Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
nearest 10000? 70000 Let c = -51 - -63. Suppose 1022 = 5q + 4b, 3b - c = -b. What is q rounded to the nearest ten? 200 Let u = 450 - 450.808. Round u to 2 decimal places. -0.81 Let x = -4 + 58. Let h = x + -54.21. Let b = h - -0.20612. Round b to four dps. -0.0039 Let n(l) = l2 - 6l - 9. Let k be n(7). Let o be -17((-111)/(-15) + k/5). Round o to the nearest one hundred. -100 Let q = -30.7 + 169.7. Let b = -139.00186 + q. Round b to 4 dps. -0.0019 Let g = -110411 - 56089. What is g rounded to the nearest 1000? -167000 Let i = 9408 - 9416.918. What is i rounded to the nearest integer? -9 Let a = 0.16777 + -0.1765. Round a to three dps. -0.009 Let x(b) = 20623b - 21. Let n(w) = 103116w - 104. Let p(q) = -5n(q) + 24x(q). Let m be p(-3). What is m rounded to the nearest ten thousand? 60000 Let u(m) = -m + 2. Let d be u(3). Let n = d + -1. Let h(l) = 635000l2. Let a be h(n). What is a rounded to the nearest 100000? 2500000 Let p(r) = r2 - 9r + 18. Let g be p(3). Suppose g = -q + 3q - 3u - 604003, -4 = 4u. Round q to the nearest ten thousand. 300000 Let x(a) = -10 + 7a + 0a*2 - 7a*2 - 26a + 3a2. Let d be x(-16). Round d to the nearest one hundred. -700 Let n = -0.073 + 0.07053. Round n to three decimal places. -0.002 Let s = -259 + 258.18. Round s to 2 decimal places. -0.82 Let s = 10.3 - 7.4. Let n = s - 2.9113. What is n rounded to 3 dps? -0.011 Let a = 736 + -329. Let o be (-1 - -1) + 1/30. Suppose o = 2h - 1733 - a. What is h rounded to the nearest 100? 1100 Let t be (-38010)/3(36/28 - -3). Round t to the nearest 10000. -50000 Let f(u) = 515u2 + 19u + 2. Let b be f(8). Let r = b - 4814. What is r rounded to the nearest one thousand? 28000 Let a = 5483.99135 - -0.00865. Let v = a + -5596.74. Let h = v - -111. What is h rounded to 1 dp? -1.7 Let r be 110560006/(-16) - 6/(-16). What is r rounded to the nearest one million? -7000000 Let n(c) = c*2 + 7c + 21. Let w be n(-4). Suppose wm + 22718091 = -9321909. Round m to the nearest 100000. -3600000 Let m = -1.5 - 0.5. Let t = -237710.99998 + 237713. Let l = t + m. What is l rounded to 4 decimal places? 0 Let t = 28.9 + 3. Let v = t - 32.029. Round v to 2 dps. -0.13 Let s = -164.1 + 163.9594. What is s rounded to 2 dps? -0.14 Let d be 1/((-4)/(-14))24/(-12). Let s be 560d/(147/900). What is s rounded to the nearest ten thousand? -20000 Let u = -17.3 + 169.3. Let q = 152.000536 - u. What is q rounded to four dps? 0.0005 Let b = -1315.4 + 464.6. What is b rounded to the nearest 100? -900 Let d = -480282 + 170282. What is d rounded to the nearest ten thousand? -310000 Let x = 821923596 + -821923676.9540598. Let z = x + -15.0459455. Let w = -96 - z. What is w rounded to six decimal places? 0.000005 Let l = 1279286 - 1279184.9949. Let t = -101 + l. What is t rounded to 3 decimal places? 0.005 Let d = 262739 - 166799. Let g = d + -95909.999958. Let y = g + -30. Round y to five dps. 0.00004 Let c = -1227 - -1226.97798. What is c rounded to 4 decimal places? -0.022 Let r = 6280097.049952 + 3.950048. Let d = 6280101.70000088 - r. Let t = -0.7 + d. Round t to seven decimal places. 0.0000009 Suppose 2q - 5t + 4574 = 5q, -4t = 20. What is q rounded to the nearest 100? 1500 Suppose 4u + 44627 = -87753. Let c = -54876 + 134971. Let o = c + u. What is o rounded to the nearest ten thousand? 50000 Let y = 27 - 7. Suppose -4d - 3a = y, -5a - 29 = 4d - 1. Let i be 6299999 - d/42. Round i to the nearest one million. 6000000 Let v = 233 + -232.999808. What is v rounded to five dps? 0.00019 Suppose -236157 = 13u - 1484157. Round u to the nearest ten thousand. 100000 Let z = -38 - -4. Let l = z - -34.000272. What is l rounded to four decimal places? 0.0003 Let y(m) = -3m3 - 11m*2 + 17m. Let a(w) = -3w3 - 11w*2 + 16w. Let n(k) = -3a(k) + 2y(k). Let x be n(12). What is x rounded to the nearest 1000? 7000 Let l(q) = -159035q - 210. Let p be l(-6). Round p to the nearest 10000. 950000 Let f = -219.66249 + -0.03751. Round f to the nearest ten. -220 Let p be ((-14)/4)/(2/(-4)). Let g be p/(42/190)-420. Round g to the nearest 1000. -13000 Let f = 0.82 + -0.6. Let u = -21.5026 + 21.28. Let d = f + u. Round d to three decimal places. -0.003 Let h = 840 + -1436. Let j = h - -596.319. What is j rounded to 2 decimal places? 0.32 Suppose 55 = 4p + p. Let y = 5 - p. Let k be 1 + -8399983/y. Round k to the nearest 100000. 400000 Let j = -22042.9943 + 22048. Let a = 1.0051 - j. Let s = a - -4. Round s to 3 decimal places. -0.001 Let y = -218 + 218.004. Round y to 2 decimal places. 0 Let m = -1055937.1042 - -1055618. Let s = 319 + m. What is s rounded to two decimal places? -0.1 Let u = 12.079831698 - 96.079831228. Let f = 84 + u. Round f to 7 dps. 0.0000005 Let f = 35.37845 + -0.06845. What is f rounded to zero decimal places? 35 Let x = -32 + 126. Let p = x + -93.99902. What is p rounded to 4 dps? 0.001 Let y(x) = x3 - x2 + 4x + 80000. Let s be y(0). What is s rounded to the nearest one million? 0 Let p = -12.8 + 11. Let l = -0.1 + p. What is l rounded to one decimal place? -1.9 Let a = -0.08477 - -77.79477. Round a to the nearest ten. 80 Let q = -61975725 + 165895725. What is q rounded to the nearest one million? 104000000 Suppose -g - 3 = -4g, -10 = -n + g. Let b(s) = 82642s2 + 27s + 21. Let h be b(n). Round h to the nearest one million. 10000000 Let m = -28.06 + 13. Let l = -15 - m. Let n = l - 0.0614. Round n to three decimal places. -0.001 Let u = -2.723 - 17.225. Let l = -20 - u. Round l to 1 dp. -0.1 Suppose 164 = -2s - 58. Let u = s - -74. What is u rounded to the nearest ten? -40 Let y be (-2 - 0) + -2 + 27. Suppose -x = -5v + y, -4v - 3 = x - 5v. Suppose 34000 = j + 5o, 2o + 102000 = 3j - xo. Round j to the nearest ten thousand. 30000 Let y(b) be the third derivative of 2/3b3 + 0b + 1/6b4 + 0 + 1/30b*5 + 3b*2. Let u be y(6). Round u to the nearest 1000. 0 Let o = 32569.78 + -32368.7881. Let t = o + -201. What is t rounded to three dps? -0.008 Let g(q) = -23250q*2 + 2q + 1. Let i be g(2). Let v be (i - -4)/(-3) + 3. Round v to the nearest ten thousand. 30000 Suppose -2r - 3748 = 11492. Round r to the nearest 100. -7600 Suppose 0 = -7n + 1356 + 1136. Let w = n - 612. What is w rounded to the nearest 100? -300 Let a = 491.0414 + -491. What is a rounded to two dps? 0.04 Let i = 106 - 105.9999567. What is i rounded to 5 decimal places? 0.00004 Let h = -93.62 + 236.99. Let o = 140 - h. Round o to the nearest integer. -3 Let i = 0.36745197 + -0.3674. What is i rounded to 6 dps? 0.000052 Let g = -50820696 - -101051836. Let k = -50231135.99999952 + g. Let q = k - 4. What is q rounded to 7 decimal places? 0.0000005 Let m = 0.07393698 + -555295362.07393698. Let r = m - -555295392.9999937. Let f = r + -31. Round f to six decimal places. -0.000006 Let p be 28315(-23 + 26). Let n = 4275 - p. What is n rounded to the nearest 1000? -8000 Suppose 0 = -f - 4s - 9345012, -2f + 8s = 10s + 18690006. What is f rounded to the nearest one million? -9000000 Let j = -127.67 + 8.72. Round j to the nearest integer. -119 Let m = 0.0506 + 3.1694. Round m to the nearest integer. 3 Let m(i) = 579i - 4. Let u be m(3). Suppose -h = -2267 - u. What is h rounded to the nearest 10000? 0 Let b(t) = 33331t - 14. Let p = 49 + -17. Suppose 5w - 2 + p = 0. Let n be b(w). Round n to the nearest 100000. -200000 Let b = -0.103 + 0.493. Let x = b - 2.2. What is x rounded to zero decimal places? -2 Let v = -5604550.999785 + 5604566. Let f = -15 + v. Round f to five decimal places. 0.00022 Let v = -5574.58 - -5629. What is v rounded to the nearest ten? 50 Suppose -b + 19 = 3g + 4b, -4b + 26 = -3g. Let d be 12/8 + 7740003/g. What is d rounded to the nearest one hundred thousand? -3900000 Let c(j) = -53545j - 10. Let r be c(2). Round r to the nearest 1000. -107000 Let m = -4359305 + 8909305. Round m to the nearest one million. 5000000 Let i = -23 + 7.5. Let y = i - -15.500246. What is y rounded to four dps? 0.0002 Let a = 43.36 - 0.36. Let q = -42.999977 + a. What is q rounded to six dps? 0.000023 Let m = 101.6 - 105. Let t = m + 3.39999763. What is t rounded to seven dps? -0.0000024 Suppose -1330989 = -33u - 0u. Suppose -3q - 4m + 9*m - 66974 = 0, 0 = 5	{ "pile_set_name": "DM Mathematics" }
= hx(r) + so(r). Let u(c) = -7c. Give w(u(z)). 7z Suppose -3u = r, 4r = -r. Let z(b) = -4b + 3b - b + ub. Let d(m) = 76m. Let i(s) = 7s. Let h(l) = -3d(l) + 32i(l). Determine z(h(f)). 8f Let m(a) = -1203a2 + 15a. Let w(k) = 301k2 - 4k. Let i(q) = -4m(q) - 15w(q). Let o(j) = -3j. Give o(i(d)). -891d*2 Let b(k) = -2k*2. Let d(p) be the second derivative of -11p6/360 - p3/3 + 8p. Let a(s) be the second derivative of d(s). Give a(b(x)). -44x*4 Let w(c) = 42c + 38c - 78c. Let b(v) = 50v + 2. Calculate w(b(j)). 100j + 4 Let r(i) = 4i2. Let l(c) be the second derivative of 0 + 0c*2 - 5/6c*3 + 2c. Let u(o) = o. Let d(t) = -l(t) - 4u(t). Give r(d(a)). 4a*2 Let h(m) = 106m*2. Let j(q) = 247q*2. Give h(j(w)). 6466954w*4 Let z(s) = -33s. Let v(o) = 51o. Let j(k) = 2v(k) + 3z(k). Let h(b) = -118b*2 - 2. Give h(j(w)). -1062w*2 - 2 Let h(n) = -24291n*2. Let p(x) = -x. Give p(h(g)). 24291g*2 Let k(z) = 170z. Let q(g) = -91g + 1. Give k(q(w)). -15470w + 170 Let f(t) = 6 + 3t - t + 2t + t. Let q(y) = -1. Let h(p) = -f(p) - 6q(p). Let c(l) = 3l*2. Give c(h(k)). 75k*2 Let i(t) = 353t. Let j(l) = 134l. Calculate j(i(u)). 47302u Let b(f) = -265 - 283 + 506 - 2f2. Let r(x) = 6x. Determine b(r(z)). -72z2 - 42 Let q(b) = b2. Let o(r) = -2866r*2 - 3. What is o(q(g))? -2866g*4 - 3 Let v(i) = -7i. Let s(j) be the second derivative of -1/2j3 + 0 - 3j + 0j2. Determine s(v(a)). 21a Let g(t) = 3t2 + 1. Let v(j) = 120j*2 + 18. Let k(u) = 36g(u) - 2v(u). Let p(x) = -2x*2. Give p(k(q)). -34848q*4 Let c(r) = -2r*2 + 1. Let m(f) = -21f*2 + 11f*2 + 12f*2 + 0f + 0f. Calculate c(m(j)). -8j*4 + 1 Let g(t) = 2t. Let u(b) = b. Let i(w) = -6g(w) + 15u(w). Let q(x) be the second derivative of -5x3/3 - 4x. What is q(i(j))? -30j Suppose -4o = -3o - 6. Let i(r) = -r. Let c(h) = 3h. Let d(q) = oc(q) + 22i(q). Let s(f) = 55f - 55f - f*2. Determine s(d(a)). -16a*2 Let b(f) = -3f*2. Let c(n) = -2n*3 + 3n*2 + 2n. Let i be c(3). Let v be (28/i)/(2/(-3)). Let q(o) = o - o + vo. Calculate q(b(w)). -6w2 Let g(s) = -s3 - 11s2 + 9s - 29. Let z be g(-12). Let a(o) = -14o - zo - 7o + 24o. Let x(q) = -3q2. What is x(a(d))? -48d*2 Let f(o) = -2o. Let y be ((-3)/9)/(-1 + 16/18). Let i(q) = 14q2 + 10q2 - q2 + yq2. Give i(f(u)). 104u*2 Let p be 1 - ((-1 - 3) + 2). Let l(t) = 10 - pt - 10. Let x(r) = r. Let d(h) = -l(h) - 4x(h). Let s(c) = -5c. Determine s(d(o)). 5o Let y(l) = 38l. Let t(r) = 2r - 17333. Give t(y(q)). 76q - 17333 Let n = 121 + 154. Suppose n = 3w - 10. Let u(v) = -95 + 4v + w. Let p(r) = 3r2. Calculate u(p(d)). 12d*2 Let z(j) = 12j*2. Let v(p) = -3p*2. Let c(s) = 9v(s) + 2z(s). Let a(x) = -x2 + 9x - 6. Let w be a(8). Let g(m) = -m + m - wm - m. Give c(g(i)). -27i2 Let m(c) be the third derivative of c4/24 + 2c2 + 30c. Let z(i) = -31i2 + 5. Let b(q) = -325q*2 + 52. Let g(w) = 5b(w) - 52z(w). Calculate m(g(p)). -13p*2 Let p(w) = -2w*2. Let k(b) = -149b*2. Let u(v) be the third derivative of -5v*5/6 - 2v*2. Let c(z) = 3k(z) - 8u(z). Calculate c(p(q)). -188q4 Let x(w) = -w - w2 + w. Let m(d) be the third derivative of -10d2 + 0d + 1/15d5 + 0d*3 + 0d*4 + 0. What is m(x(y))? 4y*4 Let o(g) = -869g*2 - 907g*2 + 1732g*2. Let h(q) = 4q. Calculate h(o(r)). -176r2 Let y(j) = -15j*2 - 2j - 2. Let i(r) = 13r2 + 3r + 3. Let k(v) = 2i(v) + 3y(v). Let z(l) = -l*2. What is z(k(x))? -361x*4 Let h(m) = 29m*2 + 5m - 5. Let x(y) = -25y2 - 4y + 4. Let c(k) = -4h(k) - 5x(k). Let j(i) = i*2 - 11i. What is c(j(r))? 9r4 - 198r*3 + 1089r*2 Let c(g) = g. Let l(j) = 4j + 8j2 + 9j - 15j + 7 + 2j. What is c(l(m))? 8m2 + 7 Suppose -3c - c + 8 = 0. Let v(q) = -q*c + 6 - 6. Let w(t) = -2t*2. Let d(f) = -4v(f) + 3w(f). Let p(x) = 21x. What is d(p(j))? -882j2 Let i(p) = 3p. Suppose 14 = 2w + 2x + 2x, -2w + 5x + 14 = 0. Let h be 8/14w/2. Let z(l) = 9lh + 0l*2 - 4l*2 - 2l*2. Determine i(z(g)). 9g*2 Let z(o) = -o. Let i = -7 + 23. Let u(x) = -ix - 3x + 6x. Give z(u(q)). 13q Let v(k) be the first derivative of 10k*3/3 + 133. Let o(w) = -w - 6. Let r be o(-9). Let i(g) = 5g + 2g - 2g - rg. What is v(i(x))? 40x*2 Let f(d) = 0d*2 + 9d*2 + 14d*2 - 21d*2. Let q(u) = -16u*2. What is q(f(c))? -64c*4 Suppose 2g - 241 - 1 = 0. Let o(p) = 275p2 - gp*2 - 132p*2. Let i(x) = -3x*2. Calculate o(i(c)). 198c*4 Let s(h) = 3h*2. Let g be (-620)/(-1) - (-3 + 0). Let o(c) = -623 + 3c + g. Calculate s(o(l)). 27l2 Let y(b) = 51622b*2. Let z(a) = -5a. What is y(z(s))? 1290550s2 Let l(q) be the first derivative of 2q*3/3 - 1. Let w(k) = -19k*2 - 3k*2 + 9k*2 - 2k*2. What is w(l(s))? -60s*4 Let r(m) be the second derivative of -9m + 0m2 + 0 - 5/2m*3. Let p(l) = 2l. Give p(r(n)). -30n Let g(z) be the second derivative of -z6/120 + 8z*3/3 - 12z. Let x(s) be the second derivative of g(s). Let n(u) = 12u2. Give x(n(r)). -432r4 Let v(c) be the third derivative of -c4/24 + 42c2. Let q(a) = -44a. Determine v(q(h)). 44h Let k(y) be the third derivative of 6y*2 + 0y + 0 - 1/20y5 + 0y*4 + 0y*3. Let i(d) = 6d*2. Calculate k(i(o)). -108o*4 Let n(l) = -5l + 1. Let i(j) = -9j + 151. Calculate n(i(k)). 45k - 754 Let s(g) = -2g2. Let o(b) = -97b*2 - 6. Let d(f) = -97f*2 - 5. Let x(v) = -4d(v) + 3o(v). Determine s(x(l)). -18818l*4 - 776l*2 - 8 Let t(x) = 2x. Let a(v) = -18v - 15. Let f(j) = -1. Let o(i) = 7. Let b(y) = 6f(y) + o(y). Let u(c) = -a(c) - 15b(c). Give t(u(d)). 36d Let z = 839 + -325. Let w(r) = -1 + 1 + zr2 - 515r*2. Let y(t) = 33t*2. Give y(w(j)). 33j*4 Let i(l) = -4l*2. Let m = 27 + -25. Let u(k) = -7k*2 + 2k + 2. Let q(p) = -266p2 + 77p + 77. Let o(t) = mq(t) - 77u(t). Calculate i(o(a)). -196a4 Let d(r) = -2587 + 2587 + 153r. Let t(v) = -2v. Give t(d(a)). -306a Let l(a) = -12a2 + 11a + 11. Suppose 13u - 132 = 10u. Let j(i) = -i*2 + i + 1. Let p(q) = uj(q) - 4l(q). Let g(d) = -3d*2. Give g(p(f)). -48f4 Let i(k) be the second derivative of -k3/3 - 6k. Let c be (-32)/144 - 22/(-18). Let q(w) = c - 36w + 32w - 1. Determine i(q(t)). 8t Let p(j) = 62j2. Let z(u) = -17200u*2. Calculate z(p(b)). -66116800b*4 Let q(c) = -70c. Let g(v) = -2 + 373v - 746v + 371v + 2. Give q(g(j)). 140j Let y(u) = 35u2. Let d(n) be the second derivative of -n4/6 + 68n - 2. Calculate d(y(o)). -2450o4 Let w(p) = -6p. Let m(j) = 4446j2. Calculate w(m(b)). -26676b*2 Let p(z) = 7z. Let h(n) = n*2 + 8n + 3. Let o be h(-5). Let x = o - -14. Let u(w) = -xw + w - w. What is p(u(r))? -14r Let a(s) be the first derivative of -s*2 - 516. Let f(l) = -77l*2 + 2. Give f(a(m)). -308m*2 + 2 Let z(o) = 8o*2 + 19o - 3. Let x(a) = 23a. What is x(z(f))? 184f*2 + 437f - 69 Let s(v) = -2v2 + 6v + 2. Let b be s(3). Let y(d) = 3d + bd + 10d - 6d. Let o(p) = -2p. Calculate y(o(z)). -18z Suppose 4v - 60 = -32. Let o(h) = 3296 - 3296 + vh*2. Let a(w) = -2w*2. Determine a(o(l)). -98l*4 Let l(f) = 20f. Let q(k) = 30k. Let u(p) = -8l(p) + 5q(p). Let h(z) = -39z*2 + 24z. Let o(t) = 8t2 - 5t. Let g(d) = 5h(d) + 24o(d). Give u(g(n)). 30n2 Let t(m) = -4m + 3. Let n(q) = -6q - 4. Let o(s) = 28s - 3 + 39s - 72s. Let d(z) = 3n(z) - 4o(z). Determine d(t(j)). -8j + 6 Let y(b) = 45b*2 - 120b*2 + 40b*2 + 36b*2. Let s(a) = -61a*2. Determine y(s(q)). 3721q*4 Let j(a) = 57a + 6. Let u(n) = -7n + 64n - 368 + 375. Let v(y) = -7j(y) + 6u(y). Let c(z) = 2z. Determine v(c(p)). -114p Let o(b) = -9b. Let c = 82 + -82. Let d(p) be the second derivative of 3p + 1/6p3 + 0p*2 + c. Determine d(o(s)). -9s Let f(w) = -3w. Let l(c) be the third derivative of c5/60 - 15c*3/2 + 3c*2 + 2. What is f(l(m))? -3m*2 + 135 Let j(s) = -8s*2. Let a(k) = 3k*2 - 225k - 2. Give a(j(m)). 192m4 + 1800m2 - 2 Let v(a) = -a2. Let q(m) = 145944m. Determine q(v(r)). -145944r*2 Let z(a) = 0 + 1 + 3a2 - 1 + a2. Let d(u) = -32u*2 +	{ "pile_set_name": "DM Mathematics" }
g be 40/(-220) - (-35)/f. Suppose 4q = gl + 14, 5l + 5q - 23 = 12. Solve ln = 3n + 1 for n. -1 Let h(t) = -t*2 + 1. Let r(x) = -3x*2 - 8x + 4. Let b(k) = 4h(k) - r(k). Let g be b(5). Let l be 9/21 - g/35. Solve 0u + u + 1 = l for u. -1 Let d = 276 + -280. Let z be (-897)/(-138) - (-2)/d. Solve zs + 13 = -11 for s. -4 Let w(y) = 260y - 1529. Let s be w(19). Solve 8d - s = -3371 for d. 5 Let y = 0 + -1. Let v be (-1 - y)(-1 - 0). Let t(f) = f + 9. Let z be t(-6). Solve -zn - 7 + 1 = v for n. -2 Suppose -5 = 5n, 3l + 5n - 149 = 29. Let f = l - 57. Suppose 0 = 3c - 3s + 12, s + fs - 20 = -5c. Solve -4q + 4 = -c for q. 1 Let v(c) = -c3 + 83c*2 + 535c + 8. Let a be v(-6). Let o = 7 + -4. Solve -ok = ak + 20 for k. -4 Suppose 92 - 97 = -j. Let w be j - 0(-3)/(-18). Solve y = -wy + 18 for y. 3 Let f be -5 - (-42)/9 - (6 - 296/24). Solve 0 = 14p + 24p + fp for p. 0 Let w(v) = v2 - 40v - 3. Let p be w(42). Solve 0 = -pj + 80j - 3 for j. -3 Let k be (1 - -2) + 338/(-39)60/(-8). Solve 5j = 43 - k for j. -5 Let y(b) = -b*2 + 10b + 1031. Let x be y(37). Solve 0 = 17z - xz + 60 for z. 4 Let q(f) = f*3 - 16f*2 - 28f + 474. Let b be q(16). Solve -35n = -9n - b for n. 1 Let w(p) = -2p3 - 63p*2 - 33p + 36. Let d be w(-31). Solve 29 - d = 23k for k. -3 Let r(q) = -74q + 1209. Let l be r(16). Solve ls = -54 + 104 for s. 2 Let c = 19466 + -19454. Solve 0 = 17x + 15x - cx for x. 0 Let j be (((-375)/(-10))/5 + -7)44. Solve 11n = 33n - j for n. 1 Suppose -2h - 4q = -14, 10 = 5q + 25. Suppose hy = 9y + 16. Solve 8 = 2c + y for c. 2 Suppose -r - 5y = 11, -r - 4y + 29 = -9y. Solve 12 = 21m - r for m. 1 Let r(v) = -v2 + 3v + 19. Suppose -6h + 5h - 8 = 0. Let t be r(h). Let n = t + 75. Solve -n = c - 3 for c. -3 Suppose 4y - j = 45, 5y = -3j - 0j + 52. Suppose a = 7 + y. Let u = a + -18. Solve -z - 1 = -u for z. -1 Let m = -1841 + 1887. Solve 38 = -2b + m for b. 4 Let d be (-261)/12 + (-3)/12 + 1. Let r be 7((-9)/21 - 27/d). Suppose 0 = -rf + 4f + 6. Solve -l + fl = 10 for l. 5 Suppose 20 = 5f - 5. Suppose 35o + 16026 = -10119. Let m = -720 - o. Solve -m = fu - 7 for u. -4 Suppose -93y + 4429 = 46y - 36y. Solve 47w + 360 = -yw for w. -4 Let w = -146 + 288. Let d be 5/7 + w/497. Solve 11c + d = 12c for c. 1 Suppose 5d - 68 = 303z - 307z, d = 4z + 28. Solve 35 + 13 = ds for s. 3 Suppose 2116 - 383 = 232d - 1283. Let a be 13 + 8/(-12)3. Solve -12j - a = d for j. -2 Let u be ((-3)/(-5))/((162/(-20))/(-27)). Suppose o = 3a + u, -3o = -6o + 15. Solve 0 = h + a - 2 for h. 1 Let o(j) = j*2 + j - 10. Let n(k) = -3k*3 - 2k*2 - 3k + 3. Let r be n(1). Let b be o(r). Solve 0 = 4z - 9z - b for z. -2 Suppose -74n + 63n + 2784 = 76n. Solve -2w - 170 = nw for w. -5 Let p(h) = -17h + 11. Let n(v) = 4v - 3. Let d(q) = 26n(q) + 6p(q). Let o be d(6). Let g be (2 + o)/(-4) - 57/(-38). Solve -g = 2j - j for j. -1 Let v(u) be the third derivative of u*4/6 + 13u*3 + 59u*2 - 1. Let w be v(-18). Solve 0 = -6m + 4m + w for m. 3 Let n = 20690 + -20496. Solve -24p = n - 26 for p. -7 Let w(l) = l*2 - 7l + 1. Let t be w(7). Let b be (((-8541)/365)/39)/((-6)/50). Solve t + b = -6x for x. -1 Suppose 2z + 5o + 584 = 0, 4z = 2z - 3o - 588. Let j = z + 302. Solve -14x + j = -9x for x. 1 Let c(r) = -18r + 66. Let i(v) = 37v - 132. Let m(u) = 5c(u) + 2i(u). Let z be m(4). Solve j - z = -4 for j. -2 Suppose w + 51 = -o + 5o, -75 = -5o + 5w. Let i(r) = 6r - 64. Let c be i(o). Solve cu = 8 + 8 for u. 2 Let k be (-2)/3 + (-23)/(-3). Solve -kz = 13z for z. 0 Let u = 560 - 551. Suppose 0 = 3p + 2j - 10, -5p + 6p = 5j + u. Solve -2l + 2 + p = 0 for l. 3 Let v = 518 + -536. Let z(h) = h2 + 20h + 48. Let m be z(v). Solve 9x - m = 6x for x. 4 Suppose 4j + j - 250 = 5u, j - 56 = 3u. Solve 0 = 41y - jy - 42 for y. -7 Suppose 11w + 158 = 510. Solve -wv = -13v for v. 0 Let j be 21/12 + 9/36. Suppose s = jr - 3s - 30, -5r - 4s + 33 = 0. Solve 0 = k + 8 - r for k. 1 Let o = 354 - 321. Solve on = 14n for n. 0 Let p = -73 + 98. Suppose -3k + p - 37 = 0, 3a - 3k - 12 = 0. Solve -s + a = -1 for s. 1 Suppose 15 = -23y + 26y. Let s(h) = -h2 + 14h + 10. Let d be s(14). Suppose 13k = 8k + d. Solve kq - 12 = yq for q. -4 Let r(x) = -15x2 - 15x - 55. Let v(n) = -7n2 - 8n - 28. Let a(o) = -6r(o) + 13v(o). Let p be a(-10). Suppose -pz = -z. Solve -4u + z = 20 for u. -5 Let u be (60/50)/((-108)/30 - -4). Suppose -a + 237 = 2a. Suppose 0 = -w - uw + 5b + a, 4b + 12 = 0. Solve 5g + 9 = -w for g. -5 Let d = -3265 + 3315. Solve 9p = dp - 164 for p. 4 Let j(n) = n3 + 5n*2 - 3. Let w be j(-5). Let h be 54/(-6)1/w. Let v be (-6)/(-8) - (-10)/((-200)/(-285)). Solve -h = -4p - v for p. -3 Let f = -15840 - -15903. Solve -f + 55 = -2m for m. 4 Let y be (405/(-90))/((9/(-102))/3). Suppose 8s + 9s = y. Solve -23 - 4 = -sd for d. 3 Let r(p) = -p2 - 3p + 1. Let c(x) = -x*2 + x. Let z(h) = -c(h) - r(h). Let j be z(1). Let f be (8 - 10) + 4/6j. Solve 0y + 4y = f for y. 0 Suppose 330 - 846 = -6b. Suppose -19c + 314 - b = 0. Solve 13h - 2 = ch for h. 2 Suppose 21v - 22v = 0, 3v + 37 = f. Solve g + f = 34 for g. -3 Suppose 0 = 5v + 3n + n - 125, 3v - 75 = n. Suppose v = -5q, 2t + 5q = -3t. Suppose -tz = -0 - 15. Solve -1 = zl - 13 for l. 4 Suppose -52a + 519 + 7 = -202. Solve -az - 257 = -299 for z. 3 Let s(j) = -27j - 100. Suppose 24 = 10u - 16u. Let t be s(u). Solve tf - 13f - 5 = 0 for f. -1 Suppose 190x - 30 = 184x. Let i(f) = -f3 + 6f*2 - 7f + 11. Let y be i(x). Let n = 38 - 38. Solve 0 = -nr + r - y for r. 1 Let c = 2746 + -2743. Solve 4i = c - 23 for i. -5 Let k be 6(-3)/((-3)/1). Suppose -1336 = 11j + 15j - 1986. Solve v = kv + j for v. -5 Let g(l) = -2l - 101. Let x be g(-48). Let s(j) = 3j*2 + 17j + 10. Let a be s(x). Solve -8u + u = a for u. 0 Suppose -5j = i - 74 - 1064, 0 = 4j + 4i - 904. Let u = -215 + j. Solve 3g = -u + 1 for g. -4 Let l = 232 + -227. Suppose -ly = -o, 7y = o + 5y. Solve 2q - 10 + o = 0 for q. 5 Suppose -u + 4 = 0, -127u + 41 = 3y - 122u. Solve -2 - 19 = -yx for x. 3 Let u(o) = -o2 - 7o + 8. Let j(m) = 2m2 + 7m + 7m - 16 - m. Let l(a) = 4j(a) + 7u(a). Let q be l(-5). Solve -qc - 5 = 5 for c. -5 Let o(l) = -2l3 - 4l*2 + 14l + 68. Let i be o(-4). Solve -76n + 95n = -i for n. -4 Suppose 1616 = 4p + 384. Let h be (-7)/(p/(-8)) + (-20)/(-11). Solve 3b - 13 - h = 0 for b. 5 Let c = -349 - -349. Let l be c/(2 + -1)(8 + -7). Solve l = -2z - 6 for z. -3 Suppose l - 152 = 95f - 100f, -2l + 286 = 4f. Solve lj - 304 = 99j for j. 8 Let k = 22814 - 22586. Solve 16r + k = -22r for r. -6 Suppose -80f - 110 = -4z - 82f, 0 = z + 4f - 52. Solve 0 = 56y - zy for y. 0 Suppose 3b = 21, 2b = n - 1352 + 1296. Solve -98o + n = -84o for o. 5 Suppose -2299 = 3j - 139. Let f = 725 + j. Solve fi - 4 = 6 for i. 2 Suppose 0w + 4w = 3w + 344. Solve 13z = -30z + w for z. 8 Let o(b) = 7b*3 + 3b*2. Let y be o(-3). Let w = y - -165. Solve w = -q + 2q for q. 3 Suppose t + 189 = 4t. Suppose 2v + t = 11. Let f = v + 26. Solve fo + 1 = -o for o. -1 Suppose 10q = 6q + 20. Let a be (2 - 3)4 - -28. Suppose 2c - 4j - 10 = -c, -3j - a = -qc. Solve n + n = c for n. 3 Suppose -4j - 15 + 27 = 0. Suppose b - jb + 44 = 0. Suppose b - 12 = 5h. Solve hm - 4 = m for m. 4 Suppose -23 - 1 = -2z. Let r = -339 - -634. Let g = -290 + r. Solve gp - p + z = 0 for p. -3 Suppose 2r = 13 + 67. Suppose 45a - 50a = -r. Solve -10o = -12o - a for o. -4 Let a(y) = 6y + 75. Let g(k) = 2k + 24. Let w(x) = 4a(x) - 11g(x). Let u be w(-18). Solve -7d + 4d + 3 = u for d. 1 Suppose 4w - 4s - 276 = 0, -2w + s = 2w - 264. Let b = w + -15. Let k = b + -46. Solve -17 = kx - 1 for x. -4 Let z be (11 + -20)/9(-3)/(-6)0. Solve 30k + 44 + 16 = z for k. -2 Let w be (-2)/15 - 3385/(-75). Suppose 4q + 0q = -3f + w, 6q - f = 95. Let j(p) = 2p + 1. Let h be j(1). Solve -hz + 6z = q for z. 5 Suppose 15i + 44 = -151. Let y be 8(i/2)/(-13). Solve -s = y - 8 for s. 4 Let y(z) = 3z2 + 86z + 323. Let i be y(-25). Solve i*m = 253 - 13	{ "pile_set_name": "DM Mathematics" }
late the smallest common multiple of 40 and 7. 280 Calculate the common denominator of -101/2 and 37/36. 36 Calculate the common denominator of 82/21 and -107/56. 168 Calculate the smallest common multiple of 55 and 2090. 2090 Calculate the common denominator of 28/15 and -149/3732. 18660 What is the common denominator of 111/10 and -143/1812? 9060 Find the common denominator of -1/10 and 99/1382. 6910 Find the common denominator of -16/7 and 64/507. 3549 What is the common denominator of -37/336 and -77/30? 1680 Calculate the least common multiple of 46 and 146. 3358 What is the least common multiple of 1 and 66? 66 What is the least common multiple of 6119 and 2? 12238 What is the lowest common multiple of 66 and 21? 462 What is the smallest common multiple of 3 and 39? 39 What is the common denominator of -17/768 and -137/864? 6912 Find the common denominator of 93/16 and 63/3986. 31888 What is the smallest common multiple of 28 and 24? 168 Find the common denominator of 6/1021 and 33. 1021 Calculate the smallest common multiple of 52 and 3. 156 What is the least common multiple of 65 and 7? 455 Find the common denominator of -4/21 and -19/15. 105 What is the lowest common multiple of 7907 and 4? 31628 Calculate the least common multiple of 8 and 28. 56 What is the lowest common multiple of 8 and 61? 488 What is the least common multiple of 68 and 36? 612 Calculate the least common multiple of 1104 and 144. 3312 What is the common denominator of 59/13384 and 107/18? 120456 What is the lowest common multiple of 50 and 1950? 1950 What is the common denominator of 13/192 and -65/2016? 4032 Calculate the lowest common multiple of 968 and 616. 6776 Find the common denominator of -97/6 and -1/9890. 29670 Calculate the least common multiple of 8432 and 8. 8432 What is the common denominator of 29/360 and 29/3640? 32760 Calculate the common denominator of -121/80 and 47/112. 560 What is the least common multiple of 48 and 54? 432 What is the lowest common multiple of 270 and 108? 540 What is the common denominator of 43/178 and -59/156? 13884 Calculate the lowest common multiple of 12 and 33. 132 What is the common denominator of -101/14 and -1/28? 28 Find the common denominator of -5/28 and 73/314. 4396 Calculate the lowest common multiple of 11 and 496. 5456 Calculate the common denominator of -47/1062 and 41/3304. 29736 What is the lowest common multiple of 50 and 20? 100 Calculate the least common multiple of 126 and 1134. 1134 Calculate the least common multiple of 162 and 4. 324 What is the common denominator of 2/13 and -31/2054? 2054 Calculate the common denominator of 71/22 and 55/182. 2002 What is the least common multiple of 63 and 66? 1386 Calculate the smallest common multiple of 350 and 42. 1050 Calculate the common denominator of -14/99 and -9/10. 990 What is the common denominator of 51/20 and -27/170? 340 Calculate the least common multiple of 310 and 558. 2790 What is the common denominator of -45/8 and 41/57? 456 Calculate the smallest common multiple of 16152 and 32. 64608 What is the smallest common multiple of 132 and 18? 396 Calculate the common denominator of -19/2800 and -73/60. 8400 Find the common denominator of -33/632 and -107/1580. 3160 Find the common denominator of -85/1736 and 44/5859. 46872 What is the least common multiple of 2 and 52? 52 Calculate the common denominator of 37/50356 and 11/8. 100712 Calculate the smallest common multiple of 16 and 5. 80 Calculate the common denominator of -55/72 and -49/6. 72 What is the smallest common multiple of 264 and 22? 264 What is the least common multiple of 150 and 33? 1650 Find the common denominator of 91/2214 and -37/22. 24354 Calculate the lowest common multiple of 35 and 70. 70 What is the lowest common multiple of 490 and 120? 5880 Find the common denominator of 57/766 and -13/8426. 8426 What is the least common multiple of 352 and 320? 3520 Calculate the common denominator of -32 and 19/5782. 5782 Calculate the common denominator of -149/840 and -127/252. 2520 What is the least common multiple of 1734 and 306? 5202 Calculate the lowest common multiple of 1936 and 1694. 13552 What is the lowest common multiple of 568 and 284? 568 What is the common denominator of -89/46 and 9/34? 782 What is the common denominator of 13/174 and -65/54? 1566 Calculate the common denominator of 95/24 and -103/1680. 1680 Find the common denominator of 95/68 and -43/88. 1496 Calculate the common denominator of -58/147 and -137/168. 1176 Calculate the common denominator of -113/2844 and 79/84. 19908 What is the common denominator of -33/4030 and 151/30? 12090 Find the common denominator of -91/1650 and -109/660. 3300 Find the common denominator of -4/603 and -48/871. 7839 What is the least common multiple of 3810 and 9? 11430 What is the common denominator of -7/5 and -47/30? 30 Calculate the common denominator of -9/160 and -69/40. 160 What is the common denominator of -17/58 and 75/28? 812 Calculate the common denominator of -131/130 and 18/55. 1430 Calculate the common denominator of 121/606 and -41/30. 3030 What is the common denominator of -143/6 and 83/52? 156 What is the common denominator of 23/380 and -83/1640? 31160 Find the common denominator of -91/328 and 17/24. 984 Find the common denominator of 27/1180 and 71/16. 4720 What is the least common multiple of 9154 and 22? 100694 What is the lowest common multiple of 50 and 42? 1050 What is the smallest common multiple of 22 and 1518? 1518 Calculate the common denominator of -29/63 and 65/1197. 1197 Find the common denominator of -49/796 and -131/18. 7164 Find the common denominator of 34/77 and -46/77. 77 Find the common denominator of 1/2 and 75/3028. 3028 What is the least common multiple of 10 and 144? 720 Find the common denominator of -11/27 and -7/417. 3753 Find the common denominator of 83/12 and 61/108. 108 Find the common denominator of 1/2220 and -77/255. 37740 Calculate the least common multiple of 55 and 1380. 15180 What is the smallest common multiple of 24 and 5976? 5976 Calculate the smallest common multiple of 40 and 170. 680 What is the common denominator of 39/1604 and -97/72? 28872 What is the lowest common multiple of 7887 and 264? 63096 What is the lowest common multiple of 8 and 8324? 16648 What is the least common multiple of 782 and 51? 2346 Calculate the lowest common multiple of 91 and 182. 182 Calculate the common denominator of 137/1470 and -53/2310. 16170 What is the lowest common multiple of 36 and 892? 8028 Calculate the common denominator of 16/33 and 37/30. 330 Calculate the least common multiple of 18 and 304. 2736 Calculate the least common multiple of 43 and 5. 215 Calculate the smallest common multiple of 9 and 273. 819 Calculate the smallest common multiple of 200 and 275. 2200 What is the lowest common multiple of 462 and 1134? 12474 What is the common denominator of -85/178 and 7/22? 1958 What is the smallest common multiple of 30 and 54? 270 Find the common denominator of 35/22 and 17/9782. 107602 Calculate the common denominator of -93/53396 and 9/8. 106792 Find the common denominator of 163/60 and -91/36. 180 What is the lowest common multiple of 9 and 5755? 51795 Calculate the least common multiple of 7 and 17523. 122661 What is the smallest common multiple of 5082 and 10? 25410 What is the least common multiple of 728 and 52? 728 Calculate the least common multiple of 580 and 464. 2320 What is the common denominator of -13/560 and -13/14? 560 Find the common denominator of -63/4 and -69/20. 20 Calculate the smallest common multiple of 78 and 234. 234 Find the common denominator of 73/32 and -1/54. 864 What is the lowest common multiple of 429 and 156? 1716 Calculate the lowest common multiple of 5 and 386. 1930 Find the common denominator of 3/5 and 65/1884. 9420 Find the common denominator of 83/788 and 143/12. 2364 What is the smallest common multiple of 91 and 26? 182 Calculate the least common multiple of 102 and 34. 102 What is the least common multiple of 444 and 1184? 3552 Find the common denominator of 37/164 and 63/82. 164 What is the common denominator of 123/20 and -53/11380? 11380 Find the common denominator of 39/34 and -121/80. 1360 Calculate the common denominato	{ "pile_set_name": "DM Mathematics" }
- 4 for z. 4 Let d be ((-1)/2)/(1/(-34)). Suppose -5 = -3y - 2k, 7k - 3k + d = 3y. Solve -2 - 1 = yh for h. -1 Suppose 0u = -2u. Suppose -6o = -3o - 12. Suppose q + o = -uq - 4r, 4q + 4 = -4r. Solve q = -2j - 2 - 8 for j. -5 Suppose 19 - 3 = 4u. Solve -t = -ut + 9 for t. 3 Suppose 5m + 3b + 15 = 0, 5b + 23 = -5m - 2. Suppose z = -10 - m. Let l = z + 10. Solve n - 5n = l for n. 0 Let g be (-4)/(-10) + 3/5. Let f(h) = h*2 + 2h. Let i(m) = 2m + 9. Let t be i(-6). Let l be f(t). Solve 2s - l = -g for s. 1 Let v = -9 + 9. Suppose 3f - 12 = -vf. Solve -fo + 2o = 8 for o. -4 Let n be (-2)/(-6) + (-40)/(-15). Suppose b - 5 = -n. Solve -5o + b = -3 for o. 1 Let d(c) = 2c + 15. Let q be d(-7). Solve -2o - 11 = -q for o. -5 Let t be ((-75)/20)/((-3)/8). Solve v = 3v - t for v. 5 Let b(z) = -z*3 + 5z*2 - 2z - 4. Let s be b(4). Suppose -5k - t - 32 = 0, 0k - 3k - st - 9 = 0. Let j = -5 - k. Solve -ja = -6a for a. 0 Suppose -2s = -0s. Let u be s + -3 + (-18)/(-6). Solve -5k = -5 - u for k. 1 Let r(q) = -q + 4. Let g be r(4). Solve gb + 5 = -b for b. -5 Let b(k) = -k*2 + 8k - 8. Let j be b(6). Suppose -m = -2m. Solve 2y + my = j for y. 2 Let y be ((-8)/12)/(2/12). Let s be (-2 - 1y) + 10. Let v be ((-5)/((-10)/s))/2. Solve 2b - 7 = v for b. 5 Let k = 61 - 58. Solve -u = -2u - k for u. -3 Suppose 4u - 5x = -2x + 17, -2u = -5x - 5. Solve 3q + 2q = -u for q. -1 Let n = 16 + -13. Solve -nt - 1 + 4 = 0 for t. 1 Let m(g) = g*2 + 12g + 5. Let q(j) = 3j2 + 35j + 14. Let b(s) = -7m(s) + 2q(s). Let t = 14 - 20. Let y be b(t). Solve 5i + 16 - y = 0 for i. 5 Let t = -11 + 10. Let u be 18(t/3 - -1). Solve 0g = -3g - u for g. -4 Suppose -m + 5m - 20 = 2a, -a + 5m - 19 = 0. Let o = 12 + a. Solve 3d + o = 5d for d. 4 Let w be (-18)/(-171) - (-93)/19. Let l be (2/5)/(1/5). Suppose -2 = 2j - wb + 2, -2j - lb = -24. Solve -2f = j + 2 for f. -5 Let y = 0 - -2. Suppose 3n = -yn. Solve 3a - 12 = -n for a. 4 Let t be (1 - (-7)/(-9)) + (-34)/(-9). Solve t = 3y - y for y. 2 Suppose 0 = -5h - 2 + 12. Suppose -7 = s - 16. Let d be (-6)/h(s + -10). Solve 3u + 0u = -d for u. -1 Suppose -12 = -s - 3s. Suppose 0 = -sw + 6 + 3. Let g = 9 + -9. Solve -wj + 7j = g for j. 0 Let o(b) = -b*2 - 6b + 5. Let n be o(-6). Suppose 0m + m + 5z = 24, 0 = -4m - nz + 36. Solve -m = 3p - 1 for p. -1 Suppose -3m - 6 = 6. Let y(t) = t - 5. Let g(q) = -q + 9. Let f(x) = mg(x) - 7y(x). Let k be f(-1). Solve -ks + 0 = 2 for s. -1 Suppose 0 = 4c - 2c - 10. Suppose n - 5v = -3n + 18, 3v = cn - 16. Solve nh - 10 = -0h for h. 5 Suppose 0 = -13m + 10m. Solve m = 5r + 13 - 3 for r. -2 Let l(n) = n*3 - 5. Let p be l(2). Solve r = pr - 10 for r. 5 Let p(h) = h. Let o be p(0). Solve or = -4r - 8 for r. -2 Let h(q) = -2q + 1 + 7q*2 - 5q*2 + 5q*2. Let k(w) = -10w*2 + 3w - 1. Let l(z) = 7h(z) + 5k(z). Let j be l(2). Solve i - 4 + 2 = j for i. 2 Suppose 2k - 8 = -2r, -2k + 4r + 20 = -0k. Solve 3i = -0i - k for i. -2 Let a(y) be the first derivative of 2y*2 + 1/4y*4 - 6y - 2 + 7/3y3. Let h be a(-6). Solve d - hd = 0 for d. 0 Let s(v) be the first derivative of v*3/3 + 4v*2 - 2v - 4. Let l be s(-9). Solve -lz + 2z + 10 = 0 for z. 2 Let f = 19 + -16. Suppose -2g + 8 = -i, 3g = -fi + 8i + 12. Solve 13 = gx + 1 for x. 3 Let u = -12 + 16. Suppose 2z + uf = -3z + 10, z - 4f - 2 = 0. Solve z = -y - 2 for y. -4 Let b(d) = -4d - 9. Let p be b(-6). Suppose 5v - 2v = p. Solve -v = 3n + 10 for n. -5 Suppose -6 = -4r + 6. Suppose -30 = -6h + h. Suppose hm - rm = 0. Solve -2 = 2y - m for y. -1 Suppose -5i + 24 + 21 = 0. Suppose -14 = -y - 3s, 0s - i = -3s. Suppose 4v = 2z + 10, -3z - z - 8 = -yv. Solve x = -4 + z for x. -1 Suppose 2r - 15 = -3r. Let p(n) = -2n2 + 41n + 27. Let o be p(21). Suppose o = -ry + 6y. Solve y = 5a - 3 for a. 1 Let a = -2 - -4. Suppose -2w = 5c - 13, -12 = -3c + w - a. Let v = 3 + -3. Solve -cm + 3 + 6 = v for m. 3 Let z = -6 + 8. Let f(a) = 10a*2 - 3a. Let j be f(z). Let k = j - 9. Solve -k = -6v + v for v. 5 Suppose 12 + 20 = 4x. Suppose 5t - 7 - x = 0. Solve t = -2y + 9 for y. 3 Let z be 10/(-35) - (-4)/14. Suppose -t + 0 + 3 = z. Solve 0 = 3i - t + 6 for i. -1 Let l = 16 + -15. Solve u - l - 1 = 0 for u. 2 Let l(a) = a + 1. Let o(i) = i3 - 3i*2 - 6i + 6. Let s be o(4). Let d be l(s). Let c be (2 - 3) + (d - -6). Solve -cw + 10 = -6 for w. 4 Suppose 4i + 3 = 5i. Let t(w) = -w3 + 2w*2 - 1. Let q be t(1). Solve qx - 9 = ix for x. -3 Let i be 1/3 + 130/(-30). Let f = i - -6. Solve -fk + k + 1 = 0 for k. 1 Let s = -22 - 3. Let r = 28 + s. Solve 3o - r - 3 = 0 for o. 2 Let k be (8/12)/((-1)/(-9)). Suppose -2h - 4q = -0q - 10, 3q = -2h + 9. Solve 3w + h = kw for w. 1 Let b(p) = -p*3 + 12p*2 - 9p - 5. Let s be b(11). Suppose -4q - 5o - s = -0q, 2 = -4q - 2o. Solve -2 = qh + 4 for h. -3 Suppose 3i + 22 = j, 2i + 0i + 3j = 0. Let m = -4 - i. Let q be (0 + (2 - m))/(-1). Solve 2l - 7l + 25 = q for l. 5 Suppose -2w + 22 = -3r, 0 = 4r + 4 + 4. Solve w = 4m - 2m for m. 4 Suppose -4a = u + 3u, 0 = -u - 2a - 2. Let w = 3 + -2. Let o(f) = 13f - 1. Let l be o(w). Solve l = ux + x for x. 4 Let y be 120/18(-12)/(-10). Suppose -y = -2d - l, -2d = 3d + 4l - 17. Solve -10 = -ds + 5 for s. 3 Suppose -9 + 5 = -w. Suppose -5k - 9 = 5c - w, 2c - 5k - 19 = 0. Solve s - 4 + c = 0 for s. 2 Let z(f) = -2f - 2. Let i be z(-5). Suppose id = 4d. Suppose d = 2w + 3w. Solve w = l + 3 - 6 for l. 3 Let c = -2 - -5. Suppose 15 = ch + 2h. Solve w = -hw + 8 for w. 2 Suppose 7c - 10 = 2c. Solve -4 + 14 = -ci for i. -5 Let q = -25 + 88. Let n = q - 43. Let f(d) = d - 1. Let s be f(4). Solve 0 = sg + g - n for g. 5 Suppose 0 = -8q + 4q + 16. Suppose 0i - 6 = i + 2h, -5h = qi + 9. Solve 2w - i = w for w. 4 Suppose 0 = -5n - 5v, -2n - 10 + 30 = -2v. Suppose -2f - 6s + 3s = -13, 3f = -5s + 21. Let r = n - f. Solve -rl - l = 0 for l. 0 Let h be 3 - (-4 + 7)/3. Suppose 0 = 2d - 5b + 14, 2b - 14 = -hd - 0b. Solve -dz = -0z for z. 0 Let r = -2 - -17. Let q = -5 - -7. Suppose 0 = qf + f - r. Solve 2l = fl for l. 0 Let o(v) = v3 - 2v*2 - 3v + 1. Let m be o(3). Let g(w) = 5w2 - 2w + 1. Let u be g(m). Solve -un = 7 + 1 for n. -2 Suppose -3t + 14 = i, 2i + 12 = 6i + t. Suppose im - 5m = 0. Let w = -5 + 10. Solve 0 = -mo + wo - 5 for o. 1 Let o(f) = -f*3 - 6f*2 - 2f - 9. Let u be o(-6). Solve 12 = -0a - ua for a. -4 Let a be ((-18)/(-4) - 4)4. Solve -p = a + 3 for p. -5 Let q(b) = -b + 3. Let v be q(-10). Let w = 19 - v. Solve 0 = -wo + o + 5 for o. 1 Let j be 1/1 + 1 + 0. Suppose -3b + 2w - j = 0, -b - 4 = -5w + 1. Solve b = g + 2g for g. 0 Suppose 2q - 15 = 13. Let f(r) = r - 12. Let x be f(q). Let z be 20/(-5)(0 - 1). Solve xj - z = -0 for j. 2 Suppose -4a + n + 2n = -11, 4n + 6 = a. Solve 0 = -ai + 15 - 7 for i. 4 Let y be (0/(-5 + 4))/(-2). Solve y = -z + 5 for z. 5 Let v be (12)/((-4)/6). Let l(g) = -3 - 3 - 2g + 5 + 0. Let t be l(v). Solve ts = 2s + 12 for s. 4 Suppose -9 = 5g - 4g. Let y be 5/4 - g/12. Solve 7s = ys - 15 for s. -3 Let v(a) = a - 6. Let q be v(-6). Let k = q + 21. Solve -p + 4p = k for p. 3 Let y be (-2)/(-4)16/4. Suppose 0 = 3r - 3p - 12, p + 16 = -yr - 3p. Solve 5j = -20 - r for j. -4 Let b be (4/(-8))/(1/(-12)). Solve -2k = -bk for k. 0 Suppose -6a + 2a + 8 = 0. Solve -2p = -0p + a for p. -1 Let m = 20 - 2. Suppose j - 3 - 1 = 0. Solve jp + 2 = m for p. 4 Let v be 13 - (-2 - (-1)/(-1)). Solve w - v = -3w for w. 4 Let x = 30 - 28. Solve xh + 0h = 10 for h. 5 Let i(s) = -s*2 - 8s - 4. Let u be i(-7). Solve 0c + u = 3c for c. 1 Let r be (2/(-2))/((-1)/8). Let o be 28/r(-4)/(-2). Solve -3s + 5 + o = 0 for s. 4 Suppose -h + 2w + 8 = 0, 2h + w - 2w = 4. Let d = 5 - -11. Suppose -i = -5i + d. Solve -io + o = h for o. 0 Let v be -5 + 2 + 0 - -7. Let o = v + -4. Solve -5t + 14 + 6 = o for t. 4 Suppose 0 = f + f - 10. Let v be ((-20)/(-3) + 0)3. Solve v = -fm + m for m. -5 Let s be 1/(((-25)/(-10))/5). Solve -3h - sh = 10 for h. -2 Let s be (0 + -1)/((-4)/12). Suppose s*	{ "pile_set_name": "DM Mathematics" }
lve -12c = 22c + 374 for c. -11 Solve -132c + 131c = -3 for c. 3 Solve -2j + 421 = 417 for j. 2 Solve 13 - 113 = 20j for j. -5 Solve -119 - 378 = -71u for u. 7 Solve 0 = -38h + 166 - 14 for h. 4 Solve a + 1 = 12 for a. 11 Solve 20 = -16w - 12 for w. -2 Solve 0 = 6y - 532 + 514 for y. 3 Solve 6252 = 9a + 6333 for a. -9 Solve -7t + 4t = -12 for t. 4 Solve 0 = 7j + 13 + 22 for j. -5 Solve -6w = -14w + 32 for w. 4 Solve 3q = 4q - 8q for q. 0 Solve -16 = 30g + 14 for g. -1 Solve 40n - 50 = -250 for n. -5 Solve 330y = 333y + 9 for y. -3 Solve 4w = 10w + 18 for w. -3 Solve -51f + 52f - 4 = 0 for f. 4 Solve 25i + 65i + 810 = 0 for i. -9 Solve 0 = 49w - 35w + 98 for w. -7 Solve 6x + 48 = 72 for x. 4 Solve -24 + 4 = -5m for m. 4 Solve -2m - 22 = 9m for m. -2 Solve -6w + 36 = 3w for w. 4 Solve 0 = 294t - 302t for t. 0 Solve 1 = 12b - 11 for b. 1 Solve 0 = -1731x + 1725x + 12 for x. 2 Solve 0 = -2n + 10 for n. 5 Solve -6b + 2 = -16 for b. 3 Solve 23j - 2 = 24j for j. -2 Solve -1688y + 1686y + 10 = 0 for y. 5 Solve 0 = 6r - 10r - 13r for r. 0 Solve 14u - 14 = 7u for u. 2 Solve -2s - 9s - 33 = 0 for s. -3 Solve -4a = -964 + 944 for a. 5 Solve -a - 54 = -49 for a. -5 Solve -3w + 3 + 3 = 0 for w. 2 Solve z - 2z + 0z = 0 for z. 0 Solve 255 - 10 = -35a for a. -7 Solve 0 = 16w + 20 - 4 for w. -1 Solve -164z - 155 = -133z for z. -5 Solve -3 = 4b + 9 for b. -3 Solve 3a - 21a + 36 = 0 for a. 2 Solve 0 = 18t - 8t + 30 for t. -3 Solve -192 = -22r - 258 for r. -3 Solve 129f - 115f - 42 = 0 for f. 3 Solve 0 = 11n - 4n + 28 for n. -4 Solve -9w + 9 = 9 for w. 0 Solve -9r = 39 - 66 for r. 3 Solve 11c + 8 + 14 = 0 for c. -2 Solve 12 = 43o - 117 for o. 3 Solve 103s - 8 = 107s for s. -2 Solve -36 = -18s + 6s for s. 3 Solve 39i - 62 = 55 for i. 3 Solve -37 = -4l - 53 for l. -4 Solve 197m - 125m = 720 for m. 10 Solve 25p + 288 = 121p for p. 3 Solve -95 = 37y + 53 for y. -4 Solve 0 = 15g + 8g - 115 for g. 5 Solve 13z - 1258 + 1193 = 0 for z. 5 Solve 0 = 30z + 13 + 17 for z. -1 Solve 7 = 11a - 4 for a. 1 Solve 0 = 11n - 8n - 9 for n. 3 Solve 0g + 9g = 45 for g. 5 Solve 64l - 66l - 4 = 0 for l. -2 Solve -12d - 16 = -8d for d. -4 Solve 123 = 23l - 61 for l. 8 Solve 3k - 78 = 16k for k. -6 Solve -3y + 6y + 12y = 0 for y. 0 Solve -3q - 163 + 166 = 0 for q. 1 Solve 14 = -5v + 39 for v. 5 Solve -73 = -8q - 97 for q. -3 Solve 89v - 103v = 70 for v. -5 Solve 6 - 3 = r for r. 3 Solve -2t + 4t = 6t for t. 0 Solve -10h + 18 = -h for h. 2 Solve 2 = 25q - 26q for q. -2 Solve -131 = 3z - 122 for z. -3 Solve -19b - 40 = -23b for b. 10 Solve 55o + 4o - 413 = 0 for o. 7 Solve -165v + 156v = -72 for v. 8 Solve -11l + 4 = 37 for l. -3 Solve -6k - 11k - 51 = 0 for k. -3 Solve 0 = 8l + 210 - 210 for l. 0 Solve 5i + 576 = 581 for i. 1 Solve 0 = 54n - 71n - 136 for n. -8 Solve 5j + 142 - 107 = 0 for j. -7 Solve 45 = -11w + 1 for w. -4 Solve 0 = -11k + 10k + 2 for k. 2 Solve 10j - 9j + 4 = 0 for j. -4 Solve -10 = -131k + 133k for k. -5 Solve 5h = 12 - 27 for h. -3 Solve 0 = -120j + 111j for j. 0 Solve 11 = 13m - 106 for m. 9 Solve -2l - 7 + 1 = 0 for l. -3 Solve 171m - 140 = 185m for m. -10 Solve -6w = 2w - 24 for w. 3 Solve 0 = -518x + 529x + 77 for x. -7 Solve 2q - 8 - 2 = 0 for q. 5 Solve 10x = 52x + 252 for x. -6 Solve 0 = -44r + 40r + 8 for r. 2 Solve 4r = 6r for r. 0 Solve 4t + 10 + 10 = 0 for t. -5 Solve -7m - 16m = 46 for m. -2 Solve -84 = -11a - 128 for a. -4 Solve -4s + 691 = 707 for s. -4 Solve -4p - 3 = 1 for p. -1 Solve -73 = -n - 79 for n. -6 Solve -1 + 3 = s for s. 2 Solve 70 = 22r + 48 for r. 1 Solve 14m = 26m + 48 for m. -4 Solve -i = -0i for i. 0 Solve 54 = 11x + 21 for x. 3 Solve 0 = -169u + 171u + 10 for u. -5 Solve -21 = 5w - 1 for w. -4 Solve -60 = -83x + 68x for x. 4 Solve 0 = -722r + 729r + 21 for r. -3 Solve -6t + 5t = -4 for t. 4 Solve 70 = -45o + 340 for o. 6 Solve -5s = 2 + 8 for s. -2 Solve 24 + 0 = -6t for t. -4 Solve -83m = -86m + 3 for m. 1 Solve 3f - f + 4 = 0 for f. -2 Solve 0 = -y - 46 + 40 for y. -6 Solve 5t - 3 = -28 for t. -5 Solve -44 = -10y - 4 for y. 4 Solve 0 = 10t + 39t - 343 for t. 7 Solve 77x - 83x = -12 for x. 2 Solve -66k = -61k - 25 for k. 5 Solve 0 = -r + 55 - 57 for r. -2 Solve 0 = -17y + 15y - 8 for y. -4 Solve 20d + 54d - 148 = 0 for d. 2 Solve 0 = 77t - 171 + 17 for t. 2 Solve -24 = 16q - 22q for q. 4 Solve -5h - 5 = 5 for h. -2 Solve -12d = -7d + 25 for d. -5 Solve 0 = 16z + 12z + 9z for z. 0 Solve 15s - 37s + 88 = 0 for s. 4 Solve -669 = -6u - 711 for u. -7 Solve 8p - 13 = -37 for p. -3 Solve 3z + 56z - 354 = 0 for z. 6 Solve 8b - 42 = -18 for b. 3 Solve 10l + 54 = 4 for l. -5 Solve -2h + 41h + 156 = 0 for h. -4 Solve 3m = -960 + 957 for m. -1 Solve -r - 10 = 4r for r. -2 Solve -10w = -7w - 21 for w. 7 Solve 3k - 24 = -6 for k. 6 Solve 7n + 33 = 40 for n. 1 Solve 0 = 2z - 19 + 15 for z. 2 Solve -14d + 13d = 3 for d. -3 Solve -159 = -5i - 184 for i. -5 Solve 0 = 61p - 81p - 80 for p. -4 Solve 2p - 5 = 3 for p. 4 Solve -13o - 20 = -3o for o. -2 Solve 90 = -10a + 28a for a. 5 Solve 114 + 68 = -26k for k. -7 Solve -42f - 8 = -44f for f. 4 Solve -7i + 15 = 1 for i. 2 Solve -40 = -61r + 53r for r. 5 Solve -34o = -6o + 224 for o. -8 Solve 0 = -7a - 973 + 938 for a. -5 Solve 12z = 14z + 4 for z. -2 Solve -170 = -65v + 82v for v. -10 Solve -10n = -21 + 61 for n. -4 Solve 13d = 6 + 20 for d. 2 Solve -22k = 25k + 517 for k. -11 Solve 4b = -13 + 17 for b. 1 Solve -19y + 4y = -75 for y. 5 Solve 154c = -24 + 332 for c. 2 Solve 7g = 10g + 3 for g. -1 Solve -137 = 19n - 23 for n. -6 Solve 5p = p for p. 0 Solve -26m - 186 + 4 = 0 for m. -7 Solve 45 = -230o + 225o for o. -9 Solve -19q + 16 = 73 for q. -3 Solve 6t + 23 = 11 for t. -2 Solve 3c = 5c + 6 for c. -3 Solve -40 = 16x - 6x for x. -4 Solve 0 = 33q - 6 + 138 for q. -4 Solve 33 = -5a + 28 for a. -1 Solve -62 = 68v - 606 for v. 8 Solve -2a + 12a + 40 = 0 for a. -4 Solve 0 = -30o + 115 + 65 for o. 6 Solve -19v + 98 = -16 for v. 6 Solve -8a + 7a = -5 for a. 5 Solve -43d - 17 - 69 = 0 for d. -2 Solve 4c - 5 = 5c for c. -5 Solve -1161t = -1197t + 252 for t. 7 Solve 11 = -13x - 54 for x. -5 Solve 0 = 16d - 4d - 12 for d. 1 Solve 10b + 18474 = 18464 for b. -1 Solve 0 = f - 62 + 59 for f. 3 Solve -8j + 9j = -3 for j. -3 Solve -5u - 7 + 27 = 0 for u. 4 Solve 0 = -125i + 116i for i. 0 Solve 237o = 241o + 12 for o. -3 Solve -88a = -87a for a. 0 Solve 9k = 5k - 12 for k. -3 Solve -7v = -12v - 25 for v. -5 Solve -38k - 71 = 81 for k. -4 Solve -26z = -36z + 40 for z. 4 Solve -55d + 59d + 8 = 0 for d. -2 Solve -28 - 222 = -50l for l. 5 Solve -17k - 51 - 17 = 0 for k. -4 Solve -36 = 5r - 21 for r. -3 Solve -540 + 530 = 10u for u. -1 Solve 478m - 466m - 60 = 0 for m. 5 Solve -20 = 6c - 14 for c. -1 Solve -7 = -11n - 40 for n. -3 Solve 12l + 524 = 500 for l. -2 Solve 0 = 8r - 15 - 25 for r. 5 Solve -9d - 14 = 5d for d. -1 Solve -24n = 23 + 1 for n. -1 Solve 0 = -11p + 125 - 158 for p. -3 Solve 36g + 9 = 27g for g. -1 Solve -230 = 32w - 262 for w. 1 Solve -198 = 25b - 23 for b. -7 Solve -38w = -74w + 25w for w. 0 Solve 22 = -135t + 146t for t. 2 Solve 20f + 45 = 5 for f. -2 Solve 4109u = 4108u - 9 for u. -9 Solve 0 = h + 11 - 4 for h. -7 Solve 0 = 7j - 5 - 2 for j. 1 Solve 9 = 10p - 7p for p. 3 Solve 119v - 84 = 105v for v. 6 Solve 6l - 9 = 9 for l. 3 Solve 0 = 11s - 6s - 25 for s. 5 Solve 0 = -4c - 2c + 6 for c. 1 Solve -241 = -3m - 238 for m. 1 Solve 0c + 3c = -c for c. 0 Solve -14u + 103 = -117u for u. -1 Solve 108b = 69 + 39 for b. 1 Solve -9t = 7t + 64 for t. -4 Solve -11 = y - 6 for y. -5 Solve -5h = -24h + 57 for h. 3 Solve 12 = 10y - 7y for y. 4 Solve -4d = 29d - 231 for d. 7 Solve 0 = -7s + 3s - 16 for s. -4 Solve 15a + 8 = 11a for a. -2 Solve 32 = -5h + 37 for h. 1 Solve -36 = 7o + 5o for o. -3 Solve 10r + 8 - 8 = 0 for r. 0 Solve 16b + 153 = 41 for b. -7 Solve 3306l - 210 = 3327l for l. -10 Solve 30h - 68 = -158 for h. -3 Solve 0 = 6*p - 226 + 274 for p. -8	{ "pile_set_name": "DM Mathematics" }
dm + 3dhm2 - 11hm wrt m. 2a*2dh - 44a*2d + 6dh Find the third derivative of 2lu*2 + 4luy*3 + 8ly + 2u*2y*3 + 2u*2y2 - y3 wrt y. 24lu + 12u2 - 6 Find the second derivative of 803c*2 - 596c wrt c. 1606 Find the third derivative of -213a6 - 10a*2. -25560a3 What is the third derivative of j2k3x*2 + 71j*2k*3 + 3j*2 + 39jk2x*2 - jk*2 wrt k? 6j*2x*2 + 426j*2 What is the first derivative of -33k*2 - 2k - 187 wrt k? -66k - 2 What is the second derivative of -7i*5 + 51i*3 + 479i wrt i? -140i3 + 306i Find the second derivative of -2d3m - 4d3 + d2m*2 - 22d*2m + 64dm*2 + dm + 2m wrt d. -12dm - 24d + 2m2 - 44m Differentiate 2586w2 - 1841 with respect to w. 5172w Differentiate -7b2lr - 2bl + 52br - 13544lr wrt b. -14blr - 2l + 52r Differentiate 503q3s - 762q3 wrt s. 503q*3 What is the third derivative of -800b6 + b5 - 6b2 - 211? -96000b*3 + 60b*2 What is the derivative of my*2 - 27my - 13m - 389y2 + 14y - 1 wrt m? y*2 - 27y - 13 Find the second derivative of 882q3 + 2q - 563 wrt q. 5292q Differentiate -2322k*4 - 773. -9288k*3 What is the second derivative of 523f*2 + 171f wrt f? 1046 What is the first derivative of d*2jl2 + 18d*2jl - 2dj - 2jl + j - 5l*2 wrt d? 2djl*2 + 36djl - 2j What is the third derivative of 512q*6x + q*4x*3 - 40q*2x*3 - 2 wrt q? 61440q*3x + 24qx*3 What is the second derivative of 44h*5 - 9h + 10 wrt h? 880h3 What is the derivative of 1894c*3g + 2c2g + 4342g wrt c? 5682c*2g + 4cg Find the first derivative of 19433u - 6866 wrt u. 19433 What is the first derivative of -248p*3 - 3p*2v*2 - 3p + 1428v2 wrt p? -744p*2 - 6pv2 - 3 What is the third derivative of 4231f*6l + 2f4l*3 - 1088f*2l*3 + 2f*2 wrt f? 507720f*3l + 48fl*3 What is the derivative of 13g - 125 wrt g? 13 Differentiate 17x3 + x - 94 wrt x. 51x*2 + 1 Find the first derivative of -102bt4 + 2bt2 - 19b + 1 wrt t. -408bt*3 + 4bt What is the third derivative of -11533m3 - m2 + 2649? -69198 Differentiate j*2q + j*2w + 2j2 + 459jw - 2q - 1791w - 4 wrt j. 2jq + 2jw + 4j + 459w Find the third derivative of -350i*2n3 + i2n - 7in6 - in2 - n2 + 3630n wrt n. -2100i*2 - 840in3 Find the third derivative of 58h*4 - 21h*3 - 5502h*2. 1392h - 126 Find the third derivative of 2r5 + 230r*3 + 3r*2 + 257r. 120r2 + 1380 What is the second derivative of f2j*2p + 11f2p3 + f2p2 - fj*3p*2 - 96fjp - 2j3 wrt p? 66f*2p + 2f2 - 2fj3 Find the second derivative of 3h*5x*2 + 497h*2x*2 + 6hx2 - 4h + x*2 - 2x wrt h. 60h3x*2 + 994x*2 Find the second derivative of 7811a*5 - 4a - 304. 156220a3 What is the third derivative of 710z*3 - 476z*2? 4260 Find the third derivative of 119z*4 - 3z*3 + 2805z*2 wrt z. 2856z - 18 Differentiate -i*2q + 43i2 + 2iq2 - 236q*2 wrt i. -2iq + 86i + 2q2 Differentiate 16k*3 + 79k*2 - 7391 with respect to k. 48k*2 + 158k What is the second derivative of -8j3w2 - j3w + j2w*2 + 7jw2 - 2w*2 wrt j? -48jw2 - 6jw + 2w*2 Find the second derivative of -630d*2q*2 + 2dq2 - 11q*2 - 1 wrt d. -1260q*2 What is the first derivative of 5k*3m - k*2m*3 + 2km3 - 571m*3 wrt k? 15k*2m - 2km*3 + 2m*3 Differentiate 10n*2v + 2n2z + nvz - 3v with respect to z. 2n*2 + nv What is the second derivative of -5f2k*2uw - f2u - 2f2w*3 - 3fk2w*2 - fuw - 9fw3 - 3uw wrt f? -10k*2uw - 2u - 4w3 What is the third derivative of ab*3l - 2ab*3 + 7abl + 2a - b3l + 300b3 - b2l + 10b2 - 2l wrt b? 6al - 12a - 6l + 1800 Find the third derivative of c*4g + 2215c3g + 64c2 + 23g wrt c. 24cg + 13290g Find the first derivative of 32t*3 - 3t + 23 wrt t. 96t2 - 3 Find the third derivative of 8h*6 + 11h*4 - 211h*2 + 1 wrt h. 960h*3 + 264h Find the third derivative of -52w5 - 3w*4 + 119w*2. -3120w*2 - 72w Differentiate -4k3 - 26k*2 - 274 wrt k. -12k*2 - 52k Differentiate -92a3 + 93 wrt a. -276a*2 Differentiate 325m*2z - 6mz - 1228z + 7 wrt m. 650mz - 6z What is the derivative of -2291gm*2 - 2gz + 1056m*3z - 3m3 wrt z? -2g + 1056m3 Find the third derivative of 27f*3l*3 - 2f*3l*2 - 2f*3 + 3fl3 + 36l wrt l. 162f3 + 18f What is the first derivative of -t*3 + 174t - 215? -3t2 + 174 Find the third derivative of -19ak5 + ak*4 + 12ak3 - 4ak2 - 85ak wrt k. -1140ak2 + 24ak + 72a Find the third derivative of -4c2h*4k*2 - 275c*2h*2k*2 + ch*4 + 3ch2 + 2h*3 wrt h. -96c*2hk2 + 24ch + 12 Find the second derivative of 2gk2 - 2gkl*3 - 4gkl*2s*3 + 2gks*3 - 2gl3s*2 + gls3 + 14k*2l*3 + 19k*2s*3 wrt k. 4g + 28l3 + 38s3 What is the second derivative of -g2l2p*2 + 23g*2l*2p + g*2lp2 - 21g*2p*2 + 2g*2p + gp2 wrt l? -2g*2p*2 + 46g*2p Find the first derivative of 207j4 - 2j*3 - 3054. 828j*3 - 6j*2 What is the second derivative of -443o*3 + 1589o wrt o? -2658o Find the second derivative of 80m*5w*2 - 2m*2w*2 - 3m - 59w2 - 1 wrt m. 1600m*3w*2 - 4w*2 Differentiate 158i*2 + 154. 316i Differentiate -h*3j*3 - 119h*2j*3 + 91j*3 - 2 wrt h. -3h*2j*3 - 238hj3 What is the first derivative of -20k*3q*2 - 1487k*3 - kq*2 - 19q*3 wrt q? -40k*3q - 2kq - 57q2 What is the second derivative of 91q*2u*3 - 135q*2u - 6qu*4 - 2q + 2u wrt u? 546q*2u - 72qu*2 What is the second derivative of 20q*3 + 4q*2 - 1925q? 120q + 8 Find the third derivative of 49k*3 - 239k*2 wrt k. 294 What is the second derivative of 963k*3 + 6k*2 + 1504k wrt k? 5778k + 12 What is the third derivative of -275a*3ck - a3k*2 + 2a*3k + 6a2ck + 3a*2k*2 + 3ak2 + ck*2 wrt a? -1650ck - 6k*2 + 12k Find the second derivative of -56n4 - 32n + 2 wrt n. -672n2 Find the third derivative of 1916a*3 - 2a*2 - 354a - 1 wrt a. 11496 Find the second derivative of 3i3s*3 + 72i*3s*2 - 10i*3 - 10is + s3 wrt s. 18i*3s + 144i3 + 6s Find the third derivative of -36d5f - 7d3f*2 - 80d*2f - 2f2 wrt d. -2160d*2f - 42f2 Find the second derivative of -5d*2il2 - 61d*2il - d - il2 + l2 - 21l wrt d. -10il2 - 122il Find the second derivative of -3ru3 + 2ru2 - 49ru + 4u*4 - 2 wrt u. -18ru + 4r + 48u2 Find the second derivative of 643c*3h*3t - 7c3t + 3cht + 8ch + 2ct - 13h*3 wrt c. 3858ch3t - 42ct What is the third derivative of 3382s6 + 39s*2 - 26? 405840s*3 What is the derivative of 7cjy + 7cj + 11c - 3y wrt y? 7cj - 3 What is the derivative of 2h4 + 66h*2 + 690? 8h*3 + 132h Find the second derivative of -9r4 + 10r*2 - 670r. -108r2 + 20 What is the third derivative of 4v*6 - 245v*3 - 5v*2 - 2v - 288 wrt v? 480v3 - 1470 Find the first derivative of 20828y + 19693. 20828 Find the second derivative of -78u3w*2 - 7u*3 + 2u*2w3 + w3 + 80w wrt w. -156u*3 + 12u*2w + 6w Find the third derivative of 203i*4 - 2i*3 + 1423i*2 wrt i. 4872i - 12 What is the derivative of -3q2r*4 - 36q*2 + 61qr3 wrt r? -12q*2r*3 + 183qr2 Find the third derivative of -329b*4 - 351b*2 wrt b. -7896b Find the third derivative of 8557b3 - 3b*2 + 401b wrt b. 51342 Differentiate h*2r*2 - 2h*2 - 11hr + r2 + 7 with respect to h. 2hr2 - 4h - 11r Find the third derivative of 6723c*3 + 178c*2 - 2c - 3 wrt c. 40338 What is the first derivative of -1231y - 1309? -1231 What is the third derivative of -1416p*4 + 532p*2 - 3p wrt p? -33984p What is the second derivative of 9lv2w*2 + 4lvw*2 - 2lvw - 2lw - v*2w*2 - 14v*2w wrt w? 18lv*2 + 8lv - 2v*2 What is the derivative of 12bku + bk - 2	{ "pile_set_name": "DM Mathematics" }
2 - 25v3 - 20 + 20 + 0v*3 as rv*3 + t + gv*2 + zv and give r. -25 Rearrange (-5o + 5o - o + (0o + 2o - 3o)(12 - 3 + 4))(-4 + 1 + 2) to the form uo + i and give u. 14 Rearrange (-10v - 9v + 4v)(3 - 5 + 4) to sv + n and give s. -30 Express o2 - 2o + 191o3 - 2o*2 - 188o*3 as yo*3 + p + ho*2 + co and give h. -1 Rearrange -17a2 - 1 + 2a + 3 - 1 + 11a2 to ka + t + va2 and give v. -6 Express (2 + 2 - 3)(-b - 2b + 4b)(-b - b - b) as tb*2 + fb + i and give t. -3 Rearrange ((3 - 2 - 3)(1 + 3 - 6) + 0 - 1 - 1 - 2 + 5 - 2)(-177 + 18f + 177) to v + wf and give w. 54 Rearrange -o + 4 - 4 to go + j and give g. -1 Express 12s - 19s + 21s as ms + l and give m. 14 Rearrange (0 + 0 - 1)(-2s2 + 4s2 - s2) - 36s2 + 23s*2 + 51s*2 to the form us*2 + vs + q and give u. 37 Rearrange (-n + n - n*2)(-1 + 5 - 6)(-3 - 2 + 3) to c + ln + wn2 and give w. -4 Rearrange -1 - 13b + 4 - 3 to the form sb + v and give s. -13 Rearrange 28z*2 + 480 + z - z - 483 to the form rz*2 + iz + b and give b. -3 Rearrange -3 + 5n2 - 3n*2 + 14193n - 14185n + 0 + 0 + 2n*2 + (1 - 1 + 2)(4n2 - n2 - n2) - n + n + n2 to the form qn + on2 + t and give o. 9 Express 60l - 57 + 57 in the form ul + p and give u. 60 Rearrange (q + 2 - 2)(q*3 + 0q*3 - 3q*3) - 18 + 18 - 7q*4 + (-2q - q + q)(-3q*3 + 2q*3 + 3q*3) to cq + pq4 + iq*2 + f + nq*3 and give p. -13 Express (-93i - 56i + 1 + 188i)(1 - 3 + 0) as f + si and give f. -2 Express (14 + 10 - 7)(-5 + 0 + 4)((1 + 0 + 1)(5z - z - 2z) + 1 + 2z - 1) in the form c + wz and give w. -102 Rearrange -2 - y2 + 2 - 5 + 2y*2 - 2y*2 + 5y*2 + (-y + 2 - 2)(-y + 0y + 2y) - y*2 + 0y*2 + 2y*2 to the form ly*2 + vy + d and give l. 4 Express 3c2 - 3c*2 - 2c*2 + (3c + 4c - c)(-4c + 3c + 0c)(-1 + 4 - 2) as hc2 + a + tc and give h. -8 Rearrange -4y2 + 4 + 2y*2 - 3 + 2y*3 to the form xy*2 + jy + ny3 + q and give n. 2 Express (2c*4 + 9 - 9)(2 - 3 - 1) + c - 5 + 2c4 + 5 as ac*2 + nc*3 + dc + s + jc4 and give j. -2 Rearrange (-y2 + y2 - 3y*2)(-92 + 92 - 12y) to the form qy + m + ry2 + jy*3 and give j. 36 Express (-2 + 6t*2 + 11t*2 - 6t*2)(t + 2t - t) in the form nt*3 + ht*2 + ft + a and give h. 0 Rearrange (3z3 - 3z*3 + 2z*4)(4 - 5 + 3) - 17z4 - 13z*4 - 16z*4 to v + fz*4 + cz*3 + dz*2 + qz and give f. -42 Express 6d2 - 2 + 1 + 1 as hd*2 + j + rd and give j. 0 Rearrange 15a - 6a*2 + 2a*2 - 13a to ma2 + ra + h and give m. -4 Express -m*2 - 10m*2 - 17m*2 in the form jm + fm2 + p and give f. -28 Express (4d - 4d + 2d)(-2 + 2 - 1) - 5d + 2d + 7d - 3 + 2d + 3 + (0 + 1 + 0)(2d + 0 + 0) + 4d - d - 5d in the form kd + t and give k. 4 Express -75u4 + 73u*4 + 1 - 2u3 + u3 as au3 + j + cu*4 + wu*2 + su and give c. -2 Express a - 4a + 34 + 3a - 2a in the form n + ra and give n. 34 Rearrange -5j4 + 0j*3 + 0j*3 + (-22j*3 + 59 - 59)(2j + 2j + 2 - 2j) to the form bj*4 + g + hj*2 + lj + pj3 and give b. -49 Express (2 - 1 - 5)(2f + 4f - 4f) in the form pf + j and give p. -8 Express -72g + 13222 + 241g - 13222 as lg + h and give l. 169 Express 2c2 + c2 - 8c3 - c2 + 7c*3 in the form m + wc + tc2 + hc*3 and give m. 0 Rearrange -59a*2 - 29a*2 - 11a*2 to the form f + ua + ka2 and give k. -99 Express 62n*2 + 70n*2 + 12n*2 + 36n*2 as ln + cn2 + w and give c. 180 Rearrange 3c*2 - 4c*3 - 9c*3 + c + 6c*3 - 3c to the form jc2 + pc*3 + w + fc and give p. -7 Rearrange -2015o + 6o*2 + 2015o to the form z + no + qo2 and give q. 6 Rearrange (1 - d2 - 1 + (0 - 1 + 2)(d2 + 4 - 4) - d2 + 3d2 - d2)(-3d*2 - 139 + 139) to od*4 + f + id + jd3 + xd*2 and give f. 0 Rearrange 9l - 15l + 9l - 3 + 2l to the form nl + y and give n. 5 Express (0p3 + 3p*3 - 5p*3)(4 - 4 + 2p) + 3p*4 + 2p - 2p + (2p*4 - 1 + 1)(6 - 2 - 3) as hp + j + up*4 + lp*3 + mp*2 and give h. 0 Rearrange 0v + v - 3v + (-2 + 2 + 3v)(-3 - 3 + 2) + (-6v + 2v + 3v)(-2 - 1 + 4) to x + mv and give m. -15 Rearrange -107d2 - 7d*2 + 6d*2 to the form p + td*2 + qd and give t. -108 Rearrange (-x - 5x + 7x)(0 + 0 - 2x) + x*2 - 2x*2 - 2x*2 to gx + f + ux2 and give u. -5 Express 2i + 82 + 87 + i*3 - 2i*2 - 172 in the form j + ai*3 + pi + mi2 and give p. 2 Express -3y*3 - 5 + 2y*2 + 2y*3 + 16 - 9 - 5y*4 in the form by*3 + q + dy*2 + iy*4 + oy and give q. 2 Express 0 - 1 + 8v3 + 3v4 + v2 - 10v3 in the form dv + m + hv3 + bv*4 + uv*2 and give m. -1 Express -4j*2 + 2j*2 + 0j3 + j3 + 3j + j4 as xj*2 + oj + sj3 + y + cj*4 and give o. 3 Express -17m*2 + 4m*2 - 8m*2 in the form im*2 + bm + r and give i. -21 Express (0 + 3b - 2b + 2)(-5b*2 + 7b*2 + 5b*2 + (2b - 5b + b)(b - 4b + b) + 2b - 2b - 2b*2) in the form ib + r + ub3 + wb*2 and give w. 18 Express (11 - 17 + 10)(-4 + 4j + 4) as c + rj and give r. 16 Express 2k - 3k + 0k + (-4 + 4 + 2k)(-2 - 1 + 5) + k - 2 + 2 + 1 - 1 - 3k in the form i + uk and give i. 0 Rearrange 2a - a - 4a + (-1 - a + 1)(-6 + 2 - 2) to fa + v and give f. 3 Express 2r*3 + 3r*4 + 54r + 2 - r*4 - 41r - r*2 in the form zr + xr3 + tr*2 + dr4 + j and give d. 2 Rearrange z2 - 34 + 18 + 20 to the form hz + w + cz*2 and give w. 4 Rearrange -10 + d + 6 + 9 to the form od + a and give o. 1 Rearrange 75c + 72c - 201c to p + xc and give x. -54 Rearrange (0d + 2d*2 - 3d - 7d)(2d - 2d + d) to the form cd2 + td + l + sd3 and give s. 2 Express -3g*4 - 3g*4 - 2g*4 + (0g*3 + 3g*4 + 0g*3)(0 + 0 - 3) as dg4 + fg*2 + yg*3 + tg + h and give t. 0 Express (7j - 6j*2 - 7j)(-8j + 16j + 11j) as cj2 + mj*3 + n + oj and give m. -114 Rearrange -12n - 17n + 4n + 2n to the form w + jn and give j. -23 Express -86c*2 + 88c2 - c3 + 0c3 as tc + dc2 + j + bc3 and give b. -1 Rearrange (g2 + g*2 - 7g*2)(6 + 2 + 19) to the form w + vg + qg*2 and give q. -135 Rearrange 3m - 5m + 13m + 4m to the form v + nm and give n. 15 Express -3 - 3w + 3 - 2w in the form mw + y and give m. -5 Express d3 + d3 + 0d*3 + (-2d*2 + 2d - 2d)(1 + 3 - 6)(-d - 2 + 2) + 9d*3 + 33d*3 + 0d*3 as wd + od2 + m + gd*3 and give g. 40 Rearrange 4j*3 + 2j - 3j2 + 0j*3 - 2 - 5j*4 - 5j*3 to ij*4 + tj*3 + yj*2 + r + uj and give i. -5 Rearrange 24k + k3 + k3 - 26k to the form lk3 + xk*2 + ak + j and give l. 2 Rearrange -10u - 4u + 10u + 1 to zu + x and give z. -4 Express (0 - 23 + 6 + 3b)(5b - 2b - 2b) as n + tb + lb2 and give t. -17 Express 57d - 5d2 - 57d - 36d2 in the form nd + o + vd2 and give v. -41 Express -6s*2 - 2s*4 + 8s*2 + 2s*3 - 3s + 5s as ms*3 + cs*2 + j + zs + xs4 and give z. 2 Rearrange (-k - 3 + 3)(0 + 0 - 4k) - 14k + 14k + 6k*2 to ak + d + mk2 and give m. 10 Rearrange 10u*2 + 0u - 7u3 + 0u - 13u2 to pu*3 + cu*2 + h + zu and give c. -3 Express -2r2 - r2 + 9r*2 + 7r*2 in the form t + fr + lr2 and give l. 13 Rearrange (6 - 9 + 4)(2 - 4 - 3)(-4d*4 + 3d*4 + 3d*4) to ad*4 + md + qd2 + gd*3 + t and give a. -10 Rearrange (-6u + 8u + 39u)(-6 + 4 - 2) to nu + q and give n. -164 Rearrange (0s2 - 3s*2 + 4s*2 + (-3 - 3s + 3)(-5s + 0s + 3s))(9s - s - s)(0 - 3 + 1) to the form y + fs*3 + zs + ps2 and give f. -98 Express -1 + i2 - i3 + 3 + 3i*2 + (2i - 2 + 2)(i2 + 0i*2 + 0i*2) + 7i3 + i3 - i*3 as mi + yi3 + ki*2 + t and give t. 2 Express 38n + 6n2 - 38n + (n + 2n - 2n)(2n + 4n - 2n) in the form ln + vn*2 + d and give v. 10 Rearrange 4 - 7b*3 - 9b*4 + 3b*4 - 2b + 5b4 - 6 to the form nb*4 + db + cb3 + zb*2 + o and give o. -2 Express 12i*2 + 7i*2 + 3i*2 - 5i*2 in the form yi + bi2 + j and give b. 17 Express (-2r - 1 + 1)(-1 + 1 + 3r + (1 - 2 - 2)(-3 - 1 + 2)(2 - 2 - 4*r))	{ "pile_set_name": "DM Mathematics" }
is greater: g or -1? g Let b = 33 - 33.3. Let h = 3.4 - 3.8. Are h and b unequal? True Let s = -1732 - -12127/7. Do 143 and s have the same value? False Let j = 4.54 + -2. Which is bigger: 3 or j? 3 Let l = 1545 + -1545.19. Which is smaller: l or 0.021? l Let z = -15.66 + -0.34. Let t = z - -6. Let m = t + 11. Is -8 smaller than m? True Let v = 15 + -11. Let x(b) = -b*3 + 7b*2 - 4b - 5. Let c be x(6). Suppose -6 = -cr + 5r. Which is greater: r or v? v Let l = 1 - -1. Suppose -10 = -li - 4. Suppose 14t = 20t - 18. Is t <= i? True Let d = -18653/3764175 + -1/4857. Is d equal to 1? False Suppose 0 = 5o + 3m + 33, -5m + 17 + 3 = 0. Let t = o - -14. Suppose 3y - 17 = -3a + 7y, -a + y = -t. Is 5/3 less than a? True Let t = 10 + -11. Let l be (-2)/(20/2)(-25)/50. Which is smaller: l or t? t Let z = -389 + 247. Which is bigger: z or -144? z Suppose 2x = -20x - 176. Suppose 0 = -78w + 75w - 15. Is w bigger than x? True Suppose 4h = -7 - 1. Let u be 6/10 + 4 + (-344)/40. Which is smaller: h or u? u Let f(c) = -c2 - 2c + 3. Let y be f(-3). Suppose -q + 3j + 5 = y, 2q + j - 15 = -5. Let t be ((-1)/q)/(36/(-150)). Which is greater: t or 1? 1 Let c(o) = -5o - 2. Let b be c(-1). Suppose 2 = -2k, 4q + 1 + 0 = bk. Let z = q - -1. Are -6/5 and z nonequal? True Let q = -2 - -3. Let i = 19 + -7. Let l be 1 + 1 - 7/i3. Which is smaller: q or l? l Let o = -22 + 33.2. Let q = o - 0.2. Let v = q - 19. Is v bigger than -1/4? False Let h = 8.43 - 10.43. Which is greater: -57.5 or h? h Suppose -5r + 3276 = 3721. Which is smaller: -91 or r? -91 Suppose 13o + 112 = 6o. Let g be o + 20 - (-1 + -11). Is g less than or equal to 16? True Let b(t) = t*3 - 5t*2 - 67t + 13. Let d be b(11). Let w = 0.3 + 0.1. Let u = -0.5 + w. Is d != u? True Let l = 2 - 11/5. Let a = 1013.3 + -1014.6. Which is bigger: a or l? l Let q(r) = -r - 10. Let s be q(-12). Suppose 4k = sv - 32, -2v - 3k + 59 = 2k. Let d be v/(-24) - (-10)/40. Which is smaller: d or -2? -2 Let i be -9 - (-10810)/(-50) - (-4 - -10). Is -230 greater than or equal to i? True Let r be 9/(-9) + 1 + -3. Suppose -2 = -3m + i - 0, -3i + 8 = -2m. Let t = r - m. Which is smaller: t or -11/3? t Let s = 7 + -11. Let t = 1627/4 + -410. Does s = t? False Let y be (-1437)/2522 - -4. Let l = 55/14 - y. Is l bigger than 12? False Suppose 0 = 4r - t - 5, 3r - t - 3 = -0. Suppose -r = -6f + 8f. Which is bigger: f or 1/5? 1/5 Let s(p) = p3 + 8p*2 - 4p + 19. Let n be s(-8). Let k = -52 + n. Is 3/11 less than or equal to k? False Let i be (-18)/(-63) + 467/7. Let c be (170 - 0)((-40)/25 - -2). Is c less than or equal to i? False Let d = -17 + 22. Suppose 4v = -5g - 12, 4g + dv + 2 = -4. Is -0.6 at least g? True Let i(c) = 7 - 4 - 12c + 7c. Let t be i(2). Is t at least as big as 1? False Let q = 186 + -182. Let u = -3 - -7. Let j be q(4 - 0)/u. Is j at least as big as 2? True Suppose -5j + 4y + 31 = 0, -3j + 8j - 5y = 35. Suppose 8 = 3c + 2p, 4p - 16 = -jc - 0p. Is c smaller than -2/31? False Let p(u) = 3u - u - 5u - 44u2 - 1 + 4u. Let h be p(1). Which is greater: -43 or h? -43 Let g(i) = -7i3 - 48i*2 + 6i - 7. Let b be g(-7). Is b > 2/115? False Let u(t) = 2t3 - t2 - t - 1. Suppose -6g - 3 = -3g. Let a be u(g). Let o(m) = -2m*3 + 4m*2 - 3m + 1. Let s be o(2). Which is smaller: s or a? s Suppose z - 5z = 56. Let d = 12 + z. Which is greater: d or -3? d Let j be 63/128/(-3). Let k = -7 - 9. Are j and k unequal? True Let j(w) = -w*3 - 13w*2 + 14w. Let t be j(-14). Let z be 57 + (t - (0 - -3)). Let l = -1135/21 + z. Is l smaller than 1? True Let z be 1324 + 36/162 + 210/27. Which is bigger: 1334 or z? 1334 Let v be 73/(-8) + 10/80. Are -13 and v unequal? True Suppose 4g - 2g = 3k + 10, 0 = 4g + 2k - 4. Suppose i - 2i = -gq - 10, -i + 20 = -4q. Does i = -3/20? False Let u = -587.76 + 574. Let g = u + 13.8. Is 3/2 at most as big as g? False Let y = -0.204 - 0.296. Let d = 0.82 - 0.12. Let l = -0.8 + d. Which is smaller: y or l? y Let y(n) = -n*2 - 4n - 5. Let r be y(0). Suppose 3x + 0x = -21. Let w = 5 + x. Is w equal to r? False Suppose 3z - 5 = 7. Suppose 18 = zu + 6. Suppose -2k + uk + 2 = 0. Which is smaller: k or -14/9? k Suppose -16c = -0c - 704. Suppose g - c = a + 3a, 5a - g + 55 = 0. Which is greater: -10 or a? -10 Let x(f) be the second derivative of -f5/20 - f4/4 + f3/6 + f2/2 + 24f + 2. Let j be x(-1). Is -8 bigger than j? False Let a = 27 - 191/7. Which is greater: a or -6? a Let l = -2831/8 + 356. Which is smaller: 1 or l? 1 Suppose -g + 84 = 6g. Let d = g + -11. Does d = 2/3? False Let x = -43 + 41. Let p be 1(0 + 14x/32). Is p < 2/7? True Let u = 7106/65 - 188169/1430. Let c = u + 107/5. Let j = c - -4/11. Which is smaller: -2 or j? -2 Let b be 6/15 - (-22)/(-55). Which is smaller: b or 2/3013? b Let c = -4 + 3.96. Let t be (1/14)/((-16)/56-1). Which is bigger: t or c? t Let z be (-4 - -1)/(-6)(-30)/27. Suppose -8g + 9g + 1 = 0. Is z less than g? False Suppose 0 = 4q + x + 20, -15 = -42q + 45q - x. Suppose 0 = k + 2, 3g + 3k + 16 = -35. Let h = g - -11. Is h < q? False Suppose 14 = 5n - 6. Suppose -3 = 5c - u, -5c + 0c = -nu + 12. Are c and -8 nonequal? True Suppose -3u + 0 = -9. Let g(d) = -d3 + 5d*2 - 3d. Let j be g(u). Suppose 3a = a + 16. Is j smaller than a? False Let k = -2 + 1.9. Suppose 10 = -a + 4o - 2, -4a - 31 = o. Let v be (-2)/a1 + 918/(-1496). Is k bigger than v? True Suppose -11u - 618 = 119. Which is bigger: -63 or u? -63 Let g be 1265753/4206279 - (-8)/(-28). Let r = g + -15/1441. Is 0 greater than or equal to r? False Let o be 0 + -1 + 0 + -3. Let w = -77 + 79. Let k be w/(8/(24/9)). Is o bigger than k? False Let g = -75 - -76. Which is smaller: g or 5/6? 5/6 Suppose -5c - 13 = -4i, -4c + 138i = 139i + 2. Let h be (-6)/(-8)(-18)/(-1593). Which is greater: h or c? h Let c = -0.478 - -143.478. Which is smaller: c or 0? 0 Let t be (28/69)/(-1). Let b = -50 - t. Suppose -4v - 26 = -2v + 3c, 5c - 30 = 4v. Which is smaller: v or b? v Let n be ((-87992)/(-25925))/(-8) - 2/(-25). Is 1 smaller than n? False Let a(y) = -102y + 13. Let r be a(-1). Which is bigger: 116 or r? 116 Let x(p) = 9p - 65. Let i be x(7). Is i < 2/17? True Suppose 7 = x - 4z, -21z + 13 = -5x - 25z. Is x < -20/23? True Let q(i) = -15i - 31. Let g be q(-4). Is 9 greater than or equal to g? False Let b(t) = t*2 + 27t - 29. Let v be b(-28). Let c be (4 - 2)/(v/5). Is c >= -8? False Let o = 176/5 - 7/10. Are 35 and o nonequal? True Suppose -2p + 5m = 2m + 1, 5p - 3m = 2. Are 9/92 and p nonequal? True Let u be (-12)/((-11)/(-3 + -19)). Let o = 34 - 58. Is o > u? False Let v = -77 + 105. Is 25 equal to v? False Let r = -6.3 + 1.1. Let p = 2.2 + r. Let j = -7 + p. Is 0.1 at least as big as j? True Let u = 1 - 0.9. Let j(o) = 2o*2 - 3o. Let h be j(2). Suppose 33 = -3t - 4x - 32, -4t - hx - 70 = 0. Is u less than t? False Suppose 0 = 3p + 2b - 5 - 7, 4b + 6 = -p. Suppose -3c = -c + p. Which is smaller: -4 or c? -4 Let l = 215 + -206. Is -7 less than l? True Let s = 0.17 + -0.17. Is s not equal to 12/17? True Suppose -3c = 6, -3z - 3c + 2c = 8. Suppose 195h - 202h - 42 = 0. Are h and z unequal? True Let f(u) be the first derivative of 33u2 + u + 1. Let v be f(1). Let l = -265/4 + v. Which is greater: 1 or l? 1 Let c = 1450 - 1501. Is c greater than or equal to -47? False Suppose -6 + 2 = -4u. Suppose 4s - 17 = -u. Suppose -p = sp. Which is smaller: p or -5/9? -5/9 Let t = 0.3 + -0.4. Let s = -0.0658 - 11.9342. Is s at least t? False Let f be ((-3)/(-3))/((-2)/(-6)). Suppose -fk - 18 = -39. Which is smaller: 8 or k? k Suppose 5o - b = -5, -2o + 0 - 2 = -4b. Is 1/89 > o? True Let r = 43 + -28. Is 13 less than r? True Let i = -56 - 86. Is 0.7 equal to i? False Let c be 446/(-25)(8 + 42/(-4)). Which is greater: 45 or c? 45 Let c = -4/9 - -41/72. Let v be 5/3 + (-4)/6. Which is smaller: v or c? c Let v = -341 - -339. Let g = 764681/1640082 + -2/13899. Let q = -2/59 - g. Which is bigger: q or v? q Suppose 2d = -15 + 21. Suppose i + 0i = -2s - 18, -ds = 9. Is i equal to -13? False Let z(q) = 2q*2 - 18q - 1. Let w be z(9). Which is smaller: w or 1/	{ "pile_set_name": "DM Mathematics" }
4, -4m = o - 33. Calculate the lowest common multiple of m and w. 16 Let c(g) = g2 + 5g - 4. Suppose -17 = -5d + 8. Calculate the smallest common multiple of c(-6) and d. 10 Let r = 8086 + -64785/8. Calculate the common denominator of -3 and r. 8 Suppose 3q = 4o - 5, 6 - 20 = 2o + 4q. Let s be (1 + -2)/(0 + o). Calculate the common denominator of -87/2 and s + -2 - (-100)/22. 22 What is the common denominator of -24/7 and (-126)/26 - 51/(-17)? 91 Suppose -6 = -2d - 4v, 0 = 2d - 7d - 5v + 15. Suppose dl + 507 = -1239. Calculate the common denominator of -91/18 and (4/6)/((-56)/l). 126 Let x = 13 + 1. Let j(s) = -s3 - 11s*2 - s - 5. What is the smallest common multiple of x and j(-11)? 42 Suppose -29 + 5 = -4q. Let k = 8 - 0. Suppose 4 = 2l, j - l = 2j - k. Calculate the lowest common multiple of q and j. 6 Let a be 12(-8)/(-102) + -2. Let y = a + 22/85. Find the common denominator of y and 94/(-10) + (1 - 2). 5 Suppose 0h = -2h - 6. What is the common denominator of 115/6 and (-27)/617/h? 6 Calculate the common denominator of ((-26)/195)/((-16)/250) and -13/16. 48 Let c(p) = p - 3. Suppose -3b + 2f + 37 = 10, 2f = 4b - 38. What is the smallest common multiple of c(10) and b? 77 Let n(f) = f + 9. Let o be n(-8). Calculate the common denominator of (-2)/8 + (-295)/12 and ((-74)/3 + 2)o. 6 Suppose -11 + 19 = 2p. Suppose 2r + 6 = pr. What is the smallest common multiple of 7 and r? 21 Suppose 0 = -10w + 30 + 60. Calculate the least common multiple of w and 30. 90 Suppose -4x = -b + 153, -2x - 67 = 4b + 5. Find the common denominator of 2/20(x + 1) and -1/18. 90 Let p = -4 - -2. Let c(x) = -x3 - 4x*2 - 2x + 5. Let n be c(-6). Find the common denominator of p/4n/11 and -89/20. 220 Let s = 35 - 25. What is the lowest common multiple of 18 and s? 90 Let s be ((-3)/(-2))/((-24)/928). Calculate the lowest common multiple of 22 and (s + 2)/4-1. 154 Let x be (-3)/((-4)/3 + 1). Suppose -x - 13 = -u. Calculate the least common multiple of u and 10. 110 What is the lowest common multiple of 4 and (8/(-14))/(4/(-14))? 4 Let q be (-125)/(-10)4/5. Let c = 26 - q. Calculate the lowest common multiple of 14 and c. 112 Let d = -9 + 23. Let h(g) = g + 11. Let u(c) = -c - 10. Let q(y) = -2h(y) - 3u(y). What is the least common multiple of q(0) and d? 56 Suppose 2p - 3s + 2s - 42 = 0, p = 4s + 28. What is the smallest common multiple of 2 and p? 20 Suppose -5o + 40 = -3o. Let j = o - 2. Calculate the lowest common multiple of 6 and j. 18 Suppose 6a - 40 = 44. Calculate the smallest common multiple of 10 and a. 70 Let s = -1065/296 - 38/37. Find the common denominator of s and 97/8. 8 Let b = 2330 + -9393/4. Find the common denominator of b and 0 + (-11)/(-6) + 3. 12 Suppose 0 = -5r - 10 - 10. Let q(d) = d3 + 5d*2 + 2d. Calculate the smallest common multiple of 8 and q(r). 8 Let s(l) = l*2 - 3l + 6. Let k be (-52)/(-8) - (-2)/(-4). Suppose -m - 4g - k = 0, -7 = -m + 4g + 3. What is the lowest common multiple of s(4) and m? 10 Let d = -598/7 - -85. What is the common denominator of 25/14 and d? 14 Let s = 13/76 + -2549/684. Find the common denominator of s and 43/9. 9 Let t = 234061/12 + -19494. Let i = -137 + 227. Calculate the common denominator of (2/i)/(4/(-770)) and t. 36 Suppose 5h = 99 - 19. Let z be -1 + -1 - 1-4. Suppose -k + 3k - 86 = -5l, 3l - 54 = -zk. Calculate the smallest common multiple of l and h. 16 Let h = -3/5687 + 392463/113740. What is the common denominator of 107/22 and h? 220 Let d = 6 + -3. Suppose -2c + 2 = 0, 5i - 4c + dc = 9. Calculate the lowest common multiple of i and 7. 14 Calculate the common denominator of (34 + -3)2/(-6) and 29/5. 15 Let j = -1712 + 13717/8. Calculate the common denominator of j and 54/7. 56 Let k = 2/6947 + 243121/83364. Calculate the common denominator of -149/18 and k. 36 Let o = -6830 - -1372835/201. Let g be (-2)/6017939/(-67). Let y = o - g. Calculate the common denominator of -93/16 and y. 80 Suppose -4s - 2f = -40, -s - f - f + 7 = 0. Suppose 0 = 5g - 4x - 31, 4x + 2 = g - x. What is the common denominator of g and (-52)/72(s + -1)? 9 Find the common denominator of (5/10)/((-11)/(-38)) and -79/4. 44 Let w be -22 - -2 - 6. Let m be (111/2)/((-2)/w). Calculate the common denominator of -53/14 and -1 - (m/44 + -1). 154 Let b be (-9)/18 + 256411/29421. Let d = 4/4203 - b. Calculate the common denominator of (-1)/2 + (-246)/(-40) and d. 140 Let u = 13 + -2. What is the lowest common multiple of 10 and u? 110 Let o(x) be the third derivative of -x5/6 - x4/24 - x3/3 - x2. Let d be o(-2). Find the common denominator of 75/2 and (-3)/5 - 472/d. 10 Let x be (3 + -5 + 3)6. Suppose n + x = 4n. What is the smallest common multiple of n and 2? 2 Suppose -10t = -8 - 12. Calculate the smallest common multiple of t and 4. 4 Suppose 107 = -4b + p, -2b - 44 = -p + 7. Let z = -3 - b. Let q = 3853/246 + -34/41. Find the common denominator of q and z. 6 Suppose 4b = i + 69, -5b + i + 105 = 6i. Let y = b - 10. Calculate the lowest common multiple of y and 16. 16 Let a(l) = -7l + 4. Let s be a(-3). Suppose -4 = f + 5g + s, 5f + 3g + 57 = 0. Find the common denominator of (6/8)/((-1)/f) and -54/11. 44 Let x = 1776523/99 - 150298/11. Let r = x - 4277. Calculate the common denominator of r and -77/6. 18 Let a be (24/(-20))/((-2)/10). Let c be ((-27)/2)/((-2)/(-4)). Calculate the common denominator of 31/2 and (c/2)/((-4)/a). 4 Suppose 3x - 5x + 12054 = 0. Let v = 1762877/8 - 12677383/56. Let j = v + x. What is the common denominator of 83/8 and j? 56 Let g(t) = 6t*2 - 2t - 7. Let d be g(-5). Let n = -14129/4 - -3555. Find the common denominator of (1/(-30))/((-2)/d) and n. 20 Let w be (-3)/9(-8102)/(-4). Let c = w + 587. Let a = 844/9 + c. Calculate the common denominator of a and -145/18. 18 Suppose 0c - 12 = -4c. Let j(p) be the second derivative of p4/12 + 5p*3/6 + 2p*2 - p. What is the lowest common multiple of c and j(-5)? 12 Suppose 4r - 28 + 188 = 0. Let a = -18 - r. Calculate the least common multiple of a and 20. 220 Let u(i) = i3 - i2 - i + 168. Let w be u(0). Suppose -5g + 14 = b + w, -5g + 104 = -b. Find the common denominator of 91/2 and -3 + b/24 - 0. 8 What is the common denominator of (780/(-56))/5 - -2 and 37/32? 224 Let t(b) = -b*3 + 9b2 - b - 6. Let w be t(9). Let q be 2/(-3) - (-1835)/w. Let d = q - -497/4. Find the common denominator of d and -41/18. 36 Let j(r) be the second derivative of -r3/3 + 2r2 + 3r. Let h be j(3). Calculate the least common multiple of 20 and (-1 + h)/((-3)/20). 20 Find the common denominator of 43/2 and 44/(-55) - (-834)/80. 8 Suppose 3y - 2b = 17, 5y + 2b = -3b - 5. Suppose -n + 88 = yn. Let a(q) = q*3 + 7q*2 + 9q - 2. What is the lowest common multiple of n and a(-4)? 110 Let h(o) = -o3 + o2. Let w be h(2). What is the lowest common multiple of (14/(-8))/(4/(-16)) and ((-6)/w)/((-15)/(-80))? 56 Let s be (90/(-4))/((-1)/2). Suppose 4p - 36 = n, -8p = -3p - n - s. Suppose -p = -g + 3. Calculate the smallest common multiple of g and 8. 24 Calculate the common denominator of 73/14 and (3 - 1)(-201)/(-96). 112 Let b = -1885/328748 - 7/796. Let c = b + 34291/826. Find the common denominator of 55/3 and c. 6 Calculate the lowest common multiple of 7 and 4/10 - 28/(-5). 42 Suppose -2q + 21 = -19. Calculate the smallest common multiple of q and 18. 180 Let w be 5/((-10)/6)1. Let z be 94/(-6) + (-2)/w. What is the smallest common multiple of 2 and (8/(-5))/(3/z)? 8 Let b = 12477/35 - 1811/5. What is the common denominator of b and -28/13? 91 Suppose 0r + 5g = 2r - 6, g = 0. Calculate the common denominator of -21/5 and (462/(-4))/r + 3. 10 Let q be ((-554)/(-4))/((-2)/4). Let g = q + 1673/6. Find the common denominator of g and 51/7. 42 Let d = -45/19 + 1519/152. Find the common denominator of d and 20/9. 72 Calculate the smallest common multiple of 3 and 645/(-4)(-6)/9. 45 Let y(p) = 11p3 - p2 + p. What is the least common multiple of 10 and y(1)? 110 Let k be (3/26)/((-5)/(-22)). Let i = -9/13 - k. Calculate the common denominator of i and (2 + -3)/(33/21). 55 Let s be (-1)/(-3) + (-1048)/(-56). Let p = s + -33/7. Calculate the	{ "pile_set_name": "DM Mathematics" }
3 - 4f*2 - 5f. Let z be b(5). Suppose -5q - r + 79 = 0, 0 = -2q + 5r - zr + 37. What is the units digit of q? 6 Suppose 0 = t - 99 - 75. Suppose -t + 54 = -3n. Let q = -29 + n. What is the units digit of q? 1 What is the tens digit of 3 + 65 - 36/(-9)? 7 Let z(g) = 12g + 3. What is the units digit of z(2)? 7 Suppose -c - 5 - 1 = n, -4n - 20 = 3c. Let v be -3 - (2 + (-3 - n)). What is the units digit of v/(2/(-1)) + 0? 2 Let m(g) = 0g + 6g - 4g - 11. Let p be m(8). Suppose 2s + 4 = -pa, -28 = -2s + s + 5a. What is the units digit of s? 8 Let u = 66 - 26. What is the units digit of u? 0 Let z(c) be the third derivative of c4/12 - c3/6 + 3c2. What is the tens digit of z(8)? 1 Let p = -133 - -233. What is the hundreds digit of p? 1 Let q(j) = -j2. Let b(r) = -r3 + r2 + 8r + 9. Let i(d) = -b(d) - 6q(d). What is the units digit of i(-6)? 3 Let u(l) = -l*2 - 6l - 1. Let p be u(-5). Suppose -52 = -px - 0. What is the tens digit of x? 1 Let a = 4 + 1. Suppose -126 = -as - 21. What is the units digit of s? 1 Suppose 155 = 3d - 0p - p, -2d - p + 95 = 0. What is the units digit of d? 0 Let b = -15 + 29. Let l = 29 + b. Let r = l - 26. What is the units digit of r? 7 Suppose -3h + 5r + 34 = 5, 2r = 5h - 23. Suppose -h = g - 8. What is the units digit of g? 5 Let z = -2 - -4. Suppose 0 = 2y - y - 24. Suppose za + y = 4a. What is the tens digit of a? 1 Let i(k) = -k*3 + 2k*2 + 3k + 2. What is the units digit of i(3)? 2 What is the units digit of 44 - 3(3/3)/(-3)? 5 Suppose 2t - 2a - 232 = 3a, a + 557 = 5t. What is the units digit of t? 1 Suppose 0 = -4x + 8x - 20. Suppose -5t + 20 = 0, -3n + 3t - x = -26. What is the tens digit of n? 1 Let w = 6 - 3. Let g = 21 - w. What is the tens digit of g? 1 Suppose -2z - 2 = 2i, z + 5i + 9 = -2z. Suppose -4 + 25 = 3a - 3x, za = -2x + 10. What is the units digit of a? 6 What is the tens digit of (-3)/(-15) + 198/10? 2 Suppose 2o = -3p + 53, -3o + 2p + 3p + 51 = 0. What is the units digit of o? 2 Suppose 0 = 2t - 4t + 3m + 3, 4t + 2m + 2 = 0. Suppose o - 4 = -t. What is the units digit of -1o/(-10)35? 4 Let n be ((-9)/3)/1 - -4. What is the units digit of (0 + n)/(7/21)? 3 Suppose -9 = -w - 2w. Suppose -4j + 26 = 2v - 8j, v - 4j - w = 0. What is the units digit of v? 3 Let t(r) = r2 + r + 13. Let y be t(0). Let v be (-38)/4-21. Let z = v - y. What is the units digit of z? 6 Let q = 9 + -4. Suppose -ql + 0l - 13 = 2p, l = -3p. Suppose -p = t - 11. What is the units digit of t? 0 Let p(v) = 6v - 25. What is the units digit of p(6)? 1 Let m be 0/((2 - 5) + 1). Let t be (m(-1)/2)/(-2). Suppose 0 = 3b + 4o - 65, t = -0b + b + o - 20. What is the units digit of b? 5 Suppose -2h = -h. What is the units digit of 5 + 1/3h? 5 Let i be 0 - -1 - (-2 - -1). What is the units digit of i/(-9) - (-145)/45? 3 Let f = -3 - -8. Suppose 0 = -fz + 2l + 116, -2l - 10 = -z - 6l. What is the tens digit of z? 2 Suppose 3f - 4o + 12 = 0, -2f + 3o + 0 = 8. Let h = f + 7. Suppose -hk - 21 = -3c, 2c - 3k - 24 = k. What is the units digit of c? 2 Suppose y + 3y = 0. Suppose yc = c - 10. What is the units digit of c? 0 Suppose 25 = 5g + 5m, -5 = g - 2m - 4. Suppose 3 = w - gd - 10, 0 = 3w + 4d - 65. Let y = w - 13. What is the units digit of y? 6 Let w(a) = 24a - 12. What is the tens digit of w(5)? 0 Let r be 5/(-10)4/(-2). Suppose c + r = 6. Let b(u) = u*3 - 4u*2 - 3u. What is the tens digit of b(c)? 1 Suppose 3 = -5q + 23. Suppose qk + 4 - 36 = 0. What is the units digit of k? 8 What is the units digit of (18/15)/((-14)/(-35))3? 9 Let c be (-1)/(-4) - 14/(-8). Let s(n) = -3n*3 + 2n*2 + 2n - 1. Let w be s(c). Let t = w - -21. What is the units digit of t? 8 Let l be 90/(-25) + 6/10. Let h = -6 - l. Let d(u) = -2u - 2. What is the units digit of d(h)? 4 Let o be 1/(-1) + 2 + 5. Let q(x) = -x2 + 5x + 8. Let r be q(o). Let v = r - 0. What is the units digit of v? 2 Let r(q) = q*3 - 17q*2 + 15q + 23. What is the units digit of r(16)? 7 Let y(b) = -5b - 3. Let l be y(-4). Suppose 103 + l = 5f - 3d, 0 = -3f - 3d + 48. What is the tens digit of f? 2 Suppose -4m + h = -3m - 1, 5h - 25 = -5m. Let g(l) = 3l*2 - 4l*3 + 5l - 2 + 0 + ml3. What is the tens digit of g(3)? 1 What is the units digit of (45/(-15))/(6/(-10))? 5 Suppose -4i = -5d + 16, -16 = -4i - d - 2d. Let r = i + -3. What is the units digit of 1 + (0 - 2/r)? 2 Suppose 2r - 398 = 2p, 2r - 4p = 5r - 597. What is the units digit of r? 9 Suppose 0 = 3k, r + 5k - 20 - 19 = 0. Suppose -4u + r = -25. What is the units digit of u? 6 What is the tens digit of (-2)/(-5) + (-2979)/(-15)? 9 Let i(o) = 4o - 5. Let y(v) = -v + 1. Let n(a) = -2i(a) - 9y(a). Let s be n(2). Suppose -4b + 1 + s = 0. What is the units digit of b? 1 Suppose 3i + 4u = 6u + 113, -5u = -i + 42. What is the units digit of i? 7 Let t(v) = 157v - 15. What is the units digit of t(1)? 2 Suppose -2o = 74 + 10. Let h = 59 + o. What is the tens digit of h? 1 Let q(l) = -l2 + 5l - 2. Let t be q(4). Suppose k + a - 14 = 0, -tk + 63 = -5a - 0a. What is the tens digit of k? 1 Suppose 8q - 12q = -12. What is the units digit of q? 3 What is the units digit of (-2)/7 - (-74)/14? 5 Suppose 2t + 0t - 52 = 0. Let w = 43 - t. What is the tens digit of w? 1 Suppose -5l - 19 = 16. Let t = l + 10. Suppose -2p = -o + t, 2o - 5o = -3p - 18. What is the units digit of o? 9 What is the tens digit of (-1841)/(-35) - (-4)/10? 5 Let o be 1 + 3 - 2 - -2. Suppose -3h = h + oz + 20, -2z - 10 = 3h. Suppose -4k - 3l + 29 = 0, h = 2k + l - 3 - 10. What is the units digit of k? 5 Let x = 2 - -5. Let u = 8 + x. What is the units digit of u? 5 Suppose -68 = -5z + 3z. What is the tens digit of z? 3 Suppose 12v - 510 = 6v. What is the tens digit of v? 8 Let u(z) = -z + 1. Let b(a) = 9a - 5. Let j(g) = b(g) + 3u(g). Let q(c) = c2 + 2. Let t be q(0). What is the units digit of j(t)? 0 Let t be (-2 - 5/(-3))-18. Let d(z) = 7 - z*2 + 0z*2 + 4z + 4z. What is the units digit of d(t)? 9 Let m(h) = -3h - 2. Let b be m(-9). Suppose -3s = 2k - b, -15 = -3k + k - s. What is the units digit of k? 5 Suppose 3u - 11 = -5o, -5 + 36 = 4o - 5u. Let s = -8 + o. What is the units digit of ((-5)/s)/(2/8)? 5 Suppose 8 = 4d, 2v + 7d = 2d + 20. Suppose b + b + 45 = vo, 5o - 45 = -4b. What is the units digit of o? 9 Suppose 4u = -0u + 5k + 51, 0 = 5k + 15. What is the units digit of u? 9 Let p = 4 - 6. What is the tens digit of p/(-10) + (-89)/(-5)? 1 Suppose -2c + 0c + 10 = 0. What is the units digit of c? 5 Let a = -22 - -26. What is the units digit of a? 4 Suppose -12 = 13m - 17m. Suppose -4t = 4p + 8, 4t - 7 = -0p - p. Suppose -t = -4n + mn. What is the units digit of n? 3 Let z = 5 + -1. Suppose -o = zo - 10. What is the units digit of o? 2 Suppose -i + 96 = 2i. What is the units digit of i? 2 Let w(l) = 4l3 - 3l*2 + 4l - 2. What is the tens digit of w(3)? 9 Let k be 1(1 + (2 - 0)). Suppose 0 = 4s + d - 22, 5d + 1 - 26 = -ks. Suppose -1 = v + 3u, -5u + 3u + 47 = sv. What is the units digit of v? 1 Suppose j = -j + k + 98, -k = 4j - 184. Suppose -4h = h - z + 39, 0 = 5h - 3z + j. Let x(q) = -q + 7. What is the tens digit of x(h)? 1 What is the hundreds digit of 168 + ((-2)/4)/(5/20)? 1 Suppose -84 = -2c + 4w, -3c + 27 + 54 = 3w. What is the units digit of c? 2 Let n(t) = -t*2 - 14t + 14. What is the tens digit of n(-11)? 4 Let h = -33 + 47. Suppose -g = g - h. What is the units digit of g? 7 Let x(h) = 2h2 + 2h - 2. Suppose 3 - 1 = -5g - 4p, 3p + 19 = 5g. Suppose -5s - 6 = -gs. What is the units digit of x(s)? 2 Suppose p = 5p + 8. Let m be 1/(-2)16/p. Suppose 4y = 5j + 3y - 5, -5j - my + 5 = 0. What is the units digit of j? 1 Suppose -14 = 5t - m, 0t - 16 = 4t - 2m. Let s be 3/(-1 - (-16)/18). What is the units digit of s/(-6) - 1/t? 5 Let m(s) = 70s - 2. What is the hundreds digit of m(5)? 3 Let j = -11 + 8. Let g be (j/2)/((-6)/72). Let d = g + -6. What is the units digit of d? 2 Suppose -2v = 2v - 3f - 37, -3f = 4v - 43. Suppose -74 - v = -3l. What is the units digit of l? 8 Let s = -27 - -39	{ "pile_set_name": "DM Mathematics" }
v(z(x)). -7x2 Let q(v) = -3v. Let k(x) = -3x2 - 98x. Determine q(k(w)). 9w2 + 294w Let s(i) = i2. Let m(b) be the first derivative of b2/2 + 8b - 3. Let g(d) = -3. Let p(h) = 8g(h) + 3m(h). Give s(p(j)). 9j*2 Let f(d) = -d. Let t(b) be the first derivative of 25b*2/2 - 9. What is t(f(p))? -25p Let k(l) = -3l2 + 5l - 5. Let g(x) be the first derivative of 4x3 - 21x*2/2 + 21x - 2. Let h(i) = 5g(i) + 21k(i). Let p(m) = -3m. Give p(h(y)). 9y*2 Suppose 0 = 2q - 2x - 3 - 9, -4q = -x - 12. Let g(l) = 3l. Let t(o) = 16o. Let p(f) = qt(f) - 11g(f). Let a(i) = 2i2 + 0i*2 - 4i*2. Give a(p(u)). -2u*2 Let j(x) be the first derivative of -2x*2 + 12. Let u(r) = -r. Determine j(u(q)). 4q Let b(g) be the first derivative of -g6/36 - g3 + 1. Let h(f) be the third derivative of b(f). Let m(d) = -2d. Determine m(h(c)). 20c2 Let z(g) = g2. Let q(d) be the first derivative of -5d2 + 34. Give q(z(s)). -10s*2 Let a(d) = d - 3. Let j(u) = u - 4. Let f(m) = -4a(m) + 3j(m). Let w(z) be the third derivative of -z4/24 - 2z2. Calculate f(w(h)). h Let o(t) be the second derivative of t4/6 - 5t. Let y(m) = -m. What is y(o(p))? -2p*2 Let m(k) = 8k. Let d(n) = -13n2 + 3n. Give m(d(y)). -104y2 + 24y Let a(p) = -3p + p + p. Let q(w) be the first derivative of -11w*2/2 + 47. Calculate a(q(s)). 11s Let m(z) = -2z. Let c(u) = 3u. Let q(h) = 3c(h) + 4m(h). Let a(t) = 23t. Calculate a(q(o)). 23o Let s(b) = -b. Let m(u) = -u*2 + 4. Let j(h) = -2h*2 + 9. Let l(t) = 2t + 2. Let q be l(-3). Let a(r) = qj(r) + 9m(r). What is a(s(k))? -k*2 Let y(r) = -57r*2. Let d(c) = 114c. What is y(d(j))? -740772j2 Let m(x) = -109x + 115x - 3 + 3. Let c(q) = -6q*2. Give c(m(l)). -216l*2 Let v(o) = 2o. Let d(t) = -t2 - t. Let k(s) = s2 - 4s - 4. Let n be k(5). Let m(j) = j2 + 2j. Let u(i) = nm(i) + 2d(i). Calculate v(u(x)). -2x2 Let l(u) = u2. Let k(a) = a2 + a. Let c(t) = 3t*2 - 2t. Let s(j) = c(j) + 2k(j). What is l(s(d))? 25d4 Let d(z) be the first derivative of -z4/12 - 4z - 3. Let n(s) be the first derivative of d(s). Let l(p) = -5p. Calculate l(n(c)). 5c2 Let q(l) = 2l*2. Let s(p) = -30p. What is q(s(w))? 1800w2 Let p(l) = l2. Let c(a) = 2a*2 + a. Calculate p(c(b)). 4b*4 + 4b3 + b2 Let p(y) = 8y2. Let a(r) = -5r*2 + 6r. Let n(b) = -4b2 + 5b. Let q(i) = -5a(i) + 6n(i). Calculate p(q(s)). 8s4 Let c(b) = 40b*2 - 2. Let p(i) = i. Determine p(c(a)). 40a2 - 2 Let b(l) be the first derivative of l3/3 - 3l2 - 5. Let f(q) = -q. Determine f(b(u)). -u2 + 6u Let n(s) = -6s2. Let p(k) = 9k - 8. What is p(n(h))? -54h2 - 8 Let c(l) = -97l. Let i(s) = 3s. Calculate i(c(q)). -291q Let d(z) = 16z - 1. Let g(k) = -10k*2. Determine d(g(n)). -160n*2 - 1 Let x(m) = -2m + 5m - 4m - 2m. Let t(v) = -7v. Determine t(x(w)). 21w Let z(u) = -12 + 1 + u + 11. Let f(o) = o2 - 1. What is f(z(c))? c2 - 1 Let z(a) = -20a. Let o(x) = -43x. What is o(z(q))? 860q Let b(u) = -u*2. Let o(n) be the second derivative of -5n*4/12 + 10n. Determine o(b(g)). -5g4 Let i(g) be the second derivative of g4/6 - 2g. Let k = -2 - -4. Let n(y) = 2y + ky - 2y. Determine i(n(z)). 8z*2 Let q(h) = 5h - 1. Let p(t) = t. Determine p(q(i)). 5i - 1 Let g(o) = 9o2. Let a(h) be the third derivative of h4/24 - 3h2. What is a(g(d))? 9d*2 Let o(j) be the first derivative of 1 + 0j*2 + 1/3j*3 + 0j. Let d(k) = 4k. What is d(o(m))? 4m*2 Let o(s) = 5s - 1 + 1. Let i(v) = v. Calculate i(o(z)). 5z Let f(a) = -2a. Let q(v) = -5v - 278. Calculate q(f(p)). 10p - 278 Let k be -3((-8)/3)/2. Let d(h) = -2h + 2h + 7h - kh. Let g(p) = -2p*2. Give d(g(t)). -6t*2 Let l = -10 + 12. Let t(d) = -2d + d - 4dl + d. Let i(a) = -2a*2. What is t(i(q))? -16q*4 Let x(l) = -l - 3l + 2l. Let s(w) be the third derivative of -w4/2 + w2 + 9w. What is s(x(q))? 24q Suppose 0t + 36 = 3t. Let m(x) = 12x - tx + 5x2. Let v(w) be the third derivative of w4/24 + w*2. Calculate v(m(s)). 5s*2 Let q(v) = -3v. Let a be 65/(30/8). Let i = a - 7. Let n(w) = -i + w2 + 0 + 1. Calculate n(q(r)). 9r*2 Let l(m) = -m + 1. Let x be l(-3). Let j(y) = -xy - y*2 + 4y. Let u(z) = z2 + z2 - 4z2. Calculate j(u(c)). -4c*4 Let i(j) = 3j. Let y(x) be the first derivative of -x*2/2 - 6. Give i(y(t)). -3t Let q(x) = x*2 - 7x*2 - 2x2. Let m(d) = -d2 + 3d + 3. Let i(p) = p2 - p - 1. Let j(s) = -3i(s) - m(s). Give j(q(f)). -128f4 Let d(t) = -3t2. Let k(o) be the first derivative of o4/24 - o*2/2 - 3. Let v(p) be the second derivative of k(p). What is v(d(f))? -3f*2 Let w(m) = 2m2. Let s(g) = -g2 + 4g - 2. Let v be s(3). Let q(j) = v - 1 - 2j*2 + 4j*2. Give q(w(b)). 8b*4 Let x(m) = 6m. Let z(k) be the third derivative of 0k3 - 2k*2 + 0k + 1/30k5 + 0 + 0k*4. Calculate z(x(f)). 72f*2 Let k(m) = -27m*2. Let f(l) = -2l*2 + 2. What is f(k(j))? -1458j4 + 2 Let o(u) be the second derivative of u4/4 - 2u. Let x(f) = 2f. What is x(o(m))? 6m2 Let p(j) = -10j2. Let a(y) = -y2 + y - 1. Let f(w) = -5w2 + 4w - 4. Let l(o) = -4a(o) + f(o). Calculate l(p(h)). -100h*4 Suppose -q = 4q - 5. Let o = q + 3. Let w(g) = -o + 4 + 3g2. Let l(m) = -m2. What is l(w(f))? -9f*4 Let i(r) = -26r*2 - r + 3r - 2r. Let t(u) = -u2. Calculate t(i(k)). -676k*4 Let g(t) = -23t - 1. Let s(v) = 3v2 + v2 - 5v*2 + 0v*2. Give g(s(z)). 23z2 - 1 Let p(k) = -k2 - k*2 + 10k2. Let i(z) = -z2. Determine i(p(g)). -64g4 Let h(d) = -2d*2 - 3d. Let l(v) = v*2 + v. Let u(z) = h(z) + 3l(z). Let t(m) = 7m. Determine t(u(c)). 7c2 Let p(j) = -j2. Let n(y) = -6y2. Let c(a) = 2n(a) - 10p(a). Let l(t) = 35t*2. Calculate l(c(w)). 140w*4 Let p(b) = -5b - 6b + 27b - 12b. Let t(q) = -4q. Determine p(t(j)). -16j Suppose -4m + 2k + 3k = -8, 3k + 4 = 2m. Let p(i) = -i*m - 20 + 20. Let s(c) = -4c*2. Give s(p(g)). -4g*4 Let s(u) = u. Let i(m) = -10m. Let v(o) = 2i(o) + 22s(o). Let j(d) be the third derivative of d*5/60 - 39d*2. Calculate j(v(c)). 4c*2 Let z(a) = a + 7. Let b be z(-6). Let h(f) = 1 - b - 4f2. Let r(x) be the first derivative of x2 - 5. What is r(h(d))? -8d2 Let v(r) = r. Let o(c) = -3312c. Give o(v(l)). -3312l Let q(f) = -3f - 7. Let p(y) = -y - 3. Let z(m) = 7p(m) - 3q(m). Let h(r) = r + 4. Determine z(h(b)). 2b + 8 Let z(f) = 52f*2. Let o(b) = -11b*2. Calculate o(z(l)). -29744l*4 Let h(f) = 2f2. Let k(b) = -b2. Let d(g) = h(g) + 3k(g). Let r(l) = -4 - l + 0 + 4. Determine d(r(y)). -y2 Let t(l) = 5l. Let k(x) = x + 2. Let s(j) = 1. Let o(b) = 3k(b) - 6s(b). Calculate o(t(n)). 15n Let f(x) = -4x. Let d(o) = -2403o. Calculate f(d(l)). 9612l Let p(z) = -z*2. Suppose -4x + 13 = 5. Suppose xd + 0 = 2. Let s(v) = 1 - d + v2. What is p(s(m))? -m4 Let a(z) = 49z - 2. Let x(q) = 2q + 3q - 2q - q. What is a(x(y))? 98y - 2 Let w(v) = 2v + 2. Let p(y) = 3y + 5. Let q be (-3 + 0)/(9/30). Let j(c) = qw(c) + 4p(c). Let r(f) = f*2. Calculate j(r(m)). -8m*2 Let u(l) = 16l*2. Let r(p) = -8p - 10. Let t(a) = 9a + 12. Let x(f) = 6r(f) + 5t(f). Give u(x(j)). 144j*2 Let j(b) = 2b*2. Suppose -u + 8 - 5 = 0. Let g(s) be the third derivative of 0s*u - 1/24s4 + 0 - s2 + 0s. Give g(j(y)). -2y*2 Let n(s) = 6s. Let k = -9 - -6. Let m = k + 5. Let i(o) = 3om - 5o*2 + 0o*2. What is n(i(t))? -12t*2 Let b(y) = 918y + 136. Let d(m) = 34m + 5. Let i(w) = -5b(w) + 136d(w). Let o(f) = -f2. What is o(i(v))? -1156v*2 Let u(y) = 3y + 2y - 4y. Let a(h) = 16h. Give a(u(r)). 16r Let q(o) = -138o2 - o. Let d(z) = 7z*2. Determine q(d(m)). -6762m*4 - 7m*2 Let v(p) = -6p*2 - 1. Let h(o) = 16o*2 - 2o. Give h(v(u)). 576u4 + 204u*2 + 18 Let f(m) = -2m*2. Let l(d) = 3d + 26 - 26. Determine f(l(y)). -18y2 Let h(a) = -24a2. Let n(v) be the third derivative of v4/24 + 8v2. What is n(h(i))? -24i*2 Let y(p) = -p - 3p + 3p. Let s(a) be the first derivative of -2a*3/3 + 3. What is s(y(u))? -2u*2 Let a(z) = -9z - 11. Let	{ "pile_set_name": "DM Mathematics" }
Collect the terms in 41o - 89o + 43o. -5o Collect the terms in -10 + 12 - 6 - c3. -c3 - 4 Collect the terms in 6z + 8z - 14z + 22z*3. 22z*3 Collect the terms in 21 + 21 - 42 - 21h. -21h Collect the terms in 1 + 4 + 8u*2 - 1. 8u2 + 4 Collect the terms in i3 + 574i - 1148i + 574i. i3 Collect the terms in 7 + 3f3 + f3 - 7. 4f3 Collect the terms in 1 - 3w - 13 + 4 + 8. -3w Collect the terms in 88t + 88t - 174t. 2t Collect the terms in -7s*3 + 12s*3 - 7s*3. -2s*3 Collect the terms in -3l*3 + 67 + 5l*3 - 67 - 4l*3. -2l*3 Collect the terms in -6z + 6z + z2. z2 Collect the terms in -41b*3 + 87b*3 - 32b*3. 14b*3 Collect the terms in -59q + 59q + q2 - 5q*2 + 15q*2. 11q*2 Collect the terms in -8j*3 + 9j*3 + 0j3. j3 Collect the terms in 18 + 11 + 1 + 3i3. 3i*3 + 30 Collect the terms in -8a*2 + 42 - 100 + 58. -8a*2 Collect the terms in -11g + 6g - 6g. -11g Collect the terms in 0 + 6t - 5t - 2. t - 2 Collect the terms in 24w*2 + 5 - 11 + 6 - 28w*2. -4w*2 Collect the terms in -9c - 2c + 7c. -4c Collect the terms in 71n*3 - 1 - 75n*3 + 1. -4n*3 Collect the terms in 6l + 2l - 21l + 8l. -5l Collect the terms in 225n2 - 107n*2 - 108n*2. 10n*2 Collect the terms in -3m + 38 - 38. -3m Collect the terms in 6h*3 - 14h*3 + 6h3 - h3 - h*3. -4h*3 Collect the terms in 6052j - 6052j - 3j*2 + 9j*2. 6j*2 Collect the terms in -18d*2 + 70d*2 - 17d*2 - 24d*2. 11d*2 Collect the terms in 245 - 245 - 2l. -2l Collect the terms in -69k - 1 + 1. -69k Collect the terms in -43q*3 - 5q*3 - 4q*3. -52q*3 Collect the terms in 120f*2 - 235f*2 + 2 + 122f*2 - 2. 7f*2 Collect the terms in 10 - 2 + 25k - 7. 25k + 1 Collect the terms in -4 + 0n*2 + 56n - 3n2 - 7n. -3n2 + 49n - 4 Collect the terms in -9q + 7 + 4q*2 - 8q*2 + 9q. -4q2 + 7 Collect the terms in -2u + 16u + 2u - 15u. u Collect the terms in -3t + t + 4t2 + 0t. 4t2 - 2t Collect the terms in -9t - 8t + 15t. -2t Collect the terms in -29d + 13d - 23d. -39d Collect the terms in -34w3 + 160w*2 - 160w*2. -34w*3 Collect the terms in -4y*3 - 6y*3 - 5y*3 + 18y*3. 3y*3 Collect the terms in 2w - 3w - 31w*2 + w + 12w*2. -19w2 Collect the terms in w2 - 34 + 584w - 584w + 34. w*2 Collect the terms in 8180 - 8180 + 2b. 2b Collect the terms in -2k - 12k3 - 4k + 7k - k. -12k*3 Collect the terms in -60a + 4a3 + 60a + 0a3 - 3a3. a3 Collect the terms in -4684t + 2345t + 2344t. 5t Collect the terms in -5z2 - 10z*3 + 0z*2 + 5z*2. -10z*3 Collect the terms in 5v*2 + 0v*2 + 0v*2 - 4v*2 + 14v*2. 15v*2 Collect the terms in f + 0f + 6f - 5f. 2f Collect the terms in -1 + 25m + 1 - 6m. 19m Collect the terms in -3f3 - 43f + 43f - 12 + 12. -3f*3 Collect the terms in 228 - 228 + 3s. 3s Collect the terms in -41v - 41v + 81v. -v Collect the terms in -12i3 - 13i*3 + 37i*3 - 13i3. -i3 Collect the terms in 23r2 + 4r - 4r - 11r*2. 12r*2 Collect the terms in 1 + 3 - 4 - 46f*2. -46f*2 Collect the terms in -50q - 20q - 16q. -86q Collect the terms in -4r - 9r + 7r. -6r Collect the terms in -2 - 7 + u3 - 2 + 11. u3 Collect the terms in -148w*3 - 81w*3 - 99w*3 + 49w*3. -279w*3 Collect the terms in -b + 0b + 0b2 + b + 9b*2. 9b*2 Collect the terms in -251q + 171q - 237q. -317q Collect the terms in 207p*2 + 56p*2 + 560p*2. 823p*2 Collect the terms in 54f*3 - 28f*3 - 29f*3. -3f*3 Collect the terms in -67j*2 - 15 + 27j*2 + 39j2. -j2 - 15 Collect the terms in 1722o + 35o*3 - 1722o. 35o3 Collect the terms in -17u + 13u - 24u. -28u Collect the terms in -98z - 6z2 + 207z - 109z. -6z*2 Collect the terms in -t - 2 - 10 + 9t*2 + 12. 9t*2 - t Collect the terms in -37q*3 + 78q*3 - 43q*3. -2q*3 Collect the terms in 27z*3 + 9z*3 - 6z*3 + 148z*3. 178z*3 Collect the terms in -15x + 32x - 2x*3 - 17x. -2x3 Collect the terms in -152z + 152z + 11z*2 - 3z*2. 8z*2 Collect the terms in -39l*2 - 39l*2 - 26l*2 + 106l*2. 2l*2 Collect the terms in 4o + 288402 - 288402. 4o Collect the terms in -8d + 2d2 + 3d*2 - 4d*2 - 2d2. -d2 - 8d Collect the terms in 19j - 26j - 3j*2 + 33j. -3j2 + 26j Collect the terms in -6l + 61l + 10l + 3l. 68l Collect the terms in -7v*3 + 5v*3 + 36 - 36. -2v*3 Collect the terms in -2p*3 + 6587 - 6587. -2p*3 Collect the terms in -269r*2 + 137r*2 + 3r*3 + 132r*2. 3r*3 Collect the terms in 12a - 22a + 9a + 8a. 7a Collect the terms in -423d3 + 138d*3 + 146d*3 + 145d*3. 6d*3 Collect the terms in -1 + 1 - 41z*3 + 11z*3. -30z*3 Collect the terms in 5p - 12p + 3p + 2p. -2p Collect the terms in 9i - 185i*2 - 9i. -185i2 Collect the terms in 13z + 71 - 71. 13z Collect the terms in -4z + z*2 - 26 - 2z + 6z. z2 - 26 Collect the terms in -104i*2 + 48i*2 + 56i*2 + 13i*3. 13i*3 Collect the terms in -4p*2 - 91446769 + 91446769. -4p*2 Collect the terms in -3x*2 + 10x*2 + 12x*2. 19x*2 Collect the terms in 2m + 10m - 4m - m. 7m Collect the terms in 10 + 9 - 19 + 21w*2. 21w*2 Collect the terms in 8d + 14d + 8d - 43d + 9d. -4d Collect the terms in 44f + 52f + 546f. 642f Collect the terms in 0 + 0 + 19n*2 - 25n*2. -6n*2 Collect the terms in -561 + 561 + b - 20b + b. -18b Collect the terms in -15j - 21j + 32j. -4j Collect the terms in k2 + 1 - k2 - 1 - k2. -k2 Collect the terms in 1750n*2 + 663n*2 + 478n*2 - 308n*2. 2583n*2 Collect the terms in -3 + 3 - 18b*3. -18b*3 Collect the terms in 70w*3 - 7 + 7. 70w*3 Collect the terms in -18f + f + 9f2 - 14f*2. -5f*2 - 17f Collect the terms in 5 - 77w + 75w + 182. -2w + 187 Collect the terms in -5r*3 - 3221r*2 + 3221r*2. -5r*3 Collect the terms in 261t*3 - 75t*3 + 208t*3 + 751t*3. 1145t3 Collect the terms in 15 + z2 + 3 - 2 + 7. z*2 + 23 Collect the terms in 195f - 195f - 5f*3. -5f*3 Collect the terms in -15z*2 + 27z*2 - 12z*2 - 9z*3. -9z*3 Collect the terms in 8s + 2s - 2s. 8s Collect the terms in -2923p + 2909p + 9 - 9. -14p Collect the terms in 2 - 2 + 4k - 7k. -3k Collect the terms in 33 - 11 - 22 - 8l. -8l Collect the terms in 3z + z - 3z + 217 + 104. z + 321 Collect the terms in 896 - 896 + 4u*2. 4u*2 Collect the terms in 117b - 117b + 114b*2. 114b*2 Collect the terms in 168l*2 + 133l*2 - 37l*2 - 68l*2. 196l*2 Collect the terms in -1 - 62u - 2 + 1. -62u - 2 Collect the terms in 2351s + 126s + 819s. 3296s Collect the terms in 2p*2 - 4p + p + p. 2p2 - 2p Collect the terms in -80y + 86y + 5 - 5. 6y Collect the terms in 2n - 3n + 10n - 7n. 2n Collect the terms in -2 + 4z2 + 2 - 3z + 8z. 4z*2 + 5z Collect the terms in -87f2 + 43f*2 + 42f*2. -2f*2 Collect the terms in 34d*3 - 20d*3 - 26d*3. -12d*3 Collect the terms in -i - i + 16i*3 + 2i. 16i3 Collect the terms in 67 - 30 + 22c*2 - 37. 22c*2 Collect the terms in -300m - 7m2 - 296m + 596m. -7m*2 Collect the terms in 8w*3 + 267w - 267w. 8w*3 Collect the terms in -20t3 - t3 + 73t3. 52t*3 Collect the terms in -3 - 134a - 3 - 2 + 6. -134a - 2 Collect the terms in -14f + 13f + 26f. 25f Collect the terms in -119b - 126b - 122b + 375b. 8b Collect the terms in -58g + 18g + 15g. -25g Collect the terms in -9d2 + 21d*2 - 2d2 + d2. 11d2 Collect the terms in -54p*2 + 171p*2 - 59p*2 - 60p*2. -2p*2 Collect the terms in -13z*3 - 17z*3 + 42z*3 - 25z*3. -13z*3 Collect the terms in -56o*2 + 104o*2 - 48o*2 - 8o*3. -8o*3 Collect the terms in -17 - 2q + 23 + 8q - 6. 6q Collect the terms in 138 + 13t - 138. 13t Collect the terms in -o + 15o + 15o. 29o Collect the terms in s + 4s + 3s. 8s Collect the terms in 11 + 23n + 4n*2 + 22 - 12. 4n*2 + 23n + 21 Collect the terms in 8q + 104q + 47q + 40q. 199q Collect the terms in -7q*3 - 1115 + 1115. -7q**3 Coll	{ "pile_set_name": "DM Mathematics" }
