Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
) = -398h + 38. Let q(z) = -181z + 18. Let p(d) = -10b(d) + 22q(d). Let g(w) = -w3 - w2 + 5. Let t be g(0). Calculate p(t). 6 Let w = 4 + -5. Let a(r) = 10r + 4. Let o(i) = -16 + 4 - 30i + 1. Let x(y) = -8a(y) - 3o(y). Give x(w). -9 Let q(m) = m*2 - 13m + 32. Suppose 143p - 1262 - 311 = 0. Calculate q(p). 10 Let w = -99 + 137. Let n be (0 - 3)/(-5 - w/(-7)). Let b(d) = d3 + 6d*2 - 10d - 10. Determine b(n). 11 Let l = -6 + 2. Suppose -846 - 612 = -6v. Let d(p) = vp + 5p2 - p3 + 238p + 2p3 - 5 - 478p. Determine d(l). -1 Let o = -1192 - -1715. Let h(a) = -20a2 + 0a3 - a3 - o + 2a + 4a*2 + 552. Give h(-16). -3 Let y(o) = -86o*2 - 4o - 11. Let r(x) = 144x2 + 8x + 22. Let m(f) = -3r(f) - 5y(f). What is m(0)? -11 Let y(u) = -18u - 1. Let w(n) = -33n. Suppose -13j - 37 = -89. Let o(a) = jw(a) - 7y(a). Give o(4). -17 Let l(v) = -v3 + 23v*2 - 121v + 5. Let w be l(15). Let g(q) = -q*2 - 9q + 9. What is g(w)? -1 Suppose 9n - 7n - 6 = 0. Suppose 3t - 2j - 14 = t, -23 = -4t + 3j. Suppose -g - nc = -18, 3 = tc - 7. Let d(z) = -z*3 + 2z*2 + 3z + 2. What is d(g)? 2 Let g(s) = -s*2 - 27s - 11. Let n(u) = -5u - 2. Let z(d) = -2g(d) + 11n(d). Let f(x) = 26x*2 - 18x. Let p(a) = -f(a) + 12z(a). What is p(3)? 0 Suppose -9 = r - 13, 3m - 98 = 4r. Let u(d) = -2d*3 + 76d*2 - 4d + 148. Determine u(m). -4 Let m(b) = 343b - 5817. Let k be m(17). Let c(t) = -2t*2 + 28t + 15. Give c(k). 15 Let b(m) be the second derivative of 1/2m2 - 46m - 2 + 0m3 - 11/20m*5 - 1/12m*4. What is b(1)? -11 Suppose -103o - 1482 = -1173. Let x(z) = z*3 + 2z*2 - 3z - 1. Determine x(o). -1 Let a(m) = 4m - 14. Suppose 5s + 5 = -5p - 15, -4p = -12. Calculate a(s). -42 Let u(y) = 71y2 + 2y + 54. Let s(g) = -37g2 - g - 24. Let i(k) = -9s(k) - 4u(k). Give i(-1). 48 Let s(n) = -4n*2 - 9n + 14. Let f(x) = -3x2 - 9x + 13. Let k(t) = -3f(t) + 2s(t). Let h = 15495 - 15504. Give k(h). -11 Let c(i) = -i*2 - 5i + 4. Let s(y) = 2y2 + 3y - 8y + 6y + 4y - 3y - 3y3. Let o be 3/(-2)(-4)/(-6). Let v be s(o). Determine c(v). -20 Let q be 1(1/6)/(10 - 1121/114). Let s(b) = 50b - 2. Calculate s(q). 48 Let f(y) be the first derivative of y3/3 - y2/2 + y + 75. Let g(t) = t*3 - 6t*2 + 9t - 8. Let w(q) = -3f(q) + g(q). What is w(8)? 21 Let o(s) = -12s - 14. Let x = -21414 + 21420. Calculate o(x). -86 Let a(b) = 4b3 + 3b + 1. Let m be ((-16 - -31) + -18)/((-3)/(-2)). Calculate a(m). -37 Let a = 39 + -26. Suppose 0 = -3q + 3c - a + 37, -3q + 22 = -4c. Let k(r) = r*3 - 9r*2 - 11r - 8. Determine k(q). -18 Let r(s) = 96 + 7s - 191 - s3 - 8s*2 + 102 - 19s. Determine r(-6). 7 Let r(j) be the second derivative of j*3/6 - 9j*2 + 8691j. Suppose -2 + 15 = g. Calculate r(g). -5 Let f(i) = -9i + 60. Let n(t) = t3 - 64t*2 - 127t - 324. Let k be n(66). Give f(k). 6 Let l be 5(4 + (-16)/5). Let b be (-6)/l(-4)/1824. Let s(j) = 9j*2 - 21j*2 + 4j + bj2 + 3j*2. Give s(5). -5 Let i be (-6)/33 + (-72)/(-33). Let r(g) be the third derivative of 1/8g*4 + 0g - 24g2 + 0 - 1/6g*3. Give r(i). 5 Suppose -14h + 830 + 1326 = 0. Let y = -143 + h. Let c(u) = u*2 - 11u + 5. Give c(y). 5 Let p be -2 + (-8)/(-21). Let q(x) = -5 - px*3 + 3x*2 + 3x*3 - 4x*2. Let o(h) = 340h + 35020. Let j be o(-103). What is q(j)? -5 Let r = -62 + 66. Let g(f) = f*3 + 7f*2 - 7f + 10. Let d be g(-8). Let a(m) = m*3 + 0 + 1 - 3m*2 - 5m + 0md + 3. Calculate a(r). 0 Let o(b) be the first derivative of -1/12b*4 - 1/3b*3 - 9 + 0b - 16b2. Let a(f) be the second derivative of o(f). Calculate a(-4). 6 Let r(x) be the first derivative of -x2/2 - 24x - 3. Let l(o) = -o*2 + o + 2. Let j be l(2). Let b be j(1 - (15/10)/1). Determine r(b). -24 Let o be 1(-3 + (-13)/2)-2. Suppose 2a + 3d = 1, -3a = -6a - d + o. Suppose 5y = l + l - 8, 3y = -2l + a. Let u(f) = f - 1. Give u(y). -1 Let z(i) be the second derivative of i4/12 + i3 - i2/2 + 2i. Suppose 17661r + 12 = 17659r. Calculate z(r). -1 Let r(x) = x*2 - 6x - 21. Let m(u) = u*3 + 26u*2 + 93u + 118. Let d be m(-22). Determine r(d). -5 Let x = -7711 - -46271/6. Let m(z) be the third derivative of 0z - 10z*2 + 0 + 1/60z*5 - xz*3 - 1/6z*4. Calculate m(6). 7 Suppose 17v - 15840 = -27v. Let z = v - 358. Let q(a) = a3 - 3a2 - a + 2. Give q(z). -4 Let a(p) be the second derivative of p4/12 - p3/3 + p2 + p. Let b be 119 - 121 - ((-32)/(-20) - 4/(-10)). Give a(b). 26 Suppose 0 = k - 2g - 3, -3g - 15 - 9 = 5k. Let o(b) = -b2 - 5b - 11. What is o(k)? -5 Let k(s) be the second derivative of 0s3 + 0 - 1/120s*5 - 12s + 5/6s4 - 1/720s*6 + 0s*2. Let b(v) be the third derivative of k(v). What is b(0)? -1 Let r(s) = -s - 1. Suppose 5x - 8 = -2y - 0, 3x - 7 = y. Let g be y3 - (-3 + 1 - 0). Determine r(g). 0 Let k(c) be the first derivative of -2c3/3 + c2 + 4c + 25. Let w(b) = b2 + 1. Let v(o) = k(o) - w(o). Calculate v(-2). -13 Suppose 11 = 4a + 3. Let h(o) = -o*2 - 3o + 2. Let d be h(a). Let u(r) = -7r - 16. Let t(z) = z. Let f(n) = -6t(n) - u(n). Give f(d). 8 Let f(s) = s*3 + 6s*2 + 3. Suppose 8c - 3 = 13. Let i(k) = 2k2 - k - 3k*c + 0k. Let q be i(-3). Calculate f(q). 3 Let z(l) = -l + 8767l2 - 4344l*2 - 4417l2 + 1 - 3. Let v(r) = -r2 + 2. Let q be v(2). Calculate z(q). 24 Let i(o) = -7o2 + 12o - 5. Suppose -3m - 1 = -2k, -2k - 59m = -63m. Determine i(k). -9 Let a(j) = -j2 - 8j - 2. Let f be 6/(-33) + 399/77 + 170. Let k = f + -183. Determine a(k). -2 Suppose -466k + 458k + 8 = 0. Let o(f) = -1 + 5906f2 - 6f*3 + f - 5906f*2. What is o(k)? -6 Let t be -6(-1)/(-2) + (6 - 0). Let v(q) = -q*3 - 2q*t - 6q*3 - 1 - 6q*3. Calculate v(1). -16 Let h(o) = 8o*2 - 1 - 1 + 7o + 0 + o*3. Suppose 0 = -2g - 5x + 6, 26g - 31g + 15 = -3x. Suppose -w - y - 25 = gw, 2w + y = -11. What is h(w)? -2 Suppose -3o - 29 = -4p, 3p - 5 = -8. Let h(s) = -2s3 - s2 - 6s - 1. Let r(z) = 6z*3 + 3z*2 + 17z + 3. Let n(i) = oh(i) - 4r(i). Give n(-1). 2 Suppose -2s - 22 = -4b, -2b - 72 = 3s - 39. Let z(l) be the first derivative of 2l2 + 6l - 94. Calculate z(s). -38 Suppose m + 2y = 3m - 6, -3m + 6 = -4y. Let x be (8/(-6))/(m/(-18)). Let t(r) = -6 + 3r2 - r - xr*2 + 11. What is t(-4)? -7 Let n(l) = 66l + 212l + 23 - l2 - 266l. Give n(14). -5 Let c(s) = s*3 - 39s*2 - 81s - 48. Suppose 16k = -12k + 8k + 820. Determine c(k). -7 Let s(k) = 4k - 39. Let c(l) = 39l - 380. Let d(g) = -3c(g) + 29s(g). What is d(-28)? 37 Suppose 2f = 4d, -4d + 9d - 3f = 2. Let l be d/(-6)(1 + 22/2). Let u(m) = -2 + 2m + 0 - 1. Determine u(l). 5 Let u(g) = g*3 + 18g*2 + 62g - 46. Let d be u(-13). Let n(z) = -12z + 25. Calculate n(d). 109 Suppose 98o - 28 = 92o + 26. Let l(v) = -4v*2 + 34v + 18. Calculate l(o). 0 Let v(s) be the first derivative of 1/2s2 + 140 + 9s. What is v(-13)? -4 Let u(i) be the third derivative of -i4/8 - i3 + 119i2 + 4. Calculate u(-9). 21 Let o(j) = -12j - 9j + 28j + 6j2 + j3 - 13j + 6. Let v = -35 + 28. What is o(v)? -1 Let v(h) = -h*3 + 8h*2 - 15h - 3. Let l be v(5). Let b = 3 + l. Suppose b = 4i - 0 + 28. Let z(t) = t2 + 7t. Give z(i). 0 Let w(v) = -v*2 + v + 156. Let z be w(13). Suppose -4f - 3h - 16 = z, 20h = 4f + 25h + 16. Let b(g) = -g*2 + 3g - 1. Give b(f). -29 Let a(u) = 6u2 + 6u - 91. Let l(q) = 20q2 + 19q - 294. Let c(i) = -13a(i) + 4l(i). Calculate c(6). 67 Let l(n) = -n*2 - 6n + 7. Suppose 5i + 4u + 11 = 0, -92u + 87u + 37 = -i. Give l(i). 0 Let m(x) = 73x2 - 439x + 11. Let p be m(6). Let j(v) = v*3 - 3v*2 - v - 7. Give j(p). 38 Let v(y) = -8y*3 + 3y*2 - 8y - 11. Let f(o) = 7o3 - 2o*2 + 7o + 9. Let c(z) = 7f(z) + 6v(z). Let j be ((-1)/1)/((-10)/90-3). Give c(j). 3 Let p(f) = f2 - 3f + 2. Let g be p(0). Let b(o) = 6o2 + o3 - 17o2 + og + o - 19 + 9o2. Give b(0). -19 Let z(x) = 13x*2 - 30x + 2. Let s(d) = d*3 - 24d*2 - 108d - 110. Let f be s(28). Calculate z(f). -6 Let h(a) = -7a. Let s(w) = 1. Let t(f) = -h(f) - s(f). Suppose 33 = 6o + 423.	{ "pile_set_name": "DM Mathematics" }
t g = -15 - s. What is the tens digit of g? 1 Suppose 4r + 4 = 16. Suppose u + 6 = ru. What is the units digit of u? 3 Suppose 3m = -2m + 40. Let b = 1 + m. What is the units digit of b? 9 Suppose 12 = -3k, 2t + 0k = k + 14. What is the units digit of 0 + 2/(-3 + t)? 1 Let x = 616 - 221. Suppose 4j = -c + 325, j = 6j - c - x. What is the units digit of 12/42 - j/(-14)? 6 Suppose -2 - 2 = 3r - 5d, 0 = 3d + 12. Let z(n) = -n*3 - 7n*2 + 4n + 3. What is the tens digit of z(r)? 3 Let h(j) = j*2 + 9j - 7. What is the units digit of h(-12)? 9 Let d(w) = w*3 - 12w*2 + 2w + 9. What is the units digit of d(12)? 3 Suppose -2r = -6r + 196. What is the tens digit of r? 4 Suppose 3q = 3 + 9. Suppose -4g + qt = 0, t - 2 - 10 = -5g. What is the units digit of g? 2 Let y(g) = -g3 + g2 + 5g - 3. Let n be y(3). Let f be (-4)/n(9 - 3). Let l = 10 - f. What is the units digit of l? 6 Suppose 4z - 16 = -4. Suppose 3d = -5v + 13, zd - 4v - 41 = -2v. What is the units digit of d? 1 Let t(m) = 29m - 13. Let v(u) = -15u + 7. Let c(x) = 6t(x) + 11v(x). Let r be c(1). What is the units digit of r/16 + 38/4? 0 Suppose -4v + 2v = -12. What is the units digit of v? 6 Let j = -5 + 6. Let y(o) = 7o - 8o - 5 + j + o2. What is the units digit of y(3)? 2 What is the units digit of 4 + (0/2 - -16)? 0 Let s = -24 + 27. What is the units digit of s? 3 Let b(a) = a2 - 5a + 4. Let u be b(5). Suppose -uc + 0c = -3s - 79, -c + 3s + 22 = 0. What is the tens digit of c? 1 Suppose -13 = -3z - 4k, -2k + 1 = z - 4. Suppose -d - 36 = -zd. What is the tens digit of d? 1 Let w = 0 - -3. Let k(z) = -z3 + 5z*2 - 3z - 1. What is the units digit of k(w)? 8 Let o(y) = -3y2 + 4y + 9. Let d(r) = 2r - 5r - 9 + 3r2 + r2. Let j(f) = -4d(f) - 5o(f). What is the units digit of j(-6)? 3 Suppose 76r = 81r - 575. What is the units digit of r? 5 Let w be ((-3)/(-5) - 1)5. Let r be 1 - (w + 2) - 0. Suppose -a = -4 - r. What is the units digit of a? 5 Let d = 6 - 3. Suppose -p - 39 = -dr, 5r + p - 52 = r. What is the units digit of r? 3 Suppose 3d - 9 + 0 = 0. What is the units digit of ((-22)/4)/(d/(-12))? 2 Let k = 16 + 7. Suppose k + 13 = 3i. What is the units digit of i? 2 Suppose c + 26 = 2c. What is the tens digit of c? 2 Let z be 6/(-27) + 34/(-9). Let n(f) = f2 + 2f + 1. Let a be n(z). Suppose -5g + 2g = -a. What is the units digit of g? 3 Let p = -7 + 13. Let c(w) = -w*3 + 8w*2 - 8w - 6. Let u be c(p). Suppose 3a = 3x + 6, 2x + 4 - u = -a. What is the units digit of a? 6 Let t(w) = 3w*3 + 17w*2 - 12w - 8. Let s(k) = k*3 + k + 1. Let b(u) = 4s(u) - t(u). What is the tens digit of b(16)? 1 Suppose -4u - u = -90. Let m = u - -3. Suppose -9 = 4d - m. What is the units digit of d? 3 Suppose 24 = -5r - 3g, -4g + 14 - 6 = 0. Let y be 0((-15)/r)/5. What is the units digit of 1 + y/(-3) + 2? 3 Let g(l) = l*2 + 2l + 3. Let s be g(-3). Let n be s/9 + (-1)/(-3). What is the units digit of (1 + n)2/4? 1 Let m(x) be the first derivative of -x - 5/2x*2 + 2. What is the units digit of m(-1)? 4 Suppose 0d - 4d = 24. Let r(w) = w2 - w + 3. Let s be r(3). What is the units digit of 66/s - 4/d? 8 Suppose 0 = -2w + 4b + 2 - 10, -w - 4b = -14. Suppose 5u = 2o + 3o + 15, wu = -2o + 26. What is the units digit of u? 8 Let m(n) = 7n*2 - 3n - 2. Let f be m(-3). Let a be 1/2 + f/4. Suppose 3c - 5v - a = -0v, 6 = c - 3v. What is the units digit of c? 6 Let u(w) = w - 3. Let y be 2 + 0 + (1 - 1). Suppose 0 = -yq + 6 + 6. What is the units digit of u(q)? 3 Let s(i) = i2 + 2i - 10. Let g be s(-5). Suppose v = 3o - 3v - 57, go - 2v - 81 = 0. What is the units digit of o? 5 Let l(g) = 4g - 22. Let m(c) = c - 7. Let a(o) = -2l(o) + 7m(o). What is the units digit of a(-7)? 2 Let h(d) = d3 - 7d*2 - 9d + 10. Let j be h(8). Let x = -2 + j. Suppose 0 = z - xz - 4. What is the units digit of z? 4 Let h(a) = a3 - 14a*2 - 15a + 21. What is the tens digit of h(15)? 2 Let d = 4 + -4. Suppose 2s - 6s + 8 = d. What is the units digit of s? 2 Let a = 10 + 11. What is the tens digit of a? 2 Let j(d) = -5 - 3 - 2d + 4. Let h = 9 + -15. What is the units digit of j(h)? 8 Let y(t) be the first derivative of -t4/4 + 5t*3/3 + 4t*2 - 10t + 7. What is the tens digit of y(5)? 3 Suppose 0z = -3z - 702. What is the tens digit of 3/4 + z/(-8)? 3 Let l = 30 + 70. What is the units digit of l? 0 Suppose -5k = 12 + 3, 4y - 2k - 30 = 0. Suppose 12 = 2j - y. What is the units digit of j? 9 Suppose 0 = 3p - 7p. Suppose p = -0i - 5i + 25. What is the units digit of i? 5 Let b be (2/(-3))/(4/(-18)). Suppose 15 = 4p - 5t, -2p + 2t = 6t - 40. Suppose 2a = ba + 2, -a + p = 3o. What is the units digit of o? 4 Let h be -36/(36/(-310)). Suppose -4c = c - h. What is the tens digit of c? 3 Let p be (-12)/(-5) - 4/10. Suppose 0 = 2u - 3u + p. Suppose 2y - 5 = 3y, -uy = f + 3. What is the units digit of f? 7 Let c(q) = -133q3 - q2 + q + 1. What is the hundreds digit of c(-1)? 1 Suppose -7z + z + 504 = 0. What is the units digit of z? 4 Let c(v) = -v3 - 3v*2 - 6v - 5. What is the units digit of c(-4)? 5 Let u = -27 - -7. Let b = u + 33. What is the tens digit of b? 1 Suppose -5t - 16 = -w, 4t - 65 = -3w + 2t. What is the tens digit of w? 2 Suppose -4l = -3l. Suppose -x + 4 + l = 0. What is the units digit of x? 4 Let f(d) = d*3 + 7d*2 + d + 4. Let s = 6 + -13. Let m be f(s). What is the units digit of (-8)/12m3? 6 Let f be (3 - 0/(-3))1. Let j be 3-3(-1)/f. Suppose -2i + 3w = -6i + 14, -9 = -ji - 3w. What is the units digit of i? 5 What is the tens digit of 86/4 - (-3)/(-6)? 2 Let n(j) = -3j - 5. What is the units digit of n(-6)? 3 Let l(i) be the second derivative of -i3/6 - i2 + 3i. What is the units digit of l(-7)? 5 Let a = 2 + 0. Let y(i) = -i3 + 3i*2 - 4i + 3. Let x be y(a). What is the units digit of ((-21)/3)/(x + 0)? 7 What is the units digit of (-2704)/(-18) - 6/27? 0 Suppose 5g = -0g + 10. Suppose 0 = -gm + 37 - 13. What is the tens digit of m? 1 What is the units digit of 30 + (-6)/8 + (-21)/(-12)? 1 Let a(v) = -v3 + 12v*2 - 11v + 13. Let g(u) = -u*3 + 2u*2 + 3u + 1. Let y be g(-2). What is the units digit of a(y)? 3 Let k = -7 + 11. Suppose 90 = -7z + 10z. Suppose -ky - y = -z. What is the units digit of y? 6 Let f(b) be the third derivative of -1/3b*3 + 0 + 5/24b*4 + 0b - b*2. What is the units digit of f(2)? 8 Let h(x) = 2x - 11. Let l be h(9). Let u(n) = n*2 - 4n - 9. What is the tens digit of u(l)? 1 Suppose 0 = -3f + s - 22, 4 + 7 = -f + 4s. Let q = 9 + f. What is the units digit of q? 2 Let n(s) = -5s2 - 4s + 7. Let z(u) = -10u2 - 9u + 15. Let c(b) = -13n(b) + 6z(b). Let y = 9 - 7. What is the tens digit of c(y)? 1 Suppose -5h - 6 + 76 = 0. Suppose 2i = 4l + 24, 3l + h - 31 = -2i. What is the tens digit of i? 1 What is the tens digit of 4 - -1(11 - 1)? 1 Let l(x) = -x*3 - 7x*2 + 2x - 10. What is the tens digit of l(-8)? 3 Let c = -56 + 81. Suppose -5y + c = 0, y - 3y - 22 = -2l. What is the units digit of l? 6 Let r(b) = -9b - 11. What is the tens digit of r(-5)? 3 Let n(x) = 2x2 - 2x + 1. Let c be n(1). Let u(p) = c + 6p + 2 + 4 - 5p. What is the tens digit of u(10)? 1 Let y(b) = -b - 2. Let t be y(-5). Suppose 80 = tj - 2d, -j + 1 = d - 24. What is the tens digit of j? 2 Suppose 0s + 4s - 10 = -o, 5s - 23 = -3o. Let j be (0 + 8/o)3. Suppose 3f + 5n = 10, f + jn = 2n + 2. What is the units digit of f? 0 Suppose -3g - 20 = -7g + 2q, 2q - 10 = -g. Suppose -p = -g + 4. Suppose pi = 4u - 0u - 10, -5i + 30 = u. What is the units digit of u? 5 Suppose -50 = 2n - 3z + z, 45 = -2n + z. What is the units digit of n(2 + (-18)/8)? 5 Let n = -1 + 13. What is the tens digit of n? 1 What is the hundreds digit of 6 - 3 - 2 - -117? 1 Suppose 4s + 4i = -48, 4i - 34 = 2s + i. Let f = s - -25. Suppose b - 2h = -0b + f, -3h = b - 6. What is the units digit of b? 9 Suppose 6o - 2 = 5o. Suppose -ou = -4u + 56. What is the units digit of u? 8 Suppose -4p - p + 75 = 0. Let y = 29 - p. What is the units digit of y? 4 Let o(c) = 3c*2 - 17c - 19. Let y(g) = -	{ "pile_set_name": "DM Mathematics" }
derivative of 3f - d + 1 - f2 - 3f. Let x(c) = 4c. Give x(n(l)). -8l Let t(b) = 13b3 + 2b*2 + b. Let v be t(-1). Let w = -6 - v. Let a(m) = 6 - 3m2 - w. Let k(o) = -o2. What is a(k(n))? -3n4 Let i(n) be the second derivative of -n4/12 - 2n. Let s(p) = -p. Determine i(s(t)). -t2 Let d(g) be the second derivative of -g4/12 + 5g. Let h(b) = -4b*2. What is d(h(p))? -16p*4 Let d(t) = -3t. Let z(l) be the first derivative of -1 - 2l2 + 2l*2 + 4l*2 - 2l*2. What is d(z(u))? -12u Let p(j) be the third derivative of -j*5/30 + 4j2. Let u(m) be the third derivative of m4/4 - m*2. Calculate p(u(f)). -72f*2 Let p(h) be the first derivative of 0h*2 + 6 + 2/3h*3 + 0h. Let y(l) = 0l - 3l*2 + 0l. Give p(y(i)). 18i4 Let k = -5 + 8. Let d be (k - 2)/(2/4). Let f(o) = -o + do + o. Let m(q) = -3q. Give m(f(p)). -6p Let a(v) be the second derivative of -v*4/4 - v. Let k(i) = -14i + 17i + 2 + 3. Let o(c) = -5c - 8. Let f(r) = -8k(r) - 5o(r). What is f(a(g))? -3g2 Let n(q) be the first derivative of -2q2 - 1. Let p(h) be the first derivative of -h2 - 9. Calculate n(p(l)). 8l Let k(b) = 3b - 3b + 3b. Let c(m) = -6m2. Give k(c(q)). -18q2 Let h(o) be the third derivative of o4/24 + 9o2. Let l(n) = -3n*2. Calculate l(h(u)). -3u*2 Suppose -2h = l - 157, 0h - 323 = -4h - 5l. Let b(a) = 77 - 2a - h. Let t(n) = -3n. What is b(t(u))? 6u Let d(h) = -2h. Let i be 7 + -4 - 0/(-1). Let b(l) = -2l + il + 0l. Give d(b(o)). -2o Let g(q) be the second derivative of -5q*4/12 - 6q + 1. Let x = -1 + 1. Let v(h) = xh + 0h + h. Determine v(g(d)). -5d2 Let d(q) be the second derivative of q4/6 + 2q. Suppose -5s - 4y + 22 = 0, 2y - y - 7 = -2s. Let v(o) = -o*s + 4o2 - o2. Determine d(v(c)). 8c4 Let i(g) = -3g2. Let p(x) = x2 - 6x + 8. Let v be p(6). Let d(b) = b2 - 8b + 2. Let c be d(v). Let t(f) = f - f + 5f2 - 3f*c. Determine i(t(m)). -12m4 Let o(z) be the first derivative of -z2 - 10. Let c(p) = 3p2. Determine o(c(j)). -6j2 Let v(s) = s2. Let n(l) = 646l2. Give n(v(d)). 646d*4 Let x(r) = 48r - 1. Let t(v) = 4v2. Give x(t(a)). 192a*2 - 1 Let l(x) = 2x + 326. Let n(g) = g. Give n(l(z)). 2z + 326 Let u = 17 + -15. Let f(o) = -6 - uo*2 + 5 + 1. Let k(n) be the first derivative of 2n*3/3 + 1. Determine f(k(b)). -8b*4 Let l(a) = 36a. Let c(i) = -7i. Let v(q) = 21c(q) + 4l(q). Let k(h) = 3h*2 + 4h*2 + 6h*2 - 11h*2. Give k(v(x)). 18x*2 Let w(h) = 6h*2 - 2h*2 + 2h*2 - 5h*2. Let u(y) = -8y. Determine w(u(a)). 64a2 Let o(x) = -3x + 7. Let d(h) = -2h + 4. Let b(i) = -7d(i) + 4o(i). Let k(l) = 8l - 6. Let u(j) = -17j + 13. Let s(r) = -13k(r) - 6u(r). What is b(s(n))? -4n Let u(s) = -16s. Let x(h) be the first derivative of 18 - 2h2 + h2 - 12. Calculate x(u(c)). 32c Let j(k) = 6k*2. Let x(h) = 5h2 + h + 1. Let y(u) = u2 + u + 1. Let b(a) = x(a) - y(a). Determine j(b(v)). 96v4 Let i(g) = 3g*2 - 4. Let v(r) = -7r*2 + 9. Let k(t) = 9i(t) + 4v(t). Let j(l) = -2l. What is j(k(f))? 2f2 Let b(x) be the first derivative of -11x*3/3 + 14. Let w(p) = p. Calculate b(w(q)). -11q*2 Let c(l) = 3l*2. Let w(q) be the first derivative of 0q + 4 - 1/2q2. Give c(w(m)). 3m*2 Let f(z) = -26z. Let k(q) = -267q2. Give f(k(j)). 6942j*2 Let n(r) = -2r*2. Let b(s) = 16145s + 2. Determine n(b(q)). -521322050q2 - 129160q - 8 Let a(z) = 2z2. Let d(u) = -6207u. Give d(a(v)). -12414v2 Let j(o) = 5o. Let x(g) = g*2 + 0g*2 - 2g*2 + 2g*2. Calculate j(x(d)). 5d*2 Let u(o) = 55o*2. Let x(s) = 12s*2. Give x(u(g)). 36300g*4 Let i(w) = 64w*2. Let b(o) = -5o*2. Determine b(i(m)). -20480m*4 Let l(s) = 385s*2 + 35. Let p(w) = 32w*2 + 3. Let x(u) = 3l(u) - 35p(u). Let k(v) = 3v*2. Calculate k(x(r)). 3675r*4 Let q(m) = 6m*2. Let d(b) = 7b*2 + 5b. Let z(h) = 4h2 + 3h. Let k(s) = 3d(s) - 5z(s). Give q(k(a)). 6a4 Let w(i) = 3i*2. Let q(x) = -6. Let g(f) = -1. Let v(m) = -3g(m) + q(m). Let k(j) = j - 2. Let t(r) = -3k(r) + 2v(r). What is w(t(c))? 27c2 Let g(o) = o2 - o. Let y(t) = -5t*2 + 4t. Let z(j) = -12g(j) - 3y(j). Let m(h) be the second derivative of -h*4/12 + h. Determine z(m(l)). 3l4 Let v(i) = -i. Let w be v(5). Let t(b) = b. Let u(f) = f2 - 6f. Let j(d) = wu(d) - 30t(d). Let z(r) = -r. What is z(j(g))? 5g*2 Let m(s) = 2s*2. Let r(a) be the second derivative of -3a*4/4 - 3a. Determine m(r(d)). 162d4 Let p(o) = -2o. Let c(v) = v + 12v2 + 2v - 3v. Calculate c(p(x)). 48x*2 Let y(c) = c. Let b(j) = 24j. Let a = -11 - -10. Let t(v) = v*3 + 5v*2 + 2. Let d be t(-3). Let n(h) = ab(h) + dy(h). Let u(z) = -z. Give u(n(p)). 4p Let r(w) be the second derivative of -13w3/6 - 15w. Let c(f) = -2f2. Give r(c(b)). 26b*2 Let s(b) = 463 + 4b2 - 463. Let a(v) be the third derivative of -v7/1260 + v4/12 - v2. Let y(q) be the second derivative of a(q). Calculate y(s(r)). -32r4 Let c(v) be the first derivative of 4v*3/3 + 2v*2 + 4v - 2. Let w(k) = -4k2 - 3k - 3. Let y(j) = -3c(j) - 4w(j). Let q(p) = -2p. Give q(y(t)). -8t*2 Let y(v) = -2v. Let j be (6/4)/(15/80). Let g(h) = h + 9h - jh. Determine g(y(x)). -4x Let a(k) = 3k + 0k - 4k. Let l(v) = 11v2. Calculate l(a(d)). 11d*2 Let m(o) be the second derivative of 7o*3/3 + 33o. Let f(c) = 5c2. Give f(m(z)). 980z*2 Let r(a) be the first derivative of -7a*3/3 - 2. Let y(j) = 3j + 2j2 + 0j - 3j. What is r(y(s))? -28s*4 Let x(c) = 6c. Let t(r) = 31r2. Give t(x(a)). 1116a*2 Let r(h) = 28h. Let q(c) = -17c. Calculate q(r(x)). -476x Let j(s) = 2s. Let l(r) = -212r. What is j(l(i))? -424i Let a(l) = 2l2. Let r(k) be the second derivative of -k3/6 - 2k2 + 3k. Let b be r(-6). Let w(j) = 4j + 2j*b + 0j - 4j. Calculate w(a(o)). 8o*4 Let q(o) = 3741o + 2. Let z(m) = m*2. What is z(q(n))? 13995081n*2 + 14964n + 4 Let b(m) = -m*2. Let q(t) = -59t - 2. Calculate q(b(n)). 59n2 - 2 Let s(b) = -b. Let p(i) = -i. Let a(v) = -3p(v) + 6s(v). Let z(t) be the third derivative of t4/24 - t2. Determine z(a(c)). -3c Let c(v) = v. Let b(l) = 437l - 2. Determine b(c(j)). 437j - 2 Let y(p) = p*2. Let m(r) be the third derivative of -4r*5/15 + 5r*2. Give y(m(a)). 256a*4 Let w(j) = -14j - 5 - 2 + 7. Let t(g) = -2g2. Give t(w(f)). -392f*2 Let x(m) be the second derivative of 0 + 0m*2 - 2m - 5/6m3. Let a(h) = -h. Determine a(x(y)). 5y Let y(d) = -d2. Let z(k) = k2 + 4. Let q(c) = -1. Let j(s) = 4q(s) + z(s). What is y(j(g))? -g4 Let q(c) = -2c. Let v(a) be the third derivative of 0a3 + 0a + 5a2 + 5/24a*4 + 0. Determine q(v(j)). -10j Let l(c) = -8c + 8c - 2c. Let q(f) = 7f*2. Give q(l(k)). 28k*2 Let k(x) = 5x - 3x - 3x + 0x. Let n(d) = 34d. What is k(n(b))? -34b Let g(h) = 6h*2. Let m(s) = 14s + 1. Determine g(m(o)). 1176o2 + 168o + 6 Let c(m) = 2m. Let q(h) be the third derivative of 2h*2 + 0h*4 + 0h*3 + 0h - 1/10h5 + 0. Give c(q(y)). -12y*2 Let h(m) = 2821 + 6m - 2821. Let x(v) = 7v2. Give x(h(z)). 252z*2 Let z(o) = -1158o*2. Let b(n) = -2n. Give z(b(v)). -4632v2 Let b(j) = -j + 11j - 5j + 2j. Let t(x) = 3x2. What is t(b(s))? 147s*2 Let a(j) = 0j*2 + 0j2 - j2. Let c(v) = -v + 3. Let x(w) = -3w + 8. Let u(k) = -8c(k) + 3x(k). Calculate u(a(d)). d2 Let m(z) = 16z*2. Let u(g) = -15g*2. Determine m(u(w)). 3600w4 Let r(y) be the second derivative of -y4/4 + 2y. Let x(m) = -2m*2. Determine r(x(s)). -12s*4 Let r(i) = 7i. Let f(s) = -33s2. Calculate f(r(g)). -1617g*2 Let n be (-2 + 0)/(10/(-15)). Let o(b) = -n + 2b2 + 3. Let s(j) be the third derivative of j4/24 - j*2. Give s(o(l)). 2l*2 Let y(v) = -4v + 3. Let t(u) = -u + 1. Let h(q) = 12t(q) - 4y(q). Let c(i) = -9i - 5i + 17i. Calculate h(c(s)). 12s Let n(q) = -8q - 4. Let v(d) = 4d*2. Determine n(v(i)). -32i*2 - 4 Suppose -t = -2t + 2. Let m(q) = 4q2 - 2q*2 + 2q*t. Let p(d) = 2d*2. Determine p(m(l)). 32l*4 Let y(i) = -4i*2. Suppose 8 - 32 = -3a. Let q(d) = -7d*2 + 3 +	{ "pile_set_name": "DM Mathematics" }
actor of 166904? True Is 278 a factor of 209761? False Does 15 divide 3476700? True Does 69 divide 16613120? False Is 813 a factor of 8067399? True Is 192120 a multiple of 24? True Is 243268 a multiple of 32? False Is 104 a factor of 9051432? True Is 80106 a multiple of 158? True Is 187 a factor of 176026? False Is 4023796 a multiple of 262? True Is 12358268 a multiple of 299? True Does 103 divide 1049412? False Is 189764 a multiple of 25? False Is 15 a factor of 19842251? False Is 719756 a multiple of 29? False Is 144 a factor of 527056? False Does 26 divide 1093534? True Is 307773 a multiple of 6? False Is 2814600 a multiple of 1058? False Is 4952204 a multiple of 993? False Does 69 divide 613402? False Does 111 divide 9433113? True Is 31 a factor of 2357178? True Does 401 divide 1387861? True Does 2 divide 6490? True Is 4391625 a multiple of 105? True Does 698 divide 2451638? False Is 374 a factor of 3354032? True Does 8 divide 147471? False Is 4728374 a multiple of 7? True Is 91 a factor of 575120? True Does 132 divide 50424? True Is 23 a factor of 11354571? True Does 220 divide 65478? False Is 49 a factor of 155277? False Does 26 divide 297882? True Is 269452 a multiple of 18? False Is 10553263 a multiple of 48? False Is 2582461 a multiple of 178? False Is 6 a factor of 1722534? True Does 31 divide 329871? True Is 209 a factor of 1770021? True Is 240 a factor of 1553467? False Is 92469 a multiple of 95? False Is 271138 a multiple of 153? False Does 118 divide 1723390? True Is 52 a factor of 345755? False Is 293295 a multiple of 104? False Is 45 a factor of 302408? False Does 143 divide 210624? False Is 721859 a multiple of 25? False Is 93296 a multiple of 6? False Does 921 divide 16358802? True Does 125 divide 190375? True Does 297 divide 43310? False Is 40 a factor of 34265? False Is 72450 a multiple of 42? True Is 217408 a multiple of 64? True Does 19 divide 723304? False Is 805263 a multiple of 7? False Is 6 a factor of 2047084? False Is 130728 a multiple of 13? True Is 200 a factor of 1008686? False Does 25 divide 97127? False Is 74 a factor of 51652? True Is 13 a factor of 12714? True Does 7 divide 652309? True Is 6215663 a multiple of 5? False Is 198256 a multiple of 8? True Does 365 divide 14581730? False Is 1477841 a multiple of 400? False Does 363 divide 5830506? True Is 209 a factor of 1564088? False Is 381612 a multiple of 6? True Is 91 a factor of 329959? False Is 1325858 a multiple of 46? True Is 330 a factor of 1449543? False Does 93 divide 45653? False Does 81 divide 431163? True Is 38 a factor of 3478558? True Is 1561270 a multiple of 358? False Is 18409885 a multiple of 294? False Is 59 a factor of 255164? False Is 5223090 a multiple of 30? True Does 7 divide 228102? True Is 2640900 a multiple of 28? False Is 512 a factor of 1796096? True Is 382754 a multiple of 22? False Is 14240254 a multiple of 27? False Does 37 divide 664346? False Does 206 divide 69759? False Is 5974640 a multiple of 47? True Is 2 a factor of 5335375? False Is 38 a factor of 114921? False Does 7 divide 15983? False Is 722 a factor of 381938? True Is 6325277 a multiple of 219? False Does 622 divide 10663568? True Does 44 divide 136899? False Does 888 divide 2331000? True Does 12 divide 122784? True Does 29 divide 37123? False Does 13 divide 3786666? True Is 518776 a multiple of 41? False Is 434442 a multiple of 16? False Does 410 divide 202950? True Does 18 divide 740160? True Is 49888 a multiple of 4? True Is 427321 a multiple of 331? True Is 64090 a multiple of 65? True Is 1352752 a multiple of 168? False Does 27 divide 20665334? False Does 8 divide 58384? True Is 251 a factor of 488520? False Is 115518 a multiple of 13? True Is 298056 a multiple of 22? True Is 14 a factor of 436436? True Is 229749 a multiple of 285? False Is 2000546 a multiple of 74? False Is 25 a factor of 1090543? False Is 68 a factor of 615876? True Is 23 a factor of 398666? False Does 251 divide 45682? True Is 1042837 a multiple of 9? False Is 1291175 a multiple of 5? True Is 503557 a multiple of 323? True Does 70 divide 2439084? False Is 9746989 a multiple of 20? False Is 32 a factor of 119399? False Is 7723563 a multiple of 540? False Is 11 a factor of 253931? False Does 64 divide 732853? False Does 2 divide 216766? True Does 6 divide 532791? False Is 3255 a multiple of 167? False Does 59 divide 1050967? True Does 6 divide 33821? False Is 726571 a multiple of 47? False Is 3209482 a multiple of 223? False Is 377594 a multiple of 2? True Does 35 divide 705565? True Is 405 a factor of 196930? False Is 476410 a multiple of 122? True Is 753 a factor of 5190640? False Is 153 a factor of 12110562? True Does 60 divide 8043686? False Does 2 divide 405389? False Is 11 a factor of 441516? False Is 47125 a multiple of 6? False Does 35 divide 2313465? True Does 115 divide 27945? True Is 20788383 a multiple of 651? True Does 6 divide 300240? True Does 52 divide 8697780? True Is 464 a factor of 49648? True Does 191 divide 305027? True Is 8 a factor of 1011985? False Is 103577 a multiple of 152? False Does 12 divide 2463825? False Does 41 divide 258773? False Is 127 a factor of 14066593? False Is 50470 a multiple of 14? True Is 321 a factor of 2501293? False Is 6 a factor of 138990? True Is 283628 a multiple of 34? True Does 10 divide 16608046? False Is 639488 a multiple of 8? True Does 114 divide 22011576? True Does 39 divide 117585? True Is 138003 a multiple of 5? False Is 88 a factor of 320232? True Is 3961165 a multiple of 15? False Is 1105785 a multiple of 45? True Is 38 a factor of 2251922? False Is 601344 a multiple of 162? True Is 299498 a multiple of 8? False Does 33 divide 17853? True Is 33774 a multiple of 2? True Is 2443351 a multiple of 23? False Does 12 divide 206112? True Is 58 a factor of 7063308? False Does 38 divide 129960? True Is 4261210 a multiple of 955? True Does 12 divide 171274? False Is 10 a factor of 144820? True Does 224 divide 157746? False Does 29 divide 1649404? True Is 138134 a multiple of 9? False Is 62937 a multiple of 37? True Is 1722757 a multiple of 101? True Does 160 divide 676756? False Is 3954233 a multiple of 10? False Is 1517204 a multiple of 326? True Is 2145 a multiple of 11? True Is 73565 a multiple of 203? False Does 14 divide 1524054? True Is 973717 a multiple of 258? False Does 12 divide 473852? False Is 7 a factor of 341976? False Is 269538 a multiple of 503? False Is 3 a factor of 1693123? False Does 12 divide 152133? False Is 621809 a multiple of 463? True Is 198531 a multiple of 81? True Is 8028 a multiple of 50? False Does 40 divide 4146680? True Is 34 a factor of 762885? False Does 12 divide 34356? True Is 923108 a multiple of 8? False Is 174800 a multiple of 100? True Is 126 a factor of 122220? True Is 23 a factor of 10719242? True Is 125648 a multiple of 18? False Does 28 divide 22523165? False Is 28 a factor of 5104204? True Does 901 divide 5871992? False Is 4667172 a multiple of 172? False Is 521 a factor of 167762? True Is 878784 a multiple of 96? True Is 1563 a factor of 2622714? True Does 77 divide 478192? False Is 187635 a multiple of 189? False Is 1259 a factor of 9254909? True Is 23138251 a multiple of 169? False Does 12 divide 105236? False Is 177866 a multiple of 12? False Is 940592 a multiple of 543? False Is 75 a factor of 1031325? True Is 4474495 a multiple of 8? False Does 89 divide 137238? True Is 1575834 a multiple of 26? True Does 1358 divide 6849752? True Does 12 divide 136575? False Is 13795 even? False Is 1399398 a multiple of 8? False Is 154 a factor of 342608? False Is 722375 a multiple of 25? True Is 62 a factor of 21857358? False Does 20 divide 298880? True Is 23 a factor of 6178897? False Is 6337761 a multiple of 26? False Does 3 divide 755631? True Does 23 divide 4791797? True Is 9 a factor of 4399826? False Is 217855 a multiple of 11? True Is 283393 a multiple of 34? False Is 5 a factor of 1948652? False Is 4 a factor of 689871? False Does 147 divide 5295480? False Does 23 divide 25589114? False Is 42 a factor of 162708? True Is 59 a factor of 108303? False Does 170 divide 93378? False Is 576 a factor of 62304? False Is 65030 a multiple of 70? True Is 88342 a multiple of 387? False Is 447157 a multiple of	{ "pile_set_name": "DM Mathematics" }
r(z) wrt z? -64z3 Let m(s) = 995s*2 - 32s - 384. Let f(a) = -994a2 + 40a + 385. Let u(v) = 4f(v) + 5m(v). Differentiate u(t) wrt t. 1998t Let x(w) = w2 + 30w + 146. Let q be x(-24). What is the third derivative of 31h2 - 18h*q - 19h*3 - 6h*2 - 23 - 8h*2 wrt h? -114 What is the second derivative of 3946q + 8215q2 - 10397q*2 + 4 - 4 wrt q? -4364 Let v(b) be the third derivative of 109b6/20 + b5/60 - b*4/12 - 917b3/6 + b2 - 183b - 15. Find the third derivative of v(x) wrt x. 3924 Let f = -246 - -374. Differentiate -f + 11l - 4l - 51l - 81l wrt l. -125 Suppose 4u = -2o + 10 + 4, -u = 3o + 4. Suppose 4s = -uv + 54, 3v - 4s - 34 = -6s. What is the first derivative of -4d + 1 + 5d + v + 10d wrt d? 11 Find the third derivative of -376p4 + 169p*4 + 175p*4 - 4317p*2 - 29p*3 - 24p*3 wrt p. -768p - 318 Let l be (-4 + -2)/(-2) - (-41 - -16). What is the second derivative of -lb + 2b*4 + 2b*2 + 118 + 2b*2 - 118 wrt b? 24b*2 + 8 Suppose 0 = -80p + 86p - 30. Suppose -4s = pa - 28, -s + a = -a - 20. What is the first derivative of 28x*3 - 21x*3 - 2x + s - 24x3 wrt x? -51x*2 - 2 What is the derivative of -3948 - 7227 + 4855n - 2114 + 1314 wrt n? 4855 What is the derivative of 11z3 + 3790z*2 + 1587 - 7604z*2 + 3794z*2 wrt z? 33z*2 - 40z Let p = -1390 - -1392. Let l(w) be the second derivative of 8/3w3 - 2w + 0 - 6wp. Find the first derivative of l(r) wrt r. 16 Suppose -h = -11 - 4. Suppose 5v = -5 + h. Differentiate -36sv + 39 - 107 + 22 wrt s. -72s Let d(x) = 2x + 58. Let c be d(-28). What is the third derivative of -26z*2 - 8z*2 + 145z*3 + 28z*c + 149z*2 + 119z*2 wrt z? 870 Suppose -43r = -1437 - 5572. Find the third derivative of -323p2 - rp*5 + 11969p - 11969p wrt p. -9780p2 Let s(l) be the third derivative of l6/120 - 177l4/8 + 3475l*3/6 + 1732l*2. Differentiate s(c) wrt c. 3c*2 - 531 Let g(v) be the second derivative of -48v - v*2 + 7/20v*5 - 1/2v*4 + 0 + 7/3v*3. Find the second derivative of g(o) wrt o. 42o - 12 Let g(m) = -9m2 - 35m + 60. Let y = -236 - -241. Let f(p) = 11p2 + 36p - 59. Let j(r) = yg(r) + 4f(r). What is the derivative of j(i) wrt i? -2i - 31 Let n(y) = -y3 + 36y*2 - 69y + 56. Let m be n(34). What is the first derivative of 118t3 + mt*4 - 118t*3 + 14 wrt t? 88t*3 Suppose -22l + 26l - 84 = 0. What is the first derivative of 12n - 11n - 13n - 3n3 + 212 - ln wrt n? -9n2 - 33 Suppose 4i - 9 = -149. Let t be 0((-10)/i + (-18)/14). What is the second derivative of tc + c + 25c3 - 9c*3 wrt c? 96c Let y be (-8)/(-24) + -2(-29)/6. Differentiate -4x - 172 + y + 19 with respect to x. -4 Let g = 330 + -210. Find the third derivative of 19i2 + 22i*2 + 268i*3 - gi*3 - 103i*3 wrt i. 270 Find the first derivative of 18g*2 + 896 - 140 + 1595 + 5g*3 - 212 + 15g*2 wrt g. 15g*2 + 66g Let w(c) = 10c2 + c + 4. Let s(r) = -393r*2 + 182r + 14. Let b(u) = -s(u) + 4w(u). Find the second derivative of b(q) wrt q. 866 What is the second derivative of -975g - 65 - 633g4 - 118g*4 + 65 wrt g? -9012g*2 Let j(o) be the third derivative of 815o8/28 - o4/24 + 595o3/6 + 6525o*2. What is the second derivative of j(z) wrt z? 195600z*3 Let p be (2 + 15/(-6))-4. Suppose -15 = 3f, -p = -2l - 2f - 4. What is the second derivative of 2u - 10ul + u4 - 6u - 6u wrt u? -108u*2 Find the third derivative of -1229b*3 - 230b*2 - 29 + 65 - 1236b*2 - 36 wrt b. -7374 Let r(s) = 23s*3 + 25s*2 + 3s + 103. Let l(k) = -22k3 - 24k*2 - 2k - 103. Let u(h) = 6l(h) + 5r(h). What is the second derivative of u(w) wrt w? -102w - 38 Let g(k) be the first derivative of -1804k*5/5 - 143k + 52. What is the derivative of g(t) wrt t? -7216t3 Let u(h) be the third derivative of 0h + 2/3h4 + 0h*3 - 1/60h*6 + 0 + 0h*5 - 13/210h*7 + 68h*2. Find the second derivative of u(d) wrt d. -156d*2 - 12d Let t = 727 - 699. What is the first derivative of -z + tz + 333 - 17z wrt z? 10 Let k(o) be the third derivative of -o*9/504 + 59o8/42 + o5/20 - 5o4/4 - 1350o*2. Find the third derivative of k(n) wrt n. -120n*3 + 28320n*2 Let b = 546 + -476. What is the derivative of -b + 302z - 304z + 215 + 18z*3 wrt z? 54z*2 - 2 Let p be -1 + (-8)/(-4) - -3. Suppose 2a = pa - 2316. What is the third derivative of -8z*2 + 1158z*5 + 18z*6 - az*5 wrt z? 2160z*3 Let v(k) = 2k + 2. Let o(q) = -2q4 - 1156q*3 + 3q*2 + q - 54. Let b(j) = -o(j) - v(j). Find the third derivative of b(a) wrt a. 48a + 6936 Let z = -306 - -308. Differentiate zn - 24 - 95n*2 + 211n*2 - 99n*2 wrt n. 34n + 2 Let s(g) be the first derivative of 6g + 0g*3 + 5 - 3/4g*4 - 5g*2. Let p(n) be the first derivative of s(n). Find the first derivative of p(u) wrt u. -18u Let w(f) = -3f + 2. Let q be w(-1). Let c = 155 - 149. What is the third derivative of -cm*2 - 6 - 2m*q + 6 - 19m*5 wrt m? -1260m*2 Let u(g) be the third derivative of 455g*4/12 - 1331g*3/6 + 4g*2 - 160g. What is the first derivative of u(d) wrt d? 910 Let k be 221/68 + 1/(-4). Find the second derivative of -t*2 + 3141 + 15tk + t2 + 4t - 3138 wrt t. 90t Let f(r) = -80r + 41r + 40r. Let z(k) = 39k*2 + 3k + 21. Let p(n) = 3f(n) - z(n). Find the first derivative of p(q) wrt q. -78q Let y(c) be the second derivative of 0c4 + 0c*3 + 27/20c*5 - 9/2c*2 - 18c + 0. Find the first derivative of y(d) wrt d. 81d2 Suppose -44q + 4422 = -11q. Find the first derivative of -116 - qf*3 + 18f + 136f3 + 9f + 40 - 33 wrt f. 6f2 + 27 Let u(r) be the second derivative of -138r6/5 + r4/6 - 328r2 - 85r. Differentiate u(v) wrt v. -3312v3 + 4v Let h(l) = -6132l3 + 5l*2 + 10l - 1657. Let k(u) = 3074u3 - 2u*2 - 4u + 828. Let m(v) = -2h(v) - 5k(v). Differentiate m(y) with respect to y. -9318y2 Let q = -348 + 445. What is the second derivative of -18f*3 - 5f*2 + 30f*2 - 2 - 23f*2 - qf wrt f? -108f + 4 Find the first derivative of -16s*4 - 61s*4 - 42s*4 + 714s - 8050 - 716s + 27s*4 wrt s. -368s*3 - 2 Let h be (3 - (-4 - -5))108/8. Find the second derivative of 3d2 - 193 + 192 + hd - 3d4 - 11d*4 - 8d*4 wrt d. -264d*2 + 6 Let n be ((-63)/2)/(-7) + 10/(-4). Find the third derivative of 67b*3 - 3b*4 - 2b2 + bn - 27 - 61b3 wrt b. -72b + 36 Let s(d) = d*3 - 30d*2 - 65d + 34. Let t be s(32). What is the third derivative of 9j4 + tj + 31j2 - 33j*2 + 104 - 2j - 4j6 + 3j*6 wrt j? -120j*3 + 216j Suppose -34 + 2 = -8s. Find the second derivative of 6b*s + 2b - 54b4 - 12b*4 - 97 - 19b4 + b4 wrt b. -936b2 Let j(y) be the first derivative of 39y*3 + 17/2y*2 + 0y - 97. Find the second derivative of j(x) wrt x. 234 Let w(c) be the third derivative of -5/24c4 - 7/6c*3 + 0c - 43/120c6 + 74c*2 - 1/30c*5 + 0. What is the second derivative of w(z) wrt z? -258z - 4 Suppose -5z - 254 = -294. What is the third derivative of zm*2 + 74m*2 - 14m*3 - 20m*3 - 26m*2 wrt m? -204 Let s(d) be the first derivative of 2/5d*5 + 0d + 1/2d2 - 112 - 34/3d*3 + 35/4d*4. Find the third derivative of s(v) wrt v. 48v + 210 Let u(w) = -624w3 + 9w*2 + 906w + 9. Let t(n) = -313n3 + 4n*2 + 453n + 4. Let s(o) = -18t(o) + 8u(o). What is the second derivative of s(r) wrt r? 3852r Suppose 0 = 13s - 2 - 24. What is the third derivative of 189qs + 4q*5 - 2q*3 - 188q*2 - 7 + 7q*3 - 3 wrt q? 240q*2 + 30 Let w(r) be the first derivative of -2353r6/6 + r3/3 + 601r2/2 - 2666. What is the third derivative of w(q) wrt q? -141180q*2 Let s(q) be the second derivative of 1849q8/56 - q7/42 + q*6/30 - 7q*4/3 + 79q3/6 + q2 - 45q + 15. Find the third derivative of s(u) wrt u. 221880u*3 - 60u*2 + 24u Let j(p) be the first derivative of 29p2/2 - 2p - 2. Let z be j(1). Find the first derivative of 11x3 + 31 - 38 - zx*3 wrt x. -48x*2 What is the third derivative of -8n*2 - 58n*4 - 730n*4 - 886n*4 + 6854 - 6788 wrt n? -40176n Let d be (88/55)/(4/(-10)	{ "pile_set_name": "DM Mathematics" }
5? 0.1 What is the nearest to 3423 in 2/11, -1/73, 4? 4 Which is the nearest to 18/5? (a) 20 (b) -1/10 (c) -2/7 (d) -1/2 b What is the closest to 2 in 419, 8, -55? 8 What is the nearest to 2/3 in -2, 76.2, 5? -2 What is the closest to 0.1 in 2, -1/2, 0, -597? 0 Which is the closest to 0.1? (a) -728/45 (b) 14 (c) -4/9 c Which is the nearest to 1? (a) 0.1 (b) -0.231 (c) 1/4 (d) -2/9 (e) 0.4 e What is the nearest to -1 in 59, -1/3, 1.356? -1/3 What is the nearest to -105 in -5, 0.7, -4? -5 What is the nearest to 0.2 in -41, 2/5, 1, -2/15, -1? 2/5 What is the nearest to 1 in 2, 3949, -2/13? 2 Which is the nearest to 13? (a) 2/9 (b) 3011 (c) -1/2 a Which is the nearest to -1/4? (a) -0.5 (b) -5 (c) 1638 (d) -47 a What is the nearest to -1 in 3/8, -495, 2, -3? 3/8 Which is the closest to -2/5? (a) -22 (b) 0.4 (c) 400 (d) 5 (e) 0.2 e What is the closest to -91/5 in 0, -19, -1/3? -19 What is the closest to 3 in 1, -2/5, 140/17, -5/2, 0? 1 Which is the closest to -15? (a) -48 (b) -62 (c) -1 (d) 3 c What is the nearest to 0 in 3, -98/57, 2, -4/5? -4/5 What is the nearest to -1/25 in -518, 0.4, 4? 0.4 Which is the nearest to -0.02? (a) 4/5 (b) 30 (c) 2 (d) 11/21 d What is the closest to 0 in 1, 1/10, -3, -0.66? 1/10 What is the nearest to -7 in 2.15, 4/3, 4? 4/3 What is the closest to -1988 in -1, -0.03, 0.4, -4, 0.3? -4 Which is the nearest to -15? (a) 1.1 (b) -8/5 (c) -2/5 (d) 1/7 b Which is the nearest to 11? (a) -12/17 (b) 1 (c) -1/2 (d) 3 d What is the closest to 3 in 703, 0.3, -9, -0.5, 2/9? 0.3 Which is the closest to 0.1? (a) -3/5 (b) 4/9 (c) 2/5 (d) -3.61 c What is the nearest to -0.12 in 5, 0, -6, 0.024? 0 Which is the closest to 1/2? (a) 7412 (b) -4 (c) 0.3 (d) 0.1 (e) 0 c What is the nearest to 0 in 7, -0.3, 3/29, 0.1? 0.1 What is the closest to -1 in -18, -5, -0.1, -1.321? -1.321 What is the closest to -20 in 0.08, -1/4, 1.4, -2/9? -1/4 Which is the closest to 0? (a) 4 (b) -439 (c) 42 a What is the closest to -3 in 1, 1/31, -27/4? 1/31 Which is the nearest to 48? (a) 1/3 (b) -0.05 (c) 0.3 (d) 0.1 a What is the nearest to 2 in 4/13, -0.1, -3/4, -2341? 4/13 Which is the nearest to 1/4? (a) 2 (b) 3/4 (c) -1/2 (d) 0.02835 (e) 1/6 e What is the closest to -1 in 0.6, 2, -1, 0.2? -1 What is the nearest to 0.1 in -1/2, 46, -1/39, 0.4? -1/39 What is the nearest to 7 in -2, -2/23, -92, 2, 1/3? 2 What is the closest to -1 in -5/3, -3, 68/9, -7, 0.3? -5/3 What is the closest to 54 in 1, -0.4, -5, -2/13, -0.2? 1 What is the closest to 1 in -1822/5, -5, -0.4, 1/5, 18/17? 18/17 What is the closest to 2/7 in -1/49, -6, 30? -1/49 What is the nearest to 2 in 0.4, -2.89, -1/2, 1/5? 0.4 What is the nearest to 1/141 in 0.5, 1/7, -3, 15? 1/7 Which is the closest to 1? (a) -2 (b) -6 (c) -123 (d) -5 a Which is the closest to -47? (a) -3 (b) -1/5 (c) 2/921 a What is the closest to -25 in 2/9, 11, 0.05, -5? -5 Which is the closest to 1? (a) 0.3 (b) 3 (c) -1/6 (d) 1316 a What is the closest to 10 in -6/11, 114, 0? 0 Which is the nearest to 0? (a) 5/4 (b) 2/25 (c) -8/3 (d) -4 (e) 1 b Which is the closest to -1/5? (a) -0.07 (b) -2/7 (c) -2/3 (d) 2/49 b Which is the nearest to 0? (a) 0.4 (b) -52 (c) 3/10 (d) 0.5 (e) 15 c What is the nearest to -2 in -13, -103, -4? -4 Which is the nearest to 0.3? (a) 3555 (b) 5 (c) -2 (d) 2/7 d Which is the closest to -13? (a) 2/11 (b) 0.3 (c) -3 (d) 0.21 c What is the closest to 89 in -6, -4/9, -2? -4/9 What is the nearest to 0.1 in 0.5, -1, 0.2686, -10? 0.2686 Which is the closest to -0.1? (a) -1 (b) -25.006 (c) 5 (d) -0.1 d What is the nearest to 11 in 8, -1/6, -2, -4? 8 Which is the nearest to 2/3? (a) 4 (b) -1/2 (c) 0.13 (d) 0.10651 c What is the nearest to 4/7 in -117/8, 4, -2, -0.3? -0.3 What is the nearest to -489 in 4/3, -3, 5/6? -3 Which is the closest to -1/3? (a) -99 (b) 5/3 (c) -5 (d) -0.5 (e) -1 d What is the nearest to -10 in 2.4, -7, -10, 1, 3/7? -10 What is the nearest to 5 in -0.1, -47/4, -4, -1/3? -0.1 What is the closest to -3 in -0.4, -0.5, -1, 4, 2? -1 Which is the closest to -1/11? (a) 5 (b) 2/9 (c) 499 (d) 2 (e) -1/8 e What is the nearest to 0.1 in -392, 0.0784, -2/7? 0.0784 What is the nearest to 0 in -3, -0.7, -2/7, -37.2, 2/27? 2/27 Which is the nearest to 1? (a) 4 (b) 139 (c) 3/5 (d) -3 c Which is the nearest to 1? (a) 3 (b) 2 (c) 9 (d) -2 (e) 6/5 e Which is the nearest to 0? (a) -17 (b) -0.23 (c) -1/8 (d) 0.1 d Which is the closest to -15? (a) -0.5 (b) 0.07 (c) -2/3 c Which is the nearest to 0.0419? (a) -2/23 (b) -0.06 (c) -2 (d) -7 (e) -0.4 b What is the nearest to 0.1 in 2, -3.3, 0.4, -1, -5? 0.4 What is the nearest to -1 in 621, -4, -3, 1/2, -0.9? -0.9 Which is the closest to -21? (a) 13 (b) 2/11 (c) -0.3 c Which is the closest to -2/15? (a) 15 (b) -1/3 (c) 1 (d) 0 (e) -5 d What is the closest to 0.2 in -3, -0.4, -491, -15? -0.4 What is the closest to -3 in 1/3, -2/3, 4308/11, 2/5? -2/3 What is the nearest to -4 in 0.2, 0.5, 0.035, 0, 3? 0 What is the nearest to -9 in 3/4, -3/13, -1.1, 1, -0.5? -1.1 What is the nearest to 31 in -0.1, 23, -2? 23 What is the closest to 43/5 in -30, 4/7, 0.4, -7, 2? 2 Which is the closest to -12602? (a) -13 (b) 5 (c) 2/25 a What is the nearest to 23/6 in 2/3, 1, 0.5, -2/3? 1 What is the nearest to -6 in -29, -8/3, -1/4, 3/2? -8/3 Which is the closest to -1/19? (a) -8/5 (b) -8/11 (c) -3/7 c Which is the closest to 0? (a) -66 (b) -26 (c) 2 c Which is the closest to 2? (a) 0.3077 (b) -5 (c) 0.2 (d) -3 (e) 2/5 e Which is the closest to -6? (a) 9 (b) -1/3 (c) -1 (d) 770 (e) 3 c What is the closest to -1/4 in -0.26, -2/91, -4, 3/2? -0.26 What is the nearest to -7084 in 2/3, -3, 8/5? -3 Which is the nearest to -1/2? (a) -0.1 (b) 5 (c) 4 a Which is the closest to 1? (a) -0.2 (b) -0.03 (c) 0.0846 c What is the nearest to 1/5 in 13, -0.14, -4, 0, 5? 0 Which is the nearest to -1? (a) -3/5 (b) 6592 (c) -4/7 (d) 3 a Which is the nearest to -2/5? (a) -1/2 (b) -0.4 (c) 2886 b What is the closest to 2 in 4, 92, 0.03? 0.03 What is the nearest to 6/11 in 5, -1/3, 0, -4? 0 What is the nearest to -2/7 in 0.06, -0.066, -0.9, 0.5? -0.066 Which is the closest to 12? (a) -2/3 (b) -2/7 (c) 0.3 (d) -0.1 (e) 1/5 c Which is the closest to -0.26? (a) 2/9 (b) -5 (c) 26 (d) -3/5 d Which is the closest to -1? (a) 0 (b) 0.5 (c) -83 a Which is the closest to -2/9? (a) 7.19 (b) 4 (c) -5/6 c Which is the closest to -3/4? (a) 1.3 (b) 1.1 (c) -5 b What is the closest to 3/5 in -1/21, -0.3, 5? -1/21 Which is the nearest to -9? (a) 4 (b) 1/11 (c) -0.1 (d) -2 (e) 2/9 d What is the nearest to -1 in -0.395, -3/8, -2? -0.395 Which is the nearest to -1/26? (a) -4 (b) 1/2 (c) -1 (d) 2 (e) 23/33 b What is the nearest to -1 in 5, 649, 6? 5 What is the closest to 0.08 in 45/13, -15, 0? 0 Which is the closest to 0.1? (a) 0.07 (b) -0.4 (c) 11 (d) 3/109 a What is the closest to 0 in -2/3, -4287, -0.2, 0? 0 What is the nearest to -1/2 in -1, -3, -4, -7/5, -124? -1 Which is the closest to 0? (a) 102.3 (b) -0.03 (c) 1 b Which is the nearest to -0.1? (a) 70 (b) -5 (c) -151 b Which is the nearest to 2? (a) -1/11 (b) -51 (c) -1066 a Which is the closest to 2/3? (a) 16 (b) 0 (c) 10 (d) 1.7 b Which is the nearest to -100? (a) -3 (b) 5 (c) -5 (d) -2 c What is the closest to 1 in 2, -984, 2/7? 2/7 Which is the closest to 80? (a) 5 (b) 3/8 (c) -4 (d) -2/7 (e) -2 a What is the closest to -7 in 0, 0.5, -9008? 0 Which is the nearest to -0.1? (a) -0.2 (b) 0.1 (c) 0.0434 a Which is the nearest to -2/5? (a) 5 (b) 3/22 (c) 0.06 (d) 0 d Which is the closest to -13/9? (a) 0.3 (b) -2/13 (c) 2 (d) -3/5 (e) 0.81 d Which is the closest to 1? (a) -1/4 (b) 5 (c) -27 (d) -1.49 (e) 0 e What is the nearest to -3.441 in -14, -0.15, -1/4? -1/4 Which is the nearest to -2? (a) -313 (b) -142 (c) 5 c What is the nearest to 8/3 in -3/4, 2/3, 174? 2/3 What is the nearest to -8/3 in 0.2, 5, 5/14, -0.4, 2/13? -0.4 Which is the nearest to -9? (a) -1 (b) 8 (c) -56 a Which is the nearest to -2? (a) -5 (b) 2/95 (c) -2 (d) -0.028 c Which is the nearest to 1/4? (a) -0.5 (b) -3 (c) 38 (d) -0.3 (e) 74 d What is the	{ "pile_set_name": "DM Mathematics" }
to -1? (a) -698 (b) -2 (c) -0.1 (d) -5 c What is the closest to -1/14 in 2/3, 0, 1, -23/12, 0.2? 0 Which is the nearest to -0.64? (a) 1 (b) -397 (c) 0.4 (d) 0.2 d Which is the closest to -2/11? (a) -14 (b) -1 (c) -320 (d) 0 d Which is the closest to 0.1? (a) 4/5 (b) -0.1 (c) -1/3 (d) -22 (e) 5 b What is the closest to -4 in 23, 1, 0.06? 0.06 What is the closest to 0.1 in -0.5, -6.8, -77.7? -0.5 What is the nearest to -3 in 1/4, -6, 718, 3/8? -6 What is the nearest to 7/20 in 2.6, -5, 2? 2 Which is the closest to -1/2? (a) 2/15 (b) 0.06 (c) 2/35 c Which is the nearest to 310/9? (a) 0.2 (b) -2/3 (c) 166 a What is the nearest to -2/7 in -9, 1, -2, -1107? 1 Which is the nearest to -1/3? (a) -36.9 (b) -1.1 (c) -0.11 (d) 0.1 (e) 1/6 c What is the closest to -0.1 in 73/28, 4, 1/13, 5? 1/13 Which is the nearest to 0? (a) -0.03 (b) -0.0016 (c) -0.4 b What is the nearest to -0.01 in 5, 2/7, -60, -0.07? -0.07 Which is the closest to 13? (a) 0.6 (b) -4 (c) -3.3 a Which is the nearest to 0.3? (a) 1/7 (b) 2/17 (c) -0.2 (d) -0.0969 a Which is the closest to -17? (a) -1/2 (b) -0.02 (c) 3 (d) -0.1 (e) -1/7 a Which is the nearest to 1/3? (a) -4 (b) 2/7 (c) 0.19 (d) -1/4 b What is the nearest to 2 in 0.3, 3/2, -1, -3/26, 0.4? 3/2 Which is the nearest to 60? (a) -2 (b) 4 (c) 1/3 (d) 9 d Which is the closest to 1? (a) -0.4 (b) -17 (c) -0.03 (d) 0 d Which is the nearest to -2/9? (a) 450 (b) -2/7 (c) 7 (d) 3/4 b What is the closest to 0.5 in -0.03, 31, -3/4, 0.2, 4? 0.2 What is the nearest to -2/7 in 0.1, -186, -2.6? 0.1 Which is the closest to -851? (a) -0.3 (b) -2/5 (c) -2 c Which is the closest to 2/9? (a) -2/23 (b) -1.11 (c) -13 a What is the nearest to -3 in -0.09, -3/37, -0.78? -0.78 Which is the closest to 2? (a) 1/51 (b) 1 (c) -4 (d) -5 b Which is the closest to 0.1? (a) 10/17 (b) 3 (c) -2.417 a Which is the nearest to -0.2? (a) 18 (b) -3 (c) -5/42 (d) -2/15 d Which is the closest to 121? (a) 37 (b) -2 (c) 1/3 a What is the nearest to -3 in 0, -10/11, -2/189, -1/5? -10/11 What is the nearest to 1 in 2/9, 4, 0.18, 2/7? 2/7 What is the nearest to 62/5 in 2, 1/3, 2/9, 0.2, 3/5? 2 Which is the closest to -1? (a) -169 (b) -1/11807 (c) 0.5 b What is the nearest to 0.39 in 0, -4/307, -0.3, -2? 0 What is the closest to 0.1 in 2.1, -7.24, 0.1? 0.1 Which is the nearest to 0? (a) 149 (b) 4 (c) 0.08 (d) 65 c Which is the closest to 0? (a) 0.3 (b) -1.12 (c) -0.6 a What is the nearest to -2/13 in -20, -2, 0.2025? 0.2025 What is the nearest to -2/5 in -500, 1, 6/29? 6/29 Which is the nearest to 0.06? (a) 0 (b) -170 (c) 2/9 a What is the nearest to -4 in -153, 4, 5, 18, -4? -4 What is the closest to -0.1 in 1, 1/9, 2/3, 3970? 1/9 What is the nearest to 1/4 in 0, -12, 4, 0.36? 0.36 What is the closest to -0.1 in -6, 6, -2, 18? -2 What is the nearest to 2/5 in 1/2, 2, -0.9, -3, -1.929? 1/2 Which is the closest to 0.05? (a) 38 (b) -2/15 (c) -2/9 b What is the closest to -4 in 7, 0.04, -4, -22? -4 What is the nearest to 0 in -0.252, 2/7, 2.2, 0.5? -0.252 What is the closest to -1 in -33672, 3, -10, 1? 1 Which is the closest to 0.3? (a) 1/6 (b) -14/5 (c) 57 (d) -6 (e) 1 a Which is the closest to -1? (a) 3 (b) -0.3 (c) -4 (d) 2/9 b What is the nearest to 0.022 in 5, -501, 4, -0.4, 6/7? -0.4 What is the nearest to 0.1 in 1/5, 53, 1/2, -4, -0.61? 1/5 Which is the closest to 2/11? (a) 1 (b) 167 (c) -0.3 c What is the nearest to -2/11267 in 5, 1/3, -0.5? 1/3 What is the nearest to -402 in -2, -5/78, 1/3? -2 Which is the nearest to 0.28? (a) -1/50 (b) -2/3 (c) -4 (d) 2/7 (e) 1 d What is the nearest to 16 in -3, 3, 4/35? 3 What is the nearest to 2/3 in 0.27, -7/2, -9/8, -15? 0.27 Which is the closest to -2? (a) 9/4 (b) 2 (c) -26.9 b Which is the closest to -0.16? (a) -1 (b) 2/11 (c) -2 (d) -3 b What is the closest to 2/4385 in -3, 3/2, -14? 3/2 Which is the closest to 0.3? (a) 2/3 (b) 1/4 (c) 747 b Which is the closest to 0? (a) 188 (b) 2/27 (c) -0.4 (d) 3 (e) 2/9 b What is the closest to 0 in 902, 3, 5? 3 Which is the closest to 1? (a) 2/9 (b) -2 (c) 30366 a Which is the nearest to 3? (a) 3 (b) -4.4 (c) -0.4 (d) 2 (e) 1.8 a Which is the closest to 1/2? (a) 32 (b) 9517 (c) 2/17 (d) -1/8 c Which is the nearest to -0.2? (a) -4 (b) 0.2 (c) -1/5 (d) 4/7 (e) 72 c Which is the nearest to 2? (a) 6.76 (b) -5 (c) -8 a Which is the nearest to 2/7? (a) -1 (b) 1/2 (c) -2/101 (d) 0.1 (e) -0.3 d Which is the nearest to -0.04? (a) -0.12 (b) 1/6 (c) -5 (d) -31 a What is the closest to 0.1 in 2, -6, 0.13, -36, -4? 0.13 What is the closest to 1 in 4, 13, -5, 80? 4 What is the closest to 2/11 in -683, 0.2, 0.1? 0.2 Which is the nearest to 0? (a) 2/9 (b) 3 (c) -0.076 (d) 1/26 d What is the closest to -8/5 in 5, 0.07, -1, -11.4, 2/11? -1 What is the nearest to 6.6 in 2/7, 0.01, -1/10, 1? 1 Which is the nearest to -2/1129? (a) 5 (b) -4/7 (c) 1 b Which is the nearest to -1.1? (a) 5 (b) -0.1 (c) 0.251 (d) 0.5 b What is the closest to -1/4 in 4, 0.2, -286, -7? 0.2 Which is the closest to 5? (a) 0 (b) -3 (c) -4/7 (d) 46 (e) -2 a What is the nearest to -0.2 in -1/23, 0, -2, 4, 77? -1/23 What is the closest to -0.03 in 0.07, -2043, 0.2? 0.07 Which is the closest to 1? (a) -0.4 (b) -1.1098 (c) 5 a What is the closest to -0.01 in 5, 0.5, -1/2, 6/499? 6/499 Which is the nearest to 2? (a) -6 (b) 477 (c) -1 c What is the nearest to 0 in 289, -0.1, -22.3? -0.1 What is the closest to 12 in -6, -1/3, -1, 11, 0.5? 11 What is the nearest to 2/3 in -5, 5, -5/2, 25, -11.4? -5/2 What is the nearest to 4 in -1, 4, -1.0957? 4 Which is the nearest to 2? (a) 2.1 (b) 2/237 (c) -2 (d) 0.07 (e) 1/3 a Which is the nearest to -6? (a) 1/7 (b) 26 (c) -5 c Which is the nearest to 9? (a) 5 (b) 4 (c) 1 a What is the nearest to 1 in -0.2, -12, 64/9? -0.2 Which is the nearest to 61? (a) 2/503 (b) 1/2 (c) 0.2 b Which is the nearest to -1/812? (a) -3 (b) 0.09 (c) 18 b Which is the closest to -53? (a) 1/4 (b) 6 (c) 0.065 c Which is the closest to 3? (a) 46 (b) 4 (c) 0.01 (d) -0.4 b Which is the closest to -0.6? (a) 18 (b) -5 (c) 1/10 (d) -2 c Which is the closest to -0.27? (a) 2 (b) 2/11 (c) -5/3 (d) -1/11 d Which is the nearest to -0.06? (a) -1 (b) 1/4 (c) -237 b Which is the nearest to -4? (a) -412 (b) -1/5 (c) -70 b What is the nearest to 1/2 in -21, -14, -5, -3/14? -3/14 What is the nearest to -5 in 1/7, 3, -1192, 5? 1/7 What is the closest to 1 in 1/17, 4, -4, 329? 1/17 Which is the closest to 0.6? (a) -0.4 (b) -0.5 (c) 1/38 (d) 4/5 (e) 1 d What is the nearest to 2/5 in -2, 0.4, -1/5, -1115? 0.4 Which is the closest to -17352? (a) -3 (b) 5/2 (c) 1/4 a Which is the closest to -1? (a) -5/6 (b) -1.23 (c) -0.6 (d) -1/3 a What is the closest to 0.004 in 0.5, -1/19, -2, -3? -1/19 What is the closest to -1/4 in 49, 1/6, 0, -0.08? -0.08 What is the closest to 0 in -13, 1335, 1/2, 1? 1/2 Which is the nearest to 0.22? (a) 1 (b) 0 (c) 0.03 (d) 0.37 d What is the closest to -1 in -1.96, -2, -0.1, -1/38? -0.1 What is the closest to 0.4 in -0.2, 19.6, 9? -0.2 What is the closest to -9 in 0.07, 28, -2? -2 What is the closest to 0.1 in -1, -1/10, -65? -1/10 What is the nearest to -713 in 3/16, -1/2, 0, -3, 0.3? -3 What is the nearest to -6 in 0.02, -0.7, -0.2, -40? -0.7 What is the nearest to 622 in -5, -0.79, 0.5, 0? 0.5 What is the closest to -0.6 in -3.5, -0.15, -0.4? -0.4 Which is the nearest to 0? (a) -0.5 (b) -22/7 (c) 1 a What is the closest to -646 in -201, -0.3, 0.5? -201 Which is the closest to -0.1? (a) 448 (b) -0.1 (c) 4 (d) 2/5 (e) -1 b Which is the nearest to 1/2? (a) -0.5 (b) 16 (c) -319 (d) -2/7 d Which is the nearest to 127.7? (a) -3 (b) -1/6 (c) -2 (d) 19 (e) 15 d What is the closest to -0.1 in -0.5, -361, -3.07? -0.5 What is the closest to -2.7 in 5, -0.3, 2, 3/7? -0.3 Which is the closest to 4? (a) 0 (b) -2/17 (c) 5 (d) -163 (e) 33 c What is the closest to -0.2 in -2/21, -35, -2, -0.2? -0.2 Which is the closest to -2/5? (a) 2/5 (b) 11 (c) 2/9 (d) 1 c What is the nearest to -0.2 in -11, -2/553, -4? -2/553 What is the closest to -1 in -0.3, -107/5, -2, -1? -1 What is the closest	{ "pile_set_name": "DM Mathematics" }
the form nu4 + z + fu + du3 + au*2 and give d. -1 Express (-1 + 1 - 4)(4n3 + 29n3 - n3)(-2 + 5 - 5) in the form bn*3 + gn*2 + cn + w and give w. 0 Express 3k2 - k2 - k2 - 1 - 3k*2 + 1 + (-k - 2k + k)(0k + 3k - 6k) - 143k2 - 193 + 390 - 194 in the form vk + qk2 + b and give b. 3 Rearrange (-17 + 17 - 6y)(120 - 2y - 119 + 20y) to dy + a + gy2 and give g. -108 Express 0l*2 + 3l*3 - 21 + 3l*2 + 3l - 4l2 - 5l*3 in the form cl*2 + r + ml*3 + sl and give r. -21 Rearrange (-184 + 1093i - 2186i + 1088i)(i*2 - 2 + 2) to ci*3 + si*2 + hi + x and give s. -184 Rearrange (-31 + 5 - 8 + (-1 + 1 - 2)(1 + 1 + 1))(-5r4 - 5r4 + r4) to the form mr4 + n + xr*2 + or + sr3 and give n. 0 Rearrange 121d*2 - 1829d*2 - 163d*2 to the form n + id*2 + hd and give i. -1871 Rearrange -67 + 124 - 71 + 15n to mn + t and give m. 15 Rearrange (14u2 - 38u + 38u)(-352 - 98u + 352) to a + mu*3 + qu*2 + bu and give m. -1372 Express 36h + 4h*3 - 2h*3 - 34h + (h - h - 2h)(4h2 + 5h - 5h) as sh + qh2 + v + rh*3 and give s. 2 Rearrange -35 - 334o*2 - 4o*3 + 342o*2 + 2o*3 to the form go*2 + v + no + lo3 and give v. -35 Rearrange (5f*2 + 6 - 6)(2f + 3 - 3)(-17f + 0f - 122f) to b + pf*2 + tf + of4 + hf*3 and give o. -1390 Express 33 - 3s*3 + 13s*3 + 6 - 9s*3 as ls + ds3 + i + ws*2 and give d. 1 Rearrange 20w*2 + 6w - 22w + 19w + 4w2 to the form vw*2 + iw + h and give i. 3 Express (j - 3j2 - j)(j - 3j + 0j) + 0j + 6j*3 + 0j + (-2j3 - 3j*3 + 4j*3)(-1 - 6 + 3) as wj2 + dj + ij3 + s and give i. 16 Rearrange -24940i3 + i2 - 142i + 662i + 24940i3 + i4 to ui*2 + wi + fi4 + y + gi*3 and give g. 0 Rearrange (-3 + 2v*2 + 3)(0 - 5 + 4) + ((1 - 1 + 2)(1 + 2 - 4) - 2 + 4 - 4)(-7 + 7 + 14v2) + v2 + 4v - 4v to d + kv + pv2 and give p. -57 Express (-2 + 0 + 0)(76z2 + 359z*2 + 196z*2) in the form cz + vz2 + j and give v. -1262 Express 17u + 405 + 37u - 55u as m + ru and give m. 405 Express -5761o*3 + 6681o3 - 2 + 2 + (0 + 0 - o2)(2o - 4o + 0o) - o*3 + 3o3 - o3 as ao2 + qo*3 + bo + l and give q. 923 Express (-4 + 2 - 1)(-2x*2 - 135x*3 + 4x + 134x3 + 0x*2) in the form jx + yx2 + dx*3 + a and give y. 6 Rearrange (4k + 2k + 0k)(4k*3 + 3 - 3) - 15k*4 + 2k - 4k + 2k*4 to the form zk*2 + f + jk*4 + tk*3 + yk and give y. -2 Express 214i - 5i2 - i3 - 213i + 0i*3 as si*2 + g + di + vi3 and give d. 1 Express -23 + 11 + 12 + 2f*2 - 39f*3 as vf*3 + hf + pf2 + o and give o. 0 Express -3k*2 + 2k*2 + 2k*2 + 2k*2 + 2 + 5k + 20k as gk*2 + fk + b and give f. 25 Rearrange 4w2 - 3w*2 + 0w*2 - 2w*2 + 3w*2 + 3w*2 + (6w - 7w - 5w)(3w - 8w - 2w) to lw2 + b + iw and give l. 47 Rearrange -118l + l2 + 219l + 7l2 - 683l - 7l2 to a + ul*2 + jl and give j. -582 Express 61z2 - 59z*2 + 23z*2 + z in the form rz + yz2 + d and give y. 25 Rearrange ((1 - 2 + 0)(-2 - 3 + 3) - 5 + 0 + 2)(-2g + 0g - 2g) to the form r + lg and give l. 4 Rearrange (68y - 21 + 77y - 140y)(3 - 6 + 2) to the form zy + f and give f. 21 Express v + 2v - v + 32v*2 + 4 - v + 9 as sv*2 + l + tv and give l. 13 Rearrange (12 - 12 + 5n + (0 + 2n + 0)(-2 - 2 + 5))(-40n2 + 74 - 10n*2 - 74) to cn*3 + fn + m + hn2 and give m. 0 Express 9 + 8 - 4 + h - 2h + 3h - 3h + 0 - 2h + 0 - 2h + h + 2h + (-3 - 4 + 5)(-h + 1 - 1) + 0h - 5h + 52h in the form k + jh and give k. 13 Express (-v + 2v + 8v)(10v2 - 10 + 10) + v3 - 3v3 + v3 as tv*3 + iv + sv2 + r and give t. 89 Rearrange -2f - 3f + 4f + (-1 + 0 + 3)(107f + 84f - 60f) to cf + b and give c. 261 Rearrange 167c + 50 + 27c - 50 to the form t + sc and give s. 194 Rearrange 5o2 + o - o + (-3 - 2o + 3)(2o - 3 + 3) + 2o2 + 2 - 2 + 1 + o2 - 1 + 30o*2 + 56o - 56o to the form do*2 + fo + g and give d. 34 Express 6m3 - 3m*2 + m + 2m*2 + 5m*2 - 13 + 21 - 3m*2 as qm*3 + g + fm*2 + dm and give g. 8 Express (39n2 - 1 + 62n - 3 - 64n)(-4 + 6 - 3) as g + xn + hn*2 and give g. 4 Express -12 - 110x*3 + 2x + x*4 - x + 108x*3 as mx*2 + hx*3 + yx*4 + t + px and give m. 0 Express -140v2 + 202v*2 - 14v*2 - 223v*2 as o + uv + zv2 and give z. -175 Express (0 + 4 - 2)(m + m - 3m) - 5m + 4m + 2m + (5 + 2 - 2)(0 - 3m + 0) in the form cm + v and give c. -16 Rearrange 735 - 735 + 63g*2 - 2812g*2 - 52g*2 to pg*2 + d + yg and give p. -2801 Rearrange -72n2 - 47n + 23n + 24n + 553n2 to xn*2 + m + qn and give x. 481 Rearrange 2y + 7y - 2y - 6y + 2y2 + 29 to the form z + iy + xy2 and give x. 2 Express 195 - 387 + 76u*2 + 192 as ku + p + xu2 and give x. 76 Rearrange k - 2k*2 - 3k*2 - 14 + 0k*2 + 4k*2 to the form hk + tk2 + f and give t. -1 Rearrange 480174v - 480169v - 7 - 203 to mv + y and give m. 5 Rearrange -1 - 682x - 105x + 1 + (-2x - 4x + 10x)(1 + 1 + 0) to dx + b and give d. -779 Express ((1 + 0 - 2)(-4x - x + 3x) - x - 2x + 2x)(142x - 142x + 65x*2 - 1132x*2) as g + vx + qx2 + yx*3 and give g. 0 Rearrange 76n*3 - 24n4 + n4 + 3n - 77n*3 to an + hn4 + q + fn*2 + wn*3 and give f. 0 Express 24s*2 - 20s*2 - 3s2 - s3 + 9 as as + is*2 + d + cs*3 and give c. -1 Rearrange 2p + 101 - 5p2 - 101 - 40p3 + p2 + 39p3 + 17p*4 to the form ip*2 + jp*4 + qp + z + xp3 and give x. -1 Express (-10 - 14 + 8)(-2b - 8 + 8) as tb + l and give t. 32 Rearrange 3 - 3 + 2s + (4 + 3 - 3)(-4s + 0s + 5s)(3 + 14 - 6) to the form o + zs and give z. 46 Express -5101s*2 + 5102s*2 + 55s - 1 - 2 - 5s in the form ps*2 + g + ns and give p. 1 Express (3 - 2 - 3)(0 - 6 + 4)(-19f + 95f + 59f)(-3 + 3 - 1)(0f - 3f + f) in the form kf*2 + pf + r and give k. 1080 Express -2s + 34s*2 - 3 + 28s*2 + 35s*2 - 136s*2 + 33s*2 as fs*2 + ws + a and give a. -3 Express (-45o + 49o + 72o)(19o - 16o + 2 + 4) in the form j + ho + wo*2 and give h. 456 Express -250f - 332f + 644f - 262f - 3 in the form h + vf and give h. -3 Express 25 - 57k + 17 + 55k - 12 as ik + u and give u. 30 Rearrange -271f*2 - 5 - 4f*3 + 0f*2 + 2f*3 - 502f*2 + 3 to the form p + of + if2 + sf*3 and give i. -773 Express -9h*2 - 11h*2 + 33h*2 + 4h - 16h2 in the form qh*2 + i + nh and give q. -3 Rearrange -251u3 + 257 - 276 + 4u + 240u3 - 2u*2 + 2u*2 to the form r + gu + pu2 + nu*3 and give n. -11 Express -1 + 4a*2 - 2a4 + a2 + a - 7a2 + 3a*3 in the form ia + p + fa2 + sa*3 + ma*4 and give f. -2 Express -345w*4 - 2w3 - w2 + 4w3 + 346w*4 + 0w - 2w + 2 in the form zw*3 + t + nw + hw2 + gw*4 and give g. 1 Express 9 - 5 + 1 - 500b + 2b2 + 1 - 7 as db + rb2 + g and give g. -1 Rearrange -47p2 - 40 + 40 + (-p2 - 2p2 + 4p*2)(-2 + 1 - 2)(-2 - 3 + 4) to the form zp*2 + l + sp and give z. -44 Express -46p + 2 + 3p + 4p - 78p + 0 as gp + r and give g. -117 Rearrange 8t - 20t2 - 16t*2 + 9t + 48t2 to nt + o + ut2 and give n. 17 Rearrange -6 + j3 + 15j*2 + 10 - 6 - 3j*3 to the form sj*2 + i + oj*3 + pj and give o. -2 Express -6 - 2y - 3y*3 + 10y*3 - 10y*2 + 4 - 2y*4 - 7y*3 as b + ay + qy2 + ty*4 + ny*3 and give a. -2 Rearrange 875 + 34r - 167r - 876 to ar + j and give j. -1 Express 164c - 61c*3 - 164c - c*3 - 6c3 - c3 + (-2c - 2c + 3c)(4c2 - c2 + 0c*2) as l + wc + xc2 + bc3 and give b. -72 Express -b3 + 14b2 - 5b*2 + 0b*3 - 7b*2 - 5b*2 + 24b as ib2 + g + rb*3 + yb and give y. 24 Rearrange (-2t + 3 - 3)(0 + 5 - 2)(-21 + 24 + 28 + (-1 - 3 + 8)(1 + 2 - 4)) to b + yt and give y. -162 Express -2 + l3 + l - 11l - 36l - 63l as i + cl2 + dl + ol3 and give c. 0 Rearrange (11a*2 + 0a*2 + 8a*2)(46a + 8a - 13a) to xa + q + ma3 + na*2 and give m. 779 Rearrange -5 - 3s - 9 + 4 + 8 + 3s3 - 9s*	{ "pile_set_name": "DM Mathematics" }
ate the remainder when 21 is divided by f(-5). 10 Suppose 0n + 72 = 6n. Calculate the remainder when 23 is divided by n. 11 Suppose -i = -3u - 23, 10i = 5i - 5u + 155. Calculate the remainder when i is divided by 15. 14 Let y = -22 + 10. Suppose c + 2h - 1 = 5, -40 = 5c - 4h. What is the remainder when (y/8)/(2/c) is divided by 1? 0 Let i = -44 + 77. Suppose -172 = -4m - 2v, 3v - i = -m - 0v. What is the remainder when m is divided by 23? 22 Let a(u) = -u2 - 23u - 30. Let h = -84 - -164. Let r = -46 + h. Calculate the remainder when r is divided by a(-21). 10 Let k(b) = -b*2 + b - 4. Let o be k(-3). Let y = o + 20. Calculate the remainder when 6 is divided by y. 2 Suppose 0 = 7n - 659 - 132. What is the remainder when n is divided by 39? 35 Suppose -3q = -5q + 24. Calculate the remainder when 23 is divided by q. 11 Let s be (22/8)/(2/(-8)). Let j = s + 10. What is the remainder when (3 - j) + 10 + -10 is divided by 2? 0 Let r(p) = p - 3. Let x be r(9). Let n = x - -1. Suppose -3h + 7 = -47. Calculate the remainder when h is divided by n. 4 Let v be 2 - 0 - (15 - 7). Let i = v - -8. Let b(z) = z3 + 3z*2. What is the remainder when b(-2) is divided by i? 0 Suppose -2p = -3 - 1. Suppose 5c - 4s - 66 = 0, -c - ps = -3c + 28. What is the remainder when 20 is divided by c(-2)/(-4) - -2? 6 Let s(d) = 8d*2 - 4d + 3. Suppose -2a - 18 = -u, -5u + a + 55 + 17 = 0. Calculate the remainder when s(2) is divided by u. 13 Let k(a) = 11a + 3. Calculate the remainder when 46 is divided by k(1). 4 Let o be 45/64/6. Let c(t) be the second derivative of t3/6 - t2/2 - 4t. Calculate the remainder when 7 is divided by c(o). 3 Suppose 3y = 3c - 18, c - 4y - 18 = y. What is the remainder when c is divided by 3? 0 Suppose 2z = 43 - 1. Suppose 4d - 4y - 332 = 0, -6d + 249 = -3d - 2y. Calculate the remainder when d is divided by z. 20 Suppose -2v + 5 = 3r, -35 + 12 = -2v + 3r. Calculate the remainder when 18 is divided by v. 4 Suppose 4l + i + 0 = 11, 4 = -4l - 4i. Suppose -lj = -3j - 11. What is the remainder when 30 is divided by j? 8 Suppose -5f + 87 = -3n, 2f - n = -0n + 34. Let j(z) = 22z. Calculate the remainder when j(2) is divided by f. 14 Let f = 287 + -157. What is the remainder when f is divided by 33? 31 What is the remainder when 4 is divided by (9/(-9))/((-2)/6)? 1 Suppose 5g + 40 = 10g. Calculate the remainder when 8/20 - (-113)/5 is divided by g. 7 Suppose -z = -3b + 77, -31 = b - 2b - z. Calculate the remainder when b is divided by 15. 12 Suppose -3i = q - 16 - 7, 5q - 97 = 3i. Calculate the remainder when 78 is divided by q. 18 Suppose 0 = 3l + 2l - 25. Suppose 0r + 5 = lr. What is the remainder when 102/4 - r/2 is divided by 9? 7 Suppose -5m + 19 = i, -104 = -3i - m - 33. Calculate the remainder when 77 is divided by i. 5 Let d = -41 + 71. What is the remainder when d is divided by 19? 11 Let m(i) = i2 + 8i - 1. Let u be m(-5). Calculate the remainder when (8/u)/((-2)/76) is divided by 10. 9 Suppose 45l - 41l - 84 = 0. Suppose 3q - 4c = 5q - 12, 4q - 51 = c. Calculate the remainder when l is divided by q. 9 Let c(a) = a + 4. Let l be c(-3). Let y be (l + 74/4)2. What is the remainder when (-2)/(-1 + 33/y) is divided by 7? 6 Suppose 5c + 39 = l, -5l + l + 102 = -2c. Calculate the remainder when (-47)/(0 + -1) + -1 is divided by l. 22 Suppose 0f - 35 = -5f. What is the remainder when 18 is divided by f? 4 Suppose -5q + 31 = -29. Calculate the remainder when q is divided by 6. 0 Let b be 0/(-5 + 2) + -117. Calculate the remainder when b/(-5) + (-21)/(-35) is divided by 13. 11 Let d = 70 - 49. Suppose 2o = 23 + d. Calculate the remainder when o is divided by 3/(-9) - 25/(-3). 6 Suppose -4o + 0o - 60 = 0. Let l = o + 33. Suppose 2j + 44 = 3m, 2m = m - j + l. What is the remainder when 46 is divided by m? 14 Let o = -80 - -91. Let q(i) = i3 + 6i*2 - 2i + 7. What is the remainder when q(-6) is divided by o? 8 Let q(l) be the second derivative of 1/6l3 - 4l + l*2 + 0. Calculate the remainder when 14 is divided by q(3). 4 Let a be 5 + 2/(3 - 5). Suppose -3l + al = 16. Calculate the remainder when 31 is divided by l. 15 What is the remainder when 18 is divided by 4/(-22) + (-92)/(-22)? 2 Let a be (40/(-6))/((-8)/(-48)). Let t = -22 - a. What is the remainder when t is divided by 8 - ((4 - 2) + -1)? 4 Suppose 2k = -3b - 7, -b - 4k + 6 = -5k. What is the remainder when 17 is divided by 0 - ((b - 10) + 0)? 8 Suppose -35 = -5t - a, -3a - 11 = -5t + 4. Suppose -3r + t = 3. What is the remainder when 1 is divided by r? 0 Let c(h) = 10h*2 + 1. Suppose f - 6f + 2x + 444 = 0, -x + 438 = 5f. What is the remainder when c(-1) is divided by 600/f - (-4)/22? 4 Let q = 120 + -94. Calculate the remainder when 47 is divided by q. 21 Suppose 2k - 37 = 3v, 5v + 105 = -0k + 5k. Calculate the remainder when k is divided by 3. 2 Suppose -1 = -o + 14. Calculate the remainder when 44 is divided by o. 14 Let z(i) = -i3 - 8i*2 - 7i + 6. Calculate the remainder when 2 + (-165)/(-12) + 6/24 is divided by z(-7). 4 Let n(s) = 13s3 + 17s*2 + 8s. Let b(f) = -3f3 - 4f*2 - 2f. Let l(a) = 9b(a) + 2n(a). What is the remainder when 28 is divided by l(-3)? 13 Suppose -5z + 5o + 95 = 0, 20 = -5z + 2o + 106. Let b = -3 + 3. Suppose b = -3w - 2w + 30. Calculate the remainder when z is divided by w. 4 Let k = -96 - -324. What is the remainder when k is divided by 23? 21 Let v be 0 + 2/((-4)/2). Let l = 2 - v. Suppose -2q + 35 = lq. What is the remainder when q is divided by 3? 1 Let a be (4/6)/(1/6). Suppose ar - 90 = -5c, 4r - 6c + c - 70 = 0. Calculate the remainder when 38 is divided by r. 18 Let r be (-22)/(-10) + 1/(-5). Suppose 0 = 2u - 6 - r. Let h(q) = q2 - 9q + 6. Calculate the remainder when h(9) is divided by u. 2 Suppose -5k - 49 = -3b, -24 = 4b + 2k - 124. Let p = 28 + b. What is the remainder when p is divided by 13? 12 Suppose 5g - 1 = 9. Let m = 2 - 4. Calculate the remainder when g is divided by -6((-5)/(-3) + m). 0 Suppose 0c - 3i + 53 = c, -5i = c - 45. What is the remainder when c is divided by 17? 14 Let w(u) = u3 - 9u*2 + u - 4. Let h be w(9). Suppose k + 1 = h, 0 = -4z + 4k + 24. Calculate the remainder when z is divided by 4. 2 Let p(n) = n2 - 3n - 6. What is the remainder when 14 is divided by p(5)? 2 Let i(k) = k*2 - 4k + 28. Calculate the remainder when i(16) is divided by 32. 28 Let v(z) = -3 - 6z - 5 - z2 + 5. What is the remainder when 16 is divided by v(-3)? 4 Suppose z + z - 14 = 0. Suppose 18 = -2u + 3u. Let p = u + 2. Calculate the remainder when p is divided by z. 6 Suppose 4p - 3w + 1 = -2w, -5p - 5w = -5. Suppose b + b - 50 = p. Suppose 4f + 4 = 56. What is the remainder when b is divided by f? 12 Suppose 4z - 14 = 18. Let q = 26 + z. Suppose -3k - q = -5k. Calculate the remainder when k is divided by 9. 8 Calculate the remainder when 56 is divided by (-6308)/(-209) - (-2)/(-11). 26 Suppose 5i = 6i - 19. Calculate the remainder when i is divided by 5. 4 Let f(w) = -w*3 - 6w*2 - 5w + 5. Let t = 102 + -95. Calculate the remainder when t is divided by f(-5). 2 Suppose 4s - 189 = -17. Suppose -h + 2 + 3 = 0. Suppose -22 = hq - 6q. Calculate the remainder when s is divided by q. 21 Let u(t) = 2t*2 - 4t - 1. Let h be u(3). Suppose -7 - h = -r. What is the remainder when 46 is divided by r? 10 Let b be ((-4)/(-6))/((-3)/(-9)). Let g = -2 + 5. Suppose x - o = -bo - 2, 4x + 4 = -go. Calculate the remainder when x is divided by 1. 0 Suppose -3q + 16 = -q. What is the remainder when 15 is divided by q? 7 Calculate the remainder when 0 - 4/((-4)/27) is divided by 8. 3 Let k = -3 + 13. Let l = k + -4. Let j(m) = -m*2 + 8m - 4. Calculate the remainder when 22 is divided by j(l). 6 Let k(s) = s*3 + 11s*2 + 9. Let x = 141 - 46. Suppose -5d = -3n + x, -2n - 2d - 33 = -3n. Calculate the remainder when n is divided by k(-11). 7 Let u = -150 + 212. Calculate the remainder when u is divided by 16. 14 Suppose 0w = -w + 37. Let o = 1 - -2. Suppose 3b - 31 = -3d - b, -ob - 32 = -2d. What is the remainder when w is divided by d? 11 Let z(v) = -12v*3 - 2v**2	{ "pile_set_name": "DM Mathematics" }
i = -ai for i. 0 Let w(k) = -3k*2 + 5k + 3k2 - 3k + 7k2 + 3. Let i be w(-2). Suppose 0 = 3y - 3 - i. Solve -2z - y = -0 for z. -5 Suppose 0 = 7f - 67 - 283. Let b = 52 - f. Solve 5g - 4g = b for g. 2 Suppose z + 2u + 3 = 0, -z - 5u = -6 + 18. Let a be -6(-1 + -1) + z. Solve p - a = -4p for p. 3 Let g(r) = 2r3 - 75r*2 + 35r + 82. Let l be g(37). Solve 3z + lz = -22 for z. -2 Let w(u) = -10 + 3 + 3 - 4u. Let h be w(-1). Solve h = -0r - 5r for r. 0 Suppose -4v = -v - 6. Suppose 2g + o = 3, 3o = -vg + 6g - 21. Suppose a - 2a - 9 = -gs, a = 5s - 15. Solve a = -3l + 2 + 4 for l. 2 Let c(j) = 3j2 - 181j - 120. Let a be c(61). Solve a = 3d + 11 for d. -3 Let m(h) = -h3 - 2h*2 + 1. Let s be m(1). Suppose 485o + 36 = 487o. Let d be (s - 3)o/(-30). Solve d = k - 0k for k. 3 Suppose 0 = 31f - 9f - 110. Solve 0 = fa - 0a for a. 0 Suppose -8r - 1 = -25. Suppose -6k = -9 - r. Suppose -kt + 8t = 0. Solve s - 1 + 2 = t for s. -1 Let u be -2 - ((0 - 3) + (-2 - 35)). Let l = 42 - u. Suppose 0 = -p - 2p + 6. Solve 6 = -pi - l for i. -5 Let x = 2 - -13. Suppose 0 = 3n - s + 3s - 20, -5n = 3s - 34. Suppose -4k + i = -2, 2i + 2i = 5k - n. Solve kv = -5v - x for v. -3 Let u(f) = 7f - 61. Let t be u(9). Suppose -4a + 11 = -1. Let q = -3 + a. Solve q = b - 1 - t for b. 3 Let r be (6/8)/(2/16). Let u be ((-93)/(-15))/((-1)/(-5)). Let f = u - r. Solve 2t - f = -3t for t. 5 Let f(l) = -l2 + 14l - 3. Let h be f(11). Solve -24c = -18c - h for c. 5 Suppose 4l = 2l + 4. Suppose lz - 2u = 3u - 1, 5u - 36 = -3z. Let j(o) = o2 - 7o. Let p be j(z). Solve p = 3n - 2n - 5 for n. 5 Let g = 15 - 12. Let v(x) = 6x. Let r be v(-1). Let q = r + 10. Solve -g = -qh - 19 for h. -4 Let h(k) = 3k. Let y be h(1). Suppose 0 = yu - 10 - 8. Solve -3i + ui = 3 for i. 1 Let f(k) = k*3 - 15k*2 - 13k - 43. Let a be f(16). Solve at + 37 = 17 for t. -4 Let s = 11 + -3. Suppose s - 28 = 2x. Let c be x/45 + (-58)/(-18). Solve -6 = -w - c for w. 3 Suppose 0 = 8j - 81 - 39. Solve 0r + j = 5r for r. 3 Let w be (1 - 25)84/(-24). Suppose 4r - 3a - 47 = 0, 0a = 3r + a - w. Solve -5f + 36 = r for f. 5 Suppose -4v - s - 47 = 0, 3v + 17 = 2v - 2s. Let m be (-44)/v1/4. Solve -1 = 2k + m for k. -1 Suppose -4p = x - 30, 2x - 86 = -2x + p. Solve -xr - 6 = -24r for r. 3 Let g = -55 - -55. Solve -9q - 36 + 27 = g for q. -1 Let m(o) = o*2 + 2o - 2. Let j be m(2). Let i(d) = -1 - 25d2 - jd + 1 + 24d2. Let l be i(-5). Solve 5 = -2v - l for v. -5 Let a = -2 + 6. Suppose ao - o = 0. Suppose 15 = 3k + r, -k = 5r - o - 5. Solve 0 = kn - 0n - 25 for n. 5 Suppose n - 99 = -17. Suppose n - 2 = 10g. Solve 4s + g = 8s for s. 2 Suppose -31t = 10t. Solve t = 6s - 0 - 6 for s. 1 Let u be (-9)/15 + (-36)/(-10). Let s(c) = -c2 - 3c + 2. Let r be s(u). Let b be 2 - r/(-4) - -2. Solve -1 = -bi - i for i. 1 Suppose -4p = -5 - 11. Suppose 5g = -r + 4g, p = -2r - 4g. Solve -ra = 3a - 25 for a. 5 Let d(p) = 2p2 + 6p - 36. Let t be d(-6). Solve a - 1 - 1 = t for a. 2 Let q = -8 + 11. Let d be 8/4 + -4 - (-6)/q. Solve dk - 5 = -k for k. 5 Let p(t) = t2 - 6t + 5. Let h be p(5). Let z be (14/(-1))/((-5)/((-40)/(-16))). Solve 10w - zw = h for w. 0 Suppose -r + 10 = u, 3r - 24 - 10 = -4u. Solve 0 = -13g + 19g - r for g. 1 Suppose d = -2d + 9. Suppose 0 = -3x + 6, -5x = dl - 0l - 16. Suppose 4u - 2u = 6. Solve -5 = -uz - lz for z. 1 Let s = 29 - 25. Suppose -4 = g + 5p - 1, 5g = sp + 14. Solve gy - 6y = 20 for y. -5 Let g = -932 + 939. Solve -g + 22 = 5j for j. 3 Let f(y) = y2 - y + 4. Let p be f(2). Suppose -5a = -3c, -3c + 2a = pa. Let o(u) = -u + 7. Let i be o(c). Solve 5d + 3 = -i for d. -2 Let t = 9 - 4. Suppose 3n + 3l = 15, 0 = -3l + 5l + 4. Solve -n = 4c + t for c. -3 Suppose 5n - 81 = 3g, 2n + 130 = -4g - 4. Let x = g - -34. Solve -xu + 15 = -7u for u. -3 Let g(x) = -x*3 + 50x*2 + 50x + 70. Let f be g(51). Solve 11 = -6t - f for t. -5 Suppose t = -x, -4x = -t + 2t - 6. Let s = -11 - -18. Let f = s - x. Solve -5q + f = 20 for q. -3 Let n(q) = 2q3 - 11q*2 - 3q + 10. Let f be n(4). Let b = 55 + f. Solve -5c - 5 - b = 0 for c. -2 Suppose 72c - 76c = -12. Solve 4q = q + c for q. 1 Suppose -4x = 9b - 6b - 43, 1 = x + 4b. Solve -4u + x = 9 for u. 1 Let p be 4/8 - (65/(-10) - -5). Solve -7a = -pa - 5 for a. 1 Suppose 0 = -5t + b - 18, 3t + b - 6 = 4t. Let a be (t/6)/(1/(-14)). Solve 3 - a = 4r for r. -1 Suppose -28 = -5c - 8. Suppose -r = -cr. Solve r = t + 2 for t. -2 Let j be -8(0 - 2)/(-4). Let a = 237 - 227. Let y be -3 + (a - (-16)/j). Solve 2f + y = f for f. -3 Suppose -c + 9 = 3t, 0 = -t + 2t - 5c - 19. Suppose -ts + 22 = 5a, -s - 2a = -6 - 1. Let u(p) = -18p + 108. Let f be u(6). Solve sn + f = 9 for n. 3 Suppose 3l - 17 = -4n, 0 = 4l - 5n + 5 - 7. Solve -2v = -1 - l for v. 2 Let r(b) = -b*2 + 10b - 23. Let o be r(7). Let m be ((-90)/(-12) + -5)/((-1)/o). Solve -17 = 3z - m for z. -4 Let a = -185 - -243. Solve -10w - 8 = -a for w. 5 Let h = -46 - -23. Let t = h - -35. Solve 0r - t = -4r for r. 3 Suppose g = -g + 4. Suppose 3o = 0, -p - go = 2p - 150. Let x be p/12 + (-2)/12. Solve -xj = -0 + 20 for j. -5 Let y(b) = 4b + 16. Let x be y(0). Solve -18 = -r - x for r. 2 Let j = -554 + 565. Solve 0 = -7s + j - 32 for s. -3 Let h(n) = 2n2 + 5n + 5. Let p be h(0). Solve -pw + 2w = 9 for w. -3 Let x = -365 + 368. Solve -x - 21 = 8n for n. -3 Let g be 1-3 + (-19)/((-57)/18). Suppose 0f - 5j + 20 = 4f, -3j = f - 12. Solve f + 3 = gc for c. 1 Let o = 51 + -48. Suppose 5w + 13 = 8a - 4a, 3a - 9 = ow. Solve 0 = -y - ay - 3 for y. -1 Let r = -49 + 55. Solve -122b + 120b = -r for b. 3 Suppose 0u = 3u - 6. Let b(q) = q + 14. Let s be b(12). Suppose 0 = -5h - 3j + s, 0h = 4h + j - 18. Solve -hw = -uw for w. 0 Let r(i) = i3 + 7i*2 + 5i - 2. Let v be r(-6). Solve 0n = vn - 8 for n. 2 Suppose -155 = 5l - 3j, 3l + 22 + 71 = 4j. Let i = 46 + l. Solve 1 = 4c - i for c. 4 Suppose -2p - 5 + 13 = 0. Suppose 0 = pf + f. Let o be (21 - f)/3 + -2. Solve -s = -os for s. 0 Suppose -4w + 5n = -15, 10w - 5w - n = 24. Let c = -2 + w. Solve -6 = -5j + cj for j. 3 Let m(n) = n*3 + 10n*2 + 1. Let r be m(-10). Let c = 19 + r. Let w(h) = h + 10. Let y be w(-7). Solve 8p - yp - c = 0 for p. 4 Let b = 2 - -3. Let a be (-1)/(-3)(0 - 0). Suppose 2q + 4d - 7 = 13, a = -4q + 4d - 20. Solve -bp = -qp for p. 0 Suppose -21p + 5i = -16p - 25, -2p + 4i = -16. Solve -3 = -pj + j for j. 3 Let i(q) = q*3 - 4q*2 + q + 4. Let n be i(0). Solve -n = -2a - 12 for a. -4 Let o(k) = k*2 + 16k + 7. Let a be o(-19). Let t be ((-3)/(-4))/(41/a). Solve 3l + t = 7l for l. 3 Let h(a) = 2a*2 + a + 6. Let b be h(4). Let i = -40 + b. Solve ix - 6x = -20 for x. 5 Let m = -194 + 195. Solve -3v - m = 2 for v. -1 Let a(f) = 0 - 16f - 4f*2 + 3 - 1 + 2f*2. Let j be a(-8). Suppose -3p - 45 = -3c, c = -0c + jp + 15. Solve 2y + 3y - c = 0 for y. 3 Suppose 3u = 6, u - 148 = 3w + 2u. Let z be w/(-4) + (-6)/12. Let i(t) = -t*2 + 13t - 12. Let h be i(z). Solve h = -m - 4m + 15 for m. 3 Suppose 0 = 5t - 5. Let r be -1(-68)/(-4)t. Let h = r + 18. Solve 2c = 1 + h for c. 1 Suppose -22 = 4j + 2t, 2t - 16 = 5j + 16. Let n be 0/2(j + 5). Solve 4r = -n + 4 for r. 1 Let x(b) = b3 + 5b*2 - b - 3. Let y = -13 - -8. Let v be x(y). Solve 2u = v - 10 for u. -4 Let i = 16 - 14. Suppose 3j + j - ij = 0. Solve j = 3h - 0h for h. 0 Suppose 0 = 14f - 9f. Suppose f = -6x - 6x + 60. Solve -4p = -xp - 1 for p. -1 Suppose -3w + 5w - 8 = 0. Suppose wa = -5p + 3a + 20, 4a - 20 = -5p. Solve u - p + 8 = 0 for u. -4 Let l(x) = -x2 - 13x - 30. Let p be ((-12)/(-30))/((-2)/50). Let o be l(p). Solve -u + 4u - 3 = o for u. 1 Suppose 0j + 13 = -3j + r, 5j + r + 19 = 0. Let o be 3 + (1 - j/(-1)). Suppose b - 2 = -o. Solve 10 = -4n + b for n. -2 Let b = -146 - -154. Solve bh + 25 = 3h for h. -5 Let z be (120/5)/(-4) - (-8 - 6). Suppose 4y = 2y + 2. Solve y = 3o - z for o. 3 Suppose -3q + 9 = -v, 2q + 5v - 35 = -12. Solve -i = qi + 20 for i.	{ "pile_set_name": "DM Mathematics" }
444111 Do -298 and -23911/3 have the same value? False Is -114879891 smaller than -114879890? True Is 0 equal to 1.31140471? False Is -2406576 at least -26472332/11? False Which is bigger: 68 or -148795? 68 Is 158 smaller than 162750/1033? False Which is bigger: 9 or 68111/6948? 68111/6948 Is -52766 not equal to -67617? True Which is smaller: -274988672 or -274988670? -274988672 Which is greater: 73097672 or 73097663? 73097672 Which is smaller: 169042 or -561? -561 Is 1 at least 2/39845831? True Which is smaller: -1513 or -3649? -3649 Which is bigger: -88585 or -89218? -88585 Which is smaller: 13883 or -9773/5? -9773/5 Which is smaller: 0.29336 or 99/5? 0.29336 Is 53/16970061 at most 0? False Which is bigger: 1.7244 or -686? 1.7244 Is 3.341294 less than -7? False Is -21365557 at least as big as 0.1? False Is -1681214/151 less than or equal to -11135? False Is 1 != 12/82271801? True Is -159/165853 <= 1? True Which is greater: -29 or 1.8104999? 1.8104999 Is -47046274 > -47046270? False Which is smaller: -1 or 9071/67185? -1 Which is smaller: 229349/12 or 19113? 229349/12 Is 241628699 less than 241628698? False Do -372603 and -372597 have the same value? False Is 252883489 greater than or equal to 252883487? True Which is smaller: -116577765 or -1? -116577765 Is -33062 at least as big as -33138? True Which is bigger: -1229365 or -1229355? -1229355 Is -134996 at most 1/9? True Is 55270015 <= 3? False Do 2 and 2/5521937 have the same value? False Is 43359 at most 38206? False Is 4584164 at least 4584166? False Is 3357130 at most as big as 3357129? False Which is bigger: -185697 or -129? -129 Is 0 less than or equal to 133/11588315? True Which is smaller: 78836.3 or 92? 92 Which is bigger: -536/167647 or -1? -536/167647 Which is smaller: -7075/19661 or 0? -7075/19661 Which is smaller: 5063 or -7981? -7981 Which is smaller: 60118 or 2/17? 2/17 Is 947 <= -4/25031? False Which is bigger: 754441 or 754499? 754499 Which is bigger: 48/2161093 or 0? 48/2161093 Which is smaller: -34192 or -29207? -34192 Is 0 less than or equal to -8/105370301? False Which is smaller: 0.119775107 or 1? 0.119775107 Which is smaller: -124864 or -5369185/43? -5369185/43 Is 4209831/35 != 120281? True Which is smaller: 5638285 or 4.2? 4.2 Which is smaller: -7887952 or -7887951? -7887952 Are 89377 and 89387 unequal? True Which is smaller: 43712 or 43274? 43274 Which is greater: 958950 or 958897? 958950 Is -1/111985475 at least -0.1? True Which is smaller: -3614170 or -39755856/11? -3614170 Which is greater: -10073013 or -10073012? -10073012 Which is greater: 1 or 2442/24821? 1 Which is bigger: 96552 or 96155? 96552 Is 0.1518158 less than or equal to 0.6? True Which is smaller: -2/7 or 137572014? -2/7 Which is greater: -4362596 or -4362429? -4362429 Which is greater: -21 or -117646? -21 Which is smaller: -51474306 or -51474310? -51474310 Is 0.1080872 != -6? True Is 1965 >= -53324? True Is -11111 >= -47832? True Which is bigger: -7 or -18142/2829? -18142/2829 Do -111376.38 and -10 have different values? True Which is greater: -460887 or 122? 122 Is -25141 greater than -24828? False Which is bigger: 0 or 1/17799511? 1/17799511 Is -810139 != -1/6? True Is 0.28 < -0.45822? False Is -49593477 at most -49593490? False Which is smaller: -1030 or 22/1619? -1030 Are 1453 and 656583/452 unequal? True Is -0.94 at most as big as -0.185183? True Which is greater: 19882307 or 2/5? 19882307 Which is bigger: -7321915 or -7321914? -7321914 Is -1.1055 greater than or equal to 20/7? False Is 3508/15 != 27766? True Do 14240122 and 14240113 have the same value? False Is 6966575/2 < 3483289? True Is 1193.034 smaller than -0.4? False Which is smaller: 20.96246 or 2/443? 2/443 Which is bigger: 30437407/149 or 204277? 30437407/149 Which is bigger: -8343519 or -8343512? -8343512 Is -10503381/59 < -178023? True Do -2618 and 4123 have the same value? False Which is greater: -22/2373 or 0.04? 0.04 Is -3241454 > 0? False Are 0 and 2/81192055 equal? False Which is smaller: -1337890 or -1337892? -1337892 Is -971872 >= -971852? False Is 93662 greater than 93571? True Is 52121/1729 less than or equal to 30? False Is -341567 less than or equal to -109? True Is -278196904 less than -556393809/2? False Do -1/10396309 and 1 have different values? True Which is smaller: 2/85532909 or 0? 0 Is 25396 bigger than -219/2? True Which is greater: 1 or -4/443200731? 1 Which is smaller: -3827120 or 6.8? -3827120 Which is bigger: 2 or -76223412? 2 Which is smaller: 1/19686433 or 0? 0 Are -752531307 and -752531309 unequal? True Which is smaller: 35888959 or 35888955? 35888955 Which is smaller: -41 or 135248.6? -41 Which is smaller: 0 or 1935/18572? 0 Which is smaller: 42917 or 43275? 42917 Which is greater: -14/88038071 or 0? 0 Which is smaller: 170871 or 2904814/17? 170871 Which is smaller: 0 or 27/96509? 0 Which is greater: -182371/3777 or -47? -47 Is 205634336 bigger than 205634335? True Is 34676491 at least as big as 34676498? False Are -406218/1295 and -314 non-equal? True Is -1/1415603906 at most 0? True Is -1 != 4559/76688? True Which is smaller: 2 or -0.19717582? -0.19717582 Which is smaller: -356667 or -356690? -356690 Which is greater: -0.068 or 3418564? 3418564 Is 7108 greater than or equal to 4968? True Is -2201509 bigger than -2201506? False Which is smaller: -0.03 or -3.6486? -3.6486 Is 910/410503 <= 0? False Is 57858192 at most as big as 57858191? False Which is bigger: 0.2 or 89728102? 89728102 Which is greater: 4179301 or 4179359? 4179359 Which is smaller: 6131489/12 or 510958? 6131489/12 Which is smaller: -66 or 0.05255298? -66 Which is smaller: 1 or -584/506531? -584/506531 Which is smaller: -1 or -8/108831261? -1 Is -2415886/13 < -185838? False Is -1/105333301 >= 1? False Do 9267763 and 9267759 have different values? True Is 3/584872817 >= -1? True Which is bigger: -1 or -1/4257072? -1/4257072 Which is smaller: 3 or -2060733? -2060733 Which is smaller: 5179042/25 or 207161? 207161 Which is bigger: 5050 or 540235/107? 5050 Which is bigger: -69772 or 20? 20 Is 21/185737931 smaller than -1? False Which is bigger: -361970747 or -361970748? -361970747 Which is smaller: 0 or 1710/16121? 0 Is 1 equal to -189/185296? False Are -523 and 6236/23 unequal? True Is 1 less than -2/39747913? False Is 82011 at most 82328? True Which is smaller: 4022/9761 or -1? -1 Which is smaller: -0.6688 or -0.182? -0.6688 Is -143904/41741 at least as big as -2? False Are -3397/1979 and -3 non-equal? True Does 75921/1787 = 41? False Which is greater: 0 or 4744/10197? 4744/10197 Which is smaller: -314/66515 or 0? -314/66515 Which is smaller: -119796 or -119633? -119796 Is 1255/7 greater than 902? False Is 16218036 at least as big as 16218035? True Is -171289351/2 smaller than -85644676? False Which is smaller: 434578/3 or -5? -5 Is 4 smaller than 15929046/29? True Which is greater: 0 or -2482/407095? 0 Which is smaller: -441732/41 or -10775? -10775 Which is smaller: 13376037/7 or 1910862? 1910862 Which is smaller: 1 or 1619/229392? 1619/229392 Do -1061140 and -1061129 have different values? True Which is greater: 2452724 or -1? 2452724 Which is smaller: 2/255 or -16321? -16321 Which is smaller: -3701803 or -3701812? -3701812 Which is bigger: 15781 or 0.245? 15781 Do 0.0514469009 and 0 have the same value? False Which is smaller: -10/26566861 or 1? -10/26566861 Is 1 at most as big as 88/33522675? False Which is bigger: -296922 or -297328? -296922 Which is greater: -5.58351 or 5? 5 Which is smaller: -1 or -419/62033? -1 Is 841415 smaller than 3? False Which is greater: 4128265 or 4128266? 4128266 Are -0.1 and 36931926/11 equal? False Is -406/72913 greater than -1? True Is -149 at least as big as -18136/121? True Is -624643 < -16240703/26? True Which is smaller: -278097 or -0.34? -278097 Is -689/12068 > 0? False Is -1449619 at most -1449603? True Is -1 greater than 269/3276068? False Is -16934 at most as big as -16955? False Which is smaller: -119584865 or -119584866? -119584866 Is 5.02787052 <= 0? False Is 39866 at least as big as 24.8? True Is -5132 at most 2714/11? True Which is smaller: 234794 or 234797? 234794 Is 0.13 less than or equal to -4056004? False Is 9672765 > 9672765? False Which is smaller: 363846 or -480? -480 Which is bigge	{ "pile_set_name": "DM Mathematics" }
