Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-3? True Suppose 0 = 46g - 28748 + 6530. Does 23 divide g? True Is (7 + 35/(-3))/((-2)/24) a multiple of 14? True Let g = 78 + -43. Let q be (-2)/7 - (-920)/g. Does 13 divide (q/5)/(2/10)? True Suppose -5h + 19461 - 881 = 0. Does 84 divide h? False Suppose -4t + 245 = 5q, 2q + 4t - 115 = -t. Is ((-4)/(-3))/(10/q) even? True Suppose 2x - 486 = x. Let b = -304 + x. Is 16 a factor of b? False Let j = -43 + 410. Is j a multiple of 7? False Let s(t) = 2t3 + t2 + t + 2. Suppose 5x - 11 = -b, 3x = -0x - b + 7. Let w be s(x). Suppose 3v - 29 = -h, -3v + v + w = -4h. Does 5 divide v? True Suppose 0 = -x + 5, 2v + 2x - 14 = 0. Suppose 0o + 13 = 2p - o, vp = -4o + 18. Suppose 24 = pn - 4n. Does 8 divide n? True Does 43 divide 7114 + (-7 - (0 + -2))? True Suppose 1095 = 10r - 345. Is 12 a factor of r/10(-150)/(-20)? True Suppose q - 515 = -4q. Let n = q + -50. Is 4 a factor of n? False Let q(f) = f*2 - 16f - 27. Let s be q(18). Suppose sp + 275 = 14p. Is 10 a factor of p? False Suppose -33u + 66u = 31779. Is 62 a factor of u? False Let v = 51 - 45. Let r(y) = 11y - 17. Is 17 a factor of r(v)? False Suppose q - 20 = -h, 4q + h + 0h - 65 = 0. Suppose -2f + 33 = 5l, -f - 5l + 4l = -q. Suppose f - 2 = 2m. Is 6 a factor of m? True Let o = 1111 - 136. Does 13 divide o? True Suppose -u + 0 + 4 = 0. Suppose -uh + 0h + 12 = 0. Suppose -3b - 246 = -5v - 5b, -hb = 6. Is 30 a factor of v? False Let o(c) be the first derivative of c*2/2 + 9c - 6. Does 4 divide o(3)? True Let b(d) = 10d2 + 4d + 2. Let x be b(-2). Suppose xm - 60 = 30m. Does 5 divide m? True Let x = -643 + 1657. Is 13 a factor of x? True Let q(v) = -v*3 - 10v*2 + 4v + 10. Let l be q(-10). Is 35 a factor of ((-28)/(-8))/((-3)/l)? True Suppose -3v - v = 16. Let c(k) = -k3 - 3k*2 + 5k + 4. Let f be c(v). Suppose f = 4r - 20, 5n + 2r - 273 + 83 = 0. Is 16 a factor of n? False Suppose 6 = -n + 4z, z + 4 = -3n + 6z. Suppose -6g - n = -7g. Suppose -gd = 6p - p - 93, -9 = 3p. Is 18 a factor of d? True Suppose -6p + 149 = -643. Is 33 a factor of p? True Let g(s) = -3s + 81. Is g(-25) a multiple of 26? True Suppose -4g - g + 12795 = -k, 3k + 10247 = 4g. Is g a multiple of 71? False Let f be (13 - 7)/(3/(-4)). Let p be (47 + f/4)-3. Is ((-15)/9)/(3/p) a multiple of 15? True Let p = 9 - 4. Suppose 125 = 2i - 0f + 3f, 0 = -3i + f + 171. Let v = i - p. Does 19 divide v? False Let n be (-3)/3 + (-1 - -233) + 1. Suppose -18 - n = -5b. Does 5 divide b? True Let r = -43 - -42. Is 10 a factor of 315/30 + r/2? True Let z(r) = -r - 4. Let t be z(11). Let x = -9 - t. Is 3 a factor of x? True Let l(c) = 5c2 - 22c - 167. Does 10 divide l(-18)? False Suppose -2i + 19 = 3. Does 5 divide ((-60)/i-1)/(1/12)? True Suppose 0 = t + t - 10. Suppose 0h - 230 = -4n - 2h, 3h - 285 = -tn. Does 28 divide n? False Is 12 a factor of 24/1251? False Let q(r) = 14r*2 + r. Let c be q(1). Does 53 divide -4 + 50/c - (-322)/6? True Let f be 2556/21 - (-8)/28. Suppose 5a + 4y - 115 = -y, -5a + 2y + f = 0. Is a a multiple of 8? True Let h(g) = 6g*2 - 3g + 2. Let d be h(1). Suppose 32 = ds - 618. Does 26 divide s? True Let h(l) = 5l*2 - 11l + 51. Is h(5) a multiple of 11? True Let f(m) = 8m + 1. Let o(a) = -9a - 1. Let p(x) = -9x - 1. Let z(j) = 6o(j) - 7p(j). Let q(b) = 6f(b) - 4z(b). Is 24 a factor of q(2)? False Let b(j) = -12j*3 + 10j*2 + 4j - 37. Is 129 a factor of b(-7)? False Let a(c) = 4c2 + 48c + 42. Is a(-21) a multiple of 110? False Suppose -4x + 18 - 2 = 0. Let l(a) = a3 - 2a*2 - 7. Let g be l(3). Suppose 4w - 80 = gb - xb, -5w = 4b - 103. Is 19 a factor of w? True Let h(m) = 2m2 + 4. Suppose -2x + 3w + 1 = -4x, 4x = -w + 13. Let c be h(x). Let p = 56 - c. Is p a multiple of 20? True Let n be -5 - (-2 + 0) - -5. Let r(p) = 5 + 0pn + p2 + 3p + 2p. Does 9 divide r(6)? False Is 6 a factor of 14/(-1 + 5 + (-92)/24)? True Let r(d) be the third derivative of d*6/120 - 2d5/15 - d4/6 - 5d3/2 + 9d*2. Is 15 a factor of r(9)? True Let x = -140 + 283. Does 24 divide x? False Let t be 3 + 1 + -2 + -142. Suppose -8w - 10 = -42. Is (6/w)/((-15)/t) a multiple of 3? False Let z(n) = -n*2 - 88n + 137. Does 28 divide z(-43)? True Let j(p) = -p*2 + 5p + 4. Let x be j(5). Suppose -xy + 2h + 0h = -46, -4y = -h - 45. Let t = 59 - y. Is 24 a factor of t? True Suppose -3 + 1 = -o. Let v be (-2)/9 - o/(-9). Is 14 a factor of 421/3 - v? True Let z(c) = c3 - 4c*2 - 10c + 10. Let l be z(6). Let s = l + -14. Is (1 - 3)/(s/(-36)) a multiple of 3? True Let c(z) = 3z2 + z2 - 1 + 10z*3 - 2z*2 - 4z*3. Suppose -2 - 1 = -3w. Is 4 a factor of c(w)? False Let c(i) = 8 + 4i - 2i*2 - 2i*2 + 2i*2 + 6i*2. Is c(-2) a multiple of 4? True Suppose -7 - 15 = 2z + 4f, z = 5f - 39. Let b = z + 24. Suppose bl = -4v + 341, v = 3v - 3l - 143. Does 20 divide v? False Let k be ((-8)/(-1))/(7 + (-5 - 0)). Suppose 5n = 2u - 39 - 4, 20 = -kn. Is 9 a factor of u? True Let c(k) = k3 + 5k*2 - 7k + 2. Let w be c(-6). Suppose -3h - 6 = -0h - 4m, -2m = h - w. Suppose 44 = g + hy, 23 + 75 = 2g - y. Is 16 a factor of g? True Let j(p) = -2p - 2. Let z(s) = -9s*2 - 7s + 4s3 + s2 + 3s*2 - 3s*3. Let l be z(6). Is 5 a factor of j(l)? True Suppose -3b = -2r - 681, -b = 3r - 118 - 109. Is b even? False Let z = 302 + -202. Let c = -206 + z. Let i = c + 148. Does 12 divide i? False Let l be 19-2 - (-2 + 1). Let r = 151 - 96. Let b = r + l. Does 6 divide b? True Let g be 6/(-27) - 7/9. Let o = 4 - g. Suppose 4z - 13 = -t + 5, -3t + 33 = oz. Is 6 a factor of t? True Suppose 5n + 21 + 194 = 5o, 5n - 114 = -2o. Does 6 divide o? False Is 18 a factor of 9 - -2 - 9 - -89? False Let n = -2 - -7. Suppose no = 3o + 4. Suppose -3u - 26 = -2i + ou, 2i = 3u + 30. Does 9 divide i? True Let m be 1914/30 + 2/10. Let a = m + -43. Is a a multiple of 7? True Is (164/20 + -4)415 a multiple of 3? True Let v(q) be the second derivative of 70q*3/3 + 10q. Let y be v(3). Suppose -218 = -2d + 3w, 2d - 2w = 6d - y. Is d a multiple of 24? False Let a(m) = -20m*3 - 3m*2 - 2m. Let t(b) = 2b2 + 3b + 1. Let p be t(-2). Suppose -l - l + w + 3 = 0, -w = -pl + 2. Does 4 divide a(l)? False Suppose 4n + 4780 = -4s + 26108, 0 = -3s + 2n + 15986. Does 70 divide s? False Suppose -3a + 14 - 5 = 0. Suppose 7m = am + 60. Is (0 + 13)/(5/m) a multiple of 25? False Let v(k) = k. Let q(z) = -2z + 1. Let c(g) = 2q(g) + 3v(g). Let n be c(0). Suppose 2y - 24 = -4w, 49 + 11 = 4y + nw. Does 4 divide y? True Let o(v) = -35v + 1. Let f be o(-1). Let s = -50 + f. Let j = 24 + s. Is 3 a factor of j? False Let u be -1(-2)/3-3. Let o(t) be the third derivative of -t6/120 + t4/6 + t*3/2 + 4t*2. Is 2 a factor of o(u)? False Let a(d) = 23d*2 - d - 1. Let v be (-18)/(-4)(1 - 3). Let q(s) = -s - 10. Let r be q(v). Is 23 a factor of a(r)? True Suppose 21l = 27l - 252. Is l a multiple of 21? True Does 7 divide (200/35)/498? True Let y(p) = -8p - 1. Let u be y(-5). Suppose -3o - 4h - 12 + u = 0, -o = 2h - 9. Is 6 a factor of o? False Is ((-23)/(-3) + -1)(-80 - -83) a multiple of 5? True Let x = -25 + 29. Suppose xf = -5o + 312, 2f + f = -o + 69. Is 13 a factor of o? False Suppose 0p = p + 4y - 15, 3 = y. Let n be 81/64/p. Suppose 7 + n = j. Is 25 a factor of j? True Let j(z) = 6z2 - 13z - 40. Is 40 a factor of j(8)? True Let y(r) = -2r3 - r2 + 3r + 1. Let s be y(-2). Is 366/s + -4 - 4/14 a multiple of 8? True Let a = -3 + -3. Let s be a/(-15) + 8/(-20). Suppose -3l + 24 = 3u, -4u + 5 = l - sl. Does 5 divide l? False Let c(h) = -2 + 2h2 - 9 - 11 + 24 + 3h. Is c(-3) a multiple of 8? False Let x(j) = -j*3 - 24j*2 - 48j - 28. Does 5 divide x(-22)? True Suppose 23w - 17w - 312 = 0. Is 26 a factor of w? True Let u be (-37)/(-3) + 5/(-15). Let r = 127 - u. Is 26 a factor of r? False Let v(f) = -f*3 + 11f*2 - 11f + 10. Let w be v(10). Suppose -4n + 5c = -7, -4c + 1 + 3 = w. Suppose 0g - 105 = -ng. Does 7 divide g? True Let j be 4 + (1588/14 - 16/(-28)). Suppose -5m = -2h + 102, 0 = h + 3h + 16. Let f = j + m. Is 16 a factor of f? True	{ "pile_set_name": "DM Mathematics" }
e of -q*3u*3 - 4q*3u + 1437q3 - 6q*2u*3 + 1711q*2u wrt q? -6u3 - 24u + 8622 Find the first derivative of -595835h - 1603713 wrt h. -595835 Differentiate -3tz2 + 1549986tz + 24z*2 + 1400z - 3 wrt t. -3z2 + 1549986z Find the second derivative of 89220f3h*3 + 5f*3 + 22fh3 + 30fh2 - f + 18h*3 wrt f. 535320fh3 + 30f What is the derivative of 1459c2j*2q + 2c2j + 6660c2 - 2cj2q + j*2 wrt q? 1459c*2j*2 - 2cj2 Differentiate -2461004y + 2440907 wrt y. -2461004 What is the derivative of t*3v - 340t3 + 28t*2u - 32tuv - 3tu + 6tv wrt v? t3 - 32tu + 6t What is the first derivative of -141598j4 - 156420 wrt j? -566392j*3 What is the third derivative of -1878h*4 + 4h*3v*3 - 2h*2v - 615v3 - 4v*2 wrt h? -45072h + 24v3 What is the third derivative of 101b*2t*4 - 348898b*2 - 1665t*4 - 2t*2 wrt t? 2424b*2t - 39960t What is the third derivative of 4777b*2mz2 + 9916b*2z*3 + 2bmz*2 + bmz - 2mz3 - 2mz2 wrt z? 59496b*2 - 12m Find the second derivative of -1039l2w*3 - 255l*2w*2 + 680054lw + 6w*3 wrt l. -2078w*3 - 510w*2 Find the third derivative of -2pry*4 - 109pry*2 - 5p + 19ry*4 + ry*2 + r + 1379y*3 - 7y wrt y. -48pry + 456ry + 8274 Differentiate -38747h - 39638. -38747 Find the third derivative of -5v4 + 7541v*3 + 2v*2 - 4v + 374 wrt v. -120v + 45246 What is the third derivative of -159n*3x*3 + 3n*3x*2 - 202n*3x + 3n2x*3 + 92n*2x*2 - nx*3 - 7x*3 wrt x? -954n*3 + 18n*2 - 6n - 42 What is the second derivative of 21716n3 + 339n - 1? 130296n What is the first derivative of 40ad2q + 2ad*2 + 634aq2 + 3d*2q*2 - 42dq2 + dq - 21q2 - 2q wrt a? 40d2q + 2d2 + 634q*2 Find the second derivative of 10d*5l - 1745d3lm + 6dl + d - 89lm + 5m wrt d. 200d3l - 10470dlm What is the third derivative of -303024w*3 + 555w*2 + 307 wrt w? -1818144 Find the first derivative of -4510bq4 + 2bq2 + 2bq + 178b + 155 wrt q. -18040bq*3 + 4bq + 2b Find the third derivative of 97345d4 - 40460d*2 + 4d wrt d. 2336280d Find the second derivative of -1743022y*2 + 2202263y wrt y. -3486044 What is the second derivative of 13307l4 - 17l*3t + 2lt + 18l + 3867t - 4 wrt l? 159684l2 - 102lt Find the second derivative of 120337a*2 - 3a + 16489. 240674 Find the second derivative of -21m5 + 734m*4 - 2m*3 - 164935m. -420m3 + 8808m*2 - 12m What is the third derivative of -299875i6 - 2i*2 + 1567i + 3? -35985000i3 What is the third derivative of 2d*4s + 4836d3s*3 + 484d*2s*3 + 2d*2s*2 + 9 wrt d? 48ds + 29016s*3 Find the second derivative of 51459f*3 + 193395f. 308754f Find the third derivative of -6h*2v3 - h2v2 + 193hv4 + 358286h + 30v4 wrt v. -36h*2 + 4632hv + 720v Differentiate -650650o2u + 14521o2 - 22 with respect to u. -650650o*2 Find the second derivative of -2429nv3 - 7nv2 + 831nv - v3 - v2 + 223v + 2 wrt v. -14574nv - 14n - 6v - 2 Find the first derivative of 48665z3 - 4z*2 + z - 61979 wrt z. 145995z*2 - 8z + 1 Find the third derivative of 39438u3v*2 - 2u*3 + 96u*2v*2 + 35u*2 + 11uv2 - 1 wrt u. 236628v*2 - 12 Find the second derivative of 194c*2i*3q*3 - 97c*2i*3q + ci3q*3 - 324cq + 6i3 + i2q3 wrt c. 388i*3q*3 - 194i*3q What is the derivative of -101292t3 - 77783 wrt t? -303876t*2 What is the third derivative of 213373m*2t3 + m2t - 46612mt2 + 2mt + t3 - 2t*2 wrt t? 1280238m*2 + 6 Find the second derivative of -41h*3u + 9802h2ku - 448018hku - 2hu wrt h. -246hu + 19604ku Find the second derivative of -2n2v*2 - 2n*2v + 44npv2 - np - 3nv*2 + 79n - 10pv*2 + 4pv + 2v wrt v. -4n2 + 88np - 6n - 20p What is the first derivative of -1040cf3j + cf3 - cfj - 20698f*3j + 3f3 + 2f*2 wrt c? -1040f*3j + f*3 - fj Find the first derivative of 18254b2g + 648b2 + 3g - 456 wrt g. 18254b2 + 3 Find the second derivative of -797786a*4 + 8a + 2648 wrt a. -9573432a2 Find the third derivative of 24279b4 - b3 - 31122b2. 582696b - 6 Find the second derivative of 2k3q*2 + 3672k3 + k2q2 + 44954kq2 + 11kq wrt q. 4k*3 + 2k*2 + 89908k Find the third derivative of u*4y - 2u4 + 1414u*3y - 2u3 + 3u*2y + 6u2 + 1326u - y wrt u. 24uy - 48u + 8484y - 12 Find the first derivative of -99a2z - 2a2 - 2481az + 1702a + 88 wrt z. -99a2 - 2481a What is the third derivative of 590430f3n + f*2n - fn + 726f wrt f? 3542580n Differentiate -a4r + 871a3r - r - 10694 wrt a. -4a3r + 2613a2r What is the second derivative of u*5 - 8u*4 - 2862u*3 + 86174u wrt u? 20u3 - 96u*2 - 17172u Find the second derivative of 1506hn*4 - 43hn - 316h + 97n4 + 5n wrt n. 18072hn*2 + 1164n*2 What is the third derivative of 77o*6 + 500o*5 + 3o*3 - 593102o*2 wrt o? 9240o*3 + 30000o*2 + 18 Differentiate -11487j*2 + 4j - 191890 wrt j. -22974j + 4 Find the second derivative of 2973y*5 - 39y*4 + 2y*3 - 35y + 9144 wrt y. 59460y3 - 468y*2 + 12y Differentiate -85998k2 - 94239 wrt k. -171996k What is the second derivative of -162599r4 + 2r - 117464? -1951188r2 What is the derivative of 29853s*4 - 10750 wrt s? 119412s*3 Differentiate 12214p*2y*3 - 2p*2yz - 8pyz + 10478y3z - 4y3 with respect to z. -2p*2y - 8py + 10478y3 What is the derivative of -5447h3 + h2r + 19hr2 + 1466r*2 + 5r - 20 wrt h? -16341h2 + 2hr + 19r*2 What is the third derivative of 1559a5 + a3 - 163a2 - 23? 93540a*2 + 6 Find the first derivative of -223460z*4 - 13211 wrt z. -893840z*3 What is the third derivative of 137940x*4 - 2x*3 + 19370x*2 - 14x? 3310560x - 12 Find the second derivative of 77021c*2x*3 - 2cx3 + 898cx - 12c + 2x wrt c. 154042x*3 What is the third derivative of 17d*6 - 102d*5 + 10d*4 - 102043d*2 + 2? 2040d*3 - 6120d*2 + 240d What is the third derivative of -2h5 + 62181h*4 - 40943h*2 wrt h? -120h*2 + 1492344h What is the second derivative of -38912a2 - 583626a? -77824 What is the third derivative of -2982h2p*3 + 28h*2p*2 - 41h wrt p? -17892h2 What is the derivative of 5050145y*2 + 1786631? 10100290y What is the second derivative of -74415v2 + 148v - 277? -148830 Find the second derivative of 1324300c2 + 166c + 712 wrt c. 2648600 What is the third derivative of 142gk*2n*3 - 8gk2n*2 - 200gkn*3 + 6gkn*2 - 135k*2n*2 wrt n? 852gk2 - 1200gk What is the first derivative of 2l*3q*2 + 273985l*3 + 171014lq3 wrt q? 4l*3q + 513042lq*2 Find the second derivative of -23q*3x*2 + 2q*3x + 2430q3 + 83q*2x*2 - 23q*2x + qx2 - 2x*2 + 2 wrt x. -46q*3 + 166q*2 + 2q - 4 Differentiate 413008a3 - 3221609 with respect to a. 1239024a2 What is the second derivative of v4 - v*3 + 776309v*2 - 3169826v? 12v2 - 6v + 1552618 What is the derivative of -8072a2 - 22451 wrt a? -16144a What is the second derivative of 2793c2j*2 - 4056c*2j - 20c2 - 2cj2 - 19j*2 wrt j? 5586c*2 - 4c - 38 What is the third derivative of -262043s5 + 332169s*2 wrt s? -15722580s*2 What is the second derivative of 78b*3h*2 + 85b*3h + 7323bh*3 + 1440h wrt h? 156b3 + 43938bh What is the second derivative of s2y*2 + 76s*2y - 4s2 - 18sy2 - 28sy - 2087y*2 wrt y? 2s*2 - 36s - 4174 Differentiate -1772526h + 869122 wrt h. -1772526 What is the third derivative of -d4i - d*4 + 10009d*3i + 3d3 - 185d*2i - 54i wrt d? -24di - 24d + 60054i + 18 Find the second derivative of -14io3 - 666io - 12i + 3o4 - 134o*2 wrt o. -84io + 36o*2 - 268 Find the third derivative of 2476270y*3 - 2873664y*2 wrt y. 14857620 What is the second derivative of 61492w*5 - 11w*2 + 1165873w? 1229840w*3 - 22 Find the thi	{ "pile_set_name": "DM Mathematics" }
n*2 wrt n. 12480n - 12 Let x(y) = 1247y - 2235. Let l(w) = 2w - 2. Let m(b) = 4l(b) + x(b). What is the derivative of m(r) wrt r? 1255 Suppose 12 = -22u + 56. Differentiate -20 + 2s2 + 5s*u - 5s*2 + 2s3 - s2 wrt s. 6s2 + 2s Let i(c) = -c*3 + 6c*2 - c + 1. Let u(z) = -3951z*3 - 30z*2 - 35z + 18. Let h(q) = -5i(q) - u(q). What is the second derivative of h(o) wrt o? 23736o Let q(g) = -248g3 - 6g*2 + 6g + 203. Let h(p) = -249p3 - 5p*2 + 5p + 197. Let n(r) = 6h(r) - 5q(r). Differentiate n(m) with respect to m. -762m2 Differentiate -1652 + 10c*3 - 2417 - 3c*3 + 2777c*4 - 7c*3 wrt c. 11108c*3 Suppose 71l = 74l - 12. What is the second derivative of -17g + lg + 94g + 63g4 wrt g? 756g*2 Let t(k) be the third derivative of -4k + 1/24k4 + 2k*2 + 0k*3 + 0 - 83/30k*5 + 0k*6 - 17/42k*7. What is the third derivative of t(n) wrt n? -2040n Let l(k) = k*3 - 2k + 13. Let q(x) = 10634x3 - 8831x*2 - 4x + 26. Let d(i) = 2l(i) - q(i). Find the third derivative of d(v) wrt v. -63792 Let o(a) be the third derivative of -34a*7/105 - 13a6/120 - a4/24 + 1363a3/3 + 631a*2 + 5. What is the second derivative of o(i) wrt i? -816i*2 - 78i Let y = 22 + -11. Suppose 2s = 4z - 6z + 10, 25 = 5z - 4s. What is the third derivative of -6g - zg + yg - 18g5 - 9g*2 wrt g? -1080g*2 Let x(m) = 317m*4 - 6m*2 + 12m + 1921. Let u(b) = 315b4 - 7b*2 + 14b + 1921. Let c(j) = -6u(j) + 7x(j). Find the first derivative of c(o) wrt o. 1316o3 What is the first derivative of -35l*2 + 69819 - 70469 - 2l - 21l2 wrt l? -112l - 2 Let o(r) = 36418r + 18790. Let m(a) = 24276a + 12525. Let p(w) = -8m(w) + 5o(w). Differentiate p(d) wrt d. -12118 Let b(f) be the third derivative of -83f9/252 + f8/48 + 106f*5/3 - 3340f*2. What is the third derivative of b(w) wrt w? -19920w*3 + 420w*2 Let l(g) = -2g*3 - 15g*2 + 9g + 10. Let f be l(-8). What is the second derivative of 702u2 - 702u*f - 2 + 59u*4 + 51u*4 + 14u wrt u? 1320u2 Suppose 0 = -35j + 28j + 168. Find the third derivative of 19g*6 + jg*6 - 29g*6 + 18g*6 - 137g*2 wrt g. 3840g*3 Suppose 36c = 33c + 15. What is the second derivative of -h - 85h*3 + 152h*3 + 11h*c - 43 - 70h*3 wrt h? 220h*3 - 18h Let d(s) be the first derivative of -356s3/3 + 9486s - 10748. What is the derivative of d(f) wrt f? -712f Let o(l) be the second derivative of 0l*3 - 51/2l*2 - l + 1/12l*4 - 31 - 3/5l*5. Find the first derivative of o(d) wrt d. -36d*2 + 2d What is the second derivative of -56 - i*2 + 11i*5 + 503i + 20 + 18 + 21 wrt i? 220i3 - 2 Let w(x) = 8x + 110. Let c be w(-9). What is the third derivative of 3b6 + 2 - 13b*6 + 126b*2 - cb*2 - 2b*3 wrt b? -1200b*3 - 12 Find the third derivative of -519p*2 - 217p*2 - 72p*2 - 300p*3 - 3p*3 wrt p. -1818 What is the third derivative of 198 + 2r*6 + 688954r*3 + 6r*2 - 689754r3 - r5 - 7r2 wrt r? 240r*3 - 60r*2 - 4800 Suppose o = -2o + 2b + 10, -b = -3o + 11. What is the second derivative of -5j4 - 23j - 12j4 + jo - 6 + 21j wrt j? -192j2 Let j(x) be the first derivative of -8 + 0x*3 - 13/12x*4 + 10x*2 + 25x. Let y(m) be the first derivative of j(m). What is the derivative of y(q) wrt q? -26q Find the first derivative of -184s*3 - 111s*3 - 264s*3 - 193 - 132s*3 + 275 wrt s. -2073s*2 What is the second derivative of 920h*5 - 2h + 2063h2 + 0h3 + h3 - 462h5 - 541 - 2h*3 - 456h*5 wrt h? 40h*3 - 6h + 4126 Let l = 168 + -166. What is the second derivative of 14c2 - 6c*2 - 35c + 237c3 - 6c*l - 2c*2 wrt c? 1422c Let u(q) = q*2 - q + 2. Let x(i) = 112i*4 - 5i*2 + 5i - 93. Suppose 4n + 15 = n, 5j = 5n + 50. Let l(d) = ju(d) + x(d). Differentiate l(s) wrt s. 448s3 Find the third derivative of -19k - 67k - 3k*3 + 2775k*2 - 100k*4 + 86k - 2k3 wrt k. -2400k - 30 Let f be 4/(-114)-3 - 1375/(-475). Find the second derivative of -70m*5 - 20m*3 + 102m + 20m3 + fm wrt m. -1400m3 Let g(n) be the third derivative of 29n7/210 + n6/10 - 1637n4/24 - 401n*2. Find the second derivative of g(y) wrt y. 348y*2 + 72y Let t(l) be the third derivative of 17l5/60 - l4/4 + 44l*3 - 72l*2. Differentiate t(m) with respect to m. 34m - 6 Suppose 0 = 5o - 10o. Suppose 5i + of - f = 5, 2i - 29 = -5f. What is the second derivative of -34 - id + 22d*2 + 34 wrt d? 44 Let v(w) = -2644w*2 - 17w + 263. Let q(r) = 1761r2 + 11r - 175. Let l(j) = 8q(j) + 5v(j). What is the second derivative of l(u) wrt u? 1736 Let l(h) be the second derivative of 9h6/10 - 3h5/5 - h4/6 + 19h3/6 + 31h*2 + 27h + 53. Find the second derivative of l(n) wrt n. 324n2 - 72n - 4 Let d(b) = 7b + 54. Let o be d(0). Find the second derivative of 57i + oi - 70i*3 - 58 - 110i wrt i. -420i Find the first derivative of -600 + 1702v + 4804v + 8170 + 5479v wrt v. 11985 Suppose -122q + 125q - 21 = -a, q = 2a - 63. Let j(h) be the second derivative of 0 - 17/2h*2 + 1/2h*4 - ah + 0h3. Differentiate j(t) wrt t. 12t Let g(f) be the first derivative of -38f4 + 2f*3/3 - 215f + 604. What is the derivative of g(o) wrt o? -456o2 + 4o Let b(x) be the second derivative of -67/2x2 + 3/2x*4 + 7 + 1/6x*3 - 2x. Find the first derivative of b(f) wrt f. 36f + 1 Let t(k) be the first derivative of -5321k*2/2 + 6085k - 758. Differentiate t(w) wrt w. -5321 Suppose 5i - 15 = 30. Let v be 8/(-3)(-27)/2. What is the third derivative of 3 + i + 16p5 - 12 - vp*2 wrt p? 960p*2 Suppose 13v - 12v - 18 = 0. Let k = v + -15. Find the third derivative of 40z*3 - 37z*k + 15z*3 - 11z2 wrt z. 108 Let o(n) = -n3 + 8n2 + 10n - 8. Suppose j - 6 = -i, 4i + 0j - 51 = 5j. Let w be o(i). Find the second derivative of 2 + w + 18l - 7l2 - 3 wrt l. -14 Let j(q) = 61q*2 + 175. Suppose 235 = 7o + 207. Let s(n) = -62n2 - 177. Let z(d) = oj(d) + 3s(d). Differentiate z(l) with respect to l. 116l Find the first derivative of -2740c + 149c3 + c2 + 226 - 151c3 + 2740c wrt c. -6c2 + 2c Let d(x) be the second derivative of x - 41x3 + 0x*4 + 227/30x*6 - 13 + 0x*5 + 0x*2. Find the second derivative of d(t) wrt t. 2724t*2 Let o(r) = 338r*3 - 2r*2 - 3358. Let u(a) = 673a*3 - 5a*2 - a - 6719. Let b(m) = 5o(m) - 2u(m). What is the derivative of b(d) wrt d? 1032d*2 + 2 Let h(k) be the third derivative of 13k6/120 - k5/20 + k*4/8 - 27k*2. Let s be h(1). Differentiate 9v + 50 + 0v - 2v + sv with respect to v. 20 Let y be (-85)/((-13600)/192) - 154/(-30). Let d(i) be the first derivative of 26 - 13/2i*2 - yi*3 + 0i. Find the second derivative of d(b) wrt b. -38 Let n(g) be the third derivative of -619g7/30 + 898g*5/15 + 7570g*2. What is the third derivative of n(c) wrt c? -103992c Suppose 21b - 6b = 1050. Let g(r) be the first derivative of -64r4 + br*4 + 15 + 10 - 2r*3. What is the third derivative of g(s) wrt s? 144 Let g(l) be the first derivative of -5l*5/12 - 13l*4/24 - 6l*3 - 51. Let o(s) be the third derivative of g(s). What is the first derivative of o(v) wrt v? -50 What is the second derivative of 54 + 131n*2 - 1006n*2 + 52 - 106 + 1126n wrt n? -1750 Let o be (15/3 + 4 + -4)9. Differentiate 6i3 + i2 + o - 3i3 + 85 wrt i. 9i*2 + 2i Let n = -36 - -80. Let d = n + -42. Find the second derivative of 13b5 - 6b + b + db5 wrt b. 300b*3 Let u(j) be the third derivative of 0j*7 + 5/56j*8 - 1/60j*5 + 39 - 2j*2 - 1/4j*4 + 0j*6 + 0j + 0j3. Find the third derivative of u(t) wrt t. 1800t*2 Let m(i) = 28i*2 - i + 2. Let r(w) = 4016w*2 + 3w - 5198. Let v(b) = 3m(b) + r(b). Differentiate v(z) wrt z. 8200z Let y(q) be the second derivative of -44q2 + 0q*3 - 55q + 0q4 + 1/20q*5 - 2 - 41/15q*6. Differentiate y(k) with respect to k. -328k*3 + 3k*2 What is the third derivative of 984q*6 + 28q - 34q + 20q*2 + 761q*6 - 4q*2 - 37q*6 wrt q? 204960q*3 Let g be 1/(-4) + (-63)/(-28). What is the first derivative of 2s*3 - g	{ "pile_set_name": "DM Mathematics" }
.159072 Convert 93.4371l to millilitres. 93437.1 What is 0.3845592 millimeters in meters? 0.0003845592 What is three eighths of a litre in millilitres? 375 Convert 0.932459kg to nanograms. 932459000000 How many decades are there in 188.58465 months? 1.57153875 What is seven thirds of a day in hours? 56 What is 98.99894t in grams? 98998940 What is 21/5 of a meter in centimeters? 420 Convert 91.40544l to millilitres. 91405.44 What is 15.69618 minutes in milliseconds? 941770.8 How many milligrams are there in fifty-nine quarters of a gram? 14750 What is one twentieth of a hour in minutes? 3 How many millilitres are there in one tenth of a litre? 100 Convert 0.8962135 years to decades. 0.08962135 How many decades are there in 71/5 of a millennium? 1420 What is 21/8 of a tonne in kilograms? 2625 How many meters are there in 43157.59 kilometers? 43157590 How many nanograms are there in 25/8 of a microgram? 3125 What is 675.016ms in seconds? 0.675016 What is 4.978034 millilitres in litres? 0.004978034 How many minutes are there in two fifteenths of a day? 192 How many nanograms are there in one tenth of a milligram? 100000 What is five quarters of a litre in millilitres? 1250 How many nanograms are there in 5988.174 grams? 5988174000000 How many meters are there in thirteen fifths of a kilometer? 2600 What is one tenth of a gram in milligrams? 100 How many micrometers are there in 3/50 of a centimeter? 600 What is 92565.87 millimeters in nanometers? 92565870000 What is 292.0142 millilitres in litres? 0.2920142 What is 61/2 of a meter in millimeters? 30500 What is 232.723 litres in millilitres? 232723 What is 7.528773 litres in millilitres? 7528.773 Convert 18504.38 litres to millilitres. 18504380 Convert 54364.65g to micrograms. 54364650000 Convert 49053.74 centimeters to kilometers. 0.4905374 How many micrometers are there in 7/4 of a millimeter? 1750 Convert 72.9695 millilitres to litres. 0.0729695 What is 3/8 of a millimeter in micrometers? 375 Convert 5451.054um to centimeters. 0.5451054 How many kilograms are there in 3/10 of a tonne? 300 What is 6/25 of a centimeter in micrometers? 2400 What is 6509.712 years in centuries? 65.09712 How many milliseconds are there in 2.055965s? 2055.965 What is thirteen fifths of a millennium in centuries? 26 How many centuries are there in one tenth of a millennium? 1 What is 76429.13ml in litres? 76.42913 Convert 9780.96 millilitres to litres. 9.78096 Convert 0.2716206 micrometers to nanometers. 271.6206 What is 4799.163mg in grams? 4.799163 What is three eighths of a kilometer in meters? 375 What is 3/25 of a millimeter in micrometers? 120 What is 5696.35ng in kilograms? 0.00000000569635 What is 3/25 of a millisecond in microseconds? 120 What is 598.608ml in litres? 0.598608 What is seven quarters of a litre in millilitres? 1750 How many seconds are there in 1/28 of a week? 21600 How many millennia are there in 233383.7 centuries? 23338.37 Convert 2201.712 litres to millilitres. 2201712 How many minutes are there in 7/3 of a hour? 140 How many nanograms are there in nine tenths of a microgram? 900 What is two sevenths of a week in days? 2 Convert 3.773356ml to litres. 0.003773356 What is 3/8 of a micrometer in nanometers? 375 What is 8090.943 months in decades? 67.424525 How many micrometers are there in 9827.991km? 9827991000000 Convert 27718.7 years to millennia. 27.7187 What is 667.8323 centuries in years? 66783.23 How many kilometers are there in 25.36394nm? 0.00000000002536394 What is 14990.18ug in tonnes? 0.00000001499018 What is 748086.3 seconds in days? 8.65840625 How many meters are there in 5/4 of a kilometer? 1250 How many micrometers are there in 17/2 of a centimeter? 85000 How many kilometers are there in 49863.82um? 0.00004986382 What is 27/5 of a centimeter in millimeters? 54 What is 3/10 of a centimeter in micrometers? 3000 How many millimeters are there in 6/5 of a centimeter? 12 What is 31390.75 millimeters in kilometers? 0.03139075 What is 42438.3l in millilitres? 42438300 What is 27/2 of a kilogram in grams? 13500 How many hours are there in 13/4 of a day? 78 How many grams are there in fourty-three quarters of a kilogram? 10750 How many nanoseconds are there in 7.902875 weeks? 4779658800000000 How many milligrams are there in 605.6716 nanograms? 0.0006056716 How many millimeters are there in three fifths of a meter? 600 How many millilitres are there in 1/5 of a litre? 200 What is 1/10 of a centimeter in micrometers? 1000 What is five eighths of a milligram in micrograms? 625 How many months are there in one sixth of a decade? 20 Convert 721774.3 centuries to decades. 7217743 What is 773.5996nm in centimeters? 0.00007735996 How many minutes are there in seven thirds of a day? 3360 Convert 26890.428 months to millennia. 2.240869 How many millimeters are there in one fifth of a meter? 200 What is 22.659432 months in centuries? 0.01888286 How many hours are there in fifty-eight thirds of a week? 3248 How many millennia are there in 782.3058 months? 0.06519215 How many milliseconds are there in 57017.25 weeks? 34484032800000 What is 75/2 of a millimeter in micrometers? 37500 How many millilitres are there in 47/4 of a litre? 11750 How many centimeters are there in 51/5 of a meter? 1020 What is one twentieth of a millennium in years? 50 How many seconds are there in 6/25 of a hour? 864 What is 836.5087 nanoseconds in seconds? 0.0000008365087 Convert 33436.45 millimeters to nanometers. 33436450000 How many nanometers are there in 9.064781um? 9064.781 What is 55.08834 decades in years? 550.8834 Convert 3477.535 years to decades. 347.7535 What is 0.4439232t in kilograms? 443.9232 How many tonnes are there in 4.319459ng? 0.000000000000004319459 What is 0.34698 nanograms in kilograms? 0.00000000000034698 How many nanometers are there in six fifths of a micrometer? 1200 What is 12/25 of a meter in millimeters? 480 Convert 0.7685474 centimeters to meters. 0.007685474 Convert 2.27314 millimeters to micrometers. 2273.14 How many meters are there in 92.21596um? 0.00009221596 How many meters are there in fifteen quarters of a kilometer? 3750 How many micrograms are there in 649233.3 nanograms? 649.2333 How many minutes are there in 437.9252 weeks? 4414286.016 What is 2.82038 kilometers in nanometers? 2820380000000 How many millimeters are there in twenty-one halves of a centimeter? 105 How many centimeters are there in 3/8 of a kilometer? 37500 What is 10841.2nm in millimeters? 0.0108412 What is 1/5 of a meter in millimeters? 200 What is 0.6486423 nanograms in milligrams? 0.0000006486423 What is 4386.284l in millilitres? 4386284 How many days are there in 4802.634 weeks? 33618.438 How many decades are there in 718873.3 millennia? 71887330 How many minutes are there in 1/6 of a week? 1680 What is thirteen sevenths of a week in hours? 312 How many tonnes are there in 2522.033 milligrams? 0.000002522033 What is three tenths of a meter in millimeters? 300 How many meters are there in three tenths of a kilometer? 300 What is 25/4 of a litre in millilitres? 6250 How many millilitres are there in thirteen quarters of a litre? 3250 Convert 0.7047449 micrometers to nanometers. 704.7449 How many kilograms are there in seven quarters of a tonne? 1750 Convert 93299.42l to millilitres. 93299420 Convert 0.2581637 centuries to millennia. 0.02581637 What is 5/8 of a litre in millilitres? 625 How many millilitres are there in seventeen quarters of a litre? 4250 What is 877270.6ml in litres? 877.2706 Convert 0.8999443 nanograms to milligrams. 0.0000008999443 What is 69/2 of a decade in months? 4140 How many months are there in 37/2 of a century? 22200 What is 4.34638 micrograms in nanograms? 4346.38 What is fourty-four fifths of a meter in millimeters? 8800 Convert 98779.5 weeks to nanoseconds. 59741841600000000000 Convert 657103.7 grams to micrograms. 657103700000 How many centuries are there in 489656.2 millennia? 4896562 What is 40806.23 days in milliseconds? 3525658272000 Convert 26.81812 meters to millimeters. 26818.12 How many millilitres are there in eleven quarters of a litre? 2750 How many years are there in 11/10 of a decade? 11 How many millimeters are there in three fifths of a meter? 600 Convert 40.68441	{ "pile_set_name": "DM Mathematics" }
71, -5520? -6669 What is the next term in -84, -1151, -2934, -5433, -8648? -12579 What is next in 1869313032, 1869313031, 1869313030, 1869313029? 1869313028 What is the next term in 6231, 9424, 12617, 15810? 19003 What comes next: -777, -695, -515, -195, 307, 1033, 2025, 3325? 4975 What comes next: -135649, -273388, -411127? -548866 What is the next term in -127892, -127870, -127848, -127826? -127804 What is the next term in 1402623, 5610526, 12623707, 22442166, 35065903? 50494918 What comes next: -191665, -191677, -191687, -191695? -191701 What is next in 1159158, 1159268, 1159570, 1160160, 1161134, 1162588? 1164618 What is next in 24025640, 48051282, 72076924? 96102566 What is the next term in -4812366, -4812364, -4812362, -4812360, -4812358? -4812356 What is the next term in -93610, -93837, -94062, -94285? -94506 What is next in 41971, 335566, 1132267, 2683564, 5240947? 9055906 What comes next: -10851840, -10851843, -10851846? -10851849 What comes next: 713278, 1426583, 2139900, 2853229, 3566570? 4279923 What is the next term in -28956, -28965, -28980, -29001, -29028, -29061, -29100? -29145 What is next in -2083, -4093, -6035, -7903, -9691, -11393, -13003, -14515? -15923 What comes next: -642639, -1285316, -1927991, -2570664? -3213335 What comes next: 264, 438, 910, 1824, 3324, 5554? 8658 What is the next term in -79057812, -79057818, -79057826, -79057836, -79057848, -79057862, -79057878? -79057896 What is next in -5470957, -5470958, -5470975, -5471020, -5471105, -5471242? -5471443 What comes next: -16302750, -32605473, -48908196, -65210919? -81513642 What comes next: -830, -1235, -1606, -1925, -2174, -2335, -2390, -2321? -2110 What is next in 18906337, 37812684, 56719041, 75625414, 94531809, 113438232, 132344689? 151251186 What comes next: 10309, 22359, 34409, 46459, 58509, 70559? 82609 What comes next: -11636, -11518, -11400? -11282 What comes next: -1684, -3258, -4832, -6406? -7980 What is next in -56672, -112957, -168818, -224249, -279244, -333797, -387902? -441553 What is next in 1006270766, 2012541542, 3018812306, 4025083052, 5031353774, 6037624466, 7043895122? 8050165736 What is the next term in 53100, 53683, 54266, 54849, 55432, 56015? 56598 What is next in 515, 747, 731, 449, -117, -985, -2173? -3699 What is the next term in -5684, -5849, -6168, -6677, -7412, -8409, -9704, -11333? -13332 What is the next term in 426299, 426301, 426303, 426305, 426307? 426309 What comes next: 1520, 5189, 11362, 20051, 31268, 45025, 61334? 80207 What comes next: -10200, -10306, -10626, -11268, -12340, -13950, -16206, -19216? -23088 What is the next term in -1522, -2020, -2518? -3016 What is the next term in -237938, -475847, -713730, -951587, -1189418, -1427223, -1665002? -1902755 What is next in 141620, 566493, 1274614, 2265983, 3540600, 5098465? 6939578 What is the next term in -144658, -144656, -144654? -144652 What is next in -1288887, -2577782, -3866677, -5155572, -6444467, -7733362? -9022257 What is next in 402193, 402197, 402203, 402211, 402221? 402233 What comes next: -2269, -5934, -12033, -20566, -31533? -44934 What comes next: -799882, -1599814, -2399746, -3199678? -3999610 What comes next: -299, -1189, -2715, -4913, -7819? -11469 What is the next term in -2153, -10400, -24739, -45170, -71693? -104308 What comes next: 96836, 96864, 96890, 96914? 96936 What comes next: -5242410, -5242331, -5242190, -5241981, -5241698, -5241335, -5240886, -5240345? -5239706 What comes next: 1471698, 2943186, 4414674, 5886162, 7357650? 8829138 What is next in 437, 1400, 2979, 5156, 7913, 11232? 15095 What is next in -42051, -84148, -126257, -168384, -210535, -252716, -294933? -337192 What is the next term in -23642, -47288, -70936, -94586? -118238 What comes next: 3076, 2958, 2920, 2974, 3132, 3406? 3808 What is the next term in 7512220, 15024432, 22536644? 30048856 What comes next: -16868678, -16868680, -16868682, -16868684, -16868686, -16868688? -16868690 What is next in 294136, 588291, 882446? 1176601 What comes next: -38255, -76426, -114563, -152666, -190735? -228770 What comes next: 814034214, 814034215, 814034216, 814034217? 814034218 What is the next term in -97986, -391686, -881098, -1566222, -2447058, -3523606, -4795866? -6263838 What comes next: 1917, 1836, 1729, 1584, 1389, 1132, 801, 384? -131 What comes next: -169280, -338515, -507712, -676871, -845992, -1015075? -1184120 What is next in -38361, -37724, -37087, -36450, -35813? -35176 What is the next term in -215331, -215009, -214473, -213723? -212759 What is next in 2107604, 4215208, 6322812? 8430416 What is the next term in 53561, 214111, 481669, 856241, 1337833? 1926451 What comes next: -1399, -8420, -15473, -22552, -29651? -36764 What is the next term in -484513, -484514, -484499, -484462, -484397? -484298 What comes next: 365141, 730342, 1095585, 1460870, 1826197, 2191566, 2556977? 2922430 What is next in 1343100, 1343094, 1343088, 1343082, 1343076? 1343070 What is the next term in -28291, -113072, -254375, -452200, -706547? -1017416 What comes next: -18853, -17055, -15257, -13459, -11661? -9863 What is the next term in 339, 2935, 10119, 24231, 47611? 82599 What comes next: -2213, -3881, -5549, -7217, -8885? -10553 What is the next term in -147386, -294938, -442508, -590102, -737726, -885386? -1033088 What is the next term in -80864, -161720, -242576, -323432? -404288 What is the next term in 474, 921, 1648, 2655, 3942, 5509, 7356? 9483 What comes next: -4381, -9779, -16199, -23647, -32129, -41651, -52219? -63839 What is next in 4151, 4813, 5913, 7451, 9427? 11841 What comes next: -781, -545, 207, 1769, 4435, 8499, 14255, 21997? 32019 What is next in -9980, -20941, -31898, -42851? -53800 What is next in 246488, 985271, 2216576, 3940403, 6156752, 8865623? 12067016 What comes next: -2337, 5588, 27065, 68862, 137747, 240488? 383853 What is the next term in 46952, 46994, 46998, 46946, 46820, 46602, 46274? 45818 What is the next term in -628, 753, 6144, 17549, 36972? 66417 What comes next: 40881704, 40881705, 40881706, 40881707? 40881708 What comes next: 946768, 1893457, 2840146, 3786835, 4733524, 5680213? 6626902 What is the next term in -3673, -8756, -15295, -23290? -32741 What is the next term in -169270, -169853, -170436, -171019? -171602 What is next in -1255761, -2511539, -3767317? -5023095 What is next in -450, 274, 1000, 1728, 2458, 3190, 3924? 4660 What is the next term in -16501, -16251, -15829, -15235, -14469, -13531? -12421 What is the next term in 222, 713, 1538, 2697, 4190, 6017, 8178? 10673 What comes next: 394, 3272, 6148, 9022, 11894, 14764, 17632? 20498 What is next in -5189, -14152, -30673, -58532, -101509? -163384 What is next in -3772, -7905, -12342, -17077, -22104, -27417, -33010? -38877 What comes next: -562449, -562479, -562509, -562539? -562569 What is next in 500412, 500562, 500812, 501162? 501612 What is next in 258284, 516568, 774842, 1033100, 1291336, 1549544? 1807718 What is next in 30645664, 245165342, 827433036, 1961322754, 3830708504, 6619464294? 10511464132 What is next in 94990926, 94990927, 94990928? 94990929 What is next in -641719, -643356, -644993, -646630? -648267 What is next in 10225, 20375, 30465, 40501, 50489, 60435, 70345, 80225? 90081 What is the next term in 2379, 9122, 20349, 36054, 56231? 80874 What is the next term in 40267445, 40267457, 40267491, 40267559, 40267673, 40267845? 40268087 What is next in -45642685, -45642688, -45642693, -45642700, -45642709, -45642720, -45642733? -45642748 What comes next: 1001, 6952, 17801, 33548, 54193, 79736, 110177? 145516 What is the next term in 640, 1417, 2184, 2941, 3688, 4425, 5152? 5869 What is the next term in 209, 772, 1671, 2918, 4525, 6504, 8867, 11626? 14793 What is next in -92017, -367933, -827793, -1471597, -2299345, -3311037, -4506673? -5886253 What is next in -2223, -1554, -1039, -756, -783, -1198? -2079 What is the next term in 1297, 2562, 3767, 4906, 5973? 6962 What is next in 58232, 232867, 523896, 931319, 1455136, 2095347? 2851952 What is next in 5630446, 11260890, 16891322, 22521736, 28152126, 33782486? 39412810 What is next in -28466, -56958, -85480, -114038, -142638, -171286? -199988 What comes next: -77573, -77617, -77733, -77957, -78325? -78873 What comes next: -1794, -2440, -3078, -37	{ "pile_set_name": "DM Mathematics" }
). 2j2 + 1 Let f(z) = -3z - 3. Suppose 40s + 18 = 34s. Let u(t) = -t*2 - 3t - 4. Determine sf(g) + 2u(g). -2g2 + 3g + 1 Suppose -278 + 70 = 26u. Let s(z) = -5z + 9. Let i(b) = 3b - 6. Give ui(k) - 5s(k). k + 3 Let o(g) be the third derivative of g5/60 - g3/6 - g2. Let b be ((-2)/7)/((-11)/77). Let m(l) = -2l*3 - 3l*2. Determine bo(w) + m(w). -2w3 - w2 - 2 Let v(f) = f. Suppose x + 7x - 24 = 0. Suppose 0 = xk - 0 - 3. Let l(m) = -m2 - m - 1. Let w = 0 - -1. What is kl(j) + wv(j)? -j2 - 1 Let v(s) = -38s - 9. Let f(n) = -13n - 3. Calculate -17f(g) + 6v(g). -7g - 3 Let l(g) = -g2 - 1. Let f(n) be the second derivative of n4/4 + n*3/6 + 3n*2/2 + 49n + 1. Give -f(a) - 4l(a). a2 - a + 1 Let n(u) = 10u - 2. Let j(c) = c. Let t = -1031 + 1043. What is tj(a) - n(a)? 2a + 2 Let m(n) be the second derivative of -3n2/2 + 14n - 2. Let t(g) be the third derivative of g*5/60 - 2g*3/3 + 3g*2. Give -4m(c) + 3t(c). 3c2 Let v(s) = -s3 + 2s2. Let a(t) = -350t*3 + 280t*2. Calculate 3a(z) - 420v(z). -630z*3 Let m(u) = -7u*2 - 2u + 140. Let w(c) = -8c2 - 3c + 140. Calculate 6m(x) - 5w(x). -2x2 + 3x + 140 Let o(z) = 42z2 - 19z - 4. Let m(a) = 167a2 - 83a - 17. Determine -2m(x) + 9o(x). 44x2 - 5x - 2 Let k(o) = 135o. Let l(r) = 946r. Determine 43k(i) - 6l(i). 129i Let g(p) be the third derivative of p5/10 - 3p*3/2 - 15p2. Let r = -2 - -3. Suppose -l = -0 + r. Let b(t) = -t2 + 1. What is lg(k) - 9b(k)? 3k2 Let g(y) = 5y + 6. Let k(h) be the first derivative of h*2/2 + h - 12. Let x(o) = g(o) - 6k(o). Let i(r) = -6r - 2. Determine i(m) - 5x(m). -m - 2 Let u(k) be the second derivative of -13k3/6 - 60k. Let f(l) = l. Give 4f(i) + u(i). -9i Let w = -36 + 37. Let m(a) = 12a2 - 2a + 1. Let h be m(w). Let l(r) = 36r + 10. Let d(q) = -7q - 2. What is hd(z) + 2l(z)? -5z - 2 Let p(q) = q3 - 4q*2 - 6q + 2. Let n(l) = 9l2 - l3 + 13l - 4 - l*3 + 0l*2. Let y = -51 + 64. Let a be 2/(-3) - 20/(-3). Give an(c) + yp(c). c3 + 2c*2 + 2 Let r(m) = -2m*2 - 7m + 17. Let v be r(-5). Let s(j) be the first derivative of j*2 + 3. Let q(y) = 8y. Determine vq(p) - 9s(p). -2p Let d(q) = 29q*3 + 13q*2 + 10q + 19. Let r(i) = 15i3 + 7i*2 + 6i + 11. Determine 4d(h) - 7r(h). 11h3 + 3h*2 - 2h - 1 Let w(l) be the third derivative of -l5/15 - l4/12 + l*3/6 - 113l*2. Let p(n) = -11n*2 - 6n + 3. Determine 3p(s) - 8w(s). -s*2 - 2s + 1 Let l(p) = -131p - 12. Let a(u) = -33u - 3. Determine -9a(w) + 2l(w). 35w + 3 Let a(t) = 28t - 89. Let p(c) = -10c + 30. Give 6a(q) + 17p(q). -2q - 24 Let q(w) = -6w + 5. Let v be (-14)/(-4)40/7. Suppose c - v = -4a + 2c, -3a - 3c = -15. Let b(u) = -3u + 3. What is ab(y) - 3q(y)? 3y Let z(r) = r*2 + 5r - 124. Let f be z(9). Let x(y) = -8y3 + 2y*2 + 2y - 2. Let d(q) = -40q3 + 11q*2 + 11q - 11. Determine fd(v) - 11x(v). 8v3 Suppose 7 - 1 = y. Let o(t) = -5t*3 + 5t*3 - y + 5t2 - t3 + t. Let c be o(5). Let l(x) = -x + 1. Let j(u) = 5u - 4. Calculate cj(k) - 3l(k). -2k + 1 Let g(n) = 5n - 6. Suppose 9r - 28 = 8. Let p(q) = q. Calculate rp(x) - g(x). -x + 6 Let u(c) = 13c*2 - 9c. Let b(n) = 3n2 - 2n. Let q(s) = s*2 + s + 2. Let m be q(0). Let k be (60 - 33)((-3)/9 - 0). Give kb(w) + mu(w). -w2 Let v(z) = -z3 - z*2 - z. Let i(a) = -2a + 4a2 - 3a*2 - 3a*3 + 1 - 3a*3 + 5a*3 - 4a*2. Give -i(h) + 3v(h). -2h3 - h - 1 Let b(i) = -3i*3 - 4i*2 + 3i - 19. Let q(k) = 5k3 + 3k*2 - 2k + 19. Give -2b(g) - 3q(g). -9g3 - g2 - 19 Let o(n) = 4n + 2. Let c(j) = j. Suppose 73l + 16l = 534. Determine lc(r) - 2o(r). -2r - 4 Let d(m) = -57m*3 - 33m*2 + 33m - 33. Let l be 2 - (-2 + 2) - -31. Let b(w) = -7w3 - 4w*2 + 4w - 4. Calculate lb(g) - 4d(g). -3g3 Let d(o) = -2o - 1. Let i(q) = 2q + 2. Let h(r) = 2r3 + r2 - r + 1. Let w be h(1). Let k = w - 0. Suppose 7x = 5x + 4. Determine kd(l) + xi(l). -2l + 1 Let v(t) = -13t*2 + 3t - 5. Let h(g) = g - 5. Calculate -2h(z) + v(z). -13z2 + z + 5 Let m(i) = i2 - 105. Let w(y) = y*2 - 106. Calculate -3m(q) + 2w(q). -q2 + 103 Let z(x) = -4x - 1. Let v(k) = 0k - 1 + 173k*2 - 174k*2 - k. Determine 2v(q) - z(q). -2q2 + 2q - 1 Let f(d) = 4d3 - 5d2 - 5. Let k(m) = -55 + m2 + 102 - m*3 - 46. Give 6f(a) + 30k(a). -6a*3 Let w(m) = 15m*3 - 5m. Suppose -5t + 198 = 173. Let h(f) = 7f*3 - 3f. Give th(l) - 3w(l). -10l3 Let i(f) = -7f*2 + 3f - 4. Let b(s) = -27s2 + 11s - 16. Let y(z) = 2b(z) - 9i(z). Let r(x) = 5x2 - 3x + 2. Determine -5r(k) + 3y(k). 2k2 + 2 Let y(t) = 335t*3 - 8t*2 - 4t - 4. Let z(u) = 104186u3 - 2486u*2 - 1243u - 1243. Give 1243y(c) - 4z(c). -339c3 Let y(v) = 121v*3 + 9v*2 - 2v + 4. Let m(b) = 244b3 + 20b*2 - 5b + 9. What is -4m(u) + 9y(u)? 113u3 + u2 + 2u Let i(b) = b*2 - b + 1. Let u(v) = -8v - 4v2 + 10 + 2 - 5 + 11v*2. Suppose 0 = n - d - 5, 3n + 9 = -0d - 3d. Calculate nu(c) - 6i(c). c*2 - 2c + 1 Let a(n) = -4n - 9. Let f(x) = -2x + 39. Let o(z) = -5z + 117. Let w(b) = -17f(b) + 6o(b). Let r be w(-11). Let l(t) = -2t - 4. What is rl(g) + 2a(g)? 2g + 2 Let z(f) = -f3 + f2 - 2. Let y(u) = 16u*3 - 7u*2 + 6. What is -y(q) - 3z(q)? -13q3 + 4q*2 Let a = 27 + -30. Let i(p) = -4p*2 - 4p + 5. Let r(t) = -12t + 2 - 16t + 26t - 2t*2. Determine ai(o) + 7r(o). -2o*2 - 2o - 1 Let l be 0/(8/4 - 0). Suppose 4p + 3w = 5, -4p + 3w + 2 + 9 = l. Let a(j) = j*2 + 1. Let y(v) = -4v*2 - 4. Calculate pa(q) + y(q). -2q2 - 2 Let s(t) = -385t*3 + 2. Let w(y) = 810811y*3 - 4213. What is 4213s(p) + 2w(p)? -383p*3 Let g(m) = -4m. Let z(o) = -4o + 1. Determine -3g(y) + 4z(y). -4y + 4 Let p(a) = -a + 5. Let g(v) be the third derivative of v*4/12 - 3v*3/2 + 188v*2. Determine -6g(o) - 10p(o). -2o + 4 Let j(c) = 14c3 - 11c*2 - 5c - 95. Let z(a) = -5a3 + 4a*2 + 2a + 32. Determine -4j(n) - 11z(n). -n*3 - 2n + 28 Let y(l) = 100 + 8l - 6l - 104. Suppose -2v + 3h - 4 = 0, -3v + 3h = -2h + 7. Let f(x) be the first derivative of -x2/2 + x - 3. Give vy(m) + 3f(m). -m - 1 Let s(d) = 14d3 + d2 + 6d. Let x(i) = 70i*3 + 7i*2 + 32i + 1. Calculate 11s(z) - 2x(z). 14z3 - 3z*2 + 2z - 2 Let b(l) = -13l + 5. Let f be (54/(-81))/(2/(-27)). Let c(j) be the second derivative of j3/2 - j2/2 - 3j. Give fc(y) + 2b(y). y + 1 Let z(u) = -3u3 + 5u*2 - 2u + 1. Let w(j) = -7j3 + 11j*2 - 5j - 3. Let r(g) = -1. Let b(h) = 6r(h) - w(h). Determine -2b(i) - 5z(i). i3 - 3i*2 + 1 Let o(g) = 2g*2 - 6g + 3. Let d(v) = -9v3 - 36v*2 + v - 9. Let b be d(-4). Let m(j) = -4j*2 + 13j - 6. Determine bo(k) - 6m(k). -2k2 - 3 Let w(r) = r - 1. Let t(k) = -3k + 211. Determine t(m) + 2w(m). -m + 209 Let v(p) = 5p*2 - 29p + 3. Let j(d) = -11d2 + 59d - 5. Calculate -3j(f) - 7v(f). -2f2 + 26f - 6 Suppose 2t + 17 = -5f, -3f = -17t + 22t + 14. Let j(h) = -5h*2 - 3h - 2. Let q(b) = -4b2 - 3b - 1. Determine fj(g) + 4q(g). -g*2 - 3g + 2 Suppose -3b + 2163 = 2148. Let a(y) = 8y*3 + 5y - 3. Suppose 0 - 18 = 3j. Let d(h) = 9h*3 + 6h - 4. What is bd(q) + ja(q)? -3q3 - 2 Let m(g) = g - 1. Let k(w) = -2w + 2. Let y be 1881/(-15) + 7/((-35)/(-2)). Let d = -122 - y. Calculate dk(i) + 7m(i). i - 1 Let h(y) be the second derivative of -5y3/6 + 3y*2 + 73y - 2. Let t(i) = 5i - 5. Determine 6h(o) + 7t(o). 5o + 1 Let x(l) = 4l - 15. Let p(a) = -72a + 7. Let g(w) = -101w + 10. Let n(z) = 5g(z) - 7p(z). What is 6n(h) + x(h)? -2h - 9 Let j = 10 + -15. Let k(f) = 2f*2 + 7f + 6. Let b(m) = 2m2 + 6m + 5. Calculate jk(x) + 6b(x). 2x2 + x Let l(s) = 7s*2 - 4s. Let n(r) = r*2 + 111r - 45r - 66r. What is -l(z) + 6n(z)? -z2 + 4z Let d(a) = 5a3 + 6a*2 - 8. Let c(s) = -3s*3 - 4s*2 + 5. Let j = 13 - 4. Let b(r) = 3r - 22. Let q be b(j). Determine qd(w) + 8c(w). w*3 - 2w*2 Let r(h) = h. Let q(m) = 4m + 31. Let x(w) = -2w - 11. Let v(f) = 6q(f) + 17*x(f).	{ "pile_set_name": "DM Mathematics" }
+ 11 - 11)(1 + 1 - 1). -39i*2 Expand (-5 + 0 + 2)(2w3 - 2w*3 - 2w*5) - 8w*2 - 3w*2 + 3w*5 + 9w*2 + 2w*4. 9w*5 + 2w*4 - 2w*2 Expand (-3a + a + 4a)(-30 + 44 - 75). -122a Expand (4m + 2m + m)(2m - 2m*4 + 4m*4 - 20m*3 + 21m*3). 14m*5 + 7m*4 + 14m*2 Expand 10k - 3k + 4k - k + 3k - 3k - 2k + 3k + k + (-1 - 3 + 6)(2k + k - 2k) - 2k + 0k + 4k. 16k Expand 4m*2 + 0m*2 - 3m*2 + (-3 - m + 3)((2 + 1 - 1)(2m + 0m + 0m) - 2m + 0m + 4m). -5m*2 Expand (-f + 0f + 0f)(9f + f + 19f). -29f2 Expand (26n - 16n - 24n*2 - 8n)(-n2 - n2 + n2). 24n*4 - 2n*3 Expand (2 - 3 + 4)(-a + 7a - 4a)(3a - 5a + 4a)(-a2 - a2 + a2). -12a*4 Expand (0 + 4 - 3)(-73 + 66 + 55)(-2v + 0v - v). -144v Expand (5r + 7r - r)(2 - 1 - 3)(0r + r - 4r). 66r2 Expand ((-2j + 2j + j)(-2 - 5 + 5) - j - 4j + 2j)(3 + 3 - 4). -10j Expand (10 + 13 - 29)(-2 + 2 + n)(3n - 2n - 2n). 6n*2 Expand -2t*2 + 3t*2 - 3t*2 + (4t - 2t - t)(-t - 2t + 2t) - 3t2 + 3t*2 + 2t*2 - 2t*2 + 3 - 3 + t + 2t*2 - 4t*2 + 3t*2. -2t*2 + t Expand (-18 + 1 - 2 + 3h)((2h + h - 5h)(h - 2h + 2h) - 4h2 + 5h*2 - 2h*2). -9h*3 + 57h*2 Expand (-4f*2 + 3f*2 + 4f*2)(4f + f - 6f)(-3f - 1 + 1 + (2 + 2 - 1)(-4 + 4 + f) + 3f + 2f - 3f). -6f4 Expand (-p + 2p + 0p)(-4p + 4p + 2p) - p2 - 1 + 1. p2 Expand ((4 - 4 - 1)(-3 + 1 + 4) + 4 - 5 - 4)(-o + o + 2o*5). -14o*5 Expand 4 - 4 + 4i + (0 + 1 + 1)(-4i + 2i + 3i) + (0 + 3 - 2)(-6i + 4i + 6i). 10i Expand (2w*3 + 2w - 2w)(-26 + 12w + 26). 24w*4 Expand (5x + 0x + 0x)(x + 0x + x) + (x + 0 + 0)(-x - 2x + 2x). 9x*2 Expand (-3 + 3 + p)(-2p2 + p2 - p2). -2p*3 Expand (2 + 4 - 4)(-2 + 3 - 2)(0 + 0 + 2u). -4u Expand (l - 3 + 3)(-1 + 11 + 6). 16l Expand ((-2c + 4 - 4)(2 - 2 - 2) + c - 6c + 3c)(-27c - 40c + 37c). -60c*2 Expand -37j*2 + 15j*2 + 16j*2 + 2j*2 - 2j2 + j2 + (-1 + 1 - j*2)(-2 - 1 + 2). -4j2 Expand -2 + 2 - 2f - 13f - f + 0f + (-1 + 3 - 1)(f - 2f + 0f) - f - 3f + 6f. -15f Expand (3 - 6 + 1)(-54m - 13 + 0 + 13). 108m Expand (-4 + 4 - 2n*2)(4n - 4n + n*3). -2n*5 Expand -6r2 - r2 + 5r2 + (11 - 6 + 5)(4 - 4 - r)(2 - 2 + 2r). -22r2 Expand (-2 + 2 + 2d - d - 1 + 1 + (3d + 2d - 4d)(1 + 1 + 2))(-d3 - 4d*2 + 4d*2). -5d*4 Expand (-4k3 - k3 + 7k3)(2 + k - 2) + 3 + 14k4 - 3. 16k*4 Expand (2a + 0a - 4a)(-3a + 3a + 2a*3) - a + 2a*4 + a + 2a*4 - 2a*4 - 2a*4 + (2a*2 + 0a*2 - 3a*2)(-5a2 + 3a*2 + 4a*2). -6a*4 Expand (2t2 + t3 - 2t2)(-2 - t + 2) + 14t4 - 2t*4 + 20t*4. 31t*4 Expand (-1 + 1 - 2k)(-1 - 1 + 1) + 106k + 274k - 127k. 255k Expand (-3 + 3 + 2c)(2 + 0 - 1) + (-1 + 3 - 4)(-7c - 10c + 4c). 28c Expand -2s3 - 2 + 2 - 3s*3 - 3s*3 + 7s3 + (-s2 - 3s2 + 5s*2)(-5s + 3s + 0s) - 7s*3 + 4s*3 - 2 + 5 + 1 + 3s*3 - 1. -3s3 + 3 Expand (-w2 + w*2 + 2w*4)(-4 + 3 + 3 + (-4 + 3 + 3)(0 + 1 + 0) + 1 - 4 + 4 + (1 + 3 - 3)(17 + 3 - 7)). 36w4 Expand (3f + f - 2f)(0f - 5f + 3f) - 5f*2 + 5f*2 + 2f*2 - 1 + 1 - 2f*2 + (0 + 4 - 2)(4f + 4f + 6f)(-5f + f + 2f). -60f2 Expand (-1 + 2t + 1)(-3 + 6 - 2) + 4t - 2t - 3t + 1 + (-1 - 3 + 2)(3t - t - 4t) - t + 4t - 2t. 6t + 1 Expand (-7n4 - 4n*2 + 4n*2)(-2n + 0n + 0n) + (3n*2 + 4n*2 - 5n*2)(0n3 + 0n*3 - 2n3) + 1 - n5 - 1. 9n5 Expand (3b - 4b + 2b)(5b + 2 - 2)(-2b - 2b + 2b) - 11b + 11b - 12b3. -22b*3 Expand (-2b*2 + 4b2 + b2)(0b - 3b + b + (2b + 0b + 0b)(0 + 0 + 2) + 1 - 14b - 1). -36b3 Expand -b4 + b4 - b5 + 2b*5 + 6b*5 + 0b5 + (-b4 - 3b2 + 3b*2)(10 - 8b - 10). 15b*5 Expand ((2l*3 - 5l*3 + 5l*3)(2l - 4l + 0l) + 0l3 - l4 + 0l3)(2 - 1 - 2). 5l4 Expand (4r + 3r - r)(0 + 0 - r) - 3r2 - r2 + 5r*2. -5r*2 Expand -3p2 + p2 + 0p2 + (7p + 11p + 6p)(-5p + 3p + 0p). -50p2 Expand (-5l*2 + 16l*2 + 3l*2)(1 + 6 - 3). 56l2 Expand (-2f*2 - 3f2 + f2)(8f*3 - 8f*3 + 2f + 2 + 5f3). -20f*5 - 8f*3 - 8f*2 Expand (-2n + 2n + 4n)(2n*3 + 0n*3 + 0n*3). 8n*4 Expand (-5o + o - 6o)(4 - 1 + 0). -30o Expand (2i - 3i + 0i)(0 + 0 + 2) - 2i + 10i + 9i. 15i Expand (-2b*2 - 2b + 2b)((0 + b + 0)(0 - 1 + 2) + 2b + 0b + 0b - 3b + 0b + 4b). -8b*3 Expand (4f + 3f - 5f)(0 - 13 + 23)(-2 - 1 + 7). 80f Expand (c - c - c)(-1 + 3 - 3)(-2 - 1 + 5). 2c Expand (0q + q - 2q)(4 - 5 + 4) + (4q + 2 - 2)(-3 + 2 + 3). 5q Expand 3a3 - 2a*5 - 3a3 - a4 + a*4 + 2a5 + (-2 + 2 - a2)(3a3 - a3 + 0a3) - a5 + 2a*5 + 0a*5 - 5a*4 + 13a*4 + 3a*5 - 9a*4. 2a5 - a4 Expand (-2 - 3 + 1)(6q - 2q + 2q)(0 + 1 + 0). -24q Expand f*4 - 2f*4 + 2f*4 - 6f*4 + 3f*4 + 2f*4 + 3f*4 - 2f4 + f4 + (0 + 0 - 3f2)(2f2 + 1 - 1) - 2f*3 - 2f*4 + 2f*3. -6f4 Expand (z2 - 2z2 + 3z*2)(-7z2 + 14z*2 + 4z*2). 22z*4 Expand -27m - 2m2 + 24m + 3m2 - m2 + 2m*2 - 2m*2 + (5m + m - 4m)(3m - m - 4m) - m*2 - 2m + 2m. -5m*2 - 3m Expand 70y + 14y*2 - 70y + (-1 + 0 + 2)(y2 - 3y*2 + 4y*2). 16y*2 Expand 12o*3 + 6o*3 - 3o*3 + (-1 + 1 + o)(2o2 - 1 + 1) + 2o3 + o3 - 4o3. 16o3 Expand (d3 - d*4 - 8d + 8d)(-4 + 0 + 3) + (-2d3 - d3 + 5d*3)(3 - 3 - 2d). -3d4 - d3 Expand (-1 + 2 + 1)(-10 - 1 + 0)(-2a - 3a + 4a). 22a Expand (-33m + 9m + 3m)(2 + 2m - 2 + (2m - m + m)(-1 + 2 + 1) - m + 2m - 3m). -84m*2 Expand 4c - 4c2 - 4c + (2c2 + 0c + 0c)(-2 - 2 + 6) - 3c2 + 5c2 - c2 - 3c + 2c*2 + 3c + c*2 - 3c*2 + 3c*2 + 0c*2 + 3c*2 + 0c*2. 7c*2 Expand (0 + 0 + 2a*2)(a - 6a + 4a)(0 + 3 + 3) + (4a*2 - 4a2 - a2)(0 + 0 + 2a). -14a3 Expand (11z*2 + 12z*2 - 21z*2)(0z + 0z + z*2). 2z*4 Expand (-3 - k + 3)(-7 - 5 + 4 + (2 - 2 + 2)(0 - 2 + 3)). 6k Expand (-6w4 - 6w*4 + 6w*4)(2w + 2 - 2) + (-4 + 4 + 2w*3)(w2 + w - w) + w5 - 2w5 + 0w*5. -11w5 Expand (-y2 + 3 + 0y2 - 4y + y)(27 + 2y - 27). -2y3 - 6y*2 + 6y Expand (0 + 2 + 0 + (-1 + 2 - 4)(-2 + 2 + 1))(-3 + r + 3). -r Expand (-g + g - g*2)(0g2 + 0g*2 - 2g*3). 2g*5 Expand (-2q + 2 - 2)(-2 + 2 + q) + 10q*2 + 12q*2 - 10q*2. 10q*2 Expand (x + 5x - 4x)(0 - x*2 + 0)(2x - 4x - x). 6x4 Expand (2y - y - 3y)(5y4 - 4y4 + y4) + (-y + y + 2y3)(8y2 - 7y*2 + 0y*2). -2y*5 Expand -2a*4 + 1 - 1 + (-2a + 3a - 3a)(-4a*3 + 3a*3 + 2a*3) + (a + 0a + 0a)(-2a3 + 0a*3 + 0a*3). -6a*4 Expand (10 - 2b + 2b3 - 10)(3 + 0 - 5). -4b3 + 4b Expand (-20 - 16 + 23)(0 + 4 - 2)(3w2 - 3w2 - w3). 26w3 Expand (-1 + 1 + b)(b*3 + 17b - 17b) - 2b4 - 1 + 1. -b4 Expand (1 + 1 - 1)(2d*4 - 3d*2 + 3d*2) + 2d - 2d + 2d4 - d4 - d4 + d4 + (4d - 4d + 2d2)(-2d2 + 5d*2 - 5d2). -d4 Expand (-5m + 6m - 22 - 3m)(-4m - m + 3m). 4m2 + 44m Expand (3 - 3 + 12g)(-4 - 3 + 0). -84g Expand (3s - 2s + 0s)(2s - 4s + 0s) - 4 + 4 - 3s2 - 2s*2 - 2s + 2s. -7s*2 Expand (-1 + 2 - 2)(3h - h - 3h + (0 + 4 - 2)(-2h + 3h - 3h)). 5h Expand -2t + t*4 + 2t + (t*4 + 2t4 - t4)(1 - 6 - 3). -15t*4 Expand (-2 - 2 + 2)(0x - x - 2x). 6x Expand (-2v + 2v + 2v)(-1 + 2 + 5 + (3 - 2 - 2)(-2 + 2 + 2) + 1 - 1 - 3). 2v Expand 82w*3 + 10w*5 - 83w*3 + 14w*5 + (3w4 + w4 - 3w4)(-4w + 6w - 4w) + 0w - w*5 + 0w + 0 + 2w5 + 0. 23w5 - w3 Expand (0 - 1 + 3)(2 - 2 - 2x) - 1 - 2x + 1 - x - 44 + 44. -7x Expand (0r2 - 3r*2 + 2r*2)(2 - 4 + 0)(-11r + 5r2 + 11r). 10r4 Expand (-5o*2 + 3o*2 + 4o*2)(-o + 22o2 - 4o*2 - 7o*2). 22o*4 - 2o*3 Expand (0 - 3 + 5)(1 + 2 - 5)(i2 - 21i*2 - 26i*2). 184i*2 Expand (2v + 5v + v)(v*2 - 2v*2 + 0v*2) - 2v + 2v + 2v*3 - 5v + 5v - 2v*3. -8v*3 Expand (-1 + 1 + 3s)(0s3 - s3 + 4s	{ "pile_set_name": "DM Mathematics" }
2). Let w = x + 17. Is 8 a factor of r(w)? True Let z be 0/1 - 11-8. Let n be 0 + (-174)/(6 + -3). Let r = z + n. Is 15 a factor of r? True Let l be (-109)/(-5) + 4/20. Is 12 a factor of l - 0(1 - 0)? False Let f = -227 - -330. Does 34 divide f? False Let v = 0 - 3. Let f = v + 18. Does 8 divide f? False Suppose r = -3r - 16. Does 30 divide (-1 + -7)30/r? True Suppose -5i = -2i - 120. Is 10 a factor of (-1 - -19)i/24? True Suppose -136 - 11 = -3j. Is 6 a factor of j? False Let k(o) = 2o2 + 4o + 2. Let j be k(-2). Suppose -jw + 4w = -26. Let b = w + 19. Is 6 a factor of b? True Let r = -5 - -14. Does 9 divide r? True Suppose -2r = d - 357, -2r = -3r + 3d + 161. Does 22 divide r? True Let r = -325 - -531. Is 23 a factor of r/3 + (-1)/(-3)? True Let d(h) = -h*2 - 7h - 7. Let y be d(-5). Suppose -4j + 33 = -5o, yj = -3o - 5 + 23. Does 7 divide j? True Let n = 123 - 42. Is n a multiple of 8? False Let r be 8 + (2 - (-12)/(-4)). Suppose 0 = -2x - r + 43. Is 12 a factor of x? False Is 9 a factor of (-8)/(-28) + 250/7? True Suppose -6y + 41 = -19. Is 2 a factor of y? True Suppose 3b - 3 = 3. Does 4 divide (-111)/(b/(-2))? False Let v = -24 - -56. Is 8 a factor of v? True Suppose 0 = w - 3w + 66. Is 33 a factor of w? True Let g = -4 - -7. Suppose -i - 5t = -gt - 13, 28 = 4i - 4t. Does 8 divide i? False Suppose 10 + 5 = -5w. Let t = 2 + w. Is 0(t - 0) - -24 a multiple of 24? True Let d(c) = 5c*2. Let h be d(5). Suppose 2b + 10 = 0, 7l = 2l + 3b + h. Is l a multiple of 8? False Suppose 0 = 6m - 677 + 149. Is m a multiple of 22? True Let q = -12 + 8. Let y be 2/q + (-182)/(-4). Does 6 divide ((-4)/10)/((-1)/y)? True Does 3 divide ((-2)/6)/(8/(-96))? False Suppose 140 = 5u - 2i, -u + 28 = -2i + 3i. Does 14 divide u? True Let t = 129 + -43. Is t a multiple of 4? False Let r = 10 - 6. Suppose 0 = j - 3d - 17 - 16, -rj = -4d - 116. Does 11 divide j? False Let x be (20/(-6))/518. Does 6 divide 1/(x/14 + 1)? False Let a(f) = -143f - 1. Let n be a(1). Is (n/40)/((-2)/10) a multiple of 9? True Suppose 0i = -9i + 189. Is 19 a factor of i? False Let z(a) = -3a + 5. Let u(q) = 5q3 - 2q*2 - 4q3 + 2 - q2 - q. Let o be u(2). Is 17 a factor of z(o)? True Let v(i) = i*3 + 5i*2 - 9i - 12. Let p be v(-6). Suppose 0 = 3f + 7k - 4k - 45, 0 = -3f + 4k + 17. Let y = f - p. Is 2 a factor of y? False Let k(q) = 18q - 4. Is k(3) a multiple of 9? False Suppose a + a = 5n - 703, -5n + 707 = 2a. Is 40 a factor of n? False Let k be 2 + (-6)/42. Is 18/(-4)(k - 5) a multiple of 11? False Suppose -2a + 96 = 2a + 5r, 0 = 3a - r - 72. Suppose -2g = -3g + a. Is 12 a factor of g? True Let v(t) = -7t*2 + 7t + 7. Let k(f) = -6f2 + 7f + 6. Let b(g) = -6k(g) + 5v(g). Does 4 divide b(9)? False Let o(d) = d*2 + 8d + 64. Is 17 a factor of o(-10)? False Let d(z) = z + 5. Let g(q) = -2q - 10. Let o(f) = 5d(f) + 2g(f). Suppose 3 = 5y + 2j - 20, 2j + 17 = 3y. Is 10 a factor of o(y)? True Suppose 3d - 2r - 2 = -1, 3d + 3r = -24. Let b be (-2)/(-2 - d)-1. Let z(o) = 26o - 1. Is z(b) a multiple of 14? False Suppose 3u + 12 = 0, -3w - w - u = 136. Let f = 2 - w. Is f a multiple of 11? False Suppose d = -d + 3l + 119, 2l - 307 = -5d. Let f = -19 + d. Is f a multiple of 11? False Let p = 102 + -24. Does 26 divide p? True Suppose n = -a + 2n + 39, 4n = 5a - 195. Is a a multiple of 13? True Suppose 2i - f = 83, 5i - 5f = -0f + 200. Is 13 a factor of i? False Let h = 17 - -22. Is 24 a factor of h? False Let r(j) be the first derivative of -j3/3 + j2 - j + 2. Let q be r(2). Is 3 a factor of (q - (-8)/5)5? True Let p(g) = g3 - g2 - g + 71. Is p(0) a multiple of 20? False Suppose -5w + 7w - 8 = 0. Suppose -3l - 2l = -2u + 46, -68 = -4u + wl. Does 3 divide u? False Let w(r) = -r2 + 12r - 15. Let a be w(13). Let u = a - -42. Does 14 divide u? True Suppose -22x + 20x + 96 = 0. Is 16 a factor of x? True Does 10 divide 2 - ((1 - -4) + -28)? False Suppose p = -5d + 13 + 22, 0 = -5p + d + 253. Is 10 a factor of p? True Suppose -3f = 5s - 0f - 56, 5s = -5f + 60. Is 10 a factor of s? True Let v = 160 + 17. Is v a multiple of 36? False Suppose 120 = 4y + 3x, -2 = -x + 2. Suppose 9 + y = 3q. Is q a multiple of 12? True Suppose 0m - 18 = 3m. Let p be 2/(m/3)-3. Suppose pw = 15, 2j - 2w = -2j + 102. Is 14 a factor of j? True Suppose -3p = p + 2t - 94, 3p + t = 71. Does 4 divide p? True Suppose 5v - 247 = 4d, -4v + 0d = -5d - 203. Suppose -3y + v = -10. Is y a multiple of 7? False Let n = 81 + -47. Is n a multiple of 22? False Let g(y) = 3y2 - 2. Suppose 4v + 2m - 28 = 0, -2m = 5v - 25 - 9. Let w = v + -2. Is 17 a factor of g(w)? False Let m = 0 + -1. Let u(j) = j + 1. Let c be u(m). Suppose c = -4r + 48 + 48. Is r a multiple of 7? False Let z be (-4)/(-5)10/4. Suppose -4u + 26 = zh, 0 = -2h + 2u - 5 + 37. Is h a multiple of 10? False Let q(u) = 155u3 + u2. Does 39 divide q(1)? True Suppose 6b = 3b + 9. Suppose -b = p - 23. Is 14 a factor of p? False Let t(g) = -6g - 2. Let l be t(-2). Does 7 divide 136/l + 4/10? True Suppose k + 5n - 18 = 0, -n + 19 = 2k - 17. Let q = k + 24. Does 15 divide q? False Let r(n) be the second derivative of 17n4/12 + n3/2 + 5n. Is 13 a factor of r(-2)? False Suppose 0 = -i + 6i. Suppose -c - 2j = 8, -5c + ij = 4j + 70. Let r = c - -33. Does 15 divide r? True Suppose 0 = 2a - 0a - 64. Suppose -5z + 0z - 2u + 25 = 0, a = z - 5u. Is 5 a factor of z? False Suppose -g + 5 = 2i, -4i - 5g + 13 = -0i. Suppose 0b - 2b = -5a + 2, 2a + ib + 2 = 0. Suppose -4z = -az - 48. Does 12 divide z? True Let z(a) = -37a*3 - 2a*2 - 2a - 1. Let f be z(-1). Suppose -f = -8j + 5j. Does 6 divide j? True Suppose 0 = -3g + 6, -4n - g + 3g + 4 = 0. Suppose 22 - n = -o. Does 8 divide (-5)/164/o? True Suppose -a + 0 - 1 = 0. Let z(y) = y + 1. Let i be z(a). Suppose -48 = -2j - ij. Is 24 a factor of j? True Let s(d) = -d*2 + 27d - 39. Does 3 divide s(18)? True Let s(d) = -d*3 + 12d*2 + 15d + 18. Let p be s(13). Let a = p + -15. Is a a multiple of 9? False Let t(o) = -2o3 - 4o*2 - 3o - 1. Let v be t(-2). Suppose -5z - vw = 0, 0z - 6 = 2z + 4w. Suppose 67 = zx - 41. Is 18 a factor of x? True Let k(c) = c*2 + 5c + 6. Let x be k(-5). Let n = -1 + x. Suppose 10i = -5w + 5i + n, w - i - 9 = 0. Is 3 a factor of w? False Let l(i) = -i + 5. Let r be l(8). Let s = 5 + r. Suppose y = 0, 3y + 78 = sk + 6y. Is 13 a factor of k? True Suppose -3h = f - 22, -3h - 2f + 3f + 14 = 0. Suppose -2i + 179 - h = 3s, 0 = s - i - 56. Is 20 a factor of s? False Suppose 220 = 5u + f - 3f, -u = -5f - 21. Does 14 divide u? False Let c = -13 + 10. Let v = c + 5. Is 450/27 - v/3 a multiple of 16? True Let i = 26 - 45. Let l = 9 + i. Is 7 a factor of 4/l + 148/20? True Suppose -5l + 211 = 2w - 0w, 5w - 4l - 577 = 0. Suppose o + 37 = h, h - 4h + 2o + w = 0. Suppose n - h = -12. Is 10 a factor of n? False Suppose 2c + o + 199 = 6c, 12 = -4o. Is c a multiple of 17? False Let u(b) = b3 + 9b*2 + 11b + 7. Is u(-5) a multiple of 13? True Suppose -y + 126 = -4y. Let g be ((-3)/9)/(1/y). Suppose -z + 27 = -g. Does 19 divide z? False Let l = 0 + 3. Suppose lk - 33 + 146 = 4c, -180 = -5c - 4k. Does 16 divide c? True Let p(h) = h3 + h2 - 4h + 4. Let b be p(5). Let w = b + -56. Suppose 3c - c = w. Is 15 a factor of c? False Let j be (-3)/(-3)-11. Is 13 a factor of (34/(-5))/(j/5)? False Let q(y) = 2y*2 + 1. Let x be q(2). Suppose 0 = 3n + 2j - 2 + 3, 5n = -j + 10. Suppose -4d + 38 = no + x, -18 = -2o - 3d. Does 6 divide o? False Suppose 12 = 7b - 3b. Let f = 7 - b. Is f a multiple of 4? True Let t = -3 + 6. Is 2 a factor of t/1 - (-2 + 1)? True Let p(z) = -z*2 + 9z - 8. Let u(s) = s*3 + 6s*2 + 4s + 1. Let c be u(-5). Does 5 divide p(c)? True Suppose -w = 3z - 16, -3z + z + 12 = 2w. Let r be 11/w + 11. Suppose -4p + r = -3p. Is p a multiple of 8? False Let r = 14 - 9. Suppose 0 = -v - 2j, 0j - 33 = -3v + rj. Let a(w) = -w*2 + 8w + 5. Is a(v) a multiple of 17? True Let k(z) = z - 4. Let s be k(4). Suppose 3i + 2x = 484, -i + 4*x + 134 + 32 = s. Does 6	{ "pile_set_name": "DM Mathematics" }
t(10))*2 - (-1(sqrt(28) + sqrt(7)))*2). sqrt(7) + 33 Simplify sqrt(13) + sqrt(208)-3 + (sqrt(104)/(sqrt(8)3))2 + (sqrt(117)/sqrt(12))/(sqrt(33)/(sqrt(99) + sqrt(11))). -9sqrt(13) + 13/9 Simplify ((sqrt(153) - sqrt(153)-1-4) + 0 + (sqrt(153)-1)2-1 + 5 + -1 + sqrt(153))5. -745 - 30sqrt(17) Simplify (((sqrt(105)/sqrt(3))/sqrt(7) + sqrt(5))3 + (sqrt(50)/sqrt(40) - (sqrt(500) - (sqrt(500) - 1sqrt(500)) - sqrt(500))))*2. 845/4 Simplify (-5 + 6(2(sqrt(1900) - (2 + sqrt(1900) + sqrt(1900))) + -1 + sqrt(1900)3))*2. -4200sqrt(19) + 69625 Simplify sqrt(171) + 2 + 0 - (-1 + -1 + -2sqrt(19)). 4 + 5sqrt(19) Simplify -3((0 + sqrt(11)1)*2 + (sqrt(77) + sqrt(77)-2)/sqrt(7)) + 4. -29 + 3sqrt(11) Simplify -1 + (-1(sqrt(171)-2 + sqrt(171) - sqrt(171) - sqrt(171)) + sqrt(171))/(sqrt(729)2 - sqrt(729)). -1 + 4sqrt(19)/9 Simplify 1 + 5 + 4sqrt(99)2. 6 + 24sqrt(11) Simplify -2 + (sqrt(245) + sqrt(245) + 1)6 + 5. 9 + 84sqrt(5) Simplify 3((sqrt(200) - (-3 + sqrt(200))-2)-4)2. -17280sqrt(2) + 88128 Simplify 1((0 + sqrt(20)/sqrt(4))2 + 1) - (-3 + (1 + sqrt(125) + 2)2). -125 - 30sqrt(5) Simplify 5(2 + (-2 + sqrt(832) + sqrt(832))22 + -2 + 4). -640sqrt(13) + 33340 Simplify (sqrt(1088) - (sqrt(1088) + -1))2-6 - (-6(sqrt(170) + sqrt(170)3))/sqrt(10). -6 + 24sqrt(17) Simplify 5(2(sqrt(325) + sqrt(325) + -6sqrt(325)5))2. 5096000 Simplify 4((-1sqrt(175)34)2 + 4). 100816 Simplify 6(-4 + sqrt(3)2-1 + sqrt(96)/sqrt(8))*2. 96 Simplify ((sqrt(567) - sqrt(567)1)6 - -2((sqrt(63))*2 + -3))-6-6. 4320 Simplify 6sqrt(70)/(-1sqrt(10)) + (sqrt(63)/(sqrt(9) - (sqrt(9) - 1sqrt(9))) - sqrt(378)/sqrt(6)) + 2. -8sqrt(7) + 2 Simplify ((2((sqrt(98) - (-2 + sqrt(98) + 2) - sqrt(98)) + sqrt(98)) + -4)-4)2. 256 Simplify (2-2sqrt(130) + sqrt(130) + 6(sqrt(130) - -2sqrt(130)))/(sqrt(1000) + sqrt(1000)23). 3sqrt(13)/14 Simplify (1(sqrt(153) + 0 + -1sqrt(153))22)*2. 0 Simplify 3 + (sqrt(150)/sqrt(5))/sqrt(6) + -5 - 1-6(2 + sqrt(25)/sqrt(5)). 10 + 7sqrt(5) Simplify (sqrt(176)5 + sqrt(176))/(sqrt(28)/(sqrt(7)2) - sqrt(4)). -24sqrt(11) Simplify (-4 + sqrt(468)2-3 + sqrt(468) + sqrt(468)2 + -4)*2. 288sqrt(13) + 4276 Simplify ((sqrt(72) - 2(sqrt(72)1 + sqrt(72))) + (-6(sqrt(72)1 - sqrt(72)) - sqrt(72)))*2. 1152 Simplify -5 + -1(0 + -6(sqrt(11) + sqrt(176) + 1)2). 60sqrt(11) + 1651 Simplify 5((-2sqrt(18))/sqrt(9) - (sqrt(2) - (1sqrt(24))/sqrt(12)))-41. 40sqrt(2) Simplify sqrt(76) + ((sqrt(76) + 0)-5)2 + sqrt(76) + (sqrt(76) - (sqrt(76)-1 + 0))*2 + -3sqrt(190)/(1sqrt(160) + sqrt(160)). 29sqrt(19)/8 + 2204 Simplify (0 + (sqrt(1100) + 0 - ((sqrt(396)2)2 + sqrt(44))))2. -3168 + 16sqrt(11) Simplify (5sqrt(30)/(sqrt(250) + (sqrt(250) - sqrt(250)-1 - sqrt(250)))4-1)2. 12 Simplify (-6(sqrt(33) - sqrt(2112)3))/((sqrt(132) - sqrt(33))/sqrt(3) + sqrt(11) + -2(sqrt(11) + (sqrt(11) - (sqrt(22)/sqrt(2) + sqrt(11))))). 69sqrt(3) Simplify ((-33sqrt(225))/sqrt(9))/((-1sqrt(30))/sqrt(6) - 2(sqrt(80) + sqrt(5))). 9sqrt(5)/11 Simplify -2 + (2sqrt(847) + sqrt(63) + -5)2 + -1 + 3. -10 + 50sqrt(7) Simplify -3sqrt(15)/sqrt(5) + ((sqrt(3) + -1)-3)2 - -5sqrt(27)/(sqrt(45)/sqrt(5)). -16sqrt(3) + 36 Simplify sqrt(245) + (sqrt(245) + -1sqrt(245) + sqrt(245))*2 + sqrt(245) + 4 + -1 + sqrt(45) + -1(sqrt(5)2)2. 17sqrt(5) + 228 Simplify ((sqrt(1539) + 0 + 2)3)21 + -5. 324sqrt(19) + 13882 Simplify (-2 + 2 + -2 + (sqrt(1872) - (5sqrt(1872) + 5)))*2. 672sqrt(13) + 30001 Simplify (-2sqrt(275))2 + -3(1sqrt(11))2 + (sqrt(891) + -3sqrt(891) + -3 - sqrt(891))*2. 162sqrt(11) + 9095 Simplify (-1(-1sqrt(425) + -3 + 3))*2. 425 Simplify -3(1sqrt(6)-3)/(sqrt(12)/(-2sqrt(6) - sqrt(6))). -27sqrt(3) Simplify ((-3((1 + sqrt(363) - sqrt(363) - sqrt(363))2 + -1 + sqrt(363) + (2sqrt(363) - sqrt(363))))2 + 2)-2. -22 Simplify ((sqrt(1280) - -3sqrt(1280)-1) + 1)*2. -64sqrt(5) + 5121 Simplify (sqrt(200) + 1 + sqrt(200) + -3 - sqrt(200))*2 - (-5 + (sqrt(2) + -1 - sqrt(2)) - (sqrt(4)/sqrt(2) + 2)). -39sqrt(2) + 212 Simplify (2sqrt(432))2 - sqrt(240)/(sqrt(25)/sqrt(5)). -4sqrt(3) + 1728 Simplify (sqrt(72)-34)/(-1sqrt(81)-2). -4sqrt(2) Simplify 6(5 + (-2 + -4 + (sqrt(192)2 - sqrt(192)))2). -576sqrt(3) + 1398 Simplify ((0 + sqrt(17) + sqrt(68) - sqrt(17))3 + (sqrt(17) + 0 + -3)-5)*2 + -4. 30sqrt(17) + 238 Simplify (-3sqrt(216)/sqrt(9) - sqrt(24))/(sqrt(72)/sqrt(6)-4). sqrt(2) Simplify 0 + 4 + (sqrt(1377) - (-2 + sqrt(1377))) + -3 + sqrt(1377)-2 + sqrt(1377). -9sqrt(17) + 3 Simplify -3 + sqrt(847) + -1 - (sqrt(847)3 + -3). -22sqrt(7) - 1 Simplify (sqrt(2904)3)/(4sqrt(6)/sqrt(2)). 33sqrt(2)/2 Simplify 2((sqrt(224) + sqrt(14))/sqrt(2))*2 + (5 + 1sqrt(175))*2. 50sqrt(7) + 550 Simplify ((sqrt(72) + 3sqrt(72) + -4)2 + -1)1. -192sqrt(2) + 1167 Simplify 2 + (2(sqrt(12) - -3sqrt(48)/sqrt(4)))/(sqrt(44)/(sqrt(176)1)). 2 + 32sqrt(3) Simplify -2(sqrt(833) + -2sqrt(833))2 - (-4sqrt(204)/(sqrt(300) + sqrt(12)))*2. -15062/9 Simplify 4(sqrt(243)-2)2-5 + (sqrt(3) + sqrt(15)/sqrt(45) + -4)6. -19464 + 8sqrt(3) Simplify -2 + sqrt(245)-3-1 + -5. -7 + 21sqrt(5) Simplify (21(sqrt(432) + 1) + -1 + 1)2. 96sqrt(3) + 1732 Simplify 5((sqrt(11) - sqrt(44)/sqrt(4))2-5 + sqrt(11) + 2 + 2sqrt(11)-4-3 + -5). -15 + 125sqrt(11) Simplify (-3((sqrt(2299) - (sqrt(2299) + -5)-2) + 2)2)2. -19008sqrt(19) + 747180 Simplify -5 + (sqrt(832) - 4(sqrt(832) + sqrt(832) + -2)2) - (-3 + (1 + sqrt(832))2 + (3(-1 + sqrt(832) - sqrt(832)))*2). -14172 + 248sqrt(13) Simplify (sqrt(24) + -2sqrt(216) + sqrt(216))/(-6sqrt(12)4). sqrt(2)/12 Simplify -2(sqrt(2) - sqrt(14)/sqrt(7)4)2 + -2 + -5(sqrt(2) - (sqrt(2) + sqrt(10)/sqrt(5) + sqrt(2))). -38 + 10sqrt(2) Simplify ((sqrt(1300)1 + -3 - sqrt(1300)26) + 2)*2-6. -943806 - 1320sqrt(13) Simplify (sqrt(432) + -2 - sqrt(432))2 + 5 - 4(sqrt(3) - sqrt(27))2. 9 + 16sqrt(3) Simplify (3-2sqrt(99) + (sqrt(99) - (sqrt(99) - ((-5(sqrt(99) + -1sqrt(99)) - sqrt(99)) + sqrt(99)))))/(sqrt(729)-1-6). -sqrt(11)/9 Simplify (-5 + sqrt(162) + -1 + 5)2 - (1 + sqrt(162) + 4 - sqrt(162))2-3. -18sqrt(2) + 238 Simplify ((-1sqrt(3240))/(sqrt(8) - (sqrt(648)-5 + sqrt(648))))*2. 405/1369 Simplify (sqrt(19)-24 - (0 + sqrt(2299)))2 + ((1sqrt(1539))2 + -5 - (-4 + 0 + sqrt(1539) + sqrt(1539))2). 144sqrt(19) + 2221 Simplify (-23sqrt(150))/((sqrt(36)2)/sqrt(12) - sqrt(3) - (sqrt(3) - sqrt(12))4). -6sqrt(2) Simplify (3(sqrt(2) + -1) + -3)2 + (6-2sqrt(16)/sqrt(8))2. -36sqrt(2) + 342 Simplify ((sqrt(325) + -3sqrt(325) - sqrt(325)) + sqrt(325) + sqrt(325) + 3 + ((sqrt(13) - sqrt(39)/sqrt(3)) + 0)1)*2. -30sqrt(13) + 334 Simplify (-1((sqrt(108) + sqrt(108) + sqrt(108) + (sqrt(108) - (sqrt(108) + 3 - sqrt(108))))-1 - sqrt(108))-1)2. -180sqrt(3) + 2709 Simplify ((sqrt(1125) + sqrt(45))3 + sqrt(45) + (sqrt(1125) - (sqrt(1125) + sqrt(1125)-1)) + sqrt(1125) + sqrt(1125))/(52sqrt(900)). 17sqrt(5)/50 Simplify (-5 + sqrt(208) + 1)2 + sqrt(130)/(sqrt(50)/(sqrt(5) + sqrt(5) + 1sqrt(5))) + -4. -29sqrt(13) + 220 Simplify ((sqrt(110) + -3sqrt(110))-6 - sqrt(110))/(sqrt(10) - (sqrt(20)/sqrt(32) - sqrt(10))) + 5. 5 + 44sqrt(11)/7 Simplify -3(sqrt(68) - (((sqrt(68) - (sqrt(68) - (-1 + sqrt(68))))6)*2 - sqrt(68)) - (((0 + sqrt(68))-6)*2 + sqrt(68)))-5. -73980 + 2190sqrt(17) Simplify (((2sqrt(84) - sqrt(84)) + sqrt(84))-1)/(sqrt(84)/sqrt(7)2). -sqrt(7) Simplify ((sqrt(2662) - sqrt(2662)-1)1)/(-5sqrt(10)/(sqrt(20)/sqrt(4))). -22sqrt(11)/5 Simplify (2(sqrt(76) - 2sqrt(76))6)/((-1sqrt(1200) - sqrt(12))/sqrt(3)) + -3. -3 + 12sqrt(19)/11 Simplify ((sqrt(210)-1)/sqrt(6) - (1sqrt(350))/sqrt(10))/((sqrt(1701) + -3sqrt(1701) - sqrt(1701))/sqrt(3)). 2sqrt(5)/27 Simplify sqrt(5) + sqrt(10)/sqrt(2) + -4 + sqrt(720) + sqrt(720)1 + sqrt(5) + 3(sqrt(2695)2)/sqrt(11). -4 + 69sqrt(5) Simplify 5 + -3((1 + sqrt(72) + 0 + sqrt(72))1)2 + 0. -862 - 72sqrt(2) Simplify 2(5 + (sqrt(36)/(sqrt(3) + sqrt(6)/sqrt(2) + sqrt(3) - sqrt(3)))/(1sqrt(600)))*2 + 3. sqrt(2) + 5301/100 Simplify (-6(sqrt(136)-2 - sqrt(136)) - (sqrt(136) - (sqrt(136) + sqrt(136)2))	{ "pile_set_name": "DM Mathematics" }
ger? 108 What is 17635 to the power of 1/2, to the nearest integer? 133 What is the third root of 4751 to the nearest integer? 17 What is the cube root of 5544 to the nearest integer? 18 What is the square root of 5401 to the nearest integer? 73 What is the third root of 4357 to the nearest integer? 16 What is the sixth root of 1150 to the nearest integer? 3 What is 46415 to the power of 1/5, to the nearest integer? 9 What is 18719 to the power of 1/7, to the nearest integer? 4 What is the third root of 32522 to the nearest integer? 32 What is 14399 to the power of 1/2, to the nearest integer? 120 What is the fourth root of 8199 to the nearest integer? 10 What is 5123 to the power of 1/10, to the nearest integer? 2 What is the square root of 3073 to the nearest integer? 55 What is the fifth root of 15798 to the nearest integer? 7 What is 56025 to the power of 1/7, to the nearest integer? 5 What is the square root of 2722 to the nearest integer? 52 What is the square root of 464 to the nearest integer? 22 What is the square root of 91377 to the nearest integer? 302 What is 6054 to the power of 1/9, to the nearest integer? 3 What is the square root of 10773 to the nearest integer? 104 What is the cube root of 1687 to the nearest integer? 12 What is the square root of 26894 to the nearest integer? 164 What is 35149 to the power of 1/2, to the nearest integer? 187 What is the ninth root of 27399 to the nearest integer? 3 What is the seventh root of 48721 to the nearest integer? 5 What is 1579 to the power of 1/5, to the nearest integer? 4 What is the third root of 798 to the nearest integer? 9 What is 237 to the power of 1/2, to the nearest integer? 15 What is 340 to the power of 1/3, to the nearest integer? 7 What is 1135 to the power of 1/2, to the nearest integer? 34 What is the third root of 37446 to the nearest integer? 33 What is 2717 to the power of 1/3, to the nearest integer? 14 What is 30335 to the power of 1/3, to the nearest integer? 31 What is the fifth root of 55058 to the nearest integer? 9 What is the cube root of 2138 to the nearest integer? 13 What is the cube root of 26084 to the nearest integer? 30 What is the eighth root of 164415 to the nearest integer? 4 What is 943 to the power of 1/2, to the nearest integer? 31 What is the third root of 8426 to the nearest integer? 20 What is the cube root of 550 to the nearest integer? 8 What is the third root of 136159 to the nearest integer? 51 What is the sixth root of 6352 to the nearest integer? 4 What is the square root of 2282 to the nearest integer? 48 What is the seventh root of 2556 to the nearest integer? 3 What is the square root of 902 to the nearest integer? 30 What is the third root of 53520 to the nearest integer? 38 What is 24638 to the power of 1/3, to the nearest integer? 29 What is the cube root of 6943 to the nearest integer? 19 What is 9114 to the power of 1/3, to the nearest integer? 21 What is the eighth root of 8717 to the nearest integer? 3 What is 1484 to the power of 1/8, to the nearest integer? 2 What is the tenth root of 1081 to the nearest integer? 2 What is the seventh root of 10187 to the nearest integer? 4 What is the square root of 673 to the nearest integer? 26 What is the square root of 6878 to the nearest integer? 83 What is 44234 to the power of 1/2, to the nearest integer? 210 What is 127010 to the power of 1/6, to the nearest integer? 7 What is the square root of 14251 to the nearest integer? 119 What is the square root of 609 to the nearest integer? 25 What is the square root of 1888 to the nearest integer? 43 What is the sixth root of 4322 to the nearest integer? 4 What is the cube root of 593 to the nearest integer? 8 What is the square root of 6834 to the nearest integer? 83 What is the fifth root of 898 to the nearest integer? 4 What is 39369 to the power of 1/3, to the nearest integer? 34 What is 6779 to the power of 1/3, to the nearest integer? 19 What is 3018 to the power of 1/3, to the nearest integer? 14 What is the square root of 2160 to the nearest integer? 46 What is the square root of 36500 to the nearest integer? 191 What is the tenth root of 1563 to the nearest integer? 2 What is the cube root of 11522 to the nearest integer? 23 What is 5229 to the power of 1/3, to the nearest integer? 17 What is the square root of 5240 to the nearest integer? 72 What is the fourth root of 14982 to the nearest integer? 11 What is the cube root of 49596 to the nearest integer? 37 What is 2177 to the power of 1/3, to the nearest integer? 13 What is the tenth root of 63755 to the nearest integer? 3 What is the cube root of 95262 to the nearest integer? 46 What is the eighth root of 26298 to the nearest integer? 4 What is the cube root of 587 to the nearest integer? 8 What is the fifth root of 37331 to the nearest integer? 8 What is the ninth root of 4856 to the nearest integer? 3 What is 2186 to the power of 1/2, to the nearest integer? 47 What is 11825 to the power of 1/2, to the nearest integer? 109 What is the third root of 16278 to the nearest integer? 25 What is the square root of 6141 to the nearest integer? 78 What is the cube root of 7282 to the nearest integer? 19 What is the square root of 7258 to the nearest integer? 85 What is 1471 to the power of 1/5, to the nearest integer? 4 What is the fourth root of 15375 to the nearest integer? 11 What is 91232 to the power of 1/4, to the nearest integer? 17 What is the cube root of 1530 to the nearest integer? 12 What is the tenth root of 2579 to the nearest integer? 2 What is the third root of 2271 to the nearest integer? 13 What is 1754 to the power of 1/3, to the nearest integer? 12 What is the fifth root of 6123 to the nearest integer? 6 What is the third root of 3783 to the nearest integer? 16 What is the square root of 87949 to the nearest integer? 297 What is the cube root of 2083 to the nearest integer? 13 What is the cube root of 669 to the nearest integer? 9 What is 5231 to the power of 1/2, to the nearest integer? 72 What is the square root of 348 to the nearest integer? 19 What is the eighth root of 15245 to the nearest integer? 3 What is the ninth root of 1258 to the nearest integer? 2 What is 94645 to the power of 1/8, to the nearest integer? 4 What is the cube root of 396 to the nearest integer? 7 What is 438 to the power of 1/2, to the nearest integer? 21 What is 19597 to the power of 1/8, to the nearest integer? 3 What is the ninth root of 67925 to the nearest integer? 3 What is the tenth root of 2410 to the nearest integer? 2 What is 1214 to the power of 1/3, to the nearest integer? 11 What is the third root of 1321 to the nearest integer? 11 What is the seventh root of 109127 to the nearest integer? 5 What is 14965 to the power of 1/3, to the nearest integer? 25 What is the tenth root of 2222 to the nearest integer? 2 What is 2190 to the power of 1/3, to the nearest integer? 13 What is the square root of 53783 to the nearest integer? 232 What is the third root of 3905 to the nearest integer? 16 What is the square root of 3415 to the nearest integer? 58 What is the seventh root of 8507 to the nearest integer? 4 What is the square root of 1603 to the nearest integer? 40 What is 5442 to the power of 1/2, to the nearest integer? 74 What is the cube root of 4132 to the nearest integer? 16 What is the third root of 301 to the nearest integer? 7 What is the seventh root of 24889 to the nearest integer? 4 What is 1746 to the power of 1/7, to the nearest integer? 3 What is 3714 to the power of 1/3, to the nearest integer? 15 What is the square root of 25789 to the nearest integer? 161 What is the third root of 11081 to the nearest integer? 22 What is the sixth root of 513 to the nearest integer? 3 What is 2170 to the power of 1/8, to the nearest integer? 3 What is 22713 to the power of 1/2, to the nearest integer? 151 What is 6606 to the power of 1/2, to the nearest integer? 81 What is the cube root of 1794 to the nearest integer? 12 What is the ninth root of 2547 to the nearest integer? 2 What is 13923 to the power of 1/4, to the nearest integer? 11 What is 100057 to the power of 1/2, to the nearest integer? 316 What is the eighth root of 11564 to the nearest integer? 3 What is the cu	{ "pile_set_name": "DM Mathematics" }
dps? 0.001 Let r = 66 + -7. Let t = -59.0000137 + r. What is t rounded to six dps? -0.000014 Let n(c) = -c*3 - 9c*2 + 10c - 2. Let v be n(-10). Let f be (v - (-1 + 213499))(-120)/14. What is f rounded to the nearest one hundred thousand? 1800000 Let n = -929260 + 929259.9030006. Let x = -0.097 - n. What is x rounded to 6 dps? -0.000001 Suppose 0 = -2m - 16511 + 4011. Let n be (m/3)/(3/16560). What is n rounded to the nearest 1000000? -12000000 Let r = 308.1 - 308.00892. What is r rounded to 2 dps? 0.09 Let y = 6007396 + -17841396. Round y to the nearest one hundred thousand. -11800000 Let w be 9/(-54) + 6862/(-12). Let k be (-1)/(-1 + w/(-570)). Let z = k - -855. Round z to the nearest one hundred. 600 Let n = -153.7 - -138. Let t = n + -0.3. Let q = t - -15.99999967. Round q to seven dps. -0.0000003 Let p = -1419 - -1419.2246. Round p to 2 dps. 0.22 Let k = 411.00001668 + -411. Round k to 7 dps. 0.0000167 Suppose 15 = 3i + 2i. Let p = -36 + 38. Suppose 1957352 = -iq + 4m + 67356, -3q + pm = 1889998. Round q to the nearest one hundred thousand. -600000 Let t = 14.4 - -62.6. Let f = t + -76.34. What is f rounded to 1 decimal place? 0.7 Let p = 1209 + -1208.999996156. Round p to seven dps. 0.0000038 Let i = -1750 - -1759.12. Let g = 22 + -13. Let x = g - i. Round x to 2 decimal places. -0.12 Let k = 4747.5 - 4727.613. Let c = -0.213 - k. Round c to the nearest integer. -20 Let u(c) = -4848c2 - 36c + 74. Let h be u(2). What is h rounded to the nearest one thousand? -19000 Let x = -9.7 + 9. Let o = x - -0.718. Round o to two dps. 0.02 Let n = 1358 + -1229.8. Round n to the nearest ten. 130 Let i be -3 - (1 - (-14 + 4)). Let x be (-304)/i + (-6)/(-21). Let k = x + -26. Round k to the nearest 10. 0 Let v = -152684 - -681684. Round v to the nearest 10000. 530000 Suppose 3v - 82666689 = 17233419. Suppose -2k - v = -5k. Suppose 0 = p - 4f + k, 3f + 0f = -4p - 44399991. Round p to the nearest 1000000. -11000000 Let t(i) = -425i*2 - 1. Let b be t(-1). Suppose 638 + 272 = 35y. Let v = y + b. What is v rounded to the nearest one thousand? 0 Let k = 19.1 - 19.10000048. What is k rounded to seven decimal places? -0.0000005 Let r(p) = -p*3 - 9p*2 + p + 1. Let i be r(-9). Let k be (-12)/i - (-8484)/8. Suppose -u - 38 = k. What is u rounded to the nearest one thousand? -1000 Let v = -7564 + 7153.11. Let g = v - -409. What is g rounded to one decimal place? -1.9 Let s = 1.2 - 1.32. Let a = 0.11976 + s. What is a rounded to 4 decimal places? -0.0002 Suppose z + 27808 + 1664 = 0. Let p = z - -60272. What is p rounded to the nearest 1000? 31000 Let z = 110 - 110. Let x = z - -0.025. Round x to 2 decimal places. 0.03 Let i = -0.028 + 22.028. Let v = i - 23.42. Let h = -0.64 - v. Round h to 1 dp. 0.8 Let n = -6.822 + 0.022. Let o = n + -35.2. Let k = -41.9999963 - o. What is k rounded to 6 decimal places? 0.000004 Let x = -1.78 + 1.13. What is x rounded to the nearest integer? -1 Let v = 8244993.00181 - 8244869. Let k = v - 124. What is k rounded to 4 dps? 0.0018 Let q = 0.0065544 + -0.007. What is q rounded to 5 dps? -0.00045 Let j = -5647.51 - -5752. Let z = 105 - j. What is z rounded to 1 dp? 0.5 Let w = 23 - 55. Let r = 32.0000012 + w. What is r rounded to six decimal places? 0.000001 Let z(v) = -v - 2. Let o be z(-2). Suppose 4d = 0, 5a + 49524575 = -od - d. Let t = -6204915 - a. What is t rounded to the nearest one million? 4000000 Let b = 307358.5099 - 307338. Let t = 20.482 + 0.018. Let o = b - t. Round o to three decimal places. 0.01 Let d = 11.9361271 - 67.9361561. Let t = -0.86 + -55.14. Let c = t - d. What is c rounded to five dps? 0.00003 Let j = 2422426 - 2422431.019759. Let z = 5.02 + j. What is z rounded to four decimal places? 0.0002 Let n = 18.1 + -18.100566. What is n rounded to 4 decimal places? -0.0006 Let a = 81.135 + 396.275. Let o = a - 671.3. Let p = 196 + o. What is p rounded to one dp? 2.1 Suppose 2p + 5m - 3m - 5558926 = 0, -p = -m - 2779471. Suppose -p = -6s + 11680533. What is s rounded to the nearest one hundred thousand? 2400000 Let k = -9.5 - -9.50000111. Round k to 7 decimal places. 0.0000011 Let j = -520.0181 + 520. Round j to 3 dps. -0.018 Let z = -2.8 + 0.56. Let o = 49 - 46.9. Let y = z + o. What is y rounded to 1 dp? -0.1 Let d be ((2 - -16) + -9)(-520)/(-6). What is d rounded to the nearest 100? 800 Let b = -1.2 - 1.8. Let u = -14 - b. Let q = -11.72 - u. Round q to one decimal place. -0.7 Let k = 0.185 - 4.945. Let i = k - -3.5. Let w = i + 0.04. What is w rounded to 1 decimal place? -1.2 Let g = -16 + 28. Let m = g + -12.14. Let f = m + 0.78. Round f to 1 dp. 0.6 Let b = 3.0369 - 2.95. What is b rounded to two decimal places? 0.09 Let h = 1 - -5. Let q = h - 4. Suppose 0y = -z + qy + 1900006, -2z - 5y = -3799985. What is z rounded to the nearest one million? 2000000 Let b = 1415 + -1414.98742. Round b to 3 dps. 0.013 Let v = -270.2 + 297. What is v rounded to the nearest integer? 27 Let b(x) = -4896x*2 - 4x - 88. Let u be b(34). What is u rounded to the nearest one million? -6000000 Let p = -72 + 67.44. Let y = 4.8 + p. Round y to 1 dp. 0.2 Suppose 0 = -2o + 4o - 39875646. Suppose 2p + o + 1062177 = 0. Round p to the nearest one million. -11000000 Let o = 746 + -745.9999391. Round o to 5 decimal places. 0.00006 Let j = 95.6 - 95.60904. Round j to four dps. -0.009 Let u = 228 + -227.9598. What is u rounded to two decimal places? 0.04 Suppose -7w + 4 = -5w. Let a be (1/(-3))/(w/12). Let o(x) = 4400x. Let s be o(a). Round s to the nearest one thousand. -9000 Let t = 44 - 43.13. Round t to 1 dp. 0.9 Let u = 23.046 + -0.046. Let m = -22.91 + u. Let w = m + -0.08993. Round w to five decimal places. 0.00007 Let y = 36333.8648 - 36288.8921894. Let o = -53.027373 - y. Let l = o + 98. What is l rounded to six dps? 0.000016 Let l = 13.2833 + 0.0767. What is l rounded to the nearest integer? 13 Let a = -1.252 - -1.53. Let k = a - 0.09. Let y = -0.188157 + k. What is y rounded to five dps? -0.00016 Let p = -15296 - -15622.624. Let x = p - 0.624. Let i = x + -325.9999797. Round i to 6 dps. 0.00002 Let m = -7432.00004269 - -7432. What is m rounded to six dps? -0.000043 Let o = -22 - 4. Let v = 18 + o. Let m = -8.15 - v. Round m to two dps. -0.15 Let t = -644242 + 644240.118223. Let y = t - -79.883327. Let l = 78 - y. Round l to 4 decimal places. -0.0016 Let w = -28.75 - -1.75. Let v = 1549362681 + -1549362654.00000083. Let d = v + w. Round d to seven decimal places. -0.0000008 Let k = 1.2662 - 121.2862. What is k rounded to the nearest 10? -120 Let a = -60680.0166 + 60711. Let q = a + -31. What is q rounded to three dps? -0.017 Let n = -6.1299396 + 6.13. What is n rounded to 5 decimal places? 0.00006 Let a be (-2)/9 + 98824/99. Suppose a + 902 = -f. What is f rounded to the nearest one thousand? -2000 Let g = 8.793 - -1.737. What is g rounded to the nearest integer? 11 Let p = 244 + -245.6. What is p rounded to the nearest ten? 0 Let x = -17955461.3383688 - -18554931.63837. Let d = -599470 + x. Let h = -0.3 + d. Round h to 6 dps. 0.000001 Let t = -152.89309 - -152.9. What is t rounded to 4 decimal places? 0.0069 Let c(g) = 22g - 296. Let b be c(-9). Round b to the nearest 10. -490 Let z = 1232.35 - 1195. Round z to the nearest 10. 40 Let o = -2167 - -2167.01427. What is o rounded to two decimal places? 0.01 Let l(t) = -t2 - 10t + 16. Let s be l(-11). Suppose 0 = -k - 0k + 4p + 570, 4k - sp - 2225 = 0. What is k rounded to the nearest one hundred? 600 Let y = 39.77 - 40. Let g = 0.2300113 + y. Round g to six decimal places. 0.000011 Let i = 35 + -52. Let b = i + 20. Suppose 4x - c = -21600002, 8088178 + 8111820 = -bx - c. Round x to the nearest 1000000. -5000000 Let y = 9669 - 27799. What is y rounded to the nearest one hundred? -18100 Suppose -40 + 1 = -3u. Let h = 18 - u. Suppose -hr + 3d + d = 26499984, r - 4d + 5299984 = 0. Round r to the nearest one million. -5000000 Suppose -76 = 8z - 100. Suppose 4q - 10 = -q. Suppose 0 = 2r - 4, 70004 = qk + zr - r. What is k rounded to the nearest 10000? 40000 Suppose 0 = 2w + 2j + 2968796, 11w = 9*w - j - 2968798. What is w rounded to the nearest one hundred thousand? -1500000 Let b = 2685.9 + -2580. Let d = b - 111. What	{ "pile_set_name": "DM Mathematics" }
+ 2i wrt i? 106ak + 2a - 102k + 4 What is the first derivative of 8o*2v*2z - 2o2z + 271ov*2 + 1892v*2z - vz wrt o? 16ov2z - 4oz + 271v2 What is the third derivative of -8018i*3 + 1631i*2 + i wrt i? -48108 Differentiate -717uv2z - uv + 18uz + 19u - 2v2z + 2 wrt v. -1434uvz - u - 4vz What is the second derivative of 501h*2u*2 + 806h*2u - 2hu - 2u3 wrt u? 1002h*2 - 12u Find the second derivative of ns4 + 33n - 210s5 - 12s wrt s. 12ns*2 - 4200s*3 What is the third derivative of -9s*4 - 7s*3 + 1014s*2 - 2 wrt s? -216s - 42 Find the third derivative of 25n3w + 6n2 + nw + 3 wrt n. 150w Find the third derivative of 17tw4 - 5tw - 3w*4 - 226w*2 - w + 1 wrt w. 408tw - 72w What is the third derivative of -4466n4 - 65n*2 - 12n wrt n? -107184n Find the third derivative of -16l*5 + 25l*2 + 2. -960l*2 Find the second derivative of -9b*4 + 16b*2u + 9bu - 38u wrt b. -108b*2 + 32u Find the second derivative of -91x5 + 2x*3 + 5x + 5 wrt x. -1820x3 + 12x What is the second derivative of -1703k2s + 7ks - k + s + 7 wrt k? -3406s Find the second derivative of -261j*5 - 9j - 6. -5220j3 Find the second derivative of 268s*3t*2 + 2s*2t*3 - 4st2 + 12t*3 + 4 wrt s. 1608st2 + 4t*3 Find the second derivative of 2h*3p - 190h2p - 11hp + 2h + 4 wrt h. 12hp - 380p Find the second derivative of -9j2ku2 - j2ku - 111j*2u*2 + 4jku - 113u wrt u. -18j*2k - 222j2 Differentiate 14t*4w + 10t3w*3 + 14w*3 - 4 wrt t. 56t*3w + 30t2w*3 What is the third derivative of 3290j*6 + 6j*2 + 82 wrt j? 394800j*3 Differentiate 2p*2s + 2ps + 479s with respect to p. 4ps + 2s Find the second derivative of 97j5 + 7j*3 + 669j wrt j. 1940j3 + 42j What is the first derivative of -2071o3 + 12873 wrt o? -6213o*2 Find the second derivative of -4f*3 - 161f*2 - f + 613 wrt f. -24f - 322 Find the second derivative of -17jv*2w + 5jvw + 37j + 28v2w + v*2 - 2v - 2 wrt v. -34jw + 56w + 2 What is the second derivative of 3d*3l + 15d2l*2 - dl*2 - 35l*2 wrt d? 18dl + 30l2 Differentiate i2no*2 + 1272i*2n - io3 + 57no3 + 2no + n + 22o wrt i. 2ino2 + 2544in - o3 What is the first derivative of 173it2u*2 + 6iu2 - 3t*2 - 2t - 617u2 wrt i? 173t*2u*2 + 6u*2 What is the second derivative of -991z*3 + 724z? -5946z Find the first derivative of -2327a*2 + 2a - 6612 wrt a. -4654a + 2 What is the second derivative of 40i*4 + 308i? 480i2 What is the second derivative of 3a*2m - 308a2 + 4am + a + m - 2 wrt a? 6m - 616 Find the third derivative of 8d3j*2p + 3d3j + 7d3p + 2d2j*2p - 13d2 + 10dj2 wrt d. 48j*2p + 18j + 42p What is the derivative of 1205g2 - 756 wrt g? 2410g What is the second derivative of 517v4 + 5v*3 - 1040v - 2? 6204v2 + 30v Find the first derivative of 182i3m*2 + 3i*3 - 145i*2 - 48im4 wrt m. 364i*3m - 192im3 What is the first derivative of -b3i2 + 3b*3ip - 387b*3 - 77i*2p wrt p? 3b3i - 77i2 What is the first derivative of -46v*2x*2 + 4v*2x - 2x2 + 4x wrt v? -92vx*2 + 8vx Find the first derivative of 4gs2w - gs - 11gw - 4s*2 - sw - 4w wrt s. 8gsw - g - 8s - w What is the second derivative of b3d*2gp + b3dp2 - 2b*3p - 37b2d*2p*2 + bdg - 2bdp*2 + d wrt d? 2b*3gp - 74b*2p*2 Differentiate -2613mv + 2763m wrt v. -2613m What is the second derivative of -2u*5x + 22u3x - 31u2x + 88u - 15x wrt u? -40u3x + 132ux - 62x Find the second derivative of -2a*3j*2 + 3a*3p + 2a3 + 32a*2j2 + a2j + 3aj2p wrt j. -4a3 + 64a*2 + 6ap What is the second derivative of 1814d*2 - 12637d? 3628 What is the second derivative of 31n4x3 + n4 - nx2 - 50x*3 wrt n? 372n*2x*3 + 12n2 Find the second derivative of g4 - 12g3tz + 32g*2tz + 1378gtz - 4t wrt g. 12g*2 - 72gtz + 64tz Differentiate 2gp*3 - 725gpz*2 + 2p*3 + 8p*2 + 7z*2 with respect to g. 2p*3 - 725pz2 What is the third derivative of 4962f*4 + 1169f*2? 119088f Find the second derivative of 920h4 + 761h. 11040h2 What is the second derivative of 2g*3t*3 + 7g*2t*3 + 8g*2t + 7gt2 + t3 wrt g? 12gt*3 + 14t*3 + 16t What is the first derivative of -4pr*2 + 2pr - 609p - 8r2 - 3r wrt r? -8pr + 2p - 16r - 3 Find the third derivative of -450p3r*3 + 39p*3r*2 - 10r*2 wrt r. -2700p*3 What is the third derivative of 14488z4 - z3 - 57z2 + 13? 347712z - 6 Differentiate -14a3 - 3a*2 + 370. -42a*2 - 6a Find the third derivative of 40d3im3 + 3d*3im2 + 170d*3i - 2d3m*3 - 3d*3m*2 - 5im3 wrt m. 240d*3i - 12d3 - 30i Find the second derivative of 7g2m*2 - 6g*2m + g*2 - 273m*2 - 126m - 1 wrt m. 14g2 - 546 Find the third derivative of 849f*3 + 89f*2 - 2f. 5094 What is the derivative of -7w4y - 18w2y*2 + 8y*2 - 11y wrt w? -28w3y - 36wy*2 What is the first derivative of 24q*2 + 12q - 2867 wrt q? 48q + 12 What is the derivative of -863k*4 - 393 wrt k? -3452k*3 What is the third derivative of 2g*4y*2 - 23g*3y2 + g3 + g*2 - 235gy2 wrt g? 48gy2 - 138y*2 + 6 Find the second derivative of -24b*4 + 5b*2 - 295b. -288b2 + 10 What is the second derivative of -8472p*2 + 13941p? -16944 Differentiate -2d3v*2 - 499d*3 + 233v*3 wrt v. -4d*3v + 699v2 Differentiate -3f*3 - 1640f*2 + 1519 wrt f. -9f*2 - 3280f What is the third derivative of -o*5 - 167o*3 + 8o*2 + 4 wrt o? -60o*2 - 1002 Find the third derivative of -22fi2w*3 + 120fw3 - 5fw2 + 4fw - 2i*2w wrt w. -132fi*2 + 720f What is the third derivative of 17ghw3 + 7ghw + 10gw*3 - 7gw2 + h2w3 - h2 wrt w? 102gh + 60g + 6h*2 Find the second derivative of -40k*3 - 5k*2 + 10k + 12 wrt k. -240k - 10 Differentiate -5k*2w2 + k2 + 6kw*2 - 27 wrt w. -10k*2w + 12kw Find the second derivative of -190h2 - 2h - 22. -380 Find the second derivative of -87a2g*2i*2 + 2a*2t*3 + 3ai2t - 2ai*2 + 2g*2i*2t*3 - 2g*2it2 wrt a. -174g*2i*2 + 4t*3 Find the first derivative of -200a + 156. -200 What is the second derivative of 233x5 - 2x*4 + 465x? 4660x3 - 24x*2 What is the third derivative of 1561p*6 - 3p*2 + 220p wrt p? 187320p3 Find the second derivative of -l3m3 - l3m + l2m - 21lm3 - m3 + 92m wrt m. -6l*3m - 126lm - 6m What is the third derivative of 1312h*3l - 205h2 + hl wrt h? 7872l Find the second derivative of -o3 + 184o*2 + 567o. -6o + 368 What is the second derivative of -759j*5 + 5j*4u - 12ju - 71j wrt j? -15180j*3 + 60j*2u Find the first derivative of 1078fg*3o - 113fg*3 - fg wrt o. 1078fg*3 What is the first derivative of -4361x - 27737? -4361 What is the derivative of -151ir*3 + ir*2 + 2051ix3 - 2ix2 + 4r*2x*3 wrt r? -453ir2 + 2ir + 8rx3 Find the third derivative of -9wx5 + 91wx2y + 5x3y + 2x2 wrt x. -540wx2 + 30y Differentiate -544g2 + 210 wrt g. -1088g What is the third derivative of 4688d6 - 7d*2 - 19d - 6 wrt d? 562560d3 What is the derivative of 2194i*3r + 1300i3 + 3i*2q - qr wrt r? 2194i*3 - q Differentiate -5m*3r + m*2r - 4m2 + 257r with respect to m. -15m2r + 2mr - 8m Find the third derivative of -26uy4 + uy*3 + uy + 2y4 - 6y*3 + 2001y*2 wrt y. -624uy + 6u + 48y - 36 What is the third derivative of 65i6 - i5 - 10i4 - 2i*2 - 2i + 76? 7800i3 - 60i*2 - 240i Find the third derivative of -5647j6 + j3 + 7067j*2 wrt j. -677640j*3 + 6 Find the second derivative of 2bf5 + 201bf2 - 659bf - 2f*2 - 1 wrt f. 40bf3 + 402b - 4 What is the derivative of 109i2w*2 + 101i*2 - 2iw3 wrt w? 218i*2w - 6iw**2 What	{ "pile_set_name": "DM Mathematics" }
x + fk and give b. -9744 Rearrange -23z - 110z2 + 103z*2 + 13z + 6z - 326z*2 to hz + l + nz2 and give l. 0 Rearrange (-487l + 487l - 444l*2)(1 - 8 + 1) + l*2 + 0l*2 + 0l*2 to sl*2 + j + ul and give s. 2665 Rearrange (-o + 4o - o)(1 - 5 + 2) + o - 184 + 184 + (-1 - 3 + 1)(-8o - 9o - 10o) to s + ro and give r. 78 Rearrange 2d*2 + 406d - 2d2 + d2 - 27 + d2 - 405d + 3d3 - d4 to the form sd*2 + id + u + zd4 + wd*3 and give s. 2 Rearrange -2997643g + g*3 - 146g*4 + 2997643g - 29 - g*2 to the form rg*3 + kg*2 + q + pg + wg4 and give q. -29 Express z2 + 1 + 47z*3 - 62z*4 - 204z + 206z - 45z*3 as kz*4 + wz*2 + y + sz + mz3 and give m. 2 Express -4 + 1179u - 15 - 2375u + 1181u - 9 in the form hu + o and give o. -28 Rearrange (6839h - 3386h - 3455h + 11698)(-3 - 2 + 3) to xh + g and give x. 4 Express y2 - y2 - 3y4 + (-540 + 540 - 78y*2)(-41y2 - 250y + 250y) in the form oy*3 + gy*2 + z + xy + sy4 and give s. 3195 Express (-2 - 2k*2 + 2)(-5 - 2 + 4) - 286k2 - 556 + 293k*2 + 556 - 135k as f + wk2 + tk and give w. 13 Rearrange (-5 + 5 - 6n)(0 - 1 + 4)(390n - 101 + 101) to mn2 + u + fn and give m. -7020 Rearrange 2385d + 863d + 3901d + 3708d + 5d - 3d - d - d - 4 + 4 + (-2 + 0 + 4)(2d - 5d + 5d) to n + id and give n. 0 Rearrange -41 + 878m*2 + 176 - 134 to d + vm + km2 and give d. 1 Rearrange 67 + 44j*2 + 5 - 15j*2 + 86 - 73 to the form sj + wj2 + h and give w. 29 Express -2863h - 1 + 4h2 + 87h*3 + 1 + 2860h as lh2 + n + jh + wh3 and give j. -3 Rearrange (-215o*4 - 141o*4 - 309o*4)(0 - 3 + 1) to vo2 + co*4 + jo*3 + f + ho and give c. 1330 Express (-5a3 + 0a*3 - 33a*3)(-4 - 1 + 4) + 2a3 + 0a*3 - 4a*3 in the form ya*2 + ca + za3 + t and give c. 0 Express -6657p + 2p3 - p3 + p2 + 3244p + 3937p as ap + r + sp2 + fp*3 and give s. 1 Express -2 - 23z*3 + 212z*2 - 216z*2 + 10z*3 as r + tz*2 + vz*3 + xz and give x. 0 Rearrange 26750 - 26750 - 1299g to the form lg + i and give l. -1299 Express (-2l + 5l - l)(1 + l - 1 + (0 - 1 - 1)(l + 4l - 3l))(-33729 - 62l + 33679 - 15l) as pl + dl3 + cl*2 + s and give d. 462 Rearrange (-4l + 5l - 3l - 2)(2 - 3 + 24) - 22l + 18l + 9l - 4l + 6l + 0l + (-7 + 6 + 0)(2 - l - 2) to the form pl + t and give t. -46 Express -12439 + 1009l - 3811l + 6224 + 6215 in the form al + k and give k. 0 Express -39q + 6091 + 3q + 4q + 29q + 2q in the form sq + z and give z. 6091 Express 86f - 17 + 61f - 174f in the form bf + w and give w. -17 Express (-92h3 + 53h*3 + 51h*3)(h + h + 0h)(0 - 2 + 3) as ih2 + uh*4 + n + mh*3 + gh and give u. 24 Rearrange (-159r2 - 191r*2 + 62r*2)(-4 + 1 + 4)(-35 - 10 - 4) to the form zr*2 + y + gr and give z. 14112 Rearrange -3s3 + 3s*2 - 617s + 636s - 26 - 5s*2 + 2s*4 to the form cs*3 + ls + ws2 + is*4 + h and give l. 19 Express 5479 - 5479 + 3l - 1788l2 + 346l*2 as kl + v + nl2 and give n. -1442 Rearrange -48 - 1466p + 26 + 23 + 642p - 2253p to l + hp and give l. 1 Rearrange 2 - 289u*4 - 212u*4 - 3u + 2u2 + 87u*4 to gu*2 + du + zu4 + s + cu*3 and give d. -3 Express (-2y*3 - 6y - 20689 + 4y + 21401)(3 - 1 - 4) as ny3 + fy*2 + k + uy and give u. 4 Express -9i + 24 - 11i + 1 + i - 5 as yi + b and give b. 20 Rearrange (-99b*2 - 123b*2 + 170b*2)(84 + 16 - 45) to the form fb2 + pb + w and give f. -2860 Express (61600 - 61600 - 119p)(4p - 4p + 3p)(4p + 5p - 2p) as tp*3 + vp*2 + l + zp and give t. -2499 Rearrange (-136s2 - 2s*2 + 960s*2)(38 + 12s - 38) to the form bs + u + ws2 + rs*3 and give r. 9864 Rearrange 8w*2 - 7w*2 - 314w + 116w - 139w to the form f + zw2 + vw and give v. -337 Express (-w + 5w - w)(-4199w2 - 317w*2 + 7663w*2) in the form m + nw*3 + bw*2 + uw and give m. 0 Rearrange (13 + 13 - 37)(-6u + 5u + 2u)(9u + 7u - 6u)((4 - 5 + 4)(-4 + 5 - 3) - 3 + 3 - 1) to cu2 + gu + p and give c. 770 Rearrange 637 + 375 + 3r - 4r + 111 to hr + w and give w. 1123 Express 482 + 469 - 9w*4 + 466 + 62w3 - 1419 + w2 in the form k + qw4 + dw*3 + tw*2 + xw and give q. -9 Express 1595607q3 - q - 1593740q*3 + 0q in the form iq3 + k + bq*2 + fq and give i. 1867 Rearrange (0 + 8 + 0)(n3 + 3n*3 - 3n*3) + (-n + 0 - 9 + 14)(n - n*2 - n) + 2n*3 - 34n*3 + 5n*3 to l + jn*2 + mn + gn3 and give j. -5 Express 1278z + 2050z - 117z + 2148z + 398z in the form r + fz and give f. 5757 Rearrange -106p + 35079 - 94p2 - 35079 to tp + r + wp2 and give w. -94 Rearrange 246 - 55 + 255 + 22493y - 22500y - 40 to the form h + qy and give q. -7 Express -4272n + 7562974 - 7562974 in the form vn + l and give l. 0 Express (-43r + 17r + 3 + 25r)(-1 + 6 - 3)(10 - 1 + 0) as k + hr and give k. 54 Rearrange (-895y - 3659y - 929y)(4 - 1 - 1) to the form xy + n and give x. -10966 Rearrange 1771n + 3038n + 2788n - 639n + 1299n to t + in and give i. 8257 Express -207 - f + 103 + 107 - 2f*2 in the form gf*2 + z + yf and give g. -2 Rearrange 270936v + 19 - 43v*4 + 41v*4 + 2v*2 - 13v*3 - 270939v to the form wv2 + uv + d + xv3 + hv*4 and give h. -2 Express (1093 - 28w*2 - 1093)(26w2 - 95w - 7w2 - 17w*2)(1 + 0 - 3) as ow2 + b + pw*3 + rw*4 + kw and give r. 112 Rearrange 2 - 2v2 + 86v*3 - 5v*2 - 90v*3 to cv*2 + fv + i + zv3 and give z. -4 Express 278z - 278z + 3654z*2 + 1048z*2 + 1970z*2 as uz + lz2 + q and give l. 6672 Rearrange 16x + 24x - 6x + 3 + 317 to the form c + mx and give m. 34 Rearrange (803d - 23857d - 41938d)(1 + 1 + 0) to id + k and give i. -129984 Express -105d4 - 2d + 29d3 + 293d*4 - 32d*3 + d as md*2 + q + yd*4 + cd*3 + nd and give c. -3 Express -1 + 3069p + 26 + 2193p - 25 in the form u + lp and give l. 5262 Rearrange 10342h - 3672h - 506283 + 506283 to mh + u and give m. 6670 Rearrange -302q2 + 5 - q + 3q + 144q2 + 157q*2 - 189q*3 to h + kq*2 + sq + cq3 and give c. -189 Express -120k - 146k + 139k + 2 as s + vk and give s. 2 Rearrange -36s*3 + 52s*3 - 239s*3 - 18s*3 - 6s*2 to f + zs + ms2 + vs*3 and give m. -6 Express 33k - 1150k4 + 71 - 64 - 97k - 376k - k2 + 1149k*4 as ik*3 + c + lk*4 + rk + pk2 and give p. -1 Express 93z + 33z + 120z - 46 + 55 as u + gz and give g. 246 Rearrange -98z + 18414 + 18429 + z2 - 36845 + z3 to the form dz + az*3 + g + wz*2 and give a. 1 Rearrange -53504a*3 - 6 + 53503a*3 - 3a*2 - 852a + 851a to the form w + pa + oa2 + ua*3 and give p. -1 Express (83 + 38 + 44)(0 - 15w + 0 + 2w + 0 + 0 - w + 2w + 0w + (-1 + 1 - 1)(0w - 2w + 0w)) in the form b + hw and give h. -1650 Rearrange (-15h - 19h + 13h)(2h - 2h - h) + (-10h*2 + 0h*2 - 23h*2)(2 + 1 - 4) - h2 + h2 - 2h2 to the form nh + b + yh2 and give y. 52 Rearrange 46 + 33v*2 + 58v*2 - 80v*2 + 0v*3 + 14 + 2v*3 to o + xv*3 + hv*2 + jv and give h. 11 Rearrange (-4o2 + 78o - 78o + (0o + 0o - 2o)(3o - 2o - 2o))(-496o + 1002o + 1277o*2 - 506o) to mo4 + co*3 + so + ro2 + x and give m. -2554 Express i + 6i*3 + 5i*2 - 5i*3 + 9i*4 - 17i*2 + i + 1 + 14i*2 in the form ri + ti3 + oi*2 + y + li*4 and give l. 9 Express -3k + 2 + 5k + 6k*2 - 7k*3 + 8k - 12k + 5k*3 as jk*3 + zk*2 + o + fk and give f. -2 Rearrange 3793o3 + o - 256o*2 - 2o*4 + 708o*2 - 228o*2 - 226o*2 to the form no*3 + lo*4 + ho*2 + w + do and give h. -2 Rearrange -6r - r + 3r + (4r + r - 4r)(5 - 2 - 2) + 2r - 5r - 7r + (-3 + 3 + 2r)(5 - 1 - 2)(-394 + 964 - 262) to c + ar and give a. 1219 Express -2 - 380t - 4t*3 + 10525937t*2 - 10525937t*2 in the form ut + qt3 + b + at*2 and give u. -380 Rearrange -12j - 1220 + 1222 - 8j + (3 + 5 - 2)(4j - 3j - 2j) to yj + l and give l. 2 Express -47p2 + 19p*2 + p - 18p - 112p2 + 5p as u + yp2 + fp and gi	{ "pile_set_name": "DM Mathematics" }