t k(s) = -5876s2 - 7204s + 15. Let j(z) = -840z2 - 1029z + 2. Let i(x) = -15j(x) + 2k(x). What is the second derivative of i(u) wrt u? 1696 Let t(z) be the third derivative of 17z7/840 + 2z5/15 + z4/4 - z*3 + 15z*2 + z. Let r(d) be the second derivative of t(d). Differentiate r(h) wrt h. 102h Let x = 75 - 80. Let v be (-182)/(-4) - (0 + x/10). Differentiate -vp + 30 + 69p - 10 wrt p. 23 Let p = 18 + -26. Let s be -3 + (-19)/(-3) + p/6. Find the third derivative of -32t2 - 17t*s - 3t*3 + 8t*2 - 29t*3 wrt t. -192 Let v(h) = -10 + 2h - 14 + 41. Let a be v(-6). Find the first derivative of 25 + ab + 15b + 7b wrt b. 27 What is the second derivative of 299f + 3884f5 - 1281f - 630f - 1607f wrt f? 77680f3 What is the first derivative of 2005 - 6484 + 2828 + 946m - 36m + 2602 wrt m? 910 Let d = -5479 - -5483. Let t(y) be the second derivative of 10/3y*3 + 19/20y*5 + 0y*2 + 0y*d + 5y + 0. Find the second derivative of t(i) wrt i. 114i Let k(y) = -y3 + 4y*2 + 10y - 21. Let i be k(5). Find the third derivative of 42f2 - 34f*i + 32f*2 + 33f*2 - 57f*2 wrt f. -816f Let g(i) = 9i + 4. Let c(k) = -6k*2 + 127k + 185. Let u(w) = -c(w) - 4g(w). What is the first derivative of u(l) wrt l? 12l - 163 Let r = -248 + 248. Let p(t) = t*2 - 3. Let u be p(2). Find the first derivative of 27g - u + 7 + r wrt g. 27 Let m(w) be the second derivative of -59w7/7 + 2w*5/5 - 23w*4/2 + 6070w. What is the third derivative of m(z) wrt z? -21240z2 + 48 What is the third derivative of -57u*2 - 953u*2 - 1075u4 - u4 - 815u4 - 2u + 4u wrt u? -45384u What is the second derivative of 37c2 - 208 - 194 - 16c + 380 wrt c? 74 Let j(g) = g*2 + 3g - 5. Let z be (10/7 - 2)(-21)/6. Let f be j(z). What is the third derivative of fh + h - 8h2 - 6h + 4h3 wrt h? 24 Let c(j) be the second derivative of -2393j4/4 + j3/6 + 1791j2/2 - j - 3385. What is the derivative of c(m) wrt m? -14358m + 1 Suppose -5q + 1 + 9 = 0. Find the third derivative of 27o*6 + 21o*6 - 46o*q + 2o - o*6 wrt o. 5640o*3 Suppose 4u + 4x - 92 = 0, -3x - 26 = -u - 15. What is the third derivative of 9g6 - 8g*6 - ug*5 + 63g*2 - 5g*5 wrt g? 120g*3 - 1500g*2 Let y(i) be the second derivative of 28i6/5 - i4/6 + 133i3/3 + 478i. Find the second derivative of y(k) wrt k. 2016k2 - 4 Find the third derivative of -12291a*6 + 7a*5 + 160a - 341a2 - 286a*2 + 649a*2 - 7a*5 wrt a. -1474920a*3 What is the first derivative of 11g*2 - 5g*2 - 2539 + 970 - 8g*2 - 617g wrt g? -4g - 617 Suppose 43g = 49g - 3552. Find the first derivative of -1191x*3 + 598x*3 - 44 + gx*3 + 51x*2 wrt x. -3x*2 + 102x Let c(h) = 304h + 313. Let i be ((-2)/(-5 + -1))/(1/(-12)). Let v(q) = -101q - 105. Let s(f) = ic(f) - 11v(f). Differentiate s(g) with respect to g. -105 Let k(y) = -y3 + y2 + y. Let c(q) = -213q5 + 6q*3 - 35q*2 - 6q - 2. Let r(n) = -c(n) - 6k(n). What is the third derivative of r(s) wrt s? 12780s*2 Find the second derivative of -422r + 12r2 + 218008r*4 - 3 - 218266r*4 - 12r*2 wrt r. -3096r*2 Find the second derivative of 198u*3 - 36 - 426u*3 + 2u*2 + 932u*3 + 80u + 1116u3 + 1779u*3 wrt u. 21594u + 4 Let v(g) = -4g2. Let z(d) = 2281d*2 + 1792d. Let r(w) = -6v(w) + z(w). Find the second derivative of r(l) wrt l. 4610 Let m(r) be the first derivative of -46 - 1/2r*2 + 0r - 37/2r4 + 16r*3. Find the third derivative of m(g) wrt g. -444 Suppose 2i = 4x - 2i + 348, -x - 3i = 71. Let c = -83 - x. What is the first derivative of 0 + cq3 + q3 + 0q3 + 6 wrt q? 3q*2 Let v(g) = 18g*4 - 5g*2 - 6g + 137. Let h(p) = -p. Let c = -379 - -373. Let z(j) = ch(j) + v(j). Differentiate z(y) with respect to y. 72y*3 - 10y Suppose 0 = 21f - 58f + 185. Let j(a) be the second derivative of 0a3 + 7a*2 + 0a*4 + 19/20a*f + 0 + a. Differentiate j(t) wrt t. 57t*2 Let y(d) = -8858d*3 - 910d*2 - 3d. Let u(m) = 8858m3 + 911m*2 + 2m. Let j(b) = -3u(b) - 2y(b). What is the third derivative of j(z) wrt z? -53148 Let c(u) be the third derivative of 29u8/42 + u4/12 - 265u*3/6 - 32u*2 + 6. What is the second derivative of c(r) wrt r? 4640r*3 Let c(y) be the third derivative of 1373y*4/12 + 97y*3/6 + 1701y*2 + 1. What is the first derivative of c(b) wrt b? 2746 Let d(b) be the first derivative of 2077b*4/4 - 2b*3/3 + 808b*2 + b + 722. Find the third derivative of d(y) wrt y. 12462 Let s = 12203 - 12197. Let y(i) be the first derivative of 0i + 0i4 + 0i*3 + 0i5 - is - 7/2i2 - 9. What is the second derivative of y(g) wrt g? -120g*3 Let b(q) = 28q2 - q - 2. Let l = 86 - 82. Let c(t) = -t2 - t. Let h(o) = lc(o) - 2b(o). Find the second derivative of h(j) wrt j. -120 What is the second derivative of 337g + 1839g*4 - 146g + 10 - 177g wrt g? 22068g*2 Suppose -98v - 58 = -250 - 102. Let q(c) be the second derivative of -12c2 + 13/6c*v + 23c + 0. What is the derivative of q(b) wrt b? 13 Let q be 6 + 0 + 6/(-2). Suppose 0 = -j - q, -2c + 4j = -4c - 4. What is the third derivative of 9n*2 - 5n*4 - 3n*c - 2n*4 wrt n? -240n Let c be (6 - 0)/(45/555). What is the first derivative of -3o - 6 - 3 - c + 23o*3 wrt o? 69o*2 - 3 Let k(d) be the first derivative of -322d*3/3 - 570d - 4016. Differentiate k(n) wrt n. -644n Find the second derivative of 0 + 37k*2 + 1051k + 942k + 2 - 2 wrt k. 74 Find the second derivative of 578d + 235d4 + 33d*4 + 173d*4 + 61d*4 + 10d*4 wrt d. 6144d*2 Let p(a) = -11969a - 6639. Let b(z) = -3996z - 2213. Let u(i) = 17b(i) - 6p(i). Differentiate u(n) with respect to n. 3882 Find the second derivative of -827m - 1 - 3 + 4 - 52m4 - 5m*2 - 68m*4 wrt m. -1440m*2 - 10 Let h be 20(-7)/(-224)8. Let b(o) = -210o + 144. Let z(m) = -419m + 284. Let n(p) = hb(p) - 3z(p). Find the first derivative of n(v) wrt v. 207 Suppose 5p + 27 = -5w + 192, 3p = -4w + 136. Find the second derivative of -2 + 50s - ws - 60s*4 + s wrt s. -720s*2 Suppose -12 + 20 = -d. Let m be d/6(-11 - -8). Find the third derivative of 4z4 + 0z*2 + 5z*m - 14z*2 - 6z*2 wrt z. 216z What is the third derivative of -22750u3 - 2678u*2 - 21326u*3 + 42671u*3 wrt u? -8430 Differentiate -15u + 59u + 1847 - 9u - 12u + 105u*2 - 15u wrt u. 210u + 8 Let m(l) be the third derivative of l5/15 + 113l*4/12 - 349l*3/6 - 3l*2 + 15. What is the first derivative of m(n) wrt n? 8n + 226 What is the derivative of -128d - 429d*2 + 129d + 508 + 85 wrt d? -858d + 1 Let l(v) = -v - 24. Let k be l(-8). Let s be 26/10 - k/40. What is the third derivative of -20y*2 - 100y3 + y2 - 6y2 + 73y*s wrt y? -162 Let l = -40 - -45. Suppose lu = -4s - 3, -18 = 3s - 5s + 4u. Find the second derivative of 14t3 + 9t + st - 3t*3 - 2t wrt t. 66t Suppose 3s = 3r + 6s, 4r - s = -15. Let v = 7 + r. What is the third derivative of -39t*2 + 21t*v + 19t*4 + 38t*2 wrt t? 960t Let f(h) be the third derivative of -h*4/12 - 17h*3/6 - 10h*2. Let n be f(-10). What is the second derivative of 3i*3 - i + 10i*n - 2i wrt i? 78i Let q be (4/10)/(24/120). What is the second derivative of 47f*2 - 2 - 98f*q + 51f*2 + 72f*3 - 17f wrt f? 432f Suppose -96 = -40i + 32i. Find the second derivative of -66 - 37 - i - 59f*5 - 2f - 26 wrt f. -1180f3 Let l(z) = 16z*2 - 13z2 - z3 + 4z - z3 - 2. Let p be l(-2). Differentiate 25a*2 - pa*3 - 10a*2 + 30 - 15a*2 wrt a. -54a*2 What is the third derivative of -5402f*5 + 1425f*4 + 1410f*4 - 2835f*4 - 680f*2 wrt f? -324120f*2 Let g = 64 - -10. Let h = -64 + g. Find the second derivative of 3p - 24p5 - 5p + 3p5 - hp wrt p. -420p3 Let k = 934 + -931. Find the second derivative of -77c*3 + 36c*4 - 26c + 77c3 - kc*4 - 2 wrt c. 396c*2 Let x(q) be the first derivative of 0q*2 - 56/3q*3 - 8q*6 + 0q + 39 + 0q5 + 0q*4. What is the third derivative of x(i) wrt i? -2880i*2 Let p(z) = 2z*3 - 27z*2 + 14z - 11. Let a be p(13). Let g be a + (-60)/(-3) +	{ "pile_set_name": "DM Mathematics" }
32104344 Convert -122253 (base 10) to base 11. -8393a Convert 21110120210220 (base 3) to base 12. 13b4229 11000010111110101 (base 2) to base 11 69004 Convert 42b2d9 (base 16) to base 8. 20531331 Convert -3069e (base 15) to base 8. -453436 What is -3086a9 (base 12) in base 14? -15b637 Convert -217137 (base 10) to base 5. -23422022 Convert 56c07 (base 15) to base 14. 72882 What is -4b3e71 (base 15) in base 10? -3607756 Convert 648105 (base 10) to base 7. 5336343 -613430 (base 7) to base 10 -104489 -151223 (base 6) to base 13 -681c Convert -257445 (base 16) to base 10. -2454597 What is -68d332 (base 16) in base 15? -90a775 What is b2a74b (base 12) in base 5? 1204000341 What is 1a7626 (base 14) in base 13? 26cc46 14441168 (base 9) to base 4 123112333031 What is -b86257 (base 13) in base 9? -8123513 What is 486099 (base 11) in base 16? bbd92 -101211221022212 (base 3) to base 6 -323325552 Convert -16427099 (base 10) to base 15. -169744e What is 65065200 (base 7) in base 12? 1a353b6 What is 46861 (base 12) in base 16? 17149 What is -6d68a (base 16) in base 3? -211202201201 What is -323134221 (base 5) in base 7? -14506650 Convert -13433652 (base 8) to base 14. -58bb86 Convert 25346226 (base 8) to base 7. 65536252 What is 6c2d (base 15) in base 2? 101100111010001 Convert 1280858 (base 13) to base 5. 2441034213 What is -3235e (base 15) in base 3? -22002122022 What is 23a67 (base 11) in base 3? 1202101221 What is -6263694 (base 10) in base 9? -12706150 Convert -b8bc6 (base 15) to base 4. -2033030220 What is 11011010101101011 (base 2) in base 16? 1b56b 351a619 (base 11) to base 16 5dd21b What is 1102303333 (base 5) in base 16? 2463cb What is -1001011123 (base 4) in base 14? -6d21d Convert 1211111001202 (base 3) to base 5. 222131431 Convert -112004104 (base 5) to base 3. -221102121010 21220101111 (base 3) to base 13 55a62 Convert 10614457 (base 8) to base 7. 25360100 405360 (base 7) to base 8 207014 Convert -1542303 (base 6) to base 14. -2538b 15413521 (base 7) to base 14 2a84b8 -b0186 (base 12) to base 16 -37bf6 Convert -200030213 (base 4) to base 3. -20200220102 What is -11306060 (base 8) in base 3? -11122000110210 112331111 (base 5) to base 2 1111100110110101110 Convert 340103404 (base 5) to base 7. 15435063 Convert -48a58 (base 11) to base 12. -34959 Convert 31414320 (base 5) to base 4. 1000120132 Convert 211122110002 (base 3) to base 6. 13315345 -51112313 (base 6) to base 11 -904978 -2235245 (base 6) to base 2 -11011110100001101 What is -d0c2 (base 14) in base 10? -35842 What is 182677 (base 9) in base 3? 12202202121 Convert -929511 (base 12) to base 16. -230d9d 23163366 (base 7) to base 2 111110000001101010110 What is -102001202112 (base 3) in base 11? -1396a7 4327104 (base 8) to base 2 100011010111001000100 What is 12774132 (base 8) in base 10? 2881626 What is -1022130323 (base 5) in base 15? -2c5b78 1aa6f8 (base 16) to base 9 3251885 Convert -c3671 (base 14) to base 10. -470499 352db1 (base 16) to base 2 1101010010110110110001 What is -765634 (base 8) in base 2? -111110101110011100 -1002010123 (base 4) to base 6 -5444511 What is -292228 (base 11) in base 9? -765551 Convert -1646412 (base 9) to base 4. -3133303100 Convert -6b8d1 (base 14) to base 15. -52b56 Convert 12a855 (base 15) to base 7. 10421663 10001002011 (base 3) to base 5 3403321 Convert -2005 (base 12) to base 4. -312011 What is -31482 (base 12) in base 7? -356240 3c81a (base 13) to base 15 23917 Convert -43639 (base 14) to base 7. -1246402 447bd (base 15) to base 11 139668 Convert 65762151 (base 8) to base 4. 311332101221 -1001011100000000 (base 2) to base 13 -14797 What is 37021354 (base 8) in base 14? 111ab24 Convert 29856 (base 13) to base 15. 18313 Convert 560a2 (base 13) to base 5. 14443434 -c51697 (base 14) to base 3 -110111212010002 What is 113332111 (base 4) in base 16? 17f95 341aa (base 16) to base 13 761aa 443205411 (base 6) to base 2 11110011111111001001111 12210201022 (base 3) to base 8 337105 What is 1525622 (base 9) in base 13? 2371ac -57310016 (base 8) to base 5 -11140020212 Convert -262231 (base 7) to base 10. -48826 What is 21001400 (base 5) in base 16? 2a044 What is 2631070 (base 9) in base 7? 15135255 What is 30616 (base 7) in base 4? 1311112 217364 (base 10) to base 7 1563500 -124244203 (base 5) to base 6 -21132130 What is -1523222 (base 7) in base 8? -625415 Convert -1002200210 (base 4) to base 2. -1000010100000100100 Convert -1110001011111100000 (base 2) to base 4. -1301133200 Convert -12051b (base 12) to base 16. -470e7 Convert -14979d (base 14) to base 13. -1c1894 14b67 (base 16) to base 13 2c801 11010100000110 (base 2) to base 15 404e Convert 72660 (base 12) to base 11. a239a Convert 16474606 (base 9) to base 12. 2922536 -101110011000101 (base 3) to base 14 -a47c4c What is 10200212212 (base 3) in base 8? 216157 Convert 114321313 (base 7) to base 15. 9580ad What is 900068 (base 11) in base 15? 1d9758 Convert 12211200 (base 5) to base 15. 2476a What is 41188 (base 16) in base 11? 172363 What is -153241252 (base 6) in base 14? -604c36 Convert 1260da5 (base 14) to base 7. 135060565 What is 303023233 (base 4) in base 6? 4254331 Convert 4450343 (base 6) to base 16. 36c57 What is -1202012202002 (base 3) in base 4? -3202320020 -143471 (base 10) to base 12 -6b03b What is -234320443 (base 5) in base 6? -35201025 -589a (base 13) to base 16 -30b0 Convert 9aa36b (base 12) to base 9. 4565762 What is -1000214232 (base 5) in base 15? -28ad97 -111001110010001001 (base 2) to base 5 -30033211 What is 1845203 (base 10) in base 8? 7023723 What is 108a38 (base 14) in base 9? 1045556 Convert 742490 (base 13) to base 3. 12010010001112 -64508 (base 13) to base 9 -305258 Convert -427c32 (base 13) to base 8. -5746276 Convert 4214503 (base 7) to base 2. 1111100000101000111 Convert 3613314 (base 8) to base 2. 11110001011011001100 11101110100111011110 (base 2) to base 15 1448d4 What is -122013232 (base 4) in base 3? -12102202121 311314 (base 10) to base 11 1a2993 Convert -2022011020 (base 3) to base 5. -2422222 -ae4f7 (base 16) to base 6 -23145235 Convert -147452 (base 10) to base 14. -3ba44 What is -1111001010001110 (base 2) in base 3? -10011011210 Convert -34210343 (base 6) to base 11. -652a2a What is 53944 (base 12) in base 5? 12011322 What is 220112100101 (base 3) in base 15? 98101 What is 133745 (base 9) in base 14? 219d5 Convert b7c982 (base 14) to base 16. 5ee806 Convert -7a8168 (base 12) to base 14. -39166c Convert 2960b (base 13) to base 6. 1400424 Convert -25965 (base 10) to base 16. -656d Convert -893a4 (base 12) to base 7. -1355413 What is 232a5 (base 14) in base 4? 110321201 -a727237 (base 11) to base 8 -110016470 Convert -b9b99 (base 13) to base 10. -335929 Convert -2885c8 (base 16) to base 3. -11222220220211 -16a393 (base 11) to base 12 -108014 4652215 (base 7) to base 11 369a47 What is -25423421 (base 7) in base 16? -2339f9 What is -11220220110220 (base 3) in base 12? -a61a80 What is -221151 (base 9) in base 14? -361c0 -3003222123 (base 4) to base 9 -1451323 Convert -40223140 (base 5) to base 6. -10511232 What is -46331 (base 12) in base 11? -64506 152235 (base 6) to base 3 202021112 What is 10022101022111 (base 3) in base 4? 12231201022 Convert 2011424 (base 6) to base 7. 543631 Convert 2546646 (base 7) to base 6. 11033523 Convert 59a51 (base 13) to base 7. 1253052 What is 5b0d3 (base 14) in base 16? 364f1 Convert 62400331 (base 7) to base 2. 10100000000010000110001 285313 (base 12) to base 10 672639 Convert 52152 (base 14) to base 4. 300103030 -146c60 (base 13) to base 10 -500825 What is -5215061 (base 7) in base 13? -18bc33 -1122213000 (base 4) to base 13 -ccc0c What is -552a31 (base 13) in base 16? -1e9992 What is -1547186 (base 9) in base 12? -354780 What is -3e1110 (base 15) in base 8? -13320632 Convert -80646 (base 10) to base 2. -10011101100000110 What is -116a1 (base 13) in base 3? -1121202121 Convert -94487 (base 11) to base 2. -100001100111001000 Convert 33069 (base 16) to base 6. 4251333 Convert -226147 (base 10) to base 12. -aaa57 1001111111111101100110 (base 2) to base 7 31165143 Convert -2114321 (base 8) to base 9. -1047760 Convert -3043221 (base 7) to base 4. -1120302231 Convert 213003511 (base 6) to base 2. 1110011010110110000011 -314013 (base 10) to base	{ "pile_set_name": "DM Mathematics" }
= 4l. Solve 0g + 3g - v = -lu, 4u - 6 = -g for u. 1 Suppose -2g = 5k - 9 - 16, -2k - g = -11. Let c = k - -3. Suppose -2 = l - c. Solve lv - 6v - 10 = -2b, v = 2b - 5 for v. -5 Let g be (74 + -53)/((9/2)/3). Solve 5c = -0c + d - g, 0 = 4c + 2d for c. -2 Let w(c) = c*2 + 3c + 4. Let z(b) = -4b2 - 8b - 11. Let v(j) = 7w(j) + 2z(j). Let y be v(6). Solve yr - q = -2r + 11, -13 = 4r + 5q for r. 3 Suppose 4k - 12 - 8 = 0. Solve -2y + 4c - 2 = 12, ky = -3c - 22 for y. -5 Suppose 3 = -5p + 8. Suppose 1 = -5b - j, 0j - 5j - 5 = 4b. Solve b = -3a + 4l, -4 = l - p for a. -4 Let z be (4 - 1) + 4 + 2. Suppose 5v + 4 - z = 0. Let k be (-3)/2(-1 - v). Solve -2o = 4c + 2o - 24, o - 16 = -kc for c. 5 Suppose -2l + 8 = 5x, -4l + 4x = -13 - 59. Let o = 39 - l. Solve 0 = n + 2b + 3b + 25, -5b = -n + o for n. 0 Let y(m) = 2m*2 + 7m + 2. Let v be y(-5). Let f = v + -9. Let w = -5 + 26. Solve 0 = 4d - 3s - w, 2d - 7 - f = 3s for d. 3 Let a be ((-9)/(-15))/(((-16)/20)/(-4)). Solve ap - 5r - 24 = 0, 2p + 9 = p - 4r for p. 3 Suppose -32 = -7m + 3. Solve -mp + 14 = 3l, 4l + 1 = 2p - 15 for p. 4 Let g(t) be the third derivative of -t4/24 - t3/3 + 6t*2. Let j be g(-9). Solve -3m + 5d = -j, -m + 5d + 1 - 2 = 0 for m. 4 Let u = 26 - 22. Solve 4a - 15 = i, i = ui - 15 for a. 5 Let q = 12 - 12. Let b(u) be the first derivative of -u*2/2 - u + 1. Let l be b(-5). Solve t + 3 = q, 1 - l = 3r + t for r. 0 Let l(f) = f + 6. Let t be l(-11). Let z(v) = -v*3 - 4v*2 + v - 7. Let c be z(t). Solve -4g = -d + c, -4g = -5d - 0 + 33 for g. -2 Let h(p) = -4p - 4. Let v be h(-1). Solve v = -2g + 5r - 23, 4 + 3 = -4g - 3r for g. -4 Suppose -5r - 4n = -5 - 12, -3 = -r - n. Solve 13 = b - rz + 2z, 2b - 6 = z for b. 1 Let s(u) = u*3 - 10u*2 - 9u + 2. Let g be s(11). Let j be 3/(-4) - (-618)/g. Solve -5m + 3a = -1 - 4, -5m = 3a + j for m. -2 Let i be -5 + ((-9)/1)/3. Let o = i + 18. Solve 5b = 2n - 10, -n - n = b - o for n. 5 Let r be -4 - (2 - 18/2). Let i = 17 - r. Solve 2d - 2c - 10 = 0, -2d + 0d - 4c = i for d. 1 Suppose -34 = -5q - o + 26, -3q + 29 = 2o. Solve 3r - 6 = 3a, -2r - 2r + q = a for r. 3 Suppose 5o - 135 = -5l, 4l + l - o = 153. Let n be 5/(l/(-4))33. Let b = -10 - n. Solve -b = -3x, 0h + h + 8 = x for h. -4 Let u = -3 - -6. Let v be 0/1 + u - -19. Let a(r) = -r*3 - 11r*2 - 10r + 4. Let l be a(-10). Solve -3g + g + 11 = 5f, 0 = -lf + 5g + v for f. 3 Suppose -3q + 12 + 24 = 0. Let s = -13 - -20. Suppose 0 = 3r - sr + 4. Solve -4u = -2u + 5o + q, o - r = 3u for u. -1 Let t(z) = 2z - 1. Let b be t(1). Let p be 4 - (b + (-1 - -2)). Let c be 0/(-4) + 6 + -2. Solve cd = pq - 16, -5d = -3d + 5q - 4 for d. -3 Suppose 18 = 4j + 2. Suppose v = 5h + 10, 2h = -jv - 2h - 8. Suppose 4x + vx = 12. Solve -8 = -2s - 4a, a = -s - xa + 8 for s. 0 Suppose -3w + 14 = 8. Solve -b + 8 = -3k, wb - 4k = 7b + 36 for b. -4 Suppose -2i = -3w - 9, -10 = -9i + 4i - 5w. Solve -4h - ix = -17, -4h + x = -15 - 6 for h. 5 Suppose -2 - 4 = -2g. Let n be 0 - (3 - 5 - g). Solve 3w = s + n, 2s + 0s + 2w + 10 = 0 for s. -5 Suppose 0 = -2o - q + 135, 59 = o - 4q - 31. Suppose -o = -2h - 3h. Solve -4c + 0f = -f + h, 2 = 2c + 4f for c. -3 Suppose 4g + 4 = 2k, 2g - 3k = -8k + 10. Solve g = -2q + 4q, 5b - q + 5 = 0 for b. -1 Suppose 2r - 34 + 2 = 0. Let z = 18 - r. Solve 3h = 4j - 2 - 4, -6 = 3h + zj for h. -2 Suppose 4 = -n + 6. Suppose no - 3 = -o. Suppose -o = -0r - r. Solve -2d - 2f = -r + 15, -4d = -5f + 10 for d. -5 Let z = -8 + 6. Let f(v) = 2v2 - v + 2. Let m be f(z). Solve n = w, 3w = -n - 2n + m for w. 2 Suppose 2y - d - 3d = 4, y - 8 = -4d. Let s = 24 - y. Solve -a - 10 = l + l, 4l = 4a - s for a. 0 Let i(j) = -3j + 7j + 3j2 + 0j2 + 4 - j3. Let s be i(4). Let a = -16 + 39. Solve -2k = -5f + a, 1 = -f - sk + 3k for f. 3 Let d(x) = 12x2 - 3x - 2. Let k be d(-1). Solve 6 - 31 = -5n, n = 4r + k for r. -2 Let y be (-4)/(8/14) - -7. Suppose -4c = f + 1, 3 - 17 = -3f + 5c. Let x be f/(-2)10/(-3). Solve -4j - 3 - 1 = y, -xj - 2 = -3l for l. -1 Suppose -5i - 3x = -4i + 12, -2i - 5x - 19 = 0. Let d = -1 + 2. Let y = 5 - d. Solve 3f = -ih - 9, -3h + yh + 1 = 0 for f. -2 Suppose -5c - 2w = 35, 5c + 17 = -w - 13. Let l = c + 10. Let y = -56 + 70. Solve -2d + 13 = -ls - y, 5s + 25 = 0 for d. 1 Let s = 62 - 62. Suppose -5i = 4 - 19. Let f be 6 + s + (-3)/i. Solve -y = -3m + 3, 4m = -2y - 1 + f for y. 0 Suppose 12y = 9y + 33. Solve y = -2f + 3h, 4f + 5h - 27 = 3f for f. 2 Let l(w) = -2w + 4. Let d be l(0). Solve dv - 3v + 5 = -2r, 0 = -5v + r - 25 for v. -5 Let g be (-36)/(-10) - (-7 - (-198)/30). Solve -4 - 4 = gf + 2y, 5f + 10 = 3y for f. -2 Let j(p) = 24p. Let y be j(1). Solve -y = -4b - 4z, -2b + 1 = -4z + 19 for b. 1 Let i be 1 + 1/(-1 - -2). Let f be i - (-4 - -1 - -2). Solve -2 = -fl + d + 1, 0 = 4l - 4d - 12 for l. 0 Suppose 0 = -2a - 3x + 15, 5a - 5x + 9x - 48 = 0. Suppose 0 = 5h - 47 + 2. Let i = a - h. Solve 2c + 4n + 1 = n, -5c - 2n + i = 0 for c. 1 Suppose -6c = -9c. Let d be 3 + c - 18/(-1). Solve -q = 3x + 2q + d, 5q = 3x + 5 for x. -5 Let b be (-2376)/(-405) - 4/(-30). Solve b = 2q + 5y - 4y, -3y - 37 = -5q for q. 5 Let s(f) = 12f - 2. Let w be s(3). Let j be (-1)/(1/w-2). Solve d = 2 - 5, 2u + j = -3d for u. -4 Let n be 2/8 + (-2)/8. Let h be -2 + 3 + (1 - -1). Suppose -ha - a + 8 = 0. Solve w - as - 3 + 2 = n, 0 = -2w + s - 7 for w. -5 Suppose 5c = 4j - 58, 3 + 11 = 2j + 5c. Let m be 38/j - (-2)/(-12). Solve 0 = 4r - 2r + 4q, 0 = mr + 3q for r. 0 Suppose 16 = 4r + 2v, -r - 2v + 8 - 1 = 0. Solve h + 8 = -3g, rg = -0g + 4h - 13 for g. -3 Let y = 17 - 10. Let x(r) = -r*2 + 6r - 2. Let d be x(5). Suppose 3s + 3g = 0, -s - 2g = 2s. Solve -3w - 5l = -sw - 17, y = dw - 5l for w. 4 Let g be (-12)/(1/(-2)). Suppose 3a = 5b - 3b + 78, 0 = 2a - b - 53. Let c be (-2 - a/(-20))-5. Solve 17 = -d + 3j, -gd = -d + 3j + c for d. -5 Let j be (0 - (-3)/3)-1. Let f be 3 - ((-4)/(-2) - 3). Let g = f + j. Solve -gn = -h + 6h + 17, 4h = -4n - 12 for h. -4 Suppose -4 - 10 = -7b. Solve 4k + 1 = -3z + 9, -bk = 2z - 2 for z. -4 Suppose 2j - 11 = 5. Solve -5k + 18 = l, k - 4l + j = 5k for k. 4 Let p(j) = 2j2 - 2j - 1. Let h be p(2). Solve -2y + 5r = -h, 0y = 2y - 2r for y. -1 Suppose -4j + 0j = -144. Suppose 0k = -4k + j. Solve -kl + 4l + 11 = -2t, t = 4l - 10 for l. 3 Let s(a) = -a3 + 9a*2 + a - 4. Let p be s(9). Solve 5q + 14 = 4c + 36, pc + 19 = 2q for q. 2 Let c be (-37)/(-6) - (-2)/(-12). Suppose -3p = -cp + 57. Let d = -8 + 12. Solve -3y + 14 = -5y + dx, 0 = 4y + x + p for y. -5 Let v = -18 + 28. Suppose 0 = r - 3r + v. Solve i = -4w + 14, 2i = 6i + rw - 23 for i. 2 Let n(i) = 9i + 4. Let d be n(4). Let j be (d/6)/(2/6). Suppose 0 = -3f - 20 + 95. Solve -f = v + 3v - p, -v - 5p + j = 0 for v. -5 Let i(h) = h + 8. Let n(t) = t*3 + 5t*2 - 4t + 4. Let a be n(-6). Let y be i(a). Solve 0 = 4j, -3j = f - y + 3 for f. -3 Let p = -9 - -13. Solve -4b + 15 = 5v, -pb + 3v = -b + 9 for b. 0 Suppose -4q - 3 + 11 = 0. Solve -5h + 17 = 3c - 3h, 4c = -qh + 22 for c. 5 Let f(t) = 4t2 + t. Let r be f(-1). Let j be 24/9 - (-1)/3. Solve 8w - rw = -3y - 19, jy + 2w = -4 for y. 2 Suppose 5m = 5y - 5, 4y - m - 2 - 8 = 0. Suppose 3s - 9 = -y. Solve -2x = 3l + 1 - s, 4x - 4l - 32 = 0 for x. 5 Suppose 4y = -2y - 84. Let r be 0/(-1) + (-10 - y). Solve rm + k = -m, -5k = -3m + 28 for m. 1 Let y be 8/3(-6)/(-8). Solve -3x = -4h - 5x - 2, -2h - yx - 2 = 0 for h. 0 Let v(d) = d + 3. Let a = 0 - 0. Let m be v(a). Solve 8o - mo = 5y - 5, 3y = o - 3 for y. -2 Let a = 52 + -35. Suppose -8s + 4s - 4 = 0. Let k be 3 + s(-2)/(-2). Solve -kc - 3 = r + 9, -3c - a = r for c. -5 Suppose 3r + 2r - 10 = 0. Suppose -rs = 5c + 3s - 30, -5s = -3c + 2. Let i be 26/6 - 2/(-3). Solve -2p + ip + 6 = cq, -p + 17 = 5q for p. 2 Let s(y) be the first derivative of 9/2y*2 - y + 1. Let v be s(1). Solve 0 = -vx + 3x - 4m + 11	{ "pile_set_name": "DM Mathematics" }
((sqrt(297) - (sqrt(297)1 - sqrt(297) - sqrt(297))) + sqrt(297) - sqrt(297) - sqrt(297) - sqrt(297)))/sqrt(9))/(sqrt(48)/sqrt(4)). sqrt(11)/2 Simplify sqrt(275)-25. -50sqrt(11) Simplify (-4-1(4 + sqrt(3) + -1))*2. 96sqrt(3) + 192 Simplify (-11sqrt(143))/(1sqrt(99)). -sqrt(13)/3 Simplify (-1sqrt(175) - sqrt(175))6. -60sqrt(7) Simplify (sqrt(102) + (sqrt(102)1 + sqrt(102) + sqrt(102) + sqrt(102) - sqrt(102))-3)/(1sqrt(294)). -8sqrt(17)/7 Simplify (1sqrt(5) + -2 - (sqrt(125) - sqrt(125)-1 - sqrt(125))*2)-4. -4sqrt(5) + 508 Simplify 2 + 3 + sqrt(2) + (2 + sqrt(2))-6. -5sqrt(2) - 7 Simplify (-1sqrt(162))*2 + sqrt(288)/sqrt(4). 6sqrt(2) + 162 Simplify (sqrt(200)-26 - sqrt(200))*2 + sqrt(200). 10sqrt(2) + 33800 Simplify sqrt(11) + 1 + 0 + -4. -3 + sqrt(11) Simplify ((sqrt(19) + 3)5 - sqrt(228)/(sqrt(84)/sqrt(7)))2. 120sqrt(19) + 529 Simplify -1 + (sqrt(2) - (3sqrt(2))2)-3. -3sqrt(2) + 53 Simplify 1(sqrt(176) + 3). 3 + 4sqrt(11) Simplify (sqrt(33) + (sqrt(825) - (sqrt(825) - sqrt(825)-1) - sqrt(33)) + sqrt(33))/((-1sqrt(891) - sqrt(891)) + sqrt(11))-6. -24sqrt(3)/17 Simplify (-6(sqrt(1331) + 2sqrt(1331) + 4)3)*2. 85536sqrt(11) + 3886380 Simplify -1 + -3sqrt(153) - 1((sqrt(153) + 0)*2 + sqrt(153)). -154 - 12sqrt(17) Simplify 3(4(sqrt(1216) + -1 + sqrt(1216)) + sqrt(1216))5. -60 + 1080sqrt(19) Simplify 1sqrt(108)-3. -18sqrt(3) Simplify (-5sqrt(125)/sqrt(5))/sqrt(5). -5sqrt(5) Simplify -4 + -3 + sqrt(32)-2. -8sqrt(2) - 7 Simplify 2 + sqrt(55)/(sqrt(30)/(sqrt(6)3)). 2 + 3sqrt(11) Simplify (sqrt(252) + sqrt(252)1)/sqrt(4) + ((-2sqrt(630))/sqrt(10))2 + -2. 6sqrt(7) + 250 Simplify sqrt(1331) + 0 + 5. 5 + 11sqrt(11) Simplify (sqrt(352)1 - sqrt(352))/sqrt(11). 0 Simplify (sqrt(224)/(sqrt(8) - sqrt(128)))/sqrt(4). -sqrt(7)/3 Simplify (sqrt(117) + sqrt(117) + 3-1sqrt(117))/((1sqrt(18))/sqrt(2) - sqrt(9) - sqrt(9)). sqrt(13) Simplify sqrt(11)23 + sqrt(33)/sqrt(3) + -5. -5 + 7sqrt(11) Simplify 3((sqrt(208) + 0)2 + sqrt(208)) + 5. 12sqrt(13) + 629 Simplify (sqrt(80) - sqrt(80)2-3 - sqrt(80))*2. 2880 Simplify ((sqrt(187) - sqrt(187)1)-2)/sqrt(11). 0 Simplify (0 + sqrt(1584)-4 + sqrt(1584) + sqrt(1584))*2-4. -25344 Simplify -1(1 + sqrt(288))2. -289 - 24sqrt(2) Simplify (-5 + sqrt(1216)-3)2. 240sqrt(19) + 10969 Simplify (sqrt(171)/(sqrt(324)-1 - sqrt(9)) + 2)2. -4sqrt(19)/7 + 215/49 Simplify (sqrt(539) + 0 + (sqrt(539)1)2)-4 + 4. -2152 - 28sqrt(11) Simplify (-3(sqrt(45) + -2sqrt(45)))/(sqrt(63)/(-1sqrt(7))). -3sqrt(5) Simplify (0 + -1 + sqrt(612) + sqrt(612) + (sqrt(612) + 1)-2)*2. 9 Simplify (-2(sqrt(76)/sqrt(4))*2 - sqrt(19))2. -76 - 2sqrt(19) Simplify (sqrt(750)-1)/(sqrt(66)/sqrt(99)). -15sqrt(5) Simplify sqrt(1260)/sqrt(7) - (sqrt(5) + -1 + -5). 6 + 5sqrt(5) Simplify (1 + (-1sqrt(2) + -1)1)2. 2 Simplify 5 + (sqrt(176))2 + ((sqrt(176))2 - sqrt(11)) + 5 + -1. -sqrt(11) + 361 Simplify (sqrt(612) + 1)2 + 4. 12sqrt(17) + 617 Simplify ((sqrt(245) + (-1 + sqrt(245) - sqrt(245)) + sqrt(5))3)*2 + -4. -144sqrt(5) + 2885 Simplify (5(2sqrt(833) + sqrt(833)))*2. 187425 Simplify sqrt(7)2-5 - (-1sqrt(847))*2. -847 - 10sqrt(7) Simplify ((sqrt(18) + (sqrt(18) - sqrt(18)-1))/sqrt(9)2)*2. 72 Simplify (-2 + sqrt(2))-4 - sqrt(6)/sqrt(75). -21sqrt(2)/5 + 8 Simplify (sqrt(171)/sqrt(3))/sqrt(3) + (-5sqrt(76))*2 + sqrt(19). 2sqrt(19) + 1900 Simplify ((-1sqrt(624) - sqrt(624))/sqrt(12))/(sqrt(4) - (sqrt(12)/sqrt(3)-4 + sqrt(4))). -sqrt(13)/2 Simplify sqrt(187)/(sqrt(11) + sqrt(539) + sqrt(539)-1). sqrt(17) Simplify (1sqrt(891))*2 + -3 - sqrt(891). -9sqrt(11) + 888 Simplify (sqrt(68)14)/(-3(sqrt(4) - sqrt(64))). 4sqrt(17)/9 Simplify 5 + (2sqrt(176) + sqrt(176))2. 1589 Simplify sqrt(22)/(sqrt(55)/(sqrt(30)/sqrt(6))). sqrt(2) Simplify -4(-1sqrt(243) + -5)2. -1072 - 360sqrt(3) Simplify ((-1sqrt(250))/(1(sqrt(5) - sqrt(20))))*2. 50 Simplify (sqrt(5) - (sqrt(20)3)/sqrt(4))-5. 10sqrt(5) Simplify 3 + (sqrt(38)/sqrt(50) + sqrt(19) - sqrt(19)). sqrt(19)/5 + 3 Simplify (-2 + (sqrt(252) - (0 + sqrt(252))) - (sqrt(252) - (sqrt(252)2 + 3 + sqrt(252))))2. 24sqrt(7) + 1009 Simplify (1(sqrt(17) - 6(sqrt(17) - sqrt(102)/sqrt(6))))*2. 17 Simplify 3 + -4 + sqrt(1100) + -3. -4 + 10sqrt(11) Simplify ((sqrt(12)/sqrt(4) + -2 + sqrt(3) - sqrt(3))2 - sqrt(3)) + (sqrt(12)/sqrt(4))2 + -3. -5sqrt(3) + 7 Simplify -1 + -1sqrt(2) - (-3-3sqrt(2))*2. -163 - sqrt(2) Simplify 3 + 2sqrt(51)/sqrt(3). 3 + 2sqrt(17) Simplify 5(0 + sqrt(11))-4 + -2. -20sqrt(11) - 2 Simplify sqrt(176) + 5 - sqrt(176). 5 Simplify sqrt(22)/(sqrt(11) + (sqrt(44)-2)/sqrt(4)). -sqrt(2) Simplify (sqrt(35) + (sqrt(35) - (-1sqrt(70))/sqrt(2)))/(sqrt(5)1-6). -sqrt(7)/2 Simplify (sqrt(1344) + (sqrt(1344) - -2sqrt(1344) - sqrt(1344)))/(2sqrt(12)/sqrt(4)). 12sqrt(7) Simplify sqrt(95)/(6sqrt(5)) + (sqrt(76) + -5)*2. -119sqrt(19)/6 + 101 Simplify (sqrt(684) + -1 + (sqrt(19) - (2sqrt(133))/sqrt(7)))2-5. -2380 + 50sqrt(19) Simplify (sqrt(117)-1-2)/((sqrt(63)-2)/sqrt(7)). -sqrt(13) Simplify 22sqrt(242) - sqrt(242). 33sqrt(2) Simplify (sqrt(114)-2-3)/(sqrt(864)-2 + sqrt(6)). -6sqrt(19)/23 Simplify ((1sqrt(51)/sqrt(3) - sqrt(17))-2)2. 0 Simplify 4 + (sqrt(260)/(sqrt(5)-2))2 + -2. 15 Simplify (sqrt(117) + -2 + sqrt(117))2 + sqrt(117) + (-2sqrt(13) + sqrt(13) + 1 - sqrt(13)). -23sqrt(13) + 473 Simplify -4 + -1 + sqrt(13) + sqrt(52)/sqrt(16). -5 + 3sqrt(13)/2 Simplify ((2sqrt(187)-3)/(sqrt(11) + -5(sqrt(11) + -1sqrt(11) - sqrt(11))))2. 17 Simplify (sqrt(25) - (sqrt(100)/sqrt(2))/sqrt(2))/(-3-2sqrt(5)). 0 Simplify -1 + ((sqrt(90) + sqrt(90)-2 + sqrt(90))/sqrt(10))/sqrt(3) + -1. -2 Simplify (-2(2 + sqrt(44)))2. 32sqrt(11) + 192 Simplify sqrt(95)/(sqrt(20)/(sqrt(12)/sqrt(3))). sqrt(19) Simplify 1 + -2sqrt(117) - sqrt(117) - sqrt(117) - (2(sqrt(117) + 0 + sqrt(117))*2 - sqrt(117)). -935 - 9sqrt(13) Simplify ((-2sqrt(14))/sqrt(7))25. 40 Simplify (1 + (sqrt(1900) - (sqrt(1900) + -2)))*2. 9 Simplify (sqrt(11) + -4 + (-1sqrt(11))*2)6 + -3. 6sqrt(11) + 39 Simplify ((sqrt(40)/sqrt(2) - sqrt(20))2)/sqrt(4). 0 Simplify (sqrt(132) - (-1sqrt(132)3 - sqrt(132)))/(sqrt(48)/(sqrt(4)1)). 5sqrt(11) Simplify (sqrt(5) - (sqrt(5) + (sqrt(5) - (sqrt(40)/sqrt(4))/sqrt(2))*2))6. 0 Simplify (-5(sqrt(363) + 1))2-2. -18200 - 1100sqrt(3) Simplify sqrt(99)2 + sqrt(33)/sqrt(48). 25sqrt(11)/4 Simplify (-6sqrt(105)/sqrt(3))/(sqrt(180)2). -sqrt(7)/2 Simplify ((1sqrt(700))*2 - sqrt(7))6. -6sqrt(7) + 4200 Simplify (sqrt(54)/sqrt(2))2 + 2. 29 Simplify -2 + sqrt(20) + (sqrt(5) + sqrt(60)/sqrt(3))2. 2sqrt(5) + 43 Simplify (-4 + (sqrt(99)/sqrt(9) + 5)*2)-6. -60sqrt(11) - 192 Simplify (sqrt(11) - (sqrt(11) - (2 + sqrt(275)))2) + 1(sqrt(11) + sqrt(11) + -2). -182 - 13sqrt(11) Simplify (sqrt(405) - (-3 + 2sqrt(405) - sqrt(405)))*2 - sqrt(405) - (-6sqrt(405)-2)2. -58311 - 9sqrt(5) Simplify -4((sqrt(1584) - ((sqrt(1584) + (sqrt(1584) + -1)-1 + sqrt(1584))*2 - sqrt(1584))) + 0). 6340 Simplify (0 + (2sqrt(17)-2 + sqrt(17) - sqrt(17)))2 + -2. 270 Simplify (1(sqrt(77) - (sqrt(77)1 + sqrt(77) + sqrt(77) + sqrt(77))))/sqrt(11). -3sqrt(7) Simplify (sqrt(66) + sqrt(66) + -1sqrt(66)-2)/(1sqrt(384)). sqrt(11)/2 Simplify ((2-2sqrt(20))/((sqrt(100) - -3sqrt(100)) + sqrt(100)))*2. 16/125 Simplify 64(-5-2sqrt(17))2. 40800 Simplify 4(sqrt(147) - (sqrt(147)-1-4 + sqrt(147))). -112sqrt(3) Simplify ((-61sqrt(132))/(sqrt(108)/sqrt(81)))2. 3564 Simplify (sqrt(102) - 2(sqrt(102)2 - sqrt(102)))/(4(sqrt(24)/sqrt(4) + sqrt(6))). -sqrt(17)/8 Simplify ((sqrt(27)/sqrt(3))/sqrt(3) + -2 + 1)*2. -2sqrt(3) + 4 Simplify 4 + 61sqrt(125). 4 + 30sqrt(5) Simplify (sqrt(891)41 + 4)2. 288sqrt(11) + 14272 Simplify 4 + sqrt(832)-1. -8sqrt(13) + 4 Simplify 4(sqrt(13) + (sqrt(13)-2)*2)-4-5. 80sqrt(13) + 4160 Simplify (-1 + (sqrt(4900) + -1sqrt(4900) + sqrt(4900))/((sqrt(77)-1)/sqrt(11)))*2. 20sqrt(7) + 701 Simplify sqrt(833)-2-6 - (-2sqrt(833))2-4. 84sqrt(17) + 13328 Simplify (4(-2sqrt(3) + -1))2 + -1 + sqrt(9)/sqrt(3) + 3. 65sqrt(3) + 210 Simplify (sqrt(175) + 0 + sqrt(175)-2)*2 + (6	{ "pile_set_name": "DM Mathematics" }
y - 23 - 26. Calculate -4g(d) + 11r(d). -2d - 1 Let o(s) be the third derivative of -s6/120 - s4/12 + 2s3/3 + 35s*2. Let y(d) = -2d*3 - 5d + 11. Determine -11o(h) + 4y(h). 3h3 + 2h Let s(d) = 5d2 + 9d - 4. Let g(h) = -h*2 - 2h + 1. Calculate 9g(m) + 2s(m). m*2 + 1 Let l(p) = 4 - 1 - 3 - 6p + 3p2 + 2. Let r(n) = -4n*2 + 7n - 2. Determine -6l(c) - 5r(c). 2c2 + c - 2 Let z(w) = 10w*2 + 30w + 30. Let n(g) = g + 1. Give 30n(j) - z(j). -10j*2 Let w(k) = -k + 2. Let n be (-1)/20 - -2. Let a(r) = 4r - 7 + rn + 2r*2 - 2r*2. Suppose -5o - 5l + 18 = -27, -4o + 34 = 3l. Give ow(x) + 2a(x). 2x*2 + x Let a(m) = -2m + 2. Let z(i) = -1. Let g(l) = l*2 + 5l - 3. Let q be g(-6). What is qz(j) + a(j)? -2j - 1 Let a(h) = h*2 - h + 1. Let m be (-2)/20-6 + (-1089)/165. Let k(u) = -1 - 5 + 2u - 5u*2 + 2u. What is ma(y) - k(y)? -y2 + 2y Let z(f) = -6f + 33. Let b(d) = d + 1. Calculate -4b(h) - z(h). 2h - 37 Let k(f) = 4f*2 - 5f2 - 13 + 16 - f2. Let n(w) = -w*2 + 4. Give -4k(d) + 3n(d). 5d*2 Let f(l) = -9l + 5. Let a(w) = w - 1. Suppose 4t - 2t = -h + 2, 0 = 2t - 2h + 10. Determine tf(u) - 6a(u). 3u + 1 Let v(w) = 2w*3 + 4w*2 - 2w + 3. Suppose -3q = 2q - 525. Let z be q/25 - (-1)/(-5). Let g(x) = 5x3 + 9x*2 - 4x + 7. Calculate zg(n) - 9v(n). 2n3 + 2n + 1 Let m(i) be the third derivative of -i4/24 - i2. Let s(u) be the third derivative of u*4/2 + 30u*2. What is -15m(o) - s(o)? 3o Let j(z) = -9z*2 + 5z + 7. Let k(p) = -4 + 14 + 6p - 2p + 3p - 13p*2. Determine 7j(y) - 5k(y). 2y2 - 1 Let n(j) = j2 - j + 1. Let r(z) = 7z2 - 7z - 1. Calculate -6n(a) + r(a). a2 - a - 7 Let i(o) = 6o*3 - 2o*2 + 3o - 5. Let n(r) be the first derivative of 5r4/4 - 2r3/3 + r2 - 4r + 5. Calculate -4i(l) + 5n(l). l3 - 2l*2 - 2l Let u(x) = 2x + 0x + x - 3. Let f(m) = -5m + 6. Determine -4f(p) - 7u(p). -p - 3 Suppose 3c - 4y - 10 = 1, -4y = 5c + 3. Let m(i) = -6. Let l(u) = 0 + 1 - 8. Let r(n) = -5l(n) + 6m(n). Let b(v) = -2v - 4. Calculate cb(z) - 6r(z). -2z + 2 Let a(p) = 3p2 - 3. Let k(d) = d2 - 2 - 4d2 + 6d*2. Give -2a(g) + 3k(g). 3g2 Let p(x) = x3 + x*2 - x. Let v(s) = 8s*2 - 8s. What is 24p(i) - 3v(i)? 24i3 Let q(r) = -5r*3 - 7r*2 - 2r. Let l(x) = -2x3 - 3x2 - x. Let n(c) = -c2 - 9c - 4. Let o be n(-6). Calculate ol(w) - 6q(w). 2w*3 - 2w Let y = 24 - 26. Suppose 7 = n + 3. Let z(g) = -2g - 2g*2 - 2g*2 - n + 6g*2. Let m(a) = -8a*2 + 9a + 17. Calculate ym(b) - 9z(b). -2b2 + 2 Suppose -2q = -0q - 8. Let x(k) = 2k*2 - 3k - 2. Let r(a) = 2a2 - 4a - 2. What is qx(p) - 3r(p)? 2p2 - 2 Let d(a) = 23a*2 + 3a - 17. Let b(p) = -8p2 - p + 6. Let g be ((-17)/(-3))/((-10)/(-30)). Determine gb(h) + 6d(h). 2h*2 + h Let r(h) = -4h + 2. Let j(n) = -3n + 2. Let y = -2 - -4. Let w = -3 - y. Calculate wj(v) + 4r(v). -v - 2 Suppose 2j - 15 = -39. Let f be ((-3)/j)/((-3)/(-12)). Let a(x) = -x3 - x2 - x - 1. Let m(l) = -5l3 - 4l*2 - 2l - 2. Calculate fm(o) - 4a(o). -o*3 + 2o + 2 Let h(b) = -7. Let t(f) = 30. Let s(v) = 21h(v) + 5t(v). Let c(k) = -k*2 + 2. Give -3c(x) + 2s(x). 3x*2 Suppose -3c + 10 + 5 = 0. Let w(y) = -3y2 + y2 + 10y - 2 - 11y. Let o(z) = -z3 + 5z*2 + 2z + 5. Calculate cw(u) + 2o(u). -2u3 - u Let v = 109 + -108. Let j(c) = -1. Let n(o) = -o - 3. What is vn(i) - 2j(i)? -i - 1 Let z(h) = 17h. Let p(j) = j + 1. Determine 2p(x) - z(x). -15x + 2 Let f(r) = -3r - 2. Let q(o) = o - 2o - 1776 + 1775. What is -f(v) + 5q(v)? -2v - 3 Let k(p) = 3p2 + 3p. Let u(z) be the second derivative of z*4/3 + 2z*3/3 - 13z. Give -3k(m) + 2u(m). -m*2 - m Let a(u) = -5u*3 - 3u*2 + 2u + 3. Let v(m) = -4m3 - 2m*2 + 2m + 2. Give -2a(n) + 3v(n). -2n3 + 2n Let v be 16/(-20)(-4)/((-24)/15). Let y(d) = d2 - 3. Let b(s) = -s2 + 1. Calculate vy(a) - 5b(a). 3a*2 + 1 Suppose -4k + 3k - 3i = -21, i = -4k + 29. Let x(d) = 6d*2 - 23. Let p(h) = 24h*2 - 7h. Let u be p(1). Let c(o) = -2o2 + 8. What is kx(t) + uc(t)? 2t*2 - 2 Let l(p) = -2p*2 + 2p - 3. Let w(k) = k*2 - k - 1. Calculate -l(c) + w(c). 3c*2 - 3c + 2 Let w(n) = -4n2 + 4n - 9. Let k(t) = -2t2 + 2t - 4. Determine 9k(p) - 4w(p). -2p2 + 2p Let b(t) = 4t2 + t - 3t - 14t2 + 9t2. Let k = 3 + -5. Let x(v) = v2 - v*2 + 11v + 6v2. Determine kx(h) - 11b(h). -h2 Let r(a) = a2 - 7. Let v(k) = -3k*2 + 21. Calculate -17r(q) - 6v(q). q2 - 7 Let v be 74/10 - (-15)/25. Let r be ((-2)/(-2))/(2/v). Let s(a) = -a2 - 3 + 2a + 4 - 4a2. Let x(f) = -6f*2 + 3f + 1. What is rs(h) - 3x(h)? -2h2 - h + 1 Let a(w) = -11w + 7. Let b(n) be the second derivative of -5n3/6 + 3n*2/2 + 36n. Give -2a(y) + 5b(y). -3y + 1 Let a(k) = 5k*2 - 2k + 2. Let t(f) = -f + 1. Determine -a(u) + 2t(u). -5u*2 Let f = 10 - 8. Suppose 5t = -2 + 27, 3t = fu + 41. Let r(k) = 19k2 + 13k - 13. Let s(g) = 9g2 + 6g - 6. Calculate us(o) + 6r(o). -3o2 Let h(x) = 2x*3 + 6x + 13. Let v(u) = 2u3 + 7u + 13. Determine -7h(g) + 6v(g). -2g3 - 13 Let r(g) = -g2. Let u(d) = 18d*2. Calculate -48r(q) - 3u(q). -6q*2 Let m(y) = 2y + 83. Let n(g) = -2g - 82. Calculate 3m(c) + 4n(c). -2c - 79 Let g(z) = z - 4. Let v be ((-3)/(-6))/(1/(-22)). Let f = 8 + v. Let k(m) = -2m + 7. Calculate fk(d) - 5g(d). d - 1 Suppose 4c + 11 = -25. Let b = -5 - c. Let w(t) = -3 + 1 + 6t + 0t. Let o(d) = -5d + 1. Calculate bo(l) + 3w(l). -2l - 2 Let p(l) = -3l2 + 14l + 4. Let u(d) = 1. Give -p(m) + 4u(m). 3m*2 - 14m Let n(k) = 4k2 - 7k - 8. Let o(p) = 17 - p*2 + 5p + 11p - p - 8p*2. What is 13n(x) + 6o(x)? -2x*2 - x - 2 Let i(z) = 5z - 8. Let m(r) = -2r + 3. Let j(k) = -3i(k) - 8m(k). Let d(x) be the second derivative of -2x3/3 + x2/2 - 4x. Give d(u) + 5j(u). u + 1 Let t(p) = -p*2 + 1. Let w(y) be the first derivative of -6y + 2 + 2y3 - 1/2y*2. Calculate -5t(f) - w(f). -f2 + f + 1 Let j(t) = t2 - 1. Let l(y) = -5y3 + 15y*2 - 15. Give 15j(p) - l(p). 5p3 Suppose 2 = h + j, -5h + 4h + 6 = 3j. Let x(v) = hv + 3 + 0 - 5 - v. Let y(w) = 2w + 3. What is 7x(g) + 4y(g)? g - 2 Let s(o) = 17o - 7. Let b(y) = 25y - 10. Give 5b(x) - 7s(x). 6x - 1 Let a(l) = -6l*2 - 9l. Let d(z) = 3z2 + 5z. Suppose 0 = -4s - s + 20. Let n = -1 - s. What is na(g) - 9d(g)? 3g*2 Let p(w) = -2w - 6. Let a(k) = -2k - 5. Calculate -4a(v) + 5p(v). -2v - 10 Let u(r) = -r + 1. Let s(q) = -2q2 - 3q + 7. Calculate -s(i) + 3u(i). 2i*2 - 4 Let q(n) = -13n2 - n. Let i(j) = j2 + j. What is -i(k) - q(k)? 12k2 Let t(f) = -3 + 1 + 0 + f2 + 4. Let r(b) = -1. Determine -3r(m) - 2t(m). -2m*2 - 1 Let f(n) = 8n - 1. Let d(b) = -8b + 2. Give 3d(j) + 4f(j). 8j + 2 Let c(f) = -f - 1. Let z(m) = 14m - 6m + 137m2 + 6 - 139m*2 + 2m*3. Give -8c(j) - z(j). -2j3 + 2j2 + 2 Let x(j) = j3 - j - 1. Let d(v) = -6v3 + v2 + 6v + 5. Let w(u) = d(u) + 5x(u). Let k(g) = -2g*3 + 4g*2 + 4g - 2. Give -k(q) + 4w(q). -2q*3 + 2 Suppose -l - 4k + 37 = -0l, -7 = -l + 2k. Let g(v) = 3v + 17. Let f(d) = -d - 6. Give lf(j) + 6g(j). j Let c(d) = d - 9. Let x be c(11). Let t(a) = 6a*3 + 3a*2 + xa - 6a + 0a. Let o(g) = 2g3 + g2 - g. What is 7o(v) - 2t(v)? 2v3 + v2 + v Let v(q) = 4q3 + q2. Let m(g) = 7g3 + g2. Let t(b) = -b*2 + 4b. Let a be t(3). Determine am(p) - 5v(p). p*3 - 2p*2 Let v(u) = -4u*2 - 6. Let x(m) = 2m*2 + 3. What is 6v(l) + 11x(l)? -2l*2 - 3 Let b(n) = 2n - 1. Let d(i) = -3i + 2. Let t(y) = -y3 + 5y*2 - 7y + 9. Let r be t(4). Calculate rd(u) - 5b(u). -u - 1 Let s(z) = 9z2 - 2z - 9. Let h be (-7)/(-2) - (-6)/(-12). Let n(g) = -g*2 - 5 + 3g*2 + 3g*2 - g. Calculate hs(y) - 5n(y). 2y*2 - y - 2 Let s = -93 + 88. Let i(n) = -n. Let d(p) = -2p. Give si(b) + 3d(b). -b Let p(j) = j + 1. Let n(b) = -5b - 22. What is n(w) + 3p(w)? -2w - 19 Suppose 6 = 5b - 64. Let y(u) = -17u + bu - 2 - 1. Let t(f) = 10f + 7. Let g(m) = -11m - 7. Let	{ "pile_set_name": "DM Mathematics" }
z: 1}. What is prob of picking 1 a and 1 c? 1/10 What is prob of picking 2 w and 2 n when four letters picked without replacement from {s: 1, w: 3, n: 2, o: 6, p: 2}? 3/1001 Two letters picked without replacement from {t: 9, p: 2, h: 8, v: 1}. Give prob of picking 1 v and 1 h. 4/95 Three letters picked without replacement from {o: 1, e: 7, u: 2, z: 2}. Give prob of picking 2 z and 1 u. 1/110 What is prob of picking 2 f and 1 i when three letters picked without replacement from ffuwyuiiffuf? 1/11 Calculate prob of picking 1 z and 2 x when three letters picked without replacement from xxxzi. 3/10 Calculate prob of picking 1 m, 1 u, and 1 t when three letters picked without replacement from wwwtwmuqw. 1/84 What is prob of picking 1 f and 2 w when three letters picked without replacement from wxvwvfvv? 1/56 What is prob of picking 1 w and 1 n when two letters picked without replacement from bynwa? 1/10 Two letters picked without replacement from {e: 5, q: 2, g: 6, r: 3, f: 1}. What is prob of picking 2 g? 15/136 What is prob of picking 4 p when four letters picked without replacement from {a: 1, p: 4, h: 1, m: 9}? 1/1365 Two letters picked without replacement from {c: 3, l: 3, z: 1, f: 1, m: 7, x: 2}. Give prob of picking 2 m. 21/136 What is prob of picking 1 d and 1 v when two letters picked without replacement from tdddvtxvxqdttxxqtxv? 4/57 Calculate prob of picking 1 w and 3 g when four letters picked without replacement from {w: 1, g: 2, d: 2, a: 1, i: 1}. 0 Four letters picked without replacement from {n: 1, j: 4, p: 1, y: 2, r: 11}. What is prob of picking 1 r, 1 y, and 2 j? 11/323 Three letters picked without replacement from {r: 1, m: 3, u: 1}. Give prob of picking 3 m. 1/10 Three letters picked without replacement from veveeeeveve. Give prob of picking 2 v and 1 e. 14/55 What is prob of picking 1 g, 1 v, and 2 y when four letters picked without replacement from gevvvvbbymye? 4/495 What is prob of picking 1 m and 1 y when two letters picked without replacement from {y: 6, a: 3, m: 7, s: 1}? 21/68 What is prob of picking 3 k when three letters picked without replacement from dkkdkkdkkk? 7/24 Two letters picked without replacement from {y: 2, b: 2, f: 10}. Give prob of picking 2 f. 45/91 Calculate prob of picking 4 v when four letters picked without replacement from {x: 2, f: 4, v: 6, s: 1, c: 4, h: 1}. 1/204 Four letters picked without replacement from {b: 10, n: 1, u: 1, x: 3}. What is prob of picking 1 u, 1 n, and 2 x? 1/455 Two letters picked without replacement from {a: 1, d: 2, k: 4, i: 1, e: 2, v: 5}. What is prob of picking 2 e? 1/105 Calculate prob of picking 4 f when four letters picked without replacement from {n: 2, f: 17}. 35/57 Three letters picked without replacement from nsnnssesshshnses. Give prob of picking 3 n. 1/140 What is prob of picking 2 z when two letters picked without replacement from lznalzo? 1/21 What is prob of picking 1 w and 1 u when two letters picked without replacement from {w: 6, p: 1, n: 4, l: 2, u: 2}? 4/35 Three letters picked without replacement from qoortqrrtrsotoqs. What is prob of picking 1 s, 1 q, and 1 o? 3/70 Two letters picked without replacement from yyvxxvyvxvxvyv. What is prob of picking 2 v? 15/91 Four letters picked without replacement from {y: 3, z: 8}. What is prob of picking 2 z and 2 y? 14/55 Four letters picked without replacement from {s: 1, i: 1, w: 3, p: 2, o: 3}. Give prob of picking 1 s and 3 w. 1/210 What is prob of picking 2 v and 2 j when four letters picked without replacement from {j: 11, v: 2}? 1/13 What is prob of picking 2 l when two letters picked without replacement from xdeldeddlqdqx? 1/78 Calculate prob of picking 1 a, 1 f, 1 i, and 1 d when four letters picked without replacement from {n: 1, i: 1, d: 2, f: 1, a: 2}. 4/35 What is prob of picking 2 m and 1 z when three letters picked without replacement from zlzmzmmm? 9/28 Three letters picked without replacement from cdqxl. Give prob of picking 1 c, 1 q, and 1 l. 1/10 Two letters picked without replacement from pzypyzapyepppppzppy. What is prob of picking 1 a and 1 e? 1/171 What is prob of picking 1 i, 1 u, and 2 d when four letters picked without replacement from zuddzdziddzuddux? 9/260 Four letters picked without replacement from {n: 2, r: 8}. What is prob of picking 3 r and 1 n? 8/15 Calculate prob of picking 3 s when three letters picked without replacement from sisisssss. 5/12 Calculate prob of picking 3 m when three letters picked without replacement from {p: 2, m: 7, t: 6}. 1/13 Calculate prob of picking 1 g, 1 x, and 2 k when four letters picked without replacement from okkroqgqxko. 1/110 Two letters picked without replacement from {d: 1, y: 2, l: 4, k: 4, p: 1, q: 7}. What is prob of picking 1 d and 1 q? 7/171 What is prob of picking 2 d when two letters picked without replacement from ddrdjzdjrjrjrrr? 2/35 What is prob of picking 2 y when two letters picked without replacement from iyyiiyi? 1/7 Calculate prob of picking 1 u, 1 c, and 1 f when three letters picked without replacement from {u: 1, a: 4, c: 3, f: 1, i: 4}. 3/286 Four letters picked without replacement from ggtgtgtttttttt. What is prob of picking 4 g? 1/1001 Calculate prob of picking 2 o and 1 q when three letters picked without replacement from zopzzzoookoqzooopz. 7/204 Three letters picked without replacement from {x: 2, y: 4, n: 1, d: 2}. Give prob of picking 1 d, 1 x, and 1 y. 4/21 Calculate prob of picking 3 y and 1 f when four letters picked without replacement from {f: 3, y: 15}. 91/204 What is prob of picking 2 q when two letters picked without replacement from qzzzq? 1/10 What is prob of picking 1 p and 1 b when two letters picked without replacement from {b: 1, p: 2, t: 4}? 2/21 Two letters picked without replacement from {p: 3, n: 4, y: 1, q: 6}. What is prob of picking 1 q and 1 n? 24/91 What is prob of picking 3 w when three letters picked without replacement from {w: 4}? 1 Three letters picked without replacement from mmyimyyyimmyyyy. What is prob of picking 1 i, 1 y, and 1 m? 16/91 Calculate prob of picking 1 x and 3 o when four letters picked without replacement from {x: 2, o: 3, d: 1, a: 1}. 2/35 Two letters picked without replacement from jjmmajn. Give prob of picking 1 m and 1 n. 2/21 Three letters picked without replacement from tkkbrpi. What is prob of picking 2 k and 1 b? 1/35 Calculate prob of picking 1 g, 1 q, and 1 c when three letters picked without replacement from ggggqqqqggcggcgc. 27/140 Calculate prob of picking 3 c and 1 f when four letters picked without replacement from {f: 8, t: 7, c: 3}. 2/765 What is prob of picking 2 p when two letters picked without replacement from {g: 7, q: 3, p: 4}? 6/91 Three letters picked without replacement from ohoujjuuuhjp. What is prob of picking 1 h, 1 u, and 1 p? 2/55 Calculate prob of picking 1 y and 2 q when three letters picked without replacement from jqjyqljwyoyyqjwjjw. 1/68 Calculate prob of picking 3 b when three letters picked without replacement from iiiiiiiiiibbbbbiiib. 20/969 What is prob of picking 1 u and 1 d when two letters picked without replacement from {t: 1, v: 3, s: 1, h: 5, u: 1, d: 2}? 1/39 Calculate prob of picking 3 j when three letters picked without replacement from jujjjujujjjjju. 30/91 Two letters picked without replacement from {c: 1, y: 1, h: 1, f: 1, u: 1}. Give prob of picking 1 h and 1 f. 1/10 What is prob of picking 1 t and 3 w when four letters picked without replacement from {w: 5, t: 5}? 5/21 Three letters picked without replacement from {f: 4, j: 5, p: 3}. Give prob of picking 3 p. 1/220 Calculate prob of picking 1 d and 2 f when three letters picked without replacement from ddddffddfdffdddddf. 15/68 Calculate prob of picking 1 m, 1 i, 1 b, and 1 u when four letters picked without replacement from ibibmu. 4/15 Calculate prob of picking 2 k when two letters picked without replacement from kkkkvkkkkkvkk. 55/78 What is prob of picking 2 r when two letters picked without replacement from {b: 1, r: 3}? 1/2 What is prob of picking 1 r and 1 f when two letters picked without replacement from yeppeeffyppbprppfe? 1/51 What is prob of picking 4 w when four letters picked without replacement from {w: 4, x: 3}? 1/35 Two letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
rs of s? 13, 17 Let c be 0 - (1 + -6 - -1). Let b be ((-88)/14)/((-82)/1435). Suppose -3i + b = 5m, cm - 6m + 5i = -44. What are the prime factors of m? 2, 11 Let a(k) = -3k*2 + 23k + 143. Let b(d) = d*2 - d - 1. Let l(h) = a(h) + 2b(h). What are the prime factors of l(23)? 5, 19 Suppose 5t + 100845 - 285390 = -5j, -4j + 184542 = 5t. List the prime factors of t. 2, 3, 6151 Let i be ((-12)/(-9))/((40/45)/(-4)). Let d(p) = 8p2 - 11p - 14. Let v be d(i). Suppose -v + 104 = -2b. List the prime factors of b. 2, 59 Let r(c) = 26c*3 - 15c*2 + 47c. What are the prime factors of r(5)? 2, 5, 311 Suppose -58y + 915869 - 174872 = -453107. What are the prime factors of y? 2, 5147 Suppose y + 46i = 10i + 48259, -144262 = -3y - 5i. What are the prime factors of y? 48079 Let g(p) = 2p*2 - p - 1. Let k be g(-1). Suppose -kw - 4i = 26 - 1000, -2i - 1493 = -3w. What are the prime factors of w? 3, 5, 11 Let p be (272/40 - 7)-10. Suppose 5k = -4l + pk + 2951, 2l - 1475 = -k. What are the prime factors of l? 11, 67 Suppose 5b + 2 = y + 18, 0 = -5b - 2y + 13. Suppose 4o - 764 = -4c, -4c + bc - 2o = -195. List the prime factors of c. 11, 17 Let t(m) = -1389m + 73. What are the prime factors of t(-48)? 5, 7, 1907 Suppose 278b = 345b - 4483439. What are the prime factors of b? 61, 1097 Let x(r) = r - 7. Suppose -5s - 17 = -32. Let k be x(s). List the prime factors of (44/((-12)/(-6)))/(k/(-30)). 3, 5, 11 Let a = 310 - 107. Suppose h = 1, 5m - a = h + 86. Suppose -z + 7 = 3t - m, -174 = -2z + 5t. What are the prime factors of z? 7, 11 Let l(t) = -50t - 120. Suppose 35 = -5o + 4j, -4o + o = 5j + 58. List the prime factors of l(o). 2, 5, 43 Suppose 4i = 4g - 40984 - 25148, -5g + 2i + 82659 = 0. List the prime factors of g. 61, 271 Let t = 10018 + -569. What are the prime factors of t? 11, 859 Let p(y) = 2y*2 - 2y - 33. Suppose -2x + 28 = 2w - 3x, 0 = 5w + x - 56. List the prime factors of p(w). 3, 7, 11 Suppose -3l = -u + 23, 4u - 2l - 47 - 35 = 0. Suppose 4s + k - 6394 = -k, u = 4k. What are the prime factors of s? 2, 3, 7, 19 Let y = 584 - 576. Let q be 1/24-11. Let z = y - q. What are the prime factors of z? 2, 3, 5 Suppose -25d + 14d + 31d - 1267580 = 0. What are the prime factors of d? 61, 1039 Let z(n) = n*2 - n - 9. Let b be z(-4). Suppose -3y + 45 = g - 4g, y = -3g + b. What are the prime factors of -2(1 - y)/((-4)/(-2))? 13 Let p = -10 - -15. Let x be (-14)/(-4 - (-10)/p). Suppose 0 = 3o - 5c - 119, -2o - 4c = -xc - 79. List the prime factors of o. 2, 19 Let t = 63 + 144. Suppose 4l - 3z - 312 = 0, 0 = -l + 4l + 5z - 205. Let a = t - l. What are the prime factors of a? 2, 3, 11 List the prime factors of (-209562)/(-18) + (-43 - -37)(-1)/9. 3, 3881 Let i = -23252 - -41324. What are the prime factors of i? 2, 3, 251 Let k be 6 - (-4)/(-6)-9. Let p(y) = 31y - 79. What are the prime factors of p(k)? 293 What are the prime factors of (-3)/(((-2)/87442)/((-24)/(-72)))? 43721 Let i = -380 - -377. List the prime factors of i/(-2 - (-33)/(-2352)-142). 2, 7 Suppose -112r - 8r = -31r - 2808662. List the prime factors of r. 2, 31, 509 Suppose -15 = 4j - 3, -210 = 2u + 2j. Let b be ((-12)/(-9))/(4/u). What are the prime factors of (b - 11)/(1-1)? 3, 5 Suppose -2c = 14c - 59440. Suppose 17r - 1793 = c. What are the prime factors of r? 2, 3 Let l = -5 - -154. Let o = l + -143. Let q(h) = 10h + 46. What are the prime factors of q(o)? 2, 53 Suppose 0 = -l - 4, 22l = k + 23l - 11671. What are the prime factors of k? 5, 467 Let r = 9 - -8. Let l(h) = 6 - h2 + 10 - 4 + 3 + rh. List the prime factors of l(12). 3, 5 Suppose -33n + 4k = -28n - 253576, -3n + 152172 = 2k. List the prime factors of n. 2, 5, 317 Let i = -107 - -115. Suppose n + ir - 6r = 372, -4n + r + 1515 = 0. List the prime factors of n. 2, 3, 7 Let q = 44 + -42. Suppose 4 = -qi - 16. List the prime factors of (-636)/i - 3/5. 3, 7 Let b = 39091 - 23293. What are the prime factors of b? 2, 3, 2633 Suppose 6r + 995234 = 61r - 14r. List the prime factors of r. 2, 53, 229 Suppose w + 164 = -46. Let c = w + 281. List the prime factors of c. 71 Let s be -1 + (-14)/(-4) + 8/16. Suppose s - 7 = o. Let c(a) = 11a2 + 4a + 8. List the prime factors of c(o). 2, 3, 7 Let x be 49/(-7)(-25)/35. Suppose xr - 8r + 2256 = 0. List the prime factors of r. 2, 47 Suppose 4k + 5i = 62972, -22k + 20k = -3i - 31464. What are the prime factors of k? 2, 3, 43, 61 Let l = -23539 + 49622. List the prime factors of l. 26083 Let k(t) be the first derivative of -181t4 + t3/3 - t2 - 2t + 113. List the prime factors of k(-1). 5, 29 Suppose 13q - 26478 - 15473 = 0. Suppose 9b + q = -6133. List the prime factors of (72/(-10))/(39/b). 2, 3 Suppose -3w + y + 67 = -8, -100 = -4w - 5y. Suppose 3z + 6974 = wz. List the prime factors of z. 317 Suppose -62g + 12669 = 2j - 67g, 8j + 4g - 50652 = 0. List the prime factors of j. 2, 1583 List the prime factors of (74491 - 613)(-2)/(-6). 2, 7, 1759 Suppose 3098868 = 45r + 759048. What are the prime factors of r? 2, 3, 7, 619 Let m = 93 + -92. Let w(q) = 72q3 + q2 + q - 1. Let u be w(m). Suppose -14 = -h - 2g - 5, 5h - u = -3g. List the prime factors of h. 17 Suppose 3a + 312 = 7a. Suppose 2y + 4 + 6 = 0, -3h = -2y - 22. Suppose a = p + 3x, 2p - hx + 79 = 3p. List the prime factors of p. 3, 5 Let o = 6705 - -23033. List the prime factors of o. 2, 14869 Let g = 57 - 26. Let s = g + 34. Let v = 97 - s. List the prime factors of v. 2 Let s(b) = -66b + 3569. List the prime factors of s(-56). 5, 1453 Let h(z) = -z*3 + 48z*2 - 174z + 78. What are the prime factors of h(39)? 3, 13, 179 Suppose 5x = 3z + z - 5614, 0 = 3z + 2x - 4222. List the prime factors of z. 2, 19, 37 Let d = 1011 - -974. What are the prime factors of d? 5, 397 Let q be (-4)/10 - 128/(-20). Suppose -5z + 3j = -81, -73 = z - qz - j. What are the prime factors of (-6)/((-36)/z)46? 5, 23 Let g = 196 - 268. What are the prime factors of ((-8)/14)/(g/27468)? 2, 109 Let s be (-604)/(-3)-12(-5)/40. Let o = s - 143. List the prime factors of o. 3, 53 Suppose 4a + 160 = 5z, 45 + 125 = 5z - 2a. List the prime factors of (8 - 7 - z)(-20)/14. 2, 5 Let q(y) = -388y + 131. Let u be (-1)/(6/905). What are the prime factors of q(u)? 5, 7, 37 Let l(u) = -21u*3 - 12u*2 - 20u - 14. What are the prime factors of l(-8)? 2, 5, 1013 Suppose 3125 + 2790 = 5w. Let p = w - 687. List the prime factors of p. 2, 31 Let h = -792 + 326. Let p = 617 + h. What are the prime factors of p? 151 Let o(i) = 44i - 119. Let u be 9/((1 - 5) + 5). List the prime factors of o(u). 277 Let x(v) = -31v - 4. Let i(r) = -r - 1. Let s(f) = 3i(f) - x(f). What are the prime factors of s(12)? 337 Suppose 0 = 28o - 214446 - 106994. Suppose 0 = -444k + 434k + o. List the prime factors of k. 2, 7, 41 Let z(w) = -w3 + 14w*2 + 11w + 49. Let c be z(15). List the prime factors of (c + 10)(512/(-1) - 2). 2, 257 Let b(t) = t2 - t - 12. Let y = 74 - 89. Let h be -2 + 99/y - (-6)/(-15). What are the prime factors of b(h)? 2, 3, 13 Let p = 3050 + -2532. List the prime factors of p. 2, 7, 37 Suppose 96s + 90s - 1996322 = 8701840. List the prime factors of s. 113, 509 Let x = 1398 + 6811. What are the prime factors of x? 8209 Suppose 0 = -5k + 2q + 38150, 4k - q = -6771 + 37294. What are the prime factors of k? 2, 3, 53 Let n = -140 + 140. Suppose -14v - 9v + 9867 = n. List the prime factors of v. 3, 11, 13 Suppose -a - 2j + 19 = 0, 4j - 83 = -2a - 3a. Suppose 0 + a = 5u, -3 = 5n - u. List the prime factors of ((n - -5) + 287)/(4/2). 2, 73 Let q(d) = 31d2 + 9d - 551. List the prime factors of q(-20). 7, 1667 Suppose 5v - 736 + 231 = 0. Suppose -2b = -u - 3u + 664, -666 = -4u + 3b. Let k = u - v. List the prime factors of k. 2 Let w(v) = -2v*3 + 32v*2 - 13v + 38. Let y be w(16). Let f = 341 + y. What are the prime factors of f? 3, 19 Let b = -251 + 253. Suppose -3j = q - 3025, bj = -0j + q + 2010. List the prime factors of j. 19, 53 Let s be 1 + 3 - 13/(-1). Suppose 2f - 2n = -2f - 22, -3n + s = -2f. What are the prime factors of (-190)/f6/124? 5, 19 Let d be 758	{ "pile_set_name": "DM Mathematics" }
. -11/5 (((-216)/(-210))/(-9))/(11/(-330)) 24/7 What is 42/8(-580)/(-12180)? 1/4 ((-17)/(-5))/(4/56966/345) 17 What is the value of (26005/(-15603))/(5/342)? -114 Evaluate ((-180)/105)/(112/2548). -39 Evaluate (42/15)/(1089/(-16335)). -42 Calculate (20/(-36)(-36)/15)/(17/34). 8/3 -14(455618/(-1316))/131 37 Calculate ((522/(-4))/(-9))/((-748)/2618(-14)/(-16)). -58 Evaluate ((-5)/(500/(-8)))/(44/990-144). -1/80 Evaluate (-28)/(1400/(-375))(-2)/12120/930. -5/31 2/((-536)/(-6))1108/(-81) -2/67 Evaluate ((-18)/(-40))/(3132/250560). 36 Evaluate -58(-53)/153702590/14. 37 What is the value of (2/(-4))/((1/(-7))/(1682/203))? 29 Evaluate ((-1800)/(-5625))/(17/((-289)/34)). -4/25 What is the value of -12(-75)/240(-8)/(-72)-6? -5/2 Calculate (((-5865)/92)/(-51)-2)/(10/(-224)). 56 28/(-6)(-70)/((-980)/63) -21 What is the value of 55(1140/385)/76? 15/7 What is (4/(-20))/(5/30018)? -2/3 Calculate (((128/(-24))/(-16)0)/((-42)/(-21)))/6. 0 Evaluate ((((-180)/(-10))/3)/(-2))/((-13)/13). 3 (-12)/24((-34)/(-153))/(4/333) -37/4 Evaluate ((-25)/15)/((-58520)/528). 2/133 What is the value of (((-60)/(-594))/(-5))/(561/(-10098))? 4/11 Evaluate (10/20)/(((-7)/140)/(3/(-10)))7. 21 What is ((-5)/10)/((-17303)/(-3146))? -1/11 (-3)/(12642/2352)(-2)/76 2/57 (-285(-666)/52725)/(22/80) 72 Calculate (((-6)/(-4))/(1380/368))/(4/(12/93)). 2/155 Calculate (3/(-5))/(4857/(-161900)). 20 37(-148)/646989417 -2/139 (-96)/25626/(-1)62/9 13 What is (-3)/(11/((-88)/10)(-8418)/115)? -2/61 Calculate -288(-83)/((-116532)/117). -24 What is (-28)/80((-470)/280)/4710? 1/8 Evaluate 75/6(-486)/243. -25 (3533/(-39))/((-19)/19) 41 Calculate -353/(-1)1752/(-721532)-353. 90 (2613/15678)/((-2)/120) -10 What is the value of (14/(-20))/76/(-96)-24? -3/20 ((-378)/4)/((-2835)/810) 27 What is the value of (294/(-1029))/((-4)/210)? 15 Calculate ((-126)/33264)/((-49)/2156). 1/6 Calculate ((-510)/(-15))/(-1224)201. -5/9 What is the value of (8/(-456))/((3/2)/(18/(12/(-2))))? 2/57 What is ((236985/24)/(-259))/(5/(-16))? 122 What is the value of (-1(-7)/((-147)/(-14)))/((-4)/18)? -3 What is (-23751)/(-117)2/14? 29 Calculate 5088/(-477)135/(-1980). 8/11 Evaluate (13/(416/408))/((-8)/(32/(-3))). 17 What is the value of 1(9/((-360)/(-16)))/(14/(-5))? -1/7 What is (18/6)/((2262/221)/(-58))? -17 -59(-72)/(-10620)15/(-738) 1/123 What is the value of (177/((-18408)/52))/((-1)/156)? 78 Calculate 66/(-5)(-8540)/(-1708). -66 ((-2380)/9520)/((-2)/(-406)) -30 What is ((-2)/8)/(45/9180)? -51 Calculate (10476/(-13386))/(11/253). -18 Calculate ((-68)/(-119))/((51/170)/((-6)/10)). -8/7 What is the value of ((-18)/(-30))/(((-4)/(-8))/(36/(-72)))85? -51 -10(-567)/(-105)(-65)/78 45 What is ((-4)/30)/((-4)/(-12))(-41535)/127374? 3/23 Calculate (7480/(-275))/((-8)/(-1)). -17/5 Evaluate (188/(-12))/((-74)/9546-43). -47 What is ((-18)/4)/((-1758)/(-1465)5/(-56))? 42 Evaluate 272552/(-43803)2/7(-2)/83. 4/3 Evaluate ((-26)/429011(-1)/19)/(24/(-144)). -2/95 Calculate (20/12480-52)/(((-35)/18)/5). 3/14 What is ((20328/330)/((-2)/5))/(-2)? 77 What is the value of ((-20)/(-60))/(7(-12)/(-1638))? 13/2 What is the value of (3243/(-718865))/(3/(-10))? 2/133 What is the value of (-780)/(-312)(-36)/1215? -2/27 Evaluate (16/(-80)(-7)/(-7))/(44/40). -2/11 Evaluate -3-3(14/2)/21(-36)/(-4806). 2/89 What is the value of (127/(-5(-5)/(-25)))/(239/(-239))? 127 What is the value of (107(-10676)/(-1175930))/(4/70)? 17 Evaluate (-8)/((-31)/(651/(-252))2/(-15)). 5 Calculate (5852/(336/12))/(-11). -19 Calculate (-876)/2993((-9)/12)/(21/71). 3/41 What is the value of (5/(-4))/(80190/114048)? -16/9 Evaluate ((-104)/48)/(4784/(-83168)). 113/3 (-620)/(-120)(-14445)/(-9951) 15/2 Evaluate ((-41)/(328/(-312)))/1. 39 What is 574/(-8610)(-12)/10(-7200)/162? -32/9 What is (-47)/((-752)/(-48))((-4)/(-2))/((-1)/(-9))? -54 -5(-17)/(-272)-8(-12)/(-1695) 2/113 Evaluate (139480/31700)/(11/(-210)). -84 What is (-21)/35((-60)/(-9))/10(-975)/13? 30 1/(((-18130)/280(-3)/(-14))/(12/16)) -2/37 What is the value of (-8)/(-42)78075/6940? 15/7 Calculate (6/(-10))/((-9024)/827200). 55 What is the value of (-11193)/246(8/5)/((-28)/(-10))? -26 What is the value of (14/(-13))/((-2520)/(-114660))? -49 ((-24751)/(-2335))/((-8)/40) -53 10/2256-6298/27416 -2/115 Evaluate (5(-8)/500)/(49(-6)/(-420)). -4/35 Calculate (-88)/14(120/400)/(39/(-455)). 22 Evaluate (-12138)/(-4335)60/(-7). -24 Evaluate -48/32(-4891)/(-73). -67 ((-28)/(-70))/((4/(-4))/(335/1608)) -1/12 Evaluate ((-2)/(-4))/((-711)/29388(-2)/(-3)). -31 Evaluate 14/(-4)((-3416)/(-110593))/(((-4)/(-6))/1). -6/37 1((-28896)/(-80))/21(-15)/(-6) 43 What is (9/157514)/((-15)/(-375)-115)? -2/115 Evaluate (45/15)/(-3(234/12)/((-36)/(-16))). -3/26 Calculate (-870)/165(6765/30)/41. -29 Evaluate (4360/(-2725))/((-2)/(-15)11/((-66)/(-9))). -8 Evaluate ((6/8)/((-17625)/(-150)))/(-29/(-180)). 3/47 ((125/(-18))/25)/(245/(-378)) 7/6 What is ((-4)/10)/(672/(-240))25606/62? 59 What is the value of (-1124)/(-16298)(-2726)/4? -47 Evaluate (-86)/(-1032)-15-20. 25 Calculate (2/(-5))/(8874/145)6. -2/51 (38/95)/((-21)/2730) -52 What is (-61755)/(-16468)(-16)/5? -12 Calculate 130/66316558/(-7305). -4/9 What is the value of 2(((-16)/(-40))/(904/30))/((-195)/130)? -2/113 What is the value of (-76)/(-1045)(75/(-54))/((-825)/(-495))? -2/33 What is the value of (3339/(-318)14/(-49))/(((-12)/(-58))/2)? 29 What is ((-14)/28)/(2/((-528)/(-36)))26? -44 Calculate (510/6-2)/((-64575)/77490). 20 ((-810092)/(-19599))/(-42/(-24)) 124 Evaluate 141/479/((-14457)/244). -47 Evaluate 42781/3976. 11/7 What is (210/570)/(((-1)/8)/((-28)/784))? 2/19 (((-14238)/12)/7)/(138/92) -113 Evaluate (-62)/(4960/784)30/(-273). 14/13 What is ((5341/654)/(1/244))/(-1)? -49 (-44)/10(-175)/3640-130 -55/2 Evaluate (7/(-28)470)/(880/704). -94 Calculate 1120(-112)/(-182280)-93. -48/7 What is (-49)/(-1960)-3056/4? -21/2 What is 2/(-4)138697/2037? -33 (35/(-1750))/((-10)/8) 2/125 (44274/2656440)/(1/42) 7/10 (585/(-468))/((-2)/(-10))4 -25 What is the value of 80/140(-42)/12(4/(-90))/(-2)? -2/45 Evaluate (0/((-480)/((-720)/18)))/2. 0 What is the value of 1/(-24)(-85)/102(-12)/(-1)? 5/12 What is ((-225)/(-1890)21)/((-5)/170)? -85 What is (-540)/140(-23)/(276/56)? 18 Calculate 20844/3821422/136. 3/34 What is 8910/(-9405)(-228)/168? 9/7 What is 16/6-2156/5200? -4/25 What is (-126)/12010(-3)/(((-54)/(-52))/(-3))? -91 What is the value of (555/(-1221))/(880/(-121))? 1/16 What is (686/49)/143? 3 Evaluate ((-12)/(-16))/(321732/(-15888)). -1/27 What is ((8/10)/((-5)/(50/14)))/(44038/(-1589))? 2/97 What is ((-210)/(-294))/(3/12-2)-28? 40 Evaluate 12/((-2)/(-2))264222/56619. 56 What is (-1134)/(-252)(-6)/(-63)133? 57 ((-16)/20)/(((-41)/123)/(130/12)) 26 Evaluate 1/(14/(-4270)80/22414). -61 What is the value of (-270)/54(-16)/(-520)? -2/13 What is 62090/(-44)16/(-120)? 38 What is (-16)/(181056/92)9? -3/41 What is the value of ((178/12)/((-46)/(-92)))/((-81)/243)? -89 ((23280/(-240))/(-97))/(((6/357)/2)/(-1)) -119 What is ((-19905)/(-139335))/(((-1)/14)/1)? -2 What is the value of ((-3)/((-6)/(-8))126/(-756))/((-2)/210)? -70 What is the value of (-106206)/(-9136)754/1209? 29/4 What is 252/(-77)(-15950)/(-2900)? -18 What is the value of (1064/(-24206))/(154/91)? -2/77 Calculate ((-61500)/92256/(-80))/(1/138). 69 What is the value of (-192)/(-96)1/(-7)-7? 2 Evaluate (57/(-19))/3(-50)/2675. 2/107 What is the value of (18/54036)/(2(-4)/400)? -60 ((-72)/(-54))/(2/(-39))894/(-447) 52 What is the value of ((-332)/19588826)/(2/(-6)-2)? -21 What is the value of 24/80120/(-144)5/3? -5/12 Evaluate ((-6)/9)/((-534)/18423)10/5. 46 Evaluate (275/(-550))/(((-1)/3)/(790/(-15))). -79 (1433/(-57288))/((-1)/(-12)) -3/31 (680/1428)/(((-5)/18)/(-5))(-28)/4 -60 What is the value of 6/(-48)(-77088)/(-7884)? -11/9 What is (31/(-2))/((214335/(-21450))/433)? 65 What is the value of 7/140-10560/8? -35 What is (-88)/121(-18)/(-126)(-14)/4? 4/11 Evaluate ((-6)/36)/(485/(-1164)8/(-10)). -1/2 (6/7)/((26/(-140))/(60/300)) -12/13 Evaluate 30/(-50)(-5)/2247/(-39). -19/2 What is the value of -3*((-35)/((-5460)/(-104)))/((-2)/53)? -53 What is the value of	{ "pile_set_name": "DM Mathematics" }
eters? 3500 How many weeks are there in 13930.2849 hours? 82.9183625 How many years are there in 21/5 of a decade? 42 What is 18/7 of a week in hours? 432 What is 11/8 of a gram in milligrams? 1375 How many tonnes are there in 51.14323 grams? 0.00005114323 What is three eighths of a day in hours? 9 What is seventeen quarters of a gram in milligrams? 4250 What is thirty-seven fifths of a decade in years? 74 How many meters are there in fourty-nine quarters of a kilometer? 12250 Convert 9.81927l to millilitres. 9819.27 What is sixty-four fifths of a millisecond in microseconds? 12800 What is seven halves of a gram in milligrams? 3500 What is 892892.3 millennia in years? 892892300 What is 1/4 of a litre in millilitres? 250 How many millilitres are there in thirty-three fifths of a litre? 6600 How many tonnes are there in 991.6875 grams? 0.0009916875 What is 569223.3 centuries in decades? 5692233 What is 3.317435 litres in millilitres? 3317.435 What is 3/5 of a millennium in decades? 60 How many grams are there in seventeen halves of a kilogram? 8500 How many litres are there in 78.635 millilitres? 0.078635 How many millilitres are there in eleven halves of a litre? 5500 How many centimeters are there in 1/80 of a kilometer? 1250 What is 0.2681228ml in litres? 0.0002681228 How many micrometers are there in 1/4 of a millimeter? 250 What is 26/5 of a millennium in months? 62400 Convert 948232.6 weeks to days. 6637628.2 What is 9.395276 tonnes in milligrams? 9395276000 What is 31/2 of a century in years? 1550 How many microseconds are there in 566452.6 nanoseconds? 566.4526 What is 64.0712 decades in months? 7688.544 Convert 2.015591 milligrams to nanograms. 2015591 Convert 59016.44ns to milliseconds. 0.05901644 What is one sixteenth of a gram in micrograms? 62500 How many months are there in 23/6 of a year? 46 What is 0.5197522 millilitres in litres? 0.0005197522 How many micrometers are there in 3/50 of a centimeter? 600 How many minutes are there in 17/4 of a week? 42840 How many centimeters are there in one twentieth of a kilometer? 5000 How many micrograms are there in 45767.93mg? 45767930 How many millilitres are there in three eighths of a litre? 375 How many minutes are there in 3/8 of a week? 3780 Convert 230.10018 months to millennia. 0.019175015 What is 8/3 of a day in hours? 64 Convert 537001.5 tonnes to nanograms. 537001500000000000000 What is seventeen halves of a litre in millilitres? 8500 How many nanometers are there in fifty-seven halves of a micrometer? 28500 How many months are there in twenty-one quarters of a decade? 630 What is 11/2 of a litre in millilitres? 5500 How many microseconds are there in 3/40 of a second? 75000 What is 1/100 of a kilometer in meters? 10 How many millilitres are there in thirty-one halves of a litre? 15500 What is 5/14 of a week in minutes? 3600 How many millimeters are there in five eighths of a meter? 625 What is 55/4 of a kilogram in grams? 13750 Convert 840355.2 months to centuries. 700.296 What is 99.87109 micrograms in tonnes? 0.00000000009987109 What is 2568250.8 hours in days? 107010.45 What is six fifths of a centimeter in micrometers? 12000 What is 922.845nm in centimeters? 0.0000922845 What is one tenth of a minute in milliseconds? 6000 Convert 8.686029 years to months. 104.232348 How many millilitres are there in 0.6264138l? 626.4138 What is eleven eighths of a tonne in kilograms? 1375 What is 981916.5l in millilitres? 981916500 How many nanograms are there in seventy-three quarters of a microgram? 18250 How many years are there in 8802.768 decades? 88027.68 Convert 17047.44ml to litres. 17.04744 What is 87.788457 milliseconds in hours? 0.0000243856825 What is 1/4 of a kilogram in grams? 250 How many millilitres are there in 914293.1 litres? 914293100 Convert 79.33511us to milliseconds. 0.07933511 What is nineteen quarters of a micrometer in nanometers? 4750 How many nanometers are there in twenty-five quarters of a micrometer? 6250 How many nanograms are there in six fifths of a microgram? 1200 How many milliseconds are there in 824.0684 weeks? 498396568320 How many nanometers are there in 12/25 of a micrometer? 480 What is twenty-five halves of a millennium in years? 12500 What is 9.703884s in minutes? 0.1617314 What is eighty-five quarters of a litre in millilitres? 21250 How many grams are there in seven halves of a kilogram? 3500 How many litres are there in 0.9099794 millilitres? 0.0009099794 What is 1/5 of a meter in centimeters? 20 Convert 972158.3l to millilitres. 972158300 How many micrometers are there in 49/5 of a millimeter? 9800 What is 1571.9004s in minutes? 26.19834 How many seconds are there in 1/4 of a minute? 15 How many micrometers are there in seventeen quarters of a centimeter? 42500 What is 9.475134 millilitres in litres? 0.009475134 What is 6.456023ug in grams? 0.000006456023 What is 63.731628 minutes in days? 0.044258075 How many tonnes are there in 779244.5 milligrams? 0.0007792445 How many days are there in 1.912788us? 0.00000000002213875 What is 11/2 of a centimeter in micrometers? 55000 What is 6/5 of a litre in millilitres? 1200 What is five quarters of a meter in millimeters? 1250 What is 33/5 of a meter in centimeters? 660 What is eleven eighths of a gram in milligrams? 1375 How many decades are there in 1.590328 years? 0.1590328 Convert 2128.6818ns to hours. 0.0000000005913005 How many millennia are there in 70055.55 centuries? 7005.555 How many hours are there in 37/2 of a day? 444 How many centimeters are there in 5/8 of a kilometer? 62500 How many nanograms are there in 3790.962kg? 3790962000000000 How many decades are there in 499.3322 millennia? 49933.22 How many kilometers are there in 64.49704um? 0.00000006449704 How many millilitres are there in 40417.82 litres? 40417820 How many millilitres are there in three tenths of a litre? 300 What is fourty-eight fifths of a decade in years? 96 What is 0.91095 nanograms in grams? 0.00000000091095 How many grams are there in 0.6011258kg? 601.1258 What is twenty-six fifths of a kilogram in grams? 5200 What is six fifths of a milligram in micrograms? 1200 How many millilitres are there in 44/5 of a litre? 8800 How many nanometers are there in 45/4 of a micrometer? 11250 What is 57.04374 grams in milligrams? 57043.74 What is thirteen fifths of a micrometer in nanometers? 2600 Convert 0.4894945mm to centimeters. 0.04894945 Convert 676342.6ms to seconds. 676.3426 How many kilometers are there in 90972.8 millimeters? 0.0909728 How many millilitres are there in 15/4 of a litre? 3750 What is 3/5 of a litre in millilitres? 600 Convert 3.735608 milliseconds to seconds. 0.003735608 How many millimeters are there in 68067.85cm? 680678.5 What is 49.07729 centimeters in millimeters? 490.7729 What is 43.66767 nanograms in micrograms? 0.04366767 What is three tenths of a kilogram in grams? 300 What is 61539.85 weeks in hours? 10338694.8 What is 3/5 of a kilometer in centimeters? 60000 Convert 238889.1 decades to months. 28666692 What is seven halves of a centimeter in millimeters? 35 How many kilograms are there in 5.700877 tonnes? 5700.877 What is 18.92691l in millilitres? 18926.91 What is 1/16 of a kilogram in milligrams? 62500 What is 73668.49 millimeters in kilometers? 0.07366849 What is three fifths of a millisecond in microseconds? 600 Convert 0.1412603km to nanometers. 141260300000 How many decades are there in three tenths of a century? 3 What is 32/5 of a centimeter in micrometers? 64000 Convert 600.099m to millimeters. 600099 Convert 558213.6 milligrams to kilograms. 0.5582136 How many milligrams are there in three tenths of a gram? 300 How many years are there in five quarters of a millennium? 1250 Convert 66339.22m to kilometers. 66.33922 How many kilograms are there in 0.6227689ug? 0.0000000006227689 Convert 36693.72m to micrometers. 36693720000 What is 515.9163ug in milligrams? 0.5159163 How many nanometers are there in 34/5 of a micrometer? 6800 What is 1185.477l in millilitres? 1185477 How many centimeters are there in 977917.4km? 97791740000 What is 16790.76 centuries in millennia? 1679.076 How many millilitres are there in 36.21306 litres? 36213.06 What is 3/10 of a kilometer in meters? 300 What is 5/4	{ "pile_set_name": "DM Mathematics" }
/(x*(2/23)(x(x(1/12)/x)/x)/x) assuming x is positive. x(3257/2484) Simplify ((d/d24d)/d(-6))/(d(2/69)/(dd(d*7d)/d)) assuming d is positive. d(-485/69) Simplify h7hh/(h(h(1/2)hh)/h)(h1)9 assuming h is positive. h*(31/2) Simplify c/(cccc*(3/14))c/c*4(c/(c*11c))/(cc(2/45)) assuming c is positive. c(-10873/630) Simplify (r(-11)(rr(-4))/r)/(r(2/13))18 assuming r is positive. r(-231/13) Simplify ((yy1)/(y3/y))/(((y/(y*6/y)yy)/y)/(y(2/5)y)) assuming y is positive. y*(22/5) Simplify (yyy(2/9)/yy)(2/49)/(y(-9)/(y(y/((y(-2)y)/y))/y)) assuming y is positive. y(5332/441) Simplify (q(2/15)q4)/(q/(q4q)q24) assuming q is positive. q(-238/15) Simplify (r(-4/3)rrrr1(r*(1/4)/r)/rrr5)(2/41) assuming r is positive. r(83/246) Simplify (c(2/15)c/(c(-2/41)/c))(-32) assuming c is positive. c*(-42944/615) Simplify ((((g/(ggg(1/53)g))/g)/gg(gggg(-5/6)/g)/g)19)(31/3) assuming g is positive. g(-534223/954) Simplify ((a0)(-3/5)aa(-4)/aaa/a(-3))(-27) assuming a is positive. a(-27) Simplify ((n/((n(1/24)n)/n))/((n/(n*(-13)n))/nnn))/((n(-25)/n)/n(20/7)) assuming n is positive. n(2657/168) Simplify (a4/a)/(a/(aa1))(a/((a2/a)/a))(2/15) assuming a is positive. a(62/15) Simplify ((y(-1/2))*(-5/4)/(y/(y/(y/(y/(y/(yyyy(yy/(y/y*(-2)))/yyyy)))))(y/(yy(-5)))/y))(-4) assuming y is positive. y*(-5/2) Simplify ((((vvv/(v(-3/4)v))/vvv)/v)/v*(1/5))/((v/(vv/((vvv*9v)/v)v))/v(-3/10)) assuming v is positive. v(-27/4) Simplify ((qq*(-2/43)q)/((qq43q)/q))(3/4) assuming q is positive. q(-1356/43) Simplify (((l*23l)/l)/(l*16l))/(l(-19)/l27) assuming l is positive. l52 Simplify ((w(4/7)w)(2/61))(-1/20) assuming w is positive. w(-11/4270) Simplify (s(-21)s(s(((s/(ss(-1/7)s))/s)/ss)/ss)/s)(-16) assuming s is positive. s(2448/7) Simplify (a(-2/11)/(a(-2/9)a))/(a/a0)(-27) assuming a is positive. a(2578/99) Simplify (m(1/6))11/(m/(mm/((mm(-5))/m)))(-1/22) assuming m is positive. m(103/66) Simplify (((q/q(3/7))/q(2/5))/(qq1)(12/5))(-4/31) assuming q is positive. q(648/1085) Simplify ((ll/(l/(l3/l)))23)(-4/5) assuming l is positive. l(-276/5) Simplify (d(-1/12))31(d/(dd/(d/d(1/7))))/(dd*(-18)d) assuming d is positive. d*(1115/84) Simplify (ll(l/l(-10/11))/ll*24)/((ll*21l)/ll(14/3)) assuming l is positive. l(8/33) Simplify (((x/(x(1/2)x))/x)/(x/(xx(3/16))))/(x13x(-8)) assuming x is positive. x(-101/16) Simplify (j*(-5)j*(-9)jj(j(-2/3))28)(4/11) assuming j is positive. j(-368/33) Simplify (j(-7/6))(-11/2)(j/((j/j21)/j))(-13/4) assuming j is positive. j(-781/12) Simplify (i/i(-12))(-33)(ii(-1/15))/ii*(9/2)/ii assuming i is positive. i(-12737/30) Simplify (t(-3/8))(-11/6)/(t(-14/5)t(-4)) assuming t is positive. t(599/80) Simplify (j/(j/(j/(jj/j*(-2/15))j)))*(2/61)(j/(j/j(1/14)))(-1) assuming j is positive. j*(-971/12810) Simplify k(k*(-2)k)/kk(1/2)k*(1/2)k/((k/(kkkk/(k/k(2/3)k)k))/k) assuming k is positive. k(14/3) Simplify (p(-5)/p)(-24/7)/((p(1/6)p)/p)(-1/30) assuming p is positive. p(25927/1260) Simplify vv(-6)vvvv(-1/8)((v*(-12/7)vv)/vv)/(v/(vv/(v(-3)v))) assuming v is positive. v*(65/56) Simplify (aa(aa*(2/7))/aaa(-1)(aa/(a(a/a0)/a))41)(-16) assuming a is positive. a(-4848/7) Simplify r14/((r(10/7)r)/r)(r/r(-11))/r5 assuming r is positive. r(137/7) Simplify (y(8/5)/y)/y*(-1/9)(yy(-12/7)/y)(12/11) assuming y is positive. y(-4016/3465) Simplify (((x(2/9))(-16))(-18))(-44) assuming x is positive. x(-2816) Simplify ((oo29)/(o/o(5/7)))20 assuming o is positive. o(4160/7) Simplify (ss0)30/(s/((ss*0s)/s)s(-12)) assuming s is positive. s42 Simplify (oo*(-1/3)o)*(-9)/(oo/(oooo15/o)oooo(-4)) assuming o is positive. o Simplify ((s(-1/2))(1/29)/(s1)(-47))(1/41) assuming s is positive. s(2725/2378) Simplify ((((ss/s*(2/5))/s)/s)/ss)*(2/85)/(ss*(-10)/ss(-9)) assuming s is positive. s(8071/425) Simplify (c(-1/3))47(((c/((c/(cccc/((c*(4/9)/cc)/c)c))/c))/c)/c)(-30) assuming c is positive. c(-457/3) Simplify (t8)(-2)tt18ttttt/t(2/9) assuming t is positive. t(70/9) Simplify (s(-3)/s)39s(-15)/((s(1/3)/s)/s) assuming s is positive. s(-508/3) Simplify (yy1)/(y/y(1/15))yy*11y/(y/y*(1/5))y assuming y is positive. y*(214/15) Simplify tt*(-2/11)t*(-14)(t(3/11))34 assuming t is positive. t(-43/11) Simplify (u/(u/(u/u2)))/u*(-8)(uu(-3))(-5/8) assuming u is positive. u(33/4) Simplify (c/c(-10/7)c7)/(c/c(-9)c/(c/((ccc(7/5))/c)cc)c) assuming c is positive. c(-69/35) Simplify (o(-19)o/(o/((oo(-1/4))/o)))(2/91) assuming o is positive. o*(-11/26) Simplify ((cc6)/c)(3/11)/(c(-3)/c0) assuming c is positive. c*(51/11) Simplify (ww*6ww(-1))/(w30/(w/((w(-3/2)ww)/w))) assuming w is positive. w(-43/2) Simplify (h(-4/5)h)*(-5/13)/((h(hh(-8/5)h)/h)/(hh(7/6))) assuming h is positive. h(659/390) Simplify (j(-4/3)j(j/(j/(jj*(5/7))j)jj)/jj)/((j/j(2/25))/(j10j)) assuming j is positive. j(6542/525) Simplify (z(-6)zz*6z*(2/13)/zz(-3))(-41) assuming z is positive. z(1517/13) Simplify (m(-4/3)/((mm/((m5m)/m))/m))/((m*10m)/(mm(-4)mm)) assuming m is positive. m(-28/3) Simplify (((m/(mm*8m))/mm)/m)(-2)(m*(29/2)m)/m(8/5) assuming m is positive. m(339/10) Simplify (c/c*(-4))/(c(c/(cccc/c(2/7)c)c)/c)(c(-1/4))25 assuming c is positive. c*(41/28) Simplify (vvv(4/3)v)/(v*(-20)/v)(vv/v(-10))(1/86) assuming v is positive. v(3286/129) Simplify (o(8/9)o(-2/7))/(o10o(3/2)) assuming o is positive. o(-1373/126) Simplify ww/(w*(-2)/w)www*6(w/(www(4/3)))38 assuming w is positive. w(-227/3) Simplify (((((v(-1/6)/v)/v)/v)/(v*3v))(3/11))(-2) assuming v is positive. v(43/11) Simplify (((s(-7)s)/(s(-2/9)s))(1/56))0 assuming s is positive. 1 Simplify ((pp(1/2)p)*(-27)(p/((p/(p(pp*(2/3)/p)/p))/pp))(1/41))(1/51) assuming p is positive. p(-16601/12546) Simplify (f/(f(-7)f)f/f4)/(f/(f2f)f*5f) assuming f is positive. 1 Simplify (n4/(n/n(-2/95)))/(n*(-8/5)nnn(2/27)) assuming n is positive. n(1285/513) Simplify ((x*(-2)x/(x/x5))(-10/9))(-14) assuming x is positive. x(140/3) Simplify (wwww(7/5)/www)/((w/(w7/w))/w)w*10/((ww((w/w(-2/13))/w)/www)/ww) assuming w is positive. w*(1186/65) Simplify ((((rr*7r)/rr)/r(-1/3))/(r(2/3)r(-2/3)/r))(-4/29) assuming r is positive. r(-124/87) Simplify g(-13/3)/(ggg(g(g/g*(-11))/g)/g)g*(-32)/(g/(g/(g/(gg(g/(g(1/10)g))/g)))) assuming g is positive. g(-1513/30) Simplify m(9/4)m(-8)(m(1/3))(1/39) assuming m is positive. m(-2687/468) Simplify (k(-1))*(-21)/((k/((kk(-3))/k))/k(-1/7)) assuming k is positive. k(118/7) Simplify (s(-5)s(-1/6))/(s/((s/(ss*(-3/16)/s))/ss))(-11/4) assuming s is positive. s(-1091/192) Simplify (x/((x1/x)/x))(-2)(x/(x/(xxxxx(-5/2))))(1/7) assuming x is positive. x(-53/14) Simplify (h7/h(7/2))/(h(1/3)h/h20) assuming h is positive. h(133/6) Simplify ((ll/l(1/2)l)/l*(-1)l/((l*5/l)/l)ll/l(-2))8 assuming l is positive. l44 Simplify (l/l(2/11)l)*45/(ll*(-2/9)ll/l(-8)) assuming l is positive. l(7033/99) Simplify ((((z/z7)/z)/(z(zzz/(z/(z*(1/2)zz)))/z))/((z((zz(5/6))/z)/z)/(zz/((z/(z(z(3/4)z)/z)zz)/zz))))0 assuming z is positive. 1 Simplify ((l/((l/((((ll*(2/17)l)/l)/l)/l))/ll)l)/((l/(((lll/(l/l*(-7))l)/l)/l))/l))/((ll(-10)l)/(l/(ll(1/10)))) assuming l is positive. l(343/170) Simplify (r(r/(rr4))/r)(-20/11)(((((r/(r/r*(-2/43))r)/r)/r)/r)/r)/(r/r*3r) assuming r is positive. r*(2472/473) Simplify (ww*(-2/29)w)/w*(2/5)(((ww(-3))/w)/w)*(-5/16) assuming w is positive	{ "pile_set_name": "DM Mathematics" }
:38 AM? 11:24 PM How many minutes are there between 12:11 AM and 8:39 AM? 508 What is 104 minutes before 8:02 PM? 6:18 PM How many minutes are there between 1:17 PM and 9:41 PM? 504 How many minutes are there between 6:45 PM and 11:11 PM? 266 What is 636 minutes before 6:00 AM? 7:24 PM What is 101 minutes before 10:54 AM? 9:13 AM How many minutes are there between 7:09 PM and 6:09 AM? 660 How many minutes are there between 11:48 AM and 11:05 PM? 677 What is 480 minutes after 3:31 AM? 11:31 AM What is 525 minutes before 8:45 PM? 12:00 PM What is 41 minutes after 1:06 AM? 1:47 AM What is 54 minutes after 6:54 PM? 7:48 PM What is 250 minutes after 2:24 PM? 6:34 PM What is 354 minutes after 2:04 AM? 7:58 AM What is 60 minutes before 4:07 PM? 3:07 PM How many minutes are there between 9:48 AM and 10:44 AM? 56 How many minutes are there between 12:25 PM and 11:29 PM? 664 What is 710 minutes after 5:10 PM? 5:00 AM How many minutes are there between 10:40 AM and 3:57 PM? 317 What is 430 minutes after 3:43 AM? 10:53 AM How many minutes are there between 11:51 AM and 9:42 PM? 591 How many minutes are there between 12:18 PM and 12:38 PM? 20 How many minutes are there between 12:04 AM and 9:45 AM? 581 What is 253 minutes after 4:06 PM? 8:19 PM How many minutes are there between 11:20 PM and 2:00 AM? 160 How many minutes are there between 8:30 AM and 7:40 PM? 670 How many minutes are there between 10:55 AM and 5:39 PM? 404 What is 270 minutes before 2:34 AM? 10:04 PM How many minutes are there between 6:11 PM and 12:06 AM? 355 How many minutes are there between 8:59 AM and 3:55 PM? 416 What is 160 minutes before 7:42 AM? 5:02 AM What is 56 minutes before 8:08 PM? 7:12 PM What is 617 minutes before 3:50 PM? 5:33 AM What is 429 minutes before 4:50 AM? 9:41 PM How many minutes are there between 10:23 AM and 12:55 PM? 152 What is 553 minutes after 3:03 PM? 12:16 AM How many minutes are there between 12:27 AM and 8:54 AM? 507 How many minutes are there between 4:18 AM and 2:52 PM? 634 What is 707 minutes after 4:44 PM? 4:31 AM How many minutes are there between 7:23 PM and 11:35 PM? 252 How many minutes are there between 1:36 PM and 9:26 PM? 470 What is 344 minutes before 1:57 AM? 8:13 PM What is 62 minutes before 1:50 PM? 12:48 PM What is 296 minutes after 2:36 AM? 7:32 AM What is 209 minutes before 12:32 PM? 9:03 AM What is 249 minutes after 3:02 AM? 7:11 AM How many minutes are there between 4:17 AM and 9:44 AM? 327 What is 89 minutes before 8:48 AM? 7:19 AM What is 194 minutes before 9:41 AM? 6:27 AM What is 9 minutes after 2:53 AM? 3:02 AM How many minutes are there between 12:56 PM and 10:34 PM? 578 How many minutes are there between 11:13 AM and 11:32 AM? 19 How many minutes are there between 5:43 AM and 4:19 PM? 636 How many minutes are there between 8:57 AM and 4:16 PM? 439 What is 644 minutes before 7:31 PM? 8:47 AM How many minutes are there between 8:05 AM and 1:20 PM? 315 What is 175 minutes after 9:22 PM? 12:17 AM What is 612 minutes after 7:42 PM? 5:54 AM What is 322 minutes after 10:36 AM? 3:58 PM How many minutes are there between 12:19 AM and 4:25 AM? 246 How many minutes are there between 3:43 PM and 6:39 PM? 176 What is 646 minutes after 3:19 PM? 2:05 AM How many minutes are there between 2:32 PM and 2:27 AM? 715 What is 19 minutes after 3:18 AM? 3:37 AM What is 505 minutes after 7:38 PM? 4:03 AM What is 470 minutes after 6:10 AM? 2:00 PM How many minutes are there between 4:02 PM and 7:19 PM? 197 How many minutes are there between 10:11 PM and 6:57 AM? 526 How many minutes are there between 3:02 AM and 8:20 AM? 318 How many minutes are there between 10:37 AM and 6:29 PM? 472 How many minutes are there between 1:12 PM and 9:56 PM? 524 What is 690 minutes after 7:52 PM? 7:22 AM What is 165 minutes after 10:30 PM? 1:15 AM What is 194 minutes after 1:02 AM? 4:16 AM How many minutes are there between 8:38 PM and 5:12 AM? 514 What is 60 minutes after 8:33 AM? 9:33 AM What is 60 minutes after 1:19 AM? 2:19 AM What is 568 minutes after 9:59 PM? 7:27 AM How many minutes are there between 9:17 PM and 4:01 AM? 404 What is 681 minutes after 3:48 AM? 3:09 PM What is 587 minutes before 1:18 AM? 3:31 PM How many minutes are there between 11:50 PM and 2:29 AM? 159 How many minutes are there between 6:00 PM and 1:10 AM? 430 What is 705 minutes before 5:45 AM? 6:00 PM What is 144 minutes after 4:30 PM? 6:54 PM What is 618 minutes after 1:30 AM? 11:48 AM How many minutes are there between 10:09 AM and 7:27 PM? 558 What is 320 minutes before 4:04 AM? 10:44 PM How many minutes are there between 12:13 AM and 5:45 AM? 332 What is 292 minutes before 10:20 AM? 5:28 AM How many minutes are there between 6:36 PM and 4:00 AM? 564 What is 195 minutes before 6:31 AM? 3:16 AM How many minutes are there between 1:46 AM and 8:32 AM? 406 How many minutes are there between 8:30 PM and 12:44 AM? 254 What is 244 minutes after 12:32 AM? 4:36 AM What is 59 minutes after 4:20 AM? 5:19 AM What is 394 minutes after 11:45 AM? 6:19 PM What is 687 minutes before 11:59 AM? 12:32 AM What is 42 minutes before 8:01 PM? 7:19 PM How many minutes are there between 7:28 AM and 6:12 PM? 644 How many minutes are there between 9:29 AM and 7:14 PM? 585 What is 587 minutes before 5:22 PM? 7:35 AM How many minutes are there between 9:53 PM and 2:42 AM? 289 How many minutes are there between 6:15 AM and 1:54 PM? 459 What is 514 minutes after 8:07 PM? 4:41 AM What is 90 minutes after 9:45 PM? 11:15 PM How many minutes are there between 8:18 AM and 7:43 PM? 685 How many minutes are there between 6:23 PM and 8:31 PM? 128 How many minutes are there between 9:56 AM and 8:08 PM? 612 What is 644 minutes after 2:02 PM? 12:46 AM What is 171 minutes after 10:17 AM? 1:08 PM What is 315 minutes after 10:10 AM? 3:25 PM What is 691 minutes after 5:43 PM? 5:14 AM How many minutes are there between 10:16 PM and 12:38 AM? 142 How many minutes are there between 5:55 AM and 11:13 AM? 318 What is 9 minutes before 9:23 AM? 9:14 AM What is 457 minutes before 3:35 AM? 7:58 PM What is 373 minutes before 5:29 AM? 11:16 PM How many minutes are there between 4:21 AM and 5:37 AM? 76 What is 332 minutes before 12:36 AM? 7:04 PM What is 669 minutes after 10:43 PM? 9:52 AM What is 44 minutes after 4:08 PM? 4:52 PM How many minutes are there between 12:02 AM and 10:27 AM? 625 What is 453 minutes after 7:09 PM? 2:42 AM What is 514 minutes before 6:19 AM? 9:45 PM How many minutes are there between 4:48 PM and 10:09 PM? 321 What is 286 minutes before 8:02 PM? 3:16 PM What is 300 minutes after 4:38 AM? 9:38 AM What is 689 minutes after 8:50 AM? 8:19 PM How many minutes are there between 7:49 AM and 5:48 PM? 599 How many minutes are there between 10:02 AM and 10:06 AM? 4 What is 175 minutes before 2:24 PM? 11:29 AM What is 616 minutes after 3:12 AM? 1:28 PM What is 41 minutes after 8:00 AM? 8:41 AM How many minutes are there between 4:12 PM and 3:34 AM? 682 What is 137 minutes after 10:27 AM? 12:44 PM How many minutes are there between 2:09 PM and 7:46 PM? 337 What is 525 minutes before 2:53 AM? 6:08 PM How many minutes are there between 10:39 PM and 11:33 PM? 54 What is 408 minutes before 6:50 PM? 12:02 PM How many minutes are there between 6:11 PM and 4:08 AM? 597 How many minutes are there between 7:16 AM and 5:50 PM? 634 What is 414 minutes after 11:01 PM? 5:55 AM What is 63 minutes after 8:40 AM? 9:43 AM What is 260 minutes after 9:10 AM? 1:30 PM How many minutes are there between 12:44 PM and 2:47 PM? 123 What is 467 minutes after 12:37 PM? 8:24 PM What is 342 minutes after 4:52 PM? 10:34 PM How many minutes are there between 5:05 PM and 12:53 AM? 468 How many minutes are there between 1:58 PM and 12:37 AM? 639 What is 385 minutes after 2:51 AM? 9:16 AM How many minutes are there between 7:10 PM and 5:27 AM? 617 What is 48 minutes before 4:07 PM? 3:19 PM What is 443 minutes before 5:32 PM? 10:09 AM What is 709 minutes before 5:58 PM? 6:09 AM What is 557 minutes before 11:41 PM? 2:24 PM How many minutes are there between 10:22 PM and 5:10 AM? 408 What is 708 minutes before 8:26 PM? 8:38 AM How many minutes are there between 1:06 PM and 7:51 PM? 405 How many minutes are there between 3:27 AM and 2:32 PM? 665 How many minutes a	{ "pile_set_name": "DM Mathematics" }
of 335, 6761, 24187, 58109, 114023? 916a3 + 4a*2 + 2a - 587 What is the o'th term of 357764, 357888, 358016, 358148, 358284? 2o2 + 118o + 357644 What is the s'th term of -11246, -44678, -100394, -178388, -278654? s*3 - 11148s*2 + 5s - 104 What is the t'th term of 23515, 49356, 75197, 101038? 25841t - 2326 What is the v'th term of -145089, -290209, -435329, -580449, -725569? -145120v + 31 What is the y'th term of 28851, 57970, 87089, 116208? 29119y - 268 What is the a'th term of -9027679, -18055356, -27083035, -36110716, -45138399, -54166084? -a2 - 9027674a - 4 What is the i'th term of -206096, -412403, -618710, -825017, -1031324? -206307i + 211 What is the z'th term of -17378, -34370, -50972, -67184? 195z*2 - 17577z + 4 What is the d'th term of 9786, 9745, 9690, 9621, 9538? -7d2 - 20d + 9813 What is the o'th term of -13480, -27022, -40634, -54316, -68068, -81890, -95782? -35o2 - 13437o - 8 What is the y'th term of 1027152, 1027156, 1027160? 4y + 1027148 What is the g'th term of 68639, 60071, 51503, 42935, 34367, 25799? -8568g + 77207 What is the m'th term of -342953, -685902, -1028851, -1371800? -342949m - 4 What is the c'th term of 1908, 152, -1604? -1756c + 3664 What is the z'th term of 472254, 944492, 1416730, 1888968, 2361206, 2833444? 472238z + 16 What is the i'th term of -16148, -19660, -23174, -26690, -30208, -33728, -37250? -i2 - 3509i - 12638 What is the r'th term of 103085058, 103085064, 103085080, 103085112, 103085166, 103085248, 103085364, 103085520? r3 - r2 + 2r + 103085056 What is the j'th term of -1418, 1545, 4522, 7519, 10542, 13597, 16690? j3 + j2 + 2953j - 4373 What is the u'th term of -26082, -51917, -77750, -103581, -129410, -155237, -181062? u*2 - 25838u - 245 What is the o'th term of -58025, -117023, -176021, -235019? -58998o + 973 What is the q'th term of -7070, -28319, -63758, -113399, -177254, -255335, -347654, -454223? -2q*3 - 7083q*2 + 14q + 1 What is the u'th term of 608773, 608801, 608829, 608857, 608885, 608913? 28u + 608745 What is the p'th term of 31544, 28902, 26260, 23618? -2642p + 34186 What is the l'th term of -291513, -583030, -874549, -1166070, -1457593, -1749118? -l*2 - 291514l + 2 What is the t'th term of -179217, -716726, -1612521, -2866602, -4478969, -6449622, -8778561? -179143t2 - 80t + 6 What is the x'th term of -51906, -50984, -50062, -49140, -48218? 922x - 52828 What is the r'th term of 18290, 36062, 53834, 71606, 89378? 17772r + 518 What is the y'th term of -8511, -34018, -76515, -135996, -212455, -305886? y*3 - 8501y*2 - 11y What is the r'th term of 66115178, 132230366, 198345554, 264460742, 330575930? 66115188r - 10 What is the l'th term of 198026, 396051, 594078, 792107, 990138, 1188171? l2 + 198022l + 3 What is the v'th term of -30136274, -30136276, -30136278? -2v - 30136272 What is the l'th term of -44924, -89922, -134926, -179936, -224952, -269974, -315002? -3l*2 - 44989l + 68 What is the m'th term of -1847, -4740, -9559, -16304, -24975? -963m2 - 4m - 880 What is the i'th term of 28376, 57714, 87056, 116402, 145752? 2i2 + 29332i - 958 What is the s'th term of 27856, 24799, 21750, 18709, 15676, 12651? 4s2 - 3069s + 30921 What is the w'th term of -126793, -507607, -1142443, -2031301, -3174181, -4571083, -6222007? -127011w2 + 219w - 1 What is the u'th term of 41548690, 41548693, 41548698, 41548705? u*2 + 41548689 What is the c'th term of 5498053, 5498042, 5498023, 5497996, 5497961, 5497918? -4c*2 + c + 5498056 What is the d'th term of -4271, -19478, -44823, -80306, -125927, -181686, -247583? -5069d2 + 798 What is the a'th term of 5300, 5594, 5836, 6032, 6188? a3 - 32a2 + 383a + 4948 What is the c'th term of 48720, 48403, 48086? -317c + 49037 What is the t'th term of 11554985, 11554991, 11554997, 11555003, 11555009? 6t + 11554979 What is the u'th term of 3149066, 3149291, 3149520, 3149753, 3149990, 3150231? 2u2 + 219u + 3148845 What is the r'th term of 4281, 4345, 4453, 4605, 4801, 5041, 5325? 22r2 - 2r + 4261 What is the b'th term of -234667802, -469335605, -704003406, -938671205, -1173339002, -1408006797, -1642674590? b*2 - 234667806b + 3 What is the j'th term of -778833, -778814, -778795? 19j - 778852 What is the r'th term of -13608, -27361, -41148, -54969, -68824? -17r*2 - 13702r + 111 What is the y'th term of -8466503, -16933027, -25399563, -33866117, -42332695? -y*3 - 8466517y + 15 What is the z'th term of -735, -2635, -6439, -12669, -21847, -34495, -51135, -72289? -87z3 - 430z*2 - z - 217 What is the q'th term of 9460451, 18920905, 28381359, 37841813? 9460454q - 3 What is the v'th term of 2262658, 4525312, 6787966, 9050620, 11313274? 2262654v + 4 What is the a'th term of -321424, -320940, -320456, -319972? 484a - 321908 What is the q'th term of 6775790, 27103125, 60982016, 108412463, 169394466, 243928025, 332013140? 6775778q2 + q + 11 What is the u'th term of 15, -168, -389, -636, -897, -1160? 2u*3 - 31u*2 - 104u + 148 What is the p'th term of -43548785, -43548783, -43548781, -43548779? 2p - 43548787 What is the x'th term of 2704428, 2704430, 2704432, 2704434, 2704436, 2704438? 2x + 2704426 What is the h'th term of 91451, 91482, 91513, 91544, 91575, 91606? 31h + 91420 What is the o'th term of -212439, -424890, -637365, -849876, -1062435? -2o*3 - 212437o What is the o'th term of -20702, -60223, -126092, -218309? -13174o2 + o - 7529 What is the p'th term of -98, -688, -2038, -4148, -7018? -380p*2 + 550p - 268 What is the j'th term of 1424531, 2849059, 4273585, 5698109, 7122631? -j*2 + 1424531j + 1 What is the k'th term of -13201298, -13201275, -13201204, -13201061, -13200822, -13200463, -13199960, -13199289? 4k3 - 5k - 13201297 What is the f'th term of 17280, 35648, 54028, 72426, 90848, 109300, 127788, 146318? f*3 + 18361f - 1082 What is the t'th term of -1457, -1709, -2027, -2411, -2861? -33t2 - 153t - 1271 What is the t'th term of -264, -451, -566, -609, -580, -479, -306? 36t2 - 295t - 5 What is the c'th term of -235140, -940595, -2116354, -3762417, -5878784? -235152c2 + c + 11 What is the o'th term of 9527, 38506, 86931, 154802, 242119? 9723o*2 - 190o - 6 What is the g'th term of 52845658, 52845657, 52845656, 52845655, 52845654? -g + 52845659 What is the i'th term of 916869, 916356, 915843? -513i + 917382 What is the n'th term of 9168, 17902, 26636? 8734n + 434 What is the b'th term of -1135442, -1135435, -1135428? 7b - 1135449 What is the y'th term of 3166, 16169, 37840, 68179, 107186? 4334y2 + y - 1169 What is the c'th term of 639983, 1279949, 1919913, 2559875, 3199835? -c2 + 639969c + 15 What is the v'th term of -308257, -613284, -918311? -305027v - 3230 What is the u'th term of 389763, 389792, 389819, 389844? -u*2 + 32u + 389732 What is the s'th term of 436309, 436292, 436277, 436264, 436253, 436244? s*2 - 20s + 436328 What is the u'th term of 4701, 2521, -1101, -6171, -12695, -20679? -u*3 - 715u*2 - 28u + 5445 What is the l'th term of 208974, 415251, 621528, 827805, 1034082, 1240359? 206277l + 2697 What is the p'th term of -4093, -8098, -12151, -16252, -20401? -24p*2 - 3933p - 136 What is the r'th term of -24991, -25203, -25417, -25633, -25851? -r*2 - 209r - 24781 What is the r'th term of 53098151, 53098173, 53098215, 53098283, 53098383, 53098521, 53098703? r*3 + 4r*2 + 3r + 53098143 What is the s'th term of 42159917, 84319836, 126479755, 168639674? 42159919s - 2 What is the r'th term of 11876, 23097, 34234, 45245, 56088, 66721, 77102? -7r*3 + 11270r + 613 What is the m'th term of -6650, -26597, -59844, -106391, -166238, -239385, -325832? -6650m2 + 3m - 3 What is the q'th term of 76, 80, 110, 238, 536, 1076? 12q3 - 59q*2 + 97q + 26 What is the v'th term of 30420, 60857, 91286, 121713, 152144, 182585? v*3 - 10v*2 + 30460v - 31 What is the b'th term of 14311815, 28623615, 42935427, 57247257, 71559111, 85870995, 100182915, 114494877? b*3 + 14311793b + 21 What is the a'th term of -32830731, -65661475, -98492219, -131322963? -32830744a + 13 What is the c'th term of 37931, 37921, 37911, 37901, 37891, 37881? -10c + 37941 What is the z'th term of 3583761, 3583823,	{ "pile_set_name": "DM Mathematics" }