65 - v. What is i rounded to three dps? -0.007 Let p = 140 + -141.116. Let b = 0.88 + p. Let l = b - -0.18. Round l to 2 dps. -0.06 Let m = -26100007118 - -26086189773.00037. Let z = 13817252 + m. Let g = z - -93. Round g to four dps. 0.0004 Suppose 85 = 15w - 5. Let r be (-111375)/(-66) + (3/w - 2). Round r to the nearest 10. 1690 Let v = 2692 - 2691.197. What is v rounded to 1 dp? 0.8 Let j = 41528.3 - 46063. What is j rounded to the nearest one thousand? -5000 Let u = 2561 + -2589. Let o = -18167 - -18138.99672. Let a = u - o. What is a rounded to 4 decimal places? 0.0033 Let t = -0.073529 + 0.6335031. Let f = t - 0.56. Round f to 5 decimal places. -0.00003 Let c = 134.89996749 - 134.9. Round c to 5 decimal places. -0.00003 Let c = 33 - 90. Let d = c + 55.49. Let l = 18.89 - d. Round l to zero dps. 20 Let y = 1827 + -1826.9999968155. Round y to 7 decimal places. 0.0000032 Let u = 0.014335 - 0.0166719. What is u rounded to 5 decimal places? -0.00234 Let m = 236 - 234. Suppose 3i - 7i + 12959996 = -2j, -mi = 5j - 6480010. What is i rounded to the nearest 1000000? 3000000 Let f(u) = -20u - 116. Let t be f(-5). Let p(y) = y - 293. Let d be p(t). What is d rounded to the nearest one hundred? -300 Let k = 0.0164 - 1.0664. Let j = k + 1.04999629. What is j rounded to 6 decimal places? -0.000004 Let k = 7740.08548 + -7739. Let r = k + -1.4175. Let m = -0.335 - r. Round m to 4 decimal places. -0.003 Let r be -26 + 46 + -15 - (76253 - 2). What is r rounded to the nearest one thousand? -76000 Let s = 1.4 - 3.1. Let w = s - -1.788. Let m = w + 6.212. Round m to zero dps. 6 Let r = -2221.19 + -266.41. What is r rounded to the nearest 100? -2500 Let k = -557 + 556.539. Let i = 0.179 + k. What is i rounded to two dps? -0.28 Suppose 29 + 594 = 7f. Suppose -fk = -85k - 11200000. Round k to the nearest 1000000. 3000000 Let i = 0.870132661702 - 204965.466136561702. Let a = 204973.096 + i. Let u = 8.5 - a. What is u rounded to 6 dps? 0.000004 Let r(g) = 490249g + 1335706g - 270392g + 67. Let i be r(-9). Round i to the nearest 1000000. -14000000 Let g = -0.056 - -0.056002215. What is g rounded to six decimal places? 0.000002 Let a = 13702 + -13702.000007857. What is a rounded to seven dps? -0.0000079 Let o = -20900.08 + 21412. What is o rounded to the nearest ten? 510 Let p = 965072763 + -965072644.00000243. Let z = -119 + p. What is z rounded to 7 dps? -0.0000024 Let j = -29863.00066425 - -29863. Round j to 5 decimal places. -0.00066 Let u(o) = o3 + o2 - 6o - 8. Let t be u(-2). Suppose t = -p + 49402 + 4498. What is p rounded to the nearest 1000? 54000 Let w = 94 + -170. Let x = 84 + w. Let m = 7.624 - x. What is m rounded to 1 decimal place? -0.4 Let m = 435.49697983 + -83.49697821. Let r = m - 352. Round r to six decimal places. 0.000002 Let t be ((-74787678)/22 + (-23)/253)1225/14. Round t to the nearest 1000000. -297000000 Let z = 158 + -158.62. Let r = z - -5.08. What is r rounded to one decimal place? 4.5 Suppose 5s - y + 47384 = 0, -4s - 37896 = -0y + 2y. What is s rounded to the nearest 1000? -9000 Let x(d) = 242753d + 12. Suppose 10z = 5z - 20. Let s be x(z). Round s to the nearest 10000. -970000 Let b = 0.0267 - 13.8267. Let g = b + 17.7. Round g to the nearest integer. 4 Let z be -4 + 0 + 2/((-8)/(-156)). Suppose -43a + za - 10724168 = 0. Let m be -640(a/260 + 4/(-10)). What is m rounded to the nearest 1000000? 3000000 Let k = 3.124 - 2.79. Let z = -0.333998267 + k. What is z rounded to 7 dps? 0.0000017 Let l = 311.867 + 0.133. Let r = 311.8842 - l. What is r rounded to 2 decimal places? -0.12 Let b = -4.163 + -1304.937. Round b to the nearest 100. -1300 Let o = -247.68 - -252. Let i = o - 4.319359. Round i to 5 dps. 0.00064 Let h = 415005.799952 + -414911.8. Let p = -94 + h. Round p to five dps. -0.00005 Let m = 2.483 + -0.083. Let r = -7.504925 + 5.1049. Let t = m + r. What is t rounded to six dps? -0.000025 Let u(q) = -3q + 3. Let g be u(-1). Suppose gt = 105 + 153. Suppose tr = 41r - 203400. What is r rounded to the nearest ten thousand? -100000 Let i = -0.1705 + 2.5705. Let y = 49.4 + -61. Let o = i + y. Round o to the nearest integer. -9 Let o = 138506 + -138506.84169. What is o rounded to 2 decimal places? -0.84 Let b = 123 + -113.86. Let x = 9.1401342 - b. What is x rounded to 5 dps? 0.00013 Let d(i) = i3 + 3i*2 - i - 3. Let v be d(-3). Let t be 3/(v + 2/4). Suppose tp + 8079 = -1821. What is p rounded to the nearest one hundred? -1700 Let r be -3 - (-5)/((-5)/(-24)). Suppose x + 18 = r. Suppose 0 = -3i + xn + 62399994, 0 = 2i + 4n + n - 41600010. Round i to the nearest one million. 21000000 Let a = -655.675 + 645. What is a rounded to zero dps? -11 Let c = -19981.9 + 19147. What is c rounded to the nearest 100? -800 Let s = 813.3 - 858.73. Round s to the nearest ten. -50 Let r = -22512135.86354676 + 22512146. Let b = 0.16355626 + r. Let c = -10.3 + b. What is c rounded to 6 decimal places? 0.00001 Let n = 32.0094 - 29.276. Round n to 2 decimal places. 2.73 Let f = -0.173 + 94.173. Let w = -315.8 - f. Let z = w + 457. What is z rounded to the nearest ten? 50 Let y = 298.999 - -7.451. Let h = y + -298. What is h rounded to zero decimal places? 8 Let u = -561 + 803. Let c be u/(3 + 1 - 2). Suppose -4z - 8g + 3g - 138 = 0, -5g = -3z - c. What is z rounded to the nearest 10? -40 Let n(s) = 22924s*2 - 163s - 637. Let y be n(-51). Round y to the nearest 1000000. 60000000 Let l = 105882.955937 - 105883. What is l rounded to 4 decimal places? -0.0441 Let r = -9.043 + 6.3. Let q = r - -3.43. Round q to 1 dp. 0.7 Let j = -944.92 - -943.72978. Round j to 1 dp. -1.2 Let g = -13.071 + 13.07099864786. What is g rounded to seven dps? -0.0000014 Suppose -13d - 826563 = 1042837. Round d to the nearest 10000. -140000 Let n = 0.0964 - 529.0964. Let b = n + 528.98145. Let l = -0.02 - b. Round l to three decimal places. -0.001 Suppose w = 11w. Suppose k + 15 - 53 = w. What is k rounded to the nearest 10? 40 Let w = 300770 - 300659.0587. Let s = -111 + w. Let f = s + 0.06476. Round f to 4 decimal places. 0.0061 Let g = -261.817 - -280.64. Round g to one dp. 18.8 Let h = 285 + -284.11. Let s = h - 0.8899984. Round s to five dps. 0 Let w = 5295.892 - 5305. Let q = 0.592 - w. What is q rounded to 0 decimal places? 10 Let j = -98.67 - -166.38. What is j rounded to the nearest integer? 68 Let n be 0-34/(-12). Suppose n = -5b + 5i + 56400010, -4i = -7 + 15. What is b rounded to the nearest one hundred thousand? 11300000 Let y be -3 - (0/(-6) + -2 + 1). Let d be 15/y(1/3 + -1). Suppose 4t + 1517064 = 3l - 1002930, dl = -t - 630010. What is t rounded to the nearest 100000? -600000 Suppose 26b + 453420133 = 22b - 2421019867. Round b to the nearest 1000000. -719000000 Let n = 0.0580097198 + -0.058015. What is n rounded to 7 decimal places? -0.0000053 Let i(t) = -5851t*2 - 8769t*2 + 20t + 268 - 794t2 - 332. Let r be i(22). What is r rounded to the nearest 1000000? -7000000 Let c = -19.018 - -19. Let z = 0.01 - c. Let n = -0.338 + z. Round n to 1 dp. -0.3 Let m = -0.97429 + 1.0326. What is m rounded to 2 dps? 0.06 Suppose 0 = 6h - 48h + 696480582. Let c = 30282871 - h. What is c rounded to the nearest 1000000? 14000000 Let v = -89259398 - -89259397.64099831. Let m = 0.859 - 0.5. Let i = v + m. Round i to seven dps. -0.0000017 Let d = -166737.7796912 + 166720.78. Let c = d + 17. What is c rounded to four dps? 0.0003 Let k = 10367622167443069028 + -10367622231713251166.99999643. Let y = k - -64270181817. Let z = 322 + y. Round z to six dps. 0.000004 Let t = 13424.11 - 13456. Round t to 0 decimal places. -32 Let o = -38678.09 + 38500. What is o rounded to the nearest 10? -180 Let z = -6957.1375 + 6972.2375663. Let h = z + -15.1. Round h to 6 decimal places. 0.000066 Let a(d) = 23d + 255. Let z be a(-11). Suppose 2548 = -2w - 4o - 107464, -2w + zo = 109994. What is w rounded to the nearest 10000? -60000 Suppose -28598185 = 61w + 16213391. Let g be ((-3201)/2)/((-6)/992). Let b = g + w. What is b rounded to the nearest 100000? -500000 Let m = 0.104 + 3710.896. Let w = 3742.87 - m. Round w to 0 dps. 32 Let u = 24 - 20. Suppose 4n - 24 = -u*n. Let c be -22199 - n/(1 + 2). Round c to the nearest 100	{ "pile_set_name": "DM Mathematics" }
t of ((-4)/v + -14)-2? 2 Let p(y) = -y - 3. Let q be p(3). Let i be (-67)/(-5) - q/(-15). Suppose -2g - 72 = -3n, n - 11 = -g + i. What is the tens digit of n? 2 Suppose -6j - 5 = -35. Suppose 3s + w - 81 = 0, -jw - 75 - 60 = -5s. What is the units digit of s? 7 Let q(s) = s + 4. Let n be q(0). Suppose x = 9 - 4, z = nx + 68. Suppose 0 = g - 2l - z, -3l = 7g - 2g - 388. What is the units digit of g? 0 Let l(q) = 12q - 3q + 1 + 2q. Suppose 9v = 6v + 3. What is the tens digit of l(v)? 1 Let z(j) be the first derivative of j2/2 + 14j - 16. Let s be -18-12/(-3). What is the units digit of z(s)? 2 Let i = -1422 - -4517. What is the hundreds digit of i? 0 Let t = 19 + -1. Suppose t = 5c - 32. Suppose 0 = -2y + c + 50. What is the units digit of y? 0 Let w = -11 - -28. Suppose -16g - 23 = -wg. What is the units digit of g? 3 Suppose 9 = -3d, -26b + 21b + 1536 = 3d. What is the units digit of b? 9 Let r = 88 - 133. Suppose 0 = 2x - 224 + 66. Let d = r + x. What is the tens digit of d? 3 Let t = -81 + 77. What is the units digit of t((-39)/15)/((-2)/(-35))? 2 Let u be -3 - (-1247 - 2/(-2)). Suppose 7t = 999 - u. What is the units digit of t? 8 Let i(w) = w*2 + 6w + 0w2 - 2w - 2w + 7. What is the units digit of i(-4)? 5 Let q(o) = -11o2 + o + 3. Let i be q(3). Let z = i + 196. What is the hundreds digit of z? 1 Let a(v) = v3 - 4v2 - 4v - 7. Let m be a(5). What is the units digit of (-5)/((-20)/104) + -1 + m? 3 Let z = -21 + 29. Suppose -zx = -4x - 20. Suppose 0 = -b + xb - 4. What is the units digit of b? 1 Let f(a) = -87a - 799. What is the hundreds digit of f(-54)? 8 Let w be 5 - (-2 + -2 + 4). Suppose 5 = a + 5g + 4, wg + 51 = a. What is the tens digit of a? 2 Suppose 5t + 11 = 4z - 489, 4t + 4z = -364. Let m = -46 - t. What is the tens digit of m? 5 Let v(l) = -l*3 - 2l*2 - 3l. Let w be v(-2). Let a be 4/w(-2 + 8). Suppose aj + 5z = 3j + 20, -2j - 2z + 24 = 0. What is the tens digit of j? 1 Let w = -10 + 23. Let i = 21 - w. Let z = i + 3. What is the tens digit of z? 1 Suppose -q - 4j = -222, 141 = 2q + j - 324. Suppose 2c = -66 + q. What is the units digit of c? 4 Let j(s) be the first derivative of -3s*2/2 + 3s - 6. Let r be j(2). Let d = r + 17. What is the tens digit of d? 1 Let p be ((-2)/4)/(6/(-144)). Suppose 3r = -t + 5t - p, -r = -5t + 26. Suppose t = -3s - 6, 64 = 4v - 3s. What is the tens digit of v? 1 Suppose -133 + 333 = 4w. What is the units digit of 4/3225/w? 6 Suppose 4f - 9f = -5r + 3490, 5r + 2f = 3469. What is the units digit of r? 5 Let p = 146 - -24. What is the units digit of p? 0 Suppose -4u - i + 12957 = 0, -2u - i + 6481 = 2i. What is the units digit of u? 9 Let w(o) = -5o3 + 8o2 - o - 47. What is the hundreds digit of w(-9)? 2 What is the units digit of (-6)/(-7) + (-7839)/(-91)? 7 Let n be 7/(-4) - 2/8. Let d = 28 + -24. Let i = n + d. What is the units digit of i? 2 Let i(s) = -s2 - 5s - 10. Let d be i(-4). Let r be (d/10 - -1)5. Suppose -rt = 2f - 20 - 14, -2f + 5t + 48 = 0. What is the units digit of f? 9 Let w = 2630 - 1473. What is the units digit of w? 7 Suppose -4o + 197w + 4699 = 192w, 5w + 2357 = 2o. What is the thousands digit of o? 1 Let j(p) = 7p*3 - 2p*2 - 2. Suppose -3o = 5m + 4, 0 = -7m + 6m - 2. What is the units digit of j(o)? 6 Let y be ((-1)/(-1))/((-3)/(-234)). Suppose z - y = -0z. Suppose -5u + z + 37 = 0. What is the units digit of u? 3 Suppose 2r + 581 = m, -r = 2 + 3. Suppose -4j - 5u = -709, 3u + 269 = 5j - m. What is the hundreds digit of j? 1 Let d(b) = 43b. Let c be d(-3). What is the tens digit of (c/(-6))/(4/8)? 4 Suppose 0 = 13u - 10u - 3639. Suppose -4w - 345 = -u. What is the units digit of w? 7 Let m be (-2)/(-7) - (-360)/63. Suppose q = -0 + m. Suppose qj + 46 = 226. What is the tens digit of j? 3 Let z(s) = s3 - 24s*2 - 26s + 9. Let g be z(25). Let i = 164 + g. What is the units digit of i? 8 Let o = -680 + 1071. What is the tens digit of o? 9 Let c be -2 - -2(-20)/(-8). Suppose 0 = -5h, -236 = -2x + h + ch. What is the hundreds digit of x? 1 Suppose 4o = -l + 3, l + 0l = o + 3. Suppose 1027 = -ls + 145. What is the tens digit of (3/(-9))/(2/s)? 4 Suppose -c + 20 = -20. Suppose h - c = -2q, 2q - h - 2h - 56 = 0. What is the units digit of q? 2 Suppose -1 = 5n - 21. Suppose -p + 45 = 5m + np, 2m - 2p = 2. Suppose -4g + 168 = 4c, 2c - 5c = mg - 136. What is the units digit of c? 7 Let f be (-31/(-6))/((-5)/(-1140)). Let b = -111 + f. What is the units digit of b? 3 Suppose 3k - 305 = -4m, -3k - 89 = -3m + 124. Suppose m = 4o - 210. What is the units digit of o? 1 Let q(i) = 7i2 - 3i + 1. Let u(p) = -2p + 9. Let d be u(3). Let l be q(d). What is the tens digit of (-11)/l + (-61)/(-5)? 1 Let s be 4 + -7 + (-1)/((-4)/2300). Suppose -10g - g + s = 0. What is the units digit of g? 2 Let g be 3/9 - (-166)/6. Suppose 3i = -i - g. Let o(f) = -2f + 9. What is the tens digit of o(i)? 2 Let g(d) = d - 2. Let r be g(0). Let k be (r - -4)1 - 7. Let o = k - -30. What is the units digit of o? 5 Suppose -5h = -410 - 380. What is the units digit of (0 + 2)/(478/h - 3)? 9 What is the tens digit of 20205/333 - 20/(-110)? 3 Suppose 21x - 10705 + 2368 = 0. What is the tens digit of x? 9 Let v(n) = -18n - 59. What is the hundreds digit of v(-14)? 1 Let p(c) = 2c*2 + 3c + 28. What is the tens digit of p(13)? 0 Let o(n) be the second derivative of 7n3/6 - 17n*2 - 16n. What is the units digit of o(5)? 1 Let t = -215 + 1297. What is the units digit of t? 2 What is the units digit of (2295)/(-10 + 12)? 5 Let p(c) = 4c - 9. Let i be p(6). Suppose -f = i + 16. Let s = 43 + f. What is the units digit of s? 2 Suppose -221v = -220v - 394. What is the units digit of v? 4 Let b be (-8)/(-1(-4)/6). Suppose 15 = -5r + 4h, -1 = r - 3h + 2. What is the tens digit of r/b - 369/(-12)? 3 Let j = 262 + 239. What is the hundreds digit of j? 5 Suppose 0 = -j + 215 + 170. What is the tens digit of j? 8 Let u = -78 + 124. Suppose -4h + 39 = -49. Let f = u - h. What is the tens digit of f? 2 Let w(m) = 17m*2 - 4m + 8. What is the hundreds digit of w(5)? 4 Let h = 222 + -37. Suppose z + 5u = h, 173 = 3z - 2z + u. What is the tens digit of z? 7 What is the units digit of (-8195)/(-3) - (-11)/(66/(-4))? 1 Suppose 0 = 2o + 4, 3j + 2o - 616 = 730. What is the units digit of j? 0 Let x = 6 - -26. Let w be -481(-1 - -3)/(-6). Let c = x - w. What is the tens digit of c? 1 Suppose m = -8d + 64, 14m = 9m + 2d + 446. What is the tens digit of m? 8 Let c(o) = -2o + 18. Let m be c(0). Let s = m - 19. Let j = s + 5. What is the units digit of j? 4 Let h(s) = 17s + 11. Let r(t) = 9t + 6. Let c(f) = -6h(f) + 11r(f). Let a be c(-1). What is the tens digit of 11 + 0/(a/3)? 1 What is the tens digit of 3/6 + 978/12? 8 Let i = 1120 + -620. What is the hundreds digit of i? 5 Suppose 2i - z = 1, -19 = -3i + 2z + 3z. What is the units digit of (14/35)/(i/(-260))? 2 Suppose -31 = q + 44. What is the tens digit of ((-204)/(-10))/(2 + 140/q)? 5 Suppose c - 676 = 567. What is the hundreds digit of c? 2 Suppose -5h - x + 68 = x, -4h = 3x - 53. Let n = h + 8. Suppose 0 = a - 3 - n. What is the units digit of a? 5 Let b(j) = j - 2. Let z be b(4). Suppose -zr = -4 - 10. Let a = 16 - r. What is the units digit of a? 9 Let j(q) = 5q*2 - 12q + 7. Let c(l) = -4l2 + 11l - 6. Let f(a) = 4c(a) + 3j(a). Let g be f(3). What is the units digit of (6/g)/((-3)/(-18))? 3 Suppose -o = 5c - 182 - 553, -1414 = -2o + 4c. What is the tens digit of o? 1 Let j(u) = 2u*2 - 7u - 56. What is the tens digit of j(22)? 5 Let a(h) = 198h3 - 8h*2 + 7h. What is the units digit of a(2)? 6 Suppose -4o + 2w + 14896 = 0, -2o - 2w - 1251 = -8705. What is the thousands digit of o? 3 What is the tens digit of 237/(-4)52/(-3)? 2 Suppose -a = 7a - 376. Suppose 30m - 29m = a. What is the units digit of m? 7 Let p(t) = t*2 - 5t - 6. Let l = 1 + 5. Let c be p(l). Suppose -h + 12 = -c. What is the tens digit of h? 1 Suppose -4a - 1 = g - 4g, 5g + 3a = -8. Let m be (-14)/(-1 - (g - -2)). Suppose 25 = mv - 241. What is the tens digit of v? 3 Suppose 5w	{ "pile_set_name": "DM Mathematics" }
it of 264141? 4 What is the units digit of 84518? 8 What is the hundred thousands digit of 1979358? 9 What is the hundred thousands digit of 1596497? 5 What is the units digit of 251366? 6 What is the thousands digit of 2210800? 0 What is the hundreds digit of 1362183? 1 What is the thousands digit of 353367? 3 What is the millions digit of 1591027? 1 What is the ten thousands digit of 10037488? 3 What is the ten thousands digit of 89965? 8 What is the millions digit of 1049944? 1 What is the ten thousands digit of 249249? 4 What is the tens digit of 1941522? 2 What is the thousands digit of 3414882? 4 What is the hundreds digit of 821613? 6 What is the thousands digit of 337219? 7 What is the units digit of 32721405? 5 What is the thousands digit of 660609? 0 What is the tens digit of 1828511? 1 What is the ten thousands digit of 201629? 0 What is the ten thousands digit of 239097? 3 What is the ten thousands digit of 36389? 3 What is the thousands digit of 99742? 9 What is the hundred thousands digit of 611924? 6 What is the ten millions digit of 10780167? 1 What is the units digit of 1584720? 0 What is the hundreds digit of 76222? 2 What is the units digit of 1651251? 1 What is the millions digit of 8517861? 8 What is the tens digit of 3947355? 5 What is the ten millions digit of 24680910? 2 What is the tens digit of 43219? 1 What is the units digit of 2805791? 1 What is the units digit of 676274? 4 What is the thousands digit of 6596013? 6 What is the thousands digit of 3012692? 2 What is the units digit of 937157? 7 What is the hundreds digit of 4900272? 2 What is the hundred thousands digit of 7133518? 1 What is the thousands digit of 126829? 6 What is the thousands digit of 27966352? 6 What is the thousands digit of 676071? 6 What is the tens digit of 11847487? 8 What is the ten millions digit of 21386304? 2 What is the hundreds digit of 16997303? 3 What is the units digit of 33772130? 0 What is the tens digit of 588876? 7 What is the tens digit of 3090245? 4 What is the hundred thousands digit of 251993? 2 What is the thousands digit of 23164962? 4 What is the hundreds digit of 40169? 1 What is the millions digit of 5822051? 5 What is the ten millions digit of 12310715? 1 What is the units digit of 13160665? 5 What is the tens digit of 14816518? 1 What is the tens digit of 291152? 5 What is the hundred thousands digit of 16359687? 3 What is the ten thousands digit of 3064175? 6 What is the ten thousands digit of 1836173? 3 What is the millions digit of 4108050? 4 What is the ten thousands digit of 552495? 5 What is the ten millions digit of 15052389? 1 What is the hundred thousands digit of 1726011? 7 What is the units digit of 51167? 7 What is the thousands digit of 9962794? 2 What is the ten thousands digit of 610858? 1 What is the tens digit of 192711? 1 What is the thousands digit of 374949? 4 What is the units digit of 238081? 1 What is the tens digit of 722171? 7 What is the thousands digit of 195903? 5 What is the tens digit of 2120963? 6 What is the tens digit of 24081094? 9 What is the ten thousands digit of 378686? 7 What is the hundreds digit of 15145653? 6 What is the tens digit of 15538? 3 What is the hundreds digit of 28881? 8 What is the hundred thousands digit of 14593917? 5 What is the thousands digit of 3790698? 0 What is the hundred thousands digit of 1311262? 3 What is the ten thousands digit of 2250347? 5 What is the hundreds digit of 423729? 7 What is the ten thousands digit of 33544479? 4 What is the thousands digit of 388649? 8 What is the hundred thousands digit of 428211? 4 What is the tens digit of 202994? 9 What is the hundreds digit of 6998948? 9 What is the hundreds digit of 6762528? 5 What is the units digit of 3137300? 0 What is the units digit of 3904466? 6 What is the thousands digit of 493218? 3 What is the hundred thousands digit of 1384903? 3 What is the hundreds digit of 326966? 9 What is the hundred thousands digit of 1662611? 6 What is the ten thousands digit of 1475721? 7 What is the ten thousands digit of 53526? 5 What is the units digit of 5908903? 3 What is the hundred thousands digit of 790587? 7 What is the thousands digit of 16765792? 5 What is the tens digit of 588868? 6 What is the ten thousands digit of 2753759? 5 What is the ten thousands digit of 4647208? 4 What is the tens digit of 4463505? 0 What is the tens digit of 86707? 0 What is the units digit of 1206996? 6 What is the hundreds digit of 3621174? 1 What is the thousands digit of 260395? 0 What is the ten thousands digit of 65542? 6 What is the hundred thousands digit of 18643905? 6 What is the units digit of 2817864? 4 What is the millions digit of 5937212? 5 What is the units digit of 1134538? 8 What is the ten thousands digit of 1240335? 4 What is the thousands digit of 147620? 7 What is the hundreds digit of 222824? 8 What is the hundreds digit of 321561? 5 What is the units digit of 2941902? 2 What is the thousands digit of 307045? 7 What is the tens digit of 2093502? 0 What is the thousands digit of 1133464? 3 What is the tens digit of 3021455? 5 What is the ten thousands digit of 309993? 0 What is the hundred thousands digit of 171015? 1 What is the hundreds digit of 5621555? 5 What is the hundreds digit of 42478? 4 What is the thousands digit of 2292262? 2 What is the hundred thousands digit of 3925050? 9 What is the hundreds digit of 729050? 0 What is the millions digit of 3482625? 3 What is the hundred thousands digit of 545649? 5 What is the tens digit of 2114821? 2 What is the units digit of 20906296? 6 What is the units digit of 394749? 9 What is the hundred thousands digit of 243794? 2 What is the ten thousands digit of 144370? 4 What is the hundred thousands digit of 12846085? 8 What is the units digit of 774338? 8 What is the hundreds digit of 645914? 9 What is the hundred thousands digit of 112780? 1 What is the thousands digit of 3903622? 3 What is the thousands digit of 36211? 6 What is the tens digit of 10116173? 7 What is the millions digit of 3353023? 3 What is the thousands digit of 12007637? 7 What is the units digit of 401972? 2 What is the thousands digit of 169531? 9 What is the tens digit of 35794? 9 What is the hundred thousands digit of 3297986? 2 What is the units digit of 2550515? 5 What is the hundred thousands digit of 964487? 9 What is the tens digit of 32298? 9 What is the tens digit of 1314647? 4 What is the hundreds digit of 1034399? 3 What is the hundred thousands digit of 3859668? 8 What is the units digit of 455842? 2 What is the thousands digit of 1761565? 1 What is the millions digit of 1345686? 1 What is the thousands digit of 752033? 2 What is the units digit of 94126? 6 What is the millions digit of 4855643? 4 What is the ten thousands digit of 1297751? 9 What is the ten millions digit of 19060835? 1 What is the hundreds digit of 2317247? 2 What is the units digit of 171990? 0 What is the thousands digit of 4968545? 8 What is the thousands digit of 174976? 4 What is the units digit of 1130187? 7 What is the ten thousands digit of 5516660? 1 What is the hundreds digit of 2212118? 1 What is the tens digit of 145440? 4 What is the tens digit of 15377? 7 What is the tens digit of 6901545? 4 What is the units digit of 13146700? 0 What is the thousands digit of 208903? 8 What is the hundred thousands digit of 2463798? 4 What is the thousands digit of 57711? 7 What is the millions digit of 2380050? 2 What is the ten thousands digit of 89164? 8 What is the hundred thousands digit of 256331? 2 What is the units digit of 1302144? 4 What is the hundred thousands digit of 465223? 4 What is the hundred thousands digit of 265875? 2 What is the ten thousands digit of 1525011? 2 What is the thousands digit of 708283? 8 What is the hundred thousands digit of 2589988? 5 What is the hundred thousands digit of 10138907? 1 What is the hundreds digit of 2705849? 8 What is the hundreds digit of 11733924? 9 What is the units digit of 195418? 8 What is the tens digit of 4043695? 9 What is the hundred thousands digit of 843794? 8 What is the tens digit of 910? 1 What is the millions digit of 2034870? 2 What is the units digit of 1832443? 3 What is the millions digit of 6805834? 6 What is the hundreds dig	{ "pile_set_name": "DM Mathematics" }
9 - 8 = 0. Let z(j) be the first derivative of 8/13jt + 8/13j - 10/39j3 - 11. Factor z(o). -2(o - 2)(5o + 2)/13 Let b(w) be the third derivative of -w*5/240 - 63w*4/16 + 835w*2 + 2. Factor b(l). -l(l + 378)/4 Suppose 21u = -16u + 4u + 9u. Factor 0 + ut - 1/4t*3 + 0t2. -t3/4 Let l(a) be the second derivative of -a8/840 - a7/360 + a*6/720 + 23a*4/12 - 2a + 1. Let g(t) be the third derivative of l(t). Factor g(y). -y(y + 1)(8y - 1) Let f(z) be the second derivative of z4/4 - z2/2 - 4z - 6. Let y(p) = -9p2 + 2. Let a be -6 + -22/4. Let g(x) = af(x) - 2y(x). Factor g(i). -3(i - 1)(i + 1) Let a(j) be the first derivative of -139 - 20/7j2 + 24/7j*3 + 0j*5 - 17/14j*4 + 1/21j*6 + 0j. Find b such that a(b) = 0. -5, 0, 1, 2 Suppose -3g = -5s - 293, 10g - 9g - 93 = 4s. Suppose -92b = -gb + 18. Determine w, given that -4/7w*3 + 36/7w*b + 0 + 0w = 0. 0, 9 Let k(z) be the third derivative of z7/16380 + z6/936 - 7z5/390 - 8z*4 - 3z*2 - 7. Let o(q) be the second derivative of k(q). Factor o(r). 2(r - 2)(r + 7)/13 Let j be 1598/8874 + 6/(-87). Let f(n) be the second derivative of -2/3n*2 + 2/9n*3 + jn*4 - 1/15n*5 + 14n + 0. Suppose f(p) = 0. What is p? -1, 1 Let h(d) be the first derivative of -d*5/40 - 7d*4/24 - 62d - 165. Let t(j) be the first derivative of h(j). Determine s, given that t(s) = 0. -7, 0 Let d be (67 + -117)25/(-90) + -13. Factor -1/9s*2 + 7/9s + d. -(s - 8)(s + 1)/9 Let a = 2255/61 - 6704/183. Factor -b2 + 0b + 4/3 - ab3. -(b - 1)(b + 2)*2/3 Factor -1/4i + 1/4i3 - 1 + i2. (i - 1)(i + 1)(i + 4)/4 Suppose -n - 3 = 2j, -256n + 2j = -255n - 9. Let i(o) be the second derivative of -1/84o*4 - 9o + 1/21on + 0 - 1/140o*5 + 0o*2. Factor i(h). -h(h - 1)(h + 2)/7 Let w = 11194 - 44775/4. Let d(r) be the first derivative of -3/8r - 1/24r3 + 3 + wr*2. What is u in d(u) = 0? 1, 3 Suppose 103d = 95d + 16. Let h(q) be the third derivative of 0 + 1/36q*3 - 1/360q*5 + 0q - 30qd - 1/240q*6 + 1/48q*4. Factor h(k). -(k - 1)(k + 1)(3k + 1)/6 Let s(g) be the third derivative of g*6/900 - 2g5/75 - g4/180 + 4g3/15 + 34g*2 + 42. Solve s(p) = 0 for p. -1, 1, 12 Let t(m) be the third derivative of 0 - 17/120m*5 - 2m + 0m3 - 45m*2 + 0m*4 - 1/240m6. Factor t(o). -o2(o + 17)/2 Let m(z) be the second derivative of 0z*3 - 1/20z*5 - 1/20z*6 - 119z + 0z2 + 0z*4 - 1/84z7 + 0. Factor m(p). -p3(p + 1)(p + 2)/2 Let g(c) be the second derivative of c7/42 - c6/30 - c5/20 + c4/12 - 1000c. What is w in g(w) = 0? -1, 0, 1 Let w(r) be the third derivative of -r + 35r*2 - 3/4r*3 + 5/16r*4 + 1/240r*6 - 7/120r*5 + 0. Find t, given that w(t) = 0. 1, 3 Let m be 209625/100 + 4/(-16). Let b be m/60 - (-104)/(-65). Find f such that bf*2 + 314/9f*4 - 4f*5 + 256/9f - 64/9 - 770/9f3 = 0. -1/2, 2/9, 1, 4 Suppose -3w + 21 = -12. Suppose -wy = -9y - 4. What is t in t*2 - 3t*y + 49 - 45 - 2t = 0? -2, 1 Suppose a - 80a = 41a + 105a + 361a. Let j(r) = -3r3 - r2 - r. Let i be j(-1). Factor a + x2 + 0x - 1/2xi. -x2(x - 2)/2 Let b(a) = -a*3 + 2a*2 + 3a - 6. Let q be b(2). Suppose 2k - 28 = -qk. Factor kj - 10j*2 - 9j + 5j2. -5j(j - 1) Let o be (-114)/615681/(-6). Factor 5/4b - 3/2 - ob*2. -(b - 3)(b - 2)/4 Determine h so that -17h4 - 39h*5 + 66870h*2 - 5835h - 702 + 791h4 - 75582h*2 - 2766h*3 = 0. -1, -2/13, 9, 13 Factor 200z - 2/7z2 - 35000. -2(z - 350)*2/7 Let m(c) be the first derivative of 2c*5/55 - 7c*4/11 + 8c*3/3 - 40c2/11 - 317. Find u, given that m(u) = 0. 0, 2, 10 Let j(w) be the first derivative of -w4/9 + 28w3/27 + 40w*2 + 144w - 4953. Factor j(m). -4(m - 18)(m + 2)(m + 9)/9 Let y be 10(0 - 5)/(-5). Let p be (-2)/y + (3 - 968/360). Factor 1/3t2 - 1/9t - 1/9t4 + pt*3 - 2/9. -(t - 2)(t - 1)(t + 1)2/9 Let x be 2(44/(-8) + -2). Let n be (12/x)/(((-16)/(-10))/(-4)). Solve 5m4 + 1 + 10m*n - 60m + 111m - m5 - 56m - 10m3 = 0 for m. 1 Let g(d) be the second derivative of -2d + 4d3 + 0d*2 - 2/3d*4 - 21 + 1/15d*6 - 3/10d*5. Factor g(j). 2j(j - 3)(j - 2)(j + 2) Let y = 693 + -337. Suppose -s + q + 66 = 0, 2q + y = 4s + 88. Factor -34i*2 - 49 - 35i*2 + 14i + si2. -(i - 7)2 Let g be -12 + (7 + -2)/5. Let d(q) = q3 + 12q*2 + 10q + 17. Let p be d(g). What is v in 2v - 5v*3 + 92v*2 + 139v*3 - 128v*2 + pv3 = 0? 0, 1/9 Let s(x) be the first derivative of x6/3420 - x*5/76 + 3x*4/19 - 13x*3 + x - 39. Let j(a) be the third derivative of s(a). Suppose j(i) = 0. Calculate i. 3, 12 Let w = 578 + -459. Let d = w - 592/5. Suppose 1/5p*2 + 7/5p*3 - d + 2/5p*4 - 7/5p = 0. What is p? -3, -1, -1/2, 1 Suppose -2z = 3t + 21, -2z + 6z + 2t = -14. Let k(u) be the first derivative of -1/3u*4 + 31 + 2u*2 + zu - 8/9u3. Let k(m) = 0. Calculate m. -3, 0, 1 Let z(a) be the second derivative of -8a - 76/9a3 + 1/9a*4 + 0 + 0a*2. Factor z(c). 4c(c - 38)/3 Let z be (53760/(-616))/160 - (-261)/1102. Factor 0 - 9p2 - zp*3 - 27/5p - 3/5p4. -3p(p + 1)(p + 3)*2/5 Let m be (-6351)/(-87) + -62 + 64/(-6). Factor -2/3o*2 + 0 - o + mo*3. o(o - 3)(o + 1)/3 Let g = -103 + 102. Let b be -1(g/5 + (-28)/10). Find j, given that 18/13j2 + 12/13j*b + 2/13j*4 + 0j + 0 = 0. -3, 0 Solve 30p2 + 132p*2 - 1155p - 3p3 + 843p = 0 for p. 0, 2, 52 Let w(t) be the third derivative of t*5/390 - 25t*4/156 - 18t*3/13 - 225t*2. Factor w(d). 2(d - 27)(d + 2)/13 Let z(t) = -t2 + 2t + 1. Let m(l) = 6l2 - 21l - 13. Let r = -367 - -371. Let b(w) = rm(w) + 28z(w). Factor b(y). -4(y + 1)(y + 6) Let z(q) = -4q3 + 24q*2 + 290q + 898. Let h(b) = -9b3 + 52b*2 + 570b + 1795. Let l(y) = -2h(y) + 5z(y). Determine v, given that l(v) = 0. -5, 18 Let g(a) be the second derivative of 7a6/30 - 159a*5/20 + 187a*4/6 + 20a*3 + a + 1279. Solve g(y) = 0. -2/7, 0, 3, 20 Let f(z) be the third derivative of -13z*4/24 - 115z*3/6 + 283z*2. Let k be f(-9). Solve -kq + q*3 - 3/2q*2 + 1/2q4 + 2 = 0 for q. -2, 1 Let j(k) be the first derivative of k6/1260 + k*5/210 - 7k*3/3 - 13k*2/2 - 184. Let o(s) be the third derivative of j(s). Factor o(u). 2u(u + 2)/7 Let b(d) be the third derivative of -d6/150 - 62d*5/75 - 55d*4/2 + 2904d*3/5 + 11d*2 + 127. Factor b(j). -4(j - 4)(j + 33)2/5 Let x(l) = 2l*2 + 72l + 75. Let q be x(-35). Suppose 4r + 1 = v, -qr + 3v = -2v + 5. Determine j so that 12j + 3/2j*2 + r = 0. -8, 0 Find i, given that -4i*4 + 2924i - 85i3 - 320i*2 - 15724i + 213i3 = 0. -8, 0, 20 Let l(i) = -2i3 + i2 - i. Let t(r) = 3r3 - 39r*2 + 251r - 387. Let s(j) = -10l(j) - 5t(j). Factor s(y). 5(y - 3)2(y + 43) Let u = -1/131278 + 1050229/656390. Let 3/5f3 - 2/5f*2 + 1/5f*4 - u - 12/5f = 0. What is f? -2, -1, 2 Let a(w) = 18w3 - 63w*2 + 30w. Let h(p) = -5p2 + p3 + 9 - 9 + 3p*2. Let q(j) = a(j) - 15h(j). Factor q(f). 3f(f - 10)(f - 1) Let v be 6/(-1 + 0)16/(-144)3. Let z(o) be the first derivative of -2/3o*6 + 4o - 8/3o3 - vo*2 + 2o*4 + 50 + 4/5o*5. Suppose z(m) = 0. What is m? -1, 1 Find d such that -57/4d - 405/8d2 + 207/8d*3 + 0 + 3/2d*4 = 0. -19, -1/4, 0, 2 Factor 0 - 4/7w*3 + 176/7w + 172/7w2. -4w(w - 44)(w + 1)/7 Let y = 166769 + -833841/5. Factor 84/5 + yq2 - 88/5q. 4(q - 21)(q - 1)/5 Let z(x) be the third derivative of -30x2 - 2x - 4/5x5 + 0x*3 - 1/30x*6 + 0 + 14/3x*4. Let z(y) = 0. What is y? -14, 0, 2 Let m(i) be the third derivative of 0i*3 + 28i + 5/6i4 + 2/5i*5 - 4/35i*7 - 1/84i*8 - 2/15i6 + 0 + i2. Determine n so that m(n) = 0. -5, -1, 0, 1 Let z(n) be the third derivative of -5n8/48 - 1333n*7/14 - 284855n*6/12 + 34177n*5 + 102245n*4/3 + 2576n*2. Let z(u) = 0. What is u? -286, -2/7, 0, 1 Let q(j) be the first derivative of -10j*2 + 0j + 2/3j3 + 72. What is y in q(y) = 0? 0, 10 Suppose 3n = a + n - 201, -2a - 3n = -430. Let r = a - 205. Determine v, given that 9/4v5 + 33/4v*r + 37/4v*3 + 1/2	{ "pile_set_name": "DM Mathematics" }
7a2 + 383a*6 + 1211a*6 wrt a. 136200a*3 Let p(c) be the second derivative of -13/5c*5 + c - 55 - 7/2c*2 + 0c*6 + 0c*3 + 9/4c*4 - 1/42c*7. Find the third derivative of p(u) wrt u. -60u2 - 312 Let f(y) = -y4 + 2y - 81. Let i be 4 - (-7 + (-28)/(-2)). Let c(x) = 2x*4 - x + 81. Let p(q) = if(q) - 4c(q). Differentiate p(o) with respect to o. -20o*3 - 2 Let a(x) be the second derivative of -3x*5/20 - 33x*4/4 + 469x3/2 - x2 - 5499x. Find the second derivative of a(o) wrt o. -18o - 198 Differentiate -128o4 + 2562 + 84o*3 + 430o*4 - 13o*3 - 71o*3 wrt o. 1208o*3 Suppose 0 = -5o + 9o - 28. Let r(z) = 5z - 24. Let h be r(o). Find the third derivative of hj2 + 12j*6 - 30j*2 - 27j*6 - 15j*6 wrt j. -3600j*3 Let l(a) = -349a*4 + 12a*3 + 108a + 12. Let h(k) = k*4 + 2k*3 + 2. Let g(v) = 6h(v) - l(v). Find the second derivative of g(f) wrt f. 4260f2 Let k(u) be the first derivative of 328u*7/7 + 311u*3/3 - 3u*2/2 - 979. Find the third derivative of k(t) wrt t. 39360t*3 Let u be (-13)/(-2) - (-140)/(-40). Find the third derivative of 5643m*3 - 5459m*u + 3m*2 - 6m*2 wrt m. 1104 Suppose -24s + 0 + 0 = -30s. Let v(u) be the first derivative of -u + 17 + su*2 - 20/3u*3. Differentiate v(c) wrt c. -40c What is the third derivative of -4 + 502f2 - f6 + 539f*4 - 33f*2 - 2657f*4 wrt f? -120f*3 - 50832f Let c(l) = 107l2 - 8l + 1. Let s(q) = 2q - 1. Suppose a = -47 + 48. Let h(k) = ac(k) + 5s(k). What is the second derivative of h(y) wrt y? 214 Suppose 0 = -5s + 10, -3x - 3s = -18 - 6. Find the third derivative of -i*x + 219i*2 + 3i*6 - 14i*5 - 17i5 - i5 - i*5 wrt i. 240i*3 - 1980i*2 Let m(x) = 136x*2 + 2x - 49. Let w(c) = -68c2 - c + 24. Let v(f) = 2m(f) + 5w(f). What is the derivative of v(j) wrt j? -136j - 1 Find the third derivative of 1262o3 - 787o*2 + 2992o*2 - 308o*3 + 55 - 55 wrt o. 5724 Let d(t) be the third derivative of -3t6/20 - t5/60 + 9t4/8 - 1411t*3 - 4465t*2 + 2t. What is the first derivative of d(q) wrt q? -54q2 - 2q + 27 Let m be 4/8 + (-236)/8. Let d be m/(261/(-540)) - (4 + 0). What is the derivative of -28p4 - d + 14 + 18 + 18 wrt p? -112p*3 Let n(g) be the third derivative of 1/20g*5 + 11g*2 - 31/6g*3 + 0g + 0 + 0g4 - 1/105g*7 + 0g*6. What is the derivative of n(u) wrt u? -8u*3 + 6u Suppose 56 = 6j - 10. Suppose -2r + y + 1 = -10, r - j = -5y. Differentiate -1 - r + 3 + 16o*4 - 5 wrt o. 64o*3 Let j = 516 + -504. Find the second derivative of 34 - 11k - 37k2 - jk + 26k - 45 wrt k. -74 Let m(n) = 127n - 11. Let w(b) = -124b + 12. Suppose -i - 3t = -10 - 4, -4i + 23 = t. Let s(v) = im(v) + 4w(v). Find the first derivative of s(k) wrt k. 139 Suppose 4g - 153 = g. What is the derivative of -4j4 + 138j*3 - 16j*4 - 137j*3 + g wrt j? -80j*3 + 3j2 Let h(i) = i2 - 12i + 6. Let r be h(4). Let a be r/10-1 + 4/10. Find the second derivative of 8u3 + au*3 - 44u*3 + 4u + 3u wrt u. -198u Suppose 203 + 88 = 97y. Let p(k) be the first derivative of 8k*2 + 16/3k*y + 0k - 10. Find the second derivative of p(f) wrt f. 32 Let k(o) = -4o3 - 37o*2 - 12o + 2. Let l be k(-9). What is the first derivative of -84 + 2m3 + 29m - 52m3 - lm wrt m? -150m2 Let p(w) = -2w - 6. Let x(y) = -1354y - 1409. Let b(t) = 6p(t) - x(t). Find the first derivative of b(d) wrt d. 1342 Find the third derivative of -803n2 + 54359n*5 - 54361n*5 - 3116n*2 + 92n*6 wrt n. 11040n*3 - 120n*2 Differentiate 1135n*2 + 201n*2 + 447n*2 - 3n - 322n2 - 3128 with respect to n. 2922n - 3 Suppose 5v - 51 = -11. Suppose 3x - v = 4. What is the second derivative of 16ux - 11u*4 + 8u - 2u + u4 wrt u? 72u*2 Let g(m) = -743m*3 - 2010m*2 - 9m + 6. Let a(p) = -2972p3 - 8043p*2 - 33p + 22. Let v(w) = 6a(w) - 22g(w). Find the third derivative of v(b) wrt b. -8916 Let z(x) = -x*2 + 36x + 593. Let l be z(48). Suppose 2i - 4b = 7 + 9, 0 = 2b + 6. What is the second derivative of 15j*2 + 19j - 5j + lj*i wrt j? 64 Find the third derivative of -26 + 75 - 2f*2 - 1012f*6 - 15 wrt f. -121440f*3 Let f = 14 - -92. What is the second derivative of -fy + 2y5 + 3 - 3 - 46y*2 - 54y*2 + 95y*2 wrt y? 40y*3 - 10 What is the second derivative of 1379u*3 - 41u*2 + 4u*4 - 1379u*3 + 4u*4 + 715u + u*4 wrt u? 108u*2 - 82 What is the third derivative of 6p*6 + 56p*2 + 968p - 972p - 1644p*5 + 1400p*5 wrt p? 720p*3 - 14640p*2 What is the second derivative of -5 - 1246m*3 + 16m + 2m + 12 + 27 wrt m? -7476m Let a(c) be the first derivative of -95/2c2 + 67/4c*4 + 0c + 0c3 + 73. What is the second derivative of a(i) wrt i? 402i Let t(q) = -100q - 6 - 59 - 53 - 5 - 37. Let y(o) = -197o - 322. Let z(p) = -10t(p) + 6y(p). What is the first derivative of z(m) wrt m? -182 Let t(u) be the third derivative of -211u7/42 + u4/12 - 352u*3/3 + 2u*2 - 493u. What is the derivative of t(x) wrt x? -4220x3 + 2 Let t(i) be the third derivative of 3/10i*5 + 58i*2 + 0i*3 + 0 + 0i*4 + 5/24i*6 + 0i. Find the third derivative of t(s) wrt s. 150 Let g(w) = 2w - 18. Let u be g(12). Suppose ud - 41 - 7 = 0. What is the second derivative of 528j3 + dj - 528j3 + 11j*4 wrt j? 132j*2 Let s(t) be the third derivative of -146t7/105 + t6/60 - 307t3/6 + t2 + 584t. What is the first derivative of s(p) wrt p? -1168p3 + 6p*2 Let x(b) = -3b + 42. Let f be x(13). Let t(o) be the second derivative of -o*3 - 39o + 13o + o2 + 0o*f. What is the derivative of t(i) wrt i? -6 Let r(a) = 3a + 6. Let v be r(-1). Find the third derivative of 18z2 - 1 + 63z*2 - 52z*v - 37z*3 wrt z. -534 Differentiate 28p + 7p4 + 8774 - 21p - 7p - 1549p*3 - 4p*4 with respect to p. 12p*3 - 4647p*2 Let o(w) be the third derivative of -155w*4/6 - 6305w*3/3 - 5w*2 - 32w - 6. Differentiate o(t) with respect to t. -620 Let j(k) be the third derivative of -302k5/3 + 503k*3/3 + 1131k*2. Differentiate j(u) wrt u. -12080u Let q(x) be the third derivative of 0x6 + 0x*5 + 0 + 1/24x*4 - 62/3x*3 + 1/210x*7 + 0x + 148x2. Differentiate q(o) wrt o. 4o*3 + 1 Differentiate 1908 + 4386s + 1413 + 2980s + 708 + 798 with respect to s. 7366 What is the third derivative of 1097i*4 + 477i*2 + 5191i2 - i5 + 3511i4 - 970i*2 wrt i? -60i*2 + 110592i Differentiate 2b3 - 3615b*4 + 7661 + 6431b*4 + 48 wrt b. 11264b*3 + 6b*2 Find the second derivative of 127l*4 + 14l*2 - 123l*4 + 5l*2 + 603l wrt l. 48l2 + 38 Let f be (-34)/(-84)56/80. Let q(w) be the third derivative of 0w + 0 + fw*5 - 5/8w*4 - 2w*2 + 0w*3. Find the second derivative of q(i) wrt i. 34 Let y(o) be the first derivative of 43/2o*2 + 19o - 48. What is the derivative of y(q) wrt q? 43 Suppose -4v - 23 = -5j, -j + v + 3 = -2. What is the derivative of -16bj + 30b*3 + 63b*3 + 35 wrt b? 231b*2 Let f = 263 - 241. Differentiate 15b - 21b - fb + 30 - 18b wrt b. -46 Let f(n) = -5n + 19n + 12n + 29 - n*3 + 40n*2 - 14n*2. Let o be f(27). Find the third derivative of -9z*5 - 42z*o - 8z*4 + 9z*4 + 78z*2 wrt z. -540z*2 + 24z Let o = 116 + -99. Find the first derivative of o + 10 + 37i2 - 27i*2 + 48i*2 wrt i. 116i What is the second derivative of 2847y - 697y*4 + 757y*4 + 2165y*4 wrt y? 26700y*2 Let z(q) = 205q*2 + 2q + 1258. Let o(v) = 410v2 + 3v + 2529. Let i(r) = -2o(r) + 5z(r). Differentiate i(t) with respect to t. 410t + 4 Suppose -13s = -3s - 70. What is the second derivative of -971 - 6k + k*3 - 6k + sk3 + 970 wrt k? 48k Let q(z) be the first derivative of 605z6/6 + 469z*2 - 1285. Find the second derivative of q(c) wrt c. 12100c*3 Suppose -3q = -2q - 4. What is the second derivative of 1504j*3 - 57j + 92jq - 1504j*3 wrt j? 1104j*2 Suppose 3j - 58 = -235. Let b = -54 - j. Differentiate -3 + b + 16c2 + 10c*2 - 6c*2 wrt c. 40c Let v(d) = d4 + d2 - 2. Let g(u) = 57u5 - 3u*4 + 4u3 - u2 + 6. Let j(i) = g(i) + 2*v(i). Fi	{ "pile_set_name": "DM Mathematics" }
a What is the closest to -1/2 in -339/151, -1/7, -2/25? -1/7 Which is the closest to 279? (a) 1/2 (b) 2 (c) 0 (d) 4 (e) 3/5 d What is the closest to 1/20 in 4, 3/2, 1/3, -0.3, 287? 1/3 What is the closest to -1 in -2094, -2/5, 0.4, 11? -2/5 What is the closest to 1 in 5, -0.073, -1/2, -8, 4? -0.073 Which is the nearest to -7? (a) -5 (b) -1/8 (c) 0.4 (d) 141 a Which is the nearest to 1? (a) 0.1 (b) -26/25 (c) -1/3 (d) 2 a Which is the nearest to 0.087? (a) -3 (b) 0.3 (c) 6 (d) -0.07 d What is the nearest to -0.02 in 2, -0.5, -0.1, -3/50? -3/50 Which is the nearest to -0.3? (a) -8 (b) -4 (c) -1/44 c What is the nearest to -1096 in -5, 4, 3, -71.5? -71.5 What is the closest to -9/16 in 4/53, -2.4, -4, 5? 4/53 Which is the closest to -0.1? (a) -5 (b) -2/11 (c) -2/197 (d) 287.5 (e) 3 b What is the closest to -22 in 0.3, -0.5, -5, 3, -13/8? -5 What is the closest to 0 in 6, 209, -1/2, -2/13? -2/13 Which is the closest to 2/3? (a) -0.2 (b) -4 (c) -1/846 (d) 0.12 d Which is the nearest to -1? (a) 0 (b) -0.03 (c) -26 (d) -44.2 b What is the closest to 0.1 in -3, 2/911, 2/13, -64? 2/13 What is the nearest to -0.2 in 2/17, -12, -4, 114? 2/17 Which is the closest to -2/9? (a) -61 (b) -6/11 (c) -1/257 c Which is the nearest to -32? (a) -0.8 (b) 2/3 (c) -3 (d) 19 c Which is the closest to 1/2? (a) 0.4 (b) 1/5 (c) -4 (d) -28/919 (e) 0.3 a What is the nearest to 0 in 0.9, -0.5, -10.92? -0.5 What is the closest to 2 in -8, -1/4, 1167, -3? -1/4 What is the nearest to 2/3 in -183/436, 6, 2? -183/436 Which is the closest to 3? (a) -185 (b) 16 (c) -4/9 c Which is the nearest to 2? (a) 0.5 (b) 507 (c) 4/7 c Which is the closest to -0.2? (a) 0.08 (b) 176 (c) -4 (d) -3/7 d What is the closest to 6693 in -0.1, 5, 0.3? 5 Which is the closest to 4? (a) -2 (b) 25 (c) -1.56 (d) -0.3 d Which is the nearest to -0.2? (a) -2/315 (b) -17 (c) 0.3 a Which is the closest to 7? (a) -1.8 (b) 1/4 (c) -11 b Which is the closest to -222? (a) 2 (b) 2/13 (c) 1/13 (d) -5 (e) -0.5 d Which is the nearest to -4? (a) -2.2 (b) 0.2 (c) 0.05 a Which is the closest to 0.1? (a) -2 (b) -5/2 (c) -5 (d) -40 a What is the closest to 1/41 in -3, -1, 1, -0.04? -0.04 What is the nearest to 0 in -2, 1/8, -80541, -0.5? 1/8 Which is the nearest to -14? (a) -5 (b) 10 (c) 4 (d) 0.3 a Which is the closest to 13? (a) 0.23 (b) -3.5 (c) 0.4 (d) 2 d Which is the closest to -2? (a) 2 (b) 13 (c) 1835 a Which is the nearest to -2/7? (a) 4/5 (b) -4 (c) -4/9 (d) -2.5 c What is the nearest to 2 in 0.1, 4, 11, -43.049? 0.1 What is the closest to 18 in 4, 2/11, 5, -0.08, -2? 5 Which is the nearest to 0.1? (a) -1 (b) -1.2 (c) -240 (d) -0.3 (e) 18 d What is the nearest to 7 in -68, 4, -5? 4 Which is the closest to 751.6? (a) -2/3 (b) 70 (c) -1 b Which is the nearest to 3/4? (a) -0.59 (b) -6/7 (c) 1/5 (d) 3/4 d What is the nearest to 2/7 in -1/58148, -0.4, 3, 2/9? 2/9 Which is the nearest to 0? (a) -0.4 (b) -49 (c) -4 (d) -390 a Which is the nearest to 13? (a) -3/5 (b) -27.2 (c) -1/12 (d) 1/5 d Which is the nearest to 1? (a) 0.1 (b) -136 (c) -1 (d) -5 a What is the closest to -5 in -2, 3/8, 0.5, 1/6? -2 Which is the closest to 0.14? (a) 10 (b) 2/3 (c) -1 (d) 2/85 d Which is the nearest to -1? (a) -7 (b) 0 (c) 83/11 (d) 4 b What is the closest to -0.1 in 8, -275/19, -2? -2 Which is the nearest to -0.1? (a) 11.8 (b) 0.01 (c) -74 b Which is the closest to 158? (a) 1/5 (b) -5 (c) -2 (d) 4 d What is the nearest to -3/2 in -2, 0, 5/9, 2? -2 Which is the nearest to 2? (a) -5 (b) 1 (c) -77/5 (d) 14/11 d What is the closest to 5 in 0.1, -2, 0.01427? 0.1 Which is the nearest to -58/3? (a) -5 (b) 31/3 (c) 2 a Which is the nearest to 0.03? (a) -1/3 (b) -3/8 (c) -2 (d) 5/59 d What is the nearest to 26 in -0.22, -0.4, 4, 1/4? 4 What is the nearest to 1 in -4, -1041, -0.5? -0.5 Which is the nearest to -2/19? (a) -5 (b) -3/7 (c) 0.3 (d) 941 b What is the closest to 1/4 in -4, 137, 134? -4 What is the closest to 22 in 0.1, -32, -5, 0.02? 0.1 What is the nearest to 5 in 4, 2, 0.11838? 4 What is the nearest to 11 in -237/7, 0.2, -19? 0.2 What is the closest to 91/2 in -4, 1/3, 0.23, -5? 1/3 What is the nearest to 12/11 in 2/5, 0, -37, 4? 2/5 What is the closest to -1 in 160, -5, -0.3, 0.03, -2/3? -2/3 What is the nearest to -85 in 1, -0.05, 0? -0.05 What is the closest to -1/6 in -2/19, 0.4, -1.3, 2/9? -2/19 What is the closest to 2 in 4, -7, -1? 4 What is the closest to -2 in 6/109, 1, 0.5, 1/8, 0.9? 6/109 Which is the closest to 1? (a) 5 (b) 0.5 (c) -2/23 (d) 81/5 (e) -5/4 b What is the closest to -1/10 in 1/15, 3/4, -2/769, 4, 5? -2/769 Which is the nearest to 3/4? (a) 5 (b) -7 (c) -1 (d) -3 (e) 0 e What is the nearest to -1 in 5/4, 4/3, -23, 61? 5/4 Which is the closest to -3? (a) 0.19 (b) -64 (c) -0.2 c What is the closest to -9/10 in 275, 2, -3/5? -3/5 What is the closest to 567 in -1/6, -2, 0.02, 5? 5 Which is the closest to 0? (a) -34 (b) -3 (c) 7 (d) 6 b Which is the closest to -0.4? (a) 23/3 (b) 3.1 (c) 1/10 c Which is the nearest to -2/11? (a) 5 (b) 3 (c) 153 b Which is the nearest to 196? (a) 4/7 (b) 4 (c) -4/5 (d) -3 (e) 7 e What is the nearest to -1/4 in -58, -1, 0.3, -0.03? -0.03 Which is the nearest to 0.1? (a) -37 (b) -1 (c) -2 (d) 2552/3 b What is the nearest to -0.6 in 4, 1/5, -3, 2? 1/5 What is the nearest to 0.1 in 1/6, 3/2, 2, -4398, -0.5? 1/6 What is the nearest to 0 in -3, 5/17, 0.8, -0.02? -0.02 Which is the closest to -433? (a) 0 (b) 15 (c) 0.2 a What is the nearest to -1 in 2, 0.08, 2017, -2, -2/17? -2/17 What is the nearest to 2/3 in 112, 272, 4? 4 Which is the nearest to 0? (a) 0 (b) 1 (c) -2717 a What is the nearest to -0.07 in -3/7, -1, 2/11, -0.5, 0.4? 2/11 Which is the closest to -33/5? (a) 0.1 (b) -1 (c) -0.062 b Which is the nearest to -0.1? (a) 72 (b) -4 (c) 0.4 (d) 5 (e) 4 c Which is the closest to -0.1? (a) -3/4 (b) 3/4 (c) -9 (d) 4 (e) -1 a What is the closest to 17 in 2/11, -4, -8.84, -0.4? 2/11 What is the nearest to 0.03 in -2, -1/7, 34? -1/7 What is the closest to 72 in 0.2, -0.4, -2799? 0.2 What is the closest to -0.2 in 3/2, -866, 2/9, 2/7? 2/9 Which is the nearest to -1? (a) 0 (b) -14 (c) 134 (d) 0.4 a Which is the nearest to 140? (a) -0.5 (b) 5 (c) 2 (d) -0.3 b Which is the nearest to -1552? (a) -1 (b) 0 (c) -0.5 a Which is the nearest to -0.21? (a) -5 (b) 0.5 (c) 1 (d) -0.3 (e) 0.04 d What is the nearest to 8/13 in 1, 2, 4, -4/17? 1 What is the closest to 0 in 127506, 2, 4/5? 4/5 Which is the nearest to -2? (a) -2 (b) 0.237 (c) 0.1 (d) 1 (e) 1/9 a Which is the nearest to 0.04? (a) -0.5 (b) -104 (c) 3.5 (d) 1 (e) -5 a Which is the closest to 635? (a) 82 (b) 0.1 (c) -3 a Which is the closest to -7.02? (a) 2.12 (b) 2 (c) -3/2 c Which is the closest to -7? (a) -1/2 (b) 1/4 (c) -1/3 (d) 4 (e) -0.4087 a Which is the nearest to 0? (a) -3/4 (b) 2388 (c) 5 a What is the nearest to -1 in -19/20, 0.3, 0, 842? -19/20 Which is the closest to -2/37? (a) 1/5 (b) 0 (c) 3/7 (d) 98 b What is the closest to 0.08 in 3, -2/5, 0.2, 0.4, 60? 0.2 What is the nearest to -1 in 8, -6, -14, 3? 3 Which is the nearest to 0.2? (a) -0.2 (b) 127 (c) 0.3 (d) 10/21 c Which is the nearest to 23? (a) -4 (b) 30 (c) -32 b What is the closest to 4 in 0, -3.37, -2/5, 5? 5 Which is the closest to -2/7? (a) 0.1 (b) 10/11 (c) 0.04934 (d) -3 c What is the nearest to 5 in 0.022, 6, -0.1? 6 What is the closest to 13 in 1, 2/17, -2/17, -0.2, -113? 1 Which is the nearest to 39? (a) -24 (b) -2/113 (c) 4 (d) 0.2 c Which is the nearest to -0.103? (a) 3 (b) -1/2 (c) 1/56 c Which is the nearest to 0.1? (a) 4329 (b) 1/5 (c) -0.5 (d) 0.3 b Which is the closest to -538? (a) -7 (b) 5 (c) -1 (d) 1 a Which is the nearest to 0? (a) 1 (b) -148374 (c) 5 (d) -0.3 (e) -3 d What is the closest to 14527 in -3, 5, -3/7? 5 Which is the closest to 2/7? (a) -0.17 (b) -1/3 (c) 1.4 (d) -30 (e) -3 a Which is the nearest to 3/7? (a) -10 (b) 2 (c) -16/5 (d) -5 b What is the closest to 1/2 in -2, -4, -1, 0.0179, 0.5? 0.5 What is the closest to -5 in 5/9, -4/5, 28, 0.4? -4/5 What is the near	{ "pile_set_name": "DM Mathematics" }
rs picked without replacement from {a: 11, u: 5}. 1/12 Calculate prob of sequence aaa when three letters picked without replacement from aajjjaaaaa. 7/24 What is prob of sequence rrb when three letters picked without replacement from {r: 5, b: 8}? 40/429 What is prob of sequence mt when two letters picked without replacement from {m: 12, k: 3, t: 2}? 3/34 Calculate prob of sequence uqw when three letters picked without replacement from {u: 5, o: 1, q: 3, w: 4}. 5/143 Four letters picked without replacement from {s: 2, p: 5, c: 4}. What is prob of sequence cspp? 2/99 Calculate prob of sequence utr when three letters picked without replacement from {s: 8, u: 1, t: 2, r: 2}. 1/429 What is prob of sequence jhj when three letters picked without replacement from ijijiwiihhwiwhiiiwiw? 1/1140 Four letters picked without replacement from {g: 9, d: 7}. Give prob of sequence dddg. 9/208 What is prob of sequence pen when three letters picked without replacement from nepvfvvfv? 1/504 Four letters picked without replacement from {w: 3, m: 5, y: 1, l: 4}. Give prob of sequence ywwl. 1/715 Calculate prob of sequence faf when three letters picked without replacement from {i: 2, f: 3, a: 3}. 3/56 Three letters picked without replacement from kskk. What is prob of sequence kkk? 1/4 Two letters picked without replacement from {y: 5, h: 3}. Give prob of sequence hh. 3/28 Calculate prob of sequence gg when two letters picked without replacement from ggggdydyydydyyygg. 15/136 Four letters picked without replacement from nccccrcxcnrc. What is prob of sequence crrn? 7/2970 Calculate prob of sequence ka when two letters picked without replacement from {a: 3, k: 3, c: 10, b: 2}. 1/34 Three letters picked without replacement from {w: 5, z: 7}. What is prob of sequence wzw? 7/66 Three letters picked without replacement from {a: 1, u: 1, h: 2, j: 1, i: 1, p: 1}. Give prob of sequence auj. 1/210 Three letters picked without replacement from {d: 2, t: 10, m: 6}. What is prob of sequence mmm? 5/204 What is prob of sequence llz when three letters picked without replacement from {x: 3, e: 1, b: 1, z: 1, l: 6, f: 1}? 5/286 Four letters picked without replacement from {m: 2, f: 2, z: 1, s: 4, u: 1}. Give prob of sequence zssm. 1/210 Calculate prob of sequence qn when two letters picked without replacement from nqnffqqqnfqfqqnqnqqn. 3/19 What is prob of sequence aaff when four letters picked without replacement from {f: 3, a: 12}? 11/455 Calculate prob of sequence jub when three letters picked without replacement from {b: 4, j: 1, y: 2, u: 1, f: 3, a: 4}. 2/1365 What is prob of sequence wj when two letters picked without replacement from {l: 1, w: 1, j: 1}? 1/6 Three letters picked without replacement from khyhhhyeee. Give prob of sequence ekh. 1/60 Two letters picked without replacement from qeecqqqqao. Give prob of sequence aq. 1/18 Two letters picked without replacement from {q: 5, w: 5}. Give prob of sequence wq. 5/18 Two letters picked without replacement from kxxnnxqqxxknqkkxxxn. What is prob of sequence xn? 16/171 Three letters picked without replacement from {u: 3}. What is prob of sequence uuu? 1 What is prob of sequence cuuc when four letters picked without replacement from {z: 4, u: 2, c: 2, q: 2}? 1/1260 What is prob of sequence axxi when four letters picked without replacement from iwiaiixixiiiaaii? 1/728 What is prob of sequence xxz when three letters picked without replacement from {x: 4, z: 15}? 10/323 What is prob of sequence pptj when four letters picked without replacement from {w: 1, j: 4, k: 3, t: 3, p: 3, n: 1}? 1/455 Calculate prob of sequence le when two letters picked without replacement from {e: 4, z: 3, l: 2}. 1/9 Two letters picked without replacement from {n: 1, u: 1, a: 1, z: 2}. What is prob of sequence ua? 1/20 Calculate prob of sequence hh when two letters picked without replacement from {h: 10}. 1 Four letters picked without replacement from {c: 2, q: 4, z: 3, v: 1, r: 1, l: 1}. Give prob of sequence vqlz. 1/990 What is prob of sequence vvww when four letters picked without replacement from wvvwvvvvwwwvvvvwvvv? 65/1292 Two letters picked without replacement from {k: 2, j: 2}. What is prob of sequence jj? 1/6 Calculate prob of sequence msce when four letters picked without replacement from {b: 1, c: 1, j: 1, m: 1, s: 2, e: 1}. 1/420 Three letters picked without replacement from utrvrvrtvvrur. Give prob of sequence uvr. 10/429 Calculate prob of sequence mv when two letters picked without replacement from {d: 3, n: 10, m: 5, v: 2}. 1/38 Calculate prob of sequence zq when two letters picked without replacement from {i: 4, k: 1, z: 1, q: 2}. 1/28 What is prob of sequence lee when three letters picked without replacement from keexeeeedrerkel? 4/195 Four letters picked without replacement from rrnrnrgqnrcrrryrnnrg. What is prob of sequence ngqr? 5/5814 Calculate prob of sequence dag when three letters picked without replacement from {a: 1, f: 1, d: 2, g: 2, p: 1}. 2/105 What is prob of sequence ay when two letters picked without replacement from iaaagiay? 1/14 Two letters picked without replacement from pww. What is prob of sequence ww? 1/3 Calculate prob of sequence bq when two letters picked without replacement from {x: 2, d: 2, l: 3, b: 6, q: 1}. 3/91 Three letters picked without replacement from {e: 4, h: 14}. Give prob of sequence ehh. 91/612 Calculate prob of sequence cjf when three letters picked without replacement from {m: 1, o: 1, f: 1, j: 4, c: 1}. 1/84 Two letters picked without replacement from {r: 1, f: 1, k: 1, u: 1, n: 1}. What is prob of sequence fr? 1/20 Two letters picked without replacement from {n: 2, f: 1, x: 2, k: 1}. What is prob of sequence xx? 1/15 Two letters picked without replacement from ffxxgffxffxffgff. What is prob of sequence fg? 1/12 Three letters picked without replacement from avpkwnwpkpkkkwpnwvnp. What is prob of sequence pvk? 5/684 Two letters picked without replacement from {i: 3, u: 12}. What is prob of sequence uu? 22/35 Two letters picked without replacement from {g: 1, d: 4, r: 5, a: 2, j: 2}. Give prob of sequence ra. 5/91 What is prob of sequence jg when two letters picked without replacement from {g: 5, j: 1, l: 2, f: 8}? 1/48 What is prob of sequence qlu when three letters picked without replacement from {k: 1, y: 1, q: 1, l: 1, u: 1}? 1/60 What is prob of sequence ivi when three letters picked without replacement from {i: 6, v: 2}? 5/28 Two letters picked without replacement from {i: 1, b: 1, q: 1}. What is prob of sequence ib? 1/6 Two letters picked without replacement from vxsztvxtvtzvts. What is prob of sequence vv? 6/91 Four letters picked without replacement from qffqqfqfffffffffqf. Give prob of sequence fqff. 143/1224 What is prob of sequence kp when two letters picked without replacement from fkpfffffeffeppfffpf? 2/171 Three letters picked without replacement from qsistctiyccs. Give prob of sequence qci. 1/220 What is prob of sequence ywg when three letters picked without replacement from {y: 2, w: 3, q: 1, b: 4, g: 1}? 1/165 Two letters picked without replacement from vtgktttvgvvtttx. What is prob of sequence vt? 2/15 Two letters picked without replacement from dlldllddllldldlldddl. What is prob of sequence dd? 18/95 Four letters picked without replacement from myofyua. Give prob of sequence mfoy. 1/420 Two letters picked without replacement from {b: 3, f: 1, v: 5}. What is prob of sequence vv? 5/18 What is prob of sequence llx when three letters picked without replacement from {x: 3, l: 4}? 6/35 What is prob of sequence ccc when three letters picked without replacement from qcqcqqqqcqcqqq? 1/91 Three letters picked without replacement from {d: 4, n: 2, s: 1, u: 6}. What is prob of sequence dnn? 2/429 Two letters picked without replacement from jjh. What is prob of sequence jj? 1/3 Four letters picked without replacement from {d: 4, f: 4, j: 12}. What is prob of sequence fjff? 4/1615 Three letters picked without replacement from aggg. What is prob of sequence agg? 1/4 Four letters picked without replacement from {f: 2, r: 3, w: 5, b: 3}. Give prob of sequence rrrb. 3/2860 What is prob of sequence oois when four letters picked without replacement from {s: 8, y: 1, z: 1, o: 2, i: 3, e: 1}? 1/910	{ "pile_set_name": "DM Mathematics" }
the terms in -2 - 50v + 3 + 47v + 3. -3v + 4 Collect the terms in 11p*2 + 8 - 14p*2 - 82 + 5p*2. 2p*2 - 74 Collect the terms in 23d*2 - 3 + 48d*2 + 1 + 14d*2. 85d2 - 2 Collect the terms in -r2 + 11r2 - 4 - 12. 10r*2 - 16 Collect the terms in -331a + 49 - 49. -331a Collect the terms in -v - 10v + 8v - v - 3v. -7v Collect the terms in -7375d + 7375d + 4d*3. 4d*3 Collect the terms in -5q + q + 5q. q Collect the terms in -7g - 63g + 1 + 44g - 61g. -87g + 1 Collect the terms in 48 - 17f2 - 48. -17f*2 Collect the terms in -10 + 41m - 38m + 10. 3m Collect the terms in -o - 4 - 9 + 3 + 5o. 4o - 10 Collect the terms in 141r3 - 126r*3 + 1 - 1. 15r*3 Collect the terms in -112397 + 0b*3 - 6b*3 + 112397. -6b*3 Collect the terms in 7q*3 + 9q*3 + 9q*3 - 22q*3 + 4q*3. 7q*3 Collect the terms in -3w*3 - 8w*3 + 9w*3 - 7w*3. -9w*3 Collect the terms in -9 + 5x + 9. 5x Collect the terms in -120r*2 + 124r*2 + 249r*2. 253r*2 Collect the terms in 768j*2 + 763j*2 - 1530j2. j2 Collect the terms in 10d + 4 - 5d - 4d - 12. d - 8 Collect the terms in -13r + 150 - 304 + 154. -13r Collect the terms in -129p + 66p + 61p. -2p Collect the terms in 209b + 8b2 + 210b - 419b. 8b*2 Collect the terms in -32h + 113h - 39h - 38h. 4h Collect the terms in -5y + y - 5y. -9y Collect the terms in -347 + 176 + 3c + 171. 3c Collect the terms in 40r*3 - 4r*3 + 3r2 + r2. 36r3 + 4r*2 Collect the terms in -21v*2 + 11v*2 - 21v*2. -31v*2 Collect the terms in -233v*2 + 2v - 132v2 - 2v. -365v2 Collect the terms in 2p*2 + 40 - 40. 2p*2 Collect the terms in -21h*2 + 22h*2 - 4h + 25h2 + 2h. 26h2 - 2h Collect the terms in 2s - 2s - 17s - 2s - 4s. -23s Collect the terms in 25t - 25t + 40t3. 40t*3 Collect the terms in -2507b*2 - 1 + 2508b2 + 1. b2 Collect the terms in 7 + 127n2 + 35n*2 - 7. 162n*2 Collect the terms in -40o*2 + 17o*2 + 22 - 34 + 12. -23o*2 Collect the terms in 9 + 17y*2 - y + y. 17y*2 + 9 Collect the terms in 16c + 3 - 3 - 12c - c. 3c Collect the terms in -33 - 32 + 65 - 81z3 + 86z*3. 5z*3 Collect the terms in 70r - 141r - 34r*3 + 71r. -34r3 Collect the terms in 69g*3 - 176g*3 - 306g*3. -413g*3 Collect the terms in 3 - 16292z - 3 + 16292z + 2z*2. 2z*2 Collect the terms in -47977g - 4g2 + 47977g. -4g2 Collect the terms in -114b + 57b + 3b*3 + 57b. 3b3 Collect the terms in -8o*3 - 14o*3 - 9o*3 + 4o*3 + 2. -27o*3 + 2 Collect the terms in -19 - 424a + 419a + 19. -5a Collect the terms in 5z2 - 5z*2 - 4z*2 + 1 - 8z*2. -12z*2 + 1 Collect the terms in 3n + 114 - 59 - 55. 3n Collect the terms in -f2 + f3 - 3f*2 + 4f2. f3 Collect the terms in -2 - 3 + 8u + 2 + 31u. 39u - 3 Collect the terms in -53n - 1391 + 1391. -53n Collect the terms in -44o*3 + 24o*3 + 25o*3. 5o*3 Collect the terms in 12i - 12i - 4i. -4i Collect the terms in -11z*2 + 11z2 - z2. -z*2 Collect the terms in 19h + 4h - 2h. 21h Collect the terms in 1043o + 1046o - 2087o. 2o Collect the terms in -123 - r3 + 3r*3 - 4r*3 + 3r3. r3 - 123 Collect the terms in 2 - 2 - 11l + 3. -11l + 3 Collect the terms in -2 - 22d2 + 7 + 1. -22d*2 + 6 Collect the terms in 4r*3 - 10r*3 + 15017 - 15017. -6r*3 Collect the terms in 578j - 1160j + 586j. 4j Collect the terms in 427b*2 - 427b*2 + 32b*3. 32b*3 Collect the terms in -15z*3 - 13z*3 + 27z3. -z3 Collect the terms in 2 - 25 - 2 - 3w. -3w - 25 Collect the terms in 10 - 2 + 57j2 - 8. 57j*2 Collect the terms in -1096h*3 + 539h*3 + 559h*3. 2h*3 Collect the terms in -21 + 6s*2 + 21. 6s*2 Collect the terms in 6n*2 + 8n*2 - 15n2 - n2 + 0n2. -2n*2 Collect the terms in -54c + 136c - 85c. -3c Collect the terms in -5m*2 - 2m*2 + 3m*2 + 5m2. m2 Collect the terms in 12w2 - 9w*2 - 2w2. w2 Collect the terms in -1060b3 + 0b + 0b + 1061b*3 + 0b. b*3 Collect the terms in 1550557 - 1550557 + 3m*2. 3m*2 Collect the terms in 0s - 15s3 + 0s + 0s - 2s*2. -15s*3 - 2s*2 Collect the terms in 3u*2 + 24 - 24. 3u*2 Collect the terms in -3m*2 + 33 - 27 + 0m*2. -3m*2 + 6 Collect the terms in 190n + 187n - 378n - 9. -n - 9 Collect the terms in 513 + 486 - 999 + x2. x2 Collect the terms in t*3 - 83t - 86t + 169t. t*3 Collect the terms in -473 - 9t + 950 - 477 + t. -8t Collect the terms in 3f - 3f - 16f*2 - 10f*2. -26f*2 Collect the terms in -102b*2 + 102b*2 + 18b*3. 18b*3 Collect the terms in -30j*3 - 29j*3 - 34j*3 + 96j*3. 3j*3 Collect the terms in -80n + n*3 + 80n - 2n3. -n3 Collect the terms in 1270p*2 - 423p*2 - 424p*2 - 422p2. p2 Collect the terms in -35t - 38t + 69t. -4t Collect the terms in -24h3 - 28h*3 - 129h*3. -181h*3 Collect the terms in -375s*3 - 92s*3 + 2s*3. -465s*3 Collect the terms in -5 + 0y3 - y3 + 2y3 - 73. y3 - 78 Collect the terms in 9p - 13p + 33 + 3p. -p + 33 Collect the terms in -3 + 3 - 218p - 357p. -575p Collect the terms in 38q - 150q + 35q + 36q + 38q. -3q Collect the terms in -9v*3 + 9v*3 - 13v*3 + 11v*3. -2v*3 Collect the terms in 24 + 2v*2 - 5v + 5v. 2v*2 + 24 Collect the terms in -2v + 54 - 54. -2v Collect the terms in -289 - 29y*3 + 289 - 3y*3. -32y*3 Collect the terms in -12t + 23t - 11t + t2. t2 Collect the terms in -742g2 + 246g*2 + 246g*2 + 248g*2. -2g*2 Collect the terms in 4975 + 4y*3 - 4975. 4y*3 Collect the terms in 162n*2 + 111n*2 - 79n*2. 194n*2 Collect the terms in -16y*2 - 2 + 2 + 13y*2. -3y*2 Collect the terms in -843s - s*3 + 843s. -s*3 Collect the terms in 39a - 4496 + 4496. 39a Collect the terms in -52j*3 - 30j*2 + 30j*2 - 39j*3. -91j*3 Collect the terms in 8 - 7j*3 - 28j*2 - 8. -7j*3 - 28j*2 Collect the terms in -5q - 142 + 12q + 142. 7q Collect the terms in -39r2 + 42r*2 - 2r2. r2 Collect the terms in -139o3 + 1 - 1 + 63o*3 + 56o*3. -20o*3 Collect the terms in 4b*2 - 24b + 33b - 2b*2 + 0b*2. 2b*2 + 9b Collect the terms in 2p3 + 0p*3 + 929 - 929 + 0p*3. 2p*3 Collect the terms in 4x*3 + 2x*3 + 6x*3. 12x*3 Collect the terms in -154 - 5q*3 + 4q3 + 86 + 68. -q3 Collect the terms in 2r2 + 9r*2 + 6r2 - r2 - 12r2. 4r*2 Collect the terms in -85 - 3g + 6g + 85. 3g Collect the terms in 45p - 35p - p*2 - 10p. -p*2 Collect the terms in 2 + 171t - 148t - 2. 23t Collect the terms in -w + 3w3 - 2508 + 2508. 3w*3 - w Collect the terms in 22h*3 - 41 + 41. 22h*3 Collect the terms in -7p + 53 - 21 + 60. -7p + 92 Collect the terms in 20h - 59h + 22h + 15h. -2h Collect the terms in -4 - 217y2 + 4 + 214y*2. -3y2 Collect the terms in 2426 - 1214 - c2 - 1212. -c*2 Collect the terms in 36j*3 - 13j*3 - 24j3. -j3 Collect the terms in 9z + 14z - 8z. 15z Collect the terms in 3 + 3i - 26 - 14. 3i - 37 Collect the terms in 12t3 - 161t*3 + 0t*3. -149t*3 Collect the terms in -23r*2 - 3r*3 + 23r*2. -3r*3 Collect the terms in -105z*2 + 2z*3 + 105z*2. 2z*3 Collect the terms in 2t*3 - 28t*3 + 20t*3. -6t*3 Collect the terms in 11y - 5y - 5y + 14y. 15y Collect the terms in -5k + 10k + 1 + 11k. 16k + 1 Collect the terms in -623k3 - 1143k*3 - 1047k*3. -2813k*3 Collect the terms in 70x + 62x + 66x + 2x3 - 198x. 2x3 Collect the terms in -65k*2 - 4k*2 + 20k*2 - 59k*2 - 2. -108k*2 - 2 Collect the terms in 5z*3 + 27 + 5z*3 - 27. 10z*3 Collect the terms in -2t - 3 + 20t + 8t - t. 25t - 3 Collect the terms in 114d + 146d + 249d. 509d Collect the terms in 15j*3 + 2038 - 11j*3 - 2038. 4j*3 Collect the terms in 2c*2 + 18 - 33 + 15. 2c*2 Collect the terms in -4z*3 + 60 - 118 + 58. -4z*3 Collect the terms in 2 + 1379f + 0 - 1378f - 2. f Collect the terms in -5h*3 + 6 - 6. -5h*3 Collect the terms in -10o*3 + 36o*3 - 10o*3 - 10o*3. 6o**3 Collect th	{ "pile_set_name": "DM Mathematics" }
Let c be q(-1). Let g be ((-8)/4)/(2/(-6)). What is the highest common factor of g and c? 6 Suppose -2a + 5z - 39 = 0, 0 = 29a - 31a - 3z - 47. Let b be 2/4(1 - -7). Let q be (a/b)/((-2)/76). Calculate the greatest common divisor of q and 19. 19 Let r be -4 - (-736)/(24/6). What is the highest common factor of 24 and r? 12 Let v(k) = 5k2 - 23k - 102. Let x be v(-5). What is the greatest common factor of 1311 and x? 69 Suppose -3w - 2618 = -20w. What is the greatest common divisor of 22 and w? 22 Let g(i) = i. Let s(p) = -12p - 19. Let a(j) = -3g(j) - s(j). Let w be a(8). Calculate the highest common factor of 13 and w. 13 Let d(w) = -91w3 - w2 - 6w - 28. Let l be d(-3). Calculate the highest common factor of l and 46. 46 Suppose -k - 12 + 351 = 2i, 2k = -6. Let h(c) = 2c - 17. Let s be h(13). What is the greatest common factor of i and s? 9 Let s = 9 + -12. Let v be (3 + s)/2 + (4 - -11). Calculate the greatest common factor of 5 and v. 5 Suppose 27 = s - 4n, s + 5n = 3n + 3. Let d(q) = 3q3 - 179q*2 - 52q - 183. Let p be d(60). Calculate the highest common divisor of s and p. 11 Let y be ((-59)/118 - 3/2)-240. What is the highest common factor of 48 and y? 48 Let w be ((-3)/(0 + 9))/(13/(-897)). What is the greatest common factor of w and 92? 23 Let t be 3/((-6)/10)-9. Suppose -5v + 5x = -395, -3v = 5x - 176 - 69. Let r = v - t. What is the greatest common divisor of r and 7? 7 Suppose 3k - 5q = -0k + 14, -k = 2q - 12. Let c be 1/(-2) + 97/2. Suppose -6s + c = -2s. What is the greatest common factor of s and k? 4 Suppose -m = -5m + 5w + 98, -w = -4m + 90. Calculate the greatest common divisor of m and 77. 11 Suppose -5f + 4q - 217 = -721, -q + 316 = 3f. Calculate the greatest common divisor of 78 and f. 26 Suppose 4y + 9 + 11 = 0, 2l - y = 67. What is the highest common divisor of l and 248? 31 Suppose 4f - 121 = 3539. Calculate the greatest common factor of 30 and f. 15 Suppose 1222 = 4o + 3z, 6o + z - 1522 = o. What is the greatest common factor of o and 19? 19 Let s be 37/(9(-2)/(-162)). Calculate the greatest common divisor of 1221 and s. 111 Suppose 5z - 4 = -2b - 14, -b - 10 = 5z. Let l be ((-1)/(-2))/(1/z). Let w be (6/(-15))/(l/95). Calculate the highest common divisor of w and 95. 19 Let s(h) = 11h - 163. Let g be s(18). What is the greatest common factor of 65 and g? 5 Let s(h) = 356h*2 + 36h + 37. Let x be s(-1). What is the highest common factor of x and 336? 21 Let u(r) = r3 - r2 + 4r - 3. Let t be u(-4). Let s = t - -102. What is the greatest common divisor of s and 1? 1 Suppose 4 + 14 = -3r. Let c be ((-16)/r + -4)-9. Suppose -13 = -p + c. Calculate the highest common factor of 175 and p. 25 Let s = 118 - 83. Let w be 1403/8 + (-27)/8 + 3. What is the highest common factor of s and w? 35 Let p(m) = -m2 - 5m + 20. Let o be p(-8). Let n(k) = -7k - 10. Let v be n(o). What is the highest common factor of v and 27? 9 Suppose 22 = 2g - 4z, 0 - 5 = -g + 5z. What is the highest common factor of 480 and g? 15 Let a(m) be the first derivative of -9m2/2 - 47m - 2. Let z be a(-6). Calculate the highest common divisor of z and 2. 1 Let r be 6/(5/(-10)-3). Suppose 213 = 2m - y, ry + 322 = 3m + 2y. Calculate the greatest common divisor of 13 and m. 13 Let c(x) = -x2 + 15x - 7. Let s be c(14). Suppose sv - 15 = 2v, o = 2v - 18. Let b be (10/(-3))/(o/18). What is the greatest common factor of 1 and b? 1 Let y be 27/(-6)2/1 + 3. Let i(u) = 8u2 + 44u + 4. Let n be i(y). What is the greatest common factor of 56 and n? 28 Suppose x = 4x - 426. Suppose 4n - x = 5a + 219, -356 = -4n + 4a. What is the greatest common divisor of n and 14? 14 Suppose -7 = 2x + 1. Let c be x/(-14) - 4384/56. Let s = -38 - c. Calculate the greatest common factor of s and 10. 10 Let t(s) = -5s - 47. Let i be t(-23). Suppose 29 = 2g - 3y - i, -4g - 2y + 170 = 0. Calculate the greatest common factor of 4 and g. 4 Let b(k) = -200k*3 + k - 1. Suppose 3f = 5z - 1, 2f = -8z + 7z - 5. Let m be b(z). What is the highest common factor of m and 18? 18 Suppose -3159 = -1358i + 1331i. What is the highest common factor of i and 533? 13 Let h = 51 - 79. Let x = h - -46. What is the greatest common divisor of x and 12? 6 Let b(h) = 4h + 91. Let q be b(-4). Calculate the greatest common factor of 100 and q. 25 Suppose -6a + 7a = 10. Calculate the highest common factor of 235 and a. 5 Let y be 1884/15 + 12/30. Calculate the highest common factor of y and 315. 63 Let w(z) = 27z*3 + 2z*2 - 5z + 3. Let i be w(1). Let v = 0 + 4. Suppose -vr + 5 = -7. What is the highest common factor of i and r? 3 Suppose -2o + 24 = 2o - 3g, -4o = -5g - 24. What is the highest common divisor of o and 6? 6 Let i = -11 + 13. Let l be (13 - 10)/(i/(-10)). Let g(p) = p*3 + 15p*2 - 6p + 15. Let t be g(l). What is the highest common factor of t and 15? 15 Let q be 15/9((-3672)/(-15))/4. What is the greatest common divisor of q and 6? 6 Let r(z) = z + 15. Let q be r(13). What is the highest common factor of 252 and q? 28 Let p(l) = -l3 + 5l*2 + 6l - 9. Let r be p(5). What is the highest common factor of 9 and r? 3 Suppose 21v - 365 - 1714 = 0. What is the greatest common factor of v and 231? 33 Suppose -a - 322 = -325. What is the greatest common divisor of a and 81? 3 Suppose 5o + 9225 = 5w, 0 = 2w - 23o + 27o - 3708. Calculate the highest common divisor of w and 504. 168 Let i(p) = 2p - 8. Let b be i(6). Suppose bm - 20 = 12. Let u be (-74 - -74) + (-12)/(-1). What is the greatest common factor of u and m? 4 Let m = 671 + -268. Calculate the highest common divisor of m and 26. 13 Let d(w) = w - 2. Let z be d(-4). Let u be (z/(-12))/((-1)/(-16)). Suppose 4a + m - u = 2m, 10 = 5a + 3m. Calculate the greatest common divisor of 3 and a. 1 Let g(m) = -2m + 0m - 2m + 2. Let p be g(-2). Let v be (4 - -1) + 19/(342/(-18)). Calculate the highest common divisor of p and v. 2 Suppose -2k - 3s + 97 = 0, 0 = 4k - s + 4s - 197. Let g = k + -77. Let j = g + 71. Calculate the greatest common factor of j and 22. 22 Suppose -74 = -3h + 4. Suppose 0 = d + 4 - 17. Calculate the highest common factor of h and d. 13 Let w(c) = 2c2. Let r be w(4). Calculate the greatest common divisor of r and 8. 8 Let q(h) = 2h*2 + 10h - 7. Let u be q(-6). Suppose -3g + 82 = 2i, -4i + 156 = ug + 18. Calculate the highest common divisor of g and 52. 26 Let w(q) = 123q + 18. Let u be w(3). Let t be (21/2)/(u/(-132) - -3). What is the highest common divisor of t and 14? 14 Let p(x) = x3 - 26x*2 - 53x - 49. Let n be p(28). What is the greatest common divisor of n and 945? 35 Let g(q) = 3q + 31. Let x be g(-8). Suppose -xt + 159 + 23 = 0. Calculate the greatest common factor of 39 and t. 13 Let k be 14(-1 - 75/(-21)). Let n(j) = 12j*2 - 2j + 1. Let c be n(2). Suppose -h - c = -6h. Calculate the highest common factor of h and k. 9 Let v(l) = l3 - 16l*2 - 17l + 22. Let q be v(17). Calculate the highest common divisor of 11 and q. 11 Suppose 4x = -9 - 3, -r - 3x = -558. Calculate the greatest common factor of 108 and r. 27 Let o(y) = 13y + 8 + 12 - 82y*3 + 81y*3 + 13y*2. Let i be o(14). What is the highest common factor of 66 and i? 6 Let n = 26 + -28. Let q be -3(0 - (n - -3)). Calculate the greatest common factor of 3 and q. 3 Suppose 31t - 336 = 24t. Calculate the highest common divisor of 6 and t. 6 Let g be 117(-1 + (5 - 3)). Let v(h) = 9h + 81. Let r be v(-8). Calculate the highest common factor of r and g. 9 Let o(r) = -r*2 - 7r + 1. Let a be o(-7). Let z be (2/a)/((-22)/(-4873)). Suppose 2j + 113 = z. What is the greatest common factor of 15 and j? 15 Let y(m) = -6m - 1. Let d be y(-2). Suppose 4q - 49 = d. Calculate the greatest common factor of 6 and q. 3 Suppose 61i - 123080 = -24i. Calculate the highest common factor of i and 8. 8 Let v = 378 - 171. Calculate the highest common factor of v and 9. 9 Let t be (-54)/(-15) + 2/5. Suppose 2p = tp - 14. Suppose 3h - 5u - 143 = 0, 45 = -5h + 5u + 300. Calculate the highest common divisor of h and p. 7 Let a(b) = b2 + 11b - 118. Let u be a(-19). What is the highest common factor of u and	{ "pile_set_name": "DM Mathematics" }
58x2 - 1 - 2 - 242x*a + 3x. Calculate 4c(i) - 3q(i). 13i2 Let p be (1(0 + -3))/(-1). Let r(i) = -5i + 2. Let h(t) be the third derivative of -t4/24 + 8472t*2. Calculate ph(a) - r(a). 2a - 2 Let i(c) = 17c*2 - 8c - 7. Let w(g) = 20g2 - 7g - 5. Determine -5i(o) + 6w(o). 35o2 - 2o + 5 Let x(p) = 12p3 + 131p*2 - p. Let y(g) = -49g*3 - 551g*2 + 4g. What is -9x(k) - 2y(k)? -10k3 - 77k*2 + k Suppose -126a = -134a + 8. Let g(v) = 9v*3 - 6v. Let h(p) = -p. Give ag(r) - 4h(r). 9r3 - 2r Let n(a) be the second derivative of -5a4/12 - 5a*3/6 + 3a*2/2 + 137a - 5. Let h(t) = 14t2 + 16t - 10. What is 3h(b) + 10n(b)? -8b2 - 2b Let w(o) = 6o2 + 11o + 39. Let z(g) = 4g2 - 2g - 1. Give -w(s) - 5z(s). -26s*2 - s - 34 Let a(j) = 12j + 2. Let l(p) be the third derivative of -p4/6 - p3/6 + 2p2 + 262. Give 2a(s) + 7l(s). -4s - 3 Let w(j) = -5j - 1 - 6 - 1. Let b(m) = 17m + 30. Let u be b(-4). Let q = -40 - u. Let o(k) = k + 2. Determine qw(l) - 9o(l). l - 2 Suppose 74d - 14 = 76d. Let r(s) = 8s3 - 9s - 5. Let b(f) = -4f3 + 4f + 2. Determine db(v) - 3r(v). 4v3 - v + 1 Let c(l) = -10l - 6. Let r(b) = -3b - 2. Let v be r(-6). Suppose 787 = 4x - 3s + 751, 5x + s - 7 = 0. Let i(q) = 2q + 1. Give vi(m) + xc(m). 2m - 2 Let j(x) = -x*2 + x - 1. Let s(q) = 7q*2 + 4q - 10. Determine -7j(r) + s(r). 14r*2 - 3r - 3 Let m(z) = -1. Let v(x) = -58x - 871. Let a be v(-15). Let t(p) = -2p + 16. Give at(u) - 5m(u). 2u - 11 Let l(m) = m - 5. Let u be l(7). Let f(x) = -x + 1. Let c(v) = v. Let q = 49 + -12. Let z = q - 36. Determine uc(j) + zf(j). j + 1 Let z(o) = o2 - 7o2 + 4 - 6 - o + o2. Let v(x) = x*2 + 28 - 2 + 27 + 26 - 78. Give 4v(b) + z(b). -b2 - b + 2 Let q(b) = -b2 + b + 6. Let n(p) = -p*2 - 42p + 20. What is n(d) - 3q(d)? 2d*2 - 45d + 2 Let h(s) = s + 1. Let g(c) = 30c + 24. Let z(p) = -10p - 8. Let d(u) = -4g(u) - 11z(u). Let m be (-2 - (-156)/(-13))(7 + (-265)/35). What is mh(w) + d(w)? -2w Let i(k) = 22k + 6. Let s(r) = 386r + 54r - 35 + 93 + 63. Give 121i(n) - 6s(n). 22n Let f(s) = 116s*2 - 15s - 27. Let c(z) = -9z2 - 1. Determine -13c(a) - f(a). a*2 + 15a + 40 Let m(o) = 5o. Let x(d) = -14d. Let b(t) = -17m(t) - 6x(t). Let w(k) = -6k + 1. Let u = 176 - 160. Let i be 1/(-2) + (-56)/u. Calculate ib(f) + w(f). -2f + 1 Let z(f) = 3f + 13. Let k(a) = -34a + 5. Let q(g) = -11g - 4. Let b(w) = -2k(w) + 7q(w). Determine -3b(d) - 8z(d). 3d + 10 Let r(v) = -13v*2 + 130v - 379v + 124v + 121v. Let p(w) = -w3 - 38w*2 - 11w. Give 4p(b) - 11r(b). -4b3 - 9b*2 Let x be 2/(-4)0/(-2). Suppose -4t + 14 + 6 = x. Let b(d) = -23 - 4d + 11 + td2 + 14. Let p(v) = 14v*2 - 11v + 5. Give 11b(z) - 4p(z). -z*2 + 2 Let l(y) = -5 + 2 - 4y + 3y. Let v be (2 - 3) + 13 + 3/3. Let a(z) = vz - 40z + 16z + 8 + 13z. Determine 5a(g) + 12l(g). -2g + 4 Let f(m) = m*2 + 11m - 18. Let v(t) = -t + 1. Give -f(r) - 2v(r). -r2 - 9r + 16 Let k(z) = -39z2 - 8z - 2. Let v(a) = 7a2 + 2a + 1. Let y(f) = k(f) + 2v(f). Let b(o) = 100o*2 + 15o. Determine 4b(c) + 15y(c). 25c2 Let b(z) = -3z + 9. Let w(t) = -808t - 7272. Determine 808b(g) + w(g). -3232g Let i(r) = -6r2 - r + 4. Let v(l) = -l2 + 1. Suppose -149 - 75 = -14w - 28. Calculate wv(k) - 2i(k). -2k*2 + 2k + 6 Let o(q) be the first derivative of -q3/3 - q2/2 - 1352. Let n(b) = 29b3 + 5b*2 + 5b. Give n(w) + 5o(w). 29w*3 Let n(r) = -4r - 5. Let t(m) be the third derivative of m*4/8 + 2m*3/3 - 71m*2 + 2. Calculate 2n(h) + 3t(h). h + 2 Let j(q) = -12q - 192. Let g be j(-7). Let i(k) = k*2 + k - 1. Let t(h) = -66h*2 - 54h + 54. Give gi(y) - 2t(y). 24y2 Let n(b) = 2b*2 + 2b + 2485. Let o(v) = 3v2 + 2v + 2503. What is 4n(d) - 3o(d)? -d*2 + 2d + 2431 Let q = -87 - -89. Let s(r) = -4r + 10r*3 + 4r - 9r3 - qr*2. Suppose 4l = -0l - 8. Let x(o) = -4o*3 + 9o*2. Determine lx(m) - 9s(m). -m3 Let j(k) = 2k*2 - 2k + 2. Let v be j(3). Suppose 4o - 2 - v = 0. Let s(r) = 154r - 5 - 472r + 164r + 153r. Let g(q) = -2q - 11. Give og(w) - 9s(w). w + 1 Let y(f) = f - 6. Let n(t) = 1426t - 714t - 711t - 7. Calculate -6n(o) + 7y(o). o Let u(c) = -3c*2 - 5c + 1. Let w = 24570 - 24572. Let j(x) = -4x2 - 6x + 2. Determine wj(b) + 3u(b). -b*2 - 3b - 1 Let c(h) = 16517h - 71. Let s(l) = -8261l + 43. What is -3c(r) - 5s(r)? -8246r - 2 Let v(q) = 681q*2 + 9. Let r(y) = 342y*2 + 3. Determine 7r(g) - 3v(g). 351g*2 - 6 Let v(f) = 4f*2 + 1. Let d(n) = 5n*2 + n + 1. Let p = 33 + -13. Let j = p + -11. Suppose 0 = 3c + j. Give cv(b) + 2d(b). -2b2 + 2b - 1 Let v(p) = -116p - 12. Let i(w) = 176w + 19. What is -5i(o) - 8v(o)? 48o + 1 Let v(w) = 3w*3 + 57w*2 + 10w - 17. Let y(n) = -4n3 - 59n*2 - 12n + 18. What is 6v(z) + 5y(z)? -2z3 + 47z*2 - 12 Let p(i) = 5i*3 - 3i - 4. Let d(f) = 2f2 - 13f - 4. Let g be d(7). Let y(s) = -4s3 - 13 + 2s - 8 + 35 - 11. Give gy(w) + 2p(w). -2w3 + 1 Suppose 17d = 13d + 4h + 64, 3d - 4h = 57. Let o(v) = 15v3 + 6. Let m(g) = -14g*3 - 5. What is dm(c) + 6o(c)? -8c*3 + 1 Let a(c) = -50c*2 + 4c + 10. Let b(n) = 52n2 - 5n - 6. Calculate 2a(t) + 3b(t). 56t2 - 7t + 2 Let p(a) = -3a. Let x(o) = 0 - 18o + 6 + 0 - 6. What is -9p(m) + 3x(m)? -27m Suppose 0 = 28p + 562 - 170. Let t(m) = -3m - 3. Let k(q) = 16q + 14. Calculate pt(y) - 3k(y). -6y Let j(s) = -2s - 580 + 12s3 + 5s*2 + 0s*2 - 565 + 1141. Let z(u) = -6u*3 - 3u*2 + u + 2. Calculate 3j(y) + 5z(y). 6y3 - y - 2 Let f(q) = -q2 - 1. Let n(k) = -10k3 - 2k*2 - 25k - 16. Let j(x) = -7x3 - x2 - 16x - 11. Let c(t) = 7j(t) - 5n(t). What is c(b) + 3f(b)? b3 + 13b Let w(z) = 6517z - 198. Let f(n) = -6516n + 148. Calculate 4f(a) + 3w(a). -6513a - 2 Let q(d) = 2d*2 - 16d + 1. Let l(b) = -1334b + b2 + 2646b - 1317b. What is 7l(r) - 2q(r)? 3r*2 - 3r - 2 Let x(c) = 2c + 9. Let u(f) = 3f + 8. Suppose -g - 639 = -2y - 624, -g = y + 3. Determine yu(s) - 5x(s). 2s - 13 Let k(w) be the first derivative of w - 62. Let s(y) = 4y2 + 2y - 4. Give 3k(h) + s(h). 4h*2 + 2h - 1 Let j(p) = -7p3 + 2p*2 + 41p + 2. Let c(t) = -22t3 + 7t*2 + 119t + 7. What is -2c(o) + 7j(o)? -5o3 + 49o Let a(k) = 3312k2 - 216k + 432. Let q(b) = -3b2 + b - 2. Calculate 4a(v) + 864q(v). 10656v*2 Suppose 2v - 16 = 3k, -v + 0v + 4k + 18 = 0. Let b be (0 - 7/v)/(4/(-8)). Let i(p) = 10p - 6. Let y(t) = 3t - 2. What is by(a) - 2i(a)? a - 2 Let i(s) be the first derivative of 3s*4/2 - 15s*2/2 + 9730. Suppose 5r = -2x - 40, -6r = -2x - 3r - 24. Let n(t) = t*3 - t. What is xn(a) + i(a)? -9a3 Let c(y) be the second derivative of -y5/20 - y2/2 + 3y - 22. Let o(k) = 8k3 + 5. Let u = -18 + 13. Determine uc(s) - o(s). -3s3 Let h(j) = -12j*3 - 9j2 + 9. Let p(c) = -c3 - c*2 + 1. Suppose -9 = -3y - o, -99o + 12 = -103o. Calculate yh(k) - 36p(k). -12k3 Let k(i) = -8i + 580. Let a(h) = h + 13. Give -9a(v) - k(v). -v - 697 Let o(d) = -92d - 17. Let n(w) = 756w + 141. Let p(g) = -4n(g) - 33o(g). Let a(k) = 13k - 2. Give 3a(l) - 2p(l). 15l Let v(g) = 9g + 1773. Let b(k) = 2k - 42. Calculate 4b(x) - v(x). -x - 1941 Let g(m) = 4m3 + 10m*2. Let c(h) = -3h*3 - 11h*2. Suppose 4q = -3n + 8, 244q - 241q - 5n = 6. Determine qg(a) + 3c(a). -a*3 - 13a*2 Let y(r) = 2r*3 + 3r - 3. Let k be 26/8 + 24/(-96). Suppose -kl = -10 + 1. Let x(j) = j3 - 4j - 4j3 - 4 + l + 5. Determine -3x(v) - 4y(v). v3 Let o(s) = s3 + 4s*2 - 43s - 5. Let i(k) = 4k3 + 9k*2 - 87k - 11. What is 4i(h) - 9o(h)? 7h3 + 39h + 1 Let a(h) = 3h2 - h - 4. Suppose -8n + 3n = 30. Let i(v) = -v + 8019v*2 - 11 - 8015v*2 + 6. Let f be (((-3)/(-2))/1)/(3/14). Give fa(r) + ni(r). -3r*2 - r + 2 Let z(v) = -2v - 8. Let d be z(-6). Let r(k) = -d + 4k - 13k + 10k. Let c(t) = -36096t + 8 - 1 + 0 + 36094t. What is -3c(o) - 5r(o)? o - 1 Let j(h) = 7h + 2. Let f(p) be the third derivativ	{ "pile_set_name": "DM Mathematics" }
Let o = -10 + y. Which is the second biggest value? (a) o (b) 2 (c) -2/9 a Let l be -2 + 3 - 9/(-6)-2. Which is the second biggest value? (a) 5/3 (b) l (c) 0.1 (d) 0.2 d Let k = -27/10 + 33/10. Which is the biggest value? (a) k (b) -4 (c) -0.07 a Let t = 9 - 5. Let b = t - 1. Let w be 13/20 + 1/(-4). What is the smallest value in w, b, -0.1? -0.1 Let g be (-6)/(-22)16/(-18). Let y = g + 106/165. What is the third biggest value in 0.3, 3, y? 0.3 Let q = -120 - -122. What is the third smallest value in q, -46, -5? q Let r be (60/225)/((-6)/5). Let k = 0.1 + -0.2. What is the smallest value in 0.4, r, k? r Let a = 0.1 + -0.6. Let l be 2/113 - 0/(-1). Let z = l - 119/339. What is the smallest value in z, 1, a? a Let d be (2/(-21))/(4/6)2. Let u = -2 + 4. Suppose 2r = 2 + u. What is the third biggest value in r, d, -2? -2 Let g = -0.22 + -0.08. Which is the fourth biggest value? (a) -1/3 (b) -11 (c) g (d) 5/6 b Let t be 2/8 - 90/(-24). Let l = t + -1. What is the third smallest value in 5/2, l, 1? l Let n = 12 + -10. Let z be -3 - ((0 - n) + 0). What is the third smallest value in 5, -0.4, z? 5 Suppose 4h - 8 = v, 0 = -2v + 5v + 4h + 24. What is the third smallest value in -1, v, 3/4? 3/4 Let y be (2 + 1)15/(-9). Suppose -3d - 6 = 0, -3d - d = x + 10. Which is the second biggest value? (a) x (b) y (c) -0.3 a Let b = 3.35 - 0.35. What is the second smallest value in -1, 1, b? 1 Let v be (-7)/(-3) - 6/(-9). Let f be 2/(-7) + v/(-63). Which is the third smallest value? (a) f (b) -5 (c) 0.4 c Suppose 4h + 6 = -0h + z, 5h - 3z + 4 = 0. Which is the biggest value? (a) 24 (b) -0.4 (c) h (d) 1/5 a Let m = -0.04 - -0.44. Which is the second biggest value? (a) 0.3 (b) m (c) 1 b Let r = 2/65 + 246/455. What is the second biggest value in r, 0.1, -2? 0.1 Let w be (-21)/98/28. Which is the third biggest value? (a) 0.1 (b) w (c) -4 c Suppose 13k = -1 - 12. What is the second smallest value in -9, k, -0.4? k Let p be -3 + 2/2 - 1. Let m = -3 + 7. Which is the biggest value? (a) m (b) p (c) 0.3 a Suppose -5y = -3r, 2r = -2r + 2y - 14. Let j = 9 + -4. What is the biggest value in j, -4, r? j Let k = -0.5 - -1. Let t = 137/2 - 69. Which is the smallest value? (a) t (b) 0.1 (c) k a Let o = 7/3 - 25/12. Which is the third smallest value? (a) -3 (b) o (c) -0.4 b Let k be (3/(-12))/(-1)(-4)/4. What is the third biggest value in -1, k, -0.1? -1 Let d = -37 + 44. Which is the third biggest value? (a) d (b) 5 (c) 1/7 c Let f = 3.2 + -1.2. Which is the second biggest value? (a) 1/7 (b) -2/23 (c) -2 (d) f a Let a be 552/(-10)(-2)/4. Let n = a - 28. Let k = -3 - 1. What is the biggest value in n, -0.3, k? -0.3 Let h = 1 + -1.5. Let y = 1.5 + h. Let d = -4 - -6. What is the second biggest value in -1/4, d, y? y Let x = -0.17 + 0.17. Let i = -0.1 + 1.1. Let l = -3 + 0. What is the smallest value in x, i, l? l Let v = 0.6 - 0.5. Let y = 2 + 5. Let g = -10 + y. Which is the second smallest value? (a) g (b) 5 (c) v c Let n = -1.3 - -0.9. Which is the third biggest value? (a) -5/4 (b) 1/2 (c) n (d) -0.1 c Let d = -0.14 + -0.16. What is the smallest value in d, 0.2, 6? d Let q = -6 + -15. Let j = q - -12. Let p = j - -4. Which is the third biggest value? (a) 2/5 (b) p (c) 4 b Let z = -92/7 - -274/21. Which is the smallest value? (a) 0.1 (b) z (c) 5/2 b Let a = -4.2 + -0.8. Let t(q) = -q*2 + 4q - 2. Suppose -3n = -1 - 8. Let x be t(n). What is the third smallest value in 0, a, x? x Let s = 8.5 - 3.6. Let b = s - -0.1. Let l = b + -6. What is the second biggest value in l, 2/5, 1/3? 1/3 Let k = 13 - 65. Let q be ((-15)/(-6))/(2/k). Let r be 1/4 + q/20. What is the smallest value in r, 0.4, 3/2? r Suppose 52 = -2r + 58. Which is the biggest value? (a) r (b) -3 (c) -10 a Let r = 0.44 + 0.06. What is the second biggest value in -0.1, r, 2/5, 5? r Let t = -0.3 - -0.1. Let s = t - -0.6. Let l = 156 - 152. Which is the third smallest value? (a) -0.5 (b) s (c) l c Let w be (-3)/(-14)(-4)/(-3). Let p = 0.02 + 0.58. Let m = p + -1. What is the third biggest value in 3/8, w, m? m Let n = -3 + 1. Let l = -0.82 - -1. Let d = 0.08 - l. What is the smallest value in d, -1/3, n? n Let f be -1 - (-1 - 0 - 0). Let g be 1/5 - (-102)/(-60) - -2. Let p be (-2)/(1/((-2)/7)). What is the second biggest value in f, p, g? g Suppose m + 22 = 5n, -2m - 2m = 2n - 22. Let f be -2m/45-5. Which is the smallest value? (a) 1/6 (b) f (c) 0.4 a Let w = -3.97 - 0.03. What is the third smallest value in -2/9, -0.4, w? -2/9 Let v = -14.6 - -15. What is the smallest value in v, -2/15, 1/2? -2/15 Let t = 24.4 + -24. Which is the third biggest value? (a) 1/7 (b) t (c) -5 c Suppose 5p = 2p - 27. What is the biggest value in -0.5, 3, -0.1, p? 3 Let d(v) = -v3 + 4v*2. Let g = 3 - -1. Let u be d(g). Suppose j - 3r - r - 20 = u, 0 = r + 4. Which is the second smallest value? (a) -2 (b) j (c) -0.3 c Let j = -0.2 + 0.3. Let y = -0.2 + j. Let p be ((-4)/(64/12))/(36/(-32)). What is the biggest value in p, y, 2? 2 Let i = 5.6 + -6. Let k = -139147/108 + 1302638011/1010988. Let j = 2/407 + k. Which is the second biggest value? (a) j (b) i (c) -0.1 c Let c = 4.6 - 5. Let t = 3.976 - -0.024. What is the third biggest value in c, -0.5, t? -0.5 Let w = -71 - -66. What is the third smallest value in 5, w, 4/11? 5 Let x = -0.98 + 2.08. What is the smallest value in -2/5, x, 1, -3? -3 Let v = 19/30 - 3/10. Let t = 15/2 - 8. Suppose -14 = -q - 3k, 2q - 3k - 1 = -0. Which is the biggest value? (a) q (b) v (c) t a Let u = 14 + -43/3. Let o = 20 + -25. What is the biggest value in 2/11, o, u? 2/11 Let p = -314/623 + -6/89. Suppose 4t - 20 + 4 = 0. Which is the second smallest value? (a) -0.05 (b) p (c) t a Let u = -3.1 - -3. Let p = 4.09 - 0.09. Let c = -3.8 + p. What is the third smallest value in 1, c, u? 1 Let m be (-218)/21(-22)/(-20). Let z = m + 79/7. Which is the second biggest value? (a) 2/5 (b) 4 (c) z a Let h = -0.35 + 0.35. Let v = -4 - -3.6. Which is the second smallest value? (a) h (b) v (c) 0.2 a Let u be (6 - 3)/(3 + -2). Let z be 1 + u - 3/1. Let y = -6 - -29/5. Which is the smallest value? (a) y (b) 2 (c) z a Let f(w) = w + 8. Let l be f(-7). Suppose 0 = -4u - 2h + 24, 3u - h - 14 = -l. Which is the third biggest value? (a) -0.4 (b) -2 (c) u b Suppose 2f + 0f - 5j = -25, -3j + 15 = 2f. Suppose -2z + 0 + 14 = 0. Suppose 4i + 12 = zi. Which is the third biggest value? (a) f (b) 3/5 (c) i a Let z = 0.2 - 0.2. Let j = z - -4. Let k = -3.8 + j. What is the biggest value in 2, k, 5? 5 Let m be (-92)/(-6) + (-8)/(-48). Let g = m + -153/10. Let r = 0.38 - -0.02. What is the smallest value in r, g, 1/8? 1/8 Let b = -11 - -11.04. Let s = b + -0.14. Let k = -0.32 + 0.02. What is the smallest value in -3, s, k? -3 Suppose 8 = -5v - 2. Let o be 1v + (-22)/(-10). Let d = -0.08 + -3.92. What is the smallest value in o, -2, d? d Let r(f) = 6f. Let y be r(3). Suppose t - y = 5u, -4u + 6u + 21 = 5t. Let c be 3/(-15) - 14/(-20). What is the second biggest value in -0.2, c, t? c Let k = 1056 - 1076.09. Let y = k + 20. Let l = -5.09 - y. Which is the second biggest value? (a) 1/6 (b) l (c) -1/2 c Suppose -5d = -11 - 9, 0 = o + 2d - 3. Let z = -0.14 + 0.64. Which is the third smallest value? (a) 0 (b) o (c) z c Let d = -51/20 - -14/5. Let u be (-1 - 1) + 14/2. What is the third smallest value in 2, u, d? u Let r(j) = j*3 - j. Let m be r(1). Let c = -3 - -1. What is the biggest value in c, m, 0.3? 0.3 Let z = -0.382 - -0.282. Let p be 4/(-90) - 4/10. What is the third biggest value in 0.4, z, p? p Let j = -2/63 - -71/252. Let h = -0.7 - -1. Which is the biggest value? (a) h (b) 2 (c) j b Let h = 1.5 + -1. Let t = 0.01 + -0.01. Let k = 9 + -6. What is the smallest value in t, h, k? t Let j = 0.06 - 3.06. What is the smallest value in 2/9, 0.4, j? j Let f be 17/3 - 6 - (-2)/(-3). Let y = 7 + -4. What is the third biggest value in f, y, 0.1? f Let q = -16 - -14. Let p be 48/(-315) + q/(-7). Which is the smallest value? (a) 1/17 (b) -0.1 (c) p b Let x = 0.6 + -3.6. Let o be (-4)/(-14) + 60/(-14). What is the smallest value in x, 2/9, o? o Let b = 4 - 4.3. Let p = 0.022 + 0.2	{ "pile_set_name": "DM Mathematics" }