6 - -4)(-6)/8. Let n = 8 - l. Let j(f) = f2 + f. Let w(a) = -2a*2 + 2. What is nj(s) - w(s)? s*2 - s - 2 Let t(p) = -3p - 791. Let s(u) = -2u - 396. Give 7s(g) - 4t(g). -2g + 392 Let z(s) = -s*3 + 2s + 138. Let n(m) = -6m3 + 11m + 690. Determine 4n(t) - 22z(t). -2t3 - 276 Let k(i) = i + 2. Let q(z) = -4z - 12. Let y(w) = 4w + 10. Let u(s) = -2q(s) - 3y(s). Calculate 7k(f) + 2u(f). -f + 2 Suppose -s - 12 = -l, -131l - 4s + 33 = -126l. Let f(c) = -19c. Let z(y) = 77y - 1. Give lf(r) + 2z(r). -17r - 2 Suppose -4j + 0d = 3d + 11, 0 = 2j + 2d + 8. Let a(n) = 3n2 + n - 2. Let f be a(j). Let m(z) = 13z + 5. Let b(p) = -6p - 2. What is fm(k) + 5b(k)? -4k Let c(a) = 10a2 + 6a - 5. Let l(o) = -19o2 - 11o + 13. Give -11c(f) - 6l(f). 4f2 - 23 Let r(g) = -23 - g2 - g2 + 27 + 0g2. Let w(n) = n2 - 3. Let p(f) = -f*2 - 9f - 3. Let v be p(-9). What is vr(z) - 4w(z)? 2z2 Let p(u) = 10u*2 - 4u. Let m(f) = -f + 19f2 - 6f - 137 - 125 + 262. Let d = 0 - 7. What is dp(g) + 4m(g)? 6g2 Let s(i) be the second derivative of i4/12 - i3/3 - 2i. Let q(c) = -c. Suppose o - 4o + 3 = 0. What is os(n) - 2q(n)? n2 Let j(y) = 20y*3 + 5y - 50y3 + 4y + 21y3. Let s(d) = 4d*3 - 5d. What is 5j(u) + 9s(u)? -9u3 Let v(b) = -b2 - b - 1. Let c(o) = 2o*3 + 2o*2 + 2o + 73. What is c(s) + 2v(s)? 2s3 + 71 Let z(c) = -c3 + 4c2. Let d(j) = 183 - 5j*3 - 64 + 15j*2 - 63 - 56. Calculate -4d(h) + 15z(h). 5h*3 Let s(j) = -17j*3 - 4j*2 + 5j + 5. Let d(k) = 34k3 + 7k*2 - 9k - 10. Determine -4d(w) - 7s(w). -17w3 + w + 5 Let d(v) = 2v*2 + 3v + 4. Let c(b) = 131b + 0 + 123b - 1 - b*2 - 255b. Calculate 3c(o) + d(o). -o2 + 1 Let r(f) = 16f + 6. Let n(j) = -j + 1. Determine 3n(q) + r(q). 13q + 9 Let n(k) = 10k + 377. Let f(l) = 7l + 250. What is -7f(g) + 5n(g)? g + 135 Let k(c) = -c*3 + 3c*2 - 4c + 3. Let y(i) = 3i3 - 6i*2 + 7i - 5. Calculate 5k(p) + 3y(p). 4p3 - 3p2 + p Let r(a) = -a3 - a*2 - a. Let v(d) = -7d*3 - 3d*2 + 12d - 1. Calculate 3r(m) - v(m). 4m*3 - 15m + 1 Suppose 4j - 8 = 2j. Let a(r) = 5r2 + 4r + 5r3 + 2r*2 - jr*2. Suppose -19l + 16 + 60 = 0. Let m(w) = -w3 - w2 - w. Calculate lm(f) + a(f). f3 - f2 Let s(r) = r2 + r. Suppose 3 = -9q + 12. Let p = 3 - 1. Let i(n) = -3np - 1 - 6n + 2n + 3n + 0. Give qs(y) + i(y). -2y*2 - 1 Let i(a) = 13a*2 - 1. Let m(x) = 15x*2 - 1. Let r(n) = 7i(n) - 6m(n). Let v(o) = -2o*2 + 6. Give -3r(k) - v(k). -k*2 - 3 Let x(h) = -5h*2 + 2h. Let a(l) be the third derivative of 9l5/4 - 55l*4/24 - 3l*2. Let m be -1 + 12/(-2) - (-20 - -15). Determine ma(p) - 55x(p). 5p*2 Let u(v) = 16. Let i(d) = 2. Let l(p) = 30i(p) - 4u(p). Let y(g) = g + 9. Calculate 5l(a) + 2y(a). 2a - 2 Let z(j) = 8j3 + 2j - 1. Let f(d) be the first derivative of 2d4 + 3d*2/2 - d - 724. Determine -2f(l) + 3z(l). 8l*3 - 1 Let h(v) be the first derivative of 4v*3/3 + 2v*2 + 4v + 148. Let w(l) be the third derivative of l4/24 + l3/6 + 5l2. Calculate -h(f) + 4w(f). -4f2 Let i(r) = 19r - 8r + 9 + 2. Let w(z) = 4z + 4. Suppose 10 = 5g, 2t - 8g + 14 = -4g. Let l = 15 + -7. Give lw(p) + ti(p). -p - 1 Let u(q) = 2q3 - 4q*2 - 6q - 9. Let b(i) be the third derivative of i6/120 - i5/60 - i4/24 - i3/6 - 428i2 + 2i. Determine 6b(h) - u(h). 4h*3 - 2h*2 + 3 Let c(w) = -6w + 0w - w + 23 - 27. Let a(j) = -13j - 7. Give 6a(s) - 11c(s). -s + 2 Let y(q) = 6q + 5. Let o(j) = 4j + 3. Let x(g) = -10g2 + 6g - 4. Let b be x(1). Give bo(c) + 5y(c). -2c + 1 Let r(h) = h + 11. Let a(d) = -d. Calculate -4a(k) - r(k). 3k - 11 Let c(h) = 2h*2 + 15h + 4. Let m be c(-6). Let s(a) = -4a2 + 3a + 3. Let l(i) = i*2 - i - 1. Suppose 9 + 7 = -4n. Determine ml(j) + ns(j). 2j2 + 2j + 2 Let c be 9 - -1(-2 - -3)0. Let b(n) = 0n + c + 5n + 0n + 8n. Let x(s) = 7s + 5. Calculate 4b(h) - 7x(h). 3h + 1 Let u(f) = -4f2 - 7f - 7. Let n(x) be the third derivative of -x5/30 - x4/6 - 2x3/3 - 51x*2. What is 5n(v) - 3u(v)? 2v2 + v + 1 Let s be 39 + 0/(10/(-5)). Let t(m) = m2 + 2m + 2. Let h(b) = 5b*2 + 13b + 13. Give st(r) - 6h(r). 9r2 Let q(o) = 2160o*2 - 4o - 209. Let c(b) = 172799b2 - 322b - 16721. Let x(w) = -2c(w) + 161q(w). Let i(s) = -21s2 + 2. What is 207i(y) + 2x(y)? -23y*2 Suppose 5y = 4s + 308, -3s - 231 = -3y + 2y. Let g = 74 + s. Let a(c) = c*2 - 2c. Let z(f) = 0f + f2 + 0f - f. Give gz(q) + 2a(q). -q*2 - q Let q(g) = -6g*2 - 9g - 7. Let p(c) = -10c2 - 14c - 11. What is 5p(o) - 8q(o)? -2o2 + 2o + 1 Let k(v) = 3v3 - 3v*2 - 24v - 664. Let b(i) = -i3 + i2 + 9i + 221. Give -8b(h) - 3k(h). -h3 + h2 + 224 Let u(h) = 5h + 11. Let a(f) = -f*3 - 10f*2 + 15f - 11. Let q be a(-11). Let g be q/(-2)(18/(-10) - -1). Let l(w) = -w - 2. Determine gl(k) - 4u(k). 2k Let a(x) = 10x3 + 3x*2 - 14x - 8. Let c(l) = -l*2 + 3l2 - l2 - 2l + 3l*3 - 3 - 3l. Give 3a(n) - 8c(n). 6n3 + n2 - 2n Let g(y) = y*2 + 29y - 9. Let o(f) = 1. Calculate 2g(p) + 18o(p). 2p2 + 58p Let c(z) = -7z - 1. Let i(j) = -15j - 2. Suppose 4y - 4 = -2h + 204, y = 3. Suppose 0 = hw - 100w - 12. Determine wi(f) + 13c(f). -f - 1 Let a = 7 + -6. Let y(b) = -b - 1. Suppose 2h - 5h + 18 = 0. Let s(k) be the first derivative of 7k2/2 + 6k - 2. Give as(l) + hy(l). l Suppose 50 = r + 18. Let l = 29 - r. Let p(m) = m + 5. Let s(y) = -2y - 6. What is lp(u) - 2s(u)? u - 3 Let j(n) = 8n*3 + 3n. Let k(x) = 23x3 + 9x. Suppose -104 = -6h + 40. Suppose -20i + 24i - h = 0. Give ik(d) - 17j(d). 2d*3 + 3d Let q = 242 - 247. Let n(h) = -4h3 + h2 + 5h. Let k(i) be the third derivative of -i6/40 + i4/6 + 9i2. What is qk(y) + 4n(y)? -y3 + 4y2 Let b(x) = x3 - x*2 + x - 1. Let r(m) = -2m*3 + 3m*2 - 6m - 2. Calculate -4b(u) - r(u). -2u3 + u2 + 2u + 6 Let a(q) = 0 + 14q - 8 - 6. Let d = -117 - -100. Let s(i) = -5i + 5. Determine ds(l) - 6a(l). l - 1 Let z(a) = -5a*2 - 2a. Let k(w) = -3w2 - w. Suppose 0 = -72g + 73g - 5. What is gz(c) - 8k(c)? -c2 - 2c Let p(g) be the second derivative of -3g4/2 + 23g*3/6 - 17g*2/2 - 12g + 1. Let m(z) = -3z2 + 4z - 3. What is -34m(t) + 6p(t)? -6t2 + 2t Let q(j) = -1 + j*3 - 23j - 29j + 75j - 28j - 4. Let r(n) = -3n - 3. Determine -3q(y) + 5r(y). -3y3 Let y(n) = 5n*3 + 2n*2 - 3n - 1. Let p(w) = 4w3 + w2 - 2w. Let m(g) = -3p(g) + 2y(g). Let d(x) = -2x3 + x2 - 3. Determine -2d(o) + 3m(o). -2o3 + o2 Let w(t) = 2t - 9. Let j(q) be the second derivative of -q2/2 - 2q + 66. What is -36j(m) + 4w(m)? 8m Let x(p) be the second derivative of -5p*3/6 + 3p*2/2 + p - 2. Let q(a) = -8a + 1. Let b(f) = 4f. Let k(r) = -5b(r) - 3q(r). Calculate 3k(l) + 2x(l). 2l - 3 Let u(k) = -k*2. Let j(q) = -28q*2 + q - 2. What is j(c) - 6u(c)? -22c2 + c - 2 Let g = -16 + 20. Let t(x) be the third derivative of x5/60 + x4/24 - x3/2 + 6x*2. Let j(a) = 2a*2 + 3a - 8. Determine gj(r) - 11t(r). -3r2 + r + 1 Let b(m) = -5m - 98. Let u(k) = k + 1. What is -b(y) - 6u(y)? -y + 92 Let l(q) be the first derivative of -3q*2/2 - 4q - 11. Let h(z) = 24z + 33. Let m = -86 + 90. Calculate mh(s) + 33l(s). -3s Let d(q) = 16q - 29. Let g(l) = 3. Let y(t) = -t + 1. Let a(k) = g(k) + 3y(k). What is 11a(b) + 2d(b)? -b + 8 Let w(k) = 163k3 + 11k*2 - 24k - 13. Let c(a) = -82a3 - 5a*2 + 11a + 6. What is -13c(y) - 6w(y)? 88y3 - y2 + y Let r(t) = -6t*2 + 32t - 29. Let f(u) = 3u2 - 17u + 15. Let k(m) = 11f(m) + 6r(m). Let d(g) = g*2 - 2g + 4. Determine -5d(s) - 2k(s). s*2 - 2 Let l(s) = 18s*2 - 6s. Let v(d) = d*2 - d. Let q = -679 - -673. Determine qv(b) + l(b). 12b2 Suppose 0 = -2g - x - 2x + 13, 2g = 4x - 22. Let b be (1/3)/(g/((-6)/(-2))). Let l(t) = t - 5. Let r(j) = j - 1. What is bl(m) + 2r(m)? m + 3 Let c(v) = -78v*2 + 65v. Suppose 0 = 5p - 2303 + 2298. Let t(k) = k2 - k. Determine pc(s) + 65t(s). -13s	{ "pile_set_name": "DM Mathematics" }
et z be 2/j + 2/(-4). Let r(p) be the first derivative of 2p3/3 + p2/2 - 3. What is r(z)? 1 Let w(v) be the second derivative of v6/120 + v5/12 - v4/24 + v3 - 3v*2/2 + v. Let d(r) be the first derivative of w(r). Determine d(-5). 11 Let g = -1 + -1. Let s(u) = 2u*2 + 3u + 1. Let n be s(g). Let v(a) = 0a + a2 + 6a + 2 - na. Calculate v(-3). 2 Suppose 2q + 12 = -q + f, -5q - 4f - 20 = 0. Let j(z) = -z*3 - 3z*2 + 3z + 2. Give j(q). 6 Suppose -5z = 3t - 6t - 57, 0 = -4z - 5t + 16. Let p(n) = n3 - 10n*2 + 10n - 4. Calculate p(z). 5 Let j = 5 + 2. Let a(c) = 7 - j - 3 + c. Let w = 0 - -5. What is a(w)? 2 Let k(j) = -j. Let h = -13 - -5. Determine k(h). 8 Let n(j) = j*3 - 4j*2 - 5j - 3. Suppose -3w - 23 = -4i, -6w = 3i - 2w - 11. Calculate n(i). -3 Let r(i) = -9i + 3. Let t(w) = -3w + 1. Let h(f) = 4r(f) - 11t(f). Give h(-1). 4 Let w(r) = 3r*3 + 13r2 - r - 13. Let g(m) = m3 + 6m2 - m - 6. Let y(i) = -5g(i) + 2w(i). Let d be (4/2)/(6/9). What is y(d)? 4 Let s(w) = 1. Let a(o) = o + 1. Let y(f) = -6a(f) + 5s(f). Calculate y(1). -7 Let k = -7 + 8. Let b be 1/(3/k - 4). Let i(c) = 1 - c2 + 2c - c*2 - 3c2. Give i(b). -6 Let u(o) = -o2 + 4o + 7. Let f be u(5). Let w(z) = z + 2. Let v be w(-5). Let d(i) = 2i. Let k(b) = 6b - 1. Let h(n) = vk(n) + 8d(n). Calculate h(f). -1 Suppose 2o - 14 = -2x, -x - 6 = -5o + 11. Let a(z) = xz3 + 0z3 + z2 - z*3 + 0z3. Determine a(-1). -1 Let y(t) = -t2 + 5t. Let n be y(3). Let o = n + -2. Let c(b) = b2 - 3b - 2. Calculate c(o). 2 Let j be 68/18 + (-6)/(-27). Suppose jt + 8 = 5s - 3, -t + s - 2 = 0. Let h(c) = 5c3 + 2c - 1. Give h(t). 6 Let m be 2(-1)/2 + 7. Let n(z) = z3 + 4z*2 + 5z - 3. Let u(t) = -2t3 - 3t*2 - 6t + 2. Let j(f) = 3n(f) + 2u(f). Determine j(m). 13 Let s(q) = -4q2 - 13q - 2. Let g(c) = 3c2 + 9c + 1. Let b(o) = -7g(o) - 5s(o). Give b(4). -5 Let q(f) = -f*3 - 5f*2 - f + 1. Let l(x) = -x + 9. Let g be l(5). Let b be (-18)/g - 1/2. Give q(b). 6 Let z be 18/5 + (-6)/(-15). Let d(m) = -2m*2 + 3m - 3. Determine d(z). -23 Let n(o) = -o*3 - 4o*2 + 5o - 5. Suppose 4j + 2 = -2b + 4b, -3b - j - 18 = 0. Give n(b). -5 Let x(f) be the third derivative of f6/180 - f5/60 - f*4/6 + 3f*2. Let g(y) be the second derivative of x(y). Determine g(2). 6 Suppose -2r = -2y - 4 + 2, -1 = -2y + 3r. Let h(c) = 0c - 4c + 5c. Calculate h(y). -4 Let j(p) = -4p - 4. Let m(s) = s + 1. Let n(z) = -6j(z) - 22m(z). Determine n(2). 6 Let w(h) be the first derivative of h3/3 + 2h*2 - 4h + 37. Give w(-5). 1 Let h(v) = -2v2 + 1. Let c(r) = -r + 2. Let j(m) = m - 2. Let o(n) = 6c(n) + 7j(n). Let b be o(5). Suppose 4k + 2 = bk. Calculate h(k). -7 Let w(d) be the second derivative of d3/6 - d2 - 11d. Calculate w(7). 5 Suppose 4u - 15 = -35. Let k(y) = y2 + 6y + 6. Give k(u). 1 Let r = -33 + 29. Let c(t) = -t + 3. Let u(q) = -3q + 7. Let j(o) = 5c(o) - 2u(o). What is j(r)? -3 Let a(u) = -u - 8. Suppose 0 = 4l + 2b - 46, -l - 3b - b + 29 = 0. Let v be ((-8)/(-3))/((-3)/l). Let f be a(v). Let z(i) = -i + 7. What is z(f)? 7 Suppose -5 + 1 = -4x. Let u(q) be the second derivative of q3/6 + 4q. Give u(x). 1 Let y(d) = d + 1. Suppose 4h - v = 24, -4v + 5v = 3h - 19. Let j be y(h). Let f(b) = b. What is f(j)? 6 Let u(y) = -2y2 + 2y - 7. Let z(b) = 2b2 - b + 6. Let g(i) = 4u(i) + 5z(i). Give g(-2). 4 Let i(s) = 11s + 1. Let p be i(6). Suppose 9 = 4o - p. Suppose o = 5b - 6. Let m(k) = k - 2. Determine m(b). 3 Let x(k) be the first derivative of k*3/3 - 5k*2/2 - 10k - 8. Calculate x(7). 4 Let c(y) = 3y - 5 - 4y - 4y - 1. Determine c(-4). 14 Suppose 6g - 5g + 3c = 15, -12 = -4c. Let i = g - 2. Let m(v) = -2 - 4 + i + v3 - v. What is m(-2)? -8 Let v(p) = p + 5. Let n = 9 - -1. Suppose t - 4 = 3a, -5t + 5a - n = -0t. Calculate v(t). 0 Suppose 3q - 7 - 5 = 0. Let f = q - -1. Let z(h) = -h*2 - 4 - h + 0 + fh. Calculate z(3). -1 Let l(y) = y3 - y2. Let i(v) = 2v2 + 16v. Let a be i(-8). What is l(a)? 0 Let j(q) = q - 6. Let s(y) = -1 + 0y - y + 4y - 2y. Let l(n) = -j(n) + 3s(n). Give l(-5). -7 Let b(k) = k*3 + k + 1. Suppose 2c - j - 13 = 0, -5j - 20 = -7c + 2c. Suppose 0v - 9 = v. Let f = c + v. What is b(f)? 1 Let i(x) = 0x3 + 6x*3 - 3x - 1 + 4x2 - 5x3. Let p(f) = f3 + 9f2 + f + 5. Let y be p(-9). Calculate i(y). 11 Suppose -10 = -6t + t. Let z(f) = -6f + 2. Calculate z(t). -10 Suppose 7 = l - 0l. Let z(c) = -c*3 + 8c*2 - 5c. Give z(l). 14 Let s(b) = b*2 + 6b. Suppose -7 = -j - 13. What is s(j)? 0 Suppose 4x + 36 = -2x. Let r(l) = l + 1. What is r(x)? -5 Let t(p) = -14p + 6 + 32p - 17p. Give t(0). 6 Let s(z) be the first derivative of -7 - 1/2z*2 - z - 14/3z3. Determine s(-1). -14 Let u(k) = k3 + 4k2 + 3k. Let f(l) = 1. Let x(g) = g + 4. Let i(t) = 5f(t) - x(t). Let s be i(-7). Suppose 3j + 1 = -s. Calculate u(j). 0 Let p(y) be the third derivative of -y*4/24 + 5y*3/3 - 11y*2. Suppose -5g + 16 = -9. Calculate p(g). 5 Let x(j) = -j - 5. Suppose 43 = -3c - n + 6n, 2c + 22 = 2n. What is x(c)? 1 Suppose 45y - 39y = -18. Let x(a) = -2a + 0 + 0. Determine x(y). 6 Let z(u) = 7u*2 + 2u + 4. Let m(s) = 8s2 + 3s + 5. Let i(l) = -6m(l) + 7z(l). Calculate i(4). -2 Suppose 3w - 30 = 18w. Let d(c) = c + 2c2 - c2 + 2 - 2c2. Calculate d(w). -4 Let s(n) be the second derivative of n3/3 - 4n2 + 68n. Calculate s(6). 4 Suppose 234u - 229u = 15. Let s(x) be the second derivative of -ux2 + 1/6x*3 + 3x + 0. Calculate s(6). 0 Let b(n) = -n*3 - 3n*2 + 4n - 7. Let f be b(-4). Let u(r) = -r*3 - 6r*2 + 6r - 2. Give u(f). 5 Let b(r) = -7r - r2 - r3 - 7 + 5r*2 + 2r3. Let n be b(-5). Let t(d) = -dn - d3 + d3. What is t(0)? 0 Let t(y) = -8y3 - 2y*2 - 2y - 1. Let z(s) = 9s3 + 2s*2 + 2s + 1. Let c(g) = 4t(g) + 5z(g). Calculate c(-1). -12 Let v(b) = b*3 - 3b*2 - 4b + 4. Let s = 4 - 1. Let m be v(s). Let t = -11 - m. Let i(r) = r*3 + 4r*2 + 4r + 2. Calculate i(t). -1 Let y(i) = i*2 - 3i - 4. Let p be y(5). Let g = p - 9. Let b be 1 - (-18)/g - -1. Let d(q) = -q*3 - 5q*2 - 5q. Give d(b). 4 Let o(c) = 2c - 7. Let d be (32/20)/(2/5). Suppose -4k = 5a - 35, -da = -16 + 4. Determine o(k). 3 Suppose -4s - 16 = -0s. Let n(y) = 3y + 6. Determine n(s). -6 Suppose d - 6 = -h - 2h, 4h + 11 = 5d. Let r(y) = 0y - d + 2 + 3y - 2y. Let v be 9/(-2) + (-2)/(-4). Give r(v). -5 Suppose -3r + 2u - 30 = 2r, 4u = 0. Let y(w) = w + 10. Let a(q) = -q - 10. Let h(f) = -3a(f) - 4y(f). Give h(r). -4 Let x be -1 - 2(-9)/6. Let h(g) = -2 + 7g - 3g + 1. Let a(v) = -5v + 1. Let m(t) = xa(t) + 3h(t). Determine m(-3). -7 Let c(y) = y3 + 5y*2 + 2y - 2. Let m be (6 - 13)(-1 - 0). Let t be 0 + (3 - m) + 0. Determine c(t). 6 Let n(q) = 5 + 5q*2 - 2q*3 + 4q + 4q + 3q*3 - 2q. What is n(-4)? -3 Let k(p) = -4p + 14. Let o(m) = -5m + 15. Suppose j + 2 = -3w - 3, 0 = -2j + 8. Let z(a) = wo(a) + 4k(a). Let d = 12 - 7. Calculate z(d). 6 Let b(r) = 0 + 1 - 2r - 2 + 4r. Determine b(-4). -9 Let k(h) = -3 + 4h2 - 3h2 + 1. Give k(3). 7 Let t(k) = -k2 - 15k + 4. Let f be t(-15). Let p(a) = -a3 + 5a*2 - 4a - 5. What is p(f)? -5 Suppose 0 + 2 = v. Let a(n) = n + 0n2 - n3 - 1 + 0nv - n2. Calculate a(1). -2 Let f(z) = -z2 + z + 2. Let o(l) = -l2 + 2l + 5. Let i(s) = -9f(s) + 4o(s). Let q(g) = -14g*2 + 2g - 6. Let u(k) = 17i(k) + 6q(k). Determine u(5). -2 Suppose -m - 2m - 6 = 0. Let y(t) = -7t - 2. What is y(m)? 12 Let m(b) = -5b2 - 2b + 11. Let o(t) = 2t2 + t - 4. Let w(n) = -3m(n) - 8o(n). Calculate w(-4). -9 Let w(f) be the third derivative of f5/60 + f4/6 - 2f*3/3 + 8f*2. What is w(-4)? -4 Suppose 4d + 0 - 8 = 0. Let k(t) = 4t + 2t2 + t2 - t*3 + dt - 2. Let c(h) = 5h + 89. Let m be c(-17). What is k(m)? 6 Let n(l) = -4 + 8l*2 - 1 - 9l*2 + 3l + 2. Calculate n(4). -7 Let k = 1 - -2. Let x(v) = 1 + 4v - kv - v*2 - 3v. Suppose q = -0 + 1. What is x(q)? -2 Let v(l) = l*2 - 3l + 3. Let g(a) = 2a2 + 2a + 2. Let y be g(-1). Give v(y). 1 Let m(k)	{ "pile_set_name": "DM Mathematics" }
et w(t) = t*2 - 21t - 45901. Give w(-204). -1 Let m(h) = 49h - 636. Calculate m(14). 50 Let s(n) = 13n - 1360. Calculate s(99). -73 Let c(x) = x*2 + 111x - 2412. Determine c(-131). 208 Let q(m) = -m*2 + 66m - 355. Give q(6). 5 Let x(a) = 2a3 - 103a*2 - 160a + 75. Give x(53). 22 Let p(v) = 42v2 + 303v - 199. Give p(-8). 65 Let c(t) = -29t + 213. Give c(8). -19 Let b(i) = i2 + 7i - 45. Give b(4). -1 Let t(r) = 13r - 205. Determine t(16). 3 Let l(g) = g2 + 12g - 336. Determine l(-23). -83 Let c(l) = -311l + 312. What is c(1)? 1 Let d(c) = -c2 - 17c - 134. What is d(-15)? -104 Let p(s) = -s*3 - 11s*2 + 3s - 48. What is p(-11)? -81 Let o(y) = 4y3 - 3y - 9. Give o(-3). -108 Let a(b) = 15b2 - 407b + 33. Give a(27). -21 Let f(b) = b*2 + 401b + 4432. Give f(-11). 142 Let h(v) = -46v3 + v2 + 14v + 20. Calculate h(-2). 364 Let s(t) = 56t - 618. Determine s(11). -2 Let t(c) = c3 + 30c*2 - 11c + 653. Determine t(-31). 33 Let i(k) = k*2 - 54k + 283. Calculate i(48). -5 Let i(q) = q*2 + 23q - 912. Determine i(20). -52 Let d(v) = -176v + 1709. What is d(9)? 125 Let u(a) = 570a - 3998. What is u(7)? -8 Let p(c) = -3c2 - 97c - 702. What is p(-21)? 12 Let c(m) = -1461m + 55525. Give c(38). 7 Let l(g) = 13g + 230. Calculate l(-18). -4 Let y(l) = -6l2 - 10l - 16. Give y(7). -380 Let v(j) = j*2 + 5j - 95. Calculate v(0). -95 Let a(u) = 405u - 2044. Determine a(5). -19 Let h(w) = 240w*3 - 1439w*2 - 5w + 13. Determine h(6). 19 Let w(i) = -2i + 180. Determine w(2). 176 Let m(h) = h3 + 9h*2 - 25h + 114. What is m(-12)? -18 Let c(h) = -818h - 63796. What is c(-78)? 8 Let k(i) = -i2 + i - 13. Give k(-3). -25 Let a(j) = -j3 + 8j*2 + 390j - 3. Calculate a(-16). -99 Let b(p) = -p*2 - 6p + 158. What is b(-16)? -2 Let v(t) = 10t + 142. What is v(-11)? 32 Let v(m) = 26m + 34. What is v(-1)? 8 Let j(s) = 2s - 104. Calculate j(33). -38 Let a(q) = 108q*2 + 549q + 39. Determine a(-5). -6 Let y(h) = -14h2 - 3h. Calculate y(0). 0 Let j(l) = 4l3 + 34l*2 - 19l - 8. What is j(-9)? 1 Let k(r) = 1370r - 12348. Give k(9). -18 Let h(k) = -k2 - 74k - 1008. Calculate h(-18). 0 Let y(c) = -2c3 + 58c*2 + 77c - 80. Determine y(30). 430 Let o(i) = 4475i2 - 35799i - 11. What is o(8)? -3 Let z(g) = g*2 - 68g - 70. What is z(-1)? -1 Let q(a) = 20a + 653. Determine q(-25). 153 Let h(r) = -247r*2 - 18r + 29. Determine h(2). -995 Let p(c) = 7c - 269. Calculate p(44). 39 Let q(c) = -539c - 19949. Calculate q(-37). -6 Let j(b) = b*2 + 29b - 656. Determine j(15). 4 Let k(t) = 26t2 - t + 3. Determine k(2). 105 Let d(y) = -y3 + 59y*2 - 258y - 616. Give d(54). 32 Let a(p) = -48p + 113. Calculate a(7). -223 Let m(o) = -o3 - 7o*2 - 7o + 13. Determine m(-4). -7 Let v(j) = 5j3 - 2j*2 - 8j - 13. What is v(-3)? -142 Let y(k) = k*3 - 4k*2 - 13k + 109. Determine y(6). 103 Let l(k) = -27k + 6. What is l(0)? 6 Let z(k) = -k3 - 19k*2 - 36k - 40. What is z(-17)? -6 Let c(v) = -161v + 1295. Give c(8). 7 Let z(v) = -v3 - 14v*2 + 65v + 863. Give z(-9). -127 Let c(a) = -a*3 + 16a*2 - 30a + 52. Calculate c(15). -173 Let v(l) = -171l - 381. Determine v(-2). -39 Let h(m) = -54m + 6609. Give h(122). 21 Let d(u) = -u*3 + 18u - 68. What is d(0)? -68 Let g(v) = -11v + 735. Determine g(55). 130 Let s(v) = -2v*2 - 9v - 21. What is s(-4)? -17 Let x(u) = -u*3 - 21u*2 + 22u - 13. Determine x(-22). -13 Let a(i) = 1744i + 3482. Determine a(-2). -6 Let a(x) = -2x*2 - 33x - 20. Determine a(-15). 25 Let w(r) = -22r + 138. Determine w(5). 28 Let l(k) = -2k*3 - 5k*2 + 21k - 46. What is l(3)? -82 Let f(r) = -2r2 - 196r - 582. Calculate f(-3). -12 Let q(z) = -124z - 3246. Give q(-26). -22 Let t(r) = r3 + 2r*2 + 6r - 21. Give t(0). -21 Let v(j) = -11j - 316. Calculate v(-32). 36 Let k(d) = d3 - 2d*2 + 20d - 122. Determine k(4). -10 Let j(z) = z*3 + 14z*2 + 43z + 68. Calculate j(-14). -534 Let d(y) = -390y + 1195. Give d(4). -365 Let w(a) = -3a*3 - 20a*2 - 62a - 472. Calculate w(-7). 11 Let z(i) = -i*2 + 40i + 695. What is z(-17)? -274 Let p(d) = d*2 + 55d + 674. What is p(-18)? 8 Let z(t) = -t*2 - 39t - 147. Give z(-4). -7 Let b(r) = -102r + 286. What is b(6)? -326 Let m(c) = 14c - 991. What is m(69)? -25 Let a(n) = -2n3 + 4n*2 + 2n - 40. Give a(0). -40 Let j(x) = -151x3 + x2 + 8x + 8. Determine j(-1). 152 Let q(v) = -102v2 - 3161v + 40. Give q(-31). 9 Let y(f) = -f*2 + 24f + 243. Give y(31). 26 Let t(x) = -x - 51. Calculate t(-27). -24 Let l(k) = -613k + 541. Determine l(1). -72 Let s(z) = z3 - 52z*2 - 352z - 21. Give s(-6). 3 Let p(d) = 2d + 3. Calculate p(-82). -161 Let n(c) = 5c*2 + 185c - 942. Determine n(5). 108 Let n(j) = -224j - 406. What is n(2)? -854 Let q(z) = 24z - 880. Give q(49). 296 Let m(z) = 42z - 260. What is m(9)? 118 Let y(c) = 84c - 1855. Determine y(22). -7 Let o(u) = 9u2 - 109u + 96. Calculate o(11). -14 Let b(z) = -68z + 315. Determine b(6). -93 Let j(l) = -2l*2 + 115l - 54. Give j(57). 3 Let a(t) = 32t + 705. Give a(-22). 1 Let q(x) = 13x + 751. What is q(-48)? 127 Let k(z) = -143z + 7676. Calculate k(54). -46 Let j(l) = 2l*2 + 75l - 74. Determine j(-41). 213 Let k(g) = -5g + 233. Calculate k(48). -7 Let f(q) = 341q + 29. Determine f(-1). -312 Let q(o) = o*2 + 72o - 145. Give q(2). 3 Let w(h) = -4h2 - 105h - 221. Determine w(-24). -5 Let l(j) = -1260j + 7502. Give l(6). -58 Let u(f) = -3f*2 + 127f + 328. What is u(45)? -32 Let y(r) = r*2 - 33r + 191. What is y(10)? -39 Let i(d) = d*3 - 57d*2 + 63d - 397. Calculate i(56). -5 Let f(v) = -v*2 + 44v - 280. Give f(36). 8 Let k(u) = -u*3 + 39u*2 + 56u - 654. Calculate k(40). -14 Let l(j) = 140j2 - 1388j - 144. Calculate l(10). -24 Let f(i) = 6i - 187. Calculate f(34). 17 Let d(j) = 167j - 2686. Calculate d(16). -14 Let l(u) = -u*3 + 21u*2 - 65u + 617. Determine l(19). 104 Let m(c) = -13c2 + 484c - 126. Calculate m(37). -15 Let q(s) = -3s2 - 485s + 24930. Calculate q(41). 2 Let y(r) = 3r2 - 104r + 834. Give y(22). -2 Let b(g) = -18g2 + 245g + 122. Calculate b(14). 24 Let x(g) = -g - 165. Determine x(50). -215 Let d(r) = 8r + 146. Determine d(-17). 10 Let q(t) = -t3 - 6t*2 + 16t + 1. What is q(-8)? 1 Let h(s) = -7s2 + 57s - 10. Give h(7). 46 Let d(c) = 2c3 + 69c*2 - 38c - 116. Give d(-35). -11 Let q(p) = p*3 + 16p*2 - 25p + 9. What is q(-17)? 145 Let w(i) = -i - 103. Determine w(-39). -64 Let b(j) = -89j - 933. What is b(-15)? 402 Let a(y) = -2y*2 - 155y + 286. What is a(-79)? 49 Let i(w) = 11w + 46. Calculate i(-4). 2 Let r(m) = 5593m + 10. Give r(0). 10 Let w(l) = -l*3 - 24l*2 - 134l - 455. Determine w(-18). 13 Let n(u) = -2u3 + 33u*2 + 20u + 13. Determine n(17). 64 Let t(k) = -k*3 - 10k*2 - 4k + 95. Give t(-8). -1 Let h(y) = -y*2 + 77y - 454. Give h(71). -28 Let g(x) = x*2 - 21x - 19. Calculate g(-1). 3 Let w(t) = -411t + 51. What is w(2)? -771 Let f(h) = 2h*3 + 14h*2 + 15h - 3. Determine f(-6). -21 Let f(v) = -v*2 + 38v - 234. Calculate f(23). 111 Let x(v) = v*3 - 18v*2 - 20v + 27. Give x(19). 8 Let b(j) = -3j2 - 32j - 47. Give b(-3). 22 Let s(b) = 24b2 - 133b - 84. Determine s(6). -18 Let a(m) = -814m - 7330. Determine a(-9). -4 Let m(d) = -d3 + 16d*2 + 8d - 128. Give m(16). 0 Let d(a) = 106a - 2449. Give d(23). -11 Let o(t) = -t2 - 51t - 283. Give o(-6). -13 Let q(r) = -r*3 - 47r*2 + 112r + 718. Give q(-49). 32 Let h(w) = 2w2 + 365w + 8386. Calculate h(-27). -11 Let z(w) = -w*3 - 231w*2 - 227w + 710. What is z(-230)? 20 Let d(l) = 22l + 467. Give d(-21). 5 Let f(z) = -z2 - 34z - 95. Determine f(-10). 145 Let k(w) = -2w2 + 47w - 207. Determine k(17). 14 Let d(k) = -2k3 + 6k*2 + 50k - 158. What is d(3)? -8 Let l(m) = -4m2 - 52m + 91. Calculate l(9). -701 Let m(g) = -27g + 1156. Give m(42). 22 Let j(t) = 55t + 59. Give j(-2). -51 Let o(r) = 8045r + 48264. Give o(-6). -6 Let n(h) = -h3 - 20h*2 - 29h + 16. Give n(-18). -110 Let n(j) = -j*2 - 72j + 640. Calculate n(8). 0 Let z(m) = 58m - 8518. Determine z(147). 8 Let b(h) = -2h*3 - 8h*	{ "pile_set_name": "DM Mathematics" }
d biggest value in b, d, w? b Suppose -3d = -4l, -3l + 0 + 9 = 0. Let w = 14.03 - 14. Let q = w - 0.23. What is the second biggest value in -0.1, d, q? -0.1 Let v = 12 + -11.7. Let t = 0.06 - -0.34. Let p = t - v. Which is the smallest value? (a) -2 (b) p (c) 2/9 a Let d = 1.74 - -0.26. Which is the second biggest value? (a) 4 (b) 6 (c) d a Let h = -4.9 - 0.7. Let q = -6 - h. What is the smallest value in 0.5, q, 1/5? q Let m(u) = -u3 + 7u*2 - 5u - 8. Let x(p) = p*2 - 13p + 6. Let l be x(13). Let j be m(l). What is the third biggest value in -0.1, -1/5, j? j Let q = -48.5 + 48. What is the second biggest value in 4, q, -5/4? q Suppose -g = 2f + 11, 4g + 4 = f - 4. Let u = 1.5 - 2.8. Let k = -1.7 - u. What is the smallest value in f, k, 2? f Let h = 7 + -14. Let x = 10 + h. Which is the third smallest value? (a) 1 (b) x (c) -1 b Let t be (-2 - 0) + (-2)/(-1). Suppose 0 = 15d - 7d - 32. Which is the third biggest value? (a) -1/4 (b) d (c) t a Let s = 0.09 - 0.08. Let t = 3.01 - s. Let u = -0.2 + 0. What is the third smallest value in u, t, 2/3? t Let a = 1.16 - 0.54. Let s = a - 0.22. What is the smallest value in -0.2, s, 1/4? -0.2 Let o be 3/4 - 9/36. What is the biggest value in 0.2, 4/5, o? 4/5 Let u = 110124 - 7929131/72. Let w = -19/8 - u. Which is the biggest value? (a) 0.5 (b) w (c) -2/11 a Let n be (-14)/10 + 1 + 0. Let k be 5/(-1) - 1/(-1). Let d be k/(-6)(-6)/(-4). What is the third biggest value in -1, d, n? -1 Let p = 40 + -41. Which is the third biggest value? (a) 3 (b) 1/4 (c) -2 (d) p d Let g = 52 - 50. Which is the fourth biggest value? (a) -0.4 (b) g (c) 0 (d) -51 d Let n be (-8)/10(-30)/12. Let l be (1 - (-6)/3) + n. Let f = -138 + 409/3. What is the second smallest value in -5, f, l? f Let f be (2 - 3)/(-1 - -2). Let r be f/(-4) - (-10)/8. Let l = -3 - -6. Which is the second smallest value? (a) 1 (b) l (c) r c Let v = 135/7 - 19. Which is the second smallest value? (a) v (b) 1 (c) 0.5 c Let q(g) = -5g - 10. Let f be q(-8). Let v be f/(-25)(-10)/(-3). Let r = -0.31 - -0.01. Which is the third smallest value? (a) v (b) r (c) -3 b Let c = -0.8 - -0.4. Let s = -672929/10 - -67369. Let a = 76 - s. What is the third biggest value in c, a, -1? -1 Let x = 15 + -30.7. Let s = x - -15. Let g = s - -0.2. What is the second biggest value in g, -5, -1? -1 Let y = -541 + 537. Let h be (1/1)/((-3)/5). Which is the smallest value? (a) h (b) 1/2 (c) y c Let t = 25/132 + 2/33. Which is the fourth smallest value? (a) 3/2 (b) t (c) -2/3 (d) -4 a Let u = -2 - -1.8. Which is the smallest value? (a) 3 (b) -1/4 (c) u b Let x = 22/3 + -64/9. Let d be 120/(-175) - (-4)/10. Which is the third smallest value? (a) -5 (b) x (c) d b Let k be (2 + 60/(-27))-3. Let p = -0.21 + 2.61. Let t = p + -2. What is the second smallest value in k, -0.1, t? t Let w = 0.3 - 0.3. Suppose -5x + x + 12 = 0. Which is the third biggest value? (a) 0.1 (b) w (c) x b Let x = -0.011 - -5.011. Which is the fourth smallest value? (a) x (b) -0.1 (c) 1 (d) -4 a Let f = -0.09 - 6.91. Let o = 0.16 + -9.16. Let j = f - o. Which is the third biggest value? (a) -5 (b) j (c) 3 a Let u be (-5)/((-25)/4)(-1)/2. Which is the biggest value? (a) u (b) 2 (c) 15 c Let u = 1.01 + -1. Let j = -87/20 + 23/5. Which is the biggest value? (a) 4 (b) u (c) j a Let i = -2/137 - 395/1096. Let k = 12 + -8. What is the smallest value in i, 2/21, k? i Let s(q) = q3 - 4q*2 + 1. Let x be s(4). Let v = -3.4 - -2.9. What is the smallest value in 0.1, v, x? v Suppose -5 = -l - 4l. Let i be (-6)/(-30)(-1)/l. Which is the second biggest value? (a) i (b) 5 (c) 0 c Let k be 1/(-3)(-4)/4. Which is the second biggest value? (a) -6/11 (b) k (c) 0.3 c Let x = 0.071 - -28.929. Let b = 41 - x. Let h = b + -7. What is the biggest value in 0.3, h, 0? h Let g = -8 - -5. Let l = g + -2. Let d be 0 + 0 + -1 - -3. Which is the second biggest value? (a) -0.5 (b) d (c) l a Let z = -0.01 - -0.08. Let m = z - 0.07. Which is the second biggest value? (a) m (b) 0.4 (c) 0.2 c Let v be 44/(-21)9/(-6). Let n = v - 24/7. What is the second biggest value in -4, n, 4? n Let q = -1.07 - 0.23. Let j = -3.3 - q. Which is the biggest value? (a) 1/3 (b) 4/9 (c) j b Let t = 4.1 + -0.1. What is the biggest value in 0.1, t, 6, 5? 6 Let d be (-3)/(-1) + 9 + -11. What is the third smallest value in d, 4/5, -0.02? d Let v = 16 - 12. Which is the smallest value? (a) -2/5 (b) v (c) -1 c Let u = 10.81 - 11. Let x = u - -0.09. What is the second biggest value in -2/9, -0.3, x? -2/9 Let f be -5(-41 + 3). Let r = -6 - -9. Let s = f - r. What is the smallest value in 2/15, s, 0.3? 2/15 Let k(q) = 3q*3 - q + 1. Let o be k(1). Let l be ((-1)/3)/(o/(-2)). Which is the second smallest value? (a) -1/2 (b) l (c) 1 b Let n be (-5 + 88/16)(-8)/26. What is the third biggest value in 10, n, -0.3? -0.3 Let i be (-3)/4 - 260/(-560). Let c = -1.9 - -2. What is the biggest value in 0.6, c, i? 0.6 Let s = -0.1 - -0.03. Which is the third biggest value? (a) 2 (b) 3 (c) s (d) 2/19 d Let j be (1/5)/(12/(-15)). Suppose -r = r + 6. What is the third biggest value in r, -0.4, j? r Suppose 14n + 7 = 21n. Which is the smallest value? (a) -1.3 (b) n (c) 0.4 a Suppose 0 = z + 3z + 2w - 12, 5z + 4w = 9. What is the second smallest value in -7, z, -1/3? -1/3 Suppose -2g = -g - 3. What is the second biggest value in g, 0.7, 5? g Let n be ((-6)/72)/((-62)/16). What is the biggest value in -3/7, -0.1, n? n Let h = 271/40 + -32/5. Let p = 513/7 - 73. Let l = -694/855 - -2/171. Which is the second smallest value? (a) l (b) p (c) h b Let x = 3.6 - 1.6. Which is the smallest value? (a) 3/5 (b) -2/5 (c) x b Let u = -37 - -41. Which is the third biggest value? (a) u (b) 0.02 (c) -0.4 c Let d = 33 - 32. Which is the third biggest value? (a) 2 (b) -0.03 (c) d b Let d be (-2)/6 + 112/624. What is the second biggest value in -4, 1, d? d Let v be (-6)/(-15) + 3/5. What is the third biggest value in -2/3, v, 4? -2/3 Let q = 66 - 68. Suppose 2w - 9 = -3a, -5w - 6 = 9. What is the biggest value in q, a, -5? a Let x be 1/8 + (-4 - (-4 - 0)). What is the third smallest value in 0.06, 0.5, x? 0.5 Let j = 0.153 - 0.053. Which is the third smallest value? (a) 0 (b) j (c) -2/11 (d) 3/2 b Let l be (-4)/(-6) - (-2 - -3). Which is the second smallest value? (a) -3/10 (b) l (c) 0.2 a Let b = 0.8 + 0.2. What is the biggest value in 0.1, 0.2, b? b Let n = -6 - -6.2. Which is the biggest value? (a) 5 (b) -3 (c) n a Let s = 295/21 - 96/7. Which is the fourth smallest value? (a) -3 (b) -2 (c) 2 (d) s c Let a = -7 - -6.3. Let o = a - -0.2. Suppose -5 - 11 = 4m. What is the smallest value in o, m, -2/3? m Suppose x - 12 = 3x. Let q be x/21 - (-22)/28. Which is the smallest value? (a) q (b) -4 (c) 3 b Let o(k) = k*3 + 7k*2 + 4. Let x be o(-7). Let i(h) = -2h + 5. Let a be i(5). What is the second biggest value in a, x, 0.5? 0.5 Suppose -5s + 0s + 20 = 0. What is the smallest value in -0.3, 1.6, s? -0.3 Suppose 0 = -0f + 4f + 4. Let y(d) = -d*3 - 8d*2 + 2d + 9. Let x be y(-8). Let k = -11 - x. Which is the third smallest value? (a) f (b) k (c) 2 c Let i = 0.17 + 0.23. Which is the second biggest value? (a) -2 (b) i (c) 1 b Let j = -0.9 - -2.9. Let r be 3/(-4) + 1/2. Which is the third biggest value? (a) j (b) 5 (c) r c Let h = -451 - -7665/17. What is the smallest value in 2/5, h, 2? h Let i = -0.05 + 3.05. Let l = -0.236 - 1.764. What is the third biggest value in l, i, 5? l Let l = -0.08 - -0.06. Let o = -78 - -236/3. Which is the second biggest value? (a) l (b) -5 (c) o a Let q = -54 + 812/15. Which is the biggest value? (a) q (b) -3/5 (c) 2/11 c Let o = 0.1 - 0.2. Let i = 197.4 - 216. Let x = 19 + i. What is the smallest value in o, x, 3? o Let c = -2.7 - -3. What is the fourth biggest value in 20, 0.2, 2, c? 0.2 Let k = -33 + 29. Let i = 0 + 1. Suppose 3t + 5 = 2h, -t + 4h - 3 = -8. What is the second smallest value in t, k, i? t Suppose 3d - 2 = 4. Let g = -7 + d. Which is the second biggest value? (a) 3/2 (b) -0.4 (c) g b Let d be 1 + (11/57 - 1). Let p = d - 10/19. Let u = 11/15 + p. Which is the third biggest v	{ "pile_set_name": "DM Mathematics" }
). Suppose -4w + hw - 4p = 1, -3w - vp = -59. Calculate the remainder when w is divided by 10. 7 Let m(z) = -2z*2 + 1 - z + 5z*3 - 3z3 + z2 + 5z3. Let c be m(1). Calculate the remainder when (-294)/(-10) + c/10 is divided by 11. 8 Suppose -47m + 145 = -42m. Let a = 2 - 1. Suppose -a = x - 11. Calculate the remainder when m is divided by x. 9 Let t be 1/7 - (-108)/28. Let c(p) = p2. What is the remainder when c(t) is divided by 6? 4 Let x be (-8)/(-16)(-1 - -1). Suppose 0 = k - 3m + 32, x = -4k + 4m - 28 - 92. Let g = k + 45. Calculate the remainder when 30 is divided by g. 14 Let g(y) = -y2 - 8y + 30. Calculate the remainder when g(-8) is divided by 17. 13 Let p be 1-24 - (0 - 1). Let t = p - -29. Calculate the remainder when 21 is divided by t. 3 Let c(u) = u2 - 8u - 9. Calculate the remainder when c(11) is divided by 7. 3 Let x = -2 - -2. Suppose 2h - 62 = -xs - 2s, 2h - 5s = 97. Suppose 2l = 17 + 21. What is the remainder when h is divided by l? 17 Let y = -170 + 277. Calculate the remainder when y is divided by 36. 35 Let y = -23 + 37. What is the remainder when 40 is divided by y? 12 Suppose -2j = 5m - 69, 3m - 2j + j = 48. Calculate the remainder when 59 is divided by m. 14 Suppose 7 = -2h + 21. Suppose -h = -d - 3. Calculate the remainder when d is divided by 3. 1 Let x = -69 + 107. What is the remainder when x is divided by 8? 6 Suppose 0 = -4u + 40. Suppose p = 4p - 2g + 8, 0 = 2p - 2g + 4. Let t = 32 + p. Calculate the remainder when t is divided by u. 8 Let m(b) = b*2 - 5 - 7b - 3 - 1. Let q be m(9). Suppose 11 + q = 5h. What is the remainder when 11 is divided by h? 3 Suppose -31 = 2z - 3z. Calculate the remainder when z is divided by (4/(-10))/((-1)/40). 15 Suppose -4x + 5w = -0w - 168, -x + w + 43 = 0. Calculate the remainder when x is divided by 12. 11 What is the remainder when (270/25)/(9/30) is divided by 13? 10 Let y(n) = -2n2 - 2n + 4. Let v(o) = o*2 + o - 2. Let p(d) = 9v(d) + 4y(d). Calculate the remainder when 4 is divided by p(-3). 0 Suppose -5 = f - 15. What is the remainder when 6/15 + 206/f is divided by 12? 9 Suppose 4b - 2b - 14 = 0. What is the remainder when b is divided by 4? 3 What is the remainder when (4/(-8))/(-2 + 267/134) is divided by 23? 21 Let q = -113 + 125. Let f = -65 - -112. What is the remainder when f is divided by q? 11 Suppose -22 = -g + 5h, 0g = 5g + 4h - 23. Calculate the remainder when 26 is divided by g. 5 Suppose -57 = 2j + 5z + 4, -4z = 3j + 81. Let q = 2 - j. Suppose -5f - q + 160 = 0. What is the remainder when f is divided by 14? 13 Let m(p) = 29p2. Calculate the remainder when m(-1) is divided by 8. 5 Let g(y) = 12y*2 + y + 2. Let c be g(-1). Let q = c - 7. What is the remainder when 22 is divided by q? 4 Suppose 4u = -0y + 2y - 40, 2y - 12 = -3u. Let j(c) = 4c - 14. Calculate the remainder when 3/1(y - 3) is divided by j(7). 13 Let f(o) = o*2 + 4o + 1. Suppose -3i - 4y - 22 = y, 0 = -4i - y - 18. Let u(m) = 2m*3 - m. What is the remainder when u(1) is divided by f(i)? 0 Let c be 4/(-14) + 5970/70. Suppose -4x + 0x - 3m + c = 0, -32 = -2x + 2m. Calculate the remainder when 73 is divided by x. 16 Let b = -125 - -130. What is the remainder when 19 is divided by b? 4 Suppose -20 = -6v + 2v, 0 = 2r - v - 125. Calculate the remainder when r is divided by 17. 14 Let y be -4 + 9 - (-1 - 0). Let l = y - 0. What is the remainder when 10 is divided by l? 4 Let b = 166 + -119. Let t(l) = -5l + 8. Let m(x) = 6x - 7. Let w(j) = 4m(j) + 5t(j). Calculate the remainder when b is divided by w(0). 11 Let c = -19 + 48. Calculate the remainder when 85 is divided by c. 27 Let t(g) = -48g - 11. Calculate the remainder when t(-5) is divided by 46. 45 Calculate the remainder when 7/1 - 0/(-1) is divided by (0 + -3 + 2)/(3/(-12)). 3 Let l(u) = 2u2 - 2u - 1. Let o be l(2). Let d = 6 - o. Suppose -16 = -5v + dv. Calculate the remainder when 22 is divided by v. 6 Calculate the remainder when 105 is divided by 326/6 + 1 - 49/147. 50 Let h = 5 + -3. Let k = -17 + 12. Calculate the remainder when 44 is divided by (k/h)/(2/(-12)). 14 What is the remainder when 78 is divided by (-1)/5 + 0 - 230/(-25)? 6 Suppose 8w + 420 = 12w. Calculate the remainder when w is divided by 27. 24 Let u = 98 + -68. Calculate the remainder when u is divided by 11. 8 Let u be (12/5)/(3/10). Let v(x) = -x*3 + 9x*2 - 7x - 7. Suppose -2 = -5d + h - 0, 2 = -4d + 2h. Calculate the remainder when v(u) is divided by d. 0 Suppose -190 = -4j - 2s, -8j - 5s + 245 = -3j. Suppose i + 1 = 13. Calculate the remainder when j is divided by i. 10 Let q = 21 - 11. Suppose 8u - 139 - 13 = 0. What is the remainder when u is divided by q? 9 Suppose 2h + 1 - 3 = -3x, -2h - 2x + 4 = 0. Calculate the remainder when 11 is divided by h. 3 Let f(n) = -2n + 11. Let d be f(8). Let k = d - -8. Calculate the remainder when 9 is divided by k. 0 What is the remainder when (-28)/7 - (4/2 - 186) is divided by 26? 24 Let c(h) = h*3 - 3h*2 - 8h + 1. Let v(u) = u*3 - 3u*2 - 4u + 2. Let m be v(3). What is the remainder when c(5) is divided by (-64)/(-10) - (-4)/m? 5 Suppose -8 = 2t - 84. Let i be (-2 - -1)/((-1)/3). Suppose iz + 4 = -3y + 31, -5y - 4z = -46. Calculate the remainder when t is divided by y. 8 Let c(t) = t2 - 7t + 8. Let v be c(8). Suppose 0 = 4a - f - 0f - 52, v = 4f. Let g = a - 10. What is the remainder when 10 is divided by g? 2 Calculate the remainder when 159 is divided by ((-20)/25)/((-2)/80). 31 Calculate the remainder when (-726)/(-15) - 12/(-20) is divided by 17. 15 Let p = -8 + 10. Calculate the remainder when 31 is divided by (3 - (p + -1))8. 15 Let u(n) = -9n3 + 4n*2 + 2n - 5. Let j(c) = -17c3 + 8c*2 + 3c - 9. Let t(d) = -4j(d) + 7u(d). What is the remainder when t(2) is divided by 8? 5 Let k be 3/3 + 95 - -3. Suppose -i + k = 2i. Calculate the remainder when i is divided by 12. 9 Suppose 5d - 4b + 5b = 28, 0 = 5d + 2b - 26. Suppose 0g + 2g = -2a + d, -26 = -4g + 3a. What is the remainder when 12 is divided by g? 2 Let w be ((-4)/6)/(6/(-9)). Let b(j) = 14j*3 + 2j*2 - 1. Suppose 2 = -2x + 5f - 2, 0 = 5x + f - 44. Calculate the remainder when b(w) is divided by x. 7 Suppose -d = 5g - 10, 3d - 31 = -2g + 38. Let r(v) = -v2 - 7v + 3. Calculate the remainder when d is divided by r(-5). 12 Let j(z) = 6 - 2 - 4z + 3z. Calculate the remainder when -12 + 32 + -1 is divided by j(-6). 9 Let l = -80 + 129. Calculate the remainder when 96 is divided by l. 47 Suppose 0 = 2s - 1 + 7, 0 = 2x - 5s - 3. Let m(d) = -2d3 - 4d*2 - 3d. What is the remainder when (54 - -1) + (x - -4) is divided by m(-3)? 26 Let u = 206 - 168. What is the remainder when u is divided by 13? 12 Let p be -1(-13 + -4 + 1). Let x = -9 + p. Let j(n) = n + 1. Calculate the remainder when x is divided by j(4). 2 Suppose 1 = s - 2. Let i be (-20)/(-3) - s/(-9). Let b = i + 0. What is the remainder when 20 is divided by b? 6 Let r = -118 + 131. What is the remainder when 51 is divided by r? 12 Calculate the remainder when 38 is divided by (-1)/1 - (3 - 17). 12 Let a(b) = b. Let d be a(7). Let g(v) = 5v + 4. Calculate the remainder when g(d) is divided by 4/(-10) - (-204)/10. 19 Let x(z) = 2z3 - 15z*2 - 7z + 3. Let j(l) = 2l + 1. Let r be j(2). What is the remainder when (1 - 0)/(r/205) is divided by x(8)? 8 Let v(u) = 20u - 21. What is the remainder when v(6) is divided by 25? 24 Suppose -3r - 6h + 36 = -5h, -2h - 36 = -3r. What is the remainder when r is divided by 8? 4 Let s = 12 + -9. What is the remainder when 3 is divided by s? 0 Let g(l) = -l3 - 12l*2 - 15l + 15. What is the remainder when g(-11) is divided by 15? 14 Let h(t) = 21t3 + t. Calculate the remainder when 41 is divided by h(1). 19 Suppose i = -15 + 22. Let g be (-2)/4 + 3/6. Suppose -83 = -3d - r, 1 = d - 5r - g. What is the remainder when d is divided by i? 5 Let b(u) = u - 4. Let g be b(6). Suppose -gm + 28 = 2m. What is the remainder when m is divided by 2? 1 Suppose -152 = -4p + 164. Suppose -4j = 5v - 75, 7j + 45 = 9j - 5v. What is the remainder when p is divided by j? 19 Let w(v) = 13v**2 +	{ "pile_set_name": "DM Mathematics" }
derivative of 3459w3 - 582w*2 - w + 1 wrt w? 20754 Find the third derivative of 29p*4 + 34p*2 - p. 696p Find the second derivative of -30h2r*2 + 75h*2 + hr + 2h + r2 + 34 wrt h. -60r*2 + 150 Find the third derivative of -2t*6 + 50t*4 + 80t*2 wrt t. -240t*3 + 1200t Find the second derivative of 8035v2 - 13401v. 16070 Differentiate 2b2 - 15278b - 20487 with respect to b. 4b - 15278 What is the second derivative of 6915h*2 + 1786h? 13830 What is the third derivative of -243j3 - 7j*2? -1458 Differentiate -972kr2y*3 + 9423ky3 - 3ky2 - 10r*2y*2 wrt r. -1944kry*3 - 20ry2 What is the derivative of -52l + 171? -52 What is the second derivative of 6k3w*2 - 2k*3 + 3k*2w*2 - 2k - 42w2 wrt k? 36kw2 - 12k + 6w2 Find the third derivative of 232l*5 - 11l*2 + l wrt l. 13920l2 What is the derivative of k2 + 104k - 563 wrt k? 2k + 104 Differentiate -5702s3 + 2s*2v + sv3 - 2609v*3 with respect to s. -17106s*2 + 4sv + v3 Find the first derivative of 298x*4 + 2945. 1192x*3 Find the third derivative of -2n*6 + 719n*5 - 13n*2 - 2. -240n*3 + 43140n*2 What is the third derivative of 2f*3i*3m + 22f3i2 - f2im + 12fi*3 - 8fm wrt f? 12i*3m + 132i2 Differentiate -34b*2 + 4bx2 + x2 - 51 with respect to b. -68b + 4x2 What is the third derivative of -10638u*4 + 488u*2? -255312u Find the second derivative of s*5 + 62s*2 - 138s. 20s3 + 124 Find the first derivative of 3f*2z*3 + 7f*2 - 7fz + 16f wrt z. 9f2z*2 - 7f What is the third derivative of -27n5 - 3n*3 - 25n*2 wrt n? -1620n*2 - 18 Find the second derivative of 17789nx5 + 5nx + 48n - 12x wrt x. 355780nx3 Find the first derivative of 4ot3 - 40ot2 - 3ot - 3908t*3 wrt o. 4t*3 - 40t*2 - 3t Differentiate 2h3 - 21hs - h - 262s wrt h. 6h2 - 21s - 1 What is the first derivative of 2p2 + 2p + 6447? 4p + 2 What is the first derivative of 24nz2 - 3n - 3z2 - 2z + 2920 wrt z? 48nz - 6z - 2 What is the third derivative of 648c*3g3 + c2g3 - 12c*2g*2 wrt c? 3888g*3 Find the second derivative of 450v*2 - 483v wrt v. 900 What is the third derivative of 7ksw3 - ksw2 - 3ksw - 6ks - 2sw*3 + 3w*3 wrt w? 42ks - 12s + 18 What is the first derivative of 159f2q + 351f2 + fq - 2q2 + 1 wrt q? 159f*2 + f - 4q What is the third derivative of -111y5 - 60y*3 - 2y*2 + 160y - 4 wrt y? -6660y2 - 360 What is the second derivative of -d5 + 117d*4 - 6d*3 - 4500d? -20d3 + 1404d*2 - 36d Find the second derivative of -265ay*2 - 2154ay wrt y. -530a What is the first derivative of 6b2 + 37? 12b Find the third derivative of -3c2u*3 + 3c*2u*2 - 4c*2 - 2cu4 + 31cu - 213u*4 + 2u*2 wrt u. -18c*2 - 48cu - 5112u Find the third derivative of 829b5 - b4 + 63b*2 + 3b wrt b. 49740b2 - 24b Find the second derivative of 7m5s - 4m2s*2 - 6ms2 + 43s*2 wrt m. 140m*3s - 8s2 Find the second derivative of -2795h*3 + 4487h wrt h. -16770h Find the third derivative of -3h*2q*5 - 377h*2 - 115hq6 - hq2 + q2 wrt q. -180h2q*2 - 13800hq3 What is the third derivative of -2m*6 - 20m*5 - 68m*2? -240m*3 - 1200m*2 Differentiate 3380x + 802 with respect to x. 3380 Differentiate -8973z2 - 9357 wrt z. -17946z Differentiate jopw3 + 10jopw2 + jow3 + jo + 43ow wrt p. jow*3 + 10jow*2 What is the second derivative of -83x*5 - 4x*2 - 279x wrt x? -1660x3 - 8 What is the third derivative of -9184c*3 + 971c*2 + 3 wrt c? -55104 What is the first derivative of 14i*2r + 10i - 4r + 13 wrt i? 28ir + 10 Differentiate 14kqw - 82kw + k - 1395qw with respect to k. 14qw - 82w + 1 What is the second derivative of -692d5 + 569d? -13840d3 Find the second derivative of -4c*2h*3 - 36c*2hx - 85ch3x - ch3 + 2h*2x wrt c. -8h3 - 72hx What is the second derivative of 24o*5 - 10o*4t*3 - ot*3 - 5ot - 30o wrt o? 480o3 - 120o*2t*3 Find the third derivative of 144p3 + p2 + 112 wrt p. 864 Find the third derivative of -cit*3u + 3cit2u + 5ct*3u*2 + 2ct2u*2 - ct*2u - 2it*3 + 10it2 - itu wrt t. -6ciu + 30cu*2 - 12i What is the second derivative of -3l3r*4 - 2l*3 + 66l*2r + 8lr*4 wrt r? -36l*3r*2 + 96lr2 Differentiate 20j*2n*2y - 620j2y - 8jn*2y with respect to n. 40j2ny - 16jny Find the second derivative of -n*3o*3v - 5n3ov - 3n*2o + nov + 3o4 - 2ov wrt o. -6n*3ov + 36o*2 Differentiate -34lp2w*3 - 6lp2 + lw*3 - 5p*2w2 - p2 - 90pw*3 with respect to l. -34p*2w*3 - 6p2 + w3 Find the third derivative of -15802w6 - 204w*2 - 5. -1896240w3 Find the second derivative of i2pq*2 + 2i*2pq + 19i*2p + 2ipq2 - 45pq2 - pq + q wrt q. 2i2p + 4ip - 90p What is the third derivative of 24m*4 - 29m*3z*2 + 2m*2z*2 - 550m*2 wrt m? 576m - 174z2 What is the derivative of 15a*4v*2 + 5a*4 + 159v*2 wrt a? 60a*3v*2 + 20a*3 What is the derivative of 2583f*3 + 2569 wrt f? 7749f*2 What is the third derivative of 2h*6 + 46h*4 - 187h*2 wrt h? 240h*3 + 1104h What is the third derivative of -461g6 - 929g*2 - g? -55320g3 Find the second derivative of -r3x2 + r3x - r*3 - 211r*2x + 1720x2 wrt x. -2r*3 + 3440 What is the first derivative of 235x + 279? 235 Find the first derivative of -17h2z + 886h2 - 2hz wrt z. -17h*2 - 2h Find the first derivative of -57q3 - 98 wrt q. -171q*2 Differentiate 353t - 488. 353 What is the third derivative of -1579j5 - 48j*2 + 1 wrt j? -94740j*2 What is the first derivative of 116p - 146 wrt p? 116 Differentiate 726tz*3 + 708z*3 with respect to t. 726z*3 What is the second derivative of -237g*3n*3 - 3g*3 + 4gn3 - 27gn wrt n? -1422g*3n + 24gn What is the first derivative of -o*3 + 5o - 109 wrt o? -3o2 + 5 Find the third derivative of -5454f*4x*3 - 3f*2 - 163x*3 - 2 wrt f. -130896fx3 Differentiate -c3 - 34c*2n*3 + 125n*3 + 2n*2 with respect to c. -3c*2 - 68cn3 Differentiate 197d*2 + 186. 394d Find the third derivative of -394w6 + 23w*3 - 177w*2 - 5w. -47280w3 + 138 What is the derivative of 3d*4t + d*4 - 432dt + 142t + 7 wrt d? 12d3t + 4d3 - 432t Find the third derivative of -u*4 - 78u*3 + 291u*2 wrt u. -24u - 468 What is the second derivative of 4b5 - 3b*2 - 197b + 1 wrt b? 80b3 - 6 What is the second derivative of -39svx*2 + 13sv - 2sx - 2vx2 - 16x wrt x? -78sv - 4v What is the second derivative of 3v*5 - 115v*3 + 367v? 60v3 - 690v What is the second derivative of 302a2dn2 - 4a*2dn + 2a*2n + 2a2 + 2dn wrt n? 604a*2d Find the third derivative of -1153v6 + 17v*2 + 28v wrt v. -138360v3 What is the third derivative of -102t*5 + 11t*3 + 916t*2 wrt t? -6120t*2 + 66 Differentiate -2g*2t*2 + 42g*2 + 4gt2 - 12t*2 - 42 with respect to g. -4gt2 + 84g + 4t2 Find the third derivative of -3g*6 - 36g*4 + 68g*2 wrt g. -360g*3 - 864g What is the second derivative of 1554g3m*3 - 3g*3m - 2g2m + 4g2 - m4 + 41 wrt m? 9324g*3m - 12m2 Find the third derivative of 948j*5 + 932j*2. 56880j*2 What is the derivative of -4b*3c*2s - 4b3c*2 - 84b*3s - 6b2c*2 - 4bc2 wrt s? -4b*3c*2 - 84b3 What is the second derivative of -g3 - 4296g2 + 8599g? -6g - 8592 Find the second derivative of -222c*2k*2 - 195ck2 + c + 2k*2 wrt c. -444k*2 Find the second derivative of -219c*3 - 394c + 1. -1314c Find the second derivative of -2020k*2nu3 + k2nu - k2u*3 + kn + 52ku*3 - 3n + 2u3 + 2u*2 wrt k. -4040nu3 + 2nu - 2u*3 Find the second derivative of 7977d*5 + 6d - 268 wrt d. 159540d3 What is the second derivative of 42w*3z*3 - 21w*3z - 9w2z + w*z wrt z? 2	{ "pile_set_name": "DM Mathematics" }
ind the common denominator of -35/36 and -31/1002. 6012 Calculate the least common multiple of 207 and 3542. 31878 Calculate the least common multiple of 12 and 243. 972 What is the smallest common multiple of 245 and 343? 1715 Find the common denominator of 61/9 and -127/24. 72 What is the least common multiple of 75 and 675? 675 Find the common denominator of 69/350 and 32/125. 1750 What is the least common multiple of 24 and 24? 24 Calculate the least common multiple of 44 and 208. 2288 Calculate the common denominator of 87/176 and -38/121. 1936 Calculate the smallest common multiple of 7 and 87. 609 Calculate the common denominator of -59/176 and 35/36. 1584 Calculate the lowest common multiple of 66 and 297. 594 What is the common denominator of -51/20 and 151/84? 420 Calculate the smallest common multiple of 77 and 77. 77 Calculate the common denominator of 29/4 and -101/772. 772 Find the common denominator of 107/80 and -13/220. 880 What is the common denominator of -99/284 and 137/60? 4260 What is the lowest common multiple of 135 and 50? 1350 What is the common denominator of -27/4360 and 17/140? 30520 Find the common denominator of 137/4930 and -17/30. 14790 Calculate the smallest common multiple of 126 and 133. 2394 Calculate the common denominator of 109/525 and -59/25. 525 What is the common denominator of -121/252 and 29/140? 1260 What is the smallest common multiple of 404 and 4? 404 Calculate the common denominator of 17/423 and 55/12. 1692 Calculate the smallest common multiple of 192 and 30. 960 Calculate the smallest common multiple of 14372 and 40. 143720 Calculate the common denominator of -25/8 and 43/620. 1240 Calculate the common denominator of 107/760 and 49/1045. 8360 What is the lowest common multiple of 24 and 20? 120 What is the lowest common multiple of 152 and 320? 6080 Calculate the lowest common multiple of 9 and 3492. 3492 What is the smallest common multiple of 15 and 867? 4335 Calculate the lowest common multiple of 8224 and 16. 8224 Find the common denominator of 17/874 and -83/368. 6992 Find the common denominator of 37/33 and 107/276. 3036 What is the least common multiple of 20 and 210? 420 Calculate the least common multiple of 50 and 20. 100 What is the lowest common multiple of 78 and 4? 156 Calculate the common denominator of 27/5 and 62/105. 105 What is the common denominator of -23 and 93/10? 10 Find the common denominator of -37/131 and 27. 131 What is the smallest common multiple of 60 and 1116? 5580 What is the common denominator of -83/885 and 125/12? 3540 What is the common denominator of 77/15 and -31/222? 1110 What is the least common multiple of 9 and 54? 54 Find the common denominator of 193/330 and 103/30. 330 Calculate the common denominator of 69/40 and -21/104. 520 Calculate the least common multiple of 226 and 12. 1356 Calculate the common denominator of 35/41 and -111/70. 2870 What is the common denominator of -5/3913 and -62/35? 19565 Calculate the common denominator of 5/3 and 28/1075. 3225 What is the smallest common multiple of 14 and 162? 1134 What is the lowest common multiple of 286 and 260? 2860 Calculate the least common multiple of 126 and 126. 126 What is the common denominator of -61/4335 and -35/867? 4335 Calculate the smallest common multiple of 245 and 42. 1470 Calculate the least common multiple of 33 and 387. 4257 What is the common denominator of -151/2856 and -17/44? 31416 What is the common denominator of 85/16 and 73/172? 688 What is the common denominator of 137/490 and 79/1078? 5390 What is the least common multiple of 22 and 44? 44 What is the common denominator of 13/24 and 5/171? 1368 What is the common denominator of 67/1526 and -13/70? 7630 Calculate the lowest common multiple of 3058 and 198. 27522 Calculate the lowest common multiple of 1350 and 45. 1350 Find the common denominator of 37/10 and -29/5825. 11650 Find the common denominator of -34/777 and -69/370. 7770 What is the common denominator of 85/104 and 37/143? 1144 Calculate the least common multiple of 252 and 14. 252 What is the common denominator of -87/8 and -7/16? 16 What is the common denominator of -19/406 and 107/348? 2436 Calculate the lowest common multiple of 8 and 484. 968 What is the lowest common multiple of 23 and 184? 184 What is the common denominator of 13/20 and -97/52? 260 What is the common denominator of 31/170 and 47/10? 170 Calculate the common denominator of 197/8250 and 43/12. 16500 What is the common denominator of -151/138 and 49/128? 8832 What is the smallest common multiple of 40 and 36? 360 Find the common denominator of -11/20 and 29/2084. 10420 Calculate the lowest common multiple of 1050 and 70. 1050 Calculate the smallest common multiple of 360 and 8. 360 Calculate the common denominator of 95/296 and -83/296. 296 Find the common denominator of 131/18 and 25/3. 18 Calculate the common denominator of -37/1845 and 7/150. 18450 Calculate the least common multiple of 44 and 9784. 107624 What is the common denominator of -75/272 and -59/28? 1904 What is the smallest common multiple of 9 and 548? 4932 Calculate the smallest common multiple of 1 and 60. 60 Calculate the lowest common multiple of 1100 and 20. 1100 What is the least common multiple of 150 and 1150? 3450 Calculate the least common multiple of 9 and 17618. 158562 Calculate the smallest common multiple of 25 and 10. 50 What is the common denominator of -5/9048 and -73/16? 18096 Calculate the least common multiple of 96 and 24. 96 What is the smallest common multiple of 3 and 314? 942 Calculate the common denominator of -123/1520 and 81/320. 6080 Calculate the least common multiple of 5944 and 18. 53496 Find the common denominator of -79/488 and -59/20. 2440 What is the lowest common multiple of 267 and 21? 1869 What is the smallest common multiple of 1880 and 1692? 16920 Calculate the least common multiple of 444 and 259. 3108 Calculate the common denominator of -163/126 and -3/4. 252 Calculate the common denominator of 55/26 and 127/24. 312 Calculate the least common multiple of 12 and 194. 1164 Calculate the least common multiple of 20 and 25322. 253220 What is the lowest common multiple of 44 and 55? 220 Calculate the smallest common multiple of 1488 and 1. 1488 Calculate the lowest common multiple of 7826 and 4214. 54782 Calculate the least common multiple of 10 and 20. 20 What is the least common multiple of 5595 and 6714? 33570 Find the common denominator of 22/15 and -41/15. 15 What is the lowest common multiple of 21 and 3? 21 What is the lowest common multiple of 20 and 1848? 9240 Calculate the lowest common multiple of 2088 and 116. 2088 Find the common denominator of 65/8 and -57/16. 16 Calculate the lowest common multiple of 2556 and 8. 5112 What is the lowest common multiple of 25 and 20? 100 Calculate the lowest common multiple of 6 and 48. 48 What is the lowest common multiple of 4 and 11161? 44644 Calculate the least common multiple of 7498 and 10. 37490 Calculate the common denominator of -85/2 and -101/16. 16 What is the common denominator of -65/66 and -26/7? 462 Calculate the least common multiple of 20 and 2288. 11440 What is the lowest common multiple of 6 and 1366? 4098 What is the least common multiple of 3 and 2759? 8277 Calculate the common denominator of 3/55 and -43/2730. 30030 Find the common denominator of 107/176 and -95/4928. 4928 Calculate the common denominator of 107/1200 and -86/15. 1200 Calculate the common denominator of 33/8 and -71/596. 1192 What is the common denominator of 13/9 and -16/11? 99 Calculate the common denominator of -41/198 and 25/432. 4752 Calculate the least common multiple of 243 and 378. 3402 What is the least common multiple of 1001 and 143? 1001 What is the least common multiple of 2 and 52? 52 What is the smallest common multiple of 22 and 1390? 15290 Calculate the common denominator of 51/5 and -48. 5 Calculate the common denominator of -40/49 and 143/2058. 2058 What is the common denominator of -46/81 and 14/15? 405 Calculate the lowest common multiple of 176 and 112. 1232 Calculate the smallest common multiple of 14 and 24. 168 Calculate the common denominator of 68/219 and 97/1460. 4380 Calculate the common denominator of 20/31 and -85/2	{ "pile_set_name": "DM Mathematics" }
? 1 Suppose 2o - 533 = -23. Let r = o - 112. What is the hundreds digit of r? 1 What is the hundreds digit of (-50)/225 + (-27418)/(-18)? 5 Let t = 6508 - 4338. What is the units digit of t? 0 Let d = -215 - -278. What is the units digit of d? 3 Suppose -4k - 3z = -32, -2k + 7k = 4z + 9. What is the units digit of (-31 + 13)k/(-2)? 5 Let a(y) = 4y*2 - 2y + 1. Let f be a(1). Suppose 4n + 406 = 5h, -7 = fh - 2n - 251. What is the units digit of h? 2 Let g(k) = -22k - 160. What is the hundreds digit of g(-23)? 3 What is the units digit of (506/33 - 12)33? 0 Suppose -k - 4 = -0k, 2w - k = 8. Suppose -3 = -wr + 5. Suppose 0 = -rx + 4, -3d - x = -2x - 68. What is the units digit of d? 3 Suppose -25 = -5v, 0 = 2k - 11v + 16v - 8335. What is the hundreds digit of k? 1 Let y = 486 - -429. What is the tens digit of y? 1 Let y(p) = p*2 + 4p - 7. Let w be (75/(-18) + (-4)/(-6))2. What is the units digit of y(w)? 4 Let f(z) = -4z*3 + 3z*2 + 6z + 6. Let j be f(-3). Let k = -82 + j. What is the tens digit of k? 4 Let k(n) = -n*2 + 12n + 3. Suppose 0w - 30 = -3u - 3w, 4u = 3w + 54. Let x be k(u). Suppose 0 = 5v - xv - 38. What is the tens digit of v? 1 Let l(u) = 56u*2 - 45u - 266. What is the tens digit of l(-6)? 2 Let f(q) = 67q - 8. Let z be f(-4). Let l be (-39)/2z/18. Suppose 0 = -4a - 5p + 226, -5a + 4p - 2p = -l. What is the tens digit of a? 5 Suppose b = 3 - 1. What is the units digit of (-41)/(3 + (b - (-11)/(-2)))? 2 Suppose -4t - 74 = 62. Let b be 10/45 - t/9. Let f = b + 11. What is the units digit of f? 5 Let w(s) = 2s3 + 2s*2 + 4s + 790. What is the units digit of w(0)? 0 Let u(d) = 46d + 1063. What is the thousands digit of u(45)? 3 Let t be 17/5 + 2/(-5). Let i(a) = -6a - 12. Let v be i(-7). Suppose v = p - t. What is the units digit of p? 3 Suppose -2j + 11654 = 4p, 2p + 4j - 1538 - 4280 = 0. What is the thousands digit of p? 2 Let m be 9/(-6) + 2/((-8)/(-442)). Suppose 3h + 5x = -76 + 382, -4x + m = h. What is the tens digit of h? 9 Let k(o) = 107o + 11. What is the units digit of k(3)? 2 Let y be -8 + (-3 - (-21)/(6 + -3)). Let f(k) = -2k3 + k2 + 6k - 4. What is the units digit of f(y)? 6 Let n = 229 - -375. What is the units digit of n? 4 Let i = -119 - -121. Suppose -19b + 2016 = ib. What is the units digit of b? 6 Let d(t) = 7t2 + 17t - 45. What is the tens digit of d(9)? 7 Let c(j) = 5j + 1. Let a be (21/(-9) - 0)-3. Let q(m) = -m*3 + 6m*2 + 7m + 2. Let h be q(a). What is the units digit of c(h)? 1 Let o(s) = 36s2 - 9s - 31. What is the tens digit of o(-4)? 8 What is the hundreds digit of (5 - 6129/(-5)) + 2/10? 2 Let n = -72 - -135. What is the units digit of n? 3 What is the tens digit of 7 + 1 - (-15504)/19? 2 Let a = 416 - 142. What is the hundreds digit of a? 2 Suppose -802 = -3u - 2x, 349 = 3u + 5x - 441. Suppose 4l + 4f - 316 = 0, u = 4l + 3f - 43. Let j = l - 25. What is the tens digit of j? 5 Let u(n) = 14n + 1177. What is the thousands digit of u(0)? 1 Suppose 8f - 20 = 4f. Suppose 3v - 432 = -5o + 684, 5v + 1100 = fo. What is the hundreds digit of o? 2 Suppose -4q - 3j + 21 = 0, 4q - 3j = -q + 6. Suppose 0l + 32 = 2l. Suppose -l = -qa + 92. What is the tens digit of a? 3 Suppose 4y - 5w + 14 = 34, -5y - 3w = 12. What is the units digit of (43/1 - y) + (2 - 1)? 4 Suppose -2i = -8 + 14, j = -i + 391. What is the units digit of j? 4 Suppose 2z - 4o = 122, 14o - 10o = -5z + 375. What is the tens digit of z? 7 Let i be -19 - -18 - (-388)/(-2). Let f = 394 + i. What is the tens digit of f? 9 Let n(r) = -r*2 + 3r + 6. Suppose -o + 4 = 2. Suppose 4g + 21 = 5x + o, x - 5g = 8. What is the units digit of n(x)? 6 Let h = -37 + 45. Suppose -hb + 360 = -168. What is the units digit of b? 6 Suppose 0 = 6c - c + 40. What is the units digit of (0/(-5))/(-3) - c? 8 Suppose -10113 = -9t + 1155. What is the tens digit of t? 5 Suppose 2l - 4248 = -22l. What is the tens digit of l? 7 Let z be 1(11 - 3)/4. Suppose -4v + 63 - 8 = -d, 0 = -zv - 4d + 32. What is the units digit of v? 4 Suppose 19p = 17p + 50. Suppose -p = 5f, 67 = i - 4f - 6. What is the units digit of i? 3 Let f = 1980 + -1962. What is the units digit of f? 8 Suppose 8t - 1220 = 3996. What is the units digit of t? 2 Let y be (-40)/(-18) + (-4)/18. Suppose 4q - yl - 628 = 0, 6l - 6 = 3l. What is the units digit of q? 8 Let x(y) = -y2 + 11y - 7. Let a be x(10). Suppose -aw + 200 = w. Suppose -5p - r + w + 55 = 0, 2r = 0. What is the tens digit of p? 2 Let z = -5 - -12. Suppose 0 = 3p - 5d + 3, p + d - z = -0p. Suppose 3 = -q - w + 25, -3q + 71 = pw. What is the tens digit of q? 1 Suppose 3q - 6519 = -5f + 723, 0 = -f + 3q + 1452. What is the thousands digit of f? 1 Let o(j) = j2 + 18j - 35. Let v = 93 - 119. What is the hundreds digit of o(v)? 1 Let o(h) be the first derivative of 7h3/3 + 2h*2 + 2h - 4. Let q(l) = -l*3 + 2l*2 + l + 4. Let v be q(3). What is the units digit of o(v)? 2 Suppose 4p - 1018 = -2h, h = -0p - 4p + 509. What is the tens digit of h? 0 Suppose -3z = 3s + s + 664, -4 = -z. Let w = 294 + s. What is the tens digit of w? 2 Let a(d) = 7d*2 - 4. Suppose 0 = h + r + 2 - 0, 4h = 4r. Let n = 4 + h. What is the tens digit of a(n)? 5 Let m(i) = 8i - 40. Let j be m(7). Suppose -jk + 14k = -20. What is the tens digit of k? 1 What is the tens digit of 394/4 - (-2)/4? 9 Let u = 302 + -213. What is the units digit of u? 9 Let a = -34 - 66. Let s = a - -63. Let o = s + 44. What is the units digit of o? 7 Let y(o) = -4o + 7. Let g(c) = 2c - 5. Let l be g(5). Suppose 4k + 2s = -22, -23 = lk - 2s + 3s. What is the units digit of y(k)? 3 Suppose 4t = -20 + 184. Let x = t - 23. Suppose 4h = 3l - l - 12, 4h - x = -3l. What is the units digit of l? 6 Suppose -14 = -2m - 0k + 2k, -15 = 3k. Let b(l) = 13l - 5. What is the tens digit of b(m)? 2 Let s(g) = g3 + 32g*2 - 42g + 273. What is the tens digit of s(-30)? 3 Let s = 14 - 9. Suppose -sf = -4z + 22, -5z = -f + 17 - 55. Suppose 2i + j - 38 = 0, -5i - 3j = -zj - 80. What is the tens digit of i? 1 Suppose 4v - 2v - 10 = 0. Suppose 0 = -0i - 2i - 5n + 171, -390 = -vi - 5n. What is the units digit of i? 3 Let p(q) = -4q + 29 + 2q + q. Let x be p(13). What is the units digit of -4(-6 - x/(-4))? 8 What is the units digit of (-21)/((-168)/2096)1/1? 2 Let s be 0 - 1(-5)/1. Suppose -7i + 72 = -si. What is the units digit of i? 6 Let w(a) = -4a*3 - 1 + 4a3 + a3 - 3a2 - a + 7a*2. Let r be w(-4). Suppose -rn - 5d + 34 = 0, -2n = -0n + d - 32. What is the tens digit of n? 1 Let q be 273/(-78) - 6/4. Let m(j) = -3j2 + j - 23. Let t(i) = i2 + 11. Let v(h) = -2m(h) - 5t(h). What is the tens digit of v(q)? 2 Suppose -35 = -5q + 290. Suppose -x + q = -2f - 0, -187 = -3x - 2f. What is the units digit of x? 3 Let g(n) = n*2 + 6n + 1 + 0n2 + 6. What is the units digit of g(-11)? 2 Let b = 1135 - 541. What is the hundreds digit of b? 5 What is the hundreds digit of 36/((3/(-50))/((-144)/45))? 9 Let x(i) be the second derivative of 1/6i*3 - 5i - 3/2i2 + 0. What is the units digit of x(8)? 5 Let o be 1441/7 - (-10)/70. Suppose g - o = -4v, -2v - 2g = 2g - 96. What is the units digit of v? 2 Let g be -3 + (139)/3. Let f = g + -70. Let i = -17 - f. What is the units digit of i? 7 Let t be -60((-12)/15 - 0). Suppose -2g + 23 = -33. Let c = t - g. What is the units digit of c? 0 Suppose 20g + 1060 = 24g. What is the tens digit of g? 6 Let s(o) = 86o - 22. Let k be s(9). Suppose -4l - 304 = -k. What is the tens digit of l? 1 What is the units digit of (-8)/6(-207)/6? 6 Let s = -33 + 65. Let o = s - -76. What is the units digit of o? 8 Let x = 4 - -2. Suppose xq = 4q + 84. Suppose 4d - q = d. What is the tens digit of d? 1 Suppose -3b - 94 = -259. Suppose 0 = -4v - b + 167. What is the tens digit of v? 2 Suppose 0 = -36q + q + 71015. What is the units digit of q? 9 Suppose 5q - 2a = -4a + 14876, -a - 5945 = -2q. What is the hundreds digit of q? 9 Suppose o - 3 = 3l + 9, 5l + 2o + 20 = 0. Let j(f) = -2f3 - 3f**2 - f - 9. What is the units digit of j(l)? 5 Let g = 3139 +	{ "pile_set_name": "DM Mathematics" }
*3 + ng*2 + w and give b. 60 Express -115 + 450 - 4c*2 - 114 - 49c - 109 - 113 as xc + n + oc*2 and give x. -49 Rearrange -988f*2 - 797f*2 - 568f*2 - 965f*2 + 2 + 1119f*2 to u + mf + jf2 and give j. -2199 Rearrange (0 - 1 - 109x + 101x)(-4 + 4 + x*2)(-9x - 10 + 10) to the form hx*3 + dx*2 + jx + u + lx4 and give h. 9 Express -4253 - 7265j + 4253 in the form gj + k and give g. -7265 Rearrange (-11511i + 5693i + 59 + 5766i)(i2 - i2 + 2i*2) to the form n + ai + zi3 + wi*2 and give w. 118 Express 0 + 20z - 4 + 164 - 24z + 361 as i + oz and give i. 521 Rearrange -10i + 4 - 12i*3 - 6755905i*2 + 6755905i*2 to the form hi*2 + li + s + qi3 and give l. -10 Express (-153 + 4 - 121)((-6 + 2 + 2)(-u - 3u + 2u) + 2u + 0 + 0 + 4u - 2u + 2u - 2u - u + u) as p + su and give s. -2160 Express (-x - 3x - 3x)(-24x + 11x - 25x)(-x - x - x) in the form zx + t + qx*2 + ix*3 and give i. -798 Express -26117 + 52234 - 26117 - 37017q as kq + p and give k. -37017 Rearrange -2067 + 1311j + 4134 - 2067 to the form pj + n and give p. 1311 Rearrange (-x + 4x - 88550 - 90980 + 173125)(-1 + 2 + 0) to the form kx + y and give y. -6405 Rearrange (9 + 13 + 4)(-40 + 846 - 2c - 3751 - 479) to the form oc + m and give o. -52 Rearrange (673 + 8x - 673)(-43 + 67x + 22 + 22) to the form ix2 + cx + y and give i. 536 Rearrange -1 - 41o3 + 2o*2 + 4o*4 + 0 - 14o*4 + 12o*3 + 30o*3 - 9o to uo3 + c + fo*4 + qo + ao2 and give a. 2 Rearrange -19m*2 - 26m*2 - 14m + 30m2 + m - 7m to a + tm2 + qm and give q. -20 Express -4 - 20f3 + 25f*2 - 67f*2 + 3 + 17f*3 as v + gf + xf3 + mf*2 and give v. -1 Express 1208 + 571 + p - 291 as b + jp and give b. 1488 Rearrange -17 - 2881806l3 + 413l + l2 - l2 + 2881807l3 to the form wl*3 + kl + q + zl2 and give k. 413 Rearrange -1 + 3 + 2782b*2 + 121b + 31b - 152b to the form pb2 + w + qb and give p. 2782 Rearrange (-6b - 17b - 9b)(-2067 - 19b + 2067)(-7 + 6 + 8) to the form g + zb2 + ib and give z. 4256 Rearrange 2g2 + 108g4 - g2 + 102g4 - 130g - 6g2 - 203g*4 to vg*3 + wg*2 + og + ug4 + t and give o. -130 Rearrange -2418k - 339k - 1190k + k*2 to the form wk*2 + u + yk and give w. 1 Express (-4137 + 2110 - 12n + 2101 + (3n + 2n - 3n)(-3 - 1 + 2))(-2n - 2n + 2n)(0 + 6 - 5) as zn2 + g + hn and give h. -148 Express -25 + 49q2 + 1 + 9 + 17 + 2q + 0q as vq*2 + zq + p and give p. 2 Rearrange -4s3 + s2 - 2s2 - s4 + 3s4 + 185179 + s3 - 185177 - 24s to the form us4 + os*3 + j + ys*2 + xs and give u. 2 Express (4 - 1 - 2)(11c + 30c + 11c - 6 + 44c) as ic + a and give a. -6 Express -2s - 3s + 4s + (-2 - 1 + 2)(-2s - 4s + 4s) - 8 - 35 + 54 - 10s + (2s + 8s - s)(-2 - 4 + 4) in the form cs + w and give w. 11 Express (-3 + s + 6 - 2 + (0s + 3s - 2s)(1 - 5 + 2) + s + 1 - 1 + 4s + 0s - 6s)(0 + 51 - 11)(4s - 7s + 8s) as qs + y + ms*2 and give q. 200 Rearrange (5642f + 12542f + 0 - 3226f + 0)(-1 + 4f + 1) to rf + k + zf*2 and give z. 59832 Express (2o + 0o - o)(-19o + 16o - 47o)(-5o2 + 5o*2 - 3o*2) + 8o*4 - 47 + 47 as lo*4 + f + uo*2 + to*3 + so and give l. 158 Express 5s2 - 31s*2 + 4s*2 - 13s*2 - 251 + 27s*2 in the form m + ks + ws2 and give m. -251 Rearrange -1336n*2 + 1148 + 2669n*2 - 1332n*2 to u + hn*2 + ln and give h. 1 Rearrange (-7908u - 4255 + 7906u - 5307)(-5u*3 + 4u*3 + 0u*3) to p + au*2 + qu + ju4 + xu*3 and give x. 9562 Express 511y - 1551 + 1551 as jy + p and give j. 511 Rearrange 2j*3 + 2 + 23j*2 + 8j*3 - 15038j + 15036j - 24j*2 + 12j*4 to c + oj + sj3 + bj*4 + zj*2 and give z. -1 Rearrange (-937 + f - 923 + 1781)(23f - 3f - 3f) to c + sf + of2 and give s. -1343 Rearrange -14o*3 + 62 - 5o3 + o2 + 14o3 + 3o3 + (o2 + 7o2 + o2)(3 + o - 3) to the form zo2 + m + ko + vo3 and give z. 1 Express -3o*3 + 8 + 170 + 41886o + 3o4 - 41885o - o*2 as zo*3 + ro + l + to4 + do*2 and give d. -1 Rearrange 1159r*3 - 583r*3 + r + 2r*2 - 579r*3 - 31r*4 to the form xr*4 + pr*2 + br + zr3 + i and give i. 0 Express (1 + 1 - 3 + 6 - 4 + 8 + (-1 - 3 + 2)(0 - 3 + 4) + 3 - 6 + 1)(863g - 73g - 102g) in the form x + mg and give x. 0 Express 2 - r3 - 4r*2 - 24r*2 - 266305r + 266278r as wr + y + cr3 + mr*2 and give y. 2 Rearrange -349i + 325i + 6 + 6144i*2 - 6145i*2 to the form v + oi + ui2 and give o. -24 Rearrange (-5q + 7q + 2q)(2q + 10q + 19q) + (-3 + 4 - 2)(-10q2 - q2 - 2q2) to yq*2 + x + mq and give y. 137 Rearrange -307a2 + 3612 + 788a*2 - 10837 + 3608 + 3613 + 2a*3 to g + ta + sa2 + wa*3 and give t. 0 Rearrange (-k + 5k - 3k - 2)(-186 + 414 - 169)(-1 + 3k*2 + 1) to fk + l + nk3 + ok*2 and give n. 177 Rearrange -8211d*2 - 8214d*2 + 60 + 5d + 16428d2 to ad*2 + y + sd and give s. 5 Express -565 - g*3 + 968g + 247 + 2g2 + 318 as z + bg + ug2 + xg*3 and give x. -1 Express -2k*2 - 17k + 4230k4 - 4231k*4 - 2k*3 + 2k*3 + 0k*2 - 29 in the form ok + j + wk4 + ak*2 + pk*3 and give a. -2 Express (-5s*4 + 0 - 2 + 3s*4)(149 - 1036 + 87) as fs4 + zs*3 + gs*2 + v + ms and give v. 1600 Express (14 - 14 + 5m2)(-2319 - 752 + 978) + (-4 + 2m + 4)(m + 3m - 3m) in the form pm2 + c + om and give p. -10463 Rearrange 67u - 10u - 186u - 5 - 141u + 2u2 to v + fu*2 + ju and give j. -270 Rearrange 53832k - 107928k + 4k2 + 53903k to m + wk2 + dk and give w. 4 Express (4 - 7 + 280j - 277j)((-16j2 + j2 + 5j2)(0 + 2j + 0) + 5j*3 + 5j*3 - 5j*3) as wj*2 + bj*4 + a + fj + kj3 and give b. -45 Express (-j2 - j2 + 0j*2)((0j - 2j + 0j)(-3 - 2 + 3) - 831j + 190j - 736j) as v + fj*2 + aj*3 + qj and give a. 2746 Rearrange (-54 - 142k2 - 58 + 112)(-260 + 492 - 16) to the form gk2 + j + xk and give g. -30672 Express (0r + 4r - 6r)(-281r - 625r + 178r) + 2 - 71r + 10r2 + 71r - 2 in the form sr + hr*2 + t and give s. 0 Rearrange 22701t - 5860t + 13 - 5762t - 5975t - 6055t to ft + r and give r. 13 Express (-7 + 7 + 6f*3)(144 - 311 + 471 + 647) in the form of3 + y + xf*2 + af and give y. 0 Rearrange -5194w2 - 3 + 121w*3 - 5202w*2 + 10395w*2 to aw*3 + kw*2 + mw + h and give k. -1 Express 961 - 10j - 1930 + 969 + 51j - 96j3 in the form hj + qj2 + yj*3 + u and give u. 0 Rearrange (-l - 2l*2 + l)((l - 1 + 1)(61 - 18 + 70) - 3l + 2 + 8l + 1) to xl*2 + cl + b + zl3 and give b. 0 Rearrange 33008 + 9160g*4 - 33008 + (2g*3 + 2g*3 - 3g*3)(-2g + 6g - 3g) to ng*3 + v + hg*4 + pg + zg2 and give h. 9161 Rearrange -2j - 20j2 + 27498j*4 - 13679j*4 - 13698j*4 to i + qj*4 + dj*2 + sj*3 + bj and give s. 0 Express -28896589b - 3b*2 + 28896589b + 113b3 as tb*3 + w + mb*2 + cb and give m. -3 Rearrange -2m3 + 124 - 90 - 14m*2 - 3m + m - 46 to am2 + hm*3 + tm + v and give t. -2 Rearrange -279f2 - 2f*4 + 2f - 361f2 + 6 + 675f*2 + 2f*3 to gf + mf3 + vf*2 + lf*4 + d and give g. 2 Rearrange 133t*2 - 54896t + 109789t - 16t*2 - 54891t - 3 + (2t2 + 2t*2 - 6t*2)(1 - 1 - 2) to the form h + xt + rt*2 and give x. 2 Rearrange 1009s*2 + 158 + 6s - 157 - s - 10s to ws*2 + d + cs and give d. 1 Rearrange -257 - 1382y + 7285y + 257 + 5163y to the form ny + f and give n. 11066 Rearrange (-3 - 7z + 3)(-13 - 230z + 76z + 87z) to l + az + oz2 and give o. 469 Rearrange (18 - 10 + 11)(-53z - 15z - 55z + 3 + 2z - 3 + (5z - z - 2z)(6 - 2 - 2)) to the form h + mz and give m. -2223 Express 3h3 + 7746h + 3 - 4h3 + 3h*2 - 6h*4 - 7713h as y + ih2 + wh*3 + dh + oh4 and give y. 3 Rearrange -2i - 19323i2 + 0i + 65 + 9650i2 + 9637i*2 to vi*2 + bi + r and give v. -36 Rearrange (0 - 3 - 9 + (6 - 1 - 3)(15 - 11 + 10) + 2 - 4 + 1)(0y + y - 7y) to the form s + dy and give d. -90 Express -30c	{ "pile_set_name": "DM Mathematics" }
4, -20, 8, 3, 7, -1. -20, -1, 3, 4, 7, 8 Sort -5, -304/11, -2/3, -0.3, 3. -304/11, -5, -2/3, -0.3, 3 Put -0.1, -2/2273, 5 in decreasing order. 5, -2/2273, -0.1 Put -13, -4, -526, -5, 2 in ascending order. -526, -13, -5, -4, 2 Sort 4, 3, -100 in ascending order. -100, 3, 4 Put 2/9, -1/3, -1766 in descending order. 2/9, -1/3, -1766 Sort 4, 19/2, -3/8, 16, 5, 13. -3/8, 4, 5, 19/2, 13, 16 Put 4, -4, 19, 216, 3 in increasing order. -4, 3, 4, 19, 216 Put 2/53, 0.5, -2, 297 in descending order. 297, 0.5, 2/53, -2 Sort -4, 19, -27, 5, 1, 4 in decreasing order. 19, 5, 4, 1, -4, -27 Sort -701, -4, 3, 11. -701, -4, 3, 11 Sort 15, -1195, 1 in descending order. 15, 1, -1195 Put -2, -4, 2, 74, -93, 4 in increasing order. -93, -4, -2, 2, 4, 74 Sort -1, -18, 2, -11, 5 in increasing order. -18, -11, -1, 2, 5 Put -20, 2, -4, -3, 6 in decreasing order. 6, 2, -3, -4, -20 Sort 1635, -5, -0.1, 0.5, 0.1 in increasing order. -5, -0.1, 0.1, 0.5, 1635 Sort -5, 10, -2, 1921 in ascending order. -5, -2, 10, 1921 Put -1, 725, 30 in decreasing order. 725, 30, -1 Sort -2, 3, 10, -11, 0 in decreasing order. 10, 3, 0, -2, -11 Sort -262, -2/23, 0, 61 in decreasing order. 61, 0, -2/23, -262 Sort 0.4, 4/7, 3, -571, 0.3, -4/3 in decreasing order. 3, 4/7, 0.4, 0.3, -4/3, -571 Put 72, 0, -0.04 in ascending order. -0.04, 0, 72 Put -5742, 5, 0, -23 in decreasing order. 5, 0, -23, -5742 Put -30, 7, -380 in ascending order. -380, -30, 7 Put 6, 7, 57, 0 in decreasing order. 57, 7, 6, 0 Put 0, -3, 1, 3489, 14 in ascending order. -3, 0, 1, 14, 3489 Put -12, 0, -14, -1, 4, 17 in descending order. 17, 4, 0, -1, -12, -14 Sort 0.19, -100/3, -1/5, 0.49 in ascending order. -100/3, -1/5, 0.19, 0.49 Sort 2/13, 2796, 0.5, -0.1, 0.4 in decreasing order. 2796, 0.5, 0.4, 2/13, -0.1 Sort 1, -7, -5, 4, 9, 5 in decreasing order. 9, 5, 4, 1, -5, -7 Put -99, -5, -3, -18 in decreasing order. -3, -5, -18, -99 Sort 75, -1, 345, 5, -3, -5. -5, -3, -1, 5, 75, 345 Sort -0.2, 178, 3, 4, -0.5, -2 in ascending order. -2, -0.5, -0.2, 3, 4, 178 Put 3, 26, 4, 1, -3 in descending order. 26, 4, 3, 1, -3 Sort 1, -4, 45, -13 in descending order. 45, 1, -4, -13 Put -89, -10/13, -1/2 in decreasing order. -1/2, -10/13, -89 Sort 1/12, 3, -38, 7, 14/15 in decreasing order. 7, 3, 14/15, 1/12, -38 Put -4, 5, 258, -5, -285, 2 in increasing order. -285, -5, -4, 2, 5, 258 Put 2, -4, -5, 1, -257 in decreasing order. 2, 1, -4, -5, -257 Sort -16, 6, -1568 in decreasing order. 6, -16, -1568 Put -2, 2824, 19, 0 in ascending order. -2, 0, 19, 2824 Put -3, 3, -12, 0, -1, -30 in decreasing order. 3, 0, -1, -3, -12, -30 Sort -3, -6, 5420 in ascending order. -6, -3, 5420 Sort -4, 4, 95, -2, 108 in descending order. 108, 95, 4, -2, -4 Put -7, -0.4, -1/3, -17, 2, -10 in descending order. 2, -1/3, -0.4, -7, -10, -17 Sort -5, 4, 1, 2, -3, 174. -5, -3, 1, 2, 4, 174 Put 9, 2, 475, 1 in descending order. 475, 9, 2, 1 Put 2/7, 0, 2, 1.1, 0.2, 21 in descending order. 21, 2, 1.1, 2/7, 0.2, 0 Sort 186, -4, -1, 14 in descending order. 186, 14, -1, -4 Sort -0.5, 94.9, 15, 4 in decreasing order. 94.9, 15, 4, -0.5 Put -1, 0.135, 1, 4, -8 in descending order. 4, 1, 0.135, -1, -8 Put 13, -2, 39, 0 in descending order. 39, 13, 0, -2 Sort 2, 0, -1, 4, -52, 11 in decreasing order. 11, 4, 2, 0, -1, -52 Sort 2/9, 1, -3.6, -0.0989 in decreasing order. 1, 2/9, -0.0989, -3.6 Sort 2/9, -2, -4, 2, -6, -14/4835. -6, -4, -2, -14/4835, 2/9, 2 Sort 1, -29975, 5 in ascending order. -29975, 1, 5 Sort 1, 4, 7, 2, -179, -6. -179, -6, 1, 2, 4, 7 Put -9, -600, -1/3, 0.5, -0.1, 3/7 in decreasing order. 0.5, 3/7, -0.1, -1/3, -9, -600 Sort -5, 66, 32 in increasing order. -5, 32, 66 Sort -2/11, -8, 338, 0.1, 3/5. -8, -2/11, 0.1, 3/5, 338 Sort -2/3, -0.015, 2/11 in ascending order. -2/3, -0.015, 2/11 Sort -3, -32, -2, -2062. -2062, -32, -3, -2 Put -7, 1, -5, 6, 5, -1 in decreasing order. 6, 5, 1, -1, -5, -7 Put 9.3, -13, -2/11, 2 in descending order. 9.3, 2, -2/11, -13 Sort 2, -0.3, 0.002, -3, 1.4 in descending order. 2, 1.4, 0.002, -0.3, -3 Sort -1/2, 5/52, 11/8, -5. -5, -1/2, 5/52, 11/8 Put -3.5, 2/13, 0, 0.09, -11, 0.2 in ascending order. -11, -3.5, 0, 0.09, 2/13, 0.2 Put -2, 5, 7516 in decreasing order. 7516, 5, -2 Put -45, -3, 3, 130 in ascending order. -45, -3, 3, 130 Put -3.1, 2/3, -4, 66 in decreasing order. 66, 2/3, -3.1, -4 Sort 23474/5, -0.3, -2 in descending order. 23474/5, -0.3, -2 Put -16, -57, 0 in increasing order. -57, -16, 0 Sort -7292, 0.2, 0.1, -0.4 in decreasing order. 0.2, 0.1, -0.4, -7292 Put -4/9, -1/6, -0.2, -1, -2/11661 in decreasing order. -2/11661, -1/6, -0.2, -4/9, -1 Sort -51, -74, 3, 2, 4 in decreasing order. 4, 3, 2, -51, -74 Sort -3/4, -0.6, 458 in decreasing order. 458, -0.6, -3/4 Sort 1, -280, 3, -21. -280, -21, 1, 3 Put 2, 0.2, -3/5, 3, 178, -1 in ascending order. -1, -3/5, 0.2, 2, 3, 178 Sort -4, 1199, -105 in decreasing order. 1199, -4, -105 Sort -26/11, 8, 3, -10/7 in descending order. 8, 3, -10/7, -26/11 Sort -77, 5, -3, -53 in descending order. 5, -3, -53, -77 Sort 4, -8, 41/6, -0.5 in ascending order. -8, -0.5, 4, 41/6 Put 3, -3, 4, -1, -2, -334 in descending order. 4, 3, -1, -2, -3, -334 Sort -0.8, 2/3, 0, -2/11, -0.6. -0.8, -0.6, -2/11, 0, 2/3 Put -8, 357, 1/4, -0.5 in ascending order. -8, -0.5, 1/4, 357 Put -33, -9, 1284 in ascending order. -33, -9, 1284 Put 5, -3, 3, -12, -27, 0.4 in ascending order. -27, -12, -3, 0.4, 3, 5 Sort 22, -10, 0, -12, -5, 5 in descending order. 22, 5, 0, -5, -10, -12 Put -1, -3, -2, 2, 9018, 1 in descending order. 9018, 2, 1, -1, -2, -3 Put -5, 537, 5, 11 in decreasing order. 537, 11, 5, -5 Put -4, -2/883, -460 in descending order. -2/883, -4, -460 Put 0.3, -17846, -2/5 in decreasing order. 0.3, -2/5, -17846 Sort 6, 511, -4, -2, 0 in ascending order. -4, -2, 0, 6, 511 Sort -1, -13, 9/4, 3/7, -5. -13, -5, -1, 3/7, 9/4 Sort -907, 8, -86. -907, -86, 8 Put -0.1, -2/5, 2/11, -7498, -0.2 in descending order. 2/11, -0.1, -0.2, -2/5, -7498 Sort -1/3, 0.278, 0.5, -2, -2/145. -2, -1/3, -2/145, 0.278, 0.5 Put -2, 50, 1, 3, 2 in descending order. 50, 3, 2, 1, -2 Sort 34, -7, 5, 0, -13 in decreasing order. 34, 5, 0, -7, -13 Put 2, 4.2, 442, 0.5 in decreasing order. 442, 4.2, 2, 0.5 Sort -23, 202, 2 in descending order. 202, 2, -23 Put -2/13, -7/76, 18 in decreasing order. 18, -7/76, -2/13 Sort -4/9, -0.4, 0.5, -69.8, 1/5 in decreasing order. 0.5, 1/5, -0.4, -4/9, -69.8 Put 1, 12, -5, 23, -6 in descending order. 23, 12, 1, -5, -6 Put -248, 1237, -5 in ascending order. -248, -5, 1237 Put -5, 0.5, 2/9, -20/29, 0.3 in descending order. 0.5, 0.3, 2/9, -20/29, -5 Put 1, -165, 125, 3 in decreasing order. 125, 3, 1, -165 Put -0.5, -3/17, 0.0046, 3/5, -1 in descending order. 3/5, 0.0046, -3/17, -0.5, -1 Put -392, 3/5, 5, -4 in descending order. 5, 3/5, -4, -392 Sort 1, -20, 548, -2 in increasing order. -20, -2, 1, 548 Put -18, 2, -3, 82 in descending order. 82, 2, -3, -18 Put 3, -39.13, 2, 1, -2, 1/5 in descending order. 3, 2, 1, 1/5, -2, -39.13 Put 3064, -2, -4, 26, -1 in descending order. 3064, 26, -1, -2, -4 Sort 13, 11725, 3 in ascending order. 3, 13, 11725 Put 1, -632, -122 in descending order. 1, -122, -632 Sort 2, -2/17, -1, -2/181. -1, -2/17, -2/181, 2 Put 0, 16/7, 157, -4, -3 in increasing order. -4, -3, 0, 16/7, 157 Put 0, 4, 2, -16, -39 in descending order. 4, 2, 0, -16, -39 Put 17, 4, -6417 in decreasing order. 17, 4, -6417 Sort 2, 5, -1, -4, -72/7, -9. -72/7, -9, -4, -1, 2, 5 Put 268, 2, -0.2 in descending order. 268, 2, -0.2 Sort -2424575, 1/6, 0.5 in ascending order. -2424575, 1/6, 0.5 Sort -447, 2, -3, -65, 0 in decreasing order. 2, 0, -3, -65, -447 Sort -2, 16, 602 in ascending order. -2, 16, 602 Sort -310, 0.003, 5 in increasing order. -310, 0.003, 5 Sort -41, -2, -116, 3, 0 in decreasing order. 3, 0, -2, -41, -116 Sort -6, -267, 20, 4. -267, -6, 4, 20 Put -50, -5, 14, 193, 0 in increasing order. -50, -5, 0, 14, 193 Put 8/7, -1799, 111 in increasing order. -1799, 8/7, 111 Sort 1.2, -0.5, -600, 1/2 in increasing order. -600, -0.5, 1/2, 1.2 Put 5, 99, 0, -4, -12, 2 in ascending order. -12, -4, 0, 2, 5, 99 Put -4, -3, 289, 5 in ascending order. -4, -3, 5, 289 Sort -4, 4, 231, -3, 11 in descending order. 231, 11, 4, -3, -4 Put 10, -53/5, -1/7 in decreasing order. 10, -1/7, -53/5 Sort 4, 2, -8, 1, 356 in decreasi	{ "pile_set_name": "DM Mathematics" }
4 b Let i be 1/7 + (-102)/126. Let m = 45.2 - 10.2. Let d = m - 34.97. Which is the closest to i? (a) d (b) -2/15 (c) 1/6 b Let n be ((-159)/(-742))/(2/8 - 1). What is the closest to -0.07 in n, -2, -1/4, -0.1? -0.1 Let o = 1.74 - 1.44. Let y = 119 - 127. Let d = 0 + -1. What is the closest to d in 1/4, o, y? 1/4 Let h = -194/63 + 236/63. What is the closest to -2.5 in -0.6, h, 1? -0.6 Let x = 0.5 + 0.67. Let m = 0.67 - x. What is the nearest to 0 in m, -4, -15? m Let n = -635/2 + 317. Which is the nearest to 541? (a) -0.1 (b) n (c) -2/5 a Let g = -19/29 + 28/87. Let l = -5/18 - -4/9. What is the nearest to 14 in l, 3, g? 3 Let s(x) = x*2 - 6x - 2. Let l be s(6). Let j be 12/(8/l) - -3. Suppose jk - k = 3r + 9, -2k = 2r + 10. What is the closest to 2 in -4, -2/15, k? -2/15 Let z = 106.054 - 106. Let d = -0.008 + z. Let o = 0.146 - d. What is the nearest to o in 5/6, -3, -0.1? -0.1 Suppose 10t - 40 = 50. Let j be (3/t)/((-10)/(-60)). Suppose -3u = 4w, u = 2u - jw - 10. Which is the closest to 1/9? (a) u (b) 0.2 (c) 0.3 b Let u = -18/11 - -170/77. Let f = -15758.9 + 15758. What is the closest to f in 0.1, -0.04, u? -0.04 Let z = 0.01 - 0.07. Let j = 386 - 346. Let f be (3 + (-14)/5)/(24/j). What is the nearest to 0.2 in z, f, 0.3? 0.3 Let j = 623/5 + -125. Let r(t) = -t2 - 4t - 1. Suppose -27 = -0u + 9u. Let p be r(u). Which is the nearest to p? (a) -0.3 (b) j (c) -0.2 c Let k = 0.126 - 0.026. Suppose 0 = -2d + d - 8. Let i be d/5 - (1 - 2). What is the closest to k in 0.2, -5, i? 0.2 Let x = -8 - -13. Let b = 618 + -966. Let f = -346 - b. What is the closest to -0.1 in x, -3/5, f? -3/5 Let m = 28951 - 28954. Let h = 0.1 - 0.04. Which is the closest to h? (a) 1/5 (b) -0.5 (c) m a Let z = -5.79 - 707.61. Let l = -713 - z. Which is the nearest to -3? (a) -0.03 (b) 3 (c) l (d) 2/9 a Let w = -1 - 0. Let n = -120.072 + 120. Let l = -0.192 - n. Which is the nearest to w? (a) 3 (b) l (c) 2 b Let n = 6057 - 6055. Which is the nearest to 0.02? (a) -0.4 (b) 5 (c) n (d) 3 a Let c = 0.05373 + -5.05373. What is the nearest to -2 in 4/3, 2, c, 0.07? 0.07 Let d be 1/12 + 51377/4980 + -10. Let k = 0.2 + -4.2. Let x = 0.2 - 0.2. What is the nearest to -1/3 in x, k, d? x Let i = -1.628 + 1.718. Which is the closest to 11? (a) 0 (b) i (c) -0.3 b Let s = 86 + -83. Suppose 12q + 18 = sf + 9q, 3q - 17 = -2f. Which is the closest to -2/3? (a) f (b) 5 (c) 0 c Let j = -0.06 - -0.16. Suppose -q - 9 = 5c + 1, c - 3q = 14. What is the nearest to j in 0.5, 57, c? 0.5 Let y = -133 + 189. Let m = y + -61. Let o = 0.2 - 1.2. What is the closest to -1 in 3/2, o, m? o Let y(p) = 2p2 + 47p + 18. Let s be y(0). Let o = 144/7 - 397/21. Which is the nearest to 1? (a) s (b) -4 (c) o (d) -2/19 c Suppose 2f + 2k + 139 = 41, -4f = -2k + 166. Which is the nearest to -0.1? (a) -5 (b) f (c) -2/7 (d) 0 d Let y = -100 - -99.838. Let r = 3.162 + y. Let l be (1/(-9))/(1/2). What is the nearest to -2/7 in l, 0.3, r? l Let k = 1681 - 6727/4. Which is the closest to 3? (a) 5 (b) 0 (c) k (d) -3 a Let q = 46 + 162. Let r = -163.5 + q. Let x = r - 44. What is the nearest to 1 in x, -2, -1/8? x Let z = -60 - -64. Let f = 0.05 - 0.25. Let s be ((-4)/(-6) - 24/18)/(-2). Which is the closest to s? (a) z (b) 5 (c) f c Let m = 3434 - 44644/13. Which is the nearest to -266? (a) m (b) -2 (c) -3 c Let k = -26.18655 + 0.18655. Which is the closest to 0.09? (a) 1/2 (b) 2 (c) k (d) 0 d Let v = 8 - 12. Let h = 5 + v. Let k = 18277.2 - 18277. Which is the nearest to k? (a) h (b) -0.06 (c) -2/9 b Suppose 6q - 158 = -104. Suppose -2p = -s + q, -3s - 7p - 9 = -4p. Which is the nearest to s? (a) 4 (b) 5/6 (c) 2/5 b Let x be (-9)/6 + (-4)/6-3. Let l = 33.3 - 33. Which is the nearest to -1/2? (a) l (b) x (c) 4/5 a Let o = 12.051 + -18.351. What is the nearest to -3/5 in -4, 3, o? -4 Let j = 16 - 19.5. Let h = 3.6 + j. Let v = -0.298 + -0.002. What is the nearest to -1 in h, v, -2/3? -2/3 Suppose -g = 3i - 8 - 10, 0 = 4i + 2g - 24. Let t be (-4i)/6 + 33/9. Let p be (0 - 1/(-2)) + -1. Which is the closest to 1? (a) -2/7 (b) t (c) p a Let l(q) = q*2 - 15q + 7. Let o be l(13). Let d = -5507 + 5507. Let h = 0.1 - -0.1. Which is the nearest to o? (a) h (b) d (c) 2/5 b Let k = -11 - -2. Let f = 1532 + -13790/9. Which is the closest to 1? (a) k (b) f (c) -3/8 (d) -3 b Let h = -0.05 + -0.35. Let i = h - 0.1. Let r = -55.9 + 55.8. What is the nearest to 2/3 in i, r, -3? r Let v = 18.46 - 18.96. What is the closest to -4 in v, 0.1, 4, 43? v Let x = 88.92 + -87.92. What is the nearest to x in -0.5, -4, -1/7, -0.123? -0.123 Let p = -17263 + 17267. Which is the closest to -105? (a) -0.3 (b) p (c) 0.3 (d) -0.1 a Let p = 16022 + -16023. Which is the closest to -2/5? (a) p (b) -1/6 (c) -0.06 (d) 0 b Let z be ((-560)/(-32) + -17)0(-2)/6. Let y = 19 - 13. Which is the nearest to -3? (a) z (b) y (c) -1/3 c Let y(h) = -2h3 + 9h*2 - 5h - 8. Let s be y(3). Let m = 474 + -472. Which is the closest to -2? (a) m (b) -5 (c) s b Let w = 15.94 - 16. Let s be (4/138)/(112/(-21) + 5). Which is the nearest to 0.1? (a) w (b) s (c) 0.5 a Let p be (-2)/12(-36)/964. What is the closest to -1 in 3, -0.01, -2.7, p? -0.01 Let w = -109705/21 + 5223. Let m = -23/42 - w. Let t = -0.1 + 5.1. What is the closest to 0.3 in -1/2, m, t? m Let n = -70.16 - -71. Let d = n + -0.64. Which is the closest to d? (a) -3/2 (b) -3 (c) -0.4 c Let h = 1761/7 - 254. Which is the nearest to 0? (a) h (b) 2/13 (c) 0.2 b Let b = -1861/108 - 11/108. Let s = b - -53/3. Let k = -0.04 + 2.04. What is the closest to s in k, -1, 1/14? 1/14 Let s = -6 + 19/3. Let c = -577 + 20767/36. Let v = c + 1/18. What is the closest to -1 in v, s, -1? -1 Let o = 1.3804 + -0.0004. Let v = o - -3.62. Which is the nearest to -6? (a) -1 (b) 0.5 (c) v a Let n = 2.03 + 1.97. Let f = -497.6 + 498. Which is the nearest to -1? (a) -0.02 (b) n (c) f a Let t = -28398 + 28397. Let o = 0.1 - -0.4. Which is the closest to t? (a) -13 (b) 0 (c) o b Let v = 7702 - 23110/3. What is the nearest to 1 in 1/4, 4/3, v, 19.9? 4/3 Let h = 0.61 + -0.47. Let u be (-1992)/9 + (0 - 8/12). Let s = -1558/7 - u. Which is the nearest to h? (a) 3 (b) s (c) -3 b Let s = 178.354 - 178. Let t = 0.646 + s. What is the nearest to t in -3, 1/5, -5, 0? 1/5 Let b(v) = -2v3 - 12v*2 - v - 4. Let m be b(-6). Suppose -mi = -5f, 3f - 4i - 8 = 6. What is the nearest to f in 1/3, -2, -0.3? -2 Let v = -9 - -31. Let f = v - 23. Let w = -6 - -18. What is the closest to f in -0.3, w, -0.2? -0.3 Let p = -0.06 + -3.94. Let s = 5782 - 5784. Which is the nearest to 1/4? (a) p (b) s (c) 2/25 c Suppose 0 = -7d + 22d - 60. Suppose h - 18 = -5v, -2h + 14 = -h + dv. Let i be 1 + (1/(-3))/1. Which is the nearest to 3? (a) h (b) -1 (c) i c Let j = 1.53 + -91.53. Let s = 106 + j. Let v = 0 - 0. What is the nearest to -0.1 in v, s, 1/2? v Let x = -1.28 + 0.6. Let b = -0.26 - x. Let f = b - 0.12. What is the nearest to -3 in -1/5, f, -1? -1 Let u = -771/3020 - -4/755. Which is the nearest to -2? (a) -7 (b) 0.5 (c) u (d) -2/11 c Let d(g) = -2g3 + 49g. Let s be d(-5). What is the nearest to -4 in s, 0.5, 2/5, -0.5? -0.5 Let p = -6349 + 6345. What is the closest to 0 in p, 1/52, -7? 1/52 Let x be (-3)/(-5) + (21/140)/((-279)/(-124)). Let h = -180 - -1618/9. Let l = 6 + -4. Which is the nearest to l? (a) x (b) h (c) 2/5 a Let d = 4 + 93. Let v = -97 + d. Which is the closest to v? (a) -1/4 (b) -3/2 (c) 2/9 c Let j = 1.6 + 0.4. Let z = 371.37 - -6.63. Let r = z + -377.9. Which is the nearest to r? (a) 0.9 (b) -2/5 (c) j b Let k = 61307/7 - 8758. Let x = -1.7 - -1.6. Which is the nearest to -0.1? (a) x (b) -2 (c) 1 (d) k a Let w = 102.519 + 0.481. Let x = -86 - -193. Let m = w - x. What is the closest to -1/5 in m, -1, 4/9? 4/9 Let x be (-828)/690(-5)/27. What is the closest to -0.1 in -0.4, x, -1, 5/6? -0.4 Let g = -14915 + 59663/4. Which is the closest to 171? (a) g (b) -4/9 (c) -3/4 (d) -0.1 a Suppose -103026 - 93899 = 675o - 83525. What is the closest to 3 in o, -0.3, -1/8? -1/8 Let d = 0.2 + -0.3. Let r(q) = 2*q + 424. Let i be r(21). Let s = 2801/6 - i. W	{ "pile_set_name": "DM Mathematics" }
er? 9 What is 128516 to the power of 1/2, to the nearest integer? 358 What is the fourth root of 72190 to the nearest integer? 16 What is 6151 to the power of 1/3, to the nearest integer? 18 What is 8837 to the power of 1/3, to the nearest integer? 21 What is the square root of 1620 to the nearest integer? 40 What is 49797 to the power of 1/2, to the nearest integer? 223 What is the tenth root of 1447 to the nearest integer? 2 What is 75095 to the power of 1/9, to the nearest integer? 3 What is 86320 to the power of 1/7, to the nearest integer? 5 What is the ninth root of 42711 to the nearest integer? 3 What is 5705 to the power of 1/9, to the nearest integer? 3 What is 11579 to the power of 1/10, to the nearest integer? 3 What is the sixth root of 9843 to the nearest integer? 5 What is the ninth root of 2387 to the nearest integer? 2 What is 1091 to the power of 1/3, to the nearest integer? 10 What is the eighth root of 680 to the nearest integer? 2 What is 918 to the power of 1/2, to the nearest integer? 30 What is the seventh root of 411 to the nearest integer? 2 What is the tenth root of 117 to the nearest integer? 2 What is 38495 to the power of 1/5, to the nearest integer? 8 What is 576 to the power of 1/2, to the nearest integer? 24 What is the fourth root of 8606 to the nearest integer? 10 What is the third root of 1117 to the nearest integer? 10 What is 1820 to the power of 1/2, to the nearest integer? 43 What is 3824 to the power of 1/7, to the nearest integer? 3 What is the square root of 92758 to the nearest integer? 305 What is the sixth root of 19823 to the nearest integer? 5 What is 713 to the power of 1/6, to the nearest integer? 3 What is the cube root of 6605 to the nearest integer? 19 What is 668 to the power of 1/2, to the nearest integer? 26 What is 42542 to the power of 1/10, to the nearest integer? 3 What is the cube root of 2501 to the nearest integer? 14 What is 922 to the power of 1/2, to the nearest integer? 30 What is the square root of 604 to the nearest integer? 25 What is the square root of 4810 to the nearest integer? 69 What is the tenth root of 603 to the nearest integer? 2 What is the square root of 33651 to the nearest integer? 183 What is the square root of 11197 to the nearest integer? 106 What is 602 to the power of 1/2, to the nearest integer? 25 What is the tenth root of 693 to the nearest integer? 2 What is 1243 to the power of 1/9, to the nearest integer? 2 What is 2899 to the power of 1/3, to the nearest integer? 14 What is the square root of 3664 to the nearest integer? 61 What is the sixth root of 29178 to the nearest integer? 6 What is 17130 to the power of 1/3, to the nearest integer? 26 What is the seventh root of 10926 to the nearest integer? 4 What is the square root of 13982 to the nearest integer? 118 What is the seventh root of 294 to the nearest integer? 2 What is 9115 to the power of 1/2, to the nearest integer? 95 What is 1298 to the power of 1/2, to the nearest integer? 36 What is 2604 to the power of 1/5, to the nearest integer? 5 What is the cube root of 95278 to the nearest integer? 46 What is the tenth root of 146 to the nearest integer? 2 What is 5884 to the power of 1/2, to the nearest integer? 77 What is the tenth root of 90 to the nearest integer? 2 What is 23782 to the power of 1/3, to the nearest integer? 29 What is the tenth root of 600 to the nearest integer? 2 What is 148 to the power of 1/7, to the nearest integer? 2 What is the fifth root of 66593 to the nearest integer? 9 What is 5758 to the power of 1/3, to the nearest integer? 18 What is 22964 to the power of 1/2, to the nearest integer? 152 What is 915 to the power of 1/2, to the nearest integer? 30 What is 89 to the power of 1/5, to the nearest integer? 2 What is the cube root of 2267 to the nearest integer? 13 What is the fourth root of 701 to the nearest integer? 5 What is 335 to the power of 1/2, to the nearest integer? 18 What is the fourth root of 1274 to the nearest integer? 6 What is 1491 to the power of 1/4, to the nearest integer? 6 What is the square root of 20204 to the nearest integer? 142 What is the seventh root of 3164 to the nearest integer? 3 What is 16510 to the power of 1/2, to the nearest integer? 128 What is 8350 to the power of 1/6, to the nearest integer? 5 What is the sixth root of 4773 to the nearest integer? 4 What is 85099 to the power of 1/2, to the nearest integer? 292 What is 14181 to the power of 1/6, to the nearest integer? 5 What is the fifth root of 6168 to the nearest integer? 6 What is the third root of 63535 to the nearest integer? 40 What is the square root of 4191 to the nearest integer? 65 What is the eighth root of 60036 to the nearest integer? 4 What is the eighth root of 634 to the nearest integer? 2 What is the square root of 27795 to the nearest integer? 167 What is the cube root of 1553 to the nearest integer? 12 What is the square root of 4561 to the nearest integer? 68 What is the square root of 3726 to the nearest integer? 61 What is 80507 to the power of 1/2, to the nearest integer? 284 What is 82903 to the power of 1/2, to the nearest integer? 288 What is 3213 to the power of 1/7, to the nearest integer? 3 What is the ninth root of 5082 to the nearest integer? 3 What is the third root of 4558 to the nearest integer? 17 What is the cube root of 26429 to the nearest integer? 30 What is the square root of 849 to the nearest integer? 29 What is 454 to the power of 1/3, to the nearest integer? 8 What is the sixth root of 73722 to the nearest integer? 6 What is the sixth root of 559 to the nearest integer? 3 What is the square root of 201687 to the nearest integer? 449 What is the square root of 2823 to the nearest integer? 53 What is 15010 to the power of 1/2, to the nearest integer? 123 What is 742 to the power of 1/2, to the nearest integer? 27 What is the eighth root of 30759 to the nearest integer? 4 What is the square root of 2566 to the nearest integer? 51 What is 45222 to the power of 1/3, to the nearest integer? 36 What is 104720 to the power of 1/2, to the nearest integer? 324 What is 11062 to the power of 1/9, to the nearest integer? 3 What is 15535 to the power of 1/3, to the nearest integer? 25 What is the fourth root of 2605 to the nearest integer? 7 What is the cube root of 1233 to the nearest integer? 11 What is the cube root of 8989 to the nearest integer? 21 What is the ninth root of 1232 to the nearest integer? 2 What is 23447 to the power of 1/8, to the nearest integer? 4 What is 41181 to the power of 1/9, to the nearest integer? 3 What is the third root of 2328 to the nearest integer? 13 What is the sixth root of 33008 to the nearest integer? 6 What is 1358 to the power of 1/2, to the nearest integer? 37 What is the cube root of 1332 to the nearest integer? 11 What is 485 to the power of 1/10, to the nearest integer? 2 What is 629 to the power of 1/2, to the nearest integer? 25 What is 3961 to the power of 1/2, to the nearest integer? 63 What is 458 to the power of 1/8, to the nearest integer? 2 What is 6554 to the power of 1/3, to the nearest integer? 19 What is the third root of 52414 to the nearest integer? 37 What is the third root of 2940 to the nearest integer? 14 What is 33183 to the power of 1/2, to the nearest integer? 182 What is the seventh root of 17181 to the nearest integer? 4 What is the fifth root of 4495 to the nearest integer? 5 What is the square root of 80910 to the nearest integer? 284 What is the cube root of 137 to the nearest integer? 5 What is the ninth root of 1174 to the nearest integer? 2 What is the third root of 9532 to the nearest integer? 21 What is the square root of 53004 to the nearest integer? 230 What is the third root of 23640 to the nearest integer? 29 What is the square root of 2554 to the nearest integer? 51 What is the tenth root of 3093 to the nearest integer? 2 What is the fifth root of 7554 to the nearest integer? 6 What is the fifth root of 14638 to the nearest integer? 7 What is the square root of 7057 to the nearest integer? 84 What is 37327 to the power of 1/2, to the nearest integer? 193 What is 193961 to the power of 1/10, to the nearest integer? 3 What is 12894 to the power of 1/2, to the nearest	{ "pile_set_name": "DM Mathematics" }