ppose 4 = g - i. Suppose 0 = -3u + gu - 5j - 146, 5u - j - 411 = 0. Is u a prime number? True Let h(u) = 5 + 8u2 - 84u*3 - 1 - 5u*2 + 2u - 5. Is h(-2) a composite number? True Let h = 36198 - 23587. Is h a composite number? False Is ((-14)/(-8))/(17/9316) a prime number? False Let g = -1151 + 2142. Is g prime? True Let v(t) = 6t2 - 7t*2 + 4t + 4t3 + 288 - 3t*3 - 3t. Let n be v(0). Suppose -3b + 7b = -4g + n, 0 = 2g - 5b - 179. Is g prime? False Suppose w - 3w - 2z - 1844 = 0, 5w - 4z + 4601 = 0. Is (w/(-6))/(5/10) prime? True Suppose -9 - 7 = -5k - 3t, -k + 3t - 4 = 0. Let p(a) = 28ak + 7a*2 + 2a + 0a. Is p(1) composite? False Let d(a) = 17a*3 + 5a*2 - 16a - 5. Is d(7) composite? True Suppose -3s = -3x - 6 - 57, -4x + 98 = 3s. Let b = s - -41. Is b a prime number? True Let v(p) = -9 + 2 - 7p + 169p*2 - 168p*2. Suppose -55 = 4q - 11. Is v(q) a composite number? False Let l be ((-2)/(-4))/((-6)/72). Suppose 4k - 116 = 20. Is k/6 - 2/l prime? False Suppose 0 = 15k - 1047 - 1983. Is k a composite number? True Let r(a) = -2a2 + 11a. Let o be r(5). Suppose 3q - 4z - 361 = 0, -4z + 595 = oq - 9z. Is q composite? True Let q = 4223 + -2292. Is q prime? True Suppose 3a - 10 = 2, -62207 = -5p + 2a. Is p a composite number? True Suppose 5n = -5y + 22125, 3y = 3n + y - 13280. Suppose 0 = -q + n + 109. Is q prime? False Let d(n) = 12n2 - 4n + 1. Let u be -1 - 1 - (-7 - -7). Is d(u) composite? True Let j = -33927 + 54349. Is j a composite number? True Let v be -1 + 1 + 6 + 6. Let i = v - 8. Suppose -880 = -im + 4n, -2m + 7m - 1103 = 2n. Is m a prime number? False Let s = -149 - -154. Suppose y + 498 = -2h + 1809, sy + h = 6591. Is y composite? False Suppose -5k = -q + 7518, 2k = -5q + 14340 + 23115. Is q a composite number? True Let m be (-2)/(-5) - 72/(-45). Suppose 3v - 4625 = -mv. Suppose g + q = -q + v, 0 = -4g - 5q + 3688. Is g composite? True Suppose -5k - 689 = -2374. Is k prime? True Let u = 10 + -8. Suppose -3y + 4q = -381, 2q - 635 = -5y - uq. Is y composite? False Let f(a) = a3 - a2 + 6a + 22. Let u(i) = -i2 + 8i - 9. Let z be u(4). Is f(z) a composite number? True Let u be (-4 - -3)/((-3)/30). Let k(w) = w*3 - 10w*2 + 4w - 25. Let v be k(u). Is 7/(-35) - (-1368)/v a prime number? False Suppose 82712 = -9v - 24073. Let i = -7664 - v. Is i composite? False Let d(y) = 3y*3 - 4y*2 + 10y - 7. Let b = -14 - -20. Is d(b) a composite number? False Let n be ((-2)/(-3) + 316/(-6))/(-2). Let w = 69 - n. Is w prime? True Is -2(0 + 243092/(-8)) composite? False Let w = 2 - 4. Is (-7551)/(-27)(-42)/w composite? True Suppose -284 = -4f + 124. Let h = f + -53. Is h composite? True Suppose -3s + 2a + 16 = 0, -s + 2s = 4a + 22. Let h = -53 + 121. Suppose 2y - 47 = 3x, -sx = -3y + 3x + h. Is y a composite number? False Suppose -17b = -21b - 60. Is (-2110)/b(-12)/(-8) a prime number? True Let u(t) = -55t + 4. Let x be u(-5). Let y = x + 466. Is y a prime number? False Let h = -1684 + 10571. Is h composite? False Suppose -3g = -4g - 31. Let j = g + 428. Is j a prime number? True Let k = 19354 + -13431. Is k prime? True Suppose -y + 10 = y. Let o = 6 - y. Is (o/3)/(2/222) a prime number? True Suppose 3p = 8p - 85. Let i = -14 + p. Suppose -5k + 0a + ia = -401, -k + 3a = -73. Is k a composite number? True Let u(n) = 135n2 + 10n - 18. Is u(5) a prime number? True Suppose -1 = -2c + 19. Is (2 + (-32)/12)/(c/(-3945)) a prime number? True Suppose 5x + 2y - 10400 - 32045 = 0, 0 = -5y - 25. Is x a composite number? True Suppose 0 = -0i - 9i + 9549. Is i composite? False Let h be (-9)/(15/3730-1). Suppose -27v = -33v + h. Is v prime? True Suppose -4b + 2 = -6. Suppose -3j - bj + 10 = 0. Suppose 0 = jt + 5a - 108, a - 3a + 114 = 2t. Is t a composite number? False Let h(o) = 214o2 + 2o. Let d be h(-1). Suppose 79 = b - d. Is b composite? True Let a(u) = -u*2 - 8u + 8. Let m be a(-9). Is 272 - (1 - m) - -2 - 3 a composite number? False Is (-19)/(1444/(-150624)) + (-2)/(-19) composite? True Suppose z + 57 = -5b, -5b = -4z - 11 + 83. Is (-2300)/b + 8/(-12) composite? False Suppose u + 3v = -8, -3u + 6v + 4 = v. Let j be -2 - (u + -9 + -2). Suppose 0 = -4a + 3k + 139, 2a + j - 58 = -3k. Is a a composite number? False Let z = -13 - -22. Let w(n) = -3 - 9 + 17n2 + n3 + 5n - 26n2. Is w(z) a composite number? True Let w(t) = 3t + 28. Let y be w(-8). Suppose 2o + 614 = yo. Is o a composite number? False Let r(i) = -3i - 8. Let d be r(-8). Let n be d/(-120) + (-4)/(-30). Suppose -4j + 12 = 0, n = -x - 0j - j + 544. Is x a composite number? False Let t = 11 - 16. Let m = -5 - t. Suppose 4p + mp - 1876 = 0. Is p a prime number? False Suppose -2n = -n - 1349. Suppose 2o = -4u - 3o + n, -652 = -2u + 2o. Is u a composite number? False Suppose 0 = 5g - 2g + w - 23008, 7666 = g - 3w. Is g a prime number? True Suppose 2i - 7 = -s + 8, -2i + s = -5. Suppose 3c - i = 1. Suppose -5p - 10 = 0, cz + 5 - 101 = -3p. Is z composite? True Suppose 19d - 7d - 120 = 0. Suppose dp = -0p + 37910. Is p a prime number? False Let n(h) = 3h3 - 5h*2 + 18h - 3. Is n(4) prime? True Let b(z) = -3z + 17. Let a(u) = 4u - 18. Let y(s) = -2a(s) - 3b(s). Let l be y(10). Is (-1047)/l + 2/(-5) prime? False Let f be 761 - (-4 + 7 + -4). Suppose -f = -3q + q. Is q composite? True Suppose 14 = 6w + 50. Let r(c) = 7c2 - c - 19. Is r(w) composite? False Suppose 0 = -x - 3m + 2m + 114, 3m - 227 = -2x. Suppose 7r - 774 - x = 0. Is r composite? False Let i(r) = r*2 - 5r + 7. Let s = -14 + 21. Let b be i(s). Is (-422)/3b/(-14) a composite number? False Let m(j) = j - 2. Let g be m(6). Suppose 3b + 0s + gs - 3219 = 0, 5s = -5b + 5360. Is b prime? True Let d(h) = -3h + h3 + 2h - 590 + 589. Let w be (1/(-1))/((-3)/12). Is d(w) prime? True Let t(h) = -404h3 + h2 - 1. Let c be t(-1). Suppose -5p + 161 = j - 2810, -p - 2j = -587. Let d = p - c. Is d a composite number? False Let g(t) = 251t*2 + 7t - 11. Is g(-6) a composite number? True Let q = 4759 - 1040. Is q a prime number? True Suppose 0 = -3r - 3o + 6, -2r + o = 6o + 2. Suppose -201 + 9 = -y + 5k, rk - 4 = 0. Is (y - 1) + (6 - 8) a composite number? True Let x(t) = 5t2 + 3t - 2. Let r be x(1). Suppose r = y + y, 4g + 355 = -3y. Is (-4)/(-2)g/(-14) prime? True Let b(k) = -k2 - 14k - 13. Let z be b(-13). Suppose -j + 58 - 12 = z. Is j a composite number? True Let d = -182 - -431. Let a(j) = d + 160 - 329j3 + 3j + 330j3. Is a(0) composite? False Suppose 31676 = 6y - 61018. Is y composite? True Is 5/(100/27128) + 6/10 a prime number? False Let g(j) = 225j - 9. Let d be g(8). Let o(k) = k3 - 5k*2 + 5. Let z be o(5). Suppose 2x + d = 5w, 5w = 3w - zx + 728. Is w a composite number? False Suppose -4d + 18 = -0d + 2w, -5d - 2w + 20 = 0. Is (21710/260)/(d(-1)/(-28)) a composite number? True Let q(i) = -2i - 38. Let k be q(17). Let h = k + 125. Is h a composite number? False Let a(c) = -24c*3 - 10c*2 + 11c - 2. Let h be a(1). Let k = 32 + -58. Is k/((-10)/h-1) a composite number? True Is (-1)/(-2) + (-975480)/(-48) a prime number? True Suppose 4n = -7265 + 30685. Is n prime? False Let i(w) = -w*2 + 14w - 11. Let a be i(11). Suppose -ad + 17d = 0. Suppose 2m - 122 = 4l, -2m + dm + 140 = 2l. Is m composite? False Let y be (-6)/33 + (1 - 6124/(-44)). Suppose -1434 = -yq + 134q. Is q a prime number? True Suppose -16a = -18a + 13394. Is a a composite number? True Suppose -6s + 430 = -1256. Suppose 2q = -87 - s. Let x = -131 - q. Is x a composite number? False Let p(m) = 4m*3 - m + 1. Let k be p(1). Suppose ka - 11583 = -1163. Suppose 3n = -2n + a. Is n composite? False Suppose -k = 2a + 2107 - 7938, 0 = 2k - 4a - 11686. Is k prime? False Let a(l) = l + 16. Suppose 0 = -0s + 4s + 44. Let v be a(s). Suppose -h = vh - 522. Is h prime? False Suppose -2t + 4t + 2 = 0, 0 = 4r + t - 4327. Is 9 - 11 - (-1 - 1r) a prime number? False Suppose -y = -1 - 4. Suppose -yg - l = -724, -3g + 2*l = 43 - 480. Is g a composite number? True Let y be 4/(-10) - (-144)/60. Suppose -10 =	{ "pile_set_name": "DM Mathematics" }
ifference between 4 and 0.039253? 3.960747 What is -4 less than -1411? -1407 What is the distance between -10 and -0.054732? 9.945268 2+0.431 2.431 What is -225 minus -1? -224 Add together 0.0028 and 52. 52.0028 What is the distance between -0.03 and 43? 43.03 Put together 0.06647 and -6. -5.93353 What is -0.48 - 10.1171? -10.5971 0.08564 - 53 -52.91436 Add together 0.156 and 9.527. 9.683 1.2 + 277.3 278.5 Subtract 0.00251 from -20. -20.00251 Total of 1.7 and -775504. -775502.3 What is -4 less than 23207? 23211 What is the difference between 145 and 2684? 2539 What is 0.3236 - -3? 3.3236 Sum -6 and -6.97. -12.97 Work out -2652051 - -3. -2652048 What is the difference between -0.176 and -259? 258.824 What is 1.5881 + -0.2? 1.3881 What is 0.01391 minus 31? -30.98609 -2467+-126 -2593 Subtract 524.48 from 0.3. -524.18 Subtract -6327 from 1. 6328 What is -81 take away -26? -55 What is the distance between 1201 and 190? 1011 What is 0.259 less than 1.757? 1.498 Total of 1.8 and -2.3857. -0.5857 What is -0.3 take away 0.7061? -1.0061 Calculate 1 - 1020. -1019 Total of -2.2 and 1407. 1404.8 What is -1014 minus 0? -1014 Calculate 5 - 143849. -143844 What is the distance between -635 and 0.219? 635.219 Total of -0.2 and 143. 142.8 -229880 + 0.07 -229879.93 What is -0.0199 take away 6175? -6175.0199 What is 6 - 9372? -9366 What is -8724 + 11? -8713 What is 4.557 plus -0.33? 4.227 What is the distance between 0.5 and -165.57? 166.07 What is 825 plus 1? 826 What is 3 + 4.141? 7.141 What is 160780 minus -0.06? 160780.06 -25.1 - 8 -33.1 Put together 0.8467 and -0.03. 0.8167 -3167 - 5 -3172 What is -0.290359 less than -2? -1.709641 What is -1.53 minus 28? -29.53 0.02+22.53 22.55 Subtract -2.604 from -31. -28.396 Add together -4428 and -0.096. -4428.096 Calculate 24709 - -1. 24710 What is the distance between -378 and 5641? 6019 -5.1 + 0.05 -5.05 What is the distance between -14184 and -1? 14183 Calculate -0.4 - 65.56. -65.96 Subtract 54481 from 43. -54438 Put together -13380 and -0.3. -13380.3 Total of -34 and -16582. -16616 What is -117 + 271? 154 Total of -0.083 and -4.7. -4.783 Add 0.581 and 1995. 1995.581 Add together 0.16 and -24.5. -24.34 -0.284 + 0.06 -0.224 What is -4.2 minus 0.66? -4.86 709+0.033 709.033 What is -1.33 minus -15128? 15126.67 What is 8601 + 0.01? 8601.01 What is -2.5 take away 0.11? -2.61 Calculate 7658 - 1. 7657 96644+-1 96643 Work out -20 - 3105. -3125 0.9415 + 2 2.9415 What is 1 take away -105385? 105386 0.1043 + -3 -2.8957 Sum 94262 and -2. 94260 -0.1+0.654 0.554 What is 2.792 minus -3.97? 6.762 What is 65 take away -1.09? 66.09 Add -0.025 and -0.32. -0.345 Calculate -15 + -42. -57 What is 0.2 less than -1162.2236? -1162.4236 What is 4 less than -1535.87? -1539.87 Calculate -260 + -0.3. -260.3 What is -13 + 69? 56 Put together 0.0778 and 0. 0.0778 -12 - 1.679 -13.679 Work out -0.05 - -1172. 1171.95 -0.2+722 721.8 Calculate -0.33 + -26953.8. -26954.13 Add together -60 and 3516. 3456 Work out 37209 - -1.7. 37210.7 What is 0.034 - 0.41653? -0.38253 Total of -26768 and -0.4. -26768.4 What is the difference between -786 and 0.075? 786.075 What is 969.89 plus -0.2? 969.69 What is -4.12 minus -0.1? -4.02 Work out 393 - 7. 386 Work out 3149.7 - 11. 3138.7 Subtract -7414.8 from -139. 7275.8 -4793 - 6 -4799 What is the difference between 0.02 and -1650? 1650.02 What is -0.046 plus 0.39636? 0.35036 What is 13 plus 198213? 198226 Put together -0.4 and 2246. 2245.6 What is -9.9 + 28? 18.1 What is the difference between 72.4281 and 0? 72.4281 Work out -0.1 - -1.02415. 0.92415 Work out 0.61 - 25. -24.39 What is 0.5 less than -15.53356? -16.03356 Add together 796207 and -3. 796204 What is the difference between -49 and 1461? 1510 What is -1.9 - 129144? -129145.9 What is -157741 + -5? -157746 What is -16194 - -0.2? -16193.8 What is -0.4 minus -802? 801.6 Work out 312 + 0.1. 312.1 -118631.6 + 1 -118630.6 Subtract -1635 from -0.06. 1634.94 What is -19.9454 less than 6? 25.9454 50 - -109 159 Sum 5 and 306421. 306426 What is -0.1 - -22.594? 22.494 What is 0.95 take away 0.0989? 0.8511 -17.457 - -3 -14.457 Calculate -47 - 1.9. -48.9 What is -9024 take away 5? -9029 What is the difference between 0.03 and -1500? 1500.03 Subtract -266124 from 0.3. 266124.3 Put together -48 and -34. -82 -0.025+0.46829 0.44329 Subtract 21936 from -2. -21938 What is -25397 less than -0.04? 25396.96 Work out 0.007 + -0.8. -0.793 Calculate 12322.2 + -0.4. 12321.8 Calculate -0.87 - 138. -138.87 Calculate -7.918 + -111. -118.918 What is -139.1 - 58? -197.1 2.1 + 2268 2270.1 -4+43361 43357 Subtract 173 from 7.44. -165.56 -6165.707+-0.4 -6166.107 What is -6228 - 0.3? -6228.3 Add together 0 and -45.18. -45.18 -741.5 - -42 -699.5 573 + -455 118 Sum 5 and 0.3839. 5.3839 What is the difference between -135.6 and 0.31? 135.91 What is -4 - 23956? -23960 What is -1927.43 + -2? -1929.43 -6 + 198696 198690 What is -4927 minus -12? -4915 What is -474.3 - -2? -472.3 Put together 353 and 431. 784 What is 0.3 minus 466047? -466046.7 Calculate 8.9 - 9384. -9375.1 Sum 6 and 0.21. 6.21 Total of 0 and -980765. -980765 -0.2 + -3.06658 -3.26658 Add together 80.8 and -0.4. 80.4 Add 722 and -0.2. 721.8 What is the difference between 5 and -3.46066? 8.46066 Put together -3707 and 2. -3705 Work out 0.5 + 186. 186.5 What is the difference between -347 and 0.2? 347.2 What is -1 less than 0? 1 What is the distance between -0.3402 and -7? 6.6598 0.07 + -818 -817.93 What is -0.1 - 792868? -792868.1 What is -21716 plus 0.5? -21715.5 What is -5 plus -0.8557? -5.8557 What is -3 take away 2467190? -2467193 Calculate -9 + 556293. 556284 What is -3.01 take away 7142? -7145.01 Put together 4 and -74335. -74331 Sum -1 and -0.775882. -1.775882 Sum 4 and -233. -229 What is 5 plus -964? -959 What is 0 plus 46? 46 What is -0.0498079 - -4? 3.9501921 0.4+125944 125944.4 What is -0.6 take away 929? -929.6 Put together -3 and -14321. -14324 Work out -304 + -27. -331 Add together 0.105193 and -0.075. 0.030193 Add together -0.0449 and -34. -34.0449 What is 0.3 less than -0.805? -1.105 What is the difference between 0.02 and 1247? 1246.98 What is -0.1 + 1340? 1339.9 Calculate -119 + -0.0102. -119.0102 Subtract 0 from -0.806. -0.806 What is 0.81 + 0.28? 1.09 0.1 + 1144 1144.1 What is -5670.262 plus -2? -5672.262 What is the difference between -5 and -206.2? 201.2 -1.961 - 0.07 -2.031 What is the distance between -3 and 70? 73 What is the distance between 2.49 and -0.1? 2.59 0.09 - 9754 -9753.91 Calculate 6.163638 - -5. 11.163638 -0.53 - 11.22 -11.75 What is 0.0748 + 6? 6.0748 What is -12.7 plus 254? 241.3 Put together 1.13 and -25584. -25582.87 0 - -10541 10541 What is 83.839 plus -1? 82.839 What is -233 minus -0.075? -232.925 Put together 192 and 7. 199 Add -1742 and 0.4. -1741.6 1 - 4198.8 -4197.8 Sum 0.186 and -56.6. -56.414 What is -23960 + 3? -23957 -4954 - 68 -5022 26.52 - 4 22.52 Work out 192 + -0.23. 191.77 What is the difference between -36260 and 1? 36261 Put together -1 and 0.0234. -0.9766 Total of -4 and -70.01. -74.01 Sum -2.6 and 0.01738. -2.58262 What is 920754 less than 0? -920754 Add together -945468 and 0.4. -945467.6 -273+-19.8 -292.8 Calculate 42 - 12.5. 29.5 Put together 1.09 and 0.1244. 1.2144 What is -1839 - 5? -1844 80.28+12 92.28 Sum -2 and 0.618141. -1.381859 Calculate 6193 + 1394. 7587 What is -184.3 minus 518? -702.3 What is 0.1 + -12898? -12897.9 Sum 28 and 0.7. 28.7 0.3+122 122.3 Calculate -1 - 312. -313 Add -2 and 50491. 50489 Calculate 1.88 - 0.2. 1.68 What is -111 minus -2637? 2526 Sum -66 and 74. 8 What is the distance between 48 and 33677? 33629 -0.2+60167 60166.8 Sum -10.8 and -19298. -19308.8 What is 26133 - 5? 26128 Sum 1803270 and -3. 1803267 What is -697.98 + 0.1? -697.88 What is 4 take away 6082? -6078 Put together -0.049 and 46. 45.951 What is 57.8 - 0.0865? 57.7135 What is -287.57 minus -4.9? -282.67 Calculate -2686 - 1.5. -2687.5 -0.019 + -0.35849 -0.37749 204 + -0.2 203.8 Calculate 35 - 0. 35 Add together -0.0446481 and 4. 3.9553519 Calculate -203 - -12. -191 Sum 78 and -278.5. -200.5 Subtract -80.057 from 0.1. 80.157 What is -0.3 - 894.35? -894.65 Total of 0.2 and 295825.5. 295825.7 Subtract -58 from 72. 130 What is 8.26 plus 32? 40.26 What is the distance between 4 and -2.5151	{ "pile_set_name": "DM Mathematics" }
a composite number? False Is (-31)/(16 + 230/(-14)) + 49492 prime? True Let a be (-8)/(2/8 - 17/36). Suppose ab - 1440 = 27b. Is (7 + b/(-24))1493 a composite number? False Let l(g) = -g3 + 149g*2 - 627g - 551. Is l(144) composite? False Suppose -3t - 4c + 17376 = 1033, 4t = c + 21816. Suppose -4n - 7o + 3o = -5432, -4n = -3o - t. Is n prime? True Suppose n = t + 2t - 2016929, 5n = 3t - 2016913. Is t prime? True Suppose 126840 = 2t - 84446. Is t composite? True Let j be ((-4)/(-10))/((-68)/(-680)). Suppose -5r = -5 - 15. Suppose -3t = u - 145, 0 = ju + rt + t - 580. Is u a composite number? True Let o = 865011 - 150872. Is o composite? False Suppose -3s = -4g - 3587383, 41s - 40s + 2g = 1195811. Is s a prime number? True Is (-3)/108-12(-1 - -478852) a prime number? True Suppose 192t - 156t = 788796. Is t a composite number? False Let o(d) be the first derivative of -137d*2/2 + 90d + 164. Is o(-7) prime? True Let d(r) = 8r2 - 216r + 3227. Is d(-110) composite? False Let c(h) = -1420h3 - 2h*2 - h + 1. Let f be c(-2). Suppose 0 = 9w - 54786 - f. Is w composite? False Suppose 2s - 10 - 4 = -p, 4s + 4p = 36. Let i(g) be the second derivative of g5/4 + g4/2 + g3/6 + 7g*2/2 - 9g. Is i(s) prime? True Suppose -2g = -20178 - 14722. Suppose -4z - 5t + 13969 = 0, -2t - g = -5z + 3t. Is z a composite number? False Let p(g) = -150g - 13. Let z be p(-4). Suppose -3f - 5o = -73, 7f + o = 3f + 103. Suppose fd - 25d = z. Is d prime? True Let q = -32 - 337. Let l be 60/3(-115)/20. Let x = l - q. Is x composite? True Suppose -k = -2, -54 = -2i + k + 2k. Let w = -27 + i. Suppose 5o = -2b + 1221 + 292, wo + 1553 = 2b. Is b a prime number? True Let j(m) = -1617m + 8606. Is j(-17) a composite number? True Suppose -3f = -3s + 960, 4f + 322 = 5s - 1276. Suppose 4p + l + 526 = 0, -2p + 2l = 3l + 264. Let h = s + p. Is h a composite number? True Let j(q) = 2q*2 - 3q - 5. Let a be j(3). Suppose 18150 = 5g - 4i + 2461, -12552 = -ag + 4i. Is g a prime number? True Is ((-1536616)/16)/(4/(-8)) a prime number? False Let j = 80 + 233. Let u = 564 - j. Is u a composite number? False Let u = -6 - -8. Suppose -uo = -4o + 1092. Let d = o + 397. Is d prime? False Let w(s) = 4s - 26. Let k be w(7). Let r be k-610-1 - 1. Suppose r = 2g + 2t + t, 3g + t - 1832 = 0. Is g composite? True Let f(n) = -11401n - 1594. Is f(-23) prime? True Suppose 3l + w = 553989, -1149880 = -5l + 2w - 226587. Is l prime? False Suppose -g - 7 = -4v - 8, -5g = -2v - 23. Suppose -5n = -3f - 33176, gn + 3f - 41743 = -8549. Is n prime? True Suppose y - 242 = -5i, 7i = 6i + 5y + 38. Is (i/(-6) - -1) + 5438 prime? True Let s = 487451 - 344442. Is s composite? True Let n be (-4)/80 - (-2)/2. Let z be (-66)/n(-2)/(-6). Is 4/z + (-57568)/(-88) - -1 composite? True Let y(o) = 1984o*2 - 96o + 1273. Is y(13) composite? True Suppose 3d + 4x = -8, 3d - 3x = -0x - 15. Let l(q) = 4q + 207q3 + 7 - 112q*3 - 109q*3 - 9q*2. Is l(d) prime? True Suppose -7g + 3g = -2f + 66, 2g + 157 = 5f. Let c = f + -17. Suppose -cn - 92 = -18n. Is n a prime number? True Let s(c) = -c*3 + 3c*2 + 8c. Let o = -18 - -23. Let j be s(o). Is (4/(-18) - (-1100)/(-72))j prime? False Suppose -3m = -15, -4n + 0m - 3m = 5. Let l = -1683 - -1698. Is -6n/l + 675 a composite number? False Suppose -k = -4f + 497831, 248893 = 2f + 113k - 118k. Is f a prime number? True Let y(x) = 3627x2 - 7x + 19. Let t be y(2). Let m = t + -5746. Is m prime? False Let a(g) = 9936g - 3967. Is a(26) composite? False Let v(w) = -81w*2 - w - 1. Let t be v(6). Let r be (3/189)/((-12)/(-43056)). Let z = t + r. Is z prime? True Is (-626477)/((-6)/1 - (56/14 + -9)) a prime number? True Suppose -24d + 20d = -2l + 97794, -4l - 3d + 195566 = 0. Is l a prime number? False Let i = -197318 + 337039. Is i a composite number? False Let j(k) = -740k + 4k2 + 14 - 18k*3 + 745k - 16k3. Is j(-4) prime? False Suppose 0 = 27c + 9c - 347184. Is (c/(-2))/((4 - 4) + -2) a prime number? True Suppose 101459 = -20y + 1999239. Is y a prime number? True Let w be (-4 - -2)/((-3)/(-18)). Let t(p) = -p*2 - 13p - 10. Let n be t(w). Suppose 3h = -nm + 1076, 1977 - 370 = 3m + h. Is m composite? True Is (-4152)/(-96)1604 + -1 + -1 composite? False Is (-58)/464 - (154654020/32)/(-9) composite? True Suppose 14h - 5h - 10593 = 0. Suppose h = 4t - 4p - 719, -t + 459 = -4p. Is t a composite number? False Let z be (-28)/(-8) + ((-2)/(-4) - 0). Let p(c) = -z + 4 - 5 + 6c. Is p(7) prime? True Let k(s) = s*3 + 81s*2 + 36s + 39. Is k(-17) a composite number? False Suppose -37 = 13o - 180. Suppose -op = 3p - 8204. Suppose p = 4b - 562. Is b composite? True Suppose 4s = -4v - 1922 + 14762, -4v + 12845 = -s. Suppose 5g + 10458 = 3t, -2t + 0t = 8. Let z = v + g. Is z a composite number? False Let v(x) = -12x*3 - 2x*2 + 5x - 5. Let y be v(4). Let l = -356 - 136. Let s = l - y. Is s a composite number? False Suppose -11z + 20035 = -10z + 4b, -3z = -2b - 60119. Is z a prime number? False Suppose -s = -2g + 13 - 14, -4g + 5s = 5. Suppose -3i = -4k - 2035, 3i + 3k - 2662 + 655 = g. Is i composite? False Let o(a) = 16a2 + 16a + 0a2 + 9 + 0a3 + 10 + a3. Let z be o(-15). Suppose 13887 = zs + s - 2p, -5s + 13886 = -p. Is s composite? False Let c = -8664 + 33653. Is c a prime number? True Let d(c) be the first derivative of 28c*3/3 - 17c*2/2 + 84c + 14. Is d(9) a prime number? False Let g(a) = -a*3 + 3a*2 + 2a - 6. Let y be g(3). Suppose 86 = 5j - yj - 2t, -4t = -4j + 64. Suppose 296 = 2p - j. Is p prime? True Suppose 11r - 107996 = 74142. Suppose 0 = -2z + 3q + r, -2z + q = -5z + 24859. Is z composite? True Let f(z) = 1747z*2 + z - 15. Let m be f(-5). Suppose -15x + m = -57940. Is x a prime number? False Let a = 133 + -133. Suppose -5c = 5y - 4y - 816, a = -5c + 3y + 812. Is c composite? False Let r(l) = -2l*3 + 6l*2 - l - 4. Let w be r(2). Suppose -t + w = -3. Is 0 + 291 + 20/t composite? True Let n be (-1)/(-1)(-4 + (-64)/(-8)). Suppose -q + 2q + 3w - 1673 = 0, -5q - nw + 8365 = 0. Is q a prime number? False Suppose -8167 = -12b - 115. Suppose -bx - 14572 = -675x. Is x composite? False Let z(i) be the second derivative of i3/2 + 55i*2/2 - 18i. Let b be z(-17). Suppose bo - 5p - 2223 = 0, -3o + p - 3p = -1673. Is o a composite number? False Suppose 2d = 10, 4y + 3d - 17 = 3y. Suppose 118n + 3x + 25850 = 119n, -yn + 51673 = 3x. Is n composite? False Let x(w) = 2w*3 - 2w*2 + w. Let m be x(2). Let a be ((-17292)/(-20))/(2/m). Suppose 3d = 3b - 3276, 4b - 3d + 8d = a. Is b prime? True Let a(v) = 4v - 2. Let f(k) = 4k - 2. Let g(r) = 5a(r) - 4f(r). Let s be g(1). Suppose -sb + 4x = -382, 5b + 3x = 4x + 955. Is b composite? False Is (22 - -4) + -20 + 3/((-6)/(-1984486)) prime? True Suppose -3g + 1271856 = 3n, 16g = -5n + 14g + 2119787. Is n a composite number? False Suppose -2r + 628422 = 2f, 1571049 = 150f - 145f + 2r. Is f prime? False Is 4 + 66/(-17) + (-8)/(2040/(-25084065)) prime? True Suppose 20z - 1128591 = 999149. Is z prime? False Suppose 5n = 2n + 105. Suppose 37b = 44b. Suppose b = w - n - 24. Is w a composite number? False Let c(b) = -b*2 + 8b + 8. Let j(w) = -2w2 + 15w + 17. Let h(o) = -7c(o) + 3j(o). Let d be h(16). Suppose -d = u - 258. Is u a prime number? False Let m be (-13 - -8)/(2 + -3). Suppose 0 = -mb + 3b + 8. Suppose 2s + 68 = 4u, -3u + bs + 61 = -0s. Is u a prime number? False Let a(l) = -l3 + 11l*2 + 2. Let w be a(11). Suppose -5444 = -4y + 2z, -3y + wz + 3145 = -938. Is y prime? True Suppose 15 = -2x - x. Let w be ((-554)/4 + 4)x2. Suppose -4t - s + w = 0, 0 = 4t + 4s - 1378 + 42. Is t composite? False Let c = 271 - 262. Suppose 589 = -cx + 2416. Is x a composite number? True Suppose 26935 + 509 = 4r. Suppose 9t - r = 43350. Is t a composite number? True Let f be (6/18 - (-39)/(-9)) + 2. Is (-3 + ((-2001)/2)/3)f composite? False Suppose 3 = -4d + 19. Suppose 0 = df + 5m - 681 - 264, -2m = -5f + 1140. Suppose -3*g = 8 - f. Is g composite? True	{ "pile_set_name": "DM Mathematics" }
usand? 228000 What is -0.000071527538 rounded to 5 dps? -0.00007 What is -0.0000897729297 rounded to six dps? -0.00009 Round 16508502.1 to the nearest 10000. 16510000 Round -0.00057590335 to five dps. -0.00058 Round -0.000206761532 to 5 dps. -0.00021 What is 459371.004 rounded to the nearest 10000? 460000 Round -0.2225760207 to four decimal places. -0.2226 What is 35731.8729 rounded to the nearest 100? 35700 What is -0.000921944628 rounded to five decimal places? -0.00092 Round 9709042.89 to the nearest one hundred. 9709000 What is 539.99734 rounded to the nearest 100? 500 Round -15562.1817 to the nearest one hundred. -15600 What is -0.135399895 rounded to four dps? -0.1354 What is 1.5942335 rounded to one dp? 1.6 Round -11713308.5 to the nearest one million. -12000000 Round -0.59917178 to 1 decimal place. -0.6 What is -0.00008515339955 rounded to six dps? -0.000085 What is -864350.933 rounded to the nearest 1000? -864000 Round -0.017988379 to three decimal places. -0.018 Round 0.00000300600293 to seven dps. 0.000003 Round 992195.4 to the nearest one million. 1000000 Round -6459.72906 to the nearest one thousand. -6000 Round -0.000334030371 to 5 decimal places. -0.00033 What is -1638405420 rounded to the nearest 100000? -1638400000 What is -0.0000325216755 rounded to 5 dps? -0.00003 What is 0.00063544831 rounded to 6 decimal places? 0.000635 What is -231653601.5 rounded to the nearest ten thousand? -231650000 Round -2349.3583 to the nearest one hundred. -2300 What is 0.00022319061 rounded to five dps? 0.00022 Round -163815369.01 to the nearest 1000. -163815000 What is -0.00406228 rounded to two dps? 0 What is 101203623.76 rounded to the nearest one million? 101000000 What is 0.000001665740986 rounded to seven dps? 0.0000017 Round -0.69367056 to 5 decimal places. -0.69367 What is 0.00007286842815 rounded to six dps? 0.000073 Round -0.000046968479 to 6 dps. -0.000047 Round -18.81928408 to the nearest 10. -20 What is -4950631 rounded to the nearest one hundred thousand? -5000000 Round -0.000490025274 to seven decimal places. -0.00049 Round -783900.2 to the nearest one thousand. -784000 Round -1342358570 to the nearest one hundred thousand. -1342400000 Round -15.247831602 to 4 dps. -15.2478 Round 0.00154203094 to three decimal places. 0.002 Round -0.00013656092 to five dps. -0.00014 Round -1.246837266 to 4 dps. -1.2468 Round -0.01430763924 to five dps. -0.01431 What is 58403.76673 rounded to the nearest integer? 58404 What is 630429416 rounded to the nearest ten thousand? 630430000 What is 0.0058993922 rounded to 2 decimal places? 0.01 Round -1974.155 to one dp. -1974.2 Round 45.107364 to the nearest integer. 45 Round 234210.52 to the nearest 100000. 200000 What is -405.1341773 rounded to 0 decimal places? -405 Round -36.034507 to 1 dp. -36 Round -31238433.2 to the nearest 1000000. -31000000 What is 6162518.275 rounded to the nearest one thousand? 6163000 Round -0.00033844428 to 5 decimal places. -0.00034 What is 0.009730074 rounded to 6 dps? 0.00973 What is -45.3930085 rounded to three dps? -45.393 What is -6.421178411 rounded to one dp? -6.4 Round -2.3547739 to one dp. -2.4 Round 0.001895566465 to four decimal places. 0.0019 What is -0.000063276918 rounded to 6 decimal places? -0.000063 Round -0.00000108791068 to seven dps. -0.0000011 Round 0.363879293 to two decimal places. 0.36 Round -0.0546304042 to 6 decimal places. -0.05463 What is -2.3420815 rounded to zero decimal places? -2 Round 41.3562055 to three decimal places. 41.356 Round -715.103853 to the nearest 10. -720 What is 0.00245522305 rounded to 4 dps? 0.0025 Round -3994087.1 to the nearest 100000. -4000000 What is 21450501.71 rounded to the nearest 1000000? 21000000 Round -612556.8108 to the nearest ten. -612560 What is 53466704.4 rounded to the nearest one million? 53000000 What is 538185.466 rounded to the nearest one hundred? 538200 Round 13.5424768 to the nearest integer. 14 What is -5.09670599 rounded to 1 dp? -5.1 Round -0.03292681244 to three decimal places. -0.033 Round -5.89775148 to three dps. -5.898 What is -15743912 rounded to the nearest one million? -16000000 What is 0.0788594228 rounded to 2 decimal places? 0.08 What is -0.0000075487638 rounded to six decimal places? -0.000008 What is -323.1767931 rounded to 1 decimal place? -323.2 What is -0.60290212 rounded to four decimal places? -0.6029 What is -652095.4094 rounded to the nearest 100? -652100 Round -0.0001249903063 to 7 decimal places. -0.000125 Round -0.0020761573 to five dps. -0.00208 What is 0.0000060446382 rounded to 6 decimal places? 0.000006 Round -1259975.97 to the nearest 10000. -1260000 Round 117.67687 to 2 decimal places. 117.68 Round 0.0000003328004798 to 7 decimal places. 0.0000003 Round 2941101430 to the nearest one hundred thousand. 2941100000 Round -8296.33516 to the nearest 1000. -8000 What is -12.2499528 rounded to the nearest 10? -10 What is 424625.376 rounded to the nearest 100000? 400000 What is -0.6032686 rounded to 3 decimal places? -0.603 Round -281064.3 to the nearest one thousand. -281000 Round 0.00018144664 to four decimal places. 0.0002 Round -389.5682932 to two dps. -389.57 Round 563.122992 to one dp. 563.1 What is -0.00768346972 rounded to three decimal places? -0.008 What is 0.0312770299 rounded to five dps? 0.03128 What is -10083997.8 rounded to the nearest 1000000? -10000000 What is 5.0750539 rounded to one dp? 5.1 Round 0.00001922263298 to six dps. 0.000019 Round -17713.3888 to the nearest 1000. -18000 What is 5965.356275 rounded to one dp? 5965.4 What is -0.004626103 rounded to two dps? 0 What is 0.0000424501575 rounded to 5 decimal places? 0.00004 Round 0.1057508732 to two dps. 0.11 Round 0.04830621 to four decimal places. 0.0483 What is 122909.3012 rounded to the nearest 1000? 123000 What is -447537.62 rounded to the nearest one hundred thousand? -400000 What is -0.000000491933966 rounded to seven dps? -0.0000005 What is -1403959.68 rounded to the nearest 10000? -1400000 What is 81.770254 rounded to the nearest integer? 82 Round -78802.8352 to the nearest 10000. -80000 What is -25730.004 rounded to the nearest 1000? -26000 Round 0.0344546344 to six dps. 0.034455 What is -138.83983 rounded to the nearest one hundred? -100 Round 64.494527 to 2 decimal places. 64.49 What is 5117273450 rounded to the nearest 100000? 5117300000 What is -0.1448710591 rounded to five dps? -0.14487 Round 6.761470084 to one dp. 6.8 What is -333334390 rounded to the nearest 1000000? -333000000 What is 75.8482756 rounded to the nearest integer? 76 What is 0.001293419382 rounded to 6 decimal places? 0.001293 Round -0.0141904585 to six dps. -0.01419 What is 112554.18 rounded to the nearest 100? 112600 What is 0.00307987627 rounded to 5 dps? 0.00308 What is 0.000271292574 rounded to 6 decimal places? 0.000271 Round 14291478 to the nearest ten thousand. 14290000 What is -4.59558594 rounded to three decimal places? -4.596 What is -71574026.7 rounded to the nearest 10000? -71570000 What is -0.0001013145119 rounded to 7 decimal places? -0.0001013 Round -0.000459087593 to 6 decimal places. -0.000459 Round 3.26804135 to the nearest integer. 3 What is -78.09337671 rounded to three dps? -78.093 Round -39273.3207 to 0 decimal places. -39273 Round -0.0604616204 to five dps. -0.06046 Round 3397359.637 to the nearest 10. 3397360 What is -0.002812705801 rounded to five decimal places? -0.00281 Round 4441.9775 to the nearest 100. 4400 Round -19335891000 to the nearest one million. -19336000000 What is 0.087345715 rounded to five decimal places? 0.08735 What is -15.05628837 rounded to 0 dps? -15 What is -1425823086 rounded to the nearest 1000000? -1426000000 Round 223.845954 to the nearest 10. 220 What is 71849.933 rounded to the nearest ten? 71850 What is 0.04536816494 rounded to 5 dps? 0.04537 Round 0.000005535944198 to 7 dps. 0.0000055 What is 60.528055 rounded to 1 decimal place? 60.5 What is -0.000158790185 rounded to five dps? -0.00016 Round -129042472.8 to the nearest ten thousand. -129040000 What is 0.0821971979 rounded to 4 dps? 0.0822 What is 0.68488444 rounded to one dp? 0.7 Round -6936.90898 to the nearest 1000. -7000 What is -5862.421906 rounded to one decimal place? -5862.4 What is 1.728776 rounded to 3 decim	{ "pile_set_name": "DM Mathematics" }
t b(x) = -x*3 + 4x*2 + 9x - 8. Give b(6). -26 Let m(j) = -j + 13. What is m(20)? -7 Let x(b) = -b + 21. Give x(18). 3 Let k(b) = b*2 + 2b - 2. Give k(-2). -2 Let d(p) = -p*3 - 8p*2 + 6p + 113. Calculate d(-6). 5 Let b(t) = -t*2 + 13t + 28. What is b(15)? -2 Let h(w) = w - 4. Calculate h(6). 2 Let r(g) = 3g - 7. Calculate r(-8). -31 Let d(t) = t3 - 6t*2 - 7t - 3. Calculate d(7). -3 Let u(t) = -t*2 - 13t - 24. Determine u(-12). -12 Let r(k) = k*3 - 16k*2 + 13k - 6. Give r(15). -36 Let q(x) = -x*3 - 20x*2 + x + 55. Determine q(-20). 35 Let u(g) = 6g*2 + 2g + 3. Determine u(-3). 51 Let l(a) = -35a + 138. Determine l(4). -2 Let t(o) = 8o + 4. Determine t(-2). -12 Let c(d) = 6d + 60. Calculate c(-14). -24 Let u(r) = r3 + 20r*2 + 20r + 17. Give u(-19). -2 Let m(k) = -k*3 - 3k*2 - 14k - 3. Give m(-3). 39 Let b(w) = 11w + 129. Give b(-11). 8 Let w(k) = 17k + 2. Determine w(-2). -32 Let f(d) = -2d2 - 11d + 3. What is f(-6)? -3 Let h(l) = -l*3 + 24l*2 - 49l + 116. Give h(22). 6 Let c(n) = -3n2 - 10n - 20. Give c(-4). -28 Let u(a) = -13a - 29. Give u(4). -81 Let x(w) = -w2 + 9w + 2. Determine x(-5). -68 Let b(u) = -u + 2. Give b(4). -2 Let i(c) = 2c3 - 9c*2 + 4c + 10. Determine i(6). 142 Let n(z) = -6z - 4. Calculate n(0). -4 Let j(a) = a3 + 30a*2 - 102a - 96. Calculate j(-33). 3 Let d(c) = -c*3 - 4c*2 - 4c - 4. Determine d(-3). -1 Let n(m) = 3m - 16. What is n(8)? 8 Let v(m) = m3 - m2 - 41m + 7. What is v(-6)? 1 Let f(x) = -x*2 + 8x + 38. Give f(11). 5 Let w(s) = s*3 + 9s*2 + 21s + 49. What is w(-7)? 0 Let n(c) = -c*3 - 6c*2 - 7c - 2. Calculate n(-5). 8 Let l(r) = -10r - 51. Calculate l(-6). 9 Let k(h) = -h2 - 3h + 1. Determine k(-3). 1 Let n(r) = r*3 - 14r*2 + 14r - 7. Determine n(13). 6 Let a(p) = p2 - 1. Give a(-2). 3 Let f(x) = x2 - 30x - 106. Give f(33). -7 Let w(o) = -o2 + 3o + 1. Give w(3). 1 Let m(v) = 3v2 - 3v + 5. What is m(4)? 41 Let p(n) = n*3 - 5n*2 - 6n + 7. Give p(5). -23 Let h(f) = f*3 - 11f*2 - 11f - 16. Determine h(12). -4 Let q(z) = -z*3 + 21z*2 + 2z + 5. Calculate q(21). 47 Let k(b) = -b*3 - 18b*2 + 28b + 166. Determine k(-19). -5 Let g(a) = -a*2 + a + 40. Determine g(0). 40 Let c(i) = 2i*2 - 2. What is c(2)? 6 Let c(u) = -82u - 2. Calculate c(-1). 80 Let x(i) = -11i + 34. Determine x(9). -65 Let k(w) = -2w*2 - w + 1. Calculate k(4). -35 Let k(i) = 2i*2 + 19i + 15. What is k(-8)? -9 Let g(f) = 2f3 + 9f*2 - 5f + 6. Give g(-5). 6 Let x(n) = -8n + 4. Give x(-2). 20 Let g(w) = 30w + 2. Calculate g(-1). -28 Let u(a) = -a*3 + 6a*2 - 4a - 6. Determine u(5). -1 Let t(b) = b*3 - 20b*2 + 22b - 26. Determine t(19). 31 Let h(c) = 3c + 3. Calculate h(-2). -3 Let v(h) = 2h - 4. What is v(-4)? -12 Let s(c) = 6c3 - c2 + 2. Calculate s(-1). -5 Let b(o) = -14o + 16. What is b(6)? -68 Let q(t) = t3 + t2 - 5t + 15. Give q(0). 15 Let o(g) = -2g + 21. Calculate o(10). 1 Let o(n) = -8n - 5. Determine o(2). -21 Let g(d) = 18d + 16. Determine g(-2). -20 Let i(v) = v*2 - 41v + 236. What is i(7)? -2 Let v(m) = m - 31. What is v(34)? 3 Let d(b) = 2b + 5. What is d(4)? 13 Let f(z) = -z2 + 12z - 25. Determine f(10). -5 Let c(j) = j*2 + 11j - 7. Calculate c(-11). -7 Let h(b) = b*2 - 40b + 52. Determine h(39). 13 Let v(a) = a*3 + a + 4. Calculate v(-2). -6 Let h(r) = r + 46. Give h(-13). 33 Let c(g) = -7g - 248. What is c(-35)? -3 Let m(t) = t*3 + 9t*2 - 4t - 22. What is m(-9)? 14 Let j(d) = d - 20. Calculate j(0). -20 Let x(c) = -c*3 - 15c*2 - 17c - 3. Calculate x(-14). 39 Let b(l) = -39l - 207. What is b(-6)? 27 Let s(z) = 23z + 7. Calculate s(-4). -85 Let v(h) = -2h - 61. Calculate v(-30). -1 Let p(m) = 5m + 65. Calculate p(-13). 0 Let a(f) = f*2 - 16f + 65. Give a(7). 2 Let n(h) = -11h3 + 35h*2 - 36h + 2. Calculate n(1). -10 Let d(w) = -w*3 + 6w*2 - 2w. Give d(6). -12 Let d(t) = t*2 - 14t + 11. Determine d(12). -13 Let a(k) = 53k - 367. Determine a(7). 4 Let r(u) = 29u + 184. Give r(-6). 10 Let g(f) = f*3 + 3f*2 + 3f + 5. Give g(-2). 3 Let o(i) = 4i3 - 3i*2 - 5i - 1. What is o(-2)? -35 Let s(n) = 14n - 1. Give s(-2). -29 Let w(z) = -2z + 19. Determine w(15). -11 Let u(q) = -q*3 + 26q*2 + 24q + 69. Determine u(27). -12 Let r(k) = 21k + 5. Calculate r(-1). -16 Let c(d) = -d3 + d2 - d + 29. What is c(0)? 29 Let f(c) = -26c + 284. What is f(11)? -2 Let o(w) = w - 4. Give o(10). 6 Let j(t) = 2t3 - 9t*2 + 4t + 7. What is j(4)? 7 Let s(k) = -k*3 + 9k*2 - 6k - 1. Give s(8). 15 Let q(j) = 150j + 1054. Determine q(-7). 4 Let y(j) = j2 - 3j - 1. Calculate y(3). -1 Let u(d) = d*2 + 20d - 4. What is u(-20)? -4 Let k(p) = -p*2 - 24p - 19. Calculate k(-24). -19 Let k(b) = -b*2 + 16b + 4. Give k(15). 19 Let t(r) = 11r - 5. Determine t(2). 17 Let v(y) = -y3 + 11y*2 - 7y + 15. Determine v(11). -62 Let q(i) = -i*3 + 4i*2 + 10i + 6. What is q(6)? -6 Let b(u) = 10u - 16. Give b(2). 4 Let y(w) = -w2 - w + 18. Calculate y(5). -12 Let q(f) = -2f*3 + 6f*2 - 2f - 2. Determine q(4). -42 Let d(h) = -6h - 26. Give d(-4). -2 Let a(v) = -8v + 24. Calculate a(2). 8 Let j(h) = -2h2 + 52h - 10. Give j(26). -10 Let x(j) = j*2 - 24j - 78. Give x(27). 3 Let o(z) = -z*2 - 13z - 15. Give o(-11). 7 Let q(k) = -k*3 + 13k2 - k + 1. Give q(13). -12 Let r(j) = -j2 + 11j - 11. Determine r(1). -1 Let r(x) = x2 - 10x - 6. Give r(4). -30 Let r(g) = -127g + 635. Give r(5). 0 Let s(l) = l3 + 2l. Determine s(2). 12 Let x(p) = 5p + 23. Determine x(-5). -2 Let a(b) = 14b + 27. What is a(-8)? -85 Let b(a) = -a*2 + 2a - 5. What is b(-4)? -29 Let h(k) = -k*3 - 31k*2 - 4k - 132. Calculate h(-31). -8 Let j(b) = b*2 - 52b + 207. What is j(48)? 15 Let w(y) = y*3 - 10y*2 - 10y + 9. Calculate w(11). 20 Let b(x) = x*3 + 7x*2 - x - 1. Calculate b(-7). 6 Let j(p) = -5p - 30. What is j(-5)? -5 Let l(b) = 9b2 + 6b + 4. Give l(-3). 67 Let m(k) = -8k2 + 6k - 14. Determine m(4). -118 Let f(l) = l*3 + 21l*2 + 69l + 10. Give f(-17). -7 Let h(u) = 2u2 + 11u - 50. What is h(-8)? -10 Let i(m) = -2m3 - 10m*2 + 6m + 2. What is i(-5)? -28 Let s(x) = x*3 - 20x*2 + 19x + 9. Give s(19). 9 Let m(t) = -t*2 - 21t + 44. What is m(-21)? 44 Let w(p) = -7p + 37. Calculate w(5). 2 Let i(f) = 2f. Calculate i(-5). -10 Let k(m) = 2m + 7. Calculate k(3). 13 Let p(w) = -2w*3 - 2w*2 - 4w - 3. Give p(-2). 13 Let a(m) = -m*3 + 4m*2 - 5m + 19. Calculate a(7). -163 Let l(j) = -j*2 - 18j - 82. Calculate l(-7). -5 Let l(d) = -35d2 + 3d + 1. What is l(-1)? -37 Let f(i) = -6i - 53. What is f(-10)? 7 Let z(l) = 42l - 47. Calculate z(1). -5 Let q(c) = -c*3 + 8c*2 - 3c + 2. Calculate q(8). -22 Let p(r) = 12r - 134. Give p(11). -2 Let x(v) = -v2 + 6v - 2. Determine x(9). -29 Let r(s) = -s*3 - 7s*2 + 9s + 3. Calculate r(-8). -5 Let c(d) = d*3 + 8d*2 + 10d + 2. Give c(-2). 6 Let r(f) = f. Give r(1). 1 Let k(l) = -3l2 - 5l - 5. Determine k(-5). -55 Let x(v) = -v*2 + 8v - 9. Calculate x(6). 3 Let o(g) = g*2 + 9g + 36. What is o(-4)? 16 Let c(s) = 4s3 - 2s2 + s + 1. Calculate c(2). 27 Let f(l) = -l3 + 7l2 + 11l - 15. Give f(8). 9 Let c(o) = o*2 + 8o + 7. Calculate c(-6). -5 Let q(z) = z*3 - 10z2 - 10. Give q(10). -10 Let t(w) = -w2 + 7w - 2. Calculate t(5). 8 Let q(h) = 2h - 5. Give q(2). -1 Let p(x) = -x*2 + 6x + 4. Determine p(6). 4 Let j(i) = i. Give j(-12). -12 Let p(m) = 2m3 + 2m*2 + 2m - 2. Determine p(2). 26 Let w(c) = -4c + 52. Determine w(9). 16 Let r(t) = t3 + 2t*2 - 4t - 1. Calculate r(3). 32 Let b(y) = -y*2 - 7y - 6. Calculate b(-4). 6 Let a(w) = 4w2 - 7w - 41. What is a(4)? -5 Let m(t) = -t*3 - 3t*2 + 5t + 10. Give m(-3). -5 Let m(u) = 5u. Give m(10). 50 Let x(i) = -i2 - i + 24. Determine x(5). -6 Let r(y) = -y3 + 6y*2 + 39y + 13. What is r(10)? 3 Let l(a) = 21a2 + 4a - 3. Determine l(1). 22 Let u(r) = -10r - 115. What is u(-12)? 5 Let u(d) = 2d3 - d2 - 4d + 4. What is u(2)? 8 Let w(s) = 5s + 17. Give w(7). 52 Let t(v) = -v*2 + 88v - 415. Give t(5). 0 Let r(q) = -21q + 147. What is r(7)? 0 Let d(g) = -2g**2 -	{ "pile_set_name": "DM Mathematics" }
arest 10000. -130000 Let l = 767299 - 767300.999995. Let q = l - -2. Round q to six dps. 0.000005 Let q = 0.0431 + -324.0431. Let u = q - -324.0000143. What is u rounded to six decimal places? 0.000014 Suppose 0 = -5f + f + 16. Suppose fm - 3900 = m. What is m rounded to the nearest 100? 1300 Suppose a = -2m - 0a + 2945, 5m - 5a = 7355. Let l(s) = 7s2. Let n be l(-8). Suppose -m - n = -2k. Round k to the nearest one hundred. 1000 Suppose -4o = -3x - 718, -3o + 953 = -4x - 2o. Round x to the nearest one hundred. -200 Let h = -1027 + 1022.905. Let i = 3.99 - -0.01. Let q = h + i. Round q to 2 dps. -0.1 Let v(o) = o3 - o2 + o - 18400000. Let c be v(0). What is c rounded to the nearest 1000000? -18000000 Let t = 3 + 0. Suppose 25 = tr + 7. Suppose 4g + 6608 = 3i, -2g - r = g. What is i rounded to the nearest 1000? 2000 Let q(z) = -1600z + 1. Let x be q(2). Let p = 12889 - x. Suppose -11912 = 4k + p. Round k to the nearest one thousand. -7000 Suppose 493 = -6d + 133. Round d to the nearest one hundred. -100 Let w = 197 + -197.0113. What is w rounded to 3 dps? -0.011 Let f be (-28)/(-10) - (-2)/10. Suppose 0 = -5p + 2b + fb - 294985, -2b = 6. What is p rounded to the nearest ten thousand? -60000 Let u = -96 + -744. What is u rounded to the nearest 100? -800 Suppose 5w - 1 - 14 = 0. Suppose 4m = -5o - 1999980, -wo + 4o + 400010 = 2m. Round o to the nearest one million. 0 Let p = 1 - -2. Suppose 6q = pq - 9600000. Round q to the nearest one million. -3000000 Suppose -110 = -4z + 10. Let r be 6/(-9) + z/(-9). Let t be r/6 + 258002/3. Round t to the nearest ten thousand. 90000 Let g = -28 - -43. Suppose -g = h - 5t, 2 + 10 = 2h + 4t. Let x be (-1 - 12099999) + h + 0. Round x to the nearest 1000000. -12000000 Let z(b) = 18749b2 + 10b - 16. Let h be z(8). Round h to the nearest 1000000. 1000000 Let n = 0.309861 - 0.31. Round n to 5 decimal places. -0.00014 Let v = 89.6 - 83. What is v rounded to 0 decimal places? 7 Suppose -671300 = 16y - 20y. Suppose -5o = 39325 - y. What is o rounded to the nearest 1000? 26000 Let y = -3788860 - -12388860. Round y to the nearest one million. 9000000 Suppose 2i = i - 6. Let n(f) = 344f2 + 3f - 8. Let w be n(i). Let x = w - 17358. What is x rounded to the nearest 10000? -10000 Let o = -1.5 + 110.5. Let x = 108.879 - o. Let u = x + 0.19. What is u rounded to two dps? 0.07 Let i = -53.9999696 - -54. Round i to 5 dps. 0.00003 Let s = -0.87 + 0.86899. What is s rounded to four decimal places? -0.001 Suppose 5h + 50720 = -3g, 3g = -5h + 2h - 50712. Round g to the nearest 1000. -17000 Suppose -48 - 122 = -5n. What is n rounded to the nearest 10? 30 Let o = 0.1 + -0.105. Let a = 0 + o. Let b = a - -0.00458. Round b to four decimal places. -0.0004 Suppose 5x - 450 = -0x. What is x rounded to the nearest 10? 90 Let m = 24713 + -24712.39179. Let x = 3.60827 - m. Let t = x - 3. What is t rounded to 5 dps? 0.00006 Let j = -5 - 0. Let r = j + 4.982. Let p = r + 0.478. Round p to 1 dp. 0.5 Let h = -3912.619 - -3920. Let y = 0.019 + h. Round y to zero decimal places. 7 Let h = 528 + 630. Suppose 2p - h = -81158. Let r be (890/4)/(1/p). Round r to the nearest 1000000. -9000000 Let c = 69 - 68.9999697. Round c to six dps. 0.00003 Suppose 4f - 3y + 2y - 119996 = 0, -149992 = -5f + 2y. What is f rounded to the nearest 10000? 30000 Let v = -1 - -1. Let n(m) = -665m3 - m2 - 3m - 2. Let r be n(-2). Suppose v = -2w + 6w + r. What is w rounded to the nearest one hundred? -1300 Let a = -22.76 - 0.24. Let n = -18.6 - a. Round n to the nearest integer. 4 Suppose 3y - 21998955 - 6201045 = 0. What is y rounded to the nearest one million? 9000000 Suppose m - 10861 = -35861. What is m rounded to the nearest 10000? -30000 Let b = -0.06 - 27.94. Let g = -13 - b. Let z = -15.000046 + g. What is z rounded to five dps? -0.00005 Let x = -0.27 + -11.18. Let n = x + 11. Round n to 1 decimal place. -0.5 Let c = -0.06 - -0.159. Let g = c - 1.689. Let q = 0.47 + g. Round q to one decimal place. -1.1 Let o(t) = -t2 - 5t - 3. Let v be o(-3). Suppose -s - 116000 = -vs. Round s to the nearest 10000. 60000 Let v(s) = 5s*2 - s - 3. Let j be v(-3). Suppose -3z - 117 = j. Let n = z + 30. Round n to the nearest ten. -20 Let i = 0.23 + -10.23. Let d = -9.99985 - i. Round d to four dps. 0.0002 Let p = 0 - -0.000088. Round p to four dps. 0.0001 Let t = -1 + 0.4. Let g = t - 1.8. Let j = 0.2 + g. What is j rounded to zero dps? -2 Suppose 15 = -2y + 5y. Suppose -15 + 5 = -5p. Suppose yk - 2d - 8 = pd, 2k = 3d + 6. What is k rounded to two decimal places? 0 Let t = 143 - 53. Let a = -90.00000164 + t. Round a to 7 decimal places. -0.0000016 Let g(f) = 34f - 12. Let i(p) = -17p + 6. Let d(n) = -3g(n) - 5i(n). Let m be d(8). What is m rounded to the nearest one hundred? -100 Let p = 138369216 + -138369082.000059. Let x = p + -134. Round x to five dps. -0.00006 Let o = -5.8 + 6. Let b = 3875.2001 - 3875. Let h = b - o. Round h to 4 dps. 0.0001 Let b = 62 - 23. Let w = b + -39.00000108. What is w rounded to 7 decimal places? -0.0000011 Let w = -4.98 + -0.02. Let r = 5.000125 + w. What is r rounded to five dps? 0.00013 Let v = 0.9799981 - 0.98. Round v to 6 dps. -0.000002 Suppose -4p = 5r - 240015, r = -0r + 3. What is p rounded to the nearest 1000? 60000 Let n = -98.056 + 0.056. Let h = n - -97.9999909. Round h to 6 dps. -0.000009 Let o(z) = -z2 + 5z - 1. Let w be o(2). Let g(s) = 8079s2 - 2s + 2. Let p be g(w). Suppose -5a - p = 108033. Round a to the nearest 10000. -60000 Let w = -0.14 - -0.13999976. Round w to 7 decimal places. -0.0000002 Let n = 0.72599433 + -0.726. What is n rounded to six decimal places? -0.000006 Suppose 3r + 1244000 = 4a, 3a = -2r + 3r + 933000. What is a rounded to the nearest one hundred thousand? 300000 Let k = 2 - 6. Let z = -4.000004 - k. What is z rounded to 6 dps? -0.000004 Let u be 26/6 - (-4)/6. Let q(r) = -r*3 + 5r*2 + r + 1. Let k be q(u). Let s be (-525)/k16000/(-2). Round s to the nearest one million. 1000000 Let a = -0.42 - -0.661. What is a rounded to two dps? 0.24 Suppose -3q - 2070 = 2k + k, 0 = q - k + 692. Let m = 1353 - q. Suppose w - 1356 = m. Round w to the nearest 1000. 3000 Let z = -3.87 - -4. Let s = z - 0.12994. What is s rounded to four decimal places? 0.0001 Let y = 0.01 + 0.02. Let p = y - 2.03. Let i = 1.9999998 + p. What is i rounded to seven decimal places? -0.0000002 Let s be 2(-2)/((-8)/6). Suppose -sc + 2049994 = 2c + 3r, 3c - 3r - 1230006 = 0. Round c to the nearest one hundred thousand. 400000 Let f = -19 + 45. Let x = f - 25.9923. Round x to 3 dps. 0.008 Let t(g) = -475g2 + 2g - 2. Let p be t(1). What is p rounded to the nearest one hundred? -500 Let a = -328208.39 + 334783. Let u = 6575.6099952 - a. Let n = -1 + u. What is n rounded to 6 decimal places? -0.000005 Let c = 46104 + -221104. What is c rounded to the nearest ten thousand? -180000 Let d = -10.011 - -10. Let j = -0.219 + d. Round j to 1 dp. -0.2 Suppose -4l = v + 4 - 2, -5l + 2v = -4. Let a = 0 - l. Suppose -h + ah = 14. Round h to the nearest ten. -10 Let a(b) be the third derivative of b*5/60 - 25b3/6 + b2. Let z be a(0). Let m = -15 + z. What is m rounded to the nearest 100? 0 Let f(n) be the third derivative of 34001n6/120 - n5/60 - n4/12 + n3/3 + 3n*2. Let v be f(1). Round v to the nearest 10000. 30000 Suppose 0 = 7v - 3v - 36. Let k be (-2)/v + 3100/18. Round k to the nearest ten. 170 Let u = 0.08 - 0.05. Let z = u + -0.030039. What is z rounded to 5 decimal places? -0.00004 Suppose 3x - 2b - 56 = 0, 8x - 3b = 3x + 94. Suppose 4n + 2l - 22 = 5l, 4n - x = 4l. What is n rounded to the nearest 10? 10 Let o = 6.05 - 0.05. Let w = o - -13. Let d = w + -18.1. What is d rounded to 0 decimal places? 1 Suppose 4i - 17983 = 19617. What is i rounded to the nearest 1000? 9000 Suppose 3o - 25460824 = 4k, 5k + 8248338 = -3o - 23577665. Suppose -a + 949556 = -8815647. Let u = k + a. Round u to the nearest 1000000. 3000000 Let o = 1.1 - 1.099967. Round o to 5 decimal places. 0.00003 Let i = -19806.102 - -19807.0320093. Let p = 0.93 - i. What is p rounded to six decimal places? -0.000009 Let b = -90 + 1	{ "pile_set_name": "DM Mathematics" }
-2 - 0)) + 12. Solve 10 = -a - 2y, -2a + y + k = -2y for a. 0 Suppose 0 = -4p + p + 15. Solve ps = 3h, -h + 0h = -5s for h. 0 Let m = 9 - -21. Solve -5g + 0g - 2u - 35 = 0, m = -2g - 4u for g. -5 Let o be -305/(50/(-4)). Suppose -x + o - 3 = 0. Solve 4a = j + 7 + x, 15 = -3j + a for j. -4 Suppose -4q + 12 = -2b, -5q + 6b + 16 = 4b. Suppose -5k = -0k. Solve -3r + t - 16 = 0, -4r - t - 4t + q = k for r. -4 Suppose -2f + 7 = 21. Let n = 11 + f. Suppose nd - 6d + 6 = 0. Solve -dx - b + 24 = 4b, -x = b - 6 for x. 3 Suppose 15 = 5m, -19 = -0p - 4p - m. Solve f - 24 = 5q + 2f, 0 = 3q + pf + 28 for q. -4 Suppose -13 = -3u + 2. Solve 5t = x + u - 2, 2x + 6 = 0 for t. 0 Let m(a) = a3 - a + 5. Let g be m(0). Solve 3j - gj = -2p + 6, -4p = j - 7 for j. -1 Suppose 0 = 4w - 5w. Solve -d = 4d - h, -5d + 3h = w for d. 0 Let s be (-13)/(273/14)2-3. Let c be (-2)/(-1 - (-2)/6). Let q = c + -1. Solve qg + 0t = -st + 6, 9 = -3g + 3t for g. -1 Suppose -i - 5t = i + 25, 0 = -3i + 2t + 10. Solve -3x - 5b - 28 = -ib, 4x + 5b = -29 for x. -1 Let g(i) = 7i + 16. Let f(p) = -8p - 16. Let h(o) = 6f(o) + 7g(o). Let z be h(8). Solve -3q - 4r = -2q + 4, -5q + 2r + z = 0 for q. 4 Let s be (0/(-3))/(-4)1. Solve -2d = 3z + 21, sz + 3z = 5d for d. -3 Let g be -8(0 - 3/6). Let m(r) = -6r. Let x be m(2). Let v = 19 + x. Solve 4 = 5k + 3w - v, k = gw + 16 for k. 4 Let z be (-40)/(-12)(-6)/(-4). Solve x - 2 = g, 2g = -3g - zx - 10 for g. -2 Suppose 0 = 4r + 3q - 11, -2r = 4q - 11 + 3. Solve c - 4 = 5d, rc + 5 - 2 = -d for d. -1 Let k(a) = -a + 1 + 7 + 3. Let r be k(9). Suppose 4h = o - 30, -6h = 3o - 2h - 10. Solve -2b = -7b + 4w + o, -4b + 8 = rw for b. 2 Suppose 1 - 5 = -v. Suppose -3g - 3y - 18 = -6g, 2y = -2g + v. Solve 5h + g = -q - 1, -h - 3q = -13 for h. -2 Let v = 24 - 15. Solve -4g + 2o - 24 = 0, -4g - 27 = -5o + v for g. -4 Let n = -13 + 13. Suppose nz = -z. Solve -4y - 12 = -5y - 2b, z = 5y + 4b - 30 for y. 2 Suppose 2d = 4d - 4. Solve -dg = q - 0g + 8, 5g = -5q - 30 for q. -4 Suppose -v - 77 = -5j + 2v, -46 = -2j + 5v. Solve -5h = 4a - 3h - 14, -5h = -a - j for a. 2 Suppose 4p + 3g + 3 = 2, 3p = -4g - 6. Solve -pb = 0, -4b - 9 = -3n + b for n. 3 Let c = -24 - -29. Solve u = n - c + 2, 0 = -2u + 5n - 15 for u. 0 Suppose d - d = -20d. Solve 5j + 5s - 4 - 1 = d, 0 = -3j - 2s for j. -2 Suppose r - 5 = -0d - 4d, -2d = 2r - 10. Let f(n) = 2n + 10. Let q = 10 + -15. Let a be f(q). Solve 4k - i - r = a, -4k + 3 + 5 = -4i for k. 1 Suppose -4g = -3z + 13, -3 - 6 = g + 5z. Let p be (-3)/4g/1. Solve -pt + t - 3s = 15, -3 = 2t - s for t. -3 Let j(f) = f*2 - 7f + 7. Let c be j(6). Solve 2o = -3z + c, 2z = -3o + 1 - 2 for z. 1 Suppose 3g - 12 = -g. Suppose gd = 6d. Solve d = -4r - p - 21, 7p + 4 = 3p for r. -5 Let d(o) = -o - 3. Let v be d(-7). Solve -vu - 4p - 7 = -u, p = 2 for u. -5 Suppose -t + 3t = 0. Solve -f - 4z + 15 = t, 5 + 6 = -3f + 2z for f. -1 Suppose 0 = l - 3 + 4, -5l = p. Suppose -3o + 3a + 4 + 11 = 0, 5 = o + pa. Let j = 10 + -8. Solve -jb = -0b - ow + 19, 2w = -3b for b. -2 Suppose -12 = 2d + d. Let m = d - -6. Suppose 2 = -my + 4y. Solve -4z - y = -3z - p, 2z + 3p - 23 = 0 for z. 4 Let y(k) = -2k - 2. Let w be y(-2). Suppose -wz + 15 = z. Solve 2l + 3l + 10 = 0, 0 = -a + zl + 15 for a. 5 Let a = -68 - -72. Solve ab - 5j = 13, 0b = b + 2j + 13 for b. -3 Suppose -2l = -8 - 36. Let h = 24 - l. Solve j - ht = 5j + 8, 0 = 3t for j. -2 Suppose 12 = 2b + 2b. Let w(y) = -y2 + 4y + 1. Let t be w(b). Suppose -15 = 3p - 36. Solve 3u + c + 7 = 0, 0 = -tu + pu - 2c - 5 for u. -1 Suppose x - 10 - 1 = 0. Solve -2k = -b - 2b + x, 23 = -5k + 3b for k. -4 Suppose 3j = 4 + 2. Suppose -2s + jq = -12, 5 = -s - q + 13. Let r = s - -30. Solve 3z = -k + 19, -4k + 7k - r = -5z for z. 5 Suppose 0 = -3l + 18. Let v(j) = j3 - 7j*2 + 8j - 3. Let g be v(l). Solve 2r = -4a + 11 - 29, -a - 2r - g = 0 for a. -3 Let w(o) = o3 + 4o*2 - o - 7. Let p be w(-2). Solve pr - 5x - 10 = 0, -7x + 2x - 10 = -r for r. 0 Let h be (-6)/(-90)69 - (-4)/10. Let f = -6 - -8. Let z(d) = -d*3 + 5d*2 - 3d - 4. Let w be z(4). Solve -fu = m + 11, wu = -u - h for m. -1 Let i = -2 - -14. Solve 5y + h = 12, 0 = 4y - h - i - 3 for y. 3 Let t(g) = -3 + 0g + 4g - 3g. Let y be t(5). Solve -4z - yc = -8, 0 = 5z - 4c - 11 + 1 for z. 2 Suppose -2u - u = 18. Let p be u/2(-2)/2. Suppose 4o - 2l - 2 = 0, 4l = -2o + 3 + p. Solve 2d - 6 = 4v, -3v + 5 = -5d - o for d. -3 Let i = 5 - 3. Suppose r = 2c - 6c - 20, -c - 26 = 2r. Let f be 4/(r/(-15)) - 2. Solve -g - 3a + 8 = 0, fg - ig + 4 = 3a for g. 2 Let d be (-4)/318/(-8). Let j be d + -2 + -2 - -4. Solve -c - 3c - 4u = 0, -u - j = -2c for c. 1 Suppose -2i = -2o - 2, 0 = 5i - o - 1 - 8. Solve -ip - 3z = -2z - 4, 5p - 10 = 3z for p. 2 Let i be 7(-3 + (-69)/(-21)). Solve -4u - 3z + 8 = -i, 4u + z = 6 for u. 1 Let k = -6 + 13. Let d(o) = 2o. Suppose 0y - 3y + 3 = 0. Let l be d(y). Solve u = lj + k, 4j = j - 2u for j. -2 Let i(h) = -4h - 5. Let n be i(-2). Suppose -na = -9 - 0. Solve 3l + 10 = d, al - l - 4d = 10 for l. -5 Let j(f) = -f2 - 24f - 20. Let r be j(-23). Let u(a) = 3a3 + 2a*2 - 2a + 1. Let o be u(1). Solve -3 = -2b - b + oc, -4b - 3 = -rc for b. -3 Let l be (-7)/(-2) + (-6)/4. Suppose m = -l - 36. Let y be m/(-10) - (-5)/25. Solve -15 = -h + yr, 5r = h - 18 - 1 for h. -1 Let t be (2 + -4)1 + 10. Let h = -5 + t. Solve -4q + hj = 5j - 2, 0 = -5q + j - 1 for q. 0 Let z be (18/(-8))/((-6)/8). Solve -4t - 2b = zb + 37, 10 = -2b for t. -3 Let k be (-6)/(54/(-69)) + 4/12. Solve 4n - k = 4t, t - 3t = 5n + 25 for n. -3 Let h be 1/((-2)/4) + -9 + 15. Solve -q = -0q - 3j - 17, -4q - 12 = hj for q. 2 Let k(s) = s2 + s - 2. Let z be k(2). Let a(p) = p2 + 6p + 4. Let i be a(-6). Let y be z + -3 + i + -1. Solve 5b - 9 = -g - 3g, -yb = -g - 3 for g. 1 Let q be 1/(0 + -1 + 2). Suppose 4 = -5t - q. Let m be (5 - 7) + 6 + t. Solve -5 = 3z - 2a, ma - 5 = z + z for z. -1 Suppose 0 = 4t - 4u, -15 = -4t - 0u - u. Let j = t - 12. Let x = j + 15. Solve -3b = -2m - 9, m - 2b = -4m - x for m. 0 Let t be -3 + (4 - -2) + 39. Let o be (-4)/10 + t/5. Suppose -3c = -0c. Solve 0 = 4n - cn + o, -2n + 2 = -3k for k. -2 Let l(g) = -2g - 2. Let d be l(-3). Suppose dt = 7t - 135. Solve -5x = -0x + 4w - t, 5 = 3x - 2w for x. 5 Let t(y) = -y - 2. Let v be t(2). Let r = 4 + v. Solve rd = -2p + 2d, 5p = d - 12 for p. -3 Let m(s) = s + 4s*3 - 8s + 0s3 - 3s*3 + 5s*2 - 2. Let t be m(-6). Solve 0 = 4z + tr - 24, -3r + 13 = z - 1 for z. 2 Let w(m) be the second derivative of m*4/12 - 5m*3/6 + 3m*2 + m. Let y be w(4). Solve -ys = 10, 13 = -2i - 2s - 7 for i. -5 Suppose -3v + 73 = -116. Suppose 5t = 3b - v, -2t + 7 = b - 3. Solve b = -5n - l, 5n + 4 = l - 10 for n. -3 Suppose -4d - 8 = -8d. Solve 3a + 9 = -4r, -da - 3r = -4 + 10 for a. -3 Suppose -4w = 5v, 2w = -3v - v - 6. Solve -5t - 4q + w = 0, 5t - 3t - 19 = -5q for t. -3 Suppose z + 8 = 2g - 0, z + 17 = 5g. Let k = -4 + g. Let w be (9/3 - 2) + k. Solve w = 2h + 2n + 11 + 9, -4h - 5n - 45 = 0 for h. -5 Let t = -82 - -34. Let v be t/605/(-2). Solve 3p + 4y - 45 = -vp, -3y = -p - 10 for p. 5 Let x be 185/10 - (-2)/4. Solve i - 3h + x = 0, -4i = -0i + 5h - 9 for i. -4 Suppose -3p + 5n = 2p - 30, -4p + 20 = -3n. Solve 0 = -4o - 3j + 2j - 15, -5 = 3o + pj for o. -5 Suppose 6a - 2a = 12. Solve 4v - 11 = ao, 2v + v = 3o + 9 for v. 2 Let d(k) = -k*3 - 11k*2 - 18k + 4. Let m be d(-9). Solve m = 4c + 4g - 4, 4 = 4g for c. 1 Suppose 0 = k - 4k + 6. Suppose 2g = -2f + 4g + 24, -3f = kg - 31. Let s = -7 + f. Solve -a = -y + sy + 19, 0 = 5a - 2y + 10 for a. -4 Suppose f + 4 - 19 = 0. Solve 2p + 7r = 2r - 1, -3r + f = -4p for p. -3 Let u = -6 + 9. Let k = 1 + u. Let l be ((-5)/(-10))/((-3)/(-36)). Solve 0 = -lz + 5z - 2x + 12, 0 = -kz + 3x + 4 for z. 4 Let p(u) = u + 7. Let y be p(-7). Let n = 9 + -4. Suppose -l -	{ "pile_set_name": "DM Mathematics" }
sest to -2/3? (a) 1 (b) -2 (c) u c Let f be -2 - (1134/(-297) - (-2)/(-11)). What is the closest to f in -0.3, -2, 2/9, 0.09? 2/9 Let y = -0.07 - -3.07. Let d = -1.48 - -57.48. Let h = d - 56. Which is the nearest to h? (a) y (b) 0.3 (c) 1/23 c Let y = 0.05 - -0.05. Suppose 16o + 2 = -78. What is the closest to y in o, 1/3, -2/23? -2/23 Let k be (-26)/(-65)2/(-4). What is the closest to 1 in -4, 4, 69, k? k Let g = -86.5925 - 0.0075. Let k = 87 + g. Which is the closest to -0.7? (a) -3/8 (b) -0.2 (c) k a Let o = 2.15 - 7.15. Let m = 8 + -14. Which is the closest to m? (a) -0.5 (b) -1 (c) o c Let g = -24 - -21. Let d = 59 + -60. Which is the nearest to 4/7? (a) g (b) d (c) -0.4 c Let x = -38.5 - -39. Let g = 9 - 8. Let q = -0.55 + 0.15. What is the closest to g in x, q, 4? x Let q = 0.548 + -0.248. Which is the closest to -1? (a) -0.1 (b) q (c) -0.3 (d) -3 c Let d = -19 - -32. Let o = -8 + d. Suppose 19 = 3u + 5f, -of = 2u - 0f - 16. What is the closest to -4 in u, 0.4, -2? -2 Let p(d) = -d3 - 6d*2 - 3d - 13. Let z be p(-6). What is the closest to 0.05 in -0.3, z, -4? -0.3 Suppose -2g = x - 23, 3g + 4x = -15 + 62. Let t = 33.6 - 33.3. Let y = 0.9 + -1. What is the nearest to g in t, y, -1? t Let w = 679.93 + -680. What is the closest to 0 in 0.2, 0, w? 0 Let s be (1/1)/((-2)/(-6)). Let r = -15.6 + 28. Let h = 12 - r. Which is the nearest to -1? (a) 2/3 (b) s (c) h c Let q = 1.1 - 1.6. Let r = 30227/110 - 2537/10. Let l = r - 21. What is the nearest to 2 in q, -0.2, l? l Let a = 1983 + -1983. What is the nearest to -2/5 in a, 0.5, 7? a Let b = 16 - 37. Let u = -37 - b. Let i = u + 18. What is the closest to 0 in i, 1/6, 3/4? 1/6 Let z = 0.512 + -0.622. Which is the nearest to -0.1? (a) -3 (b) -4 (c) -0.06 (d) z d Suppose -w + 5l = -2 + 20, -w - 5l = -22. Let v = 31/90 - -1/18. Which is the closest to -2/5? (a) w (b) v (c) -2/9 c Let c = -1023/7 - -1024/7. Let d = 12 - 17. What is the closest to d in -0.4, c, 2/7? -0.4 Let t be (-4)/2 - ((-268)/(-120) - 3). Let r = t + 7/5. Which is the closest to 0.2? (a) 0.5 (b) 0.2 (c) r b Let l = 2/7 + -1/28. Let z = -9776/9 + 1086. Which is the nearest to l? (a) -0.3 (b) -5 (c) z c Let n = 1567 + -1566.9. What is the nearest to 3 in n, -0.9, -0.4, -1? n Let z = -0.1291 - -0.2291. What is the closest to z in 0.5, 4, 4/5? 0.5 Let t = 1.3 + -1.8. Let u = -8 + 7.9. Which is the closest to u? (a) -4 (b) t (c) -3 b Let b = -173 + 159.88. Let h = 0.12 + b. Let k = h - -11. What is the nearest to 0 in 0, k, -4? 0 Let i = -43 + 48. Which is the nearest to 1/4? (a) -5 (b) i (c) 61 b Let f = 1.19 - 2.19. Let w = -5.0238 - -0.0338. Let v = w + -0.01. Which is the closest to 1? (a) 1 (b) f (c) v a Let o = 0.051 - 0.251. Let m = 0.3 - 1.3. Let k = -1.1 + 0.1. What is the closest to m in o, k, -4? k Let j = 10.69 + -0.09. Let d = 25 + -14. Let r = d - j. What is the nearest to -1 in 0, r, -5? 0 Let d = 30.9 - 50.9. What is the nearest to 0 in 5, 1, -2, d? 1 Let n = -773 + 5414/7. What is the nearest to -2 in 3, -2/11, 5, n? -2/11 Let r = -0.25 + 0.51. Let u = r - 0.16. Which is the closest to u? (a) -0.3 (b) 3/4 (c) -1 a Let l = 0.3 + -0.6. Let s = l + 0.3. Let m(z) = -4z + 56. Let h be m(13). What is the closest to s in 0.1, -3, h? 0.1 Let h = 1851 + -1852. Which is the closest to h? (a) -0.9 (b) 1 (c) 2 (d) 3 a Let v = 4.6 + -5. Let w = 0 - v. Let j(o) = -8o3 - 295o*2 + 40o + 106. Let i be j(-37). What is the closest to 1/3 in w, i, -3? w Let a = 0.6 + -2.6. Let n = -0.6 - 2.4. Suppose 6z = 277 - 265. What is the nearest to -5 in n, z, a? n Let q be (8/(-6))/(2/(-1)). Let f = -0.2 - 2.8. Let v = -93/55 - -23/11. What is the closest to f in v, 0.3, q? 0.3 Suppose n + 4 = 5f, 2f + 24 = 3n + 5f. What is the closest to -0.2 in -2, -0.5, n? -0.5 Let l = 81.7 - 81.6. Let x be (-1)/21/(-2). What is the closest to l in 3/7, -2, x? x Let x = -211.7 + 212. Which is the closest to x? (a) -2 (b) -1 (c) 5 b Let v = 3 + -3. Let f = 56 + -56.1. What is the closest to 0.7 in v, f, -3? v Let g(q) = q3 + q2 - 5q - 5. Let h be g(-2). Let o = 0.028 + -2.928. Let l = 3 + o. Which is the nearest to 2/3? (a) h (b) l (c) 4 a Let j = 498.9 - 499. What is the nearest to j in 2, -0.4, -0.5, 0? 0 Let c = 113 - 118. What is the closest to 0 in 12, -2, c, 1? 1 Let q = -2348/17 - -138. What is the nearest to 2/5 in -2, 0.03, q? 0.03 Let r = 0.39 - 0.15. Let j = r + -0.64. What is the closest to -1 in 0, 0.3, j? j Let v = 0 - -4. Let k = -1 - v. Let i = 0.5002 + -0.5002. Which is the closest to -0.1? (a) k (b) -4/7 (c) i c Let u(q) = 0q*3 - 4 - 10q*3 + 9q*3 - q + 5q*2. Let i be u(5). Which is the closest to 1/2? (a) i (b) -1 (c) -4 b Suppose 34s + 4g = 31s + 542, 0 = 5s - 2g - 912. Which is the closest to 1? (a) -0.4 (b) 0 (c) s b Let f be (3/14)/((-6)/(-8)). Let o = -3.538 + 2.538. Which is the nearest to 7? (a) o (b) f (c) -0.5 b Let j(z) = z*2 - 4z + 3. Let s be j(3). Let v be (-45)/2(-7)/35. Let m = v - 5. Which is the nearest to s? (a) 2/21 (b) m (c) 1 a Let x be -4 - 6/((-12)/7). Let k = 23 + -28. What is the closest to -2 in 4, k, x? x Let f = -0.76 + -0.94. What is the nearest to 0.1 in -2, -3/2, 2/11, f? 2/11 Let j = 1 + -1. Let h = -0.1 + j. Suppose -q = -3d - 15, 5d - 13 = -4q - 38. What is the nearest to -2/7 in h, -1, q? h Let q = 172.1 - 170.1. Which is the closest to 2? (a) -4 (b) q (c) 16 (d) -3/4 b Let m = 822 - 820. Which is the nearest to -2/3? (a) -2 (b) m (c) 2/13 (d) -5 c Let y = -0.93 - 3.07. Which is the closest to 0? (a) -0.03 (b) 5 (c) y a Let u = -173.5 - -173. Let z = -0.07 - 0.23. Let l = -0.2 - -0.1. Which is the closest to l? (a) z (b) u (c) -4 a Let m = 2.51 - 2.53. Which is the closest to 1? (a) 1 (b) -1/6 (c) m a Let b = -4.4 + 2.4. Let x(h) = -2h + 3. Let l be x(3). Let p = 0.9 - 1. What is the closest to p in l, b, -5? b Let s = -1131 - -1128. Which is the nearest to 0.2? (a) s (b) 1/3 (c) 34 (d) -2 b Let k be (-2)/(-3) + 10/(-6). Let h = 9 + -35. Let y = h - -26.2. What is the nearest to k in -5, 2/13, y? 2/13 Let n be (-12)/(-54)(-42)/(-28). Which is the closest to 2/7? (a) n (b) 3/2 (c) 0.1 (d) 4 a Let y(g) = -11g + 21. Let z be y(6). Let d be (-3)/(z/(-2) + -3). Which is the closest to 0.1? (a) d (b) -3/4 (c) 4 a Let g = -33/476 - 5/68. Which is the nearest to 2/11? (a) g (b) -4 (c) -2/11 (d) 0.05 d Let u = 0.3 - 0.4. Let v = -1/11 - 6/55. Which is the closest to u? (a) v (b) -2 (c) -1/3 a Let h = 51 - 50.85. Let p = 0.05 + h. Let a = 0.34 + -0.04. What is the closest to -2 in 3, a, p? p Let n = -14/23 - -136/299. Let y = 8 + -2. Suppose 2g - k + 1 = 0, -yg - 4 = -3g - 4k. Which is the nearest to 1? (a) n (b) -4 (c) g c Let i = 2/209 - 223/1463. Suppose 0 = -z + 5z - t + 96, -4t - 99 = 5z. What is the closest to -1/4 in z, i, 2? i Let r = 60 + -67. Let b = -6.6 - r. Let m be ((-1)/(-2))/((-7)/(-6)). What is the nearest to -1/4 in -2/9, m, b? -2/9 Suppose 5v + 301 = -99. Let m = v - -238/3. Let z = 1361 - 1357. Which is the closest to m? (a) -2/11 (b) z (c) -0.1 a Let n = 401 + -401.1. What is the closest to n in 1/45, 1/2, -2? 1/45 Let r = -561 - -565. What is the closest to 0.1 in r, -4, 1/3, 12? 1/3 Suppose 4k = 4y, 0 = -y - 3k - 0 + 4. Which is the closest to y? (a) -5 (b) -0.07 (c) -2/3 b Let k = 537/11 - 49. Let d = 210 - 210. Which is the nearest to 0.2? (a) k (b) d (c) -0.2 b Let z = 57.5 - 45. Let h = z - 11. Let t = 3.5 - h. Which is the closest to 0.1? (a) t (b) 1 (c) -0.1 c Let t = 0.1 + -0.1. Let j(p) = -2p3 - 60p*2 - 251p - 34. Let f be j(-25). What is the closest to 0.2 in 1, f, t? t Let f(h) = -7h*2 - 4. Let x be f(0). Which is the closest to -0.1? (a) 3/7 (b) x (c) 8 (d) 6 a Let x = -28.1 - -28. Let n = 23/36 + -5/36. What is the closest to x in n, 1, -0.8? n Let o = 0 + 0.08. Let k = o + -0.07. Let r = 0.41 - k. Which is the closest to -1/3? (a) 5 (b) r (c) 1/5 c Let z = 18.73 + -19.23. Let d = 3 + -3.2. Let y = d + 0.3. Which is the closest to y? (a) -1 (b) -1/4 (c) z b Let y = 482 - 480.6. Which is the nearest to 19? (a) -3 (b) 1/3 (c) -0.4 (d) y d Let t = 1696 - 1694. What is the	{ "pile_set_name": "DM Mathematics" }
h + 3 + 0 = 0. Suppose -2q - 15 = -3. Let c(p) = p + 1. What is hl(w) + qc(w)? 2w Let m be 0 + ((-2)/33 - -4). Let a(v) = -v3 + 4v*2 - 3v. Let p(t) be the second derivative of -t*5/4 + 7t*4/4 - 8t*3/3 + 2t. Give mp(l) - 11a(l). l*3 - 2l*2 + l Let q(z) = -21z*3 + 16z*2 - 11z - 11. Let j(p) = -72p3 + 68p*3 - 2 + 7p*2 - 4p*2 - 2p. Calculate -11j(a) + 2q(a). 2a3 - a2 Let t(k) = -29k - 7. Let w(l) = l + 1. Calculate -t(g) - 6w(g). 23g + 1 Let p(u) = -3u - 5. Let o(q) = 2q + 4. Calculate -7o(g) - 6p(g). 4g + 2 Let d(x) = 2x. Let n(m) = 4m - 1. Suppose -t + y - 10 = 0, 0t - y = 3t + 18. Let k = t - -5. Calculate kn(a) + 5d(a). 2a + 2 Let r(a) = a*3 - 3a - 1. Let c(w) = -w. What is 4c(y) - r(y)? -y3 - y + 1 Let v(o) be the second derivative of o5/20 - o3/6 + o2/2 - 12o. Let x(d) = 4d3 + 2d*2 - 3d + 6. Calculate -3v(a) + x(a). a3 + 2a*2 + 3 Suppose 1 = m + 8. Let u(l) = 3l2 - 10. Let b(c) = -c2 + 3. Determine mb(x) - 2u(x). x*2 - 1 Let s(x) = x. Let b(t) be the second derivative of 0 - 1/2t*2 + 1/2t*3 + 2t. Calculate -b(p) + 4s(p). p + 1 Let f(q) = -3q*3 - 2q + 1. Suppose 5i + 50 = 5c, 23 = -5c - i + 79. Let g(t) = ct + 16t3 - t2 + 1 + t2 - 6. Calculate 11f(a) + 2g(a). -a3 + 1 Suppose 8 + 0 = 8k. Let q(x) = x2 - x - 1. Let y(i) = -i3 + 2i2 - 5i - 4. What is ky(u) - 4q(u)? -u*3 - 2u*2 - u Let s be 2(3 - (-4 - -9)). Let y(k) = 6k3 - 9k*2 + 9k + 9. Let a(m) = 3m3 - 4m*2 + 4m + 4. Calculate sy(f) + 9a(f). 3f3 Suppose -4o + 2o = -2t + 10, 4o + 12 = 2t. Let n(i) = -5i2 + 4i + 4. Let b(x) = 4x2 - 3x - 3. Determine tb(a) + 3n(a). a*2 Let s(f) = 5f. Suppose 11 = 2l - 1. Let v(h) = 4h. Let b(o) = lv(o) - 5s(o). Let u(q) = 3q. What is -8b(m) - 3u(m)? -m Let k(g) = g2 + 2g. Let v be (-1 - -3)/(1/(-1)). Let s(l) = l*2 + l + 1. Let j(t) = -8t*2 - 11t - 7. Let b(q) = j(q) + 6s(q). Give vb(h) - 5k(h). -h2 + 2 Let u(n) = -n + 15. Let o(c) = -c + 22. Let z(x) = -5o(x) + 8u(x). Let f(t) = -2t + 7. Give 7f(b) - 5z(b). b - 1 Let w(u) be the second derivative of 9u5/20 - 3u4/4 - u3/3 + 5u2/2 - 21u. Let y(k) = -14k3 + 14k*2 + 3k - 8. Determine -8w(g) - 5y(g). -2g3 + 2g*2 + g Let o(r) = -2r + 3r - 2 - 3. Let u(f) = 7f - 12. Let d(b) = -6b + 11. Let v(p) = -6d(p) - 5u(p). Determine -6o(i) + 5v(i). -i Let r(y) = 5y*2 - 2y + 1. Let d be (-18)/15-5 - 1. Suppose -32 = -o + do. Let u(i) = 14i2 - 6i + 3. Give or(l) + 3u(l). 2l2 - 2l + 1 Let l(h) = 2h + 17. Let o(p) = -9 + 15 - 2p + 3p. Calculate -4l(g) + 11o(g). 3g - 2 Let f(l) = -7l + 5 + 4l + 0 - 4l2. Let h(q) = 3q*2 + 2q - 4. Calculate 2f(t) + 3h(t). t*2 - 2 Let j(o) = 31o + 9. Let k(y) = -47y - 13. Let c(w) = -8j(w) - 5k(w). Let q(x) = 4x + 2. Determine 2c(g) + 7q(g). 2g Let z(j) = -22j*2 - 5. Let b(l) = -23l*2 - 6. Determine -3b(f) + 4z(f). -19f*2 - 2 Let y(r) = r + 1. Let o(n) be the second derivative of 0 - 7/6n*3 + 5n - 3/2n2. Give o(u) + 5y(u). -2u + 2 Let l(t) = -3t*3 - 7t + 4. Let v(u) = -u*3 - u + 1. Suppose 2o + 1 = -5. Let f(d) = d*3 + 4d*2 - 4. Let z be f(o). What is zv(j) - l(j)? -2j3 + 2j + 1 Suppose q = i - 2q - 5, 1 = -2i - 5q. Let v(z) = z3 - 2z - 2. Let m(k) = -k*3 + k + 1. Give im(g) + v(g). -g*3 Let n(v) = 58v2 - 87. Let l(j) = j2 - 1. Determine 87l(m) - n(m). 29m*2 Let a(p) = -p - 3. Let f(g) = -3g + 2 + 6 + g + 5g. Calculate -8a(l) - 3f(l). -l Let j(p) = 8p - 5. Let s(o) = -o + 1. What is j(d) + 3s(d)? 5d - 2 Let f(l) = -4l3 + l - 1. Let d(u) = 3u*3 + 1. Give 3d(t) + 2f(t). t3 + 2t + 1 Let u(o) = 3o2 + 3o + 3. Let k(m) be the first derivative of -4m3/3 - 2m*2 - 4m - 30. Give 2k(z) + 3u(z). z*2 + z + 1 Let m(r) = 15r*2 + 4r - 4. Let n(i) = -14i2 - 3i + 3. What is 3m(z) + 4n(z)? -11z2 Let o(z) = -z2 + 4z - 2. Let l be o(2). Let q(d) = -l - 3d + 3d + 2d. Let y(k) = -3k + 2. What is -5q(x) - 4y(x)? 2x + 2 Let l(a) = a2 - 1. Let n(s) be the second derivative of s5/6 - 4s*3/3 - 3s*2/2 + 2s. Let g(x) be the first derivative of n(x). Give -g(p) + 8l(p). -2p*2 Let c(y) = -234y*2 - 91y - 91. Let g(l) = 13l2 + 5l + 5. Determine 5c(v) + 91g(v). 13v2 Let u(n) = 4n2 + 1. Let p(q) = q2 + 1. Suppose 10 = 4w - 2. Suppose -2h + w = -h. Let a = -3 + 2. Give au(k) + hp(k). -k2 + 2 Let c(l) be the second derivative of -l4/4 - 4l3/3 + 7l*2 + 3l + 24. Let v(o) = 2o2 + 5o - 9. Let f = 13 + -5. Determine fv(y) + 5c(y). y*2 - 2 Let o(l) = l - 1. Let a(j) = -5. Let x(n) = n + 16. Let k(c) = -21a(c) - 6x(c). Determine k(q) + 9o(q). 3q Let v(w) = -3w*3 + 9w2 - w. Let o(d) be the second derivative of d5/4 - 7d4/6 + d3/3 + 27d. What is -5o(l) - 8v(l)? -l*3 - 2l*2 - 2l Let p(j) be the first derivative of -5 + 0j2 + 5j + 1/3j3. Suppose 2b = -6, 0 = 3u + 5b + 16 - 49. Let t(c) = 6c2 + 26. Calculate up(w) - 3t(w). -2w*2 + 2 Let h(r) = 5r*3 - 2r - 2. Suppose -4m = 2a - 24 + 6, 5m = -3a + 25. Let q(i) = 4i3 - 2i - 1. What is mh(t) - 3q(t)? -2t3 + 2t - 1 Let y(r) = 4r2 - 4r - 7. Let j(g) = -3g2 + 4g + 6. Determine -3j(s) - 2y(s). s*2 - 4s - 4 Let g(h) = 6h - 1. Suppose 0 = 3j - 154 + 160. Let l(v) = -v. Give jg(o) - 10l(o). -2o + 2 Let i(g) = 5g + 2. Let b be i(5). Let m = -23 + b. Let c(l) = -l2 + l. Let s(h) be the second derivative of h4/6 - h*3/2 + h. Determine mc(f) + s(f). -2f2 + f Let j(m) = 100m*2 - 8m + 8. Let h(b) = -67b2 + 5b - 5. What is -8h(u) - 5j(u)? 36u2 Let g(f) = -5f*3 - 3f*2 - 2f + 3. Let x be 5/((-3 + -1)/(-4)). Let m(r) = 9r3 + 5r*2 + 3r - 5. Give xg(b) + 3m(b). 2b3 - b Let j(a) = -11a*2 - 13. Suppose 0 = -5s + 3s + 26. Let v(p) be the first derivative of 5p*3/3 + 6p - 1. Give sv(f) + 6j(f). -f*2 Let w(o) = 17o*2 + 13o + 13. Let c(j) = 2j - 1. Let f be c(-6). Let n(h) = 8h*2 + 6h + 6. Determine fn(p) + 6w(p). -2p2 Let m(d) = 3d. Let h(w) be the first derivative of -w*3/6 + 2w - 5. Let j(v) be the first derivative of h(v). Determine -10j(b) - 4m(b). -2b Let v(s) = s - 2. Let x(a) be the third derivative of -a4/24 + a3/6 - 4a*2. Let q(r) = -r - 4. Let b(j) = -q(j) + 5x(j). What is -2b(l) - 9v(l)? -l Let g(i) = 4i - 12 + 20 - i - 11. Let n(u) = u2 - 8u + 6. Let m be n(5). Let f(k) = 7k - 7. Give mg(x) + 4f(x). x - 1 Let v(x) = -7x*3 + 11x*2 - 2x. Let c(q) = -4q3 + 6q*2 - q. Calculate 11c(a) - 6v(a). -2a3 + a Let y(b) = -b2 + b + 1. Let d be 2/(0 - 3/(-9)). Suppose 0 = -2w + dw - 8. Let h(k) = 3k2 - 2k - 3. Determine wh(x) + 4y(x). 2x2 - 2 Let o(l) = -10l - 11l2 + 3l*2 - 2l*2 + 10 - 4l3. Let w(n) = -n3 - 3n2 - 3n + 3. Let p = -15 + 5. What is pw(x) + 3o(x)? -2x3 Let a(o) be the third derivative of -o4/6 - 5o*3/6 + 11o*2. Let x(f) = -4f - 4. Give -4a(y) + 5x(y). -4y Let c = 12 - 13. Let f(i) = 9i. Let u(h) = -h. Calculate cf(s) - 6u(s). -3s Let i(s) = -14s - 14. Let p(g) = -5g - 5. Let z(j) = 6i(j) - 17p(j). Let v(c) = -5c - 5. Let o = -3 - -2. Let w = 0 + -6. What is ov(k) + wz(k)? -k - 1 Let t(y) = 4y + 6. Let i(q) = 4q + 6. Give 2i(f) - 3t(f). -4f - 6 Let v(z) = 29z*3 - 6z*2 + 17z - 17. Let j(l) = 5l3 - l2 + 3l - 3. What is 34j(d) - 6v(d)? -4d3 + 2d*2 Let y(f) = -3f2 + 1. Let i(m) = -m3 - 7m2 + 2. Let d = 4 - 9. What is dy(w) + 2i(w)? -2w3 + w2 - 1 Let j(c) = 5c + 11. Let k(x) = x + 3. Give 2j(d) - 9k(d). d - 5 Let s(b) = -b2 - 4b - 6. Suppose 5u - u - 132 = 0. Suppose -5v + u = 2g, g + 5 = -3v + 24. Let d(q) = -q*2 - 5q - 7. Determine vd(o) - 6s(o). o*2 - o + 1 Let s(w) = 0w*2 + 5w - 4w - 4w*3 - 2w2 + 1. Let y(l) = l3 + l*2. Suppose -18 = 8j - 2. What is jy(v) - s(v)? 2v*3 - v - 1 Let b(y) = -7y*3 - 7y*2 - 7y - 7. Let i(n) = 3n3 + 4n*2 + 4n + 4. Calculate 4b(u) + 7i(u). -7u3 Let b(j) = -6j*3 - 7j + 4. Let m(t) = -t*3 - t + 1. Calculate b(y) - 4m(y). -2y3 - 3y Let z(c) = -1. Let n(f) = -2*f - 2. Let y(p) = -	{ "pile_set_name": "DM Mathematics" }
4p3 - 2p*2 Expand (-1 + 1 - j)(0j2 - 2j*4 + 0j*2) + 16j + 2j5 + 0j*5 - 28j. 4j5 - 12j Expand (-10 + 2 + 1)(2r - 2r - r2)(2r - 2r + r*3). 7r*5 Expand (u - u + u)(3u3 + 0u + 0u + 2u*3 - u + u + (4u*2 - 4u*2 + 2u*2)(3u - 2u - 3u)). u4 Expand (4p - 4p + 2p)(2 + p - 2) - p2 + 4p - 4p - 86 + 3p*2 + 86. 4p2 Expand (m3 + m3 - m3)(1 - 4 - 20). -23m*3 Expand (3g - 5g + 1 - g)(1 + 0 + 0). -3g + 1 Expand (-2n*2 + 4 - 4)(5n3 - 6n*3 + 0n*3) + (-3n3 + n2 - n*2)(-3n2 + 8n2 - n2). -10n5 Expand (-3u + 2u - u)((-3 + 3 - 1)(4 - 1 - 2) + 2 - 2 - 8). 18u Expand (-2d2 - 1 + 1)(-122 + 64 + 62)(2d - 1 + 1). -16d3 Expand (0p - 4p + 2p)(0 + 0 - 2p) + (-3p + 2p - 2p)(-4 - 2p + 4) - 2p*2 + 0p*2 + 0p*2. 8p*2 Expand (-2 + 2 - 2b)(1 - 4 + 0)(0 + 2 - 4)(-4 + 7 + 4). -84b Expand (3w - 9 + 9)(-w + w - 2w). -6w*2 Expand (-3g*2 + 2g*2 + 2g*2)(-110 - 8 + 22). -96g2 Expand -6w2 + w2 - w*2 + (4w + w - 4w)(-2w + 0 + 0) + 0w*2 + 0w2 - w2 - 13 + 13 - 4w2. -13w*2 Expand (-2s*3 + 0s*3 + 4s*3)(-s*2 + 3 - 3) - 2s2 + s5 + 2s2 - s5 - 2s5 - s5 + s2 - s2 - 2s5. -7s*5 Expand (-k + 0 + 0)(k + 2k - 2k) + 6k2 + 0k*2 + 4k*2. 9k*2 Expand (6t*2 + 4t*2 - 4t*2)(-t + 2t + 2t) + 2t3 - 3t*3 + 2t*3. 19t3 Expand (u5 + 2u5 - 5u*5)(-4 - 1 + 4) + 0u4 + u5 + 0u4 + (u - u5 - u)(-3 + 1 + 0) + u - u + 2u5 - u5 + u*5 + 3u*5. 10u*5 Expand (-2o3 - o3 + 4o3)(1 - 1 - 2o) + 0o*4 - 18o4 - o4. -21o4 Expand (2 + z - 2 + 12z + 6z - 3z + 0z + 0z - 2z + 0z + 0z + z + (2 + z - 2)(1 + 0 + 0) - 5z + 3z + z - z - 2 + 2)(-3 - 2 + 4). -14z Expand (-11y2 + 4y*2 + 15y*2)(-y*2 + 0y*2 - 4 + 3y*2) + 0y2 + y4 - y*2 - 3y*4. 14y*4 - 33y*2 Expand ((5 - 3 - 1)(1 - 1 - 2u4) + 2u*3 - 2u*3 - 3u*4)(u + 5u + u). -35u*5 Expand -8b*4 - 4b*3 + 4b*3 + (-2 + 0 + 4)(-4b - 2b*4 + 4b) + b - b - b*4. -13b*4 Expand (2u*2 - 2u2 - u4)(-2 + 0 + 0) + 2u4 - u3 + u*3 - 7u*4 - 2u4 + u4 - 2u2. -4u*4 - 2u*2 Expand ((6 - 2 - 3)(2 + 0 + 0) + 5 - 2 - 2)(-5h + 5h + 4h). 12h Expand (-2 + 68m + 0 - 66m)(0m + 0m - 2m3). -4m*4 + 4m3 Expand m2 + 1 + 0 - 3m2 + (28 - 28 + 42m*2)(-2 + 4 - 3). -44m2 + 1 Expand (-4d - 9d + 0d)(d + d + 0d)(-2 + 2d + 2 + (d - 3d + 3d)(-2 - 2 + 5) + 4d - 6d + 3d - 1 + 3 - 4 - 3d). -26d*3 + 52d*2 Expand (0x*3 - 4x*3 + 0x*3)(-1 - 2x + 5x - x). -8x4 + 4x*3 Expand (1 + 1 - 4)(0d - 31 + 36 + d). -2d - 10 Expand -4g + 6g + 2g2 + 0g*2 + (2g + 0g - 4g)(5g + 3g - 3g). -8g2 + 2g Expand (-2w + 1 - 1)(2w2 + 3w*2 - 6w*2). 2w3 Expand (-u3 - 4u3 + 3u*3)(17u - 26 + 26) + u4 + 0u*2 + 0u*2. -33u*4 Expand ((-4 + 0 + 2)(0 + 0 - 1) + 0 - 6 + 2)(o + o - o). -2o Expand -o*4 + 2o4 + o4 + (3o2 + 0o*2 - 4o*2)(0o2 - 9o2 + o2) + 4o4 + 3o*2 - 3o*2. 14o*4 Expand (1 + 2 + 0 - 6s)(-s3 - 3 + 3). 6s*4 - 3s*3 Expand (0h*4 - 2h*4 + 0h*4)(3 - 3 - 2 + (-1 + 1 - 2)(-1 + 6 - 3) - 1 - 5 + 5). 14h*4 Expand -3f*5 + 3f5 - f5 + (-2f3 - f + f)(f2 - f2 + 2f2) + 3f*2 + 4f*5 - 3f2. -f5 Expand (0 + 0 - 3)(0s*2 + 2s2 - s2) + 0s + s2 + s2 - 2s. -s*2 - 2s Expand (-137 - 14n + 137)(3n - 3n - 3n). 42n*2 Expand (-1 + 1 - x)(-22 + 8 - 6). 20x Expand (1 + 9 - 3)(-1 - 3h2 + 1). -21h*2 Expand (-2 - 2 + 5)(-1 + 0 + 0)(-12 + 1 + 0)(-6p3 + 4p*3 + 5p*3). 33p*3 Expand (7z*3 - 12z*2 + 12z*2)(-4z + z - 2z) - 1 + 1 - z*4. -36z4 Expand t4 - t4 + t4 + 3t4 + 3t*4 - 5t*4 + (-2t + 2t + 3t*3)(0t + 0t + 2t). 8t*4 Expand 2 - j - 2 + (4 + 3 - 4)(j - 5j - 2j). -19j Expand (3 + 4 - 3)(-1 - 1 + 1)(b3 - b3 + b3). -4b*3 Expand (-6f + 3 + 25 + 4f)(-2f3 - 3 + 3). 4f*4 - 56f*3 Expand (-2 + 0 + 0)(2i3 - 3i*3 + 4i*3) - 5i*3 + 0i*3 - 3i*3. -14i*3 Expand (2 - 1 + 0)(-3k2 + 3k2 + k2)(-15k - 20k + 29k + 3k2). 3k*4 - 6k*3 Expand (1 - 1 - 2m)(1 + 4 - 3) + 4m - 2m + 5m. 3m Expand (-1 + 1 - 2y)(-y + 3y - 3y) + (y - y - 2y)(-y - 2y + y) + (y + 0y + y)(-5y + 4y + 0y) + 5y*2 - 10 + 10. 9y*2 Expand (2 + 0 + 0 + (-3 + 3 - 1)(0 + 4 - 3) + 2 - 1 + 1)(2z - 2z - z) - 12z + 5z + 0z. -10z Expand (-1 + 3 - 1)(i - 1 + 1) - 3i + 2i - 2i - i + 2i - 2i. -3i Expand (2j3 + 0j*3 + 0j*3)(5j - 2j - 4j)(2 - 2 - 1). 2j4 Expand (86m - 50m + 75m)(m - m - 2m). -222m2 Expand (-4 + 4b + 10 - 6b)(1 + 0 - 2 + (4 - 3 + 1)(1 + 1 + 0) + 2 - 4 + 3). -8b + 24 Expand (0k + 3k - k)(-16k*2 + 4k*2 + 3k*2) - 2k + 2k + 2k*3. -16k*3 Expand (5k + 21 - 21)(4k - 5k - k3 + 2k3) - k4 - k4 + k4. 4k4 - 5k*2 Expand (-2p + 4p - p + (-3 + 1 + 0)(-4p + p + 4p) + 3 - 3 - p)(-2 - 2p + 2) - 1 + 1 - p*2 + (p - 2p - p)(-p - 3p + 2p). 7p*2 Expand (36 - 23 + 10)(m*4 + 4m*4 - 4m*4). 23m*4 Expand (-z - 3z + 5z + (3 - 3 + 2)(-5z + 4z + 2z) - 3z + 2z + 0z)(-3 + 7 + 2) - z + 2z + z. 14z Expand (-9 - 3 + 3)(-3k + 2 - 2). 27k Expand (-2 + 0 + 3)(3 + r - 2r + 2). -r + 5 Expand -48u2 + 108u - 108u - 2u2 + u2 + 3u2 + (3 - 1 - 3)(-2u2 - 3u*2 + 3u2) + u2 + 2u - 2u - 3u2 - u2 + 6u*2. -41u*2 Expand (0h - h - h*4 + 0h*4)(11h - h + 9h). -19h5 - 19h*2 Expand (4 - 2 - 1)(7f - 5f - 3 + 0f). 2f - 3 Expand (-6z + 3z - 5z)(0 + 0 + 2z) - z - 2z + 4z - 6z*2 + 2z*2 + 0 + 0 + (6z - 3z - 2z)(4z - 4z + 2z) + 3z2 - z2 - 4z*2. -20z*2 + z Expand (-1 - 3 + 3)(-y*3 + 5y*3 - 2y*3) + y + y - 3y - 2y3. -4y*3 - y Expand (838 + 44h*2 - 838)(0h + 2h - 3h). -44h3 Expand -4 + 4 + b2 + 0 + 0 + 2b2 + (3b + b - b)(0 - 2b + 0). -3b2 Expand (p2 + 2p2 - p2)(2p*2 + 0 + 0). 4p4 Expand h3 - 2h3 + 2h*3 + (2h*3 + 3h*3 - 2h*3)(0 + 0 - 2). -5h3 Expand -2d*4 - 4d*5 + 2d*4 + (3d + 3 - 3)(d4 - 3d*2 + 3d2) + (-d3 + 2d - 2d)(-3d + 3d - d2) - 2d5 + d5 + 3d5. 2d*5 Expand (3 - 5 + 3)(-d*5 - 3d*2 + 3d2) - d5 - d*5 + 5d5 + d5 - d*5 - 3d5. -d5 Expand (-2o - 1 + 1)((-2 + 2 - 2o)(3 - 6 + 0) - o + 4o - 2o). -14o2 Expand -p4 - 5p*4 + 4p4 + (-p2 - 5p2 + 5p*2)(-2p2 + p2 + 2p*2) - 12p*4 - 10p*4 + 19p*4 + (3p - p - p)(-p + p - p3). -7p*4 Expand (62x - 64x + 0 + 8)(0x2 + 2x2 + x2). -6x3 + 24x*2 Expand (-18t + 3t - 12t)(-t + 3t + 0t)(1 + t*2 - 1). -54t*4 Expand 0t5 + t5 + 0t5 + (0t*3 + 2t*3 + 0t*3)(t*2 - 1 + 1) + (4t + t*4 - 4t)(-3 - t + 3) - t5 - 3t*5 + 8t*5 + 0t*5 - 3t5 + t5. 4t5 Expand 3 - 14 + 12 - 12x*2 - 2x*5 + (2x2 - x2 - 2x2)(x*3 - 4x*2 + 4x*2) - 5x5 - x5 + 5x5. -4x*5 - 12x*2 + 1 Expand 4q*3 - 20 + 20 + (5q - 2q - q)(2q2 + 2q*2 - 3q*2) + (-2q*2 + 0 + 0)(2q - q + q). 2q*3 Expand (0f + 2f + 0f)(3f*4 + f - f) + (-5f*5 + 3f*5 + 3f*5)(4 - 4 + 1). 7f5 Expand (7k + 5k - 2k)(2k + 0 + 0) + 0k2 + 3k2 - k2. 22k2 Expand (2s - 4s + s)(-2s4 + 3s*4 + 0s*4 + (-s - 2s + 2s)(-2s3 - 5s*2 + 5s*2) - 4s*2 + 4s*2 + 4s*4). -7s5 Expand ((y - y - y3)(-3y - 3y + 7y) + 4y4 + 0y4 - y4 + 1 + y*4 - 1)(5y + 3y - 5y). 9y*5 Expand (-7y3 - y3 + y*3)(-1 + 2 + 2). -21y3 Expand 7m*3 - 7m3 - m5 + (-m5 + m5 - m*5)(-2 + 1 + 0) - m*5 - 2m5 + m5 + 5m5 - 3m*5 - 4m*5. -4m*5 Expand (-3h3 - h3 + h*3)(-4 + 1 + 1) - 5h3 - 5h + 5h. h3 Expand (-4l - 3l + 5l)(4l + l + l). -12l2 Expand g2 + 4g*4 - 2g*2 - 2g4 + (g3 - 2g3 + 0g*3)(9 + 6 + 3 - g). 3g4 - 18g3 - g2 Expand (3 - 3 + 4s2 + (-2s - 1 + 1)(3s - s + s))((5s - 2s - s)(-2 + 1 + 4) - s - 4s + 4s). -10s3 Expand (-23 - 15 + 12)(0w + 0w - 2w). 52w Expand -3l2 + 4l*3 + 3l2 + l3 - 3l*3 +	{ "pile_set_name": "DM Mathematics" }
Let k = -38 + 36. What is the biggest value in 4, k, 0.5? 4 Let i(a) = 1 - 4a + 12 - a + 4a. Let w be i(7). What is the third biggest value in 4/5, 0.2, w? 0.2 Let i = -9.29 - -8.4. Let o = i + -0.01. Let x = o + -0.1. Which is the smallest value? (a) x (b) -2 (c) 0.4 b Let f = -283/6 + 97/2. Which is the second smallest value? (a) f (b) 66 (c) 1/4 a Let n = 4.1 + -9.1. What is the smallest value in -0.4, n, 2/9, 4? n Let x = 2 - 4. Suppose 20 = 4r - 0r. Suppose 0 = -3s + 4i - 21, -rs + i - 5i - 3 = 0. Which is the third smallest value? (a) s (b) x (c) 1 c Let v = 8.5 + -9. What is the second biggest value in 1, 4, v? 1 Let p be 4/((-21)/(0 - 3)). Which is the third biggest value? (a) -6 (b) p (c) 1 a Let v = -59.4 + 59. Let y = -3.7 + -1.3. Which is the biggest value? (a) y (b) v (c) -1 b Let d be (-2)/4 + (0 + -6)/(-6). Let p = 425/9 + -47. What is the second smallest value in -2/13, p, d? p Let i = -0.2 + 0.2. Let h = 38.8 + -39. Let s = i + h. Which is the second smallest value? (a) 0.5 (b) s (c) -3 b Let x = -4 - -3.6. Let i = x - -0.3. Let p = 0.22 - -0.18. Which is the biggest value? (a) i (b) p (c) 2/7 b Let v be (-38)/(-9) + (-16)/72. Let x = 1 + v. Let d be (-2)/3 - (-16)/18. Which is the smallest value? (a) d (b) x (c) -0.2 c Let i = -7 + 6.95. Let w = -1.05 - i. Which is the biggest value? (a) 1/11 (b) 0.4 (c) w b Let q = -17/4 - -19/4. Let l = -124 - -622/5. Which is the second smallest value? (a) q (b) l (c) -3 b Let w = -4 + -2. What is the third smallest value in 0.4, 4, w? 4 Let a = 0.34 + 0.06. What is the smallest value in -1/7, a, -3, 5? -3 Let j = 5 - 3. Let h be ((-1 - -1)/(-3))/1. Which is the second biggest value? (a) j (b) -0.1 (c) h c Let t = 0.25 - 5.25. Which is the second smallest value? (a) 5 (b) 8 (c) t a Let n be (45/(-48) - -1)/((-11)/(-22)). Suppose 4k = 5x + 17, 0k = -5k - 3x + 12. What is the third smallest value in k, -4, n? k Let k = 4.1 - 4.2. Which is the fourth biggest value? (a) k (b) 0.2 (c) 3/2 (d) 4/9 a Let f = 5.341 - -0.059. Let p = 0.4 - f. Let r = 131 - 131. What is the second biggest value in r, -1, p? -1 Suppose 5k - 4v + 6v = 11, k = -3v + 10. Let f be ((-26)/22 + k)-1. Let c be (-1)/26/8. What is the third biggest value in f, c, -1/4? c Let f = 7 - 8. Let q = -65 + 199/3. Which is the third smallest value? (a) 2 (b) q (c) f a Suppose -5t = -3n - 14, 10t + 4n - 28 = 5t. Let z = 5186109/91 - 56989. Let o = -12/13 + z. Which is the second smallest value? (a) -2/9 (b) t (c) o c Let g = 33 + -30. Which is the third smallest value? (a) -4 (b) 4/3 (c) g c Let i(g) = -g - 12. Let h be i(-8). Let s = h - -8. Suppose 2o - s - 4 = 0. What is the third smallest value in o, 0.4, -4? o Let g be (-3)/(2 + 17/(-4)). Let d be 12(1 - -1)/(-2). Let o = -59/5 - d. What is the third smallest value in o, 2, g? 2 Let d = 2 + -3. Let v = 7.9 + d. Let l = 7 - v. Which is the second biggest value? (a) -2/9 (b) l (c) 0.3 b Let k = -1 - 3. Let s = -8 + 7. Let l be 9/(-3)s/7. What is the second smallest value in l, 2/7, k? 2/7 Let k(r) = -r2 + 7r - 2. Let p be k(6). Suppose 0f - g = 3f, 0 = -pf + 5g. What is the second biggest value in f, 0.3, 1? 0.3 Let c = 65 + -69. What is the smallest value in 0.2, c, 5, -0.1? c Let k = -0.43 - 16.57. What is the biggest value in -2/5, 5, k? 5 Let w = -10.5 - -11. What is the biggest value in w, -2/15, 1? 1 Let v = 1.75 + -0.75. What is the third biggest value in 0.1, v, 2/5? 0.1 Let r be ((-2)/2)/(14/8). Let g = 43.5 + -44. Which is the second smallest value? (a) 5 (b) r (c) g c Let r(f) = 4f2 + 35f - 11. Let s be r(-9). Which is the second smallest value? (a) -5/6 (b) s (c) 1 (d) 6/11 a Let r(i) = i + 2. Let k be r(-6). Let u = -1 - k. Suppose -3g - 1 = 2l + u, -3l - 6 = -g. Which is the smallest value? (a) 5 (b) g (c) -1/3 c Let z be (-1)/20 - -5. Let s = 36 - 26. Let q = -9.6 + s. What is the third biggest value in -5, q, z? -5 Let k = -7 - -2. Let u = 4.9 + k. Let i = 727/7 - 104. Which is the third smallest value? (a) i (b) 1/4 (c) u b Let x(j) be the second derivative of -j5/20 + j4/12 + 5j3/6 - j2 - 4j. Let k be x(3). What is the third smallest value in 2, -0.1, k? 2 Let w(k) be the first derivative of -k4/4 - k3/3 - k*2/2 + 2. Let g be w(0). What is the second biggest value in g, -2, -0.2? -0.2 Let m = 0.16 - 0.06. Which is the third smallest value? (a) 4 (b) 5 (c) m b Let s = 0.75 + 1.25. What is the smallest value in 1, s, 8, 0? 0 Let y = -0.5 + 1.5. Let t = y - 1.4. Which is the smallest value? (a) 1 (b) -0.5 (c) t b Suppose 5o - o = -668. Let r = -1501/9 - o. Which is the third biggest value? (a) r (b) -1/4 (c) -3 c Let p = -109/207 - -7/23. Let m = -11 + 0. Let r = m + 21/2. Which is the third smallest value? (a) -3/5 (b) r (c) p c Let n = 0.45 + -1.45. Let f be 14/216/1. What is the third smallest value in n, -1/7, f? f Let k = -0.68 + 3.68. What is the second biggest value in k, 1, 0.2? 1 Let l = -1.1 - -1.6. Which is the fourth biggest value? (a) -2 (b) 4 (c) l (d) 5 a Let m = 0.2 + -0.4. Let j = m + 0.3. Let r be (-1)/(-3)(1 + -4). What is the biggest value in r, 1/5, j? 1/5 Let d = 1/4 + 1/4. What is the biggest value in -4, d, -2, -1? d Let d = -1039/596 - 1/149. Which is the third smallest value? (a) -0.3 (b) d (c) 1/5 c Let r(p) = 2p2 - 5p - 3. Let o be r(4). Let x be ((-1)/(-3))/(1/o). Let k be (-2 - 2/(-2)) + x. What is the third smallest value in k, 1, -2/5? k Let w = -23 + 19. What is the third biggest value in -8, w, -2? -8 Let j = 0.9 + -0.6. Let d = 45.9 + -42. Let k = -4 + d. What is the third smallest value in k, j, -0.2? j Let v = -2.1 + 0.1. What is the biggest value in v, 0, -0.02? 0 Let y = -0.1 + 1.1. Which is the smallest value? (a) -1/7 (b) 0 (c) y a Let j = 6 + -6.4. Let l be 5 + -21 + 1. Suppose 3h = lh. What is the second smallest value in j, h, 3? h Suppose 0q + 2q - 4 = 0. Suppose -21 = 4w + 5g, 2w - qg = -5g - 13. Let u = 299.6 + -300. Which is the second smallest value? (a) u (b) w (c) -3 a Let o = 0.21 - -11.79. Let l = -12.3 + o. Which is the second smallest value? (a) 2 (b) 4 (c) l a Let a = -116.8 + 118. What is the second biggest value in a, -2, 4? a Let w = 0.2 + -0.1. Let x = 34 + -29. Which is the third biggest value? (a) w (b) -3 (c) x b Let k be 2/(-5) + (-5658)/(-8520). Let j = 1/71 - k. Let s = -9 + 4. Which is the second biggest value? (a) s (b) 0.03 (c) j c Let z(w) = w*3 - 5w*2 + w - 6. Let q be z(5). Let l = 6 + -8. Let t be 1/(-5) + 11/5. Which is the third biggest value? (a) t (b) l (c) q b Let g = -10.6 + 14. Let l = 3 - g. Which is the biggest value? (a) 2 (b) 3 (c) l b Let h be (-12)/(-30)15. Let s = h - 5. What is the second biggest value in s, 1/8, 3? 1/8 Let p be (12/(-50))/(3/10). Which is the biggest value? (a) p (b) 3 (c) 5 c Suppose y - 9 = 4m + 6y, 31 = 4m - 3y. Which is the fourth smallest value? (a) -9 (b) -0.5 (c) -2/19 (d) m d Suppose -12 - 3 = 3j. Suppose -r - 10 = 4r. Which is the biggest value? (a) j (b) 3 (c) r b Let u be (10/8 - 1)/(1/2). Let g = -2.03 + 0.03. Which is the second smallest value? (a) -3/2 (b) u (c) g a Let g = 0.1 + -0.1. Let f be 1/1(-2 - -1). Let u = 67 + -66.7. What is the second smallest value in f, g, u? g Let y = 148/3 - 50. Which is the biggest value? (a) y (b) 0.4 (c) 0.1 b Let h = -67 - -62. Let l be (12/110)/3-5. What is the biggest value in -1, l, h? l Let o be -1 + (18/10 - (-1)/5). Which is the smallest value? (a) 3/8 (b) o (c) -0.4 (d) 0.3 c Let l = -5.2 + 1.2. What is the second smallest value in -0.4, l, 0? -0.4 Let h(l) = -2l*2 + 2l + 7. Let z be h(3). Which is the smallest value? (a) -1/3 (b) z (c) 3 b Let t = 2 - 2. Let v = -2.01 - -0.01. What is the third biggest value in v, t, 4? v Let j be 7/30 - 2/5. Let d = 421 - 416. Which is the second biggest value? (a) d (b) j (c) -2/3 b Let k = 0.27 - 0.17. Which is the third smallest value? (a) -3/8 (b) k (c) 0.04 b Let f = 5.8 - 0.8. Let v be -2*(-12)/14 - 2. Which is the third biggest value? (a) v (b) f (c) -1/5 a Let q = -62 - -184/3. Which is the third biggest value? (a) q (b) 0.02 (c) 5	{ "pile_set_name": "DM Mathematics" }
0))/sqrt(11))/((sqrt(144)/sqrt(3))/sqrt(12)). sqrt(5) Simplify (-3sqrt(48))/sqrt(4). -6sqrt(3) Simplify (sqrt(2299) - -1(sqrt(2299) + 2 + sqrt(2299)))2. 132sqrt(19) + 20695 Simplify -6((sqrt(91)-1)/sqrt(7))*2 - (-4 + (sqrt(156) + sqrt(156) + -2sqrt(156) + sqrt(156))/sqrt(12)). -74 - sqrt(13) Simplify (sqrt(21)/(sqrt(12)/(sqrt(28)/sqrt(7) + sqrt(4))))*2 + -1. 27 Simplify (5sqrt(63)/sqrt(3) - sqrt(21))/(sqrt(147)2). 2sqrt(7)/7 Simplify (3((sqrt(1053) - (3 + 0 + sqrt(1053))) + -3))2. 324 Simplify (sqrt(66)/(-2sqrt(726)))*2-1. -1/44 Simplify (sqrt(63)41 - sqrt(63)) + -5. -5 + 9sqrt(7) Simplify 4(sqrt(684))*2 - -3(sqrt(19) - sqrt(190)/sqrt(10)). 2736 Simplify (sqrt(45) - sqrt(2880)2)/(sqrt(63)/(2sqrt(7))). -30sqrt(5) Simplify (-6(5 + sqrt(3))-5)2. 9000sqrt(3) + 25200 Simplify ((sqrt(1053)2 - sqrt(1053))-1)*2. 1053 Simplify ((sqrt(36)1-6)/(sqrt(12) + sqrt(768)/sqrt(4) + sqrt(12)))2. 3 Simplify (sqrt(117) - ((4 + sqrt(117))-3 - sqrt(117)))*2 + 5. 360sqrt(13) + 3074 Simplify -6(1 + -4sqrt(1584)). -6 + 288sqrt(11) Simplify sqrt(637) + 1 + -4 + (2 + 0 + sqrt(637) - sqrt(637)). -1 + 7sqrt(13) Simplify (sqrt(2) - (sqrt(14) - sqrt(224))/sqrt(7)) + -3 + sqrt(18). -3 + 7sqrt(2) Simplify (sqrt(33) + sqrt(33) + (sqrt(2673)2 - sqrt(2673) - sqrt(2673)))/sqrt(11). 2sqrt(3) Simplify 3 + (sqrt(68)/sqrt(2))/sqrt(2). 3 + sqrt(17) Simplify -4(sqrt(637)-1)2-2. 5096 Simplify ((sqrt(85) - (sqrt(85) + -1sqrt(85) + sqrt(85))) + sqrt(85))/sqrt(5) - (sqrt(17) + (sqrt(51)/sqrt(3))2 + -2). -15 Simplify sqrt(15)/(sqrt(18)/sqrt(6)) - ((sqrt(5) - sqrt(320)) + -4). 4 + 8sqrt(5) Simplify (-6sqrt(84)/(sqrt(12) - sqrt(12)-4) + 2)*2. -24sqrt(7)/5 + 352/25 Simplify (sqrt(51)-14 - sqrt(51))/(sqrt(9)/(-2sqrt(3))). 10sqrt(17) Simplify -3 + 2 + (sqrt(243) + 1 - sqrt(243)) + (sqrt(243) - (sqrt(243) - (-1 + sqrt(243))4)) + sqrt(243). -4 + 45sqrt(3) Simplify 3 + (-6(sqrt(19) + 4) - sqrt(19)) + -4. -7sqrt(19) - 25 Simplify sqrt(40)/(sqrt(8) - sqrt(8)-2) + (sqrt(5) - (-1sqrt(405))*2). -405 + 4sqrt(5)/3 Simplify sqrt(16)/(2sqrt(72)) + ((sqrt(2) - (sqrt(2) + 1)2) + (sqrt(2) - (-3 + sqrt(32))))*2. -47sqrt(2)/6 + 33 Simplify sqrt(1568) + (sqrt(1568) - (0 + sqrt(1568))*2) + 1 + 4. -1563 + 56sqrt(2) Simplify (sqrt(24) + sqrt(24) + sqrt(24) + sqrt(24) + (sqrt(216) - sqrt(24)) + sqrt(24))/sqrt(8) + 4. 4 + 7sqrt(3) Simplify (-1sqrt(720) + 5)*2 - (-1 + 1sqrt(5) + -4). -121sqrt(5) + 750 Simplify ((sqrt(1377) - sqrt(1377)-1-1)-4)*2. 0 Simplify 3sqrt(77)/(sqrt(7) - sqrt(112))3. -3sqrt(11) Simplify (-5sqrt(175)/sqrt(5))/(1sqrt(7)-1). 5sqrt(5) Simplify sqrt(88)/sqrt(8) + -1 + 1sqrt(11)3. -1 + 4sqrt(11) Simplify 3-2sqrt(112)-5. 120sqrt(7) Simplify (sqrt(891)2 + 4 - sqrt(891))*2. 72sqrt(11) + 907 Simplify 1((sqrt(76) - (sqrt(76) + -2sqrt(76)1) - sqrt(76))/(1sqrt(4)-3 + sqrt(4)))2. 19/4 Simplify (sqrt(180) + 1 - sqrt(180)) + 4 + (-2sqrt(180)1)2. 725 Simplify (sqrt(2) + 2 + -5)4. -12 + 4sqrt(2) Simplify (5 + -1sqrt(153) + -2 + 3)*2. -36sqrt(17) + 189 Simplify (5(sqrt(20) - sqrt(180)))/(-1sqrt(64)). 5sqrt(5)/2 Simplify ((1sqrt(114)-3 - sqrt(114))/((sqrt(90)/sqrt(3))/sqrt(5)))2. 304 Simplify (sqrt(192)3)*22 + sqrt(192). 8sqrt(3) + 3456 Simplify sqrt(34)/(sqrt(2) - sqrt(2)-1)6. 3sqrt(17) Simplify (sqrt(1225)-2)/(sqrt(20)/(sqrt(16)/sqrt(4) + sqrt(4))) + 3. -28sqrt(5) + 3 Simplify sqrt(50)/(1sqrt(250)). sqrt(5)/5 Simplify sqrt(11) + 1 + 0 + sqrt(33)/sqrt(3) + 4. 5 + 2sqrt(11) Simplify sqrt(209)/(sqrt(891)-1). -sqrt(19)/9 Simplify ((2 + sqrt(21)/sqrt(3))2 + sqrt(7) - sqrt(7) - sqrt(7)) + (sqrt(7) - sqrt(42)/(sqrt(18)/sqrt(3))). 3sqrt(7) + 11 Simplify ((sqrt(170) - (sqrt(170) - (5(sqrt(170) + sqrt(170) + (sqrt(170) - (sqrt(170) - sqrt(170)-1))) - sqrt(170))))/((sqrt(70)-3)/sqrt(7) + sqrt(10)))2. 68 Simplify (2 + ((1 + sqrt(200))4)*2)-6. -19308 - 1920sqrt(2) Simplify (-1sqrt(500)4-6)*2. 288000 Simplify ((4sqrt(38)/sqrt(2) + 1sqrt(1216))-4)2. 43776 Simplify (sqrt(200) + sqrt(200) + (sqrt(200) - (0 + sqrt(200) + -3)) + sqrt(200))2. 180sqrt(2) + 1809 Simplify (2sqrt(99)2)2-45. -31680 Simplify (sqrt(18)/(sqrt(24)/sqrt(4)))2 - sqrt(147)1. -7sqrt(3) + 3 Simplify ((sqrt(100)/sqrt(5))/sqrt(2))/((sqrt(12)/sqrt(2))/sqrt(3)). sqrt(5) Simplify (-1sqrt(1573) + (sqrt(26)/sqrt(2))*25)6. -66sqrt(13) + 390 Simplify sqrt(144)/((sqrt(3) - (-1sqrt(3) - sqrt(3))) + sqrt(3)). sqrt(3) Simplify 3(0 + sqrt(153))*2. 459 Simplify (sqrt(272) + -2sqrt(272)2 + 2 + (sqrt(272) - (sqrt(272) + 1 - sqrt(272))))2. -16sqrt(17) + 1089 Simplify sqrt(11) - 1sqrt(11)-1 - sqrt(11) - -6sqrt(11)2. 13sqrt(11) Simplify 21sqrt(208). 8sqrt(13) Simplify 6((2sqrt(300))*23 + -2). 21588 Simplify 6-2sqrt(320)5. -480sqrt(5) Simplify -5 + -1 + (2sqrt(28))/sqrt(4) + sqrt(7). -6 + 3sqrt(7) Simplify (sqrt(20)/sqrt(4) - sqrt(5))-6 + -4. -4 Simplify ((sqrt(78) + (sqrt(78)1 - sqrt(78)) + sqrt(78) - sqrt(78))/sqrt(6) + 4)*2. 8sqrt(13) + 29 Simplify (6(sqrt(63) + 1 - sqrt(7)))2. 144sqrt(7) + 1044 Simplify (-6(sqrt(88) + 1sqrt(88)))/sqrt(8). -12sqrt(11) Simplify -2sqrt(13)61. -12sqrt(13) Simplify (-2(-1sqrt(133) + sqrt(133)))/sqrt(7). 0 Simplify (3sqrt(245)-1 - sqrt(245)) + 4. -28sqrt(5) + 4 Simplify 3 + (sqrt(60)/sqrt(6))/sqrt(5). sqrt(2) + 3 Simplify (sqrt(13) + 5 + -4)5. 5 + 5sqrt(13) Simplify (2sqrt(143)1)/(sqrt(2695)/sqrt(5)). 2sqrt(13)/7 Simplify sqrt(360)/sqrt(2) - sqrt(5) - -6(sqrt(500) + sqrt(5)). 71sqrt(5) Simplify 0 + 5(sqrt(468) + sqrt(52))/sqrt(4). 20sqrt(13) Simplify (sqrt(162) + -1)2 + 6(sqrt(18) + sqrt(2)). 6sqrt(2) + 163 Simplify sqrt(12)/sqrt(150) + 2(sqrt(2)-3 + sqrt(2)). -19sqrt(2)/5 Simplify -6sqrt(576)/sqrt(12)6. -144sqrt(3) Simplify ((sqrt(99) - 2sqrt(99))/sqrt(9))2 - (1 + sqrt(1331) - sqrt(11))2. -1090 - 20sqrt(11) Simplify (sqrt(50) + sqrt(150)/(sqrt(3)-2))*2-1. -25/2 Simplify 6(2sqrt(153) + -3). -18 + 36sqrt(17) Simplify (2(sqrt(45) + sqrt(45)-3))/((-2sqrt(54))/sqrt(6)). 2sqrt(5) Simplify (sqrt(76) - (sqrt(76) - -1sqrt(76)-1))2. 76 Simplify -3(sqrt(121)-3)/sqrt(11). 9sqrt(11) Simplify 0 + 1sqrt(5) - ((sqrt(45)1)/sqrt(9) + sqrt(5) + sqrt(5))*2. -45 + sqrt(5) Simplify ((sqrt(143) - -2sqrt(143) - sqrt(143))1)/sqrt(11). 2sqrt(13) Simplify -3(sqrt(2057) + (sqrt(2057) - (-3 + sqrt(2057))6))*2. -99708 + 4752sqrt(17) Simplify (sqrt(78) + (sqrt(78) + sqrt(78)2)-6)/sqrt(6). -17sqrt(13) Simplify sqrt(153)/(sqrt(63)/(sqrt(35)/sqrt(5))). sqrt(17) Simplify sqrt(110)/(-1sqrt(160))-1. sqrt(11)/4 Simplify sqrt(95)/(-4((sqrt(20) - sqrt(5)) + sqrt(5)) - sqrt(5))4. -4sqrt(19)/9 Simplify (sqrt(28)/sqrt(4)1)2-5 + 4. -31 Simplify sqrt(14)/(sqrt(98)3). sqrt(7)/21 Simplify sqrt(121)/(sqrt(33)/sqrt(12)). 2sqrt(11) Simplify 1sqrt(17)-3 - (sqrt(17) + (sqrt(17) - sqrt(85)/(sqrt(5)1))). -4sqrt(17) Simplify 2 + sqrt(44)/(sqrt(12)/sqrt(3)). 2 + sqrt(11) Simplify sqrt(30)/(sqrt(30)/(sqrt(9)/sqrt(3))) + 5. sqrt(3) + 5 Simplify -6(sqrt(55)/sqrt(5))2 + (sqrt(44) + sqrt(2156) + sqrt(44))2. 3498 Simplify 5(-3 + (1 + sqrt(432))3). 180sqrt(3) Simplify -3(sqrt(13)-2 + -4). 12 + 6sqrt(13) Simplify ((1sqrt(513))/sqrt(9))/(4sqrt(6)/sqrt(2)). sqrt(19)/4 Simplify -3(sqrt(171) + sqrt(171)-2 + sqrt(171) + sqrt(171))/sqrt(9). -3sqrt(19) Simplify ((2sqrt(56))/sqrt(8) - sqrt(35)/(-2sqrt(5) + sqrt(5)))-6. -18sqrt(7) Simplify sqrt(21)/(sqrt(252) - sqrt(252)-4). sqrt(3)/30 Simplify ((sqrt(2736) + -2)2 + 1)6. -288sqrt(19) + 16446 Simplify (sqrt(38)/(sqrt(4)/sqrt(2)) + (sqrt(19) - (sqrt(133)/(sqrt(28)/sqrt(4)) - sqrt(19))))2 + -1. 75 Simplify (-2sqrt(500) - (((-3sqrt(245))2 - sqrt(245)) + sqrt(245))) + 1. -2204 - 20sqrt(5) Simplify (2sqrt(136)-5)/(1sqrt(32)). -5sqrt(17) Simplify sqrt(17) + -1 + 5 - sqrt(187)/(-1sqrt(11)). 4 + 2sqrt(17) Simplify (1 + (sqrt(204)/sqrt(192) - sqrt(17)))*2. -3sqrt(17)/2 + 169/16 Simplify (-6(sqrt(102) + sqrt(102)2))/(sqrt(72)/(sqrt(12) - (sqrt(12) - sqrt(24)/sqrt(2)))). -18sqrt(17) Simplify -5 + sqrt(125) + (sqrt(125)-2)*2 + 4. 5sqrt(5) + 499 Simplify -5 + (-5(sqrt(19) - (-1 + sqrt(19))) + -1)2. 31 Simplify sqrt(18)1 + 0 + sqrt(72). 9*sqr	{ "pile_set_name": "DM Mathematics" }
- 0n. Put l, j, 0.09 in descending order. l, j, 0.09 Let y = 135 - 1077/8. Let g be (-36)/(-16) + (-570)/360. Put g, y, -1/4 in descending order. g, y, -1/4 Let g = -1677 + 1677.06. Sort 0.2, 6, g in decreasing order. 6, 0.2, g Let q(m) = -160m*2 - 4 + 74m*2 + 80m2 - m3 - 6m. Let a(n) = -n3 - 4n*2 + 5n - 5. Let x be a(-5). Let l be q(x). Sort 2, -4, l. -4, l, 2 Let p be (2/(-20) - 1)(-130)/1430. Put p, 4/11, -0.074 in descending order. 4/11, p, -0.074 Let m = -0.0057 + -0.1943. Put 2/5, m, -0.09 in decreasing order. 2/5, -0.09, m Suppose -17g - 6 = -19g. Suppose 2m - 20 = -4n, 0m - gm + 9 = -n. Put -3, -4, m in decreasing order. m, -3, -4 Let y be (-46)/69 - (-30)/(-9). Sort -1, -4/7, y in decreasing order. -4/7, -1, y Suppose -12y = -8y. Sort y, 12, 3 in descending order. 12, 3, y Suppose -5r + 67 - 22 = 0. Suppose 10 + 8 = ri. Put i, -3, 4 in decreasing order. 4, i, -3 Let m = -31 + 28. Sort 2, 2/7, m, 5. m, 2/7, 2, 5 Suppose 4g + 5z + 9 = 0, -g + z = 4g + 4. Sort -3, 29, g in decreasing order. 29, g, -3 Let n be (-1)/14 + 30/208. Let d = 6 - 4. Sort 5, d, 1, n. 1, d, 5, n Let c = 1365 - 1364.5. Sort 13, c, 1/3, 1/4 in descending order. 13, c, 1/3, 1/4 Suppose -4w = -3z + 7z, -z + 5w = -30. Suppose -3y + 2u + z = 0, -2y + 5u = 2y + 5. Put 3, -3, y in decreasing order. y, 3, -3 Suppose 0 = -4j - 2w - 2w, 0 = 4w + 12. Suppose 2m + 6 = 2. Put m, -8, -5, j in decreasing order. j, m, -5, -8 Let x = -2 - 0. Let f be ((-8)/x)/(50/(-1440)). Let b = 116 + f. Sort -0.3, -2/9, b in ascending order. -0.3, -2/9, b Let l(o) = -o + 0o2 + 5o*2 + 4 + 0o2 + 3. Let s(b) = -b2 - 2. Let u(d) = -2l(d) - 9s(d). Let v be u(-2). Sort -1, 0, v in decreasing order. 0, -1, v Let b = 46 - -11. Let q = -59 + b. Sort q, 1/2, -4, 2/3. -4, q, 1/2, 2/3 Suppose -4p + 10 = -2p. Suppose -5 - 5 = pa. Sort a, 14, 5 in decreasing order. 14, 5, a Let l = 13.4 + -13. Let c = -6 - -10. Let k = 18 + -17. Sort l, c, k in increasing order. l, k, c Suppose -15c = 3c - 18. Sort 4, -2, c, 3 in descending order. 4, 3, c, -2 Let t = 2 - 1. Suppose 0 = 2p + 10, 11x + 4p + 125 = 6x. Let z = x - -26. Put -3, z, t in decreasing order. z, t, -3 Suppose -14u + 16 = -6u. Put u, 5, 26 in increasing order. u, 5, 26 Suppose -7k + 9k + 4t - 12 = 0, -3t - 5 = -2k. Sort k, -2, -6 in descending order. k, -2, -6 Let q be 5/1 - 0/(-1). Let k = -28.49 + 31.4. Let r = 0.09 + k. Sort 0, q, r. 0, r, q Let x be (12/(-16))/(3/(-12)). Let g = 2 + -6. Let n = -0.0524 - -0.1524. Sort g, x, n in descending order. x, n, g Suppose -4h = 4, 2q - 6h - 37 = -h. Sort 1, 3, q in descending order. q, 3, 1 Suppose 3v - 19 = -5a, 3v - 2a + 16 = -0a. Let c = 888 + -886. Sort 5, v, c, 0 in ascending order. v, 0, c, 5 Let c = 18.4 + 3.6. Let r = -21 + c. Sort r, 0.07, 2/3 in descending order. r, 2/3, 0.07 Suppose 5c + 3m = 16, -3c - 10m = -5m. Let s(j) = 2j - 9. Let w be s(6). Sort c, -7, w in decreasing order. c, w, -7 Let q(y) = -7y + 13. Let d be q(5). Let f = -27 - d. Let t = 1 + -4. Put t, 6, f in decreasing order. 6, t, f Let l be 2/44(-4)/(-96). Let a = 6.7 - 6. Let z = -5.7 + a. Sort 1/8, z, l in descending order. 1/8, l, z Suppose -5a - 264 - 86 = 0. Let g = a - -60. Sort -1, g, -2, 2 in descending order. 2, -1, -2, g Let v = -5 + 1. Let b = -782.9 + 783. Sort v, b, 37. v, b, 37 Let u = -395 + 391. Put -5, u, -1/68 in decreasing order. -1/68, u, -5 Suppose 0 = -4w + 20. Suppose 9x - 8x = 4. Put -3, x, w in descending order. w, x, -3 Suppose -4c + 4 - 30 = -q, -3q + 2c + 38 = 0. Suppose 14z - qz + 8 = 0. Let s(i) = -i*2 - 2i - 2. Let g be s(z). Put g, 2, 0 in increasing order. g, 0, 2 Let d = 2.58 - -1.42. Sort 4/3, -1/11, d, 0.07 in descending order. d, 4/3, 0.07, -1/11 Let z = 5.92 - 6. Let y = -2.92 + z. Let q = -21.2 - -20.7. Sort 4, q, y in decreasing order. 4, q, y Let n = 1.8 - -0.2. Let r = 5504 - 5504.4. Sort r, -1/6, 0.1, n in increasing order. r, -1/6, 0.1, n Let l = -14 + 66. Let s be 4/14 - l/(-14). Suppose -8 = -12m + 16m. Sort m, s, 2 in ascending order. m, 2, s Let b = -6.5 - -19.1. Let x = 3 + 10. Let p = b - x. Sort 0.1, p, 3. p, 0.1, 3 Let m be (-5880)/1029 + (-10)/(-14). Sort -14, m, 1 in decreasing order. 1, m, -14 Let q(v) = v - 2. Let a be q(3). Let w be -1(2/6)/a. Put -0.26, w, 0, 5 in ascending order. w, -0.26, 0, 5 Let b = -30 + 43. Suppose 0 = -bq + 14q. Sort 4, q, 5. q, 4, 5 Suppose -2b - 9 = -t, 18 = 4t - 5b - 9. Sort 31, 5, t, 2 in ascending order. 2, t, 5, 31 Suppose 5n = 4x - 63, -47n = -46n + 3x + 5. Put -16, n, 4, -3 in decreasing order. 4, -3, n, -16 Suppose 5u - 8u - 3 = 3q, 5u - 3q - 3 = 0. Sort -4, 28, u. -4, u, 28 Let p = -856343 + 281737063/329. Let w = p - 4/47. Put w, 2/13, -2/17 in descending order. w, 2/13, -2/17 Suppose -4x = -x + 18. Let h(j) = j3 + 8j*2 - 10j - 7. Let f be h(-9). Sort f, x, -4. x, -4, f Suppose 3 = -4r + r. Suppose 7w + 186 = 10w. Let z = -62 + w. Sort z, 5, r. r, z, 5 Suppose 0 = -j - 2j + 3l + 12, 13 = 2j - 3l. Let i(o) = -2o - 5. Let c be i(j). Put c, -8, -5, 4 in descending order. 4, c, -5, -8 Let s = 8.6 + -8. Let r = s + -0.2. Let h = -0.579 + 0.779. Put r, h, -0.6 in decreasing order. r, h, -0.6 Suppose 5w + 18 = 3, -2c = -3w - 17. Sort c, 2, 3 in descending order. c, 3, 2 Suppose -3t + 15 = -0t. Suppose 20w = -4w + 7w. Put t, w, -5 in decreasing order. t, w, -5 Suppose -143 = -18x + 7x. Suppose -6 - 3 = 3t. Sort t, x, 1 in increasing order. t, 1, x Let q = 133 + -132.5. Sort q, -3, -20 in descending order. q, -3, -20 Let u be (-63)/189 - (-2)/((-14)/(-3)). Put 5, -3, 0.5, u in decreasing order. 5, 0.5, u, -3 Let l = -32.8 + 32.3. Sort 0, 3, 1/2, l in descending order. 3, 1/2, 0, l Suppose -4 = -2d + 3f, -2f + 0 - 6 = -2d. Let r be (-189)/(-42)(-6)/(-9). Put -2, r, d in descending order. d, r, -2 Let a = 282 - 281.35. Put a, -2/25, 0 in increasing order. -2/25, 0, a Suppose -21r - 248 + 311 = 0. Let x = 1 + -1. Sort 2, 5, x, r in descending order. 5, r, 2, x Let r = 0.1 + -0.2. Let i = 1.4 - 1.7. Sort r, -0.2, -0.4, i in decreasing order. r, -0.2, i, -0.4 Let z = 978 - 982. Sort z, -0.081, -1/4 in ascending order. z, -1/4, -0.081 Let m(s) = 2s*2 + 4s*2 - 7s - 1 - 2s3 + 3s*3. Let o be m(-7). Suppose 0 = -5d + 3p - 9, 6 + 7 = -5d + p. Sort d, o, -5. -5, d, o Let l = 38.6 + -38.4. Let r be (-1)/5 + 4/(-30). Sort l, -2/13, r in increasing order. r, -2/13, l Suppose -94 - 306 = -20t. Put -3, 0, t in decreasing order. t, 0, -3 Let w be (-2084)/26 + (-8)/(-52). Let t be (2/3)/(w/6744). Let l = t + 56. Sort l, 0.3, 0. l, 0, 0.3 Let l = 0.0583 - 0.1183. Put l, -5, -5/2 in decreasing order. l, -5/2, -5 Let i(j) = 7j3 - j2. Let d be i(-1). Put 1, d, -3, -0.5 in decreasing order. 1, -0.5, -3, d Let b = 19.1 + -23.1. Sort 0.08, 1, b in descending order. 1, 0.08, b Let j(d) = d*2 + 2d + 5. Let t be 16 + -20 - -14. Let y be j(t). Put -1, y, -3 in descending order. y, -1, -3 Let g(u) = -u3 + 57u*2 - 55u - 60. Let v be g(56). Sort -5, v, 1 in descending order. 1, v, -5 Let n = 3.08 - -1.02. Let f = -3.78 + n. Let y = 0.08 + f. Sort y, -6, -5 in increasing order. -6, -5, y Suppose 3i = -i. Suppose i = 2d - 0d - 6. Sort 16, d, 1 in decreasing order. 16, d, 1 Let c be 8 + -4 + (-68)/16. Let r = -3153259/68 + 46374. Let l = 3/68 - r. Sort c, -1, l in descending order. c, -1, l Let s = 352/5 + -351/5. Put -14, s, 0 in ascending order. -14, 0, s Let n = -1.014 + 1.414. Sort -23/3, -0.4, n, -2/3 in increasing order. -23/3, -2/3, -0.4, n Let k be ((-50)/3)/(-2) + (-14)/(-21). Let b(g) = g - 12. Let n be b(k). Suppose -s + 2j + 8 = -3s, 0 = -3j - 12. Sort n, 5, s in descending order. 5, s, n Let u be (-2)/17 - (464/238)/(-2). Let l = -18 + 15.4. Sort l, u, -5 in ascending order. -5, l, u Let o = 371 + -367. Put -3, -7/4, o in descending order. o, -7/4, -3 Let j(q) = -4q2. Suppose -2b + 3b = 1. Let k be j(b). Sort 0, 17, k in ascending order. k, 0, 17 Suppose 5s - 9 = -5c - 34, 0 = -5s + 4c - 16. Let y(g) = -g + 10. Let j be y(5). Suppose 50 = -jf - 5*f. Put 5, f, s in descending order. 5, s, f Let r = 5 - 5.9. Let h = -7139/4 - -1784. Put r, h, -0.1 in descending order. -0.1, h, r L	{ "pile_set_name": "DM Mathematics" }