uppose 18 = -2l - l. Is k(l) composite? False Is (-5)/((-15)/1224) - 1/(-1) prime? True Suppose 0 = 3s - 230 - 112. Suppose g + l - s = 0, 5g - g = -3l + 460. Let c = g - -9. Is c a composite number? False Let v = -277 - -614. Is v prime? True Let s(p) = 3p + 2. Let q be s(-2). Is -3q(-4)/(-8) composite? True Suppose 2b - 2k + 4 = 0, -2 = b + 3b + 2k. Is (357/(-3))/1b prime? False Suppose 2c + 4 - 12 = 0. Suppose k = ck - 18. Is k a composite number? True Let c(j) be the second derivative of -j + 0 + 23/12j4 + 1/6j*3 + 1/2j*2. Is c(-1) prime? True Let c be 4(-2 + 36/(-16)). Let n(m) = -m*3 - 17m*2 - 7m - 4. Is n(c) composite? True Suppose 0 = 5k - 2516 + 851. Suppose a + 2a = k. Is a composite? True Let f(h) = h - 3. Suppose -g - 2q + 5 = 0, 4g + 9 = 5g + 3q. Let o be f(g). Is ((-9)/o)/(3/8) a composite number? True Let l(w) = -87w. Let s be l(-5). Let n = 646 - s. Is n a composite number? False Let j(b) = -b3 + 7b*2 - 4b - 8. Let q be j(6). Suppose qz + 4o - 434 = 2o, -2z = -3o - 237. Is z prime? False Let y = -4 + 3. Let w be ((-1)/(1/2))/y. Suppose -wl = 23 - 65. Is l a composite number? True Suppose 2p = -0p. Let l = 6 + -1. Suppose lv - 2v - 159 = p. Is v a composite number? False Is (0 - -404) + 2 + 1 composite? True Let k(n) = -2n2 - 6n + 7. Let u be k(-5). Let f = 36 - u. Is f a prime number? False Let k(i) = -i*2 - 8i + 4. Let f be k(-7). Is (-2)/(-2)0 + f a prime number? True Let p = 0 + 2. Let d = p - -29. Is d a prime number? True Suppose c + 125 = 6c. Is (1(-1 - c))/(-2) prime? True Let a(n) = 25n*2 - 6n - 2. Let o be a(-4). Suppose 5t - 3t - o = 0. Is t a composite number? False Let j(o) = o - 1. Let f(a) = 6a2 + a - 6. Let w(x) = f(x) + 2j(x). Let n be w(7). Suppose -2h = -3i - 6h + n, 8 = 2h. Is i a prime number? True Let n(y) be the third derivative of -y6/120 + y5/10 + y4/8 + y3/3 - y*2. Suppose -5d = -2 - 13. Is n(d) composite? True Let d(c) = -2c + 4. Let t be d(3). Let u = t + 4. Is u((-33)/(-6) + -2) prime? True Suppose 0d + d + r - 8 = 0, 36 = 5d + 4r. Let g(x) = 2x*3 + 3x*2 - 3x - 1. Is g(d) a prime number? True Let q(l) be the third derivative of 149/6l3 + 1/24l*4 + 0l + 0 - 1/120l6 - 1/60l5 + l2. Is q(0) a prime number? True Let w = -163 - -3882. Is w composite? False Let o = 143 + 536. Is o composite? True Let b(g) = -618g - 25. Is b(-4) a prime number? True Let p(y) = y3 + 8y*2 + 3y - 4. Let t be p(-7). Suppose 4c + 12 = 0, -4c = 4b - 8c - t. Suppose bf - 56 = -f. Is f composite? True Let b be ((-2)/(-3))/(4/18). Suppose 2u + bu = -10, 0 = 2n - 5u - 56. Is n a composite number? False Let p(r) = -r3 + 3r*2 + 17r - 5. Is p(-6) prime? False Suppose 3a - v - 542 = 0, 5 = -4v + 9v. Is a prime? True Let r be (-3)/(1 - (-6189)/(-6180)). Suppose -3k = 2k - r. Is k/12 - 2/(-3) prime? False Let t = 2639 - -2420. Is t a composite number? False Suppose 152 - 2 = -5t. Let d = t - -92. Is d prime? False Suppose 3d - y - 725 = -3y, 479 = 2d - 3y. Suppose -d = -t - 74. Is t prime? True Let q(w) = 55w + 129w + w - 10. Let m be q(7). Suppose 0h = 5h - m. Is h a composite number? False Let q(l) = 15l3 - 5l*2 - 3l + 9. Is q(4) composite? False Let a(j) = 3j3 + 5j*2 - 5j - 13. Is a(6) prime? False Suppose -4x + 544 = 3p, 0p = -3x - 3p + 411. Is x prime? False Let f(x) = 2x*2 + x. Let t be f(1). Suppose 6l - 45 = 5l - 4k, tl - 2k - 149 = 0. Is l composite? True Let i(d) = -16d - 18. Is i(-7) a composite number? True Let o = 5 - 5. Let a(s) = s2 + 1. Let b be a(o). Is -4(b + (-234)/8) a prime number? True Let z = -19 - -28. Suppose 3 + z = -4w, -2w - 8 = l. Is l/(5/((-895)/2)) a prime number? True Suppose -5l = -87 - 43. Suppose 2t - 5u = l, u + 66 = 4t - 2u. Suppose d - t = -3. Is d prime? False Suppose r = -13r + 12418. Is r a composite number? False Let d be (0 + 2)(-9)/(-2). Let i = d + -13. Let u(g) = -8g - 1. Is u(i) a composite number? False Is (60/16)/(-5)-188 prime? False Suppose -1235 = -2k - 3k. Let u = k - 68. Is u composite? False Suppose z + 43 = 2o, 151 = 2z - 5z - 5o. Let y = z + 70. Is y composite? False Suppose -t + 75 = -4g + 5g, 0 = -2g - 4t + 146. Is g composite? True Let g(i) = 6i*2 + 5i + 10. Is g(9) prime? True Let w be (-374)/(-14) - (-2)/7. Is (-392)/(-18) - (-6)/w prime? False Suppose 4g - 5g - t = 1, 2g - 5t = -2. Let x be (26/(-4))/((-2)/12). Is g/(1 + (-40)/x) composite? True Suppose 0 = -4o + 5o - 35. Is o composite? True Suppose -8d - 645 = -3d. Let a = d + 242. Is a composite? False Let o(r) = -31r. Let d(b) = b + 8. Let f be d(-7). Let v be f + 5/(5/(-2)). Is o(v) composite? False Suppose 13 - 48 = -c. Suppose 0 = -3h - 14 - 16. Is h/4(-966)/c a prime number? False Let i(h) = 9h*3 - 5h*2 - 4h + 2. Let w be i(4). Is (-2)/(-4) - w/(-4) composite? True Let f = 5833 - 3860. Suppose 5r + 2n = f, -3r - 3n + 1180 = 2n. Is r a composite number? True Suppose -4m = -4, 0m + 3m + 92 = s. Let p(h) = 4h2 + h + 1. Let k be p(-1). Suppose -x + s = kx. Is x composite? False Suppose -3i = 4i - 35. Suppose 0 = -4g + 4h + 200, -g + ih = -6g + 280. Is g a composite number? False Let o(q) = -q*2 + 10q - 9. Suppose 0 = -4k - 28 + 8. Let z(g) = -g2 - 5g + 6. Let u be z(k). Is o(u) a prime number? False Suppose 0y = 4y - 16. Is (2/(-3))/(y/(-762)) composite? False Let j = -188 - -100. Is 2438/22 - 16/j prime? False Suppose -3y + 634 = -y. Let x = y - 190. Is x prime? True Suppose -62 - 50 = -2v. Suppose v = s - 21. Is s prime? False Suppose -3n + 2 = -13. Suppose -nk + 597 = p, 0p - 4k = -2p + 1166. Is p a prime number? True Suppose -11v + 1418 = -9v. Is v composite? False Suppose -3q - 4o = -22, -4q + 2 = -o - 2. Suppose -38 = -u + 3z, u = qz + 36 + 1. Is u prime? False Suppose 15 = 3m + 3l, 4l - 14 = 4m - 2m. Is ((-2286)/12)/(m/(-2)) prime? False Suppose 3q + 38 = 4g, 5q + 5g + 37 = -38. Is 4/q - 2893/(-7) composite? True Is ((-157)/2)/(4/(-8)) composite? False Suppose 24 = -4x - 4a, 3x + 5a + 24 = -2. Let m(p) = 2p*2 - p + 3. Is m(x) prime? True Is -2 + (-25)/(-20) - (-18670)/8 prime? True Suppose -4g = 33 - 233. Let x = 691 - g. Is x a prime number? True Suppose -95 = -b - 5u, -207 + 45 = -2b + 4u. Is b a prime number? False Is 2/(-4) - (-8870)/20 a prime number? True Let d be 12 - (10 - -13). Is 7/d - 1006/(-3) composite? True Suppose -4p - 4g = -16, 5g - 52 = 5p - 22. Is (3 + -4)(p - 78) a composite number? False Is (-5606)/(-30) - (-4)/30 prime? False Let o = 3222 + 1641. Is o a composite number? True Let i = 2 + -7. Let o(k) = -7k*2 + 4k - 13. Let j(w) = -3w2 + 2w - 6. Let x(v) = ij(v) + 2o(v). Is x(7) prime? False Suppose 1693 = 5y - 2197. Is y a prime number? False Suppose 0 = 9u - 10u + 1059. Suppose 2p = -p + u. Is p a prime number? True Let m(i) = 9i2 + i - 1. Suppose v + 11 = -2q - 5, -4q - 20 = -4v. Let f be (-1 - 0)(-4 - q). Is m(f) prime? False Let b = -5 + 8. Is (b - 0)322/6 a prime number? False Let y(n) = 4n2 - 3n + 3. Is y(4) a prime number? False Suppose -5d = -4d - 221. Let h = 408 - d. Is h composite? True Suppose u = -3, 0 = 3d - d - 3u - 9. Suppose d = -4o + 3y + 10, 0 = -o - 3y + 4y + 2. Suppose 0 = 3f - l - 62, 0 = -of - 3l + 70 - 9. Is f prime? True Let v(l) be the third derivative of l5/60 + l4/8 + l3/3 + l2. Let h be v(-6). Is (-1)/(-3) + h/3 a prime number? True Let r be (13/(-39))/(1/(-6)). Suppose j + 4t = 293, rj = -3j + 2t + 1465. Is j a prime number? True Let f(d) = -d2 + d + 1. Let w(n) = n3 + n2 - 2n. Let a(y) = 2f(y) - w(y). Let i be a(-4). Suppose -2s = is - 148. Is s prime? True Let m(j) = j3 - j + 37. Let v be (1 - 0)-1 + 1. Let d be m(v). Suppose -5q + n + 6 = -d, q + 3n = 15. Is q a composite number? True Suppose 4o - 1540 = 672. Is o prime? False Let u = 867 + 346. Is u a composite number? False Let q = 646 - 109. Suppose -8m - q = -11m. Is m a prime number? True Suppose 4l + l + 12930 = v, -51810 = -4v + 2l. Is v composite? True Let s(o) = 7o3 + 4o + 1. Let v be s(3). Let l be 0/(9/(-3) - -4). Suppose -3r - 4y + 2y = -106, -5r + 3*y + v	{ "pile_set_name": "DM Mathematics" }
+ -896007? -896006.924 Work out -63244085 - -0.06. -63244084.94 What is 0.16 minus -5108754? 5108754.16 2 + -27614129 -27614127 What is 0.116979597 + 435? 435.116979597 What is -0.1 + 12257795? 12257794.9 -601.9033 - -0.002 -601.9013 Work out 51347 + -220.4. 51126.6 What is 18 minus 1.71755? 16.28245 Calculate -0.015504352 - -0.2. 0.184495648 Calculate -25969 + 646. -25323 -0.5769 + 2.24 1.6631 What is -9.30028 + 0.195? -9.10528 2000112+0.19 2000112.19 Work out -239714 - 6418. -246132 1628839.24 - -1 1628840.24 Work out 0.04 - -3031656.557. 3031656.597 What is -2.77723 less than -0.052? 2.72523 What is -129.1 less than 1100.9048? 1230.0048 What is the distance between 5.1127 and -2.0132? 7.1259 What is -78188539.25 + 0.1? -78188539.15 Add together 5 and 7129567. 7129572 Add together -0.21 and 245692.0274. 245691.8174 What is -4 less than -817318376? -817318372 -62515 - 574590 -637105 What is -38025761 minus -0.547? -38025760.453 What is -5369.02 less than -5.5? 5363.52 Add together 0.72 and -44351.65. -44350.93 Total of 2 and -19871425. -19871423 Calculate -525786 - 1408. -527194 What is -0.00004 plus 66.9? 66.89996 Total of 16061 and -2255. 13806 -0.7+315.5386 314.8386 Sum -0.4 and -591983.8. -591984.2 Add together 50.80156 and -56. -5.19844 Calculate 5 - -51.3557031. 56.3557031 2123+-5757.86 -3634.86 Work out 91339247 + 1.6. 91339248.6 Calculate -0.18 + -5569050. -5569050.18 Work out 5750 + 2407. 8157 Put together 277047863 and 5. 277047868 Sum 687 and -952863.2. -952176.2 Work out -2305884 - 0.1. -2305884.1 What is 1 - 4992.097404? -4991.097404 What is the difference between -267731.9049 and -0.8? 267731.1049 What is the distance between -4571947 and 14? 4571961 Subtract 1806.045 from -3. -1809.045 Work out -3.772 - 771. -774.772 -1.735 + -265186 -265187.735 -1098927805+0.048 -1098927804.952 Sum -0.22 and -75.30545. -75.52545 What is -0.12829 take away 352? -352.12829 What is the difference between -0.0537 and 0.98696? 1.04066 Work out 0.73 - 48894. -48893.27 What is -4 less than -32230682? -32230678 What is 60 minus -230257? 230317 What is -0.3 minus 9606196? -9606196.3 What is -27.85 plus -3907.37? -3935.22 -1972681.5 + 7 -1972674.5 Sum -72 and 157542. 157470 What is the difference between -32 and 33050? 33082 What is the difference between 0.2 and -17444919? 17444919.2 Work out 6.63 + -30.581. -23.951 Work out -10.9677778 + 2.1. -8.8677778 What is 189 less than 8273.616? 8084.616 Calculate -0.3 - -4.3178641. 4.0178641 Add -3356830 and -9. -3356839 Add together 0.0328 and -1062304. -1062303.9672 What is the distance between -2768.337 and 472? 3240.337 Work out 0.6 + -404.8254. -404.2254 Calculate 41.3 + -1836.377. -1795.077 What is -21 + 2465053? 2465032 What is -4.7648 take away 2008? -2012.7648 Calculate -9688 + -1444.2. -11132.2 2 - -47.0509597 49.0509597 Add together 61444 and 1.683. 61445.683 Add together -3 and -125930.33. -125933.33 Subtract -0.740159 from 0.4. 1.140159 Total of 2415516 and -1. 2415515 Add 0.41912 and 2.921724. 3.340844 18246 + 661937 680183 Calculate 62895293 + 0.1. 62895293.1 Add together 1.776488085 and 0.01. 1.786488085 Work out 0.25 + -1480679. -1480678.75 -0.1 - 0.075960279 -0.175960279 Subtract -0.03218 from -4176.6. -4176.56782 What is 117995978811 + 3? 117995978814 Calculate -1.312 + 27525604. 27525602.688 What is 22592 less than -4133? -26725 What is the difference between 1084 and 1.4866766? 1082.5133234 Put together 0.063094 and 0.0735. 0.136594 What is -0.073876224 take away -0.3? 0.226123776 Calculate -0.376289 + 13. 12.623711 Work out 185 - 2.73205. 182.26795 What is -1.57 take away 467455? -467456.57 What is 20 less than -0.30661233? -20.30661233 Total of -22107 and 3568. -18539 Calculate 35.1757 - 372684. -372648.8243 What is -374446693 - -9? -374446684 What is the distance between -0.3 and -558112273.1? 558112272.8 Subtract -0.024 from 492716647. 492716647.024 Work out -18123 + 15595. -2528 Total of 10.9621 and 0.361. 11.3231 Add -3206698432 and -2. -3206698434 Subtract 0.56978029 from 0. -0.56978029 What is -4 plus 2771.816652? 2767.816652 -7352593 + -19.7 -7352612.7 What is the distance between 288.070422 and -0.5? 288.570422 What is 0.493 - 4622172? -4622171.507 Total of -0.03 and 3960160035. 3960160034.97 What is the difference between 30.4 and 150388515? 150388484.6 What is -72633 less than 0.001? 72633.001 Sum 19 and 0.265952123. 19.265952123 Sum 0.4 and -49941812. -49941811.6 Add together -10986272 and -145. -10986417 What is -1.2 take away -80896.3? 80895.1 What is 21164010 plus 71? 21164081 What is the difference between 141068.5 and -85? 141153.5 Total of -25 and 448314. 448289 Calculate 788 + 0.03102194. 788.03102194 What is 2 take away -194214.763? 194216.763 What is 812812.5138 less than -0.2? -812812.7138 What is -567.512 + -2.5? -570.012 Subtract -50 from 190371. 190421 Calculate -0.773 + 0.1448. -0.6282 What is -103892918 - -5? -103892913 Subtract -3.4 from -142175. -142171.6 What is -137508 - -7.2? -137500.8 Put together -701 and -54812597. -54813298 What is -23385 take away -2074? -21311 Work out 6 + 2527116. 2527122 Work out 0.3 + 2989651758. 2989651758.3 What is 9640904 less than 12.4? -9640891.6 What is -18979195 minus 0.039? -18979195.039 5888582 - -3 5888585 Sum -0.91 and 9486910. 9486909.09 84.55355 - -2 86.55355 What is 4374247 + 533? 4374780 What is -2 minus 16426637110? -16426637112 Sum -26755 and 7.905. -26747.095 Work out 15205.45 - -6377. 21582.45 Total of -28197.54 and -0.36. -28197.9 Work out -0.4829 + -3155.33. -3155.8129 Work out -16 - -2627.504. 2611.504 Calculate 26120684085 - -0.4. 26120684085.4 Calculate -483 - 17771. -18254 What is -17117468 + -248? -17117716 Add together 0.3 and 2054431644. 2054431644.3 What is the difference between -1.01 and 1.1368721? 2.1468721 Sum 0.053 and -2437067.2. -2437067.147 What is 73517 take away 130.9? 73386.1 Sum 3327.23935 and 0.3. 3327.53935 What is 1589 less than -397.3? -1986.3 Total of 0.35 and 226374797.9. 226374798.25 48294+-40793 7501 What is 0.0148 plus 12931? 12931.0148 What is 50702239.3 less than -0.1? -50702239.4 What is 104 + -0.02718574? 103.97281426 What is the distance between 1409390892 and 0.4? 1409390891.6 Add together 0.5 and -8304506754. -8304506753.5 -33064.8 + 1815 -31249.8 Work out 3.05 + 39.289233. 42.339233 Subtract -0.204121 from -799. -798.795879 Put together -0.1 and -16.588657. -16.688657 What is -2701 less than 1367599.9? 1370300.9 Put together -1697 and -656200. -657897 What is 51753 minus -18.5? 51771.5 Sum 253.94448 and 2.53. 256.47448 What is 13593 plus 523? 14116 What is the distance between 19968422 and -0.3? 19968422.3 What is 2 plus -179890105? -179890103 Subtract 2083039001 from 12. -2083038989 Sum 13 and 1.0299658. 14.0299658 What is 0.29845 + -38.88? -38.58155 14370+4530.4 18900.4 Put together 3076 and 382958. 386034 Work out 232846.35 + -0.2. 232846.15 -0.172+39689 39688.828 Put together 0.1 and -1296.4791. -1296.3791 -8127651612+-0.3 -8127651612.3 Work out -450 + 32534. 32084 What is 333 - 14125121? -14124788 What is -0.01 + 4841502? 4841501.99 0.4 - 9397913 -9397912.6 11588334+-0.0395 11588333.9605 What is 979009 plus 244.4? 979253.4 Work out 170519 + -222809. -52290 29829.6 + 3.05 29832.65 Calculate 120652 - -110. 120762 What is -440 - 3286409? -3286849 64097522 - 5 64097517 What is -2481106713 less than -8? 2481106705 What is -1.43 take away -20885826? 20885824.57 Total of 28 and -0.170290238. 27.829709762 Total of 45797740 and 0.237. 45797740.237 Calculate 0.017 + -39.0635109. -39.0465109 -75693984.49+1 -75693983.49 Put together -43.4 and 105145.093. 105101.693 Sum -2 and 343140780. 343140778 What is 15 less than 846776? 846761 -630+-39768 -40398 Calculate -0.5 - 1285268763. -1285268763.5 Calculate 5068 + 124.3054. 5192.3054 What is -1 - -4306306? 4306305 What is the distance between 24297546 and 3? 24297543 Add 79606 and 103. 79709 What is 1248113.78 + -508? 1247605.78 -3259.1+-1375 -4634.1 What is 0.09199978608 take away 3? -2.90800021392 -408320 - -1583 -406737 Add -4917 and -6315. -11232 What is the distance between 292240.79 and -97? 292337.79 What is 0.11 minus -2500609? 2500609.11 Calculate 3.3760021 + 2. 5.3760021 What is 1.964662 plus 1.1? 3.064662 What is 0.677497	{ "pile_set_name": "DM Mathematics" }
-9 -7526/9 Divide 5 by -5233. -5/5233 Divide -110 by 22. -5 Divide 30 by -3139. -30/3139 Divide 3686 by -194. -19 What is 26297 divided by 4? 26297/4 Calculate -13910 divided by 4. -6955/2 Divide -12 by 776. -3/194 -261198 divided by 1382 -189 What is -286304 divided by 184? -1556 What is 1837 divided by -1287? -167/117 Calculate -917775 divided by 61185. -15 Divide 31 by 3191. 31/3191 Calculate -5586 divided by -6. 931 What is 2369042 divided by 326? 7267 Divide -123176 by 173. -712 -151 divided by -31796 151/31796 31 divided by 467 31/467 Divide 812725 by -3. -812725/3 What is -46925 divided by 9385? -5 Calculate -2 divided by 22661. -2/22661 Divide -1088199 by 63. -17273 Divide -9223 by -23. 401 11 divided by -1110 -11/1110 -69354 divided by -6 11559 What is 5126570 divided by 1? 5126570 Divide 3 by -8935. -3/8935 Divide -3299 by -1. 3299 3757 divided by -289 -13 Divide 17778 by -4. -8889/2 Calculate -375661 divided by -10153. 37 Calculate 4568 divided by -449. -4568/449 -43408 divided by -2713 16 Divide -2192094 by -1893. 1158 -190385 divided by -38077 5 11 divided by -60276 -11/60276 -397854 divided by 279 -1426 -442869 divided by 11 -442869/11 What is -18600 divided by -3720? 5 2075586 divided by -345931 -6 Divide 25 by -554. -25/554 Calculate 179880 divided by 5. 35976 Divide -165291 by -119. 1389 -12 divided by 31739 -12/31739 Calculate -291212 divided by -72803. 4 Divide 582 by 11. 582/11 Calculate -2 divided by -469949. 2/469949 Calculate -2299 divided by -209. 11 -2388304 divided by 4 -597076 Calculate 4278 divided by -130. -2139/65 129 divided by 8905 129/8905 Calculate -5 divided by 2390. -1/478 Divide -2228 by 745. -2228/745 Calculate 4 divided by -91743. -4/91743 What is -32252 divided by 8063? -4 What is 8 divided by 24345? 8/24345 What is -46340 divided by -11585? 4 What is 2779 divided by -1? -2779 Calculate 0 divided by -139692. 0 What is 299336 divided by -1207? -248 Calculate -5100 divided by -1275. 4 5 divided by 120085 1/24017 Calculate 14 divided by 6328. 1/452 Divide 29760 by -2480. -12 Divide -5 by -97151. 5/97151 What is -2181855 divided by 13? -167835 412 divided by 2 206 -725557 divided by -5 725557/5 Calculate 1156492 divided by -1. -1156492 Divide -3214 by -61. 3214/61 Calculate 88 divided by -12150. -44/6075 Divide -102155 by 12. -102155/12 What is 1161 divided by -756? -43/28 Divide -685685 by 455. -1507 Divide 180520 by 5. 36104 Divide 457860 by 91572. 5 3237135 divided by 2 3237135/2 Divide -3 by -17138. 3/17138 576192 divided by 8 72024 Calculate 385272 divided by 9. 42808 613000 divided by -122600 -5 Divide 3 by 153484. 3/153484 Calculate 175074 divided by -3. -58358 What is 963248 divided by -8? -120406 Calculate 1295716 divided by 4. 323929 What is -18774 divided by -1341? 14 Divide -21622 by -19. 1138 Divide 13 by 1458. 13/1458 Calculate -171970 divided by -2. 85985 Calculate 22688 divided by 2. 11344 What is 4 divided by -195414? -2/97707 Calculate 163 divided by -186. -163/186 57402 divided by -6378 -9 Calculate -27468 divided by -2. 13734 Calculate 231507 divided by 887. 261 Calculate 44 divided by 76. 11/19 What is -186792 divided by -93396? 2 -3 divided by 533584 -3/533584 What is -2 divided by -85673? 2/85673 Calculate -4416 divided by -6. 736 Divide -21700 by 1550. -14 -1668 divided by -104 417/26 Divide 232596 by -639. -364 Divide 651 by 1. 651 Divide -1525 by -2171. 1525/2171 155092 divided by 764 203 Divide -70470 by -11745. 6 Divide -194962 by 1. -194962 What is -26728 divided by -2? 13364 Divide 0 by -630. 0 Divide -98 by 10628. -49/5314 What is -182501 divided by 4? -182501/4 63 divided by 52343 63/52343 0 divided by 125244 0 What is -3098876 divided by 4? -774719 25753 divided by -1981 -13 Divide 204910 by -310. -661 Calculate -38688 divided by -4. 9672 What is 26068 divided by -686? -38 Calculate 265768 divided by 1912. 139 What is 32391 divided by -3? -10797 Divide 177463 by 187. 949 What is -7688 divided by 20? -1922/5 22692 divided by 366 62 Divide -1362102 by 2. -681051 Divide -46099 by 1. -46099 Divide -11516 by 1. -11516 What is -43346 divided by -21673? 2 -223481 divided by -2 223481/2 Divide 99080 by -12385. -8 188 divided by 342 94/171 What is 168104 divided by 6? 84052/3 32280 divided by -1345 -24 Calculate 2359992 divided by -2568. -919 Divide 651 by -149. -651/149 What is -192491 divided by 169? -1139 Calculate -18970 divided by -5. 3794 What is 164212 divided by -41053? -4 Divide -13450 by -6725. 2 Calculate 579654 divided by -6. -96609 What is 741894 divided by -6? -123649 Calculate 13 divided by -319. -13/319 Calculate 798966 divided by -88774. -9 Calculate -21 divided by -1226. 21/1226 Calculate -635968 divided by -76. 8368 4566120 divided by 5 913224 Calculate -124500 divided by 6. -20750 7382 divided by 7382 1 Divide -1545264 by -24528. 63 Divide 0 by 8820. 0 Calculate 1891376 divided by 472844. 4 What is -11 divided by 864? -11/864 Calculate 71680 divided by -10240. -7 Calculate -449573 divided by 449573. -1 Divide 4107420 by 1710. 2402 Divide 158403 by -3. -52801 47360 divided by 640 74 Calculate -777672 divided by -12344. 63 6 divided by 8364 1/1394 Divide 15 by -2113. -15/2113 What is -1 divided by 272130? -1/272130 Divide -275652 by -3. 91884 49 divided by -581 -7/83 -331548 divided by 165774 -2 Divide -2745275 by -549055. 5 2 divided by 589910 1/294955 What is 5 divided by 33510? 1/6702 1248629 divided by 3 1248629/3 What is -4 divided by -5676? 1/1419 Divide -1465 by -293. 5 Divide -1405708 by 351427. -4 Divide 6811 by 4. 6811/4 4640 divided by -792 -580/99 What is -1156230 divided by -2? 578115 What is -363450 divided by 2423? -150 What is 1 divided by 26693? 1/26693 62284 divided by -4 -15571 Divide 1116 by 28. 279/7 Divide 2865 by 7. 2865/7 127 divided by 812 127/812 36167 divided by 27 36167/27 What is 1417 divided by -2117? -1417/2117 Divide 1 by -18459. -1/18459 Calculate -223167 divided by 10627. -21 Calculate -8330 divided by -35. 238 What is 2148993 divided by 102333? 21 Divide -361775 by 12475. -29 Calculate -19444 divided by -2. 9722 1863465 divided by -2 -1863465/2 What is 17521 divided by -2503? -7 What is -6742 divided by 2? -3371 What is -8853016 divided by -4? 2213254 What is 338 divided by -531? -338/531 Calculate 73854 divided by -1119. -66 What is -28 divided by -1327? 28/1327 166170 divided by 573 290 What is 4533 divided by -43? -4533/43 Divide 171297 by -3. -57099 Divide 692240 by -69224. -10 What is -85410 divided by -1170? 73 What is -3420 divided by 855? -4 Calculate -401576 divided by 3976. -101 Calculate 82179 divided by 23. 3573 Divide 649944 by 1062. 612 What is -5 divided by -14864? 5/14864 -7 divided by -2701 7/2701 Divide -2 by 1597887. -2/1597887 5946 divided by -2 -2973 Calculate -203 divided by -136. 203/136 Divide -167550 by -5585. 30 -318 divided by 318 -1 Calculate 23679 divided by -32. -23679/32 Calculate -379772 divided by -722. 526 Divide -112636 by 3884. -29 Calculate 827 divided by 138. 827/138 -31780 divided by -4 7945 Calculate -164604 divided by 14964. -11 Divide 3037704 by 564. 5386 Divide -1152 by -29. 1152/29 Divide -65439 by -1983. 33 What is 29 divided by -25273? -29/25273 Divide -3888 by -72. 54 What is -544 divided by 3? -544/3 Calculate 800316 divided by 564. 1419 What is 427040 divided by 53380? 8 What is -1273745 divided by -1? 1273745 122 divided by -776 -61/388 17626 divided by 115 17626/115 Divide -14328 by -72. 199 3786924 divided by -2 -1893462 What is -3 divided by -776956? 3/776956 Divide -656 by -22. 328/11 Calculate 141 divided by -250. -141/250 Divide 667377 by -9. -74153 Divide 1 by -6803. -1/6803 Divide 1466 by -15. -1466/15 Divide -133972 by -13. 133972/13 What is 3 divided by 1060758? 1/353586 Divide 584 by 32. 73/4 Divide 0 by -12166. 0 Calculate -128 divided by -2422. 64/1211 Divide 224 by 2798. 112/1399 What is 361662 divided by 21? 17222 22040598 divided by 6 3673433 Calculate -3001 divided by 52. -3001/52 What is -331304 divided by -82826? 4 Divide -5960 by 8. -745 11 divided by 530 11/530 1136104 divided by -4897 -232 Calculate 8 divided by 8497. 8/8497 Calculate 7821 divided by -43. -7821/43 Calculate -189886 divided by 4997. -38 What is -839328 divided by 4? -209832 What is -122465	{ "pile_set_name": "DM Mathematics" }
n + km and give w. -311 Rearrange (-3 - 1 + 5)(-1 - i + 1) + 119738i - 35501i - 57496i to x + hi and give h. 26740 Rearrange 2069k + 2068k - 13 - 4125k + (-32k + 14k + 13k)(1 - 2 + 3) to the form x + gk and give g. 2 Rearrange ((7b - 4b - b)(-b2 - 3b*2 + 6b2) + b3 + b*3 - 4b*3 - 6b*3 - 3b*3 - 2b*3)(336 + 52 - 90) to gb + mb*2 + cb*3 + k and give c. -2682 Express -3286a - a*2 - 799a + 0a2 + 152a as pa + u + va*2 and give v. -1 Express (15u + 16u + 72u)(60u + 3u - 8u) + (2u + 2u - 2u)(2u - 3u + 3u) in the form su + j + mu2 and give m. 5669 Express -45590a*2 + 45608a*2 + 13a - 144a - 12a in the form h + ja2 + ua and give u. -143 Rearrange -169v3 - 120v*3 + 110v*3 + (121v - 55v2 - 121v)(0 + 0 + v) to the form bv*3 + iv*2 + xv + d and give b. -234 Rearrange 4707x - 11296753 + 11296753 to the form q + ax and give a. 4707 Rearrange (0x + x + 0x + (0 - 7 + 0)(-2 + 2 + x))(-3 + 9 - 7)(-2 + 5 + 1)(4 + 0 - 3) to the form a + cx and give c. 24 Express 2y*2 - 3y*2 + 3y*2 + (y - 2y + 2y)(-3 + 3 + y) - 2y - 2y*2 + 2y - 120 + 3639y - 3639y + 3y2 in the form my + f + sy2 and give f. -120 Rearrange -y2 + 45y - 74793 + 74793 to the form ay2 + x + jy and give a. -1 Express 27n3 - 30n*3 - 2n*4 - 3n + 52 - 25 + 52 as wn2 + rn*4 + yn + vn3 + t and give r. -2 Rearrange 8 - 256u - 54 + 41 to the form yu + l and give y. -256 Express -18h*4 - 17h*4 - 2h*3 + 33h*4 - 3394h*2 - h - 2 in the form g + wh*3 + ph*2 + th*4 + ch and give t. -2 Rearrange 4057511i3 - 2i - 7i - 4057535i*3 to ti*3 + ai + bi2 + g and give t. -24 Express (-3x - 5x - 3x)(1 - 1 - 2x) + (x + 4x - 4x)(-x + 4x - 2x) + (-2x + 2 - 2)(-7 + 5x + 7) - 4x2 + 14 - 14 as vx + s + ux2 and give v. 0 Rearrange (-7f*2 - 29f - 6f + 70f)((-1 + 1 + f)(-1 + 0 - 1) + 4 + 16f - 4) - 2f*3 + 1 - 1 to the form tf*2 + i + wf*3 + jf and give t. 490 Express (-9k - 6 - 21 + 23)(-182 - 14k + 182) in the form fk*2 + y + ak and give f. 126 Express -3 - 6c2 + 84869c*3 - 84889c*3 + 4c*2 in the form hc + sc3 + t + lc*2 and give l. -2 Rearrange -345h*2 + 222h*3 + 218h*3 - 443h*3 + 9h + 3 - 9h to oh + q + lh3 + vh*2 and give v. -345 Rearrange 287w - 2242 - 1020 - 286w to y + cw and give c. 1 Rearrange -1400m2 - 9m*3 + 1400m*2 - 221m*4 + 5 + 7m*3 to c + wm*2 + lm*4 + im*3 + xm and give l. -221 Express 440b2 + 257b*2 - 537b*2 + 2b + (-1 + 3 - 4)(b2 + b2 - 4b*2) + (8b - 2b + b)(-9b + b - 2b) in the form r + qb2 + lb and give q. 94 Express 206j2 + 102j*2 + 529j*2 - 6 + 7 - 199j*2 + 2j in the form k + oj2 + cj and give o. 638 Rearrange (2 + 5d + 2 - 9)(0d3 - 2d*3 + 4d*3) + (d - d + d)(-13d3 + 5d*3 + 9d*3) to jd + kd4 + td*3 + l + qd*2 and give t. -10 Rearrange 269j*3 + 939j*3 + 0 + 1 - 217j*3 - 2j to dj + kj*3 + s + hj*2 and give k. 991 Rearrange 5b*3 + 3b*3 + 2b*3 + (12b - 3b + 10b)(3b2 - b2 - 5b2) to the form lb*2 + g + yb*3 + tb and give y. -47 Rearrange (-2 + 5 - 2)(-r + 2r - 2r) + (-103 + 227 + 39)(8 + 9r - 8) to the form wr + g and give w. 1466 Express -11a4 + a3 + 35 - 330563a + 0a3 + 330563a - a*2 as oa*3 + ga + ca2 + k + ia*4 and give k. 35 Rearrange (-1 + 1 - 2j*2)(-225j2 + 114j*2 + 113j*2 - 500j - 2) to nj + kj*3 + y + vj*2 + pj*4 and give v. 4 Rearrange -225r*2 + 240r*2 - 10r*2 + 31r*4 - 1 to mr*4 + gr*3 + wr + o + ur2 and give m. 31 Rearrange -x4 - 84913x*3 - 49x + 169825x3 - 84911x*3 - 1 to dx + nx3 + rx*2 + kx*4 + h and give h. -1 Rearrange -389p*2 + 1 + 156p - 10 + 9 - 179p to r + mp + jp2 and give j. -389 Express 105 - 2u*4 + 209 - 172 - 10u*3 + 52 + 2u*2 + 387 as gu*2 + du + ju3 + ru*4 + s and give j. -10 Express -86c*4 + 1027 - 6c - 1029 - 3c3 + 167c*4 - 80c*4 - 17c*2 as nc*4 + fc*2 + g + tc + dc3 and give g. -2 Express (-255 + 36x + 255)(18x*2 + 4x*3 - 2x + 4260 - 4262 - 72x2) in the form jx*2 + u + tx*4 + ix*3 + rx and give r. -72 Express (-4z + 6z - 4z)(-230z3 + 78z*3 - 146z*3) + 21z*2 - 21z*2 + 44z*4 as oz*4 + mz*3 + r + tz*2 + uz and give u. 0 Express -83i - i2 - 174i + 3i3 - 4i*3 + 3i*3 - 140i as a + pi + si*3 + ni*2 and give p. -397 Express 659064p*3 - 4259p*4 - 659064p*3 + (3p*3 - 3p*3 - 2p*3)(2p + 0p + 0p) in the form mp*4 + y + ap*2 + bp*3 + ip and give m. -4263 Express 0h - 2h + 3h + (-4h + h + 11h)(-90 + 432 + 454 + 583) as r + ch and give c. 11033 Express (-4p*4 + 5p*4 - 3p*4 + (-2p*2 + 2p - 2p)(4 + 2p2 - 4))(-114 + 281 + 156) in the form np + wp*4 + v + rp*3 + mp*2 and give w. -1938 Rearrange 77d - 175d4 - 246d + 171d - 12d*3 to the form wd + rd2 + zd*4 + fd*3 + u and give f. -12 Express 5774 + 30v - 17431 - 5v + 5785 + 5810 in the form b + sv and give b. -62 Rearrange (-15736 - 3263 + 2760 - 5 + 0 + 3 + (6 - 4 + 0)(-4 + 0 + 3) - 2 + 0 + 1 + 1 - 1 - 1)(-4 - s*2 + 4) to ns*2 + ls + k and give n. 16245 Express (-5n - 3n + 5n)(0 + 0 - 1) + 84 + 97 - 210 + 4n in the form s + gn and give g. 7 Rearrange (3 - 1 - 4)(0u*2 + 0u2 + u2)(0u + 0u - 3u)(-2 - 2 + 2 + (33 + 542 + 320)(-1 + 5 - 5)) to the form x + bu2 + pu*3 + gu and give g. 0 Express 294p3 - 101p*3 - 92p*3 + 10p*2 + 2p - 3p4 + 0p*4 - 2 - 103p*3 in the form np*2 + lp + ap4 + hp*3 + g and give g. -2 Express 20 - 3108h - 30 + 10 in the form fh + c and give f. -3108 Rearrange -11a - 2999a + 491a to sa + o and give s. -2519 Rearrange 364m*3 + m - 3m*2 - 1 + 2m*4 + 360m*3 - 1292m*3 + 293m*3 + 371m*3 to h + im + nm4 + vm*2 + om*3 and give n. 2 Rearrange 37231u + 0 + 0 - 33886u to w + ku and give k. 3345 Rearrange 48a3 + 74a*2 - 12a - 18a - 70a*2 + 536a*3 + 28a to q + pa3 + da*2 + ha and give h. -2 Express -2 - 87d - d3 + 0d*3 - 63d*2 + 82d*2 + 0d*3 + 2d*3 as od*2 + yd*3 + m + gd and give g. -87 Rearrange (-4433p + 7 + 8978p - 5015p)(-4 + 4p3 + 4) to the form vp*2 + z + wp*3 + sp + gp4 and give w. 28 Rearrange 154807 - 154804 + 30y*2 + 4y - 95y2 to ay*2 + w + dy and give a. -65 Rearrange (-19t + 20t - 343t)(1 + 1 - 1)(-13 + 21 - 10) to the form nt + s and give n. 684 Express -15t3 + 30 - 184t*3 - 56 - 6t*2 + 8t*2 + t + 25 as qt*3 + jt*2 + c + zt and give j. 2 Rearrange -2a2 + 852a*4 - 1486a*4 + 2a - 104a3 + 658a*4 to ya*3 + l + da*4 + ia*2 + fa and give y. -104 Express ((0 - 1 + 3)(0a - a + 0a) + 4 - 4 - a - a + 3a + 0a + (-101 + 101 - 90a)(-1 - 4 + 4))(118 - 146 - 277) as ga + h and give g. -27145 Rearrange (-4 + 5 - 4 + h)(185 + 200 + 183)(-2 - 2 + 8) to the form g + xh and give x. 2272 Express (-153x + 93x - 170x)(-4x2 - 5 + 2x*2 + 9 + 2x*3) as gx*2 + lx + q + bx4 + cx*3 and give l. -920 Rearrange -35f + 1 + 42f3 - 39f*3 + 156f*2 + 160f*2 - 311f*2 to v + wf + qf2 + hf*3 and give h. 3 Rearrange (109v*4 - 2688v*3 - 111v*4 + 2221v*3)(3 + 1 + 4) to the form r + ov + sv*4 + jv*3 + iv*2 and give s. -16 Rearrange -2959 - c - 2208 - c + 1764 to the form jc + x and give j. -2 Express -40 + 14 - 10m2 + 5 + 4m - 23m3 + 21 in the form bm + rm3 + k + im*2 and give b. 4 Express 293g - 136085 + 333g + 136088 + 818g in the form wg + b and give b. 3 Express 26755z*3 + 3z*4 + 16z*2 + 0z + 2z2 + 1 + 0z - 26756z3 in the form cz*3 + xz*2 + hz*4 + i + rz and give i. 1 Express 2u - u + 2u - 4u + 2u + 4u + (-2 + 5 - 1)(1 - 1 - u) - 2u + 5u - 5u + 7 - 7 + 3u - 6u + 5 - 9 - 6u as gu + y and give g. -8 Express (297 - 10f - 297)(f - 4f + 2f)(-35 + 25 + 33)(2f - 2 + 2)(0 - 4 + 6) in the form nf*3 + i + lf*2 + zf and give i. 0 Express -11a4 + 68 - 66 + 20a*2 + 4a*2 + 17a - 22a2 in the form ta + ua3 + i + oa*4 + ra**2 and give t. 17 Rearrange (-2 +	{ "pile_set_name": "DM Mathematics" }
608 Calculate the smallest common multiple of 492 and 1230. 2460 Calculate the least common multiple of 9902 and 9. 89118 What is the lowest common multiple of 1188 and 198? 1188 What is the common denominator of -12/731405 and -18/192475? 3657025 What is the common denominator of 23/8 and 73/9856? 9856 Find the common denominator of -65/1399802 and -89/14. 9798614 What is the common denominator of -35/66674 and 81/14416? 533392 Find the common denominator of -75/5816 and 77/52344. 52344 Calculate the least common multiple of 206107 and 4. 824428 Find the common denominator of 21/2480 and 11/2780. 344720 What is the common denominator of 93/107810 and -37/140153? 1401530 Find the common denominator of 155/7308 and -19/360. 73080 What is the common denominator of -89/23650 and -109/15050? 165550 Find the common denominator of -113/33906 and -79/36. 203436 What is the common denominator of 13/19692 and 121/118152? 118152 What is the common denominator of 19/30042 and 35/16? 240336 What is the common denominator of -7/2595 and 67/443745? 443745 Find the common denominator of -191/210 and 83/33868. 3556140 Find the common denominator of 1/3240 and -163/9360. 84240 Find the common denominator of -47/9044 and -109/756. 244188 What is the least common multiple of 24352 and 66968? 267872 Find the common denominator of -65/78876 and -47/67608. 473256 What is the lowest common multiple of 76 and 134824? 134824 What is the smallest common multiple of 11001 and 779? 451041 Calculate the lowest common multiple of 10120 and 400. 101200 What is the common denominator of -81/2440 and 49/1520? 92720 What is the common denominator of 97/130 and -131/72? 4680 What is the least common multiple of 11550 and 2982? 820050 Calculate the lowest common multiple of 624 and 15087. 3138096 Calculate the smallest common multiple of 44774 and 122. 44774 Calculate the smallest common multiple of 8 and 1064. 1064 Calculate the lowest common multiple of 41808 and 4992. 334464 What is the common denominator of -49/143 and -4/9867? 9867 Find the common denominator of 71/15730 and 62/715. 15730 Calculate the common denominator of -87/16 and -17/210168. 420336 Calculate the lowest common multiple of 19827 and 9. 19827 What is the lowest common multiple of 6 and 421590? 421590 Calculate the smallest common multiple of 391 and 161. 2737 What is the lowest common multiple of 1167138 and 74104? 4668552 Calculate the lowest common multiple of 120 and 14524. 435720 Calculate the lowest common multiple of 24 and 1551. 12408 Calculate the least common multiple of 296 and 1479. 437784 What is the least common multiple of 17274 and 43185? 86370 Calculate the common denominator of 34/513 and -89/127110. 1143990 Find the common denominator of -41/678 and 31/6102. 6102 Calculate the common denominator of 143/751302 and -29/180. 7513020 What is the common denominator of 143/31968 and 77/444? 31968 Find the common denominator of 1/692993 and -37/175. 17324825 Find the common denominator of 43/35300 and 61/40. 70600 Find the common denominator of -63/684134 and 57/870716. 9577876 Calculate the smallest common multiple of 4532 and 68. 77044 What is the common denominator of 137/110 and -93/2830? 31130 Calculate the smallest common multiple of 4940 and 4940. 4940 Find the common denominator of 43/296 and -59/1110. 4440 Find the common denominator of -52/7 and -161/16410. 114870 What is the smallest common multiple of 308616 and 56? 308616 Calculate the common denominator of 32/314203 and -26/253. 3456233 What is the common denominator of 41/331944 and -127/48? 663888 Find the common denominator of 53/36207 and -25/33. 398277 Calculate the lowest common multiple of 76 and 4080. 77520 Find the common denominator of 53/16455 and 29/36. 197460 What is the common denominator of 107/6 and 12/109547? 657282 Find the common denominator of 17/3480 and 27/58. 3480 What is the common denominator of 2/77 and -75/12496? 87472 Calculate the common denominator of -109/2250 and 133/29250. 29250 What is the smallest common multiple of 864 and 40704? 366336 Calculate the smallest common multiple of 1540 and 7378. 811580 Calculate the least common multiple of 31140 and 240. 124560 Find the common denominator of -13/1824 and 25/152. 1824 What is the common denominator of 44/227613 and -29/6? 455226 What is the common denominator of 95/132 and -25/1971? 86724 Calculate the common denominator of -5/88 and 85/29112. 320232 What is the common denominator of 35/16146 and -71/312? 64584 What is the least common multiple of 77091 and 63? 231273 Calculate the lowest common multiple of 206508 and 8. 413016 Calculate the common denominator of 31/33 and -16/219. 2409 Calculate the common denominator of 32/96825 and 83/38730. 193650 Calculate the common denominator of 133/5916 and -93/6902. 41412 Find the common denominator of -65/182042 and -65/52012. 364084 What is the common denominator of 29/1212 and -29/1111? 13332 What is the smallest common multiple of 5316 and 1334316? 1334316 Find the common denominator of 83/513452 and -27/1797082. 3594164 Calculate the least common multiple of 70368 and 48. 70368 Calculate the common denominator of 73/5756 and -79/6140. 8835460 What is the least common multiple of 12936 and 574? 530376 Calculate the common denominator of 25/313584 and -67/1692. 940752 Calculate the smallest common multiple of 12 and 132934. 797604 Calculate the common denominator of 73/95472 and -133/11934. 95472 What is the lowest common multiple of 189296 and 472? 11168464 What is the smallest common multiple of 144 and 10240? 92160 Calculate the lowest common multiple of 8844 and 36. 26532 Find the common denominator of -12/1715 and 2/25235. 176645 What is the common denominator of -35/44707 and -21/27512? 357656 Calculate the common denominator of -55/77529 and -46/5409. 232587 Find the common denominator of -49/13040 and -73/28688. 143440 Calculate the lowest common multiple of 35640 and 102. 605880 Calculate the lowest common multiple of 34368 and 137472. 137472 What is the common denominator of -113/615706 and -139/140? 6157060 What is the smallest common multiple of 264747 and 735? 1323735 Calculate the common denominator of -169/84 and 43/55076. 165228 Find the common denominator of 79/60 and 2/42705. 170820 Calculate the common denominator of 87/282448 and 115/6096. 847344 Calculate the least common multiple of 24030 and 267. 24030 Find the common denominator of 17/182 and 99/135434. 948038 What is the smallest common multiple of 85254 and 21? 596778 What is the lowest common multiple of 2079 and 64233? 4945941 Calculate the least common multiple of 461656 and 3860. 2308280 What is the common denominator of 173/51330 and -19/598850? 1796550 What is the lowest common multiple of 24106 and 12? 144636 What is the lowest common multiple of 770 and 186060? 2046660 What is the least common multiple of 66 and 97372? 292116 Calculate the common denominator of 32/2211 and 17/762594. 8388534 Calculate the lowest common multiple of 286 and 1186. 169598 What is the lowest common multiple of 49718 and 16? 397744 Find the common denominator of -25/42 and 113/36582. 36582 Calculate the common denominator of -67/61732 and 71/242. 679052 What is the common denominator of 67/424 and 91/41252? 4372712 What is the smallest common multiple of 3600 and 200? 3600 Calculate the smallest common multiple of 31450 and 13875. 471750 Find the common denominator of 22/12065 and 51/1604645. 1604645 What is the lowest common multiple of 42 and 252? 252 What is the lowest common multiple of 14306 and 2070? 643770 Calculate the smallest common multiple of 1194 and 32636. 97908 Calculate the lowest common multiple of 75 and 29166. 729150 Calculate the lowest common multiple of 1610 and 96600. 96600 Calculate the lowest common multiple of 52866 and 61677. 370062 Calculate the smallest common multiple of 190 and 12141. 121410 Find the common denominator of -7/12573 and 107/390. 1634490 Calculate the lowest common multiple of 3299 and 17. 56083 What is the common denominator of 55/32896 and -39/1280? 328960 Calculate the lowest common multiple of 24 and 77104. 231312 What is the least common multiple of 2535 and 15? 2535 Find the common deno	{ "pile_set_name": "DM Mathematics" }
). Sort 5, s, x in increasing order. x, s, 5 Let r be 52 + (-4 - (-4)/123). Let m = r + -45. Let p = -7 + 4. Put p, m, 0 in ascending order. p, 0, m Suppose 4g - 9g = 5j - 40, -4g + 5j - 13 = 0. Put 31, 2, -3, g in ascending order. -3, 2, g, 31 Let p = 296 - 302. Sort -5, p, 4, 1/7 in ascending order. p, -5, 1/7, 4 Let b = 63 + -33. Let h be (-13)/6 - (-5)/b. Put 3, h, -4, 5 in descending order. 5, 3, h, -4 Let p = 566 - 750. Put p, 4, 1 in increasing order. p, 1, 4 Let d = -22 - -43. Suppose 0b - 5b + d = n, -23 = -3n - 5b. Let f be -33 - -27 - (-29)/5. Sort 2, f, n. f, n, 2 Let a = 11 - 57/5. Let m = 9 - 8.82. Let z = 5.18 - m. Put 4, a, z in descending order. z, 4, a Let v(p) = p*3 - 2p*2 - 9p + 13. Let n be v(3). Sort 3, 310, n in descending order. 310, 3, n Suppose 26h + 73 = 2j + 23h, 4j + 3h - 101 = 0. Sort j, 5, 4 in descending order. j, 5, 4 Suppose 0 = -4h - 5v + 17 - 49, 2h = v - 2. Suppose -m = k - 1, m - 18 + 1 = 3k. Suppose 3r + 3 = 3u, -2u + m = 5r + 3u. Sort r, -1, h. h, -1, r Suppose 2k - 15 = 5b, -2b = -5b + 3k. Sort 62, 2, b in decreasing order. 62, 2, b Let x be (-630)/25 - 3/(-15). Let f = -18 + 33. Let k = x + f. Sort 5, k, -3 in descending order. 5, -3, k Suppose 5x + 10 = -h, 0x + h - 2 = x. Let d = 14 + x. Sort 0.5, d, -1/10 in decreasing order. d, 0.5, -1/10 Suppose -34y - 320 = -42y. Sort 3, -2, y in descending order. y, 3, -2 Suppose -14s + 437 + 326 = 1057. Let o be (-2 - -1)5/(-1). Sort 1, o, s. s, 1, o Let u be (34 - 0)/((-18)/(-2) - -2). Let d = 157/33 - u. Put d, -0.2, -3/7 in descending order. d, -0.2, -3/7 Let x = 10 - 15. Suppose -4 = f, -20 = -8h + 3h + 5f. Let m = 5217 - 5221. Put x, h, m in decreasing order. h, m, x Let g(n) = -n + 7. Let u be g(7). Suppose uf = f. Let m = 83 + -82.5. Put -1/3, f, m in increasing order. -1/3, f, m Let f = -6 + 6. Let q = 11.4 - 1.4. Let p = q - 5. Put p, f, -0.2 in ascending order. -0.2, f, p Let z = 4.4 - 4. Let g = 0.156 - -0.044. Let b = -112/177 - 2/59. Sort z, g, b in decreasing order. z, g, b Suppose 0 = 3i + i - 20, -2y = 2i - 4. Let p be y/(-18)-2 + 0 + 0. Put p, 2/9, -1/8 in decreasing order. 2/9, -1/8, p Suppose 5 = 5f - 0f. Let w be 1848/(-1155) + 2/20. Put w, 3/5, f in descending order. f, 3/5, w Let j be ((-3)/12)/(66/24). Let y = -47.5 - -47. Put j, y, 0.3 in decreasing order. 0.3, j, y Let w be -2 + 2 + 5 + -1. Suppose 591n - 551n + 80 = 0. Put -3, n, w in decreasing order. w, n, -3 Let g = -1391/7 - -199. Sort g, -7, 1, -2 in increasing order. -7, -2, g, 1 Let p(t) = t2 + 5t + 3. Let d be p(-5). Let k be (d/(-7))/((-8)/(-14)). Let a = 4.6 - -0.4. Sort -3, k, a. -3, k, a Let h be -1 + (-3)/3 + 1. Let b be ((-1 + 2)-9)/(-1). Suppose -5s - i = -7s - 14, s + 5i = 15. Sort b, h, s in descending order. b, h, s Let t = 0.71 - 0.51. Sort 0, -3.1, t in descending order. t, 0, -3.1 Let k = 247 + -249. Suppose -5h - 91 = -1. Sort 2, h, k in descending order. 2, k, h Let r(x) = 3x3 - x2 + 6x - 7. Let y be r(2). Let l = y + -21. Sort l, -39, 0 in increasing order. -39, 0, l Let x = -7.2 + 13.2. Put 1, 5, -1/9, x in decreasing order. x, 5, 1, -1/9 Let v = 0.82 - -1.32. Let c = v + -0.14. Sort -5, c, 3/5 in increasing order. -5, 3/5, c Let c = 1215/7334 - 3/386. Sort 1/4, c, -2. -2, c, 1/4 Let f = 161.1 - 164.1. Sort -0.4, 21, -3/4, f in ascending order. f, -3/4, -0.4, 21 Let y be (-2 + 13)(-1)/(-1). Let q = 16 + -27. Let n = -16 - q. Sort y, n, 0.5 in decreasing order. y, 0.5, n Suppose -10q = 15q + 125. Sort q, 16, -2, -3 in decreasing order. 16, -2, -3, q Let n be (70/252)/(-23/18). Sort n, -2, -1. -2, -1, n Let n be ((-32)/12)/((-8)/3). Sort -38, 0, n in decreasing order. n, 0, -38 Let i be (1/(-2))/((-2)/20). Suppose -5w + 3w + 4 = -g, 2w - 2g - 2 = 0. Suppose -29 = 4a + in, a + 2n + wn + 26 = 0. Put a, 2, 0 in decreasing order. 2, 0, a Suppose 12 = -3s, 0s = -5o + 3s - 8. Let g be o(2/(-2) - -2). Let a be (-45)/(-21) - (-3)/(-21). Sort g, a, 1 in decreasing order. a, 1, g Let j = 861 + -865. Sort -1/2, j, 1/5. j, -1/2, 1/5 Let c = -2766 + 2765.9. Put c, 1/9, -20, -6 in increasing order. -20, -6, c, 1/9 Suppose -2o = 2o - 16. Let h be (-12)/(-36) - (-44)/(-6). Let j be (h - -5) + 2 + -2 + 1. Put -3, j, o in increasing order. -3, j, o Let j be (6/10 - 1)(-32 + 27). Sort -12, -5, j in descending order. j, -5, -12 Suppose 5b + 5g = 15, -3b - 5g + 15 = -b. Let x(c) = 2c + 4. Let d be x(b). Let h be -6 - (-3 - (-4)/2). Sort h, d, -3. h, -3, d Let s = 2 + -2. Let k = s - -0.1. Let q = -110 + 114. Sort k, 7, q in ascending order. k, q, 7 Suppose 4p = 5a - 424, -5p + 2a - 191 = 356. Let x = 112 + p. Sort x, -4, 0, 4 in decreasing order. 4, x, 0, -4 Let z = -96 - -95. Let b be (-1)/2 - (z + (-25)/(-40)). Let y = 171/85 + -24/17. Put 5, b, y in descending order. 5, y, b Suppose -s = i + 1, 0 = -s + i - 5i - 1. Let b = -14 + 5. Let y = b + 5. Sort y, 5, s in decreasing order. 5, s, y Let w(n) be the first derivative of n4/4 + 13n*3/3 + 5n - 15. Let a be w(-13). Let p = -2 + 3. Put a, p, 0 in decreasing order. a, p, 0 Let t(g) = g - 23. Let k be t(5). Let l be 76/k - (0 + -4). Sort 2, -5, l in ascending order. -5, l, 2 Let j(i) = i*2 + 16i - 90. Let c be j(5). Put -5, -3, 4, c in descending order. c, 4, -3, -5 Let j(i) = i*2 - i. Let p be j(2). Let d = 5 + p. Let c = -29/4 + d. Put 2/7, 0, c in decreasing order. 2/7, 0, c Let a = 505 - 507. Put -6, -5, -12, a in decreasing order. a, -5, -6, -12 Let v = -0.0328 + -3.9672. Let x be (-18)/(-8) + -2 + 0. Put 1/5, v, x in descending order. x, 1/5, v Let v(q) = -66q - 516. Let s be v(-8). Sort s, -1, 4, 3 in increasing order. -1, 3, 4, s Let z = 479 + -482. Sort 2, z, -0.4, 27 in decreasing order. 27, 2, -0.4, z Let w(z) = -25z + 18. Let v be w(-3). Let o = 90 - v. Let t(k) = k3 - k + 5. Let s be t(0). Put 1, s, o in ascending order. o, 1, s Let i = 11/3 - 149/39. Let g = 0.35 - -8.65. Sort 4, i, g in decreasing order. g, 4, i Let i = 91 + -47. Let h = i + -46. Sort h, 1/6, 2, 5 in decreasing order. 5, 2, 1/6, h Let z = 2 + 2. Let q = 4 + -6. Let o be (2 + -2)/(1 + q). Sort 3, z, o. o, 3, z Suppose 2c + 270 = 20c. Put 1, -4, c, -1 in increasing order. -4, -1, 1, c Let l(p) = 9p + 342. Let u be l(-38). Sort u, 1, -10, 5 in descending order. 5, 1, u, -10 Let t be -58/(-140)21. Suppose 0 = h - 2j + t, -5h - j - 1 = -4. Suppose y + 0y = -5, -10 = -5n + 4y. Put 5, h, n in increasing order. n, h, 5 Let c(k) = -k3 + 4k*2 + k - 7. Let j be c(-4). Let y = 120 - j. Sort y, -5, 4. -5, y, 4 Let b = -849.9 - -850. Put -1/12, -4, 1, b in descending order. 1, b, -1/12, -4 Let g(w) = 8w - 28. Let j be g(4). Sort 9, -4, j in descending order. 9, j, -4 Let n = 164.5 - 164.8. Let f = 2 - -1. Sort n, 0.2, f in ascending order. n, 0.2, f Suppose 0 = 5j - 4l + 237, -5l = -11 - 4. Let d be ((-6)/(-27))/((-6)/j). Let m = 0.07 + 2.93. Sort 0.1, m, d in increasing order. 0.1, d, m Suppose -22i = -13i + 45. Sort i, -4, 61, -2 in decreasing order. 61, -2, -4, i Let d be -1 - (-12)/((-4)/(-1)). Let a be ((-2)/19)/(d - -6). Let q = -14/19 + a. Sort -1/2, q, -2 in decreasing order. -1/2, q, -2 Let d be 7 + 217/(-56) - (-1)/(-8). Put 4, d, 1, -19 in decreasing order. 4, d, 1, -19 Let s(n) = n2 - 32n + 31. Let q be s(31). Put 6, -1, q in ascending order. -1, q, 6 Let k(t) = -t*2 + 18t - 48. Let o be k(3). Put o, 0.8, 1, 2/5 in increasing order. o, 2/5, 0.8, 1 Let h(w) = -19w + 471. Let p be h(25). Let v(o) = o + 7. Let k be v(-6). Sort k, 11, p in descending order. 11, k, p Let u = -3865 + 3859. Let h be ((-2)/(-18))/((-2)/4). Sort -0.1, 0, u, h in ascending order. u, h, -0.1, 0 Suppose -4c = 0, 2c + 289 - 357 = i. Sort 1, -2, 5, i. i, -2, 1, 5 Suppose -3u - 2 = -2a - 4, 4u = 4a + 4. Suppose u = 6s - 10s + 4. Let w(x) = 3x*2 + x - 1. Let n be w(s). Sort n, -5, -1 in decreasing order. n, -1, -5 Let l = 5 - 8. Suppose -4a = -2a - 10. Suppose -4 = 6p - ap. Put l, p, 3 in descending order. 3, l, p Let a = 1.05 + -10.45. Let z = a + 0.2. Let m = -9 - z. Put 2/7, -5/2, m in increasing order. -5/2, m, 2/7 Let d be 3 + (-2)/33. Let y = -325 + 316. Put d, -2, y in decreasing order. d, -2, y Let z = 3.9 + -3.6. Let s = -2.83	{ "pile_set_name": "DM Mathematics" }
+ sqrt(1900) + -2 + -5(5 + (sqrt(19) - (-2 + (sqrt(57)/sqrt(3))2 - sqrt(19)))1). 20sqrt(19) + 1959 Simplify 5 + (sqrt(39)/sqrt(3) - sqrt(13))-5 + 0 - ((sqrt(52)/(sqrt(4) + sqrt(12)/sqrt(3)))*2 + sqrt(13) - (-5 + (4sqrt(13))*2)). -sqrt(13) + 819/4 Simplify (14(sqrt(48) + -1sqrt(144)/sqrt(3) - (sqrt(48) + sqrt(48) + (-3 + -3sqrt(48) - sqrt(48))))3)*2. 6912sqrt(3) + 28944 Simplify 0 + (sqrt(245) + 0 + 2 - sqrt(245) - -4(sqrt(245) + sqrt(245)1 - sqrt(245)))25. 20 + 280sqrt(5) Simplify (-4(-2 + sqrt(2)))*2 + (sqrt(2) - (sqrt(2) - sqrt(32)-4)*2) + 2(sqrt(12)/(2sqrt(6) - sqrt(6)) - sqrt(180)/sqrt(10)). -482 - 67sqrt(2) Simplify -4 + (((-51sqrt(20))/sqrt(4) - (4 + sqrt(5) + sqrt(60)/(sqrt(12)3))2) + -4)2. -94sqrt(5)/3 - 556/9 Simplify (sqrt(432)-16 + 5 + -5 + 6(2 + (sqrt(147) - (-2 + sqrt(147))-6)))2. -26640sqrt(3) + 151452 Simplify ((-2sqrt(144)/sqrt(4))/(sqrt(4)/(sqrt(8)/sqrt(4))))/(6-4(sqrt(81)1 + sqrt(81))). sqrt(2)/72 Simplify (((sqrt(175) - (sqrt(175) + 3sqrt(175))) + -1)-1)*2 - (2-3sqrt(343) + -3)2. -10781 - 222sqrt(7) Simplify (sqrt(99)/(sqrt(3) - 3sqrt(3)))/(sqrt(11) + 1sqrt(11)-6) - (-2 + ((-2sqrt(243) + sqrt(243))-4)2 + 5). -3891 + sqrt(3)/10 Simplify ((63sqrt(1000) + sqrt(1000) + sqrt(1000))-6)/(sqrt(16)/(sqrt(40)/sqrt(5)-2)-3). -800sqrt(5) Simplify 2 + -4 + ((-3 + sqrt(9)/sqrt(27) + (sqrt(363)2 - (sqrt(75)-2 - sqrt(3))))-2)*2. -800sqrt(3) + 40102/3 Simplify (3sqrt(567)4 + 2 - ((sqrt(63) - (sqrt(63)2 + 5)2) + -2sqrt(4032))) + -4. 275 + 213sqrt(7) Simplify (1sqrt(187)-5 - 3sqrt(187)-2)/((sqrt(132) + sqrt(132) + sqrt(132)3)/sqrt(12) - sqrt(1408)/sqrt(2)). -sqrt(17)/3 Simplify ((2 + (-6sqrt(200)-1 - sqrt(200)) + ((sqrt(216) + (sqrt(216) - (sqrt(216) + 2sqrt(216))))/sqrt(9))/(sqrt(24)/(sqrt(2) + sqrt(8)/sqrt(4))))3)*2. 1728sqrt(2) + 41508 Simplify 1 + (-5 + 1 + (sqrt(76) - -1sqrt(76)))2 + ((-3sqrt(76)2 + sqrt(76))6)*2 + -1. -32sqrt(19) + 68720 Simplify (-2-2sqrt(1800) + (sqrt(1800)-1 - sqrt(1800))1)/(sqrt(160)1 + (sqrt(90)-1 - sqrt(90))/sqrt(9)) + -3. -3 + 6sqrt(5) Simplify (((sqrt(1400) + sqrt(1400)2)6 + -1(sqrt(1400) + -1sqrt(1400)))/((2sqrt(6776))/(1sqrt(72) + sqrt(8) + sqrt(8))))2. 405000/121 Simplify ((-3sqrt(572)1 - (sqrt(572) - -6(sqrt(572) - (sqrt(572) - sqrt(572)-2))))/(sqrt(2816)-3))*2. 13/9 Simplify (4(sqrt(70) - ((sqrt(70)3 - sqrt(70))-3 - sqrt(70))))/(1sqrt(90)-5)4. -128sqrt(7)/15 Simplify (sqrt(130)34 - sqrt(130)1-4)/(((sqrt(90) + (-1sqrt(90) - sqrt(90)))/sqrt(9) - sqrt(360))-4). 4sqrt(13)/7 Simplify 0 + (-3sqrt(1375)1)/(-31sqrt(704)). 5sqrt(5)/8 Simplify -5((1sqrt(2000)3)/((sqrt(10) - sqrt(250)-2)1))2. -9000/121 Simplify 1(-1 + ((sqrt(2) - sqrt(10)/(sqrt(5)-1)) + (sqrt(98) + 4 - sqrt(2)) - ((-2 + sqrt(2) + 1)1 + 4)*2)). -8 + 2sqrt(2) Simplify (-56(5 + (sqrt(80) - (sqrt(80) + sqrt(80) + -1) - sqrt(80))1 + sqrt(80)13))2. 43200sqrt(5) + 104400 Simplify (6(-1sqrt(70) + sqrt(70)) + (-3sqrt(70) + sqrt(70))-3)/((-2sqrt(70)2)/(1sqrt(7)3)). -9sqrt(7)/2 Simplify (-1(sqrt(1008) + (1sqrt(1008) - sqrt(1008) - sqrt(1008)))-1)/(3sqrt(9)16-5). 0 Simplify (((sqrt(270)-2 + sqrt(270))45)/(sqrt(864)1 + sqrt(864) - (-1sqrt(54) - sqrt(6))))2. 1125/49 Simplify 66(-2 + 4 + -2sqrt(1088)-4 + sqrt(1088) + sqrt(1088) + sqrt(1088) + 5). 252 + 3168sqrt(17) Simplify (-5(4 + sqrt(1872) + -2) + 0)2 + -3 + (4(sqrt(1872) - sqrt(1872)2))2 + -5 + sqrt(1872)-2. 1176sqrt(13) + 76844 Simplify (1 + sqrt(57)/(sqrt(384)/sqrt(8)) + (sqrt(76) + 0 + 3)2)*2-1. -6275/16 - 119sqrt(19)/2 Simplify (-4 + ((sqrt(224)/sqrt(8) + sqrt(28))13)/((sqrt(32) - ((sqrt(3200) - sqrt(3200)1) + sqrt(3200)))/sqrt(8)))*2. 16sqrt(7)/3 + 172/9 Simplify -3 + (sqrt(77) - 5-2sqrt(77) - sqrt(77) - -5(sqrt(77) - -2sqrt(77) - sqrt(77)))/(sqrt(448)/sqrt(4) + sqrt(7) + sqrt(28)-1). -3 + 20sqrt(11)/3 Simplify (-1(4 + -1 + sqrt(800)))2 + (sqrt(10) - ((sqrt(10) - 2sqrt(250)) + sqrt(10)))/((-1sqrt(50))/sqrt(10)). 111sqrt(2) + 809 Simplify 5 + -4((sqrt(1700) - (sqrt(1700) - (sqrt(1700) + 3sqrt(1700) + -3))) + (sqrt(1700) - sqrt(1700)23))*2 + 4 + 2. -6825 - 240sqrt(17) Simplify 6-36(0 + sqrt(12) + -1 - 3(sqrt(12) - sqrt(72)/sqrt(6)))*2. -1404 + 432sqrt(3) Simplify ((2sqrt(50))/sqrt(10) + (sqrt(180)4 - sqrt(5)) + 2 + sqrt(320)-12)*2 + -4. 36sqrt(5) + 405 Simplify (-5 + (-3sqrt(396)-2 + -1sqrt(396) + 3 - (4 + (sqrt(396) - (sqrt(396) + -1))4)) + 0)*2. -600sqrt(11) + 10000 Simplify ((sqrt(68) - (sqrt(68) - (-1sqrt(68) + sqrt(68))))6 - sqrt(68) - 3sqrt(68)2)/(63sqrt(4) - (sqrt(4) - 3sqrt(4)4 - sqrt(4))). -7sqrt(17)/30 Simplify sqrt(833) + 2 + -2 + 0 - (1 + 0 + (sqrt(153) + -2 - sqrt(153))). 1 + 7sqrt(17) Simplify (-2 + -5 + (-3sqrt(650)-4)/(-2sqrt(2)-66))2. -35sqrt(13)/3 + 2089/36 Simplify 1(-4 + 4 + 0 + 4((sqrt(121) - (sqrt(121) - 1sqrt(121)))/sqrt(11) - sqrt(11)))2. 0 Simplify -6(-4 + ((sqrt(42)/(1sqrt(7)))/(-2sqrt(2)2) - (2 + 4(sqrt(12) + -2)))*2). -11337/8 + 594sqrt(3) Simplify (6(sqrt(22)-2 - sqrt(22))-56)/((3-2sqrt(24))/(sqrt(36)/(1sqrt(3)))). -90sqrt(11) Simplify -4(1-52(-2 + 5 + sqrt(891)-2) + 0)2. -1429200 + 43200sqrt(11) Simplify 5 + (-53sqrt(70) + (sqrt(70) - (sqrt(70) + 6(sqrt(70) + 2sqrt(70)))))/((sqrt(110)-14)/((sqrt(88)-1 - sqrt(88))/sqrt(8))). -33sqrt(7)/2 + 5 Simplify (1 + (sqrt(1053) + -1)1 + (-2 + sqrt(1872) + sqrt(1872))1)*2 + -5. -132sqrt(13) + 14156 Simplify 1(sqrt(85) - (sqrt(85) + -4(sqrt(85)2 - sqrt(85))))/(1sqrt(80)) - 1(sqrt(2057) + -1)-3-3. -98sqrt(17) + 9 Simplify (-2 + -5 + sqrt(320) + 3(sqrt(25) + sqrt(125)/sqrt(5))/sqrt(5)4)*2. -448sqrt(5) + 5169 Simplify (sqrt(117)4-2-1-4)/(-2-2sqrt(225)3). -8sqrt(13)/15 Simplify (sqrt(190)/(sqrt(10)-5) - sqrt(19))2 - (sqrt(19) + 5 + sqrt(1900)) - (5(-5 + -2sqrt(76)))2. -205066/25 - 1011sqrt(19) Simplify ((1sqrt(130)63)/((sqrt(70) + sqrt(70)-1)/sqrt(7) - sqrt(10)-2-2)-4)2. 4212 Simplify (sqrt(104)12 - sqrt(104)-26)/((sqrt(8) - -2sqrt(8))-2 - (sqrt(280)/sqrt(5))/sqrt(7)). -2sqrt(13) Simplify (-2 + -3(sqrt(896)-3)/(sqrt(2) - sqrt(128)-6) + 5)2. 432sqrt(7)/49 + 8271/343 Simplify ((sqrt(144)/(1sqrt(8)) + ((sqrt(1800) - 2sqrt(1800)) + sqrt(1800) - sqrt(1800) - sqrt(1800) - sqrt(1800)))/(-2sqrt(324)4))*2 + -5. -4919/1152 Simplify (2(sqrt(17)1 + -3 - (sqrt(68)/sqrt(4) + sqrt(17))-3))*2 - (sqrt(153)3 + -2)*22. -96sqrt(17) + 606 Simplify ((sqrt(513)-1 - sqrt(513)) + 2sqrt(342)/sqrt(6))/(((42sqrt(363) - sqrt(363) - sqrt(363)) + sqrt(363))-4). sqrt(19)/77 Simplify (-2 + ((sqrt(847) + 1sqrt(847) + -4 + sqrt(847))-3 - (-5 + (4 + 0 + sqrt(847) - sqrt(847)))))*2. -2178sqrt(7) + 68728 Simplify (3 + 5 + sqrt(1008) + sqrt(1008)3 + sqrt(1008) + -5)2 + ((sqrt(252) - (sqrt(252) + 2)) + sqrt(252) + 1 + 3)2. 384sqrt(7) + 25465 Simplify (-5sqrt(567)-226)/(-4sqrt(441)-15). 18sqrt(7)/7 Simplify (6((sqrt(256) - sqrt(256)-1 - sqrt(256)) + sqrt(256) + (-2sqrt(32) + sqrt(32))/sqrt(2)))/(sqrt(1152)-2-2-1). -7sqrt(2)/8 Simplify 5(-26(-2sqrt(325)-1 - (-1 + (sqrt(325) - -2sqrt(325))))2 + 5). -19535 + 600sqrt(13) Simplify ((2 + (sqrt(567) + sqrt(567)4)3)3)2 + -3(((-1 + sqrt(567))*2 - sqrt(567)) + sqrt(567))-42. 4428sqrt(7) + 1161843 Simplify -4 + 1(sqrt(300) + -1) - (sqrt(363) - sqrt(363)4)*2-21. 10sqrt(3) + 6529 Simplify (sqrt(2736)-1 + (sqrt(19) - (-3 + sqrt(152)/sqrt(8))))2 - (2 + 1(sqrt(19) + sqrt(228)/sqrt(48))). -147sqrt(19)/2 + 2743 Simplify (sqrt(9)/sqrt(432) - sqrt(3) - (5 + sqrt(147)) - (3 + (sqrt(363) - (-4 + sqrt(363))) + 5))2. 1615sqrt(3)/6 + 22897/48 Simplify ((3(sqrt(162) + 2)-4)2 + (((sqrt(96)/sqrt(2) + sqrt(48))/sqrt(2))/sqrt(432))2)4. 20736sqrt(2) + 860552/9 Simplify (((sqrt(10) + -2sqrt(10))3 + sqrt(10) + sqrt(80)/(-2sqrt(8)))/(((sqrt(60) + sqrt(60) + 1sqrt(60))/sqrt(5))/(sqrt(54)/sqrt(81))))*2. 125/324 Simplify ((-2-1sqrt(252))/(sqrt(64) + -2sqrt(64)))/((sqrt(441)35 + sqrt(441))-4). sqrt(7)/896 Simplify 2 + (0 + 6(-3 + sqrt(1900) + sqrt(1900)-2 + sqrt(1900) + -4 + (sqrt(1900) - sqrt(1900)2)))*2 + -2. 5040sqrt(19) + 7016	{ "pile_set_name": "DM Mathematics" }
3031779 Product of 91310 and -45.6. -4163736 11 * 21488806 236376866 What is -88917.2 times -29? 2578598.8 1050.9-946 -994151.4 What is -0.0536 times -585235? 31368.596 Calculate -3.07510543. -32419.725 Work out -2890 * 54350. -157071500 Multiply -0.139 and -0.0396. 0.0055044 Calculate 1.9847550.293. 0.581533215 -0.4 -540524 216209.6 Calculate -29-2252459. 65321311 Calculate -0.078080.18763. -0.0146501504 Calculate -0.239.1094. -7.82188 What is the product of -2607561 and 0? 0 983.36780 767020.8 Calculate 1917.7387.6. 743300.52 What is -1142606 times 0.19? -217095.14 Product of -33837750 and -0.2. 6767550 Calculate -1487.58-0.1. 148.758 Work out -16749 * -0.1991. 3334.7259 Product of -0.03513941 and -0.4. 0.014055764 Work out -77079 * -798. 61509042 Multiply -145 and -0.2123857. 30.7959265 104.95081 times 1 104.95081 What is 7.12 times -45349? -322884.88 -0.4 * -2.05729 0.822916 Multiply 9.79 and -10946. -107161.34 What is the product of -1592046 and -0.07? 111443.22 Work out -11 * 1124.042. -12364.462 What is -46.863353 times 0.2? -9.3726706 What is the product of -33725 and 0.12874? -4341.7565 Multiply 194.93 and -139. -27095.27 -0.0847515 * 0.1 -0.00847515 270 * -222431 -60056370 Product of 8541962 and 0.8. 6833569.6 Multiply -0.0353 and -63103. 2227.5359 215283.155 60878.325 Calculate 0.06-3594504. -215670.24 Multiply -4646403 and 0. 0 Multiply 2317113 and 0.7. 1621979.1 Multiply 0 and -529516. 0 Calculate -0.0273397.3. -91.7271 0-129813147 0 Product of -364704 and 1.3. -474115.2 What is the product of -5.092 and 309? -1573.428 Product of -0.99 and 1264798. -1252150.02 What is 203564.65 times 0.03? 6106.9395 What is 1.54 times 26.456? 40.74224 Multiply -58199 and 25.8. -1501534.2 Work out -30.4 * 27.0435. -822.1224 Product of -1808 and -42.07. 76062.56 What is -0.1255037 times 17? -2.1335629 22755370 times -1 -22755370 Calculate 177191587. 33910899 What is -1.578 times -11.429? 18.034962 -25 -44810 1120250 Calculate -0.34072.672. -1221.8016 Multiply -6.3 and 510792. -3217989.6 Multiply 0.4 and -181151288. -72460515.2 What is -2 times 48917820? -97835640 0.214991.66 2998.332 385615 * -36 -13882140 Calculate 13586.965-0.5. -6793.4825 -295030.9-8 2360247.2 Calculate 0.07-88108.603. -6167.60221 Multiply 0.10831152 and -0.081. -0.00877323312 What is -0.3 times -13522.795? 4056.8385 Product of -0.202 and -3.6524. 0.7377848 -0.1-61532.93 6153.293 71644 times -192 -13755648 Product of -97361137 and 11. -1070972507 0.23 times -274031 -63027.13 What is the product of -2034701 and 3? -6104103 What is -0.1 times 16031706? -1603170.6 -11 times 15419206 -169611266 Product of 32.289 and -0.74. -23.89386 Product of 44542 and 291. 12961722 Work out -1500.6 * -1628. 2442976.8 -3 * -0.37828651 1.13485953 0.1 * 19.0250704 1.90250704 What is the product of -0.5 and -1771510? 885755 Work out -163028.38 * -0.3. 48908.514 Work out 8 * -20419105. -163352840 2.6 * 9104903 23672747.8 -655.7 times -14677 9623708.9 Product of -0.3481 and -100.818. 35.0947458 Product of 0.1 and -28784913. -2878491.3 Multiply -6.536 and 1.4. -9.1504 -100.033511813 -0.33511813 Calculate 180154-2.744. -494342.576 -3899868 * 4 -15599472 Product of 3.313 and 172.43. 571.26059 Work out 28926760 * 43. 1243850680 -0.05 * 0.00000022 -0.000000011 What is the product of -10911 and -3899? 42541989 Calculate 3466.96-107. -370964.72 586913.99 82107.31 1785777372 357155474 -0.367249.6 -3.525504 -1243010.0209 -2597.8909 -98381.7 0.3 -29514.51 Multiply 297293 and 0.67. 199186.31 Multiply 313 and -1.363948. -426.915724 0.279 * -45.83 -12.78657 -23.7390.049 -1.163211 3-2564171 -7692513 Work out -85377.7 * -845. 72144156.5 -7677.503 * 0.17 -1305.17551 Product of 0.060116 and 2106. 126.604296 What is -1.2 times -5812.164? 6974.5968 0.7-35584 -24908.8 What is the product of -130.2497 and -0.9? 117.22473 Calculate -14.13228682. -405334.024 Multiply -1626 and -6709. 10908834 -0.2 times -0.5699848 0.11399696 16 * -95625 -1530000 Multiply -0.2307 and 0.12336. -0.028459152 0 times -34739334 0 Work out -8343323 * 4.2. -35041956.6 What is 4.3069034 times -0.3? -1.29207102 -4 * -93945045 375780180 Work out -0.08 * 0.049345129. -0.00394761032 Product of -133 and -1132602. 150636066 -3241 * 1075 -3484075 6951 times 564.5 3923839.5 Multiply 1355897581 and 0.2. 271179516.2 Calculate -7.4-111855. 827727 -768409939 times -5 3842049695 0.3-7277100.4 -2183130.12 What is the product of -0.8 and 28.003622? -22.4028976 3 times -1289258 -3867774 0.5 times 4268.692 2134.346 Calculate -54.5-1244. 67798 Multiply -101.7285 and -0.27. 27.466695 Calculate -0.1-6830968. 683096.8 What is the product of -117167 and -2564? 300416188 Product of -29195 and -2.7. 78826.5 1-3517837 -3517837 Work out -54101 34.6. -1871894.6 Calculate 50.07378077. 0.36890385 -612887120.3 -18386613.6 Multiply -3.225 and 417. -1344.825 Calculate 52940.08224. 435.37856 Product of -12663 and -462.7. 5859170.1 -16658 -0.157 2615.306 Product of 73 and 119.318. 8710.214 95070.3 66785 Work out 8977 2792. 25063784 What is the product of -182.70262 and 0? 0 19.5 times -0.45762 -8.92359 -118284.01 -18284.01 Work out -2.61 -498015. 1299819.15 Product of -2.029034 and -1.5. 3.043551 What is -44 times -1.312924? 57.768656 Calculate -120696316. -72417786 Work out -474647 32. -15188704 Work out -5490473 * 2. -10980946 Calculate -0.415678956. -6271582.4 Multiply 1 and 944.9627. 944.9627 Work out 21.444 -595. -12759.18 Calculate -5.870.0077725. -0.045624575 Product of -0.57 and -0.13537007. 0.0771609399 Multiply 7297 and -0.118. -861.046 -679 77688 -52750152 What is the product of 4 and 80324412? 321297648 5502435-2 -11004870 Calculate 1139938510. 139938510 Work out -5 * -0.60998935. 3.04994675 Work out -300.981 * 76. -22874.556 Product of -3.06 and 5718. -17497.08 -117426990.1 -1174269.9 What is -5802754 times 4? -23211016 Product of 0.05047 and 128.63. 6.4919561 What is the product of 0.4302 and 3400? 1462.68 Calculate -0.0222.5377. -0.450754 Multiply -42.81 and -7259. 310757.79 Calculate 142274157. 81096237 Work out 46.7834 -16. -748.5344 -0.069251.7047 -0.118050475 0.1720.0859119 0.0147768468 Multiply 1789013 and 0.2. 357802.6 3454.73 * -326.6 -1128314.818 -3286855 times -0.08 262948.4 Multiply -303.5998 and -2.7. 819.71946 What is the product of 32496 and 388? 12608448 Product of -24 and -435050. 10441200 Multiply 280865 and -156. -43814940 7000013 times 6 42000078 What is the product of 627 and -31.9149? -20010.6423 -0.09 times 1283639 -115527.51 Multiply 4120 and 15546. 64049520 -1741663 times 0.1 -174166.3 Calculate 0.065551132. 3349.146 What is 16735 times 0.00016? 2.6776 What is -567 times -32.9087? 18659.2329 686 6.627 4546.122 Work out 373.61294 * 4. 1494.45176 Calculate -13.91189723. -2639046.93 What is -653.255 times -73? 47687.615 -10.575 42.011 -444.266325 -3654.6 * -0.35 1279.11 Calculate 0.1054-9186. -968.2044 What is -10235 times 1796? -18382060 -2.52 -450201 1134506.52 -0.09 * -179093.19 16118.3871 -914-28.799 26322.286 -2875 times 17.5037 -50323.1375 4 126268448 505073792 What is -1 times -16015549? 16015549 What is 112015 times -0.047? -5264.705 -0.117 times 16.4347 -1.9228599 Multiply -63 and 411943. -25952409 Calculate 0.4561435-49. -22.3510315 Calculate -2.6091-157. 409.6287 Work out 163002.26 * -4. -652009.04 Multiply 2200770.5 and 0. 0 1524853 times -83 -126562799 What is 70.98 times -8.802? -624.76596 894130 * -14 -12517820 -29020.03382 -98.14564 Work out -3115153 0. 0 91148669.5 61023586 Multiply 180.155 and -28. -5044.34 17.9223.063 54.895086 What is 17173948 times 0.5? 8586974 Multiply 4239.79 and 146.7. 621977.193 Work out -5 * -2826.4. 14132 -16 * 682833 -10925328 Work out 1 * -3147153. -3147153 -140946766-0.2 28189353.2 -0.55057540.03 -0.016517262 What is 32.83 times 26.6? 873.278 Product of 3 and -11369837. -34109511 5.48383 * 0.16 0.8774128 -0.0431565474 -1262618.96 What is the product of -118.636776 and 0.4? -47.4547104 859 times -0.6741 -579.0519 Calculate 5178959528. 894797640 19 * 458497 8711443 What is the product of -345021 and 714? -246344994 What is the product of 441 and 98178? 43296498 What is 2349243 times 0.04? 93969.72 Multiply -	{ "pile_set_name": "DM Mathematics" }
remainder when c(d) is divided by 13. 11 Suppose -2l - 3l = 0, 4n - 176 = -l. What is the remainder when 1273 is divided by n? 41 Let k = -121 + 278. Calculate the remainder when k is divided by 16. 13 Let f(w) = 31w*2 + 25w - 56. Let y = -49 + 73. Calculate the remainder when f(2) is divided by y. 22 Suppose -5z = -3h - 753, 452 = 3z - h - h. Calculate the remainder when z is divided by 53. 44 Calculate the remainder when 130 is divided by (28/3)/(28/126). 4 Let z = -354 - -267. Let p = z - -107. Suppose -4w = -0w - 308. What is the remainder when w is divided by p? 17 Calculate the remainder when 163 is divided by (9/(-54)-100)/(2/3). 13 Let h = -1187 - -1212. What is the remainder when 246 is divided by h? 21 Let r(z) = -z*3 + 9z*2 - 9z + 8. Suppose 55x + 12 = 57x. Let u = 13 - 0. Calculate the remainder when r(x) is divided by u. 10 Let o be ((-35)/10)/(2/(-4)). Suppose o = c + 2. Suppose 5i - 5k - 76 - 39 = 0, -ci - k = -121. Calculate the remainder when 95 is divided by i. 23 Suppose -c = -2c + 2j + 20, 0 = 4c + 2j - 50. Let y be (-3)/4 - (-171)/36. What is the remainder when -2 - (y + (-31 - -1)) is divided by c? 10 Suppose -65 = 4c - 3a, c = 3a - 1 - 4. Let k = -51 - -48. Calculate the remainder when 34 is divided by (90/c)/(k/8). 10 Let a(p) = 6p2 - 4p + 55. Let n(d) be the third derivative of -d4/6 - d3/6 - d*2. What is the remainder when a(0) is divided by n(-5)? 17 Let f = -266 + 440. What is the remainder when f is divided by 22? 20 Suppose 3w - 3h - 30 = 0, -h - 2h = -w. Let z be 0 + (44 - 4/4). Calculate the remainder when (-1 - -4)z/3 is divided by w. 13 Suppose -3h - 55 + 145 = -4o, 5h - 139 = 3o. Let y(v) = -v2 - v + 129. Calculate the remainder when y(0) is divided by h. 25 Suppose 29 = -4a + 85. Let j = 69 - 39. What is the remainder when j is divided by a? 2 Suppose 0 = 3w - 5w + 16. Suppose 0 = wl - 705 - 559. What is the remainder when l is divided by 32? 30 Let c(t) = 9t + 26. Let h be c(6). Suppose -10z + 6z = -h. Let w = 149 - 92. What is the remainder when w is divided by z? 17 Suppose -3u = -2m - 3, 4u - 4 = -5m - 0. Suppose 55 = 5z + 3o + 2o, -4z - 2o + 54 = m. Calculate the remainder when 31 is divided by z. 15 Suppose z + 293 - 1739 = 5h, 5669 = 4z + 3h. What is the remainder when z is divided by 75? 71 Let f = 45 - 20. Suppose -22z - 36 = -fz. What is the remainder when 45 is divided by z? 9 Let b(k) = -k*2 + 29k - 49. Calculate the remainder when b(26) is divided by 4. 1 Suppose -2b - w + 10 - 3 = 0, 2w - 16 = -5b. Suppose ba - 4 - 2 = 0. Suppose 0 = -aq + 19 + 8. Calculate the remainder when q is divided by 5. 4 Suppose -4d - o - 4 + 14 = 0, 4d - 5o - 22 = 0. Suppose -d = -z - 1. What is the remainder when 28 is divided by 11 + z/(4/(-6))? 4 Suppose 4p - 40 = -8. Calculate the remainder when 28 is divided by p. 4 Let j be (-4)/(-10) - (-253)/55. What is the remainder when 92 is divided by -2 + 48 - 1/(j/(-5))? 45 Let g = -1 - -7. Suppose -2u = -gu - 4. What is the remainder when 81 is divided by 1 + (u - -21)/1? 18 Let u(h) = 2h - 63. Let p(c) = -c + 31. Let t(g) = 13p(g) + 6u(g). What is the remainder when 193/3 + 6/9 is divided by t(8)? 14 Suppose 683 = 3u + 4w, -9w + 1115 = 5u - 14w. Calculate the remainder when u is divided by 13. 4 Suppose 2t = 0, 147 = 3f - 4t + 3t. Calculate the remainder when 176 is divided by f. 29 Suppose v - 2w = -3w + 112, 0 = -3v + 4w + 315. What is the remainder when v is divided by 7? 4 Suppose a + 2p + 0p - 61 = 0, 0 = 3a + 2p - 203. Calculate the remainder when a is divided by 19. 14 Suppose 0f - f = 4j - 60, 3f = -5j + 68. Suppose 3i + 8 = -j. Calculate the remainder when 44 + (-4)/(-8)i is divided by 14. 12 Let y(w) = -10w + 1. Let h be 0 + -1 + (-14)/(-2). Let d be y(h). Let k = 92 + d. Calculate the remainder when 96 is divided by k. 30 Suppose 32b = -h + 35b + 70, -70 = -h - 3b. What is the remainder when h is divided by 21? 7 Let z be (3/(-2))/((-3)/28). Let q = -8 - -4. What is the remainder when (q/z)/((-1)/329) is divided by 19? 18 Let i = -5 + 22. Let z = i + 5. Suppose 3n - 30 = 2a, 0 = n + n - 5a - 31. Calculate the remainder when z is divided by n. 6 Let h = 1532 - 1485. What is the remainder when 172 is divided by h? 31 Let q = 2185 - 2047. Calculate the remainder when q is divided by 34. 2 Let v(b) be the first derivative of b3 + b2/2 + 5b - 16. Calculate the remainder when v(4) is divided by 31. 26 Suppose 0 = 178k - 176k - 18. What is the remainder when 32 is divided by k? 5 Let g = -23 - -45. Suppose -a - 30 = o - 4o, -10 = 5o. Let m = -24 - a. Calculate the remainder when g is divided by m. 10 Let t be -1(-1 + (-3 - 1)). Suppose 14a = 19a - t. Calculate the remainder when 3 is divided by a. 0 Let w(q) = -q*3 - 25q*2 - 69q - 37. Calculate the remainder when 42 is divided by w(-22). 13 Suppose 0 = 2y + 4l - 32, y - 16 = -0y - l. Calculate the remainder when 23 is divided by y. 7 Let a be 1(1 - (4 + -2)). Let w(u) = -u*3 + 11u*2 + 2u - 5. Calculate the remainder when ((-1)/a)/((-3)/(-87)) is divided by w(11). 12 Suppose 0 = -3s + 137 + 40. Let m = s + -50. What is the remainder when 33 is divided by m? 6 Suppose 0 = 2m - 2, 4b + 0b + 3m = 127. Let a = b + -13. What is the remainder when (-274)/(-4) + 1 + (-7)/(-14) is divided by a? 16 Let j be (-22)/77 + -214(-3)/42. Suppose 11s + 76 = js. What is the remainder when s is divided by 11? 8 Suppose -12b - 2 = -2a - 7b, 3b = 6. Calculate the remainder when 28 is divided by a. 4 Suppose 4l - 116 = 56. Calculate the remainder when l is divided by 25. 18 Let k(j) = -j + 3. Let y be k(7). Let d = y - -18. Calculate the remainder when d is divided by (-5)/((-15)/6) + 3. 4 Let b = 5 + 9. Suppose l = 196 + 607. Suppose 11r + 198 = l. What is the remainder when r is divided by b? 13 Let b(p) = -4p3 + p2. Let f be b(-1). Suppose 5h = ft - 0h - 50, 5t + 4h = 59. Calculate the remainder when (-226)/(-7) + (-4)/14 is divided by t. 10 Suppose -17f - 256 = -528. Calculate the remainder when 42 is divided by f. 10 Suppose -2l + 3t - 10 = 0, 0 = 2l + 4t - 4. Suppose 3z + 10 = -4g, 0g + z + 4 = -2g. Calculate the remainder when 14 is divided by (l/g)/(4/8). 2 Let w(q) = -q3 + 8q*2 - 8q + 23. Let b be w(7). Calculate the remainder when 34 is divided by -2b/2814/(-4). 2 Let u = -32 + -125. Let j = -84 - u. What is the remainder when j is divided by 25? 23 Let m = -197 + 276. Let i = m - 47. What is the remainder when i is divided by 24 - 2 - (7 + -2)? 15 Let g be (-2)/(-5) - 52/(-20). Suppose -f + 24 = gf. What is the remainder when f is divided by -7(10 - (-72)/(-7))? 0 Suppose -g + 71 = 5p, 0 - 1 = -g. Calculate the remainder when 3 + -3 + 48 - -5 is divided by p. 11 Suppose -3u + 4w = 2u - 179, -3u + 109 = -2w. Suppose 2j - s = -2j + 36, 4j + s - 28 = 0. Let z = j + 2. What is the remainder when u is divided by z? 9 What is the remainder when (-3)/(-9 - (-3120)/350) is divided by 24? 11 Let v = 256 - 208. Calculate the remainder when 526 is divided by v. 46 Let g(s) = 93s - 1. What is the remainder when g(1) is divided by 10((-896)/(-40))/7? 28 Suppose 0 = 2u - 65 + 89. Calculate the remainder when 77 is divided by (-1 + u)/(-1)(-4)/(-2). 25 Let r = -79 + 184. Suppose 33 = 3n - r. Calculate the remainder when n is divided by 7. 4 What is the remainder when 490 is divided by 8/(-6) - (-19769)/159? 121 Let o(g) = 35g + 313. Calculate the remainder when 230 is divided by o(-8). 32 Suppose 15 = 2r + 5i - 24, 0 = 3i + 9. What is the remainder when r is divided by 6? 3 Let w = -1028 - -1039. Suppose 226 = 3f + 37. Calculate the remainder when f is divided by w. 8 Suppose 16w = 14w + 134. Calculate the remainder when w is divided by 12. 7 Let r be 14(6/4 - 3). Let y = r + 19. Calculate the remainder when y/6 - 37/(-3) is divided by 7. 5 Suppose -5k + 1269 = 4s, 359 = 3k - s - 416. What is the remainder when k is divided by 82? 11 Let v = 596 - 946. Calculate the remainder when 55 is divided by 8/(-10)v/28. 5 Let i(s) = s*3 - 9s*2 - 10s - 3. Let f be i(10). Let a(z) = -6*z + 5. What is the remainder when 91 is divided by a(f)?	{ "pile_set_name": "DM Mathematics" }
ne g(-70). -1082 Let r(w) = 108w2 + 16151w - 7318. Calculate r(-150). 32 Let s(r) = -r*3 - 35r*2 + 29r + 832. Calculate s(-36). 1084 Let u(s) = 554s + 9412. What is u(-17)? -6 Let g(r) = -2r*2 + 321r + 423. What is g(164)? -725 Let w(a) = 78a + 1829. Give w(-15). 659 Let v(d) = -69d*2 + 188d + 153. Determine v(0). 153 Let w(f) = -7f3 - 1076f*2 + 308f + 22. Calculate w(-154). 22 Let c(s) = -s*3 - 170s*2 - 1890s + 45897. What is c(-156)? 33 Let v(z) = 2z3 + 3z*2 + 997z + 5077. Give v(-5). -83 Let n(a) = -10a3 + 2957a*2 + 885a + 761. What is n(296)? -127 Let c(b) = -4b3 + 169b*2 + 136b + 12. Determine c(43). 313 Let w(j) = -36j2 - 216j + 645. Give w(3). -327 Let c(w) = 404w - 41096. Give c(99). -1100 Let r(m) = -27571m - 248141. Give r(-9). -2 Let l(v) = 2v2 + 534v - 26098. What is l(-306)? -2230 Let b(k) = k*3 - 2k*2 - 3381k + 1051. Give b(59). -11 Let y(n) = -14n2 - 17828n - 53419. What is y(-3)? -61 Let k(u) = -13u2 + 253u - 1030. What is k(6)? 20 Let w(d) = -334d - 7167. Determine w(-23). 515 Let p(s) = -s3 + 64s*2 - 702s - 1631. Determine p(49). -14 Let q(d) = -d*3 + 23d*2 + 22d - 161. Determine q(28). -3465 Let g(t) = 2t3 - 193t*2 + 4384t - 138. Determine g(60). 102 Let h(n) = -5085n - 40287. What is h(-8)? 393 Let j(y) = 5823y - 471667. Give j(81). -4 Let x(z) = -16966z - 984112. Give x(-58). -84 Let s(v) = v2 - 41v + 601. Give s(10). 291 Let r(y) = 25194y + 403100. Determine r(-16). -4 Let o(f) = -2f*2 - 361f + 4503. What is o(-192)? 87 Let u(k) = -5k3 + 50k*2 - 15k + 103. Determine u(11). -667 Let m(f) = -3f3 - 16f*2 - 6f + 20. What is m(-6)? 128 Let b(u) = 2u3 - 39u*2 - 17u + 2278. Calculate b(15). -2 Let t(p) = 5p3 - 1983p*2 - 812p + 7209. Give t(397). 63 Let v(l) = l*2 - 738219l + 5167456. Determine v(7). -28 Let l(a) = -5a2 - 12a + 23. Calculate l(8). -393 Let m(h) = 1361h + 2162. Give m(-2). -560 Let c(q) = -21q*2 - 148q + 863. Determine c(6). -781 Let p(g) = 2g3 - 462g*2 + 33g - 6641. Determine p(231). 982 Let d(g) = g3 + g2 - 742g - 920. Give d(-27). 160 Let g(y) = -157y + 2656. Determine g(17). -13 Let s(b) = 2b2 + 33b - 11857. What is s(-85)? -212 Let c(m) = 9063m + 145150. What is c(-16)? 142 Let z(g) = -g3 + 120g*2 + 5801g - 256. Give z(-37). 40 Let b(m) = 2m3 - 77m*2 + 12m - 1791. Determine b(39). 198 Let u(n) = 1377n + 3420. Calculate u(-2). 666 Let n(c) = -17265c - 68965. Calculate n(-4). 95 Let g(q) = -q*3 + 15q*2 + 819q - 11366. What is g(14)? 296 Let z(b) = 49b2 + 31b - 97. Calculate z(-6). 1481 Let w(p) = -p*2 - 70394p - 633486. Calculate w(-9). -21 Let a(j) = -7j3 - 6j*2 - 24j - 21. Determine a(-6). 1419 Let g(r) = -13r - 493. What is g(-18)? -259 Let k(y) = -4204y - 8285. Determine k(-2). 123 Let j(l) = 8l3 + l2 - 38l - 35. What is j(-5)? -820 Let f(i) = i*3 - 235i*2 - 1371i + 4. Determine f(-6). -446 Let x(p) = 31p - 1899. Give x(59). -70 Let c(v) = -15v*2 + 3927v - 407. Calculate c(263). -5141 Let n(c) = 3c3 - 66c*2 + 136c - 331. Calculate n(20). -11 Let f(v) = v*2 - 110v - 11182. What is f(-64)? -46 Let t(w) = 313433w + 2507515. What is t(-8)? 51 Let a(x) = 9520x*2 + 57109x - 17. Give a(-6). 49 Let l(h) = 88h2 + 14130h - 6116. Give l(-161). 2 Let d(u) = u*3 + 25u*2 + 147u + 63. What is d(-17)? -124 Let v(p) = 2p3 + 31p*2 + 368p + 2964. Determine v(-11). 5 Let r(q) = -3q2 - 292q + 22377. Determine r(-148). -119 Let p(i) = -256i + 11651. What is p(46)? -125 Let u(a) = 384a - 32240. What is u(85)? 400 Let h(q) = -q*3 + 99q*2 + 3449q + 13581. Determine h(127). -8 Let c(h) = 3807229h - 34265069. Determine c(9). -8 Let m(v) = 6887v - 34450. What is m(5)? -15 Let r(h) = -23h2 - 373h - 244. Give r(-15). 176 Let f(p) = 3p3 + 32p*2 + 94p + 743. Give f(-10). 3 Let z(m) = -3m3 + 8m*2 + 70m - 322. Determine z(4). -106 Let q(u) = 2u3 + 19u*2 + 845u + 7467. Determine q(-9). -57 Let d(f) = f*2 + 1076f + 39239. Calculate d(-38). -205 Let p(s) = 1534s - 297878. Calculate p(195). 1252 Let p(w) = -394w - 11772. Calculate p(-30). 48 Let m(r) = 5r2 - 21106r - 63360. Give m(-3). 3 Let k(t) = -1904t3 + 48t*2 - 49t. Determine k(1). -1905 Let o(w) = -13929w + 115484. What is o(8)? 4052 Let d(r) = -9r*2 + 971r + 227. Determine d(108). 119 Let x(h) = -h*3 + 7h*2 - 88h + 140. What is x(5)? -250 Let w(x) = -67x2 + 1905x + 7648. Calculate w(-4). -1044 Let x(f) = -906f + 700. Calculate x(2). -1112 Let d(x) = 114x + 27819. Determine d(-242). 231 Let s(j) = 106j2 + 1780j + 7022. Give s(-6). 158 Let h(a) = -738a - 4395. Calculate h(-7). 771 Let y(b) = -48b*2 + 154b + 455. What is y(-3)? -439 Let p(b) = -12030b + 9142825. Calculate p(760). 25 Let x(w) = 6w*3 + 6w*2 + 29w + 22. Calculate x(-4). -382 Let k(a) = -a*2 + 415a - 24972. What is k(342)? -6 Let t(l) = -3408l + 207958. Determine t(61). 70 Let u(o) = -4o*3 - 14o*2 - 1778o - 14304. Determine u(-8). 1072 Let s(y) = 103y - 7741. Calculate s(76). 87 Let b(k) = -1350k - 2511. Give b(-4). 2889 Let c(b) = -187b2 - 440b + 51. Calculate c(-3). -312 Let r(w) = w*3 + 28w*2 + 6w + 190. Calculate r(-28). 22 Let s(d) = d*3 + 12d*2 + 16d - 686. Determine s(0). -686 Let q(r) = 7r2 + 89r - 271. Give q(5). 349 Let m(p) = p*2 - 113p - 7478. Calculate m(-47). 42 Let x(q) = -100q3 + 4q*2 - 11q + 8. Give x(2). -798 Let t(p) = -p*3 + 716p*2 - 5387p - 196094. Give t(708). 22 Let d(g) = 7g2 - 869g + 1828. Calculate d(122). -2 Let v(r) = -3r2 + 230r + 496. Calculate v(79). -57 Let r(u) = -8u3 + 52u*2 + 449u + 27. Determine r(11). 610 Let q(c) = 25981c - 77923. Calculate q(3). 20 Let n(j) = -106j + 9852. Calculate n(93). -6 Let r(q) = -2q2 + 634q + 3228. What is r(-5)? 8 Let g(t) = -1132t - 13621. Give g(-12). -37 Let z(s) = 18483s - 295668. What is z(16)? 60 Let s(g) = 1373g + 136795. What is s(-100)? -505 Let g(b) = -b3 + 251b*2 + 11b - 2748. Give g(251). 13 Let w(g) = -447g + 21748. Calculate w(49). -155 Let v(u) = u3 - 7u*2 + 65u - 953. What is v(11)? 246 Let s(o) = 19o2 - 10o + 32. Calculate s(8). 1168 Let w(j) = -720887j + 12255079. Calculate w(17). 0 Let l(v) = -v2 + 723v - 55669. Give l(88). 211 Let k(l) = -76842l + 614743. Determine k(8). 7 Let j(u) = -687u + 2276. What is j(2)? 902 Let t(b) = b*3 + 24b*2 - 51b - 2144. Determine t(-22). -54 Let q(j) = -51j2 + 15577j - 6536. What is q(305)? 174 Let m(g) = -18g3 - 7g*2 + 66g + 217. Determine m(-3). 442 Let j(s) = 6s3 + 3808s*2 + 6361s + 19640. What is j(-633)? 17 Let a(l) = 2l2 - 1511l - 67836. Calculate a(-42). -846 Let n(w) = -64w + 650. What is n(27)? -1078 Let c(w) = -w3 - 119w*2 - 4148w - 475538. What is c(-118)? 2 Let w(r) = -r*2 - 1067r + 11980. Calculate w(11). 122 Let l(j) = j*3 - 98j*2 - 4803j + 19681. Give l(133). -3 Let y(u) = 472u2 + 263u + 10. Calculate y(-1). 219 Let a(b) = -20b2 - 374b - 2584. What is a(-7)? -946 Let r(a) = 143907a + 2014692. Give r(-14). -6 Let g(h) = -h3 + 93h*2 - 356h + 54. Give g(89). 54 Let s(o) = -39o2 - 101o - 26. Determine s(-6). -824 Let l(u) = -6u2 - 3108u + 81. Give l(0). 81 Let q(a) = -2a3 + 312a*2 - 919a + 293. Determine q(153). 140 Let q(s) = 142s + 52263. Calculate q(-368). 7 Let w(r) = r2 + 1136r + 96037. Determine w(-92). -11 Let p(o) = 213o - 1311. Calculate p(5). -246 Let v(h) = 16h*2 + 144h - 2012. Give v(11). 1508 Let w(p) = 116p3 + 3p*2 + 4p + 1. Give w(0). 1 Let h(z) = -7z2 + 1051z + 6388. Give h(156). -8 Let y(z) = -6283z + 2104812. Give y(335). 7 Let s(h) = -h3 - 63h*2 - 86h + 1454. What is s(-62)? 2942 Let s(g) = -6g2 + 941g - 11221. Give s(13). -2 Let d(g) = 454g + 6105. What is d(-14)? -251 Let i(v) = -10v*3 - 14v*2 - 94v - 113. Give i(-2). 99 Let b(j) = 22j3 + 3j*2 - 61653j + 61651. Calculate b(1). 23 Let r(a) = -9a2 - 863a + 99. What is r(-97)? -871 Let x(p) = 21p2 + 1834p - 14677. Give x(8). 1339 Let b(d) = -d*3 - 86d*2 - 1438d - 1918. Calculate b(-64). 2 Let s(b) = -b*3 - 27951b*2 - 27949b + 3. What is s(-1)? 2 L	{ "pile_set_name": "DM Mathematics" }
9akq2 - 7akq - aq2 + kq*2 + 6k + 4q2 wrt a. 9kq2 - 7kq - q2 What is the second derivative of 2l*3m*3 + 5l*3 + 2l*2 - 115lm3 - lm*2 + 704m wrt m? 12l3m - 690lm - 2l Find the first derivative of -41j*2 - 91j + 12116 wrt j. -82j - 91 Find the first derivative of -8h*2m*2s + 16h2m*2u - 20h2u - 11m2su - 4m*2 wrt s. -8h*2m*2 - 11m*2u What is the second derivative of 38v5x - 9v2x*3 + 30vx3 + 2vx wrt v? 760v*3x - 18x3 Find the third derivative of -3g*5 + 19g3 + g2 + 44 wrt g. -180g2 + 114 Find the third derivative of -6341w5 - w2 + 12w + 26. -380460w*2 Differentiate -4l*4 + 26l*3o*2 + 3l*2 + 5o*2 + 18 wrt l. -16l*3 + 78l*2o*2 + 6l What is the first derivative of 13466q4 + 1690? 53864q3 Find the third derivative of b2t2y - 3b2ty3 - 33b*2t + bt2y*2 - 151bty3 - t2y3 wrt y. -18b*2t - 906bt - 6t2 Find the third derivative of 5636j*3 + 106j*2 - 4j wrt j. 33816 What is the second derivative of -2819f2 - 2726f wrt f? -5638 Differentiate -2b3 + 4719b + 2898 wrt b. -6b2 + 4719 Find the third derivative of 15c*4 - 26c3 - c2 + 54c. 360c - 156 What is the third derivative of x*6 - 7x*4y + 3x3 + 5x*2y + 3x2 - 2y wrt x? 120x3 - 168xy + 18 Find the first derivative of 4g*4i*2 - 42g*2i*3 - 497i*3 wrt g. 16g*3i*2 - 84gi3 What is the second derivative of -61u*4 + u - 15? -732u*2 Find the second derivative of 9710qv2 + 5qv - 217q + 2v2 - 1 wrt v. 19420q + 4 What is the third derivative of 2l3n*3 - 2l*3 - 35ln3 + 42ln2 wrt n? 12l*3 - 210l Find the third derivative of 836q5 - 177q*2 + 2. 50160q*2 What is the second derivative of -30l*4w*2 - 198l*2w*2 + 193lw2 + 2lw + 3l - w*2 wrt l? -360l*2w*2 - 396w*2 Differentiate -8j*2 + 3jq2 - 188q*2 wrt j. -16j + 3q2 What is the second derivative of -81j*3oq2 - j3o + joq*2s*2 - 19joqs2 + 2joqs + 9jqs*2 + jqs + qs*2 wrt q? -162j*3o + 2jos2 Find the second derivative of 3j*2r*2 - 6j*2r - 15jr*3 - 6r wrt r. 6j2 - 90jr What is the second derivative of 32i*5 - 3i*3 + 36i wrt i? 640i3 - 18i Find the first derivative of 3h2k*3 + 5137h*2k*2 + 948k*3 wrt h. 6hk3 + 10274hk2 What is the first derivative of -69l*2 - 17l - 2608 wrt l? -138l - 17 What is the third derivative of 103b*2n*3 + 17b*2n*2 - 2b*2n - 8b wrt n? 618b*2 What is the derivative of 13jpt + 36jp + 4jt + p wrt t? 13jp + 4j Find the second derivative of -b3h*2 + 32b*3h + 2b2h + 8bh*2 wrt h. -2b*3 + 16b Find the first derivative of 47d2 - d - 103. 94d - 1 What is the third derivative of 1579b2k*5 - 4b*2k*4 - 5b*2k*2 - 2b - 35k2 wrt k? 94740b*2k*2 - 96b*2k Find the second derivative of -2786k4 + 2125k wrt k. -33432k2 What is the derivative of -592g*2j + 8j - 46 wrt g? -1184gj Find the second derivative of 10dt2w - 2dtw2 - 6dw2 + 19t*2w*2 + 12t*2w - 5t2 wrt w. -4dt - 12d + 38t2 What is the third derivative of -97o*2r*6 - 468o*2r*2 + 2o*2r + r*6 wrt r? -11640o*2r*3 + 120r*3 Find the second derivative of -2k*3y2 + k3 + 179k2y*2 - 290y wrt y. -4k3 + 358k*2 What is the second derivative of 8b*4 - 7b*3 - 5b + 15 wrt b? 96b2 - 42b Find the second derivative of 42ms*3 - ms + 6m + s3 + 6 wrt s. 252ms + 6s Differentiate 1198s2 + 409 with respect to s. 2396s What is the second derivative of -5cp*5 - 20cp4 - 22c - 8p2 + 8p wrt p? -100cp*3 - 240cp2 - 16 What is the third derivative of -1393x*4 + 4x*2 - 118? -33432x What is the second derivative of n*4 + 250n*3s - 3ns + 3n - 2s wrt n? 12n2 + 1500ns Differentiate 54bdm*2s + bd - 15bm2 + bms + 2dm2s + 2m2s with respect to d. 54bm*2s + b + 2m2s Find the second derivative of 14f2j2 + f2jl - 18f2l - 10fj2 + j2l + 2j - 3l wrt j. 28f*2 - 20f + 2l What is the third derivative of -444l*4 + 2l*3 + 4l*2 - 84l wrt l? -10656l + 12 What is the second derivative of 858p*2 + 478p? 1716 Find the second derivative of 48a5 - 3a*2b2 - a2 + 3a - 92b*2 wrt a. 960a*3 - 6b*2 - 2 What is the second derivative of -34n4 - n2 - 20n + 9 wrt n? -408n*2 - 2 Find the third derivative of 19a6 - a5 + 8a4 + a2 + 320 wrt a. 2280a*3 - 60a*2 + 192a Find the third derivative of -1422k5 - 2k*3 + 3k*2 - 5k - 14 wrt k. -85320k2 - 12 What is the third derivative of dj5 - d - j6 + 30j4 + 1023j*2 wrt j? 60dj2 - 120j*3 + 720j What is the derivative of -38h2 - h - 106 wrt h? -76h - 1 What is the third derivative of 6jv*2x*3 + jv*2x*2 - 5jvx*3 + 12jvx*2 - 5v*2x*3 - 4v*2 - vx*2 wrt x? 36jv2 - 30jv - 30v*2 Find the second derivative of -165l*2 - 541l - 1. -330 What is the second derivative of 47fu*3 - 5fu + 17f - 3u4 - u wrt u? 282fu - 36u*2 Differentiate 178c*3u + 706c3 + 2cu3 wrt u. 178c*3 + 6cu2 Find the second derivative of -3ry3z + ry2z + ry2 - 2ryz + 2ry - 5y3 + 21yz wrt y. -18ryz + 2rz + 2r - 30y Find the second derivative of 11324b2m - 5bm + 10b + 9 wrt b. 22648m What is the third derivative of -2q3r*3y*2 - 6q*3y*2 - 3q*2ry - qr*3 + 5r*3 + 16y*2 wrt q? -12r*3y*2 - 36y*2 Find the second derivative of -27y*2z*2 + 1393y*2z - 3yz*3 wrt z. -54y*2 - 18yz What is the second derivative of 217aw2 - aw + 3w - 2 wrt w? 434a What is the derivative of 2c2o*2 + 5c*2o - 6c + 38o*2 - 2 wrt c? 4co2 + 10co - 6 What is the third derivative of 4434x*4 + 6673x*2 wrt x? 106416x Find the first derivative of -648f + 2079. -648 What is the first derivative of 2873d*4 + 8016? 11492d*3 What is the second derivative of -16iq2 - 160i + 2q3 - 2q wrt q? -32i + 12q Differentiate -r*3t + 2153r3 + 475rt2 + 2r with respect to t. -r*3 + 950rt Find the first derivative of -3n*4 + 2n*3 - 491n - 706. -12n3 + 6n*2 - 491 What is the second derivative of 1925k*2 - 771k? 3850 What is the third derivative of -4cj*3x*4 - 4cj3x*2 - 1788cj2x*3 - 44c - 8x2 - x wrt x? -96cj3x - 10728cj*2 Find the third derivative of 14i*6 + 7i*4 - 175i*2. 1680i*3 + 168i Differentiate 38l - 169 wrt l. 38 Differentiate -g4 - 67g*3 - 22g*2 - 21449 with respect to g. -4g*3 - 201g*2 - 44g Find the third derivative of -852l3 - 305l*2. -5112 What is the third derivative of -1275a*6 - 2a4 - a3 + 2038a2? -153000a*3 - 48a - 6 What is the second derivative of -3b2s*2 + 4b*2t*3u + 14b2t*2u - 2bst3 - s2t*3 - 87s*2t*2u + t*2u wrt b? -6s2 + 8t*3u + 28t2u Find the third derivative of -1028n3s*2 + 961n*2s*2 + 2s*2 wrt n. -6168s*2 What is the derivative of 6086kr - 5r + 200 wrt k? 6086r What is the second derivative of -246u*5 + 640u wrt u? -4920u3 Find the third derivative of 72g*4h + 2g4 + 2g*3h - 10g3 + 115g*2h + 5h wrt g. 1728gh + 48g + 12h - 60 Find the first derivative of -21f*3g - 2f3 + g + 23 wrt f. -63f*2g - 6f2 What is the first derivative of apy2 - apy + 16ay2 - 121py - y2 wrt a? py*2 - py + 16y2 What is the derivative of 1121d*2 + 1009? 2242d Find the third derivative of -13y4 + 5y3 - y2 - 356y wrt y. -312y + 30 Differentiate 229z3 - 200 wrt z. 687z*2 Find the first derivative of -2n*4s + 16n2s + 3s - 1 wrt n. -8n*3s + 32ns What is the third derivative of 2su*5 + 195su4 + 3su2 - 87s wrt u? 120su*2 + 4680su Differentiate -5p*2u - 37p2 - 765pu3 + 2p + 12 with respect to u. -5p2 - 2295pu2 Find the first derivative of -5p*2r + 19pr*3 + 5pr - p - r3 + 1591 wrt p. -10pr + 19r*3 + 5r - 1 What is the first derivative of 43g4m*2 - 377m*2 wrt g? 172	{ "pile_set_name": "DM Mathematics" }