, 1267714, 1267569, 1267358, 1267087? 1266762 What comes next: -208, 707, 2770, 5999, 10412? 16027 What is the next term in -25591, -51254, -76917? -102580 What is the next term in -39635, -317176, -1070635, -2538014, -4957315, -8566540, -13603691, -20306770? -28913779 What is the next term in 917233, 1834445, 2751657, 3668869? 4586081 What is next in 495987, 992655, 1489323? 1985991 What is next in 112246, 224512, 336778, 449044, 561310, 673576? 785842 What comes next: -21835349, -21835574, -21835813, -21836072, -21836357, -21836674? -21837029 What is the next term in -2896, -2979, -3186, -3559, -4140, -4971? -6094 What comes next: 4992300, 9984597, 14976894, 19969191, 24961488, 29953785? 34946082 What is the next term in -955, -4861, -14597, -32803, -62119, -105185, -164641? -243127 What is the next term in 2218, 2165, 2134, 2137, 2186? 2293 What is next in -71354917, -71354907, -71354891, -71354869? -71354841 What is the next term in 80012828, 80012835, 80012842, 80012849, 80012856, 80012863? 80012870 What is next in -226, -230, -234, -238, -242, -246? -250 What is next in 92601, 92363, 91953, 91365, 90593? 89631 What comes next: -708984, -708991, -708998, -709005, -709012, -709019? -709026 What is the next term in 687, 1277, 2273, 3687, 5531, 7817, 10557? 13763 What is the next term in -4803, -5153, -5503, -5853, -6203? -6553 What is the next term in -11673, -29290, -46907? -64524 What comes next: -4813, -19031, -42751, -75973, -118697, -170923, -232651? -303881 What is next in -109447, -109427, -109401, -109369, -109331, -109287, -109237? -109181 What is the next term in 107909, 104123, 100337, 96551? 92765 What is next in 5581, 5146, 4435, 3454, 2209, 706, -1049, -3050? -5291 What is next in 2748930, 5497800, 8246658, 10995498, 13744314, 16493100? 19241850 What is next in 25524, 37173, 56586, 83763? 118704 What is next in 40426, 81341, 122258, 163177, 204098? 245021 What comes next: 38042, 152024, 341920, 607736, 949478, 1367152? 1860764 What is the next term in -609935, -609958, -609981? -610004 What comes next: 218220, 218143, 218074, 218013, 217960, 217915? 217878 What comes next: 5156, 21589, 48978, 87329, 136648, 196941, 268214, 350473? 443724 What comes next: -49777, -99565, -149345, -199117, -248881, -298637, -348385? -398125 What comes next: -52, -94, -160, -256, -388, -562, -784? -1060 What is the next term in 79417, 79173, 78525, 77275, 75225, 72177, 67933, 62295? 55065 What comes next: -5762234, -5762233, -5762232? -5762231 What is next in -630424, -630655, -631040, -631579, -632272? -633119 What is the next term in -1081126, -1081219, -1081314, -1081411, -1081510, -1081611, -1081714? -1081819 What is next in -8273373, -8273377, -8273381, -8273385, -8273389, -8273393? -8273397 What is the next term in 735, 549, 363, 177? -9 What comes next: -194473292, -194473290, -194473288, -194473286, -194473284? -194473282 What is the next term in -2735, -11291, -25667, -45863, -71879, -103715, -141371? -184847 What is next in 55280, 111967, 168654, 225341, 282028, 338715? 395402 What is next in 1519979, 3039921, 4559839, 6079721, 7599555, 9119329, 10639031? 12158649 What is next in 16561, 66418, 149573, 266026, 415777? 598826 What is next in 740884, 740876, 740854, 740812, 740744, 740644? 740506 What comes next: 129143, 261142, 393141, 525140? 657139 What is the next term in 1743, 7791, 17875, 31995, 50151, 72343, 98571? 128835 What is next in -50311488, -50311489, -50311490, -50311491, -50311492? -50311493 What is the next term in 279711, 279802, 280049, 280530, 281323, 282506, 284157, 286354? 289175 What is the next term in 345, 2171, 5339, 9849, 15701? 22895 What is next in 86623, 344487, 774269, 1375975, 2149611, 3095183? 4212697 What comes next: -19996, -19352, -18278, -16774? -14840 What comes next: 3876, 5055, 6234? 7413 What is next in -13419, -26564, -39709, -52854, -65999? -79144 What is the next term in -4278, -6215, -8154, -10095, -12038, -13983, -15930? -17879 What is next in -59093, -118212, -177339, -236480, -295641, -354828? -414047 What comes next: -82631, -165329, -248027, -330725, -413423? -496121 What is next in -43488, -42735, -41490, -39753, -37524? -34803 What is next in -161419, -322844, -484273, -645706, -807143, -968584? -1130029 What is next in 8286, 16612, 24970, 33360? 41782 What comes next: 316, 1702, 4136, 7618, 12148? 17726 What is next in -762, -5406, -18044, -42678, -83310? -143942 What is the next term in 2773, 4498, 7227, 10954, 15673, 21378, 28063, 35722? 44349 What is next in -2091686, -8366962, -18825754, -33468062, -52293886, -75303226, -102496082? -133872454 What comes next: -4915, -3871, -2145, 257, 3329, 7065, 11459? 16505 What comes next: 1583, 3190, 4819, 6482, 8191, 9958, 11795? 13714 What is next in 182, 620, 1552, 3224, 5882, 9772? 15140 What comes next: 145440738, 145440749, 145440774, 145440819, 145440890, 145440993, 145441134? 145441319 What is the next term in -75962, -151901, -227840, -303779? -379718 What is the next term in 39996151, 79992287, 119988421, 159984553, 199980683? 239976811 What is next in -37, 307, 1411, 3713, 7651, 13663? 22187 What is the next term in -16235484, -16235482, -16235480, -16235478? -16235476 What is next in 261118296, 261118293, 261118290? 261118287 What is next in 4988140, 4987970, 4987800? 4987630 What comes next: 118, 140, 392, 994, 2066, 3728, 6100, 9302? 13454 What is the next term in -12254379, -12254377, -12254373, -12254367, -12254359, -12254349? -12254337 What comes next: 4848, -696, -15746, -45054, -93372, -165452, -266046, -399906? -571784 What comes next: -323, -379, -433, -485? -535 What comes next: -11201, -13639, -16077, -18515, -20953? -23391 What is next in 1462142330, 1462142331, 1462142332, 1462142333, 1462142334, 1462142335? 1462142336 What comes next: -13608, -14559, -15510, -16461, -17412, -18363? -19314 What is next in 526, 851, 1154, 1435? 1694 What comes next: -95342, -95331, -95312, -95285? -95250 What is next in -146666, -146647, -146624, -146603, -146590, -146591? -146612 What is next in -2127, -15, 3579, 8661, 15237, 23313? 32895 What is the next term in 531, 1878, 3237, 4608, 5991, 7386, 8793? 10212 What is the next term in 85236, 85352, 85468, 85584, 85700, 85816? 85932 What comes next: 14306810, 28613640, 42920468, 57227294, 71534118, 85840940? 100147760 What comes next: -7015964, -14031925, -21047886, -28063847, -35079808, -42095769? -49111730 What is the next term in -1382, -5840, -13268, -23666? -37034 What comes next: 6280, 12615, 18954, 25291, 31620? 37935 What comes next: -48941, -48991, -49041, -49091, -49141? -49191 What comes next: 9978, 15007, 20046, 25101, 30178, 35283, 40422, 45601? 50826 What is next in 15612, 17669, 21096, 25893, 32060? 39597 What comes next: 52359, 420112, 1418307, 3362166, 6566911? 11347764 What comes next: 78862, 77704, 76546, 75388? 74230 What comes next: 53104, 52764, 52424, 52084, 51744? 51404 What comes next: 4112785, 4112802, 4112809, 4112800, 4112769? 4112710 What is next in -16397, -16443, -16469, -16463, -16413? -16307 What is next in -395, -4679, -16631, -40025, -78635, -136235, -216599? -323501 What comes next: -14762722, -59050891, -132864506, -236203567? -369068074 What is next in -512058, -512129, -512200, -512271? -512342 What is the next term in 9635436, 19270861, 28906284, 38541705, 48177124, 57812541, 67447956? 77083369 What comes next: 2999, 1776, 539, -718, -2001, -3316, -4669? -6066 What comes next: 260671, 521343, 782015? 1042687 What comes next: 22022007, 44044018, 66066029, 88088040, 110110051, 132132062? 154154073 What is the next term in -438, 1554, 7024, 17706, 35334? 61642 What is the next term in 89641, 90560, 91479, 92398? 93317 What comes next: 69792347, 69792346, 69792349, 69792356, 69792367? 69792382 What is the next term in -5654, -10932, -16230, -21548, -26886? -32244 What comes next: 1179251, 1178499, 1177747? 1176995 What is the next term in -3852, -14954, -33340, -59010, -91964, -132202, -179724? -234530 What is next in -1465183, -2930930, -4396677, -5862424? -7328171 What is next in -14223, -15792, -18407, -22068, -26775, -32528, -39327? -47172 What is next in 1196565, 2393130, 3589697, 4786266, 5982837, 7179410? 8375985 What is next in -9982, -20171	{ "pile_set_name": "DM Mathematics" }
1)/((-6)/c). Solve 4z = k - 7, 0 = -fk + 2k - 3z - 9 for k. 3 Suppose 126 = -2950i + 2959i. Solve 0 = -5f - 3w + 12, -9w - 4 = -3f - iw for f. 3 Let b be (2 - -6) + -3 + 4/(-4). Solve -bq + 3r = -0q + 15, -3r = 4q + 9 for q. -3 Let i(r) = r*3 + 14r*2 + 3. Let f be i(-14). Suppose -fm - u + 71 = -2, 2m = -4u + 52. Solve 0 = -2p - 2g + g + 2, m = 4p - 3g for p. 3 Suppose -7w + 20w + 78 = 0. Let f be ((-3)/(-2))/(5w/(-100)). Let r = 47 + -12. Solve r = fc - 3j, -3c = -5j - 49 + 12 for c. 4 Let g = 0 - -5. Suppose -5s = -gu, 0u + 14 = 4u + 3s. Let z be (-4)/28 - u/(-14). Solve 0 = f - 3, l - 4f + 21 - 4 = z for l. -5 Let p = 13 - 10. Suppose -4m = -2m - k + 20, -pk = -m. Let o be 1/(21/m - -2). Solve of - r = -2r - 22, -2r - 29 = 5f for f. -5 Suppose -1209 = 5z - 1239. Let b = 1 - 1. Solve -5d = -2v + 9, -4d + bv = -2v + z for d. -3 Let a = -5 - 16. Let t = a + 23. Solve -2h + 3n = h - 15, -2h - 10 = tn for h. 0 Suppose -33g = -41g. Solve -3i = -5f + i + 33, -5i - 10 = g for f. 5 Let b = 106 - 101. Let t(m) = -3 + 2 + 3 - 3 - m3 + 6m*2 - 4m. Let i be t(5). Solve -2 = -n - ba + ia, -3n = 4a - 9 for n. -1 Let s(w) = -3w - w - w - 6 + 4w. Let f be s(-12). Let x be 14/4 - f/4. Solve -2y = -4p + 3y + 12, 6 = xp + y for p. 3 Let d = -318 + 332. Solve -15 = 5h - 5l, 4h = -l - 8 - d for h. -5 Let l = 21 + -30. Let w be (3/l)/((-4)/48). Solve 4d + 24 = 2c, 0c + 2c - w = -d for d. -4 Let y = 17 + -16. Let b be y/4(40/5 + -8). Solve t + u = b, -20 = -2t - t + 2u for t. 4 Let k be -5 - -4 - -10 - (6 - 13). Solve b - 3f = f - k, f = 4 for b. 0 Let s = 24 + -25. Let z(x) = -2x*3. Let d be z(s). Solve -2a - 1 = 3, -a = dc + 8 for c. -3 Suppose 4g - g = -3r, -14 = -3r + 4g. Suppose 0 = j + 5d - 4, -3j - 17 = -3d - 65. Solve 5y - 3w + 5 = 0, 0 = -3y + 2y - rw - j for y. -4 Let h = 450 - 445. Solve hn - 4 = 2f + 3n, -4n + 5 = -3f for f. -3 Let l be (-6 - -3)/(6/(-8)). Suppose -3r - 2 = -lr. Solve -rc - 2 = 2a, -c - c = 5a + 11 for a. -3 Let b = -24 - -25. Solve -4q = 8s - 5s + b, 0 = -q - s for q. -1 Let o = 137 + -31. Let z = -103 + o. Solve zy + r + 4 = 0, -5y + 2r = r - 4 for y. 0 Suppose -3p - 4p + 231 = 0. Let n be -6(-1)/25. Suppose -4v + n = r - v, -3v = 4r - p. Solve 0 = 2a - 4y - r, a - 5a - y = 24 for a. -5 Suppose -c - 2a + 2 = 0, 30c - 32c + 5a + 13 = 0. Suppose -5y - 4n + 33 = 0, 5y - 27 = -0n - n. Solve 3r - y = -h - 3h, -h = -2r - c for h. 2 Let y(k) = -k*2 + 7k - 6. Let i be y(5). Solve 12 = -q + 2f + i, -3q - 2f = 0 for q. -2 Suppose 51l - 10l - 123 = 0. Solve -9 = 2j + lu, j + 5u = -5 - 3 for j. -3 Let s(t) = t*2 - 2t - 4. Let f be -4 - (1 - 0 - 3). Let a be s(f). Solve 4h = -n + 2, -an + 4 = 3h - 4 for h. 0 Let u(d) = -d3 - 2d*2 - 7. Let h be u(-3). Let i(l) = -2 + 2l + 0l + l + 4l*2 - 2l. Let x be i(h). Solve -4 = 2r + 4p, -r = 2p - 6p - x for r. 4 Let g be 1/(55/18 + -3). Suppose 0 = -5o - 4n + 32, -2n = -2o - n + g. Solve -i - 26 = 5c, -i - o = 2c - 3i for c. -5 Let j = -738 - -767. Solve -j = o + 5y, -4o - y - 1 = -5o for o. -4 Let r(w) = -w*3 + 47w*2 + w - 27. Let d be r(47). Solve -5t + 2j + 3j = 25, -4t = 4j + d for t. -5 Suppose 0 = -4v + 54 - 42. Suppose 13 = p - vi, 6p - p - 35 = 5i. Solve 4r = 4l + 24, pr - 21 = 4l - l for r. 3 Let d = -17 + 19. Let h(o) = -6 - 1 + 7 + 1 - do + o3. Let x be h(2). Solve -3p + 4y = -0y + x, 3p + y - 5 = 0 for p. 1 Suppose -2h - 3g = 3h, 5g = 5h. Suppose h = -0f - 5f + 20. Solve 4y + 30 = 5r, fr - 12 = 5y + 21 for y. -5 Let b be 4/1 - (2 + -3). Solve bt - 2y - 6 = -37, -5t = 2y + 19 for t. -5 Suppose 66s = 79s - 13. Solve 2h + 3k + s = 2k, 5k + 5 = 0 for h. 0 Suppose -4c - 5 + 13 = 0. Solve -1 = i + 6f - 5f, 0 = 2i + 4f - c for i. -3 Let r = 183 + -168. Solve 25 = 5a + 5c, 0 = 3a + 2a + 3c - r for a. 0 Suppose -5r + r + 8 = 0. Suppose -2x = -8, rb + 4x - 11 = 15. Solve -i - bv - 24 = 0, 5i = 3i + 2v for i. -4 Let r be 805/25 - 12/10. Solve 0 = 3x + 2x + 3u + r, 4x + 3u + 26 = 0 for x. -5 Suppose 5n - 120 = 5h - 80, 3 = -h. Solve -nl + 5 = 3s - 0s, 0 = s - 2l + 2 for s. 0 Let j be ((-2)/(-9))/(-1) - 4540/(-180). Suppose 37a - 42a = -j. Solve ah + 10 = -0, -5f = 5h + 10 for f. 0 Let g(l) = l*2 + 2l - 23. Let s = 121 - 127. Let i be g(s). Solve -2y - f - i = 0, 3y + 2 = -6f + 5f for y. -1 Let j(v) = -v*3 - 3v*2 + 5v + 4. Let o be (-19)/5 + 5/(-25). Let k be j(o). Solve kf - b = -3f - 7, 3f - 1 = 5b for f. -3 Let n be (-616)/(-18) + 4/(-18). Let i = n - 33. Solve w = -2a - 6, -4a = -5w + 25 + i for w. 2 Let s be 72/(-30) + (-8)/(-20). Let t be (18/(-27))/(s/(-3)). Let u be (t - 0)-4 - 2. Solve i = a + ua - 7, 0 = 5a - 4i for a. 4 Suppose 786k = 783k + 69. Solve -i - 3 = 3i + 3g, 4g + k = i for i. 3 Suppose -39 = 3u - 16u. Solve 3d = -4h + 10, 0 = h + uh + 4d - 12 for h. 1 Let n be 11 + (2 - 6) - 2. Suppose -3k + 0z + 7 = 2z, nk - z = 29. Solve -kb + 4u = -10, -5u - 36 = 3b - 5 for b. -2 Suppose -2h - 11 = -3h + 2o, -2o = 4h - 4. Suppose -11 = hg - g - 3v, -5g + 5 = -v. Solve -2n + 4n - 5i = -35, 0 = -gn - i - 5 for n. -5 Suppose -26 = -i - 2g, 4i + 2g - 21 - 65 = 0. Let k be (-5)/i + (-39)/(-12). Solve -3q = -2j + 7, -3j + kq = -5 - 1 for j. -1 Let b be (-48)/2(3 - (-4 + 10)). Suppose 4q = -4t + b, -2q + 36 = 3t - 5q. Solve 4o + t = o, -5i = -4o - 40 for i. 4 Let a = 11 - 7. Suppose 2m + 3 = 13. Let o(d) = 6d - 42. Let l be o(10). Solve -mb + 6 - l = -3s, -16 = -ab - 4s for b. 0 Let y(u) = u*2 + 24u - 35. Let i be y(-26). Let g be 2/(-5) - (-51)/15. Solve 9 = -gl - c, -2l + 3c + 0 - i = 0 for l. -4 Let d be 13 + 4/(-1) + 0. Let i = -7 + d. Solve p + o = -4, 5o + i + 10 = -p for p. -2 Let r = 4 + -2. Suppose -rk - 5j - 4 = -20, 0 = -k - 4j + 11. Solve -5z + 2p + 20 = -p, kz - 12 = -3p for z. 4 Let s(x) = 2x + 11. Let z be s(-3). Let d be z/(-15) - 93/(-9). Solve 2w + 8 = -3r, r + 2w + d - 2 = 0 for r. 0 Suppose -28b - 136 = -62b. Solve bt - 6 = 4h - 18, -t - 7 = h for h. -2 Let v(c) = -c3 + 2c*2 + 37c - 9. Let d be v(7). Solve -3i = 2y - 4, -y = 3i - 0y - d for i. 2 Let k(j) = -17j + 73. Let g(s) = -8s + 37. Let n(d) = 5g(d) - 2k(d). Let h be n(6). Solve 5b = 4q + 24, -2b = -4q - hb for q. -1 Let n(o) = -o2 - 6o - 3. Let g be n(-4). Suppose gr + r = r. Solve 4i = 5a + 31 - 10, r = a + 5i + 10 for a. -5 Suppose 15 = -99m + 102m. Solve 4w + c + 14 = 0, w - 1 = -2w + mc for w. -3 Let w = 42 - 39. Solve 20 = 8i - 3i, 0 = wu + 4i - 28 for u. 4 Let a = 26 + -10. Suppose s + 0 - 2 = o, -5s = 3o - 26. Solve 18 = -5w - of, -3w + 5f - a = f for w. -4 Let v(m) = -m3 + 16m*2 - 29m + 19. Let t be v(14). Solve -3b - 6 = -6z + 4z, 15 = -tz for b. -4 Suppose 0 = -t - 5z - 23 + 1, -3t + 4z = -29. Solve 4g + 2c = 20, -c - tc = -2g for g. 4 Let m(v) = -v2 + 4v + 10. Let c be m(6). Let z be (-2)/c + (-1 - (-2 - 1)). Let p be 8/6(-15)/(-2). Solve -2x = 2r - 10, -2x + 3 = zr - p for r. 3 Suppose 34a - 475 = 35. Solve 0 = -7w + 2w + 5d - 5, -5w + a = -d for w. 4 Let i be 15/(-15) - (-3)/1. Suppose -6r + 3r = -18. Solve -5f + r = -iq, 2q + 2q - 12 = -2f for q. 2 Suppose -6024 + 6006 = -9w. Solve 0 = 4z - wz + 2, z = -4g + 3 for g. 1 Suppose -108 = -7o + 3o. Suppose 5w + 2 = o. Solve -wq - 21 = -d, q + d + 9 = -0d for q. -5 Let m(d) = -2d2 - d2 + d + 3 + 2d*2. Let r be m(0). Let w be (-6 + 3)24/(-18). Solve -6 = 5g - v + 3, -wg + 8 = rv for g. -1 Let o(l) = 87l - 174. Let v be o(2). Solve -n + 2i = v, i - 4i - 13 = 5n for n. -2 Suppose -48 = -15p - 18. Solve -2b + p = 5n + 15, 2b - 3n - 11 = 0 for b. 1 Let w be 1(18 + 2) + 0. Let n(s) = -7s - 2. Let f be n(-1). Let u(g) = g*2 - 5. Let y be u(3). Solve -4z + h = -z - w, 0 = -yz - fh - 5 for z. 5 Suppose 1535g = 1543g - 16. Solve -4q + 3v = 28, -gq + v + 8 = 5v for q. -4 Let p be 3100/(-45)15/2. Let h = p - -73. Solve 0 = -o - 5x + h, 3o + x = -o + 16 for o. 3 Let a = 453 + -438. Let z = 8 + -5. Solve -zp - a = 3i, p	{ "pile_set_name": "DM Mathematics" }
y/6 - 0). Which is the third smallest value? (a) 2 (b) z (c) 5 c Let l = 2.3 + -2. Let o = 0.85 - 0.05. Let b = o - -2.2. What is the third smallest value in b, l, -1? b Let k = 4.06 - 0.06. Let p = -2.543 - -2.543. Which is the biggest value? (a) p (b) 3 (c) k (d) -3/2 c Let j = -13 + 23. Let b be 0 - (24/j + -2). Let h = 73 - 73. What is the smallest value in 2/9, h, b? b Let h = -7.99 - -7.59. Which is the third smallest value? (a) h (b) 0.3 (c) -14 (d) 1/3 b Suppose 22u - 672 = 604. Which is the smallest value? (a) 0.2 (b) -3 (c) u (d) -4/3 b Let y = -8 - -7.96. Let t = -10.96 + y. Let n = t + 11. Which is the biggest value? (a) -2/3 (b) n (c) 4 c Let n = 0.842 - 0.93. Let y = 0.312 - n. Let i = 3 + 1. Which is the smallest value? (a) y (b) -1/5 (c) i b Let i = 7.1 - 7.105. Let k = i - -2.005. What is the smallest value in -3/4, -3/5, k, 1/2? -3/4 Let o = 369 - 372. Let t = 0.05 - -0.15. Which is the second smallest value? (a) o (b) -5 (c) 4 (d) t a Let n = 8 + -7. Let f be n + (4/(-4) - -1). Let k = -14.2 + 14. Which is the second biggest value? (a) f (b) k (c) 6 a Let i = -14 + 15. Which is the third smallest value? (a) -6/11 (b) 0 (c) i c Let r = 0.31 - -1.19. Let v = -1.4 + r. What is the biggest value in v, 3, -0.4? 3 Let k = 2.3 + 2.7. Which is the third biggest value? (a) -8 (b) k (c) -2 (d) 3/2 c Suppose p + 2 = -2u - 6, 8 = -2u + 5p. Let t = -30 - -27. Which is the second smallest value? (a) t (b) u (c) -0.3 a Let x = 162/5 + -977/30. What is the fourth smallest value in -0.3, -0.01, x, -3? -0.01 Suppose 3z = 4q - 86 + 89, -q - 4 = -4z. Which is the third biggest value? (a) 2/13 (b) -0.008 (c) q b Let o = 23.6 - 1.6. Let x = o - 11. Let h = 9 - x. What is the biggest value in 2, h, 5? 5 Let f(h) = h2 + 7h - 5. Let g be f(-8). Let p = 5.118 - 0.118. Which is the third biggest value? (a) p (b) 4/3 (c) -2/9 (d) g b Let o(d) = -8d3 + d. Suppose 3 = 3p - 0. Let y be o(p). Let w be 7/y(0 + 0). What is the third biggest value in w, -4, 2? -4 Let s be ((-4)/(-10))/(8/(-4)). Let t = -411 - -410.7. What is the third biggest value in -1/3, t, s, -0.5? -1/3 Let x = 53/4 + -13. Let v = -56 - -46. Let n be v + 9 + (-8)/(-7). Which is the second smallest value? (a) -2 (b) n (c) x b Let x = -509 - -509.4. Which is the second biggest value? (a) x (b) -0.33 (c) -3/2 (d) -0.4 b Let o = 721 - 716. What is the second biggest value in 0.9, -0.09, o, -5? 0.9 Suppose 2 = 2q + 4r, -q + 3q + r + 1 = 0. Let c = -52 - -56. What is the smallest value in q, 0.1, c? q Suppose 14g + 5 = 47. Let h = -4 - -3. What is the second smallest value in h, 5, g? g Let b = -0.09 + -1.91. Let d be 115/15-1. What is the third biggest value in b, d, 0.3, 0.1? d Let i = 11 + -6. Let s = 6.3 + -6.8. What is the third biggest value in 2/3, s, i? s Let q(r) = -2r + 4. Let l be q(-4). Suppose 2g = 6g - l. Let h = -0.12 - -1.12. Which is the second biggest value? (a) h (b) g (c) 0.1 a Let s(c) = -c3 - 5c*2 - 8c - 4. Let m be s(-6). Let v be 26/(12/m-3). Let r = v + 58. What is the second biggest value in r, 1/6, 2/11? 2/11 Let p = 1.9115 - -0.0885. Which is the fourth biggest value? (a) p (b) 3 (c) 36 (d) 1 d Let s = 19 - 24. Let c = s + -3. Let k = c + 7. What is the third biggest value in -2/7, 1, k? k Let o = -276 - -271. Which is the smallest value? (a) o (b) -2/13 (c) 34 a Let m be (-5 - -3) + 153 + 1. Let w = m + -756/5. Which is the biggest value? (a) w (b) 0 (c) 2/5 a Let o be ((-12)/12)/(-1(1 + 2)). Which is the smallest value? (a) o (b) 0.34 (c) -2 c Let i = -0.07 - -0.47. Let k = -0.44 + i. Let h = 0.06 - k. Which is the second biggest value? (a) h (b) -0.7 (c) -2/13 c Let o = -97 - -101. What is the biggest value in o, -28, -3/8? o Let l be ((10 - 16)/(-18))/((-8)/10). What is the third smallest value in 0.01, 4, l? 4 Suppose 5y + 366 = 346. Which is the second smallest value? (a) y (b) 5/6 (c) -0.5 (d) -10/9 d Let z(t) = t2 - 16t + 11. Let f be z(15). Let r be 3 + -1 + (-216)/114. Which is the biggest value? (a) f (b) r (c) 0.3 c Let g(o) = -4o - 1. Let t be g(-6). Let k(s) = -3s*2 + s - 4. Let v be k(3). Let y = v + t. Which is the second smallest value? (a) 0.1 (b) y (c) 2/7 a Let t = 14 + -10.2. Let g = -2.8 + t. Let l = 26.5 - 26. Which is the biggest value? (a) g (b) l (c) -2/7 a Let i be (-20)/(-12)24/20. Suppose -ir + 11 = 7. Which is the second biggest value? (a) r (b) 0.4 (c) -2 b Let k = -0.1 + 0.2. Suppose -21z = 111 - 195. Which is the second smallest value? (a) k (b) 3 (c) -2 (d) z a Let g = 0.3 - -1. Let j be -2(2/15 + 96/(-45)). Suppose 3t - 20 = -4v, -4t + j + 11 = 3v. What is the biggest value in g, v, 1/4? v Let w = -1392 + 1388. What is the third smallest value in -5, 78, 2, w? 2 Let l = -7.32 + 5.13. Let i = -0.81 + l. What is the third biggest value in i, -0.1, 5? i Let n = 137 - 137.1. What is the smallest value in n, 2/17, -5, -16? -16 Let k = 299.5 - 299. What is the third smallest value in k, 4, 0.002? 4 Let u = -30.3 - -35.3. What is the fourth biggest value in -0.2, -2/5, u, -5? -5 Let g = -30 - -9. Let u = g - -16. Let d = -0.1 + 5.1. What is the second smallest value in u, d, 2/15? 2/15 Let z = 1734 + -1733.6. Which is the smallest value? (a) 3 (b) -0.2 (c) -4 (d) z c Let u = -334 + 335. Which is the third biggest value? (a) -18 (b) 0.1 (c) 0.2 (d) u b Let s = -1937 + 1936. What is the second smallest value in 5/4, s, -2/203? -2/203 Let o = -0.72 + 6.32. Let q = 6.1 - o. Which is the third smallest value? (a) -1/2 (b) q (c) 5/3 (d) -1/3 b Let s = -0.324 + -0.04. Let u = s + -0.036. Let f = -1.3 - 4.7. Which is the smallest value? (a) 3/5 (b) u (c) f c Let l = -768 + 2303/3. What is the fourth smallest value in -0.4, -9, l, 2/17? 2/17 Let b = 0.06 + -0.05. Let k = 13 + -16. What is the fourth smallest value in b, 0.1, k, -2/7? 0.1 Suppose 6v - 16v - 30v = 11v. Let q = -33 - -19. Let r be (1/4)/(q/24). What is the second biggest value in r, v, 0.2? v Suppose -12 = -4u + q, 105u - 5q + 6 = 107u. What is the third smallest value in -7/3, -2, -2/15, u? -2/15 Let w = -860 - -863. Suppose 0 = -2c - c - 3g + 18, -4g = -3c - 17. What is the biggest value in c, -2, 1/3, w? w Let j = -604/1485 - -2/297. Which is the third smallest value? (a) j (b) -0.3 (c) 0.2 (d) 25 c Let o be (-200030)/(-12) + 3/(-18). Let s = o + -83698/5. Let q = s - -71. Which is the third biggest value? (a) -2/7 (b) 1 (c) q a Let s = 21.8 - 22. Which is the smallest value? (a) -5 (b) 9 (c) s (d) 2 a Let h = -11.05 - -31.6. Let q = h + 0.45. Which is the biggest value? (a) 2/23 (b) 0 (c) q (d) 0.5 c Let m be (-30)/(-25)-5 + -7. Which is the second smallest value? (a) -1 (b) m (c) 0.1 (d) -3 d Let a = 988.4 - 988. What is the smallest value in -14, -1, a, -2? -14 Let r(p) = -p*2 - 2p - 4. Let s be r(0). Let v be (1 + -1)1/(-2). What is the second biggest value in s, 2/5, v? v Let m(i) = 3i*2 - 123i - 122. Let y be m(42). Let u(p) = p + 6. Let w be u(-5). Which is the third biggest value? (a) 0 (b) y (c) w a Let x = -86 + 162. Let f = 75.6 - x. What is the biggest value in f, -14, 0? 0 Let r = 90.724 + -94.7. Let g = r + -0.074. Let y = g - -0.05. What is the third biggest value in y, -0.3, 5? y Let r(k) = -23k - 145. Let t be r(-6). Let o = 0 + -0.5. Which is the second biggest value? (a) -4 (b) t (c) o a Suppose -4l = -2l. Let v = 3.751 + -4.251. Which is the second biggest value? (a) v (b) l (c) -14/15 a Let h = -0.27 + -0.03. Suppose 11z = d + 7z - 4, 0 = -3d - 2z - 16. Which is the second biggest value? (a) d (b) -0.4 (c) h b Let z = 3 + -2.7. Which is the third biggest value? (a) -62 (b) z (c) 4 a Let q = 144.97 + -144. Let t = 3.03 + q. Let g = 2 - 1.95. Which is the second smallest value? (a) -2/15 (b) g (c) t b Let g = -5.1 - -0.1. What is the third biggest value in -2/9, g, -0.1? g Let h(x) = -30x**3 - x - 1. Let v be h(-2). Let n = v + -4575/19. Which is the third biggest value? (a) 0.5 (b) -2 (c) n b Let g = -19 + 19.1. Which is the second biggest value? (a) g (b) -4 (c) 3 (d) -3 a Let n = 3 + -4.8. Let y = 81.6 - 79.9. Let x = n + y. Which is t	{ "pile_set_name": "DM Mathematics" }
, 224 = 36s - 4h for s. 6 Solve -18 = 2w - 8i, 8502i + 8 = -4w + 8504i for w. -1 Solve -j - 116 = 13b - 27, 3b = -b + 7355j - 7353j - 32 for b. -7 Solve 2b + c + 684465 = 684445, -3c = 5b + 49 for b. -11 Solve y = -3p - 23, 3y - 6p + 0 + 3 + 12 - 36 = 0 for y. -5 Solve -a = -13l + 53, -60l - a = -62l - 2a + 22 for l. 5 Solve -b + 4w = 19, 477 - 468 = b + 3w for b. -3 Solve -21w = -2w - 5x + 137, -421x = -w - 419x - 35 for w. -3 Solve -8c + 3m + 63 = 14c, -4586 + 4691 = c - 5m for c. 0 Solve 2p - 4p + 2 = l + 2p, l - 143p - 14 = 159p - 318p for l. -2 Solve -8s = 6s + p + 111, 1227s - 2p - 102 = 1225s for s. -4 Solve 0 = -3t + 3m - 15, 7t + 76m - 79m + 39 = 0 for t. -6 Solve -x = 176c - 179c + 33, -2c + 284 + 113 = -9x for c. -4 Solve 408h - 405h - 56z - 374 = 0, h = -3z - 27 for h. -6 Solve 257j = 84j + 80j + 79j - i + 22, 0 = -j - 4i + 143 for j. -1 Solve 3j + 4w - 70 = 125 + 38, -44j = -3w + 36 for j. 3 Solve 4z = -2t - 22, -124848 + 124863 = -3z - 3t for z. -6 Solve -4k - 12 = a, 0 = -135a + 137a + 2k for a. 4 Solve 0 = -4l - d + 14, -4l + 51d - 1993 + 239 = 0 for l. -5 Solve -3a - 65 = -4g - 7a - 105, 0 = 4a - 0 + 4 for g. -9 Solve -4g - 4u + 70 = -9g, 412g = 417g + 23u - 65 for g. -10 Solve 5l - 25 = -5u, -5u = 10l + 1 - 51 + 5 for l. 4 Solve 80 = t - 2j, -170j - 111 = -2t + 164j - 329j + 87 for t. 4 Solve 3d - 99 = -18u, -u - 379785d + 379781d = -17 for u. 5 Solve -9m + 9m - 34r = 4m - 29r - 168, -5m - 2r = -227 for m. 47 Solve -v - 9 = 0, -104u - 15 = -107u + v for u. 2 Solve 6k - 179087g - 44 = -179085g, 3g = 5k - 58 for k. 2 Solve -9q + 4g + 5g - 26 = -20q, 5q + 2 - 26 = 2g for q. 4 Solve -6l + 3k + 13009 = 12961, -3k - 27 = l for l. 3 Solve 2v - 3j - 19 = 46, -86v - 8j - 19 = -3j for v. 1 Solve -x - 18 = 7l, -9909x = 2l - 9905x + 20 for l. -2 Solve 3488t - 3504t = 2q - 24, -3q = 3t - 36 for t. 0 Solve 0 = -i + 2m + 6, -6668m + 6671m + 19 = -i for i. -4 Solve -9381l = -9378l + 7v + 21, -2v + 14 = -2l for l. -7 Solve -27r + 7r - 65 = -7k - 15r, -18 = 3r for k. 5 Solve 4g + 3x = -2904 + 2922, -6g + 32 = 5x for g. -3 Solve 16 + 38 = 3m + 5y, -406y + 154 = m - 393y for m. -2 Solve -1170i + 1175i - 33 = 4x, -3x - x - 5i = -57 for x. 3 Solve -4570g + 4575g - 38 = 2b, -2b = g + 38 for b. -19 Solve 3a - 117 = 0, 4p + 5268 = -9a + 5631 for p. 3 Solve 5b - 27s + 20 = -87, -6 + 74 = -4b + 4s for b. -16 Solve 5w - 108d + 37d - 126d + 843 = 0, 5w + 4d + 39 = 0 for w. -11 Solve 2c - 12b + 9 = 35, -b - 35 + 32 = -c for c. 1 Solve 4t = 7c + 8c + 82, 0t + 3t = 42c - 36c + 51 for t. 13 Solve 2y + 0y + x = 23, 2x + 47 + 26 - 11 = 8y for y. 9 Solve 26a + 156 = 30a - 24z, -2a + 2z = -6a + 78 for a. 21 Solve -79879 = -s + j - 79886, 0 = 58s - 2j - 42 for s. 1 Solve -2f - 55b + 34 = -53b, 0 = 9f + 4b - 78 for f. 2 Solve -4n + 211099 - 211212 = -t + 4t, 2t - 61 = 2n - t for n. -29 Solve 2012669d - 2012668d = -k + 13, d + 11 = k for d. 1 Solve 2g = 5m - 70, -792g = 2m - 786g + 176 for m. 2 Solve -13v + 722 = j - 697 + 1327, -4j - 4v + 32 = 0 for j. 1 Solve -b = 3, u + 2u + 303 = -3b + 243 for u. -17 Solve -16t - 3g = 660 - 795, -3g = 5t - 102 for t. 3 Solve 0 = -5c - 0c + 231b - 235b - 50, -25b - 5b = -6c + 288 for c. -2 Solve -3h - 12z + 183 = 0, 3614573h = 3614575h + 2z - 122 for h. 61 Solve 6r = -4c + 21r - 75 - 71, -r - 8 = -5r for c. -29 Solve 0 = -m + 1, 5k + 14015 = -63m + 14068 for k. -2 Solve -4s - 880f - 76 = -877f, 2s + 54 = -2f for s. 5 Solve 4l + g + g + 53 = 93, -142g = -2l + 592 for l. 12 Solve -u - 930 + 966 = m, 0u + u + 11m - 300 = 46 for u. 5 Solve -23z - 95014i - 422 = -95009i, -i = -z - 22 for z. -19 Solve u - 3w - 24 = -3u - 3, 5u - u + w = 9 for u. 3 Solve 3i + 4q - 5q + 266 = 294, -21 = -7q - 2 - 110 for i. 5 Solve 31d - 31 = 3x, -716x - 5 = -5d - 711x for d. 1 Solve -5j - 59 = 42r - 75, 5r = 4j - 90 for j. 20 Solve k + 173204 = c + 173196, -20 = 2c + 4k for c. 2 Solve q - 8c - 8 - 18 = -0q + 3, 252q - 249q - 21 = 2c for q. 5 Solve 3k = 3s - 0 - 12, 2192k - 4s = 2195k - 9 for k. -1 Solve -38z - 128 = -21z + 15k, 334z + 4 = 337z - 4k for z. -4 Solve -265 = -14c + b, 20558 = -2c - b + 20597 for c. 19 Solve w = 2c - 3, 96w - 101w - 31c = -67 for w. 1 Solve -4q = -74l - 448, 95q - 12 = 90q + 5l - 6 + 29 for q. 1 Solve l - 1 = 2j + 4, -6484j = -4l - 6488j + 20 for l. 5 Solve -5q = -l - 454816 + 454815, -4l - 76 = 4q for q. -3 Solve -18a - 5w + 1015 = 0, 384094a = 384090a + w + 215 for a. 55 Solve 14j + 73 = -53v + 51v + 42j - 23j, 7 = -5v - j for v. -4 Solve 5n + r = 2r + 769 - 791, 3n + 66 = 3r for n. 0 Solve -2p - 2x + 126 - 65 = 55, 15 = -10p - x for p. -2 Solve 5x = 2u + 31, -8u + 3x + 2 - 23 - 18 = 0 for u. -3 Solve -4a - 2l - 118 = 0, -1204a = -1209a + 3l - 142 for a. -29 Solve 77 = 3h - 5k, 0 = -4250h + 4246h - 4k + 60 for h. 19 Solve 4y = -5b + 66, -4y - 137 - 138 = -b + 140 - 421 for b. 10 Solve -69718k + 69713k + 8v + 47 = 0, -k = 5v + 17 for k. 3 Solve -2667d - m - 50 = -2663d, -20 = 2d - 2m for d. -12 Solve -3x + 30 = -2j, -6j + 8x - 16 = -j - 4 + 65 for j. -9 Solve -2s + 38 = 5d, -114512d = -114511d + 2s - 30 for d. 2 Solve 4v - 4m = 68, -391690m = -5v - 391687m + 87 for v. 18 Solve 30y - 28y = 2q - 16, 5y = 3q - 48 for y. -12 Solve 2f = -b + 9, -91f + 193f + 19 = 3b + 106f for b. 1 Solve 0 = d + 5n - 16 + 83, -d + 12d + 142 = 5d - 10n for d. -2 Solve -3z = 7967i - 7971i + 20, -16 = -2i + 3z - 0 for i. 2 Solve 2v + 17g - 22g + 19 - 207 = 0, 14v - 176 = 5g for v. -1 Solve -h = 3k - 18, h - 15738k - 19 = -0h - 15740k for h. 21 Solve -2n + 10d - 110 = 0, -3d - 1857 = n - 1898 for n. 5 Solve -22m = -3z + 589 - 598, -z - 3 = 2m for m. 0 Solve -r = 3c - 20, -18094r + 2c = -18099r + 22 for r. 2 Solve 108i - 216i + 110i - 8p + 18 = -3p, 28i + 118 = 3p for i. -4 Solve -5f - 6m - 45 = -11m, -10m + 11m + 9 = 4f + 6m for f. -4 Solve 20g + t - 167 = 0, -4t + 1891 = 1463 for g. 3 Solve 0 = -3k - z + 14, -16k - 514354z + 75 = -514349z for k. 5 Solve 3w - 499u = -442u - 384, -4u + 38 = 2w for w. 5 Solve -3s - p = -25, 10653p + 171 = 10662p for s. 2 Solve 24o + s - 22 + 2 = 46o - 26o, -14s + 12s = 5o - 25 for o. 5 Solve -5r + 2o = 7 + 20 + 4 - 0, -4o + 7 = r for r. -5 Solve 0 = 4x - 4f + 4, 51179x + 4f - 2f + 28 = 51175x for x. -5 Solve 3b - 5v + 38 = 0, 1596030v + 8 = -3b + 1596032v for b. 4 Solve -16a - 84 = -2m + 180, -86m + 82m = -2a - 48 for m. 4 Solve -105050 = 3t + 3a - 105077, 2a + 60 = 4t for t. 13 Solve 14g - 53 = 5c, g - 8499c = -8497c + 12 for g. 2 Solve 6a - 10 = -2f + 4a - 0a + a, -3f + 6a - 30 = 0 for f. 2 Solve -3a = 4b + 22, -31a - 16 = 2b - 27a for b. -4 Solve 0 = -x - 11l - 33 - 15, 5x - l + 6l + 40 = 0 for x. -4 Solve -432z + 437z = 4c + 90, -3c + 5z + z = 11z - 125 for c. 5 Solve -4y + 54 = 16p - 42, 5p - 8 - 25 = -2y for p. 5 Solve -z + 5z = 2s, -10z = -14z + 7z + 15 for s. -10 Solve 0 = 10u - 15a - 455 + 545, 0 = -2u - a + 6 for u. 0 Solve i + 13 = 4j - 17, 0i - 16 - 35 = 4i + 7j for i. -18 Solve 3h = -143y + 142y + 220, -7y + 72 = h - 6y for h. 74 Solve -998265 = 5y + 4g - 998255, 5g = 18y + 36 for y. -2 Solve -18g - 144792k - 906 = -144796k, 99 = -2g + k for g. -51 Solve 3n - 5n - 2k - 66 = 0, -k - 21 = 72n - 38n - 29n for n. 3 Solve -2j + 4u - 186 = 0, 1951366j - 5u = 1951361j - 247 + 12 for j. -1 Solve 6 = j + c, -2j + 80238 - 80225 = c for j. 7 Solve -3044x - 3 + 2 + 17 = -3040x, 0 = 3y + 4x + 35 for y. -17 Solve 4l + 284702i - 284696i + 2 = 0, -2l + 3i = 19 for l. -5 Solve 17h - 14h + 24 - 42 = 2j, -14h + 4j - 7j = -10 for h. 2 Solve -8r + 68 = -5k, 278k + 28 = 274k + 2r for k. -4 Solve -15 = -5f + 96034r - 96039r, 9f - 27 = -4r for f. 3 Solve -5i + 16362v - 9 = 16360v, 50 = -2i - 5v for i. -5 Solve 3c + 4c = 3b + 107, -7c + 6c = -3c + 2*b + 34 for c. 14 Solve -3	{ "pile_set_name": "DM Mathematics" }
929551, -1394330, -1859109? -464779d + 7 What is the r'th term of 13558, 27094, 40630? 13536r + 22 What is the s'th term of 254, 608, 986, 1388, 1814? 12s2 + 318s - 76 What is the p'th term of -7635, -7596, -7559, -7524, -7491, -7460, -7431? -p*2 + 42p - 7676 What is the x'th term of 356, 1347, 2992, 5291, 8244? 327x2 + 10x + 19 What is the t'th term of -530, -4116, -13834, -32750, -63930, -110440, -175346, -261714? -511t3 - 9t - 10 What is the g'th term of 9674760, 19349520, 29024280, 38699040, 48373800, 58048560? 9674760g What is the n'th term of -193682, -774723, -1743124, -3098885, -4842006? -193680n*2 - n - 1 What is the q'th term of 1159, 2255, 3345, 4429, 5507? -3q*2 + 1105q + 57 What is the m'th term of 10, -491, -2022, -5099, -10238, -17955, -28766? -86m3 + m2 + 98m - 3 What is the k'th term of -634334, -634338, -634344, -634352? -k*2 - k - 634332 What is the o'th term of 265, 412, 625, 904, 1249, 1660, 2137? 33o*2 + 48o + 184 What is the i'th term of -37276, -37289, -37302? -13i - 37263 What is the h'th term of -282, -414, -546, -678? -132h - 150 What is the i'th term of -1237, -1242, -1247? -5i - 1232 What is the b'th term of -18591, -18624, -18681, -18762? -12b*2 + 3b - 18582 What is the f'th term of 197, 365, 529, 689, 845, 997, 1145? -2f2 + 174f + 25 What is the s'th term of 815, 2704, 5859, 10280, 15967, 22920? 633s2 - 10s + 192 What is the v'th term of 76, -175, -564, -1091? -69v2 - 44v + 189 What is the i'th term of 4497, 9192, 13887? 4695i - 198 What is the h'th term of 1846, 3743, 5662, 7615, 9614, 11671? 2h3 - h2 + 1886h - 41 What is the c'th term of 1817, 3627, 5437, 7241, 9033, 10807? -c3 + 6c*2 + 1799c + 13 What is the m'th term of 1871, 993, 115, -763? -878m + 2749 What is the i'th term of 5251, 5247, 5243? -4i + 5255 What is the n'th term of 46, 192, 604, 1426, 2802, 4876, 7792, 11694? 24n3 - 11n*2 + 11n + 22 What is the y'th term of -132425, -264848, -397271, -529694? -132423y - 2 What is the y'th term of 943, 7289, 24507, 58033, 113303, 195753, 310819, 463937? 906y*3 + 4y + 33 What is the o'th term of -701, -1382, -2037, -2654, -3221? 2o3 + o2 - 698o - 6 What is the x'th term of 549, 921, 1295, 1671, 2049, 2429? x*2 + 369x + 179 What is the q'th term of -285, -742, -1535, -2832, -4801? -28q3 - 261q + 4 What is the o'th term of 467, 492, 519, 548, 579, 612? o*2 + 22o + 444 What is the g'th term of -8821, -8818, -8815, -8812, -8809, -8806? 3g - 8824 What is the n'th term of 40, 184, 424, 760, 1192? 48n*2 - 8 What is the b'th term of -111458, -222917, -334376? -111459b + 1 What is the j'th term of 69520, 139039, 208558, 278077? 69519j + 1 What is the s'th term of -36, -113, -228, -381? -19s*2 - 20s + 3 What is the k'th term of 204, 418, 630, 840, 1048, 1254? -k*2 + 217k - 12 What is the z'th term of -5838252, -11676502, -17514752, -23353002, -29191252, -35029502? -5838250z - 2 What is the r'th term of 21237, 84938, 191107, 339744? 21234r*2 - r + 4 What is the c'th term of -81, -48, -25, -12, -9? -5c*2 + 48c - 124 What is the k'th term of -1803, -1844, -1923, -2046, -2219, -2448, -2739? -k*3 - 13k*2 + 5k - 1794 What is the p'th term of -1040, -2081, -3124, -4169, -5216, -6265, -7316? -p*2 - 1038p - 1 What is the r'th term of -1326, -2509, -3692? -1183r - 143 What is the a'th term of 4450, 4449, 4448, 4447, 4446, 4445? -a + 4451 What is the s'th term of 24136, 48250, 72362, 96472, 120580, 144686? -s2 + 24117s + 20 What is the g'th term of 25605, 25602, 25597, 25590, 25581, 25570, 25557? -g*2 + 25606 What is the n'th term of 177, 323, 469? 146n + 31 What is the o'th term of 3588, 7146, 10702, 14256? -o*2 + 3561o + 28 What is the q'th term of -1772, -1797, -1822? -25q - 1747 What is the l'th term of -1246, -1226, -1218, -1228, -1262, -1326, -1426, -1568? -l3 + 27l - 1272 What is the u'th term of -901297, -1802589, -2703879, -3605167? u*2 - 901295u - 3 What is the x'th term of 643, 627, 585, 505, 375, 183? -2x3 - x2 + x + 645 What is the w'th term of 2, -283, -758, -1423? -95w*2 + 97 What is the p'th term of 582, 1061, 1540? 479p + 103 What is the d'th term of 1648, 1651, 1656, 1663? d*2 + 1647 What is the p'th term of -219, -1021, -2345, -4191, -6559, -9449? -261p*2 - 19p + 61 What is the a'th term of -1297394, -1297396, -1297398? -2a - 1297392 What is the w'th term of -1297, -2005, -2713, -3421, -4129? -708w - 589 What is the b'th term of 14317, 28667, 43049, 57457, 71885, 86327? -b*3 + 22b*2 + 14291b + 5 What is the n'th term of 1695, 3412, 5153, 6918, 8707, 10520, 12357? 12n2 + 1681n + 2 What is the z'th term of -1519, -2971, -4301, -5449, -6355, -6959, -7201? 10z3 + z2 - 1525z - 5 What is the v'th term of -2005, -8059, -18143, -32251, -50377, -72515, -98659, -128803? v*3 - 2021v*2 + 2v + 13 What is the y'th term of -71372, -142736, -214100? -71364y - 8 What is the t'th term of 5995, 5993, 5991? -2t + 5997 What is the n'th term of 138, 779, 1856, 3375, 5342, 7763, 10644, 13991? n*3 + 212n*2 - 2n - 73 What is the i'th term of -86, 51, 186, 313, 426? -i*3 + 5i*2 + 129i - 219 What is the m'th term of -114037, -114073, -114109, -114145, -114181, -114217? -36m - 114001 What is the n'th term of 235239, 235238, 235237, 235236? -n + 235240 What is the h'th term of -471, -479, -509, -573, -683, -851, -1089, -1409? -2h3 + h2 + 3h - 473 What is the u'th term of -12693, -25387, -38081, -50775, -63469, -76163? -12694u + 1 What is the p'th term of 401, 815, 1229? 414p - 13 What is the b'th term of -565, -609, -649, -685, -717? 2b*2 - 50b - 517 What is the w'th term of -74, -154, -230, -302? 2w2 - 86w + 10 What is the w'th term of 345, 841, 2189, 4815, 9145, 15605? 71w3 - w + 275 What is the v'th term of 485487, 1941957, 4369413, 7767861, 12137307, 17477757, 23789217, 31071693? v3 + 485487v*2 + 2v - 3 What is the k'th term of -155280, -155273, -155266? 7k - 155287 What is the c'th term of 152748, 1221933, 4124010, 9775425, 19092624? 152741c*3 - 2c + 9 What is the o'th term of 36, -712, -1958, -3702, -5944? -249o2 - o + 286 What is the a'th term of 37733, 37730, 37729, 37730, 37733, 37738? a2 - 6a + 37738 What is the w'th term of 40631, 81292, 121953, 162614, 203275, 243936? 40661w - 30 What is the t'th term of 6510, 13055, 19596, 26133, 32666? -2t*2 + 6551t - 39 What is the x'th term of -134, -89, -34, 31? 5x2 + 30x - 169 What is the o'th term of 804, 1660, 2516, 3372? 856o - 52 What is the c'th term of -322, -698, -1056, -1402, -1742, -2082, -2428? -c3 + 15c*2 - 414c + 78 What is the k'th term of 4481, 17927, 40369, 71831, 112337, 161911, 220577, 288359? 4k3 + 4474k*2 - 4k + 7 What is the j'th term of 187831, 187824, 187817, 187810, 187803, 187796? -7j + 187838 What is the l'th term of -110, -415, -872, -1481, -2242, -3155? -76l*2 - 77l + 43 What is the j'th term of -936, -1826, -2654, -3390, -4004? 5j3 + j2 - 928j - 14 What is the h'th term of -744, -745, -750, -759? -2h2 + 5h - 747 What is the p'th term of 1594, 3256, 5064, 7090, 9406, 12084, 15196? 12p3 + p2 + 1575p + 6 What is the t'th term of 13385, 26771, 40157? 13386t - 1 What is the w'th term of 699, 904, 1119, 1350, 1603, 1884? w3 - w2 + 201w + 498 What is the z'th term of -45, -191, -343, -501, -665, -835, -1011? -3z2 - 137z + 95 What is the d'th term of 24180, 24162, 24144, 24126, 24108, 24090? -18d + 24198 What is the z'th term of -300342, -300343, -300344, -300345, -300346? -z - 300341 What is the p'th term of -6024, -12060, -18100, -24144, -30192? -2p*2 - 6030p + 8 What is the m'th term of 1504, 3006, 4502, 5992, 7476, 8954, 10426? -3m2 + 1511m - 4 What is the o'th term of 358, -222, -802? -580o + 938 What is the c'th term of 295, 269, 221, 139, 11, -175? -2c3 + c2 - 15c + 311 What is the l'th term of 4237, 8473, 12709? 4236l + 1 What is the p'th term of 29, 26, 57, 176, 437, 894, 1601, 2612? 9p3 - 37p*2 + 45p + 12 What is the m'th term of 2529, 5009, 7391, 9627, 11669, 13469, 14979, 16151? -8m3 - m2 + 2539m - 1 What is the f'th term of -57290, -57281, -57272? 9*f - 57299 What is the s'th term	{ "pile_set_name": "DM Mathematics" }
) = 4q - 59. Let n be z(16). Let p(o) = -o - 1. Let d be p(-8). Let m(k) = -d + 7 + nk - 13 + 2k. Let g(h) = 4h - 7. Calculate 5g(w) - 3m(w). -w + 4 Let u(b) be the first derivative of b4/4 - b + 410. Let i(s) be the third derivative of s6/40 - s*3/2 + 17s*2. Determine -i(z) + 4u(z). z*3 - 1 Let w(h) = 20h*2 + 17h. Let s = 722 + -166. Let c = s - 562. Let i(p) = 0p - 6p + 0p - 7p*2. What is cw(z) - 17i(z)? -z2 Let a(v) = 3v - 742. Let t(n) = 12n - 2971. Determine 11a(m) - 3t(m). -3m + 751 Let a(v) be the third derivative of -v*5/15 + 5v*3/6 + 8v*2 - 3. Suppose 0 = -3b - 6 - 3. Let i(t) = 5t2 - 5. Give ba(p) - 2i(p). 2p*2 - 5 Let p(l) = -32l + 3. Let o(w) be the first derivative of -8w2 + w + 7035. Determine 5o(j) - 2p(j). -16j - 1 Let s = -2180 - -2178. Let j(k) = -k*2 + k. Let m(y) = -2y*3 - 4y*2 + 2y. Give sj(b) + m(b). -2b*3 - 2b*2 Let t(l) = 44l*2 + 2l - 51. Let b(d) = 11d2 + d - 11. Give 9b(k) - 2t(k). 11k*2 + 5k + 3 Let s(c) = -3c - 1. Let n(b) be the third derivative of -b4/8 - 17b*2 - 8. Give -7n(g) + 6s(g). 3g - 6 Let n(p) = -860p2 - 880p + 110. Let u(z) = z*2 - 8z + 1. Calculate 4n(s) - 440u(s). -3880s2 Let o(d) = 16d - 13. Suppose -6t + 87 = 93. Let w be (t - -2)/(-14 - 759/(-55)). Let c(i) = -3 + 3 - 11i + 9. What is wo(h) - 7c(h)? -3h + 2 Let y(a) = 21a*2 - 4a + 4. Let v(o) = 64o2 - 11o + 11. Suppose 5d + 3p + 11 = 0, 5p = -8d + 6d + 7. Give dv(g) + 11y(g). -25g2 Let d(g) = -g2 - 4. Let a(c) = -3c2 + 2c + 16. Calculate -a(w) - 3d(w). 6w*2 - 2w - 4 Let n = 5 - 0. Let x be (-4)/(-6)-3 + n. Let y(w) = -w3 - w2. Let k(q) = -21q*2 + 2q*3 - 22q*2 + 70q*2 - 26q*2. What is xk(u) + 3y(u)? 3u*3 Let d(w) = w - 1. Let i(v) = -7v3 + v2 - 6v - 1. Let a be i(0). Let x(r) = -12r + 7. What is ax(l) - 4d(l)? 8l - 3 Let t(h) = 2h*2 - 2h + 9. Let u(s) = 24s2 + 28s*2 - 105s*2 - 19 + 21s*2 + 28s*2 + 5s + s*3. Calculate -5t(l) - 2u(l). -2l*3 - 2l*2 - 7 Let g be 0/(-7(-3 - 20/(-7))). Suppose g = 2d + 5u - 2u + 12, -3d + 2u - 5 = 0. Let a(k) = -6k + 3. Let q(y) = 7y - 2. Calculate dq(r) - 2a(r). -9r Let f(z) = -1101430z2 - 187z - 187. Let h(b) = 53081b2 + 9b + 9. Calculate 9f(g) + 187h(g). 13277g2 Let f(n) = -n3 + 8n*2 + 173n - 1. Let s(z) = -13z2 - 172z + 2. Give 3f(c) + 2s(c). -3c3 - 2c*2 + 175c + 1 Let s(l) = -151l + 2. Let g(i) = i2 + 2i - 2. Determine 2g(f) + s(f). 2f*2 - 147f - 2 Let a(v) = -2543v3 + 3v*2 + 10v + 23. Let b(x) = 1018x3 - x2 - 4x - 9. Calculate -5a(f) - 13b(f). -519f3 - 2f*2 + 2f + 2 Let w(y) be the second derivative of 5y3/6 - y2/2 + 233y + 8. Let s(h) = h - h - 3h + 2h. Let o = 2 - -2. What is os(t) + w(t)? t - 1 Let l(h) = -12259h + 28. Let c(y) = 6126y - 16. Calculate -7c(d) - 4l(d). 6154d Let n(g) = -g - 5. Let c be n(-8). Let r(k) = 2 - c + 0. Let v(d) = 2d - 10. Let w(q) = q2 + 5q - 58. Let u be w(-11). What is ur(y) - v(y)? -2y + 2 Let v(y) = -2y2 + 16y - 4. Let w(a) = -3a2 + 16a - 5. Let m be (4 + 119/(-21))/((-75)/(-180)). Calculate mw(b) + 5v(b). 2b2 + 16b Let c(b) be the third derivative of b4/12 + b3/2 - 3b2 - 209. Let i(g) be the second derivative of -g3/6 - g2/2 - 4g. What is -2c(x) - 5i(x)? x - 1 Let q(a) = 12985a3 - 220a. Let u(v) = -481v3 + 8v. What is 4q(m) + 110u(m)? -970m3 Let c(x) = -489x - 303. Let d(n) = 391n + 303. Calculate -8c(k) - 10d(k). 2k - 606 Let x(i) = 32i + 4. Let f(b) = 173b + 17. Let c(s) = 216s + 21. Let y(k) = 4c(k) - 5f(k). Determine -x(o) - 2y(o). -30o - 2 Suppose 40a = -2459 + 2219. Let c(j) = -13j3 - 7j*2 + 11. Let t(b) = 6b*3 + 4b*2 - 6. Calculate ac(m) - 11t(m). 12m*3 - 2m*2 Let x(f) = -13f - 71. Let s(q) = 2q + 24. Determine -7s(i) - 2x(i). 12i - 26 Let c(a) = 46a3 + 6a*2 - 8a + 2. Let g(y) = 146y3 + 21y*2 - 24y + 5. Determine -7c(q) + 2g(q). -30q3 + 8q - 4 Let a(v) = 67v2 + 24v - 30. Let z(k) = -333k2 - 120k + 144. Determine -24a(t) - 5z(t). 57t2 + 24t Let f(r) = 68r2 + 25r + 4. Let y(d) = 68d2 + 25d + 5. Give 4f(s) - 3y(s). 68s2 + 25s + 1 Let x(y) = 12y2 + y - 9. Let a(g) = 13g*2 + g - 10. Let k(m) = -2m*2 - 105m - 993. Let j be k(-40). Determine jx(t) - 6a(t). 6t2 + t - 3 Let u(y) = 43y*3 + 15y*2 - 13y + 86. Let c(s) = 21s3 + 7s*2 - 6s + 38. Give 9c(p) - 4u(p). 17p3 + 3p*2 - 2p - 2 Let i(o) = -6 + 2o2 - 61o + 82o - 7o2. Let q(b) = b2 - 4b + 1. Suppose 4n - 50 = 3s, 3s = -n + 4s + 13. What is nq(m) + 2i(m)? m2 - 2m - 1 Let m(o) = -o - 1. Let b(h) = 3h + 6. Let d be (-450)/(-315) + 4/28-3. Calculate db(y) + 4m(y). -y + 2 Let d(u) = 2041u3 + 8u + 4. Let o(q) = 46943q3 + 182q + 91. Calculate 91d(h) - 4o(h). -2041h3 Let a = 157 + -149. Suppose j = 3 - a. Let w(f) = -f. Let m(k) = 6k - 1. Calculate jw(c) - m(c). -c + 1 Let i(a) = -a + 1. Let t(q) = -27q*2 + 3q - 2. Determine -2i(k) - t(k). 27k*2 - k Suppose 3o + 8 = -y, 3y - 2y = -5o - 16. Let x(q) = -39q*3 - 27. Let f(v) = 3v*3 + 2. Determine yx(i) + 54f(i). 6i*3 Let c(t) = -6t*3 + 6t*2 + 4t + 3. Let b(s) = 5s3 - 5s*2 - 3s - 2. Suppose -3r + 12 = -5a, 17r - 12 = 14r - 4a. Determine rb(l) + 3c(l). 2l*3 - 2l*2 + 1 Let h(r) = 2r*3 + 10r*2 - 6r - 1. Let x(i) = -2i3 - 10i*2 + 7i + 1. Let z(u) = 211u - 1892. Let q be z(9). What is qh(s) + 6x(s)? 2s*3 + 10s*2 - 1 Let u(d) = 2d + 6. Let c(o) be the third derivative of -5o4/24 - 13o*3/6 - 152o*2. Let y = -115 + 128. Determine yu(g) + 6c(g). -4g Let c(r) = -2r2 + 2r + 1. Let n(v) = 10v2 - 5v - 2. Let w(i) = 7c(i) + 2n(i). Let l(p) = -13p2 - 9p - 7. What is 2l(h) + 5w(h)? 4h2 + 2h + 1 Let n(w) = 6w - 4 - 14 + 0w + 20 - 4. Let q(i) = -1. Give -n(p) + 3q(p). -6p - 1 Let r(p) = -11p2 + 4p - 6. Let l(i) = -21i2 + 7i - 11. Suppose -368 = -13u - 225. Determine ur(h) - 6l(h). 5h*2 + 2h Suppose 355k + 59 = 296k. Let z(g) = -6g + 5. Let v(t) = -t + 1. Give kz(u) + 3v(u). 3u - 2 Let n(c) = 1010c3 - 9c*2 + 15c + 18. Let t(x) = 504x3 - 4x*2 + 7x + 8. What is 4n(w) - 9t(w)? -496w3 - 3w Let f(j) = -2j3 + 4j*2 - 14j + 4. Let n(t) = 2t3 - 5t*2 + 13t - 5. Suppose -2a - x = -9, 4x = 7a - 12a + 21. Give af(h) + 4n(h). -2h3 - 18h Let s(v) = 600v - 62. Let k(h) = h + 5. Give 12k(t) + s(t). 612t - 2 Let f(t) = -4564t3 - t2 + 2. Let g(a) = -18254a3 - 5a*2 + 9. What is -9f(i) + 2g(i)? 4568i3 - i2 Let p(b) = -35b + 55. Let q(u) = u2 - 32u - 100. Let l be q(35). Let f(k) = -5 - 3 + l - 4k + 7k - k. Give 110f(z) + 6p(z). 10z Let i(p) = -16p. Let o(n) = -323 - 308 + 631 + n. What is 3i(z) + 24o(z)? -24z Let c(h) = -89h*2 + 713h - 6. Let d be c(8). Let t(w) = -2w3 + 2w*2 - 2w + 15. Let m(n) = n*2 - n. Calculate dm(z) - t(z). 2z3 - 15 Let z(x) = -3353x*3 - 13x*2 - 7. Let h(a) = -1117a*3 - 4a*2 - 2. Give -7h(w) + 2z(w). 1113w*3 + 2w*2 Let i(x) = -x - 2. Let w = -852 + 481. Let g = 369 + w. Let k(n) = n + 3. Determine gk(z) - 3i(z). z Let k(b) = -26b*3 - 4. Let a(w) be the second derivative of -77w*5/20 - 11w*2/2 - 1417w. Determine 4a(f) - 11k(f). -22f3 Let k be ((0 + 2)/(-4))/(5/(-130)). Let i(a) = 20 - 8 + ka*2 - 5 - 12 + 3a*2. Let f(d) = -40d*2 + 12. What is -5f(z) - 12i(z)? 8z*2 Let a(d) = 110d*3 - 10d*2 + 32d - 17. Let x(u) = 128u3 - 12u*2 + 32u - 18. Determine 7a(m) - 6x(m). 2m3 + 2m*2 + 32m - 11 Let i(b) = b + 2. Suppose 4s + 367 = 6g - g, 3s = -4g - 252. Let z = -68 - s. Suppose 5c + z - 5 = 0. Let a(t) = 4t + 10. What is ca(v) + 14i(v)? 2v - 2 Let v(a) = 3a*3 - 67a*2 - 3a - 1. Let o(w) = -w*2 - w. Calculate 3o(f) - v(f). -3f3 + 64f*2 + 1 Let p(w) = 1233w*2 - 17w - 79. Let h(j) = 154j2 - 2j - 10. Determine -17h(l) + 2p(l). -152l2 + 12 Let f(r) = r2 + r. Let q(o) be the third derivative of 13o*5/3 + 143o*4/12 + 2o*2 + 2383o. What is 572f(m) - 2q(m)? 52m2 Let o(d) = -4d - 2.	{ "pile_set_name": "DM Mathematics" }
f 214988231? 8 What is the thousands digit of 569729694? 9 What is the hundred millions digit of 369709614? 3 What is the tens digit of 770220560? 6 What is the ten thousands digit of 6377163694? 6 What is the hundreds digit of 8591484886? 8 What is the tens digit of 4977176674? 7 What is the hundreds digit of 26172553? 5 What is the ten thousands digit of 234110388? 1 What is the tens digit of 44043792? 9 What is the thousands digit of 9150110? 0 What is the tens digit of 4564294786? 8 What is the thousands digit of 1694369365? 9 What is the hundred thousands digit of 1938341439? 3 What is the tens digit of 2334293769? 6 What is the ten millions digit of 167036311? 6 What is the ten millions digit of 110092012? 1 What is the tens digit of 447288292? 9 What is the ten millions digit of 51273191? 5 What is the ten millions digit of 206653890? 0 What is the hundred thousands digit of 218071025? 0 What is the tens digit of 414067534? 3 What is the thousands digit of 40403774? 3 What is the thousands digit of 655692045? 2 What is the tens digit of 159392808? 0 What is the hundreds digit of 6398537698? 6 What is the hundred thousands digit of 915532351? 5 What is the millions digit of 39407520? 9 What is the ten millions digit of 12300230? 1 What is the units digit of 72898954? 4 What is the thousands digit of 4623617023? 7 What is the millions digit of 115705657? 5 What is the ten thousands digit of 609179144? 7 What is the thousands digit of 4158859697? 9 What is the thousands digit of 137203916? 3 What is the thousands digit of 143228765? 8 What is the millions digit of 8722188? 8 What is the hundred thousands digit of 310609928? 6 What is the tens digit of 1133083442? 4 What is the billions digit of 1487260828? 1 What is the hundred millions digit of 531139840? 5 What is the ten millions digit of 69576371? 6 What is the units digit of 6572091160? 0 What is the ten millions digit of 159910352? 5 What is the ten millions digit of 1996928224? 9 What is the tens digit of 443065256? 5 What is the hundred millions digit of 1056701774? 0 What is the millions digit of 82608926? 2 What is the thousands digit of 774665285? 5 What is the hundred thousands digit of 196350949? 3 What is the hundred thousands digit of 77762185? 7 What is the hundreds digit of 289357120? 1 What is the tens digit of 27027166? 6 What is the ten thousands digit of 4015242011? 4 What is the ten thousands digit of 108417622? 1 What is the hundreds digit of 1082060879? 8 What is the millions digit of 24565333? 4 What is the billions digit of 4028310403? 4 What is the units digit of 12851249? 9 What is the billions digit of 6225742143? 6 What is the ten millions digit of 215983373? 1 What is the units digit of 1505994240? 0 What is the millions digit of 2299075192? 9 What is the ten millions digit of 7664663900? 6 What is the hundred millions digit of 447290717? 4 What is the hundred thousands digit of 37393159? 3 What is the ten thousands digit of 499999743? 9 What is the thousands digit of 5381001? 1 What is the hundreds digit of 349360435? 4 What is the units digit of 647422407? 7 What is the tens digit of 16440552? 5 What is the thousands digit of 12721754? 1 What is the ten millions digit of 518192697? 1 What is the hundreds digit of 563704049? 0 What is the units digit of 116842418? 8 What is the tens digit of 212241382? 8 What is the ten thousands digit of 537002340? 0 What is the hundreds digit of 424684710? 7 What is the billions digit of 1694783802? 1 What is the units digit of 220092? 2 What is the thousands digit of 60243201? 3 What is the ten millions digit of 30175600? 3 What is the ten thousands digit of 468551223? 5 What is the thousands digit of 1162025474? 5 What is the millions digit of 59921849? 9 What is the millions digit of 199518807? 9 What is the hundred thousands digit of 2987439092? 4 What is the units digit of 159130207? 7 What is the hundred thousands digit of 224995476? 9 What is the ten thousands digit of 582229729? 2 What is the thousands digit of 1499089817? 9 What is the units digit of 943311? 1 What is the hundred thousands digit of 38193581? 1 What is the ten thousands digit of 259785911? 8 What is the tens digit of 1274433516? 1 What is the tens digit of 118311422? 2 What is the ten millions digit of 265400121? 6 What is the thousands digit of 29866055? 6 What is the millions digit of 205697211? 5 What is the billions digit of 3509628711? 3 What is the millions digit of 1523457752? 3 What is the hundred thousands digit of 29976702? 9 What is the millions digit of 669143639? 9 What is the hundred millions digit of 250026216? 2 What is the thousands digit of 59317273? 7 What is the hundred thousands digit of 851218306? 2 What is the hundred thousands digit of 4146307467? 3 What is the hundred millions digit of 1046620649? 0 What is the hundred thousands digit of 68200442? 2 What is the hundreds digit of 522962669? 6 What is the hundred thousands digit of 631293584? 2 What is the ten millions digit of 33585852? 3 What is the thousands digit of 27365435? 5 What is the ten millions digit of 664573036? 6 What is the units digit of 7894220073? 3 What is the hundred thousands digit of 1160639704? 6 What is the thousands digit of 790964450? 4 What is the units digit of 1473548206? 6 What is the hundred thousands digit of 1284818884? 8 What is the ten millions digit of 2325339410? 2 What is the ten thousands digit of 12037680? 3 What is the hundred thousands digit of 457545147? 5 What is the units digit of 331985593? 3 What is the tens digit of 199409833? 3 What is the hundred millions digit of 714166401? 7 What is the millions digit of 600216260? 0 What is the millions digit of 1761785250? 1 What is the hundred millions digit of 4626429509? 6 What is the hundred millions digit of 7557084291? 5 What is the hundreds digit of 32458993? 9 What is the hundred thousands digit of 43241757? 2 What is the billions digit of 3279971150? 3 What is the tens digit of 526534197? 9 What is the units digit of 66729193? 3 What is the billions digit of 1505147770? 1 What is the thousands digit of 2974403184? 3 What is the thousands digit of 7351548779? 8 What is the hundred millions digit of 156312214? 1 What is the hundred thousands digit of 291764386? 7 What is the hundreds digit of 57006920? 9 What is the ten millions digit of 37871570? 3 What is the billions digit of 2041443282? 2 What is the units digit of 2270627169? 9 What is the tens digit of 44799271? 7 What is the hundred millions digit of 537629748? 5 What is the ten thousands digit of 113151256? 5 What is the hundreds digit of 275986679? 6 What is the units digit of 15112169? 9 What is the millions digit of 36737666? 6 What is the units digit of 77263035? 5 What is the hundred thousands digit of 12980431? 9 What is the thousands digit of 387917658? 7 What is the ten millions digit of 409529388? 0 What is the tens digit of 66863514? 1 What is the hundreds digit of 932219841? 8 What is the hundred thousands digit of 720417507? 4 What is the tens digit of 671686868? 6 What is the millions digit of 127009687? 7 What is the tens digit of 724010967? 6 What is the thousands digit of 69690225? 0 What is the tens digit of 66919193? 9 What is the thousands digit of 293795944? 5 What is the millions digit of 56559369? 6 What is the hundred thousands digit of 77190669? 1 What is the tens digit of 149951441? 4 What is the ten thousands digit of 47558558? 5 What is the tens digit of 55401390? 9 What is the hundreds digit of 1026822406? 4 What is the tens digit of 155574683? 8 What is the ten millions digit of 1113955262? 1 What is the ten millions digit of 192013470? 9 What is the tens digit of 75761994? 9 What is the ten millions digit of 68886029? 6 What is the hundreds digit of 35467265? 2 What is the ten thousands digit of 343342? 4 What is the ten thousands digit of 2052342740? 4 What is the billions digit of 2460373109? 2 What is the units digit of 1735399463? 3 What is the tens digit of 331338732? 3 What is the ten millions digit of 863270016? 6 What is the ten thousands digit of 21971965? 7 What is the hundred millions digit of 1369788173? 3 What is the millions digit of 84039048? 4 What is the tens digit of 1540	{ "pile_set_name": "DM Mathematics" }
ppose -2w - w = -m. What is the remainder when 37 is divided by w? 7 Let a be -4 + (2 - (-4 + -1)). Suppose -2f = af - 120. Calculate the remainder when 69 is divided by f. 21 Let b(f) = -f3 + 11f*2 - 6f - 5. Calculate the remainder when b(10) is divided by 9. 8 Let y(l) = -l*2 - 22l - 34. What is the remainder when y(-13) is divided by 11? 6 Suppose -4k = -2u - 72, 4k - 21u + 18u - 74 = 0. What is the remainder when 27 is divided by k? 10 Suppose -3w - 12 = 0, 0w - 4w + 59 = 5f. Suppose -10 = -2b, 3b = -q + 16 + 15. Suppose 14n - qn = -116. Calculate the remainder when n is divided by f. 13 Suppose -10p + 9p + 237 = 0. Calculate the remainder when p is divided by 22. 17 Suppose 4v - 66 = -2v. What is the remainder when 70 is divided by -2 + (v - (-1 - 2))? 10 Suppose 10u = 6u + 20. Suppose 4w + n - 371 + 40 = 0, 2n = 3w - 262. Suppose ul + 4 = w. What is the remainder when l is divided by 6? 4 Let l = 28 + 71. Suppose 3y + 12 = l. What is the remainder when 143 is divided by y? 27 Let x be 2/(1/(12/6)). Let n(y) = -y*2 + 7y - 4. What is the remainder when 70 is divided by n(x)? 6 Let u(k) = -k*2 + 8k - 2. Let a be u(5). Let o(r) = -r*3 + 12r*2 + 12r + 16. What is the remainder when o(a) is divided by 1? 0 Suppose -10i + 7i + 12 = 0. Suppose i = -3n - 98. Let w = -19 - n. What is the remainder when 58 is divided by w? 13 Suppose 4z - 2z = 70. Suppose -3k + 417 = -3p, -4k - 4p + 486 + 62 = 0. What is the remainder when k is divided by z? 33 Suppose 0 = -7i - 9i + 224. Calculate the remainder when i is divided by 4. 2 Suppose -33g + 848 = -373. Calculate the remainder when 92 is divided by g. 18 Let v(m) = -m*3 + 3m*2 + 7m + 9. Let j(o) = -o*3 + 4o*2 + 8o + 10. Let w(z) = -5j(z) + 6v(z). Calculate the remainder when 26 is divided by w(-3). 5 Let f(j) = j*2 - 2j + 6. Let d(w) = w*3 + 6w*2 + 7w + 4. Let l be d(-5). Calculate the remainder when f(5) is divided by l/(-5)40/6. 5 What is the remainder when 187 is divided by 6/(-33) + (-20102)/(-209)? 91 Let l = 2322 - 2194. Calculate the remainder when 2814 is divided by l. 126 Suppose 29 = -5x + 124. Let i = x - 10. What is the remainder when i is divided by 7? 2 Calculate the remainder when (-30 + 31)/((-2)/(-94)) is divided by 16. 15 Let y = -3 + 5. Suppose 875r - 408 = 444r + 414r. What is the remainder when r is divided by y? 0 Let j be (0/(-1 + 4))/(-2). Suppose 0 = -3p - 4u + 54, j = -5p - u - 4u + 90. Calculate the remainder when 69 is divided by p. 15 Let p(b) = -b2 + 18b - 17. Let y be p(17). Suppose v - 2 - 61 = y. What is the remainder when v is divided by 33? 30 Let h(m) = -2m2 + 23m. Let u(c) = 6c2 - 68c. Let z(s) = -11h(s) - 4u(s). What is the remainder when 89 is divided by z(8)? 17 Suppose -3y = 2r - 75, 4r + 2y - 4y = 174. Calculate the remainder when 459 is divided by r. 39 Let g(i) = -i2 - 5i + 8. Let x be g(-6). What is the remainder when ((-152)/6)/(4 - (-42)/(-9)) is divided by (x/6)/(1/39)? 12 Let c(v) = -8v + 124. Calculate the remainder when 34 is divided by c(13). 14 Let z = -3 - -13. What is the remainder when 16/(-4) + -2 - (-34)/2 is divided by z? 1 Let q(w) = 7w + 35. Let r be q(-9). Let z = 30 + r. What is the remainder when 9 is divided by z? 1 What is the remainder when 28 is divided by 21((-1)/(-12))/(1/4)? 0 What is the remainder when 24 is divided by (900/(-250))/(7/(-5) - -1)? 6 Let n(x) = -x2 + 14x + 142. Calculate the remainder when n(19) is divided by 9. 2 Let t(y) = 3y2 + 16y - 2. Let g be t(-9). Suppose -4a - 5h = -g + 256, -160 = 4a + 4h. Let j = a - -63. What is the remainder when j is divided by 12? 10 Let s(u) = 4u + 6. Let b be s(-1). What is the remainder when ((-1)/b)/((-6)/792) is divided by 34? 32 Suppose -12i = -17i. Suppose in - 2f - 14 = -2n, 0 = -3f + 6. Calculate the remainder when (-1)/((-3)/39) + 2 is divided by n. 6 Let w(k) = -6k - 6. Suppose 21 + 19 = -5o. Let x be w(o). Let i = -28 + x. Calculate the remainder when 54 is divided by i. 12 Suppose 84 = 10l - 16. Calculate the remainder when 39 is divided by l. 9 Let s = 89 + -61. Suppose 26t = st - 26. Calculate the remainder when t is divided by 3. 1 Suppose -105r + 100r + 3224 = 2s, -3s = 3r - 4845. Calculate the remainder when s is divided by 10. 7 Suppose -2 = 4z - 3z. Let n(v) = -v + 1. Suppose 35 + 136 = 19d. Calculate the remainder when d is divided by n(z). 0 Let g be (((-4)/(-3))/(-2))/((-2)/15). Suppose -gt - 3c = -126, -2t - 2t + 100 = 2c. What is the remainder when 68 is divided by t? 20 Suppose -u + 13 = 4h - 18, u + 41 = 5h. Let w = 0 + h. Let y = 16 - w. What is the remainder when 15 is divided by y? 7 Let b = -77 + 6. Let l = b - -100. What is the remainder when l is divided by 8 + (-15)/((-60)/32)? 13 Let o(s) = -3s - 8. Let z be 7/24/7. Suppose 7 + z = 3i. Calculate the remainder when o(-6) is divided by i. 1 Suppose -130i - 22 = -131i. What is the remainder when 80 is divided by i? 14 Let l be (9/9)/(2/(-70)). What is the remainder when 40 is divided by (96/80)/((-2)/l)? 19 Let r = 89 - 45. Calculate the remainder when 250 is divided by r. 30 Let p(z) = 3z2 + 18z + 67. What is the remainder when 465 is divided by p(-5)? 49 Suppose 2u + 6q = 3q + 171, 3q = -9. Let z(i) = -i*2 + 16i - 9. Calculate the remainder when u is divided by z(11). 44 Suppose 0c + 4c + 4n + 124 = 0, c - n + 39 = 0. What is the remainder when 0 + 10/c + (-1152)/(-14) is divided by 21? 19 Let m = -5 - -15. Suppose 2a + 28 + 30 = 2z, 44 = 2z + 5a. What is the remainder when z is divided by m? 7 Let b(s) = s3 + 3s2 + 25. What is the remainder when 2600 is divided by b(-4)? 8 Let k(a) = a3 + 3a2 - a + 1. Let s be k(-3). Suppose 3y + 3p + 1 = 28, sp = 20. What is the remainder when (4 + 105/(-10))-2 is divided by y? 1 Suppose -698 = 54j - 4532. What is the remainder when j is divided by 4? 3 Calculate the remainder when (-5)/(40/(-6966)) + (-22)/(-88) is divided by 109. 108 Let o(w) = -29w3 - w2 - w - 1. Let q be o(-1). Suppose -2u + q = 3l, 4l + 4u - 7u = 60. Calculate the remainder when l is divided by 5. 2 Let u be (7 - 2) + (1 - 2). Suppose -2f + 99 = v, uv + 3f = 4f + 432. Calculate the remainder when v is divided by 6. 5 Suppose 11m = -0m + 33. Suppose mh = 7h - 60. Let z(i) = 6i - 2. Calculate the remainder when z(5) is divided by h. 13 Let l(s) = -507s*3 - 4s*2 + 2. What is the remainder when l(-1) is divided by 34? 29 Let u = 454 - 442. Calculate the remainder when 443 is divided by u. 11 What is the remainder when (-1 - (3 - 12))16 is divided by 19? 14 Let w = 975 + -942. Calculate the remainder when w is divided by 8. 1 Let t(f) = 2f2 + 4f - 9. Let c(m) = m*3 + 3m*2 - 2m - 2. Let z be c(-4). What is the remainder when t(z) is divided by 31? 27 Let g(k) = -11k - 44. What is the remainder when g(-11) is divided by 20? 17 Suppose -33m + 13109 + 7285 = 0. Calculate the remainder when m is divided by 10. 8 Suppose w - 5a = 4 - 1, 0 = 2w - 2a - 14. Let y = 11 - w. Suppose 2r + 54 = c + 2c, 3r - 39 = -yc. Calculate the remainder when c is divided by 6. 4 Let u be -8 + (-3 - (-5 + 4)). Let v(i) = -i3 - 10i*2 - 3i - 13. Calculate the remainder when v(u) is divided by 11. 6 Suppose -z + x = -7, 0 = 4z + x - 6x - 29. Suppose -5f + 20 = d, 2f - zf = -5d + 129. What is the remainder when 73 is divided by d? 23 Let b = 57 - 14. Suppose -b = -3a + 4g, -20 = -5a + 5g + 45. What is the remainder when 32 is divided by a? 5 Let q = -378 - -389. Let m = 156 - 105. Calculate the remainder when m is divided by q. 7 What is the remainder when ((-1863)/(-828))/(2 - 135/68) is divided by 111? 42 Suppose 27c = 1066 - 364. Suppose 5l = -0b + 3b + 48, 5l - 5b = 50. What is the remainder when c is divided by l? 8 Calculate the remainder when (-12 - -14)(21/2 - -2) is divided by 4. 1 Let c(a) = -89a*3 - 2a*2 - a. Suppose -3y = -4 + 7. Calculate the remainder when c(y) is divided by 23. 19 Let j(v) = v*2 + 14v + 42. Suppose -4m = -8 + 60. Suppose u - 14 = -6. What is the remainder when j(m) is divided by u? 5 Calculate the remainder when ((-178)/(-6))/((-4)/(-48)4) is divided	{ "pile_set_name": "DM Mathematics" }
remainder when 101577993 is divided by 40? 33 What is the remainder when 178636 is divided by 307? 269 Calculate the remainder when 101359 is divided by 72. 55 What is the remainder when 5642915 is divided by 769? 762 What is the remainder when 641769 is divided by 213913? 30 What is the remainder when 3147719 is divided by 1049140? 299 What is the remainder when 207366547 is divided by 10188? 10183 What is the remainder when 27709934 is divided by 957? 956 Calculate the remainder when 29952880 is divided by 432. 160 What is the remainder when 182058 is divided by 60638? 144 Calculate the remainder when 250927 is divided by 83392. 751 What is the remainder when 41605705 is divided by 39? 37 What is the remainder when 62690 is divided by 28969? 4752 Calculate the remainder when 15986203 is divided by 828. 7 Calculate the remainder when 55374 is divided by 17875. 1749 What is the remainder when 354700 is divided by 1443? 1165 What is the remainder when 21350983 is divided by 4463? 4454 Calculate the remainder when 552278 is divided by 106. 18 Calculate the remainder when 3646728 is divided by 25. 3 What is the remainder when 967461 is divided by 360? 141 Calculate the remainder when 286033 is divided by 1572. 1501 Calculate the remainder when 29381256 is divided by 4197322. 2 Calculate the remainder when 151614 is divided by 75742. 130 Calculate the remainder when 11056743 is divided by 1726. 1713 What is the remainder when 142726 is divided by 1807? 1780 Calculate the remainder when 5099 is divided by 536. 275 Calculate the remainder when 24891433 is divided by 1914722. 47 What is the remainder when 1496276 is divided by 62344? 20 Calculate the remainder when 156749 is divided by 77770. 1209 What is the remainder when 39951 is divided by 3424? 2287 Calculate the remainder when 4690910 is divided by 104242. 20 What is the remainder when 40690 is divided by 32559? 8131 What is the remainder when 37419 is divided by 1798? 1459 Calculate the remainder when 499946 is divided by 70. 6 What is the remainder when 462834 is divided by 582? 144 What is the remainder when 247371 is divided by 1649? 21 What is the remainder when 638290435 is divided by 2942? 2941 Calculate the remainder when 582238 is divided by 4345. 8 Calculate the remainder when 1181 is divided by 55. 26 Calculate the remainder when 14771003 is divided by 532. 23 What is the remainder when 86613 is divided by 2544? 117 Calculate the remainder when 886387 is divided by 110612. 1491 What is the remainder when 100835285 is divided by 560196? 5 Calculate the remainder when 507008 is divided by 25259. 1828 What is the remainder when 4221857 is divided by 1407168? 353 Calculate the remainder when 115870 is divided by 28911. 226 Calculate the remainder when 16148201 is divided by 30. 11 What is the remainder when 1049033 is divided by 3485? 48 What is the remainder when 506346 is divided by 253103? 140 What is the remainder when 241470 is divided by 268? 2 What is the remainder when 2925275 is divided by 60? 35 What is the remainder when 320430618 is divided by 3011? 3009 What is the remainder when 54301041 is divided by 27150464? 113 What is the remainder when 9768835 is divided by 49? 48 Calculate the remainder when 1052832 is divided by 149. 147 What is the remainder when 19531 is divided by 906? 505 Calculate the remainder when 98629630 is divided by 4. 2 Calculate the remainder when 1871034 is divided by 187101. 24 Calculate the remainder when 243371697 is divided by 2379. 2376 Calculate the remainder when 2340846 is divided by 130043. 72 What is the remainder when 952514 is divided by 750? 14 What is the remainder when 101228 is divided by 739? 724 What is the remainder when 716999 is divided by 418? 129 Calculate the remainder when 1591566 is divided by 543. 33 Calculate the remainder when 251198 is divided by 251178. 20 What is the remainder when 195250 is divided by 6969? 118 Calculate the remainder when 4043206 is divided by 33139. 248 What is the remainder when 18022000 is divided by 8509? 8447 What is the remainder when 17191927 is divided by 1082? 29 Calculate the remainder when 122193 is divided by 1474. 1325 What is the remainder when 12684 is divided by 1404? 48 What is the remainder when 436899 is divided by 72803? 81 Calculate the remainder when 61277833 is divided by 2955. 2953 What is the remainder when 10829868 is divided by 2055? 18 What is the remainder when 1832366772 is divided by 1101? 1098 Calculate the remainder when 29008 is divided by 4695. 838 Calculate the remainder when 2779204 is divided by 379. 376 Calculate the remainder when 9429 is divided by 1544. 165 What is the remainder when 22358468 is divided by 37? 34 What is the remainder when 1667482 is divided by 160? 122 Calculate the remainder when 72374215 is divided by 148. 143 What is the remainder when 173650 is divided by 173563? 87 What is the remainder when 802195 is divided by 266473? 2776 What is the remainder when 290920 is divided by 1293? 1288 Calculate the remainder when 739201 is divided by 351. 346 Calculate the remainder when 7959602 is divided by 456. 122 Calculate the remainder when 18057571 is divided by 71. 70 Calculate the remainder when 980471 is divided by 392. 79 Calculate the remainder when 21795 is divided by 6758. 1521 Calculate the remainder when 2173457 is divided by 213. 5 What is the remainder when 19852113 is divided by 2128? 1 Calculate the remainder when 24228105 is divided by 50. 5 What is the remainder when 11397 is divided by 3786? 39 Calculate the remainder when 2887797 is divided by 14885. 107 Calculate the remainder when 9566369 is divided by 594. 593 What is the remainder when 424194 is divided by 1478? 8 Calculate the remainder when 26624712 is divided by 13312334. 44 Calculate the remainder when 53389 is divided by 8460. 2629 What is the remainder when 96382079 is divided by 5760? 5759 What is the remainder when 354317908 is divided by 29? 26 What is the remainder when 2469334 is divided by 1234644? 46 Calculate the remainder when 1304338 is divided by 188. 182 What is the remainder when 8867846 is divided by 2216961? 2 Calculate the remainder when 208974 is divided by 151. 141 Calculate the remainder when 16564617 is divided by 8282206. 205 What is the remainder when 106377 is divided by 34278? 3543 Calculate the remainder when 426145 is divided by 30438. 13 What is the remainder when 138005 is divided by 1270? 845 What is the remainder when 3029699 is divided by 73895? 4 What is the remainder when 86093 is divided by 1493? 992 Calculate the remainder when 34063 is divided by 14149. 5765 Calculate the remainder when 18322859 is divided by 15. 14 Calculate the remainder when 10524586 is divided by 8691. 8476 Calculate the remainder when 190788 is divided by 148. 16 What is the remainder when 695293 is divided by 963? 7 Calculate the remainder when 1145622 is divided by 2178. 2172 Calculate the remainder when 2116646 is divided by 140. 126 Calculate the remainder when 1048975 is divided by 209783. 60 Calculate the remainder when 59429 is divided by 3236. 1181 Calculate the remainder when 18721 is divided by 1246. 31 What is the remainder when 376343 is divided by 93281? 3219 Calculate the remainder when 10754077 is divided by 4049. 3982 Calculate the remainder when 420471 is divided by 2564. 2539 Calculate the remainder when 15201489 is divided by 112. 65 Calculate the remainder when 485953 is divided by 2809. 2805 Calculate the remainder when 44476 is divided by 10944. 700 What is the remainder when 3102413 is divided by 468? 41 Calculate the remainder when 169594 is divided by 56411. 361 Calculate the remainder when 1704575 is divided by 284065. 185 Calculate the remainder when 2989385 is divided by 10905. 1415 Calculate the remainder when 2958298 is divided by 493049. 4 Calculate the remainder when 92008 is divided by 2729. 1951 Calculate the remainder when 7466835 is divided by 519. 501 Calculate the remainder when 1514310 is divided by 757135. 40 Calculate the remainder when 2085930 is divided by 6601. 14 What is the remainder when 3820632 is divided by 13220? 52 Calculate the remainder when 12908070 is divided by 1079. 1072 What is the remainder when 11119689	{ "pile_set_name": "DM Mathematics" }
Which is the fifth smallest value? (a) -1/2 (b) -2/1853 (c) -0.6 (d) 29 (e) 0.3 d Which is the seventh biggest value? (a) 16/5 (b) -3/14 (c) -8 (d) -1 (e) 0.29 (f) 1 (g) 11 c Which is the third biggest value? (a) 0.1 (b) 0.4 (c) -317/2 (d) 1 (e) -4 a Which is the third biggest value? (a) 0.13 (b) 4 (c) -2/3 (d) -25 (e) -3 (f) 4.9 a What is the second smallest value in -5, -0.3, -0.1334, -0.1, 62300? -0.3 Which is the smallest value? (a) 0.3 (b) -1/3 (c) 0.1 (d) -0.2 (e) 1/3 (f) 2/9 (g) 7/6 b Which is the smallest value? (a) -5 (b) -8995938 (c) 1/2 b Which is the second smallest value? (a) 40.923 (b) -2 (c) -0.073 c Which is the biggest value? (a) 0.2 (b) 1.5 (c) -4 (d) -10868 (e) -0.4 b What is the sixth smallest value in 5, 18, 14, -136.3, -0.02, -5? 18 What is the third biggest value in 2, 0, -0.5, 703/113, 5? 2 Which is the fourth biggest value? (a) 31 (b) -5 (c) 0.8 (d) -317 (e) 4/17 b What is the third smallest value in 0, 0.1, -493.71554? 0.1 What is the biggest value in 5672632, -9, 0.2? 5672632 What is the smallest value in 1/24, -1/23, 1.1, -57, -4? -57 What is the second smallest value in -29, -2.59, -2/95, 0.4? -2.59 Which is the smallest value? (a) -5 (b) -3/7 (c) -6 (d) 26082 (e) -2 c Which is the fourth smallest value? (a) -49/3 (b) 4 (c) 2 (d) -25 (e) -105 c Which is the second smallest value? (a) -5 (b) 37.1 (c) -0.01 (d) -1/3 d What is the biggest value in 13, -5, 0, -43.0937? 13 Which is the third biggest value? (a) -1.02093 (b) 3 (c) -4 (d) 1/7 (e) -36 (f) -5 (g) 5 d Which is the fourth smallest value? (a) -69 (b) -5 (c) 1/5 (d) -39/17 (e) -4 d What is the biggest value in -1/5, -2/7, -4, 5/4, -13/7, 0.058, 0.1? 5/4 Which is the second smallest value? (a) 7/9 (b) 11 (c) 70623 b Which is the biggest value? (a) 0.4 (b) -2142 (c) -5 (d) 3 (e) -3 (f) 0.07 (g) 2/11 d What is the second smallest value in -0.03, -0.5, -0.06, 7/37? -0.06 Which is the second smallest value? (a) 15626/3 (b) -4/7 (c) 0.5 (d) 33 (e) -1 b Which is the smallest value? (a) 5 (b) 3/5 (c) -100/3 (d) 27 c What is the fourth smallest value in -1/6, 3, -10, -3/13, 95/3? 3 Which is the second smallest value? (a) 49426 (b) 66 (c) 13 (d) 2/11 c Which is the second biggest value? (a) -17 (b) 0.2 (c) -4 (d) 0.12 (e) 8 (f) -0.5 (g) 3 g Which is the second biggest value? (a) -1564438.2 (b) 1 (c) -5 (d) 1/2 d Which is the fifth smallest value? (a) 3 (b) -0.099 (c) -0.007 (d) 0.2 (e) 0.3 (f) 13 (g) -2/13 e Which is the biggest value? (a) -10.6 (b) -151769 (c) -5 c Which is the fifth biggest value? (a) 109 (b) -3 (c) 0.3 (d) -1/3 (e) 1 (f) -19691 b Which is the smallest value? (a) 1 (b) -0.2 (c) -2/7 (d) 10 (e) 14/27 (f) -2/5 (g) -2/13 f What is the third smallest value in -3/74, -2, -18, 1/4, -0.2, 33/10? -0.2 Which is the third smallest value? (a) -2/5247 (b) -2 (c) 2.42 c What is the biggest value in 4325, -20/21, -0.1? 4325 What is the seventh biggest value in -2/5, 0.5, 12/17, -2/11, -2/79, -1/6, 0.3? -2/5 Which is the biggest value? (a) -583.29 (b) -362 (c) -3 c What is the third smallest value in 0.3, -3, -1, -199/31? -1 Which is the third biggest value? (a) -5929 (b) 28/39 (c) 3/4 (d) 3 b Which is the fifth smallest value? (a) -24 (b) -0.2 (c) -3/4 (d) -3 (e) -0.5 (f) -594 e Which is the third biggest value? (a) 1/18 (b) 109 (c) 2 (d) -4 (e) 5 (f) 0.2 c Which is the third smallest value? (a) -2/7 (b) 2/23 (c) 1/11 (d) -1.85 (e) 3 b What is the biggest value in -0.1, -60, 1.9, -30, 0.4? 1.9 Which is the second smallest value? (a) 7/8 (b) 4 (c) 1/2 (d) -8 (e) 208 (f) 2/27 f What is the smallest value in -5, 3, 18, 1335.465, 4? -5 What is the fourth smallest value in -253, -1156, -2/19, 1? 1 Which is the fourth biggest value? (a) 3/5 (b) -22614 (c) 86 (d) 1 (e) 6/11 e What is the smallest value in 3, 2, -0.0032, 346? -0.0032 What is the third smallest value in 17/56, -2, 0.179, 0? 0.179 What is the smallest value in -14/11, -5, -2.08044? -5 Which is the fourth biggest value? (a) 0.4 (b) -9/7 (c) -7.8 (d) -0.87 (e) 0.5 b What is the fourth smallest value in -92, 2, 10, 0.4, 12, -12? 2 What is the fourth smallest value in 377860, 4, 4/3, 2? 377860 Which is the second smallest value? (a) 2.2 (b) -25 (c) -0.1 (d) 73.9 c What is the fifth smallest value in -1/3, 0.3, -4/5, -19, -6/2597? 0.3 Which is the third biggest value? (a) 0.03 (b) 0 (c) 1.1 (d) 2/7 (e) 133 (f) -0.5 (g) 53/5 c Which is the third biggest value? (a) 1.68 (b) -1/79 (c) -2/65 (d) -1/4 (e) -1 c What is the smallest value in 2/7, -5, -2480/1869, 19? -5 Which is the third smallest value? (a) 0.01 (b) 0.006 (c) -0.6 (d) -0.045 (e) 3 b What is the biggest value in -0.5, -0.25, 29315.2, 2/5? 29315.2 Which is the seventh smallest value? (a) 5 (b) 2/3 (c) 1 (d) -4 (e) 0.5 (f) 54.1 (g) 2/9 f What is the second biggest value in -2/7, -21/10, 61/228? -2/7 What is the smallest value in -124, 5, -3, 0.1, -191? -191 What is the second smallest value in -203, 3512/343, 1? 1 What is the third smallest value in 0.08, -4, -38, 4, 5, 336? 0.08 Which is the smallest value? (a) 4286030 (b) -2 (c) 0 (d) -2/19 b What is the smallest value in 81, -0.2, 25583? -0.2 Which is the fifth smallest value? (a) -0.2 (b) 0.2 (c) -2.3 (d) -1/8 (e) -186 (f) -1 (g) -0.16 g Which is the fifth smallest value? (a) 29 (b) 0.15 (c) -0.2 (d) 0.1 (e) 8.8 a What is the third biggest value in -1/18, -5, -0.1, 0.36481, -3? -0.1 Which is the smallest value? (a) -0.5 (b) 0.6 (c) 547 (d) 5.42 a Which is the smallest value? (a) 16 (b) 10 (c) -1.4 (d) 0.3 (e) 19 c What is the second smallest value in 1, 4, -0.4, 6757, -3/2, 0.2, -0.3? -0.4 What is the second biggest value in -3.826, -46, 8, -0.14? -0.14 Which is the fifth smallest value? (a) -4 (b) 4 (c) 0.043911 (d) 5 (e) -52 d What is the biggest value in 113, 0.04, -2/87, -0.3? 113 Which is the second biggest value? (a) -1.62189 (b) 0.3 (c) 3/98 c What is the fifth biggest value in -6, 258, -1550, -3, 3, -0.05? -6 Which is the fifth biggest value? (a) 594 (b) -8 (c) 6 (d) -2/5 (e) -0.5 (f) 1/8 e Which is the smallest value? (a) 5 (b) 2.77 (c) -80643 (d) 2/9 (e) -0.3 c Which is the third smallest value? (a) 3 (b) -2 (c) 1 (d) 3/7 (e) -260115/2 (f) -4 b What is the third biggest value in 2911, -2, 1.66, -0.4, 2/7, 2/5? 2/5 What is the second biggest value in 1.86, 0, -0.2, -3165, 1? 1 What is the third biggest value in -0.01, 301, 2471/6, 3/5? 3/5 Which is the fourth biggest value? (a) -2 (b) 291 (c) -10/11 (d) 0.5 a Which is the third smallest value? (a) 1/4 (b) -113 (c) 1849/6 c What is the smallest value in 1/2, -1/2, -5.2, 0.11, -5, 1, -11? -11 What is the fourth smallest value in 4, -7716, -2/5, 5/2, 0.21? 5/2 What is the seventh smallest value in -1, -0.5, 47.6, -18, 1/3, 0.11, -1/8? 47.6 What is the smallest value in 0.5, 4, -97986, -0.4? -97986 Which is the fifth smallest value? (a) -3 (b) -1 (c) 24.6 (d) 2/7 (e) 267 e Which is the biggest value? (a) -0.7 (b) -9 (c) -2 (d) -2967 a What is the fourth biggest value in 5, -177/11, -12/5, -0.4, -0.5, 0.5? -0.5 What is the fourth biggest value in 2, -65, -0.4, -2/7, 2/5, 0, -1076? -2/7 What is the biggest value in -2/73, -8/25, -2, 2/5, -0.3? 2/5 What is the third smallest value in 0.5, 1/5, -3, -12, -2/79, -40? -3 What is the third biggest value in 5, 11, -3/2, 0.1, 139, 4, -32? 5 Which is the seventh smallest value? (a) -2/11 (b) 0.2 (c) -4 (d) -0.4 (e) 2 (f) -0.029751 (g) 0.22 e What is the second biggest value in 0.043693, 297/7, -0.4? 0.043693 What is the smallest value in -6333, 1, 2/11, -3, -0.2, 7? -6333 What is the sixth smallest value in -0.7, 4/3, -0.06, 246, -10, 3? 246 Which is the third smallest value? (a) 0.2 (b) 2/29 (c) -81 (d) -8 b Which is the smallest value? (a) -0.3 (b) -12482 (c) -10 (d) -3 (e) -1 b What is the fifth smallest value in -2/7, 766/3, -3, 5, -2/19, -4/5, -4? -2/19 What is the second biggest value in 2/17, 14, 1/269, -2/9? 2/17 What is the third smallest value in 0, 5, 2, -1/3, -89, -281? -1/3 What is the third smallest value in -2, 1,	{ "pile_set_name": "DM Mathematics" }
e third derivative of -o5/420 + o4/84 - o*3/42 - 3o2. Factor t(z). -(z - 1)2/7 Find g, given that 2/3g3 + 0g*2 + 0 + 2/3g*5 + 0g + 4/3g4 = 0. -1, 0 Let l(t) be the third derivative of t10/120960 - t8/26880 - t4/24 + 4t2. Let g(y) be the second derivative of l(y). Factor g(s). s3(s - 1)(s + 1)/4 Let h(b) be the second derivative of b6/60 + b5/15 - b*2/2 + 2b. Let k(m) be the first derivative of h(m). Factor k(j). 2j2(j + 2) Let m(t) = t*2 - 4t - 9. Let w(j) = 4j2 - 11j - 27. Let u be 4/(-2) - (-2 + 7). Let n(r) = um(r) + 2w(r). Factor n(i). (i + 3)*2 Let l(c) = -c + 5. Let d be l(3). Let -dh - 8h3 - 6h*2 + 10h - 2h4 + 1 + 7 = 0. Calculate h. -2, -1, 1 Let q(g) be the second derivative of 0 - 4/5g*2 + 1/30g*4 + 0g*3 - g. Find b, given that q(b) = 0. -2, 2 Let y(h) be the first derivative of 1/24h*6 - 3/16h*4 + 1/4h*2 - 1/20h*5 + 1/12h*3 + 0h - 5. Solve y(w) = 0 for w. -1, 0, 1, 2 What is r in -4r2 - 9r*2 + 20r*2 - 2r*3 - 11r*2 - 2r = 0? -1, 0 Let k be (-46)/(-120) - 24/180. Suppose 1/4a2 + 0a + 0 - ka3 = 0. Calculate a. 0, 1 Suppose 2v - 220 = 7v. Let i(u) = -u2 - 3u + 3. Let n(x) = -8x2 - 22x + 22. Let z(m) = vi(m) + 6n(m). Factor z(a). -4a2 Let m(c) be the third derivative of c6/225 - c5/75 + c4/60 - c3/6 - 6c*2. Let s(z) be the first derivative of m(z). Factor s(u). 2(2u - 1)2/5 Suppose -3m - 4 = -5m. Factor -3a*3 - 4am + a2 - 6a - 2a*2 - 4a*2. -3a(a + 1)(a + 2) Let x(s) be the third derivative of s7/560 + s6/120 - s5/80 - s4/8 + s*3/3 + 6s*2. Let b(w) be the first derivative of x(w). Factor b(m). 3(m - 1)(m + 1)(m + 2)/2 Let x(u) = 25u2 + 28u + 13. Let b(y) = 37y2 + 42y + 19. Let o(s) = -5b(s) + 7x(s). Factor o(j). -2(j + 1)(5j + 2) Find f, given that -3f + 1/2 + 53/8f2 - 55/8f*3 + 27/8f*4 - 5/8f5 = 0. 2/5, 1, 2 Factor -d2 + 8/5d + 1/5d3 - 4/5. (d - 2)2(d - 1)/5 Suppose -4s - 4 = -6s. Factor 24q - 12q3 - sq*3 - 10 + 18 - 14q*2 - 4q*2. -2(q - 1)(q + 2)(7q + 2) Let m(j) be the second derivative of -j5/140 + j4/28 + j3/42 - 3j*2/14 - 6j. Suppose m(q) = 0. Calculate q. -1, 1, 3 Let t(y) be the third derivative of y8/1008 + y7/315 - y*6/180 - 2y*5/45 - 7y4/72 - y3/9 + 4y2. Factor t(w). (w - 2)(w + 1)*4/3 Suppose 0s + s - 4s = 0. Let x(m) be the second derivative of s + 1/40m*6 + 3/40m*5 - 3/8m*2 - 3m - 1/4m3 + 0m*4. Factor x(y). 3(y - 1)(y + 1)3/4 Suppose u - 2u + 2 = 0, 5s = -2u + 284. Suppose 4p - 3z = 24, 5p - 5z + 21 = s. Factor -2w - 3w*2 - 3w*p - 2w4 + w + w4 + 0w4. -w(w + 1)*3 Let u(j) be the first derivative of 1/13j*2 - 7 - 4/13j + 2/39j3. Factor u(o). 2(o - 1)(o + 2)/13 Let m(z) = -39z*3 + 13z*2 + 44z - 3. Let p(i) = 59i3 - 19i*2 - 66i + 5. Let s(g) = -7m(g) - 5p(g). Factor s(q). -2(q - 1)(q + 1)(11q - 2) Let -4/9 + 34/9v2 + 2v + 4/3v3 = 0. What is v? -2, -1, 1/6 Let z(p) be the first derivative of p5/80 + p4/24 - 3p - 1. Let g(f) be the first derivative of z(f). Factor g(q). q*2(q + 2)/4 Let n = 44 - 41. Let i(a) be the second derivative of 1/6a4 - 1/10a*5 + 0 + 0a*2 + 0a*n - 3a. Factor i(s). -2s2(s - 1) Suppose 4b - 2 + 38 = -3l, 3l + 30 = -2b. Let o be (-8)/(-5) - l/20. Solve w + 1 + 2w + w3 + 3w*o + w - w = 0. -1 Let s(m) = m - 5. Let j be s(3). Let p be (j + 1)1 - -1. Factor pk - 2/5 + 2/5k*2. 2(k - 1)(k + 1)/5 Let p(s) = 8s*2 + 11s - 29. Let l(d) = -4d2 - 5d + 15. Let w(x) = 5l(x) + 3p(x). Let w(z) = 0. Calculate z. -3, 1 Let j(s) be the third derivative of -s9/756 + s7/70 - s*6/45 - 7s3/6 - s2. Let f(u) be the first derivative of j(u). Solve f(y) = 0. -2, 0, 1 Suppose k + 0k - 1 = 0. Let u = 1 + k. Factor 6w2 - w3 - 4wu + 2w*3 - 2w*4 - w. -w(w - 1)(w + 1)(2w - 1) Let n(s) be the first derivative of s5/5 - 7s4/12 + s3/3 + s*2/2 + 4s + 4. Let o(b) be the first derivative of n(b). What is f in o(f) = 0? -1/4, 1 Let d(k) be the second derivative of -1/18k6 + 1/6k*5 + 1/126k*7 - 1/6k*2 + 5/18k*3 + k - 5/18k4 + 0. Factor d(r). (r - 1)5/3 Let y = 2/179 + 344/1253. Factor -2/7b2 + 0b + y. -2(b - 1)(b + 1)/7 Solve -10u4 + 2u*5 - 17u*4 - 24u*3 - 6u + 27u2 + 19u*5 + 9u3 = 0. -1, 0, 2/7, 1 Let p(t) be the first derivative of -t4/10 + 4t3/5 - 9t*2/5 + 56. Solve p(l) = 0 for l. 0, 3 Let j be (650/(-120))/13 + 4/6. Suppose -2y = -x - 0y, y = -2x + 5. Solve -1/4o + 1/2o*x - j = 0 for o. -1/2, 1 Let p be ((-7)/84)/((4/(-3))/4). Factor 1/4g*2 - 1/4g*4 + pg - 1/4g3 + 0. -g(g - 1)(g + 1)2/4 Let a(g) be the third derivative of -g5/15 + 4g*4/3 - 8g*3 + 11g*2 - g. Suppose a(l) = 0. What is l? 2, 6 Let t = -4 - -16. Let y(r) = r - 9. Let m be y(t). Find s, given that -4 - m + 3s*2 + 4 = 0. -1, 1 Let q(n) = -n + 1 + 2n2 + n2 - 4n2. Let c be q(0). Suppose -w + 15w*2 + 10w - c + 3 + 3w4 + 11w*3 = 0. What is w? -1, -2/3 What is r in 1/2 + 11/4r - 9/4r4 - 11/4r*3 + 7/4r*2 = 0? -1, -2/9, 1 Let n = -457 - -9599/21. Let t(g) be the first derivative of -ng*3 - 1/7g*2 - 2 + 4/7g. Let t(k) = 0. What is k? -2, 1 Suppose -2j + 3j - 6 = 0. Let s = j + -1. Factor -10h4 + 2h3 + hs + 5h5 + 0h*4 + 2h*2. 2h*2(h - 1)*2(3h + 1) Let a(x) be the first derivative of 5x*4/4 - 20x*3/3 + 10x*2 + 11. Factor a(q). 5q(q - 2)2 Let i(f) be the first derivative of f7/840 + f6/120 + f5/60 + 4f3/3 - 1. Let s(m) be the third derivative of i(m). Find l such that s(l) = 0. -2, -1, 0 Let v(t) be the second derivative of -t7/105 + t*5/50 + 4t. Factor v(o). -2o3(o - 1)(o + 1)/5 Let q(l) = -70l*5 + 125l*3 + 55l*2 + 55l - 55. Let t(h) = -5h5 + 9h*3 + 4h*2 + 4h - 4. Let f(g) = 4q(g) - 55t(g). Find c such that f(c) = 0. -1, 0, 1 Suppose 4 = -0k + 2k. Let v be 22/4 + 1. Factor -2h2 + h3 + 3h + hv - 2hk - 1. (h - 1)3 Let h = 8731/30 - 291. Let r(b) be the second derivative of hb5 + 0b*2 + 3b + 0 + 2/27b4 + 1/27b*3. Factor r(v). 2v(v + 1)(3v + 1)/9 Suppose 16 = 5f - 2r - 2r, 5f = 3r + 17. Let u = f + -2. Suppose ut - 2t*2 - 3t3 - t3 + 2t3 + 2t*4 = 0. What is t? -1, 0, 1 Factor 3/2z*5 + 0z*4 + 0z*2 - 3z*3 + 0 + 3/2z. 3z(z - 1)*2(z + 1)*2/2 Factor 1/2q*5 + 0q*2 + 0 + 0q - 1/4q4 - 1/4q3. q3(q - 1)(2q + 1)/4 Let x(f) = 10f*4 + 19f*3 - 5f*2 + 11f + 11. Let v(r) = r4 + r3 + r*2 + r + 1. Let w(k) = 22v(k) - 2x(k). Factor w(t). 2t*2(t - 4)*2 Suppose -6o*2 + 5o2 - o4 - o + 3o2 - 5o*2 - 3o3 = 0. Calculate o. -1, 0 Let c(n) = n2 + 8n + 8. Let f be c(-8). Factor f + 3g4 - 8 - g4 + g3 + g5. g*3(g + 1)2 Let l(i) be the second derivative of -i7/210 + 2i6/75 - 3i5/100 - i4/15 + 2i3/15 - 22i. Determine u so that l(u) = 0. -1, 0, 1, 2 Solve -4o5 - 22 + 42o*3 + 22 - 26o*3 = 0. -2, 0, 2 Let j(l) be the first derivative of 2l*5/35 - 5l*4/14 + 2l*3/7 + 5l*2/7 - 8l/7 - 6. What is p in j(p) = 0? -1, 1, 4 Solve -2/17r4 - 4/17r + 0r3 + 0 + 6/17r2 = 0 for r. -2, 0, 1 Let p(u) be the second derivative of -u4/54 + u*3/9 - 15u. Factor p(t). -2t(t - 3)/9 Let n(x) be the first derivative of -5x3/3 - 15x*2/2 + 11. Factor n(u). -5u(u + 3) Let i(m) be the third derivative of -7m6/180 + m5/30 - m3/3 + m2. Let a(r) be the first derivative of i(r). Suppose a(b) = 0. What is b? 0, 2/7 Let u be 2 + -2 - (-42)/105. Solve -up3 + 0p*2 - 2/5p*5 + 0p - 4/5p4 + 0 = 0 for p. -1, 0 Suppose j - 3j = 32. Let z be 72/j2/(-3). Solve 4 - 3u + 2u - zu2 + u2 - u = 0 for u. -2, 1 Let u(b) be the first derivative of 2 - 1/120b6 + 0b4 + b2 - 1/60b5 + 0b + 0b3. Let p(v) be the second derivative of u(v). Factor p(m). -m2(m + 1) Factor 0h + 0h*3 + 4/5h*2 - 3/5h*4 + 0 + 1/5h5. h2(h - 2)2(h + 1)/5 Let l(k) be the third derivative of k7/10080 + k6/1440 + k*5/480 - 5k*4/24 - 3k2. Let t(b) be the second derivative of l(b). Factor t(h). (h + 1)2/4 Let c(b) = -b -	{ "pile_set_name": "DM Mathematics" }
ree letters picked without replacement from ddodggdddddgdgdo? 9/28 What is prob of picking 2 y and 1 v when three letters picked without replacement from vlvvlvyvvvvvy? 9/286 Calculate prob of picking 1 e and 2 t when three letters picked without replacement from {y: 1, l: 6, e: 2, t: 2, q: 1}. 1/110 Three letters picked without replacement from {v: 9, g: 2, t: 6}. What is prob of picking 1 g and 2 v? 9/85 Two letters picked without replacement from jjuruutjprppyt. What is prob of picking 1 t and 1 p? 6/91 Two letters picked without replacement from {u: 10, w: 10}. What is prob of picking 1 w and 1 u? 10/19 Calculate prob of picking 1 p and 1 h when two letters picked without replacement from {h: 4, s: 3, p: 6}. 4/13 What is prob of picking 1 j and 1 u when two letters picked without replacement from ujjuuuu? 10/21 Three letters picked without replacement from oodddodduddduauudd. Give prob of picking 1 u and 2 d. 15/68 Four letters picked without replacement from {v: 3, d: 15, b: 2}. What is prob of picking 4 d? 91/323 Calculate prob of picking 4 g when four letters picked without replacement from {p: 9, g: 10}. 35/646 What is prob of picking 1 l and 3 m when four letters picked without replacement from mllllllmllllllmllllm? 64/4845 What is prob of picking 1 r, 1 g, and 2 p when four letters picked without replacement from sfrgysrrsgrpps? 8/1001 What is prob of picking 2 l, 1 w, and 1 i when four letters picked without replacement from xcwlwxxlwwwxiliw? 9/455 Calculate prob of picking 1 c and 1 r when two letters picked without replacement from rbxuucburybb. 1/33 What is prob of picking 2 b when two letters picked without replacement from {v: 11, s: 1, b: 3}? 1/35 What is prob of picking 2 p and 1 m when three letters picked without replacement from {m: 1, p: 6, h: 7}? 15/364 What is prob of picking 1 y and 1 e when two letters picked without replacement from eyeeeeeeeeeye? 11/39 Calculate prob of picking 4 c when four letters picked without replacement from {c: 4}. 1 Three letters picked without replacement from xauchmcmchuhu. What is prob of picking 3 h? 1/286 What is prob of picking 2 t and 1 e when three letters picked without replacement from myttttetymmyymt? 3/91 Four letters picked without replacement from vvwzltzj. Give prob of picking 1 t and 3 w. 0 What is prob of picking 1 c, 1 i, and 2 r when four letters picked without replacement from {r: 4, c: 5, t: 3, s: 1, i: 1}? 30/1001 Calculate prob of picking 2 j when two letters picked without replacement from {p: 2, q: 2, t: 4, j: 2}. 1/45 Calculate prob of picking 1 d and 1 c when two letters picked without replacement from {q: 1, o: 1, d: 1, g: 2, j: 1, c: 1}. 1/21 What is prob of picking 1 j, 1 q, and 1 d when three letters picked without replacement from {d: 1, y: 3, i: 2, v: 3, j: 2, q: 4}? 8/455 Calculate prob of picking 1 c, 2 z, and 1 b when four letters picked without replacement from {p: 4, c: 1, b: 2, z: 2}. 1/63 What is prob of picking 1 t and 1 l when two letters picked without replacement from ttnttttltllttlttllt? 8/19 Calculate prob of picking 1 z and 1 d when two letters picked without replacement from zzkzzzzzkzkzdzz. 11/105 What is prob of picking 1 e and 1 m when two letters picked without replacement from {m: 12, e: 6}? 8/17 Four letters picked without replacement from ustuutuuuututu. Give prob of picking 1 t, 1 s, and 2 u. 144/1001 Two letters picked without replacement from ywyywwww. Give prob of picking 2 w. 5/14 Three letters picked without replacement from okxqokqeeqeqoqoeekyq. What is prob of picking 1 k, 1 y, and 1 e? 1/76 What is prob of picking 3 c when three letters picked without replacement from jjccjjcjjcjc? 1/22 What is prob of picking 2 e and 1 m when three letters picked without replacement from {s: 5, v: 1, m: 1, e: 4, z: 5}? 3/280 What is prob of picking 1 n, 1 j, 1 v, and 1 i when four letters picked without replacement from jnvnniviijinjijivii? 32/323 What is prob of picking 1 k and 1 m when two letters picked without replacement from mvqmqvvqgkvk? 2/33 Three letters picked without replacement from kkkqukkiuqqugqguiilu. Give prob of picking 1 l and 2 u. 1/114 What is prob of picking 3 r and 1 m when four letters picked without replacement from jjkggrmjrlkgggr? 1/1365 What is prob of picking 3 o when three letters picked without replacement from {o: 3, g: 1, w: 1}? 1/10 What is prob of picking 1 e, 1 c, and 1 v when three letters picked without replacement from {c: 4, y: 6, u: 1, e: 1, r: 1, v: 2}? 8/455 Four letters picked without replacement from {c: 4, e: 3}. What is prob of picking 2 c and 2 e? 18/35 What is prob of picking 2 z when two letters picked without replacement from zzznznznnn? 2/9 What is prob of picking 2 h and 2 x when four letters picked without replacement from xxhhxhhh? 3/7 Three letters picked without replacement from {g: 1, t: 1, p: 1, o: 2, d: 1, n: 1}. What is prob of picking 1 o, 1 g, and 1 d? 2/35 Four letters picked without replacement from {p: 7, b: 1, r: 7, d: 1}. What is prob of picking 2 p and 2 r? 63/260 What is prob of picking 2 e when two letters picked without replacement from vvvvveuuvve? 1/55 Calculate prob of picking 4 a when four letters picked without replacement from aakaaaaaakakaaaakaaa. 364/969 Two letters picked without replacement from hoopwoop. What is prob of picking 1 w and 1 h? 1/28 What is prob of picking 3 a and 1 v when four letters picked without replacement from avvvaavaavaavaaaaaa? 143/323 Calculate prob of picking 2 w when two letters picked without replacement from {w: 5, h: 2, r: 5, k: 3}. 2/21 Calculate prob of picking 3 k when three letters picked without replacement from {x: 2, k: 6}. 5/14 Four letters picked without replacement from vvvsvts. What is prob of picking 4 v? 1/35 What is prob of picking 3 f and 1 m when four letters picked without replacement from fxfmmfxffxx? 2/33 Four letters picked without replacement from {k: 1, x: 2, b: 4}. Give prob of picking 1 b, 2 x, and 1 k. 4/35 What is prob of picking 1 n and 1 q when two letters picked without replacement from qxnvvvxtoxxxx? 1/78 What is prob of picking 1 d and 1 n when two letters picked without replacement from mdnwduwn? 1/7 Four letters picked without replacement from {v: 2, h: 3}. What is prob of picking 3 h and 1 v? 2/5 Two letters picked without replacement from pjjcdccdjcwcdfdc. Give prob of picking 1 c and 1 w. 1/20 Calculate prob of picking 1 h and 1 s when two letters picked without replacement from shhhsjhjhhh. 14/55 What is prob of picking 2 q and 1 y when three letters picked without replacement from hhqqbbbbhhbbybhyq? 3/340 Two letters picked without replacement from hddfdddisihihdsi. Give prob of picking 1 h and 1 s. 1/20 Calculate prob of picking 2 w and 2 e when four letters picked without replacement from werwreegwggewwwkwee. 105/1292 What is prob of picking 1 z and 2 k when three letters picked without replacement from {z: 1, q: 10, k: 7}? 7/272 Three letters picked without replacement from cwzsozzcszcn. What is prob of picking 1 z, 1 w, and 1 o? 1/55 What is prob of picking 1 a and 2 u when three letters picked without replacement from {v: 4, r: 1, n: 3, a: 2, u: 2, e: 3}? 2/455 Three letters picked without replacement from kxxxkxkkxxkx. Give prob of picking 3 x. 7/44 What is prob of picking 1 a and 1 v when two letters picked without replacement from {s: 5, k: 4, v: 3, a: 1}? 1/26 Calculate prob of picking 2 v when two letters picked without replacement from {w: 8, v: 2, y: 2, e: 1}. 1/78 Four letters picked without replacement from {y: 1, e: 2, t: 2, v: 4}. What is prob of picking 2 e, 1 y, and 1 t? 1/63 Calculate prob of picking 2 q when two letters picked without replacement from gpnqqqngggqngnqqgq. 7/51 Three letters picked without replacement from {k: 1, o: 1, v: 2, y: 4}. What is prob of picking 1 v, 1 o, and 1 k? 1/28 Calculate prob of picking 1 g, 1 r, and 1 j when three letters picked without replacement from {r: 1, j: 1, a: 3, k: 3, g: 2, u: 1}. 2/165 Calculate prob of picking 1 s, 1 q, and 1 a when three letters picked without replacement from ssqayyyxxxzx. 1/110 Three letters picked without replacement from twttttw. What is prob of picking 1 w and 2 t? 4/7 Two letters picked without replacemen	{ "pile_set_name": "DM Mathematics" }
y(y/(yy*(-9))y)(6/23) assuming y is positive. y(4533/230) Simplify (w(-2))27(w(11/3)ww)/ww(-5) assuming w is positive. w(-163/3) Simplify (t*21((tt28)/tt)/t)/(t*(-1/5)t(-4/29)) assuming t is positive. t(7154/145) Simplify ((w(ww/(ww(-8/5)ww))/w)/w(2/63))/(w(-12)/w)14 assuming w is positive. w(57509/315) Simplify (((s/(s(-1/3)/ss)s)(1/27))29)44 assuming s is positive. s(8932/81) Simplify (((u0/u)/uuuu*6u)/(((u/(u/((u/(((((u*(1/2)u)/u)/u)/u)/u))/u)))/u)/u(u(-3/4)uu)/u))46 assuming u is positive. u(575/2) Simplify ((xx/(x(x/(x/x(-4/9)))/x)x/(x*(2/3)x)x)/((xx/x*1)/(xxxx*(1/4)x)))(-2/35) assuming x is positive. x(-31/90) Simplify ((x(x/x(-1))/xx)*(1/46)xx(3/5)x(-3)/x)38 assuming x is positive. x(-10203/115) Simplify ((s(2/25)/((ss(1/6)s)/s))/(ss/(ss*(-1/5))s(-7)))(-2/23) assuming s is positive. s(-707/1725) Simplify ((d/((d(-2/31)/d)/d)ddd/d11)(-14/5))7 assuming d is positive. d(14994/155) Simplify (z(-8)zz26/z)/(z(z/z*(1/22))/zz(z/(z/(z/z(-1/6))))/z) assuming z is positive. z(524/33) Simplify (l(-1/34)/lll(19/5))44 assuming l is positive. l(14102/85) Simplify ((n18n)/n(15/7))/(n/(n/n12)(n(-9)n)/n) assuming n is positive. n(97/7) Simplify m19mmm/m(-5)(m*(-6)mmmm)/((m(-22)m)/mm) assuming m is positive. m46 Simplify (ss*(-17)ss(4/7))/(s(-2/11))(-12/11) assuming s is positive. s(-12389/847) Simplify (o(-22)oo)/(o/o(-32))o(-23)/o(3/2) assuming o is positive. o(-155/2) Simplify (m2/(m*3/m))/(mm/(m(m/(m/(m(-1)m)m))/m))(1/17) assuming m is positive. m(-3/17) Simplify (b/(b/b8)b)/((b/(((b/b*17)/b)/b)b)/b)bb/b*(-31)b/(b(b18b)/bbb) assuming b is positive. b*3 Simplify (xxx10x*14x)/(x*(1/8)/(xx/(xx(-10))x)) assuming x is positive. x(311/8) Simplify (i(-3))*(45/4)i/(i/((ii/(i10ii))/i))ii(i(-1/2)/i)/i assuming i is positive. i(-181/4) Simplify ((w*9ww(-1/5))19)(-1/22) assuming w is positive. w(-931/110) Simplify ((i(-1/6)i(1/3))(-44))(3/10) assuming i is positive. i(-11/5) Simplify ((hh(hhh*(1/11)h)/h)/((h/((hh/h(7/4)h)/h))/h))/(h/h(-1/3))(-30/13) assuming h is positive. h(4243/572) Simplify ((w/(w(-1/3)/w)ww/((ww(-3/2))/w)w)(-39))(-1/4) assuming w is positive. w(533/8) Simplify ((m1)(-32)/(m1/m(-9)))(-1/7) assuming m is positive. m6 Simplify (s(-5/4)/s(-2))/(s(14/5)ss(s/s15)/s) assuming s is positive. s(219/20) Simplify ((bb/(b*(2/59)b))/b)/b*(16/3)(bb(b/(b/(bb/b(-16)))b)/bb)/(b/b(-7/3)) assuming b is positive. b(2177/177) Simplify (o(-10)o)/o*(8/5)(o5/o)(-4) assuming o is positive. o(-133/5) Simplify (c4)*36(c(-1))(2/49) assuming c is positive. c*(7054/49) Simplify (jj*2j)*(2/21)/(jj(-1/4))(2/47) assuming j is positive. j(689/1974) Simplify (((n/n21)/n)/(n/(n*(-8)/n)nn))7 assuming n is positive. n(-231) Simplify (w40/(w34/w))/(w/(w/w(-11)w)w(9/4)) assuming w is positive. w(67/4) Simplify (((a(1/10)/a)/((a/a(3/2))/a))/(a(a*(-1)a)/a)(4/3))(-24) assuming a is positive. a(-72/5) Simplify ((x(-3)x)/(x/x(-6)x)((x(2/7)x)/x)28)(-1/18) assuming x is positive. x*(1/9) Simplify w/(ww*(1/10))w*(3/11)w(5/2)/((w/w(2/31))/w) assuming w is positive. w(4667/1705) Simplify (m18(m/(m(4/25)/m))/m)/((((m((mmm*(-6/13)m)/m)/mm)/m)/m)/(m(-3)/m)) assuming m is positive. m(4648/325) Simplify ((a(-1/7)a*2/a)/(((a/(a/(aa*0a)))/a)/a)(-4))16 assuming a is positive. a(96/7) Simplify ((s/s(-6))/ssss)/(s/s(2/31))(s(4/7))(-4/3) assuming s is positive. s*(4754/651) Simplify (o/(oo*(-1/43))(o*(13/4)oo)/o)/((o/(oo*(-2/3)oo))/o(-26)) assuming o is positive. o(-10523/516) Simplify (h(2/9))35(h(-3))0 assuming h is positive. h*(70/9) Simplify ((bb*(1/5)/bb)/b(b/(b(2/3)/b))/bb)(39/2) assuming b is positive. b(299/10) Simplify (pp(-11)p)*(4/5)(p(-6))(-2/59) assuming p is positive. p(-2064/295) Simplify ((l(-11)l)/(l/((ll*(-3/7))/l)l))/((l/(l*(-4/7)l))/l)(-32) assuming l is positive. l(-183/7) Simplify ((i/(i/(ii(-2/13))))/((i/i3)/i))31 assuming i is positive. i(1550/13) Simplify (v6)26/(v6/(v(2/9)v)) assuming v is positive. v(1361/9) Simplify ((m(1/15))(-22/3))(-36) assuming m is positive. m(88/5) Simplify (q(-1)qqqq/(q/((q/(q/q*(-10))qq)/q)q)q)(-29) assuming q is positive. q203 Simplify (s10/s(1/4))/(ss(-7)/s)(-5/14) assuming s is positive. s(29/4) Simplify (q/q(-9))/q*1(q11)0 assuming q is positive. q*9 Simplify (c/(c/((cc/c*(-2/15))/cc)))*5(c(-8))(1/18) assuming c is positive. c(92/9) Simplify (((h/((h/h(3/14))/h))/(h/(hhh(2/13))))(3/22))(1/4) assuming h is positive. h(1293/16016) Simplify (((u(3/2))(-11))49)(1/9) assuming u is positive. u(-539/6) Simplify ((p(-2/11)pp)/(p*10p)(p(-2))(2/111))39 assuming p is positive. p(-146315/407) Simplify (((y(1/11)yy)/y)24)46 assuming y is positive. y(13248/11) Simplify (n3)(-1/27)(nn/(nn/n*(1/2)nn))10 assuming n is positive. n(-136/9) Simplify o(4/5)/o(1/6)o/o*(-2/49)o8 assuming o is positive. o(14221/1470) Simplify (x*(3/8)x*6)/(xx*(-14)xx(2/57)) assuming x is positive. x(8363/456) Simplify (z(3/2))(2/9)/(zzz(3/7))(-15/8) assuming z is positive. z(821/168) Simplify (u1/u)(2/9)/(uuuu/u*(-2/3)u(-1/2)) assuming u is positive. u(-25/6) Simplify ((j(-6))(6/7))(-24) assuming j is positive. j(864/7) Simplify (k(1/16))(2/47)/((k/k*(-1/47)k)/((k(-6/7)/k)/k)) assuming k is positive. k(-12833/2632) Simplify (j*2/jj13)/(j(3/14)/j(5/3)) assuming j is positive. j(649/42) Simplify (b(-11)/(b/(b/b2))b/((b((b/b*2)/b)/b)/b)(b((b/b(-3/8))/b)/b)/bb)(-30) assuming b is positive. b(1035/4) Simplify ((w(-13)/(w/w(-1/2)))(44/7))(-3/7) assuming w is positive. w(1914/49) Simplify (x26x(-11/6))(-2/41) assuming x is positive. x(-145/123) Simplify ((z/((z/((z(z*(-4/5)/z)/z)/z))/z))/((z(zzz30/z)/z)/z))(-8) assuming z is positive. z*(1272/5) Simplify bb*(-1)b*(-2/7)b*(-3/17)/(b/((b/(b/(bb10)))/b)) assuming b is positive. b(1016/119) Simplify ((l(-2))14)(-1/25) assuming l is positive. l(28/25) Simplify f*(-32)f*0ffff(-8)f(3/5) assuming f is positive. f(-182/5) Simplify (o(-2/3))(-33)/((o/(o(-5/3)/o))/o(2/11)) assuming o is positive. o(611/33) Simplify (p(-2/11))(-2/53)/(((p/p15)/p)/p)27 assuming p is positive. p(251860/583) Simplify (((w/(w/(w(w/w(1/6)w)/w)))/(w(w(-3)w)/ww))(2/19))(-23) assuming w is positive. w(-391/57) Simplify (s(-32)/((s(-11)/s)/s))(-38) assuming s is positive. s722 Simplify (c/(c(1/4)c)c(-2/35))(-5) assuming c is positive. c(43/28) Simplify (y/((yy/((yy/(y4/y))/y))/y))(-36)/((y(2/15)y)/yyy(2/23)) assuming y is positive. y(24419/345) Simplify (bbb(-4))(1/3)b(bb11)/bbbb(-3/5)/b assuming b is positive. b(176/15) Simplify r*(-1/2)r*(-3/13)r/((r*12/r)/r)rrr(rrr(-10)/r)/r assuming r is positive. r(-435/26) Simplify (v1/vvv19v)/((((vv(25/3))/v)/v)/(v30/v)) assuming v is positive. v(128/3) Simplify ((ll23)/(l18/l))/((ll/(l(l/l*15)/lll)l)/l(-1/5)) assuming l is positive. l(-41/5) Simplify ((p*(-1)/pp)12/((p/p0)/(p/p(9/4))))(-2/19) assuming p is positive. p(3/2) Simplify (t(1/28)t8)/((((t5t)/t)/tt)/(t/t(-1/10))) assuming t is positive. t(579/140) Simplify c7c/(c/((c*(11/6)/c)/cc))(((c/c(2/7))/c)/c)(1/2) assuming c is positive. c(151/21) Simplify ((o(1/8)o)(2/31))(-7/5) assuming o is positive. o*(-63/620) Simplify ((t(tt/(t/((t/(t/t(-15)))/t)))/tt)(-3/11))(3/8) assuming t is positive. t*(63/44) Simplify ((u/((uu/((uu/((u8/u)/uu))/u))/u)u)/((uu*(-7)/uu)/u))/(u*(-5)u)(1/4) assuming u is positive. u3 Simplify (sss*(-4)s/(s(s6ss)/ss)	{ "pile_set_name": "DM Mathematics" }