? 6048 What is the common denominator of 68/65 and -32/35? 455 What is the common denominator of -151/18 and 71/96? 288 What is the lowest common multiple of 2 and 54? 54 Calculate the smallest common multiple of 222 and 6. 222 What is the common denominator of 45/14 and -145/744? 5208 Calculate the smallest common multiple of 36 and 48. 144 Find the common denominator of -17/9 and -37/24. 72 What is the common denominator of -58/909 and -1/36? 3636 Find the common denominator of -25/54 and 2/21. 378 Calculate the least common multiple of 30 and 102. 510 What is the common denominator of 20/49 and -32/5? 245 Calculate the least common multiple of 12 and 1. 12 What is the common denominator of -47/12 and 127/2412? 2412 Calculate the common denominator of -23/8 and -39/13340. 26680 Calculate the smallest common multiple of 11 and 66. 66 Calculate the lowest common multiple of 474 and 4187. 25122 Calculate the common denominator of -109/240 and -103/14. 1680 Calculate the smallest common multiple of 264 and 90. 3960 Calculate the smallest common multiple of 83 and 7. 581 What is the lowest common multiple of 14 and 3672? 25704 Calculate the smallest common multiple of 52 and 1912. 24856 Find the common denominator of 2/3 and -16/603. 603 Calculate the common denominator of 57/6692 and -83/14. 6692 Find the common denominator of 37/152 and 55/6. 456 Calculate the common denominator of 157/126 and -77/6. 126 What is the smallest common multiple of 11 and 410? 4510 What is the lowest common multiple of 150 and 195? 1950 What is the common denominator of -151/204 and 29/18? 612 What is the common denominator of 19/144 and 43/456? 2736 Calculate the smallest common multiple of 22 and 17974. 17974 Calculate the common denominator of -157/1932 and 47/345. 9660 What is the least common multiple of 104 and 130? 520 What is the common denominator of -43/270 and 139/288? 4320 What is the common denominator of -23/84 and 75/224? 672 What is the lowest common multiple of 493 and 116? 1972 Find the common denominator of -119/18 and 13/9. 18 Calculate the common denominator of -1/30 and -157/300. 300 Calculate the least common multiple of 219 and 3. 219 Calculate the common denominator of -169/120 and 93/220. 1320 What is the smallest common multiple of 12 and 8228? 24684 Calculate the smallest common multiple of 175 and 35. 175 What is the least common multiple of 708 and 152? 26904 What is the common denominator of -101/24 and -15/86? 1032 Find the common denominator of -74/9 and -65/801. 801 Find the common denominator of -19/5 and -3/790. 790 What is the common denominator of -53/7 and -149/1764? 1764 Calculate the lowest common multiple of 1 and 11. 11 Find the common denominator of 53/9 and -25/8. 72 Calculate the lowest common multiple of 37 and 74. 74 What is the least common multiple of 165 and 33? 165 Find the common denominator of -29/3376 and 35/422. 3376 What is the common denominator of 61/105 and 5/147? 735 Calculate the common denominator of -71/2892 and -1/1205. 14460 Calculate the lowest common multiple of 12 and 1932. 1932 Calculate the lowest common multiple of 198 and 171. 3762 What is the common denominator of -121/80 and 19/248? 2480 What is the least common multiple of 32 and 60? 480 What is the common denominator of -69/1466 and 69/4? 2932 Calculate the common denominator of -13/2070 and 35/2691. 26910 Find the common denominator of 89/3360 and 25/864. 30240 Calculate the common denominator of 46/2271 and -11/30. 22710 What is the lowest common multiple of 1790 and 1074? 5370 Calculate the least common multiple of 108 and 12. 108 What is the lowest common multiple of 10 and 30? 30 Find the common denominator of -14/1143 and 19/889. 8001 Find the common denominator of -127/1188 and 149/270. 5940 What is the smallest common multiple of 58 and 203? 406 What is the common denominator of 47/50 and 131/110? 550 Find the common denominator of -21/382 and -6/5. 1910 Find the common denominator of -55/1311 and -39/253. 14421 Find the common denominator of -71/14 and -121/5010. 35070 Calculate the common denominator of 119/48 and -133/528. 528 What is the common denominator of -61/2 and 29/6154? 6154 Calculate the least common multiple of 210 and 1. 210 Find the common denominator of 149/30 and 181/90. 90 Calculate the common denominator of 53/1916 and 13/10. 9580 Find the common denominator of 89/112 and -103/6. 336 What is the common denominator of 37/180 and 55/276? 4140 Calculate the smallest common multiple of 238 and 2822. 19754 What is the least common multiple of 16 and 188? 752 What is the smallest common multiple of 13 and 8? 104 Calculate the common denominator of -31/17 and -85/16. 272 Calculate the least common multiple of 18 and 44. 396 Calculate the least common multiple of 4 and 121. 484 What is the common denominator of -7/6325 and 74/1725? 18975 Calculate the lowest common multiple of 7 and 93. 651 What is the lowest common multiple of 12 and 224? 672 What is the lowest common multiple of 9 and 1224? 1224 Calculate the smallest common multiple of 10 and 3073. 30730 What is the common denominator of -17/30 and 32/45? 90 What is the smallest common multiple of 80 and 20? 80 What is the common denominator of 43/62 and -31/10? 310 Find the common denominator of -89/86 and 37/76. 3268 Calculate the least common multiple of 13975 and 3. 41925 Find the common denominator of 71/110 and -31/44. 220 Calculate the least common multiple of 36 and 320. 2880 Find the common denominator of 89/108 and -59/1008. 3024 Calculate the smallest common multiple of 186 and 2. 186 Calculate the common denominator of -157/228 and -52/9. 684 Find the common denominator of 37/219 and -12/5. 1095 Calculate the least common multiple of 148 and 407. 1628 Find the common denominator of -55/28 and -9/4004. 4004 Calculate the smallest common multiple of 120 and 390. 1560 Calculate the smallest common multiple of 165 and 429. 2145 Calculate the lowest common multiple of 20 and 348. 1740 What is the smallest common multiple of 3032 and 22? 33352 Find the common denominator of -99/32 and -13/96. 96 Calculate the smallest common multiple of 5082 and 9. 15246 Calculate the lowest common multiple of 12 and 378. 756 What is the common denominator of -55/1608 and -85/2412? 4824 What is the common denominator of 79/2 and -61/504? 504 Find the common denominator of 59/4 and 17/1552. 1552 Calculate the lowest common multiple of 2 and 200. 200 What is the lowest common multiple of 238 and 56? 952 Find the common denominator of -43/112 and 59/432. 3024 Calculate the least common multiple of 653 and 62. 40486 Calculate the common denominator of -127/6 and 93/122. 366 Find the common denominator of -32/27 and -115/48. 432 What is the common denominator of 17/24 and 31/30? 120 Calculate the lowest common multiple of 325 and 858. 21450 Calculate the least common multiple of 18 and 972. 972 What is the common denominator of 19/175 and 32/125? 875 Find the common denominator of -47/1380 and -93/4. 1380 What is the lowest common multiple of 1135 and 13? 14755 Calculate the common denominator of -25/96 and 37/84. 672 Calculate the common denominator of 58/5109 and -11/1179. 15327 Calculate the common denominator of -19/14 and 109/392. 392 What is the common denominator of 67/1050 and 31/1050? 1050 Calculate the common denominator of -36/419 and -61/12. 5028 What is the common denominator of 117/110 and -61/110? 110 What is the lowest common multiple of 90 and 90? 90 Calculate the lowest common multiple of 94 and 200. 9400 Calculate the least common multiple of 12 and 10. 60 What is the common denominator of -107/216 and 113/5040? 15120 Calculate the common denominator of 69/128 and -47/4. 128 Calculate the least common multiple of 4284 and 18. 4284 Calculate the least common multiple of 27 and 57. 513 What is the smallest common multiple of 36 and 1045? 37620 Find the common denominator of -103/312 and 187/780. 1560 What is the least common multiple of 522 and 12? 1044 What is the lowest common multiple of 7 and 1270? 8890 Calculate the common denominator of 79/490 and 94/15. 1470 What is the smallest common multiple of 20 and 134? 1340 What is the smallest common multiple of 7	{ "pile_set_name": "DM Mathematics" }
t -1, -5, l in descending order. l, -1, -5 Let z be (-5)/106/(-6). Let n = -0.13 - -5.13. Put n, z, 0.4 in increasing order. 0.4, z, n Suppose 5i - i - 72 = 0. Let p be i/2716. Sort -5, 1, p in descending order. p, 1, -5 Let m(z) = z + 6. Let r be m(-6). Put -0.03, 2, r in decreasing order. 2, r, -0.03 Let f = -4 + 7.7. Let d = 4 - f. Sort d, 0.2, -3/5. -3/5, 0.2, d Let a = -5.141 + 0.141. Sort a, -1/5, -4 in decreasing order. -1/5, -4, a Let l be 1/(6/4)12/(-16). Let k = -3.1 + 3. Let c = 5.1 + k. Put c, l, 0 in descending order. c, 0, l Let p(w) = 17w3 + w2 - 2w + 1. Let g be p(1). Let c = -12 + g. Put 3, -2, c in decreasing order. c, 3, -2 Let b be ((-45)/(-140))/(24/28). Put 2, -34, b in ascending order. -34, b, 2 Let u = 75.67 - 76. Let x = -0.03 - u. Let z = 0.1 + 0.9. Put z, 4, x in decreasing order. 4, z, x Suppose -3l - 5 = -5h, -4l = -2h + 5h + 26. Let r be ((-36)/(-36))/(-1 - 0) - -2. Put h, r, -3 in ascending order. -3, h, r Let j = -42 - -45. Sort -5, 4, j, 2 in decreasing order. 4, j, 2, -5 Let j be (-297)/45 - (-9)/15. Sort -4, -3, j in ascending order. j, -4, -3 Let r = 5.7 - 0.7. Let u be 3 - (0 - 74/(-26)). Sort -2, r, u in decreasing order. r, u, -2 Let g = -0.24 - -0.04. Sort g, 0.1, -0.03, -2/9. -2/9, g, -0.03, 0.1 Let p(u) = -u*3 + 6u*2 - 7u + 6. Let x be p(4). Suppose x = -0z + 5z. Put -1, z, 5 in increasing order. -1, z, 5 Suppose -16 = -0f - 3f - 5x, -4f = -x - 6. Sort 3, -2, f. -2, f, 3 Let i = 96 - 90.98. Let z = 0.02 - i. Put z, 0.3, 4 in ascending order. z, 0.3, 4 Let z be (-2)/3 + (-11)/(-3). Let l be (-1z)/(1 + 0). Suppose -3b = -6b + 3. Sort l, -5, b in descending order. b, l, -5 Suppose 3p - 9 = 4b, 2b - 1 + 3 = 4p. Put -3, p, 3 in increasing order. -3, p, 3 Suppose v = 2v + 1. Suppose 4m - 10 - 46 = 0. Suppose -2 = -3s - m. Put v, 4, s in decreasing order. 4, v, s Let h(d) = -d - 2. Let m be h(-4). Let l be 0 - (2 + (-18)/7). Let n = 5.08 + -0.08. Sort m, n, l in ascending order. l, m, n Let r = 6 + -7. Put 2, -2, r in decreasing order. 2, r, -2 Let n = 25 + -20. Put -2/5, n, 2/11 in increasing order. -2/5, 2/11, n Let k(l) = l*3 - 2l*2 - 4. Let t be k(3). Suppose -9 = 6o + 27. Sort t, 3, o in increasing order. o, 3, t Suppose s = -7 - 0. Put -1, -2/9, s in decreasing order. -2/9, -1, s Let m = 27 + -26. Let h = 1 + -1. Sort m, h, -10 in descending order. m, h, -10 Let r = -5.7 + 0.7. Let i(b) = b*3 - 2b*2 - 3b + 3. Let q be i(2). Sort 1, q, r. r, q, 1 Let h = -6.65 - -5.7. Put 2/3, -3, h in decreasing order. 2/3, h, -3 Let d(r) = -2r + 1. Let h be d(3). Put 0, 1, h in increasing order. h, 0, 1 Let d = 48 + -48. Put -3, -0.1, 0.3, d in descending order. 0.3, d, -0.1, -3 Let a be (-210)/(-4)(-1)/9. Let c = -6 - a. Sort c, -0.4, -2 in ascending order. -2, -0.4, c Let y = -1024/7 - -146. Sort 0, 0.2, y, -1/25 in descending order. 0.2, 0, -1/25, y Let y = -32 - -34. Sort y, 0, -10 in ascending order. -10, 0, y Suppose z = n - 0n - 6, -z + 18 = 5n. Put z, 5, 38 in increasing order. z, 5, 38 Let z = 0.5 - 0.2. Sort -2, z, 1.1 in increasing order. -2, z, 1.1 Let h(y) = -3 - y*3 + 4y + 1 - 5 - 4y2. Let v be h(-5). Put v, -5, -2/9 in decreasing order. -2/9, v, -5 Suppose 0 = -3i + 31 + 20. Let g be i/26 - (-8)/(-52). Sort -0.03, 3, g. -0.03, g, 3 Let n(h) = h*2 - 5h + 2. Let d be n(3). Let m = -9 - -14. Put m, d, 0 in ascending order. d, 0, m Suppose 3t - 2t = -5b - 29, b + 21 = -4t. Let j(n) = n*2 + 5n - 1. Let p be j(b). Put p, -5, 3 in descending order. 3, p, -5 Suppose a = 11a + 10. Sort a, 0, -3 in descending order. 0, a, -3 Let j = -18 + 36. Let l be 51/j + -3 - 0. Let n = 0 + -2. Put -0.5, n, l in decreasing order. l, -0.5, n Let w = -3.98 - -4. Put -5, w, 0.3 in increasing order. -5, w, 0.3 Let u be 2 - (-5 - -1 - -4). Sort u, 5/2, 1. 1, u, 5/2 Suppose -4h - 5 = 7. Put h, 3, 2 in ascending order. h, 2, 3 Let d(g) = 2g3. Let k be d(1). Put -3/4, k, -1.2 in descending order. k, -3/4, -1.2 Let h = 11 + -7. Suppose hy + 12 = 3a + 3y, 0 = -4a + 4y + 16. Let v = -3 + a. Put v, -0.2, 2 in ascending order. -0.2, v, 2 Suppose -24 = 3o - 12. Sort -3, o, -6. -6, o, -3 Let o = -12 + 17. Suppose -3v = -ox - 42 + 2, 4v = 2x + 30. Let b = -0.23 - -0.13. Put v, 0.1, b in decreasing order. v, 0.1, b Let j = 7 - 3. Let v(k) = -k2 - 3k + 7. Let d be v(-5). Sort j, 1, d in increasing order. d, 1, j Let y(l) = -l*2 - 20l - 58. Let m be y(-16). Sort m, 1, -5 in decreasing order. m, 1, -5 Let i = 6 - 12. Let a = i - -8. Let j = a + 2. Sort j, -3, -4 in decreasing order. j, -3, -4 Let r = 4 - -1. Let v = -0.037 + 2.137. Let i = -0.1 + v. Put 0.2, r, i in decreasing order. r, i, 0.2 Let b = 14.8 - 15.8. Put -3, b, 5, -5/3 in ascending order. -3, -5/3, b, 5 Suppose -3z - 12 = 2f, -3z + 4f = z - 4. Put 4, 53, z in ascending order. z, 4, 53 Suppose 3o = -2b + 9, 3 + 3 = 2b. Let l = -1 + 7. Let u = l + -8. Put 4, u, o in decreasing order. 4, o, u Suppose -2 - 13 = -3o. Let w be (-6)/(-1)2/4. Sort w, -4, o. -4, w, o Let n = -3.038 + 0.038. Put 2/19, 2, n in descending order. 2, 2/19, n Let x = -14 + 13. Let s = 6 + -1. Sort s, x, 4 in decreasing order. s, 4, x Let f = -39 - -38. Put 4, 0.1, f in increasing order. f, 0.1, 4 Let x = -7 + 5. Let w = 0.33 + -0.73. Sort x, w, 2/19 in increasing order. x, w, 2/19 Let s(a) = -a + 7. Let l be s(4). Let m = -2/61 - 104/549. Sort m, 4, l. m, l, 4 Let y = -23/45 - -1/9. Let r = 0.32 + -0.02. Sort y, 1/2, r. y, r, 1/2 Suppose 10l - 24 = 16. Let y be 2/((1 + -2)2). Put 2, y, l in ascending order. y, 2, l Let c(s) = 3s - 7. Let u be c(2). Let v(l) = -l*3 + 3l*2 - 2l + 2. Let a be v(2). Let f = a + 2. Sort f, 1, u. u, 1, f Let b(c) = c + 1. Let s be b(2). Suppose -9 = so + 3m, 4o = 3m + m + 4. Put 3, o, 4 in descending order. 4, 3, o Let o = 0.5 - -3.3. Let b = o + -4. Let v = 439/7 + -63. Put v, b, 1 in decreasing order. 1, b, v Let o = -0.041 + -2.959. Sort 1/8, o, 2, -1 in descending order. 2, 1/8, -1, o Let i be ((-26)/(-91))/((-1)/(-14)). Suppose -5p + 2p = -4r + 14, 5p = 10. Suppose 3x = -2t - 1, -5 = 3t - rx - 13. Sort t, i, -2. -2, t, i Suppose -2c - 3 - 9 = 0. Let o = -5 - c. Sort -1, -3, o in descending order. o, -1, -3 Suppose 0 = -0v - v + 3. Suppose -2p + vg = 3p - 10, 3p + 2g = 25. Put p, 3, -2 in decreasing order. p, 3, -2 Let c(q) = q2 - q. Let n be c(-1). Suppose -n + 4 = x. Put 5, x, 4 in increasing order. x, 4, 5 Let b(d) = -2d*2 - 10d - 9. Let x be b(-4). Put 3, 4, x, -2 in descending order. 4, 3, x, -2 Let s(r) = -r*3 + 6r*2 + r - 6. Let i = -3 + 9. Let m be s(i). Suppose -1 = 5q + 3a + 1, -q + 2a + 10 = m. Put q, 4, 5 in decreasing order. 5, 4, q Let w be (-52)/72 + (-2)/(-4). Let c = -0.045 - -3.045. Sort w, -1, c in decreasing order. c, w, -1 Let r = -10 + 14. Sort 1, r, -1 in descending order. r, 1, -1 Let k be (10/(-40))/(9/8). Sort -2/19, -0.4, k, 2 in descending order. 2, -2/19, k, -0.4 Let h = 1.61 - -1.39. Let y be (1 - 3 - 0)1. Sort h, y, -3. -3, y, h Let l = -2.4 - 0.6. Let d = 3 + -2.8. Let u be 2/(-8) - 78/(-120). Put l, u, d in decreasing order. u, d, l Let k be 34/(-10) + (-6)/(-15). Suppose 0 = -4t - 0t. Suppose -w + 5 - 1 = t. Sort 2, k, w in increasing order. k, 2, w Let n be (-105)/(-36) + -5 + 2/(-12). Put 0, 0.1, n, -0.4 in descending order. 0.1, 0, -0.4, n Let k = 57 - 62. Let d(t) = t3 - 3t*2 - 4t + 3. Let f be d(4). Sort 0, k, f. k, 0, f Let u = -7.38 + 7.4. Put 0.2, -0.1, -0.2, u in ascending order. -0.2, -0.1, u, 0.2 Suppose -1 = -2j - 9. Let h be 6 - (-2 - j) - -1. Suppose -4a + 4 = 4q, 2a - 2 = 4a - 2q. Sort a, -3, h. -3, a, h Let j = 12 - 8. Sort j, 3, 5 in decreasing order. 5, j, 3 Let c = 23 + -20. Put -1, -5, c, 2 in descending order. c, 2, -1, -5 Let t = 8 + -4. Suppose -ti = -o + 5 - 26, -5i - 3o + 5 = 0. Put 0, i, 2 in descending order. i, 2, 0 Let z = -11 + 8. Suppose -5q - 6 - 9 = 0, -2h - 280 = 2q. Let c = h - -955/7. Put c, z, 3 in increasing order. z, c, 3 Let y be (-62)/(-22) - 3 - (-265)/(-55). Sort -4, 0, y in descending order. 0, -4, y Let t = 1 + 3. Let z = -2 + t. Put -2/5, 1, z in decreasing order. z, 1, -2/5 Let w = -1.29 + 0.09. Let h = 0.5 + w. Let v = h - -1. Sort v, 0.5, 1/3 in decre	{ "pile_set_name": "DM Mathematics" }
out replacement from {g: 2, w: 2, n: 8}. What is prob of picking 2 w and 1 g? 1/110 Calculate prob of picking 1 t and 1 v when two letters picked without replacement from {g: 3, v: 2, q: 1, d: 2, o: 3, t: 1}. 1/33 Three letters picked without replacement from {x: 4, o: 5, f: 7}. What is prob of picking 2 f and 1 x? 3/20 Three letters picked without replacement from {s: 5}. Give prob of picking 3 s. 1 Four letters picked without replacement from {z: 1, e: 1, n: 5, m: 1, l: 7}. Give prob of picking 2 n, 1 e, and 1 z. 2/273 Two letters picked without replacement from {w: 2, b: 8, h: 9}. What is prob of picking 2 b? 28/171 Calculate prob of picking 2 e when two letters picked without replacement from {e: 7, d: 1}. 3/4 What is prob of picking 1 d, 1 r, and 1 v when three letters picked without replacement from idrrrrdrrdiddrrrvrr? 55/969 Two letters picked without replacement from pbpbbbbbbppbbbbbbb. Give prob of picking 1 p and 1 b. 56/153 Three letters picked without replacement from uukmmlkkkl. Give prob of picking 1 m, 1 l, and 1 k. 2/15 Two letters picked without replacement from hznddzdvzhd. Give prob of picking 1 z and 1 n. 3/55 Calculate prob of picking 1 k and 1 b when two letters picked without replacement from {b: 3, n: 1, z: 1, g: 5, k: 2}. 1/11 Two letters picked without replacement from vkaaazavvvazkkv. What is prob of picking 1 z and 1 a? 2/21 What is prob of picking 2 u and 1 g when three letters picked without replacement from ugggugugugg? 14/55 Three letters picked without replacement from wuswpuppwpwwwpspppp. Give prob of picking 2 p and 1 s. 24/323 What is prob of picking 1 m and 2 h when three letters picked without replacement from {h: 2, m: 4, x: 4, f: 1, i: 1, z: 2}? 1/91 What is prob of picking 1 h and 1 b when two letters picked without replacement from {c: 2, v: 3, m: 2, b: 8, h: 1, d: 4}? 4/95 Two letters picked without replacement from feleeqeelffaeal. What is prob of picking 2 f? 1/35 Calculate prob of picking 4 h when four letters picked without replacement from {h: 6}. 1 Three letters picked without replacement from {h: 2, l: 5, r: 8, x: 1}. What is prob of picking 2 h and 1 r? 1/70 Three letters picked without replacement from cccvvlcvlcflc. What is prob of picking 1 v, 1 c, and 1 f? 9/143 Two letters picked without replacement from cfcfcc. Give prob of picking 1 c and 1 f. 8/15 Calculate prob of picking 1 b and 1 w when two letters picked without replacement from jmbljblwwwbbblwwjb. 10/51 Three letters picked without replacement from fpfppffffppofoffp. Give prob of picking 2 p and 1 f. 27/136 Four letters picked without replacement from ttyttttttttttytyttty. What is prob of picking 4 y? 1/4845 What is prob of picking 2 g when two letters picked without replacement from ggsgggggwsgw? 14/33 What is prob of picking 2 w, 1 v, and 1 n when four letters picked without replacement from vwwowwwohnhowownc? 3/170 Three letters picked without replacement from rqrbyrurur. What is prob of picking 2 r and 1 q? 1/12 Calculate prob of picking 3 a when three letters picked without replacement from {b: 5, a: 5, l: 3}. 5/143 Two letters picked without replacement from {b: 1, j: 1, g: 1}. What is prob of picking 1 b and 1 g? 1/3 Calculate prob of picking 1 p and 1 k when two letters picked without replacement from kbbkkbp. 1/7 Calculate prob of picking 1 b and 1 z when two letters picked without replacement from cubbyiyuz. 1/18 What is prob of picking 2 p when two letters picked without replacement from bppbppbbpbpcbppbbpb? 4/19 Calculate prob of picking 4 z when four letters picked without replacement from {q: 2, z: 6}. 3/14 Three letters picked without replacement from {c: 2, l: 3, z: 1, e: 1, k: 3}. What is prob of picking 1 c, 1 k, and 1 e? 1/20 What is prob of picking 1 w and 2 e when three letters picked without replacement from kaweaaakaweaiekaake? 4/323 Two letters picked without replacement from {t: 2, x: 6}. Give prob of picking 2 t. 1/28 Two letters picked without replacement from {c: 1, e: 1, h: 1, i: 2, w: 2, b: 1}. What is prob of picking 1 i and 1 c? 1/14 Two letters picked without replacement from {o: 2, r: 10, k: 1, q: 3}. Give prob of picking 1 k and 1 q. 1/40 Three letters picked without replacement from {x: 5, i: 7}. What is prob of picking 2 x and 1 i? 7/22 Three letters picked without replacement from {x: 6, o: 2}. What is prob of picking 3 x? 5/14 Three letters picked without replacement from {y: 2, b: 3, j: 3, t: 6, d: 3}. What is prob of picking 2 d and 1 t? 9/340 Four letters picked without replacement from mlloamaalkkllml. Give prob of picking 1 a, 2 m, and 1 o. 3/455 Calculate prob of picking 1 n, 1 e, and 1 u when three letters picked without replacement from {w: 1, e: 4, o: 6, n: 3, z: 3, u: 1}. 1/68 Two letters picked without replacement from {c: 1, p: 2, y: 1, m: 2, a: 2, h: 5}. Give prob of picking 1 h and 1 m. 5/39 Calculate prob of picking 1 y and 1 a when two letters picked without replacement from caycccayycccy. 4/39 Calculate prob of picking 1 e and 2 a when three letters picked without replacement from eeaaaaaaaa. 7/15 Calculate prob of picking 1 u and 2 z when three letters picked without replacement from zzzwwwwuzzuuzuzuz. 7/34 Three letters picked without replacement from awhhwpwwuwwa. Give prob of picking 1 u, 1 h, and 1 p. 1/110 Two letters picked without replacement from dfavadraa. What is prob of picking 2 d? 1/36 Two letters picked without replacement from {a: 1, o: 5, v: 6, h: 4}. Give prob of picking 1 o and 1 a. 1/24 Four letters picked without replacement from szzzsznzns. Give prob of picking 2 z and 2 n. 1/21 What is prob of picking 2 g, 1 b, and 1 f when four letters picked without replacement from {y: 6, d: 1, s: 2, g: 9, b: 1, f: 1}? 12/1615 Two letters picked without replacement from {j: 4, t: 15}. What is prob of picking 1 j and 1 t? 20/57 What is prob of picking 1 g, 1 d, and 2 o when four letters picked without replacement from {d: 3, o: 5, g: 5}? 30/143 Calculate prob of picking 1 t and 2 i when three letters picked without replacement from itttittttiiiiitiit. 27/68 Four letters picked without replacement from gggg. Give prob of picking 4 g. 1 Three letters picked without replacement from ssllss. What is prob of picking 2 s and 1 l? 3/5 Three letters picked without replacement from bbbrynrrnbq. What is prob of picking 2 n and 1 r? 1/55 Calculate prob of picking 1 f, 1 p, and 1 n when three letters picked without replacement from fnpn. 1/2 Calculate prob of picking 3 s and 1 c when four letters picked without replacement from ccccjscscjccccscccj. 13/3876 Calculate prob of picking 1 r and 1 d when two letters picked without replacement from rrdmmmwm. 1/14 Two letters picked without replacement from {f: 1, r: 3}. What is prob of picking 2 r? 1/2 Three letters picked without replacement from nnxnxxjxkxxx. Give prob of picking 3 x. 7/44 What is prob of picking 2 s and 2 f when four letters picked without replacement from {l: 1, r: 8, s: 2, f: 2, c: 1}? 1/1001 What is prob of picking 2 c when two letters picked without replacement from cbbccbbbcbccbcbccbc? 5/19 Calculate prob of picking 2 p and 1 m when three letters picked without replacement from pppmpmpppmmm. 21/44 Four letters picked without replacement from {k: 1, a: 1, v: 1, c: 1, s: 2, d: 2}. Give prob of picking 2 s and 2 d. 1/70 What is prob of picking 1 e, 1 r, and 1 i when three letters picked without replacement from geirrnn? 2/35 Three letters picked without replacement from vjsvsarrvrvtrrv. Give prob of picking 1 v, 1 r, and 1 j. 5/91 Two letters picked without replacement from pjjpp. What is prob of picking 2 p? 3/10 Three letters picked without replacement from dydhy. Give prob of picking 1 d, 1 y, and 1 h. 2/5 Calculate prob of picking 2 s and 1 z when three letters picked without replacement from {y: 7, z: 3, s: 2}. 3/220 Calculate prob of picking 1 p and 2 a when three letters picked without replacement from {p: 3, a: 3, z: 5}. 3/55 Calculate prob of picking 2 y, 1 h, and 1 s when four letters picked without replacement from yhhysyhyyhhshsyhys. 49/255 Two letters picked without replacement from xzxzzxxxxzxxxxzx. Give prob of picking 1 x and 1 z. 11/24 Calculate prob of picking 2 s, 1 m, and 1 y when four let	{ "pile_set_name": "DM Mathematics" }
(nn(-5))/((n/(n(-2/3)/n))/n))/(n(-5)n(-4)) assuming n is positive. n(10/3) Simplify ((h*(5/4)/h)/(h/(hh*(4/7))hh))(-1/18) assuming h is positive. h(11/168) Simplify u(-1/2)/((uuu(-1))/uu)(u/u(2/11))/u(1/4) assuming u is positive. u(-41/44) Simplify (nn*1n)*(-2/3)n*(2/17)/nn(2/11) assuming n is positive. n(-505/187) Simplify (jj(-2/25))/j(j9/j)/j assuming j is positive. j(173/25) Simplify (a/(a/(aa/(aa*(1/3)a))))/((a*(-2/45)a)/aa) assuming a is positive. a(-58/45) Simplify (r(2/13))(-10) assuming r is positive. r(-20/13) Simplify mm*(-34)/mm(-17) assuming m is positive. m(-51) Simplify g/(g/(g/(g*(-2)g)))g(4/7) assuming g is positive. g(18/7) Simplify ((s(2/5)s)/s)/(s/(s*(20/3)/s)s) assuming s is positive. s(61/15) Simplify (a(-1))(-39)/(a(1/2))(-4/27) assuming a is positive. a(1055/27) Simplify (u*(3/4)/uuuu(u/u(-1/5))/uuu)/(u(-1)/(u(uuu*(-8))/uuuu)) assuming u is positive. u(59/20) Simplify ((l6/l)/ll)/l13 assuming l is positive. l(-8) Simplify (h/(h1h))31/((h(-1)/hh)/h)(-21) assuming h is positive. h(-73) Simplify (c15cc(-10/3)c)(-22) assuming c is positive. c(-902/3) Simplify ((j/(jj(-16)/jj))/j(-1/17))(-12) assuming j is positive. j*(-3276/17) Simplify u(u*5/u)/uu*5u*(-3)uu(u(-3)/u)/u assuming u is positive. u3 Simplify w(-1/5)/w7(ww(-1))48 assuming w is positive. w(-36/5) Simplify c8/c(-5/2) assuming c is positive. c(21/2) Simplify (x*(-1/4)x(-1/5))7 assuming x is positive. x(-63/20) Simplify w(-1/31)/w(12/11) assuming w is positive. w(-383/341) Simplify n*(-2/17)/(n/(n(nn/(nn*(3/7)nn))/n)) assuming n is positive. n(-303/119) Simplify (hh*29h)9 assuming h is positive. h279 Simplify j*22(((j/(jj(jjjj(-8)j)/jj))/j)/j)/j assuming j is positive. j22 Simplify ((g(-1))(-30))(-20) assuming g is positive. g(-600) Simplify (yy/(yy(-1/8)y)yy)(-16) assuming y is positive. y(-34) Simplify (u*(-1)/uu)6/(u(-2))(4/25) assuming u is positive. u(-142/25) Simplify (w(-3)/w4)/(w*(-6)w(-3)) assuming w is positive. w2 Simplify w*(2/13)w(5/13) assuming w is positive. w(7/13) Simplify (l(ll/l*(-1/15))/ll)/lll(-9)/l assuming l is positive. l(-104/15) Simplify (f(f/f(-3))/f)/(f(3/8)f) assuming f is positive. f*(21/8) Simplify (tt*(-11)t)2 assuming t is positive. t(-18) Simplify (c/(c/(cc/c(-4))))/(c/c(2/5))(c*(-3/4)c)/c(-3/8) assuming c is positive. c(241/40) Simplify (b/((bb/(bb/((bb/b0b)/b))b)/b))/(b(-1)b)(((b1/b)/b)/b)/bb(-3) assuming b is positive. b(-7) Simplify (nn/n(2/29))/nn/(n/(n*(-3/10)/n))(n/((nn(-6/5)/n)/n))/((nnnn*(2/11)n)/nn) assuming n is positive. n(-4309/3190) Simplify ((d/((d/d(1/3))/d))/(d(-4/3)/d))(1/13) assuming d is positive. d(11/39) Simplify l/(l/(ll(l/(ll/(l(lll/((l/l7)/l)l)/ll)ll))/ll))l(-22)l assuming l is positive. l(-10) Simplify (b(-2/7))(-34)/(b(1/3)/(b/(b(1/7)/b))) assuming b is positive. b(236/21) Simplify t*(-3/14)tt(-20) assuming t is positive. t(-269/14) Simplify ((v(v/(v/((vvv/(vv/v(-1/3)v))/v)v)v)/v)/v)*(15/4)/(vv/v*11vvv*7vv) assuming v is positive. v(-43/4) Simplify (m/((m/(m/(mm*(-16))))/m))/mm(m(2/7)m)/m assuming m is positive. m(121/7) Simplify ((y/y2y)/(yy/y*(-1/4)y))/(y*(-3/2)/((y/(yyy(-2/11)y))/y)) assuming y is positive. y*(-201/44) Simplify (kk13)6 assuming k is positive. k84 Simplify ((((v(-10)v)/v)/vv)/(v/v*2v))(-34) assuming v is positive. v340 Simplify a/(a*10/a)a/((((aa/(aa*0)a)/a)/a)/aa) assuming a is positive. a(-7) Simplify ((y/(yy*(-4)))/yy/(yyy*(-1/4))y)(17/4) assuming y is positive. y(221/16) Simplify ((j/(j/((j(1/4)/j)/j)))(3/17))44 assuming j is positive. j(-231/17) Simplify ((c(-1/4))(-5/3))(1/26) assuming c is positive. c(5/312) Simplify (hh(-5)/h)(1/10) assuming h is positive. 1/sqrt(h) Simplify j(-1/41)j23 assuming j is positive. j(942/41) Simplify (pp(1/2))/(p(-13)/pp) assuming p is positive. p*(29/2) Simplify xx*(-9/8)xxx(-10/9) assuming x is positive. x(55/72) Simplify s6/(s0/s)(s/(ss(-2)))13 assuming s is positive. s*33 Simplify (hh(1/18))(-2/93) assuming h is positive. h(-19/837) Simplify (x/(((x(2/5)/xxx)/x)/x)x)/xx/x*(2/11)x((x/x(-2/9))/x)/xx/x*(1/4)x assuming x is positive. x(8693/1980) Simplify (s1)*(-1/65)/((ss*1s)/s)(-13) assuming s is positive. s(1689/65) Simplify h(-2/11)/(h/h(-3)h) assuming h is positive. h(-57/11) Simplify (b/(b(b*0/b)/bb))*(12/13)(b2)(2/15) assuming b is positive. b(232/195) Simplify (o(-1/3)/o)(-11/6) assuming o is positive. o(22/9) Simplify v/(vv(-3/2))v(-14/3) assuming v is positive. v(-19/6) Simplify ((u/u*6)/(uu(1/8)))(-15/7) assuming u is positive. u*(105/8) Simplify ((zz*(-2/7)z)/z)(-3/29) assuming z is positive. z(-15/203) Simplify ((hh(h/(h*(-1)/h))/hh)/hh(2/15)/h)/(h(-1/6)hhh(-3)) assuming h is positive. h(43/10) Simplify (d8/d(-8))(-10/3) assuming d is positive. d(-160/3) Simplify ((h(2/13)/h)/(h/(h3hh)))/(hh(-1/6)(h/(hh2))/h) assuming h is positive. h(415/78) Simplify ((k/(k/k(-2/3))k)/k)/k*(1/2)k*(-2/3)/(((k/(k/((kk*(-4))/k)))/kkk)/k) assuming k is positive. k(13/6) Simplify (s(-3/5)/sss/(s/(s8s))s)(-1/4) assuming s is positive. s(-47/20) Simplify (x(-12/7))(2/77) assuming x is positive. x(-24/539) Simplify ((x/(x/(xxx(3/2)x))x)/(x(-2/5)/x))2 assuming x is positive. x(69/5) Simplify (f(4/7)ff(1/2))/(f(f/f(-2/3))/f)(2/21) assuming f is positive. f(241/126) Simplify (g(-19)g(-16))26 assuming g is positive. g(-910) Simplify (u(uuuu(-3/5))/uuu(-1/12))/(u2/u)(-9) assuming u is positive. u(739/60) Simplify n(-4/9)(nn/(n/(n(-11)nn)n))/n assuming n is positive. n(-94/9) Simplify (m/m(-34))/(m*8m) assuming m is positive. m26 Simplify w0/w*(-1/4)(ww(w/(w/(w/(w/w*(-1/4))w)))/ww)/www(2/9) assuming w is positive. w(29/9) Simplify ((w(1/4))(-2/11))(-5/3) assuming w is positive. w(5/66) Simplify i(-1/20)i(-5/6) assuming i is positive. i(-53/60) Simplify (rr/(rr/(r/(rr/(r/((r(2/7)/r)/r))r))))/(rr(-6/5))(rrr/(r/(r/r*2r))r)/r0 assuming r is positive. r(137/35) Simplify (ll*(-2)l)*(36/11)(l(-1/2))49 assuming l is positive. l(-49/2) Simplify (x(1/4))*(6/7)(x(2/9)/x)/(x/x(1/4)) assuming x is positive. x(-331/252) Simplify ((b/b(-5)b)(1/58))37 assuming b is positive. b(259/58) Simplify pp*6pp(-1/15) assuming p is positive. p(119/15) Simplify (n(-7/5)/nn)/((n(-2/17)/n)/n) assuming n is positive. n(61/85) Simplify l*4lll*9l(-2/5)/(l0/l) assuming l is positive. l(78/5) Simplify (d(1/2)/(d/(d/(d/d(-9)))))18 assuming d is positive. d*(-171) Simplify ((p/(p/(pp*(5/3))))/((pp(3/8))/p))(28/5) assuming p is positive. p(77/6) Simplify ((o/o(2/7))/o)(5/4) assuming o is positive. o(-5/14) Simplify (((a*9aa)/a)/a)/aa*(-7) assuming a is positive. a Simplify aa*(-3/29)a(a/(a/(a/a18a)))/aa assuming a is positive. a(-409/29) Simplify (w/((www8)/w))/(w(1/4)w)w/(w9w)ww*9wwww assuming w is positive. w(-17/4) Simplify (p(-2/13)/(pp6))(-1/33) assuming p is positive. p*(31/143) Simplify (ii*(-10)i(i/(i(5/2)i))/i)/(i((i/(ii*(-7)))/iii)/iii/i(4/3)) assuming i is positive. i(-121/6) Simplify (v10)45 assuming v is positive. v450 Simplify ((yy*(2/9)y)/y)(-17/5)/(y4yy5) assuming y is positive. y(-637/45) Simplify (((b/(((bb(-1/8))/bb)/b))/b)/((bb(1/3))/b))(-3/19) assuming b is positive. b(5/152) Simplify ((ss*(-2/3)s)/s)*(1/35)(ss/s(-1)s)(14/11) assuming s is positive. s(5891/1155) Simplify mm/m25m(6/5) assuming m is positive. m(-109/5) Simplify g*(-1/4)g*(-3/2)(gggg1)39 assuming g is positive. g(617/4) Simplify ((qq/q**(-	{ "pile_set_name": "DM Mathematics" }
second derivative of -x5/20 + x4/3 + x*3/2 + 7x*2/2 - 2x. Determine r(5). -3 Let l(i) be the first derivative of 2 + 1/3i3 + 2i*2 + 2i. Give l(-5). 7 Let u be 2/(-8) + 10/40. Let k(s) = s3 - s2 - s + 6. Determine k(u). 6 Let s(i) = 3i - 1. Suppose 2x = -4k + 20, -5k + 27 = -2x + 5x. Give s(x). 11 Suppose c = -c + 24. Suppose 0 = 3z - 6z + c. Let r(n) be the first derivative of n*3/3 - 3n*2 + 6n + 1. What is r(z)? -2 Let w(b) be the first derivative of b5/20 - b4/4 - b3/3 - b2 - 4b + 2. Let h(i) be the first derivative of w(i). Give h(3). -8 Let z = 14 + -8. Suppose -c + z = -3c. Let s(l) = -l + 1. Give s(c). 4 Let g(m) = m - 14m2 + 25m*2 + 3 - 18m2 + m3. Give g(7). 10 Let c(f) = -14 - 14 + 27 + 4f - f2 + 0f*2. Calculate c(3). 2 Let z(y) = y + 1. Let u = -3 - -3. Suppose -3i + u = -6. Let f = i + -2. Calculate z(f). 1 Suppose 5x - g = 6, 0 = 2x - 4g + 3g. Suppose -xr + 6 = -0r. Let b(t) = t + 4. What is b(r)? 7 Let l(d) = 3d2 + 0 + 3 - 10d + 16d - d3 - 6. What is l(4)? 5 Let p(d) = d3 - 4d2 + d + 4. Let y be p(4). Let g(w) = -w + 12. Let t be g(y). Let x(h) = -h + 9. Give x(t). 5 Let k(s) = s3 - 7s2 + 9s - 9. Suppose 7 = 3h - 11. What is k(h)? 9 Suppose 0 = 3w + 2w + 30. Let y(o) = -o + 6. Let x(q) = -2q + 6. Let n(b) = wy(b) + 5x(b). Give n(-4). 10 Let g(o) be the first derivative of 2o3/3 - o2 - 4o + 15. What is g(3)? 8 Suppose 1 + 4 = 5o. Suppose 5d = -4 - o. Let l be (-8)/((-6)/(d - -4)). Let x(z) = -2z2 + 6z. Determine x(l). -8 Let n(q) = -q*2 + q. Let s(v) = 6v*2 - 4v + 3. Let b(u) = -5n(u) - s(u). Let h be 6/27 - 11/9. Let m be (0/h)/(1 - 3). Determine b(m). -3 Let y(w) = w3 - 3w*2 + w - 5. Let n(x) = 2x - 42. Let p be n(23). What is y(p)? 15 Let b(m) = -m - 2. Suppose 2r - 2l + 10 = -0l, 0 = r - 4l + 20. Give b(r). -2 Suppose -17v + 20v + 9 = 0. Let q(d) = -1 - 3d2 - 2 - d - 3d - d*3. Give q(v). 9 Let p(m) = -7m*3 - 3m - m*3 - 5m - 2m2 + 7m. Let z be ((-12)/5)/(4/20). Let k be (-8)/z3/(-2). Calculate p(k). 7 Let s = 7 - 7. Let t(n) = -n2 + n + 2. Let g be t(s). Let c(r) = 2r*g - 7 + 4r*3 - 3r*3 - r + 2r*2 - 6r. Give c(-5). 3 Let l(u) be the second derivative of -u5/20 + u4/3 + u*3/2 - 3u*2/2 + 2u. Let d = -31 + 33. Give l(d). 11 Let f(k) be the second derivative of k5/20 - k4/12 - k*3/6 - 6k. Determine f(2). 2 Let h(x) = 4x. Suppose -4f + 7 = a, -40 = -5f - 0f + 5a. Suppose fb - 65 = 7. Suppose -5 = -4s + 3j - b, 3s + 8 = j. Determine h(s). -4 Let w = -9 + 5. Let h be (2/3)/(w/12). Let f(n) be the second derivative of -n5/10 - n4/4 - n3/3 - 3n*2/2 - n. Give f(h). 5 Suppose -4 = -3p + d, -d = -4d + 6. Let r(k) = 2k + 3 + 6k - p. What is r(1)? 9 Let q be 1/(0 + 0 + 1). Let t be -5 - (3/q - 2). Let u(g) = g - 2. Give u(t). -8 Let l = 2 + 0. Suppose 0 = -0a - la + 4. Let v(d) = -14d*2 + 11d + 14. Let z(g) = 5g2 - 4g - 5. Let r(u) = -6v(u) - 17z(u). Give r(a). 1 Let j(f) be the third derivative of f4/24 - f3/6 - 10f2. Let z(w) = -w3 + 6w*2 - w. Let y be z(6). What is j(y)? -7 Let o(a) = -10 - a + 4a + a - 5a. What is o(0)? -10 Let y(s) be the second derivative of -s4/12 + 2s3/3 + s2/2 + s. Let a = -3 + 12. Suppose b + a = 5f, -3 = -f - 0b - b. Determine y(f). 5 Let g(d) be the second derivative of -9d5/20 + d4/12 - d3/6 + d2/2 - 5d. Calculate g(1). -8 Let b(z) = 7z - 2. Let v(h) = 22h - 7. Let m(a) = 7b(a) - 2v(a). Determine m(-1). -5 Let j(f) = -4f2 - 3f - f*3 - f + 0f*3. Suppose 5g - 25 = -5r, -4r + 13 = -2g - g. Suppose ro + 0x = -3x - 27, 0 = -3o + 4x + 11. Give j(o). 3 Let g = 111 + -114. Let r(t) = t*2 + 3t - 2. Determine r(g). -2 Let r be 2/(-4) - (-6)/4. Let d(b) = 200b - 11b*2 - 200b + 3b2. Give d(r). -8 Let v(l) = -l - 1. Let p be v(-3). Let g(c) = -4c - 2 + pc + c. Determine g(-5). 3 Let y = -31 - -32. Let f(j) = -5j*2. Calculate f(y). -5 Let j(s) be the second derivative of -4s*2 + 1/6s3 + 0 + s. Let v be j(7). Let k(p) = -p2 + 2p + 1. Give k(v). -2 Let y = 128 - 63. Let t be (-91)/y - (-3)/(-5). Let h(w) = -w2 - 3w - 3. Give h(t). -1 Let p(z) be the third derivative of -z*5/60 - 7z4/24 + z3 + z*2. What is p(-7)? 6 Let r(f) = -2f*2 + 5f + 4. Let y be 1 - (5 + (-2 - -1)). Let g be 9/6(-8)/y. What is r(g)? -8 Let j(v) = -3v + 6 + 2v + 0v - v2. What is j(0)? 6 Let b(o) = o3 - 9o2 + o - 13. Suppose -3y + 3j - 3 = -4y, -y + 3j + 15 = 0. Determine b(y). -4 Suppose o = -4, 8y - 8 = 6y + 3o. Let j(s) = -4s2 + s - 2. Give j(y). -20 Let j(n) = -2n*2 + 2n + 3. Let b(c) = c. Let w(y) = 4b(y) + j(y). Calculate w(5). -17 Let z be 5 + -4 + 2 + 1. Let l(m) = m3 - m2 + m. Let b(n) = -5n*3 + 8n*2 - 6n - 1. Let o(p) = zl(p) + b(p). Let g be 24/10 + (-3)/(-5). What is o(g)? 2 Suppose -4t + 5 = -3. Suppose tu = -n - 10, 3u - n + 14 = -u. Let j(b) = -b - 2. What is j(u)? 2 Let z(o) = -7o. Let y(d) = -9d + 1. Let v(a) = -3y(a) + 4z(a). What is v(-3)? 0 Let b(k) be the second derivative of k*4/12 + 7k*3/6 + 5k*2/2 - 3k. Calculate b(-6). -1 Let v(i) = -i*3 - 12i*2 - 19i + 14. Let r be v(-10). Let w(p) = p*2 - p - 2. Determine w(r). 10 Let m(j) = 2j + 7. Let p(s) = 3s + 13. Let g(k) = 7m(k) - 4p(k). What is g(-5)? -13 Let u be (-2)/6 - 14/3. Let q(b) be the first derivative of b2 + 7b - 12. Give q(u). -3 Suppose m = -3 + 7. Let b(i) = 6i2 + 3 + 0i - 1 + i*3 + mi. Suppose 4u = 8, 0 = 3h - 2u + 3u + 13. Calculate b(h). 7 Let n(h) be the first derivative of 8h3/3 - h2/2 - h - 6. What is n(-1)? 8 Suppose 3 = 2x - 3. Let w = x + -2. Let d(c) = -c*2 + 5c*3 - 2 + 2c*2 + w. Determine d(1). 5 Let g = -1 - 2. Let q(s) = -4s + 2s + 3 - 4s*2 + 3s*2. Give q(g). 0 Suppose 2o = -4j - 1 - 1, o = j - 4. Let k be (0/j)/(-2) - -2. Let i(h) = h2 - h - k + h + h3 - h. Give i(2). 8 Let p be 0 - -4 - (-2)/(-1). Let u(o) = 3 - op - 3 + 2o. Calculate u(2). 0 Let j(y) = -y*2 + 10y + 13. Let w(m) = 3m2 - 29m - 38. Let d(f) = -17j(f) - 6w(f). Give d(5). 2 Let t(j) = -j*2 + 6j - 5. Let p = 0 - -2. Suppose -5h - x = -21, -3x - p = h + h. What is t(h)? 0 Let t(f) = -3f2 + 2f. Suppose 2v = 2u - 3v - 19, -5v - 23 = -4u. Give t(u). -8 Let p = 17 - 2. Let i(r) = -r2 + 14r + 14. Let x be i(p). Let b(u) = 4u3. What is b(x)? -4 Let p(l) be the third derivative of -l4/4 - l3/6 + 66l*2. What is p(-1)? 5 Let m(s) = s + 4. Let d be m(-2). Suppose u + t - 3 = 2t, 3t + 7 = du. Suppose -2w + u = 8. Let q(h) = h2 - h - 4. Determine q(w). 8 Let n(d) = 3d*3 - 18d*2 - 7d - 7. Let g(i) = -5i3 + 27i*2 + 11i + 10. Let t(x) = 5g(x) + 8n(x). Give t(-9). 3 Suppose 2f - 28 = 5v, -4f = -f - v - 16. Let z(j) = -j - 1. What is z(f)? -5 Let h(b) be the first derivative of -2b3/3 + b2 - b - 4. Give h(1). -1 Let c(t) = t - 5. Let j be 6/(-21) + (-33)/7. Determine c(j). -10 Let d(c) be the third derivative of 0 + 0c + 1/60c*5 - 3c*2 - 1/30c*6 + 1/6c*3 + 1/12c4. Give d(-1). 4 Let c(b) be the first derivative of -b3/3 + 3b2/2 + 3b + 7. Determine c(5). -7 Let r(x) = -4x3 + 0x*3 + 3x3 - x2 + 7 - x + 2x2. Determine r(0). 7 Let p(l) = 3l*2 + 36l + 3. Let v be p(-12). Let w(z) = 3z2 - 2z - 3. What is w(v)? 18 Let c(s) = 1 + 1 - s + 2 - s*2. Determine c(-3). -2 Suppose -47a = -42a + 25. Let j(t) = -t2 - 7t - 7. What is j(a)? 3 Let d(n) be the second derivative of -5n4/12 - n3/3 - n2 + 2n. Determine d(-2). -18 Let i(r) = 1. Let u(p) = -p - 3. Let x(m) = 7i(m) + 2u(m). What is x(2)? -3 Let o(t) be the first derivative of -t*2/2 - t + 13. Determine o(-5). 4 Let d(n) = 3n + n + n + 1. Let h(z) = -z*3 - 9z*2 - 12z - 33. Let a be h(-8). Calculate d(a). -4 Let i be (-3)/9 + 4/12. Suppose -3p - y - 5 = i, 0 = -4p - 0p + y - 16. Let a(n) = -n + 1. Calculate a(p). 4 Let p = 67 + -64. Let d(m) be the first derivative of -3m - m*2 + 1/3m3 + 2. What is d(p)? 0 Let j(g) = -g3 - 7g2 - 6g + 6. Suppose -61 = 14n + 9. Give j(n). -14 Suppose 3w + 2 = -5c, -5w + 0 = 5c + 10. Let u(z) = z2 + 2z*2 - 6z + 0 - 4z*2 - 4. Determine u(w). 4 L	{ "pile_set_name": "DM Mathematics" }
7k2 - 5k*2 + (-2 + 2 + k)(2k - 2k + k). 4k2 Expand (0c + 8c - 4c)(0 + 0 + 3c)(-2 - 4 + 4). -24c*2 Expand (-5 + 5 + 4)(1 + 0 + 0 + (-1 - 1 + 3)(-4 - 1 + 3))(i*3 + 5i*2 - 5i*2). -4i*3 Expand 2p*3 - 2p3 + p3 + 3p3 + 2p*3 - 4p*3 + (4p + 2p - 4p)(2p*2 - 4p*2 + 0p2) - 2 + p3 + 2. -p*3 Expand (-f - 3f + 5f + (-2 - 2 + 2)(-3 - 2f + 3))(0f3 + 0f*3 - 2f*3). -10f*4 Expand 3s - 3s - s + (3 - 3 - 2)(3 - 3 - s) + 0s - s + 3s - 2 + 2 - s + (-s + 1 - 1)(-3 - 4 + 6). 3s Expand (6 + 7a2 - 6)(4a - 2a + 3a). 35a3 Expand (-j3 + 15j3 - 5j*3)(-4j2 + j2 + 0j*2). -27j*5 Expand (-2 + 1 - 3)(2n + 1 - 1) - 2n + 2n + 2n + n + 2 - 2 + (1 + 1 - 1)(0n + 3n - n) - n + 5n - 2n. -n Expand 20p*4 - 25p*2 + 25p2 + p4 - 3p4 - 2p*4 + (-p + 2p*3 + p)(1 - 1 - 2p) - 4p*4 + 3p*4 + 0p*4. 11p*4 Expand (-v + 0 + 0)(70v + 15 - 85v + 0). 15v2 - 15v Expand -2n2 + 2n*2 + 2n5 + (1 + n5 - 1)(-5 + 1 + 3) + 4n5 - n5 + 0n5. 4n*5 Expand (-2 + 3x*2 - 2x*2 + 0 - 4x)(3x3 - x3 - 4x3). -2x*5 + 8x*4 + 4x*3 Expand (4 - 4 - 5g)(g3 - 3g*3 + 5g3) - g4 - 4g4 + 2g*4. -18g4 Expand (1 - 1 - k2 + 2k)(3k - k - k)(0k2 - 4k*2 + 3k2). k5 - 2k4 Expand (-3f5 + f5 + 4f5)(2 - 3 - 1) + f*2 - 2f5 - f2 + 1 - 1 + 3f5 + 3. -3f*5 + 3 Expand (276 - 276 - 20m)(-1 + 2 - 2) - m + 3m - 3m. 19m Expand -9 - y - 10 + 8 + (y - 1 + 1)(2 - 1 - 3) + 2 - y - 2. -4y - 11 Expand (-2 - 2p + 3p - 2p)(-p2 - p2 + p2). p3 + 2p2 Expand -2 + 4q*2 + 2 + 2q*2 + 3q2 - q2 + (0q - q + 0q)(-q + 0 + 0). 9q2 Expand (t2 + t2 - t2)(t2 - 2t*2 + 12t*2). 11t4 Expand (c3 + 2c3 - 2c*3)(7 + 4 - 4). 7c3 Expand -8q*3 - 5q3 - q3 + (q2 + q2 + 0q2)(3q + q - 3q). -12q3 Expand (0 - 2 + 1)(4n - 4n + 2n) - 4 + 4 - 2n. -4n Expand (-2v + 4v - v)(-v + 3 - 3) + 82 - 82 + 22v2. 21v*2 Expand (-1 + 0 + 2)(-2z - z + 2z)(1 + 1 - 5) + 2 - 2z - 2. z Expand (b - 4 + 4)(-1 + 2 - 3) + 10 + 24 - 13 - 2b. -4b + 21 Expand (-3 - 2 + 4)(-152 - 117l + 152). 117l Expand (3 + 3 - 5)(-4j - j + 2j)(-4j + j + j). 6j2 Expand b4 + 3b - 3b - 2b4 - b4 + b4 + (b + b + 0b)(b - 2b*3 - b) - 14 + 14 + 6b4. b4 Expand -2y + 6y - 2y + 1 - y + 0y + 0y + (y + 2y - 4y)(3 - 3 - 3). 4y + 1 Expand (-2f*3 + 0f*3 + 4f*3)(-8 - 5 - 11). -48f3 Expand (0f*2 + 4f*2 - 2f*2)(-3f - 3f + 5f) - 2f*3 + 7f*3 - 2f3. f3 Expand -6 + 6 + 10j2 + (2j + 3j - 4j)(1 - 1 - j). 9j*2 Expand (-7g + 13 - 13)(-g + 2g*2 + g) - 4g*3 + 5g*3 - 4g*3 + (3g*2 - 2g*2 - 2g*2)(-6g + 2g + 3g) - g3 + 4g3 - g3. -14g3 Expand 3c + 2c - 3c + 0 + 0 + 2c + (-c + 3 - 3)(3 + 0 - 4). 5c Expand (1 - 4 + 2)(-3v + 3v - 2v2 + 0v + 0v - 4v*2 + (0 + 2v + 0)(0v - 3v + v)). 10v*2 Expand (-4 - 2 + 5)(2 - 4 + 0 + (-1 - 1 + 1)(-4 + 5 - 4))(-2p2 - p2 + 2p2). p2 Expand (-v - 4 + 4)(0 + 0 - 2) + (1 - 5 + 5)(-5v + 2v + v) + 0v + 0v - 2v + 2v + 6v - v. 5v Expand -2i + i + 3i - 5i + 0i + 6i + (2 - 4 + 1)(i + 0i - 3i) + 2i - 4i + 3i. 6i Expand -4 + 8t + 3 + 1 + (-3 + 4 + 4)(t - t + 2t). 18t Expand (0 + 2u + 0)(-28 + 12u2 + 28). 24u*3 Expand -3l*4 + 3l4 + l4 + (0 + 2l2 + 0)(-l*2 - 2l + 2l) + (-2l*2 + 3l*2 - 3l*2)(l*2 - 2l + 2l) + 2l*4 - 7l4 + l4. -7l4 Expand (-4o + 4o - o3 + 0o*3 + 0o*3 + 2o*3 + (5o - o - 3o)(0o + 0o + 2o2) + o3 + 3o*3 - 6o*3)(1 - 2 + 4) - o*3 + 0o3 - o3. o*3 Expand -5m*2 + 6m*2 + 8m*2 - 23 + 23 - 6m*2 + (-3m - 2m + 6m)(3m + m - 6m). m2 Expand (2a*2 - 2 + 2)(1 + 1 - 3 - 2a) + 6a*3 - 3a*3 - 14a*3. -15a*3 - 2a*2 Expand (-8q - 2q4 + 4q*2 + 8q)(-q - 3 + 3). 2q*5 - 4q*3 Expand (d - 2d - 3d)(d*2 + 2d - 2d) - d3 + 2d3 + d3. -2d3 Expand (r2 + 2r*2 - 5r*2)(-r3 + r3 - 3r3) - 3 + 5r*5 + 3 - 2r5 - r2 + r*2 + (5 - 2 - 1)(3r - r5 - 3r) + 0r5 - 2r*5 + 4r*5. 9r5 Expand (-b2 + b*2 + 11b*2)(-3b2 + b3 + 3b*2 + (3b - b + 0b)(-1 + 1 + b*2)). 33b*5 Expand (2t + t - t)(3t - 11t + 11t) + 2t - 2t + 6t2. 12t*2 Expand (m - m - 6m)(2 + 3 - 1). -24m Expand -9a5 - 15a*5 + 8a*5 + (-a - 3a + 2a)(-1 + 1 + 2a)(2a2 - a3 - 2a*2). -12a*5 Expand -2x + 2x - 3x*3 - 11x*3 - 4x*3 + 6x*3 + 1 - 2x*2 - 2x*3 + 2x*2 + 0x - 2x3 + 0x + (-2 + 4 - 3)(x3 - 2x*3 + 0x*3). -15x*3 + 1 Expand (-2f + 3f - 2f)(-1 - 2f + 1)(1 - 5 + 3)(146f + 149f - 35f). -520f*3 Expand (0 + 1 - 3)(-6j4 + j4 + 3j*4 + (-3 - 1 + 2)(j4 + j3 - j*3) + 5j*3 - 5j*3 + 13j*4). -18j*4 Expand (0 + 1 + 5)(3m - m - 4m) + (-1 + 2 + 0)(-m - m + m) + 5m + m - 4m. -11m Expand (-q*3 - 2q*3 + 2q*3 + 2q*3 - 3q*3 + 2q*3 + (4 - 4 - 2q*2)(3q - 2q - 3q))((0q + 0q - 2q)(-1 + 0 + 0) + q + 5 - 5). 12q4 Expand (-1 + 2 + 0)(-5r + 5r + r*3)(r*2 + 16 - 16) + (-r + 2r*2 + r)(-4r + 2r*3 + 4r). 5r5 Expand (3 + 5 - 5)(1 - a - 1) + (5 + 4 - 2)(0a + 0a - 2a). -17a Expand (2c - 3c + 2c)(11 - 5c - 24 + 12). -5c2 - c Expand -5k + k + k + (-4 + 1 + 1)(k + 0k - 3k). k Expand (9d - 11d + 8d)(-2d - 3d + 6d). 6d2 Expand (7 - 6 + 11 + (-3 + 2 + 0)(2 - 5 + 4))(-2u*2 + 2u*2 + 2u*2) + 3u*2 + 2u*2 - 3u*2. 24u*2 Expand -k - 3 + 3 + (0k + k + k)(0 + 1 - 2) + (0 - 1 + 4)(-5k + 5k + 3k). 6k Expand (3v2 - 2v + 1293 - 1293)(2v*2 - 2v2 - v2). -3v4 + 2v*3 Expand (-3u + 4u + 0u)(-u + 1 - 5u + 4u). -2u*2 + u Expand (5b*2 - 2b2 - b2)(2 + 0 - 1) + (-2b + 5b - b)(-10 + 3b + 10). 8b*2 Expand (0 + 6 + 0q - q)(0 + 10q - 4 - 8q). -2q*2 + 16q - 24 Expand -3p2 + 0p + 2p2 - 2p + (6p - 7p + 12p)(2 + p - 2). 10p2 - 2p Expand -8w4 + 20 - 20 + (-2w*2 + 0w + 0w)(-2w2 + 4w*2 + 0w*2) + 2w*4 + 0w*4 + 0w*4. -10w*4 Expand (-2f + 3 + 0f - 2)(4f3 + 3f*3 - 4f*3). -6f*4 + 3f*3 Expand (n - 44 + 44)(-3n - 2n + 3n)(1 + 2 - 4) - 4 + 2n2 + 4. 4n*2 Expand (6j + j + 0j + (2j - 4j + j)(-4 + 3 + 3))(2j*2 + 2j - 2j). 10j*3 Expand (3 - 4 + 0 + (1 + 0 - 2)(-2 - 4 + 4))(-4k + k + 2k). -k Expand -7m*2 + 3m*2 + 2m*2 + (-4m - 4m + m)(-m + 2m + 0m) - 5m + 3m*2 + 5m. -6m2 Expand (-5 + 5 + h)(-4h + 3h - 2h)(-5h + 2h + 2h). 3h*3 Expand (-1 + 3 - 1)(i*5 + 5i*5 - 5i*5) + 2i*5 - 3i*5 + 2i*5 + 2i*5 - 2i*5 + 3i*5. 5i*5 Expand (4 + 3 - 5)(2k + 2k - 5k) + (3 - 6 + 2)(k - 3 + 3). -3k Expand (-3p - p - p)(-2p*2 - 3p*2 + 4p*2) - 1 + 2p*3 + 1. 7p*3 Expand (2l*2 - 2l*2 + 2l*4)(30 - 30 - 9l + (-4 + 2 + 3)(-l - l + l) - 1 + 1 - 2l). -24l*5 Expand (210 + 223 - 376)(2v2 + v2 - 4v*2 + (-2v + 2v - 2v)(-v - v + v)). 57v*2 Expand (10 - 2 - 29 + 5)(-u - 45 + 45). 16u Expand (4q*3 + 0q3 + q3)(3 - 3 + 2). 10q*3 Expand (-2 - 4a - a*2 + 4a)(4 + 0 - 6 + (1 + 0 + 1)(1 - 4 + 4) - 6 + 5 - 8). 9a2 + 18 Expand -2 - y + 2 + 1 + y - 1 + (-4 + 4 - y)(3 + 0 - 4). y Expand -4a + 3a + 0a + (3 + a - 3)(-1 + 0 + 0) + a - 2a + 2a + 0a - 6a + 2a + a - 2 + 2. -4a Expand (-2w2 + 0w*2 + 0w*2)(1 + 1 - 4) + 3w + 3w*2 - 3w + (3w2 - 5w2 - w2)(1 - 6 + 3). 13w*2 Expand (-u + 0u + 2u + (2 - 2 - 2u)(0 + 1 + 0))(6u - 1 - 7u + 0). u*2 + u Expand (0a + 5a - 2a)(0 + 1 - 3) - 3a + 2 - 2. -9a Expand (5 - b2 - 5)(0 - 6 - 16b + 2b*3 + 15b). -2b5 + b3 + 6b*2 Expand (-2o + 2o - o)(-69o2 - 2o + 35o2 + 40o*2). -6o*3 + 2o*2 Expand (-3 + 1 + 1)(-3 + 3 - 3)(3i + 0i - i). 6i Expand (2q - 2q - 2q)(2q3 - 4q3 + q3)(3q + 0q + 0q). 6q5 Expand (0 + 0 + q2)(4q - 2q - 3q) - 5q2 - q3 + 5q2 + (-9q + 9q - q2)(2 - 3q - 2). q3 Expand (7 + 2 - 3)(0m3 - 2 + m3 - 1). 6m*3 - 18 Expand -9l*2 + 9l*2 + 5l*4 + (l - l + 2l)(0 + 0 + 3l*3). 11l*4 Expand (6m - 23*m	{ "pile_set_name": "DM Mathematics" }
= -84 + 88. Suppose 5o - 84 = -zd, -o + 2d + 12 = -2d. Does 8 divide o? True Is (-13 - (-564 - -17))/(1/4) a multiple of 38? False Let s(y) = -y*2 - 11y + 11. Let h = 80 + -50. Suppose -5q - h = 15. Does 13 divide s(q)? False Let g(m) = -m3 - 11m*2 - 3m - 15. Let n be g(-11). Suppose -2x + 162 = -n. Is x a multiple of 15? True Let h = 24 - 19. Let m(u) = u3 + 2u*2 + 2u + 6. Is m(h) a multiple of 32? False Let o(y) = -y*3 - 29y*2 - 5y - 9. Let p be ((-10)/3)/5 - 170/6. Does 22 divide o(p)? False Let q = 8 + 0. Let j be (q - 1) + 0/5. Let a = -2 + j. Is 2 a factor of a? False Let y = -167 - -280. Does 8 divide y? False Let n be ((-144)/(-1))/((-2)/(-2)). Let k = n - 99. Does 9 divide k? True Let p = 154 + -133. Suppose -3x - 16 = t + 4, 14 = -2x - t. Is x/4(-238)/p a multiple of 3? False Suppose 0 = 2a - 4b - 970, 0 = -a - a - b + 970. Is 13 a factor of a? False Suppose 7m - 26520 = -13m. Is m a multiple of 17? True Let p(u) = -u2 + 25u - 2. Let j be p(30). Is (-3)/(((-18)/j)/(-3)) a multiple of 11? False Suppose -20 = 2x - 276. Suppose -4m + 4y = -x, 0m + 65 = 2m - 3y. Does 5 divide m? False Suppose -296 = 77f - 78f. Is f a multiple of 26? False Suppose -3n + 5n + 102 = 0. Let o = -8 - n. Is 11 a factor of o? False Is 24 a factor of ((-5772)/(-2))/13(-47)/(-2)? False Let w(u) be the first derivative of -15u*2/2 - 29u - 10. Is 9 a factor of w(-9)? False Let u = 495 + -135. Suppose u = -6r + 9r. Suppose -4v = v - r. Is v a multiple of 8? True Let y(r) = 3r*3 - 3r*2 - 2r + 1. Let d be y(6). Suppose 441 = 5p - d. Is 27 a factor of p? False Suppose 3m - 15m + 648 = 0. Is m a multiple of 54? True Let c(y) = -y2 + 4y - 1. Let o be c(4). Let l be -1o/(-3)-129. Suppose 0r - 44 = -5b + 3r, 4b - l = 5r. Is 5 a factor of b? False Let f(w) be the third derivative of w4/6 - 2w3 + w2. Let z be f(7). Let o = z + 17. Is o a multiple of 11? True Let c be (-2 - (-1 - 2)) + 29. Let b = c - 25. Is b a multiple of 3? False Suppose -4k + 111 = -749. Is k a multiple of 23? False Suppose 18n - 13n = 1590. Does 9 divide n? False Let g(d) be the third derivative of d5/60 + 7d*4/24 + 31d3/6 - d2 + 6d. Does 3 divide g(-7)? False Is 1(-718)/(-2) - 8 a multiple of 9? True Let y(a) = 80a3 - 2a*2 - 6a + 6. Is y(1) a multiple of 5? False Let y be (4/6)/(9/(-27)). Let k be (-20)/(y + 44/24). Suppose 7m = 2m + k. Is 8 a factor of m? True Is 22 a factor of (68/(-8))/(3/132-1)? True Let j = 16 + -23. Let q(o) = o3 + 11o*2 + 9o - 14. Let v be q(-10). Let s = v - j. Does 2 divide s? False Let a = -128 - -132. Suppose 3h - 2h = 2i - 23, ai + 3h = 61. Is 6 a factor of i? False Let c be 1385((-12)/(-20) - 1). Is 35 a factor of (-39)/(-26)c/(-3)? False Is 23 a factor of 42/63 - (-488)/6? False Let i(s) = -s3 + 4s*2 + 4s - 3. Let w be i(5). Is 5 a factor of (8/6 - -2)/(w/(-84))? True Let l = -12 - -1142. Is l a multiple of 22? False Let p be 11/((-88)/1792)6/(-8). Suppose 4j = -4u + p, 38 = -5j + 6j - u. Does 7 divide j? False Suppose 2r - v - 1706 = v, -2r - v + 1700 = 0. Is 24 a factor of r? False Let y be 162 + (0 - 3) + -2 + 1. Suppose -y + 1093 = 5d. Is 11 a factor of d? True Let w(z) = 32z - 286. Does 15 divide w(23)? True Let u(c) = -2c*2 - 20c - 1. Let w(o) = -o*2 - 1. Let x(i) = -u(i) + 3w(i). Is x(17) a multiple of 9? False Let i = -51 - -55. Suppose 0 = -2y - if + 26, 4y - 2f = f + 107. Is 5 a factor of y? False Let k(r) = -r*2 - 7r + 10. Let d = -32 - -24. Let x be k(d). Suppose 0u + 77 = xu - s, u + 4s = 52. Is 26 a factor of u? False Suppose -33n + 29n + 12 = 0. Let i(w) = w + 2. Let j be i(4). Is 4/j + 43/n a multiple of 15? True Let j(v) = -55v + 429. Does 13 divide j(0)? True Let i = -24 + 26. Suppose 0 = 2n + 2s - 44, -2n + is + 124 = 3n. Does 6 divide n? True Suppose 0 = -4k - 0k + f + 1, k = 5f + 5. Suppose k = 9n - 13n + 180. Is n a multiple of 9? True Suppose -58 = -2c + 5w, -3c + 77 - 7 = w. Suppose -2t + 10 = 2x, 3t - 2x - 2x - 1 = 0. Let o = c - t. Does 9 divide o? False Let a(b) = b*2 + 7b + 8. Let v = -15 + 9. Let j be a(v). Suppose -26 = -4x + j. Is 3 a factor of x? False Let s(z) be the first derivative of -z5/20 - 7z*4/12 - 5z*3/6 - 7z*2/2 + 8z - 8. Let q(j) be the first derivative of s(j). Does 10 divide q(-7)? False Let l = 8 + -14. Let r be 3 - 0/(-3 - l). Does 5 divide r/(-2)(-64)/6? False Let b(m) be the third derivative of -m5/60 + 3m*4/8 - 3m3/2 + m2 + 4. Suppose 2 = 3l + 5j - 11, -l - 4j = -2. Is b(l) a multiple of 9? True Let v(o) = o3 + 10o*2 + 10o + 13. Let k be v(-9). Suppose kz - 66 - 6 = 0. Does 18 divide z? True Let p = -251 + 359. Suppose -2g - 2r + p = 0, -4r = -4g - r + 237. Is g a multiple of 19? True Suppose 3g - 2a = g + 204, 4a + 108 = g. Is g a multiple of 23? False Let x = 139 - 139. Suppose -5w = 5, -j + xj = -5w - 115. Is 10 a factor of j? True Suppose -10 = -7i + 11. Suppose -2b + 210 = ib. Does 6 divide b? True Suppose -4n + 223 = -5f, -70 - 74 = -2n - 4f. Let s = n - -5. Is s a multiple of 15? False Does 60 divide (-34)/221 - 11652/(-26)? False Suppose 3a - 3 = -3y, 0 - 5 = -a + 3y. Let w be a/12 + 7/(-42). Suppose wq + 45 = 5q. Is q a multiple of 4? False Let u(t) = 25t - 60. Is 29 a factor of u(14)? True Let f = 7286 - 4088. Is f a multiple of 17? False Suppose 0 = -5p + r + 3, -2p + p - 4r = -9. Suppose 8 = 5x - 47. Suppose j - x = -p. Is 5 a factor of j? True Is 35 a factor of 564 + (14 - 22)1/2? True Let y(u) = -u - 1. Let b(h) = 3h - 27. Let f(c) = 5c - 40. Let q(w) = -7b(w) + 5f(w). Let s(d) = -q(d) - 3y(d). Is s(-5) a multiple of 7? False Let c be ((-10)/(-4))/((-1)/(-2)). Let y(s) = 7s2 - 9s + 23. Let z be y(2). Suppose 2w - z = k + 105, cw + 4k = 358. Is 11 a factor of w? False Let q = -295 - -353. Is q a multiple of 29? True Suppose -1545 = -3f + 5a, 2f - 5a - 607 - 418 = 0. Is 10 a factor of f? True Let s(t) = 1 - 3 - 2t - 5 - 6. Let u be s(-8). Is 12 a factor of ((-16)/(-2))/(2/u)? True Does 15 divide (-36)/(-132) - 5277/(-11)? True Suppose -5d - 220 = -20. Let z = d - -58. Does 18 divide z? True Suppose -2v = -3l - 1, -5v + 12 = 3l - l. Let o(s) = l + s - s + 24s3 - s2 + 0s. Is o(1) a multiple of 12? True Suppose 10c - 587 = -37. Is c a multiple of 5? True Suppose -4m + 7048 + 1796 = 0. Is 33 a factor of m? True Let l(o) = -o2 - 5o + 14 + 20o + 7o. Is l(21) a multiple of 10? False Let p = -5 - -10. Suppose 4t - py = 173, 5t + 0t + y - 180 = 0. Is t a multiple of 5? False Suppose 2n = 11 - 1. Suppose 39 = -nu + 2u. Let g = u - -22. Is g a multiple of 3? True Suppose -9c - 190 = -928. Suppose -2t + c = y, -3y + 251 = t - 0t. Is 14 a factor of y? True Is 4 - ((-72438)/90 - 6/45) a multiple of 15? False Let w(u) = -u3 - 12u*2 - 12u + 14. Let n be (4/(-10) + (-252)/(-80))-4. Is w(n) a multiple of 25? True Let k = 5 + -72. Let p = 112 + k. Is (2 - 1) + p + -2 a multiple of 11? True Suppose -14 = -3z - z + p, -5p - 6 = -4z. Suppose 711 = 5k + zk. Is k a multiple of 25? False Let v be (-7 + 8)(-1 + 3). Suppose l + vl = 27. Is 8 a factor of l? False Suppose 2i + 2i + 4 = 0. Let b(u) = -13u + 2. Let z(s) = -38s + 6. Let c(v) = -14b(v) + 5z(v). Is c(i) a multiple of 2? True Let l(f) = f*3 - 5f*2 - 5f - 4. Let j be l(6). Let p be ((-3)/(-6))/(j/(-116)). Let x = -21 - p. Does 6 divide x? False Suppose -4y + 2z = y - 269, -3y - 3z + 153 = 0. Let a = y + -46. Is 2 a factor of a? False Suppose 170 = -5p - 5l, 4p + 138 = 5l + 38. Let b be (-2)/10 + 54/p. Let x = b + 8. Is x a multiple of 3? True Let p = 391 + -91. Is p a multiple of 25? True Suppose -22 = 2z + 2. Let t(h) = -15h + 9. Let s be t(z). Suppose p = -2p + s. Is p a multiple of 8? False Let k = 4736 - 2931. Is 85 a factor of k? False Let j(x) = 4x*2 - 33x - 109. Does 27 divide j(17)? True Let u = 149 + 1798. Is 11 a factor of u? True Suppose 0 = 8b - 13b + 105. Suppose -l + 77 = 2c - 42, 4l = -4c + 248. Suppose -f + c = -b. Is 21 a factor of f? False Suppose -3j - 4a + 42 = 0, 5j - 4a = -3a + 47. Suppose 11c - 84 = jc. Is 14 a factor of c? True Let t(x) = -3x*	{ "pile_set_name": "DM Mathematics" }
138116 What is the least common multiple of 3720 and 26? 48360 What is the smallest common multiple of 12 and 592? 1776 What is the smallest common multiple of 162976 and 6? 488928 Calculate the least common multiple of 1054 and 40269. 1369146 What is the least common multiple of 1008 and 364752? 2553264 What is the common denominator of -53/1647184 and 121/20? 8235920 Calculate the lowest common multiple of 23823 and 87351. 262053 Calculate the least common multiple of 84 and 13918. 584556 Find the common denominator of 105/6812 and 137/20436. 20436 Calculate the smallest common multiple of 63966 and 112. 511728 Calculate the smallest common multiple of 12 and 46524. 46524 Calculate the common denominator of 81/10 and 11/114910. 114910 Find the common denominator of 71/17464 and 86/163725. 1309800 Calculate the smallest common multiple of 66349 and 4. 265396 Calculate the smallest common multiple of 358 and 6086. 6086 Calculate the common denominator of -3/107770 and 13/12. 646620 Find the common denominator of 67/16815 and -41/5035. 891195 What is the lowest common multiple of 195637 and 1010? 1956370 What is the common denominator of 87/58036 and 15/36932? 406252 Calculate the common denominator of 139/20736 and -125/288. 20736 Find the common denominator of 169/4032 and -13/3168. 44352 Calculate the smallest common multiple of 4368 and 7644. 30576 Calculate the common denominator of 13/12132 and 65/12. 12132 Find the common denominator of -151/8556 and 22/303. 864156 Find the common denominator of -29/169812 and -79/6. 169812 What is the lowest common multiple of 44064 and 748? 484704 What is the lowest common multiple of 3834 and 426? 3834 Find the common denominator of 101/4 and -43/36780. 36780 Calculate the common denominator of -26/111 and 61/12171. 450327 What is the lowest common multiple of 30 and 520110? 520110 What is the least common multiple of 55 and 90145? 90145 What is the least common multiple of 189720 and 87420? 8916840 Calculate the smallest common multiple of 1861410 and 15. 1861410 Calculate the common denominator of 31/2390 and -121/4780. 4780 What is the common denominator of 121/868 and -31/1169? 144956 What is the common denominator of 73/156438 and -19/33? 1720818 Calculate the least common multiple of 115 and 5070. 116610 Calculate the common denominator of 123/10760 and -99/9128. 12277160 Find the common denominator of -95/57192 and -55/271662. 1086648 Calculate the common denominator of -85/19872 and -151/17388. 139104 What is the common denominator of 97/194616 and -149/55332? 5643864 Find the common denominator of -55/495838 and 73/4494. 1487514 Calculate the common denominator of 61/5 and 44/21965. 21965 Find the common denominator of 139/41490 and 57/682280. 6140520 What is the common denominator of -10/271881 and -15/60418? 543762 Calculate the least common multiple of 14868 and 324. 133812 Calculate the lowest common multiple of 110 and 20594. 1132670 What is the least common multiple of 101468 and 4? 101468 What is the common denominator of -149/2860 and 99/38740? 426140 What is the smallest common multiple of 8 and 32991? 263928 What is the smallest common multiple of 495 and 208197? 1040985 Calculate the lowest common multiple of 381288 and 9. 1143864 Calculate the common denominator of -69/16070 and 85/6428. 32140 Calculate the common denominator of 31/6954 and -11/123. 285114 Calculate the smallest common multiple of 10902 and 474. 10902 Calculate the lowest common multiple of 2139 and 506. 47058 Find the common denominator of -133/90 and 1/10860. 32580 Find the common denominator of -11/3864 and 157/1932. 3864 Calculate the smallest common multiple of 2138790 and 60. 4277580 What is the lowest common multiple of 46360 and 1300? 3013400 What is the lowest common multiple of 499896 and 59736? 9498024 What is the smallest common multiple of 498485 and 40? 3987880 What is the smallest common multiple of 76 and 2743? 208468 Calculate the smallest common multiple of 1278248 and 10. 6391240 What is the lowest common multiple of 8425 and 11795? 58975 Find the common denominator of 11/45128 and 59/14. 315896 Find the common denominator of 79/7536 and 25/7536. 7536 Find the common denominator of -65/88 and 6/1301245. 10409960 Find the common denominator of -179/2460 and -59/2136. 437880 Calculate the least common multiple of 233172 and 233172. 233172 Find the common denominator of 5/696 and 169/30. 3480 What is the lowest common multiple of 1512 and 50976? 356832 What is the common denominator of -62/89067 and 80/33? 89067 Find the common denominator of -67/554644 and 1/44. 6101084 Calculate the common denominator of 5/72 and 74/250425. 2003400 Find the common denominator of 50/39931 and -7/10. 399310 What is the least common multiple of 11508 and 6? 11508 What is the least common multiple of 319 and 3799? 41789 What is the lowest common multiple of 5148 and 396? 5148 What is the lowest common multiple of 28251 and 12? 113004 What is the smallest common multiple of 1236 and 2266? 13596 Find the common denominator of 99/1498 and 37/64. 47936 Find the common denominator of -57/170870 and 131/30. 512610 Calculate the common denominator of -59/13215 and -85/78. 343590 Calculate the common denominator of -43/168 and -139/1008. 1008 What is the common denominator of -35/93076 and 43/511918? 1023836 Calculate the smallest common multiple of 24 and 1633. 39192 Calculate the least common multiple of 2460 and 44. 27060 Find the common denominator of 67/167214 and -32/29. 167214 Calculate the common denominator of 39 and 83/16490. 16490 What is the smallest common multiple of 1891 and 2867? 88877 What is the lowest common multiple of 333866 and 26? 333866 Calculate the least common multiple of 18291 and 3752. 146328 What is the lowest common multiple of 694 and 130472? 130472 What is the smallest common multiple of 27764 and 20? 138820 Calculate the common denominator of -37/14310 and 74/477. 14310 What is the lowest common multiple of 81600 and 150? 81600 Calculate the common denominator of 115/1062 and 52/60219. 7105842 Find the common denominator of 17/38450 and 21/16918. 422950 Calculate the common denominator of 13/3222 and -79/18. 3222 Calculate the least common multiple of 5859 and 3069. 64449 Find the common denominator of 43/1511472 and 65/12. 1511472 What is the least common multiple of 1584 and 30096? 30096 What is the lowest common multiple of 3900 and 163800? 163800 What is the least common multiple of 726 and 4092? 45012 What is the least common multiple of 829260 and 126? 5804820 What is the smallest common multiple of 21008 and 4784? 483184 What is the common denominator of 157/38670 and -97/23202? 116010 Calculate the least common multiple of 77820 and 120. 155640 Calculate the lowest common multiple of 17641 and 161. 123487 Calculate the least common multiple of 3398 and 20. 33980 What is the least common multiple of 51609 and 132? 2270796 What is the common denominator of -13/224308 and -83/36? 2018772 Calculate the least common multiple of 530760 and 160. 2123040 What is the lowest common multiple of 366 and 33231? 4054182 Calculate the smallest common multiple of 120080 and 44. 1320880 Find the common denominator of -38/275 and 71/18865. 94325 Calculate the common denominator of -38/14883 and -47/34276. 1131108 Calculate the smallest common multiple of 3850 and 368225. 5155150 Find the common denominator of 79/17292 and -44/393. 17292 What is the least common multiple of 2094 and 6980? 20940 Calculate the least common multiple of 12771 and 645. 63855 Find the common denominator of 119/65556 and -73/14568. 131112 Calculate the least common multiple of 6360 and 840. 44520 Calculate the common denominator of -71/56436 and -61/47030. 282180 Calculate the least common multiple of 1890468 and 407748. 20795148 Calculate the lowest common multiple of 376 and 6392. 6392 What is the lowest common multiple of 232 and 2768? 80272 Calculate the common denominator of 12/588497 and 4/84071. 588497 Calculate the common denominator of -13/6525 and 43/29145. 437175 Calculate the common denominator of -1/350 and 61/125320. 4386200 Calculate the common denominator of -47/142 and -31/164010. 164010 Calculate the co	{ "pile_set_name": "DM Mathematics" }
hat is the value of -30(-7)/140(-49)/292/(-161)? 21 ((-91)/(-24206)-95)/(15/61) -1/7 Calculate ((-9)/48(-420)/(-525))/(12/8). -1/10 What is 18150/432(-6)/(-30)? 5/4 ((-3150)/3780)/(5/((2/1)/(-12))) 1/36 Calculate ((-6)/(-3)2/10)/((-40533)/3435). -2/59 What is 3833/68994(4/5)/(4/(-50))? -5/9 (((-16800)/1120)/(537))/((9/(-2))/(-3)) -2/37 What is ((-43)/((-39732)/(-539)))/(49/70)? -5/6 What is (12/(-7))/(7590/3220)? -8/11 Calculate ((14/(-21))/((70/3)/7))/((-1456)/22880). 22/7 ((16/10)/((-10496)/3280))/(-22/(-352)) -44 Evaluate (16548/(-3940))/(((-4)/(-12))/(40/(-6))). 84 What is the value of ((-8540)/(-2562)6/(-14))/(1/((-56)/2))? 40 What is ((12/9)/(-2))/((-636)/(-63918))? -67 Calculate (33/1848-7)/(6/(96/4))-124. 62 Evaluate ((30/(-24))/(-1))/((500/360)/((-25)/(-15))). 3/2 77/(-66)(-45)/140 3/8 What is (3/6)/(((81/(-6))/1)/(948/4108))? -1/117 What is (44/10)/(1453/2906012/(-9))? -66 Evaluate (12/((-96)/(-20)))/(-2(-5)/(120/18)). 5/3 What is ((-41)/((-9020)/360))/(36/132)? 6 Calculate 12/((12/(-2))/((-34)/(-68))). -6 Calculate (-3885)/(-7770)(-642)/(-3). 107 What is (-39)/(-10)(-1056)/936? -22/5 What is (6160/(-105))/(6(-24)/216)? 88 What is the value of ((-5)/(-3))/((-44)/110(-75)/(-108)-2)? 3 ((-8)/((-376)/14142/(-8)))/((-268)/(-14)) -2/67 Calculate ((-4857)/(-16190))/(((-18)/3)/(5-53)). 53/4 (141/611)/((-189)/(-78)) 2/21 Evaluate 6995/16788(32/9)/((-435)/36). -2/87 Calculate 45(-336)/(-360)(-5)/(-105)12. 24 Evaluate -2(6/(-369))/((-100)/(-225)3). 1/41 42(-16)/6(-1197)/(-6384) -21 18(-2)/12(-7)/(168/(-376)) -47 Evaluate (((-2)/2)/(-7))/(((-57270)/91798)/345). -79 (1/8)/(36/(-48))90/(-9) 5/3 (46/138)/((-2)/(-3))66 33 Calculate (8985/21564)/(-3(-2)/216). 15 (195/(-10075))/((-288)/(-480)) -1/31 (3543/14172)/((-1)/(-108)) 27 Calculate (2/12)/((-64)/(5702400/(-1125))). 66/5 ((-4)/(-240))/((-4)/(-5)(-46)/(-92)) 1/24 Calculate (42900/120)/1432/(-1). -5 (228/(-435024)-212)/(2/32) 16/9 (6057/50475)/((-3)/(-70)) 14/5 Evaluate (-201)/(-13065)5(-3)/(-24)4. 1/26 Evaluate ((1440/200)/(-36))/(14/364). -26/5 (-2784)/4805/((2/3)/(34/(-51))) 29 Evaluate 10(107/((-170665)/(-348)))/(3/((-99)/(-6))). 12 Evaluate 9888/(-103)((-70)/35)/(64/(-6)). -48 (255/340)/(3/2)60 30 What is the value of 330/(-36)3984/1660? -6 Calculate 114672/(-1408). -21 Calculate 364((6/(-33))/((-122)/671))/2. 72 ((-9)/5942)/(((-1127)/(-42))/23) -2/77 What is (-6)/(-2)84/(-9)3(-260)/273? 80 (4960/100)/((-1616)/(-1010)) 31 (10/(-14))/((-11)/(-22)238/(-2499)) 15 What is the value of 8/156(21/(-21))/((-10)/15)? 1/13 50(16632/2100)/(-99) -4 What is ((-1118)/(-3354))/(((-12)/(-27))/(-2))? -3/2 Evaluate ((-8)/(-36))/((-10)/12)657/(-73). 12/5 Evaluate ((-208)/(-39))/(31144/(-2061)). -6/17 What is the value of (94/(-10))/(15(-82)/6150)? 47 Evaluate (((-726)/18)/(-11))/((-3)/(-2)86/(-258)). -22/3 What is the value of (-18)/4(-80)/1813/((-390)/102)? -68 Calculate (-12)/(-90)1(-288)/((-128)/(-8)). -12/5 Calculate ((-32550)/4340)/(290/(-4))-2(-1)/6. 1/29 Calculate ((-259)/(-121471))/((-4)/324). -2/469 Evaluate ((-640)/(-70))/(-8)84630/(-1560). 62 What is 5/21(-9537)/(-15895)? 1/7 (-54)/44660/1398 -45 Calculate 3/9010/(-8)3960/(-14850). 0 Calculate (-30)/40-12510/(-45)-1. 102 What is (-366)/1830(-480)/(-24)? -4 Calculate (-110)/551247/(-86). 29 What is the value of (75/(-600))/((-5)/28)30/4? 21/4 Calculate 5292/(-42)(-36)/72. 63 What is the value of (46/(1/(-1)))/(6/(-90)30/4)? 92 What is the value of 6(-14)/(3136/(-21))6/(-18)? -3/16 What is (-3)/1095/6897-22? 1/11 What is (-75)/8(-1868)/(-2335)? -15/2 What is the value of 377/((-135)/(29700/(-715)))? 116 What is 68/142244788/629034? 52/3 What is ((18/180)/((-11)/(-2)))/((-8)/1600-10)? 4/11 Evaluate ((-39)/30)/13(-15)/42-6. -3/14 What is 13/26020((-4)/10)/((-8)/(-240))? -12 What is 245544/(-9444)(-64)/(-26)? -64 What is 2/(-18)(-5934)/45494? 1/69 Evaluate 18713/286((-6)/(-4))/((-24)/(-32)). 17 Evaluate ((-15)/63)/((-12)/(-42)). -5/6 Evaluate 8/104/((-96)/(-140))4342/(-2338). -26/3 Evaluate ((-14)/(-196))/(4/18(-423)/(-564)). 3/7 Evaluate 4/(-78)195/(-180)64/((-4)/(-2)). 16/9 Calculate (-4)/(56/119)207348/(-15878). 111 Calculate (112(-135)/(-6300))/(18/10020/24). 16 Evaluate 30/(-900)(-84)/(-63). -2/45 (2/(-10)55/(-3))/((-1955)/(-1173)) 11/5 (4/(-6))/((11280/90)/47)-208 52 (((-216)/(-90))/((-90)/(-150)))/((-1)/1122) -2/61 Calculate (-3)/6-110(-13)/(2730/(-252)). 66 What is (-2(-180)/1820)/(60/280)? 12/13 What is the value of (2(-2)/(-8))/((22154/(-1060))/(-11))? 5/19 Evaluate 7/(-1)(-1196)/(-2898)-9. 26 What is the value of (38/21616/15352)/((-2)/(4/(-7)))? 4/7 (195/(-1380))/(221/(-34)) 1/46 What is the value of 6/(-18)2628/8322? -2/19 Evaluate (744998/22015)/(6/(-14)(-14)/40). 112 What is -9(-5)/(-1160)(-80)/30? 3/29 What is the value of ((-2)/(-574))/(300/((-3402000)/(-270)))? 6/41 What is (230/6)/((14/63)/(2620/1950))? 46 What is (-8)/(-8)-4436/(-5014)? 8/23 Evaluate 2/(-4)29658/(-84031). 3/17 Evaluate 111(-52(-150)/10400)/(11/4). 3 What is the value of (741972/354123)/((-33)/14)? -8/9 What is ((-3456)/486)/(9(-20)/1620)? 64 What is the value of ((-4)/(-33)1(-7106)/(-76))/(16/168)? 119 (2325/8680)/(((-9)/(-21))/((-4)/7)) -5/14 What is (15/(-54))/((-47810)/6147)-16? -4/7 What is ((-592)/3700(-15)/(-6))/((-27)/120)? 16/9 Evaluate ((-1)/3)/((893/(-38))/(-47))-178. 52 Calculate (72/(-612)-34)/((-8470)/(-55)). 2/77 What is 2703/(-10812)22/1? -11/2 (68/170)/((45/30)/(-3)) -4/5 What is the value of (-184/96)/(15/60)1? -3 (-3)/(-6)(-20)/(-25)4230/(-36) -47 What is (3/(-4))/(((-19580)/352)/(-89))105? -126 What is (318/(-583))/(-17(-14)/10472)? -24 ((16490/935)/(-97))/((-38)/132) 12/19 Evaluate (640/(-100))/(2248/(-40745)). 116 What is ((70/15)/14(-15)/(-100))/(115/1610)? 7/10 ((1504/(-3807))/(-16))/((-1)/((-6)/2)-1) -2/27 What is (-9)/(-39)559/1419? 1/11 (5639/(-273))/((-7)/631) 72 -6(-10)/1521(-12)/(-168) 6 Calculate (((-318)/(-9))/(-1))/(((-20)/(-75))/((-10)/(-25))). -53 What is ((-1)/(-9))/(379/(161454/(-3195)))? -2/135 What is the value of ((360/576)/((-5)/12))/(90/24)? -2/5 What is the value of ((-7)/196-7)/(15/(1980/(-341)))? -3/31 What is the value of -386046/(-2760)? 43 What is the value of -398/(-104)(4-9)/(-4)? 27 What is the value of (-1764)/(-11424)1748? 126 48/533480/(-8928) -36 What is 1((-385)/21)/113648/160? -38 Evaluate ((-6)/30)/((-132)/(-25740)1443). -1/37 -76(-1525)/7686 25/3 Calculate 62566/(-82)(-78)/(-546). -109 What is the value of (20/54)/((-460)/3312)? -8/3 ((-48)/32(-1)/3)/((460/680)/23) 17 ((-3)/40)/(249381/110836) -1/30 What is the value of 615/20(-1068)/(-801)? 41 Calculate (-27)/18((-532)/(-33))/(-19). 14/11 What is (22/11)/(3570/(-105))? -1/17 (((-1155)/10)/(-7))/12360/(-708) -55 Evaluate (39/(-884))/((-1233)/4658). 1/6 Evaluate (22/74746/(-1356))/((-2)/(-38)). -38 (-39476/(-2652))/((-266/8)/3) -14/13 What is the value of (8151/114)/(-143)(-51)/(-6)? -17/4 Calculate (((-29744)/110)/13)/((-21)/((-1050)/(-20))). 52 Evaluate 66/8411504/(-1043988). -2/231 Evaluate (-23)/(-2)(-66630)/(-11105). 69 What is ((-35)/(-2030))/(-12(-23)/1656)? 3/29 What is the value of (-45)/30112/(-24)(-12)/(-14)? 6 (2/3)/((-48)/89127510/14672) -33/5 Calculate ((6/1)/((-21273)/(-2026)))/(95/(-7)-2). 2/95 Calculate ((32/(-20))/((-4416)/(-690)))/((-50)/(-8)). -1/25 What is the value of (-30760)/(-9228)(-18)/35? -12/7 Calculate 215/258((-11)/(-44)-6)/(4/(-3)). 15/16 Calculate ((-25758)/54)/53-1. 9 What is the value of 52(2/(56/(-21)))/114/147? -26/7 Evaluate -6(((-3276)/135)/26)/((-28)/40). -8 -1215/450(-4375)/125 14 ((-24)/429)/(5430/405) -2/143 (-5)/20-44(-4)/(-6)(-396)/88 -33 What is the value of (-79(-435)/(-45820))/((-3)/(-152))? -38 What is ((-909)/3333)/((-114)/176)? 8/19 What is the value of (-3904)/(-53680)(-5)/(-6)21? 14/11 What is 903/1204(-11)/(-3)? 11/4 (-3)/6((-132)/99)/29/22 3/22 What is the value of 181((-8)/(-204))/(46/(-23))? -6/17 Evaluate (-42)/(-56)(208/28)/(-13). -3/7 What is the value of ((5538/142)/(-117)3/242)/((-2)/(-8))? -2/121 What is ((992/372)/((-5)/5))/(12/(-117))? 26 What is 5(-22)/(-462)*147? 35 What is the value	{ "pile_set_name": "DM Mathematics" }
3 - 3/8r2 - m. Factor f(k). (k - 1)2(k + 2)/4 Find q, given that 2/5q - 8/15 + 2/15q*2 = 0. -4, 1 Suppose -24 + 4 = -4c. Factor 5/2x3 + 5/2x*2 + 1/4 + 1/4x*c + 5/4x*4 + 5/4x. (x + 1)*5/4 Suppose 5v = -v + 13v. Let y(l) be the third derivative of 1/1008l*8 - 1/180l*5 - 1/360l*6 + vl*3 + 1/630l*7 + 0 + 0l + 0l4 + l2. Factor y(k). k2(k - 1)(k + 1)2/3 Let w(b) be the second derivative of 1/9b*4 - 4/9b*3 - b - 4/63b*7 + 4/15b*5 - 1/45b*6 + 0 - 1/3b*2. Determine i, given that w(i) = 0. -1, -1/4, 1 Let i = -324 + 324. Find u, given that i - 1/3u*2 + 1/3u = 0. 0, 1 Factor 0 - 12f2 - 33f*4 + 15/2f*5 + 42f*3 + 0f. 3f2(f - 2)*2(5f - 2)/2 Let h = -3 + 7. Let v(o) = 8o + 202. Let d be v(-25). What is q in -8/7q + 24/7q*d - 26/7q*3 + 12/7q*h + 0 - 2/7q*5 = 0? 0, 1, 2 Let n = -9 - -12. Factor -4/13 - 14/13g + 6/13gn - 4/13g*2. 2(g - 2)(g + 1)(3g + 1)/13 Let z(q) = -7q*5 - 5q*4 + 11q*3 - 9q*2 - 5q. Let h(n) = -3n5 - 2n*4 + 5n*3 - 4n*2 - 2n. Let r(x) = -10h(x) + 4z(x). Factor r(p). 2p2(p - 1)*2(p + 2) Let z be (-8)/(-6)(8 - 5). Suppose 11c*3 + 7c + c - 16c2 - 2cz - c3 = 0. What is c? 0, 1, 2 Let m = 23/45 + -4/9. Let o = 13/30 + m. What is h in oh3 - 1/4h*4 + 0h + 0 - 1/4h2 = 0? 0, 1 Let x(j) be the third derivative of j6/30 + j5/15 - j4/6 - 2j*3/3 - 16j*2. Factor x(t). 4(t - 1)(t + 1)2 Factor 3z + 0 - 3/2z3 + 3/2z*2. -3z(z - 2)(z + 1)/2 Suppose 2f - 2 - 8 = 0. Suppose -4p + f = -23. Factor 12b3 - pb + 3b + 4b*4 + 2b*2 - 2b*3. 2b(b + 1)(b + 2)(2b - 1) Let t(c) = -4c5 + 4c*3 + 2c2. Let j(a) = -a5 + a4 + a3. Let s(x) = 2j(x) - t(x). Factor s(d). 2d*2(d - 1)(d + 1)2 Let f(p) be the second derivative of 0p*3 - 1/120p*5 + 0 - 1/48p4 - p2 + 2p. Let c(n) be the first derivative of f(n). Factor c(i). -i(i + 1)/2 Let h(p) = 4p3 + 17p*2 + 3p. Let i(x) = -2x3 - 8x*2 - 2x. Let a(k) = 2h(k) + 5i(k). Solve a(n) = 0. -2, -1, 0 Factor -188h3 - 4h*2 + 2 + 2h*4 + 188h*3. 2(h - 1)*2(h + 1)*2 Let q(c) be the third derivative of 1/6c*4 + 0c - 4c2 + 1/2c*3 + 0 - 1/60c*5 - 1/180c*6. Let m(b) be the first derivative of q(b). Factor m(v). -2(v - 1)(v + 2) Let p(h) = -2h*2 + 2h + 2. Let l be p(3). Let b be ((-4 - -2)2)/l. Factor 0m + 2/5m2 - b. 2(m - 1)(m + 1)/5 Let d(p) be the second derivative of p5/2 - 2p*4/3 - 7p*3/15 + 2p*2/5 + 2p. Let d(k) = 0. Calculate k. -2/5, 1/5, 1 Let p(o) be the third derivative of -11o5/20 - o4/4 + 10o*2. Factor p(s). -3s(11s + 2) Let p(m) be the second derivative of m*6/120 + 3m*5/40 + 7m4/48 - m3/4 - m*2 - 4m + 6. Find v, given that p(v) = 0. -4, -2, -1, 1 Let w = -43/3 - -89/6. Solve wp2 + 0p*3 + 0p + 0 - 1/2p4 = 0 for p. -1, 0, 1 Factor -2/3j*3 + 0 + 2j + 4/3j2. -2j(j - 3)(j + 1)/3 Let i(d) be the first derivative of d7/56 + d6/60 - 5d3/3 - 1. Let q(h) be the third derivative of i(h). Determine c so that q(c) = 0. -2/5, 0 Let a(d) be the first derivative of d9/4032 - d8/2240 - d7/1120 + d6/480 + 4d*3/3 - 6. Let b(t) be the third derivative of a(t). Factor b(u). 3u*2(u - 1)*2(u + 1)/4 Determine u, given that -4u4 + 18u + 10 + 6u4 + 30u*2 - 10 + 14u*3 = 0. -3, -1, 0 Let w(l) = 29l*2 - 13l*2 - 15l2. Let y(h) = h3 + 3h2 - h - 1. Let m(c) = -2w(c) + y(c). Determine b so that m(b) = 0. -1, 1 Factor -14/3r - 2/3r*4 - 10/3r*3 - 4/3 - 6r*2. -2(r + 1)*3(r + 2)/3 Let w(s) be the second derivative of -1/78s4 + 1/195s*6 + 0 + 0s*2 + 0s*3 + 0s*5 + s. Factor w(c). 2c*2(c - 1)(c + 1)/13 Suppose -8c + 4c = -12. Let n(f) be the second derivative of -1/10f*5 + 1/6f*4 - 1/15f*6 + 0f*2 + f + 0 + 1/3fc. Solve n(a) = 0 for a. -1, 0, 1 Let s(v) be the third derivative of -v7/735 + v6/420 - v2. Factor s(i). -2i3(i - 1)/7 Let j be 43/(-516)(16/10)/(-2). Let u(m) be the second derivative of 0m*2 + 1/75m*6 - 3m + 0 + 3/50m5 + jm*3 + 1/10m*4. Factor u(i). 2i(i + 1)3/5 What is a in 0a*2 + 1/3a*3 + 0 - 1/3a = 0? -1, 0, 1 Suppose 5c - 3c + o - 32 = 0, o = 3c - 38. Let i be 20/c - (-24)/42. Determine w so that 0w*4 - 9/5w*3 - 6/5w*i + 3/5w*5 + 0 + 0w = 0. -1, 0, 2 Determine u, given that -18/5u2 - 12/5 - 3/5u*3 - 27/5u = 0. -4, -1 Suppose 323g4 - 128 + 697g*4 - 334g*4 - 4900g*3 - 1328g - 4536g2 = 0. Calculate g. -2/7, 8 Let w(r) = -r2 - r - 1. Let t(x) = 5x*2 - x + 3. Let h(q) = t(q) + 6w(q). Let n(y) = -2y2 - 8y - 4. Let k(s) = 4h(s) - 3n(s). Factor k(i). 2i(i - 2) Let d be 18/12(-1)/(-9). Let k(w) be the second derivative of -w2 + 0 - dw*4 - w + 2/3w3. Let k(i) = 0. Calculate i. 1 Let q(s) be the first derivative of -s4/12 - 5s3/9 + s2/6 + 5s/3 + 45. Determine n, given that q(n) = 0. -5, -1, 1 Let v(z) = -z*2 + 9z - 20. Let c be v(5). Let 1/2t + c - 1/2t*3 + 1/2t*2 - 1/2t*4 = 0. What is t? -1, 0, 1 Let q(a) be the first derivative of -7 + 1/9a*3 + 1/30a*5 + 0a + 1/8a4 + 0a2. Factor q(y). y2(y + 1)(y + 2)/6 Let t(h) be the second derivative of -h6/195 + h5/130 + h*4/26 - 5h*3/39 + 2h*2/13 + 5h. Let t(q) = 0. Calculate q. -2, 1 Let o(k) = -19k2 + 16k*2 - 6k + 2 - 4 + k*3. Let l(p) = 4p*3 - 8p*2 - 18p - 6. Let n(g) = -3l(g) + 10o(g). Solve n(i) = 0. -1 Let n = 5 - 0. Factor 7l4 - 3l*5 + 3l - nl2 - l4 - l2 + 0l*5. -3l(l - 1)3(l + 1) Let j(h) be the first derivative of -4h - 3h*2 + 6 - 2/3h*3. Factor j(z). -2(z + 1)(z + 2) Let g be 5/18(-9)/(-15). Let f(w) be the third derivative of 0 + 0w + 1/60w*5 + 2/3w*3 - 2w*2 - gw4. Factor f(r). (r - 2)2 Let z(d) be the third derivative of 0 + 0d3 + 1/360d*6 + 0d*5 + 0d + 0d4 - 2d*2 - 1/315d*7 + 1/1008d8. What is n in z(n) = 0? 0, 1 Let p(h) be the second derivative of -h5/10 + h*3/3 + 3h. Factor p(n). -2n(n - 1)(n + 1) Factor -1/3x - 1/6x2 - 1/6. -(x + 1)2/6 Factor 4/9 - 2/9m*2 - 2/9m. -2(m - 1)(m + 2)/9 Let n(j) be the third derivative of j8/6720 + j7/1680 + j*5/20 - 2j*2. Let s(r) be the third derivative of n(r). Factor s(z). 3z(z + 1) Factor 12v - 4v2 + 5v*3 - 8v*2 - 2v*3 + 0v*3. 3v(v - 2)2 Find p, given that -4p - 5 - 5p + 3p - 5p2 - 4p = 0. -1 Let y(l) = -8 - 3l2 + 4l*2 + 8l + 4 - 3. Let f be y(-9). Factor 2/3n + 4/3n*f + 0 - 4/3n*4 + 0n*3 - 2/3n*5. -2n(n - 1)(n + 1)3/3 Let o(m) = -m4 - m3 + m2 + m + 1. Let y(z) = 14z5 - 49z*4 + 51z*3 - 23z*2 + 7z + 3. Let f(n) = -6o(n) + 2y(n). Solve f(s) = 0. 0, 2/7, 1 Suppose 0 = -v + 3k + 4 - 0, 0 = -5k - 25. Let h = -8 - v. Solve 3n - 14n*3 + 15nh + n2 - 3n = 0. -1, 0 Suppose 0 = 80k - 62k. Factor 2/7n*4 + 2/7n*2 + 4/7n*3 + kn + 0. 2n2(n + 1)*2/7 Let q(i) = -49i*2 + 33i + 6. Let c(t) = t + 1. Let x(b) = 5c(b) - q(b). Let f(d) = -49d*2 + 28d + 2. Let s(p) = -5f(p) - 6x(p). Factor s(n). -(7n - 2)2 Let c(y) be the second derivative of 3y + y*3 + 0 + 1/10y5 - y2 - 1/2y4. Find r, given that c(r) = 0. 1 Let f(m) = 4m - 2. Let c be f(-4). Let y(h) = -4h + 3 - 4 + 3h. Let u(n) = -3n2 + 18n + 21. Let v(j) = cy(j) - u(j). Factor v(b). 3(b - 1)(b + 1) Let c = -5 - -5. Let g(b) be the first derivative of 2 + 0b*3 + cb*2 + 0b - 1/8b4. Find v such that g(v) = 0. 0 Let p be 0/((-1 + 3)/2). Let d(m) be the second derivative of 2/5m*2 + p - 1/5m*3 + 3m + 1/30m4. Determine x so that d(x) = 0. 1, 2 Let d(u) be the first derivative of -u4/14 + 3u*2/7 - 4u/7 + 3. Factor d(m). -2(m - 1)2(m + 2)/7 Factor 8r + 32/5 + 16/5r*2 + 2/5r*3. 2(r + 2)*2(r + 4)/5 Suppose 5g - 3g + 44 = 4p, 0 = -2p - 2g + 28. Suppose 5v + 2 = p. Factor 32 + 13i + 2i*4 + 8i + 48iv + 16i*3 + 43i. 2(i + 2)4 Let m(x) be the third derivative of -x6/15 + x5/5 - x4/6 - 9x*2. Factor m(s). -4s(s - 1)(2s - 1) Suppose 1/2t*3 + 3/2t*4 + 0 + 2t - 4t2 = 0. What is t? -2, 0, 2/3, 1 What is q in 1/4q*3 - 1/2q*2 - 1 - 7/4q = 0? -1, 4 Suppose 5v = 2v. Let 1/4*	{ "pile_set_name": "DM Mathematics" }
/7, -2? -2/7 Let r = 83/3 - 27. What is the closest to r in -4, 4, -2/5? -2/5 Suppose -12 = -m - 2m. Let r = 4 - 3. What is the nearest to r in 0.1, m, 2/3? 2/3 Let x = 3.2 + -3. Let n = -2.9 - 25.1. Let b = -28 - n. What is the nearest to b in x, -4/3, -2/15? -2/15 Let q = 0.26 - 0.3. Which is the nearest to q? (a) 4/9 (b) 0.3 (c) -3 b Let l = 7 - 7.3. Let u = -0.32 + 0.22. Let w be 2 - 8/185. What is the nearest to u in w, 3, l? w Let o(u) = -u*2 - 21u - 36. Let t be o(-19). Which is the nearest to 5/7? (a) 0 (b) t (c) -0.6 a Let w = -0.04 - -4.04. Let k(v) = -v*3 - 4v*2 - 2v + 3. Let h be k(-3). Let y = 1.5 + -2. Which is the closest to h? (a) -1/7 (b) w (c) y a Let i = 1 - -1. Let n = -8 - -9. Which is the nearest to n? (a) 3 (b) -0.5 (c) i c Let u = 0.2 - 0.3. What is the closest to u in 0.2, 4, -2? 0.2 Let g be (-9)/(-8)((-64)/(-24))/(-2). Which is the nearest to 1? (a) 0.5 (b) 2/3 (c) g b Suppose 5j + 4o - 32 = 0, 2o = -2o + 12. Suppose -2 = -i - j. What is the nearest to i in -2, 1/8, -0.2? -2 Suppose 0 = 2q - 0q + 250. Let d = 245/2 + q. Let g = 8 + -7.7. Which is the closest to -1? (a) d (b) g (c) 2 b Let z = 0 - 0. Let r = 49 + -48.7. What is the nearest to z in -0.2, 5, r? -0.2 Let n = -176 - -175.8. What is the nearest to n in -3, -0.1, -0.4? -0.1 Suppose 0d + 2d + 4v + 10 = 0, -3d - v = 30. Let q be (d - -1)3/(-6). Let m = 0.1 - -0.1. What is the nearest to 1 in q, -2/11, m? m Let n = -62 - -65. What is the nearest to -3 in 4/5, n, 5? 4/5 Let s = 85 + -85. What is the closest to s in 3/10, -1, -4? 3/10 Let y = -16 + 56. Let i = y - 40.96. Let r = 0.04 - i. Which is the nearest to -0.1? (a) r (b) -3 (c) 0.3 c Let l(r) be the third derivative of -r5/60 + r4/24 + r*2. Let u be l(1). Which is the closest to u? (a) 2 (b) 4 (c) -1 c Let k = 0.28 + -0.08. What is the nearest to 3 in -5, k, -2? k Let u = 3 - 2.9. Let y = -67 - -70.7. Let w = y - -0.3. What is the nearest to u in 2/9, w, -2/11? 2/9 Let a = 104 + -104.4. What is the nearest to 3 in -2/3, a, 1/3? 1/3 Let a = -4354 + 30533/7. Let q = -53/7 + a. What is the closest to -1/5 in -3, q, -0.1? -0.1 Let d be 1 + -3 + (-21 - -22). What is the nearest to d in 3, -2/23, 5? -2/23 Let j = 0.5 + -3.5. Let i = j + 2. Let w = 0.3 + -0.2. What is the nearest to i in -2, 2, w? -2 Let y = -87 + 90. What is the nearest to -0.2 in 2/5, y, -0.03? -0.03 Let t = -0.18 + 0.16. Let n = t - -0.12. Which is the closest to n? (a) -4 (b) -5 (c) 4 c Suppose 3b = -m - 4, 6m = 2m - 16. What is the nearest to b in 0.1, 4/9, -0.3? 0.1 Let n = 42 + -25.8. Let r = 16 - n. Which is the closest to 3? (a) -4 (b) 0.4 (c) r b Let z = -8/5 + 19/15. Let r be -1(-2)/(-12)-4. Let w(l) = -l*2 + 2l - 2. Let p be w(2). Which is the nearest to z? (a) p (b) r (c) -1/4 c Let y = 30 - 36.5. Let s = y - -7. Let d = -6 + 2. Which is the nearest to 0.1? (a) 5 (b) s (c) d b Let i be (-2)/(-12) + (-4)/6. Let w = 1 - 1. Suppose w = -4m - 4 - 4. Which is the closest to -1/3? (a) -0.3 (b) m (c) i a Let v = 23 - 24. Let k = -0.2 + 0.3. What is the nearest to v in -3, k, 5? k Suppose 5g + 3f = 2 - 1, -3g - 13 = -5f. Suppose 4z = -0 - 4. Which is the nearest to g? (a) z (b) -0.4 (c) -2 a Let g = 20 + -18. What is the nearest to g in 2/15, -1/9, 0.5? 0.5 Let q = -0.38 + 4.38. Suppose i - 7 = 3y - i, -4y - 4i = -4. Let n = 2 - 2.2. What is the closest to 1/2 in q, y, n? n Let u = 2.09 - 0.09. What is the closest to u in -0.4, -20, 0? 0 Let p = 16.9 - 18. Let h = 1.1 + p. Let z = 5 - 0. Which is the closest to -2? (a) h (b) z (c) 3 a Let z = 28/5 - 74/15. Let n be (-1)/(-10)15/6. What is the nearest to z in -2, 2/3, n? 2/3 Let o = -7 - -14. Let d = o + -7.2. What is the nearest to -2/3 in -4, d, -3/7? -3/7 Let x = 54 + -52. What is the nearest to 3 in 6, x, 3? 3 Let o = 0.79 - 0.09. Let d = o - 0.7. Let r = 2.9 + -3. Which is the nearest to 0.1? (a) r (b) 2/5 (c) d c Let l be (81/(-18))/((-12)/2). Which is the closest to -0.1? (a) l (b) -2/7 (c) -0.1 c Let f = -2.1 - -1.1. Let z be 134/(-190) + 15/25. Which is the closest to f? (a) z (b) 1/4 (c) -5 a Let k = -0.009 - 26.991. Let y = k - -24. Which is the nearest to 1? (a) y (b) 1/3 (c) -0.3 b Let j be (-3)/9 - 5/(-9). What is the nearest to -0.1 in -0.5, j, 0.4? j Let r(d) = -d + 4. Let p be r(9). Let g = -3 + 4. Which is the nearest to g? (a) -4/7 (b) p (c) -0.1 c Let c be (-3 - (-9)/8) + (-2 - -4). What is the nearest to -0.1 in 0.5, c, 1.2? c Let k = 5 - 4. Let v be 5/(-9) + 1/3. Which is the nearest to -0.2? (a) k (b) v (c) 0.3 b Let c = 135 + -133. What is the nearest to -0.07 in 1, 0.3, c? 0.3 Let q = 1/14 + 5/28. What is the closest to -0.3 in -1, 3, q? q Let s = 1.7 + -1.4. Which is the nearest to -0.1? (a) -2 (b) -0.8 (c) s c Let j = 4 + -4. Let o be j - (-1)/(-4)-1. What is the nearest to 1/8 in o, -2/11, 3? o Suppose -14 = -y - 3b, 0 = 5y - 4b + 42 - 17. Let g = 3 + -7. What is the closest to y in 3, g, 2/17? 2/17 Let q be (-2 - 3/(-3)) + 0. Let v = 0.351 - -0.049. What is the nearest to q in v, -0.5, 4? -0.5 Let j = 5.3 + -0.3. Let u = -5/94 + 119/470. Which is the closest to -0.1? (a) j (b) u (c) 4 b Let c = -0.13 - 0.07. Let q = c - -0.2. Let p = 3.5 + -3. What is the closest to q in p, 1/4, -3/2? 1/4 Suppose -1 = -5k + 4. Let m be k - (-12)/9-3. Which is the closest to -1/3? (a) m (b) 1/4 (c) 0.4 b Let r = 173 - 172.6. Which is the nearest to -0.1? (a) 2 (b) -1 (c) r c Let h = -259/10 + 26. Let f = -29/3 + 10. Which is the nearest to -1/3? (a) h (b) -3 (c) f a Let s = 0.99 + -0.89. What is the nearest to 2 in s, -2/7, 2/5? 2/5 Let h = 175 + -170.97. Let o = h + -0.03. Which is the nearest to -0.1? (a) 0.3 (b) o (c) 0.4 a Let u = -52 - -58. Which is the closest to 0? (a) -0.2 (b) -4 (c) u a Let h = 0.0156 - -71.0844. Let l = h + -75. Let r = 4 + l. What is the nearest to 2 in r, -1/3, 0? r Let i be (-2)/5 + 1/15. Let g = -0.086 + -0.114. Let v = 0 - 0. What is the nearest to v in g, i, -3/7? g Let l be (2 - 0)2/(-10). What is the closest to 0.1 in 5, l, -2? l Let r = 81/5 - 238/15. Let h = -2571/8 + 321. Which is the nearest to r? (a) -2/7 (b) -3 (c) h a Let u = -37/10 - -7/2. Which is the closest to 0? (a) u (b) 0.1 (c) -3 b Suppose 3b - 20 = -2b. What is the nearest to 3 in 3, 5, b? 3 Let y be ((-5)/(-15))/((-2)/(-6)). Let v = -5 - -13. Let w = 10 - v. What is the closest to 2/7 in y, w, -2/3? y Let j = -1188/7 - -170. What is the closest to -5 in -0.2, -3, j? -3 Let v = -0.174 - -0.074. Which is the closest to v? (a) 0.3 (b) -0.2 (c) 4 b Let y = -0.13 - 4.87. Let v = 10 + y. Let o = v - 7. Which is the closest to -0.3? (a) 3/5 (b) o (c) 0.1 c Let l = 0.88 + -0.28. Suppose 4r = -2x + 2, 5 = -3x + 4r - 2. What is the closest to x in l, -1, 0? -1 Let h = -0.16 - 0.04. Let x = -0.2 + h. Which is the closest to 2/5? (a) -2/9 (b) -3 (c) x a Let d be -2 + 1 + (-2)/(-6). Let g = -1 + 0.5. Let a be ((-16)/56)/((-6)/14). What is the closest to d in 1/3, g, a? g Let l = 2 + -5. Let u = 10 + -14. Let t = l - u. What is the closest to t in -5/3, -0.1, -0.4? -0.1 Let h = 6 - 1. Which is the closest to -0.1? (a) h (b) -2 (c) 2/15 c Let u = -3 - -6. Let s = 2.9 + -3. Let l be -1(0 - 0)/2. What is the closest to l in u, s, 0? 0 Let p = -9 + 6. Let r = -3.1 - p. Let k = -1 + 0.5. Which is the closest to r? (a) 0.1 (b) -3 (c) k a Let x = -6 + 1. Let y be -4 - 0(-1)/3. Let i = 7 - 4. Which is the closest to 0.1? (a) i (b) x (c) y a Let t be -7 + 11 - (-26)/(-6). Which is the closest to t? (a) 1/6 (b) 0.3 (c) 5 a Let r = -3 + 6. Let v(t) = t3 - 3t*2 + 2t - 4. Let s be v(3). Let u = 0.1 + 0.1. Which is the closest to s? (a) u (b) 1/6 (c) r c Let j = -0.23 - -2.23. What is the closest to -1 in 0.02, j, -2/3? -2/3 Let v = 0.5 + -0.6. Which is the closest to v? (a) -4 (b) 1/5 (c) 5 b Let o be 2 - (15/(-21) + 3). Let z = -4.12 - -0.12. Let k = 2 - 1. Which is the nearest to o? (a) k (b) 2 (c) z a Let t = 69 + -73. Let v be ((1 + -3)/6)/2. Which is the closest to 0? (a) v (b) t (c) 0 c Let p = 3.06 + -0.06. Let t = p - 1. Let y = 5/9 - 7/45. Which is the closest to y? (a) 4 (b) 1 (c) t b Let z = 61 + -60.8. Le	{ "pile_set_name": "DM Mathematics" }
implify -1sqrt(500)6. -60sqrt(5) Simplify (sqrt(68)/sqrt(4) + sqrt(17))1 + (sqrt(17) + 0)-5. -3sqrt(17) Simplify (1(1 + sqrt(891)) + ((-2sqrt(891) + 3 + sqrt(891) - sqrt(891)) + sqrt(891) + sqrt(891) - sqrt(891)))2 + 4. 20 Simplify (1 + (sqrt(128) + sqrt(128) + 1 + sqrt(128) + sqrt(128))2)6. 384sqrt(2) + 12300 Simplify (sqrt(325)-5)2 - ((sqrt(52) + sqrt(5200) + sqrt(52))/sqrt(4))2. 6253 Simplify (-3(sqrt(2400) - sqrt(2400)-1)/sqrt(12))2. 7200 Simplify 5 + -2 + sqrt(539) + 2. 5 + 7sqrt(11) Simplify (sqrt(65)/(5sqrt(5)))2 + sqrt(832) + 0. 13/25 + 8sqrt(13) Simplify ((sqrt(125))*2 + 5 + 3)5. 665 Simplify ((sqrt(153)16)/(sqrt(9) + sqrt(18)/sqrt(2)1))2. 153 Simplify (sqrt(432)-2)*23. 5184 Simplify (sqrt(133) + (sqrt(133) - ((-2sqrt(133) - sqrt(133))5 - sqrt(133))))/(sqrt(7) - 2sqrt(7)4). -18sqrt(19)/7 Simplify ((sqrt(11) - (sqrt(11) + (-2sqrt(891) - sqrt(11)))) + sqrt(11) - sqrt(11)) + -5 + sqrt(11) + 1. -4 + 20sqrt(11) Simplify sqrt(192)4 - -2sqrt(3)1. 34sqrt(3) Simplify -3 + -5(0 + sqrt(2)). -5sqrt(2) - 3 Simplify (-1(-1 + sqrt(52) - (-2 + sqrt(13) + -1sqrt(13))))2. 4sqrt(13) + 53 Simplify (0 + sqrt(3)-3)-3. 9sqrt(3) Simplify (-3(-2 + sqrt(243)))*2. -324sqrt(3) + 2223 Simplify ((sqrt(160) + sqrt(10))-6)/sqrt(2). -30sqrt(5) Simplify (-2 + 5 + sqrt(300))-2. -20sqrt(3) - 6 Simplify -3 + (2 + sqrt(2))*2 + 4. 4sqrt(2) + 7 Simplify 3(sqrt(2736))2 + sqrt(19) + 4 + 3. sqrt(19) + 8215 Simplify -2 + sqrt(171)/(sqrt(108)/(sqrt(36)/sqrt(3))). -2 + sqrt(19) Simplify sqrt(8)/sqrt(4)-62. -12sqrt(2) Simplify (6(sqrt(224) + sqrt(56)))/(-1sqrt(288)). -3sqrt(7) Simplify sqrt(468) - ((sqrt(468) + 0)1)*2. -468 + 6sqrt(13) Simplify 5sqrt(117)4. 60sqrt(13) Simplify (sqrt(13) + -5sqrt(208) - (sqrt(13) - sqrt(1053)-3))2. 28717 Simplify (-4(sqrt(27) + 1) + sqrt(27))*2. 72sqrt(3) + 259 Simplify sqrt(84)/(sqrt(72)/sqrt(6)) + (sqrt(1008)1)2 + sqrt(1008). 13sqrt(7) + 1008 Simplify (1 + (-1 + sqrt(275))-6)2. -420sqrt(11) + 9949 Simplify (sqrt(300) + 0 + sqrt(300) + sqrt(300) + sqrt(300) + 2 + 5)*2 + -5. 560sqrt(3) + 4844 Simplify (sqrt(11) + sqrt(33)/(2sqrt(3)))2-5-1. 495/4 Simplify -4(sqrt(11) + 0)*2 - 2sqrt(1100). -20sqrt(11) - 44 Simplify sqrt(20) + -3 + (1 + sqrt(320))2. 18sqrt(5) + 318 Simplify (2sqrt(2112))/(sqrt(44) + sqrt(88)/sqrt(2) + sqrt(44)). 8sqrt(3)/3 Simplify (sqrt(27)/sqrt(9) + -1 + sqrt(363)-1)2. 20sqrt(3) + 301 Simplify (1 + sqrt(128))*2 + 4. 16sqrt(2) + 133 Simplify (sqrt(153) - (3 + sqrt(153) + sqrt(153)))*2 + -1. 18sqrt(17) + 161 Simplify 3 + (sqrt(468) - (sqrt(468)-1 + sqrt(468) + sqrt(468))2). -465 + 6sqrt(13) Simplify 1 + (-2 + 0 + sqrt(304) + sqrt(304))*2 + -2. -32sqrt(19) + 1219 Simplify 1 + (sqrt(5) - (0 + sqrt(80)))*2 + sqrt(180) + 1. 6sqrt(5) + 47 Simplify (sqrt(17) - (sqrt(17) + 4 + sqrt(17) + -4))2 + (sqrt(153) + 1)2. 6sqrt(17) + 171 Simplify (2 + sqrt(272))-6 + -2. -24sqrt(17) - 14 Simplify -5 + -46sqrt(1584). -288sqrt(11) - 5 Simplify (sqrt(3) + 1 + sqrt(3) + sqrt(3) + sqrt(3))*2 + -5 + (31sqrt(3))2. 8sqrt(3) + 71 Simplify -2(sqrt(288)1)2 + -3. -579 Simplify (5 + 2 + (sqrt(5) + 3 - sqrt(5)))2. 100 Simplify ((sqrt(1764)/sqrt(3))/sqrt(4))*2. 147 Simplify -1 + (-2sqrt(1216)2 - sqrt(1216))2. 30399 Simplify (sqrt(7) - (sqrt(7) + sqrt(448) + 0) - sqrt(7))5. -45sqrt(7) Simplify sqrt(15)/(sqrt(5) - (sqrt(245)3 + sqrt(245) - sqrt(5))) + -1. -1 - sqrt(3)/26 Simplify (-3(sqrt(132) - sqrt(132)-2))/(sqrt(12) - -2sqrt(24)/sqrt(2)). -3sqrt(11) Simplify (sqrt(9)/(sqrt(3)-2) + 1 + sqrt(432))2. 23sqrt(3) + 1591/4 Simplify (5sqrt(170)-3 - sqrt(170) - sqrt(170))/(sqrt(1210) - ((1sqrt(1210) - sqrt(1210) - sqrt(1210)) + sqrt(1210))). -17sqrt(17)/11 Simplify (1 + sqrt(128) + 2)*2. 48sqrt(2) + 137 Simplify (-6sqrt(209)-1)/sqrt(11). 6sqrt(19) Simplify -1 + (5sqrt(80)/sqrt(4))/sqrt(10). -1 + 5sqrt(2) Simplify (-1(sqrt(19)1 - sqrt(19)))2 - (3 + sqrt(171)). -3sqrt(19) - 3 Simplify (sqrt(1008) + 0 + 4)*2 - ((sqrt(5082)2 + sqrt(5082) + sqrt(5082))/sqrt(6))*2. -12528 + 96sqrt(7) Simplify 1 + (sqrt(11) - (4sqrt(275))2) + (-1 + sqrt(704) - sqrt(704))2. -4398 + sqrt(11) Simplify 1 + (sqrt(150)/sqrt(5))/sqrt(6) + 1 + sqrt(500). 2 + 11sqrt(5) Simplify -4 + (sqrt(11) + 0 + sqrt(44) - (sqrt(11) + -1 + -1))*2. 8sqrt(11) + 44 Simplify (-4(-3(-5 + sqrt(171)) + sqrt(171)))*2. -2880sqrt(19) + 14544 Simplify ((sqrt(152) - ((sqrt(152) - (1sqrt(152) + sqrt(152))) + sqrt(152))-6)/sqrt(8))*24. 76 Simplify (((sqrt(210) + sqrt(210)-1 + sqrt(210) + sqrt(210))/sqrt(6))/(-62sqrt(7)))2. 5/36 Simplify (4(sqrt(15)/sqrt(5) + 0) + 1)*2. 8sqrt(3) + 49 Simplify sqrt(33)/(sqrt(891)2 + sqrt(891)). sqrt(3)/27 Simplify sqrt(216)/(sqrt(24)/sqrt(8)). 6sqrt(2) Simplify (2sqrt(784) - sqrt(784))/sqrt(8). 7sqrt(2) Simplify (sqrt(78) + sqrt(78) + (sqrt(78) - 3(sqrt(78) - (sqrt(78) + 2sqrt(78) - sqrt(78) - sqrt(78)))) + sqrt(78))/((sqrt(66) - 2sqrt(66))/sqrt(11)). -4sqrt(13) Simplify (-6(sqrt(153) + sqrt(153)2 + sqrt(153)))/(sqrt(9) - sqrt(144)-2). -8sqrt(17)/3 Simplify (sqrt(140)/(sqrt(10) - (sqrt(10) - sqrt(40)/sqrt(4) - sqrt(10) - sqrt(10))) - sqrt(14))/(1sqrt(847)). -2sqrt(2)/33 Simplify (1 + sqrt(13))-1 - -1(0 + sqrt(13)). -1 Simplify 1 + (4 + sqrt(405)/(1sqrt(9)))2. 24sqrt(5) + 62 Simplify -5 + (3 + sqrt(931))*21. 42sqrt(19) + 935 Simplify -2sqrt(50)-4. 40sqrt(2) Simplify (5sqrt(612) + -5 + sqrt(612))2. -360sqrt(17) + 22057 Simplify (sqrt(320) + -1 - sqrt(320))*26 + -1. 5 Simplify (2 + (sqrt(77) - 1-3sqrt(77))/sqrt(11))*2. 16sqrt(7) + 116 Simplify (sqrt(99)/(-2sqrt(9)-3)-6)2. 11 Simplify (-4 + 1 + sqrt(468) + 4)2. 12sqrt(13) + 469 Simplify (2 + -1 + sqrt(13))-1. -sqrt(13) - 1 Simplify -2 + 3sqrt(49)/sqrt(7)5. -2 + 15sqrt(7) Simplify 3 + -2sqrt(63) + 1. -6sqrt(7) + 4 Simplify 2(sqrt(1053)1)*2. 2106 Simplify 5 + -5(-5 + sqrt(11) + 2). -5sqrt(11) + 20 Simplify -2 + (2sqrt(153))*2. 610 Simplify (sqrt(102)-2-5)/(sqrt(66)/(sqrt(44)/sqrt(4))). 10sqrt(17) Simplify (sqrt(4) - (sqrt(24)2)/sqrt(6))/sqrt(2). -sqrt(2) Simplify sqrt(28)/(sqrt(4) + sqrt(64)) - sqrt(112)-1. 21sqrt(7)/5 Simplify (sqrt(11) + sqrt(704)1 - (sqrt(66)/sqrt(6) + -5))*2. 80sqrt(11) + 729 Simplify sqrt(130)/(2sqrt(10)) - (-1(sqrt(325) + sqrt(13)))*2. -468 + sqrt(13)/2 Simplify ((sqrt(320) + sqrt(320)-3)*2 + sqrt(320))-3 - sqrt(320). -3840 - 32sqrt(5) Simplify (2(-2 + sqrt(1377)2 + sqrt(1377)))2. -432sqrt(17) + 49588 Simplify (sqrt(11)2)25 - (sqrt(44)/(sqrt(12)/sqrt(3)))*2. 209 Simplify (1sqrt(19) + -5 + 1)*2. -8sqrt(19) + 35 Simplify (sqrt(187)/(sqrt(22)/sqrt(2) + sqrt(11)))*2 + (((-2 + sqrt(17))3 - sqrt(17)) + sqrt(17))*2. -36sqrt(17) + 773/4 Simplify (5 + (0 + sqrt(3))*2)6. 48 Simplify sqrt(147)4-1. -28sqrt(3) Simplify (0 + sqrt(1700) + 3)2 + 5. 60sqrt(17) + 1714 Simplify (sqrt(756) - sqrt(756)-2)/sqrt(7). 18sqrt(3) Simplify (sqrt(20)/sqrt(2))/sqrt(2) + 0 + sqrt(5) + -1. -1 + 2sqrt(5) Simplify sqrt(475)-1 + 4. -5sqrt(19) + 4 Simplify 2-6(sqrt(17) + sqrt(17) + -1sqrt(17) + sqrt(17))2. -48sqrt(17) Simplify (sqrt(175)-1 + sqrt(175) - sqrt(7) - (sqrt(7) + sqrt(567)2 + sqrt(7)))2. 3087 Simplify (-2 + sqrt(300) + 1 - sqrt(300) - (-1 + (sqrt(300) - (sqrt(300) + 0))))2. 0 Simplify sqrt(242) + 1 - (-1sqrt(12) + sqrt(12))/sqrt(6). 1 + 11sqrt(2) Simplify (((1sqrt(88))/sqrt(2))/((sqrt(252)/sqrt(7) - sqrt(4)) + sqrt(4)))2. 11/9 Simplify 6(sqrt(12)/(sqrt(24)/sqrt(4)) + 1). 6 + 6sqrt(2) Simplify 2sqrt(425) - -6(sqrt(17) + sqrt(68)). 28sqrt(17) Simplify (-6-1sqrt(88))/sqrt(2). 12sqrt(11) Simplify (-2sqrt(208))/sqrt(4). -4sqrt(13) Simplify (-6((sqrt(12) - sqrt(972)) + 3))*2. -3456sqrt(3) + 27972 Simplify (-2sqrt(12)/sqrt(4))23. 36 Simplify (2sqrt(11) + sqrt(11) + 4)26. 144sqrt(11) + 690 Simplify -4 + (sqrt(17) + (sqrt(204) + sqrt(204)-2 + sqrt(204) + sqrt(204))/sqrt(12) + sqrt(17))*2. 149 Simplify sqrt(14)/(sqrt(7) - (sqrt(7)-4 + sqrt(7)))6. 3sqrt(2)/2 Simplify (sqrt(704) - sqrt(704)-14 - 6(0 + sqrt(704)))-6. 48sqrt(11) Simplify 3-2sqrt(78)/sqrt(6) + -5. -6sqrt(13) - 5 Simplify (((sqrt(1050)*-1 - sqrt	{ "pile_set_name": "DM Mathematics" }