o + 3o) to the form wo*3 + xo*2 + po*4 + h + ao and give p. 36 Rearrange (u - u - u)(-3979 - 161u + 3979) to the form q + su + iu*2 and give i. 161 Rearrange -81 + 2k3 - k2 - k4 - k3 + 83 to the form yk + pk*3 + sk*4 + a + rk*2 and give a. 2 Rearrange (-109 + 16j + 109)(0 - 3 + 5 + 6 - 1 - 2 + (-4 + 4 + 1)(-1 + 4 - 2)) to the form d + bj and give b. 96 Rearrange 54s*2 - 113s*2 - s + 3s*4 + 58s2 + s3 + 1 to ws + is*4 + ps*2 + ls*3 + d and give d. 1 Express -86 + 86 - 9x as rx + f and give r. -9 Rearrange (s + 2s - s)(-28 + 40 + 55 + (-4 - 2 + 4)(7 - 3 - 2)) to the form bs + c and give b. 126 Express -j2 + 5j4 + j3 - 6j4 + 2j*4 + 2 as cj*2 + tj*3 + sj + o + uj4 and give u. 1 Rearrange g3 + 13g*2 - 2g - 2 + 8g2 - 5g*2 - g to the form wg + u + ig2 + zg*3 and give i. 16 Express -8t*4 + 7t*4 - 136t + 135t - 11 + 2t*3 as ut*2 + st*3 + dt + z + it4 and give i. -1 Express -11q*2 + 12q + 2q3 - 12q in the form fq3 + dq*2 + j + iq and give f. 2 Rearrange -37y2 + y2 + 19y*2 - 33y*2 to q + uy*2 + by and give u. -50 Express l3 - l2 + l3 - l2 + 0l2 + 7 as vl + sl3 + y + tl*2 and give s. 2 Rearrange 5m3 - 4 + m3 + 0m3 + 2 to w + jm*3 + im*2 + rm and give j. 6 Express 146h - 6h*2 - 146h + 6 - 6 + h*2 + (2 - 2 + h)(2h + h - 2h) in the form oh2 + x + ch and give o. -4 Express k3 + k3 - k*2 + 0k*3 + 10k*2 in the form qk*2 + ck*3 + h + bk and give c. 2 Rearrange -8k + 11k + 7k + 29k to ok + r and give o. 39 Rearrange 3l - 46 - 4l - l + 1 to il + k and give k. -45 Rearrange (0 - 7 + 3)(3 - 3 - n) to the form k + gn and give g. 4 Rearrange 4s - 2s - s + (-1 + 3 - 3)(s + s - 4s) + 4s - 2s + 3s to fs + x and give f. 8 Express 2o + 2o + o + 26o as wo + r and give w. 31 Rearrange 3k3 - 5k3 + k3 + 2k - 2k*2 - 3k*3 to ik + jk3 + wk*2 + q and give i. 2 Express -13o*2 + 6o*2 - 13o*2 as i + ho*2 + mo and give h. -20 Express (2t + 4 + 1 - 7)(0t + 151 - 2t - 158) in the form xt2 + zt + n and give n. 14 Express -23r2 + 3r + r*3 + 44r*2 - 21r*2 - 2 in the form c + ar + hr3 + dr*2 and give c. -2 Rearrange (5 + 0 + 6)(2c2 + 3c*2 - 2c*2) + (-10c - c*2 + 10c)(-4 + 1 + 1) to rc + l + nc2 and give n. 35 Rearrange 5t*3 - 8t*3 - 2t*4 + 5t*3 - 2t*2 to k + mt*3 + gt*2 + at*4 + xt and give a. -2 Rearrange 990r2 - 496r*2 - 493r*2 - 86r to the form fr2 + kr + h and give h. 0 Rearrange -16k3 + 38k*3 - 24k*3 + 3k*2 - 4k*4 to a + xk + bk2 + uk*3 + yk*4 and give u. -2 Rearrange 46x*3 + 4x*2 - 5x*2 + 5x*2 - 2 - 2x*2 - 2x*4 to t + ux*4 + qx*3 + rx*2 + wx and give t. -2 Rearrange (0q + 0q + 2q)(3q - 2q + 2q) - 3q*2 - 1 + 1 to jq + mq2 + c and give m. 3 Rearrange (3r*2 - 6r*2 + 0r*2)(0r + r - 3r)(5 - 9 - 8) to mr*2 + x + lr + kr3 and give k. -72 Express -117 + 117 + 52v in the form jv + p and give j. 52 Rearrange d - 10d + 0d + 2 to p + ud and give u. -9 Express 26t + 22t + t in the form st + z and give z. 0 Express (-1 + 5 - 5)(-2r - 4r + 0r)(0r2 - 4r*3 + 0r*2) in the form q + ur*4 + wr*2 + hr + ar3 and give u. -24 Rearrange (3i*2 + 2i*2 - 3i*2)(-5i - 3i + 4 + 7i) to hi + qi3 + li*2 + a and give a. 0 Rearrange -1 + 1 + 6h + (-1 + 3 - 5)(-2 + 2h + 2) - 4h + 3 + 2 - 3 to yh + m and give y. -4 Rearrange (3t - 2t*2 - 3t)(-4t - 3t + 4t) + (-t + 0 + 3 - 8)(-t2 + 0t*2 + 3t*2) to the form q + jt*2 + wt*3 + gt and give j. -10 Rearrange (5 + 2 - 2)(-o - o + 3o) - o - 5o + 4o - 4o + 4o + 2o - 3o + 4o + 0o + (2o - o + 0o)(2 + 0 + 0) to the form co + q and give c. 8 Rearrange 17 - 4o + o + 2o - 86o3 + 85o*3 to go*3 + yo + n + xo2 and give g. -1 Rearrange -2l*2 + 0 + 0 + (6l - 2l - 2l)(l - 2l + 0l) + 0l*2 - 3l*2 + 5l*2 + 3l*2 - 114l + 248l - 121l to r + al + ul*2 and give a. 13 Express -7t*3 + 15t - 29t + 12t as ft2 + pt + rt3 + j and give r. -7 Express 13h*3 - 1 - 11h*2 + 9h*2 - 2h*4 + 3 - 6h*3 as wh*4 + s + fh + qh2 + zh*3 and give w. -2 Rearrange 1 + 8f - 15f + 0 + (-f + 3 - 3)(-3 - 2 + 6) - 2f + 0f + 0f + 2f + 0f + 0f - 4f + 3f + 3f to bf + r and give b. -6 Rearrange -1 - 5 - 3v + 1 + 4 to the form h + lv and give l. -3 Express (35q - 20q + 24q)(-2q3 + 4q*2 - 4q*2) as lq*3 + nq + gq2 + c + uq4 and give u. -78 Rearrange -116 - l3 + 118 - 6l3 - 3l*3 to fl*3 + sl*2 + z + yl and give f. -10 Express 0j - 4j - 2j in the form sj + t and give s. -6 Express (2y - 10y*2 - y + 13y*2)(0y - 3y + 0y) as qy*2 + my*3 + ay + n and give q. -3 Rearrange (2u2 - u2 + 3u*2)(u2 - u2 + 14u2 + (4 - 4 - u)(-9 - 3u + 8u + 8)) to the form du4 + ru*3 + ou*2 + s + fu and give d. 36 Rearrange 3 + 33a - 5 + 2 to the form z + ca and give c. 33 Express -2 + 2 - 19c in the form x + ac and give x. 0 Express 5 - 5 + 2x + 3x - 3x - 2x + (4x - 3x + 0x)(2 - 3 - 1) + (-1 - 1 + 1)(-5 + 5 + x) + 1 - 2x - 1 in the form dx + s and give d. -5 Express (-2 + 2 - 2q*3)(63q - 21q - 119q) in the form dq*4 + uq*3 + nq*2 + m + vq and give d. 154 Express -95v2 + 3 - 2v*3 - 5v*4 - v + 95v*2 in the form uv + pv3 + xv*4 + b + mv*2 and give u. -1 Express -3o + 296o2 + 0o + 4o - 300o*2 in the form ko + co2 + a and give c. -4 Express 5v*2 + 8v*3 - 6v*3 + 5v*2 - 42v*2 + v in the form wv*2 + iv + cv3 + d and give d. 0 Express (0 - 4 + 2)(-2d + d + 3d) + 8d - 25d - 10d + 1 + 2d - 1 as s + fd and give f. -29 Express -2 + 3 - 9y + 3y in the form f + cy and give f. 1 Rearrange -587 - 51y + 15y + 587 to uy + j and give u. -36 Rearrange (0h + h - 3h)(10 + 16 + 1 - 64) to uh + b and give u. 74 Rearrange (-x - x - x)(0 - 1 - 1)(3x*2 + 4x2 - x2) to the form ux2 + v + tx*3 + qx and give t. 36 Express 29t + 18t - 18t in the form vt + i and give v. 29 Express -19u - u2 + 1 + 17u - 41u2 in the form ru + w + lu2 and give r. -2 Rearrange (4 - 2h - 4)(h + h - 4h + (7 - 1 - 2)(-h + 0h + 3h)) + 2h + 2h2 - 2h to the form j + ah2 + mh and give a. -10 Rearrange (-2 + l + 2)(-2l*3 + 4l*3 - 3l*3)(1 + 2 - 13) to jl3 + i + ol*4 + bl + nl2 and give o. 10 Express (-h4 + 0h*4 - 2h*4)(-6 + 3 + 1)((2 + 0 - 4)(-5 + 5 - 2) + 28 + 48 - 11) as ch2 + oh*3 + ih*4 + s + bh and give i. 414 Express 61a + 65a - 141a as o + wa and give w. -15 Rearrange 9r - r + 6r*2 - r - 5r to the form sr2 + tr + k and give t. 2 Express (2h - 7h + 4h)(16 + 7 + 1) as o + wh and give w. -24 Express 3 - 2g + 2g2 - 3g - g3 - 4 - g2 as xg + rg*3 + dg*2 + p and give x. -5 Express 3k*2 - 2k + 0k3 + 2k - 5k3 - 2k*4 in the form ck*3 + jk + n + gk4 + mk*2 and give g. -2 Rearrange -6l*3 + 4l3 + l2 - 17l - l2 to the form rl + kl2 + o + jl*3 and give r. -17 Rearrange 5 + 6 - 2s3 + s2 + 4s - 11 to the form cs*3 + js + r + fs2 and give c. -2 Rearrange (5t + 3t - 40t)(-2t*2 + 1 - 1)(-3 + 1 + 4) to the form dt3 + j + ot*2 + at and give d. 128 Rearrange ((5i - i - 2i)(-1 + 3 - 6) + 2i + 0i - 3i)((4 - 6 + 3)(0 + 0 + 1) + 2 + 2 - 2) to ni + g and give n. -27 Express 0s*2 - 7s*3 + 12s*3 + 0s2 - 1 - s2 as ws3 + ms*2 + js + y and give m. -1 Express -1 + 5 - 6f - 2 + 2f*2 as vf*2 + lf + o and give v. 2 Rearrange 56 - 2k2 - 30 - 28 - k4 to hk*3 + wk*4 + o + tk + ck2 and give w. -1 Express (17z - 12z + 24z)(-2z*2 + 2z - 2z) as h + bz + mz2 + dz*3 and give d. -58 Rearrange (-3 + 3 + 2)(-7x3 + 10x*3 + 19x3) + (x2 + 2x2 + x2)(-x - x + 3x) to g + fx*3 + lx + yx2 and give l. 0 Express (3b + 7b - 15b*2 + 11b*2)(3b2 - 4b2 - b2) as cb2 + jb + db4 + l + qb*3 and give d. 8 Rearrange 4 + x - 8x - 3 + (3 - 2 + 0)(0x - 4x + 2x) to the form c + nx and give n. -9 Rearrange 0n*2 + 5 + 13n	{ "pile_set_name": "DM Mathematics" }
en four letters picked without replacement from khukqttqbtk? 3/55 What is prob of picking 2 y and 1 o when three letters picked without replacement from {y: 5, o: 2}? 4/7 Four letters picked without replacement from {i: 4, o: 3}. What is prob of picking 4 i? 1/35 Two letters picked without replacement from {k: 2, b: 4, u: 4, s: 1, a: 1, n: 3}. What is prob of picking 1 n and 1 u? 4/35 Three letters picked without replacement from {a: 4, h: 4, v: 1, b: 8, x: 2}. Give prob of picking 1 b, 1 h, and 1 x. 64/969 Calculate prob of picking 4 m when four letters picked without replacement from {m: 9, u: 2}. 21/55 Three letters picked without replacement from mmmemmemmem. Give prob of picking 3 m. 56/165 Calculate prob of picking 2 f when two letters picked without replacement from {f: 2, l: 2}. 1/6 What is prob of picking 1 n and 1 m when two letters picked without replacement from {a: 8, n: 4, m: 2}? 8/91 Calculate prob of picking 1 l and 1 s when two letters picked without replacement from yyllvlsslv. 8/45 Two letters picked without replacement from eeeeeeeuuu. What is prob of picking 2 u? 1/15 What is prob of picking 1 d, 1 g, and 1 z when three letters picked without replacement from gzdjdjqs? 1/28 Calculate prob of picking 1 s, 1 j, and 1 e when three letters picked without replacement from {j: 1, e: 3, s: 3, y: 2, o: 1, m: 2}. 9/220 Two letters picked without replacement from {y: 4, h: 2}. What is prob of picking 2 y? 2/5 Calculate prob of picking 2 v when two letters picked without replacement from {n: 1, b: 2, v: 2, e: 1}. 1/15 Two letters picked without replacement from {n: 5, h: 2, e: 3, f: 2}. Give prob of picking 1 f and 1 h. 2/33 Three letters picked without replacement from fogjjjs. Give prob of picking 1 j, 1 s, and 1 g. 3/35 Three letters picked without replacement from {y: 5, d: 2, p: 3}. Give prob of picking 1 d and 2 p. 1/20 What is prob of picking 1 s and 2 w when three letters picked without replacement from {s: 4, w: 8, e: 8}? 28/285 Four letters picked without replacement from {a: 7, x: 1, i: 3, q: 1}. What is prob of picking 3 a and 1 x? 7/99 Three letters picked without replacement from {b: 4, g: 3, q: 2, p: 2, t: 1}. Give prob of picking 1 q, 1 b, and 1 t. 2/55 What is prob of picking 1 w and 2 o when three letters picked without replacement from {b: 3, o: 2, j: 1, w: 1}? 1/35 Two letters picked without replacement from ukvkkkvvvvkkvkvkkk. Give prob of picking 2 k. 5/17 Calculate prob of picking 1 v and 2 y when three letters picked without replacement from vyyyv. 3/5 Four letters picked without replacement from rkssswrrszs. Give prob of picking 1 z, 1 k, and 2 s. 1/33 What is prob of picking 1 p and 3 v when four letters picked without replacement from {v: 12, p: 3}? 44/91 What is prob of picking 1 d and 1 l when two letters picked without replacement from ilbdr? 1/10 Calculate prob of picking 1 s, 1 w, and 1 y when three letters picked without replacement from wysjayb. 2/35 What is prob of picking 3 p when three letters picked without replacement from upuppp? 1/5 Three letters picked without replacement from mdddmd. What is prob of picking 1 m and 2 d? 3/5 Calculate prob of picking 1 p and 1 t when two letters picked without replacement from txtxpxtxp. 1/6 What is prob of picking 1 k, 1 t, and 1 j when three letters picked without replacement from {t: 5, j: 1, k: 7}? 35/286 What is prob of picking 1 r, 1 l, and 1 y when three letters picked without replacement from {y: 3, l: 1, j: 3, i: 2, a: 2, r: 1}? 3/220 Calculate prob of picking 1 i and 2 v when three letters picked without replacement from gigivgviiig. 1/33 What is prob of picking 1 m and 1 t when two letters picked without replacement from {t: 2, h: 7, s: 2, x: 1, m: 2, g: 1}? 4/105 Four letters picked without replacement from zczzzzczccccc. Give prob of picking 2 z and 2 c. 63/143 Two letters picked without replacement from {j: 1, y: 1, v: 1}. What is prob of picking 1 j and 1 v? 1/3 What is prob of picking 1 g and 1 r when two letters picked without replacement from wbubuupubbgru? 1/78 Calculate prob of picking 2 i and 1 y when three letters picked without replacement from {b: 4, i: 3, y: 6, g: 1}. 9/182 Two letters picked without replacement from {g: 2, k: 6, t: 3, m: 2, x: 3}. Give prob of picking 2 k. 1/8 Four letters picked without replacement from {f: 2, n: 7, l: 6}. Give prob of picking 2 l and 2 f. 1/91 What is prob of picking 1 s and 2 p when three letters picked without replacement from ppsps? 3/5 What is prob of picking 1 x, 1 t, and 2 o when four letters picked without replacement from bztuzbououxuu? 1/715 Four letters picked without replacement from {u: 4, x: 1, d: 2, f: 3, g: 2}. Give prob of picking 1 f, 2 u, and 1 g. 4/55 Four letters picked without replacement from {w: 12, z: 7}. What is prob of picking 1 w and 3 z? 35/323 Two letters picked without replacement from hhhhhhhhmhhhhhh. Give prob of picking 1 m and 1 h. 2/15 Two letters picked without replacement from {y: 2, i: 1, x: 1, j: 1}. Give prob of picking 1 x and 1 i. 1/10 Four letters picked without replacement from {v: 2, p: 7}. Give prob of picking 4 p. 5/18 Calculate prob of picking 1 x, 1 p, and 1 c when three letters picked without replacement from cstctpsx. 1/28 What is prob of picking 1 n and 1 i when two letters picked without replacement from {h: 2, m: 2, i: 2, n: 4}? 8/45 What is prob of picking 3 s when three letters picked without replacement from ssussuuuuuuuuuuuuuu? 4/969 Two letters picked without replacement from nwaavaddvede. What is prob of picking 2 v? 1/66 What is prob of picking 1 z and 1 h when two letters picked without replacement from ghmzmzzthm? 2/15 Four letters picked without replacement from heahhhiaehhahah. What is prob of picking 1 i, 1 a, and 2 h? 16/195 What is prob of picking 1 t, 1 f, and 2 z when four letters picked without replacement from affzztztttzzztfzft? 14/85 Two letters picked without replacement from nnnmnmnnnnm. Give prob of picking 1 m and 1 n. 24/55 Three letters picked without replacement from rhchr. Give prob of picking 1 c, 1 h, and 1 r. 2/5 Calculate prob of picking 2 t and 1 j when three letters picked without replacement from {j: 3, t: 2}. 3/10 Three letters picked without replacement from qqqqqqq. Give prob of picking 3 q. 1 Two letters picked without replacement from llkkllkukukkkkklkuky. Give prob of picking 1 u and 1 y. 3/190 What is prob of picking 4 t when four letters picked without replacement from ttttttt? 1 What is prob of picking 2 f and 1 b when three letters picked without replacement from {f: 6, c: 2, b: 4, p: 2, e: 1}? 12/91 Calculate prob of picking 1 f, 2 a, and 1 s when four letters picked without replacement from {a: 4, f: 2, s: 3, v: 6}. 12/455 What is prob of picking 1 j and 1 e when two letters picked without replacement from iittjeiieitti? 1/39 Three letters picked without replacement from {a: 11, w: 2, s: 2}. Give prob of picking 2 s and 1 w. 2/455 Calculate prob of picking 1 r and 1 h when two letters picked without replacement from {r: 1, d: 2, a: 1, h: 1}. 1/10 What is prob of picking 1 x and 2 f when three letters picked without replacement from fssfhshhxsiffhhs? 3/280 Calculate prob of picking 1 n and 1 w when two letters picked without replacement from {a: 4, n: 5, c: 2, w: 8}. 40/171 Three letters picked without replacement from {j: 3, f: 3, e: 2, u: 4, g: 2, y: 2}. What is prob of picking 1 g, 1 y, and 1 u? 1/35 What is prob of picking 2 l and 2 f when four letters picked without replacement from kkfpkkllkllwlkxfw? 1/238 What is prob of picking 2 t and 1 v when three letters picked without replacement from rvtjjitvjttrttjjrtt? 56/969 Calculate prob of picking 1 g, 1 i, and 1 h when three letters picked without replacement from ghcnnhgcrhrgihc. 12/455 Calculate prob of picking 3 w when three letters picked without replacement from zzzwzjwzw. 1/84 What is prob of picking 2 g when two letters picked without replacement from {g: 2, m: 1, f: 1, h: 1}? 1/10 Four letters picked without replacement from {a: 3, j: 2}. Give prob of picking 1 j and 3 a. 2/5 Two letters picked without replacement from {k: 1, i: 3, l: 5, b: 7}. Give prob of picking 2 l. 1/12 What is prob of picking 2 m, 1 z, and 1 f when four letters	{ "pile_set_name": "DM Mathematics" }
*2 + 20d - 10. Let z be i(10). Which is smaller: -6 or z? z Let k = -32023/14 + 2287. Which is smaller: -16 or k? -16 Let p = 258 + -262. Let m be p(-1)/(14/133). Are 186/5 and m unequal? True Let v be 56/(-14) - 58/(-8). Let q(g) = g + 1. Let w(y) = -3y - 10. Let a(b) = 4q(b) + w(b). Let j be a(9). Are j and v equal? False Let i(j) = j3 + 6j*2 - 3j - 14. Let s be i(-6). Suppose -sv + 15 = -r, -3v = -5v. Which is greater: r or -11? -11 Suppose -4t = z - 0 - 20, z = 3t + 27. Let r be ((-1)/(-145))/((-19)/(285/z)). Which is smaller: 1 or r? r Let m = 45 + -43. Suppose 2a + 2r = -ma + 4, -10 = -2a + r. Suppose 0 = 3h + 2d + 5, -6d = -ah - 3d. Which is smaller: h or 11? h Let k = -273.0194 + 0.0194. Let u = -276 - k. Is u > 24? False Let m be 9 - 110/20 - (-1)/(-2). Suppose mx + 323 + 61 = 0. Is -128 >= x? True Let d = 265/3 - 86. Let k = d + -115/57. Is -1 at least as big as k? False Let v(p) = -2p - 10. Let a = -18 + 35. Let g be v(a). Let s be 3/2 + 1g/8. Which is bigger: s or -1? -1 Let k = 0 - 2. Let g = -14/117995 + -519136/353985. Are k and g equal? False Let n be -2(2 - 29/14). Suppose j + 4i = -15, 29j - 3i - 7 = 34j. Which is bigger: j or n? j Let q(w) = -2w3 - 3w*2 + 4w + 10. Let u be q(-2). Let y be 0(1 + 2)/u. Do 2/449 and y have different values? True Suppose -2g = -3v + 1098, -v + 4299 = -5g + 1567. Let x = 431 + g. Which is smaller: -112 or x? x Let f = -13 + 28. Let u be (22 - 7800/351) + (-492)/(-27). Is f less than u? True Let b = 180.17 + -177.17. Is b greater than 2017? False Let c(a) = -153a + 1072. Let k be c(7). Is 5/12 less than k? True Let r(q) = 4q*2 + 151q + 4009. Let z be r(-48). Is z at least as big as 5978? False Suppose -6t + 0t = -1092. Suppose -8i - t = 178. Let k be i + ((-3)/1)/(1/(-1)). Is -43 < k? True Suppose 993 = 224p - 220p + s, 948 = 4p - 4s. Let b be 13/(-2 - (-39)/19). Which is greater: p or b? b Suppose 13p + 11p = 25p. Which is smaller: 7/368 or p? p Let k = 2025 + -2105. Which is smaller: -71 or k? k Let j = 301 + -302. Let i be (j + 21/(-9))(-33)/(-22). Which is bigger: i or -72/13? i Let p = -0.3599 + 0.3199. Is p less than or equal to -1/626? True Let j = 1.6388 - 1.68. Let k = -0.3122 - j. Let i = k + 0.071. Which is bigger: -2/75 or i? -2/75 Suppose 0 = 4o + y - 19, 3y = -3o + 8o - 28. Suppose 4h - 3h + 148 = -3z, z + 726 = -oh. Let n be h/(-4) - -62/(-48). Are n and 37 nonequal? True Let r be 24/(-16) + 6/4. Let t be (-38)/38 - (0 + r + -1). Which is smaller: 75 or t? t Let a be (611/(-130) - -1) + 1 + 0. Let u = 9/103 + 1088/515. Let f = a + u. Which is smaller: -0.1 or f? f Let u = 78219 + -4927927/63. Let y = -16/7 - u. Suppose 10i = 19 - 29. Is y equal to i? False Let o be ((-80973)/729)/((5 + -3)/12). Which is bigger: -666 or o? -666 Let c = 68.705 + 2.295. Are c and -2/3 equal? False Let y = -27.13 + 5.13. Let c = 0.1 + -5.1. Let n = 4 + c. Is y less than n? True Let a = 58.55 + -52.55. Which is smaller: 0.053 or a? 0.053 Let n = 219841 - 219840. Let b be 2 - ((-50)/(-6) + 0). Is n less than b? False Let v = 537 + -432. Let a = -278 + v. Is -171 greater than a? True Suppose 6n - 4x + 6 = 5n, -3n - 4x = 18. Let o = n - -18. Suppose ol - 144 = 18l. Which is smaller: l or -25? -25 Let a = -419/1644 + 2/411. Is a != 2/1329? True Suppose x - 53 = v, -2x = 8v - 3v + 237. Let a be (3 - (3 - 1))(-77)/v. Let b = 129/91 - a. Which is greater: b or 0? 0 Suppose -5g - 1 = 4. Let r be 62g/(-2) + -11 + 14. Suppose 5k - 2q = r, 2q + 1 = 3k - 17. Is k less than or equal to 22/3? False Let y be 1/(-1 + (-12)/(-14)). Let d(j) = -24j3 + 8j - 5j3 + 28j*3 - 6j*2 + 8. Let o be d(y). Is -22 >= o? False Let m = 1932 - 2262. Let s(k) = -3k*2 - 4k - 12. Let r be s(-11). Is r < m? True Let z be 1925/2 + -1 - 26/78. Let g = -958 + z. Which is bigger: 3 or g? g Let m be 2/4(-11 - -11). Let z = -76 - -88. Let h be 3(z/(-30) + 526/1290). Is m > h? False Let h be ((-208)/(-80) - (-4)/10)/1. Suppose -5x - 4j + 40 = 183, -9 = -hj. Suppose -5d + 0r = r + 164, -2r = 2d + 72. Which is bigger: d or x? x Let p = 435 - 240. Let c = p + -184. Suppose 18 = 2h + 3k, h + 2k = -h + 20. Which is smaller: h or c? c Let g = 1 + -2. Let h = 15425/3 + -5143. Is g at least h? True Let l be (2/12 - (-105)/(-270)) + 1581/432. Which is smaller: 3 or l? 3 Let h = -0.135 - -0.035. Let q(s) = 3s - 2s + 2s - 9 - 2s. Let u be q(9). Is h less than or equal to u? True Let v be 14 + 0 + (-2 - 1). Let m = 12 - v. Let j = 23/3 + -206/27. Which is smaller: m or j? j Let i be (-45)/(-25)(29 - 4). Suppose -g + 7700 = -2g. Let b be g/(-176) - (-6)/(-8). Is i equal to b? False Let a = 101 + -104. Let z be (a + 78)(-6)/105. Let x = -136/35 - z. Which is smaller: x or -0.47? -0.47 Let x be (-3 - (-16)/4)/(8/((-56)/(-7))). Which is smaller: x or 1/8291? 1/8291 Suppose -4n - 7 = -3w, -5w - 5n + 29 = -6. Suppose -12 = -4k + wk. Let t be ((-39)/12)/(3/k). Which is greater: t or 14? 14 Suppose -4411d = -4400d - 11. Let r be 160/(-15)13/46 + 3. Which is smaller: d or r? r Let l = 136.06 - -2.94. Let j = l - 142. Which is smaller: -1/11 or j? j Suppose f = -1 + 22. Suppose -40 = 2739j + 2737j - 5478j. Which is bigger: j or f? f Let s = -48 - -47. Let u be 48(-3 - (-101)/33). Let q = u + -789/275. Which is bigger: q or s? q Let w = -671 + 1123. Let g = -231 + w. Which is smaller: 441/2 or g? 441/2 Suppose z - 5z - 12 = 5v, -4v - 18 = -z. Suppose -2h = 4k + 30, -3k + zh = -2k. Is k at most -5? True Suppose -6t = -10t + 8. Let k be t/(-6) - 2/(-3). Let v = 3.521 - 0.721. Which is smaller: k or v? k Let i(o) = 2o2 - o. Let y be i(0). Suppose -2m + 168 = -ym. Let g = 590/7 - m. Which is smaller: g or 1.4? g Suppose -6b + 3b + 780 = 0. Let u = b - 141. Is u <= 117? False Let w be (-1)/(-5) - (5 - (-104)/(-5)). Suppose 15r + w = 11r. Let j be -1 + 1 + r - (-1178)/361. Which is bigger: -1 or j? j Let c be -1(-4)/123. Let o = 32 + -29. Suppose 0p + u = op - 10, 0 = -2p + 2u + 8. Which is smaller: p or c? c Let x be (3762/(-4))/(-3) - (-15 + 20). Let z = x - 308. Is 93 >= z? True Let h be (-7 - (-312)/36) + 2/(-3). Let c be ((-35)/(-28) - 1/4)/h. Which is bigger: c or 1/10? c Let n(q) = -q3 + 9q*2 - 20q + 65. Let p be n(6). Suppose p = 7k + 46. Which is smaller: 24/35 or k? 24/35 Let n(j) = -133j - 399. Let k be n(-3). Which is smaller: 59/51 or k? k Let v = -30 - -29. Let t(f) = -f*2 - 10f - 25. Let o be t(-6). Let m be 0 - ((-20)/22 - o). Which is smaller: v or m? v Let h(m) = 4m2 - 9m - 3. Let x be h(4). Let t(n) = -n*2 + 29n + 28. Let v be t(30). Is v less than x? True Let n be (1 - (-6)/(-8)) + 5310/360. Suppose -6w + nw = -9. Is w at most 23? True Let q(x) = -2x - 4. Let l be q(27). Let f = l - -26. Is -31 at least as big as f? True Let g(u) = -3225u - 9937. Let k be g(-3). Is -285 less than or equal to k? True Suppose -4f - 91 = -j, 5f - 3 - 12 = 0. Suppose -2v - 6 = 0, -a - 3v + j = -4v. Let i be 3 + (1 - 2) + (-176)/a. Which is bigger: 1 or i? 1 Let w(n) = -n2 + 27n - 181. Let i be w(15). Let q be (8/3)/((-2)/(-9)). Let z be (i/2 + 2)2/q. Which is smaller: z or -0.04? -0.04 Let x be (-10796)/(-26) + (-2427)/10517. Is 418 less than x? False Let x = 18420 + -18434. Which is bigger: 377 or x? 377 Let c be (2484/(-8) - 10)/(68/(-16) - -4). Which is bigger: 10263/8 or c? 10263/8 Let p = 36 - 186/5. Let r = -53.5021 + 51.5021. Which is greater: p or r? p Let t be 15945/((-150)/(-135))2/3. Does 4782 = t? True Let t be 6/(-39) - (185/65 + -3). Suppose 2d = 4d + 492. Let r be -3 + d/(-39) + -3. Are t and r nonequal? True Let v be (-4991)/(-10) - (0 - (-2)/(-5)). Is v less than 500? True Let a = 12019 - 12019. Are 19 and a unequal? True Let a = 5.129 - 5.229. Is 5/12 < a? False Let r = 3829 - 4081. Are -9 and r non-equal? True Let h(u) = 3u*2 - 19u + 8. Let x be h(6). Suppose 0 = xc - y + 3y - 6, -5y + 8 = 4c. Is 5 >= c? False Let q = -0.1 - -15.1. Let z = -13 + q. Let i(o) = o*3 - 17o*2 - 2o + 30. Let y be i(17). Which is bigger: z or y? z Suppose 96 = 4q - 0q. Let r be (-6)/2020/q. Let w = 1294 + -6498/5. Which is bigger: r or w? r Let t be 4440/2786/(-12) + 8. Which is	{ "pile_set_name": "DM Mathematics" }
3g2/2 + 807g/2 - 402. -3(g - 268)(g - 1)/2 Find f, given that -f*5 + 31f*4 - 298f*3 + 638f*2 + 2299f + 1331 = 0. -1, 11 Factor 10t2 + 24t + 8. 2(t + 2)(5t + 2) Factor 5k*2 + 175k + 620. 5(k + 4)(k + 31) Find h, given that 3h2 - 2109h - 6354 = 0. -3, 706 Find r, given that 2r4/3 + 340r*3/3 = 0. -170, 0 Factor 9k*4 + 105k*3 + 63k*2 - 33k. 3k(k + 1)(k + 11)(3k - 1) Factor -h2 - 96h - 2304. -(h + 48)*2 Suppose 4d*5 - 8d*4 - 132d*3 + 392d*2 + 128d - 384 = 0. What is d? -6, -1, 1, 4 Factor -5c4 - 15c*3 - 15c*2 - 5c. -5c(c + 1)*3 Factor 10j*3 - 404j*2 + 160j. 2j(j - 40)(5j - 2) Solve -2d3/3 + 80d*2/3 - 1024d/3 + 4096/3 = 0. 8, 16 Solve 4x4 - 100x*3 + 184x*2 = 0 for x. 0, 2, 23 Find k, given that -15k*4 - 669k*3 + 4110k*2 + 2964k - 1800 = 0. -50, -1, 2/5, 6 Let -u*3 - 7u*2 - 8u + 16 = 0. Calculate u. -4, 1 Factor -6f3/11 - 56f*2/11 - 18f/11. -2f(f + 9)(3f + 1)/11 Factor p*2 - 4p - 21. (p - 7)(p + 3) Factor -d2 + 40d - 384. -(d - 24)(d - 16) Let -2c*2/9 + 10c/9 + 588 = 0. What is c? -49, 54 Suppose -4r4 - 164r*3 - 1140r*2 - 2844r - 2376 = 0. What is r? -33, -3, -2 Suppose -o*4/3 + 5o*3/3 - 7o2/3 + o = 0. What is o? 0, 1, 3 Suppose q2/9 + 15q + 44 = 0. Calculate q. -132, -3 Let 2x*4/5 - 1038x*3/5 + 6174x*2/5 - 9234x/5 = 0. Calculate x. 0, 3, 513 Suppose 32d2/5 + 146d + 698/5 = 0. Calculate d. -349/16, -1 Determine f, given that 2f3/15 - 74f*2/15 + 28f/3 = 0. 0, 2, 35 Factor -7u3 - 877u*2 + 1528u + 508. -(u - 2)(u + 127)(7u + 2) Factor -y3 - 38y*2 - 37y. -y(y + 1)(y + 37) Determine l so that -2l2/7 + 10l/7 + 12/7 = 0. -1, 6 Solve -2c3 - 4c*2 = 0. -2, 0 Determine m so that 220m*5 + 700m*4 - 3345m*3 + 2230m*2 - 140m - 120 = 0. -6, -2/11, 1/2, 2 Factor 3a2/5 + 126a/5 - 81. 3(a - 3)(a + 45)/5 Suppose -2a2/13 - 380a/13 - 752/13 = 0. Calculate a. -188, -2 Factor -d4/4 + d3/2 + d*2/4 - d/2. -d(d - 2)(d - 1)(d + 1)/4 Solve -5b4 + 20b*3 + 355b*2 + 330b = 0 for b. -6, -1, 0, 11 Suppose -2w2/5 - 5048w/5 - 3185288/5 = 0. Calculate w. -1262 Suppose -t*3 - 62t*2/5 - 204t/5 - 72/5 = 0. Calculate t. -6, -2/5 Determine d so that 3d4/5 - 27d*3/5 - 348d*2/5 - 972d/5 - 816/5 = 0. -4, -2, 17 Solve 5l4 - 90l*3 - 545l*2 - 690l = 0 for l. -3, -2, 0, 23 Solve 3v2 - 1650v + 226875 = 0 for v. 275 Factor -h*2/7 + 47h/7 + 48/7. -(h - 48)(h + 1)/7 What is w in 45w*5 - 9415w*4 + 20675w*3 + 5275w*2 - 20720w + 4140 = 0? -1, 2/9, 1, 2, 207 What is a in -a*2/5 - 32a/5 + 68/5 = 0? -34, 2 What is p in -2p5/7 + 10p*4/7 + 10p*3/7 - 90p*2/7 + 72p/7 = 0? -3, 0, 1, 3, 4 Suppose 5l3 - 2635l*2 = 0. Calculate l. 0, 527 Factor 2m*2 + 4496m + 2526752. 2(m + 1124)2 Factor -2c*3 + 18c*2 - 40c + 24. -2(c - 6)(c - 2)(c - 1) Solve -7p*4 - 26p*3 - 20p*2 + 8p = 0 for p. -2, 0, 2/7 Factor -n4/3 - n3/3 + n*2 + 5n/3 + 2/3. -(n - 2)(n + 1)3/3 Factor 3v*2/8 + 27v/2 + 945/8. 3(v + 15)(v + 21)/8 Factor 2w3/3 - 8w*2 + 24w. 2w(w - 6)2/3 Factor -t5/2 - 29t4/2 - 52t*3 - 50t2. -t2(t + 2)2(t + 25)/2 Find h such that -2h5/3 - 26h*4/3 - 30h*3 - 22h*2/3 + 140h/3 = 0. -7, -5, -2, 0, 1 Solve -u*4/7 - 40u*3/7 - 468u*2/7 - 1296u/7 = 0. -18, -4, 0 What is g in -10g2/9 - 3298g/9 - 2632/9 = 0? -329, -4/5 Factor -10t2 + 155t + 80. -5(t - 16)(2t + 1) Factor -2q*2/5 + 74q/5 - 624/5. -2(q - 24)(q - 13)/5 Factor 4w3 - 3252w - 3248. 4(w - 29)(w + 1)(w + 28) Suppose -3i*2 + 5i/4 = 0. What is i? 0, 5/12 Determine i, given that 6i3/5 + 188i*2/5 + 58i/5 - 124/5 = 0. -31, -1, 2/3 What is d in 4d4 + 76d*3 + 292d*2 + 132d - 504 = 0? -14, -3, 1 Factor 2r2 - 1022r + 1020. 2(r - 510)(r - 1) Factor 4z2 - 1672z + 174724. 4(z - 209)2 Find f such that -4f*3 + 48f*2 - 140f = 0. 0, 5, 7 Factor 4j4 + 48j*3 + 108j*2 - 16j - 144. 4(j - 1)(j + 2)*2(j + 9) Factor -4a3 - 84a*2 - 156a - 76. -4(a + 1)2(a + 19) Determine g, given that -4g5 - 4g*4 + 24g*3 + 56g*2 + 44g + 12 = 0. -1, 3 Factor 4h2 - 168h + 164. 4(h - 41)(h - 1) Factor g*3 - 3g*2 - 16g - 12. (g - 6)(g + 1)(g + 2) Factor -4r2/7 + 42136r/7 - 110965156/7. -4(r - 5267)2/7 Factor -4u*4 + 12u*3 + 372u*2 + 692u + 336. -4(u - 12)(u + 1)*2(u + 7) Suppose -f*5/4 - 2f*4 - 7f3/4 = 0. Calculate f. -7, -1, 0 Let -l2/8 - 261l/4 - 521/8 = 0. Calculate l. -521, -1 Solve 5q*5 - 50q*4 + 160q*3 - 160q*2 = 0 for q. 0, 2, 4 Determine f, given that -2f*2/3 + 32f/3 = 0. 0, 16 Factor -3h2/4 + 21h - 147. -3(h - 14)2/4 Factor 2v*3 + 1718v*2 - 1720v. 2v(v - 1)(v + 860) Factor 4j*5 - 12j*4 + 12j*3 - 4j*2. 4j*2(j - 1)3 Solve -l3/2 + 33l2/2 - 90l - 250 = 0 for l. -2, 10, 25 Suppose 2p4/13 - 24p*3/13 + 8p*2 - 192p/13 + 128/13 = 0. Calculate p. 2, 4 Solve 4k2 - 4 = 0 for k. -1, 1 Factor -4q*2 - 9200q - 5290000. -4(q + 1150)2 Factor -2j*2 - 4j. -2j(j + 2) Solve s*3/4 - 29s*2/2 - 181s/4 - 61/2 = 0 for s. -2, -1, 61 Factor 5p4 + 50p*3 - 255p*2 + 340p - 140. 5(p - 2)(p - 1)*2(p + 14) Let w*4 + 2w*3 - 24w*2 - 50w - 25 = 0. What is w? -5, -1, 5 Suppose -3g5 - 27g*4 + 12g*3 + 108g*2 = 0. What is g? -9, -2, 0, 2 Factor 5r*3/2 + 3r*2/2 - 77r/2 + 69/2. (r - 3)(r - 1)(5r + 23)/2 Factor -28o*3 - 2080o*2 - 15376o - 4224. -4(o + 8)(o + 66)(7o + 2) Solve -3p3 - 57p*2 - 204p + 660 = 0 for p. -11, -10, 2 What is x in -14x5/9 - 20x*4/3 - 58x*3/9 - 4x*2/3 = 0? -3, -1, -2/7, 0 Determine p so that -3p*4/7 + 9p*2/7 + 6p/7 = 0. -1, 0, 2 Determine l so that 566l4/13 - 1128l*3/13 - 8l*2/13 = 0. -2/283, 0, 2 Solve 4r*5 - 39r*4 - 105r*3 - 41r*2 + 57r + 36 = 0 for r. -1, 3/4, 12 Find z such that -20z4/7 + 404z*3/7 + 1392z*2/7 + 80z/7 - 1856/7 = 0. -2, 1, 116/5 Factor -w*5 + 81w*4 - 79w*3 - 81w*2 + 80w. -w(w - 80)(w - 1)*2(w + 1) Find g such that 2g5/11 - 6g*4/11 - 30g*3/11 - 34g*2/11 - 12g/11 = 0. -1, 0, 6 Factor 14i5/9 - 68i*4/9 + 8i*3 + 80i*2/9 - 128i/9. 2i(i - 2)*3(7i + 8)/9 Suppose 5p*2 + 420p + 8820 = 0. What is p? -42 Factor -2939h3/5 + 2941h*2/5 - 2h/5. -h(h - 1)(2939h - 2)/5 Factor -3p*3 + 921p*2 + 3p - 921. -3(p - 307)(p - 1)(p + 1) Find f, given that -3f*5/4 - 21f*4/2 - 39f*3/4 + 189f*2 - 243f = 0. -9, 0, 2 Solve -2b2 - 128b + 130 = 0. -65, 1 Suppose -j*4/5 - 14j*3/5 - 13j*2/5 = 0. Calculate j. -13, -1, 0 Factor -4c*2 + 448c - 880. -4(c - 110)(c - 2) Factor -v*2/9 - 940v/9 + 943/3. -(v - 3)(v + 943)/9 Solve 3j*4/2 - 81j*3/2 + 45j*2 + 2688j + 7056 = 0 for j. -4, 14, 21 Factor -5k4 + 95k*3 + 435k*2 + 565k + 230. -5(k - 23)(k + 1)*2(k + 2) Factor -q*2/9 - 104q/9 - 2704/9. -(q + 52)*2/9 Let -3j*5/4 - 18j*4 - 177j*3/2 + 234j*2 - 507j/4 = 0. What is j? -13, 0, 1 Factor -5s4 + 95s*3 + 315s*2 + 325s + 110. -5(s - 22)(s + 1)*3 Factor 3h*4/7 - 15h*3/7 + 3h*2 - 9h/7. 3h(h - 3)(h - 1)2/7 Factor 20y*3 + 12y*2 - 36y - 28. 4(y + 1)2(5y - 7) Factor t2/6 + 17t/6 + 8/3. (t + 1)(t + 16)/6 Determine u, given that u3 - 159u*2 - 1674u - 2704 = 0. -8, -2, 169 What is y in -6y2 + 255y/4 + 99/4 = 0? -3/8, 11 Factor 3j3/4 + 69j*2 - 3j - 276. 3(j - 2)(j + 2)(j + 92)/4 Let -19h*4/5 - 39h*3/5 - 21h*2/5 - h/5 = 0. What is h? -1, -1/19, 0 Find c, given that -4c*2/3 + 92c + 568/3 = 0. -2, 71 Factor 3x3/4 + 18x*2 - 81x + 84. 3(x - 2)2(x + 28)/4 Factor -r*3/3 + 14r*2/3 - 11r/3 - 26/3. -(r - 13)(r - 2)(r + 1)/3 What is p in -3p4/5 + 9138p*3/5 - 1856232p*2 + 629261430p - 627407025 = 0? 1, 1015 Solve -g*5/9 - 10g*4/9 + 7g*3/3 + 214g*2/9 - 608g/9 + 128/3 = 0. -8, 1, 2, 3 Find i, given that 2i4 + 180i*3 + 1808i*2 + 5580i + 3950 = 0. -79, -5, -1 Factor 5v3 - 15v + 10. 5(v - 1)2(v + 2) Factor -21u2 - 69u - 18. -3(u + 3)(7u + 2) Suppose 2j*4/3 - 40j*3/3 + 298j*2/3 - 980j/3 + 400 = 0. Calculate j. 4, 5, 6 Factor -3m*4 -	{ "pile_set_name": "DM Mathematics" }
2, 4, 96? 2o3 - 13o*2 + 7o - 2 What is the c'th term of -1320, -2637, -3954, -5271, -6588? -1317c - 3 What is the v'th term of -1236, -1213, -1200, -1203, -1228? -v3 + v2 + 27v - 1263 What is the k'th term of 347, 347, 355, 377, 419? k*3 - 2k*2 - k + 349 What is the c'th term of 11, 17, 23, 29, 35, 41? 6c + 5 What is the x'th term of -52, -104, -144, -166, -164, -132, -64, 46? x*3 - 59x + 6 What is the v'th term of 479, 481, 485, 491, 499, 509, 521? v2 - v + 479 What is the h'th term of -32, -34, -30, -14, 20, 78, 166? h3 - 3h2 - 30 What is the t'th term of -14610, -14612, -14614, -14616? -2t - 14608 What is the q'th term of 726, 1444, 2164, 2886, 3610, 4336? q*2 + 715q + 10 What is the i'th term of 30, 64, 90, 102, 94, 60? -i*3 + 2i*2 + 35i - 6 What is the k'th term of 13, 37, 67, 97, 121, 133, 127? -k*3 + 9k*2 + 4k + 1 What is the a'th term of -6, -21, -46, -81, -126, -181? -5a2 - 1 What is the g'th term of -992, -993, -994? -g - 991 What is the v'th term of 91, 86, 79, 70, 59? -v2 - 2v + 94 What is the d'th term of 715, 2822, 6325, 11218, 17495, 25150, 34177, 44570? -d*3 + 704d*2 + 2d + 10 What is the c'th term of -38, -49, -54, -47, -22, 27, 106? c*3 - 3c*2 - 9c - 27 What is the n'th term of -5, -17, -29, -41, -53? -12n + 7 What is the v'th term of -787, -789, -791, -793? -2v - 785 What is the p'th term of -55, -123, -199, -289, -399, -535, -703, -909? -p*3 + 2p*2 - 67p + 11 What is the m'th term of 1801, 1804, 1807? 3m + 1798 What is the i'th term of 213, 412, 605, 798, 997, 1208? i3 - 9i*2 + 219i + 2 What is the g'th term of 8236, 8238, 8240, 8242, 8244? 2g + 8234 What is the w'th term of 9, 1, -5, -3, 13, 49? w3 - 5w*2 + 13 What is the z'th term of -106, -213, -320, -427, -534? -107z + 1 What is the o'th term of 5649, 5654, 5659, 5664, 5669, 5674? 5o + 5644 What is the k'th term of -185, -182, -179, -176? 3k - 188 What is the q'th term of -620, -609, -594, -575, -552, -525, -494? 2q2 + 5q - 627 What is the z'th term of -24, -95, -214, -387, -620, -919? -z*3 - 18z*2 - 10z + 5 What is the o'th term of -94, -104, -120, -142, -170, -204, -244? -3o2 - o - 90 What is the t'th term of -440, -441, -442? -t - 439 What is the p'th term of -1, 20, 43, 68? p2 + 18p - 20 What is the h'th term of -68, -52, -28, 4? 4h2 + 4h - 76 What is the i'th term of 7, 0, -17, -50, -105, -188? -i3 + i2 - 3i + 10 What is the z'th term of -6, -10, -24, -54, -106, -186, -300, -454? -z3 + z2 - 6 What is the l'th term of -324, -327, -330, -333, -336? -3l - 321 What is the m'th term of -1104, -1093, -1078, -1059, -1036, -1009, -978? 2m2 + 5m - 1111 What is the u'th term of -180, -360, -540? -180u What is the i'th term of 62, 550, 1868, 4430, 8650, 14942, 23720, 35398? 69i3 + i2 + 2i - 10 What is the i'th term of 307, 305, 299, 289, 275, 257, 235? -2i*2 + 4i + 305 What is the s'th term of -8, -24, -52, -92, -144, -208? -6s2 + 2s - 4 What is the v'th term of 339, 335, 329, 321, 311, 299? -v2 - v + 341 What is the p'th term of 223, 495, 765, 1033, 1299, 1563, 1825? -p2 + 275p - 51 What is the p'th term of -54, -82, -110? -28p - 26 What is the d'th term of 0, 17, 60, 141, 272, 465, 732? 2d3 + d2 - 3 What is the r'th term of 740, 743, 746? 3r + 737 What is the q'th term of -6, -8, -10? -2q - 4 What is the j'th term of -35, -63, -91, -119, -147, -175? -28j - 7 What is the s'th term of -40, -136, -288, -496, -760, -1080? -28s2 - 12s What is the g'th term of 1, 8, 15? 7g - 6 What is the w'th term of 69, 86, 93, 84, 53, -6, -99? -w3 + w2 + 21w + 48 What is the k'th term of 95, 100, 107, 116, 127, 140, 155? k*2 + 2k + 92 What is the i'th term of -100, -200, -292, -370, -428, -460, -460? i*3 - 2i*2 - 101i + 2 What is the b'th term of 1668, 3321, 4976, 6633? b*2 + 1650b + 17 What is the m'th term of 120, 312, 506, 702, 900? m*2 + 189m - 70 What is the z'th term of 251, 454, 655, 854, 1051, 1246? -z*2 + 206z + 46 What is the m'th term of 1687, 1686, 1683, 1678, 1671, 1662? -m*2 + 2m + 1686 What is the z'th term of -4848, -9699, -14550, -19401, -24252? -4851z + 3 What is the y'th term of 139, 133, 127, 121? -6y + 145 What is the f'th term of -162, -222, -322, -462, -642, -862? -20f2 - 142 What is the g'th term of -293, -297, -313, -347, -405? -g3 + 3g - 295 What is the u'th term of 7, -9, -47, -113, -213, -353, -539? -u*3 - 5u*2 + 6u + 7 What is the m'th term of 60, 100, 118, 114? -11m2 + 73m - 2 What is the j'th term of 3832, 3831, 3830, 3829, 3828? -j + 3833 What is the m'th term of 17, -4, -61, -160, -307, -508, -769? -m*3 - 12m*2 + 22m + 8 What is the s'th term of 1866, 1869, 1882, 1911, 1962? s3 - s2 - s + 1867 What is the w'th term of -35, -34, -33, -32, -31? w - 36 What is the i'th term of 72, 84, 104, 132, 168, 212? 4i2 + 68 What is the s'th term of 54, 233, 524, 921, 1418, 2009, 2688? -s3 + 62s2 - 7 What is the h'th term of -29, -61, -95, -131, -169, -209? -h2 - 29h + 1 What is the j'th term of 1326, 1311, 1286, 1251? -5j*2 + 1331 What is the w'th term of 25, 166, 559, 1330, 2605, 4510, 7171, 10714? 21w*3 - 6w + 10 What is the k'th term of 1738, 1729, 1716, 1699, 1678? -2k2 - 3k + 1743 What is the c'th term of -55, -57, -59, -61, -63, -65? -2c - 53 What is the p'th term of -41, -72, -93, -98, -81, -36, 43, 162? p3 - p2 - 35p - 6 What is the y'th term of -138, -433, -742, -1071, -1426, -1813? -y3 - y2 - 285y + 149 What is the g'th term of -103, -93, -83, -73, -63, -53? 10g - 113 What is the t'th term of -371, -1476, -3317, -5894, -9207, -13256? -368t2 - t - 2 What is the x'th term of 6, -24, -54, -84, -114, -144? -30x + 36 What is the w'th term of -74, -99, -124, -149, -174, -199? -25w - 49 What is the k'th term of 26, 33, 48, 71, 102, 141, 188? 4k*2 - 5k + 27 What is the b'th term of -117, -127, -137? -10b - 107 What is the i'th term of 24, 35, 34, 21? -6i*2 + 29i + 1 What is the o'th term of -494, -496, -498, -500, -502? -2o - 492 What is the n'th term of 44, 211, 498, 911, 1456, 2139, 2966? n3 + 54n*2 - 2n - 9 What is the p'th term of -3, -102, -373, -900, -1767, -3058, -4857, -7248? -14p3 - 2p*2 + 5p + 8 What is the c'th term of 46, 42, 34, 22, 6, -14, -38? -2c2 + 2c + 46 What is the y'th term of 343, 345, 347? 2y + 341 What is the q'th term of 12, 27, 44, 63, 84, 107, 132? q2 + 12q - 1 What is the s'th term of -281, -276, -269, -260, -249? s*2 + 2s - 284 What is the s'th term of 166, 161, 152, 139, 122, 101, 76? -2s2 + s + 167 What is the a'th term of 132, 139, 156, 189, 244, 327, 444? a3 - a2 + 3a + 129 What is the v'th term of -27, -110, -249, -444, -695, -1002, -1365? -28v2 + v What is the z'th term of 54, 125, 210, 315, 446? z3 + z2 + 61z - 9 What is the v'th term of -9, -12, -15, -18, -21, -24? -3v - 6 What is the v'th term of 3912, 7826, 11740, 15654? 3914v - 2 What is the k'th term of -1860, -1861, -1862, -1863, -1864? -k - 1859 What is the b'th term of -1985, -1994, -2015, -2054, -2117, -2210, -2339? -b*3 - 2b - 1982 What is the l'th term of 130, 133, 136, 139, 142? 3l + 127 What is the n'th term of 148, 298, 436, 556, 652? -n3 + 157n - 8 What is the k'th term of 80, 320, 718, 1268, 1964, 2800? -k*3 + 85k*2 - 8k + 4 What is the m'th term of -210, -253, -284, -297, -286? m*3 - 50m - 161 What is the t'th term of 165, 168, 181, 210, 261, 340, 453, 606? t3 - t2 - t + 166 What is the h'th term of -473, -475, -477, -479? -2h - 471 What is the k'th term of -427, -429, -433, -439? -k2 + k - 427 What is the y'th term of -72, -53, -20, 27, 88, 163, 252? 7y*2 - 2y - 77 What is the q'th term of -13, -5, 7, 23? 2q2 + 2q - 17 What is the d'th term of -5352, -10702, -16052? -5350d - 2 What is the g'th term of -25, -41, -69, -109, -161, -225? -6g*2 + 2g - 21 What is the m'th term of -236, -471, -706? -235m - 1 What is the y'th term of 501, 1001, 1501, 2001, 2501, 3001? 500y + 1 What is the a'th term of -1073, -2131, -3167, -4169, -5125? 2a3 - a2 - 1069a - 5 What is the w'th term of -21, -13, 11, 57, 131? w*3 + 2w*2 - 5w - 19 What is the t'th term of -7895, -7874, -7839, -7790	{ "pile_set_name": "DM Mathematics" }
be (-2 - j) + 3 + -2. Which is smaller: c or 1? c Let g(q) = -q*2 + 4q - 2. Let o be g(4). Let n be 72/(-27) + 21. Which is bigger: o or n? n Let w = 2445 - 46467/19. Is -2 less than w? True Let y be 19/1 + 0/5. Suppose -y = -4n + 13. Suppose -6x = -2x + n. Is x at least -3? True Suppose 3c + 5 = 2, -4a - 4c = 8. Let g be (a + -13)/(-2). Let b be -2 - (-2)/4g. Which is bigger: -2/9 or b? -2/9 Let n = -5 + -3. Is n greater than -9? True Let c be 38/8 - (-3 - 66/(-24)). Which is smaller: 1 or c? 1 Suppose -4s = -4z, 2 = 2z - 6. Suppose 1 + 3 = -sh. Let w be -1 + -3 - (0 + -2). Are w and h nonequal? True Let o = -0.48 + 4.48. Is o less than -2? False Suppose 0 = 2m - 5y - 21, -2m + 5y = -3m - 12. Let o be (m + 1)(-20)/16. Which is greater: o or -6? o Suppose 2p - 2g + 8 = g, -4p + 3g - 4 = 0. Suppose 2 = 4s + 4z - p, 0 = 2z - 2. Let k be 32/(-8) - (1 + -3). Which is smaller: s or k? k Let x = 10 + -7. Let c be 1/(1/(20 - x)). Is 18 < c? False Let f(x) = -4x2 + x + 5. Let h(o) = o2 - 1. Suppose 0 = -k + 2i + 3i + 20, i + 25 = -4k. Let p(a) = kh(a) - f(a). Let d be p(-1). Is d bigger than 1/6? False Let k = 84 - 37. Suppose -5t + 50 = -o - o, 4t - 3o - k = 0. Suppose 4u + 18 = 5h, h + 0h - 3u = t. Is 4 at least as big as h? True Suppose 3l - 3k = 4l + 6, 2k = -4. Is -1 < l? True Let k be ((-6)/(-27))/((-12)/63). Which is greater: k or -2? k Suppose -3c = -k + 10, -3 + 10 = -5k - 4c. Which is smaller: k or -1/9? -1/9 Let b be (-2)/(-4) - (-72)/(-16). Is -1 at most b? False Let r(g) = -6g - 60. Let b be r(-18). Is b not equal to 47? True Let f = -10 + 17. Let p = f - 6. Are 0 and p nonequal? True Let f be 6/(-5)335. Let m = -11 - -15. Let p be m/18 + (-44)/f. Do 1 and p have different values? True Let w(d) = -2d2 + 15d - 7. Let q be w(7). Are q and -1/11 non-equal? True Suppose 5f + 0f - 10 = u, 0 = 5f + 3u - 10. Is f >= 6? False Suppose 4 = 2o + 3m + 3, 5m + 30 = 3o. Suppose 5d - 9 - 6 = 5h, -oh = -d - 5. Is h >= 1? True Let y be (-2)/(9/((-27)/6)). Is y greater than -4/19? True Let h be -4 + 0 - (-12 + 8). Are 4/17 and h equal? False Let j = 0.01 - 0.41. Let l = -0.3 - j. Let n be (2/4)/(10/8). Are n and l nonequal? True Let p(y) = y2 + 9y - 3. Let x be p(-10). Let i be (-3)/x(-2)/(-3). Suppose 0 = d + 4k + 20, 17 = 5d - 3k + 2. Which is smaller: i or d? i Let n be 90/(-5) - (0 - -3). Let w = 31 + n. Is w > 10? False Suppose 2k = -k + 9. Let b = -5 + k. Let y = 0.4 + -0.3. Is y at least b? True Suppose 3i = 4n + i + 16, -n - 4i + 14 = 0. Let z = n - -2. Let g be ((1/(-2))/(-1))/(-1). Is g greater than z? False Suppose -5h = -0h - 5. Let b(s) be the third derivative of s*4/24 + 7s3/6 - s2. Let j be b(-6). Is h equal to j? True Let g = -0.15 - -10.15. Are g and -2 non-equal? True Let m(o) = o*2 + 6o - 8. Let c be m(3). Is 19 smaller than c? False Let d be (-78)/24 + (1 - -1). Let b(j) = j - 9. Let u be b(7). Is d at least u? True Let i be ((-4)/6)/((159/9)/1). Is -2 <= i? True Let t = -29/95 - -2/19. Is t less than -1/5? False Let c(z) = z*3 - 4z*2 - z + 4. Let q be c(4). Suppose q + 1 = -s. Is -7/6 at least as big as s? False Let g be (-6)/33 + (-2)/(-374). Which is bigger: 0 or g? 0 Let m be 0 - 12/42 - (-2)/(-28). Which is greater: -1 or m? m Suppose 5d + 20 = 0, -5l = 5d + 9 + 6. Let v = -3.3 - 1.7. Which is greater: l or v? l Let y = -200/651 + 2/93. Let k = 1 - 0.5. Let p = 0.3 - k. Is p at least as big as y? True Let c be (-162)/39 - (-2)/13. Let t = -7 - c. Does -3 = t? True Let h = -34 - -24. Let n(c) = c + 2. Let k be n(h). Which is greater: k or 1/4? 1/4 Suppose 0 = 3f, -4f + 1 = -2s + 7. Let o be 6/2 - 5 - 0. Let j = s + o. Which is greater: -2/7 or j? j Let d = -0.1 - 6.9. Let q = d - -9. Is q < -1/2? False Suppose q - 3q - 6 = 0. Let m be (1/(-2))/(q/6). Let x be (m/3)/(5/6). Which is smaller: x or 2? x Let v = 6 + -6. Let a be 206((-5)/(-6) - 1). Let l = a - -34. Which is greater: v or l? v Let t be (-1)/2(4 + 2). Which is bigger: t or -11/4? -11/4 Let a = 18/229 + 99579/458. Let v = a - 205. Let r = v + -12. Which is smaller: 0 or r? 0 Let g = 16 + -10. Let o = 5 - g. Do -4/7 and o have the same value? False Let y be 1 + ((-2943165)/(-66))/(-5). Let p = 8915 + y. Let h = -13/11 - p. Which is smaller: h or 1? 1 Let j = -6/61 - 7546/183. Let q(i) = -i*3 - 5i*2 - 2i - 7. Let n be q(-6). Let v = n + j. Are 3/7 and v equal? False Let l = -4 + 3. Let f = -0.8 - l. Let i = 0.4 + -0.2. Is i <= f? True Let q(i) = i*2 - 15i + 3. Let j be q(14). Is -11 smaller than j? False Let r = 83/6 + -14. Which is smaller: 0 or r? r Suppose 4 - 2 = -q. Let h be 27/(-9)1/5. Which is bigger: q or h? h Let v(a) = -a3 - 2a*2 + a + 3. Let j be v(-3). Is j less than 1/3? False Let i = 1173/2 + -615. Do -28 and i have the same value? False Let x = 0.78 - -0.22. Is x less than or equal to -3/17? False Let k be -1(-6)/1533. Is k < 2? True Let i be -5 + (-15)/1028. Is i greater than or equal to -46? False Suppose -5v + 25 = -10v. Let j(r) = r*3 + 4r*2 - 4r + 6. Let b be j(v). Is 1/8 less than or equal to b? True Let v = -9 + 0. Which is smaller: v or 1? v Let c = 0 + 3. Let p be (-2)/c - 609/(-90). Let b = -13/2 + p. Which is greater: 1 or b? 1 Let x = -1627/740 + -1/740. Let r = 5 + -4.9. Is r equal to x? False Let f be -8(3/(-12) + 0). Suppose 3v + 5 = 4l, 3v - 8 = -fl - v. Is l != 2? False Let m = 5.2 - 5. Let h = m + -0.3. Let q be (-2)/(-12) + (-8)/12. Is h bigger than q? True Let x be ((-1)/(-3))/((-3)/9). Is 2/197 equal to x? False Let c(w) = w + 9. Let k be c(-5). Is k > 3? True Let d = -0.07 + 14.07. Which is smaller: d or 1? 1 Suppose -4b + 2 = -2t - 2, -4t = 3b - 3. Let u be 0((-1)/(-2) - b). Which is bigger: u or 1/4? 1/4 Let r = -9 + 5. Let z = 1 + r. Let f = 0 - 1. Is f greater than z? True Let q(y) = 3y2 - 29y - 6. Let h be q(7). Is h > 2? False Suppose -6s + 40 = -c - 2s, 3c - 2s = -170. Which is smaller: c or -59? c Let p(d) = 2d + 1. Let z be p(-3). Suppose -2k - 12 = k - 3g, -5g - 34 = k. Let c = k - z. Is c < -4? False Let s = 7 - 6.94. Let p(q) = q*2 + 3q - 5. Let o be p(-4). Which is bigger: o or s? s Let q = -1.3 - -0.7. Let x = q + -0.4. Is -2 greater than or equal to x? False Let h(l) be the second derivative of 0 + 3/2l2 + 1/6l*3 - l + 1/20l*5 + 1/12l*4. Let m be h(0). Is m >= 3? True Let y be ((-6)/(-12))/(1 + -3). Suppose 0 = b - 5b + 16. Suppose bv - 6v = -2. Which is smaller: y or v? y Let a = -121 - -120. Which is bigger: -13/3 or a? a Suppose 0 = -4n + 25 + 3. Suppose 0 = 5z + 25, -2z = g - 4g + 10. Suppose g = -3u + nu. Which is bigger: u or 2? 2 Suppose -r + 7 - 6 = 0. Let h = r - 11. Let n be h/(-15)6/(-4). Which is smaller: -1/15 or n? n Let o = -14 - -18. Is o >= 9/2? False Suppose 4w + 12 = 3n - 3, -4n = 12. Which is smaller: w or -8? -8 Let n be -15(-2)/(-10)-2. Which is smaller: 4 or n? n Let s be 50/(-6) - (-2)/6. Let c = 9 + s. Is -0.2 < c? True Let k = 3 + 0. Let i be -2(1 + (-2)/k). Is 0 greater than or equal to i? True Let b be (2/(-6))/((-2)/(-9)). Let w be 11/3 - (-4)/(-6). Suppose -w = 4m + 9. Which is greater: b or m? b Suppose 5x + 17 = 4z - 3, 3x + 3z = 15. Let k = -16/17 + 271/306. Is k at most x? True Let d be 4/(-20) + 33/90. Which is bigger: d or -1? d Suppose -4u - 16 = -5s + 17, 5u = -3s + 5. Is u at most as big as 10? True Let q = -7 - -4. Let r be (15/(-24))/(q/12). Which is bigger: r or 1? r Let k be 8/36 - (0 - 0). Which is greater: 0.4 or k? 0.4 Suppose -9f + 3f + 18 = 0. Which is smaller: f or 7/4? 7/4 Suppose 4c + 48 = -3z, 3c + 5z + 58 = 22. Let o = 10 + c. Which is smaller: -1 or o? o Let r(l) = -l2 - 2l - 2. Let x(j) = j - 8. Let v be x(6). Let q be r(v). Let m = -3 + 1. Is m at least as big as q? True Let h be 30/(-4)(-4)/(-6). Let c = h + 7. Is 1 > c? False Let w be ((-8)/340)/(2/10). Which is smaller: 0.1 or w? w Let p be 3/(-9) - (-1)/3. Suppose 3x - 1 - 8 = p. Suppose 2r = -5m - 14, -4m - 4 - 6 = 2r. Are x and r nonequal? False Let p = -35/2 - -17. Which is smaller: 0 or p? p Let i = 0.05 - 0. Let s = -1.2 + 3.15. Let z = s + i. Do 2 and z have the same value? True Suppose 0 = -4u + 4b - 424, 163	{ "pile_set_name": "DM Mathematics" }
1360 Four letters picked without replacement from {v: 2, p: 4, q: 4, j: 1}. Give prob of sequence qqpj. 1/165 Two letters picked without replacement from {j: 4, k: 3, m: 1}. Give prob of sequence kk. 3/28 Calculate prob of sequence xoxg when four letters picked without replacement from ocggxcjxgxgoxx. 20/3003 Calculate prob of sequence kk when two letters picked without replacement from {g: 7, k: 12}. 22/57 What is prob of sequence tq when two letters picked without replacement from {q: 2, t: 9}? 9/55 What is prob of sequence wpbp when four letters picked without replacement from pbbwpbpbpbpbb? 7/858 Three letters picked without replacement from fnfffnnnnffn. What is prob of sequence nnf? 3/22 Four letters picked without replacement from alaaaala. Give prob of sequence alal. 1/28 Three letters picked without replacement from urian. Give prob of sequence iua. 1/60 Three letters picked without replacement from {v: 1, i: 8, m: 1, f: 5, n: 5}. What is prob of sequence fvf? 1/342 Calculate prob of sequence cqqj when four letters picked without replacement from {q: 3, j: 1, u: 4, c: 1, x: 6}. 1/5460 Three letters picked without replacement from {g: 2, d: 1}. What is prob of sequence ggd? 1/3 Three letters picked without replacement from lllr. Give prob of sequence rll. 1/4 Three letters picked without replacement from {z: 3, u: 3, t: 1, e: 4, a: 5, s: 1}. Give prob of sequence aut. 1/272 Two letters picked without replacement from {s: 1, g: 1, j: 1, c: 5, r: 1}. Give prob of sequence gj. 1/72 Calculate prob of sequence egq when three letters picked without replacement from egeeyeeeegeqgee. 1/91 Four letters picked without replacement from chdmmummummmmmmm. What is prob of sequence hdum? 11/21840 Four letters picked without replacement from {m: 4, u: 3, g: 3, y: 3}. What is prob of sequence ggum? 3/715 Calculate prob of sequence cccc when four letters picked without replacement from {h: 1, c: 14}. 11/15 Three letters picked without replacement from {h: 5, v: 8}. What is prob of sequence hvh? 40/429 What is prob of sequence llln when four letters picked without replacement from lnnnnnnnnnnnlnl? 1/455 Two letters picked without replacement from {v: 2, y: 1, l: 1, x: 1, s: 1, q: 1}. What is prob of sequence xs? 1/42 Four letters picked without replacement from fffsssiuqffftqiftt. What is prob of sequence ifqt? 7/6120 What is prob of sequence ccce when four letters picked without replacement from {e: 1, c: 14}? 1/15 Three letters picked without replacement from sddjvbbdssbbbd. What is prob of sequence dbd? 5/182 Four letters picked without replacement from {k: 5, e: 3}. Give prob of sequence ekkk. 3/28 Two letters picked without replacement from djjjddjhhjjjjjjjjj. Give prob of sequence hd. 1/51 What is prob of sequence vf when two letters picked without replacement from vfspfpp? 1/21 Calculate prob of sequence th when two letters picked without replacement from {u: 5, o: 3, a: 2, t: 3, h: 2}. 1/35 Calculate prob of sequence uoo when three letters picked without replacement from {u: 2, o: 3}. 1/5 Calculate prob of sequence fdgc when four letters picked without replacement from fggffbffdccf. 1/495 Three letters picked without replacement from mmad. What is prob of sequence mad? 1/12 Calculate prob of sequence yw when two letters picked without replacement from {j: 2, w: 1, g: 1, y: 1, e: 2}. 1/42 Two letters picked without replacement from {n: 3, v: 1, o: 7, m: 7, h: 2}. What is prob of sequence mv? 7/380 Three letters picked without replacement from {a: 1, g: 1, w: 2, z: 4}. What is prob of sequence aaa? 0 Three letters picked without replacement from ffqbfffnfqfq. What is prob of sequence fqn? 7/440 Four letters picked without replacement from ararrsarraa. What is prob of sequence aaaa? 1/66 What is prob of sequence soo when three letters picked without replacement from ooooosoooooo? 1/12 Calculate prob of sequence oyl when three letters picked without replacement from olylyydyoylylyyyy. 1/51 What is prob of sequence rm when two letters picked without replacement from rqrgmyeg? 1/28 What is prob of sequence qpzw when four letters picked without replacement from {z: 1, r: 1, p: 2, k: 6, q: 5, w: 1}? 1/4368 Four letters picked without replacement from ivivjfvjlllgi. Give prob of sequence ijgi. 1/1430 Two letters picked without replacement from uufluffufl. Give prob of sequence ul. 4/45 Two letters picked without replacement from {p: 4, c: 5, m: 2}. Give prob of sequence pm. 4/55 What is prob of sequence tgcb when four letters picked without replacement from {c: 1, t: 7, b: 4, g: 4, i: 2}? 7/4590 Calculate prob of sequence sm when two letters picked without replacement from {s: 3, l: 1, a: 4, m: 4, b: 2}. 6/91 Calculate prob of sequence na when two letters picked without replacement from {g: 1, a: 2, w: 1, m: 1, n: 1, b: 1}. 1/21 Two letters picked without replacement from gbhhhghhhgghhhgghgh. What is prob of sequence hb? 11/342 What is prob of sequence mf when two letters picked without replacement from {h: 1, f: 3, m: 3, x: 2, k: 1, s: 1}? 9/110 Calculate prob of sequence zz when two letters picked without replacement from rrrprtjppjrzrj. 0 Three letters picked without replacement from ininiinvnn. What is prob of sequence inv? 1/36 Two letters picked without replacement from aaaaaaaqaaaaaaaaaaa. What is prob of sequence aq? 1/19 Two letters picked without replacement from {c: 2, d: 7, m: 11}. What is prob of sequence mc? 11/190 Calculate prob of sequence csyc when four letters picked without replacement from syocsssco. 1/378 Two letters picked without replacement from hdqjmqu. What is prob of sequence jm? 1/42 Two letters picked without replacement from {w: 1, l: 3, o: 1, v: 1, g: 5, d: 1}. Give prob of sequence go. 5/132 What is prob of sequence pp when two letters picked without replacement from lppypwaaaw? 1/15 Calculate prob of sequence nnk when three letters picked without replacement from dnkzznnnn. 5/126 Two letters picked without replacement from {a: 2, u: 8, o: 6, d: 2, b: 1, p: 1}. What is prob of sequence du? 4/95 Two letters picked without replacement from {w: 2, g: 1, p: 1, b: 2, m: 2, n: 4}. Give prob of sequence bn. 2/33 Calculate prob of sequence nl when two letters picked without replacement from {l: 1, n: 1, w: 2}. 1/12 Three letters picked without replacement from emteeeeemmeeeeeeeeee. What is prob of sequence tmm? 1/1140 Four letters picked without replacement from {a: 6, m: 1, t: 8, j: 1, c: 3}. What is prob of sequence acjt? 1/646 What is prob of sequence xkl when three letters picked without replacement from {x: 2, d: 2, s: 5, e: 1, l: 2, k: 1}? 1/429 Four letters picked without replacement from vvjvjjvv. Give prob of sequence vvvj. 3/28 What is prob of sequence mam when three letters picked without replacement from {a: 2, m: 2, k: 2, l: 2}? 1/84 What is prob of sequence xx when two letters picked without replacement from {l: 2, x: 2}? 1/6 Two letters picked without replacement from kkuak. Give prob of sequence kk. 3/10 Four letters picked without replacement from eeydyyyysidyydd. Give prob of sequence syye. 1/390 Four letters picked without replacement from {y: 7}. Give prob of sequence yyyy. 1 Two letters picked without replacement from {e: 1, p: 3, i: 2, r: 4, w: 6, a: 3}. What is prob of sequence rw? 4/57 What is prob of sequence bo when two letters picked without replacement from oibsbobosikv? 3/44 Two letters picked without replacement from oohmohyhyy. What is prob of sequence yo? 1/10 Two letters picked without replacement from ihihiiiiiiiiiifih. Give prob of sequence ih. 39/272 Calculate prob of sequence dg when two letters picked without replacement from gdggdg. 4/15 Three letters picked without replacement from sisisii. Give prob of sequence sii. 6/35 What is prob of sequence vkv when three letters picked without replacement from kvpvvpp? 1/35 Calculate prob of sequence akkz when four letters picked without replacement from zzuka. 0 Four letters picked without replacement from {i: 4, h: 15}. Give prob of sequence hiii. 5/1292 What is prob of sequence pp when two letters picked without replacement from upuppuuuuppuuuuupu? 5/51 What is prob of sequence xja when three letters picked without replacement from hxzhzazxmzjx	{ "pile_set_name": "DM Mathematics" }
e in -1, -0.4, b? -0.4 Let s be (0 - (-1)/(-9))/((-16)/32). What is the third biggest value in 29, s, -0.1, 0.2? 0.2 Let x = 1.93 + -5.93. Let g = -1106/5 - -220. What is the third smallest value in g, 0.4, 5, x? 0.4 Let t = -8 - -5. Let x(s) be the third derivative of s*4/8 + 3s*3/2 - 33s*2. Let y be x(t). What is the second biggest value in -5/4, y, -0.3? -0.3 Suppose -96u + 39 = -109u. Which is the third biggest value? (a) u (b) -0.29 (c) 5 (d) 0 b Let x = 256 + -259. Which is the second smallest value? (a) 4 (b) 0.9 (c) x (d) -4 c Let q(j) = -j3 - 21j*2 - 19j + 18. Let p be q(-20). Let w = 2.8 + 0.2. Which is the fourth smallest value? (a) -4 (b) p (c) 0.3 (d) w d Let g = -2.09 + -129.91. Let u = g + 129. Let v = 5 + -5.4. Which is the second biggest value? (a) 2 (b) u (c) v c Let d = -55 + -12. Let v = -66.8 - d. What is the biggest value in v, 0, 4? 4 Let q = 1 - 4. Let x = -7 - q. Let d = 0 - -3. Which is the biggest value? (a) -5 (b) x (c) d c Let k be 0/(-2)(-13 - -12). Let q be 0 - -3 - (-2 + k). Which is the biggest value? (a) q (b) 1 (c) 0.02 a Suppose 0 = 2w - 2l + 5l + 21, 0 = 4l + 20. Which is the biggest value? (a) w (b) 17 (c) 1 b Let k be (-6)/(-45) + (-406)/(-105). Suppose -kw - 32 = 28. Let u = 11 + w. What is the smallest value in u, -1/4, 0.5? u Let r be -12 + (-323)/(-187). What is the second smallest value in 2/9, r, -5? r Let m = -708.8 - -709. What is the third biggest value in m, -1/4, 0.4, -49? -1/4 Let a = -0.34 - 0.06. Let w = 4.378 - -0.022. Let l = w + 0.6. What is the third biggest value in l, -1, a? -1 Suppose -12 = -4q, 3q - 11 = -5g - 2. Let i = 2.27 - 0.27. Which is the fourth smallest value? (a) 1/2 (b) -20 (c) i (d) g c Let j = 0.223 - 1.223. Which is the smallest value? (a) j (b) 0.2 (c) 0.21 a Let u = 2/91 + -4/13. Let y = -11824 - -11829. Which is the smallest value? (a) -0.1 (b) 1 (c) y (d) u d Let y be 1 - (-2)/(22/(-9)). Let d = -70486 - -494210/7. Let r = d + -115. Which is the biggest value? (a) y (b) r (c) -2 b Let s be (-42)/1176354/(-2). Let g = -46/7 + s. Let w = 4 - 9. Which is the smallest value? (a) -0.3 (b) w (c) g b Let j = -1/65 - 61/260. Let g = 2.1 - 2.6. What is the third biggest value in g, j, -0.1? g Suppose 0 = 38g - 34g - 68. Let u = 22 - g. Let f be ((-3)/(-36))/((-6)/(-16)). What is the second biggest value in f, -0.1, u? f Let v = 0.06 - 4.06. Let x be 4/10(6 - 52/8). What is the second smallest value in x, v, 2/5? x Let t be (-8)/3(-3)/(7 + -6). Let o be (30/(-12))/(2/t). What is the smallest value in 5, o, 2? o Let m be (8521616/(-170))/((-6)/15). Let p = -125738 + m. Let z = 420 + p. What is the third biggest value in z, 1, 5? z Let j = -0.0439 - 0.4561. Which is the fourth biggest value? (a) j (b) 1/3 (c) -2/3 (d) -37 d Let m = -0.4 + 0.2. Let n = 355 - 1063/3. Let z = -0.83 + 0.03. What is the third smallest value in z, m, n? n Let z = -207.3 + 207. What is the fourth smallest value in 4/3, -0.29, z, -2/5? 4/3 Let k = -25/21 + 9/7. Suppose 13r = -4n + 11r - 16, 12 = 4n - 5r. Which is the third biggest value? (a) k (b) n (c) 2/17 b Let t be ((-4)/(-5) + (-4)/6)/(-1). Which is the fourth smallest value? (a) -4 (b) t (c) -1/3 (d) 0.2 d Let p = 0.08 + -1.48. Let s be (-81 - 3)/(3 + -25) - (-4 - -8). What is the second biggest value in s, 5, 1/7, p? 1/7 Let z = 133/639 - -1/71. What is the second smallest value in -2/3, z, 0.2, 1? 0.2 Let x be (14/28)/((21/6)/7). Which is the third smallest value? (a) -4.34 (b) x (c) 2 c Let f(k) = k - 30. Let p be f(0). Let i be 1/((4/25)/(-4)). Let d be 20/i + (-4)/p. Which is the biggest value? (a) d (b) -0.5 (c) 0.4 c Let t = -285 - -287. Let q = -0.14 - 0.26. Let s be -1 + (4/(-5))/(-2). What is the third biggest value in q, s, t? s Let c(g) = -g*3 + 14g*2 - 9g - 45. Let t be c(13). Let h = -28 - -49. Suppose -7a + t = h. What is the second smallest value in 0, 1/8, a? 0 Let p = 12 + -17. Let l = -395 + 2766/7. Which is the biggest value? (a) 1 (b) p (c) l a Let y = 339.2 - 339. Which is the second biggest value? (a) 0.4 (b) y (c) -0.1 b Let a be 0 - (-4)/(36/3). Suppose 3g - w = -3w + 12, -5g = w - 13. Suppose -p - 5s = gp - 12, -9 = -3s. What is the third smallest value in a, p, -1/7? a Let v = 35 + -35.1. Let d = -0.352 - 0.048. Let y = -3 - -2.8. What is the smallest value in d, v, y? d Let i = 36/301 - 1/7. Let y = -133/172 - i. Which is the fourth biggest value? (a) -1 (b) 3 (c) y (d) -0.2 a Let n = 0.25 - 3.25. What is the second smallest value in 10/3, n, -5? n Let i be 538/36 - (-1)/((-4)/(-6)). Let l = i + -1646/99. What is the biggest value in -1, 1/7, l, 2/19? 1/7 Let q = 3.437 - -0.063. Let k = 3.6 - q. What is the second smallest value in k, -13, -0.3? -0.3 Let q = 0.5 - 5.5. Let g = -4 + q. Let z = g - -8. Which is the smallest value? (a) z (b) -3/5 (c) 2 a Let w = -10 - -15. Let u = 331 - 330.242. Let z = 0.042 + u. Which is the smallest value? (a) w (b) z (c) -3 c Let v = -1.038 - 0.062. What is the smallest value in -6, v, 0.4? -6 Let r = -4/255 - -2/15. Let d = 0.1 - -4.9. Let m = -24 + 23. Which is the second biggest value? (a) r (b) d (c) m a Let j = 1726 - 1726.3. Which is the second smallest value? (a) -0.4 (b) -1/4 (c) -4 (d) j a Let a be 1/((-70)/(-24) - 3). Let d be 14/a - (-16)/24. What is the third biggest value in d, 0.16, 3? d Suppose 2k + 3k = -20. Let l be (3 + -4)k/(-34). Let s = -1559/5 + 313. What is the biggest value in s, l, -5? s Let l = -2 - -2.5. Suppose 5n = -1 - 14, -4n = 3i + 24. Let t be (-24)/(-42) - (-4 - i). Which is the biggest value? (a) -4 (b) t (c) l b Let x = 0.069 + 0.231. Which is the fourth biggest value? (a) 0.5 (b) -1/4 (c) -7 (d) x c Let f = -20 + 36. Let v = f - -1. Let i = 16.9 - v. Which is the biggest value? (a) 2/15 (b) 0 (c) i a Let t(x) = -x3 + 7x*2 + 7x + 10. Let v be t(8). What is the second biggest value in -8, 4, v? v Suppose 28y - 19y + 18 = 0. Which is the third smallest value? (a) 0.15 (b) 1 (c) 1/8 (d) y a Let o = -210.03 - -211.03. Let n be -2 + 2 - (-2)/(-6). Let w = n - -1/12. Which is the third smallest value? (a) w (b) 2 (c) o b Suppose -18r - 20r = -114. Let l be 18/(-27)9/(-8). What is the third biggest value in r, 6, 1/3, l? l Let v = -0.13 - -0.53. Which is the third biggest value? (a) 1/2 (b) v (c) -1/12 c Let j = 1837/25164 - -1/932. What is the third biggest value in j, 1/4, -1? -1 Let x = 6.2 + -3.3. Let k = 50.8 - 47.8. Let q = x - k. Which is the second smallest value? (a) -0.2 (b) -11 (c) q a Let w be 1504/368 + 4-1. Let r be 1 - ((-6)/(-10) - 48/(-20)). What is the second smallest value in r, w, -1? -1 Let h = 61 + -63. Which is the third smallest value? (a) 0 (b) 0.05 (c) h b Let n = 305.4 + -305. What is the smallest value in -0.1, n, -0.017, 2/7? -0.1 Let z = -4 + -1. Let x = 41.5 + -38. Let w = 8.5 - x. What is the third biggest value in z, w, -2/17? z Let l be (16/(-10))/(20/(-250)-5). What is the third smallest value in -5, 4, l, -2? -2 Let h = 37.6 + -44.5. Which is the smallest value? (a) 1/6 (b) h (c) -0.3 b Let d = 51.2 + 7.8. Let i = d + -118. Which is the biggest value? (a) -4 (b) i (c) 3 c Let h = 20 - 20.3. What is the third biggest value in 3, h, -52? -52 Let j(v) = v3 + 26v2 + 38. Let y be j(-26). Let s = -36 + y. Let t(o) = -o2 + 1. Let u be t(3). Which is the smallest value? (a) -1/2 (b) u (c) s b Let v be (4/(-3))/(2/6). Let x = 1.33 - 1.13. What is the third biggest value in x, -0.4, v? v Suppose 2 = -5x + y + 10, 0 = -5y - 15. Which is the third smallest value? (a) 1/7 (b) -0.02 (c) x c Let d be (-12)/(-130)(350/(-30))/(-7). What is the biggest value in d, -3, 0.06? d Let k = -2/25 - 17/100. Let d = 75/568 - 1/142. What is the second biggest value in 1/4, 0, k, d? d Let u = -3.2 + 0.4. Let s = -2.74 - u. Let m = s + -0.02. Which is the biggest value? (a) -4 (b) m (c) 3 c Let v be (-2)/6 - (-1445)/2805. Let u = 0.05 + 0.05. Let i = u + -0.6. Which is the third biggest value? (a) v (b) -1 (c) i b Let u = 2820.05 - 2820. Which is the second smallest value? (a) -1 (b) u (c) 8 b Let m(t) = -t2 + 4t - 5. Let s be m(2). Let a(v) = -v*	{ "pile_set_name": "DM Mathematics" }
k*5 - 27k*3 + 4k Expand ((-4x + 0x + 2x)(-5 + 4 - 1) + 11x - 4x - 4x + (1 - 2 + 0)(x + x - x) + 2x + 4x - 4x)((3x + 3x - 4x)(3 + 2 - 4) + 2x + 2x - 2x). 32x*2 Expand 5n*3 - 3n*3 + 0n3 + (n2 + 2n2 - n2)(-n + n - 5n) + (-129n + 2n3 + 129n)(6 - 3 - 4). -10n*3 Expand (8 - 29 - 76 - 126)(3d2 - 3d2 + d3). -223d3 Expand 8z5 - z5 - z5 + (z3 - 2z3 + 2z*3)(2z2 - z2 - 2z*2) + (-6z*2 + 2z*2 + 3z*2)(-33z3 + 10z*3 + 6z*3). 22z*5 Expand (96j - 96j + 86j*3)(2j - 1 - 2 + 0j). 172j4 - 258j*3 Expand (9 - 7 - 19 - 20)(0u + 2u - u). -37u Expand (2 - 4 + 1)((-2g5 - 3g + 3g)(-6 + 3 - 1) + 3g3 - 3g3 - g5) + (-6 - 4 + 7)(g2 + 0g2 + g2)(2g*3 - 5g3 + g3). 5g5 Expand -k5 + k3 - k3 - 3k*2 + 3k*2 - 3k5 + (-k2 - 2k3 + k2)(133k - 133k + 4k2) + 2k5 + k5 - 7k5. -16k*5 Expand 37a*3 - 17a*5 - 37a3 + (a4 + 5a4 + 4a*4)(a + a - 3a). -27a5 Expand p5 + 148p3 - 1 + 152p*4 - 152p*4 + (0p4 + p5 + 0p4)(1 - 2 + 2). 2p5 + 148p*3 - 1 Expand (0u*2 + 3u*2 + 2u*2)(-1 + 102u + 3 - 6 - 74u). 140u3 - 20u*2 Expand (-2o*2 + 2o*2 - 2o*4)((4 - 4 + 1)(0o - o + 2o) + 10o + 6o + 5o). -44o5 Expand 118y*5 + 124y*5 - 25y - 240y5 + 3y2 + (-y + y2 + y)(-y3 - y2 + y2). y5 + 3y*2 - 25y Expand (2 - 7 + 2)(-2 + 2 + i) + (-67 - 27i + 67)(0 + 1 - 3). 51i Expand (2o + o2 - 2o)(6o - 12o - 26o) + o*3 - 3o + 3o. -31o*3 Expand 1 - 1 + 2l*4 + (-3l + 4l - 3l)(2l*3 - 2 + 2) + 35l*4 - 26l*4 - 62l*4. -55l*4 Expand (-4f5 + f5 + 4f5 + (-f + 0f + 3f)(-f*4 + 0f*2 + 0f*2) - 3f*4 + 3f*5 + 3f*4)(-4 - 18 + 2). -40f5 Expand (m2 - 5m*2 + 3m*2 + 32 - 32 + 8m2 + (m2 + 3m2 - 6m*2)(0 + 1 - 2) - 3m2 + 5m*2 - 4m*2)(-3m2 - 3m*3 + 3m*2). -21m*5 Expand ((2j*3 - 2j*2 + 2j*2)(27 - 27 + 7j2) - 2j*5 - 3j*5 + 2j*5)(-2 - 4 + 5). -11j5 Expand (3m + 0m - 6m)(-388 - 5m + 388)(3m*2 - 2m + 2m). 45m*4 Expand (-7 + 13 + 4)(-4 - 8 + 2)(0p + 4p - 2p). -200p Expand (0 + 1 + 0)(-6j + j + 2j) + 3 - 3 - j + 3j + 17j + 26j + (-1 + 0 - 1)(-3j + 0j + j) - 2j + 3j - 3j - j - 4j + 3j. 42j Expand (-2j + j2 + 2j)(-6j - 2j + 3j + (j + j - j)(-1 + 1 + 1)). -4j*3 Expand (-167v + 4v + 53v)(-5 + 3 + 1)(0v + 0v - 2v). -220v*2 Expand (-34c + 79c - 11c)(9c + 3c4 - 9c) + (5 + 2c - 5)(-3c2 + 3c*2 - 2c*4) - 2c5 + c5 - c*5. 96c*5 Expand (4i - 8i - 2i)(i4 - 34i + 454i2 - 454i*2). -6i*5 + 204i*2 Expand (3y + 0y - 5y)(-9y*2 + 19y*2 + 7y2 + 1 - 1 + y2 + (-y - 3y + 2y)(3y - 6y + 4y) + y*2 - 3y2 + y2 + y2 - y2 - 5y2). -20y*3 Expand (2 + 2 - 2)(0r4 + 0r*4 + 2r*4) + 41r*3 - 41r*3 - 27r*4. -23r*4 Expand (100u*2 - 97u*2 - 49u*2)(1 - 1 + 16u3). -736u*5 Expand 16t*4 + 13t*4 + 7t4 - t4 - 2t4 + 5t4 + (t3 - t*3 - 2t*3)(4t - 4t - 2t) - 2t*4 - 2t*3 + 2t*3. 40t*4 Expand (34r*4 - 115r + 115r)(2r - 2r - 2r)(4 - 3 - 2). 68r5 Expand (3 - 2o - 3)(4o - 4o - o) - 41 + 7029o*2 - 7035o*2 - 10. -4o*2 - 51 Expand (-4q + 4q + 5 - 3q)(0q*2 - 4q*2 + 5q*2 + (0 - 2q + 0)(0q + 9q - 2q)). 39q3 - 65q*2 Expand (3h + 3 - 3)(-7h - 8h - 14h). -87h2 Expand (a - a + a)(5 - 4 - 2)(-8 + 15 - 1). -6a Expand (78 - 36 - 43 + 89n)(2n + 0n - n). 89n2 - n Expand (10 - 12u + 0 - 7)((0 + 1 - 3)(2u3 + 3u - 3u) - 2u3 + u3 + 4u3)(3u - 7u + 3u) + (u5 + 3u*3 - 3u*3)(5 - 4 - 2). -13u5 + 3u*4 Expand ((-14 - 20 + 20)(-4s2 + 12s*3 + 4s*2) + 2s - 2s - 2s*3)(-6s2 + 2s*2 + 3s*2). 170s*5 Expand (-8g + 6g + 4 - 4g*2 + 10g*2)(-g*3 + 2g*3 - 2g*3). -6g*5 + 2g*4 - 4g*3 Expand (-4s3 + s3 + s*3)(-2s2 + s - s) - s + s5 + s + (3s*3 + 2s*2 - 2s*2 + (0s + 0s - s2)(s + 14s + 68s))(-2s*2 + 2s*2 + 2s*2). -155s*5 Expand (-7x*2 + 16 - 16)(5x2 - 4x*2 - 2x*2) + (2x*3 + 0x*3 - 3x*3)(-3x + 6x - x) + 4x3 - 2x*4 - 4x*3 - 5 + 0x*4 + 3 - 2x4. x4 - 2 Expand (-2r - r + r)(-2 + 0 + 0) + (4 - 6 - 1)(9r + 8r - 9r) + (-1 + 1 - 2)(-2r + 2r - r). -18r Expand (4d - 6d + 4d)(-24 + 27 + 69)(4 - 5 - 1). -288d Expand (3j + 0j - 5j)(6j4 - 4j4 - j4) + 34j5 - 32j*5 + 137j*5. 137j*5 Expand (7 - 3w - 2w + 39w)(-4 + 0 + 0). -136w - 28 Expand (-1 + 0 - 1)(0d - 238d - 533d). 1542d Expand (3 + 2o - 3)(-3 + 3 - 4o) + 16o2 + 15o*2 - 16o*2. 7o*2 Expand -3q + 3q - 2q*3 + (4q - 4q + q)(0 - 2q2 + 0) - 3q3 + q3 + q*3 + 0q*3 - 2q*3 + 3q*3 - 127q + 125q + 10 - 16q*3 - 7. -20q*3 - 2q + 3 Expand 0g4 - 2g4 - g4 + (-3g - g + 0g)(-6g*3 + 29g*2 - 29g*2 + (5g - 5g - g)(-2g2 + 2g2 - g2)). 17g4 Expand 2s*2 - 2s*2 - 2s4 + s4 + 4s - 4s + (2s2 - 2s*2 - 2s*2)(3s2 - s2 - s2) + 8s*4 - 55s*4 - 70s*4. -120s*4 Expand (1 - 1 - 2k*2)(3k2 - 3k2 + k2)(-15 + 3 - 6 - 2 + 5 - 4 + (-1 + 0 + 0)(-2 + 1 + 0) - 3 - 3 + 4 + 3 - 3 + 2). 36k4 Expand (-10t*3 + 22t*4 + 10t*3)(-2t + 1 - 5 + 1). -44t*5 - 66t*4 Expand (2a + 1 - 1)(-1 + 1 + 2a) + 3a2 - a2 - 5a*2 + (-a - a + 0a)((-1 + 2 + 0)(5 - a - 5) - 3a + 5a - 4a + 0a - a + 3a - 3a + 2a + 3a). -a*2 Expand (6 - d - 3 - 1)(-20d3 - 4d3 - d3) - 5d2 - 1 + 5d2 + d4. 26d4 - 50d*3 - 1 Expand (-1 - 3 + 8)(3t4 + 3t*4 - 2t*4) + 2t*2 - 4t4 + t2 - 5t2. 12t*4 - 2t*2 Expand (-1 + 1 + 1)(-j*4 + 3j*4 - 3j*4) + (-j + 0j + 0j + (1 - 2 - 1)(8j + 0j - j))(2j + 2j - 6j)(-11j*2 + 4 - 4). -331j*4 Expand (-u - 4u + 3u)(0u2 + 3u*2 + 2u*2) - 31u*3 - 69u*2 + 69u*2. -41u*3 Expand (2 - 2q - 2)(-43q + 2q2 + 48q + 0q2). -4q*3 - 10q*2 Expand (-b + 4b - b)(-b + 4b - 2b) - 1002b*2 + 1 + 1011b*2 + 5b - 2. 11b2 + 5b - 1 Expand (-3w + 2w + 3w)(50 - 221 + 5) + (4 + 1 - 3)(-2w + 5w - 2w). -330w Expand 3w4 - w4 - 4w4 + (-2w*3 - 2 + 2)(-55w + 35w + 113w) + w - w - w4. -189w*4 Expand (-20p*2 + 20p*2 - 5p*3)(-5p - 9p + 2p). 60p4 Expand 4 - l2 - 4 + (-1 - 3 + 2)(-3l2 - l2 + 5l2) + l2 - 2 + 2 - 3l*2 - 2l2 + l2. -6l2 Expand (2s*2 - 2s + 2s)(338 + 33s - 338)(2 + 20s2 - 4 - 22s2) + s2 - s*2 - 2s*5. -134s*5 - 132s*3 Expand ((-111138 - 953v*2 + 111138)(-v + v - 2v) - 2v + 2v3 + 2v)(2 - 2 - 2v*2). -3816v5 Expand f5 - 4f5 - f5 + (3f*3 - 4f*3 + 3f*3 + (-3 + 1 + 0)(-2f + 2f - 2f3) - 3f*3 + 2f*3 + 6f*3)(-8 + 4f2 + 8). 40f*5 Expand (63p - 63p - 42p + (0 + 0 + 2)(p - 3p + 4p))(0 + 0 - 2p2)(-4 + 4 + 3p). 228p*4 Expand ((1 - 2 + 0)(1 - 4 + 4) + 3 - 2 + 1)(168m - 109m - 104m - 2 - m + 2 + (-2m + m + 2m)(1 - 4 + 2)). -47m Expand -2a2 + 3a*2 + 7a2 - a + a + a2 + (-3a + 0a + 0a)(a - 8 + 8). 6a2 Expand (14y*2 + 0y*2 - 5y*2)(-3y2 + y3 + 3y*2 + (2 - y - 2)(3y2 + 4y*2 - 5y*2) + 4y*3 + 0y*3 - 2y*3 + 13y*3 + 13y*3 - 9y*3). 162y*5 Expand 2g*3 + 5 - 5 + (168g - 15g2 - 168g)(-2g - 5 + 5) + 5g3 - 5g*3 - 4g*3. 28g*3 Expand 4y + 19y4 - 3y - 2y + 0y*4 - 7y4 + y4 + (-3y3 - 2y*3 + 4y*3)(-3y + 3y - y). 14y4 - y Expand (1 + 2 + 0)(-249 - 128x3 + 249). -384x*3 Expand (-76 - 622 - 586 - 923)(2z - 4z - z). 6621z Expand -4z + 2z + 0z + (16z - 3z + 8z)(0 + 3 - 1). 40z Expand (-20j - 58j - 9j)(-3j*3 + 4j*3 - 4j*3 + (5j - 3j - 3j)(-2j2 + j2 + 2j2) + 0 + 0 + 2j*3). 174j*4 Expand 6v*3 - 2v*3 + 0v*3 + (16v - 17v + 0 - 1)(3v2 + 2v*2 - 6v*2) - 6v*3 - 5v*3 + 8v*3. 2v3 + v2 Expand (-u*3 - 5u + 5u)(-2 + 0 + 1)(-1 - 1 + 3)(2 + 3 + 2). 7u3 Expand (-3f3 + f3 + f*3)(242 - 479 + 119). 118f3 Expand (174j - 235j - 73j)(-2 + 0 - 1). 402j Expand (3f2 + 5f*2 - 4f	{ "pile_set_name": "DM Mathematics" }
(1 + 2 - 1). 2v Expand (-8 - x + 4x + 9)(-6x + 7x + 2x). 9x2 + 3x Expand (-r - 3r + 8r)(-1 - 2 + 4)(1 + 0 + 0). 4r Expand (5h*2 + 10h*2 - 2h*2)(-h - 3h + 3h + (-3 + 2 + 2)(-2h - h + 4h) + 0h - h + 2h). 13h*3 Expand (6j - 4j - 3j)(-3j + j + j)(19 + 20 - 13). 26j*2 Expand (-10t + 5t2 + 10t)(0 + 3 - 5)(t + 0 + 0). -10t3 Expand 0v5 - v5 - 3v5 + (4v + 2v + 0v)(4v*4 - 2v*4 - 3v*4) + (4v2 - v2 - v*2)(-v*3 + 2v*3 - 3v*3). -14v*5 Expand (3u - 3u - 2u - 1)(2 + 0 + 2u*2 - 5). -4u*3 - 2u*2 + 6u + 3 Expand -2r2 + 4r*2 + 3r*2 + (-2r + r - 2r)(-r - 2r + 5r). -r*2 Expand (-1 + 1 - 2)(-4 - y + 4 - y + y + y + (-1 + 2 - 2)(7y - 3y - 2y) + y - 4y + y + (-2 + 0 - 1)(-6 + 2 + 3)(2y - 2 + 2)). -4y Expand (-8 + 10 - 9)(-2b + b + 0b). 7b Expand -15o*4 + 6o*5 + 15o*4 + (-5o*3 + 5o3 - o3)(-2o*2 - 1 + 1) + 2o5 - o5 + o*5. 10o*5 Expand ((1 - 1 - 2u)(-2u + 2u + u) + 3u*2 + 0u*2 - 4u*2 + (2u + u - 5u)(u + 3u - 3u))(-3u + 0 + 0). 15u3 Expand 0y*2 - 2y*3 + 0y*2 - 4 + 2y*3 + 4 + (-6y*2 + 3y2 + y2)(3y - 3y + 2y) + 0y3 + 0y*3 + 2y*3 - 28y*3 - 3y*3 + 5y*3. -28y*3 Expand -5n3 + n3 + 0n3 + (-n2 - 3n*2 + 2n*2)(-3n - 3n + 5n) + 0n + 3n3 + 0n. n*3 Expand (5d + 2d - 6d)(3 + 0 - 2). d Expand ((-c - 2c + 4c)(c*2 + 5c*2 - 4c*2) + 0c*3 + 2c3 - c3 - 3c3 - c3 + 0c*3)(3c + 9c - 4c). -8c*4 Expand (6z*2 + 3z*2 - 5z*2)(-4z2 + 0z*2 + 3z*2) + (-6z + z + 2z)(-2z3 + 10 - 10). 2z*4 Expand (0b + b*3 + 0b)(-2b + 8b - 2b). 4b4 Expand (p + 1 + 6p*2 - 1)(-2p + 5p - 4p). -6p3 - p2 Expand (-15 + 15 + 15s)(-s + 0 + 0) + (s - 2s + 0s)(0 + 0 + s) + 3s2 + s2 - 2s2 + (-s + 0s + 0s)(-s + 4s - 5s). -12s2 Expand (3b - 1 + 1)(0 + 1 + 1). 6b Expand (1 - 3p2 - 1)(-2p2 - p2 - 5p2) + p2 - p*2 - 2p*4. 22p*4 Expand (5g - 3g - 4g)(g - 3g + g) + g*2 + 3g*2 - 5g*2 + 4g + 4g + 3g + g*2 - 2g*2 - 5g2 + g2. -4g2 + 11g Expand (-2 + 4 - 5)(1 - 2r - 1). 6r Expand (0d + 0d - d3)(-3 + 4 - 3 + (0 - 4 + 2)(1 + 1 + 0) + 1 + 3 - 5). 7d3 Expand (h - h + h3)(-130h*2 + 142h - 142h). -130h5 Expand (0 + 0 + g5)(-6 + 5 + 2) + (-1 + 1 - 2g*2)(g*3 - 2g3 - g3) + 2g5 + 2g*5 - 2g*5 - 2g*5 - 3 + 3 + 2g*5 - 3g*5 + 2g*5. 6g*5 Expand (3x*2 + 2x*2 - 4x*2)(1 - 1 - x*2) + 4x*4 - 6x4 + x4 + 4x - 4x - 2x4. -4x*4 Expand (2o + 3o - 6o)(-o + 32 - 15 - 21). o2 + 4o Expand (g - 2g + 3g)(7g + 46 - 46)(-3g*3 + 2g*3 - 5g*3). -84g*5 Expand (0v + 4v2 + 0v)(2 + 2 - 2) + (-4 + 4 - 2v*2)(-2 + 5 - 1) - v*2 + 3v2 - v2 - 2v2 + 0v + 0v + 2v*2 + v - v. 5v*2 Expand -1 + 1 + 2h*4 + (-h + 0 + 0)(-h*3 - 1 + 1) + (-2h + 3h + 10h)(0h + 0h + h)(-h*2 - h + h). -8h*4 Expand -3b*5 + 4b5 + b5 + (2b3 + 0b*3 - 3b*3)(-3b2 - 7b*2 + 2b*2). 10b*5 Expand (-2d - d*2 + 2d)(-4d + 3d + 3d) + ((5d2 - 16d + 16d)(-2 - 2 + 6) + 5d2 - 4d*2 + 0d*2)(7 - 7 + 2d). 20d*3 Expand (-2 + 2 - 3k)(3 + 0 - 1)(-3 + 1 + 0)(24 - 24 - k). -12k*2 Expand (2s + 0s + s)(-3 + 3 - s*2 + (-1 - 2s + 1)(0 + 0 + 2s) + 1 + 2s2 - 1 + 0s*2 - 2s2 + s2). -12s3 Expand 3u + 0u - 5 - 4u + (-4 - 2 + 3)(-3u + u + 0u). 5u - 5 Expand 2 - 2 + 2o3 + (-o2 + 2 - 2)(-19 + 19 + 4o). -2o3 Expand (-u - u2 + u)(0 - 5 + 1)(2 - 3u - 2). -12u*3 Expand 3l - 4l + 5l + (-3l + 2l + 2l)(8 - 6 + 6). 12l Expand f - 3f + 4f + (4 - 4 - 4)(-4f + 2f + 3f). -2f Expand (-1 + 3a + 1)(-a*4 + 3a*4 - 4a*4) + (-2a*4 - 3a*4 - 6a*4)(0a + 2a - 3a). 5a5 Expand m4 + m4 + m4 + (3m - 6m + m)(-4m*3 + 4m3 + m3) + (-4m - 2m + 4m)(0m3 - m3 + 2m3). -m4 Expand (0d2 + d2 - 2d*2 + (0 + 2d*2 + 0)(4 + 2 - 4) + 4d2 - 5d*2 + 2d*2)(d*3 - 5d*3 + 5d*3). 4d*5 Expand (-3 - 3 + 3)(-4o + 4 - 4) + 0o + 2o + 2o. 16o Expand (0 + 0 - 3)(0z3 + 0z*3 - 2z*3) + 0z*3 + 3z*3 - 4z*3 - 1 + 2z*2. 5z*3 + 2z*2 - 1 Expand (-4 + 6 + 7)(2u3 - 2u*2 + 2u*2) + 4u3 - u3 - 2u3. 19u*3 Expand 5p*3 - 2p*4 - 5p*3 + (3p*2 + 3p*2 - 2p*2)(2p + p - 2p)(2p - 1 + 1). 6p4 Expand (5l - 2l - l)(-4 + 48l - 16l - 10l) + l2 + 0l*2 - 3l*2. 42l*2 - 8l Expand (-1 - 2 - 5)(x + 2x*4 - x). -16x*4 Expand (-6w + 4w + 3w)(3 + w - 3)(3 - 5 - 1). -3w2 Expand (0 - 5 + 6 - k)(-5k2 - 2k*3 + 5k*2 + (3k - 4k - 3k)(-k2 + 0k*2 + 2k*2)). 6k*4 - 6k*3 Expand (0m + 0m + 2m)(0 - m2 + 0) + 5m*3 - 2m*3 - 4m*3 + (m + 5 - 5)(0 + 0 - 2m2). -5m*3 Expand (11 + 20 + 12)(5f2 - 3f*2 + 0f*2) + (-2 + 3 + 0)(-f*2 - 4 + 4) - 3f - f*2 + 3f. 84f2 Expand 4545 - 4545 - 63b*2 + (0b - 4b + 2b)(5b + 0b - 4b). -65b2 Expand (4g + 1 + 2g3 - 2g - 2)(298 + 67g - 298). 134g4 + 134g*2 - 67g Expand (u*2 - 2 + 2)(209 + 2u3 - 8u*3 - 208). -6u5 + u2 Expand 0u - 2u + 4u + (-3 + 3 + 2)(-2 + 2 - 2u) - 3 + 3u + u - 7u. -5u - 3 Expand (2v + 0v - v)((-3 - 2 + 6)(-2 + 2 - v) + 3v - 2v - 2v). -2v*2 Expand ((-5 - 2g + 5)(2g + g - 5g) - 4g*2 + 3g2 - g2)(-g - 2g + 2g)(-3 + 2 - 1). 4g3 Expand -t2 + 2t*2 + 0t*2 + (-2t - 3 + 3)(3t - 4t + 0t) + (2t2 - 2t*2 + 4t*2)(-3 + 5 - 1). 7t2 Expand (2g + 0g - g)(-10g + 10g - 7g2). -7g3 Expand (-j2 + 0j2 - j3 + 4j*3 + 1)(-2j + 2j + 7j). 21j*4 - 7j*3 + 7j Expand (7 + 8q2 - 7)(q - 5q + 3q). -8q3 Expand x + 4x - 4x + 3x - 4x + 5x + (-2x - 4x + 4x)(2 - 7 + 3). 9x Expand (-3 - 2 + 2)((-2g + 2g - 2g)(-2g2 - 2g2 - g2) - 6g3 + 7g*2 - 7g*2). -12g*3 Expand -3o3 - o3 + 2o3 + (65o*3 + 10352o*2 - 10352o*2)(-1 + 5 - 5). -67o3 Expand (2s - s - 2s)(0 + 23s + 0)(2s + 2s*3 - 4 + 4). -46s*5 - 46s*3 Expand (-6l*3 + 3l*3 - 8l*3)(l + 0l + 0l) + 0l4 - 4l*4 + 2l*4 + 4l*4 + 0l*4 - 2l*4. -11l*4 Expand (-2p - p + 0p)(-p*2 + 3p - 3p) + (3p*2 - 6p + 2p + 5p)(0p + p + p). 9p3 + 2p*2 Expand (-3m3 + m3 + 4m3)(-114m2 + 59m*2 - 4m + 1 + 59m2). 8m*5 - 8m*4 + 2m*3 Expand (3 + 2 + 1)((-2t2 + 5t2 - t2)(0 - 2t + 0) - 4t + 4t - 2t3)(-3 - 1 + 2). 72t3 Expand (-4p*3 + p - p)(2 - 2 - 3)(-5p + 3p + 0p). -24p4 Expand -4l - 2l5 + 4l + (2l2 - 8l*2 + 0l*2)(l*3 - 2l*3 + 4l*3). -20l*5 Expand (2 - 1 + 1)(-2v + 0v + 0v)(-3v4 + 0v*3 + 0v3) - v5 + v*5 + 2v*5. 14v*5 Expand -2i*2 + 2i2 - i2 + (-4i - 2 + 0i + 2i)(1 - 6i - 1). 11i*2 + 12i Expand (7 - 2 - 3)(-3x + 0x + x)(3 - 3 + 2x). -8x*2 Expand (2x - 2x + 2x)(-7x*2 + 5 - 5)(-2 - 1 + 6) - 5x3 + 5x*3 + 2x*3. -40x*3 Expand (-6 - 2 + 4)(-o - o + 5o). -12o Expand (v*3 + 0v3 + v3)(0 + 0 + 1) + v + 4v + 0v + 2v*3. 4v*3 + 5v Expand (0 + 4 + 4)(-4 + 1 + 2)(5y + 0y - 2y). -24y Expand (3 - 1 - 3)(-2y + 4 - 4) - 4y + 4y + y + (-y + 0 + 0)(-2 - 4 + 2). 7y Expand (-4q2 + 3q2 - q2)(-5q*3 + 4q*3 + 2q*3 + (-2q + 0q + 4q)(2q*2 + 0q*2 - 4q*2)). 6q*5 Expand (-2u - 2u + 3u)(-12u - u - u). 14u2 Expand (-1 + 3l + 3 + 0l)(-2 + 5l2 + 2). 15l*3 + 10l*2 Expand (1 + 8 - 1)(3 - 5 + 1)(-4 + 1 + 1)(7r + r + 4r). 192r Expand 5p3 - p3 - 6p3 - 2 - 2p*3 + 2 + (-2 + 2 - 1)(0p2 + 0p2 - p3) - 2 - p*3 + 2 + 5p*3 - 3p3 - p3 - 9p3 + 0p3 - p3. -13p3 Expand (-21 + 43 - 9o - 23)(4o*2 - 2o*2 + 0o*2). -18o*3 - 2o*2 Expand (1 + 3 - 5)(-4 + 11 + 2)(w - 1 + 1) + (-2w + 3w - 2w)(2 - 1 - 3) - w + 3w - 3w. -8w Expand (0b + 0b - b)(-2b + 0b + b). b2 Expand (-b2 + 37b - 37b + 8b*4)(-5 + 2 + 1). -16b4 + 2b*2 Expand (o - 4o + o + (0 + 1 + 0)(2o - 2o - 2o) - 5 + 5 + 2o)(0o3 + 0o3 + o3). -2o4 Expand (-142v - 155v + 141v)((1 - 2v - 1)(-2 + 1 - 1) + 0v - v + 2*v).	{ "pile_set_name": "DM Mathematics" }
25/3)t))(-1/3))41)(2/19))26 assuming t is positive. t(53300/171) Simplify ((mm*(2/7)mm)/m)11/((m(-2)m)/m*7)((m/(m(-2)/m))45)(-12) assuming m is positive. m(-14888/7) Simplify (w*(-12/11)/(w(w/(w*12ww))/ww))*(-41)/(w/((w/(ww*(-3))wwww)/w)ww(1/10)ww(-1/7)w0/w) assuming w is positive. w(-341287/770) Simplify (s*(-2/3)s)(4/19)/(s1)*(-30/7)((s/s(2/3))(5/3))28 assuming s is positive. s(23834/1197) Simplify ((((a/(a5/a))/(a(-1/4)/a))/(a(-2/5))(-3/10))(-2/13))(12/5) assuming a is positive. a*(1122/1625) Simplify (p/((ppp/(pp*31))/p))/(ppp/p(-21)ppp)pp/(p/p*(21/5))pp/(p(-12/13)pp) assuming p is positive. p(658/65) Simplify (n15/nn((nn*(6/7)n)/n)/n)*(-2/27)(n(-9)/(n(4/5)/n))/(n/n*(4/5)n(2/7)) assuming n is positive. n(-659/63) Simplify ((n/(n/(n*(-2/17)/n))n/(nnn/(n*(-2/3)n)n)(n/(nnnn(-14)))/(nn(-5)))(-1))(-4/19) assuming n is positive. n(2492/969) Simplify (((ss(1/5))/(s/(ss*(-3)))(s*(-1)s)(-31))(-44/7))(-48) assuming s is positive. s(-19008/35) Simplify (((q/(q/q*(-2))q)/q)(3/17))(-14)((((q/(q/(qq/q*(-1/7))))/qq)/q)(-8))23 assuming q is positive. q(-24436/119) Simplify (((b0b)/b)14(b/((b*(-2/5)b)/b))/b(1/5))/((b(6/5)/bb(-7))/(b(1/6)/(bb(-1/7)))) assuming b is positive. b(307/42) Simplify ((ggg(-4))/(g/g(-3/5))gg*(-1/6)gg(g*4g)/g)/(g*10g4)(2/61) assuming g is positive. g(5077/1830) Simplify ((n(2/5))*(-1/19)(nn(-8)n)/(n*(4/9)n))/((n/n(-2/11))(-3/11))(-12/5) assuming n is positive. n(-852371/103455) Simplify ((ww7w6)/(w(-6/5)/(ww/w(-3/4)ww)))(-3/14) assuming w is positive. w(-171/40) Simplify ((qq(-26))(-2/91)q26q/(q/(qq7q)q))(6/19) assuming q is positive. q(18864/1729) Simplify ((x(1/3)/xxxx(16/3))/((x/x(-11))/xx)(5/7))(2/61) assuming x is positive. x(-80/1281) Simplify ((j6)(1/35)j*(-19)jjj21)(-1/3) assuming j is positive. j*(-146/105) Simplify (((qq2)(2/17)(q/(q/(q(-6/11)q)))/q6)(12/13))(-4/17) assuming q is positive. q(46608/41327) Simplify aa(-6/5)a((aa*10)/a)/aaa(a/(a/(aa(1/42)/a)))/aa(27/2) assuming a is positive. a(2554/105) Simplify (p/p*1)/(ppp/p(-7))p/(p/(p/p*(2/3)))p*2(p/p(1/2))5/((pp(1/8)p)/(pp5)) assuming p is positive. p(-31/24) Simplify ((g(-1))(-1/73)(g/(g/(g/g*(-5/4))))/(gg/(g/((gg/(gg/(g*4/gg)))/g)g)))/((g0)(10/3)/(g(-2/3)g*(1/7)gg)) assuming g is positive. g(4537/6132) Simplify ((k/k(2/55)k(-31))/(k/(k/k(-2)))(-16))(4/9) assuming k is positive. k*(-13648/495) Simplify (ff*(-4/5)ffff/(f/((f/(f4/f))/f))fff*(-4)ff/(ff*(-1/6)/f)f)/(((f*7ff)/f(-2))/(((ff5)/f)/f(-1/5))) assuming f is positive. f(-133/30) Simplify ((f(-5)f)(2/13)(((f(f(-1/3)f)/f)/ff)/f)(-1/7))(2/15) assuming f is positive. f(-62/819) Simplify (l(1/6)(l/l5)/l)(-42)(l(-1/3)l)(-17)/(l(1/3))(-50) assuming l is positive. l(625/3) Simplify (o*(2/3)/oo)*(-2/7)(o1/o)24(o/o(-3))/(o/(o4/o))(o(o/(ooo/o(-1)))/oo)(-2/3) assuming o is positive. o(50/7) Simplify (v*7v)(-2/25)/(v18)39 assuming v is positive. v(-17566/25) Simplify (lll*(3/10))/(l/(l/(l(l/l*36)/l))l)l(-14)l(-41) assuming l is positive. l(-187/10) Simplify j(-31/5)/(j/j11)(j/(j28j))/(j*(2/65)j) assuming j is positive. j*(-328/13) Simplify (((((kk(-1/3))/k)(-26))(-21/5))(-12))2 assuming k is positive. k(4368/5) Simplify ((((i/((i*1i)/i))/i)/i)(9/5))48/(((i(-1/4)/i)/(i/i(3/4)i))/((i(-2/5)/i)/i)(2/7)) assuming i is positive. i(-11969/70) Simplify ((mmm/m(2/5)m)(-37))(1/11)/((m(-2/3))41)44 assuming m is positive. m(196442/165) Simplify ((k(1/3))(-38))(-19)/((k/(k(2/11)/k)k)/k(-4)(k*1k)(-28)) assuming k is positive. k(9565/33) Simplify (c(1/2)/((c(-4)/c)/c)c(1/3)c(2/3)/c)/((c5/c)/c(2/17))(-13) assuming c is positive. c(1937/34) Simplify ((x20x)30/(x/(x/(x(-1/28)x))xx31))(-4/3) assuming x is positive. x*(-16717/21) Simplify ((f(f/(f/(f/f*(4/7))))/ff/((f*(3/7)f)/f))/(ff6)(1/34))2 assuming f is positive. f(27/17) Simplify ((l/(l/l(1/23)))/(l/((l/((((l/(ll*(-10/3)/l))/l)/l)/l))/l))(lll(-23))/((l/(l/(l/l(-9))))/l))(-25) assuming l is positive. l(55700/69) Simplify ((xx/(x(-1)/x))27/(x(6/5)(x(x/(xx*(1/3)x))/x)/xx))/(xx/x*(-5)x*(-10)x)(-41) assuming x is positive. x(392/15) Simplify ((yy0yyyy)(-31)/(y/(y3y)y(-2/15)))/(y0/(y/(yy*(3/5)y))(y/(yy*1y))32) assuming y is positive. y(-1342/15) Simplify ((((y(-2/9))(3/23))26)21)9 assuming y is positive. y(-3276/23) Simplify ((i(-2)/(i4/i))/((i*1/ii)/i)*35)/(ii*(-3/2)/ii*(1/2)ii(3/7)ii/(i/i(-1/5))i) assuming i is positive. i*(-253/35) Simplify ((yyy(-6)y)/((yy4/yy)/y))(-31/2)/((y(1/4))18/(y(2/7))(-6/13)) assuming y is positive. y(9452/91) Simplify (bb(-1/4)b/(bb/(b(-1/5)bb)b)(b(3/2))(-40))19 assuming b is positive. b(-22591/20) Simplify ((((mm*(-14)m)/(m/(mm11)))39)(-45/4))(-1/16) assuming m is positive. m(-1755/64) Simplify (fff(1/3)/fff(f/(f*3/f))/f(f/f6)/f(1/7))/((f/f(2/3))(-11))(1/16) assuming f is positive. f(-401/112) Simplify (((o18/((o(9/2)/oo)/o))(-2/49))(-40))(15/7) assuming o is positive. o(17400/343) Simplify ((c(-29)/c20)/(c0cc5c))15 assuming c is positive. c(-840) Simplify ((l/(ll(-10/11)))/l5)/(l4/(l/(ll/l(-14/3)))) assuming l is positive. l(-454/33) Simplify ((((u((u/u2u)/u)/u)/uu(-1/3))(-6/11))(-2/91))(-10) assuming u is positive. u(40/143) Simplify ((t/(t/t(4/9))(t(1/22)/t)/t)/(t/(t0t)t(tt*(-6/13))/tt))(3/29) assuming t is positive. t(-7847/24882) Simplify ((w(-2))(-23))*22(w1)(-3/8)/(www*(-5/2)ww(6/11)) assuming w is positive. w(88931/88) Simplify ((j(-2/5))(1/21)/(j(-2))(5/4))/((j/j(-7))/j(4/5))(-41) assuming j is positive. j(62513/210) Simplify (((nn5)/n)(-3/10)/(n/(nn7)n/(nn0/nn)n))15 assuming n is positive. n(135/2) Simplify (((ff/(f*(-1/8)f))/f)/ff/(f/f(-1)))41/(f(-5)/(ff*(1/6)f))28 assuming f is positive. f(2971/24) Simplify ((o/(o/((o*(2/3)/o)/o))o*(-5))/(o/((oo(2/3))/o))(-11/6))/((oo(3/4)(oo/o(-8))/o)/((o/(o/o(1/2)))/o)30) assuming o is positive. o(-1133/36) Simplify ((n/n(2/17)n(-2/13))/(n11/(n*(-8/5)nn)))(10/11) assuming n is positive. n(-21816/2431) Simplify (g/(gg*(3/4))(g*(-6/13)g)/g(gg(3/7))(-39))(-2/31) assuming g is positive. g(20721/5642) Simplify ((l/l(-2/5))31/(l0)(-18))/((l(-1/5)/l)/(l(-2/7)/l))(-3/35) assuming l is positive. l(53174/1225) Simplify ((r/(((r*(-16)r)/r)/r))*(-1/8)/(rr/(rrr/(r/((r/((r/(((r/r(1/8))/r)/r))/r))/r))))(4/7))(1/4) assuming r is positive. r(-81/112) Simplify (((x/((xxx*(2/13))/xx))/xx)/(xx0))39(xx*6xxx(2/7))/((x/(x3x))/x(-3/7)) assuming x is positive. x(-505/7) Simplify (b/(bb*27)b)(-11)/((b/b(3/16))/(bb(-28)b)) assuming b is positive. b(4147/16) Simplify (z/(z/z29)z)/z(-2/101)z/(z*(-33)zz)(zz/(z/(zz/z*(2/17))z)z)/z assuming z is positive. z(109720/1717) Simplify ((b(10/3)/bbb(-18))/((bb*11b)/b)(-2/97))(-35) assuming b is positive. b*(146860/291) Simplify oo*15o*21(o/o40)17 assuming o is positive. o(-626) Simplify (((m/(m9m))/m)/(mm*(-2)/m)m(-7)/m(2/7))/(((m/(m*(-9)/m))/m)/(mm*(-11)/mm))(-3/13) assuming m is positive. m(-971/91) Simplify ((f(-7))26/(f*(2/65)f/f0))39 assuming f is positive. f(-35691/5) Simplify (w(-1/4))(1/32)/(w(-5)ww/((ww/(ww*(-2/27)))/www)) assuming w is positive. w(17509/3456) Simplify ((o(2/23)/oo(-2/23))/(o(2/75)/(ooo(-8)/o)))(17/6) assuming o is positive. o*(-5117/225) Simplify ((tt*(-4)t/(t/(((t/t*4tt)/tt)/t)))/((t*(-5)t)/tt/(t3t)))/((((tt*(-1/	{ "pile_set_name": "DM Mathematics" }