. What is the units digit of 60/v2/t? 5 What is the tens digit of (0 + 342/30)25? 8 Suppose 5q = q + 452. Suppose -2h + q = 3o, 215 = 7h - 3h - 5o. What is the units digit of h? 5 Suppose -50d = -2m - 51d + 8394, -5d - 16760 = -4m. What is the thousands digit of m? 4 Let d(q) = 197q - 79. What is the tens digit of d(5)? 0 Suppose 69k - 128528 = 11k. What is the tens digit of k? 1 Let z be 2 + -48 + 6 + -1. Let k = 115 - 183. Let w = z - k. What is the units digit of w? 7 Let k(v) = 2v2 - 2v + 4. Let m be k(-3). Suppose 6c + c - m = 0. Suppose -cb - 30 = -5b. What is the units digit of b? 0 Let a be 9/34/6. Let o be a - 1/(-4)-4. What is the units digit of (o - 8/12)33? 1 Let w(v) = 10v2 - 1 - 6v2 + v2 - 4v2 - 13v. What is the units digit of w(15)? 9 Let f = -903 - -1241. What is the hundreds digit of f? 3 Let q(v) = v2 - v + 6. Let c(m) = m2 - 11. Let y be c(4). What is the units digit of q(y)? 6 Let x = 22 - 18. Suppose -3u + 127 = -2m, 2u = 6m - 3m + 83. Suppose 2g = 3o + u, -g - xo + 18 - 2 = 0. What is the units digit of g? 0 What is the hundreds digit of (31 - 6)2/428? 3 Let i = -248 + 275. What is the tens digit of i? 2 Let c = 823 + -307. What is the units digit of c? 6 Suppose 2n + 3n = 20. Suppose -j = 4b + 18 - 6, nj - 3b + 10 = 0. What is the units digit of ((-5)/j)/((-2)/(-48))? 0 What is the tens digit of (-3 + (-4365)/6)/(36/(-72))? 6 Let k(a) be the second derivative of 35a*3/6 - 23a*2/2 + 19a. What is the units digit of k(7)? 2 Suppose -56o + 2646 = -49o. What is the tens digit of o? 7 Let x = 25 - 23. Let y = -2 - x. What is the tens digit of 2/y - (-513)/18? 2 Let p be 2/((-8)/(-28)-1). Let c = 36 - p. Suppose c - 8 = 5u. What is the units digit of u? 7 Suppose -23 = 4s - 2f + 15, -4f + 41 = -3s. Let d(x) = -x*3 - 8x*2 - 8x + 3. Let z be d(s). Let c = z + -5. What is the units digit of c? 5 Suppose 278 = r - 484. What is the units digit of r? 2 Let b(m) = 50m - 15. What is the tens digit of b(4)? 8 Let s = -2 - -7. Suppose sc - 9 = 16. Suppose 0 = 5g - c. What is the units digit of g? 1 Let t = -3254 + 4967. What is the tens digit of t? 1 Suppose 0 = -2f - 2f + 12. Suppose 0 = -fo - 2m, -4o - m - 7 = -2. Let z = 4 - o. What is the units digit of z? 6 Suppose 3v = -v + 104. What is the units digit of v? 6 Let j(z) = -2z + 4. Let n be j(5). Let t be (-33)/(-1 - 3/n). Suppose -4c = -w - w - t, -3w + 34 = c. What is the tens digit of c? 1 Suppose -964 = 23r - 25r. Let l = r + -321. What is the units digit of l? 1 Suppose -2j = -3u + 11, 0 = 4u - j + 6j - 30. What is the tens digit of 4/u - 1862/(-35)? 5 Let w(t) be the first derivative of -t*4/12 - 7t*3/3 + 5t*2 + 7t - 1. Let h(q) be the first derivative of w(q). What is the tens digit of h(-13)? 2 Suppose 2o - 2h = 2452, -2o - 3o + h = -6126. What is the tens digit of o? 2 Let o be 2 - ((3 - 8) + 5). Suppose -395 = -3j - oj + 5k, 5k - 298 = -4j. What is the units digit of j? 7 Let l(c) = -16c*3 - 15c*2 - 2c + 19. What is the thousands digit of l(-6)? 2 Let o(d) = d*2 - 13d + 4. Let j be o(13). Suppose t - 5 = -3i, 5 + 0 = t - ji. Suppose 8 + 92 = tg. What is the units digit of g? 0 What is the tens digit of (-1 - -123) + (-25)/5 + 0? 1 Let c(b) = b3 + 10b*2 + 5b. Let y be c(-8). Let h be ((-2)/(-4))/(11/y). Suppose 5o - hi = 322, 5i = -6o + 2o + 233. What is the tens digit of o? 6 Suppose -43015 = -3s - 7s - 5t, 4s - 17208 = -4t. What is the tens digit of s? 0 Let x = 217 - 217. Let g = -7 - -11. Suppose -gn + 60 + 20 = x. What is the units digit of n? 0 Suppose -t - 9 - 3 = 0. Let g = t + 15. Suppose gj + 0w = -4w + 238, -4j + w + 292 = 0. What is the tens digit of j? 7 Let w(r) = 9r*3 + 2r*2 - r - 2. Let u be w(-1). Let f = u + 8. Suppose f = 6m - 4m - 14. What is the units digit of m? 7 Let n(s) = -58s - 48. What is the tens digit of n(-16)? 8 Suppose 4a - v = v + 30, a = 5v + 3. Let n = 4 - a. Let k(u) = -u3 - u2 - 3u - 4. What is the tens digit of k(n)? 5 Suppose 34b = 3442 + 3324. What is the tens digit of b? 9 Suppose -3h + 618 = 3j, 4j + 1030 = 5h + 7j. What is the tens digit of h? 0 What is the tens digit of ((-6 + 22)28)/1? 4 Let l(w) = 3w + 7. Let g be l(-1). Suppose -4r - r + 674 = 3a, 2a + gr = 446. What is the hundreds digit of a? 2 Let q be (-1)/(-1) - (-7 - (0 - 0)). Let c(y) = 16y + 73. What is the tens digit of c(q)? 0 Let x(b) = -7b3 + b. Let t be x(-1). Let q be -2 - (t/(-1) - 1). Suppose -99 = -qy + 11. What is the tens digit of y? 2 Suppose k + 1 = -4a, 3a + 2a - 10 = -5k. Let x(q) = q*3 + 7q*2 - 2q - 12. Let r be x(-7). Suppose s - k - r = 0. What is the units digit of s? 5 Let m(l) = -l*2 - 10l - 10. Let b be m(-8). Let h(z) = -z*3 + 8z*2 + 5z - 4. What is the units digit of h(b)? 8 Suppose 2a - j = 16, 12 = -0j - 3j. Suppose -27 = 3k + 4n + 62, 4k + 124 = -4n. What is the units digit of k/(-21) + 2/a? 2 Suppose -2i - 652 = -3r + 2i, -i - 658 = -3r. What is the units digit of r? 0 Suppose -4w = -w - 15. Let x(p) = -wp + 2 - 5p - 3 + 0p - p2. What is the tens digit of x(-8)? 1 Let f be 88/(-10) + 63/(-315). Suppose -2t = 12 - 0. What is the units digit of t/f + 128/6? 2 Let p(b) = -2b3 - 11b*2 - 9b + 9. Let q be p(-7). Suppose 0 = -9a + 12a - q. What is the tens digit of a? 7 Suppose -56f = -38f - 24210. What is the thousands digit of f? 1 Let v = -596 + 856. What is the tens digit of v? 6 Suppose 258 - 216 = -2c. What is the units digit of (7/c)/((-1472)/(-492) + -3)? 1 What is the hundreds digit of (-80)/(-280) - 2913/(-21)? 1 What is the units digit of (-68 - -1)/(31/(-186))? 2 Let y = -25 + 25. Suppose yj + 2j - 158 = 0. What is the units digit of j? 9 Let j be ((-26)/(-4))/((-10)/(-260)). Suppose 7u - j = 55. What is the tens digit of u? 3 Let l be -13 - ((-4)/(-4) + -1). Let m = -9 - l. What is the units digit of 19 + (m - 0 - 0)? 3 Let d(p) = -p*3 - 7p*2 + p - 8. Suppose 6q + 81 = -3q. What is the units digit of d(q)? 5 Suppose -25f = -35f - 160. Let z(d) = 2d*3 + 31d*2 - 17d + 28. What is the tens digit of z(f)? 4 Let h = -6353 + 8920. What is the units digit of h? 7 Let p = 434 + -134. What is the tens digit of p? 0 Let o(v) = 2v - 5. Let k(z) = -3z + 3 + 3z - 3z + 2z. Let g(u) = 7k(u) + 3o(u). What is the tens digit of g(-5)? 1 Let c(r) = 1. Let v(l) = -2l - 8. Let b(d) = 5c(d) - v(d). What is the tens digit of b(0)? 1 Let w(o) = 241o - 139. What is the hundreds digit of w(10)? 2 Let b be (-55)/33(-36)/10. Suppose 0 = -bi + 275 + 199. What is the tens digit of i? 7 Let x(i) = -i - 26. Let p be (-35)/3 - (-6)/(-18). Let f be x(p). What is the units digit of 615/35 - 6/f? 8 Let o(b) = b2 + 1. Let g(p) = -p3 - 2p2 + 5p + 6. Let h(z) = -g(z) - 2o(z). What is the units digit of h(5)? 2 Let u = 1475 + -730. Suppose b = 3x + 265, x = 9b - 12b + u. What is the tens digit of b? 5 Suppose -13u + 18u - 20 = 0. Suppose ub - 2b - 4a = 66, -5b - 4a = -95. What is the units digit of b? 3 Let u = -779 + 1225. What is the tens digit of u? 4 Let m(w) = w3 + 31w*2 + 14w + 263. What is the units digit of m(-13)? 3 Let x(p) = p*2 + 9p + 6. Let n be x(-6). Let v = n - -15. Suppose -o = vo - u - 7, -3u = 9. What is the units digit of o? 1 Let f be (120)/((-42)/(-21)). Suppose 0 = -fn + 4n + 396. What is the tens digit of n? 6 Let k = 144 + -110. What is the tens digit of (k/(-7))/(-2(-6)/(-84))? 3 Suppose 5q = -f + 1453, 0 = -5f + f - q + 5831. What is the tens digit of f? 5 Suppose 2d = -h - 16, -2h - 8d = -3d + 36. Let g = h + 9. What is the tens digit of (4 - -10)(g - -1)? 2 What is the units digit of (1184/(-64))/((-4)/1352)? 3 Suppose -j = -c - 2400, -6c + 2c = -5j + 12001. What is the thousands digit of j? 2 Let f = -225 - -368. Suppose -w + 55 = 2o, -4o - o - f = -3w. What is the units digit of w? 1 Suppose 3p + 9 = -6. Let t(r) = r - 6 - 1 + r*2 + 0r*2 + 10. What is the units digit of t(p)? 3 What is the hundreds digit of (-28)/(-20)1471 + (-6)/(-10)? 0 Suppose -4y - 5d = -349, 3y + 0d - 259 = -d. Suppose -m + 4c = -61, -y = -0m - 2m - 4c. What is the tens digit of	{ "pile_set_name": "DM Mathematics" }
-13 Solve 0 = 92u - 226 + 1790 for u. -17 Solve -110 = 462k - 572 for k. 1 Solve -394c + 330 = -197c - 212c for c. -22 Solve 76 = 61p - 90 + 44 for p. 2 Solve 46q - 1243 = 198q + 125 for q. -9 Solve 0 = -55z - 456 - 39 for z. -9 Solve 0 = -105u - 12568 + 9313 for u. -31 Solve -25k - 2418 = 76k + 85k for k. -13 Solve -261z = 256z - 487z + 330 for z. -11 Solve 0j + 338 = 17j - 43j for j. -13 Solve 20d + 990 = 1230 for d. 12 Solve 413x - 60 = 403x for x. 6 Solve -70d - 56 + 53 = 137 for d. -2 Solve -173d = -265d - 184 for d. -2 Solve 32c = 8c + 5c + 76 for c. 4 Solve -20h - 41 = -61 for h. 1 Solve -47r - 143r - 6r + 588 = 0 for r. 3 Solve 13c = -72c - 340 + 1785 for c. 17 Solve 317h - 3059 = 184h for h. 23 Solve 55t + 984 = 159 for t. -15 Solve 574 - 296 = 411j - 544 for j. 2 Solve 37m = 76m - 273 for m. 7 Solve 880 = -98h + 2863 + 1643 for h. 37 Solve -161q + 29q - 990 = 33q for q. -6 Solve -1188 = 23h + 182h + 3322 for h. -22 Solve 9025 = -1298i - 220 - 20609 for i. -23 Solve -584g + 879 - 6135 = 0 for g. -9 Solve -1076 = 103l - 149 for l. -9 Solve -32a - 59a = 40a - 3144 for a. 24 Solve 627h - 11295 - 1245 = 0 for h. 20 Solve 110 = -3a - 79 + 150 for a. -13 Solve 543 + 6492 = -376u - 3493 for u. -28 Solve 0 = 86c + 4971 - 3251 for c. -20 Solve 11g = 8 - 140 for g. -12 Solve -49f - 296 + 154 - 250 = 0 for f. -8 Solve 2107 = 28o + 1631 for o. 17 Solve 105q + 244q - 27q = 966 for q. 3 Solve -271t + 526 = 1610 for t. -4 Solve -627 = -9v + 11v + 55v for v. -11 Solve -48k - 374 = 183 + 67 for k. -13 Solve 275g = -182g - 12903 + 107 for g. -28 Solve -423k + 422k = -9 for k. 9 Solve 0 = 89p - 103p + 42 for p. 3 Solve -49r = 84r - 266 for r. 2 Solve -184 + 81 = -7a - 96 for a. 1 Solve 99n - 3568 = 445n - 123n for n. -16 Solve 0 = -5c + 35 + 50 for c. 17 Solve 19n - 1309 = -3n + 99n for n. -17 Solve 60u - 4167 = -2487 for u. 28 Solve 18r + 13r = -1051 + 245 for r. -26 Solve 793w - 44 = 815w for w. -2 Solve 9b = -14b - 5b + 308 for b. 11 Solve 9y - 19y - 193 = -53 for y. -14 Solve -12h + 44h + 441 = -17h for h. -9 Solve 238 = -84m - 9m + 52 for m. -2 Solve 0 = 11i + 16i + 670 - 22 for i. -24 Solve 0 = 2p - 135 + 107 for p. 14 Solve -j = -6j - j - 2j for j. 0 Solve 6187 = 7m + 5907 for m. 40 Solve -167c + 204 = 598 + 3280 for c. -22 Solve -304s - 245 = -89s - 1320 for s. 5 Solve -19i - 79i = 31i - 258 for i. 2 Solve 4 = -1046o + 1048o - 6 for o. 5 Solve 0 = 1168m - 49m + 36927 for m. -33 Solve 0 = -283f - 2572 + 7666 for f. 18 Solve 0 = 355w - 368w + 7 - 20 for w. -1 Solve -763k = -1936k - 15249 for k. -13 Solve 241d - 128d + 452 = 0 for d. -4 Solve 711 + 799 = 125h + 260 for h. 10 Solve 3927 - 1052 = -125c for c. -23 Solve -541 = 9m + 576 - 1153 for m. 4 Solve -50m - 101m = 755 for m. -5 Solve -231j + 87j + 858 + 726 = 0 for j. 11 Solve 1121q + 360 = 1061q for q. -6 Solve 567z + 1038 = -96 for z. -2 Solve 38c - 13 - 114 = 177 for c. 8 Solve -977o - 2397 - 1404 = 1084 for o. -5 Solve 1432a = 1460a for a. 0 Solve -19 = 663g - 658g + 26 for g. -9 Solve -74o - 186 - 86 = 172 for o. -6 Solve 16l + 46159 = 46431 for l. 17 Solve -6572f + 6956f = -7296 for f. -19 Solve 0 = 176w - 994 + 1874 for w. -5 Solve 0 = 18y - 3y - 160 + 250 for y. -6 Solve 0 = 77j - 45j + 64 for j. -2 Solve -3m + 16 - 34 = 3m for m. -3 Solve 225q + 41q = 10q + 1792 for q. 7 Solve 15b = 25b - 17b - 42 for b. -6 Solve 253h - 3736 - 3095 = 0 for h. 27 Solve -52t + 718 - 510 = 0 for t. 4 Solve -337 = -17w + 34 - 82 for w. 17 Solve 190f = 47 + 333 for f. 2 Solve -91f = -14116 + 12387 for f. 19 Solve 276d = 303d - 324 for d. 12 Solve -51 - 35 = -22l - 20 for l. 3 Solve 36w - 133w + 668 = 70w for w. 4 Solve 40j + 37j - 617 + 78 = 0 for j. 7 Solve 0 = -22y + 69y - 235 for y. 5 Solve 74u + 153 = -40 - 29 for u. -3 Solve 0 = 12412r - 12280r - 2112 for r. 16 Solve 122d - 150d = 182d - 1260 for d. 6 Solve 0 = -589s - 1596 - 4883 for s. -11 Solve 2625s - 2664s = -858 for s. 22 Solve -9m + 6 - 36 = 33 for m. -7 Solve 218 = -10v + 153 - 175 for v. -24 Solve -281b - 384b + 914 = -1746 for b. 4 Solve 20 - 110 = -18h for h. 5 Solve 246u + 82u = 43u + 6270 for u. 22 Solve 27q + 459 = 123q + 57q for q. 3 Solve -9n - 82 = -100 for n. 2 Solve -3850 = 75y + 46y + 385 for y. -35 Solve 2257 + 36 = -877a - 1215 for a. -4 Solve -3075 = -17u - 188u for u. 15 Solve -142745b + 142574b = -513 for b. 3 Solve 26614 = -363z - 365z + 7686 for z. -26 Solve -3k + 298 - 585 = -290 for k. 1 Solve -3p + 111 = 5p + 7 for p. 13 Solve 107b + 1583 + 450 = 0 for b. -19 Solve -5047g - 918 = -4993g for g. -17 Solve -63o - 73o - 185 = -2089 for o. 14 Solve -2909n = -2917n + 88 for n. 11 Solve -2952y = -2930y for y. 0 Solve 38 - 44 = 6h for h. -1 Solve -54x = -209x + 470 - 5 for x. 3 Solve 0 = -62b + 447b - 8470 for b. 22 Solve -762 + 172 = 185l + 520 for l. -6 Solve -127s + 21s + 848 = 0 for s. 8 Solve 0 = 88r - 137r + 100r + 204 for r. -4 Solve -755v + 20531 + 5894 = 0 for v. 35 Solve 53f = 592 - 716 + 1555 for f. 27 Solve -82y - 11335 = -10843 for y. -6 Solve 159n = -103 + 421 for n. 2 Solve -18n - 15n + 8 = -355 for n. 11 Solve -65d - 396 - 189 = 0 for d. -9 Solve 42p - 399 = 63p for p. -19 Solve -51 - 74 = -6664p + 6639p for p. 5 Solve 333 = 43d - 80d for d. -9 Solve -710 + 827 = -13b for b. -9 Solve -9131f = -9099f + 96 for f. -3 Solve 926d - 466d + 44 = 471d for d. 4 Solve 0 = -148p - 1362 - 1894 for p. -22 Solve 205g - 120g - 85 = 0 for g. 1 Solve -228y + 724 + 68 = -327y for y. -8 Solve 432s - 405s - 540 = 0 for s. 20 Solve -5 = -4p + 1 + 6 for p. 3 Solve -258s + 65 = -253s for s. 13 Solve 5494 = -1687c + 1110c - 2584 for c. -14 Solve -32k - 72k = 0 for k. 0 Solve 10498 + 2102 = -504q for q. -25 Solve 307s - 187s + 529 = 2209 for s. 14 Solve -2617 + 797 = -455p for p. 4 Solve -5878i + 5772i = 3392 for i. -32 Solve -182h = -55h + 2032 for h. -16 Solve 0 = 4x - 212x + 832 for x. 4 Solve 44x - 8x = -339x + 3750 for x. 10 Solve 0 = -27c + 4223 - 3926 for c. 11 Solve -1308813 = 42x - 1309947 for x. 27 Solve -224v - 658 - 458 = 1796 for v. -13 Solve -5256 = 216x - 713x + 3193 for x. 17 Solve 0 = -7q - 5q - 9q + 42 for q. 2 Solve -115f - 429 = -631 - 2213 for f. 21 Solve 138l - 315 = 117l for l. 15 Solve 155r = 417r + 178r - 7920 for r. 18 Solve 3h - 4 + 9 = 11 for h. 2 Solve 0 = 21y - 0 + 273 for y. -13 Solve 309 = 2t + 313 for t. -2 Solve -268 = 80t + 179 - 47 for t. -5 Solve -5s - 198 = 4s + 18 for s. -24 Solve -1181 + 929 = 12r for r. -21 Solve -53g - 60g = -g - 336 for g. 3 Solve -42g + 23 = -g + 187 for g. -4 Solve 108s = 59 + 998 + 779 for s. 17 Solve -10l - 727 = -32l - 1013 for l. -13 Solve 124 - 460 = 29r - 85r for r. 6 Solve -212m = -192m + 120 for m. -6 Solve 21413 = -98b + 17787 for b. -37 Solve -80y = -57y - 23 for y. 1 Solve 69q + 342 = 480 for q. 2 Solve 0 = 3905p - 3569p + 3696 for p. -11 Solve 1588x - 20480 = -140x + 3712 for x. 14 Solve 29w = 11w + 10w + 3w for w. 0 Solve 22082 = -2378f - 9196 - 4392 for f. -15 Solve 0 = -654i + 8300 + 856 for i. 14 Solve -93m - 6m - 758 = 430 for m. -12 Solve 128 = 53n + 75 for n. 1 Solve 6m + 13 = -20 - 27 for m. -10 Solve -20c + 49 + 33 = -118 for c. 10 Solve 105 = 995l - 9425 - 6390 for l. 16 Solve -178f + 1384 = -574 for f. 11 Solve 82p + 72p + 336 = 126p for p. -12 Solve 330989 - 330807 = -14r for r. -13 Solve 0 = 10a + a - 33 for a. 3 Solve -74 = b - 64 for b. -10 Solve 100t + 1367 + 589 = 556 for t. -14 Solve 1109 = -62l + 83 - 28 for l. -17 Solve 96p - 3p + 1870 = 8p for p. -22 Solve 9 = 14m - 6 + 1 for m. 1 Solve 0 = -1084j + 1081j + 33 for j. 11 Solve -215j + 4356 = -159 for j. 21 Solve -53237c + 53067c - 1700 = 0 for c. -10 Solve 414 = 283v - 435 for v. 3 Solve -33 - 96 = 40a - 49 for a. -2 Solve -156z - 1204 = -70z for z. -14 Solve -6t + 223162 - 223186 = 0 for t. -4 Solve -336 = -51d + 785 - 254 for d. 17 Solve 51k = 61k - 70 for k. 7 Solve 74a = -1 + 149 for a. 2 Solve 240 = -46l - 67 - 199 for l. -11 Solve -54*j - 152 - 39	{ "pile_set_name": "DM Mathematics" }
u2 Let x(w) = 29915826 - 2w*2 - 29915826. Let s(p) = -40p + 2. Calculate s(x(d)). 80d2 + 2 Let d(c) = 37c*2. Let v(y) = -196y + 85. Let s(g) = -97g + 34. Let k(z) = 5s(z) - 2v(z). Give k(d(x)). -3441x*2 Let f(u) = -10u. Let t be (-2 - 6/(-3))/2. Let k(x) = -2x + 0x + tx. Determine f(k(p)). 20p Let f(y) be the third derivative of -y*5/60 + 3y*2. Let d = -674 - -706. Let x(p) = -dp - 30p + 44p - 48p. Determine f(x(a)). -4356a*2 Let l(h) = -2249h - 6. Let a(s) = -692625s - 1847. Let b(j) = -6a(j) + 1847l(j). Let t(d) = -2d*2. Give t(b(y)). -6822818y*2 Let v be (-22)/1 + (50 - 22). Let t(a) = 19a2 - 67a*2 + 23a*2 + va*2. Let n(f) = -38f*2 - f + f. Calculate t(n(i)). -1444i4 Let v(h) be the third derivative of -h5/30 + 2689h2. Let y(m) = 2371m. What is v(y(r))? -11243282r2 Let k(r) = 2361r. Let u(j) be the second derivative of -j*3/6 + 403j + 2. Determine k(u(z)). -2361z Let v(h) = 27h2. Let f(r) = r2 + 3r - 7. Let s(c) = 32c*2 - 6c + 13. Let l(q) = 2f(q) + s(q). Calculate v(l(j)). 31212j*4 - 1836j*2 + 27 Let g(r) = -563r - 6. Let z(j) = 80j - 2. Determine g(z(n)). -45040n + 1120 Let k(n) be the third derivative of n5/60 + n4/8 - 5n3/3 + 11n*2. Let d be k(3). Let u(l) = -3l + 9l - dl. Let g(r) = 18r2. What is g(u(h))? 72h*2 Let o(m) = 1273165m*2. Let s(a) = -8a*2. Give o(s(b)). 81482560b*4 Let u(z) = 6979277z*2. Let r(f) = 2f. What is r(u(l))? 13958554l2 Let n(t) = -5t. Let x(i) = -i*2 + 1184i + 180. Give x(n(w)). -25w2 - 5920w + 180 Let i(k) = -6k. Let w = -377 + 565. Suppose -6v = -2v - w. Let d(u) = 23 + 2u - v + 24. Give i(d(a)). -12a Let k(d) be the first derivative of -11d*2/2 - 10843. Let w(m) = -729m. Give w(k(o)). 8019o Let u(o) = -186o + 1. Let b(y) = -8y - 3. Let z(l) = 55l + 22. Let c(a) = 22b(a) + 3z(a). What is c(u(n))? 2046n - 11 Let u(y) = y2 + y + 2. Let l be u(-2). Suppose 6 = lx + 2a - 2, 3x - 2a - 20 = 0. Let s(w) = -2 + 2 - xw + 5w. Let g(o) = -23o. Determine g(s(m)). -23m Let x(m) = 112m*2 - 17 - 12 - 15 + 56 - 10. Let r(g) = 212g*2 - 415g*2 + 202g*2. Calculate r(x(t)). -12544t*4 - 448t2 - 4 Let u(j) be the second derivative of j6/45 + j*4/6 - j. Let b(q) be the third derivative of u(q). Let c(i) = 18 - 3 + 2i - 15. What is b(c(k))? 32k Let n(a) = -87a + 6. Let b(d) = 4d - 243. Let l(u) = -u + 54. Let i(m) = 2b(m) + 9l(m). Determine i(n(f)). 87f - 6 Suppose 11 = a + 16. Let d(n) = -2n. Let i(o) = o2 + 10o. Let y(z) = ad(z) - i(z). Let l(k) be the second derivative of 3k*4/4 - 3k. What is y(l(u))? -81u4 Suppose -2t = 2s - 14, -2t = -s + 6s - 29. Let a = 1629 + -1625. Let r(i) = 12i - ai - si. Let h(w) = 12w2. Calculate r(h(b)). 36b*2 Let t(l) = -13l. Let o(c) = -34381512c2. What is t(o(f))? 446959656f*2 Let g(j) be the first derivative of 1321j*3/3 - 3109. Let l(r) = 3r. What is l(g(d))? 3963d2 Let y(m) = 8 - 3087m - 3 + 3093m. Let w(x) = 2x - 31. What is w(y(i))? 12i - 21 Let n(f) be the first derivative of 0f*2 + 2/3f*3 - 56 + 0f. Let b(y) = -29y - 1. Calculate n(b(l)). 1682l*2 + 116l + 2 Let z(n) = -471n - 13. Let i(h) = 5195h. Calculate i(z(p)). -2446845p - 67535 Let h(m) = -2m - 2. Let o(p) = 66p + 36. Let r(c) = 36h(c) + 2o(c). Let n(k) = -16k*2 + k. Give n(r(d)). -57600d*2 + 60d Let k(d) = -2591d2. Let y(h) = -4h + 17. Determine y(k(f)). 10364f2 + 17 Let x be (6 - 99)-1 - 7. Let r(p) = -xp + 46p + 44p. Let o(g) be the first derivative of -2g*2 - 1. Calculate o(r(l)). -16l Let s(i) be the first derivative of i*5/60 - 41i*3/3 - 47. Let h(u) be the third derivative of s(u). Let p(l) = -3l*2 + 14l. Give p(h(r)). -12r2 + 28r Let s(c) = 0c - 4c + 5c. Let a(w) = 8w - 9w + 81w*2 - 127w*2. Give a(s(l)). -46l*2 - l Let m(u) = 6u*2 - 10u*2 + 3u + 0u2 - 4u*2 - 6u2. Let n(l) be the first derivative of -l3 + 5. What is n(m(d))? -588d4 + 252d*3 - 27d*2 Let j(l) = -5l*2 + 5l + 3. Let w(g) = -1. Let r(z) = j(z) + 3w(z). Let d(f) = 2f + 6. Let q(t) = -3t - 12. Let y(k) = -2d(k) - q(k). What is y(r(x))? 5x2 - 5x Let u(i) = -61i2 - 585i - 576i + 1739i - 578i. Let q(s) = s2 + 3s*2 + 0s2 - s2. Determine u(q(m)). -549m4 Let f(g) = 12g*2 - 9g. Let r(s) be the first derivative of -s*5/30 + 38s*2 - 25. Let h(b) be the second derivative of r(b). What is f(h(y))? 48y*4 + 18y*2 Let c(n) = 75n*2 + 42n - 14. Let q(i) = 1763i2 + 984i - 328. Let d(g) = -164c(g) + 7q(g). Let o(m) = -19m. Give d(o(b)). 14801b*2 Let d(i) = i + 3. Let z(o) = -o - 4. Let c(h) = -4d(h) - 3z(h). Let u(y) be the third derivative of y5/6 - y3/6 + y2 - 47. What is c(u(j))? -10j*2 + 1 Let y(q) = 361 + 799q - 361 - 28q. Let o(p) = -2p. What is o(y(k))? -1542k Let h(k) = -78k. Let j(w) be the second derivative of -w*3/6 + 366w. Calculate h(j(v)). 78v Let c(l) = -4l - 21. Let p(g) = 74g - 223g + 84g + 72g. Calculate c(p(v)). -28v - 21 Let k(o) be the first derivative of o3/3 + 2856. Let t(a) = -a2 - 2811. Calculate k(t(m)). m4 + 5622m*2 + 7901721 Let y(u) = 35559u. Let s(a) = 1106a. What is y(s(r))? 39328254r Let z(l) = 32866l2 + 168l. Let y(p) = -p. Calculate z(y(t)). 32866t2 - 168t Let s(b) = b*2. Let j(h) = 4h*3 + 6h*2 - 8h + 16. Let v be j(5). Let c(t) = -vt - 17 - t2 + 314t + 312t. Calculate c(s(k)). -k4 - 17 Let a(r) = r2. Let n(l) be the third derivative of 0 + 0l*3 + 0l - 79/4l4 + 169l*2. Give n(a(x)). -474x*2 Let v(n) = -3387n + 1843n - 4653n + 195n - 2014n. Let b(q) = q*2. Determine b(v(z)). 64256256z*2 Let a be 16/(-15)(-13 + 3). Suppose d = 5d + 3g - 2, -2d - g = -2. Let f(x) = -a - 2x + d + 2. Let r(q) = -14q*2. Give f(r(y)). 28y*2 Let s(x) = 2x*2. Let h(r) = 68759604r*2. Calculate s(h(g)). 9455766284473632g*4 Let n(s) = -973431s. Let v(k) = -239k. What is v(n(y))? 232650009y Let q(g) = 2g2. Let w(a) = -321738532a. Determine q(w(n)). 207031365947030048n2 Let n(q) be the second derivative of -q4/12 - 127q. Let p(a) be the first derivative of a*2 - 15 + 16 - 3a*2. What is p(n(r))? 4r*2 Let b(w) = -17w + 1. Let n(p) be the second derivative of 0p3 + 0p*2 + 26p - 1/12p4 + 1. Determine b(n(a)). 17a*2 + 1 Let l(i) = -231i + 1. Let y(m) = -463m + 2. Let r(v) = -4l(v) + 2y(v). Let j(a) = -17a*2 - 76a. Calculate j(r(q)). -68q2 + 152q Let h(b) = 4b. Let u(k) be the first derivative of 0k + 19/2k2 + 142. Determine u(h(z)). 76z Let u(z) be the third derivative of -3z2 + 0 - 1/24z*4 + 0z*3 + 0z. Let y(d) = 1264d2 - 603d*2 - 624d*2. Determine y(u(s)). 37s2 Let h(y) be the first derivative of y5/15 + y*2 - 29y - 96. Let d(p) be the second derivative of h(p). Let x(t) = -2t2 - 5. Determine d(x(a)). 16a*4 + 80a*2 + 100 Let d(i) = 6485i*2 + 75i - 600. Let r(k) = 608k2 + 7k - 56. Let w(f) = -7d(f) + 75r(f). Let x(l) = -17l2. Calculate x(w(o)). -714425o*4 Let g(f) = 7f*2. Let h(z) = 223z + 35. Let m(d) = 10d + 2. Let a(x) = -h(x) + 15m(x). Give g(a(s)). 37303s2 + 5110s + 175 Let s(n) = -2n2 + 25n. Let j(z) = 1124z + 1121z - 3363z + 1221z. Calculate s(j(d)). -21218d2 + 2575d Let l(w) = -13455w. Let q(y) = 6314y - y*2 + 6319y - 12633y. Determine l(q(b)). 13455b*2 Let z(n) = -n. Let w(b) be the first derivative of -28 - 30b + 0b2 + 19/3b*3. Let h(a) be the first derivative of w(a). Calculate h(z(p)). -38p Let w(j) = 50709611j. Let t(h) = -2h*2. Give t(w(l)). -5142929295542642l2 Let p(n) be the third derivative of n4/8 + 2n2. Let s(r) = 5r. Let v = 76 + -91. Let l(y) = -35y. Let d(t) = vs(t) - 2l(t). Give p(d(h)). -15h Let x(a) = a*2. Let j(c) = -176c - 53. Let n(g) = -81g - 25. Let i(q) = 6j(q) - 13n(q). Give i(x(w)). -3w*2 + 7 Let a(m) = -31m + 70. Let c(w) = 18w - 40. Let y(b) = -4a(b) - 7c(b). Let s(k) = -k2 + 156. Calculate s(y(d)). -4d*2 + 156 Let h(j) = 22j. Let v(n) = -237n + 67 + 78n + 79n - 47 + 91n. What is h(v(g))? 242g + 440 Let n(u) = -75u. Let d(k) = -190k + 71. Determine d(n(y)). 14250y + 71	{ "pile_set_name": "DM Mathematics" }
Let x = -4466 - -4517. What is the remainder when 1047 is divided by x? 27 Let r = 1163 + -1150. Suppose 18 = 4w - 18. What is the remainder when 4w - (-5)/5 is divided by r? 11 Suppose -q + 330 = 4q. Suppose -5i + q = -219. Suppose 164 = 18n - 52. What is the remainder when i is divided by n? 9 Suppose -4q = 4, 8 = 5l - 4q - 6. Calculate the remainder when ((-32)/10 - -3)/(l/(-310)) is divided by (-82)/(-5) - (-8)/(-20). 15 Suppose -2v + r = -5, 0 = v + r - 25 + 21. Suppose -4b - 4g + 251 - 35 = 0, -vg = -b + 38. What is the remainder when b is divided by 21? 8 What is the remainder when 294 is divided by ((-7)/112-24)/(3/398)? 95 Let p(z) = z3 + 3z*2 - 7z - 1. Suppose -4k = -3k + 1. Let h be (4 + k)/1(-12)/9. What is the remainder when 39 is divided by p(h)? 6 Calculate the remainder when 98 is divided by (-5)/((-7)/35 + (-2 - (-28)/15)). 8 Suppose 0 = -5c + 25, 4o - o - 2c = 1478. Calculate the remainder when o is divided by 12. 4 Let w(g) = 26g2 + 6g - 38. Let u be w(3). Let j = -94 + u. Calculate the remainder when j is divided by 11. 10 Suppose 24r - 42 = 3r. Suppose 0 = -rm + 2a + 99 + 101, 4m - 416 = -4a. What is the remainder when m is divided by 15? 12 Calculate the remainder when (-35688)/(-144) - ((-246)/(-36) - 7) is divided by 119. 10 Let z = 30454 - 30412. What is the remainder when 190 is divided by z? 22 Let z be (-358)/4 - (66/(-12) + 6). Let c = z - -133. What is the remainder when c is divided by 5? 3 Let z = 748 - 488. Suppose 5a - a = -z. Let t = 108 + a. What is the remainder when t is divided by 15? 13 Suppose 1713o = 1718o - 7785. What is the remainder when o is divided by 82? 81 Let o be (1/1)/(2/8). Suppose om + 9 = 105. Suppose 0 = 3l - h - 44, 3l + h - 10 = 30. What is the remainder when m is divided by l? 10 Let y(k) = -2 - 11k2 - k2 - 5 + k3 - 2 - 12k. What is the remainder when 0/(-1) + (-88)/(-4) is divided by y(13)? 2 Suppose z + 4g - 14 = 0, -12z + 5g = -9z - 25. Suppose 32m + 1050 = 47m. What is the remainder when m is divided by z? 0 Let z(x) = 9x - 37. Let h(v) = -2v - 10. Let y be h(-8). Let s = 116 + -68. What is the remainder when s is divided by z(y)? 14 Let t be (-50)/(-325) - (-2)/(-13). What is the remainder when (-5(t - 1))/(8/232) is divided by 30? 25 Suppose 0 = 3a - 148 + 154. Let n be ((-1385)/(-30) - 0) + a/12. Suppose 5d - n = -3x + 17, -31 = -x - 5d. Calculate the remainder when 125 is divided by x. 13 Suppose -3r + 18 = 3z - 12, -2 = -2r. Let h(v) = 24v - 194. What is the remainder when 30 is divided by h(z)? 8 Let p(j) = j2 + 2j - 2. Let h be p(-2). Calculate the remainder when (190/h)/(-2 - -1) is divided by 16. 15 Let v = 94 - 103. Suppose 0 = -k - 3f + 71, k = -4k + 5f + 295. What is the remainder when k is divided by v/((-36)/8) - (-12 + -2)? 14 Let f be (114/9-1)/(4/18). Let j = f - -117. Suppose 0 = 3g - 12 - j. Calculate the remainder when g is divided by 5. 4 Suppose 42t = 39t + 18. Let a = 24 - t. Calculate the remainder when 52 is divided by a. 16 Suppose 3b + 8973 - 26073 = 0. Suppose 28x - 32x + b = 0. Calculate the remainder when (x/(-4))/(-5) - (-6)/8 is divided by 25. 22 Let f = 62 + -51. Let n(z) = z*2 + 4z - 3. Let a be n(-7). Calculate the remainder when 247/6 + (-3)/a is divided by f. 8 Let x be 7/21 + 17/3. Suppose 25r - 425 = -0r. Calculate the remainder when ((-94)/x)/((-1)/3) is divided by r. 13 Let s = -6660 + 7587. What is the remainder when s is divided by 155? 152 What is the remainder when 5821 is divided by -2 + (-2298)/(-54) + (-80)/(-180)? 40 Let k(q) = q*3 - 7q*2 + 10q - 10. Let b(i) = -26 - 16 + 2i + 30. Let g be b(9). What is the remainder when 109 is divided by k(g)? 11 Suppose -17n = 5w - 21n - 416, 6w - 488 = 2n. What is the remainder when 224 is divided by w? 64 Let n(x) = -x*2 + 29x + 416. What is the remainder when 718 is divided by n(-10)? 16 Let a(j) = j*3 - 15j*2 + 7j - 11. Suppose -5t - 18 = -3t. Let l be 1/((-15)/25)t. What is the remainder when a(l) is divided by 16? 14 Suppose 20 = 2t + 136k - 134k, -k + 30 = 3t. Calculate the remainder when 3578 is divided by t. 8 Suppose -2h = 8, 3h = -197z + 193z + 3936. What is the remainder when z is divided by 325? 12 Let k = 666 - 411. Let p = 88 + k. What is the remainder when p is divided by 8? 7 Suppose 5l = 3l + 84. Let g(z) = 7z + 12. Let r be g(9). Suppose 3x + 2x - r = 0. What is the remainder when l is divided by x? 12 Let k(c) = c*2 + 17c + 93. What is the remainder when k(19) is divided by 87? 81 What is the remainder when 358 is divided by (-12)/18((-693)/(-2))/(-7)? 28 Let m = -15233 + 15317. What is the remainder when 1077 is divided by m? 69 Let b(j) be the second derivative of -4j*3/3 + 2j*2 - 4j. Calculate the remainder when 103 is divided by b(-6). 51 Let r = 8359 - 8219. Calculate the remainder when 421 is divided by r. 1 What is the remainder when 10/(-6)((-1644)/3 + -7) is divided by 32? 29 Let g = -400 - -614. Suppose -94 = 3x - g. What is the remainder when 199 is divided by x? 39 Let n(g) = 2g2 - 27g - 601. What is the remainder when n(-13) is divided by 13? 10 Suppose -15821 = -2w + 5d, 4w = 10d - 5d + 31657. What is the remainder when w is divided by 99? 97 Suppose -2c + 386 = -32h + 34h, 5h - 5c = 905. What is the remainder when h is divided by 83? 21 Let w(l) = -l*2 + 16l - 20. Let f be w(14). Suppose 15x = fx - 126. What is the remainder when (x/(-27))/(-1) - (-89)/3 is divided by 5? 4 Let h be ((-4 - -3)/(-1))/(3/(-138)). Let q = 108 + h. Calculate the remainder when q is divided by 3/210 - 2. 10 What is the remainder when 493 is divided by (-25 + 23)/(4/(-968))? 9 Let o = 2584 + -2598. Let r(f) = -6 - 4f - 14 - 2. Calculate the remainder when r(o) is divided by 9. 7 Let r be (-188)/(-14) + 264/462. Suppose 0 = 7p + rp - 588. Suppose 3f - 113 = 298. Calculate the remainder when f is divided by p. 25 Let o be 25-5 - (-48)/(-8). Let q = 163 + o. Calculate the remainder when q is divided by 17. 15 Let h be (4 + -4)/(-7)(-2)/4. Let l = 9 + 2. Suppose -6t + lt - 405 = h. Calculate the remainder when t is divided by 28. 25 Suppose -54t + 16 = -50t. Suppose -13z + 16z = k - 77, -2z = -tk + 338. Calculate the remainder when k is divided by 26. 8 Let r(s) = -27s + 43. Let h be r(-9). Suppose -5m - 17m + h = 0. Calculate the remainder when 1 - 2 - -1 - -48 is divided by m. 9 Calculate the remainder when 548 is divided by (-1946)/(-32) - (-744)/3968. 60 Let x(r) = -13 - 18r - 13 + 51r. Let v be x(4). Let k = 125 - v. Calculate the remainder when 48 is divided by k. 10 Let f = 73 + -59. Suppose 7p = -4p + 704. What is the remainder when p is divided by f? 8 Suppose 9h + 144 = -0h. Calculate the remainder when 24 is divided by -4 - h/4 - -5. 4 Let o(a) = -9 + a*3 - 17a*2 - 3a*2 + a - 14a*3 + 14a*3. What is the remainder when 46 is divided by o(20)? 2 Let d = -1542 + 683. Let b = 1047 + d. Suppose 4h - 26 = 5t - 80, 0 = t - 3h - 13. What is the remainder when b is divided by t? 8 Let x(p) = -13p - 195. Let c(v) = 2v + 2. Let z(d) = -c(d) - x(d). Calculate the remainder when 19 is divided by z(-17). 1 Suppose 4l - 112 = 18l. Let x(h) = 2h2 + 8h - 8. Calculate the remainder when x(l) is divided by 20. 16 Suppose 2x = -3m + 432, 101 + 43 = m - 2x. Let l = 199 - m. What is the remainder when l is divided by 5? 0 Let t(h) be the first derivative of -27h*2/2 - 6h + 9. Let v be t(-1). Calculate the remainder when 56 is divided by 7/v + (-29)/(-3). 6 Let h = -3761 + 3765. Calculate the remainder when 365 is divided by h. 1 What is the remainder when (6 + -14 - -879) + 11 is divided by 26? 24 Let p(s) = 21s2 - 105s - 794. What is the remainder when p(-7) is divided by 18? 16 Let p(l) = -22l + 235. Suppose -5o = -3o - 3j - 101, -o = 4j - 34. Let f = o - 11. Calculate the remainder when p(6) is divided by f. 33 Suppose -2y - 93 = -993. What is the remainder when y is divided by 147? 9 Suppose y + y = -4i + 330, -75 = -i - 3y. Let c = -62 + 72. Suppose 3o + c - 1 = 0, 2s + o - 41 = 0. What is the remainder when i is divided by s? 18 Suppose -3t + 2j + 2114 = 0, 2t + 7j - 1384 = 2*j. Calcu	{ "pile_set_name": "DM Mathematics" }
16-4 + (54/12 - 4). Let i(m) be the second derivative of -5/12m*4 - 5m*3 + wm*2 - 24m + 0. Solve i(q) = 0 for q. -7, 1 Let i(g) be the first derivative of g*4/6 + 11g*3/9 + 13g*2/6 + 4g/3 + 366. Factor i(x). (x + 1)(x + 4)(2x + 1)/3 Let k be 168/(-48)(-6)/360. Let z(j) be the second derivative of -1/24j3 - 1/4j*2 + kj*6 - 19/80j*5 + 0 + 5/16j*4 - 7j. Factor z(p). (p - 1)*3(7p + 2)/4 Let a(b) be the first derivative of 2b*5/15 - 14b*4 + 110b*3/3 - 82b*2/3 - 2384. What is h in a(h) = 0? 0, 1, 82 Let l(c) be the first derivative of 1/10c*4 + 0c - 17/5c2 - 32/15c*3 - 170. Factor l(d). 2d(d - 17)(d + 1)/5 Let y(i) = -2i2 + 2i - 2. Let j(l) = 7l2 + 2806l + 1976842. Let g(w) = j(w) + 3y(w). Factor g(r). (r + 1406)2 Let y(n) = -n3 - 9n*2 - 2n - 20. Let a be y(-9). Let w be (a/(20/6))/(73/(-365)). Factor -72h3 - 4h*w + 106h*2 + 18h*4 - 44h - 10h - 2h + 8. 2(h - 2)(h - 1)*2(9h - 2) Let t(l) be the second derivative of -27l*5/100 - 17l*4/10 + 436l*3/5 - 288l*2/5 - 2286l. Suppose t(x) = 0. Calculate x. -12, 2/9, 8 Suppose 0h2 + 5900h + 2h2 - 5768h + 2178 = 0. Calculate h. -33 Let b(m) be the third derivative of 11m2 + 1078/45m*5 + 0m + 0 + 8/9m3 + 343/10m*7 + 56/9m*4 + 686/15m*6. Suppose b(i) = 0. What is i? -2/7, -2/21 Let u(g) = -9g*4 + 1297g*3 + 2901g*2 + 1899g + 292. Let x(c) = -c*3 + 2c*2 - c. Let r(i) = -2u(i) - 6x(i). Determine h, given that r(h) = 0. -1, -2/9, 146 Let z(i) be the second derivative of 1/50i*6 - 3/20i*4 + 1/5i*2 + 1/100i*5 + 1/10i*3 - 103i + 0. Factor z(u). (u - 1)*2(u + 2)(3u + 1)/5 Suppose 42294u - 24 = 42288u. Factor 4/3p2 + 8/3p - u. 4(p - 1)(p + 3)/3 Factor 54 + 2/5k3 + 222/5k - 46/5k2. 2(k - 15)(k - 9)(k + 1)/5 Let k(r) = -17r - 93. Let m be k(-6). Suppose -5q + z = -15, -8q - 4z = -mq - 16. Find p, given that 0 + 1/6p*q - 1/3p - 1/2p2 + 0p*3 = 0. -1, 0, 2 Let o = -1120703 + 1120713. Solve -11/3x + o + 1/3x2 = 0 for x. 5, 6 Let w(a) = 1605a*2 - 1590a + 9. Let b(k) = -7k - 1. Let s(f) = 3b(f) + w(f). Determine p so that s(p) = 0. 2/535, 1 Let h = -30883/279 + 3459/31. Find v, given that hv + 0 + 4/9v*3 + 4/3v*2 = 0. -2, -1, 0 Suppose -9x + 177 = -165. Suppose -2g = 4t - x, 5t - 31 = g - 2g. Let -3o2 + 7o*2 - 16 + go + o = 0. What is o? -4, 1 Suppose -8g = 13682 - 2490. Let s = -1396 - g. Suppose -3/7u*2 + 0u*s + 0 + 2/7u + 1/7u4 = 0. Calculate u. -2, 0, 1 Find v, given that 0 - 2/3v*3 - 2/3v*4 + 16/3v*2 + 8v = 0. -2, 0, 3 Let u be 1 + (-1)/(3/18-2). Determine y so that 5 - 947y*4 - 10y*2 - 936y*u + 1888y*4 = 0. -1, 1 Let j(d) = 4d*3 + 44d*2 + 81d + 36. Let u(b) = -2b3 - 22b*2 - 40b - 18. Let k = 98 - 100. Let h(y) = kj(y) - 5u(y). Factor h(w). 2(w + 1)2(w + 9) Let q(n) be the third derivative of n8/840 - n7/420 - n6/45 + n5/15 + 25n3/3 - 3n*2 - 13n. Let m(b) be the first derivative of q(b). Factor m(r). 2r(r - 2)(r - 1)(r + 2) Suppose -3/4z3 + 87/2 - 351/4z + 45z2 = 0. Calculate z. 1, 58 Suppose 1/4g*3 - 1587/2 - 13g*2 + 805/4g = 0. Calculate g. 6, 23 Let v(m) be the second derivative of -m9/7560 - m8/240 + m7/84 - m4/4 - m*2 - 119m. Let p(f) be the third derivative of v(f). Solve p(d) = 0. -15, 0, 1 Let c(a) be the third derivative of -5a8/336 + 3a*7/14 - 5a*6/8 + 7a*5/12 + 700a*2. Factor c(u). -5u*2(u - 7)(u - 1)2 Suppose 0 = 4i + 48, 0 = -2f + 4i + 6i - 5i + 76. Factor -2/3g2 + fg + 26/3. -2(g - 13)(g + 1)/3 Let r(m) be the first derivative of m*2 - 1/6m*4 + 13 + 15m + 1/20m5 - 1/6m*3. Let q(k) be the first derivative of r(k). Factor q(n). (n - 2)(n - 1)(n + 1) Let n(g) = g3 - 1132g*2 + 75983g + 588826. Let m(z) = 2z3 - 1132z*2 + 75982z + 588784. Let y(s) = 3m(s) - 2n(s). Factor y(o). 4(o - 145)2(o + 7) Let b(m) be the second derivative of -m*7/210 - 2m6/75 - m5/20 - m*4/30 + m - 332. Let b(i) = 0. Calculate i. -2, -1, 0 Let g be ((-33)/((-726)/308))/(6 + 5). Let gb*2 + 6/11 + 16/11b + 4/11b3 = 0. Calculate b. -3/2, -1 Let b(m) be the first derivative of -m4/126 + 4m*3/7 - 108m*2/7 + 91m - 141. Let j(y) be the first derivative of b(y). Suppose j(g) = 0. What is g? 18 Let b(l) be the first derivative of -16 + 2/5l5 + 0l*2 + 0l*3 + 1/15l*6 + 2/3l*4 - 21l. Let c(t) be the first derivative of b(t). Factor c(i). 2i2(i + 2)*2 Let c(n) be the third derivative of 19n - 25/33n3 + 1/660n*6 - 1/30n5 - n2 + 35/132n4 + 0. Determine g so that c(g) = 0. 1, 5 Let k(i) be the second derivative of 1/4i*4 - 1/14i*7 + 6i*2 - 4 + 4i*3 + 6i - 21/20i5 - 1/2i*6. Find l such that k(l) = 0. -2, -1, 1 Suppose -5c = -5r - 95, 2r = -2c + 7r + 53. Factor 18 - 2 - 9q2 - cq + 7q2. -2(q - 1)(q + 8) Determine m, given that -1060m*3 + 1160 - 2920m - 5/2m5 + 2660m*2 + 325/2m4 = 0. 1, 2, 58 Let s(l) be the third derivative of l6/30 + 88l5/15 - 271l*4/6 + 364l*3/3 + 101l*2 - l. Factor s(b). 4(b - 2)(b - 1)(b + 91) Let f(a) = 10a2 - 3a - 1. Let z be f(-2). Suppose 48b - zb = 12. Factor bn2 + 2n*2 + 16n - 7n2 - 16 - 3n*2. -4(n - 2)*2 Let o(w) be the third derivative of 3w*6/10 + 632w*5/15 + 682w*4/3 + 544w*3/3 + 1195w*2. Factor o(m). 4(m + 2)(m + 68)(9m + 2) Let m be 64/612 + 38(-21)/(-6783). Factor 10/9p - mp*2 + 4/3. -2(p - 6)(p + 1)/9 Suppose 24s + 37 = 2s + 169. Let p(y) be the first derivative of 0y*4 + 6/25y*5 - 1/10y*s - 2/5y*3 + 0y + 3/10y2 + 22. Factor p(b). -3b(b - 1)3(b + 1)/5 Let w be (-73)/(-5) - (-52)/130. Let y(x) = x*2 - 22x + 105. Let h be y(w). Factor 1/2q3 + h + 1/2q + q*2. q(q + 1)*2/2 Suppose -t - t = -10. Let x(u) = 200u + 402. Let r be x(-2). Find b such that -6b + 3b - b*r - tb - 3b2 = 0. -2, 0 Let p be -3 + ((-39)/(-15) - -1). Let y be 8460/144 + -59 - 41/(-20). Factor -p - yu*3 + 9/5u + 3/5u2. -3(u - 1)(u + 1)(3u - 1)/5 Suppose -4u = -20, 0 = 5h - 7u + 4u + 15. Let k(g) = g3 - g2 - 2g + 2. Let c be k(h). Factor y - 8y2 + 0y*c - 3y. -2y(4y + 1) Let 1387v*2 + 210 + 44v*4 - 167v*2 - 34v*4 - 15v*5 + 369v*3 + 101v*3 + 739v + 246v = 0. What is v? -3, -2, -1, -1/3, 7 Let t(x) be the third derivative of x2 - 26 + 0x*4 + 1/420x*7 + 0x + 0x3 - 1/240x*6 - 1/60x5. Factor t(z). z2(z - 2)(z + 1)/2 Factor 131220 - 810r + 5/4r*2. 5(r - 324)*2/4 Suppose -13i + 22i = 27. Find h, given that 16h*3 - 40h*2 + 36hi - h4 - 20h - 77h*3 - 4h*4 = 0. -2, -1, 0 Let n(t) = -12t*2 - 1. Let r(w) = 70w*2 + 114w + 122. Let k(c) = 6n(c) + r(c). Factor k(j). -2(j - 58)(j + 1) Let y(d) be the first derivative of -d4/24 + d3/2 - 7d*2/6 + 14365. Solve y(t) = 0. 0, 2, 7 Let x(l) be the first derivative of -37/35l*5 + 84 + 3l*4 + 0l + 8/7l2 - 68/21l*3 + 5/42l6. Suppose x(d) = 0. What is d? 0, 2/5, 1, 2, 4 Let s(d) be the second derivative of d4/30 - 194d3 + 423405d*2 + 6d - 75. Solve s(h) = 0 for h. 1455 Let a(g) be the first derivative of -50g - 98 - 5/3g*3 + 35/2g*2. Let a(r) = 0. What is r? 2, 5 Suppose 28a - 27a = -85a + 172. Let y(v) be the second derivative of -1/6v4 - 4v*a - 4/3v*3 + 0 - 37v. Factor y(o). -2(o + 2)2 Let a(g) = -2g*2 - 2585g - 90466. Let p be a(-36). Factor -84/11l + 0 - 2/11l*p. -2l(l + 42)/11 Let p be (-931)/(-28) + -37 + 6 + 0. Find v, given that v4 + pv*3 + 0 + 1/4v + 3/2v2 = 0. -1, -1/4, 0 Let r = -223 - -227. Suppose -10m*3 + 10m - 255m4 + 123m*4 - 4 + 10m*2 + 126m*r = 0. Calculate m. -2, -1, 1/3, 1 What is n in -18n - 36n2 + 42n + 74n3 + 144 - 6n*4 - 200n*2 = 0? -2/3, 1, 6 Suppose -3w = 13w - 192. Factor 4b*5 - 64b - 388b4 - wb - 36 + 432b4 - 8b*2 + 72b*3. 4(b - 1)(b + 1)3(b + 9) Factor -2764/9 + 1378/9c + 2/9c*2. 2(c - 2)(c + 691)/9 Find y such that 106/15y*3 - 34/15y - 22/5y2 + 0 - 2/5y4 = 0. -1/3, 0, 1, 17 Let g(x) be the third derivative of -x5/12 + 565x4/12 + 2300x3/3 - x2 + 2302x. Factor g(j). -5(j - 230)*(j +	{ "pile_set_name": "DM Mathematics" }
+ 29b2 - 8b*2 + 66 - 5b + 72b2 - 126 wrt b? 186 Let m(v) be the first derivative of -34v*2 - 56/3v*3 + 59 + 0v. What is the second derivative of m(h) wrt h? -112 Suppose 0u = 4u, 0 = -3y + 4u + 12. Let l = 6 - 2. Find the second derivative of 17n + 19n*4 - 3n*l - yn wrt n. 192n2 What is the third derivative of 90 - 98l*2 + 19l*2 - 7961l*6 + 18l*2 + 33l*2 + 24l*2 wrt l? -955320l*3 Let a be 0 + -3 + 5 - (2 - 2). Suppose 3j = x + 2, -aj = 5x + j - 26. Differentiate 0y4 - 9y*4 + 25 - 4 - 13y*x wrt y. -88y*3 Let y = -53 + 71. What is the third derivative of -8w*6 + 24 - 2w2 - 64 + w3 + 25 + y wrt w? -960w3 + 6 Suppose -5u + 13u - 32 = 0. Suppose 3x - ul - 96 = 0, -3x - 2l + l + 111 = 0. Find the third derivative of xv*4 - 8v*2 - 8v*2 - 7v*4 wrt v. 696v Let u = 460 + -456. Find the second derivative of -3 - 2b2 + 4 - u - 2058b + 2065b wrt b. -4 Let g(h) be the third derivative of -7h6/60 - h5/60 - 3h4/8 - 797h*3/2 - 451h*2 + h. What is the first derivative of g(f) wrt f? -42f*2 - 2f - 9 Let u = -132 - -134. Find the second derivative of 119z2 - 236z*2 - 11z*3 + 2 + 41z + 118zu wrt z. -66z + 2 Let t = 86 + -44. Suppose -38 = 2i - t. Differentiate -6w*2 - 7 + 19w*i - 7 with respect to w. 26w Let a(i) be the second derivative of 19i2 + 59/12i*4 + 1 + 20i + 0i3. Differentiate a(j) wrt j. 118j Let k(n) be the first derivative of -117/2n2 + 179 + 0n + 0n4 - 1/5n*5 - 80/3n*3. What is the second derivative of k(o) wrt o? -12o*2 - 160 Let p = -191 + 257. Find the first derivative of -68g + 1 + 16 - p - 56 wrt g. -68 What is the third derivative of 2856v6 - 5399v*2 - 495v*6 - 7281v*2 wrt v? 283320v*3 What is the derivative of -426 - 319s*3 - 473 - 63 - 2249s*3 - 194s*3 wrt s? -8286s*2 Let p(y) = 1123y*3 - 6y*2 + 846. Let c(o) = 1121o*3 - 8o*2 + 845. Let z(h) = -3c(h) + 4p(h). Differentiate z(f) with respect to f. 3387f*2 Find the third derivative of -10755k*2 + 10k - 4k - 6k - 624k3 + 3876k2 wrt k. -3744 Let x(u) be the first derivative of u4/2 - 8u3/3 - 130u*2 + 2164u + 11186. Differentiate x(m) wrt m. 6m2 - 16m - 260 Let b(w) be the first derivative of 569w4/4 - 56w*3 - 3553. What is the third derivative of b(u) wrt u? 3414 Let o = 12305 - 12303. Let b = -1 + 2. Differentiate -7 + 38c*o + b - 24 + 5 with respect to c. 76c Let w(r) = 3663r - 1342. Let u(i) = -1838i + 671. Let p(x) = -7u(x) - 4w(x). Differentiate p(k) with respect to k. -1786 Find the second derivative of 149516n - 2416 - 299032n - 2345n2 + 149517n wrt n. -4690 Let b = -26427 - -26430. Let v(h) be the first derivative of 0hb + 0h*2 - 17 - 39/4h*4 + 29h. What is the derivative of v(i) wrt i? -117i2 Let x = -382 - -385. Differentiate -19 + 136 + 2841h*x - 2869h*3 wrt h. -84h*2 Let o(i) be the first derivative of 0i*5 + 0i*3 - 5/2i*2 + 49 + 0i*4 - 125/6i*6 - 3i. What is the second derivative of o(d) wrt d? -2500d3 What is the first derivative of 2351h + 727 + 398h + 1103h + 187 + 102 wrt h? 3852 Let v(j) = -6j - 20. Let a = -71 - -65. Let b be v(a). Find the third derivative of -6w*2 + 3w*2 - bw*4 - 6w*2 wrt w. -384w Suppose 13t - 31 = -5. What is the derivative of -15 - y2 - 23 + 2 + ty*2 wrt y? 2y Let d = 295 - 206. What is the third derivative of -44l2 - 43l*2 + 13l*4 + dl*2 + 2l*5 + 1 + 0 wrt l? 120l*2 + 312l Let z(k) = 294k - 72. Let l(y) = -99y + 24. Let j(q) = -14q + 89. Let m be j(6). Let a(i) = mz(i) + 16l(i). Find the first derivative of a(d) wrt d. -114 Let k(a) = -398a*3 + 3a - 1132. Let u(l) = 796l3 - 7l + 2267. Let f(q) = -5k(q) - 2u(q). What is the derivative of f(h) wrt h? 1194h2 - 1 Let r = 242 - 229. What is the first derivative of 42 + 24 - r + 25q wrt q? 25 Let r be 2/4 + 11/2. Let x(y) = y*3 - 2y*2 + 7y + 12. Let d be x(r). Find the second derivative of 198k2 - 8k + 9k3 - 9k - dk2 wrt k. 54k Let q(v) be the second derivative of -17/6v4 + 0v*2 - 11/6v*3 + 0 + 58v. What is the second derivative of q(i) wrt i? -68 Let b(k) be the third derivative of 11k8/4 - 15k5/4 - k3/6 - 7k2 - 102. Find the third derivative of b(m) wrt m. 55440m2 Let y be 5 + (-20)/(4 - -1). Let r(n) = -n2 + n - 1. Let q(w) = -172w2 + 261w - 6. Let o(h) = yq(h) - 6r(h). Find the second derivative of o(j) wrt j. -332 Let h(l) = -l*3 + 7l*2 + 10l - 63. Let v be h(7). Find the third derivative of vq4 - 8q*4 + 142q*5 + 7q*4 + 2q*3 - 195q*2 - 6q*4 wrt q. 8520q*2 + 12 What is the first derivative of 1193 - 2060k + 353 + 1704 - 248 + 230 wrt k? -2060 Let h be ((-52)/(-16))/((-1)/20). Let i = h + 71. What is the third derivative of 24w2 + 13w*2 + 22w*6 + 5w*i wrt w? 3240w*3 What is the second derivative of 15 + 720m*2 - 52 + 1544m*2 + 21 + 25 + 47m wrt m? 4528 Suppose -3h + 5 = -9z + 5z, 4z - 19 = -5h. Differentiate 99 - 69 - 2c*h + 29c*4 - 45 - 30 wrt c. 116c*3 - 6c*2 Let y(i) be the second derivative of 68i7/21 + i5/20 - 5i4/3 + 41i*2/2 - 569i - 3. Find the third derivative of y(q) wrt q. 8160q2 + 6 Let c(a) = 633a*3 + 6a*2 - 255a - 1. Let p(x) = -950x3 - 9x*2 + 380x + 1. Let o(g) = -8c(g) - 5p(g). Find the second derivative of o(m) wrt m. -1884m - 6 Let c(s) be the first derivative of -11s*6/24 + 13s*5/20 - 47s*2 + 14. Let k(t) be the second derivative of c(t). Find the third derivative of k(i) wrt i. -330 Let f(u) be the first derivative of 0u*2 - 8/3u*3 - 46 - 35u + 1/2u4. Find the first derivative of f(b) wrt b. 6b*2 - 16b Suppose -58207 = -3p - z + 16761, 5p = -5z + 124960. Differentiate -25f*4 + 24988f*3 - 26 - pf*3 wrt f. -100f*3 Let y(j) = 2j. Let u(i) = -142i - 209. Suppose 6 = 3a - b, -a + 3b = -9 + 15. Let q(m) = ay(m) + u(m). What is the first derivative of q(k) wrt k? -136 Find the third derivative of 214w2 - 29w*4 - 12w*4 - 411w*5 + 418w*5 + 736w*2 wrt w. 420w*2 - 984w Let u(t) be the second derivative of -1047t5/20 - 2025t*2 + 1162t. Differentiate u(r) wrt r. -3141r2 Let h(d) be the third derivative of 1/60d*6 - d + 31/6d*3 + 0d5 + 0 - d2 + 0d4 + 1/3d*7. What is the first derivative of h(z) wrt z? 280z*3 + 6z*2 Let l(v) = 50v*2 - 54. Suppose -4y + 9 = -11. Let i(k) = 99k2 - 108. Let d(c) = yl(c) - 2i(c). Differentiate d(m) with respect to m. 104m Find the second derivative of 15789d4 - 27035d*4 - 1296d + 14228d4 wrt d. 35784d*2 Let z = 170 - 145. Differentiate 10s*4 - 29s*4 - zs*4 - 7 + 3 with respect to s. -176s*3 Let m be (-99)/(-15) + 21/(-35). Find the third derivative of 56z*2 + 28z*6 - 72z*m - 31z*6 wrt z. -9000z*3 Let u be (-4)/7 + 450/126. Find the second derivative of -7z*3 + 2 + u + 7z - 3 + 10z3 + 9z*3 wrt z. 72z Let u be 3 - 1/(0 - -1). Suppose 2717s - 2708s = 45. What is the second derivative of -uo - 3o - 48o5 + 33o*s wrt o? -300o*3 Let d be -30((-7)/(-7))/((-10)/32). Let i = -51 + d. Find the first derivative of 26a4 + 51 - 102 + i wrt a. 104a*3 Let r = -1071 + 1073. Let o(p) be the second derivative of 0p*3 - 3p*r + 0p*4 - 11/20p*5 + 0 - 6p. Find the first derivative of o(y) wrt y. -33y2 Let s(b) = -b3 - 7b*2 - 2b - 13. Let r be s(-7). Let i be (-1 - 1 - -2)/r. What is the third derivative of 6f6 + if*2 - 31f2 + f6 - 2f6 wrt f? 600f*3 Let z be 1/(14/6) + 2656/581. What is the second derivative of -9j - 4j + 3j*4 + 26jz - 2 - j4 - 5j4 + 25j*5 wrt j? 1020j*3 - 36j*2 Let o be -7 + 2/35 + (-29889)/(-4305). Let z(j) be the third derivative of -3j*3 - 10j*2 + oj + 0 + 1/2j4. Find the first derivative of z(u) wrt u. 12 Let t(q) be the first derivative of 2609q*6/2 - 125q3/3 + q2/2 - 9q + 8821. What is the third derivative of t(i) wrt i? 469620i*2 Find the third derivative of -124v*2 - 4051v*3 - 1128v*3 - 149v*2 + 223v*3 wrt v. -29736 Let i(m) = -3 + 13 + 12 + 30m + 16 + 14 + 60m2. Let s(d) = 5d + 1. Let v(y) = 2i(y) - 12s(y). What is the first derivative	{ "pile_set_name": "DM Mathematics" }
2.700971 decades to millennia. 0.02700971 How many minutes are there in 7/4 of a hour? 105 Convert 423.9339 months to decades. 3.5327825 How many minutes are there in fourty-five eighths of a week? 56700 What is 17/2 of a day in hours? 204 How many millilitres are there in 48/5 of a litre? 9600 What is fourty-six fifths of a century in decades? 92 How many minutes are there in 1/6 of a hour? 10 How many millilitres are there in 70279.66l? 70279660 What is 21/5 of a meter in millimeters? 4200 How many nanometers are there in nine tenths of a micrometer? 900 How many kilograms are there in 140950.9ug? 0.0001409509 How many nanograms are there in 1/64 of a milligram? 15625 How many months are there in 3/8 of a decade? 45 What is twenty-nine fifths of a litre in millilitres? 5800 What is six fifths of a kilogram in grams? 1200 How many years are there in 3/40 of a millennium? 75 Convert 56.18825us to nanoseconds. 56188.25 What is 5557583.43 minutes in weeks? 551.3475625 What is 27/2 of a meter in millimeters? 13500 What is 1/5 of a day in minutes? 288 How many millilitres are there in 2/125 of a litre? 16 What is 2402.41 decades in months? 288289.2 How many decades are there in 37/5 of a century? 74 What is 43/6 of a century in months? 8600 Convert 2347.046mg to nanograms. 2347046000 What is 4409.892ml in litres? 4.409892 What is three fifths of a decade in years? 6 What is 79226.61 years in months? 950719.32 What is 6.463391 millilitres in litres? 0.006463391 How many seconds are there in twenty-eight ninths of a hour? 11200 How many centuries are there in twenty-one halves of a millennium? 105 How many meters are there in three fifths of a kilometer? 600 What is twelve sevenths of a week in days? 12 Convert 5.015633 microseconds to nanoseconds. 5015.633 Convert 209154.9 micrometers to nanometers. 209154900 What is 3/8 of a microgram in nanograms? 375 Convert 493.7847um to kilometers. 0.0000004937847 What is 1134.74088 milliseconds in weeks? 0.000001876225 How many micrometers are there in 46020.36 millimeters? 46020360 What is fifteen quarters of a centimeter in micrometers? 37500 How many months are there in 11/8 of a century? 1650 What is 9/10 of a litre in millilitres? 900 What is 61.775 millilitres in litres? 0.061775 What is 1/4 of a litre in millilitres? 250 How many litres are there in 15598.53ml? 15.59853 What is 3/40 of a litre in millilitres? 75 What is 6282.96 kilograms in nanograms? 6282960000000000 How many milligrams are there in 11/2 of a gram? 5500 What is 1/4 of a week in hours? 42 Convert 24.471kg to tonnes. 0.024471 How many nanograms are there in 0.4560327mg? 456032.7 How many micrograms are there in 0.2454235 nanograms? 0.0002454235 Convert 57.9374 tonnes to micrograms. 57937400000000 What is 771425.5kg in micrograms? 771425500000000 How many milligrams are there in 93.34187 tonnes? 93341870000 What is 6/25 of a millennium in decades? 24 What is 61707.24 years in millennia? 61.70724 How many millilitres are there in 3/8 of a litre? 375 How many years are there in 31/2 of a decade? 155 What is 81.9434ml in litres? 0.0819434 What is 77/2 of a micrometer in nanometers? 38500 What is one twentieth of a gram in milligrams? 50 Convert 13762.31 weeks to microseconds. 8323445088000000 What is 9/10 of a decade in months? 108 How many millilitres are there in 1/4 of a litre? 250 How many years are there in 2955.1671 months? 246.263925 How many nanograms are there in 17/4 of a microgram? 4250 What is 0.2706351 centuries in years? 27.06351 What is 8868.437ml in litres? 8.868437 How many micrometers are there in seven sixteenths of a centimeter? 4375 What is 1060.859 decades in millennia? 10.60859 What is one sixth of a day in hours? 4 How many seconds are there in 18/5 of a hour? 12960 How many micrometers are there in 21378.42nm? 21.37842 How many litres are there in 734.3968ml? 0.7343968 What is thirty-four fifths of a litre in millilitres? 6800 Convert 0.4501407ml to litres. 0.0004501407 How many nanoseconds are there in 12/25 of a microsecond? 480 How many litres are there in 3.804294ml? 0.003804294 What is thirty-three fifths of a millimeter in micrometers? 6600 How many centuries are there in 0.2588329 millennia? 2.588329 How many millilitres are there in 3/25 of a litre? 120 What is 5.066981ml in litres? 0.005066981 How many years are there in 22863.534 months? 1905.2945 What is 15.606783 months in years? 1.30056525 How many months are there in 10/3 of a decade? 400 Convert 782.1913 centuries to months. 938629.56 What is 6/25 of a kilogram in grams? 240 Convert 61516.3 millennia to decades. 6151630 Convert 355091.7kg to milligrams. 355091700000 How many months are there in twenty-one halves of a year? 126 How many milligrams are there in eleven halves of a gram? 5500 How many meters are there in 367.7773 millimeters? 0.3677773 Convert 204.6565 weeks to microseconds. 123776251200000 How many meters are there in five quarters of a kilometer? 1250 How many millennia are there in 7.68237 centuries? 0.768237 How many nanometers are there in 52.32603 centimeters? 523260300 How many decades are there in 1/5 of a century? 2 What is 1463.884nm in micrometers? 1.463884 What is 346496.6 days in minutes? 498955104 What is seven quarters of a decade in months? 210 Convert 668.0508 months to decades. 5.56709 How many nanograms are there in 15/4 of a microgram? 3750 How many millennia are there in 109.03764 months? 0.00908647 What is twenty-five quarters of a century in years? 625 What is 0.9947274 decades in millennia? 0.009947274 What is twenty-one fifths of a tonne in kilograms? 4200 What is thirty-one halves of a millennium in years? 15500 How many decades are there in 2282.8647 months? 19.0238725 What is nine sixteenths of a kilometer in centimeters? 56250 Convert 0.4609456um to centimeters. 0.00004609456 How many months are there in seven quarters of a century? 2100 How many millilitres are there in 33.93419l? 33934.19 How many nanoseconds are there in 3.245927 minutes? 194755620000 What is 558918.9 nanograms in kilograms? 0.0000005589189 Convert 3114.407kg to milligrams. 3114407000 What is 26/5 of a litre in millilitres? 5200 What is seven halves of a week in hours? 588 Convert 22.25599 millilitres to litres. 0.02225599 Convert 0.8516457km to nanometers. 851645700000 How many hours are there in 35798.742ns? 0.000000009944095 Convert 1.924011 grams to milligrams. 1924.011 How many milliseconds are there in seventeen halves of a second? 8500 What is 0.4290067kg in grams? 429.0067 What is 34.84556l in millilitres? 34845.56 How many months are there in seven thirds of a year? 28 How many minutes are there in twenty-five quarters of a hour? 375 How many nanometers are there in 3/50 of a micrometer? 60 What is three tenths of a century in decades? 3 Convert 0.540275 centuries to months. 648.33 What is 97.09717mg in tonnes? 0.00000009709717 How many grams are there in thirteen quarters of a kilogram? 3250 How many millilitres are there in 443.7568l? 443756.8 Convert 5.086513 tonnes to milligrams. 5086513000 What is 50.35574mg in tonnes? 0.00000005035574 What is 0.9532077 millilitres in litres? 0.0009532077 How many weeks are there in 164444099.4 seconds? 271.8983125 How many millennia are there in 30.90923 centuries? 3.090923 What is 16.37811 millilitres in litres? 0.01637811 Convert 0.8969079 hours to minutes. 53.814474 How many millilitres are there in 55/4 of a litre? 13750 How many months are there in 73.62991 millennia? 883558.92 Convert 0.6797599ng to kilograms. 0.0000000000006797599 Convert 1631.097ml to litres. 1.631097 What is 58.82715 milligrams in micrograms? 58827.15 How many microseconds are there in 8.931458 minutes? 535887480 How many litres are there in 680022.7 millilitres? 680.0227 How many months are there in twenty-five halves of a year? 150 What is 97274.03mm in micrometers? 97274030 How many millimeters are there in 3/10 of a meter? 300 How many tonnes are there in 7632.01 nanograms? 0.00000000000763201 What is 11/8 of a microgram in nanograms? 1375 What is 43.82483 millennia in centuries? 438.2483 What is 9/10 of a gram in milligrams? 900 How many decades are there in seventy-seven halves of a century? 385 What is 6	{ "pile_set_name": "DM Mathematics" }
Let r(x) be the second derivative of -x*4/6 - 4x*3/3 - x. What is -8k(u) + r(u)? -2u2 Suppose 0 = -3z + 25 - 10. Let g(d) = -7d2 - 9d - 5. Let m(h) = -4h2 - 5h - 3. Let t = -7 + 4. Give tg(j) + zm(j). j*2 + 2j Let v(n) = 1. Let c(g) = -7g + 4. Calculate c(t) - 4v(t). -7t Let y(t) = t2 + t - 1. Let a = 37 - 39. Let g(x) = -x + 2. What is ay(n) - 2g(n)? -2n*2 - 2 Suppose m - 3t - 10 + 0 = 0, 0 = 2m + 5t - 20. Let b(u) = 4u3 + 22u*2 - 10u. Let r(g) = -g*3 - 7g*2 + 3g. Determine mr(j) + 3b(j). 2j3 - 4j*2 Suppose 3p + 4n - 34 = 0, -p - p - 5n + 25 = 0. Let l(m) = m. Let z(g) = 3g. Calculate pl(h) - 2z(h). 4h Let n(r) = -7r3 + 4r*2 - 5r - 6. Let o(x) = -8x3 + 5x*2 - 6x - 7. What is 6n(t) - 5o(t)? -2t3 - t2 - 1 Let s(i) = -2i*3 + 19i*2 + 2i. Let a(j) = -3j3 + 18j*2 + 2j. Give 3a(d) - 4s(d). -d*3 - 22d*2 - 2d Let n(g) = g*3 + 4g2 + 2. Let z(w) = w2. Suppose -4m - 5 = -9m. Give mn(p) - 2z(p). p*3 + 2p*2 + 2 Let d(m) = 4m*2 + 4m - 5. Let a be (-11 - -4) + 3 + 0. Let t(n) = -5n2 + 0n*2 + 6 - 2n - 3n. Calculate ad(i) - 3t(i). -i2 - i + 2 Let z(l) = l + 0 + 1 + 0l. Let h(t) be the second derivative of -5/2t2 + 2t - 4/3t3 + 0. Determine h(g) + 6z(g). -2g + 1 Let m(j) = -6j + 12. Let r(t) = 5t - 12. Determine 4m(h) + 5r(h). h - 12 Let k(y) = 2y*2 + 4y - 1. Let h(b) = 2b2 + 5b - 2. Let g = 29 - 31. Determine gh(r) + 3k(r). 2r2 + 2r + 1 Let w(t) = 16t2 - 40t - 10. Let y(z) = -3z2 + 8z + 2. Give -2w(r) - 11y(r). r*2 - 8r - 2 Let w(a) = -1. Let l(v) = -3v - 7. Let t(z) = -z + 12. Let i be t(11). What is il(k) - 6w(k)? -3k - 1 Let k(x) = -8x2 + x - 13. Let r(f) = -9f*2 - 14. Let t(u) = 7k(u) - 6r(u). Let o(y) = y2 - 3y + 3. Give -5o(j) - 2t(j). -j*2 + j - 1 Let o(w) = -11w*3 - 14w - 3. Let b(s) = -7s3 - 9s - 2. What is -8b(j) + 5o(j)? j*3 + 2j + 1 Let u(i) = -2. Let c = -5 - -3. Let s(t) = t*2 - t + 6. What is cs(f) - 6u(f)? -2f*2 + 2f Let n(s) = -126s3 + 27s + 27. Let h(i) = 23i3 - 5i - 5. Determine -27h(v) - 5n(v). 9v3 Suppose -2y + 1 + 3 = 0, 0 = -4a - y - 14. Let t(p) = 3p*3 - 2p*2 + 5p. Let j(b) = -2b3 + 2b*2 - 4b. What is aj(z) - 3t(z)? -z*3 - 2z*2 + z Let w be -9 + 1 + (4 - 0). Let l(c) = -5c - 3. Let n(f) = -6f - 10. Let i(z) = -1. Let y(t) = 6i(t) - n(t). What is wl(r) - 3y(r)? 2r Let a(h) = -2h - 2h + 5 - 3. Let v(w) = -23w + 1. Let m(g) = -15g + 1. Let i(r) = -8m(r) + 5v(r). Determine -3a(u) - 2i(u). 2u Let j(d) = 20d2 - 8d - 11. Let f = -138 + 130. Let o(n) = -7n2 + 3n + 4. Determine fo(r) - 3j(r). -4r2 + 1 Let c(x) = -7x*2 + 3x + 1. Let z(q) = q*2 - q. Give -2c(g) - 6z(g). 8g*2 - 2 Let x(r) = 5r*3 - 5r*2 + 6r - 9. Suppose -40 = -z - 46. Let d(n) = 14n3 - 14n*2 + 17n - 26. What is zd(k) + 17x(k)? k3 - k2 + 3 Let c(j) = -4j2 - 5j - j*2 - 1 + 0. Let l(p) be the first derivative of -4p*3/3 - 2p*2 - p - 2. Give 3c(i) - 4l(i). i2 + i + 1 Let l be 11/55 - 22/10. Let k be 15/6(0 - l). Let n(m) = -3m2 + 5m - 5. Let z(o) = 5o2 - 8o + 8. Calculate kz(b) + 8n(b). b*2 Let f(c) = 3c*2 - 9c + 3. Let n(a) = 5a2 - 14a + 5. Calculate 8f(q) - 5n(q). -q*2 - 2q - 1 Let d(t) = -3t + 1. Let g(p) = p3 + p + 6. Let w be g(0). Suppose 5b = m - 28, -2m + 0b = -3b - 35. Let h(a) = 6a - 2. What is md(j) + wh(j)? -3j + 1 Let g(y) = 6y + 7. Let p(b) = -4b - b - 3 + 17 + 4b. Let h be p(0). Let z(u) = -u - 1. Give hz(f) + 2g(f). -2f Let h(k) = 15k. Let b(j) = 676j. Calculate -2b(p) + 91h(p). 13p Let k(v) = -1. Let c(t) = t*2 + 3. What is 4c(l) + 14k(l)? 4l*2 - 2 Let w(o) = -2o - 2. Let p(s) = -s - 2. Let d(i) = -8i + 2. Let l be d(3). Let x = l - -19. What is xp(q) + 2w(q)? -q + 2 Let t(g) = g. Let x(c) = -69c. Determine -46t(b) - x(b). 23b Let x(s) = -s*3 - 4s*2 - s + 1. Let c be x(-3). Let k(z) = z. Let m(f) = 6f - 5. Let r(l) = 7l - 6. Let h(d) = -6m(d) + 5r(d). What is ck(y) - 4h(y)? -y Let w(j) = j3 + 2j*2 - 2. Let k(b) = 3b*3 + 5b*2 + b - 5. Calculate 2k(r) - 5w(r). r3 + 2r Let z(r) = -3. Let a(w) = -w*3 - 4. What is 3a(p) - 4z(p)? -3p*3 Let x(c) = -3c - 1. Let j(p) = 1. Give -4j(y) + x(y). -3y - 5 Suppose -5b + 44 = -b. Let z(n) = -6n*2 + 11n. Let d(l) = l*2 - 2l. What is bd(g) + 2z(g)? -g*2 Let i(l) = 13l*2 - 7l - 9. Let k(t) = 6t2 - 3t - 4. What is 4i(r) - 9k(r)? -2r2 - r Let y(l) = l3 + 3l2 - l - 6. Let k(h) = h3 + 2h2 - 5. Give 3k(i) - 2y(i). i3 + 2i - 3 Let m(o) = -o2. Let n(q) = -q3 - 5q2 - 2q. Suppose -2x + 18 = x. Suppose 3b = -3s - 0s, -3s - x = -3b. Calculate bn(y) - 4m(y). -y3 - y2 - 2y Suppose 17q - 18 = -137. Let v(l) = -2l - 1. Let a(u) = 2u + 1. Give qa(d) - 6v(d). -2d - 1 Let b(y) = -y - 1. Let u(d) = -2d - 3. Let p be 0 - 1/((-11)/(-3) - 4). Give pu(l) - 5b(l). -l - 4 Let g(t) = -22t3 + 22t*2 + 16. Let y(b) = 7b*3 - 7b*2 - 5. Let h be (-32)/(-3)(-3)/2. Determine hy(i) - 5g(i). -2i3 + 2i*2 Let z(n) = 1. Let t(r) = -2r - 35. Calculate -t(s) - 6z(s). 2s + 29 Let o(f) = 135f3 - 35. Let i(l) = -8l*3 + 2. What is 35i(t) + 2o(t)? -10t*3 Let c = -1 - -3. Suppose -ct = 2t + 36. Let b(y) = -4y - 7. Let n(h) be the second derivative of -h*3/3 - 3h*2/2 - 2h. Calculate tn(g) + 4b(g). 2g - 1 Let l(q) = -q3 - q2 - 1. Let y(z) = 8z*3 + 6z*2 + z + 7. Calculate -14l(k) - 2y(k). -2k*3 + 2k*2 - 2k Let s(u) = -4u3 - 6u*2 - 4u + 3. Let c(t) = -11t3 - 17t*2 - 11t + 8. Determine -6c(l) + 17s(l). -2l3 - 2l + 3 Let d(q) = -q - 26 + 26. Let a(k) = 5k. Give -a(s) - 6d(s). s Let q(v) = 1 + 3v - 4v + 2v + 1. Let x(h) = -2h + h + 3 + 3h. Suppose 0 = 5u - 2i + 21, -5i + 6 = -3i. Calculate uq(b) + 2x(b). b Suppose -22 + 2 = 5x. Let r(n) = -4 - 54n2 + 48n*2 - 4n + 4n - 3n. Let u(a) = 7a2 + 4a + 5. Determine xu(k) - 5r(k). 2k2 - k Suppose 3d + 0l - 17 = l, -d + 7 = -l. Suppose 3u = -2u + 20. Let g(s) = 2s - 4. Let k(h) = -2h + 3. Determine dk(p) + ug(p). -2p - 1 Let l(b) = -21b2 + 7. Let a(q) = -22q*2 + 6. Give -5a(y) + 4l(y). 26y2 - 2 Let k(w) be the second derivative of -w4/3 + w*3/3 + 5w. Let n(b) = 11b - 14b*2 + 2b*2 - 11b*2. Determine -34k(d) + 6n(d). -2d*2 - 2d Let p(f) = -16f2 - 5f - 11. Let x(u) = u*3 - 12u*2 - 13u - 4. Let b be x(13). Let r(t) = 3t2 + t + 2. Calculate bp(d) - 22r(d). -2d*2 - 2d Let j(f) = 6. Let o(p) = 1. Let u(i) = -j(i) + 5o(i). Let b(h) = h2 + h + 4. Determine -2b(t) - 7u(t). -2t*2 - 2t - 1 Let n(m) = 8m3 + m2 + 2. Let t(y) = 5y*2 + 9y - 8. Let u be t(1). Let x(d) = 17d3 + 2d*2 + 4. Determine ux(q) - 13n(q). -2q3 - q2 - 2 Let o(r) = -2r3 - r2 - r. Let w(u) = -u3 + 1. Let a(x) = -o(x) + w(x). Let g(h) = -4h*3 - 7h*2 - 7h - 6. Determine -6a(m) - g(m). -2m3 + m2 + m Let j(q) = -q. Let z(v) = 3v + 1. Give -5j(x) - z(x). 2x - 1 Let q(a) = a2 + 3a + 4. Let l(p) = 8p - 8p - 7 - p*2 - 5p. Determine -3l(t) - 5q(t). -2t2 + 1 Let j(n) = 144n*3 - 33n*2 + 33n. Let x(q) = -9q3 + 2q*2 - 2q. Give 6j(l) + 99x(l). -27l3 Let s(w) = -4w*3 - 5w*2 + 3w - 3. Suppose -4o + 3o + 5g - 12 = 0, -2g = 2o - 12. Let f(i) = 3i*3 + 4i*2 - 2i + 2. What is of(x) + 2s(x)? x*3 + 2x*2 Let y(l) = 11l + 2. Let o(d) = -6d - 1. Calculate -7o(b) - 4y(b). -2b - 1 Let f(y) = 11y2 + 9y - 1. Let r(c) = 21c2 + 17c - 2. Determine 11f(m) - 6r(m). -5m2 - 3m + 1 Suppose 0c = -3c + 3. Let y be 1 - (-3 + c + 0). Let b(m) = -2m + 1. Let i(q) be the second derivative of -5q3/6 + q2 + 4q. What is yi(u) - 7b(u)? -u - 1 Let u(i) be the first derivative of -i4/4 + i3/3 - 3i*2/2 + 5i - 17. Let k(a) = -3a3 + 3a*2 - 8a + 14. Give -3k(b) + 8u(b). b3 - b2 - 2 Let w(f) = 5f2 + 4f - 6. Let p(i) = 4i2 + 3i - 5. Suppose 5m + 37 = 12. Give mw(l) + 6p(l). -l2 - 2l Let y(x) = 13x2 - 13x + 13. Let v(c) = 7c2 - 6c + 6. Calculate 13v(s) - 6y(s). 13s2 Let w(p) = 45p**2 - 12. Let	{ "pile_set_name": "DM Mathematics" }
5 Two letters picked without replacement from {b: 1, o: 2, h: 1, x: 3}. Give prob of picking 1 h and 1 b. 1/21 What is prob of picking 1 a and 1 i when two letters picked without replacement from {i: 1, n: 7, a: 2, x: 2}? 1/33 Calculate prob of picking 1 j and 1 q when two letters picked without replacement from {q: 1, r: 7, a: 4, j: 8}. 4/95 What is prob of picking 1 z and 1 t when two letters picked without replacement from {t: 2, m: 1, u: 3, z: 1, w: 3}? 2/45 What is prob of picking 3 c when three letters picked without replacement from {k: 3, z: 1, g: 2, b: 7, c: 1}? 0 Two letters picked without replacement from {y: 1, d: 2, r: 1, h: 1, p: 1, x: 1}. Give prob of picking 1 x and 1 p. 1/21 Two letters picked without replacement from {j: 9, d: 9}. What is prob of picking 2 d? 4/17 Three letters picked without replacement from aiuqai. Give prob of picking 1 u and 2 i. 1/20 Three letters picked without replacement from assnsssfsssaasaa. Give prob of picking 1 a, 1 s, and 1 n. 9/112 What is prob of picking 1 v and 2 t when three letters picked without replacement from {t: 6, v: 3, s: 2, n: 3, d: 6}? 3/76 Calculate prob of picking 1 e and 2 r when three letters picked without replacement from {e: 1, w: 7, r: 1}. 0 Four letters picked without replacement from qqqqqq. Give prob of picking 4 q. 1 Two letters picked without replacement from {u: 2, k: 7, l: 2}. What is prob of picking 2 l? 1/55 Calculate prob of picking 4 w when four letters picked without replacement from {y: 1, t: 2, k: 2, w: 6}. 1/22 Three letters picked without replacement from {z: 1, r: 1, a: 7}. What is prob of picking 1 z and 2 a? 1/4 Two letters picked without replacement from nohhndn. Give prob of picking 1 h and 1 n. 2/7 Calculate prob of picking 1 k and 1 i when two letters picked without replacement from {t: 3, s: 12, i: 3, k: 2}. 3/95 Calculate prob of picking 1 t and 1 h when two letters picked without replacement from hnthhtth. 3/7 Three letters picked without replacement from {j: 2, w: 9, f: 1, z: 3, u: 2}. Give prob of picking 2 u and 1 z. 3/680 Four letters picked without replacement from xbxqbxtqyqtqltyb. What is prob of picking 2 b, 1 l, and 1 q? 3/455 Four letters picked without replacement from dddddoddddddddddddod. What is prob of picking 2 o and 2 d? 3/95 Calculate prob of picking 2 v when two letters picked without replacement from {n: 2, v: 9}. 36/55 What is prob of picking 3 k and 1 o when four letters picked without replacement from qqqqkqqqkokckoqoko? 2/153 Four letters picked without replacement from zrrrzrrzrr. What is prob of picking 3 z and 1 r? 1/30 What is prob of picking 1 f, 1 r, and 1 t when three letters picked without replacement from {f: 3, v: 1, r: 1, t: 3, w: 1, p: 5}? 9/364 What is prob of picking 1 p and 2 h when three letters picked without replacement from {h: 17, p: 3}? 34/95 Two letters picked without replacement from pew. What is prob of picking 1 e and 1 w? 1/3 What is prob of picking 1 r and 1 l when two letters picked without replacement from {o: 1, a: 2, z: 1, l: 1, r: 5, y: 5}? 1/21 Two letters picked without replacement from {b: 1, d: 6, u: 8}. What is prob of picking 1 u and 1 d? 16/35 Three letters picked without replacement from tttgtjvtvk. Give prob of picking 1 g, 1 t, and 1 j. 1/24 Three letters picked without replacement from qddyqddqqdyqqqqdq. Give prob of picking 2 d and 1 y. 3/68 Four letters picked without replacement from {c: 3, z: 2, t: 1, e: 1}. Give prob of picking 2 z and 2 c. 3/35 What is prob of picking 1 v and 1 k when two letters picked without replacement from jjkjjjjjjjjkjkkjjvkj? 1/38 What is prob of picking 1 c, 2 k, and 1 m when four letters picked without replacement from kmkcckk? 12/35 Three letters picked without replacement from hhbm. Give prob of picking 1 m and 2 h. 1/4 Two letters picked without replacement from hhzhvvv. What is prob of picking 1 z and 1 v? 1/7 Three letters picked without replacement from {e: 9, r: 7}. Give prob of picking 1 e and 2 r. 27/80 Calculate prob of picking 1 v, 1 y, and 1 x when three letters picked without replacement from xxyzzxnvnzz. 1/55 Four letters picked without replacement from {a: 2, k: 2, x: 11}. Give prob of picking 2 k and 2 x. 11/273 What is prob of picking 3 k when three letters picked without replacement from ukuuukuuukyky? 2/143 Calculate prob of picking 1 p, 2 c, and 1 q when four letters picked without replacement from cpqqqpcqq. 5/63 Two letters picked without replacement from arlhlws. What is prob of picking 1 w and 1 r? 1/21 Calculate prob of picking 2 o when two letters picked without replacement from {o: 7, c: 1}. 3/4 Four letters picked without replacement from nzxzxnxanaaxzaxz. Give prob of picking 1 z, 2 n, and 1 x. 3/91 Four letters picked without replacement from iyyyyiiibiiiiyy. What is prob of picking 2 i and 2 y? 4/13 Calculate prob of picking 1 f, 1 t, and 2 h when four letters picked without replacement from {p: 12, t: 1, h: 3, f: 4}. 4/1615 Calculate prob of picking 2 j when two letters picked without replacement from sjjyjsssjvssssjjjrj. 28/171 Calculate prob of picking 2 c when two letters picked without replacement from vchvsvvsccevvsshv. 3/136 What is prob of picking 1 n, 1 l, and 2 i when four letters picked without replacement from {l: 1, i: 2, e: 1, q: 2, n: 1}? 1/35 Four letters picked without replacement from {i: 5, b: 3, k: 3}. What is prob of picking 1 k and 3 i? 1/11 Three letters picked without replacement from {t: 5, o: 5}. Give prob of picking 1 t and 2 o. 5/12 Calculate prob of picking 2 e when two letters picked without replacement from {e: 11, o: 2, p: 6}. 55/171 Two letters picked without replacement from owwwooootwwmwwomwo. Give prob of picking 1 t and 1 w. 8/153 Three letters picked without replacement from {p: 2, f: 1, h: 1, s: 1, c: 3, d: 3}. What is prob of picking 1 s, 1 d, and 1 h? 1/55 Two letters picked without replacement from {v: 1, a: 2, p: 1}. Give prob of picking 1 v and 1 p. 1/6 Four letters picked without replacement from ihhhihhhhi. Give prob of picking 2 i and 2 h. 3/10 Calculate prob of picking 4 w when four letters picked without replacement from uwwwuuuuuwww. 1/33 Calculate prob of picking 3 p and 1 v when four letters picked without replacement from ppvpppppvpppppvvpp. 364/765 Two letters picked without replacement from {h: 3, t: 3, k: 2, j: 6, m: 1}. What is prob of picking 2 h? 1/35 Four letters picked without replacement from tzsllyz. Give prob of picking 2 s, 1 l, and 1 y. 0 Calculate prob of picking 2 d when two letters picked without replacement from {d: 7, o: 9}. 7/40 Calculate prob of picking 2 z and 1 w when three letters picked without replacement from zwwnzwwnn. 1/21 Calculate prob of picking 2 s when two letters picked without replacement from {s: 2, y: 4, v: 11, e: 2}. 1/171 What is prob of picking 1 r, 1 k, and 1 n when three letters picked without replacement from {k: 1, i: 2, n: 13, u: 3, r: 1}? 13/1140 Four letters picked without replacement from brrbbrbrbbrrrbrbbrr. What is prob of picking 1 r and 3 b? 70/323 Four letters picked without replacement from pypypppy. Give prob of picking 4 p. 1/14 Three letters picked without replacement from {y: 2, v: 10, b: 6}. What is prob of picking 2 v and 1 b? 45/136 Calculate prob of picking 1 m and 1 h when two letters picked without replacement from {z: 2, m: 1, q: 1, h: 1}. 1/10 Two letters picked without replacement from {q: 2, p: 2}. Give prob of picking 2 q. 1/6 Four letters picked without replacement from {t: 1, a: 2, c: 4}. What is prob of picking 1 c, 1 t, and 2 a? 4/35 Two letters picked without replacement from {f: 5, u: 2, q: 3}. What is prob of picking 1 u and 1 f? 2/9 Two letters picked without replacement from whmrwwhwhhw. Give prob of picking 1 h and 1 r. 4/55 Three letters picked without replacement from gfafgpifigggzpp. What is prob of picking 1 g and 2 a? 0 What is prob of picking 1 e and 1 c when two letters picked without replacement from edmdmmcddevmmmmmdm? 2/153 Two letters picked without replacement from {v: 8, y: 3, z: 2, j: 2}. Give prob of picking 1 y and 1 v. 8/35 What is prob of picking 3 d when three letters picked without replacement from dddddeddddddddddddd? 16/19 Four letters picked without replacement fr	{ "pile_set_name": "DM Mathematics" }
2, q: 1, x: 1}. 0 What is prob of picking 1 t and 2 r when three letters picked without replacement from cryccccrtcttt? 2/143 Two letters picked without replacement from qqqqqmmqqmqq. Give prob of picking 1 m and 1 q. 9/22 What is prob of picking 1 i and 1 s when two letters picked without replacement from {s: 3, i: 7, z: 8}? 7/51 Four letters picked without replacement from rspseersepeeeerepppf. Give prob of picking 1 r, 2 s, and 1 f. 3/1615 Calculate prob of picking 1 q and 2 n when three letters picked without replacement from {d: 5, q: 3, n: 4}. 9/110 Four letters picked without replacement from {e: 1, u: 1, o: 2, n: 6, x: 3}. What is prob of picking 1 x, 1 n, and 2 o? 18/715 Three letters picked without replacement from pnjpivnnnnnvpjnttnnt. Give prob of picking 1 t, 1 i, and 1 v. 1/190 Calculate prob of picking 1 o and 1 z when two letters picked without replacement from {z: 12, o: 6}. 8/17 Three letters picked without replacement from {c: 7, f: 2}. Give prob of picking 3 f. 0 Calculate prob of picking 2 x when two letters picked without replacement from {r: 2, x: 1, z: 1}. 0 Three letters picked without replacement from {a: 2, b: 3, f: 4, s: 4, w: 1, y: 6}. What is prob of picking 2 f and 1 w? 1/190 Two letters picked without replacement from {l: 5, i: 3}. Give prob of picking 2 l. 5/14 Two letters picked without replacement from {c: 5, o: 3}. Give prob of picking 2 o. 3/28 Calculate prob of picking 1 z and 1 v when two letters picked without replacement from {l: 1, v: 1, c: 3, z: 1, x: 1}. 1/21 Four letters picked without replacement from cccccccccocccccocccc. What is prob of picking 2 o and 2 c? 3/95 Calculate prob of picking 1 k, 1 g, and 1 l when three letters picked without replacement from {y: 2, g: 1, k: 2, o: 1, l: 1, w: 1}. 1/28 Calculate prob of picking 4 o when four letters picked without replacement from {d: 5, y: 2, o: 4}. 1/330 Four letters picked without replacement from tlmceexlcllllelxc. What is prob of picking 1 t, 1 e, 1 l, and 1 x? 3/170 Four letters picked without replacement from {a: 3, y: 2, q: 4, f: 1, t: 2}. Give prob of picking 2 t and 2 y. 1/495 What is prob of picking 1 b and 1 n when two letters picked without replacement from lnxezbeenlzl? 1/33 Calculate prob of picking 2 n and 2 t when four letters picked without replacement from tnttdtttnt. 1/10 Two letters picked without replacement from teetttepppettttep. Give prob of picking 2 e. 5/68 Two letters picked without replacement from yyxi. Give prob of picking 1 x and 1 y. 1/3 Three letters picked without replacement from nttgntgtnttgtgggt. Give prob of picking 2 g and 1 t. 3/17 What is prob of picking 3 l and 1 a when four letters picked without replacement from {w: 8, a: 6, l: 3}? 3/1190 Calculate prob of picking 1 i and 2 e when three letters picked without replacement from {p: 4, e: 3, d: 4, q: 1, i: 1}. 3/286 What is prob of picking 1 q, 1 d, and 1 c when three letters picked without replacement from dddxudddddudcdddddqu? 7/570 Calculate prob of picking 1 o and 2 r when three letters picked without replacement from prqrprrrrqrqrorxrro. 110/969 Calculate prob of picking 1 g and 1 p when two letters picked without replacement from {p: 1, g: 9, e: 3, f: 1}. 9/91 Two letters picked without replacement from hrvrgg. What is prob of picking 1 h and 1 v? 1/15 What is prob of picking 1 s and 1 j when two letters picked without replacement from jsjj? 1/2 Calculate prob of picking 4 v when four letters picked without replacement from hrvvvhvvrrrrrr. 5/1001 Two letters picked without replacement from {i: 1, m: 1, h: 2, j: 3}. Give prob of picking 1 h and 1 j. 2/7 What is prob of picking 1 q and 3 c when four letters picked without replacement from ccqcqqccccqcqcccccc? 455/969 What is prob of picking 2 p when two letters picked without replacement from {b: 4, p: 16}? 12/19 What is prob of picking 1 a and 1 n when two letters picked without replacement from {v: 3, u: 3, n: 1, a: 2, r: 1, s: 1}? 2/55 Four letters picked without replacement from {o: 3, u: 5, y: 3, s: 2}. Give prob of picking 1 u, 1 y, and 2 o. 9/143 Calculate prob of picking 2 u when two letters picked without replacement from {v: 1, u: 6, l: 7, o: 3}. 15/136 Two letters picked without replacement from {t: 5, a: 5}. Give prob of picking 1 t and 1 a. 5/9 Four letters picked without replacement from zqmmzzlzlzzqmzz. What is prob of picking 2 m, 1 l, and 1 q? 4/455 What is prob of picking 1 v, 1 t, 1 g, and 1 r when four letters picked without replacement from {r: 12, g: 3, x: 1, t: 2, v: 1}? 6/323 Calculate prob of picking 1 z and 2 u when three letters picked without replacement from {u: 2, z: 16}. 1/51 Two letters picked without replacement from {k: 3, a: 5}. Give prob of picking 1 a and 1 k. 15/28 Calculate prob of picking 1 x and 1 q when two letters picked without replacement from {d: 1, x: 2, q: 2, h: 1}. 4/15 Two letters picked without replacement from {n: 1, l: 4, c: 2, y: 5, p: 2, x: 1}. What is prob of picking 1 c and 1 p? 4/105 What is prob of picking 1 u, 1 x, and 1 k when three letters picked without replacement from xuxxxxxxkxxxxxxxxxx? 1/57 Two letters picked without replacement from nhhhhhahhhhhhhb. Give prob of picking 1 b and 1 n. 1/105 Four letters picked without replacement from wwnflkwnln. What is prob of picking 2 l, 1 k, and 1 f? 1/210 What is prob of picking 2 j when two letters picked without replacement from {o: 10, j: 2}? 1/66 Two letters picked without replacement from {r: 2, o: 1}. Give prob of picking 2 r. 1/3 What is prob of picking 1 f and 2 c when three letters picked without replacement from {c: 7, f: 1, r: 2}? 7/40 Four letters picked without replacement from gdqggggggqgggg. What is prob of picking 1 q, 2 g, and 1 d? 10/91 Four letters picked without replacement from kqmkmmm. What is prob of picking 1 m, 2 k, and 1 q? 4/35 Three letters picked without replacement from {t: 5, y: 5, b: 1, x: 1, e: 3}. Give prob of picking 3 e. 1/455 Two letters picked without replacement from ggssggsssgsssssggss. Give prob of picking 2 s. 22/57 Calculate prob of picking 1 e, 1 s, and 1 h when three letters picked without replacement from eshee. 3/10 Three letters picked without replacement from qqbcttqtqqcq. Give prob of picking 1 t, 1 b, and 1 c. 3/110 Two letters picked without replacement from {z: 1, s: 1, q: 2, m: 1, h: 2, b: 1}. Give prob of picking 1 s and 1 z. 1/28 Two letters picked without replacement from {d: 3, e: 4, c: 1, m: 1, l: 2, u: 1}. What is prob of picking 2 e? 1/11 Three letters picked without replacement from wzooodooddwdz. What is prob of picking 2 w and 1 z? 1/143 What is prob of picking 2 b when two letters picked without replacement from bbbbbb? 1 Three letters picked without replacement from {h: 2, j: 1, l: 1, x: 7, p: 5}. What is prob of picking 1 l and 2 x? 3/80 Four letters picked without replacement from svssssvvsvs. What is prob of picking 4 v? 1/330 Four letters picked without replacement from xmjjjxmmxjmmmm. Give prob of picking 3 m and 1 x. 15/143 Three letters picked without replacement from {x: 9, r: 1, p: 2, d: 2}. What is prob of picking 1 d and 2 x? 18/91 What is prob of picking 4 d when four letters picked without replacement from {d: 4, t: 4, w: 2, k: 4}? 1/1001 What is prob of picking 1 g and 1 k when two letters picked without replacement from ygkgykkxygxzxyy? 3/35 Two letters picked without replacement from njudujnd. Give prob of picking 2 d. 1/28 Calculate prob of picking 1 n, 1 h, and 1 d when three letters picked without replacement from nknhnhhhhhdnh. 14/143 What is prob of picking 1 x and 2 r when three letters picked without replacement from {r: 6, o: 1, x: 1, s: 2, u: 2}? 3/44 What is prob of picking 1 z and 2 e when three letters picked without replacement from {e: 3, z: 8}? 8/55 Four letters picked without replacement from dwwnaknndnnd. Give prob of picking 4 n. 1/99 What is prob of picking 1 i, 1 g, and 1 p when three letters picked without replacement from {g: 5, p: 9, o: 2, i: 2}? 15/136 Two letters picked without replacement from ooooooopopooppopoo. What is prob of picking 2 o? 26/51 Calculate prob of picking 4 a when four letters picked without replacement from {a: 4}. 1 What is prob of picking 1 f and 2 j when three letters	{ "pile_set_name": "DM Mathematics" }
0 divided by -27937. -40/27937 What is 9484 divided by 9484? 1 860340 divided by 71695 12 What is -380 divided by -4902? 10/129 What is 364582 divided by 2? 182291 Calculate -1555609 divided by -3. 1555609/3 Divide -262325 by -1. 262325 Divide 30 by 1053. 10/351 Divide 21888 by 29. 21888/29 What is 914298 divided by -66? -13853 Calculate 129505 divided by -25901. -5 4425298 divided by 2194 2017 What is -11545 divided by -6? 11545/6 Calculate -88185 divided by 17637. -5 Divide 2047344 by 341224. 6 -34360 divided by 3436 -10 -21083 divided by -21083 1 Calculate 3200 divided by -50. -64 108060 divided by 5 21612 Divide -7553 by 53. -7553/53 What is 595332 divided by -6? -99222 What is 338 divided by -13? -26 160242 divided by 4 80121/2 What is 465365 divided by -93073? -5 Calculate -213786 divided by -333. 642 Calculate -2063236 divided by 62. -33278 Calculate -1205 divided by 7. -1205/7 224460 divided by -129 -1740 Calculate 178634 divided by 1. 178634 What is -82270 divided by -16454? 5 What is 20853 divided by 6951? 3 85961 divided by 67 1283 -67726 divided by 3 -67726/3 16893 divided by 1 16893 What is -246950 divided by 55? -4490 -160578 divided by 3 -53526 What is 495535 divided by -99107? -5 -238520 divided by 5963 -40 Calculate -11 divided by -9805. 11/9805 101838 divided by -1543 -66 Divide 4627 by -68. -4627/68 Calculate 31 divided by 144585. 31/144585 Calculate 2 divided by -31649. -2/31649 Calculate -9415 divided by 1883. -5 9281 divided by -30 -9281/30 What is -4 divided by -271669? 4/271669 Divide -2806700 by -850. 3302 What is 755700 divided by 5? 151140 Calculate -16862 divided by -7. 16862/7 Divide 21375 by -19. -1125 Divide 36807 by -4. -36807/4 Divide -1864257 by 4. -1864257/4 Divide 634691 by 8. 634691/8 What is 1134 divided by -21? -54 Calculate -2636 divided by -98. 1318/49 What is 5382 divided by 1794? 3 Divide -7586 by -61. 7586/61 -1069128 divided by -6 178188 What is -315595 divided by 355? -889 100 divided by 90 10/9 Divide 449 by 115. 449/115 7471 divided by 31 241 What is 624 divided by -77? -624/77 Calculate 39 divided by -10471. -39/10471 2316750 divided by 77225 30 What is 74294 divided by -121? -614 Divide -15640 by 136. -115 What is 1 divided by -39634? -1/39634 51064 divided by -3928 -13 Calculate -65966 divided by 7. -65966/7 Divide 580 by 363. 580/363 0 divided by 10050 0 15 divided by 47978 15/47978 Divide -9 by 5802. -3/1934 What is 2 divided by -14865? -2/14865 -2 divided by -56665 2/56665 What is 5607 divided by -12? -1869/4 Divide 248 by -59. -248/59 What is 427986 divided by 213993? 2 11 divided by 15565 1/1415 Divide 6 by 15586. 3/7793 Calculate -180645 divided by -3. 60215 Calculate 409745 divided by 35. 11707 What is -642 divided by 49? -642/49 Divide 4 by 27. 4/27 Calculate -7501 divided by 27. -7501/27 Divide -4892 by -2446. 2 Divide 3326 by -427. -3326/427 What is -19 divided by -9123? 19/9123 -7 divided by 2750 -7/2750 1517800 divided by -303560 -5 What is 96798 divided by 3723? 26 What is 4479139 divided by -7? -639877 Calculate -1481 divided by 36. -1481/36 -882973 divided by -31 28483 -120 divided by 87 -40/29 Calculate 44261 divided by -44261. -1 Divide 170896 by -4. -42724 Divide -165956 by -7. 23708 Calculate 53823 divided by -5. -53823/5 6 divided by 1454743 6/1454743 Divide 36275 by -7255. -5 Divide -108500 by -62. 1750 What is -14 divided by -4619? 14/4619 Divide -46526 by -541. 86 What is -1755658 divided by -34? 51637 What is 15 divided by -3498? -5/1166 -27435 divided by 31 -885 Divide -288353 by -7033. 41 Calculate -722624 divided by 16. -45164 -5 divided by -35901 5/35901 Calculate -54675 divided by -25. 2187 Divide 422 by -213. -422/213 3 divided by 68927 3/68927 What is -817648 divided by 15724? -52 113 divided by -65 -113/65 What is -647 divided by -306? 647/306 What is 354915 divided by 27? 13145 What is -812660 divided by 203165? -4 63924 divided by -6 -10654 Calculate -6392 divided by 3196. -2 Divide -370441 by -1. 370441 10 divided by -223512 -5/111756 Calculate -1 divided by 1311. -1/1311 What is 0 divided by 23392? 0 394060 divided by 23180 17 -19998 divided by 3333 -6 14652 divided by 444 33 751 divided by -5304 -751/5304 -1205180 divided by -241036 5 2 divided by -15321 -2/15321 Divide -1 by 14160. -1/14160 0 divided by -7006 0 What is 60140 divided by -4? -15035 Divide -46608 by 1. -46608 -4 divided by -19151 4/19151 Calculate 257028 divided by 85676. 3 What is 714960 divided by -238320? -3 Divide -3719 by -3. 3719/3 Divide 895 by -31. -895/31 82498 divided by 494 167 What is -21182 divided by 119? -178 893490 divided by -13 -68730 356322 divided by 6 59387 Divide -2 by -792374. 1/396187 436567 divided by 1 436567 -895452 divided by 223863 -4 Calculate -7932 divided by -26. 3966/13 What is -9024 divided by -64? 141 14540 divided by 6 7270/3 2 divided by -130311 -2/130311 -600455 divided by -120091 5 Calculate 644319 divided by 1. 644319 What is 1084 divided by 1989? 1084/1989 Divide -5532 by 1383. -4 -1154208 divided by 104928 -11 Calculate 0 divided by 277398. 0 -94653 divided by -2 94653/2 Calculate -1 divided by -10872. 1/10872 169330 divided by -574 -295 What is -41064 divided by 177? -232 What is 3140 divided by -1716? -785/429 Calculate 868995 divided by 1413. 615 Calculate 502258 divided by -2347. -214 Divide -197 by -862. 197/862 Divide 30 by -1098. -5/183 -1 divided by 386157 -1/386157 Calculate -5 divided by -119803. 5/119803 -2 divided by -108698 1/54349 Divide 4750 by 34. 2375/17 Calculate 160812 divided by -27. -5956 2717900 divided by -6 -1358950/3 Calculate -81240 divided by -30. 2708 What is -1773690 divided by -6? 295615 What is -3 divided by 573007? -3/573007 Divide -2 by 8061. -2/8061 Calculate -84476 divided by 431. -196 What is -11805 divided by -11805? 1 What is 12525 divided by 2505? 5 Calculate -64844 divided by -16211. 4 Calculate -5544546 divided by -98. 56577 What is 2 divided by 41951? 2/41951 What is 27784 divided by -13892? -2 -15 divided by 4974 -5/1658 What is -4 divided by -594384? 1/148596 Divide -4407 by -339. 13 Divide 5 by 51766. 5/51766 Divide 283 by 643. 283/643 What is -152737 divided by -12? 152737/12 What is 9016 divided by 28? 322 What is 5 divided by 5938? 5/5938 50640 divided by -40 -1266 What is -6319 divided by 64? -6319/64 3958484 divided by 2 1979242 28219 divided by -5 -28219/5 Calculate 16004 divided by 4. 4001 Calculate 11165 divided by -5. -2233 Divide -108484 by -6. 54242/3 What is 0 divided by 10125? 0 What is -2071206 divided by 345201? -6 Divide 61659 by -61659. -1 3837605 divided by 4 3837605/4 What is -2374 divided by -452? 1187/226 What is 327163 divided by 4? 327163/4 Calculate -153 divided by -248. 153/248 -62 divided by 1300 -31/650 -721044 divided by 120174 -6 0 divided by 494 0 0 divided by 488418 0 What is 0 divided by 16535? 0 Calculate 6324 divided by 372. 17 Calculate 38704 divided by 1. 38704 What is 321 divided by 1131? 107/377 Divide -6166788 by 6. -1027798 -8698 divided by -14 4349/7 What is 1735188 divided by -123942? -14 -636 divided by 33 -212/11 452638 divided by -2 -226319 What is -310414 divided by 310414? -1 What is 29690 divided by -5938? -5 36910 divided by -1 -36910 2 divided by 31323 2/31323 Calculate -4 divided by -49379. 4/49379 What is -1000272 divided by 5496? -182 397602 divided by 6 66267 Calculate -1755588 divided by -585196. 3 826686 divided by -1 -826686 Calculate 13008 divided by -16. -813 -885178 divided by 7 -126454 Divide 4 by -1352. -1/338 Divide 1 by 21960. 1/21960 -22820 divided by -20 1141 Divide 16 by 171918. 8/85959 Divide -71330 by -1. 71330 What is 3727568 divided by 1? 3727568 Divide -4 by -14967. 4/14967 Calculate 4458 divided by -24. -743/4 What is -58388 divided by 2? -29194 Divide 706 by -409. -706/409 Calculate 4 divided by 108274. 2/54137 Divide 823342 by -1. -823342 What is -1212660 divided by -4? 303165 What is -79042 divided by 1? -79042 Divide 80 by -143. -80/143 Divide 106428 by -2172. -49 -212970 divided by -1 212970 What is 1738 divided by -1738? -1 What is 17094 divided by -3? -5698 What is -140 divided by -1338? 70/669 5605 divided by -5 -1121 Calculate -96 divided by 49. -96/49 -103173 divided by -6069 17 Divide 2300 by -100. -23 Divide -2927876 b	{ "pile_set_name": "DM Mathematics" }
4840g4 + 11966730g + 1 wrt g? -1369618080g2 Find the second derivative of 11u*2x*3 - 371927u*2x2 + u2x + 94u*2 - 20ux - 7u + 2x3 - 5 wrt x. 66u*2x - 743854u2 + 12x Differentiate -4df*3 + 42219df + 4579341dv + d + f2v with respect to f. -12df*2 + 42219d + 2fv What is the third derivative of 529123310s6z*2 + 2s*2z*2 - 4s*2z - 2sz*2 - 2108s - 2z2 + 106z wrt s? 63494797200s3z*2 What is the third derivative of 19347591j*3 - 2j*2 + 118j + 20061 wrt j? 116085546 Find the second derivative of -112l2p*2 + 72425l*2p - 3l2 - 6lp2 - 28000lp + 18p*2 wrt l. -224p*2 + 144850p - 6 What is the first derivative of -3m2y - 4m2 - 51my + 12m - 1209y + 16307 wrt y? -3m*2 - 51m - 1209 Differentiate -11186t4 + 382t3 - t2 + 621054802 with respect to t. -44744t3 + 1146t*2 - 2t What is the second derivative of -70op*2u + 4op*2 - 4opu - 2op - 227ou + 35p2u - p*2 + 4pu + 16 wrt p? -140ou + 8o + 70u - 2 Find the third derivative of -97572d*3y2 + d3 - 4613349d2y*2 wrt d. -585432y*2 + 6 What is the third derivative of -61867323g*5 - 57g*2 - 83939g wrt g? -3712039380g2 What is the third derivative of -58c*3q*3 + 1437c*3q*2 - 2c*3q + 316762c2q3 + c2q2 - 2cq2 - 153c - 3q3 - 68q*2 wrt q? -348c*3 + 1900572c*2 - 18 Find the third derivative of 6986063h*4 + 12h*3 + 92142750h*2 - 2h. 167665512h + 72 Find the third derivative of -55803s*4 + 76s*3 + 228s*2 - 258666 wrt s. -1339272s + 456 Find the second derivative of 2g4 - 13954g*3 + 53g*2 - 265g - 14. 24g2 - 83724g + 106 Find the third derivative of -74889617x4 - 2x*2 + 282431584x wrt x. -1797350808x What is the third derivative of 24680951n*3 - 414341n*2 + 6? 148085706 Differentiate -6238622w*3 + 22w*2 + 368020593 with respect to w. -18715866w*2 + 44w What is the second derivative of -51598f4 + 10f*3 - 202f*2 - 2652054f - 14 wrt f? -619176f2 + 60f - 404 What is the third derivative of 3222085u4 + 7u*3 + 3u*2 + 7043625 wrt u? 77330040u + 42 What is the third derivative of 1197721s5 + 12s*2 + 1150396s? 71863260s2 Find the first derivative of 39nu + 449940n + 2u - 1211777 wrt n. 39u + 449940 Find the third derivative of 8g4 + 59598g3 - g2 - g - 539337 wrt g. 192g + 357588 What is the third derivative of 219s*4 + 18951s*3 + 3222176s*2 + 5s - 3? 5256s + 113706 What is the derivative of 393359733a - 116804591? 393359733 Differentiate 122388n3 - 2n*2 + 223n - 101258055 with respect to n. 367164n2 - 4n + 223 What is the first derivative of -72gr - 166845g - 8204r wrt g? -72r - 166845 What is the first derivative of 9a*2w*2 - 4837175aw3 - 123380351w*3 wrt a? 18aw2 - 4837175w3 Find the second derivative of h4 + 2h3 + 739687h*2 - 9880h + 22003. 12h2 + 12h + 1479374 What is the derivative of 111780700v + 58596546 wrt v? 111780700 Find the second derivative of -1830o*2w*3 - 92o*2w + 13875ow*3 + 3ow - 736o + 12w wrt w. -10980o*2w + 83250ow Differentiate 5k2 + 7044430k + 783876357. 10k + 7044430 What is the derivative of 21bkls + 4bkl + 805bks - 296bk + 6bls + 2bl - 3k - 2l - 4 wrt s? 21bkl + 805bk + 6bl Find the third derivative of vw*4 - 31vw3 + 36vw2 + 301060vw + 18w*4 + 15w*3 wrt w. 24vw - 186v + 432w + 90 What is the third derivative of 10700724m*5 + 59935m*2 + 6m - 6? 642043440m2 Find the third derivative of 3o*2r*3 + 39661o*2r*2 - 3o*2r + 3385or*4 + 2or3 - 4 wrt r. 18o*2 + 81240or + 12o What is the second derivative of 7389130m5 - 2m - 952749 wrt m? 147782600m3 Find the third derivative of 1661415r*5 - 77r*3 + 250464082r*2. 99684900r*2 - 462 Find the second derivative of 46924u*2v*5 - 206u*2v3 + u2v - 95u + 2287556v wrt v. 938480u*2v*3 - 1236u*2v What is the third derivative of -2i5 + 48735i*4 - 2i*3 + 11i*2 + 18588i wrt i? -120i2 + 1169640i - 12 What is the second derivative of -73875445f2 + 155880870f? -147750890 What is the third derivative of 435a4r*2 + 3a*4 + 50795a*3 + 14a*2r + 2a2 + 2ar2 - 6601r - 24 wrt a? 10440ar*2 + 72a + 304770 What is the third derivative of 14570750n4 - 17817131n*2 wrt n? 349698000n What is the first derivative of 11439461x2 + 15012679 wrt x? 22878922x What is the third derivative of 1832c3k*3q + 1135c3k*2q - 161c3k + c*3q + 233ck*3q - ck2q - ck - k2q wrt k? 10992c3q + 1398cq Differentiate 63023695b - 16035232 with respect to b. 63023695 What is the second derivative of 5o*3 - 5267128o*2 - 12789964o wrt o? 30o - 10534256 What is the first derivative of 7s*4 - 10s*3 - 104s*2 + 94s - 43027372 wrt s? 28s3 - 30s*2 - 208s + 94 Find the third derivative of 4s3z*3 - 1103159s*3z*2 - 395s*2 + 356sz3 - 2s + 2z2 - 7z - 1 wrt s. 24z3 - 6618954z*2 What is the first derivative of 142i*4 - 37200i*2 + 52869216 wrt i? 568i*3 - 74400i Find the first derivative of -135384i4 - i3 + 4i*2 + 31173818. -541536i*3 - 3i*2 + 8i What is the derivative of -o*3 + 5821814o + 140262400? -3o2 + 5821814 What is the derivative of 4625619jk2z + jkz - 2jz + 40308k2 + 3z - 168 wrt j? 4625619k2z + kz - 2z What is the first derivative of 11432144z4 - 8822411 wrt z? 45728576z*3 What is the second derivative of 1033326865c*2 - 531302806c? 2066653730 What is the second derivative of -60947u3x*2 + 1726u*3x + 2u3 + 15u*2x3 + u2x - 3x - 2 wrt x? -121894u3 + 90u*2x What is the third derivative of 101013800z3 + z2 + 9694z + 2892? 606082800 Find the third derivative of -90i3s - 35268i3 - 4i*2s + is - 576s + 8 wrt i. -540s - 211608 What is the third derivative of 140q*5 - 3750q*4 - 2q*3 + 2q*2 - 13380q - 2? 8400q2 - 90000q - 12 Find the third derivative of -35811627j5 - j2 - 13j - 2560345 wrt j. -2148697620j2 What is the second derivative of -3211408c*3 + 1290595c? -19268448c What is the third derivative of -29410112z*5 + 98273983z*2 wrt z? -1764606720z*2 What is the second derivative of 7d*3w*2 - 184d*3w - 5d2w2 - d2 - 5863d - 50514w*2 wrt w? 14d*3 - 10d*2 - 101028 What is the first derivative of -28491850sw2 + 399199749w*2 wrt s? -28491850w*2 Differentiate -127568563l*3 - 364835292. -382705689l*2 What is the third derivative of 2u*6 - 5679490u*5 + 4u*3 + 40079843u*2 wrt u? 240u*3 - 340769400u*2 + 24 What is the third derivative of -31otw*3 + 13ot - 2ow3 - 2ow2 + 34421tw3 - 45119tw2 wrt w? -186ot - 12o + 206526t Find the third derivative of -16045572g3 + g2 - 5g + 17306 wrt g. -96273432 What is the third derivative of -17h*5 - 7323h*4 - 6657695h*2? -1020h*2 - 175752h What is the third derivative of -d*4z - 276238737d3z - 2d2z + 5d2 - 3dz - 242276z wrt d? -24dz - 1657432422z Find the third derivative of 299888152g*4 - 600g*2 + 14989g. 7197315648g What is the derivative of 17340113g + 5102335 wrt g? 17340113 Find the first derivative of -f*3 + 2f*2 - 13393958f - 45454913 wrt f. -3f2 + 4f - 13393958 What is the second derivative of 39ls*3 - l + 1188s*5 - 20s*2 + 74483s wrt s? 234ls + 23760s3 - 40 Find the first derivative of 39aipq + 31aip - 4ap + 5a + 2iq + i + 80655pq - 12p - 123 wrt q. 39aip + 2i + 80655p Find the second derivative of 32196541b*2 + b - 28911490. 64393082 What is the third derivative of -445068538i*6 - 1205585545i*2? -53408224560i*3 What is the third derivative of 6o*4p + 10o4 + 4o*3p - 1838o3 - 2o*2 - 2o + 8p + 191439 wrt o? 144op + 240o + 24p - 11028 Find the second derivative of 5hk2 + 124hkn*2 - 5hkn + 204hk - 67k3n - 8k2n*2 + 138k*2 - k - 2n*2 wrt k. 10h - 402kn - 16n2 + 276 Differentiate 63824705b*2 - 435292970 wrt b. 127649410b What is the second derivative of -11i3x*3 + 388	{ "pile_set_name": "DM Mathematics" }