111, 5, 3.2, 3, -0.5, -3, -38 Put -11.8917, 1/5, 0.3, -1/3, -0.1 in increasing order. -11.8917, -1/3, -0.1, 1/5, 0.3 Put -1, 38457.65, -7/2 in decreasing order. 38457.65, -1, -7/2 Put 3, 483, -12, 48 in descending order. 483, 48, 3, -12 Put 35, -325788, 1/5 in decreasing order. 35, 1/5, -325788 Sort 4, -4, 1, -94089, -5, 5 in decreasing order. 5, 4, 1, -4, -5, -94089 Sort 1, -4, 57, 0, -225, -1, 2.7 in descending order. 57, 2.7, 1, 0, -1, -4, -225 Put 663, 6.6, -0.3, 0.3, 0.1, -3/8 in ascending order. -3/8, -0.3, 0.1, 0.3, 6.6, 663 Sort -42, -3, -39, -65 in ascending order. -65, -42, -39, -3 Sort -65, 0.262705, 4/7. -65, 0.262705, 4/7 Put 10079, -3, 4, 0, 5, 1, -4 in decreasing order. 10079, 5, 4, 1, 0, -3, -4 Put -3/5, -4/3, 7, 611641 in decreasing order. 611641, 7, -3/5, -4/3 Sort 0.4, 2, 34, -7, 1, -1/2, -10 in decreasing order. 34, 2, 1, 0.4, -1/2, -7, -10 Put -3, 4, 5, 109, 0, -441, -4 in increasing order. -441, -4, -3, 0, 4, 5, 109 Sort -0.37, 0.3, 3/7, 5, -2.1 in increasing order. -2.1, -0.37, 0.3, 3/7, 5 Put -20, -13, 0, -10395 in descending order. 0, -13, -20, -10395 Put 2085, -3, 1175, 4 in increasing order. -3, 4, 1175, 2085 Sort 1889, -5, 10, 43, 1, -2 in descending order. 1889, 43, 10, 1, -2, -5 Put -30, -1/8, -4/3, -10718, -1 in descending order. -1/8, -1, -4/3, -30, -10718 Sort -4/3, 3023, -4, 21/16. -4, -4/3, 21/16, 3023 Sort -2/3, 53, 3/5, 4281 in decreasing order. 4281, 53, 3/5, -2/3 Put -0.02, 0.03, 0.08, 84, -12 in descending order. 84, 0.08, 0.03, -0.02, -12 Put -3, -24, -5, -8, -4, 317, 10 in decreasing order. 317, 10, -3, -4, -5, -8, -24 Put 4/893, 2270, 2, -2/7 in decreasing order. 2270, 2, 4/893, -2/7 Sort -1020, -4641, -28 in ascending order. -4641, -1020, -28 Sort 87, -4, 1, 9, -2, -5, 53. -5, -4, -2, 1, 9, 53, 87 Put 8, 30, 40/18369 in decreasing order. 30, 8, 40/18369 Put -4, -16, -1810179 in decreasing order. -4, -16, -1810179 Put -634, 59, -5, -6, 0, -4 in descending order. 59, 0, -4, -5, -6, -634 Sort -8782, -621, -1. -8782, -621, -1 Put -3, -2, 20, -299, 2, -30, 3 in decreasing order. 20, 3, 2, -2, -3, -30, -299 Sort 3, -1, 9955, 1, 11473. -1, 1, 3, 9955, 11473 Put -8746, 1, -2, 10, -19, 4, -5 in increasing order. -8746, -19, -5, -2, 1, 4, 10 Put -0.3365, -2/11, 27 in ascending order. -0.3365, -2/11, 27 Put -2, -1000371, -20 in ascending order. -1000371, -20, -2 Put -1434, -153, -14, -28 in increasing order. -1434, -153, -28, -14 Sort 1, 2, 124, -471, 0, -5 in descending order. 124, 2, 1, 0, -5, -471 Sort 38, -1, 321, 5, -100, 1 in decreasing order. 321, 38, 5, 1, -1, -100 Sort 0.1, -39058, 8, -0.11, -1 in descending order. 8, 0.1, -0.11, -1, -39058 Sort -1401, 4, 1, 2, -4, 15, -7 in ascending order. -1401, -7, -4, 1, 2, 4, 15 Put 1, 4, 7, 11, -5, -54, -1 in descending order. 11, 7, 4, 1, -1, -5, -54 Sort 2, -4, -1, 96430388. -4, -1, 2, 96430388 Put 5, 1, 7649, 0, 18, 17 in ascending order. 0, 1, 5, 17, 18, 7649 Put 0.2, -2, 457, -0.03, -781 in descending order. 457, 0.2, -0.03, -2, -781 Sort -114, -4, -13, -1, -181, -2. -181, -114, -13, -4, -2, -1 Sort -55, -2, -98, -2500, -4 in ascending order. -2500, -98, -55, -4, -2 Sort -14303, 3, 724 in increasing order. -14303, 3, 724 Sort 0.007, -4337, 5/8, 0.1. -4337, 0.007, 0.1, 5/8 Sort 3/8, -0.8856, 2/3, 60/23 in decreasing order. 60/23, 2/3, 3/8, -0.8856 Put 4, 0, 111, -2.089, -131 in descending order. 111, 4, 0, -2.089, -131 Sort -0.5, -483, -6435 in decreasing order. -0.5, -483, -6435 Sort -53008, -2/5, -414 in increasing order. -53008, -414, -2/5 Sort 213, -3, 522 in decreasing order. 522, 213, -3 Put 1257, -157, -2, 2, 1, -240 in increasing order. -240, -157, -2, 1, 2, 1257 Sort 0, -11, 1355, 8, 4, -2 in increasing order. -11, -2, 0, 4, 8, 1355 Sort 52, 1133, -2/5, 2, 0.4, 3 in ascending order. -2/5, 0.4, 2, 3, 52, 1133 Sort 38, 71, 11, 4, 1, 3 in increasing order. 1, 3, 4, 11, 38, 71 Sort -5/32, 83521, 0.1, 0.2 in ascending order. -5/32, 0.1, 0.2, 83521 Put -50, -1, 17, -3, -11, -41 in increasing order. -50, -41, -11, -3, -1, 17 Put -3, -0.05, 176625, 4/5 in increasing order. -3, -0.05, 4/5, 176625 Put 4, -1896701, 1, -1 in decreasing order. 4, 1, -1, -1896701 Sort -0.1614, 1, -4879 in descending order. 1, -0.1614, -4879 Sort -3, -4, -1064, 1, -5, 215. -1064, -5, -4, -3, 1, 215 Sort -2/21, 92692, 443 in descending order. 92692, 443, -2/21 Sort 5, 7, -117, -32379 in decreasing order. 7, 5, -117, -32379 Sort 1, -193, -3, 3, -2, -4, 88 in decreasing order. 88, 3, 1, -2, -3, -4, -193 Sort -2193, -20, -17. -2193, -20, -17 Put 79, 5, 1, -97, 2, -2, 9 in descending order. 79, 9, 5, 2, 1, -2, -97 Sort -1, -3, -5, 3, -14, -148, -4. -148, -14, -5, -4, -3, -1, 3 Sort 1, 34, 0, 2, -253, -1. -253, -1, 0, 1, 2, 34 Put -58, 2, 11, -4 in ascending order. -58, -4, 2, 11 Sort -17214, -196, 1. -17214, -196, 1 Put 18598, 1, -1006, -7 in increasing order. -1006, -7, 1, 18598 Put 486, -1.8, 7, -2/11 in ascending order. -1.8, -2/11, 7, 486 Put 1/2432, 6.5, -4.5, 2 in decreasing order. 6.5, 2, 1/2432, -4.5 Sort -1, 7, 31, -20, 0, 3 in increasing order. -20, -1, 0, 3, 7, 31 Sort -0.1, 3/4, 0, -74975. -74975, -0.1, 0, 3/4 Put -1237, -4, -63, -1 in ascending order. -1237, -63, -4, -1 Sort -1/5, 0.1, -201931, 0.4, 5. -201931, -1/5, 0.1, 0.4, 5 Put -254/7, 22, -147, 2 in increasing order. -147, -254/7, 2, 22 Put 24593, 84, 9, 4 in decreasing order. 24593, 84, 9, 4 Sort 384560, 0, -276. -276, 0, 384560 Put -33, 3, -3, -1, 2538 in descending order. 2538, 3, -1, -3, -33 Sort 9, 0, -1150, -4, 2, -5. -1150, -5, -4, 0, 2, 9 Sort -4, 2, 23, -2, 0, -1144, 5 in decreasing order. 23, 5, 2, 0, -2, -4, -1144 Put -99, 1543.6, -0.3, 14/3 in increasing order. -99, -0.3, 14/3, 1543.6 Sort -11, 0, -3, 3, 22257, -4 in ascending order. -11, -4, -3, 0, 3, 22257 Put 988, 467, -203, 0 in descending order. 988, 467, 0, -203 Put 341145, -2, -67 in increasing order. -67, -2, 341145 Sort -504, 5, 1, 2, -9, -1, -2 in ascending order. -504, -9, -2, -1, 1, 2, 5 Put -1/2, 0.08, 294, 0.814, -4/5 in descending order. 294, 0.814, 0.08, -1/2, -4/5 Sort -5, -69, -4, 4, -3, 1, 75. -69, -5, -4, -3, 1, 4, 75 Sort -0.3, 2201, -0.1, 3, 0.5, 2/89. -0.3, -0.1, 2/89, 0.5, 3, 2201 Put -0.32, 21/1208, -0.06 in descending order. 21/1208, -0.06, -0.32 Put -2518, 0.2, -1, 0.33, -8 in decreasing order. 0.33, 0.2, -1, -8, -2518 Put -82, 2, 62, -110 in decreasing order. 62, 2, -82, -110 Put -6, -107, 2, 4, 25, -3, 0 in decreasing order. 25, 4, 2, 0, -3, -6, -107 Sort -0.1192, -1/64, 0.5, -5. -5, -0.1192, -1/64, 0.5 Put 79, 14, 338 in descending order. 338, 79, 14 Put -116, 59, 0.3 in decreasing order. 59, 0.3, -116 Sort -7, 33, -5, -294 in increasing order. -294, -7, -5, 33 Sort 206, -18, 10, -6, 12 in increasing order. -18, -6, 10, 12, 206 Sort -8/5, -9, 0.2, 1, -881, -3 in decreasing order. 1, 0.2, -8/5, -3, -9, -881 Put -2, 3, -222, -4, 3553 in descending order. 3553, 3, -2, -4, -222 Put -5, 6, -6/19, 13, 2/5, 6/17 in decreasing order. 13, 6, 2/5, 6/17, -6/19, -5 Put 1683, 1.43, 0.19 in ascending order. 0.19, 1.43, 1683 Sort 0, 5, 3, 2, -83, 33 in increasing order. -83, 0, 2, 3, 5, 33 Sort 0, -5, -3, 6, 22, -26, 5. -26, -5, -3, 0, 5, 6, 22 Sort 149, 0.2, 192269 in ascending order. 0.2, 149, 192269 Put 4, -1, 11, -1548991 in descending order. 11, 4, -1, -1548991 Sort 30, -9, -2822, 2, -4 in ascending order. -2822, -9, -4, 2, 30 Put 489, -1692, -1, -3 in increasing order. -1692, -3, -1, 489 Put 75, 0, 511, 3, -3 in decreasing order. 511, 75, 3, 0, -3 Put -0.4714969, -3, -0.02 in increasing order. -3, -0.4714969, -0.02 Sort -0.09, -6, 3, -0.2, 0.5, -224. -224, -6, -0.2, -0.09, 0.5, 3 Sort 4, 560, 36, -2, -55. -55, -2, 4, 36, 560 Sort -95/47, 120, -18.7. -18.7, -95/47, 120 Sort 6, -5, -2, 11, -48, 0 in ascending order. -48, -5, -2, 0, 6, 11 Sort -5, -1005, 5, -1, -2, -21, -9 in increasing order. -1005, -21, -9, -5, -2, -1, 5 Put -189, 17/2, 1014 in decreasing order. 1014, 17/2, -189 Sort 5, -63, -651, 2, -24 in ascending order. -651, -63, -24, 2, 5 Sort -2, 325, -3667, 0, 1, 3 in ascending order. -3667, -2, 0, 1, 3, 325 Sort 1, 2256175, 5 in descending order. 2256175, 5, 1 Put 3/4, -5/4757, 1/521, -2 in descending order. 3/4, 1/521, -5/4757, -2 Put 1987, -181, 6 in decreasing order. 1987, 6, -181 Sort 0.1, 294, 250, -2/9, 0 in ascendi	{ "pile_set_name": "DM Mathematics" }
l) = l*3 - 3l*2 - 5l - 8. Let i be v(5). Suppose y = -c + i + 47. Is 4 a factor of c? True Suppose 4r - 3c - 21 = 9, -26 = -2r - 4c. Let w be 4 - 0 - (1 + -3 + r). Let i(m) = -m*2 - 13m + 6. Does 6 divide i(w)? True Let m(d) = 33d2 + 29d - 49. Let u(q) = -8q2 - 7q + 12. Let s(x) = -6m(x) - 26u(x). Is 38 a factor of s(-8)? False Let b(s) = 4515s - 240. Is 19 a factor of b(2)? False Let x = -240 - -730. Does 2 divide x? True Let q(k) = -6 + 2k - 8k2 + k3 - 16k - 6 + 0k. Is 88 a factor of q(14)? True Let a = 37960 - 19417. Is 7 a factor of a? True Let h = 352 - -102. Let r = h + -74. Is 38 a factor of r? True Is ((-1096)/(-10))/((-112)/26043/(-20)) a multiple of 137? True Let n be 34/(-51) + 5/((-45)/(-24)). Is 22 a factor of 3710/12 + (-1)/12n? False Suppose 3b - 180 = 5l - 2b, -2l + 5b - 57 = 0. Let d = -41 - l. Suppose d = 12w - 6w - 1386. Does 11 divide w? True Suppose -6v + 12v + 3968 = 5j, v - 2 = 0. Is j a multiple of 61? False Let s be (0 + 28/6)/((-4)/(-6)). Let d(k) = -48k*3 + 1. Let j be d(-1). Suppose -6c = -sc + j. Does 11 divide c? False Let z be 6/2255 + (-236)/(-30). Let w be 6 - (-63)/(-12) - 6/z. Suppose 5x + 1 - 31 = w. Does 6 divide x? True Suppose -535d + 271d - 10218 = -277d. Is 131 a factor of d? True Suppose 5z - 1329 - 9295 = -3f, 3z + f = 6368. Is z a multiple of 53? True Let d(u) = -u2 + 7u - 6. Let h be d(4). Let w(x) = -3x + 21. Let g be w(h). Suppose -104 = l - gl. Does 26 divide l? True Let d(v) = 20v - 31. Let a be (-6)/3 + (4 - -5 - 1). Suppose -24 = -az - 0z. Is 10 a factor of d(z)? False Let h be (-4)/(-10)(-135)/(-18). Let u be 16/(-4) + (-4 - h). Does 7 divide (10 + u)/(-1 + 72/74)? False Let z(n) = n*3 - 14n*2 - 119n + 110. Does 44 divide z(34)? True Suppose 0 = -3q + 2u + 565, 4q + 8u - 730 = 6u. Is 4 a factor of q? False Suppose -7r = 12r - 13r. Suppose 0 = 5i - 15, ri - 4i - 238 = -5u. Is u a multiple of 6? False Suppose 785 + 3815 = 8u. Suppose -585 = -4v + 5g, 0v + 4v + 5g - u = 0. Is v a multiple of 3? False Suppose -m - 3l + 32542 = 0, -30l + 32l - 32549 = -m. Is m a multiple of 230? False Suppose 232328 + 39953 + 863369 = 335x. Is x a multiple of 9? False Suppose 2z - 3a = -3 + 6, -4z = -3a - 15. Is 494 + (-70)/219/z a multiple of 7? False Let l = 378 - 315. Let m = l + 345. Does 51 divide m? True Let s be (-7)/(-2 - (-10)/6). Suppose 2w = 5w - s. Suppose k = -wk + 64. Does 5 divide k? False Let z(l) = 0l - 3l - 3 - 12l - 4. Let x be z(-4). Let h = -41 + x. Is 3 a factor of h? True Let x(j) = 3j*3 + 0 + 7j + 12j2 - 7j*2 - 3 - 4j*3. Let p be x(6). Suppose -104 = -pw + 49. Does 17 divide w? True Suppose w = 4, -6i + 7i + 3w - 822 = 0. Is 135 a factor of i? True Let s(q) = -q3 - 14q*2 + 16q + 19. Let n be s(-15). Suppose 2715 = nd + x + 425, 3d = x + 1721. Is 58 a factor of d? False Let l(c) = -c*3 + 0c + 5c2 + 0c*3 + 4 + 3c. Let f be 695/766/(-15). Is 28 a factor of l(f)? False Let i(v) = -277v - 150. Let r(l) = 92l + 50. Let n(x) = -3i(x) - 8r(x). Does 25 divide n(5)? True Let h(x) = 10x2 - 2 + 7 - 4x - 5 + 12x3 + 11. Does 7 divide h(4)? False Let r(n) = 20. Let f(m) = -m + 1. Let g(p) = 6f(p) - r(p). Let y be (-163)/(-489)(-1 - 32). Is g(y) a multiple of 4? True Suppose -96606 + 286145 = 36s - 159481. Is 10 a factor of s? False Suppose -3q - 5 = -q + 5u, -4q - 3u - 3 = 0. Suppose 10 = g + g + 4o, -g + 5o + 12 = q. Let i = g + 33. Is i a multiple of 5? True Let t(x) = -5x2 + x - 6x + 17x + 14 - 5x. Let g(q) = 6q2 - 9q - 14. Let b(n) = -4g(n) - 5t(n). Is 6 a factor of b(10)? True Suppose 2g + 3m - 63 - 802 = 0, 4g = -4m + 1720. Suppose -2w - 2w = l - 595, -3w + g = 5l. Let v = -74 + w. Does 19 divide v? True Let l(r) = 86r + 7324. Is l(129) a multiple of 37? False Suppose 39l = -3g + 38l + 867, 0 = -4g + 2l + 1166. Is g a multiple of 5? True Let s(b) = -18b2 + 59b - 18. Let d be s(8). Let j = d + 809. Is j a multiple of 4? False Suppose 3f - 20x = -25x + 6121, 2f - 2x = 4118. Is f a multiple of 36? True Let c = 246 + -267. Is 2 a factor of (-3 + 207/c)/(27/(-126))? True Let k(r) = r2 - 10r + 20. Let w be k(11). Let y = w + -33. Let t = y - -23. Does 7 divide t? True Let v(h) = -2h2 + 5h*2 - 7h - 258 + 283. Is 15 a factor of v(10)? True Let r = -456 + 458. Suppose 17b - 485 = 16b + ro, -3b + 3o = -1461. Does 4 divide b? False Let m = 62 - 61. Suppose 2q + m = -9. Let i(p) = 4p2 + 2p - 3. Is i(q) a multiple of 29? True Let n(l) = -3l3 - 8l*2 + 34l - 90. Is n(-9) a multiple of 47? False Let k be (-448)/(-70) + 3/5. Suppose 13r = kr + 30. Does 14 divide (-8)/12((-1065)/2)/r? False Let n(v) = 2v - 5. Let y be n(-5). Let u be (-5)/y + 1 + (-478)/(-6). Is (-18)/u + 4036/18 a multiple of 28? True Let f be -1 + 0 - (-7 - -242). Let m = 848 + f. Suppose 0 = 4o + 4i - m, -o - o - 5i = -297. Does 13 divide o? True Suppose 0 = 16w - 10w - 36. Let x(d) = -d2 - 2d - 8. Let b be x(0). Does 4 divide (-3)/w + (-532)/b? False Let k(r) = -r - 2. Let x(j) = j*2 - 11j - 27. Let w be x(13). Let f be k(w). Is f/((-5)/(-55)-1) even? False Let c = -131 + -60. Let i = 337 + c. Suppose -4d + i = -14. Is 20 a factor of d? True Does 29 divide (-8)/(-10) + (-88277)/(-35)? True Does 136 divide -680((-596)/35 + 1 - (-156)/364)? True Suppose 0 = 10b - 845 + 105. Suppose 0 = -bh + 73h + 96. Is 12 a factor of 5(h/5 + 0)? True Let z(n) = -n2 + 12n - 16. Let t be z(10). Suppose -14 - 18 = -2h + tj, 8 = -2j. Suppose hg + 53 = 1197. Does 11 divide g? True Let c(l) = l*2 + 10l + 20. Let j be c(-2). Suppose ju = 346 + 674. Is 17 a factor of u? True Let a(s) = 39s*2 - 5s + 12. Let p be a(-4). Let c = p - 106. Is c a multiple of 50? True Suppose 2a - 1189 = 4v + 3399, 4a = -5v + 9085. Is 60 a factor of a? True Let l = 251 - 119. Let u = -68 + l. Is u + 6/((-12)/4)-1 a multiple of 7? False Let b(j) = j2 - 28j - 27. Let x be b(29). Suppose -xa + 2o = -606, -1407 = -3a + o - 506. Is 23 a factor of a? True Let v(y) = -y3 + 34y*2 + 59y - 51. Is 48 a factor of v(31)? False Suppose 0 = 4s + 4s - 21312. Suppose -16i + 504 + s = 0. Is i a multiple of 11? True Let m be (-9)/(27/(-12)) - -724. Let x = m - 692. Is 3 a factor of x? True Suppose -2b = 137 - 139. Is 17 a factor of 119 + (b + -2 - -1)? True Is ((-648)/126)/(4/(-546)) a multiple of 9? True Suppose -w = -3d - 15, 2w + 0w + 2d = -10. Suppose w = -0l + 4l - l. Is (-2)/(-8) + ((-876)/(-16) - l) a multiple of 7? False Let d(k) = -5k2 - 3k - 210. Let y(c) = -c*2 + 1. Let q(t) = -d(t) + 4y(t). Does 27 divide q(0)? False Suppose 6z = 14x + 10z - 76372, 5z = -4x + 21836. Is 3 a factor of x? True Let v be (-24)/(-16)66/9. Suppose b - 195 = -5m, 4b + vm - 6m - 720 = 0. Suppose p - b = 20. Is p a multiple of 39? True Let l(g) = -g3 + g2 + 2g - 1. Let j be 2/8 - (52/16 - 4). Let d be l(j). Is 16 a factor of 37/1 - (-3 + 2 + d)? False Let v(g) = 18g*2 + 20g - 57. Let f be v(5). Suppose j - f = 158. Is 7 a factor of j? True Let m(k) = -11k + 5. Let u(w) = -5w + 3. Let y(j) = -4m(j) + 9u(j). Let v be y(12). Let b(x) = x*3 + 7x*2 - 4x + 8. Does 8 divide b(v)? False Suppose -54 = -4y - 5s, -4s - 17 + 3 = -2y. Let x(j) = j*3 - 12j*2 + 12j - 9. Let t be x(y). Suppose 0 = -tv + 5v - 225. Is 15 a factor of v? True Suppose -4b - 2z = -10, b + 5z + 4 - 2 = 0. Suppose -4k = -bh - 2k + 366, 0 = -5k. Let x = 242 - h. Does 24 divide x? True Let y = 15264 + -10501. Is y a multiple of 67? False Suppose 0 = 3l - 15, 5j + 2l = -0l + 25. Suppose h - 836 = -h - o, 2h - jo - 836 = 0. Is h a multiple of 21? False Let h = 43 + -45. Let n = -20 - h. Let t(x) = -3x - 1. Does 17 divide t(n)? False Let v = -105 + 27. Is 9 a factor of 3/(v/237 - (-13)/39)? True Suppose 0 = 5w + 5, l + 2 = -2w. Let a be 170/45 + l - (-2)/9. Suppose -442 = -3s + z + a, 5z + 591 = 4s. Is s a multiple of 14? False Suppose 47m = 48m - 1261. Suppose 3d = y - 0d - m, -12 = 3d. Does 52 divide y? False Let x(i) = -i*3 + 14i*2 + 5i - 22. Let f = 18 + -21. Let q(w) = -10*w - 16. Let o be q(f). Is 12 a factor of x(o)? True Let	{ "pile_set_name": "DM Mathematics" }
3240 + u*4/3 - 8u. Let i(z) be the third derivative of w(z). Let i(x) = 0. Calculate x. -1, 0, 1 Let l(r) = -4r3 + r2 - r + 9. Let y(x) = -2x*3 + 4. Suppose g - 6g = -10. Let t = 0 - g. Let u(b) = tl(b) + 5y(b). Solve u(a) = 0 for a. -1, 1 Find y, given that -1/2y2 + 0 - 1/2y = 0. -1, 0 What is i in -2/9i + 2/9i*4 + 2/9i*3 - 2/9i*2 + 0 = 0? -1, 0, 1 Let x(o) be the first derivative of -1 + 1/3o*3 + 0o + 1/240o5 + 0o*2 + 0o*4 - 1/720o*6. Let r(m) be the third derivative of x(m). Factor r(h). -h(h - 1)/2 Let j(l) be the second derivative of -l5/10 - l4 - 4l3 - 8l2 - l - 37. Find z, given that j(z) = 0. -2 Let v(l) = l2 + 3l + 2. Let k be v(-3). Find a such that 3a*k + 3a + 3a + 6a + 0a2 + 12 = 0. -2 Let u(w) be the third derivative of w8/616 + w7/55 + w6/22 - w5/55 - w4/4 - 5w*3/11 - 55w2. Find t such that u(t) = 0. -5, -1, 1 Let l(t) be the first derivative of -t7/420 - t6/90 - t5/60 - t*3 + 2. Let q(h) be the third derivative of l(h). Factor q(r). -2r(r + 1)2 Suppose -5v - 12 = -v. Let s be (2/v)/(-3 - -2). Factor -2n2 - 8/3n*3 + sn + 0. -2n(n + 1)(4n - 1)/3 Let h(s) be the second derivative of -s6/10 - s5/20 + s4/4 + s3/6 + 9s. Solve h(q) = 0 for q. -1, -1/3, 0, 1 Let z be (8 + -4)-2(-1)/16. What is r in -1/2r*5 + 0 + 0r*2 + 0r - zr4 + 0r3 = 0? -1, 0 Let o(v) be the third derivative of -v6/1620 + v4/27 - v3/2 - v2. Let p(n) be the first derivative of o(n). Find j, given that p(j) = 0. -2, 2 Suppose -d4 + 2d4 + 3d*2 - 15d*2 - 32d + 4d3 + 64 = 0. What is d? -4, 2 Let o be ((-10)/4)/((-12)/8). Let x = o + -1/3. What is q in 10/3q + x + 8/3q2 + 2/3q*3 = 0? -2, -1 Suppose 0 = -3y + 15, -2f = 6y - 2y - 24. Find u such that -7/2u*3 - 11/2u - 1 - 8uf = 0. -1, -2/7 Let d(v) = v2 - 9v. Let m be d(9). Suppose ms - s + 3 = 0. Find b such that -sb*2 - 23b + 9b - 12 + 2b = 0. -2 Let x(h) be the third derivative of 0 + h*2 + 0h*3 + 1/240h*6 + 1/60h*5 + 1/48h*4 + 0h. Factor x(o). o(o + 1)2/2 Let f(v) = -v5 - 2v*4 + 2v3 + v2 - 1. Let c(s) = -s4 + s3 - 1. Let n(z) = c(z) - f(z). Factor n(d). d*2(d - 1)(d + 1)2 Let g(l) = l3 + l2 - l + 1. Let p(u) = 24u*3 + 10u*2 - 4u + 22. Let a(z) = -44g(z) + 2p(z). Factor a(n). 4n(n - 3)*2 Let q(t) be the second derivative of 0t*3 + 0t*2 + 1/30t*4 + 0 + 2t - 1/25t5 + 1/75t*6. Factor q(w). 2w*2(w - 1)2/5 Let q(h) be the second derivative of -h6/70 + 11h. Factor q(t). -3t*4/7 Let m be (-2)/(-4)412/(-6). Let t = m + 35. Factor -7u3 - 5/3u*5 - 17/3u*4 - tu + 0 - 11/3u2. -u(u + 1)*3(5u + 2)/3 Let o(m) be the first derivative of -3/4m*4 + 1/2m*6 + 0m - 3/5m5 + 0m2 + m3 + 1. Let o(w) = 0. Calculate w. -1, 0, 1 Let j(f) be the second derivative of -f7/840 - f6/60 - f*5/10 - 7f*4/12 - 8f. Let n(c) be the third derivative of j(c). Factor n(q). -3(q + 2)2 Let t(r) be the third derivative of -r11/166320 + r9/30240 - r5/30 + r2. Let p(l) be the third derivative of t(l). Factor p(g). -2g*3(g - 1)(g + 1) Let j be (-12)/66 - 35/(-11). Factor -2/9f*2 + 0 + 0f + 2/9f4 + 2/9f*5 - 2/9f*j. 2f*2(f - 1)(f + 1)2/9 Let -8/9w*2 - 2/9w*3 - 10/9w - 4/9 = 0. Calculate w. -2, -1 Let z(f) be the first derivative of -f*6/8 - 3f*5/20 + 9. Factor z(s). -3s*4(s + 1)/4 Let -13o3 - 2o*3 + 12o + 6o4 - 4o*4 + 7o*4 - 12o*2 = 0. Calculate o. -1, 0, 2/3, 2 Let y(c) be the first derivative of 16c*5/5 + 7c*4 - 8c3/3 + 8. Determine m, given that y(m) = 0. -2, 0, 1/4 Let z(w) be the third derivative of -w6/40 + 9w5/20 - 27w*4/8 + 27w*3/2 + 9w2. Let z(j) = 0. Calculate j. 3 Factor m2 + 8 + m*2 - 4m - 5m2 - m2. -4(m - 1)(m + 2) Factor -17m - 48 - 5m - 2m - 5m2 + 2m*2. -3(m + 4)*2 Let a = -123747019/3737 + 33114. Let v = a - -168169/14948. Find k such that -25/4k*3 + 1 + vk*2 - 6k = 0. 2/5, 1 Let o(q) be the second derivative of -3q2 + 0 + 1/10q*5 + 7/3q*3 - q - 5/6q*4. Factor o(a). 2(a - 3)(a - 1)2 Let f = 3 + 0. Factor -10u + 2u - 3u*f + 3u*3 - 2 - 10u*2 - 4u*3. -2(u + 1)*2(2u + 1) Let -7m*4 + 8m*2 + 6m*3 + 2m*4 - 8m - 3m4 + 2m*5 = 0. What is m? -1, 0, 1, 2 Let g(s) be the third derivative of -1/24s*4 + 1/120s*6 + 0 + 1/6s*3 - 1/60s5 + s2 + 0s. Let g(p) = 0. Calculate p. -1, 1 Let n(q) be the first derivative of q4/10 + 16q*3/15 - 9q*2/5 + 21. Find v, given that n(v) = 0. -9, 0, 1 Let y(r) be the first derivative of 9r*4/4 + 2r*3 - 3r*2/2 + 14. Let y(h) = 0. Calculate h. -1, 0, 1/3 Let j(w) = -6w*4 - 63w*3 - 15w*2 + 69w. Let y(i) = -i*4 - 9i*3 - 2i*2 + 10i. Let q(f) = 2j(f) - 15y(f). Find g, given that q(g) = 0. -2, 0, 1 Suppose 0l - 12 = -6l. Let z(p) be the second derivative of 0p4 + 1/135p*6 + p + 0 + 0p*l - 1/90p*5 + 0p*3. Find q such that z(q) = 0. 0, 1 Find d, given that 3 + 3d2 + d3 + 9d2 - 1 - 6d*3 - 9d = 0. 2/5, 1 Let o(q) be the second derivative of 8q2 + 0 + 4q*3 - 7q + 3/4q4. Suppose o(c) = 0. What is c? -4/3 Let b(z) be the first derivative of -z4/24 - z3/6 - z2/4 + 4z - 3. Let r(g) be the first derivative of b(g). Solve r(k) = 0 for k. -1 Let s(o) be the second derivative of -o4/48 + o3/2 - 9o2/2 + 34o. Factor s(c). -(c - 6)*2/4 Let v = 2176/3 + -724. Let 0 + 6x*3 + vx + 14/3x2 + 10/3x*4 + 2/3x*5 = 0. What is x? -2, -1, 0 Let j(v) be the first derivative of -5v*4/12 + 2v3/9 + 6. Factor j(h). -h2(5h - 2)/3 Let w = -1 - -4. Solve w - 30k3 - 3k*5 + 32k*2 - 15k - 2k2 + k4 + 14k4 = 0. 1 Let t(d) = d5 + d2 + d3 + 2d4 - 2d*4. Let r = 9 - 12. Let k(b) = -2b*5 + 2b*4 - 3b*3 - 5b*2 - b. Let w(g) = rt(g) - k(g). Solve w(l) = 0. -1, 0, 1 Let y(w) = 14w5 + 18w*4 + 2w*3 - 2w*2 + 2w + 2. Let j(h) = 14h5 + 18h4 + h3 - 3h2 + 3h + 3. Let n(f) = -2j(f) + 3y(f). Solve n(r) = 0. -1, -2/7, 0 Let g(v) be the second derivative of v*6/30 + 2v*5/5 + 2v*4 + 16v*3/3 + 5v*2/2 + 7v. Let t(k) be the first derivative of g(k). Factor t(b). 4(b + 2)3 What is z in -2z*2 - 10z + z*2 + 11z + 2 = 0? -1, 2 Let w(x) = 23x2 - 5x - 11. Suppose 19 + 171 = -5t. Let f = t + 4. Let k(g) = 4g*2 - g - 2. Let a(v) = fk(v) + 6w(v). Suppose a(b) = 0. What is b? -1 Let t(g) = g4. Let p(k) = -18k*4 - 16k*3 - 108k + 4k3 + 81 + 30k*4 + 54k*2. Let n(u) = 2p(u) - 22t(u). Factor n(w). 2(w - 3)*4 Solve -8k + 3k3 + 8k - 6k2 = 0 for k. 0, 2 Let w(d) be the second derivative of d6/480 - d5/240 - d4/48 - 5d*2/2 + 4d. Let x(p) be the first derivative of w(p). Factor x(h). h(h - 2)(h + 1)/4 Factor -8c3 + 3c*3 + 48 - 48. -5c*3 Let h = 22 + -20. Factor 0 + 2/3k + 4/3kh - 4/3k*4 - 2/3k*5 + 0k*3. -2k(k - 1)(k + 1)*3/3 Let p(s) = -17s*2 - 8s - 5. Let d(c) = 26c2 + 12c + 8. Let t(y) = -5d(y) - 8p(y). Factor t(m). 2m(3m + 2) Let p(j) be the third derivative of 0j*5 + 0j*3 - 5j*2 + 0j*4 + 0 + 1/360j*6 + 0j. Factor p(v). v*3/3 Determine f so that 44f*2 - 5 - 3f + 13f - 49f*2 = 0. 1 Let m = 23 - 21. Let c(i) be the first derivative of -m - 1/9i*3 + 0i + 0i2. Suppose c(l) = 0. What is l? 0 Let l(j) be the first derivative of 0j - 3/2j2 - 3/4j*4 + 2 - 2j3. Find z, given that l(z) = 0. -1, 0 Let g(i) be the first derivative of -i6/240 - i2 - 3. Let n(v) be the second derivative of g(v). Factor n(b). -b3/2 Let v(g) be the first derivative of -1 + 0g3 - g + 0g*5 - 1/18g*4 + 1/6g*2 + 1/90g6. Let y(q) be the first derivative of v(q). Factor y(z). (z - 1)2(z + 1)2/3 Let g(p) be the third derivative of -p7/5460 + p6/780 - p5/390 - p3/3 - 6p*2. Let i(n) be the first derivative of g(n). Solve i(c) = 0. 0, 1, 2 Let j(o) be the third derivative of 1/90o*5 - 1/180o*6 + 0o + 0 - 3o2 + 0o*3 + 0o*4 + 1/504o*8 - 1/315o*7. Factor j(z). 2z*2(z - 1)*2(z + 1)/3 Factor 3 - 9i4 + 2i*4 + 10i*4 - 6i*2. 3(i - 1)*2(i + 1)*2 Find z, given that -16 - 3z*2 + 1/4z*3 + 12z = 0. 4 Let x be (-2)/(	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from zozoozzhzzzhhozh. What is prob of picking 4 z? 1/26 Three letters picked without replacement from {k: 7, l: 1}. What is prob of picking 3 k? 5/8 Two letters picked without replacement from llkhlkylzlkklly. What is prob of picking 1 y and 1 h? 2/105 Calculate prob of picking 3 s when three letters picked without replacement from {s: 3, y: 1, q: 5}. 1/84 Calculate prob of picking 2 c and 1 d when three letters picked without replacement from cvccccdcvddc. 63/220 What is prob of picking 1 w and 1 h when two letters picked without replacement from loolwvxwhwvlovowvxlo? 2/95 Two letters picked without replacement from dedrdeerreeeeree. What is prob of picking 2 e? 3/10 Three letters picked without replacement from {p: 2, m: 2, t: 4, s: 2, o: 1, u: 4}. Give prob of picking 2 m and 1 t. 4/455 Two letters picked without replacement from kkvivw. What is prob of picking 1 w and 1 v? 2/15 Two letters picked without replacement from ipipivpprzp. Give prob of picking 1 z and 1 r. 1/55 Two letters picked without replacement from {g: 4, d: 3, w: 2, y: 3, n: 2, e: 2}. What is prob of picking 1 w and 1 g? 1/15 Four letters picked without replacement from fnsffnffnffnfssgjf. Give prob of picking 2 s and 2 f. 3/85 What is prob of picking 1 x and 1 h when two letters picked without replacement from hxhxo? 2/5 Two letters picked without replacement from nknyyrynyrrrjrjy. Give prob of picking 1 n and 1 r. 1/8 Three letters picked without replacement from uyuyytyuuttyy. What is prob of picking 1 t and 2 y? 45/286 Calculate prob of picking 4 f when four letters picked without replacement from fffff. 1 Two letters picked without replacement from nnkaoskaak. Give prob of picking 1 k and 1 a. 1/5 Three letters picked without replacement from {r: 3, e: 13}. Give prob of picking 3 e. 143/280 What is prob of picking 1 b and 1 m when two letters picked without replacement from urgumrmrzbu? 2/55 Three letters picked without replacement from {a: 2, p: 4, h: 4}. Give prob of picking 3 p. 1/30 Three letters picked without replacement from hjjceem. Give prob of picking 2 j and 1 c. 1/35 What is prob of picking 2 w when two letters picked without replacement from wwewemmewemwemmemwm? 5/57 Calculate prob of picking 1 a, 1 p, and 2 r when four letters picked without replacement from {a: 5, r: 4, p: 1}. 1/7 Calculate prob of picking 1 i, 1 h, and 2 q when four letters picked without replacement from mihmhihiqiiiihqqqh. 7/102 What is prob of picking 2 q when two letters picked without replacement from rxriqifxqxhiiiirif? 1/153 Three letters picked without replacement from {f: 1, l: 6, j: 3, p: 7}. Give prob of picking 1 l, 1 j, and 1 f. 9/340 What is prob of picking 2 h when two letters picked without replacement from qqhhqqqqhqh? 6/55 What is prob of picking 3 j when three letters picked without replacement from jjjjjjjjjjff? 6/11 What is prob of picking 1 f and 1 j when two letters picked without replacement from pilipxpfijl? 1/55 Three letters picked without replacement from {d: 5, x: 1, b: 9, p: 3}. Give prob of picking 1 b and 2 p. 9/272 Two letters picked without replacement from qqllllllqllqqqllqqql. What is prob of picking 1 q and 1 l? 99/190 What is prob of picking 1 y and 1 l when two letters picked without replacement from yfylvycvyfvvyylvu? 3/34 What is prob of picking 1 f and 3 p when four letters picked without replacement from {f: 3, p: 7}? 1/2 Calculate prob of picking 1 x, 1 t, and 1 u when three letters picked without replacement from jujxujtuvujpjpxjjx. 1/68 Two letters picked without replacement from {a: 1, u: 10, x: 3, q: 2}. What is prob of picking 2 u? 3/8 What is prob of picking 1 x and 1 f when two letters picked without replacement from {f: 1, z: 1, t: 1, x: 1, o: 1}? 1/10 Two letters picked without replacement from {b: 7, k: 11, y: 2}. What is prob of picking 1 b and 1 k? 77/190 Calculate prob of picking 1 i and 1 d when two letters picked without replacement from iniiidnnnnidinniii. 2/17 Three letters picked without replacement from bibttvfvttfvbb. Give prob of picking 2 v and 1 f. 3/182 What is prob of picking 2 r when two letters picked without replacement from {r: 6, u: 4}? 1/3 What is prob of picking 1 u, 1 a, and 1 q when three letters picked without replacement from agaaqqhaaqhuhhaq? 3/70 Calculate prob of picking 1 x and 2 w when three letters picked without replacement from {w: 3, h: 1, x: 2, q: 4, c: 2, m: 3}. 6/455 Three letters picked without replacement from {t: 4, k: 2, p: 1, r: 1, j: 1, e: 3}. What is prob of picking 1 t and 2 e? 3/55 What is prob of picking 2 n when two letters picked without replacement from {n: 15, f: 5}? 21/38 What is prob of picking 2 p when two letters picked without replacement from {l: 1, p: 11}? 5/6 Three letters picked without replacement from {g: 3, n: 1, e: 1, a: 2}. Give prob of picking 1 n, 1 g, and 1 a. 6/35 Three letters picked without replacement from {b: 2, z: 1, q: 1, p: 1}. Give prob of picking 1 z and 2 q. 0 Three letters picked without replacement from giigii. What is prob of picking 2 i and 1 g? 3/5 Two letters picked without replacement from {r: 1, d: 4, s: 1, y: 1, t: 3, x: 6}. What is prob of picking 1 d and 1 r? 1/30 What is prob of picking 1 b and 1 m when two letters picked without replacement from {d: 5, b: 3, m: 4}? 2/11 What is prob of picking 1 p and 1 y when two letters picked without replacement from pyp? 2/3 Calculate prob of picking 1 g, 2 o, and 1 y when four letters picked without replacement from {y: 5, f: 4, o: 1, g: 1}. 0 Two letters picked without replacement from quauo. What is prob of picking 1 a and 1 q? 1/10 Two letters picked without replacement from pnppapapnnpp. What is prob of picking 1 n and 1 a? 1/11 Calculate prob of picking 1 v and 1 b when two letters picked without replacement from {e: 1, b: 1, a: 3, w: 6, v: 3}. 3/91 Two letters picked without replacement from okp. Give prob of picking 1 p and 1 o. 1/3 What is prob of picking 2 i when two letters picked without replacement from ciiiccff? 3/28 What is prob of picking 3 h when three letters picked without replacement from hhhhhhhhxhhhh? 10/13 Two letters picked without replacement from dzaizdzadzd. What is prob of picking 1 i and 1 d? 4/55 Four letters picked without replacement from klkklll. Give prob of picking 2 k and 2 l. 18/35 What is prob of picking 1 f and 1 d when two letters picked without replacement from qdddddddf? 7/36 What is prob of picking 1 t and 1 o when two letters picked without replacement from hrrotrorlh? 2/45 Two letters picked without replacement from qzlzkl. Give prob of picking 1 z and 1 k. 2/15 What is prob of picking 2 d and 1 e when three letters picked without replacement from {e: 1, s: 2, t: 3, z: 1, d: 5}? 1/22 Calculate prob of picking 1 a and 1 k when two letters picked without replacement from {d: 1, w: 1, a: 6, k: 1}. 1/6 Two letters picked without replacement from {x: 4, e: 3, k: 4}. What is prob of picking 2 x? 6/55 What is prob of picking 2 s when two letters picked without replacement from {f: 2, z: 8, m: 4, s: 2}? 1/120 Two letters picked without replacement from mpmmmmpmnnpnxpmp. Give prob of picking 1 p and 1 n. 1/8 Two letters picked without replacement from {e: 3, f: 3}. Give prob of picking 2 e. 1/5 Two letters picked without replacement from hjaajb. Give prob of picking 1 b and 1 a. 2/15 What is prob of picking 4 e when four letters picked without replacement from eeeeeeeeee? 1 What is prob of picking 4 g when four letters picked without replacement from {g: 5, v: 8}? 1/143 Calculate prob of picking 3 h when three letters picked without replacement from hhjhhhjhhj. 7/24 Two letters picked without replacement from gttttgggggtsggtggg. Give prob of picking 2 t. 5/51 What is prob of picking 2 s and 1 f when three letters picked without replacement from qmfswps? 1/35 Four letters picked without replacement from {l: 3, c: 2, v: 4}. What is prob of picking 1 v and 3 l? 2/63 What is prob of picking 1 x, 1 h, and 2 p when four letters picked without replacement from {p: 11, x: 1, h: 3}? 11/91 Two letters picked without replacement from xmgx. Give prob of picking 2 x. 1/6 What is prob of picking 1 c and 1 z when two letters picked without re	{ "pile_set_name": "DM Mathematics" }
? 21/323 Three letters picked without replacement from juxjbxxbbb. What is prob of picking 1 b and 2 x? 1/10 What is prob of picking 1 x, 1 s, and 2 d when four letters picked without replacement from dssdsxxsx? 2/21 What is prob of picking 1 o and 1 g when two letters picked without replacement from {g: 1, o: 1, e: 7, z: 6}? 1/105 Three letters picked without replacement from {v: 1, y: 7, w: 9, u: 1}. What is prob of picking 1 w and 2 y? 63/272 Calculate prob of picking 3 x and 1 u when four letters picked without replacement from {x: 3, u: 1, q: 4, f: 1, p: 6}. 1/1365 What is prob of picking 1 y and 1 h when two letters picked without replacement from laayuyyyaiyihyyyyy? 10/153 What is prob of picking 1 b and 1 m when two letters picked without replacement from zombzkx? 1/21 Three letters picked without replacement from {k: 1, d: 1, y: 8, r: 6, t: 1}. What is prob of picking 1 d and 2 r? 3/136 Calculate prob of picking 3 q when three letters picked without replacement from qqqqqq. 1 What is prob of picking 1 j and 1 u when two letters picked without replacement from jjujuuuyu? 5/12 Two letters picked without replacement from nmmnmnmmmm. Give prob of picking 1 n and 1 m. 7/15 Calculate prob of picking 1 g and 1 t when two letters picked without replacement from {g: 9, r: 1, t: 5, d: 1}. 3/8 Calculate prob of picking 1 m, 1 p, and 1 x when three letters picked without replacement from psxppmpxhxxmfm. 12/91 What is prob of picking 1 h, 1 x, and 1 i when three letters picked without replacement from {r: 2, h: 1, m: 1, x: 2, i: 2}? 1/14 Four letters picked without replacement from annnnnnnnnnnnnnnnna. Give prob of picking 4 n. 35/57 Two letters picked without replacement from mmmmcmmmmmc. Give prob of picking 1 m and 1 c. 18/55 Three letters picked without replacement from tvuvivdvi. Give prob of picking 1 t, 1 i, and 1 d. 1/42 Two letters picked without replacement from ttrtttrt. Give prob of picking 1 t and 1 r. 3/7 Calculate prob of picking 2 u when two letters picked without replacement from duuddudduduududd. 7/40 What is prob of picking 1 u and 1 p when two letters picked without replacement from puuiuuupuu? 14/45 Calculate prob of picking 2 h and 2 n when four letters picked without replacement from {n: 2, p: 1, g: 3, h: 3, m: 3, a: 3}. 1/455 Calculate prob of picking 2 o when two letters picked without replacement from tnntnonnonottonnono. 5/57 Calculate prob of picking 3 n and 1 d when four letters picked without replacement from {d: 7, n: 3}. 1/30 Two letters picked without replacement from unanocjcj. What is prob of picking 1 a and 1 c? 1/18 Two letters picked without replacement from {b: 1, u: 2, w: 1, j: 3}. What is prob of picking 1 w and 1 u? 2/21 What is prob of picking 3 i when three letters picked without replacement from mmiiiiiimmi? 7/33 Three letters picked without replacement from eecweccewewece. What is prob of picking 3 e? 5/52 Two letters picked without replacement from {h: 3, l: 1, e: 1}. Give prob of picking 1 h and 1 e. 3/10 Four letters picked without replacement from wlwwlwiwwwlil. Give prob of picking 1 i, 2 w, and 1 l. 168/715 Three letters picked without replacement from qqjdvvvjjv. Give prob of picking 2 q and 1 d. 1/120 Calculate prob of picking 1 o and 2 d when three letters picked without replacement from vdojzvqzvvvzd. 1/286 What is prob of picking 2 j when two letters picked without replacement from {j: 13, q: 5}? 26/51 Two letters picked without replacement from pllllllpllllllplpl. What is prob of picking 1 l and 1 p? 56/153 Two letters picked without replacement from bddkjzzjddqk. What is prob of picking 1 k and 1 q? 1/33 What is prob of picking 1 i and 2 q when three letters picked without replacement from {i: 2, q: 5, g: 9}? 1/28 What is prob of picking 1 o and 1 f when two letters picked without replacement from jfhjhoofhhohfohoj? 15/136 Calculate prob of picking 3 m when three letters picked without replacement from mmmmmmmmmmmnmmmmmm. 5/6 Calculate prob of picking 1 t and 3 h when four letters picked without replacement from huhhuuhuhutuu. 2/143 Calculate prob of picking 1 q and 2 t when three letters picked without replacement from pttttyyttypyyyqqpq. 15/272 Two letters picked without replacement from {p: 4, z: 1, c: 7, g: 1, m: 2, h: 2}. What is prob of picking 2 p? 3/68 What is prob of picking 3 b and 1 r when four letters picked without replacement from {r: 8, b: 3}? 4/165 Calculate prob of picking 1 v, 1 g, and 1 d when three letters picked without replacement from {v: 1, m: 1, g: 1, d: 1, s: 1}. 1/10 Three letters picked without replacement from {b: 6, q: 2}. Give prob of picking 2 q and 1 b. 3/28 Calculate prob of picking 2 i when two letters picked without replacement from cdccdddicddicd. 1/91 Two letters picked without replacement from {w: 3, k: 7, t: 2}. Give prob of picking 1 w and 1 t. 1/11 Calculate prob of picking 1 p and 2 z when three letters picked without replacement from ppzzz. 3/5 Four letters picked without replacement from gnggnnggngnggngnnnnn. What is prob of picking 4 n? 22/323 Three letters picked without replacement from {x: 7, i: 2, r: 7}. Give prob of picking 3 x. 1/16 Two letters picked without replacement from tyssiqctyicisssii. What is prob of picking 1 s and 1 i? 25/136 Four letters picked without replacement from zupazazapfazfha. Give prob of picking 1 p, 2 f, and 1 a. 2/273 What is prob of picking 1 y and 1 p when two letters picked without replacement from {y: 8, e: 6, p: 1}? 8/105 Calculate prob of picking 2 e and 1 k when three letters picked without replacement from kkkeeeeekeeeke. 45/91 Calculate prob of picking 3 d when three letters picked without replacement from tdddtddddd. 7/15 Two letters picked without replacement from {w: 3, m: 15}. What is prob of picking 1 w and 1 m? 5/17 Four letters picked without replacement from qqqqq. Give prob of picking 4 q. 1 Four letters picked without replacement from aaaaaaiaaaaaa. What is prob of picking 3 a and 1 i? 4/13 Four letters picked without replacement from {q: 4, r: 6, h: 3, z: 1, y: 2}. What is prob of picking 2 h, 1 r, and 1 y? 9/455 What is prob of picking 1 v and 1 e when two letters picked without replacement from {f: 5, e: 1, v: 4}? 4/45 What is prob of picking 2 v and 2 z when four letters picked without replacement from {z: 5, o: 1, f: 6, v: 3}? 2/91 Two letters picked without replacement from ccwsc. Give prob of picking 1 w and 1 s. 1/10 Three letters picked without replacement from kkkskkkkkkss. Give prob of picking 2 s and 1 k. 27/220 Four letters picked without replacement from daazaaaoaooaodzbd. Give prob of picking 1 o, 2 a, and 1 d. 9/85 Four letters picked without replacement from {c: 7, r: 6}. Give prob of picking 4 c. 7/143 Four letters picked without replacement from {o: 3, g: 5}. Give prob of picking 3 g and 1 o. 3/7 Three letters picked without replacement from aaawawa. Give prob of picking 3 a. 2/7 Two letters picked without replacement from {a: 2, t: 4}. Give prob of picking 2 a. 1/15 What is prob of picking 1 f and 1 w when two letters picked without replacement from {f: 2, w: 1, t: 1, o: 4, z: 2}? 2/45 Three letters picked without replacement from vvzrzzvvkzdvvdyzzy. What is prob of picking 1 y, 1 v, and 1 z? 3/34 Four letters picked without replacement from {o: 4, k: 1, e: 3, a: 6}. Give prob of picking 3 o and 1 k. 4/1001 What is prob of picking 2 t, 1 s, and 1 p when four letters picked without replacement from {t: 4, p: 3, s: 1}? 9/35 Calculate prob of picking 2 p when two letters picked without replacement from pkppkpwpppppkwppp. 33/68 Three letters picked without replacement from {r: 1, p: 18}. Give prob of picking 3 p. 16/19 What is prob of picking 2 q when two letters picked without replacement from {q: 5, c: 9}? 10/91 Four letters picked without replacement from igisbicbbqgibqgiqiq. Give prob of picking 1 s, 1 b, and 2 g. 1/323 Calculate prob of picking 4 q when four letters picked without replacement from qqqqq. 1 What is prob of picking 2 d and 1 f when three letters picked without replacement from {f: 17, d: 3}? 17/380 Calculate prob of picking 1 v and 1 l when two letters picked without replacement from lvbblzlvl. 2/9 Three letters picked without replacement from {z: 4, a:	{ "pile_set_name": "DM Mathematics" }
t r = -4 + y. What is the third smallest value in -0.1, c, r? -0.1 Let j be (1 - (1 - -1))(4 + -3). What is the third biggest value in j, -3/5, 2/7, -2/9? -3/5 Let j = 0.2 + -0.3. Let m be 3/2723. Let n = -3 - -3.4. Which is the third smallest value? (a) j (b) m (c) n b Let f = -3.98 - -4. Let h = 2.98 + f. Let t = -5 + h. Which is the biggest value? (a) 4 (b) 3/2 (c) t a Let p be (3 + (-19)/2)-2. Let l = p + -9. Which is the second smallest value? (a) -3 (b) l (c) 2 c Let n = 57 + -55.94. Let w = n + -0.06. Let r(z) = -z + 8. Let u be r(6). Which is the third smallest value? (a) u (b) w (c) 0.2 a Let u = -55 + 54. What is the smallest value in 3, 0.3, u? u Let y = 0.07 + 1.93. Which is the biggest value? (a) 3 (b) 0.8 (c) y a Let h be 8/126 + (-5 - 99/(-21)). What is the third smallest value in h, -1, 0.2, -3? h Let j = -3.982 - 0.018. Which is the smallest value? (a) -5 (b) 3 (c) j (d) -0.2 a Let f = 108669/236132 - -1/3107. Let i = f + -4/19. What is the third biggest value in 0.3, 0.4, i? i Let v = 37 + -16. Let m = v + -24. What is the biggest value in -2/3, m, 0.4? 0.4 Let g be 154/1480 - (-2)/(-8). Let r = g + -2/37. Suppose 4o = -14 + 22. Which is the second biggest value? (a) o (b) -2 (c) r c Let x be (-2)/(-9) - (0 + 0). Let i = 31 - 31.2. Let n be (-2)/4 - (-7)/(-98). What is the third smallest value in n, i, x? x Let h be 4/(-15) - (-28)/70. Which is the second biggest value? (a) h (b) 5 (c) -3 a Let l = -3/16 + -5/16. Let y be ((-2)/(-6))/((-1)/(-3)). Let v be 4/((-16)/6) - y. Which is the biggest value? (a) 0 (b) v (c) l a Let r = -9.3 - -4.5. Let i = 6 - 1. Let y = r + i. What is the biggest value in -5, 2/17, y? y Let q(t) = -7t - 17. Let h be q(-3). Let d be 2/5 - 8/(-5). Let w be 10/(-4)1d. Which is the smallest value? (a) h (b) w (c) 1 b Let m = -2.6 - -2.4. Which is the second biggest value? (a) m (b) -1 (c) 0.2 a Let k = 2/3 + -1. What is the second biggest value in k, 15, 0.3? 0.3 Let x = -275/4 - -70. Let p = 31 - 157/5. What is the biggest value in x, 3, p? 3 Let t(x) = -26x + 4. Let g be t(8). Let c = g - -3058/15. What is the third smallest value in -0.5, 2/3, c? 2/3 Let n = -451/3 - -149. Which is the second biggest value? (a) 41 (b) 5 (c) n (d) 0.2 b Let f be 6/30(-10)/(-8). Which is the second smallest value? (a) 128 (b) -1/6 (c) f c Let s = -97 - -482/5. Let h be (-24)/(-45) + (-2)/6. What is the second smallest value in h, 1, s? h Let i be 0 - 0/6 - 1. Let z be ((-1)/(-8 + -2))/1. Which is the second biggest value? (a) 1/2 (b) z (c) i b Let z(v) = -v + 9. Let r be z(5). Let w be (2/(-3))/((-4)/24). Let l = w - r. What is the third smallest value in l, -1, -3/4? l Let y = -60 + 55. What is the third biggest value in -0.1, 5, y, 4? -0.1 Let k(g) = 3g. Let p be k(2). Suppose -4q - p = -3l, 4l = 3q + 2 + 6. Which is the third biggest value? (a) q (b) 2 (c) -5 c Let r = 3 - 1. Let z be (-1)/10/1. Suppose -3u - rv = -0 - 2, z = 4u + 2v - 4. Which is the smallest value? (a) -3 (b) -1/5 (c) u a Let t = -22.5 + 22. What is the biggest value in 3, -3/5, t? 3 Let a = -1.4 + -10.6. What is the biggest value in -0.2, a, -0.5? -0.2 Let n = -3/2 - -3. Which is the biggest value? (a) 2/9 (b) 3 (c) 1 (d) n b Suppose 0 = -16z + 1 - 17. Let q = 533/5 - 107. What is the smallest value in q, z, 0.5? z Let a = -257/332 + 2/83. What is the second smallest value in a, 0.5, -2? a Let n = 956913 - 199995209/209. Let j = -46/19 - n. What is the third smallest value in -1, -3, j? j Let p = 6.06 - 6. Let i = -6.71 + 6.7. Let x = i - p. Which is the biggest value? (a) 1/11 (b) x (c) -2 a Let t = -7 + 11. Let h = -0.3 + 0.4. Which is the second biggest value? (a) -3 (b) h (c) t b Let v = -33 - -28. Which is the second biggest value? (a) v (b) -1/3 (c) 1 b Suppose -28s - 15 = -33s. Let d be (2/4)/(2/44). Which is the second biggest value? (a) 2 (b) s (c) d b Suppose 2 = 2h - h. Let t be h - (2 - 6/33). Let r = -0.05 + 0.05. What is the third biggest value in 4/3, r, t? r Let l be ((-2)/10)/(0 - 1). Let y = -1 + -2. Let f = y - -8. Which is the third biggest value? (a) f (b) 0.1 (c) l b Suppose n = -3n + 16. Let d be (-1)/3 + (n - 3). Let b be 3/(-2) - (-1)/2. What is the biggest value in -0.1, b, d? d Let l = -0.04 - -3.04. Let f = 1 + l. Which is the third smallest value? (a) f (b) -0.3 (c) 0.5 a Suppose -u - 5r + r = -1, -4u - 2r + 4 = 0. Let i be 2/(4/(-6))u. Let j be (1/(-1))/(6/i). Which is the biggest value? (a) 0.2 (b) -3/4 (c) j c Let q = -75/44 - -16/11. Let y(d) = d3 + 8d*2 - 8d + 11. Let k be y(-9). Let p = 2.9 + 0.1. What is the third biggest value in k, p, q? q Let s = -5.6 - -0.6. What is the second biggest value in 0, s, -0.4? -0.4 Let q = 9.3 + -8.9. Which is the fourth smallest value? (a) -0.2 (b) 0 (c) 3 (d) q c Let k = 7 - 8. Let z = k + 4. What is the second smallest value in 5, 2, z? z Let y = 58.78 - 60. Let r = y - -0.22. What is the second smallest value in r, 2, 0.1? 0.1 Let g = -15809/15 + 1053. Let z = g - -23/15. Which is the biggest value? (a) -0.2 (b) 1 (c) z b Let z = 2.3 - -0.63. Let l = z - -0.07. Let v = -17 - -22. Which is the smallest value? (a) l (b) -0.1 (c) v b Let w = 3.1 + -0.1. Which is the smallest value? (a) w (b) 1/11 (c) -3 c Let p(m) = -m - 6. Let j be p(-6). Let g = -0.884 + -0.116. Which is the second biggest value? (a) g (b) -5 (c) j a Let c = -8045986/225 + 35760. Let f = 20254/25 - 810. Let u = c + f. What is the third smallest value in u, -3, 0? u Suppose 0 = -2f + 5f - 9. Suppose 3t - z = 12, ft + 0t = 2z + 15. Suppose -v = t - 2. What is the third smallest value in -1/10, 3, v? 3 Let p = 0 - 1. Let x = 0.031 + -0.131. What is the second biggest value in -4, p, x? p Let y(j) = j + 16. Let w be y(-12). What is the second smallest value in -7, w, -1? -1 Let q = 1 + 4. Let g = q - 2. Let u = g + -6. Which is the third smallest value? (a) -4 (b) u (c) 2 c Let o = 6 + -7. What is the smallest value in 0.5, o, 6? o Let s = 1.1 + -0.6. Let n = s - 0.5. What is the biggest value in 0.4, n, -2? 0.4 Let b = 14.8 - 15. What is the smallest value in b, 0.4, -5? -5 Let a = 1 - 1.5. Let r = -0.3 + -1.7. What is the smallest value in -0.1, r, a? r Let o be 2/5 + (-18)/120. Which is the third biggest value? (a) -5 (b) o (c) -1/12 a Let u = 69.96 + -70. Which is the biggest value? (a) -3 (b) -0.4 (c) u (d) 0.2 d Let o = 23 + -14. Let j = -9.3 + o. Let z be 1 + 1 + (-13)/7. Which is the second biggest value? (a) j (b) z (c) 0.2 b Let l = -16 + 22. Let r = l - 1.5. Let z = r - 5. What is the second smallest value in 2/5, 4, z? 2/5 Let g(w) = -w*3 + 3w*2 - 4w - 4. Let k be g(3). What is the smallest value in -3, k, -3/4, 2? k Let h = -2 - -2.2. Suppose 7g - 3g - 24 = 0. Let l be ((-4)/16)/(g/(-8)). What is the third biggest value in 5, h, l? h Let g(l) = l + 10. Let k be g(-6). Suppose -r - 10 = kr. Which is the second biggest value? (a) r (b) 2/11 (c) -2/11 c Let b = -35 - -10. Let w = -25.4 - b. What is the third biggest value in w, -2, 4? -2 Let h be -2 - (123/(-24) - -3). Which is the biggest value? (a) -0.4 (b) h (c) 0.1 b Let j = -1.96 - -1.7. Let m = 0.06 + j. Which is the biggest value? (a) -1 (b) -0.4 (c) m c Let c = -21/11 - -127/55. What is the third biggest value in 2, 0.2, c? 0.2 Let u = -23 + 22.6. Which is the smallest value? (a) -1 (b) u (c) -0.5 a Let m = -4.03 + 4. Let y = -0.53 - m. What is the biggest value in -1, y, -0.2? -0.2 Suppose -4r + 24 = 4z, 3r - 2z = z + 12. What is the second biggest value in -0.2, r, -2/13? -2/13 Let y be 1 + -2 + (-18)/(-14). Which is the third smallest value? (a) 0.03 (b) y (c) 2 c Let p = -0.03 + -2.97. What is the third smallest value in 1, 0, p? 1 Let w = 16.7 + -17. Let f = -18/5 + 4. What is the second biggest value in -0.1, f, w? -0.1 Let j = 191 + -185. Which is the biggest value? (a) -0.1 (b) -0.2 (c) j c Let u = 5/19 + 13/95. Suppose -q = 5l - 2 - 11, -5 = 5l - 5q. What is the second smallest value in l, -0.5, u? u Let w = 27 - 23. What is the third smallest value in -3, w, 0? w Let m = 0.04 + 0.26. Let w = -16 + 6. Let d be (w/25)/(2/(-20)). Which is the second smallest val	{ "pile_set_name": "DM Mathematics" }
the closest to s in 0, w, 4? 0 Let g = 80 + -561/7. Which is the nearest to -2? (a) g (b) 4 (c) 1 a Let c = -0.4 - -0.8. Let k = -0.6 + -0.4. What is the closest to k in -4, 5, c? c Let w = -4.5 + 5. Let a = -7 - -4. Let i = -3 - a. What is the nearest to 2/13 in 1/10, w, i? 1/10 Let n = -1.5 + 5.5. Let y = n + -4.4. What is the nearest to -2/7 in y, -0.3, -4? -0.3 Let s = 0.037 + -30.037. Which is the closest to s? (a) 3/5 (b) 4 (c) 0.3 c Let p(v) = v*3 - 10v*2 - 12v + 13. Let f be p(11). Suppose 2s = q - fs + 18, 0 = 3s - 15. Which is the closest to q? (a) -4 (b) 0.5 (c) 0 b Let h = 51 + -51.2. Let q = -3.7 - -4. What is the closest to -2/5 in 2, q, h? h Let r = -0.105 - -0.005. What is the nearest to r in 0.1, 0, 0.4? 0 Let f = -15/8 - -11/8. What is the closest to f in 1, -0.5, 3? -0.5 Suppose -2s = -0s + 2. Let z = -0.23 - 3.97. Let r = z - -0.2. Which is the nearest to -0.1? (a) 5 (b) s (c) r b Let n be 186/(-180) + (-2)/121. What is the nearest to n in -2, -1/5, -4/7? -4/7 Let w be -3 + 92/28 - 0. Let u be 4/3(-3)/(-10). Which is the closest to 2? (a) 0 (b) u (c) w b Let u = 4.4 - 4.2. Which is the nearest to -1? (a) u (b) -16 (c) 0.4 a Let z = -0.63 + 0.33. Which is the nearest to 3? (a) -1/2 (b) z (c) -1 b Let b = -11 + 11.1. What is the closest to -2 in 1/3, 2, b? b Let w = -15 + 11. Which is the nearest to -2/7? (a) -1 (b) -2 (c) w a Let t = -0.07 - -3.07. Let m(b) = -6b - 4. Let v be m(-1). What is the closest to 2/7 in 2/9, v, t? 2/9 Let u = 1 - 0. Which is the closest to u? (a) -0.3 (b) 2 (c) 2/17 c Let u = 2 - 1. Let x = 5.07 - 0.07. Let c = -226 + 228. What is the closest to u in c, -2, x? c Let c = 9 + -12. Let i be -1 - 31/1. What is the nearest to -2 in -0.5, c, i? c Let u = 115.9 + -111. Let n = -0.1 - u. Which is the closest to 0.1? (a) 1 (b) n (c) 5 a Let h = -99.7 - -106. Let n = 6 - h. What is the closest to -0.3 in 0.3, 5, n? n Let s = 22 - 13. Let o = s - 10. Which is the nearest to o? (a) 1 (b) 2/11 (c) -5 b Let y = 0.041 - 2.341. Let v = 2 + y. Let g be (-4)/1415/10. Which is the nearest to -1? (a) 5/3 (b) g (c) v b Let o = 17 + -16.9. What is the nearest to o in -4, -1/3, -2? -1/3 Let g be (-8)/(-5) + 4/10 + 0. Let y = -6.4 + 6. Which is the closest to 0? (a) g (b) 2/17 (c) y b Suppose 0 = k + 2k + u - 12, -5k - u = -18. Let r = 202.8 + -203. Which is the closest to 0? (a) k (b) r (c) 1/6 c Let v = 2 - 1.5. Let x be (-7)/35-11. Which is the nearest to 0.1? (a) 5 (b) x (c) v b Let d = -10 - -6. Let p be 4((-1)/6 + 0). Which is the closest to p? (a) 4 (b) d (c) 3/2 c Let m = 6 + -4. Suppose 2u - 4l = 0, 1 = -4u + 2u + 3l. Let x = 0.4 - 0.3. What is the nearest to x in 0.2, m, u? 0.2 Let n = 16.93 - 17. Let h = 0.01 + n. Let g = h + -3.94. What is the closest to 1 in -3, 0, g? 0 Suppose 4 = x + 3. Let p be (-10)/(-6) - (2 - x). Let o be (-1)/(-5) + 8/(-10). What is the closest to -2 in p, o, -5? o Let k = 3 + -5. Let w = -2.01 - k. Let q = 1.99 - w. Which is the closest to 0? (a) q (b) -0.5 (c) -0.2 c Let q = 145 - 434/3. What is the nearest to 3 in -1/3, -0.3, q? q Let v(y) = -y*3 + 6y*2 - 5y. Let t be v(5). Let n = 84 + -87.9. Let k = n - -1.9. Which is the closest to t? (a) 3 (b) 1/2 (c) k b Let p = -0.1 - 0. Let x = -642/7 - -92. Let o = 0.2 - -3.8. What is the closest to p in o, 0.3, x? x Let d = -31/5 - -148/15. Let g = d + -3. Let u = -20 + 19.6. What is the closest to 0 in 0.1, g, u? 0.1 Suppose 0p - 3p - 5y = 14, 3p + 2 = -2y. Suppose 0 = 4w - 6w - p. Let u = 1 - 0. Which is the nearest to 2/7? (a) w (b) u (c) -5 b Let m = -30 - -149/5. What is the nearest to m in 5, 3/4, 0.4? 0.4 Suppose 3u = -2m, -5m - u = -0u. What is the nearest to -2/3 in 1, m, 0.1? m Let m = -0.034 - -2.034. What is the closest to -2/3 in 2/3, -8, m? 2/3 Let g = -4 - 0. Let p = g - -4.5. Let n = p - 0.4. Which is the nearest to n? (a) -1/3 (b) 0 (c) -1/4 b Let r = 25 + -24.5. Let w be ((-2)/12)/((-6)/(-9)). What is the nearest to 3 in r, w, 1? 1 Let h = -1 + -0.4. Let r = h - -0.7. Let x = r + 3.7. Which is the nearest to 0.1? (a) 3/2 (b) -2 (c) x a Let p = 3 + -2. Suppose 3 = d - p. Let k = 2168/19 - 114. Which is the closest to 1? (a) -3 (b) d (c) k c Let o = 0.1 + 0.4. Which is the nearest to -2? (a) 5 (b) o (c) -2 c Let u = -4 + 3.15. Let l = 0.15 - u. What is the nearest to l in -1/5, -0.5, -1? -1/5 Let s be (16/10 - 2) + 1. Let q = -11.9 - -12. What is the closest to 1 in 2/7, s, q? s Let i be (-5)/(-10)16/(-28). Which is the closest to 0? (a) 4 (b) i (c) -0.2 c Let v = -4 - -3.6. Let p = -1.4 - v. Which is the nearest to 2/3? (a) p (b) 1 (c) -1/2 b Let n = 1.9 + -2. Let o be 1/(-2) - (-66)/4. Suppose f + 3f = o. Which is the nearest to n? (a) 1/3 (b) 0.5 (c) f a Suppose v = 2v. Let o = 0.21 - 0.01. Which is the closest to o? (a) v (b) -4 (c) -1 a Let k be ((-304)/78 + 4)(-3)/2. Let m = 1.99 - -0.01. What is the nearest to -3/5 in -3, k, m? k Let y = 9 - 8.8. Let q = 5.09 + -0.09. Let w = q + -10. What is the closest to 1 in y, -4, w? y Let s be (-24)/10(92/12 - 1). Which is the nearest to 0? (a) -3 (b) s (c) -5 a Let z be ((-1)/2-2)/1. Let p = 0.28 + 0.22. Which is the nearest to -4? (a) -1 (b) p (c) z a Let o = -21 - 12. Let n be 11/o + (-2)/(-6). Which is the nearest to 1? (a) -2/3 (b) n (c) -2 b Suppose 4v = -10 - 14. Let m = v + 7. What is the closest to m in -1/2, 0, 4? 0 Let q = 0.65 + -1.15. Let t be 0 - (-1)/(2/(-6)). What is the nearest to -1 in 2, q, t? q Let s = -5.87 + -0.13. Let p = 5.6 + s. Let f = 0.06 + 3.94. What is the closest to -1 in 1, p, f? p Let a = 11 - 11. What is the nearest to a in 5, 0.2, -0.8? 0.2 Suppose 13 = -3i + 4. Let y = 14 - 14.6. Let g = y - -2.6. What is the closest to i in -0.1, g, 0.1? -0.1 Let w = 0.085 + 0.915. Which is the closest to -0.02? (a) w (b) -3 (c) -0.4 c Let d be 299/(-7) + 6/(-21). Let t = 173/4 + d. Let v = 7.9 - 8. Which is the nearest to t? (a) 0 (b) 1/6 (c) v b Let w = -18.5 + 18. Let o = w + 0.8. Which is the closest to 2/7? (a) 5 (b) 0 (c) o c Let h(k) = -k - 2. Let j be h(-1). Let g = 2.5 + -3. Which is the nearest to -1/3? (a) g (b) 3/10 (c) j a Let t = 5.93 + 0.07. Let h = 4 - t. Let g = h + 3. What is the nearest to g in -3, 1, 1/5? 1 Let t = -0.4 - 4.6. Let v = 10 + t. Let f = 208.5 - 209. What is the closest to -0.1 in 3, f, v? f Let f = -1.2 + -2.8. Which is the nearest to 1? (a) f (b) -0.3 (c) -0.4 b Let i = -21.2 - -20. What is the closest to 0.1 in i, -0.5, 0.5? 0.5 Let y(n) = -5n*3 - 2n*2 + 2n - 1. Let k be y(1). Let l be ((-9)/3)/(k/(-8)). Which is the closest to 2/7? (a) 1 (b) l (c) 1/4 c Let w = -0.063 - -0.373. Let l = w - 0.01. What is the nearest to -0.1 in -4/3, l, 1/2? l Let u = -5 + 14. Let r be (-16)/(-72) - (-4)/u. Which is the nearest to -0.1? (a) -1 (b) r (c) -0.4 c Let t = 3 - 5. Which is the nearest to -1? (a) -0.3 (b) t (c) 0.4 a Let g = 1160/7 + -166. Let m = -2 - 2. Let b be (1 + 6/m)4. What is the nearest to g in 5, b, 0.3? 0.3 Let h = -163 - -166. Let i = -16 - 24. Let a = 159/4 + i. What is the closest to 0 in -2/7, h, a? a Let l = 1/67 - 206/335. What is the nearest to l in 5, 1/4, -1/2? -1/2 Let b be (-1)/(-15) - 11/(-33). What is the closest to b in 0.2, -0.3, 4? 0.2 Let g = 0.2 + -0.3. Let j = 39 - 37. Let t = 2137/52 - 165/4. What is the closest to 0.2 in j, t, g? g Suppose -3t - 4 = 4c, -2c - 3t = -4c - 20. Let f = 0 - 3. What is the closest to -0.2 in -1/5, f, c? -1/5 Suppose 11 = -3u + 5p, u + u - 4p = -4. Let s = -13 - u. Let t = 0.3 - -0.2. Which is the nearest to 0.1? (a) t (b) 0.1 (c) s b Let o = 0.4 + -0.2. Suppose j - 4 = x - 7, 2x - 20 = -5j. What is the nearest to o in x, 0, 0.5? 0 Let j = 21 + -20.7. Let m = -1/9 + 29/18. Which is the nearest to 2? (a) m (b) j (c) 5 a Let u = 4 + -8. Let h = 83.1 + -83. What is the nearest to h in u, 5, 0.2? 0.2 Let n = 5/6 - 7/6. What is the nearest to 2 in 0.2, 2, n? 2 Let s = -17.77 + -0.23. Let l = -20 - s. What is the nearest to -1/4 in 5, l, 0.1? 0.1 Let k = -128 + 259/2. What is the nearest to -1 in k, 3, -0.19? -0.19 Let y(r) = r3 - 4r*2 + 3r + 3. Let x be y(3). Let o be 0 - -1 - x/6. Suppos	{ "pile_set_name": "DM Mathematics" }
5 (b) 3 (c) 0.717 (d) 8 (e) 4 c What is the nearest to 3/5 in 0.3, 1/4, -26? 0.3 What is the closest to -1 in -13, -0.1, -6598? -0.1 Which is the nearest to 2? (a) -20.2 (b) -9 (c) -1/3 (d) 2 d What is the nearest to -0.1 in 284, 3/5, 1, 0.06, -1/2? 0.06 Which is the nearest to -0.05? (a) 50 (b) 2/7 (c) 3 (d) 0.1 d What is the closest to 15/23 in -167, 0.12, -2/17? 0.12 Which is the nearest to -3/2? (a) -2 (b) -0.035 (c) -2/5 a What is the nearest to -5 in -68, -1/46, -1/9? -1/9 What is the nearest to -2/7 in 4, 0.1, 0.0224? 0.0224 What is the closest to 1/3 in 0.05, 0.2, -128/7, -0.4? 0.2 Which is the nearest to -1? (a) -0.05 (b) 1/20 (c) -2815 (d) 2/7 a What is the nearest to -1 in -0.3, -0.045, 2/9, -10, 10/9? -0.3 What is the closest to 1 in 9, 6, -0.1, -2? -0.1 Which is the closest to 27? (a) 15/58 (b) 1/3 (c) 0.2 b Which is the closest to -1? (a) -2 (b) -576 (c) -5 (d) 16 (e) 0.2 a What is the closest to 2/5 in 400, -2, -506? -2 Which is the closest to 2/3? (a) -0.03 (b) -0.2 (c) -0.219 (d) -1/6 (e) 4 a What is the nearest to -4/15 in -0.04, 3, 2/59, 0.5? -0.04 What is the closest to -13/1097 in 2/3, 1/6, -0.4, -3? 1/6 What is the nearest to 1 in 3/4, 3, 0, -0.4, -0.996? 3/4 Which is the closest to 78? (a) -3 (b) 16 (c) 5 b Which is the nearest to -0.009? (a) -0.4 (b) 1 (c) -15/13 a Which is the closest to 0.2? (a) -2.92 (b) -1 (c) 1/3 (d) 0.1 (e) 3 d Which is the nearest to -734? (a) 2 (b) 2/5 (c) 18 b Which is the closest to -2? (a) 0.3 (b) 73/3 (c) 3 a What is the closest to 0.1 in -0.5, 0, 106, -4? 0 Which is the nearest to 44? (a) 28/9 (b) -10 (c) -2 a Which is the nearest to -1/3? (a) -1449 (b) -0.1 (c) 0.01 (d) 0.5 b Which is the closest to -0.5? (a) -0.022 (b) -6/7 (c) -0.2 (d) -1/4 (e) -1 d What is the nearest to -0.1 in 0, -14, -18/11? 0 What is the closest to -0.4 in -0.4, -0.1, 42/11, -42? -0.4 What is the nearest to 0 in 3, -315, 11? 3 Which is the nearest to -4? (a) 2/23 (b) -0.276 (c) -16 b What is the closest to 26/11 in -0.4, 3, 6, 1/3? 3 What is the closest to 1.2 in -8, 2, -32? 2 Which is the nearest to 2/13? (a) 1/149 (b) 4 (c) -1/3 a Which is the closest to -4/7? (a) -2 (b) 146 (c) -1 c What is the closest to 0 in 2, 7, -1/192? -1/192 Which is the nearest to -78? (a) -0.4 (b) -0.12 (c) 0.2 (d) -1/12 a Which is the nearest to 3301? (a) -29 (b) 0 (c) -0.1 b What is the closest to -7 in -11598, -4, 4, -2? -4 Which is the nearest to 1? (a) -4/5 (b) -2/17 (c) 1 (d) -303 (e) -5 c Which is the nearest to 0.106? (a) -0.2 (b) 240/17 (c) -4/3 a What is the nearest to -734 in -229, -2, -3? -229 What is the closest to -13.75 in -0.5, -1/6, 4? -0.5 Which is the closest to 2/3? (a) -168 (b) -0.3 (c) -5 (d) 10 (e) 2 b Which is the closest to -16? (a) -5/3 (b) -11/50 (c) -0.06 a Which is the closest to -47? (a) 0 (b) 5 (c) -3/28 (d) -2 d What is the nearest to -1588 in -0.07, 4, 2/3? -0.07 What is the nearest to 2/7 in 5, 14, -4/3, 29/5? -4/3 Which is the closest to -1/4? (a) 0.4 (b) 1529 (c) -0.05 (d) 2 c Which is the nearest to -61/65? (a) -98 (b) 3 (c) 5 b What is the closest to 2/2813 in -0.1, 0.5, 4, 2/7? -0.1 Which is the nearest to -0.2? (a) 5/4 (b) -2 (c) -34 (d) 3/4 d What is the closest to -0.1 in -436, -5, 0? 0 What is the nearest to 0.5 in 1/9, 0.1, -3/11, -265? 1/9 What is the nearest to -0.2 in -22, -55, -0.15? -0.15 Which is the closest to 0? (a) -8 (b) 2 (c) -120 b Which is the closest to 0? (a) -0.3 (b) 3 (c) -20/9 (d) 0.097 d What is the nearest to -2/11 in -353, -1, 3, 0? 0 What is the closest to 0 in 7, 57.1, 2, -1/3? -1/3 What is the closest to 2/65 in -4, -0.1, -1.8, 4/9? -0.1 What is the closest to 0.2 in -0.64, -11.6, -2/21, 0.1, 10? 0.1 Which is the closest to 2/77? (a) -1/4 (b) -5 (c) 2 (d) 3 (e) 9 a Which is the closest to 0? (a) -4 (b) 7 (c) 9 (d) -0.1 (e) -21 d What is the nearest to -1/4 in 75, -0.007, 3/2? -0.007 Which is the closest to -0.1? (a) 4 (b) 18/11 (c) 37 b Which is the nearest to -2/15? (a) -51 (b) -3 (c) 5/3 (d) -2/19 (e) 1.6 d Which is the nearest to -1? (a) -5 (b) 1/59 (c) -24.9 b Which is the nearest to 100? (a) 646 (b) -1 (c) 4 c What is the closest to 0 in 1, -0.35, 5, -0.155? -0.155 Which is the closest to 0.164? (a) -6/11 (b) 1/12 (c) -0.1 b Which is the closest to -0.017? (a) 4 (b) -16 (c) 1/9 (d) -5 (e) 0 e Which is the nearest to 14/5? (a) 0.283 (b) 0.3 (c) 3/5 (d) -3/4 (e) -0.13 c What is the closest to -7341 in -2/7, 1/2, 0.1, -16? -16 Which is the closest to -0.2? (a) -11627 (b) -2 (c) -0.5 c What is the closest to -0.29 in 2/15, 1, 3, -6? 2/15 What is the closest to -1/22 in 5, -0.2, -1, 0.3? -0.2 What is the nearest to -0.1 in 10/43, -0.1, 4, 3? -0.1 Which is the closest to -2? (a) 0.41 (b) 0.3 (c) 4 (d) -3 d Which is the closest to -10? (a) -61 (b) -9 (c) -3 b What is the closest to -2 in 0.02, 3/4, -2, 0.15, -5/14? -2 Which is the nearest to -1? (a) -139 (b) 1 (c) 0.07 c What is the nearest to -1 in 39.7, 0, 1/2, -18, 4? 0 Which is the closest to 0.7? (a) 5 (b) -5 (c) -0.074 c What is the nearest to -0.1 in -0.3, 1, 285? -0.3 Which is the closest to -3/2? (a) 184 (b) 0.2 (c) -1/89 c Which is the closest to 0.1? (a) -39 (b) 60/17 (c) 91 b Which is the nearest to 5? (a) 2/13 (b) 0 (c) 20 (d) -2/11 a Which is the nearest to 0.3? (a) 2/9 (b) -2/15 (c) 1199 a What is the nearest to 15 in 8, -0.2, -0.3, 10? 10 Which is the nearest to -6? (a) 3 (b) -2 (c) -3.107 c What is the nearest to 0.2 in -1, -5, 0.273? 0.273 What is the nearest to 8 in -86, -5, 0.5, 0.42? 0.5 Which is the closest to -5/12? (a) -7 (b) -313 (c) 1 c What is the closest to -3 in -0.5, 158, 7, 0.2? -0.5 Which is the nearest to -3326? (a) -2/11 (b) 2 (c) -0.3 c Which is the closest to 2? (a) 24 (b) 0.3 (c) 18 b What is the closest to -2/41 in -2/3, -4/7, 78, -2? -4/7 Which is the closest to -1/2? (a) 119 (b) -8 (c) -1.1 (d) -0.1 (e) 3/5 d Which is the closest to 0? (a) 25 (b) -281 (c) 1/3 (d) 1 (e) 2 c Which is the closest to -1? (a) 69 (b) 2 (c) 24 (d) 13 b What is the nearest to 0.1 in -0.2, -1.3, -1.5, 9? -0.2 Which is the closest to -770? (a) -5 (b) 3 (c) 1/2 a What is the closest to 8 in -3.8, 4, 102? 4 What is the closest to 1 in -1/4, -0.05, 0.009, -1/9? 0.009 Which is the closest to -2/9? (a) 2/65 (b) 51 (c) 0.3 (d) 3 (e) -4 a What is the closest to 1.1 in -4, 0, 0.1, 15, -10? 0.1 What is the nearest to -0.09 in -7/5, 5, 6/7? 6/7 What is the nearest to 9 in 5/8, -2, 13? 13 What is the closest to -2/9 in 1, -1, 229? -1 What is the closest to 1 in -19/75, 1/8, -4, 3/7, 1/4? 3/7 Which is the closest to -29.9? (a) 5 (b) 3 (c) -17 (d) -2/7 c Which is the nearest to 0.3? (a) 0.1 (b) -1/13 (c) -2 (d) -27 a Which is the closest to -20? (a) -4 (b) -0.1 (c) -13/10 a Which is the nearest to 0.1? (a) 0.0028 (b) -5/2 (c) 2/7 a What is the nearest to -3 in 0.4, 4, 0.08, -4, -5? -4 Which is the closest to -18? (a) -2/27 (b) 1/5 (c) 28 a Which is the nearest to -1? (a) 8 (b) -17 (c) -1 (d) -3/7 c Which is the closest to 2? (a) 0 (b) 145404 (c) 2 (d) -0.1 c Which is the nearest to 2? (a) -5/2 (b) -2/5 (c) -0.3 (d) 21 (e) -11/7 c Which is the closest to 11? (a) -16 (b) -229 (c) 0.3 c Which is the closest to 5/3? (a) -0.4 (b) -13 (c) 126 (d) -4 (e) 0.5 e Which is the nearest to 0.05? (a) -2/3 (b) 0.2 (c) -234 b Which is the closest to -0.1? (a) -1 (b) 2.73 (c) -3 (d) 0.023 (e) -0.4 d Which is the nearest to -5/7? (a) -0.1 (b) 1.5 (c) -5/6 c What is the nearest to 0.01 in -0.296, 0.04, -2/7? 0.04 Which is the closest to -0.1? (a) -4 (b) -6 (c) -0.63 (d) -2/9 d Which is the nearest to 1/3? (a) -6/13 (b) 0.049 (c) 3 (d) -1 (e) -0.5 b What is the nearest to 4/5 in -0.16, -1, -3601? -0.16 What is the closest to 1/2 in 13, -2/71, 4, -30? -2/71 Which is the closest to -1/3? (a) -2 (b) 159 (c) 1/4 (d) 13 c Which is the closest to -6? (a) -4 (b) 296 (c) 0.4 (d) -2 a Which is the nearest to -4/319? (a) 1/3 (b) 2/9 (c) -1 (d) -3 b What is the nearest to 5/371 in 2/11, -5, -0.3, -2.1? 2/11 What is the nearest to -3/85 in 75, 0.1, -4/3? 0.1 What is the	{ "pile_set_name": "DM Mathematics" }
of sequence oa when two letters picked without replacement from {f: 5, o: 6, i: 4, a: 1}. 1/40 What is prob of sequence jl when two letters picked without replacement from {l: 1, h: 1, j: 2, p: 5}? 1/36 Calculate prob of sequence wwu when three letters picked without replacement from wauawwawwwwawzuw. 3/70 Two letters picked without replacement from {v: 2, r: 1, q: 1, e: 2, p: 1, w: 1}. Give prob of sequence wv. 1/28 Calculate prob of sequence xf when two letters picked without replacement from {f: 1, x: 2}. 1/3 What is prob of sequence ddu when three letters picked without replacement from {y: 1, d: 3, c: 5, t: 1, u: 1, f: 2}? 1/286 Two letters picked without replacement from mtrmmtrhhmmtt. What is prob of sequence hr? 1/39 Four letters picked without replacement from {g: 7, y: 7}. Give prob of sequence gyyy. 35/572 What is prob of sequence gi when two letters picked without replacement from {i: 1, v: 1, g: 2}? 1/6 Three letters picked without replacement from {i: 9, v: 1, m: 2, j: 6}. What is prob of sequence mmj? 1/408 What is prob of sequence uxu when three letters picked without replacement from uux? 1/3 Four letters picked without replacement from nmjmjmmmjjmmmm. What is prob of sequence mjmm? 12/143 Three letters picked without replacement from {p: 1, h: 1, k: 1, n: 1, g: 1}. What is prob of sequence pkn? 1/60 Four letters picked without replacement from {i: 6, g: 1, l: 3, j: 9}. Give prob of sequence jgji. 3/646 Three letters picked without replacement from wangp. Give prob of sequence npg. 1/60 Calculate prob of sequence xh when two letters picked without replacement from {d: 3, b: 2, h: 4, x: 2, y: 1, g: 2}. 4/91 What is prob of sequence jj when two letters picked without replacement from {h: 2, j: 2, k: 8}? 1/66 Calculate prob of sequence kvmk when four letters picked without replacement from {j: 3, k: 3, v: 3, q: 2, h: 1, m: 4}. 3/1820 Two letters picked without replacement from cesesveee. What is prob of sequence sc? 1/36 Three letters picked without replacement from qwwwqwwwwwwwwwwqww. Give prob of sequence qww. 35/272 Two letters picked without replacement from {n: 13, x: 6}. Give prob of sequence xx. 5/57 Two letters picked without replacement from wwjtttf. What is prob of sequence fw? 1/21 What is prob of sequence ile when three letters picked without replacement from iiblegbilkgkiglb? 1/280 Two letters picked without replacement from {d: 4, b: 7}. What is prob of sequence bb? 21/55 Two letters picked without replacement from {d: 1, g: 1, j: 3}. Give prob of sequence dg. 1/20 Two letters picked without replacement from {h: 1, a: 1, t: 1, l: 2}. What is prob of sequence ll? 1/10 What is prob of sequence hk when two letters picked without replacement from okwcckhph? 1/18 Calculate prob of sequence qww when three letters picked without replacement from {q: 2, n: 2, w: 4}. 1/14 Calculate prob of sequence pp when two letters picked without replacement from puuppry. 1/7 What is prob of sequence hh when two letters picked without replacement from {h: 4}? 1 Calculate prob of sequence fr when two letters picked without replacement from {f: 8, r: 2}. 8/45 Three letters picked without replacement from ohwhmhmnhn. What is prob of sequence mmh? 1/90 What is prob of sequence yll when three letters picked without replacement from llllllllllllydl? 2/35 Two letters picked without replacement from qqoqlzqqqlqqlqqz. Give prob of sequence qq. 3/8 Four letters picked without replacement from ddddddddzzddddz. What is prob of sequence zzzd? 1/455 Two letters picked without replacement from ffffffffyffyyf. Give prob of sequence yy. 3/91 Two letters picked without replacement from {a: 4, f: 2, c: 4, v: 2}. What is prob of sequence av? 2/33 What is prob of sequence rv when two letters picked without replacement from {v: 1, r: 7}? 1/8 Two letters picked without replacement from gvggggggggvgggv. What is prob of sequence vv? 1/35 What is prob of sequence zm when two letters picked without replacement from mmmlkmmmmzmmmmm? 2/35 Two letters picked without replacement from vvavaa. What is prob of sequence va? 3/10 What is prob of sequence uu when two letters picked without replacement from hqcmmcmuumcm? 1/66 What is prob of sequence vttv when four letters picked without replacement from vttvtvtt? 1/14 What is prob of sequence ln when two letters picked without replacement from {t: 3, b: 3, j: 2, l: 2, n: 3}? 1/26 What is prob of sequence rir when three letters picked without replacement from {r: 5, u: 9, z: 1, i: 3}? 5/408 Two letters picked without replacement from {r: 2, x: 2}. What is prob of sequence xr? 1/3 Two letters picked without replacement from {p: 7, o: 4}. Give prob of sequence op. 14/55 Two letters picked without replacement from cajevvevvjvtctcvjej. Give prob of sequence vv. 5/57 Four letters picked without replacement from snunnxxnnnnncsycsyxn. What is prob of sequence nycc? 1/3230 Two letters picked without replacement from nfnn. Give prob of sequence nf. 1/4 Four letters picked without replacement from {e: 3, z: 11}. Give prob of sequence ezee. 1/364 Two letters picked without replacement from {v: 1, k: 5, u: 2, b: 3, a: 6}. What is prob of sequence bk? 15/272 Three letters picked without replacement from wdyyywwwydd. Give prob of sequence wyw. 8/165 Three letters picked without replacement from {r: 3, z: 3, q: 2, l: 1, j: 2, c: 1}. Give prob of sequence rrz. 3/220 What is prob of sequence ll when two letters picked without replacement from {l: 9, h: 3}? 6/11 Calculate prob of sequence ama when three letters picked without replacement from mamaam. 3/20 Two letters picked without replacement from qunqqussqtqqttstn. Give prob of sequence nn. 1/136 Three letters picked without replacement from ssmmsmmsmse. Give prob of sequence mse. 5/198 Three letters picked without replacement from {q: 1, n: 1, g: 8, e: 1, o: 1, h: 4}. Give prob of sequence noe. 1/3360 Calculate prob of sequence sg when two letters picked without replacement from {h: 3, b: 3, g: 10, s: 4}. 2/19 Four letters picked without replacement from {g: 3, a: 3, f: 1, c: 1, l: 5}. What is prob of sequence ggfg? 1/2860 Three letters picked without replacement from gqqciicqg. Give prob of sequence iiq. 1/84 Three letters picked without replacement from ddiiirriaradirrrr. What is prob of sequence ara? 7/2040 Two letters picked without replacement from bggq. Give prob of sequence gq. 1/6 Four letters picked without replacement from xxuwwuxxuxwwxxu. What is prob of sequence wwxx? 1/65 Four letters picked without replacement from {e: 5, q: 1, m: 4, g: 9, y: 1}. Give prob of sequence eyem. 2/2907 Three letters picked without replacement from {p: 2, j: 1, b: 1, r: 1}. What is prob of sequence pjr? 1/30 What is prob of sequence kkqk when four letters picked without replacement from {k: 7, q: 3}? 1/8 Two letters picked without replacement from srerssressrrrsrsrsr. What is prob of sequence rr? 4/19 Calculate prob of sequence nfq when three letters picked without replacement from {f: 1, a: 1, n: 2, q: 1, b: 2, i: 1}. 1/168 What is prob of sequence bb when two letters picked without replacement from nbb? 1/3 Two letters picked without replacement from {i: 7, c: 3}. Give prob of sequence ci. 7/30 Four letters picked without replacement from {v: 17, j: 2}. Give prob of sequence jvvv. 5/57 Two letters picked without replacement from {d: 11, w: 5}. What is prob of sequence dd? 11/24 Two letters picked without replacement from illiiiiiii. What is prob of sequence ii? 28/45 What is prob of sequence vvr when three letters picked without replacement from vrv? 1/3 What is prob of sequence mlln when four letters picked without replacement from {n: 1, m: 8, l: 6}? 2/273 Two letters picked without replacement from pydpddd. Give prob of sequence pp. 1/21 Four letters picked without replacement from {d: 1, u: 3, o: 2, k: 4, p: 4}. Give prob of sequence pkop. 4/1001 Three letters picked without replacement from {k: 10, e: 8, y: 1}. What is prob of sequence yee? 28/2907 Two letters picked without replacement from {s: 16, r: 2}. What is prob of sequence rr? 1/153 What is prob of sequence yp when two letters picked without replacement from yyyyyyypyyyy? 1/12 What is prob of sequence xd when two letters picked	{ "pile_set_name": "DM Mathematics" }
- 162 = b, -5j = 5b - z. Let s = j - 31. Round s to the nearest one hundred. 0 Suppose 2t = 3b - 10003, 4b - 3800 = -3t + 9560. Suppose 0 = -a + b - 336. Let y = a + -1101. Round y to the nearest 100. 1900 Let x = 417555 - 959755. Round x to the nearest 10000. -540000 Suppose -15 = -12b + 21. Suppose -3s = bs + 24. Let u(d) = -137d*2 + 12d + 10. Let k be u(s). What is k rounded to the nearest 100? -2200 Let h(v) = -v + 366. Let a be h(0). Let m = -957 + 1106. Let g = a - m. Round g to the nearest ten. 220 Let p = -5168 - -2230. Let i = p + 2938.00001651. Round i to 6 dps. 0.000017 Let a = 142 + -145.08. Let z = a + 3.080434. Round z to 5 dps. 0.00043 Let j = 990 + -990.008256. Round j to 3 decimal places. -0.008 Suppose 74878 = 6r - 56342. Let a be ((-1580)/6)/(81/r). Round a to the nearest ten thousand. -70000 Let a = -20075.8 + 11016.9. Round a to the nearest 1000. -9000 Suppose -9s + 14s + 4v - 13717520 = 0, 20 = 4v. Round s to the nearest ten thousand. 2740000 Let d = 9393744 - 1133452. Suppose 5b - 11739698 = 5z + d, -b - 3z + 4000006 = 0. What is b rounded to the nearest one hundred thousand? 4000000 Let j = -75.7 + 80. Let o = j - 100.3. Let c = o - -95.9999498. What is c rounded to 6 decimal places? -0.00005 Let c = 0.0831 - 14.9631. Let g = c + 15. Let i = g + -0.1218. What is i rounded to 3 dps? -0.002 Suppose 5p - 19 = -o, o - 5p = -7 - 4. Let w = 1227741 + 392445. Suppose -w + 80186 = -oa. What is a rounded to the nearest 10000? 390000 Let n = 2586.3 + -2586.15703. What is n rounded to 2 decimal places? 0.14 Let w = 106 - 108. Let g be 1896008/(-4) + -3 + (3 - w). Round g to the nearest 100000. -500000 Let h = -107578.998 + 107490. Round h to the nearest ten. -90 Let j = 251.055137 + -0.023137. Let g = -251 + j. Round g to two decimal places. 0.03 Let v = -35.5 + 154.5. Let z = 116.501 + 1.729. Let u = z - v. What is u rounded to 0 decimal places? -1 Suppose -10q + 48 = -14q. Let y be (-9)/q(-48)/3. Let p be (1280/y)/(2/(-600)). Round p to the nearest 10000. 30000 Suppose 5a = -d + 898425, 2d + 898375 = 3d - 5a. What is d rounded to the nearest 100000? 900000 Let j be (30/45)/((-4)/174). Let z = -27 - j. Suppose -632000 = -10p + zp. What is p rounded to the nearest ten thousand? 80000 Suppose 0 = -4n - 5b - 18645180, -4n + 3b = 2999047 + 15646165. What is n rounded to the nearest 100000? -4700000 Let d = 1013 + -740.4. Let p = 227 - d. What is p rounded to the nearest ten? -50 Suppose -12 = -3i - k, 0i = -i - 2k + 9. Suppose -iz - 146 = 4y, -6z - y = -z + 266. Let c be 44((-1)/2z - -3). Round c to the nearest 1000. 1000 Let l = -23044 - -23044.0000021358. What is l rounded to six dps? 0.000002 Let l(p) = p*3 - 15p*2 + 15p - 11. Let o be l(14). Suppose -oy - 15807 = 28893. Round y to the nearest 1000. -15000 Let l = -1611.5 + -380.5. Let j = -1991.9997738 - l. What is j rounded to 5 decimal places? 0.00023 Let d = -3637.7766 - 3.4534. Let o = -3620 - d. Round o to the nearest integer. 21 Let x be 28/4 + -4 + 1. Suppose -xy - 51799984 = -9y + 4m, -3y + 4m = -31079984. Round y to the nearest 1000000. 10000000 Let q(f) = 17f3 + 10f*2 - 20f - 3. Let j be q(10). Suppose 2w + j = -2y - 83609, 0 = -3w - 9. Round y to the nearest 10000. -50000 Let y = 8656.8 + -8656.855053. What is y rounded to 3 dps? -0.055 Let f = -162.08 + 157. Let y = 16660.478 - 16665. Let u = f - y. Round u to one decimal place. -0.6 Let h = -0.2009 - -0.20081369. What is h rounded to 6 dps? -0.000086 Let g = -3.287361 + 3.3019. Round g to 3 decimal places. 0.015 Let o = -0.072666 + -859.397334. Let z = -874 - o. What is z rounded to the nearest integer? -15 Let u = 27 - 27.065. Let l = u + -0.235. Let f = l - -2.68. What is f rounded to 1 decimal place? 2.4 Let l(n) = 48582214n*3 - 2n*2 + 3n - 1. Let j be l(1). Suppose -7h = -j + 14982214. Suppose -a - h = -4a. Round a to the nearest one million. 2000000 Let z(l) = -1229404l3 - 6l*2 + 13l + 15. Let p be z(-1). Round p to the nearest one million. 1000000 Let u = -215 + 214.934. Let y = 0.0152 + u. Round y to 2 dps. -0.05 Let v = 114755031489548.02592 - 114746060604949.755920567. Let b = -8970884602 + v. Let w = -3.73 - b. What is w rounded to 7 decimal places? 0.0000006 Let l = 24.776791 - 24.805. Let r = 0.03 + -0.002. Let p = l + r. What is p rounded to 5 decimal places? -0.00021 Suppose i + 2i + 2g - 153235 = 0, -5g - 5 = 0. Let l be (-2)/(-8) - 1/(-4)i. What is l rounded to the nearest 1000? 13000 Let l = -1525535644.763842934 - -29818987651.46384376. Let q = l - 28293452032. Let t = q + 25.3. Round t to seven decimal places. 0.0000008 Let q = -184009121.7833629530906 + -13.2162860469094. Let s = -184008888 - q. Let b = -247 + s. What is b rounded to 5 decimal places? -0.00035 Let a = -59167 - -55117.1. What is a rounded to the nearest one hundred? -4000 Let f(r) = r*2 - 1. Let b be f(0). Suppose 27i + 16 = -30 + 235. Let a be (11 - i)/(b/(-725)). Round a to the nearest 1000. 3000 Let p be 30(1 - -3841)14790/(-4437). Round p to the nearest one hundred thousand. -400000 Suppose -j - 7c + 24803 = -4c, 2j + c - 49581 = 0. Let h be (j/6 - -2)/(1/120). What is h rounded to the nearest ten thousand? 500000 Suppose k + 8k = 9. Let v be k/4(-24)/(-3). Suppose -572 = q + 2n, vq + 0n + 1136 = 4n. Round q to the nearest one hundred. -600 Let p(u) be the first derivative of 162644u*2 - 152u - 221. Let x be p(4). Round x to the nearest ten thousand. 1300000 Let g = 139320 + -139318.99159. What is g rounded to three dps? 1.008 Suppose 3z + 17 = 4a, -5z + 4 = -z. Suppose 5t + 9 = 5s - 2s, -4t + 5s - 15 = 0. Let r be t + ((-422500000)/a)/5. Round r to the nearest 1000000. -17000000 Let g = -214 + 230. Suppose -gn + 11n - 323000000 = 0. What is n rounded to the nearest 1000000? -65000000 Let z = -45.8739 + 0.0739. Let g = -45.7952 - z. What is g rounded to three decimal places? 0.005 Suppose -16678642 - 4328498 = -42x. What is x rounded to the nearest ten thousand? 500000 Let n = 30.47 + 1.53. Let a = n + -36.5. Round a to the nearest 10. 0 Let j(i) = -63i*3 - 5i*2 + 15i - 2. Let k(y) = 22y - 18. Let g be k(11). Suppose -2w = -236 + g. Let z be j(w). Round z to the nearest one thousand. -14000 Let p = -4.258633517 + 4.2586. What is p rounded to six decimal places? -0.000034 Let h = -32.0696898 - -32.07. Round h to five decimal places. 0.00031 Let w = -15.13 - -14.3. Let t = 1.256 + w. Round t to two dps. 0.43 Let h = -6 - -20. Suppose -5c + hm - 3550005 = 13m, -2m + 2840010 = -4c. Round c to the nearest 1000000. -1000000 Let s = -237.3 + 305.125. Let f = s + -69. Let b = -1.2 - f. Round b to one decimal place. 0 Let j = -0.2803 - -1.5493. Let n = j + 100.331. What is n rounded to the nearest ten? 100 Let l = 356.9317 - 357. Let b = -9.8717 + l. Round b to 1 decimal place. -9.9 Suppose -38x + 29x - 252 = 0. Let o be (-21 - x) + (-102)/3. What is o rounded to the nearest integer? -27 Let x be (-60)/(-18) + -4 + (-33239992)/12. Round x to the nearest one hundred thousand. -2800000 Let g = 858213 - 858060.0113. Let y = g - 153. What is y rounded to 2 decimal places? -0.01 Let w = -681.9431 - -682. Let k = w - 0.0192. What is k rounded to 2 decimal places? 0.04 Let o = 25933.74 - 25846. Round o to the nearest 10. 90 Let m = 23.37718 + 0.01282. Let a = -977.39 + m. Let h = 953.9447 + a. What is h rounded to 2 decimal places? -0.06 Let c = -0.022 + 119.022. Let x = c - 120.03. Round x to two decimal places. -1.03 Let w = 1 + -0.73. Let c = -224.311 + 224. Let z = w + c. What is z rounded to 2 decimal places? -0.04 Let o = 93 + -117. Let k be o/183 - 1684016/(-4). What is k rounded to the nearest 100000? 400000 Let m = -62460.3 + 66886. Round m to the nearest 100. 4400 Let r = 9805 - 27819. Let l = -16442 - -5328. Let d = r - l. What is d rounded to the nearest 1000? -7000 Let x = -37 - -66. Let u = 26 - x. Let z = -2.9999965 - u. Round z to six dps. 0.000004 Let s = -90381.00038007 + 90381. Round s to six decimal places. -0.00038 Let q = 49.103 + -0.103. Let c = 36 + q. Let i = c - 84.9998. What is i rounded to three decimal places? 0 Let i be (28 + 2)/(42/8204). Let b = i - 12400. What is b rounded to the neares	{ "pile_set_name": "DM Mathematics" }
(2/(-24)). 6 What is the value of ((-6)/12)/(-2 + (-3)/(-2))? 1 Calculate -9 + -6(-69)/48. -3/8 What is 8/(-5) - (-532)/95? 4 Calculate 408/(-54) - (-64)/(-144). -8 What is the value of 44/132 - (22/(-24) - -1)? 1/4 What is -522/(-36) + -3? -1/9 Calculate (-39)/26(-4)/15. 2/5 Calculate 6/(-16)-36/(-81). -1/12 (18/(-60))/(108/45) -1/8 Calculate (-15 - -14)/((-3)/6). 2 (-42 - -38) + 3(2 + -1) -1 What is (3 + 4)/(-35)6? -6/5 What is (-2)/24 - (1 - 4)/12? 1/6 -1 + 2 + 38/57 5/3 What is 16/2 - (1 - -3)? 4 Calculate 4/2 - (-1)/(-4)0. 2 What is 4 + (-436)/32 + (-4 - -13)? -5/8 What is the value of 2 - 20/12 - 16/12? -1 Evaluate 520/140 - 1(-4)/14. 4 What is the value of (1/3)/(109/(-981))? -3 What is 2/(-1)195/(-78)? 5 What is the value of -54/(-40)(-36)/(-27)? 2/3 Calculate 13 - (8 + 1716/(-348)). -2/29 What is 15 - (-16)/(-16)? 4 Calculate (0 + -5)26/65. -2 Evaluate (-264)/(-140) + -1 + 6/(-21). 3/5 What is (1/3)/((-3)/2)? -2/9 2 + -1 + 5 + (-1 - 0) 5 What is the value of ((-20)/18)/(8/(-18))-2? -5 What is the value of -3 + 7 + -29 + 24? -1 Evaluate ((45/21)/(-5))/(-1). 3/7 -12 + (-1)/(4/(-24)) -6 What is the value of (2(-2)/(-52))/((-6)/12)? -2/13 Evaluate -5 + 11/726318. -2/11 -2 + (282/144 - 1/3) -3/8 What is the value of (-34)/4 + 4 - -7? 5/2 What is the value of 1/(-2)11? -1/2 Calculate ((-124)/(-310))/(-1 - 9/(-10)). -4 Evaluate (10 - 4) + -4 + -6. -4 Evaluate (74/(-222))/((-2)/(-24)-62). 2/31 (-7)/(-6)90/420 1/4 (-2(-1)/2)/(207/(-2277)) -11 What is (-1 + 34/32)(-9 - -13)? 1/4 Evaluate (249/90 - 3) + (-4)/(-12). 1/10 What is the value of 10/6-1 - (-6)/6? -2/3 What is the value of 9/2 - 2/(1 - 5)? 5 Calculate (-70)/(-7) - 64/12. 8 Calculate 5/(-25) + (-46)/(-80). 3/8 What is the value of (-56)/(-21) + (-60)/(-45)? 4 Evaluate 24/12828 - 4. 5/4 What is the value of (2(-2)/(-36))/(2/12)? 2/3 What is (-10)/(-6)(-362)/(-905)? 2/3 Calculate 1 - 2 - 4(-6)/(-6). -5 What is the value of (-4)/123 - 15/(-25)? -2/5 What is ((-12)/(-16))/((-165)/(-40))? 2/11 What is 11/((-5)/(-25))? 5 What is the value of (12/(-36))/((-2)/122)? 1 What is (0/(-6)(-1)/4)/(-2)? 0 Evaluate (1/(-9))/((-38)/57). 1/6 (1 + -3 - 4)1/2 -3 (-8)/(-44) + 72/88 1 ((-39)/21 + 2)(0 + -4) -4/7 4/5 - 864/480 -1 (-9)/(-6) + (-55)/(-10) 7 Calculate (9 + -6)/((-3)/(-5)). 5 What is ((48/(-28))/2)/((-6)/21)? 3 What is the value of (-9 + 1)(-5 + 114/24)? 2 What is the value of (-6)/27 + 49/(-63)? -1 Calculate (32/1681)/((-2)/(-7)). 2/3 Calculate 216/(-48)2/24. -3/8 Evaluate (-234)/(-52) - (7 + -2). -1/2 What is ((-6)/(-24))/((-3)/(-4))? 1/3 Evaluate 3(-45)/(-81) - (-2)/(-3). 1 Evaluate (1 - 1) + 10/(-35). -2/7 What is the value of ((-2)/(-9))/((-2)/18)? -2 Evaluate (52/(-8) + 7)/(14/(-4)). -1/7 What is -7 + 3 - (-1)/(-5)-22? 2/5 Calculate 0/3(-10)/30. 0 -3 + -1 + 51/3 + -7 6 Evaluate 3192/(-560) - 6/20. -6 ((-19)/38)/(6/8) -2/3 What is 1 + (-45)/6 - (-57)/38? -5 Evaluate (-22)/88(-1)/(-1). -1/4 Evaluate (-45)/6 + (-33)/176-8. -6 What is the value of 1(165/(-40) - -4)? -1/8 What is the value of (-140)/(-28)((-6)/15 - 0)? -2 What is (-30)/(-12) + -2 + 14/(-4)? -3 32/(-60)105/(-252) 2/9 Evaluate 4/(-14) - ((-1248)/(-91) + -11). -3 What is the value of (-5 - (-3 + 1)) + 3 + 0? 0 What is the value of 4/(-2)-2(-2)/28? -2/7 Calculate 2744/2170 - (16/(-20) - -2). 2/31 What is the value of 2/3 - ((-1162)/(-70) + -16)? 1/15 Calculate 4/(-3) - 6/(-18). -1 Calculate 6/12 + 6 + (-1 - 4). 3/2 Calculate ((-117)/(-36) - 3)(-4)/3. -1/3 What is the value of (-5 + 5 + 4)/(4 + -3)? 4 Evaluate ((-3(-2)/(-6))/1)/1. -1 Calculate (5/(-12))/((-21)/(-1092)13). -5/3 What is the value of -6 - -11 - (-6)/(216/(-188))? -2/9 Evaluate (-1)/(-15)(-237)/158. -1/10 (1 - 1) + (-1)/((-48)/36) 3/4 Calculate 1 - (-1 + -2 + -5). 9 What is (236/(-48) - -5)/(2/(-9))? -3/8 (-9 - 15)/(-6) - 7 -3 3 + (-1 + -1 - 3/5) 2/5 (-6)/(-4 - -7 - -8) -6/11 Evaluate (2/(-18)-3)/(3/27). 3 (-3)/((-135)/39) + (-5)/5 -2/15 1-2 + (-4 - (3 + -13)) 4 What is -1 + (-76)/(-68) - 36/(-272)? 1/4 What is 132/(-34) + 12 - 8? 2/17 What is 4/(-2)(-2 - 14/(-4))? -3 Evaluate (1 - -1)12/(-36). -2/3 What is 12/(-28) + 29/35? 2/5 Evaluate 6/93 - 164/620. -1/5 Calculate (-4(-9)/(-6))/(122/(-61)). 3 Evaluate 8/3-1054/(-2520). 4/7 (-6)/(-11)(-20)/(-30) 4/11 Calculate (-4)/(-5) - 144/30. -4 Evaluate (-492)/(-380) + 4/38. 7/5 What is 1/(3 - (540/8)/15)? -2/3 What is (-68)/(-18) - 19/(-342)4? 4 What is the value of (-28)/(-12)(60/28 - 2)? 1/3 What is ((-20)/(-15))/((-4)/12)? -4 (-2 + -1)(-6 - -3 - -4) -3 Calculate -62(-9)/144. 3/4 What is 34/40 + ((-165)/12 - -13)? 1/10 What is (8/(-10))/(6/45) + 3? -3 What is ((-215)/(-86))/(5/2)? 1 What is the value of -6 - (532/21)/(-4)? 1/3 What is (-1)/((-9)/10)(-21)/(-14)? 5/3 (4 + 96/(-30))5 4 What is the value of 5/(-3) - (37 - 39)? 1/3 Evaluate (3 - 4)/(-1 - 0). 1 -2 + (55/30 - (3 - 3)) -1/6 Evaluate (28/(-10))/((-189)/(-35) - 5). -7 What is the value of 18/(-15)390/52? -9 Evaluate 171/189 - 2/6. 4/7 Calculate 8/(-3)102/(-136). 2 Calculate (-3 + 5)6/4. 3 What is the value of 3(2 + (-28)/15)? 2/5 Evaluate 2/13(-10 - -11). 2/13 (-9)/(-15) - -226/(-70) -1/7 What is (-54)/12(-3)/(-18)? -3/4 What is (16/28)/(1288/(-196))? -2/23 Calculate -5(3/(-2))/((-15)/2). -1 (-1 - (-4)/(-12))(3 - 6) 4 What is the value of ((-7)/3 + 1)/((-136)/(-204))? -2 Evaluate 37/(-119) - (-54)/5049-11. -3/7 What is (-5 - 5/(-2)) + 2 - -1? 1/2 What is the value of 6/(-27) - (-258)/432? 3/8 Evaluate (-31)/6 - (-1)/122. -5 Calculate ((-2)/4)/(14/56). -2 What is 5(4/(-3)-3)/(-5)? -4 Evaluate 1/(-11) + (-4)/44. -2/11 Evaluate -4 - (2/(-2) - -2). -5 What is the value of -25 - -23 - (0 - -1)? -3 (-3 - (-30)/9) + 8/3 3 Calculate (29/145 - (-16)/6) + -3. -2/15 What is the value of (70/(-455))/(4/(-26))? 1 ((-3)/(-1) + -4)3 -3 Evaluate 8/(-36) - (36/6 + -6). -2/9 Calculate -141 - (-10 + 16)/(-1). -8 What is ((-12)/(-6))/(-3(-2)/(-18))? -6 Calculate 2/(-1)-3(-1)/27. -2/9 Evaluate (-2)/5 - (-2781)/10815. -1/7 64/34 - -122/(-12) -2/17 What is (-2)/((7 + -2)/20) - -6? -2 What is 1/((-1)/(-4)) - 243/54? -1/2 -9 + 245/28 + (-2)/(-8) 0 (-247)/76 + (-1)/(-4) + 7 4 0(1 + (-3)/2) 0 (-5)/1(1 + 215/(-225)) -2/9 What is (-98)/34 + 16/((-192)/(-36))? 2/17 Evaluate ((-1036)/(-126) - 8)/(-1). -2/9 -3 + (-17)/(-3) - 4 -4/3 What is the value of 18/168(-21)/(-18)? 1/8 Calculate (-3)/(-10) - 1/(-5). 1/2 Calculate (1 - (-1 - (-2 + 2)))2. 4 What is the value of (2/(-4))/(11 + 910/(-84))? -3 What is (-92)/16 + 0 + 6/8? -5 Calculate (1 + 10/(-15))/(1/(-6)). -2 What is ((-8)/12)/(20/45) - -1? -1/2 15(6 + 144/(-30) + -1) 3 Calculate ((-1)/(-2))/((-3)/3) + 2. 3/2 What is the value of -6 - 1 - ((-267)/15 + 11)? -1/5 What is 10/18132/(-55)? -4/3 Evaluate 9 - (-40)/(-5) - 22/18. -2/9 What is the value of 9 + 0 - (-323)/(-19)? -8 What is the value of (-10)/(-5) + (5/(-4))/1? 3/4 Evaluate (1/12)/((-6)/(-48)). 2/3 Evaluate (4/42)/(12/(-18)). -1/7 What is the value of 1056/180 + (-8)/(-60)? 6 Calculate 29/95 - (-18)/1080-12. 2/19 What is (-559)/117 + 4/(-18)? -5 Evaluate (-860)/(-100) - (2 + 6). 3/5 What is the value of ((-14)/(-63))/((-6)/9)? -1/3 Evaluate (0 + 0)/3 - -4. 4 Evaluate 6/(-20)(20/(-12) + 2). -1/10 What is the value of (38/22 + -2)(-356)/534? 2/11 22/63 - (-8)/36 4/7 -1(5/(-9))/(-5) -1/9 Evaluate (-2)/1 + (-57)/(-24). 3/8 What is the value of ((-10)/(-24))/(215/387)? 3/4 Calculate ((-2)/(-3))/(6/(-126)-77). 2/11 12/(-36) + (1 - (-14)/(-30)) 1/5 Evaluate ((-48)/18)/((-4)/(-6)). -4 What is the value of 276/(-36) + (-16)/12? -9 What is (1134/225 + -5)15? 3/5 Calculate -4 + (-5)/90-75. 1/6 Evaluate (2(-12)/(-28))/((-8)/14). -3/2 Calculate (-282)/(-252) - (1 - (-8)/(-48)). 2/7 (-10)/(-8) + 18/(-18) 1/4 What is (0/(-4) - 1)(-2)/10? 1/5 What is (-15)/(-9) + 12/(-18)? 1 ((-33)/(-7) - 10) + -2 + 7 -2/7 Calculate 1/10 - 2727/7070. -2/7 Calculate 45/63 - (-2)/(-2). -2/7 Evaluate 4/(-58) + 118/29. 4 1 - 0 - 0 - (11 + -9) -1 Calculate 4(-2)/18(-21)/(-14). -2/3 Calculate ((-9)/27)/((-12)/(-9)). -1/4 Evaluate -14 - -11 - 238/(-28). -2/7 (4/10)/(5/((-25)/3)) -2/3 Evaluate -23/905. -1/3 (-135)/(-18)(-5)/304 -5 (-30)/(-40)60/(-9) - -5 0 -3(2 - (65/30)/1) 1/2 4/(-7)182/(-468) 2/9 What is (-36)/2*9/2	{ "pile_set_name": "DM Mathematics" }
5 What is the next term in -1754, -3525, -5320, -7151, -9030? -10969 What is next in -322606, -322615, -322624? -322633 What comes next: -61083, -122164, -183245? -244326 What is next in 113, -267, -655, -1051, -1455, -1867? -2287 What comes next: 3294, 3402, 3582, 3834, 4158? 4554 What is the next term in -681, -679, -677, -675? -673 What is next in 2377, 3224, 4073, 4924, 5777, 6632? 7489 What comes next: -2375, -9475, -21329, -37955, -59371, -85595? -116645 What is next in -8444, -16911, -25380, -33851, -42324, -50799? -59276 What comes next: -142554, -285080, -427606, -570132, -712658? -855184 What comes next: -15537, -31072, -46607, -62142, -77677? -93212 What comes next: 848, 1721, 2594, 3467? 4340 What comes next: 617, 1162, 2069, 3338, 4969? 6962 What comes next: -605845, -605846, -605847, -605848? -605849 What is next in 10044, 10054, 10066, 10080, 10096, 10114? 10134 What is the next term in 125, 53, -63, -229, -451, -735, -1087? -1513 What is next in 130, 144, 166, 196, 234, 280, 334? 396 What is the next term in -8865, -17729, -26593, -35457, -44321? -53185 What comes next: -14, 32, 166, 430, 866? 1516 What is next in -55, -383, -1245, -2899, -5603, -9615, -15193? -22595 What comes next: -14496, -58011, -130536, -232071, -362616? -522171 What is next in 412, 794, 1834, 3862, 7208, 12202, 19174? 28454 What is next in -245612, -245591, -245542, -245453, -245312, -245107, -244826? -244457 What comes next: 1997, 1994, 1991, 1988? 1985 What is the next term in 268106, 536213, 804320, 1072427, 1340534, 1608641? 1876748 What is next in 2271441, 2271442, 2271445, 2271450? 2271457 What is next in 151343, 151343, 151345, 151349, 151355? 151363 What is the next term in -58, -750, -2726, -6628, -13098, -22778, -36310? -54336 What comes next: 1469, 5887, 13249, 23555? 36805 What is next in -226, -382, -532, -670, -790, -886, -952? -982 What comes next: 318, 786, 2060, 4542, 8634, 14738, 23256? 34590 What is next in -12546, -12232, -11918, -11604, -11290? -10976 What is the next term in 63073, 126144, 189215, 252286, 315357? 378428 What is the next term in -4550, -4435, -4322, -4211, -4102, -3995? -3890 What is next in -173, 271, 1939, 5443, 11395? 20407 What is next in -133479, -266959, -400439, -533919? -667399 What comes next: -4138, -16429, -36884, -65503, -102286, -147233, -200344? -261619 What is the next term in 2340, 4684, 7016, 9330, 11620, 13880, 16104, 18286? 20420 What comes next: -261, -315, -411, -549, -729? -951 What is the next term in 10037, 40152, 90345, 160616, 250965? 361392 What is next in -227, -481, -785, -1163, -1639, -2237, -2981, -3895? -5003 What is the next term in 4008, 8015, 12022? 16029 What comes next: 163904, 163906, 163908, 163910, 163912, 163914? 163916 What is the next term in 30203, 30198, 30193? 30188 What is the next term in 52730, 105467, 158204, 210941? 263678 What is next in 162, 325, 486, 651, 826, 1017, 1230? 1471 What comes next: 23897, 47776, 71655, 95534? 119413 What is the next term in -13229, -13228, -13227, -13226, -13225, -13224? -13223 What is next in -120, 123, 766, 2007, 4044, 7075? 11298 What is next in -11338, -22674, -34010, -45346, -56682, -68018? -79354 What comes next: -15856, -31692, -47504, -63286, -79032, -94736, -110392, -125994? -141536 What comes next: 8631, 34539, 77725, 138195, 215955, 311011, 423369? 553035 What is the next term in 11381, 22744, 34107? 45470 What comes next: -1083161, -1083160, -1083159? -1083158 What comes next: 166237, 332474, 498711, 664948? 831185 What is the next term in 41, 2, -81, -214, -403? -654 What is the next term in 273545, 273552, 273573, 273614, 273681, 273780, 273917? 274098 What comes next: -15007, -30012, -45017, -60022, -75027? -90032 What is the next term in -14505, -14490, -14459, -14406, -14325, -14210, -14055, -13854? -13601 What comes next: -156426, -312856, -469286, -625716, -782146? -938576 What is the next term in 2147, 8672, 19569, 34844, 54503, 78552, 106997, 139844? 177099 What comes next: 2420, 4796, 7182, 9584, 12008, 14460? 16946 What is next in -62191, -62193, -62195, -62197? -62199 What is the next term in -1725471, -1725467, -1725461, -1725453, -1725443, -1725431, -1725417? -1725401 What is next in -41965, -83934, -125907, -167884, -209865, -251850? -293839 What is next in -4586, -4586, -4576, -4550, -4502, -4426, -4316? -4166 What comes next: 72, 48, -22, -162, -396? -748 What is the next term in 32648, 32661, 32674, 32687, 32700? 32713 What is the next term in 234161, 468315, 702469? 936623 What comes next: -8025, -8026, -8027, -8028, -8029? -8030 What is the next term in -62, -192, -378, -596, -822, -1032? -1202 What comes next: -2516, -2543, -2584, -2645, -2732, -2851, -3008? -3209 What is next in 145, 561, 1233, 2149, 3297, 4665? 6241 What comes next: -331, -393, -511, -685, -915, -1201, -1543? -1941 What is the next term in -3313, -3396, -3549, -3778, -4089, -4488, -4981, -5574? -6273 What comes next: 744, 824, 958, 1152, 1412, 1744? 2154 What is next in 8, -439, -1770, -4429, -8860, -15507, -24814, -37225? -53184 What comes next: -201265, -402542, -603819, -805096, -1006373, -1207650? -1408927 What is the next term in 1823, 7231, 16245, 28865, 45091, 64923? 88361 What comes next: -50224, -100440, -150656, -200872? -251088 What comes next: -21684, -21686, -21690, -21696, -21704, -21714? -21726 What is next in 63288, 63290, 63306, 63342, 63404? 63498 What is next in -447, -761, -1077, -1395, -1715? -2037 What is next in -43, -447, -849, -1243, -1623? -1983 What is next in 232, 129, -44, -287, -600? -983 What is the next term in -378, -411, -494, -651, -906, -1283? -1806 What is next in -558053, -558052, -558051, -558050? -558049 What comes next: 10691, 10704, 10733, 10784, 10863, 10976? 11129 What is next in -506, -948, -1390? -1832 What comes next: 1169, 1144, 1107, 1064, 1021? 984 What is next in 5867, 23331, 52439, 93191, 145587, 209627? 285311 What is next in 520717, 520715, 520713, 520711? 520709 What comes next: 1381, 1124, 697, 100, -667, -1604, -2711? -3988 What is next in 4811878, 4811876, 4811874? 4811872 What is the next term in -4164, -8310, -12456? -16602 What is the next term in -10123, -20237, -30347, -40453, -50555? -60653 What comes next: -7103, -7275, -7449, -7625, -7803, -7983, -8165? -8349 What is the next term in -2914, -5740, -8384, -10756, -12766, -14324, -15340? -15724 What is next in -850, -3317, -7392, -13063, -20318, -29145? -39532 What is the next term in 3750, 3690, 3590, 3450, 3270, 3050, 2790? 2490 What comes next: -204002, -408011, -612022, -816035, -1020050, -1224067, -1428086? -1632107 What is next in -19927, -39851, -59775, -79699, -99623? -119547 What is the next term in 2608, 2660, 2712, 2764, 2816, 2868? 2920 What is the next term in -120835, -120837, -120839? -120841 What comes next: -9623, -38484, -86585, -153926, -240507, -346328? -471389 What is next in 14955, 29932, 44939, 59982, 75067, 90200, 105387? 120634 What is next in -212723, -212713, -212695, -212663, -212611? -212533 What is next in -1882, -1118, 154, 1934? 4222 What is the next term in -20139, -40292, -60447, -80604, -100763? -120924 What is next in 4240, 4225, 4208, 4189, 4168, 4145? 4120 What is the next term in -460, -1116, -1950, -2962? -4152 What is next in -4984, -4979, -4978, -4981? -4988 What comes next: 16469, 16420, 16297, 16064, 15685? 15124 What comes next: -1035, -8940, -30587, -72846, -142587, -246680? -391995 What comes next: 284, 1124, 2522, 4478, 6992, 10064, 13694? 17882 What is the next term in 2326, 9289, 20898, 37153, 58054? 83601 What comes next: 368, 779, 1234, 1733, 2276, 2863, 3494? 4169 What comes next: 4249, 33896, 114343, 270982, 529205, 914404, 1451971, 2167298? 3085777 What comes next: 17, 277, 537, 797, 1057? 1317 What is the next term in 305, 625, 959, 1313, 1693, 2105, 2555, 3049? 3593 What comes next: -314, -1206, -2686, -4748, -7386, -10594? -14366 What comes next: 496, 44, -406, -854? -1300 What comes next: 16304, 16309, 16316, 16325, 16336, 16349? 16364 What comes next: 5864, 11751, 17640, 23531? 29424 What is next in 742, 893, 1142, 1489, 1934, 2477? 3118 What is next in -211816, -423648, -635480, -847312? -1059144 What is the next term in 22053, 22049, 22047, 22047, 22049, 22	{ "pile_set_name": "DM Mathematics" }