49 for l. 1 Solve -o - 1316 + 1276 = -9o, 0 = 2p + 5o - 4o - 47 for p. 21 Solve -b - 16842 = 18s - 16869, 0 = 5b - 5s - 40 for b. 9 Solve 3b = 125y + 148 - 633 + 68, 5b + 2y + 64 = 0 for b. -14 Solve 3r + 0q - q + 26 = 6r, 0q - 802 = r - 25q for r. -2 Solve -4z = -2h + 46, 5h + 95 = 30666z - 30671z for h. -5 Solve -34s + 2c + 23 = -s + 2s + 208 + 159, 8s - 4c = -68 for s. -10 Solve -3x - 5524z + 5529z = 43, -3x + x - z - 2z = -22 for x. -1 Solve -213m + 211m - 146 + 145 = -o, -87 = 36m + 5o for m. -2 Solve -3j + 2a - 66 = -0j - 71, 5a + 8 = -63j + 66j for j. 1 Solve 5q + 6g = 175, -1103q + 4g - 145 = -1112q for q. 5 Solve -36 = 5o + 3s, -29250s = -6o - 29251s - 38 for o. -6 Solve 3m + 321 = 3k, 224 = -26043k + 26045k + 3m for k. 109 Solve 2s + 13 + 8 = -3j, 15617s - 4j = 15618s + 3 for s. -15 Solve -u - 56 + 96 = -4l + 63, -3l - 5u + 23 = 0 for l. 6 Solve -30i + 0p + 36 = 2p, 3p - 133 + 127 = 3i for i. 1 Solve -26 = -3o + 6o - 5m, -25 = -2o - 96m + 57 for o. -7 Solve -630l - 24 = -632l - 7k, 2l = 13l + 4k - 63 for l. 5 Solve 3h - 2i = 34100 - 34109, -4h = -i + 2 for h. 1 Solve -2y + 13 = 7n, -2n + 113y = 119y + 18 for n. 3 Solve -4s - 77 = -9u, 1433u = 1435u - 2 for s. -17 Solve 5d + 2m + 30 = 0, 95186d - 2m - 26 = 95190d for d. -4 Solve -21y + 18y - 159 = -8u, 12y - 13y = -u + 18 for y. 3 Solve -2w - 3g = -2g, 5w + 0w - 40g = 473g - 466 + 1497 for w. 1 Solve 0 = -2n - 16467w + 16465w - 10, 2w + 34 = -5n for n. -8 Solve -n + 2s = -5n - 0n + 138, 3n + 256s = 42s - 534 for n. 36 Solve -95426r - 4 = -95430r - 2k - 0, -3r + 25 = -4k for r. 3 Solve 12 = -20v + 17v, -4t = -199v - 736 for t. -15 Solve -37y = -9l - 33y + 88, -3l + 4y = -16 for l. 12 Solve 117g - 121g = -2p - 34, 7p + 5g = -24 for p. -7 Solve 5 = d, -8r + 12r = -3r - 3d + 15 for r. 0 Solve 8p - 37p - 2l - 2l - 821 = -80, -4p = -24l + 25l + 104 for p. -25 Solve 0 = -5i - 5w - 68 - 32, -6i + 168 = -4i - 11w for i. -4 Solve -2j = 2s - 8, -4j - 121240s - 20 = -121245s for j. 0 Solve -4h = -2j + 18 + 84, 7j + 137 = -2h + 10j for h. -4 Solve 25f = -5d - 895, 154 = -5d - 2f + 87 for d. 1 Solve -5k = -l + 68, -3l + 7k - 140685 = -140873 for l. 58 Solve -h - h + 45t + 470 = -7h, -60 = 2h + 3h + 4t for h. -4 Solve 29u + 30u + 33u = 65u + 4k + 394, -40 = -4u - 4k for u. 14 Solve -115h = -4n + 14364 - 13737, 2h + n = 3 for h. -5 Solve 66 = 5y + 11, -6c - 6c - 2y = -14c - 22 for c. 0 Solve -20d + 82b + 300 = 78b, b - 11 = 6b - 10 + 24 for d. 14 Solve 3d + 16d - 34 = 2p + 17d, 0 = 39p - 2d - 77 for p. 3 Solve -10l + 35l - 14l - 6l = 5o + 9l + 26, 8o = -5l - 43 for o. -6 Solve -2n = -5x + 23, 13887x = 13883x + 3n - 4n - 18 for x. -1 Solve 3k + 360 = -11n, 3n - 4k + 8k + 397 = 302 for n. -33 Solve 3q - 37 = 5t, -39q + 12q + 31q + 24t = -196 for q. -1 Solve u - 54 = 2j, -9639j = -9649j - 4u - 288 for j. -28 Solve -62 = 5l - p - p, 22l - 2p + 96 = -0l for l. -2 Solve 360l - 363l + 4r + 16 = 0, -l - 8 = -4r for l. 12 Solve 0 = -126b + 124b + o - 115, b + 7o + 65 = 0 for b. -58 Solve 4r - 88 = -12p + 14p, -6p - 277 = r for r. -1 Solve 2i - 4i - 4f = 18 + 68, -2f = 2i + 82 for i. -39 Solve -72g + 21g = 255, -2a + 0 + 5 + 7 = -2g for a. 1 Solve 47o - 63 - 241 = 5s, 4s - 783o = -782o + 13 for s. 5 Solve -206m + 207m + 7 = 11d, 4m = -6d + 4d + 3m - 7 for d. 0 Solve -6t = -35443p + 35442p - 5, 0 = -5t + 3p + 15 for t. 0 Solve 0 = -4i - 5z - 94, -152593i + 152598i - 4z + 138 = 0 for i. -26 Solve m + 45 = y + 14m, 2y - 222 + 198 = 3m - 7m for y. 6 Solve 16z = -5a - 28 - 42, -8z - 42 = 126a - 127a for z. -5 Solve x + 123l - 646 = 484l + 809, 1 = -l - 3 for x. 11 Solve 123m + 125 = -4p + 124m, 30m = p + 180 for p. -30 Solve v - 13 = 0, 755971z - 755966z - 16 = -2v for z. -2 Solve 2o + o - 11 = 4, 130 + 45 = -5s - 3o for s. -38 Solve 3z + 24d + 90 = 0, -7620d + 7617d = -5z + 22 for z. 2 Solve 0 = -28f + m - 391, -10 = -472f + 467f + 6m - 74 for f. -14 Solve 105 = -5p - 7r, -5r = 2076p - 2075p + 75 for p. 0 Solve 20r - 9y - 22 = -14y - 7, 0 = 4y + 430 - 490 for r. -3 Solve 2i = -h + 21, 4h - 3h + h + 3i = 32 for h. 1 Solve -2o - 32r = -34, -4o - 3r + 28287 = 28219 for o. 17 Solve -566w + 569w + 4n - 8 = 0, 4w + 4n = 4 for w. -4 Solve 5o + 114 = -4v, -3o + 375v - 110 = 379v for o. -2 Solve -6t + 3t - 4o + 1010 = 911, t - 33 = -14o - 32o for t. 33 Solve -82j + 5s - 39 = -84j + 2s - 15, 93s - 186 = 0 for j. 9 Solve 163x = 168x + 2k - 81, 21k - 690 = x for x. 3 Solve 130948v + 3 = 130947v - g, -5v - 12 = 4g for v. 0 Solve -5p - 8h + 13h - 225 = 0, -24p + 4p - 5h + 300 = 0 for p. 3 Solve 0 = -62y + 2c - 1110 + 1180, 0 = 4y + y + 3c + 7 for y. 1 Solve d - 134y = d - 65y - 70y - 1, -3y - 11 = 4d for d. -2 Solve -5y = 3c - 78, 2c + 17962y - 18007y = -93 for c. 21 Solve -3653y - 9 = 2q - 3657y + 5, -10q - 33 + 9 = 3y for q. -3 Solve 0 = -2p + 2z + 8, 0 = 58p - 53p + 21z - 20 for p. 4 Solve 0 = -322j + 324j + z - 59, 4j - 3z - 113 = 0 for j. 29 Solve -3z = -5q - 1, 321z - 3q - 380 = -82z - 226z + 875 for z. 2 Solve 0 = 4g + 8045002u - 8045000u - 2, 5g + 20 = 2u for g. -2 Solve z = 3l - 134, 1023l - 1025l - 2z + 92 = 0 for l. 45 Solve d + 4321r - 4318r + 9 = 0, -10r - 32 = d + 3d for d. -3 Solve -2m = 1879u - 1883u - 34, 114 = u + 24m for u. -6 Solve -5k = -d - 0k + 11 + 17, 5k + 34 = 620d - 617d for d. 3 Solve -4h + 45 = o, h = -215691o + 215696o - 15 for o. 5 Solve -1088 + 1058 = f - 2f - 3g, 4f + 50g - 46g - 88 = 0 for f. 18 Solve -2r + y + 1 = 0, -50502r + 50503r - 5 = -y for r. 2 Solve -18 = -39927u + 39917u + 42t, -3t + 33 = -u - 2u for u. -15 Solve -5v - 222 = -2p, 71v - 140v + 66v - 158 = 5p for v. -46 Solve -2w = -2r - 124, 4r = -944w + 945w - 71 for w. 59 Solve -2a = -3j - 27, 88j + 9j + 451 + 622 = -2a for a. -3 Solve -183k + v - 26 = -186k, -8 = 3k - v for k. 3 Solve -98y + 3c - 2c = -86y + 58, 4c - 44 = -y + 2y for y. -4 Solve 9l = 11l - 5v + 97, 4v = 19l + 17l + 15l - 51l + 76 for l. -1 Solve 4r - o = -14, 21o + 70 = -5r + 27o - 3o for r. 4 Solve u = q + 273 - 275, 3u + 2u + 2q - 4 = 0 for u. 0 Solve 0 = 2u + a - 24, -u - 918838a + 918851a - 15 = 0 for u. 11 Solve -3v - 4z = v - 32, 14z + 32 = 5v + 15z for v. 6 Solve i + 10b - 2 - 161 = 0, -5i + 631b = 626b + 65 for i. 3 Solve -r - 30 = -9q, -269337q - 21 = -269342q + 2r for q. 3 Solve 4u + 3d - 1782 = -1768, 4u - 1256 = -624d for u. 2 Solve 0 = -64w - 123w - 5l + 71, -159 = -0l + 2l + 37 for w. 3 Solve -5n = -5m + 90, -1600m + 1603m + 72 = -4n for n. -18 Solve 3t + 33 = -35f + 40f + 38 + 47, 20t = f - 9 for t. -1 Solve 2i + 5x = -3, 5i + 156969 = -3x + 157009 for i. 11 Solve -9i + 69 - 45 = -8i - 2o, -42 = -5i + 4o for i. -2 Solve 54092s - 54092s - v + 2 - 4 = 0, -s - v = 0 for s. 2 Solve 0 = 722h - 364h - 360h + 6, 36 = -6p - 4h for p. -8 Solve 0 = -10s + 5r - 950, 463s - 459s + r = -386 for s. -96 Solve -12f = -25a + 20a, 3a - 2f = 0 for a. 0 Solve 4f - 4q + 171499 - 171487 = 0, -5f = -4q + 7 for f. 5 Solve -o + 5u - 8 = 0, -24u = o - 25u + 1 + 3 for o. -3 Solve 2n + 3p + 8p + 221 = 899, -4p + 147 + 95 = 3n for n. -2 Solve -9v - 14v + 5k - 73 = 0, 2k - 16k + 555 = -5v + 48k - 7k for v. -1 Solve 5l + 35 = 8p, -4l - 23431 = -2p - 23403 for p. 0 Solve -4c + 4n - 52 = 0, 64n + 4286 = -5c + 12n + 5076 for c. 2 Solve 5248u - 4n = 5244u - 20, 2u + 5n = 53 for u. 4 Solve 20f - 25f - a = -13, -85 = 2f - 19a - 32 for f. 2 Solve -4b + 94 = -61y + 338, 5b - 2 + 7 = 2y - 3 for y. 4 Solve 11y + 501 = -2m, -m + 2y + 56 = -31 for m. -3 Solve -38 + 283 = -5z - 55, -13668 = 3m + 228z for m. 4 Solve 3c - 15 = -15 - 15, -4c - 7 = 4h + c - 2c for h. 2 Solve -5m + 0d - 4d - 183 + 281 = 0, -36 = 4m - 2d for m. 2 Solve 2a = 7a - 4 + 9, 5a = 3d + 43 for d. -16 Solve -3 = -t + 19, u - 45 = -2t for u	{ "pile_set_name": "DM Mathematics" }
6q2 - 1314852q Find the third derivative of 56735d5 + 6d*4 - 10d*3 - 97243554d*2. 3404100d*2 + 144d - 60 What is the first derivative of -12r3 + r2 + 990808r - 152968088? -36r2 + 2r + 990808 Differentiate -s*2 + 19562389s + 57141073 with respect to s. -2s + 19562389 Find the third derivative of 142842824j*5 - 649171j*2 - j - 5 wrt j. 8570569440j*2 What is the third derivative of -524814x*4 + 323x*2 - 671x? -12595536x Find the third derivative of -861k*2v*3 + 23k*2v + 2kv*3 + 2159kv2 + 1061v*3 - 2v*2 wrt v. -5166k*2 + 12k + 6366 Find the second derivative of 83052h5 + h3 + 5h + 276234 wrt h. 1661040h3 + 6h Differentiate 52417714ju*2 + 7u*2 + 165961 with respect to j. 52417714u*2 Differentiate 3a*3 + 1462228a - 211444 with respect to a. 9a2 + 1462228 Find the second derivative of b4 - 497977b*3 + 22b*2 - 37965647b. 12b2 - 2987862b + 44 What is the derivative of 317990795o - 223541711 wrt o? 317990795 What is the third derivative of 40104625t*3 + 9021939t*2 wrt t? 240627750 What is the first derivative of 5l*2u + 2l2 + 68847l + 18651724u wrt l? 10lu + 4l + 68847 Find the first derivative of 12819l4 - 2296l*3 + 144104567. 51276l*3 - 6888l*2 What is the first derivative of 5876h*4k + 9189h2k*2 + 1210469725k*2 wrt h? 23504h*3k + 18378hk*2 Differentiate 953k*2n + k*2 - kn - 852k + 145555147n with respect to k. 1906kn + 2k - n - 852 Differentiate -391429022c*2 - 277669954. -782858044c What is the second derivative of -2dm*5q + 3597482dm*3q - 166dm - 87964q wrt m? -40dm3q + 21584892dmq What is the derivative of 737273u*3y - 4u3 + 46383896y wrt u? 2211819u2y - 12u2 What is the second derivative of -18961784z*3 - 75840681z - 1? -113770704z What is the third derivative of -29595z5 + z4 - 764z3 - 12z*2 + 9815105 wrt z? -1775700z*2 + 24z - 4584 What is the derivative of -30773u2 + 7398986? -61546u What is the derivative of -386o4 - 188763o3 + o2 - 117258505 wrt o? -1544o3 - 566289o*2 + 2o What is the second derivative of 1874679h3 + 8h*2 - 51495367h wrt h? 11248074h + 16 Differentiate 1853f*4r + 335f3r*2 + 2r*2 + 1186760 wrt f. 7412f*3r + 1005f2r*2 Find the second derivative of 20241754c*4 - 4c - 1175231. 242901048c2 Find the third derivative of -52757048s*3 - 66461570s*2. -316542288 What is the second derivative of 575g*4p*2y + 778774g2py + 8gp2y - 3162gp*2 + gpy - 2gy + 3p*2 - 2 wrt g? 6900g*2p*2y + 1557548py Find the second derivative of -8d5p + 59903199d5 + 753297844dp wrt d. -160d*3p + 1198063980d3 Find the third derivative of -110b*3i*3 - 2b*3i*2 + 9101b*3 - 35212b*2i3 + b2i2 - bi*2 wrt i. -660b*3 - 211272b*2 Find the first derivative of 73i*3 - 4i*2 - 292031i - 463782026 wrt i. 219i2 - 8i - 292031 Find the second derivative of -1272880n4 + n3 + 1027685n + 1 wrt n. -15274560n2 + 6n What is the third derivative of 46583kn*3 - 947709kn2 + 508n*3 - 2n*2 wrt n? 279498k + 3048 Find the second derivative of -92ox*4 - 23879ox3 - 5657ox + 11o + 5x - 2 wrt x. -1104ox2 - 143274ox Find the first derivative of 6869427y*2 - 2y - 35742209. 13738854y - 2 Find the second derivative of -44488905b*2j*3 - 47777bj3 + 307bj wrt b. -88977810j*3 Find the second derivative of -30fm2 - 9fmw*2 + 2fmw + 4fw - 368538m2w*2 + 2mw2 + 141w*2 - 22 wrt m. -60f - 737076w2 Find the third derivative of 327g*6j + 3092g6 - 7669050g*2j - j wrt g. 39240g3j + 371040g3 Find the first derivative of 28iux + 223529368iu + 363140ix + 2ux wrt x. 28iu + 363140i + 2u Find the third derivative of 64182563o4 + o2 - 6069o - 1901 wrt o. 1540381512o Find the second derivative of 32008041r*3 - 112r + 32842. 192048246r What is the second derivative of -309721680i*2 + 568513007i? -619443360 What is the third derivative of -72931470b4q*3 - 2b*4 - 28b*2q*2 - 35q*3 + 12203q*2 wrt b? -1750355280bq3 - 48b Find the second derivative of 51928746o2 - 28670603o. 103857492 Find the second derivative of 2669670j2pu - j2p - j*2u + 9569jp + ju + 1 wrt j. 5339340pu - 2p - 2u What is the first derivative of -4by3 + 19590by + 176b - 98y3 - 500y*2 - 229 wrt b? -4y*3 + 19590y + 176 What is the second derivative of 426076212g2 - 126550874g wrt g? 852152424 Find the second derivative of -2u4 + 564u*3 - 84u*2 + 360019u - 7. -24u2 + 3384u - 168 What is the derivative of -3d2q + 3654dq*3 + 3dq2 + 3q*3 + 4q*2 + 4061q wrt d? -6dq + 3654q3 + 3q*2 What is the derivative of 13462583j + 3930545? 13462583 What is the derivative of 8571623km*2 + 13217806m*2 wrt k? 8571623m*2 Find the third derivative of -9074345r*3 - 133r*2 - 12r + 4. -54446070 Find the third derivative of -34252bsv3 + 41bsv*2 - 14bv3 + 365bv2 - 1720bv - 33sv3 wrt v. -205512bs - 84b - 198s Find the second derivative of 50ck2r - 2ckr + ck + 16321569c + 18k*2r - 63728k2 + kr wrt k. 100cr + 36r - 127456 What is the third derivative of -5k*3or3 + 17981916k*3r*3 - 20k*2or3 + 123481k*2or2 + 7r*3 wrt k? -30or3 + 107891496r*3 Find the first derivative of 70y*2 + 5093y - 35246275. 140y + 5093 Find the second derivative of -37365c*3 + 93c*2 + 13603108c. -224190c + 186 What is the derivative of 34275691n - 36065337 wrt n? 34275691 Find the first derivative of 5276005sw*2 + 1153w*2 - 4w - 29 wrt s. 5276005w2 What is the derivative of -509l*3 - 367571l + 787740060 wrt l? -1527l2 - 367571 What is the second derivative of 28882669v*2 + 2v - 3614647 wrt v? 57765338 What is the third derivative of 91708767r4 + 11052230r*2? 2201010408r What is the second derivative of 16u4 - u3 + 79890u*2 + 533u + 5184? 192u2 - 6u + 159780 What is the second derivative of -721925678t3 + 19470t + 7426? -4331554068t What is the first derivative of -6807899hq + 88239749q wrt h? -6807899q What is the second derivative of -790o*5 - 108329o*4 + 2327o - 2826? -15800o3 - 1299948o*2 Find the second derivative of 203fo3 + fo*2x*3 - 30fox*3 + 5fox - 221o2x*3 + 143ox2 wrt o. 1218fo + 2fx3 - 442x*3 Find the first derivative of -45958920jr - j - 20362489r wrt j. -45958920r - 1 Find the second derivative of -7508368h*3 + 450414h wrt h. -45050208h Differentiate 447216a*2 - 5a - 40649720 wrt a. 894432a - 5 Find the first derivative of -8bs - 17659b + 117381st*2 + 26t*2 wrt s. -8b + 117381t2 Find the third derivative of -1528497b*3n*2s*2 - 24b*3n*2 + 847b*2n*2s - b*2n - bn - 215bs2 + 32n*2s wrt b. -9170982n2s*2 - 144n*2 Differentiate 190002l*2 + 18l + 30860479. 380004l + 18 Find the second derivative of -54569285g*2 - 7g + 3360249 wrt g. -109138570 What is the second derivative of -3361477b3 + 48513529b wrt b? -20168862b What is the derivative of -102255y*3 + 28y + 3141903 wrt y? -306765y2 + 28 Find the second derivative of -56928314g*5 - 8074g + 6014 wrt g. -1138566280g3 What is the third derivative of 1331600b*2d3 - b2 + 801bd*2 + 2b - d*5 + 35d*2 wrt d? 7989600b*2 - 60d2 Find the third derivative of -j2k3 + 2j*2k*2 + 12j*2k + 89j2 + 12jk3 + j - 178916k*3 - 370k wrt k. -6j2 + 72j - 1073496 Differentiate -15p2 - 228357p + 70581715 with respect to p. -30p - 228357 What is the derivative of 1337tu3 + 3641tu2 + 1672u*3 - 1643 wrt t? 1337u*3 + 3641u*2 Differentiate -45227i*2k*2 - 73124939i*2 - 42ik4 with respect to k. -90454i*2k - 168ik*3 Find the second derivative of 87243298b*4 - 12129511b. 1046919576b2 What is the second derivative of 1248980035f*2 + 572482319f wrt f? 2497960070 Find the first derivative of 2d3i + 2d3 + d2i - 334603d2 + 15800722di2 + 3d + 2 wrt i. 2d3 + d2 + 31601444d*i Find the firs	{ "pile_set_name": "DM Mathematics" }
10 -10519642 Convert 101111001010111011001 (base 2) to base 10. 1545689 What is -68228 (base 9) in base 8? -130512 Convert -3303112130 (base 4) to base 10. -996764 -633939 (base 10) to base 7 -5250135 What is -10526553 (base 8) in base 15? -2ed57e Convert -714544 (base 10) to base 16. -ae730 What is -19849 (base 11) in base 7? -143405 What is 21112020222121 (base 3) in base 9? 7466877 -1381862 (base 12) to base 8 -16703612 What is -1400004340 (base 5) in base 6? -203210444 Convert 603648 (base 9) to base 2. 1010111001010010011 What is 21022222010 (base 3) in base 4? 203032332 -515325414 (base 6) to base 15 -bb866a -104442 (base 5) to base 10 -3747 What is -222506 (base 7) in base 3? -1222222112 3617238 (base 10) to base 13 9985a1 What is 15425f (base 16) in base 10? 1393247 What is -5b445c (base 15) in base 16? -42a76d 12120110211002 (base 3) to base 12 baa002 1133043442 (base 5) to base 4 22001212131 5064026 (base 8) to base 5 320243431 Convert 1512434021 (base 6) to base 3. 1022112110012111 3201670 (base 8) to base 12 351708 -c772 (base 13) to base 15 -82ca -2104020 (base 6) to base 2 -11000111001001100 24b76 (base 14) to base 13 31cc4 -12122220112120 (base 3) to base 7 -34403436 What is 12333020 (base 4) in base 12? 14688 What is -951345 (base 13) in base 11? -1a71a95 Convert -15746700 (base 8) to base 3. -20212210200002 What is 110021010021010 (base 3) in base 15? 88b16c What is 584198 (base 12) in base 14? 28c6a0 -1010000111110101101 (base 2) to base 10 -331693 What is 30203103 (base 7) in base 14? 49303a What is 197519 (base 10) in base 4? 300032033 771089 (base 15) to base 11 3225651 Convert 471203 (base 10) to base 13. 136625 -34044422 (base 5) to base 7 -2356412 Convert -10001001010110011011100 (base 2) to base 12. -16106a4 Convert -201242301 (base 5) to base 16. -c4c3f -9108d5 (base 14) to base 2 -10010100111100011001011 What is -35640014 (base 7) in base 10? -3169331 What is -106031 (base 9) in base 3? -10020001001 What is 2a6815 (base 13) in base 7? 11602040 What is -23541460 (base 7) in base 8? -7772255 Convert -20859b9 (base 12) to base 14. -b60701 Convert -444662 (base 7) to base 4. -103023032 What is 101002200101 (base 3) in base 12? 97054 Convert -3052531 (base 6) to base 2. -100011111010000111 What is 2baeb3 (base 15) in base 16? 203cb5 Convert -440505 (base 7) to base 13. -29115 What is -138012 (base 11) in base 12? -a4957 110100100101001011 (base 2) to base 8 644513 -236654 (base 8) to base 9 -133500 Convert 2013184 (base 9) to base 12. 4382b7 26b26a (base 12) to base 4 2130212302 -6462411 (base 7) to base 8 -3003702 What is -1257424 (base 9) in base 12? -292041 -42411040 (base 6) to base 15 -199166 57708 (base 13) to base 4 212322033 -51642 (base 7) to base 10 -12672 Convert 20368 (base 14) to base 9. 127284 Convert -10445145 (base 8) to base 6. -120100005 ca0a8 (base 15) to base 6 21425252 What is 46f59a (base 16) in base 4? 101233112122 Convert 81729a (base 15) to base 3. 102120110000001 -5121078 (base 10) to base 4 -103202100312 197517 (base 11) to base 2 1001001111010101000 What is -1213321424 (base 5) in base 14? -54a011 Convert 210d2b (base 14) to base 3. 2002201202110 What is 212121022200 (base 3) in base 15? 929dc Convert 143205015 (base 6) to base 2. 1011010001101011000011 What is -10122000202202 (base 3) in base 7? -22254230 Convert 2942336 (base 10) to base 16. 2ce580 What is -475314 (base 11) in base 5? -143104344 Convert -447135 (base 8) to base 15. -2eba8 What is -3872244 (base 10) in base 11? -2205302 Convert 501545345 (base 6) to base 16. 818c21 What is -10124005 (base 9) in base 4? -102202003031 161259 (base 12) to base 13 101aba What is 1284372 (base 9) in base 14? 145031 Convert 805f56 (base 16) to base 15. b12b29 Convert -25505202 (base 7) to base 3. -11100221001200 100001110010010110110001 (base 2) to base 6 513500401 -1621215 (base 9) to base 4 -3123222302 Convert -3515315 (base 7) to base 5. -103110012 What is 3020122020 (base 4) in base 16? c8688 -409f5e (base 16) to base 13 -b538a1 What is 15166 (base 8) in base 13? 3111 Convert -45023021 (base 6) to base 10. -1356277 What is -211210221200 (base 3) in base 2? -1101101101000000100 Convert 10010001001101110 (base 2) to base 12. 3703a What is -310212313 (base 4) in base 11? -137990 -1244831 (base 9) to base 15 -d646a What is 1022110300 (base 4) in base 7? 2405362 Convert 3526022 (base 7) to base 2. 1101100010111010010 -101322455 (base 6) to base 8 -6537343 Convert -1155224 (base 6) to base 7. -345664 Convert 3714277 (base 8) to base 10. 1022143 What is 32356771 (base 8) in base 6? 404412505 Convert -12875683 (base 9) to base 7. -105062460 Convert -1a4635 (base 14) to base 2. -11100100000100100111 What is -26aaa6 (base 16) in base 6? -130151422 What is 1122222210001 (base 3) in base 11? 555388 21200433 (base 5) to base 13 63190 -1562da (base 16) to base 14 -286ab8 What is -7080a (base 15) in base 14? -93b3b What is -11323022123 (base 4) in base 2? -101111011001010011011 120030201 (base 4) to base 8 301441 What is -482082 (base 11) in base 4? -2322202310 What is 103020300 (base 4) in base 13? 298a7 177ca14 (base 13) to base 8 35144742 2324446 (base 7) to base 5 33321443 261a35 (base 11) to base 2 1100100101101101111 -3122405 (base 6) to base 3 -21200000112 Convert 4562412 (base 10) to base 2. 10001011001110111101100 Convert badda (base 16) to base 12. 30ab36 -1122011201 (base 4) to base 11 -232259 3d1b2 (base 14) to base 13 53b14 What is -2587356 (base 11) in base 5? -2121201441 121012220100001 (base 3) to base 8 40702313 Convert -111100110001111 (base 2) to base 9. -46616 Convert -1772032 (base 8) to base 15. -a4697 Convert -26b21a1 (base 12) to base 8. -35270611 What is -227d6b (base 16) in base 10? -2260331 -1001011111010110110 (base 2) to base 15 -62211 What is 19b9 (base 14) in base 7? 16422 Convert 348914 (base 10) to base 15. 6d5ae What is -113644 (base 8) in base 10? -38820 -1001000001100111011001 (base 2) to base 3 -11110012102102 568eb (base 15) to base 9 458685 73288 (base 15) to base 5 43140303 4549569 (base 10) to base 13 c33a6b Convert 21a600 (base 11) to base 13. c3880 What is 44106 (base 8) in base 6? 221354 -1647452 (base 8) to base 11 -2a7991 What is 31031203023 (base 4) in base 5? 1341311441 Convert 3322102302 (base 4) to base 6. 33550150 Convert -2000001120 (base 3) to base 11. -27676 What is -24b17ab (base 12) in base 10? -7198259 What is -115057 (base 8) in base 15? -ba66 Convert 1e314 (base 15) to base 8. 300411 -40410 (base 7) to base 11 -7406 Convert -10100112132 (base 4) to base 16. -11059e 9472b (base 15) to base 4 1302323111 Convert 122211111021 (base 3) to base 9. 584437 What is 29ec9 (base 15) in base 16? 20f34 What is 132ab9 (base 12) in base 6? 10435153 What is 2333341 (base 5) in base 16? a7db What is 13b22a (base 12) in base 6? 11025254 -5125778 (base 9) to base 10 -2733659 Convert 1001110010100110110100 (base 2) to base 15. 35a705 Convert -3033781 (base 9) to base 13. -447c0a -1001110101101111011 (base 2) to base 13 -b39b1 Convert -d11e2 (base 15) to base 11. -412361 Convert -8671 (base 11) to base 4. -2302330 -75278 (base 12) to base 2 -100101101000111100 Convert 453885 (base 12) to base 14. 20ac05 Convert -2320011332 (base 4) to base 12. -304452 What is -96a03 (base 11) in base 12? -696b4 Convert 6bb6a (base 16) to base 7. 3515165 What is 120201121021022 (base 3) in base 5? 4114414303 Convert 38be04 (base 15) to base 11. 15a0152 Convert 2096925 (base 12) to base 7. 103306112 Convert 2004104011 (base 5) to base 7. 45523200 Convert 13946c (base 16) to base 7. 13623023 -2472760 (base 10) to base 2 -1001011011101100111000 -8246 (base 13) to base 2 -100011000110100 Convert -3ca8a (base 14) to base 6. -3115350 Convert -23552761 (base 8) to base 12. -1891b01 What is 1c181e (base 16) in base 4? 13001200132 4c6a6 (base 14) to base 7 1411566 98b02 (base 13) to base 4 1003200012 What is -156782 (base 9) in base 13? -35126 Convert -7206572 (base 8) to base 4. -13100311322 What is -111152620 (base 7) in base 13? -151aba5 -1030781 (base 9) to base 10 -551764 -222257 (base 9) to base 3 -20202021221 What is -39937 (base 14) in base 9? -235407 What is 364640 (base 14) in base 8? 7051260 Convert 151bd (base 15) to base 3. 1011001	{ "pile_set_name": "DM Mathematics" }
Suppose 20 = c + 3q, -c - 5q - 3 + 33 = 0. Let u = -2 + 1. Let m = u - -10. Calculate the remainder when m is divided by c. 4 Let l(x) = -6x + 3. Suppose -3s + 8 = s. Let c be l(s). Let h = c + 18. What is the remainder when h is divided by 5? 4 What is the remainder when 3 is divided by 24/(-30) - (-9)/5? 0 Suppose -3x + 48 = -0. Let y(f) = f2 - 3f + 2. Let w be y(2). What is the remainder when x is divided by 6 - 1/2w? 4 Let a = 22 + -1. What is the remainder when a is divided by (-1 - 1)/(-2)8? 5 Let b(s) = 37s2 - 1. Let m be b(1). Let a = m + -22. What is the remainder when 53 is divided by a? 11 Let k be ((-72)/(-10))/(12/(-90)). Calculate the remainder when 9 is divided by (2/(-6))/(3/k). 3 Let g = 66 + -23. What is the remainder when g is divided by 11? 10 Let d = 22 - 5. What is the remainder when 65 is divided by d? 14 Suppose 0 = -3q + q + 8. Suppose 0 = 8m - qm - 68. Calculate the remainder when 33 is divided by m. 16 Let s be (-60)/(-14) + 2/(-7). Suppose 0 = 2q - sy - 6, y - 63 = -5q - y. Calculate the remainder when q is divided by 3 - 5 - 6-1. 3 Suppose -u = -2s - 2s + 100, -u = -4. Let z = -36 + s. Calculate the remainder when z/(5/3 + -2) is divided by 16. 14 Let z(h) = -1 + 6h + 1. Suppose 4i + 70 = 134. What is the remainder when z(5) is divided by i? 14 Let d = 1 + 1. Let x = 13 - d. Calculate the remainder when ((-14)/21)/(1/(-48)) is divided by x. 10 Let x = -21 + 1. Let v = 73 + x. Let q = 50 + -32. What is the remainder when v is divided by q? 17 Let n = -2 + 9. Let x = 13 - n. Calculate the remainder when 17 is divided by x. 5 Calculate the remainder when 49 is divided by (-1)/(-4) + 255/20. 10 Let a = 3 - 6. Let r(m) = -m*3 - 18m*2 + 41m + 24. What is the remainder when r(-20) is divided by (a/(-3))/((-1)/(-3))? 1 Suppose 5l - l + 948 = -3s, -3l - 718 = 4s. Calculate the remainder when l/21(-1 + -6) is divided by 20. 18 Let p = 4 + -4. Let o(x) = x + p + x2 - 3x - 4x + 3. What is the remainder when 19 is divided by o(7)? 9 Let h be 1 - 1 - (3 - 5). What is the remainder when (5 - 3) + 26/h is divided by 8? 7 Let c(s) = -2 - 2s - 4s - 3s. Suppose -4y + 5p + 59 + 33 = 0, 2 = -y - 5p. What is the remainder when c(-6) is divided by y? 16 Let v(s) be the first derivative of -s2/2 + 3s + 3. Calculate the remainder when 47 is divided by v(-9). 11 Let z = -48 + 13. What is the remainder when 19 is divided by (-340)/z - 2/(-7)? 9 Let k(y) = -6y. Let j be k(-1). Suppose j = 2a - 0. Suppose 0f - 3f = -ax - 63, 0 = -2f - 5x + 7. Calculate the remainder when 31 is divided by f. 15 Let x(p) = 2p + 9. Suppose 11 + 5 = 2b. What is the remainder when x(7) is divided by b? 7 What is the remainder when 1/(1/39) + -56 + 60 is divided by 4? 3 Calculate the remainder when 28 is divided by 19 + (2 - 3)/(1 - 0). 10 Calculate the remainder when 46/6 - (-15)/45 is divided by 4/(-6) - 17/(-3). 3 Suppose 0 = -5u + u - 28. Let q = u - -46. Let i = 25 - 5. Calculate the remainder when q is divided by i. 19 Suppose 0 = 6d - 713 + 83. Calculate the remainder when d is divided by 53. 52 Suppose 4c + 46 = 3o, 3c = 8c + 5. Calculate the remainder when o is divided by 8. 6 Let x = 4 - 2. Let b = 28 - -19. Suppose -xs + b = -41. Calculate the remainder when s is divided by 23. 21 Suppose n = -2w + 29, -n = 4n - 3w - 119. Let s(l) = l2 + 4l - 8. Let j be s(-6). Suppose jr - 39 = r. What is the remainder when n is divided by r? 12 Let o(g) = -g - 3. Let z be o(-9). Let l(r) = -4r - 7r3 - 3 + 9r*2 + 6r*3 - zr. Calculate the remainder when l(7) is divided by 7. 4 Let q(y) = -2y + 2. Suppose -d + 0d + 97 = 0. Suppose -p = 3s - 65, 4s + 4 = 5p + d. Calculate the remainder when s is divided by q(-3). 6 Suppose -15w + 5w = -230. What is the remainder when 228 is divided by w? 21 Let n = 6 - 4. Suppose -9 = 2l + 1, 0 = nj + 5l + 11. Suppose k - 3 - 16 = 0. Calculate the remainder when k is divided by j. 5 Suppose 3m = w - 17, -w = 4w + 3m - 13. Calculate the remainder when (-2)/w - 157/(-5) is divided by 16. 15 What is the remainder when (0 + 50/8)4 is divided by 14? 11 Let h(g) = g*2 + 6g - 4. Let p be h(-7). Suppose o = po - 86. Suppose -4q = -u - o, 5q = 2u + 32 + 21. What is the remainder when 32 is divided by q? 10 Suppose -23 = -3c + 13. Let n(g) = -g2 + 15g + 17. What is the remainder when n(c) is divided by 14? 11 Let p = 33 - 12. What is the remainder when 83 is divided by p? 20 Suppose y - 2m = 9, -2m = -2y - 6m - 22. Let p = 3 + y. What is the remainder when p is divided by 1? 0 Suppose -2l + 7 = -17. What is the remainder when l is divided by (5/3)/(2/6)? 2 Suppose -m + 35 = 4m. Calculate the remainder when 7/3(m - -2) is divided by 11. 10 Let c be (1 - 1) + (4 - 4). Suppose c = -4j + 104 + 48. Suppose 2i + 3v - 41 = 0, i = -5v + 12 + 26. What is the remainder when j is divided by i? 12 Suppose -2y + 4o - 28 = 0, -o + 41 = -4y + 2o. Let b = y - -16. Calculate the remainder when 21 is divided by b. 5 Let a be -2(-2)/4-1. Let o(k) = -8k*3 - 2k*2 - k. Suppose -18 = -4d - 2. Calculate the remainder when o(a) is divided by d. 3 Suppose 4r + 2c = 3r + 2, -4c - 4 = -2r. What is the remainder when (70/15)/(r/3) is divided by (1 + 8)(-1)/(-3)? 1 Let k(h) = -3h + 98. What is the remainder when (-3)/((-6)/64) + 1 is divided by k(27)? 16 Let a(j) = 2j2 + j + 4. Let o(p) = p2 - p - 1. Let w(t) = a(t) - 3o(t). Let s be w(8). Let d = 40 + s. What is the remainder when d is divided by 8? 7 Let s be (-57)/(-9) - 1/3. Let a(d) = 4d + 4. Let j be a(s). Suppose -3q + 2 = -j. Calculate the remainder when 29 is divided by q. 9 Suppose 0 = -3k + 18. Suppose 2a - k = -3j - 0j, -a + 17 = -2j. Let d(w) = w*2 - 6w. What is the remainder when d(8) is divided by a? 7 Let x(f) = -f*3 - f + 2. Calculate the remainder when 7 is divided by x(0). 1 Suppose 4l = -0l + 32. Calculate the remainder when 38 is divided by l. 6 Let q(u) = -u3 - u2 - 1. Let n(p) = 4p*3 + 5p*2 + 7. Let i(y) = -n(y) - 3q(y). What is the remainder when 9 is divided by i(-3)? 4 Let i be (-2 - -1)/(-1 - -2). What is the remainder when 0 - 0 - (-11 - 0) is divided by (1 + 2 + -9)i? 5 Let g = -16 - -25. What is the remainder when g is divided by 5? 4 Let z(l) be the first derivative of -l2 - 14l + 1. What is the remainder when z(-11) is divided by 5? 3 Suppose 4f - 265 = -53. Calculate the remainder when f is divided by 11. 9 Let p(i) = i + 29. Calculate the remainder when p(-13) is divided by 11. 5 Let d(s) = -7s + 11. Calculate the remainder when d(-6) is divided by 18. 17 Suppose -116 = -5r - 0z - 3z, r - 31 = 2z. What is the remainder when 49 is divided by r? 24 Let c = -32 + 58. Calculate the remainder when 77 is divided by c. 25 Let t be (-37)/(-7) - (-4)/(-14). Suppose tp + 0p - 25 = 0. Suppose -o + 5s - 6 = 0, 2s - 8 = -0s. Calculate the remainder when o is divided by p. 4 Let g be (-7 + -1 + 3)/1. Let y(z) = -333z + 3. Let i be y(g). What is the remainder when 2/7 - i/(-42) is divided by 14? 12 Let u be 1 + 2 + -5 - -1. Let p be 11u/(-2)2. Let v(d) = -d*3 + 10d*2 + 14d. Calculate the remainder when v(p) is divided by 9. 6 Let g(c) = -2c + 3. Let d be (-5)/1(-9)/(-15). Calculate the remainder when 26 is divided by g(d). 8 What is the remainder when 33 is divided by (5 - (4 - 1))4 - -1? 6 Let v = -6 + 18. Let l(f) = 47f*2 + 2f. Let n be l(-2). Suppose -h - 3h + n = 0. What is the remainder when h is divided by v? 10 Let n(m) = -9m + 2. Suppose 2u - 8 = -3b, 3 = -3u - 12. What is the remainder when n(-5) is divided by (16/6)/(1/b)? 15 Let m(l) be the second derivative of -1/2l*2 - 3l + 7/2l3 + 0. What is the remainder when 58 is divided by m(1)? 18 Let q(f) = -5f*2 - 3f + 2. Let m(u) = -u*2. Let z(g) = -6m(g) + q(g). Calculate the remainder when z(8) is divided by (-12)/(-9)99/6. 20 Calculate the remainder when 142 is divided by 5/10-449/(-2). 44 Suppose s = -4v + 36, -8 = 3v - 5s - 35. What is the remainder when 70/(-1 + 1 - -2) is divided by v? 8 Let u(x) = -4 - 3 - x + 2x. Let f be u(5). Calculate the remainder when 24 is divided by (39/(-6))/(f/4). 11 Suppose q - 4 - 2 = 3x, 3q - 7 = -2x. Let	{ "pile_set_name": "DM Mathematics" }
etermine kr(u) + 2s(u). -u - 2 Let o(w) = 4w3 - 3w*2 - 3w - 2. Let z(v) = 3v3 - 2v*2 - 3v - 2. Give 2o(u) - 3z(u). -u*3 + 3u + 2 Let v(q) = 9q3 + 2q*2 + 5q + 10. Let m(t) = 14t3 + 3t*2 + 8t + 15. Let p(x) = -5m(x) + 8v(x). Let h(g) = -1. What is 3h(f) + p(f)? 2f3 + f2 + 2 Let t(l) = -6l - 14. Let g(u) = -2u - 5. Suppose -20 = -10o + 6o. Give ot(w) - 14g(w). -2w Let j(l) = -12l + 5. Let h be 4 - (3 - (4 + 2 - 2)). Let p(y) = -6y + 3. Give hp(r) - 3j(r). 6r Let q(j) = -3j2 + 2j + 1. Let w(x) = 2x2 - 2x - 1. Suppose -7g = -3g - 20. Give gw(f) + 4q(f). -2f2 - 2f - 1 Let z(y) = y*3 + 2y*2 + 2y + 2. Suppose 0 = -5s + 12 + 3. Let k(g) = 2 - g - 3 - 4g*2 + 3g2 + gs. Calculate -2k(w) - z(w). -3w*3 Let v(y) = 4y - 1. Let w(g) = 5g - 1. Calculate -4v(z) + 6w(z). 14z - 2 Let l(x) = -5x + 2. Let f(p) = p. Give 4f(c) + l(c). -c + 2 Let j(u) = 3u2 - 3u + 2. Suppose 5p = z - 21, 2z + 6 + 7 = -p. Let v(f) = -f*3 - 4f*2 + 4f - 2. What is zj(i) - 3v(i)? 3i3 - 2 Let f(k) = 61 - 5k - 61. Let w(v) = -4v + 1. Calculate 2f(p) - 3w(p). 2p - 3 Let g(t) = 3t3 + 3t2 - 7. Let l(a) = a3 + a*2 - 2. Suppose 3i - 25 = -4. Suppose -w = 42 - 40. Determine il(d) + wg(d). d3 + d2 Let o(m) = -3m3 - 3m*2 - 5m - 5. Let g(z) = -2z3 - 2z*2 - 3z - 3. Let i = 18 - 23. Give ig(h) + 3o(h). h3 + h2 Suppose 20 = -5z - 5a - 0, -a + 2 = -z. Let c be 4/(-2)z/2. Let w = -4 + c. Let n(h) = h. Let f(i) = -i2 + i - 2. What is wf(j) + n(j)? j*2 + 2 Let j(d) = -2d2 - d + 2. Let o(l) be the first derivative of l3/3 + l*2/2 + 3. Suppose 3k - 2 = -5. Determine kj(z) - o(z). z2 - 2 Let d(f) = 6f - 2. Let y(p) = -9p + 2 - 14p + 16p. What is -5d(h) - 4y(h)? -2h + 2 Let g(o) = 4 - o - 3o + 2o. Let d(l) be the third derivative of 0 - 5/24l4 + 0l - 3l2 + 3/2l*3. Determine -3d(f) + 7g(f). f + 1 Let s(b) = 23b + 2. Let v(x) = 22x + 1. Determine -3s(r) + 4v(r). 19r - 2 Let n(p) = -2p3 + 4p. Let m(y) = -2y3 + 1 + 0y + 3y + 2y. Suppose 3l - 2d = -4d - 14, -5l + 2 = -3d. Suppose -2b = -7 + 1. Give bn(a) + lm(a). -2a3 + 2a - 2 Let k(z) = z*3 + 6z*2 + 9z + 7. Let f(h) = -h*3 - 13h*2 - 14h - 17. Let q be f(-12). Let u(i) = -i*3 - 5i*2 - 8i - 6. Determine qu(l) + 6k(l). -l3 + l2 - 2l Let d(n) = -n2 - 6n + 4. Let w = 18 + -14. Let u be (-1)/((-9)/5 + 2). Let x(k) = -k*2 - 7k + 5. Determine ud(c) + wx(c). c*2 + 2c Let k(l) = -6l3 + 10l*3 - 7l + 7l - 2 - 13l. Let x(s) = -2s - 2s*3 + 1 + 0s*3 + 8s. Calculate -6k(r) - 13x(r). 2r3 - 1 Let d be (-1 - -1)/3 + 0. Let w = 3 + d. Let i(x) = -4x - 8xw + 6x + 5x. Let c(k) = -7k*3 + 6k. Determine 7c(a) - 6i(a). -a*3 Let x = -9 + 9. Suppose 4b = -0b - 5n - 4, -5b - 4n + 4 = x. Let q(t) = -3t3 - 5. Let c(j) = -2j*3 - 4. What is bq(d) - 5c(d)? -2d*3 Let n(b) = -16b + 1. Let z(f) = -17f + 1. Determine 4n(w) - 3z(w). -13w + 1 Let a(c) = 2c - 1. Let u(k) = k2 - 2k - 13. Let d be u(6). Let o(r) = r*2 + 11r - 5. Give da(w) - 2o(w). -2w2 - 1 Let h(g) be the second derivative of g4/12 - g2/2 - 13g. Let x(l) = l*2. Let v = 9 + -6. Give vx(a) - 2h(a). a2 + 2 Let j(u) = -5u*2 - 13u + 17. Let c(n) = 2n - 4 - n + 2n + n*2. Let r be 65/7 + (-8)/28. What is rc(s) + 2j(s)? -s2 + s - 2 Let y(d) = 6d*2 + 2d. Suppose 3f - 3k = -k + 9, f + 2k - 11 = 0. Let r(g) = -g2 - 2g - 2g2 - 2g*2. What is fr(n) + 4y(n)? -n2 - 2n Let i = 9 + -4. Let h(z) = 3z - 6. Let k be h(3). Let n(q) = -4q*3 + 4q + 2. Let r(u) = 7u3 - 7u - 4. Determine in(b) + kr(b). b*3 - b - 2 Let i(y) = 3y*2 + 5y + 5. Suppose -19k + 5 = -24k. Let b(t) = -t - 1. Give ki(f) - 5b(f). -3f2 Let g(z) = 4z + 0z - 1 - 5z. Let k(v) be the second derivative of v4/12 - v3/2 - 2v2 - 20v. What is 6g(s) - 2k(s)? -2s2 + 2 Suppose -2m + 3r - 47 = -6m, m + r - 13 = 0. Let t(f) = -14f2 + 2 + 1 - 6. Let o(b) = 5b*2 + 1. Determine mo(s) + 3t(s). -2s*2 - 1 Let p(o) = -2o*2 - 2o. Let k(n) be the second derivative of -n*3/6 - 6n. Let t = 1 - -1. What is tk(y) - p(y)? 2y*2 Let b(m) = 5m*2 - 12m + 5. Let n(r) = 2r2 - 6r + 3. Let s(d) = -4b(d) + 9n(d). Let p(h) = -h + 1. Give 5p(j) - s(j). 2j*2 + j - 2 Let k(m) = 7m*3 + 20m*2 + 17m + 17. Let u(c) = 2c3 + 7c*2 + 6c + 6. Determine -6k(j) + 17u(j). -8j3 - j2 Let d be -2(4 + -3) + (-3)/(-1). Let r(o) = -4o + 3. Let h(z) = -z + 1. Calculate dr(w) - 3h(w). -w Let v(q) = q3 - q - 1. Let k(r) = -r3 - r2 + 1. Give -k(i) + v(i). 2i3 + i2 - i - 2 Let s be 1 - 5/(-2)-4. Let u(k) = 0 + 1 + 7 + k + 0. Let d(z) = -2. Determine sd(m) - 2u(m). -2m + 2 Let i be 1 - (-6)/(-3) - 2. Let q be -5 + (-2 - i - 0). Let c(p) = -3p + 6. Let m(s) = -7s + 13. What is qm(f) + 9c(f)? f + 2 Let r(f) = 2f + 12. Let z(d) = d - 1. Let y(p) = -2r(p) - 20z(p). Let t(x) = -5x - 1. Let k be 2 + -12 + -14. Let m = 7 - 4. Determine kt(u) + my(u). -2u + 2 Let d(x) be the third derivative of x5/20 - x4/12 - x3/3 - x2. Let s(l) = l*3 - 7l*2 + 5l + 5. Calculate -5d(k) - 2s(k). -2k3 - k2 Suppose 6f = 24f - 72. Let z(p) = p. Let l(c) = 3c. Calculate fl(d) - 7z(d). 5d Let j = -1 + 3. Let f be -3-23/(-18). Let m(s) = s - 3. Let d(i) = i - 1. Let l(k) = 2d(k) - m(k). Let u(h) = -h*2 + 2h + 2. Calculate fu(c) + jl(c). c*2 Let u(b) = -8b + 3b2 - 3 + 3. Let q(g) = -2g*2 + 5g. Let o(k) = k*3 - 5k*2 - 7k + 1. Let v be o(6). Calculate vu(a) - 8q(a). a*2 Suppose 3j - 5j = -4. Let m(n) = 2n. Let q(h) = -6h - 2. Let k(z) = -4m(z) - q(z). Let s(b) = b - 1. Give js(o) + 2k(o). -2o + 2 Let f(p) = 4p*3 + 2. Let a be (0/(-1))/(-3 - -2). Suppose y - 2h + 2 - 15 = a, 3h = -4y - 3. Let c(k) = 0 - 3k3 - 2 + 0. Determine yc(o) + 2f(o). -o3 - 2 Let g(c) = -c2 + 2. Suppose -4b = -7b + 3x - 57, -2x - 4 = 0. Let q(o) = -3o*2 + 7. Give bg(l) + 6q(l). 3l*2 Let g(b) = -2b*2 + 4b - 1. Suppose 2h - 3j - 2j - 9 = 0, 5h + 65 = -5j. Let q(s) = -5s*2 + 11s - 3. What is hg(a) + 3q(a)? a*2 + a - 1 Let q be (-2)/33 - -2 - 13. Let l(v) = 10v2 - 6. Let x(f) = 21f*2 - 13. Determine ql(y) + 6x(y). -4y*2 Let f be 3 + -3 + (-8 + -1)/(-3). Let x(n) = -2n*2 - 3n + 4. Let v(j) = -5j2 - 8j + 11. Give fv(z) - 8x(z). z*2 + 1 Let p(k) = -4k*2 + 13k - 2. Let w(d) = 2d2 - 6d + 1. What is -4p(g) - 7w(g)? 2g2 - 10g + 1 Let w(v) = 2v2 - v + 1. Let t(j) = -3j*2 + 2j - 2. Let n(z) = -3t(z) - 4w(z). Let g(q) = q - 1. Give 2g(o) + n(o). o2 Let z(k) = -5k - 1. Let h(r) = -5r - 1. Calculate -6h(i) + 5z(i). 5i + 1 Let r(b) = -8b3 - 3b + 5. Let k(z) = -z*3 - z + 1. Calculate 3k(h) - r(h). 5h3 - 2 Let n be 3/(-9)(3 - 12). Let f(a) = -5a + 2. Let g(o) = 14o - 6. Determine ng(v) + 8f(v). 2v - 2 Let w(g) = 40g*2 + 5g + 1. Let x(t) = 10t2 + t. Determine -2w(y) + 9x(y). 10y*2 - y - 2 Let q(r) = -7r - 7. Let j(a) = 13a + 14. What is -3j(m) - 5q(m)? -4m - 7 Let f = 15 + -19. Let t(g) = -4g2 - 7g - 7. Let w(p) be the second derivative of -p*4/6 - 2p*3/3 - 2p*2 + p. Determine ft(k) + 7w(k). 2k*2 Let u(r) = 1 - 253r*3 + 0 + 254r*3. Let s(t) = -8t*3 - 8. What is -2s(l) - 18u(l)? -2l*3 - 2 Let o(z) = -z + 1. Let p(n) = 2n*2 - n + 6. What is 4o(y) - p(y)? -2y2 - 3y - 2 Let v(p) = 2p2 + 8p + 75. Let m(n) = -n*2 - 5n - 50. Give 8m(b) + 5v(b). 2b2 - 25 Let k = -22 + 16. Suppose -3i + 25 = 2i. Let g(l) = il - l + 0l - 3l. Let r(d) = 8d + 1. Calculate kg(p) + r(p). 2p + 1 Let a(u) = u + 9u + u*3 + 2u*2 - 13u. Let x(v) = 5v3 + 9v*2 - 13v. Determine -9a(g) + 2x(g). g*3 + g Let y(z) = -4z*3 - 3z - 2. Let d(h) = -5h3 - 4h - 2. Calculate -5d(p) + 6y(p). p*3 + 2p - 2 Let q(g) = -g*3 - 7g*2 - 7g + 7. Let l(r) = -r*3 - 6r*2 - 6r + 6. Suppose -2o - 12 = -0o. What is oq(h) + 7l(h)? -h*3 Let r(c) = -1. Let j(p) = 2. Let o(y) = -2j(y) - 5r(y). Let z(v) = -v. Suppose 5k - k + 2f = 10, 3k - 8 = -f. What is ko(d) - 2z(d)? 2d + 3 Let h(w) = 13w**3 + 7	{ "pile_set_name": "DM Mathematics" }
5? 238 In base 7, what is -255 - 42? -330 In base 2, what is 11 - 10? 1 In base 2, what is -111101 + -100101101? -101101010 In base 5, what is -2 + -141001? -141003 In base 4, what is 3311 + 0? 3311 In base 5, what is -1114 - 100? -1214 In base 13, what is 3 - -21? 24 In base 10, what is -14 + -205? -219 In base 8, what is -106 - -10? -76 In base 10, what is -4 + 78? 74 In base 13, what is -18 + 7? -11 In base 15, what is -75d - 0? -75d In base 8, what is -1 - -10211? 10210 In base 8, what is -11 - 41? -52 In base 7, what is -32 + -20? -52 In base 15, what is -1 + 270? 26e In base 3, what is 110201 - -1? 110202 In base 5, what is -4 - -1004? 1000 In base 10, what is 29 + -7? 22 In base 16, what is 6 - -58c? 592 In base 12, what is 52 - -1? 53 In base 5, what is 12 - -2? 14 In base 11, what is -5309 - -3? -5306 In base 8, what is -511 + 0? -511 In base 8, what is 1 + -10? -7 In base 8, what is 3 - -762? 765 In base 3, what is -1 + -1112020? -1112021 In base 9, what is 102 - 103? -1 In base 10, what is -30 - -16? -14 In base 4, what is 0 + 210321? 210321 In base 13, what is 3b0 + 9? 3b9 In base 11, what is -8 + -aa3? -1000 In base 10, what is 4 - -73? 77 In base 12, what is -1407 - -9? -13ba In base 14, what is 1a2 - 19? 187 In base 16, what is 191 + -1? 190 In base 2, what is 11 + 10000010111101? 10000011000000 In base 8, what is 3 - 447? -444 In base 11, what is 1411 + -2? 140a In base 10, what is 63 + 60? 123 In base 15, what is -6 + -b3? -b9 In base 16, what is 2 + 100? 102 In base 4, what is -101 + 32? -3 In base 15, what is 606e - 4? 606a In base 6, what is 52354 + 5? 52403 In base 13, what is 5 - 123? -11b In base 15, what is -1 + 18d4? 18d3 In base 9, what is -774 + -2? -776 In base 11, what is 18 - -12? 2a In base 4, what is -1 + 321011? 321010 In base 6, what is 311 + -2? 305 In base 15, what is 3 - 7b? -78 In base 9, what is -3 - 65? -68 In base 14, what is -5b + 6? -55 In base 16, what is f1 + 4? f5 In base 9, what is 27 + 25? 53 In base 12, what is 148 - 0? 148 In base 15, what is -4 + 2ad? 2a9 In base 4, what is 30223 - 3? 30220 In base 10, what is 6569 - -2? 6571 In base 6, what is 134 + 11? 145 In base 11, what is 3 - -281? 284 In base 3, what is -1002002 - -111? -1001121 In base 8, what is 614 + 4? 620 In base 3, what is -20 + 1120? 1100 In base 4, what is 3112011 + -3? 3112002 In base 7, what is -145 - 3? -151 In base 3, what is 101112 - 2? 101110 In base 8, what is -2661 + 1? -2660 In base 5, what is 20013 - 0? 20013 In base 3, what is -111210 + 11? -111122 In base 11, what is -323 + 4? -31a In base 13, what is 0 - 1b? -1b In base 2, what is -11011 - -101? -10110 In base 10, what is -316 - 2? -318 In base 7, what is -6 - 106? -115 In base 9, what is 1035 + -6? 1028 In base 7, what is -1 - 1003? -1004 In base 3, what is -1222 + 0? -1222 In base 14, what is -5b - -6c? 11 In base 9, what is -2 - 12038? -12041 In base 14, what is c - 13? -5 In base 12, what is 112b - 1? 112a In base 16, what is 2 + -2e? -2c In base 3, what is -2 - 1221? -2000 In base 15, what is -5 + 60e? 609 In base 7, what is 6 - 2544? -2535 In base 15, what is 596b + 0? 596b In base 10, what is 309 + 1? 310 In base 15, what is -18 + 3? -15 In base 7, what is 36 - -1? 40 In base 5, what is 33331 - -1? 33332 In base 8, what is 2 + 553? 555 In base 2, what is 11011 + -1011? 10000 In base 5, what is 0 + 1002? 1002 In base 15, what is -10 - -69? 59 In base 7, what is 136 - -102? 241 In base 13, what is 0 + -cc0? -cc0 In base 16, what is -3 - -24? 21 In base 10, what is 61 - -74? 135 In base 16, what is 4 + -9c? -98 In base 2, what is -10110001010 + -100? -10110001110 In base 13, what is a79 - a? a6c In base 6, what is -312 - 1? -313 In base 16, what is -3 - 6c? -6f In base 12, what is -3 - -805? 802 In base 15, what is -2 - -18? 16 In base 4, what is -11 - -2301? 2230 In base 15, what is 123 - 1? 122 In base 8, what is 0 - 447? -447 In base 2, what is 101010101 + 110? 101011011 In base 9, what is 140 + 7? 147 In base 7, what is -14 - 32? -46 In base 13, what is 30 + -178? -148 In base 9, what is -110 - -4? -105 In base 6, what is -12404 - -5? -12355 In base 13, what is 861 + -3? 85b In base 4, what is -11 - 303? -320 In base 8, what is 1 + -161? -160 In base 10, what is 52 + 3? 55 In base 13, what is 1 + 3c? 40 In base 9, what is -114 - 4? -118 In base 8, what is -47770 + 3? -47765 In base 6, what is -305 - -30? -235 In base 8, what is 2 + -24? -22 In base 13, what is 5 + 90? 95 In base 4, what is -331 + 1? -330 In base 8, what is 2561 + 0? 2561 In base 11, what is 2 + 104? 106 In base 6, what is 4210 - 1? 4205 In base 13, what is 21 - -3? 24 In base 4, what is 11333 + 31? 12030 In base 8, what is 5 + 21? 26 In base 6, what is -1 - -5013? 5012 In base 3, what is 1010210 - -2? 1010212 In base 11, what is 2a6 - 5? 2a1 In base 15, what is -b - -aa? 9e In base 3, what is -110 - -211? 101 In base 7, what is 125 - -4? 132 In base 7, what is -5 - 562? -600 In base 4, what is 12033 + 30? 12123 In base 6, what is 553 + 1? 554 In base 11, what is 20 + -35? -15 In base 15, what is 28 + -4? 24 In base 10, what is 2 - 298? -296 In base 5, what is -1414 - 1? -1420 In base 8, what is -11421 + 5? -11414 In base 11, what is -3 - 57? -5a In base 6, what is -1214 - -5? -1205 In base 7, what is 11 + -55? -44 In base 3, what is -2000001 + -11? -2000012 In base 11, what is 5 + 16? 20 In base 4, what is -11 - -101102? 101031 In base 12, what is -54 - 0? -54 In base 3, what is 20 - -202120? 202210 In base 6, what is 5122 - 4? 5114 In base 8, what is -15 + -1177? -1214 In base 13, what is -2 - 467? -469 In base 11, what is 23 + -104? -91 In base 2, what is -1 - 10110110010? -10110110011 In base 7, what is 133 - -4? 140 In base 2, what is 100 + -1110011? -1101111 In base 14, what is -4 + -86? -8a In base 13, what is -15 - -26? 11 In base 16, what is 92 + 3? 95 In base 12, what is 2 + 59? 5b In base 8, what is 262 - 1? 261 In base 3, what is -10 + 1111? 1101 In base 9, what is -4705 + 4? -4701 In base 16, what is 22 + 13? 35 In base 9, what is -848 + 3? -845 In base 3, what is 102 + 2? 111 In base 9, what is 1 - 3721? -3720 In base 10, what is 52 + 1? 53 In base 14, what is -cc - 2? -d0 In base 15, what is 4 - -4eb? 500 In base 10, what is -976 + -11? -987 In base 10, what is 10 + -266? -256 In base 16, what is 1 + 161a? 161b In base 9, what is 747 - 4? 743 In base 5, what is 214 - 1? 213 In base 14, what is -8905 + -3? -8908 In base 5, what is -1223442 - 0? -1223442 In base 5, what is -11212 - -1? -11211 In base 3, what is 1100 - -1022? 2122 In base 9, what is 611 + -12? 588 In base 12, what is 5 + 15? 1a In base 11, what is 157 + -1? 156 In base 4, what is 11032223 + 0? 11032223 In base 3, what is 11 + -2210? -2122 In base 5, what is 313 - -10? 323 In base 9, what is -2755 + -1? -2756 In base 13, what is 0 - -7aa? 7aa In base 5, what is 3 - 4320? -4312 In base 16, what is 32 - -d7? 109 In base 15, what is -943 + 1? -942 In base 6, what is -205 + -5? -214 In base 10, what is -747 - 4? -751 In base 15, what is -7 + 51? 49 In base 12, what is 6 + -18a? -184 In base 5, what is -4323 - 2? -4330 In base 7, what is -2 + -13? -15 In base 10, what is -67 + 24? -43 In base 9, what is -42 + 8? -33 In base 13, what is -5 + b4a? b45 In base 6, what is 200 + 151? 351 In base 2, what is -10011 - 101001? -111100 In base 2, what is -1001111010000 - -101? -1001111001011 In base 11, what is -77a - 1? -780 In base 7, what is -115 + -4? -122 In base 4, what is -12213 - 123? -13002 In base 7, what is 2 + -41? -36 In base 8, what is -47 - 3? -52 In base 15, what is -5 - 7e? -84 In base 5, what is 0 + -3023? -3023 In base 11, what is 80 - 6? 75 In base 3, what is -201112 + -21? -201210 In base 13, what is -49 + -16? -62 In base 10, what is 5 - 96? -91 In base 3, what is -11 - 1101102? -1101120 In base 7, what is 4 + -2633? -2626 In base 9, what is -12 - -414? 402 In base 15, what is 9 - -65? 6e In base 9, what is -101 + -105? -206 In base 3, what is -11120 - 212? -12102 In base 12, what is -6 - -8? 2 In base 16, what is 3 - 352? -34f In base 8, what is 156 - 0? 156 In base 15, what is -4 + -5e7? -5eb In base 12, what is -39 - -3? -36 In base 4, what is 2122 + -11? 2111 In base 10, what is -1137 + 3? -1134 In	{ "pile_set_name": "DM Mathematics" }
. 332 Let v(y) = -28y2 - 320y - 295. Determine v(-1). -3 Let w(u) = 164u2 + 71u + 149. Determine w(-2). 663 Let n(o) = 75o2 + 10507o + 841. Determine n(-140). -139 Let t(n) = n*3 + 24n*2 + 144n - 126. Determine t(-15). -261 Let p(y) = -777y - 22872. Determine p(-27). -1893 Let o(s) = -s2 - 12774s + 102298. What is o(8)? 42 Let z(d) = -995d2 - 37d - 29. Determine z(-1). -987 Let g(z) = -10z2 - 3645z - 55754. Determine g(-16). 6 Let o(b) = b*3 + 48b*2 + 24b - 4837. Calculate o(9). -4 Let t(x) = 45850x - 137565. What is t(3)? -15 Let x(w) = 777w - 329463. Determine x(424). -15 Let s(r) = 2r3 - 208r*2 - 1319r + 16. Calculate s(-6). 10 Let t(j) = -6j3 + 49j*2 + 634j - 14. What is t(-7)? 7 Let o(p) = 27p2 + 1572p + 2. Calculate o(0). 2 Let g(n) = n*3 - 113n*2 + 414n + 986. Determine g(109). -1412 Let o(v) = 2v3 + 10v*2 - 209v + 480. Determine o(3). -3 Let z(k) = 295k - 6722. Determine z(24). 358 Let x(g) = -137g*2 - 148g + 73. What is x(-3)? -716 Let c(j) = -j*3 - 7j*2 - 214j - 434. Determine c(-2). -26 Let n(r) = -16r3 + 153r*2 + 260r - 18. Calculate n(-2). 202 Let t(j) = -253j - 68756. Determine t(-272). 60 Let b(y) = y3 + 275y*2 - 51061y + 889. What is b(127)? 0 Let b(x) = -x*2 + 2639x + 150917. What is b(-56)? -3 Let d(y) = -69190y + 1591364. Give d(23). -6 Let q(k) = 3099k - 1035068. Determine q(334). -2 Let k(d) = 168196d - 2186547. What is k(13)? 1 Let c(l) = 2l*3 + 472l*2 - 20219l + 541. What is c(37)? -88 Let w(o) = -2o2 + 37678o + 1207744. What is w(-32)? 0 Let u(w) = -236w2 - 66084w - 723. Calculate u(-280). 397 Let a(r) = 3r3 + 14r*2 - 110r + 979. Calculate a(11). 5456 Let m(k) = -k*3 - 101k*2 - 6637k - 740997. Calculate m(-105). -12 Let o(b) = 2b3 + 7b*2 + 195b - 1405. Give o(5). -5 Let k(l) = 10l3 - 67l*2 + 213l - 21. Calculate k(3). 285 Let m(g) = -2759g - 15855. Give m(-7). 3458 Let k(o) = -5o*3 + 3o*2 + 1771o - 8304. Calculate k(5). 1 Let d(h) = -2h3 - 71h*2 - 720h - 6070. Calculate d(-26). -194 Let s(o) = -9o2 + 1503o - 1175. What is s(167)? -1175 Let h(i) = -1287i - 28250. Determine h(-22). 64 Let w(f) = -6f*2 + 925f - 144. Calculate w(154). 10 Let y(x) = 14685x + 425815. Calculate y(-29). -50 Let r(a) = 2a*3 + 103a*2 - 117a - 3374. What is r(-52)? 6 Let o(x) = 2x2 + 3283x - 162883. Calculate o(48). -691 Let a(x) = -458x - 9488. Give a(-21). 130 Let c(o) = -5o*2 - 2781o - 381583. What is c(-310)? 27 Let b(f) = -5337f + 58981. Calculate b(11). 274 Let r(h) = h3 - 3h*2 - 132h + 608. Determine r(5). -2 Let y(l) = -47305l + 1561171. Calculate y(33). 106 Let l(b) = -111b*3 + 113b*2 - 272b + 273. What is l(1)? 3 Let m(q) = -10384q + 3219023. Calculate m(310). -17 Let l(u) = -u2 - 62u - 1188. Give l(-38). -276 Let i(r) = 1022r2 - 527351r - 542. Give i(516). -26 Let s(f) = 590f2 + 1763f - 33. Give s(-3). -12 Let n(g) = 303g2 - 26g + 25. Give n(1). 302 Let g(d) = 607d - 24916. Determine g(41). -29 Let c(t) = -16t*2 - 2097t + 22567. Determine c(10). -3 Let q(j) = -1499j2 - 5974j + 96. Give q(-4). 8 Let t(k) = -k*3 + 83k*2 - 1712k - 290. Calculate t(45). -380 Let b(l) = -5877l + 352680. Give b(60). 60 Let d(k) = -85k*3 + 950k*2 - 142k - 19. Give d(11). 234 Let y(t) = -t*3 - 467t*2 - 5763t - 8222. Give y(-11). -5 Let o(q) = -262q2 + 6804q - 18026. Determine o(3). 28 Let q(r) = 939r - 9213. Give q(9). -762 Let h(p) = 1134p*2 - 574939p + 503. Calculate h(507). -4 Let y(q) = 369q - 2124. Give y(6). 90 Let r(b) = b3 - 4b*2 + 2768b + 16964. Give r(-6). -4 Let p(h) = h*2 - 86h + 1149. Give p(64). -259 Let a(h) = -759h + 16926. Determine a(22). 228 Let r(j) = 21458j + 1716647. Determine r(-80). 7 Let z(i) = 3i3 + 13i*2 + 205i + 832. Determine z(-4). 28 Let f(x) = -2x2 + 76x - 506. What is f(8)? -26 Let g(u) = -207u2 + 4972u. Give g(24). 96 Let y(p) = -17206p - 137664. Calculate y(-8). -16 Let k(j) = -501530j - 1003094. Determine k(-2). -34 Let u(c) = -60392c + 1509780. Determine u(25). -20 Let w(p) = 46p*3 + 28p*2 + 2p + 9. What is w(-2)? -251 Let u(t) = -57t - 2337. What is u(-51)? 570 Let v(n) = -2358n - 4074. What is v(-2)? 642 Let g(z) = 8z2 + 21746z + 281321. Calculate g(-13). -25 Let c(t) = 5t2 + 1874t + 5609. What is c(-3)? 32 Let n(t) = t*3 - 72t*2 - 1004t - 298. Calculate n(84). 38 Let d(n) = n*3 - 87n*2 + 1492n + 4490. What is d(28)? 10 Let b(p) = -p*3 + 10p*2 + 730p - 780. Calculate b(32). 52 Let x(o) = -o*3 - 81o*2 + 708o - 273. Give x(-89). 83 Let k(u) = 2u2 - 1531u + 10814. Determine k(7). 195 Let y(w) = 5w3 + 18w*2 + 8233w + 24657. What is y(-3)? -15 Let o(y) = -y*2 - 20y + 2331. What is o(-58)? 127 Let a(c) = 18027c - 90135. What is a(5)? 0 Let u(m) = -9m*3 - 4m*2 - 3160m + 6345. Calculate u(2). -63 Let m(n) = 311n + 5843. What is m(-19)? -66 Let h(l) = 1750l + 5217. What is h(-3)? -33 Let a(r) = -8r2 + 319r - 1627. Calculate a(31). 574 Let s(y) = 256y + 9246. Give s(-38). -482 Let s(r) = 2r*3 - 59r*2 - 12r - 448. What is s(30)? 92 Let t(w) = 3w2 + 79w + 1592. What is t(-34)? 2374 Let a(j) = -4j3 - 227j*2 - 219j - 2839. Determine a(-56). 17 Let l(s) = -4s3 - 19s*2 + 57s - 23. Determine l(2). -17 Let m(n) = -17n + 1796. Calculate m(106). -6 Let y(q) = 6q - 187. Give y(-16). -283 Let x(p) = 120p + 7723. What is x(-65)? -77 Let t(q) = -3092q - 95890. Determine t(-31). -38 Let d(b) = 852b - 44356. Determine d(52). -52 Let s(k) = 8k*3 + 17k*2 + 115k - 343. Calculate s(-6). -2149 Let x(o) = -7976o + 2919210. Determine x(366). -6 Let n(c) = -c3 + 202c*2 - 650c + 10544. Calculate n(199). -3 Let v(x) = -10x3 + 7x*2 + 197x - 615. Give v(3). -231 Let k(h) = -6h3 - 894h*2 + h + 3352. Calculate k(-149). 3203 Let h(k) = 3468k + 34687. Give h(-10). 7 Let i(l) = -2l2 - 155l + 1503. Determine i(-83). 590 Let u(a) = -a*3 + 140a*2 + 1179a + 654. Calculate u(148). -86 Let y(k) = -13k - 8. Give y(16). -216 Let o(r) = 3r*3 - 24r*2 + 3952r - 31614. What is o(8)? 2 Let l(y) = -2y3 - 29y*2 + 206y + 11. Determine l(6). -229 Let d(j) = -j*3 - 33j*2 + 18j - 209. What is d(-33)? -803 Let q(t) = -23161t + 209078. Give q(9). 629 Let x(o) = -640o + 34069. Give x(54). -491 Let c(f) = -6f3 - 270f*2 - 41f - 604. Give c(-45). 1241 Let o(u) = -7181u + 43858. Calculate o(6). 772 Let j(z) = -z3 - 103z*2 + 105z + 10842. Give j(-103). 27 Let p(f) = -2f3 - 279f*2 - 702f - 2337. Calculate p(-137). -8 Let o(r) = -3r3 - 4170r*2 - 16639r - 31. What is o(-4)? -3 Let x(y) = -92y - 297. Give x(-8). 439 Let z(m) = -m3 + 269m*2 + 2779m - 73. What is z(-10)? 37 Let j(h) = -h*3 + 9h*2 + 24h - 147. Determine j(10). -7 Let y(v) = -v*2 - 2841v - 258270. What is y(-94)? -52 Let z(m) = -5m2 + 251m + 2581. Give z(59). -15 Let h(y) = -14y3 - 7471y*2 - 4788y + 4797. Calculate h(-533). 0 Let m(o) = o*2 - 1030o - 11428. Give m(-11). 23 Let k(l) = -2l2 + 340l + 3486. Give k(0). 3486 Let r(w) = 3w2 + 133w - 440. Determine r(7). 638 Let s(l) = 408l + 71398. Give s(-175). -2 Let r(h) = -h3 + 15h*2 - 2774h + 47713. Determine r(17). -23 Let j(u) = 5u2 - 2972u - 33278. Calculate j(-11). 19 Let q(v) = -82v2 - 6881v - 6219. Determine q(-83). 6 Let b(u) = -693u + 269. Calculate b(-2). 1655 Let r(s) = -s3 + 442s*2 + 1121s + 95223. What is r(445)? -7 Let h(o) = -o*2 - 5117o - 152593. Determine h(-30). 17 Let b(h) = 145h + 5070. Calculate b(-28). 1010 Let h(n) = 71905n - 12799057. Give h(178). 33 Let o(a) = 3208a - 9638. Determine o(3). -14 Let l(q) = 3074q + 8689. Determine l(-3). -533 Let z(q) = 2q2 - 52797q + 52801. Determine z(1). 6 Let h(v) = -13v2 - 215v + 105. Give h(-8). 993 Let y(i) = 3i2 + 52i + 238. Calculate y(-9). 13 Let t(i) = -7i3 + 234i*2 - 385i + 2081. Determine t(32). 1 Let b(v) = -196v + 17813. Calculate b(80). 2133 Let z(v) = v3 - 2v*2 - 1633v + 25885. Calculate z(21). -29 Let h(i) = i*3 + 33i*2 + 284i + 448. Determine h(-11). -14 Let q(j) = -165j + 3572. Calculate q(8). 2252 Let m(x) = -30x*2 - 1097x + 481.	{ "pile_set_name": "DM Mathematics" }
. Suppose 0 = yr - 19r - 120. What is the tens digit of r? 3 Suppose 14k - 150 = 9k. Suppose -12o + k = -6o. What is the units digit of o? 5 Suppose -4t + 6 = -2. Let a(o) = 7o*2 - o. Let w be a(-1). Let q = w + t. What is the units digit of q? 0 Let q = -1802 + 2772. What is the units digit of q? 0 Let f be -2 + -1 - 3/(-1) - -124. Let c = -34 + f. What is the units digit of c? 0 Let w(k) = 3k*3 + 7k*2 - k - 11. Let j(o) = -4o*3 - 11o*2 + o + 17. Let m(u) = 5j(u) + 7w(u). What is the tens digit of m(7)? 4 Let p(v) = -3v - 24. Let q be p(-7). Let o(y) = -13 - 16y + 13. What is the units digit of o(q)? 8 Let n(s) = 20 - 36s + 4s2 - 11 - 20. What is the units digit of n(10)? 9 Let u = 7 - 1. Suppose -uy = 315 - 1077. What is the tens digit of y? 2 Suppose -7n + 5n + 652 = 0. What is the hundreds digit of n? 3 Let f(m) = -m*3 - 11m*2 - 4m - 16. Let n be f(-12). Suppose n = 8i - 6i. Suppose r = -3r + i. What is the units digit of r? 2 Suppose v = 5 + 2. Suppose 0 = -vl - l + 1232. Let t = l + -96. What is the tens digit of t? 5 Let l = 12 + -9. Let r be -15 + (-9)/l. Let z(m) = -m3 - 8m*2 - 3m - 10. What is the units digit of z(r)? 4 Suppose 51p = 55p. Suppose 5x = 5c - 175, -4c + px = 2x - 158. What is the tens digit of c? 3 Let n = 55 - 52. Suppose -206 = -no - t, 6 + 2 = 4t. What is the tens digit of o? 6 Let j(m) = m2 - 5m - 10. Let w be j(10). Suppose -64 = -2u + w. What is the units digit of u? 2 What is the units digit of (8 + 105/(-14))/(1/454)? 7 Let f(t) = -7t*2 - 5t - 1. Let n(r) = 9r2 + 5r + 2. Let c(w) = -4f(w) - 3n(w). Suppose -g = -3g, 3s = -4g - 18. What is the units digit of c(s)? 4 Let p(b) = -b2 + 10b + 2. Let x(l) = 2l - 2. Let q be x(6). Let f be p(q). What is the tens digit of 84/8 + f/(-4)? 1 Let k(z) = -z3 + 81z*2 + 62z. What is the tens digit of k(81)? 2 Suppose 4w + 42 - 62 = 0. Suppose -s - 584 = -ws. What is the tens digit of s? 4 Let a(d) = 9d - 1. Suppose 7 = 3g - 2. Suppose 2h + 2x - 10 = 0, -gh - 4x = -2h - 11. What is the units digit of a(h)? 6 Let l be 0 + 1/(-3) + (-52)/(-12). Let o(r) = 29r + 29. What is the units digit of o(l)? 5 Let w = -505 + 1486. What is the tens digit of w? 8 Let b = -137 - -151. What is the units digit of b? 4 Suppose -31f + 20f = -4180. What is the units digit of f? 0 Suppose -6s + 37 = -89. What is the tens digit of s + (2 - -18)/(-5)? 1 Suppose -122c + 118c + 2q = -6344, -4c + 3q + 6342 = 0. What is the hundreds digit of c? 5 Let w(c) = -c*3 - 27c*2 - 5c + 82. What is the units digit of w(-27)? 7 Suppose -55q = -56q + 70. Let n be 1/(-2) + 648/16. Let h = q - n. What is the units digit of h? 0 Let j = 185 - 69. Let c = 189 - j. What is the tens digit of c? 7 Let n(f) = f*3 - 9f*2 + 22f - 7. What is the tens digit of n(9)? 9 Let b(r) = 106r - 102. What is the units digit of b(5)? 8 Let z(g) = -8g + 1. Let c(r) = -8r + 2. Let p(d) = -5c(d) + 4z(d). What is the units digit of p(4)? 6 Let m(n) = 88n + 1. Let o be m(5). Let t be 21o/18. Suppose -3d + t = -20. What is the tens digit of d? 2 Suppose -3h = -111 - 18. Let i = h - -88. What is the hundreds digit of i? 1 Suppose -m - 3i = i + 9, 0 = -5m - 3i + 6. Let c be (-2 - m)(-12)/15. Suppose -p - 21 = -3j, -4j + 15 = -p + cp. What is the units digit of j? 6 Let t(d) = 27 + 2 - 2d - 2d - 3d. What is the tens digit of t(-9)? 9 Suppose 4n + 3 + 7 = 2f, -5f = 3n + 40. Let m(q) = q*3 + 3q*2 - 8q - 5. Let h be m(n). What is the tens digit of (-4 - (-160)/h)-3? 4 Let t be (75/(-6) - 1)-14. Let a be t/5 + (-1)/(-5). Suppose y = -y + a. What is the tens digit of y? 1 Suppose 3s + 5f = 8s - 1925, s - 3f = 385. What is the tens digit of s? 8 Let n = 391 + -117. What is the hundreds digit of n? 2 Let v = 30 - 14. Let j(z) = 1 - 6z + 1 - 5 + vz. What is the tens digit of j(2)? 1 Suppose -56d + 43994 = -44206. What is the hundreds digit of d? 5 Let b = 337 + 46. What is the hundreds digit of b? 3 Let j(o) = 49o - 26. What is the units digit of j(14)? 0 Let k = 12 + -100. What is the units digit of (1(-9)/2)/(44/k)? 9 Let y be (-1 + 0 + 0)-27. Suppose 2q - 2g - y = -5, 32 = 2q - 4g. What is the units digit of q? 6 Suppose 4007 = -6u + 16823. What is the thousands digit of u? 2 Let z = -2 - -7. Suppose -n + 5 = 3q + 59, zn = -3q - 222. Let p = n - -60. What is the tens digit of p? 1 Suppose 100t - 133t + 110616 = 0. What is the hundreds digit of t? 3 Let x(z) = 23z3 + 2z - 1. Let r = 15 + -14. Let t be x(r). Let d = t - 16. What is the units digit of d? 8 Suppose 0 = -w + 3 - 11. Let l = w + 10. Suppose 0 = -3q + 2g + lg + 130, 46 = q - 2g. What is the units digit of q? 8 Let a(b) = -8b3 + 2b*2 - 8b - 5. Let p be a(-5). Suppose -29d + 24d + p = 0. What is the hundreds digit of d? 2 Let d = -13 + 7. Let g(v) = v*3 + 4v*2 - 12v + 2. Let w be g(d). Suppose -h = -3i - 54, 66 = 2h - wi - 38. What is the tens digit of h? 5 Suppose -5b = 2f - 24, -3f + 40 = 4b + 11. Suppose 0h + f = -h + 5o, 4h = -o + 14. Suppose -y + 32 = hy. What is the units digit of y? 8 Let j = 573 - 173. What is the units digit of j? 0 Let p be 44/(5 + -1) - -2. Suppose 12h - ph + 101 = 0. What is the hundreds digit of h? 1 Suppose -2c + 4l + 587 + 3625 = 0, 3c = -4l + 6338. What is the units digit of c? 0 Let z(j) = j2 - 16j + 76. What is the tens digit of z(6)? 1 Suppose 5j - 740 = 15j. Let g = -14 + -28. Let u = g - j. What is the units digit of u? 2 What is the tens digit of -4 + (-4)/2 + (9 - -2556)? 5 Suppose -p = -3a + 3p + 90, 142 = 5a - 4p. Let o = 74 - 34. Let u = o - a. What is the tens digit of u? 1 Suppose 0 = -39h + h + 48944. What is the units digit of h? 8 Let d(i) = 337i*2 + 12i + 7. What is the units digit of d(-3)? 4 Let d(g) = 257g + 54. Let b be d(6). Suppose -22k + b = -16k. What is the units digit of k? 6 Let r(w) = -w3 - 10w*2 + 2w + 8. Let l be r(-10). Let b be -20l/(-45)9. Let t = -34 - b. What is the units digit of t? 4 Suppose 4y + 2 = 30. Suppose 2i + 10 = yi. Suppose m = -il + 16, 0l + 20 = m + l. What is the units digit of m? 4 Let y = -4039 + 7310. What is the tens digit of y? 7 Let b(d) = d2 + 9d - 1. Let x be b(-7). What is the units digit of (7 - 4)/(x/(-425))? 5 Let a(f) = -2f2 + 44f + 12. What is the units digit of a(13)? 6 Suppose 32t - 672 = 20t. What is the tens digit of t? 5 Suppose -5g + 5 = -5b, -b - 4g = -0b + 1. What is the hundreds digit of 8120/48 - b/(-6)? 1 Let g = 66 + -94. Let n = g - -42. What is the units digit of n? 4 Suppose -5 = 2m - 3. Let z be ((-72)/42)/(m/7). Suppose p - 2 - z = 0. What is the tens digit of p? 1 Let v be 0 - (4 + -3 + -8). Suppose -vr + 6r = -68. What is the tens digit of r? 6 Let h = 47 - 43. Suppose -o = 4s - 66, ho - 23 = s + 258. What is the units digit of o? 0 Suppose 10w - 11w = 0. Suppose -99 = -3k - wk. What is the tens digit of k? 3 What is the hundreds digit of 144 + 7 + 4/((-4)/5)? 1 Let f(w) = w - 1. Let d(g) be the first derivative of 7g*2 - 10g - 3. Let c(o) = -d(o) + 8f(o). What is the tens digit of c(-2)? 1 Let s(m) = -26m - 179. What is the hundreds digit of s(-23)? 4 Let p = 17 - 15. Let f(u) = -2u + 3. Let d be f(p). Let c = 31 + d. What is the tens digit of c? 3 Let j = -159 + 81. Let b = -37 - j. What is the units digit of b? 1 Let i = 3 - -2. Suppose -g + ig - 8 = 0. Suppose -3 = -gm + 15. What is the units digit of m? 9 Let r(u) = -u2 - 10u + 9. Let s be r(-11). Suppose 17 = -2k - 3k + 4t, 0 = 5k - 3t + 14. What is the units digit of k/(25/13 + s)? 3 Suppose -2z - z - m = -11, 5z - 4m - 7 = 0. Suppose 0 = -t - z, -2t - 11 + 33 = 4x. Let u(p) = p*2 - p - 4. What is the units digit of u(x)? 8 Let q be (-4)/3 - (-1)/3 - 7. Let b(x) = 2x*2 + 3x - 15. What is the units digit of b(q)? 9 Suppose -w = -2w. Suppose -3b + 4x = 3x - 13, w = 5b + x - 19. Suppose bp - 324 + 112 = 0. What is the tens digit of p? 5 Suppose 4l = t - 53, -l - 2t + 13 = 3t. What is the units digit of 2/(-8) + 2 + (-699)/l? 0 Let s(l) be the second derivative of -l3/3 - 5l*2/2 - l. Let q be s(-4). Suppose -qf + 4*f = 12. What is the tens digit of f	{ "pile_set_name": "DM Mathematics" }
-d*6/2160 - 7d5/720 - d4/24 - 119d3/3 + 22. Let x(j) be the third derivative of k(j). Factor x(n). -(n + 1)(n + 6)/6 Let l(k) be the first derivative of 3k5/5 + 5k*4/3 - 23k3/9 - k2 + 6954. Solve l(d) = 0 for d. -3, -2/9, 0, 1 Let z(c) = -111c + 108. Let v be z(-7). Factor -291m - 248m - 290m + 392 + 2m2 + vm. 2(m + 14)2 Suppose 2b + 11 = 3t + 32, 0 = 5b + 3t. Let q(o) be the first derivative of -3o*b - 6 + 0o + 3/2o2 + 9/4o*4 - 3/5o*5. Factor q(i). -3i(i - 1)3 Let p(s) be the third derivative of -s5/30 - 7s*4/6 - 40s*3/3 + 4s*2 + 9s + 19. Solve p(b) = 0. -10, -4 Let j(r) = 3r2 - r + 1. Let b(f) = 32f*2 - 98f + 96. Let w(p) = b(p) - 10j(p). Factor w(k). 2(k - 43)(k - 1) Let b be (8736/(-13104))/(0 + (1 + 3/(-2))/1). Let bt*2 + 32/3t + 64/3 = 0. What is t? -4 Find p, given that -2/3p2 - 460p - 2752/3 = 0. -688, -2 Let h be (-32)/20 + (-90)/(-25). Let q(l) be the second derivative of -4/5lh + 5l - 1/5l3 + 0 + 1/30l*4. Factor q(j). 2(j - 4)(j + 1)/5 Let k(c) be the first derivative of 3c*5/5 + 79c*4/4 - 97c*3/3 - 419c*2/2 - 246c + 9392. Suppose k(n) = 0. Calculate n. -82/3, -1, 3 Suppose 758/5z - 76/5z*2 + 4 = 0. What is z? -1/38, 10 Let h = 962313 - 2886938/3. Factor -3g + 1/3g3 - 3 + hg*2. (g - 3)(g + 1)(g + 3)/3 Let d(p) be the first derivative of p4/18 - 16p*3/9 - 3p*2 + 100p/9 - 2465. Factor d(n). 2(n - 25)(n - 1)(n + 2)/9 Find l such that -30l - l*3 - 43l*2 - 51l + 11 + 18 + 11 + 85l2 = 0. 1, 40 Determine v, given that v + 0 + 8/3v*2 + 4/3v*3 = 0. -3/2, -1/2, 0 Let k(c) = 15c*2 - 49c + 55. Let d be (-15)/(-20)(-472)/(-6). Let r(p) = -27 - 13p + dp - 7p*2 - 21p. Let z(y) = -3k(y) - 7r(y). Factor z(h). 4(h - 6)(h - 1) Let y(o) be the third derivative of 0o + 0 + 1/12o*5 - 1/42o*7 + 1/24o*6 - 70o*2 - 5/24o*4 + 0o*3. Factor y(s). -5s(s - 1)2(s + 1) Suppose 2046l - 2014 = 2078. Determine y so that -32/19y - 104/19yl + 0 - 18/19y*4 - 96/19y3 = 0. -4, -2/3, 0 Let u(j) = j3 - 11j2 - 10j - 57. Let h be u(12). Let z be 22/h + 112/132. What is a in za3 - 4/11a + 0 + 2/11a2 = 0? -2, 0, 1 Let v(u) be the first derivative of u3/6 + 197u*2 + 77618u - 881. Factor v(c). (c + 394)*2/2 Factor -164/3 - 2/9m*2 + 170/9m. -2(m - 82)(m - 3)/9 Let u(v) = 9v3 - 416v*2 - 1738v - 1724. Let m(q) = -11q3 + 414q*2 + 1737q + 1706. Let b(i) = -2m(i) - 3u(i). Determine x, given that b(x) = 0. -2, 88 Let k(i) be the first derivative of 4/11i5 + 25/11i*2 + 80/33i*3 + 15/11i*4 + 12/11i + 108 + 1/33i6. Factor k(o). 2(o + 1)*4(o + 6)/11 Let t(r) be the first derivative of 9 + 10/3r3 + 1/20r*6 + 0r + 13/40r5 + 0r*2 + 1/4r*4. Let b(g) be the third derivative of t(g). Factor b(v). 3(v + 2)(6v + 1) Let p(n) = n - 25. Let v be p(7). Let l = 21 + v. Factor 6 + 8w2 - 15w + 7w2 - lw*3 - 3w*2. -3(w - 2)(w - 1)2 Let d be ((-261)/(-153) - -16) + -15. Solve d - 2/17c*2 + 44/17c = 0 for c. -1, 23 Let j(b) be the third derivative of -1/8b4 + 1/336b*8 - 2b*2 + 17b + 0 + 1/70b7 + 1/60b*6 - 1/30b*5 - 1/6b*3. Factor j(l). (l - 1)(l + 1)4 Let r(j) be the first derivative of j3/9 + 349j2/3 + 121801j/3 + 771. Factor r(p). (p + 349)*2/3 Solve 2 - 296/3y - 302/3y2 = 0. -1, 3/151 Let s(k) = -20k*3 - 1040k*2 - 2k - 101. Let m be s(-52). Factor -2/7im + 0 - 2/7i*2 + 4/7i. -2i(i - 1)(i + 2)/7 Suppose 0 = 24l - 29l. Let n be -2(-2)/(-4)(-49)/35. Factor l + no - 1/5o2. -o(o - 7)/5 What is q in -88/7q - 4/7q*3 + 52/7q*2 + 0 = 0? 0, 2, 11 Let b = 408 + -400. Let bz*5 - 2z*5 + 6z*3 + 108z*2 - 42 + 3z*5 - 66z*4 + 5652z - 5667z = 0. Calculate z. -1, -2/3, 1, 7 Suppose 4w - 3f = 15, -3f = -w + 1 + 14. Suppose -202608 + 202118 = -98d. Factor 2/5y*4 + 0y - 2/5yd - 2/5y*2 + 2/5y*3 + w. -2y*2(y - 1)*2(y + 1)/5 Let x(f) be the first derivative of -3/8f4 + 3/4f*3 + 0f*2 + 0f + 1/20f5 + 131. Factor x(w). w2(w - 3)*2/4 Factor 283023/7v + 1063/7v2 + 281961/7 + 1/7v*3. (v + 1)(v + 531)*2/7 Suppose -3k - 5j + 39 = 0, -2k = -5j + 10j - 36. Let q(p) be the first derivative of 500p + 5/3p*k + 50p*2 - 10. Let q(v) = 0. What is v? -10 Let q(k) be the first derivative of 13/4k*4 + 0k - 2/3k3 + 113 + 1/4k*6 - 2k*5 - 5/4k2. Determine l so that q(l) = 0. -1/3, 0, 1, 5 Let u(w) be the third derivative of -w8/120 - w*7/14 - 29w6/180 - w5/10 - 5w3/2 + 9w*2 - 3. Let n(d) be the first derivative of u(d). Factor n(z). -2z(z + 1)(z + 3)(7z + 2) Let l(o) be the third derivative of o*5/15 - 103o*4/3 - 2110o*3/3 + 442o*2 - 2o + 2. Let l(b) = 0. What is b? -5, 211 Determine m, given that -2/3m4 - 32/3m*3 - 224/3m - 52m2 - 98/3 = 0. -7, -1 Let x = -31232 - -2436029/78. Let j = -9/13 - x. Factor 1/6w*3 + 1/6 - jw - 1/6w2. (w - 1)2(w + 1)/6 Suppose n - 12p = -11p + 12, -108 = -4n + 9p. Factor 0 - 7/5t2 + 13/10t*3 + nt + 1/10t4. t2(t - 1)(t + 14)/10 Let w(g) = 34g - 65. Let n be w(2). Suppose -nx = -4d - 1, 3x - 4d = -x + 4. Find f such that 0 + 2/9f4 + 2/3f*2 + 8/9f*x + 0f = 0. -3, -1, 0 Suppose l - 108 - 89 = 3y, -2l + 405 = 5y. Let n be (-128)/l(-5)/1. Factor 4r - 4/5r*2 - n. -4(r - 4)(r - 1)/5 Determine x so that -5x*4 - 5x*3 + 19838 + 4276x + 4207x + 990x*2 - 383x - 1478 = 0. -6, 17 Solve -268/7o + 8/7 - 136/7o*2 = 0. -2, 1/34 Let s = 12743 + -12743. Let h(y) be the first derivative of -4y + 6 + y*3 + sy*2 + 1/4y*4. Factor h(c). (c - 1)(c + 2)2 Let u(g) = -g3 - g*2 - g + 1. Let o(t) = -12t*3 - 9t*2 - 4t + 15. Let d = -125 - -103. Let n(w) = du(w) + 2o(w). What is b in n(b) = 0? -1, 4 Let c(t) = -2t - 30. Let h be (-15 - -1) + (10/(-2) - -2). Let i be c(h). Solve -18p*2 - 24p*4 + 21p*i - 1 - 8p*3 - 2 - 12p - 4p3 = 0. -1 Let x(f) be the second derivative of f7/1260 + 59f*6/180 + 3481f*5/60 - 95f*4/12 + 221f. Let z(o) be the third derivative of x(o). Factor z(u). 2(u + 59)2 Let x(d) be the first derivative of 4d*3/3 - 100d*2 - 636d - 2666. Suppose x(l) = 0. What is l? -3, 53 Factor 28/9i + 2/9i*2 + 26/9. 2(i + 1)(i + 13)/9 Let d be 4/((-1)/(-1 - 0)). Let j be 15/(-135) + (-138)/(-27). Determine n so that -2nd - nj + 9n - 14n + 5n - n3 = 0. -1, 0 Suppose -4i - 2 + 1 = 3l, 5l - 45 = 5i. Solve 5r*3 + 7r*5 + lr*3 - 32r*5 + 66r*4 - 81r4 = 0 for r. -1, 0, 2/5 Let y(x) be the first derivative of x4 - 1052x3/3 + 34320x*2 + 69696x + 5170. Factor y(h). 4(h - 132)2(h + 1) Suppose -20u - 17945 = 17u. Let x = u - -487. Factor 1/2l3 - 1/4l + 0 - 1/4lx. l(l - 1)(2l + 1)/4 Let m(v) = -62v3 - 420v*2 - 19956v + 86522. Let f(p) = -72p3 - 422p*2 - 19954p + 86521. Let z(k) = 6f(k) - 7m(k). What is w in z(w) = 0? -104, 4 Let m(c) be the second derivative of 0 + 1/6c4 + 96c + 9c2 + 2c*3. Factor m(f). 2(f + 3)*2 Let c be (-456)/(-171) + 610/(-255). Let x(d) be the first derivative of 4/17d - cd3 - 23 - 5/17d*2. Find s such that x(s) = 0. -1, 2/7 Suppose 0 = 145k - 158k + 195. Let w(z) be the third derivative of 5/228z*4 + 0z*3 + kz*2 + 0 - 1/570z*5 + 0z. Let w(d) = 0. Calculate d. 0, 5 Let w(g) = -19g2 - 9g - 6623 + 42g2 - 273g - 10g2. Let n(j) = -9j*2 + 282j + 6624. Let x(m) = 4n(m) + 3w(m). Factor x(p). 3(p + 47)2 Let p be (26740/(-112))/(6/(-16)). Let f = p + -634. Factor 0 - 4/3j*2 + fj. -4j(j - 2)/3 Let n(u) be the first derivative of 15/2u + 100 - 11/8u*2 - 1/3u*3 + 1/16u*4. Suppose n(o) = 0. What is o? -3, 2, 5 Let x = 354 - -65. Suppose -u = x - 422. Factor 3/10k + 0 - 1/5k2 - 1/10k*u. -k(k - 1)(k + 3)/10 Let g(x) be the third derivative of -x5/300 - 5x*4/24 + 44x*3/5 - 1377x*2. Determine c, given that g(c) = 0. -33, 8 Let a(h) be the third derivative of -1 - 13/120h*4 + 0h + 7/15h3 + 40h*2 - 1/300h*5. Let a(j) = 0. Calculate j. -14, 1 Let u = 290/133 - 36/19. Find g such that -ug*2 - 4/7 + 6/7g = 0. 1, 2 Suppose 100j2 - 11j*4 + 100j*2 - 214j - 4678 - 14j*3 + 475	{ "pile_set_name": "DM Mathematics" }
+ 3. Calculate r(n). -11 Let n(s) be the second derivative of 3/2s2 + 0 - 1/6s*3 + 1/12s*4 - 3s. What is n(0)? 3 Suppose -h - 4h - 2b = 43, -3b + 9 = -3h. Let g(r) = 4r - 10. Let z(f) = 9f - 20. Let u(y) = hg(y) + 3z(y). What is u(9)? 1 Suppose -11k + 41k = -150. Let v(m) = -7m. Let g(c) = -8c. Let u(j) = -6g(j) + 7v(j). What is u(k)? 5 Suppose -i = -4i + 9, 5g - 5i - 15 = 0. Let k(h) = 3h*2 - 3h - 4. Let b(a) = 10a2 - 7a - 13. Let l(d) = -2b(d) + 7k(d). What is l(g)? -8 Let b(y) = 3y2 + 11y + 8. Let p be b(-3). Let w(q) be the first derivative of -8q + 2 + 1/2qp. Give w(4). -4 Let r(a) = -a2 + a + 1. Let p(w) = 2w - 3. Suppose 3c - 4t = -5t - 8, 10 = -5t. Let s(q) = cr(q) - p(q). Let v = 1 + 2. Determine s(v). 7 Let v(p) = 7p3 + 8p2 + p + 5. Let n(u) = -u3 - u*2 - u - 1. Let o(w) = 6n(w) + v(w). Calculate o(-3). 5 Let v = 49 + -49. Let j(u) = -2u - 12. Calculate j(v). -12 Suppose 22k - 55 + 165 = 0. Let g(o) = -o*3 - 6o*2 + 3o + 2. Determine g(k). -38 Let x(h) be the second derivative of h7/2520 - h6/180 + 31h4/12 - 2h. Let q(z) be the third derivative of x(z). What is q(6)? 12 Let j(s) = -5s2 - 8s - 5. Let x(k) = 14k2 + 24k + 14. Let b(d) = 17j(d) + 6x(d). Let f = 8106 + -8098. Give b(f). -1 Let s = -27 - -21. Let c be 44/s + 17/(-51). Let u(m) = m2 - 1. What is u(c)? 8 Let r(j) be the third derivative of -1/40j*5 + 0j + 1/24j4 - 5j*2 + 0 + 2/3j*3. Let y(w) be the first derivative of r(w). Give y(-1). 4 Let d(x) = x. Suppose -4 = 4t - 0. Let n(p) = -p - 5. Let k(z) = tn(z) - 2d(z). Calculate k(0). 5 Let q(a) = -1920a + 954a - 2a2 + 5a*2 + 1002a + 4. What is q(-12)? 4 Let s(v) = -v*2 + 16v - 31. Let b be s(14). Let i(m) = 3m - 2 - 3m - m*2 - 2m. What is i(b)? -5 Let j(m) = -m - 7. Let f(t) = 6t + 45. Let a(r) = 2f(r) + 13j(r). Give a(3). -4 Let b = 4 - -1. Let z(a) = b + 2 + 2 - a - 19. Calculate z(-5). -5 Let x(m) = 0 + 0 + 3 + 0 - 2m2 + m2. Suppose -2p - s = -0 - 5, -4p = 5s - 7. What is x(p)? -6 Suppose 0 = -4g - 2i + 8 - 26, 31 = -3g + 2i. Let t(q) = q - 89. Let n(a) = -2a + 125. Let b(p) = 2n(p) + 3t(p). Give b(g). -10 Suppose 151h = 153h + 2. Let r(j) = j3 + j2 + j + 1. Give r(h). 0 Let g(d) = -d*3 - 9d*2 - 8d. Let j be g(-8). Let w be (2 - (-6 + -1)) + -2. Let s(a) = -6a - 7 - 5 + wa. Give s(j). -12 Let c(u) = u + 1. Let y(m) = m*2 + 9m + 10. Let w(t) = 2c(t) - y(t). Determine w(-6). -2 Let w(r) be the first derivative of 3r*2/2 - 5r + 154. Give w(3). 4 Let x(a) = a3 + a2 + a - 1. Let y(p) = -5p3 + p2 - 3p + 1. Let o(l) = -6x(l) - y(l). Calculate o(-6). -13 Let x(g) = g - 2g2 + g2 - 1734g3 + 1738g*3 + 2. Calculate x(-1). -4 Let g(j) = 5j*3 + 13j*2 - 2j - 10. Let t(q) = -9q3 - 24q*2 + 3q + 18. Let r(o) = -7g(o) - 4t(o). Give r(-4). 6 Let q(l) = 2 + 0 + 0 + 3 + 6l - l2. Give q(5). 10 Let a(x) = -2x + 3 + 175x2 + 0x - 176x2 - 2x. Determine a(-4). 3 Suppose 3i + 9g - 4g = -55, 4g - 91 = 3i. Let l be (-10)/i + 1406/10. Let v(s) = 5 + ls - 142s - 2. Give v(0). 3 Let h(i) = i2 + i - 7. Let n be h(-4). Let u(a) = -4a*2 - 3a - 5 - 2a3 - 7 + 5 + 3a3. Calculate u(n). 3 Let f(l) = l2 + 12l + 26. Let k be f(-7). Let n(y) = -y3 - 10y*2 - 6y + 22. Give n(k). -5 Let v(m) = -m + 24. Suppose 0 = -0t + t + f + 68, -3t - 4f = 208. Let q be (-2)/(-8) + 16/t. Calculate v(q). 24 Let i(t) = -5t + 1. Let y be (2 - 4)(-3)/(-12)-6. What is i(y)? -14 Let s(g) = 8g + 165. Let t be s(-21). Let m(w) = 7w*2 + 5w - 4. Let c(o) = 13o2 + 10o - 7. Let k(j) = -6c(j) + 11m(j). Give k(t). 4 Let a(b) = -18b - 5 - 14b + 35b + 3. Give a(-9). -29 Let w(g) be the first derivative of -2 - 1/2g*2 - 7g. Suppose 3a + 5q - 4 = -24, -4q - 16 = 5a. Calculate w(a). -7 Let p(o) = -o*3 - 5o*2 - 5o - 1. Let j be p(-4). Let d(k) = 1. Let y(v) = 24 + 36 - 53 + v. Let w(r) = jd(r) - y(r). Give w(0). -4 Let s(q) = 2q + 4. Let t(p) = 4p - 4. Let w be (-3)/(3/(-6)3). Let j be t(w). Suppose -l - jl + 15 = 0. Calculate s(l). 10 Suppose 4w + 209 = 5w - 2p, -4w + 2p + 860 = 0. Let m(h) = w + 213 + h*2 - 429 + h. Suppose 2f - 2z + 4 = 0, 6f + z + 10 = f. What is m(f)? 3 Let q(s) be the second derivative of -s*5/20 - 7s*4/12 - 7s3/6 + s2/2 - 3s - 5. Determine q(-6). 7 Let c = -28 - -31. Let n(i) = -c + 5i - 3i2 - 1 + i3 - 2i*2. Suppose -5a = -4p - 32, a - 4a = 2p - 6. Calculate n(a). 0 Let w(q) = -q3 - 6q*2 - 5q - 7. Let s = 23 - 20. Suppose -5v - 20 = 2t, 3t - sv = v - 7. Give w(t). -7 Let u = -4 - -3. Let z(a) = -a*2 - 3a + 1. Let p = 47 - 50. Let s(w) = 2w - 1. Let x(f) = ps(f) - 2z(f). Calculate x(u). 3 Let c(t) = 7 + 16t*2 - t - 10t*2 + 4t2 - t3. Calculate c(10). -3 Let h(m) = m*3 - 26m*2 + 49m - 10. Let k be h(24). Let u = -17 + k. Let o(b) be the third derivative of -b4/24 - b3/3 - b*2. What is o(u)? 1 Let o = 12 + -14. Let q be 4/612/o. Let r be -4 + 6 + q + 7. Let z(k) = -4k + 6. Give z(r). -14 Suppose 0h = -2h + 6, i - 4h + 10 = 0. Suppose 15 = il + l. Let g(v) = v3 - 5v2 - 1. What is g(l)? -1 Let s(g) = g3 - 5g2 - 4g - 2. Suppose 13j - 6j - 119 = 0. Let c = j - 11. What is s(c)? 10 Suppose 10d + 33 = -3w + 6d, -4d + 23 = -5w. Let n(a) = -3a - 22. What is n(w)? -1 Let l be ((-50)/45)/(-5) - (-48)/27. Let t(v) = v*3 - 2v*2 - v + 1. Calculate t(l). -1 Suppose z = 5c - 19, 5z + 17 = 4c + 6z. Let v(y) = -y3 + 3y*2 + 6y - 5. Calculate v(c). 3 Suppose 23o = 26o + 15. Let w(v) = -v - 1. What is w(o)? 4 Let i(x) = -280x2 + 2 + 3 + 279x*2 + 4x. Let q(w) = -w*2 - 7w - 2. Let t be q(-6). Suppose 4 = tb - 12. Calculate i(b). 5 Let s(h) = -11h + 2. Let l(a) = 19a - 3. Let k(n) = -3l(n) - 5s(n). What is k(5)? -11 Let z(b) = -b3 - 7b*2 - 4. Let v be ((-20)/(-30))/(1 + 46/(-42)). What is z(v)? -4 Let k(p) be the third derivative of 1/6p*3 - 9p*2 + 1/6p*4 + 0p + 1/30p5 + 0. Determine k(-3). 7 Suppose 5369d = 5373d. Let s(u) = -6u + 10. Determine s(d). 10 Let v(q) be the third derivative of q4/8 - q3/6 - 111q2. Give v(1). 2 Let i = -266 + 470. Let r be i/36 + (-2)/3. Let q(c) = 5c - 4. What is q(r)? 21 Let n(f) = 22 + 21 - 45 - 6f + f2. Suppose 0 = -4w + 30 - 6. Calculate n(w). -2 Let y(f) = -6 + 4f2 - 3f*2 + 7f - 2f2. Let u be y(6). Let i(l) be the third derivative of -l6/120 - l4/24 - 2l*3/3 + 2l2. What is i(u)? -4 Let b(k) = k3 - 5k2 + 4k + 4. Suppose 9y - 68 = -8y. Calculate b(y). 4 Let s(c) = c*2 - 2c + 2. Suppose -3y + 9y - 24 = 0. Suppose yz - 2w - 12 = 0, 2z - 9 - 5 = -w. Calculate s(z). 17 Let d(p) = -p2 + 8p - 8. Suppose -4n = 2l + 3l + 47, -5n - 15 = 0. Let i be 12/6l/(-2). Let w be d(i). Let u(y) = -y + 1. Give u(w). 2 Let p = -7 - -9. Let w(k) = k2 + k + 1. Let t(c) = 3c*2 - 2c - 5. Let z(g) = pw(g) - t(g). Suppose 5y - 4 = -4i, 0 = -3i + i - 3y. Give z(i). -5 Let k(j) = 2j*3 - 3j*2 - 3j - 1. Let u(f) = f*2 + 7f + 13. Let x be u(-5). What is k(x)? 17 Let z(d) = 87d + 6 - 175d + 88d - 8d2 - d3. What is z(-8)? 6 Let y(l) = -4l - 44 - 35 + 53. What is y(-7)? 2 Let k(t) = -t + 4. Let a be k(-5). Let x be (a/(-6)2)/(-1). Let g(s) = -7sx + 6s*2 - 8s*2 + 0s2 + s2. Give g(1). -8 Let q(n) be the second derivative of n5/60 + n4/8 + n*3/6 - 2n*2 + 9n. Let b(a) be the first derivative of q(a). Calculate b(-4). 5 Let n(d) = -8d + 2. Let k be (-2 + 1)(0 + 0)/1. Suppose k = 3h + 8 - 17. Calculate n(h). -22 Let j(l) = -l2 - 10l + 30. Let m = -403 + 390. Determine j(m). -9 Let l(z) be the first derivative of 2z3 + 23 + 5/2z*2 + 1/4z*4 + 0z. What is l(-4)? 12 Let r(x) = 11x2 - x + 6. Let i(v) = 32v*2 - 3v + 17. Let p(n) = -6i(n) + 17r(n). Determine p(-2). -22 Let y be (-1)/2 + (9 - (-19)/(-2)). Let l(p) = p*2 - 7p - 8. Let c be l(8). Let h(g) = -g + cg - 3g. Determine h(y). 4 Let s(r) = -17r3 + 23r*2 + 24r - 26. Let u(d) = -10d3 + 12d*2 + 12d - 13. Let h(i) = -3s(i) + 5u(i). Let a be (-140)/49(-14)/4. Calculate h(a). -7 Let s(t) be the first derivative of -t3/3 - t*2/2 - 14. Let j(m) =	{ "pile_set_name": "DM Mathematics" }
k*2 + 196k - 597. (k - 3)(k + 199) Find g, given that -g3/5 + 41g*2 - 406g/5 = 0. 0, 2, 203 Determine o, given that -2o4/17 - 182o*3/17 - 4230o*2/17 - 4050o/17 = 0. -45, -1, 0 Factor q*2/2 + 67q + 4489/2. (q + 67)*2/2 Factor 55f*3/3 - 15f*2 - 10f/3. 5f(f - 1)(11f + 2)/3 Factor 5o4/3 - 25o*3/3 - 35o*2/3 + 25o/3 + 10. 5(o - 6)(o - 1)(o + 1)2/3 Factor -b2/3 - 43b/3 - 130. -(b + 13)(b + 30)/3 Factor -a3/4 + 9a2/2. -a2(a - 18)/4 Let -2q*5/13 - 14q*4/13 - 14q*3/13 + 38q*2/13 + 32q/13 - 40/13 = 0. Calculate q. -5, -2, 1 Factor -13z3/4 - 6z*2 + z. -z(z + 2)(13z - 2)/4 Factor -4h4/7 - 572h*3/7 + 504h*2 - 7120h/7 + 4768/7. -4(h - 2)3(h + 149)/7 Factor 5j2 - 105j - 810. 5(j - 27)(j + 6) Factor -4t4 + 476t*3 + 480t*2. -4t*2(t - 120)(t + 1) Factor 5o*5 - 85o*4 + 315o*3 + 405o*2. 5o*2(o - 9)*2(o + 1) Factor 98o3 - 9954o*2 + 5664o - 808. 2(o - 101)(7o - 2)2 Solve -q5 - 10q*4 - 6q*3 + 32q*2 + 47q + 18 = 0 for q. -9, -1, 2 What is n in 2n4/3 - 256n*3/3 + 8680n*2/3 - 30752n/3 = 0? 0, 4, 62 Factor 4q4 - 468q*3 + 12968q*2 + 42240q + 28800. 4(q - 60)2(q + 1)(q + 2) Determine n so that n3/4 + n2/2 - 3n/4 = 0. -3, 0, 1 Factor 6x3/5 + 1284x*2/5 - 6x/5 - 1284/5. 6(x - 1)(x + 1)(x + 214)/5 Factor 2t*3/9 - 128t*2/9 + 122t/3. 2t(t - 61)(t - 3)/9 Let -9y*5 + 105y*4 - 63y*3 - 33y2 = 0. What is y? -1/3, 0, 1, 11 Factor -z4 + 15z3 + 33z*2 + 17z. -z(z - 17)(z + 1)*2 Factor 2l*5/9 + 4l*4/9 - 88l*3/3 + 112l*2. 2l*2(l - 6)*2(l + 14)/9 Solve -2i4/5 + 62i*3/5 - 714i*2/5 + 3626i/5 - 1372 = 0. 7, 10 Suppose -i*5/3 - 34i*4/3 - 76i*3 + 298i*2/3 + 229i/3 - 88 = 0. Calculate i. -24, -11, -1, 1 Determine v so that 25v2 - 20v = 0. 0, 4/5 What is w in 5w3 + 10w*2 - 25w - 30 = 0? -3, -1, 2 Find j, given that 12j5 - 48j*4 - 57j*3 - 15j*2 = 0. -1/2, 0, 5 Determine j, given that -4j*5/7 - 1076j*4/7 - 10260j*3 + 72900j*2/7 = 0. -135, 0, 1 Factor -4z*5 - 20z*4 - 16z*3 + 64z*2 + 128z + 64. -4(z - 2)(z + 1)(z + 2)3 Let -5b*3/3 - 5b*2/3 + 5b/3 + 5/3 = 0. Calculate b. -1, 1 Factor -k4/3 - k3/3 + 10k2/3 - 8k/3. -k(k - 2)(k - 1)(k + 4)/3 Factor 4q*2 - 28q + 48. 4(q - 4)(q - 3) Let -867r3/2 - 4131r*2/2 + 504r - 30 = 0. Calculate r. -5, 2/17 Factor 89u2 - 359u + 12. (u - 4)(89u - 3) Factor -9t2 - 93t - 30. -3(t + 10)(3t + 1) Factor 2i*3 - 588i*2 + 43218i. 2i(i - 147)*2 Factor 4p*5 - 8p*4 + 8p*2 - 4p. 4p(p - 1)*3(p + 1) Determine f, given that -f*4/7 - 9f*3/7 - 3f*2 - 19f/7 - 6/7 = 0. -6, -1 Find a, given that -4a5 + 72696a*4/7 - 47195280a*3/7 + 13478432a*2/7 = 0. 0, 2/7, 1298 Factor 2t*2 + 484t - 1470. 2(t - 3)(t + 245) Let 4g3 + 172g*2 - 16g - 688 = 0. Calculate g. -43, -2, 2 Factor 3f4 - 39f*3 + 150f*2 - 96f - 288. 3(f - 6)(f - 4)*2(f + 1) Factor -25v4/2 - 2890v*3 - 165882v*2 + 134096v - 26912. -(v + 116)*2(5v - 2)2/2 Factor -u3/5 - 11u*2/5 + 14u/5 + 24/5. -(u - 2)(u + 1)(u + 12)/5 Determine j so that 2j4/5 - 14j*3/5 = 0. 0, 7 Factor 35t*4 + 480t*3 + 315t*2 - 130t. 5t(t + 1)(t + 13)(7t - 2) Find x, given that -3x*2/5 + 3x - 12/5 = 0. 1, 4 Suppose -3r4/4 - 159r*3/2 - 9039r*2/4 - 8109r - 7803 = 0. What is r? -51, -2 Let 2l5/7 - 2l*3 + 12l*2/7 = 0. What is l? -3, 0, 1, 2 Suppose -441l*5 + 4494l*4 - 844l*3 + 40l*2 = 0. Calculate l. 0, 2/21, 10 What is y in 5y*4 + 14y*3 - 123y*2 + 164y - 28 = 0? -7, 1/5, 2 Factor 4c4 + 7032c*3 + 7028c*2. 4c*2(c + 1)(c + 1757) Factor 99y*2/7 + 96y/7 - 3/7. 3(y + 1)(33y - 1)/7 Factor -4s*2/3 - 140s/3 - 136/3. -4(s + 1)(s + 34)/3 What is q in q*3/7 - 39q*2/7 + 38q/7 = 0? 0, 1, 38 Suppose -2l3/23 + 14l*2/23 + 56l/23 + 40/23 = 0. What is l? -2, -1, 10 Factor -5z2 - 570z + 4235. -5(z - 7)(z + 121) Determine g, given that -g*5 - 4g*4 + 3g*3 + 10g*2 - 8g = 0. -4, -2, 0, 1 Factor -w*2/8 + 22w - 175/8. -(w - 175)(w - 1)/8 Factor -2n*2 + 1458n + 1460. -2(n - 730)(n + 1) Factor -4m3 - 672m*2 + 1356m - 680. -4(m - 1)2(m + 170) Factor -2s2/17 - 6s/17. -2s(s + 3)/17 Factor 4w4 - 24w*3 + 20w*2. 4w*2(w - 5)(w - 1) Find m such that -24649m*2/4 - 1413m - 81 = 0. -18/157 Factor -m*5 - 48m*4 - 576m3. -m3(m + 24)2 Determine r so that -2r*3 - 534r*2 + 2162r - 1626 = 0. -271, 1, 3 Suppose 21s5/5 + 111s*4/5 + 27s*3 - 15s*2 - 156s/5 - 36/5 = 0. Calculate s. -3, -2, -1, -2/7, 1 Let 6c4 - 50c*3 + 156c*2 - 216c + 112 = 0. Calculate c. 2, 7/3 Solve -2j2 + 22j - 60 = 0 for j. 5, 6 Let -12j4/5 + 501j*3/5 - 5166j*2/5 - 1323j/5 = 0. Calculate j. -1/4, 0, 21 Find h, given that 2h3 - 14h*2 + 22h - 10 = 0. 1, 5 Let 5p5/2 - 45p*4 - 5p*3/2 + 45p*2 = 0. What is p? -1, 0, 1, 18 Find m, given that -2m*3/9 - 36m*2 - 1944m - 34992 = 0. -54 Factor 82j3/3 + 500j*2/9 + 16j/9. 2j(j + 2)(123j + 4)/9 Factor 4z5/3 + 24z*4 - 52z*3 + 80z*2/3. 4z*2(z - 1)*2(z + 20)/3 Solve g*2 - 77g - 78 = 0. -1, 78 Find p, given that -16p2 - 228p - 56 = 0. -14, -1/4 What is b in 3b5 - 12b*4 - 24b*3 + 192b*2 - 336b + 192 = 0? -4, 2 Factor 4x3 - 164x*2 - 168x. 4x(x - 42)(x + 1) Factor 5y*2 - 5420y + 1468820. 5(y - 542)2 Suppose 5o*3 + 1060o*2 - 5o - 1060 = 0. What is o? -212, -1, 1 Suppose -g*4/2 - 3g*3 - 4g*2 + 3g + 9/2 = 0. Calculate g. -3, -1, 1 Let -3c2/8 + 18c - 69/2 = 0. What is c? 2, 46 Solve -4x4/17 + 110x*3/17 - 152x*2/17 - 104x/17 = 0. -1/2, 0, 2, 26 Factor -t2/4 - t - 1. -(t + 2)2/4 Suppose -5q3 + 245q*2 - 920q + 900 = 0. Calculate q. 2, 45 Solve -z*5/2 - 30z*4 - 475z*3 - 640z*2 + 5655z/2 - 1682 = 0. -29, -4, 1 Find l, given that 5l5 + 305l*4 + 6575l*3 + 57095l*2 + 158840l + 137180 = 0. -19, -2 Suppose h*3 + 30h*2 + 252h + 392 = 0. What is h? -14, -2 Suppose 6w3/11 - 1206w*2/11 = 0. Calculate w. 0, 201 Determine o, given that 3o*4/2 - 1005o*3 - 2019o*2/2 + 2013o = 0. -2, 0, 1, 671 Suppose 3i2 + 81i - 174 = 0. What is i? -29, 2 Let -2n4/15 - 44n*3/5 - 74n*2/3 + 168n/5 = 0. Calculate n. -63, -4, 0, 1 Factor -b*3 + 6b*2 + 25b + 18. -(b - 9)(b + 1)(b + 2) Find c, given that 5c4 + 15c*3 - 10c*2 - 60c - 40 = 0. -2, -1, 2 Suppose -3l2 - 2643l - 2640 = 0. What is l? -880, -1 Factor 2p2 - 42p - 464. 2(p - 29)(p + 8) Factor -k*2 + 128k - 2160. -(k - 108)(k - 20) Factor 75d*2/2 - 3d. 3d(25d - 2)/2 Factor -3c*2 + 462c + 465. -3(c - 155)(c + 1) Factor -p*2/7 + 8p/7 - 15/7. -(p - 5)(p - 3)/7 Determine o, given that 8o*5 - 26o*4 - 2o*3 + 26o*2 - 6o = 0. -1, 0, 1/4, 1, 3 Factor q*4/3 + 11q*3/3 - 16q*2/3 - 320q/3. q(q - 5)(q + 8)*2/3 Factor -2v*2 + 4940v - 3050450. -2(v - 1235)2 Factor -r3/3 - 23r*2/3 - 91r/3 + 169. -(r - 3)(r + 13)2/3 Factor -2x*2 + 148x - 2738. -2(x - 37)2 Solve -3q*2/2 + 819q = 0 for q. 0, 546 Find f such that 21f2 - 15f = 0. 0, 5/7 Find f such that f*2/3 - 178f/3 = 0. 0, 178 Factor -36m2 + 1344m - 12544. -4(3m - 56)*2 Suppose -6779814y*3 - 6788318y*2 - 25520y/3 - 8/3 = 0. What is y? -1, -2/3189 Factor g*3 - 4g*2 - 3g + 18. (g - 3)*2(g + 2) Factor 2v3/11 + 8v*2/11 + 6v/11. 2v(v + 1)(v + 3)/11 Suppose 6m*5/5 + 12m*4/5 - 24m*3/5 - 12m*2/5 + 18m/5 = 0. Calculate m. -3, -1, 0, 1 Suppose -4k5 - 8k*4 + 32k*3 + 64k*2 - 64k - 128 = 0. What is k? -2, 2 Factor 3p3 + 123p*2 + 234p. 3p(p + 2)(p + 39) Find f, given that 4f*2 - 32f + 60 = 0. 3, 5 What is r in -r3/6 + r2/3 = 0? 0, 2 Factor 2k4/5 + 16k*3/5 - 38k*2/5 + 4k. 2k(k - 1)*2(k + 10)/5 Let -4v4/9 + 40v*3/9 - 28v*2/3 = 0. What is v? 0, 3, 7 Let -8y*4 - 386y*3 - 4936y*2 - 9418y - 2052 = 0. Calculate y. -27, -19, -2, -1/4 Factor -6r5 + 181r*4 - 534r*3 + 576r*2 - 244r + 27. -(r - 27)(r - 1)3(6r - 1) Factor -d2 - 2462d - 1515361. -(d + 1231)*2 Let -2m*5/15 - 98m*4/15 - 82m*3/15 + 674m**	{ "pile_set_name": "DM Mathematics" }