t h = 2400 + -497. Let v = h + -1314. What is the hundreds digit of v? 5 Let j(g) be the first derivative of g*7/840 + 53g*4/12 - 5g*3 + 6. Let q(o) be the third derivative of j(o). What is the tens digit of q(0)? 0 Suppose 1027577 = 89c + 203971. What is the thousands digit of c? 9 Suppose -66c + 275 = -77c. Let a(g) = -52g - 295. What is the hundreds digit of a(c)? 0 Let p = -3959 - -15940. What is the units digit of p? 1 Suppose 3i - 26 = -d, 8i + 2d - 2 = 7i. Suppose -2l + 1898 = iy - 6y, 5y + 2l = 2373. What is the units digit of y? 5 Suppose r + 14 = 2w, -92 = 4r + 3w - 2w. Let y(g) = -g*2 - 8g - 7. Let f be y(r). Let t = -210 - f. What is the units digit of t? 5 Suppose 2f - 12232 = -w, 3f - 9460 - 8894 = -3w. What is the tens digit of f? 1 Let v(q) = q3 + 9q2 + q. Let a be v(-9). Let k(s) = -s2 - 10s - 6. Let i be k(a). What is the units digit of 9/i + 52/2? 9 Suppose 4p + i + 1 = 13, -p - 3i = 8. Suppose 3w - 3k = -7k + 3790, 2k + p = 0. What is the tens digit of w? 6 Let p = 7227 - 622. What is the thousands digit of p? 6 Let o(u) be the second derivative of 32/3u*3 + 35u + 0 + 11u2. What is the units digit of o(4)? 8 What is the hundreds digit of -3(-3 + 2) + (-27806)/(-1)? 8 Let q = -8 - -16. Let w(x) be the third derivative of x*4/24 + 2x*3/3 - 284x*2. What is the units digit of w(q)? 2 Let v = 62 + -59. Suppose -vh - 1665 = -8h. What is the units digit of h? 3 Let x = 169 - 160. Suppose -21s = -xs - 2784. What is the hundreds digit of s? 2 What is the units digit of 1110/(-444) - 11631/(-2)? 3 Let l = 99 + -94. Suppose -c - 3u = -118, -5c - 148 + 708 = lu. What is the hundreds digit of c? 1 Suppose -70r + r = -671991. What is the units digit of r? 9 Let v be -46(0 - (-27)/24). Let r = v - -14. What is the units digit of 15/((-585)/6) + (-1211)/r? 3 Let o(q) = 7q - 25. Suppose -32 = -9k + k. Let l be o(k). Suppose -32 = -5c + 3u + 16, lc + 4u = 52. What is the units digit of c? 2 Let w(o) = -16o3 + o2 - 19o - 67. What is the tens digit of w(-3)? 3 Let s(t) = -t3 + 9t*2 - 5t + 2. Let b be s(6). Suppose -83f = -bf - 2262. What is the hundreds digit of f? 7 Let b(u) = 4u3 - 8u*2 + 34u - 15. Suppose -f - 23f + 144 = 0. What is the tens digit of b(f)? 6 Let r be 646/190 + (0 - 4/10). Suppose 3x - f - 19 = 0, 4x + f - 26 = rf. Suppose 791 = 4z + m, -3z - 599 = -xz + 5m. What is the units digit of z? 8 What is the tens digit of (4194 + -9)/3 + 3 - 3? 9 Let w(j) = -11j - 69. Let t be w(15). What is the hundreds digit of t/(-78) - 167(-5 + 0)? 8 Suppose -3w + 5a = -20357, -87a - 33960 = -5w - 85a. What is the units digit of w? 4 Suppose 140 = 5f - 0f. What is the units digit of (1010/(-7))/(-2) - 4/f? 2 Let k = -489 + 492. Suppose h - j + 2j - 1646 = 0, -4943 = -kh + 2j. What is the tens digit of h? 4 Let w(q) = -124q + 1689. What is the thousands digit of w(-47)? 7 Let k = -140 + 90. Let p = k - -53. Suppose 0 = -pf + 182 + 112. What is the units digit of f? 8 Let k(r) = -3r3 + 71r*2 - 34r + 9. What is the tens digit of k(19)? 1 What is the ten thousands digit of 68861(13 - 1837/143)? 1 Suppose -4o - 4x - 1376 = 0, -4x + 1369 = -4o - x. Let y = 837 + o. What is the tens digit of y? 9 Let p = -323 + 67. Let y = p - 5. Let h = -155 - y. What is the units digit of h? 6 Suppose -2m + 2o - 9 = 3, 4m + 60 = -5o. Let q(i) = i3 + 15i*2 + 16i + 11. What is the units digit of q(m)? 1 Let v = 328 - 324. Let o(n) = 9n2 - 8n + 18. What is the hundreds digit of o(v)? 1 Suppose 264q - 159145 = 226q + 255321. What is the tens digit of q? 0 Let n = -930 + 935. Suppose -5d - nv + 9v + 7569 = 0, 5d - 7601 = -4v. What is the tens digit of d? 1 Let n(w) = 2w*2 - 49w - 21. Let o be n(25). Let m be 444/o - 31. Suppose r - m = -4f, 4r - 3f - 321 = 92. What is the tens digit of r? 0 Let v be -2 + 10/(-2) - -1. Let g(r) be the second derivative of r*4/6 - 7r*3/3 - 3r*2/2 - 101r + 9. What is the hundreds digit of g(v)? 1 Let i(n) = -n*2 - 3n + 4. Let f be i(-5). Let k = f - 115. What is the tens digit of 12/16 + k/(-4)? 3 Let t(r) = -5r - 48. Let s be t(-8). Let b be -3 + 8 + 6 + s. Suppose 4z - 12 = 0, -x + 65 = -4z - b. What is the tens digit of x? 8 Let w(u) = 478u*2 - 16u - 204. What is the hundreds digit of w(-8)? 5 Suppose -2y - w + 119218 = 0, -2y = -9w + 7w - 119212. What is the thousands digit of y? 9 What is the units digit of (1 + 249928/42)/(10/18)? 3 Suppose -66c - 167c + 14c + 1377510 = 0. What is the tens digit of c? 9 Let y(s) = s2 - 11s + 9. Let z be y(12). Suppose zw = 26w + 15. Let d(n) = -7n - 1. What is the units digit of d(w)? 0 What is the thousands digit of (-1 + 8/(-2))(-88 - 844)? 4 Let w = 27970 + 5654. What is the ten thousands digit of w? 3 Let u = 59 + -57. Let l be 6u/1824. Suppose -4d - 62 = -2h, -5d + l = 4h - 43. What is the tens digit of h? 2 Let k(s) = s*2 - 2s*2 + 41 - 46s - 24s + 41s. Let i be k(-28). Let j = 79 - i. What is the units digit of j? 0 Let t(s) = s*2 - 20s + 4. Let f be t(18). Let i be (27/6 - 0)f/(-6). What is the tens digit of (36/i)/((-1)/(-62))? 9 Let b be 206/282 + (-124)/(-434). Let d(s) = -s*3 + 18s*2 + 3s + 21. What is the tens digit of d(b)? 4 Let c = 570 + -570. Let v(x) = 27x + 863. What is the hundreds digit of v(c)? 8 Let p(g) = g2 + 9g + 6. Let t be p(-10). Suppose -10z + t = -4. What is the tens digit of -2((-37)/z + -4)? 4 Let q(o) = 2o2 - 2o - 1. Let j be q(2). Suppose jk = 4a + 336, 6a - 3a - 473 = -4k. Let v = k - 60. What is the units digit of v? 6 Suppose 0 = -12z + 21z + 3654. Let w = z + 1100. What is the units digit of w? 4 Suppose 0 = -6h + 14h - 24. Let n(g) = -4g + 0g + 6 + 10g*2 + 2g - 3. What is the tens digit of n(h)? 8 Let i = -125 + 60. Let q = i + 69. Suppose 570 = qa + 3g, -g - 4g = -5a + 730. What is the units digit of a? 4 Suppose 3x - 18620 = -4g, 7561 = 2x - 5g - 4837. What is the units digit of x? 4 Let h = -1 + 1. Let j(n) = 2n3 - 5n*2 - 1. Let w(p) = -11p*3 + 31p*2 - p - 28. Let i(z) = -6j(z) - w(z). What is the tens digit of i(h)? 3 Suppose p - 6p = -3l - 4524, -2p + 1820 = 4l. Suppose 128 + p = -2k. Let q = k + 734. What is the tens digit of q? 1 Suppose 3j = -3v - 3, 0 = -3v + 4v - 5j + 7. What is the hundreds digit of ((-926)/5 - v)/((-72)/180)? 4 Let o = -25 - -53. Let r be (316/20)/((-3)/30). Let c = r + o. What is the units digit of c? 4 Suppose -x + 6 = 2x, 14 = 3o - 2x. Suppose -og = -g - 55. Suppose 2d + 27 = gd. What is the units digit of d? 3 Let g be ((-104)/12)/((-8)/1980). What is the hundreds digit of (g/26)/(4/8)? 1 What is the thousands digit of -142/8(-7615 - -43)? 9 Let n = -2421 - -3606. Suppose -2k = d - n, 2k - 758 - 436 = -4d. What is the hundreds digit of k? 5 Suppose o = 0, 4o - 2 = -5z + 1633. What is the hundreds digit of -4 - (-12)/9z? 4 Suppose 3z = z + 128. Let h(q) = -10q - q3 - 3q - 7q2 + 58 - z. What is the units digit of h(-6)? 6 Suppose 3o + 21 = -4o. Let l be (-663)/(-119) + o/(-7). What is the units digit of l/10 + (-4)/(-10)? 1 Let b be (-22)/(-3)(-54)/242. What is the hundreds digit of (-65340)/b + (-1 - 8)? 9 Let j(w) = -w3 + 91w*2 - 208w + 696. What is the hundreds digit of j(71)? 7 Let j = 81 + -151. Let x = j - -40. What is the units digit of 40/(-30)(x/(-2))/(-1)? 0 Suppose -4d = -0i + i - 3, 9 = 3i - 3d. Suppose 1880 = 4b - 2p, 3b - 1126 = ip + 287. What is the units digit of b? 9 Let k(d) = 187d*2 + 66d - 25. What is the hundreds digit of k(11)? 3 Let y be (-520)/(-208) + -15/(-2). Suppose 0 = yc + 601 - 2401. What is the units digit of c? 0 Suppose -3d - 9 = -24. Let g be -1 - 72184/(-8). Suppose 0 = do - g + 6. What is the units digit of o? 3 Suppose -9496q = -9534q + 676704. What is the hundreds digit of q? 8 What is the thousands digit of (-27286)/(-6)(25 + -22)? 3 Let s be -1 - -4 - (3 + -21). Let z be 0 + (2 - 2) + s. Suppose n + v = 30, 5n + 2v - 156 + z = 0. What is the units digit of n? 5 Let y(c) be the third derivative of c5/60 + 7c*3/6 - 4c**2. Let i be (-2)/(-6) - (-33)/9. What is the units digit of y(i)? 3 S	{ "pile_set_name": "DM Mathematics" }
a + 15, 4r - 5a - 11 = m for r. 5 Suppose 2b - 258 = -b. Suppose i + 36 - b = 0. Let q be 15/i-2-5. Solve 3s - 2 = qr - 2s, -3r - 8 = -2s for r. -4 Let s = 77 + -269. Let w = -180 - s. Solve -w = 4u + 4f, -u - 4f - 3 = -0u for u. -3 Let b be ((-1)/(-3))/((-3)/((-234)/2)). Suppose 5n - 5w + b = 8, -n = 5w - 5. Solve -5i + a + 0a - 14 = n, 0 = -3i - a - 2 for i. -2 Suppose -h + 364 = -i, -3h - 2i + 493 = -599. Let o be 1/7 + (h/49)/4. Solve 6 = -5q + 2w, oq + 9 - 24 = -5w for q. 0 Let p = 3347 + -3346. Solve -3i + p = -n + i, i = 0 for n. -1 Let t(a) = -a2 + 12a + 17. Let y be t(13). Let u be (-1)/4 + 57/y. Suppose -x + 2 = -3c, 5 = 4x - c - u. Solve 2i - 10 = -3p, 4p = xi - 16 - 9 for p. 0 Suppose 13n - 20n - 7 = 0, 4v + 5 = -5n. Solve v = 3z, -3c = -5z + 6 + 3 for c. -3 Suppose 4x = 89 + 43. Let j be x/6 - (5 - (-28)/(-8)). Solve -2k + 14 + j = 4g, 4g = 3k - 7 for k. 5 Let o(a) be the third derivative of a4/3 - a3/6 - 13a2. Let v be o(3). Let j = v + -1. Solve 4w - 4 = -t, 0w = 3w - 4t - j for w. 2 Let n = 249 - 243. Let j be (-8)/(-384)8 - (-5)/n. Solve 2r + 11 = -q, 4q + j = -2r - 19 for q. -3 Let c = -20100 + 20104. Solve 2z - 20 = 6u, z + u = cz + 2 for z. -2 Let r be (2286/(-63))/(8/(-28)). Let x = 230 + -103. Let y = x - r. Solve 16 = d + 2d + 2s, y = d - 5s + 23 for d. 2 Let u = -7 + 11. Suppose -3a + 6 = -a. Suppose -g = -3n + 13, -n - 3 = 3g + 16. Solve -ul + 5 = v, -v + 15 = al + nv for l. 0 Let l = 16129 - 16099. Solve 0 = -3p - 5y - 18, l = -3p - 2p + y for p. -6 Suppose -52 = 76v - 72v. Let c = v + 17. Solve 4n - 18 = -2o, 2n = 6n - co - 12 for n. 4 Suppose -9t - 2a + 2 = -13t, 4a = 2t + 4. Solve t = -2y - d + 9, 5y - 6d + 8d = 21 for y. 3 Suppose -7 = -93n - 83 + 355. Solve z + nz - 32 = -4v, -5z + 12 = -2v for z. 4 Let k be (8/(-8))/((-4)/988). Suppose ki - 256i = -225. Solve -2w - 2 + 7 = -3y, 0 = -3y - 2w - i for y. -5 Suppose 2a + 25 = -3u, -6 = 3u - 5a + 5. Let h be 1(1 + -4 - (-7)/u). Let m be (51 - (h + 1))(-3)/(-9). Solve -3g = 4x - m, -g + 4x - 20 = -5g for g. 2 Let y(b) = b*2 + 13b + 24. Let u be y(-5). Let w = u - -16. Solve -5h - 2p + 21 = w, -2h + 5p = 3h for h. 3 Let i(j) = -j3 + 6j*2 + 3. Let m be i(6). Suppose 2o + 2z = 4, 2o - 5z = m - 13. Suppose 5s - 9 = 2s. Solve 27 = 5w - 4c - 8, o = 5w + sc for w. 3 Suppose 0 = -4b - 5y + 38, -5b + 237 = -2y + 239. Solve -f + i - 8 = -1, 3f + 17 = bi for f. -3 Suppose -70m = -72m. Suppose m = 30j + 31 - 121. Solve 4r - 1 = -2u + u, 0 = -3r + j for u. -3 Let k(f) = -f3 + 33f*2 - 16f - 509. Let v be k(32). Solve -53 = -vh - 2b - 49, -2h + b + 12 = 0 for h. 4 Suppose 24 = 4a + 2w, -13w + 9w - 43 = -5a. Solve 2l - 2 = 3b - a, 5b - 2 = -3l for l. -1 Let d(q) = q*3 + 2q*2 - 6q - 5. Let b be d(-3). Solve 3g - 20 = -2z - b, -5z + 21 = -2g for z. 5 Let l(m) = m*2 - 9m + 21. Let t be l(11). Suppose 21h + 220 = th. Solve 2b = -h, -2u + 0b - 14 = 2b for u. -2 Let y(z) = z*3 - 18z*2 - 176z - 3. Let p be y(-7). Solve 5j - 6 = -pk, -2k + 2j + 4 = -8 for k. 4 Suppose -34 + 66 = 2c - 4a, 0 = -4c + 5a + 46. Solve -5o + v - 30 = -20, co + 2v = -8 for o. -2 Suppose 61a + 80 = 41a. Let s = a + 9. Solve -3u + 2u + 7 = -2c, 2c - 23 = -su for u. 5 Suppose -3a = 3c - 105, 3c = -16 + 4. Suppose 0h = 2j + h - 59, -4h + 47 = j. Suppose -a + j = -4f. Solve -q - 4l + 9 = 0, -4q = 5l - f - 0 for q. -3 Suppose -12d - 1785 = -5d. Let u = -250 - d. Solve 7 + 3 = -3j + 4v, -3j - v - u = 0 for j. -2 Let q(m) = m + m + 3 - 7 - 24. Let g be q(16). Solve gt + 4 = 0, 2k + 11 = -4t - t for k. -3 Let a be -3 + 3 + 0 + 3. Suppose 0 = -3y + f - 0f + 3, 3f + 1 = 5y. Let n be (-122)/(-6) - y/(-3). Solve -ab + 2b = 4t - n, -4b + 32 = 3t for b. 5 Suppose -45 - 175 = 27t - 49t. Solve -28 = -3a - 3g - t, 0 = -a + g for a. 3 Let i be (-64)/6 + 14/21. Let o(u) = -u2 - 9u + 13. Let d be o(i). Solve -2j - 2k + 14 = 0, 5k = -dj + 35 - 4 for j. 2 Let c be ((-315)/(-10))/9-4. Let g be (c/4)/((-10)/(-140)). Let o = g - -53. Solve 2q = q, 0 = oh + 4q for h. 0 Let w = 481 + -478. Suppose 2b = 6b + wb. Solve x = -3n + 4, bn + 2x = 2n - 8 for n. 2 Let g = -154 - -149. Let s be (-3520)/(-224) - (g/(-7) + -1). Solve 0 = 3i + 2w - 3w - s, 0 = -4w - 16 for i. 4 Suppose 0 = -53p + 62p - 4338. Let y = p + -480. Solve 2h - 3w + 7w - 4 = 0, 2w - y = -5h for h. 0 Let s(j) = 2j - 7. Let c be s(1). Let y be (c/(-10))/(6/36). Solve 3z = 2m + 2, z + 4 - 14 = ym for m. -4 Let g(u) = -u3 + 48 - u2 - 45 + 23u - 13u. Let o be g(2). Solve 3b - o = -2, b - 7 = -4x for x. 1 Let s = -783 + 763. Let m be (-450)/(-12) - s/(-8). Solve -5y + m = 4w, y + 19 = 5w - y for w. 5 Let v be (-340)/(-13) + (40/52)/(-5). Solve d + v = -5p, -4d + 2p - 6 = -12 for d. -1 Suppose -5r = -414 - 296. Suppose i - 5i = 4w - 88, -3i = -5w + r. Solve -5d - 16 - 24 = 5g, -4d - 2g - w = 0 for d. -5 Let h be (12/(-2))/(14(-15)/105). Solve -12 = -o - 5q, 0 = ho - 44q + 43q - 4 for o. 2 Let s(r) = r*2 - 107r + 2821. Let b be s(47). Solve -74v + 71v = -c + 11, v - c = -b for v. -5 Suppose 145s = 110s + 110 + 240. Solve -4u - s = -3t + 13, -4t = -4 for u. -5 Suppose -3q = -n - 34 + 143, -11q + 150 = 2n. Solve 102p - np = -4r + 31, -p - 3r + 15 = 0 for p. 3 Let k = 113 + -98. Let b(r) = r*2 - 18r + 47. Let d be b(k). Solve ds = -2h - 0s + 8, -5s = -5 for h. 3 Suppose 28c + 186c = 856. Solve -cx - 2b = 18 - 20, -4x = -3b - 27 for x. 3 Let a(c) = c*3 + 4c*2 + 3c + 5. Let o be ((-5)/10)/(3/18). Let l be a(o). Solve q - li = -14 - 4, -4 = -i for q. 2 Suppose -2f + 17 = 3p - 7f, -4p + 32 = -2f. Let b be (-6)/(-3 + p) - -5. Solve 4j + 0j + 8 = 2h, -b = 2j - 4h for j. -2 Suppose -14 = -6m - 2. Let x = 14 - 10. Suppose -xp - 5j = -5p + 12, -24 = -mp - 5j. Solve -s - 3s + p = o, -9 = -o - 3s for o. 0 Let z be -21/9(-27)/3. Suppose 9f + zf = 33. Solve 4i = 2m + 14, -9 = -fi - 2m + 3m for i. 2 Suppose 3a - 6 = 3m, -a + 0m - 1 = -2m. Solve 2x + 5w - 25 = x, 4w - 41 = -ax for x. 5 Let l(b) = 5b - 5b + 0b + b - 18. Let r be l(19). Let h be 51 + 0 + -2 + r. Solve 0 = -5i + 2s - 18 - 0, 2i - 4s + h = 0 for i. -4 Suppose 4u - 6 = 2u. Let h = -2 - -4. Suppose -hx - 1 = -5. Solve uz = z - 4, -xz = 3n + 1 for n. 1 Let q(z) = z*3 + 5z*2 - 10z - 5. Let y be q(2). Solve -c + 17 = 3v, -yc + 0v - 4 = -2v for c. 2 Let s = 1943 - 1816. Solve -si + 24 = -131i, -y + 13 = -3i for y. -5 Let l(f) = -f2 + 4f - 7. Let d be l(5). Let n = d + 44. Suppose 7z = -z + n. Solve 3i - zu - 32 = 0, i + 4i - 30 = 2u for i. 4 Let y(n) = 2n*2 - 4n + 4. Let z = 238 + -236. Let k be y(z). Solve 0 = -4v - ka + 24, 5v - 2a = a + 14 for v. 4 Suppose 12o - 653 = 13o. Let h = o - -669. Solve -2z = -4w + h, -z = 4w - 13 + 3 for z. -2 Let n be (-2)/(-1 + 5)(-174)/29. Suppose -12 = -f + 5a, a - 8 = -2f + na. Solve 0 = -5s - g, 2g - 8 + f = -4s for s. -1 Let t(y) = -8y + 3. Let b be t(-3). Suppose 0l = -9l + b. Solve 0z + lz = -3a, -3a - z = 8 for a. -4 Let u = 91 - -46. Let i = -112 + u. Suppose 0 = -4z - p - 0p + 5, 5p - i = -z. Solve j + 5l - 10 + 1 = z, -j + 5l - 11 = 0 for j. -1 Suppose -4j + 129 = -6c + 1, 3j + 74 = -4c. Let z be 0 - -55(-4)/c. Solve -5x = -zo + 30, o + 0x - 2x = 10 for o. 2 Let r = 1598 - 1563. Solve 0 = 4m - 4d + 12, 0m + 5d - r = -5m for m. 2 Let g be (-16)/20 + 504/(-45). Let j(s) = -3s - 16. Let h be j(g). Solve 0i - 5u - h = i, 4i - u - 4 = 0 for i. 0 Suppose 0 = -25q + 23q + 236. Let k = -112 + q. Solve 4o = 5g - 21, g - 4o = kg - 29 for g. 5 Let g(r) be the second derivative of -3r*3/2 - 30r*2 + 2r - 39. Let t be g(-7). Solve 2o - 3o + j = 1, to - 4j = -6 for o. 2 Let c = -301 + 298. Let v be -2 + (2 - c) - 3. Solve 5d + f = -vd - 19, 5d + 2f + 18 = 0 for d. -4 Suppose -126v = 114v - 720. Solve 3d = -4n - 12 + 5, 5d = vn - 2 for d. -1 Let q be ((-42)/15)/(2/(-10)). Suppose -8z = -z - 112. Suppose -13k - 24 = -zk. Solve -4i - 2o - q = k, -3i	{ "pile_set_name": "DM Mathematics" }
900, 7166, 11982, 18660, 27512? 38850 What comes next: -910161, -3640632, -8191411, -14562492, -22753869? -32765536 What is the next term in 1282, 2663, 4082, 5557, 7106, 8747, 10498? 12377 What comes next: -8813539, -17627076, -26440611, -35254144, -44067675, -52881204, -61694731? -70508256 What comes next: 29019, 117118, 263951, 469518, 733819, 1056854? 1438623 What is the next term in 139638, 139615, 139592, 139569, 139546? 139523 What is next in -15862, -17723, -19584, -21445, -23306, -25167? -27028 What is the next term in -4521, -4300, -3699, -2526, -589, 2304? 6345 What is the next term in 486, 1855, 4140, 7365, 11554? 16731 What is next in -4562, -13660, -27266, -45374, -67978, -95072, -126650, -162706? -203234 What is next in 4012460, 4012466, 4012484, 4012520, 4012580, 4012670, 4012796, 4012964? 4013180 What is the next term in 3176779, 12707119, 28591017, 50828473? 79419487 What is next in 1045024, 1045014, 1044998, 1044976, 1044948, 1044914? 1044874 What comes next: 72145, 144213, 216281, 288349, 360417? 432485 What is next in -96701, -102800, -108931, -115100, -121313, -127576, -133895, -140276? -146725 What comes next: -341556, -340788, -340008, -339210, -338388, -337536? -336648 What comes next: -42269, -84563, -126865, -169175, -211493, -253819, -296153? -338495 What is next in -1073, -4244, -9511, -16874, -26333, -37888, -51539? -67286 What is next in -65698, -66953, -68208, -69463, -70718, -71973? -73228 What comes next: 572, 10929, 44054, 112925, 230520, 409817? 663794 What is the next term in 130215, 130512, 130985, 131640, 132483? 133520 What is next in 11821905, 11822060, 11822317, 11822676? 11823137 What is the next term in -17137355, -17137364, -17137375, -17137388, -17137403, -17137420, -17137439? -17137460 What is next in -8899, -4293, 313, 4919? 9525 What is next in -254031, -254034, -254037, -254040, -254043? -254046 What is the next term in -1193, -4618, -8043, -11468? -14893 What is the next term in 1607050, 1607091, 1607186, 1607359, 1607634? 1608035 What is the next term in -367553, -735203, -1102869, -1470557, -1838273? -2206023 What comes next: -216, -120, 120, 534, 1152, 2004, 3120? 4530 What comes next: -4907, -22235, -51133, -91601? -143639 What is the next term in 801104, 800428, 799752? 799076 What comes next: 3971, 3961, 3995, 4097, 4291, 4601, 5051? 5665 What is next in 180086, 358433, 536780, 715127, 893474? 1071821 What comes next: 24995, 50067, 75139, 100211? 125283 What is next in -1214, -191, 828, 1843, 2854? 3861 What is the next term in -559963, -1119962, -1679963, -2239966, -2799971, -3359978, -3919987? -4479998 What comes next: 2095, 10319, 24085, 43393, 68243? 98635 What is the next term in -676, -1509, -2652, -4105, -5868, -7941, -10324? -13017 What comes next: -4024144, -8048290, -12072436? -16096582 What comes next: -6473873, -12947723, -19421573, -25895423, -32369273? -38843123 What comes next: 42484, 84994, 127554, 170188, 212920? 255774 What is next in 292998, 292943, 292860, 292749, 292610, 292443, 292248? 292025 What comes next: -107, -181, -313, -491, -703, -937? -1181 What comes next: -34093, -136425, -306979, -545755, -852753? -1227973 What comes next: 106898, 107926, 108954? 109982 What is the next term in -108192, -216587, -324986, -433389? -541796 What is next in 47365, 88390, 129415, 170440? 211465 What is the next term in 2266, 2352, 2500, 2716, 3006, 3376, 3832, 4380? 5026 What is the next term in -45026, -45167, -45308, -45449? -45590 What comes next: 153578, 307155, 460730, 614303? 767874 What is the next term in 27427756, 27427739, 27427722, 27427705? 27427688 What comes next: 17572, 70579, 158972, 282745, 441892, 636407, 866284? 1131517 What is the next term in 2331407, 4662897, 6994383, 9325865? 11657343 What comes next: -2021362, -4042725, -6064088, -8085451? -10106814 What is the next term in 491510, 983011, 1474512, 1966013, 2457514? 2949015 What comes next: 301, 1081, 2445, 4513, 7405, 11241? 16141 What comes next: -1444625, -2889178, -4333733, -5778290, -7222849, -8667410, -10111973? -11556538 What is next in -472, -2075, -4826, -8725? -13772 What comes next: 401, 4633, 16133, 38537, 75481, 130601? 207533 What is next in 7469, 16061, 24645, 33215, 41765, 50289, 58781, 67235? 75645 What is next in -10916305, -10916304, -10916303? -10916302 What is next in -1493834, -1493831, -1493828, -1493825? -1493822 What is the next term in -36, -560, -1992, -4794, -9428, -16356, -26040, -38942? -55524 What is next in -1781, -6094, -12933, -22298, -34189, -48606? -65549 What is the next term in 7081, 28568, 64455, 114736, 179405, 258456, 351883? 459680 What is next in 1595, 1067, 207, -985? -2509 What is the next term in -10546941, -10546931, -10546921, -10546911, -10546901, -10546891? -10546881 What is next in 851294, 3405172, 7661636, 13620686, 21282322, 30646544? 41713352 What is the next term in -99, 1132, 4449, 10884, 21469, 37236? 59217 What is the next term in -179712, -359420, -539138, -718872, -898628, -1078412? -1258230 What comes next: 46745, 373923, 1261949, 2991239, 5842209, 10095275? 16030853 What is next in 79178092, 158356183, 237534274? 316712365 What is the next term in 934, 1967, 3188, 4693, 6578? 8939 What is the next term in -173418, -346692, -519974, -693264, -866562, -1039868? -1213182 What is the next term in -9682, -11366, -14164, -18076, -23102, -29242? -36496 What is next in -72572067, -72572069, -72572071? -72572073 What comes next: -239529, -239551, -239573, -239595, -239617, -239639? -239661 What is next in 5659596, 5659657, 5659718, 5659779, 5659840, 5659901? 5659962 What is next in -42519, -85176, -127823, -170460, -213087, -255704? -298311 What comes next: 106012, 424205, 954530, 1696987? 2651576 What is next in -58222819, -58222818, -58222817, -58222816, -58222815? -58222814 What is next in -93517, -188229, -284119, -381181, -479409, -578797? -679339 What comes next: 1954, 15048, 50514, 119536, 233298? 402984 What comes next: -240668601, -240668602, -240668603, -240668604, -240668605? -240668606 What is the next term in 277, 326, 333, 196, -187, -918? -2099 What comes next: 373931572, 373931574, 373931576, 373931578, 373931580, 373931582? 373931584 What is next in 3478537, 6957069, 10435599, 13914127, 17392653? 20871177 What is next in 5477, 11325, 17565, 24197, 31221? 38637 What is next in 16478, 34523, 54134, 75311, 98054, 122363? 148238 What comes next: -24158761, -48317523, -72476285, -96635047? -120793809 What is next in -8901, -34637, -77197, -136575, -212765? -305761 What comes next: 33210, 67463, 101718, 135975? 170234 What comes next: -322880, -1291613, -2906168, -5166545, -8072744? -11624765 What is next in 1423, 1845, 2277, 2719, 3171, 3633, 4105? 4587 What is next in 40071, 80234, 120483, 160818? 201239 What is the next term in 23431, 46849, 70261, 93661, 117043, 140401, 163729? 187021 What is next in -265498, -265504, -265494, -265462, -265402, -265308, -265174? -264994 What comes next: -191714, -382635, -573556? -764477 What comes next: 162814, 325564, 488264, 650890, 813418, 975824, 1138084, 1300174? 1462070 What is next in -1450, -9556, -31450, -74026, -144178, -248800, -394786? -589030 What is next in 589, -28220, -115831, -291644, -585059? -1025476 What is the next term in -51575, -103558, -155533, -207500? -259459 What is next in 5536, 22129, 49794, 88537, 138364, 199281, 271294? 354409 What comes next: 5675, 19270, 40785, 70220, 107575, 152850? 206045 What is the next term in -46919, -37428, -21611, 532, 29001, 63796? 104917 What is next in 4858, 36558, 122614, 290206, 566514, 978718, 1553998, 2319534? 3302506 What is the next term in 5579, 10744, 15929, 21140, 26383? 31664 What comes next: 541683, 1083363, 1625035, 2166693, 2708331, 3249943? 3791523 What is the next term in 110532, 221059, 331624, 442227, 552868, 663547, 774264? 885019 What comes next: 224372, 227806, 231240, 234674, 238108, 241542? 244976 What comes next: 37299, 36457, 35615, 34773, 33931? 33089 What comes next: 938011, 1876031, 2814049, 3752065, 4690079, 5628091? 6566101 What is the next term in 10974, 11482, 12314, 13470? 14950 What is the next term in 15725, 15829, 15935, 16043, 16153? 16265 What is the next term in -1775194, -3550381, -5325564, -7100	{ "pile_set_name": "DM Mathematics" }
the remainder when 22 is divided by -2 + (p - 1 - -16). 10 Let l(d) = -d*2 + 3d*3 - 2d*3 + d - 7d - 4d2 + 5. Let a be l(6). Suppose -m = -aq - 48, m - 6 - 42 = q. What is the remainder when m is divided by 17? 14 Let h = 215 + -183. What is the remainder when 31-1(-2 - 1) is divided by h? 29 Suppose -14 + 69 = 5r. Suppose rx = -9 + 284. Calculate the remainder when 70 is divided by x. 20 Calculate the remainder when 40 is divided by 775/25 - (0 + -12). 7 Let i(c) = c3 - 12c*2 + 12c + 14. Let a(f) = -f*2 - 5f + 11. Let k be a(-5). Calculate the remainder when 45 is divided by i(k). 20 Suppose -3w = -2u - 40, -2w = -2u - u - 20. Let k = -8 - -18. Suppose -m + k = -19. What is the remainder when m is divided by w? 13 Let p = -919 - -653. Let z = 529 + p. What is the remainder when z is divided by 53? 51 Let i = 1015 + -963. What is the remainder when 1765 is divided by i? 49 Let x be (-14)/4(-24)/7. Let u = x + -10. What is the remainder when 4 is divided by u? 0 Let m(z) = -169z - 1. Let w be m(-1). Suppose -10l - w = -13l. Suppose 0 = -4i + u + 79, -5u + 88 = 5i + 8. What is the remainder when l is divided by i? 18 Let y(t) = -t3 - 9t*2 - 8t - 12. What is the remainder when y(-9) is divided by 32? 28 Let r be (5/(-15))/((-2)/12). Suppose -l = 5m - 24, rl - 2m = -l + 4. Suppose ld = 5d - 13. What is the remainder when 23 is divided by d? 10 What is the remainder when 114/(-18) - -6 - (-190)/3 is divided by 13? 11 Suppose 0 = g + 3 - 20. Suppose g = m - 4. What is the remainder when m is divided by 4/16 - (-43)/4? 10 Let k(x) = x + 21. Let i be k(-13). Suppose -3d - z = i - 135, -5z = d - 19. Let w(u) = -14u*3 - 2u - 1. What is the remainder when d is divided by w(-1)? 14 Let q be 38/6 + 2/(-6). Let u be -4 + (-4)/q-6. Let r = 24 - u. What is the remainder when r is divided by 13? 11 Suppose 2h = -0s - 5s + 1421, 0 = -3s - 5h + 845. Suppose -21 + s = 8q. What is the remainder when 96 is divided by q? 30 Let x = 60 - 36. Suppose m + 3m = x. Calculate the remainder when 51 is divided by (13/(-3))/(m/(-18)). 12 Let h(o) = -3o + 19. Let a be h(3). Suppose -189 = -ay + 3y. What is the remainder when y is divided by 14? 13 Let g = -113 + 193. Suppose 3w = -w + g. Let l = 865 + -786. What is the remainder when l is divided by w? 19 Let v(t) = -24t - 95. Suppose 5y + 5l - 130 = 0, -y - 2l - 19 + 49 = 0. Let k = 39 - y. What is the remainder when v(-6) is divided by k? 15 Let k(i) = 2i - 21. Let z be k(6). Let d = 27 + z. Calculate the remainder when d is divided by 10. 8 Suppose 2i - 53 + 19 = 0. What is the remainder when 83 is divided by i? 15 Let v(n) = 5n - n - 9 + 33. Calculate the remainder when v(-3) is divided by 9. 3 Let p(w) = 3w*2 + 16w - 116. Calculate the remainder when 67 is divided by p(5). 28 Suppose -3w - 129n + 81 = -132n, 3w - 2n = 77. Calculate the remainder when 1102 is divided by w. 21 Suppose 5c = -3q + 250, -2q = c - 61 - 101. Let z = -29 + q. Let h = -32 + z. Calculate the remainder when h is divided by 4. 3 Suppose -171 = -r - 167. Let b be ((-4)/6)/((-3)/9). Suppose -8 = p - bp + 4v, 2p - 16 = -rv. What is the remainder when 29 is divided by p? 5 Suppose 7o - 138 - 51 = 0. What is the remainder when 323 is divided by o? 26 Calculate the remainder when 22 is divided by ((-38)/3)/(18/(-27)). 3 Let l(p) = 87p + 369. Calculate the remainder when l(0) is divided by 76. 65 Let h(n) = 8n + 612. Calculate the remainder when h(-54) is divided by 91. 89 Let d be (4/(-2))/(4/(-42)). Let p = -1306 - -2467. Calculate the remainder when p/d - (-4)/(-14) is divided by 14. 13 Let j(r) = -4r2 + 11 - r3 + 6r + 5r*3 - 4r*2 - 3r*3. What is the remainder when 9 is divided by j(7)? 1 Let n(y) = 57y - 1237. What is the remainder when 83 is divided by n(22)? 15 Suppose 5k - 2k + 3 = 0. Let t be 4/k - -3 - -49. Let b = t + -12. Calculate the remainder when b is divided by 19. 17 Let r = -18 - -31. Let h = -6 + r. What is the remainder when 10 is divided by h? 3 Suppose 3j - 5x = 131, j - 5x - 28 = -1. Suppose 0 = 4h - 5w + 2w - j, -h + 5w = -13. What is the remainder when h is divided by 3? 1 Let f be 80/(1(0 - -1)). Calculate the remainder when (48/f)/((-2)/(-410)) is divided by 31. 30 Let k(j) = j*3 + 36j*2 + 33j - 7. Calculate the remainder when k(-35) is divided by 13. 11 Suppose -4p = 5a - 190, 2p + 0p = -a + 38. Let c = 5 + -2. What is the remainder when a is divided by 264/24c? 12 Let o(t) = -t*2 - 6t - 6. Let k be o(-4). Suppose 4m = km + 100. Calculate the remainder when m is divided by 14 - 1/(4/4). 11 Suppose 592 = 2c + 6c. Let f = c - 49. Suppose -10 = -5n + 5b, 3n - 1 - 10 = 2b. What is the remainder when f is divided by n? 4 Let c(n) = -3n. Let j be c(-4). Let d be (j/21)/((-8)/(-28)). Suppose 0 = -w + dq - 2 + 12, -3w + q + 25 = 0. What is the remainder when w is divided by 2? 0 Let m be 229/5 + (-6)/(-30). Suppose -2f = d - 123, -134 = -3f + 3d + m. Calculate the remainder when f is divided by (-7 + 6)/(11/(-21)). 19 Let y(h) = -8h + 6. Let z be y(-8). Suppose -f = -2f + 2. What is the remainder when z/25 - 2/(-10) is divided by f? 1 Let c = 138 + -231. Let l = -62 - c. Calculate the remainder when 185 is divided by l. 30 Let n = -9 - -24. Calculate the remainder when 2 - (2 - 56/2) is divided by n. 13 Let y be (90 - -1) + 28/7. Suppose 19p - y = 14p. Calculate the remainder when 67 is divided by p. 10 Let q = 135 - 13. Calculate the remainder when q is divided by 42. 38 Suppose -b + 8 + 17 = -3i, -5b - 2i = -74. Calculate the remainder when 284 is divided by b. 12 Let v(h) = -h*3 + 13h*2 + h - 19. Let r be v(13). Suppose 0 = -3z - z + 16. What is the remainder when 19 + (-12)/(r/(-2)) is divided by z? 3 What is the remainder when 318 is divided by (-689)/(-13) + 12 - -2? 50 Suppose 5u = -2r + 27, -1 - 2 = 3u. Let t(l) = l2 - l + 4. Let y be t(-6). Let s = y + -17. What is the remainder when s is divided by r? 13 Let l = -12 - -15. Let s be 20/3 + 1/l. Let v(k) = -k2 + 8k + 5. Calculate the remainder when 35 is divided by v(s). 11 Suppose 119 = w - 5d - 280, -w - 4d = -426. What is the remainder when w is divided by 7? 1 Let w(s) = 6s3 + 2s*2 - 2s + 2. Let m be w(2). Suppose 6u - m = 3u. Suppose 0 = 2a - 3a + 34. What is the remainder when a is divided by u? 16 Suppose -2a + 175 = -h, -2 = -5h - 7. What is the remainder when a is divided by 52? 35 Let r(m) = -m*2 - 8m + 2. Let o(u) = 2u2 + 8u - 1. Let l(x) = 2o(x) + 3r(x). Calculate the remainder when l(9) is divided by 7. 6 Suppose -3c + 37 = -2. Let w(k) = 9k*2 + 3k + 5. What is the remainder when w(-3) is divided by c? 12 Let t(d) = d*3 + 33d*2 + 4d + 148. What is the remainder when t(-33) is divided by 6? 4 Suppose 33 = 5s - 72. Calculate the remainder when ((-492)/9)/(s/9 - 3) is divided by 14. 12 Let j = -19 + 21. Suppose -j = 3f - 26. Calculate the remainder when f is divided by 6. 2 Let r(p) = 2p3 - 38p*2 + 37p - 8. Suppose 27 = m + 8. What is the remainder when m is divided by r(18)? 9 Suppose 67 = 7u + 5q, 6q = 3u + 4q - 8. Let c = 8 - 1. Suppose -co = -2o - 45. What is the remainder when o is divided by u? 3 Let n(m) = 72m - 93. What is the remainder when n(2) is divided by 7? 2 Suppose -106t = -113t + 371. What is the remainder when t is divided by 14? 11 Let o(a) = -a*3 + 35a*2 + 115a + 33. Calculate the remainder when o(38) is divided by 28. 15 Let p(o) = -o*3 - 16o*2 - 25o - 56. What is the remainder when p(-15) is divided by 7? 3 Suppose -14z + 86 = 2. What is the remainder when z is divided by (1 - (-9)/(-5))-5? 2 Let w be (-2)/4-3 + (-137)/2. Let l = w + 136. Suppose 0 = b - 12 - 6. Calculate the remainder when l is divided by b. 15 Calculate the remainder when (-60)/(-45) - 1923/(-9) is divided by 27. 26 Suppose -2y - 5h + 26 = 0, 2y - 2h = 4y - 32. Calculate the remainder when 593 is divided by y. 17 Let p = 117 - 88. What is the remainder when 45 is divided by p? 16 Let o(p) = p*3 + 20p*2 - 30p - 47. Calculate the remainder when o(-21) is divided by 18. 16 Let x(h) = h*2 + 13h + 83. Calculate the remainder when x(-13) is divided by 37. 9 Sup	{ "pile_set_name": "DM Mathematics" }
5, 853 What are the prime factors of 35? 5, 7 List the prime factors of 1856. 2, 29 What are the prime factors of 1970? 2, 5, 197 What are the prime factors of 2295? 3, 5, 17 List the prime factors of 1598. 2, 17, 47 What are the prime factors of 52070? 2, 5, 41, 127 What are the prime factors of 689? 13, 53 What are the prime factors of 33223? 33223 What are the prime factors of 369? 3, 41 What are the prime factors of 2340? 2, 3, 5, 13 What are the prime factors of 1056? 2, 3, 11 What are the prime factors of 2238? 2, 3, 373 What are the prime factors of 15709? 23, 683 What are the prime factors of 8272? 2, 11, 47 List the prime factors of 17221. 17, 1013 What are the prime factors of 1048? 2, 131 What are the prime factors of 291? 3, 97 List the prime factors of 15776. 2, 17, 29 List the prime factors of 34939. 34939 List the prime factors of 17517. 3, 5839 What are the prime factors of 449? 449 List the prime factors of 90. 2, 3, 5 What are the prime factors of 3171? 3, 7, 151 What are the prime factors of 118586? 2, 13, 4561 What are the prime factors of 38601? 3, 4289 List the prime factors of 1553. 1553 What are the prime factors of 96? 2, 3 What are the prime factors of 23963? 31, 773 What are the prime factors of 77124? 2, 3, 6427 What are the prime factors of 7258? 2, 19, 191 List the prime factors of 7469. 7, 11, 97 What are the prime factors of 97070? 2, 5, 17, 571 What are the prime factors of 4207? 7, 601 What are the prime factors of 67539? 3, 47, 479 What are the prime factors of 27234? 2, 3, 17, 89 What are the prime factors of 4263? 3, 7, 29 List the prime factors of 5790. 2, 3, 5, 193 List the prime factors of 89280. 2, 3, 5, 31 List the prime factors of 1784. 2, 223 List the prime factors of 6933. 3, 2311 List the prime factors of 31613. 101, 313 What are the prime factors of 27172? 2, 6793 List the prime factors of 2546. 2, 19, 67 List the prime factors of 1562. 2, 11, 71 What are the prime factors of 663? 3, 13, 17 List the prime factors of 227. 227 List the prime factors of 9106. 2, 29, 157 List the prime factors of 401. 401 List the prime factors of 6341. 17, 373 List the prime factors of 5759. 13, 443 List the prime factors of 10283. 7, 13, 113 What are the prime factors of 1185? 3, 5, 79 What are the prime factors of 36266? 2, 18133 What are the prime factors of 1998? 2, 3, 37 List the prime factors of 759. 3, 11, 23 What are the prime factors of 81463? 81463 List the prime factors of 6588. 2, 3, 61 What are the prime factors of 962? 2, 13, 37 What are the prime factors of 157? 157 List the prime factors of 17534. 2, 11, 797 What are the prime factors of 68886? 2, 3, 43, 89 What are the prime factors of 16856? 2, 7, 43 What are the prime factors of 93344? 2, 2917 List the prime factors of 620. 2, 5, 31 List the prime factors of 2018. 2, 1009 List the prime factors of 6237. 3, 7, 11 What are the prime factors of 13563? 3, 11, 137 List the prime factors of 14536. 2, 23, 79 List the prime factors of 156. 2, 3, 13 List the prime factors of 46227. 3, 19, 811 What are the prime factors of 1664? 2, 13 What are the prime factors of 1696? 2, 53 List the prime factors of 1166. 2, 11, 53 What are the prime factors of 1263? 3, 421 What are the prime factors of 781? 11, 71 What are the prime factors of 3671? 3671 List the prime factors of 2913. 3, 971 List the prime factors of 16497. 3, 13, 47 List the prime factors of 1786. 2, 19, 47 What are the prime factors of 718? 2, 359 List the prime factors of 149921. 149921 What are the prime factors of 45833? 45833 List the prime factors of 66367. 7, 19, 499 List the prime factors of 8703. 3, 967 What are the prime factors of 80523? 3, 23, 389 What are the prime factors of 5354? 2, 2677 What are the prime factors of 9022? 2, 13, 347 List the prime factors of 10360. 2, 5, 7, 37 What are the prime factors of 1189? 29, 41 What are the prime factors of 585? 3, 5, 13 List the prime factors of 4541. 19, 239 List the prime factors of 145231. 17, 8543 List the prime factors of 869. 11, 79 What are the prime factors of 1978? 2, 23, 43 List the prime factors of 160706. 2, 7, 13, 883 What are the prime factors of 88547? 88547 What are the prime factors of 10521? 3, 7, 167 List the prime factors of 39. 3, 13 List the prime factors of 1997. 1997 List the prime factors of 734. 2, 367 List the prime factors of 86920. 2, 5, 41, 53 What are the prime factors of 381? 3, 127 List the prime factors of 8181. 3, 101 List the prime factors of 3218. 2, 1609 List the prime factors of 52096. 2, 11, 37 What are the prime factors of 581? 7, 83 What are the prime factors of 2325? 3, 5, 31 What are the prime factors of 280? 2, 5, 7 List the prime factors of 644. 2, 7, 23 List the prime factors of 29995. 5, 7, 857 What are the prime factors of 2413? 19, 127 What are the prime factors of 4510? 2, 5, 11, 41 List the prime factors of 448. 2, 7 List the prime factors of 13402. 2, 6701 What are the prime factors of 2257? 37, 61 What are the prime factors of 1132? 2, 283 List the prime factors of 8262. 2, 3, 17 List the prime factors of 36931. 36931 List the prime factors of 4676. 2, 7, 167 What are the prime factors of 545? 5, 109 What are the prime factors of 3736? 2, 467 What are the prime factors of 10541? 83, 127 What are the prime factors of 810? 2, 3, 5 List the prime factors of 6686. 2, 3343 List the prime factors of 1235. 5, 13, 19 What are the prime factors of 9627? 3, 3209 List the prime factors of 727. 727 List the prime factors of 4330. 2, 5, 433 What are the prime factors of 41993? 7, 857 What are the prime factors of 4158? 2, 3, 7, 11 List the prime factors of 2951. 13, 227 What are the prime factors of 1615? 5, 17, 19 What are the prime factors of 1899? 3, 211 List the prime factors of 8273. 8273 What are the prime factors of 37842? 2, 3, 7, 17, 53 List the prime factors of 1801. 1801 List the prime factors of 23053. 23053 List the prime factors of 205. 5, 41 What are the prime factors of 26917? 11, 2447 What are the prime factors of 8799? 3, 7, 419 List the prime factors of 4351. 19, 229 What are the prime factors of 7148? 2, 1787 List the prime factors of 161. 7, 23 What are the prime factors of 44890? 2, 5, 67 List the prime factors of 5634. 2, 3, 313 List the prime factors of 8062. 2, 29, 139 List the prime factors of 41571. 3, 31, 149 List the prime factors of 3364. 2, 29 What are the prime factors of 15? 3, 5 List the prime factors of 260. 2, 5, 13 List the prime factors of 21959. 7, 3137 What are the prime factors of 1383? 3, 461 List the prime factors of 134969. 139, 971 List the prime factors of 1305. 3, 5, 29 List the prime factors of 5414. 2, 2707 What are the prime factors of 1726? 2, 863 What are the prime factors of 1806? 2, 3, 7, 43 List the prime factors of 1348. 2, 337 What are the prime factors of 1356? 2, 3, 113 List the prime factors of 42811. 31, 1381 List the prime factors of 55828. 2, 17, 821 What are the prime factors of 567? 3, 7 What are the prime factors of 3345? 3, 5, 223 List the prime factors of 1201. 1201 List the prime factors of 16662. 2, 3, 2777 List the prime factors of 45593. 127, 359 List the prime factors of 73999. 73999 List the prime factors of 11399. 11399 List the prime factors of 89481. 3, 7, 4261 What are the prime factors of 5766? 2, 3, 31 What are the prime factors of 64671? 3, 21557 What are the prime factors of 641? 641 What are the prime factors of 36157? 11, 19, 173 What are the prime factors of 382? 2, 191 List the prime factors of 38044. 2, 9511 What are the prime factors of 118? 2, 59 What are the prime factors of 3881? 3881 What are the prime factors of 1776? 2, 3, 37 List the prime factors of 17756. 2, 23, 193 What are the prime factors of 114607? 31, 3697 List the prime factors of 651. 3, 7, 31 What are the prime factors of 99552? 2, 3, 17, 61 What are the prime factors of 727? 727 What are the prime factors of 32792? 2, 4099 What are the prime factors of 980? 2, 5, 7 What are the prime factors of 2541? 3, 7, 11 What are the prime factors of 1767? 3, 19, 31 List the prime factors of 3451. 7, 17, 29 List the prime factors of 933. 3, 311 List the prime factors of 1369. 37 List the prime factors of 135615. 3, 5, 9041 List the prime factors of 1597. 15	{ "pile_set_name": "DM Mathematics" }
der. q, k, -5 Suppose -2s = 1 + 9. Let h be 1/3 - (-8)/3. Sort -3, s, h. s, -3, h Suppose 25 = 3d + 2d. Suppose 0 = 3v - 3x + 8x + d, 3v - 35 = 5x. Sort -2, -1, v in ascending order. -2, -1, v Let p(n) = n*2 + 4n + 4. Let l be p(-4). Suppose 0 = z - lz + 6. Sort 1, -1, z. -1, 1, z Let d = -6 - -7. Sort d, -0.2, 0.2 in increasing order. -0.2, 0.2, d Suppose 5d + 3w - 38 = 0, w = 5d - 4w - 30. Put d, -2, -3 in ascending order. -3, -2, d Let w be 1/6 + (-280)/(-48). Let a(v) = v3 - 7v*2 + 6v + 4. Let j be a(w). Put -3, j, -4 in descending order. j, -3, -4 Suppose -5b + 15 = -0b. Suppose -5i + 2c - 3c + 25 = 0, 0 = -4i - 3c + 31. Let n(y) = y3 - y + 1. Let m be n(1). Put m, b, i in descending order. i, b, m Let i be (-4)/(-14) - (-282)/42. Suppose m + i = 16. Sort m, -4, 5 in ascending order. -4, 5, m Let a(t) = t3 - 11t*2 + 9t + 13. Let p be a(10). Put -1, -2, 1, p in increasing order. -2, -1, 1, p Suppose -3l = -4q + q + 12, q = -5l + 4. Put l, 3, -1 in descending order. 3, l, -1 Let m = -3.2 - -6.5. Let j = m - 0.3. Sort 1, 2, j in increasing order. 1, 2, j Let p(g) = g2 - g - 4. Let w be p(-2). Sort 5, w, 0. 0, w, 5 Let p(u) = -3u*2 - 8u - 3. Let t be p(-3). Put t, -1, 2 in ascending order. t, -1, 2 Let c = 2.6 - 7.7. Let n = c - -5. Let u be (-33)/(-21) + 1 + -2. Sort u, 1/5, n in decreasing order. u, 1/5, n Let f(y) = y*2 + 6y + 2. Let j be f(-4). Let b = j + 7. Sort -2/7, b, -1/8. -2/7, -1/8, b Let p = 32/11 - 3. Sort 0, p, 4 in decreasing order. 4, 0, p Let w = -7/2 - -4. Let u(f) = 14f - 17f - 2 + 1. Let d be u(1). Sort w, d, 0.1 in ascending order. d, 0.1, w Let i = -222/5 + 44. Let h = 0.95 - -0.05. Let x = h - 1.3. Sort x, i, -2 in decreasing order. x, i, -2 Let y be 2 + 0 + 11 + -2. Suppose -w = -5g + w + y, -2w - 2 = -2g. Put 12, 1, g in descending order. 12, g, 1 Let t(d) = -d3 - 3d*2 + 5d + 5. Let l be t(-4). Sort -4, l, -5. -5, -4, l Let k = -0.36 - -1.36. Put -5, -2/11, k in ascending order. -5, -2/11, k Let s(n) = 3n2 + 3n + 4. Let g be s(-2). Sort g, 3, -2 in descending order. g, 3, -2 Let k = -7/60 - 2/15. Sort k, 2, -2, 3 in decreasing order. 3, 2, k, -2 Let d = 3.6 - 3.6. Sort -0.4, d, -4. -4, -0.4, d Suppose 12s = 7s - 25. Put 0.1, -2, -4, s in descending order. 0.1, -2, -4, s Let d(v) = -v*3 - 5v*2 + 6v + 3. Let s be d(-6). Sort s, 2, 0 in increasing order. 0, 2, s Let b = 0.61 + -0.01. Let u = 3.4 + b. Let g = 0.01 + -0.31. Sort u, 0.2, g. g, 0.2, u Suppose 2y - 2 - 8 = 0. Let p be (-4)/(-2)1/y. Let z = -85/88 - -12/11. Put -2/13, p, z in decreasing order. p, z, -2/13 Let i = -3 - -2. Let k = i - -1.4. Put 1/2, -0.4, k in descending order. 1/2, k, -0.4 Let r = 444 - 303. Let a be 4/18 + r/(-27). Sort a, -3, 0 in decreasing order. 0, -3, a Let o = 56 + -57. Put 5, o, 2 in increasing order. o, 2, 5 Let p be 4 - ((-24)/(-84) - (-38)/14). Let l = -10 - -6. Sort l, p, 2. l, p, 2 Suppose -y - 1 = 2s, 4s + 7 - 2 = y. Let z be (2/(-22))/(1/(-2)). Sort y, z, -2/9 in descending order. y, z, -2/9 Let a = 11 + -10. Let c = a + -5. Sort c, 9, -5 in descending order. 9, c, -5 Let f(i) = 5i + 34. Let n be f(-7). Sort n, -4, -2 in decreasing order. n, -2, -4 Let y be (0 - 2)/(21/(-2 - -5)). Let a(o) = -o3 - 6o*2 - 5o + 3. Let k be a(-5). Suppose -2v + 10 = kv. Sort y, -3, v in ascending order. -3, y, v Let r = -3.1 - -0.1. Put 2/3, r, -2 in ascending order. r, -2, 2/3 Let b = -12.1 - -3.1. Sort -2, 1, b in descending order. 1, -2, b Let u = 105 - 429. Let b = u - -4210/13. Sort b, 1, 1/8 in descending order. 1, 1/8, b Let l = -0.1 + 0.1. Let g = 0.4 - l. Let y be (-2)/4 + (-35)/(-42). Sort y, -3, g. -3, y, g Let f = -29 + 27. Suppose 3q + 4b = 17, 4b + 0 - 21 = q. Put q, 4, f in increasing order. f, q, 4 Let h = -1477/1188 + -2/297. Let k = 0.4 - -3.6. Put 1/2, k, h in decreasing order. k, 1/2, h Suppose 3a + 5 = -13. Let p(t) = t*3 + 5t*2 - 6t + 2. Let o be p(a). Let v(u) = -3u - 14. Let l be v(-4). Sort o, l, -3. -3, l, o Let c be -2 + 0 - (-14 - -6). Suppose -s = -0j - 3j + c, 18 = 2j + 4s. Suppose -j = -b + 2. Put -4, b, -5 in increasing order. -5, -4, b Let o be (5/8 - -1) + -2. Let r = -2.7 + 6.7. Put 0.3, r, o in descending order. r, 0.3, o Let g = -120.3 + 120. Sort g, 0.5, -0.01, 2/5 in descending order. 0.5, 2/5, -0.01, g Let v = 4.97 + -5. Let n = 4 + -3.7. Sort n, v, 2/5. v, n, 2/5 Suppose 0 = -l - 2l - 6. Sort 2, l, 8. l, 2, 8 Let g = 0 + -0.16. Let p = 0.06 + g. Let n = -101/12 + 33/4. Sort p, 3/2, n in decreasing order. 3/2, p, n Let m(u) be the third derivative of -u4/12 - u3/2 + u2. Let l(w) = -w3 - 6w2 - 2. Let x be l(-6). Let c be m(x). Sort c, 0, 5 in descending order. 5, c, 0 Let x = 1509/7 - 216. Put x, 0.05, -5, 0.5 in ascending order. -5, x, 0.05, 0.5 Let f = -1 - -3. Sort f, 3/5, 1/10, -0.5 in ascending order. -0.5, 1/10, 3/5, f Let q = 8 - 9. Suppose 0 = 4j + j - 10. Let k = j - q. Put -1, k, -3/7 in ascending order. -1, -3/7, k Let y = 461/5 - 93. Let r = -83 + 85. Sort r, -0.2, y in decreasing order. r, -0.2, y Let t = -167/228 - 1/57. Let q = 0 - 0.1. Let l = 0 + q. Put l, t, -4 in descending order. l, t, -4 Suppose -6 = -2v + 3q, 3v + q = -q - 17. Sort -6, -0.3, -2, v in decreasing order. -0.3, -2, v, -6 Suppose 3 = 4f - 0f + 5s, -5f + 4s - 27 = 0. Let m be (-1 + 1)/((-4)/(-4)). Let a = 1 + m. Sort 5, a, f in descending order. 5, a, f Let i = -13081705/709 + 18451. Let t = i - -18617/25524. Let x = t + -5/9. Sort x, -5, 3/7 in decreasing order. 3/7, x, -5 Let d be (-7)/1 - (-1 - 2). Put 1, d, 0 in ascending order. d, 0, 1 Let r = 4 + 1. Suppose 5w - 1 = 4o, 0o - rw + 6 = o. Let j = 2 + -4. Sort -4, j, o. -4, j, o Let t = -266 + 1069/4. Let u(j) = -j + 2. Let s be u(1). Sort s, t, 5 in descending order. 5, t, s Let k = 12.24 - 143.34. Let x = -137 - k. Let u = 0.9 + x. Sort 0, -0.3, u in increasing order. u, -0.3, 0 Let s be (-1 - -1)/(-1 + 0). Put -4, -15, s in increasing order. -15, -4, s Suppose -2z + y = -y, -3z - 5y = -40. Let h(o) = -o2 + o + 1. Let v be h(0). Sort v, -3, z in ascending order. -3, v, z Suppose -5t = -3t + 22. Let d = t - -6. Sort d, -4, 5 in descending order. 5, -4, d Let h = -29 + 32. Put h, 2, 4 in increasing order. 2, h, 4 Let q = -1/38 - -81/190. Let n = -1889 + 1911.02. Let f = n - 22. Sort f, q, 0 in ascending order. 0, f, q Suppose 3a - 3o = -2o + 2, -3a - 2 = -2o. Sort 3, a, 1 in decreasing order. 3, a, 1 Let g be 4(-2)/(-4) - 1. Let t be -5 - -7 - 12. Sort g, -4, t in decreasing order. g, t, -4 Let x = -10 - -5. Let c = -8.99 - 0.01. Let n = -6 - c. Sort x, -4, n. x, -4, n Suppose -v = 5c - 4, 0 = -3c + 4v - 0v + 7. Let y = 4 - c. Let f = 2 + -3. Put 2, f, y in decreasing order. y, 2, f Let a(r) = -r*2 - 10r - 19. Let j be a(-7). Put -35, -3, j in ascending order. -35, -3, j Let a be 2/1 - 0/2. Sort a, -2, -1. -2, -1, a Let j be (-2)/4 - (20/8 - 3). Suppose -x - 10 = 4x. Put x, 2, j in decreasing order. 2, j, x Let w = 379/5 + -75. Let r = -1 + w. Put -2, -3/2, r in increasing order. -2, -3/2, r Let b = -105 - -118. Sort -5, b, -3. -5, -3, b Let w(s) = -s3 + 3s*2 - 4. Let y be w(3). Let c be 0 - (0 + y/(-2)). Sort -1, 3, c in descending order. 3, -1, c Let m = 13 + -10. Suppose 2i = -j - 15 + m, 8 = -3j + i. Put j, 5, 1 in descending order. 5, 1, j Let g = 0.49 + 0.01. Let z = -1 - -1. Let r = -1.1 - 3.9. Put g, z, r in increasing order. r, z, g Suppose -3v - 8 = v. Let b be (5/2)/(v/4). Let q be (-6)/(-3 + (-36)/(-8)). Sort q, b, -3 in descending order. -3, q, b Let r = -0.9 + 5.7. Let z = -5 + r. Let d be (-2)/(-10) - 0/1. Sort d, 1/4, z in descending order. 1/4, d, z Let z = -139 - -110. Put -4, z, 1 in decreasing order. 1, -4, z Suppose -4v + 0v + 17 = 3t, 2 = -2t. Let b(d) = -d*2 - 14d + 3. Let z be b(-14). Sort -3, z, v in descending order. v, z, -3 Suppose 2u + 0u = 5c - 10, u + 5 = -3c. Let d = -36 - -34. Put d, c, -5 in increasing order. -5, d, c Let v(g) = 4g + 5. Let a be v(0). Sort 6, 2, a, 1 in decreasing order. 6, a, 2, 1 Suppose 0 = 5b - 3p - 13, -9 = -b - b + 5p. Suppose 4o - 3 = 1. Sort o, -2, b in increasing order. -2, o, b Suppose 0 = -4n + 2 - 6. Put n, 2/5, 2/9 in increasing order. n, 2/9, 2/5 Let	{ "pile_set_name": "DM Mathematics" }
35)/(-2sqrt(5)). -3 + sqrt(7)/2 Simplify (-5sqrt(270)/sqrt(10))/sqrt(9). -5sqrt(3) Simplify (4sqrt(34)/sqrt(2) + (sqrt(204) + -2sqrt(204))/sqrt(12))2. 153 Simplify -2sqrt(275) + 3. -10sqrt(11) + 3 Simplify -1(5 + -1sqrt(7) + 5). -10 + sqrt(7) Simplify (-6(sqrt(66) - (sqrt(66) - (sqrt(66) + -3sqrt(66)))) + sqrt(66))/(3sqrt(600)). 13sqrt(11)/30 Simplify (sqrt(27) + -2sqrt(3888))*2 - (sqrt(243)1 - sqrt(27)). -6sqrt(3) + 14283 Simplify 3 + sqrt(192) + 1 + sqrt(192) - sqrt(192) - (0 + sqrt(192) + -4). 8 Simplify (6(0 + sqrt(7) + sqrt(7) + sqrt(7)-2))23. 0 Simplify (sqrt(132)-3-4 + sqrt(132) - sqrt(132))/(sqrt(12) - sqrt(24)/(-1sqrt(2))). 6sqrt(11) Simplify (sqrt(250)/(sqrt(30)/sqrt(3)))/(sqrt(5) + sqrt(45) + sqrt(180)/sqrt(4)). sqrt(5)/7 Simplify sqrt(13) - sqrt(208)1 - (sqrt(65) + sqrt(65) + sqrt(65)-1)/sqrt(5). -4sqrt(13) Simplify (sqrt(56)/(sqrt(8) + 6sqrt(48)/sqrt(6)))*2. 1/7 Simplify sqrt(78)/(-2sqrt(96)). -sqrt(13)/8 Simplify -45sqrt(11)-2-5. -200sqrt(11) Simplify (sqrt(80) + sqrt(80)2 - sqrt(80))/sqrt(10). 4sqrt(2) Simplify (1sqrt(6655))/sqrt(5)-5. -55sqrt(11) Simplify ((sqrt(210) + sqrt(210)1 + sqrt(210))/sqrt(10))/sqrt(252). sqrt(3)/2 Simplify 1sqrt(17)2 - (sqrt(85)/(sqrt(5)4) + sqrt(17) - sqrt(17)). 7sqrt(17)/4 Simplify (1(sqrt(208) + sqrt(208)2) - sqrt(208))2 - ((sqrt(13)2 + -3 + sqrt(13))*2 + -3). 18sqrt(13) + 709 Simplify (-5(sqrt(325) - 1sqrt(325)))*2 - ((1sqrt(117)-2)/sqrt(9))2. -52 Simplify (-3(-1sqrt(425) - sqrt(153)/(sqrt(27)/sqrt(3))))2. 5508 Simplify (sqrt(55) - (sqrt(55) - 1sqrt(6655)))/sqrt(11)-3. -33sqrt(5) Simplify ((-6sqrt(171)/sqrt(3))/(sqrt(144)/sqrt(12)))2. 171 Simplify ((0 + sqrt(19))51)2. 475 Simplify ((2sqrt(408))/sqrt(12))/sqrt(2). 2sqrt(17) Simplify -6(5sqrt(1584) + 3). -360sqrt(11) - 18 Simplify (-3(2sqrt(72) + -1 + -1(sqrt(72) + 1)))2. -216sqrt(2) + 684 Simplify -4(sqrt(11) + sqrt(704) + 2 + sqrt(11)). -40sqrt(11) - 8 Simplify ((sqrt(51)/sqrt(3)-6)2 - sqrt(17))6. -6sqrt(17) + 3672 Simplify (((-2sqrt(363))/sqrt(11) + sqrt(33))/((sqrt(44)/sqrt(2))/sqrt(2)))*2. 3 Simplify (3 + (sqrt(7) + 0)-4)*2. -24sqrt(7) + 121 Simplify (-1 + sqrt(1573))*2 - (sqrt(13) - 5(sqrt(13) + -1)*2). -33sqrt(13) + 1644 Simplify sqrt(114)/(1sqrt(216) + sqrt(216)). sqrt(19)/12 Simplify (sqrt(245) + -1 + (4 + (sqrt(20)/sqrt(4))2 - sqrt(5)))44. 128 + 96sqrt(5) Simplify -5 + -2sqrt(700) + sqrt(700) + -3. -10sqrt(7) - 8 Simplify (sqrt(180)/(2sqrt(5)))/(2sqrt(24)/sqrt(2)). sqrt(3)/4 Simplify (3 + (((sqrt(72) - (sqrt(72) + sqrt(72) + -2sqrt(72))) + sqrt(72) + sqrt(72))/sqrt(3))/(-2sqrt(108)))*2. -3sqrt(2) + 19/2 Simplify (sqrt(95)/sqrt(45))*2 - (5 + sqrt(57)/sqrt(3)). -sqrt(19) - 26/9 Simplify (sqrt(75)/sqrt(80) - sqrt(15))/sqrt(3). -3sqrt(5)/4 Simplify (3 + (sqrt(220)/sqrt(11) + sqrt(5) - (sqrt(40)/(sqrt(8) + sqrt(128) - sqrt(8)) + sqrt(5))))*2. 21sqrt(5)/2 + 389/16 Simplify (-2(sqrt(243) + (sqrt(243) - (0 + sqrt(243)))))2. 972 Simplify (-5 + -3 + sqrt(17) + -3 + -2)2. -26sqrt(17) + 186 Simplify (sqrt(33)4)/sqrt(3) + (sqrt(22) + 5sqrt(22))/sqrt(2). 10sqrt(11) Simplify (-4 + sqrt(15)/sqrt(5) - (-5 + sqrt(3) + -3)2)-3. -51sqrt(3) + 213 Simplify (sqrt(20)/(sqrt(24)/(sqrt(6)-2)))*2. 20 Simplify 1sqrt(1872)-3. -36sqrt(13) Simplify sqrt(4)/(sqrt(2) + sqrt(4)/(sqrt(98) + sqrt(2))). 8sqrt(2)/9 Simplify (1sqrt(864))/sqrt(2)-3. -36sqrt(3) Simplify (sqrt(88)/(-2sqrt(2)))2. 11 Simplify (-1(sqrt(110)1 + sqrt(110)) - sqrt(110))/(-2sqrt(90) + sqrt(90)). sqrt(11) Simplify ((1sqrt(294))/sqrt(2)6)*2. 5292 Simplify ((sqrt(99) + 3sqrt(99)6 + sqrt(99) - sqrt(99) - sqrt(99)) + sqrt(99))/((sqrt(99) + sqrt(99)3)/sqrt(11)). 19sqrt(11)/4 Simplify (4sqrt(495))/(-1sqrt(5)-2). 6sqrt(11) Simplify sqrt(468)1 + 0. 6sqrt(13) Simplify (((sqrt(135) - sqrt(135)2)/sqrt(5))/((sqrt(18)-1)/sqrt(2)) + 0)2. 3 Simplify (sqrt(1080) - (5sqrt(1080) + sqrt(1080)) - sqrt(1080))/sqrt(6). -36sqrt(5) Simplify (sqrt(1200) + (-1sqrt(1200) - sqrt(1200)) + sqrt(1200) - sqrt(1200))*2. 1200 Simplify (-3(sqrt(11) + 0))*2 + (3(-2 + sqrt(11)))*2 + sqrt(11) + 5. -35sqrt(11) + 239 Simplify (sqrt(343) - (6(sqrt(343) - (sqrt(343)-2 + sqrt(343))) - sqrt(343)))*2. 34300 Simplify 5 + -2sqrt(425)-2. 5 + 20sqrt(17) Simplify (sqrt(34)/(sqrt(10)/sqrt(5)) - sqrt(17)) + sqrt(170)/(sqrt(10)3) + sqrt(17). 4sqrt(17)/3 Simplify ((-43sqrt(171))/sqrt(9))*2. 2736 Simplify (sqrt(5200) - (1sqrt(5200) + sqrt(5200) - sqrt(5200)))/sqrt(4)1. 0 Simplify ((-2 + sqrt(432) + sqrt(432))-3)*2. -864sqrt(3) + 15588 Simplify (sqrt(1872) + 1)*2-51. -9365 - 120sqrt(13) Simplify (((sqrt(2) - (1 + sqrt(2)))6 - (0 + sqrt(2)1)) + 5)*2. 2sqrt(2) + 3 Simplify (sqrt(171)-1)25 + -3 + 5. 857 Simplify sqrt(14)/(-3sqrt(63)) - (-6sqrt(8) - sqrt(14)/(sqrt(14)/sqrt(2))). 116sqrt(2)/9 Simplify (sqrt(85) + ((sqrt(85) - (sqrt(85) - (sqrt(85) + 1sqrt(85)))) + sqrt(85))-5 + sqrt(85))/(-6-1sqrt(5)). -13sqrt(17)/6 Simplify (4 + sqrt(245)-1 + 1)2. -70sqrt(5) + 270 Simplify (sqrt(112) - (-4 + sqrt(112)2 + sqrt(112))) + sqrt(112). -4sqrt(7) + 4 Simplify -1(sqrt(17) + (sqrt(17) - (sqrt(17) + (sqrt(153)3)/sqrt(9)))*2). -153 - sqrt(17) Simplify -6(sqrt(17) + sqrt(1377))-2. 120sqrt(17) Simplify 2sqrt(171)1 + 4. 4 + 6sqrt(19) Simplify sqrt(612) + -43sqrt(612). -66sqrt(17) Simplify (2sqrt(450))/sqrt(9). 10sqrt(2) Simplify (-5 + (4sqrt(2448) - sqrt(2448)) + sqrt(2448) + sqrt(2448))2. -600sqrt(17) + 61225 Simplify (sqrt(84)/sqrt(27))/(sqrt(40)/(sqrt(30)/sqrt(3))). sqrt(7)/3 Simplify (sqrt(637)-3)2 + 3. 5736 Simplify 2 + 1sqrt(176) + 5 + 5. 12 + 4sqrt(11) Simplify (sqrt(72) - 2sqrt(72))/sqrt(4) + -2sqrt(288). -27sqrt(2) Simplify ((sqrt(300) - (-2 + sqrt(300) + sqrt(300)2)) + (sqrt(300) + sqrt(300) + -1)-1)*2. -240sqrt(3) + 4809 Simplify 1-2(sqrt(1584)-3 + sqrt(1584)). 48sqrt(11) Simplify (-1 + sqrt(12)/((sqrt(6) - sqrt(6)2-3) + sqrt(6)))*2. -sqrt(2)/4 + 33/32 Simplify (6sqrt(34)/sqrt(2) - sqrt(34)/sqrt(8))*2 + (sqrt(17) + sqrt(170)/sqrt(90))5. 20sqrt(17)/3 + 2057/4 Simplify (sqrt(475) + (sqrt(475) + -4(sqrt(475) + -1) - sqrt(475)))-3. -12 + 45sqrt(19) Simplify ((2 + 6(-2 + sqrt(68)))4)*2. -3840sqrt(17) + 40768 Simplify (sqrt(2057)3)2 - sqrt(1377)-4. 36sqrt(17) + 18513 Simplify -2 + (sqrt(4)/sqrt(2))2 + 2 + 4. 6 Simplify (sqrt(2299) + -2 + sqrt(2299) - sqrt(2299))26. -264sqrt(19) + 13818 Simplify -3 + sqrt(3888) + 1. -2 + 36sqrt(3) Simplify (-1sqrt(121)2)/(sqrt(11) - 2sqrt(539)). 2sqrt(11)/13 Simplify (((-3sqrt(504))/sqrt(9))/sqrt(8))2. 63 Simplify (0 + sqrt(425) + 4)2. 40sqrt(17) + 441 Simplify (sqrt(567) - (sqrt(567) + (sqrt(567) - -4sqrt(567)))2) + 1. -20411 + 9sqrt(7) Simplify (sqrt(132)1)/sqrt(12) - (sqrt(88) - (sqrt(88) - (sqrt(88)1 - sqrt(88))))/sqrt(8). sqrt(11) Simplify sqrt(252)/sqrt(4) + 2 + sqrt(847). 2 + 14sqrt(7) Simplify -1(sqrt(5) - (sqrt(5) - ((-3sqrt(15))/sqrt(3) + sqrt(5)))). 2sqrt(5) Simplify -3(4sqrt(95)/sqrt(5) - (sqrt(19) + -3sqrt(38)/sqrt(2))). -18sqrt(19) Simplify 6(sqrt(2057) + 1sqrt(2057)). 132sqrt(17) Simplify -4 + 4(sqrt(38)/sqrt(2))*23. 224 Simplify (sqrt(19) + -1 + 4)*2 + sqrt(1900) + -2. 26 + 16sqrt(19) Simplify (-5 + sqrt(19) + 0 + (sqrt(133)2)/sqrt(7) + sqrt(19))3. -15 + 12sqrt(19) Simplify (sqrt(1216) + -5 - sqrt(171)-5)*2. -230sqrt(19) + 10076 Simplify (6(sqrt(40) - -2sqrt(40)))/(sqrt(24)/sqrt(3)3). 6sqrt(5) Simplify sqrt(132)/(sqrt(12) - 3sqrt(192)). -sqrt(11)/11 Simplify (-5(-1 + sqrt(19) + sqrt(19) + 1 + sqrt(19))-5)2. 106875 Simplify -2(sqrt(51)/(1sqrt(3)))2. -34 Simplify sqrt(78)/(sqrt(48)/sqrt(8)-6). -sqrt(13)/6 Simplify 2 + (3 + (sqrt(2) + sqrt(6)/sqrt(3))*2 + 1)2. 26 Simplify (1 + sqrt(153) + 5 - sqrt(153)) + 3. 9 Simplify sqrt(51)/(sqrt(3)-6) - (0 + (sqrt(17) + -5)2). -42 + 59sqrt(17)/6 Simplify (-1-2sqrt(77))/(sqrt(176) + sqrt(176)1 + sqrt(176)). sqrt(7)/6 Simplify (4 + (6(sqrt(19) + 1) - ((sqrt(19) - sqrt(57)/sqrt(3)) + 3)))*2-2. -1466 - 168sqrt(19) Simplify (-2 + sqrt(170)/((sqrt(70) - (sqrt(70) - -2sqrt(70)) - sqrt(70))/sqrt(7)) + 4)*2. -4sqrt(17)/3 + 53/9 Simplify -5 + 4*(1 + sqrt(46	{ "pile_set_name": "DM Mathematics" }
20) Simplify o*(2/7)ooo(-4)/o assuming o is positive. o(-19/7) Simplify ((u/u(-3))/(u(-5/2)u))/(u(6/11)uu/u8) assuming u is positive. u(241/22) Simplify ((z/(z/z0))/z2)(-38) assuming z is positive. z76 Simplify (oo(3/13)/o)/o(-1/8) assuming o is positive. o(37/104) Simplify ((h/h(-1/3))38)(-4/29) assuming h is positive. h(-608/87) Simplify (p(-1/9))(-28) assuming p is positive. p(28/9) Simplify m*6/((m/((mmm11)/m))/m) assuming m is positive. m18 Simplify (o/(o/(((oo*(-2/3))/o)/oo)))(-3)/(o(3/5)oo(-1/2)) assuming o is positive. o(9/10) Simplify (p/p*(3/4)p/(p*5p))/(pp(-5/6)/ppppppp/(p(3/8)pp)p) assuming p is positive. p*(-205/24) Simplify oo/(o/((oo(-12))/o))oooooo(3/25)ooooo assuming o is positive. o(-22/25) Simplify (n(2/19)nnn(-8)/n)(-7) assuming n is positive. n(917/19) Simplify (m(2/5)m*(-5)m)(2/21) assuming m is positive. m(-12/35) Simplify m2/m(1/3)(mmm/(mm/(m/(m*(-1/3)m))m)m)/m(2/15) assuming m is positive. m(43/15) Simplify ww((w*25w)/w)/www(-11) assuming w is positive. w16 Simplify (t/(tt9/t))/((tt/t*(-1/4))/t)((t*(-2)/tt)/t)(2/11) assuming t is positive. t(-431/44) Simplify (y22/y)12 assuming y is positive. y252 Simplify ((u(-1))23)(-4/23) assuming u is positive. u4 Simplify r(2/7)/rr(r/r*(-2/25))/rr assuming r is positive. r(239/175) Simplify (m(-13))(-27) assuming m is positive. m351 Simplify s*(-1/7)ss(ss17)/s assuming s is positive. s(132/7) Simplify dd*(-40)dd(-13) assuming d is positive. d(-51) Simplify o(-6)o/(o(3/2)/o) assuming o is positive. o(-11/2) Simplify (v(-1/18)/(v4/v))(-2/41) assuming v is positive. v(55/369) Simplify (q*(-13)q(3/8))(-34) assuming q is positive. q(1717/4) Simplify i12ii(i/i(-19))/ii assuming i is positive. i34 Simplify ((k(-1/4))(1/4))(-3/13) assuming k is positive. k(3/208) Simplify (x5/x(-2))/(x/x1)(-36) assuming x is positive. x7 Simplify ((r/r(-1/3))/r)/(r(-2/5)/r) assuming r is positive. r(26/15) Simplify (d(-2))(-16) assuming d is positive. d32 Simplify (w*(-1/9)wwwww/(w/w(-5)))(-1/42) assuming w is positive. w(5/189) Simplify ((j(-9)/j)/jj)/(jj(-2/45)) assuming j is positive. j(-493/45) Simplify (aaa*0aa0)(20/11) assuming a is positive. a(60/11) Simplify ((zzz(2/5)zzz)/z(-5))/(z/((z(-2/7)z)/z))13 assuming z is positive. z(-221/35) Simplify c4ccc11 assuming c is positive. c17 Simplify (o(o(o*(-1/3)o)/oooo)/o)/((o/(o(o/o*9)/oo))/o)(o(1/3)o)29 assuming o is positive. o(106/3) Simplify (w*0/(www(-1/8)w))/(www(-2/3)/w)(-33) assuming w is positive. w(65/8) Simplify ((w(-3))(11/4))(-2/33) assuming w is positive. sqrt(w) Simplify (i*(-2/31)/(ii/(ii(i/(i*(-2/19)/i)i)/iiii)))(-7/8) assuming i is positive. i(-20783/4712) Simplify t(-43)/t(1/5) assuming t is positive. t(-216/5) Simplify ((c(-2/3))49)(2/3) assuming c is positive. c(-196/9) Simplify (z0)(-5/4)/(z(-6)/(zzz/(z/z4)zz)) assuming z is positive. z14 Simplify q(-7)q(-20/9) assuming q is positive. q(-83/9) Simplify c21/((c/((c/(c/(c(-12)c)))/c))/c) assuming c is positive. c9 Simplify (tt17)/t(3/14) assuming t is positive. t*(249/14) Simplify ((qq(-2/5))/q)(-49)qqq7q/q(2/25) assuming q is positive. q(738/25) Simplify (r*(-1)r)*2(((r/r*(-2/3))/rr)/r)/r3 assuming r is positive. r(-7/3) Simplify h/(h*8h)h/(hh*42/h)h assuming h is positive. h*(-48) Simplify (bb/(bb/b(-1))bbb)*45bb/(b(b/(bbb*(1/2))b)/b)b(-1) assuming b is positive. b(183/2) Simplify ((d(4/7)d)/(d/(d*0dd)))/(d(2/11)d(-5)) assuming d is positive. d(569/77) Simplify ((nnn*(-3))/n)/n(n(n/(n/n(-2/11)))/n)/n(nnnn(-3/8))/(n(n/n1)/n) assuming n is positive. n(-137/88) Simplify (m/(m/(mm(-2/13))))/(m(-3/13)/m) assuming m is positive. m(27/13) Simplify ((o0)(5/2))(-32) assuming o is positive. 1 Simplify (ff/(f(ff*(-5))/f)f*(-1/3))/((f/(f/(f(fff(-3))/f)))/(f/f(2/3))) assuming f is positive. f7 Simplify h(1/8)/h(2/37) assuming h is positive. h(21/296) Simplify ((t(-2)/t)/(t/t(-1/17)tt))/(t*10/((t/(t/(tt/(t/(t*(-2/25)t)))))/t)) assuming t is positive. t*(-6434/425) Simplify ((o(oo(4/7))/oo)/(o/((o(((oo*(-2))/o)/o)/oo)/ooo)))/(o(-2)/o(1/4)) assuming o is positive. o(79/28) Simplify (m(-5)/m)/m*(-2/15)(m(-1/3))(-50/3) assuming m is positive. m(-14/45) Simplify p(1/30)/(pp(-40)) assuming p is positive. p(1171/30) Simplify ((f/(f(-1/4)/f))/ff3)(2/65) assuming f is positive. f(17/130) Simplify (x(-4/7)/x(2/7))/(x(-1/4)/xx)(-29) assuming x is positive. x(-227/28) Simplify h(-1/14)h/(h/(h25/h)) assuming h is positive. h(335/14) Simplify (((c/c*(-3)c)/c)/(c*14c))(2/11) assuming c is positive. c(-2) Simplify (b*(-3/7)/(bb3))/(b(-1)/bb(-2)/b) assuming b is positive. b(4/7) Simplify (x(-10/3)x)/(x*(-28)x) assuming x is positive. x(74/3) Simplify (p(-1)pp/p*(-2/17)p)/(p0/p(1/7)) assuming p is positive. p*(269/119) Simplify ((ww/(ww(-1/20)))/w)(-8/3) assuming w is positive. w(-2/15) Simplify w3/ww(w/(w(1/10)w))/w assuming w is positive. w(19/10) Simplify (a(1/4)/a)/(a(-3)/a) assuming a is positive. a(13/4) Simplify ((s*(4/3)s)/(ss/(sss(-1/5))s))(-40) assuming s is positive. s(-136/3) Simplify (t*(-7)t/(t/(t/(t/(t/t(3/7))))))(-2/17) assuming t is positive. t(90/119) Simplify (k3)(-19/5) assuming k is positive. k(-57/5) Simplify (c*(-2/65)/c)/cc(-2/35) assuming c is positive. c(-190/91) Simplify ((vv/((v(3/2)/vv)/v)vv)/v)21 assuming v is positive. v(105/2) Simplify ((rr(-1)/r)/rr/((((rr6)/r)/r)/r))/(r4rr(-4)) assuming r is positive. r(-6) Simplify (w(w*(-5)w)/ww(-1/14))/(w(-3/7)/ww(2/5)) assuming w is positive. w(-213/70) Simplify (((qq/q6)/q)/q(-1/5))(-12) assuming q is positive. q(288/5) Simplify (ss(5/4)/s)/s(-10/7) assuming s is positive. s(75/28) Simplify ((x1)(2/3))(-35) assuming x is positive. x(-70/3) Simplify ((h1)25)(9/2) assuming h is positive. h*(225/2) Simplify ll*(2/33)/ll*(-8)l/(l/(lll((l(-1)l)/l)/l))l1 assuming l is positive. l(-196/33) Simplify ((l15l)/(l*(-2/17)l))(-7) assuming l is positive. l(-1799/17) Simplify (vv/(((v/(v/v(-2/7)))/v)/v))25 assuming v is positive. v(750/7) Simplify ((q/(q(-3/2)q))/q(2/5))(4/9) assuming q is positive. q*(22/45) Simplify (k/((k/(kkkk(2/5)))/k))(2/75) assuming k is positive. k*(44/375) Simplify (ss2/s)/s(-3)((ss(-1/3))/s)(-27) assuming s is positive. s14 Simplify ((g(-4/7)g)(15/8))42 assuming g is positive. g(135/4) Simplify (y(-6)y/(y/((yy10y)/y)))/((y*(-8)y)/(y(y2y)/yy)) assuming y is positive. y16 Simplify m(5/4)/m(-2/19) assuming m is positive. m(103/76) Simplify p/p(-26)p(-2/21) assuming p is positive. p(565/21) Simplify (j(-1))(-34)(j6j)/(j/(j(-7)/j)) assuming j is positive. j32 Simplify (i/(i*(-14)/ii))/ii(-28) assuming i is positive. i(-14) Simplify (v/v(-1))(-45)v2/v(2/3) assuming v is positive. v(-266/3) Simplify (z/z(1/21)zz*(-2)z)(-26) assuming z is positive. z(-520/21) Simplify (xxx/(x*(-3)x)x(1/3))/(x(-1/2)x(-1/4)) assuming x is positive. x(73/12) Simplify (t(2/19)/(t(-4)/t))/(t*(-4/7)t(-4)) assuming t is positive. t(1287/133) Simplify (x/((xx0/x)/x)x/(((x*(4/7)x)/x)/x))/(x*5/(xx*(-1/6)x)) assuming x is positive. x(11/42) Simplify ((m/m(3/5))/m(-4))/(m(-1)m)50 assuming m is positive. m(22/5) Simplify (n(-2)n*(-2))/(nnn0)(-5/3) assuming n is positive. n(-2/3) Simplify (n(1/3)n)0/(n(2/9)/(n(nn/(n/n*(-3)n)nn)/n)) assuming n is positive. n(-11/9) Simplify (((p1pp)/p)/p)(-2/5)/(p(3/2)p/(pp/(p/((p/p*(-5))/p)))p) assuming p is positive. p(21/10) Simplify (l/l0)/(l	{ "pile_set_name": "DM Mathematics" }
-2767/151 or -19? -19 Which is smaller: -29891 or -29889? -29891 Is -477236 less than or equal to 2? True Are 1/71594 and 25 equal? False Are 12/454855 and 1 non-equal? True Which is greater: -33 or 6.87? 6.87 Is 105152 smaller than 105157? True Do 235 and 2054 have the same value? False Is -64 less than 0.03698? True Which is greater: -2572/165 or -15? -15 Do 0.3 and 25023 have the same value? False Is 21.5 bigger than 1.54? True Which is bigger: 603 or 643? 643 Which is smaller: 44430 or 44432? 44430 Does -2 = -37216? False Is -1235.53 bigger than -0.3? False Which is smaller: 15.4 or -462/5? -462/5 Which is smaller: -422237 or -422240? -422240 Which is bigger: 27/14 or 804? 804 Is 152943 greater than 152943? False Is 2/5 at most 2990968? True Which is bigger: 0 or -0.596? 0 Which is bigger: 1 or 0.087214? 1 Is -2/145605 greater than or equal to 1? False Which is smaller: -375 or 45? -375 Which is smaller: -21656 or -21655? -21656 Is 208/155 at least 2? False Which is bigger: -4108/105 or -40? -4108/105 Which is smaller: -24307 or -24211? -24307 Which is greater: 4/34553 or 0? 4/34553 Which is greater: 244388/5 or 48879? 48879 Is 0.08 less than or equal to 3094/33? True Is 46853 equal to 46856? False Is -10443 at most 2? True Is -42109 less than or equal to -42064? True Is -9/16 greater than 2.394? False Do -8610/173 and -49 have the same value? False Which is smaller: -11333 or -11423? -11423 Is -18 at least -330? True Are 12447 and 12449 non-equal? True Which is greater: 0 or 1/9287? 1/9287 Are 587658 and 2 equal? False Which is smaller: -4223686 or -4223685? -4223686 Is 990.65 less than -3? False Is -18820 greater than -18801? False Is -389 at most as big as -496? False Do -2092 and -2069 have the same value? False Is -487913 smaller than -487914? False Which is smaller: -240811 or -240808? -240811 Is -35810/13 smaller than -2755? False Which is greater: 0 or -4/249635? 0 Which is smaller: -286 or 1.8? -286 Which is smaller: 1/7231995 or -1? -1 Is -187809 equal to -1126853/6? False Which is greater: -468 or -1/265? -1/265 Is 85/48934 at most as big as -1? False Which is greater: 1350688 or 1350689? 1350689 Is 84237 greater than 84237? False Which is greater: -166 or -13098/79? -13098/79 Which is greater: 1125688 or 1125687? 1125688 Which is bigger: 1 or 2/28989? 1 Are -216426/17 and -12730 non-equal? True Are 5215 and 5227 unequal? True Which is greater: -2 or -1227/895? -1227/895 Which is greater: 167329 or 167333? 167333 Are -3294 and -1/3 nonequal? True Do -164 and 16/49 have the same value? False Does 18244 = 18234? False Which is smaller: -1 or 33/65107? -1 Are 48964 and 48973 non-equal? True Are -8/22643 and 1 non-equal? True Which is greater: 969 or 60? 969 Which is smaller: 969030 or 969028? 969028 Does 9 = -7.3? False Which is smaller: 40414 or 40411? 40411 Is 24697 >= 24699? False Which is greater: -4768 or -4785? -4768 Is 449740 greater than or equal to 0.2? True Which is smaller: 0 or 305740? 0 Is 228 != -279? True Is 19913 at least as big as 19913? True Is 27/5 at least as big as 0.023? True Which is smaller: 496 or 2464? 496 Which is bigger: 12/73127 or 0? 12/73127 Are 1604 and -2766 equal? False Is -8817 equal to -8949? False Is -12015/152 less than or equal to -79? True Is 3/907588 < -1/2? False Is -7029 > -81? False Is -72494/195 bigger than -372? True Which is greater: 151104 or 151102? 151104 Which is greater: -84648 or -84649? -84648 Are -69692 and -69693 equal? False Is -140 at least as big as -402? True Which is smaller: -15965 or -15906? -15965 Are -1 and -9/18391 unequal? True Is 86636 equal to 86632? False Which is smaller: 2 or 279/170? 279/170 Is -40059 at least as big as -40064? True Are -12940 and -12815 equal? False Which is bigger: 2619/11 or 238? 2619/11 Which is smaller: 245028 or 245025? 245025 Which is greater: -3 or -622/333? -622/333 Which is smaller: 3/4 or 4535? 3/4 Are 1 and -2/2304383 unequal? True Is -8713 < -0.4? True Which is bigger: -1918708 or -1918706? -1918706 Is 1020/13 > 77? True Which is greater: 141438 or 141427? 141438 Does 28351 = 28346? False Which is smaller: -1 or -4/21229? -1 Which is bigger: -8902 or -8904? -8902 Which is smaller: -1 or 5745? -1 Is -29349 smaller than -29345? True Is -4513/17 less than -266? False Which is bigger: -7539160/3 or -2513054? -7539160/3 Which is greater: 1164 or 656/5? 1164 Is 299 greater than or equal to 386? False Are 0 and -110/34047 nonequal? True Is -133516 less than -133517? False Which is smaller: -890/773 or -1? -890/773 Which is greater: -3668 or -3677? -3668 Which is smaller: -11065 or -1? -11065 Is -1429/61 equal to -23? False Are -0.9143 and 2/85 equal? False Is 842 > -2691? True Is -0.7 at least -213056? True Is -34/98759 at least as big as 0? False Which is bigger: -328/343 or -1? -328/343 Which is greater: 0.1 or 105542? 105542 Which is smaller: 5035 or 5029? 5029 Is -23102 less than -23097? True Which is smaller: -1 or -98/1129? -1 Which is greater: 1942 or 1891? 1942 Is 0 greater than 24/77? False Which is smaller: 21782 or 21697? 21697 Are -40416 and -40391 nonequal? True Which is smaller: -15 or 11596? -15 Which is smaller: 0 or 158/2527? 0 Is -12448 > -12452? True Which is greater: -5253 or -798? -798 Which is greater: -66533 or -66532? -66532 Is -998226 >= -998227? True Is 36.685 greater than or equal to 3? True Are -9149 and -9108 unequal? True Is 17467 >= 17469? False Which is smaller: 2/190117 or -1? -1 Is 19103 equal to 19103? True Are -65851 and -65859 nonequal? True Is 101709 less than 101707? False Is -7345 greater than -7343? False Are -252279/37 and -6819 unequal? True Do -1/27248 and -1 have different values? True Is 15 < 240/11? True Is -1 > -2/104567? False Which is smaller: -1832 or -2/61? -1832 Which is bigger: -1 or -3/2347427? -3/2347427 Are 4668909 and 4668908 non-equal? True Which is greater: 2738 or -698? 2738 Which is smaller: -97231 or -0.1? -97231 Which is bigger: 14098 or 14091? 14098 Are 18543 and 4 unequal? True Are -170692 and -170693 unequal? True Is -8100 > -8109? True Are -26140 and -26139 unequal? True Which is smaller: 30010 or -0.06? -0.06 Which is smaller: 7962 or 363? 363 Which is smaller: 348 or 35736/103? 35736/103 Are 516255/7 and 73752 equal? False Which is greater: 14149 or -32? 14149 Which is greater: -0.0434 or -3/563? -3/563 Is -1802 bigger than -0.037? False Which is greater: 0.3339 or 16? 16 Are 0 and 404/967 unequal? True Which is bigger: 2/5 or 3625/8? 3625/8 Which is smaller: 99/26 or 44/17? 44/17 Which is greater: 64 or -2762.2? 64 Which is bigger: -69446/27 or -2571? -2571 Which is smaller: 0 or 2/578405? 0 Is -3/8 less than 2745? True Are -11423 and -11401 unequal? True Which is smaller: 0 or 560336? 0 Is 1 at least -6/81215? True Which is bigger: -194 or -35? -35 Is 8469 smaller than 21? False Which is smaller: 1 or -1/84382? -1/84382 Is -38709 at most as big as -38710? False Which is bigger: 970770 or 970771? 970771 Are -1 and -3/11887790 equal? False Is -180698 greater than -180698? False Which is greater: 0 or 313/219? 313/219 Is -105 less than or equal to -17350/167? True Does -2 = 131508? False Which is smaller: -0.31 or -0.05733? -0.31 Do -31653 and -221565/7 have the same value? False Is 1118 at most 1766? True Is 6561/7 greater than 936? True Which is bigger: 25734 or 25732? 25734 Is -106683 less than -106684? False Which is smaller: -45180 or -45187? -45187 Which is smaller: -7.61 or 5? -7.61 Which is bigger: 0.865 or 0.04? 0.865 Which is greater: 7508/65 or 117? 117 Are -3046621 and -3046623 nonequal? True Which is bigger: 0.04973 or -1/12? 0.04973 Is 1/16 greater than or equal to 0.298? False Is 104193/5 >= 20839? False Which is smaller: 7579 or 7572? 7572 Is -89 <= -2545/29? True Which is greater: -31.5 or -70/13? -70/13 Is 3/1040824 smaller than -1? False Which is smaller: 191 or -73? -73 Which is smaller: -148256 or -148261? -148261 Is 10/156151 at most -1? False Which is smaller: -1 or -2/258083? -1 Does -122469 = -122473? False Is -221 > 1263? False Which is bigger: -195 or -646? -195 Which is greater: 2/6111 or 353? 353 Which is smaller: 0.1 or 331848? 0.1 Is -3238/7 at least as big as -2? False Is -558289 at least -2791442/5? False Which is smaller: 1486 or	{ "pile_set_name": "DM Mathematics" }
without replacement from {f: 2, k: 2, u: 5}. Give prob of picking 2 k and 1 f. 1/42 What is prob of picking 1 w, 1 y, and 1 q when three letters picked without replacement from dqwzzyy? 2/35 Two letters picked without replacement from ccccc. Give prob of picking 2 c. 1 Four letters picked without replacement from {w: 1, m: 5, v: 1, p: 2, o: 1, r: 6}. What is prob of picking 1 p, 1 r, 1 w, and 1 o? 3/455 Calculate prob of picking 2 h when two letters picked without replacement from {n: 7, h: 12}. 22/57 Calculate prob of picking 4 o when four letters picked without replacement from {o: 9, y: 2, f: 6}. 9/170 Four letters picked without replacement from {o: 2, a: 4, u: 1, k: 1}. What is prob of picking 2 o, 1 k, and 1 u? 1/70 What is prob of picking 2 y when two letters picked without replacement from {y: 2, c: 2}? 1/6 What is prob of picking 2 l and 2 p when four letters picked without replacement from {l: 11, p: 2}? 1/13 Calculate prob of picking 2 z and 2 j when four letters picked without replacement from jzjzzzjzjjjj. 14/33 Four letters picked without replacement from {u: 1, f: 3, c: 2, z: 1, k: 6}. Give prob of picking 1 c and 3 k. 8/143 Calculate prob of picking 2 e when two letters picked without replacement from zezzee. 1/5 What is prob of picking 2 p and 1 c when three letters picked without replacement from {c: 6, p: 2}? 3/28 What is prob of picking 1 u and 1 q when two letters picked without replacement from {a: 10, q: 4, u: 2}? 1/15 Four letters picked without replacement from {p: 2, z: 2, g: 2}. What is prob of picking 2 g and 2 z? 1/15 Calculate prob of picking 1 r, 1 q, and 1 d when three letters picked without replacement from qsqrxdm. 2/35 Calculate prob of picking 1 w and 2 b when three letters picked without replacement from zzwdzdbdwzbdbzwdxdd. 3/323 What is prob of picking 1 y and 2 n when three letters picked without replacement from nynyynnnnny? 28/55 Three letters picked without replacement from kikk. What is prob of picking 2 k and 1 i? 3/4 Three letters picked without replacement from hhhhhfhfhhh. Give prob of picking 2 f and 1 h. 3/55 Four letters picked without replacement from {f: 1, n: 1, t: 1, r: 3, k: 1}. What is prob of picking 1 k, 1 t, and 2 r? 3/35 Calculate prob of picking 1 t and 2 r when three letters picked without replacement from {t: 2, r: 2, o: 2, m: 4, d: 2}. 1/110 What is prob of picking 2 p when two letters picked without replacement from {d: 2, l: 3, p: 10}? 3/7 Two letters picked without replacement from {p: 1, a: 1, b: 1, q: 1, m: 1, t: 2}. Give prob of picking 1 q and 1 m. 1/21 Three letters picked without replacement from {h: 3, w: 2}. What is prob of picking 3 h? 1/10 Calculate prob of picking 3 d when three letters picked without replacement from daddddddaddd. 6/11 Calculate prob of picking 2 y and 2 p when four letters picked without replacement from {y: 3, p: 8}. 14/55 Two letters picked without replacement from hlgghdggllh. Give prob of picking 1 l and 1 g. 12/55 What is prob of picking 1 o, 1 p, 1 k, and 1 x when four letters picked without replacement from {p: 1, k: 3, e: 2, o: 6, x: 1}? 18/715 Three letters picked without replacement from {i: 2, c: 5}. Give prob of picking 1 c and 2 i. 1/7 Four letters picked without replacement from lbyllylblllylllllb. Give prob of picking 1 y and 3 b. 1/1020 Calculate prob of picking 3 l when three letters picked without replacement from {a: 8, l: 3}. 1/165 What is prob of picking 1 j and 1 d when two letters picked without replacement from ddgdpjjgdpdggjj? 4/21 Three letters picked without replacement from {d: 6, q: 7}. What is prob of picking 1 q and 2 d? 105/286 Calculate prob of picking 1 k and 3 t when four letters picked without replacement from {g: 2, z: 1, w: 1, k: 2, t: 6}. 8/99 Calculate prob of picking 4 c when four letters picked without replacement from {c: 4, g: 7}. 1/330 Three letters picked without replacement from {k: 3, l: 4}. Give prob of picking 2 k and 1 l. 12/35 Calculate prob of picking 1 w and 1 y when two letters picked without replacement from {w: 1, y: 2}. 2/3 Two letters picked without replacement from bbbe. Give prob of picking 2 b. 1/2 Three letters picked without replacement from {p: 1, t: 4, a: 2, o: 10}. Give prob of picking 1 a and 2 o. 9/68 What is prob of picking 2 l when two letters picked without replacement from ddjdlldjdldjjddlj? 3/68 Calculate prob of picking 2 y, 1 l, and 1 p when four letters picked without replacement from {p: 3, y: 13, l: 3}. 117/646 What is prob of picking 2 z when two letters picked without replacement from sllzzzqzx? 1/6 Two letters picked without replacement from {w: 1, l: 5, k: 1, x: 3, o: 2}. What is prob of picking 1 k and 1 o? 1/33 Two letters picked without replacement from {k: 9, u: 8, w: 2}. Give prob of picking 1 u and 1 k. 8/19 Calculate prob of picking 1 y and 1 d when two letters picked without replacement from {y: 1, d: 2, m: 5, u: 1, r: 1}. 2/45 Calculate prob of picking 1 u and 1 j when two letters picked without replacement from sssuj. 1/10 Two letters picked without replacement from mhrmrhrrhmmhhhmh. What is prob of picking 1 m and 1 r? 1/6 Four letters picked without replacement from pppppeppppeeeeppepp. What is prob of picking 3 e and 1 p? 65/969 Calculate prob of picking 2 h and 1 z when three letters picked without replacement from lhzhfzzz. 1/14 Two letters picked without replacement from {k: 3, w: 2, g: 5}. What is prob of picking 1 k and 1 g? 1/3 Three letters picked without replacement from {y: 1, q: 3, i: 1, x: 2, p: 5}. What is prob of picking 2 x and 1 p? 1/44 Four letters picked without replacement from rgggrukllgkklrlkv. Give prob of picking 3 r and 1 k. 1/595 What is prob of picking 1 h and 2 f when three letters picked without replacement from fahaftthf? 1/14 Three letters picked without replacement from dununxsxdndssx. What is prob of picking 1 n, 1 d, and 1 u? 9/182 Four letters picked without replacement from {w: 10, b: 3, r: 2}. What is prob of picking 4 w? 2/13 Four letters picked without replacement from uxuxpxxsxxpxxpxs. What is prob of picking 2 p and 2 x? 27/455 What is prob of picking 1 s, 1 q, and 1 d when three letters picked without replacement from vqmsd? 1/10 Four letters picked without replacement from jajaeajaaeaj. What is prob of picking 1 a, 2 e, and 1 j? 8/165 Three letters picked without replacement from nnnnhhhn. Give prob of picking 1 n and 2 h. 15/56 Three letters picked without replacement from yuyyyuqqyyauuyii. What is prob of picking 1 y, 1 u, and 1 a? 1/20 What is prob of picking 1 c and 1 u when two letters picked without replacement from {u: 3, c: 5, h: 2}? 1/3 Calculate prob of picking 1 h and 2 r when three letters picked without replacement from hrrhrrrqrhhrhrhqr. 27/85 Two letters picked without replacement from {h: 2, w: 1, f: 1, m: 2, x: 1, g: 1}. Give prob of picking 1 h and 1 f. 1/14 What is prob of picking 1 r and 1 v when two letters picked without replacement from vzenr? 1/10 What is prob of picking 1 w, 1 d, and 1 e when three letters picked without replacement from dwwxewxddx? 3/40 Three letters picked without replacement from uaddddauauddaua. Give prob of picking 3 a. 2/91 What is prob of picking 1 m and 1 u when two letters picked without replacement from {d: 2, u: 2, t: 2, r: 2, m: 4}? 4/33 What is prob of picking 2 m and 2 f when four letters picked without replacement from mfiddifmmifmmmf? 6/91 Calculate prob of picking 2 t and 1 h when three letters picked without replacement from {w: 3, v: 2, h: 4, t: 1, f: 2}. 0 Four letters picked without replacement from {a: 6, z: 13}. Give prob of picking 4 z. 715/3876 What is prob of picking 2 q, 1 d, and 1 t when four letters picked without replacement from {d: 2, q: 2, c: 1, h: 1, k: 2, t: 1}? 1/63 Two letters picked without replacement from {i: 1, m: 2, r: 2, k: 1, l: 1}. Give prob of picking 1 r and 1 i. 2/21 Calculate prob of picking 2 z when two letters picked without replacement from zzzzzzzezzzzzzzzzz. 8/9 What is prob of picking 1 t and 1 c when two letters picked without replacement from {e: 7, c: 2, t: 6}? 4/35 What is prob of picking 4 c when four letters picked without replacement from ccccczzccc? 1/3 Two letters picked without replacement from drudiff	{ "pile_set_name": "DM Mathematics" }
g(p) be the first derivative of 1/4p4 + 0p - 14 - 11/5p5 + 0p*2 + 43/3p*3. Find the third derivative of g(r) wrt r. -264r + 6 What is the third derivative of 4p2 - 25p*2 + 9p*2 + 12 - 3p*4 - 38p*3 + 17p*2 wrt p? -72p - 228 Let t(u) be the second derivative of 4/3u4 - 8/15u*6 + 0u*5 + 0 + 0u*3 - 20u + 0u2. What is the third derivative of t(z) wrt z? -384z Let c(a) = a*3 + 17a*2 + 5a - 10. Let x be c(14). Find the third derivative of -15g2 + 6136 + 51g*4 - x wrt g. 1224g What is the derivative of 13 - 258 - 7u3 + 5u - 10u3 - 2u*3 wrt u? -57u*2 + 5 Let z(n) be the first derivative of 10n*2 + 15n*2 - 9n*2 + 7n - 33n - 27. What is the first derivative of z(g) wrt g? 32 Let k(a) = -8a*3 - 4a*2 - a + 4. Let y(f) = 14f*3 + 9f*2 + 2f - 7. Let z(q) = 11k(q) + 6y(q). What is the second derivative of z(g) wrt g? -24g + 20 Suppose 3j - 2d + 35 = 2d, -4d = -4j - 40. Let t = j + 12. Find the third derivative of -3r2 - 6r*6 + tr6 + r6 wrt r. 240r3 Let y(d) = -4d - 2. Let c be y(-2). Suppose -2q = q - 15. Find the third derivative of -7l*3 - ql*5 - cl*2 + 7l*3 wrt l. -300l*2 Suppose -4l - 8 = -u - 0u, -l - 17 = -4u. Suppose -j + 35 = uj. What is the second derivative of -114c*3 - jc*4 - c + 114c*3 wrt c? -84c*2 Let l = 50 - 44. Find the second derivative of -4r*4 + 16r - lr + r4 wrt r. -36r2 Let q(j) be the third derivative of j6/120 - 11j5/6 + j4/8 + 24j*3 - 113j*2. What is the second derivative of q(m) wrt m? 6m - 220 Let f(a) be the first derivative of -279a2/2 + 374a + 411. Differentiate f(x) wrt x. -279 What is the first derivative of -446 + 161c4 - 1297 + 1089 wrt c? 644c*3 Let l = -7 - -8. Let c(v) = -4v*3 + 2 + 3v2 - 4 - v2. Let y(p) = p*2. Let m(d) = lc(d) - 2y(d). Find the first derivative of m(s) wrt s. -12s2 Find the first derivative of z4 + 2617 - 44z3 + 5z*3 - 2859 wrt z. 4z*3 - 117z2 Find the second derivative of m4 - 3m3 + 0m*4 - 6m*4 - 3 - 6m + 21m4 wrt m. 192m*2 - 18m Let q(k) = -20k2 + 95k. Let c(m) = m*2 + m. Let o(p) = -10c(p) - q(p). Find the second derivative of o(b) wrt b. 20 Let o(g) = g*2 + 9g + 22. Let n be o(-6). Let q = 2 - -1. Find the third derivative of -z*2 - 9z*6 + qz*5 - 3z*5 - nz*2 wrt z. -1080z*3 Suppose 4h + 4y = 4, 4h + 2y = -0y + 6. What is the first derivative of -hd2 - 10 + 6d*2 + 6d*2 wrt d? 20d Suppose -4s - 62 = -2s. Let m = -29 - s. What is the third derivative of -4w2 - 3w*m - 23w*5 + 20w*5 wrt w? -180w*2 Let i(g) be the second derivative of 0g*4 - 2g + 13/20g5 + 0g*2 - 1/3g*3 + 0. What is the second derivative of i(r) wrt r? 78r Let d(p) be the third derivative of -299p7/210 - p4/6 - p3/2 - 201p*2. Find the second derivative of d(a) wrt a. -3588a*2 Let d(q) = -2q*2 + 2q + 1. Let z(a) = -252a2 + 4a - 211. Let r(k) = 2d(k) - z(k). Differentiate r(i) with respect to i. 496i Find the third derivative of -2r6 - 40r*5 - 208r*5 - 7180r*3 + 7180r*3 + 462r*2 wrt r. -240r*3 - 14880r*2 Suppose 10k = 6k + 16. What is the third derivative of 2l*4 - 3l*k - 9l*4 + 9l*2 + 0l*4 wrt l? -240l Let m be ((-6)/4)/((-18)/48). Suppose -2 = -mr + 6. Find the first derivative of 3s*3 - 6s*3 + r - 4s*3 + 0 wrt s. -21s*2 Find the first derivative of 6g*4 + 0 - 81g*4 - 56 + 20g + 0 - 17g wrt g. -300g*3 + 3 Suppose 0 = -67w + 70w - 5427. What is the first derivative of 1800 - w - 6g*2 - 4g*2 wrt g? -20g Let p be ((-27)/(-12))/(0 + 2/8). What is the first derivative of 6 + 24d - 43 - pd wrt d? 15 Let c(v) be the third derivative of 113v6/120 - v5/60 - 3v*2 + 8. What is the third derivative of c(l) wrt l? 678 Let c(u) be the second derivative of -23u6/3 + u3/3 - 361u2/2 - 406u. Find the first derivative of c(x) wrt x. -920x3 + 2 Suppose -3b = -3t - 24, 2t + b + b = 0. Let c be 6/7(-14)/t. What is the second derivative of -5x*c + 0x*3 + 4x*3 + 4x wrt x? -6x Let n(t) be the third derivative of 13t7/210 + t6/120 + t*5/30 - 23t*3/3 - 151t*2. Find the third derivative of n(y) wrt y. 312y + 6 Let f(t) = 4t. Let n(w) = 88w*2 + 20w + 18. Let x(a) = 10f(a) - 2n(a). What is the first derivative of x(r) wrt r? -352r Let r be (39/4)/(3/(-12)). Let o be r/(-15) - 3/5. Find the third derivative of -3a*3 - 5a*3 + 3a*3 + 5ao wrt a. -30 Let u(r) = r2 + 5r + 5. Let c be u(-6). What is the first derivative of y + y + c + 6y*3 - 2y wrt y? 18y2 Let u be 15/10 - (-2)/4. Suppose -5r + a = -17, 8 = -2a - ua. What is the first derivative of n*r - 1 - 1 + 0 + 2n*3 wrt n? 9n*2 Suppose 6 + 2 = 2o. Find the third derivative of 0v6 + 4v2 - v6 + ov2 wrt v. -120v*3 Differentiate -82 - 30z*4 - 30z*4 + 85z*4 + 24 - 61z*4 wrt z. -144z*3 Let a = 4 - 0. What is the third derivative of 14l2 - l2 - al4 - 6l2 - l2 wrt l? -96l What is the second derivative of -12 + 380b + 12 + 4b2 + 3b*2 - 5b*2 - 45b*4 wrt b? -540b*2 + 4 Suppose -13 = x - 15. Differentiate 5l*2 - 12 - 13l*x - 6l + 6l with respect to l. -16l Let c be 20/618/4. Suppose -3t + 3s = 0, -2s = 3t - 0t - c. What is the third derivative of tx2 + 17 + 3x*6 - 17 - 4x*2 wrt x? 360x*3 Let z = 33 + -26. What is the third derivative of zu*3 - 11u*3 - 4u*3 + 2u*2 wrt u? -48 Find the first derivative of 102 - 359l*4 - 51 - 135 wrt l. -1436l*3 Let d be (-44)/(-11)((-3)/(-4))/1. What is the second derivative of 2633a - 3a*3 - 2670a + 5ad wrt a? 12a Let c(b) be the second derivative of 365b4/12 + 53b*3 + 3b - 28. Find the second derivative of c(a) wrt a. 730 Let i(y) = -5y4 - 7y*3 - 25y2 + 5. Let j = -158 - -157. Let m(c) = -c3 + 1. Let x(h) = ji(h) + 5m(h). What is the third derivative of x(f) wrt f? 120f + 12 Suppose 2m - m = -2m. Let n(z) be the third derivative of 0 - 1/6z*3 - 2/15z*5 + mz + 0z4 - 8z*2. Find the first derivative of n(d) wrt d. -16d What is the second derivative of -123 + 56l2 - 111 - 276l + 234 wrt l? 112 Let r(m) be the first derivative of -4m5/5 - 14m*3/3 - 5m*2/2 + 5m + 166. What is the second derivative of r(x) wrt x? -48x2 - 28 Let j(x) = -x. Let h be j(-4). Suppose 0 - h = -2a. What is the second derivative of 3z5 + az - 7z + 6z wrt z? 60z3 Suppose -x + 28 = 4r, -r = 3r - 4x - 28. What is the second derivative of 19n2 - rn*2 - 6n - n*2 wrt n? 22 Find the second derivative of -2c + 3 + 0c + c - c - 79c*2 - 5c wrt c. -158 Let a(w) = 4 + 0w2 + 3w*2 + 11w - 2w2. Let y be a(-11). What is the third derivative of 3j*2 - 6j*2 - 3j*4 + 0j*y wrt j? -72j Let x be (2 + (3 - 9))-2. Differentiate -2 - 11 + xk*4 - 7k*4 wrt k. 4k*3 Suppose 4 = -4l, 0v + 34 = 5v - 4l. Suppose v = 2p - 2. Find the second derivative of 8t2 - pt*4 - 8t*2 + 5t + 6t4 wrt t. 24t*2 Let d(y) = -46y*3 + 4y*2 - 2y - 90. Let k(t) = 42t3 - 3t*2 + t + 89. Let j(m) = -3d(m) - 4k(m). What is the second derivative of j(n) wrt n? -180n Let q(v) = v5 + v4 - v*3. Let x(a) = 173a*6 + 5a*5 + 5a*4 - 5a*3 + 21a*2. Let o(d) = 5q(d) - x(d). Find the third derivative of o(w) wrt w. -20760w3 Let a(z) = -z + 17. Let x be a(-8). What is the third derivative of xm*5 + 5m*2 + 20m*5 - 9m*5 wrt m? 2160m*2 Let g = -222 + 473. Let f be g/1 + 4 + -7. What is the third derivative of 8y*4 + 13y*2 - 248y*3 + fy*3 wrt y? 192y Let k = 1364 + -1362. Let f(x) = -x4 - 1. Let r(y) = y4 + 0y4 + 3y*4 + 9 - y. Let j(c) = kr(c) + 18f(c). Find the second derivative of j(s) wrt s. -120s*2 Let j(n) be the first derivative of -7n*2 - 7n + 20. What is the first derivative of j(z) wrt z? -14 Find the second derivative of 186t - t3 - 550t*2 - 37t + 553t2 wrt t. -6t + 6 Suppose -4d = -5d + 26. Let g = d - 15. What is the second derivative of -5x3 - x - gx + 5x wrt x? -30x Let j be 102/5 - -6(-5)/(-50). Find the first derivative of jr*4 + 113r + 14 - 113r + 1 wrt r. 84r*3 Let c(y) = 42y*3 + 164y*2 - 10y	{ "pile_set_name": "DM Mathematics" }
nd v? 18 Let y(d) = 5d2 - 3d2 - d2 + 4 + d. Let w be y(-4). Let l be (22)/(1/10). Calculate the highest common factor of l and w. 8 Let y = 1 - -41. Suppose -66 = -2c + 2t + 2t, 5c + 5t = 105. Let m = c - 18. What is the highest common factor of y and m? 7 Let x(w) = -w*3 + 3w*2 + 3w + 16. Let k be x(4). Calculate the greatest common divisor of 4 and k. 4 Let q(u) = 6u2 + u + 1. Let l be q(-1). Calculate the highest common factor of l and 18. 6 Suppose 0 = -2a - 2b + 104, 5b + 75 = 2a - 43. Let r(z) = z2 + z - 3. Let w be r(3). Calculate the highest common factor of w and a. 9 Let x(a) = -5a - 1. Let r be x(-4). Let f be (-5 - -4)/((-2)/76). Calculate the highest common divisor of r and f. 19 Suppose -l - l = -2. Let z be (-2 - 12)l/(-2). Let t(c) = 6c*2 + 2c + 1. Let q be t(-3). Calculate the highest common factor of z and q. 7 Let x = -41 - -71. Suppose -4g - 5v + 25 = -19, 2g + 2v - 20 = 0. Calculate the greatest common divisor of x and g. 6 Let h = -6 - -10. Let u = h - -1. Let v be -2(102/(-4) + -2). Calculate the greatest common factor of u and v. 5 Let v = 7 - 0. Let l be (-4)/(-2) + (0 - 3). Let y be -7(12/(-1) - l). What is the highest common divisor of v and y? 7 Let v(p) = -p - 1. Let f be v(-3). Suppose 0 = -s + 4, 0 = 5u - 0s - 5s - 30. Calculate the highest common divisor of u and f. 2 Let g be (-9 + 1)/(2/(-1)). Suppose gv = 2v + s - 15, -2s = -3v - 22. Let b be (-12)/v8/6. Calculate the highest common divisor of 6 and b. 2 Suppose -3p = 2p - 70. Suppose u + 3v - 111 = -18, 333 = 4u - v. What is the greatest common divisor of u and p? 14 Suppose 5m + 111 = 3j, 81 = -j + 4j + 5m. Suppose 3d + 5i - 37 = 0, i - 2 + 3 = 0. Let r be 119/d + 2/(-4). What is the greatest common factor of j and r? 8 Let k(x) = x*2 + 7x - 5. Let h be k(-10). Calculate the greatest common factor of 75 and h. 25 Let g = 10 - 14. Let u be 2/6 - g/(-12). Suppose uv - 32 = -v. What is the greatest common factor of v and 48? 16 Suppose 9j = 108 + 45. What is the highest common divisor of j and 119? 17 Let h(f) = 5f3 + f2 - f. Let w be h(1). Let x be (-1 + 77)w/4. What is the highest common divisor of 38 and x? 19 Suppose -147 = -2x - n, 3n + 42 = 3x - 201. Calculate the highest common divisor of x and 19. 19 Let q be 9/1(-1760)/(-60). Calculate the highest common factor of 24 and q. 24 Let x = 7 - 11. Let m(w) be the first derivative of w*4/4 + 4w3/3 - w2/2 + 2w + 1. Let t be m(x). What is the highest common divisor of t and 42? 6 Suppose -12 = -3w, -k - k = -3w - 60. What is the greatest common divisor of k and 9? 9 Suppose 5b - 119 + 9 = 0. Let c = b + -3. Calculate the highest common divisor of 133 and c. 19 Let y(b) = -2b - 6. Let s be y(-6). Let r be (s/(-8))/(3/(-72)). Calculate the highest common factor of r and 18. 18 Let b = -4 - -6. Suppose -3l - 7 = b. Let p be ((-6)/(-10))/(l/(-30)). Calculate the greatest common divisor of p and 6. 6 Let a(v) = v3 - v2 + v + 77. Let y be a(0). Let c(m) = m*3 + 2m*2 - 2m - 1. Let b be c(2). Calculate the highest common divisor of y and b. 11 Let w = -14 - -39. Let h(a) = 8a2 + 0a*2 + 16 - 7a*2 - 6. Let m be h(0). Calculate the highest common factor of m and w. 5 Let f = 280 - 71. Calculate the highest common factor of 19 and f. 19 Suppose 0 = h + 4 + 1. Let g be 36h1/(-4). Let t = g + -23. What is the highest common factor of 198 and t? 22 Let i(p) = -24p - 1. Let l be i(-1). Suppose -9y - 75 = -282. Calculate the highest common divisor of y and l. 23 Let l be 22(0 - -2) + 1. Let d be (-38)/(-8) + ((-13)/(-4))/13. What is the highest common factor of l and d? 5 Suppose -2 = o - 5. Let f be 2/1 - (o + -45). What is the greatest common factor of 110 and f? 22 Let z = -228 + 323. Let k = 199 + -123. Suppose k = i + i. Calculate the greatest common divisor of i and z. 19 Let j = 10 - -5. What is the greatest common divisor of j and 5? 5 Suppose -17n + 15n = -64. Let f = 7 + -3. What is the highest common factor of f and n? 4 Let y be -3 + -2 + 3 + 6. Suppose 2a - 84 = -s, 3a = 10 - y. Calculate the highest common divisor of s and 32. 16 Let t = 22 - 10. Let v be 3240/t. Calculate the highest common factor of v and 5. 5 Suppose 4m - m = 0. Suppose -2 = -n - mn. Suppose y = 3l + l - 61, 3y = 5l - 71. Calculate the highest common factor of n and l. 2 Suppose -4g + 2r + 58 = 0, -4g + 82 = -4r + 26. Calculate the greatest common factor of 75 and g. 15 Let u be 12/(-1)1/(-3). Let j = 46 + -10. Suppose -um = -5n - 105, 0 = 2m - m + 2n - j. What is the greatest common divisor of 6 and m? 6 Suppose -5r + 3n + 39 + 18 = 0, -2n = -2. Calculate the highest common divisor of r and 132. 12 Suppose 5x - 3j - 37 = 0, 2x - j - 14 = -0j. What is the highest common factor of 45 and x? 5 Let i = 29 + 3. Let u = i - 18. Calculate the greatest common divisor of u and 154. 14 Suppose 18 = 2c + 4. Calculate the greatest common factor of c and 14. 7 Let p = 35 + -23. Let y = 100 - -3. Suppose -y + 7 = -k. Calculate the highest common divisor of p and k. 12 Suppose -z = -5w + 298, 3w - z - 190 = -6z. Calculate the highest common factor of 36 and w. 12 Let a be 114 + (-3 - -2 - 2). Let p = -76 + a. What is the greatest common divisor of p and 5? 5 Suppose -136 = -7l + 5l. Suppose 5d - 81 = -v - 3v, 5d - 87 = 2v. What is the highest common factor of l and d? 17 Suppose 2b = -b + 81. Suppose 0 = -4c + 13 + b. What is the greatest common factor of c and 15? 5 Let v(l) = l3 - 16l*2 + 14l + 29. Let a be v(15). Calculate the highest common factor of 154 and a. 14 Suppose -110 = -5k + 3o, k - o = -5o + 22. Calculate the highest common factor of 11 and k. 11 Let p(u) = u3 + 15u*2 + 14u + 1. Let w be p(-14). Suppose -j - 3m = -m - 16, -m - w = 0. What is the greatest common divisor of 198 and j? 18 Let a be (36/7)/(3/21). Suppose s = -4t - 7, 35 = 5s - 2s - 2t. Calculate the highest common factor of a and s. 9 Let l(i) = i2 - 10i - 17. Let k be l(13). What is the greatest common divisor of 11 and k? 11 Let q = 31 - 21. Suppose 2p + 0p = 14. Suppose -2b - i + p = 0, -b - 4i = -0i. What is the greatest common divisor of q and b? 2 Let x = -20 - -36. What is the greatest common factor of 40 and x? 8 Suppose x - 12 = -0x. Let q = 1 - -3. Suppose 0s - qs = -48. Calculate the highest common factor of x and s. 12 Suppose -10v + 702 = -8v. What is the highest common factor of 39 and v? 39 Let n = -23 + 27. Calculate the greatest common divisor of n and 44. 4 Suppose -28 = -2d - 2d. What is the highest common factor of 7 and d? 7 Suppose 2v = p - 328, -5p + 2v = 7v - 1580. What is the highest common divisor of p and 40? 40 Let f be ((12/(-9))/4)/(3/(-126)). Calculate the highest common factor of f and 2. 2 Let v be (-3 - -6)/(-3) + 54. Let f = -31 + v. What is the greatest common factor of 33 and f? 11 Suppose 0 = 4a, -3a + 71 = 2s + 5. Suppose 5u = 86 + 24. What is the greatest common factor of s and u? 11 Let o = -78 + 134. Calculate the highest common factor of 84 and o. 28 Let b(n) = 6n - 4. Suppose -3x - 12 = -5x. Let d be b(x). What is the highest common factor of 80 and d? 16 Suppose -19 = -5t + 11. Suppose -tf + 180 = -f. What is the greatest common divisor of 9 and f? 9 Let i be (-20)/(-15) - 1520/(-12). What is the highest common divisor of 8 and i? 8 Let d(x) = -x. Suppose -2c + 12 = 4n, c + 6 = -0n + n. Let v be d(n). Let q be (-2 + -1)/(v - -3). What is the highest common factor of q and 21? 3 Let k(v) = v*2 + v + 2. Let j be k(6). Let g = -26 + j. Suppose 4z - 75 = 105. What is the highest common factor of g and z? 9 Let m(l) = 17l3 + 4l*2 - 4l - 4. Let j be m(-4). Let d = j + 1672. Suppose 0 = -0o - 5o + d. What is the greatest common factor of 12 and o? 12 Let s be (-3)/(18/28)-6. What is the highest common factor of s and 70? 14 Let y(m) = m2 - 5m - 5. Let f be y(6). Let w = f + 7. Calculate the greatest common factor of w and 4. 4 Let a = 4 + -2. Let d = -11 + 17. Calculate the highest common divisor of a and d. 2 Let x be 3/(-5) - 1224/(-40). Calculate the greatest common divisor of 20 and x. 10 Suppose -4a + z + 2z = 12, a + 3*z = -3. L	{ "pile_set_name": "DM Mathematics" }
What is the nearest to 5 in 0.4, 0.5, -5? 0.5 What is the nearest to 8 in -1, -4, 0.4, -0.5? 0.4 What is the nearest to 2 in -0.1, 0, 0.3, -1/3? 0.3 What is the closest to 1/2 in -6, -8, -0.1? -0.1 Which is the nearest to 0? (a) -4/3 (b) 6 (c) 10 a Which is the nearest to 1.1? (a) 0 (b) 0.3 (c) -23 b What is the closest to 2 in 3/4, -2/15, -0.2, 2/9? 3/4 What is the closest to 4 in -0.0432, 5, -0.3? 5 Which is the nearest to 2/7? (a) -3/5 (b) -154 (c) -4 a Which is the nearest to -2? (a) -4 (b) -83 (c) 4/31 a What is the nearest to 1 in -47, 0, 0.4, 1/5? 0.4 What is the closest to -1/2 in -3/7, -3, 3/2? -3/7 What is the nearest to 1/2 in 10/7, -501, 2/13? 2/13 What is the closest to 1 in 2/11, 2.32, 0.3, 2/5? 2/5 What is the closest to 1 in 0, -1/3, -114? 0 What is the nearest to -1 in 0.4, -5, 2/29, -2/7? -2/7 Which is the closest to 106? (a) 2/7 (b) 1 (c) 1/2 (d) 2 d Which is the closest to 1/4? (a) -1.03 (b) -3 (c) -4/9 (d) -5 c Which is the nearest to 0.2? (a) 0.5 (b) -1/7 (c) 2 (d) 2/9 d Which is the closest to 0.39? (a) 3 (b) -4 (c) -1/2 (d) 0.1 d Which is the nearest to 0.3? (a) -1/4 (b) -3/5 (c) -8 (d) -0.1 d What is the closest to 0 in -45, -3, -5, -1? -1 Which is the closest to -0.2? (a) -5/2 (b) 13 (c) 1 c What is the closest to 0.2 in -1, 0, 47/2? 0 What is the closest to -0.02 in -5/4, 0.01, -3/7? 0.01 Which is the nearest to 1/3? (a) -4 (b) 0.026 (c) -0.01 b Which is the closest to 0.2? (a) 1/4 (b) -2/5 (c) -3 (d) 1/8 a What is the closest to 1/3 in -5, -0.1, -148? -0.1 Which is the nearest to 1? (a) -3 (b) -11 (c) -2/7 (d) -1/6 d Which is the closest to 41/3? (a) -5 (b) 2/3 (c) -0.9 b What is the closest to 0 in -4, 2/13, -0.5, -1/13? -1/13 Which is the closest to 0.1? (a) -3 (b) -0.8 (c) -1 (d) 4 b Which is the nearest to 1? (a) 0.14 (b) -0.2 (c) -1/2 (d) -2 a What is the closest to 9 in 1, 0.045, -1/3? 1 What is the closest to -0.2 in 12, -2, -5/39? -5/39 What is the nearest to 10/3 in -0.5, -1/6, -5? -1/6 Which is the closest to -0.09? (a) -0.05 (b) 0.2 (c) 0.4 a Which is the closest to -0.1? (a) 4 (b) 5 (c) 0.05 (d) -0.5 c Which is the closest to 0.1? (a) -4 (b) 10 (c) -2/3 c What is the closest to -4 in -35, 0.3, -0.1? -0.1 Which is the nearest to 1? (a) -1 (b) -1087 (c) 5 a What is the closest to 0.1 in -5, -2, 12, 3? -2 Which is the closest to -3? (a) 1/5 (b) -2 (c) -0.1 (d) 2 b Which is the nearest to 2/5? (a) -0.5 (b) -6/11 (c) 6 a Which is the nearest to -2/7? (a) 3 (b) 88 (c) 0.5 (d) 0.3 d Which is the nearest to -0.37? (a) -1/2 (b) -5 (c) 1 (d) -1/4 d What is the nearest to -1/12 in -2/7, 0.4, 0.3? -2/7 What is the closest to 0 in 2, 5, 3/2? 3/2 Which is the closest to -1? (a) 34 (b) 4 (c) 0 c Which is the closest to -2? (a) 0.4 (b) 2 (c) -2/7 (d) 2.2 c What is the nearest to 1 in -0.4, -24, -3/13, 1? 1 What is the closest to -4 in -0.5, 0, -5, 2/5? -5 Which is the nearest to -0.2? (a) -5 (b) 0.6 (c) -2/7 (d) -0.5 c Which is the nearest to -0.4? (a) -1.3 (b) -3 (c) 3/7 (d) -0.2 d What is the closest to 1 in -1/8, -2, -1/10, 1/4? 1/4 Which is the closest to -1/4? (a) -3/8 (b) 2 (c) -5 (d) -1 a Which is the closest to 1? (a) 0.4 (b) -932 (c) -2/3 a Which is the closest to 0.04? (a) -1 (b) -8 (c) -5 a What is the closest to -1 in 1/5, 0, -1/2? -1/2 What is the nearest to -3 in -3, -32, 3? -3 What is the closest to 1/3 in -10/7, 1/4, 0.4? 0.4 Which is the nearest to 0? (a) 0 (b) -2/13 (c) 7 (d) -0.46 a What is the nearest to 0.2 in 0.2, 2, 1/4, 14? 0.2 What is the closest to 1 in 1/22, 4, 2? 1/22 Which is the closest to -0.1? (a) -224/3 (b) 2/7 (c) -1 b Which is the closest to 2/47? (a) -0.2 (b) -5 (c) -1 a What is the closest to 3 in 22, 0, 3, -0.1? 3 What is the closest to -1/2 in 0.165, -0.5, 3? -0.5 What is the nearest to 1/3 in 0.2, 1/4, -4/5, 14/9? 1/4 What is the nearest to -12/5 in -4, 154, 0.2? -4 Which is the nearest to -1/4? (a) 2/7 (b) -4 (c) 3 (d) 1/14 d Which is the nearest to -7? (a) -0.4 (b) -0.2 (c) -0.042 a What is the closest to -11 in -1, 0, -0.1, -1/3? -1 Which is the closest to -2/7? (a) -4 (b) 1 (c) -0.1 c Which is the closest to -3? (a) -0.3 (b) -4 (c) 0 (d) -2/13 b What is the closest to 2/7 in 0.5, 0, -9, -3? 0.5 What is the nearest to -0.3 in -4, 1, 5, -0.5? -0.5 Which is the closest to 0.1? (a) -1 (b) 0.03 (c) -5 b Which is the closest to 5.4? (a) -0.8 (b) -1 (c) 0.4 c What is the nearest to 1 in 1, 1/5, -0.2, -1/4? 1 Which is the nearest to 2/3? (a) 2 (b) -1 (c) 4 (d) -2 a What is the closest to -1/4 in -0.03, -0.07, -0.2? -0.2 What is the nearest to 26 in 5, 0.4, 0.1? 5 Which is the nearest to -1/2? (a) -0.31 (b) -0.2 (c) 5 a What is the nearest to 1 in 4, 1/7, 4/1021? 1/7 What is the closest to 0.03 in 0.4, 2/17, 0.2? 2/17 What is the nearest to 0.12 in 2/11, 0.3, 0.25? 2/11 What is the closest to 3 in 0.1, 3, 0.2? 3 Which is the closest to -3? (a) 1/2 (b) 0.4 (c) -3 (d) -13 c What is the closest to -2 in 0.21, 1/7, -2/35? -2/35 What is the closest to 23/39 in 3, 0.2, -3, -5? 0.2 Which is the nearest to 1? (a) -0.5 (b) 17 (c) 2 (d) 4 c What is the closest to -4 in 7, 3, -4? -4 Which is the closest to 8? (a) -18 (b) 4 (c) -2/7 b Which is the closest to -1? (a) -6 (b) 1 (c) 5 (d) 7/4 b Which is the closest to 1? (a) 0 (b) -2/13 (c) -1.3 a Which is the closest to 5? (a) 1 (b) 3 (c) -5 b What is the closest to 1/4 in -1, 8, 0.1? 0.1 Which is the closest to -25? (a) -4 (b) 2/3 (c) -13 c Which is the closest to -1/2? (a) 0.3 (b) -0.12 (c) 1/2 (d) 1/6 b What is the closest to -16 in -2, -0.2, -0.13, 0? -2 Which is the nearest to 0.5? (a) 0.04 (b) 1 (c) -5 a Which is the closest to 1/37? (a) -0.1 (b) -8 (c) 0.1 (d) -21 c Which is the closest to 1? (a) -2 (b) -0.3 (c) -0.08 (d) -3 c What is the nearest to 1 in -0.3, 0.4, -39, -0.1? 0.4 Which is the closest to 0.1? (a) 2 (b) 3 (c) -4/3 (d) -66 c Which is the closest to -2? (a) 24 (b) 4 (c) 0.01 c What is the nearest to -1 in 0.2, -3, -137? 0.2 What is the nearest to 5 in -21, -17, 4, -4? 4 What is the nearest to -0.2 in 80, 6, -0.4? -0.4 What is the closest to -0.1 in -0.4, 0, -0.017? -0.017 What is the closest to -6 in -2, 1, -0.2, -19? -2 What is the closest to -0.24 in 9, 0.5, -2? 0.5 Which is the nearest to 0.1? (a) 2 (b) 3.6 (c) 4/3 c Which is the nearest to 2/9? (a) -3/4 (b) -4 (c) 14 (d) -2/15 d What is the closest to -3 in -274, -1/3, -0.2, -1/2? -1/2 What is the closest to -0.2 in -5, -2, 0.2? 0.2 What is the closest to -1 in -0.26, 1.8, 4? -0.26 Which is the closest to 4? (a) 0 (b) -0.1 (c) -1 (d) 1 d Which is the nearest to -0.1? (a) 0.06 (b) -4 (c) 5 (d) 3/5 a What is the nearest to 0.1 in 5, -5, 7, -1/9? -1/9 Which is the nearest to 0.1? (a) 0.28 (b) -2/13 (c) 4/3 (d) 0.3 a What is the closest to 1/9 in 4/3, 1, 5, 0.2? 0.2 Which is the closest to -1? (a) -13 (b) 3/8 (c) -5 (d) 0 d What is the closest to -0.3 in 8, -2, 2, -1/4? -1/4 What is the closest to 3 in -0.2, 3, -4? 3 Which is the nearest to 1? (a) 12/13 (b) -1/4 (c) 10 (d) -5 a What is the nearest to 1/3 in 4, -11, 1.4? 1.4 Which is the closest to -0.1? (a) 3/5 (b) 2/7 (c) -1/2 (d) -0.09 d What is the closest to -0.1 in -0.4, -64, -0.6, -4? -0.4 What is the nearest to 104 in 0.3, -7, -5? 0.3 Which is the closest to -1/6? (a) 2/7 (b) 12 (c) -0.05 c What is the closest to 35 in 3/2, -2/25, 4/3? 3/2 Which is the closest to -0.1? (a) -5 (b) -0.11 (c) -8 (d) 1 b Which is the closest to 0.26? (a) -1/2 (b) 4 (c) -0.2 (d) -2/9 c What is the closest to -2/15 in 3, 10, 2, 2/3? 2/3 Which is the closest to -2/5? (a) 1/8 (b) 0.06 (c) -0.3 c Which is the closest to 64? (a) 2 (b) -0.3 (c) -2/7 a What is the closest to 0.1 in -2, 4, -4.8? -2 Which is the nearest to 0.1? (a) 51 (b) -0.09 (c) 3 b Which is the nearest to 0.1? (a) -0.3 (b) 5 (c) -6 (d) 19 a What is the nearest to -0.5 in -1, -2/79, -5? -2/79 Which is the closest to 1/61? (a) -1 (b) 0 (c) 0.3 b Which is the nearest to -1? (a) -2 (b) 4 (c) 763 a Which is the closest to 0.1? (a) 0 (b) 10 (c) 1 (d) 0.4 a Which is the closest to -2/7? (a) 1/3 (b) 0.2 (c) -3 (d) -1/3 d What is	{ "pile_set_name": "DM Mathematics" }