i(a) - 5o(a). What is the third derivative of g(q) wrt q? -1956 Let z(p) = 6p*2 + 13p*2 + 21p + 12p. Let i(d) = -39d*2 - 65d. Let l(f) = 3i(f) + 5z(f). What is the second derivative of l(c) wrt c? -44 Let c(q) = 19q + 2. Let w be c(1). What is the second derivative of 25 - wt*3 + 25 - 29t - 50 wrt t? -126t Let p be (-15)/36-16/15. Let u(b) be the third derivative of 5/24b*4 + 0 - pb*3 + 0b + b2. Find the first derivative of u(r) wrt r. 5 Let i(z) = -z3 + 1. Let d(g) = -11g3 + 17. Let l(u) = -u2 + 5. Let x be l(3). Let b(n) = xi(n) + d(n). Differentiate b(y) with respect to y. -21y2 Let u(l) be the first derivative of l6/6 - 24l*4 - 5l*2 - 5l + 760. What is the second derivative of u(n) wrt n? 20n3 - 576n Let c(k) be the third derivative of -263k9/504 - k5/12 - k4 + 194k*2. What is the third derivative of c(y) wrt y? -31560y*3 Let n = -33 - -56. Differentiate 4x - n - 11x - 3x2 + x2 + 50x wrt x. -4x + 43 Let m = 38 - 33. Differentiate 12 - 3y2 - my2 - 19 + y2 wrt y. -14y Let y(r) be the third derivative of 313r*7/105 - 46r*5/15 + 287r*2 - r. Find the third derivative of y(q) wrt q. 15024q Let y be ((-1)/(-3))/((-2)/6). Let k be (18 + -3)/(-3)y. What is the second derivative of 3d + 13 - kd5 - 13 wrt d? -100d*3 Let g(q) = 2q - 12. Let d be 2/(-8) + 25/4. Let y be g(d). What is the second derivative of -6v4 - 3v + yv4 - 2v wrt v? -72v2 Let a(u) = -u2 - 6u + 2. Let b be a(-6). Find the first derivative of -12 - 5m2 + 45m*3 + 5m*b - 54m*3 wrt m. -27m*2 Suppose -2z - 5j - 14 = 0, -5z + j = -z - 16. What is the second derivative of 20c3 - 3047c*2 + 3047c*2 + 49c + 2cz wrt c? 132c Let a(r) be the first derivative of -16r3/3 + r2 - 160r + 91. What is the derivative of a(i) wrt i? -32i + 2 Let t = -56 + 60. What is the second derivative of tb*3 + 8b + 12b - 12b*3 wrt b? -48b Let v(y) be the second derivative of 0y6 + 0 + 1/3y*3 + 0y*5 + 0y*4 + 0y*2 + 1/42y*7 - 6y. What is the second derivative of v(u) wrt u? 20u3 Let g be 4/6-3539/(-130). Let b(k) be the first derivative of gk + 12 + 13/2k2. Differentiate b(i) wrt i. 13 What is the third derivative of -79v*3 + 72v*4 - 81v*3 - 87v*3 + 249v*3 - 800v*2 wrt v? 1728v + 12 Let g(p) = p5. Let s(j) = -j2 + 9j - 18. Let a be s(7). Let h(d) = 19d*5 + 9d*2. Let f(o) = ag(o) - h(o). Find the third derivative of f(n) wrt n. -1380n2 Let b(v) be the first derivative of 65v4 - v3/3 - 179v + 12. What is the third derivative of b(d) wrt d? 1560 Let c(q) be the third derivative of -3/10q*5 + 0q - 5/112q8 + 0q*3 + 0q*4 + 0q*6 + 0q*7 - 16q*2 + 0. What is the third derivative of c(x) wrt x? -900x*2 Let u(h) be the first derivative of 127h*2/2 + 70h + 92. What is the first derivative of u(y) wrt y? 127 Let c(j) = 17j2 + 12j - 49. Let h(y) = 36y2 + 26y - 99. Let q(a) = 13c(a) - 6h(a). Differentiate q(t) with respect to t. 10t Let b(l) be the third derivative of -17l*2 + 0l*3 - 11/8l*4 - 9/70l*7 + 0l*6 + 0 + 0l + 0l5. What is the second derivative of b(m) wrt m? -324m*2 Let g(l) be the second derivative of 0l*7 + 0l*5 + 0l*2 + 0l*3 + 5/14l*8 + 0l*6 + 4l + 0 - 1/12l4. Find the third derivative of g(w) wrt w. 2400w*3 Let h(a) be the second derivative of 14/15a*6 + 0a*2 + 0a*3 + 0 + 3a + 0a5 + 7/12a*4. What is the third derivative of h(b) wrt b? 672b Let a(c) be the third derivative of c9/378 + c6/18 - 4c3 + c2. Let l(o) be the first derivative of a(o). What is the third derivative of l(k) wrt k? 480k*2 Suppose g + 2g = 2g. Find the second derivative of -5j*5 + gj*5 + 3j5 - j5 - 30j wrt j. -60j*3 Let c(r) = 2r3 - 11. Let n(y) = -y3 + 1. Let j(a) = a - 4. Let p be j(3). Let u(h) = pc(h) - 6n(h). Differentiate u(b) with respect to b. 12b2 Let z be 101 - (-9 + 17). Let q(r) be the first derivative of 1/5r5 + 0r*3 + 0r*4 - 5/2r*z + 0r - 2. What is the second derivative of q(t) wrt t? 12t2 Suppose 0 = 2l - l - 4. Let k be (65/26)/(10/24). What is the second derivative of -lo3 + ko*3 - 5o + 7o3 + 11o wrt o? 54o Let n be -1(-1 + 1 + -2). Suppose 5 - 39 = -17c. Find the second derivative of 4m + nm - 2m*c - 5m*2 wrt m. -14 Let x(c) = 653c*3 + 8c*2 - 406c - 24. Let w(i) = 218i3 + 3i*2 - 135i - 9. Let a(s) = 8w(s) - 3x(s). Find the second derivative of a(j) wrt j. -1290j Let b(w) = 2w - 4. Let u be b(4). Find the third derivative of 3hu + 33h*2 - 10h*4 - 37h*2 wrt h. -168h Let n(m) be the third derivative of -19m6/120 + m5/30 - 31m*4/6 + 16m*2 + 5. Find the second derivative of n(v) wrt v. -114v + 4 Let u(i) = -i + 2. Let y be u(0). What is the derivative of -134wy - 12 + 134w*2 + 6w*4 wrt w? 24w*3 Let w(x) = 67x*3 - 8x + 109. Let k(n) = n*3 + n - 2. Let h(f) = 6k(f) + w(f). Differentiate h(b) wrt b. 219b2 - 2 Let w(s) = -7s - 2s2 - 2s - 6 + s*2 + 2s. Let b be w(-5). What is the third derivative of -3x2 - 3x*b - 2x4 - x2 wrt x? -120x What is the second derivative of -4m*4 - 7m*4 + 157m - 4m4 + 69m wrt m? -180m2 Let s(v) be the first derivative of -6v*5/5 - 11v*4/4 - 39v + 52. Find the first derivative of s(n) wrt n. -24n3 - 33n*2 Find the third derivative of 13n*4 + 143n*2 - 723n*6 - 13n*4 + 500n*2 wrt n. -86760n*3 Differentiate -207 + 14d + 59d + 108d + 98d with respect to d. 279 Let a(w) = 12w*2 + w + 13. Let v(t) = 34t*2 + 2t + 39. Let n(c) = 11a(c) - 4v(c). What is the first derivative of n(m) wrt m? -8m + 3 Let s(d) be the second derivative of 11d*6/30 - 3d*5/20 + 5d4/6 + d2/2 + 6d + 5. What is the third derivative of s(h) wrt h? 264h - 18 Let l = 35 - 33. Differentiate 14 - 4g2 + g2 - 6g*l + 4g*2 wrt g. -10g Let f(g) be the first derivative of 25/2g2 + 3 + 0g*3 + 0g + 0g4 + 26/5g*5. What is the second derivative of f(y) wrt y? 312y*2 Let s(g) be the first derivative of 0g*2 + 7/3g*3 + 21 - 23g. Differentiate s(k) wrt k. 14k Let n be 4/6 - (-14)/6. What is the second derivative of 2z*n - 4 + 6z + 4 wrt z? 12z Let z(t) = 31t*2 - 61t + 4. Let f(o) = -30o2 + 62o - 3. Let s(x) = -4f(x) - 3z(x). What is the second derivative of s(k) wrt k? 54 Let y = 126 + -126. Let n(p) be the second derivative of -p*2 + 0 + yp*3 + 6p + 7/12p4. Find the first derivative of n(c) wrt c. 14c Let b(k) = -6k - 8. Let y(z) = -3z - 4. Suppose 0 = -3t + 12 - 6. Suppose 0 = td - 5 + 1. Let s(n) = db(n) - 5y(n). What is the derivative of s(m) wrt m? 3 Let g(s) be the second derivative of s*5/20 + 5s*4/6 + 26s*3/3 - 13s. Find the second derivative of g(v) wrt v. 6v + 20 Find the second derivative of -4714 - 8y2 + y3 - 2y - y3 + 4488 + 18y*5 wrt y. 360y*3 - 16 Let c(d) = -30d*3 + 396d + 495. Let l(z) = 7z3 - 99z - 124. Let w(a) = -2c(a) - 9l(a). What is the derivative of w(b) wrt b? -9b2 + 99 Let r(x) = 3x*3 + 6x + 79. Let w(t) = -10t3 - 17t - 236. Let g(f) = 17r(f) + 6w(f). Differentiate g(p) wrt p. -27p2 Let m(c) = -c3 + 6c*2 + c - 2. Let h be m(6). Suppose -3 - 5 = 2s, -4t + h = -s. Differentiate t + 3j + 3j + 6 - j with respect to j. 5 Suppose -92 = -17b + 13b. What is the second derivative of -4g - 4g + 27g*4 - bg wrt g? 324g2 Let l be -12 - -6 - -11 - 5. Let q(g) be the second derivative of 0g*3 - g + lg*2 + 0 + 1/6g*4 + 1/4g*5. Find the third derivative of q(c) wrt c. 30 Let f be (275/6)/1. Let y = f - 22. Find the first derivative of 10ly - 3l*3 + 4 + 2 wrt l. 21l*2 Find the second derivative of 88i*4 + 194i + 11i4 - 123i wrt i. 1188i2 Let t(r) = 2r + 5. Let o be t(-1). What is the derivative of -n*o - 9 + 7 - 3n*3 + 4 wrt n? -12n2 Let k(l) be the second derivative of -l6/15 - 11l4/6 + 67l*2 + 61l. What is the derivative of k(n) wrt n? -8n3 - 44n Find the third derivative of 115p2 + 9220 - 2p*4 - 9220 - 60p*6 wrt p. -7200p*3 - 48p Find the first derivative of -195 - 236v2 + 11v + 227v2 + 7v*4 - 11v wrt v. 28*v	{ "pile_set_name": "DM Mathematics" }
hat is the nearest to -1/3 in -1, r, -0.5? -0.5 Let n = 7 + -17. Let q be (3/n)/((-15)/20). Let j = 7 + -3. What is the nearest to q in -0.2, j, 5? -0.2 Let g = 1.3 - 2.2. Let s = g + 1. Which is the nearest to s? (a) 5 (b) 2 (c) -1 c Let u(p) = -p3 + p2 + 1. Let t be (1 + -1)/(0 + 1). Let z be u(t). Let l = 4.4 + -4. What is the closest to z in 1, -2, l? 1 Let b = -3.1 + -0.9. What is the nearest to -0.1 in 2, b, 8? 2 Let v = -68/3 + 281/12. Which is the closest to -1? (a) v (b) -1 (c) -1/9 b Let c be 22/(-18) - 4/(-18). Let i be (-1)/(-5) - 1/(-45). What is the closest to -1/2 in -4, c, i? c Let l = 21 + -21.05. Let g = -0.25 + l. What is the closest to -1 in 2/9, 0.1, g? g Let x = -0.6 - 1.4. Let p = -4.5 + 11. Let s = 7 - p. Which is the closest to 0.1? (a) s (b) x (c) -4 a Let d be 2/(-34/6). Let h = 832/3 + -277. What is the nearest to 0.1 in d, -2/5, h? h Let i = 1 + -1. Let j = -5 - 0. Let w = -2 - j. Which is the nearest to i? (a) 0.4 (b) w (c) -1/2 a Let r = 0.03 + -0.53. What is the closest to -1 in -0.2, r, 1/3? r Let k be (3 + 17/(-4))/(15/(-6)). What is the nearest to k in 6/11, -2/5, -1? 6/11 Let g = 0 + 0. Let c be (-1)/(15/(-10))(-1 + -5). What is the closest to 1/3 in c, -0.4, g? g Suppose f - 4 - 3 = 0. Suppose 2q + f = 17. Which is the closest to 1? (a) q (b) -1/3 (c) 2 c Let h = -1 - -4. Let r be (3/5)/(h/(-8)). Let k = -6/5 - r. Which is the nearest to k? (a) -0.5 (b) 0 (c) 0.3 c Let k = 2.83 - 0.83. What is the closest to k in 3, -0.2, -0.1? 3 Let k(l) = -l3 + 13l*2 - 1. Let g be k(13). What is the closest to g in -0.2, 1/3, 0.5? -0.2 Let v = -242 + 3144/13. What is the nearest to 1 in v, -2, 0? 0 Let r = -1.948 + -0.052. What is the closest to 2 in r, 3, 0.4? 3 Let a = 0 + 3. Let q = 15 + -18. What is the nearest to -1 in q, a, 4? q Let k = 67/14 + -16/7. Let u(y) = -2y + 8. Let i be u(6). Let n be 1i(-4)/(-88). Which is the nearest to 3? (a) n (b) k (c) 2/3 b Let g = 10 + -10.2. What is the closest to -1 in 0.1, 2/13, g? g Let g(o) = o + 4. Let u be g(-4). Suppose 4z + 9 = l, 5l + 2 = 27. Which is the nearest to z? (a) -3/5 (b) u (c) 6 a Suppose 7 - 5 = -2h. Which is the nearest to h? (a) 0.07 (b) -2/7 (c) -0.1 b Let u = 0.08 - 0.08. What is the nearest to u in 0.1, 2/7, 2/3? 0.1 Let o = -39 + 37. What is the nearest to 1 in o, -4, 0.3? 0.3 Let x = 0.4 + -0.5. Let i = 11 + -11. Which is the closest to i? (a) 1/4 (b) -5 (c) x c Let h = -47/60 + 8/15. Which is the closest to h? (a) 2 (b) 0 (c) 1/7 b Let i = 5 - 5. Let g = -0.2 - i. Let z be (-2)/(-4) - (-6)/4. What is the closest to 2 in 0.5, g, z? z Let p = 4.9 - 5. Let l = -1.9 + p. Which is the nearest to -1/4? (a) l (b) 1 (c) -5 b Let b = 7/20 + 1/20. Let x = -472/5 - -94. What is the closest to x in -1, b, 4? -1 Let k = -0.33 - -0.05. Let g = k - 0.02. What is the nearest to 2/7 in -0.4, -1/2, g? g Let l = -0.025 - -2.725. Let f = l + 1.3. Suppose 0 = 3g - 1 - 2. Which is the nearest to 0? (a) f (b) g (c) 2 b Let k = -1.8 + -1.8. Let g = -7 - -3. Let v = k - g. What is the nearest to -2/5 in 4/3, v, -4/7? -4/7 Let l = 0.6 + -1.6. Let x = -0.96 - l. Let j = -0.36 - x. What is the nearest to -1/3 in -0.5, 1/9, j? j Suppose -4k = 2m, m = -m. Suppose -4c = -12, k = -4l - c - 3c + 12. What is the closest to 0 in 2, l, 0.2? l Let g = 21 + -13. Let t = -12 - -21. Let n = g - t. What is the closest to n in 1/3, 2/7, -4? 2/7 Let q = 105.5 + -106. What is the nearest to -2 in 5, -0.4, q? q Let q be 3/(9/7) - (12 + -9). Which is the nearest to 0.1? (a) -1 (b) q (c) 1 b Let k = 124 - 125. Which is the nearest to -0.5? (a) -2/7 (b) 0.1 (c) k a Let b be (-34)/(-10) + 2/(-5). Let m be 1/b + 0 + -1. Let q be (2 - -2)(-6)/56. What is the nearest to -0.1 in q, -5, m? q Let u = 10 + -5.5. Let o = -13.2 + u. Let m = 9 + o. What is the nearest to 2/9 in 1, m, 3? m Let y(h) = -3h + 28. Let r be y(11). Which is the nearest to -0.11? (a) r (b) 4 (c) 5 b Let d = -1 + 1/2. Which is the closest to 2/7? (a) -2 (b) d (c) 0.1 c Let d = 0.2 + -0.4. Let g = -1.7 - 0.3. Let j = g - -3. Which is the closest to -1/4? (a) j (b) d (c) 4 b Let v = 3.91 + 0.09. Let i = -3.9 + v. Let s(h) = h + 11. Let l be s(-6). What is the closest to i in l, 0.2, -2/5? 0.2 Let t = 6 + -7. What is the closest to t in -2/7, 1, 0? -2/7 Let s be 2 + -1 - (-3)/(-15). Let m = 9 - 11. Which is the closest to m? (a) s (b) 1/6 (c) 5/4 b Let c = -10 - -12. Let u = -18/13 - -77/65. What is the nearest to -2/5 in 1, c, u? u Let h = 0.9 - -0.1. Let g = 3.01 - 0.01. Let r = -2.5 + g. What is the closest to h in r, -2, -0.1? r Let o be (1 + 0)/((-2)/4). Let m be (-8 - -2 - -3)/(-1). Suppose -3u = -my - 0y, 6 = 2y. What is the closest to u in -4, -0.3, o? -0.3 Let b(m) = -m3 + 3m2 + m - 1. Let c be b(3). Let f = 4.7 + -5. Let y = -0.9 - -1. What is the nearest to 0 in c, y, f? y Let o = -4.2 - -4. Let p be (4 + 2)/(3 - 1). Let z = p + -8. Which is the nearest to 0? (a) o (b) 0.4 (c) z a Let q(h) = h3 + 11h2 + 26h + 11. Let g be q(-8). Which is the closest to 0.32? (a) 0.2 (b) 5 (c) g a Let x = -61 + 64.9. Let i = 1.1 + x. Which is the closest to -2/5? (a) i (b) 2 (c) 0.1 c Let s be ((-2)/(-11))/1 - (-24)/(-132). What is the closest to 0.1 in 0.1, -0.1, s? 0.1 Let p be 15/20 + (-13)/12. What is the closest to p in -5, 17, -0.1? -0.1 Let v = 9 + -13. What is the closest to 2/3 in v, 3, -3? 3 Let r(j) = 2j3 - 25j*2 + 12j + 10. Let i be r(12). Which is the closest to -0.1? (a) -3 (b) i (c) 0 c Let b be -1(0 + 217/6). Let i = -36 - b. Let r = 8 + -9. What is the closest to 0 in r, i, -2/5? i Let n = -2.16 - -0.16. Let x = n - 1. What is the nearest to -0.1 in -1/5, -0.1, x? -0.1 Let f(z) = -z2 + 7z - 4. Let u be f(8). Let i = u - -12. Which is the closest to i? (a) 5 (b) 0.2 (c) 2/7 b Let t = -23/10 + 9/5. Let o be ((-5)/2)/((-1)/(-2)). Let p be (-1)/o25/10. Which is the nearest to -1? (a) p (b) t (c) 0 b Let k = 2 + 1. Let h = k + -5. Let p = -9 - -7. Which is the nearest to h? (a) p (b) 4 (c) 1 a Let d(x) = x - 1. Let k be d(2). Let u = 2 - 5. Let i = u + 3. What is the closest to i in k, -1/4, -0.1? -0.1 Let l = 1.1 - -4.9. Let q = -5.6 + l. What is the nearest to 1 in q, 3, 4/3? 4/3 Let x = -143/360 + 7/40. What is the nearest to 2/13 in -1/5, x, -0.5? -1/5 Let y = 0.33 - 0.03. What is the nearest to -1/5 in y, -5, 0.1? 0.1 Let h(n) = -n2 - 7n + 9. Let y be h(-8). Let j = 17 + -17.5. Which is the nearest to 1? (a) j (b) y (c) 0.4 b Let a = 0.09 - -0.11. Let j = 10/9 - 13/36. Let g be (2/10)/(6/10). What is the nearest to a in g, j, 1/5? 1/5 Let b be (-3)/18 - 2/6. Let r(j) be the first derivative of -j*2/2 + 5j - 2. Let v be r(6). What is the nearest to v in -4, b, 1/3? b Let d = -1.4 + -0.6. Suppose 5j = -j. Let x = -1/72 + 25/72. Which is the closest to j? (a) 0.2 (b) x (c) d a Let p = -8.4 - -4.4. Which is the closest to -9? (a) -1 (b) p (c) 5 b Suppose 2b - 2t + 3t + 18 = 0, -3t = -4b - 26. What is the closest to -0.1 in b, -4, -1/5? -1/5 Let n = -4 - -3. Let b = n + 2. Let z = -25/3 - -8. What is the closest to 1 in b, -0.1, z? b Let h = -4.94 - 0.06. Let r = h + 4.8. What is the closest to 0 in -3, r, -0.4? r Let h be 0/2 - (-4 + 3). Suppose o - 2l - 14 = 2o, l + h = 0. Let q be ((-3)/(-2))/(o/4). What is the nearest to -1/3 in q, 0.1, -1? q Let d = 14 + -18. Let y = 3 + d. Which is the closest to y? (a) 0.5 (b) 0.4 (c) 4 b Suppose -20v + 18v = -6. Let o be (-2)/12(3 - 1). Which is the closest to o? (a) -2/5 (b) -1/5 (c) v a Let p be (15/18)/(-1) + 1. What is the nearest to 1/2 in 0.4, -1, p? 0.4 Let j = -0.09 - 0.91. Which is the closest to -1? (a) -0.5 (b) j (c) 1 b Let g = -13 + 17. Let x = -2 + 2.4. Let u = -0.3 - 2.7. What is the closest to u in 0, g, x? 0 Let u = 5.2 - 5.3. Which is the closest to -1? (a) 6/7 (b) u (c) 4 b Let d = -8 + 13. Suppose -5 = dq + 5r, 2q - 2r + 3 = 5. Let h = 0.7 - 0.4. Which is the nearest to q? (a) 3 (b) -3/5 (c) h c Let p = -100 - -100.1. Which is the nearest to p? (a) 1 (b) -3 (c) 1.1 a Let o(s) = -s3 + s*2 - s - 5. Let x be o(0). Let v = 10 + x. Let d(q) = q + 6. Let f be d(-7). Which is the nearest to 0? (a) f	{ "pile_set_name": "DM Mathematics" }
- i - 2. Let w(y) = y*3 + 3y*2 - y - 3. What is to(a) + vw(a)? 2a*3 + a Let g(s) = 73s*3 + 16s*2 + 3s - 1. Let d(n) = -109n3 - 26n*2 - 3n + 2. Determine -5d(h) - 8g(h). -39h3 + 2h*2 - 9h - 2 Let w(p) be the first derivative of -237 + 60 + 74 - 3p2 + 82. Let l(q) = -2q. Determine 7l(c) - 2w(c). -2c Let o(q) = -7q - 3. Let c(k) = 8k + 2. Suppose -23v + 20 = -30v - 1. Give vo(s) - 4c(s). -11s + 1 Let h(r) = 652r3 - 5r*2 + 5r + 2. Let l(t) = 327t3 - 2t*2 + 2t + 1. What is -2h(c) + 5l(c)? 331c3 + 1 Let q(j) = 7. Let r(i) = -2i - 3146. What is 12q(l) + r(l)? -2l - 3062 Let o = -8 + 10. Let h(k) = 41 + 4ko - 41 - 2k + 7k. Let q(m) = 3m*2 + 5m. What is 4h(v) - 5q(v)? v*2 - 5v Let s(l) = -4l + 0 + 4 + 3l - 5. Let p(q) = -1. Let v(g) = -158g2 - 458g + 45. Let x be v(-3). Determine xp(t) - s(t). t + 4 Let t(b) = 9b + 3. Let g(i) = 127i + 10. Determine g(u) - 3t(u). 100u + 1 Let c(o) = -6631o + 202. Let r(b) = -39785b + 1162. Determine 23c(a) - 4r(a). 6627a - 2 Let s(j) = 102 + 101 - 209 + j*2 + 47j - 57j + 7j*2. Let u(d) = 3d*2 - 3d - 2. Let f be 153/15 - 2/10. Calculate fu(g) - 3s(g). 6g2 - 2 Let v(f) = 3f + 4844 - 4846 + 4f. Let n(q) = -57q + 17. What is 6n(a) + 51v(a)? 15a Let p(l) = l - 1. Suppose 39 = 2111n - 2098n. Let c(w) = w. What is nc(u) - 2p(u)? u + 2 Let l(b) = 16b*3 + 3b*2 + 4b + 3. Let c(d) = -197 - 201 + 15d3 + 3d - 199 + 2d2 + 599. Determine -3c(m) + 2l(m). -13m*3 - m Let x = -1812 + 1809. Let r(g) = 7g*2 - 3. Let j(m) = -4m*2 + 1. Give xr(d) - 5j(d). -d2 + 4 Let m(b) = 2b*2 + 4b + 16. Let y(z) = -z + 2547 + 2541 + 2542 - 7631 - z*2. Calculate m(i) + 3y(i). -i*2 + i + 13 Let j(p) = -8p*3 - 2p*2 + 7p + 1. Let v(u) = 5u3 + u2 - 5u - 1. Suppose -w = -5q - 25, -23 = w - 2q + 5q. Give wj(r) - 7v(r). 5r*3 + 3r*2 + 2 Let c(h) = -339h + 3 - 338h + 1009h - 338h. Let z(l) = l. Give c(t) - 4z(t). -10t + 3 Let q(r) = 3r - 2 + 0r + 7 - 4. Suppose 4h - 2h - 10 = 0. Let p(j) = -2 - j - hj + 4 - 4. Give -6p(g) - 11q(g). 3g + 1 Let i(g) = 9g + 3. Let r(n) = 19n + 6. Let m(o) = 2o*2 - 12o - 12. Let p be m(7). Calculate pr(s) - 5i(s). -7s - 3 Let x(b) = b + 1. Let w(g) = -4g - 1. Let n = -189 + 194. Suppose -21f - 2s = -18f + 4, -nf + 5s - 15 = 0. What is fw(m) - 2x(m)? 6m Let u(r) = 37r3 + 7r*2 - 7r. Let g(b) = 5b2 - 2b - 3b - 13b*3 + 38b*3. Let x(q) = 205q - 35060. Let z be x(171). Determine zu(o) + 7g(o). -10o3 Let j(o) = -o. Let r(x) = -44x*2 + 7 - 2x*3 + 23x*2 - 4x + 22x2 - 5 + 0. Give 2j(b) - r(b). 2b3 - b2 + 2b - 2 Let n(x) = -2x - 2. Let u(q) be the second derivative of -q + 1/3q*3 + 1/2q*2 - 82. Calculate -7n(o) - 6u(o). 2o + 8 Let c(i) = -4. Let r(o) = o*3 + 436. Give -4c(p) - 2r(p). -2p*3 - 856 Let j(w) = -2w + 6. Let i(s) = 8s + 6. Let g(f) = 13f + 11. Suppose 4l - 15 = 5. Let u(c) = li(c) - 3g(c). Calculate 6j(q) + 13u(q). q - 3 Let q(v) = -8v*2 - 142v + 477. Let w(f) = -10f2 - 227f + 715. Determine 8q(n) - 5w(n). -14n2 - n + 241 Let w(i) = 1 - 2907656i + 6 + 2907651i. Let d = 10 + -4. Let j(z) = 4z - 6. Suppose -4s + 28 = 8. Calculate dj(y) + sw(y). -y - 1 Let q(j) = -8 - 9j - 15 - 7 + 26. Let d = -14 - -20. Let b(r) = 19r + 9. Suppose 63a - 123 - 696 = 0. Give aq(z) + db(z). -3z + 2 Let k(i) = 384i - 4. Let t(g) = -192g + 3. Determine -4k(z) - 7t(z). -192z - 5 Let s(m) = -1168m - 43. Let h(c) = -519c - 21. Give -7h(u) + 3s(u). 129u + 18 Let m(p) = -11694p + 75. Let i(d) = -467d + 3. Calculate -51i(f) + 2m(f). 429f - 3 Let d(i) be the first derivative of -7/2i2 + 100 - 7i - 8/3i3. Let w(y) = -y2 - y - 1. What is -d(g) + 6w(g)? 2g2 + g + 1 Let s(j) = -j3 + 26j*2 + 42j + 3. Let y(n) = 3n3 - 104n*2 - 161n - 11. Give -11s(c) - 3y(c). 2c3 + 26c*2 + 21c Let g(o) = 7o3 - 6o - 3. Let j(f) be the first derivative of f4/4 - f2/2 - f + 12096. What is g(l) - 5j(l)? 2l3 - l + 2 Let x(h) = -h2 + 3h - 15. Let o(n) = -2064n*2 + 96n - 480. What is -o(m) + 32x(m)? 2032m*2 Let k(v) = 2v*3 + 3v - 2. Let m be 24/(-30)-5 - -2 - -1. Let i(z) = 26 + z - 9 - m - 10 - 1. What is 2i(x) - k(x)? -2x3 - x Let t(v) = -v2 + 4v - 3. Suppose 8j + 89j + 168 = -317. Let u(b) = b*2 - 3b + 3. Calculate ju(d) - 4t(d). -d*2 - d - 3 Let k(s) = 17s - 3. Let x(n) = 16n - 2. Let q(t) = -t3 - 22t*2 - 123t - 38. Let j be q(-12). Calculate jk(a) + 3x(a). 14a Let m(s) = 36s*2 + 87s + 75. Let q(t) = 3t2 + 7t + 6. Let g(f) = -6m(f) + 75q(f). Let i(b) = b*2 - b. Calculate 2g(z) + 6i(z). 24z*2 Let q(h) = -38h*2 + 8h - 12. Let t(d) = -18d2 + 3d - 5. Let l(c) = 3q(c) - 7t(c). Let g(x) = -6x2 - x. Calculate -5g(i) - 2l(i). 6i*2 - i + 2 Let f(u) = -11u*2 + 7u. Let t(k) be the third derivative of -k5/12 + k4/8 - 3032k2. Determine 3f(z) - 7t(z). 2z2 Let r(q) = -q2 + 1. Let u be (17 - 13) + 2 + -7. Let z(l) = 2l3 + 6l*2 - 3l - 4. Give uz(a) - 4r(a). -2a3 - 2a*2 + 3a Let v(x) = 2x + 2. Suppose 13f + f = -154. Let a(l) = l*2 + 10l. Let b be a(f). Suppose -bu + 8u + 18 = 0. Let y(w) = -3w - 2. Calculate uv(c) + 5y(c). -3c + 2 Let p(m) = 3. Let h be 222/(-11) - 20/(-110). Suppose t - 2t - 2 = 0. Let i be ((-14)/(-8) + t)(h - 0). Let q(b) = b + 4. Determine ip(n) - 4q(n). -4n - 1 Let h(z) = z2 + z. Let s(r) = -34r*2 - 3r. Let d(x) = 4x3 - 6x*2 - 39x - 32. Let b be d(-1). Calculate bh(t) - s(t). 31t*2 Let p(r) = 5r + 2. Let s(d) = 11d + 4. Let f(k) = -2k + 26. Let j be f(5). Suppose 5g = 2g - 4t - 10, -3g = t + j. Calculate gs(a) + 13p(a). -a + 2 Let z(g) = 2g3 + g2. Let s(u) = -1078u*3 - 3u*2 - u. What is s(y) + 3z(y)? -1072y3 - y Let g(d) = 30d - 32. Let s(t) = -31t + 69. What is 3g(q) + 2s(q)? 28q + 42 Let j(z) = -546z2 + 5z - 30. Let p(s) = 1091s2 - 9s + 50. Determine -5j(w) - 3p(w). -543w2 + 2w Let f(i) = i*2 - 4i - 2. Let l(m) = 6m2 + 6m + 1. Let q(a) = 2f(a) + l(a). Let b(g) = -7g*2 + 2g + 2. What is 4b(v) + 3q(v)? -4v2 + 2v - 1 Let a(d) = -66d2 + 18d - 4. Let t(x) = -66x2 + 13x - 3. Calculate 3a(i) - 4t(i). 66i2 + 2i Let z(x) = -12x - 7. Let s = -416 + 422. Suppose 4k - 8o = -so + 26, 4k + o = 29. Let l(y) = -6y - 3. Give kl(q) - 3z(q). -6q Let i(r) = 10r3 - r - 6. Let o(t) be the second derivative of -t5/20 + t*2/2 - 22t + 37. What is -i(n) - 6o(n)? -4n*3 + n Let c(i) = 4i*3 + i - 1. Let r(o) = 18o*3 - 2o*2 + 6o + 30. What is 4c(l) - r(l)? -2l*3 + 2l*2 - 2l - 34 Let f(w) = -1089w - 2. Let t(q) = -1524q - 3. Let c(h) = 7f(h) - 5t(h). Let d(k) = k*2. What is -c(u) + 4d(u)? 4u2 + 3u - 1 Let y(i) = -477i3 - 9i*2 - 7i - 18. Let p(m) = -159m3 - 3m*2 - 2m - 5. What is 7p(v) - 2y(v)? -159v3 - 3v*2 + 1 Let x(y) = -4y + 3. Let t(v) = -17v + 12. Let p(j) = -2t(j) + 9x(j). Let n(g) = -g. Determine 3n(r) - p(r). -r - 3 Suppose 260a - 265a = 5l + 25, 4a = l - 25. Let r(k) = k*2 - 1. Let x(t) = -8t*2 - 2t - 20. Determine ar(q) - x(q). 2q*2 + 2q + 26 Let l(j) = -4j + 1. Let k(f) = -53f + 16. Determine -k(y) + 6l(y). 29y - 10 Let y(i) = -9i2 + 9i - 19. Let c(w) = -25w2 + 5w - 30. Let s(u) = -36u2 + 8u - 44. Let v(j) = 7c(j) - 5s(j). Calculate -11v(n) - 6y(n). -n*2 + n + 4 Let j(c) be the third derivative of -3c*5/20 - 11c*4/8 - 14c2. Let s(n) = n2 + 4n. Suppose -14u = 12u + 104. Determine uj(x) - 33s(x). 3x*2 Let m(s) = 19s - 52. Let h(f) = 13f - 53. Determine 3h(r) - 2m(r). r - 55 Let z(s) = s2 - s + 1. Let i be 8 + 4 + -1 + (-12)/2. Let f(t) = 7t*2 - 35t + 5. Determine iz(p) - f(p). -2p*2 + 30p Suppose 128l + 933 = 165. Let n(i) = -8i*3 - 21i*2 - 6i + 6. Let u(t) = 23t3 + 63t*2 + 17t - 17. Determine lu(h) - 17n(h). -2h3 - 21h2 Let f(g) = -g2 + 2g - 4. Let x = 1 + 76. Let u = 79 - x. Let j(k) = -2k3 + k3 + 73k + 0k*3 - 62k - 21 - 6k2. What is uj(l) - 11f(l)? -2l3 - l2 + 2 Let r(q) = -3*q - 28. Let n(f) = f + 9. Suppose	{ "pile_set_name": "DM Mathematics" }
ine x(n(z)). -5036504z4 Let m = -18 - -20. Let s(k) = k + 0k - mk - k. Let p(y) be the third derivative of 4y*5/15 + 19y*2. What is s(p(b))? -32b*2 Let w(u) = 8u*2. Suppose k + 16 = -2x - 3k, 0 = -5x - 5k - 15. Suppose -7c + xc = 0. Let r(o) = 2o + co - o. Calculate r(w(b)). 8b*2 Let y(r) be the third derivative of -1/20r*5 + 0r + 0r4 + 18r*2 + 0r*3 + 0. Let k(a) = -9a*2. Calculate k(y(g)). -81g4 Let t(n) be the first derivative of -n2 + 2. Suppose 44i - 42i + 12 = 0. Let x(v) = -v. Let z(d) = -7d. Let a(k) = iz(k) + 49x(k). Give t(a(b)). 14b Let h(b) = -2 - 2 + 5 + 3 - 2 - 46b. Let r(f) = -5f. Give r(h(n)). 230n - 10 Let n(q) = 29q. Let v(k) = 10k - 32. Let m(g) = -3g + 10. Let w(h) = -16m(h) - 5v(h). What is w(n(z))? -58z Let h(n) be the first derivative of -13n*5/120 - 11n*3/3 - 4. Let m(c) be the third derivative of h(c). Let z(r) = 4r. What is m(z(o))? -52o Let l(s) = 4s + s - 10s + 3s. Let f = -5 + 10. Let w(y) = 2y2 + y2 - fy*2. Calculate l(w(q)). 4q*2 Let r(l) = l. Let m(b) be the first derivative of 3b*2/2 + 10b + 35. Give r(m(a)). 3a + 10 Let m(k) = -27574k2. Let n(b) = -b2. Give n(m(u)). -760325476u4 Suppose -5k = -4a - 43, 4k - 2k + 5a = 4. Let t(p) = 1 - 1 - kp + 5p. Let n(o) = -14o2. What is t(n(d))? 28d*2 Let v(b) = -8b2. Let g(l) be the second derivative of -l3/3 + 2l + 14. What is v(g(i))? -32i*2 Let u(a) = -2a. Let n(z) = -393z + 9. Let s(t) = 295t - 7. Let j(o) = -7n(o) - 9s(o). Calculate u(j(k)). -192k Let d(p) = 64p. Let l(c) = -9c2 - 7. Calculate l(d(u)). -36864u2 - 7 Let w(b) = b2. Let s = 7/65 - -109/195. Let y(t) be the second derivative of 0 - 3t + 0t*2 + st*3. Determine w(y(g)). 16g*2 Let x(g) = -249g - 3. Let f(n) = n*2 + 267. What is f(x(p))? 62001p*2 + 1494p + 276 Let b(t) = -11t. Let x(i) = -i2 - i + 2. Let s(z) = -6z*2 + 6z + 8. Let m(h) = s(h) - 4x(h). Give m(b(n)). -242n*2 - 110n Let v(o) = 1092o + 5. Let y(l) = 23l*2. Calculate v(y(a)). 25116a*2 + 5 Let u(h) = 7h*2. Let b(j) be the first derivative of -13j*3 + 631. Give u(b(r)). 10647r*4 Let i be 8/14 + 17/7. Let x(p) be the second derivative of 0p*2 + 1/4p*4 + 0p*i - p + 0. Let q(n) = -2n. Give q(x(k)). -6k2 Let x(u) be the first derivative of 3u*2 + 0u*2 + 31 - 11 + 3u*2. Let n(d) = -2d*2. Calculate x(n(g)). -24g*2 Let g(b) = 36b + 26b - 14 + 9b + 12. Let d(f) = -2f2. Calculate g(d(l)). -142l*2 - 2 Let r(x) = -5x + 3. Let k(g) = 24g - 14. Let l(v) = -3k(v) - 14r(v). Let i(p) = 101p - 218p + 115p. Determine i(l(d)). 4d Let z(n) = -2n*2 + 2 - 2. Let a(f) be the third derivative of 2/3f*4 + 0 + 0f*3 + 9f + 3f2. Calculate z(a(q)). -512q*2 Let f(h) = -38h2. Let o(u) = -u2 + u - 1. Let n(c) = -10c2 + 8c - 8. Let z(k) = -n(k) + 8o(k). Determine z(f(q)). 2888q*4 Let v(m) = 10m + 2. Let r(s) = -2s2 + 4s*2 + 1927s - 7s2 - 1927s. Give v(r(f)). -50f2 + 2 Let n(p) = 14p - 920 + 920 + 12p. Let d(g) = 6g. What is n(d(r))? 156r Let o(w) = 2w*2. Let f(k) = -4k*2 + 65292k. What is f(o(r))? -16r4 + 130584r*2 Let t(w) = 8w. Let r(a) = -15a. Let v(f) = 6r(f) + 11t(f). Let x(s) be the first derivative of 3 - 1/2s*2 + 0s. Calculate x(v(d)). 2d Let h(w) = -w - 3w - w + 3w. Let a(s) = 4s*2 - 1893s + 1893s. Calculate h(a(g)). -8g*2 Let f(m) be the first derivative of -4m*3/3 - 1560. Let u(w) = 4w*2 - 2 + 2. Give f(u(j)). -64j*4 Let k(t) = -2t. Let f(u) = -5u - 6. Let v(w) = 16w + 16. Let z(x) = -8f(x) - 3v(x). Calculate z(k(b)). 16b Let o(h) = -2h. Let n(x) = -47 + 8 + 8 + 31 + 255x2. Give o(n(q)). -510q2 Let j(v) = -v2. Suppose o = -4f + 4o + 55, 5 = f + o. Let g be ((-4)/(-10))/(f/1150). Let y(p) = -gp2 + p + 44p*2 - p. Give j(y(b)). -4b4 Let d(a) = a2. Let r = 28 - -4. Suppose 5q + p = -p + r, -5q = p - 31. Let s(y) = -4 + q + 6y - 2. Calculate d(s(h)). 36h*2 Let o(f) = -4f. Let t(l) = 36l + 396. Let s(v) = v + 9. Let m(y) = -264s(y) + 6t(y). Determine o(m(i)). 192i Let g(k) = 2k2. Let m(h) be the second derivative of 153h*4/4 + 67h. What is m(g(j))? 1836j4 Let o = -65 - -70. Let b(v) = 43 + ov - 43. Let j(i) = 3i. Calculate b(j(g)). 15g Let p(d) = -359d2 - 2. Let y(a) = 16a*2 + 5. Let r(b) = 19b*2 + 6. Let f(w) = -5r(w) + 6y(w). Calculate p(f(k)). -359k*4 - 2 Let n(d) = -1577d. Let j(i) = -2i. Calculate n(j(q)). 3154q Let z(u) be the first derivative of u*6/72 + 2u3/3 + 3. Let d(x) be the third derivative of z(x). Let g(i) = i2. Give g(d(r)). 25r4 Let k(x) = -8x*2. Let l(h) = -61h*2 - 4. Calculate k(l(n)). -29768n*4 - 3904n*2 - 128 Let f(p) be the second derivative of 5p*3/6 + p. Let i = -4 - -8. Let g(d) = -4 + i + 2d + d. Give g(f(w)). 15w Let z(b) be the third derivative of -b7/2520 - b4/12 + 3b*2. Let v(q) be the second derivative of z(q). Let p(w) = 0w - 2w + 3w. What is p(v(s))? -s*2 Let t(z) = -70z + 44z - 36z - 20z - 77z. Let w(a) = 3a2. Give t(w(m)). -477m*2 Let b(p) = 19p*2. Let q(a) = -71494a*2. Give b(q(f)). 97116448684f*4 Let q(r) = -9r*2. Let x(b) = -3b + 1. Let c be x(-6). Let h = 28 - c. Let s(d) = -8d + hd + 0 + 0. Determine s(q(y)). -9y2 Let v(l) = -18l*2. Let z(g) be the first derivative of 4g*2 - 94. What is v(z(o))? -1152o*2 Let j(t) = -10t. Let s(m) be the second derivative of 0 + 0m2 + 1/12m*4 - 5m + 0m3. Calculate j(s(d)). -10d*2 Let i(k) be the second derivative of -17k*4/12 + 18k + 1. Let j(s) = -s*2. What is i(j(w))? -17w*4 Let v(c) = 1 - 1 - 9c + 19c - 11c. Let d(g) = 2g + 1. Calculate d(v(k)). -2k + 1 Let h(v) be the first derivative of -v*2/2 + 17. Let d(z) = 4z*2 - 6z2 + z2. Calculate h(d(y)). y*2 Let t(r) = 6r*2 - 3r - 3. Let x(f) = -f*2 + f + 1. Let c(v) = t(v) + 3x(v). Let q = 26 + -24. Let j(l) = 199 + ql2 - 199. Give j(c(o)). 18o*4 Let t(u) be the third derivative of 0u*3 + 0 - 1/24u*4 + 0u - 2u2. Let n(r) be the second derivative of -r4/4 - 10r. Give n(t(p)). -3p2 Let x(r) = -4830r. Let f(o) = 6o. Calculate x(f(w)). -28980w Let j(c) = 4c. Let k(w) = 16w - 11w - 4 + 5 - 3w. Determine k(j(y)). 8y + 1 Let o(h) = -176h + 84h + 2h*2 + 94h. Let x(s) = -2s. Calculate x(o(y)). -4y*2 - 4y Let u(k) = -k*2. Suppose 0 = 132o - 145o. Let b(l) be the first derivative of 0l + ol2 - 7/3l*3 + 8. Give b(u(a)). -7a*4 Let m(c) = -139541c + 3c2 + 139541c. Let l(r) be the first derivative of -2r2 + 1. Calculate l(m(w)). -12w*2 Let h(n) = -69n*2 - 3. Let o(p) = 124p - 1. What is o(h(b))? -8556b2 - 373 Let r(k) = k + 134. Let n(u) be the second derivative of -u4/6 + 66u. What is r(n(q))? -2q2 + 134 Let v(j) = -3j*2. Let r(z) = 5z + 9. Let i(l) = 9l + 8. Let y(n) = -7i(n) + 6r(n). Calculate v(y(c)). -3267c*2 - 396c - 12 Let h(g) = -2g2 - 63g. Let z(k) = 3k - 8. What is z(h(s))? -6s*2 - 189s - 8 Let x(k) be the first derivative of -k*6/180 + 8k*3/3 + 7. Let q(v) be the third derivative of x(v). Let u(p) = -12p*2. Determine q(u(z)). -288z*4 Let d(l) be the first derivative of 3l*3 + 48. Let b(x) = 10x. What is b(d(w))? 90w2 Let d(x) = -2x - 13. Let q(z) be the second derivative of -z*3/6 - 4z + 24. Calculate d(q(c)). 2c - 13 Let p(o) = -4o*2 - 10o. Let h(w) = -w*2 - 3w. Let y(q) = -10h(q) + 3p(q). Let c(u) = 16u + 39u - 8u + 0u2 + u2. What is c(y(f))? 4f4 - 94f*2 Let y(r) = 21r*2 - 396r + 27. Let p(v) = 5v2 - 99v + 6. Let b(a) = -9p(a) + 2y(a). Let d(k) = 2k. Give d(b(w)). -6w*2 + 198w Let s(z) = 7z2. Let i(b) = -90b*2. Let j(k) = -4i(k) - 54s(k). Let p(n) = -n. Let q(g) = -3g. Let t(y) = -7p(y) + 2q(y). Determine j(t(c)). -18c2 Let n(a) = -a2 + 7a - 4. Let w be n(5). Let l(y) = 3y2 + y2 - wy*2 + 0y*2. Let v(m) = 2m + 421 - 421. Calculate l(v(q)). -8q2 Let m(a) = 10a*2 - 1. Let d(o) = 17o + 111. Calculate d(m(r)). 170r2 + 94 Let r(b) = b2 - 4b - 8. Let h be r(6). Let c(a) = 2a2 - ha2 + a2. Let s(y) = 3y2. Determine s(c(j)). 3j*4 Suppose 3g - 6*g = g. Let t(w) be t	{ "pile_set_name": "DM Mathematics" }
v1))/vvv(1/2)(vv19v)/v(4/21))(1/14) assuming v is positive. v(853/588) Simplify ((c(-1)c(-6))/(c(-5)c/(c6/c)))/((c0/c)*(-13)c*(-1/7)ccc(-3)) assuming c is positive. c(-69/7) Simplify (((pp(p(1/4)/p)/p)/((p(-2/13)ppp)/p))/((p(-8)p)/p(-9)))(-1/22) assuming p is positive. p*(17/104) Simplify (mmmm*(3/7)m(1/10)/m)/(m(1/2)m/(((m7/m)/mm)/mm))((mm/m(-3/5))/m4)/(m0)(-2/37) assuming m is positive. m(197/35) Simplify (y(-2/31)/y(y*4/yy)/y)*(3/11)((y/y(5/2))/(y(1/14)/y))(-27) assuming y is positive. y(38088/2387) Simplify (nn(2/3))(1/21)/((n/(n(-2/5)/n)n)/nn3)(n(n/(n/n0)n)/nn)(-11)(nn(6/11)n)/(n/(n*(-1)n)) assuming n is positive. n(-89311/3465) Simplify ((s/(s/s(-1/11)))/(s/((ss6s)/s)))(-7/3)/((s1/s)(2/11))22 assuming s is positive. s*(-455/33) Simplify (h/(((hh(-13))/h)/h))/(h8/h)h(17/4)h(-2/21) assuming h is positive. h(1021/84) Simplify (((((g*(-1/15)g)/g)11)46)(-8/5))(-1/16) assuming g is positive. g(-253/75) Simplify (b(-5)(bbb(-2/9))/b)/(b/b(1/2))21((bb1)43)(32/3) assuming b is positive. b(16247/18) Simplify (((h3/hh)/(hh(-3)))/(hhh1hhh5/h))/((h/h(-2/29))/h(-6))(-4/7) assuming h is positive. h(8/203) Simplify (((r/r(-5)r)/rrr(-4)/rr)/(r/r*(-1)rr)(-2/81))/((r(-2))(-2/29)/(r(-2/7))30) assuming r is positive. r(-92255/16443) Simplify ((k(9/2)/((k(2/27)k)/k))/(k*(-5/2)/kk)(1/7))(-43) assuming k is positive. k(-38872/189) Simplify ((x(-1/14))(6/23)/(x(-15))27)(6/17) assuming x is positive. x*(391212/2737) Simplify (((vv/v(-3/16))/v)/v(32/7))/(v(3/5)/(v/(v(-22)/v)v)) assuming v is positive. v(11769/560) Simplify ((y(-1))(15/7))(6/17)/(y(-2/19)yy/((y(1/2)/y)/y))(-23) assuming y is positive. y(349653/4522) Simplify ((y(-24)/y(yy/(((y/(yy*(-2/3)))/y)/yy))/y)/(y4/(y5y)))13 assuming y is positive. y(-845/3) Simplify ((f(3/10))(12/7)/(f/(f/f(-12))f/(f(f(-15/4)f)/fff)f))44 assuming f is positive. f(15037/35) Simplify (c(2/5)/c)4(c(-1/3))(-1)(c(-2/7)cc0/cc)9 assuming c is positive. c(458/105) Simplify ((i(-2))44(ii/(i/i(1/3)))(-1/12))(-48) assuming i is positive. i(12688/3) Simplify (z*7/z((z/z(-1/4))/z)/z)/(z/z0z(-2)z)(z/(zz(-2/3)))36/(z*(-2/7)z)(-2/27) assuming z is positive. z(22153/756) Simplify (((q*15/q)/(qq28))/(q26q(13/3)/q))(-43) assuming q is positive. q(5719/3) Simplify (g/(g5/g)g(-1/7))(-9/5)g(-1/8)/ggg/g(-6)(((g/(gg3g))/g)/g)/g(-5) assuming g is positive. g(3229/280) Simplify (((n/(n(nn(-2/23))/n))/n)/n(1/2)(nn*(-5/3)nn)/(nn(-12)))(-2/55) assuming n is positive. n(-137/345) Simplify (m(-1/9)/((mm/(mmm/m6mm))/m)(m/(mm0))(1/17))/(((m(2/15)/m)/(m(-7)m))/(((m(-1/4)/m)/m)/m(-4))) assuming m is positive. m(-989/180) Simplify ((p/(p5p))(-42)(pppp/(p/(ppppp/p(-1/3))))/p(ppp*(-1/11)p)/p)(-3/11) assuming p is positive. p(-7235/121) Simplify ((i(-2/5))33)22/(i/i(-2/17)iii(-1/9)i5/(i(-3/7)i)) assuming i is positive. i(-1594907/5355) Simplify (b/b(-25))/(bb*(3/38))(bb/((b/(b/b23))/b))(-10/11) assuming b is positive. b(18017/418) Simplify (((r(1/4))(-1/7))(-25))(-32) assuming r is positive. r(-200/7) Simplify ((g/(g/((gg*15)/g))ggg*(3/16))/(gg*(-14)g/(g(1/3)/g)))(-1/30) assuming g is positive. g*(-1369/1440) Simplify ((((zzz(-1/16)z)/z)/zz(-14))/((zzz(-12)zz)/(z/(z24z))))18 assuming z is positive. z(-4185/8) Simplify ((t(-7/4)/t)31/(t/(t*(-11)/t)tt(3/28)))(-2/9) assuming t is positive. t(1391/63) Simplify (n(-2/5))44/(n(-4/5)n*(-3))n(-2)/n4(n/(n/n(1/3)))/n(3/8) assuming n is positive. n(-2381/120) Simplify (((v/v(-2))/v(2/13))/(v(1/9)v)43)(-17) assuming v is positive. v*(89369/117) Simplify ((nn1)(-1/4)/(n(2/5))(-8))/(n*(1/3)/nn*(-12)n)38 assuming n is positive. n(13381/30) Simplify (g2/g(-4))/(g/g(-1/2))(-3)(g(g*0g)/g)*45(g/(gg/(g/((g/(g1g))/g)))g)(10/11) assuming g is positive. g(1281/22) Simplify (cc*(-2/3)c)26/(c7c(c/c*3)/c)(c(-2/3))(-2/11)/((c(c7c)/c)/(c(c(-2)/c)/c)) assuming c is positive. c(620/33) Simplify ((f/(f/(ff/(f/(ff(-3))))))(-2/39)/(((f/(f/(f4/f)))/f)/f)33)(-2/17) assuming f is positive. f(2570/663) Simplify ((((((bb(-2))/b)/b)/b)/((b/(b(-3)/b))/b))/(bbb*(3/4)b/b(-2)))/(b(-1/10)/(b*(-2/3)b))(1/13) assuming b is positive. b(-823/60) Simplify s*(-6)/sssss/(s/(s(-3/26)/s))(ss(-25))/s(-1/24) assuming s is positive. s(-9071/312) Simplify (((u/(uuu(-3)/uuuu)uu(-1))/(u2)(4/19))(-2/13))(-2/29) assuming u is positive. u(-32/7163) Simplify (j/((jjj/j(-4))/j))/j(-2)(j((j/j*2)/j)/j)/(jj*(-1/3)/j)((jjjjj*(1/6)/jj)/((j*(-5/4)j)/j))3 assuming j is positive. j(139/12) Simplify (uu(-2/21)u*23u/(u*(-3/4)/u)uu/(((uu*(-15)uu)/u)/u))(-2/71) assuming u is positive. u(-3583/2982) Simplify (k(-1/3)/(kk(7/4)))(-25)((k/(kk*1k))(-32))(-16/7) assuming k is positive. k*(-5813/84) Simplify (((w/(ww(3/2)))/w)(-13))*(-3/4)((w/((w*(-2)ww)/w))(-5/2))(-49) assuming w is positive. w(1765/8) Simplify (aa*(14/3)a/a*(-21)a*(5/13)a/a(2/33))(-23) assuming a is positive. a(-286051/429) Simplify (a(-18/11)/a(-2/45))/(a14/(a*(-19)aa)) assuming a is positive. a(-16133/495) Simplify (((p(pppp(-17)p)/pp)/((pp*(-19)p)/p))/(((p/p*16)/pp)/(p/p(-1/8))))30 assuming p is positive. p(2655/4) Simplify ((g(1/4))18)(-2/11)/((g(1/10)/(g/(g(3/2)/g)g))/(g1/g)(-3/28)) assuming g is positive. g(32/55) Simplify ((m3m*(2/9)m)/(m/m*(-4)m(2/13)))/(m(-2/13)m(1/10))(12/7) assuming m is positive. m(-491/585) Simplify ((v/(v(3/8)v))*47v*(-11/3)/vv(-14))19 assuming v is positive. v(-16549/24) Simplify k(-1/4)k/(k(((k*(1/4)/k)/k)/k)/kk)k(1/3)/k(-5/3)(k/(k/(k/k*(-9))k))/(k*(-6)/k)(k(-2))(-1) assuming k is positive. k(45/2) Simplify ((g(2/9))(-8))4g(g/g*3)/ggg/g(-4/5)g(g/g(-2/17))/gg(g/g(1/3)g)/g assuming g is positive. g*(-2698/765) Simplify cc*24c/(c*(2/57)/c)c(cc*5ccc)(1/25) assuming c is positive. c(40363/1425) Simplify (((o/(o*(-4/3)oo))/o)(-2/23)/((o(-1/8)/o)/o(-1/18)))(4/19) assuming o is positive. o(1867/7866) Simplify (((aa*(1/9)a*(-3)a)(-9))(3/8))(-2/47) assuming a is positive. a(-6/47) Simplify (z*(-4/9)/(zz/z(-3/13)))(-13)((z(2/9)/z)/z)(5/3)/(z(-2/3)z(z/(z/z(1/14))z)/zz) assuming z is positive. z(11495/378) Simplify ((o1/oo/o(-3/10))/(o(-6/7)/oo(1/18)/o))(-16) assuming o is positive. o(-20672/315) Simplify (o(-6)/oooo/o*(-7/6)(oo(o*(1/13)/o)/oo)/(o/((o(o/(o(1/5)o))/o)/oo)))47 assuming o is positive. o(-54191/390) Simplify (nn/(nn/(n/n7)))/(n(n/(n/((n/(n/(n/(n*6/n))))/nn)))/n)nn*(2/7)nn1n(n2/(n(n*(-8/3)/n)/nn))(-1/8) assuming n is positive. n(143/84) Simplify (((i/(iii*(9/5)i))/(ii(5/6)i))/(ii(-7))37)1 assuming i is positive. i(6461/30) Simplify (qq1)(13/3)/(q(-1))(5/7)(q(1/4))(-13)(qq0)(-1/31) assuming q is positive. q(15881/2604) Simplify ((w/(w12/w)w*11w/((w/(ww(-8)))/w)wwww/(w(1/3)/ww)w)(-22))23 assuming w is positive. w(506/3) Simplify (g0/g)30/((g/(g/g(-3/4)))/g(2/13))(g*(1/3)/ggg1)/(g(1/6)(g/(g/(g/g*6g)g))/gg) assuming g is positive. g*(-3577/156) Simplify ((((ii(-35))/i)/(i(-1/2)i))(-25))(7/2) assuming i is positive. i(12425/4) Simplify ((d(1/21)d)/d(-6))(-26)/((dd(-4))/d(dd/(d(-6)d))/dd8ddd*(-1/12)d) assuming d is positive. d(-16477/84) Simplify (s(4/3)/(s/(s*(-5)/s))(s(2/3))(3/43))/(s(2/9)/(s3/s))(-21) assuming s is positive. s(-1847/43) Simplify (((l/((l*28ll)/ll))/((ll/(l/(ll*(1/14)))l)/ll))(-6))*(-2/1	{ "pile_set_name": "DM Mathematics" }
lify (sqrt(1872)-1)2 + 0 + sqrt(13) + -1 + (sqrt(104) + 4sqrt(104))/sqrt(8)4 + -1. 21sqrt(13) + 1870 Simplify 6(4 + (4(sqrt(1872)-3 - sqrt(13) - sqrt(13)))2 - (sqrt(13) + (sqrt(26)-3 + sqrt(26))/sqrt(2) - sqrt(65)/(sqrt(35)/sqrt(7)))). 12sqrt(13) + 1802136 Simplify -42(sqrt(3) + 1 + -5 + (sqrt(3) - (3 + sqrt(3) + -1 + sqrt(3))2)) + (((sqrt(3) - sqrt(3)-1)-1 - -2sqrt(12))-5)2-2. -440 + 48sqrt(3) Simplify (((-2 + sqrt(2448) + sqrt(2448)2 + sqrt(2448))65 + -3)2 + -1)2. -731520sqrt(17) + 141020929 Simplify (sqrt(63)/(sqrt(21)/sqrt(7)))/(sqrt(343)-1 - sqrt(7)) - (-1sqrt(135)/sqrt(5) - ((sqrt(27))*2-4 + sqrt(27)/sqrt(144))). -108 + 25sqrt(3)/8 Simplify ((sqrt(1900)1 - -1(sqrt(19) + sqrt(19) + -1))-1)*2 - (0 + (sqrt(19) - (sqrt(2736) + 1 - sqrt(2736) - sqrt(2736))) + 2). -37sqrt(19) + 2736 Simplify (423((sqrt(288) + 3 + sqrt(288) + 0 - sqrt(288)) + 3 + sqrt(288) + sqrt(288)3))*2. 414720sqrt(2) + 4167936 Simplify -4(2(sqrt(256) - sqrt(16))-4)/(-2sqrt(648) + sqrt(80)/(-1sqrt(10)))2. -192sqrt(2)/19 Simplify (((sqrt(125) + -4 + sqrt(125))-2 - (sqrt(45) + sqrt(1125)4)/sqrt(9))5 + -4)*2 + -4. -14760sqrt(5) + 211417 Simplify (5(4 + (1 + 5(3 + sqrt(1300)-2))5))*2. -2100000sqrt(13) + 81426400 Simplify (6((-2 + -1sqrt(1539) - (sqrt(1539) + (sqrt(1539) + (sqrt(1539) - sqrt(1539)2) - sqrt(1539))-4)) + 4(sqrt(1539) - sqrt(1539)-1) + -5))*2. -9072sqrt(19) + 223380 Simplify -3 + 0 + 2 + (4(sqrt(300) + 0) - sqrt(300) - sqrt(300))2 + (((1 + sqrt(300))-4 + (sqrt(300) - (sqrt(300) + 1 + 1 - sqrt(300) - sqrt(300))))-1)2. 240sqrt(3) + 2435 Simplify 2sqrt(6)/(sqrt(144)/sqrt(12)) - ((sqrt(200) + -1sqrt(200))/sqrt(10))/(-4sqrt(40)/sqrt(4)). sqrt(2) Simplify 3 + ((-1 + (sqrt(192) - 1sqrt(192)) + sqrt(192) + 0 + 2)*2 - -4(-4(-1 + sqrt(192))2 - sqrt(192))) + 1. -2891 + 240sqrt(3) Simplify (2(sqrt(1280) + 2sqrt(1280)-2))/((5(1sqrt(100) + sqrt(100)))/(32sqrt(10))). -144sqrt(2)/5 Simplify ((-6(1 + sqrt(1008) + -2))2 - (-5 + (sqrt(1008) + 0 - sqrt(1008)) - (2(sqrt(1008)1 - sqrt(1008)) - sqrt(1008)))2)-2 + 5 + 0. -70577 + 1488sqrt(7) Simplify (sqrt(13)-2 + -3)*2-2 + (-1 + sqrt(1053) + 0)*2 + 3((3sqrt(468)1)*2 + -3). -42sqrt(13) + 13559 Simplify (6(sqrt(2736) + sqrt(2736) + sqrt(2736)2-5 + 5 + (sqrt(2736) - 1sqrt(2736)))-5 + -4)2. -887040sqrt(19) + 157617316 Simplify 0 + 5(4 + -2-1sqrt(448))-6. -480sqrt(7) - 120 Simplify (-1(sqrt(228)-2)/((-1sqrt(21))/sqrt(7)) - (-5 + -1 + sqrt(171) + -1 + -3))*2. -140sqrt(19) + 1031 Simplify (sqrt(20) + (sqrt(100)/sqrt(5) - sqrt(20))-6 + sqrt(20))/(sqrt(324)-2) + -4 + (sqrt(165)/(sqrt(3)-3 + sqrt(3)))/sqrt(11). -4 - 11sqrt(5)/18 Simplify (2 + (-6sqrt(196)/(sqrt(7) + 5sqrt(14)/sqrt(2)))/(-5sqrt(48)/sqrt(3) + 6sqrt(16)2))2 + -2. -2sqrt(7)/7 + 57/28 Simplify -4(5 + (sqrt(288) + (sqrt(288) - -4sqrt(288)-3) - (3 + sqrt(288)-2)))*2. -73744 + 1536sqrt(2) Simplify -2(sqrt(6)/((sqrt(10)-3)/sqrt(5)) - 5(-5 + sqrt(432))). -50 + 362sqrt(3)/3 Simplify -3 + (-2 + sqrt(468) + sqrt(468) + (sqrt(468)-3)2 + 4 + 3sqrt(468) - (1sqrt(468)24)2-4). 30sqrt(13) + 124019 Simplify -2 + 4(-1sqrt(1573)-3 + sqrt(1573) + (sqrt(1573) - (sqrt(1573) + -1 + 5)) + sqrt(1573))-34. -2640sqrt(13) + 190 Simplify (((sqrt(85) - (sqrt(85) - -2sqrt(85)))2 - 61sqrt(85))1)/(5sqrt(20)/(sqrt(4) + sqrt(4) + sqrt(20)/sqrt(5))-1). 6sqrt(17) Simplify ((((-4sqrt(756)2 + sqrt(756) - sqrt(756))/sqrt(12))/(sqrt(216)/sqrt(6)-5) + -3)5)2. -120sqrt(7) + 337 Simplify ((((sqrt(117) + -2 - sqrt(117)) + sqrt(117) - sqrt(117))-1 - (-2 + sqrt(117) + -5)) + ((-2sqrt(117) - sqrt(117)) + -1 + -3)-3)21. 1008sqrt(13) + 7929 Simplify ((1 + sqrt(1900))2 - ((3(sqrt(19) + 1))*2 + sqrt(19))) + 5 - ((3sqrt(190))/sqrt(10) + (sqrt(19) - 2sqrt(19))-1)*2. sqrt(19) + 1422 Simplify ((45sqrt(224))/((sqrt(1152)1 - sqrt(1152)) + sqrt(8))1)2. 11200 Simplify ((sqrt(104)1-6 - (sqrt(104) - (-2sqrt(104) - sqrt(104)))-5)-6)/(((sqrt(88)1 + sqrt(88))-1)/(sqrt(704)1)). 336sqrt(13) Simplify -6((sqrt(170) + sqrt(170) + sqrt(170) + -1(sqrt(170) + 1sqrt(170)) - sqrt(170))/(-2sqrt(360)) + -3 + sqrt(85)/sqrt(5)4 + -4). -24sqrt(17) + 42 Simplify -5 + ((sqrt(72) - sqrt(72)-1) + 0 - (-1 + sqrt(72) + 2 + sqrt(72)))2 - (6(3 + sqrt(72) + sqrt(72) + -3 + 0))*2. -10372 Simplify -3(2(-1sqrt(76))*2 - (sqrt(76) - (-4 + -1sqrt(76) - sqrt(76)))*2) - 6(sqrt(76) + sqrt(76) + 4sqrt(76))-6-5. -2016sqrt(19) + 1644 Simplify 3(-1 + sqrt(200) + 3 + (2sqrt(200) + sqrt(200))*2-4 - (-4 + sqrt(200) + (sqrt(200) + 0)*2 - (-1 + sqrt(200) + sqrt(200) + 5))). -22170 + 60sqrt(2) Simplify (-1(-1sqrt(468) + -5) + -4(sqrt(416)2)/sqrt(2))*2. -260sqrt(13) + 8813 Simplify (((2sqrt(468))/(sqrt(484) - -2sqrt(484) - sqrt(484)) + (sqrt(208) + -1 + -2 - sqrt(208)) + -3)-2)2. -144sqrt(13)/11 + 17892/121 Simplify (((sqrt(22) + (sqrt(352) - sqrt(22)))1 - sqrt(22))/((sqrt(77)-2)/sqrt(7) - sqrt(11)) - (sqrt(64)3)/(sqrt(8)3))*2. 18 Simplify ((5(-5sqrt(77)-2 - -5(sqrt(77) - (sqrt(77) + (sqrt(77) - (sqrt(77)2 + sqrt(77))) - sqrt(77)))))/(-3sqrt(11)5 + sqrt(1584)-2))2. 109375/1521 Simplify ((3sqrt(2736)-5)2 - (sqrt(2736) - (4 + 4sqrt(2736)))) + 0 + 3. 36sqrt(19) + 615607 Simplify ((1sqrt(504) + (sqrt(56) - (sqrt(56) - (sqrt(8064) - sqrt(8064)1))) + sqrt(56))/(4(sqrt(8) - sqrt(32)/sqrt(4)) + sqrt(32)-6) + -2)6. -12 - 2sqrt(7) Simplify 3 + (sqrt(208)/sqrt(4))2-3 + (sqrt(208) + -1)*2 + 1 + sqrt(117). -5sqrt(13) + 57 Simplify -1 + (sqrt(475) - ((-1 + sqrt(475))*2 - sqrt(475))-4) + (((4sqrt(190))/sqrt(10))2 - sqrt(38)/sqrt(8)). -111sqrt(19)/2 + 2207 Simplify ((sqrt(320) + -2)-5 + 2 + 4 + -3 + -1sqrt(320))*2 + -3. -1248sqrt(5) + 11686 Simplify -5(-1 + 5 + -5(-6(sqrt(252) + -1) + (1 + sqrt(252) - sqrt(252))4))*2. -1144580 + 82800sqrt(7) Simplify ((sqrt(2700) + -4sqrt(2700))-4 - ((sqrt(3) - (sqrt(30)-1)/sqrt(10)) + (5sqrt(30))/sqrt(10)))*2. 373827 Simplify 2 + -2 + (-3 + (sqrt(931) + (sqrt(931) - (1sqrt(931) + 1)) - sqrt(931)) + (1 + (2sqrt(931) - sqrt(931)) - (1sqrt(931) + -3)))*2. 0 Simplify -6((-5 + sqrt(1216)-2)2 - (2sqrt(1216)-1)2) + (2 + sqrt(1216) + sqrt(1216))-5 + sqrt(1216) + 1 + (sqrt(1216)-1)2. -1032sqrt(19) + 1057 Simplify (-24(-1 + sqrt(1053)2) + 0 + 4 + 3)2 + 1. -4320sqrt(13) + 269794 Simplify 3(sqrt(14)/(sqrt(70)/sqrt(10)) + sqrt(2) + 4) + (0 + 2 + -3sqrt(98))*2. -78sqrt(2) + 898 Simplify (5(sqrt(99) + -3 + sqrt(99))6)*2-6 + -3(((sqrt(99) + 0)2 - sqrt(99))3 + ((sqrt(99)2 + 4)2 - sqrt(99)) + sqrt(99)). -2189127 + 194283sqrt(11) Simplify -5(((4 + -1sqrt(117) - (1 + (1sqrt(117) - sqrt(117)))) + (-3 + 1sqrt(117))-6)2)*2. -123480 + 17640sqrt(13) Simplify (2 + (1sqrt(72) - sqrt(72)) + -2 + 2 + sqrt(72) - ((1sqrt(72) + -1)-2 + -1))2. 36sqrt(2) + 649 Simplify (5 + 5(-3 + sqrt(320) - sqrt(320))3 + 3(sqrt(500)4 + sqrt(500) + 5))*2. -7500sqrt(5) + 113125 Simplify sqrt(98) + 2 + (sqrt(90)/sqrt(5))/sqrt(9) + 5 + 4(5 + sqrt(2)) + -1 + sqrt(32). 16sqrt(2) + 26 Simplify 6((6(sqrt(704)-1)21 + 2(sqrt(704) - (sqrt(704) + 1))25)-1 + 0). -25404 Simplify (3sqrt(78)3 + sqrt(78)31)/((1sqrt(66)-3 - sqrt(66))/(sqrt(77)/sqrt(112)))-1. 3sqrt(13)/4 Simplify (3sqrt(1900)6 + -5 + (sqrt(1900) + 2)-5 + -5)*2 + -2. -5200sqrt(19) + 321498 Simplify -3 + (((sqrt(2) + 2)6-3 + 4)*2 - (sqrt(18)-12 - 4(0 + sqrt(18)))*2). 1021 + 1152sqrt(2) Simplify ((sqrt(152)-1)/sqrt(4) + (-4(sqrt(38) - sqrt(608) - sqrt(38)) - sqrt(38) - sqrt(38)))/(4sqrt(2)-2 - -1sqrt(2)3). -13sqrt(19)/5 Simplify (0 + sqrt(2548) - sqrt(2548) - ((sqrt(156)/sqrt(108) - sqrt(13)) + sqrt(1872) + sqrt(1872)1) - (-2 + 46(-1 + sqrt(1300))))*2. -41080sqrt(13)/3 + 8119384/9 Simplify ((sqrt(38) - -2sqrt(1368)) + sqrt(38) - (sqrt(342) - (sqrt(342)1 - sqrt(342) - sqrt(342)) - sqrt(38)))/(6sqrt(200)14). 3sqrt(19)/80 Simplify 4((5(sqrt(187) - (sqrt(187) + -5(sqrt(187) + sqrt(187)-1 + sqrt(187)) - sqrt(187))))/((sqrt(66)1 + sqrt(66))/sqrt(6)-5))*2 + 3. 615 Simplify (3(2 + sqrt(52) - sqrt(78)/(-1sqrt(6)) - (1 + ((sqrt(130) + sqrt(130) + 1sqrt(13	{ "pile_set_name": "DM Mathematics" }
y(19) is divided by 2/5 + 472/20? 23 Let j be ((-42)/(-8))/((-3)/8). Let w(f) = f*2 + 7f - 9. Let r be w(j). Let p = -42 + r. Calculate the remainder when 137 is divided by p. 43 Let p = 581 + -135. Suppose 20d - 834 - p = 0. What is the remainder when 193 is divided by d? 1 Let i = 690 - 656. Suppose 5r - 590 = -4w - 0w, 4r - 4w - 436 = 0. Calculate the remainder when r is divided by i. 12 Let d = 21420 + -21395. Calculate the remainder when 268 is divided by d. 18 Let s = 40 - 70. Let v(t) = -t*2 + 12t + 39. Let z be v(-5). Let k = s - z. What is the remainder when 27 is divided by k? 11 Let v = 11256 - 11172. Calculate the remainder when 574 is divided by v. 70 Suppose 5g - 78 = -3i, 4i - 96 = i + g. Let n be (7 - 10)14/(-6). Calculate the remainder when i is divided by ((-31)/n + 1)77/(-22). 7 Calculate the remainder when 3368/6204/136 is divided by 114. 44 Let m = -2955 + 8798. Suppose m = 5d + 1753. What is the remainder when d is divided by 82? 80 Suppose -s + 5o = -2821, 38s - 43s + 14193 = -3o. Calculate the remainder when s is divided by 158. 155 Let q be ((-300)/350)/(2/(-196)). Suppose -3s + 5b = -q, -4b + 45 = s + 17. What is the remainder when 473 is divided by s? 25 Let g = 24025 - 24008. Calculate the remainder when 89/2 - (-1)/2 is divided by g. 11 Let b = 669 - 423. Let m = 251 - b. What is the remainder when 7 is divided by m? 2 Let i = 12540 - 12451. What is the remainder when 376 is divided by i? 20 Suppose -g + 5n = -13, -9g + 7g - n + 70 = 0. What is the remainder when 3431 is divided by g? 32 Suppose -3x + 31 + 37 = 2k, 153 = 5k - x. What is the remainder when 6322 is divided by k? 29 Let r(o) = -o*3 + 9o*2 + 82o - 5. What is the remainder when r(-6) is divided by -5 + (5 - 1) + 34? 10 Suppose -3m + 13 = 2a, 5m + 19 = 4a + 4m. Let u(b) = b*2 + 6b - 19. Calculate the remainder when 102 is divided by u(a). 30 Let h be -2(-3)/((-3)/(-422)) + 5. Suppose -hq + 856q = 1078. Suppose -7f + 2f + 195 = 0. Calculate the remainder when q is divided by f. 37 Suppose 0 = -3f - f + 5w + 1529, 0 = 3f + 5w - 1173. Calculate the remainder when 1556 is divided by f. 12 Suppose 0 = 17l - 0l + 24l - 57236. What is the remainder when l is divided by 28? 24 Suppose 4v - 96 - 64 = 0. Let a = 40 - v. Suppose -4f - f + 875 = a. Calculate the remainder when f is divided by 44. 43 Let a = 26 - 22. Suppose 0 = 2i + m - 65, ai - 4m - 23 = 77. Suppose id - 37d + 77 = 0. What is the remainder when 130 is divided by d? 9 Suppose -4j - 4a = 1736, -3j + a - 415 = 891. Calculate the remainder when j/(-45) - (2/3 + -1) is divided by 8. 2 Suppose 4g = 5f - 47 - 76, -5f + g + 117 = 0. Calculate the remainder when 657 is divided by f. 13 Let a be 1232/126 + (-2)/(-9). Suppose m + 3 = -2w, 2m = 4m + 5w + a. Suppose 0 = -mv + 38 - 13. Calculate the remainder when 7 is divided by v. 2 Suppose f - 14 + 41 = -5y, -6y = -f + 72. Let v = -401 - -598. What is the remainder when v is divided by f? 17 Suppose -5m = -20 - 5. Let g = -10407 - -10489. Calculate the remainder when g is divided by m. 2 Let c(j) = -2j*2 - 57j - 65. Calculate the remainder when 1818 is divided by c(-26). 63 Let u = -970 - -975. Suppose 0 = 4k - 5v - 2411, -uk - 1055 = 4v - 4038. What is the remainder when k is divided by 20? 19 Let r(m) = m*3 + 2m*2 - 3m - 15. Let o be r(0). Let z(c) = -c*3 - 16c*2 - 17c - 13. What is the remainder when 81 is divided by z(o)? 13 Let k(q) = -q*3 + 31q*2 - 29q - 27. Let g be k(30). Calculate the remainder when 24 is divided by 42/(g/1) + 6. 4 Suppose -6309 = 124q - 23669. What is the remainder when 1683 is divided by q? 3 What is the remainder when (384/(-80))/(3/(-240)) is divided by 71? 29 Let p(u) = -14u + 8. Let f be p(-16). Suppose 4k + f = -r + 5r, 3r + 4k - 167 = 0. Calculate the remainder when r is divided by 10. 7 Suppose 0 = -4m + 137 + 43. Suppose -r = -4r - m. What is the remainder when (5/((-75)/384))/(3/r) is divided by 43? 42 Let g(d) = 2d2 + 6d + 3. Let s(y) = -20y - 11. Let m be s(-1). What is the remainder when g(m) is divided by 55? 54 Suppose 0 = -3c - 3z + 1500, -c - 2z = -6c + 2486. Suppose 0 = 2m - 0d + d - c, -4d - 758 = -3m. What is the remainder when m is divided by 23? 20 Suppose 4h - 5d = 75, -4h + d = 2d - 57. Let s be 2904/54 + (-4)/(-18). Suppose -17k + hk + s = 0. What is the remainder when k is divided by 5? 2 Suppose 9x - 34 - 20 = 0. Let u(g) = -2g2 + 16g + 6. Let y be u(8). Suppose 0 = -4n + 150 + y. Calculate the remainder when n is divided by x. 3 Let x = -83 - -115. Let q(h) = -2h*3 - 30h*2 - 47h - 15. What is the remainder when q(-14) is divided by x? 27 Let f = 418 - 261. What is the remainder when f is divided by 4? 1 Suppose -19c - 9m + 10m = -775, -c + 37 = -m. What is the remainder when c is divided by 3? 2 Suppose -3s = 3y - 321, 54s - 3y = 52s + 234. Calculate the remainder when 1235 is divided by s. 14 Let g = -1761 - -1832. Calculate the remainder when 162 is divided by g. 20 Suppose 152 = 3l + g, -3g = 4l + 35 - 241. What is the remainder when l is divided by (-212)/3183-9? 14 Let x(s) = -s3 + 63s*2 + 14s - 204. Calculate the remainder when x(63) is divided by 22. 18 Let b(c) = 84c - 1. Let x(l) = -l2 + 5l + 88. Let t be x(0). Let w = t - 59. Calculate the remainder when b(1) is divided by w. 25 Suppose -2n + 2m = -4n - 8, n - m = 4. Suppose n = -f - 14 + 16. Calculate the remainder when 134 is divided by 3 - 518/(-12) - f/12. 42 Calculate the remainder when (5988/14)/(165/770) is divided by 77. 71 Let o(z) be the second derivative of -z4/12 - 37z*3/6 + 7z*2 - 29z + 1. Calculate the remainder when o(-33) is divided by 50. 46 Let c(d) be the second derivative of 0 - 1/12d4 + 23/6d*3 - 14d + 21/2d2. What is the remainder when c(19) is divided by 20? 17 Let j = 131 - 131. Suppose -5n + 13 + 22 = j. What is the remainder when 33 is divided by n? 5 What is the remainder when 1309 is divided by 1 + (-196)/(-11) - 2340/(-12870)? 17 Suppose 3l - 30 = -3c, -l + 14 = -15c + 17c. Let b(s) = 6s + 137. Calculate the remainder when b(l) is divided by 22. 19 What is the remainder when 382 is divided by (686 + -16)(-18)/(-36)? 47 Suppose -14s + 1978 = 32. Calculate the remainder when s is divided by 36. 31 Suppose 6l + 240 = 469 + 485. Calculate the remainder when 1664 is divided by l. 117 Let j be (-1 + 3)178/(-4). Suppose -4s + 5g - 494 = 0, -49g = -54g - 10. Let c = j - s. Calculate the remainder when c is divided by 10. 7 Suppose 0 = -2t - 4q + 36, -q = -t + 2q - 7. Let k = 55 + t. Suppose -865r = -140r - 6819 - 1156. What is the remainder when k is divided by r? 8 Let v(z) = 4z2 + 4z - 22. Let r be v(6). Suppose 10j - 248 = -2x + 5j, 3j + r = x. Calculate the remainder when x is divided by 41. 11 Let a(g) be the first derivative of 171g2/2 + 20g + 53. What is the remainder when a(2) is divided by 52? 50 Let n(p) be the first derivative of p*4/4 - 4p*3/3 - 5p*2/2 - 16p + 47. Calculate the remainder when n(7) is divided by 33. 30 Suppose v + 5v = -2v. Let j be v/(0 - -1 - -1). What is the remainder when 55 is divided by j(-2)/8 - -14? 13 Let q = -100 - -109. What is the remainder when (-4563)/(-45) - q/(-15) is divided by 22? 14 What is the remainder when 80560/19 + 0/(-1) + 6 is divided by 72? 70 Let h(x) = -x3 - 11x*2 - 6x - 7. Let g = -3495 - -3500. Calculate the remainder when h(-11) is divided by g. 4 Suppose -3m + 5616 = -i, m - 396 = 5i + 1476. What is the remainder when m is divided by 468? 0 Suppose k - 448 = -x, -2x - 4k = -685 - 199. What is the remainder when x is divided by 449? 5 Suppose -3t + 172 + 230 = 0. Let x = 65330 + -65315. What is the remainder when t is divided by x? 14 Suppose 46o - 2130228 = -257o - 120o. Calculate the remainder when o is divided by 58. 48 Let z = -6 - -8. Let j be (4/8)/(4/80z). Suppose -jo - 5w = 27 - 77, -2w = 5o - 35. What is the remainder when 38 is divided by o? 3 Suppose -80c = -27315 + 2675. Calculate the remainder when 626 is divided by c. 10 Let g(r) = 74r + 181. Calculate the remainder when g(4) is divided by 80. 77 Let w(v) = -v*2 - 23	{ "pile_set_name": "DM Mathematics" }
Solve -4r + gr = i for r. 0 Let g = -8226 - -8246. Solve gs - 104 = -44 for s. 3 Let g be ((-50)/8)/(3/(-12)). Let l(k) = -k - 12. Let i be l(-7). Let c be (-155)/(g/i) - 2. Solve -c = 5o - 9 for o. -4 Let x = 4319 + -4307. Solve 10t = 4t + x for t. 2 Suppose -7 = -13f + 32. Let r be f1 + (42/(-6) - -8). Solve 0o + ro = 4 for o. 1 Let y = 13773 + -13753. Solve q + 57 = yq for q. 3 Let g(j) = j3 + 8j*2 - 10j - 6. Let y = -36 - -27. Let f be g(y). Suppose 2h + 4 = fh. Solve -z + h = z for z. 2 Let p be -111(-452 - -368). Solve -p + 66 = -6r for r. 3 Let q = 17351 - 17008. Solve -18p + q = -67p for p. -7 Let i(d) = 5d2 + 30d + 3. Let t be i(-6). Suppose to - 7o = 4, 2o = -s. Solve 2j - s = -0 for j. 1 Let y(b) = -4b3 - 15b*2 + 9b - 22. Let v be y(-5). Solve v = -8u + 10 for u. -6 Suppose -358p + 348p = -190. Solve -17g - p + 104 = 0 for g. 5 Let g be 2/8 - 97/4. Let i be ((-2)/(g/(-111)))/(1/(-4)). Suppose -6t = -i - 5. Solve -1 = -3o - t for o. -2 Let c be (0/(2 - -6))/(-3 + 5). Solve -19x + 28x - 27 = c for x. 3 Let h = -20 + -71. Let m = h - -134. Let n = -28 + m. Solve 3l + 0l - n = 0 for l. 5 Let x(r) = -728r + 734. Let l be x(1). Solve 0 = lk + 149 - 143 for k. -1 Suppose -22c + 21c + 45 = -g, 2 = -g. Solve 0 = -7s + c - 8 for s. 5 Suppose 96h - 2539 = 14h + 987. Solve -hn - 90 = 2n for n. -2 Suppose -a = -3t + 187, 0t - 2 = 2t. Let d = a - -193. Let i(l) = l - 4. Let y be i(6). Solve -d = -x + y for x. 5 Suppose -200 = 18b - 43b. Solve -80 = -24p + bp for p. 5 Let g(m) = -2m2 + 22m - 59. Let a be g(7). Let j be (-33)/a + (5 - 4). Solve -t - 2t + j = 0 for t. 4 Let o be ((1 - 0)-7)/(-1). Let c(z) = -9z - 196. Let n be c(-22). Suppose nt - 7 = -i, -11t + i = -9t + 3. Solve -o = 3f - t for f. -2 Suppose -2d + 6d = 8x + 576, -4x + 114 = d. Solve -dk = -120k - 84 for k. 6 Suppose -20 - 16 = 3w. Let g be (8 - w)1/4. Solve 0y = y + g for y. -5 Let g(h) = -38h2 + 26h + 65. Let w be g(-3). Let d = 360 + w. Solve -dj + 2 = -7j for j. -1 Let i(l) = 3l3 + 13l2 + l + 42. Let p(d) = d3 + 7d2 + 21. Let k(b) = -2i(b) + 5p(b). Let q be k(9). Solve -r = -qr for r. 0 Let l(v) = 30v + 129. Let x be l(-4). Let z = -4 + x. Solve -zc + 4 = -1 for c. 1 Suppose -2w = 3 + 5. Let s(d) = d3 + d2 - 18d - 8. Let o be s(w). Solve -ou + 19u = -3 for u. -1 Suppose 0 = -5f - k + 28, 1 = k - 2. Let t be (-231)/(-15) - (42/f + -8). Solve 4c = c + t for c. 5 Suppose 4y + u = 27 + 12, 2u + 10 = 0. Let f(o) = -3o2 + 31o + 22. Let j be f(y). Solve jn = -n for n. 0 Let u be (-3)/(-5) + 0 + (-523980)/(-3075). Solve ut = 188t for t. 0 Let q(t) = -t2 + 93t + 3259. Let u be q(-27). Solve -16g + ug - 9 = 0 for g. 3 Let s = 63 - 63. Suppose a - 13 = 2d - sd, d - 5a + 20 = 0. Let l be -181/d - 6/(-15). Solve -6 + l = k for k. -2 Let r(z) = -7z - 54. Let j be r(-8). Suppose -3a = 2a - y - 23, 2y + j = -a. Let l = -3 - -7. Solve 16 + a = ls for s. 5 Suppose 0 = -67n + 64n - 2b + 39, 3n = 3b + 9. Solve 70 = -nv + 34 for v. -4 Suppose 4n - 16 = 0, 3w = -2n - 1 + 21. Suppose -r - u - 7 = -5u, 5 = wr - 5u. Solve -11 + r = -2y for y. 3 Suppose 59y - 2981 = -326. Solve y = 2f + 35 for f. 5 Let f(b) = b*2 - 13b + 55. Suppose 3t + 5d - 4 = 0, 6 = t - 2d - 10. Let c be f(t). Solve -13n + cn = -6 for n. -3 Let q = -7463 + 7477. Solve 14v - q = -42 for v. -2 Suppose 3f + 85 - 437 = -4x, 4x - 336 = -f. Solve 23b = x - 13 for b. 3 Let j(n) = 4n2 - 39. Let t be j(-4). Solve -tg + 0 = -100 for g. 4 Suppose 6z = z + 3q + 180, -180 = -5z - 5q. Suppose -p - z = 5n - 10n, -5p = 5. Solve -nt = -12 - 2 for t. 2 Let g be 25/6 - 5/30. Suppose -33 = -j + 4n, -137 = -gj + 2n - 19. Suppose 3k = a - 17, -a = 4a - k - j. Solve -at + t = 8 for t. -2 Let j(v) = -v*2 - 340v - 4179. Let k be j(-13). Solve k = 15x - 6x for x. 8 Suppose -493c + 23820 + 12567 = -25238. Solve 28h - c = -41 for h. 3 Suppose 412 + 290 = 51b - 24b. Solve -61 + 9 = -ba for a. 2 Let d(r) = r2 - r + 1. Let c be (-2 + 0)2 + 4. Let x be d(c). Let h be (x + 0)/(15/75). Solve -hj + 2 = -8 for j. 2 Let w(v) = -40v - 1275. Let r be w(-32). Solve rz + 272 = 242 for z. -6 Suppose -26b = -23b + 225. Let h = 76 + b. Solve 4q + h = -11 for q. -3 Let y = 4 + -2. Suppose h = g - 908, -6h - g + 4560 = -11h. Let m = h - -916. Solve -yw = -3w + m for w. 3 Let s(p) = -33p2 - 643p - 27. Let u be s(-19). Solve -286 + u = -9h for h. 1 Let q(t) = -t3 + 4t*2 + 46t. Let f be q(9). Solve fy + 530 = 467 for y. -7 Let a = 14 - 11. Let n be (-12 + 12)2/(-4). Solve -a = y - n for y. -3 Suppose -2f + 5 = 1, 4m = -3f - 26. Let w be m/(-16)-6 + 4. Solve -2d + 3 = -w for d. 2 Let f be (-5)/25 - (-7436)/(-20). Let b = f + 372. Solve bu = 5u + 20 for u. -4 Suppose 0 = 21l - 56 - 28. Solve ls + 133 = -15s for s. -7 Let t be 1096/26 + 36/(-234). Suppose -v + 7v = t. Suppose 0 = vd - 21. Solve 0 = dk - 6 for k. 2 Let g be (-11)/(-2) - (-5 + (-88)/(-16)). Let r be g4/20(1 - -1). Suppose 0 = -5m - 5t, 4t - 6t = 4m - 8. Solve 2u = -ru + m for u. 1 Let a = 4 - 0. Let g(i) = -i*3 + 6i*2 - 2i + 20. Let t be g(6). Suppose -tw = -3 - 21. Solve al + 3 = wl for l. -3 Suppose 7n = 993 + 561. Let g = n + -214. Solve -m + gm = 0 for m. 0 Suppose -19156i + 19142i + 1736 = 0. Solve 47b = ib - 616 for b. 8 Suppose -4v = -3p + 78, -3v + 30 = 12. Solve 33u = -p - 32 for u. -2 Let l be 8 + -2 + -2 + 0. Suppose 0 = -r + 2a - 1, 0 = -4r + 4a + 8. Solve -9s - l = -rs for s. -1 Let h(f) = 172 - 17 - 39f + 20f + 12f. Let k be h(22). Solve -k - 5 = -2b for b. 3 Suppose 11r - 448 = 4r. Suppose -2h - r = 6. Let g = -35 - h. Solve gn = n for n. 0 Let i = 8807 - 8731. Solve i = -35d + 181 for d. 3 Let q(m) be the first derivative of -m3/3 + 3m*2 + 16m - 12. Let r be q(8). Solve rf = -2f for f. 0 Let w = -3026 - -3065. Solve -613f - w = -600f for f. -3 Let q = 689 + -497. Solve 3j - q = 35j for j. -6 Let s = -558 + 661. Solve sa - 79a - 48 = 0 for a. 2 Let z(t) = 8t + 41. Suppose 6d - 25 = -55. Let h be z(d). Solve -h - 19 = 5r for r. -4 Let t = -8237 + 8469. Solve -tz - 12 = -235z for z. 4 Suppose 34f = 38f - 3z - 21, -21 = -2f + 3z. Solve 22r - 11r - 66 = f for r. 6 Suppose 5a = 9a + 6w - 6, 0 = -2a + 2w + 28. Solve -52 = -au - 70 for u. -2 Let l(d) be the second derivative of -d5/20 + d4/2 - 2d3/3 - 7d. Let k = 4 + 1. Let r be l(k). Solve -3o = 2o - r for o. 1 Let q be 2/8 - (-405)/(-4). Let w = q - -140. Let y be (w/6 - 2) + 4/8. Solve 2a = ya - 3 for a. 1 Suppose 0 = 4l - 5l + 2. Suppose li + 11i - 26 = 0. Solve -ir = -0 - 6 for r. 3 Let q(c) = c + 7. Let v be -5 - (-2 + 0 + -3). Suppose -6y + 5y - 5z = 27, y + 3z + 19 = v. Let g be q(y). Solve g = 6b - b for b. 0 Suppose 15a - 2133 - 9081 = -6a. Solve av - 520v = -14 for v. -1 Let d = 367 - 327. Let a be ((-176)/d - -2)-5. Solve -a = -m + 7m for m. -2 Let j(u) = u*3 + 20u*2 + 61u + 38. Let i be j(-16). Let l = i - 80. Let a(y) = y*3 + 6y*2 - 7y + 3. Let c be a(-7). Solve -cx = -lx for x. 0 Let s be 14 + -6(4 + -2). Solve 0 = 3g - sg + 3 for g. -3 Suppose -135 + 35 = 2q. Let x = q - -133. Suppose -5c + x = 2n, n = c - 5c + 64. Solve -9u - c = -4u for u. -3 Suppose 3l - n - 46 = 0, -506l = -507l - 4n + 50. Solve 1280q - 1277q = -l for q. -6 Let z(b) = -3b*2 + 6b + 6. Let r be z(0). Solve r = 9q - 10q for q. -6 Let x(z) = 2z3 + 187z*2 - 97z - 168. Let a be x(-94). Solve -17w = -55w + a for w. 3 Suppose 0 = 5w + f + 175, 0 = -3w + 3f + 53 - 140. Let o be w/4-1 + (-16)/(-32). Solve 0 = -8b + b + ob for b. 0 Let h = 9 - -3. Let a = 353 - 351. Solve am + h = -m for m. -4 Let a = 12647 - 12630. Solve at - 3t = -70 for t. -5 Let m be 1/(((-4)/(-168))/(60/35)). Suppose -6z + m = 12z. Solve 0 = 4x - z for x. 1 Let v(g) = g*3 - 3g*2 + g - 21. Let n be v(5). Suppose -3q = -83 - 31. Suppose qr - 4 = nr. Solve -r = -w + 4 for w. 5 Let x = 35 - 30. Let w(f) = f*3 + 11f*2 - 14. Let j be w(-5). Suppose 3h - j + 124 = 0. Solve 15 + x = hs for s. 5 Let l(a) = 9a - 19 - 9 - 31 + 5*a. Let	{ "pile_set_name": "DM Mathematics" }
.04 (d) 81 c What is the closest to -0.04 in 5, 2/3, 1.82, -4? 2/3 What is the closest to 41/33 in 2/13, -1/2, -12? 2/13 Which is the nearest to 3? (a) 0.36 (b) -42 (c) -2 (d) 2 d What is the nearest to 0.1 in 9.9, -0.054, 1/3, 2/7? -0.054 Which is the closest to -2/5? (a) 24 (b) 0.3 (c) 0.1 (d) 15 (e) 2 c What is the closest to 0 in 2/7, -2/9, -3664? -2/9 What is the closest to 2/11 in -3/4, 17, -10, 2/9? 2/9 What is the nearest to 2/11 in -0.3, 7.32, -0.1, 0.5? -0.1 Which is the closest to -9? (a) 1870 (b) -0.1 (c) -12 c What is the nearest to -289/3 in -5, 1/4, 0.5, -1, -18.9? -18.9 Which is the nearest to 3? (a) 4 (b) -0.07 (c) 0 (d) 44 (e) -2/9 a Which is the nearest to -4? (a) -2/5 (b) -5 (c) -1 (d) -806 (e) 0.5 b What is the nearest to -1 in -2/241, 1, 3, -15, 2/3? -2/241 What is the nearest to 3 in -1.42, -1.6, 4, -2.5, 5? 4 Which is the nearest to 0.029? (a) -1 (b) 1/6 (c) -2/81 c Which is the closest to -1? (a) 0.2 (b) -0.03 (c) -5 (d) -2 (e) 7 b What is the nearest to -9 in 3, -84/17, -0.1? -84/17 Which is the nearest to 8? (a) 4 (b) 3/2 (c) -1/4 (d) -6 a What is the nearest to 0.1 in 3/16, 1/7, -80, 1/6, -1? 1/7 What is the closest to 3/50 in 3/7, -0.2, -3/7, -2/21? -2/21 Which is the nearest to -169? (a) -2/249 (b) 0.08 (c) 2/7 a Which is the closest to -0.04? (a) -1/48 (b) -2 (c) 2/5 (d) -4 a What is the nearest to 0.04 in -1, 7, -0.128, 1, 0.3? -0.128 Which is the nearest to -2/7? (a) 5/1297 (b) -0.4 (c) 5 b What is the nearest to -3 in -7, -2, -3, 6? -3 Which is the nearest to -1? (a) -3 (b) 1/2 (c) -2 (d) 65882 c Which is the nearest to -0.5? (a) 0.3 (b) -4/7 (c) -748/15 (d) 0.4 b Which is the nearest to -20? (a) 33 (b) 0.1 (c) -0.3 (d) -0.4 (e) -2/23 d What is the closest to -6 in 0, 0.14, -0.3? -0.3 Which is the closest to -1/2? (a) 2/13 (b) -0.1 (c) 4.5 (d) -2/5 d What is the nearest to 2/3 in 1/18, -19, -3, -6, -1/3? 1/18 What is the nearest to 28 in -0.5, -0.4, 0.1, -0.3464? 0.1 What is the nearest to -2/249 in -0.8, -2, 2? -0.8 Which is the nearest to 2/5? (a) -27752 (b) -4 (c) -3 (d) 0.5 d What is the nearest to -155 in -1, 6/7, -0.13? -1 Which is the nearest to -38? (a) 23/2 (b) -0.03 (c) 0 (d) -0.4 d What is the closest to 2/5 in -905, 6, 1.2, -4? 1.2 What is the nearest to 0.5 in 0.4, -6, 1, 78? 0.4 What is the nearest to 10210 in 0.3, -0.5, 0? 0.3 Which is the nearest to 4/3? (a) 2/17 (b) 0.12 (c) -0.5 (d) -1 b Which is the nearest to 499? (a) -4/3 (b) -5 (c) -227 a What is the closest to 0.1 in -4, -1/6, 2288? -1/6 What is the closest to -6 in -0.081, 274, 3/4? -0.081 Which is the nearest to -0.02? (a) -4 (b) -1/6 (c) -58 b Which is the closest to -0.1? (a) 0.5 (b) -4.7 (c) -5/4 (d) 38 a Which is the nearest to -0.3? (a) -2 (b) -335 (c) -2/11 c Which is the closest to -284? (a) -4/7 (b) 2/5 (c) 1/24 a What is the closest to -25 in -5, -2, -6, 0.58? -6 Which is the nearest to 0? (a) 0.2 (b) 3/2 (c) 1/45139 c Which is the nearest to 1? (a) -5/2 (b) 1/23 (c) 60 (d) 5 (e) 0 b What is the nearest to 2/5 in 15, -4, 1, -0.06, 3/4? 3/4 What is the nearest to 0.72 in 1/7, 75, -1.2? 1/7 What is the closest to -45 in -0.6, -1/4, -1, -8? -8 What is the closest to 1.3 in -1/2, -172, 1/2, -4/9? 1/2 Which is the closest to 301? (a) 0.4 (b) 1/51 (c) 1 (d) -0.3 c Which is the nearest to -1? (a) -4 (b) -13 (c) 117 a What is the closest to 106 in 0.4, -1, 1/13, -1/5? 0.4 Which is the closest to 0.2? (a) -0.04 (b) 1 (c) 4 (d) 0.4 (e) 0.1 e What is the closest to 2 in 0.5, 2/13, 1/13, 2/71? 0.5 What is the closest to -1 in 5, -21.097, 0.1? 0.1 What is the nearest to 1 in 0.1, 1/5, -3/5, -3/5807? 1/5 Which is the closest to -0.73? (a) 0 (b) 5 (c) 4.1 (d) -1 d What is the nearest to 65 in -81, 4, 5? 5 Which is the closest to -2? (a) -32 (b) -4 (c) 4 (d) 3/23 b What is the closest to 0.1 in -0.4, -1.3, -3/4, -0.06, 4? -0.06 What is the nearest to -29/28 in 15, -0.3, -3/4? -3/4 Which is the closest to 158? (a) 3 (b) 0 (c) -5.02 a What is the closest to -76 in -0.1, -4, -20? -20 What is the closest to 0 in 62, 5, -0.2, -134, -2/7? -0.2 What is the nearest to 1 in -19/5, 4, 1/2, 1/4? 1/2 What is the closest to -0.1 in 4, 1/4, -2/3, -3214/9? 1/4 What is the nearest to -0.1 in 0, -0.4, 13, -254? 0 Which is the nearest to 0? (a) 0 (b) 1/489 (c) -14 (d) -4/3 (e) -0.2 a What is the nearest to 0 in 0.0248, -0.3, 3, 1? 0.0248 What is the nearest to -2 in 11, 0.1968, -9? 0.1968 What is the nearest to 2.01 in -0.3, 3, 0.4, 0.34? 3 What is the closest to -0.04 in 282/17, 10, 1, 0.4? 0.4 What is the nearest to 1 in 0, -2/39, -5, 0.2, 0.05? 0.2 What is the closest to -43/5 in -0.001, 0, 1, 2/5, -0.051? -0.051 Which is the nearest to 3? (a) -2/11 (b) 3 (c) 3/14 (d) 98 (e) 5 b What is the nearest to 1 in 0, -5, 0.1, 2/53? 0.1 What is the closest to 0.2 in 1/4, 12, 5, 2, -1.4? 1/4 What is the nearest to 0.2 in -1, 0, -1/2, -9? 0 What is the closest to -14 in 0, -30, 1, 1/3? 0 Which is the closest to 77? (a) 23 (b) -2 (c) 5/7 a Which is the closest to 0.14? (a) -1/7 (b) 422 (c) -32 a What is the closest to -2.9 in 4/7, 1/2, -0.13? -0.13 Which is the closest to -1/4? (a) -4 (b) 2 (c) 5.114 b Which is the nearest to 1? (a) 2/3 (b) 0.1 (c) -6/7 (d) 3 (e) 0 a What is the nearest to 10 in 2/7, 2, 1, -62, 0? 2 What is the nearest to -2 in -1, 2/3, -43.1, -1/8? -1 What is the nearest to 0.4 in -0.6, 0, 5.1, -3, -1? 0 What is the nearest to -3 in -4, 14, 2/5, 5, 0.1? -4 What is the nearest to -1/4 in -11, -2, -0.15, 1/39, -6? -0.15 What is the nearest to -5/2 in -0.2, -13/18, 7? -13/18 Which is the closest to 0? (a) 0.0391 (b) 2/17 (c) 0.4 (d) -2 (e) -5 a Which is the nearest to -390? (a) -1 (b) -5 (c) 1 (d) 16 b What is the closest to -3/7 in -2, -3/4, 3/2, 0.2, -84? -3/4 What is the nearest to -114 in 0, 7, 15/13, 3/7? 0 Which is the nearest to 1/4? (a) 3 (b) -0.5 (c) 5 (d) -3/4 b Which is the nearest to 0.2? (a) -490 (b) 3 (c) -5 b What is the closest to 0.04 in 1.3, 1/2, -1, -10, -6? 1/2 What is the nearest to 0 in 5/2, -1, 59, -16? -1 What is the closest to 0 in 2/75, 1, -5, 12, 0.3? 2/75 What is the nearest to -2/7 in 0.18, -2, -2/17, 2/9, 119? -2/17 What is the nearest to 15 in 0.2011, -2/7, -2/23? 0.2011 What is the nearest to 396 in -1395, 5, -2? 5 Which is the nearest to -3? (a) 3/2 (b) 11014 (c) 5 (d) -5 d What is the nearest to 3/22 in -1/4, -112, 4, -6/11, 0.4? 0.4 What is the nearest to 11 in 4, 1, -4, -9? 4 Which is the closest to 1? (a) 0.41 (b) 0.06 (c) 38/3 a Which is the nearest to 0? (a) -2 (b) 94/7 (c) 2/2171 (d) 0.4 c Which is the nearest to -213? (a) 1 (b) -4 (c) -0.33 (d) -8 d Which is the nearest to 4? (a) 7/3 (b) 19 (c) -5 (d) 6 a Which is the closest to 0? (a) -3/2 (b) -4 (c) -1/2 (d) -479 c Which is the nearest to 2? (a) 3/13 (b) 10/19 (c) 4 (d) 1 d Which is the nearest to 1/4? (a) -2124 (b) 3 (c) -2/5 c Which is the closest to 22/17? (a) 2 (b) -5 (c) 2/55 a Which is the closest to 0.2? (a) 3 (b) -260 (c) -2/25 (d) 13 c Which is the closest to -7/10? (a) 0.168 (b) -2 (c) 6/35 (d) 2/9 a What is the closest to 0 in -4/127, 2, -3/5, -0.4? -4/127 Which is the nearest to 4? (a) 0.6 (b) -0.239 (c) 1 (d) -4/3 c What is the closest to -2/203 in -0.1, 27, -1/2, 0.2? -0.1 What is the closest to -50 in 1, -3/5, 2/15, 5/4, 1.3? -3/5 Which is the closest to -0.07? (a) 1 (b) 998 (c) 8 (d) 1/5 d What is the nearest to -0.1 in 1/8, 86, 3, 1? 1/8 Which is the nearest to 3? (a) 10 (b) -24 (c) -0.7 c Which is the closest to -3? (a) 3.4 (b) -186 (c) -0.3 (d) 5 c Which is the closest to 0.03077? (a) 0 (b) 3 (c) -1 a What is the closest to -2/5 in -2, -0.67, -1/5? -1/5 What is the nearest to -3 in -31, 10/3, 0.4? 0.4 Which is the nearest to 2/3? (a) -2 (b) -1 (c) -3 (d) 0.19 (e) 307.8 d What is the nearest to -0.1 in 0.1, 5, 83/210, 0? 0 Which is the nearest to 8? (a) -2/3 (b) -3.308 (c) 4 c What is the nearest to 2 in -11, 4, 5, -1/236? 4 What is the closest to 1 in -0.35, 5, -3/7, -4, -10? -0.35 Which is the closest to 1/22? (a) -0.04 (b) 1 (c) 5 (d) 0.05 (e) -5 d Which is the nearest to 15? (a) -5 (b) 5 (c) 85 b Which i	{ "pile_set_name": "DM Mathematics" }
7 - -52) - (25 - 6)? 13 Calculate 0 + -1 + -46 + 24 + (-57 - -19). -61 What is 42 + 13 + -43 + (0 - (16 - -6))? -10 Evaluate (122 - 49 - 68) + 0 + 5 + (3 - 7). 6 55 - 37 - (-31 - -15 - -24) 10 Evaluate 3 - 53 - (2 + -30 + 60 + -46). -36 0 + -12 + 0 + 59 + (-22 - -4) + 8 37 What is the value of (0 - 0) + -5 + (96 - 94) - (30 - -18)? -51 What is (1 + 0 - 9) + -7 + (-40 - (-8 - -2))? -49 What is the value of -25 + (60 - (53 - -8))? -26 What is the value of (26 - (-18 + 28)) + -33 + -12? -29 (-63 - (-5 - -2) - 0) + (-35 - -24) - -11 -60 Evaluate (17 - 25 - 4) + -2 + -42. -56 (-9 - -4 - -9) + (-3 - 4) - (-1 - -83) -85 18 + 12 + -8 + -5 + -11 + 10 - 5 11 Evaluate (36 - -53 - 215) + 84. -42 6 + (12 - 8 - 2) - (15 + -4) -3 -2119 + 2122 - (-1 + (1 - 2) + -1 + 27) -21 Evaluate (4 - (-1 + 4 - 2)) + 0 + 4 - 19. -12 (1 - 58) + (-80 - -96) + -36 + 2 -75 (-5 - (20 - -33)) + 55 -3 -2 + (2 - -1) - (126 + -128) - (0 + 35) -32 What is -83 - (-13 + 35 + -17) - (-3 + 10 - 6)? -89 What is -1 + 1 + (78 + -44 - 4)? 30 What is the value of (-22 - (-37 + 46)) + (3 - -5 - -1)? -22 (-16 - 125 - -9) + -1 + -5 -138 Calculate 10 + -59 + -69 + 136. 18 What is the value of 22 + -11 - (78 + -15) - (0 + -10)? -42 What is the value of (-107 - (-48 - -25) - 2) + 29? -57 (23 - 6) + 1 - (-134 - -108) 44 -38 + 95 - 88 - (-22 + 2) -11 What is -3 + (1 - (16 - -14)) - (15 - 2)? -45 What is the value of 1174 + -1183 + (17 - (2 - 0)) + 55? 61 100 + -67 + -95 + 67 5 (1 - (-9 + -6 + (19 - 10))) + (-3 - 0) 4 Evaluate (-131 - 7) + (-18 - (9 + -42)). -123 Evaluate 14 - ((-5 - -5) + -12 + 12) - 2. 12 -84 + 148 + -69 - (-2 - -64) -67 Evaluate 42 - 30 - (4 + -10 + -3 + 15). 6 What is the value of -948 + 964 - (1 + 1 + 0 - -5)? 9 What is the value of -1 - 4 - (238 - 235) - -4? -4 Evaluate (27 - 4) + (-32 - -23 - 9). 5 What is the value of 33 - (-53 - (-1 - 92))? -7 -1468 + 1529 - (-52 + -6) 119 What is the value of (18 - 12) + 35 + -7 + 41 + -22? 53 What is the value of (-9 - -23) + -3 - (-19 + 25)? 5 Evaluate (2 - ((5 - 3) + -21)) + 682 + -667. 36 What is the value of (0 - 0 - (-107 - -97)) + -13 + 19? 16 What is the value of -48 - (16 + 61 + -54)? -71 What is 23 - (33 - (-54 - -42))? -22 What is -47 - -162 - (-60 + 129)? 46 Evaluate 8 - 6 - (-70 + (4 - -8) - -11). 49 What is the value of -7 - -108 - (-32 - ((15 - 15) + -14))? 119 Calculate 30 + -69 - (44 - 94). 11 1 + (-15 + 6 - 3) - (-73 + 15) 47 Evaluate 120 - (-10 - (85 - 127)). 88 What is -61 - (-22 - (28 - 53))? -64 Calculate -15 + -3 + 4 + (3 - -2) + -11. -20 What is the value of 34 + 8 - (-536 - -579)? -1 Evaluate (-84 - -67) + 53 + -109. -73 What is (70 - 143) + 22 - 88? -139 -8 + 12 + 6 + (-5 - 0) - (0 + 43) -38 Evaluate 67 - (60 + -63 - (-4 - 3)). 63 Calculate 22 + -66 + -13 + 62. 5 Evaluate 1 - -45 - (-1949 + 2016). -21 59 - (15 + (-13 + 37 - 48)) 68 35 - (-27 - (-148 - -46)) -40 What is 121 + -50 + 26 + -87? 10 Calculate -122 - (191 - 254) - (19 + 1). -79 Evaluate -6 + 1 - (-44 + (75 - (45 - 12))). -3 86 + 13 + -14 + 2 + (-7 - (-2 - 2)) 84 Evaluate 15832 - 15810 - (1 - 1). 22 10 - (-16 - -38) - (-5 + 10 + 14) -31 Calculate (31 - (-13 + 94)) + 65. 15 What is 21 + (-74 - 3) + 126? 70 Calculate -50 - ((51 - 8) + -74). -19 What is the value of (6 - -41) + 27 - 42? 32 What is 56 + -12 + 67 + -57? 54 Evaluate 4 - 2 - (-104 - 39 - -101). 44 12 + 0 + 1 + -318 + 306 1 -8 - 142 - (759 - 840) -69 What is 575 - 630 - (4 - (-4 + 28))? -35 Calculate 10 - 0 - (210 + -303 + 175). -72 (-5 - -3 - -14) + (-39 + 36 - -1) - 55 -45 What is the value of (0 - 3) + -3 + ((-30 - 17) + 20 - 0)? -33 Calculate 45 + -75 - (-11 + (-6 - -5)) - -56. 38 Evaluate 2 + -39 - (13 - (215 + -111)). 54 What is the value of 12 + (101 - 72) + (-1 - 3) + (9 - 1)? 45 Calculate (-43664 - -43665) + (1 - (40 + 2)). -40 Evaluate (40 - -15 - -26) + 21 + 0 + -20. 82 Evaluate (86 - 77) + 2 + (10 - 20) + 3 + -6. -2 What is the value of 49 - (234 + (21 - 132))? -74 What is the value of 13 + -1 - (63 + -15 + (15 - 41) + 44)? -54 16 - (0 - -2) - (36 + 45 + -84) 17 Calculate 124 + -20 - 19 - (-2 - -15). 72 What is the value of -3 - (6 - (1 + 4 - 7 - -9))? -2 Calculate (-2 - (-3 - ((19 - 11) + -4))) + -73 + 14. -54 Calculate -106 + (149 - (-41 - -110)). -26 What is the value of (-4 + -3 + (-43 - -45) + 37 - -3) + 11? 46 What is the value of 1235 + -1225 + (-11 - (-3 + 4))? -2 What is -19 + 31 + -14 + (-35 - -30 - (-42 + 1))? 34 What is -11 - (-103 - -69) - (0 - 14)? 37 What is the value of 1 - 19 - (-8 + 14) - -66? 42 Evaluate (-13 - (-9 - 14) - 15) + -5 + 24 + -1. 13 What is -17 - 40 - -96 - (-17 - -1)? 55 What is the value of -11 + 29 + (-36 - -25 - 69)? -62 Calculate -43 + (1 - 0 - (117 + -122)). -37 Calculate -7 - (43 - (-40 - -18) - 25). -47 (-7 - (-88 + 83)) + 10 + 1 + 0 - 77 -68 What is 160 - (163 - -43) - (-5 - (0 + (1 - 2)))? -42 Evaluate (60 - (-4 - -15)) + (-27 - -21 - (3 - 19)). 59 Calculate (-37 - (-11 + 17)) + -64 - (-15 + -1). -91 What is the value of 12 - (-117 - -107 - ((3 - 19) + 2))? 8 Evaluate (110 - (-123 - -172)) + -184. -123 Calculate -1 - (-2 - (-3 + 2)) - (21 - (-149 + 147)). -23 What is (-152 - -193) + 2 + -36? 7 -106 + 124 - (30 + 0) - -35 23 What is -20 + 24 + -9 + -6 + 4 + 3 + -45? -49 What is (-2 + 1 - -5) + (-3 - (-27 + 6)) + -18? 4 Evaluate 23 + -2 + -74 + -7 + -11. -71 Calculate -5727 + 5553 - (-112 + 1). -63 What is 1 + (-55 - (0 + 1)) + (28341 - 28359)? -73 Calculate (-55 - (-44 - (-2 + -23))) + -2 + 2. -36 Evaluate -19 + 29 - -82 - 57. 35 Calculate -18 + 47 + -18 - 67 - ((8 - 3) + -5). -56 What is the value of -16 + 20 + 0 + (4 - (36 + 0 + -9))? -19 Evaluate 54 - 0 - (2 + 8 - (147 + -143)). 48 Calculate -11 + 36 + -18 - (30 - 7 - -43). -59 Calculate (11 - 2) + (4 - 4) - (29 - 58). 38 What is the value of -93 + 90 - 122 - -220? 95 What is -7 + 30 - 54 - -47 - 93? -77 Evaluate 55 + 94 + -255 + 112. 6 (-20 - 38) + -9 + 1 + -21 + 21 + -9 -75 Evaluate 8 + 1 - -10 - 29. -10 Evaluate 94 - (11 + -38) - 61. 60 Calculate -10 + 0 + (-48 - (69 + -122)). -5 -8 + 10 + 3 + -10 - 3 - -26 18 What is the value of -7 + -3 - ((3 - 1) + 14 + -33 + 8)? -1 What is -48 - (-1 - -35 - (40 + 1))? -41 What is 10 + (-7 - -61) - 124? -60 What is the value of -2 + 107 - (-2258 - -2287)? 76 Calculate 0 - ((-15 - -24) + 36 + (-10 + 3 - -5)). -43 What is -2 + (-25 - -11 - -35) + 8 - -4? 31 Evaluate -43 + 57 + -19 + (-2 - 4) + (53 - 1). 41 What is (-18 - (-17 - 22)) + 20 - -5? 46 Calculate 86 - (-8 - (-40 + -15)). 39 What is the value of (-1 - -22 - (3 + -3)) + -32 + -68 + 93? 14 Calculate (8 - -154 - (2 + 1)) + (-14 + -34 - -32). 143 (-7 + -3 - -4 - (-18 + 4 + 4)) + 43 47 Evaluate 43 - (11 + -2 + 5 + -27 + 22 - 4). 38 Calculate -7 - -17 - (-7 - (-54 + -7) - 1 - -4). -47 What is the value of (21 - 0 - 102) + -3? -84 Calculate 745 + -692 + (1 - 76). -22 What is the value of 28 - (-86 + 89 + 0 + 0 + 6 - 0)? 19 -107 - (30 + -115) - 89 -111 Calculate -3 + 5 + -7 + -58 + 3 + 12 + -17. -65 (-2 - -2 - -5) + (-1 - -5) + -3 + 30 36 What is -75 + 3 + -806 + 791? -87 (1 - 1) + (169 - 179 - -18) 8 -9 + 4 - (-4 + -69) - (1 + -16 + 10) 73 What is the value of 217 + -120 - 92 - (-1 - -29)? -23 Calculate 1 - 12 - (-22 + 4). 7 What is the value of 21 - ((52 - 32) + 112)? -111 What is the value of -21 - (-33 - (-11 - (26 - 44)))? 19 What is 18 - (3 + (-9 - -24) + -5)? 5 Evaluate (-1 - -2 - -36) + (-43 + (97 - 23) - 39). 29 Calculate -157 + 109 + 30 + -2 - (5 + 66). -91 What is the value of 16309 - 16322 - (-2 - (0 + 19))? 8 What is -141 - -186 - (28 + 65)? -48 What is the value of 47 - (179 + -61) - (-10 + -2 - -2)? -61 What is 21 + 20 + -69 - (0 + -64)? 36 What is the value of (45 - 18) + -24 + (-60 - (-3 + -2 + 2))? -54 Calculate -6 - (30 + (-14 - 1 - -8)). -29 (25 - 20 - -52) + (27 - 5) 79 What is the value of (-12 - 9) + -108 + 63 - 22? -88 Evaluate 18 + (2 + 12 - 140 - -34). -74 What is the value of -14 - (-55 - 11) - (-52 + 76)? 28 Evaluate 62 + -103 - -108 - 6. 61 What is (56 - (-112 + 226)) + (-2 - (1 - 2))? -59 What is the value of 13 - 42 - ((-3 - (-5 + -1) - 7) + -2)? -23 What is -32 - (4 + 31 - 25)? -42 What is the value of 59 + (43 - (58 - -41))? 3 Evaluate -32 + -23 + -44 + 0 + 17. -82 (5 - (-21 - -14)) + -9 + 14 + -11 - 58 -52 What is the value of (162 - 1) + -40 + -57? 64 What is 2592	{ "pile_set_name": "DM Mathematics" }
9, 3, 73/3, 7? 7 Which is the smallest value? (a) -1/2 (b) -263 (c) -10 (d) -0.1 (e) 14/9 b What is the second smallest value in -6, 543, -1/5? -1/5 What is the third smallest value in -2355/278, 3, -2/9? 3 What is the third smallest value in 39/46, 0.3, -2/3, 2? 39/46 What is the biggest value in 0.274, 1/3, 3/68, 0? 1/3 What is the smallest value in 2, -8, -45.1? -45.1 What is the fourth biggest value in 2/11, -10056, -0.3, 3/4? -10056 What is the fifth smallest value in -10, -0.1, 31, 3, 0.6? 31 Which is the smallest value? (a) 0.186 (b) -27101 (c) -2/3 b What is the third smallest value in 0.01, -3/2, 58/7? 58/7 Which is the second smallest value? (a) 151 (b) -5 (c) -7 (d) -3 b Which is the second biggest value? (a) -29/5 (b) 4 (c) -0.2 (d) -11 (e) 12 (f) 2/7 b Which is the third smallest value? (a) -2/9 (b) -38/11 (c) 2/3 (d) 1/5 d Which is the second smallest value? (a) -1 (b) 0.5 (c) -3 (d) -12.895 c Which is the smallest value? (a) 5 (b) -12 (c) -0.053 (d) -0.068 b Which is the third smallest value? (a) -1/2 (b) 7 (c) -0.09 (d) 1.2 (e) 0.3 (f) -3 c What is the second biggest value in 4, -6, -816, -1? -1 What is the fourth biggest value in 967, -3/10, 0, 4/7? -3/10 Which is the third biggest value? (a) 3/5 (b) -22 (c) 30 (d) -7 d What is the second biggest value in 0.06, -16/3, -5, 9/8, 0.01? 0.06 Which is the second smallest value? (a) -3 (b) 1/106 (c) -0.5 (d) -2106 a What is the third biggest value in 102, -0.8, -2.4? -2.4 Which is the biggest value? (a) -280 (b) -0.11 (c) 1 c Which is the smallest value? (a) 184 (b) -0.3 (c) 18 (d) -2 d What is the biggest value in -485, -0.4, -4.8, -4/7? -0.4 Which is the second biggest value? (a) 2 (b) 1 (c) 1.483 (d) 4 (e) 0 (f) -9 a What is the biggest value in -9, 4.4, 143/5, 0? 143/5 What is the smallest value in -3/68, -0.1, 15.4? -0.1 What is the second smallest value in 972, 0, 18/13, -0.1? 0 Which is the second smallest value? (a) 2 (b) 0.6 (c) -1.6 (d) 0.2 (e) -126 c What is the smallest value in 11, -0.2, -110/9, -3/13? -110/9 What is the biggest value in -127, 2/3, -46, 0.3, -3? 2/3 What is the fourth biggest value in -1, 29, 3, 0.01, 2.7? 0.01 What is the biggest value in -266, 0.24, -2/9? 0.24 Which is the fourth smallest value? (a) -16 (b) -4 (c) -1 (d) -25 (e) 4/3 c Which is the smallest value? (a) 13 (b) 0.3 (c) -1/5 (d) 203 (e) 2/9 (f) 0 c Which is the biggest value? (a) -2/7 (b) 6 (c) -3 (d) 2.4 (e) 7 e Which is the biggest value? (a) -0.2 (b) -62.5 (c) 10 c What is the second biggest value in -2/33, 0.14, 0, -0.3, -3? 0 Which is the fifth biggest value? (a) -0.04 (b) 1 (c) 3 (d) -1 (e) 2.5 d Which is the fifth smallest value? (a) -0.4 (b) 266 (c) 3/4 (d) -0.5 (e) 3 b Which is the fifth smallest value? (a) 0.03814 (b) 0.3 (c) -1 (d) 4 (e) 3 d What is the biggest value in 2/3, 2/115, 0.2, 2/15, 2, -157? 2 What is the smallest value in -383, 1048, -2? -383 Which is the second biggest value? (a) 3/4 (b) -127 (c) 1 (d) 0.1 (e) 51 (f) -3/2 c What is the second smallest value in -0.1, 0, -1/5, 6, 1/62618? -0.1 Which is the second biggest value? (a) 5 (b) 2/245 (c) -93 (d) 1/8 (e) 3 e Which is the second smallest value? (a) 83/2 (b) -2/7 (c) 63 a Which is the sixth biggest value? (a) 0.19 (b) -0.169 (c) -0.4 (d) -3 (e) -5/3 (f) -5 f Which is the fourth biggest value? (a) 5/6 (b) 0.4 (c) -4/3 (d) -3231/2 d What is the fourth smallest value in 0, -2, 20, 11, -2/11, -2/3? 0 What is the second smallest value in 2322, -3/4, -3? -3/4 Which is the third smallest value? (a) 3 (b) -1/8 (c) -1/3 (d) 1/4 (e) 126 (f) 84.8 d What is the fifth biggest value in -0.4, 0.2, -0.041, -15, -2, -28/9? -28/9 Which is the third smallest value? (a) 0 (b) 0.5 (c) 50333 c What is the third biggest value in 2, -58/5, -2/9, 0, -8? -2/9 What is the sixth biggest value in 59, -1.7, 0.3, -7/2, -8, 2? -8 What is the biggest value in -0.063, 5/2, 2, -2/13, 11/3? 11/3 Which is the biggest value? (a) -2 (b) 4/21 (c) -5 (d) 1474 d What is the third biggest value in 0.2, -11, -1, -18, 11/4, -3.3? -1 What is the third biggest value in 10, -0.1, 3, 2/3, -26, -5? 2/3 Which is the third smallest value? (a) -3 (b) -5 (c) 1 (d) -1/3 (e) -10/2047 d Which is the fourth smallest value? (a) 3 (b) 2 (c) 5 (d) -0.18 (e) -2 (f) 2/17 b Which is the third smallest value? (a) -4/7 (b) 4 (c) -0.03 (d) -0.5 (e) -7.9 (f) 0.2 d Which is the fourth biggest value? (a) 2 (b) -1 (c) 1/5 (d) 8 (e) -251 b What is the second smallest value in 212, -2, -3, 0.2, 9, 4/7? -2 Which is the third smallest value? (a) -8.375 (b) -3 (c) -4/13 c What is the fourth biggest value in 2/9, 0.9, -3/7, -32? -32 Which is the fourth smallest value? (a) -14 (b) 1.8 (c) 0 (d) -8 b Which is the smallest value? (a) 2/5 (b) 0.05 (c) -0.1 c Which is the second smallest value? (a) 54 (b) 3/5 (c) -26 b What is the second biggest value in 2/9, 0.1, 20, 0.44, 4? 4 What is the third biggest value in 0.3, -2/3, 0.485, -7? -2/3 What is the second biggest value in -0.7, -0.5, 1/356? -0.5 What is the second smallest value in 101.84, 3, -6, -1/2? -1/2 Which is the third smallest value? (a) 0.3 (b) 2/16593 (c) 2/9 a Which is the biggest value? (a) 440.94 (b) -2/7 (c) -2/11 a What is the fourth smallest value in -61.2, -5, -9, -3, 9? -3 Which is the fourth biggest value? (a) -6 (b) 0 (c) 2/3 (d) -174 d Which is the third biggest value? (a) -79 (b) -0.39 (c) 2 a Which is the smallest value? (a) -0.04 (b) 537 (c) 3/4 (d) 4 a What is the biggest value in -5, 13.689, 8, 1? 13.689 What is the second biggest value in 1.5, 0, 1, 540/19? 1.5 What is the fifth smallest value in 3, 29435, -4, 0.5, -7? 29435 Which is the second smallest value? (a) -3/5 (b) 4 (c) -1 (d) -5 (e) 62 c Which is the second smallest value? (a) 4/7 (b) -3 (c) 19.14 (d) 2/11 d What is the second biggest value in 0, -48/25, 0.2? 0 Which is the third biggest value? (a) 4 (b) -0.3 (c) 0.1 (d) -7/2365 d What is the second biggest value in -1/199, -0.3, 1/20? -1/199 What is the smallest value in -3, 2, -0.002? -3 What is the third biggest value in -0.055, -0.184, -5? -5 Which is the smallest value? (a) -0.2 (b) 1/10284 (c) -88 c Which is the smallest value? (a) 3/4 (b) 14/19 (c) 2 (d) 0 (e) -1 e What is the third biggest value in -439, 19, 0.5? -439 What is the fourth biggest value in -13, -27, -3, -3/4, -2/3? -13 What is the biggest value in 37, 23, -8, 1/3? 37 What is the biggest value in 5, 1505, 2/11, 0.3? 1505 Which is the fourth smallest value? (a) -2/11 (b) 965 (c) -1/9 (d) 2 b Which is the second biggest value? (a) -0.4 (b) 2/15 (c) 3.91 (d) 110 c What is the fifth smallest value in 4.9, 1/8, -0.3, 1/7, 0.6807? 4.9 Which is the biggest value? (a) -0.1108 (b) -3 (c) 104 c Which is the second biggest value? (a) 568/25 (b) 3 (c) -0.3 b What is the third smallest value in -1/4, 2, -7.456? 2 Which is the smallest value? (a) 0.7 (b) -17/4 (c) -0.1 (d) -2/27 b Which is the third biggest value? (a) 0.4 (b) -550 (c) 56 b What is the fourth biggest value in 0.1, 0.4, -1.03, -3/4, -145? -1.03 What is the second biggest value in 4, -5, 9, 5, -12/7? 5 What is the biggest value in -1/5, -1.71, -0.4, -8? -1/5 What is the third smallest value in 0, 99, -9, 70? 70 What is the second smallest value in -2, 0.06, 491? 0.06 Which is the third smallest value? (a) -15300 (b) -3/7 (c) -0.5 b Which is the second biggest value? (a) 3 (b) 1 (c) -0.2 (d) 5/2 (e) -47 d What is the fourth smallest value in -0.2, 1.5, -2/9, -0.1, 31/3, -3? -0.1 Which is the fourth biggest value? (a) 10 (b) 1/3 (c) 7 (d) 4/7 (e) -8 b What is the second smallest value in -6638, 3, 1/4? 1/4 Which is the second smallest value? (a) -1 (b) 2 (c) -2/19 (d) -7 a What is the biggest value in -1/12, 0.5, 3/14, 14/13, -0.3? 14/13 Which is the second biggest value? (a) -0.7 (b) -693 (c) 0 a What is the third smallest value in 2, -2/643, 2/3, -0.39? 2/3 Which is the second biggest value? (a) -22/7 (b) -3 (c) 4 (d) -3.1 (e) 0.5 (f) 5 c Which is the fourth smallest value? (a) 2/13 (b) 9/23 (c) 1.7 (d) 2/9 (e) -4 b What is	{ "pile_set_name": "DM Mathematics" }
+ 3g = kw - 629. What is the tens digit of w? 1 Let w(o) = o*2 + 5o - 12. Let n be w(-7). Suppose ny - 200 = -2y. What is the tens digit of y? 5 Suppose 0 = -m - 3m + 3f - 15, 0 = m - 3f + 6. Let r(j) = 13j*2 + 6j - 3. What is the tens digit of r(m)? 9 Suppose x = -3x. Suppose t - 69 = -xt. What is the tens digit of t? 6 Let l be (18/3)/((-24)/(-176)). Suppose 0 = -3q - s + 177 - l, 5q - 220 = -2s. What is the units digit of q? 6 Let h = -331 + 576. What is the hundreds digit of h? 2 Suppose -4k + 7s + 1946 = 5s, -k + 494 = s. Suppose -3q - 5o = -o - 482, 3q = 3o + k. What is the tens digit of q? 6 Let f(t) = -14t + 62. Let u(s) = 9s - 41. Let l(b) = -5f(b) - 8u(b). Let x be l(9). Suppose x + 2 = 2h + 3a, 12 = 2h - 2a. What is the units digit of h? 4 Let l be (14/(-7))/((-2)/143). Let k = l + -32. What is the tens digit of k? 1 Suppose 0 = 2l - 3 - 5. Suppose 3h - 2 - l = 0. Suppose -3w - hc = -57, 2w - 52 + 14 = 3c. What is the tens digit of w? 1 Suppose 0 = -7y + 4y + 15. Suppose yo - 217 = -2n, -o + 3 = 4n - 422. What is the tens digit of n? 0 Suppose 5m - 2u = 3u + 80, 2u - 2 = 0. Suppose mc = 3c + 3430. What is the hundreds digit of c? 2 Let c be -3 + (-16)/(-6) + (-8)/(-6). What is the units digit of 2/((-8)/(-356))c? 9 Let g be 1331/(-33) - (-2)/(-3). Let j = g - -46. What is the units digit of j? 5 Let m = -7451 - -11618. What is the hundreds digit of m? 1 What is the units digit of -64 + 69 + 340/(2 + 0)? 5 Let i = 1562 - -2121. What is the thousands digit of i? 3 Let n = 16 + -8. Suppose 4o - 604 = 3q, -4 = 3q + n. Suppose -o = -8c + 4c. What is the tens digit of c? 3 Let n(s) = -s3 - 8s*2 - 4s - 9. Let i be n(-8). Suppose 57 = -5g - i. What is the units digit of g/(-24) + (-2)/(-6)? 1 What is the hundreds digit of (-1)/5 + 3927/35 + 9? 1 Let f = -41 - -47. Let t(c) = 14c*2 - 50c + 9. What is the hundreds digit of t(f)? 2 Let q be (11/5)/(17/85). Let d = 129 + q. What is the tens digit of d? 4 Let l be -2((-30)/(-4) + -1). Let z = 10 + l. What is the tens digit of 3 + (0 - (z + -17))? 2 Suppose -448 = -2s + 102. What is the tens digit of s? 7 Suppose 5k + 8 = -4n - 7, 4n + k = -3. Suppose n = i - 4 - 1. Suppose -1 - 3 = -3y - ih, h = 2y - 7. What is the units digit of y? 3 Suppose 4q - 620 + 36 = 0. Suppose 5b = -4a + 194, 3a + 2a = 3b - q. Let g = b - 13. What is the tens digit of g? 2 Let l(n) = -6n + 7. Let b(a) = -2a*2 + 13a - 1. Let z be b(7). What is the tens digit of l(z)? 5 Suppose 5j = -13 + 183. Let g = j - 29. Suppose -3l + 90 = 3v, 0 = -0v + gv + l - 162. What is the tens digit of v? 3 Let a = -10 - -17. Suppose -4m = -am + 270. What is the units digit of m? 0 Let s = -51 - -52. What is the units digit of (0/3 - 9)(s - 4)? 7 Suppose 5a - 3x = -12, a + x - 12 = -2x. Suppose a = h - 2 - 1. Suppose -4y + 5q = -232, hy - 6q - 171 = -3q. What is the units digit of y? 3 Let c(w) = 9w - 23. Let q(d) = -13d + 34. Let k(j) = -7c(j) - 5q(j). Let a be k(4). What is the units digit of 5 - 0 - (a - 1)? 7 What is the units digit of 2 + (608 - (-60)/10)? 6 Let r be (-1 - 1) + (-4)/1. Let b(n) = -n*2 - 7n + 3. Let p be b(r). Suppose -4j + pj = 20. What is the units digit of j? 4 Suppose -14c = -27c + 2782. What is the tens digit of c? 1 Let x(a) = 11 - 5 + 2a2 + 15 - 9a. What is the units digit of x(4)? 7 Let l(p) = -2p3 - 3p*2 - 2p - 2. Let h be l(-3). Let n = -22 + h. What is the units digit of n? 9 Suppose -4x + k + 10002 = 0, 0 = 2x - 5k - 2717 - 2293. What is the thousands digit of x? 2 What is the units digit of (-3)/(-6 + (-9191)/(-1533))? 7 Let u(l) = l - 1. Let p(f) = -4f - 6. Let s(a) = -p(a) - 6u(a). Suppose -12 = 2y - k, k + 3 = -4y - 15. What is the units digit of s(y)? 2 Let w = -1511 - -2297. What is the units digit of w? 6 Suppose 0 = -0d - 38d + 3116. What is the units digit of d? 2 Let j(k) = 1785k*2 + 9k + 10. What is the units digit of j(-1)? 6 Let r be ((-4)/(-2))/(-61/(-2049)). Suppose 0 = 3w - h - r, 0w = -3w + 2h + 679. What is the hundreds digit of w? 2 Suppose -g + 2174 = 3k + 632, -5k - 2g = -2569. What is the hundreds digit of k? 5 Suppose d + 12 = 2w, 4w + 0d - d = 24. Let z be (6/9)/(1/w). Suppose -63 = -7n + zn. What is the units digit of n? 1 Suppose s = 245 + 99. What is the units digit of s? 4 Suppose 4951 = 3v - 5a, -a + 6a = -v + 1657. What is the tens digit of v? 5 Let d be (-4)/14 - (-58)/7. Suppose -498 = dc - 14c. What is the units digit of c? 3 What is the units digit of (-18)/12(0 - (-844)/(-6))? 1 Let h = 29 + -49. Let c = h + 25. Suppose ca = 13 + 92. What is the tens digit of a? 2 Suppose -28 = -5q - 3n, 3n + 2 = q - 0n. Suppose qz = -0z + 165. Suppose 3h - 159 = -z. What is the units digit of h? 2 Let s(p) be the third derivative of p3 + 0 - 5/12p*4 + 1/30p*5 + 0p + 5p2. What is the tens digit of s(6)? 1 Suppose 3u = 6u - 3, 0 = -k + u + 3223. What is the tens digit of k? 2 Let k = 109 + 1096. What is the thousands digit of k? 1 Let h(d) = -15d - 5. Suppose -v - 5 = -3m - 13, m - 2 = -2v. What is the tens digit of h(m)? 2 Suppose 11000 = 5q + 4g + 1247, -4g = 4q - 7804. Suppose 14t = -409 + q. What is the units digit of t? 0 What is the units digit of 13 - 1 - 2297/(-1)? 9 Suppose 2x = -5c + 15, 13x + 2c = 10x + 39. What is the tens digit of x? 1 Let j = -526 - -737. Suppose -5a + 139 + j = 0. What is the units digit of a? 0 Let s = 2 + -4. Let j be (-2 + (1 - -1))/s. Suppose j = -5k + 2k + 84. What is the units digit of k? 8 Suppose 41q - 9162 = 35q. What is the hundreds digit of q? 5 Let k(y) = -2y*2 + y. Let m be k(0). Suppose m = b + t - 108, -4b - 3t + 8t = -387. What is the units digit of b? 3 Let l(n) = 38n - 45. Let c(w) = 19w - 22. Let f(u) = -5c(u) + 3l(u). What is the units digit of f(7)? 8 What is the units digit of (-1816)/(-12)(-30)/(-4)? 5 Let n = -136 - -127. What is the tens digit of n/2 + 3 - (-845)/10? 8 Let o(b) = 2b*2 - 2b + 269. Let u(m) = m*3 + 2m*2 + 2m + 1. Let d be u(-1). What is the hundreds digit of o(d)? 2 Let f be 4/(1/10-4). What is the units digit of (-10)/((-5)/(f/(-4)))? 5 Let w = 11 - -5. What is the tens digit of 1/(-2(-4)/w) + 129? 3 Let y = 1677 + -578. What is the tens digit of y? 9 Let r(g) = 85g2 - 5. What is the units digit of r(5)? 0 Suppose 4j + 5m - 39 = -0j, -4j + 4m + 12 = 0. Let z be j/8 - 6/8. Suppose 2b - 22 = -zb. What is the units digit of b? 1 Suppose 3u = -j - 2j + 42, j - 3u = 14. Let g(v) be the first derivative of -v2/2 + 22v + 10. What is the units digit of g(j)? 8 Let k(s) = s*3 + 5s*2 - 6. Let l be k(-5). What is the units digit of l/(-4)2256/72? 7 Let l(s) be the third derivative of -s7/2520 + s6/80 + 7s5/60 + s2. Let x(h) be the third derivative of l(h). What is the units digit of x(-8)? 5 Let c be 2 + -2 + 1 - -3. Suppose ch = 3 - 11. What is the units digit of 2/(h2/(-20))? 0 Let f be (-16)/(-10)(-2)/12-15. What is the hundreds digit of (111 - f) + 4/2? 1 Let z be 15(-16)/(-12) + -3. Let y = z + -11. Suppose c - 4s = -2, s + 1 = y. What is the tens digit of c? 1 Suppose 4f - 2t - 910 - 136 = 0, -3t + 1031 = 4f. What is the units digit of f? 0 Suppose -38r + 42r = 308. Suppose 3z = 106 + r. What is the tens digit of z? 6 Let a be ((-6)/7)/((-12)/56). Suppose 0 = ac - c - 6. Suppose -ci + 55 = 3h - 76, -220 = -5h - 3i. What is the tens digit of h? 4 Suppose 0 = 4f - 3d + 35, -f - 2d - 8 = -3d. Let q(t) = t2 + 10t - 8. Let b be q(f). Suppose bp = 24 + 72. What is the tens digit of p? 3 Let y(l) = 12l - 3. Let f(s) = -25s + 7. Let q(h) = 3f(h) + 7y(h). What is the units digit of q(6)? 4 Let s = 269 - 147. Let a = 288 - s. What is the units digit of a? 6 Let n = -14 + -2. What is the units digit of (4 - 20/n)8? 2 Let j = 244 + 1098. What is the tens digit of j? 4 Suppose 8 = 4j - 0. Let u be j + -46 + 0/(-4). Let t = 68 + u. What is the units digit of t? 4 Let t be 96(-15)/(-6). Let l = -86 + t. What is the tens digit of l? 4 Suppose -139 - 232 = -i. What is the tens digit of i? 7 Let u = -2 - -6. Suppose -317 = -uv + 103. Let x = v - 69. What is the units digit of	{ "pile_set_name": "DM Mathematics" }
4). Let h be (-4)/14 - c/7. Suppose h = -n + v + 15 - 2, -5v = 2n - 5. Is n a multiple of 10? True Let w = 30 - -75. Suppose 2f + 3f = w. Suppose 2p + 2p - x = 27, 0 = 3p - x - f. Is 6 a factor of p? True Let n be 1225/28 - (-2)/8. Suppose 4b - n = -y, -2y = b - 32 - 56. Does 13 divide y? False Suppose -3o + z + 137 = -z, o - 3z = 48. Is 1/2 - o/(-10) even? False Let d(o) be the first derivative of o6/180 + o5/120 + o4/24 - 2o*3/3 + 2. Let i(j) be the third derivative of d(j). Is i(-3) a multiple of 8? True Suppose 0 = 6h - h - 145. Suppose 2n = 4, -c + 13 = -5n + 37. Let y = h + c. Does 15 divide y? True Suppose 0o = -3o. Let w(z) = -z + 4. Is w(o) even? True Suppose -2z = -2 + 14. Let f(y) = -y + 1. Let w be f(z). Suppose -2 = -3j + w. Is j a multiple of 3? True Let v(c) = -7c2 + 2c + 2. Let f be v(2). Let g = f + 59. Is g a multiple of 7? False Let h = -29 - -54. Suppose -h = -u + 1. Is 6 a factor of u? False Suppose -3i + u + 0u + 4 = 0, 4i + 4 = -u. Let m(x) = x2 + x + 49. Does 21 divide m(i)? False Is (-6300)/(-198) + 2/11 a multiple of 16? True Let r(f) = -2f - 2. Let s be r(-1). Suppose -3z - 2z - 2q + 65 = s, 3q = -z + 13. Is 6 a factor of z? False Let b be -1 + (11 - 2) + -4. Suppose -3u = 4c - 238, -bu = 6 + 2. Is c a multiple of 12? False Suppose 92 = -k + 3k. Is k a multiple of 17? False Let x(k) = -25k3 - 3k*2 - k + 1. Does 4 divide x(-1)? True Suppose 7l = 3l + 5p + 32, 5l = -5p - 5. Suppose lu = -0u. Suppose -4m - 20 = u, 4m - 1 = 4k - 77. Is 14 a factor of k? True Let m(g) = g3 - 9g2 + g - 6. Let o = -2 - -11. Let n be m(o). Does 13 divide (-1)/(n/(-60)) - 0? False Let q(b) be the first derivative of b2/2 + 5b - 8. Is q(-3) even? True Let i(h) = -2h - 7. Let l(q) = -3q - 11. Let u(v) = 8i(v) - 5l(v). Let c be u(-3). Suppose s + 3s + 6 = 2j, cs = 0. Is 3 a factor of j? True Suppose 0b - b = -3k + 22, -2k + 43 = 5b. Suppose -210 = -kc + 4c. Does 14 divide c? True Suppose 4n - 23 - 233 = 0. Does 20 divide n? False Suppose k + 5 = -4y + 6k, -5 = -2y + k. Suppose -yz + 287 = 107. Is z a multiple of 18? True Let f(s) = 7s*2 - 2s - 4. Let o be 2/(5/(-2) + 3). Is 25 a factor of f(o)? True Suppose 5u - 11 = 3u - 5o, 5o = 5. Suppose -d = -4d - u. Is 24((-3)/6 - d) a multiple of 12? True Let b = 199 - 45. Is b a multiple of 27? False Suppose -1676 = -7q + 130. Is 43 a factor of q? True Let y be -2 - -3 - (-4)/2. Suppose -5 = 2a + y. Is 10 a factor of a/(-18) + (-428)/(-18)? False Let a = -17 + -31. Is 5 a factor of a/(0 - 4) + -2? True Let x = 25 + -18. Let m be 2/x - (-141)/21. Suppose 5l = -mp + 2p + 65, 5p = -l + 45. Is p a multiple of 8? True Let q be 6/1 + -3 + -3. Suppose -2d + 5d - 51 = q. Is 6 a factor of (d/(-2) + -3)-2? False Suppose 2g = g. Suppose 0u + 8 = 2u. Suppose -2m - ux + 54 = 0, 2m + 0m - 2x - 54 = g. Does 15 divide m? False Let k(o) be the third derivative of -2o*2 + 0 + 1/8o*4 - 5/6o*3 + 0o. Is k(6) a multiple of 13? True Let i = 30 - -9. Does 10 divide i? False Let g(m) be the third derivative of 3m4/4 + m3/6 + 3m*2. Does 17 divide g(1)? False Let y be (-1 - 2)/(0 - 1). Suppose -2l = -yl + 27. Is l a multiple of 9? True Let s be 9/(-3) + 13. Let c(g) = -g*2 + 3. Is c(s) a multiple of 2? False Suppose 5g + 2f = 69, -3g - f = -3f - 51. Is 15 a factor of g? True Let t = 3 - 15. Is (27/t)/(3/(-56)) a multiple of 21? True Let a be (-78)/(-8) + (-1)/(-4). Let p(r) be the first derivative of r4/4 - 3r*3 - 2r*2 - 10r + 2. Does 25 divide p(a)? True Suppose -7 = -w - 2f - 2, -2f = -2w + 10. Let j be w + (0/(-3))/2. Suppose 3b + 20 = jb. Is 4 a factor of b? False Suppose -48 = 52h - 56h. Does 12 divide h? True Suppose 3c - 16 = -c. Suppose 2i = i + 2l + 40, 3i + cl - 110 = 0. Is 11 a factor of i? False Let f = 17 - 12. Suppose -4h + f = -3. Suppose hw + 3w = 70. Does 14 divide w? True Let q = 35 + -5. Is (45/(-2))/(q/(-40)) a multiple of 15? True Let t(u) = -u - 1. Let m be t(-3). Suppose -4x + 99 = 5f, mf - 11 + 89 = 4x. Let k = -8 + x. Is 8 a factor of k? False Does 4 divide 140/(-6)(-33)/22? False Let c be 4/6 + (-20)/(-15). Suppose -cm = -3m + 9. Does 8 divide 6/484/m? False Suppose 2t - 329 = -119. Let u = t - 48. Let m = u - 40. Does 17 divide m? True Let q(k) = 7k - 4. Let b be q(3). Let n = -10 + b. Does 2 divide n + (-5 - -1) + 2? False Let i(m) = -3m + 2. Let t be i(4). Let c(d) = -d + 2. Is c(t) a multiple of 3? True Let g = -6 + 8. Suppose i - 4i + x = -26, -3i = gx - 11. Is i a multiple of 3? False Is -2 + 3 + -4 + 69 a multiple of 22? True Suppose 0 = 4w - w - 48. Suppose -w - 4 = -4n. Suppose na + 2q - 3q - 140 = 0, -a + 28 = 4q. Does 14 divide a? True Suppose 11y - 7y = 216. Does 7 divide y? False Let f be (12/30)/((-2)/(-230)). Suppose 3m = f + 80. Is 14 a factor of m? True Let p(n) = -5n3 - 3n*2 + 3n + 6. Does 23 divide p(-4)? False Suppose -49 = 2p + 5w - 143, -4w - 160 = -4p. Is 7 a factor of p? True Let r = -9 + 13. Let q = -4 + r. Does 3 divide 10/2 + (-1 - q)? False Let l(s) = -46s - 2. Suppose k - 15 = -5b, b + 5k = -0k + 27. Let h be l(b). Is 12 a factor of (-1)/(3/(h - 2))? False Suppose -6 = y - 19. Is 13 a factor of y? True Suppose 3p = -2p + 15, a + p - 27 = 0. Is a a multiple of 8? True Suppose 0h - 5h + 2g - 10 = 0, 0 = -3h + 2g - 6. Let t = 3 - h. Is t a multiple of 2? False Suppose 15u = 1401 + 2514. Does 13 divide u? False Suppose -2s = -9s + 70. Does 5 divide s? True Let l(x) = -10x + 8. Is 12 a factor of l(-4)? True Let m(v) = 3v*2 - 3. Suppose 0 - 15 = 5l. Is 16 a factor of m(l)? False Let i(y) = 7y2 - 2y. Suppose -6 = -3k - 0. Let h be i(k). Does 7 divide (-3 + h)6/9? True Suppose n = -0n + 1. Suppose -5d + 30 = -5. Let z = d + n. Is 4 a factor of z? True Suppose -x + 3x + 24 = 0. Let k be (28/(-6))/(4/x). Suppose k = -d + 33. Is d a multiple of 19? True Suppose 11p - 81 = 6p - 3h, 5p - h - 73 = 0. Let y = p - -9. Does 12 divide y? True Let w(f) = 4f - 1. Let u be w(1). Suppose 0 = uy + 2z - 25, 0 - 15 = -3z. Suppose -yk - 3l + 147 = -0l, -4 = 4l. Does 10 divide k? True Let a(o) = o2 - 2o + 3. Let x(w) = -w + 5. Let j be x(8). Does 9 divide a(j)? True Let f = -17 + 64. Suppose 5a = 23 + 122. Let g = f - a. Does 12 divide g? False Let z(n) be the second derivative of n6/360 - 7n5/120 + n4/6 - n*3/3 + n. Let m(o) be the second derivative of z(o). Is 2 a factor of m(7)? True Suppose 5n = -2r + 23 - 117, -5r - 5n = 235. Let g = r + 78. Is g a multiple of 16? False Let k = 56 - -2. Does 21 divide k? False Let r = 540 - 40. Is 14 a factor of (-18)/(-81) - r/(-18)? True Suppose 0 = -2w + 3w - a - 20, -3w + 55 = -2a. Is 3 a factor of w? True Let o be 0 + 1 - -54. Suppose 0 = -3y + 72 - o. Is y a multiple of 7? False Suppose -14k + 936 = -1346. Does 23 divide k? False Let x be ((-8)/(-20))/((-1)/(-10)). Suppose -3t + x = 7, 3 = h + t. Suppose 2o - 3o - hd + 42 = 0, -3o = 4d - 94. Is o a multiple of 19? False Let r(w) = -5w - 1. Let p(u) = 10u + 2. Let i(x) = 2p(x) + 5r(x). Is i(-1) a multiple of 2? True Let b(y) = 5y - 9. Let x be b(9). Suppose 3l - 33 = -4u - 0u, x = 2l - 2u. Is 7 a factor of l/3 - (-4)/2? True Let m be 1 - 0 - (-4 - 103). Does 11 divide 2/5 + m/5? True Let a be 1/2 - 2/4. Suppose -166 - 384 = -5c - 5w, a = -3c - 2w + 332. Suppose -3t + c = t. Is t a multiple of 14? True Let t = 131 + 44. Is t a multiple of 35? True Suppose -290 - 1294 = -6m. Is 37 a factor of m? False Let u = -5 + 5. Suppose -4z + 2h + 42 = u, 3h = 8h + 25. Does 4 divide z? True Suppose -4r + 284 = -28. Let a = r - 54. Is 8 a factor of a? True Is 4 a factor of 4/366/168? True Let x = 76 - 44. Is 32 a factor of x? True Let v(i) = -i2 - 6i. Suppose 3s = -2s + 30. Suppose k - sk = 20. Is v(k) a multiple of 8? True Let a = 140 - -28. Is a a multiple of 42? True Let i be 70/(-21)(-12)/10. Let j be (405/(-6))/(i/(-8)). Suppose -3y = 4k - 55 - 55, -3k = 4y - j. Is 10 a factor of y? True Is 64 a factor of -2 + (-1305)/(-10) - 1/2? True Let y(w) = -4w - 12. Does 13 divide y(-8)? False Suppose -i - 2o + 5 = -5o, 2i = -3*o + 28.	{ "pile_set_name": "DM Mathematics" }