se -5r - u = -188, 3 = -5u - 7. Suppose 0n - 4k = 3n - r, k - 42 = -4n. What is the units digit of n? 0 Suppose -7q + 17q - 170 = 0. What is the units digit of q? 7 Suppose 3 = -3n, -2 + 10 = 3k + n. Suppose 2v - 65 = 3i, 2i + 95 = 4v + ki. Suppose v = 5y - c, y + 2c - 16 = -0c. What is the units digit of y? 6 Suppose 4n + 150 = 1270. What is the units digit of n? 0 Suppose -4v - 56 = 2b, v + 3 = -1. Let d = -14 - b. What is the units digit of d? 6 Suppose 0 = -p + 5z + 5 + 5, 0 = -4z + 12. Suppose -v + 4v - 3x - 21 = 0, -3v + 5x = -p. What is the units digit of 2/v + (-39)/(-15)? 3 Suppose 3o = 2o + 8. Suppose w - 4j + 4 = -o, -5j + 41 = 2w. Suppose 3v = 2v + w. What is the units digit of v? 8 Suppose 0 = 4i - 14 - 146. What is the units digit of i? 0 Suppose -3q - 323 = -2l, 0 = 3l + 2q - 715 + 198. What is the units digit of l? 9 Let y be (-128)/(-14) + 4/(-28). Let u be 10/6 + 1/3. Suppose p - y = -o, -o = 6p - up - 24. What is the units digit of p? 5 Suppose -14 = -2a + a. What is the units digit of a? 4 Let x = -39 - -56. What is the tens digit of x? 1 Let q be 3 + 3/(9/(-6)). What is the units digit of q - (0/(-4))/(-1)? 1 Suppose -4t + 279 = 2l - 403, -5l - t = -1723. What is the hundreds digit of l? 3 Suppose t + 0 - 2 = 0. What is the tens digit of 0 - t - (-16 - -2)? 1 Suppose 2w = 9 + 15. Let g = w - -3. What is the tens digit of g? 1 Let a(l) = 4l2 - 7l - 1. Let t(i) = i*2 - i. Let s(h) = -a(h) + 3t(h). Let p be s(4). What is the units digit of (-6)/(-9) - p/(-3)? 1 What is the tens digit of (-237)/(-4) - (25/20 - 1)? 5 Let u = 6 - 11. Let y = u + 11. Suppose -5r - y = -26. What is the units digit of r? 4 Suppose -26 = -4z + 2f, 3z + 3f - 37 + 13 = 0. Let r = z - 7. What is the units digit of 0 - (4 + r)/(-2)? 2 Suppose 20 = -3m + 2. What is the units digit of (m/(-4))/((-4)/(-24))? 9 Let u = -7 + 10. Suppose -us = -0s - 6. What is the units digit of 2/(s/1) - 0? 1 Suppose l + 6l = 973. What is the units digit of l? 9 Suppose 0o = 5o - 2g - 20, -o = 2g - 4. Suppose 3p - 14 = 5d, -5p + od + 22 = -10. What is the units digit of p? 8 Suppose 3t + 40 = 133. Suppose 0 = -2i - n + t, -3i = -0n - 3n - 42. What is the units digit of (1 - -3)i/12? 5 Let p = 50 - 47. What is the units digit of p? 3 Let z(a) = -2a - 3. Let f be z(-3). Suppose -4v = -fv - 4. What is the units digit of v? 4 Let f = 14 + -10. Let q = f - -3. Suppose 5j = -1 - 24, -4j + q = 3m. What is the units digit of m? 9 Let w(c) = -8 - 2c - 8 + 6. Let v be w(-7). Let g = 12 - v. What is the units digit of g? 8 Let y = -1 + -1. What is the units digit of (1/y)/((-3)/78)? 3 Let v be ((-15)/(-4))/((-3)/12). Let k = v - -28. What is the units digit of k? 3 Suppose 0 = 4w - 461 - 3. Let c be w/6(-6)/(-4). Suppose -f = -4s - 12, 6f - c = 2f - 3s. What is the units digit of f? 8 Suppose -23 = -3f + 19. What is the tens digit of f? 1 Let z(y) = y3 + 4y*2 + 2y - 3. Let v be z(-3). Let c = 25 + v. What is the units digit of c? 5 Suppose -u = -2b + 4u + 61, 4u = -3b + 80. What is the tens digit of b? 2 Let w(s) = 4s2 - 6s - 4. What is the units digit of w(-7)? 4 Suppose 0 = 3f + l - 62, -4f - 5l + 16 = -52. Suppose -4h - 2s = -12, 0 = 5h + s - 2s - f. What is the units digit of h/18 + 140/18? 8 Let w be 2/12 - (-33)/18. Suppose 3v - 20 = 2v - 2d, -46 = -wv + 2d. What is the units digit of v? 2 Suppose -158 = 4u - 482. What is the tens digit of u? 8 Let b(t) = 9t - 7. What is the units digit of b(7)? 6 Let l(q) = -4q3 + 5q*2 - 2q. Let c(s) = 0s + 2s2 - s3 + 0s - s. Let n(i) = 7c(i) - 2l(i). What is the tens digit of n(-4)? 1 Suppose -5x = 3l - 28, 5x + 0l - 20 = -5l. Suppose 3h - x = 13. Let j = h - 4. What is the units digit of j? 3 Let c(l) = 8l2 + l. Let t(a) = a2 - 11a - 1. Let x be t(11). What is the units digit of c(x)? 7 Suppose -3y - 37 = 5f, 7f - 3f = -3y - 32. What is the units digit of (28/f)/((-2)/5)? 4 Let y be (1 + 0/2)3. Suppose -5x - 7 - y = 0. What is the units digit of x/6 + 22/3? 7 Let k(o) = -3o3 + 2o*2 + o. Suppose -4 - 4 = 2q. Let m be (-6)/q(-4)/6. What is the units digit of k(m)? 4 Let m(i) = -i + 11. Let r(y) = -y3 - 3y*2 + 2y. Let c be r(-4). Let j be m(c). Suppose 33 + j = 4b. What is the units digit of b? 9 Suppose 0 = 5w, s + 4s = 3w - 25. What is the units digit of (-1 + -1)s/10? 1 Let u be 2 + 0 + -5 + 0. Let t(n) be the first derivative of -3n*2/2 + n + 4. What is the tens digit of t(u)? 1 Suppose -4k + 7 + 13 = 3w, w - 6 = -k. Suppose -kr + 27 = -81. What is the tens digit of r? 5 What is the tens digit of 0 - (1-44 - 3)? 4 Let s(a) = a + 2. Let b(u) = 2u*2 - 5u - 3. Let g be b(4). What is the units digit of s(g)? 1 Suppose -4p + 59 = -3u, -p + 6p - 60 = u. Let o = p + -7. Suppose 2f = of - 30. What is the units digit of f? 5 Suppose 9x + 2 - 1496 = 0. What is the units digit of x? 6 Let p(y) = -y*3 + 7y*2 - 5y - 3. Let d be p(4). Suppose 2g - 6g + 8 = -4h, 0 = -5g - d. Let f = 13 + h. What is the units digit of f? 6 Let x(j) = j*3 - 4j*2 + 2j + 4. Let l be x(3). Suppose v - 4b = -14, v + l + 7 = 2b. What is the units digit of v/(-6)12/4? 1 Let o(t) = -t3 - 13t*2 + 12t - 3. What is the tens digit of o(-14)? 2 Suppose 9 = 3l - 3, -3g = -l - 77. What is the tens digit of g - -4 - (3 + -1)? 2 Let l be (-52)/645/(-6). Suppose -2r = -4j - 26, -4j - 1 + l = 4r. What is the tens digit of r? 1 Let s(w) = w2 - 2w - 1. Let u be s(3). Suppose -ui - 4r = -18, -3i + r + r + 3 = 0. What is the units digit of (11(-1 + i))/2? 1 Let i(p) = -152p3 + 2p*2 + p. Let t be i(-1). Suppose 4y + 37 = t. What is the tens digit of y? 2 Suppose 4k + 4f = 24, 0 = -3k + k + 5f - 2. Let s be (-2)/6 + (-26)/(-6). Suppose -2j = -0l - sl - 16, -kj + 48 = -4l. What is the tens digit of j? 1 Suppose -4i - 5a + 792 = 0, 8i - 5i - 4a = 563. What is the units digit of i? 3 Let q = -5 - -10. Suppose -52 - 33 = -qi. What is the units digit of i? 7 Let a(v) = v3 - 3v + 3. Let d be a(2). Let c = d + -3. What is the units digit of -2 + 15/6c? 3 What is the units digit of 67 - 5/(-1 + 6)? 6 Let w be 14((-2)/(-4) + -1). Let x = -6 - w. What is the units digit of x? 1 Let q be (-4 - -2)/2-2. Suppose -qh + 6h - 80 = 0. What is the units digit of h? 0 Let q = -43 + 50. What is the units digit of q? 7 Let q(d) = -11d3 + d2 + d. Suppose 3t + 0 + 3 = 0. Let m be q(t). Suppose z - 8 = -2l, 0 = z + 5l - 0 - m. What is the units digit of z? 6 Suppose -2q = 8, 0 = -0t - 4t - 4q + 140. What is the tens digit of t? 3 Let j(x) = -x3 + 4x*2 + 2x - 3. Let n be j(4). Suppose n = r + 3. What is the units digit of r? 2 Let h = -115 - -175. Suppose -5q + 7k + 100 = 2k, -3k + h = 5q. What is the units digit of q? 5 Let m(w) = -w2 - w. Let l be m(-1). Suppose l = n + 4n - 10. What is the units digit of n? 2 Let q be (-4 + -1)/(1/(-33)). Suppose -l + 3x = -0l - 33, 5x - q = -5l. What is the units digit of l? 3 Let o = -11 - -15. What is the units digit of -4(-1)/o11? 1 Suppose -4c + 5b = -535, -b - 135 = -4c + 3c. What is the units digit of c? 0 Suppose 0 = -w - w + 60. What is the tens digit of w? 3 Let g be (-32)/(-24)6/4. Suppose 3i - 4c - 8 = 0, 0 = -2i - gc + c + 20. What is the units digit of i? 8 Suppose -5n = -3d + 402, 5d - 5n - 273 = 3d. Let q = d + -91. What is the tens digit of q? 3 Let f be (1 - -2) + 21/(-3). What is the tens digit of (f + 1)31/(-3)? 3 Suppose 4m + 0m = -4w + 56, 2w = 5m - 91. What is the units digit of m? 7 Suppose 2v + 2v + 162 = -2n, -4n + 3v = 291. Let f = n + 107. What is the units digit of f? 2 Let u(h) = -4h - 1 - h + 3h2 - h2. Let l = 11 + -7. What is the tens digit of u(l)? 1 Suppose -2l - 1 = 5o, -2l = -2o + 6o. What is the units digit of l? 2 Let v be 2 + -1 + -1 - -3. Let p be (66/(-4))/v2. Let k = 19 + p. What is the units digit of k? 8 What is the tens digit of (-3 - -2) + 134? 5 Let f(p) = p*3 - p + 38. Suppose 2s - 3s = 0. Let r be f(s). Suppose 5m + 20 = 0, -m - 2m = 5o - r. What is the tens digit of o? 1 Let s(g) = -g*2 + 6g + 8. What is the units dig	{ "pile_set_name": "DM Mathematics" }
lue in 0.2, u, -1/8, -1? u Let t = -1.72 + 2.02. Which is the fourth biggest value? (a) t (b) 0.1 (c) 0 (d) -0.5 d Let m(l) = 5l - 71. Let p be m(15). What is the third biggest value in -1, -0.03, p, -0.1? -0.1 Suppose 5 = -5d + 3o - 2, 0 = -d + 4o + 2. Let g = 58 - 132. Let z = g - -76. Which is the third biggest value? (a) z (b) d (c) -0.3 b Let c = 13 + -33. Let m = -20.5 - c. What is the second smallest value in 3, 1, -5, m? m Let s = -0.1 + 5.1. Let p = -40311/4 + 10079. What is the third smallest value in 3, p, s, -1? 3 Let x = 4 - 7. Let c = 10 - 14. Let p = c - -7. What is the second smallest value in 3/4, p, x? 3/4 Let d = 5.968 + -0.968. Suppose -6q + 12 = -3q. Suppose -4l = -4i + 24, -2i - ql = -5i + 23. Which is the biggest value? (a) i (b) d (c) -2 b Let m = -221/2 - -8615/78. What is the biggest value in -4/3, 1, m? 1 Let x = 8084/3 + -2695. Let l(k) = 2k*2 + 6k. Let n be l(-5). Let t be (-64)/110 - (-8)/n. What is the third smallest value in 4, x, t? 4 Let j be (-3 + 45/20)/(3/2). Let x = -185 + 182. What is the smallest value in -1, -0.4, j, x? x Let i = -285.882 + 286. What is the second biggest value in -0.3, i, 3? i Suppose 4d - 2 = 3u, u + 5 = -3d - 0. Let i = -0.6 - 1.4. Let h = i + 5. What is the third biggest value in 2/5, d, h? d Let i = 10/9 + -16/63. Which is the second smallest value? (a) 3 (b) i (c) -1.1 b Suppose 0 = f + 3 - 7. Let o be -1510/(-1725) - (744/92)/1. Which is the biggest value? (a) f (b) 0.2 (c) o a Suppose 3c = -34 - 20. Let x be (-10)/c - (-2)/(-6). Let r = 53/13 + -51/13. What is the third smallest value in x, -0.1, r? x Let b = 128 + -86. Let v = -41 + b. What is the biggest value in v, -7, -5? v Let j = -9.9 - -10. Let g = -1698 + 25448/15. Let t = g - -316/195. Which is the third smallest value? (a) t (b) j (c) 3 c Let f = 189 - 190. What is the biggest value in 0.4, f, 4, -0.4? 4 Let q = -20 - -23. Let w = 0.08 - 7.08. What is the second smallest value in 4, w, q, -1/3? -1/3 Let l = 195 - 389/2. Let p = -0.26 - -0.06. Which is the smallest value? (a) l (b) -1 (c) p b Let m be (10/8)/(3/12). Let s = -1.58 - 1.42. Let t = 123 + -1847/15. Which is the biggest value? (a) t (b) s (c) m c Suppose 8b - 5o = 3b + 20, -9 = 3b + 4o. Suppose 14 = -3j - b. What is the smallest value in 1, j, -2/5? j Let o = -4.9 + 5. Let z be 4/10 + ((-416)/20)/(-8). Let h be -3 - 51/(-18) - z/36. Which is the smallest value? (a) 1/5 (b) o (c) h c Let d = -164 + 64. Let k = 115 + d. What is the third smallest value in k, -0.4, 0? k Let o = 0.278 + -0.25. Let u = -0.528 + o. Which is the second biggest value? (a) u (b) -0.3 (c) 0.3 (d) 5 c Let g(d) = -d + 7. Let t be g(7). Let o = 1.056 - 18.056. Which is the smallest value? (a) -1 (b) o (c) t b Let l = -798.86 + 799. Which is the second biggest value? (a) -0.02 (b) 0 (c) -2 (d) l b Let k = -56.4 + 55.4. What is the smallest value in -6/7, -2/13, k, -1/2? k Let p = -2522 - -2455. What is the smallest value in 3, p, -0.2? p Let g = 1/68 - 95/1836. Which is the second biggest value? (a) -5 (b) g (c) -2/3 c Let m = -1497 + 1499. Let k = -552/1981 + -2/283. Which is the third smallest value? (a) 2/17 (b) m (c) k b Let y be (-1 + 6/5)-263. Let q = y + 53. What is the second smallest value in q, 0, -1/2? 0 Let h = -2.971 + -0.067. Let o = 0.038 + h. What is the third biggest value in -5, -0.6, o? -5 Let c = 474 - 475. What is the smallest value in -0.3, c, 2/35, 0.04? c Let j be 1/7(-4 + 1). Let w be 1/(2/(-8 - -4)). Let y be (w/8)/((-1)/8). Which is the second smallest value? (a) -4/3 (b) y (c) j c Let r = -2/109 - 101/436. Suppose 0 = -2y - 2y + 4. What is the second biggest value in r, y, -0.4? r Let v = -0.24 + -4.76. Which is the third biggest value? (a) 0.1 (b) 1/3 (c) v (d) 47 a Let t = 19 - 21. Let p be (1 - 10/6-1) + t. What is the third biggest value in p, -1/4, 5? -1/4 Let i be (-816)/6882 + (-10)/(-155). What is the third biggest value in -2, -4/7, i? -2 Let t(a) be the third derivative of -a5/60 - a4/24 + a3/3 + a2. Let k be t(1). Let f = -0.1 - -0.5. What is the biggest value in f, 3/4, k? 3/4 Let d = -15/13 + 157/91. Let i be (-3)/6 + 143/(-26). Which is the biggest value? (a) i (b) -1/2 (c) d c Let f = 7 + -6.88. Let v = 0 - f. Let t = 0.9129 - 0.4129. What is the biggest value in -2/11, t, v? t Let p be (-12 + 14 - 1) + (-1)/1. Which is the second smallest value? (a) 2/3 (b) -7/9 (c) p (d) -2/3 d Let x = 5732/20429 - 2/1977. Let q = x + 12/31. Which is the fourth smallest value? (a) -2/3 (b) q (c) -0.6 (d) 1 d Let g = -26 + 209/8. Let v = 21.45 + -21. Let x = v - 1.45. Which is the third biggest value? (a) x (b) g (c) -1/3 a Let k = 3.21 - 3.31. Let q = -5 + 3. Which is the second smallest value? (a) k (b) 2/5 (c) 1 (d) q a Let r = 0.39 + -0.09. Let j be (0 - -1) + 9/(-30)4. Which is the third smallest value? (a) 4 (b) j (c) r a Let m(h) = 2h*2 + 44h + 44. Let j be m(-21). What is the biggest value in j, 0.1, -3/4? j Let j = 0.19 - 0.59. Which is the third smallest value? (a) -0.1 (b) -4 (c) j a Let h = 6.08 + -0.08. Let g = h + -1. Let m(l) = l*3 + 41l*2 + 147l - 37. Let y be m(-37). Which is the smallest value? (a) g (b) -3/7 (c) y b Suppose -11h + 873 = 818. What is the third smallest value in -3, h, -3.2? h Let j = -17 + 6. Let n = j + 13.4. Let g = n + -0.4. Which is the second smallest value? (a) -1/2 (b) g (c) -6 a Let z = 0.34 + -42.34. Let p = -46 - z. Let s = -2 - -1.8. Which is the biggest value? (a) s (b) -0.4 (c) p a Let r = -4.8 - -2. Let j = 2.9 + r. Let k = -0.3 - -0.1. What is the biggest value in k, j, -0.3? j Let x = 0.7 + -1. Let s = -975.5 + 976. Which is the biggest value? (a) -1 (b) s (c) x b Let i = 1129/1245 + -10/249. Let m = 7/10 - i. Which is the second biggest value? (a) -1 (b) 0 (c) -7 (d) m d Let g(h) = h - 3. Let s be g(6). Let f = s + -23. Let x be f/14 - (-9)/21. What is the smallest value in x, -3, 2? -3 Suppose -10i + 13i + 231 = -5s, -i + 178 = -4s. What is the second smallest value in s, 0, 0.1? 0 Let n = -34/3 + 250/21. Which is the second smallest value? (a) 0.035 (b) n (c) 0 a Let k = 267/7 + -1307/35. Which is the third smallest value? (a) 1/4 (b) k (c) 0.1 b Suppose -5w - 13 = 2. Let n be 7/w - 18/27. Which is the smallest value? (a) 0.1 (b) n (c) 35 b Let m be 2/(6/(-10) - -1). Let z be 15/6(3/(-15) + 0). Which is the smallest value? (a) 1 (b) z (c) m b Let l be 0 + -4 - -4 - (-4)/(-6). Which is the biggest value? (a) 5/3 (b) l (c) 6 c Let s be (-2 - (-74)/4)/((-46)/(-92)). Which is the biggest value? (a) -4 (b) s (c) 5 (d) 4 b Let x = -64/165 + -2/165. Let v = 17.92 + -2.82. Let a = v - 16. What is the second smallest value in x, a, -1/2? -1/2 Let l = -985 - -987. What is the third smallest value in l, -0.3, -3/32? l Let y = -4523/8 - -565. Let p be 2/(((-24)/9)/(-4)). Let w(s) = -s. Let u be w(p). What is the biggest value in y, -0.5, u? y Suppose 15 + 10 = 4l - 3f, 5 = 5l + 5f. Let u = 329629957/545 + -604826. Let a = 1/109 - u. What is the second biggest value in l, -1/3, a? a Let m be -3 + -2 + 1 - -26. Let c = m - 21. Let x be (0 - 0)/(2-1). What is the third biggest value in c, -2/9, x? -2/9 Let n = 2.59 + -0.59. Which is the second biggest value? (a) -0.3 (b) 2/9 (c) n b Let i = -285632/45 - -6348. Let n = i + -2/5. Let t(h) = h*2 - 5h - 4. Let l be t(6). What is the third smallest value in n, -1/4, l? l Let x = 1018 - 1026. Let r be 4/6 - 33/9. What is the third smallest value in x, -0.2, r? -0.2 Let n be 106/(-8) + 5/(-20). Let s = n - -14. Let d = -0.08 - 2.92. Which is the third biggest value? (a) d (b) -2/11 (c) s a Let b(t) = -9t + 353. Let l be b(39). What is the smallest value in -546, l, 1/2? -546 Let w = -6715/6 + 1118. What is the smallest value in w, 7/5, 2/7? w Let r be ((-4)/(-30))/(121/(-132)). Let k = -42/1045 - r. Let i = 4.1 - 0.1. What is the second biggest value in i, -2, k? k Suppose 0 = -2l - 2r + r + 2, 3r = 6. Let k = 973 - 968. Which is the third smallest value? (a) l (b) -0.3 (c) k (d) 1 d Let s = 0.5 - 0.3. Let u = 1.96 - 1.8. Let y = u + -1.16. Which is the third smallest value? (a) 0 (b) s (c)	{ "pile_set_name": "DM Mathematics" }
m be 2 + (-1 - 12) + 1. Let h be ((-12)/m)/((-6)/(-15)). Let o = 4 - h. Solve c - 2 = 4x, -c - c = -5x - o for x. -1 Let d(s) = s*2 - 2s - 3. Let l be d(3). Solve -k = -2y, l = -4y + 5 - 13 for k. -4 Let g = -7 - -11. Suppose 24 = 5h - 4u, -3 = -4h - 3u + 10. Solve -2b - 2 = -ho - 10, gb + 5o = 3 for b. 2 Suppose 5l + 0l + 45 = 0. Let s be (2/(-6))/(1/l). Solve st = 6, -3b + 0t + 19 = 2t for b. 5 Suppose -5o + 15 = -0. Let g(m) = 2m + 4. Let q be g(o). Let l = -2 - -2. Solve -s + 4w - 6 - q = l, 0 = s + 4w - 16 for s. 0 Suppose -14u + 11u = -6. Solve k = 5c + 10, 4k - 24 = uc + 2c for c. -1 Let i = -113 + 116. Solve -ih = -m - 2m - 24, h + 4 = -2m for h. 4 Suppose 34 = -2z - 0z + 4n, -4z - 3 = 5n. Let g = z - -11. Solve -3a = a - gp - 16, -3p = 5a - 12 for a. 3 Suppose 5y = 10 - 0. Solve -4u - 8 = 3r - 2, -yu = -2r - 4 for u. 0 Suppose 0 = m + 17 - 19. Solve -5h = -5n - 25, mn = 5n for h. 5 Let l(w) = w + 5. Let b be l(3). Solve -o + b = -3n, -n + 2o - 4 = n for n. -3 Let i = -32 - -42. Solve 0 = 3b + 4t + 11, -b + 6b + 5t + i = 0 for b. 3 Let c(a) = -a2 + 5a + 1. Let s be c(5). Suppose 4k - k - 3j = 0, 5k + 2j - 35 = 0. Solve 0 = -m - p + s, -2m - 1 = 4p + k for m. 5 Suppose -4d = -7d + 6. Let j be (-1)/2-4d. Solve jw + 3z + 11 = -5, -5w - 4z - 20 = 0 for w. -4 Suppose -2i + 34 = -3u, -2u = -5u - 2i - 38. Let c = 16 + u. Suppose 2w = -5 + 59. Solve -cv - 4p - 4 = 0, 3v - 2p = w - 10 for v. 3 Let z(b) = 4b + 7 + 0b - 3b + 0b. Let o be z(-5). Solve -2l - 5j - 15 = -3l, ol + 2j + 18 = 0 for l. -5 Let g = 13 + -13. Solve -d + 2z - 3 = 0, g = -7d + 2d - 3z - 15 for d. -3 Let g(p) = -3p + 8. Let v be g(-6). Suppose -d - 7 = -w, -4d - v = -2w - w. Suppose 0 = -3f + 21. Solve 0q - q + wn = f, 2q + 3n = 14 for q. 1 Let g be 0 - ((-3)/3 - 2). Suppose -z = 2v - 6, gv - z = -3z + 8. Suppose vq + 3 = 5q. Solve 6r - qr + 3i + 18 = 0, i + 3 = 0 for r. -3 Suppose c = -0l + l + 8, 3l + 28 = 4c. Suppose 4k + cx = k - 40, -5x = -2k + 4. Let g = -5 - k. Solve 26 = 2p + 4m, -p + 22 = gm + 4 for p. 3 Let t = -47 - -49. Solve -16 = -z - 3m, tz - 17 = -2m - m for z. 1 Suppose 0 = -2f - 2w + 6w + 20, 2w = -8. Solve 0 = -fb - 0h - 4h - 18, 3b - 13 = 2h for b. 1 Suppose 2h + 2 = 3h. Solve -4g + 12 = w - hw, -5g + 32 = 3w for g. 4 Let n be 3 + (3/3 - 2). Let u be (-23)/n + 6. Solve -uv - 10 = 2m, m + 4v = -m - 10 for m. -5 Let t(o) be the first derivative of o3/3 + 2o - 4. Let r be t(0). Solve -f - 2 = x, -2x = f + rx - 1 for f. -3 Let y be 14 - ((1 - 3) + 4). Solve 0 = -4r + 2t + y, t + 0t = 5r - 9 for r. 1 Let k = 1 - 1. Let w = k + 0. Solve 0 = -2l + 2c, 2l + 8 = 4c - w for l. 4 Let t be 7/2 - 1/(-2). Solve -2k + 5k + 22 = -5n, tn + 3k + 20 = 0 for n. -2 Let m(r) = 4r*3 - 3r + 2. Let y be m(1). Suppose -3d + 3 = 0, -2w + 3d = -4w + y. Solve -3l + 4 = -s, l + ws - s - 4 = 0 for l. 0 Let p(o) = -o*3 + 4o*2 - 3o + 2. Let r = -4 + 7. Let x be p(r). Suppose -xv = -v. Solve -4t + 31 = 5c, vt + 12 = 3t for c. 3 Let g be (-2)/(-6) - (-10)/6. Solve d - 13 = 3w, gw + 0w + 26 = 5d for d. 4 Let g be (-1)/5 - 29/5. Let a = g + 3. Let k = a + 4. Solve 0 = -i + 3, u - k = 2i - 4i for u. -5 Suppose 0 = -3h - 5 - 7. Let m be h/2 + (2 - -5). Let l(i) = -i*3 - 5i*2 + 7. Let w be l(-5). Solve 4g + mo - w = 0, 2o - o = 4g - 13 for g. 3 Suppose -2s + 10 = -5f, 4 + 4 = -2s - 4f. Solve 3c - 6 = s, 2c = -3b - 1 - 1 for b. -2 Let w = 1 + 3. Suppose -4k - w = 5y - 22, -3k + 16 = 5y. Solve -kc - 11 = 5h, -h - 5c = 3h + 19 for h. -1 Suppose -4 = -l, -a - 2a - 2 = -2l. Solve 0 = -as + 2j + 2, -2j + 14 = -4s - 7j for s. -1 Let c(v) = 3v - 9. Let i be c(6). Let f(k) = k - 4. Let w be f(i). Solve -3s = r - 0s + 1, wr = -2s - 5 for r. -1 Suppose 5 = -o + 9. Solve ok + 5y = 33, 5k - 4y = k - 12 for k. 2 Suppose 2q - 7 = -1. Solve qo + d - 12 = 0, 0o - 3d = 5o - 24 for o. 3 Let u = -34 + 34. Solve 3g - h - 3 = 1, 4g - 3h - 12 = u for g. 0 Let r(l) = -l + 6. Let s(y) = -y + 6. Let i(w) = -5r(w) + 6s(w). Let u be i(-6). Solve 0m - 5m = 2p + 9, 5p = -m + u for p. 3 Let k = 79 - 67. Solve 5z + 20 = 0, -5d + 0z - k = -2z for d. -4 Let u = 10 + -5. Let r(f) = -f + 6. Let p be r(6). Suppose -2c = -pc - 8. Solve j = ub + 14, -4b + cj = 3j + 12 for b. -2 Let r(n) = n*3 + 2n*2 - 3n - 3. Let t be r(-2). Solve 5y + tc = -2c + 30, 5c - 26 = -3y for y. 2 Suppose 0f = -f - 3. Let i be (-1 - f)-1 + 7. Solve 6g - 2 = 3g + 2z, -25 = -iz for g. 4 Suppose 2m = 4m - 10. Suppose -mi + 7 = -3. Let q(f) = -4f3 - 2f*2 + 1. Let j be q(-1). Solve 18 = iu + 4z, -4u + z + j = -2z for u. 3 Let g = -19 + 22. Solve 2s - 6 = 2r, -5r + 35 = gs + 2s for s. 5 Let y(t) = 2t + 7. Let j be y(3). Solve 4i - m = -6 + 17, -2i + j = -3m for i. 2 Suppose 12m - 13m = -4. Suppose -mj - 3d + 57 = 0, -63 + 23 = -3j - 5d. Solve 2n = o + o + 6, -5n + j = -2o for o. 0 Let x = 4 - 1. Let t(o) = 2o*2 + 1. Let s be t(-3). Suppose -u = -0 - s. Solve -5l = xd - u, 2l + d = -3 + 11 for l. 5 Let r = 12 + -10. Solve n + 0c - rc = -6, c - 10 = -3n for n. 2 Suppose -5y = -0y. Let a(l) = 9l*2 - l + 2. Let f be a(1). Suppose -3q + 18 = -3r, 5r = q - yq - f. Solve qi + o = -23, o + 11 = -3i - o for i. -5 Suppose 0 = 3f + 5s - 16, -3f - 1 = -2s - 3. Solve fh - 1 + 7 = 0, 2h + 1 = -r for r. 5 Let d = 4 - 6. Let z be 31(d + 3). Suppose -6 = -3f + z. Solve 3u + 2h - 3 = 2u, 5u + fh - 8 = 0 for u. 1 Let m be (-4)/(-10) - (-13)/5. Let d = -11 - -16. Let l(o) = -2o*2 - 2o + 1. Let i be l(0). Solve i = 2q + df - 16, 5q - 14 = -mf for q. 1 Let z(d) = -d*2 + 10d - 3. Let r be z(9). Suppose 2h - rh = -8. Solve 5j - 15 = hx, -5x + 2j - 1 = 5 for x. 0 Suppose -4h = -2h - 2d - 6, 4h - 18 = -2d. Solve hy - 3 - 17 = 4z, 0 = -2y - 2z - 10 for y. 0 Let o be (-64)/(-28) - 4/14. Suppose -o = -0k + 2k. Let a(z) = z2 + z. Let f be a(k). Solve -c + 5h + 10 = -4, f = -5h - 10 for c. 4 Let r = -39 + 66. Solve -2y - r = -5w, 0 = y + 3w - 11 - 3 for y. -1 Suppose 27b - 9 = 24b. Solve -l + 3l + 3d - 2 = 0, 0 = -bl + d + 14 for l. 4 Let t = -38 - -43. Solve -t = 5b, -5l + 3b = 7b + 4 for l. 0 Let u = -20 - -27. Solve -2l + 4r - 1 = -15, 4l + u = r for l. -3 Let m(l) = l*3 - 2l*2 + 5. Let z be m(3). Solve 2h + 0h = -5r + z, -5h + 1 = 4r for h. -3 Suppose 20 = 5l + b, 2l = 3b + 2b + 35. Solve -w - 4w = 3k + 14, lk - 5w = -10 for k. -3 Let k = -55 - -63. Solve -2f - p + 1 = 0, 0 = f - 0f + 3p - k for f. -1 Let j be ((-16)/40)/((-2)/(-30)). Let p(l) = 2l + 14. Let s be p(j). Solve 0 = -6g + g - st - 25, 2g = -5t - 31 for g. -3 Let w(a) = a*3 - 13a*2 - a + 16. Let p be w(13). Suppose h = 4x - 6 - 6, -3x = -ph. Solve 5u - 12 = -m, 0 - 15 = -xu + m for u. 3 Suppose -4h + 5p + 44 = 0, h + 2p - p - 2 = 0. Let k be 26/h - 1/3. Let w = -31 - -33. Solve l + 7 = -0l + wq, 5q + 2 = -kl for l. -3 Suppose 1 = -s + 4. Solve 0 = p + sm + 8, 4p - 5m - 12 = 7p for p. 1 Suppose 3c = -2p - 3p, 2p + c = 1. Solve 15 - 1 = 2k - 2t, 0 = -pt - 9 for k. 4 Let z = 22 + -17. Solve 0 = i + 5, i + 0i = -3k - z for k. 0 Suppose -6 = 9z - 12z. Solve m + 18 = -5u, m + 0 = zu + 3 for m. -3 Let y = 68 + -63. Solve -10 = -4s - yo + 3, -2o - 2 = 4s for s. -3 Suppose -4 = -f + 1. Solve t - 2t + 2s - 5 = 0, -3s = -ft - 11 for t. -1 Let k = 7 - 5. Let f(h) = 1 - 5h2 + 2h*k + 4h*2. Let m be f(0). Solve 2a - 6a = q - 4, 4q - m = -a for a. 1 Suppose 4i - 5i + 2j = -6, -3j = -6. Solve l + 4b - 4 = -l, 0 = 5l + 3b - i for l. 2 Let t = -7 + 17. Solve -2w - 4a + t = 2, -2a + 4 = -5w for w. 0 Let y be 4(6/(-4) - -3). Suppose 3d - 3 = y. Solve dc + 18 = -0z + 3z, 5c = -z - 12 for z. 3 Suppose 12 = -b - 0b. Let o be (8/(-10))/(b/60). Let z be (-2)/(-2) - 7/(-1). Solve 0r + 2a = -4r + 2, 2r = -oa - z for r. 2 Let n(p) be the second derivative of 0p*2 - 1/6p*3 + 0 + 1/2p*4 - 3p. Let a be n(1). Solve 3q = 3y + y + 13, -5*q - a = 0 for y. -4 Let r be (-502)/9 + 8/(-36). Let	{ "pile_set_name": "DM Mathematics" }
True Let y be 3/(9/1550) - (-6)/(-9). Suppose 3k - 634 - y = -5p, 4k = -2p + 1510. Does 75 divide k? True Suppose 173i = -11i + 1203176. Does 6 divide i? False Suppose -c + l = -16, 13l - 15 = 10l. Suppose 0 = -cg + 13g + 3808. Is g a multiple of 52? False Is ((5/10)/((-2)/32))/(4/(-1502)) a multiple of 6? False Suppose 14 = -3a - 1. Let h(s) = -3s*3 - 2s*2 - 4s - 3. Let m(u) = u3 - u2 + u - 1. Let z(j) = h(j) + 2m(j). Is 15 a factor of z(a)? True Let g(x) be the first derivative of -12x*2 - 68x + 12. Is 28 a factor of g(-18)? True Suppose -3r - 344892 = -4m, 5m - 6r + 8r - 431092 = 0. Does 6 divide 2/7 + m/70? False Suppose -2s + 8553 = -t, 5t + 4255 = 2s - 4286. Is s a multiple of 26? False Suppose 5g - 85 = h, g - 7 - 26 = -3h. Is 702 + -1 + (2 - g/9) a multiple of 14? False Suppose -9v + 1560 = -4v. Suppose -3w + 4f = -v, 0 = 4w - 9w + f + 520. Suppose 3g + 52 = 2u, -5u + 3g = 2g - w. Does 10 divide u? True Let c = -2143 + 6994. Is c a multiple of 63? True Is 29 a factor of 6 + (-800)/(3 + (-205)/65)? False Suppose -132814 = -5v - 11v - 41406. Is v a multiple of 129? False Suppose 229407 = 39n + 35811. Does 73 divide n? True Suppose -65p = -79p - 19026. Let i = -800 - p. Is 10 a factor of i? False Suppose 20q = 110189 + 65431. Is q a multiple of 120? False Let n(h) = h2 - 5h - 13. Let z(o) = -o*3 - 3o*2 + 3o + 1. Let u be z(-3). Let w = u + -1. Does 18 divide n(w)? False Let t(s) = 5s - 8. Let y be t(-9). Let a = -62 + y. Let i = 223 + a. Does 18 divide i? True Suppose -14 - 6 = -4s. Suppose -sj + 601 + 3584 = 0. Suppose 5f + 4l - j - 267 = 0, -3f + 658 = -2l. Is 55 a factor of f? True Let y(l) = -22l - 78. Let z be y(-4). Let w be ((-4)/10)/((-1)/(-40)). Is 12 a factor of (w/z)/((-22)/165)? True Let z(u) = -4u2 + 64u + 7. Let b be z(17). Let g = b + 208. Is 13 a factor of g? False Suppose -4w + 121 = 5q - 284, 3q - 5w = 206. Let r be ((-31)/4)/(6/24). Let s = r + q. Is s a multiple of 5? False Let v(g) = -2g - 21. Let c(j) = -3j - 20. Let x(r) = 5c(r) - 4v(r). Let k be -16(-3)/(-2)11/22. Does 8 divide x(k)? False Let q(l) = l*2 - 20l + 36. Let n = 196 - 168. Is 4 a factor of q(n)? True Does 18 divide (306/221)/(-9) + (-372764)/(-13)? True Let w(i) = 22i2 + 69i + 994. Is w(-32) a multiple of 9? False Suppose -47x + 46x = -30. Is 32 a factor of 1120/2136/x? True Let f(r) be the second derivative of 1/2r*2 + 29/20r*5 + 2r - 1/6r3 + 0r*4 + 0. Is 29 a factor of f(1)? True Let b(u) = 5u*2 - 3u - 76. Let d be b(9). Let v = 325 + d. Is v a multiple of 57? True Let s(c) = -c*3 - 11c*2 - 24c + 3. Let d be s(-8). Does 47 divide 1747/d - 20/(-30) - 2? False Suppose 6p = 2p + 3n - 108, -108 = 4p + 2n. Let a be (-13335)/168 + 6/16. Let u = p - a. Is 15 a factor of u? False Let w = -11961 - -51636. Does 15 divide w? True Let t(n) = -73n3 - n2 - n + 2. Let i be t(1). Let a = 75 + i. Suppose 0 = -aq - 10, x - 2q + 3q - 9 = 0. Is x a multiple of 7? True Let y(d) be the third derivative of d6/60 + d5/60 + d4/8 + 211d*3/3 + 24d*2. Does 34 divide y(0)? False Let w(y) be the second derivative of 3y4 - y3/6 - 3y2/2 - 23y. Let u be w(4). Suppose -3c + u = 11. Is c a multiple of 31? True Let l(g) = 266g + 6. Let f be l(1). Let a = 385 + f. Does 62 divide a? False Suppose 0 = -3i + m + 15, 4i = -5m + 15 + 24. Suppose ib = b + 490. Is 18 a factor of b? False Suppose 495 + 305 = -5u. Let j = 39 + -3. Is 9/(j/u)(-12)/8 a multiple of 6? True Suppose 2585 = -2d - 3y, -4d - 6y = -y + 5169. Let l = d - -2341. Is 15 a factor of l? True Let z(q) = q*3 + 14q*2 + 16q - 16. Let v be 2/(-8) - 476/16 - 2. Let x = 20 + v. Is z(x) a multiple of 16? True Let f = 1982 - -10173. Does 65 divide f? True Let b = -4608 - -5538. Is 4 a factor of b? False Let r = 5481 + -5160. Does 20 divide r? False Let l be ((-3972)/(-10))/(32/(-20) - -2). Suppose 4q - 5t = 3583, 3t = 4q - 4578 + l. Is 39 a factor of q? True Let h be (1 - 3)/((-5)/18456). Let f = h + -90. Is f a multiple of 2? False Suppose -23y + 10608 = -9931. Suppose 0 = 6s - y - 367. Is 15 a factor of s? True Suppose 192 = -2g + 4g. Let q be (16/(-12))/((-2)/g). Suppose q = w - 3a, 2w = 6w - 5a - 284. Does 38 divide w? True Let v(b) = 21b - 59. Let i be v(3). Suppose iw - 5047 = -1207. Does 64 divide w? True Let k(f) = -f3 - 6f*2 + f. Let b be k(-6). Let q be -47 - (-3)/(b/(-4)). Let z = 125 + q. Is 15 a factor of z? False Suppose 6i - 3i = 12. Let p be (i(-4)/8)/(2/24). Does 14 divide 2 + -3 - -2 - (p + -2)? False Suppose -4g = 5h - 1548 + 467, -5h - 2g = -1083. Let r = 318 + -203. Let t = h - r. Is 10 a factor of t? False Let t(j) = 126j + 12751. Does 6 divide t(-56)? False Let d = -169 - -172. Is (-1 - -47)/(d - 1/1) a multiple of 4? False Suppose 5d = -2n + 931, -2d + 3d - 3n - 176 = 0. Let k = -153 + d. Is k a multiple of 8? True Suppose 5l - 5j = 8l - 90, 120 = 4l + 4j. Suppose -5s - 10 = -l. Suppose 0 = 4h + 2a - 86, -82 = -3h - a - sa. Is 19 a factor of h? True Let y(p) = -35p + 16p + 207 + 10p. Is 6 a factor of y(9)? True Let l(h) = -h2 + 19h + 2. Let a be l(20). Let t = a - -41. Is (t/(-5))/((-1)/5) a multiple of 11? False Suppose y - 3x + 13 = 0, -y - x + 12 = 5. Suppose 0 = yf + 10f - 2604. Is f a multiple of 31? True Suppose 0 = -7m + 15m - 1208. Let h = 410 - m. Is 37 a factor of h? True Suppose 5j - 3o = -5, 0 = -j - o + 3 + 4. Suppose -i = 2h - 56, -jh + 10 - 128 = -2i. Does 29 divide i? True Let q be (2/(-1) - (-1 - -2))-1. Let z be (q + -4)39 + -1. Let k = 63 + z. Is k a multiple of 3? False Let r(u) = -u*2 - 10u - 9. Let o be r(-5). Let l = 49 + o. Let f = -23 + l. Does 10 divide f? False Suppose -3v = -12v + 396. Let o = -37 + v. Does 3 divide o? False Let w(u) = 1311u + 428. Is 26 a factor of w(6)? True Let q = 2685 - 1690. Suppose 13v + q = 3322. Is v a multiple of 13? False Let b(w) = 77w2 - 11w + 146. Is b(6) a multiple of 23? True Suppose 3d - 49 = 2. Let g(v) = 18v - 7. Does 23 divide g(d)? True Let y(u) = -12u + 4u - 13 - 11u - 19 - u2. Let h be y(-17). Does 8 divide (h(-42)/(-10))/((-6)/(-80))? True Let i(s) = -s*2 + 7s - 2. Let o be i(5). Is (46528/20)/o + 1/5 a multiple of 12? False Suppose 3j - 992 = -5v, -3v - 6j + 596 = -4j. Suppose 1037 = 5z - g, -z + v = -8g + 4g. Is z a multiple of 52? True Is 6 a factor of -210-1452/182? True Suppose -2d - q = -0q - 1, -4d + 2q + 14 = 0. Suppose t - 1461 = -0t - dl, -5799 = -4t + l. Is t a multiple of 12? False Suppose -19n = -10n - 63. Suppose 888 = -nh + 11h. Is 7 a factor of h? False Suppose -395r + 400r = -2w + 46184, -3w = 5r - 69276. Is 17 a factor of w? False Let z(m) = -m + 1. Let o(d) be the first derivative of 11d3/3 + d2 - d - 17. Let w(j) = o(j) + 5z(j). Is 12 a factor of w(4)? True Let j be 280/(-80) - 1602/4. Let n = j - -858. Is n a multiple of 10? False Suppose 0 = -2j + 4f + 39136, -3j + 58674 = -f + 5f. Does 29 divide j? False Suppose 5t + u - 1 = 0, u = -4t - u + 2. Let d be (4 - t - -2) + -1. Suppose z + 160 = 4c - 135, c - dz = 50. Is 15 a factor of c? True Let h(p) = 137p + 236. Does 14 divide h(4)? True Let b = 197 - 194. Suppose -5y - 1057 = -3f, 0 = -bf - 4y + 158 + 908. Is 72 a factor of f? False Suppose -37s - 28s + 555289 + 241091 = 0. Is 12 a factor of s? True Let w be 24(-4 - (-70)/15). Suppose -ws = -18s + 58. Suppose 0 = 3g - 43 - s. Is g a multiple of 6? True Suppose -3v = q - 2062, -4v - 55q + 2754 = -53q. Does 10 divide v? False Let g(y) be the second derivative of -2y*5/5 + 5y*4/12 + 3y*3/2 + 3y*2/2 + 4y + 22. Is g(-3) a multiple of 13? False Is 17791 + (-27)/36-20 a multiple of 24? False Let a(n) = 197n*2 - 11n - 47. Does 67 divide a(-4)? True Let u(s) = -14s + 75. Suppose -2t - f + 6 = -5f, -t - 3f + 8 = 0. Does 2 divide u(t)? False Let u(x) = x*3 + 2x*2 - 4x + 4. Let f be u(-3). Let q(t) = -11t + 64. Let z be q(f). Let r(l) = -24l + 58. Is 43 a factor of r(z)? False Let h = -489 + 1516. Let l = h + -497. Does 30 divide l? False Let j(r) be the second derivative of -34r - 4r*2 - 1/2r**3 + 0. Is j(-7) a multipl	{ "pile_set_name": "DM Mathematics" }
+ ru and give f. -9 Express -h - 4h + 4h - 1 - 2h + 1 + (1 + h - 1)(-2 - 1 + 4) + 0 - 2h + 0 - h + 4h - 5h + (h + 0h + h)(44 + 26 + 7) in the form yh + k and give k. 0 Express 2l*2 + 0l*2 - 5l*2 + (4l - 2l - l)(-2 + 2l + 2) as w + zl + dl2 and give d. -1 Express -2m*2 - 51m - 25 - 45 + 51m in the form t + pm + zm2 and give t. -70 Express (0 + 1 + 0)(-a3 + a3 + 2a3) - a3 - 2 + 2 + (6a*2 - 3a*2 + 3a*2)(3a - 3a + 6a) in the form k + na + qa3 + oa*2 and give q. 37 Express ((-4 + 3 + 3)(4 + 3 - 5) - 2 + 6 - 2 + 0 - 2 + 3 - 3 + 0 + 2)(21i*2 - 34i + 34i) in the form ui*2 + vi + h and give v. 0 Express 4y2 + 2y*3 + 6y - 7y2 - 23y in the form by + l + sy*3 + hy*2 and give b. -17 Rearrange -31s*2 - 45s*2 + 59s*2 to ms*2 + v + hs and give m. -17 Rearrange -5 + 2t + 4 + 0 - t2 + 3t*3 to zt*2 + w + kt*3 + at and give k. 3 Express -2i2 + 3i*4 + 2i*2 + 88i*3 - 92i*3 - 2 - 2i in the form x + ji3 + mi*2 + ui*4 + pi and give j. -4 Rearrange 29 + 3k3 - 29 + 3k*2 + 0k*3 to the form uk + o + dk2 + bk*3 and give d. 3 Express -5c*2 + 4c*2 - 4c + 1 - 3c4 + 0c*4 + 3c + 2c3 in the form v + fc + zc2 + bc*4 + pc*3 and give b. -3 Express 0 - 12i - 3 + 3 as x + ni and give n. -12 Express (5n - 24n - 5n)(-3n + 3n + n) + (2 - 5 + 2)(3n2 - 4n2 - n2) as xn + v + jn*2 and give j. -22 Express (4x - 5x - x)(11 + 32 + 6) + 2x - 2x - x as u + fx and give f. -99 Express 0 - 83i*2 + 32i*2 - 2 in the form mi*2 + xi + q and give q. -2 Rearrange 1 - 10 + 0q3 - 4q*3 to zq*3 + nq*2 + pq + b and give b. -9 Express (9t4 - 6t*4 + 6t*4)(2 - 4 + 3 + 1 - 2 + 3 + (-3 + 2 + 2)(-2 - 3 + 4)) in the form gt*2 + nt*4 + ut*3 + b + dt and give n. 18 Rearrange 58y - 58y - 29y2 to the form vy + ty2 + l and give t. -29 Express (-3j + 3j - 4j)(-j - 10j - 10 + 11) in the form gj + y + lj*2 and give l. 44 Rearrange 2m*2 - 9m*2 - 2m*2 - 3m*2 to the form r + tm + lm2 and give l. -12 Rearrange -3v*2 + 12v + 6v2 - 6v to tv + rv*2 + d and give r. 3 Express (6q + 2q - 47q)(q + 1 - 1) + 2q - 2q + q2 + (q + 3 - 3)(-2q - 1 + 1) as cq*2 + yq + k and give k. 0 Rearrange (-2y + y + 2y)(-y - 2y + 5y + (-4 + 4 + 2)(-y + 2y + y) + (3 - 4 + 2)(-1 - 2y + 1) - y - 6y + 4y) to wy*2 + p + ky and give w. 1 Rearrange (0n + 0n + n*2)(-5 + 2n + 5)(-5 - 1 + 3)(-5 + 3 + 0 + (-8 + 4 + 0)(4 - 2 + 0)) to pn2 + vn + j + kn3 and give k. 60 Rearrange (5 + 2 + 5)(-2w2 + w2 + 3w*2) - 1 + 2w*2 + 1 + (w - 2w + 2w)(4 + w - 4) - w*2 - 3w*2 + 2w*2 to the form gw*2 + l + jw and give g. 25 Rearrange 1 - 1 + m*4 + 3m + 3 to vm2 + wm + rm3 + ym*4 + b and give w. 3 Express 8i + 2 + 24i + 5i as j + ti and give t. 37 Express -16t4 + 4 + t3 - 2t2 + 3t + 18t4 + 0t*2 in the form b + rt*4 + vt + ht3 + it*2 and give r. 2 Rearrange -86u - 56u2 + 14u*2 + 86u to the form j + nu2 + wu and give n. -42 Express (2l - 5l + l + 5l3)(l + 2l + 0l) in the form y + nl2 + ol + xl3 + bl*4 and give n. -6 Express 19m + 19m2 - 12m - 8m + 0m in the form wm2 + gm + j and give g. -1 Rearrange 3j2 - j2 - j2 + (2j + 0j + 0j)(j - j + j) + (-2j + 3j - 3j)(4j - j - 5j) to the form sj + aj2 + m and give a. 7 Express (2f*3 + 0f + 0f3 - 2f)(7 + 7f - 7)(-2 + 2 - 2) as of + vf3 + w + gf*4 + uf*2 and give u. 28 Express 2t + 16t - 9t as ot + z and give o. 9 Rearrange 3i*2 - 2 + 2 - 7i*2 to q + wi*2 + gi and give w. -4 Rearrange 0q + 0q + q*2 - 18q*2 to the form jq + f + nq2 and give n. -17 Rearrange 44 + h2 - h + h2 + 7 to the form fh*2 + o + ph and give p. -1 Express -t + 23 - 4t - 23 as jt + n and give j. -5 Express -2 - 10 + 20b + 12 as f + nb and give f. 0 Express (12n2 - 17n*2 - 18n*2)(3 - 2n - 3)(1 - 2 + 3) as pn3 + jn*2 + h + gn and give p. 92 Rearrange (-3 + 3 + 2)(-35z + 8z - 176z) to xz + c and give x. -406 Express b3 + 0b*3 + 6b3 - b3 + 3b2 as zb*3 + jb*2 + n + wb and give z. 6 Express (i*2 - 3i2 + i2)(3 - 4 + 0) + (-i + 2i - 7i)(3i + i - 6i) as r + qi2 + li and give q. 13 Rearrange -13m3 - 7m*3 + 13m*3 - 5m to the form jm2 + qm*3 + hm + g and give q. -7 Express -6k + 16k + 2k + 8k as qk + s and give q. 20 Rearrange -6r + 0r2 - 10r + 2r2 + 29r to the form sr2 + u + tr and give t. 13 Express -3c - 26c - 3c in the form rc + k and give r. -32 Express (6z + 35 - 35)((-5 + 2 + 1)(-1 + 1 - 4z) - 5z + 2z + z) in the form x + pz + hz*2 and give x. 0 Rearrange (s + 1 - 1)(6 - 14 - 10) to the form z + hs and give h. -18 Rearrange (1 - c - 1)(0 + 0 + 2c) + 3c*2 - 2c*2 + 0c*2 + (-3c + 3c + c2)(2 + 2 - 2) - 5c2 + 2 - 2 to pc*2 + z + wc and give p. -4 Express (15 + 13 - 5)(v2 + v3 - v2) in the form lv + w + qv3 + zv*2 and give q. 23 Rearrange 4c - 2c - 5c - 3 + 3 + c + (-3 + 3 + c)(-2 + 0 + 0) + (3 - 5 + 3 - c)(-1 + 1 + 1)(-4 + 7 + 25) to the form ac + d and give d. 28 Rearrange 2 + 2h + 2h*2 - 2h + 4h2 to the form v + uh*2 + zh and give v. 2 Express -34y3 + 69y*3 - 33y*3 - 2 + 15y as cy2 + x + zy + uy3 and give z. 15 Rearrange 8 - 2s - 8 + 4s to xs + g and give x. 2 Express (b - 2b - b)(5b + 4 - 4)(6 - 4 + 0) + (3b2 - 2b2 + b2)(4 + 0 - 3) + 3b2 - b2 + 0b2 in the form m + xb*2 + zb and give x. -16 Rearrange (3 - 4 + 0)(4v - v - 4v)(24 + 0 - 5) to the form uv + s and give u. 19 Rearrange (0 - 5 - 3)(5 - 5 - 2g2) to the form sg + x + ig2 and give i. 16 Express (-2v*2 + 3v*2 - 5v*2)(0v + 6 + 2v - 3v) in the form cv + sv3 + r + kv*2 and give k. -24 Express (6 + 0 - 8)((t + 0 + 0)(-4 + 1 + 1) + (0t + 4t + 0t)(1 - 2 + 4)) in the form xt + n and give x. -20 Rearrange j*3 - 4j*2 - 2j + 0j + 4j*2 to the form sj*3 + vj + w + tj2 and give t. 0 Rearrange 3i*3 + 4i*2 + 14i*2 - 6i*3 - 17i*2 + 2 to ci*2 + bi*3 + y + si and give b. -3 Express l2 + l3 - l*2 + (1 + 5l - 1)(4l*2 - 4l*2 + 6l*2) + 0l*3 - 3l*3 + 2l*3 as rl + a + ml3 + sl*2 and give m. 30 Express 34b*2 + 2b*3 - 19b*2 - 19b*2 in the form rb*2 + n + zb*3 + cb and give z. 2 Express -8b + 4b*2 + 0b2 - b2 - 5b2 as lb + ob2 + q and give o. -2 Rearrange -4 + c2 + 6c + 4 + 0c2 to fc + s + pc2 and give f. 6 Express 5 - 5c*2 + 5 - 7 in the form b + gc + kc2 and give k. -5 Express (-3 + 3a*2 + 3)(5a - a - a) + (-a + a - 2a*2)(-4a - 13 + 13) in the form ua + ia3 + sa*2 + d and give u. 0 Express 0r*2 - 2r*2 - 2r*3 + 2r - 2r2 in the form xr + s + kr3 + hr*2 and give h. -4 Rearrange -6n*2 + 15 + 0n*2 + 10 - 6 to kn*2 + q + wn and give k. -6 Express (-g - 2g2 - g + g)(19 - 19 + 3g) - 4g - 3g3 + 4g as yg2 + s + tg + cg3 and give y. -3 Express -6 - 10h*2 + 4 + 2 in the form kh + sh2 + t and give s. -10 Rearrange -7g*2 + 3g*2 + 2g*2 + (2 - 2 - 2g)(2g - 1 + 1) + (-2 + 2g + 2)(-4g + 2g + g) to o + qg2 + ug and give q. -8 Rearrange (0i - i + 2i + (2 + 0 - 1)(-i - i + 0i) - 4i - 5i + 5i)(2i2 - i2 + i2) + 5 - 5 + 2i*3 to ni + ai2 + fi3 + g and give f. -8 Express -o4 + o + o + 2o3 - 4o - 4o2 + 0o*3 in the form h + bo + go2 + fo*4 + no3 and give g. -4 Express r2 - 2r + 2r + (3r - 2r + 0r)(r + 4r - 4r) + 25r - r2 + 3r*2 - 26r as j + nr2 + xr and give x. -1 Rearrange (2k - 3 + 3)(3k2 + 0k + 0k) + k3 + 0k*3 - 4k*3 to wk*2 + b + ck + ak3 and give c. 0 Express (-3z*3 + 3z*3 - 2z2 + z3)(4 + 7 + 5) in the form nz*3 + vz*2 + iz + t and give n. 16 Rearrange (0s2 + 4s*2 - 2s*2)(5 - 3 - 3) + 13s - 13s - 3s2 + (s - 2s - s)(2s - 2 + 2) to g + ns + ys*2 and give y. -9 Rearrange 2 - 5 + 5 + 18v*3 to av*2 + d + sv*3 + nv and give s. 18 Rearrange -3o + o3 - 1 + 2o - 40o4 + 41o*4 - 2o*2 to uo + vo*3 +	{ "pile_set_name": "DM Mathematics" }
hat is the least common multiple of 54 and 16650? 49950 What is the common denominator of 17/18660 and -87/49760? 149280 Calculate the lowest common multiple of 5111 and 703. 189107 Calculate the lowest common multiple of 29614 and 12529. 325754 Find the common denominator of 167/1260 and 163/18540. 129780 Calculate the common denominator of 1/351733 and -41. 351733 What is the common denominator of -111/1736 and 17/114? 98952 Calculate the common denominator of -16/18171 and 7/261. 526959 Calculate the smallest common multiple of 13860 and 128184. 21150360 What is the least common multiple of 493 and 29461? 854369 What is the least common multiple of 596460 and 33? 6561060 Calculate the least common multiple of 33276 and 12408. 732072 What is the common denominator of 143/6 and 24/12527? 75162 What is the common denominator of 59/126 and -97/1582476? 4747428 Calculate the common denominator of -5/1792 and 145/4224. 59136 Find the common denominator of 33/122048 and 111/10. 610240 What is the smallest common multiple of 4545 and 315? 31815 Calculate the common denominator of 61/255012 and -157/8070. 1275060 Find the common denominator of 111/238 and -83/13244. 225148 What is the least common multiple of 24 and 48804? 97608 Calculate the least common multiple of 486 and 26946. 242514 What is the common denominator of 25/4473 and 79/126? 8946 Calculate the common denominator of 137/11830 and -131/1092. 70980 Find the common denominator of 181/15330 and 157/3066. 15330 What is the common denominator of 89/44 and 53/130388? 1434268 Calculate the lowest common multiple of 294 and 41286. 289002 Calculate the common denominator of 97/18 and -37/112125. 672750 Calculate the common denominator of 56/25 and -59/92200. 92200 Calculate the common denominator of 79/2256 and -43/4. 2256 Calculate the common denominator of -71/1512 and -43/4158. 16632 Calculate the lowest common multiple of 70 and 19440. 136080 Calculate the common denominator of 133/83490 and 87/194810. 584430 Calculate the least common multiple of 44 and 14492. 159412 Calculate the smallest common multiple of 6192 and 96. 12384 Calculate the smallest common multiple of 174 and 45066. 45066 What is the lowest common multiple of 246 and 2298? 94218 What is the lowest common multiple of 36848 and 364? 479024 Find the common denominator of -47/72 and 23/16182. 64728 What is the common denominator of 79/8082 and 26/7719? 20794986 Calculate the common denominator of 39/1064 and 31/257640. 1803480 Calculate the least common multiple of 450 and 14100. 42300 What is the common denominator of 36/274507 and 20/831? 823521 Calculate the common denominator of 103/44 and -71/277101. 1108404 What is the least common multiple of 604 and 9664? 9664 Calculate the common denominator of 57/404635 and 25/66. 2427810 What is the common denominator of -49/2844 and -103/80580? 241740 What is the common denominator of -9/88618 and 35/4? 177236 What is the common denominator of 57/161 and -40/19? 3059 Calculate the lowest common multiple of 194290 and 1787468. 8937340 What is the lowest common multiple of 393536 and 2464? 2754752 Find the common denominator of 59/2310 and -139/12474. 62370 Calculate the common denominator of -23/524 and 31/1068. 139908 Find the common denominator of -49/58 and 59/92976. 2696304 Calculate the lowest common multiple of 73414 and 176. 587312 Calculate the common denominator of -38/2637 and 64/477. 139761 Calculate the common denominator of 17/12 and -25/88812. 88812 Calculate the common denominator of -83/179490 and 83/80. 1435920 Calculate the common denominator of 55/122 and 21/6344. 6344 Calculate the least common multiple of 504 and 8232. 24696 Calculate the common denominator of 181/4890 and -119/18. 14670 Calculate the lowest common multiple of 17400 and 270. 156600 What is the smallest common multiple of 54418 and 163254? 163254 What is the common denominator of -157/2970 and 123/20900? 564300 Calculate the least common multiple of 51030 and 790. 4031370 What is the common denominator of -127/27566 and -9/121? 303226 Calculate the smallest common multiple of 2136 and 512. 136704 Calculate the lowest common multiple of 9336 and 7002. 28008 Find the common denominator of -103/5004 and 63/220. 275220 What is the common denominator of -53/44 and -125/961408? 10575488 Calculate the common denominator of -56/33 and -137/66. 66 Calculate the common denominator of 59/51465 and -8/511. 360255 What is the common denominator of 26/231 and 26/9219? 101409 Calculate the common denominator of 52/7965 and 127/26550. 79650 What is the common denominator of 29/207 and -103/1242? 1242 What is the smallest common multiple of 4961 and 57482? 6955322 What is the lowest common multiple of 3159 and 3355? 10598445 Calculate the smallest common multiple of 708476 and 9574. 708476 What is the least common multiple of 17280 and 1536? 69120 Calculate the lowest common multiple of 8547 and 154. 17094 Calculate the common denominator of -89/62952 and -47/3294. 566568 What is the common denominator of -3/250 and 69/50? 250 What is the least common multiple of 50205 and 90369? 451845 Calculate the common denominator of 137/1482 and 109/5928. 5928 What is the least common multiple of 1224 and 81? 11016 What is the least common multiple of 21720 and 13032? 65160 Calculate the smallest common multiple of 21775 and 117. 195975 Calculate the smallest common multiple of 26100 and 72. 52200 Calculate the smallest common multiple of 372960 and 4480. 1491840 What is the common denominator of 99/21500 and 83/160? 172000 What is the common denominator of 7/14706 and -25/28044? 1205892 Calculate the least common multiple of 130 and 29081. 290810 Calculate the lowest common multiple of 44 and 224. 2464 Calculate the least common multiple of 486962 and 834792. 5843544 Find the common denominator of 32/64275 and 109/120. 514200 Calculate the common denominator of -52/55 and -71/97130. 97130 What is the smallest common multiple of 28994 and 178106? 1246742 Calculate the common denominator of -19/44208 and -50/52497. 839952 Calculate the smallest common multiple of 9526 and 55. 47630 Calculate the common denominator of -81/266 and 103/20938. 146566 Calculate the smallest common multiple of 277773 and 1431. 2499957 Calculate the smallest common multiple of 21825 and 683850. 2051550 What is the smallest common multiple of 19404 and 1372? 135828 What is the lowest common multiple of 49950 and 300? 99900 What is the least common multiple of 260 and 1720? 22360 What is the lowest common multiple of 81 and 2358? 21222 Calculate the common denominator of 4/9225 and -17/15. 9225 Calculate the common denominator of 17/2072 and -7/752. 194768 What is the lowest common multiple of 7 and 639402? 4475814 What is the common denominator of 133/3768 and 103/212? 199704 What is the smallest common multiple of 117 and 22374? 290862 Find the common denominator of -5/1934 and -57/86. 83162 Find the common denominator of -25/6 and 51/17770. 53310 What is the smallest common multiple of 53663 and 824? 429304 What is the common denominator of 39/124340 and 7/40? 248680 What is the common denominator of -7/7264 and 43/1744? 791776 Calculate the common denominator of -13/559665 and -17/24. 4477320 What is the least common multiple of 3774 and 370? 18870 What is the lowest common multiple of 2616 and 612? 133416 Calculate the least common multiple of 190 and 150062. 750310 Find the common denominator of -23/125720 and -127/53880. 377160 What is the common denominator of 55/32 and -71/4388? 35104 What is the least common multiple of 10 and 59170? 59170 Calculate the smallest common multiple of 18 and 1154290. 10388610 What is the least common multiple of 13700 and 45210? 452100 What is the smallest common multiple of 13245 and 8358? 36900570 What is the smallest common multiple of 1862 and 27930? 27930 What is the smallest common multiple of 333 and 3? 333 Calculate the lowest common multiple of 1397 and 90297. 993267 Calculate the common denominator of -97/80 and 51/18958. 758320 What is the smallest common multiple of 11132 and 4554? 100188 Find the common denominator of 50/627 and -65/31262. 1781934 What is the smallest common multiple of 2219	{ "pile_set_name": "DM Mathematics" }
-y + 44. Calculate the remainder when ((-77)/11)/((-2)/r) is divided by n(27). 15 Let v = -6902 + 7377. What is the remainder when v is divided by 20? 15 Let b(l) be the third derivative of l5/60 + l4/8 - 6l3 + 3l*2. Calculate the remainder when 1066/8 - 3/12 is divided by b(7). 31 Suppose -a = 2w - 48, -623a = -620a - 5w - 122. Calculate the remainder when 5628 is divided by a. 40 Let j(q) = -12 - 8 + 19q - 38q. Let i(u) = -37u - 39. Let r(v) = -4i(v) + 7j(v). What is the remainder when r(7) is divided by 41? 39 Let j be (-441 + -3)/6 - 4. Let r = 326 + -219. Let k = r + j. What is the remainder when k is divided by 3? 2 Suppose -17o - 13o - 48o + 66612 = 0. Calculate the remainder when o is divided by 22. 18 Suppose -3q + 8q = 0. Suppose -3r = -qr - 144. Suppose -4l = -r + 36. What is the remainder when 7 is divided by l? 1 Let m(z) = 37z3 - z2 - z + 1. Let i be (-2)/36/(-2). Calculate the remainder when m(i) is divided by 14. 11 Let b = -62 + 192. Calculate the remainder when -13(-3)/78 - b/(-4) is divided by 13. 7 Let s(v) = 3v. Let r = -2033 + 2105. Calculate the remainder when r is divided by s(5). 12 Let c(v) = 7v2 - 36v - 57. Calculate the remainder when c(9) is divided by 52. 30 What is the remainder when 1423 is divided by 4536/144 + (-92)/(-18) + -5? 13 Calculate the remainder when ((-2)/(-6) - ((-1)/(-1))/1)-753 is divided by 145. 67 Let i(l) = -3l - 11. Let u be i(-5). Let d(b) = b + 6. Let f = 684 + -679. What is the remainder when d(u) is divided by f? 0 Suppose 0 = 301v - 303v + 24. Let u(h) = -h3 - 3h*2 - h + 3. Let p be u(-4). Let j = p - v. What is the remainder when 19 is divided by j? 8 Suppose -4f - 2o + 386 = 0, 2f - 15o + 17o = 198. Calculate the remainder when 1219 is divided by f. 91 Let b(i) = -i*2 - 2i - 3 + 5 - 3. Let q be b(-3). Let r(u) = 2u2 + 5u - 2. What is the remainder when 17 is divided by r(q)? 7 Suppose -2h + 4w = -28, -5h + 4w = -h - 36. Calculate the remainder when 123 - (3 + h - 6) is divided by 33. 23 Suppose 3r = -9m + 213, -2r + 19 - 9 = 0. What is the remainder when 0 + 1 - 38/(-1) is divided by m? 17 Let h be (-1)/2 - 54/4. Let q = 1203 - 1183. Let i = q + h. What is the remainder when 46 is divided by i? 4 Calculate the remainder when 8/36 - 56296/(-279) is divided by 21. 13 Suppose -1510 = -3r - 4c, 6r - r + 4c - 2506 = 0. Suppose -k + r = 5k. Let y(q) = -q + 8. Calculate the remainder when k is divided by y(-6). 13 Calculate the remainder when 396 is divided by (-4 - 115/(-20))28. 4 Let b(n) = 8n + 5n2 - 9n - 3n2 + 2n*2. What is the remainder when 1(3 - (-30)/(20/4)) is divided by b(-1)? 4 Suppose 3o = 4w - 173, w = 5w + o - 161. Suppose 2v = -u + 81, 1002 = 4u - 4v + 630. What is the remainder when u is divided by w? 7 Let y = -817 - -870. Calculate the remainder when y is divided by 12/20 + (-261)/(-15). 17 Suppose 0 = -8d + 106 + 166. Suppose -37f = -df - 60. What is the remainder when f is divided by (-66)/44/(-6)? 9 Let c(g) = 18g2 - g - 1. Let w be c(-1). Let v be 891/w + 1/2. Let f = v + -18. What is the remainder when f is divided by 9? 5 Let q(v) be the first derivative of -v3/3 + 4v*2 - 15v - 29. Let r be q(6). Let x(h) = -17h + 3. Calculate the remainder when x(r) is divided by 21. 12 Let h = 391 - 234. What is the remainder when 778 is divided by h? 150 Let f = 200236 - 200154. Suppose 0 = 2k + 2o - 0o - 322, -o = 0. Calculate the remainder when k is divided by f. 79 What is the remainder when (0 + 5)7020/50 is divided by 351? 0 Suppose -109q = -160096 - 161781. What is the remainder when q is divided by 19? 8 Suppose -1026 = -4o - 282. Let c = o - -289. Calculate the remainder when c is divided by 96. 91 Let l(k) = -17k - 4. Suppose 127 = 4s + 5f, -22s + 4f + 202 = -12s. Calculate the remainder when l(-4) is divided by s. 18 Suppose 0 = -10f - 0f - 0f + 430. What is the remainder when 286 is divided by f? 28 Let o(v) = -v*2 - 66v - 769. What is the remainder when 248 is divided by o(-23)? 28 Suppose 35l = 36l - 2. What is the remainder when 94 is divided by ((-74)/(-111))/(l/72)? 22 Let f be 4 - (-4)/8-10. What is the remainder when 14f-360/21 is divided by (2/(-1))/((-2)/25)? 20 Suppose -12464 = -6l + 44l. Let t = 337 + l. What is the remainder when (48/15)/(2/10) is divided by t? 7 Let a = -273 + 378. Suppose 3p + 75 = -3n, -p - 45 = -3n - n. Let b = p + 56. Calculate the remainder when a is divided by b. 24 Suppose 8h = -h + 837. Let q be 1 - 5/((-15)/(-9)). Let n = h - q. What is the remainder when n is divided by 27? 14 Let k be (2/(-7) + 318/(-63))30. Let h = 190 + k. Calculate the remainder when 146 is divided by h. 26 Suppose 9f - 7f = 5o - 242, -12 = -3f. What is the remainder when 281 is divided by o? 31 Let d(o) = -o2 - 41o - 114. Let z be d(-18). Let j = z - 268. Calculate the remainder when 83 is divided by j. 19 What is the remainder when ((-4910113)/(-7410) - (-2)/(-15))(1 - -1) is divided by 86? 35 Suppose -5s + 4g = 23, s - 2g = -0g - 7. Let i(q) = -3q3 + q2 - 3q - 4. Let x be i(s). Let o = 135 - x. What is the remainder when o is divided by 26? 14 Let s(z) = z3 + 14z*2 - 117z - 53. Calculate the remainder when s(-19) is divided by 41. 37 Let p be 13 - (-8)/(-28)-7. Suppose -pc = -z - 0 - 2, -4z = -c - 11. What is the remainder when z is divided by 2? 1 Let u(f) = -82f3 + 2f*2 + f. Let y be u(-1). Suppose 115t = 100t + 1440. Let i = t - y. Calculate the remainder when 35 is divided by i. 9 Let j(m) = m2 - 15m. Suppose 5v - 77 = i, -2i + 5i = 2v - 36. Let k be j(v). Suppose k = -0o + 11o - 44. What is the remainder when o is divided by 1? 0 Suppose 72l = 981 + 459. Suppose -t - 3 + 6 = 0. Suppose 2 = 2v - 5o - l, -to = 0. What is the remainder when 43 is divided by v? 10 Calculate the remainder when (19 - 399/19) + 963 is divided by 474. 13 Let u(i) = -i*3 + 9i*2 + 2i + 35. Calculate the remainder when 1413 is divided by u(0). 13 Suppose -4p + 41 = 5h, 2h = 5p - 29 - 14. Let b(q) = -7 - 5q + pq + 3q. What is the remainder when 51 is divided by b(3)? 9 Let j be -2 + ((-2)/(-4)22 - 4). Let y be (-2)/4 + 830/4. Suppose jn - 63 = y. What is the remainder when n is divided by 11? 10 Let j = -25 + 50. Let z = -316 - -321. Suppose 0v + 5p + 345 = zv, 3p - 9 = 0. Calculate the remainder when v is divided by j. 22 Suppose 3i + 263 = 130 + 169. What is the remainder when 13880 is divided by i? 8 Let f be -7(1 + -3 + 96/21). Let y = f + 64. Let d = -12 + 24. Calculate the remainder when y is divided by d. 10 Suppose -b - 35 = -3f + 165, 4b + 317 = 5f. What is the remainder when 1020 is divided by f? 54 Let t = 36 - -60. Suppose 2v - t = -4s, -2v + v = 3s - 74. Calculate the remainder when 337 is divided by s. 25 Calculate the remainder when -9 - 1 - -3 - (-2 - 9346) is divided by 18. 17 Suppose 6f - 3654 = -36f. What is the remainder when 11828 is divided by f? 83 Suppose -8r - 175 = -43r. Suppose ra - 225 = -2p, -p = a - 37 - 5. Calculate the remainder when a is divided by 21. 5 Let g = -50 - -54. Suppose 5a + 18 = d + 2a, -gd - 4a + 104 = 0. Calculate the remainder when 45 is divided by d. 21 Suppose 19 = -29c + 30c - 4l, 2l - 7 = -c. Let z = -31 + 55. What is the remainder when z is divided by c? 2 Suppose -14c - 1 = -15. What is the remainder when 128 is divided by (-123)/(-9) - ((-10)/(-6) - c)? 11 Suppose 47k = 41k + 120. What is the remainder when k is divided by (-2)/(-5 + (-78)/(-16))? 4 Let h be (4 - (-22)/(-4))/((-9)/24). Suppose -hi + 172 = -2u + 6u, -86 = -2i + 5u. What is the remainder when 163 is divided by i? 34 Let d be -27(-2)/2 + -1. Suppose 3i - 5i = -d. Suppose -45u - 20 = -53u + 20. What is the remainder when i is divided by u? 3 Suppose 5x - y = 105, 3y = 24 - 24. What is the remainder when 4544 is divided by x? 8 Let j = -36 - -85. Let n be -1 - (-4)/(-2)-5. Let r(p) = p + 4. What is the remainder when j is divided by r(n)? 10 Let d be (4 + 270/(-25))/(1/(-10)). Suppose -2k + 157 = -k. Suppose kq - 155q = d. Calculate the remainder when q is divided by 18. 16 Let w be ((-25)/(-10))/(4/40). Suppose -2p = -m - 71 + 8	{ "pile_set_name": "DM Mathematics" }
7)/2 + p)30/(-45). Suppose -1467 = -11m - n. What are the prime factors of m? 2, 5, 13 Suppose -2400 = 4z - 4v, -15z - 2v - 1180 = -13z. List the prime factors of 20/255 - z. 599 Let m(g) = -25171g3 - 27g*2 - 17g + 9. What are the prime factors of m(-1)? 2, 3, 5, 839 Let k(g) = -2g3 - 7g*2 - 4g + 3. Suppose 58a - 20 = 62a. List the prime factors of k(a). 2, 7 Let c be 5 + 99/55 + 8/(-10). Suppose 0 = -4u - 2h + 874, -3u = -u + 2h - 440. Suppose 119 = co - u. What are the prime factors of o? 2, 7 Let v(r) = r3 - 6r*2 + 5r. Let h(w) = -w*2 + w. Let f(d) = 4h(d) - v(d). Let o be f(2). Let y(g) = -5g3 - 2g*2. List the prime factors of y(o). 2 Let p be (712/(-2))/((11/(-2))/11). Let y = p + -486. What are the prime factors of y? 2, 113 Let s = 70 + -49. List the prime factors of s/14(-7310)/(-15). 17, 43 Let n be 23/6 - (-8)/48. Let o = n + -6. What are the prime factors of (-376)/o((-5)/(-10))/1? 2, 47 Let s(n) = n3 + 9n*2 + 6n - 10. Let c be s(-6). Let u = c - 57. List the prime factors of u. 5 Let a(n) = n3 - n2 - n. Let q(d) = d*3 - 9d*2 + 9d + 83. Let x(v) = -2a(v) + q(v). List the prime factors of x(-13). 2, 3, 53 Let l be (2/(-6))/((-28)/(-8484)). Let j = l - -116. List the prime factors of j. 3, 5 Let r be 0(4/(-10))/(8/10). Suppose 7k - 29 + 15 = r. Suppose 2f + 5b - 50 = 40, 0 = -kf + b + 102. List the prime factors of f. 2, 5 List the prime factors of (-24(-78)/(-416))/(3/(-1940)). 2, 3, 5, 97 Let d = 278 - 110. Let z = 339 - d. List the prime factors of z. 3, 19 Let f = 54 - 3. Suppose -1215 + f = -6r. Suppose -r = -n + 18. What are the prime factors of n? 2, 53 Let l be ((-5)/30)/((-1)/30). Suppose 2111 = ld + c, -9c = 2d - 4c - 849. List the prime factors of d. 2, 211 Suppose 0 = 5s + 3307 - 11042. Suppose -5z = -n - s, z - n = 3n + 298. List the prime factors of z. 2, 5, 31 Let q be (-1)/((-80)/(-25) + -3) - 8. Let g(c) = -33c + 116. List the prime factors of g(q). 5, 109 Let h(c) = -2c2 - 81c + 508. Let y be h(-46). Let z(s) = -s*3 + 5s*2 - 5s + 2. Let g be z(3). List the prime factors of 166 - (g + -3 + y). 2, 3 Suppose 0 = 462g - 459g - 2520. What are the prime factors of g? 2, 3, 5, 7 Suppose -q + 179 = 4h + h, -4q - 54 = -2h. What are the prime factors of 3238/14 + (95/h - 3)? 3, 7, 11 Let f be (-2)/1 - -2 - -334. Let u be (-18 - -2) + (3 - -603). Let w = u - f. What are the prime factors of w? 2, 7, 19 Suppose 2c = 1 - 7. Let a be (c - 19/(-5))/(2/10). Suppose ad + 2d = 468. List the prime factors of d. 2, 3, 13 Let w(l) = -2l*3 + 13l*2 + 25l - 19. Let g be w(8). Let d(y) = y*2 - 14y - 60. What are the prime factors of d(g)? 5, 43 Let v(q) be the second derivative of -q4/6 - q3/2 + q*2/2 - 23q. Let x be v(2). Let a(b) = b*3 + 15b*2 + 15b + 10. List the prime factors of a(x). 3, 17 Let m be 3/(0 - -3 - 2). What are the prime factors of (-1 + m/(-9))/((-1)/105)? 2, 5, 7 Let y(j) = -985j - 64. List the prime factors of y(-7). 3, 11, 23 Suppose -103u + 107u = 4b - 57240, 14322 = b + 3u. What are the prime factors of b? 3, 13, 367 Suppose -39y = -939088 + 340750. What are the prime factors of y? 2, 3, 2557 Let c(s) = 8s2 - 57s - 17. Let v(b) = -7b2 + 55b + 17. Let a(g) = 6c(g) + 7v(g). What are the prime factors of a(29)? 3, 47 Let q(s) = 560s - 836s + 5 + 896s. List the prime factors of q(1). 5 Let w(g) = -6g*3 + 9g*2 + 31g - 8. Let r be w(-6). Let s = r + -683. List the prime factors of s. 743 Suppose 737q - 382q + 1421784 = 381q. List the prime factors of q. 2, 3, 7, 31 List the prime factors of ((-166)/(-249))/((-4)/(-40830)). 5, 1361 Let k be -2 - -50 - 6/6. Let y = k - 62. What are the prime factors of -2y/10 + 611? 2 Let d be 9/27 - 16/(-6). Suppose g + 110 + 16 = -2r, -3r + dg - 171 = 0. Let k = r - -134. What are the prime factors of k? 73 Suppose -196 = l - 212. Suppose -lq + 16300 = 4q. What are the prime factors of q? 5, 163 Let p(s) = -86s - 52. Let a be -11 + (2 - (3/(-3))/1). Let y be p(a). Suppose -11i + y = -7i. What are the prime factors of i? 3, 53 Let g be (-5 - 1)70/3. Let l = g - -65. List the prime factors of (80/(-25))/(2/l). 2, 3, 5 Let q(i) = -4i3 - 78i*2 + 17i + 41. List the prime factors of q(-23). 2, 3, 7 Let t = -10421 + 19510. What are the prime factors of t? 61, 149 Suppose 14 = 2d + 66. Let s(w) = -53w - 167. What are the prime factors of s(d)? 7, 173 Let y(r) = -3 + 6 - 7 + 19r - 14. Let n(t) = -20t + 17. Let l(m) = -3n(m) - 2y(m). What are the prime factors of l(6)? 3, 13 Let n = 6011 - 5910. What are the prime factors of n? 101 Let v be (-4)/10 + ((-160)/(-25) - 6). Suppose v = 5k - 448 - 1267. List the prime factors of k. 7 Suppose 1183r - 184884 = 1169r. List the prime factors of r. 2, 3, 31, 71 Suppose 51b = 95464 + 146378. Suppose -2653 = -4r + d + 2088, -4r + 2d = -b. List the prime factors of r. 3, 5, 79 Let m(x) = x2 + 76x - 35. What are the prime factors of m(21)? 2, 7, 11, 13 Let x be (-6)/24-27020. List the prime factors of (-3(-28)/105)/(4/x). 2, 3, 13 Suppose -2s + 322 = 12s. Suppose 0 = 3k + s - 26, 2d = k + 915. List the prime factors of d. 2, 229 Let t = 54 - 54. Suppose -4r - 3k + 30 = t, -k + 5k = 4r - 16. Suppose -10v + rv = -396. List the prime factors of v. 3, 11 Suppose -130m + 2356205 + 985212 = 844897. List the prime factors of m. 2, 4801 Let t = -5673 + 38600. List the prime factors of t. 19, 1733 Let g = 159 + -157. Let k be 1/(-2) + (-372)/(-8). Suppose -k = -gb + 8p - 4p, -5p = -4b + 98. List the prime factors of b. 3 Let n(k) = -97k3 + k2 - k - 2. What are the prime factors of n(-2)? 2, 3, 5, 13 Let f(g) = g*2 - 12g + 22. Let i be f(11). Let t(a) = 5a + ia*2 + 4a - 3a + 0a + 10. What are the prime factors of t(-3)? 7, 13 Suppose 0l - 4l = 5b - 80, -10 = -2l. Let i be ((-21)/12 + 2)b. What are the prime factors of (-231)/(-6) + i/2? 2, 5 Suppose -57182 = -4x - 253v + 255v, -2v = -8x + 114358. List the prime factors of x. 2, 7, 1021 Let o(d) be the second derivative of d5/20 - d4 + 11d3/2 + 3d*2 - 40d. List the prime factors of o(11). 2, 31 Let x = 3978 - 2410. What are the prime factors of x? 2, 7 Let w = 1246 + 2893. What are the prime factors of w? 4139 Let h(o) = -37o3 + 2o*2 + 5o - 8. Let g(d) = -18d3 + d2 + 3d - 4. Let y(s) = -7g(s) + 3h(s). What are the prime factors of y(2)? 2, 3 Suppose 15 = -3o, 4l - 6775 = 3o + 8020. List the prime factors of l. 5, 739 Suppose -2960 = 17q - 9q. Let t = 736 + q. What are the prime factors of t? 2, 3, 61 Let g(y) = 12y*2 + 47y + 7. Let h = -24 - -32. List the prime factors of g(h). 1151 Let y = 26 + -3. Let g = 40 - y. Let k = g - -32. List the prime factors of k. 7 List the prime factors of (-10 - -3) + 5127 + (-7)/((-28)/(-16)). 2, 1279 Suppose -5g - 27259 - 11252 = -3b, -3g = -4b + 23100. Let q be (15 + (-870)/70)35. List the prime factors of g/q5/(-2). 2, 107 Suppose 9c - 13c + 4o + 217296 = 0, 0 = 5c - 2o - 271620. What are the prime factors of c? 2, 3, 503 Suppose 21x = 9x + 24. Suppose 5r - xs = 3109, -2r = -6s + s - 1252. What are the prime factors of r? 3, 23 Suppose -5m + 299 = 279. Suppose 5j + 1162 = mu, -j - 2j = -2u + 582. List the prime factors of u. 2, 3 Let b = -22 + 109. Let i = b + -71. Suppose -i = -4j + 256. List the prime factors of j. 2, 17 Let x = 72 + 171. Suppose 235a - xa = -6544. What are the prime factors of a? 2, 409 Suppose -6 = -3n, -3h + 7n - 9n = -1. Let b be h/1 + -1 + (-936)/(-9). Let u = 323 - b. What are the prime factors of u? 13, 17 Let i(a) = 491a*2 - 5a - 1. Let l be (15/(-60))/((-1)/(-4)). What are the prime factors of i(l)? 3, 5, 11 Let b be (-6)/(-27) - (-16)/(-72). Let u be 6 - 8 - (-16 - b). Suppose -h = -u - 18. What are the prime factors of h? 2 Let l be 2378/(-10) - (-5)/(25/(-1)). Let d = -193 - l. List the prime factors of d. 3, 5 Let m(j) = 2j2 - 7j - 39. Let g be m(10). Suppose 0 = 4d - 5q - 336, 5d + 3q = 6d - g. List the prime factors of d. 79 Let s = -1782 - -2872. Suppose -s = -4k + 1790. List the prime factors of k. 2, 3, 5 Let y be 1/(3/27) - 4. Suppose -q = 2p + 400 - 1469, q + yp - 1075	{ "pile_set_name": "DM Mathematics" }
? k*3 - 17k*2 + 3k - 4205 What is the d'th term of -198, -446, -704, -978, -1274, -1598, -1956? -d3 + d2 - 244d + 46 What is the g'th term of 4504, 4506, 4508, 4510, 4512, 4514? 2g + 4502 What is the r'th term of 7338, 58699, 198092, 469533, 917038, 1584623? 7336r3 + 9r - 7 What is the g'th term of 5049, 10205, 15375, 20565, 25781, 31029? g3 + g2 + 5146g - 99 What is the t'th term of -6556, -26245, -59060, -105001, -164068, -236261? -6563t*2 + 7 What is the v'th term of -55, -138, -265, -436, -651, -910? -22v*2 - 17v - 16 What is the t'th term of 11690, 23396, 35104, 46814, 58526, 70240, 81956? t*2 + 11703t - 14 What is the z'th term of -9627, -9597, -9567, -9537, -9507? 30z - 9657 What is the d'th term of 164, 1233, 4136, 9791, 19116? 153d3 - d2 + d + 11 What is the x'th term of -6725, -26962, -60697, -107936, -168685, -242950, -330737, -432052? -x*3 - 6743x2 - x + 20 What is the b'th term of -16777, -33559, -50343, -67129, -83917? -b2 - 16779b + 3 What is the g'th term of 119, 346, 573, 800? 227g - 108 What is the t'th term of -249894, -499805, -749716? -249911t + 17 What is the h'th term of -7171, -7187, -7203, -7219? -16h - 7155 What is the c'th term of 234, 176, 54, -156, -478? -4c3 - 8c*2 - 6c + 252 What is the x'th term of 74177, 148378, 222579, 296780, 370981, 445182? 74201x - 24 What is the j'th term of 1049, 2059, 3073, 4091? 2j*2 + 1004j + 43 What is the p'th term of -771, -6043, -20351, -48213, -94147, -162671? -753p3 - p - 17 What is the h'th term of -44244, -44239, -44224, -44193, -44140, -44059, -43944? h3 - h2 + h - 44245 What is the h'th term of -174, -117, -68, -33, -18? -h3 + 2h*2 + 58h - 233 What is the b'th term of 808, 497, 186, -125? -311b + 1119 What is the a'th term of -2240, -4591, -6942, -9293, -11644, -13995? -2351a + 111 What is the m'th term of -1871, -1855, -1841, -1829, -1819? -m*2 + 19m - 1889 What is the l'th term of -16642, -16631, -16626, -16633, -16658, -16707, -16786? -l*3 + 3l*2 + 9l - 16653 What is the i'th term of 558, 1089, 1596, 2073, 2514, 2913? -i*3 - 6i*2 + 556i + 9 What is the n'th term of 621, 943, 1265? 322n + 299 What is the p'th term of -326, -650, -998, -1382, -1814, -2306, -2870, -3518? -2p*3 - 310p - 14 What is the p'th term of 18847, 37592, 56349, 75124, 93923, 112752? p*3 + 18738p + 108 What is the i'th term of 5054, 5057, 5084, 5147, 5258, 5429, 5672? 2i3 - 11i + 5063 What is the f'th term of -4, -172, -634, -1540, -3040, -5284, -8422, -12604? -25f3 + 3f*2 - 2f + 20 What is the b'th term of -40327, -40329, -40331, -40333, -40335? -2b - 40325 What is the m'th term of 189, 745, 1659, 2925, 4537, 6489, 8775? -m3 + 185m*2 + 8m - 3 What is the h'th term of -28454, -28450, -28448, -28448, -28450, -28454, -28460? -h*2 + 7h - 28460 What is the k'th term of -232293, -464596, -696895, -929190, -1161481, -1393768? 2k2 - 232309k + 14 What is the j'th term of 37094, 74190, 111286? 37096j - 2 What is the p'th term of 168, 1617, 5624, 13467, 26424? 213p3 + p2 - 45p - 1 What is the v'th term of -2667, -5345, -8029, -10719, -13415? -3v*2 - 2669v + 5 What is the u'th term of 17, -9, -75, -199, -399? -3u3 - 2u*2 + u + 21 What is the s'th term of -1921, -3863, -5851, -7909, -10061, -12331, -14743? -4s3 + s2 - 1917s - 1 What is the w'th term of 91, 78, -15, -224, -585, -1134? -6w*3 - 4w*2 + 41w + 60 What is the y'th term of 200, 803, 1812, 3227? 203y2 - 6y + 3 What is the a'th term of 1316, 5363, 12144, 21659? 1367a2 - 54a + 3 What is the l'th term of 274, 392, 516, 652, 806, 984, 1192? l*3 - 3l*2 + 120l + 156 What is the z'th term of -10081, -10125, -10167, -10207, -10245, -10281? z*2 - 47z - 10035 What is the i'th term of -164, -262, -350, -434, -520, -614, -722, -850? -i*3 + 11i*2 - 124i - 50 What is the w'th term of -818, -796, -826, -938, -1162, -1528? -5w3 + 4w*2 + 45w - 862 What is the f'th term of 1017, 2240, 3473, 4722, 5993, 7292, 8625, 9998? f3 - f2 + 1219f - 202 What is the j'th term of 2374, 9487, 21342, 37939, 59278? 2371j*2 + 3 What is the h'th term of -53203, -106382, -159561? -53179h - 24 What is the x'th term of -71025, -142046, -213079, -284130, -355205, -426310? -x*3 - 71014x - 10 What is the x'th term of 447, 921, 1397, 1875, 2355, 2837, 3321? x*2 + 471x - 25 What is the f'th term of 173, 668, 1483, 2618, 4073, 5848? 160f2 + 15f - 2 What is the m'th term of -308, -1405, -4064, -9065, -17188, -29213? -130m3 - m2 - 184m + 7 What is the d'th term of -3519, -7091, -10663, -14235, -17807? -3572d + 53 What is the c'th term of -3712, -3740, -3816, -3964, -4208, -4572, -5080, -5756? -4c*3 - 3708 What is the u'th term of -7, 23, 79, 161? 13u*2 - 9u - 11 What is the s'th term of 2589, 5248, 7897, 10530, 13141, 15724, 18273? -s3 + s2 + 2663s - 74 What is the a'th term of 1687, 3356, 5029, 6712, 8411, 10132, 11881? a3 - 4a*2 + 1674a + 16 What is the k'th term of 2786, 11129, 25042, 44531, 69602, 100261? k*3 + 2779k*2 - k + 7 What is the v'th term of 53, 149, 255, 371, 497? 5v*2 + 81v - 33 What is the c'th term of 5446, 5418, 5372, 5308, 5226? -9c2 - c + 5456 What is the n'th term of -9268, -9193, -9116, -9037, -8956? n2 + 72n - 9341 What is the y'th term of 1029, 1032, 1043, 1068, 1113? y*3 - 2y*2 + 2y + 1028 What is the c'th term of 2684, 5373, 8074, 10793, 13536, 16309, 19118, 21969? c*3 + 2682c + 1 What is the t'th term of 208, 27, -488, -1505, -3192, -5717, -9248, -13953? -28t3 + t2 + 12t + 223 What is the t'th term of -6477, -6475, -6473? 2t - 6479 What is the d'th term of -10, -145, -546, -1357, -2722, -4785, -7690, -11581? -24d*3 + 11d2 + 3 What is the q'th term of 556, 1561, 3242, 5605, 8656? q3 + 332q2 + 2q + 221 What is the a'th term of -84, -116, -128, -120? 10a2 - 62a - 32 What is the x'th term of 729, 2653, 5859, 10347, 16117, 23169, 31503? 641x2 + x + 87 What is the n'th term of -318, -273, -228? 45n - 363 What is the u'th term of -315, -441, -771, -1407, -2451, -4005? -17u3 - 7u - 291 What is the l'th term of -831162, -831165, -831168, -831171? -3l - 831159 What is the w'th term of 181, 179, 167, 145, 113? -5w*2 + 13w + 173 What is the l'th term of -22507, -45036, -67577, -90136, -112719, -135332? -l*3 - 22522l + 16 What is the q'th term of -100824, -403291, -907404, -1613163, -2520568, -3629619? -100823q2 + 2q - 3 What is the i'th term of -121, -326, -857, -1870, -3521, -5966, -9361, -13862? -26i3 - 7i*2 - 2i - 86 What is the v'th term of 3646, 3639, 3632, 3625? -7v + 3653 What is the s'th term of -36, -254, -868, -2082, -4100, -7126, -11364, -17018? -34s*3 + 6s*2 + 2s - 10 What is the a'th term of 814, 775, 702, 589, 430? -a*3 - 11a*2 + a + 825 What is the f'th term of -384, -1070, -1756? -686f + 302 What is the o'th term of -8063, -16244, -24425? -8181o + 118 What is the z'th term of 45686, 91398, 137108, 182816, 228522? -z2 + 45715z - 28 What is the i'th term of 2620, 5250, 7894, 10558, 13248, 15970, 18730, 21534? i3 + i2 + 2620i - 2 What is the a'th term of 3347, 3346, 3345, 3344? -a + 3348 What is the m'th term of 496, 477, 430, 343, 204? -2m*3 - 2m2 + m + 499 What is the m'th term of 10199, 10091, 9903, 9629, 9263, 8799, 8231, 7553? -m3 - 34m2 + m + 10233 What is the n'th term of 2843, 5691, 8539, 11387, 14235? 2848n - 5 What is the o'th term of -182351, -182352, -182355, -182360? -o*2 + 2o - 182352 What is the k'th term of -397, -572, -747, -922? -175k - 222 What is the l'th term of 5133, 10263, 15391, 20517? -l2 + 5133l + 1 What is the u'th term of -1797, -3588, -5381, -7176, -8973? -u*2 - 1788u - 8 What is the q'th term of 4637, 4647, 4665, 4691? 4q2 - 2q + 4635 What is the d'th term of -1893, -7544, -16953, -30120? -1879d2 - 14d What is the i'th term of 1276, 1300, 1322, 1342, 1360? -i*2 + 27i + 1250 What is the b'th term of 17, 72, 203, 440, 813? 5b3 + 8b*2 - 4b + 8 What is the g'th term of -40634, -40633, -40632? g - 40635 What is the u'th term of -85400, -170795, -256190? -85395u - 5 What is the h'th term of -3065, -6177, -9289, -12401? -3112h + 47 What is the	{ "pile_set_name": "DM Mathematics" }
equence eggg when four letters picked without replacement from geegegggggggge? 120/1001 Calculate prob of sequence qp when two letters picked without replacement from {q: 4, p: 1, z: 1, c: 6, k: 1}. 1/39 Calculate prob of sequence ppd when three letters picked without replacement from {p: 2, d: 1, v: 1}. 1/12 Four letters picked without replacement from gguvoogogv. Give prob of sequence vovu. 1/840 Calculate prob of sequence nvl when three letters picked without replacement from {l: 4, n: 4, v: 2, a: 1}. 16/495 What is prob of sequence mn when two letters picked without replacement from {o: 2, w: 6, m: 3, b: 1, n: 2, x: 1}? 1/35 Calculate prob of sequence yi when two letters picked without replacement from {y: 7, i: 2}. 7/36 Calculate prob of sequence kxjk when four letters picked without replacement from jyhyxhkkykkhh. 1/1430 Three letters picked without replacement from {w: 1, u: 2, a: 1}. What is prob of sequence awu? 1/12 What is prob of sequence an when two letters picked without replacement from {a: 1, n: 4, y: 3}? 1/14 Calculate prob of sequence ssa when three letters picked without replacement from {q: 1, s: 13, a: 1}. 2/35 What is prob of sequence wdl when three letters picked without replacement from ldjlwj? 1/60 Four letters picked without replacement from nvvvgyynnja. What is prob of sequence ajyg? 1/3960 Three letters picked without replacement from {d: 4, u: 1, a: 3, i: 1, z: 4}. Give prob of sequence zdd. 4/143 What is prob of sequence nee when three letters picked without replacement from {e: 8, n: 5}? 70/429 Calculate prob of sequence hhlh when four letters picked without replacement from lllhhh. 1/20 What is prob of sequence bbbm when four letters picked without replacement from {m: 9, b: 5}? 45/2002 Calculate prob of sequence ttf when three letters picked without replacement from {f: 3, t: 5}. 5/28 Four letters picked without replacement from {l: 4, u: 4, b: 9}. What is prob of sequence bllb? 9/595 Four letters picked without replacement from gggkgtggktgkkg. Give prob of sequence tkgk. 8/1001 What is prob of sequence ow when two letters picked without replacement from wwwqo? 3/20 Three letters picked without replacement from sshsyhyhhyhy. Give prob of sequence hsh. 1/22 What is prob of sequence kk when two letters picked without replacement from {h: 3, k: 2, v: 15}? 1/190 What is prob of sequence kgs when three letters picked without replacement from hskghqv? 1/210 Calculate prob of sequence yyyy when four letters picked without replacement from {y: 7}. 1 Four letters picked without replacement from gggggkgggggk. What is prob of sequence gggg? 14/33 Two letters picked without replacement from {c: 11, d: 7, z: 2}. What is prob of sequence cd? 77/380 Two letters picked without replacement from lkkklkkqluuk. What is prob of sequence ql? 1/44 Calculate prob of sequence zn when two letters picked without replacement from {n: 2, v: 3, z: 1, a: 1}. 1/21 Calculate prob of sequence ctnt when four letters picked without replacement from bfmtccnccntbbnmt. 3/1820 What is prob of sequence wot when three letters picked without replacement from {w: 2, x: 4, o: 1, t: 3}? 1/120 Three letters picked without replacement from aqqai. What is prob of sequence iaa? 1/30 Four letters picked without replacement from jujjjuju. What is prob of sequence juju? 1/14 Two letters picked without replacement from nnphngp. What is prob of sequence ph? 1/21 Calculate prob of sequence hfhf when four letters picked without replacement from {f: 2, h: 5}. 1/21 Two letters picked without replacement from {r: 1, o: 3, g: 5, t: 5, w: 4}. Give prob of sequence wt. 10/153 Four letters picked without replacement from ywwjwjrgjylw. Give prob of sequence ryyg. 1/5940 Three letters picked without replacement from jkvxvsjjjjjx. Give prob of sequence vvx. 1/330 What is prob of sequence xx when two letters picked without replacement from {n: 2, i: 1, c: 1, m: 1, x: 2}? 1/21 Three letters picked without replacement from {v: 6, k: 12}. What is prob of sequence vvk? 5/68 What is prob of sequence gg when two letters picked without replacement from mgggmm? 1/5 Two letters picked without replacement from wwppwpppppw. What is prob of sequence wp? 14/55 What is prob of sequence do when two letters picked without replacement from jjjjdddood? 4/45 Calculate prob of sequence hfi when three letters picked without replacement from {i: 1, f: 3, h: 2, l: 4}. 1/120 Two letters picked without replacement from rjjrrjrrjjjjrjjrrjrr. Give prob of sequence rr. 9/38 Calculate prob of sequence xa when two letters picked without replacement from {a: 4, c: 7, q: 2, g: 2, x: 2}. 1/34 Three letters picked without replacement from {m: 1, a: 3, o: 9, d: 3, x: 1, t: 1}. What is prob of sequence dax? 1/544 What is prob of sequence aamy when four letters picked without replacement from ayamyaq? 1/70 Two letters picked without replacement from ixij. What is prob of sequence ii? 1/6 What is prob of sequence rmmm when four letters picked without replacement from {m: 3, r: 5}? 1/56 Two letters picked without replacement from {j: 13, k: 1, m: 1, e: 5}. What is prob of sequence jm? 13/380 What is prob of sequence vvqd when four letters picked without replacement from {d: 2, b: 4, q: 4, v: 2, t: 2, f: 1}? 2/4095 Two letters picked without replacement from {v: 1, d: 12}. What is prob of sequence vd? 1/13 Three letters picked without replacement from {r: 2, h: 8, d: 1, q: 2, o: 5}. Give prob of sequence rrh. 1/306 What is prob of sequence wrr when three letters picked without replacement from rrbrbbwrjrnwbirrn? 7/340 What is prob of sequence pp when two letters picked without replacement from {p: 4, h: 6}? 2/15 Four letters picked without replacement from {d: 5, z: 4, p: 2, g: 2, r: 1, x: 1}. What is prob of sequence pgzp? 2/4095 What is prob of sequence uhu when three letters picked without replacement from {u: 3, h: 1, p: 4, d: 2}? 1/120 Two letters picked without replacement from {v: 1, i: 1, y: 3, b: 5, c: 3}. Give prob of sequence ib. 5/156 What is prob of sequence bqgb when four letters picked without replacement from gqgbb? 1/30 Three letters picked without replacement from {b: 4, y: 1, g: 2, s: 8}. Give prob of sequence bss. 16/195 Calculate prob of sequence yj when two letters picked without replacement from yjjy. 1/3 What is prob of sequence xaaa when four letters picked without replacement from {a: 7, x: 5}? 35/396 Three letters picked without replacement from xpqypqybyqbyyyyyy. What is prob of sequence qbx? 1/680 What is prob of sequence fwv when three letters picked without replacement from {v: 1, e: 2, w: 3, s: 1, f: 10}? 1/136 Calculate prob of sequence sf when two letters picked without replacement from jjjkfjssjskm. 1/44 Calculate prob of sequence zg when two letters picked without replacement from ggggzgggzg. 8/45 Calculate prob of sequence ddd when three letters picked without replacement from ddggd. 1/10 What is prob of sequence wcu when three letters picked without replacement from uwwcucww? 1/21 Three letters picked without replacement from {m: 3, n: 1}. Give prob of sequence nmm. 1/4 Calculate prob of sequence hio when three letters picked without replacement from {h: 4, i: 6, o: 2, a: 1, f: 7}. 2/285 Three letters picked without replacement from iqutriuiufrq. What is prob of sequence rfq? 1/330 Calculate prob of sequence cmcc when four letters picked without replacement from ccmccccqlclmccmcllcl. 33/1292 Three letters picked without replacement from uddumdulwuuuum. What is prob of sequence uwu? 1/52 Two letters picked without replacement from nknnxnpnk. What is prob of sequence pk? 1/36 Two letters picked without replacement from {c: 7, e: 7}. What is prob of sequence ee? 3/13 Three letters picked without replacement from {b: 3, c: 1, f: 5, p: 4}. What is prob of sequence pbp? 3/143 Calculate prob of sequence mwm when three letters picked without replacement from whwmhiimw. 1/84 Three letters picked without replacement from {f: 2, x: 5, s: 2}. Give prob of sequence xss. 5/252 Three letters picked without replacement from {y: 1, j: 3, a: 3, l: 2, d: 1, z: 3}. Give prob of sequence jja. 3/286 What is prob of sequence he when two letters picked without replacement from heeoos? 1/15 Calculat	{ "pile_set_name": "DM Mathematics" }
o(s) = -s*3 + 6s*2 - s + 3. Let g be o(6). What is the smallest value in 0.2, g, 4/13? g Let s = 0 + -1. Let d = 19.04 - 0.04. Let b = 14 - d. What is the second biggest value in b, s, 2/5? s Suppose -7 = -3m + 11. Let w(z) = z*2 + 10z + 10. Let d be w(-9). Let i be (d + 4)/(m + -3). What is the second smallest value in -2, -5, i? -2 Suppose -18 = -2w - 2w + 3r, 0 = -w + 2r + 2. Let s(z) = z - 9. Let m be s(w). What is the second biggest value in m, -4, 4? m Let s = 3 + -2.95. Let j = s - 0.15. Which is the third smallest value? (a) 2/7 (b) 4 (c) j b Let p be 3/2(40/15 - 0). Let n = -1 + 0.7. What is the third biggest value in n, p, -0.2? n Let m(v) = -v2 - 1. Let o be m(1). Let u = -68 - -68. Which is the smallest value? (a) o (b) u (c) -5 c Let y = 4 - 3. Let d = -8 - -8. Which is the smallest value? (a) d (b) y (c) 1/11 a Let m = -101 - -154. Which is the biggest value? (a) m (b) -1 (c) -3 a Let v = -160 + 1762/11. Let m = -0.012 + 0.022. What is the smallest value in m, v, 5? m Let d = -9 - -9.1. Let c = -3.1 + d. What is the second smallest value in 2, 1, c? 1 Let b = -32 - -36. Suppose 0 = -3y + 4o + 7, 5o = -y - 0o - 4. What is the second smallest value in y, 0.2, b? y Suppose -3y - 27 = 2m, 0 = -5y + 2m - 0m - 29. Let x be 10/(-35) - 37/y. Suppose xp = 2p - 9. Which is the biggest value? (a) p (b) 0.3 (c) 1/3 c Let t = 154/15 - 52/5. What is the second smallest value in t, -2/11, 5, -5? -2/11 Let c(i) = i*3 + 5i*2 - 7i - 9. Let k be c(-6). Let v = k + 2. Let y be (-3)/(-2) + 36/(-6) + 4. What is the third biggest value in 0.4, v, y? v Let d = 3 + -2.4. Let z = 0.12 - 4.12. What is the biggest value in d, -2, z? d Let t = 12 + -12.3. Let a = t - 0.4. What is the second biggest value in a, 0, -2? a Let u = -2.6 + 1.6. What is the second biggest value in u, 6, 2? 2 Let f = 0.2 - 0.5. Let v = 16 + -18. Which is the second smallest value? (a) -1 (b) f (c) v a Let h = -0.6 - -1. Let u = 0 - h. Suppose 2t - 4w + 20 = -2t, t + 2w - 4 = 0. What is the biggest value in 0.1, u, t? 0.1 Let n = -0.077 - -6.077. What is the biggest value in n, 5/2, -1/4? n Let i = -3.61 - -3.21. Let j = -7 + 14. Which is the smallest value? (a) i (b) 0.1 (c) j a Let f be (-1)/3 + 2/10. Let j(h) = h3 + h2 - 4h + 5. Let o be j(0). What is the smallest value in o, -0.5, f? -0.5 Let f = 1.7 + -1.2. Let j = f + -1.5. What is the smallest value in j, 3, 0.4? j Let l be 15/25 - 111/135. What is the smallest value in 0, l, 0.1? l Let k = 16.7 + -17. Let d = -1.2 - -0.2. Let t = d - 0. Which is the smallest value? (a) 1 (b) t (c) k b Let r be (2 - 184/32)6. Let u = -1 - -0.8. What is the second biggest value in -0.4, r, u? -0.4 Let i = 0.2 + -0.3. Let d = -16 - -15. What is the second smallest value in 2, d, i? i Suppose -j - 2 - 2 = 0. Let p = 378 + -381. Let f = -7/25 - -99/175. Which is the third biggest value? (a) p (b) j (c) f b Let p = 1.5 - 1.5. Let h = -426.99 + 431. Let y = h + -0.01. What is the smallest value in -0.4, y, p? -0.4 Let q be (-22)/(-99) + 7/(-72). Which is the third smallest value? (a) 3 (b) q (c) 4 c Let h = 0 + -1. Let t = h + 0.5. Let f = 5 + -2. What is the third smallest value in f, t, 1/8? f Let c = 2/33 - 109/165. Suppose y - 7k + 3k + 7 = 0, 3k = -5y + 11. What is the second biggest value in c, 2/5, y? 2/5 Let w = 5.69 + 4.75. Let y = w - 10. Let i = y - 0.04. Which is the biggest value? (a) 3 (b) -4 (c) i a Let r = 0.22 + 4.78. Which is the second smallest value? (a) r (b) 2 (c) 2/3 b Let k = -5.47 + 0.47. What is the smallest value in -0.2, -13, 0, k? -13 Let d = 6.9 + -7. Let z = 15 + -19. Let l = 2 + -2.2. What is the third biggest value in l, d, z? z Let z = 3.6 - -0.4. Let h = z - 3.7. Let y = -0.2 - h. What is the biggest value in 0.3, y, 2? 2 Let n = -0.05 - 0.95. What is the second smallest value in 0.5, 0.2, n? 0.2 Let f be 12/30 - (-2)/(-30). Let h = -0.1 - -0.2. What is the third smallest value in 4, f, h? 4 Let v = -44 + 47. What is the second smallest value in -0.03, v, 2? 2 Let i be 5/6 + -1 - 0. Let s = 7 - 14. Let n be 2/s + (-64)/(-175). Which is the smallest value? (a) 1/5 (b) i (c) n b Let v = -0.54 + 3.54. Which is the third biggest value? (a) -1 (b) 2 (c) -0.5 (d) v c Suppose -2y - 11 = -n, -6n = -3n + 5y. Let f = -37 + 36.5. Which is the biggest value? (a) 4 (b) n (c) f b Let l be (6 + -3)8/84. Suppose 5k = -y + 21, -6 - 8 = 2y - 4k. Suppose y = t - 0t. What is the third smallest value in t, l, 3? 3 Let u be (-18)/(-15)(-20)/(-6). Let h = 0.3 + 0. What is the second smallest value in u, 2/7, h? h Let n = -0.35 + 1.35. Which is the third smallest value? (a) 3 (b) n (c) 1/2 a Let r = -10 + 12. What is the third smallest value in 1/3, r, -3/5? r Let y = -41 + 22. Let j = y + 16. Let o = -16/9 + 22/9. Which is the biggest value? (a) j (b) o (c) 2/9 b Let j = 7 - 6.5. Let i = -2.5 + j. Let q = -11 + 13. What is the second smallest value in -1/4, q, i? -1/4 Let l = 0.044 + 1.956. Which is the third biggest value? (a) l (b) 1.6 (c) 2/7 c Let a = -7 + 5. Let q be -2 - a/1816. Let x = 3.07 + 2.93. What is the third smallest value in 3, x, q? x Let l be 2/(-10) + 24087/(-165). Let o = l + 146. Which is the third smallest value? (a) -0.1 (b) -3 (c) o a Suppose 0 = 2l - 4z - 560, -2z = l - z - 265. Let w = -4052/15 + l. Let i = 0.4 - -0.1. Which is the smallest value? (a) w (b) 1/6 (c) i a Let n = -0.36 + 0.06. Let g = -2.3 - n. Let k be (12/(-10))/(6/(-15)). What is the second biggest value in k, -1, g? -1 Let a = -0.43 - -0.13. Let y = 96717/6556 - 4/1639. Let u = 121/8 - y. What is the second biggest value in a, -4, u? a Suppose -4w = 4i - 0 + 4, 3w = i - 11. Which is the smallest value? (a) 3/5 (b) -2 (c) 0.5 (d) i b Let b be ((-5)/40)/(28/8 - 3). What is the third biggest value in b, 4, -2/19? b Let n = 10 + -21/2. What is the second smallest value in 4, 5, n, -1? n Let v = 1 + -14. Let x = v - -9. Let k = x + -1. What is the third biggest value in k, 0.2, 3? k Let i be (-8)/(-2)(-2)/2. Let d(y) = -y - 6. Let l be d(-11). Let k = i + l. Which is the second smallest value? (a) 0.4 (b) -5 (c) k a Let g = 5 - 0. Suppose -2k - 4 = -d - 7k, -20 = -gd + 5k. Let b = -144/5 + 28. What is the second smallest value in d, b, -3? b Let h = -7.9 - -8. Which is the biggest value? (a) -0.3 (b) 5/3 (c) h b Let t = 2020/7 + -288. Which is the second biggest value? (a) 2/15 (b) -2 (c) t a Suppose -3s = 2s - 5. Let x be (-2)/(-14) - (-1 + s). Let u be (2 - 3/2)-4. What is the smallest value in x, -1/4, u? u Let q be 26/8 + 3/4. Suppose 5r - 21 = -0r - 3s, qr - 14 = -s. Suppose 0 = ro - 4o. Which is the second smallest value? (a) -4 (b) o (c) 3/2 b Let r = -9 + 10.2. Let k = r + 0.8. Suppose 4m = 3u + 3, 0 = 4m - 4u + 2 - 10. Which is the biggest value? (a) m (b) k (c) 4 c Let h = -2.04 - -0.04. Let y = -304/5 + 603/10. Which is the second biggest value? (a) h (b) y (c) 2 b Let y be 7 + -10 - (-1 + -1). Let q = 4.95 - -0.05. What is the smallest value in 3, q, y? y Let l = -38 + 34. Which is the third biggest value? (a) 2/3 (b) -0.3 (c) l (d) 1 b Let w = 2.8 + -2. Let k = w + -0.4. Which is the third smallest value? (a) k (b) 3/8 (c) -3 a Let l = 1.2 - 1.7. What is the biggest value in 1/3, l, -0.1? 1/3 Let k = 0.07 - 0.37. Let t = 0.7 - k. Let g = 75 - 78. Which is the third biggest value? (a) g (b) 5 (c) t a Let g be ((-8)/5)/((-5)/((-125)/(-15))). What is the second smallest value in -3, g, 0.3? 0.3 Let v be (-66)/(-105) - (-2)/(-10). Let p be (-4)/18 - 74/(-90). What is the second smallest value in p, v, 1/2? 1/2 Let d = 11/7 + -2. Let q = 17 + -17.48. Let w = 0.02 - q. Which is the third biggest value? (a) w (b) -5 (c) d b Let l = -1.5 - -1.51. Let j = l + 3.99. Which is the biggest value? (a) 3 (b) j (c) -1 b Let s(y) = -y*2 - 3y + 4. Let d be s(-3). Suppose 0*b = -b - d. What is the third biggest value in b, -3, 0.3? b Let p be 1/(-2) + 1 - 1. Let r = 5 - 7. Let q = 25 + -20. Which is the biggest value? (a) p (b) q (c) r b Let t = 3.3 - 3. Let k = 299/3 - 100. What is the second biggest value in t, -0.4, k? k Let n = 7.1 - 6.8. Which is the second smallest	{ "pile_set_name": "DM Mathematics" }