/4)) assuming z is positive. z*(331/40) Simplify ((v/(vv/(v/v(-9))))/(((v(5/3)v)/v)/v)v/(v*(2/23)/vvv)vv9)(-4/21) assuming v is positive. v(-5036/1449) Simplify (p(2/35))(5/7)(p/p*(1/9))/((ppp/(pp*24p))/p) assuming p is positive. p*(10994/441) Simplify ((o/((oo/(o(o16/o)/o)oo)/o))/(((oo/o*(-4))/o)/ooo))/(o/(o14o)o(-2/17)) assuming o is positive. o(359/17) Simplify (k/(k/k(3/7)))/k(-27)kk(-2/17)k/(kkk(-33)) assuming k is positive. k(7177/119) Simplify (x*9x)(1/7)/((x(-15/7)/x)/(x*(-28)x)) assuming x is positive. x*(-157/7) Simplify (d/(ddd(2/9)/dd))*(1/9)/((d/(dd/((dd(-4/11)/d)/d)dd))/d(-5)) assuming d is positive. d(-688/891) Simplify (n(n/(nn(-1/22)))/n)(-6/11)n/n*(11/6)n(-2/21) assuming n is positive. n(-1615/1694) Simplify (z(-5)/(z(-6)zz)(z2)(3/11))(-47) assuming z is positive. z(235/11) Simplify ((((g/(g/(g/(gg/((gg(-10))/gg)))))/g)(1/49))(3/7))9 assuming g is positive. g(-297/343) Simplify (t/(t/(t/(t(t(-10/9)t)/tt)t))tt*(-5)ttt)/(t2)(-38) assuming t is positive. t*(685/9) Simplify ((ii23)(-7))(1/16) assuming i is positive. i(-21/2) Simplify u*(-1)u*1u*(-7/4)/uu(-12) assuming u is positive. u(-59/4) Simplify o/(oooo(-24))o/(o*(25/3)/o)((o*24o)/o)/oo/o(11/2) assuming o is positive. o(205/6) Simplify ((cc/c*(2/5)c)*(-2/7)(c/((cc(4/9))/c))/((((cc*(2/5)c)/c)/c)/c))(-8) assuming c is positive. c(-208/63) Simplify (z(-1/23))(-1/28)((z/((z(-5/6)/zz)/z))/z)/((z(-7/6)/z)/z) assuming z is positive. z(3221/644) Simplify (((z/z*5z)/z*(-1/3))/((zz/(zz(z/z*(2/13)z)/zzz))/zzz(-2/13)))(2/61) assuming z is positive. z(2/183) Simplify ((m0/(mmm*0))/((mm*(2/13)/mm)/mmm(mm6/m)/m))(-26/5) assuming m is positive. m(238/5) Simplify (t11/t)/(t/(t/t*3))(tt(-2/5))48 assuming t is positive. t(179/5) Simplify (h/(hhh(-3)))(12/5)/(h(-1/15)/(hh(-2/73)/h)) assuming h is positive. h(5299/1095) Simplify (((hh4)/h)/(hhh10))/(h(2/27)/hh/h(2/43)) assuming h is positive. h(-9320/1161) Simplify ((((t*0/tt)/t)(1/31))38)(2/21) assuming t is positive. t(-76/651) Simplify (l(-3/4))(22/7)/((((l*(9/2)/l)/ll)/l)/(l((l/(l/((l/(l/(l7l)))/ll)))/l)/l)) assuming l is positive. l(15/7) Simplify (((q(6/7)/qqq)/q)/q)(11/3)((q/(q/(qqq*4q)))/qqq)32 assuming q is positive. q(5365/21) Simplify (i*(1/6)i/(i*(5/2)/i)(i/(i/(i/(i/i1))))/(i(-2)/i))26 assuming i is positive. i(286/3) Simplify (d/d(-5/2))/(d(-12/13)/d)(d(2/7)/d)(-4) assuming d is positive. d(1507/182) Simplify (((oo*2oo)/o)/(o/(o(2/9)/o))(oo1)/(o((o/((o/o(-7))/o))/o)/o))(1/2) assuming o is positive. o*(101/18) Simplify (qq/q(1/4))(-8)/(q*9/qq/(q/(q(1/8)/q))) assuming q is positive. q(-169/8) Simplify ((j/j7)/j10)/(j*7j)(-35) assuming j is positive. j264 Simplify j/j*(-2/19)j/j*16((((j/(jjj*(-21)/j))/j)/j)/j)/jj(3/4) assuming j is positive. j(293/76) Simplify (y/(y*(-9/2)y))48/(y16)45 assuming y is positive. y(-504) Simplify ((c/(c/(c/(c(-13)/c))))(-9/8))(1/46) assuming c is positive. c(-135/368) Simplify v*32v*(4/13)vv(1/7)v(1/25) assuming v is positive. v(76191/2275) Simplify (x/x(3/2))38/(xx(4/9))39 assuming x is positive. x(-226/3) Simplify ((((iii(-14)/i)/i)/i)/(i(10/9)i))/(i*(8/5)/ii/(i(i/(i/(ii/(i/(i*(-4)/i)i))i))/i)) assuming i is positive. i(-1112/45) Simplify ((d(2/7)d(-3/5)/d)(-2/33))(-2/81) assuming d is positive. d(-184/93555) Simplify (d(-5/6))(-11)/(d/(ddd*(-4/15)/d)d/d(-25)) assuming d is positive. d(-171/10) Simplify p*(-1/6)p/(p/(p*(1/6)p))(p(1/10))(1/79) assuming p is positive. p(791/790) Simplify (aa/a1)26(aa(2/31))(-6/5) assuming a is positive. a*(3832/155) Simplify (((w/(ww/(ww3))w)/(ww7))/(w0)(-2/77))(-15) assuming w is positive. w60 Simplify n/(nnn/(nn*2n))(n/((n/(nn*(-1/4)))/n))/nnn/(n/n(-15))nn/n2 assuming n is positive. n(-45/4) Simplify ((j(13/2))(-26))(-34) assuming j is positive. j5746 Simplify j(-2/9)/(jj*(-4))j/((jj(-1/11)j)/j)j/(j/j(-7)) assuming j is positive. j(-409/99) Simplify ((y/y(-5)y*(-6)/y)/(yy*(-2)y)(1/6))(-7) assuming y is positive. y*7 Simplify (jj*2/jjjj(j/((j/(jj*(-2/23)j))/j)j)/jj)/(j*12/((((jj(-4))/j)/j)/j)) assuming j is positive. j(-209/23) Simplify (b*(-3)b18)/(b(-1/21)b(-21)) assuming b is positive. b(757/21) Simplify c14/(((c/c18)/c)/cc)(c6c)(-48) assuming c is positive. c(-304) Simplify (rr/(r/(r/r(-1/2)))r(1/8))32 assuming r is positive. r84 Simplify ((h(2/11)/h)/h(-4/11))/(h14h/(h/h(-5/2))) assuming h is positive. h(-263/22) Simplify (t(-2/11)/tt*(-5)/tt/t*(-3)(tt(-11))/t)16 assuming t is positive. t(-2496/11) Simplify (((nn(-3/11)/n)/n)/(n(1/3)n))/(n(2/67)/(n12n)) assuming n is positive. n(22915/2211) Simplify ((g0gg(-5/2))/(g1/(g(3/2)/g)))50 assuming g is positive. g*(-100) Simplify ((qqq(-4/9)q)/q)(-25)/(q(-3/11)q/((q(-7)/q)/q)q) assuming q is positive. q(-4912/99) Simplify (z(-17)z(-4/11)/z)/(((zz/(z/((z/z*(2/3)z)/zz)))/zz)/zzzzz*25z) assuming z is positive. z(-1607/33) Simplify (t(4/5)tt21)/(t(-1/8)/t(-3)) assuming t is positive. t(797/40) Simplify ((gggg(-2/5))/g4(g/g(-2/5))/(g/(g/((g/g2g)/g))))20 assuming g is positive. g20 Simplify (r22/(r(7/2)r))/(r*(-2)rrr/(r*13/rr)) assuming r is positive. r*(59/2) Simplify ((pppp*(-2/5)pp)(-20)/((pp(2/3))/p)(-1))(-12/13) assuming p is positive. p(1096/13) Simplify ((l/(((l/(l*(-34)lll)l)/l)/l)l)/(l*(-15)l))(-2/39) assuming l is positive. l(10/13) Simplify (l*17l*(-15/4))/(ll*(1/18)l(2/33)) assuming l is positive. l(4805/396) Simplify (m*(-1/5)m/((m*(1/3)m)/m))/(m*(-11)m/m(2/29)) assuming m is positive. m(4583/435) Simplify (k*(-11)/kk*(4/3)/k)/(kk*(-5)kk/k0) assuming k is positive. k(-29/3) Simplify (((aa/(a/((a((a/((aaa(-2/55))/a))/a)/a)/aa)))/a)/a2)/(a(-6/5)/(aaa/(a*(-2/49)a)a)) assuming a is positive. a(3442/2695) Simplify v(-15)vv0/vvv(-21)/(v/v(-5/4)) assuming v is positive. v(-149/4) Simplify ((ll((l/(ll(2/5)/l))/l)/l)(-50)l3l*(-7)l)(29/3) assuming l is positive. l(-319) Simplify z/z*(-1/8)z/(zz(-2/57)/z)z/(zz(2/13))z((zz/(z(z/(z/(zz(z/z(-30))/z))z)/z))/z)/z assuming z is positive. z(-177803/5928) Simplify (j(-7)/(jj/(jjj(-10/3)jjj)))/(j*(-1/6)/jj)30 assuming j is positive. j(-7/3) Simplify (i(-1/8)/((i1iii)/i)(i/i(-9))/i4)(-19/6) assuming i is positive. i(-437/48) Simplify (tt(-3)/tt*(-1/3)(((t*(-1/7)/t)/t)/t)/tt(-5))(-4) assuming t is positive. t(1048/21) Simplify (x(-5)x)(2/11)(x(1/4))(1/61) assuming x is positive. x(-1941/2684) Simplify (((p/p1p)/((p(pp(-2/5)/pp)/p)/p))/(p*(-5)pp/p(-2/5)p))(3/23) assuming p is positive. p(9/23) Simplify (uu(-3/5))/(u/((uu*(-13)u)/u))u(-15)uu(-3/8) assuming u is positive. u(-1079/40) Simplify qq/(q/(q*(-2/27)qq))q*(-15)q*(-21)/(qq*(-16/5)q) assuming q is positive. q(-4303/135) Simplify ((q0q)/qq/q*(-5/4))/((qq*(-9))/qq/(qq(-1/4))qq) assuming q is positive. q9 Simplify (w22/(ww*(-32)ww))(-1/30) assuming w is positive. w(-17/10) Simplify (q/(qq(-2/7)))16/(qq(-1/3)q)(-45) assuming q is positive. q(557/7) Simplify (m*(4/3)(mm(4/9))/mmm(3/5)m/(mm3))46 assuming m is positive. m(782/45) Simplify ((ii/(((i/(ii(-7)i))/ii)/i))/iii(-2/17)i)(-1/80) assuming i is positive. i(9/340) Simplify (bb(-22)b(5/12))/(b/((b(-1/9)bb)/b)bb(2/43)) assuming b is positive. b(-33655/1548) Simplify ((w(-10)/(w5w))/(ww*(-2/3)ww/(ww*(-11)w)w))(-31) assuming w is positive. w(2635/3) Simplify (i6/(i5/i))/((((i(-3/17)/i)/i)/ii)/(i*(-1/6)i)) assuming i is p	{ "pile_set_name": "DM Mathematics" }
-al = 4c - 32. Is c prime? False Let h(q) = 34q3 + 2q*2 + 3q. Let c be h(3). Let d = c - 510. Is (-1 - d/12)-4 prime? True Let c be (1/(-2))/((-3)/12). Suppose 3l - 4m - 8 = 20, -cm + 12 = 5l. Let i(g) = 9g*2 - 4g + 3. Is i(l) composite? False Let k = -1946 - -2815. Is k composite? True Let t(y) = -y*2. Let m(z) = 5z*2 + 11z + 9. Let p(o) = m(o) + 6t(o). Is p(7) a prime number? True Let q(c) = 49c*2 - 3c - 3. Is q(-2) composite? False Suppose -3k - 31 = -145. Suppose -v + 0v - k = 0. Is (v/(-4))/((-3)/(-6)) a composite number? False Suppose -l - 2l + 54 = 0. Suppose -5y + 5 = 10, b = 4y + l. Is b composite? True Let f = 515 + -366. Is f a prime number? True Suppose -h + 25 = 4h. Suppose 21 = hp + 6. Suppose -px = -19 - 128. Is x composite? True Let u be (-7)/1(-18)/(-21). Let f be (-1 - -2)u/3. Is 4/f110/(-4) composite? True Suppose -727 = -4q + 1669. Is q a prime number? True Let d = -108 + 82. Let v(k) = -3k3 - 3k*2 - k + 4. Let c be v(-3). Let i = c + d. Is i a composite number? True Suppose 3s = s - 3t + 2933, 3t + 4362 = 3s. Is s prime? True Let g = -28 + 47. Suppose -g + 351 = 4h. Is h a prime number? True Let t(x) = x*2 - 14x - 4. Let a(o) = o*2 - o. Let i(b) = -2a(b) + t(b). Is i(-7) a composite number? False Let z be 3/(2/(-4)-2). Suppose -zv + 1 = r, v = -3v + 2r + 18. Is (v + -193)/(-1 + 0) composite? False Suppose -1497 = -0x - 3x. Is x prime? True Let g(l) = l*3 + 7l*2 + 4l - 1. Let v be g(-6). Is (-5)/25 - v/(-5) prime? True Suppose -338 = -2s + 108. Is s prime? True Let b(x) = x3 + 6x*2 - 4x + 2. Is b(4) prime? False Let y(t) be the first derivative of -t*4/4 - 4t3/3 - t2 + 2t - 5. Is y(-5) prime? True Suppose -3y + 0 + 9 = 0. Suppose -2s - 3m + 307 = 0, m + 468 = ys - 2m. Is s a prime number? False Let a be (-2)/(-4)(-1 + 1). Let j = 399 - 233. Suppose a = 3q - q - j. Is q a composite number? False Let k(q) = q*3 + 7q*2 - 10q - 11. Let c be k(-8). Suppose cr - p = p - 7, 4r = -p - 3. Is 79/(r - 1 - -3) a prime number? True Let t be (-2)/(-4)(-20)/(-2). Let l = 8 - t. Suppose -lg = g - 436. Is g prime? True Let a = -326 + 489. Is a a composite number? False Let y = 82 - 29. Is y composite? False Suppose 5r - l = -61, l = -1 + 2. Let a(b) = 27b*2 - b - 1. Let s be a(-1). Let j = s + r. Is j a prime number? False Suppose 14 = 5m + 84. Is 1119/2m/(-21) a composite number? False Let k(x) = -412x. Let q be k(5). Is 2q/(-8) - 4 composite? True Let k(a) be the second derivative of -8a*3/3 - 2a*2 - 2a. Let r be k(4). Is 2/(-4)2 - r a prime number? True Suppose 2r - 302 = k, -5r = -2k + 6k - 729. Is r prime? True Let o be 2/(66/(-32) - -2). Is (-6)/(-9) + o/(-6) prime? False Suppose -1 = s - 6. Let n(b) = b2 - 3b + 7. Let i(m) = 1. Let x(p) = -2i(p) + n(p). Is x(s) prime? False Let f(s) = -9s2 + 0 - 4 + 5 + 10 - s3 - 9s. Is f(-8) composite? False Let z(t) = 371t - 47. Is z(6) a composite number? False Let j = 19 + -14. Suppose jh + 2t + t - 174 = 0, 4t + 87 = 3h. Is h a composite number? True Let v(g) be the first derivative of g*3/3 + 2g*2 - 1. Is v(-7) prime? False Suppose 0 = 31w - 26w - 955. Is w a composite number? False Is (5 + -3)/((-8)/(-1324)) a composite number? False Suppose 4 - 12 = -2q. Suppose -16 - 4 = -qx. Is 4/(-10) - (-397)/x composite? False Let d(a) = a2 + 2a + 2. Let u be d(-2). Let t be u/6 - (-5710)/15. Suppose -t = -4p + p. Is p prime? True Let b(h) = h3 + h2 - 5h + 4. Let w be b(3). Let s = w + -4. Is s prime? False Let d be (22/(-55))/(1/35). Let k = -12 - d. Is k a composite number? False Let u = 3684 - 2207. Is u a prime number? False Let g be ((-2)/4)/((-1)/4). Let u be 11/5 - g/10. Suppose -uf + 9 = -5c, -4f - 3c + 4c = -27. Is f composite? False Let f = 2 + 2. Let b be (-1156)/(-18) - f/18. Is 3/(-9) - b/(-3) prime? False Suppose -3x + 619 = 202. Is x prime? True Let q(j) = -2j3 + 2j - 1. Let c be q(1). Is 162 - 18 - (c + 0) a composite number? True Let p = 16 - -115. Is p composite? False Let t(j) = 395j3 - 2j + 2. Is t(1) composite? True Suppose 0 = 5j + 15, -5l + j + 19 = -l. Suppose 3s + 0s - 216 = 3n, 3n - 253 = -ls. Is s composite? False Suppose -2b + 2037 = b. Is b a composite number? True Let d = 403 - -288. Is d a prime number? True Suppose 2n + 57 = a, 240 = 4a + 2n + 2n. Is 2 + -2 + a - 1 composite? True Let o = -116 - -249. Is o composite? True Suppose 5i - 10 = 0, -3c - 5i + 38 = -86. Let a = -7 + c. Is a a composite number? False Suppose 2s + 24 = 3a - 114, -2a + 4s + 100 = 0. Let o = -240 - a. Let w = -169 - o. Is w a composite number? True Let s be 6 + -1 - (3 - 2). Let k be (-4)/(-6)(s + -1). Suppose 38 + 28 = ku. Is u a prime number? False Let s be 6/(-21) - (-51)/7. Suppose -c + 42 - s = 0. Is c a prime number? False Suppose -d - 4l + 43 = 0, d + 2d - 3l - 159 = 0. Suppose -5h + 2q = -99, h - d = -h - 3q. Is h prime? False Let x = -231 - -437. Is x a composite number? True Let b be (-26540)/14 - (-2)/(-7). Is (b/36)/((-2)/3) a prime number? True Suppose 0 = 5g - 8 + 38. Let z = 8 + g. Suppose 53 = h + 3i - 2i, -zh + 106 = -5i. Is h a composite number? False Suppose -2n + 38 = 3r + 2n, 5r + 5n = 60. Let p(t) = -t3 + 13t*2 - 12t + 5. Is p(r) a composite number? True Let d(u) = 7u2 - 6u + 54. Is d(-13) a prime number? False Let w(t) = -39t - 14. Is w(-15) a prime number? True Suppose 4y + 0a = 5a + 45, 2a + 15 = y. Suppose -2m + 383 = yv, m + 1 = -0. Is (-3)/6 + v/2 a prime number? False Let l(d) = -d2 - 4d + 4. Suppose -3v = -z + 7, -4v + 4z = v. Let a be l(v). Suppose 3m = ay - 66 - 6, -5m = -20. Is y a prime number? False Let x = 83 - 49. Suppose 5w + 11 = 291. Let a = w - x. Is a composite? True Let m = 28 - 13. Is m a composite number? True Suppose g + 2 = 2p - 0, -p = g - 4. Suppose gt - 75 = 27. Is t composite? True Is ((-1 + 144)-1)/(-1) composite? True Let y(b) = -3b2 + 9b + 1. Let u be y(8). Suppose -4f = -185 - 647. Let c = f + u. Is c a composite number? False Let p(t) = -2t*2 - 9t - 10. Let m be p(-5). Is (-40)/m + (-1)/(-3) a prime number? True Is ((-4)/12)/(3/(-666)) a prime number? False Suppose 0 = l + l. Suppose 2z - 7z = -3r - 73, -z + 5r + 19 = l. Is z prime? False Suppose 44 = k - 4z, -4k - 2z - 3z + 218 = 0. Let q = -29 + k. Suppose 2m = q + 3. Is m prime? True Is (-6)/((-12)/4) - -783 a prime number? False Let a be -2(-149)/(-4)-2. Let r be 6 + -1 - (-7 + 8). Suppose -5i = m - 56, -i + a = rm + 4i. Is m prime? True Suppose -2d + 19 = -3n, n + 23 = 4d - 0d. Is 3/(-18)n46 prime? True Let g(w) be the second derivative of -7w3/3 - 7w*2/2 + 4w. Is g(-7) a composite number? True Suppose -110 = -3s + 64. Is s prime? False Suppose 6a - 5845 = 11729. Is a a prime number? False Let x(a) = -1 - 1 - 3a2 - 4a*2 - 7a - a*3. Let b be x(-6). Suppose 0q - bq = -28. Is q prime? True Suppose -3v - 2581 - 46 = -5j, 2j - 1034 = -3v. Is j a composite number? False Let g be (-4 + -8)(-220)/16. Suppose -o + 0i = i - 140, -o + 4i = -g. Is o prime? False Let w(x) = 88x2 + x - 10. Is w(3) composite? True Suppose 5z + 2d - 95 = -3d, -2z + 2d = -18. Let j(o) = o*2 + 10o + 1. Is j(z) composite? False Let y = 1593 - 608. Is y composite? True Let t(p) = -5p2 - 2. Let h be t(2). Is (-1 - h) + 5 + -3 a composite number? False Let q(d) = d2 - 2d + 1. Let t be q(-4). Let y = t - -4. Let h = -18 + y. Is h a composite number? False Is 1216/2 + 6/2 composite? True Let k = 10 + 14. Suppose -4a + 34 = 5b, 0 = 3a + 2b + b - k. Let y(c) = 9c - 3. Is y(a) a composite number? True Suppose -3q + 2j + 16 = -2j, -5q - j = 4. Let r be ((-2)/3)/(3/(-18)). Suppose 2w = -qw + ri + 16, 4i - 14 = -w. Is w composite? True Suppose -89 + 23 = -2b. Is b a composite number? True Suppose -4c - 4a = 40, -4c - a = a + 48. Let s be 144/(-14) - 4/c. Is 2 - 62s/4 composite? False Suppose 6z - 1255 = z. Is z prime? True Suppose 3u + 19 = -4l, 27 = -5u - 2l - 0. Let n(b) = 4b*2 + 7b. Is n(u) a composite number? True Let w(v) be the first derivative of -2v3/3 - 3v*2/2 + 3v - 1. Let x be w(-3). Let d(c) = -5*c + 1. Is d(x	{ "pile_set_name": "DM Mathematics" }
4 Suppose 5c = 14 + 6. Suppose 21 = -3j + 10j. Suppose 0 = jg + 2b + c, g = 4g - 4b - 8. Solve 2q + 1 - 7 = g for q. 3 Let w(p) = p*2 + 4p + 4. Let h be w(-4). Let z be 5 - h - 14/(-2). Solve -3n + 25 = -zn for n. -5 Let a = -12 - -14. Let r(t) = 2t - 4. Let i be r(a). Solve iq + q + 2 = 0 for q. -2 Let q(a) = -a*3 + 3a*2 - a - 4. Let o be q(3). Let s = o - -12. Solve -sj - 1 + 26 = 0 for j. 5 Let b = 13 - 12. Let o be 0/(b/(-1 - -2)). Let s be (-9 + 8)/(-1 + o). Solve -4j + 5j - s = 0 for j. 1 Let v(k) = k + 27. Let u be v(-11). Let l = u - 13. Solve lm = -2m + 10 for m. 2 Let j be 1/3 - (-14)/3. Solve -ji + 20 = -i for i. 5 Suppose 0 = 4m - 12 + 4. Let f be (-1m)/(10/(-15)) + 1. Solve -g - fg - 5 = 0 for g. -1 Let p be 4 + 3 + -3 + -4. Suppose p = 3v - x - 13, -21 = -5v + x + x. Solve -5 = va - 0 for a. -1 Suppose -200 = -17x - 23x. Solve -x = -f - 7 for f. -2 Suppose 6n + 282 = -0n. Let k = 49 + n. Solve kf - f + 1 = 0 for f. -1 Let a(y) = -4y2 + 25y - 22. Let k be a(4). Solve -2 = -3x - k for x. -4 Let r be 117/(-26)20/6. Let u = r - -9. Let v = -1 - u. Solve vl = l for l. 0 Suppose -v - 1 = 4a, -4a + 3 - 6 = 3v. Solve a = 2o - 0o + 6 for o. -3 Suppose 3u + 4m - 3 - 32 = 0, 2u + m - 15 = 0. Solve -uh + 90 = 75 for h. 3 Let q(z) = -z*2 + 33z + 284. Let y be q(39). Solve 4m - 34 = -y for m. -4 Suppose -3h = 5y - 14, -7y = -5h - 2y + 10. Solve hz + 4 = z for z. -2 Suppose 1 - 5 = -d. Suppose -5m = 0, -dm + 69 = -0s + 3s. Suppose 9 = -2u + s. Solve -3i = -u - 5 for i. 4 Suppose -4g + 2h + 2h + 8 = 0, 0 = -5h + 25. Suppose -10 = 5f - gf. Suppose 5r + 25 = 0, -5r = 5s - 3r + f. Solve q = 4 + s for q. 5 Suppose 5v - 11 + 1 = 0. Suppose 12 - 32 = -4d + r, -28 = -vd - 4r. Suppose 2w - 13 = -1. Solve -3b = -wb + d for b. 2 Let l(z) = -z*2 + 4z + 34. Let m be l(8). Let c = 4 + 2. Suppose -3s + b - 3 = 2b, c = 5s - mb. Solve s = 2o - 4o - 2 for o. -1 Let z = 8 - 6. Let y = 10100 + -10091. Solve zf + f = y for f. 3 Let t = 35 - 43. Let w(a) = a + 12. Let u be w(t). Solve 4k - 3k - u = 0 for k. 4 Let v(u) = u2 - 6u + 2u - 4 + 7. Let b = 66 + -63. Let f be v(b). Solve fi - 4i = -16 for i. 4 Let l(g) = 60 - 2g + 2g + 5g. Let v be l(-12). Suppose 4u = -s + 9, s = -s + u + 9. Solve j + 4j - s = v for j. 1 Let x = 1 - -14. Suppose -16 = 19z - 16. Solve 0 = -zs - 5s + x for s. 3 Let j(i) = 6i - 13 + 0i - 9i. Let s be j(-6). Solve -25 = -5g - s for g. 4 Let l(q) = 2q*2 - 5q - 15. Let n be l(-2). Solve 4 = nd - d for d. 2 Let d = -1063 + 1070. Solve -df + 29 = 1 for f. 4 Suppose 4a = 42v - 38v + 52, -4a - 2v + 22 = 0. Solve -a = 3n - n for n. -4 Suppose 264 = -2x + 5x. Let v = x + -68. Solve -3f + 8f - v = 0 for f. 4 Suppose -3b = 2b - 25, -17 = t - 5b. Solve 2d = td - 18 for d. 3 Suppose 0 = -5n + 66n - 366. Solve 22d - 20d = n for d. 3 Let i(w) = -w + 5. Let t be i(-2). Solve 2q = tq - 3q for q. 0 Let l be (-1)/3 - (-15)/(-9). Let w be (-4)/l + 41. Suppose -6z - 7z = -52. Solve d - w = -z for d. 2 Suppose 0 = -7c + 2c + 4j - 210, -3c - 2j = 104. Let s = -36 - c. Solve 3k = sk for k. 0 Let u = 3 - -2. Suppose -3k - up - 6 = 0, -4k = 8p - 4p. Suppose -16 = -kt - 4c, 0t = t + 3c - 2. Solve 0y + t = 2y for y. 4 Let g = -124 + 128. Suppose 8 = 4h, -6h + 23 = 3z - 2h. Solve -g = -3n + z for n. 3 Let b = 110 - 107. Solve bk - 12 - 3 = 0 for k. 5 Let l(c) = -6c + 99. Let s be l(14). Solve s + 5 = -5g for g. -4 Suppose -25 = -25o + 20o. Suppose 0 = n - 3p + 7, 2n + 8 = -p + op. Solve h = -n + 3 for h. 1 Let g = -339 + 342. Solve -10r = -gr for r. 0 Let l be (-5)/((-25)/4)10/(-4). Let k be 10/60 + 1/12l. Solve -h + 4h = k for h. 0 Let t(m) = m3 + 4m*2 - 7m - 5. Let r be t(-5). Let b be -1 + 1(r - 0). Solve -bu = 5 - 1 for u. -1 Suppose 46 = -w + 53. Solve 3i + 4i - w = 0 for i. 1 Suppose 21j - 69 = 36. Solve r - 1 = -j for r. -4 Let n(d) = d3 + 7d*2 + 7d - 1. Let o = -91 + 86. Let h be n(o). Solve -5k = -4 + h for k. -2 Let c(r) = r2 + r + 7. Let a be c(0). Suppose -af + 9f = 6. Solve -fh = -8h - 15 for h. -3 Let g = -18 + 18. Suppose 5m = -g - 10. Let p be (-27)/(-6)m/(-3). Solve -1 = pq + 2 for q. -1 Suppose 0 = -2i + 1501 - 1477. Solve -13m + im = -4 for m. 4 Let u be (-52)/(-39) - (22/(-6))/1. Let o be 4 + (u + -1 - 0)-1. Solve o = -m - 0m - 3 for m. -3 Let o(z) be the first derivative of z4/4 + z3/3 - z2 - 5. Let f = -2 + 0. Let c be o(f). Solve -v = -cv - 3 for v. 3 Suppose 18z + 4g + 28 = 20z, 5g = -5. Solve -6 = -zm - 54 for m. -4 Let a be (-78)/(-26) - (-2)/(2/(-5)). Let b be (-4)/1 + -6 + (-28)/a. Suppose -3g + 2i = 2g - 35, 0 = -4g - 4i. Solve 0 = -gk - b + 29 for k. 5 Let o be -2 - (-6 + 3/(-3)). Suppose -4p - 2 = -3z - 2p, op = 3z - 5. Suppose z = -5u + n + 20, -u + 13 = 3n - 7. Solve t = ut for t. 0 Let j = 17 + -15. Suppose -5q + jq = 0. Suppose 8r = 16 - q. Solve rf = -f for f. 0 Let x = 706 + -706. Solve -215u + 217u - 2 = x for u. 1 Let q(w) = w - 4. Let z(s) = -s - 1. Let t(h) = -q(h) - 2z(h). Let r be (98/(-245))/(2/30). Let y be t(r). Solve -3a + 7a - 12 = y for a. 3 Let j(v) = 6 - 5v + 4 + 3 + v2 - 10. Let c be j(5). Suppose -4u - 3m + 10 = -21, -m + 25 = 5u. Solve ug + c = g for g. -1 Let w = -18 + 55. Let s = w + -25. Solve -5b + s + 13 = 0 for b. 5 Suppose 0 = 12v - 4v + 5v. Solve -3h - 17 + 5 = v for h. -4 Let t(h) = 2h - 11. Suppose 9v - 8 = 8v. Let w be t(v). Solve -25 = -4b - w for b. 5 Suppose -28b - 12 = -32b, 5b - 25 = -5p. Solve 5d + 15 = pd for d. -5 Let t = 17 + -14. Suppose -j - 10 = -3o, -to + 2j + 0j + 5 = 0. Suppose 0z + 12 = -4z + 3c, 0 = -5c + 20. Solve -5k = -zk - o for k. 1 Let p be 17/(7/4). Let j(u) = 2u - 5. Let f be j(p). Suppose 3w - f - 3 = 0. Solve 4t - 6 = w for t. 2 Suppose 8c - 22c = -1666. Let r = -117 + c. Solve -rg = -4g for g. 0 Suppose -2w = 2w - 20. Suppose wb = 8b - 27. Let k(q) = q*2 - 9q + 9. Let i be k(b). Solve 3a = -0a - i for a. -3 Let v be 70/35(10/4 - 1). Solve -vb + 4 = -2b for b. 4 Let n(x) be the third derivative of -x5/60 - x4/8 + 5x*3/6 - 28x*2. Let u be n(0). Solve 17 = 3b + u for b. 4 Let n = -50 - -139. Suppose 4z = -n + 125. Solve k = -z + 4 for k. -5 Let b(r) = 14r - 136. Let c be b(10). Solve -a = -3a + c for a. 2 Let h = -9 - -8. Let x(w) = -23w3 + w2 - w - 1. Let j be x(h). Let n = j - 8. Solve -4 = -4g - n for g. -3 Let n = -3 - -7. Suppose -3m = 5s - 15, 4s - 8 = 5m + n. Solve m = -k + 2k - 3 for k. 3 Let g = 445 + -441. Solve -gh + 48 = 12h for h. 3 Suppose m = -3n + 82, -5n + 5m - m = -148. Let p = -24 + n. Suppose -pg = -4d - 12, -g - g = 2d - 2. Solve -g = b - 3 for b. 1 Suppose 0 = 5k + 21 - 31. Suppose -4a + 62 = -kd, 0 = -3a + 5a - 3d - 29. Solve -11o - 15 = -ao for o. 3 Let d = 115 + -114. Solve 0 = -x + d for x. 1 Suppose -m - 4m + 3i = -45, -25 = -5m - i. Suppose -24 = 2a - ma. Suppose 0 = 3x + a - 15. Solve -12 = -o - xo for o. 3 Let m be (174/21 + -4)-7. Let q be m/(-40) - (-17)/4. Suppose 3j = -4j + 70. Solve -3c + j = -qc for c. -5 Let l(j) = -j*2 + 4j + 1. Let f be l(4). Let y(b) = b*2 - 5b + 5. Let c be y(5). Suppose 12m - 6m = 66. Solve -m = ck - f for k. -2 Let y(s) = 4s + s*2 + 5s2 + s3 - 10 - 5s - s. Let k be y(-6). Solve 0 = kb - 6b - 8 for b. -2 Suppose -98 = -15a + 217. Solve au - 12 = 17u for u. 3 Let n(s) = s3 + s2 - 8s - 2. Let u = 36 + -39. Let j be n(u). Solve q = 3q - j for q. 2 Let o = 1055 - 1055. Solve o - 14 = 7i for i. -2 Suppose -823h + 824h = 0. Solve 0 = 2z - h + 4 for z. -2 Suppose 0 = 3o - 0o - 54. Let s = o + -19. Let z = s - -11. Solve 0 = 5h - 3h - z for h. 5 Suppose -p = 8p - 135. Suppose -57 = -6f - p. Solve -9b - 8 = -fb for b. -4 Let o be ((-4)/(-6))/((-4)/(-18)). Suppose 3d - o = m + 7, 22 = m + 5d. Solve -p = 7 - m for p. -5 Suppose -79o = -77o - 264. Let u = -124 + o. Solve 2q + u = -0 for q. -4 Let y be (-1)/(332/56 - 6). Solve -2v = -y + 10 for v. 2 Let m(c) = 2c2 + 32c + 37. Let q be m(-15). Solve -q*r + 15 = 1 for r. 2 Let l = -76 - -79. Solve -	{ "pile_set_name": "DM Mathematics" }
3h4/4 - 5h*3/4 - 3h*2/4 + h. h(h - 1)*2(h + 1)(h + 4)/4 Factor 3h*3 + 129h*2 + 1449h + 1323. 3(h + 1)(h + 21)*2 Let -28r*4 + 640r*3 - 4388r*2 + 7760r + 1200 = 0. What is r? -1/7, 3, 10 Factor -d*2 + 959d + 960. -(d - 960)(d + 1) Find x, given that -4x*4 + 272x*3 - 4884x*2 + 8712x = 0. 0, 2, 33 Find r, given that r*5 - 37r*4/3 + 14r*3 + 26r*2/3 - 15r + 11/3 = 0. -1, 1/3, 1, 11 Solve -3x4 + 216x*3 + 441x*2 + 222x = 0 for x. -1, 0, 74 Factor -d*2 + 353d. -d(d - 353) Factor u3/4 + 131u2/4. u2(u + 131)/4 Factor -2b*2 + 88b - 726. -2(b - 33)(b - 11) Solve 4w4/19 - 10w*3/19 - 6w*2/19 + 16w/19 + 8/19 = 0. -1, -1/2, 2 Determine r, given that -42r4 - 93r*3 - 60r*2 - 9r = 0. -1, -3/14, 0 Find v such that -25v5 - 2310v*4 + 11005v*3 - 14530v*2 + 1980v + 3880 = 0. -97, -2/5, 1, 2 Factor -12g3/25 - 14g*2/25 - 2g/25. -2g(g + 1)(6g + 1)/25 Let d3/4 - d2/2 = 0. What is d? 0, 2 Factor t*3/5 - 6t*2/5 - 3t + 20. (t - 5)*2(t + 4)/5 Solve -g*3/7 + 96g*2/7 - 2304g/7 = 0. 0, 48 Determine s, given that 2s4/9 + 2s*3 = 0. -9, 0 Factor 2i*5 - 36i*3 + 162i. 2i(i - 3)*2(i + 3)2 Let r2/2 + 8r + 14 = 0. Calculate r. -14, -2 Find z such that 3z*5 + 3z*4/2 - 18z*3 - 21z*2/2 + 24z + 18 = 0. -2, -1, 3/2, 2 Factor n*2/2 + 1194n + 712818. (n + 1194)2/2 Find i, given that -i2/7 - 2012i/7 - 1012036/7 = 0. -1006 Factor -7i4/8 + i3 + 13i2/8 - i/4. -i(i - 2)(i + 1)(7i - 1)/8 Determine a, given that 21a*4/2 + 24a*3 - 135a*2/2 + 21a + 12 = 0. -4, -2/7, 1 Find l, given that -2l5/19 + 18l*4/19 + 26l*3/19 - 50l*2/19 - 96l/19 - 40/19 = 0. -1, 2, 10 Factor a*2/8 - 1451a/2 + 2105401/2. (a - 2902)2/8 Factor b2 + 70b + 69. (b + 1)(b + 69) Suppose -2u4/3 + 38u*3 + 356u*2/3 + 80u = 0. What is u? -2, -1, 0, 60 Determine q so that -3q5 + 30q*4 - 93q*3 + 90q*2 = 0. 0, 2, 3, 5 Factor 44f*3 - 36f*2 - 96f - 16. 4(f - 2)(f + 1)(11f + 2) Solve -s*4 - 30s*3 - 224s*2 + 30s + 225 = 0 for s. -15, -1, 1 Let -5b3 - 660b*2 = 0. What is b? -132, 0 Let -18h*5/7 - 246h*4/7 + 394h*3/7 + 494h*2/7 - 248h/7 - 120/7 = 0. Calculate h. -15, -1, -1/3, 2/3, 2 Factor -3r5 + 3r*4 + 15r*3 + 9r*2. -3r*2(r - 3)(r + 1)2 Factor -4f*3/3 + 7924f*2/3 - 3920396f/3 - 3928324/3. -4(f - 991)2(f + 1)/3 Let -4i5 + 16i*4 + 12i*3 - 40i*2 - 32i = 0. What is i? -1, 0, 2, 4 Determine b, given that -3b2 + 420b - 14700 = 0. 70 Factor -4t2 - 232t - 3364. -4(t + 29)2 Determine r, given that -27r*4 - 1638r*3 - 2676r*2 - 1242r - 177 = 0. -59, -1, -1/3 Factor -3w2/2 - 39w/2 - 18. -3(w + 1)(w + 12)/2 Factor 2u3/13 + 6u*2 + 288u/13 - 10368/13. 2(u - 9)(u + 24)*2/13 Determine r, given that -2r*5 - 26r*4 - 94r*3 - 46r*2 + 96r + 72 = 0. -6, -1, 1 Let -2d4/15 + 50d*3/3 + 506d*2/15 + 254d/15 = 0. Calculate d. -1, 0, 127 Let -t*2/5 + 85t + 1716/5 = 0. What is t? -4, 429 Factor 2d3 + 16d*2 + 22d - 40. 2(d - 1)(d + 4)(d + 5) Factor -3y*3/4 + 63y*2/4 - 90y + 75. -3(y - 10)2(y - 1)/4 Solve 2s5/19 + 36s*4/19 - 170s*3/19 + 140s*2/19 + 168s/19 - 176/19 = 0. -22, -1, 1, 2 Factor k*4/6 + 2k3/3 - k2/2 - 7k/3 - 4/3. (k - 2)(k + 1)*2(k + 4)/6 Factor h*4/2 + 3h3/2 + h2/2 - 3h/2 - 1. (h - 1)(h + 1)*2(h + 2)/2 What is y in -4y2/3 - 158y/9 + 140/9 = 0? -14, 5/6 Factor -k*2/2 + 28k - 343/2. -(k - 49)(k - 7)/2 Solve 2a*3 - 76a*2 + 146a - 72 = 0. 1, 36 Let -a*5 + 241a*4 + 975a*3 + 1223a*2 + 490a = 0. What is a? -2, -1, 0, 245 Factor -48i4 - 948i*3 - 693i*2 - 687i/4 - 57/4. -3(i + 19)(4i + 1)3/4 Suppose -3v*5 + 133v*4 + 1503v*3 + 3351v*2 + 2740v + 756 = 0. What is v? -7, -1, -2/3, 54 Let 10q4/7 - 54q*3/7 - 120q*2 + 3944q/7 - 1440/7 = 0. What is q? -9, 2/5, 4, 10 What is x in -x*4/6 - 5x*3/6 + 2x*2/3 + 22x/3 + 8 = 0? -4, -2, 3 Find x such that 4x2 - 120x + 900 = 0. 15 What is n in 4n2 + 5360n + 10704 = 0? -1338, -2 Let -d*2 + 8d + 33 = 0. Calculate d. -3, 11 Suppose -7c5 + 40c*4 - 37c*3 - 56c*2 + 44c + 16 = 0. What is c? -1, -2/7, 1, 2, 4 Find y, given that y*5/6 + 13y*4/6 + 21y*3/2 + 139y*2/6 + 68y/3 + 8 = 0. -4, -3, -1 Factor 2p2/5 + 6p - 68/5. 2(p - 2)(p + 17)/5 Factor m*2 - 175m. m(m - 175) Factor -3y*3 + 741y*2 - 45384y - 46128. -3(y - 124)2(y + 1) Suppose -4g5 - 24g*4 - 52g*3 - 48g*2 - 16g = 0. What is g? -2, -1, 0 Let 3q5/4 + 9q*4/4 - 3q*3/4 - 21q*2/4 + 3 = 0. What is q? -2, -1, 1 Factor 13l*5 + 86l*4 + 82l*3 - 396l*2 - 567l + 270. (l - 2)(l + 3)3(13l - 5) What is f in -2f*5/3 + 148f*4/3 + 304f*3/3 + 4f*2/3 - 302f/3 - 152/3 = 0? -1, 1, 76 Find x such that -x*4/3 - 4x*3/3 - 4x2/3 = 0. -2, 0 Solve -q2/9 + 2q/3 - 5/9 = 0. 1, 5 Factor -h4/3 - 7h3/3 + h2 + 55h/3 - 50/3. -(h - 2)(h - 1)(h + 5)2/3 Let p2 - 109p = 0. Calculate p. 0, 109 Find d such that -d*3/4 - 5d*2/2 + d/4 + 5/2 = 0. -10, -1, 1 Determine c, given that -10c*5 - 396c*4 + 1420c*3 - 1784c*2 + 942c - 172 = 0. -43, 2/5, 1 Suppose 3x5 - 105x*4 + 1290x*3 - 6270x*2 + 9075x - 3993 = 0. What is x? 1, 11 Factor -5i2 + 845i - 840. -5(i - 168)(i - 1) Factor -c*3 + 237c*2 - 18723c + 493039. -(c - 79)*3 Find r such that -2r*4/3 - 2r*3 + 8r/3 = 0. -2, 0, 1 Factor 4v3/3 + 124v*2/3 - 416v. 4v(v - 8)(v + 39)/3 Let -2r*3/3 - 82r*2/3 - 436r/3 - 560/3 = 0. Calculate r. -35, -4, -2 Factor -5v4/2 + 7v3/2 - v2. -v*2(v - 1)(5v - 2)/2 Determine l, given that -3l4/5 - 31l*3/5 - 16l*2 - 4l/5 + 48/5 = 0. -6, -4, -1, 2/3 Factor -w*2/7 - 8w/7 + 33/7. -(w - 3)(w + 11)/7 Determine m so that 2m3/9 - m2/9 - 25m/9 - 4/3 = 0. -3, -1/2, 4 Suppose 728v*2 + 2913v/4 + 1/4 = 0. What is v? -1, -1/2912 Factor 2m4 + 76m*3 + 90m*2 - 13000m + 25000. 2(m - 10)(m - 2)(m + 25)2 Factor -6n*3/5 + 197n*2/5 + 448n/5 + 49. -(n - 35)(n + 1)(6n + 7)/5 Factor -k2/2 - 68k + 137/2. -(k - 1)(k + 137)/2 Suppose 2r*3/5 + 22r*2 + 1456r/5 - 1568/5 = 0. What is r? -28, 1 Factor -7d4 - 3d3. -d3(7d + 3) Suppose 3k4 + 6k*3 - 255k*2 - 1050k = 0. What is k? -7, -5, 0, 10 Suppose 1372z5 + 30380z*4 + 3472z*3 - 18176z*2 + 6656z - 704 = 0. What is z? -22, -1, 2/7 Factor -c*3/5 + 22c*2 + 117c/5 - 666/5. -(c - 111)(c - 2)(c + 3)/5 Solve -2q5 + 18q*4 - 14q*3 - 18q*2 + 16q = 0. -1, 0, 1, 8 Solve 3x5/4 - 21x*4/2 + 57x*3 - 150x*2 + 192x - 96 = 0 for x. 2, 4 Determine j so that -135j5 + 8181j*4/2 + 2967j*3 - 2331j*2/2 + 93j = 0. -1, 0, 2/15, 1/6, 31 Determine x, given that 3x5 - 6x*4 - 39x*3 - 30x*2 = 0. -2, -1, 0, 5 Factor 2z*2/7 + 110z/7 + 156. 2(z + 13)(z + 42)/7 Factor -2k3/7 + 2k*2 + 6k - 54/7. -2(k - 9)(k - 1)(k + 3)/7 Suppose b2/9 + 214b/9 - 215/9 = 0. What is b? -215, 1 Let 7b4/5 - 33b*3/5 - 101b*2/5 - 15b - 14/5 = 0. Calculate b. -1, -2/7, 7 Factor 3r3 + 729r*2 + 59049r + 1594323. 3(r + 81)3 Factor 3s*2/7 - 75/7. 3(s - 5)(s + 5)/7 Factor -2l*2 + 132l + 1022. -2(l - 73)(l + 7) Factor -v*4/5 + 16v*3/5 - 3v2. -v2(v - 15)(v - 1)/5 Suppose w5/8 - w4 + 2w3 - w2/4 - 17w/8 + 5/4 = 0. What is w? -1, 1, 2, 5 Let 2p2 + 140p + 138 = 0. What is p? -69, -1 Determine x, given that -3x2 + 1554x + 1557 = 0. -1, 519 Factor u*3/7 + 8u*2/7 + 15u/7. u(u + 3)(u + 5)/7 Factor a*3/2 - 29a*2/2 + 14a. a(a - 28)(a - 1)/2 Find b, given that 4b2 - 100b = 0. 0, 25 Find k, given that -3k4/5 + 3k*3 + 9k*2/5 - 27k + 162/5 = 0. -3, 2, 3 Factor 35y2 + 285y + 280. 5(y + 7)(7y + 8) Factor -3c*3 + 3c*2 + 3c - 3. -3(c - 1)2(c + 1) Let 2x3/5 - 26x*2/5 + 78x/5 - 54/5 = 0. What is x? 1, 3, 9 Factor -5x4 - 760x*3 - 28880x*2. -5x*2(x + 76)*2 Factor 4d*4/3 + 3312d*3 + 6180184d*2/3 + 4110192d + 6160324/3. 4(d + 1)2(d + 1241)*2/3 Factor 5f*5 - 40f*4 + 100f*3 - 80f*2. 5f*2(f - 4)(f - 2)2 Factor f5/4 + 53f*4/4 + 455f*3/4 + 1075f2/4. f2(f + 5)2(f + 43)/	{ "pile_set_name": "DM Mathematics" }
the remainder when c + 418/6 + 6/18 is divided by 8? 7 Let m(x) = 109x + 264. What is the remainder when m(9) is divided by 40? 5 Let h(q) = -q3 + 15q*2 + 18q - 3. Suppose -6k + 72 = -24. Let r(c) = -c + 19. What is the remainder when h(k) is divided by r(9)? 9 Suppose i = 12x - 7x - 49, 5x - 4i - 61 = 0. What is the remainder when 638 is divided by x? 8 Suppose 320m = -330m + 661m - 29898. Calculate the remainder when m is divided by 47. 39 Suppose -148 = 9m - 46m. Calculate the remainder when 54473/285 + m/(-30) is divided by 52. 35 Calculate the remainder when 1976 is divided by 332/14 + (-720)/1008. 21 Calculate the remainder when (2 + 659)/(2 + (1 - (8 + -6))) is divided by 98. 73 Suppose -19d = -18d - m + 49, 3d + 131 = -m. Calculate the remainder when 68 is divided by (d/(-30))/((-3)/(-18)). 5 Suppose 0 = -5b + g + 388, 0g - 2g = 5b - 379. Let o be 1295/b + 6/33. What is the remainder when 77 is divided by 342/o - (-6)/(-51)? 17 Suppose -34z = -24z + 2610. Let q = -252 - z. Calculate the remainder when 98 is divided by q. 8 Let i = -241 + 205. What is the remainder when 38 is divided by (138/(-4))/(i/24)? 15 What is the remainder when -2(-254)/(-4)1538/(-1538) is divided by 8? 7 Suppose -2b + b = -24. Let z = -458 - -451. What is the remainder when 95 - ((-165)/(-105) - 3/z) is divided by b? 21 Suppose 4q - 84 = 5y, -242y + 246y = -3q + 63. What is the remainder when 3670 is divided by q? 16 Suppose 5a - a + 1872 = 0. Let k = -253 - a. Calculate the remainder when k is divided by 27. 26 Suppose 74d + 657 + 272 = 5073. What is the remainder when 891 is divided by d? 51 Let w(d) = -2d - 6d3 + 22 + 4d*3 - 31. Let h = 83 - 57. Calculate the remainder when w(-3) is divided by h. 25 Suppose 333h = q + 328h - 81, -3q + 4h = -210. Calculate the remainder when 92 is divided by q. 26 Let n(u) = 110u + 7. What is the remainder when n(3) is divided by 234? 103 Let v(b) be the first derivative of 1/4b4 + 10b - 9b2 - 12 - 8/3b*3. Calculate the remainder when v(10) is divided by 8. 6 Let k = -45 + 53. Suppose 4v = -2x + 200, -2 + k = -3x. Suppose 4m = -15 + v. Calculate the remainder when 70 is divided by m. 7 Suppose -5v + 250 + 1070 = 0. Let x = -6323 + 6342. What is the remainder when v is divided by x? 17 Let j(b) = 3b + 8. Let k be j(6). Suppose 20 = -3x + 5c, 0x - k = 2x + 3c. Calculate the remainder when 9 is divided by ((-3)/15 - 32/x) + -1. 1 Let d(c) = c*2 - 31c + 11. Let s be d(18). Let v = s - -338. Calculate the remainder when v is divided by 29. 28 Let r(v) = 57v3 - 4v*2 + 10v + 1. What is the remainder when r(2) is divided by 25? 11 Let l be 0 + (3 - 1) - (-2 - -8). Let s(y) = -y*3 - 6y*2 - 11y - 3. Calculate the remainder when s(l) is divided by 8. 1 Let s(l) = -2l2 + 28l + 843. Calculate the remainder when 722 is divided by s(28). 14 Calculate the remainder when 285 is divided by 18/(30/44 + (-6)/33). 33 Let p = 52165 - 52033. Calculate the remainder when p is divided by (-5)/(-1 + (-16)/(-18)). 42 Suppose 11c = 7546 + 10398 + 9985. Calculate the remainder when c is divided by 843. 10 Suppose -16 = 4f - 68. Suppose 2p + z - 5 = 0, -3 = -0z + z. What is the remainder when f is divided by p? 1 Let u(h) = 2h2 + 81h - 587. Calculate the remainder when u(9) is divided by 36. 16 What is the remainder when 1529 + 2 + 432/(-18) is divided by 68? 11 Let o = 2 + 2. Suppose g - 143 = -3q, -84 = -4q + og + 80. What is the remainder when q is divided by (-5 + 115)/(-22) + (-1)/(-1)17? 10 What is the remainder when 37616/40 - -9 - (51/15 - 3) is divided by 95? 94 Let s(d) = -2d + 5d + 2d - 2 - 5. Suppose -5 = -4k + 7, -5k = -5h + 240. What is the remainder when h is divided by s(5)? 15 Let u = 11196 + -10730. Calculate the remainder when u is divided by 93. 1 Let o = -401 + 440. Suppose -61 = -10v + o. Calculate the remainder when 35 is divided by v. 5 What is the remainder when 43 is divided by 780/(-325)(-2 + (-1 - 2))? 7 Suppose 0 = -3t - 2r + 4776, -3188 = -2t - 66r + 64r. Calculate the remainder when t is divided by 55. 48 Suppose 298i = 296i + 7638. Calculate the remainder when i is divided by 26. 23 Suppose 2q - 816 = 4m, -4q - 7m = -12m - 1623. Suppose 0 = -13a + 300 + q. Calculate the remainder when a is divided by 11. 10 Let o be 6/(-54) + 100984/36. Suppose o = 23b + 10b. What is the remainder when 181 is divided by b? 11 Let o = -8117 - -9071. What is the remainder when o is divided by 249? 207 Let y = -22714 + 23899. Calculate the remainder when y is divided by 253. 173 Suppose 2p + 92 = 3p. Let k(a) = 2a*2 - 12a + 19. Let z = -97 - -103. Calculate the remainder when p is divided by k(z). 16 Suppose 10a - 1288 - 892 = 0. Let g = a - 206. What is the remainder when 30 is divided by g? 6 Let y = 40 - 28. Suppose -2i + 62 = -4o, 3o - i - 17 = 4o. Let g(s) = s2 + 11s - 72. What is the remainder when y is divided by g(o)? 4 Let u(a) = 2a3 - 27a*2 + 111a - 13. What is the remainder when 826 is divided by u(8)? 142 Let h(u) = -u*2 - 8u + 44. Let c = 347 + -356. What is the remainder when h(c) is divided by 4? 3 Let r(t) = t*2 + 6t - 16. Calculate the remainder when r(-12) is divided by 21 + -5 + 8 + 8. 24 Let n(k) = -29k + 9. Let g(q) = -19q + 6. Let b(a) = -8g(a) + 5n(a). What is the remainder when 483 is divided by b(3)? 15 Let a(z) = -z*3 - 2z*2 + z + 130. Let i be a(0). Suppose 3x - 2o = 113 + 66, i = 2x + 4o. What is the remainder when x is divided by 8? 5 Let o = 76 + -74. Suppose -3p + p + 2 = ok, -12 = 3k. Suppose pn = 244 + 96. What is the remainder when n is divided by 19? 11 Let n(a) = 2a*2 - 22a + 33. What is the remainder when n(13) is divided by (-2)/(-6)6/15360? 37 Let j be 56/(-9) - (-8)/36. Suppose 0 = -5b - 5k + 15, 0 = -4b - b + 5k - 15. Calculate the remainder when 23 is divided by (-3)/jb + -1 + 19. 5 Let w(f) = f + 39. Suppose 14m + 555 = -m. Let q = -55 - m. Calculate the remainder when 35 is divided by w(q). 14 Suppose -335x + 2640697 = -23x - 579767. What is the remainder when x is divided by 116? 114 Let r = 2005 - 1745. What is the remainder when r is divided by 69? 53 Suppose 4y = -5q - 5, -3q = y + q + 4. Suppose yr = -2r. Suppose r = 3l + 2l - 20. What is the remainder when 17 is divided by l? 1 Let u(x) = 2x*2 - 427x + 5826. What is the remainder when u(14) is divided by 38? 12 Let q be (-12)/(-10)160/(-24). Let j(u) = u2 + 15u + 38. Let h be j(-9). What is the remainder when 25 is divided by 2/q - 244/h? 10 Suppose 7i - 11i - 2r = -4, -15 = 3i - 3r. Let w(k) = 38k + 62. What is the remainder when w(i) is divided by 14? 10 Let f = 33772 - 30113. Calculate the remainder when f is divided by 78. 71 Let i = 14724 + -13995. What is the remainder when i is divided by 74? 63 Let j(t) = t*2 - 6t - 1. Suppose -31z + 30z + 76 = 0. What is the remainder when z is divided by j(7)? 4 Let v = -90640 + 90644. Calculate the remainder when 0 + (15 - (-1 + 2)) is divided by v. 2 Suppose 0 = 3m - 5t - 32, 0 = 4m - 0t - t - 20. Suppose 0 = -1042a + 1040a + 584. Let k = 304 - a. Calculate the remainder when k is divided by m. 0 Let f(m) = 2m - 5. Let x be (-4 + 2)/((-17)/238). What is the remainder when (x/42)/(4/54) - 1 is divided by f(4)? 2 Let t(h) = 6h*2 + 51h + 132. What is the remainder when t(-27) is divided by 10? 9 Suppose o + 7t = 2t + 319, -1276 = -4o + 2t. Let d = -298 + o. Calculate the remainder when 86 is divided by d. 2 Suppose 0 = -4r + 4, 18 = 3g + 2r - 5. Calculate the remainder when 197/6 - (-3)/18 is divided by g. 5 Let c = 90 - 79. Suppose -cl = -400 - 414. Let q = l - 63. What is the remainder when 31 is divided by q? 9 Suppose -5z - 18 + 33 = 0, 50 = v - 4z. What is the remainder when v is divided by (((-8)/3)/(-4))/((-16)/(-120))? 2 What is the remainder when 200 is divided by -91/(-24) - (-4 - (-1565)/(-8))? 0 Let q(o) be the third derivative of o6/120 + o5/60 - 2o*4/3 - 11o*3/6 + 99o*2. What is the remainder when 292 is divided by q(5)? 56 Let t be (-2)/(-2) + (-6 - 10 - -20). Suppose -4k = -4u - 1608, 0u + tu - 1238 = -3k. What is the remainder when k is divided by 10? 6 Sup	{ "pile_set_name": "DM Mathematics" }
rivative of 8q2 - 7/6q*3 + 0 + 0q + 1/12q4. Determine u(6). 5 Let d(w) be the third derivative of w4/12 - 5w*3/6 - 7w2. Let r be ((-1)/(-1))/(1/6). What is d(r)? 7 Let c(l) = l2 - l - 2. Let v(t) = 3t2 + t - 6. Let o(z) = 4c(z) - v(z). Determine o(-4). 34 Suppose -v + 16 = -h - 2h, 0 = 3h + 9. Let x(y) = 7 - v - 1. Let f(c) = -c*2 - 2c + 2. Let l(j) = -f(j) - 2x(j). Determine l(-4). 8 Let s be (-16)/24 - (0 + 20/(-3)). Let j(u) = u2 - 6u + 6. Determine j(s). 6 Let a(i) = -2i + 2. Let t(d) = -13d + 9. Let x(n) = 3a(n) - t(n). Determine x(-8). -59 Let x = 252 - 250. Let y(o) be the second derivative of -ox + 1/12o*4 + o + 0 + 0o*3. Determine y(-3). 7 Let n = 100 - 98. Let p = 18 - 13. Let r(d) = -7d3 + d2 + 5d + 1. Let y(l) = 3l3 - l2 - 2l. Let t(w) = py(w) + 2r(w). Give t(n). -2 Let g be 24/4 + -3 - -33. Suppose -2k - k + g = 0. Let z(i) = 1 - 5i2 - 5i + ki2 - 6i2. What is z(3)? -5 Let g(v) = v2 - 7v + 4. Suppose -2l - 3 = -1. Let i be (-2 - -5) + 5 + l + 0. Calculate g(i). 4 Let u(t) be the second derivative of 1/20t5 + 0 + 2t*2 + 1/6t*3 + 2t - 1/12t4. Give u(0). 4 Let r be (-1 - -3) + -17 - (-5 + 3). Let h(j) = 2j*3 + 9j*2 + 9j + 2. Let w(s) = -s*3 - 4s*2 - 4s - 1. Let y(z) = rw(z) - 6h(z). Determine y(2). -3 Suppose -q = -2s - 33, 0q + 54 = -4s - 2q. Let t = s - -18. Let v(r) = r*2 - 2r. Determine v(t). 3 Let r(a) = 2a + 1. Let k(q) = q2 + q - 94. Let u be k(9). Give r(u). -7 Let i(x) be the second derivative of -x4/12 - 2x*3/3 - 4x*2 + 7x + 8. Calculate i(-4). -8 Let j(t) = -t*2 - 7t - 7. Let b(r) = 3r2 + 18r + 22. Let u(k) = -2b(k) - 7j(k). Calculate u(-10). -25 Let k(r) = r*3 - 3r*2 - 4r + 3. Let j(w) = -3w3 + 9w*2 + 11w + 2. Let p be j(-1). Determine k(p). -9 Let l(a) = -2a + 8. Suppose -5t + 6t = r - 17, 5r - 121 = -4t. Let i be ((-10)/(-15))/(2/r). Give l(i). -6 Let r = -61 + 43. Let s = r - -22. Let v(n) = n3 + n2 + 4n + 9. Let t(o) = o*2 + o + 1. Let m(y) = -5t(y) + v(y). Calculate m(s). 0 Let s(r) be the third derivative of -r6/120 + r5/60 + 7r3/3 + r2. Suppose -57 + 37 = -5l, -2l = -3y - 8. Calculate s(y). 14 Suppose 8s = 5s - 9. Let b(q) = 2q2 - 6q - 2. Let j(r) = 5r2 - 13r - 4. Let g(a) = sj(a) + 7b(a). Calculate g(-5). -12 Let j(i) = -i*3 + 3i*2 + 5i - 2. Suppose 8 = -3n + 2z + 15, 16 = 4n + 4z. Determine j(n). 13 Let f(i) = -5i + 36. Let a(g) = 2g - 12. Let j(k) = -8a(k) - 3f(k). What is j(-5)? -7 Let s(f) = -2 + 1 - 8f2 - 2 + 249f - 252f. Give s(-2). -29 Let g be (-2)/(3(-2)/(-24)). Let u = -2 - g. Let m be (-46)/(-6) + (-4)/u. Let c(b) = -b*2 + 7b + 3. Give c(m). 3 Let p(n) = n*2 - n - 5. Let r be (3/(-1) - -3)/(-1). Suppose r = 4l - z - 1, -4l + 3 + 2 = -5z. Determine p(l). -5 Let u(g) = g*3 - 5g*2 - 7g - 7. Suppose 58 + 86 = 24x. Calculate u(x). -13 Let c(z) be the third derivative of z6/720 - z5/60 + 7z*4/24 - 3z*2. Let v(x) be the second derivative of c(x). Give v(3). 1 Let m(w) = w + 12. Let v be m(-10). Let q(d) = -74d*v + 2 - 5d - 74d2 + 147d*2. Determine q(-4). 6 Let q = 89 + -90. Let d(o) = 7o3 - o2 + o + 1. What is d(q)? -8 Let a(d) = 4d. Suppose -6w + 44 = -10. Suppose wb = -17 - 1. Calculate a(b). -8 Suppose -3o - 15 = -3r, -4r + 0o + o = -14. Let z(j) be the third derivative of -j5/60 + j4/12 + j3/6 - 2j*2 + 8j. Give z(r). -2 Let n(q) be the first derivative of -q*4/2 - 31q*3/3 + 15q*2/2 - 23q - 715. Give n(-16). -7 Let q(f) = -f - 26. Let n be ((-165)/35 - -5) + 2/(-7). Give q(n). -26 Suppose 2o + 2u = -4 - 10, 2o + 5u = -17. Let z(s) = s - 2. Let f(p) = 0p + 2p - p - 1. Let n(d) = -3f(d) + 2z(d). Give n(o). 5 Let v = -938 - -923. Let j(u) = -2u2 - 31u - 17. Give j(v). -2 Suppose -7 + 1 = -2g. Let z(c) = 0c - gc + 2c + 2. Suppose 0 = -4r - 12, -l - 13 = l + 3r. Calculate z(l). 4 Let s(p) = 2p2 - 15p + 26. Let h be s(6). Let g(a) = -3a. Determine g(h). -24 Let k(r) = -26r - 13. Let t(n) = -n - 3. Let m(x) = -k(x) + 6t(x). Let u be (1 - -11)-4. Let c(d) = 13d - 3. Let l(s) = uc(s) + 5m(s). Give l(1). -5 Let p(j) be the first derivative of 5j3/3 - j2/2 + 2j - 74. Determine p(1). 6 Let z(n) = -5n - 1. Let x be 400/35 + 3 + (-17)/7. Suppose x = 12d - 16d. Calculate z(d). 14 Let w(n) = n2 + 6n - 6. Let k be 1/(-3) + ((-385)/(-15))/11. Suppose 4u + f + 26 = 0, -7u = -ku - 2f + 39. Give w(u). 1 Suppose -u = 2m + 2u - 14, -9 = -m - 2u. Let q(p) = -3p*2 + 7p*2 + 0p - p*3 + 2p - m. Let f = 2 + 2. Give q(f). 7 Let l(z) be the third derivative of -z*5/120 + 13z*3/6 + 4z*2. Let n(h) be the first derivative of l(h). Determine n(-3). 3 Let z be (3/(-2))/(2/(-12)). Let y = -6 + z. Suppose 0 = yu - 5u + 6. Let g(n) = 2n*2 - 2n - 3. What is g(u)? 9 Let l(a) = 29a2 + 113a - 17. Let t be l(-4). Let m(v) = 3v2 + 8v - 22. What is m(t)? 13 Let u(h) = h*2 - 5h + 6. Let p(i) = i*3 + 6i*2 - 4i - 20. Let f be p(-6). Give u(f). 2 Let l(b) be the second derivative of b*3/6 - 56b. Give l(8). 8 Let o(k) = k - 1. Let l(z) = z*2 + 12z - 3. Let w(d) = -3d2 - 35d + 8. Let a(t) = -17l(t) - 6w(t). Let n be a(-6). Give o(n). 2 Let n(h) = 3h. Let u(o) = -7o + 1. Let v(z) = 6n(z) + 5u(z). Give v(2). -29 Let s(q) = 2q2 + 7q + 17. Let x be s(-7). Suppose 14 = -10t - x. Let k(l) = l + 10. What is k(t)? 2 Let c(u) be the third derivative of -u5/60 + u4/2 + 3u*3/2 + 455u*2 + 2. Calculate c(15). -36 Let y(n) = 0 - 2 + 1. Let h(d) = 2d*2 - d - 4. Suppose g = 2 - 4. Let t(b) = gy(b) + h(b). What is t(2)? 4 Let r(m) be the third derivative of m6/120 - m4/4 - m*3/3 + 3m*2 - 15. What is r(-4)? -42 Suppose 0 = -k + 8 - 3. Let i(z) = -3 + 1 - z - 3 + 2z. Give i(k). 0 Let c(i) = 3i + 7. Let y be (-1)/(-2)-101. Let t be ((-8)/y)/((30/25)/(-6)). Determine c(t). -17 Let v(m) = -2m*2 + 3m + 39. Let h(c) = 3c2 - 3c - 59. Let o(a) = 5h(a) + 8v(a). Give o(10). 7 Let f(d) = d*2 - 12d - 3. Let h(v) = v + 1. Let y(n) = -f(n) - 6h(n). Give y(5). 2 Suppose 29r + 72 - 101 = 0. Let q(m) be the second derivative of m3/6 + m2/2 + 2m. Give q(r). 2 Let p(z) = -2z*2 - z - 1. Let k be p(-1). Let w(o) = 2o - 1. Give w(k). -5 Suppose -m + 22 = 5u, 5m - 60 = -5u - 10. Let v(n) = n3 - 7n*2 - 4n + 5. What is v(m)? -23 Let a(l) = l*2 - 7l - 7. Let s = -267 + 272. Determine a(s). -17 Let y(i) be the second derivative of 1/6i3 - 7/2i*2 + 0 - 10i. What is y(-6)? -13 Let h = -10 + 4. Let x(k) = 95k - 7 - 96k - 4 + 0. What is x(h)? -5 Let t(z) be the first derivative of z*2/2 - 3z - 24. Calculate t(6). 3 Suppose 0 = -4s - 39 - 13. Let d = -8 - s. Let c(w) = w - 4. Give c(d). 1 Suppose z = 3z - 18. Let r(g) = 4 + 3g - 5g*2 + 11g*2 + 0g*2 - zg*2. What is r(3)? -14 Let h(n) = -n - 3. Let j be h(-6). Let x(s) = -1 - 3s2 + 2 - sj + 13s - 15s. Give x(-2). 1 Let t(s) = 2s + s2 - 1 - 3s + 0. Let v = 3157 + -3154. Calculate t(v). 5 Let r = 493 - 483. Let x(d) = d*2 - 13d + 10. Calculate x(r). -20 Suppose 296 = 3r - 586. Let g be r/77 + (-2)/(-11). Let c(y) = 5y + y + gy2 - y3 + 0y*3 - 2. What is c(5)? 3 Suppose -5 - 10 = -5d. Suppose -3h - dq + 12 = 0, 3h - 6h + 12 = -4q. Let r(j) = j. Calculate r(h). 4 Suppose 2j = -4y - 6, 3j - 8 = -5y - 17. Let l(k) = 3k*2 + k + 6. Calculate l(j). 30 Let x(y) = 7y*3 + 2y*2 + 5y - 6y3 - 14y*3 - 9y*3 - 4y. What is x(-1)? 23 Let c(r) = -r*3 + 6r*2 - r - 1. Let h be -5 - -9 - 51. Let u be 3/(-3) + (-2 - (h - 8)). Calculate c(u). -7 Let z(i) = i*2 - 8i - 7. Suppose -27m + 46m = 171. Calculate z(m). 2 Let k(r) be the first derivative of r*3/3 + 6r - 169. Suppose 0 = 3d - 8d + 50. Suppose -4v + d = -5f, 4v + 3f = -f - 8. Calculate k(v). 6 Let m = 64 - 61. Let l(o) = 0 + o*3 - 2 + 0o*m + 20o*2 - 18o*2. Calculate l(-3). -11 Let n(k) = 2k + 4. Let s be (0/(-2))/((-10 - -9)-1). Calculate n(s). 4 Let g(u) = -u2 - 2u - 12. Let b(w) = -2w3 - 10w*2 - 2w - 10. Let m be b(-5). Determine g(m). -12 Let x(j) = j*2 + j - 5. Let y be (-3)/((-6)/(-40))48/15. Let i = y + 64. Calculate x(i). -5 Let g(v) = -4*v	{ "pile_set_name": "DM Mathematics" }
1)*2(l + 2)*2/5 Let r(s) = 3s*4 + 60s*3 + 72s*2 + 51s + 6. Let q(b) = -2b4 - 30b*3 - 36b*2 - 25b - 3. Let v(y) = 15q(y) + 7r(y). Solve v(o) = 0 for o. -1, -1/3 Let s = -130 - -135. Suppose 4g - 3j + 5 = 2j, 0 = -sg + 5j - 5. Solve g - 1/2r*4 + 0r - 1/6r3 + 1/3r*2 = 0. -1, 0, 2/3 Let m(z) = 31z*2 + 590z + 24. Let o be m(-19). Determine d so that 0 + 7/4do - 4d*4 - 3/4d*3 - d + 4d2 = 0. -1, 0, 2/7, 1, 2 Let v(j) be the first derivative of -j3/5 + 9j2 - 168j/5 - 579. Factor v(n). -3(n - 28)(n - 2)/5 Let v(i) be the third derivative of -i*5/45 + 5i*4/9 + 34i*2. Determine a, given that v(a) = 0. 0, 10 Factor -188/15t + 2/15t2 + 4418/15. 2(t - 47)*2/15 Find l such that 0 - 32/3l*3 + 578/3l + 1/3l4 + 221/3l*2 = 0. -2, 0, 17 Determine d so that -2d*4 + 4261d - 12d2 + 8 - 4265d + d*4 + 5d*4 + 4d*3 = 0. -2, -1, 1 Let c(g) = -5g*3 - 20g*2 + 10g + 10. Let j(d) = d4 + d2 - d. Let i(x) = -c(x) - 5j(x). Find u, given that i(u) = 0. -1, 1, 2 Let n(o) be the first derivative of -o6/72 - o5/24 + 13o*3/3 + 8. Let t(z) be the third derivative of n(z). Solve t(m) = 0. -1, 0 Suppose 0 = -4x + 5r + 6, -2x - 2r + 12 = 0. Let u be (-1)/4 + (-12)/(-16). Find n, given that -1/2n*x + 0 - 3/4n*3 + 3/4n*2 + un = 0. -2, -1/2, 0, 1 Let p(m) = -3m4 + 7m*3 - 13m*2 - 23m - 24. Let k(u) = -4u4 + 8u*3 - 14u*2 - 23u - 27. Let b(f) = -4k(f) + 5p(f). Factor b(g). (g - 3)(g + 1)2(g + 4) Let t(k) be the first derivative of -5k3/3 - 3k2/2 + 4. Let m = -29 + 25. Let h(w) = -w2 - w. Let j(n) = mh(n) + t(n). Solve j(f) = 0 for f. 0, 1 Let i be 4/(-12) - (-4)/3. Let q = -2 + 8. Find l, given that -5l*4 + i - 6l*2 + 16l*2 - q = 0. -1, 1 Let c(k) be the second derivative of 2/75k*6 + 16/15k*3 - 48k + 6/25k5 + 0k*2 + 4/5k*4 + 0. Factor c(o). 4o(o + 2)3/5 Let j be 70/20(-162)/(-14). Let o = j + -40. Factor -5/2k4 + 0 - 4k*3 - 2k*2 - ok*5 + 0k. -k*2(k + 1)(k + 2)2/2 Suppose -96/11h*2 - 96/11 + 24/11h*3 - 2/11h*4 + 160/11h = 0. What is h? 2, 6 Let w = 9454 - 9451. Let -2y + 0 + 3/2y*4 + 6y*2 - 11/2yw = 0. Calculate y. 0, 2/3, 1, 2 Let g(r) be the third derivative of -r8/84 + 11r7/168 + r6/24 + 5r*3/6 - 15r*2. Let s(y) be the first derivative of g(y). Let s(z) = 0. Calculate z. -1/4, 0, 3 Let f be (-2 + (-24)/(-2))6/15. Let 4j2 + f + 26j - 14j2 + 0 - 20j = 0. Calculate j. -2/5, 1 Let j = 1127 - 1125. Suppose 3/7i4 + 3/7i*3 + 0i - 3/7i5 - 3/7i*j + 0 = 0. What is i? -1, 0, 1 Let i = -77 + 2. Let r = -47 - i. Let 3j*2 - 30j - j*2 + rj = 0. What is j? 0, 1 Factor -3m3 - 138m - 54m + 177 - 152m + 72m2 + 92m + 63. -3(m - 20)(m - 2)*2 Factor 0 + 0d*2 + 4/7d*5 + 16/7d*4 + 16/7d*3 + 0d. 4d3(d + 2)*2/7 Let t(d) = -3d*3 - 5d*2 + 29d + 29. Let z(o) = 6o3 + 11o*2 - 59o - 59. Let j(b) = -5t(b) - 2z(b). Let j(x) = 0. Calculate x. -3, -1, 3 Let f be 1 + 3 + 96/(-28). Let v(r) = r*3 + 4r*2 + r - 4. Let b be v(-3). Let -2/7c*b + 2/7c + f = 0. Calculate c. -1, 2 Let s(g) be the third derivative of g*5/12 - 125g*4/12 + 3125g*3/6 + 3g*2 + 6g. Factor s(w). 5(w - 25)2 Let g be 24/8 - (-1)/(-1). Let w = 7 - g. Find d, given that 3d*4 + d - wd*4 - 3d*2 + 5d*4 + 3d*3 - 4d4 = 0. 0, 1 Let z(c) be the second derivative of c5/210 + c4/21 + c3/7 + 4c2 - 8c. Let m(q) be the first derivative of z(q). Solve m(o) = 0. -3, -1 Let k(z) be the second derivative of -1/15z6 + 0 - 1/5z*5 + 23z + 2/3z3 + 1/6z*4 + 0z*2. Factor k(r). -2r(r - 1)(r + 1)(r + 2) Let s(a) be the first derivative of a6/14 - 24a*5/7 + 171a*4/4 + 40a*3/7 - 600a*2/7 + 639. Suppose s(h) = 0. Calculate h. -1, 0, 1, 20 Let i(t) be the first derivative of -2t*3/9 + 13t*2/6 - 2t - 6. Solve i(g) = 0 for g. 1/2, 6 Let z be 2/(-10) + (-6 - (-217)/35). Factor 1/6n3 + z + 1/6n*2 + 0n. n*2(n + 1)/6 Let s(z) be the first derivative of -z5/30 + z2/2 - z + 6. Let n(h) be the first derivative of s(h). Let v(r) be the first derivative of n(r). Factor v(b). -2b2 Let l = 47/43 - -1741/6708. Let j = 17/12 + l. Determine s so that -44/13s*3 - 2/13 - 6/13s*5 - js*2 - 2s*4 - 14/13s = 0. -1, -1/3 Factor 15w3 - 284w*4 + 176w*4 - 3w*2 - 2w*2 + 153w*4 + 25w*5. 5w*2(w + 1)*2(5w - 1) Let o(x) be the second derivative of -5x8/1344 + x6/32 + x*5/24 + 15x*2/2 + 3x + 2. Let k(i) be the first derivative of o(i). Solve k(u) = 0. -1, 0, 2 Let i be -2 + 5/135 + 2. Let o(x) be the second derivative of 0x2 + 1/90x*5 + 0 + 1/54x*4 - 1/135x*6 + 3x - ix3. Factor o(t). -2t(t - 1)2(t + 1)/9 Let t(d) be the third derivative of 1/110d5 + 0d*6 + 0d - d*2 + 1/22d*3 - 1/2310d*7 + 0 - 1/33d*4. Solve t(b) = 0. -3, 1 Let k = -34 - -40. Let t(c) = -c + kc - 9c - 12 + 5c*2. Let p(n) = -3n*2 + 3n + 8. Let v(o) = 8p(o) + 5t(o). Solve v(g) = 0. -2 Let x(m) be the first derivative of 3/8m4 + 5/3m*3 - 1/20m*5 - 1/120m*6 + 5 + 0m + 0m2. Let p(d) be the third derivative of x(d). Factor p(c). -3(c - 1)(c + 3) Let v(a) be the first derivative of -a5/45 - a4/36 + a3/9 + 5a*2/18 + 2a/9 + 49. Factor v(t). -(t - 2)(t + 1)3/9 Let h(p) be the first derivative of -p4/2 + 4p*3/3 + 50. Solve h(i) = 0. 0, 2 Let h(s) be the third derivative of -3s*2 + 0 + 1/10s*6 + 2/35s*7 + 0s + 0s4 + 0s*3 + 1/84s*8 + 1/15s*5. Factor h(c). 4c*2(c + 1)*3 Suppose 5f - 9f = -16. Let c be (f + -6)(20/(-6) + 3). Find h such that ch4 + 2h*2 + 0 - 2/3h - 2h3 = 0. 0, 1 Let n(s) be the third derivative of 1/3s*3 - 1/18s*4 + 0 + 0s + 1/270s5 + 11s*2. Let n(c) = 0. What is c? 3 Solve -8/7t*3 - 74/7 + 32t + 290/7t2 = 0. -1, 1/4, 37 Suppose -3o = 3c - 5c + 7, 3o = 5c - 13. Let w = 1 - o. Factor 6r2 - 5r*2 - w + 1. (r - 1)(r + 1) Let n = 27 - 25. Factor -2jn + 2j - 2j + 60j*4 - 58j*4. 2j*2(j - 1)(j + 1) Find t, given that -128/3 - 2/3t*3 - 136/3t - 40/3t2 = 0. -16, -2 Factor 225y - 45y2 + 7y*3 - 8y*3 - 375 + 3y3 + y3. 3(y - 5)3 Suppose 108 = -65s + 64s. Let l be (7/((-294)/s))/((-8)/(-14)). What is q in 1 - lq - 7q3 + 8q*2 - 1/2q*5 + 3q*4 = 0? 1, 2 Let w(m) = 2m*2 + 2m - 2. Let b be w(-2). Let o = -2/541 + 1108/7033. Factor -32/13 - okb + 16/13k. -2(k - 4)2/13 Find n, given that 4n*2 - 2n*2 - 79n*4 - 1 - 69n*4 + 147n*4 = 0. -1, 1 Let v be 3(4/12 + 0). Let c be v2/(-4)-24. Factor -2p2 - c + 12 - 2p. -2p(p + 1) Suppose -4b + 13 = 5. Factor -5 + 23x*2 + b - 20x*2. 3(x - 1)(x + 1) Let v(r) = 2r + r2 - r3 - 3r - 1 - 2r2. Let y(q) = q4 + 5q3 + 4q*2 + 4q + 4. Let x = 4 - 3. Let p(a) = xy(a) + 4v(a). Factor p(u). u*3(u + 1) Let a(i) = -12i3 + 315i*2 - 3024i + 4719. Let m(q) = -3q3 + 78q*2 - 756q + 1180. Let c(k) = 4a(k) - 15m(k). Solve c(t) = 0 for t. 2, 14 Let u be (2/(-13) - ((-15972)/143)/11)/6. Determine a so that 4/3a - ua*2 + 1/3 = 0. -1/5, 1 Let c(l) be the first derivative of 1/21l*3 - 5/7l*2 + 22 + 9/7l. Factor c(g). (g - 9)(g - 1)/7 Factor -10/3c*2 - 1/6c*4 + 0 - 2c - 3/2c3. -c(c + 1)(c + 2)(c + 6)/6 Let c(a) be the first derivative of a*5 - 15a*4/4 + 5a*3/3 + 15a*2/2 - 10a - 77. Factor c(j). 5(j - 2)(j - 1)*2(j + 1) Let i(h) be the third derivative of -h9/756 + h8/420 + h*7/105 - 11h*3/6 - 9h*2. Let b(t) be the first derivative of i(t). Factor b(j). -4j*3(j - 2)(j + 1) Let p(y) be the second derivative of 3y*5/80 + 9y*4/4 + 81y*3/2 - 9y - 1. Let p(i) = 0. What is i? -18, 0 Let a = 21 - 19. Let l be a/36 - -14. Find w, given that -10w*2 + 2w*3 - w + 4w + l + 3w + 0w*3 = 0. -1, 3 Suppose 0 = 5l - 3q - 13 - 26, 5l - 2q = 36. Let x be (4 + -3)/(2/l). Find v such that -4v - v*2 + 3v*3 + 1 - 2v*x + 3v = 0. -1, 1 Let v(k) be the third derivative of k*6/420 + 37k*5/210 - 11k*4/12 + 13k*3/7 - 4k*2 - 28. Determine u, given that v(u) = 0. -39, 1 Let y(b) be the second derivative of -2b*7/189 - 22b*6/135 - 2b*5/9 + 106b*4/27 - 266b*3/27 + 98b**2	{ "pile_set_name": "DM Mathematics" }
3 - 7/((-98)/152236)? 7, 1553 Suppose 6o - 3a = o + 24, 2a - 3 = -3o. Let q(h) = 9h3 - 2h*2 - 6h - 3. What are the prime factors of q(o)? 2, 3, 17 Suppose 82j - 1468 = 80j. Let c = j - 421. List the prime factors of c. 313 Let g(w) = -2406w3 + 5w - 17. Let b(p) = -802p3 + 2p - 6. Let x(s) = -11b(s) + 4g(s). List the prime factors of x(-1). 2, 401 Suppose -3z - 3z + 42 = 0. Let t = z + 11. Let g = 25 - t. What are the prime factors of g? 7 Suppose 2s = 11 - 21, r - 161 = s. What are the prime factors of r? 2, 3, 13 Let z(s) = s2 - 2s + 27. Suppose 3l - l - 35 = -c, -c = 3. List the prime factors of z(l). 2, 5, 7 Let f(a) = -4a*2 + 26a - 187. Let s be f(9). Let r = s + 526. List the prime factors of r. 3, 83 Suppose 30 = -5c, -10770 - 7267 = -f + 5c. List the prime factors of f. 11, 1637 Let n(b) be the second derivative of -b*5/20 - 5b4/12 + b3 + 17b2/2 + 7b - 11. List the prime factors of n(-10). 457 Let u(t) = -5t3 - 18t*2 - 15t - 52. Let p be u(-10). Let h = 4770 - p. List the prime factors of h. 2, 23 Let u be (-1)/2 - (-1015)/2. Let p = -367 + u. List the prime factors of p. 2, 5, 7 Let y(f) = 9f2 + f. Suppose 0 = x + 5x - 6. Let h be y(x). Suppose 0 = -hi + 8i + 212. What are the prime factors of i? 2, 53 Let f(t) = 21t + 263. Let q be f(6). Let y = q + 832. What are the prime factors of y? 3, 11, 37 Let s(w) = -156w. Let m be s(1). Let y(h) = 4h3 - 8h*2 - 14h + 33. Let v be y(5). Let q = v + m. List the prime factors of q. 107 Suppose 0 = 3x - 2n - 1304, -5n = -2n - 6. Suppose -440f = -xf - 232. What are the prime factors of f? 2, 29 Suppose 5y + 265 + 389 = -2q, -3y = 2q + 394. Let n = 434 + y. What are the prime factors of n? 2, 19 Let n be ((-55)/(-10))/((-14)/2352). Let d = -561 - n. What are the prime factors of d? 3, 11 Let b(f) = 14493f3 - 2f*2 + 38f - 35. What are the prime factors of b(1)? 2, 7247 Suppose -a = -f + 64318, -f - 3f + 12a + 257312 = 0. List the prime factors of f. 73, 881 Suppose 0h - 2s = -5h + 23, -h + 2s = -3. Suppose -hl + 1602 = -1268. What are the prime factors of l? 2, 7, 41 Suppose 2f = a + 29563 + 27618, -57161 = -2f - 3a. What are the prime factors of f? 2, 7, 1021 Let t(h) = -2h2 - 14h - 8. Let r be t(-6). List the prime factors of (-6)/(-72)r921. 307 Let c be 42(4/(-8))/((-3)/(-15)). Let k = c - -111. Suppose -kr + 1008 - 48 = 0. What are the prime factors of r? 2, 5 Suppose 45 = 3t - 3u + 24, 3u = -3t + 3. List the prime factors of (-3 - (-10)/t)(-356 - 0). 2, 89 Suppose 0 = -7v + 4v + 2409. Suppose -187 = 4z - v. What are the prime factors of z? 2, 7, 11 Suppose 0 = g + 5, 0 = q + 37g - 19g - 31618. What are the prime factors of q? 2, 7927 Suppose -3u = -k - 26, 5u + k - 62 = -2k. Let l be 12/(-5) + 2 - 196/u. Let j = 43 - l. What are the prime factors of j? 3, 7 Let f = -39 - -16566. List the prime factors of f. 3, 7, 787 Let n(f) = 0 + 8 + 5 - 9 - 6f. What are the prime factors of n(0)? 2 Let c(r) = -6r + 8. Let l = -49 - -56. Suppose -5n - l = 18, y + 5n = -44. List the prime factors of c(y). 2, 61 Let s(w) = 30w - 27. Let v(c) = 30c - 25. Let x(d) = 4s(d) - 3v(d). What are the prime factors of x(14)? 3, 43 Let d(r) = -r3 - r2 + 2r - 11. Let u be d(-4). Suppose f + 105 = 3i + u, 4i - 208 = 3f. Let v = -16 - f. List the prime factors of v. 2, 3 Suppose -f - 3d = -1864, f - 2d = 70 + 1804. Suppose -23t + f = -18t. List the prime factors of t. 2, 11, 17 Let c(j) be the second derivative of j - 21j*2 - 2/3j*3 + 0. What are the prime factors of c(-19)? 2, 17 Suppose -88p = 189p - 8949039. List the prime factors of p. 3, 11, 89 Suppose -6u + 8u + 13 = 3o, -3o - 2u = -29. What are the prime factors of (99/6)/((o/4)/7)? 2, 3, 11 Suppose 3544t + 27890 = 3554t. What are the prime factors of t? 2789 Let w(o) = o*2 - 5o - 13. Let g(s) = s + 7. Let m be g(0). Let k be w(m). What are the prime factors of (-2235)/(-60) - (k - (-7)/(-4))? 2, 19 Let o(w) = -24w + 36w + 26w + 9 + 17w. List the prime factors of o(3). 2, 3, 29 Let t = -127 + 131. Suppose 3c = -6 + 21, 5h + tc - 2140 = 0. What are the prime factors of h? 2, 53 Let t be 8 - (0 - (-8)/(-4)). Let h(d) = -2d*2 + 0d + d*3 - t + d + 8d*2. What are the prime factors of h(-5)? 2, 5 Let l = -11884 - -16662. What are the prime factors of l? 2, 2389 Suppose 63u + 42222 = -133422. Let i = -1845 - u. What are the prime factors of i? 23, 41 Suppose -293 - 246 = -49q. Suppose -7g + 4v = -qg + 4860, -g - 4v + 1224 = 0. What are the prime factors of g? 2, 3, 101 Let a = 62499 - 44146. What are the prime factors of a? 18353 Let j(f) = -f3 - 5f*2 + 2f - 33. Let l be j(-10). Suppose 0 = -3z - 0z - 711. Let o = z + l. What are the prime factors of o? 2, 3, 5, 7 List the prime factors of (-2)/((34/281367)/(-1)). 3, 613 Let f be -3 - (-1 - -3) - -5. Suppose f = z + 1, 0 = -4a - z + 4z + 2683. List the prime factors of a. 2, 5, 67 Let q(t) = -t. Let j(u) = 4u3 + 12u*2 - u. Let y(a) = -j(a) + 2q(a). Let o = 712 + -717. What are the prime factors of y(o)? 5, 41 Let r(x) = -2447x + 1000. What are the prime factors of r(-13)? 3, 10937 Suppose 5y = z - 20585, y = 110z - 111z + 20603. List the prime factors of z. 2, 5, 103 Let m(x) = 4x + 0 + 7 - x2 + 16. Let r be m(7). Suppose -ra - 3j + 51 = 2, -57 = -3a + j. What are the prime factors of a? 2, 5 Let u(v) = 66v3 + 17v*2 - 14v + 24. Let q(i) = -44i3 - 12i*2 + 9i - 16. Let n(c) = 7q(c) + 5u(c). What are the prime factors of n(4)? 2, 3, 13 Let s(g) = -g*3 + 9g*2 + 8g + 20. Let v be s(10). Suppose v = -5u + 3k + 845, 3u + 12k - 16k = 496. What are the prime factors of u? 2, 43 Let x = -487 - 74. Let o = x - -1032. List the prime factors of o. 3, 157 Suppose -3t + 79263 = 4u, -5u - 5t + 44105 = -54970. What are the prime factors of u? 2, 3, 367 Let x be (-340)/816/20. Let a = 242 + x. List the prime factors of a. 2, 13 Suppose -5u + 8u - 3o = -9, -3o + 8 = -2u. Let g(s) = -207s*3 + 2s2 + s + 2. What are the prime factors of g(u)? 2, 3, 5, 7 Let w(l) be the second derivative of l5/4 + l*4/3 - 7l*3/2 - 5l*2 + 8l + 1. What are the prime factors of w(7)? 2, 877 Suppose -24l - 135855 = 42l - 1795293. What are the prime factors of l? 3, 17, 29 List the prime factors of (-3)/((3378148/(-16320))/(-23) + -9). 2, 3, 5, 17 Let i(p) = 59p2 + 185p + 9. What are the prime factors of i(-6)? 3, 11, 31 Let x(l) = -8l + 10. Suppose 0 = -18h + 22h + 92. What are the prime factors of x(h)? 2, 97 Let h be 7/(-56)-438. Suppose 0 = 24k - hk - 2630. List the prime factors of k. 2, 263 Let s(d) = -d2 + 8d - 2. Let p be s(7). Suppose 144 + 188 = x - 5v, 3x - pv - 976 = 0. List the prime factors of x. 2, 7, 23 Let c = -25 - -6. Let a be 4/14 - (-804)/28. Let j = c + a. List the prime factors of j. 2, 5 Suppose 82o - 78o = -5s + 19, -2o - 8 = 0. What are the prime factors of 9207/s + ((-60)/35)/6? 5, 263 Let o(s) = 7s + 36. Let m = 35 + -13. Let z be o(m). Suppose 2i = -2g + z, -2g + 93 = i + g. List the prime factors of i. 2, 3 Let s = 21 + -16. Suppose -g = 3l + l, sl = g. Let j = 30 + g. List the prime factors of j. 2, 3, 5 Suppose -24494 = 18j - 69674. Suppose j + 658 = 12d. List the prime factors of d. 2, 3, 11 Suppose 0 = 9p - p - 32. Suppose 14v - 11v - 825 = -m, -pv - 839 = -m. What are the prime factors of m? 3, 277 Suppose 179498 = 44s + 17799 - 10341. What are the prime factors of s? 2, 5, 17, 23 Suppose -6h = 52 - 424. Suppose 176 = 5a - 3v, 2a - v - 3v = h. What are the prime factors of a? 37 List the prime factors of ((-503)/(-3))/(((-34)/(-1428))/((-48)/(-14))). 2, 3, 503 Let h = 16 - 12. Suppose hb - 770 = 778. List the prime factors of b. 3, 43 Let v(o) = 6o2 + 190o + 1403. What are the prime factors of v(-22)? 127 Let j(h) = -h - 3. Let c be j(1). Let d = 1 - c. Suppose 0 = -4i + 2i - db + 215, b = 5i - 497. What are the prime factors of i? 2, 5 What are the prime factors of 19818/4 + (-2)/4 + -6? 2, 1237 Suppose 102l + 82l - 904427 = 512557. List the prime factors of l. 3, 17, 151 Let n(c) = -1597*c - 139. List the prime factors of n(-3). 2, 1163 Suppose 2	{ "pile_set_name": "DM Mathematics" }
30 Calculate the highest common factor of 5577 and 330. 33 Calculate the highest common divisor of 1020 and 816. 204 Calculate the greatest common divisor of 32 and 39328. 32 What is the greatest common factor of 1628 and 220? 44 Calculate the greatest common divisor of 30 and 70. 10 What is the greatest common divisor of 11 and 719? 1 What is the greatest common factor of 2296 and 168? 56 What is the highest common divisor of 8368 and 48? 16 What is the highest common factor of 140 and 98? 14 What is the greatest common factor of 63 and 303? 3 What is the greatest common divisor of 232 and 4118? 58 What is the greatest common factor of 30400 and 19? 19 Calculate the greatest common factor of 6 and 726. 6 Calculate the highest common factor of 256 and 68. 4 Calculate the highest common factor of 3712 and 192. 64 Calculate the greatest common factor of 2 and 1730. 2 Calculate the greatest common divisor of 7 and 3. 1 What is the greatest common factor of 378 and 5103? 189 Calculate the highest common divisor of 1521 and 9. 9 Calculate the highest common divisor of 49 and 49. 49 What is the greatest common factor of 28 and 12? 4 Calculate the highest common divisor of 28 and 98. 14 Calculate the highest common factor of 459 and 85. 17 Calculate the highest common factor of 448 and 1288. 56 What is the highest common divisor of 105 and 336? 21 Calculate the highest common divisor of 159 and 63. 3 Calculate the highest common factor of 184 and 984. 8 What is the highest common factor of 4125 and 33? 33 Calculate the highest common factor of 2 and 16. 2 Calculate the highest common factor of 658 and 846. 94 What is the greatest common factor of 39 and 429? 39 Calculate the highest common factor of 729 and 45. 9 Calculate the highest common factor of 570 and 30. 30 Calculate the highest common factor of 11 and 20. 1 What is the greatest common divisor of 28 and 238? 14 What is the greatest common factor of 42 and 7910? 14 What is the greatest common factor of 33 and 528? 33 What is the greatest common divisor of 14 and 86? 2 What is the greatest common factor of 45 and 27? 9 What is the greatest common factor of 112 and 392? 56 Calculate the greatest common divisor of 2400 and 350. 50 What is the highest common divisor of 90 and 50? 10 What is the highest common factor of 544 and 17? 17 What is the highest common factor of 22 and 9427? 11 What is the highest common divisor of 348 and 12? 12 What is the highest common factor of 5339 and 19? 19 Calculate the greatest common factor of 7898 and 22. 22 What is the greatest common divisor of 703 and 4588? 37 What is the greatest common divisor of 1 and 113? 1 What is the highest common factor of 13952 and 384? 128 Calculate the highest common factor of 378 and 423. 9 Calculate the highest common factor of 1932 and 184. 92 Calculate the greatest common factor of 109 and 1199. 109 Calculate the greatest common factor of 150 and 20. 10 Calculate the highest common factor of 3060 and 72. 36 What is the highest common divisor of 128 and 544? 32 What is the greatest common divisor of 429 and 132? 33 Calculate the highest common divisor of 665 and 95. 95 Calculate the greatest common divisor of 44 and 748. 44 What is the highest common factor of 4 and 2? 2 Calculate the greatest common factor of 1168 and 438. 146 What is the highest common divisor of 35 and 45? 5 What is the highest common divisor of 1768 and 78? 26 What is the greatest common divisor of 230 and 40? 10 Calculate the greatest common factor of 1644 and 48. 12 What is the greatest common factor of 7 and 19068? 7 What is the greatest common factor of 72 and 252? 36 What is the greatest common factor of 1089 and 153? 9 Calculate the greatest common factor of 165 and 264. 33 What is the highest common divisor of 6 and 57? 3 What is the highest common divisor of 306 and 36? 18 Calculate the greatest common divisor of 78 and 12714. 78 Calculate the highest common divisor of 400 and 10300. 100 Calculate the greatest common factor of 261 and 54. 9 Calculate the greatest common divisor of 658 and 14. 14 What is the highest common divisor of 903 and 21? 21 What is the greatest common factor of 56 and 8? 8 Calculate the greatest common divisor of 2884 and 84. 28 What is the highest common divisor of 222 and 6? 6 What is the highest common divisor of 9275 and 159? 53 What is the greatest common divisor of 72 and 90? 18 What is the greatest common factor of 68 and 1054? 34 What is the greatest common factor of 480 and 30? 30 Calculate the greatest common divisor of 824 and 2266. 206 What is the highest common divisor of 54 and 6? 6 Calculate the highest common factor of 125 and 50. 25 Calculate the greatest common divisor of 18 and 342. 18 What is the highest common factor of 48 and 372? 12 Calculate the highest common divisor of 26 and 1703. 13 Calculate the greatest common divisor of 58101 and 181. 181 Calculate the greatest common factor of 12 and 1326. 6 What is the greatest common factor of 19346 and 68? 34 What is the greatest common divisor of 297 and 11? 11 Calculate the greatest common divisor of 205 and 40. 5 Calculate the highest common factor of 492 and 20. 4 What is the highest common factor of 95 and 15485? 95 Calculate the greatest common divisor of 68 and 476. 68 What is the highest common factor of 48 and 552? 24 What is the greatest common divisor of 36 and 873? 9 What is the greatest common divisor of 16 and 152? 8 Calculate the highest common factor of 47 and 1269. 47 Calculate the greatest common factor of 1 and 8123. 1 What is the greatest common divisor of 742 and 14? 14 Calculate the highest common divisor of 7455 and 105. 105 What is the greatest common divisor of 14 and 162? 2 Calculate the highest common divisor of 280 and 5530. 70 Calculate the highest common divisor of 60 and 128. 4 What is the greatest common divisor of 3384 and 252? 36 Calculate the greatest common divisor of 780 and 54210. 390 Calculate the highest common factor of 148 and 15133. 37 What is the highest common divisor of 1848 and 5236? 308 What is the highest common divisor of 407 and 1287? 11 Calculate the highest common divisor of 625 and 2. 1 What is the highest common divisor of 28640 and 80? 80 Calculate the greatest common factor of 159 and 848. 53 What is the greatest common factor of 5728 and 32? 32 Calculate the highest common divisor of 11 and 187. 11 Calculate the greatest common factor of 2895 and 30. 15 What is the highest common factor of 2132 and 52? 52 What is the highest common divisor of 264 and 168? 24 Calculate the greatest common factor of 39 and 2509. 13 Calculate the greatest common divisor of 58 and 2987. 29 What is the greatest common factor of 48 and 948? 12 Calculate the highest common factor of 45 and 1152. 9 Calculate the highest common divisor of 228 and 1539. 57 Calculate the highest common divisor of 840 and 40. 40 What is the highest common factor of 21 and 3? 3 What is the greatest common divisor of 98 and 3822? 98 What is the highest common divisor of 580 and 1885? 145 Calculate the greatest common factor of 49 and 46844. 49 What is the highest common divisor of 785 and 15857? 157 What is the greatest common divisor of 64 and 23248? 16 Calculate the highest common factor of 154 and 1166. 22 What is the greatest common divisor of 16 and 8? 8 Calculate the highest common divisor of 1711 and 116. 29 What is the greatest common divisor of 7520 and 10? 10 Calculate the greatest common factor of 26 and 299. 13 Calculate the greatest common divisor of 671 and 99. 11 Calculate the greatest common factor of 1974 and 42. 42 What is the highest common divisor of 3165 and 15? 15 Calculate the greatest common divisor of 343 and 98. 49 Calculate the highest common divisor of 1864 and 4. 4 What is the highest common divisor of 549 and 99? 9 Calculate the highest common factor of 112 and 259. 7 Calculate the greatest common divisor of 182 and 26. 26 What is the highest common divisor of 42 and 112? 14 What is the greatest common divisor of 800 and 704? 32 What is the highest common factor of 4845 and 68? 17 What is the greatest common factor of 354 and 13983? 177 What is the greatest common factor of 135 and 3105? 135 Calculate the greates	{ "pile_set_name": "DM Mathematics" }
002 + g. What is the nearest to 0.1 in n, -0.5, p? -0.5 Let f be (-4)/(-12) + (-45712)/(-8988) - 5. Let v = f - -1/107. What is the nearest to 1/6 in -4, v, -0.4, 1? v Let j = -19.6 + -0.4. Let z = -143 + 162.5. Let d = z + j. Which is the nearest to -1/4? (a) -0.2 (b) -3 (c) d a Let y be 1 - -26(-2)/64. Let c be ((-111)/333)/((14/6)/7). What is the closest to y in 6/11, c, 1/9? 1/9 Let n be (0 - -2)20/(-40). Let g be 12/16n/3. Which is the nearest to 4? (a) 1 (b) 1/10 (c) g a Let v be -5((108/6)/6 - 63/15). Let f be 2 + (-12)/4 + 4. What is the closest to 1 in f, v, 1? 1 Let p = 109.67 - 103. Let w = 6.7 - p. Which is the closest to 0.06? (a) 0.3 (b) -1/5 (c) w c Let l be 1/(-1) - -2 - (2 + -3). Suppose 5t = 6t + l. Let s be t/((-8)/12) - 17/5. Which is the closest to 0.1? (a) s (b) 5 (c) 0.4 c Let k be ((-8)/180)/((-11)/(-55)). Let t = -65 + 194/3. What is the closest to 0 in t, k, 0.4? k Let i be (-102)/85 - (-22)/10. Let x be (((-20)/5)/(-24))/((-20)/30). Which is the closest to 0? (a) -5 (b) x (c) i (d) 4 b Let m(s) = s*2 + 15s - 4. Let r be m(-15). Let q = -76.53 - -68.53. Which is the closest to q? (a) r (b) -0.1 (c) 4/5 (d) -1 a Let j = 12.46 - 0.46. Let v = 35/737 + 9/67. Which is the nearest to v? (a) j (b) 4 (c) -1/2 c Let g = -162677.3 + 162681.3. Let i = -2.29 - -0.09. Let x = -2 - i. What is the closest to g in 2/15, x, -3? x Let w be 1/(10/(-3 + -7)). Which is the closest to w? (a) 1/11 (b) -0.7 (c) -3/4 (d) 0.3 c Let f be (-40 + (-21899)/(-549))/(((-1)/(-3))/(-1)). Let b = 3.93 - -0.07. What is the nearest to -1 in b, -8, f? f Let m = 9562 - 2514807/263. What is the nearest to 0.1 in 1/4, -0.4, -5, m? m Let m = -810 - -501. Let r = -304 - m. What is the closest to -1 in -0.5, -2/13, r? -0.5 Let g = -35.8 - -33.8. Let y = -3 + g. Which is the closest to -1/4? (a) y (b) -0.4 (c) 1/5 b Suppose -3t + 0x = 2x - 3, 4x = 5t - 5. Let h = -13/597 + -1129/2985. Let l = -1 - -2. What is the closest to l in t, h, 4? t Let k(l) = l2 + 6l - 20. Let d be k(-8). Let q be (-1)/(-7)9 + (-5 - d). Let v = -0.3 + -0.7. Which is the nearest to q? (a) v (b) 2 (c) 3/7 c Let q = -13 - -13.1. Let z = -24/53 - -302/901. What is the nearest to -43 in z, -2, q? -2 Let f = 6159/4 + -30807/20. Let u = 3 - 4. Let g = u + 1. What is the nearest to g in 2, 0.5, f? 0.5 Let a = -1.91 + 2.2. Let r = -2.3 - -2.11. Let y = r + a. What is the nearest to y in -2/7, -5, 0? 0 Let r = -68 - -38. Let n be 2 + (-14)/r-3. Suppose 0 = 4i + 2h + 2h - 12, 3i - 9 = -h. What is the closest to -0.1 in i, n, 1/2? 1/2 Suppose -398s - 3036 = -467s. Which is the nearest to 0? (a) 1/11 (b) 6 (c) -0.1 (d) s a Let v = 17.05 - 15. Let j = v - 0.05. Let s be 8/(-36) + (-128)/72. What is the closest to s in 0.3, j, -0.5? -0.5 Let r(m) = 558m + 7255. Let c be r(-13). Let s = -2 - -4. What is the nearest to s in -0.3, -1, c? c Let p = -5932/3 + 23737/12. Let z = 1/115 - -227/345. Which is the nearest to z? (a) p (b) 3 (c) -1 a Let g be 2/8 - 26/40. Let j = -98.39 - -91.4. Let z = 0.99 + j. Which is the nearest to z? (a) -2/9 (b) g (c) 0.5 b Let z = 8367.93 + -8368. Which is the closest to -2/33? (a) -5 (b) z (c) -3 (d) -1 b Let z = 0.04372 - -221.05628. Let a = -221 + z. Let h be 22/(-42) - 3/21. What is the closest to a in 3, -1, h? h Let n = 181 - 165. Let l = -15 + n. What is the nearest to 1/5 in l, 0.1, -1? 0.1 Let g(l) = 6l*2 - 126l - 126. Let r be g(22). What is the nearest to 0.1 in -4, r, 0, 69? 0 Let z be 1/2(-204)/(-3). Let x = 55989 - 55993. What is the closest to x in 0.2, z, -1/6? -1/6 Let x = 101/5 + -103/5. Let k = -120449 - -120448. What is the nearest to 0.2 in k, x, -2/7? -2/7 Let w be -1 - 2/(-6) - 0. Let p be 34-1 + (-72)/(-18). Let m be ((-258)/p - 3/5)/(-2). Which is the closest to w? (a) m (b) -0.4 (c) -0.2 b Suppose 4w + 5o = o - 4, -5o = w + 17. Let b be ((-12)/8 + 4/8 + 5)/(66 - 100). What is the nearest to 0 in -1/4, b, w, -2/39? -2/39 Let j = 122379 + -122379.5. Let w = 5.9 + -0.9. What is the closest to 1 in w, -1, j? j Let t be 28/28 - (-56)/(-35). What is the closest to t in 2/3, 0.3, 0.6, -2/7? -2/7 Let p(n) = -2n - 17. Let u be p(-6). Let f = -32 + 31. Let t = 19 - 19.02. What is the nearest to f in t, -0.5, u? -0.5 Let o = -3634 - -3631.5. What is the closest to -3/7 in o, -0.5, -2, -3/4? -0.5 Let r = -17041 - -17040. Which is the closest to 20? (a) r (b) -3 (c) 18/5 c Let s = 5.787 + -4.887. Which is the closest to 1? (a) -5 (b) 15 (c) s c Let o = 66 - 64.98. Let x = o - 0.02. Let r = 335 - 338. What is the nearest to 0.2 in x, 5, r? x Let m = -31.7 - 144.3. Let q = -174 - m. Which is the nearest to -1? (a) -7/6 (b) q (c) -1 c Let q = 26780.3 + -26781. What is the nearest to q in 4, 3/10, -2/17, 71? -2/17 Let l = 2.8 - -0.2. Let n = 128549 + -128553. Which is the closest to 0.1? (a) n (b) -3 (c) l (d) -0.05 d Let p = -42.9 - -43. Let w be 1/3 + -3 + (-175)/(-15). What is the nearest to p in 1, 0.3, w? 0.3 Let n = -0.1071 + 0.0071. Let w(o) = -9o3 + 2o*2 - 1. Let i be w(-1). Let s be (2/(-5))/(7/i). Which is the closest to n? (a) s (b) 0.2 (c) 1 b Let p = 0.2 + -0.2. Let m(n) be the first derivative of -15n*2 + 150n + 255. Let l be m(5). Which is the closest to l? (a) 0.08 (b) p (c) -1 b Let q = -280/37 - -803/111. What is the closest to -0.3 in -4, q, -3/4, 0.5? q Let u = -421 - -542. Let x = u - 125. Which is the closest to 0? (a) 0.2 (b) x (c) -10 (d) 1/7 d Let b(a) = -7a2 + a3 + 7 - 50a + 1 - 10a + 51a. Let u be b(8). Let j = -318 + 2222/7. What is the closest to -6 in j, 3, u? j Suppose 4p = 7p. Let f = 122.92 - 120.92. What is the nearest to 2/3 in -2, p, 1, f? 1 Let l = 2 - 1.7. Let r = 91973 - 91975. Which is the closest to 2? (a) r (b) 4 (c) l c Let r = -224.1 + 224. Suppose -12w + 9w + 3 = 0. What is the nearest to w in r, -36, -1/3? r Suppose -5n = -10n + 5o + 75, o + 47 = 3n. Let z be (27/48)/(12/n). Let w = -0.2 - -0.1. What is the nearest to w in -1, -0.3, z? -0.3 Let z = 19880 + -19866. What is the nearest to 36 in z, -1, -0.2? z Suppose -g + 4q + 30 = 0, 0 = -4g - 3q + 12 - 44. What is the nearest to 1 in -98, g, 21? g Let r be (-11 - 82/(-8))1/(-3). Let b = 3.8 - 22.8. Let u = -19.1 - b. What is the closest to -2/5 in u, 2, r? u Suppose l - 60 = -2l. Let n be (-2(-30)/l)/(-1 + 0). Let f = -0.8 - -0.9. What is the nearest to f in -0.2, n, 1? -0.2 Let k = 6587.7 - 6587. What is the nearest to 1 in k, -3, -13? k Let w = 128.6 + -127.6. What is the nearest to w in 0.18, 0.3, -5, 4? 0.3 Suppose -12z = -9z - 126. Let c be 39/(-36) + -8(-7)/z. What is the closest to c in 2/5, 3/4, -0.1? 2/5 Let m = 195740785/1022 - 383055/2. Let t = m - -2/73. Which is the nearest to 12? (a) -0.5 (b) 0.3 (c) t b Let a = -0.03 + -1.97. Let n = 452 + -450. Let v = -0.2178 + 0.4178. What is the nearest to a in 0.4, v, n? v Let v = 50.9 - -60.1. Let m = v - 111.1. What is the closest to 1/2 in -0.7, -2, 4, m? m Let p = -20969.1 + 20969.3. Let z be 4/(-6) - -1 - 1. Which is the closest to z? (a) 3/4 (b) p (c) -0.2 (d) 1/4 c Let w = -10 + 14. Let p = -20117 - -20115. Suppose -3z - z = -8. What is the nearest to z in w, 13, p? w Let z = 384.39 + -386. Let k = 1.51 + z. Let s = -0.1 + 0.2. Which is the closest to s? (a) k (b) -0.06 (c) -1 b Let h = -1.89 + -0.11. Suppose -24j + 3 = 16j - 39j. Let u = 0 + 2. Which is the closest to -2/5? (a) j (b) h (c) u b Suppose -20g + 108 = 428. What is the nearest to g in 1/6, -5/2, -14? -14 Suppose 0 = v - a + 3 - 4, 4v + 3a - 18 = 0. Suppose -b + k = -8, 2k + 10 = 5b + vk. What is the nearest to -0.1 in -2, 4, b, -0.4? -0.4 Let x = -80.3 + 83.3. Which is the closest to -20? (a) 15 (b) -2/9 (c) 0.5 (d) x b Let d = 0.5882 - -0.4118. What is the closest to d in 8/3, 1/2, 0, 0.3? 1/2 Let p = 12758 + -12785. Which is the nearest to 3? (a) -1 (b) p (c) 0.13 c Let a be 14/49 - ((-4)/(-7) + 0). What is the closest to 27 in -2/5, a, 1/2? 1/2 Let a be (-4)/489 - 11093/(-60). Let m = a - 184. What is the closest to 3/4 in 2, 3/7, m? 3/7 Let j = 154/545 + -2476/4905. Let o(w) = w + 4. Let r be o(-3). What is the closest to -1 in 0.3, -1/7, r, j? j Suppose 1578*l - 1552	{ "pile_set_name": "DM Mathematics" }
00004 Let v = 11.000101 + -11. What is v rounded to four dps? 0.0001 Let n = -142.1115 + 659856.1115. Let i = n + -659717.19963. Let p = -3.2 - i. What is p rounded to four dps? -0.0004 Let z = 94.44977 + -94.5. Let l = 0.05 + z. Round l to 4 decimal places. -0.0002 Let y = 10.259 - 0.059. Let t = -6.2 + 0.1. Let c = t + y. Round c to the nearest integer. 4 Let g = -0.689 + 0.76. Let u = -971181.9289969 - -971182. Let z = g - u. What is z rounded to 6 decimal places? -0.000003 Let p = 87 + -47. Let v = 103 - p. Let j = 63.00000131 - v. What is j rounded to seven decimal places? 0.0000013 Suppose 5639975 = 3s - 0s - 5q, s - 3q = 1879985. Round s to the nearest 100000. 1900000 Let m = -15 + 19. What is m rounded to the nearest integer? 4 Suppose 0 = 3u - 0u. Suppose -f = 2t - 14793676, -4f = 3t - uf - 22190514. Let w = -4196838 + t. What is w rounded to the nearest one million? 3000000 Let k be -15 + -32290 - 10/(-2). Round k to the nearest 1000. -32000 Suppose -87 - 21 = -4o. Round o to the nearest 10. 30 Let f = -18.2 - -18. Let z = 1003 - 1003.1934. Let k = f - z. Round k to 3 decimal places. -0.007 Let f = 0.048 - 3.038. Round f to zero decimal places. -3 Let c(v) = 31v*2 - 19v - 30. Let y be c(9). What is y rounded to the nearest one hundred? 2300 Suppose 3x - 6390787 + 990799 = 0. Suppose -i + x = 5n, 720020 = n + n - 5i. Round n to the nearest 100000. 400000 Let k = -23.856 + 24. Let d = 32.31 + -32.1719. Let j = k - d. What is j rounded to three decimal places? 0.006 Let d = -5.12 + 0.12. Let b = 1 + d. Let r = b - -13.1. Round r to zero dps. 9 Let v = 0.0299 + 45.5701. Let d = 42.1 - 1.1. Let i = d - v. Round i to the nearest integer. -5 Let v = -1.00006 + 1. Round v to 5 decimal places. -0.00006 Let w = -6380.712 + 6380.61999961. Let s = -0.046 + 0.138. Let a = s + w. What is a rounded to seven decimal places? -0.0000004 Let o = 5504879093657 - 5504877766840.2999995. Let r = -1326817 + o. Let x = 0.3 + r. What is x rounded to 6 decimal places? 0.000001 Let j = 0.07 + -0.027. Let a = 0.154 - j. Let n = 0.11099949 - a. What is n rounded to seven dps? -0.0000005 Let p = 0.843 + -45.143. What is p rounded to the nearest ten? -40 Let l(g) = g2 - 10g + 3. Let q be l(10). Suppose 2 = -2k, 5k + 27599998 = qj + 7k. What is j rounded to the nearest one million? 9000000 Let j = -5.19922 + 5.2. What is j rounded to 4 decimal places? 0.0008 Let i = 2111.98787 - -0.01213. Let v = -2117.685 + i. Let c = -0.015 + v. What is c rounded to the nearest integer? -6 Let l = -6.32 + 6.4. Round l to the nearest integer. 0 Let m(y) = y*2 + y - 1. Let q be m(0). Let j be (-4 + 621q)5152. What is j rounded to the nearest one hundred thousand? -3200000 Let r = 169 - 87. Let m = -81.9926 + r. Round m to three decimal places. 0.007 Let c = -15.7146 - -15.7. What is c rounded to three dps? -0.015 Let o = -27 - -26.99992. Round o to four dps. -0.0001 Let w = 5.2 + 0.5. Let r = w + -14.3. Let n = r - -1. Round n to the nearest integer. -8 Let w(p) = -24500p*2 - p + 2. Suppose k + o - 3 = 0, -o = 2k - 0o - 5. Let h be w(k). Round h to the nearest 10000. -100000 Let f(w) = -2 + 3050w*3 - 3w + 4491w3 + 4459w3 - w2. Let n be f(-2). What is n rounded to the nearest ten thousand? -100000 Let c = -0.25 - -0.05. Let h = 0.2000032 + c. Round h to six dps. 0.000003 Let l(r) = r*2 - 9r + 4. Let o be l(9). Suppose -2 = -m, m - om - 3439994 = 4t. Round t to the nearest 100000. -900000 Suppose 3b + 15 = -2b. Let n be b - (-7)/(7/6). Suppose -32981 + 236981 = -nt. Round t to the nearest ten thousand. -70000 Let i = 17 + -14. Let s = 4 - 2. Suppose -sz + 4z + 5k = 1720, -iz + 2546 = -k. Round z to the nearest one hundred. 900 Let b = -619 + 619.0000393. What is b rounded to six decimal places? 0.000039 Let v = -0.1 - 1.4. Let x = -1.50108 - v. Round x to 4 dps. -0.0011 Let x be 226/12. Suppose -7d + xd + 2000 = 0. Round d to the nearest one hundred. 400 Suppose 10 = -2z, 3z + 2245 = 5l + z. Let w = -767 + l. Round w to the nearest 100. -300 Suppose -s + 5w + 13000 = 0, -3s + 6s + 2w - 39000 = 0. Round s to the nearest ten thousand. 10000 Let z = 8.8631 + -0.8676. Let n = z - 8. Round n to three dps. -0.005 Let x be (-1)/((10/8)/(-5)). Let l be x + (1 - 605) + 0. What is l rounded to the nearest 1000? -1000 Let f = 0.27 - 0.27. Let u = -1.1 - -1.0999965. Let a = f + u. What is a rounded to 6 dps? -0.000004 Let x = -7 - 28. Let p = 23 + x. Let h = -5.4 - p. Round h to the nearest integer. 7 Let g be ((-20)/(4 - 8))/1. Suppose 0 = -4x - s - s + 56400010, gs - 70500025 = -5x. Round x to the nearest 1000000. 14000000 Let d(k) = 4029k*2 + 12k - 11. Let r be d(9). Suppose -5f + 1776446 = r. What is f rounded to the nearest one hundred thousand? 300000 Let m = -27467702595 + 27467702205.00000167. Let p = m - -390. What is p rounded to seven decimal places? 0.0000017 Let b(y) = y3 + 22y*2 + 38y - 4. Let p be b(-20). Round p to the nearest ten. 40 Let o = 3.4 + -3. Let i = o + -0.6. Let j = -0.2000019 - i. What is j rounded to six dps? -0.000002 Let s = -9.4 + -2.2. Let y = s + 16.3. What is y rounded to the nearest integer? 5 Suppose -3g + 3l = -120, -5g - 3l = -0g - 208. What is g rounded to the nearest ten? 40 Let n be (872/(-24) + 0 + 3)90. Round n to the nearest 1000. -3000 Let j = -55207.0269876 + 55207. Let i = j - -0.027. What is i rounded to 6 decimal places? 0.000012 Let k = 4 - 6. Let w = 2 + k. Suppose -51500000 = -5r - wr. What is r rounded to the nearest one million? 10000000 Let r = -25 - 55. Let q = -79.9852 - r. Round q to 3 dps. 0.015 Let o = -0.089 + 0.089101. Round o to five dps. 0.0001 Let p = -26 + 8. Let u be (p - 2732)30012. Round u to the nearest 1000000. -10000000 Let c = -51.074 + 51. Let n = c + -0.256. What is n rounded to 1 decimal place? -0.3 Let w = -117.51 + 117. Let r = -0.428 - w. Let b = r + 0.658. What is b rounded to 1 dp? 0.7 Let n = 12.6 - 13. Let z = 0.1 + n. Round z to the nearest integer. 0 Let x = -3.4018 - 5.8083. Let o = -0.0799 + x. Let y = -7.9 - o. Round y to 1 dp. 1.4 Let u = 36 + -80. Let o = 1424813108 + -1424813063.99999922. Let l = u + o. What is l rounded to 7 dps? 0.0000008 Let t = 5.6 + -8.7. Round t to zero decimal places. -3 Let s = -256.9783 + 257. What is s rounded to 3 decimal places? 0.022 Let c = 66 - 66.06. What is c rounded to two decimal places? -0.06 Suppose 0 = 6u - u + 1015. What is u rounded to the nearest 10? -200 Let g = -59435888.9999876 + 59435921. Let j = g - 32. What is j rounded to 6 decimal places? 0.000012 Let z = 7071 - 7275.07. Let o = -205 - z. What is o rounded to one decimal place? -0.9 Let u = -1.1 + 18.1. Let i = u - 17.00000022. Round i to 7 dps. -0.0000002 Let l = -0.19 + 0.18999965. Round l to 7 decimal places. -0.0000004 Let y = 0.11 + 0.01. Round y to two decimal places. 0.12 Let b = 4439 - 4437.5955. Let l = -1.4 + b. Round l to three dps. 0.005 Let l = 133 - 132.941. Let h = l + -0.0589933. Round h to 6 decimal places. 0.000007 Suppose -11 = -5h + 4. Suppose 2s - hw = -3s + 3, 2s + 5w = -5. Suppose q + 12898 = -l, -2q + 6 - 2 = s. Round l to the nearest 1000. -13000 Let l = -204.1 + 213. Let q = 4.3 - l. Let w = -4 - q. What is w rounded to one decimal place? 0.6 Let k be (1650/20)/((-6)/(-4000)). Round k to the nearest 10000. 60000 Let h = -540.403 - -521. Let g = 0.003 + h. What is g rounded to zero decimal places? -19 Let g = 117.99999834 + -118. Round g to seven dps. -0.0000017 Let y = 31 + -22. Let n = 8.9928 - y. What is n rounded to 3 decimal places? -0.007 Let k = -3 - -3.05. Let b = k + -0.04999954. Round b to seven dps. 0.0000005 Let q = -3.153 - -3.165967. Let z = q - 0.013. What is z rounded to 5 dps? -0.00003 Let j = -68 + 68.0000042. What is j rounded to six dps? 0.000004 Let t be (-6)/(-2) + 6/(-6). Suppose t*x = -1044819 + 3566291. Let s = 890736 - x. What is s rounded to the nearest 100000? -400000 Let i = -64.746 + 65. Let n = 480726 - 480725.746119. Let b = n - i. What is b rounded to 5 dps? -0.00012 Let n = -0.8 + 0.04. Let s = -4 + 3.7. Let r = n + s. What is r rounded to 1 decimal place? -1.1 Let q = -18524 - 4058. Let m = 2418 - q. Round m to the nearest 10000. 30000 Let p = 539 +	{ "pile_set_name": "DM Mathematics" }
(v) = -271v + 125v - 4 + 244v. List the prime factors of i(1). 2, 47 Let l = 181 - 54. Suppose -5i + 927 = l. Suppose i = 3g + g. What are the prime factors of g? 2, 5 Suppose 3y + 292 = 5y + 4m, 3m = 15. What are the prime factors of y? 2, 17 Let a(k) = -12k*3 + 2k + 1. Let i be (-8)/(-10) - (-414)/45. Let s be (i + -7)/(-31). List the prime factors of a(s). 11 Let x(c) = -4c*3 + 4c*2 - 4c - 1. Let s be x(-4). Suppose 5m - 135 = s. What are the prime factors of m? 2, 47 Let r(y) = 9y*2 - 18y - 150. List the prime factors of r(-12). 2, 3, 227 Let b(c) be the first derivative of c*3 + 7c*2/2 + 3c - 1. Let n(o) = o - 12. Let u be n(7). What are the prime factors of b(u)? 43 Suppose -5p + p = -3420. List the prime factors of p. 3, 5, 19 Let b be (-1 + -45)((-25)/(-10) - 4). Let r = b + -18. What are the prime factors of r? 3, 17 Let q be (-36)/(-21)(-70)/(-4). Suppose 0 = -3c + 5h + 8, -2h + 10 - q = -4c. Let x = c + 9. What are the prime factors of x? 3, 5 Let q(d) = -243d3 - d2 + 4d + 4. List the prime factors of q(-1). 2, 11 Let c be 88/5 - 2/(-5). Suppose -65 = -cr + 13r. What are the prime factors of r? 13 Let i(x) = 37x*2 + 5x - 12. What are the prime factors of i(6)? 2, 3, 5 Let s be 2(6 + -3) + -2. Suppose s - 6 = -d. Suppose -4t + 45 = z, -dz + 2t + t = -112. List the prime factors of z. 53 Let l = 8 - -30. Let u = 94 - l. Let v = 80 - u. List the prime factors of v. 2, 3 Let y = -3634 + 6400. List the prime factors of y. 2, 3, 461 Let c(j) = -j*2 + 5j. Let i be c(5). Suppose i = 5z - z - 244. What are the prime factors of z? 61 Let l = 267 - -270. List the prime factors of l. 3, 179 Suppose 4a = 4r - 113 - 51, 5a = -2r - 240. What are the prime factors of a/4(-16 - -10)? 3, 23 Suppose 0 = 5v + 9 - 4. Let d(j) = 67j*2 - j. Let l be d(v). Let b = 103 - l. List the prime factors of b. 5, 7 Let w(l) = 7l - 21. Let f(z) = -7z + 20. Let v = -12 - -10. Let m(h) = vw(h) - 3f(h). What are the prime factors of m(8)? 2, 19 Let s(f) = f2 - f. Let c(w) = -2w*2 - 8w - 1. Let x(h) = -c(h) - s(h). Let q be x(-9). List the prime factors of -42(6/(-9))/q. 2, 7 What are the prime factors of (-53 + -6 + 6)/((-2)/4)? 2, 53 Let o(z) = -z2 + z. Let l(u) = -6u*2 + u + 10. Let d(i) = -l(i) - 6o(i). What are the prime factors of d(-3)? 7, 17 Let s be (-45 + 0)(-144)/27. Suppose -7v + s = -3v. What are the prime factors of v? 2, 3, 5 Suppose 0 = -6k + 2k + 8. List the prime factors of (41/k)/(6/24). 2, 41 Suppose 4c = -m + 12, -3c = 2m + 2c - 18. Let u(d) = 8d - 4 + 10d - 6d. List the prime factors of u(m). 2, 11 Let c = 172 + -98. What are the prime factors of c? 2, 37 Let s = 1729 + -1187. What are the prime factors of s? 2, 271 Let f be 3 + 15/(-3) - -3. Suppose 4v = -2h + f + 3, 3v + 3 = -3h. What are the prime factors of v? 3 Suppose -5r + 5 = -4r, -3g + 5r = 1. Let k(v) = v*2 + 9v + 4. Let z be k(-4). List the prime factors of (-372)/z - 2/g. 23 What are the prime factors of (-3)/(33/(-44)) - (-1 - 1352)? 23, 59 Let s = 399 - 294. What are the prime factors of s? 3, 5, 7 Suppose 3c + 10c - 3705 = 0. Let b = -82 + c. What are the prime factors of b? 7, 29 List the prime factors of (-60)/(-80)8196/9. 683 Let y be 165/3 + (2 - 1). Suppose -5g + 176 = 4f - 82, -g + y = 3f. Let p = g - 19. What are the prime factors of p? 31 Suppose -12 - 48 = -5s. Suppose s = 2m - 0m. Suppose -126 = 3w - mw. List the prime factors of w. 2, 3, 7 Suppose 4u + 4 = 32. Suppose 4 = s - u. What are the prime factors of s? 11 List the prime factors of 1272 + 2 - (3 + -3)/3. 2, 7, 13 Suppose 2v - 10 = -3v. Suppose vu - 4 = 0, q = -q + 4u - 12. What are the prime factors of (-65)/(-10) - q/(-4)? 2, 3 Let x = 28 + -26. Let o = x + 37. What are the prime factors of o? 3, 13 Suppose 301 = 2s + 77. Suppose 2m + m - 2u = s, 5m - 5u = 185. Let a = m + -22. List the prime factors of a. 2 Let r(u) be the first derivative of 61u5/120 - u4/24 - u*3/3 + 11. Let v(n) be the third derivative of r(n). What are the prime factors of v(1)? 2, 3, 5 Let i = -227 - -953. Let z = i + -490. Suppose 6w - z = 22. What are the prime factors of w? 43 Let a(m) = m*3 - 19m2 + m + 30. Let t(o) = o3 - 20o2 + 2o + 30. Let c(z) = -5a(z) + 6t(z). What are the prime factors of c(25)? 5, 41 Let g be 13189/77 - 4/14. Suppose 19 + g = 5f. What are the prime factors of f? 2, 19 Suppose 15 + 25 = t. Suppose -2l - 44 = l - 5c, -2l - t = 2c. Let b(g) = g3 + 18g*2 + 3. What are the prime factors of b(l)? 3 Suppose 2 = 2c + 4x, c + x + 17 = -3c. Let j(a) = -a*2 - 6a + 3. Let s be j(c). List the prime factors of (s/(-12))/((-3)/45). 2, 5 Suppose 3745c + 3390 = 3750c. List the prime factors of c. 2, 3, 113 Let m(x) be the first derivative of 2x3/3 - 11x*2 - 2x - 4. List the prime factors of m(13). 2, 5 What are the prime factors of (-17)/(-102)138/3138? 2, 23 Let i(l) be the second derivative of 1/20l5 + 3l*2 - 7l + 13/6l3 - 11/12l*4 + 0. What are the prime factors of i(10)? 2, 3 Let v(z) = 9z*2 + 7z. Let t be v(4). Suppose -4f = -8f + t. What are the prime factors of f? 43 Suppose 0 = -3v + 204 + 3699. List the prime factors of v. 1301 Suppose -7v + 4 = -6v. Suppose -d + 546 = vi, -3i - 5d - 126 = -4i. What are the prime factors of i? 2, 17 Let c be (0 + 8/(-12))-36. List the prime factors of 4/c826 + 6/(-9). 137 Suppose 2p - 5a = 252, p = -7a + 9a + 127. What are the prime factors of p? 131 Let x = 2752 + 65. List the prime factors of x. 3, 313 What are the prime factors of -10 + 5/((-10)/(-582))? 281 Suppose v = 3v - 3r - 318, -3v + 2r = -472. Suppose -4z - z = -f + v, 4 = 4z. List the prime factors of f. 7, 23 Suppose 5b = 4q - 8080, 0 = -18b + 20b. List the prime factors of q. 2, 5, 101 Let h(k) = k - 45. Let z be h(7). Let d = 22 - z. List the prime factors of d. 2, 3, 5 Let n(g) = 2 - 15g - 4g3 + 37g + 3g2 - 23g. Let x be n(-2). List the prime factors of x/80(-85)/(-1). 3, 17 Let x = 1251 + -503. What are the prime factors of x? 2, 11, 17 Let c(k) = k2 - 5k + 5. Let g be c(5). Suppose -gp - 112 + 7 = 0. Let f = p - -26. List the prime factors of f. 5 Suppose 0 = 3g - 4g + 4s + 1798, 3g - 4s - 5386 = 0. List the prime factors of g. 2, 3, 13, 23 Suppose 0 = -19c + 6c + 27313. List the prime factors of c. 11, 191 Let k(q) = -230q + 21. Let t be k(2). Let c = -151 - t. List the prime factors of c. 2, 3 Let k be (-8)/60 + (-2468)/(-60). Let l be (-4)/(-10) + 82/(-5). Let f = l + k. List the prime factors of f. 5 Let f(j) be the second derivative of -j3/6 + 9j*2 + 4j. Let k be f(6). Suppose -i - k = -16. List the prime factors of i. 2 Suppose -a = 4a + 4k + 124, -47 = 2a - k. Let p = a - -23. List the prime factors of -1(3 + p) + 37. 5, 7 Let i(p) = -5p3 - 1. Suppose 5q - 5n - 30 - 15 = 0, -4q - 5n = -18. Suppose 0 = -5f + 3y - 2, qf = 4f - 4y - 7. List the prime factors of i(f). 2 Let g(f) = 3f2 + 18f - 21f2 + 6f2 - f3 - 15. List the prime factors of g(-14). 5 Let r(c) = -c*3 - 41c*2 - 28c - 121. List the prime factors of r(-41). 13, 79 Suppose 0 = -35g + 30g + 10, -g + 3690 = 2w. What are the prime factors of w? 2, 461 Let z(p) = 330p - 316. List the prime factors of z(7). 2, 997 Let s(z) = -3z3 + 25z*2 + 17z + 41. Let x(u) = -2u3 + 13u*2 + 9u + 21. Let c(i) = 3s(i) - 5x(i). List the prime factors of c(-9). 3, 5 Let u(q) = 6q - 16. Let c be u(4). Let r(t) = -t3 + 9t*2 - 4t + 7. List the prime factors of r(c). 3, 13 Let r = 43 - -86. List the prime factors of r. 3, 43 What are the prime factors of 1 + 7/(-8) - 517371/(-1896)? 3, 7, 13 Let n(l) = l*3 + 8l*2 + 3l - 3. Suppose -9v = -7v - 114. Let t be (-3)/(-9) + v/(-9). List the prime factors of n(t). 3, 17 Let n(u) = -2u3 + 17u*2 + 12u - 21. Let x be n(9). Suppose -3o = x, o = -6i + 3i + 451. List the prime factors of i. 151 Suppose -2l = -2y + 866, 2y - 5l = -0y + 881. List the prime factors of y. 2, 107 Let n = 3 - 1. Let c(i) = -i + n - 3i2 - 8 - 2i + 0i3 - i3. List the prime factors of c(-3). 3 Suppose 9263 = 26t - 9535. What are the prime factors of t? 3, 241 Sup	{ "pile_set_name": "DM Mathematics" }