, 2a + vc = -6. Let h(i) = 6i2 + 3i + 4. Is h(a) composite? True Is -139223((-171)/21 - -8) prime? True Suppose -27 = -4h - 5n, -4n + 19 - 1 = 2h. Suppose ht + m - 2234 = 0, 2t - 5m = -0t + 1495. Is t a prime number? False Suppose -6l = -8l + 10594. Is l a composite number? False Suppose -4b = 145 - 2061. Is b prime? True Let n be (-1811)/(-2) - (-6)/(-36)-3. Let j = 737 + n. Is j a composite number? True Let w be 2772 + (-1 - 0)/1. Suppose -g = 4h - 2g, 4h = -g. Suppose y + 3l - 562 = 0, w = 5y + 2l - hl. Is y a prime number? False Is 24170/4 + (5/(-10))/(-1) a prime number? True Let y(m) = -m*3 - 19m*2 + m + 137. Is y(-30) a prime number? True Suppose -10 = -2i + u, i - u = 3u + 12. Suppose -if = f. Is (396/4 - 4) + f a prime number? False Suppose -2753 = -6h - 191. Is h prime? False Suppose -4g = 3689 - 9553. Let y = -997 + g. Is y prime? False Let w(x) = 621x + 1. Let v(a) = -2a*2 + 4a + 2. Let d be v(2). Is w(d) prime? False Let z(w) = -2w + 41. Let g be z(18). Suppose gl - 26305 = -5q, 3q - 33544 + 7239 = -5l. Is l a prime number? True Let f(o) = 2o*2 + 49o + 106. Is f(56) prime? False Let b(h) = h*2 - 29h + 877. Is b(0) a composite number? False Let q = -6 - -2. Let k(s) = 6s2 - 3s2 - 1 - s3 - 6s2 - s. Is k(q) prime? True Suppose 0 = 5k + 15, k + 1152 = 2h + 3k. Is h prime? False Let z(o) = 13o2 + 7o - 6. Let r be z(-10). Let x = -701 + r. Is x prime? True Let t(o) = o*3 + 12o*2 + 12o + 9. Let w be t(-11). Is (79/w)/((-2)/4) a prime number? True Is ((-2)/(1 + 0))/((-36)/6462) a prime number? True Suppose -3d - 5q = -275, 3q + 357 = 4d - 0q. Suppose -2 = -x - 0. Is x/9 - (-8710)/d a prime number? True Suppose 2x = 5m - 7815, m - 118 - 1458 = 3x. Is m composite? True Is 1/14-2 - 2309010/(-77) a prime number? False Let j(k) = 190k - 27. Is j(2) composite? False Let l(a) = a*2 - 3a + 4. Let j be l(2). Suppose 5n - 580 = 3f, -3n - jf = 2n - 555. Is n composite? False Suppose 2n - 7 = -1. Suppose 80 = nm - 181. Is m a prime number? False Suppose 22 = 3r + 7. Suppose 3s + 0z + z = 5, -5z = rs - 5. Is 138/s - 4/2 a composite number? False Suppose -12 = -14n + 16. Is (-3218)/(-3) - n/(-6) prime? False Let a(k) = -49k + 1. Let s(j) = -50j + 1. Let z(b) = -5a(b) + 4s(b). Suppose u + 3u - 8 = 0. Is z(u) composite? False Suppose 4c + 1332 = 6c - 2b, -c + 2b + 670 = 0. Let v = -18 - 117. Let q = c - v. Is q a composite number? False Let b(x) = -3x + 225. Let r(z) = -z + 113. Let n(v) = -2b(v) + 5r(v). Let u be n(0). Suppose u = -4i + 431. Is i a composite number? False Suppose -6 = -x + 2a, -2x + 18 = -4x - 2a. Let q(h) = h + 10. Let y be q(x). Suppose 2o = yo - 508. Is o prime? True Let d(y) be the second derivative of y*4/12 + 2y*3/3 + 11y*2/2 - 3y. Let f be d(-12). Suppose 0 = 2r - 3x - f, -3r + r - x = -95. Is r a prime number? False Let w = 17146 - 7913. Is w composite? True Suppose 2j - 6 = i, 4i - 4j + 16 = i. Let q be ((-4172)/(-12))/(i/(-60)). Suppose 1280 = -5b + q. Is b a prime number? True Let z(d) = 178d*2 + 45d + 334. Is z(-11) a composite number? False Suppose 7k = 2k - 2i + 4733, 2k - 5i = 1870. Let b = k - 410. Is b a prime number? False Let o(n) = -n2 + 24n - 42. Let r be o(22). Is (-1)/r(-3 - -4)-16114 a prime number? False Let r = 9 - 13. Let x(v) = 31v3 + 6v*2 + 5v + 1. Let g be x(r). Let q = -562 - g. Is q composite? True Suppose -k + 199 = -710. Let a = k + -516. Let i = 404 + a. Is i a prime number? True Is 4629(66/(-18))/(-11) prime? True Let m = -11 + -2. Let u = 13 + m. Suppose w - 2l + 75 = 286, u = 5w - 4l - 1061. Is w a composite number? True Suppose -3c - 29 = -86. Suppose -f = -c - 58. Is f a composite number? True Let l be 19/17 + (12/(-102) - 0). Is 29(19 - ((-4)/(-4) + l)) a composite number? True Let f = 10155 - -29138. Is f a composite number? False Let h = 13144 - -19399. Is h composite? True Let d(k) = -109k + 8. Suppose 0 = -2q - 16 + 10. Is d(q) a prime number? False Suppose 0o + 6 = -3o. Suppose 2q - 4z - 34 = 0, -7z + 4z + 15 = 3q. Is (-11542)/(-18) + o/q a composite number? False Let r(h) = 14h*2 - h - 9. Suppose -g + 22 + 0 = 0. Suppose 5u - g = -2. Is r(u) a prime number? True Suppose -10b + 46637 = -44373. Is b a prime number? False Let v = 2 + -2. Suppose v = -3y + 126 + 141. Is y a prime number? True Suppose 5f = 4x - 56823, -13f + 8f + 56833 = 4x. Is x composite? False Suppose -12 = 2m + 8. Let p = 14 + m. Suppose 0 = 2f + 4y - 178, pf + 2y = 4y + 336. Is f composite? True Let a = 83 + -81. Suppose ar - 6 = 0, -2746 = -3w - 2w + 3r. Is w a prime number? False Suppose -d - 436 = -o + 976, -4o + 5678 = 2d. Is o a prime number? False Is -2(-113193)/63 - 9/21 prime? True Suppose 34431 = i - 4d - 46268, i = -3d + 80734. Is i a composite number? True Let j(b) = b*2 - b + 480. Let n be j(0). Let g(c) = 35c*3 - 2c*2 - 3c + 3. Let h be g(2). Let p = n - h. Is p a composite number? False Suppose -3070 = -56z + 46z. Is z a prime number? True Is ((-32)/(-96))/((-3)/(-12303)) prime? True Let h = -42091 + 67310. Is h a prime number? True Suppose 3g = -5z + 381374, -4g = 5z - 4z - 508527. Is g composite? False Let g(v) = 7951v*2 - 6v - 8. Is g(-3) prime? True Is ((-165)/22)/(-36/124044) composite? True Let y(z) = 5z + 1. Let u be y(-11). Let a be (-11)/(-2 - 110/u). Let h = 446 + a. Is h composite? False Suppose -5m = -1133 - 402. Is m composite? False Let i(n) = 352n*2 + 39n + 49. Is i(8) a prime number? False Suppose -2o = -4b + 44, 0 = 2b + 2o - 0o - 28. Let q be b/(-2)20/(-15). Suppose 97 = 5z - q. Is z prime? False Suppose -2440 + 11502 = 2v. Is v a composite number? True Let m be (-21 - -1)(-3)/6. Is 344 - ((-28)/m - (-1)/(-5)) composite? False Let w = -151256 + 220677. Is w composite? True Let z(s) = -s2 - 4s + 5. Let d be z(-5). Let f(w) = 2w + 106. Let u(b) = 5b + 319. Let c(i) = -8f(i) + 3u(i). Is c(d) prime? True Let s be 30/18(577 + -1). Suppose 0 = -2x - 5l + 1891, -4l + 934 = 2x - s. Is x a prime number? True Suppose -9o = -10758 - 6909. Is o prime? False Let p(o) = -77o3 + 4o*2 + 11o + 9. Is p(-4) a prime number? True Suppose -11n = -5n - 26214. Is n prime? False Suppose -19 = -g - 5d - 2, -2g + 2d - 2 = 0. Suppose 0t - 12 = -4t. Suppose -477 = -3l - tr, 0 = 3l - 2r - gr - 505. Is l prime? True Let f be 0/(-3) + -1 + 1. Suppose -i + 5a + 62 = 0, 4i + fi - 123 = -5a. Is i a composite number? False Let u(m) = -m*3 + 9m*2 - 16m + 71. Is u(-21) composite? True Let j = 134 + -13. Suppose -j = -5h + y + 625, 2y = 3h - 449. Is h a prime number? True Let n(f) = 3f*3 + 6f*2 - 4f + 4. Let k(p) = 4p3 + 7p*2 - 5p + 3. Let l(b) = 2k(b) - 3n(b). Is l(-9) composite? True Suppose -4q + 1673 = -5019. Is q a composite number? True Suppose 0 = -4z + 3466 + 1858. Suppose -4b + 3m - 6m = -z, -3b + 993 = 4m. Is b composite? True Let f(n) = 682n*3 - 2n*2 + n. Is f(1) prime? False Let z = -2 + 3. Let u be 60/8((-135)/(-25) - 5). Is 105 + 1 + u/z composite? False Let w be -3(-1 - 1 - -1). Let q(a) be the second derivative of 5a*3/6 + 2a*2 + a. Is q(w) composite? False Let p(j) = 3j*2 - 36j - 187. Is p(42) a prime number? True Suppose 4b - a = 5 + 6, 4 = -b - 2a. Suppose -2k - 199 = 4y + 37, by = 4k - 108. Is y/4(-10 + -4) composite? True Let f(x) = 1566x + 155. Is f(12) a composite number? False Let m be (-5)/(-5) - 23/(-1). Suppose -my = -21y - 237. Is y composite? False Suppose -2p - 4a = -10710, 9p - 26700 = 4p + 5a. Is p a composite number? True Let y(q) = -q2 + 9q - 4. Let m be y(9). Is -41 - (1 + -566 + m) prime? False Let b(a) = -57a + 5. Let x be b(-4). Suppose -3d = -x - 400. Is d a composite number? False Let l(a) = -282a - 115. Is l(-27) prime? True Let k(q) be the third derivative of q6/20 - q5/15 + q*4/12 - 5q*3/6 + 5q*2. Is k(5) composite? True Let u(y) = -401y + 7. Let g(o) = 200o - 4. Let c(t) = -5g(t) - 3u(t). Let s be c(9). Let p = -1081 + s. Is p a prime number? False Let m(c) = c3 + 21c*2 + 32c - 24. Let j be m(-19). Suppose -3 = -2*h - 19. Let b = h + j. Is b composite? True	{ "pile_set_name": "DM Mathematics" }
- 2 + 2 + (2k2 + 3k*2 - 4k*2)(-16 + 37 + 35) to the form fk2 + zk + n and give f. 57 Express -7446y + 0y3 + y3 + 7446y - 1 - 99y*2 as gy*2 + my*3 + jy + q and give g. -99 Rearrange (-114 + 4 + 26)(-5q + q + 2q)(-q + 11q - 5q) to the form rq + aq*2 + i and give a. 840 Rearrange 9b - b*3 + 2b*3 + 5b3 - b3 to pb2 + u + kb*3 + db and give p. 0 Rearrange -11p + 2p3 + p + p2 - 10p - 5p3 + 127 - 126 + p4 to the form cp + up*2 + xp*4 + kp*3 + m and give m. 1 Express 8z + 187 - 7z + 6z - 9z as n + wz and give n. 187 Express (0 + 0 + 16850a - 15569a)(-5 - 1 + 4) as d + ra and give r. -2562 Express 6a4 + 0 - 3 - a + 2 + 3a*2 as wa*4 + da*2 + fa + ja3 + m and give m. -1 Express (3 - 1 - 391b - 2)(-2b + 0 + 0) + (4b + 2b - 4b)(5b + b - 3b) + b - b - 2b2 as d + tb*2 + ub and give u. 0 Rearrange -j - j3 + j + (-j3 + 2j3 - 5j*3)(-1 + 0 - 1) + (-18j + 35j + 40j)(j*2 - 2j*2 + 3j*2) to fj*2 + pj*3 + bj + r and give p. 121 Express (-3y + y + 4y + (-2y + 2y + 2y)(0 + 2 - 1))(-2y + 6y - y)(-9y2 + 29y*2 + 20y*2) as xy + z + by3 + vy*4 + py2 and give v. 480 Rearrange -t2 + 0 - 7 + 12t + 6 - 3t*4 + 2t*4 - 2 to the form ut*4 + wt*2 + ht*3 + n + dt and give n. -3 Rearrange (-2 + 2 + 3i)(-1 + 1 - 6i) + (-5 + 5 + 6)(-2i2 - 2i*2 + 9i*2) to yi + b + si2 and give s. 12 Express 387j*3 + 362j*3 - 2j*2 + 6j - 807j3 as gj*2 + fj*3 + q + dj and give g. -2 Rearrange 43i2 - 77i*2 + i + 23i2 + i3 to vi3 + fi + j + ni2 and give v. 1 Rearrange 515g - 6 + 20 - 6 - 8 to wg + p and give w. 515 Rearrange (-2s + 2s - s)(s + 2 + 0 - 3s)(13806s2 - 797096 + 797096) to ds + q + as3 + hs*4 + cs*2 and give h. 27612 Rearrange -492k*2 - 2k + 112k2 + 89k*2 + 73k*2 to x + ok*2 + jk and give x. 0 Rearrange (2y2 + y2 - 5y*2)(1 - 6 + 3)(4 - 2 + 0) - 614 + 2y*2 - 387 + 813 to hy*2 + ay + x and give h. 10 Rearrange 5p - 7 + 89p + 2p - 33p - 17p to q + wp and give w. 46 Rearrange (5 - 4 + 0)(13x + 70x3 - 2x - 66x3) to mx + sx3 + fx*2 + z and give s. 4 Rearrange -4 + 5n + 4 + 2n + 6n + 0n - 2 + n + 2 + (-n - n + 3n)(4 - 6 - 1) + 7n - 3n - 7n to xn + b and give b. 0 Rearrange 0l + 6l - 45 + 742 - 2l - 3l to jl + t and give j. 1 Rearrange (993 - 37 + 46)(c2 + 0 + 0)(-5 + 5 - c*2) to the form kc*3 + ic*2 + r + xc + vc4 and give v. -1002 Rearrange (0q - 4q - 3q)(-44q - 11q + 9q)(2 - 3 + 2) to the form u + lq*2 + vq and give l. 322 Rearrange -1395w + 110596 - 110596 to iw + l and give i. -1395 Rearrange (5j - 3j + 0j)(13j2 - 2j*2 - 77j*2) to fj + lj2 + h + yj*3 and give y. -132 Express 1525 - 1525 - 325p as q + tp and give q. 0 Rearrange 8608 - 421t*2 - 8608 to the form u + it*2 + at and give i. -421 Rearrange -118g + 152g - 140g - 341g - 400g to the form mg + r and give m. -847 Express (-3j + 3j*2 + 3j)(59 - 4 + 158 + (-5 - 3 + 6)(1 - 1 + 1)) as lj2 + k + aj and give l. 633 Express o4 + o3 + 1 - 1 - 7o4 + 2 + 72o*2 + 4o*4 as xo*2 + bo*4 + go*3 + uo + d and give b. -2 Express (0c + 2c - 3c)(4327 + 39c + 20c - 4325 - 6c2) as hc*2 + x + zc + qc3 and give h. -59 Rearrange -21x - x - 3x3 - 14x - 5x to tx*3 + jx*2 + a + kx and give j. 0 Rearrange -q - q*4 + 52 + 1 + 4q*3 + 4q*3 - 5q*3 to the form cq*4 + h + rq + lq2 + sq*3 and give r. -1 Rearrange -7h4 + 6 + h2 - 9h2 + 6h*2 + 25h*4 - 5 - 2h*3 - 24h to zh4 + fh*2 + u + mh*3 + vh and give f. -2 Express (0 + 1 - 2)(-9 - 6 + 4)(2l + 1 + 1 - 1) + 26l + 1090 - 1090 as j + cl and give c. 48 Express x - 1 - x2 - 1 - 13x - 13x3 + 4x + 6x as ux*2 + tx*3 + h + jx and give j. -2 Rearrange 1 + 343w - 343w + 398w2 to hw + tw2 + z and give z. 1 Rearrange -5352l + 2672l - 33 + 2677l to the form k + rl and give r. -3 Rearrange 2y*2 + y + 1802y*3 - 1800y*3 - 191 - y + 2y - 4y to the form gy*3 + k + ty + cy2 and give t. -2 Rearrange (1 - 1 + 1)(-17x + 28 - 28)(3 - 1 - 1) to the form v + qx and give q. -17 Express 23p*3 + 19p*3 + p - 4p*4 + 2p4 - p2 - 8p3 in the form lp*3 + jp*2 + x + yp*4 + rp and give l. 34 Express -4 + 3 + 2132u4 - 2130u*4 + (2u*3 + 0u3 + u3)(-u + 4u - 4u) as ku*4 + du + au2 + iu*3 + n and give n. -1 Rearrange d - d + 3d + d - 5 + 5 + (42 + 3 + 35)(0d - 5d + 4d) to td + u and give t. -76 Express 0n*2 + 3n2 - n2 + (0 + 1 - 3)(-1 + 4 - 6)(-37 + 37 - 17)(-n + n - n2) in the form o + jn*2 + mn and give j. 104 Express -2o2 - 2 + 2 + (o2 - 2o + 2o)(-211 - 221 + 63 - 163) as xo + go*2 + d and give g. -534 Rearrange (-5 - 100a - 87a + 179a)(-1 - 2a*2 + 1) to the form ma*2 + wa + ua3 + y and give m. 10 Rearrange (l + 5l - 4l)(-4 + 1 + 4)(-2 - 1 + 2)(-26 - 20 + 45) to tl + x and give x. 0 Rearrange (454g*2 - 63g + g*3 - 454g*2)(-2g + 11g - g) to the form wg4 + ug*2 + p + tg*3 + lg and give u. -504 Rearrange 329u + 280u - 4u2 - 707u to p + wu2 + zu and give w. -4 Express (-162g + 31g + 67g)(3 + 0 - 2)(-14 + 1 - 5) in the form mg + n and give m. 1152 Express 4g4 - g4 - 5g*4 + (-g + 4 - 4)(-g*3 + 2g*3 + 0g*3) - 21g*4 + 4g*4 - 10g*4 as zg*4 + ug*3 + hg*2 + yg + i and give z. -30 Express 241 + 2n - 505 + 220 as un + a and give a. -44 Express -2p - 2 + 2 + (-3 + 3p + 3)(155 - 259 - 201) in the form mp + i and give m. -917 Express -207c + 38126 + 1754c - 38126 as t + vc and give v. 1547 Rearrange -3d*3 - 12d - d*2 + 3d*3 + 30d + 2d3 + 7d*3 to the form hd*3 + gd*2 + z + pd and give z. 0 Rearrange (2 - 2 - q + (4q + 0q - 17q)(-1 - 4 + 6))(5q*2 - 2 - 70q + 70q) to x + mq*2 + uq + oq3 and give u. 28 Express 273j*4 - 6j - 2j + 2 + 2j + j*2 - 271j*4 as q + aj + cj3 + nj*2 + pj*4 and give p. 2 Express (2a + 0a - a)(-36a - 2 - 48a + 104a) in the form ga*2 + u + va and give v. -2 Rearrange 30d3 - 1033d + 21d3 - 74d*3 + 22d*3 to t + hd + od2 + id*3 and give t. 0 Rearrange (o + 0o + o)(2 + 5 - 3 + (0 + 0 + 2)(0 + 2 + 0)) - 5o - 2o + 5o + (-5 + 0 - 1)(0 + 0 - o) to f + no and give n. 20 Rearrange 2i*2 + 2i*3 + 327i*4 - 664i*4 - 5 + 335i*4 + 2i - 3i3 to si*3 + ki*4 + wi + ai2 + r and give a. 2 Express (-3b - 2b + 3b)(19b - 7b - 6b) as sb2 + ob + g and give s. -12 Rearrange (27 + 7 - 4)(-27p*2 - 21 + 43 - 21) to yp + a + op2 and give a. 30 Rearrange 0w + 2w + 279w*2 + 2w + 7w - 278w*2 to the form u + rw + lw2 and give r. 11 Express -115g*3 + 3 - g - 4g*2 + 114g*3 + 2g*2 in the form xg*3 + j + vg + yg2 and give v. -1 Rearrange -c2 + 132c4 + 2 - c3 + c*3 - 21c + 26c - 8c to the form hc2 + x + sc*4 + pc*3 + vc and give x. 2 Rearrange b*4 - 11b*3 + 2b*3 - 17248 + 17256 - 2b*2 - 3b + 3b to the form i + ob*2 + ub + tb4 + vb*3 and give o. -2 Express -257c + 148c - 391c - 83c as q + dc and give d. -583 Rearrange (3g + 0g - g)(-11g - 2g - 13g - 3g + g + 0g + (2g - 1 + 1)(-2 - 2 + 6) + 4g - 3g + 0g) to yg*2 + ug + d and give y. -46 Express -d*2 + 95d*4 - 94d*4 + 19 - 10d - 2d3 - 18 as vd + td3 + hd*4 + q + zd*2 and give v. -10 Rearrange -8 - 14 - 4g*3 + 38 - 11 - g to the form cg + tg2 + og*3 + d and give c. -1 Rearrange -20w*2 + 22w*2 - 624w*3 + 640w3 - w4 to pw4 + nw*3 + rw*2 + uw + j and give n. 16 Express -j3 + j2 - j*2 + (4j2 + j2 - 3j2)(-16 + 16 + 3j) - 598j + 45j3 + 598j in the form mj3 + rj*2 + i + bj and give m. 50 Express (-5d + 11d + d)(-1 + 1 - 2) + 5d - d - 5d + (-10d - 13d + 13d)(3 - 2 - 2) as x + ad and give a. -5 Rearrange -5w2 + 58w*3 - 7496 + 5w*3 + 7496 to the form aw*3 + pw + n + zw2 and give a. 63 Express -13l*2 - 3 + 2 + 5l*3 - 5 + 7 as zl + b + kl2 + tl*3 and give k. -13 Express (4 - 1 + 3)(-150f - 17f + 88f)(-4f + 5f + f) in	{ "pile_set_name": "DM Mathematics" }
0))2 - (1 + sqrt(7))2-5) + -3(1 + (sqrt(7) - (-3 + sqrt(112))))). -3660 - 295sqrt(7) Simplify (46-6sqrt(96))/((sqrt(4)/sqrt(2)6 + 2sqrt(2)-5)-5). -144sqrt(3)/5 Simplify -5 + 2(((sqrt(147) - (sqrt(147) + (sqrt(147) - (-1 + sqrt(147))))5) + -4 - (5 + sqrt(147)-15))6)*2. -14112sqrt(3) + 24691 Simplify (5 + (-1(sqrt(448) - (sqrt(448) + -2sqrt(448)) - sqrt(448)))/(2(sqrt(400) - (sqrt(400) - sqrt(400)-2)) - sqrt(400)) + 0)*2. 4sqrt(7)/5 + 15653/625 Simplify -3((sqrt(12) - 1sqrt(108))/((-1sqrt(66))/sqrt(11)))2 - ((sqrt(162) + (-1sqrt(162) - sqrt(162)) + 4)*2 + (sqrt(162)-1)*2 + 4). -368 + 72sqrt(2) Simplify (-3-5((1sqrt(187) + sqrt(187))-3 - (sqrt(187)3-4 - sqrt(187)))/(6sqrt(891)2))*2. 20825/1296 Simplify 1((-1 + -61sqrt(1872)-36)5-3)*2. -583200sqrt(13) + 4912877025 Simplify ((sqrt(6292)-2 + 1sqrt(4212))/(4sqrt(196) + sqrt(196) + sqrt(196) - (sqrt(4) - 4sqrt(12)/sqrt(3))))*2. 2197/2025 Simplify ((((sqrt(720) + sqrt(720) + 3)5 - (4 + (sqrt(720) - (sqrt(720) + -3))))2-2)*2 + 4)-2. -2306056 - 61440sqrt(5) Simplify 2(-5 + 1(3sqrt(75)3 + (sqrt(75) - (2 + sqrt(75) + sqrt(75) + (sqrt(75) - (sqrt(75) - (sqrt(75) + 0)))) - sqrt(75))))2. -840sqrt(3) + 5498 Simplify 5 + (-1((sqrt(130) + 1sqrt(130))2 + 3sqrt(130)-2))/(-4(-5sqrt(160)-1 - sqrt(160))). -sqrt(13)/32 + 5 Simplify (51(sqrt(18) + -1) - (sqrt(242) + -1)1-2)*2 + -3. -518sqrt(2) + 2784 Simplify (5sqrt(3645)1)/(3(sqrt(81) - ((sqrt(81) - 1sqrt(81)) + sqrt(81)) - sqrt(81)))1. -5sqrt(5) Simplify (((sqrt(66) - sqrt(66)1)-4 - (sqrt(66) + sqrt(66)2 - sqrt(66))1)3)/(sqrt(1944)-31). sqrt(11)/9 Simplify ((41sqrt(96) - sqrt(96))/(sqrt(6) + -1(sqrt(6)1 + sqrt(6))))/(3(sqrt(128)-2 + sqrt(128))-6)5. -5sqrt(2)/24 Simplify ((sqrt(50) - sqrt(100)/(sqrt(2) + sqrt(18)))*2 + (sqrt(50)-1 + sqrt(50))6 + -1 + (1sqrt(7200))*2)-3. -173451/8 Simplify (2(2sqrt(637) + 1 + sqrt(637))*2 + -1 + 0)-1 + 4 + -1. -11464 - 84sqrt(13) Simplify 0 + (((sqrt(190) - -1sqrt(190))-4 - sqrt(190))1)/(6(sqrt(360) - sqrt(360)-2) - sqrt(360) - sqrt(360)) + 5. -3sqrt(19)/32 + 5 Simplify (2 + -5 + 1 + sqrt(18) + -1 + -5)2 + 0. -48sqrt(2) + 82 Simplify (-3(2 + ((sqrt(288) - (sqrt(288) + sqrt(288) + -52sqrt(288) + sqrt(288))) + sqrt(288) + -2sqrt(288)-4)/(-4sqrt(18)/(sqrt(8)/sqrt(4)))))*2. -612sqrt(2) + 5238 Simplify (1sqrt(175) + 2 + 2 - (6(sqrt(175) - (0 + sqrt(175) - sqrt(175))) + 4))*2-1. -4375 Simplify (((sqrt(960)-3 - sqrt(960))-2)/(sqrt(132)/((-4sqrt(66))/sqrt(6)))4)*2. 1310720 Simplify 5(-2(sqrt(448)2 + 4) + (sqrt(231)/(sqrt(44)/sqrt(4)))/(sqrt(3) - (2sqrt(300) - sqrt(3))))2. 23080sqrt(7)/9 + 11756195/324 Simplify (-4 + sqrt(7)2 + -1 - (1 + sqrt(448) + 1) - (-2 + 3 + (sqrt(14) - sqrt(28)/sqrt(32))/sqrt(2)))2. 108sqrt(7) + 6127/16 Simplify 3 + -5 + 3sqrt(272)1 + (-5 + sqrt(272)5)2 + -3. -188sqrt(17) + 6820 Simplify (-62sqrt(2592) - (sqrt(2592) - 5sqrt(2592)2))/(-6sqrt(36)/(sqrt(4)-1)4). -3sqrt(2)/2 Simplify (sqrt(45)6-46)2 + -3 + (sqrt(35) - (sqrt(1715) + 1sqrt(1715) + sqrt(1715)))/sqrt(7) + -62sqrt(80). -68sqrt(5) + 933117 Simplify 1-5(sqrt(252) + 1)2 + (4(sqrt(28)2 + 1))2. 68sqrt(7) + 543 Simplify (((-1sqrt(931))2 + -2 - ((2(sqrt(931) + -1) + sqrt(931))*2 - sqrt(931))) + (-2(sqrt(2299) - (2 + sqrt(2299) + sqrt(2299)))-5)2)1 + -5. 4491sqrt(19) + 222841 Simplify ((sqrt(1176) - (sqrt(1176) + 1-2sqrt(1176)) - -51sqrt(1176))/(3(sqrt(16)/sqrt(2) - sqrt(8))-5 - (sqrt(8) + 12sqrt(8) + sqrt(432)/sqrt(6))))2. 2401/12 Simplify ((-2-2sqrt(264))/((1sqrt(891) - sqrt(891)) + sqrt(11)))/((sqrt(288) + (sqrt(288) - (sqrt(288) + -2sqrt(288)3)) + sqrt(288))3). sqrt(3)/36 Simplify (-3 + -6(-1sqrt(2187))/(sqrt(72)/(sqrt(8) - sqrt(8)4)))*2-1. -78741 - 972sqrt(3) Simplify (1(sqrt(1088)-1-5 + sqrt(1088) + 2) + (1sqrt(1088)1 + sqrt(1088) - sqrt(1088) - (-1 + -3 + sqrt(1088))))*2. 576sqrt(17) + 39204 Simplify (-3(sqrt(612) + -1 + sqrt(612)4))*2 + 4 - (2(sqrt(612) - (sqrt(612) + 3sqrt(612)-1)*2) + -2). -552sqrt(17) + 142611 Simplify -1 + (1 + sqrt(32) - sqrt(2))*2 + 4 + 1 + sqrt(2) + 5(sqrt(2) + (sqrt(8)/sqrt(4))*2) + (sqrt(2) + sqrt(2) + 2 + sqrt(2))-6. -6sqrt(2) + 21 Simplify -3 + ((31sqrt(130))/sqrt(10))2 + (sqrt(468) + sqrt(468) + -1(sqrt(468)-1 + sqrt(468))2)-6 + 2. -72sqrt(13) + 116 Simplify sqrt(15)/sqrt(80)6 + -4 + -3 + (-1 + sqrt(300) + sqrt(3) - -4sqrt(9)/sqrt(3) - (-1sqrt(147)4)2). -2360 + 33sqrt(3)/2 Simplify (4 + 1-5(5 + (sqrt(147) - (2sqrt(147) - sqrt(147))) + sqrt(147))-6)*2 + 0. 64680sqrt(3) + 156016 Simplify ((1sqrt(245)-3)/(-6sqrt(5)-2))/((-1sqrt(112) + sqrt(112))6 - (sqrt(112) - -6-1sqrt(112))). -sqrt(7)/80 Simplify -5((1 + sqrt(1872) - sqrt(832)5) + 0 + sqrt(325) + (sqrt(13) - (sqrt(13) - (-2 + sqrt(13) + -4))))*2. -31585 - 1100sqrt(13) Simplify (-6(-1 + -3(sqrt(1539) - (2 + sqrt(1539))) + 5 - (sqrt(1539) - (sqrt(1539)2 + 3) - (sqrt(1539) + 3 + 4))))2. 25920sqrt(19) + 236016 Simplify (sqrt(1800) + (sqrt(1800) - (sqrt(1800) - (-3sqrt(1800) - sqrt(1800))) - sqrt(1800))-2)/(sqrt(729)-2 - sqrt(63)/(sqrt(28)/sqrt(4)))4. -440sqrt(2)/19 Simplify 2(-3 + -5 + sqrt(325) + -64sqrt(325)) + 5. -230sqrt(13) - 11 Simplify -44((sqrt(275)-5 + sqrt(704)-3)2 - (1sqrt(121)1)/(sqrt(11) - sqrt(11)-1-4)). -422576 - 16sqrt(11)/3 Simplify (5(sqrt(343) - ((-1 + sqrt(343) - sqrt(343)) + 5)) + 2(sqrt(343) + (sqrt(343) - (3(0 + sqrt(343)) - sqrt(343)))) + -3 + 2)2. -1470sqrt(7) + 9016 Simplify -4 + (4(1 + ((sqrt(612) + -1)4 - (sqrt(612) - (0 + sqrt(612) - sqrt(612)) - sqrt(612))-5))4)*2 + 5. -36864sqrt(17) + 2509057 Simplify 2(sqrt(192) - (sqrt(192) - (sqrt(192) + 1sqrt(192) + sqrt(192) + 2))*2) + (-4-6(1sqrt(3) + -3))*2. -3568sqrt(3) + 5368 Simplify (2 + (2 + 1 + sqrt(272))4 + (-1sqrt(272) + -4)1 + 3)2. 312sqrt(17) + 2617 Simplify 4 + 3(-4 + (sqrt(180)2 + -2)*2 - (2(sqrt(180) + -1) + -1 + 0 + sqrt(180))). -198sqrt(5) + 2173 Simplify (((sqrt(399) + sqrt(399)1 - sqrt(399))/sqrt(7) + sqrt(228)6)/((sqrt(243) + ((sqrt(243) - sqrt(243)2) + sqrt(243) + sqrt(243))6)-2))*2. 3211/15876 Simplify 1 + (6(sqrt(800) + (sqrt(800) - (1 + sqrt(800)))) + (sqrt(800) - (sqrt(800) + 3 + sqrt(800))-4))2. 3600sqrt(2) + 180037 Simplify (sqrt(3) - (sqrt(3) + -1)6 - (sqrt(3) - (sqrt(3) + 1))1) + -4 - (0 + 5 + sqrt(432)). -17sqrt(3) - 2 Simplify ((3(sqrt(216) - sqrt(216)2 - sqrt(216) - sqrt(216) - sqrt(216)) - sqrt(216))/sqrt(9)5)/(sqrt(32)/sqrt(4)-3 - sqrt(64)/sqrt(2)). 13sqrt(3) Simplify (-2 + -5(sqrt(108) + -1) - ((-1sqrt(108) + sqrt(108))-3 - sqrt(108) - (2 + 1 + sqrt(108))))2-4 + 2. -4030 + 864sqrt(3) Simplify (2 + ((1 + sqrt(2736))-3-4 - (-2 + sqrt(2736) + 4 + 3)) + -5 + -3)2. 264sqrt(19) + 331057 Simplify (((sqrt(70)-2 - sqrt(70) - sqrt(70))-5 - (sqrt(70) - (-3sqrt(70) - sqrt(70))1))/(6sqrt(70)/(sqrt(14)/sqrt(2))5))*2. 7/4 Simplify ((-3(sqrt(117) + sqrt(117)1 + sqrt(117) + 0) + (0 + sqrt(117) + 1 - (1 + sqrt(117))2))-3 + 4)2. 1260sqrt(13) + 105349 Simplify -5(-1(sqrt(98) + 3) + (sqrt(98)2 + 0)2 + -1)-4. -140sqrt(2) + 7760 Simplify (((sqrt(91) - -4sqrt(91)) + sqrt(91))-3 + (-1sqrt(91) - sqrt(91))-5 + sqrt(91))/((21sqrt(84))/(1sqrt(432))). -21sqrt(13) Simplify (5-2(-22sqrt(170) - sqrt(170)))/(sqrt(110)/(sqrt(11) + (sqrt(99)3)/sqrt(9))-3). -200sqrt(17)/3 Simplify (-2(-3 + 1sqrt(512) - (sqrt(352)/(sqrt(22)/sqrt(2)) + -3))-2)2 + 5. 4613 Simplify 3 + (sqrt(2299) + (2 + sqrt(2299)-2 + sqrt(2299))*2 - ((0 + sqrt(2299))4)*2 - ((5 + sqrt(2299)1)*2 + -5)-1). -32159 + 77sqrt(19) Simplify ((0 + sqrt(684) + -1 + (sqrt(684) - (sqrt(684) + 0 + 3)))4 - (5 + 3sqrt(1216) - (sqrt(1216) + 0 + 3 + sqrt(1216))))2. -576sqrt(19) + 5188 Simplify (1 + (sqrt(117) + 1 + sqrt(117) - (1 + sqrt(208)))*2)4-4. -848 Simplify (((4(2sqrt(175) + sqrt(175) - sqrt(175)))/sqrt(5))/((-2sqrt(500) + sqrt(20))/sqrt(4))-25)*2. 44800/81 Simplify (62(-1(3sqrt(130) + sqrt(130)) + sqrt(130)))/(sqrt(90)-2 + (sqrt(10) - (sqrt(10) - sqrt(70)/(sqrt(63)/sqrt(9))))). 36sqrt(13)/5 Simplify -3(((sqrt(847) + 5)*2 + -2)-4 + -1	{ "pile_set_name": "DM Mathematics" }
3085t - 255 = 0 for t. -5 Solve 0 = -919w + 1192w - 819 for w. 3 Solve 112f - 297352 = -286936 for f. 93 Solve 24777 = -1915m - 30758 for m. -29 Solve 103u - 32416 = -910u for u. 32 Solve 282f - 47208 = -1812f - 1840f for f. 12 Solve -828g - 897g = -35261 - 11314 for g. 27 Solve 1399u + 21577 = -120u - 788u - 31484 for u. -23 Solve 25758n - 4445 = 304651 for n. 12 Solve 0 = -107p + 26p - 358p + 1756 for p. 4 Solve 99m + 128m + 11886 - 40488 = 0 for m. 126 Solve 626 + 929 + 57 = -76f - 60 for f. -22 Solve 44c - 1865 = 1775 + 232 for c. 88 Solve 442h + 1444h - 39984 = 1084h - 1697h for h. 16 Solve 1294a + 346a + 13120 = 0 for a. -8 Solve -252 = -64l - 820 - 508 - 460 for l. -24 Solve -41680 + 42364 = -18u for u. -38 Solve -2379 - 5133 = -474a + 105a - 257a for a. 12 Solve -3726758 = 15t - 3727793 for t. 69 Solve -697s - 38329 = 239s - 3697 for s. -37 Solve -6789n = 2788n + 1141n - 300104 for n. 28 Solve 0 = -3158v + 158621 - 41775 for v. 37 Solve 2574 = -104b - 12b + 1027 - 3093 for b. -40 Solve 0 = 122w + 5176 - 10178 for w. 41 Solve 0 = -253a - 791a - 1602a - 85442 + 376502 for a. 110 Solve 21g - 11g = -92 - 68 for g. -16 Solve 0 = 164x - 16386 + 8350 for x. 49 Solve 7586 - 3625 = 91j - 5139 for j. 100 Solve -174k + 380 + 29 = 61 for k. 2 Solve 230u = -251u + 8177 for u. 17 Solve 2487 = 77h + 2949 for h. -6 Solve 11o - 15646 + 16361 = 0 for o. -65 Solve -9466j - 583022 = 709357 - 137527 for j. -122 Solve -34u + 33u + 11985 = -104u - 152u for u. -47 Solve 4444f - 400f - 368004 = 0 for f. 91 Solve -4390 = -5969b + 6408b for b. -10 Solve -22662 = 6087n + 239079 for n. -43 Solve 2725a = 1281a - 7220 for a. -5 Solve 157a + 1794 = 11999 for a. 65 Solve -2562 = 936b - 875b for b. -42 Solve -55z + 75z - 7356 = -126z + 1550 for z. 61 Solve -3155q - 8528q = -771078 for q. 66 Solve 34g + 21g + 1840 = 9g for g. -40 Solve 66b + 23b + 51 = -5022 for b. -57 Solve 288 = 153j - 630 for j. 6 Solve -1112738 = 15202n + 1044400 - 211282 for n. -128 Solve 3920q + 918 = -202922 for q. -52 Solve 4360 = -109d - 1190 + 839 - 1393 for d. -56 Solve 18412 = -2828s - 1775s for s. -4 Solve -377i + 4327921 = 4308317 for i. 52 Solve -4659s - 30083 - 161411 = 171908 for s. -78 Solve -451y + 6901 = -44062 for y. 113 Solve 343m + 15158 = -221m - 19m for m. -26 Solve -323z = 2125 + 12087 for z. -44 Solve -214 = 15m + 274 - 578 for m. 6 Solve 780142 = -13085k - 410593 for k. -91 Solve 186 = -541k + 570k - 394 for k. 20 Solve -660900 = 7068n + 116580 for n. -110 Solve 238581c - 238881c = 12300 for c. -41 Solve -166t + 608t - 59808 = -982t for t. 42 Solve 779 + 955 + 6526 = 295n for n. 28 Solve -4303y = 150488 + 38844 for y. -44 Solve -2r - 49628 = -49694 for r. 33 Solve q - 113q + 4280 = -5q for q. 40 Solve 142l = -53335 + 57311 for l. 28 Solve -162816 = 10064t - 6672t for t. -48 Solve -111 = 198b + 17b + 107b + 1177 for b. -4 Solve -954t - 73917 = -1228t - 1445t for t. 43 Solve 2w - 830564 = -3w - 830714 for w. -30 Solve 1371w - 798w = 600w + 2592 for w. -96 Solve 59u + 8568 = 10751 for u. 37 Solve 6036t = -9610t + 923114 for t. 59 Solve -14961 = -387n + 9420 for n. 63 Solve -217p - 930 = 487p + 111p + 1515 for p. -3 Solve -3483 = -146k - 15601 for k. -83 Solve 10797 = -674z - 1555 - 1488 - 9750 for z. -35 Solve 1336615 = 49c + 1333724 for c. 59 Solve 134c - 4636 = -3296 for c. 10 Solve -2388u + 21684 = -38016 for u. 25 Solve 453d + 901d + 44682 = 0 for d. -33 Solve 101784y = 104377y - 199661 for y. 77 Solve -6982 = -97j - 2132 for j. 50 Solve -16085 = -51y - 18227 for y. -42 Solve -3153 = 132l + 7 + 1328 for l. -34 Solve 132n + 277983778 - 277982062 = 0 for n. -13 Solve 12d + 12961 - 13345 = 0 for d. 32 Solve 236k - 17730 = 844 + 6914 for k. 108 Solve -73070j + 3667 = -72877j for j. 19 Solve 407y - 2863y - 283064 = 2889y + 1559y for y. -41 Solve -499k - 56k - 2731 = 32234 for k. -63 Solve 0 = -57a + 6608 + 8817 - 14000 for a. 25 Solve 701n + 92n = -998n + 66267 for n. 37 Solve 0 = 68o + 30783 - 34727 for o. 58 Solve 1025q - 32199 - 13853 = 17226 + 8472 for q. 70 Solve -28299i = -28415i + 4060 for i. 35 Solve -851y - 1165 = -676y + 235 for y. -8 Solve -175f - 33f = -942 + 8846 for f. -38 Solve -113296h + 113221h + 6075 = 0 for h. 81 Solve 0 = -3295u - 79666 + 7666 - 10952 - 170763 for u. -77 Solve -32481x = -32453x + 1428 for x. -51 Solve 14c - 28660 = -28184 for c. 34 Solve 12988 = -252h + 3916 for h. -36 Solve 1343b = 1395b - 2132 for b. 41 Solve -31o + 4820 - 1000 = -242o - 6097 for o. -47 Solve -3230k + 1080 = -3387k + 19763 for k. 119 Solve -7097d - 30228 = -6181d for d. -33 Solve 192n + 345 + 34 + 1589 = 69n for n. -16 Solve -3473d - 42460 - 27742 = 106921 for d. -51 Solve 26k + 38k = 16k - 25k - 146 for k. -2 Solve 43030 + 10804 = 7400q - 12766 for q. 9 Solve -186257p + 741 = -186238p for p. 39 Solve -1343 - 992 = -96c - 576 + 257 for c. 21 Solve -158m + 35993 - 11965 - 12020 = 0 for m. 76 Solve 43271g = 43120g - 5436 for g. -36 Solve -39t - 858 = 23t + 1498 for t. -38 Solve 229s - 2053 + 498 - 477 = 258 for s. 10 Solve 349y = -19914 - 3469 for y. -67 Solve 45d = -7d + 8d - 10d + 3078 for d. 57 Solve 1458y + 2292y = 356y + 10135 - 61045 for y. -15 Solve -31164b - 58 = -31193b for b. 2 Solve -23637691 + 23593039 = 732n for n. -61 Solve 0 = 4825h - 4834h - 819 for h. -91 Solve -31g + 10286 = 155g - 865 + 1851 for g. 50 Solve -40081w = -40108w - 810 for w. -30 Solve 177t = -308704 + 289411 for t. -109 Solve 351o + 233o + 276o = 12900 for o. 15 Solve -70x + 3475203 - 3472753 = 0 for x. 35 Solve -21584 = -88h - 480h for h. 38 Solve -165o + 1038o + 275967 = 268o - 2802o for o. -81 Solve 283u - 240 - 2479 = 11431 for u. 50 Solve -96n = -63n - 32n - 46n + 1710 for n. 38 Solve -3419l - 5399l + 1537l = -176l - 35525 for l. 5 Solve 576l - 1129l - 32 = -545l for l. -4 Solve 8827k - 552 = 8781k for k. 12 Solve 111p = 39010 - 73980 + 18542 for p. -148 Solve 1553o - 3419 = -39138 for o. -23 Solve 16127u + 320 = 8071u + 8064u for u. 40 Solve -25n - 641 = 1525 + 484 for n. -106 Solve 0 = 671g + 39472 + 28299 for g. -101 Solve -180i + 155i = 110i - 8303 - 5467 for i. 102 Solve -466 - 847 = -7j - 2253 + 520 for j. -60 Solve -105945 = -17a - 104534 for a. 83 Solve 535 + 11161 = 141t + 31t for t. 68 Solve 125984 = 12003s - 296586 - 973683 + 15908 for s. 115 Solve 43q - 3570 = -135q + 8356 for q. 67 Solve 0 = 36n + 140955 - 140271 for n. -19 Solve 22q + 17q + 435 = 40q + 4q for q. 87 Solve -1386 = -5246s + 5323s for s. -18 Solve -14344 = -2972m + 1179m for m. 8 Solve -1940 + 28096 = 2410y - 354 for y. 11 Solve -1075b - 1040b - 3778b + 200362 = 0 for b. 34 Solve 233j = 389j - 624 for j. 4 Solve -2828 = 114k + 1106 + 1967 - 999 for k. -43 Solve -155869a + 155799a = -1890 for a. 27 Solve 4927z + 4899 - 246352 = 14751 for z. 52 Solve -268s = -384s + 1996 + 2992 for s. 43 Solve 15550 + 13292 = 203s + 671s for s. 33 Solve -1044h - 2235h - 2783h + 176h + 464994 = 0 for h. 79 Solve -100g + 36716 = -11g + 459g for g. 67 Solve 0 = 194s - 2277s - 216632 for s. -104 Solve 39091 - 11305 = -10843s - 16615 - 107401 for s. -14 Solve 63178 = -382v - 111v + 48033 - 57819 for v. -148 Solve -816 = -5542x + 5576x for x. -24 Solve -62g + 2562 = -239g - 1052 - 5590 for g. -52 Solve 125s + 87s - 7000 = -71s + 3s for s. 25 Solve -1456 = 41479u - 41570u for u. 16 Solve 155q + 179q + 485 = -151q for q. -1 Solve 0 = 267647b - 267812b - 7095 for b. -43 Solve -620s = -3370s - 1534s - 6411s - 245985 for s. -23 Solve -49s = 45s + 5546 for s. -59 Solve 1609s = 2651s - 1305s + 2367 for s. 9 Solve 1014863 - 998303 = -345r for r. -48 Solve 576m - 5716 - 11791 = -642m + 6853 for m. 20 Solve -1212p + 1331 - 47 = -164p - 5004 for p. 6 Solve 3041h + 198712 = -20240 for h. -72 Solve 82y = 238y + 63 - 1467 for y. 9 Solve -164i - 146 + 614 = -204i - 428i for i. -1 Solve 140t - 460t + 25065 = 3625 for t. 67 Solve 0 = -1211r - 8049 + 21370 for r. 11 Solve 74q - 238q = 7440 - 1372 for q. -37 Solve -204y + 53*y	{ "pile_set_name": "DM Mathematics" }
es? 0.0002 Suppose -4d + 1565 = -g, -g - 375 = -d - 4g. Round d to the nearest one hundred. 400 Suppose -2 + 26 = 3q. Suppose 0 = -4d + 7 + 5. Suppose -35000 = -da + qa. Round a to the nearest one thousand. -7000 Let f = -245.802 - -245.441946. Let m = f + 0.36. Round m to five decimal places. -0.00005 Let q = 1036.99999579 - 1037. What is q rounded to seven decimal places? -0.0000042 Let u = -762 - -502. What is u rounded to the nearest one hundred? -300 Let i = -2.998 - -3. Let p = 0.0019938 - i. What is p rounded to 6 dps? -0.000006 Let k(d) = d*3 + 6d*2 + 5d + 6. Let b be k(-5). Let h(n) = n - 2. Let z be h(b). Suppose 2x - zx = -128000. What is x rounded to the nearest ten thousand? 60000 Let b = -0.71601243 + 0.716. Round b to 6 decimal places. -0.000012 Suppose 0 = -3l, -3n - l = -5l - 21. Suppose ny - 4y + 5812 = 5a, 4y = 4a - 4656. Round a to the nearest one hundred. 1200 Suppose 1319687 + 2880313 = -a. What is a rounded to the nearest 1000000? -4000000 Suppose 0 = -s - 2s + 51. Suppose -s = 5c + 43. Let r = c - 7. What is r rounded to the nearest 10? -20 Let c = 43.0000033 + -43. What is c rounded to six dps? 0.000003 Let a(u) = -68996u3 + u2 - 2u + 1. Let t be a(-5). Suppose 4f + t = -17375464. What is f rounded to the nearest one million? -7000000 Let u = 58.7 - 9.7. Let b = 48.9999947 - u. What is b rounded to 6 dps? -0.000005 Let h be (0 + -3)(-10)/6. Suppose -3v + ha - 2685 = 0, v + 880 = 3a - 19. What is v rounded to the nearest 100? -900 Suppose -107 = -g - 496. Let r = -114 - g. Let h = r + -180. What is h rounded to the nearest 10? 100 Let t = -0.288 - -0.419. What is t rounded to two decimal places? 0.13 Let q = 0.235 - 0.23500318. What is q rounded to six dps? -0.000003 Let k = -35.29 + -0.71. Let y = 33.1 + k. What is y rounded to the nearest integer? -3 Let g(u) be the first derivative of u4/4 - u3/3 + u2 - 3u + 6. Let n be g(4). What is n rounded to the nearest ten? 50 Let l = -75.8 + 14.8. Let t = -54.7 - l. Round t to the nearest integer. 6 Let m(v) be the third derivative of 0 + 374999/24v4 - 2v*2 + 0v + 2/3v3. Let x be m(4). Round x to the nearest one million. 2000000 Let w = 56374.08 - 54733. Let h = -1675 + w. Let k = -35 - h. Round k to one dp. -1.1 Let u = -158649 + 214354.5. Let y = u - 55638.49949. Let w = -67 + y. What is w rounded to four decimal places? 0.0005 Suppose 0 = -0x - 2x + 94. Let b(u) = 3u*3 + 5u*2 - u. Let s be b(-4). Let p = x + s. What is p rounded to the nearest ten? -60 Let b be (15/(-12))/(33/(-36) - -1). What is b rounded to the nearest ten? -20 Suppose -583 - 467 = -3t. Let w be (t/4)/(2/(-8000)). Round w to the nearest 100000. -400000 Let k = -1.45 - -1.45635. Round k to 3 dps. 0.006 Suppose -4y + 29945524 = 3g - 5394421, -5y + 23559975 = 2g. Suppose 2q + 3u = -2820031 - g, -21900002 = 3q + u. What is q rounded to the nearest 1000000? -7000000 Let d = 0.09 + 15.91. Let v = d - 16.00000021. Round v to 7 decimal places. -0.0000002 Let k = 22574.39 + -22479. Let n = -161 + 65. Let m = k + n. What is m rounded to one decimal place? -0.6 Suppose 0 = 4v + 2x + 15606, x - 1 = -4. What is v rounded to the nearest 1000? -4000 Let q = 29 + -20.3. Let m = -0.7 + q. Let a = 8.3 - m. What is a rounded to 1 decimal place? 0.3 Suppose -5549992 = 5c + 4l, 4l - 9l - 2219990 = 2c. What is c rounded to the nearest one hundred thousand? -1100000 Suppose -b + 2260000 = b + 3l, -2l = 5b - 5650000. What is b rounded to the nearest 100000? 1100000 Let v = -160.6 - -185. Let z = -26.408 + v. Let n = 2 + z. What is n rounded to 3 dps? -0.008 Let g(t) = -17501t*2 + t + 2. Let a be g(2). Round a to the nearest ten thousand. -70000 Let z = -3220664 + 3215251.061. Let r = 5407 + z. Let c = r - -6. Round c to 2 decimal places. 0.06 Let f = -38841.2 + 38851.200004. Let q = 10 - f. Round q to six dps. -0.000004 Let i = 0.044 + -0.04. Let b = -2578 + 2573.804. Let v = i - b. Round v to the nearest integer. 4 Let r = 11898741.5 - 11898749.5000017. Let d = r - -8. Round d to 6 dps. -0.000002 Let j = 133 + -133.000118. What is j rounded to 5 dps? -0.00012 Let z = -0.4 + 0.9. Let n = z - 0.500055. What is n rounded to 5 dps? -0.00006 Let z(k) = -9k*2 - 1961. Let b(f) = 5f*2 + 980. Let h(d) = 11b(d) + 6z(d). Let g be h(0). Let m = g + 2056. What is m rounded to the nearest 100? 1100 Let j = 6 + -6.15. Let d = 0.1511 + j. Round d to 4 decimal places. 0.0011 Suppose -4l - 8 = k, -7k + 3k - 4 = 2l. Suppose 2a - 4 = -ka. Let m be a/(-6) + (-2)/(-6). Round m to the nearest integer. 0 Let a = 7.083047955 - 25181.463046955. Let j = -25170.38 - a. Let s = 4 - j. Round s to 7 dps. 0.000001 Let z = 3 + -2.89. Let q = 0.04 + z. Let r = q + -0.15000017. What is r rounded to 7 decimal places? -0.0000002 Let o = 1.9 + -2.78. What is o rounded to one decimal place? -0.9 Let a = 15.55456 + 3.44654. Let w = a - 19. What is w rounded to 3 dps? 0.001 Let v = -0.281029 + 13.280997. Let o = -13 + v. What is o rounded to five dps? -0.00003 Let f = 24.976 - -0.024. Let z = 24.48 - f. Let o = 0.93 + z. Round o to one dp. 0.4 Let h = -0.047 - 0.067. What is h rounded to two dps? -0.11 Let k = -1987782 + 1204010. Let o = -464864 - k. Let p = o + -848908. What is p rounded to the nearest one hundred thousand? -500000 Let h = 11 + -10.99999938. What is h rounded to 7 decimal places? 0.0000006 Let k = -15.6 - -0.6. Let h = -15.022 - k. Round h to 2 dps. -0.02 Let x = 16 + -23. Let a(d) = 11632d*2 - 4d + 4. Let j be a(x). Suppose 0 = -v - 0v - j. Round v to the nearest one hundred thousand. -600000 Let h = -5834.3 - -5838.30015. Let n = -4 + h. Round n to four decimal places. 0.0002 Let o(n) = 359260n*3 - 3n*2 + 2n + 1. Let b = 4 - -1. Let j = b + -2. Let p be o(j). Round p to the nearest 1000000. 10000000 Let q = -2414452 - -2414398.00108. Let b = 54 + q. What is b rounded to four dps? 0.0011 Let z(i) = 22i2 + 5i + 18. Let n be z(14). Round n to the nearest 1000. 4000 Suppose -2391 - 8409 = 3b. What is b rounded to the nearest 1000? -4000 Let v = 4.6 - 4. Let u = v + -0.49. Let s = u - -0.21. What is s rounded to one dp? 0.3 Let j = -5 + 6. Let x = -1.2 + j. Let o = 0.20016 + x. Round o to four dps. 0.0002 Let l be (-4)/1 - (-100)/4. Let o be 2000(-7)/(l/240). Round o to the nearest one hundred thousand. -200000 Let s = -327.8 + 302. What is s rounded to the nearest integer? -26 Let i = -14.986 - -15. Let k = -0.112 + 0.04. Let q = i + k. What is q rounded to 2 decimal places? -0.06 Let f(m) = -52327m + 57. Let l be f(-9). What is l rounded to the nearest 100000? 500000 Let x = -247421637 - -247421588.00000115. Let s = -104 - -55. Let a = x - s. What is a rounded to seven decimal places? 0.0000012 Let u = -3 - -2.9999565. Round u to six decimal places. -0.000044 Let u = 5 - 4.9999885. What is u rounded to six decimal places? 0.000012 Let z(i) = 15i*2 + 12i + 16. Let q(y) = -11y3 + 2y2 + y. Let d be q(-1). Let t be z(d). Round t to the nearest 100. 2300 Let s = -456 + 1776. What is s rounded to the nearest one hundred? 1300 Let d(l) = 6 - l2 + 2l + 2l*3 - 3l + 4l. Let y be d(-6). Round y to the nearest 100. -500 Let o = 0.1 + -0.9. Let k = o - -1.1. Let w = 0.2999968 - k. What is w rounded to six decimal places? -0.000003 Let m = -5 - -4. Let h = 1.00008 + m. Round h to 4 decimal places. 0.0001 Let s = -11.7 + 11. Let z = 0.4122 + -1.112116. Let i = s - z. Round i to 5 dps. -0.00008 Let a = -3.8 - -5. Let o = -0.85 + a. Let b = 0.3466 - o. What is b rounded to three decimal places? -0.003 Let u(l) = -2l*2 - 2l. Let b be u(-2). Let f be 200000(-1 + (2 - b)). Round f to the nearest 1000000. 1000000 Let r = 964 + -963.99999609. Round r to six dps. 0.000004 Let u(v) = 340000v. Let s be u(5). Suppose 0 = k - 3k + s. What is k rounded to the nearest one hundred thousand? 900000 Let j = 10 + -8. Let r(d) = d2 - 3d + 2. Let g be r(j). Suppose -p - 72 - 178 = g. Round p to the nearest one hundred. -300 Let k = -109.8 + -14.2. Let n = k + 35. Let p = n - -89.0051. Round p to three decimal places. 0.005 Suppose -3w = -5j - 131995, -4w + 4j + 45174 = -130822. What is w rounded to the nearest 10000? 40000 Suppose 0 = -n - 1010176 - 1	{ "pile_set_name": "DM Mathematics" }
-3168? -527s - 6 What is the i'th term of -14220, -14107, -14020, -13971, -13972, -14035? -2i3 - i2 + 130i - 14347 What is the z'th term of 575, 2259, 5041, 8921, 13899, 19975, 27149? 549z*2 + 37z - 11 What is the i'th term of -15370, -15365, -15360, -15355? 5i - 15375 What is the m'th term of -42447, -84893, -127339, -169785? -42446m - 1 What is the w'th term of -28705, -57412, -86119? -28707w + 2 What is the o'th term of 1476895, 2953789, 4430683, 5907577, 7384471, 8861365? 1476894o + 1 What is the x'th term of 18547, 37068, 55591, 74116? x*2 + 18518x + 28 What is the w'th term of -11518, -11522, -11520, -11506, -11474, -11418? w*3 - 3w*2 - 2w - 11514 What is the a'th term of 26138, 52278, 78418, 104558, 130698, 156838? 26140a - 2 What is the x'th term of 426170, 852339, 1278508? 426169x + 1 What is the c'th term of -100, -726, -2392, -5614, -10908? -86c3 - 4c*2 - 12c + 2 What is the z'th term of 18814, 37617, 56410, 75193, 93966, 112729, 131482? -5z2 + 18818z + 1 What is the v'th term of -133119, -266227, -399321, -532401, -665467, -798519, -931557? 7v2 - 133129v + 3 What is the b'th term of 169464, 338914, 508364, 677814? 169450b + 14 What is the y'th term of 2274, 2225, 2094, 1875, 1562? -y3 - 35y*2 + 63y + 2247 What is the y'th term of -472, -468, -464, -460, -456, -452? 4y - 476 What is the f'th term of 822048, 822046, 822044, 822042? -2f + 822050 What is the o'th term of 6911, 13918, 20925, 27932? 7007o - 96 What is the o'th term of -216, -494, -962, -1620, -2468? -95o*2 + 7o - 128 What is the g'th term of -477086, -477084, -477080, -477074, -477066, -477056, -477044? g*2 - g - 477086 What is the y'th term of 70, 276, 616, 1090? 67y*2 + 5y - 2 What is the z'th term of 11431, 22862, 34293, 45724, 57155, 68586? 11431z What is the q'th term of 330, 500, 680, 876, 1094, 1340? q3 - q2 + 166q + 164 What is the b'th term of -419, -439, -459, -479, -499, -519? -20b - 399 What is the t'th term of -946361, -946360, -946359? t - 946362 What is the c'th term of 149, 7, -377, -1123, -2351? -20c3 - c2 + c + 169 What is the m'th term of 16437, 32876, 49281, 65634, 81917, 98112, 114201, 130166? -3m3 + m2 + 16457m - 18 What is the y'th term of -1299, -5172, -11629, -20676, -32319, -46564, -63417, -82884? -y*3 - 1286y*2 - 8y - 4 What is the q'th term of 56264, 56241, 56182, 56069, 55884, 55609, 55226, 54717? -3q3 - 2q + 56269 What is the v'th term of 27390, 54767, 82142, 109515? -v*2 + 27380v + 11 What is the t'th term of -10414, -41650, -93710, -166594, -260302? -10412t2 - 2 What is the k'th term of -1232, -1352, -1552, -1832, -2192, -2632? -40k*2 - 1192 What is the z'th term of 4230, 4239, 4248, 4257? 9z + 4221 What is the d'th term of 90, 190, 320, 486, 694, 950, 1260, 1630? d*3 + 9d*2 + 66d + 14 What is the q'th term of -730, -700, -670, -640, -610, -580? 30q - 760 What is the k'th term of 955, 871, 781, 685? -3k*2 - 75k + 1033 What is the u'th term of -1130224, -2260448, -3390672, -4520896? -1130224u What is the l'th term of -21061, -21028, -20993, -20956, -20917, -20876? l2 + 30l - 21092 What is the j'th term of 224, 1639, 5462, 12899, 25156? 201j3 - 2j*2 + 14j + 11 What is the u'th term of -13466, -13476, -13492, -13514, -13542, -13576? -3u2 - u - 13462 What is the w'th term of -56, 853, 2364, 4471, 7168, 10449, 14308, 18739? -w3 + 307w*2 - 5w - 357 What is the u'th term of -253968, -507939, -761912, -1015887, -1269864, -1523843, -1777824? -u*2 - 253968u + 1 What is the y'th term of 71, 159, 269, 413, 603? 2y3 - y2 + 77y - 7 What is the y'th term of -72628, -72609, -72586, -72559, -72528, -72493? 2y2 + 13y - 72643 What is the o'th term of 40, 118, 206, 310, 436? o3 - o2 + 74o - 34 What is the u'th term of -534975, -534941, -534895, -534831, -534743, -534625, -534471? u3 + 27u - 535003 What is the g'th term of 324, 521, 588, 525, 332, 9, -444? -65g2 + 392g - 3 What is the u'th term of -24, -10, 34, 120, 260, 466, 750, 1124? 2u3 + 3u*2 - 9u - 20 What is the x'th term of 2218, 8872, 19958, 35476? 2216x2 + 6x - 4 What is the i'th term of -341894, -683793, -1025692, -1367591, -1709490, -2051389? -341899i + 5 What is the x'th term of 2834167, 2834165, 2834163, 2834161? -2x + 2834169 What is the i'th term of -34934, -34942, -34954, -34970, -34990, -35014, -35042? -2i2 - 2i - 34930 What is the n'th term of -3065, -3093, -3153, -3251, -3393, -3585, -3833? -n*3 - 10n*2 + 9n - 3063 What is the c'th term of 9276, 9270, 9264, 9258? -6c + 9282 What is the p'th term of -5, 63, 275, 709, 1443, 2555, 4123? 13p*3 - 6p*2 - 5p - 7 What is the t'th term of -4064, -4062, -4060? 2t - 4066 What is the d'th term of 647, 1298, 1939, 2564, 3167, 3742, 4283? -d3 + d2 + 655d - 8 What is the m'th term of -556, -678, -800, -922, -1044, -1166? -122m - 434 What is the s'th term of -248111, -496209, -744297, -992369, -1240419, -1488441, -1736429? s3 - s2 - 248102s - 9 What is the k'th term of -1675, -3352, -5051, -6778, -8539? -k*3 - 5k*2 - 1655k - 14 What is the s'th term of -634, -1314, -2012, -2728, -3462, -4214? -9s2 - 653s + 28 What is the l'th term of 14878, 14886, 14900, 14920, 14946, 14978, 15016? 3l2 - l + 14876 What is the n'th term of 122920, 122914, 122908, 122902? -6n + 122926 What is the f'th term of 36097, 36214, 36409, 36682, 37033, 37462? 39f2 + 36058 What is the j'th term of -2424, -2431, -2438? -7j - 2417 What is the x'th term of -781, -1493, -2095, -2533, -2753? 9x3 + x2 - 778x - 13 What is the g'th term of 161, 921, 2289, 4265? 304g2 - 152g + 9 What is the j'th term of -576, -612, -666, -732, -804? j*3 - 15j*2 + 2j - 564 What is the l'th term of 25, 21, 17, 19, 33, 65, 121, 207? l*3 - 6l*2 + 7l + 23 What is the z'th term of 38, 563, 1986, 4757, 9326, 16143? 75z3 - z2 + 3z - 39 What is the y'th term of -2858, -2917, -2976, -3035, -3094? -59y - 2799 What is the p'th term of -44795, -44786, -44769, -44744, -44711? 4p*2 - 3p - 44796 What is the n'th term of 2642, 2599, 2544, 2471, 2374? -n*3 - 36n + 2679 What is the d'th term of 3255, 6508, 9761, 13014, 16267, 19520? 3253d + 2 What is the u'th term of 18733, 74907, 168531, 299605, 468129, 674103? 18725u*2 - u + 9 What is the i'th term of -193116, -193095, -193074, -193053, -193032? 21i - 193137 What is the d'th term of 7487, 7435, 7355, 7253, 7135, 7007, 6875? d*3 - 20d*2 + d + 7505 What is the f'th term of -84, 125, 694, 1803, 3632, 6361, 10170? 30f*3 - f - 113 What is the j'th term of 3530, 7031, 10502, 13943, 17354? -15j*2 + 3546j - 1 What is the q'th term of 308, 1183, 2574, 4427, 6688, 9303, 12218, 15379? -9q3 + 312q*2 + 2q + 3 What is the i'th term of 81006, 162016, 243026, 324036, 405046? 81010i - 4 What is the w'th term of 436, 496, 570, 658, 760, 876, 1006? 7w*2 + 39w + 390 What is the t'th term of -23029, -46056, -69083? -23027t - 2 What is the b'th term of 114930, 114926, 114922, 114918, 114914, 114910? -4b + 114934 What is the z'th term of 2064, 2214, 2494, 2928, 3540, 4354, 5394? 4z3 + 41z2 - z + 2020 What is the q'th term of -1138, -1418, -1878, -2512, -3314, -4278? q3 - 96q2 + q - 1044 What is the d'th term of 197, 413, 663, 965, 1337? 3d3 - d2 + 198d - 3 What is the l'th term of 39, 479, 1793, 4455, 8939, 15719, 25269, 38063? 79l*3 - 37l*2 - 2l - 1 What is the l'th term of -34109, -34112, -34115, -34118, -34121, -34124? -3l - 34106 What is the x'th term of 71, 207, 479, 953, 1695, 2771, 4247, 6189? 11x*3 + 2x*2 + 53x + 5 What is the i'th term of -138504, -138505, -138506, -138507, -138508, -138509? -i - 138503 What is the p'th term of 9802, 19604, 29394, 39166, 48914? -p*3 + 9809p - 6 What is the y'th term of 31923, 63834, 95735, 127626, 159507? -5y2 + 31926y + 2 What is the o'th term of 3110, 3103, 3096, 3089, 3082, 3075? -7o + 3117 What is the t'th term of 258389, 258386, 258373, 258344, 258293, 258214? -t3 + t2 + t + 258388 What is the y'th term of 484103, 484106, 484109? 3y + 484100 What is the i'th term of -174612, -174614, -174618, -174624, -174632, -174642, -174654? -i**2 + i - 174612 What is the d'th term	{ "pile_set_name": "DM Mathematics" }
(-60 + 64) - -14? 5 What is 19 + -70 + 32 + 16? -3 57 - ((52 - 48) + 2 + 14) 37 Calculate 11 + -2 - (-12 + (65 - 27)). -17 (-16 + 8 - 3 - -8) + (-1 - -3) -1 Evaluate -70 + 7 + 196 + -162. -29 What is -7 - (-10 - (-7 - 2))? -6 What is the value of 7 - (2 - -2) - (-3 - (1 + -1))? 6 What is the value of (-5 - 38) + 55 - 42? -30 What is the value of -8 - (-14 + (-2 - (1 + 2 + 0)))? 11 Evaluate 6 + (11 - 11) + -2. 4 What is the value of (-1 - (41 + -49)) + (1 - 3) + -12? -7 (-35 - (-6 - 9)) + -6 -26 What is the value of 46 + (-15 - -7) + -20? 18 What is 1 - 2 - ((10 - 0) + -7 + -11)? 7 Evaluate 3 - 10 - (-13 + 16) - -24. 14 Calculate -51 + 23 + 41 - (-7 + 0 + 1). 19 What is the value of (234 - 235) + (2 - (-3 - -1))? 3 What is the value of -12 + -1 + 2 + 11? 0 What is the value of -18 + 0 + 4 - -24 - (9 + 0)? 1 What is the value of (6 - 0) + (20 - 1 - (111 - 105))? 19 What is the value of (13 - -4) + 4 + -6? 15 Evaluate (6 - 1) + -7 + -8 + -3. -13 Calculate -10 - -8 - -3 - (-22 + 13). 10 7 - (-10 + 4 + -13 + 31) -5 Calculate 34 - 37 - 28 - -41. 10 Calculate -16 + 33 - 37 - (-1 - 7). -12 What is (-15 - (6 - 15)) + 0 + 13? 7 What is (7 - -5 - 16) + -1 + 8? 3 -22 - 2 - (284 + -315) 7 What is the value of 0 + 7 - (-46 - (50 - 99))? 4 What is the value of 4 - (-3 + 7) - (-19 + 27)? -8 Calculate -18 - (24 - 33 - -10). -19 Calculate (-1 - -5) + 3 + 1 + -2. 6 Calculate -19 - -11 - (0 + -6) - 12 - -2. -12 Calculate 24 + (-11 + 0 + 22 - (-2 - -11)). 26 Calculate -13 - (13 + -6 + -8). -12 What is the value of 12 + (-9 - 12) - (16 - 1)? -24 (-3 - (10 - 0)) + 10 + 5 2 What is (-13 + (8 - 7) - 3) + 12? -3 -3 + 26 + -31 + -26 -34 What is the value of -74 + 98 - (7 - 1)? 18 What is (-6 - -7) + -8 - (-1 + 2)? -8 Calculate 12 + (-4 - 3) - (-24 + 33). -4 -2 + -1 + -4 + (-4 - 4) + 5 -10 What is the value of (18 - (-28 - -38)) + 10? 18 What is the value of -18 + -2 - (136 - 153)? -3 What is -6 - -3 - (2 - 22) - 10? 7 6 + 16 - (19 - -12) -9 (7 - 4 - -5) + -6 - 9 -7 What is (-15 - (-10 - 2)) + -4? -7 Calculate 2 + -6 + (-15 - -12) - 27 - -2. -32 Calculate 4 + -10 + 2 + (-4 - -4). -4 (-8 - (9 + 3 + -8)) + 3 + -4 -13 Calculate -34 + 2 + 1 + 13 + -12. -30 -7 + 9 - (-1 + 7) - (136 - 124) -16 What is the value of (-11 - (33 + -77)) + -38? -5 What is the value of 26 + 4 + -8 + -14? 8 Evaluate 14 + -37 + (-33 - -35). -21 What is (1 - 0 - 2) + (-17 - (-7 - 6))? -5 Calculate 14 + (2 - 3 - (3 - 1)) - -1. 12 Calculate (2 - 28) + 2 + (-49 - -92) + -40. -21 What is -10 - -36 - (7 - -7)? 12 What is the value of -11 + 1 + (-3 - 5 - -5)? -13 What is -6 + 12 + 12 + -11? 7 Evaluate (-19 - 14) + 16 + 20 + 0. 3 What is (11 - 23) + 20 + 6? 14 What is the value of 17 - (-19 + 1 + 11 + 15)? 9 What is (20 - 1) + (32 - 58) + 10? 3 What is the value of -3 + 1 - -3 - (-1 + -7)? 9 Evaluate 1 + -5 - (20 - (9 - -22)). 7 Calculate (-4 - 15) + 48 + -14 + (-2 - -13). 26 Calculate -12 + -24 + 34 - 13. -15 What is -12 - (17 - 18 - (0 - -22))? 11 Calculate -2 + -8 + 3 + (-7 - -20). 6 What is -30 + 20 - (-30 + 11)? 9 Calculate 23 - (48 + -28) - 10. -7 What is the value of (-21 - -45) + -27 + (-1 - 1)? -5 What is the value of (-4 - -6) + (6 - 1 - -3) + -11? -1 -14 + 0 - (-15 + 10) - -1 -8 8 - (0 + -2 + (-8 - -7) + 11) 0 What is the value of 2 - (-5 + 1 + 19 + 1)? -14 What is -4 + 4 + 2 - 4 - 11? -13 What is the value of (3 + 23 - 22) + (1 - 1) + -1? 3 What is the value of (19 - -2) + (-118 - -89)? -8 Evaluate (-266 - -262) + (-3 + -4 - (1 - 0)). -12 What is -514 - -502 - ((-3 - -17) + -2)? -24 Calculate (2 - -3) + 6 + -5 + 10 + -3. 13 What is -3 - (1 + 2 + -7 + 10 + -3)? -6 Calculate 2 - -1 - (-11 + (-15 - -8) + 14). 7 13 + (9 - 5) - 15 2 What is the value of 13 + -30 + (5 - (2 - (8 - 6)))? -12 What is the value of (4 - 0) + (-55 - 12) + 29? -34 (3 - -1) + -2 - (31 + -31) 2 What is 0 + 1 + 4 - (-227 - -245) - 1? -14 Evaluate (4 + 1 - (-42 + 36)) + -9 + -23. -21 Evaluate -7 + (-6 - -1 - (-13 + 4)). -3 What is the value of (-34 - -40) + -1 + 24 + -7 - 1? 21 -59 - (-15 - 3) - -20 -21 2 - -2 - ((-14 + 3 - -14) + 3) -2 -6 + -3 + (-3 - (-10 - (-8 + 0))) -10 8 - (-12 + 4 + (40 - (-1 - 6))) -31 Evaluate 4 + -6 + -3 - ((2 - 0) + 1). -8 Calculate (17 - (19 - 14)) + -13. -1 What is the value of (-11 - -13 - (0 + 0)) + -10? -8 (-24 - -47 - 39) + (2 - 14) -28 What is -5 + (2 + 6 + -12 - (-1 + -2))? -6 Calculate -2 + (24 - 26) - (0 + 10 + -2). -12 -1 + -12 + (-19 - -62) + -11 19 -25 + (6 - -3) + -1 + 7 -10 What is the value of (17 - 4) + 2 + 5? 20 Evaluate -164 - -145 - (-2 + -5). -12 What is (-3 - -1) + -82 + 31 + 66? 13 Evaluate 11 - (-10 - (-8 + -2)). 11 Evaluate (0 + -7 + -1 - (306 - 312)) + 17. 15 -2 + 27 + (-3 - 3) 19 Evaluate 3 + -73 + 53 + -15. -32 What is the value of 5 + 26 + -1 + (3 - 5) + -2? 26 What is the value of (-6 + 25 - 41) + 10? -12 What is the value of -1 + 11 - ((-5 - -3) + 3 + -8)? 17 Calculate (2 - 12) + 10 + (-1 - -2) + -11. -10 What is 7 - 3 - (7 + -19 + 22)? -6 12 - (8 - (10 - 0)) - 3 11 Evaluate 10 - (-3 + -9 + 8 + 2 + 0). 12 What is the value of -15 - 4 - (9 + -3 - 14)? -11 Evaluate 7 - (61 + (-15 - 19)). -20 Evaluate -1 + -7 - (-78 + 55) - -2. 17 -11 - ((-2 - 5) + 0 + 5) -9 What is the value of -8 + -8 - (45 - 64)? 3 What is the value of (9 + -5 - -1) + (35 - 44)? -4 Evaluate -42 + 46 + -9 - (-24 - 0). 19 What is the value of 20 + -8 + 4 + 2 + (-2 - -10)? 26 3 + (-18 - -6) + 10 + (-1 - -4) 4 Calculate 21 + 1 + -5 + (1 - (6 - 3)). 15 What is the value of 72 + -58 + -3 + -3 + 8? 16 What is -7 - -24 - -6 - (-3 + 5 - -3)? 18 What is -24 + 6 - (-14 - -9)? -13 What is 0 + 19 + 1464 + -1469? 14 Calculate -5 - (7 - (-1 + -4 + 3)). -14 What is the value of -1 - (-2 + 16) - -1? -14 What is -3 + (-8 - (-1 - 6 - -5)) + -1? -10 Evaluate 26 + (5 + -8 + -3 + 15 - 8). 27 -14 + 49 + -14 + -13 - (12 - 1) -3 9 - ((5 - (-9 - -3)) + -5) 3 What is -14 - (14 - 33) - -6? 11 What is the value of 7 - (-30 + 8 + 14)? 15 Calculate -27 - (-16 + -6 + -7). 2 What is -1 + -4 + (-1 - (-4 + -4 - -12))? -10 What is -30 - (4 + (-41 - -8))? -1 Evaluate -19 + -9 + -39 + 35 + (2 - -8). -22 Calculate (1 - 2) + -26 + 21 + 14 + -6. 2 What is (-4 - 0) + (-130 - -137)? 3 -4 + 77 + -75 + 1 + -6 - -34 27 (-23 - -32) + -23 - 3 -17 Evaluate -4 + 1 - -10 - (0 + (-4 - -6)). 5 1 + (9 - -5) + -13 + 3 5 What is the value of -18 - (-11 + 13 + -1)? -19 (53 + -11 - 30) + 3 15 Evaluate (-7 - -9 - -2) + -16. -12 Evaluate 3 + -3 + (39 - 19) + (-2 - 0). 18 Calculate 6 - (-1 + 12) - -6. 1 Evaluate 1 + -4 + 3 - (8 + -29 + 19). 2 Evaluate 18 - 5 - 20 - -37 - (9 + 1). 20 Calculate 8 + (125 + -126 - (8 + 0)). -1 What is 21 - (-20 + 17 + 3)? 21 Calculate -7 - (6 + -12) - (3 + -13 - 9). 18 What is the value of -6 - (-4 - 4) - (-9 + 23)? -12 What is (-11 + 11 - 3) + -5 + -1? -9 Calculate (6 - (26 - 35)) + -2. 13 Calculate -122 + 100 + (-3 - -7). -18 Calculate (-117 - -129) + ((-1 - 0) + 1 - 2). 10 Calculate 6 - (7 + 5) - 3. -9 Calculate 0 + (-22 - -17) + -1. -6 What is the value of 1 + (-36 + 1 - (9 - (-6 + 26)))? -23 -26 + 19 - (-4 + -1) -2 What is -17 + (-18 - -29 - (-6 + 4))? -4 What is the value of (-1 - -1 - -9) + (-661 - -646)? -6 Calculate 7 + (-15 - (-23 - -5)). 10 What is -11 - (-25 + 59 + -29 + -12 + 0)? -4 Evaluate 1 + 2 + (-9 - -4) + -6 - -19. 11 What is the value of 4 - (-23 + 60) - 2? -35 What is the value of 3 - (5 + 4 + (13 - 7))? -12 6 - (11 - (-10 - (3 + -6 - 1))) -11 What is (-79 - -80) + (-2 + 3 - 1) + -8? -7 -16 - ((-34 - -34) + (-12 - -3)) -7 What is -23 - -2 - (851 + -867)? -5 Evaluate 4 + (1 - 0) - ((15 - -6) + -9). -7 Evaluate (-2 + 5 - -5) + -17 + 1. -8 1774 + -1769 + (-32 - 0) -27 What is the value of 7 - (-3 + 3) - 12 - (-22 - 9)? 26 What is -2 - -18 - (42 - 27) - -13? 14 Calculate -2 + -20 + 552 + -510. 20 What is 0 + 1 - (21 - (16 - (7 + -1)))? -10 What is (1 - 11) + 44 + -10 + -10? 14 What is the value of 0 - -16 - (-72 + 78)? 10 Calculate (-5 - (-7 - 6) - 7) + -5. -4 14 + 0 - (365 - 350) -1 What is 12 - (-19 + (3 - 0) + -1)? 29 Calculate (20 - 31 - (-6 - 3)) + 6 + -1. 3 22 - 13 - (0 + (-2 + 3 - -5)) 3 Evaluate (1251 - 1261) + (1 - -12). 3 Evaluate -13 + -2 + (-283 - -301). 3 15 - (13 + (-3 - 2)) 7 What is the value of 8 + -4 + 4 - 4 - -2? 6 (-15 - (-6 + -3)) + -11 + 3 -14 Calculate (9 - 0) + -82 + (-26 - -83). -16 What is	{ "pile_set_name": "DM Mathematics" }
ate the highest common factor of 2100 and 4050. 150 Calculate the highest common divisor of 57183 and 98. 49 Calculate the highest common divisor of 20438 and 110. 22 What is the greatest common factor of 151192 and 168? 8 Calculate the highest common factor of 259202 and 436. 218 What is the greatest common divisor of 184 and 66884? 92 What is the highest common factor of 40 and 44340? 20 What is the highest common divisor of 833 and 2992? 17 What is the greatest common divisor of 4380 and 1200? 60 Calculate the greatest common divisor of 59772 and 816. 204 Calculate the highest common divisor of 322636 and 316. 316 Calculate the greatest common factor of 188221 and 8591. 781 What is the highest common factor of 37644 and 1044? 12 What is the highest common divisor of 2759 and 12193? 89 Calculate the highest common divisor of 303854 and 556. 278 What is the greatest common divisor of 212941 and 93344? 2917 What is the greatest common factor of 8838480 and 7? 7 What is the greatest common factor of 1984883 and 127? 127 What is the greatest common divisor of 780 and 26580? 60 Calculate the highest common factor of 2562 and 199958. 122 Calculate the highest common divisor of 329 and 8883. 329 What is the highest common factor of 49392 and 432? 144 What is the greatest common factor of 971794 and 21998? 1294 What is the greatest common divisor of 102 and 897906? 102 What is the highest common factor of 172184 and 12? 4 What is the greatest common divisor of 424 and 33788984? 424 Calculate the highest common divisor of 206325 and 5544. 63 Calculate the highest common divisor of 12362 and 728. 14 What is the greatest common divisor of 2048 and 2636? 4 Calculate the highest common divisor of 73020 and 180. 60 What is the greatest common divisor of 1122 and 101184? 102 What is the greatest common factor of 142728 and 15650? 626 What is the greatest common factor of 1340 and 1480? 20 Calculate the greatest common factor of 48 and 8223. 3 What is the highest common factor of 37152 and 4? 4 What is the highest common factor of 1490 and 370? 10 Calculate the greatest common divisor of 45 and 235. 5 Calculate the greatest common factor of 676 and 852267. 169 What is the greatest common factor of 193074 and 42? 42 What is the highest common factor of 3712 and 108? 4 Calculate the highest common divisor of 145255 and 440. 55 What is the highest common factor of 70 and 1946? 14 What is the greatest common divisor of 2930 and 2029318? 586 Calculate the greatest common factor of 73559 and 34. 17 What is the highest common factor of 1178 and 7391? 19 Calculate the greatest common factor of 2790 and 6390. 90 What is the highest common factor of 5087370 and 115? 115 What is the greatest common divisor of 286 and 488642? 22 Calculate the highest common factor of 457 and 1036019. 457 What is the highest common factor of 11070 and 150? 30 What is the greatest common factor of 329165 and 215? 215 What is the highest common factor of 648635 and 255? 85 Calculate the greatest common divisor of 26734 and 8. 2 Calculate the greatest common divisor of 51969 and 1173. 51 What is the greatest common divisor of 1148 and 6300? 28 What is the greatest common factor of 45200 and 9600? 400 What is the highest common divisor of 196 and 33838? 14 Calculate the highest common factor of 63570 and 234. 78 What is the greatest common divisor of 437100 and 744? 372 What is the highest common divisor of 12169 and 16125? 43 What is the highest common factor of 680 and 4190? 10 What is the highest common divisor of 7 and 41027? 7 What is the greatest common divisor of 2488 and 18971? 311 What is the highest common divisor of 26 and 183794? 26 What is the greatest common divisor of 1813 and 5383? 7 What is the greatest common divisor of 80784 and 616? 88 What is the greatest common divisor of 395 and 369720? 395 What is the highest common factor of 18096 and 24? 24 What is the highest common factor of 1458 and 3294? 54 What is the highest common divisor of 153259 and 1? 1 Calculate the greatest common factor of 8016 and 498. 6 Calculate the highest common factor of 2530304 and 7060. 1412 What is the highest common divisor of 199694 and 638? 638 What is the greatest common divisor of 62 and 4887646? 62 What is the greatest common factor of 94599 and 1449? 207 What is the greatest common divisor of 1656897 and 33? 33 What is the highest common divisor of 1800 and 576? 72 Calculate the highest common factor of 45505 and 100. 5 What is the highest common divisor of 714 and 2149? 7 Calculate the highest common divisor of 45734 and 169. 13 What is the highest common divisor of 90 and 440955? 45 Calculate the highest common factor of 240 and 61536. 48 What is the highest common divisor of 5725 and 151369? 229 What is the greatest common divisor of 108 and 104232? 12 Calculate the highest common factor of 27 and 40230. 27 Calculate the highest common divisor of 337672 and 8. 8 What is the highest common divisor of 20465 and 805? 5 What is the highest common factor of 42 and 4589781? 21 Calculate the greatest common factor of 39610 and 2796. 466 What is the greatest common divisor of 12994 and 1898? 146 What is the greatest common divisor of 37 and 1295333? 37 What is the greatest common divisor of 377 and 755677? 13 Calculate the highest common divisor of 136 and 1999064. 136 Calculate the greatest common divisor of 30769 and 377. 29 Calculate the greatest common divisor of 364 and 3250. 26 What is the greatest common divisor of 3132 and 4428? 108 Calculate the highest common factor of 1267035 and 135. 15 What is the highest common factor of 8793 and 711? 9 What is the highest common divisor of 49 and 412377? 7 Calculate the greatest common divisor of 42 and 118860. 42 Calculate the highest common factor of 3268 and 4522. 38 What is the greatest common divisor of 5940 and 3548160? 1980 Calculate the greatest common divisor of 230448 and 648. 24 Calculate the highest common factor of 64 and 284488. 8 What is the greatest common factor of 273357 and 315? 63 Calculate the highest common divisor of 22 and 3038. 2 What is the highest common divisor of 22 and 31031? 11 What is the greatest common divisor of 242 and 5786? 22 Calculate the greatest common divisor of 2763 and 63. 9 What is the greatest common factor of 3520 and 30? 10 Calculate the greatest common divisor of 21053 and 629. 37 What is the greatest common factor of 4704 and 115836? 588 What is the highest common divisor of 461004 and 492? 492 Calculate the highest common factor of 1548 and 60768. 36 What is the greatest common divisor of 580 and 38050? 10 What is the greatest common factor of 882 and 26586? 126 Calculate the highest common factor of 535548 and 117. 39 What is the greatest common divisor of 21560 and 131120? 440 Calculate the highest common divisor of 5575 and 6913. 223 What is the greatest common factor of 87 and 242817? 87 Calculate the highest common divisor of 16552 and 152. 8 What is the highest common factor of 29382 and 747? 249 What is the highest common divisor of 651 and 95325? 93 Calculate the highest common divisor of 317107 and 3738. 623 What is the greatest common factor of 18 and 239157? 9 What is the greatest common divisor of 78585 and 744? 93 What is the highest common divisor of 79226 and 7? 7 Calculate the greatest common factor of 71382 and 6. 6 Calculate the highest common factor of 48 and 14904. 24 Calculate the highest common factor of 71651 and 411. 137 Calculate the greatest common factor of 7678 and 242. 22 Calculate the greatest common factor of 26 and 31342. 2 What is the greatest common divisor of 33 and 254375? 11 What is the greatest common factor of 408 and 11169? 51 What is the highest common divisor of 120484 and 448? 28 What is the highest common divisor of 183 and 29613? 3 What is the greatest common factor of 153 and 1089? 9 What is the greatest common factor of 21651 and 91? 7 What is the greatest common divisor of 30294 and 9350? 374 What is the greatest common divisor of 26975 and 96031? 1079 What is the greatest common factor of 1236 and 19356? 12 What is the highest common divisor of 213939 and 99? 99 What is the greatest common divisor of 455 and 63115? 65 What is the greatest	{ "pile_set_name": "DM Mathematics" }
-24b2r + 24b2 Find the second derivative of 256k*3r*5 + 7k*3 - 5k*2r wrt r. 5120k3r*3 Find the second derivative of 3a3 - a2 + 4619a wrt a. 18a - 2 What is the third derivative of -23i4u*2 + 9i*3u2 + i3 + 1949i2u*2 + 2u*2 wrt i? -552iu2 + 54u*2 + 6 Find the third derivative of 29i*6 - 6i*4 - 226i*2 + 1. 3480i*3 - 144i What is the second derivative of 41rt*3 + 10rt + 51r - 15t5 wrt t? 246rt - 300t*3 What is the second derivative of 828l*2 + 275l - 1 wrt l? 1656 What is the second derivative of 22824n5 - 2513n wrt n? 456480n3 Differentiate 93g*3p - 2g3 + 191g*2j*3 - 3g*2j*2 - 4gj2p - 2j3p wrt p. 93g3 - 4gj2 - 2j*3 Differentiate -2w*4 + 28w*3 + 270 with respect to w. -8w*3 + 84w*2 What is the third derivative of -dk*3v*3 + 105dkv*3 + 51dv - 5k*3v2 - k3 - 2kv*3 wrt v? -6dk3 + 630dk - 12k Find the first derivative of -11n2q - 3541n2 - 158nq wrt q. -11n*2 - 158n What is the derivative of f*4t + 2f2m*3 + 15f*2t - 113m3t wrt f? 4f3t + 4fm*3 + 30ft Find the second derivative of -9768y*3 + 17749y. -58608y Find the second derivative of -208p*4 + 16p*3 + 1050p - 1. -2496p2 + 96p Find the third derivative of -2277y3 - y2 - 1465y wrt y. -13662 Find the third derivative of -2391p5 + 2389p*2. -143460p*2 What is the second derivative of -82o*3 - 3o*2 - 2o - 40? -492o - 6 What is the derivative of -5323z*2 + 2289 wrt z? -10646z Differentiate -95a2r*2 + 167a*2 + ar*2 wrt r. -190a*2r + 2ar Find the third derivative of -314b3 - 137b*2 + 1 wrt b. -1884 What is the second derivative of -175f*4 - 114f - 2? -2100f2 Find the third derivative of -j5 - 7j*4 + 121j*3 + 15244j*2 wrt j. -60j*2 - 168j + 726 Find the second derivative of j*2s3 - j2s2 - 5j*2s - 19js*3 + 17js wrt s. 6j*2s - 2j2 - 114js Find the second derivative of -6hl2x + 2hlwx - hwx*2 + 48l*2wx3 - 5l*2wx + 2lx + 4wx - 3x*3 wrt x. -2hw + 288l*2wx - 18x Find the first derivative of 406b3 + 8b + 7377 wrt b. 1218b2 + 8 Find the second derivative of 7p*3tz + p3t - p*3 - 99p*2t - ptz + 3t - 31z wrt p. 42ptz + 6pt - 6p - 198t What is the third derivative of 8h*4 - 98h3 - h2 - 1161h? 192h - 588 Find the third derivative of -3no*2u*3 - 2no2u + 327o2u4 + o2u + 9ou2 wrt u. -18no2 + 7848o*2u What is the second derivative of 4c2i + c*2 + 10ci - 2i wrt c? 8i + 2 Find the third derivative of -25b*2j*3y - b*2j2 + b2 + 3bj*3y - bj - 11j*2y wrt j. -150b2y + 18by What is the derivative of -241j4 + 326 wrt j? -964j*3 What is the third derivative of -18i*6 + 13i*3s + 19i2s - 3is wrt i? -2160i3 + 78s Find the third derivative of -2a3k*3 + 3a*3k + 14a2k*2 - 106ak4 wrt k. -12a*3 - 2544ak Differentiate -3x*2 - 6x + 1563 with respect to x. -6x - 6 What is the derivative of 3au2 - 2au - 7072a + 6u2 + 4u wrt u? 6au - 2a + 12u + 4 Find the third derivative of a*4q*2 + 2a*3q*2 - 3a*2q*2 - 10a*2q + 2q2 wrt a. 24aq2 + 12q*2 Find the second derivative of 346u*4 - 20u - 4. 4152u2 What is the first derivative of -2j*2t*2 + 22jt2 + j + 422t*2 wrt j? -4jt2 + 22t*2 + 1 Find the third derivative of 484f*3v*2 - 337f*2v*2 + 2fv2 wrt f. 2904v*2 Differentiate 93j*3n + j*3s - 4jn*3s + 224jns + 19n3 - s with respect to s. j3 - 4jn*3 + 224jn - 1 What is the derivative of -1237mz2 + 109z*2 + z wrt m? -1237z*2 Differentiate 2gvy*2 - gxy3 - 2gxy + 7vxy3 + 2vxy - 2xy + 3y3 with respect to v. 2gy2 + 7xy3 + 2xy What is the third derivative of -93w*5 - 2w*4y + w*2y + 2wy - 99w wrt w? -5580w*2 - 48wy What is the third derivative of -20602i*3 + 359i*2 - 4i - 5? -123612 What is the third derivative of -3a5 - 210a*3k - 26a2k - 2a2 - a wrt a? -180a*2 - 1260k What is the third derivative of -3229t3 - 8749t*2? -19374 What is the second derivative of cv*4 + 14267cv3 - 402cv + c + 2 wrt v? 12cv2 + 85602cv Differentiate -3qr + 106q + 377r with respect to q. -3r + 106 Find the second derivative of 12j2k*2l - 2j2l*2 + 7j*2l - 76jk*2l*2 + 2jl2 - 201kl2 wrt k. 24j*2l - 152jl*2 Find the third derivative of 5666u*6 - 4u*2 - 28u + 1. 679920u3 What is the third derivative of 64p*5 + 47p*2 - 2p wrt p? 3840p2 Find the first derivative of -498gj3 - 201j*3 wrt g. -498j*3 What is the derivative of 11aix - ai - 97ax - 4x wrt i? 11ax - a What is the second derivative of 82h3m*2 - 2h*3 - 210hm wrt m? 164h*3 What is the second derivative of -1653d*2 + 2d + 198 wrt d? -3306 What is the derivative of 2d3 - 31d*2m + 25d + 279m - 1 wrt d? 6d2 - 62dm + 25 What is the second derivative of 2184r*3 + 10r + 9 wrt r? 13104r What is the second derivative of 497v*2 + 45v + 6 wrt v? 994 What is the third derivative of 1755g3 - 2395g*2 wrt g? 10530 What is the second derivative of 264g*2 + 2693g? 528 Find the first derivative of -176v2 - 3v + 2230 wrt v. -352v - 3 Find the first derivative of -2jl2p - 3jl*2 - jlp + jl - 12lp - 32l wrt p. -2jl2 - jl - 12l What is the derivative of 4010p*2 + 2p - 1714? 8020p + 2 What is the third derivative of -9921q*3 + 162q*2 - 10 wrt q? -59526 Differentiate -4s*4 - 6s + 56 with respect to s. -16s3 - 6 What is the third derivative of 8u6 + u5 + 30u4 + 85u*2 - 3u? 960u3 + 60u*2 + 720u Find the first derivative of 26w4 + 6w*3 - 342. 104w*3 + 18w*2 Find the third derivative of 26s*5 + 30s*2. 1560s*2 What is the second derivative of -41m*2o*2 + 234m*2ow + 88mo2 - 60mow - mw wrt m? -82o*2 + 468ow What is the second derivative of -4d*2x4 + d2x + 63dx4 - 14dx + 2 wrt x? -48d*2x*2 + 756dx2 Find the second derivative of -2hy5 - 9hy2 + hy - 7h - 513y*2 - 40y - 1 wrt y. -40hy*3 - 18h - 1026 Find the second derivative of 3327o5 - 29o - 39. 66540o3 Find the third derivative of -2842g*3x*3 + 3g*3x2 - g2x - 17x*2 wrt x. -17052g*3 Differentiate 67v - 180 with respect to v. 67 Find the second derivative of -14g3i*3 + 2g*3i - g*3 - 7i*3 + 53i wrt i. -84g3i - 42i Find the second derivative of 2h*2l*2x - 6h2l*2 + 2h*2l - 4h2 + 3hl2 + hlx + 5hl + 4l*2x + 2 wrt h. 4l2x - 12l2 + 4l - 8 What is the derivative of 6np*2z - 3npz + 9nz - 23n - 3p3 wrt p? 12npz - 3nz - 9p2 Find the second derivative of 5724o*5 - 8980o. 114480o3 What is the derivative of -18o*3p3 + o3 + 22p3 wrt o? -54o*2p*3 + 3o*2 What is the third derivative of 4077sy3 - 4sy2 + 2sy - 191y wrt y? 24462s Find the second derivative of -479u*2x3 + u2x - 2ux3 + 428ux + 1 wrt u. -958x*3 + 2x Find the third derivative of 1430g3ir2 - 2g*3i - 566g2r*2 + 3g*2 - 2ir2 - i wrt g. 8580ir2 - 12i What is the third derivative of 36p5 - p3 - 141p*2? 2160p*2 - 6 Find the first derivative of 176by2 + 90y*2 wrt b. 176y2 What is the second derivative of -p4 - 2p3 + 487p*2 - 3p + 192 wrt p? -12p2 - 12p + 974 What is the second derivative of -9l3m - 16l3p2 + l2m2 - 1860lm2p*2 + lmp wrt l? -54lm - 96lp2 + 2m*2 What is the third derivative of -6k*5 + 11k4 - k2 - 59k wrt k? -360k*2 + 264k Find the first derivative of -3hs*2 - hs - 10h + 996s + 179 wrt s. -6hs - h + 996 What is the second derivative of b*3 + 37b*2 + 201b? 6b + 74 What is the third derivative of -2a*4s*3 + 59a4 - a3s2 - 2a*2 + 23as3 - 4as2 wrt a? -48as3 + 1416a - 6s2 Find the third derivative of -225g*2q4 - g2q3 - 1764g*2q*2 wrt q. -5400g*2q - 6g2 Differentiate -22qr + 36q - 1246r wrt q. -22r	{ "pile_set_name": "DM Mathematics" }
ich is the closest to 3.1? (a) -115 (b) 3/239 (c) -0.4 b Which is the closest to -1? (a) 2.1 (b) 0.1 (c) 5 (d) -3.22 (e) -0.8 e Which is the closest to -18? (a) -20 (b) 931 (c) 0.2 a Which is the closest to 1? (a) 21 (b) 1053 (c) 0.15 (d) -1/2 (e) -5 c What is the closest to 1/9 in -3, 4, -18, 50, 151? -3 What is the closest to 4 in 17, -10, 0, 0.978, 0.4? 0.978 What is the nearest to 2/51 in -311, -1/7, -4, 13/5? -1/7 What is the nearest to -778 in 2052, 0.1, -0.3? -0.3 Which is the closest to -2/3? (a) -111 (b) -0.1 (c) 0.1 (d) 1 (e) 1/12 b Which is the nearest to -804? (a) -8 (b) -1/16 (c) 13/5 a Which is the nearest to 9? (a) -161 (b) -0.1 (c) 2 (d) 154 (e) 0.1 c What is the nearest to 0.02 in 2, 24969, -0.4? -0.4 Which is the closest to -1? (a) 876 (b) 0.3 (c) 2 (d) 94 b Which is the closest to -2/7? (a) -32/11 (b) 5 (c) -1138 (d) -2/5 d What is the nearest to -18 in 0.3, 557/5, -5? -5 Which is the closest to 0.1? (a) 4/3 (b) -47 (c) 3895 (d) 3 (e) 0 (f) -0.2 e Which is the nearest to 93? (a) -5 (b) -0.3 (c) 13 (d) 3 (e) 1 c What is the closest to 90 in -2, 0.1, -110/9, -0.5, -4? 0.1 What is the nearest to -66 in -15, 0.06, 33, 0.5, 0.1, 0? -15 What is the nearest to 22 in 3/979, 10, 0? 10 Which is the nearest to 0.1? (a) 1 (b) 4/3 (c) 11/31 (d) 18 (e) 3 c What is the nearest to -0.2 in 1/4, 21617.4, -2? 1/4 Which is the closest to -2/7? (a) 3 (b) 5.2 (c) -225/4 (d) -0.03 d Which is the nearest to 0? (a) 0.4 (b) 0.1 (c) 1.07 (d) 3504 b What is the nearest to -0.1 in -1/8, 0.552, -3/91, -2? -1/8 Which is the closest to -2249.2? (a) -2917 (b) -0.3 (c) -5 a What is the nearest to -1 in -2/19, 0.1, 0.4, -0.0008359? -2/19 Which is the nearest to -505/6? (a) 1/11 (b) 3 (c) -2 (d) -5 (e) 0 d Which is the closest to 2/3? (a) -1.8 (b) -1 (c) 1 (d) -0.5 (e) 0.2 (f) 3/10408 c Which is the nearest to -1? (a) 1/2 (b) -16/7 (c) 286 (d) -301 (e) -4/7 e Which is the nearest to -0.3? (a) -0.1 (b) 5/4 (c) 3 (d) 0 (e) -5 a Which is the closest to 2/3? (a) 38/3 (b) -2/11 (c) 3099 b What is the closest to 2/9 in 0.5, -4, -8, 104, -112? 0.5 What is the nearest to -181 in 1, -0.09, 25? -0.09 Which is the closest to 4? (a) 0.3 (b) -62 (c) 1 (d) -35 (e) 6 (f) -0.15 e Which is the closest to -6254/9? (a) -2/15 (b) 2.6 (c) 1 (d) 0.4 a Which is the nearest to 14/13? (a) 0 (b) 6/5 (c) 0.17 (d) 0.06 (e) -6/5 b What is the nearest to -21762 in -6/5, 12, 2? -6/5 Which is the closest to -1? (a) 4 (b) -10/21 (c) 5 (d) -4 (e) -1968 b Which is the closest to -2/5? (a) -9 (b) 46 (c) -2/9 (d) 139 (e) -4 c Which is the nearest to 1? (a) -49 (b) 23 (c) 1320 b What is the closest to 1/45 in -0.5999, 1/2, 1? 1/2 Which is the closest to -2? (a) 11/5 (b) -3.31 (c) 0.4 (d) -5 (e) 2/153 (f) 2/19 b Which is the nearest to 0? (a) -5 (b) 0.02 (c) 34073 b Which is the nearest to 16? (a) -4 (b) -5/2 (c) 0.4 (d) -37 (e) -0.08 c Which is the nearest to 11? (a) 1 (b) -24 (c) 2/3 (d) -179 (e) 0.4 a Which is the closest to 6689.82? (a) -2/3 (b) 4 (c) 0 b What is the nearest to -19 in 0, -1, -120, 15.1? -1 Which is the closest to -0.4? (a) 1003 (b) 7 (c) -0.3 c Which is the closest to 2/3? (a) -52 (b) 94 (c) 3 (d) -60 (e) 0.4 e What is the nearest to 2 in 3, -1.4, 0.01, -3724, -3? 3 Which is the nearest to -43? (a) 745 (b) -3 (c) 2/17 b What is the nearest to -2/35 in -4/245, -5, -1911, -0.5? -4/245 Which is the closest to -2/9? (a) -147 (b) -19.9 (c) 17 c Which is the closest to -9? (a) 1 (b) 0.4 (c) 0.04 (d) -589 (e) -1/8 e Which is the nearest to -0.2? (a) -1.4 (b) 253/212 (c) -3 a What is the closest to -1 in -2, -3, -1/5, -49033/2? -1/5 What is the nearest to 0.033 in -503/3, 114, 2? 2 What is the nearest to 1 in 0.3, 5/3, 0.051, -2/5? 5/3 What is the nearest to -4/19 in 42, 20/31, 4, -2/3? -2/3 Which is the closest to 2/17? (a) 263.2 (b) 0 (c) 0.1 (d) 5 c What is the nearest to -2 in -0.2, 59, -1/2, -10/381, 2/7? -1/2 What is the closest to -4 in 2, 0, 7, -5, -0.88, 60/17? -5 Which is the closest to 0? (a) -1610 (b) 2/11 (c) 113 (d) 4 (e) -15 b What is the closest to 0 in -0.4, -3/61, -478, 1/4? -3/61 What is the closest to -180173 in -1/2, 13/3, 3/5? -1/2 What is the closest to -2 in 3816, -0.1, 14, -2/5? -2/5 Which is the nearest to 26? (a) -2 (b) -2/15 (c) 0 (d) -1/2 (e) -75/4 c What is the nearest to 0.1 in 5/2, 0, 0.118853? 0.118853 What is the closest to -2 in 713, -0.37, 154? -0.37 What is the nearest to -3 in -168, 1749, -7, 2/5? 2/5 Which is the closest to 2/3? (a) 0.02 (b) -17 (c) -3/1141 (d) 0.3 d Which is the nearest to 0? (a) 0.0261 (b) -11 (c) 0 (d) 0.09 (e) -7 c What is the nearest to 0 in -2/85, 1/3, -7, -1/13? -2/85 Which is the nearest to 655/11? (a) -0.9 (b) -1/2 (c) -7 b Which is the nearest to 51? (a) -6 (b) -2 (c) -65 (d) 5 d What is the nearest to -1 in 22, -216, -3, 4, -642? -3 What is the nearest to -0.1 in -2, -2/19, -0.105, -1.7? -0.105 Which is the nearest to -3964? (a) 1 (b) -2 (c) 4 (d) -10 (e) -2/9 d What is the closest to 0.14 in 21, 0.32, 15? 0.32 Which is the nearest to 8? (a) 0.5 (b) 2 (c) 25 (d) -4 (e) -0.61 (f) 0.09 b Which is the nearest to -122? (a) -3 (b) -0.4 (c) -2/615 (d) 1/23 a What is the closest to 94 in -1/6, 0.026, 2, 3? 3 Which is the closest to -3445/83? (a) 0.14 (b) 7 (c) -0.5 c Which is the nearest to -1.1? (a) 2/21 (b) -4 (c) 205129 a Which is the closest to 2/25? (a) -2/9 (b) -0.12 (c) 1/6 (d) 425 (e) -0.03 c What is the closest to -2/3 in 766, -1/7, -39/4? -1/7 What is the closest to 0.02 in 0.4, -0.0202, -0.3, 0.27, 10, 2/19? -0.0202 Which is the closest to 22? (a) -4 (b) 0.2 (c) -4/31 (d) -712 b Which is the closest to -5? (a) 0.5 (b) 0.3 (c) 9/4 (d) -0.0351 (e) 1 d Which is the nearest to -1/2? (a) -19760 (b) -5 (c) 0.2 (d) 1/8 d Which is the nearest to -892? (a) 2.57 (b) -4 (c) -1 (d) -0.3 b Which is the nearest to 2? (a) -97 (b) 0.41 (c) -35 b Which is the closest to -5? (a) 52 (b) -2/39 (c) 0.05 (d) -1 d Which is the closest to 0? (a) 4 (b) 5/4 (c) -4.3 (d) 2/11 (e) -3 d What is the nearest to 0.21 in -2.581, 5/6, -6/5? 5/6 What is the closest to -1 in 19/44, 1/3, 7, -4? 1/3 What is the closest to 1368 in -0.5, -6.5, -4? -0.5 What is the closest to 1/3 in 242, -53, 0.3, -2? 0.3 Which is the closest to 1/311? (a) 3.14 (b) -0.01 (c) -1 (d) 0.08 b What is the nearest to -1/3 in -2/13, -52/5, 0.246, -13, -1.5? -2/13 Which is the closest to 68/201? (a) 1.3 (b) 0 (c) -6 b What is the closest to 1/895 in -1/17, -3, 1/5, 2/21? -1/17 Which is the closest to 1/4? (a) -2 (b) -2/685 (c) 1 (d) -111 (e) 0 e What is the closest to -1.6 in 5, 134, -1, -2/93, -0.4? -1 Which is the closest to 2/5? (a) 0.4 (b) -321 (c) 2.2 (d) -1.3 (e) 0.04 a Which is the nearest to -2.4? (a) -2 (b) -0.1642 (c) -1 (d) 5/4 a What is the closest to 9654042 in 2/7, 4, 5? 5 What is the nearest to 2/5 in 1385, -622, 10? 10 What is the closest to 0.1 in 3.618, -2/3, 402? -2/3 Which is the closest to 2/9? (a) -2/7 (b) 2 (c) -0.8 (d) -0.139 (e) 97/18 d What is the nearest to 188 in -2/13, 1/4, -1/5, 1.2? 1.2 What is the nearest to -9 in 4, -5/2, -4/51? -5/2 What is the closest to -2/3 in 0.01, -0.3, 0.2, 2, -46840/9? -0.3 What is the closest to 0.1 in -13, -0.3, -3, 180459? -0.3 What is the closest to -0.1 in -0.4, -6/11, 105197, -4? -0.4 What is the closest to 19/22 in 16, -27/47, -0.01? -0.01 What is the closest to 0 in 4, 743054, -2/5? -2/5 Which is the nearest to -1? (a) -0.1 (b) 26/21 (c) -5/108 (d) -0.5 (e) 13 d What is the nearest to 379 in 2.06, -53/5, 1/4? 2.06 Which is the nearest to -1.9653? (a) -9 (b) -3 (c) -16 b Which is the closest to -1/31? (a) 0.12 (b) 2 (c) -1 (d) 0.7 (e) -0.8 a Which is the closest to 223? (a) -1 (b) 65 (c) 2 (d) -2/11 b Which is the closest to -0.2? (a) 0 (b) 0.63 (c) -26 (d) -5.46 a What is the nearest to -1.1 in -707, -0.5, 5, -2, 12.82? -0.5 What is the nearest to -0.3 in -0.4, 2/9, 9/29, 3187, -1/8, -1/7? -0.4 What is the closest to 1/4 in 10/237, -414, 4, -1/7, 0.03? 10/237 What is the nearest to -84 in 0.276, 4/3, 0.01, -0.3? -0.3 Which i	{ "pile_set_name": "DM Mathematics" }
k Suppose -12p - 49 = -150 + 53. What is the closest to -1 in -1/3, p, -0.07, 10? -1/3 Let l = 1.9 + -2. Let m be 27/(-5) + 2/5. Let i be (5 + -6)/((m/(-2))/(-5)). Which is the nearest to i? (a) 0.05 (b) 5 (c) l a Let y = -56 + 104. Let n = 48.5 - y. What is the nearest to 2 in n, -1/2, 1/4? n Let x = -315.9 + 300. Let u = 139.1 + -150. Let i = x - u. Which is the nearest to 2? (a) 2/9 (b) i (c) -2/5 a Let p = 1.582 + -4.582. What is the nearest to 1 in -12, -0.3, p, 0.2? 0.2 Let p = 58 + -966. Let h = 907.6 + p. Which is the nearest to -0.1? (a) h (b) -0.5 (c) -0.3 c Let o = -10 - -10.04. Let u = -4.68 - -0.68. Let q = -6.8 + 7. Which is the nearest to q? (a) o (b) 0 (c) u a Let c = 2692432/9 - 299159. Let n(i) = i2 + 6i + 6. Let x be n(-7). What is the closest to -2/3 in 0.2, c, -0.4, x? -0.4 Let r = 0.01 + 3.99. Let c be 161/(-552)-2 - (-2)/(-6). What is the nearest to c in -2/21, 11/2, r? -2/21 Let f = 0.2 + -0.2. Suppose 2l - 17 = -5r, -3l + 3 = -14r + 17r. Let n be (-70)/(-12) - r - 2/6. Which is the closest to f? (a) 1/8 (b) -2/13 (c) n a Let f = 13723/2 - 68613/10. Which is the closest to 0.2? (a) -0.2 (b) -469 (c) f (d) -0.1 c Suppose -192s = 46s + 952. What is the closest to -0.1 in -2/19, 4, 31, s? -2/19 Let m = 16.2 - 16. Let h = -27.6 - -26.6. What is the nearest to h in m, -3, -11? m Suppose -16 = -4g - 4z, -4z = -8z + 8. Suppose -9c + 280 = -gc. Let w = 35 - c. What is the nearest to 1 in -4/5, -3/4, w? -3/4 Let d = -13.8 + 14. Let m = -11411 - -11411.3. What is the closest to d in 2/5, 1, m, -3? m Suppose -28v + 176 = 16v. Let a = -20 + 25. Suppose -4p + 16 = -2g + 7g, ap - 20 = -3g. What is the nearest to g in v, 1/30, 3? 1/30 Let p = -67682/3 + 22560. Which is the nearest to -1? (a) 10 (b) p (c) -289 b Let t be 0(2/4)/(4/(-8)). Let s = t + 3. Let x = -28 + 29. What is the closest to -0.1 in -4, s, x? x Let n = -501.4 - -501.3. What is the closest to 1 in n, -0.3, -272/9? n Let x = 119963/79978 + 2/39989. Let t = 11.5 + -12. Let o = 12.2 + -11. Which is the nearest to 0? (a) o (b) t (c) x b Let u be (-134)/(-20) - (-5 - (7 - 16)). Let y = 71/30 - u. Which is the closest to -4? (a) 0 (b) 2/5 (c) y c Let u = 16.83 - -0.17. Let z be 7 - 9/(1404/1027) - ((-28)/12 - -3). What is the closest to -2/7 in u, 2, z? z Let y = 3/8825 + 44119/17650. Which is the nearest to 0.144? (a) 4 (b) y (c) 0 c Let u = 0.07 - -0.13. Let i = -22 - -173. Let f = i - 153. Which is the closest to u? (a) f (b) -3/4 (c) 5 b Let d = 0.1924 + 0.7076. Let u = -45/148 - -2/37. What is the closest to u in -4, 0.1, d? 0.1 Let l = -0.1 - 4.9. Let z = 0.72 + -116.72. Let v = z + 116.4. Which is the closest to 3? (a) l (b) v (c) 5 c Let z = -1 + 0. Let v = 0.01 - 0.01. Suppose 0 = -331j + 320j - 33. Which is the nearest to v? (a) -4/3 (b) j (c) z c Let h = -10.58 + 10.54. Which is the nearest to h? (a) -2 (b) -4 (c) -0.4 (d) -3 c Let m(n) = n3 - n2 - 2n + 1. Let g = -14 + 16. Let r be m(g). Let p = 2360.3 + -2360. What is the nearest to -2 in p, 4, r? p Let l = -776.4 - -780.4. What is the closest to 1 in 2.4, l, 29/3? 2.4 Let u = 4 - 3. Let l = -234969 + 234979. What is the nearest to 0 in u, -0.3, 0.2, l? 0.2 Suppose 0 = 32565f - 32572f - 14. Which is the nearest to -2/9? (a) 1/3 (b) f (c) 9.1 a Let q be (-12)/243((-18)/(-12) + -3). Let o = -0.054 - 0.346. Which is the nearest to 1/4? (a) q (b) -1 (c) o a Let o = 1/9427 + -18859/47135. Which is the closest to 13? (a) o (b) -3 (c) -0.8 a Let d = -5586.3 - -5586. Suppose 3f = f + 8. Which is the closest to 0.1? (a) -4 (b) f (c) d c Let j = -203 - -203. Let l be (2 + (-27)/15)3. Which is the closest to l? (a) j (b) -0.5 (c) 0.5 c Let w be (2/(-9 - -3) - -1)/(40/(-120)). What is the nearest to -3/10 in -1/11, -3, w, -5? -1/11 Let k(y) = -4y - 8. Let q be k(-4). Let l = -1748 + 1748. Which is the closest to 4/3? (a) q (b) l (c) 1/5 c Let t be (-24)/(-14) + 2/((6 + 8)/2). Which is the closest to 1? (a) t (b) -0.015 (c) 3 (d) 1 d Let f be (10/(-4) - -1)48/(-144). Which is the closest to f? (a) 0.4 (b) 56 (c) 4 a Let f = -0.04 + 0.34. Let r = -69.38 + 68.88. Which is the closest to 1? (a) r (b) -4/7 (c) f c Let g = 432.95 - 532. Let p = g + -0.95. Let t = p + 101. Which is the nearest to t? (a) -0.4 (b) -1/4 (c) -4 b Suppose -44t + 37t = -7. Let p be -1 - (308/(-245) + t/(-7)). Which is the closest to 0? (a) 4 (b) p (c) 1 b Suppose 8g + 42 = 22g. Let c be 1154/(-30) + 1/(-5). Let f = 38 + c. What is the closest to g in f, 4, -0.5? 4 Suppose a = -a + 3o - 68, o + 204 = -5a. Let j be 4/10 + (-64)/a. Let p be 2 - 2 - j - -4. What is the closest to p in 5, 0.2, 2/3? 2/3 Let l = 100 + -102. Let s = 19 - 23. Let z = 5 + s. Which is the closest to l? (a) z (b) -0.1 (c) 5 b Let y = -1 + -2. Let o be 19/2(4 + -3)/(-2). Let v = o + 5. What is the closest to -10 in v, y, -0.5? y Let k be (10/(-8))/51. Let h = 14635.8 + -14635.3. Which is the nearest to k? (a) 4/7 (b) 3 (c) h c Let i = 0.53 + -0.03. Let f = 0.059 + 4.941. Let j = -1 - -1. Which is the closest to j? (a) 2 (b) f (c) i c Let d(v) = 6v2 + 4v + 2. Let n be d(-2). Let u be 5 + (-30)/n - 3. Let q = 47 - 47.5. Which is the nearest to 0.1? (a) q (b) u (c) 0 c Let v = 3841 + -3588.3. Let f = -253 + v. Let t = 7.85 - -0.15. Which is the closest to 0.1? (a) f (b) 0.2 (c) t b Let p = -161 - 494. Let m = 653.7 + p. Which is the closest to -1/4? (a) -2 (b) 0.2 (c) 0.5 (d) m b Let w = 0.2 + 8.8. Let l = w - 9.3. Let x = 4.9833 - -0.0167. Which is the nearest to -4? (a) -5 (b) l (c) x a Let o = -0.1 - -0.1. Let i = -7619.3 + 7620.3. Which is the nearest to i? (a) -0.2 (b) -0.4 (c) o c Suppose -39z - 1568 = -7z. Let u = z - -243/5. What is the nearest to u in 2, 6, 1? 1 Let y = 23/2 - 165/14. Which is the nearest to y? (a) -2/29 (b) -0.4 (c) 58 b Let q = 164 + -164.257. Let d = q - 4.743. What is the nearest to -1/2 in -9, 5, d? d Suppose -p + 3p = 16. Let x be (p/2)/(28/2). Let b = -1381 - -1378. What is the closest to -2/5 in b, 7/3, x? x Let l = -4565 - -4564.883. What is the closest to 0 in l, -1/3, -0.3? l Let x = 117 + -115. Suppose -2h = -3h - xm - 16, 0 = -3h + 3m - 30. Let l be 2/4 + -1 + h/(-16). Which is the nearest to -1? (a) l (b) -6 (c) -2/3 c Let j = 5.3 + -0.3. Let v be 612/(-64) - -1. Let q = -15084 + 15081. What is the nearest to v in q, -1/3, j? -1/3 Let w = -1.478 + 6.478. What is the nearest to -5 in w, -2/5, 1/10, -3? -3 Let m(d) = d2 - 23d - 48. Let k be m(25). Let z be -1(-11)/((-121)/k). What is the nearest to 2/15 in z, -3/4, -3? z Let i = -2.2241 - 8.7759. Which is the nearest to i? (a) -0.07 (b) -2/11 (c) 2/17 b Let o = -9.1 + 7.1. Let u = 5.2 - 5. Let n = 4 + -2. What is the nearest to u in n, -0.3, o? -0.3 Let u = 375 - 349. Let n = 25.9 - u. Let w = 3.07 + -0.07. What is the closest to n in -0.3, w, -4? -0.3 Let p = 24.3 - 28.3. Let z = -3959/9205 - -2/1315. Which is the nearest to -2? (a) -0.3 (b) z (c) p (d) -0.2 b Suppose 212 = -2x - 2x. Let o = -1/152982 - 101987/152982. Which is the closest to 0.1? (a) 5 (b) o (c) x b Let q(j) = -j2 - 51j - 80. Let n be q(-50). What is the nearest to -11 in 0, 2/3, n? 0 Let d be (-1 - -2) + (-1)/1. Let j = -4009.44 + 4009.54. What is the nearest to j in d, 0.05, -0.02? 0.05 Let f = 4 + -2. Let k = 59111 + -178841/3. Let y = 503 + k. What is the nearest to 0 in 0.5, y, f? y Let w = 5.5 - 11.5. Let o(v) = 2v3 - 6v*2 + 3. Let l be o(1). Which is the nearest to -0.1? (a) w (b) l (c) 3/8 c Suppose -30w + 15w + 1125 = 0. Let x be (-12 - -6) + w/27 + 3. Which is the closest to -1? (a) -2 (b) -3.2 (c) x (d) 1 c Suppose -27q = 2q. Let z(l) = l2 + 6l - 4. Let j be z(-7). Let u be 1(j + -7)-1. Which is the closest to q? (a) 0.4 (b) 2 (c) u a Let t = -299/118 + 120/59. Which is the closest to -18? (a) -0.4 (b) t (c) 0.5 b Let s = -29.8406 + -0.1594. What is the nearest to 10 in s, -1, 0.4? 0.4 Let u = -1727.9 + 1704.9. Which is the nearest to u? (a) 2/51 (b) -2/7 (c) 2/9 b Let o = -310 - -309.28. Let h = -0.82 - o. What is the closest to h in -0.5, -9, 3? -0.5 Let u be (-58)/15 + (11 - 708/60)*-5. Which is t	{ "pile_set_name": "DM Mathematics" }
t 3, 0, r in descending order. 3, 0, r Let h be ((-44)/(-10) - 4)/(((-2)/30)/1). Let w be (-2)/5 + 2/30. Sort 1/7, w, h, 0.5. h, w, 1/7, 0.5 Suppose -307 = -4m - 295. Suppose -2n + z + 2 = 0, 5n - 1 = 3z + 6. Put m, n, 2/15 in ascending order. n, 2/15, m Let r be (-11 - (-56)/8)3. Put -0.2, 7, r in decreasing order. 7, -0.2, r Let c = 1185.07 - 1185. Put 0, 5/2, c, 0.1 in descending order. 5/2, 0.1, c, 0 Let c = -0.174 + 108.174. Let j = c - 108.4. Let d be 122/26. Sort d, 5, j in decreasing order. 5, d, j Let l = -37.83 - -38. Let z = l + 1.83. Let h = 3 - 2. Sort z, -4, h. -4, h, z Let u = -27 + 26. Put -5, 59, u, -3/7 in decreasing order. 59, -3/7, u, -5 Let y = -3043 - -63905/21. Let d = 5 - 1. Suppose 13 = dn - 3. Put n, y, -0.4 in decreasing order. n, y, -0.4 Let v be 6(1 + 204/(-198)). Put -3/8, -1.3, v in ascending order. -1.3, -3/8, v Suppose 0 = 4z - 2s - 15 - 5, s - 15 = -3z. Sort z, 4, -3, -115. -115, -3, 4, z Let z(p) = -4p2 - 43p - 67. Let i be z(-2). Suppose -y - 14 = -0y + 3l, 32 = -4y - 4l. Put i, 8, 1, y in ascending order. y, 1, i, 8 Suppose 3j - 6u + 6 = 0, 7 = -23j + 24j + u. Let n be 12/20 - 18/5. Sort -9, j, n. -9, n, j Suppose 0 = 3t - 4k - 29 + 315, 2t + 187 = -k. Let b = -90 - t. Put 2, -0.12, b in decreasing order. b, 2, -0.12 Suppose q - 46 = -4l - 19, -l = 4q + 12. Let s be (l/(-12))/(2/(-45)). Let z be (2 + s/(-9))/(-1). Put 2/11, z, -1 in decreasing order. 2/11, z, -1 Let p(y) = -y2 + 5y - 1. Let f be p(3). Let j be (1/(-2))/(8/(-48)). Let u be (0 - 1)/(4 - j). Put -2, f, u in descending order. f, u, -2 Let w be 1/2 - 3/(-2). Let a be w(-4 + (-13)/(-2)). Suppose 7 + 0 = 3c - 4s, 3s = -12. Put a, c, -2 in ascending order. c, -2, a Suppose v + 2v + 9 = 0. Suppose -67t - 17t = 84. Put -5, v, 6, t in descending order. 6, t, v, -5 Let k = -0.004 - -28.004. Let g = k - 28.2. Let t = 2.05 + -0.05. Put t, g, -5/3 in descending order. t, g, -5/3 Suppose -c = -2c - 9. Suppose -5v - 4k + 30 = 0, 9k - 4k - 5 = -3v. Let h = v + c. Sort -3, 3, h. -3, h, 3 Let w = 6 - 3. Let q = -4 + w. Sort -21, q, 5 in decreasing order. 5, q, -21 Suppose -2z + 3 = 1. Suppose -4j = 2j - 2v + 24, 5j + 2v = -20. Put 2, j, z in descending order. 2, z, j Let a(o) = 3o3 - o2 + 2o - 4. Let w = 58 - 58. Let m be a(w). Let c(y) = -y2 - 8y - 8. Let x be c(-7). Put 4, m, x in increasing order. m, x, 4 Let m(i) = i*2 - i - 11. Let u be m(-3). Let a = 4 + 3. Let v = a + -5. Sort 17, u, v in increasing order. u, v, 17 Let j be -4 + (0/1)/(-2). Suppose -124 - 41 = 55m. Put 1, m, j in decreasing order. 1, m, j Let d = 259 + -254. Put d, -5, -3, 86 in descending order. 86, d, -3, -5 Let k be (2/(-4))/((-1)/(-4)). Let j be 6/k - 1-3. Suppose -15 = -3t + 3w, -19 = -2t + 4w + w. Put j, 4, t in decreasing order. 4, t, j Let p = -1.1 - -0.1. Let u = -10.77 - -10.3. Let x = -0.37 - u. Sort p, 0.5, x in decreasing order. 0.5, x, p Let o = -336 + 336. Sort -5, -9/20, o in increasing order. -5, -9/20, o Suppose -39n + 34n = -15. Let v(b) = -b3 + 2b*2 + 3b + 1. Let i be v(n). Put i, -1.3, 4 in descending order. 4, i, -1.3 Suppose -w - 4w - 10 = 0. Let s = 4.992 + 0.008. Sort w, -0.1, s in ascending order. w, -0.1, s Let d = -0.2 - -0.15. Let z = 0.35 - d. Let s(i) = 3i + 1. Let u be s(-2). Put z, 0.3, u in decreasing order. z, 0.3, u Let g be 5/55-2 + (-312)/(-1474). Sort -0.4, -1/9, g in descending order. g, -1/9, -0.4 Let j = 382 + -381.8. Put 0.4, j, 0, 37 in increasing order. 0, j, 0.4, 37 Suppose 3f = 5s + 23, 3f + 6s = 3s - 9. Sort -3, f, 5, -4 in decreasing order. 5, f, -3, -4 Suppose 17m - 4 = 21m. Let t be (-5)/(-5)(-5 + m)/3. Sort 2, -5, 0, t in descending order. 2, 0, t, -5 Let v(h) = -2h - 21. Let c be v(-11). Suppose c + 1 = 2p. Put 2, p, -9 in increasing order. -9, p, 2 Let j = -2 - -1. Suppose -161o + 170o = 18. Sort j, o, 1, -4 in descending order. o, 1, j, -4 Let l be (-8)/44 - (-342)/66. Put l, 1, 7, -4 in ascending order. -4, 1, l, 7 Let p be (-182)/(-35) + -1 + 12/15. Put -1, p, 3, 0 in descending order. p, 3, 0, -1 Let v = 753 + -750. Let d = -18 - -17.9. Sort 2, 1/6, d, v in decreasing order. v, 2, 1/6, d Let d = -5.5 + 12. Let n = d - 5.88. Let x = n - 0.12. Sort 0, 0.2, x in increasing order. 0, 0.2, x Suppose 0 = -0h + h - 2, -h = -5l + 13. Let j = l - 1. Let n(w) = -w2 - 27w - 171. Let z be n(-16). Put -9, j, z in ascending order. -9, j, z Let b = 772 - 769. Let k = 10 - 14. Put -1/12, b, k in increasing order. k, -1/12, b Let j be -3(-5 + 1)-3. Let a = j + 39. Sort -2, -4, a in descending order. a, -2, -4 Let v(c) = 2c2 - 2c + 1. Let a be v(2). Let q(y) = y*3 + 25y*2 + 28y - 33. Let j be q(-24). Let o = j - -131. Put 1, a, o in ascending order. 1, o, a Let y(i) = i - 5. Let w be y(9). Suppose 0 = -4d - 5n - 43, -d - 65 = 4d - 5n. Sort d, w, -2 in descending order. w, -2, d Let f(v) = -9v - 13. Let w(u) = -5u - 7. Let d(t) = -6f(t) + 11w(t). Let l be d(-2). Put 18, l, -4 in increasing order. -4, l, 18 Let n = 939 + -938.6. Put -0.05, n, -2 in decreasing order. n, -0.05, -2 Let k be ((-3)/(-1))/(7 - (-256)/(-40)). Put k, 18, 4 in ascending order. 4, k, 18 Suppose 3g + 53 = 4b - 2g, 2g - 46 = -4b. Let d be 5/3 + b/(-18). Put -4, 3, d in increasing order. -4, d, 3 Let n(j) = j + 13. Let u be n(-9). Suppose ug + 4 = -q, 7 - 3 = -2g. Put q, -0.02, -5 in ascending order. -5, -0.02, q Let n(h) = h3 - 3h*2 - 9h - 4. Let u be (-3)/((-3)/(-2)) + (0 - -7). Let m be n(u). Suppose -4j + d = 14, j = 6d - 2d + 4. Sort 8, m, j. j, m, 8 Let l = 20 - 29. Suppose 3x + 64 = 49. Let y be ((-8)/(-20))/15. Put l, y, x in increasing order. l, x, y Let l = 2110 + -1607. Sort 1, l, -2. -2, 1, l Suppose 6 = -2q - 12. Let x(z) = z*3 - 28z*2 - 30z + 31. Let n be x(29). Suppose no - 5 = 7o. Sort q, o, -2 in descending order. o, -2, q Suppose -5u = -0v + 4v - 1, 2u = -5v - 3. Sort v, 5, -12, 1 in decreasing order. 5, 1, v, -12 Let a be (5 - 43)/(2/4). Let v = a - -56. Sort 4, 2, v in increasing order. v, 2, 4 Let q = -5 + 2. Let g = -773 + 774. Sort q, g, 2. q, g, 2 Let c = -3.8 + -0.2. Let w = c - -14. Sort 1, w, 0.3 in ascending order. 0.3, 1, w Suppose 15w - 38 = 67. Put w, 0.2, 3/5, -2 in decreasing order. w, 3/5, 0.2, -2 Let x = -1202 + 1199. Sort 33, x, 2 in descending order. 33, 2, x Suppose -4v - 8 = 20. Suppose 47l = 42l - 25. Sort l, 3, -1/8, v in increasing order. v, l, -1/8, 3 Let k = 352.92 + -353. Sort -4/5, -1/5, -3, k. -3, -4/5, -1/5, k Let k = 44/49 - 137/98. Sort 7, k, 8 in descending order. 8, 7, k Suppose g + 6 = 5s - 1, -s = 5g + 9. Let z(v) = 5v + 24. Let m be z(-4). Suppose m + s = a. Put 4, a, -0.4 in ascending order. -0.4, 4, a Suppose -2z = -4p + 14, 4p + 3z = -6 + 5. Suppose -3i - 6 = -0. Sort i, 0, -6, p. -6, i, 0, p Let s(j) = -34j - 236. Let p be s(-7). Put p, -2, 12 in descending order. 12, p, -2 Let m(r) = r. Let i be m(5). Suppose -z = -2z - 4h - 1, -i = 5z + 2h. Suppose 0 = -u + v + 2, -4u = -4v + 7v - 22. Sort u, z, 3 in ascending order. z, 3, u Let l = 2.9 + -3. Suppose 5p + 2k - 1740 = -3k, -2k - 360 = -p. Let h be -4 + 0 + p/77. Sort 2/25, l, h in descending order. h, 2/25, l Let r = 37 + -33. Sort 3, -12, r, 0 in ascending order. -12, 0, 3, r Let w = -102.2 + 87. Let m = w - 0.8. Let x = m + 15.5. Sort 4, -5, x in descending order. 4, x, -5 Let j(k) = -21k + 59. Let y be j(3). Suppose 5n = 2s, 2s + 0s - 14 = -2n. Put y, 4, 5, n in decreasing order. 5, 4, n, y Let p(f) = 67f - 68. Let u be p(1). Put u, 5, -5 in ascending order. -5, u, 5 Let k be 15/(-55) - 86/(-154). Let j = -13 + 8. Sort k, j, 0.1, 4 in ascending order. j, 0.1, k, 4 Let h = 15 + -10. Suppose -13 = -hp - 3d, -5d - 27 = -3p - 2d. Suppose -4s = -2a + 12, -2s = -5s + 2a - 7. Sort 1, s, p in ascending order. s, 1, p Suppose 0 = -2t + 2y - 318, y + 14 = 9. Sort 1, t, 4 in descending order. 4, 1, t Suppose -4 + 20 = -4y. Suppose 5t + 14 = -c - 7, -t - 25 = -5c. Sort 3, y, c in ascending order. y, 3, c Let l(u) = -3u - 3. Let b(k) = k*2 + 10k + 7. Let w be b(-9). Let x be l(w). Let a = -5 + x. Put -4, a, 0 in descending order. 0, a, -4 Let k = -159 - -151. Put k, 3, -3, 0.4 in increasi	{ "pile_set_name": "DM Mathematics" }