and n? 14 Let p(k) = -k*2 + 6k + 150. Let o be p(15). What is the highest common divisor of 120 and o? 15 Suppose 5i - b + 4b + 15 = 0, -4i + 5 = -b. Suppose it = 2t - 140. Suppose -30w - 12w + 1176 = 0. What is the greatest common factor of w and t? 14 Let n(z) = 3z*3 + 1. Let y be n(1). Suppose -6 = yj - 10. Calculate the greatest common factor of 4 and j. 1 Let k(l) = 19l - 136. Let s be k(14). What is the greatest common divisor of s and 26? 26 Let h = 912 + -874. Calculate the greatest common divisor of 551 and h. 19 Suppose 1 = -4d + 5, 3y - d = 251. Let q = 115 - 59. What is the greatest common factor of y and q? 28 Suppose -u + 6u = 4u. Suppose uf - 12 = f + 5k, -4f - 3k + 3 = 0. What is the greatest common divisor of 12 and f? 3 Let d = 0 + 8. Suppose -dk + 20 = -3k. Suppose 5m = 5u + 20, -2m + ku - u + 5 = 0. What is the greatest common factor of m and 63? 7 Let q be 9((-2)/(-2) - -2). Let p = 37 - q. What is the greatest common factor of 40 and p? 10 Let p be 1 - (72/(-2) - 0). Let h = p - -17. Let b(j) = -j*2 + 17j - 16. Let a be b(4). Calculate the highest common divisor of a and h. 18 Let c be 2/(-10) - 10/(-25)408. Let f = 235 - c. What is the highest common factor of 12 and f? 12 Let q be -3(-476)/21 - 1-2. Calculate the greatest common factor of 112 and q. 14 Let v = -11 + 3. Let n be (0 - v)/(21/1). Calculate the greatest common factor of n and 16. 4 Let s be (8/6)/(3/18). Suppose 3u - 5 - 38 = -5f, -2u = f - 10. Calculate the greatest common factor of f and s. 8 Let b be 8/(-16)14 - -61. Let z = -24 - -26. What is the greatest common divisor of z and b? 2 Suppose 0 = -2f - s + 89, 2f - 31 - 64 = 5s. Calculate the greatest common factor of 105 and f. 15 Suppose y = n + 1, 0n + 2n = -2y + 18. Suppose 0 = -2x + 3o + 34, -4x + 46 = yo - 0. What is the highest common factor of x and 98? 14 Suppose 4q - 255 = 245. Let c be 2/3(-30)/(-4). Suppose cu = 0, 3u - 200 = -4r + u. Calculate the highest common factor of r and q. 25 Let w(j) = 6j + 86. Let k be w(-9). Calculate the greatest common divisor of k and 20. 4 Suppose -5v - 2a = -0v, -v - 2a = 0. Let g be 1 - (v - (0 + 160)). What is the highest common divisor of g and 23? 23 Suppose 0 = -11c + 9495 + 1417. What is the highest common factor of 64 and c? 32 Suppose 4g + 1265 = v + 9g, 2g - 5096 = -4v. What is the highest common factor of v and 85? 85 Suppose 9591o - 9596o = -240. What is the highest common factor of 2136 and o? 24 Let l = 57 - 61. Let i be (20/(-3))/(l/(-66)-1). What is the greatest common factor of i and 10? 10 Let y be (34/(-4))/((-2)/4). Let a = 7 - y. Let s be 4-1 - (-3 + a). What is the highest common factor of 99 and s? 9 Suppose 3z = -9, 4q - 5z - 100 = -q. Suppose -5r = 4c - 6r - 382, 4r = -c + 87. Let y = c + q. What is the greatest common divisor of y and 14? 14 Let t = -766 - -934. Calculate the greatest common factor of 308 and t. 28 Suppose 21w = 85 + 209. Let k = 1 - 2. Let p be (k + 2 + -2)-2. What is the greatest common divisor of w and p? 2 Suppose -5t - 121 = 104. Let q be (-108)/10(t/2)/9. What is the greatest common factor of 27 and q? 27 Let o be ((-40)/(-50))/((-10)/(-325)). Calculate the greatest common factor of o and 65. 13 Suppose 4i = 3g - 30, -g - 4 - 2 = 4i. Let q(b) = -b3 + b2 - 1. Let l be q(0). Let z = g + l. Calculate the greatest common factor of z and 10. 5 Suppose -93 = -5a - 2x + 94, -a + 34 = -3x. Let w be (-3)/(90/4) + (5386374/(-270))/(-49). Calculate the highest common divisor of w and a. 37 Let q = -17 - -35. Let y = 15 + -15. Suppose 3p + 0p - 594 = y. What is the greatest common divisor of p and q? 18 Suppose 35j - 387 - 103 = 0. What is the highest common divisor of 6 and j? 2 Suppose 51n - 88n + 8288 = 0. Calculate the greatest common divisor of n and 140. 28 Suppose 28g - 42 = 7g. Suppose -gm + 119 = -5o + 2o, 0 = 5m + 5o - 285. What is the highest common divisor of m and 638? 58 Let p = -13 - -8. Let g = -3 - p. Suppose 0 = n - 5i + 27 - 8, -2i - 2 = -2n. What is the greatest common divisor of g and n? 2 Let m(k) = k3 - 28k*2 - k + 51. Let x be m(28). What is the highest common factor of x and 207? 23 Let k(q) = 4q*3 - 4q*2 - q - 10. Let j be k(4). What is the greatest common divisor of 2 and j? 2 Suppose -6t = -5t + 86. Let y = 122 + t. What is the greatest common divisor of y and 9? 9 Suppose -4x + 140 - 12 = 0. Suppose -g = -m - x, -3g - 3m = 2g - 128. What is the highest common factor of g and 196? 28 Let k(x) = -x2 + 20x - 28. Let p be k(14). Calculate the highest common factor of 896 and p. 56 Suppose -3 = 2q + q. Let i be 39/2 + q/(-2). Suppose -4b = i, -3k + b + 39 = -2k. What is the highest common divisor of 51 and k? 17 Suppose -5w + 39 + 621 = 0. Suppose -2m + 44 = -o, -m + 2o + 40 = m. Suppose -5l = -7l + m. Calculate the highest common factor of l and w. 12 Suppose 3c - 3771 = -3z, 8z = 3z - 2c + 6276. What is the greatest common divisor of 66 and z? 66 Let b = -42 + 78. Suppose h = 8h. Let g be h/(-1 - -3) + 12. Calculate the greatest common divisor of b and g. 12 Let o = 2489 - 1799. What is the greatest common factor of o and 30? 30 Let q be 66/(36/21). Let k(u) = 11u + 11. Let d be k(9). Let z = 215 - d. Calculate the greatest common divisor of q and z. 21 Let r = 232 + -228. Calculate the greatest common divisor of 36 and r. 4 Let q = 1196 - 1131. What is the highest common factor of 208 and q? 13 Suppose 2w - 430 = -4t - t, -5t = -w + 200. What is the greatest common divisor of 490 and w? 70 Let u = 405 - 392. Let g(h) = -h + 22. Let y be g(9). Calculate the highest common factor of y and u. 13 Suppose -10y - 79 + 559 = 0. Let c = -42 + y. Calculate the highest common divisor of c and 2. 2 Let m = -134 - -161. What is the greatest common factor of 3 and m? 3 Let v(a) = -2a - 11. Let g be v(-7). Suppose 14 - 56 = -gr. Calculate the highest common factor of 98 and r. 14 Suppose 566 = 7r - 204. What is the greatest common divisor of 44 and r? 22 Suppose -14z - 470 + 666 = 0. Calculate the greatest common divisor of z and 4396. 14 Suppose -4w + 0w + 784 = 4p, 2p = -4w + 788. What is the greatest common factor of w and 11? 11 Suppose 4f = 11f - 126. What is the highest common divisor of 6 and f? 6 Suppose 0 = -3j - j + 936. Suppose 8l = 99 + 109. Calculate the highest common divisor of l and j. 26 Suppose 211o - 206o + 2s - 798 = 0, -2o = -4s - 324. Calculate the greatest common factor of 280 and o. 40 Let g = 18 - -18. Suppose 13o - 19o + g = 0. What is the highest common factor of 4 and o? 2 Let i be (-2 - -3)/(16/32). Suppose -5v + 32 = -78. Calculate the greatest common factor of i and v. 2 Let j(s) = -s*2 + s - 24. Let q(h) = 3h*2 - 4h + 73. Let n(w) = 8j(w) + 3q(w). Let m be n(7). What is the highest common factor of m and 36? 12 Let r = 3 - -33. Let i(z) = z*3 - 4z*2 + 7z - 3. Let k be i(5). Let g be (-2)/(-6) + 209/k. Calculate the greatest common factor of r and g. 4 Let h = -129 + 141. Suppose 3y = -2o - 11, 4o - 3y - 5 = -0. Let r(s) = -7s - 1. Let p be r(o). What is the greatest common factor of h and p? 6 Let m be (-2)/(-4 - 120/(-28)). Let v be (m + 103)/(-1 + 2). Suppose -o + 6 = -6. Calculate the highest common divisor of o and v. 12 Let h be 15 + (1 + (-8)/6)-3. What is the highest common divisor of h and 8? 8 Let a(v) = 2v2 - 75v + 343. Let c be a(5). Calculate the highest common factor of 450 and c. 18 Suppose -4x + 5y = -19, -3y - 4 - 5 = 0. Let z(k) = 16k*2. Let i be z(x). Calculate the greatest common divisor of 8 and i. 8 Let x = -114 - -228. What is the greatest common factor of 6 and x? 6 Let f be (-193)/(-6) - 2/12. Let d be -42/(-8)256. Calculate the greatest common divisor of f and d. 32 Suppose -3g + 19 = 7. Let j be 72/((g - 2)/2). Let f(u) = -5u - 21. Let m be f(-6). What is the greatest common divisor of m and j? 9 Let g = 667 + -590. Let d = 7 + 15. What is the highest common divisor of d and g? 11 Suppose 0 = -4i + 2i + 10. Suppose d + 50 = -4d. Let w(r) = -r + 25. Let o be w(d). What is the greatest common divisor of i and o? 5 Let c(b) = -6*b + 2. Let n be c(-4). Suppose 2	{ "pile_set_name": "DM Mathematics" }
0)/((-3)/17). -17/5 What is (66/(-1320))/((-9)/20)? 1/9 Calculate 0/(-35)2/40. 0 3/(-81)(-456)/(-76) -2/9 Calculate (-6)/(18144/196)-1(-6)/(-21). 1/54 ((1024/56)/(-16))/(((-432)/210)/4) 20/9 ((-18)/(-378))/(4/4) 1/21 What is the value of 8/(-3)2(-114)/(-19)? -32 What is (1/16)/((1392/96)/29)? 1/8 What is the value of 7/3(-214380)/(-16674)? 30 Calculate (((-8)/(80/(-10)))/(-1))/((-2)/(-30)). -15 Evaluate (564/(-282))/(2/(-6)). 6 (-271)/(-4065)31 1/5 (15/17510/(-30))/((-1)/(-2)) -2/35 Calculate 7/21(-30)/50-9. 9/5 Evaluate (-1617)/(-343)(-7)/(-1). 33 What is 312/3122/4114? 7 What is the value of 13/26((-64)/2)/(-2)? 8 Calculate (104/399/(-28))/(-1). 6/7 Evaluate (-13)/9(-558)/2418. 1/3 What is the value of (285/(-228))/((-3)/(-4))(-12)/(-2)? -10 Evaluate (-12)/((-4752)/11)-3. -1/12 What is the value of -4(6/1)/((-87)/(-58))? -16 (-2)/(-85)(-7600)/4560 -2/51 (9/11)/(7350/7700) 6/7 What is the value of (1200/210)/(5/((-140)/24))? -20/3 What is (72/(-28))/((-63)/(-294))? -12 What is the value of 55/(-6)(-316)/(-790)? -11/3 Evaluate ((672/(-36))/(9/27))/(-2). 28 What is (-6)/(-9)609/174? 7/3 Calculate ((-1)/((-2)/22))/((-10)/90-9). 11 What is (-1032)/(-1290)10/(-1)14? -32 What is the value of (-7)/(-14)14/(-6)27? -9 (((-5)/60)/((-1)/(-6)))/(4/(-160)) 20 Calculate (4/(-15)(-2538)/(-188))/(1/(-5)). 18 What is the value of (-24)/4800-1? 0 What is the value of (38/(-12))/(16/((-324)/9))? 19 ((-40)/(-4)(-16)/(-40))/((-6)/6) -4 What is (228/95)/(-2((-56)/(-10))/4)? -6/7 What is the value of -9(-8)/249/(-351)? -1/13 What is the value of 91/((-49140)/72)210? -28 115/(-184)44(-2)/(-5) -11 What is (48/40)/((-13)/65)? -6 Calculate (8/(-160)4)/(4/(-32)). 8/5 What is (70/(-56))/(325/26)-10? 1 4/6(-151)/(-151)6/38 2/19 What is the value of -1(220/(-3))/(-5)15/20? -11 Calculate (-108)/(-28)882/(-189). -18 Evaluate 1/(15/3105-9). -23 ((-27)/63)/((-1)/(-1)) -3/7 Calculate (416/144)/13(-36)/16. -1/2 What is the value of ((-9)/14)/((-7)/((-343)/(-21))-2)? -3/4 What is the value of ((-12)/(-26))/((-1)/(((-250)/25)/(-10)))? -6/13 What is the value of (1/2)/(39/2184-28)? -1 Evaluate (-2)/(-35)25/1(-1138)/(-569). 20/7 What is (-21)/((-3094)/182)? 2/17 What is the value of 136/17(1610/(-112))/23? -5 What is (14/616)/(4(-8)/64)? -1/22 Evaluate ((-7002)/1945)/(2/5). -9 What is the value of ((-2)/2)/((25/(-80))/(-5)2)? -8 (-184)/(-414)3/(-1) -4/3 Evaluate ((-2)/(-6))/((-2897)/8691). -1 Calculate (-35)/2072/84. -3/2 What is ((-2576)/184)/((-21)/12)? 8 Calculate 4/((-1)/(-1))20631/6348. 13 What is 26/(-195)-15(-21)/18? -7/3 What is (7/4)/((-763)/(-5232))? 12 What is (-24)/(-9)729/(-2592)? -3/4 Evaluate ((-6)/(-120)5)/(16/(-8)). -1/8 (2(-7)/841)/(1/(-2)) 1/3 Calculate -942/(-36)(-26)/(-4). 13 Calculate ((-3240)/189)/(-30)7/8. 1/2 What is the value of ((-312)/260)/(((-3)/(-12))/((-35)/6))? 28 Calculate -123/6((-143)/6)/(-13). -11 What is the value of 288/112-72/28? -9/7 Evaluate 26/13(-10)/(1/((-18)/(-24))). -15 Calculate 182/(65/(-5))-25/(-20). -7 Calculate (6(-1)/(-21))/(74/686). 7 344/1720(10/(-12))/(2/6) -1/2 What is ((-24)/(-168))/(1/(-1))-21? 3 What is the value of ((-34938)/41408)/(6/(-16)-2)? -9/8 Evaluate (3102/423)/((-55)/(-210)). 28 (6/(-4))/(-4(-177)/(-8024)) 17 Calculate 1(18/1)/(-6). -3 580/10(-5)/150-15 29 What is 1(-2)/82/(-4)? 1/8 What is ((-25)/((-4500)/30))/((-1)/102)? -17 Calculate 6/(((320/56)/(-10))/(138/161)). -9 -103/(-60)102/3 17 Evaluate 27(1/1)/((1665/(-30))/(-37)). 18 ((-60)/16)/(-5)2/(-2) -3/4 4/((-40)/(-3))((-630)/21)/(-15) 3/5 (-22)/3(2376/(-24))/33 22 What is the value of ((-4)/(-10))/(((-20)/(-880))/(60/32))? 33 Evaluate (((-26)/(-156))/((-2)/3))/((-2)/(-24)). -3 Evaluate 0/(365/(-146)(-16)/(-10)). 0 What is -50(-12)/(-210)7? -20 Calculate (((-7)/35)/(2898/90))/((-4)/(-14)). -1/46 What is ((-1)/((-140)/84))/((-2)/(-60))? 18 Calculate (8/(-20))/((-25)/(9000/(-48))). -3 What is 120/(-24)3/(-10)? 3/2 (4/(96/(-20)))/((-4470)/(-447)) -1/12 What is ((21/49)/(2/7))/(63/12)? 2/7 What is the value of (-4)/6(-14565)/7768? 5/4 Calculate 6510/100-2. -13 Evaluate (195/117)/(15(-4)/(-468)). 13 What is the value of 13/2(-5208)/(-2821)? 12 -5(-141)/(-235)(-13)/(-3) -13 Evaluate ((-22)/(-132))/(6/(-60)). -5/3 What is (-4)/(-6)3(-24)/322? -3 What is the value of 57/(6840/(-200))241/(-5)? 8 What is the value of 1128/(-462)(-2)/(-6)? -2/9 What is ((-126)/(-210))/((-2)/(-10))2? 6 ((-266)/(-3059))/(2/46) 2 What is the value of (5/2)/(-130/(-20))? 5/3 What is the value of 7/(35/30)(-11)/(231/14)? -4 (-18)/(-15)(-50)/(-5) 12 Evaluate 2/(-1(-28)/182)1/(-2). -13/2 What is the value of 9/(-6)((-10)/55)/(123/(-451))? -1 (13041/2132)/(5/(-28)) -14 5/2(3/(-4))/((-210)/28) 1/4 What is (-45)/10(2/8)/(36/288)? -9 ((-1)/2)/(6/((-84)/7)2) 1/2 What is ((-8)/(-30))/((-1184)/2664)? -3/5 What is the value of (18/153010)/((-12)/(-51))? 1/2 243/(-2835)7/5 -3/25 (8/30010)/((-14)/7)-10 4/3 (306/51)/3(-21)/2 -21 Evaluate 89/17819/(836/(-24)). -3/11 What is the value of (2(-5)/50)/(8/((-280)/(-49)))? -1/7 Evaluate (6/(-27))/((-26)/585). 5 Calculate ((-20)/((-14880)/8))/((-3)/(-18)). 2/31 2/(-4)(1728/12)/(-9) 8 What is the value of ((-2)/(-9))/((-3)/9)(-216)/(-18)? -8 What is the value of (((-2)/(-4))/(113/(-1356)))/(-8)? 3/4 Calculate (21(-10)/45)/((-32)/(-48)). -7 Evaluate 7105/(-203)(-15)/(-21). -25 Evaluate 42/16(-96)/(-30). 8/5 (((-2)/(-1))/8)/(103/6180) 15 (165/181511/(-2))/(34/4) -1/17 Evaluate ((-3)/(-2))/((-20493)/1188). -2/23 Evaluate ((-417)/(-278))/(11/(-10)). -15 What is the value of 3/(-3)598/46? -13 What is the value of (3/4)/((-720)/3360)(-8)/(-7)? -4 What is 137/((-49320)/48)(-15)/2? 1 ((-12)/(-200)5)/(45/20) 2/15 What is ((-6)/115)/(-9(-5)/(-75))? 2/23 What is the value of 25/156/(-4)(-1216)/190? 16 Calculate ((-18)/(-9))/((-190)/665). -7 What is the value of 6/(-1)((-392)/(-378))/14? -4/9 Evaluate ((5-6)/(21/(-3)))/(160/70). 15/8 What is ((-28)/7)/(-2)((-36)/(-40))/3? 3/5 242/39616/44 2/9 What is 21/((-15)/(-5))-2? -14 Calculate (-45)/40(-20)/75. 3/10 Calculate (-5)/(((-2)/3)/((-1)/((-9)/12))). 10 279/622/1 9 What is the value of ((-110)/(132/12))/(((-40)/(-4))/(-5))? 5 What is the value of 6/(-12)(-203)/(-7)(-10)/(-5)? -29 What is the value of -42((-255)/119)/(-3)? -30 What is (14/(-2))/((-449)/(-449))? -7 Evaluate ((-527)/(-204)-8)/((-190)/57). 31/5 Evaluate (-6)/(-3)-1(-27)/54. 1 What is the value of (15/7)/(19(-174)/15428)? -10 What is the value of (60/(-150))/(16/10)? -1/4 What is the value of (44/33)/((1/(-12))/((-15)/(-40)))? -6 What is the value of (-5)/(30/4)210/((-50)/(-5))? -14 Calculate 500/(-175)609/(-2262). 10/13 ((-16)/10)/((-2360)/(-32450)) -22 81/(-405)(-30)/(-18) -1/3 Evaluate (-2814)/1675(-10)/6. 14/5 What is the value of (-102)/493261/(-36)? 3/2 What is the value of (11-1)/(((-8)/32)/(10/(-40)))? -11 64/(-5)(-671)/10736 4/5 (-12)/(-14)5530/(-316) -15 Evaluate 20/72(-4)/(-10)(-24)/(-28). 2/21 (21/36)/(987/423) 1/4 Calculate ((-16)/(-320)-32)/(2(-3)/30). 8 Evaluate (-8)/5445/(-75)(-15)/10. -2/15 30/(-25)(-875)/(-75) -14 ((-383)/7660)/(1/6) -3/10 What is the value of ((-481)/37)/((6/(-3))/(-2))? -13 What is (5/(-15)6)/(14/(-63))? 9 (((-7)/7)/7)/(26/(-364)) 2 What is the value of 3/(-12)-169/(-72)28? -14 Evaluate ((2/(-150))/(46/1656))/((-4)/10). 6/5 What is ((-108)/(-90))/(2/5)4/(-66)? -2/11 Evaluate (5/15)/((3/(-63))/((-1)/1)). 7 (-21/(-8))/(-109/160) -4/9 Calculate (((-30)/(-65))/(-6))/((135/15)/54). -6/13 (-33)/(-6)64/(-32) -11 What is ((-210)/4)/(-15)(-5)/(140/68)? -17/2 -1((-150)/24)/(15/24) 10 Calculate (78/234)/((-2)/6)14. -14 Calculate 1/(10/25015). 5/3 Evaluate ((-7)/5)/(((-3)/(-6))/((-5)/10)). 7/5 What is ((-15863)/(-4923))/(1/(-9))? -29 Evaluate (649/354)/(44/8). 1/3 Evaluate (7/((-70)/(-6)))/(5(-9)/2700). -36 What is the value of 198/(-396)(-4)/(-26)? -1/13 Evaluate (44/(-3))/((-450)/675). 22 What is ((-4)/6060/24)/(26/(-12))? 1/13 What is the value of ((-1)/(-2)1)/((114/108)/19)? 9 Calculate (-27)/(-18)6/96/39. 2/13 Evaluate (-770)/(-275)(-20)/4. -14 3/20832/(-2184)1-7 2/5 What is 8/60-25(-2)/100? 1/15 What is (-5(-24)/140)/(1*8/(-56))? -6 E	{ "pile_set_name": "DM Mathematics" }
= 0. Put -1, 7, q in descending order. 7, -1, q Let d = -260 + 238. Put 5, 3, d in decreasing order. 5, 3, d Suppose -b - 6 = 3j + 5, -4j - 3b = 8. Suppose -13f + 6 = -7f. Put f, -2, j in decreasing order. f, -2, j Let x = 24065/6 - 4025. Let a = x + 14. Let u = 1 + -5. Sort a, -2, u in decreasing order. a, -2, u Let g(t) = -t2 + 1. Let n(p) = -7p*2 + 19p + 2. Let f(h) = -4g(h) + n(h). Let c be f(6). Sort -5, c, 2 in descending order. c, 2, -5 Suppose 18 = 4f - 22. Let r(z) = -z*2 + 29. Let s be r(5). Suppose -5l = -sq - 2, 3q + 12 = -2l - 1. Put q, -2, f in increasing order. q, -2, f Suppose 7b + 1484 = 1512. Sort -7, 12, b. -7, b, 12 Suppose 0 = -5s - 3s + 16. Suppose 2l = -2m - 0m + 4, -sl + 7 = m. Sort 1, l, 3, -1 in descending order. l, 3, 1, -1 Let a be ((-36)/6 + -4)(-1 - 0). Let y = a + 4. Sort 2/5, 2/3, y in ascending order. 2/5, 2/3, y Let o = -72.3 - -72. Let w = -10 + 33. Let u = w + -28. Sort 0, o, u in ascending order. u, o, 0 Let w = -0.9 + 1. Let f = 0.0309 + -0.1309. Sort w, f, 3. f, w, 3 Suppose 2a - 4 - 2 = 0, -5a = 2y - 17. Suppose 0 = g - 0g - 3. Put g, -2, -12, y in ascending order. -12, -2, y, g Let y(v) = -v2 - 8v + 11. Let q(h) = -3h + 9. Let g be q(6). Let i be y(g). Put i, -2, 3, 1 in descending order. 3, i, 1, -2 Let i(d) = -d3 + 3d*2 + 3d. Let f be i(4). Let a be 9 + (299/(-13) - -12). Sort f, a, -3, 5. f, -3, a, 5 Let y = -4 + 4.4. Let b = 412/9 - 46. Put 2, b, y in decreasing order. 2, y, b Let z be ((-1)/(-3) + -1)-3. Let c = 1326 + -1328. Sort -1, c, z in decreasing order. z, -1, c Let c = -3.28 + -2.72. Put 5, c, 6, -5 in increasing order. c, -5, 5, 6 Let y = 1 - -2. Let c(v) = -20v - 1184. Let z be c(-59). Put 0, z, 2, y in decreasing order. y, 2, 0, z Suppose -5l + v + 14 = 0, -13v + 14 = -3l - 18v. Suppose -w - 9 = -6. Put -5, w, l in decreasing order. l, w, -5 Let g be 1(-1 - -2) + 0. Let n be (-1 + -5)/((-2)/11). Suppose w + 19 = 3m + 6, -n = -4w - 5m. Put w, g, 7 in increasing order. g, w, 7 Let z = 0.698 + 5.502. Put -0.3, z, -0.5, 2 in increasing order. -0.5, -0.3, 2, z Let f = 469 + -469.31. Let m = 6 - 7. Put 0, f, -1/2, m in decreasing order. 0, f, -1/2, m Suppose -4 = 2b - 0. Let d = 935 - 944. Sort b, 1, d, 1/3 in decreasing order. 1, 1/3, b, d Suppose 31 = 6y + 19. Sort y, 0, 1 in descending order. y, 1, 0 Let x = 119 + -116. Let w = -1 + 1.5. Let r = -25 - -25.1. Put x, w, r in ascending order. r, w, x Let c be ((-2)/1)/(91/7). Let j = 4.3 - -12.7. Let m = j + -14. Put c, m, 5/2 in decreasing order. m, 5/2, c Suppose 2p + 4z - 20 = 0, 15z - 20z = p - 19. Put p, -11, 1, -8 in decreasing order. p, 1, -8, -11 Suppose 4 = -s + 3s. Suppose 0 = -3b + n - 8, -sb + 4n = 9 + 13. Let l = 1015 + -1015.7. Put b, 1, l in increasing order. b, l, 1 Let n be (10/(-6))/(2/6). Let h(s) = -s*3 + 3s*2 - s + 5. Let c = 136 - 136. Let b be h(c). Sort b, n, -3 in descending order. b, -3, n Suppose 3l - 3 = 6. Suppose -lg = -2f - 3f - 20, -4g + 3f + 23 = 0. Let t(x) = x2 - 6x - 5. Let k be t(6). Put g, 3, k in decreasing order. g, 3, k Suppose -28 = -44w + 37w. Sort -3, 5, w, -18 in decreasing order. 5, w, -3, -18 Let f = -243 + 249. Sort 10, f, -4, 4. -4, 4, f, 10 Let i = 247 - 259. Put i, 5, -20, 1 in increasing order. -20, i, 1, 5 Let l = -388/1173 + -1/391. Put 4, -5/6, 0.3, l in descending order. 4, 0.3, l, -5/6 Let a be ((-13)/4)/((-7)/(-28)). Let r = -9 - a. Put 1, -3, 2, r in descending order. r, 2, 1, -3 Suppose 8f = 3q + 6f + 3, -2q - 2f + 8 = 0. Sort q, -2/15, -7, 0.1 in decreasing order. q, 0.1, -2/15, -7 Let f = -24.58 + -0.42. Let u = f - -19. Sort u, 2/5, -3/8, -2/11. u, -3/8, -2/11, 2/5 Let v = -326 - -326.4. Put -0.5, v, -7, 7/8 in decreasing order. 7/8, v, -0.5, -7 Let z = 143.2 + -143. Let p be ((-31)/(-2))/(6/(-4)). Let c = 127/12 + p. Sort z, 0.5, c. z, c, 0.5 Let d = 1251 + -1252. Put 1, -4, d, -3 in decreasing order. 1, d, -3, -4 Let t = 5/93 - -7/62. Let p be (-3)/3 + (-7)/(-5). Put 1/5, t, p in increasing order. t, 1/5, p Suppose 0 = -4r + 5m - 16 + 76, -r = -4m - 26. Sort 4, -9, r in descending order. r, 4, -9 Let l(z) = -z3 - z2 - 20. Let j be l(0). Let b be (-3 - 12/j)(-10)/4. Sort -4, 2, b in descending order. b, 2, -4 Suppose -2q - 3q + 2g + 85 = 0, -3q + 51 = -3g. Let t = q - 20. Sort t, 4, 3. t, 3, 4 Suppose 11 - 36 = 5m + 5f, -5f - 25 = 0. Sort -10, 4, 1, m in ascending order. -10, m, 1, 4 Let o be (-21)/6 - (-2)/(-4). Suppose -31 = 2w - 5w - 2d, w - 4d = 1. Sort w, 3, o. o, 3, w Let f = -862.73 + 857. Let c = 6 + f. Let x = 0.03 + c. Sort -1/11, x, -2/15 in descending order. x, -1/11, -2/15 Suppose 11 = -2j + 17. Suppose -4 = -2u + x, -5u + 3x + 10 = -u. Let r = 15 + -17. Sort j, r, u. r, u, j Let u be ((-15)/10)/(6/(-20)). Suppose -113 = -2y - l + 54, -ul = -4y + 369. Let i = 341/4 - y. Sort i, 1, -1. -1, i, 1 Let b = 0.79 - -57.21. Let w = 57.96 - b. Sort -2, 5, 0, w. -2, w, 0, 5 Let q = -2.044 + 0.044. Let r be -2 - -2 - 11/2. Put r, -4/5, q in descending order. -4/5, q, r Let x be (-8 - -13) + (-30)/(-3). Sort x, 4, 4/3, 1/4 in increasing order. 1/4, 4/3, 4, x Let g = 0.9 + -0.6. Let o be (3/4)/((-369)/1312). Put o, 2, 3/2, g in descending order. 2, 3/2, g, o Let h(j) = j + 3j - 4 - j. Let q be h(10). Suppose q - 6 = 5d. Sort 1, d, 2 in ascending order. 1, 2, d Let r = -0.12 - 0.28. Let d be (40/6)/(-5)2/(-8). Put r, d, -0.25 in decreasing order. d, -0.25, r Let t = 42.1 - -13.9. Let a = 51 - t. Sort 0.25, -2/3, a in descending order. 0.25, -2/3, a Suppose -2n = n - 6. Suppose 0 = -11r + 3 - 3. Sort 4, -2, r, n in ascending order. -2, r, n, 4 Let l = 79 - 99. Let p be 6/((-5)/l6). Sort -44, -4, p in decreasing order. p, -4, -44 Let d(v) = 9 + 0v2 - 8v + 7v2 - 6v*2. Let o be d(7). Suppose -5w - 12 = -7w. Put -0.4, w, o in descending order. w, o, -0.4 Let m(k) = -2k*3 - 21k*2 + 6k + 28. Let h be m(-10). Sort 1/4, 2, h, 1/2. h, 1/4, 1/2, 2 Let m(f) = f*2 + 31f + 27. Let l be m(-30). Suppose 0 = r + 5. Put l, r, -1 in decreasing order. -1, l, r Let v(i) be the third derivative of 0i + 1/3i*3 + 0 + 12i*2 + 1/8i4. Let q be v(1). Put -2/7, 1/3, q in ascending order. -2/7, 1/3, q Let m(b) = -b2 + 21b - 70. Let h be m(16). Sort -4, h, -5. -5, -4, h Let f be -1 + (13/5 - 12/(-30)). Suppose t - 8 = 3t - 3l, fl = -5t + 18. Put 3, t, -3, -4 in descending order. 3, t, -3, -4 Let i = -141 + 116. Let p = 31 + i. Sort 2, p, 5 in decreasing order. p, 5, 2 Let t = 22 + -19. Let b = -99/7 + 14. Put t, 5, 0, b in ascending order. b, 0, t, 5 Let q be 1(2 + (-2 - -5)). Let t(n) = n*3 - 6n*2 + n - 7. Let d be t(6). Let u = -76.1 + 76. Put u, q, d in descending order. q, u, d Suppose -7 = -4u - 15. Suppose -2x = 10, 2d = -4x - 0 - 14. Sort d, 1, u in decreasing order. d, 1, u Let y = 0.4 - 6.4. Let m = 10 + y. Let v = 2.9585 + 0.0415. Sort v, m, 0 in decreasing order. m, v, 0 Let l = 6.6 - -1.4. Sort 3, l, 1/2 in decreasing order. l, 3, 1/2 Suppose -69 = -f - 177. Let m = 113 + f. Sort 0.1, -2, m, 0.6. -2, 0.1, 0.6, m Suppose z - 7 - 15 = -3j, 4j - 30 = -2z. Put j, -1.9, 1/4 in decreasing order. j, 1/4, -1.9 Suppose 4n + 5 = -3. Let u = -9 - -8. Sort u, -5, n in ascending order. -5, n, u Let k = 282 + -280. Sort k, -3, 5 in descending order. 5, k, -3 Suppose -o - 6 = u, u + 2o + 1 = -7. Let z be 2/8 - 7/u. Let r = -3 - -1. Put 4, z, r in descending order. 4, z, r Let q(t) = -t*2 + 15t + 10. Let a be q(15). Suppose -2l + 4z = 8, -2z = -a - 0. Sort -1, -3, -4, l in decreasing order. l, -1, -3, -4 Let x be (-62)/3(-12)/8 - 4. Let a = -35 + x. Sort 0.04, a, 5. a, 0.04, 5 Suppose -2n = 3n. Let a = 257 - 254. Put n, 4, a, -1 in ascending order. -1, n, a, 4 Let u = -41.2 - 0.8. Let b = u + 41.5. Sort b, 4/7, -5 in increasing order. -5, b, 4/7 Let g = 55.2 + -53.6. Sort -5, -1/5, g in increasing order. -5, -1/5, g Let x = -9 + 10. Let v = -13 + x. Let t = 7 + v. Sort t, 2, -3. t, -3, 2 Let i(r) = -r*3 - 6r*2 - 2r. Let n be i(-5). Let z = 0.224 + 4.776. Put -4, n, z, 4 in increasing order. n, -4, 4, z Let h(m) = 2m. Let r be h(2). Suppose 3b = 2b + 2d - 80, 3d = -5b - 361. Let u = -74 - b. Put r, u, -5 in increasing order. -5, u, r Suppos	{ "pile_set_name": "DM Mathematics" }
.4, 0.3? -0.4 What is the closest to -1 in 0.35, 0.3, 2? 0.3 Which is the nearest to -1.2? (a) -1.3 (b) 2/15 (c) 5 a Which is the nearest to 1? (a) 14 (b) 4 (c) -1/7 (d) 2 d Which is the nearest to 1? (a) 2/51 (b) 1/4 (c) 8/15 c Which is the closest to -3/2? (a) 1/5 (b) -0.051 (c) -0.1 (d) 5/2 c Which is the closest to -1? (a) -1 (b) -3 (c) 1/6 (d) 1/17 a What is the closest to -4 in 0.4, 8, 11, 9? 0.4 What is the closest to -1 in -7, -3, 0, -1/2? -1/2 What is the closest to -5 in 0, -1/10, -4/3, -2/7? -4/3 What is the closest to 2.6 in 0.1, -5, 9? 0.1 Which is the closest to -3? (a) -87 (b) 2/9 (c) -1/2 c What is the nearest to 4 in -0.1, 0.4, 459/4? 0.4 Which is the nearest to -1? (a) -0.5 (b) 0.5 (c) 0 (d) 4 a Which is the closest to 0.2? (a) -1/6 (b) -2/11 (c) 11 (d) 1 a What is the nearest to -2 in 0, 0.9, -1/3, -0.5? -0.5 What is the nearest to 2 in 1/22, -0.4, -2? 1/22 Which is the nearest to -0.09? (a) -0.08 (b) 0 (c) 0.4 (d) 0.05 a What is the nearest to -2 in -0.3, -12/7, 2/9, 0.3? -12/7 What is the nearest to -6 in 4/3, 2, 2/17, 0? 0 Which is the closest to 1/2? (a) 3 (b) -4/9 (c) -4/5 (d) 0.7 d What is the nearest to 0 in 1/6, -0.008, -0.4? -0.008 What is the closest to 39 in 2, 1/2, -3/4, 3? 3 What is the nearest to 0.1 in -4, -9, -16, -2? -2 Which is the nearest to -1/4? (a) 0.4 (b) -5 (c) -5/6 c Which is the nearest to 2/7? (a) -4.5 (b) -1 (c) 11/3 b Which is the closest to 14? (a) -3/8 (b) 0.3 (c) 2 (d) 0.1 c Which is the closest to 4? (a) -4 (b) 0.5 (c) 4 (d) -2/21 c What is the nearest to -3 in -9, 0.03, 4, 2/13? 0.03 Which is the nearest to 1.912? (a) 5 (b) -3 (c) 1 c Which is the nearest to -1? (a) 9 (b) -1 (c) -0.12 b What is the nearest to 0.3 in 1/2, -0.36, 1/3, 4? 1/3 Which is the nearest to -0.1? (a) -12 (b) 0 (c) -5/4 b What is the nearest to 0 in -0.3, 44, 4? -0.3 What is the nearest to -1 in -65, 5, -1? -1 Which is the nearest to -9? (a) 1 (b) 2 (c) -5 (d) -2/3 c What is the closest to 0 in 1, 4, 0.3, 4/3? 0.3 What is the closest to 2 in -1/3, -181/6, -2/7? -2/7 What is the closest to -2/7 in 13, -2.6, -2? -2 What is the closest to -7/8 in 4, 0.2, -5? 0.2 What is the closest to -1 in 4, 0, -0.2, 0.036? -0.2 What is the nearest to 2 in 0.2, 4, -3/4, -0.018? 0.2 Which is the nearest to 3/7? (a) -2 (b) 1/2 (c) -0.2 b Which is the closest to 1/2? (a) -2/17 (b) -38 (c) -1 (d) 1/3 d Which is the nearest to 1? (a) -0.16 (b) 3.6 (c) 0.2 c What is the closest to 0.1 in 4, -6, 14? 4 Which is the closest to -0.1? (a) 2/9 (b) -2 (c) 5 (d) -5 a What is the nearest to -4 in 1/7, -0.4, 4, 0.5? -0.4 Which is the closest to -0.09? (a) 1/4 (b) 1 (c) -1/2 a Which is the closest to -39? (a) -2 (b) 0.1 (c) 5/2 (d) 5 a What is the nearest to 1/4 in -77, -0.5, 0.5, 1/11? 1/11 Which is the nearest to -2? (a) -4 (b) 9 (c) -2/5 c What is the nearest to -1 in 0, -0.2, 23/5? -0.2 Which is the nearest to -2/5? (a) 1/64 (b) 1/6 (c) 1/3 a What is the closest to -2 in 5, -1, 19, -0.1? -1 Which is the closest to 4? (a) 37 (b) -0.04 (c) 1 c Which is the nearest to 4? (a) -1 (b) -45 (c) -5 a Which is the nearest to 0.1? (a) 3 (b) 2 (c) -0.1 (d) 0 d Which is the nearest to 1/3? (a) -0.7 (b) -0.3 (c) 0.086 c Which is the nearest to 0.2? (a) -2/11 (b) -0.1 (c) -70 (d) 4 b What is the closest to 2 in 1, -545, 0.4, -2? 1 What is the nearest to 1 in 11, -2, 109? -2 What is the nearest to 2/7 in 0.3, -1, -7, -2/7? 0.3 Which is the closest to 4? (a) 4/7 (b) -1 (c) 5 (d) 0.1 c What is the closest to -2/5 in -1.396, -0.4, 2/13? -0.4 Which is the closest to -0.02? (a) -0.4 (b) 2 (c) -0.04 c What is the closest to -0.24 in -0.2, 0.3, 1, 0.05? -0.2 Which is the closest to -3.7? (a) -1/11 (b) -0.02 (c) 1 a What is the nearest to -3 in -0.4, 0.4, -0.1, 6? -0.4 What is the nearest to 3 in 18, -0.4, -0.2, 0? 0 What is the nearest to 0.2 in -4, -2/7, -5, -0.2? -0.2 Which is the closest to 3? (a) 3 (b) 1/6 (c) 0.2 (d) 0.5 a Which is the nearest to 11? (a) 5 (b) 1/5 (c) 27 a Which is the nearest to -256/5? (a) -2/9 (b) 4/3 (c) -2/11 a What is the nearest to 1 in 2/201, 2/13, 3/8, -0.4? 3/8 Which is the closest to 98.6? (a) -2/5 (b) 1/6 (c) 4/3 (d) 5 d Which is the nearest to 0? (a) -4 (b) -0.4 (c) 2 (d) -0.04 d Which is the nearest to -61? (a) -1 (b) -5 (c) 3 b What is the nearest to 2 in -6/5, 4, -2, 1/4? 1/4 What is the nearest to 2/3 in -1/5, -7, -2/7, 5? -1/5 What is the nearest to 2/7 in 0.2, 4.1, 0? 0.2 What is the nearest to -2/11 in 1/2, -2/15, -0.5, 5? -2/15 Which is the closest to 0? (a) -3/8 (b) 0.2 (c) 3.1 b What is the closest to -5 in -0.12, 0.5, -1? -1 Which is the closest to 17? (a) -0.1 (b) -1 (c) 89 a Which is the nearest to 1/2? (a) -2/13 (b) -0.655 (c) -2/7 (d) 4/3 a Which is the nearest to -1? (a) -6/11 (b) 0.4 (c) 0.2 (d) -1/3 a What is the nearest to -1/3 in 8, -1/5, -1? -1/5 Which is the closest to 2/7? (a) -0.4 (b) -573 (c) -0.1 c What is the nearest to -0.05 in 4, -0.2, -2, 0.07? 0.07 What is the closest to 1 in -4, -3, -1/5, 1? 1 What is the closest to -0.1 in -4, 2, 0.5, 1? 0.5 Which is the closest to -0.059? (a) -1/12 (b) 0.2 (c) -1/7 a What is the nearest to 2 in -1/6, -3, -255? -1/6 Which is the closest to -2? (a) -2 (b) 11 (c) 2 a Which is the closest to -1.5? (a) -2/3 (b) -2/11 (c) -73 a What is the closest to -30 in -1, -13, 5, -2/11? -13 Which is the nearest to -1? (a) 13/9 (b) -2/3 (c) 3/2 b Which is the nearest to -1? (a) -0.5 (b) 2/25 (c) 5 a What is the closest to -13/2 in -8/7, 16, 2, 1/5? -8/7 What is the nearest to -0.1 in -0.3, 4/39, -0.2? -0.2 Which is the closest to -10? (a) -3 (b) -0.5 (c) 0.4 (d) -1/3 a Which is the nearest to -2/7? (a) 4 (b) -82 (c) 5 (d) 1 d Which is the closest to 1? (a) 6/5 (b) 7 (c) -1/4 a What is the nearest to -2 in -3/5, -20, 1/8, 1/2? -3/5 Which is the closest to -0.1? (a) -0.5 (b) -0.13 (c) 0.1 b What is the nearest to -12/7 in 12, -8, -1/2? -1/2 Which is the nearest to -1? (a) -3 (b) -104 (c) 5/3 a What is the closest to -0.1 in -69, 2, -3, -1/7? -1/7 Which is the closest to -1? (a) 0.03 (b) -3 (c) 1/5 a Which is the nearest to -1? (a) 0.1 (b) 1.5 (c) 3 a Which is the nearest to -0.1? (a) -1 (b) 3 (c) 0 (d) -0.148 d What is the nearest to -1 in 30, -0.5, 0.093? -0.5 What is the nearest to 1 in 1/4, -7, -0.2, -2? 1/4 Which is the nearest to -2/3? (a) 2/7 (b) -1 (c) 5 b Which is the closest to 4/3? (a) 4/9 (b) -7/2 (c) -2 a What is the nearest to 1 in 2, -0.38, 0.3, -1/2? 0.3 What is the closest to -1 in -5, 0.2, 0.027, -1/4? -1/4 Which is the closest to 1/3? (a) 33 (b) -0.3 (c) -2/17 (d) -2/11 c What is the closest to 0 in 465, 1, 3/7? 3/7 What is the nearest to -2/5 in -1/5, 1/9, -2/3, -3? -1/5 What is the closest to 10 in -0.4, 5, -1? 5 Which is the closest to 1? (a) -14 (b) 5 (c) -2/7 c What is the closest to 24 in 2/9, -1, 2/21? 2/9 What is the nearest to -0.2 in 0.2, -2, 3, -4? 0.2 Which is the nearest to -55/6? (a) -2 (b) 3/5 (c) 5 (d) 3/4 a What is the nearest to 0.1 in -12/7, -3, -2/5? -2/5 What is the closest to 2 in 0.1, -5, -6? 0.1 Which is the closest to 0? (a) -3 (b) 3/20 (c) 2/33 c Which is the nearest to -1? (a) 2/9 (b) 0.02 (c) 2/11 (d) -5 b Which is the nearest to -1? (a) -2 (b) 5 (c) -1.3 (d) 6 c What is the nearest to 2/7 in -4, -5, 0, 18? 0 What is the nearest to 0.1 in 2/7, -4, -2/5, -0.1? 2/7 Which is the nearest to 2/7? (a) -0.1 (b) -0.4 (c) 8.09 a Which is the closest to 1/4? (a) 0 (b) -3 (c) -2.8 a Which is the closest to -0.07? (a) 0.1 (b) 2/5 (c) 4 (d) 2/63 d Which is the nearest to 1/5? (a) 3.4 (b) -1 (c) 3 b What is the nearest to -2/3 in 3/7, -0.2, 0.1, 4? -0.2 Which is the closest to -2? (a) 0 (b) 0.3 (c) 0.2 (d) 1 a Which is the closest to -2? (a) -0.5 (b) 6 (c) -0.3 a Which is the nearest to 1? (a) -2.2 (b) 4 (c) -1/4 c Which is the nearest to 0.1? (a) 0 (b) 1/4 (c) 2/5 a Which is the closest to -1/2? (a) -6 (b) -0.5 (c) -3/8 (d) -2 b What is the closest to 2/5 in 4/3, 0.17, -0.3, 6? 0.17 Which is the nearest to -2/3? (a) -0.3 (b) -26 (c) -2/3 c What is the closest to 0 in 1/2, -2/13, -0.4, 0.1? 0.1 Which	{ "pile_set_name": "DM Mathematics" }
3, 29 Suppose -3m = 13 + 2, 0 = 2f - 5m - 33. Let s be (-2)/f - (-6)/4. Suppose y - 4 = s. What are the prime factors of y? 5 Let s be 0 - (-5 - (-2)/1). Suppose sx - 24 = x. What are the prime factors of x? 2, 3 Let i = -94 - -228. What are the prime factors of i? 2, 67 Let m(n) = 5n2 + 2n - 3. Let g be m(2). Suppose g = 5b - 59. What are the prime factors of b? 2 Let p(x) = -x2 + 3x + 2. Let i be p(3). Suppose 2d = -id + 92. Let u = d - 13. List the prime factors of u. 2, 5 Suppose 1 = -5h + 26. Let d = -8 - -34. Suppose -d = -hy + 4. What are the prime factors of y? 2, 3 Let r be (-10)/((15/(-6))/5). Suppose 3f - 2f = r. What are the prime factors of (-8)/f - (-84)/10? 2 Suppose -r + 217 = 12. List the prime factors of r. 5, 41 Suppose -5r = -3r - 5w - 284, -5w + 112 = r. List the prime factors of r. 2, 3, 11 Let y = -12 - -9. Let j = y + 12. What are the prime factors of j? 3 List the prime factors of (-2)/(-6) - (-490)/6. 2, 41 List the prime factors of 4 - 6 - (-46)/(4 - 2). 3, 7 Let b = 4 + 1. Suppose 17 = bw - 8. Suppose 0 = -wd + 2 + 43. What are the prime factors of d? 3 Let a(x) = x*3 + 6x*2 + 5x + 3. Let d be a(-5). Let n be d/((-3)/(-1)) - -19. Suppose -3v = v - n. List the prime factors of v. 5 Suppose -4m - m = -20. Suppose 5j = -4o + 10, mo - 2j = -o + 29. Suppose 76 = ov + 21. List the prime factors of v. 11 Suppose -2 + 0 = -4f + 3n, 4f - 10 = -n. Suppose -fs + 8 = -0s. Suppose 56 - 12 = sc + 5o, 5c - 55 = -2o. List the prime factors of c. 11 Suppose -3u = 2l - 48, -2l - 9 = -3. Let y(w) = -w - 3. Let x be y(-8). Suppose xc = 2c + u. What are the prime factors of c? 2, 3 Suppose b - 2 = -y - 2y, 10 = 5b - 5y. Suppose 5v + 26 = 3c + 3v, 5c + bv = 54. What are the prime factors of c? 2, 5 Suppose 0 = 4m - 187 + 35. What are the prime factors of m? 2, 19 Let j = -97 - -50. Let k = j + 73. List the prime factors of k. 2, 13 Let m(z) = -27z. What are the prime factors of m(-3)? 3 Suppose -74 = y - 3y. Suppose -3c + 4j = -y, 2c - j - 8 = 10. List the prime factors of c. 7 Suppose 3c - 20 = -2k, 0 = -k - 5c + 24 - 0. List the prime factors of 1080/78 - k/(-26). 2, 7 Let a(j) = 5j - 3. Let u be a(3). Let m be 1/(15/u + -1). What are the prime factors of (22/m)/((-2)/(-4))? 11 Let y = 42 + -26. What are the prime factors of y? 2 List the prime factors of (-542)/(-4)-518/(-45). 271 Suppose f + 56 = 4w - 3f, 3w - 2f - 40 = 0. Suppose 1 = 29t - 30t. List the prime factors of w - (t + (-1 - 0)). 2, 7 Suppose l = -2l. Suppose l = -5u - 4q + 69, 4u - 37 = -q + 27. What are the prime factors of u? 17 Suppose -4p + 5p = 45. What are the prime factors of p? 3, 5 Let p(r) = r2 + 9r - 32. List the prime factors of p(8). 2, 13 What are the prime factors of 1189/8 + (-27)/(-72)? 149 Suppose -3t = -2t - 345. What are the prime factors of t? 3, 5, 23 Suppose 11t - 62 = 9t. What are the prime factors of t? 31 Let w(p) = -p*3 + 4p*2 + 3. What are the prime factors of w(3)? 2, 3 Suppose -3 - 2 = -f. Suppose -fv + 4v + 24 = 0. What are the prime factors of v? 2, 3 Suppose 23 + 7 = -5o. Let f = 8 - o. What are the prime factors of f? 2, 7 Suppose 0 = 5s - 2s - 204. List the prime factors of s. 2, 17 Let y(p) = 2p - p - 2p - 2p - 2. Let h be y(-6). Suppose -10 = -2m + h. List the prime factors of m. 13 Suppose 4a + 3 - 1 = 5s, -12 = -2a - 4s. Let g(k) = k - a + k - 3. List the prime factors of g(5). 5 Suppose -2q + 5q - 171 = 0. Let g = q + -34. List the prime factors of g. 23 Suppose 0 = 4n - 2z - 3z + 15, -3n = -5z + 15. Let o be 63/7 + (2 - -1). Suppose ny - o = -2y. List the prime factors of y. 2, 3 Suppose -2z - 304 = -5k, 2k - k + 3z = 54. List the prime factors of k. 2, 3, 5 Let s(r) = -13r - 8r + 6r + 4 - 2. List the prime factors of s(-1). 17 List the prime factors of 5/((-20)/16) - -20. 2 Suppose -3x - 5m = -69, -5x + 0x = 5m - 125. List the prime factors of x. 2, 7 List the prime factors of -41/2 + 0 - -153. 151 Let m(g) = 9g + g + 5 - 5. What are the prime factors of m(2)? 2, 5 Let j be (-2)/(-6) - 2/6. Suppose -o + 12 = -j. Suppose 0 = -4u - 0u + o. List the prime factors of u. 3 Let h(b) = -b2 - 9b - 3. Let q be h(-4). Suppose 3u - 2i - q = 0, 3i - 4 = 2. What are the prime factors of u? 7 Suppose -5g + 181 = 4a, -4a = -0g + g - 161. Let j = a - 23. List the prime factors of j. 2 Suppose -5r + 174 = -3r. List the prime factors of r. 3, 29 Let w(z) = -z3 - 2z*2 + 5z + 4. Let r be w(-3). Let a be 24 - (2 + r). Let m(y) = y + 2. List the prime factors of m(a). 2, 5 What are the prime factors of ((-18)/(-4) + -4)106? 53 Let g = -167 - -274. What are the prime factors of g? 107 Let w(g) = -g3 - g2 + g + 14. What are the prime factors of w(0)? 2, 7 Let w = -1 - -3. Suppose -wq + 6 = 124. Let b = -39 - q. What are the prime factors of b? 2, 5 List the prime factors of 1 - (24/(-32))/((-1)/(-16)). 13 Suppose o + 3o - 16 = 0. Suppose 5 = -l - n, 17 = ol - 5n - 8. Suppose -t + 6 = -l. What are the prime factors of t? 2, 3 Let h = -12 + 34. Suppose s - h = -s. List the prime factors of s. 11 Suppose -12l + 15l - 15 = 0. Suppose -li + 152 = 47. What are the prime factors of i? 3, 7 Let a be (4/(-3))/((-18)/(-27)). Let q(r) = 3r*2 - 2 - 5r + 3r2 - 7r2. What are the prime factors of q(a)? 2 Let a(b) = -b3 + 19b2 + 13b - 13. Let z(p) = -2p3 + 39p*2 + 26p - 27. Let x(u) = -13a(u) + 6z(u). List the prime factors of x(14). 3, 7 Suppose -2y + 4v + 44 = 0, -56 = -7y + 4y + 4v. List the prime factors of y. 2, 3 Suppose 9 = -2k + 29. List the prime factors of k. 2, 5 Suppose -3g = 46 - 169. Let v = g - 20. Suppose -3u + p = -3p - 7, 4u = 3p + v. What are the prime factors of u? 3 Let w be (-2)/(-6) - (-5)/3. Suppose 0 = wt - 5t. Suppose t = 5f + b - 10, -2b + 10 = 5f + 3b. List the prime factors of f. 2 Let f(g) = 3g*2 + 5g + 1. Let u(r) = -3r2 - 4r - 1. Let o(x) = -6f(x) - 7u(x). Let h = -5 + 7. List the prime factors of o(h). 3 Let d(p) = 3p2 + 1. Suppose -c + 4j + 14 = c, -4c - 8 = 4j. Let a be d(c). Suppose 3q + 5m = 48, 0q - aq + 38 = -2m. What are the prime factors of q? 11 Let g(k) = 2k*2 - 6k + 6. Let a(z) = -z*2 + 6z - 3. Let o be a(4). Let c be g(o). Suppose -c = -3p + 4. What are the prime factors of p? 2, 5 Let q be 4/(8/363). Suppose -5b + 143 = -3z, -5z - q = -26. What are the prime factors of b? 31 Let l = 57 - -168. What are the prime factors of l? 3, 5 Suppose -2l + 0u + 5u + 142 = 0, 0 = 5l - 3u - 336. List the prime factors of l. 2, 3, 11 List the prime factors of (3/3)/(6/408). 2, 17 Suppose -l + 54 = -0l. Suppose 0s - 3s = 3c - 54, 3s = -c + l. List the prime factors of s. 2, 3 Let s = 8 + -4. Let n(r) = -r3 + 3r*2 + 4r + 2. Let f be n(s). Suppose 0 = -fy + y + 16. What are the prime factors of y? 2 Suppose -14y + 17y = 198. What are the prime factors of y? 2, 3, 11 Suppose -5j + q + 14 = 0, -5j + 2q = -5 - 8. Suppose 27 = 2i - 3z, 8 + 1 = 4i + jz. List the prime factors of i. 2, 3 Let r(p) = p*2 - 4p + 2. Let f be r(5). Suppose 3o = 4s + 75, -fs + 50 = 2o - 2s. What are the prime factors of o? 5 Let q be (-1)/2(5 - 7). Suppose 0 = 2j - q - 31. List the prime factors of j. 2 Let m(w) be the first derivative of w2/2 + 10w - 1. What are the prime factors of m(-7)? 3 What are the prime factors of -5 + 1/1 + 263? 7, 37 Suppose -7g = g - 304. What are the prime factors of g? 2, 19 What are the prime factors of 6/(-39) + 288/13? 2, 11 Suppose -l + 4n - 36 = -5l, -5l + 5n = -5. Suppose 2z + lx = 4z - 68, -3z - x = -68. Suppose -g = -5g + z. List the prime factors of g. 2, 3 Let b(v) = 3v2 - 3v + 5. What are the prime factors of b(-5)? 5, 19 Let z = 2 + -9. Let m = z + 11. List the prime factors of m. 2 Let f(r) = -2r + 215. What are the prime factors of f(0)? 5, 43 Let l = 2 + 0. Suppose -4f = 12, -f - 3f = -ld + 22. Let m(i) = i - 3. What are the prime factors of m(d)? 2 Let s(k) = 3k2 + 2k - 1. Let d be s(2). List the prime factors of -10(1 - 21/d). 2 Suppose -50 = 2s - 4d, 5s + 2d + 167 = -2d. Let n = 23 - 41. Let x = n - s. What are the prime factors o	{ "pile_set_name": "DM Mathematics" }
- 5x2 + 3. Determine gc(j) - 6u(j). -4j Suppose -5n - 2g + 58 = -34, 5n = -3g + 93. Suppose 0 = 22k - 180 - n. Let a(d) = 5d + 8. Let j(o) = o + 2. What is kj(c) - 2a(c)? -c + 2 Let n(y) = -3y + 1. Let q(o) be the first derivative of -o2 + o + 4. Suppose -90h + 350 + 310 - 120 = 0. Determine hn(i) - 10q(i). 2i - 4 Let m(g) = 740g*3 + 14g*2 - 14g + 8. Let a(t) = -494t3 - 9t*2 + 9t - 5. Give 8a(s) + 5m(s). -252s3 - 2s*2 + 2s Let v(f) = 1. Let j(m) = -4m - 19. Let z be j(-3). Let d be 9/1z/(-21). Let r(x) = -1 - 26x + 11x + 16x. Determine dr(h) + 5v(h). 3h + 2 Let j(d) = -d + 1. Suppose -24 = -101r + 9r - 116. Let w(f) = -3f2 - 6f + 3. What is rw(b) + 4j(b)? 3b2 + 2b + 1 Let d(u) = u*2 - u + 1. Let z(n) = 984. Let t(o) = 219. Let r(p) = 9t(p) - 2z(p). Calculate 2d(k) + r(k). 2k2 - 2k + 5 Let y(r) = 5r3 - 10r*2 - 17r + 13. Let v(b) = 2b3 - 6b*2 - 9b + 7. Determine 5v(o) - 3y(o). -5o3 + 6o - 4 Let c(m) = -24m2 + 15m + 5. Let y(o) = -o*2 + 2o + 1. Calculate c(b) - 6y(b). -18b*2 + 3b - 1 Suppose 49j = 10j + 117. Let n(z) = 17z - 11. Let r(w) = -8w + 5. Determine jn(g) + 7r(g). -5g + 2 Let q(s) = -5s + 20. Let z(n) = 2n - 7. Suppose 0 = -42m + 1056 - 342. Suppose -4x + 3g = 44, -5x = -14g + mg + 28. What is xz(j) - 3q(j)? -j - 4 Let p(s) = 21s*3 + 5s*2 + 5s - 2. Let o(w) = 8w2 - 3 + 341w + 31w3 - 65w - 211w - 57w. Determine 5o(l) - 8p(l). -13l3 + 1 Let j(p) = p3 - 9p*2 + 3p - 1. Let m(r) = 8r3 - 27r*2 + 300r - 3. Calculate 3j(d) - m(d). -5d*3 - 291d Let g(z) = 11z2 - 17z + 1. Let l(j) = 26j2 - 33j + 3. Calculate -7g(x) + 3l(x). x*2 + 20x + 2 Let h(t) = 65 + 75 - 7t2 + 6t - 144. Let o(f) = -40f2 + 34f - 31. Let a(j) = -20j2 + 17j - 16. Let m(y) = -7a(y) + 4o(y). Give -17h(z) + 6m(z). -z*2 - 4 Let q(w) = -10335w + 44. Let t(l) = -5169l + 24. Calculate 6q(b) - 11t(b). -5151b Let m(d) = 37d3 + 3d2 - 3. Let g(s) = -s2 + 63s + 1577. Let j be g(81). Let l(z) = -1479z*3 - 119z*2 + 119. What is jm(t) + 3l(t)? -34t*3 Let x(n) = -3n*3 - 6n*2 - 4n - 6. Let u be 74/185((-84)/9 - 6/9). Let w(g) = -g3 - g2 - g - 1. Calculate uw(o) + x(o). o*3 - 2o*2 - 2 Let n(h) = 9h*3 - 20h*2 - 1437h - 7. Let s(k) = -25k3 + 55k*2 + 4311k + 19. Give 11n(l) + 4s(l). -l*3 + 1437l - 1 Let g(c) = c*2 + 6. Let f = -118 - -120. Let u(k) = 24k*2 - 27kf - 6 - 1. Let a(b) = -b2. Let v(h) = 2a(h) - u(h). What is 6g(r) - 5v(r)? r2 + 1 Let a(d) = 34d*3 - 6d*2 + 2d. Let y(u) = -15u3 - u2 - u + 1. What is -a(b) - 2y(b)? -4b3 + 8b2 - 2 Let b be (2 - (-3 + 4))/((-2)/8). Let t(k) = k3 - k*2. Let g(x) be the first derivative of 3x*4/4 - 8x*3/3 + 239. Calculate bt(u) + g(u). -u*3 - 4u*2 Let b(w) = 228w - 62. Let l(i) = -116i + 33. Calculate 4b(k) + 9l(k). -132k + 49 Let r(h) = -3 - 2h - 2h*2 + 2 + 4h. Suppose -13 = -21v + 29. Let m(d) = 254 - 764 + 253 + 257 + dv. Calculate -3m(j) - r(j). -j*2 - 2j + 1 Let u(z) = -203z2 + 28. Let t(k) = 59k*2 - 5. Let m(r) = 28r*2 - 2. Let x(b) = 5m(b) - 3t(b). Give -5u(f) + 28x(f). -21f*2 Let a(j) = -12j*2 + 7j - 9. Let y(w) = -55w2 + 28w - 42. Let c(f) = 9a(f) - 2y(f). Let p(g) = -1. Give -c(n) - 3p(n). -2n*2 - 7n Let i(v) = 11v3 - 5v*2 + 2v. Let g be (-2 - (-36)/(-8))2. Let m(x) = -23x*3 + 11x*2 - 4x. Calculate gi(o) - 6m(o). -5o3 - o2 - 2o Let g = 254 - 199. Suppose 54c + 4 = gc. Let z(i) = 2i2 - i + 3. Let f(s) = 2s - 5 + 0s2 - 4s*2 + 0s. Give cf(o) + 7z(o). -2o2 + o + 1 Let t(g) = 21g - 18. Let y(r) = -43r + 37. Give -5t(o) - 3y(o). 24o - 21 Let d(n) = 8 + 1 - 42n2 - 20 - 7n + 4 + 103n2. Let v(k) = -20k*2 + 2k + 2. Determine -2d(b) - 7v(b). 18b2 Let n(x) = 8x*2 - 4x - 2. Let o(k) = k - 1. Let t be (6/20)/((-108)/90) + 135/(-36). Determine to(i) - n(i). -8i2 + 6 Let d(z) be the third derivative of z3/6 - 63z2. Let w(x) = -4x + 37. Let s be w(9). Let p(v) = 3v - 3. What is sd(h) + p(h)? 3h - 2 Let d = 47 - 48. Let t(f) = -1. Suppose -68a - 77 = 9a. Let n(p) = -p2 - 2p - 1. What is an(r) + dt(r)? r*2 + 2r + 2 Let s(i) = 6923i3 + 2i*2 + i - 2. Let a(r) = 2r*3 + 3r*2 + r - 2. What is a(p) - s(p)? -6921p3 + p2 Let b(s) = -s*2 - 3s + 1. Let y(z) = 9z2 + 16z - 1. Determine -6b(d) - y(d). -3d*2 + 2d - 5 Let f(n) = -n*2 - n + 1. Let t(y) = -17y*2 + 8y - 26. Let z(w) = 99w2 - 49w + 160. Let q(m) = 37t(m) + 6z(m). Give -2f(v) - q(v). 37v*2 Let m(t) = -3t. Let s(y) = -4170y2 - 30y. What is 10m(o) - s(o)? 4170o*2 Let q(i) = 3i*2 - 5i - 3. Suppose 3m + 3d = 3, -7 = 3m + 5d - 20. Let c(j) = -4j2 + 6j + 3. Give mc(p) - 5q(p). p*2 + p + 3 Let d(c) = 50c*3 + 14c*2 + 14c + 10. Let l(a) be the third derivative of -a6/12 - a5/20 - a4/8 - a3/3 + 3610a2. Determine 3d(g) + 14l(g). 10g*3 + 2 Let a be (37 - (39 + -18)) + -11. Let z(k) = -6k*3 + 3k*2 + k + 1. Let x(g) = -12g*3 + 5g*2 + g + 1. Determine az(l) - 3x(l). 6l*3 + 2l + 2 Let r(m) = -m - 2. Let w be (1/(-2))/(24/16828/24). Let f(t) be the third derivative of 0 + 2t*2 - 1/12t*4 - 2/3t*3 + 0t. What is wf(b) + 7r(b)? -b - 2 Let h be 46/(-2) + 7 + 21. Let v(o) = -8o3 - 5o2 + 5. Let m(n) be the third derivative of n6/6 + n*5/5 - 2n*3 - 3n*2. Calculate hm(y) + 12v(y). 4y*3 Let h(m) = m - 1. Let c(z) = -z + 2. Let r(b) = -2c(b) - 3h(b). Let i(n) = -3n - 2n - 2n - 171 + 169. Calculate i(u) - 6r(u). -u + 4 Let n(q) = -2q3 - q2 + q - 1. Let l(m) = -7m3 - 133m*2 + 5m - 5. Determine -l(j) + 5n(j). -3j*3 + 128j2 Let f(z) = -z2 + z - 1. Let l(i) = -46i2 - 21i - 3. Let n(q) = 20q2 + 10q + 1. Let m(o) = -6l(o) - 13n(o). Determine -5f(h) - m(h). -11h*2 - h Let n(f) = -780f + 26. Let s(j) = -1172j + 27. Let c(d) = -3n(d) + 2s(d). Let o(r) = 7r + 49. What is 5c(m) + 3o(m)? m + 27 Let b(u) = -u - 11. Let r = 8 + -2. Let h(o) be the first derivative of -o - 9421. Calculate rh(y) - b(y). y + 5 Let h(i) = 9i3 - i2 + 2i. Let r(o) = 721o - 3599. Let p be r(5). Let z(w) = 8w3 - w2 + 2w. What is pz(n) - 5h(n)? 3n3 - n2 + 2n Let t(u) = 7u3 + 9u*2 + 5u + 4. Let j(x) = -x*3 - x - 1. Suppose -16 = 2a - d, -3a + 29 = 4d + 20. Give aj(n) - t(n). -2n*3 - 9n*2 + 1 Let c(j) = -8. Let q(w) = -10w - 528. Let v(n) = -3n - 153. Let k(r) = 2q(r) - 7v(r). Determine 5c(l) + 3k(l). 3l + 5 Let w(k) = -36k2 + 39k + 4. Let g(q) = -12q2 + 12q + 1. Determine 19g(d) - 6w(d). -12d2 - 6d - 5 Let v(b) = 16812b + 99. Let i(j) = -2101j - 12. Calculate 33i(p) + 4v(p). -2085p Let f(v) = 11v*3 + 182v*2 - 8v - 8. Let y(p) = -4p3 - 61p*2 + 3p + 3. Determine 3f(m) + 8y(m). m*3 + 58m2 Let s(q) = -q2 - 21q. Let w(l) = -461l - 1385. Let o be w(-3). Let t(r) = r. Determine os(i) - 22t(i). 2i2 + 20i Let r(k) = k*2 - 1. Let m(t) = 10 + 15 + 26t*2 + 19t*2 + 23t*2 - 67t*2 - 22. Suppose 2o = o - 3. Calculate or(u) - m(u). -4u*2 Let s(g) = -3639g*3 + 2g*2 - 2. Let m(l) = -21832l*3 + 13l*2 - 13. Determine -6m(t) + 39s(t). -10929t3 Let n(z) = -z2 - 5z + 1. Let x(b) = 315b*2 + 3675b - 735. Give -2940n(a) - 4x(a). 1680a2 Let q(y) = 1. Let i(m) = m + 5. Let r = 123 - 127. Let n be i(r). Let u(d) be the third derivative of d4/8 - d3/6 - 15d*2. What is nq(p) + u(p)? 3p Let c(k) = -16461k*3 + 14632k*2 + 58528. Let b(q) = -2q*3 + 2q*2 + 8. Calculate 7316b(r) - c(r). 1829r3 Let w(d) = 35d - 4. Let n(u) be the third derivative of -17u4/24 + u3/3 + 58u*2. Give 13n(p) + 6w(p). -11p + 2 Let f(x) = 5 + 4x + 2x - x - 7x2. Let p = -105 - -114. Let w(n) = 6 + 2n + 2n2 - 4 + n2 - 6n*2. What is pw(z) - 4f(z)? z2 - 2z - 2 Let a be (-2)/39/(-12)4. Let j(k) = -k*3 - 2k + 2. Let o = 78 + -83. Let l(n) = 6 + 1 - 2 - n*2 + 0 - 5n - 3n3. Determine al(y) + oj(y). -y3 - 2y2 Let q(d) = d2 + 51d + 302. Let z be q(-7). Let j(t) = 9t*2 - 6t - 7. Let p(u) = 24u2 - 14 - u2 - 4u**2 -	{ "pile_set_name": "DM Mathematics" }
(r). 11r3 - 119r*2 - r Let y(n) be the first derivative of 2n*3/3 - 3n*2/2 - n + 640. Let v(r) = 2r*2 - 3r - 1. Suppose t + 8 = 3. Calculate tv(h) + 6y(h). 2h2 - 3h - 1 Let t(b) = 7b2 + 5b - 1. Suppose -4a + 3g = 82 - 96, 0 = 3a - g - 3. Let u(i) = i. Give at(s) + 5u(s). -7s*2 + 1 Let n(m) = -7m + 3 - 5 + 16m. Let d(j) = 19j - 5. Let v = 135325 - 135327. Give vd(q) + 5n(q). 7q Let d(w) = -3w - 4. Let p(k) = -6k - 9. Let o(a) = -9d(a) + 4p(a). Suppose 2373n - 1180n - 25 = 1168n. Let l(v) = -v. What is no(b) + 6l(b)? -3b Let m(c) = -3c2 - 3. Let u(a) = -a2 + a - 1. Let f(p) = 4p2 - 91 - 3p - 89 + 184. Let h(j) = 2f(j) + 7u(j). What is -2h(v) - m(v)? v2 - 2v + 1 Let z(m) = -3m2 + 153m + 12. Let n(j) = j*2 - 76j - 7. Determine 5n(o) + 3z(o). -4o2 + 79o + 1 Let g = 13372 + -13373. Let y(w) = 3w - 5. Let o(l) = -l. What is go(t) - y(t)? -2t + 5 Let x(p) be the first derivative of p3/3 + 3p*2/2 + p + 287. Suppose d + 4 = 5d. Let l(c) = 32038 - c*2 - 32038. Give dx(v) + 2l(v). -v2 + 3v + 1 Let x(t) = 101t + 19. Let y(k) = 84k + 16. Let g(s) = -5x(s) + 6y(s). Let h(n) = -10n + 4. Determine -8g(m) + h(m). -2m - 4 Let y(f) be the first derivative of 3/2f*2 - 87 + 3f. Let b(z) = z - 1. Determine -2b(d) + y(d). d + 5 Let u(y) = -y. Let a be 22/22(-2)/1. Let m(o) = 8o + 1. Suppose -4i = -j + 6, 51 = j - 5j + i. Calculate am(k) + ju(k). -2k - 2 Let w(a) = -10a3 + 4a*2 - 6a - 6. Let s(m) = 51m3 - 22m*2 + 31m + 32. What is 3s(o) + 16w(o)? -7o3 - 2o*2 - 3o Let f(o) = -o - 1. Let k(z) = -7z. Let l(m) = 14m. Let q(r) = 7k(r) + 3l(r). Give -10f(c) + 2q(c). -4c + 10 Let h(x) = -233x*2 - x + 4. Let g(t) = 6t*2 + t - 1. Determine -2g(a) - h(a). 221a2 - a - 2 Let k(j) = 11j3 + j2 - 90j - 45. Let u(n) = 3n*3 - 23n - 12. Determine -8k(p) + 30u(p). 2p3 - 8p*2 + 30p Let l(v) = 66v + 103. Let d(t) = 33t + 56. Give -11d(j) + 6l(j). 33j + 2 Let z(h) = h + 10. Let l(f) = 10f + 692. Let i(y) = -3y - 199. Let r(x) = -7i(x) - 2l(x). Give -4r(q) + 3z(q). -q - 6 Let g(d) = -2d - 56. Let v(p) = -p - 41. Calculate 2g(b) - 5v(b). b + 93 Suppose -4n - 70w - 4 = -69w, -4w = 0. Let i(q) = q + 1. Let b(z) = 5. What is ni(p) + b(p)? -p + 4 Let n(v) = -13v - 80v2 + 0v - 1 + 3v + 7v + 9. Let s(a) = -53a2 - 2a + 5. Calculate -5n(u) + 8s(u). -24u2 - u Let z(k) = -94k*2 - 6k - 62. Let u(a) = 251a2 + 17a + 185. Calculate 3u(d) + 8z(d). d*2 + 3d + 59 Let j(z) = -111z2 - 10z + 30. Let i(l) = 335l2 + 32l - 97. Determine 4i(k) + 13j(k). -103k2 - 2k + 2 Let i(k) be the second derivative of k3/6 - k2/2 - 2073k. Let s(t) = 3t - 3. What is 15i(h) - 6s(h)? -3h + 3 Let w(m) = -1. Let t(v) = 248v - 12. Determine -t(b) + 7w(b). -248b + 5 Let w(f) = 7f2 + 7f - 17. Let a(v) = 5v2 + 10v - 16. Calculate -3a(q) + 4w(q). 13q2 - 2q - 20 Let d(j) = 6j - 1265. Let v(b) = -5b + 1289. Determine -2d(m) - 3v(m). 3m - 1337 Let c(n) = -4n + 1. Suppose -5h - 4f = 26, 0h - 3h = 3f + 18. Let x(k) = k. Suppose 0 = 499i - 462i + 222. Calculate hc(j) + ix(j). 2j - 2 Let u(r) = 5972r + 20. Let f(m) = -2985m - 12. Determine 5f(o) + 3u(o). 2991o Let o(s) = s - 3s + 3s - 3. Let c(t) be the second derivative of 7t*3/6 - 19t*2/2 - 4t - 639. Calculate -6c(u) + 39o(u). -3u - 3 Let v(l) be the third derivative of -11l*5/60 + 3l*4/8 + 718l*2. Let u(q) = 6q*2 - 4q. What is 9u(t) + 4v(t)? 10t2 Let m(y) = -5y + 269. Let k(i) = -3i + 2. What is 2k(l) - m(l)? -l - 265 Let j(k) = -25k2 + 3k - 25. Let i(b) = -29b2 + 5b - 24. What is 2i(c) - 3j(c)? 17c2 + c + 27 Let c(b) = -4b*3 + 4b*2 - 4b - 1. Let x(z) = 17z3 - 17z*2 + 17z + 3. Suppose 5l + 5g + 342 = 277, 5l = -4g - 61. Determine lc(a) - 2x(a). 2a3 - 2a*2 + 2a + 3 Let c(z) = 27z - 4. Let k(o) be the first derivative of 851o*2 - 253o + 905. Give -253c(w) + 4k(w). -23w Let k(h) = 29h*2 - 4h + 229. Let c(p) = 49p2 - 7p + 459. Calculate -4c(o) + 7k(o). 7o2 - 233 Let l(g) = 9g*2 - 3g + 3. Let k(r) = 14r2 - 9r - 4r2 + 11r - 6r + 4. Let b be 15/(-6) - 90/60. Calculate bl(p) + 3k(p). -6p*2 Suppose -21j = -29j - 43j - 102. Let x(y) = -19y2 + 2y - 2. Let t(w) = -19w2 + 3w - 3. Determine jt(p) + 3x(p). -19p2 Let h(r) = 2954r - 1014. Let v(c) = 985c - 317. Determine 5h(z) - 16v(z). -990z + 2 Let q(a) = 4a2 - 10. Let s(u) be the first derivative of u3/3 - u - 4163. Calculate -2q(w) + 10s(w). 2w*2 + 10 Suppose 0 = 5b + 9 + 1. Let w(h) = h + 3. Let l(k) = -k + 6. Let t(g) = -19 - 12g + 2g + 14g. Let j(q) = 7l(q) + 2t(q). Give bj(p) + 3w(p). p + 1 Let f(r) = 3r*2 - r + 3. Let z(u) = -9454 + 9u*2 - 9442 + 18904 - 2u. Give 8f(m) - 3z(m). -3m2 - 2m Let g(d) = 30 + 4d3 - 5d*3 - 14 - 6d*2 - 5d - 2d2. Let h be g(-7). Let o(k) = -1692 + k2 - hk3 + 1692. Let y(s) = s3. Calculate o(i) + 4y(i). 2i3 + i2 Let j(k) = 4k - 5. Let v(o) = -1. Suppose -31f + 47f = -57f - 73. What is fj(c) + 4v(c)? -4c + 1 Let x(s) = -1. Let d(c) = 296c - 2. What is d(u) - 6x(u)? 296u + 4 Let m(n) = 8n2 - 54n + 3. Let d(h) = 9h2 - 40h + 5. What is 4d(p) - 3m(p)? 12p2 + 2p + 11 Let w(c) = -63c2 - 5c. Let g(y) = 32y2 + 2y. Let x be (10/(-6))/(18(-20)/(-1080)). Give xg(q) - 2w(q). -34q*2 Let r(g) = -391g*2 - 31g + 3. Let v(o) = 1565o2 + 113o - 11. Determine 11r(u) + 3v(u). 394u2 - 2u Let c(p) be the first derivative of -p3/3 - p2/2 + p - 1344. Let m(u) = 66u2 + 54u - 54. What is 108c(j) + 2m(j)? 24j2 Let r(w) = -10w*3 - 292w*2 + 175w + 7. Let j(x) = -3x3 - 97x*2 + 57x + 2. Calculate 7j(s) - 2r(s). -s*3 - 95s*2 + 49s Let w(y) = -3y - 5. Let l(i) = i3 + 4i*2 - 8i + 19. Let g be l(-6). Let x be (2 - g) + (-3 - 6). Let k(b) = -15b - 26. Determine xk(d) + 11w(d). -3d - 3 Let b(l) = -120l - 65. Suppose -3n + 331 = 5a, -a = 4a - n - 323. Let r(u) = -1398 + 704 + 11u + 700. What is ar(i) + 6b(i)? -5i Let f = -179 + 178. Let i(q) = -10q2 + 4q - 4. Let c(v) = -v*2 + v - 1. Let d be 1 + (-6)/7119/(-34). What is dc(m) + fi(m)? 6m2 Let u(z) = -49z*2 + 7z + 1. Let r(n) = -73n2 + 10n + 2. What is -5r(i) + 8u(i)? -27i2 + 6i - 2 Let j(c) = 7c3 - 7c*2 - 7c + 7. Let d(i) = i*2 + i - 1. Suppose 0 = 5378v - 5414v - 1008. What is vd(k) - 4j(k)? -28k*3 Let m(l) = 28l*2 + 216l + 12. Let k(w) = -35w2 - 217w - 14. What is -6k(o) - 7m(o)? 14o2 - 210o Let c(w) = w*2 - w + 1. Let m(z) = -46z*2 + 22z - 22. Suppose u + 2 = 4f, 0 = -3u + 5u + 5f + 4. What is um(o) - 44c(o)? 48o2 Let t(v) = -2v*2 + 5. Let z(s) = -31s*2 + 9s + 28. Give 6t(a) - z(a). 19a*2 - 9a + 2 Let k(r) = 3313r + 8. Let i(y) = 9940y + 27. What is 3i(v) - 10k(v)? -3310v + 1 Let h(p) = 283p*3 - 13p*2 - 66p - 18. Let u(w) = 71w3 - 3w*2 - 16w - 4. Determine 2h(t) - 9u(t). -73t3 + t2 + 12t Let u be 2 + (36/(-6) - 3). Let d(j) = -j*3 - 7j*2 - 2. Let r be d(u). Let q(t) = -t - 1. Let n(s) = -4s - 4. Determine rn(o) + 7q(o). o + 1 Let m(r) = 4r - 4. Suppose -5u + 26 = i, 7i + 4u - 40 = 3i. Let o(b) = -9b + 8. Determine io(d) + 13m(d). -2d - 4 Let a(r) = -426r*2 + 13r - 3. Let p(d) = -2558d2 + 85d - 19. Calculate 13a(t) - 2p(t). -422t2 - t - 1 Let v(g) = 25g*2 - 37g + 2. Let m(b) = 20b2 - 36b + 2. Determine 6m(i) - 5v(i). -5i2 - 31i + 2 Let g(s) = -2s2 - 2s + 2. Let d(m) = 16m2 + 9m + 9. Give d(l) + 6g(l). 4l*2 - 3l + 21 Let u be (322/56)/(-23) - 290/(-8). Let q(o) = o. Let w(p) = 11p. Give uq(g) - 4w(g). -8g Suppose w = 4f - 55, 2 = 4w - 2. Suppose -22a - 35 = -15a. Let q(x) = x*2 - 5x + 3. Let u(c) = 2c2 - 14c + 8. What is au(t) + fq(t)? 4t2 + 2 Let k(i) = 9i. Let z = -2477 + 2474. Let t(j) = -j - 1. Let w(a) = 7a - 1. Let o(c) = -t(c) + w(c). What is zo(l) + 2k(l)? -6l Suppose a - 88 = h, -33a - 70 = -34a - 5h. Suppose -ai + 82i = -9. Let d(w) = -1. Let c(q) = q - 2. What is id(k) - c(k)? -k - 1 Let o(y) = 2y*2	{ "pile_set_name": "DM Mathematics" }
ed by 3. 26851/3 Calculate 3565470 divided by -6. -594245 What is 1 divided by 7822655? 1/7822655 What is -2118913 divided by 69? -2118913/69 -5875552 divided by 4 -1468888 What is -447721284 divided by -111930321? 4 9335040 divided by 29920 312 978246 divided by -165 -326082/55 Calculate -15210743 divided by -15210743. 1 Divide -161631795 by 5. -32326359 Divide 390 by -40582. -195/20291 Divide 3105170 by 16343. 190 What is -20517 divided by 23647? -20517/23647 What is 282058503 divided by -3? -94019501 Divide 128582640 by 1620. 79372 Calculate -492 divided by 1146. -82/191 Calculate 100240 divided by 8. 12530 Divide -44953252 by 4. -11238313 What is -1096577 divided by 188? -1096577/188 Divide 12380 by -177. -12380/177 -5472770 divided by -56 2736385/28 Divide 15858297 by 6069. 2613 Divide 312428568 by -1896. -164783 What is -3666755 divided by 5? -733351 Divide 5 by 311106. 5/311106 Divide -67947 by -1. 67947 Calculate -6020 divided by 1151. -6020/1151 Calculate -1 divided by 9629901. -1/9629901 What is -53 divided by -4256? 53/4256 Divide -728380 by -485. 145676/97 7532 divided by -1694 -538/121 Divide -69037689 by -987. 69947 68876496 divided by 11479416 6 -12185 divided by 69 -12185/69 Calculate -567228984 divided by -4. 141807246 -23466960 divided by -5926 3960 -1540 divided by 30240 -11/216 Calculate -617777 divided by -38. 617777/38 Calculate -451 divided by 21066. -451/21066 What is -3554800 divided by -2? 1777400 4 divided by 5678747 4/5678747 What is 913840644 divided by -26877666? -34 Divide -3697 by -7148. 3697/7148 Divide 511805079 by 3. 170601693 Calculate 1635 divided by -1567. -1635/1567 What is 94155312 divided by 2994? 31448 Calculate -4694288 divided by -6. 2347144/3 Calculate 203 divided by 99099. 29/14157 79404536 divided by -79404536 -1 2675 divided by -36497 -2675/36497 -89988002 divided by 30629 -2938 What is 24044935 divided by -1? -24044935 What is -3905308 divided by 46? -84898 Calculate -544766391 divided by -81. 6725511 What is 1074587 divided by 46? 1074587/46 Divide 586002 by -202. -2901 Divide -2908839 by -11589. 251 Calculate -27604122 divided by 4600687. -6 Divide -848297 by 434. -848297/434 11700880 divided by 2340176 5 -9792208 divided by -80264 122 Calculate 45744720 divided by 73. 626640 55470070 divided by -1 -55470070 What is -11 divided by 5890871? -11/5890871 What is 47 divided by 80622? 47/80622 What is -282059 divided by 543? -282059/543 Calculate -91870176 divided by -8364. 10984 What is -4 divided by -61385? 4/61385 What is 56742912 divided by 18? 3152384 -4 divided by 6627846 -2/3313923 Calculate -5838624 divided by 8. -729828 -1330894767 divided by -12261 108547 78486000 divided by 2060 38100 Calculate -176320690 divided by -5. 35264138 174 divided by -371754 -29/61959 53273151 divided by 31881 1671 13451 divided by 356 13451/356 Calculate -12810209 divided by -10. 12810209/10 Calculate 21856117 divided by -7. -21856117/7 What is 113509 divided by -188? -113509/188 Calculate 2039429 divided by -32. -2039429/32 -90979522 divided by 2458906 -37 33099 divided by 172 33099/172 Divide -11080996 by -32026. 346 What is -864848852 divided by -644? 1342933 Divide 37900 by 169. 37900/169 Calculate 246374324 divided by -4102. -60062 Divide 1246704 by 36. 103892/3 What is 17907992 divided by -21733? -824 Calculate 20948175 divided by -6982725. -3 Divide 1452148 by 3. 1452148/3 Calculate -25230996 divided by 61092. -413 Divide 910787 by 590. 910787/590 Calculate -10287550 divided by -97. 10287550/97 What is 389653548 divided by 24604? 15837 What is 4708149 divided by -4708149? -1 Calculate 458620 divided by -4. -114655 Divide -46402700 by -38035. 1220 -40618212 divided by -29 1400628 Calculate 19108 divided by 232. 4777/58 Divide 588939 by 588939. 1 What is 1853100 divided by 5? 370620 Calculate 219631840 divided by -2. -109815920 Divide -94 by -7306201. 94/7306201 Calculate 4 divided by 4712124. 1/1178031 Calculate 20 divided by -2701576. -5/675394 -10614 divided by 1168 -5307/584 Calculate -13473 divided by -29016. 1497/3224 -17484237 divided by -98781 177 What is -52 divided by 28077630? -26/14038815 Calculate -1135 divided by 265048. -1135/265048 What is 6146928 divided by 85374? 72 Calculate 1809 divided by 99281. 1809/99281 -20 divided by 12618382 -10/6309191 4460473 divided by 4460473 1 Calculate 2985435880 divided by -2. -1492717940 929849 divided by -1 -929849 Calculate -3 divided by -69926369. 3/69926369 Calculate -2855443 divided by 4. -2855443/4 Calculate 105528960 divided by -1758816. -60 Calculate -107720160 divided by -626280. 172 Calculate -14012488 divided by -12206. 1148 What is -36237300 divided by 110? -329430 Calculate -246125040 divided by 1172024. -210 What is 10158511 divided by 94? 10158511/94 Calculate -718316 divided by 870. -359158/435 Divide 4 by 87278810. 2/43639405 What is 288307421 divided by 433? 665837 9521 divided by -7512 -9521/7512 355935754 divided by -2 -177967877 What is -2981460 divided by 40290? -74 Divide 122278091 by -169. -723539 Divide 18046560 by -2. -9023280 What is 2 divided by 2742414? 1/1371207 68773390 divided by 6 34386695/3 -50694240 divided by -80 633678 -2 divided by 2713078 -1/1356539 Divide -2127582 by 12442. -171 -897744 divided by -7608 118 What is -66395516 divided by -23038? 2882 Divide -162 by -1612579. 162/1612579 Divide -2749945 by -55. 49999 24221133 divided by 2141 11313 -9672456 divided by -68 142242 Divide 0 by 2936036. 0 Divide 21662718 by 656446. 33 2905995 divided by 15 193733 -24659401 divided by -3 24659401/3 492495 divided by 98 492495/98 Divide 201420121 by 5. 201420121/5 What is 4082240 divided by 64? 63785 Calculate -13 divided by -417527. 13/417527 Divide -2019 by 98406. -673/32802 Divide 52784 by -608. -3299/38 Calculate 984061 divided by 13. 75697 What is 6447197 divided by -2? -6447197/2 What is -913731024 divided by 12? -76144252 Calculate -14 divided by -1060382. 7/530191 Divide -127871208 by 32712. -3909 -154235277 divided by 1563 -98679 -11713519 divided by -11713519 1 135365 divided by 100 27073/20 Calculate -231324 divided by 1892. -57831/473 -43911055 divided by -8782211 5 Divide -68782662 by -27. 2547506 4 divided by 1885630 2/942815 -7 divided by -6158372 7/6158372 0 divided by 2950096 0 Calculate 3451814 divided by -185. -3451814/185 Calculate -237 divided by 44311. -237/44311 -8995 divided by 7408 -8995/7408 Divide -506662 by -506662. 1 What is 300571830 divided by 7706970? 39 Divide -11194865 by -5. 2238973 Calculate -70114928 divided by 4. -17528732 Calculate -65 divided by 199867. -65/199867 Calculate -75780616 divided by 39428. -1922 What is 29860055 divided by 3? 29860055/3 -4 divided by 233842 -2/116921 What is 25741233 divided by 4? 25741233/4 What is 149997470 divided by -7? -21428210 Divide 326537 by 7. 326537/7 -14634680 divided by 22760 -643 What is -112868 divided by -53? 112868/53 Calculate -118563642 divided by 27. -4391246 1068984 divided by 18 59388 -5 divided by 30435429 -5/30435429 Calculate -3431 divided by -88. 3431/88 Calculate -120428 divided by -5250. 8602/375 93891 divided by -1781 -93891/1781 Calculate 506338293 divided by -3. -168779431 -1257689 divided by 6 -1257689/6 What is -962636 divided by -6? 481318/3 Calculate -2001232 divided by 500308. -4 -87958920 divided by 490 -179508 Divide 418627 by -165. -38057/15 -558069764 divided by 14 -39862126 Calculate 1 divided by 138473296. 1/138473296 What is -8480867 divided by 4? -8480867/4 Calculate 5616799 divided by 6. 5616799/6 Calculate 300 divided by -17198. -150/8599 Calculate 8130780 divided by 7. 1161540 Calculate 644621404 divided by 23022193. 28 Divide 3 by -20979949. -3/20979949 -2449 divided by 5769 -2449/5769 Divide 4 by -15768382. -2/7884191 Calculate 2142797 divided by 152. 2142797/152 What is -117406608 divided by -2? 58703304 36 divided by -376354 -18/188177 Divide -158112 by 37. -158112/37 -1424 divided by -851 1424/851 Divide 70626621 by 417909. 169 -5282 divided by -1611 5282/1611 What is 1 divided by 25092903? 1/25092903 Divide -23492 by 410. -11746/205 Calculate -29311 divided by 72. -29311/72 What is -2 divided by 32465633? -2/32465633 Calculate 15721467 divided by 2787. 5641 What is 61 divided by -16002? -61/16002 -238	{ "pile_set_name": "DM Mathematics" }
he terms in -4944805 - 12k + 9889612 + 18k*3 - 4944807 + 12k + 0k. 18k*3 Collect the terms in -2c*2 - 1928156 + 1928142 + 4c*2. 2c*2 - 14 Collect the terms in -28388p - 4 + 14139p + 4 + 14200p. -49p Collect the terms in -17f*2 + 12f*2 - 9f2 + f2 + 121f2 + 16f*2. 124f*2 Collect the terms in -51b*2 - 60b*2 + 189b*2 - 87b*2 - 26b*2. -35b*2 Collect the terms in 37530 - 75r*2 + 37533 - 187667 + 37534 + 37530 + 37540. -75r*2 Collect the terms in 685b - 1547b - 23b*2 + 862b - 46b2 + 81b*2. 12b*2 Collect the terms in 203702m + 12m2 + 203637m - 16m2 - 407339m. -4m2 Collect the terms in -67 + 2x + 30 - 65x + 36 - 66x. -129x - 1 Collect the terms in -y - 8y - 2867y3 + 11y - 2y - 3. -2867y*3 - 3 Collect the terms in 14011q*3 + 13888q*3 + 13883q*3 + 14018q*3 - 55513q*3. 287q*3 Collect the terms in 25x*3 + 10x*3 + 12x*3 + x + 32x*3 + 7x*3 - 4x. 86x3 - 3x Collect the terms in -3200p + 5834p + 2817p + 3254p. 8705p Collect the terms in 41 + 38 - y3 + 30 - 10467y + 10469y. -y3 + 2y + 109 Collect the terms in -336w - 24 - 4 + 29 + 6 - 7. -336w Collect the terms in 31u3 + 295 - 34u*3 - 940 + 327 + 318. -3u*3 Collect the terms in -2290n*2 - 38n*3 - 2285n*2 + 6867n*2 + 32n*3 - 2292n*2. -6n*3 Collect the terms in 70884n + 92494n - 41350n + 86707n. 208735n Collect the terms in 5 - 1 + 96m + 4 + 40 - 3 - 47. 96m - 2 Collect the terms in -2462 - 2458 + 5t3 + 7381 - 15t - 2461. 5t3 - 15t Collect the terms in 154 - 154 + 190m - 9m + 108m. 289m Collect the terms in -418f2 - 7f*3 - 33f*2 + 404f*2 + 47f*2 - 3f + 3f. -7f*3 Collect the terms in -68s*2 + 410s - 1661s + 412s + 411s + 428s. -68s2 Collect the terms in -22 - 203t + 65t - 24 - 106. -138t - 152 Collect the terms in t - 5t - 5t + 3t - 9913 + 9907. -6t - 6 Collect the terms in 343v + 687v + 351v - 559v + 224v + 705v. 1751v Collect the terms in -84w + 0 - 1924w2 - 3 + 2w*3 + 39. 2w*3 - 1924w*2 - 84w + 36 Collect the terms in 46 - 127q - 68 + 22. -127q Collect the terms in -1436 - 5g + 3g + 383 - g + 5g. 2g - 1053 Collect the terms in -33t + 28t + 11t + 4t. 10t Collect the terms in -68v*2 + 75v*2 + 123 - 123 + 39v. 7v2 + 39v Collect the terms in 47867t3 - 22387t*3 - 25486t*3. -6t*3 Collect the terms in 3 - 81180415l*2 + 81180494l*2 - 3. 79l*2 Collect the terms in -576d - 1765d - 5216d - 3588d. -11145d Collect the terms in 4n - 2637792n*3 + 822667n*3 - 4n. -1815125n3 Collect the terms in 220w*3 + 199w*3 + 8w*2 + 200w*3 - 650w*3. -31w*3 + 8w*2 Collect the terms in -103714a*3 + 103903a*3 + 24a*2 - 24a*2. 189a*3 Collect the terms in -187 + 2 + 3v + 184 + 1 + 14v. 17v Collect the terms in -6b2 - 446358b*3 + 4b*2 + 445951b*3 + 4b*2 - 2b*2. -407b*3 Collect the terms in 54146m*3 + 53972m*3 - 108122m*3. -4m*3 Collect the terms in -1073y*2 + 5373y*2 - 1074y*2 - 1076y*2 - 1075y*2 + 3 - 1076y2. -y2 + 3 Collect the terms in -29y + 29y + 8024708y2 + 8024906y*2 - 16049617y*2. -3y*2 Collect the terms in -1082w*2 - 872w*2 - 19 + 1721w*2. -233w*2 - 19 Collect the terms in 7052633o*2 - 5342591o*2 + 15299636o*2. 17009678o*2 Collect the terms in -133p - 374p - 347p + 519p. -335p Collect the terms in -362 - 60051 - 14n + 8n*2 + 16n. 8n2 + 2n - 60413 Collect the terms in -3531 + 1478q2 + 3477 - 1477q2. q2 - 54 Collect the terms in 412 - 2544 + 36 + z. z - 2096 Collect the terms in 75w - 292w - 5 + 76w + 55w + 67w. -19w - 5 Collect the terms in 6466340270 - 6466340270 - 41z2. -41z*2 Collect the terms in -19389 + 7t*3 + 9455 + 9937. 7t*3 + 3 Collect the terms in 2571c - 935 - 2576c + 935. -5c Collect the terms in -5355 + 10702 - 121o + o2 - 5352. o2 - 121o - 5 Collect the terms in 2698 + 5081 + q3 + 1360 - q2 - 2q2. q3 - 3q*2 + 9139 Collect the terms in 13364s - 6682s - 6685s - 1881. -3s - 1881 Collect the terms in 15u + 13u + 5u + 3u + 21u + 12u. 69u Collect the terms in -201 - 234o - 8 + 268o. 34o - 209 Collect the terms in 82 + 20n*2 + 5n*2 - 126 + 3n*2. 28n*2 - 44 Collect the terms in 12i*2 + 176i*3 + 15i*2 - 61i*3 - 48i*3 - 48i*3. 19i*3 + 27i*2 Collect the terms in 2532155o + 761685o - 30487o. 3263353o Collect the terms in -2 + 19014b - 5237b - 6890b - 6888b. -b - 2 Collect the terms in -1664 - 203u + 1664 + 291u - 81u. 7u Collect the terms in -d2 + 136188224d - 136188224d. -d2 Collect the terms in -128505786 - 6l*2 + 14l + l*2 + 128505786 - 14l. -5l2 Collect the terms in -3x + 348784x3 - 348972x*3 + 3x. -188x3 Collect the terms in 62221m*2 - 62221m2 + 3658 - 4631 - m3. -m*3 - 973 Collect the terms in -241285y*2 - 9737y*2 - 63992y*2 + 20860y*2. -294154y*2 Collect the terms in -71u + 114u - 505u + 79u. -383u Collect the terms in 138k + 3 - 569k + 1516k - 547k - 542k - 3. -4k Collect the terms in -10205g + 5741g + 4484g + 3. 20g + 3 Collect the terms in -4 + 511r - 17 - 2 - 112r. 399r - 23 Collect the terms in 966j*2 - 3939j*2 + 1540j*2 + 1431j*2. -2j*2 Collect the terms in 224p*3 + 9890 - 4p*2 - 4943 - 4945. 224p*3 - 4p*2 + 2 Collect the terms in 9067b*2 + 9068b*2 - 45324b*2 + 9063b*2 + 9057b*2 + 9072b*2. 3b*2 Collect the terms in 30429 - 35b - 6b - 79b - b. -121b + 30429 Collect the terms in 30362b3 - b2 + b*2 - 31919b*3. -1557b*3 Collect the terms in 726z + 28 - 1676z + 949z. -z + 28 Collect the terms in -1 - 127i - 252i + 448i - 93i + 1. -24i Collect the terms in 66 - 19839o*2 + o - 15 + 19836o*2 + 40. -3o*2 + o + 91 Collect the terms in 1522520x*3 + 2424x - 1522396x3 - 2424x. 124x3 Collect the terms in 15 + 76 - 25 + 32 - 3q. -3q + 98 Collect the terms in -155n + 1985n + 997n. 2827n Collect the terms in 0 + 1904094k + 0 - 952052k - 952040k. 2k Collect the terms in 4h*3 - 13503945816 + 13503945816. 4h*3 Collect the terms in 1788w*2 - 53w - 54w + 56w. 1788w2 - 51w Collect the terms in -3076g + 15334g - 3082g - 3074g - 3024g - 3075g. 3g Collect the terms in -24 + 43 + 27 - 470w + 19. -470w + 65 Collect the terms in 497 + 1602x*3 - 351 - 146 + 15x*3. 1617x*3 Collect the terms in -78058n*2 - 90n + 8737n2 + 90n. -69321n2 Collect the terms in 6230t - 13401t + 6741t. -430t Collect the terms in -1634 + 1048 + 642 + f3. f3 + 56 Collect the terms in 16080h*2 - 7810h*2 - 6888h*2. 1382h2 Collect the terms in -552 + y2 - 367 + 262 - 309. y*2 - 966 Collect the terms in -2s*2 - 9s*3 + 16s*3 + 2s*2 - 1 + 188s*3. 195s*3 - 1 Collect the terms in 16142205q*2 + 40q*3 - 16142205q*2. 40q*3 Collect the terms in 6917528r*2 + 1 - 6917528r*2 - 38r*3. -38r*3 + 1 Collect the terms in -97636y - 97669y + 195305y + 120y3. 120y*3 Collect the terms in -521156 + 1563473 - 521160 + 16r - 7r - 521157 - 10r. -r Collect the terms in 850i3 - 31i + 7i - 20i + 44i. 850i*3 Collect the terms in 58v*3 + 863592 + 125v*3 - 863592. 183v*3 Collect the terms in -2269c - 2c3 + 202309 - 202309. -2c*3 - 2269c Collect the terms in 1868412639 - 1868412639 - 287t. -287t Collect the terms in 3846r - 7724r + 284 + 3882r. 4r + 284 Collect the terms in -19775x2 - 12x - 19764x2 + 12x + 39537x2 + 7x*3. 7x*3 - 2x*2 Collect the terms in 4543p*2 + 4935p*2 - 7p*3 + 2p*3 + 4926p*2 - 19327p*2 + 4923p*2. -5p*3 Collect the terms in -53r*3 - 33r*3 - 66r*3 + 86r*3. -66r*3 Collect the terms in 0f*3 - 2123f + 564f - 2f*3 - 1672f - 3253f. -2f*3 - 6484f Collect the terms in 14h2 + 9192 + 2h*2 - 3h*2 - 8h*2 + 8730. 5h*2 + 17922 Collect the terms in 563z*2 - 566z*2 + 141z - 4 + 2 + 1 + 129z. -3z*2 + 270z - 1 Collect the terms in -21948 + 9v - 22419 + 44365 - 4v. 5v - 2 Collect the terms in 6k*2 + 10k*2 + 3 + 17k*2 - 4 + 1. 33k*2 Collect the terms in -156m*2 + 544m*2 + 166m*2 - 292m + 294m. 554m*2 + 2	{ "pile_set_name": "DM Mathematics" }
-5b - 4m - 4 = 0, -3b + 2m = -7b - 2. Suppose bd = 3d + 3s - 21, 0 = -5d - 3s + 41. Calculate the greatest common divisor of 80 and d. 10 Suppose 2j = 3j - 39. Calculate the highest common divisor of 13 and j. 13 Let i(s) = 5s3 - 4s*2 + 5s - 3. Let l be i(2). Calculate the greatest common divisor of l and 31. 31 Let g = 55 - -8. What is the highest common factor of g and 9? 9 Let y(k) = -k*2 + 7k + 7. Let o be y(6). Calculate the greatest common factor of o and 13. 13 Let p = -133 + 254. Suppose -8 = -4t + 4. Let s be 35/t - (-2)/(-3). Calculate the greatest common factor of p and s. 11 Let n(h) = -h3 + 6h*2 - 4h. Let m be n(5). Let f(t) = -t*3 + 6t*2 + 5t + 5. Let d be f(m). Calculate the greatest common divisor of d and 22. 11 Let t be (72/10)/(3/10). Let j be ((-15)/6 + -2)(-8)/6. What is the greatest common factor of t and j? 6 Suppose 6o - 15 = o. Suppose 0 = -ob + 62 - 17. Suppose -v - 4k + 50 = 0, -4k + 110 = 5v - 60. Calculate the highest common factor of v and b. 15 Let z be (-2 + -3)12/15. Let k be ((-220)/(-50))/(z/(-10)). What is the highest common divisor of 22 and k? 11 Suppose 0 = -k, 2i - 22 = 3k - 7k. Calculate the greatest common divisor of 11 and i. 11 Suppose 2d - 115 = -x, -3x + 51 = d - 14. Let v(t) = t + 3. Let k be v(-4). Let l be (k/1)/((-1)/14). Calculate the highest common factor of l and d. 14 Suppose 2j - 4 = 4. Calculate the greatest common divisor of 1 and j. 1 Suppose 0 = 3m + 5 + 16. Let n = m + 11. Calculate the greatest common divisor of 28 and n. 4 Let q be (-10 - 2)/3 - -102. Let p = -62 + q. Calculate the highest common factor of p and 24. 12 Let y = 80 - 0. Suppose 2w = -q - 3q + 92, 0 = 4q - w - y. Let g be 147 - (-4 + 4)/1. What is the highest common divisor of q and g? 21 Suppose -128 = -15w + 11w. Calculate the highest common divisor of 4 and w. 4 Suppose 2a + 2i = 10, -5 = -3a + 3i - i. Calculate the greatest common divisor of 3 and a. 3 Suppose 0 = z + 3b - 80, 0 = 2b - 5 - 5. Let f = 33 + -20. What is the greatest common divisor of f and z? 13 Let l be 3 - (3 + -1 - 1). Suppose lm = 4m + 16. Let k be 0 + 0 - (m - -3). What is the greatest common divisor of 1 and k? 1 Let y = -40 - -48. What is the greatest common divisor of y and 8? 8 Let l = -28 - -45. Suppose 14z - 3z = 187. What is the highest common divisor of z and l? 17 Let j be 0 + (2 + 2)/4. Calculate the greatest common factor of 13 and j. 1 Suppose -2a = 2a - 96. Let f be (270/a)/(2/8). Calculate the highest common factor of 18 and f. 9 Let v be (26/(-8)6)/(6/(-8)). What is the highest common factor of v and 117? 13 Let n(x) = x + 91. Let r(u) = -u + 1. Let q be r(1). Let g be n(q). What is the greatest common factor of g and 13? 13 Let y = 241 - 106. What is the highest common divisor of 54 and y? 27 Let p be (13)/((-21)/(-28)). Let z be p(2 - (1 - 1)). Let w be -1 + 1 + 188. What is the highest common divisor of z and w? 8 Let w = 11 + -12. Let f be 77 - (-1 + w) - 3. Calculate the greatest common divisor of f and 19. 19 Let t(v) = 2v*2 - 3v + 9. Suppose -4u + 34 - 10 = 0. Let g be t(u). Suppose 0 = -4k + g - 27. What is the highest common divisor of 45 and k? 9 Suppose 0 = -2a + 7a - 75. Let c = 0 + a. Let y = 633 + -498. What is the greatest common divisor of y and c? 15 Let r = 318 - 183. Calculate the greatest common divisor of 15 and r. 15 Let f(x) be the third derivative of x4/24 - x3/6 - 2x2. Let g be f(2). Suppose -39 = -4r + 5. What is the greatest common divisor of r and g? 1 Suppose -4 + 2 = x - p, 3x + p - 2 = 0. Suppose 2d + 88 = 5a, -5d - 16 - 4 = x. What is the greatest common divisor of a and 16? 16 Suppose 138 - 54 = 4l. Let p(k) = k2 - 4. Let m be p(-5). Suppose m = r + 2r. Calculate the greatest common divisor of l and r. 7 Let q = -13 - -29. Let k be (0 - 0) + 42 - 2. What is the greatest common factor of q and k? 8 Suppose -17n + 12n = -90. Calculate the highest common factor of 27 and n. 9 Let v = 12 + -7. Suppose t + 1 = -vh, 3h + 0 = 3. Let l(a) = -a*3 - 7a*2 - 7a + 6. Let q be l(t). Calculate the greatest common factor of q and 18. 6 Let r = -107 - -172. Suppose r = s + 4s. Calculate the highest common divisor of s and 117. 13 Suppose -122 = -5r - 47. Let j(m) = 40m. Let h = 2 - -1. Let v be j(h). Calculate the highest common factor of r and v. 15 Let y = 10 - -32. What is the greatest common divisor of 28 and y? 14 Let r = 96 + -63. What is the greatest common divisor of 3 and r? 3 Let j = -57 + 81. Calculate the highest common divisor of j and 216. 24 Suppose 2s = 3s - 3. Suppose 3v - s = 2v. Calculate the greatest common factor of v and 15. 3 Let o(c) be the third derivative of -c6/120 + 3c5/20 + c4/8 + c*3/3 + 2c*2. Let z be o(8). Calculate the greatest common factor of z and 10. 10 Suppose -4z + 0 = -12. Let o be 3/(z - 12/8). Calculate the greatest common factor of o and 18. 2 Let s be ((-56)/20)/((-8)/20). What is the highest common factor of 14 and s? 7 Let f be (-2 + 2)7/(-14). Suppose fn - 32 = -2n. What is the highest common divisor of n and 4? 4 Let j(n) = -2n*2 + n - 5. Let o be j(-5). Let m = -40 - o. Calculate the greatest common divisor of m and 20. 20 Suppose -2n = -4n + 12. Let r = n - 6. Suppose -4c + 22 + 10 = r. What is the highest common factor of 56 and c? 8 Let j(k) = k*2 + 5k - 4. Let r be j(-5). Let v be ((-3)/r)/((-2)/24). Let p be (v/(-6))/(1/6). Calculate the greatest common divisor of 18 and p. 9 Let o(j) = -j*3 + 7j*2 + 5. Let v be o(7). Suppose 3q - vr = 3, 2r + r - 39 = -5q. Calculate the highest common factor of 2 and q. 2 Suppose 4a - 2b - 42 = -0b, 2a - 4b = 36. Suppose l = -4i, -5l - 3i = 2i - 15. What is the highest common divisor of l and a? 4 Let u(x) = -5x + 7. Let y be u(-7). Let s(c) = -c. Let m be s(-3). Suppose 84 = k + mk. What is the greatest common factor of y and k? 21 Let y = 20 + -12. Suppose -4c + y = -0. Suppose 0 = -h + 2h - 2. Calculate the highest common divisor of h and c. 2 Let d(p) = p*2 - 6p - 2. Let h be d(8). Suppose -2w = -4w + 568. Suppose 3c - 3 - 3 = 0, -4l + w = 2c. Calculate the greatest common divisor of h and l. 14 Let f be 12/28 + (-1002)/(-14). What is the highest common divisor of f and 8? 8 Suppose 0 = -2l + 3b - 241, 5l + 4b = 4l - 148. Let j be (-1)/(-3) - l/(-6). Let n = -15 - j. Calculate the greatest common divisor of n and 66. 6 Let i be (19-14 + 0)-1. Calculate the greatest common factor of 38 and i. 38 Let o(m) = 6m3 + 12m*2 + 9m + 10. Let q(u) = -u*3 + u - 1. Let n(w) = -o(w) - 5q(w). Let p be n(-11). Calculate the greatest common divisor of 14 and p. 14 Suppose -m + 7 = -9. Calculate the highest common factor of 16 and m. 16 Let p be 2 - 1(-4)/(-2). Suppose n = 1 - 10. Let y = p - n. Calculate the highest common divisor of 1 and y. 1 Suppose 85 = 5r + 5m, -49 = -3r - 2m + 1. Let w(p) = 2p - 13. Let j be w(9). Let n = -3 + j. Calculate the greatest common divisor of n and r. 2 Suppose t = -0t + 28. Suppose -t = -3v + 329. What is the greatest common divisor of 17 and v? 17 Suppose 3v + 0v - 42 = 0. Suppose 2c - v = -l, -4c + 22 + 8 = l. What is the greatest common factor of 16 and c? 8 Suppose -3r = -4l - 43, 0l + l - 41 = -5r. What is the greatest common factor of 6 and r? 3 Let b = 1 + 2. Suppose -bh + 20 = -10. What is the greatest common factor of h and 110? 10 Let r(j) = 2j*3 - 7j*2 - 3j + 8. Let x be r(6). What is the highest common divisor of 68 and x? 34 Suppose -2v + 25 - 1 = 0. Let i(s) = s2 - 18s - 52. Let r be i(22). What is the greatest common divisor of r and v? 12 Let v(h) = 17h - 6. Let a be v(3). What is the greatest common factor of 9 and a? 9 Suppose 0 = 3y - 2h + 22 + 14, -4h = -3y - 30. Let k = y - -31. What is the greatest common divisor of 17 and k? 17 Let g = 33 + 17. Calculate the greatest common factor of 20 and g. 10 Let w(x) = -x2 + 11x + 7. Let q(u) = -1. Let p(k) = 3q(k) + w(k). Let b = 23 - 13. Let h be p(b). What is the greatest common divisor of h and 70? 14 Suppose 3z - 75 = 150. Let x(j) = -4j + 1. Let m be x(-1). Suppose mq = 98 - 23. Calculate the greatest common divisor of q and z. 15 Le	{ "pile_set_name": "DM Mathematics" }
= 4536c + 149845. Determine y(-33). 157 Let u(k) = 4413k - 26273. Determine u(6). 205 Let f(q) = -233q - 87. Calculate f(-2). 379 Let y(b) = -80b*2 + 308b + 16. Calculate y(6). -1016 Let t(x) = -149944x - 3448806. What is t(-23)? -94 Let t(y) = 2306y + 34635. What is t(-15)? 45 Let u(v) = -2v3 - 282v*2 + 6v + 182. Determine u(-141). -664 Let h(g) = -3g3 - 106g*2 - 657g - 23. Calculate h(-8). -15 Let q(g) = 3g3 + 309g*2 + 5162g - 320. Give q(-82). 8 Let b(m) = 47503m + 95003. Determine b(-2). -3 Let w(h) = -2894023h + 28940236. Give w(10). 6 Let h(m) = -2m3 - 204m*2 - 594m + 66. Determine h(-99). 66 Let o(h) = 17h3 + 2517h*2 + 145h - 310. Determine o(-148). 134 Let t(v) = 5v2 + 54v - 3. Give t(-25). 1772 Let j(m) = -27m2 - 84m - 468. Determine j(-8). -1524 Let l(y) = -656254y + 656265. Calculate l(1). 11 Let u(f) = -f2 - 8974f + 80798. Determine u(9). -49 Let i(n) = -n*2 + 91550n - 457726. Give i(5). -1 Let r(u) = -1865u - 22621. Give r(-12). -241 Let d(f) = 2f*3 + 19f*2 + 54f + 657. Calculate d(-9). 252 Let q(s) = 2s3 + 380s*2 + 1498s + 1878. Give q(-186). 18 Let f(z) = -2214347z - 77502151. What is f(-35)? -6 Let o(x) = -16x*2 + 520x - 3126. Give o(8). 10 Let m(o) = 2o2 - 52o + 415. Calculate m(9). 109 Let s(o) = -5032o + 29861. Determine s(6). -331 Let m(q) = -4383q*2 - 39413q + 299. Give m(-9). -7 Let p(h) = h*2 + 20267h + 506166. Calculate p(-25). 116 Let f(b) = b*2 - 119b + 3319. What is f(46)? -39 Let b(p) = 6p2 + 711p - 2594. Determine b(-122). -32 Let w(k) = 6k2 - 21k - 33105. What is w(76)? -45 Let z(o) = -4o3 - 29o*2 + 14o + 1. What is z(-8)? 81 Let i(b) = -1655b - 108292. Give i(-65). -717 Let c(j) = 1240j*2 + 47j - 1. Calculate c(-1). 1192 Let x(q) = -1295q - 240869. Give x(-186). 1 Let g(a) = -1325289a*2 + 1325304a - 2. Give g(1). 13 Let m(v) = 13249v + 1099649. Give m(-83). -18 Let p(u) = -52588u - 157774. Give p(-3). -10 Let h(u) = 1468u - 83609. Give h(57). 67 Let k(z) = z3 - 2z*2 - 526z + 4589. Determine k(10). 129 Let o(t) = 2t2 - 1004599t + 15068539. Give o(15). 4 Let w(r) = 156r + 16909. What is w(-108)? 61 Let q(x) = -1093x + 68870. What is q(63)? 11 Let a(r) = -153231r - 4596922. Calculate a(-30). 8 Let f(n) = 69022n + 1104271. What is f(-16)? -81 Let v(f) = f*3 - 6f*2 - 9739f + 38983. Determine v(4). -5 Let r(p) = -71p3 - 3p*2 - 8p - 3. Calculate r(-1). 73 Let f(o) = 1408o + 45079. Calculate f(-32). 23 Let m(u) = -1660u - 1298. Calculate m(0). -1298 Let g(m) = 95m2 + 1951m + 868. Give g(-20). -152 Let y(n) = -12n2 - 62n + 3986. Calculate y(-21). -4 Let h(u) = -59510u - 119019. Determine h(-2). 1 Let z(y) = -2y*3 - 66y*2 - 551y - 54. Determine z(-18). 144 Let a(w) = 9988w + 119866. Determine a(-12). 10 Let m(q) = 11000q - 88040. Determine m(8). -40 Let j(i) = -2i3 + 404i*2 - 13349i + 2602354. What is j(201)? 7 Let j(o) = -2o3 - 309o*2 + 4721o + 31. What is j(14)? 73 Let t(c) = -5c2 - 17111c + 119683. Calculate t(7). -339 Let c(z) = z*2 + 615z - 17342. Determine c(27). -8 Let p(x) = -2x2 - 671x - 5249. What is p(-8)? -9 Let l(h) = h*2 - 2259h - 2393388. What is l(-786)? -18 Let q(x) = 90x3 - 572x*2 + 118x + 11. Calculate q(6). -433 Let g(i) = i*3 + 32i*2 - 2167i - 23880. Calculate g(-10). -10 Let h(x) = -504x2 - 1245x - 475. Calculate h(-2). -1 Let z(q) = -2q3 - 10q*2 - 125q - 287. Give z(-8). 1097 Let q(y) = -2297y + 33209. What is q(15)? -1246 Let b(o) = 6230o + 44042. Calculate b(-8). -5798 Let c(u) = 38u2 - 8889u + 76293. Determine c(225). 18 Let t(k) = -13k2 - 2291k - 1588. What is t(-176)? -1060 Let u(x) = x*3 - 1173x*2 + 1222x - 58598. What is u(1172)? 2 Let l(h) = -389h + 40836. Determine l(104). 380 Let r(n) = -n3 - 648n*2 + 1107225n + 7. What is r(777)? 7 Let p(l) = -l*3 - 37l*2 - 161l + 20. Determine p(-32). 52 Let y(i) = i*3 + 58i*2 - 4i + 1308. What is y(-58)? 1540 Let m(i) = -13099i - 16648825. Give m(-1271). 4 Let i(w) = 80083w - 1201127. Give i(15). 118 Let p(k) = -k*2 - 607k + 25152. Calculate p(39). -42 Let k(s) = 772s + 14434. Calculate k(-19). -234 Let x(c) = -6337c - 266152. Determine x(-42). 2 Let b(g) = -460g - 116374. Calculate b(-253). 6 Let r(k) = 26k*2 + 45k - 1171. Give r(-7). -212 Let h(j) = -64j2 + 3734j - 54403. What is h(30)? 17 Let t(x) = x*2 + 75x - 567. Calculate t(-83). 97 Let i(b) = 3b3 + 32b*2 - 3123b - 39421. What is i(-13)? -5 Let q(d) = -43d2 - 21d - 80. Determine q(-3). -404 Let r(u) = -838797u + 14259545. Determine r(17). -4 Let k(b) = -246b + 3410. What is k(13)? 212 Let w(x) = -5x2 + 834x - 4273. Determine w(5). -228 Let h(a) = 46a3 + 4195a*2 + 819a + 317. Give h(-91). 317 Let o(g) = g*3 - 99g*2 + 172g + 2031. Calculate o(97). -103 Let i(h) = -1834002h + 12838014. Give i(7). 0 Let r(p) = 811p - 1854. What is r(2)? -232 Let b(j) = 3788j - 30300. What is b(8)? 4 Let n(i) = -6i*2 + 774i + 773. Give n(-1). -7 Let w(l) = -2l2 - 674l + 29323. Calculate w(39). -5 Let i(m) = m3 - m2 - 56m - 158. Give i(-3). -26 Let w(n) = -4n*3 - 8n*2 - 254n - 784. Give w(-3). 14 Let z(u) = 3u2 + 39045u - 39059. Give z(1). -11 Let y(b) = b*3 - 68b*2 - 137b + 578. Give y(70). 788 Let a(b) = -32035b + 2338555. Determine a(73). 0 Let r(a) = a3 - a2 + 43a - 126. What is r(3)? 21 Let t(d) = d*3 + 124d*2 + 2013d + 1886. Give t(-105). -4 Let k(b) = 8387b + 561958. Determine k(-67). 29 Let x(w) = -w3 - 13w*2 - 65w - 571. What is x(-11)? -98 Let o(z) = 18z2 - 427z - 147. What is o(29)? 2608 Let t(q) = -24q3 - 94q*2 + 475q + 1919. What is t(-4)? 51 Let b(u) = 2u3 - 67u*2 - 2745u + 28678. Calculate b(54). 4 Let y(z) = -780z2 + 4z - 4. What is y(1)? -780 Let y(x) = -13x2 - 682x - 3873. Calculate y(-51). -2904 Let g(l) = -115164l - 345499. Calculate g(-3). -7 Let z(f) = -1184f - 14392. Determine z(-11). -1368 Let f(d) = d*3 - 2480d*2 + 92802d - 224. Calculate f(38). 4 Let o(m) = -24859m + 1068957. What is o(43)? 20 Let m(h) = -5h*3 - 50h*2 - 307h - 3020. Give m(-10). 50 Let i(v) = 135v + 2618. Determine i(-33). -1837 Let i(o) = 3078o - 24671. Give i(8). -47 Let g(p) = 424p - 7332. Calculate g(17). -124 Let t(r) = 2r*2 - 317r - 1908. What is t(166)? 582 Let h(a) = 2063a + 2244539. Determine h(-1088). -5 Let l(r) = 14r*3 + 560r*2 + 919r + 36757. What is l(-40)? -3 Let m(u) = -9u2 + 1844u + 1703. Give m(206). -357 Let m(w) = 29383w - 176273. Determine m(6). 25 Let c(t) = -44t*2 + 3t + 39. What is c(1)? -2 Let p(v) = 2v3 + 79v*2 + 656v + 1371. Determine p(-29). 8 Let p(x) = -154x3 + 2310x*2 + 14x - 195. Calculate p(15). 15 Let y(g) = 9992g + 69862. Determine y(-7). -82 Let n(c) = -3c*3 + 27c*2 + 258c - 608. Give n(2). -8 Let b(g) = -236013g + 22. Determine b(0). 22 Let i(p) = -21286p + 42481. Give i(2). -91 Let l(f) = 5f2 + 5499f - 11007. What is l(2)? 11 Let s(b) = 2b3 + 310b*2 - 86b - 13222. Determine s(-155). 108 Let s(r) = 336r + 7503. Calculate s(-22). 111 Let l(q) = 14q*3 - 324q*2 + 48q - 260. Calculate l(23). -214 Let v(z) = 3z2 + 4110z + 85019. What is v(-21)? 32 Let m(k) = 333k + 12979. Calculate m(-39). -8 Let m(l) = -l3 + 115l*2 - 2035l + 19. Calculate m(93). 1042 Let w(p) = -2p3 + 11p*2 + 253p + 472. Determine w(15). -8 Let z(d) = 19d2 - 181d - 7378. Calculate z(25). -28 Let t(g) = 203g - 89369. Calculate t(439). -252 Let h(d) = -d3 + 166d*2 - 134d - 5098. Determine h(165). 17 Let j(k) = -k*3 - 11k*2 + 11k + 202. Give j(-9). -59 Let i(w) = -11w3 + 63w*2 - 182w + 1210. Calculate i(6). 10 Let w(f) = -9f2 - 442f - 878. What is w(-47)? 15 Let b(d) = -290d + 368. What is b(1)? 78 Let j(q) = 2q*3 - 38q*2 + 237q + 52. What is j(11)? 723 Let a(s) = 3s3 - 69s*2 - 4716s + 1627. Give a(-30). 7 Let j(o) = -o*3 + 16o*2 + 617o - 9484. What is j(15)? -4 Let h(x) = 39x + 2078. Give h(-67). -535 Let l(g) = 6g*2 + 260g - 401. Determine l(-42). -737 Let q(f) = f*3 - 71f*2 + 839f + 4420. What is q(21)? -11 Let x(o) = o*3 + 321o*2 + 1847o - 13518. Give x(-315). 27 L	{ "pile_set_name": "DM Mathematics" }