hat is 4 divided by -444? -1/111 What is 5 divided by 4790? 1/958 Divide -1358 by -2. 679 -321 divided by -1 321 Divide 2716 by -2716. -1 What is -1770 divided by -295? 6 What is 21376 divided by 16? 1336 26844 divided by -4 -6711 Divide 511 by -7. -73 What is 44 divided by -4? -11 Calculate 0 divided by -3590. 0 Divide 132 by 6. 22 Calculate -4066 divided by 1. -4066 Divide 86 by 86. 1 -600 divided by -5 120 27105 divided by 5 5421 Calculate -796 divided by 199. -4 -3352 divided by 1 -3352 Calculate 2019 divided by -3. -673 Divide -113 by -1. 113 11835 divided by -3945 -3 Calculate -3204 divided by -12. 267 -44 divided by 22 -2 Calculate 1 divided by -3111. -1/3111 What is 6 divided by 34? 3/17 704 divided by 8 88 What is 2815 divided by 4? 2815/4 What is -846 divided by -282? 3 Calculate 320 divided by -5. -64 What is -720 divided by 3? -240 Divide 20 by -4. -5 Divide -1848 by 3. -616 Divide 71 by 19. 71/19 What is -12880 divided by 184? -70 Divide 14088 by -3. -4696 -380 divided by 76 -5 5564 divided by 52 107 Divide 58854 by 6. 9809 -11484 divided by 261 -44 Calculate 11570 divided by -5. -2314 What is 109 divided by 1? 109 What is 480 divided by 30? 16 2784 divided by -696 -4 What is 2 divided by -856? -1/428 -3 divided by 193 -3/193 5 divided by 2659 5/2659 Divide -749 by -7. 107 What is 33 divided by -296? -33/296 What is -566 divided by 1? -566 Divide -3010 by -2. 1505 What is -2274 divided by 3? -758 Calculate 320 divided by -64. -5 Calculate -390 divided by -3. 130 Divide -1034 by 2. -517 2 divided by -33 -2/33 What is -7 divided by 35? -1/5 9 divided by 315 1/35 -482 divided by -9 482/9 Divide -166 by -83. 2 What is 3229 divided by 1? 3229 Divide 20 by -4. -5 Calculate 3 divided by -994. -3/994 Divide 2985 by 1. 2985 What is -6 divided by 179? -6/179 Calculate 778 divided by 1. 778 What is -770 divided by 6? -385/3 Calculate 0 divided by 275. 0 5 divided by -2 -5/2 Divide 1230 by -2. -615 What is 1224 divided by -204? -6 What is -52 divided by -66? 26/33 What is 8232 divided by 196? 42 Calculate 4 divided by 46. 2/23 -2806 divided by -61 46 -1020 divided by 3 -340 Divide -195 by 65. -3 -1479 divided by -3 493 Divide -16326 by 3. -5442 Calculate -3212 divided by -1606. 2 Divide -382 by -382. 1 Divide 3 by -718. -3/718 Divide 5 by 48. 5/48 Calculate -132 divided by -6. 22 -12 divided by 4 -3 -583 divided by 1 -583 Divide -1 by 1011. -1/1011 Divide -472 by -4. 118 501 divided by 167 3 -120 divided by 20 -6 Calculate -4555 divided by -911. 5 What is -3672 divided by -136? 27 Calculate -264 divided by 6. -44 Calculate 3 divided by 96. 1/32 What is 16682 divided by -2? -8341 What is -966 divided by -21? 46 Divide 3722 by -11. -3722/11 Divide 1 by 292. 1/292 What is 75 divided by 3? 25 Divide 249 by -3. -83 Divide -419 by 28. -419/28 Divide 36 by 6. 6 Divide -341 by -31. 11 What is 12 divided by -3? -4 Calculate -436 divided by 6. -218/3 Divide -3 by -93. 1/31 What is -3126 divided by -6? 521 Divide 5129 by 223. 23 Calculate -350 divided by -5. 70 What is 3971 divided by -361? -11 -6448 divided by -104 62 Divide 2274 by 758. 3 Calculate 983 divided by -3. -983/3 Divide -587 by 587. -1 Divide 6485 by 1297. 5 What is -27 divided by 3? -9 4984 divided by -28 -178 Divide 95 by 95. 1 -5 divided by -1427 5/1427 Calculate 28 divided by -14. -2 What is -50 divided by 25? -2 What is 18 divided by -3? -6 What is -220 divided by 10? -22 Divide 1 by 81. 1/81 Calculate 5 divided by -78. -5/78 Calculate -2 divided by -3. 2/3 Divide 2005 by 1. 2005 Divide -70 by -2. 35 -66 divided by 22 -3 What is -1 divided by -376? 1/376 What is 214 divided by -214? -1 What is 5976 divided by -1992? -3 -624 divided by 78 -8 Calculate -28 divided by -2. 14 -32 divided by -448 1/14 Divide -6 by 33. -2/11 Divide -499 by -5. 499/5 Divide 322 by 2. 161 Divide 18 by 9. 2 Calculate -2 divided by -486. 1/243 Divide -436 by -109. 4 What is 8 divided by -1? -8 What is 320 divided by 5? 64 Divide 7 by 264. 7/264 What is 830 divided by -830? -1 What is -307 divided by 27? -307/27 Calculate 1 divided by -17. -1/17 Calculate -72 divided by 6. -12 Divide -74 by 4. -37/2 -96 divided by -27 32/9 Divide -2 by -2088. 1/1044 What is -532 divided by 266? -2 16296 divided by 42 388 What is -312 divided by 5? -312/5 -17181 divided by 23 -747 593 divided by -4 -593/4 What is -15830 divided by -2? 7915 Divide 354 by -1. -354 Calculate -558 divided by -93. 6 Calculate 4 divided by -14. -2/7 126 divided by -6 -21 What is -3042 divided by 6? -507 Divide 123 by 2. 123/2 4510 divided by -3 -4510/3 Calculate -1 divided by 4221. -1/4221 Calculate 3 divided by -36. -1/12 Calculate 1092 divided by 273. 4 What is 13 divided by 195? 1/15 What is -12 divided by -1? 12 30 divided by -4 -15/2 288 divided by 39 96/13 What is 60 divided by 4? 15 Divide -3 by -499. 3/499 Calculate -1022 divided by 146. -7 Divide 160 by -1. -160 -18 divided by -247 18/247 3 divided by 584 3/584 What is -762 divided by -6? 127 Calculate 185 divided by -5. -37 Calculate 140 divided by -10. -14 -4975 divided by 5 -995 What is -212 divided by 3? -212/3 Divide -8855 by 1771. -5 Calculate -15 divided by 22. -15/22 69 divided by -1 -69 -84 divided by -14 6 -2815 divided by 3 -2815/3 Calculate 317 divided by 4. 317/4 Divide 473 by 1. 473 Calculate 7 divided by 123. 7/123 -178 divided by 2 -89 Calculate -1984 divided by 8. -248 -669 divided by -223 3 What is 807 divided by -269? -3 What is 5 divided by 3? 5/3 Calculate 118848 divided by 4. 29712 What is 212 divided by 8? 53/2 What is 11038 divided by -5519? -2 What is 41 divided by 41? 1 Calculate 4 divided by 4. 1 What is 3819 divided by 1273? 3 2176 divided by -32 -68 386 divided by -193 -2 What is -291 divided by 3? -97 Calculate 7 divided by 2195. 7/2195 989 divided by -5 -989/5 14394 divided by -6 -2399 What is -334 divided by 334? -1 Divide -1572 by 786. -2 -2 divided by -308 1/154 What is 1645 divided by 16? 1645/16 5320 divided by -532 -10 -67 divided by -5 67/5 Divide 24 by 2. 12 What is 786 divided by -1? -786 Calculate -76 divided by 19. -4 Calculate -1 divided by 122. -1/122 Calculate 48 divided by -24. -2 What is 496 divided by -6? -248/3 Divide 0 by -88. 0 Calculate -990 divided by 330. -3 What is 84 divided by -9? -28/3 What is 328 divided by 2? 164 Divide -82 by -6. 41/3 Calculate -311 divided by 2. -311/2 -6424 divided by -584 11 Divide -4 by 7948. -1/1987 What is 7 divided by -3? -7/3 Divide 0 by -490. 0 -357 divided by 3 -119 Divide 2080 by -32. -65 What is -927 divided by 3? -309 3 divided by 370 3/370 What is -3664 divided by 4? -916 -1201 divided by -9 1201/9 What is 2 divided by 67? 2/67 -13 divided by -144 13/144 -12516 divided by -447 28 Calculate -1878 divided by -6. 313 What is 3 divided by -130? -3/130 What is 3928 divided by 3928? 1 Divide 45 by -45. -1 Calculate -4857 divided by 1. -4857 -78 divided by -39 2 Divide -21 by -20. 21/20 -8 divided by -13 8/13 -1190 divided by 170 -7 Calculate 10 divided by -1958. -5/979 Calculate -5 divided by -80. 1/16 32973 divided by 6 10991/2 -1 divided by 37 -1/37 Divide 2162 by 1. 2162 Divide -16 by 186. -8/93 What is 8 divided by 6? 4/3 What is -1362 divided by 2? -681 344 divided by 172 2 9 divided by -3 -3 What is -69 divided by 150? -23/50 What is 9546 divided by -86? -111 Divide -833 by 833. -1 -666 divided by 222 -3 What is -15806 divided by -2? 7903 What is 125065 divided by -5? -25013 Divide -86 by 43. -2 Divide 11138 by -1. -11138 What is 405 divided by 5? 81 Divide 1 by -7. -1/7 Divide 106 by 7. 106/7 What is 34 divided by 1? 34 What is -23311 divided by -1? 23311 What is 270 divided by -4? -135/2 -225 divided by -75 3 Calculate 443 divided by 2. 443/2 Divide 16809 by -5603. -3 What is 12 divided by 11? 12/11 Divide 82 by -82. -1 What is -2 divided by -4? 1/2 3614 divided by -3 -3614/3 What is -136 divided by 34? -4 What is -126 divided by 21? -6 Calculate 27 divided by -124. -27/124 1602 divided by -6 -267 Calculate -2496 divided by -64. 39 What is 155 divided by -31? -5 What is 2 divided by -448? -1/224 Divide 20 by 30. 2/3 Calculate -14 divided by 19. -14/19 What is -150 divided by -50? 3 Calculate 246 divided by -2. -123 What is -57 divided by -16? 57/16 Divide 474 by 1. 474 Divide 266 by -38. -7 What i	{ "pile_set_name": "DM Mathematics" }
+ a*2/8 - a/8 - 15. Let l(i) = 0. What is i? 1 Let x = -19 + 21. Factor 4/9 + 2n + 8/9nx. 2(n + 2)(4n + 1)/9 Let m(h) be the second derivative of -h7/105 + h6/15 - h5/6 + h4/6 - h*2/2 + h. Let o(r) be the first derivative of m(r). Determine s so that o(s) = 0. 0, 1, 2 Suppose 0x - 3x + 39 = 0. Let w(o) = xo + 2 + 7 + 9o2 + 8o + 2. Let f(m) = 4m2 + 10m + 6. Let c(z) = 5f(z) - 2w(z). Suppose c(b) = 0. What is b? -2 Solve 2/9v2 + 4/9v - 2/3 = 0. -3, 1 Suppose 0 = 3v - f + 285, 3v - 3f - 2f + 297 = 0. Let g = -466/5 - v. Factor gr2 + 2r*3 - 4/5 - 2r. 2(r - 1)(r + 1)(5r + 2)/5 Let b be 3 + (35/30 - 4). What is m in -m + bm2 + 3/2 = 0? 3 Solve 16v*4 - 8v - 1112 + 44v3 + 20v2 + 1112 = 0. -2, -1, 0, 1/4 Let h(m) be the third derivative of -m7/2100 - m6/300 - m5/100 - m*4/60 + 5m*3/6 + 4m*2. Let j(p) be the first derivative of h(p). Factor j(r). -2(r + 1)*3/5 Let h be (-1 + (-5)/3 + 3)1. Factor 10/3o2 - 1/3o*3 - ho*5 + 4/3o - 4/3o4 - 8/3. -(o - 1)2(o + 2)3/3 Let h(x) be the third derivative of x5/330 + 6x2. Factor h(b). 2b2/11 Let r(p) be the third derivative of -p6/40 + p5/20 + p4/4 - 8p2. Solve r(w) = 0. -1, 0, 2 Let c(y) be the third derivative of y8/168 - 2y7/105 + y6/60 + 15y2. Factor c(w). 2w*3(w - 1)*2 Let s be 4/(52/15) - (-4 - -5). Factor 4/13w*3 + sw*4 + 2/13w*2 + 0w + 0. 2w2(w + 1)2/13 Let w(g) be the second derivative of -g6/4 + 39g5/40 - g4/2 - g3 + 4g. Let w(z) = 0. Calculate z. -2/5, 0, 1, 2 Let h = 35/87 + -2/29. Let t(i) be the second derivative of i + 0 + 1/6i4 - 2i*2 + hi*3. Factor t(o). 2(o - 1)(o + 2) Find p, given that -3/2p*3 + 0p*2 + 0 + 3/2p = 0. -1, 0, 1 Let f(z) be the first derivative of -7z4/6 + 2z*3/3 + 2z + 1. Let n(o) be the first derivative of f(o). Solve n(q) = 0 for q. 0, 2/7 Let m = 164/3 + -54. Let w(x) be the second derivative of 0 + mx3 - 1/2x*2 - 7/48x*4 - 3x. Factor w(p). -(p - 2)(7p - 2)/4 Let b be 43/(-42)35/(-15). Factor -2/3i + bi*3 + 0 + 0i*2. 2i(i - 1)(i + 1)/3 Let s be -1 + 1/(-3)231/(-70). Let x(y) be the second derivative of 0 + y + 1/3y*3 + 1/4y*2 + 1/4y*4 + 1/60y*6 + sy5. Factor x(n). (n + 1)4/2 Let f be (-3)/(-1 + 5 + -3). Let k(m) = m*2 + 3m + 2. Let b be k(f). Find c, given that -bc - 1 - 10c*2 + 2c*3 + 10c2 + c4 = 0. -1, 1 Let n(t) be the third derivative of -t6/960 + t4/192 + 19t2. Factor n(q). -q(q - 1)(q + 1)/8 Let a(r) be the second derivative of 0 + r + 1/8r*3 + 1/48r*4 + 0r*2. Let a(n) = 0. What is n? -3, 0 Let a(d) be the second derivative of 1/2d*3 - 6d + 0 - 1/12d4 - d2. Factor a(y). -(y - 2)(y - 1) Factor 18i2 - 2 - 29i*2 - 4 + 3i + 14i2. 3(i - 1)(i + 2) Let r(v) be the third derivative of v6/120 - v5/12 + v4/3 - 2v*3/3 - 27v2. Determine p so that r(p) = 0. 1, 2 Let z(c) = c - 2. Let j be z(-5). Let x = j + 11. Let -m3 - 4m - 3m*3 + xm*2 + 2m2 + 1 + m4 = 0. What is m? 1 Suppose 2t - 5a = -2a + 9, -t + 8 = 2a. Find c, given that 3c2 - 5c*2 - 20c*3 - 3c*5 + 12c*5 - tc*2 - 6c4 = 0. -2/3, 0, 2 Let d(f) be the second derivative of -f6/90 + f5/30 - f4/36 + 2f2 + 3f. Let w(s) be the first derivative of d(s). Let w(x) = 0. Calculate x. 0, 1/2, 1 Factor -13 + u*3 - 8 - 3u - 2u2 + 21. u(u - 3)(u + 1) Suppose -w - 4w - 3 = 2h, 4w - 12 = 0. Let t be (12/h)/(4/(-6)). Factor -3/2o4 + 0 + 0o - 1/2o5 - 1/2o*t - 3/2o3. -o2(o + 1)3/2 Let o(l) = -2l3 - l2 + 2l - 1. Let c be o(1). Let f be (12/9-5)/c. Factor -8/3j2 - 2/3 - fj. -2(j + 1)(4j + 1)/3 Let 0 - 66/5y*3 - 24/5y*4 - 72/5y*2 - 27/5y - 3/5y5 = 0. Calculate y. -3, -1, 0 Let s(o) be the first derivative of 0o*2 + 0o*3 + 0o + 1/14o4 - 4 - 2/35o*5. Factor s(l). -2l*3(l - 1)/7 Let u be 76/(-171) - 31/(-9). Let s be -1 + (u/3 - -3). Suppose 0 - 3/2d2 - d4 - 1/4d - 9/4ds = 0. Calculate d. -1, -1/4, 0 Let y(o) = 5o*4 - 80o*3 + 85o*2 - 10o. Let w(i) = -i4 + i2. Let q(a) = 30w(a) - y(a). Factor q(f). -5f(f - 1)2(7f - 2) Let t(s) = 5s - 17. Let n be t(4). Let i(j) be the third derivative of 1/6jn + 1/30j5 - j2 + 0j + 0 - 1/8j*4. What is v in i(v) = 0? 1/2, 1 Let q(g) = 28g*3 + g + 1. Let h be q(-1). Let x be (-44)/h - 1/1. Factor x - 2/7b - 6/7b2. -2(b + 1)(3b - 2)/7 Factor 0 - 1/3c3 + 2/3c*2 + 0c. -c*2(c - 2)/3 Let x(t) be the first derivative of 10/3t3 + t - 13/4t*2 - 1 - 9/8t4. Factor x(o). -(o - 1)2(9o - 2)/2 Factor -x*3 + 14x*4 - 4x*4 - 9x4. x3(x - 1) Let l be (16/(-12))/((-4)/(-6)). Let z be l/1 + 2 + 0. Let -2/5y - 2/5y2 + z = 0. Calculate y. -1, 0 Let q(j) be the third derivative of -1/21j*3 + 1/42j*4 + 3j*2 - 1/210j*5 + 0j + 0. Find f, given that q(f) = 0. 1 Let z(m) be the second derivative of 4m7/105 + m6/15 - m5/25 - m4/10 + 13m. Solve z(n) = 0. -1, 0, 3/4 Let b be ((-15)/(-5) - (-19)/(-5)) + 2. Find i, given that -6/5i - 2/5i*3 + 2/5 + bi2 = 0. 1 Let z = -125 - -131. Let o(q) be the first derivative of q3 + 9/4q4 - 3 - 9/2q*2 - zq + 3/5q5. Find t such that o(t) = 0. -2, -1, 1 Suppose -s + 22 = -5n, 0n + 3n = 4s - 20. Let z = -15/4 + 4. Factor -zh*3 - 1/2h*s - 1/4h + 0. -h(h + 1)2/4 Suppose j = 5j - 24. Suppose 0 = 5c - 4 - j. Let 1/3i*c + 0 - 1/3i = 0. What is i? 0, 1 Suppose -2w = -4w + 4. Let s(r) be the first derivative of 0r2 + w + 1/27r*6 - 2/27r*3 + 0r - 1/18r4 + 2/45r*5. Factor s(l). 2l*2(l - 1)(l + 1)2/9 Let r(d) = -2d*4 - 10d*3 - 12d*2 - 2d + 8. Let h(i) = i4 + i3 + i. Let j(v) = 6h(v) + r(v). Factor j(g). 4(g - 2)(g - 1)(g + 1)*2 Suppose -l + 4j - 6 = 0, 3l + 4j + 15 + 19 = 0. Let o be 96/10 + 6/l. Suppose 3/5v2 - 6/5v + 57/5v4 + ov*3 + 0 + 21/5v*5 = 0. Calculate v. -1, 0, 2/7 Let h(i) = 23i*3 - 17i*2 - 23i - 17. Let t(w) = -4w3 + 3w*2 + 4w + 3. Let u(k) = -6h(k) - 34t(k). Suppose u(o) = 0. Calculate o. -1, 0, 1 Let n(g) be the first derivative of -g5/20 + g4/12 + g*3/3 - g + 1. Let m(l) be the first derivative of n(l). Factor m(f). -f(f - 2)(f + 1) Let s = 557/70 - 62/7. Let w = s + 37/30. Factor 1/3d*2 - wd - 2/3. (d - 2)(d + 1)/3 Factor 0k + 4/5k2 + 0 + 2/5k*5 - 6/5k*3 + 0k*4. 2k*2(k - 1)*2(k + 2)/5 Let x(l) be the first derivative of 4/27l3 + 1/9l*2 + 2 + 0l + 1/18l4. Factor x(r). 2r(r + 1)2/9 Let n be 5 + (-16 - -10) + 5. Find w, given that 44/5w*2 - 16/5w*3 + 18/5 - 48/5w + 2/5wn = 0. 1, 3 Let p(d) be the third derivative of 1/15d*3 + 1/300d*6 + 2d*2 - 1/60d*4 + 0 - 1/150d*5 + 0d. Solve p(c) = 0 for c. -1, 1 Let p(b) = -b*2 - 5b - 2. Let o be p(-3). Let 7g2 - 4g*2 - 2 - 16g + 5g3 + 6 + og = 0. Calculate g. -2, 2/5, 1 Let h(i) be the first derivative of -4 + 0i3 - 3/2i*2 + 1/84i*4 + 1/210i*5 + 0i. Let c(w) be the second derivative of h(w). What is a in c(a) = 0? -1, 0 Let j = 2 + 12. Suppose 5a = -4 + j. Factor 4z + 2z2 + 6 - 5z*2 - 5z - az. -3(z - 1)(z + 2) Let l(v) be the third derivative of 0 + 6v*2 + 1/12v*4 - 3/10v*5 + 0v*3 + 0v + 27/80v6. What is x in l(x) = 0? 0, 2/9 Let j = -13 + 12. Let a be (j/2)/((-12)/16). Factor 4/3s*3 + 2/3s*2 + 0 + as*4 + 0s. 2s2(s + 1)2/3 Let y(r) be the second derivative of r4/18 - r*3/9 - 2r*2/3 - 7r. Let y(l) = 0. Calculate l. -1, 2 Let a(m) be the third derivative of -1/3m4 + 1/30m*5 - 5m*2 + 0m + 0 + 4/3m3. Factor a(g). 2(g - 2)*2 Let q = 1/263 + 523/789. Let 0 + 0o*2 + 2/3o - qo3 = 0. Calculate o. -1, 0, 1 Let o(a) be the second derivative of a5/80 + a4/8 + a3/3 + 51a. Factor o(i). i(i + 2)(i + 4)/4 Let x be 6/(-4) + (-9)/(-2). Suppose xd - 3 - 3 = 0. What is m in -2 + 1 + md + 0m*2 = 0? -1, 1 Factor 12/7o + 0 + 3/7o3 + 12/7o*2. 3o(o + 2)2/7 Let u(v) be the second derivative of v4/15 + 2v*3/5 - 8v*2/5 - v. Factor u(l). 4(l - 1)(l + 4)/5 Let c(d) = -2. Let w(n) = 1. Let o(i) = 2c(i) + 3w(i). Let h(k) = -12k*3 - 33k*2 - 15k + 10. Let t(l) = -h(l) - 4*o(l). Factor t	{ "pile_set_name": "DM Mathematics" }
+ 20j, 2j + 23 = ms for s. 5 Let j = -24463 + 24466. Solve -h + 0 = -3q - 8, 0 = -h - 2q + j for h. 5 Suppose 24 = -7g + 402. Suppose -8p - g = -14p. Solve 2l + 0n = 5n - 1, -3l + p = 3n for l. 2 Suppose -30s - 29s + 61 = 2s. Solve 4p - 7p - 4f - s = 0, 0 = -f + 2 for p. -3 Suppose -3a + 4w = -24, 7a = 9a - 5w - 23. Solve -5f + ax + 7 - 14 = 0, 0 = -f - 2x + 7 for f. 1 Let a(b) = -3b*3 + 15b*2 - 9b + 5. Let i be a(4). Suppose -5d + i = -33. Solve -4f - 1 + d = 5z, 2f - z - 1 = 0 for f. 1 Let y = 290 + -258. Solve 5l = 4o + 1, 7l - 11l = 5o + y for l. -3 Suppose -52 - 23 = -25a. Let f be -3 + (13 + 5)/a. Solve 3p - 9 = -5t, 7 = fp - 2 for t. 0 Let b(w) = -2w*3 + 13w*2 - 4w - 15. Let q be b(6). Let a be ((-13)/q - -2) + (-16)/48. Solve 2l + r = 5 - 2, -4l - a = -2r for l. 0 Let g be 2(1 + -4 - (-27)/6). Suppose -a - g = -3a + 5h, -33 = 3a + 5h. Let w be a/(-5)(-130)/(-39). Solve -5y = c + 25 - w, 5c - 4y = 40 for c. 4 Suppose 15t = 97 - 22. Solve -5b = -4d + 6d - 23, -tb - 5 = -5d for b. 3 Let f(y) = 136y2 + 406y - 3. Let k be f(-3). Solve 3t = 4j + 12, 12 = kt + 11j - 10j for t. 4 Suppose 4f = 5j - 2, -2j = -5f + 26 - 20. Solve -m + 11 - 7 = jo, -m - 8 = -o for o. 4 Let m be 48/8 + -2 + 5. Suppose -19s + 18s - 3 = -4b, -2b + m = -3s. Solve -13 = 5o - 4j - 0j, -2o - 4j + 6 = b for o. -1 Suppose -1213l = -1233l + 320. Solve -27d = -5b - 23d - 38, 3b = -d - l for b. -6 Let p be (21)/(396/(-394) + 1). Let f = -387 - p. Solve fr = -4v + 4r + 31, 0 = 2v - 3r + 7 for v. 4 Let u be 23 + 1 - (-6 - 244/(-8)). Solve 4 = 4l - 2b, -ul + 14l - 12 = 2b for l. -1 Let s(r) = -r*2 - 3r + 2. Let x be s(-4). Let k be 1/x + 5/10. Let z be k/3(4/(-2))/(-4). Solve -4t - 3a - 20 = z, 3t - a + 0a = -15 for t. -5 Suppose 2d + 302 = -3n, 3n + 61 = 4d - 271. Let r = -99 - n. Suppose rp - 5 = c, 4c + c + 2p = 56. Solve 0 = -4v - 3t - 11, 10v + 5t + c = 5v for v. -5 Let m = 6 - 1. Suppose 2g + 9 - 5 - 12 = 0. Solve 2z - 11 = z + gn, -mz - 5n - 20 = 0 for z. -1 Let h be 5(-56 + 57)/(2 + -1). Solve -m + 3n - 4 = 3m, -5m = -hn + 5 for m. -1 Suppose 7h - 6h + d - 4 = 0, h = -4d + 4. Suppose -2m + 71 = 5n, -m - hn = m - 66. Solve 3j = 5z - m, 3z = -2j + 7j + 17 for j. -1 Suppose 124 - 130 = -3h. Solve hy + 2 - 4 = 0, -2l + y = -9 for l. 5 Suppose 29r - 2r = 3402. Suppose 0 = 21m + 63 - r. Solve 2i + 5c + 5 = 0, 10i = 12i + mc - 1 for i. 5 Let s = 48 - 48. Let a be -1 - s - 75/(2 + -5). Suppose -3z + 2z = -3, -3z + a = 5d. Solve -4t + 4f = -4, -dt + 4f - 3 = -5 for t. 2 Suppose 29p + 14p - 250 = -7p. Solve -3h + py - 3y + 17 = 0, -2h = -3y - 13 for h. 5 Suppose -12s = -14s. Suppose s = 2b - v - 18 + 20, b = v - 2. Solve -4x - 13 = -k, 2k + 0k + 5x = b for k. 5 Let x(h) = -24h - 211. Let z be x(-9). Solve -l + 4 = zp, 2l = -2p - 0p for p. 1 Let f(m) = m3 - 11m*2 + 20m - 16. Let x be f(9). Let h(u) = 4u - 7. Let d be h(x). Solve 0 = -w + 5y + d, -w - 8 + 3 = y for w. -4 Let j be (-2)/(-15) + (-3540)/(-450). Let q(k) = 5k - 36. Let s be q(j). Solve -a + 15 = -4n + 2a, 2n + 10 = sa for n. -3 Let j = 987 - 1396. Let c = j - -413. Solve 6o - co = -4g, o = -4g - 2 for o. 2 Let c(n) = 2 + 2n - 5n - 6n - 2n. Suppose -3z + 2 - 12 = -2d, 4d = 5z + 16. Let p be c(d). Solve 3k = -4b - p, -5k = -4b - 3k - 18 for b. -4 Suppose -5t = 25, 5t - 8t = b + 17. Let g be (b + 3)/(9/45). Solve -ga - 5 = -5z, 0 = -3z + 5a - 5 + 2 for z. 4 Suppose -4n + 1324 + 332 = 0. Suppose 5j - n = -j. Suppose -3s + j = 42. Solve 5y - 4k = 7, 4y - 3k = 5y - s for y. 3 Suppose 21r = 26r - 5z - 5, 0 = -2r - 4z + 8. Solve p - 1 = 0, 0 = rv - 69p + 68p - 5 for v. 3 Let y = -1942 + 1947. Let n be (-228)/(-18) + 4/(-6). Suppose -7b + n = -3b. Solve -bx + 10 = 2x - yk, 6 = x - 2k for x. -2 Suppose 46j - 256 = -82j. Solve -5z - jb + 6 = 0, 49z - 54z - 3b + 9 = 0 for z. 0 Suppose -3b - 4b = -1099. Let l = b + -155. Solve -lw - 12 = w, 5s - 4 = -4w for s. 4 Let u(g) = 3g + 5. Let w be u(-2). Let n be w/((-9)/273/4). Suppose 0 = -4a - 3h + 19, 2a = -2a + 4h + 12. Solve -5o = np - 0o + 10, -a = -2o for p. -5 Suppose 2 = 5x - 8. Let z(o) be the first derivative of o4/4 + 2o3/3 - o2/2 - 4o + 1880. Let h be z(x). Solve 3v + r = 7, -r - h = -5v - 1 for v. 2 Let l be (6/5)/((-14)/(-105)). Suppose -3j + 15 = l. Solve -5h = 2s + 15, -3s - s - jh = 6 for s. 0 Suppose -u - 4y + 399 = 0, -y + 13 - 10 = 0. Let z = u - 387. Solve 16 = 2w + 2j - zj, 5j - 32 = -3w for w. 4 Let g be ((-56)/20-1 + -4)50/(-15). Solve gq - k = 24, 10k = -2q + 7k - 2 for q. 5 Let b(s) = -11s - 220. Let p be b(-29). Suppose a - p = -4x, -14x - 96 = -18x - 4a. Let l be 122/8 - 3/12. Solve -16 = 2o - 5c + l, -5c + x = 0 for o. -3 Let d(q) = 6q3 + 18q - 19. Let l be d(1). Solve l = 5n - 5a, 5n + 0n - 2a - 5 = 0 for n. 1 Let l = 180 - 189. Let x be l(-4 + (-22)/(-6)). Solve -5b = xm - 15, -2b + 2m = -3m + 25 for b. 0 Let g(i) be the first derivative of i4/4 + i3/3 - i2/2 - 7i - 67. Let n be g(3). Solve -4y - 20 = 0, z + n = 4y - 9y for z. -1 Suppose -44u - 78 = -5u. Let s = 7 + u. Solve -4q + q = -g + 16, -sq - 5g - 20 = 0 for q. -5 Let s be 39 + -28 + (1 - 4). Solve -s = -v + 2w + 3, -4w - 4 = 4v for v. 3 Suppose 3a - 8 = k, -4 = -2a - 3k + 4k. Suppose 3q = -5b - 11, 2q + 6 = -7b + ab. Solve 2l = -qw - 10, -5 + 18 = -4w - 3l for w. -4 Let z be 1453/5 + (-16)/(-40). Let h = 293 - z. Solve ho + 25 = -3c, 5o = -2 - 23 for c. -5 Let h be 240/(-180)(-3)/2. Solve -5z - 5g - h = -7, 0 = 2g - 6 for z. -2 Let y(s) = s2 - 9s - 627. Let a be y(30). Solve -3m + ak - 223 = -220, -4m = -2k + 10 for m. -4 Let t be (-2)/(-3) - (0 - (-12)/(-9)). Suppose -10 = tr - r. Let c be (-12)/(-10)5(-15)/r. Solve -5f = 2k + 31, -16 = 5f + c for k. -3 Let h(v) = -205v - 22. Let s be h(-1). Let t = s + -180. Solve -2i + 1 = 4o - 1, -to + i + 14 = 0 for o. 3 Suppose 20y - 45 = -21 + 16. Solve -5w = -yr - 22, 2r + 15 = -r + 3w for r. -1 Suppose 4z + u = -71, 3z - 9u + 77 = -5u. Let i be (-14)/(-2) - 0/z. Solve -p + 2g = -4p + 5, -5p = 2g - i for p. 1 Suppose 587a = 584a + 12. Suppose 4q + ao - 20 = -4, 20 = -2q + 5o. Solve 2f = 6f - 3y + 12, q = 4f + 3y - 12 for f. 0 Suppose 0 = 9u - 1517 + 1364. Solve -j + 3b = 5, 29 = -14j + uj + 2b for j. 7 Let f be 4 + 1 - (3 + -3 + 3). Solve -30i + 2 = -ft - 31i, -18 = 5t - 4i for t. -2 Suppose -90 + 222 = 12f. Suppose -82 - 17 = -fv. Solve 4x + v = -j, 2j - 1 = -3 for x. -2 Let t(j) = 10j + 161. Let w be t(2). Solve -2g - 5 = 3y, wy - 8 = g + 177y for g. -4 Let k(c) = 18c - 235. Let b be k(28). Let d = b - 262. Solve -y + r - d = 0, 2y - 1 = -3y - 4r for y. -3 Let r be (91/26 - 6)172/(-10). Let b = r - 40. Solve -3p = -4t + 3t + 16, 0 = 2t - bp - 20 for t. 4 Let x(w) = -230w + 1611. Let s be x(7). Solve -i = 5k + s, 5i + 3 = -3k - 2 for k. 0 Let o(z) = -233z - 3959. Let m be o(-17). Solve -4l = -2w + 12, -2w - 9 = 3l + mw for l. -3 Suppose 3i = -2x, -4i = -20x + 23x. Suppose x = -1012k + 1005k. Solve k = -q + 5o + 3, 5q - 4o + 11 = -5o for q. -2 Let c be 5/75 - 15/(-35). Let f be 12/(-30) - (18/15)/2. Let i be c - -3f/(-3). Solve 0d - d + 6 = ik, 4d = 2k + 2 for k. 1 Let u = -560 - -576. Solve 4x + 8 = -4i, 2x + i + 4i = -u for x. 2 Let g = -533 + 538. Solve -20 = gn - 5d, -5d + 9 = -4n - 12 for n. 1 Suppose -4v + 4t = -48, 0 = -5t - 0t + 10. Suppose vd - 6 = -w + 13d, 3w - 5d = 10. Solve 0 = -2z + 5y + 20, 5z + w = 2y + 13 for z. 0 Suppose 28n - 68 - 16 = 0. Suppose 24 - 7 = 3u - 2c, nu - 16 = c. Let h be (-11)/(-3) + 2/(-3). Solve 2k - 16 = ui, -hi + 4k + 1 = 5 for i. -4 Suppose -7f + 3f + 20 = 0. Suppose -448z = -9z - 90 - 1227. Solve 5x + o = -zo + f, -3o = 4x - 5 for x. 5 Let r = 2 + -39. Let w be (-12)/(-1) + 34 + r. Solve -wb = -5q - 5b - 10, -q - 2b = -12 for q. 2 Suppose -30 = -2n - 4n. Suppose 0 = -ns - 5v + 3v, -5s = -4v - 30. Solve -m + 0 = -2r + 3,	{ "pile_set_name": "DM Mathematics" }
r rounded to the nearest 1000000? 2000000 Let r = 38 - 37.876. Let p = -876.596 - -874. Let l = p - r. What is l rounded to one decimal place? -2.7 Let k(q) = -q*3 - 5q*2 - 7q + 2. Let m be k(-3). Suppose 0 = 3y + ms - 4259995, 5s = y - 6y + 7099995. What is y rounded to the nearest 100000? 1400000 Let x(u) = -87u - 3. Let o be x(-7). Let h = o - 259. What is h rounded to the nearest ten? 350 Let h = -144.7 + 128. Let g = h + 16.69999904. What is g rounded to 7 decimal places? -0.000001 Let v = 79 - 18. Let q = -1 - v. Let u = q + 61.9957. Round u to three decimal places. -0.004 Suppose -t - 3t + 3n = 947, -3n = 5t + 1204. Let r be 10/(-5) - (t + 0)-82. Round r to the nearest one thousand. -20000 Let n(i) = i*2 - 16i + 19. Let w be n(15). Let y(l) = 3l + 17 - 7l - wl. Let d be y(7). What is d rounded to the nearest 10? -40 Let k = -36039073 - -52839073. Round k to the nearest 100000. 16800000 Suppose -11g + 943906 + 622494 = 0. What is g rounded to the nearest 10000? 140000 Suppose 165v = 4w + 160v - 944000, -4v + 1180000 = 5w. What is w rounded to the nearest one hundred thousand? 200000 Let m(t) = t + 18. Let y be m(-5). Suppose -5s + y + 22 = 0. Suppose 148 = sf - 3f. What is f rounded to the nearest 10? 40 Let o = 364.9999994 - 365. What is o rounded to 5 decimal places? 0 Let x(f) = 4f2 + f - 2f + 37627f3 + 104 - 106. Let c be x(-2). What is c rounded to the nearest ten thousand? -300000 Let a = 1554813.549718 + -1554812. Let l = a - 1.55. What is l rounded to five dps? -0.00028 Let w = 3374 + -2153. Let x = w + -1220.999999509. Round x to 7 decimal places. 0.0000005 Let o = 10.9 + -9. Let n = o - 3.1. Round n to the nearest integer. -1 Let n(f) = 2f + 16. Let x be (-58)/7 + 4/14. Let q be n(x). Suppose q = -4m - 695203 - 22904797. Round m to the nearest 1000000. -6000000 Let o = 372689371991975.72000044 - 372689381009572. Let b = o + 9017596. Let x = 0.28 + b. What is x rounded to seven decimal places? 0.0000004 Let p = -1113147.00043 - -1113119. Let c = 27.877 - -0.123. Let d = p + c. What is d rounded to four dps? -0.0004 Let b(w) = 22964w*2 + 10w + 6. Suppose 53 = -5u - 2n, -17 = u - n + 3n. Let i be b(u). What is i rounded to the nearest one hundred thousand? 1900000 Let a = 1.025 + -1.105975. Let g = -0.081 - a. Round g to four decimal places. 0 Let d = -146 + 145.8969. Let s = -0.1 - d. Round s to three dps. 0.003 Let h = -0.109 - 0.461. What is h rounded to the nearest integer? -1 Let u = -0.064 + -1.336. Let l = -0.9750368 - 0.4249626. Let k = l - u. Round k to seven dps. 0.0000006 Let g(t) = 73t + 23. Let x be g(4). Round x to the nearest 10. 320 Let g = -1256.4708 + 1256. What is g rounded to two decimal places? -0.47 Let i = 647738.70019 - 647677.7. Let t = i - 61. What is t rounded to 5 dps? 0.00019 Let y = 233 + -35. Let m = y - 196.51. Let q = m + -1.4. Round q to 1 decimal place. 0.1 Let d = -6 - -11. Let n = 351 + -346.22. Let t = d - n. Round t to one decimal place. 0.2 Let r = 24 - 19. Let x = r + -5.034. Round x to 2 dps. -0.03 Let v be (1 + 1349)/((-18)/108000). Round v to the nearest 1000000. -8000000 Let n = -489 - -488.8293. Let y = n - -0.164. Round y to two dps. -0.01 Let d = -13999.9720112 + 14000. Let x = d - 0.028. What is x rounded to 6 dps? -0.000011 Let o(v) = v*3 + 18v*2 + 42v + 21. Let b be o(-10). What is b rounded to the nearest ten? 400 Let m(v) = -v - 11. Let p be m(-13). Let y be (-7 - (-1 + p))685-500. Round y to the nearest one hundred thousand. 2700000 Let t = 3.8 - 9. Let c = t - 1.8. Let g = 6.962 + c. Round g to 2 decimal places. -0.04 Let s(j) = -1 - j*2 + 8 - 5 + 16j. Let v be s(11). Suppose 3z = -258 + v. What is z rounded to the nearest 10? -70 Let p be (-9995340)/(-3)-1 - -1. Suppose 86u + 70222453 = 79u. Let b = p - u. What is b rounded to the nearest one million? 7000000 Let x = -8742 - -3407. Round x to the nearest 1000. -5000 Suppose -5i + 180205946 = -4j, -i + 4i + 3j - 108123573 = 0. Let n = -22041190 + i. What is n rounded to the nearest 1000000? 14000000 Let s(w) = -w*3 - 10w*2 - 11w - 17. Let f be s(-9). Let d be (120000/(-7))/(f + (-2105)/2100). Round d to the nearest one million. 7000000 Let v = -3357 - -5856. Round v to the nearest 100. 2500 Let y = 123.71648 - 123.7. What is y rounded to two dps? 0.02 Let g = -278 + 405. Let c = -102.2 + g. What is c rounded to the nearest integer? 25 Let t = 1.049975 - 1.05. Round t to six decimal places. -0.000025 Let l = -1.827 + 1.8. Let n = l + 0.002. Round n to 2 decimal places. -0.03 Let n = -0.23684 - -0.2353989. What is n rounded to 4 dps? -0.0014 Let k = 1539.2 - 3609.25. Let w = k + 2029. Let t = -42 - w. Round t to one decimal place. -1 Let q = 3415519 + -6290748. Let l = -1945229 - q. What is l rounded to the nearest one hundred thousand? 900000 Let f = -6745161249 - -6747300961.9927. Let q = 2139574 - f. Let u = q + 139. Round u to 3 dps. 0.007 Let q(t) be the first derivative of -t*3/3 - 19t*2/2 + 10t + 33. Let l(y) = -4y + 1. Let w be l(4). Let g be q(w). Round g to the nearest ten. 70 Let z = 254 + -253.58. Round z to 1 decimal place. 0.4 Let a = 61 + -59. Suppose 0 = as - 5f + 1564324 - 274309, -3s - 1934991 = 3f. Round s to the nearest one hundred thousand. -600000 Let f = -594461 - -594336.9714. Let s = f + 124. What is s rounded to three dps? -0.029 Let t(m) = -3054m + 20. Let u be t(2). What is u rounded to the nearest one hundred? -6100 Let v = 74019.01236690068 - 2426268903.01238300068. Let k = 2426194728 + v. Let x = k + 156. Round x to six dps. -0.000016 Let b = 1678.48 + -1644. Let h = b + -34. Round h to one decimal place. 0.5 Let x = 5693.7279 + -5694. Let h = x - -51.2525. Let p = h - 51. Round p to 3 dps. -0.02 Let u = -69.06 + 69.13782. What is u rounded to three dps? 0.078 Suppose -3j - 5 + 14 = 0. Suppose 0 = -js - 41557047 + 12157047. What is s rounded to the nearest one million? -10000000 Let x(a) = 28999a2 + 6a + 7. Let p be x(-1). What is p rounded to the nearest 100000? 0 Let l = -94 - -90.96. Let k = l + 4.63. What is k rounded to one decimal place? 1.6 Let j = 112 - -12. Let x = -14364654659.99999847 - -14364654784. Let n = x - j. What is n rounded to seven dps? 0.0000015 Let i = 3.15 - 149.15. Let x = 146.000073 + i. What is x rounded to 5 decimal places? 0.00007 Let o = 0.546314231 - 8794.616024231. Let x = o - -8794.8. Let h = x + -0.73. Round h to four decimal places. 0.0003 Let s = 1588466 + -1588465.91900049. Let t = -111.919 + 112. Let m = t - s. Round m to seven dps. 0.0000005 Let s = 83 - 165. Let q = s + 72. What is q rounded to the nearest ten? -10 Let t = 2712.9999999624 - 2713. What is t rounded to 7 decimal places? 0 Let j = -13.31 + 11.17. Round j to 2 decimal places. -2.14 Let k = -1773 - -3993. What is k rounded to the nearest one hundred? 2200 Let f = -805 - -804.99999493. What is f rounded to 6 decimal places? -0.000005 Let y = 26 - 3. Let g = 23.000004 - y. What is g rounded to five decimal places? 0 Let u = 576 - 575.9437. Round u to 2 decimal places. 0.06 Let m = -1.21 + 0.328. Round m to one dp. -0.9 Suppose -3r + 1396 = -4k + 3k, 4r = 4k + 1872. Round r to the nearest 100. 500 Let o = 2.2889 + 0.0811. Round o to 0 decimal places. 2 Suppose -4d + g + 56517 = -14721, -2g + 71244 = 4d. What is d rounded to the nearest one thousand? 18000 Let m = 2535.98947 + -2536. What is m rounded to four dps? -0.0105 Let z(m) = -m. Let v be z(-3). Let x be (3 - v) + 9800001 + -1. Round x to the nearest one million. 10000000 Let v be -5 + ((-40)/(-4) - -3). Suppose n + 6 = v, 0 = -2u + 3n - 17600006. Round u to the nearest 1000000. -9000000 Let c = 1114.999996473 + -1115. What is c rounded to seven decimal places? -0.0000035 Let n = -45.5 + 45.500275. Round n to 4 dps. 0.0003 Let y = -42063 + 42101.098. Let j = -37.975 - 0.025. Let i = j + y. What is i rounded to two decimal places? 0.1 Let q = 1606.98 + -1575. Let g = 32 - q. Let b = 0.08 - g. Round b to 2 decimal places. 0.06 Let v = -74997 - -85027.12. Let i = v - 10029.83000094. Let b = -0.29 + i. Round b to seven dps. -0.0000009 Let h be (-11 + 16 - 11) + 21000006. Round h to the nearest 1000000. 21000000 Let i(y) = -6y3 + 10y*2 - 5y + 12. Le	{ "pile_set_name": "DM Mathematics" }
3 Solve 0 = -11h - 105h for h. 0 Solve 3 = 32c - 35c for c. -1 Solve 0 = 4q - 17 + 29 for q. -3 Solve 8b - 78 = -6 for b. 9 Solve 0 = 2c - 4 + 8 for c. -2 Solve 14 = -109g + 102g for g. -2 Solve -421f - 14 = -428f for f. 2 Solve -1296s + 1298s = 4 for s. 2 Solve -12w + 9w = -15 for w. 5 Solve -32w - 208 = -240 for w. 1 Solve 76v = 83v + 7 for v. -1 Solve 0 = 2h + 25 - 29 for h. 2 Solve 333 - 88 = -35f for f. -7 Solve 0 = 67p - 11p - 56 for p. 1 Solve -37 = -4u - 57 for u. -5 Solve 0 = 76y - 70y - 18 for y. 3 Solve 576 - 591 = 5l for l. -3 Solve 0 = -6v + 17 + 7 for v. 4 Solve 49p = 37p - 96 for p. -8 Solve 14 = -275z + 261z for z. -1 Solve 3t + 117 - 102 = 0 for t. -5 Solve 0 = 8q - 41q + 33 for q. 1 Solve -175d - 7d - 1638 = 0 for d. -9 Solve 0 = 3j - 5j - 4 for j. -2 Solve 19g + 8 = 46 for g. 2 Solve -19k + 105 - 181 = 0 for k. -4 Solve 209s - 223s + 42 = 0 for s. 3 Solve 0 = -2959c + 2967c + 16 for c. -2 Solve 14q - 548 = -436 for q. 8 Solve 111 = 135f - 24 for f. 1 Solve 7c - 5 = 2 for c. 1 Solve 188q + 25 = 183q for q. -5 Solve 59h + 42 = 66h for h. 6 Solve -38d = -22d - 21d for d. 0 Solve -6p = -7 - 23 for p. 5 Solve -640r + 631r = 9 for r. -1 Solve 3a - 7 - 2 = 0 for a. 3 Solve 3 + 2 = n for n. 5 Solve -4o = 2o - 24 for o. 4 Solve 0 = 14c - 3c for c. 0 Solve -12x + 46 + 62 = 0 for x. 9 Solve 39y - 277 + 316 = 0 for y. -1 Solve 26 = 145y - 158y for y. -2 Solve -2u - 1820 = -1824 for u. 2 Solve 2p - 78 = -86 for p. -4 Solve 53 + 17 = -14h for h. -5 Solve -19 = -7v - 47 for v. -4 Solve 8p + 4p - 36 = 0 for p. 3 Solve -16 = 9u + 20 for u. -4 Solve -2n - 73 = -65 for n. -4 Solve 0 = 25m + 2m - 54 for m. 2 Solve 0 = 38h - 10h + 84 for h. -3 Solve -28f + 3 = -27f for f. 3 Solve -10r - 30r = 80 for r. -2 Solve -23l = -30l - 35 for l. -5 Solve 2222 = 24i + 2030 for i. 8 Solve 31a + 45 + 79 = 0 for a. -4 Solve 8r + 17 = 33 for r. 2 Solve -2v + 5v = -6 for v. -2 Solve -2f = -4f - 6 for f. -3 Solve -254v = -253v + 5 for v. -5 Solve -13o + 8o - 25 = 0 for o. -5 Solve -159x = -162x + 6 for x. 2 Solve 382i = 365i - 85 for i. -5 Solve 0 = 120z - 149z + 29 for z. 1 Solve 51j + 378 = -3j for j. -7 Solve 0 = 8t + 3t - 44 for t. 4 Solve 21a - 9 - 75 = 0 for a. 4 Solve 18g + 12 + 24 = 0 for g. -2 Solve -186 = -22a - 32 for a. 7 Solve 22h - 25 = 17h for h. 5 Solve -4s + 1 = -3 for s. 1 Solve 878t - 901t = 138 for t. -6 Solve 35h + 172 = -108 for h. -8 Solve 5 = 8l - 3 for l. 1 Solve -236 + 240 = -2q for q. -2 Solve 18 - 16 = -2m for m. -1 Solve 0 = -15h + 9 - 39 for h. -2 Solve -42p = -88 - 80 for p. 4 Solve 108 = 27b - 54 for b. 6 Solve -24 = -5a - 4 for a. 4 Solve -3t = -11t - 32 for t. -4 Solve 9a = 3 - 12 for a. -1 Solve 20l + 102 = 3l for l. -6 Solve -7 = 11u + 4 for u. -1 Solve 0 = -6r + 5r for r. 0 Solve 84 = -6o + 27o for o. 4 Solve -10r - 119r = 0 for r. 0 Solve -138 - 2 = 28d for d. -5 Solve -l - 4 = l for l. -2 Solve -20a + 28 - 128 = 0 for a. -5 Solve -2w + 0w = 3w for w. 0 Solve 28v - 25v + 9 = 0 for v. -3 Solve -5d = -31 + 6 for d. 5 Solve 5i + 0i = -10i for i. 0 Solve -55c = -61c for c. 0 Solve -120 = -32l - 8l for l. 3 Solve 6p = 8 - 2 for p. 1 Solve 928z - 901z = -54 for z. -2 Solve 202 = -3t + 199 for t. -1 Solve -26f + 0 = 52 for f. -2 Solve -326g + 273g = 159 for g. -3 Solve -10o + 420 - 320 = 0 for o. 10 Solve -173l + 175l + 4 = 0 for l. -2 Solve -15s + 123 = -27 for s. 10 Solve -38b = -61b for b. 0 Solve -892w + 49 = -885w for w. 7 Solve f - 149 = -144 for f. 5 Solve 9o + 2 - 11 = 0 for o. 1 Solve -27i - 4 = -25i for i. -2 Solve 0 = 69x - 66x - 3 for x. 1 Solve -5o + 0o + 20 = 0 for o. 4 Solve -9g = 8g for g. 0 Solve 0 = 25h - 213 - 37 for h. 10 Solve -190 = 58y + 158 for y. -6 Solve -12b + 15b = 18 for b. 6 Solve 25n - 4 = 21n for n. 1 Solve -50l = -54l + 8 for l. 2 Solve -9 = 7f - 23 for f. 2 Solve 0 = -8t + 1070 - 1142 for t. -9 Solve 0 = 11f - 45 + 1 for f. 4 Solve 1881 - 1885 = -k for k. 4 Solve 29z + 56 = -31 for z. -3 Solve -9a + 47 = 65 for a. -2 Solve 29j + 2 = 27j for j. -1 Solve 0 = 9v + 31v for v. 0 Solve -37 = 95c - 892 for c. 9 Solve -16v = 7v - 92 for v. 4 Solve -22x - 10x + 192 = 0 for x. 6 Solve 4913 = 4b + 4893 for b. 5 Solve -5r = -86 + 111 for r. -5 Solve 12 = -16q + 19q for q. 4 Solve 6u = 16u - 11u for u. 0 Solve 3 = 148f - 145f for f. 1 Solve 7t + 7 = 14t for t. 1 Solve 20 = -8b + 4b for b. -5 Solve -29q + 46 = -70 for q. 4 Solve 4 = 2l + 6 for l. -1 Solve -47n = -16 - 266 for n. 6 Solve 0 = -925c + 926c + 6 for c. -6 Solve 0 = 17a - 3a + 70 for a. -5 Solve -t - 6t = 7 for t. -1 Solve -2t - 8 = 6t for t. -1 Solve -5f - 17 - 8 = 0 for f. -5 Solve 3k = 3k - 3k for k. 0 Solve -76 = l + 18l for l. -4 Solve 0 = 9c - 6c - 9 for c. 3 Solve 17b = 3b + 56 for b. 4 Solve 48p + 7 = 55p for p. 1 Solve 24a - 22a - 10 = 0 for a. 5 Solve 24d + 65 = 11d for d. -5 Solve 17o - 41o = -120 for o. 5 Solve -21m + 36m - 90 = 0 for m. 6 Solve 0 = -25b + 192 - 142 for b. 2 Solve 637x = 643x - 30 for x. 5 Solve 0t = -6t - 18 for t. -3 Solve 0 = 8n - 3n - 15 for n. 3 Solve 3i - 15 = -12 for i. 1 Solve -20 = -8k - 84 for k. -8 Solve 286v = 301v + 60 for v. -4 Solve 11r + 28r = 8r for r. 0 Solve -27q - 90 = -9q for q. -5 Solve 0 = 2z - z - 2 for z. 2 Solve 0 = 22d - 65d for d. 0 Solve 5 = 5c + 15 for c. -2 Solve -13 = 33z - 20z for z. -1 Solve 38j = -30 + 68 for j. 1 Solve 0 = 4g + 10 + 2 for g. -3 Solve 12 = -25b + 29b for b. 3 Solve 33 = -48w - 159 for w. -4 Solve -12u = 3u - 90 for u. 6 Solve 0 = 33m - 460 + 130 for m. 10 Solve -15g - 14 = -g for g. -1 Solve 25 = 3q + 2q for q. 5 Solve -9 + 1 = 4j for j. -2 Solve 0 = -2o + 8o + 36 for o. -6 Solve -10 = -3v - 10 for v. 0 Solve 5c = 35 - 30 for c. 1 Solve 22y = 2y + 100 for y. 5 Solve 0 = 36u + 5u - 41 for u. 1 Solve -34 = -3a - 19 for a. 5 Solve -3w + 2 + 10 = 0 for w. 4 Solve 7p = -0p for p. 0 Solve 14t - 22 = 3t for t. 2 Solve c + 10c = -55 for c. -5 Solve -24l + 25l - 5 = 0 for l. 5 Solve 0 = 2i + 18 - 12 for i. -3 Solve 12o - 2o + 40 = 0 for o. -4 Solve -9t + 10 + 17 = 0 for t. 3 Solve 32u - 344 = 75u for u. -8 Solve 0 = 2l + 5l - 21 for l. 3 Solve -11z + 4z - 21 = 0 for z. -3 Solve -18r = -9r - 9 for r. 1 Solve -15d + 21 = -9 for d. 2 Solve -7 = -2i - 3 for i. 2 Solve -8p - 21p + 290 = 0 for p. 10 Solve -4l + 6 = -2 for l. 2 Solve 4i - 2 = 2i for i. 1 Solve -3 = -4n + 7n for n. -1 Solve 8r = 7r for r. 0 Solve -9 + 13 = -w for w. -4 Solve 36g - 33g - 15 = 0 for g. 5 Solve -6b + 4 = -7b for b. -4 Solve -7v - 3v = -10 for v. 1 Solve -8r - 10r = 108 for r. -6 Solve 0 = 5d - 7d for d. 0 Solve -8a + 8 = 24 for a. -2 Solve -13 = 52j - 325 for j. 6 Solve -14911j + 16 = -14903j for j. 2 Solve 0 = 51t - 46t + 25 for t. -5 Solve -62h + 72h = -10 for h. -1 Solve 4c = -32 + 16 for c. -4 Solve -131h = -98h - 198 for h. 6 Solve 3j = -14 - 1 for j. -5 Solve 4u + 4 = 3u for u. -4 Solve -18y = -36y + 18 for y. 1 Solve l + 3 = 6 for l. 3 Solve 0y = -8y - 16 for y. -2 Solve 9q - 7 = 8q for q. 7 Solve 7o - 475 = -475 for o. 0 Solve 41k - 49k - 40 = 0 for k. -5 Solve -296 + 350 = 9c for c. 6 Solve 3973r - 3974r = 10 for r. -10 Solve 215 = 14n + 313 for n. -7 Solve -4v + 17 - 29 = 0 for v. -3 Solve -4u + 5u = 2u for u. 0 Solve 0 = 11c + 5c - 16 for c. 1 Solve 297 = -119w - 774 for w. -9 Solve -64 + 73 = -3s for s. -3 Solve 46 - 100 = -9w for w. 6 Solve 13 = 8n - 19 for n. 4 Solve 51q - 48q = -24 for q. -8 Solve -41 + 6 = -7z for z. 5 Solve -3b + 56 = -17b for b. -4 Solve 53i - 56i = 3 for i. -1 Solve -142 = -4z - 158 for z. -4 Solve -30w + 5 - 65 = 0 for w. -2 Solve -13z = 6z + 209 for z. -11 Solve 203u = 217u + 28 for u. -2 Solve 9d = -9d for d. 0 Solve -6 = -o - 7 for o. -1 Solve -144z - 80 = -154z for z. 8 Solve 3 + 37 = -8y for y. -5 Solve -694w + 25 = -689w for w. 5 Solve 40o + 113 = -7 for o. -3 Solve -4o = -258 + 290 for o. -8 Solve 0 = 16r + 77 + 51 for r. -8 Solve q = -6q for q. 0 Solve -2t + 5 = 9 for t. -2 Solve 13*u	{ "pile_set_name": "DM Mathematics" }
0 What is next in 125564, 1004496, 3390184, 8036018, 15695388? 27121684 What is the next term in -141851, -141906, -141961, -142016? -142071 What is next in 122886, 122907, 122928? 122949 What is next in -459308, -459333, -459382, -459461, -459576, -459733, -459938, -460197? -460516 What is the next term in 27911, 111072, 249667, 443690, 693135, 997996, 1358267? 1773942 What is next in -2011, -1920, -1681, -1222, -471, 644, 2195? 4254 What is the next term in 135368, 270733, 406098? 541463 What is the next term in 487621, 1951862, 4392257, 7808800, 12201485, 17570306, 23915257, 31236332? 39533525 What comes next: -109, 4446, 16825, 40940, 80703, 140026? 222821 What is the next term in 295431, 590869, 886309, 1181751, 1477195, 1772641, 2068089? 2363539 What is next in 4300564, 17202238, 38705026, 68808928? 107513944 What comes next: 528136, 2112648, 4753500, 8450692, 13204224? 19014096 What comes next: -10322, -10193, -10064, -9935? -9806 What comes next: -51658, -52065, -52472? -52879 What is next in 83844, 335602, 755204, 1342650? 2097940 What comes next: -200221, -797607, -1793257, -3187177, -4979373, -7169851? -9758617 What is next in 14586, 14440, 14288, 14130, 13966, 13796, 13620? 13438 What comes next: 844, 6678, 22458, 53152, 103728? 179154 What is next in -63567153, -127134308, -190701463, -254268618? -317835773 What is the next term in -689809, -689815, -689825, -689839, -689857? -689879 What comes next: 6, 322, 1212, 2964, 5866, 10206, 16272? 24352 What is next in -2339, -1815, -1291, -767, -243, 281? 805 What is next in 4969071, 9938067, 14907063, 19876059? 24845055 What comes next: 1727912, 1728000, 1728088, 1728176, 1728264? 1728352 What is next in -2469, -3912, -6343, -9768, -14193? -19624 What comes next: 6875, 8106, 10165, 13058, 16791? 21370 What comes next: 191085478, 382170954, 573256430, 764341906, 955427382? 1146512858 What comes next: 23634, 23313, 22774, 22017, 21042? 19849 What is the next term in -2543, -5615, -8717, -11849? -15011 What is next in -1858, -5290, -10298, -16882, -25042? -34778 What is the next term in 163, -161, -513, -911, -1373, -1917, -2561? -3323 What comes next: 42134808, 84269613, 126404416, 168539217, 210674016, 252808813, 294943608? 337078401 What is next in 180451, 360864, 541277, 721690, 902103? 1082516 What is the next term in -1255020, -2510039, -3765062, -5020089, -6275120, -7530155, -8785194? -10040237 What comes next: 5514789, 11029577, 16544365, 22059153? 27573941 What comes next: 335632, 671425, 1007218? 1343011 What comes next: -11269430, -22538868, -33808306, -45077744, -56347182? -67616620 What is the next term in -14306, -14166, -13604, -12410, -10374, -7286, -2936, 2886? 10390 What comes next: -4079, -8182, -12289, -16388, -20467? -24514 What comes next: 3497832, 3497794, 3497756? 3497718 What is the next term in -36098159, -36098166, -36098179, -36098198, -36098223, -36098254? -36098291 What comes next: -739, -3514, -8153, -14656, -23023? -33254 What is next in 4734851, 9469705, 14204559, 18939413, 23674267, 28409121? 33143975 What is next in -201240489, -402480973, -603721457, -804961941, -1006202425? -1207442909 What is next in -36601, -73179, -109699, -146131, -182445, -218611? -254599 What is next in -189, -1615, -5679, -13701, -27001, -46899, -74715? -111769 What is the next term in -241235293, -241235299, -241235305, -241235311, -241235317, -241235323? -241235329 What comes next: -562465, -1124933, -1687405, -2249881? -2812361 What is next in 126417025, 126417028, 126417033, 126417040, 126417049, 126417060, 126417073? 126417088 What is the next term in -3728, -15063, -34004, -60551? -94704 What comes next: -70349, -282836, -636983, -1132790, -1770257? -2549384 What is next in -1388122, -2776331, -4164540, -5552749? -6940958 What is the next term in 30498, 30521, 30582, 30699, 30890, 31173, 31566? 32087 What is the next term in 811, 8208, 28863, 69406, 136467, 236676, 376663, 563058? 802491 What is next in -1485, -3073, -4671, -6279, -7897, -9525? -11163 What is next in 2364322, 2364483, 2364752, 2365129? 2365614 What is next in -175257, -175249, -175239, -175227, -175213? -175197 What comes next: -3087184, -12348777, -27784766, -49395151, -77179932, -111139109, -151272682? -197580651 What is next in -151341, -151713, -152327, -153177, -154257, -155561, -157083? -158817 What is next in 33444655, 66889311, 100333967? 133778623 What comes next: -1538, -6224, -14038, -24980? -39050 What is the next term in 1651, 3567, 5419, 7207, 8931? 10591 What comes next: -216118, -430577, -645036, -859495, -1073954, -1288413? -1502872 What comes next: -589280, -589269, -589258? -589247 What comes next: -224, -1824, -6154, -14576, -28452, -49144, -78014, -116424? -165736 What is the next term in 208, 1551, 5252, 12511, 24528, 42503? 67636 What comes next: 29513020, 59026045, 88539070, 118052095, 147565120? 177078145 What is next in 143751, 143809, 143965, 144267, 144763, 145501, 146529? 147895 What is the next term in 19741335, 39482661, 59223987, 78965313, 98706639? 118447965 What is the next term in -1871, -7364, -16529, -29366, -45875, -66056, -89909? -117434 What comes next: -119, -1726, -6083, -14564, -28543, -49394, -78491, -117208? -166919 What comes next: 321821, 1287323, 2896495, 5149337, 8045849, 11586031? 15769883 What is the next term in -364675, -729332, -1093989, -1458646, -1823303, -2187960? -2552617 What comes next: -767, -8581, -29759, -70979, -138919? -240257 What is next in 20546, 24657, 28772, 32891, 37014? 41141 What is the next term in -1060790, -1060807, -1060840, -1060889? -1060954 What comes next: 6970, 27289, 61148, 108553, 169510, 244025, 332104? 433753 What is next in 182967, 723387, 1624087, 2885067, 4506327? 6487867 What is the next term in 1429459, 5717826, 12865103, 22871290, 35736387, 51460394? 70043311 What is next in -4523, -36015, -121443, -287759, -561915? -970863 What is next in 5388765, 10777520, 16166275, 21555030, 26943785? 32332540 What is next in -61591, -61635, -61699, -61777, -61863, -61951, -62035, -62109? -62167 What is next in -2514707, -10058812, -22632327, -40235258, -62867611, -90529392? -123220607 What comes next: -44372343, -44372332, -44372317, -44372298, -44372275? -44372248 What is next in 1971490, 1971478, 1971466, 1971454? 1971442 What comes next: 2831, 7454, 15187, 26030, 39983? 57046 What comes next: 1317, 865, -399, -2883, -6995? -13143 What is next in 146172, 292712, 439252, 585792, 732332, 878872? 1025412 What comes next: -5620, -11206, -16774, -22330, -27880? -33430 What is the next term in -17946196, -17946197, -17946198, -17946199, -17946200? -17946201 What is next in -1111799, -2223596, -3335385, -4447166, -5558939? -6670704 What comes next: 10388, 10263, 10000, 9545, 8844, 7843, 6488? 4725 What is next in 128964609, 128964610, 128964611, 128964612, 128964613, 128964614? 128964615 What is next in 532277, 532508, 532739, 532970, 533201, 533432? 533663 What comes next: 911439, 3645765, 8202975, 14583069, 22786047, 32811909? 44660655 What comes next: -349919141, -349919152, -349919165, -349919180, -349919197, -349919216, -349919237? -349919260 What comes next: -3347877, -3347948, -3348023, -3348102, -3348185, -3348272? -3348363 What is next in -7272, -29051, -65380, -116259, -181688, -261667, -356196? -465275 What is next in 15562, 16899, 18234, 19567, 20898, 22227? 23554 What comes next: 242912, 971628, 2186158, 3886502, 6072660? 8744632 What is next in -436576, -874303, -1312030? -1749757 What comes next: 202531, 405021, 607511, 810001, 1012491? 1214981 What is next in -2, -1045, -4198, -10505, -21010, -36757? -58790 What is the next term in 4782633, 4782634, 4782635, 4782636, 4782637, 4782638? 4782639 What comes next: 10423, 20893, 31389, 41923, 52507, 63153? 73873 What is next in 4572, 9049, 13526, 18003, 22480? 26957 What is next in -13765423, -27530855, -41296287, -55061719, -68827151, -82592583? -96358015 What comes next: -58005, -57814, -57491, -57036, -56449, -55730? -54879 What comes next: -108, -1504, -5254, -12534, -24520? -42388 What comes next: 337800690, 337800689, 337800688, 337800687? 337800686 What comes next: 2291435, 2291397, 2291359, 2291321, 2291283, 2291245? 2291207 What comes next: -524102618, -5241026	{ "pile_set_name": "DM Mathematics" }
2 p and 2 b when four letters picked without replacement from ppbyyyyyppppppypyby. 3/323 What is prob of picking 1 y and 2 l when three letters picked without replacement from lye? 0 Calculate prob of picking 1 r, 1 i, and 1 v when three letters picked without replacement from {v: 1, n: 1, d: 2, i: 4, r: 1}. 1/21 Three letters picked without replacement from yfdyfwdwwdffgwfffw. Give prob of picking 1 f and 2 w. 35/408 Two letters picked without replacement from dzdzzzddzdddd. What is prob of picking 2 d? 14/39 Calculate prob of picking 1 o and 3 m when four letters picked without replacement from hpugmoummughoumuuhoo. 16/4845 Three letters picked without replacement from btyvjyaavjyj. Give prob of picking 1 v, 1 b, and 1 a. 1/55 Two letters picked without replacement from mmmvvvmmvvmmvmvmmvvm. What is prob of picking 1 v and 1 m? 99/190 Four letters picked without replacement from {q: 1, k: 3, l: 3, w: 1, x: 2, v: 1}. What is prob of picking 1 x, 1 k, and 2 l? 3/55 What is prob of picking 4 f when four letters picked without replacement from {i: 9, f: 9}? 7/170 Two letters picked without replacement from nqpxqpxpp. Give prob of picking 2 x. 1/36 Four letters picked without replacement from {o: 5, h: 11}. What is prob of picking 2 h and 2 o? 55/182 What is prob of picking 1 k and 1 p when two letters picked without replacement from {k: 3, v: 6, h: 2, f: 4, p: 1}? 1/40 What is prob of picking 1 m, 1 t, and 1 b when three letters picked without replacement from eeettmhbhtteth? 5/364 What is prob of picking 2 l and 1 y when three letters picked without replacement from {c: 1, y: 1, l: 3, f: 4, v: 1, m: 6}? 3/560 Calculate prob of picking 1 i and 2 c when three letters picked without replacement from jjccjjjjciccjcijcici. 28/285 What is prob of picking 1 d, 1 l, and 2 h when four letters picked without replacement from {h: 2, r: 1, e: 4, l: 5, t: 1, d: 2}? 2/273 What is prob of picking 2 s and 1 u when three letters picked without replacement from ssuesueu? 9/56 Calculate prob of picking 2 u, 1 r, and 1 q when four letters picked without replacement from {u: 3, q: 2, r: 5}. 1/7 Two letters picked without replacement from pqqapqpqpq. Give prob of picking 2 p. 2/15 What is prob of picking 2 t and 1 y when three letters picked without replacement from {o: 2, t: 3, y: 3}? 9/56 Calculate prob of picking 3 e when three letters picked without replacement from {u: 3, e: 5, q: 1}. 5/42 Three letters picked without replacement from {k: 3, v: 9}. What is prob of picking 2 k and 1 v? 27/220 Two letters picked without replacement from mdid. Give prob of picking 1 m and 1 d. 1/3 Three letters picked without replacement from {v: 12, p: 3}. Give prob of picking 2 p and 1 v. 36/455 Calculate prob of picking 1 e and 3 h when four letters picked without replacement from heweeeheeewwhehheew. 25/969 Two letters picked without replacement from {v: 1, x: 4, b: 3}. Give prob of picking 1 b and 1 v. 3/28 Calculate prob of picking 1 z, 1 v, and 2 g when four letters picked without replacement from {g: 4, z: 3, p: 1, d: 7, h: 1, v: 2}. 1/85 Four letters picked without replacement from {b: 3, i: 4, z: 1}. What is prob of picking 2 b, 1 i, and 1 z? 6/35 What is prob of picking 1 k and 1 c when two letters picked without replacement from {c: 8, e: 1, d: 2, k: 1, w: 2, q: 6}? 4/95 Calculate prob of picking 1 u, 1 i, and 1 l when three letters picked without replacement from {i: 2, u: 1, q: 1, l: 2, y: 1, j: 1}. 1/14 Three letters picked without replacement from ztttzntnznct. Give prob of picking 1 n, 1 t, and 1 z. 9/44 What is prob of picking 2 s when two letters picked without replacement from {s: 2, r: 1, m: 2, w: 8}? 1/78 Calculate prob of picking 2 d and 1 n when three letters picked without replacement from dndddnddndd. 28/55 Two letters picked without replacement from xzzjzxzjzczzbcbxxc. What is prob of picking 1 z and 1 x? 28/153 What is prob of picking 1 y and 1 q when two letters picked without replacement from {q: 1, g: 5, l: 1, y: 4, c: 1}? 2/33 Three letters picked without replacement from {n: 10, d: 9}. Give prob of picking 2 d and 1 n. 120/323 Two letters picked without replacement from ffffafhahh. Give prob of picking 2 h. 1/15 Calculate prob of picking 3 k when three letters picked without replacement from {a: 3, k: 8, b: 3, w: 3}. 7/85 Two letters picked without replacement from drrrddrrdjdddjr. Give prob of picking 1 r and 1 j. 4/35 Two letters picked without replacement from inviiiiiinimnvnnimm. What is prob of picking 1 n and 1 i? 5/19 Calculate prob of picking 4 n when four letters picked without replacement from {f: 1, w: 6, n: 8, x: 1}. 1/26 Four letters picked without replacement from jxjxjxwxqq. What is prob of picking 3 j and 1 q? 1/105 Calculate prob of picking 2 v and 2 p when four letters picked without replacement from {v: 3, p: 4, z: 2}. 1/7 Three letters picked without replacement from {n: 1, o: 4, j: 6}. Give prob of picking 2 j and 1 n. 1/11 Calculate prob of picking 3 c when three letters picked without replacement from {b: 3, x: 2, y: 3, j: 3, c: 3}. 1/364 Calculate prob of picking 1 l and 1 g when two letters picked without replacement from {g: 4, l: 3}. 4/7 Three letters picked without replacement from zzcdzzzczdz. What is prob of picking 1 z and 2 c? 7/165 Calculate prob of picking 2 j and 1 h when three letters picked without replacement from {j: 5, l: 8, u: 4, h: 1}. 5/408 Two letters picked without replacement from {a: 15, k: 5}. Give prob of picking 2 a. 21/38 What is prob of picking 2 y when two letters picked without replacement from yxxxyblbyx? 1/15 Three letters picked without replacement from {g: 15, u: 5}. Give prob of picking 3 u. 1/114 Two letters picked without replacement from {a: 5, c: 9, j: 2}. What is prob of picking 2 j? 1/120 What is prob of picking 1 m, 1 r, and 1 e when three letters picked without replacement from {m: 2, r: 1, e: 1}? 1/2 Calculate prob of picking 1 m, 1 f, and 2 c when four letters picked without replacement from {k: 3, m: 9, c: 5, f: 1}. 1/34 Calculate prob of picking 1 t, 1 m, and 2 n when four letters picked without replacement from lintnllmnt. 1/35 Three letters picked without replacement from {v: 2, q: 2, w: 1, i: 2, e: 2, f: 3}. Give prob of picking 1 f and 2 q. 3/220 What is prob of picking 2 i when two letters picked without replacement from aiaaiaaaaia? 3/55 Two letters picked without replacement from {o: 5, g: 3}. Give prob of picking 2 o. 5/14 What is prob of picking 1 j and 1 c when two letters picked without replacement from scjscj? 4/15 What is prob of picking 2 k when two letters picked without replacement from kfkffkkk? 5/14 What is prob of picking 2 c when two letters picked without replacement from ycmyc? 1/10 What is prob of picking 1 j and 2 e when three letters picked without replacement from eqtjqqeeqqge? 3/110 Three letters picked without replacement from {g: 5, k: 4, s: 2, i: 2}. Give prob of picking 2 i and 1 s. 1/143 Calculate prob of picking 2 z when two letters picked without replacement from zzzzzzzzzwjzzzwzz. 91/136 Calculate prob of picking 3 o and 1 r when four letters picked without replacement from nrnrncnoc. 0 What is prob of picking 1 c, 1 j, and 1 a when three letters picked without replacement from {c: 5, a: 4, j: 3}? 3/11 What is prob of picking 1 b and 1 x when two letters picked without replacement from {x: 2, l: 1, u: 4, b: 4}? 8/55 What is prob of picking 2 p and 2 q when four letters picked without replacement from ppyq? 0 Two letters picked without replacement from sgguz. What is prob of picking 1 z and 1 g? 1/5 Two letters picked without replacement from {t: 1, i: 2, o: 1, n: 2, d: 2, j: 1}. Give prob of picking 1 d and 1 n. 1/9 Four letters picked without replacement from {h: 2, t: 2, m: 1, e: 7}. What is prob of picking 3 t and 1 m? 0 Two letters picked without replacement from lhjl. What is prob of picking 1 l and 1 h? 1/3 Two letters picked without replacement from {a: 7, e: 3, t: 1, m: 3, w: 1, j: 2}. What is prob of picking 1 e and 1 t? 3/136 Calculate prob of picking 2 j when two letters picked without replacement from {j: 4, e: 15}. 2/57 Four letters picked without replacement from szsszmspmzsppmsmsmk. What is prob of picking 3 s and 1 k? 35/38	{ "pile_set_name": "DM Mathematics" }
19 Suppose 4w = 4049 - 561. Calculate the greatest common divisor of w and 6758. 218 Suppose 5s - 212 = 58. Suppose 18t - s = 9t. What is the highest common divisor of t and 14? 2 Let w = -344 - -340. Let y be (-17)/(-4)(8 - (w - -8)). What is the highest common factor of 459 and y? 17 Let v(g) = -56g + 1386. Let z be v(9). What is the greatest common factor of z and 49? 49 Let g(u) = -16u3 - 9u*2 - 9u - 16. Let w be g(-4). Suppose -1212o + 1208o + w = 0. Calculate the highest common factor of 9 and o. 9 Let q = 770 - 770. Suppose 4k + 5o - 2114 = 0, k - 2o - 19 - 516 = q. Calculate the greatest common factor of k and 59. 59 Let w = -15351 - -15362. What is the greatest common divisor of w and 46? 1 Let w(g) = -823g - 5742. Let u be w(-7). What is the highest common factor of 23294 and u? 19 Let v be (-8)/10 - 41356/(-245). Suppose -vb + 33 = -157b. What is the highest common factor of b and 237? 3 Let q be (-185)/((-6 - 124/(-24))3). Calculate the greatest common divisor of 2516 and q. 74 Suppose 2520 = 187a - 167a. Calculate the highest common factor of 2688 and a. 42 Let v = -76 + 39. Let z = v - -57. Suppose 49 = 8b + 17. What is the highest common factor of z and b? 4 Suppose m - 54 = -p, -p - 836m + 834m = -53. What is the highest common factor of p and 1485? 55 Let k be ((-11724)/(-84) - 3/(-7))5. Suppose -q + 2q = k. Calculate the greatest common divisor of q and 20. 20 Suppose -55 = -5d + 5q, -2d + 4 = 2q + 2. Suppose -dw = -15w + 198. What is the greatest common divisor of w and 66? 22 Let r(x) = 7x3 - 1474x*2 - 620x - 407. Let m be r(211). Calculate the highest common factor of m and 160. 32 Suppose -5k - 19 = 4x, -3x + 8x = 5k - 35. Let c(j) = -12j - 42. Let b be c(x). What is the greatest common divisor of b and 390? 30 Suppose 10 = -7m + 9m. Suppose -mf + 53 = -42. Suppose 3j = 2u + 238, j - 2u - 111 = -25. Calculate the greatest common divisor of j and f. 19 Suppose 79z - 32 = 71z. Let o(b) = 4b2 + 3b + 4. Let x be o(z). What is the highest common divisor of x and 100? 20 Let s = -24 + 158. Suppose 0 = -4q - 9t + 12t + 188, s = 3q - 4t. Calculate the greatest common factor of 2 and q. 2 Suppose -2u = 4q - 3836, 53q - 57q - 12 = 0. Calculate the highest common divisor of u and 444. 148 Let a(g) = -g2 + g + 24. Let m be a(4). Suppose t - 5f - 51 = 0, -3t + 2f = -0t - 114. What is the greatest common divisor of t and m? 12 Suppose -3r - 9 = 2f + 2r, 0 = f + 3r + 6. Let g be 61 - (-9 + f + 7). What is the greatest common factor of 108 and g? 12 Let a = -63 + 98. Let d(m) = -m3 - 16m*2 + 12m - 22. Let r be d(-17). Calculate the highest common factor of r and a. 7 Suppose m + 254 = 4q + 3m, 5m = -3q + 173. Suppose 9a + q = -2a. Let g = 18 - a. Calculate the highest common factor of 84 and g. 12 Let n(a) = -4a2 - a - 2. Let z be n(3). Let r = 40 + z. Let y be 15(3 + (-3 - r)). Calculate the greatest common divisor of 5 and y. 5 Suppose 8 = g - 2v, 3g - 4v + 2v = 28. Suppose 340f - 338f - 209 = 131. What is the greatest common factor of g and f? 10 Let c = -248 + 290. Suppose -87k + 93k = c. Calculate the highest common divisor of k and 133. 7 Suppose 5p + 538 = 4u - 213, 0 = -u + 4. Let d be (2/(-2) - 102)/1. Let r = d - p. Calculate the greatest common factor of r and 66. 22 Let v = 20 + -10. Let h(w) = w*3 - 55w*2 + 773w - 346. Let k be h(28). What is the greatest common divisor of v and k? 10 Suppose -4t + 2r + 24182 = 0, r - 6028 = -t + 5r. What is the highest common factor of 4 and t? 4 Let a be 2 + (-11)/(-44)12. Suppose -12 = -2q + 4. Suppose 2r = -6 + q. Calculate the highest common factor of a and r. 1 Let i(g) = -4g2 - 52g + 12. Let n be i(-13). Calculate the highest common divisor of 868 and n. 4 Suppose 5y - 146n + 151n = 1040, -4y + n + 842 = 0. What is the highest common factor of 810 and y? 30 Suppose 2f - 31 - 17 = 0. Let b(g) = -2g*2 + 31g. Let l = 297 + -285. Let x be b(l). Calculate the highest common divisor of f and x. 12 Let g be (-2 + 0/(-1))/((-2)/(-3)). Let o be (4(-3)/(-18))/(g/(-9)). Suppose -ol = l - 147. What is the highest common factor of 7 and l? 7 Suppose 1145 = q - 5p, 8p + 2 = 9p. Let m = q + -798. Calculate the greatest common divisor of 102 and m. 51 Suppose -3c - 8 + 6 = 4g, -2g - 4 = 0. Suppose -6s = -cs - 12. Calculate the greatest common divisor of s and 25. 1 Let s(g) = 3g2 - 11g - 26. Let a be s(-5). Suppose 45d - 4535 = -1025. Calculate the greatest common divisor of d and a. 26 Let u be 162((-35)/(-26) - 56/(-364)). What is the highest common factor of u and 54? 27 Let t be (-16)/56 - 37/(-7). Suppose 4j - 2k - 8 = 4, -tk = -j + 12. Let a be (-4)/j + ((-3)/1 - -18). Calculate the highest common divisor of 117 and a. 13 Let a = 330 + -285. Suppose o = 86 - a. Calculate the highest common divisor of o and 41. 41 Suppose 0 = 5a - 101 - 49. Let w(t) = 2t2 - 6t + 10. Suppose 2u - 3 - 3 = 0. Let b be w(u). Calculate the greatest common divisor of b and a. 10 Let o be 27/6 + 10/(-20). Suppose -oj - 36 = -0f - f, 4f + 5j = 207. What is the greatest common divisor of f and 32? 16 Suppose 0 = -4b - 2p - 6, 2b - 3p = -p - 12. Let h(a) = -a + 1. Let s be h(b). Let i be s/126 + 58. Calculate the greatest common divisor of i and 12. 12 Suppose 604862 - 9682 = 38l - 406310. Calculate the highest common divisor of 105 and l. 105 Let z(b) = 42b*2 - 13 + 6 - 8b*2 - 3b + 13b2. Let o be z(-2). What is the highest common factor of o and 17? 17 Let i(k) = 2k*3 - 110k*2 + 5k - 243. Let h be i(55). What is the highest common factor of h and 208? 16 Let a be 113 - (-2 + 1) - -1. Suppose 0 = r - 4b + 1328, 216r + 5312 = 212r + 5b. Let t = -1305 - r. What is the greatest common divisor of t and a? 23 Let s(k) = -2k3 - 3k*2 + 2k + 8. Let x be s(-4). Suppose -23a + 18a + x = 0. What is the highest common factor of a and 1? 1 Let m be (3 - -4) + 7 + 15/5. Let o = 402 - -193. Suppose -2n - 3n = -o. What is the greatest common divisor of n and m? 17 Let p be 0 + 4/(-18) - ((-476)/36 + 12). What is the greatest common factor of p and 911? 1 Let m(n) = 23n - 232. Let t be m(10). Let h be ((-55)/5)/(t/14). What is the highest common divisor of 924 and h? 77 Suppose -3c + 5 = k, -c + 2k - k - 5 = 0. Suppose -2y - y + 132 = c. Let b = 84 - y. Calculate the highest common divisor of 16 and b. 8 Let r = 8830 + -2008. Calculate the highest common factor of 36 and r. 18 Suppose -5n = -2i + 1461, -i + n = -795 + 69. Suppose 13y - 3125 = i. What is the greatest common factor of 37 and y? 37 Let w be 25267/5 - 882/630. Calculate the greatest common factor of 6 and w. 6 Let x = -54 - -145. Suppose -5g + k + 99 = -3k, -5g - 4k + x = 0. Calculate the greatest common divisor of g and 133. 19 Let j(c) = -c3 - 12c*2 - 15c - 137. Let i be j(-12). What is the highest common factor of 86516 and i? 43 Suppose 47f + 411 = 1257. Calculate the greatest common divisor of f and 2799. 9 Suppose 4i - m - 5850 = 0, -26m + 24m + 2930 = 2i. Calculate the greatest common factor of i and 532. 133 Let y(i) = i2 + 25i - 260. Let t be y(-33). Calculate the highest common divisor of t and 2188. 4 Let b be ((-756)/(-630))/(0 + 6/35020). Calculate the greatest common divisor of b and 68. 68 Suppose 25 = -0x + x. Suppose z + 2f + 15 = 2z, z = 4f + x. Let v be (-4)/(-148) + (-23822)/(-1591). What is the greatest common divisor of z and v? 5 Let l = -10261 - -11054. Calculate the highest common divisor of l and 208. 13 Let t(m) = 4m3 + 17m*2 - 143m - 28. Let b be t(11). Calculate the highest common divisor of b and 20. 20 Let u be 12027/133 - (-24)/(-56). Let i = 44 + 91. What is the highest common divisor of i and u? 45 Let a(o) = 7o - 203. Let k be a(26). Let l be (-34760)/(-168) + (-2)/k. Calculate the greatest common factor of 92 and l. 23 Let l be 3/(-12) + 22/(-8). Let u(x) = -x3 - x2 + 5x + 3. Let b be u(l). Suppose 12y - 10y = 12. Calculate the greatest common factor of y and b. 6 Let h = -455 + 296. Let z = -133 - h. What is the highest common factor of 143 and z? 13 Let n(q) = 3*q - 26. Let k be ((-38)/10)/(2/(-20)). Let f be	{ "pile_set_name": "DM Mathematics" }
(-2)/154) -28 What is (-64)/80(-100)/(-40)? -2 What is (-16)/(-414)54/(-72)? -2/69 What is the value of ((308/(-33))/(-28))/(22/18)? 3/11 What is 1326/682/12-4? -13 (-6(-28)/(-504))/(1/(-11)) 11/3 What is the value of (-19)/(456/84)40/28? -5 Evaluate (84/(-36))/((-20)/303/6). 7 What is (((-1)/5)/((-2)/5))/(870/(-2175))? -5/4 Calculate 236/2124(297/3)/1. 11 Evaluate (((-900)/105)/15)/4. -1/7 Calculate 7(11825/(-77))/43. -25 Calculate (((-10)/6)/(165/22))/(6/(-756)). 28 Calculate 12(-272)/32. -17 Calculate ((-11)/((-55)/90))/(3/(27/(-18))). -9 What is the value of ((21)/((-24)/18))/((-324)/(-3024))? -14 Calculate (-20)/6(3402/105)/(-9). 12 84/(-96)-4(-48)/14 -12 What is 12/3822/64? 11 Evaluate ((-2211)/(-2680)-10)/(2/(-8)). 33 What is the value of -15(648/(-600))/(-9)? -9/5 What is 120/(-18)6/156? -16 What is 5((64/50)/(-16))/((-14)/30)? 6/7 Calculate 1234/18511/(122). 1/33 What is the value of (((-11)/(-55))/(3/5))/(11036/(-534))? -1/62 Evaluate 443/443(-17)/(4/4). -17 What is ((-1542)/1028)/((-1)/((-1)/(-3))-1)? -1/2 (1305/50)/(-29)10 -9 Calculate ((-120)/(-18))/((-600)/75). -5/6 What is the value of (4/(32/36))/(2-3)? -3/4 What is (5/(-8)-8)/(((-2)/(-2))/(-1))? -5 27/(-3)75/(-630)-14 -15 (3/((-9)/(-3)))/(((-340)/(-17))/300) 15 What is 12/(-72)61? -1 What is the value of (((-1476)/48)/41)/(402/(-16))? 2/67 Evaluate ((-10)/(-95))/((39/(-351))/(3/(-54))). 1/19 Calculate 20/(-16)(-11968)/(-880). -17 What is the value of (((-18)/(-15))/(-1))/((-470)/(-7050))? -18 Calculate (-440)/16132/90(-38)/(-209). -22/3 What is the value of (-1(-7)/(-7))/((-50)/1050)? 21 What is the value of (9/(540/200))/(5/18)? 12 What is (18/48)/((-7812)/29760)? -10/7 Calculate (26/(-12))/(3/(-57)). 19 Evaluate -1(2/2)/(-45)(-144)/(-24). 2/15 Evaluate 10/(-54)(-140)/(-2100)(-12)/2. 2/27 Evaluate ((-4)/(24/9))/(255/(-3230)). 19 Calculate (-640)/(-20)(-5)/(-30)-3. -16 Evaluate ((-72)/6)/(((-110)/(-10))/(-11)). 12 Evaluate 2224/1668(-1)/4. -1/3 Calculate (96/(-16))/((-2)/((-6)/39)). -6/13 Evaluate (-2)/78/40-5. 2/7 What is ((-2)/(-5))/(5/(-50))86/43? -8 Calculate (-30)/50-13-5-1. 9 Evaluate -86/(-912)8/(-16)2. -1/19 Calculate ((-8)/1)/((-13)/13). 8 Calculate 6(-12)/(-16)1080/324. 15 30/(-155)4340/(-210) 4 Calculate 144/128((-36)/6)/((-27)/6). 3/2 What is the value of 3415/(-19124)(-14)/(-20)? -1/8 Calculate ((88/11)/(-4))/((-4)/6). 3 What is the value of (8500/175)/34(-21)/(-15)? 2 Evaluate (((-1218)/(-9))/(-58))/((32/(-6))/2). 7/8 Calculate 28/(-8)2(-3375)/1575. 15 (22/198020)/(1(-3)/9) -2/3 Calculate 2/(63/(25641/74)). 11 Evaluate 50/(-825)-11(-6)/(-5). 4/5 (11/((-286)/38))/(8/(-52))-1 -19/2 52/2(8/(-1))/16 -13 Evaluate -5(2/44)/(-10(-11)/(-44)). 1/11 ((-10)/25)/(1012/220) -2/23 What is the value of (11(-23)/2277)/(1/(-3))75? 25 What is -30(-3)/1812/(-4)? -15 Calculate (3/(48/(-2)))/((-1)/(-8)-8). 1/8 What is the value of (-13)/572(-204)/34? 3/22 What is ((-111)/(-185))/(81/(-45))? -1/3 Evaluate -65/10-1-3. -9 800/(-1440)12/(-40)4 2/3 What is ((-2)/(-2))/((-15)/(-40)8/(-18))? -6 What is the value of (-16)/1680-1021? 2 Calculate -1(-10)/(-4)(-19)/(-133)-14. 5 Calculate (3/2)/(2964/(-608))26/(-268). 2/67 Calculate (220/990)/((16/3)/4). 1/6 What is the value of (20/(-12))/(2/((-17)/((-425)/(-20))))? 2/3 What is the value of (12/16)/((-9)/6)0/2? 0 Calculate (558/(-4185))/((-1)/(-12)). -8/5 What is the value of (((-6)/(-6))/2)/(10/60)? 3 Evaluate ((-100)/120)/((-2)/(104/(-195))). -2/9 What is (-50)/(-5(-3)/120-10)? 40 ((-10)/6)/(355/2556) -12 Calculate 20/160(-12)/4. -3/8 Evaluate 1656/(-14168)22/(-2). 9/7 Evaluate (8250/1485)/(5/3). 10/3 Evaluate (-14)/(-1)8/56. 2 Calculate (204/(-14))/((-25)/((-175)/3)). -34 Calculate (-29)/(-58)(-26)/(-9)-1-3. 13/3 What is the value of ((-344)/4300)/(1/5)14/4? -7/5 What is the value of (12/(-10))/(118/1475)? -15 Evaluate (135/(-180))/((-3)/(-24)). -6 Evaluate 73/12412/3. 2/51 What is the value of (-176)/(-198)(1/2)/(-1)? -4/9 ((-2730)/196)/(-39)-14 -5 What is 5(1512/60)/(-14)? -9 ((-4)/303)/(((-210)/(-10))/315) -6 ((-60)/(-108))/((-200)/240) -2/3 What is ((-4)/1)/(((-256)/24)/8)? 3 What is the value of ((9/75)/(10/(-100)))/(3/(-10))? 4 Calculate 4/(-10)365/1679. -2/23 What is 1/34-1210/1806? -2/17 Calculate (57/90)/((-42)/84)3. -19/5 What is 90/242(-434)/155? -21 What is 2/8-6-153/15? 9/2 What is 20/15(-11)/(1430/30)? -4/13 What is the value of -363/((-38556)/(-72))? -6/17 What is the value of 1162/10209(-24)/(-56)? 2/41 Calculate (-7)/(-6)12/5253858/1286. 2/25 What is the value of 6/4(-8)/4120/3780? -2/21 (-2)/(-8)((-22)/231)/((-1)/7) 1/6 Evaluate 16/(-2)-143/(4300/125). 10 Calculate (0/(-1))/(1136/284). 0 What is the value of 3/2165/(-198)4/(-6)? 5/6 ((-3)/((-63)/(-96)))/(938/3283) -16 What is 63/(-2)286/(-198)? 13 Evaluate ((-4)/(56/105))/((-24)/(-32)). -10 Calculate 4/(-24)(-71916)/461. 26 What is the value of ((-61)/366)/((-2)/(-8))51/(-2)? 17 Calculate (9/4)/(20/(320/4)). 9 What is the value of 21/(-22)(-6)/21? 3/11 What is the value of 20((-3)/45)/(142/2556)? -24 Calculate 2/(-5)-5(-66)/(-132)-1. -1 Calculate (-10)/(-40)14/(-6)(-94)/(-329). -1/6 Evaluate (8/10)/((-3)/(-2)(-360)/(-1350)). 2 Calculate (594/792)/((-3)/16). -4 What is (-4)/(-504)-21-186? 31 What is the value of (4/(-10))/((-12)/(-6))? -1/5 Calculate 30/2(120/100)/2. 9 What is the value of 5(-28)/(-20)(-13)/(-13)? 7 Evaluate ((-18)/(-105))/(59/(-295)). -6/7 Calculate (592/518)/((-6)/(-7)). 4/3 Calculate (12/(-32))/((133/28)/19). -3/2 -1-9(-221)/153 -13 (165/66)/(1/4) 10 Calculate (686/2744)/((-1)/4). -1 Calculate 462/308(-48)/522. -4/29 11/14(-18)/(1044/(-203)) 1/4 -1-2(-399)/38 -21 Evaluate (0/(-65))/((-6)/3). 0 (-10)/18-2((-90)/(-50))/9 2/9 Calculate (162/(-42))/((-21)/(-14))28/(-16). 9/2 Calculate 9/1(-18)/(-1134)2. 2/7 What is the value of (-1020/400)/((5/2)/(-1))? 1/5 What is 15/(-6)(16/(-400))/(14/35)? 1/4 What is ((-990)/495)/(2/19)? -19 Calculate ((-22)/2)/(-132)-1. -1/12 Calculate (186/620)/(1/10). 3 What is the value of 45/(-110)1(-64)/(-48)? -6/11 What is ((-112)/40)/((-30)/(-100))90/385? -24/11 Evaluate (((-40)/5)/136)/((-8)/161). 2/17 4(-6)/2856/(-428) 24 (-342)/(-95)(-10)/(-6) 6 Evaluate ((-1)/(-4))/((-16)/((-3840)/(-135))). -4/9 Calculate ((-1)/13)/((-390)/(-9295)). -11/6 Evaluate (-2)/(-15)(-216)/(-36). 4/5 What is (-874)/6624-24-6? -19 What is ((-1)/12)/((-19)/(6422/(-156)))? -13/3 Evaluate 30/(-70)(-644)/233. 36 What is the value of ((-3)/4(-20)/(-9))/((-165)/(-18))? -2/11 What is ((-13)/(-52))/(143/(-88))? -2/13 What is (-1)/(20(-6)/48)? 2/5 Calculate -23/12325/130. -5/4 What is ((-7)/((-14)/4))/(24/(-96))? -8 Calculate ((-63)/14)/(3/12-3). 6 What is (5(-1)/3)/(((-784)/96)/49)? 10 What is (-30)/4411(-28)/(-10)? -21 Evaluate ((1/(-1))/(1173/46))/(1/(-9)). 6/17 Evaluate (10/4)/((-1795)/5026). -7 Evaluate 15/(1(-1)/1(-15)/(-15)). -15 Evaluate (-48)/(-12)(-450)/120. -15 What is (-2940)/(-3150)(-6)/(-70)? 2/25 What is the value of (-12250)/1000(-2)/7? 7/2 What is 754/(-116)(32/24)/(4/(-6))? 13 Calculate (7/18)/(1(-476)/204). -1/6 Evaluate (-1820)/(-1040)(-60)/(-7). 15 Calculate (4/(-14))/((-196)/686)(-6)/2. -3 Evaluate (2/18)/((378/(-18))/105). -5/9 81/(-126)4/(-36)6 3/7 Calculate 3/(9/(-2))(-2670)/(-89). -20 2/(7/(14/36))56/56 1/9 (-3)/3-1124/(444/37) 22 Evaluate ((-1)/(-4))/(((-3)/(-240)-5)/(-7)). 28 What is the value of (54/4)/1488/(-1464)? -9/2 Evaluate -1(-6)/(-54)-45. 5 What is the value of (-10)/((-90)/(-9))5/(-1)? 5 Calculate (-21060)/(-1350)(-25)/15. -26 What is 6/(-15)2/3? -4/15 Evaluate ((-3)/40)/((5/75)/(1/(-9))). 1/8 What is the value of (6/2100-4)/((-53)/(-265))? -2/35 What is the value of ((-81)/27)/(((-11)/11)/(4-1))? -12 What is 2388/75998138/4? 2/67 ((-173)/(-519))/(142/(-72)) -6/7 What is the value of 10/16228/(-190)? -3/4 Evaluate 16/132(-1278)/284. -6/11 (59/(2242/(-304)))/(1(-2)/2) 8 What is ((-4)/(-20))/(12/(-15))(-40)/7? 10/7 What is the value of ((-36)/(-128)8)/((-1)/(4/(-6)))? 3/2 Evaluate (-54)/(18(-4)/(-36)). -27 Evaluate (64/(-40))/((-5510)/475). 4/29 What is (252/(-336))/((-2)/(-140)*-3)? 5 ((-1953)/(-31))/(18/4) 14 Wh	{ "pile_set_name": "DM Mathematics" }
f 200453377? 71, 2823287 What are the prime factors of 123107517? 3, 13, 19, 79, 701 What are the prime factors of 15118389? 3, 11, 13, 17, 691 What are the prime factors of 39536593? 39536593 List the prime factors of 58630291. 47, 1247453 List the prime factors of 309301479. 3, 34366831 What are the prime factors of 52744051? 31, 607, 2803 List the prime factors of 4721801706. 2, 3, 43, 6100519 What are the prime factors of 14228539? 13, 53, 107, 193 What are the prime factors of 61018307? 7, 67, 281, 463 What are the prime factors of 1654108345? 5, 6701, 49369 List the prime factors of 58166971. 283, 205537 List the prime factors of 149305415. 5, 7, 317, 13457 List the prime factors of 33188769. 3, 79, 46679 What are the prime factors of 363967915? 5, 113, 644191 What are the prime factors of 363417141? 3, 73, 971, 1709 List the prime factors of 409762936. 2, 11, 4656397 What are the prime factors of 356599788? 2, 3, 151, 196799 List the prime factors of 82107157. 11, 383, 19489 What are the prime factors of 211049635? 5, 4903, 8609 What are the prime factors of 106493304? 2, 3, 17, 261013 List the prime factors of 548573574. 2, 3, 2437, 37517 List the prime factors of 43188020. 2, 5, 23, 93887 List the prime factors of 1363953957. 3, 97, 113, 41479 What are the prime factors of 287227758? 2, 3, 47871293 List the prime factors of 1076158. 2, 538079 List the prime factors of 1096379105. 5, 47, 281, 16603 List the prime factors of 281433818. 2, 140716909 What are the prime factors of 3765311059? 11813, 318743 List the prime factors of 405893324. 2, 101473331 List the prime factors of 190978613. 7, 4721, 5779 List the prime factors of 1090316965. 5, 31, 226913 What are the prime factors of 765342105? 3, 5, 11, 31, 149627 List the prime factors of 21667664. 2, 1354229 What are the prime factors of 78466677? 3, 37, 706907 List the prime factors of 359963570. 2, 5, 23, 1565059 List the prime factors of 249692086. 2, 7, 17835149 List the prime factors of 2768107908. 2, 3, 397, 581047 List the prime factors of 340598183. 239, 1425097 List the prime factors of 6207775080. 2, 3, 5, 13, 17, 149, 1571 List the prime factors of 74615304. 2, 3, 457, 6803 List the prime factors of 126765595. 5, 11, 73, 31573 List the prime factors of 72417905. 5, 7, 311, 6653 What are the prime factors of 270782106? 2, 3, 7, 29, 222317 List the prime factors of 7868472. 2, 3, 327853 What are the prime factors of 2327073536? 2, 9090131 List the prime factors of 2554991. 2554991 What are the prime factors of 30471665? 5, 7, 23, 37853 List the prime factors of 278238596. 2, 69559649 List the prime factors of 1022631472. 2, 31, 2061757 What are the prime factors of 2035837414? 2, 13, 17, 4605967 What are the prime factors of 106997735? 5, 13, 167, 9857 List the prime factors of 3074294474. 2, 59, 3613, 7211 What are the prime factors of 833292697? 1523, 547139 List the prime factors of 449948812. 2, 157, 716479 List the prime factors of 49432662. 2, 3, 31, 88589 List the prime factors of 295409080. 2, 5, 29, 254663 List the prime factors of 1330393168. 2, 13, 43, 148747 List the prime factors of 172397360. 2, 5, 2154967 List the prime factors of 73261931. 73261931 List the prime factors of 15209793. 3, 277, 6101 List the prime factors of 6605958650. 2, 5, 877, 150649 What are the prime factors of 22518267? 3, 7506089 List the prime factors of 662540925. 3, 5, 19, 464941 List the prime factors of 1698868389. 3, 23, 24621281 List the prime factors of 3204301484. 2, 31, 967, 26723 What are the prime factors of 39090034? 2, 461, 42397 What are the prime factors of 345063886? 2, 139, 277, 4481 What are the prime factors of 977753945? 5, 7, 27935827 What are the prime factors of 19953673? 23, 331, 2621 List the prime factors of 386168038. 2, 37, 5218487 List the prime factors of 1396850534. 2, 641, 673, 1619 What are the prime factors of 9518734? 2, 19, 23, 10891 List the prime factors of 42692010. 2, 3, 5, 1423067 What are the prime factors of 58549819? 17, 3444107 List the prime factors of 592680127. 13, 3506983 What are the prime factors of 560834125? 5, 4486673 List the prime factors of 42725627. 7, 349, 17489 List the prime factors of 2211395616. 2, 3, 1061, 7237 List the prime factors of 1565089773. 3, 13, 311, 129037 List the prime factors of 2790576496. 2, 47, 3710873 List the prime factors of 100513708. 2, 25128427 List the prime factors of 332888183. 83, 4010701 What are the prime factors of 1444392374? 2, 227, 3181481 List the prime factors of 307961657. 31, 43, 103, 2243 What are the prime factors of 319391064? 2, 3, 19, 23, 10151 What are the prime factors of 135456514? 2, 199, 211, 1613 List the prime factors of 5716101253. 31, 859, 214657 List the prime factors of 4901218053. 3, 32531, 50221 List the prime factors of 470887476. 2, 3, 937, 41879 List the prime factors of 642747901. 642747901 What are the prime factors of 30021469? 73, 411253 List the prime factors of 967011689. 7, 103, 1341209 List the prime factors of 15711048. 2, 3, 31, 7039 List the prime factors of 36225163. 13, 2786551 List the prime factors of 2722335473. 11, 13, 29, 656459 List the prime factors of 108877272. 2, 3, 7, 648079 What are the prime factors of 180554043? 3, 37, 1626613 List the prime factors of 443883668. 2, 17, 31, 43, 59, 83 List the prime factors of 193892914. 2, 5347, 18131 What are the prime factors of 22459528? 2, 7, 13, 30851 What are the prime factors of 13581899? 13581899 List the prime factors of 424794531. 3, 7, 20228311 List the prime factors of 133093899. 3, 14788211 List the prime factors of 656815150. 2, 5, 13136303 What are the prime factors of 1431948? 2, 3, 7, 17047 What are the prime factors of 35048144? 2, 541, 4049 List the prime factors of 685995316. 2, 11393, 15053 List the prime factors of 98424824. 2, 12303103 List the prime factors of 107582917. 13, 149, 55541 List the prime factors of 3985055. 5, 17, 173, 271 What are the prime factors of 945913039? 29, 32617691 List the prime factors of 221382428. 2, 73, 758159 List the prime factors of 14971496. 2, 1871437 What are the prime factors of 80446276? 2, 20111569 What are the prime factors of 7867436392? 2, 17, 37, 1563481 List the prime factors of 93922962. 2, 3, 7, 2236261 What are the prime factors of 97473696? 2, 3, 317, 3203 What are the prime factors of 1017105179? 1017105179 What are the prime factors of 64291346? 2, 7, 223, 20593 What are the prime factors of 33496288? 2, 7, 229, 653 List the prime factors of 271675398. 2, 3, 131, 345643 What are the prime factors of 4444593286? 2, 7, 1993, 159293 What are the prime factors of 2878963? 127, 22669 What are the prime factors of 338517119? 338517119 What are the prime factors of 4228585102? 2, 7, 41, 7366873 List the prime factors of 722223760. 2, 5, 1123, 8039 List the prime factors of 11666069. 1789, 6521 List the prime factors of 312494705. 5, 2383, 26227 List the prime factors of 1219645545. 3, 5, 81309703 What are the prime factors of 28859713? 379, 76147 List the prime factors of 3670547217. 3, 79, 15487541 List the prime factors of 1981261707. 3, 660420569 List the prime factors of 724739133. 3, 1381, 174931 What are the prime factors of 8310959? 8310959 What are the prime factors of 28170670? 2, 5, 11, 71, 3607 List the prime factors of 54674914. 2, 7, 3905351 What are the prime factors of 733262711? 733262711 What are the prime factors of 1074981434? 2, 17, 31617101 What are the prime factors of 108481726? 2, 17, 173, 18443 What are the prime factors of 155974872? 2, 3, 179, 36307 List the prime factors of 4473085616. 2, 1427, 195913 What are the prime factors of 1361706531? 3, 619, 733283 What are the prime factors of 3425827597? 29983, 114259 What are the prime factors of 1084189566? 2, 3, 433, 417317 What are the prime factors of 566580590? 2, 5, 17, 3332827 List the prime factors of 822426134. 2, 19, 23, 41, 59, 389 List the prime factors of 86085264. 2, 3, 31, 57853 List the prime factors of 102966946. 2, 51483473 List the prime factors of 53113591. 53113591 List the prime factors of 2681572475. 5, 107, 1002457 List the prime factors of 1800491502. 2, 3, 2063, 145459 What are the prime factors of 42622394? 2, 1213, 17569 List the prime f	{ "pile_set_name": "DM Mathematics" }
'th term of 1000, 1019, 1080, 1183, 1328, 1515? 21c2 - 44c + 1023 What is the w'th term of 8206, 16476, 24756, 33052, 41370, 49716, 58096, 66516? w3 - w2 + 8266w - 60 What is the i'th term of -10719, -21510, -32299, -43086, -53871, -64654, -75435? i2 - 10794i + 74 What is the y'th term of 319285, 319253, 319221? -32y + 319317 What is the o'th term of -4087, -8467, -12865, -17281, -21715, -26167, -30637? -9o*2 - 4353o + 275 What is the z'th term of -289, -82, 137, 374, 635, 926, 1253, 1622? z*3 + 200z - 490 What is the c'th term of -1234284, -2468698, -3703112, -4937526, -6171940? -1234414c + 130 What is the s'th term of -1894, -873, 1898, 7295, 16194, 29471, 48002, 72663? 146s3 - s2 + 2s - 2041 What is the y'th term of 339, -1353, -5073, -10821, -18597, -28401? -1014y*2 + 1350y + 3 What is the q'th term of 47465267, 47465274, 47465281? 7q + 47465260 What is the c'th term of 288980220, 288980219, 288980218, 288980217, 288980216? -c + 288980221 What is the r'th term of -11256102, -22512201, -33768304, -45024411? -2r*2 - 11256093r - 7 What is the o'th term of 3776413, 3776409, 3776405? -4o + 3776417 What is the m'th term of 485, 600, 949, 1538, 2373? m3 + 111m*2 - 225m + 598 What is the u'th term of 170848387, 341696773, 512545159, 683393545, 854241931, 1025090317? 170848386u + 1 What is the z'th term of 32226, 32194, 32166, 32142, 32122, 32106? 2z*2 - 38z + 32262 What is the t'th term of -158633305, -158633308, -158633311, -158633314? -3t - 158633302 What is the s'th term of 3304, 3802, 4300, 4798? 498s + 2806 What is the p'th term of -4134, -16590, -37414, -66660, -104382, -150634, -205470? -9p3 - 4130p*2 - 3p + 8 What is the f'th term of 14393, 59760, 135373, 241232, 377337, 543688, 740285? 15123f2 - 2f - 728 What is the a'th term of 115886, 115776, 115596, 115346, 115026, 114636, 114176? -35a2 - 5a + 115926 What is the n'th term of -130988, -261914, -392840? -130926n - 62 What is the r'th term of -664327, -664246, -664165, -664084? 81r - 664408 What is the z'th term of -13000, -21773, -30546, -39319, -48092? -8773z - 4227 What is the f'th term of 12464821, 12464823, 12464825, 12464827, 12464829? 2f + 12464819 What is the g'th term of -58915, -118060, -177197, -236326? 4g2 - 59157g + 238 What is the a'th term of 1080145, 1080192, 1080239, 1080286? 47a + 1080098 What is the w'th term of 22063, 22053, 22025, 21979, 21915? -9w*2 + 17w + 22055 What is the j'th term of -648, -5002, -16796, -39750, -77584? -620j3 - 14j - 14 What is the p'th term of 32760901, 65521800, 98282699, 131043598, 163804497, 196565396? 32760899p + 2 What is the a'th term of 1311, -559, -2415, -4251, -6061, -7839, -9579? a3 + a2 - 1880a + 3189 What is the i'th term of -25, -64, -79, -76, -61, -40, -19? -i*3 + 18i*2 - 86i + 44 What is the f'th term of 298, 1123, 2496, 4417? 274f2 + 3f + 21 What is the b'th term of -107113346, -214226691, -321340036, -428453381, -535566726, -642680071? -107113345b - 1 What is the p'th term of -22942, -29592, -36240, -42886? p2 - 6653p - 16290 What is the l'th term of 6896, 11485, 19134, 29843? 1530l2 - l + 5367 What is the y'th term of -11877, -16947, -30705, -57495, -101661, -167547, -259497, -381855? -724y*3 - 2y - 11151 What is the k'th term of 27004077, 54008152, 81012227, 108016302? 27004075k + 2 What is the r'th term of 1457362, 2914739, 4372116, 5829493? 1457377r - 15 What is the z'th term of -368, -183, 632, 2083, 4176, 6917, 10312? z*3 + 309z*2 - 749z + 71 What is the c'th term of -554385, -1108355, -1662327, -2216301, -2770277? -c*2 - 553967c - 417 What is the g'th term of 552233, 1104559, 1656885, 2209211? 552326g - 93 What is the q'th term of 19424, 38706, 57848, 76850, 95712, 114434, 133016? -70q*2 + 19492q + 2 What is the x'th term of -8237, -8095, -8023, -8057, -8233, -8587? -6x3 + x2 + 181x - 8413 What is the b'th term of -426459, -426457, -426455, -426453, -426451, -426449? 2b - 426461 What is the j'th term of 112163, 448653, 1009465, 1794593, 2804031? -j3 + 112167j*2 - 4j + 1 What is the s'th term of 36493, 72675, 108857, 145039, 181221, 217403? 36182s + 311 What is the g'th term of 578679, 2314739, 5208189, 9259035, 14467283? g3 + 578689g*2 - 14g + 3 What is the r'th term of 11024192, 11024190, 11024188, 11024186? -2r + 11024194 What is the w'th term of -364922, -364933, -364962, -365009? -9w*2 + 16w - 364929 What is the u'th term of 4917, 20443, 46319, 82545, 129121, 186047, 253323? 5175u2 + u - 259 What is the q'th term of 346599, 692385, 1038167, 1383945, 1729719, 2075489? -2q*2 + 345792q + 809 What is the n'th term of 60053, 59317, 58039, 56177, 53689? -7n3 - 229n*2 + 60289 What is the q'th term of 8457, 8899, 9635, 10665, 11989? 147q*2 + q + 8309 What is the i'th term of -118, -109, -204, -493, -1066, -2013? -15i*3 + 38i2 - 141 What is the x'th term of -42013438, -84026856, -126040284, -168053728, -210067194, -252080688? -x3 + x*2 - 42013414x - 24 What is the m'th term of -635735, -635709, -635683, -635657, -635631? 26m - 635761 What is the i'th term of -11162, -42870, -128936, -296540, -572862? -4530i3 + i2 - i - 6632 What is the t'th term of -1379, -5488, -12337, -21926? -1370t2 + t - 10 What is the s'th term of -6653, -13380, -20107, -26834, -33561? -6727s + 74 What is the m'th term of 140714, 141173, 141642, 142127, 142634, 143169, 143738? m3 - m2 + 455m + 140259 What is the u'th term of -14981, -28157, -41333, -54509? -13176u - 1805 What is the u'th term of 424461, 424430, 424399, 424368? -31u + 424492 What is the h'th term of -3679231, -7358454, -11037643, -14716780, -18395847? 3h3 - h2 - 3679241h + 8 What is the u'th term of 64753, 259032, 582829, 1036144, 1618977, 2331328, 3173197? 64759u*2 + 2u - 8 What is the s'th term of -161, -961, -2937, -6671, -12745, -21741? -97s3 - 6s*2 - 103s + 45 What is the t'th term of 944383, 1888767, 2833151, 3777535, 4721919? 944384t - 1 What is the g'th term of 213, 262, 311, 360, 409? 49g + 164 What is the c'th term of -5448, -5056, -4662, -4266, -3868, -3468? c*2 + 389c - 5838 What is the z'th term of -6804, -28873, -68668, -128655, -211300? -411z3 - 6397z2 - z + 5 What is the s'th term of 2192166, 2192169, 2192162, 2192139, 2192094? -s3 + s*2 + 7s + 2192159 What is the s'th term of 39452, 39590, 39932, 40580, 41636? 17s3 + 19s + 39416 What is the h'th term of 16009858, 16009878, 16009896, 16009912? -h*2 + 23h + 16009836 What is the k'th term of -496216, -992428, -1488636, -1984840? 2k2 - 496218k What is the i'th term of 151228, 151348, 151670, 152296, 153328? 17i3 - i2 + 4i + 151208 What is the r'th term of 469959, 469933, 469907, 469881, 469855, 469829? -26r + 469985 What is the g'th term of -1058105, -1057332, -1056561, -1055792, -1055025, -1054260, -1053497? -g2 + 776g - 1058880 What is the g'th term of -2424, -2573, -2742, -2937, -3164? -g*3 - 4g*2 - 130g - 2289 What is the a'th term of -1665737, -3331461, -4997187, -6662915, -8328645? -a*2 - 1665721a - 15 What is the m'th term of 6507497, 13014998, 19522499, 26030000, 32537501, 39045002? 6507501m - 4 What is the k'th term of -1487, -2154, -1183, 2248, 8961? 137k*3 - 3k*2 - 1617k - 4 What is the h'th term of -54683779, -109367561, -164051343, -218735125, -273418907? -54683782h + 3 What is the v'th term of 55202, 110205, 165194, 220169, 275130, 330077? -7v*2 + 55024v + 185 What is the v'th term of -789996, -789458, -788006, -785184, -780536, -773606, -763938, -751076? 76v3 + v2 + 3v - 790076 What is the c'th term of 1035006144, 1035006145, 1035006146, 1035006147, 1035006148? c + 1035006143 What is the w'th term of 37280, 149252, 335896, 597230, 933272, 1344040, 1829552? 3w3 + 37318w*2 - 3w - 38 What is the n'th term of 7839, 8163, 8491, 8823? 2n2 + 318n + 7519 What is the c'th term of 10, 477, 1314, 2521, 4098? 185c2 - 88c - 87 What is the y'th term of -120384, -240778, -361172, -481566? -120394y + 10 What is the d'th term of -603, -2557, -5863, -10509, -16483? 2d*3 - 688d*2 + 96d - 13 What is the z'th term of -2700, -5273, -7642, -9705, -11360, -12505, -13038? 1	{ "pile_set_name": "DM Mathematics" }
- -12). Let b(a) = 7a*2 - 3. What is the units digit of b(q)? 5 Suppose -11h + 23409 = 6h. Suppose 8x - h = 3655. What is the hundreds digit of x? 6 Let s(v) = -8v3 + 4v*2 - 4. Let x be s(-2). Let h = 80 - x. Suppose -hj + 321 = -w, -5j + 0w = -3w - 410. What is the units digit of j? 9 Suppose -2u + 13634 = f - 9302, -3f - 4u = -68808. What is the hundreds digit of f? 9 Let u(k) = 8 - 1 - 15k + 5k - k*3 + 13k*2. Let i be u(9). Suppose 4z - 3v - i = 0, 2z = -0z - 2v + 124. What is the tens digit of z? 6 Let r(a) = a*2 + 2a + 3. Let t be r(-1). Suppose 4d - 3d - 2l = 382, -tl = 3d - 1106. What is the hundreds digit of d? 3 What is the tens digit of (2 - -7)/(8 - (-64785)/(-8100))? 6 What is the thousands digit of ((-9402)/(-12) - 0)/((-27)/(-216))? 6 Let d = -9525 - -13694. Suppose 32q = 21431 + d. What is the units digit of q? 0 Let y = -13716 - -28784. What is the units digit of y? 8 Let z = 69108 - 33297. What is the hundreds digit of z? 8 Suppose -p + 2q = -1534 + 182, 1352 = p + 2q. Suppose 0 = 22v - 30v + p. What is the units digit of v? 9 Let c = -5 - 74. Let k = 443 + c. What is the tens digit of k? 6 Let a(l) = -196l + 9. Let d = -91 - -89. What is the tens digit of a(d)? 0 Let l(n) = 2n*2 - 18n + 9. Let u be l(9). Suppose 0 = -3j - 2b + 594, 4b - u - 983 = -5j. What is the hundreds digit of j? 1 Let x(n) = n*3 + 37n*2 + 2. Let w be x(-37). Suppose -5u + 4q + 231 = 0, -wu = u + q - 142. What is the units digit of u? 7 Let w(q) = -3q - 16. Let b be w(-9). Let j = 13 - b. Suppose -2v = jt + 3v - 111, 5v + 129 = 3t. What is the tens digit of t? 4 Let z be 451/123((4 - -1) + -2). Suppose 463 = -zl + 12l. What is the units digit of l? 3 Suppose 2v - 5f - 21017 = 0, -2v + f = -0v - 21045. What is the units digit of v? 6 Suppose -29r + 3p + 117106 = -16r, -5r - p + 45030 = 0. What is the units digit of r? 7 Suppose -p - 5a + 47 = p, 2p + 2a - 56 = 0. Suppose -9o - 56 + 20 = 0. Let f = o + p. What is the units digit of f? 7 Let u(v) = -v3 + 12v*2 - 12v + 11. Let p be u(11). Suppose pg + 171 = 3g. Suppose 2d - 131 = g. What is the tens digit of d? 9 Suppose 34 = -5n + 49. Suppose -152 = -2d + 4j + 602, -d + nj = -380. What is the tens digit of d? 7 Let g(u) = -u3 + 20u*2 - 32u - 19. Suppose 72h - 62h = 170. What is the units digit of g(h)? 4 Let p be 5 + -1 - (-6 + 7). Suppose ph + 4h - 14 = 0. Suppose hw - 3w + 178 = 0. What is the tens digit of w? 7 Let r(p) = -p*3 - 3p*2 - p + 280. Let i be r(0). Suppose -i = -2x + 596. What is the units digit of x? 8 Let o = -2286 - -3714. What is the hundreds digit of o? 4 Suppose n - 7 = -5w + 11, w = -2n. Suppose 0 = -wd + 665 - 269. What is the tens digit of d? 9 Let f(a) = 9a*2 - 26a - 481. What is the thousands digit of f(39)? 2 Suppose 0 = 1149a - 1163a + 356622. What is the ten thousands digit of a? 2 Suppose 5y + 4d = -d + 81840, 4y - 3d = 65479. What is the ten thousands digit of y? 1 Suppose -36s + 4r = -32s - 3588, 5r - 2667 = -3s. What is the hundreds digit of s? 8 Let l = 98 - 83. Let k be -81(-6)/15 + (-6)/l. Suppose kc - 23c = 819. What is the units digit of c? 1 What is the tens digit of (147724/42 - 48/(-144)) + (-24)/(-56)? 1 Let u(c) = 2286c + 25c*2 - 20c*2 - 23 + 29c*2 - 2194c + c*3. What is the tens digit of u(-30)? 1 Let n(f) = -182f - 1. Let k be n(-1). Suppose k + 365 = 6l. What is the units digit of l? 1 Let w = 145 - -104. Suppose -w - 1047 = -2p + r, -659 = -p - 5r. What is the hundreds digit of p? 6 Suppose 26567 = s + 3n, 427n + 79771 = 3s + 422n. What is the thousands digit of s? 6 Let w(v) = 2v*3 - 4v*2 - 8v + 10. Let f be w(3). What is the hundreds digit of (-408)/28(-87 - f)? 3 Suppose 3q + 9d - 4d + 1396 = 0, q + 469 = 2d. Let t = q + 1711. What is the units digit of t? 4 Suppose -v + 36 = -3p + 6p, 2p = -v + 38. Let l = v + -21. Let z = 7 + l. What is the tens digit of z? 2 Let g be (0 + 15/(-3))(-12)/15. Let j be (6/9)/((-235)/60 + g). Suppose 1181 = jk - 3. What is the tens digit of k? 4 Let j(o) = -20o2. Let b be j(1). Let d = b + 13. Let z(x) = x2 - 7x + 11. What is the hundreds digit of z(d)? 1 Suppose -2j = 2b - 38534, 6b - 127473 = -4j - 11885. What is the ten thousands digit of b? 1 Let o(q) = 711q3 - 7q*2 + 48q - 86. What is the units digit of o(4)? 8 Suppose 4c + i = -19, c + 10i - 5i + 19 = 0. Let b be 2492/c + 0 + -1. What is the tens digit of (b/(-26))/(2/3)? 3 Let l(k) = -3k*3 + 11k*2 + 9k + 20. Let n be l(-10). Suppose 7r = 20r - n. What is the tens digit of r? 1 Suppose -3v = h - 15 + 13, -2v = 4h - 28. Let k be 287 + 2/(-1) - 0. What is the tens digit of h(k/20 + -4)? 8 Suppose d = 4t - 39101, -4t + 25d + 39080 = 21d. What is the thousands digit of t? 9 Suppose -7u - 5220 = -13u. Suppose -5v + 3g + 3 = 0, 2g + 2 + 0 = 2v. Suppose v = 4q + 122 - u. What is the tens digit of q? 8 What is the tens digit of 35034((-2)/6 - (12 - (-375)/(-30)))? 3 Let d = -82 + 127. What is the units digit of (-3009)/(-5) + 9/d? 2 Let b be -335/(-45). Let a(g) = 1884g2 + 16g - 17. What is the thousands digit of a(b)? 1 What is the thousands digit of 21(-15)/735 + (-1026772)/(-28)? 6 Let g(m) be the first derivative of -m4/4 - 3m*3 - 22m*2 + 4m + 191. What is the hundreds digit of g(-11)? 7 Suppose 11d - 1068 + 3202 = 0. Let o = 669 + d. What is the hundreds digit of o? 4 Let r = -195 - -110. What is the hundreds digit of 3 - (2 + 3)r? 4 Suppose 14v - 29684 + 20085 = 34739. What is the hundreds digit of v? 1 Suppose -6b + 432 = -78. Suppose 5x + 4 = 19. Suppose 111 = 4u + 2n - n, xu = n + b. What is the units digit of u? 8 What is the hundreds digit of (19/(-76) - 80393/4-1) + 2? 1 Suppose -5m = -12m + 784. Let j = m + -114. What is the units digit of (j/((-1)/1))/(26/39)? 3 Suppose -5k + 1100 = 5k. Let q = k + -66. Let a = q - -8. What is the tens digit of a? 5 Let h = -4003 - -22320. What is the ten thousands digit of h? 1 What is the tens digit of (48/(-18)9)/((-6)/7196)? 8 Let o(m) = m*3 - 3m*2 + 23m + 65. What is the units digit of o(15)? 0 Let a be (1 + 8 - -370)(0 + 1). Suppose 0 = -5y + 3o + 483, 6o - o - a = -4y. What is the tens digit of y? 9 Suppose -1097 = 4r + 2311. Let v = -431 - r. What is the units digit of v? 1 Let q = -14494 + 19249. What is the thousands digit of q? 4 Let f = 73 + 12. Let l = 730 - 788. Let d = f - l. What is the tens digit of d? 4 Let b = 309 + -311. What is the tens digit of -237(3/9 + b)? 9 Let c = 290 + -338. What is the hundreds digit of (-14388)/(-20) - c/80? 7 Suppose -5l = -4b - 8, -b - l + 4 = -3. Suppose -39 = -3f - b. Suppose -17o = -fo - 305. What is the units digit of o? 1 Let t(g) = -7g + 55. Let i = 49 + -73. What is the tens digit of t(i)? 2 Let x(a) = a3 + 118a*2 + 16a - 6. What is the units digit of x(-30)? 4 Let o(h) be the third derivative of -19h5/120 + 35h4/24 - h3/3 - 20h2. Let f(u) be the first derivative of o(u). What is the hundreds digit of f(-7)? 1 Let x(v) be the second derivative of 6v*3 + 31v*2 + 5v. Let f be x(5). Suppose f = 5h + 5p - 2p, p + 50 = h. What is the units digit of h? 9 Let o be (5 + 2)-427/126. Let x(s) = 19s - 33. Let c(n) = 10n - 16. Let r(k) = -7c(k) + 3x(k). What is the tens digit of r(o)? 9 Let o(d) = -d2 + 12d - 8. Let w be o(8). Let g be (4/3)/(4 + (-92)/w). Suppose c - 17 + g = 0. What is the units digit of c? 9 Let t(m) = m + 17. Let w be t(-17). Suppose w = 3h - 0h - 4q - 483, -616 = -4h - 4q. What is the tens digit of 172/129 - h(-10)/6? 6 Let p = -18511 + 30949. What is the thousands digit of p? 2 Suppose 6g - 24625 - 16283 = 0. What is the units digit of g? 8 Let k(y) = 2y*2 + 1. Let i be k(2). Let m = 3057 - 3052. Suppose -548 = -iu + mu. What is the units digit of u? 7 Let q(l) = -l3 + 9l*2 + 4l + 2. Let m be q(6). Suppose -o = -5g + m, 4g = -o + 67 + 33. Let s = g + -24. What is the units digit of s? 2 What is the tens digit of 7 + 11 + -8 - -12055? 6 Let i = 105 - -813. Suppose 2l - i = -u - 45, -3l = -4*u - 1337. What is the hundreds digit of l? 4 Let k be (-16)/(-40) - 3253/(-5). Suppos	{ "pile_set_name": "DM Mathematics" }