third derivative of u(p) wrt p. 34902 Let z(r) = 15r2 + 17r. Let g = 31 - 55. Let f = -19 - g. Let o(v) = 16v2 + 17v. Let q(p) = fz(p) - 4o(p). What is the second derivative of q(s) wrt s? 22 Find the first derivative of -8489 - 14580i + 7291i - 1356i4 + 7289i wrt i. -5424i3 What is the derivative of 20347 + t3 + 109t2 - 20566 + t3 wrt t? 6t2 + 218t Suppose 6o + 91 = 109. What is the second derivative of -j2 - 2j*o - 2j*2 + 4j*3 + 55j + 127j wrt j? 12j - 6 Differentiate 1068 - 1117p + 3596p + 573p + 1520p with respect to p. 4572 Let d(k) = 2k2 + 4k - 1. Let a be d(-3). What is the third derivative of 41x2 + 4x + 5x3 - 5x + 19x3 + ax*3 wrt x? 174 Let n(y) = -1062y*2 + 3y + 829. Let a(x) = -2118x2 + 7x + 1658. Let q(r) = -3a(r) + 7n(r). What is the first derivative of q(d) wrt d? -2160d Suppose 0 = -2b - 2b + 12. Let q be 14/21 + 13/b. What is the second derivative of qk + 6k + 0k - 2k2 + 3k wrt k? -4 Suppose 0 = 6k - 5k - 5. Suppose 973 = 2s + ks. Differentiate -10a3 - 20 + 139a - sa wrt a. -30a*2 Let s(f) = -2f*3 + 2f*2 - 2f. Let m(a) = -2546a4 + 8a*3 - 8a*2 + 2772a. Let c(l) = m(l) + 4s(l). What is the second derivative of c(b) wrt b? -30552b*2 Let x(z) be the first derivative of 1/3z*3 - 42z*2 - 206 - 249/4z*4 + 0z. What is the third derivative of x(l) wrt l? -1494 Find the second derivative of -2 + 7566u - 15129u + 7573u + 6u*3 + 4u*2 - 58u*4 wrt u. -696u*2 + 36u + 8 Let b be 163 + 2/(-8) + 209/(-76). Differentiate -f + f + 19 + b + 96f4 wrt f. 384f*3 Suppose -5s + 57 = -13. Let y = -12 + s. Find the third derivative of -30ay + 51a*2 - 3a*5 + 5a*5 + 16a*5 wrt a. 1080a*2 Suppose 2c + 0f + 5f - 88 = 0, -5c + 278 = -2f. Differentiate 6n2 + 21n*3 - 6n*2 + 2n + 2n3 - c with respect to n. 69n*2 + 2 Suppose 0 = 2m - 4m + 16. Let b be m/10(9 + 1) + -3. Find the second derivative of -v + 111v3 - 13v - 111v3 - bv*4 wrt v. -60v*2 Suppose 4p = -2w - 2w, 6 = -3p - 5w. Find the first derivative of 3x + 41x*3 + 26 - 3x - 28x2 - 42x*p wrt x. -3x*2 - 56x Let k(f) = -f*2 - 10f + 13. Let u be k(-11). Find the third derivative of -7a5 - 228a*2 + 280a*u - 12a*5 + 4a*5 wrt a. -900a*2 Let c = 35 - 18. Let i = 19 - c. Find the third derivative of 4o*2 - 18o*4 - i + 2 + 9o*4 wrt o. -216o Let d(t) = -t*4 - 6t3 + t2 - 1. Let a(h) = -2068h4 + 36h*3 + 93h*2 + 20h + 6. Let r(k) = -a(k) - 6d(k). Find the third derivative of r(n) wrt n. 49776n Let t(f) be the first derivative of 17f7/7 + f6/2 + 8f*5/5 - 2f*3 + 397f + 1193. Find the third derivative of t(l) wrt l. 2040l3 + 180l*2 + 192l Let k(p) = -p*2 + 6p + 9. Let z be k(4). What is the second derivative of 46 + g + 6g - 5g - zg3 wrt g? -102g Let p = -363 - -366. What is the second derivative of -3x3 - 2x4 - x4 + 4 + 17x - x + 26x*p wrt x? -36x*2 + 138x Let n(b) = 47b2 - 8b - 8. Let g(d) = -142d2 + 25d + 23. Suppose 3 = -8s + 19. Let j(c) = sg(c) + 7n(c). What is the second derivative of j(h) wrt h? 90 Suppose 27t = 19 + 89. Find the third derivative of 11q2 - 38q*2 - 6q*2 - 78q*2 - 152q*2 + 52qt + q3 wrt q. 1248q + 6 Let a(j) = 17j*2 + 2j - 2. Let d(q) = 4171q2 - 62q - 6. Let l(h) = 3a(h) - d(h). Find the second derivative of l(u) wrt u. -8240 What is the derivative of 21741 - 226d*2 - 602d*2 + 160d*2 - 23331 wrt d? -1336d Let s(d) = 1239d3 + 75d*2 + 6. Let h(g) = 2478g*3 + 151g*2 + 13. Let q(t) = -2h(t) + 5s(t). What is the third derivative of q(a) wrt a? 7434 Let f = -442 - -614. What is the second derivative of -348j - 2 + 65j2 + 18j*2 + 189j + fj wrt j? 166 Suppose -12 = 20f - 23f, 18 = 5z - 3f. What is the second derivative of y + 43 - z - 175y*4 + 7y - 6y - 5y wrt y? -2100y2 What is the third derivative of -580b*5 - 408b*5 + 218b*5 + 3129b*2 - 5b*2 + 155b*2 wrt b? -46200b*2 Let s(f) be the third derivative of -643f*6/24 - 2167f*3/3 + 3f*2 + 424. Find the first derivative of s(o) wrt o. -9645o*2 Let b(w) be the first derivative of -293w*6/30 - 37w*4/6 + 320w - 70. Let m(z) be the first derivative of b(z). What is the third derivative of m(q) wrt q? -7032q Let z = 113 - 110. What is the second derivative of 17f - 7 - 16 + 22 - 9fz wrt f? -54f Let h be ((-7)/(28/(-24)))/(3 + -1). Suppose 0 = -3b - 4i + 47, -5b + hi + 16 = -14. What is the second derivative of bo2 - 16o + 14o2 - 5o wrt o? 46 Let u(j) be the first derivative of 27j - 28 + 0j*3 + 1/4j*4 - 9j*2. What is the first derivative of u(f) wrt f? 3f*2 - 18 What is the second derivative of 14704q + 207q2 + 224q*2 + 12q*3 + 162q*2 - 548q*2 wrt q? 72q + 90 Let i(b) = b*3 + 17b*2 - 18b + 5. Let w be i(-18). Suppose -4j = 4, -6 + 1 = -3r + wj. Differentiate 8s*2 - 1 - 7 - 3s*2 + rs*2 with respect to s. 10s Suppose 3q - 5p - 36 = 0, -5q - 7p + 3p + 23 = 0. Find the first derivative of -54v - 40 + 66v - q wrt v. 12 Let d = 250 - 247. Find the third derivative of -608i + i6 - i3 + 306i - id + 26i*2 + 303i wrt i. 120i3 - 12 Let g = -98 + 6. Let f = g - -94. Find the second derivative of 33d + 668 - 668 + 36df wrt d. 72 Let x(s) be the third derivative of 1 - 29/60s*6 + 0s*3 + 53/24s*4 + 0s*5 - 4s*2 + 0s. What is the second derivative of x(i) wrt i? -348i Suppose 62 = -6a - 208. Let w = a + 58. What is the first derivative of u*4 + w + 9 - 29u*4 wrt u? -112u*3 Let c(z) be the first derivative of 0z*3 + 223z + 0z2 - 119/4z*4 - 276. Differentiate c(a) with respect to a. -357a*2 Let i(p) be the second derivative of -31p*4/2 - 2987p*3/6 + 2695p. Find the second derivative of i(v) wrt v. -372 Let z be ((-190)/4)/((-4)/8). Find the second derivative of -zb3 - 5b*4 + 101b*3 - 25b*4 - 1 - 15b + 6b4 + 21b wrt b. -288b2 + 36b Find the third derivative of 128f3 - 7f*3 + 46f*3 - 395f*2 + 0f4 - f4 wrt f. -24f + 1002 Suppose 9c - 91315 = 2c. Find the second derivative of cy*4 - 4 - 20y*2 - 13045y*4 + 17y - 3y5 wrt y. -60y*3 - 40 Find the first derivative of -72a*4 + 113a*4 - 132a*3 + 130a*3 - 108 + 7209 wrt a. 164a*3 - 6a*2 Let x be -3((-1)/4 + 60/(-144)). Find the second derivative of -26a5 - a3 + a3 - ax - 3 - 62a + 57a wrt a. -520a*3 - 2 Let a(l) be the first derivative of -6l*4 + 31l - 17 + 4/5l5 + 0l*3 + 0l*2. Find the first derivative of a(u) wrt u. 16u*3 - 72u*2 Find the first derivative of 85 + 135r - 35r - 228 + 192r + 66r wrt r. 358 Let x(z) = z3 + 6z*2 + 4z - 1. Let n = -12 + 7. Let b be x(n). Find the third derivative of 43y2 + 2y*4 - 2y*b - 61y*2 - 9y*5 wrt y. -540y*2 Let h(b) be the second derivative of -315b*4/4 + 5345b*3/3 + 13766b. What is the second derivative of h(p) wrt p? -1890 Find the first derivative of -3n - 1997 + 478n*2 + 5n - 3046 + 706n2 + 544n*2 wrt n. 3456n + 2 Let q = -229 - -404. What is the third derivative of -19 + 3r2 - 4r*2 + 12r*2 + 27 + qr*3 wrt r? 1050 Let c(m) be the second derivative of 113m*6/15 + 11m*5/20 - 3664m*2 - 3099m. What is the derivative of c(a) wrt a? 904a3 + 33a*2 What is the second derivative of -1053 - 967 - 45m + 46m - 1188m*5 wrt m? -23760m*3 What is the second derivative of 308d*3 + 334d*3 - 93d - 60d + 13d - 70d wrt d? 3852d Let f = 34 - 34. Suppose -11i + 14i - 6 = f. What is the third derivative of -10o3 + 4o*i + 15o*3 - 11o*3 wrt o? -36 What is the third derivative of 10d*2 - 17d - 1329d6 + 150d*6 + 2 - 2 wrt d? -141480d*3 Let g(h) be the second derivative of 27h7/14 - h6/30 - 2h5/5 - 628h*4/3 - 114h - 8. What is the third derivative of g(j) wrt j? 4860j2 - 24j - 48 Let a(f) = 57f5 - 18f*2 + 47f + 1. Let t(i) = -57i5 + 15i*2 - 47i - 1. Let g(m) = 5a(m) + 6t(m). Find the second derivative of g(b) wrt b. -1140b3 What is the second derivative of 3 - 569q*4 - 400q - 3 + 2852q + 32q*4 wrt q? -6444q**2 Let q(m) be the third derivat	{ "pile_set_name": "DM Mathematics" }
next term in 6, 82, 158, 234, 310? 386 What is the next term in 129, 270, 411, 552, 693, 834? 975 What is the next term in -1872, -3745, -5618, -7491, -9364? -11237 What is the next term in -206, -203, -200, -197, -194, -191? -188 What comes next: -40, -318, -1062, -2506, -4884? -8430 What is the next term in 106, 440, 1002, 1792, 2810, 4056? 5530 What is next in 22, 46, 76, 112, 154, 202? 256 What is the next term in 168, 261, 512, 999, 1800, 2993, 4656? 6867 What comes next: -9, -43, -101, -183, -289, -419, -573? -751 What comes next: -1829, -1826, -1821, -1814, -1805, -1794? -1781 What is next in 48, 73, 96, 111, 112, 93, 48, -29? -144 What comes next: 70, 71, 72? 73 What is the next term in 119, 131, 157, 203, 275? 379 What comes next: -603, -1204, -1805, -2406, -3007, -3608? -4209 What comes next: -1261, -1265, -1279, -1309, -1361, -1441, -1555? -1709 What comes next: -266, -298, -380, -536, -790, -1166, -1688? -2380 What is the next term in -102, -187, -270, -351, -430? -507 What is next in -658, -657, -656, -655? -654 What is the next term in 531, 4253, 14357, 34035, 66479, 114881, 182433, 272327? 387755 What is the next term in 29, 61, 95, 131? 169 What comes next: 77, 168, 259, 350, 441, 532? 623 What comes next: -6352, -6349, -6344, -6337? -6328 What comes next: 209, 200, 185, 164, 137? 104 What is next in 71, 248, 533, 926? 1427 What comes next: -1076, -2154, -3222, -4274, -5304, -6306, -7274, -8202? -9084 What is next in -302, -622, -942? -1262 What is the next term in 3760, 3762, 3764? 3766 What is next in -54, -77, -100? -123 What is next in 18269, 18267, 18263, 18257, 18249, 18239, 18227? 18213 What is next in 353, 725, 1097, 1469? 1841 What is next in 70, 84, 108, 142? 186 What is next in 8, 16, 42, 92, 172, 288, 446, 652? 912 What is next in -395, -1581, -3557, -6323, -9879, -14225, -19361? -25287 What is the next term in -2534, -2536, -2538, -2540, -2542, -2544? -2546 What is next in 1, -6, -5, 10, 45, 106? 199 What is the next term in 774, 778, 782, 786, 790? 794 What is the next term in -18, -25, -32? -39 What is next in 18, 25, 46, 87, 154, 253, 390? 571 What is next in 961, 964, 969, 976, 985, 996? 1009 What is next in 151, 205, 303, 451, 655? 921 What comes next: 281, 560, 839, 1118, 1397, 1676? 1955 What is next in 12, -2, -14, -24, -32? -38 What is next in -75, -13, 49? 111 What comes next: 233, 466, 701, 938, 1177? 1418 What is next in -21, -55, -95, -141, -193? -251 What comes next: 260, 202, 46, -256, -752, -1490, -2518? -3884 What is the next term in -4, -6, -10, -16, -24? -34 What is next in -4, 19, 46, 77, 112, 151? 194 What is the next term in 81, 66, 65, 84, 129? 206 What comes next: -136, -129, -118, -103, -84, -61? -34 What is next in 7335, 7333, 7331, 7329, 7327, 7325? 7323 What comes next: 3, 26, 65, 120, 191? 278 What is the next term in 96, 393, 894, 1605, 2532, 3681, 5058, 6669? 8520 What is next in 945, 944, 943, 942, 941, 940? 939 What is the next term in 154, 308, 462, 616, 770, 924? 1078 What is the next term in 212, 416, 620? 824 What is next in -286, -300, -314, -328? -342 What is the next term in -3, -28, -69, -126, -199, -288, -393? -514 What is the next term in 41, 53, 59, 59? 53 What comes next: -52, -1, 60, 137, 236, 363, 524, 725? 972 What is next in -18, -121, -404, -957, -1870, -3233, -5136, -7669? -10922 What comes next: -725, -1474, -2235, -3014, -3817, -4650, -5519, -6430? -7389 What is next in 3, 8, 11, 12, 11, 8, 3? -4 What is the next term in -9, -19, -43, -87, -157? -259 What comes next: -1, -2, -11, -34, -77, -146? -247 What is next in -205, -204, -203, -202? -201 What comes next: 215, 185, 153, 119, 83, 45, 5? -37 What comes next: -6, -50, -166, -390, -758? -1306 What comes next: -47, -62, -63, -44, 1, 78, 193, 352? 561 What is next in 4, 5, 6, 7? 8 What comes next: -3, -5, -7, -9, -11? -13 What is next in 151, 130, 109, 88, 67? 46 What is the next term in 159, 267, 377, 489, 603, 719, 837? 957 What comes next: -170, -183, -200, -221, -246, -275, -308? -345 What is the next term in -25, -41, -59, -79, -101, -125? -151 What is the next term in 44, 81, 116, 149? 180 What comes next: 5473, 5492, 5523, 5572, 5645, 5748? 5887 What is the next term in 11, 51, 115, 203, 315, 451, 611? 795 What is next in -498, -991, -1484? -1977 What is the next term in -194, -395, -598, -803, -1010, -1219, -1430? -1643 What comes next: 19, 27, 35, 43, 51? 59 What is next in 126, 108, 64, -18, -150? -344 What comes next: 56, 34, 12, -10, -32, -54? -76 What comes next: -4, -26, -44, -52, -44, -14, 44? 136 What comes next: -5, -30, -73, -134, -213, -310? -425 What comes next: -3734, -3746, -3766, -3794? -3830 What is the next term in 3688, 3687, 3686, 3685, 3684, 3683? 3682 What is the next term in 2, 7, 14, 23, 34, 47? 62 What is the next term in -98, -221, -344, -467, -590, -713? -836 What is the next term in 166, 165, 162, 157, 150, 141? 130 What comes next: -483, -466, -435, -384, -307, -198, -51? 140 What comes next: 5, 10, 15, 20, 25? 30 What comes next: 7, 3, 5, 19, 51, 107? 193 What comes next: 223, 220, 217, 214, 211? 208 What is next in 87, 161, 235, 309? 383 What is next in -5, -24, -69, -146, -261, -420, -629? -894 What is the next term in 99, 198, 297, 396, 495, 594? 693 What is the next term in 97, 109, 137, 187, 265? 377 What comes next: -80, -83, -88, -95? -104 What is the next term in 81, 256, 555, 984, 1549, 2256, 3111, 4120? 5289 What comes next: 210, 247, 308, 393, 502, 635, 792? 973 What comes next: 155, 646, 1473, 2642, 4159, 6030, 8261? 10858 What is the next term in -32, -64, -96, -128, -160? -192 What comes next: -25, -42, -61, -82? -105 What is the next term in 2019, 2022, 2027, 2034? 2043 What is next in -4589, -4590, -4591, -4592? -4593 What is next in -149, -165, -181, -197? -213 What comes next: -308, -308, -306, -302? -296 What is next in 16, 7, -4, -17, -32, -49, -68? -89 What comes next: 16, 24, 46, 88, 156, 256, 394? 576 What is the next term in 1, -4, -11, -20, -31, -44, -59? -76 What comes next: -149, -144, -129, -98, -45, 36, 151? 306 What is the next term in 54, -27, -108, -189, -270, -351? -432 What comes next: -1410, -2829, -4262, -5715, -7194, -8705? -10254 What comes next: -71, -167, -289, -449, -659, -931, -1277, -1709? -2239 What is the next term in 45, 205, 471, 843, 1321, 1905, 2595? 3391 What comes next: -14, -23, -32, -41, -50? -59 What is next in 800, 794, 786, 776, 764, 750, 734? 716 What is the next term in 385, 386, 385, 382, 377? 370 What is the next term in -617, -616, -615, -614? -613 What is the next term in 6, -2, -10? -18 What comes next: 258, 511, 762, 1011, 1258, 1503, 1746? 1987 What is next in 13, 25, 71, 169, 337? 593 What is the next term in 9, -4, -27, -60? -103 What is the next term in -156, -169, -184, -195, -196, -181, -144, -79? 20 What is the next term in 3142, 3130, 3096, 3028, 2914, 2742, 2500, 2176? 1758 What is the next term in 26, 64, 126, 212, 322? 456 What is next in 6, -4, -12, -18, -22, -24, -24? -22 What comes next: -1073, -2168, -3281, -4418, -5585, -6788, -8033, -9326? -10673 What is next in -5, -31, -75, -137, -217, -315, -431? -565 What is next in -1255, -1229, -1177, -1093, -971, -805, -589, -317? 17 What is next in -106, -206, -302, -394, -482, -566, -646? -722 What comes next: 6, 24, 26, 6, -42, -124, -246, -414? -634 What is next in -11, -32, -67, -116, -179, -256, -347? -452 What comes next: 188, 361, 520, 659, 772, 853, 896? 895 What is next in 442, 445, 448? 451 What comes next: -1, 39, 113, 227, 387, 599, 869? 1203 What is next in 643, 1281, 1921, 2563, 3207, 3853? 4501 What is next in -872, -881, -896, -917, -944? -977 What comes next: 894, 3576, 8046, 14304, 22350? 32184 What comes next: 2177, 4358, 6541, 8726, 10913? 13102 What is next in -3968, -7943, -11920, -15899? -19880 What is next in 23, 76, 161, 272, 403? 548 What is the next term in 3, 2, 3, 6, 11, 18? 27 What is next in -3576, -3572, -3558, -3528, -3476? -3396 What comes next: -63, -47, -29, -15, -11, -23, -57, -119? -215 What is the next term in 3640, 3642, 3644, 3646, 3648, 3650? 3652 What is the next term in 222, 441, 660, 879, 1098, 1317? 1536 What comes next: 148, 298, 448, 598? 748 What is next in 13, 258, 937, 2272, 4485, 7798? 12433 What is	{ "pile_set_name": "DM Mathematics" }
What is z? 0, 1/3, 6 Let a(w) be the second derivative of -w6/900 + w5/600 + 7w3/6 + 14w. Let r(q) be the second derivative of a(q). Factor r(s). -s(2s - 1)/5 Suppose 0 = 2i + 4a, -3 - 5 = 4i + 4a. Let d be ((-528)/130)/i - 14/35. Let 0 - 2/13h3 + 8/13h*2 - dh = 0. What is h? 0, 2 Let u be (-252)/20(-8 + 3). Let p be 10/30 - (-6)/u. Factor -pa*3 + 3/7a + 0 + 0a2. -3a(a - 1)(a + 1)/7 Let m = 21 + -15. Suppose 5f + 4r = mr + 9, 4f + 3r - 21 = 0. Factor 0b*5 - 4b*4 + 4b*2 + 2b*5 + 3b*f - 5b*3. 2b*2(b - 2)(b - 1)(b + 1) Suppose -2r + 3r*3 - 15 - 2723r*2 + 65 + 2673r2 - r3 = 0. Calculate r. -1, 1, 25 Let l be (-5 - -4)/(((-6)/(-3))/8). Let o(m) = -3m3 + 2m*2 + 4m. Let c(d) = 4d3 - 3d*2 - 4d. Let y(j) = lc(j) - 6o(j). Factor y(s). 2s(s - 2)(s + 2) Let p be (-28)/3530/(-12). Let u(c) be the first derivative of -13/10c4 + 3 + 8/25c*5 + 0c + 22/15c3 - 2/5c*p. Solve u(l) = 0. 0, 1/4, 1, 2 Let i = -22/57 + 85/171. Let k(o) be the second derivative of -3o - io3 + 0 + 1/36o*4 + 1/6o2. Factor k(l). (l - 1)2/3 Let 2/13p5 + 18/13p*3 + 0 - 14/13p*2 - 10/13p*4 + 4/13p = 0. Calculate p. 0, 1, 2 Suppose -c = 3c - 24. Let z(y) = 3y - 16. Let j be z(c). Determine b so that -4/15 + 6/5b - 14/15b*j = 0. 2/7, 1 Let z(r) be the second derivative of 19r + 2/7r2 + 5/7r*4 + 0 + 19/21r3. Determine h so that z(h) = 0. -1/2, -2/15 Let x(m) be the third derivative of m7/420 + 11m6/720 + m5/60 + 44m2. Factor x(g). g2(g + 3)(3g + 2)/6 Let b(c) = 2c5 - c3 - c - 1. Let x(d) = 7d5 - 7d*4 - 12d*3 + 16d*2 - 4d - 4. Let r(z) = -4b(z) + x(z). Find m, given that r(m) = 0. -4, 0, 1 Let t(k) be the first derivative of 0k - 3/4k2 - 12 + 1/4k*3. What is g in t(g) = 0? 0, 2 Solve -32/9 + 2/9n*3 - 32/9n + 2/9n2 = 0 for n. -4, -1, 4 Let c(o) = -4o*3 + 68o*2 - 3o + 53. Let j be c(17). Factor -4/3v4 + 0 + 8/3v*3 + 0v + 0vj. -4v*3(v - 2)/3 Suppose 4z - 6 = i - 22, -4z = -3i + 24. Suppose -4v + 4a - i = 0, v = -3a + 12 + 3. Factor t*4 - 101t*3 + 89t*v - 2t*4 + 12t*2 + 4t*4. 3t*2(t - 2)*2 Let j = -2 + 4. Suppose 5m + 4b - 2b - 15 = 0, -2m = -jb - 6. Determine k, given that 2k2 - 2/5k*m - 16/5k + 8/5 = 0. 1, 2 Let d(j) be the third derivative of 0j + 5/72j*5 + 0 - 1/9j*4 - 19/720j*6 - 3j*2 - 1/2016j*8 + 1/9j*3 + 1/180j7. Factor d(u). -(u - 2)2(u - 1)3/6 Factor 40h*2 - 47h*4 - 9h*5 - 43h*4 - 20h*5 - 60h*3 + 4h*5. -5h*2(h + 2)*2(5h - 2) Factor 3s*4 - 7s*4 - 12s + 4s5 + 12s. 4s4(s - 1) Let a(i) = 5i2 + 125i - 130. Let f(g) = 10g2 + 250g - 260. Let w(n) = -5a(n) + 3f(n). Solve w(u) = 0. -26, 1 Let n(l) be the second derivative of -l*6/50 - 7l*5/50 - 17l4/60 - l3/5 + 871l. Determine h, given that n(h) = 0. -3, -1, -2/3, 0 Suppose 0y + 56 = 2y. Suppose -4g*2 - 3g - 3g + 10 - g3 + yg - 15g = 0. What is g? -5, -1, 2 Determine f so that 0 + 2/11f*4 - 54/11f*3 - 50/11f + 102/11f2 = 0. 0, 1, 25 Let a(w) = w3 + w2 - 1. Let y(m) = -25m*2 + 25m - 5. Suppose -4p - 4 = -0p. Let g(j) = py(j) - 5a(j). Factor g(f). -5(f - 2)(f - 1)*2 Let j(z) = -312z - 3744. Let y be j(-12). Solve 0c + 3/2c4 + c3 + y + 1/2c5 + 0c*2 = 0. -2, -1, 0 Let s(o) = -8o + 13o2 - 4o*2 + 4 + 8o + o*3. Let a be s(-9). Determine l, given that -5 + 199l*3 - 315l*2 + 108l - 135la + 155l3 - 7 = 0. 2/9, 2/5, 1 Let a(q) = q2 + 57q + 432. Let r be a(-48). Factor 9/5i*2 + r + 3/5i*4 - 3/5i - 9/5i3. 3i(i - 1)3/5 Let r(p) be the first derivative of p4/28 + 4p*3/21 - 11p*2/14 + 6p/7 - 65. Factor r(j). (j - 1)*2(j + 6)/7 Let x be 3/((-378)/(-33)) + 1/(-4). Let s(y) be the third derivative of -y*2 + 0y*7 + 0y*4 + 0 + 0y*5 + 0y*3 + 0y*6 + 0y - xy8. Factor s(w). -4w*5 Solve 8/5 - 2/5m + 2/5m3 + 1/5m*4 - 9/5m*2 = 0. -4, -1, 1, 2 Let j(h) = -h + 10. Let r be j(8). Suppose -2c + r = -c. Factor -3 - 33g + c - 27g*2 - 5 + 0. -3(g + 1)(9g + 2) Let y(q) be the second derivative of -q8/1260 + q7/315 - q*6/270 - 2q*3 - 10q. Let g(b) be the second derivative of y(b). Factor g(l). -4l2(l - 1)*2/3 Let m be ((-15)/12)/(0 - (-2)/(-40)). Let y be m/68 + 18/(-153). Solve 0 + yl*4 + 1/4l*3 + 0l + 0l2 = 0. -1, 0 Let r be 0 - ((-23)/6 - (-1)/(-6)). Suppose -q = -2c - 0q + 8, -rc + 14 = -q. Solve -2/3vc - 4/3v*2 - 2/3v + 0 = 0 for v. -1, 0 Suppose -5m + 72 + 145 = -3f, 5m - 222 = -2f. Determine o so that m + 2o2 - 28o + 23 + 31 = 0. 7 Let r = -2/15 + 11/15. Let x(q) be the first derivative of -rq5 + 15/4q*4 + 12q - 1/2q6 + q3 - 12q2 - 5. Suppose x(i) = 0. What is i? -2, 1 Let r(z) be the third derivative of z5/270 + 7z4/108 - 8z*2 + 12z. Factor r(y). 2y(y + 7)/9 Let a(y) be the third derivative of -y*6/1320 + 23y*5/660 - 13y*4/24 + 11y*3/6 + 123y2. Suppose a(f) = 0. Calculate f. 1, 11 Let c(h) be the third derivative of h9/75600 + h8/25200 - h5/30 - 8h2. Let x(g) be the third derivative of c(g). Determine i, given that x(i) = 0. -1, 0 Let k(x) be the third derivative of -x6/120 + 2x*5/3 - 13x4/8 + x2 + 2. Factor k(z). -z(z - 39)(z - 1) Let -3/7t2 - 9/7 - 12/7t = 0. Calculate t. -3, -1 Suppose 30h = 93h - 252. Let u(y) be the first derivative of -6 + 0y - 16/3y*3 - 308/5y*5 + 0y*2 - 98/3y*6 - 32y*h. Factor u(f). -4f*2(f + 1)(7f + 2)*2 Let l(c) be the first derivative of 2c5/35 - c4/7 - 38c3/21 - 4c*2 - 24c/7 - 478. Factor l(s). 2(s - 6)(s + 1)*2(s + 2)/7 Factor 1/4o2 - 10 + 3/2o. (o - 4)(o + 10)/4 Let q(o) be the first derivative of o6/240 - o5/60 - o4/48 + o3/6 + 15o*2/2 + 5. Let d(x) be the second derivative of q(x). Factor d(r). (r - 2)(r - 1)(r + 1)/2 Let l be (0 - -3)/(6/(-16)) + 14. Factor -3z*4 + 9/2z*3 + 6z*2 + 0 - 3/2z*5 - lz. -3z(z - 1)*2(z + 2)2/2 Let c(b) be the second derivative of b4/42 - 8b3/21 + 16b*2/7 - 10b - 8. Factor c(r). 2(r - 4)2/7 Let n(m) be the third derivative of m7/630 - m6/135 + m5/90 + 7m*3/2 + 3m*2. Let z(i) be the first derivative of n(i). Solve z(r) = 0. 0, 1 Let w = 19 + -12. Suppose -o - 5x + 0x = -13, x = 3o - w. Find y such that 0 + 5/6y4 + 1/3y*2 + 0y + 7/6yo = 0. -1, -2/5, 0 Let i(j) be the first derivative of j5/90 + j4/9 + j3/3 - 5j - 7. Let l(t) be the first derivative of i(t). Factor l(g). 2g(g + 3)*2/9 Factor 16g + 17g2 + 22 - 21g*2 - 34 + 0. -4(g - 3)(g - 1) Let r = -1 + 4. Suppose -5z - 9 = -x + 15, 3x - rz - 24 = 0. Suppose 3dx - 13d*4 + 0d*2 + 12d*4 - 2d*2 - 2d*3 + 2d = 0. Calculate d. -1, 0, 1 Let p(g) be the first derivative of 2g5/65 + 2g*4/13 - 2g*3/13 - 18g*2/13 - 97. Determine k, given that p(k) = 0. -3, 0, 2 Suppose -752i + 753i = 5j - 8, j = -i - 8. What is c in j + 1/10c2 - 1/5c + 1/10c3 = 0? -2, 0, 1 Let b(u) be the first derivative of 13u*4/66 + 28u*3/33 + 4u*2/11 + 11u + 46. Let m(l) be the first derivative of b(l). Factor m(h). 2(h + 2)(13h + 2)/11 Determine u, given that 138 - 6u*3 - 64u*2 + 8u*3 + 570u - 1038 = 0. 2, 15 Let k(n) = 7n + 41. Let a be k(-8). Let s be -1 - (a/(-9) - 4). Solve -2/3u*5 - 32/3u*2 - 4u*4 - 28/3u*3 - 6u - s = 0. -2, -1 Let w(p) be the first derivative of -1/6p6 + 0p*3 + 1/4p*4 - 14 + 0p*5 + 0p + 0p2. Determine a so that w(a) = 0. -1, 0, 1 Suppose 4d - 16 = 0, -d + 11 + 1 = 2u. Factor 4a*5 + 8a*3 - 6a*4 + 0 - 4a*2 - 12a + 18a4 - ua*2 - 4. 4(a - 1)(a + 1)4 Solve -4 + 40g*2 + 78 + 6 - 100g - 5g3 = 0 for g. 2, 4 Let j = -1555 - -1555. What is a in 8a2 - a4 + j - 2a + 5/2a*5 - 15/2a*3 = 0? -2, 0, 2/5, 1 Factor 421b*5 - 212b*5 + 36b*2 + 28b*4 + 60b*3 - 205b*5. 4b*2(b + 1)(b + 3)2 Let q(g) be the first derivative of 35g*3/3 + 4805g*2/2 + 1370g - 186. Determine j, given that q(j) = 0. -137, -2/7 Let u = 72 - 69. Let g = -1 + u. Suppose 1 - 43/2j3 - jg + 15j*4 + 13/2j = 0. What is j? -2/5, -1/6, 1 Factor -43y2 + 222y*3 - 194y - 45y4 - 31	{ "pile_set_name": "DM Mathematics" }
n) + 3q(n). What is -7d(l) + 3g(l)? -2l*2 Suppose -g + 16 = x, 0g + 5g = 3x - 24. Let y(p) = -6 - 6p2 + 5p + 3p2 + x. Let s(o) = 5o*2 - 8o - 11. Give 5s(a) + 8y(a). a*2 + 1 Let y(b) = -17b. Let n(s) = 35s. What is 3n(h) + 7y(h)? -14h Let u(g) = -3g3 - 9. Let x(h) = -9 - 4h*3 + 4 + 2h*3. What is -5u(w) + 9x(w)? -3w*3 Suppose -3l + 0 = -k + 7, 11 = k - 5l. Let j(n) = n3 - n2 + n + 1. Let m(d) = d3 + 2d + 2. Determine km(v) - 2j(v). -v*3 + 2v*2 Let m = 0 + -3. Let h(a) = 7a + 2. Let x(n) = -4n - 1. Suppose 3y + 24 = -3j, -4y + y - 5j - 30 = 0. Calculate mh(v) + yx(v). -v - 1 Let p(m) = -14m*2 + 2m. Let k(z) = 29z2 - 5z. Give -2k(n) - 5p(n). 12n2 Let z be 7/3 - 1/3. Let o(y) = 2 - z + 5y - 4y. Let j(g) = -3g. Give -2j(f) - 4o(f). 2f Let t(c) be the first derivative of -c4/2 + c2 - c - 2. Let z(w) = 9w + 4w3 - 3w - 11w + w2 + 2. Calculate -5t(b) - 2z(b). 2b*3 - 2b2 + 1 Let w(q) = -q2 + 1. Let z(b) = -6b2 + 6. Calculate -3w(j) + z(j). -3j2 + 3 Let z = 1 + 0. Suppose -4j + 5 = 5c, 5j + 2c - c = 1. Let n = z - j. Let t(m) = -1. Let d(w) = -w3 + 5. What is nd(q) + 3t(q)? -q3 + 2 Suppose -v + 21 = -5k, k + 0 = 3v + 7. Let u(x) = 6x*2 - 5x - 5. Let t(j) = 7j2 - 6j - 6. Suppose -2s = -1 - 11. Calculate kt(m) + su(m). m2 Let c(u) = -5u*3 + 4u2 + u + 36. Let z(g) = g3 - g*2 - 7. Let y(f) = 2c(f) + 11z(f). Let w(i) = i3 - 4i*2 + 2i - 6. Calculate 3w(m) - 4y(m). -m*3 - 2m + 2 Suppose 7a - 18a = -33. Let p(z) = -z*2 + z + 4. Let l(y) = -y - 1. Determine al(u) + p(u). -u*2 - 2u + 1 Let g(m) = 2m3 + 4. Let d(z) = -3z*3 - 5. Suppose 0 = -2c + 10, 4p = -p + 4c + 5. What is pg(u) + 4d(u)? -2u3 Suppose 5g = 4v + 22, g - 7 = -v + 1. Let f be 2/g(3 - 0). Let k(y) = 1. Let z(r) = -2r3 + 2r + 5. What is fz(l) - 4k(l)? -2l3 + 2l + 1 Let w(o) = 6o2 - 4o - 5. Suppose 4l = 5n + 30, -5l - 3n + 23 = -2n. Let y(u) = -u2 + u + 1. Let t be (1/(-2))/(2/(-4)). Determine ly(d) + tw(d). d2 + d Let s(a) = -5a*2 - 4a + 7. Let m(f) = -14f2 - 11f + 20. Let w = 45 - 41. Give wm(r) - 11s(r). -r*2 + 3 Let l(m) be the first derivative of -7m*4/4 + 4m3/3 + m2 + 4m - 8. Let a(f) = 15f*3 - 9f*2 - 5f - 9. Determine -4a(b) - 9l(b). 3b3 + 2b Let w(d) = -2d - 5. Let a(f) = 2f + 4. What is -2a(b) - 3w(b)? 2b + 7 Let y(i) = i2 + i - 3. Let l(r) = -r2 - r + 1. Calculate -5l(d) - 2y(d). 3d*2 + 3d + 1 Let j = -191 + 186. Let v(z) = -z3 - 1. Let f(i) be the third derivative of -i3/6 + i*2. Give jf(r) + 3v(r). -3r3 + 2 Let f(a) = a3 - a*2 + a - 1. Let x(q) = -6q*3 + 4q*2 - 8q + 3. Determine 4f(u) + x(u). -2u*3 - 4u - 1 Let m(f) = 2f - 3. Let q(p) = -p + 4. Give -3m(c) - 4q(c). -2c - 7 Let r(d) be the third derivative of d4/6 - d3/6 + 12d2. Suppose 4n = 2n - 12. Suppose 26 + 44 = -5l. Let g(j) = -9j + 2. Determine lr(z) + ng(z). -2z + 2 Let w = 3 - 0. Let s(v) = -3v3 - 5v - 5. Let y(l) = 2l3 + 3l + 3. Let h be 9/(-12) + (-23)/(-4). Determine hy(f) + ws(f). f3 Let f(n) = n2 - n + 1. Let p(k) = 4k2 - 2k + 3. Calculate 4f(t) - 2p(t). -4t2 - 2 Let c(i) = 12i*2 + 11i + 11. Let o(a) = a*2 + a + 1. Suppose -2h = h + 18. Calculate hc(l) + 66o(l). -6l2 Let y(w) = 2w - 7. Let x(j) = -j + 3. Let b(g) = -7x(g) - 3y(g). Let c(s) = 4s + 2. Calculate -6b(z) + c(z). -2z + 2 Suppose -a - m = -4, 7m - 8 = -2a + 4m. Suppose -ad + 5d - 6 = 0. Let q(w) = -55w + 3 + 49w - 23. Let j(r) = -2r - 7. Calculate dq(n) - 17j(n). -2n - 1 Let y(d) = -5d - 2. Let c(r) = 9r + 3. Let j be ((-40)/(-4))/(2/1). Suppose jn = n - 4f + 36, 5f = -2n + 30. What is ny(b) + 3c(b)? 2b - 1 Let z(t) = 5t - 14. Let f(g) = -2g + 12 + 4g - 17. Calculate -8f(y) + 3z(y). -y - 2 Let z(s) = -2s3 + 10s*2 - 7s - 4. Let c(y) = -y*3 + 7y*2 - 5y - 3. Let k be 4 - (0 - (-1 - (2 - 6))). Determine kc(t) - 5z(t). 3t3 - t2 - 1 Let z(x) = 465x - 465x - 4x2 + 3. Let t(f) = f3 - 21f2 + 16. Calculate 2t(o) - 11z(o). 2o*3 + 2o2 - 1 Let r(c) = c2 - 1. Let b(f) be the second derivative of f5/20 + f4/3 - 2f2 - 3f. Calculate -b(s) + 4r(s). -s3 Let u(f) = 1. Let w(v) = 2v*2 + 4. Determine -6u(d) + w(d). 2d2 - 2 Let f(m) = -4m*3 - 4m*2 - 5m - 4. Let d(u) = -u*2 - u - 1. Calculate 4d(y) - f(y). 4y3 + y Let g(l) = -l - 3. Suppose -3d = -19 + 13. Let b(h) = -4 - h + d - 2. What is 5b(n) - 6g(n)? n - 2 Let y(w) = 25w - 5. Let x(s) = -13s + 2. Determine 5x(g) + 2y(g). -15g Let d(o) = -30o2 + 18. Let n(z) = -z2 + 1. What is d(l) - 18n(l)? -12l*2 Let d(g) = 5g*2 - 4. Let b(v) = 4v*2 - 3. What is 4b(c) - 3d(c)? c2 Let x(j) = 23j*2 - 3j + 11. Let w(c) = 11c2 - c + 5. Calculate 9w(k) - 4x(k). 7k*2 + 3k + 1 Let y(b) = -b3 - b2 - b + 1. Let j(v) = 5v3 + 8v*2 + 6v - 5. Determine j(q) + 6y(q). -q3 + 2q*2 + 1 Let o(r) = -4r + 1. Let g = 8 - 11. Let t(p) = 17p - 1. Let b(n) = 2n - 2n - 8n. Let m(j) = gt(j) - 5b(j). Determine -6m(w) + 17o(w). -2w - 1 Let h(o) = -2o - 6. Let i(t) be the third derivative of 5t4/24 + 17t*3/6 + 40t*2. Calculate -17h(g) - 6i(g). 4g Let m(u) = -u2 + u - 1. Let j(y) be the second derivative of y4/3 - y3/6 + y2 - 7y. Calculate -j(n) - 3m(n). -n*2 - 2n + 1 Let d(f) = 1. Let s(z) = 2z - 1. Give 3d(l) + s(l). 2l + 2 Let t(a) = 8a*2 + 8a + 4. Let z(n) = -23n2 - 23n - 11. Let m = -20 + 3. Calculate mt(o) - 6z(o). 2o2 + 2o - 2 Let s(u) = -4u2 + u - 11. Let j(v) = 7v*2 - 3v + 21. Let b(d) = -6j(d) - 11s(d). Let q(g) = g*2 + 3g - 2. Determine -3b(y) + 7q(y). y*2 + 1 Let a(x) = 3x + 4. Let t(h) = 1 - 7h + 4h + 8h + 6. Suppose 3s + s - 16 = 0. Give st(r) - 7a(r). -r Let f(c) = -3c - 2. Let k(v) = 3v + 2. Calculate 2f(b) + 3k(b). 3b + 2 Suppose -3n + 15 = 3. Let g(s) = -n + s + 1 - 4s2 + 7. Let j(a) = a. Let k(p) = -9p*2 + 9. Let t(i) = -3j(i) - k(i). Calculate -5g(l) - 2t(l). 2l2 + l - 2 Let a(z) = 5z*2 + 8z - 2. Let g(c) = -2c2 - 3c + 1. Suppose 19 = 4x - 9. Let n be (12 + -11)(x - -1). Determine ng(i) + 3a(i). -i2 + 2 Let o(w) = -w3 - w + 1. Let y be (1 - 1) + 1 + 0. Let s(q) be the first derivative of q3/3 + q2/2 - 2q - 11. Determine ys(r) + 2o(r). -2r3 + r2 - r Let n(y) = -5y + 1. Let h = 14 - 13. Let c(r) = -r. What is hn(q) - 4c(q)? -q + 1 Let p(q) = -2q + 0q2 - 4 + 2q*2 - q + 6q. Let v(g) = 3g2 + 4g - 5. Give 5p(a) - 4v(a). -2a2 - a Let m(u) = -u2 + u. Let r(h) = -h2 - 5h + 5h2 + 2 - 5 + 6. Give 3m(l) + r(l). l*2 - 2l + 3 Suppose -55 = 7b + 4b. Let l(y) be the second derivative of y*5/20 - 5y4/12 - y3/6 - y. Let k(j) = 2j2. Determine bk(c) - 2l(c). -2c*3 + 2c Let i(b) be the second derivative of -3b - 13/6b*3 + 0 + 1/6b*4 - 13/2b2. Let n(d) = d2 - 6d - 6. Give 6i(o) - 13n(o). -o2 Let z(l) = -3l - 6. Let j(x) = 3x + 6. Let u(d) = 2j(d) + 3z(d). Let b(i) = -4i - 7. Determine 6b(k) - 7u(k). -3k Let p(h) = 3h*3 + 7h*2. Let o(y) = 5y*2 - 2y*2 - 6y*3 - 7y*3 + 14y*3. Let f = 7 + -14. Give fo(s) + 3p(s). 2s*3 Let l(t) = 3 + 2t*2 + 2t2 + t2. Let p(i) = -24i2 - 14. Let b = -8 - 0. Let n be (b/(-10))/(4/(-70)). Determine nl(d) - 3p(d). 2d*2 Suppose 3 = 2o - 5. Let f(d) = d + 3. Let k be ((-8)/(-6))/(2/3). Let r(j) = 3 + 0 - k. Calculate or(q) - f(q). -q + 1 Let k(j) = -1. Let u(r) = r + 1. Let n(q) = -5. Let v(y) = -n(y) + 2u(y). Calculate -4k(t) - v(t). -2t - 3 Let y(c) = -2c. Let s(l) = -5 + 0 + 5 + l. Calculate -3s(j) - 2y(j). j Let a be (-4)/(-18) - 130/18. Let z(g) be the second derivative of g4/12 + 7g3/6 + g2/2 - 11g. Let x(k) = k2 + 6k + 1. Determine ax(w) + 6z(w). -w2 - 1 Let r(u) = -u3 - 3u - 22. Let h(f) = -2f - 22. Calculate 3h(i) - 2r(i). 2i3 - 22 Let r(t) = 2t - 14. Let s(n) = -n + 9. Calculate -5r(j) - 8s(j). -2j - 2 Let w(u) = -2u + 13. Let b(n) = -2n + 14. Calculate -3b(v) + 2w(v). 2v - 16 Let c(d) = d + 3. Let u(l) = -4l - 10. Calculate 20c(o) + 6u(o). -4o Let a	{ "pile_set_name": "DM Mathematics" }
s before 1:54 PM? 2:44 AM How many minutes are there between 7:53 AM and 1:21 PM? 328 How many minutes are there between 1:51 AM and 2:01 AM? 10 What is 690 minutes before 4:09 PM? 4:39 AM How many minutes are there between 10:25 PM and 11:54 PM? 89 What is 719 minutes after 2:17 AM? 2:16 PM How many minutes are there between 10:56 PM and 6:48 AM? 472 What is 676 minutes before 2:09 PM? 2:53 AM What is 592 minutes after 11:56 PM? 9:48 AM How many minutes are there between 3:13 AM and 11:40 AM? 507 What is 238 minutes before 10:54 PM? 6:56 PM What is 209 minutes after 1:24 PM? 4:53 PM How many minutes are there between 1:23 PM and 2:45 PM? 82 What is 710 minutes after 12:22 PM? 12:12 AM How many minutes are there between 6:23 AM and 2:02 PM? 459 What is 323 minutes before 2:04 PM? 8:41 AM What is 77 minutes after 10:34 PM? 11:51 PM What is 528 minutes after 4:05 PM? 12:53 AM How many minutes are there between 4:45 AM and 7:17 AM? 152 What is 12 minutes after 5:38 PM? 5:50 PM What is 616 minutes before 5:26 PM? 7:10 AM How many minutes are there between 12:31 AM and 5:34 AM? 303 How many minutes are there between 9:36 AM and 8:07 PM? 631 How many minutes are there between 3:43 AM and 10:53 AM? 430 How many minutes are there between 2:05 AM and 4:17 AM? 132 What is 636 minutes before 7:13 AM? 8:37 PM How many minutes are there between 6:08 PM and 5:29 AM? 681 What is 520 minutes before 4:51 PM? 8:11 AM How many minutes are there between 8:47 AM and 4:20 PM? 453 How many minutes are there between 9:44 PM and 12:50 AM? 186 What is 52 minutes before 7:40 PM? 6:48 PM How many minutes are there between 8:17 AM and 11:31 AM? 194 What is 366 minutes before 8:14 AM? 2:08 AM What is 627 minutes before 7:01 AM? 8:34 PM What is 719 minutes before 5:03 AM? 5:04 PM How many minutes are there between 7:35 PM and 7:04 AM? 689 How many minutes are there between 3:35 AM and 9:00 AM? 325 What is 236 minutes before 5:24 PM? 1:28 PM What is 77 minutes before 2:33 PM? 1:16 PM What is 702 minutes before 8:39 AM? 8:57 PM How many minutes are there between 10:56 AM and 8:05 PM? 549 What is 625 minutes before 5:39 AM? 7:14 PM How many minutes are there between 4:21 PM and 3:40 AM? 679 What is 503 minutes before 11:33 AM? 3:10 AM What is 664 minutes after 6:36 PM? 5:40 AM How many minutes are there between 6:21 PM and 4:52 AM? 631 What is 175 minutes after 2:18 AM? 5:13 AM What is 543 minutes after 5:23 PM? 2:26 AM How many minutes are there between 9:16 AM and 2:07 PM? 291 What is 279 minutes before 11:52 AM? 7:13 AM How many minutes are there between 10:48 PM and 5:22 AM? 394 What is 139 minutes before 10:54 PM? 8:35 PM What is 185 minutes before 12:08 PM? 9:03 AM How many minutes are there between 11:32 AM and 4:36 PM? 304 What is 320 minutes before 12:30 AM? 7:10 PM What is 98 minutes after 1:42 AM? 3:20 AM How many minutes are there between 3:13 AM and 2:44 PM? 691 What is 706 minutes after 1:54 PM? 1:40 AM What is 277 minutes after 11:27 PM? 4:04 AM What is 700 minutes after 1:25 PM? 1:05 AM What is 50 minutes before 8:10 AM? 7:20 AM What is 323 minutes before 9:56 PM? 4:33 PM What is 202 minutes before 3:54 PM? 12:32 PM What is 102 minutes before 10:50 PM? 9:08 PM How many minutes are there between 11:11 AM and 8:59 PM? 588 What is 115 minutes before 12:15 AM? 10:20 PM What is 539 minutes after 8:17 PM? 5:16 AM How many minutes are there between 11:42 PM and 8:03 AM? 501 How many minutes are there between 1:42 AM and 12:12 PM? 630 What is 581 minutes after 7:08 AM? 4:49 PM What is 458 minutes after 1:21 AM? 8:59 AM What is 617 minutes before 5:52 PM? 7:35 AM What is 628 minutes after 2:10 AM? 12:38 PM What is 472 minutes before 11:59 AM? 4:07 AM How many minutes are there between 2:18 PM and 12:17 AM? 599 What is 628 minutes before 12:21 AM? 1:53 PM How many minutes are there between 8:30 AM and 5:58 PM? 568 How many minutes are there between 6:10 AM and 10:44 AM? 274 How many minutes are there between 5:40 PM and 7:41 PM? 121 What is 254 minutes before 2:51 PM? 10:37 AM What is 191 minutes before 6:13 AM? 3:02 AM What is 408 minutes after 2:59 PM? 9:47 PM What is 399 minutes after 6:50 PM? 1:29 AM What is 507 minutes after 3:13 AM? 11:40 AM What is 458 minutes before 6:22 PM? 10:44 AM What is 353 minutes after 9:04 AM? 2:57 PM How many minutes are there between 10:16 PM and 12:22 AM? 126 What is 120 minutes after 7:38 AM? 9:38 AM How many minutes are there between 3:12 PM and 11:58 PM? 526 What is 462 minutes after 7:55 AM? 3:37 PM How many minutes are there between 4:54 AM and 12:44 PM? 470 How many minutes are there between 5:15 PM and 10:42 PM? 327 What is 204 minutes before 10:08 AM? 6:44 AM What is 502 minutes before 8:07 AM? 11:45 PM What is 283 minutes after 4:45 PM? 9:28 PM What is 597 minutes after 10:58 AM? 8:55 PM How many minutes are there between 11:13 AM and 7:53 PM? 520 What is 503 minutes before 10:10 AM? 1:47 AM What is 289 minutes before 9:45 PM? 4:56 PM What is 420 minutes before 2:23 AM? 7:23 PM What is 388 minutes before 3:53 PM? 9:25 AM How many minutes are there between 3:31 PM and 12:16 AM? 525 What is 186 minutes before 6:39 PM? 3:33 PM How many minutes are there between 5:35 PM and 12:45 AM? 430 How many minutes are there between 8:29 PM and 6:10 AM? 581 What is 305 minutes after 11:30 AM? 4:35 PM What is 170 minutes after 12:42 PM? 3:32 PM What is 148 minutes after 7:17 AM? 9:45 AM How many minutes are there between 8:32 PM and 4:53 AM? 501 How many minutes are there between 11:15 PM and 9:14 AM? 599 What is 496 minutes after 1:17 PM? 9:33 PM What is 470 minutes before 11:32 AM? 3:42 AM How many minutes are there between 7:48 AM and 7:28 PM? 700 What is 110 minutes after 7:07 PM? 8:57 PM How many minutes are there between 4:53 PM and 2:36 AM? 583 How many minutes are there between 1:26 AM and 12:55 PM? 689 How many minutes are there between 3:38 AM and 7:29 AM? 231 How many minutes are there between 2:54 AM and 7:09 AM? 255 What is 714 minutes before 4:30 PM? 4:36 AM How many minutes are there between 7:23 AM and 2:56 PM? 453 What is 595 minutes before 2:29 AM? 4:34 PM How many minutes are there between 5:59 PM and 11:03 PM? 304 How many minutes are there between 1:30 AM and 10:54 AM? 564 How many minutes are there between 3:47 AM and 6:12 AM? 145 What is 243 minutes after 12:38 PM? 4:41 PM How many minutes are there between 10:01 AM and 4:55 PM? 414 What is 54 minutes before 5:31 AM? 4:37 AM What is 492 minutes after 2:33 AM? 10:45 AM How many minutes are there between 8:30 AM and 10:13 AM? 103 What is 528 minutes before 4:58 PM? 8:10 AM How many minutes are there between 7:22 AM and 12:26 PM? 304 What is 313 minutes after 6:55 PM? 12:08 AM How many minutes are there between 9:10 AM and 5:55 PM? 525 How many minutes are there between 2:22 AM and 4:47 AM? 145 How many minutes are there between 1:37 AM and 1:26 PM? 709 How many minutes are there between 5:03 PM and 7:22 PM? 139 How many minutes are there between 1:30 AM and 6:04 AM? 274 What is 130 minutes after 10:45 PM? 12:55 AM What is 253 minutes before 5:50 PM? 1:37 PM How many minutes are there between 9:20 PM and 2:09 AM? 289 What is 553 minutes before 11:36 AM? 2:23 AM What is 300 minutes after 7:50 AM? 12:50 PM How many minutes are there between 5:45 PM and 9:55 PM? 250 What is 641 minutes before 11:31 AM? 12:50 AM What is 360 minutes after 5:29 AM? 11:29 AM How many minutes are there between 6:35 AM and 5:39 PM? 664 What is 111 minutes before 8:02 AM? 6:11 AM How many minutes are there between 6:22 PM and 4:09 AM? 587 How many minutes are there between 4:35 AM and 4:45 AM? 10 How many minutes are there between 2:00 PM and 5:11 PM? 191 What is 286 minutes after 8:34 PM? 1:20 AM What is 135 minutes before 4:53 PM? 2:38 PM How many minutes are there between 11:25 AM and 12:34 PM? 69 What is 646 minutes before 1:28 PM? 2:42 AM What is 82 minutes before 7:17 PM? 5:55 PM How many minutes are there between 10:41 PM and 10:40 AM? 719 How many minutes are there between 11:22 PM and 12:52 AM? 90 How many minutes are there between 11:12 AM and 9:58 PM? 646 What is 372 minutes before 3:49 AM? 9:37 PM How many minutes are there between 11:39 PM and 7:39 AM? 480 How many minutes are ther	{ "pile_set_name": "DM Mathematics" }
48)))*2 - sqrt(12)-3) + (sqrt(162)/sqrt(6) + sqrt(3) - ((sqrt(3) + 4)-2 + sqrt(3))2). -36 Simplify (1((4 + 2sqrt(2736) - (-3 + sqrt(2736)1)) + ((1sqrt(190) + sqrt(190))2)/(6(sqrt(10) - sqrt(10)-1))))*2. 518sqrt(19)/3 + 26452/9 Simplify -6((1(-4 + sqrt(684) + -1 - sqrt(684)) + 3)-3)2. -216 Simplify ((4 + -5(-3 + sqrt(392)2))1 + -4)*2. -4200sqrt(2) + 39425 Simplify (4(-3 + (sqrt(99) - 5(-2 + sqrt(99))) + 2)-6)2 + -4 + -2. -124416sqrt(11) + 959034 Simplify ((1sqrt(171))/sqrt(9) + -4 + ((sqrt(152) - (sqrt(152) + (sqrt(152) - 3(sqrt(152) - (-3sqrt(152) + sqrt(152))))))/sqrt(8))2)-21. -2424 - 2sqrt(19) Simplify ((sqrt(6)-1 + sqrt(6))-3)/sqrt(2) + 0 - (-4 + sqrt(27) + sqrt(2400)/sqrt(8)). -13sqrt(3) + 4 Simplify (3sqrt(224))/(-1sqrt(252)) + 4((1sqrt(72))2 - sqrt(14)/(sqrt(35)/sqrt(5))). -6sqrt(2) + 288 Simplify -2(sqrt(400)-1 - sqrt(400) - ((sqrt(100) - (sqrt(100) - sqrt(100)-2)) + sqrt(100) + sqrt(25)))/(1sqrt(25)/(4sqrt(5)))6. 336sqrt(5) Simplify sqrt(78)/sqrt(6) + -3 - 6(sqrt(13) + 3 + sqrt(13)) - (sqrt(52) + -53sqrt(52) + -4)*2. -10229 - 235sqrt(13) Simplify 1 + -3 + (2(sqrt(28) - sqrt(448)))/(6(sqrt(4) - sqrt(4)-3))-4. -2 + sqrt(7) Simplify (6sqrt(3168)-1 - sqrt(3168))/(4sqrt(275) - (4sqrt(44) + sqrt(11))). -84sqrt(2)/11 Simplify (3((sqrt(156)/(sqrt(40)/sqrt(10)-6))/(sqrt(576)/sqrt(48) + sqrt(48)) + -4))2. 2sqrt(13) + 20749/144 Simplify (2(sqrt(66) + sqrt(66) + -5sqrt(66)1 + 6sqrt(66)2)/(sqrt(150) + -1sqrt(150)-2 - (sqrt(150) - -5sqrt(150)-1)))2. 3564/1225 Simplify (1 + sqrt(2450) + 0 - ((-2sqrt(1250) - sqrt(1250)) + (sqrt(50) - (sqrt(7200) + 0))))-2-2. 4 + 660sqrt(2) Simplify (-56(-2(-2 + sqrt(448)) + sqrt(448) - -4(-2 + sqrt(448))))2. -172800sqrt(7) + 3643200 Simplify (-1(sqrt(187) + 2sqrt(187)) - (sqrt(187) + 41sqrt(187) + sqrt(187)))/(sqrt(396)3 + 3sqrt(1331) + sqrt(1331) + sqrt(1331)). -9sqrt(17)/73 Simplify ((5(sqrt(120) + (sqrt(120) - sqrt(120)-2 - sqrt(120))))/(-2sqrt(10)4))/(3-1sqrt(6) + -2sqrt(96) + sqrt(96)). 15sqrt(2)/56 Simplify -6(((sqrt(567) - -3sqrt(567))6 + 4)*2 - (2 + (-1sqrt(567) + 5)*2)). -1956084 - 10908sqrt(7) Simplify (-4(3 + ((5 + (sqrt(2736) + (sqrt(2736) - -2sqrt(2736)) - sqrt(2736)))-3 - (0 + -1 + sqrt(2736) - (sqrt(2736) + 5 + sqrt(2736)2)))) + -1)*2. 15456sqrt(19) + 2145553 Simplify (sqrt(364)/(1-2sqrt(7))4)/(((sqrt(24) + sqrt(72)/sqrt(3))3 - sqrt(24))/(sqrt(6) + (sqrt(6) - sqrt(18)/(sqrt(3) + sqrt(27) + sqrt(3))))). -18sqrt(13)/25 Simplify 2 + ((sqrt(60)/sqrt(4) + sqrt(15))-2)/((sqrt(3) - sqrt(48))-3) + (-2 + (sqrt(125) - sqrt(125)-2-2) + 3)2. -274sqrt(5)/9 + 1128 Simplify (sqrt(21) - (sqrt(21) + 2sqrt(21)-6) - sqrt(42)/sqrt(2)-1)/(((-1sqrt(112) - sqrt(112)) + sqrt(112))6) + -1. -1 - 13sqrt(3)/24 Simplify ((51sqrt(132) + -1sqrt(132)5)5)/(sqrt(12)-3-5 + (-3sqrt(12) - sqrt(12))5). 0 Simplify ((6((-1 + sqrt(243))1 + 5) - 1((sqrt(243) + 1)4 + sqrt(243) + (sqrt(243) + 1 - sqrt(243))-2))1)2. 396sqrt(3) + 727 Simplify (-5(1 + -3 + -3sqrt(147) + 3 + sqrt(147) + 4(sqrt(147) + 0) + -4))2. -2100sqrt(3) + 14925 Simplify (((sqrt(208) - (sqrt(208)1 + 3))1 - ((sqrt(208) + -1 + sqrt(208))4 + 5))2 + 0)-2. -26656 - 512sqrt(13) Simplify -322sqrt(1700)4 - (6(((sqrt(1700) + sqrt(1700)-2)-6 + sqrt(1700) - sqrt(1700) - sqrt(1700)) + (sqrt(1700)-21 - sqrt(1700)) + sqrt(1700)))*2. -550800 - 480sqrt(17) Simplify 2-3(22-5((-2 + sqrt(272))-3 + 6(sqrt(272) + 0 + sqrt(272))))2. -52963200 - 1036800sqrt(17) Simplify 3(5 + (-4 + 2 + 4 + -4sqrt(304))4). -192sqrt(19) + 39 Simplify (sqrt(300)1 + 0 - (1 + sqrt(300) + 1)) + -4 + (3sqrt(270))/((sqrt(70)3 - sqrt(70))/sqrt(7)). -6 + 9sqrt(3)/2 Simplify ((sqrt(2187) - sqrt(2187)1)-4 - (sqrt(2187)2 + sqrt(2187))5)/((sqrt(2268) + sqrt(2268)-2)/(-2sqrt(343) + sqrt(343))). -315sqrt(3)/2 Simplify ((sqrt(24) + sqrt(2904) + 4sqrt(2904))3)/(sqrt(300) + 65sqrt(300)). 168sqrt(2)/155 Simplify (-3(2 + -1 + -4(-1 + -2sqrt(325) + -4))5)*2. 378000sqrt(13) + 4779225 Simplify (4(3sqrt(2736) - sqrt(2736)) + 4 - -6(sqrt(2736) + sqrt(2736) + -4)-2)*2. -19968sqrt(19) + 703120 Simplify ((sqrt(78)-4)/sqrt(3) + (1sqrt(208))/sqrt(8))/(-1(sqrt(60)/(sqrt(5)1))/sqrt(6)). 3sqrt(13) Simplify 5(3 + -4 + sqrt(20)/sqrt(4) + 5 - 1(2 + 2 + sqrt(500))2). -2560 - 395sqrt(5) Simplify ((((sqrt(825) - sqrt(825)-3) + sqrt(825) - sqrt(825))6)/(sqrt(36)/(sqrt(12) - (2sqrt(144))/sqrt(12))) + -4)2. 960sqrt(11) + 158416 Simplify (-65((sqrt(147)1 + 3 - (sqrt(147) - ((sqrt(147) + sqrt(147)2)-2 + sqrt(147) - sqrt(147)))) + (2(-1 + sqrt(147)) - (sqrt(147)-2 + -1)))-3)*2. -453600sqrt(3) + 4795200 Simplify (-2-6(-1sqrt(2448) - sqrt(2448)) + 5 + (2 + sqrt(2448) - sqrt(2448)) + (-1-1sqrt(2448) - sqrt(2448)))2 + -1. -4032sqrt(17) + 1410096 Simplify sqrt(15)/(sqrt(25)/sqrt(5)5) + 4 - ((5(-1 + sqrt(3)) + 3)*2 + -4). -71 + 101sqrt(3)/5 Simplify ((sqrt(720)2 - sqrt(20))/sqrt(4) + -1sqrt(5)-3-6 - ((sqrt(5)1 - sqrt(5)) + 0 - 5(sqrt(5) + -1))2-2)*2. -1080sqrt(5) + 4045 Simplify (((-1sqrt(84) - sqrt(84))-5)/(sqrt(4) + sqrt(44)/(sqrt(11) + (sqrt(11)1 - sqrt(11)))))/(-2sqrt(300)14)5. -5sqrt(7)/16 Simplify 6(sqrt(80) + -1sqrt(80) + -1 + sqrt(80)14 + (3sqrt(80)-3 - sqrt(80)) + 1 + 0 + sqrt(80))*2. 12000 Simplify 1-23(-4 + (((sqrt(2057) - 1sqrt(2057)) + 5)-1)*2)-2. 252 Simplify ((((sqrt(18)/sqrt(3))/sqrt(3))*2 - sqrt(192)/sqrt(6)) + -5(3 + sqrt(162) + sqrt(162) + sqrt(162))*2)6 + -1. -43999 - 4884sqrt(2) Simplify (sqrt(17) + -4)3 - sqrt(612)-1 - (1sqrt(204)3)/(sqrt(432)2). -12 + 35sqrt(17)/4 Simplify (-3 + -3 + -1 + (1(-1sqrt(30) + sqrt(30))-5)/(1sqrt(150)-1))*2. 49 Simplify (5(sqrt(143) - sqrt(143)1) - (sqrt(143) - (sqrt(143) + (sqrt(143) - -1sqrt(143)) + sqrt(143))3))/(sqrt(33)/(sqrt(18)/(sqrt(30)/sqrt(5)))). 11sqrt(13) Simplify 4((sqrt(24) - (sqrt(2400)2 + sqrt(24)) - sqrt(24)) + sqrt(240)/((sqrt(10) - sqrt(90)) + sqrt(10)))/(sqrt(48)-4 + -1sqrt(1452)). 88sqrt(2)/19 Simplify (sqrt(70) - (2sqrt(70)1 - sqrt(70)))/(sqrt(490)1) - (sqrt(5103) + -2 - sqrt(63)-3-1)*2. -2272 + 72sqrt(7) Simplify (sqrt(156)/(-5sqrt(3) - sqrt(3))4)/(-1sqrt(64)-5 + sqrt(64)). -sqrt(13)/36 Simplify ((sqrt(1620) + sqrt(1620)5 + (sqrt(2205) - (sqrt(2205) - -1sqrt(2205))) + sqrt(45))/((3sqrt(441) + sqrt(441) - sqrt(441))41))2. 125/196 Simplify -4((sqrt(208) + -3)-3)2 + (-6(sqrt(156)-1 + sqrt(156) - sqrt(156)) + sqrt(156))/(sqrt(432) + -2sqrt(432) - sqrt(12)) + 3. -7809 + 863sqrt(13) Simplify 1 + (-2 + (-3 + -1 + sqrt(19)2 - (-4 + sqrt(152)/(sqrt(8)-2)))5)4. -7 + 50sqrt(19) Simplify ((-6(-1sqrt(220) - sqrt(220)))/(sqrt(275)1))/((sqrt(192)/sqrt(6)-2)/(sqrt(128)/sqrt(4))). -12sqrt(5)/5 Simplify ((sqrt(198)/(sqrt(72)/(1sqrt(8) + sqrt(8) + sqrt(8))))/((-4(sqrt(11) - sqrt(176)) - sqrt(11))5))*2. 18/3025 Simplify (-5(-3 + -4 + (sqrt(192) - (sqrt(192) + 1)-6 - (-2sqrt(192)-2 + sqrt(192) + sqrt(192))))3)*2. -3600sqrt(3) + 43425 Simplify (0 + sqrt(42)/((sqrt(54) - 2sqrt(54))/sqrt(9)))2 - (sqrt(70) - (sqrt(70) - (sqrt(70) - (sqrt(70)2 + sqrt(70)))4))/(sqrt(10) + -1sqrt(10)-3). 2sqrt(7) + 7 Simplify -6(2 + sqrt(30)/(sqrt(24)/sqrt(4))4 + 2 + (-5(sqrt(180) + 1))2). -27174 - 1824sqrt(5) Simplify ((-2(sqrt(833) + 1) - (4 + 1 + sqrt(833)))6)*2 + (-3sqrt(4131))/(sqrt(147) + -3sqrt(147) + sqrt(147)). 74115sqrt(17)/7 + 271656 Simplify -1 + sqrt(7) + sqrt(7) + 4 + 2sqrt(49)/sqrt(7) - (4 + -5((1 + sqrt(7))1)2). 14sqrt(7) + 39 Simplify (-3sqrt(176)2)/(sqrt(16)-2) + (0 + sqrt(99) + 0 + sqrt(99))4 + 3. 3 + 27sqrt(11) Simplify -1 + (sqrt(294)/sqrt(6)1)/((sqrt(7)-1 - sqrt(7))-5 - sqrt(7))4. -1 + 4sqrt(7)/9 Simplify (3(sqrt(11) + -2 + sqrt(11) + sqrt(11) + 3 + -1)2 + (-3(sqrt(1331) - (sqrt(1331) + 1 + -4 - sqrt(1331)) - sqrt(1331)))*2)-3. -1134 Simplify (5 + sqrt(88)/(sqrt(8) + sqrt(72)/sqrt(9) + sqrt(8))-3)2 - 2sqrt(132)/(sqrt(300)-3). -148sqrt(11)/15 + 36 Simplify -2 + ((sqrt(52) + sqrt(52) + 2)3)2 - (sqrt(468) - (5(1sqrt(468) + sqrt(468)))2 - ((-2 + sqrt(468) + sqrt(468))2 + 1)). 90sqrt(13) + 50583 Sim	{ "pile_set_name": "DM Mathematics" }
3 + 19l + 20l + 200l*3 - 39l. 148l3 Collect the terms in -3l*2 + 128861l*3 - 128862l*3 + 3l2. -l3 Collect the terms in 7l2 + 22996088 - 22996088. 7l*2 Collect the terms in -24a - 21a - 23a + 94a - 19a. 7a Collect the terms in 3 - 61l*2 - 3 + 39l*2 + 57l*2. 35l*2 Collect the terms in -2934w - 2594w - 803w + 331w. -6000w Collect the terms in 11061b + 4222b - 111 + 111. 15283b Collect the terms in 5348b*2 - 5348b*2 - 1342b*3 - 2b. -1342b3 - 2b Collect the terms in -20713 - 20715 - 340k2 + 41428. -340k*2 Collect the terms in -1 - 12r*2 + 10190r + 1 + 0 - 10189r. -12r*2 + r Collect the terms in -197472b + 197468b + 989 - 989. -4b Collect the terms in -6295l3 + 12781l*3 - 6296l*3. 190l*3 Collect the terms in -250a + 468a - 78a*3 - 82a*3 - 218a + 162a3. 2a*3 Collect the terms in 1840y + 43y2 + 19y*2 - 1840y. 62y2 Collect the terms in 1124h*2 + 1103h*2 - 13h*2 + 122h*2. 2336h*2 Collect the terms in 166a - 602a + 156a + 135a + 153a. 8a Collect the terms in 221s + 3 + 380s3 - 109s - 111s. 380s*3 + s + 3 Collect the terms in 166g - 103g - 40g. 23g Collect the terms in -31d*2 + 8714943d - 8714943d. -31d*2 Collect the terms in 561 - 561 + u + 22u*2. 22u*2 + u Collect the terms in 91l - 12l - 46l - 18l - 13l. 2l Collect the terms in 3d + 3d - 6d - 55760d3. -55760d*3 Collect the terms in 8830 - 8830 + 2j*3. 2j*3 Collect the terms in -5 + 3t - 13t + 6t. -4t - 5 Collect the terms in 13920 - 13920 + 1455t. 1455t Collect the terms in -95 + 17 + 17 + 9c + 61. 9c Collect the terms in 2b*3 - 387b - 413b + 1204b - 404b. 2b*3 Collect the terms in -828680q*2 + 414342q2 - q3 + 414338q2. -q3 Collect the terms in 14832r - 14832r + 30r*2 + 3. 30r*2 + 3 Collect the terms in -298c + 443c - 146c. -c Collect the terms in -67370 + 37s + 67370. 37s Collect the terms in 67 - 14 - 43 - 2n2 - 10. -2n*2 Collect the terms in -3l - 16 + 14l + 16. 11l Collect the terms in -132185u + 132185u + 115u3. 115u*3 Collect the terms in 87x*2 + 34 + 34 - 83x*2 - 68. 4x2 Collect the terms in 735 + z3 - 632 + 2z3 + 5z*2. 3z*3 + 5z*2 + 103 Collect the terms in -56130r*3 + 18713r*3 + 18709r*3 + 18728r*3. 20r*3 Collect the terms in -3 - 6739c + 4 - 4. -6739c - 3 Collect the terms in 35f*2 + 21f*2 - 109f*2 + 40f*2. -13f*2 Collect the terms in 4w*2 + 6768 + 2w + 5w2 - 18w*2. -9w*2 + 2w + 6768 Collect the terms in -4972 - 10r + 4971 + 12r. 2r - 1 Collect the terms in -2802g - 29g2 + 2802g. -29g2 Collect the terms in 231s*2 + 243s*2 - 715s*2 + 235s*2. -6s*2 Collect the terms in -48g*2 - 51g*2 + 1 + 100g2 - 1. g2 Collect the terms in 47388 - 47388 - 14c2 - 12c*2. -26c*2 Collect the terms in -5043s + 1674s + 1667s + 1678s. -24s Collect the terms in 6847j - 17j*2 - 6847j. -17j2 Collect the terms in -1 - 2x + 1 - 329x3 - 64x*3 + 21x*3. -372x*3 - 2x Collect the terms in 3 - 3 + 12399q + 31845q. 44244q Collect the terms in 4212a*2 + 4230a*2 + 3 - 3 - 12685a*2 + 4215a*2. -28a*2 Collect the terms in -4k - 5k2 - 14k + 8k2 - 6k. 3k2 - 24k Collect the terms in 3n3 + 819 + 824 + 2n*3 + 0n*3 - 1643. 5n*3 Collect the terms in 18k*2 - 11k*2 - 4 + 18k*2 - 10k*2 + 4. 15k*2 Collect the terms in -96l*2 + 4l*2 + 40l*2. -52l*2 Collect the terms in -1426 - 1445 + 2871 + 5w*3. 5w*3 Collect the terms in -154 + 139f - 4226f + 74 + 80. -4087f Collect the terms in 635t2 + 874t*2 + 1505t*2. 3014t*2 Collect the terms in -2064n*2 - 2105n*2 - 16 + 4171n*2. 2n*2 - 16 Collect the terms in -6q + 18q - 31q + q. -18q Collect the terms in 7412o - 8o3 + 7414o - 22241o + 7415o. -8o3 Collect the terms in 608m*3 + 186m*3 + 0m*3. 794m*3 Collect the terms in -34t - 192t3 + 34t. -192t3 Collect the terms in 0g - 2212 - 218 - 4g + 2g. -2g - 2430 Collect the terms in 22854f - 11442f - 11439f. -27f Collect the terms in -h2 + 229h*3 + 227h3 + h2. 456h3 Collect the terms in 0b2 + b2 + 5b2 + 14b + 2b2. 8b*2 + 14b Collect the terms in 854d3 - 5d*2 + 238d*3 + 5d*2. 1092d3 Collect the terms in -360 - b2 - 359 + 719. -b*2 Collect the terms in -5 - 1 + 1586p - 781p - 785p + 4. 20p - 2 Collect the terms in 91 + 1818w*3 - 173 + 84. 1818w*3 + 2 Collect the terms in 3f*2 + 2f*2 - 17f*2 - 7f*2. -19f*2 Collect the terms in -679a*3 - 101a*3 - 911a*3. -1691a*3 Collect the terms in -3 + 30913s - 30913s + 119s*3. 119s*3 - 3 Collect the terms in 1567613s*3 - 3135223s*3 + 1567616s*3. 6s*3 Collect the terms in 16t + 22 - 14 - 6. 16t + 2 Collect the terms in 18i*2 - 64i*2 + 9i2 + i2. -36i2 Collect the terms in -9 + 13 - 4 - 1943m*3. -1943m*3 Collect the terms in -4703z + 4278z - 15897z. -16322z Collect the terms in -6886n*3 + 13777n*3 - 6889n*3. 2n*3 Collect the terms in 8i*2 + 7i*2 - 10i - 295 + 4i. 15i*2 - 6i - 295 Collect the terms in 663994o2 + 663888o*2 - 1327879o*2. 3o*2 Collect the terms in 5028i - 2498i - 2514i - 1. 16i - 1 Collect the terms in 2x2 + x2 + 9x + 15x + 36x - 4. 3x*2 + 60x - 4 Collect the terms in 1555b - 510b - 763b. 282b Collect the terms in 2z2 - 44 + 2z*2 - 5z2 + 27. -z2 - 17 Collect the terms in 48r - 19r - 11r + 227 - 227 - 20r. -2r Collect the terms in -43b + 84386 - 84386 - 45b + 80b. -8b Collect the terms in -1538 - 1534 - 1525 - k + 4597 + 4k. 3k Collect the terms in 348872u*3 - 697725u*3 + 348856u*3. 3u*3 Collect the terms in -41p*2 + 39p*2 + 6 - 3 - 3 - 612p. -2p2 - 612p Collect the terms in -7c + 15c + 35c. 43c Collect the terms in 15 + 95g3 + 52 + 49g*3 - 69. 144g*3 - 2 Collect the terms in 287y + 0 + 182y + 0. 469y Collect the terms in -8 + 120o - 8 + 17. 120o + 1 Collect the terms in 3m2 - 2655m*3 + 4m*2 + 5311m*3 - 2660m*3. -4m*3 + 7m2 Collect the terms in k2 + 0 + 0 + 78768k - 78761k. k*2 + 7k Collect the terms in -7w3 - 7367w*2 - 6w*3 - 7371w*2 + 14738w*2. -13w*3 Collect the terms in -45g*3 + 27g*3 + 25g*3 + 99g + 39g. 7g*3 + 138g Collect the terms in -314k + 154k - 4 + 4 + 221k. 61k Collect the terms in 68f3 - 13f*3 + 53f*3 + 22f*3. 130f*3 Collect the terms in -6w - 44w3 - 14w*3 + 6w. -58w3 Collect the terms in 111h*2 - 65h*2 - 21h*2 - 24h2. h2 Collect the terms in -10 + 32 - 20 - 8q3. -8q*3 + 2 Collect the terms in 298a*3 + 297a*3 - 910a*3 + 289a*3. -26a*3 Collect the terms in 9i*2 - 7i*2 - 72i*2 - 20i*2 + 15i*2. -75i*2 Collect the terms in 0y + 49y - 292 - 37y - 14y. -2y - 292 Collect the terms in 48637h2 + 2h3 - h3 - 48758h2. h3 - 121h*2 Collect the terms in 586m - 1765m + 592m + 587m + 34m*2. 34m*2 Collect the terms in -13z - 4z + 2z - 8z - 10z + 45z. 12z Collect the terms in -67449l + 67449l - 39l3. -39l*3 Collect the terms in -134604r*2 + 134604r*2 + 7r*3. 7r*3 Collect the terms in 449x - 815x + 397x. 31x Collect the terms in -78q - 3 - 164q - 3. -242q - 6 Collect the terms in 633262471 + 4c - 633262471 + 2c. 6c Collect the terms in -1373x*2 + 2746x*2 + 107x - 1357x2 - 107x. 16x2 Collect the terms in -235l*3 + 77l*3 - 56l*3 + 40l*3. -174l*3 Collect the terms in -7146u*3 + 177 - 177 - 1025u*3. -8171u*3 Collect the terms in -12t - 6 + 0 + 18 - 9 - 24t. -36t + 3 Collect the terms in 2 - 728z - 138z + 1 - 3. -866z Collect the terms in -13j + 68j - 9j - 37j. 9j Collect the terms in 1656269 + 8v - 1656269. 8v Collect the terms in -273647 + 38r + 273647. 38r Collect the terms in -21b2 + 87 - 47 + 78 - 118. -21b*2 Collect the terms in 18r - 4r + r + 2r - 6r - 5r. 6r Collect the terms in -94b*2 - 2 + 148b*2 + 48b*2 + 274b*2. 376b*2 - 2 Collect the terms in -15x + 53x2 - 28x*2 + 15x. 25x2 Collect the terms in k3 + 4 - 6 - 5k*3 - 5 - 10k*3. -14k**3 - 7 Coll	{ "pile_set_name": "DM Mathematics" }
of 47336? 3 What is the thousands digit of 4475? 4 What is the units digit of 29818? 8 What is the units digit of 31871? 1 What is the units digit of 16978? 8 What is the units digit of 530? 0 What is the tens digit of 823? 2 What is the hundreds digit of 606? 6 What is the hundreds digit of 1243? 2 What is the units digit of 914? 4 What is the units digit of 6844? 4 What is the thousands digit of 1135? 1 What is the thousands digit of 2124? 2 What is the ten thousands digit of 34615? 3 What is the units digit of 37959? 9 What is the thousands digit of 1276? 1 What is the units digit of 28069? 9 What is the ten thousands digit of 25897? 2 What is the thousands digit of 1936? 1 What is the tens digit of 46159? 5 What is the hundreds digit of 1332? 3 What is the tens digit of 2017? 1 What is the hundreds digit of 11531? 5 What is the hundreds digit of 1636? 6 What is the thousands digit of 27492? 7 What is the thousands digit of 1952? 1 What is the hundreds digit of 94554? 5 What is the ten thousands digit of 23287? 2 What is the thousands digit of 1359? 1 What is the units digit of 5871? 1 What is the hundreds digit of 1568? 5 What is the hundreds digit of 55771? 7 What is the hundreds digit of 111807? 8 What is the hundreds digit of 2410? 4 What is the hundreds digit of 300? 3 What is the units digit of 1022? 2 What is the ten thousands digit of 44710? 4 What is the units digit of 4878? 8 What is the thousands digit of 5712? 5 What is the tens digit of 968? 6 What is the thousands digit of 9711? 9 What is the tens digit of 1572? 7 What is the tens digit of 13? 1 What is the thousands digit of 19888? 9 What is the units digit of 88? 8 What is the hundreds digit of 14071? 0 What is the tens digit of 20687? 8 What is the thousands digit of 2276? 2 What is the units digit of 62996? 6 What is the units digit of 9355? 5 What is the ten thousands digit of 14367? 1 What is the hundreds digit of 40234? 2 What is the units digit of 498? 8 What is the hundreds digit of 51919? 9 What is the units digit of 1870? 0 What is the thousands digit of 53592? 3 What is the thousands digit of 1577? 1 What is the thousands digit of 1929? 1 What is the thousands digit of 64729? 4 What is the tens digit of 64976? 7 What is the hundreds digit of 6386? 3 What is the thousands digit of 73075? 3 What is the units digit of 90887? 7 What is the hundreds digit of 785? 7 What is the units digit of 1267? 7 What is the hundreds digit of 43700? 7 What is the hundreds digit of 313? 3 What is the units digit of 14017? 7 What is the tens digit of 81712? 1 What is the thousands digit of 1096? 1 What is the tens digit of 2720? 2 What is the units digit of 27? 7 What is the units digit of 3683? 3 What is the tens digit of 594? 9 What is the hundreds digit of 20461? 4 What is the hundreds digit of 4247? 2 What is the units digit of 509? 9 What is the hundreds digit of 6202? 2 What is the hundreds digit of 892? 8 What is the units digit of 10088? 8 What is the units digit of 3329? 9 What is the hundreds digit of 811? 8 What is the units digit of 10296? 6 What is the tens digit of 38667? 6 What is the ten thousands digit of 24236? 2 What is the units digit of 1135? 5 What is the tens digit of 53486? 8 What is the hundreds digit of 7183? 1 What is the hundreds digit of 2255? 2 What is the units digit of 577? 7 What is the thousands digit of 1291? 1 What is the units digit of 93? 3 What is the hundreds digit of 961? 9 What is the units digit of 979? 9 What is the tens digit of 4721? 2 What is the units digit of 1372? 2 What is the tens digit of 1220? 2 What is the thousands digit of 38336? 8 What is the units digit of 20386? 6 What is the tens digit of 19768? 6 What is the units digit of 2967? 7 What is the thousands digit of 2622? 2 What is the tens digit of 18687? 8 What is the thousands digit of 95273? 5 What is the hundreds digit of 6913? 9 What is the tens digit of 359? 5 What is the hundreds digit of 49059? 0 What is the hundreds digit of 825? 8 What is the hundreds digit of 963? 9 What is the units digit of 7979? 9 What is the tens digit of 3070? 7 What is the tens digit of 899? 9 What is the ten thousands digit of 12147? 1 What is the tens digit of 718? 1 What is the ten thousands digit of 42868? 4 What is the units digit of 74552? 2 What is the tens digit of 6249? 4 What is the ten thousands digit of 31746? 3 What is the units digit of 1327? 7 What is the thousands digit of 11701? 1 What is the ten thousands digit of 20871? 2 What is the units digit of 897? 7 What is the tens digit of 364? 6 What is the units digit of 57? 7 What is the hundreds digit of 4132? 1 What is the units digit of 3303? 3 What is the tens digit of 4529? 2 What is the hundreds digit of 1437? 4 What is the hundreds digit of 6549? 5 What is the units digit of 2002? 2 What is the units digit of 568? 8 What is the tens digit of 517? 1 What is the ten thousands digit of 25221? 2 What is the thousands digit of 32844? 2 What is the hundreds digit of 137830? 8 What is the tens digit of 41171? 7 What is the hundreds digit of 3281? 2 What is the units digit of 3440? 0 What is the units digit of 3178? 8 What is the ten thousands digit of 13021? 1 What is the hundreds digit of 527? 5 What is the hundreds digit of 906? 9 What is the tens digit of 637? 3 What is the tens digit of 539? 3 What is the hundreds digit of 315? 3 What is the units digit of 105168? 8 What is the hundreds digit of 213? 2 What is the ten thousands digit of 34050? 3 What is the units digit of 23523? 3 What is the thousands digit of 9622? 9 What is the thousands digit of 1924? 1 What is the units digit of 42287? 7 What is the units digit of 996? 6 What is the hundreds digit of 7845? 8 What is the hundreds digit of 6606? 6 What is the thousands digit of 10680? 0 What is the hundreds digit of 3990? 9 What is the hundreds digit of 15844? 8 What is the hundreds digit of 701? 7 What is the tens digit of 15346? 4 What is the ten thousands digit of 12211? 1 What is the ten thousands digit of 21805? 2 What is the units digit of 545? 5 What is the units digit of 7698? 8 What is the ten thousands digit of 94436? 9 What is the units digit of 864? 4 What is the thousands digit of 3070? 3 What is the tens digit of 148835? 3 What is the tens digit of 2836? 3 What is the tens digit of 11509? 0 What is the thousands digit of 1022? 1 What is the units digit of 2110? 0 What is the units digit of 15401? 1 What is the thousands digit of 51047? 1 What is the hundred thousands digit of 116361? 1 What is the tens digit of 867? 6 What is the thousands digit of 63502? 3 What is the ten thousands digit of 11926? 1 What is the thousands digit of 3039? 3 What is the units digit of 31532? 2 What is the units digit of 3411? 1 What is the thousands digit of 5469? 5 What is the hundreds digit of 14736? 7 What is the hundred thousands digit of 118572? 1 What is the tens digit of 18247? 4 What is the ten thousands digit of 46113? 4 What is the ten thousands digit of 19653? 1 What is the units digit of 1615? 5 What is the tens digit of 21129? 2 What is the tens digit of 3762? 6 What is the units digit of 100730? 0 What is the hundreds digit of 311? 3 What is the tens digit of 841? 4 What is the ten thousands digit of 72039? 7 What is the tens digit of 2223? 2 What is the tens digit of 5380? 8 What is the hundreds digit of 56541? 5 What is the thousands digit of 3182? 3 What is the units digit of 10297? 7 What is the hundreds digit of 33840? 8 What is the tens digit of 2036? 3 What is the units digit of 94933? 3 What is the tens digit of 2184? 8 What is the thousands digit of 16895? 6 What is the thousands digit of 12300? 2 What is the units digit of 877? 7 What is the ten thousands digit of 96236? 9 What is the hundreds digit of 3775? 7 What is the hundreds digit of 118798? 7 What is the units digit of 8384? 4 What is the hundreds digit of 160? 1 What is the hundreds digit of 33772? 7 What is the tens digit of 895? 9 What is the hundreds digit of 42812? 8 What is the tens digit of 5172? 7 What is the tens digit of 3949? 4 What is the hundreds digit of 71756? 7 What is the tens digit of 165683? 8 What is the hundreds digit of 1588? 5 What is the ten thousands digit of 41395? 4 Wha	{ "pile_set_name": "DM Mathematics" }
er when 1437528 is divided by 2522? 2510 What is the remainder when 231443 is divided by 4055? 308 What is the remainder when 2916089 is divided by 277? 110 What is the remainder when 645060 is divided by 14648? 548 What is the remainder when 15354276 is divided by 17? 12 What is the remainder when 2301003 is divided by 6444? 495 What is the remainder when 4949875 is divided by 308? 7 Calculate the remainder when 253005 is divided by 87. 9 What is the remainder when 904924 is divided by 301576? 196 What is the remainder when 40341284 is divided by 2373015? 29 What is the remainder when 2145246 is divided by 76613? 82 Calculate the remainder when 1326638 is divided by 176. 126 Calculate the remainder when 213894 is divided by 1280. 134 What is the remainder when 69782481 is divided by 9968921? 34 What is the remainder when 371525 is divided by 18575? 25 Calculate the remainder when 784357 is divided by 766. 739 What is the remainder when 5123850 is divided by 853968? 42 Calculate the remainder when 860420045 is divided by 50. 45 Calculate the remainder when 5266513 is divided by 46. 19 Calculate the remainder when 503971 is divided by 18. 7 What is the remainder when 80076 is divided by 15261? 3771 What is the remainder when 17844692 is divided by 23761? 181 What is the remainder when 586421 is divided by 2497? 2123 What is the remainder when 176839775 is divided by 68? 63 What is the remainder when 341038 is divided by 2664? 46 Calculate the remainder when 1507666 is divided by 62. 12 Calculate the remainder when 22395693 is divided by 3293. 0 What is the remainder when 1263815 is divided by 1066? 605 What is the remainder when 45023883 is divided by 174? 165 Calculate the remainder when 166402 is divided by 1005. 577 What is the remainder when 603759 is divided by 2721? 2418 What is the remainder when 12572898 is divided by 322382? 0 Calculate the remainder when 3680134 is divided by 3759. 73 What is the remainder when 38082616 is divided by 102? 100 What is the remainder when 453173 is divided by 453130? 43 Calculate the remainder when 3235772 is divided by 15263. 16 Calculate the remainder when 127456821 is divided by 1165. 1161 What is the remainder when 136880 is divided by 132484? 4396 Calculate the remainder when 188116 is divided by 2045. 2021 What is the remainder when 1818449 is divided by 5435? 3159 Calculate the remainder when 9627509 is divided by 113. 22 What is the remainder when 24062407 is divided by 47? 5 What is the remainder when 97045415 is divided by 2563? 2546 What is the remainder when 603348 is divided by 30? 18 What is the remainder when 98749 is divided by 3405? 4 What is the remainder when 2589798 is divided by 161861? 22 Calculate the remainder when 139519 is divided by 2146. 29 What is the remainder when 1082919 is divided by 10627? 9592 Calculate the remainder when 119377 is divided by 9186. 9145 Calculate the remainder when 453896 is divided by 19729. 129 Calculate the remainder when 71669574 is divided by 2664. 2646 What is the remainder when 26546299 is divided by 105? 94 Calculate the remainder when 57879876 is divided by 2199. 2196 What is the remainder when 155891 is divided by 5567? 15 What is the remainder when 27407 is divided by 5382? 497 Calculate the remainder when 6292858 is divided by 428. 402 Calculate the remainder when 104279 is divided by 5487. 26 What is the remainder when 78831 is divided by 39261? 309 Calculate the remainder when 12355419 is divided by 16. 11 What is the remainder when 3933665 is divided by 1320? 65 What is the remainder when 8166021 is divided by 277? 61 What is the remainder when 18779897 is divided by 2461? 6 What is the remainder when 4754879 is divided by 299? 181 What is the remainder when 1393463 is divided by 6481? 48 What is the remainder when 1137845 is divided by 751? 80 Calculate the remainder when 273379 is divided by 136632. 115 What is the remainder when 10531162 is divided by 2381? 2380 What is the remainder when 248300 is divided by 123119? 2062 Calculate the remainder when 5127788 is divided by 870. 8 Calculate the remainder when 4374575 is divided by 153. 152 What is the remainder when 36294212 is divided by 73? 72 What is the remainder when 3411745 is divided by 30462? 1 What is the remainder when 151409 is divided by 1415? 4 Calculate the remainder when 344663 is divided by 2743. 1788 Calculate the remainder when 2916315 is divided by 40503. 99 What is the remainder when 131585 is divided by 1664? 129 Calculate the remainder when 12580523 is divided by 1258048. 43 What is the remainder when 77170108 is divided by 2859? 2839 Calculate the remainder when 1801006 is divided by 232. 222 What is the remainder when 17850 is divided by 6606? 4638 Calculate the remainder when 429957 is divided by 169. 21 What is the remainder when 16046530 is divided by 8? 2 What is the remainder when 676536 is divided by 676531? 5 Calculate the remainder when 133174 is divided by 12. 10 Calculate the remainder when 56903368 is divided by 2149. 2146 Calculate the remainder when 421116 is divided by 1395. 1221 What is the remainder when 16088692 is divided by 28? 4 What is the remainder when 153553388 is divided by 51184456? 20 What is the remainder when 11112401 is divided by 243? 11 What is the remainder when 574176 is divided by 4? 0 Calculate the remainder when 1015159 is divided by 1235. 1224 What is the remainder when 406720 is divided by 7020? 6580 What is the remainder when 99351 is divided by 462? 21 Calculate the remainder when 100376 is divided by 16692. 224 What is the remainder when 212699 is divided by 2798? 51 What is the remainder when 9359631 is divided by 168? 15 What is the remainder when 152341 is divided by 11528? 2477 What is the remainder when 304330713 is divided by 53? 49 Calculate the remainder when 255504 is divided by 36470. 214 Calculate the remainder when 232808 is divided by 77247. 1067 Calculate the remainder when 412211 is divided by 10042. 489 What is the remainder when 337698993 is divided by 439? 438 Calculate the remainder when 20024281 is divided by 2528. 2521 Calculate the remainder when 34087303 is divided by 3933. 3925 Calculate the remainder when 65116924 is divided by 109. 106 What is the remainder when 2930198 is divided by 758? 528 What is the remainder when 594605 is divided by 919? 12 What is the remainder when 5057219 is divided by 64836? 11 Calculate the remainder when 291458 is divided by 145591. 276 Calculate the remainder when 887759 is divided by 3148. 23 Calculate the remainder when 3926332 is divided by 981578. 20 Calculate the remainder when 179776 is divided by 622. 18 Calculate the remainder when 960602 is divided by 1166. 984 Calculate the remainder when 166710 is divided by 51. 42 Calculate the remainder when 169804 is divided by 8934. 58 What is the remainder when 121536 is divided by 118297? 3239 Calculate the remainder when 13996 is divided by 4581. 253 Calculate the remainder when 115691399 is divided by 112. 103 What is the remainder when 56243352 is divided by 173? 14 Calculate the remainder when 8925 is divided by 1161. 798 Calculate the remainder when 1682925 is divided by 104. 101 Calculate the remainder when 12776837 is divided by 18. 5 Calculate the remainder when 396544 is divided by 39652. 24 What is the remainder when 409789543 is divided by 1970? 1963 Calculate the remainder when 163647038 is divided by 59747. 5 What is the remainder when 1118725 is divided by 13318? 13 What is the remainder when 11929477 is divided by 1650? 1627 Calculate the remainder when 1648783 is divided by 824323. 137 Calculate the remainder when 20936226 is divided by 268413. 12 What is the remainder when 3084298 is divided by 300? 298 What is the remainder when 1017865 is divided by 1925? 1465 Calculate the remainder when 107764 is divided by 1140. 604 What is the remainder when 13835964 is divided by 143? 142 What is the remainder when 69244921 is divided by 8655615? 1 Calculate the remainder when 82495 is divided by 27486. 37 What is the remainder when 328788 is divided by 1482? 1266 What is the remainder when 22542291 is divided by 7514061? 108 Calculate the remainder when 16961316 is divided by 1275. 1266 What is the remai	{ "pile_set_name": "DM Mathematics" }
-0.3 Let t be (-3)/15-14 - 2. Let m = -152.7 - -142.7. Which is the nearest to -0.1? (a) t (b) m (c) -5 a Suppose 4y + 5 = -y. Let z = 7147 - 7150. What is the nearest to y in z, -0.7, 5, 0.05? -0.7 Let m = -7.03 - -0.03. Suppose 4r - 6r + 5d = 120, -4r - 240 = -d. Let w be -5(1 + 64/r). What is the closest to m in 2, w, 4? w Let i = 119/52 + -20/13. Let q = -2 + 15. Let a = q - 15. What is the closest to 0 in i, a, 3/7? 3/7 Suppose -7554 - 3930 = -12k. Suppose -954 + k = 3j. Which is the closest to 0.2? (a) 2/7 (b) -3/7 (c) j a Let o(q) = q + 9. Let t be o(-9). Suppose t = -42g + 59g + 51. Which is the closest to -1/27? (a) 1/2 (b) 0 (c) g b Let k = 0.8585 - 0.9585. Which is the closest to 2/5? (a) k (b) -6 (c) -0.2 a Let u = 0.807 + -0.807. Let c = -366 + 6224/17. What is the closest to u in 1, c, 4? c Let h = 1247 + -2119. Let w = h + 1745/2. Let y = 0.07 + 2.93. What is the closest to w in y, 0.1, -42? 0.1 Let d = -2245.866 + 2246. What is the nearest to -0.1 in d, 0.4, 3? d Let f = 3 + -2. Let l = -1854.7 - -1568. Let p = l - -287. What is the nearest to 0 in 5, p, f? p Let p = 79246 + -79245. Let h = 0.9 - 1. What is the closest to h in -0.4, 2, p? -0.4 Let w = 574.1 + -573.6. What is the nearest to 73 in 1, 0.2, w? 1 Let q = 1.2 + -0.96. Let t = 3.76 + q. What is the closest to -4 in 1/4, -4, t? -4 Let r = -0.04809 + -0.15191. Which is the closest to 0.2? (a) r (b) -2 (c) 2/41 c Let n = -0.271 - -0.471. Let s be -1 + (-1 - 0)/(187/(-153)). What is the closest to 2 in n, -5, s? n Suppose -2498 = 7k + 442. Let r be 4/(-24) - 14/k. What is the closest to -12 in r, -4/3, 1? -4/3 Suppose -4n = -244h + 241h + 334, 176 = -2n + 3h. Which is the nearest to 0? (a) -4 (b) -2/7 (c) n b Let j = -722 + 1014. Let h = j - 1462/5. What is the closest to h in -35, 2/5, 1, 0.2? 0.2 Let x = 33 + -32.977. Let l = x - 2.023. Which is the nearest to -0.1? (a) l (b) 1/9 (c) 1/3 b Let j = 2.4 - -0.6. What is the nearest to j in 0.3, 3, -3/2, 2? 3 Let x be 4/221 - 1050/(-275). Let f be 1(-1 + 0 + x). What is the nearest to f in -3/23, 3, -0.3? 3 Let w = -4508.2 - -4508. Which is the closest to 0.1? (a) 2/3 (b) -0.5 (c) 1/19 (d) w c Let g(o) = -o3 + 6o*2 - 14o + 10. Let q be g(5). Let f be ((-3)/(1176/q))/((-2)/(-8)). Which is the nearest to f? (a) 3 (b) -0.2 (c) 0.4 (d) -0.4 c Let j = -1 + 0.8. Let m = 21.8 + -22. Let l be -60(-1)/(-144)4/(-5). Which is the nearest to m? (a) 0.5 (b) j (c) l b Let k = -6092 - -6093. What is the closest to -1 in -3/7, -2/13, -0.6, k? -0.6 Let s = 216/565 + 2/113. Let u = 61698 + -61709. What is the nearest to -0.1 in 0.2, s, u? 0.2 Let l = 5801 - 5798. What is the nearest to 3 in 4/3, l, 2.5? l Let f = -73 + 366/5. Suppose -2h - 4 = 4. Let u be (-4)/(-1)(1 + 14/h). Which is the closest to -4? (a) f (b) -1/2 (c) u b Let r be (2/(-14) - (-43020)/5670) + -7. Suppose -6 - 2 = 2f. Which is the nearest to f? (a) r (b) 5 (c) -1/3 (d) 0 c Let k be -9 + (-13)/(780/(-528)). Which is the nearest to k? (a) -0.4 (b) 0.3 (c) 2 (d) 8 a Let r = 113.0925 + 0.9975. Let u = 114 - r. Which is the closest to -1/3? (a) 5 (b) u (c) 1 b Let g be (-6076)/5859 + 2/54. Which is the closest to -477? (a) 3 (b) 1/9 (c) g c Let j(y) = 9y*2 - y - 2. Let u be j(2). Let i be u/(-36) + 10/45. Let a = -3.5 + 4. What is the closest to -1 in -5, a, i? i Let m = 2438.4 - 2425. Let i = -0.18 - -13.18. Let s = i - m. Which is the closest to 0.2? (a) -0.08 (b) 0 (c) s b Let y = 7989.9 - 7990. Which is the nearest to y? (a) 3 (b) 5 (c) -7 (d) 35 a Let k(z) = -13z + 67. Let x be k(5). Let f be 8/x2/24. Which is the closest to 0.1? (a) -0.5 (b) f (c) 7/9 b Suppose 2u + 2q - 5 = -1, -2q - 1 = u. Let v be (-2)/u + 24/210. Let l = -151268/7 - -21610. Which is the closest to 12/5? (a) l (b) v (c) 0.4 c Let a = -5/2 - -11/6. Let q = 36165 + -36164.9. What is the nearest to q in -1, a, 0.2, 7? 0.2 Let n = -1.46 - 1.54. Let u = -10 - -12. Let z be (u/8)/(14/8). Which is the closest to -1? (a) z (b) 0.4 (c) n a Let i(r) = -2r2 - r. Let k(f) = -13f*2 - 19f - 20. Let v(x) = 5i(x) - k(x). Let s be v(-3). Which is the closest to 11? (a) s (b) -3/2 (c) 3 (d) 2/7 a Let r = 183 - 162. Suppose r = -4t + 41. Which is the nearest to 1/5? (a) t (b) -2 (c) 4 b Let b = 633/22 - 322/11. Let u(r) = r3 + r2. Let p be u(1). Let d = 1 + 0. What is the closest to p in b, d, -1/3? d Let l(g) = 14g2 + 767g - 162. Let h be l(-55). Which is the nearest to -1.8? (a) -2 (b) h (c) 27 (d) -0.5 a Let o = -204 + -71. Let g = 269 + o. Let l = 1.2 + -0.7. Which is the nearest to -0.1? (a) 1/6 (b) l (c) g a Let p be 5 + 47/(188/(-120)). Which is the nearest to -2? (a) 0.2 (b) p (c) -0.3 c Let j = -235.33 - -236. Let y = -1.33 - j. Let r = 0 + 0. What is the nearest to 1 in r, y, -2/19? r Let q = 61 - 241/4. Let d = 3094 - 3092. Which is the closest to 3? (a) -5 (b) d (c) q b Let x = -1528/9763 - -2/751. What is the closest to 0 in 1, x, 3, -50? x Let s be (-1827)/42(-1)/((-45)/80). Which is the closest to -1? (a) s (b) 0.2 (c) -3 b Let x = -0.0086 - 22.1914. Let i = x - -21.8. Which is the nearest to -2/3? (a) 5/2 (b) 5 (c) i c Let v = -3.886 + -1.114. Which is the nearest to 0.007? (a) v (b) 0.3 (c) 3 b Let i = 2621 + -2616. Which is the nearest to -2/7? (a) -5 (b) i (c) -39 (d) -0.02 d Let k be 69/(-276) - ((-322)/8 - 1). Suppose -5l - 3r = 4, -5l + k - 21 = -5r. What is the closest to l in -0.4, -1/4, -1/10, 69? -1/10 Let t = 47828/5 - 9566. What is the nearest to t in 4, 1.9, 3/4? 3/4 Let w = 1.6097 + 0.3903. Let q = 5 + -16/3. What is the nearest to q in w, 0.1, -4/3? 0.1 Suppose 5i = -3 - 2. Let v = -240 - -239.9597. Let j = -5.0403 - v. Which is the closest to i? (a) -0.3 (b) -2 (c) j a Let u = 946/9 - 105. Let w = 845.1 - 800. Let y = w + -45. Which is the nearest to u? (a) 2/15 (b) -1 (c) y c Suppose -26a + 16 = -18a. Let j be ((-4172)/(-40))/7-2. Let s = 30 + j. What is the closest to 0 in s, a, -4? s Let u = 0.14 - 2.14. Let h = -35/47 + 23/94. Which is the nearest to h? (a) 0.1 (b) -1/3 (c) u b Let s = -8.1 + 8.07. Let h = 217 + -109. Let i be (-60)/h(-3)/5. What is the nearest to 2/9 in 4, i, s? i Let t = 9 + -5.6. Let g = t + -3.3. Suppose -3h + 5 = -10. Which is the nearest to g? (a) h (b) 0 (c) 6 b Let g = -2/121155 - 121147/484620. Let q(o) = -3o*2 - 4o - 3. Let x be q(-3). Let z be 3/(-9) - 2/x. Which is the nearest to g? (a) -6 (b) z (c) 3 b Let l = 22.2 + -21.9. Let h = -14.8 + -0.4. Let g = h - -15. Which is the nearest to 0? (a) -1.6 (b) g (c) l b Let g = -7313 + 7072. Which is the closest to -1? (a) g (b) 2 (c) 0 c Let c = 7.819 + -7.64. Let i = -0.021 - c. What is the closest to i in 2/3, -0.4, -3/2, -4? -0.4 Let t = 18929 + -18928.6. What is the closest to -2 in 4048, t, -3/2, 3? -3/2 Suppose -16p + 6p = -3p + 147. What is the nearest to 1 in 0, p, -0.4, 3/4? 3/4 Let g = -0.9 + 0.4. Let s = 110624 + -1438114/13. Which is the nearest to -1? (a) s (b) 0.2 (c) -96 (d) g d Let n be (-1)/7 + (-2)/7. Let i be -870/1344 - (1 + (-7)/6). Which is the closest to n? (a) 3 (b) -4 (c) i c Let g = -7 + 15. Let h be (-1)/(-4) + (-10)/g. Let w be -10 + (-441)/(-27) + -7. Which is the closest to h? (a) w (b) 1/2 (c) -5 a Let y = 2.7 - 0.1. Let o = y - 1.9. Let x = -3.7 + o. What is the nearest to -2/3 in -10, x, 3/4? 3/4 Let o = -0.03 - -0.53. Let w = -49 - -48.67. Let u = w - -0.33. What is the closest to 0 in -5, u, o? u Let r be (13/(-11) - -1)/(-1). Let j = 49210 - 49210.11. Which is the nearest to 1? (a) 0.3 (b) r (c) j a Suppose 3x - 4g - 36 = 0, -4g = x - 2x + 12. Let b be (x/105)/(12/(-10)). Let i = 3621 - 3617. What is the nearest to b in 1, i, -3? 1 Let d = 0.174 - -112.826. Let l = 77 - d. Let i = -36 - l. Which is the closest to i? (a) 2 (b) -0.13 (c) 1 b Let m = 1.06 - 1.2. Let p = -83.05 - -83. Let n = m - p. Which is the closest to -0.1? (a) n (b) 2/5 (c) -5 a Let f = -11059.7 + 11059. Let n(y) = y + 1. Let p be n(-6). Which is the nearest to 1? (a) 1 (b) f (c) p a Suppose -2u + 3h + 18 = -h, 3h = -15. Let m be (u10/5)/(6/15). What is the nearest to -0.1 in -2, -1/5, m?	{ "pile_set_name": "DM Mathematics" }
)))tt40 assuming t is positive. t(2025/23) Simplify (v/(v/((v/(vv16))/v)))/(vv*(-2/11)v)v/v5v(4/11) assuming v is positive. v(-247/11) Simplify h*(-5)hh(-4/7)h*(-6)h(-1/37) assuming h is positive. h(-2745/259) Simplify ((c/(c/c(-15)))/c(-23))/(c*(2/23)cc/c(1/3)) assuming c is positive. c(431/69) Simplify u/(u(u/u*(2/37)uu)/uu)u/(u/(uuuu/u*(-3/7)uuu)u)u(u(-12))(23/4) assuming u is positive. u(-16710/259) Simplify (((h/((((hh*1/hhh)/h)/h)/h)h)/(h/h(-6)))18)(-2/47) assuming h is positive. h(180/47) Simplify ((((k/(k*(-1/8)/k))/k)/k)/(k((k/k*9k)/k)/kk))(-43) assuming k is positive. k(-2451/8) Simplify ((cc*(-20)ccc)/c)/((c*14c)/c)(c/c(-19/4)c)/cc/c(-16) assuming c is positive. c(-33/4) Simplify (z(2/59)/zz/(z/z*15))/(((z/(z/(zz(-12))))/z)/z(-2/5)) assuming z is positive. z(7562/295) Simplify (z(-5/3)z/z16)/(z(-15/2)/z(-2)) assuming z is positive. z(-67/6) Simplify (((r(4/3))(2/107))(1/45))36 assuming r is positive. r(32/1605) Simplify (u8u*(25/2))/((uu/((u/(u/u24))/u))/(u/u(7/2))) assuming u is positive. u*39 Simplify tt/t*(-17)t(t/(tt*(9/7)))/t(tt(-6/7)t)/(t(12/5)/t) assuming t is positive. t(611/35) Simplify (i*(1/3)/i)/(iiii*(1/8)i)(ii*(-1))/(i/(i/(ii(-1)/i))) assuming i is positive. i(-91/24) Simplify (u(-5))6/(uu/(uu*(-10)u)u/(uu/(uu/u(-10)))) assuming u is positive. u(-51) Simplify ((m(-2)/((m/m(-2/5))/m))/((m(1/3)/m)/m(1/8)))(27/2) assuming m is positive. m(-1737/80) Simplify u(2/13)u/u*(-14)(u/u*(8/7)u)(-2/23) assuming u is positive. u(31561/2093) Simplify s*(-2/5)s*(11/6)/s((s*15s)/s)/s(1/2) assuming s is positive. s(224/15) Simplify (h*(-1/4)h)/hhh*(9/4)(h(-5))4 assuming h is positive. h(-17) Simplify (d/d(-4/25))/(d*(5/2)/d)d/(((dd(-17/3)dd)/d)/d)dd29 assuming d is positive. d(5299/150) Simplify ((t/(t7t)t(t*(-2/7)t)/t)(1/9))(-29) assuming t is positive. t(1276/63) Simplify (g14g)/gg*6g/(gggg21)gg/(gg*27g) assuming g is positive. g*(-30) Simplify (bb*(1/3))/bb*2((b/(bbb*(-1/10)b))/b)/(bb/(b(-5)/b)bb) assuming b is positive. b(-317/30) Simplify (k(-15/8)/(kk*(-13)))/((kkkk*(1/17)/kkkk)/k(1/34)) assuming k is positive. k(693/136) Simplify (s(-2/37)/s(-9)s(-2/33)s(-6/13)/s)3 assuming s is positive. s*(117838/5291) Simplify (f/(ff(1/7)/f))/f(-3/5)f(10/11)/(f30/f) assuming f is positive. f(-10254/385) Simplify ((ii/(iiii(-11))i4)(-2/55))(-38) assuming i is positive. i(1064/55) Simplify o/((o*(-23)o)/o)oooo*4ooo/o*(3/8)oo/(o(-15)o) assuming o is positive. o(397/8) Simplify o(-15/8)oo*(-5)o(ooo/o(-11/7))/(o/o(-13/3)o) assuming o is positive. o*(-1115/168) Simplify (ss/(ss0/s)s8)/((s(-1/3)/s)/ss(7/5)/s) assuming s is positive. s(179/15) Simplify (m(4/9)m/m*12)/((mm*(-4))/(mm1)) assuming m is positive. m(-50/9) Simplify (b/(b*(-13)/b)b*(-2/21))/(b(b*(8/5)/b)/bbb(-1/3)) assuming b is positive. b(1432/105) Simplify t(-4/11)tt(2/7)tt(t/t*20)/(((t/(t/(tt*(-36)tt)))/t)/t) assuming t is positive. t(1457/77) Simplify (q(9/2)qq12)/(q(-20)qqq*9q) assuming q is positive. q(51/2) Simplify z(1/9)/(z*11/z)(zz0/z)(-10) assuming z is positive. z(-89/9) Simplify ((h/h(-2/9))(-9/7)((h*(-1)/hh)/h)(3/11))(-50) assuming h is positive. h*(8150/77) Simplify ((tt/(tt/t8))/(t/((tt(-19))/t)))/(t(3/10)t)(22/5) assuming t is positive. t(-443/25) Simplify (((b/b6)/b(-9))/(((b(-1)/b)/b)/bbb(2/5)/b))(-1/5) assuming b is positive. b(-38/25) Simplify (i20)(-34)(i/(ii/i31i))/i(-4/19) assuming i is positive. i(-12365/19) Simplify ((s/s*10)/((ss*(-1/2))/s)s*(-2/9)s1)(1/17) assuming s is positive. s*(-139/306) Simplify (ff*(1/9)f/(f*0f))/(f11/(f(-6)/f)) assuming f is positive. f*(-152/9) Simplify ((kk1)/k(-36))33 assuming k is positive. k1254 Simplify (x*(-15)/(x/(xx/(x/x(-20)))))/(x(17/5)(x(x*18/x)/x)/xx) assuming x is positive. x(-277/5) Simplify ((h(-1)hhh/(hh(-10/7)))(-26))(3/14) assuming h is positive. h(-663/49) Simplify (((d/((dd/(d(-1/7)dd)d)/d))/d)/(d*(-9)dd))/(d/(d/d6)d10) assuming d is positive. d(-64/7) Simplify ((a/(aaa*(-8)/aa))(22/7))33 assuming a is positive. a726 Simplify (k(-1)/k)/kk9(k7)34 assuming k is positive. k*244 Simplify (kk/((k(2/3)/k)/k))(-3/7)k(-4/9)/((((((k/(k/(kk*(2/25)))k)/kk)/k)/kk)/k)/k) assuming k is positive. k(-1501/1575) Simplify (d15/d(-10))/((d(1/4)d)/d2) assuming d is positive. d(103/4) Simplify p(p/(((pp(2/27))/p)/p))/pp/((p*(2/13)/pp)/pp)pp4/p(1/5) assuming p is positive. p(13289/1755) Simplify (c33(cc34/c)/c)/(c(4/19)cc(-1/8)) assuming c is positive. c(9867/152) Simplify ((ooo(-1/3))/o)/oo*(1/4)(o1)44 assuming o is positive. o*(527/12) Simplify (i(i/(ii(-2/31)/iii))/i)/(i/i(-9))i/i*(8/3)i(-7) assuming i is positive. i(-1823/93) Simplify v*(-11)/vv/((vv12)/v)v*(-2/21)v(5/3) assuming v is positive. v(-150/7) Simplify (qq(-10)q*(-5/6)q(qq(-1))(1/77))(-6/7) assuming q is positive. q(53/7) Simplify (k12)(10/3)/(kk/((k/(kk*(-1/19)))/kk))(-3/11) assuming k is positive. k(8471/209) Simplify (j*(-1/11)jjj(6/5))/(j(19/2)j(-23)j) assuming j is positive. j(1717/110) Simplify ((p/(p/(p(-3/4)/pp)))/pp)*(-7/2)(pp2)(-5/6) assuming p is positive. p(1/8) Simplify (u(2/9)uu)/(u(-2/39)/u)u*(-13)/((u/(u/((uu/(uu(-10)))/u)))/u) assuming u is positive. u(-2191/117) Simplify (nn((n/n(1/5))/nn)/n)/(n(n/(nn(nn*16/n)/n))/n)n*(2/13)nnn*(1/9)nnnn assuming n is positive. n(14078/585) Simplify a(6/5)/(a12/a)(a4)(41/4) assuming a is positive. a*(156/5) Simplify (x/(((xx0)/x)/x))(2/19)x/(xxxx/(x/(((xx/x(-15))/x)/x))x)xx/(x/(x*(3/10)xx)x) assuming x is positive. x*(-2943/190) Simplify (q/((q(((q*(2/33)q)/q)/qq)/q)/qq))/qq(-5)/qq(-12)/(q/q(-3/8)) assuming q is positive. q*(-5131/264) Simplify ((((sssss/((s/(s/s(2/3)))/s))/s)/s)/s)/(s(-2/15)s)s(-6/11)/s(1/2) assuming s is positive. s(139/330) Simplify (i(-7))14(ii/i(-4/11))(-12/7) assuming i is positive. i(-7858/77) Simplify (kk*0/kk)*(-38)(kk(-2/5))/k10 assuming k is positive. k(-237/5) Simplify (ff*(3/4)fff*(9/4)(f(-1))(-3/7))(-3/14) assuming f is positive. f(-135/98) Simplify ((lll/((ll(12/11)l)/l))/(ll/(l(1/7)l)l))/((((((l(-13)l)/l)/ll)/ll)/l)/(l(3/4)/l)) assuming l is positive. l(3943/308) Simplify (i(-21))(-40)i2ii10i assuming i is positive. i854 Simplify (v/v(-5/3))/v*(4/5)(v/(v3/v))(-24) assuming v is positive. v(388/15) Simplify (m(-15)/m)*(-36)/(mm/m(-3))21 assuming m is positive. m*471 Simplify (((pp*(1/2)/pp)(-1))(-13))(2/63) assuming p is positive. p(13/21) Simplify (((a(-4))47)(-1/26))(3/7) assuming a is positive. a(282/91) Simplify ((w6ww(4/3))(-36))(1/5) assuming w is positive. w(-60) Simplify (((k(k/(kkk/k(-2/5)))/k)/((k/(k/(k(2/17)kk))kk)/k))(-1/44))(-1/10) assuming k is positive. k(-469/37400) Simplify ((p(-5))(-1/7))47 assuming p is positive. p(235/7) Simplify (y(-2))(-1)/(yy(-3/4))(-24) assuming y is positive. y*8 Simplify ((((j(j/(j/(j*(-2/37)j))j)/j)/j)/j)/(j1j))/(jj9j)(-2/25) assuming j is positive. j(-1086/925) Simplify c*(5/6)/(c(c*(-3/2)/c)/cccc)(((cc(c/c(3/2))/c)/c)/c)(10/11) assuming c is positive. c(-34/33) Simplify (((c5c)/c)40)(-29) assuming c is positive. c(-5800) Simplify (o(-12))(-6)/(o(4/7)o)(-2/87) assuming o is positive. o(43870/609) Simplify ((p(-2/9)ppp*10pp)(-3/4))(2/7) assuming p is positive. p(-62/21) Simplify ((kk/((kk(7/4))/k))(17/3))(-7) assuming k is positive. k(-119/12) Simplify y25/y30(y(y/(y*(2/1	{ "pile_set_name": "DM Mathematics" }
3/2 - 124y*2 - 15621y/2 - 15129 = 0. -123, -2 Suppose -21c2 + 225c + 66 = 0. Calculate c. -2/7, 11 Factor 2j2/5 - 5614j/15 - 624/5. 2(j - 936)(3j + 1)/15 Suppose p3/4 + p2/4 - 35p + 147 = 0. Calculate p. -14, 6, 7 Let 2w5 + 640w*4 + 67400w*3 + 2242080w*2 - 9797760w + 10077696 = 0. What is w? -108, 2 Factor 2j2/7 - 102j - 716/7. 2(j - 358)(j + 1)/7 Factor -2y2/3 + 1636y/3 - 1630. -2(y - 815)(y - 3)/3 Factor -5s3 + 20s*2 + 385s. -5s(s - 11)(s + 7) Solve -3x*3/8 - 437x*2 - 1017335x/8 + 339889/4 = 0 for x. -583, 2/3 Factor 2c5/7 - 578c*4/7 + 40886c*3/7 + 126146c*2/7 + 127312c/7 + 42632/7. 2(c - 146)2(c + 1)*3/7 Factor -166s*2/9 + s/3. -s(166s - 3)/9 Let -2r*2/15 + 1534r/15 + 512/5 = 0. What is r? -1, 768 Factor 3y3 + 195y*2 + 918y + 1080. 3(y + 2)(y + 3)(y + 60) Factor -5n*2/2 - 13n/4 - 3/4. -(n + 1)(10n + 3)/4 Suppose 21s3/4 - 169s*2/4 - 331s - 91 = 0. Calculate s. -14/3, -2/7, 13 What is j in j*3/2 - 50j*2 + 1411j/2 = 0? 0, 17, 83 Factor -4q2 - 296q/3 + 100/3. -4(q + 25)(3q - 1)/3 Factor -4b*3 - 326b*2 + 166b + 164. -2(b - 1)(b + 82)(2b + 1) Let 2y3/3 + 52y*2/3 - 110y/3 + 56/3 = 0. What is y? -28, 1 Let 36i2 - 3376i - 752 = 0. Calculate i. -2/9, 94 Determine r, given that -2r2/5 + 20516r/5 - 52613282/5 = 0. 5129 Factor -3l2/4 + 3l/2 + 9/4. -3(l - 3)(l + 1)/4 Solve -2l5 - 12l*4 + 60l*3 + 400l*2 + 582l + 252 = 0. -7, -3, -1, 6 Determine v so that -4v5 - 12v*4 + 16v3 = 0. -4, 0, 1 Factor k2/5 - 13k/5 + 6. (k - 10)(k - 3)/5 Suppose 3v4/7 + 66v*3/7 + 216v*2/7 = 0. Calculate v. -18, -4, 0 Let 3q*3/7 + 333q*2/7 + 2214q/7 + 3120/7 = 0. Calculate q. -104, -5, -2 Factor -100f3 + 24f*2. -4f*2(25f - 6) Let -x4/5 - 37x*3/5 - 198x*2/5 - 76x - 248/5 = 0. Calculate x. -31, -2 Factor 2x2 + 5296x + 3505952. 2(x + 1324)2 Determine z, given that -5z*3 - 575z*2 - 5250z = 0. -105, -10, 0 Factor -4c2 - 484c + 1488. -4(c - 3)(c + 124) Factor -5t3 - 55t*2. -5t*2(t + 11) Determine t, given that 2t5 - 14t*4 - 36t*3 - 4t*2 + 34t + 18 = 0. -1, 1, 9 Factor 4g4 + 116g*3 + 480g*2. 4g*2(g + 5)(g + 24) Let l3 - 57l*2 + 110l = 0. What is l? 0, 2, 55 Suppose -27f4/4 - 111f*3/2 - 615f*2/4 - 153f - 27 = 0. What is f? -3, -2, -2/9 Factor -2b2/9 + 33008b/9 - 136191008/9. -2(b - 8252)2/9 Factor -2l*4/7 - 4l*3/7 + 2l*2/7 + 4l/7. -2l(l - 1)(l + 1)(l + 2)/7 Factor -p*4 + 6p*3 + 8p*2 - 6p - 7. -(p - 7)(p - 1)(p + 1)*2 Suppose -7a*2/2 - 6a + 2 = 0. Calculate a. -2, 2/7 Suppose -5b4 + 1240b*3 - 79315b*2 + 301340b - 223260 = 0. What is b? 1, 3, 122 Let 35d5 - 1705d*4 - 490d3 = 0. What is d? -2/7, 0, 49 Suppose -d3/3 - 673d2/3 - 112895d/3 + 113569/3 = 0. What is d? -337, 1 Let 4w4 + 8w*3 - 32w*2 = 0. Calculate w. -4, 0, 2 What is x in -5x*5 - 50x*4 - 170x*3 - 260x*2 - 185x - 50 = 0? -5, -2, -1 Solve -2v5/3 + 154v*4/3 - 962v*3 - 1014v*2 = 0 for v. -1, 0, 39 Find x such that -4x*3 - 20x*2 + 4x + 20 = 0. -5, -1, 1 Solve 5c2 - 35c + 50 = 0 for c. 2, 5 Factor -2r3/3 + 2r*2 + 8r/3. -2r(r - 4)(r + 1)/3 Factor -4v*5 - 60v*4 - 296v*3 - 440v*2 + 300v + 500. -4(v - 1)(v + 1)(v + 5)3 Factor -3m*3/2 + 2745m*2/2 + 5499m/2 + 2751/2. -3(m - 917)(m + 1)*2/2 Find f, given that 9f*5 + 318f*4 - 894f*3 + 684f*2 - 3f - 114 = 0. -38, -1/3, 1 Factor -15t3 - 39t*2 + 54t. -3t(t - 1)(5t + 18) Factor 2g2 - 32. 2(g - 4)(g + 4) Let -14d*5 - 718d*4 - 10706d*3 - 15314d*2 + 436088d - 713336 = 0. What is d? -19, 2, 26/7 Factor 2d5 - 6d*4 - 68d*3 - 104d*2 + 48d + 128. 2(d - 8)(d - 1)(d + 2)3 Suppose -22i*2/3 + 360i - 98/3 = 0. Calculate i. 1/11, 49 Let 3447b2 - 3453b + 6 = 0. Calculate b. 2/1149, 1 Solve -j*2 - 125j - 124 = 0 for j. -124, -1 Let -5n3/3 + 200n*2/3 + 205n/3 = 0. Calculate n. -1, 0, 41 Factor 2z3/3 - 388z*2/3 + 1670z + 1800. 2(z - 180)(z - 15)(z + 1)/3 Factor 5w*2 - 8030w + 3224045. 5(w - 803)2 Let -4i*3 + 108i*2 - 384i + 368 = 0. What is i? 2, 23 Suppose -j*3/3 + 239j*2/3 - 4720j - 4800 = 0. Calculate j. -1, 120 Factor 2r3/5 + 36r*2 + 810r. 2r(r + 45)*2/5 Factor -3i*2 + 378i - 11907. -3(i - 63)2 Determine u so that 5u*5 - 785u*4 - 4035u*3 - 2455u*2 + 4030u + 3240 = 0. -4, -1, 1, 162 Factor c*4/2 + 12c*3 + 77c*2/2 - 39c - 180. (c - 2)(c + 3)2(c + 20)/2 Let 50s2 - 105s + 10 = 0. What is s? 1/10, 2 Suppose 4m3 - 36m*2 - 4m + 36 = 0. What is m? -1, 1, 9 Suppose 4h4 - 28h*3 = 0. Calculate h. 0, 7 Let 3r*5/4 + 77r*4/8 + 95r*3/4 - 105r*2/2 - 49r/2 + 343/8 = 0. What is r? -7, -1, 1, 7/6 Find k, given that k*3/2 - 45k*2 + 347k/2 - 129 = 0. 1, 3, 86 Suppose 2g2/21 - 4g/7 + 16/21 = 0. Calculate g. 2, 4 What is b in 20b3 - 884b*2 + 9856b - 1936 = 0? 1/5, 22 Factor -l3/3 + l2/3 + 4l/3 - 4/3. -(l - 2)(l - 1)(l + 2)/3 Solve 4b*4/5 - 8b*3/5 - 128b*2/5 - 24b + 252/5 = 0 for b. -3, 1, 7 Determine b, given that b*2/6 + 13b/6 - 5 = 0. -15, 2 Find n such that 2n2/7 + 144n + 2008/7 = 0. -502, -2 Factor t*3 - 459t*2 - 1849t - 1389. (t - 463)(t + 1)(t + 3) What is q in -5q3 + 2155q*2 + 4325q + 2165 = 0? -1, 433 Factor k*2/2 - k - 3/2. (k - 3)(k + 1)/2 Factor s*2 + 156s + 6084. (s + 78)*2 Determine h so that -2h*2/25 - 104h/25 + 216/25 = 0. -54, 2 Suppose 5f3 + 485f*2 + 11515f - 12005 = 0. What is f? -49, 1 Suppose 4n3 + 840n*2 + 58800n + 1372000 = 0. What is n? -70 Factor 5s3 - 2058s*2 + 1231s + 822. (s - 411)(s - 1)(5s + 2) Solve -2n*2/15 + 94n/15 - 12 = 0 for n. 2, 45 Factor -c*2/4 + 135c/4 - 131. -(c - 131)(c - 4)/4 Factor 32l*5/7 - 144l*4/7 + 258l*3/7 - 230l*2/7 + 102l/7 - 18/7. 2(l - 1)3(4l - 3)2/7 Let -3c*4 - 54c*3 - 189c*2 + 366c + 504 = 0. Calculate c. -12, -7, -1, 2 Solve 1587w3/7 - 1863w*2/7 + 288w/7 - 12/7 = 0. 2/23, 1 Factor -u*3 + 12u*2 - 41u + 30. -(u - 6)(u - 5)(u - 1) Find k, given that -3k2 - 558k - 25947 = 0. -93 Solve -4q4/3 + 1552q*3/3 - 50696q*2 + 299536q/3 - 148996/3 = 0 for q. 1, 193 Let -65z4 - 140z*3 + 45z*2 + 140z + 20 = 0. Calculate z. -2, -1, -2/13, 1 Determine s so that -s*2 + 15s = 0. 0, 15 Let -2s5/11 - 138s*4/11 - 646s*3/11 - 366s*2/11 + 1152s/11 = 0. What is s? -64, -3, 0, 1 Factor -5s3 + 5s*2. -5s*2(s - 1) Factor r*2/3 + 504r + 190512. (r + 756)2/3 Suppose -y3 - 8y2 + 4y + 32 = 0. What is y? -8, -2, 2 Determine h, given that -5h3 - 40h*2 - 35h = 0. -7, -1, 0 Factor w*4/5 + 4w*3/5 - 92w*2/5 - 192w/5 + 2304/5. (w - 6)*2(w + 8)*2/5 What is k in -2k*3 - 202k*2/3 + 68k/3 = 0? -34, 0, 1/3 Factor -i*2/5 - i/5 + 42/5. -(i - 6)(i + 7)/5 Factor -4o4 - 140o*3 + 292o*2 - 148o. -4o(o - 1)*2(o + 37) Let g*2/4 - 9g - 117/4 = 0. Calculate g. -3, 39 Find u, given that -2u5/11 + 24u*4/11 - 58u*3/11 + 36u2/11 = 0. 0, 1, 2, 9 Factor h3/4 - 33h2/2 - 34h. h(h - 68)(h + 2)/4 Find w such that -4w5 - 74w*4 - 282w*3 + 560w*2 - 200w = 0. -10, 0, 1/2, 1 Suppose -n*4/3 + 9n*3 + 113n*2 + 1117n/3 + 370 = 0. What is n? -5, -3, -2, 37 Let w*2/4 - 59w/4 - 93/2 = 0. What is w? -3, 62 Solve -v*2/3 - 835v/3 = 0. -835, 0 Determine c, given that 21c2/4 + 53c/4 - 15/2 = 0. -3, 10/21 Factor 10i3 - 35i*2 - 20i. 5i(i - 4)(2i + 1) Suppose -2n3 - 10n*2 - 4n + 16 = 0. What is n? -4, -2, 1 Factor -14t4/13 - 32t*3/13 - 22t*2/13 - 4t/13. -2t(t + 1)*2(7t + 2)/13 Suppose d4 + 93d*3 + 2784d*2 + 23552d - 98304 = 0. Calculate d. -32, 3 Find q, given that 4q4 - 61q*3 + 119q*2 - 26q = 0. 0, 1/4, 2, 13 Find t, given that 2t2/3 + 22064t/3 + 60852512/3 = 0. -5516 Factor 3f4 + 3f*3 - 9f*2 - 3f + 6. 3(f - 1)2(f + 1)(f + 2) Suppose -3c*2/2 + 414c - 28566 = 0. What is c? 138 Factor -12w3 - 225w*2 - 519w + 144. -3(w + 3)(w + 16)(4w - 1) Factor 3j2 - 942j + 73947. 3(j - 157)2 Factor o4/4 + 681o*3/4 + 116957o*2/4 + 346119o/4 + 114921/2.	{ "pile_set_name": "DM Mathematics" }
117. What is the second derivative of 2z - gz - 2 + z*3 + 5 + 4z - 6z2 wrt z? 6z - 12 Let n be (-2)/(-4)(-8)/(-1). Suppose nv - 23 = 5k, 2 = -3v - 2v - 4k. Differentiate 11jv - 162 + 72 + 58 + 53 wrt j. 22j Let q(h) be the first derivative of 1569h4/2 - 3439h + 2085. What is the derivative of q(y) wrt y? 9414y2 Let v(t) be the first derivative of -215t*5 - 826t3/3 - t2 - 92. Find the third derivative of v(m) wrt m. -25800m Let b(i) be the second derivative of i5 - 13i*4/12 - 689i*2 - 3i - 61. What is the derivative of b(h) wrt h? 60h2 - 26h Let r(f) = -685f2 - 791f + 7. Let g(m) = -1374m2 - 1585m + 15. Let b(z) = 6g(z) - 13r(z). Find the second derivative of b(o) wrt o. 1322 Let b(h) = -2h2 + 8492h + 17137. Let s(i) = i*2 - 5664i - 11425. Let j(k) = -5b(k) - 8s(k). Differentiate j(z) with respect to z. 4z + 2852 Let r(j) be the first derivative of j4/4 + 1393j*3 + 204j*2 - 6j + 1339. What is the second derivative of r(p) wrt p? 6p + 8358 Let s(k) = k3 + 4k*2 + 2k + 1. Let w(l) = -116l3 - 24l*2 - 10l + 1565. Let b(r) = 5s(r) + w(r). Differentiate b(o) with respect to o. -333o*2 - 8o Let q(v) be the second derivative of -257v4/2 - 1308v*2 + 35v - 1. Find the first derivative of q(z) wrt z. -3084z Let h(d) be the first derivative of 1313d*2/2 - 60d + 2575. Find the first derivative of h(i) wrt i. 1313 Suppose 4k - 2939 + 2859 = 0. What is the second derivative of -6 + 24h - 6 + 8 + kh2 + 53h*2 wrt h? 146 Let g(o) be the first derivative of 2111o*7/7 - 1936o3/3 - o2 - 2490. What is the third derivative of g(u) wrt u? 253320u3 What is the third derivative of 383q*2 - 2760q*4 + 1464q*2 - 86q*2 wrt q? -66240q What is the derivative of 37875m2 - 2605 - 37868m*2 - 187m*4 - 6m + 6m wrt m? -748m*3 + 14m Let m(x) be the third derivative of -7x5/30 - 7x*4/24 - 139x*3/3 + 183x*2. What is the derivative of m(z) wrt z? -28z - 7 Let a(v) = 18v + 39. Let f be a(2). What is the second derivative of -560k + 471k + 3 - fk*3 - 3 wrt k? -450k Let p(f) be the second derivative of -1089f3 - 2141f*2 - 36f + 93. Differentiate p(y) wrt y. -6534 Let y(z) be the third derivative of 1807z6/60 - 589z4/12 - z3/6 + 33z2 + 54. Find the second derivative of y(u) wrt u. 21684u Let m(d) be the third derivative of -671d4/4 - 4367d*3/6 + 1960d*2. What is the derivative of m(r) wrt r? -4026 Let v = -2 + 25. Find the first derivative of -11q*2 + 84 + 3q + 6q2 + vq + 6q2 wrt q. 2q + 26 Find the second derivative of 2860v + 850v*3 + 18 + 1127v*3 - 18 - 46v*3 wrt v. 11586v Let p(w) = -11574w2 + 5w + 13078. Let n(i) = -5801i2 + 3i + 6538. Let l(o) = -5n(o) + 3p(o). Find the first derivative of l(b) wrt b. -11434b Find the third derivative of -2 - 294z + 1 + 2761z4 - 6z*2 - 2763z*4 - 1812z*3 wrt z. -48z - 10872 Let s(w) be the third derivative of -w*7/15 - 37w*4/12 - 10w*3 + 40w*2. Let q(f) be the first derivative of s(f). Differentiate q(p) wrt p. -168p*2 Let m(l) be the third derivative of -15l6/2 - l5/30 - 26l3/3 + 1745l*2 + 2l. Find the third derivative of m(o) wrt o. -5400 Let i(l) be the third derivative of -83l5/30 + 365l*3/6 - 2030l*2. Differentiate i(n) with respect to n. -332n Let h(c) = -130c2 + 6c - 2666. Let d(l) = 65l2 - 4l + 1341. Let w(z) = -5d(z) - 3h(z). What is the first derivative of w(y) wrt y? 130y + 2 Let f(c) = 2c*2 + c + 1. Let t = 6 + 0. Let r(w) = -6w + 28w + 41w*2 - 5w - t - 11w. Let i(p) = -6f(p) + r(p). Differentiate i(q) wrt q. 58q Let s = 5 - 3. Suppose -5i + 6 = -z, 12 = -2i + 2z + sz. What is the third derivative of -8h*2 + 16h*3 + 0h3 - h3 - ih3 wrt h? 78 Let s(t) be the first derivative of 150t*3 - 117t*2 - 310. What is the second derivative of s(q) wrt q? 900 Let t(s) = -14s*3 - 65s*2 - 6s + 515. Let w(a) = 30a3 + 130a*2 + 13a - 1032. Let u(q) = -13t(q) - 6w(q). Differentiate u(n) wrt n. 6n2 + 130n Let i(g) = 611g + 3861. Let h(l) = -57. Let w(m) = 182h(m) + 2i(m). What is the first derivative of w(r) wrt r? 1222 Let w(y) be the third derivative of -401y*8/168 - 21y*4/8 - 8y*3/3 + 1229y*2. Find the second derivative of w(f) wrt f. -16040f*3 Let u(m) = -13621m*2 - 625m - 6. Let t(v) = -13617v2 - 633v - 7. Let k(q) = 6t(q) - 7u(q). What is the second derivative of k(a) wrt a? 27290 Let t(j) be the first derivative of -3327j4/4 + 83j*2/2 - 3j + 3515. What is the second derivative of t(a) wrt a? -19962a Let t(p) = 2101p*3 - 583p*2 + 85p + 20. Let a(c) = 700c3 - 195c*2 + 30c + 7. Let y(f) = -17a(f) + 6t(f). Find the third derivative of y(q) wrt q. 4236 Suppose 59x - 63x = -8. What is the third derivative of -38c2 + 47c6 - c3 + 90cx + c3 wrt c? 5640c*3 Find the first derivative of -9484l + 216l - 8826 + 1710l wrt l. -7558 Find the second derivative of 398g2 - 1133g + 212g2 + 304g*2 + 196g*2 wrt g. 2220 Let y(p) be the second derivative of -1/3p*3 + 0 - 27p - 2p5 + 35/2p*2 + 0p*4. What is the second derivative of y(m) wrt m? -240m Let l(q) be the third derivative of 491q8/56 - q5/60 + 233q*3/3 + 3q*2 - 889. Find the third derivative of l(i) wrt i. 176760i*2 Let u(i) be the second derivative of 10i8/7 + i6/15 + 255i4 - 2114i. Find the third derivative of u(v) wrt v. 9600v3 + 48v Let z(i) = -8i2 - 4 + 6i + 4i3 - 3i*3 - 3i + 6i. Let g be z(7). What is the first derivative of gu*3 - 19u + 12 - 3 + 19u wrt u? 30u*2 Let w(f) be the second derivative of 213f + 0f5 + 9/7f7 + f2 + 0 + 0f6 - 19/3f*4 + 0f*3. Find the third derivative of w(q) wrt q. 3240q*2 Find the third derivative of 556s*3 + 554s*2 - 8s + 841s3 + 8s + 547s2 wrt s. 8382 Suppose 3g + 2p - 27610 = 2g, -2p + 10 = 0. What is the third derivative of -gl + 27600l - 3 - 8l*2 + 101l*4 wrt l? 2424l What is the first derivative of 14 - 27 + 897m - 65 - 131 wrt m? 897 What is the first derivative of 161a + 316a + 62a + 656 + 126a - 41a wrt a? 624 Suppose -12v = 35 - 35. Let k(m) be the second derivative of -2m - 19/12m4 + 0 + 0m*2 + vm*3 + 19/20m*5. Find the third derivative of k(c) wrt c. 114 Let k(o) be the first derivative of 5o*4/4 + 32o*2 - 521o - 926. What is the first derivative of k(n) wrt n? 15n2 + 64 Let y(l) = 14l*3 + 3l*2 + 15l. Let k(g) = 7g3 + g2 + 8g. Let n = -366 - -363. Let o(z) = ny(z) + 5k(z). What is the third derivative of o(x) wrt x? -42 Let j(q) be the first derivative of 652 - 11q - 75q - 102q2 - 381. What is the first derivative of j(c) wrt c? -204 Let m = 83 - 70. What is the derivative of -7 - 13c + mc + 141c*4 + 56c*4 + 70 wrt c? 788c*3 Let b(k) be the first derivative of 5k*7/7 + 99k*4 - 2k*3/3 - 2k*2 + 680k + 4770. Find the third derivative of b(a) wrt a. 600a3 + 2376 Suppose 0 = 3u - l - 10, 2l + 5 = -3l. Suppose r - 10 = 5a, 4r - 8 = 5a - a. Differentiate -19q*3 - 16 + rq*3 - 11q*3 + uq*3 wrt q. -81q*2 What is the second derivative of -1359a - 4791a - 487a - 1319a - 236a - 1863a3 wrt a? -11178a Let f(j) = -1 - j + 0j + 16. Let s be f(12). Find the second derivative of -4i + si3 - 13i*3 + 3i + 2i wrt i. -60i Let q(n) be the first derivative of -173n4/2 + n3 + 1666n*2 - 3503. What is the second derivative of q(j) wrt j? -2076j + 6 Suppose 43 - 27 = 17h - 35. Let q(v) be the second derivative of hv*3 + 0 + 9/10v*5 - 2v + 0v4 + 0v*2. What is the second derivative of q(y) wrt y? 108y What is the second derivative of -1577k5 - 2k*2 - 29793k - 855k5 + 2k*2 - 25 + 29720k wrt k? -48640k3 Let r(j) be the second derivative of 7j7/2 - j6/5 + j*4/12 - 35j*3/6 + 85j*2/2 - 7494j. Find the second derivative of r(d) wrt d. 2940d3 - 72d*2 + 2 Find the second derivative of -2527z5 + z2 + 1412z5 - 3879z + z4 - z2 - 2z4 wrt z. -22300z*3 - 12z*2 Find the second derivative of -44l + 1031l5 + 83l - 6l wrt l. 20620l**3 Let x be (-2)/(-17) + 1661/187. What is the second	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.