91? 9 What is the thousands digit of 2395? 2 What is the hundreds digit of 1299? 2 What is the thousands digit of 1662? 1 What is the hundreds digit of 1598? 5 What is the thousands digit of 25586? 5 What is the hundreds digit of 455? 4 What is the hundreds digit of 8766? 7 What is the tens digit of 645? 4 What is the tens digit of 3527? 2 What is the units digit of 7236? 6 What is the units digit of 1355? 5 What is the hundreds digit of 10713? 7 What is the thousands digit of 1433? 1 What is the thousands digit of 42595? 2 What is the hundreds digit of 2549? 5 What is the units digit of 155927? 7 What is the hundreds digit of 162? 1 What is the units digit of 518? 8 What is the tens digit of 59650? 5 What is the hundreds digit of 1489? 4 What is the hundreds digit of 46050? 0 What is the hundreds digit of 2692? 6 What is the hundreds digit of 11182? 1 What is the tens digit of 253? 5 What is the tens digit of 129? 2 What is the units digit of 11577? 7 What is the tens digit of 119? 1 What is the hundreds digit of 19665? 6 What is the thousands digit of 1846? 1 What is the thousands digit of 172911? 2 What is the units digit of 2933? 3 What is the tens digit of 111129? 2 What is the tens digit of 107014? 1 What is the hundreds digit of 13212? 2 What is the units digit of 114? 4 What is the hundreds digit of 9176? 1 What is the hundreds digit of 2950? 9 What is the hundreds digit of 5520? 5 What is the units digit of 32169? 9 What is the thousands digit of 121903? 1 What is the hundreds digit of 17835? 8 What is the units digit of 2678? 8 What is the thousands digit of 2764? 2 What is the tens digit of 58858? 5 What is the ten thousands digit of 11485? 1 What is the tens digit of 110071? 7 What is the units digit of 910? 0 What is the ten thousands digit of 19055? 1 What is the hundreds digit of 10034? 0 What is the units digit of 4628? 8 What is the units digit of 33341? 1 What is the tens digit of 796? 9 What is the hundreds digit of 53289? 2 What is the tens digit of 456? 5 What is the units digit of 4638? 8 What is the hundreds digit of 21982? 9 What is the hundreds digit of 4830? 8 What is the thousands digit of 8767? 8 What is the hundreds digit of 18788? 7 What is the tens digit of 97591? 9 What is the hundreds digit of 19000? 0 What is the tens digit of 5867? 6 What is the tens digit of 1638? 3 What is the ten thousands digit of 39111? 3 What is the units digit of 1425? 5 What is the tens digit of 15398? 9 What is the thousands digit of 84799? 4 What is the thousands digit of 41089? 1 What is the units digit of 6996? 6 What is the thousands digit of 88501? 8 What is the tens digit of 170480? 8 What is the thousands digit of 3349? 3 What is the units digit of 1841? 1 What is the thousands digit of 68712? 8 What is the hundreds digit of 2052? 0 What is the tens digit of 3854? 5 What is the units digit of 7356? 6 What is the tens digit of 31744? 4 What is the ten thousands digit of 30788? 3 What is the thousands digit of 5783? 5 What is the units digit of 32064? 4 What is the thousands digit of 2028? 2 What is the units digit of 5775? 5 What is the thousands digit of 90642? 0 What is the tens digit of 1142? 4 What is the tens digit of 4560? 6 What is the tens digit of 76794? 9 What is the tens digit of 380? 8 What is the tens digit of 8721? 2 What is the ten thousands digit of 69278? 6 What is the hundreds digit of 2558? 5 What is the hundreds digit of 3269? 2 What is the tens digit of 11178? 7 What is the hundreds digit of 4176? 1 What is the tens digit of 639? 3 What is the hundreds digit of 2281? 2 What is the units digit of 2310? 0 What is the units digit of 1159? 9 What is the units digit of 47128? 8 What is the thousands digit of 5626? 5 What is the hundreds digit of 8135? 1 What is the tens digit of 175? 7 What is the ten thousands digit of 13735? 1 What is the tens digit of 89160? 6 What is the tens digit of 562? 6 What is the ten thousands digit of 40957? 4 What is the tens digit of 2017? 1 What is the tens digit of 160? 6 What is the units digit of 21630? 0 What is the tens digit of 21568? 6 What is the units digit of 712? 2 What is the ten thousands digit of 16651? 1 What is the units digit of 105112? 2 What is the units digit of 36295? 5 What is the thousands digit of 88723? 8 What is the tens digit of 135873? 7 What is the units digit of 570? 0 What is the units digit of 579? 9 What is the ten thousands digit of 43990? 4 What is the ten thousands digit of 30851? 3 What is the units digit of 65343? 3 What is the hundreds digit of 9424? 4 What is the ten thousands digit of 22354? 2 What is the hundreds digit of 798? 7 What is the hundreds digit of 1117? 1 What is the hundreds digit of 22248? 2 What is the thousands digit of 132043? 2 What is the tens digit of 17475? 7 What is the thousands digit of 1518? 1 What is the units digit of 269? 9 What is the tens digit of 18648? 4 What is the ten thousands digit of 108626? 0 What is the units digit of 5141? 1 What is the tens digit of 386? 8 What is the hundreds digit of 30527? 5 What is the units digit of 15576? 6 What is the hundreds digit of 19606? 6 What is the units digit of 4034? 4 What is the tens digit of 19962? 6 What is the ten thousands digit of 22735? 2 What is the tens digit of 69653? 5 What is the units digit of 6332? 2 What is the hundreds digit of 116380? 3 What is the thousands digit of 27320? 7 What is the hundreds digit of 18564? 5 What is the tens digit of 2326? 2 What is the hundreds digit of 530? 5 What is the hundreds digit of 649? 6 What is the hundred thousands digit of 106539? 1 What is the hundreds digit of 220? 2 What is the units digit of 22539? 9 What is the tens digit of 3488? 8 What is the thousands digit of 1195? 1 What is the hundreds digit of 8157? 1 What is the thousands digit of 1027? 1 What is the units digit of 3925? 5 What is the hundreds digit of 469? 4 What is the ten thousands digit of 24231? 2 What is the ten thousands digit of 41977? 4 What is the tens digit of 7423? 2 What is the ten thousands digit of 10307? 1 What is the thousands digit of 31140? 1 What is the thousands digit of 6020? 6 What is the units digit of 11751? 1 What is the hundreds digit of 79280? 2 What is the units digit of 2809? 9 What is the thousands digit of 21540? 1 What is the units digit of 4288? 8 What is the thousands digit of 1073? 1 What is the hundreds digit of 809? 8 What is the hundreds digit of 9765? 7 What is the ten thousands digit of 12660? 1 What is the hundreds digit of 33754? 7 What is the hundreds digit of 5168? 1 What is the hundreds digit of 519? 5 What is the hundreds digit of 1642? 6 What is the tens digit of 11676? 7 What is the units digit of 204437? 7 What is the hundreds digit of 371? 3 What is the hundreds digit of 5052? 0 What is the tens digit of 2718? 1 What is the tens digit of 86516? 1 What is the hundreds digit of 166202? 2 What is the units digit of 3981? 1 What is the tens digit of 67431? 3 What is the hundreds digit of 1035? 0 What is the units digit of 730? 0 What is the hundreds digit of 2675? 6 What is the tens digit of 67980? 8 What is the units digit of 754? 4 What is the thousands digit of 2041? 2 What is the units digit of 787? 7 What is the tens digit of 947? 4 What is the thousands digit of 3991? 3 What is the hundreds digit of 568? 5 What is the units digit of 193? 3 What is the tens digit of 44652? 5 What is the thousands digit of 8220? 8 What is the units digit of 13059? 9 What is the ten thousands digit of 43138? 4 What is the thousands digit of 1171? 1 What is the thousands digit of 2439? 2 What is the ten thousands digit of 22934? 2 What is the units digit of 26822? 2 What is the units digit of 521? 1 What is the tens digit of 1262? 6 What is the units digit of 5246? 6 What is the hundreds digit of 2187? 1 What is the units digit of 908? 8 What is the tens digit of 224? 2 What is the hundreds digit of 374? 3 What is the tens digit of 478? 7 What is the hundreds digit of 11999? 9 What is the ten thousands digit of 43974? 4 What is the hundreds digit of 11615? 6 What is the tens digit of 16261? 6 What is the tens digit of 6403? 0 What is the tens digit of 4926? 2 What is the thousands digit of 27073? 7 What is the thou	{ "pile_set_name": "DM Mathematics" }
(12 - 6) + -24 + 6 + 63. 51 -38 + (11 - (14 - 17 - ((1 - 18) + -1))) -42 What is -81 + 27 - (14 + -12 + 3 - 16)? -43 Evaluate 5 + (76 - 8) + -127. -54 What is the value of (-124 + 125 - (-92 - (0 + -1))) + (-147 - -137)? 82 What is the value of 229 - 265 - ((-4 - -11) + 11)? -54 What is the value of 54 + -20 - (-9 + -3 + -11)? 57 (-42 - (-17 - 5)) + 11 - -1 -8 Evaluate (-207 - -56) + 109 - 76. -118 (70 - 77) + 2 + 0 - (6 + 2) -13 What is 16 + 13 + -33 + -3? -7 Calculate (2 - 4) + (-22 - (30 + -1 - -4)). -57 Evaluate -150 + (-28 - -72 - 0). -106 Calculate -13 - (11 - (-2 - -34)) - (-38 - (-2 + -4)). 40 What is the value of 106 + (0 - 21 - -8) + -25? 68 Calculate 11 + (16 - 14 - (-40 - (-10 - -16))). 59 What is the value of 24 + -20 - 17 - -8 - (2 + -40 + -1)? 34 What is -1 + 1 + 37 - (-43 - -77 - 35 - -10)? 28 (76 - (-2 + 22 + -12 + -13) - 8) + 5 78 Calculate 21030 + -21013 + (35 - (1 + -3)). 54 2 + 0 + -45 + -14 + 6 + -6 + 7 -50 (3 - 12) + -4 - (-526 - -504) 9 -26 + (16 - (13 + -17 - -36 - 17)) -25 Calculate -1 + 22 + -12 + -6 - 34 - -10. -21 What is the value of 0 - 2 - (-66 + 174 + -92)? -18 What is the value of -83 + (6 - (-12 + 4 + 14 + -3 + 13))? -93 -13 - 39 - (-41 - (-2 + -9)) -22 What is 10 + (-53 + -18 - (-7 - -1)) - (10 - 18)? -47 What is the value of ((-69 - 13) + 17 - -8) + (-8 - (1 + -22))? -44 What is 0 + -15 - (18 - (-16 - -25 - -4))? -20 Calculate -6 - 7 - ((8 - -2) + -34) - 42. -31 (1 - -3) + -2 + -13 + -10 + 49 + -87 -59 Calculate 44 - (27 - -5 - -18). -6 What is the value of -91 - (-10 + -51 + -33)? 3 What is the value of (-11 - (-16 + -1)) + 0 + 0 + -9? -3 Evaluate (146 - 137) + -1 + -30. -22 What is (38 - -15) + -111 + 63? 5 Evaluate (24 - 0) + -1 + -160 - -17 - -4. -116 What is the value of -13 + (-5 - -60) + -14? 28 What is 24 - (25 - -83) - (11 + -31)? -64 What is 32 + -1 - ((855 - 891) + 20 + 2)? 45 Calculate (9 - -5) + 2 + -2 + -42. -28 Evaluate (1 - 22) + 19 + (13 - (10 + -4 - 2)). 7 What is 18 + -16 - (1 + 4 + -118 + 122 + -90)? 83 What is the value of (-1 - (3 - -2)) + (10 - 55 - (-46 - 7))? 2 Calculate -151 + (72 - -18) - 26. -87 -1 - 23 - (-1 + 26 - 10) -39 Calculate 37 - (-68 - (38 - 97)). 46 Evaluate (47 - -55 - 131 - (1 - 12)) + 103. 85 67 - (-103 - (-56 + -146)) -32 -5 - (7 - 6) - -8 - (56 + -7 + -4) -43 Evaluate (48 - 58) + 47 + 6 + (-4 - -12). 51 What is the value of -5 - (-4 + 18 - 10 - (-1 - (-58 + 2)))? 46 Calculate 69 + 91 + (38 - 112). 86 Calculate 12 + -58 + 28 + -26. -44 What is the value of (6 - 9) + (1 - (-2 + 7)) + (1 - -9)? 3 Calculate 184 + -86 + -67 - 109. -78 What is the value of (-2 - -8) + -3 + -53 - (-84 - (-146 - -53))? -59 What is 76 - (13 - (75 - 206))? -68 What is the value of -451 - -457 - (-1 + -41)? 48 Calculate 1 + 1 + -4 - (73 + 0) - (274287 + -274272). -90 What is the value of 21 + (-55 - -25) - (121 - 70)? -60 What is the value of (-2 + -8 - -5) + 21 - -3 - -39? 58 Evaluate 10 - 4 - ((20 - 11) + -10 - 8). 15 What is 0 + -87 + 0 - ((-164 - -163) + -17)? -69 Evaluate (112 - 194) + -58 + 48. -92 What is the value of -2 + (200 + -204 - (4 + 1 - -2)) + 53? 40 What is -18 + (12 - 17) + 31? 8 What is the value of (-9 - -36) + -30 - (-3 - 14)? 14 What is the value of (2 - 2) + (-10 - ((-48 - 43) + (5 - -11)))? 65 85 - (4 + (-3 - (1 + 3))) - (1037 + -1036) 87 What is the value of -52 + -4 + 14 - (-4 + 6 + 1 + -8)? -37 What is the value of (-20 + 44 - -28) + -21? 31 (53 - (42 - (16 - 1))) + -40 -14 Calculate (3 - (101 - -8)) + -3 + (-4 - -11) + -2. -104 Evaluate (-25 - (-5 + -17)) + 18 + 2 + -21. -4 49 + 129 + (-134 - 135) -91 Evaluate (44 - 12) + (-111 + 25 - 19). -73 0 + (30 - ((-8 + -3 - -22) + -4)) + -5 18 What is (-19 + 19 - (-4 + -3 + 10) - 45) + -6? -54 Evaluate -43 + -60 + 152 - 78. -29 What is -40 - (3 - (10 - -9)) - (-11 + 11)? -24 -13 - (26 - 108) - 19 50 Calculate -15 - -67 - 37 - 14. 1 1 + -14 - ((-2 - -51) + -43) -19 Calculate 19 - (62 + -132 - -20). 69 What is the value of 61 - 44 - 13 - (0 + -5)? 9 What is the value of 49 + 1 + (-1 - (1 - -5 - (77 - 63)))? 57 Evaluate 4 + -54 - (-7 + (-19 - (-13 - 4))) - -1. -40 Evaluate -47 + (-15 - (23 + -38) - -4) + -5. -48 What is the value of 19 + (6 - (-24 + 23 + (-7 - 7)))? 40 Calculate (94 - ((-1 - -5 - (-19 - -23)) + 10)) + -12. 72 What is 28 - (2 + -2) - (-5963 + 5999)? -8 What is the value of -76 + -8 + 38 + 45? -1 45 - 8 - (331 + -349) 55 (1 - ((-13 - 2) + -3)) + -13 6 Calculate (13 - 10) + (25 + -22 - (2 - (-27 - 0))). -23 65 - 158 - (20 + -1) - -30 -82 -12 - (-2 + -31 - (-76 - -55)) 0 What is -56 + (5 + -2 - ((3 - 7 - -27) + -13))? -63 Calculate -18 + 12 - (-105 + (1 - -5)) - 2. 91 Calculate (10 - (28 - (6 + 7))) + 41 - -1. 37 Calculate -15 + 18 + 13 + 9 + -9. 16 What is (-29 - -13) + (34 - 7) - (-12 + 1)? 22 Calculate 5 - 5 - (3 - -39 - (-16 + 19)). -39 What is -185 + (-113 + 140 - (-28 + 9))? -139 What is 3 - (-7 + (25 - 7)) - 31? -39 What is the value of 53 + (-49 - (-121 + 63))? 62 Evaluate (85 - 103 - (-2 - 0)) + (-4 - (0 - -1)). -21 Calculate 30 - (101 - 25 - 56). 10 What is (-57 - -39) + (65 - 30)? 17 What is (0 - -2 - -92) + (367 + -216 - 156)? 89 Evaluate 1 + 78 - (2341 + -2265). 3 Calculate (-3 - (-14 - -3)) + 50 + -49. 9 What is -6 + 4 + (14 - (-13 + 3 - -22))? 0 Calculate (3575 - 3601 - (2 - -26)) + -13 + 1 + 0. -66 Calculate -16 + (14 - (-6 - (-24 - -27)) - -107). 114 -10 - (-36 - (-25 + (-23 - -45))) 23 Evaluate (1 - (6 - 6)) + (68 - (8 - 9 - -9)). 61 -1 + (-51 - (-11 + (32 + 0 - 9)) - 1) -65 -182 + 122 + (1 - -2) + 16 -41 Calculate 36 + -26 + -16 + 9 - (2 + -27). 28 (2 - 28 - -26 - -2) + -1 + -51 -50 Evaluate -381 - -476 - (0 + 49). 46 What is the value of 3315 + -1642 + -1659 - (-27 - (-1 + 0 + 0))? 40 Evaluate -31 + 161 + -82 - 125. -77 What is the value of (-3 - 63) + 55 - 35? -46 What is 85 - (17 - (-25 + 30 - 8))? 65 Evaluate -13 + (31 - -1) + -6 + (-1 + 0 - 72). -60 Evaluate 21 + (50 - -1 - (-2215 + 2256)). 31 Calculate (-9 - 5 - -5) + (50 - 26 - -45). 60 What is the value of (-14 + -6 - (0 + -67)) + (-16 - (-5 - -2))? 34 What is the value of 12 + -9 + 16 - (-17 - (-3 - 4))? 29 (-2 - 86) + (-54 - -100) -42 Calculate (84 - -9) + (1 - 62). 32 -7 + -3 + ((26 - 13) + -14 - -66) + -3 52 (-26 - -4) + 22 + -5 + 1 - 12 -16 Evaluate 116 - 23 - 25 - (-8 + 1 + 0 + 2). 73 Evaluate -7 + (8 - -16 - 52). -35 -4 - 19 - 8 - 7 - 6 -44 What is 16 + -37 + -40 + 4 + 151? 94 Evaluate 4 + 108 + -4 + -25 + 4. 87 What is 28 + 1 - (-270 + 242)? 57 What is the value of -4 + 39 + -83 - -25? -23 What is the value of (30 - -5) + -22 + 21? 34 Calculate 34 + -43 + 52 + -49. -6 What is (-24 - 2 - 50) + 30 + -1 + 7? -40 Calculate (33 + -11 - (-19 + 20)) + -81. -60 Calculate 21 - (-67 + (-24 - -71)). 41 Calculate -48 + 1 - (5622 - 5644). -25 -194 + (146 - (75 - 30)) -93 Evaluate (-26 - (-13 + -6) - (-29 - -5)) + 3. 20 (-28 - ((-9 + 6 - -10) + -2)) + 0 -33 (-5 - (-6 + -9 - -8)) + -5 + -20 -23 What is 8 + 4 - 46 - (60 + -44 - (2 - -8))? -40 What is (2 + -27 - (-77 + -51)) + -8 - 18? 77 Evaluate 26 - (13 - 17) - 24. 6 -104 - (-247 + -11 + 57) 97 What is the value of -2 + (-11 - -15 - 6) + 46 + 19? 61 What is (6 - -1) + -2 + 12 + -22 + 16 + 10? 21 Calculate 607 - 546 - (11 + 0 + -2). 52 19 - (35 - 47) - -10 41 What is (2 - 8) + (-79 - -171 - 0)? 86 What is 73 + -71 + -25 + 109 + 7? 93 What is -17 - 3 - (-4 - -6 - (76 + -14))? 40 What is the value of -7 + 32 + -31 - (-24 + 0 + 0) - 11? 7 Evaluate -12 + 84 - (-17 + 1 - -5 - 1). 84 Calculate (-206 - -201) + (-77 - (-13 + -5 + 10)). -74 What is 0 - -7 - -15 - (-328 + 311)? 39 -19 - (-5 - -5) - -3 - (3 + -6 + -1) -12 Evaluate -9 - ((8 - -5) + 27 + -14) - (-8 + 1). -28 What is the value of 8 - (-22 + 3 - (-11 - (-28 - -30))) - -17? 31 What is the value of -55 + (61 - 52) + -27? -73 Calculate -128 + -18 + 71 + 105. 30 Evaluate 84 + -1 + (24 + -35 - 4). 68 What is 13 + (13 + 25 - -2 - 8)? 45 Calculate 5 + -64 + 4 + (-54 - -79). -30 What is 3 + 3 - (-31 + 103 + -15 + -12)? -39 Calculate 52 + -11 + (6 + 1 - 14). 34 What is the value of 3 + -2 + 0 + (12 + -58 - -50)? 5 Calculate (68 - 25) + -19 - (0 - 20). 44 Calculate 137 - (233 - 106) - ((2 - (-1 + -30)) + 2). -25 What is the value of (-5 - 5 - -13 - 26) + -119 + 221? 79 Evaluate -83 + 116 - (-26 + 11). 48 -77 + (-411 + 413 - (-3 + 2 + (6 - 5))) -7	{ "pile_set_name": "DM Mathematics" }
sequence uue when three letters picked without replacement from {u: 3, e: 1}. 1/4 Calculate prob of sequence hrb when three letters picked without replacement from {h: 2, l: 1, p: 7, r: 1, b: 2, t: 1}. 1/546 Calculate prob of sequence qx when two letters picked without replacement from {x: 4, q: 10}. 20/91 Two letters picked without replacement from {m: 1, e: 1, d: 4, r: 1, p: 1}. What is prob of sequence ed? 1/14 Calculate prob of sequence le when two letters picked without replacement from ehlsd. 1/20 Calculate prob of sequence edd when three letters picked without replacement from {d: 10, n: 6, e: 2}. 5/136 Calculate prob of sequence gg when two letters picked without replacement from gdggddgg. 5/14 What is prob of sequence mm when two letters picked without replacement from {m: 11, l: 5}? 11/24 Three letters picked without replacement from {u: 2, a: 2, l: 3, s: 4, w: 2, n: 1}. What is prob of sequence uss? 1/91 What is prob of sequence wwq when three letters picked without replacement from cjcqwwkjkwjqwjwjp? 1/102 Calculate prob of sequence llll when four letters picked without replacement from {l: 7}. 1 Three letters picked without replacement from ftffhts. Give prob of sequence fft. 2/35 Three letters picked without replacement from qqiqqqqqqqqqii. Give prob of sequence iqq. 55/364 What is prob of sequence rxq when three letters picked without replacement from {x: 4, h: 1, y: 7, q: 2, r: 2}? 1/210 What is prob of sequence sxxs when four letters picked without replacement from jusjxuuuuusuuxuuujs? 1/7752 Calculate prob of sequence zv when two letters picked without replacement from {y: 3, v: 1, z: 2, x: 1}. 1/21 Four letters picked without replacement from {p: 3, e: 5}. Give prob of sequence pppe. 1/56 Three letters picked without replacement from nainoaion. What is prob of sequence nnn? 1/84 Two letters picked without replacement from pppsxvquxxpvpvx. What is prob of sequence ps? 1/42 Calculate prob of sequence ttt when three letters picked without replacement from ttt. 1 Two letters picked without replacement from {z: 2, r: 5, e: 3, k: 1, h: 1}. Give prob of sequence zr. 5/66 Calculate prob of sequence igi when three letters picked without replacement from hiviivhvgvi. 2/165 Four letters picked without replacement from {i: 1, u: 2, m: 1, x: 2}. Give prob of sequence ixxx. 0 What is prob of sequence xk when two letters picked without replacement from taxsxsaaaatkatk? 2/105 What is prob of sequence jfk when three letters picked without replacement from {j: 1, f: 1, x: 3, l: 2, n: 4, k: 1}? 1/1320 Calculate prob of sequence zw when two letters picked without replacement from {z: 7, w: 1}. 1/8 Three letters picked without replacement from eprck. What is prob of sequence kcr? 1/60 Calculate prob of sequence wgiu when four letters picked without replacement from wuggguuiwwuewuuwwigu. 14/4845 Two letters picked without replacement from axyxzzazcxyyc. Give prob of sequence ya. 1/26 Calculate prob of sequence vrvv when four letters picked without replacement from vrvrvrrrvvrrrrvrrvr. 35/1292 Four letters picked without replacement from {g: 1, c: 1, h: 2, l: 1}. What is prob of sequence gclh? 1/60 Three letters picked without replacement from zzzczzzgzuzgzc. Give prob of sequence ucc. 1/1092 What is prob of sequence pip when three letters picked without replacement from {i: 1, j: 2, m: 2, c: 1, p: 6}? 1/44 What is prob of sequence avn when three letters picked without replacement from {v: 1, h: 3, a: 1, n: 2}? 1/105 Two letters picked without replacement from qxsxnpqsqspxyqx. Give prob of sequence nx. 2/105 Four letters picked without replacement from {c: 1, d: 3, r: 1, a: 2}. Give prob of sequence dddc. 1/140 Calculate prob of sequence rnf when three letters picked without replacement from {r: 1, n: 6, f: 12}. 4/323 Three letters picked without replacement from kqkgggdkkgqgaakggqg. What is prob of sequence gga? 56/2907 What is prob of sequence ztd when three letters picked without replacement from tzihdhf? 1/210 Calculate prob of sequence fff when three letters picked without replacement from fffj. 1/4 Three letters picked without replacement from iwiiiiiiiiiiiiiiiwi. What is prob of sequence iiw? 16/171 Four letters picked without replacement from zezauucacrcrrre. Give prob of sequence zaer. 4/4095 Four letters picked without replacement from ccfcffccffcfcfccff. Give prob of sequence cccf. 21/340 Four letters picked without replacement from yirllryyliyl. What is prob of sequence iirl? 2/1485 Two letters picked without replacement from bsssbb. What is prob of sequence sb? 3/10 Calculate prob of sequence tttp when four letters picked without replacement from ttttttptttttp. 3/26 Calculate prob of sequence ixe when three letters picked without replacement from {e: 4, i: 5, x: 3}. 1/22 Two letters picked without replacement from vivvvavasa. Give prob of sequence aa. 1/15 What is prob of sequence lu when two letters picked without replacement from uuulluuu? 3/14 Three letters picked without replacement from {b: 2, d: 2}. Give prob of sequence bdd. 1/6 What is prob of sequence ctc when three letters picked without replacement from {h: 4, c: 7, t: 7}? 49/816 Two letters picked without replacement from wtywtwsysssvtswvyvy. Give prob of sequence vy. 2/57 Calculate prob of sequence uerg when four letters picked without replacement from {e: 2, j: 2, g: 1, r: 1, d: 3, u: 10}. 5/23256 Two letters picked without replacement from {l: 1, h: 6, o: 7, q: 6}. Give prob of sequence qh. 9/95 Three letters picked without replacement from {w: 2, z: 4, g: 2, v: 4, d: 5}. What is prob of sequence zgg? 1/510 Two letters picked without replacement from {k: 9}. What is prob of sequence kk? 1 Two letters picked without replacement from xtooozookztozzo. Give prob of sequence zt. 4/105 What is prob of sequence xvv when three letters picked without replacement from vxjoxomvnvnmxm? 3/364 Two letters picked without replacement from {y: 1, q: 7, d: 3, t: 1, j: 2, c: 3}. Give prob of sequence cj. 3/136 Calculate prob of sequence pnp when three letters picked without replacement from {p: 2, r: 1, n: 1}. 1/12 Four letters picked without replacement from egazge. Give prob of sequence ggza. 1/180 What is prob of sequence ddd when three letters picked without replacement from {d: 9}? 1 Four letters picked without replacement from gwzwwfaawwawg. What is prob of sequence fawa? 3/1430 What is prob of sequence ivb when three letters picked without replacement from {b: 1, q: 3, i: 2, v: 13}? 13/2907 Calculate prob of sequence witx when four letters picked without replacement from xtwtiiiippxwrr. 4/3003 Two letters picked without replacement from lsszsvgvzzk. Give prob of sequence gk. 1/110 What is prob of sequence wm when two letters picked without replacement from fmwow? 1/10 Two letters picked without replacement from dedez. Give prob of sequence ze. 1/10 What is prob of sequence naa when three letters picked without replacement from {n: 1, a: 5, v: 5}? 2/99 Four letters picked without replacement from vvzcttzzvttvcctctot. What is prob of sequence occz? 1/2584 Four letters picked without replacement from mcmfvscscsnv. What is prob of sequence vnvm? 1/2970 Calculate prob of sequence qb when two letters picked without replacement from {p: 1, v: 2, b: 4, q: 1, f: 9}. 1/68 What is prob of sequence dz when two letters picked without replacement from zdpdahaaheedh? 1/52 Calculate prob of sequence pxpx when four letters picked without replacement from xxpxpxxxxxpx. 2/55 Two letters picked without replacement from fgggffffugf. Give prob of sequence fg. 12/55 Two letters picked without replacement from accocacaaaeaoccajccc. What is prob of sequence co? 9/190 What is prob of sequence jj when two letters picked without replacement from bbjbbbbbjjbbbbbbbbj? 2/57 What is prob of sequence xp when two letters picked without replacement from xexxxexxxpxxxxxppx? 13/102 What is prob of sequence mvbs when four letters picked without replacement from {v: 1, y: 1, s: 1, b: 1, r: 1, m: 2}? 1/420 Three letters picked without replacement from jjjjjhjjhjjj. What is prob of sequence jhh? 1/66 Four letters picked without replacement from xhjsshjhshhjxhs. What is prob of sequence ssjh? 3/455 Two letters picked	{ "pile_set_name": "DM Mathematics" }
the second derivative of -ad2y*2 + 2adm*2y + adm*2 - 2ady + 3am*2y + 670ay*2 - 289125d*2m*2y*2 - 2dm2y*2 wrt d. -2ay2 - 578250m*2y*2 Find the second derivative of 32093167i*3 + 5i + 21204869. 192559002i Find the first derivative of k2 + 10767170k - 296791411 wrt k. 2k + 10767170 What is the derivative of 47a*3 - 2a*2 + 594534ad + 239837753d wrt a? 141a2 - 4a + 594534d What is the second derivative of -65018i*2rt + 31i*2r + 26692498ir - 6it + rt wrt i? -130036rt + 62r Find the third derivative of -7a3du + 1230958a*3d - 2a2du - 81843a*2d - 2du + 3u + 2 wrt a. -42du + 7385748d Differentiate -11967639m2r - 2m2 - 14401372m + 6r3 with respect to r. -11967639m*2 + 18r*2 Find the third derivative of 77354626n*3 + 164n*2 + 85n - 967 wrt n. 464127756 What is the third derivative of -28706dl*4 + 2dl3 + 3dl - 5d + 2l4 - l3 + 4l*2 + l + 4309 wrt l? -688944dl + 12d + 48l - 6 What is the second derivative of -775281g*3y*2 - 24g*3y - 4gy*2 - 2gy + 552g - 17y2 + 2y - 60 wrt g? -4651686gy*2 - 144gy What is the second derivative of 2o*3 - 219674400o*2 - 666943874o wrt o? 12o - 439348800 Find the third derivative of -9f*3y*3 - 16f*3y*2 - 2f*3 + 4523f*2y*3 + 4f*2y - 31551 wrt y. -54f3 + 27138f*2 Find the third derivative of -51rw3 - 16rw2 - 133341rw - 40361w*3 - w wrt w. -306r - 242166 What is the first derivative of 11208288fg + 1215g - 1010 wrt f? 11208288g Find the first derivative of -i*3x - 64760i3 + 100486i*2x - 2i2 - 30ix - 3i + 36 wrt x. -i*3 + 100486i*2 - 30i Find the first derivative of 837202b4 - 886453. 3348808b*3 What is the first derivative of -26901j*3oy + 263j*3o - 311j3y + 148j2y + 15jy wrt o? -26901j3y + 263j3 Find the third derivative of -468343273r*4 - 2r*2 - 14856018r wrt r. -11240238552r What is the third derivative of -506855g*4r*2 + 17g*3r*3 + 52g*2r*3 + 4236g*2 + 11r wrt g? -12164520gr*2 + 102r*3 Find the second derivative of -7z*5 + 3z*4 - 2002025z*2 - 134987z - 538. -140z3 + 36z*2 - 4004050 What is the second derivative of -7001p5 + p3 - 166p - 29433? -140020p*3 + 6p What is the derivative of 89622146y - 61616073? 89622146 Find the second derivative of -169227361t*2 - 103764288t. -338454722 What is the second derivative of -3044408n2 - 315619n - 1? -6088816 What is the third derivative of 808182abs3 - abs + 7as3 + as*2 + 2bs3 - bs - 9b - 29774s*2 wrt s? 4849092ab + 42a + 12b Find the first derivative of 58512b*4 - 5931b - 587032123. 234048b3 - 5931 Find the third derivative of -6648237z*5 + 21308952z*2 wrt z. -398894220z*2 Find the second derivative of 46203h*5 + 9h*4 - 6h*3 - 20643805h. 924060h3 + 108h*2 - 36h What is the second derivative of -202195705w5 - 147200140w? -4043914100w3 What is the second derivative of -3cq2y - 13cq*2 - 61cq - 586c - 147q2y + 2qy - 50 wrt q? -6cy - 26c - 294y What is the second derivative of -m*2z*2 - 3996270m*2z - 15m2 - 113888754mz2 + 2z*2 wrt z? -2m*2 - 227777508m + 4 Find the first derivative of -76841096d3 - 328867378 wrt d. -230523288d*2 What is the derivative of -17110178x + 24681939? -17110178 Find the first derivative of 997052o3 - 11o*2 + 33322359. 2991156o*2 - 22o Find the first derivative of 100864807v3 + 110988768 wrt v. 302594421v*2 What is the second derivative of 17254u*5 + 1897u*3 + 55237026u wrt u? 345080u3 + 11382u What is the second derivative of -g*2i*2 - 1121119g*2 - 1006gi2 + 4gi - 2g + 3i2 + 9 wrt g? -2i*2 - 2242238 Find the second derivative of -33795591b*2 + 999379b - 6. -67591182 What is the first derivative of -24229r3 - 2243r + 33994956? -72687r2 - 2243 What is the second derivative of -209063d*3k*2 + 10d*2k*2 - 1732568dk2 - 3d wrt d? -1254378dk*2 + 20k*2 Find the first derivative of -192l*2v + 6440571l2 + 47385lv4 - 3l wrt v. -192l2 + 189540lv3 Find the third derivative of 2i*5 - 1565225i*3 + 13480667i*2 + 2 wrt i. 120i*2 - 9391350 What is the third derivative of 38589214h*4 - 6h3 + h2 + 195874586? 926141136h - 36 Find the second derivative of 5v*5 + 2v*3 + 82599v*2 - 9947575v wrt v. 100v3 + 12v + 165198 What is the first derivative of 2689n3 - n2 + 643n + 6306152 wrt n? 8067n2 - 2n + 643 Find the second derivative of -22644993z3 + 7604998z - 2. -135869958z Find the first derivative of -3a*2yz - 3269037a*2 + ayz + 23yz - 326y - 2z + 22 wrt a. -6ayz - 6538074a + yz What is the second derivative of -21822u3 + 12653u*2 - 26u - 371728 wrt u? -130932u + 25306 Find the third derivative of -5t*3vy2 + 6924t*3v - 2t2vy2 - 2t*2y - tv - 189ty2 - ty - 95vy wrt t. -30vy*2 + 41544v Find the first derivative of 14c4 - 948335cp2 - 15085474p*2 wrt c. 56c*3 - 948335p*2 Find the second derivative of -6178634u*2 - 2u + 9490132. -12357268 Find the second derivative of 229674993n5 - 7464569n - 2. 4593499860n3 What is the second derivative of 51162427w*5 - 108004120w? 1023248540w3 What is the third derivative of 18034q6 + q5 - 4q4 - q2 + 1311294q? 2164080q3 + 60q*2 - 96q What is the second derivative of o*3s*4 + 2o*3s - 5o2s - 2810697os*5 + 393388o wrt s? 12o3s*2 - 56213940os3 What is the derivative of -1854151k + 9960620? -1854151 What is the second derivative of -455178449aq*4 - 45953aq - 602q wrt q? -5462141388aq*2 Find the second derivative of -3k*4 - 15979k*3 - 68k*2 + 63841603k - 2 wrt k. -36k2 - 95874k - 136 What is the second derivative of -346q4 + 11867q*2 + 14600q + 292? -4152q2 + 23734 Differentiate 11h*3 + 583h*2 - 264h - 56747918. 33h2 + 1166h - 264 Find the second derivative of 41h3z*2 - 15h*3z + 16h2z2 + h2z + 20h*2 + 3467hz2 - z2 + 400z + 33 wrt z. 82h3 + 32h*2 + 6934h - 2 Find the second derivative of -9348621u4 - 32361686u wrt u. -112183452u2 Differentiate 90352180g*4v - 470305v - 121 wrt g. 361408720g*3v Find the second derivative of 85673231b2 + 1536839b + 10. 171346462 What is the second derivative of d*3n*2 - 11d*3 - 2609d*2n*2 - 781086d*2n - 1255dn*2 + dn wrt n? 2d3 - 5218d*2 - 2510d What is the second derivative of -51v3y*4 - 16v*3y - v*2y + 2102v2 + 3vy - 107411y*5 + 6y wrt y? -612v3y*2 - 2148220y*3 Differentiate -535753109u*2 + 505381779. -1071506218u What is the first derivative of 172109568wy*2 + 153723911y*2 wrt w? 172109568y*2 Find the second derivative of -47000012z*2 - 75131163z wrt z. -94000024 Differentiate 24795837ot + 3369762o - 2 wrt t. 24795837o Differentiate 2abd - 283abg - 2ad + 15ag - 389a - 228bdg - 22bd - b + 2d - 13 wrt g. -283ab + 15a - 228bd Find the second derivative of 18444500d2p*2 + 2d*2p - 5dp*2 - 29dp + 40d - 2p2 + 577 wrt d. 36889000p*2 + 4p Find the first derivative of 265r3 + 135550r + 905758606. 795r2 + 135550 Find the second derivative of -2330l*2m*2 - 3l*2m - 40l2 - 5lm2 + 18lm - 11l + 71m2 + 16m - 4 wrt m. -4660l2 - 10l + 142 What is the derivative of 14732c3j + 33c3t - 540c + 181jt + 206t wrt j? 14732c3 + 181t What is the first derivative of -847bn - 192256279b - 2724n*3 wrt n? -847b - 8172n2 Differentiate 10735800k + 45844. 10735800 Find the third derivative of 2873s5 + 2771s*3 + 19s*2 + 962s + 629 wrt s. 172380s2 + 16626 What is the first derivative of -494985o*2 - 21o - 2741511? -989970o - 21 Find the third derivative of 6o*6 - 325184o*5 - 26094980o*2 + 1. 720o*3 - 19511040o*2 Find the third derivative of -212570bh3 - 2bh2 - 45bh + h6 - 3h*4 - 2018h*2 wrt h. -1275420b + 120h3 - 72h What is the first derivative of 20103552d + 6956608? 20103552 Find the first derivative of -175264362h + 240	{ "pile_set_name": "DM Mathematics" }
e. p(91/8) Simplify (a8/a4)12 assuming a is positive. a48 Simplify (q/q(-13))22 assuming q is positive. q308 Simplify (w(-6))(1/35) assuming w is positive. w*(-6/35) Simplify (((nn/(nn(-2/3))n)/n)/(((nn(-3/8)nn)/nn)/n))36 assuming n is positive. n(3/2) Simplify (h(-2/63)/h(-21))(9/7) assuming h is positive. h(1321/49) Simplify (a(2/5)/a6)/(a/a*(2/13)(aa7)/aa) assuming a is positive. a(-939/65) Simplify o3o(o*(-5)o)/o(o0/o)(-6) assuming o is positive. o5 Simplify ((hhh(7/5)/h)/hh)/hh/(h/(((((h/h21)/h)/h)/h)/hh)) assuming h is positive. h*(-108/5) Simplify (c(((c/(ccc((c(-15)/c)/c)/c))/c)/c)/c)/c14 assuming c is positive. 1 Simplify (o28o)/(oo(-37)) assuming o is positive. o65 Simplify (p(-17)(p/(p/(p/(p/p(-7/5)))))/p)(-4/19) assuming p is positive. p(388/95) Simplify (s/s1)*26s*(2/15)s*(-2/9)s assuming s is positive. s(41/45) Simplify (f(1/10)/f)(-19) assuming f is positive. f(171/10) Simplify (a/a*(-5/3)a)/(a(-4/3)/a) assuming a is positive. a6 Simplify ((c((c(-2)c)/c)/cc)(35/3))(-28) assuming c is positive. c(980/3) Simplify (z(3/2))(-43) assuming z is positive. z(-129/2) Simplify (h(-6/11)hh)/hhh(1/15) assuming h is positive. h(251/165) Simplify ((s10/s)(3/8))(2/35) assuming s is positive. s(27/140) Simplify (x/(x(1/4)x)x)/(x/x18) assuming x is positive. x(71/4) Simplify ((i/((ii(ii*(-8/5))/iii)/ii)i)/i(-2/25))35 assuming i is positive. i(-56/5) Simplify (l(2/3)/l)35/(l(1/4)l)(-3/20) assuming l is positive. l(-551/48) Simplify a(-22)/a(5/12) assuming a is positive. a(-269/12) Simplify b(1/42)b(-3/13) assuming b is positive. b(-113/546) Simplify ((z/(z(-25)/z))/z)/(zz*(1/6)z) assuming z is positive. z*(143/6) Simplify ((nn/(n*(-3/11)n))/n)(-41) assuming n is positive. n(-123/11) Simplify g*(-4/7)gg(-1/15)g(g1/g)/(g(2/29)g) assuming g is positive. g*(892/3045) Simplify (q(((qq/q(-1/4)q)/q)/q)/q)*24/((qq*(1/10))/qq(-6)) assuming q is positive. q(359/10) Simplify (r/(rr(-11/6)rr))/(r/(r/r2)) assuming r is positive. r(-13/6) Simplify (m0)(-33/2)(m(-1/8)/m)/m(-1/7) assuming m is positive. m(-55/56) Simplify (((x/(x/x(-4/9))x)/x)/x)(-5) assuming x is positive. x(65/9) Simplify (v(-19))49 assuming v is positive. v(-931) Simplify ((rr/((r(rr*(10/7))/r)/rr)r)/r)(-15) assuming r is positive. r(45/7) Simplify (g11/g)9 assuming g is positive. g90 Simplify (t(-9/8)/t)/((tt18)/t) assuming t is positive. t(-161/8) Simplify (ppp(-8/3))/p(-26) assuming p is positive. p(76/3) Simplify (u(-2/31)u(-10))(4/9) assuming u is positive. u(-416/93) Simplify (q/q(2/5)q)32 assuming q is positive. q(256/5) Simplify (l(-3/2)/((l(5/4)/l)/ll))/(l(-8)/(l(-2/17)l)) assuming l is positive. l*(485/68) Simplify ((tttt*(-4))/(ttt(-1/2)))/(t(-1/3)t)(1/2) assuming t is positive. t(-17/6) Simplify ((v/(v*(2/7)/vv))50)(-4/3) assuming v is positive. v(-1000/21) Simplify ((x9xx)/xx(2/51))(-22) assuming x is positive. x(-11264/51) Simplify (n7/(nn(-13)))3 assuming n is positive. n*57 Simplify ((qqq/q(-2/5)qqqq)/(q/q(2/27)))(-11/6) assuming q is positive. q(-4807/405) Simplify (f(-14)f)/(f/(f/f(8/3))) assuming f is positive. f(-47/3) Simplify ((a(-1/2))(-15/8))(2/5) assuming a is positive. a(3/8) Simplify x*(2/35)/xx(-31) assuming x is positive. x(-1118/35) Simplify ((zzz/(zz(zz/((z(2/3)zz)/zz))/z)z)(3/4))(-8/9) assuming z is positive. z(-22/9) Simplify ((((k/((k/((k/(k0/kk))/kk)kk)/kk))/kk)/k)(3/7))(-40) assuming k is positive. k(240/7) Simplify (s/(s9/s))/ss16 assuming s is positive. s8 Simplify (o*7/o)/(ooo(-4/9)/o) assuming o is positive. o(49/9) Simplify (a0/a)(-25)/(a(1/10)a(-1)) assuming a is positive. a(259/10) Simplify (z(-6/17))(-7/2) assuming z is positive. z(21/17) Simplify ((k/k13)/k)(1/9) assuming k is positive. k(-13/9) Simplify ss/s(2/9)s*(-3)s/(s/(ss(-3)))ss(s*(-1)s)/ss assuming s is positive. s(-11/9) Simplify ((r/(rr*(-1/7)/rr))/(r/(r/(r/r(3/4)))))(-1/29) assuming r is positive. r*(3/812) Simplify ss*(-4)ss6s*(-4)/(ss*(-1)) assuming s is positive. 1 Simplify (q(q/(qqq*30/q))/qq)/q8 assuming q is positive. q(-37) Simplify p*(-2/17)/(p(p/(p/p(-6/13)))/p) assuming p is positive. p(76/221) Simplify uu(-3/25)uu(-17)u assuming u is positive. u(-353/25) Simplify (f6(ff/(f/(f/(f*(-1/4)f))f))/f)/((f(5/3)/ff)/f(-1/8)) assuming f is positive. f(83/24) Simplify (i(-1/5)/i)(-2/147) assuming i is positive. i(4/245) Simplify (j(-2/31)j(-12/11)/j)(-36) assuming j is positive. j(26460/341) Simplify (((qq*2)/q)/qqq/q(2/11)q)(-24) assuming q is positive. q(-1008/11) Simplify (fff1)(-1/18)/(ff0f)(2/15) assuming f is positive. f(-13/30) Simplify (((vv(-2))/v)/v(2/3))/(v(2/5)(v/((v/v*(-2/23))/v))/vv) assuming v is positive. v(-1373/345) Simplify (w(-1/4))*(-38)w(3/2)/(w/(w/(w/((w(-2/21)w)/ww)))) assuming w is positive. w(229/21) Simplify (y/(y/(y8/y)))36 assuming y is positive. y252 Simplify (o*1/oo*(-2/13))/((o/(o(o/(o*7/oo))/oo)o)/(o/((o/o*3)/oo))) assuming o is positive. o*(-54/13) Simplify (tt(-7/9))/(t/((t30t)/t)) assuming t is positive. t(263/9) Simplify ((a0)(4/9))(1/70) assuming a is positive. 1 Simplify (k/(k(2/9)/k)kk(-1/3)kk)(9/5) assuming k is positive. k8 Simplify (m(1/4))20 assuming m is positive. m5 Simplify ((x0/x)(-2/139))(-37) assuming x is positive. x(-74/139) Simplify (q(-2/7)q2/q)/((q/q3)/(q/(q*2q))) assuming q is positive. q(5/7) Simplify a/a(-2/5)aa*(-8)aa/(((aa*(-5))/a)/a)aa/a0 assuming a is positive. a(22/5) Simplify (dd(-1/2))24 assuming d is positive. d*12 Simplify (zz(-2/5))(-33) assuming z is positive. z(-99/5) Simplify s(-21)s(2/19) assuming s is positive. s(-397/19) Simplify (z/(z4z))/((z/(zz(2/7)))/z)z5/z5 assuming z is positive. z(-19/7) Simplify ((c/(c/c9))/(c*(1/4)c))(44/3) assuming c is positive. c(341/3) Simplify m*7/(m/(m/(m/((mm/((m/(mm(-6/11)mm))/m)m)/m)m))) assuming m is positive. m(104/11) Simplify ((f(2/13)f)/(f/(f(f(1/4)/f)/ff)))/(ff(1/10)f/(fff/f*(-3/8))f) assuming f is positive. f(353/520) Simplify x(9/5)/(x/(x(xx/(x*7x))/x)) assuming x is positive. x*(-26/5) Simplify ((y/(yy(2/5)))38)(27/4) assuming y is positive. y(-513/5) Simplify ((uu/((uu*(-1/5)u)/u))/u(-2/3))/(u/u(-2/7)uu*(-2/13)u) assuming u is positive. u*(-1727/1365) Simplify ((a(aaa*30aa)/a)/a)/a30 assuming a is positive. a3 Simplify o(-4)/o9 assuming o is positive. o(-13) Simplify c4c*(-2/19)((c(-2)/c)/c)(-6/11) assuming c is positive. c(1270/209) Simplify (q(-9)qq8/q)/((q/q(3/4))/(q/(q/(q/(q(-4/7)/q))))) assuming q is positive. q(37/28) Simplify (j/((jjjj/j6jjj)/j))/(jj5/j) assuming j is positive. j(-4) Simplify (xx*5x)/(x/x*(-6))xx1x*(-1)x assuming x is positive. x2 Simplify (q1)*(-4/5)/((qq*1q)/qq)(-13) assuming q is positive. q(191/5) Simplify q(-7)/qq(1/13) assuming q is positive. q(-103/13) Simplify d/(d/d*(-32))dd(-1/25) assuming d is positive. d(-776/25) Simplify x/x(-13/3)xx(1/20)/xx assuming x is positive. x(383/60) Simplify (f/(f5f)f)25 assuming f is positive. f(-100) Simplify (f/(f/f*(2/33))f)/(f/(ff(-2/59))) assuming f is positive. f(1999/1947) Simplify ((x/(x/(x(-5/2)xx)x))/x*(2/3))/((xx(2/3))/(x5x)) assuming x is positive. x(13/6) Simplify ((cc/(c/(c/(ccc(1/3)))))(-2/21))23 assuming c is positive. c(46/63) Simplify ((((kk6/k)/kk)/k)/(k(6/5)/k))(-1/31) assuming k is positive. k(-24/155) Simplify (p2)*(-42)p*(-4)p(p/(p/(pp/(p*(-4)/p))))/pp assuming p is positive. p*(-80) Simplify (ccc7c(-3/7)/c)/((c(-4)/c)/(c(c*(-	{ "pile_set_name": "DM Mathematics" }
+ 210m2 Expand -x + 0x + 2x + (-1 - 2 + 2)(-2 + 2 - x) + 4x + 2x - 26x + 3x - 2x + 0x + (-1 - 3 + 2)(-x + 6x - 3x) - 2x + 3x + x. -19x Expand (5 - 4h + 5h + 7)(-74 - 24 + 20)(4 + 6 - 4). -468h - 5616 Expand -8l*2 - 22l*3 + 20l*3 + 73l*2 + (-5l*2 + 3 - 3)(37l - 17l - 14l). -32l*3 + 65l*2 Expand (-845p + 3 - 788p + 1530p)(7 - 2 + 4). -927p + 27 Expand (-2 + 3 - 2)(-2q - 6q + 3q) + (q - q - 4q)(-1 + 0 - 2) + q - q - 2q + (-q - 3 + 3)(3 - 1 + 5). 8q Expand (d2 - 1 + 1)(1 + 1 - 3) - 716d - 754d + 1470d - 8256d*2. -8257d*2 Expand (-s + 5 - 5)(51s - 63s - 231s)(7 - 4 + 0). 729s2 Expand (4060g*2 - 4057g*2 + 229 - 557)(-g - 2g + 2g). -3g3 + 328g Expand (-3 + 5 - 3)(-141 - 20 - 216)(3r + 2r - 2r). 1131r Expand -9b3 + 114b*3 - 20b*3 + (-4b*3 + 2b*3 + 0b*3)(7 - 2 - 2) + b*3 + 2b3 - b3. 81b3 Expand (-5 + 5 - 2i + 0 + 0 - 2i + 3i + 0i - 5i + (1 - 4 + 1)(0i - 5i + 3i) - i + 3i + 0i - 31 + 31 + 64i)(0 + i + 0)(3i - 3 + 3). 192i3 Expand (-16i - 9i - 12i)(4 - 1 + i - 4)(-3 - 6 + 1). 296i2 - 296i Expand (2l2 - 3l*2 + 2l*2)(-l*2 - 4l + 4l) - 4l4 + l4 + 5l4 + (6l - l - 3l)(38l3 + 253l*3 - 70l*3). 443l*4 Expand (-1 + 1 + 1)(-177 + 177 + 8q) + 0q - q + 2q + (-1 - q + 1)(3 + 2 + 0) + 18q - 2q - q. 19q Expand -12v - 50v2 + 12v + (89 + 57v - 89)(-2v + 0v + v). -107v2 Expand (-5 - 3 + 6)(3t2 - 4t*2 + 3t*2) + (2t + 4t - 5t)(3 + 0 - 1)(-1 - 5 + 1)(222t + 27t - 41t). -2084t2 Expand (12 - 3a - 12)(-779a + 11 - 114 + 776a). 9a*2 + 309a Expand (4 + 1 - 4)(30 - 81 - 82)(313m - 293m - 209m). 25137m Expand (-2 - 2a + 2)(42095a3 + 5a*2 + 28455a*3 - 2a*2 - 3a*2). -141100a*4 Expand (3s + 1 - 1)(-128s*2 + 54s*2 + 230s2 - 2 + 2 - s2 + (0s + 3s - s)(2s - 5s + 4s)). 471s3 Expand (0 + 2 - 1)(0 + 82 + 276)(y2 - y2 - 5y*2). -1790y*2 Expand 5r - 2r + 4r + (1 + 3 - 1)(-r - 2r + 2r) + 13r - 7r + 3r. 13r Expand (30s - 30s - 39s*2)(14 + 26 + 3) + (-s - 3 + 3)(3s - 3s + s). -1678s*2 Expand (10570n + 23580n + 20583n - 10854n)(0n - 2n + 0n). -87758n*2 Expand (-4d + 4d + 3d*4 + (d + 0d - 4d)(-4d + 4d - d*3))(12 - 15 - 13)(-6d - d - d). 768d5 Expand (6 - 5 + 21o*2 - 8o*2)(74o2 - 19o*2 + 2o*2). 741o*4 + 57o*2 Expand (p + 0p + 0p)(-p2 + p2 - 2p2) + (-15p*3 + 7p*3 + 4p*3)(-4 + 3 - 1) + 320p2 - 320p*2 - 41p*3. -35p*3 Expand (1 + 0 + 1)(1 - 2 + 0 + (1 - 3 + 4)(-3 + 6 - 5))(10 - 12 + 66)(30j*2 + 21j*2 - 12j*2). -24960j*2 Expand (-x + 0 + 0)(2x + 0 + 0)(8 + 2 + 2 + (-3 + 3 - 1)(5 + 54 - 30) + (-7 + 2 + 3)(0 - 1 + 0) - 3 + 1 + 0). 34x2 Expand (-b + 1 - 1)(-3 + 3 - 2b) + (2142b - 3081b - 23715b + 205b)(1 - 2 - 1 - 2b). 48900b*2 + 48898b Expand (18912285 - 16997o - 18912285)(-2o2 - 3o*3 + 2o*2 + (1 - 2 + 3)(-2o3 - 3o*3 + 4o*3)). 84985o*4 Expand (-4s*3 + 10s*2 - 10s*2)(-s*2 + 4s*2 + 0s2) - s3 - 7s5 + s3 + (-2s*4 - 4s*4 + 0s*4)(s - s + 2s). -31s*5 Expand w - 2 + w + 1 - w - 4w - 4w + (1 - 2 - 2)(-9w + 2w - 7w). 35w - 1 Expand (6q - 2q - 2q)(70 - 146 + 86) + 177q + 135q - 77q. 255q Expand k*2 - 29k - 2k3 + 63k - 69k - 11k*2 - 2k - 2k3 + 11k2 + (-k2 + 0k2 - k2)(-1 + 1 + 2k) - k3 - 2k3 + k3. -10k3 + k2 - 37k Expand (-1 - 3 + 7 + 14617y - 14202y)(-2y - 5y + 8y). 415y2 + 3y Expand (3 + 1 - 5)(-2d*2 + 3d*2 - 5d*2)(-239d2 + 3478d*2 - 1321 + 1322). 12956d*4 + 4d*2 Expand 65b*3 - 65b*3 + 54b*4 + (2b*4 + 2b*2 - 2b*2)(-6 - 1 - 5) + 3b4 - 4b*4 + 3b*4. 32b*4 Expand (-6 - 2 + 7)(0q + 3q - 2q)(q - 156q2 - 460 + 460) + 4q*3 + 20q*2 - 20q*2. 160q3 - q2 Expand (-26x - 799x - 185x)(-2x3 + 4x*4 + 0x*3 - 3x*4). -1010x*5 + 2020x4 Expand -n5 + 3n5 - 3n*5 + (-3n*2 + 3n*2 - 3n*4)(-6n + 4n + 6n) + (-3 + n2 + 3)(-3n3 - 4n*3 - 3n*3). -23n*5 Expand (2m*2 + 6m*2 + 2m*2)(-28 + 5m + 28) + 3m*3 - 2m*3 + 3m*3. 54m*3 Expand (-3 - 1 + 2)(-2t - 4t + 4t)(-t2 - t2 + 5t2) + (4t*2 - 5t*2 + 2t*2)(0t - 2t + 0t). 10t*3 Expand 2t*3 - 4t + 4t + (-3t - 2t + 3t)(-2t*2 + 2t*2 + 2t*2) - 3607t*2 + 3607t*2 + 74t*3. 72t*3 Expand -s - 2s + 2s - 4 + 4 - 2s + 6s + 11s + 6s - 3s + s + s - 1 - 5s + 1 + (2 + 3 - 4)(-2s - 3 + 3) - 3s - 2s + 3s + 0s + 2s + 0s + s + 1 - 1. 13s Expand ((-5 + 1 + 3)(-4 + 2b + 4) + 1 - 1 + b + 108b + 70b - 39b)(2b2 - 2b2 - b2)(5b - 3b - 4b). 276b4 Expand (170m*4 - 84m*4 + 224m*4)(2m - 4m + 5m) + 0 + 2m*5 + 0. 932m*5 Expand -9m + 12m - 9m + (50m - 8m + 43m - 16m)(-5 - 1 + 5). -75m Expand (-q + 0q - q + (16 - 27 + 36)(2q - 1 + 1))(2 - 3 - 1)(77q*2 - 77q*2 + 27q*3 - 1)(-3 + 3 + 2q). -5184q*5 + 192q*2 Expand (766w - 5895 + 5895)(-w3 + 4w*3 - 4w*3). -766w*4 Expand (-114 + 37 + 45)(-3 - 2 + 4)(24 - 24 + 3n). 96n Expand (-37118168 + 37118168 - p - 2805p*2)(3p - 2p + p). -5610p3 - 2p*2 Expand (22d - 27d - 36d)(5 - 4 - 31 + (4 - 1 - 5)(-4 + 4 + 1))((-2d + 3 - 3)(-2d - 2 + 2) + 2d2 - 3d + 3d + 4d*2 - 2d2 - d2). 9184d3 Expand -5o*2 + 5o*2 - 10o*5 + (-5o*3 + 2o*3 + 7o*3)(-2o2 + 10o*2 + 0o2 - o2 - 2o2 + o2 + (2o*2 - o + o)(3 - 2 + 1)). 30o5 Expand -7 + 1967o - 3954o + 1973o + (4 - 6 + 4)(o + 0 + 0). -12o - 7 Expand (9m2 - 6m*2 - 5m*2 + (2m - 4m - m)(-5 + 5 + 8m))(-9m3 - 4 + 2 + 4). 234m*5 - 52m*2 Expand 382u + 1486 - 1486 + (u + 1 - 1 + (3u - 3u - u)(2 + 3 - 7) - u + 0u + 2u)(-1 + 3 + 0). 390u Expand (-n2 + 3n*2 + 0n*2)((-5n3 + 0n*3 + 4n*3)(-48 - 91 + 38) - n*3 + 2n*3 - 3n*3). 198n*5 Expand (-2 + 1 + 0)(4x + 0x - 3x)(70 + 8x - 7x*3 + 1019674x*2 - 1019674x*2). 7x*4 - 8x*2 - 70x Expand (4 - 5 + 0)(1229d - 807d + 1418d). -1840d Expand (-3v - 3v3 + 3v)(2973 - 5677 + 1786). 2754v*3 Expand -2 + q + 2 - 15q - 41 + 41 + (-3 + 2 + 3)(0q - 10q + 2q) + (-5q + 3q + 0q)(1 - 2 + 3). -34q Expand (-504 - 134 + 116)(1791k - 1791k + 75k3)(k - 2k + 0k). 39150k4 Expand (-13r*2 + 10r*2 + 24r*2)(71 - 23 + 31)(-3r + 3r + 3r). 4977r3 Expand (2f*4 + 0f*4 - 3f*4)(3f + 5 - 4 - f) + (0 + 0 + f)(-f4 - f2 + f*2) - 66f*2 + 66f*2 + 24f*5. 21f5 - f4 Expand (-3 + 7 + 0)(1792 - 4h - 4032 + 1737). -16h - 2012 Expand (-449z*3 + 1302z - 1302z)(29 - 5 - 5). -8531z3 Expand (0 + 0 - 2l)(-l + 4 - 4) + (299 + 55 - 116)(-9l + 9l - 5l2). -1188l*2 Expand (-50 + 9 - 30)(32f2 + 53f2 + f2). -6106f2 Expand (0y*4 + 5y*4 - 4y*4)(0y - y + 0y) + 3y5 - y5 - 4y*5 + (-5145 - 4330 - 237)(0y5 - 4y*5 + 2y*5). 19421y*5 Expand (0b - 2b + 0b + (-b - 1 + 1)(-6 + 2 - 1))(127b - 229b + 991b + 548b). 4311b2 Expand (-477 + 477 - 36f)(-3 + 15 + 9). -756f Expand -3 + 3 + 2a + (-a - 3 + 3)(-3 + 2 + 0) + 3a - 3a - a - 4a - 6 + 6 + (2 - 5 + 2)(-457a - 479a + 394a). 540a Expand 687 + 60j4 - 687 + (-5 + 5 - 6j*2)(2j2 + 2j2 - j2). 42j4 Expand -16 + i2 + 14 - i4 + 15i*4 + (-100i*3 - 26 - 93i*3 + 196i*3)(-2i - i + i). 8i4 + i2 + 52i - 2 Expand (-3102a*2 + 62a*3 + 3102a*2)((2 + 0 - 4)(-a - a - a) + 1 - 3a + a - 2). 248a4 - 62a*3 Expand (-2x + x - 4x)(432x - 71x*2 - 432x)(0 - 1 - 2). -1065x*3 Expand (-71r - 8 - 76r + 134r)(3r*2 + 4r - 4r) + r - r - r3 + (-2 + 3 + 1)(-2r - r3 + 2r). -42r3 - 24r*2 Expand (-5q - 2q + 6q + 2q + q - 2q + (4 - 2 + 0)(4q + 0q - 5q))(-1 + 473q*4 + 1 + 12439q*4). -25824q*5 Expand 26a - 47a - 109a + (a - 1 + 1)(4 - 2 - 3) + 6a + 2a + 0a. -123a Expand -5j*2 + 3j*2 + 4j*2 + 2j*2 + 1 - 1 + 9j + 4j2 - 9j + (3 - 2j2 - 3)(-3 + 3 + 1) - 12852j + 90j*2 + 12852j. 96j2 Expand 2o*2 + 5o*3 - 2o*3 - 2o*3 + (o - o + 2o)(-22o + 48 - 48)*(2200 -	{ "pile_set_name": "DM Mathematics" }
is the z'th term of 5089, 10168, 15245, 20326, 25417, 30524? z*3 - 7z*2 + 5093z + 2 What is the m'th term of -323, -886, -1795, -3050? -173m2 - 44m - 106 What is the q'th term of -81, -135, -219, -327, -453, -591, -735? q*3 - 21q*2 + 2q - 63 What is the s'th term of -277, -502, -853, -1330? -63s2 - 36s - 178 What is the s'th term of -300, -561, -820, -1077, -1332? s*2 - 264s - 37 What is the b'th term of -75180, -150360, -225540, -300720, -375900, -451080? -75180b What is the j'th term of 113, 0, -295, -862, -1791, -3172, -5095, -7650? -15j3 - j2 - 5j + 134 What is the r'th term of 83, 179, 301, 449, 623, 823? 13r*2 + 57r + 13 What is the x'th term of 5566, 5584, 5614, 5656, 5710, 5776? 6x2 + 5560 What is the o'th term of -2806, -11122, -24984, -44392? -2773o*2 + 3o - 36 What is the f'th term of -175, -953, -3063, -7171, -13943, -24045? -111f3 - f - 63 What is the m'th term of 6105535, 12211072, 18316609, 24422146, 30527683, 36633220? 6105537m - 2 What is the v'th term of 235592, 235594, 235596, 235598, 235600, 235602? 2v + 235590 What is the v'th term of -34219, -68440, -102661, -136882? -34221v + 2 What is the t'th term of 23673, 94719, 213137, 378933, 592113, 852683, 1160649? t*3 + 23680t*2 - t - 7 What is the l'th term of -3869, -3830, -3791, -3752, -3713? 39l - 3908 What is the a'th term of 78, 304, 530, 756, 982? 226a - 148 What is the t'th term of 815, 6597, 22319, 52961, 103503? 830t*3 - 10t*2 + 2t - 7 What is the l'th term of 88257, 176512, 264767, 353022? 88255l + 2 What is the d'th term of 51002, 50937, 50870, 50801, 50730? -d2 - 62d + 51065 What is the i'th term of 428, 810, 1142, 1418, 1632, 1778, 1850, 1842? -i*3 - 19i*2 + 446i + 2 What is the z'th term of -2432, -9724, -21866, -38852, -60676? z*3 - 2431z*2 - 6z + 4 What is the a'th term of -134, -407, -862, -1499, -2318, -3319? -91a2 - 43 What is the y'th term of 2460, 4926, 7406, 9906, 12432, 14990? y3 + y2 + 2456y + 2 What is the s'th term of 1234, 4874, 10924, 19384, 30254, 43534, 59224? 1205s2 + 25s + 4 What is the t'th term of -25766, -51531, -77300, -103073? -2t2 - 25759t - 5 What is the w'th term of -6434, -6429, -6424, -6419, -6414? 5w - 6439 What is the p'th term of -45994, -45991, -45988, -45985? 3p - 45997 What is the s'th term of -480, -462, -444, -426, -408, -390? 18s - 498 What is the g'th term of -6944, -27793, -62542, -111191? -6950g*2 + g + 5 What is the j'th term of -188036, -376073, -564110, -752147, -940184, -1128221? -188037j + 1 What is the d'th term of -683, -1256, -1829? -573d - 110 What is the c'th term of 3239, 6460, 9691, 12938, 16207, 19504? c3 - c2 + 3217c + 22 What is the a'th term of -28911, -28907, -28903, -28899? 4a - 28915 What is the d'th term of -56118, -56119, -56122, -56127, -56134? -d2 + 2d - 56119 What is the d'th term of -11, 67, 191, 349, 529, 719, 907, 1081? -2d3 + 35d*2 - 13d - 31 What is the x'th term of -25043, -50095, -75157, -100235, -125335? -x3 + x2 - 25048x + 5 What is the x'th term of -4431, -4416, -4403, -4392? -x2 + 18x - 4448 What is the f'th term of 827, 918, 1009, 1100, 1191? 91f + 736 What is the d'th term of 4850, 9672, 14494, 19316, 24138? 4822d + 28 What is the a'th term of 203, 937, 2147, 3821, 5947? -2a3 + 250a*2 - 2a - 43 What is the z'th term of 199, 311, 313, 151, -229? -9z3 - z2 + 178z + 31 What is the j'th term of -428, -1508, -3244, -5624, -8636, -12268, -16508, -21344? 2j3 - 340j*2 - 74j - 16 What is the l'th term of 1199, 4573, 10187, 18035, 28111, 40409, 54923? -l*3 + 1126l*2 + 3l + 71 What is the b'th term of -902517, -902516, -902515, -902514? b - 902518 What is the p'th term of 410821, 410823, 410825? 2p + 410819 What is the g'th term of 318, 1301, 2938, 5223, 8150, 11713, 15906, 20723? -g3 + 333g*2 - 9g - 5 What is the p'th term of -110, -937, -3252, -7823, -15418, -26805, -42752? -128p3 + 24p*2 - 3p - 3 What is the x'th term of -77373, -77370, -77363, -77352, -77337? 2x2 - 3x - 77372 What is the y'th term of 131, 154, 185, 218, 247, 266? -y*3 + 10y*2 + 122 What is the r'th term of -13295, -26582, -39869? -13287r - 8 What is the b'th term of 91, 212, 357, 538, 767, 1056? 2b3 + 107b - 18 What is the y'th term of -121, -573, -1697, -3829, -7305? -56y3 - 60y - 5 What is the x'th term of -119, 18, 243, 556? 44x2 + 5x - 168 What is the y'th term of -724841, -724860, -724891, -724934? -6y2 - y - 724834 What is the m'th term of -158053, -316111, -474169, -632227, -790285, -948343? -158058m + 5 What is the z'th term of 224224, 448451, 672678, 896905, 1121132, 1345359? 224227z - 3 What is the s'th term of 1790, 1818, 1870, 1958, 2094, 2290? 2s*3 + 14s + 1774 What is the d'th term of 677, 737, 835, 971, 1145? 19d2 + 3d + 655 What is the q'th term of 364, 1527, 3464, 6175, 9660, 13919? 387q2 + 2q - 25 What is the c'th term of 39103, 78207, 117309, 156409, 195507? -c*2 + 39107c - 3 What is the x'th term of -483, -930, -1377, -1824, -2271, -2718? -447x - 36 What is the q'th term of -1358, -1313, -1268? 45q - 1403 What is the u'th term of -69, -111, -147, -171, -177? u*3 - 3u*2 - 40u - 27 What is the w'th term of 390, 2806, 9278, 21834, 42502? 338w3 + 50w + 2 What is the r'th term of -1130, -1378, -1630, -1886, -2146? -2r2 - 242r - 886 What is the h'th term of 95508, 764050, 2578666, 6112392, 11938264, 20629318, 32758590, 48899116? 95506h3 + h2 - 3h + 4 What is the n'th term of -109739, -109744, -109751, -109760? -n*2 - 2n - 109736 What is the l'th term of -154, 150, 656, 1364? 101l2 + l - 256 What is the v'th term of -142, -277, -412? -135v - 7 What is the c'th term of -188636, -377266, -565890, -754508, -943120? 3c2 - 188639c What is the m'th term of -159, -223, -287? -64m - 95 What is the l'th term of 4043, 16167, 36373, 64661? 4041l2 + l + 1 What is the z'th term of 6372, 12781, 19202, 25641, 32104? z3 + 6402z - 31 What is the m'th term of -46463, -92863, -139263, -185663, -232063? -46400m - 63 What is the b'th term of 1110, 1131, 1152, 1173? 21b + 1089 What is the f'th term of 465, 459, 453, 447, 441? -6f + 471 What is the x'th term of 502, 835, 1168, 1501? 333x + 169 What is the m'th term of -814, -824, -834, -844, -854? -10m - 804 What is the k'th term of 1774, 1710, 1646? -64k + 1838 What is the w'th term of -1730, -3545, -5360, -7175, -8990? -1815w + 85 What is the g'th term of 4, 678, 1810, 3406, 5472, 8014, 11038, 14550? g*3 + 223g*2 - 2g - 218 What is the w'th term of -1715, -6879, -15487, -27539? -1722w2 + 2w + 5 What is the a'th term of -73, -165, -259, -355, -453? -a*2 - 89a + 17 What is the x'th term of 141716, 141714, 141712, 141710, 141708, 141706? -2x + 141718 What is the n'th term of 114, 582, 1424, 2646, 4254, 6254? n3 + 181n*2 - 82n + 14 What is the k'th term of -168743, -337484, -506225, -674966? -168741k - 2 What is the i'th term of -47, -229, -533, -959, -1507, -2177, -2969? -61i*2 + i + 13 What is the g'th term of 6881, 6887, 6893? 6g + 6875 What is the x'th term of -1251, -1403, -1555, -1707? -152x - 1099 What is the l'th term of -104, -459, -1048, -1871, -2928, -4219? -117l*2 - 4l + 17 What is the m'th term of -9555, -9558, -9561, -9564, -9567, -9570? -3m - 9552 What is the g'th term of 30938, 30913, 30888, 30863? -25g + 30963 What is the b'th term of 164, 710, 2106, 4778, 9152, 15654, 24710? 71b3 - b2 + 52b + 42 What is the u'th term of -146740, -293499, -440258, -587017, -733776, -880535? -146759u + 19 What is the t'th term of -123, -272, -421, -570, -719, -868? -149t + 26 What is the w'th term of 695, 1399, 2103, 2807? 704w - 9 What is the i'th term of -16, 518, 1052? 534i - 550 What is the t'th term of 1463, 2892, 4299, 5684, 7047? -11t2 + 1462t + 12 What is the t'th term of 222468, 444935, 667402, 889869? 222467t + 1 What is the v'th term of -198439, -396877, -595315, -793753, -992191, -1190629? -198438v - 1 What is the h'th term of 5, 276, 1095, 2738, 5481? 46h3 - 2h*2 - 45h + 6 What is the p'th term of 3925, 3957, 4011, 4087, 4185, 4305, 4447? 11p*2 - p + 3915 What is the b'th term of 207, 460, 811, 1308, 19	{ "pile_set_name": "DM Mathematics" }
value of ((-5)/(-50))/(2/(-25))? -5/4 What is (1/14)/((-12)/24)? -1/7 Evaluate (7/(-14))/(4/4). -1/2 What is (4/(8/(-4)))/5? -2/5 What is -58/(-24)3/(-10)? -1/2 What is the value of (16/(-12))/(4/(-3))? 1 What is (16/6-3)/(-10)? 4/5 What is the value of (-1)/(-2)-3128/(-320)? 3/5 (12/9)/(-4)(-64)/(-96) -2/9 What is the value of ((-4)/(-22))/((-26)/286)? -2 20/17530/(-12) -2/7 Calculate ((-18)/10)/((-17)/((-1190)/(-21))). 6 Evaluate (-8)/(-18)(-27)/18. -2/3 Evaluate (1/2)/((-53)/318). -3 Calculate ((-12)/4)/(350/4). -2/25 Calculate (18/48)/(6/48). 3 What is -19/(6/(-2))? 3 Calculate (5(-2)/6)/(13/39). -5 ((-36)/792)/((-1)/(-12)) -6/11 What is the value of ((-24)/(-12))/(6/9)? 3 What is the value of (586/2637)/((-2)/(-18))? 2 What is the value of (-6)/(-15)((-120)/(-64))/(-3)? -1/4 Evaluate (36/(-14))/(15/(-35)). 6 (((-6)/26)/(-3))/((-20)/(-40)) 2/13 What is the value of (7/(-42))/(7/378-1)? 9 What is 2/((-4)/3)152/(-114)? 2 0/(((-4)/5)/((-42)/105)) 0 Calculate ((-2)/(-1))/(((-182)/56)/(-13)). 8 ((-66)/(-330))/(2/2) 1/5 Evaluate ((-202)/505)/(2/10). -2 What is the value of (1/7)/(9/63-6)? -1/6 (3/543)/(2/6) 1/2 What is ((-6)/(-9))/(44/(-132))? -2 Evaluate (-2)/243318/(-1896). 7 What is (3/1)/1(-9)/(-135)? 1/5 (-2)/(-2)33/55 3/5 What is the value of (-5)/(9/9(-3)/(-3))? -5 8/(-18)-3(-3)/(-12) 1/3 What is 60/315(175/(-30))/(-5)? 2/9 (((-15)/6)/5)/((-8)/(-16)) -1 Evaluate (-6)/(-3)16/(-128). -1/4 Calculate ((-72)/(-90))/(12/20). 8 What is 5/2(-16)/(-20)? 2 Evaluate (-2)/(14/28-1). 4 What is the value of ((-99)/(-110))/(7/(35/(-6)))? -3/4 Calculate (140/(-8))/1. -5 What is 2((-140)/(-112))/((-2)/(-4))? 5 Evaluate (-5)/1(-4)/4. 5 Calculate -27/56-4. 1 Calculate (-1)/26(-24)/(12/2). 2/13 What is (12/(-50))/((-46)/115)? 3/5 Calculate (18/24)/((-3)/2). -1/2 Calculate (-645)/(-344)(-4)/(-3)4. 10 What is (-35)/3020/175? -2/15 ((-10)/(-60))/(1/42) 1/3 (12)/(((-16)/4)/(-2)) 1 Calculate (((-108)/33)/6)/(-3). 2/11 Calculate (-12)/15((-4)/(-1))/(-40). 2/25 What is ((-16)/(-36))/(6/27)? 2 What is the value of 2(-1)/((-1)/(-1))? -2 Calculate -2((-12)/(-40))/(-3). 1/5 What is ((-60)/165)/(2/1)? -2/11 Calculate 20/4829/30. 1/4 Calculate 34/170(-1)/2. -1/10 ((-56)/630)/((16/12)/2) -2/15 Evaluate 2/311/17612. 1/2 (-2)/(((-1760)/11)/10) 1/8 ((-1)/(-3))/1165/11 5 Evaluate ((-60)/1350-165)/(4/(-6)). -11 Calculate (-910)/819(-3)/5. 2/3 Calculate 1/(-3)3/66. -1 What is the value of (-4)/14(-350)/25? 4 Evaluate (-10)/6(-48)/40. 2 Evaluate ((-2)/8)/((-11)/33). 3/4 What is the value of 20/(-30)21/14? -1 Evaluate (3/(-2))/((-111)/(-74)). -1 Evaluate (-2)/((28/(-21))/2). 3 Calculate ((-10)/15)/((-16)/(-9)). -3/8 What is the value of (-15)/(-6)(378/35)/(-9)? -3 Calculate (-21)/(-15)(-65)/13. -7 What is ((-160)/(-4))/(-4)(-2)/(-4)? -5 What is ((-165)/275)/(6/(-10))? 1 What is the value of (-2)/6-1(-15)/5? -1 ((-12)/8)/(27/90) -5 Calculate (-60)/(-50)5/(-7). -6/7 What is the value of (1/(-6)-3)/(45/(-18))? -1/5 What is -38/84(-14)/(-18)? -2/9 -105/(-300)-4 -2/3 What is the value of (15/21)/((25/10)/1)? 2/7 -34/(4/1) -3 What is the value of (3(-1)/3)/((-6)/24)? 4 (2/3)/((133/63)/19) 6 What is the value of (-4)/16(-28)/(-7)? -1 What is the value of (-96)/16(-1)/2? 3 (-3(-5)/15)/(-1) -1 Calculate (3/((-27)/30))/((-4)/6). 5 What is 1(-8)/(80/15)? -3/2 ((-6)/(-2))/(-5(-27)/180) 4 Calculate (-2)/(-32)41. 1/4 Calculate (((-9)/(-12))/(-1))/((-33)/(-8)). -2/11 Evaluate (-4)/(-12)-12(-1)/(-14). -2/7 Evaluate (78/(-36))/(-13)-1. -1/6 ((-4)/575/(-10))/(-1) -6 What is 3/(6/1)6? 3 Evaluate 175/(-14)(-2)/(-10). -5/2 Calculate (-3)/63-3304/76. 4/7 What is the value of ((-9)/5)/((-24)/(-320)4)? -6 Evaluate 1/(-1)3/3. -1 What is 14/(448/12)-8? -3 Evaluate (16/(-576))/(4/(-16)). 1/9 Evaluate (3/(-9))/((-50)/1050). 7 What is (-5)/(-20)232/(-8)? -2 (-1(-8)/(-9))/(224/(-336)) 4/3 14/18(-1)/((-77)/22) 2/9 Evaluate (4/((-120)/27))/((-6)/10). 3/2 Evaluate (8/80-6)/(-3). 1/5 Calculate (1/(18/24))/(2/9). 6 What is 6/(-3)(3/6)/(-1)? 1 30/(-175)15/(-6) 3/7 -3((-49)/(-42))/7 -1/2 What is (-21)/648/(-28)? 6 Evaluate (8/28)/((-3)/(-126)6). 2 Calculate (8/(-16))/(1/(-6)). 3 What is the value of 21/(-63)72/3? -8 What is the value of (8/(-140)-15)/((-45)/(-42))? 4/5 Evaluate -11(-24)/2772-1. -2/21 Evaluate 2/(-8)(96/6)/(-4). 1 What is 7(-4)/(-28)1/1? 1 What is -5((-504)/40)/(-7)? -9 What is the value of (100/(-40))/((1/1)/2)? -5 Calculate (3/(24/8))/(1/1). 1 (-6)/(-8)12/54 1/6 What is (-11)/(66/(-6))6/15? 2/5 Evaluate ((-4)/16-3)/(33/8). 2/11 Evaluate (-24)/(-6)1/(-2). -2 What is ((-6)/15)/(11/((-165)/12))? 1/2 What is 6/8(-9)/((-243)/6)? 1/6 Calculate (10/(-20))/((-6)/4). 1/3 Evaluate 1/(-3)(-168)/(-364). -2/13 What is the value of ((-110)/(-66))/((-10)/12)? -2 What is the value of 6/(6(-1)/(3/(-1)))? 3 What is (1-2)/(31/62)? -4 Evaluate (3(-19)/(-228))/(1/(-6)). -3/2 What is the value of ((-2)/(-8)2)/((-5)/40)? -4 What is the value of (4/(-2))/((-1560)/(-156))? -1/5 Evaluate ((-20)/(-8)-2)/((-15)/(-15)). -5 Calculate ((-10)/25)/((-1)/(-5)). -2 Calculate (480/280)/(1/(-7)-2). 6 What is (-12)/(-8)(-3)/(27/1)? -1/6 ((-6)/(3/(-1)))/((-3)/6) -4 What is the value of (4/((-24)/(-15)))/((-2)/(-4))? 5 Calculate ((-3)/(-27)66)/(-22). -2/11 Evaluate (189/(-18))/(-7)(-8)/3. -4 What is (2/(-18))/(84/72)? -2/21 What is the value of (12/16)/(3/(-4))? -1 What is the value of 5-1(-3)/15-5? -5 1/2(-2)/(-5)-5 -1 Calculate 8/8-2(-8)/(-64). -1/4 Evaluate (-5)/(70/66/(-4)). 2/7 51/374(-28)/21 -2/11 What is (28/672)/((-2)/(-6))? 1/8 Calculate ((-78)/9)/13(-15)/(-2). -5 Calculate 232/435(-15)/36. -2/9 (-10)/(-36)(-48)/(-80) 1/6 What is the value of (3(-4)/152)/(21/28)? -2/19 Evaluate ((-40)/50)/(12/(-10)). 2/3 Evaluate (31/(-2))/((-51)/(-68)). -2 Evaluate (-36)/12(9/(-3))/(-27). -1/3 ((-1)/((-30)/4))/(1/6) 4/5 What is the value of ((-18)/105)/(322/(-165))? 3/7 ((-58)/(-203))/(2/28) 4 1/((-1)/((-3)/1)1) 3 Evaluate 4/(-6)((-3024)/256)/21. 3/8 (-33)/11(-4)/3 4 What is the value of 1/230/(-105)? -1/7 (-1)/(((-1)/(-12))/(20/(-40))) 6 What is -31(-48)/(-18)? -8 Calculate (-3)/63(-2)/(12/21). 1/6 ((-54)/45)/((-8)/(-20)) -3 Evaluate 6/5-3(-20)/24. 3 Evaluate (-1)/(-1)(1/5)/1. 1/5 Calculate (-147)/(-399)12/14. 1/19 What is the value of (14/(-49))/((-24)/140)? 5/3 What is 2(-4)/8(-9)/3? 3 What is (-16)/618/24? -2 What is (6/4)/((-18)/384-8)? 4 Calculate (-12)/105(-14)/4. 2/5 What is (2/1)/((-2)/(-2))? 2 What is the value of 3/((-230)/(-40)6)? 2/23 What is (1/(32/(-4)))/((-14)/(-28))? -1/4 (-16)/14(-7)/2 4 Evaluate ((-11)/33)/((-1)/(-3)). -1 What is the value of 4((-3)/12-6)/(-15)? -2/5 (20/3)/512/8 2 Evaluate ((-7)/(-21))/((-25)/(-45)). 3/5 (2/(-5))/(4/40) -4 Calculate 36/(-9)(-1)/(-2). -1 What is (((-56)/(-36))/7)/((-2)/(-6))? 2/3 225/(-10)1 -5 What is the value of (-2)/((-3)/3)(-5)/2? -5 (15/(-24)-4)/((-15)/(-36)) 6 What is ((-2)/7)/(-2)(-9)/9? -1/7 Evaluate 105/(420/(-6)). -5/7 What is ((-10)/10)/(2(-3)/(-54))? -9 What is (8/28)/(8/(-14))? -1/2 Calculate 4/(-3)21/14. -2 What is the value of ((-10)/20)/(1/((-12)/(-10)))? -3/5 Evaluate (72/(-252))/(6/(-14)). 2/3 ((-2)/(-16))/(24/(-144)) -3/4 Calculate (1/22)/(14/77)1. 1/4 What is the value of ((-2)/1)/((-273)/(-21))? -2/13 What is the value of (-4)/3(-2)/328? 2/3 What is (2/12)/((-20)/(-24))? 1/5 What is (-24)/(-28)(-133)/38? -3 Calculate ((-5)/50)/((-5)/(-40)). -4/5 What is the value of 4(13/(-221))/(8/(-4))? 2/17 Evaluate ((-40)/6)/1269/(-2152). 5/6 Calculate (-150)/500(-5)/6. 1/4 ((-3)/(-5))/(231/110) 2/7 -10-5((-3)/3)/10 -5 What is -12/1(-49)/14? 7 What is (1/((-95)/2))/(19/(-95))? 2/19 Calculate (2/(-6))/((-15)/722). 4/5 What is 2/(-3)9/3? -2 What is the value of 2/(-2)21/(-28)? 3/4 (-96)/369/122 -4 Evaluate (((-7)/(-2))/(-7))/((-2)/36). 9 (-336)/12324/6 -2/11 What is the value of (-18)/(-3)(80/24)/5? 4 What is the value of (5/(-6))/((-120)/9)? 1/16 Calculate (-24)/2121(-2)/12. 4 What is (-2)/((-2)/2)28/14? 4 Calculate (((-48)/(-6))/(-8))/(5/(-1)). 1/5 7-16/1477 -2 (4/22)/(38/418) 2 What is the value of ((-16)/72)/(-1)-9? -2 What is the value of (-24)/(-8)(-5)/3? -5 What is (6-1)/(-2)5/(-15)	{ "pile_set_name": "DM Mathematics" }
for p. 5 Solve 4v = -4r, -85569r + 3v + 32 = -85564r for r. 4 Solve -r + 8 = -b - 0, 0 = -b + 4r - 26 for b. -2 Solve -2f = -2k + 24, -5k + 2f - 489 = -528 for k. 5 Solve -18r - 5 = -19r, -3i = 5r - 7 for i. -6 Solve -2m = 2f + 2, 1366m - 1362m - 28 = 4f for m. 3 Solve 0 = 4h - a + 7, -19h + 3a = -21h - 21 for h. -3 Solve g = -5z + 80, -g - 768z + 766z = -35 for g. 5 Solve 2m + 4z = 10, -335z = 3m - 337z + 25 for m. -5 Solve -4a + 4 = 0, -2a + 56 = s + 49 for s. 5 Solve -b + 17 = -3s, 5s + 2b - 170 = -180 for s. -4 Solve 2z - 15w + 3 - 24 = 0, -5 = 5w for z. 3 Solve -44 = 5m + 3a, -299m + 5a + 28 = -296m for m. -4 Solve -3x + 912 = -4l + 895, -8 = l + 3x for l. -5 Solve 3r + 3f = 6, -4r + 370f - 366f + 8 = 0 for r. 2 Solve 342212p = -2m + 342207p + 8, 3m + 0m = 2p + 12 for m. 4 Solve -4a = -12, 3a + 30 = 4w + 11 for w. 7 Solve -4a + 5p - 34 = 0, -5a + 308p = 311p - 50 for a. 4 Solve -7r + 5k = 26, -3r - 2k + 5 = -4r for r. -3 Solve -7j + 5 = -x, 2x + 10 = 3j + 11 for x. 2 Solve 6607k = 6609k - g + 11, -3g + 29 = -5k for k. -4 Solve -2p - 3 = -2v - 9, 0 = p + 5v + 39 for p. -4 Solve -c + 6289 = -3f + 6308, 2c = 4f - 28 for c. -4 Solve 0 = u + 3, 30f - 27f - 2u - 12 = 0 for f. 2 Solve -5r + 4o + 629 = 505, -8r - 9o = -183 for r. 24 Solve 27 = -2p - 0p - 5w, 12w + 24 = 2p for p. -6 Solve -3b - 15 = -3z, -5b - 656 = 5z - 661 for b. -2 Solve 3j - 6 = -2m, -5m = -j - 4 + 23 for j. 4 Solve 20 = 5d + 2s, 5 = 5d - 557s + 562s for d. 6 Solve -2z + 5x + 36 = 0, z = 6x - 1431 + 1470 for z. 3 Solve 33 - 20 = 3y + 5h, 0 = -h + 5 for y. -4 Solve 16d + 20 = -4z, 127d - 124d + z = 0 for d. -5 Solve 0 = r + 105u - 102u + 4, 0 = -r - 14u - 15 for r. -1 Solve 33 = 96515c - 96511c - 11f, -4c + 6 = -2f for c. 0 Solve -5d - 85 = 28x - 30x, 3d + 77 = -4x for d. -19 Solve 7814c + 31 = 4w + 7811c, -10 = -w + c for w. 1 Solve n + 16 = 17a, 231 = 2n + 229 for a. 1 Solve 13r + 3x - 108 = 0, -5r = 317x - 315x - 39 for r. 9 Solve -2n + 2o = -555 + 557, n + 3o = -5 for n. -2 Solve -2 = 2d + 169j - 167j, -8d = 2j - 22 for d. 4 Solve -28i = -25i + 2d + 16, 5i - 4d + 56 = 0 for i. -8 Solve q - 18 = -5w, 0 = 2w - 3q - 295 + 281 for w. 4 Solve -8m + 3 = -6m - 3m, -4f - 4m = -4 for f. 4 Solve -3j + 258 = 2b + 251, -2b + 12j + 22 = 0 for b. 5 Solve 0 = 2w + 4p + 24, p + 145 = -3w + 124 for w. -6 Solve -8803b + 8802b = -13t - 166, 3t = 2b - 33 for t. -13 Solve -221a + 3r = -219a + 10, 3a = 3r - 18 for a. -8 Solve -5p - 59a + 57a = -15, -3p = -4a - 9 for p. 3 Solve -2c - 3z = 180 - 205, -5z + 35 = 2c for c. 5 Solve 25 = -3i - o + 37, -o = 5i - 22 for i. 5 Solve 0 = -5n + 5j + 15, 159n - 163n + 15 = -j for n. 4 Solve 4v - 10s = 2, -2v - 8 = -167s + 165s for v. -7 Solve g - 28s = -29s - 9, 3g = -4s - 32 for g. -4 Solve 18t + 1 = 17t + 4b, 3t - 3b = -12 for t. -5 Solve -4w - 4v = -20, 28w + 4v + 16 = 33w for w. 4 Solve 0 = -4i - 3k - 42, 74i - 69i - 5 = 2k for i. -3 Solve 0 = -5l + 25, -301n = -300n + 4l - 13 for n. -7 Solve 69 = 5r + 16m, -r + 3m - 93 = -82 for r. 1 Solve -4y = -2877t + 2878t + 42, 0 = 2y + 10t + 40 for y. -10 Solve 0 = -4w + v + 2151 - 2133, 0 = -5w + 2v + 21 for w. 5 Solve -5o + 2x - 732 = -792, -6o + 64 = -4x for o. 14 Solve -4p - 3f - 35 = 0, -352p + 37 = -348p - 5f for p. -2 Solve 0 = -16q + 2u + 24, 61 = 2q + 3u + 71 for q. 1 Solve -3 = 4s + 1, i = -2s for i. 2 Solve 2r + 10h - 821 = -785, 12 = 5r - h for r. 3 Solve s + 48v = 51v + 10, v = -18s - 40 for s. -2 Solve 5q = v + 9, 12 = -v + 3 for q. 0 Solve 3g = 3b + 33, -61b = -64b - 2g + 12 for b. -2 Solve -3x + 60j - 357 = 0, 179x + 5j - 26 = 183x for x. 1 Solve -4o = -5x + 4, 1 = -37x + 39x - o for x. 0 Solve -4w = 2d - 65 + 51, -3 = -w - d for w. 4 Solve -11x = -7x - 4i + 8, -4x - 12 = -2i for x. -4 Solve 24 - 49 = -5i - 3n, 3i - 15 = 2n for i. 5 Solve x = 5h + 27, 3h - x + 570 = 549 for h. -3 Solve -3j = 25l - 24l + 2, 0 = 2j - 20l + 208 for j. -4 Solve 2n + 18 = -s, -s = 4n + 64561 - 64527 for s. -2 Solve 403b + 68 = 402b + 5i, 5b = 5i - 80 for b. -3 Solve 0 = 4j - 5q + 87, -50q = 3j - 60q + 184 for j. 2 Solve -1447l - 27 = -3b - 1443l, -3l + 35 = 2b for b. 13 Solve 2n + 1243 - 1253 = -2o, -3o = -2n + 5 for o. 1 Solve 6 = -2v, -r - 2v - 14 = 4r - 7r for r. 4 Solve g - 13 + 20 = -2t, 3 = -2t - 5g for t. -4 Solve -3b + 4x = -2, -12 = -4b - 52x + 55x for b. 6 Solve 0 = p + 2, 1 - 40 = 5l - 3p for l. -9 Solve 0 = 6z + 5d - 15, 404 - 412 = -z + d for z. 5 Solve -3q = y + 25, y - 386 + 339 = 5q for y. 2 Solve 84a - 10 = 19q + 82a, 0 = 2q + 4a - 20 for q. 0 Solve d - 20z + 16z - 6 = 0, -d = -z for d. -2 Solve -4b - 12 = 0, 5q + 4b + 1019 = 997 for q. -2 Solve -5h + t = -33, 3t + 4501 = -3h + 4510 for h. 6 Solve 2c - 4j = 2095 - 1057 - 1052, 0 = -c + 4j - 13 for c. -1 Solve 26m - 54m = -27m - 3s, 0 = -4s for m. 0 Solve 21 = 295w - 298w - 3d, 0 = -3d - 6 for w. -5 Solve 5o - 56 = 2k, -7o - 103k + 55 = -98k for o. 10 Solve -20r + 23r + 4c - 23 = 0, 2r = -2c + 14 for r. 5 Solve j - 5 = 0, 5v + 84 + 301 = 81j for v. 4 Solve -3z + 6 = s, 2s - 364 + 332 = 4z for s. 12 Solve -t + 9 = y, 2y + 39t - 34t - 57 = 0 for y. -4 Solve -5r + 3t + 27 + 18 = 0, 3r = -9t - 27 for r. 6 Solve 4z - 5o = 27, -3z - 23o + 18o = 6 for z. 3 Solve 2i - 22o - 26 = -14o, 4i - 2o + 4 = 0 for i. -3 Solve 3y = -5l + 41, -l = -30y + 33y - 13 for l. 7 Solve 21 = -i + 9m - 2, -3i + 6 = -2m for i. 4 Solve -74s = -76s - b - 2, s = -2b - 7 for s. 1 Solve 3g - 5y = -23 + 30, 2g + y = -4 for g. -1 Solve 123j - 120j - 17 = x, -5x = 25 for j. 4 Solve -53v + 48v + 3b + 13 = 0, 19 = 3v + b for v. 5 Solve -3t - c - 12 = 0, 5t - 13c + 21 = -15c for t. -3 Solve s + 6c - 12 = 0, 2c - 2 = 5s + 2 for s. 0 Solve 0 = -5d - 4g + 9, 0 = -3d + 5g + 56 - 21 for d. 5 Solve -3p = -3o - 3, -5 = 658o - 653o + 4p for o. -1 Solve -5u + 4g - 13 = 0, -184u = -185u + 5g - 11 for u. -1 Solve -3z = -513x + 510x - 21, -47z = 2x + 161 for x. -10 Solve -728y + 15 = -724y + t, y - 6 = 2t for y. 4 Solve -5b + 119c - 92c - 148 = 0, 5b + 5c + 20 = 0 for b. -8 Solve -7j + 3j + 3m = -14 + 22, -2m = 0 for j. -2 Solve 33 = 4f + 18l - 36 + 27, -3l = 5f + 6 for f. -3 Solve -2o + 5 = 7, -47o + 53 = -5i - 45o for i. -11 Solve -452d + 454d - 7 = -f, 5f - 4d = -49 for f. -5 Solve 3l = -2c + 12, 4c + 146l - 14 = 145l for c. 3 Solve -2t = 200m - 205m + 29, 4t - 5m = -33 for t. -2 Solve 2032 = 5g + 2007, 3s + 4g - 29 = 4s for s. -9 Solve -5k = -2q - 277 + 134, 0 = -13q + 13 for k. 29 Solve 530 = 3n + 53l, 45 = 4n - 2l + 65 for n. 0 Solve -14i = -b - 7i + 15, 0 = -5b + 3i + 43 for b. 8 Solve 27c = 25c - 2u + 10, -u = -c - 1 for c. 2 Solve -18 = -2o - 2b, 57b - 15 = -3o + 60b for o. 7 Solve -3x = -4o - 25, -3o - 191 = -4x - 167 for o. -4 Solve -43 = -4o + 5m, 44m = -4o + 43m + 25 for o. 7 Solve 6j = r + 87, -2j + 1366r = 1368r - 36 for j. 15 Solve -4o = 10g + 46, 27 = -3o + 102g - 107g for o. -4 Solve 75p + w + 4 = 73p, p - 5w = -2 for p. -2 Solve -5n - 198r + 200r = 14, 8n = 4r - 20 for n. -4 Solve -2q + 2 = 3n, 268q - 267q + 2n = 2 for q. -2 Solve 5c - 45 = -5x, 4c + 104 = 2x + 98 for c. 2 Solve 0 = -443d + 442d - 2a + 9, 0 = 2d + 5a - 21 for d. 3 Solve 70 = 5q + 5c, -4q + 190c = 189c + 24 for q. -2 Solve 12 = -3q, -29i + 2q + 23 = -32i for i. -5 Solve 4v = 83i - 79i, -2v = 3i + 15 for v. -3 Solve -5w - 130 + 110 = o, -16 = -3o + 4w for o. 0 Solve 5a + 21 = -4, 4y - 4a - 36 = 0 for y. 4 Solve 16 = -4i + 3u, 5i + 125u - 121u - 11 = 0 for i. -1 Solve -4 = -3f - y, -14518f + 3 = -14518f + 3y for f. 1 Solve 5r + 62h = 65h + 99, -4h = -4r + 76 for r. 21 Solve 2103 = 3r + 2i + 2102, 5i = -3r - 11 for r. 3 Solve 4q + 757z + 10 = 754z, z + 5 = -3q for q. -1 Solve 5g - 2t = -9, g - 23t - 13 = -30t for g. -1 Solve 0 = f - 5p - 22, 4*f + p + 47 = 51	{ "pile_set_name": "DM Mathematics" }
039? 4/78039 Is 9515 less than or equal to -162.4? False Is -3658040 greater than or equal to -3658041? True Does 145776 = 145110? False Is -8230/51 bigger than 18/5? False Which is smaller: 0.2 or 7957915? 0.2 Which is smaller: -340261 or -340229? -340261 Is 8056197/35 != 230178? True Is 4015742 greater than or equal to 3? True Is 120.1 < 132/37? False Is -55271 greater than or equal to -55759? True Which is greater: -12584 or -12094? -12094 Which is smaller: 51082 or 51601? 51082 Are -33 and -275911/8519 equal? False Is 0 < 86/842881? True Which is bigger: 1 or 87274785? 87274785 Is 13 at most as big as -1435848? False Is 2314735/7 equal to 330675? False Are -28 and -4775204 non-equal? True Which is smaller: 281 or 113242/403? 113242/403 Is -10382304/13 >= -798640? True Do 14888602/195 and 76351 have the same value? False Is -11517 at least as big as 24? False Which is bigger: 305582 or 305558? 305582 Is 1354 less than -20.96? False Which is smaller: -0.20709189 or -14/5? -14/5 Is 5177960 != 2? True Is -2768/440703 not equal to 0? True Which is smaller: -7968221 or -7968219? -7968221 Which is smaller: -1/25 or -130338/11? -130338/11 Which is smaller: -2301049 or -2301034? -2301049 Is -691 equal to -124918/181? False Which is greater: -65.4113 or 487? 487 Which is greater: 33247330 or -1/6? 33247330 Are -13137935 and -13137935 equal? True Is 0 at most 2/151749237? True Which is smaller: 19 or -567/1223? -567/1223 Is 1869/32909 greater than -1? True Is -272 less than or equal to 15/127373? True Is -23 equal to 1020577? False Which is bigger: -86305 or -86371? -86305 Are 78453245 and 78453247 nonequal? True Which is bigger: -2408320 or -776? -776 Which is smaller: 9826/17409 or 2? 9826/17409 Is 0 less than -2111.67123? False Which is smaller: 1 or -55/9964? -55/9964 Is -330 at least as big as 6440? False Which is smaller: 8/10703 or -4/113? -4/113 Which is smaller: -0.19 or -112805? -112805 Is 3 less than -5624977? False Is -79.034521 not equal to -1/2? True Which is greater: 1 or -18/849115? 1 Is 0.0514013 less than 4.67? True Which is smaller: -3877928/227 or -17084? -17084 Is -574784050 > -574784051? True Are -0.01 and 29255665/2 unequal? True Is -21 bigger than 273690/7? False Which is bigger: -10.966733 or 0.1? 0.1 Is -1 != -1363/1260976? True Is 8931848 at least as big as 8931849? False Do 463 and -52480 have the same value? False Is 68742938 < 68742918? False Which is smaller: 1514436 or 1514434? 1514434 Which is bigger: 0.3 or 4672857? 4672857 Which is smaller: -3277917 or -3277923? -3277923 Is -109000079/4 greater than or equal to -27250020? True Is -4137675 at least -4137705? True Is 79758 != 7337683/92? True Which is bigger: -44325600 or -44325603? -44325600 Which is greater: -22708633 or -22708636? -22708633 Which is greater: 283752659 or 283752660? 283752660 Which is smaller: 1417188 or 4251566/3? 1417188 Which is greater: -16/2161375 or -1/4? -16/2161375 Is 287 at most -219266? False Is 0 at most as big as 58/434439? True Which is smaller: -15479291/7 or -2211327? -15479291/7 Which is greater: -170/64087 or 1? 1 Is 0 not equal to -522/1084295? True Are -125 and -25893/205 unequal? True Which is greater: -1930321 or -1/2? -1/2 Which is smaller: 47/7 or 13504? 47/7 Are -425315 and -425450 nonequal? True Is 3/17841779 at most -1? False Which is greater: -7926 or -9/13? -9/13 Which is greater: -85 or -6714/79? -6714/79 Which is smaller: -1.6 or -18/659149? -1.6 Which is smaller: 7513 or 3385? 3385 Which is bigger: 2 or -4243220? 2 Which is smaller: -1 or 267/2184520? -1 Which is smaller: -1170026 or -12870282/11? -1170026 Is 11153 > 11896? False Which is smaller: 1/5 or 26/36441? 26/36441 Which is smaller: 1089145/12 or 90762? 90762 Which is smaller: 4 or -2877909? -2877909 Which is smaller: -20706825 or -38? -20706825 Is -274300 bigger than -1920095/7? False Which is bigger: 3697486 or -1? 3697486 Which is smaller: 1 or 7/11763116? 7/11763116 Is 13177696 bigger than 13177696? False Which is smaller: -1 or -271/380275? -1 Which is greater: 4663 or 8144? 8144 Which is greater: -37 or 1712/143? 1712/143 Which is bigger: -102314 or -2353198/23? -2353198/23 Which is smaller: 751215 or 751296? 751215 Is 174511 not equal to 174602? True Which is smaller: -4131936 or -4131829? -4131936 Is 10 > -9413? True Which is smaller: 40170 or 2? 2 Is -1475489 >= -1475494? True Is -218033 at least -218093? True Which is smaller: 4274431 or 4274319? 4274319 Which is greater: 277/10350 or -10? 277/10350 Do -39632178 and -39632194 have the same value? False Is 1181282/9 smaller than -62? False Is 2/501 less than 0.48374? True Do -12 and 20.774813 have the same value? False Are -7.48 and -203491 non-equal? True Which is smaller: 23604414 or 0.15? 0.15 Are 18 and 49483/2605 equal? False Which is smaller: -23746/21531 or -2? -2 Is -268566 < -268548? True Which is smaller: -131175 or -131358? -131358 Is -2/1375932335 less than -1? False Is 2/124265151 < 1? True Are 191845 and 23213358/121 non-equal? True Which is smaller: 155631 or 156174? 155631 Which is smaller: -55/14483804 or -1? -1 Which is greater: 44/1810533 or -1? 44/1810533 Is -269 greater than -43652? True Do -8/531 and 13146 have the same value? False Which is smaller: -2 or -2630428.5? -2630428.5 Which is greater: -0.21205 or -0.04068? -0.04068 Which is smaller: -2/82085 or 1848? -2/82085 Are 1 and -6947/29878 unequal? True Are -28833 and -27800 equal? False Is -1174637 greater than or equal to -1174640? True Which is bigger: 39127812 or 39127811? 39127812 Do 77 and 244372/3153 have different values? True Is 29 greater than or equal to 361414/11971? False Do -30601410/17 and -1800083 have the same value? False Is 8505940 equal to 8505915? False Which is greater: -900028 or -900035? -900028 Which is greater: -3849901 or -0.1? -0.1 Is 6500272 less than 6500274? True Is 2207 equal to -3629? False Which is bigger: -170570184 or -170570182? -170570182 Is -306766/523 bigger than -586? False Does 2636189.8 = 2? False Are -7356077 and -7356070 unequal? True Which is smaller: 52728 or 6.4? 6.4 Are -203 and -81667/405 unequal? True Is -1/30 <= -0.0115166? True Is 49080/1319 < 38? True Which is smaller: 62068 or 61803? 61803 Which is greater: 2206881615 or 1/4? 2206881615 Is 188 less than 24581? True Is 0 <= -48413084? False Which is smaller: 1 or -3/14182951? -3/14182951 Which is greater: 4/141629607 or 1? 1 Is 21493762 smaller than 21493762? False Is -13523 bigger than 36298? False Which is greater: -1151035 or 0.013? 0.013 Is -139652 greater than -11591115/83? False Which is greater: -2 or -3401457? -2 Which is bigger: 46826528 or 46826526? 46826528 Do 781008 and 780544 have the same value? False Which is smaller: -419024/125 or -3353? -3353 Which is smaller: 24446/56077 or 1? 24446/56077 Which is bigger: -490450 or -490266? -490266 Which is greater: -721301 or -721299? -721299 Is 3/4 less than or equal to 202562/11? True Are -44588081 and -44588082 nonequal? True Which is bigger: 4/4753399 or -1? 4/4753399 Are -1.7 and -8331602 equal? False Which is greater: -5/4849059 or 0? 0 Which is smaller: 0.1 or -63.889882? -63.889882 Which is smaller: 167670246 or 167670250? 167670246 Which is bigger: -50/197 or 0.97? 0.97 Is 0 at most -421/1096628? False Is 101059121 > 101059117? True Which is smaller: -1 or 34/479143? -1 Which is greater: 2003910 or 2003914? 2003914 Which is greater: 5083/8002 or 2/13? 5083/8002 Which is smaller: 1 or 233164872? 1 Does -80784698 = -2/7? False Which is smaller: 512339 or 512320? 512320 Which is smaller: 93640 or 1779149/19? 1779149/19 Is 0 bigger than 0.91731284? False Is -10793 greater than -10892? True Which is greater: -1/3700526 or -1? -1/3700526 Is 6274934 not equal to 6274937? True Is 2 greater than 4763/7125? True Is 41317020 greater than 41317028? False Which is smaller: -8613219/22 or -391511? -391511 Which is smaller: 0.4 or -125.79962? -125.79962 Is -1/2 at least 218.3603? False Is -7675939 less than or equal to -7675940? False Which is smaller: 4027/267008 or 0? 0 Is -15707 not equal to -14407? True Which is smaller: 1 or 6026772? 1 Is -441735/167 at most as big as -2644? True Is -46038/1309 greater than or equal to -35? False Is -47/12272 bigger than -0.21? True	{ "pile_set_name": "DM Mathematics" }
u(i) = 0. What is i? -13 Let t(f) be the second derivative of -f7/4620 + f6/1980 + f5/330 - f3/6 + 2f. Let c(u) be the second derivative of t(u). Factor c(d). -2d(d - 2)(d + 1)/11 Suppose -2/9d4 + 4/9 + 10/9d + 2/3d2 - 2/9d*3 = 0. What is d? -1, 2 Let c = -183 + 367/2. Factor cq*3 - 1/2q + 0 + 1/2q2 - 1/2q*4. -q(q - 1)*2(q + 1)/2 Let m = -122 + 126. Let n(c) be the second derivative of -c + 1/100c5 + 0 + 0c*2 + 1/30c*3 + 1/30c*m. Factor n(k). k(k + 1)*2/5 Solve 2/15j*3 - 6/5j*2 - 8/3 + 16/5j = 0. 2, 5 Let a(u) be the first derivative of 0u3 + 0u*4 - 1/150u*5 + 1/2u*2 + 1 + 0u. Let r(n) be the second derivative of a(n). Factor r(y). -2y2/5 Let c(r) be the second derivative of r6/15 - r4/3 + r2 - r - 1. Solve c(o) = 0. -1, 1 Let i be 1/(((-45)/(-20))/9). Factor 2/9q*3 - 4/9q*5 - 2/9q*i + 0q*2 + 0q + 0. -2q3(q + 1)(2q - 1)/9 Suppose -5v + 4v = 25. Let w be 6/v(-10)/3. Suppose 0q*2 + 2/5q*5 + 0q*4 + 0 + 2/5q - wq3 = 0. What is q? -1, 0, 1 Let y be 56/40 + (-2)/5. Let m be (-8)/(-6) - (0 + y). What is q in 1/6q*4 - 1/2q*2 + 0 - mq + 0q3 = 0? -1, 0, 2 Solve 12d*4 - 58d*3 + 4d*5 + 125d*3 - 59d*3 = 0. -2, -1, 0 Let x = 608 - 608. Factor -3/5p*5 + 0 + 3/5p*2 - 3/5p*4 + xp + 3/5p3. -3p*2(p - 1)(p + 1)2/5 Let n(b) be the third derivative of 1/140b*7 + 0b*3 + 1/120b*5 - 1/80b*6 + 0b + 0 + b*2 + 0b*4 - 1/672b*8. Suppose n(t) = 0. What is t? 0, 1 Let d be (-4)/3-1(-6)/(-4). Factor 0s*d - 1/3 - 1/6s*3 + 1/2s. -(s - 1)*2(s + 2)/6 Let p(o) be the second derivative of o6/120 + o5/40 - o*3/6 - 6o. Let q(d) be the second derivative of p(d). Factor q(z). 3z(z + 1) Let n(f) be the first derivative of -f3/9 + f2/2 - 2f/3 + 2. Factor n(g). -(g - 2)(g - 1)/3 Let -16i - 16i - 20i2 + 9i + 3i - 5i*3 = 0. Calculate i. -2, 0 Let a(b) be the third derivative of 5b*8/672 + 5b7/168 - b6/96 - 7b5/48 - 5b*4/96 + 5b*3/12 - 18b2. Solve a(t) = 0 for t. -2, -1, 1/2, 1 Let u(w) be the third derivative of w5/42 - w*4/12 + 2w*3/21 + 2w*2. Factor u(l). 2(l - 1)(5l - 2)/7 Let j(t) be the first derivative of -3t4/28 + t3 - 45t*2/14 + 27t/7 - 6. Solve j(x) = 0. 1, 3 What is f in -2f2 - 4f + 9f - 3f + 4f = 0? 0, 3 Factor 128/13 + 24/13n*2 - 2/13n*3 - 96/13n. -2(n - 4)3/13 Let a be 2(-3)/(-6)0. Let x = a + 0. Factor -2/5z*3 + 2/5z*2 + x + 0z. -2z2(z - 1)/5 Let j(p) be the third derivative of 0 + 0p - 2p*2 - 2/105p*7 + 0p*6 + 1/3p*4 + 1/5p*5 + 0p*3. Factor j(i). -4i(i - 2)(i + 1)*2 Factor 483d*2 - 2d*3 - 477d2 + 4 - d4 - d*4 + 10d. -2(d - 2)(d + 1)*3 Suppose -4 = -0i - 2i. Suppose -4r = -t + 3 + 4, 0 = -2r - 2. Factor 3h2 + h2 - 4ht - 2 + 2h*i. -2(h - 1)*2(2h + 1) Let y be (12/(-14))/(6/(-21)). Let g(i) = i + 2. Let j be g(0). Factor -4v + 5v2 - 4v*2 + jvy + v2. 2v(v - 1)(v + 2) Suppose 0v = 4v - 8. Suppose -va - 4 = -4a. Factor -4p*5 + ap5 - p5 + 5p5. 2p*5 Let -8/5 + 32/5y - 42/5y2 + 18/5y*3 = 0. Calculate y. 2/3, 1 Let f = -29 + 33. Let u(l) be the third derivative of 1/28l*f + 0l - 1/42l5 + 2/21l*3 + 0 - 3l*2. Factor u(h). -2(h - 1)(5h + 2)/7 Let y(l) = 7l3 + 13l*2 - 23l + 3. Let o(w) = 17w - 8w*3 - 8 + 7w - 9 + 13 - 12w2. Let u(s) = 5o(s) + 4y(s). Solve u(j) = 0. -2, 1/3, 1 Let x be 3/2(-30)/(-135). Let w be 4/3 - (0 - -1). Factor -wv4 + 1/3v*2 + 0 + xv*3 - 1/3v. -v(v - 1)2(v + 1)/3 Let m = -3 + -7. Let x(i) = i + 10. Let j be x(m). Factor -2b + 4b*4 + jb*4 - 2b*3 + 2b - 2b5. -2b*3(b - 1)*2 Factor 2z*2 + 3z*2 + 137z - 152z. 5z(z - 3) Let g(l) be the third derivative of 1/840l*7 + 1/448l*8 + 0l*5 + 0l*3 - 3l*2 - 1/240l*6 + 0l*4 + 0l + 0. Solve g(t) = 0. -1, 0, 2/3 Let o be 1 - (47/12 - 3). Let h(x) be the third derivative of 0 + 1/240x6 - 1/48x*4 + ox3 + x2 - 1/120x5 + 0x. Let h(v) = 0. Calculate v. -1, 1 Let i(k) = k*2 + 7k + 4. Let x be i(-7). Factor -r2 - r3 - 3 + r + x + 0r. -(r - 1)(r + 1)2 Let a(w) = w3 + 8w2 + 2w + 16. Let m be a(-8). Factor -1/2i2 - 4i*4 - 7/2i*3 + mi + 8i5 + 0. i2(i - 1)(4i + 1)*2/2 Suppose -10d*4 - 4d*5 + 8d - 5d3 + d3 + 12d*2 - 4d*4 + 2d*4 = 0. Calculate d. -2, -1, 0, 1 Suppose 5v - 9 = w - 0w, 5v - 15 = 0. Let a(u) = u*3 - u. Let j(x) = 3x*3 + 3x - 6. Let s(l) = wa(l) - j(l). Suppose s(g) = 0. What is g? -2, 1 Factor 3o*2 + 9o*4 - 2o5 - o5 + 10o3 - 19o*3. -3o*2(o - 1)*3 Let j(k) be the first derivative of -2k7/63 + k5/20 - k4/36 - k + 1. Let x(z) be the first derivative of j(z). Factor x(n). -n2(n + 1)(2n - 1)2/3 Let z(q) = -q3 - 9q2 + 3. Let l be z(-9). Let j(a) = a3 - 3a2 + 3. Let t be j(l). Suppose 0g + 2/7g4 + 0 - 2/7g*2 + 0gt = 0. What is g? -1, 0, 1 Let h(v) be the third derivative of -v7/2100 + v6/900 + v5/150 + v3/2 + v2. Let j(u) be the first derivative of h(u). Factor j(g). -2g(g - 2)(g + 1)/5 Let y(n) be the second derivative of 0n*2 - 7n + 0 + 2/3n3 - 2/3n*4 + 1/4n*5 - 1/30n*6. Factor y(z). -z(z - 2)*2(z - 1) Let j(a) = -a*3 - 14a*2 - 25a - 8. Let p(y) = -9y3 - 114y*2 - 201y - 63. Let z(n) = 33j(n) - 4p(n). Find v, given that z(v) = 0. -1, 4 Let v(k) be the third derivative of -2k6/15 + 4k5/15 - k4/6 + 21k2. Let v(n) = 0. Calculate n. 0, 1/2 Let d(i) be the first derivative of -3i + i*3 - 4 + 3/4i*4 - 3/2i*2. Factor d(j). 3(j - 1)(j + 1)2 Let d = -14 + 2. Let i = d - -16. Solve 0 + 0k*3 + 0k - 2/9ki + 2/9k*2 = 0. -1, 0, 1 Suppose -18 = -5u + 9c - 7c, -2u = 3c - 11. Factor 3/8x2 + 0x + 0 - 3/4x3 + 3/8x*u. 3x*2(x - 1)*2/8 Factor -2q2 + q2 - 2q2 - 2q*2 + 25q. -5q(q - 5) Let h(t) be the third derivative of -t8/60480 - t7/2520 - t6/240 - t5/15 - 3t2. Let i(c) be the third derivative of h(c). Factor i(m). -(m + 3)2/3 Suppose 0 = -6b + b + 15. Let u(p) be the third derivative of 1/144p4 + 0 - 1/720p*6 - 1/1260p*7 + 1/360p*5 + 0p + 0pb - 3p*2. Solve u(w) = 0. -1, 0, 1 Let h be 857(4/(-18))/(-2). Let f = h - 95. Factor -2/9x3 + 2/9x + 2/9x2 - f. -2(x - 1)*2(x + 1)/9 Let p(u) be the third derivative of u*2 - 1/720u*6 - 1/3u*3 + 0u*4 + 0u + 0u5 + 0. Let f(b) be the first derivative of p(b). Factor f(j). -j2/2 Let d be (-4)/20 - 32/(-10). Find q such that 0 + 8 - 4 - 6q + 2qd = 0. -2, 1 Let s be (-14)/(-21) - (2 - 13/3). Let m(o) be the second derivative of 0 - 1/42o*4 - 1/21o*3 - so + 0o2. Let m(g) = 0. What is g? -1, 0 Let a(z) be the second derivative of -z7/21 + 3z*6/5 - 13z*5/5 + 3z*4 + 9z*3 - 27z*2 + 27z. Let a(s) = 0. Calculate s. -1, 1, 3 Suppose -3d = -0d. Determine c so that 42c2 + 2 - 44c2 + d = 0. -1, 1 Let q(u) be the first derivative of -u5/150 + u4/30 - u3/15 - u*2 - 11. Let f(w) be the second derivative of q(w). Let f(z) = 0. Calculate z. 1 Let u(y) = -2y*2 + 5y - y + 5 - 2 - 3y. Let b(j) = j2 - 6j + 5. Let c be b(4). Let p(r) = -5r2 + 2r + 7. Let d(k) = cp(k) + 7u(k). Solve d(l) = 0. -1, 0 Find o such that -2/7o + 0o*3 + 4/7o*4 + 2/7o*5 + 0 - 4/7o*2 = 0. -1, 0, 1 Find q, given that -2/9q - 2/9q2 + 0 + 2/9q*3 + 2/9q4 = 0. -1, 0, 1 Let a(g) = g2 + g. Let v be a(3). Let h be 14/8 - (-3)/v. Find x such that 3 - 3 - 6x3 - 2x*h = 0. -1/3, 0 Let m be 870/294 - (1 - -2). Let w = 45/98 - m. What is j in 1/2j - j*2 + 0 + wj*3 = 0? 0, 1 Suppose u + 3 + 3 = 0. Let i(o) = 2o*4 - 12o*3 + 2o*2 + 12o - 4. Let f(r) = -r4 + r3 - r + 1. Let c(q) = uf(q) - i(q). Let c(m) = 0. What is m? -1, -1/2, 1 Let j(o) = o2 - 4o + 1. Suppose -7s = -2s - 25. Let q be j(s). Factor -2k + qk*2 - 6k*3 - 5k*4 + 4k*4 + 3k*4. 2k(k - 1)3 Let u(b) = -b2 - 12b + 4. Let k(w) = 5w2 + 61w - 20. Let h(v) = 2k(v) + 11u(v). Let r be h(-10). Factor -1 + f*3 - 1 - 2fr + 2. -f3(2f - 1) Let t(m) be the first derivative of m*4/2 - 14m*3/15 - 8m*2/5 + 8m/5 + 2. Factor t(k). 2(k - 2)(k + 1)(5	{ "pile_set_name": "DM Mathematics" }
j = -10 + 10. Suppose 2l - 8 = j, 0g + g - 2l + 4 = 0. Let d = 20 + -10. Solve d = gk + k for k. 2 Suppose -645 = -201a + 1164. Solve 6p = -3p + a for p. 1 Suppose g + p = -184, 3g + 548 = 3p - 5p. Let n be (-46/(-20))/((-54)/g). Solve -n - 4 = -2q for q. 4 Let o(f) = 2f2 + 13f - 12. Let p(g) = g*2 - g. Let h(y) = o(y) - p(y). Let a be ((-60)/2)/(0 - -2). Let r be h(a). Solve ru + 1 + 11 = 0 for u. -4 Suppose 6g - 12 = -6. Let f be 4 + (56/28 - (-1 + g)). Solve -fk - 2k = 40 for k. -5 Suppose 3575o - 3579o + 560 = 4q, 4q - 580 = o. Solve -27r - q = -36 for r. -4 Let x(y) = y - 6. Let s be x(4). Let j be (-61)/(-4) + s/8. Let i be (-224)/28 - (44 + -56). Solve iv = 7v + j for v. -5 Suppose -2 = -4l + 6. Let q = 182 - 229. Let m = q + 54. Solve -lu + m = -3 for u. 5 Let o(j) = 298j + 1834. Let v be o(-6). Solve -25d + vd - 84 = 0 for d. 4 Suppose -5r - 158 = -x, -2x + 3r + 182 + 99 = 0. Let v = x + -124. Solve z = 4z + v for z. -3 Let o be 2/3 + (-7 - 1232/(-42)). Suppose -o = -7n + 5. Solve nd - 25 = 9d for d. -5 Suppose -171k - 64k + 32341 = -34634. Solve 5w - 310 = -k for w. 5 Let n(o) = -9o*2 + 14o + 8 + o*3 - 3o*2 + 2o*2. Let i be n(8). Let d be ((-80)/(-6))/(i/(-12)). Solve -b - d = 3b for b. -5 Let d = -3 - 3. Let v be (-10)/((-15 - d) + 7). Solve x - 1 = -v for x. -4 Let i = -141 + 133. Let r be (-50)/50 - i/2. Solve 19 - r = 8k for k. 2 Suppose 0 = 4t + 3u - 20, 3t + u = -u + 14. Suppose f = tf - 4. Suppose -15h + 33 = -fh. Solve -hj = -j + 8 for j. -4 Suppose 84b - 12 = 88b. Let f = b + -27. Let v be (-1)/(f/35 - (-2)/(-14)). Solve -h = -0 + v for h. -1 Suppose 10 = j + r, -j + 21r = 24r - 20. Let m be 6 - 20/j - (0 + 2). Solve ms + 3 = -3s for s. -1 Let d be -36((-15)/9)/((-15)/(-6)). Solve -dy + 34y = -26y for y. 0 Let c be -1 - ((-3)/(-3) + -6). Let k = 33 - 31. Suppose 0 = 31j - 17j. Solve -ka + j = -c for a. 2 Suppose 4g = -204z + 202z + 308, -24 = 4z. Solve g + 100 = 30j for j. 6 Let o = -36552 + 39501. Solve 5j + 2919 = o for j. 6 Suppose -5z - 5u + 510 = 0, -65u + 112 = z - 69u. Solve -zj + 111j + 56 = 0 for j. -8 Suppose 39 = 4i + h + 4, -5h = -i - 7. Solve -i = -3u + 4 for u. 4 Suppose 3c - 33 - 27 = 0. Let m be 15/c(-5 + 3 + -2). Let w be (m/2)/(1/(0 - 2)). Solve q = wq + 2 for q. -1 Suppose s = -g - 2s - 1, 3g + 3s = 3. Suppose 3h = 5h - g, c - 8 = -2h. Let u be (9/c)/((-9)/(-12)). Solve -10 = 3k + uk for k. -2 Let j = 19 + -21. Let q(z) = 2z*2 + 6z + 13. Let y(b) = -b*2 - 3b - 6. Let p(h) = jq(h) - 5y(h). Let w be p(-3). Solve 5 + 3 = ws for s. 2 Suppose -4g = -o + 13, -59 = -2o + 5g - 27. Solve -od - 4 = -20d for d. -4 Let v(w) = -2 - 1 - w + 4. Let z(a) = -a3 - a2 + 4a - 9. Let p(j) = 5v(j) + z(j). Let f be p(-2). Solve -f = -x - 6 for x. -4 Let u = 9 + -7. Suppose -4n - um + 46 = 14, 4n - 32 = -5m. Let t be ((-1)/2)/(0 - 1/n). Solve -tj = -0j for j. 0 Let j = 139 - 141. Let k be (j/(-6))/(15/135). Solve k = 4v + 11 for v. -2 Let f(w) = 4w*3 - 13w*2 - 14w + 4. Let r be f(4). Suppose -68 - 40 = -2t. Let z be r/10 + t/10. Solve -zh + 3 = -12 for h. 3 Let n be 9((-310)/(-31))/30. Suppose 0 = -a - 4x + 17, -3a + 33 = -2x + 10. Solve ny + ay = -24 for y. -2 Let t = -17 + 66. Let d = t - 40. Suppose dl = 5l + 16. Solve -lx = -x + 9 for x. -3 Let d(i) = i2 + 31i - 160. Let z be d(6). Solve -zs = 12s + 222 for s. -3 Suppose 3j + j + 4v + 8 = 0, 0 = j + 5v + 22. Suppose 5s - 92 = r, 0 = 3r - 198 + 189. Solve jf - s = -25 for f. -2 Let s be 132/(6(-4)/(-12)). Suppose -12p + sp = 3. Solve pa = -2a - 5 for a. -1 Let j = -55 - -80. Suppose -5r = -2s + j, -3s + 4r = -16 - 4. Let f be (-11)/22(s + 0). Solve 6w - w = f for w. 0 Let n be ((-5)/30)/((-18)/53676). Solve -4k - n = -513 for k. 4 Suppose 27 = -15w + 207. Solve j - w = 7j for j. -2 Let z be (10/4)/((-136)/16 + 9). Solve -zq - 128 + 128 = 0 for q. 0 Suppose -a = -5r + a + 82, -5a - 5 = 0. Suppose 4c + r = 0, -148 = 4l - 0l - 2c. Let f = l + 43. Solve -fp = p - 20 for p. 4 Let p(m) = 14m*2 + 10m + 11. Let i be p(-1). Suppose 40c - i = 65. Let u(k) = -k2 + k + 7. Let g be u(0). Solve -c = -3v + g for v. 3 Let t be 29/2784-6 + (-1)/(-16). Solve t = 242q - 248q - 30 for q. -5 Let g(v) = v3 + 11v*2 + 29v - 1. Let m be g(-5). Suppose 0d + 2y = 2d - m, -4y = 0. Solve 3x - d = 4x for x. -2 Let f = 29 + -9. Let j(g) = 2g3 + 110g*2 - 1608g + 84. Let x be j(-67). Solve 80d - xd + f = 0 for d. 5 Suppose 2c + 4z = 88, -43c + 38c = z - 256. Solve 0 = 33w - cw - 19 for w. -1 Suppose 3v = 4v + 4b - 167, 0 = 3v + 5b - 466. Let m = -131 + v. Solve -m = -3a - 1 for a. 5 Let o(j) = 23j - 249. Let w be o(13). Solve -9m - 14 = -w for m. 4 Let r be -319(-1)/(-1). Let b = -5174 + 5121. Let y = b - r. Solve 3x + 2 = -y for x. -2 Let a(k) = k3 - 14k*2 + k + 15. Let s be a(14). Suppose -4d + 3d + 1 = 0, 5g + 4d = s. Solve 0 = 5l + 15 + g for l. -4 Suppose -192c + 189c - 33 = 0. Let g be c/(-22) - 45/(-10). Solve k = 2k - g for k. 5 Let z = 1276 - 1030. Solve -zw - 7 = -253w for w. 1 Suppose j + 5o = -0o - 16, -5o = 2j + 12. Let g = -5067 + 5087. Solve -jc + g = -0c for c. 5 Let p(n) = n3 + 18n*2 - 2n - 32. Suppose 0 = 3u + 13 + 41. Let b be p(u). Suppose t = -t + b. Solve 0f = -tf - 6 for f. -3 Let s(x) = -2x*2 - 144x - 910. Let c be s(-65). Solve 2d - 44 + 38 = c for d. 3 Suppose -44 = -2d - 9d. Suppose -3f - r - 55 = -69, dr = 3f + 11. Suppose -i + 15 - 3 = 0. Solve l - i = -fl for l. 3 Let j be 1578/45 + (-49)/735. Solve -37t = -2 - j for t. 1 Let g = 34 - 20. Let o be (-2)/g + 13/91 + -59. Let u = o - -71. Solve 2y - u = -y for y. 4 Let r be 1 + -2(5 - 16). Solve rv - 13v = -20 for v. -2 Let c = -32932 - -32935. Suppose -k = -2 - 0. Suppose kh - 12 = -0. Solve -cz - h = -0z for z. -2 Let p(z) = 12z. Let k be p(2). Let j = 14 - k. Let o(i) = -2i - 19. Let x be o(j). Solve g + 1 + x = 0 for g. -2 Suppose 9a + 30 - 48 = 0. Let w(v) = -v*3 + 2v + 1. Let i be w(-1). Let t be i + (3/(-3))/(-1). Solve -t + 3 = ad for d. 1 Let q(b) = 12b - 261. Let u be q(22). Let w = -8 - -13. Suppose 30 = wa + 7o - uo, -2a - 1 = -o. Solve -3 = g - ag for g. 3 Suppose -5j + 30 = 5m - 0m, 2m - 12 = 2j. Suppose 360o - 72 = 372o. Let l be ((-10)/o)/(250/300). Solve -i = -l + m for i. -4 Let r(g) = g*3 + 7g*2 + 4g - 8. Let p be r(-6). Suppose 0s - 5 = -s. Suppose -911z + 81 = -487z - 343. Solve st - p = z for t. 1 Let n(b) = -33b + 52. Let z be n(-11). Let x = -407 + z. Solve xv = 4v + 4 for v. 1 Let s be (0/((-4)/(8 - 4)))/1. Let x be (0 - s)/(3 + -2). Let b(j) = -j - 2. Let h be b(-2). Solve 2w + hw = x for w. 0 Let k(s) = -s - s - 2s - 4 + s*2. Let o be k(5). Solve o = 2t - 5 for t. 3 Let o(w) be the second derivative of -2w3/3 + 3w. Let n be o(3). Let r be 1 + 0 - (n/(-2) - 7). Solve rj = j for j. 0 Let z(b) be the first derivative of -5b*2/2 + 161b + 22. Let m be z(27). Solve -27s = -ms for s. 0 Let j(o) = -o*3 - 7o*2 - 7o - 3. Let c be j(-6). Suppose -3394 = -45g + 14336. Let x = 394 - g. Solve -ch + xh + 3 = 0 for h. 1 Let k(y) = 179y - 514. Let o be k(3). Solve 0 = 30h + oh + 371 for h. -7 Suppose -3696 = -4u + 3o, -5o = -69 + 29. Solve -920 = 10v - u for v. 1 Suppose 2x + 31 = 3x + 18. Solve 29 + 36 = -xy for y. -5 Let b = 2385 - 2350. Solve b = -35k + 28k for k. -5 Suppose -55v + 224v - 4225 = 0. Solve v = -51i + 56i for i. 5 Let l be 2/7 - -3(-6)/63. Suppose lg = -6g - 66. Let b = g + 15. Solve j - 5 = -bj for j. 1 Let l(u) = -2u*3 + 2u*2 - 2u. Let j be l(3). Suppose -f = 2i + 48, -4f - 5i - 5 = 181. Let m = j - f. Solve k + 3 = -mk for k. -1 Suppose 9 = 3t, -4a + 7 = -2t - 27. Suppose -aj - 15 = -15j, 0 = -4m - 4j + 52. Solve 5y - m = 5 for y. 3 Let g(c) = -55c2. Let q be g(-1). Let t = -45 - q. Suppose -1 = 3m - t. Solve -ml = 2l for l. 0 Suppose 2533j + 120 = 2543j. Solve -33r = -jr - 42 for r. 2 Let z be (-30)/(-25)(-4)/8(0 - 45). Solve 22c = -zc + c for c. 0 Suppose -103u - 28u + 2278 = 3u. Solve -up = -4 + 21 for p. -1 Suppose 2j + 7j =	{ "pile_set_name": "DM Mathematics" }
t the terms in 5x2 - 16185 + 16185 - 8x*2. -3x*2 Collect the terms in 1187335b*3 + 1187334b*3 - 2374668b3. b3 Collect the terms in -114 + 6a + 54 - 37a + 60. -31a Collect the terms in -906y*2 + 14 - 7 + 904y*2 - 3. -2y*2 + 4 Collect the terms in 6720x*2 - 2663x*2 + 8558x*2 + 1025x*2. 13640x*2 Collect the terms in 197j - 613j - 337j - 612j. -1365j Collect the terms in 1004u2 + u3 + 2u*3 - 884u*2 - 120u*2. 3u*3 Collect the terms in 232j - 701j - 10j*3 + 236j + 233j. -10j*3 Collect the terms in 128n*2 - 5147 + 5147. 128n*2 Collect the terms in -76992 + 76992 + 33t. 33t Collect the terms in -287b*2 - 1717b + 1717b. -287b*2 Collect the terms in -8z*3 - 199z*3 + 137 - 137. -207z*3 Collect the terms in 7c*2 + 8c*2 + 2c*2 - 21c*2. -4c*2 Collect the terms in -50k - 35k - 44k + 141k. 12k Collect the terms in -189l + 428l + 1157l. 1396l Collect the terms in -84r2 - 67r*2 + 227r*2 - 77r2. -r2 Collect the terms in 27m2 + 726m*3 - 48m*2 + 23m*2. 726m*3 + 2m*2 Collect the terms in 2u*2 - 691u*3 - 2u*2 - 1730u*3. -2421u*3 Collect the terms in -5 - 100m*2 + 3 + 29m*2 + 76m*2. 5m*2 - 2 Collect the terms in 2t - 3 + 3 + t*2 - 5t*2 + 5t2. t2 + 2t Collect the terms in 131w - 92w + 405w + 265w - 29w. 680w Collect the terms in -373l + 256l - 145l + 262l + l2. l2 Collect the terms in -3 + 4 + 828b - 768b. 60b + 1 Collect the terms in 102q + 23 + 23 + 26 - 72. 102q Collect the terms in 8791p2 - 4439p*2 - 4453p*2. -101p*2 Collect the terms in 3u + 5u - 14u + 10u + 10u - 2u. 12u Collect the terms in -3765147c3 - 4 + 3765168c*3 + 4. 21c*3 Collect the terms in -6q*2 - 7q*2 + 7q*2 - 7q*2 + 2q*2. -11q*2 Collect the terms in -2 + 490739q + 3 - 1 - 490733q. 6q Collect the terms in 11t2 + 11454043 - 11454043. 11t*2 Collect the terms in 3 - 18 - 19 + 2i - 11. 2i - 45 Collect the terms in -5t*3 + 28 + 4t*3 + 15 - 3t*3. -4t*3 + 43 Collect the terms in 14 - 15t - 5 - 10. -15t - 1 Collect the terms in 4920t*3 + 3843t*3 + 1183t*3 + 9553t*3. 19499t*3 Collect the terms in -1467918 + 1467918 + 21i*3. 21i*3 Collect the terms in 7f + 2f - 4f - f + 12f - 45f. -29f Collect the terms in -10078513563 + 10078513563 + 39h*2. 39h*2 Collect the terms in -746a - 2 + 2 - 772a + 1540a. 22a Collect the terms in -18o*2 + 325 + 316 + 319 - 1286 + 326. -18o*2 Collect the terms in -189b - b + 31b. -159b Collect the terms in 764x2 - 764x*2 + 14x*3. 14x*3 Collect the terms in 291o*2 + 78o*2 + 92o*2 - 16o*2. 445o*2 Collect the terms in 245c*3 - 81c*3 - 87c*3 - 76c3. c3 Collect the terms in -363o - 359o + 1602o - 359o - 520o. o Collect the terms in -86 - 11i*2 + 39i*2 - 24i*2 + 86. 4i*2 Collect the terms in 710m*2 + 476m*3 - 351m*2 - 359m*2. 476m*3 Collect the terms in -13n*3 - 22104123n*2 + 22104123n*2. -13n*3 Collect the terms in -23x - 25x + 59x. 11x Collect the terms in 14w - 180 - 178 + 358. 14w Collect the terms in -67k + 19 + 83 + 73k. 6k + 102 Collect the terms in 4f - 4f + 0f - 96f*3. -96f*3 Collect the terms in 204a*3 - 254a*3 - 380a*3. -430a*3 Collect the terms in 724w*3 + 1279w*3 - 2001w*3. 2w*3 Collect the terms in 158 - 4u - 4186u2 - 158. -4186u*2 - 4u Collect the terms in -1 - 120s + 3 - 1 - 7625s*2. -7625s*2 - 120s + 1 Collect the terms in 64j2 - 69j*2 - 4 + 0 + 3 + 137j*2. 132j*2 - 1 Collect the terms in 5 - 40t + 4 - 45 + 4t. -36t - 36 Collect the terms in -45742v2 + 91435v*2 - 45708v*2. -15v*2 Collect the terms in -42445907 + 42445907 + 3f*3 - 2f3. f3 Collect the terms in 45r3 + 42r*3 + 35r*3 + 34r*3 - 173r*3. -17r*3 Collect the terms in 19j + 70 + 4j2 - 3j - 16j - 2j*2. 2j*2 + 70 Collect the terms in -106x + 341x - 2x*3 - 112x - 123x. -2x*3 Collect the terms in 1 - 12 + 11 - 13685i*2 + 13687i*2. 2i*2 Collect the terms in -3h - 318h2 + 3h. -318h2 Collect the terms in 2c - 119c2 + 74c*2 - 124c*2. -169c*2 + 2c Collect the terms in -3w + 1 + 0 + 51w*3 - 12w - 2. 51w3 - 15w - 1 Collect the terms in -3b - 6231049b*2 + 6231048b*2 + 3b. -b*2 Collect the terms in -397 + 397 - 2600048j + 2600055j. 7j Collect the terms in -272v + 242v - 3 + 3. -30v Collect the terms in -7n*2 + 20n*2 - 2n*2 + 18 - 9n*2. 2n*2 + 18 Collect the terms in -15302n - 15300n - 15303n + 45900n. -5n Collect the terms in 35j3 + 98j*2 - 202j*2 - 2 + 1 + 104j*2. 35j*3 - 1 Collect the terms in -2j*2 + 150j*3 + 209j*3 - 3j2 + j2 + 330j3. 689j*3 - 4j*2 Collect the terms in -6 - 476q + 10 - 1 - 7. -476q - 4 Collect the terms in -547 + 0j - j + 976. -j + 429 Collect the terms in 61 + 29854j3 - 29845j*3 - 61. 9j*3 Collect the terms in -5415o + 16220o - 5409o + 6o3 - 5396o. 6o3 Collect the terms in -30g + 198 + 10g - 399 - 8g + 199. -28g - 2 Collect the terms in -103k*2 - k + 2k + 329k2 - 3k. 226k2 - 2k Collect the terms in 34f + 24f + 36f + 38f + 63f - 193f. 2f Collect the terms in -47i + 320i + 630i. 903i Collect the terms in 1014d + 1004d + 1005d - 4023d + 1010d. 10d Collect the terms in -31k*3 + 7k*2 - 13 + 4 - 5k*2. -31k*3 + 2k*2 - 9 Collect the terms in 62y*3 - 160y*3 - 91y*3. -189y*3 Collect the terms in -101v - 99v - 99v + 310v. 11v Collect the terms in 3d2 + 15d*2 - 21d*2 + 67d*2 - 172d*2. -108d*2 Collect the terms in -29417j - 1 + 29417j + 1 - j3. -j3 Collect the terms in 2210l*3 - 1053l*3 - 432l*3. 725l*3 Collect the terms in -26434x3 + x2 - x*2 + 26420x*3. -14x*3 Collect the terms in 3 - 673m - 8 + 8m3 + 5. 8m*3 - 673m Collect the terms in -226 - 229 - 6518358y2 + 455 + 6518356y*2. -2y*2 Collect the terms in -1 + 1 - 1513p*3 + 4754p*3. 3241p*3 Collect the terms in 23d*3 - 155d + 5d - 56d. 23d3 - 206d Collect the terms in -565c2 - 348c*2 + 214c*2. -699c*2 Collect the terms in -344124x + 688236x - 344112x - 4x2. -4x*2 Collect the terms in -137273y + 137273y - 1024y*2. -1024y*2 Collect the terms in 3219994 - 3219996 - m - 29m. -30m - 2 Collect the terms in -509524h*2 - 509530h*2 + 1019087h*2. 33h*2 Collect the terms in -59 + 8324r*2 + 59. 8324r*2 Collect the terms in -4674w + 4674w + 24w*2. 24w*2 Collect the terms in 35y + 19y - 91y + 14y. -23y Collect the terms in -1093n3 - 202n*3 + 36n*3. -1259n*3 Collect the terms in 0 - 11o + 23o - 116o*3 - 3 + 18o. -116o3 + 30o - 3 Collect the terms in -53b + 11080 - 11080 - 44b. -97b Collect the terms in -l + 2l - l - 3989l2 + 3974l*2. -15l*2 Collect the terms in 27a*2 + 35a*2 - 6a*3 - 94a*2 + 32a*2. -6a*3 Collect the terms in 527c - 1 + 1082c + 1125c - 574c. 2160c - 1 Collect the terms in -347 + 114 + 116 + 8c + 117. 8c Collect the terms in 35m3 - 131m*3 - 183m*3. -279m*3 Collect the terms in 290 + 10l*2 - 872 + 288 + 294. 10l*2 Collect the terms in -3787d3 - d2 + d*2 + 7576d*3 - 3788d3. d3 Collect the terms in 421l - 341l + 213l. 293l Collect the terms in 3 + 886j2 - 5 - j + 22j*2 + 2. 908j*2 - j Collect the terms in 235876c - 471745c + 235869c - 4c2. -4c*2 Collect the terms in -90 + 90 - 5t*3 + 8t*3 + 2t*3. 5t*3 Collect the terms in -1994a + 920a - 5a*3 + 1074a. -5a3 Collect the terms in 6b + 6b - 11b + 9b - 3b. 7b Collect the terms in 175i - 244i + 61i. -8i Collect the terms in 5f*3 - 4f*3 + 29764618f - 29764618f. f3 Collect the terms in -94t - 3 + 3 + 42t. -52t Collect the terms in 5u3 + 300u*3 + 509u*2 - 509u*2. 305u*3 Collect the terms in 238 - 1162l + 1164l + 118. 2l + 356 Collect the terms in -622551q3 - q + 622557q*3 - 5q. 6q3 - 6q Collect the terms in 6568p - 1 + 1. 6568p Collect the terms in 75 + 143 + 7555g + 0g*2 - 7555g - g2. -g2 + 218 Collect the terms in -12d2 - 2d*2 + 3066 - 3066. -14d**2 Collect the terms i	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.