l = 672 - 681. Determine c(l). 9 Suppose 10 = -5b + 4b + 2x, 0 = 4x - 20. Let k(h) = -h + bh + 0h + 1 + 2h. Let t = -7 + 5. Calculate k(t). -1 Let t(i) = -17i*3 + 21i*2 + 6i - 98. Let z(f) = -5f3 + 7f*2 + 2f - 29. Let x(n) = 2t(n) - 7z(n). Let l be (-2 - -3)/((-2)/(-14)). Calculate x(l). -7 Let u = 2007 + -1998. Let p(v) = -2v2 + 18v - 6. What is p(u)? -6 Let p = 620 - 624. Let w(y) be the second derivative of -y*3/6 - 3y*2/2 - y. Calculate w(p). 1 Let b(p) = 5p*3 + 2p*2 + 10p - 4. Let a(m) = -m3 + m2. Let f(t) = -6a(t) - b(t). Calculate f(9). -5 Suppose -2r - 15 = -3s - 0r, 2r = -3s + 27. Let u(h) = -h*3 + 8h*2 - 7h + 8. What is u(s)? 8 Suppose 0 = 4y - 7y - 18. Let t(o) = 3o + 8. Let v(u) = -4u - 8. Let h(f) = -3t(f) - 2v(f). Give h(y). -2 Let s(n) be the second derivative of -5n4/6 + n3/6 + n2 + 17n. Let y(c) = -9c2 + c + 1. Let q(h) = -2s(h) + 3y(h). Let l = 1 + 0. Calculate q(l). -7 Let n(h) = -h3 - h + 1. Let f(j) = 8j*3 - 29j*2 - 4j - 11. Let c(p) = -f(p) - 5n(p). Let x be c(10). Let r(a) = 2a*2 + 4a + 5. Give r(x). 21 Suppose -x = -20x - 35x - 108. Let c(l) be the second derivative of -l*4/6 - 2l*3/3 - 3l*2/2 - 2l. Determine c(x). -3 Let b(n) = 5n + 84. Let g be b(-19). Let p(o) = -2o + 32. Let q(s) = -s + 11. Let m(f) = gq(f) + 4p(f). Give m(-5). -8 Let l be -38(-6 + 336/57). Let b(p) = p3 - 4p*2 + 1. Determine b(l). 1 Let i(k) = -k + 11. Let m be (-30)/4(-108)/30. Let a = m - 29. Let x be 1a/((-4)/10). Calculate i(x). 6 Let w(x) = -x3 - 12x*2 - 2x + 11. Let f(u) = -u*2 + u. Let h(b) = -3f(b) + w(b). Let p be (-1)/(-5(-1)/25) - 3. Give h(p). -13 Let q(z) be the third derivative of -1/24z*4 + 0 + 1/15z*5 + 0z + 1/120z6 + 13z*2 + 1/3z*3. Determine q(-5). -18 Let o(p) = 8p - 39. Suppose -71f - 8 + 363 = 0. What is o(f)? 1 Let l(o) be the first derivative of o5/30 - o4/24 - 2o*3 - 13. Let s(c) be the third derivative of l(c). Let k = -4 + 3. What is s(k)? -5 Let a(w) = w. Let f(h) = 8h + 2. Let r be f(-1). Let u be (-2)/(-3) + r/((-90)/(-55)). Determine a(u). -3 Suppose -3w + 18 + 0 = 0. Let j = -2 + w. Let x(t) be the third derivative of t6/120 - t5/12 + t4/4 - t3 - t2. Calculate x(j). 2 Let s(n) = -n2 + 2. Let t be (-24 - -19)/((-5)/2). Give s(t). -2 Let j(n) = -n2 - 8n + 10. Let t = -15 - -36. Let c = -30 + t. What is j(c)? 1 Let t(v) be the second derivative of v*3/3 - 3v*2/2 + 2v. Let l(z) = -1. Let c = -20 + 14. Let r(d) = cl(d) - t(d). Give r(6). -3 Let f(y) = -y. Let s be (-62/(-8))/((-19)/38). What is f(s)? 3 Suppose -14 = -3c + 4. Let s be (-7)/(-21)(3 - 0). Let v be (c/(-10))/(s/5). Let k(l) = -l*3 - 3l*2 + 2l. Determine k(v). -6 Let g(s) = s - 9. Suppose -3c + 0 + 12 = 0. Let x = 44 - 44. Suppose -c = -xq - q. Give g(q). -5 Let d(g) = -22 - 6g + 8g - 2g - 14g - 26 - g*2. Give d(-9). -3 Let k be (-10)/5 - (-2 + 0). Suppose -2t + 2x + 2 = -kt, -2t + 8 = 4x. Let i(u) be the first derivative of 2u2 - 2u - 20. Calculate i(t). 6 Let z(p) = p*3 + 3p*2 - 4p. Let i be z(-3). Let v be 0 + i - (-2)/((-8)/12). Let f(u) = -u + 4. Determine f(v). -5 Suppose -3m = -m - 8. Let t(d) = -6 + 7 - m - d2 - d. Determine t(0). -3 Let h(m) = 7m3 + m2 + 1. Let d(r) = 9r3 + 2r*2 + 2. Let y(a) = -4d(a) + 5h(a). Give y(-2). -7 Let g(c) = c2 - 3c - 5. Let q(j) be the second derivative of -j*5/20 - 11j*4/12 - 11j*3/6 - 3j*2 + 12j. Let k be q(-10). Give g(k). -1 Let x(a) = 13a2 - a - 32. Let d(v) = -8v*2 + v + 21. Let c(m) = 8d(m) + 5x(m). Give c(0). 8 Let f(j) = -j3 + 7j*2 + 11j - 6. Suppose 18s + 2v - 8 = 17s, -5s + 40 = -5v. What is f(s)? 18 Suppose -4n + 8 = -2j, -5n - 2j + 3j = -4. Suppose -3k + 5k = 3t - 3, n = -5t - k + 5. Let a(p) = -3p2 - 1. Determine a(t). -4 Let b(l) be the third derivative of l8/20160 + l7/840 + l6/180 - 2l*5/3 + 14l*2. Let a(v) be the third derivative of b(v). What is a(-6)? 4 Let g(c) = 3c - 1. Let p(u) = 14u - 6. Let k(w) = 3g(w) - p(w). Calculate k(3). -12 Let c(a) = 6a2 + a3 + 6 - 5a - 2a2 - 6. Let s be (9 - 10)/(1/5). Determine c(s). 0 Let v(h) be the first derivative of h3/3 + 9h*2/2 - 79. Give v(-9). 0 Let a(l) = -4l*2 + 8l - 6. Let f(o) = o*2 - 3o + 2. Let i(p) = 2a(p) + 7f(p). Suppose 0 = 15c - 41 + 116. Determine i(c). 2 Suppose -2d - d = -d. Let j(c) be the second derivative of -2c + c2 + 1/20c*5 + d - 1/4c*4 + 1/6c*3. Calculate j(3). 5 Suppose 26 = -5v + r + 71, 3r = 0. Suppose 3c + v - 15 = 0. Suppose 7 - c = -t. Let b(d) = d*3 + 6d*2 + 7d + 5. Determine b(t). -5 Let r = -55 - -54. Let o(u) be the third derivative of 0 + 0u - 2u*2 + 0u*3 - 1/10u*5 + 0u*4. Determine o(r). -6 Let v(p) = 14p + 5. Let d = 67 + -68. Calculate v(d). -9 Let p(m) be the third derivative of m6/60 + m4/12 + m*3/6 - 78m*2. Give p(-2). -19 Let c(z) be the third derivative of -2z*2 + 1/24z*4 - 1/6z*3 + 0 + 0z. Let s(l) = 6l2 + 2l - 1. Let n be s(1). What is c(n)? 6 Let u(g) = -g3 - g2 + 3g. Suppose h + 59 = 2d - 2h, 2h + 27 = d. Let m = 34 - d. Determine u(m). 9 Let b = -2 + 4. Let p(f) = f - bf - 1 + 1. What is p(5)? -5 Let p(x) = 3 - 4 + 2 + 2x. Let t be (-9)/6 - ((-14)/4)/1. Suppose -5m = 5q - 35, 5m - tq - 3 - 4 = 0. Give p(m). 7 Let f = 0 + 0. Let v(m) be the second derivative of 13m - 1/2m*2 - 1/12m*4 + 0m*3 + 1/20m5 + 0. What is v(f)? -1 Let l(d) be the first derivative of d2/2 + 2d + 2. Suppose -5t - 3s + 245 = 0, 2t - 2s = -7s + 117. Let p be t/(-8) + (-2)/8. What is l(p)? -4 Suppose 2h = 3p + 27, -2h - h + 23 = -p. Let l(d) be the second derivative of -d4/12 + 7d3/6 + d2 - 1750d. Give l(h). 8 Let k(o) be the third derivative of o4/24 - 5o3/6 + o2 + 91. Suppose 3u = -0u + 3h + 12, -4 = -u - 2h. Let z be 22/5 + u/(-10). Give k(z). -1 Suppose 5b = -15, 0n + b = -2n + 7. Let l(s) be the second derivative of s5/20 - s4/2 + 2s3/3 + s2/2 - 51s. Calculate l(n). -4 Suppose 0 = -4i - 3q - 9, 0 = -3i - 2i + 2q + 6. Suppose i = 4z - j - 3, -2z - 4j + 4 = -2j. Let g(l) = -z - 3l + l + 0 + l. Give g(3). -4 Suppose -d = -2 - 1, -5d - 9 = 3w. Let r = w - -11. Suppose -t + r - 2 = 0. Let g(f) = 3f. What is g(t)? 3 Let s(g) = 3 + 1 + 6g - g2 + 2 + 0g*2. Let c be 6 + 42/(-7) + 6. Determine s(c). 6 Suppose -3t + t = -2. Let b(o) = o - 2o2 + 2 - o - t. Let z(m) = -4m*3 + 40m*2 + 2m - 22. Let g be z(10). What is b(g)? -7 Let n(u) = u*3 - 9u*2 + 9u. Let m(j) = -2j + 30. Let b be m(15). Suppose -z + bz + 3s + 11 = 0, -4s = 4z - 28. What is n(z)? 8 Let b(m) = -4m + 13. Let g(n) = n + 1. Let s(x) = b(x) - 6g(x). Calculate s(3). -23 Let x(b) = b2 - 16b - 1. Let j(w) = -w*2 + 20w + 1. Let a(m) = -4j(m) - 5x(m). Let c(d) = -d*2 + 6d + 2. Let t be c(6). What is a(t)? -3 Let r(b) = -32b. Let t = -53 + 61. Let m be (0 + 1)/(t - (11 + -4)). Give r(m). -32 Let g(o) be the first derivative of -o3/3 - 3o*2/2 + 2o + 11. Let f be (2/(-1))/((-7)/(-21)). Calculate g(f). -16 Let g(x) be the second derivative of 7x3/6 + x2/2 + 47x. Give g(-1). -6 Let s(a) = -6a. Suppose -4w + 20 = w. Suppose -3x + 23 = -7x - 5z, 22 = -5x - wz. What is s(x)? 12 Let p(y) = 61y - y*2 - 49y + 4 - 19y. Suppose 22 = -5j - 2b, -b = -4j - 2b - 20. Calculate p(j). 10 Let c(q) = 4 - 3 + q - 3 + 7. Let z be (-2 + 2)/(-7 - -2). What is c(z)? 5 Let f be ((-18)/21)/((-100)/(-35) + -3). Let q(g) = -3g + 5. Determine q(f). -13 Let q(s) = -s*2 + 7s - 6. Suppose -4o + 4c = -32, 6o - 4o = -5c + 9. Determine q(o). -6 Suppose v = 2h - 4, -3h + 7v - 6v + 6 = 0. Let p(t) = -3t*3 - 3t + 2. Give p(h). -28 Let m = 24 - 17. Let a(h) = -4h. Let g(o) = 21o + 5. Let i(c) = 6a(c) + g(c). Determine i(m). -16 Suppose 9t - 2 = 8t. Let b(p) = -2p*t + 2p*2 + 210p - 23 - 209p - p2. Determine b(0). -23 Suppose 4j + 0j + 12 = 0. Let q(x) = -4x + 7. Let k(c) = 7c - 13. Let u(r) = jk(r) - 5q(r). Let b = 13 + -9. Give u(b). 0 Let a(s) be the second derivative of s3/6 + 9s*2/2 - 35s. What is a(-6)? 3 Let n(g) = 17g2 + 19g + 14. Let d(v) = 14v*2 +	{ "pile_set_name": "DM Mathematics" }
ond derivative of 725296n2v*5 + 1469n*2v - 15nv + 1 wrt v. 14505920n2v*3 What is the second derivative of 6m*2q*3 - 644m*2q*2 - 21m*2q - 6mq - 9m - 2q wrt q? 36m2q - 1288m2 Find the second derivative of -238792s*2 - 50497s. -477584 Find the second derivative of 85o3 + 12748o*2 + 5146120o wrt o. 510o + 25496 What is the first derivative of 67h*2z - 3522824h2 - 27hz2 - 27z wrt z? 67h2 - 54hz - 27 What is the second derivative of -161892w*2 - 118741w + 3 wrt w? -323784 What is the derivative of -28281c - 22091 wrt c? -28281 What is the second derivative of 165mv2 + 30mv - 98v*2 - 4v - 1243 wrt v? 330m - 196 What is the third derivative of 89304o*3 + 126109o*2 wrt o? 535824 Find the third derivative of -43961f*4 + 28f*2 - 494. -1055064f What is the second derivative of -26560d4 + 7d - 194 wrt d? -318720d2 What is the derivative of -76c*3dm - 7c*3m - 6cdm2 + 7cm2 + 3d*3 + 4m*2 + 2m wrt d? -76c3m - 6cm*2 + 9d*2 What is the third derivative of -3428115f*4 - 34815f*2 - 11 wrt f? -82274760f Find the third derivative of 59621l3x*2 - 14l*2x*2 - 10l*2x - 2lx*2 - lx wrt l. 357726x2 Find the third derivative of 3ag3uy + agy - 3auy + a - 39g3uy + 7g*3u - 118g2uy + 3uy wrt g. 18auy - 234uy + 42u Differentiate 17165s*2 - 10s + 1340717 with respect to s. 34330s - 10 What is the third derivative of hi*3t - 175729hi*3 + 2ht - 32i*2t + 37i2 wrt i? 6ht - 1054374h Differentiate 80755m4 + m3 + 4m*2 + 5m - 6537017 with respect to m. 323020m3 + 3m*2 + 8m + 5 What is the derivative of -72352b - 89840? -72352 Find the second derivative of 4gw5 + 11256gw3 + 2447637gw - 4w*2 wrt w. 80gw3 + 67536gw - 8 Find the second derivative of 20g*3h*2 + 74g*2h*2 + 27g*2hv - 6gh2 + 16ghv + 7gh + 3gv wrt g. 120gh*2 + 148h*2 + 54hv What is the second derivative of -23d*3 + 655d*2g + dg + 2d - 26g - 25 wrt d? -138d + 1310g What is the third derivative of 124721x*4 - 136x*2 - 3x + 1 wrt x? 2993304x Find the second derivative of 1765517j*3 - 587117j + 2. 10593102j What is the derivative of -9587o*2 - 39083? -19174o Differentiate -n*4 + 30n*3 - 2n*2 - 2463n + 402419 with respect to n. -4n3 + 90n*2 - 4n - 2463 What is the third derivative of -97l2x*4 + 17096l*2x*2 + 2l*2x + 44lx3 + x5 + 2x wrt x? -2328l*2x + 264l + 60x*2 Find the second derivative of -45000c*3 + 1722c + 6. -270000c What is the second derivative of 322251k*3 + 298573k - 1 wrt k? 1933506k Find the second derivative of -2q*4 + 11375q*3 - 6q + 7899. -24q2 + 68250q Find the first derivative of 103411w2 - 60353 wrt w. 206822w What is the second derivative of 333o2q*2z - 2o2q*2 + 95o*2qz + 2o*2q - o*2z - 15oq*2 - 9oqz - 5o wrt q? 666o*2z - 4o2 - 30o Differentiate 35372cg*2u - 1153cg*2 + 15cgu - 2cg + 69c wrt u. 35372cg2 + 15cg What is the second derivative of 4992sx2 - 2sx - s - 7148x wrt x? 9984s What is the third derivative of -229956m3 + m2 - 27m + 4208 wrt m? -1379736 Find the second derivative of 2y*4 - 3340600y*2 + 285y - 317. 24y2 - 6681200 What is the first derivative of -54025j*2 - 170472? -108050j What is the third derivative of 582366f6 + 1217f*2 - 10f - 5? 69883920f3 What is the third derivative of 201231z*5 - 5z*2 + 108z + 10 wrt z? 12073860z2 What is the second derivative of -1363499l*3 - 3886058l wrt l? -8180994l Find the third derivative of 1814619y*4 + 7187y*2 + 20y. 43550856y Differentiate 2958394i + 2512539 wrt i. 2958394 What is the second derivative of 2b5 - 59b*3 - 220b*2 + 112511b? 40b3 - 354b - 440 Find the second derivative of 1372l3p*2 + 67l*3 + 140l*2p + 71p3 wrt p. 2744l*3 + 426p Differentiate -2328bd + 27762d with respect to b. -2328d What is the third derivative of -46963j4 - 143387j*2 wrt j? -1127112j What is the derivative of -31b2f - 234bf - 203f + 9 wrt b? -62bf - 234f Find the third derivative of 33q3s*5 - 783q*3s*2 - 6q*3 - 5s*5 wrt s. 1980q*3s*2 - 300s*2 What is the derivative of 1360202b*2 + 590077? 2720404b Find the first derivative of -14g3 - 1422g*2 + 7952. -42g*2 - 2844g What is the second derivative of -19d2o*2 + 7d*2o + 312do*4 - 2930do wrt o? -38d*2 + 3744do2 What is the third derivative of -5224p*3sw2 - 113p*3s - 2p2sw2 - 8p*2w - 1184p2 - 10psw*2 + 3 wrt p? -31344sw2 - 678s What is the third derivative of 931143o3 + 1329o*2 + 305o - 2 wrt o? 5586858 What is the second derivative of -652k5 + k4 - 31k*2 - 750k - 18? -13040k3 + 12k2 - 62 What is the derivative of x4 - 635x3 - 8151? 4x*3 - 1905x*2 What is the third derivative of 12941v*4 - 61v*2 + v + 131 wrt v? 310584v What is the derivative of 3b4 - 8475b*3 + 4b - 642561 wrt b? 12b3 - 25425b*2 + 4 What is the second derivative of 36724b*2f*2 + 2bf2 - 76bf - b - 8 wrt b? 73448f*2 Find the third derivative of -70828t*3 + 1980t*2 - 2t. -424968 Find the second derivative of -7832c3 - 212c + 28. -46992c Find the third derivative of -94747y*4 - 178y*2 - 717y + 2. -2273928y Find the second derivative of 30c*2k*3 + 84c*2k*2 - 7c*2k - 2c2 + ck*2 - ck - c - 10931k3 wrt c. 60k*3 + 168k*2 - 14k - 4 What is the second derivative of -69314u2 - 168773u wrt u? -138628 What is the first derivative of -57659v + 22901 wrt v? -57659 Find the second derivative of 150414o*2 + 283768o wrt o. 300828 Find the second derivative of -1037j3w2 + j3 - 47j2w*2 - 119981jw - w wrt w. -2074j*3 - 94j*2 Find the second derivative of lxz2 - 121lxz - 7lz*2 - lz - 6xz*2 - 42xz - 34z*2 wrt z. 2lx - 14l - 12x - 68 Differentiate -55326ls2 - 8l - 2988063s2 wrt l. -55326s*2 - 8 What is the first derivative of -233524u - 69490? -233524 What is the first derivative of -100070w2 + w - 873445? -200140w + 1 Differentiate 325170o4t - 2o3t - 544351t wrt o. 1300680o*3t - 6o2t What is the second derivative of -385i3t*2 - 83i*3t - 2i2t*2 - 3it2 + 95i + 3 wrt t? -770i3 - 4i*2 - 6i Find the second derivative of 3af*2x*2 - 2af2x + 25291af*2 + 43af - 14ax - fx*2 + 2f wrt f. 6ax*2 - 4ax + 50582a Find the second derivative of 2s5 + 74289s*4 - 5s - 2305. 40s3 + 891468s*2 What is the second derivative of 644766s*3t*3 - 4s*3t + 2s3 + 2s*2 + st - 3t3 + 2t*2 - 7300 wrt t? 3868596s*3t - 18t + 4 Differentiate 461o*3 + 1074o*2 - 1911620 wrt o. 1383o*2 + 2148o Find the third derivative of -1382d3 + 2d*2 - 183d + 14. -8292 Find the third derivative of -64325pq3 - p - q3 + 107204q2 wrt q. -385950p - 6 What is the derivative of 51818f3gu3 + f3u3 + f3u2 - 12f*2gu3 + 2f*2u*3 - 152284fu3 wrt g? 51818f*3u*3 - 12f*2u*3 What is the first derivative of -70l*3 - 3l*2 + 114l + 11771? -210l2 - 6l + 114 What is the second derivative of 297186l5 + 110l + 1535? 5943720l3 Find the third derivative of -410009r*5y - 1138r2 - 169ry wrt r. -24600540r*2y Find the second derivative of 4969x5 + 11x*3 + 1338195x. 99380x3 + 66x What is the third derivative of -183j5 - 5222j*4 + 4j*2 - j + 257530 wrt j? -10980j*2 - 125328j What is the third derivative of -44q5 - 36q*4 - 56q*3 - 964972q*2? -2640q*2 - 864q - 336 Find the second derivative of -10mt*3 - 2mt - 23519m - 12404t3 + 6 wrt t. -60mt - 74424t What is the third derivative of 710mq*4 + 102mq3 - 3mq2 - 2915mq - 9q*2 wrt q? 17040mq + 612m What is the first derivative of 5j2mz - 3168j*2 - 2jmz - 2jm - 585jz - mz wrt z? 5j*2m - 2jm - 585j - m Find the third derivative of 171170l*4 - 91143l*2. 4108080l Find the third derivative of -234865an*3 + 2an2 - an - 30010a + 2n**2 wrt	{ "pile_set_name": "DM Mathematics" }
give g. -3 Rearrange 2a3 - 259 + 2a2 + a3 + 257 - 9a3 + a + 36a*4 to ta*4 + ja + ia2 + ma*3 + k and give i. 2 Rearrange (-149 + 2217 + 195)(k2 + k3 - k*2) to ik*3 + vk + uk2 + m and give i. 2263 Express (-3z - z + 2z + (-z - 2z - 2z)(11 + 9 + 8 + (5 - 5 + 6)(-3 + 2 + 0)))(0z + 2z + 0z) in the form o + vz*2 + nz and give v. -224 Express v*3 + 305 - 210 - 220 - 7v*3 - 4v*3 + 3v*2 in the form rv*2 + gv*3 + tv + c and give r. 3 Express (-3i + 3i - i*2)(-31 + 75 - 23) + 5i2 - 6i*2 + 4i*2 + 0i - 2i2 + 0i in the form xi2 + s + wi and give x. -20 Express 1 + 5 + 444r2 - 729r*2 in the form j + nr*2 + br and give n. -285 Rearrange -15v2 - 4v*2 + 25v*2 - 10 - 5v*2 - 7v*2 + 3v to the form w + gv + jv*2 and give w. -10 Express 189 + 8b*2 - 189 + (-6 + 3 + 1)(-b*2 + 3b*2 + 0b2) - b2 + 0b2 + 0b*2 - b - 4b*2 - 75419 + 75419 as sb + j + ob2 and give o. -1 Rearrange (28x + 555 - 555)(-4 + 3 + 2)(-1 + 0 + 3) to the form p + cx and give c. 56 Rearrange 654 - 107i + 660 - 1316 to zi + v and give v. -2 Express 1692v - 707v + 1583v as sv + j and give s. 2568 Express (-1 - 3 + 3)(-4w + 5w + w) + 0w + 2w - w - w - 7w + 2w + (75 + 79 - 6)(-w + 7w - 9w) as g + vw and give v. -451 Rearrange -33z3 - 96z + 44z + 6z*2 + 51z - 28 - 1 - 4z2 to xz*2 + gz*3 + a + yz and give g. -33 Rearrange -3w4 - 2w*4 + 3w*4 + (4 + 5 - 5)(-4 + 1 - 3)(-40 + 7w*4 + 40) to rw*3 + hw + xw4 + tw*2 + z and give x. -170 Express 837 - 837 + 1493i + (3 - 1 - 1)(-i - 1 + 1) in the form c + ti and give t. 1492 Rearrange -464 + 30 + 46h - 18h - 25h - 661 to i + ch and give i. -1095 Express -3i + 1 - 71i*3 + 64i*3 + 87i*3 - 6 + 3 as wi*3 + f + xi*2 + gi and give f. -2 Express -340 + 340 + 8x + (25 - 5x - 25)((-2 + 2 + 2)(-4 - 4 + 6) - 3 + 1 + 0 - 4 + 1 + 1) in the form hx + d and give h. 48 Rearrange 514541f - 514541f - 139 + 14f*2 to bf*2 + v + af and give v. -139 Express -8y + 6y - 16y + 4408 + 16y in the form x + fy and give x. 4408 Express (13 + 10o - 13)(5o + 6o - 2o) + (9 - 9 + 10o)(-o + 4o - o) in the form bo + ao2 + z and give z. 0 Rearrange -5v*4 + 7588v - v*2 - 3793v - 3823v + 3v*4 + 32 to the form xv*4 + hv*3 + y + lv*2 + fv and give f. -28 Rearrange -14t3 - t - 11t*2 - 2t*3 + 0t*3 - 5t*3 + 20t*3 - 13 to the form yt + nt3 + dt*2 + h and give d. -11 Express -80t - 6 - 431 - 62 - 102t + 186t as qt + n and give n. -499 Express -5l*2 - 51l*3 + 30l + 17l4 - 2 - 32l + 0l3 + 54l*3 as bl*3 + ul*2 + g + zl + cl4 and give z. -2 Rearrange ((5 - 2 + 0)(1 + 2 - 2) - 8 + 2 + 16)(-6p - 1 - 21p - 2p) to the form y + op and give o. -377 Express -224946 - 8h*3 + 112457 + 112457 - 3h*4 - 2h*2 in the form ih*3 + mh + rh4 + v + jh2 and give i. -8 Express -o4 - 22o2 + 22o*2 + (-78o*3 - 60o*3 + 46o*3)(5o - 2o + 0o) as ao + xo4 + uo*3 + n + lo*2 and give l. 0 Express (0 - 1 - 1)(2 - l - 2) + (36 + 1 + 6)(-3l + 0l + 0l + (3 - 4 + 3)(4l - 7 + 7)) as m + wl and give w. 217 Express -70d*3 - 6d*2 + 57d*3 + 36d + 4d2 + 11d*3 as ad + q + hd3 + yd*2 and give y. -2 Rearrange -29q*4 - 3q - q*2 + 1 - 51q*3 + 69q*4 + 71q*3 + 0q*2 - 36q*4 to x + oq*3 + jq*4 + fq + iq2 and give x. 1 Express 14 + c - 99c*3 - 214c*4 - 18 - 179c*3 + 215c*4 in the form dc + q + hc2 + bc*3 + wc*4 and give q. -4 Express 1327o - 4193o - 78 + 78 in the form no + p and give n. -2866 Rearrange -13 + 6s3 - 6s3 - s3 - 2s4 + 135s*2 + 4s - 134s2 to the form j + cs*4 + ds*2 + us + ks3 and give u. 4 Express 299b*2 + 292b*2 - 1 + 321b*2 - 952b*2 + 18b in the form x + gb2 + cb and give x. -1 Express u - u + 5u + (4 + 1 - 20)(-3u + 4u + u) + 4u + 2u - 5u - 3 in the form i + qu and give q. -24 Rearrange -780h4 - 772h*4 + 297h*4 - 1 - 2h*2 - 915h*4 - 56h*4 to the form lh + b + dh3 + fh*2 + kh4 and give k. -2226 Rearrange 10 + h3 + 2338h + 8h*2 + 1 - 2343h to the form d + ah3 + mh + rh2 and give r. 8 Express -377k + 1374k + 771k - 548k + 1214k - 1 as d + hk and give d. -1 Express -5v + v - 17 - 271v2 - 2v*3 + 273v*2 + 11 + 4v*4 + 7 as a + uv*3 + sv*4 + nv*2 + pv and give a. 1 Rearrange -23n + 6164n*2 - 11n - 1564n2 + 34n to hn2 + r + dn and give h. 4600 Express (-72l + 71l + 15 + 7)(730l - 560 + 560) in the form kl + al*2 + w and give w. 0 Rearrange (-10 + 3 - 7)(-672 + 670 - 49l - 92l) to x + zl and give z. 1974 Express 108b3 - b4 - 96b2 + 2b + 31b2 + 35b*2 + 2 + 28b*2 as vb*4 + a + ob*3 + mb*2 + sb and give a. 2 Express -59 + 11a2 - 418a - 65 + 216 - 91 as qa2 + y + ta and give t. -418 Express 2 - z*2 + z - 2z*2 + 19 + 30 in the form lz + tz2 + v and give v. 51 Rearrange -132 + 132 + 2954u*2 + 2010u*2 to fu + tu2 + v and give t. 4964 Rearrange (3 - 2f*2 - 3)(-7469 + 3341 - 3951 - 4091) to the form u + of + df*2 and give d. 24340 Rearrange 143 - 2117 + 2c + 316 - 1330 to h + dc and give d. 2 Rearrange -25m + 358m3 - 2m*2 + 46m - 19m + 362m*3 + 231m*3 to the form nm*2 + am + j + um3 and give u. 951 Rearrange (-2j - 20j - 33j)((6 + 8 - 5)(-5 - 39 + 4) + 2 - 1 - 2) to tj + r and give t. 19855 Express (a - 6a + 3a)(-1 - 1 + 0) - 6a + 15a + 5a + 15 - 15 + 8a + 2 - 3a + 11a - 3a in the form d + ra and give r. 31 Rearrange -21r - 405r*3 + 782r*3 + 238r - 417r3 to the form o + zr*2 + sr*3 + tr and give t. 217 Express 9457k + 1033k + 466k in the form rk + a and give r. 10956 Rearrange -2 + 0 - 286g - 8g*2 - 3 - 348618g*3 + 4 + 348620g*3 to the form fg + pg3 + ng*2 + w and give f. -286 Express 2213t*2 - 3 + 2232t*2 - 4417t*2 as bt + ut2 + l and give u. 28 Express (0o + 2o2 + 0o)(462 + 142o - 462)(-1 - 6 - 1) as ko*2 + ho + bo3 + c and give b. -2272 Rearrange (397 + 424 - 403 + 465)(-11s3 + 6s*3 - 9s*3) to the form ds + x + ps3 + rs*2 and give p. -12362 Express (-3u + 4u + 0u)(5637 + 876 + 1192 + 3644) as su + b and give s. 11349 Rearrange 8027 - 16059 + 344i + 8033 to the form ri + t and give r. 344 Rearrange a + 221a2 - 7710 + 7741 - 151a*2 to oa + l + ma2 and give o. 1 Rearrange 165s - 164s + 359s*4 - 81s*3 - 105s*3 - 182s*4 + 3 + 2s*2 - 181s*4 to bs*2 + ms + js4 + t + qs*3 and give b. 2 Rearrange (-3n2 + n3 + 3n2)(2n - 4n + 3n) + (-5998n*3 - 2251n*3 - 9422n*3)(3n - 5n + 0n) to c + tn*4 + fn*2 + zn*3 + jn and give t. 35343 Rearrange (-5u2 - 22u*2 - 201u*2)((-3u - u + 3u)(-2 - 2 + 7) + 51 - 51 + 11u) to ku3 + zu*2 + i + xu and give z. 0 Express (3 - 3 - 1)(-x - x - 4x)(274 + 53 - 103) as yx + h and give y. 1344 Express 547a2 + 529a*2 - 1638a*2 - 11 - 11 + 532a*2 as j + ya*2 + wa and give y. -30 Rearrange (-2w + 0 + 0)((1 + 2 - 4)(-3 + 1 + 3) + (-22062 + 49373 - 23765)(-4 + 1 + 4)(1 + 0 + 1)(-2 - 1 + 1)) to kw + a and give k. 28370 Rearrange -11y - 206 - 6y - 13y + 29y + 2y to the form ny + z and give z. -206 Express 22r*2 + 38r*2 - 58r*2 + 85r - 106r2 as n + fr + ir2 and give i. -104 Rearrange -381n*2 + 203n*2 - 2n + 200n2 - 24 - 11 to g + cn + xn2 and give x. 22 Rearrange (41 - 49 - 65)(-2 + 0 + 4)(-29m*4 + 8m*4 - 3m*4) to bm*2 + vm*4 + rm + x + zm3 and give v. 3504 Rearrange -66410p*2 - 215156 + 26350p*2 + 215156 to the form s + ap + tp2 and give t. -40060 Express -245b*2 - 5b + 218b2 + 172b as kb + w + zb*2 and give z. -27 Express 0l*4 - 5l4 - 180 - l2 + 32l3 + 3l*2 + 364 - 185 in the form u + rl*3 + nl + sl2 + xl4 and give s. 2 Rearrange q2 - 27538q3 - 15q4 + q2 + 27536q3 - 7q*2 + 1 to fq + yq4 + iq*3 + k + rq*2 and give y. -15 Express 1130j + 368 + 1139j + 1131j - 3399j as dj + x and give d. 1 Rearrange 2g3 - 2g3 - 1 - g4 + 11910g2 - 2g*3 - 5958g*2 - 5953g**2 -	{ "pile_set_name": "DM Mathematics" }
suming l is positive. l(-6676/57) Simplify (((m10mm6)/((m(-6)m)/m(6/5)))(1/4))(-1/3) assuming m is positive. m(-29/15) Simplify (jj*(-19)/jj*(-4/11)j)/(j(1/10)/(j/j(-1/63))) assuming j is positive. j(-120913/6930) Simplify (s(-15)/(s*(-1)s)s(-3/7)/((s/(s/(((s(ss/(s/(ss2)))/s)/s)/s)))/s))22 assuming s is positive. s*(-2530/7) Simplify (((rr(-3))/(r/r(1/14)))/(r*(-6/13)r(-16)))29 assuming r is positive. r(71427/182) Simplify ((d(1/8)d)/d(-2/9))(-2/43)/(((d/d(-3/5))/dd/d*(-1/3)dd)/(d(1/2))(-20)) assuming d is positive. d(-108329/7740) Simplify (((q(qq(-30))/q)/(((q/(q/(qq/q(31/5))))/q)/q))(-9))(1/19) assuming q is positive. q(54/5) Simplify (d(1/2))(-2/9)/(d0)43((d(-2/19)/d)/d7)38 assuming d is positive. d(-2773/9) Simplify (x(1/4))13/((x/x(2/15))/x6)(x*(1/5)x(x(2/9)x)/xx)(-1/25) assuming x is positive. x(37289/4500) Simplify b(-2/25)bbbb(-1/5)/bb*(-1/2)b(b/(b/(b/(bb*(4/5)b))))/bb((bb(-1/9))/(b(-3)/b))/(b(1/2))15 assuming b is positive. b(-493/225) Simplify ((yy*(-6/31))/yy)/(((y/((yy/((y(2/19)/y)/y))/y))/y)/y)(y/(y*(-1/8)y)y)(-7/3) assuming y is positive. y(9783/4712) Simplify ((ww*(-2/21)/w)/((ww(1/6))/w))(3/41)(w6/(ww*5/ww))50 assuming w is positive. w(-11/574) Simplify (uu20)/u(8/3)(u/(uu(-7/6)/u)u)/(uu(-33)/u) assuming u is positive. u(109/2) Simplify ((zz(2/7)/z)(2/59))*45(zz/(z(2/3)z))*(-42)z*(-4)z(2/11) assuming z is positive. z(-78968/4543) Simplify (j(-5)/j(3/4)j(-6/7)j*2)/(j(j/(j/((jj2j)/j)))/jjj*2(j/(j/(j*1jj)j))21) assuming j is positive. j(-1473/28) Simplify (((x/(x/x*(3/17)))/x)/(xx/x*(-2))(x/(x/(x(xx/x*9)/x)))/(xx(-7)))(2/91) assuming x is positive. x*(-198/1547) Simplify (((m(mm(2/13))/m)/(mm(m/m(-1/9))/mm))/(mm(1/6))24)(-3/23) assuming m is positive. m(3505/897) Simplify (g(7/2)/g(-6)g/g*4ggg*(-2/9)ggg)/((g(-1/5))(-35))20 assuming g is positive. g(-2317/18) Simplify ((t*0t/(t/(((t/(t(tt*0)/t)t)/t)/t)))/(t2/t)(4/11))/((t/(t/(t(-2/3)/t)))(-49)/((tt(2/19))/t1)) assuming t is positive. t(-51994/627) Simplify (t4t*(-12)t*(6/7)(t(t/(t/(t/t(-10)))t)/t)/t)(-8/11) assuming t is positive. t(-216/77) Simplify (f*(-1/6)/(ff/(((f/(f*(6/5)/f))/f)/f)f)(ff*(17/2))/(((fff(19/4)fff)/f)/f))(-2/65) assuming f is positive. f(157/1950) Simplify zz(-23)zz(2/19)zz(2/59)/(z(22/7)z) assuming z is positive. z(-188357/7847) Simplify (y7y(1/2)y/(y*(-1/8)y)y(-4))/(((y(y*(-3/4)y)/y)/(y/(y*(1/4)y)))/(yyy*(-2/5)/yyy)16) assuming y is positive. y(1789/40) Simplify (ww*(-20/7)w*(-4/3)w(w(10/7)/w)(1/43))(-9) assuming w is positive. w(5907/301) Simplify ((d(5/6)d*(-3/4)d)/((d/(d/((d/((dd2)/d))/d)))/d5))/((d/(d/((d/(dd/d(2/3)))/d)))2)(-4) assuming d is positive. d(-31/12) Simplify ((z*(-15)/z)/((((z(z/(z/(z*(-9)z)))/z)/z)/z)/zz)(z/(z*(-3)zzz))26)(-18/7) assuming z is positive. z(-360/7) Simplify s(-2/9)s(1/3)s0/s(-7)(s/(s((s/(s/(s/(s/s(-1/2)))))/s)/s))(-43)/(sss/s0)(-25) assuming s is positive. s*(-457/18) Simplify ((uu(-2/13))/(u/u(-4)))*(2/79)(u1/u)(-3/17)u(4/7)/u2 assuming u is positive. u(-11026/7189) Simplify (ii/(i*(-7/8)/ii)i)/(ii*30)i*(-13)(ii(4/13))/ii assuming i is positive. i(-4037/104) Simplify ((u/u(4/5)u/(u(2/3)/u)u)/(((u/(uu/(u/((uu*(2/7)u)/u))))/u)/uuu/(uu(-3))))/(u(2/13)/(uu/u*4u))(-18) assuming u is positive. u(30833/1365) Simplify (w*12/((ww(-14)/w)/w))16/((w(1/3))(-29)www(-6/13)ww(1/5)/w) assuming w is positive. w(85786/195) Simplify (t6/t(-1/5))(-3/47)(((t(1/3)/t)/t)/t)37(t(1/3)/t)(-48) assuming t is positive. t(-47279/705) Simplify ((f/f(2/5))/(f/f(3/2)))(-21/4)/((f/((f/((f/f(-2/3)f)/f))/f))/f6)(-46/3) assuming f is positive. f*(-20479/360) Simplify (vv/((v/(vv/(v/v(-28))v))/v)vvv(1/2)v*14v/v(1/6))12 assuming v is positive. v(-80) Simplify ((t2t)(-6/25)t*(-4)/(tt*(-4/5)tt))/((t0)(-50)(ttt/(t/(t/(ttt(-1/7)))))/(t(-8)/t)) assuming t is positive. t(-2986/175) Simplify (((y(1/8)y/(y(3/8)y))(34/7))10)47 assuming y is positive. y(-3995/7) Simplify (zzz*(-9)zz(2/5)zz)(-43)/((((z/(z/z(1/7)))/z)/z(1/8))/(z/(z/z0))(6/7)) assuming z is positive. z(43619/280) Simplify ((p(-4/5)pp)/(p(-1/4)/p))/((p/(p(4/5)/p))/p(-6))(((pp(-5)pp)/pp)/p2)/(p(-1)ppp)(-18) assuming p is positive. p(109/4) Simplify d((d*(-1)d)/d)/dd(2/9)d*4d*(-3/8)(d*(2/3)/((d/((dd*(-1))/ddd)d)/d))31 assuming d is positive. d(1693/72) Simplify (u(-1/9)/(u(-1/3)/u))*20(u(-2)/u)30/(u(2/7))(-42/11) assuming u is positive. u*(-6382/99) Simplify (((w(ww(2/53))/w)/ww)/(ww/(www((w32/w)/w)/w)))/(w(2/5)/w36) assuming w is positive. w(17659/265) Simplify (ii/(i/(i/(i(-2)/i)))iiii(2/15)ii(-3)/i(3/2))/(((iii0ii)/i)22)(5/8) assuming i is positive. i(-2197/60) Simplify (i(4/9)/(iii(4/3)ii)(ii/(i/(i(-5)i)))(7/6))3 assuming i is positive. i(-151/6) Simplify ((z0)*(2/43)/(z/((zz/(z/((z/((z*(-2/5)z)/z))/z)z)zz)/z))(-3/10))/((z2z(1/5))/(z(-2)/(z/z(-3)))) assuming z is positive. z(-208/25) Simplify ((p*(-4/5)ppp)/((pp3)/p))(-2/41)(p*(-1/3)pp(p*7/p)/pp)(1/15) assuming p is positive. p(203/369) Simplify ((((n(1/3))(14/9))(13/5))(-11/6))(-11) assuming n is positive. n(11011/405) Simplify (t/(tttt(1/58))t*12((tt(-8)t)/t)(1/17))(-2/39) assuming t is positive. t(-9437/19227) Simplify (f/f(-2/15)ff*(-2/77)(f/(f*(4/7)ff))(-1/7))(-2/19) assuming f is positive. f(-37706/153615) Simplify (((d/(((dd*(1/4)dd)/d)/d))/d)/dd/(d/d(-8)))(9/10)/(d*(-1/3)d*(-1)d)(38/3) assuming d is positive. d(-1801/360) Simplify (((g/g*(-8)ggg)/g)/g(((g/(g6/g))/g)/g)/g)(-21)g*(-2/17)g*(2/5)g(g/(g/((g/(gg/(g/g*(-1/4))))/g)g))46 assuming g is positive. g(-24177/170) Simplify (j/(j*(-9/4)j)(j(-1/2)/j)/j)/(j(j(j7j)/j)/jj(1/3))(j/j(-2))17/(j/j*6j1) assuming j is positive. j(557/12) Simplify (((b/b*21)/(bb/b*(-28)b))/(b/(bbb*(7/4)b))(2/3))(-22) assuming b is positive. b*1067 Simplify (nn(-41))/(n(8/7)nn)(n(3/13))35 assuming n is positive. n(-3191/91) Simplify ((rr*(2/3))/rr/(rrr6))/(r0r)(-10)(r*5/r(rr(-4)/r)/r)28 assuming r is positive. r(-73/3) Simplify ((xxx(3/4))/((x/x(5/2))/x))/(x1/xx*6/x)(x/x*1(x/((x/x*(3/8)x)/x))/xx)/((xx(x/x(-6))/x)/x(-5)) assuming x is positive. x(-99/8) Simplify ((x(-9)x)/(xx(2/35)/x))41/((xxx(1/3))3(x(2/3))(-11)) assuming x is positive. x(-34651/105) Simplify (((v6vv)/vvv*(-2/11)(v*(-1)v)(-6/13))(-23))(26/7) assuming v is positive. v(-51428/77) Simplify (((m(2/7)/m)/m)/m(-2)mm*(-15)/mmm12)31 assuming m is positive. m(-372/7) Simplify ((q/q(3/2))(-1/48)q0/(q(-10)/q))6 assuming q is positive. q(1057/16) Simplify ((q/q*(-10)q/q*(-8))/(((q/(q/((q(qq(-4))/q)/qq)))/q)/q)(-11/3))(-2/3) assuming q is positive. q*(-10/9) Simplify (((f/(f/(f/(ff*(1/4)))ff)(ff(f/(f/(ff7fff)f))/f)/f)21)(-24))(2/15) assuming f is positive. f(-2604/5) Simplify a5a*(-2/19)/aaaa*(-1/4)/aa*(-2/5)(aaa(1/4))(1/8)(a/(a/(aa(-2/7))))37 assuming a is positive. a*(658713/21280) Simplify ((xx/(xx(-2/5)))/x1x(-9)/x(-2/29))(-22) assuming x is positive. x(27214/145) Simplify (jj(-1/6)jj)/j37j(-1/24)/(((j(-44)/jj)/j)/j) assuming j is positive. j(283/24) Simplify (g/(g((g*(-16)/ggg)/g)/gg)g(g(g(9/2)g)/ggg)/g(g/g(3/2))6)(-32) assuming g is positive. g(-656) Simplify ((pp/p*7p)/(pp(-6)p))*(-35)((p/(p*(-9)pp))/pp*2p)/((pp(2/13))/p(-2/7)) assuming p is positive. p(779/91) Simplify (a/a*(-6/1	{ "pile_set_name": "DM Mathematics" }
ousands digit of 85360? 8 What is the thousands digit of 11325? 1 What is the hundreds digit of 27657? 6 What is the hundreds digit of 661? 6 What is the thousands digit of 1815? 1 What is the tens digit of 164? 6 What is the tens digit of 924? 2 What is the units digit of 237? 7 What is the thousands digit of 11558? 1 What is the units digit of 19544? 4 What is the tens digit of 40391? 9 What is the hundreds digit of 140? 1 What is the tens digit of 442? 4 What is the hundreds digit of 2266? 2 What is the thousands digit of 1039? 1 What is the thousands digit of 118149? 8 What is the tens digit of 873? 7 What is the hundreds digit of 2489? 4 What is the units digit of 4858? 8 What is the tens digit of 628? 2 What is the units digit of 42738? 8 What is the ten thousands digit of 25260? 2 What is the tens digit of 29842? 4 What is the tens digit of 797? 9 What is the tens digit of 6852? 5 What is the units digit of 46164? 4 What is the hundreds digit of 17807? 8 What is the units digit of 51171? 1 What is the ten thousands digit of 75319? 7 What is the tens digit of 645? 4 What is the tens digit of 10998? 9 What is the tens digit of 2653? 5 What is the units digit of 15743? 3 What is the tens digit of 932? 3 What is the thousands digit of 1659? 1 What is the hundreds digit of 37659? 6 What is the thousands digit of 5295? 5 What is the hundreds digit of 4236? 2 What is the hundreds digit of 61169? 1 What is the tens digit of 4672? 7 What is the hundreds digit of 6256? 2 What is the tens digit of 925? 2 What is the units digit of 9594? 4 What is the units digit of 350? 0 What is the hundreds digit of 2462? 4 What is the thousands digit of 3134? 3 What is the thousands digit of 3055? 3 What is the tens digit of 864? 6 What is the thousands digit of 43647? 3 What is the tens digit of 15610? 1 What is the tens digit of 17244? 4 What is the units digit of 667? 7 What is the tens digit of 117? 1 What is the units digit of 6642? 2 What is the thousands digit of 3027? 3 What is the thousands digit of 7695? 7 What is the thousands digit of 6123? 6 What is the tens digit of 1839? 3 What is the units digit of 5461? 1 What is the tens digit of 20352? 5 What is the units digit of 4465? 5 What is the units digit of 88321? 1 What is the thousands digit of 2843? 2 What is the units digit of 1365? 5 What is the tens digit of 10970? 7 What is the ten thousands digit of 61128? 6 What is the units digit of 8742? 2 What is the ten thousands digit of 153762? 5 What is the thousands digit of 2292? 2 What is the hundreds digit of 9166? 1 What is the thousands digit of 6907? 6 What is the thousands digit of 4038? 4 What is the hundreds digit of 21396? 3 What is the hundreds digit of 111446? 4 What is the thousands digit of 25358? 5 What is the units digit of 799? 9 What is the hundreds digit of 1390? 3 What is the tens digit of 1021? 2 What is the thousands digit of 15354? 5 What is the thousands digit of 16871? 6 What is the ten thousands digit of 65515? 6 What is the thousands digit of 41277? 1 What is the units digit of 2647? 7 What is the tens digit of 9586? 8 What is the tens digit of 7263? 6 What is the tens digit of 2888? 8 What is the hundreds digit of 977? 9 What is the hundreds digit of 1183? 1 What is the thousands digit of 4448? 4 What is the tens digit of 6268? 6 What is the hundreds digit of 3541? 5 What is the hundreds digit of 381? 3 What is the units digit of 8898? 8 What is the hundreds digit of 6595? 5 What is the ten thousands digit of 18632? 1 What is the units digit of 552? 2 What is the hundreds digit of 968? 9 What is the hundreds digit of 6608? 6 What is the units digit of 930? 0 What is the tens digit of 13481? 8 What is the tens digit of 4042? 4 What is the hundreds digit of 3272? 2 What is the hundreds digit of 19146? 1 What is the hundreds digit of 127426? 4 What is the hundreds digit of 5851? 8 What is the hundreds digit of 1061? 0 What is the tens digit of 2424? 2 What is the thousands digit of 2701? 2 What is the hundreds digit of 91976? 9 What is the thousands digit of 3909? 3 What is the hundreds digit of 7668? 6 What is the thousands digit of 7896? 7 What is the units digit of 3773? 3 What is the units digit of 19941? 1 What is the thousands digit of 18075? 8 What is the hundreds digit of 2867? 8 What is the hundreds digit of 2389? 3 What is the tens digit of 10902? 0 What is the hundreds digit of 14708? 7 What is the hundreds digit of 1461? 4 What is the hundreds digit of 31126? 1 What is the hundreds digit of 8593? 5 What is the tens digit of 116902? 0 What is the thousands digit of 14172? 4 What is the units digit of 5843? 3 What is the tens digit of 442? 4 What is the thousands digit of 2346? 2 What is the units digit of 254? 4 What is the thousands digit of 1567? 1 What is the units digit of 23812? 2 What is the hundreds digit of 342? 3 What is the tens digit of 471? 7 What is the units digit of 8553? 3 What is the hundreds digit of 78395? 3 What is the units digit of 23346? 6 What is the units digit of 2800? 0 What is the units digit of 18765? 5 What is the tens digit of 1082? 8 What is the hundreds digit of 2968? 9 What is the tens digit of 1200? 0 What is the units digit of 22303? 3 What is the tens digit of 9365? 6 What is the ten thousands digit of 12527? 1 What is the tens digit of 66286? 8 What is the units digit of 41461? 1 What is the units digit of 7193? 3 What is the tens digit of 1531? 3 What is the units digit of 597? 7 What is the tens digit of 2094? 9 What is the tens digit of 12271? 7 What is the thousands digit of 9507? 9 What is the units digit of 3530? 0 What is the units digit of 3509? 9 What is the thousands digit of 5785? 5 What is the ten thousands digit of 69599? 6 What is the units digit of 132741? 1 What is the units digit of 36406? 6 What is the thousands digit of 72357? 2 What is the hundreds digit of 835? 8 What is the units digit of 28993? 3 What is the hundreds digit of 3265? 2 What is the ten thousands digit of 151988? 5 What is the thousands digit of 3568? 3 What is the tens digit of 162532? 3 What is the tens digit of 95? 9 What is the thousands digit of 6238? 6 What is the hundred thousands digit of 180709? 1 What is the units digit of 526? 6 What is the thousands digit of 5519? 5 What is the hundreds digit of 1728? 7 What is the hundreds digit of 1990? 9 What is the tens digit of 9802? 0 What is the units digit of 9281? 1 What is the tens digit of 606? 0 What is the units digit of 2013? 3 What is the hundreds digit of 7799? 7 What is the units digit of 455? 5 What is the hundreds digit of 11194? 1 What is the tens digit of 11869? 6 What is the tens digit of 22640? 4 What is the hundreds digit of 1994? 9 What is the hundreds digit of 4740? 7 What is the tens digit of 1639? 3 What is the units digit of 17513? 3 What is the ten thousands digit of 20906? 2 What is the units digit of 1642? 2 What is the tens digit of 9702? 0 What is the hundreds digit of 343? 3 What is the units digit of 18882? 2 What is the units digit of 429? 9 What is the hundreds digit of 825? 8 What is the tens digit of 3364? 6 What is the hundreds digit of 2841? 8 What is the tens digit of 513? 1 What is the hundreds digit of 19416? 4 What is the hundreds digit of 841? 8 What is the units digit of 4187? 7 What is the hundreds digit of 1367? 3 What is the units digit of 8503? 3 What is the thousands digit of 87479? 7 What is the units digit of 16131? 1 What is the units digit of 514? 4 What is the units digit of 3039? 9 What is the hundreds digit of 1809? 8 What is the tens digit of 8712? 1 What is the units digit of 12951? 1 What is the hundred thousands digit of 105418? 1 What is the tens digit of 891? 9 What is the hundreds digit of 3174? 1 What is the hundreds digit of 4890? 8 What is the units digit of 14929? 9 What is the hundreds digit of 450? 4 What is the units digit of 8776? 6 What is the units digit of 53? 3 What is the units digit of 4920? 0 What is the ten thousands digit of 19592? 1 What is the hundreds digit of 1182? 1 What is the units digit of 2009? 9 What is the units digit of 49032? 2 What is the hundreds digit of 51729? 7 What is the tens digit of 2464? 6 What is the hundreds digit of 17363? 3 What is th	{ "pile_set_name": "DM Mathematics" }
ng order. -9898, -14, -2, 1, 2 Sort 1, -5, 17, -4658, 7, -3. -4658, -5, -3, 1, 7, 17 Put -173, 2/53353, 0.08, 0.1 in ascending order. -173, 2/53353, 0.08, 0.1 Sort 21106, -17/65, 0.4, -3/5, -3 in ascending order. -3, -3/5, -17/65, 0.4, 21106 Sort 65, 2, -3, 1, -4, 1838 in decreasing order. 1838, 65, 2, 1, -3, -4 Sort 18, -9, 3, -1, -3, 29 in decreasing order. 29, 18, 3, -1, -3, -9 Sort -5, 16, 8545, -4 in ascending order. -5, -4, 16, 8545 Sort -0.045, -267708, 3/4, -1 in ascending order. -267708, -1, -0.045, 3/4 Put -2/525, -13/2, 865, -5 in decreasing order. 865, -2/525, -5, -13/2 Sort 593, 9729, 4 in decreasing order. 9729, 593, 4 Put -18, 2, -2, 1, -11618 in descending order. 2, 1, -2, -18, -11618 Sort -0.3, 1/6, 9, 3, 147, 3/2, 0.2 in increasing order. -0.3, 1/6, 0.2, 3/2, 3, 9, 147 Sort 12, -60, 4, 3, -2028 in increasing order. -2028, -60, 3, 4, 12 Sort -8, -4, 6, -28, 105, 0 in increasing order. -28, -8, -4, 0, 6, 105 Put -5, -3, 5, 15, 182, -7 in descending order. 182, 15, 5, -3, -5, -7 Sort 5, 2115, -69, -3. -69, -3, 5, 2115 Put -2, -1/2380, -5, -2/55 in ascending order. -5, -2, -2/55, -1/2380 Sort -1309, -0.18, -3/775. -1309, -0.18, -3/775 Put 5, 28, 937.118, -1 in decreasing order. 937.118, 28, 5, -1 Sort -1.5, 2, 1.77, -7/37, 3 in descending order. 3, 2, 1.77, -7/37, -1.5 Sort 4, 338, -10, -4, -3, 2, -7 in ascending order. -10, -7, -4, -3, 2, 4, 338 Put 1, -11, 3702254 in descending order. 3702254, 1, -11 Put 90/19, -1.4, 14/11 in increasing order. -1.4, 14/11, 90/19 Sort -99, 5, -7, 1, 6, -6, -1 in decreasing order. 6, 5, 1, -1, -6, -7, -99 Put -2/11, -2, 14/5, -1, -4/3, -4 in increasing order. -4, -2, -4/3, -1, -2/11, 14/5 Sort 18/11, -75/887, -3/5 in descending order. 18/11, -75/887, -3/5 Sort -0.1, 2, 0.5, -4, 0.1, 35. -4, -0.1, 0.1, 0.5, 2, 35 Put 27156, 10, 2, -3, -2, 5 in increasing order. -3, -2, 2, 5, 10, 27156 Put 118, 3, 1, -1, -75 in descending order. 118, 3, 1, -1, -75 Sort 4, 106/9, 127.45 in descending order. 127.45, 106/9, 4 Sort 1/4, 39707, 10. 1/4, 10, 39707 Sort -1926, 5, -3820. -3820, -1926, 5 Put 0, -4, -1, 1, -5, 12655 in descending order. 12655, 1, 0, -1, -4, -5 Put 4, -6, 1, -3257, 6 in descending order. 6, 4, 1, -6, -3257 Sort -5, -21, 8, 6, -6, 5, -26 in increasing order. -26, -21, -6, -5, 5, 6, 8 Sort -3.6, 0, -265, -74 in decreasing order. 0, -3.6, -74, -265 Sort 1/2, 1, -48953 in increasing order. -48953, 1/2, 1 Put 1/2, -83604, 6 in descending order. 6, 1/2, -83604 Sort -5, -2, -177, 9, 1, -10, 26 in decreasing order. 26, 9, 1, -2, -5, -10, -177 Sort -203, -2, -6, 4, 1, -3, 0. -203, -6, -3, -2, 0, 1, 4 Sort -1860, 4, -15933 in descending order. 4, -1860, -15933 Sort -61, 27, -20240, 2 in descending order. 27, 2, -61, -20240 Put 1969, 90, 10, -13 in ascending order. -13, 10, 90, 1969 Put -115/2, 0.4, -3, 1/306, -0.05 in descending order. 0.4, 1/306, -0.05, -3, -115/2 Put 3/2, -4, -2/15, -410, 3/4, 2 in decreasing order. 2, 3/2, 3/4, -2/15, -4, -410 Put 14, 5/317, 219, 5 in ascending order. 5/317, 5, 14, 219 Put 3, -7, 5, -0.1, 0.5, 4781 in ascending order. -7, -0.1, 0.5, 3, 5, 4781 Put 8931, 5, 2788 in increasing order. 5, 2788, 8931 Sort 0, -2, 5, -0.02, 1/6, 13/5, 3 in descending order. 5, 3, 13/5, 1/6, 0, -0.02, -2 Put -61704, -0.2, 2/11, -0.3, 1 in decreasing order. 1, 2/11, -0.2, -0.3, -61704 Put -25, 5, 1, -8351, 3, 4 in ascending order. -8351, -25, 1, 3, 4, 5 Sort 7.9, 28, 8619 in decreasing order. 8619, 28, 7.9 Put -13, 5, -3, 259, 153 in descending order. 259, 153, 5, -3, -13 Sort -5, -39, -2431562 in descending order. -5, -39, -2431562 Put 20, 48, 158, -5, 0, 4, 2 in decreasing order. 158, 48, 20, 4, 2, 0, -5 Put -4142, -6, -5, 3, 8 in increasing order. -4142, -6, -5, 3, 8 Sort 1/45, -1540838, -0.4 in increasing order. -1540838, -0.4, 1/45 Sort 19, -749909, 3 in decreasing order. 19, 3, -749909 Put -2, 1/3, 5, -915045, -1 in ascending order. -915045, -2, -1, 1/3, 5 Put -4, 7, -51, 0, -3, -1, -18 in descending order. 7, 0, -1, -3, -4, -18, -51 Sort -0.6, 0.3, 0.16, 45970, -5. -5, -0.6, 0.16, 0.3, 45970 Put -13, 53/2, 37417, -2/7 in descending order. 37417, 53/2, -2/7, -13 Put 5, 2816, -4824 in descending order. 2816, 5, -4824 Sort 2/9, 300, -52, -20/29 in ascending order. -52, -20/29, 2/9, 300 Sort -6/43, 0, -568/11. -568/11, -6/43, 0 Put 2/7, -3, -5, 59.18, -4, -6 in increasing order. -6, -5, -4, -3, 2/7, 59.18 Sort -5, 9, -1, 5, 0, 4, -46540 in descending order. 9, 5, 4, 0, -1, -5, -46540 Sort 1, 6, -2, -6, 0, 3, -5. -6, -5, -2, 0, 1, 3, 6 Sort -3, -7, -5, 0, -20, -82. -82, -20, -7, -5, -3, 0 Sort -841, 3, 2, -4, 4, -5, -132. -841, -132, -5, -4, 2, 3, 4 Sort -7570, -1, 28, -3, -5, 0, 2 in increasing order. -7570, -5, -3, -1, 0, 2, 28 Sort -3/5, -17, -3, -0.04, 4, 28, 3. -17, -3, -3/5, -0.04, 3, 4, 28 Put 0.4, 0.48, -0.7, 2/67, -487 in increasing order. -487, -0.7, 2/67, 0.4, 0.48 Sort 5, -768, 2.1, -13, 2/5, 0.3 in decreasing order. 5, 2.1, 2/5, 0.3, -13, -768 Sort 310921, -14, -3. -14, -3, 310921 Sort -7545/2, 2/11, -1.8, 83. -7545/2, -1.8, 2/11, 83 Sort 5, -2, 430835 in decreasing order. 430835, 5, -2 Sort -5361, 5, 5/116, -3/13 in descending order. 5, 5/116, -3/13, -5361 Put -4, 0.17, 2726 in increasing order. -4, 0.17, 2726 Put -1, -502713, 8 in decreasing order. 8, -1, -502713 Sort 0.1, -2/11, -33, 7, 1/2312 in ascending order. -33, -2/11, 1/2312, 0.1, 7 Sort 823, 16, -436, 4 in increasing order. -436, 4, 16, 823 Put -415313, 7, 1 in descending order. 7, 1, -415313 Put -26, -274, 6, 112, -3 in ascending order. -274, -26, -3, 6, 112 Put -365, 2, -4, 7, -39, -2, -1 in ascending order. -365, -39, -4, -2, -1, 2, 7 Put 15, 3, -103, 4, 24 in ascending order. -103, 3, 4, 15, 24 Put 0.389, -5/6, 2/9 in ascending order. -5/6, 2/9, 0.389 Sort -2, 2, -320, 0, 14, -10, -7. -320, -10, -7, -2, 0, 2, 14 Sort -659, -524, -2, 5, -5 in decreasing order. 5, -2, -5, -524, -659 Sort -1, 1, -22, 2, 0, 468, 4 in descending order. 468, 4, 2, 1, 0, -1, -22 Put 157, -72577, -6 in decreasing order. 157, -6, -72577 Sort 1552, -156, -5 in ascending order. -156, -5, 1552 Put -6, -3/8, 0.8, -98, 0.2, -2 in descending order. 0.8, 0.2, -3/8, -2, -6, -98 Sort -1, 5, -3059, 1, -2, -91. -3059, -91, -2, -1, 1, 5 Sort -92, 0, -1, 29, 1, -32 in increasing order. -92, -32, -1, 0, 1, 29 Sort -4, -145907, -202. -145907, -202, -4 Put 109, -420, 3046 in increasing order. -420, 109, 3046 Sort -4, -5, -228, 2, 10, 203. -228, -5, -4, 2, 10, 203 Put 27, -5, -9, -6 in increasing order. -9, -6, -5, 27 Put -20694, 5, -0.087, -1/8 in ascending order. -20694, -1/8, -0.087, 5 Sort -4, 1, 177, -20058 in decreasing order. 177, 1, -4, -20058 Sort 1, 0, -0.36, 0.8, 1138. -0.36, 0, 0.8, 1, 1138 Put 4, -352954, -9, -5 in descending order. 4, -5, -9, -352954 Sort -195, -1, 9273. -195, -1, 9273 Sort -4, 4, -221, -7, -5543 in ascending order. -5543, -221, -7, -4, 4 Put 7, -5, 0.07, -116, 5 in descending order. 7, 5, 0.07, -5, -116 Sort 2, 642993, 1/3, -0.01, 0.5. -0.01, 1/3, 0.5, 2, 642993 Put -898, 3, 2, -16/41 in ascending order. -898, -16/41, 2, 3 Sort -5, 5447, -3, -28, 2 in ascending order. -28, -5, -3, 2, 5447 Put 4, -6, -12, 1/5, -0.197698 in decreasing order. 4, 1/5, -0.197698, -6, -12 Sort -4/7, 0, -3612, -3800. -3800, -3612, -4/7, 0 Put 1, -4255, 5, 60, 0 in decreasing order. 60, 5, 1, 0, -4255 Sort -3, 43/2, 3/7, 1/391522. -3, 1/391522, 3/7, 43/2 Sort 2, 31, 224, 8, 11, -4, 3 in descending order. 224, 31, 11, 8, 3, 2, -4 Put 4, -1, 263, -1/2, -1/3 in descending order. 263, 4, -1/3, -1/2, -1 Sort -3, 17/2, 0.3, 0.2, -0.589, 5. -3, -0.589, 0.2, 0.3, 5, 17/2 Sort -498, 3435, -86 in ascending order. -498, -86, 3435 Sort 51, 0.065, 4, -254. -254, 0.065, 4, 51 Sort -1.4, 0.51, -36943, -2/5 in descending order. 0.51, -2/5, -1.4, -36943 Put 0.1, 1/5, 2, 139/3, 44 in ascending order. 0.1, 1/5, 2, 44, 139/3 Put 0, -3600471, 4 in ascending order. -3600471, 0, 4 Sort -4, -8911, -36 in descending order. -4, -36, -8911 Sort -1/1177, 76, -2/7 in decreasing order. 76, -1/1177, -2/7 Sort -16, 8, -2, -22, 85 in increasing order. -22, -16, -2, 8, 85 Put 6, 3, 2735003 in descending order. 2735003, 6, 3 Put 28527, 1, 0, 3 in increasing order. 0, 1, 3, 28527 Sort -3, -38, 2630, -12 in decreasing order. 2630, -3, -12, -38 Sort -5, 0, -3, 542, 2, -23 in desc	{ "pile_set_name": "DM Mathematics" }
PM? 71 What is 270 minutes before 4:22 AM? 11:52 PM How many minutes are there between 3:23 AM and 7:53 AM? 270 How many minutes are there between 1:07 PM and 12:27 AM? 680 How many minutes are there between 2:08 AM and 6:12 AM? 244 How many minutes are there between 8:58 AM and 3:09 PM? 371 How many minutes are there between 10:45 PM and 5:41 AM? 416 How many minutes are there between 1:51 PM and 7:11 PM? 320 How many minutes are there between 8:43 AM and 2:20 PM? 337 How many minutes are there between 1:21 AM and 7:21 AM? 360 What is 672 minutes before 11:52 AM? 12:40 AM What is 331 minutes after 2:33 AM? 8:04 AM What is 145 minutes before 8:04 AM? 5:39 AM What is 264 minutes after 2:34 AM? 6:58 AM How many minutes are there between 1:19 PM and 11:10 PM? 591 How many minutes are there between 10:55 AM and 5:21 PM? 386 How many minutes are there between 7:01 PM and 1:00 AM? 359 What is 628 minutes before 2:50 AM? 4:22 PM What is 359 minutes after 8:16 AM? 2:15 PM How many minutes are there between 4:22 AM and 7:07 AM? 165 How many minutes are there between 7:05 AM and 8:16 AM? 71 How many minutes are there between 3:03 PM and 4:46 PM? 103 What is 410 minutes before 7:03 AM? 12:13 AM What is 25 minutes after 10:27 PM? 10:52 PM How many minutes are there between 5:17 AM and 3:56 PM? 639 What is 144 minutes before 2:47 AM? 12:23 AM How many minutes are there between 2:36 PM and 5:42 PM? 186 How many minutes are there between 8:42 PM and 11:32 PM? 170 How many minutes are there between 2:24 PM and 8:40 PM? 376 How many minutes are there between 3:12 PM and 5:59 PM? 167 How many minutes are there between 9:40 PM and 7:51 AM? 611 How many minutes are there between 1:35 AM and 1:14 PM? 699 What is 391 minutes before 4:30 AM? 9:59 PM What is 236 minutes after 12:58 PM? 4:54 PM How many minutes are there between 3:43 AM and 6:08 AM? 145 How many minutes are there between 2:57 PM and 11:05 PM? 488 What is 404 minutes after 12:46 AM? 7:30 AM What is 620 minutes after 11:25 PM? 9:45 AM What is 62 minutes after 1:33 AM? 2:35 AM What is 51 minutes before 10:20 PM? 9:29 PM What is 27 minutes after 10:04 AM? 10:31 AM What is 680 minutes after 3:36 AM? 2:56 PM What is 670 minutes before 11:43 PM? 12:33 PM How many minutes are there between 2:52 AM and 3:19 AM? 27 What is 564 minutes before 4:50 AM? 7:26 PM How many minutes are there between 12:45 PM and 1:54 PM? 69 What is 480 minutes after 9:39 PM? 5:39 AM What is 423 minutes after 2:29 PM? 9:32 PM What is 552 minutes after 3:57 AM? 1:09 PM What is 589 minutes after 8:13 AM? 6:02 PM How many minutes are there between 1:05 AM and 10:12 AM? 547 How many minutes are there between 8:20 AM and 7:24 PM? 664 How many minutes are there between 6:23 PM and 8:47 PM? 144 How many minutes are there between 1:36 PM and 7:31 PM? 355 How many minutes are there between 7:53 PM and 9:36 PM? 103 How many minutes are there between 5:25 AM and 2:31 PM? 546 What is 627 minutes after 10:49 PM? 9:16 AM How many minutes are there between 9:55 AM and 11:55 AM? 120 How many minutes are there between 1:26 PM and 12:36 AM? 670 How many minutes are there between 1:51 AM and 12:54 PM? 663 How many minutes are there between 8:48 PM and 5:22 AM? 514 What is 402 minutes before 8:05 AM? 1:23 AM How many minutes are there between 10:46 PM and 8:22 AM? 576 What is 676 minutes before 8:10 PM? 8:54 AM How many minutes are there between 9:55 PM and 5:45 AM? 470 How many minutes are there between 3:36 AM and 9:07 AM? 331 How many minutes are there between 8:21 PM and 1:13 AM? 292 What is 680 minutes after 12:25 PM? 11:45 PM What is 623 minutes after 5:02 AM? 3:25 PM What is 524 minutes before 8:31 AM? 11:47 PM How many minutes are there between 7:43 PM and 9:19 PM? 96 How many minutes are there between 6:47 AM and 8:31 AM? 104 What is 207 minutes before 9:57 PM? 6:30 PM How many minutes are there between 11:53 AM and 8:03 PM? 490 What is 394 minutes before 10:55 PM? 4:21 PM What is 142 minutes after 10:10 PM? 12:32 AM What is 488 minutes before 6:56 AM? 10:48 PM How many minutes are there between 7:08 PM and 5:38 AM? 630 What is 491 minutes before 2:52 AM? 6:41 PM What is 148 minutes before 7:55 PM? 5:27 PM What is 90 minutes after 12:29 AM? 1:59 AM How many minutes are there between 4:14 PM and 7:25 PM? 191 How many minutes are there between 2:25 PM and 7:56 PM? 331 What is 128 minutes after 1:16 PM? 3:24 PM How many minutes are there between 3:49 AM and 6:05 AM? 136 How many minutes are there between 11:31 AM and 11:00 PM? 689 How many minutes are there between 10:10 PM and 7:08 AM? 538 What is 355 minutes after 9:12 PM? 3:07 AM What is 421 minutes after 5:28 PM? 12:29 AM What is 337 minutes after 7:24 AM? 1:01 PM How many minutes are there between 5:09 AM and 7:15 AM? 126 How many minutes are there between 4:58 PM and 4:47 AM? 709 What is 293 minutes after 4:33 PM? 9:26 PM How many minutes are there between 8:54 AM and 6:43 PM? 589 What is 618 minutes before 4:31 AM? 6:13 PM How many minutes are there between 4:00 AM and 3:43 PM? 703 How many minutes are there between 1:54 PM and 1:48 AM? 714 What is 51 minutes before 8:10 AM? 7:19 AM What is 419 minutes after 10:40 AM? 5:39 PM What is 685 minutes before 2:24 AM? 2:59 PM What is 625 minutes after 10:33 PM? 8:58 AM How many minutes are there between 6:26 PM and 4:54 AM? 628 How many minutes are there between 10:58 AM and 1:48 PM? 170 What is 320 minutes before 6:42 PM? 1:22 PM How many minutes are there between 8:36 PM and 4:49 AM? 493 What is 176 minutes after 6:56 PM? 9:52 PM What is 4 minutes before 12:40 PM? 12:36 PM How many minutes are there between 6:28 AM and 7:22 AM? 54 What is 539 minutes after 12:52 AM? 9:51 AM How many minutes are there between 8:14 AM and 1:31 PM? 317 How many minutes are there between 11:40 AM and 7:30 PM? 470 How many minutes are there between 8:00 AM and 10:39 AM? 159 How many minutes are there between 8:59 PM and 1:13 AM? 254 What is 672 minutes before 8:59 PM? 9:47 AM How many minutes are there between 7:26 PM and 4:42 AM? 556 What is 104 minutes before 5:27 PM? 3:43 PM What is 88 minutes after 6:40 AM? 8:08 AM What is 104 minutes after 6:57 AM? 8:41 AM How many minutes are there between 1:17 PM and 8:18 PM? 421 What is 238 minutes after 4:38 PM? 8:36 PM How many minutes are there between 3:38 PM and 6:10 PM? 152 How many minutes are there between 10:31 AM and 3:22 PM? 291 How many minutes are there between 7:33 PM and 8:11 PM? 38 What is 539 minutes before 11:50 AM? 2:51 AM How many minutes are there between 11:27 AM and 10:48 PM? 681 How many minutes are there between 9:05 PM and 8:33 AM? 688 How many minutes are there between 8:12 PM and 3:16 AM? 424 How many minutes are there between 8:44 PM and 8:27 AM? 703 How many minutes are there between 9:49 PM and 8:28 AM? 639 What is 27 minutes after 11:11 PM? 11:38 PM What is 631 minutes after 10:41 PM? 9:12 AM How many minutes are there between 6:43 PM and 12:00 AM? 317 What is 25 minutes after 5:00 PM? 5:25 PM What is 98 minutes after 9:07 PM? 10:45 PM What is 472 minutes before 6:01 PM? 10:09 AM What is 274 minutes before 6:20 AM? 1:46 AM What is 325 minutes before 8:19 PM? 2:54 PM What is 154 minutes before 10:56 AM? 8:22 AM How many minutes are there between 5:29 PM and 7:10 PM? 101 What is 323 minutes after 9:36 PM? 2:59 AM How many minutes are there between 7:20 PM and 4:08 AM? 528 How many minutes are there between 4:16 AM and 2:05 PM? 589 What is 36 minutes after 12:56 PM? 1:32 PM How many minutes are there between 1:19 PM and 1:13 AM? 714 What is 715 minutes after 7:22 AM? 7:17 PM How many minutes are there between 10:47 PM and 12:38 AM? 111 How many minutes are there between 5:00 PM and 1:12 AM? 492 What is 641 minutes before 10:16 AM? 11:35 PM How many minutes are there between 9:35 PM and 6:27 AM? 532 What is 501 minutes before 6:39 PM? 10:18 AM What is 293 minutes after 12:41 PM? 5:34 PM What is 609 minutes before 1:57 AM? 3:48 PM How many minutes are there between 4:15 AM and 3:43 PM? 688 How many minutes are there between 1:09 AM and 7:43 AM? 394 How many minutes are there between 6:47 AM and 8:53 AM? 126 What is 538 minutes before 4:59 AM? 8:01 PM How many minutes are there between 2:38 PM and	{ "pile_set_name": "DM Mathematics" }
1 = -4s, 2s + 5m = 42. Suppose s - 9 = 3h. Solve hr - u = 8 for r. 5 Let w(i) = -i3 - 5i*2 + i + 7. Let p be w(-5). Solve -5l = p - 17 for l. 3 Suppose -t + 2s = -2s - 23, 4s + 17 = -t. Suppose 3j - 3w = 3 + t, -j - w + 4 = 0. Suppose jr = 8 - 5. Solve m + r = 2 for m. 1 Suppose 0 = 5q + 20, 35 - 29 = 3b + 3q. Solve -bh = -9h + 9 for h. 3 Let b(t) be the second derivative of -t5/20 + t4/3 + t3/2 - t2/2 - 6t. Let m be b(4). Let f = 1 + m. Solve 0 = 2i + i + f for i. -4 Let i be (13 - 15)/((-1)/70). Let c be ((-4)/10)/((-8)/i). Solve 3u + 8 = cu for u. 2 Suppose 2v + 4t - 51 + 7 = 0, 3t = 3v - 48. Let d(i) = -i2 + 17i + 23. Let x be d(v). Solve 0 = -xq - 8 - 17 for q. -5 Suppose 133k - 657 = 806. Solve 2u - ku = 27 for u. -3 Suppose -9 = 58r - 61r, -2k + 2r + 6 = 0. Solve kw - 32 = 22w for w. -2 Let m be (0/(-1))/(-3 - -2). Suppose -4v = -5n - mn + 35, -n - v + 7 = 0. Solve -5 - n = 4l for l. -3 Let m = 18 + -37. Let b = 23 + m. Suppose 13 = bf + 4y - 3, 5y - 6 = 2f. Solve fs = 3s - 4 for s. 4 Suppose 9g - 72 = 3g. Let z(y) = y + 1. Let h be z(1). Suppose hu - 3 - 3 = 0. Solve uf - 3 - g = 0 for f. 5 Let v be (-1 + 3)11(-7)/2. Let n be 2 - (-4)/(-14) - 22/v. Solve 0 = -nh - 0 - 8 for h. -4 Let m be (-4 - (-40)/12)/((-5)/30). Solve -4b + 8b = m for b. 1 Suppose 1 = l - 3. Suppose -lx + 16x - 72 = 0. Solve xa = 4a - 2 for a. -1 Suppose c - 141 = -136. Solve -cg - 5 = -25 for g. 4 Suppose -7i = -11i + 40. Solve -k + i = k for k. 5 Suppose -3b + 0b + 78 = 0. Suppose 480 = 55l - 75l. Let f = b + l. Solve -fa - 15 = a for a. -5 Let t(f) = -f + 6. Let x be t(5). Let u be (15/(-6))/(-5)2. Let c be (24/(-12))/(u-1). Solve g - c = -x for g. 1 Suppose z - 28 = -z + 5o, 4o + 12 = -z. Suppose s - zq = 32, -4q + 27 = s - 7q. Let n(r) = -r - 1. Let h be n(-1). Solve 5y - y - s = h for y. 3 Let o(t) = 2t*2 + 30t - 76. Let k be o(-18). Solve 35 = -m + k for m. -3 Suppose 5f = -4t + 29, 3f - 3t + 3 - 15 = 0. Solve fi = -i - 24 for i. -4 Suppose 0 = -4i - 16, -2i - 2 = 3q - 0. Solve -j + 3j - q = 0 for j. 1 Suppose 4w - 19 = -7. Let g be 2 + -1 - (6 + -15)/3. Let j(b) = b*3 - 9b*2 + 20b + 2. Let m be j(g). Solve -z = mz + w for z. -1 Let h be 4/14 + 32/(-112). Solve -2b + 0 + 2 = h for b. 1 Suppose -5v = -1 - 9. Let r(y) = 0y*2 + y - v + 1 + 3y*2. Let o be r(1). Solve 3j - o = -0 for j. 1 Let h(s) = s*3 - 18s*2 + 17s + 5. Let b be h(17). Suppose -r = bz - 101, 0 = -0z + z - 3r - 17. Solve -m - z = 4m for m. -4 Let u be -2 + (2 - 5/(-1)). Suppose 2y + 2y + 7 = -q, -uy = 10. Suppose -4i + 18 = 2d, 0 = -i + d - 5d + q. Solve -2s - i - 1 = 0 for s. -3 Suppose 150 = -45p + 75p. Let b be 6 - 3(-6)/(-9). Suppose -2q + 4 - 8 = -bt, -3q = 2t + 6. Solve 0 = -tu - pu + 10 for u. 2 Let r(j) = -j + 8. Let m be r(-14). Suppose -4v = 12, 4w - m = -2v + 4v. Let f = 6 - w. Solve 0 = fl - 2 - 0 for l. 1 Let k = -282 - -334. Solve 2x = k - 50 for x. 1 Let i be (-2 - 0)(-3)/6. Let y be -1 - (2 + -6)i. Solve -m - 8 = ym for m. -2 Let i = -3 + 8. Let b(w) = w3 - 19w*2 - 21w + 28. Let x be b(20). Solve -x = -iu - 18 for u. -2 Let z be ((-5)/(100/8))/((-14)/280). Solve 26o - z = 30o for o. -2 Let p(o) = o + 5. Let a be p(-3). Let s be (1 - a)(1 - 1). Suppose s = z - 4 - 9. Solve -3b = 2 + z for b. -5 Let t(r) = 10r*3 - 2r + 1. Let u be t(1). Suppose 0 = -s + us + s. Solve 0 = 3v - sv - 6 for v. 2 Let o = 527 + -523. Solve c - o = 1 for c. 5 Suppose 20q - 22 = 18. Solve -3g + 15 = qg for g. 3 Let q be (0 - -4)/((-47)/7 - -7). Solve q = 3s + 5 for s. 3 Let d(l) = -l3 + 40l*2 - 36l - 106. Let j be d(39). Solve 18x + 7 = jx for x. -1 Let s(m) be the second derivative of -m*5/20 - 5m4/6 - m3/6 - 5m2/2 - 3m. Let q be -101/33. Let z be s(q). Solve -zy + 0y = 15 for y. -3 Let z(h) = 25h - 292. Let v be z(12). Solve 4 = 10k - vk for k. 2 Let y be -2 + (192/(-104) - 2/13). Let t = 5 + 3. Let r = y + t. Solve r = 3q + 16 for q. -4 Suppose 0 = -f - 22 + 26. Let b = f + 2. Solve 2r - b = -0r for r. 3 Let p be 12((-12)/10)/(27/(-45)). Solve -3d + 15 = p for d. -3 Let w(y) = -y*3 - 11y*2 + 3y + 33. Let d be w(-11). Solve d = t + 12t - 65 for t. 5 Let f(y) = y2 + y + 4. Let v be f(-3). Suppose c - vc + 18 = 0. Solve 0 = cb - 10 + 2 for b. 4 Suppose -2c - q + 17 = -61, -c + 4q + 57 = 0. Solve 20 = -cs + 46s for s. 4 Suppose -4 = -b - b. Let q(z) = z3 - 8z*2 + 7z + 4. Let h be q(7). Suppose 34 = 3v + 4s + 5, 5v - 27 = hs. Solve -20 = -vf + bf for f. 4 Let i(s) = -s*3 - 3s*2 - 11s - 13. Let m be i(-2). Solve 1 + 4 = -my for y. -1 Let b = -902 + 915. Solve -4o = -b + 1 for o. 3 Suppose -21t + 24t = 138. Let c = t - 27. Suppose cs = 14s. Solve -r + 2 = -s for r. 2 Suppose -5m + 9 - 2 = 3a, 5a - 24 = 4m. Suppose 0 = -az + 52 - 4. Let q be z/410/15. Solve -qc + 4c = 10 for c. 5 Let b(d) = -4d3 + 23d*2 - 15d + 4. Let w be b(5). Solve -8 = 2l - w for l. -2 Let r(s) = -7 + 55s + s*3 - 53s + 5 - 5s2. Let l be r(5). Solve -3p + 2 - l = 0 for p. -2 Suppose 0 = -5k + 5y + 46 - 11, 3k - 26 = 4y. Solve 10z - k = 8z for z. 1 Suppose 2 + 1 = r. Suppose 0 = -rw + 3p + 6, 3p + 10 = -5w - 2p. Suppose w = l + 3l. Solve l = 3h - 2 + 14 for h. -4 Let q(a) = -14a - 135. Let w be q(-10). Solve -146m = -141m + w for m. -1 Suppose -5m = -2i + 61, -4i = -0i + 5m - 77. Solve 2 = -5z - i for z. -5 Let d be (-22)/121 + 9/(-11) + 1. Solve 5q - 10q - 25 = d for q. -5 Let d be 22/55 - (-54)/15. Solve -d - 1 = -5m for m. 1 Let b be 10/464/80. Suppose 0 = -3c + 4r - b, 2c - 2 = -r + 4. Solve -7 = -cn - 3 for n. 2 Let a(n) = n*3 + 19n*2. Suppose -4y + 8y = -32. Let w(o) = -o3 - 8o*2 + 2o - 3. Let i be w(y). Let k be a(i). Solve -d + 4d + 3 = k for d. -1 Suppose 0x + x + 4j - 23 = 0, 10 = 2j. Suppose -30 = -2o - 4h, 4o - xh = 8 - 3. Solve of = -0f for f. 0 Suppose -4c + 70 = 5b, -c - 13 = -2c + b. Suppose -25 = -2n + k, -4n + c = -0n + 5k. Solve -r + n = r for r. 5 Let m = 47 - 29. Let k = 589 - 587. Solve -4r - m = -k for r. -4 Suppose 0 = 6h + 55 + 95. Let f be 27 + h - 2/(-1). Solve n = fn for n. 0 Suppose 0 = i - 2r - 5, i = 3r + 5 + 3. Let k be (1/1)/i-9. Let x = -50 - -55. Solve 11 = xj - k for j. 4 Let w(b) = b*2 + 11b + 7. Let x be w(-7). Let l = 24 + x. Solve 0 = -n + 2 + l for n. 5 Suppose -4d = -2s - 48, -16s + 11s = 0. Solve -v - 3v = d for v. -3 Let k(i) = i3 + 8i*2 + 16. Let w be k(-8). Solve -23c + 35 = -wc for c. 5 Let a(p) = -p2 + 9p - 8. Let r be a(5). Suppose 4j + 2q - r = 5q, -12 = -4j - 3q. Let n be 6(0 - (1 - 2)). Solve -b = -jb + n for b. 3 Let f(x) = x3 - 3x*2 - x + 8. Let g be f(2). Suppose 0 = -3d, gd + 12 = 2v + 5d. Solve 5i + 1 = v for i. 1 Suppose 2g - 5g - 3 = 3y, 0 = y - 4g - 24. Let p be (2 - 0) + y + -5. Solve 3j - 5 - p = 0 for j. 2 Let j = 17 - 6. Let w be (j + -12)(-7 - (0 + -1)). Solve 0b + w = -3b for b. -2 Suppose 0 = 3j + 4v - 14, 15j - 14 = 10j - 2v. Let c be 1 + -3 + 3 - -9. Solve js + 0s = -c for s. -5 Let d(w) = -7w - 25. Suppose -31 = 9c + 5. Let v be d(c). Let q(s) = s2 - 1. Let m be q(-2). Solve -v = -3p + m for p. 2 Let p(r) = 3r3 - 4r*2 + 2r + 3. Let d be p(2). Solve 2o + d = -o for o. -5 Suppose 5l - 13 = 5k + 22, 2l - k = 9. Solve la - 226 = -224 for a. 1 Let a(z) = -2z - 20. Let t be a(-14). Let k = t - 13. Let p be (2 + -2)/(k + 2). Solve -3y + 8 - 23 = p for y. -5 Suppose 7r = 9r - 12. Suppose -15 = -2p + u, p - rp + 20 = u. Solve pa = 2a for a. 0 Let z be ((-1)/(-1)-1)/(-1). Let j = 71 - 10. Suppose 0 = -8t + 11 + j. Solve 2m = z + t for m. 5 Let g(a) = -7a - 2. Let m be g(-8). Let t be (2/6)/(6/m). Solve t = 2y - 1 for y. 2 Suppose -8s + 742 + 42 = 0. Let z = s + -95. Solve -4y + 5y = -z for y. -3 Let u(b) be the first derivative of 2b*2 - 49b + 3. Let r be u(13). Solve r = 4y + 11 for y. -2 Let f = -393 - -399. Solve -11 = fi + 1 for i. -2 Let r(g) = 2g3 + 9g*2 - 7g - 3. Let u be r(-5). Let y(v) = 3v - 2. Let w be y(u). Solve 3q = w - 4 for q. 5 Suppose 5d + n - 9 = 22, 5d - 32	{ "pile_set_name": "DM Mathematics" }
term in -1289, -1215, -1095, -935, -741, -519, -275? -15 What is next in -7661, -7341, -7021, -6701, -6381? -6061 What is the next term in 4623, 18496, 41617, 73986, 115603, 166468, 226581? 295942 What is next in 145106, 145108, 145110, 145112, 145114, 145116? 145118 What comes next: 9019, 18042, 27067, 36094, 45123, 54154? 63187 What is the next term in -93625, -93623, -93619, -93613, -93605, -93595, -93583? -93569 What is the next term in 44445, 44446, 44447, 44448? 44449 What is next in -805, -1014, -1207, -1378, -1521, -1630, -1699, -1722? -1693 What is next in -1102, -4411, -9926, -17647, -27574, -39707? -54046 What comes next: -7486, -14962, -22438, -29914, -37390? -44866 What is the next term in 8481, 8489, 8499, 8511, 8525, 8541? 8559 What is the next term in -120101, -120098, -120099, -120104, -120113, -120126? -120143 What is next in -9, -169, -429, -789, -1249? -1809 What comes next: -210, -325, -512, -771? -1102 What comes next: -32117, -64232, -96347? -128462 What comes next: -155, -988, -2497, -4682, -7543, -11080? -15293 What is the next term in -392, -701, -1008, -1313? -1616 What is the next term in 335, 1349, 3035, 5393, 8423? 12125 What comes next: 296, 603, 892, 1163, 1416, 1651? 1868 What comes next: 14340, 14359, 14378, 14397, 14416? 14435 What is next in 59, 1453, 3777, 7031, 11215, 16329, 22373? 29347 What is next in -106373, -106369, -106355, -106325, -106273, -106193, -106079, -105925? -105725 What is next in 1190961, 2381923, 3572885, 4763847, 5954809, 7145771? 8336733 What is next in -14186, -14185, -14184, -14183, -14182? -14181 What is next in -130, -161, -156, -97, 34, 255? 584 What is next in -4093, -16424, -36969, -65728, -102701? -147888 What comes next: -19295, -38401, -57507, -76613? -95719 What is the next term in 360, 1442, 3244, 5766? 9008 What is the next term in 9560, 9550, 9540, 9530, 9520, 9510? 9500 What comes next: 9641, 19281, 28921, 38561, 48201, 57841? 67481 What is the next term in -264, -280, -298, -318? -340	{ "pile_set_name": "DM Mathematics" }
6d + 2628155d - 12195 for d. -45 Solve -146g = -4390 + 67 - 641 for g. 34 Solve 6716m - 168 = 6723m for m. -24 Solve 934w - 47012 = -745w for w. 28 Solve 4870n + 35491 - 167015 - 44349 = 111457 for n. 59 Solve 123t - 63622 = -63130 for t. 4 Solve -7385t + 7789t = 36360 for t. 90 Solve -6810 = -860b - 502b for b. 5 Solve -162d + 490d - 129d = 75d + 2976 for d. 24 Solve -66m - 24m = -312m + 9546 for m. 43 Solve 0 = -150w - 169w + 357w - 2356 for w. 62 Solve 3t + 54t - 469 - 1298 = 0 for t. 31 Solve 223g - 3331 + 209 = 0 for g. 14 Solve -26442 = -393l + 1403l + 1024l for l. -13 Solve 695901f - 900 = 695951f for f. -18 Solve -2725t - 618200 = 4300t for t. -88 Solve -1077v + 701 = -1000v - 1686 for v. 31 Solve 369o - 193o = 212o + 1404 for o. -39 Solve -138q + 5526 - 3318 = 0 for q. 16 Solve 172 = 164n - 1013 - 7999 for n. 56 Solve -174k + 586k = 142k + 133k - 9864 for k. -72 Solve -2u - 33u - 25u - 48u = -5940 for u. 55 Solve -56o - 62o = 16o + 804 for o. -6 Solve 0 = 116x + 848 - 1357 - 999 for x. 13 Solve -850531q = -848314q + 161841 for q. -73 Solve 9d + 40 + 482 = -90d + 27 for d. -5 Solve 82x = 3774 + 3249 - 8007 for x. -12 Solve -17b + 16b + 9 = -5 - 33 for b. 47 Solve 5l + 383 - 783 - 692 = 44l for l. -28 Solve o - 3850 = -2o - 3901 for o. -17 Solve 3389x - 24777 = 93838 for x. 35 Solve 4039w + 260900 = -235897 for w. -123 Solve 1312t = 10199t + 298138 + 232542 + 251376 for t. -88 Solve 2092x + 427x + 69532 + 30859 = -116243 for x. -86 Solve 227 = -170b - 8224 - 1579 for b. -59 Solve -6514i + 1556i - 43765 = -14830 + 10729 for i. -8 Solve -1635653n = -1635656n + 87 for n. 29 Solve -1514m + 5077 = -70623 for m. 50 Solve 9660 - 6470 + 9606 = -457q for q. -28 Solve -508 = 44449r - 44556r - 1770 - 1306 for r. -24 Solve -1282p = -37p - 104p - 67319 for p. 59 Solve -330f = -2991f - 47898 for f. -18 Solve -8787 + 44434 + 36476 = -2487t for t. -29 Solve -680y - 12 = 20615 - 4987 for y. -23 Solve -2645253h = -2645328h + 375 for h. 5 Solve -398g + 67g - 1766g + 255834 = 0 for g. 122 Solve 0 = -49k + 6k + 1204 for k. 28 Solve 217g - 290g + 615 = -261 for g. 12 Solve -137i + 11691 - 4661 = -5574 for i. 92 Solve 327c = -62c + 24342 + 12613 for c. 95 Solve 0 = 6c - 133 + 47 - 28 for c. 19 Solve 40c - 296c = -122c + 1528c + 83100 for c. -50 Solve -27852 = -715y + 12903 for y. 57 Solve 7197 = -414g + 664g + 947 for g. 25 Solve -3059 - 16809 - 12379 = 774f - 513 for f. -41 Solve 0 = -91k + 257k - 7968 for k. 48 Solve -355c + 34298 - 5896 = 1067 for c. 77 Solve -5f = -21f - 320f + 49392 for f. 147 Solve -2534z + 4973 = -2668z + 149 for z. -36 Solve 0f = -90f + 4384 + 3896 for f. 92 Solve -342s + 802s + 458s + 1109s - 79053 = 0 for s. 39 Solve 47574n = 47266n - 3388 for n. -11 Solve 3844 = 159j - 4106 for j. 50 Solve -76o - 7o + 2446 = 47o + 496 for o. 15 Solve 96g - 597 - 2629 = -2g + 6672 for g. 101 Solve -406484c - 27720 = -406946c for c. 60 Solve 514 = 119s + 7178 for s. -56 Solve -1229 + 241 = 626c + 1516 for c. -4 Solve -4794770m = -4794693m + 2233 for m. -29 Solve 3591 = 4238c - 4181c for c. 63 Solve 0 = -428957k + 430842k + 82940 for k. -44 Solve 507y = -9741 - 906 for y. -21 Solve 5499p = 2474p + 121000 for p. 40 Solve 41950z = 42115z + 7755 for z. -47 Solve 274x + 25x = -861 - 225 - 110 for x. -4 Solve -55r - 74r = -175r + 1012 for r. 22 Solve -20944 = 836z + 15004 for z. -43 Solve -235j + 1353 - 725 + 516 = -1676 for j. 12 Solve -483v = 1827 - 10038 for v. 17 Solve 0 = 1924m - 251m + 37085 - 10704 + 7079 for m. -20 Solve -12807 = -915g + 11898 for g. 27 Solve -38l + 27l - 148l = 6519 for l. -41 Solve -5251x = -407x - 314860 for x. 65 Solve 8690 = 121j + 278j - 11349 - 1906 for j. 55 Solve 4165 - 805 = 250x - 140 for x. 14 Solve -1456y - 5293y = 3078y + 953219 for y. -97 Solve -1025a + 497a - 5688 - 8568 = 0 for a. -27 Solve -90n - 2405 = 422n - 7525 for n. 10 Solve -1342u - 64646 = -94170 for u. 22 Solve -5669a = -6345a + 8112 for a. 12 Solve -864 = 7v + 17v for v. -36 Solve 2474s - 56616 = 109142 for s. 67 Solve 35433 = -2001g + 4293g - 2013g for g. 127 Solve -370430 = -3647f - 711f for f. 85 Solve 613812 = 414b + 632028 for b. -44 Solve -472n + 215380 = 2697n + 755n + 971n for n. 44 Solve -52i + 43822546 = 43823586 for i. -20 Solve -80 - 650 = 66l + 1250 for l. -30 Solve 18i + 80 - 63 = 267 + 164 for i. 23 Solve -98w - 71w = -7w + 6642 for w. -41 Solve 1648 = 77w - 123 for w. 23 Solve s = 48012 - 48031 for s. -19 Solve 3188l + 1513 = 3809l - 531 - 2303 for l. 7 Solve -1427f - 1751f - 3087f = 169155 for f. -27 Solve 106j - 115j + 2982 = 33j for j. 71 Solve 7734o - 549260 = -1736o for o. 58 Solve -531x - 7x - 41585 - 44963 = 586x for x. -77 Solve -230r = 511r - 130r - 887 - 15610 for r. 27 Solve -327j - 3516j + 382j - 249192 = 0 for j. -72 Solve 2a = -2339 + 2339 for a. 0 Solve 0 = 82g + 2445 - 477 for g. -24 Solve -1166p - 28553 = 5261 for p. -29 Solve -1842n + 4663n - 23623 = 75112 for n. 35 Solve 0 = -212z + 4135z - 11769 for z. 3 Solve -15068 = 234j - 4538 for j. -45 Solve -19512 = -75q + 346q for q. -72 Solve -274m = 5545 - 18423 for m. 47 Solve 815p = 352945 - 254330 for p. 121 Solve -174o - 41o = -2357 - 10328 for o. 59 Solve -752j = -34724 + 8404 for j. 35 Solve 446g - 22503 - 113699 = -1215g for g. 82 Solve -1116435 + 1117233 = -38x for x. -21 Solve 229r + 263r + 124656 = -251r - 370r for r. -112 Solve 10142v = 10063v - 4582 for v. -58 Solve -1193n = 764n + 108440 + 26593 for n. -69 Solve 1310g - 34530 = 37520 for g. 55 Solve -385l + 25153 = 9034 + 1874 for l. 37 Solve 4794 = -230s - 69s + 17s for s. -17 Solve 121658 = 1213j - 3275j for j. -59 Solve -22m - 6116 = -4774 for m. -61 Solve -44x + 482x = 46x - 126x + 18648 for x. 36 Solve 45568 = 624j + 126j + 4318 for j. 55 Solve 4208d - 61 + 90 + 174 = 4215d for d. 29 Solve 508s - 702s = 9700 for s. -50 Solve 44r + 784 + 1555 = -569 + 708 for r. -50 Solve 19m - 20m + 44m = -70m - 5989 for m. -53 Solve 2c + 97c + 86c = -40c - 15750 for c. -70 Solve -1133530 + 1133899 = 9p for p. 41 Solve 184478s - 61800 = 184890s for s. -150 Solve -431 + 273 = 58f + 595f + 2454 for f. -4 Solve -3471a + 279 = -206a + 1756 + 1788 for a. -1 Solve -1466r + 131r + 79744 = -89r for r. 64 Solve 10425515p - 10425489p = 364 for p. 14 Solve -27621 = -954p - 80p + 9242 - 4809 for p. 31 Solve -298j - 1901 - 674 = 977 + 322 for j. -13 Solve 17g - 3483 - 3087 = -1054g - 2214g for g. 2 Solve -303s - 69 = 9627 for s. -32 Solve 11w - 9091 = -8827 for w. 24 Solve -284113 + 284491 = 42z for z. 9 Solve -229s - 212545 = -225598 for s. 57 Solve 12908w + 18202w - 4000216 = 574w for w. 131 Solve 2133w = 23867 - 148236 - 42005 for w. -78 Solve -23730 + 3003 = -144p - 1039p + 27776 for p. 41 Solve -626 + 4494 = -646b - 1946 for b. -9 Solve 347t - 909t + 7084 = -1908 for t. 16 Solve 4735i - 5245i - 61710 = 0 for i. -121 Solve 942313 = 31673c + 28360 - 828062 for c. 55 Solve 268w + 2459 + 7869 - 1752 = 0 for w. -32 Solve 3042o - 1493o - 41508 = 15805 for o. 37 Solve -42442 = -534j + 4388j + 1614j + 28642 for j. -13 Solve 0 = 59y + 91y - 560 - 2590 for y. 21 Solve -17359i - 1099i - 250632 = 2428i for i. -12 Solve 1805 - 6005 = 192d + 8d for d. -21 Solve 0 = 14n + 149n - 4238 for n. 26 Solve 0 = -5742n + 3342n + 134400 for n. 56 Solve 0 = 208m + 685m - 13258 - 6388 for m. 22 Solve -153r + 1278 = 718r - 232r for r. 2 Solve 0 = 2020c + 1577c - 37535 + 6087 - 98044 for c. 36 Solve 3801k = -180226 + 172624 for k. -2 Solve -12d - 20924 + 21092 = 0 for d. 14 Solve 2504a + 16928 - 2476 = 774a - 9768 for a. -14 Solve -1341 + 72 = 75g + 2031 for g. -44 Solve -191411 = -161r + 8599r - 60517 + 130684 for r. -31 Solve -4769b + 6374b = 65805 for b. 41 Solve -6y - 350566 = -350752 for y. 31 Solve 19386f - 16434f = -247968 for f. -84 Solve -755a - 238a - 123405 = 965a + 207a for a. -57 Solve 0 = 318r - 1199r + 129575 - 14164 for r. 131 Solve -471m - 2047 - 9467 + 1152 = 0 for m. -22 Solve -6572 = -758n + 652n for	{ "pile_set_name": "DM Mathematics" }
= -l + 7l for l. 2 Let k be 0 + 4 + (-2 - 0). Suppose 0 = -2d - kd. Solve dc = -4c + 8 for c. 2 Let q be 24/(-8)-5. Suppose 0 = 5m + 5l + 20, -qm + 2l + 15 = -0m. Solve 1 = -z - m for z. -2 Let s = -35 - -39. Solve i - 6 = si for i. -2 Let u be 4/10 + 13/5. Suppose 6 = -0d + ud. Let k be 1/d + (-2)/4. Solve -x = -kx for x. 0 Let a be 0 + 0 + 62. Suppose -n - 3z = -17, 6 + 4 = -5n + 4z. Solve a = -2h - nh for h. -3 Let c be (9/(-12) - -1) + (-504)/(-32). Let m = c + -11. Solve 5 + 5 = mn for n. 2 Suppose 4m = -20, 2m + 3m = -5a. Suppose -2n - f - 1 = -a, n = 4f - 16. Solve nl - 3l = -12 for l. 4 Let a(s) = 2s*2 + 79s - 445. Let j be a(5). Solve 5z + 161 - 181 = j for z. 4 Let o be (-25 - -26)0(-1)/(-1). Suppose o = -3w - 2a + 47, -5w + 4a + 8 + 63 = 0. Solve 2x = -x - w for x. -5 Let u = -833 + 833. Solve -4y - y + 25 = u for y. 5 Let m(n) = -2n*2 + 28n + 8. Let a be m(14). Solve 5 = -3k + a for k. 1 Let t(j) = 4j*2 + 8j + 6. Let r(c) = -3c2 - 7c - 6. Let i(g) = -3r(g) - 2t(g). Let x be i(-7). Solve 0 = 3v + 2v + x for v. -4 Suppose -2i + 7i - 20 = 0. Let w(f) = i + 15f + 4 + f2 + 5 + 1. Let g be w(-14). Solve g = 3d - 7 + 1 for d. 2 Suppose -2h = 3d + 18, -3d + h + 30 = -8d. Let f be (d/5)/(69/(-230)). Solve 5b - 2 = fb for b. 2 Let j = -1142 - -1149. Solve 35 - 14 = -ji for i. -3 Suppose -4k - 4j + 20 = 0, -4j + 8 + 4 = 0. Solve 6w - k + 8 = 0 for w. -1 Let c = 329 - 325. Solve 6b - cb - 2 = 0 for b. 1 Let r(g) = g3 + 6g*2 + 2g - 3. Let s be r(-3). Solve 0 = -4q + 2 - s for q. -4 Suppose -5m - 95 = -4a + 6a, 0 = -3a - m - 123. Let w = a - -42. Solve wy = -y + 3 for y. 1 Suppose 5c - 28 = 4k - 5, -2k - 4 = 0. Let x be c/5 - 42/(-30). Suppose 0 = -xq + q + 10. Solve -5h + 0 = -q for h. 2 Let q be -8 - (-30)/(10 + -7). Solve qw = 7w + 5 for w. -1 Let h(q) = -q3 + 9q*2 + 35q + 14. Let g be h(12). Solve -gd = 3d - 20 for d. 4 Suppose 22y = 17y. Let f(i) = -3i + 2. Let t be f(y). Solve 10 = -tw - 0w for w. -5 Let l = -53 + 55. Solve li + 2 = -8 for i. -5 Suppose -2c + 23 = 3k + 2, c + 22 = 5k. Solve -2f - c = -13 for f. 5 Let g = 181 + -181. Solve q + 1 + g = 0 for q. -1 Let f(j) = -10 - 2 + 0j + 2j. Let c be f(10). Solve o = 5o - c for o. 2 Let w = 24 + -19. Let t(a) = a - wa + 2a - 2a. Let h be t(-2). Solve 0 = -hc + 3c + 20 for c. 4 Let f(v) = -25v3 - v2 + v. Let w be f(1). Suppose 4b - 32 = 7z - 3z, 3b + z - 12 = 0. Let r be ((-3)/b)/(5/w). Solve 10 = -2n - rn for n. -2 Suppose 4a - 272 = -0a. Let u = 38 - a. Let k = u + 32. Solve -2w - k = 2 for w. -2 Suppose 5b = 0, 0d - 3d = -2b - 42. Solve do = 8o + 18 for o. 3 Suppose 31u = 6u + 100. Solve 9 = -uq + 25 for q. 4 Suppose -10828 = -x - 10594. Solve xy = 235y for y. 0 Let v(b) = -b + 16. Let a be v(15). Let d be a + -2 - ((-2 - -3) + -6). Solve -2s = 2s + d for s. -1 Let z be 0 - (-264)/(-154)(-7)/2. Solve z = -9o - 30 for o. -4 Let d = -23 + 25. Let z be 2/(d - 12/9). Solve 2x = 3x + z for x. -3 Suppose -86d + 84d + 42 = 0. Solve -2x = 5x - d for x. 3 Suppose -5 - 4 = -c. Let z(r) = -2r + 5. Let d be z(c). Let s(g) = -g - 9. Let f be s(d). Solve -fx = -0x + 16 for x. -4 Let w(u) = 2u3 - 17u*2 - 8u - 3. Let b be w(9). Solve 0 = bs - 22 - 2 for s. 4 Let w(y) = 2y*2 + 22y + 54. Let r be w(-3). Solve 2q + rq - 32 = 0 for q. 4 Suppose -11d - 50 = -215. Solve 18x - d = 23x for x. -3 Let o = -11 + 19. Let z(l) = 2l + 8. Let n be z(o). Suppose -n = -0d - 2d. Solve 3x + x - d = 0 for x. 3 Let b be (22/(-11))/(((-3)/(-2))/(-3)). Let x be ((b + -3)/1)/((-2)/(-10)). Suppose 2h = 3h - 9. Solve -4g = -hg + x for g. 1 Let h be 4 - -2 - (-1 - -3). Suppose 2n + 4 = -5c, c - 3 = n + hc. Suppose -nm + 6 = -3. Solve 4 = mq - 2q for q. 4 Let s = 1 + 4. Let x be -1 - -12 - (-3 + 6). Suppose 6t - 2t + x = -m, -5m - 4t = -8. Solve -mr - 5 = -sr for r. 5 Let l be -13(-2 + 1). Let f be (-4)/10 + (-147)/(-105). Suppose f + 0 = m - a, 5a - l = -3m. Solve -2k - m = -k for k. -1 Suppose 0 = -3g - 3f + 21, g + 2f + 8 - 13 = 0. Solve -h + gh = 0 for h. 0 Let a be 35(40/15)/((-10)/(-3)). Solve -6u + a = u for u. 4 Let g be 51/4 - 12/(-48). Let m = g + -10. Let o be ((-2)/(-4))/(m/42). Solve q + o = 2 for q. -5 Suppose -6 = -2q - 0. Suppose 2 = -5i + 2h, -i - q = -0i - 3h. Suppose -20 = -2c - ic. Solve 5v = 3v + c for v. 5 Suppose -33 = -3v + 4o, 3o = -0o - 9. Solve vw = 4w + 4w for w. 0 Let y be 2/(-10) - (-464)/20. Suppose -3 = -4i - y. Let l = 12 - i. Solve -l - 3 = -5m for m. 4 Let i be 312/54 + (174/54 - 3). Solve i = -0r + 3r for r. 2 Suppose -5k = -2r + 49, -3r + k + 41 = -0k. Solve 0 = z + 2z - r for z. 4 Let z(q) = -q - 17. Suppose -7h - 58 = 61. Let v be z(h). Solve 3m + 2 - 8 = v for m. 2 Let k = 1 + 12. Suppose 5r = 3d + 21, -5d + 2d = -3r + 15. Let n be d((-7)/2 - -2). Solve ns - k = 2 for s. 5 Let x(h) be the second derivative of h*3/6 + 2h*2 - 9h. Let z be x(1). Solve -2 + z = a for a. 3 Let q be (-8)/(-3)(-12)/(-8). Suppose -q = r - 5r, 2x = r - 3. Let j be x/(10/6)-5. Solve js + s = 0 for s. 0 Let k(h) = -h3 + 11h*2 - 17h - 9. Let f be k(9). Solve -4d + 9d = f for d. 0 Let v be (-2)/(-3)(-1074)/(-8)2. Solve 0 = 5p + 174 - v for p. 1 Let y be 36/9 - (-1 - -1). Let t be -1((0 - 4) + y). Solve -x = -tx for x. 0 Suppose 356 = -12f + 8f. Let r = 93 + f. Solve -p + rp = 0 for p. 0 Let x(i) = -3i + 4. Suppose 3 = 3u, 6 = -4f - 2u - 0u. Let t be x(f). Solve -4l + 2l = t for l. -5 Let f be (24/18)/(24/54). Solve 0 = fi - 5i - 6 for i. -3 Let u(k) = 2k - 8. Suppose h + 18 + 7 = -4g, -4h = 3g + 22. Let b = -2 - g. Let l be u(b). Solve l = i + i + 4 for i. -2 Suppose -4g + 8 = -3w - 6, -4w + 13 = g. Suppose 4v + 18 = 98. Suppose wb - h - 25 = 2h, 4h + v = b. Solve 0a = 4a - b for a. 2 Let q be 942/(-9) - 26/(-18). Let f = q + 109. Solve -1 = 2g - f for g. 2 Suppose 3o = v + 135, -2v - 73 = -3o + 65. Suppose o = 5b - 16. Let t = -9 + b. Solve -4 = tr - 7r for r. 1 Let w be ((-2)/5)/(2/(-30)). Suppose -3v - 9 = -w. Let r be -2 - v - (-11 + 8). Solve -2z + r = -4z for z. -1 Suppose 0 = -p + 12p - 22. Solve -108 = pi - 114 for i. 3 Suppose -t = b + t - 13, 0 = 3b + 5t - 34. Let w = 10 + -6. Solve wj = bj - 3 for j. -3 Let i = -4 + 9. Suppose -3u + 2 = -ix + 23, -2u - 12 = -3x. Suppose -3q = -q - x. Solve 0 = -ql - l for l. 0 Let p(i) = i2 - 32i + 116. Let s be p(4). Let r = 1 - 1. Suppose r = -5d + 20, 8 = 2f - 4f + sd. Solve -21 = -fa - 9 for a. 3 Let d be -4 + 11/((-55)/(-60)). Suppose 2w - 4 = d. Solve 0 = 5x + w + 9 for x. -3 Suppose 5w = 2u + 52 + 6, -5u + 5 = 0. Suppose 12g + w = 48. Solve -gi - i + 8 = 0 for i. 2 Let q = -23 - -59. Let k be (-4)/14 + q/(-21) - -6. Solve -kz + 7 = 27 for z. -5 Let o be (-1 - -91) + 120/30. Suppose -oh + 14h = 0. Solve hs - 5s = -25 for s. 5 Suppose 10n + 1096 = 1156. Solve p - n = -5p for p. 1 Let l(d) = d*3 + 3d*2 - 7d - 9. Let w be l(-4). Let x(i) = 14i - 29. Let q be x(w). Solve 4g - 7 = q for g. 5 Let v(g) = -g + 14. Let w be v(11). Let c = -7 + 11. Let u be ((-144)/c)/(-4) + -1. Solve wt + u = t for t. -4 Let l(o) = 2o - 6. Suppose 8 - 2 = 2s. Let k be l(s). Solve 5f - 5 + 30 = k for f. -5 Let t be (-1840)/50(-35)/14. Solve -6r + 86 = t for r. -1 Suppose 0 = 9q - 11q - 6. Let n(g) = -g*2 + 9. Let i be n(q). Solve i - 4 = -x for x. 4 Suppose -2l + w = -61, 5w = 15l - 10l - 165. Solve -l + 26 = -h for h. 2 Let y(h) = -h3 + 3h*2 + 1. Let m be y(2). Suppose -mz = 0, -z - 5 - 1 = -3n. Suppose -2s = -s. Solve -np + 4p = s for p. 0 Suppose -15n - 32 = -3c - 11n, -5c = -n - 25. Solve 0 = 9g - 7g - c for g. 2 Let q(h) = -h. Let t be q(-2). Let l(w) = -w - 2w + 2w + 11 + tw. Let m be l(-8). Solve mx = -x for x. 0 Suppose -8l + 5u + 105 = -4l, 3l + 5u - 70 = 0. Solve 40y - 75 = ly for y. 5 Suppose 7 = -r + 27. Suppose -20 = b - 6b - 5k, -5b = -4k - r. Let w be (-1 - -4)7/3. Solve -3a - b = -wa for a. 1 Suppose 3r + 5j = -0j + 26, -5j + 12 = r. Let i(w) = w*3 - 5w**2. Let d be i(5). Let o be 6/(-1 + d + 3)	{ "pile_set_name": "DM Mathematics" }
= -0q, -5f + 35 = -q. Calculate the lowest common multiple of 22 and f. 66 Let w = 353 + -14119/40. Find the common denominator of w and -27/40. 40 Let d(w) = 4w + 1. Let c be d(2). Let r = -16 + 31. Suppose -2k + r = -c. Calculate the lowest common multiple of 14 and k. 84 Let u = 176 - 106. What is the common denominator of 85/22 and (-15)/(-8)u/(-7)? 44 Let z be 1 - (-1 - 3494/10). Let s = z + -27927/80. Let n = -1/1498 - 35572/8239. Find the common denominator of n and s. 176 Let f = 25 - 11. Calculate the lowest common multiple of 16 and f. 112 Let j = -7115/1722 - -25/123. What is the common denominator of j and -49/16? 112 Let t be 2593/9 + 14/(-63). Let l = t + -287. Let s = 8/33 - 2275/264. Calculate the common denominator of l and s. 72 Let y be ((-547)/32)/((-3)/954). Let h = y - 5438. What is the common denominator of 3/8 and h? 16 Let v(k) = -k3 - k2 - 2k. Let n(h) = -h - 4. Let p be n(-2). What is the lowest common multiple of v(p) and 2? 8 What is the common denominator of (58 - 5)/(3 + -19 - 2) and (-4563)/1008 + (-2)/7? 144 Suppose -c + t = -9, 4c - 7c + 2t + 30 = 0. Let w be ((-8)/c)/(4/18). Calculate the common denominator of 97/6 and (3/(-12))/(w/(-166)). 6 Suppose -z - 2 = -5. Calculate the lowest common multiple of z and 18. 18 Let b = 92 + -84. Let h = -7 + 27. Calculate the smallest common multiple of h and b. 40 Suppose -125 = -q - 394. Let d = q + 833/3. What is the common denominator of 11/5 and d? 15 Let h = -14315/8 - -1781. Find the common denominator of (-2 - (-492)/32)(-2)/(-5) and h. 40 Let l = 172255/18 - 9578. Calculate the common denominator of (118/(-3))/((-16)/12) and l. 18 Find the common denominator of ((-7)/35)/((-12)/(-85)) and -125/24. 24 Let r = 299/21 - 32/3. Find the common denominator of r and 2/7 - (-753)/231. 77 Suppose -3l + 7 = -5l + 3o, o = -5l - 9. Calculate the common denominator of (-1)/l32/(-7) and 46/9. 63 Let o = 82/5 - 13. Calculate the common denominator of 44/49 and o. 245 Let l(b) = -b - 65214. Let y be l(0). Let m = 259133/4 + y. Let z = -425 - m. Find the common denominator of z and -43. 4 Let b = 29 + -9. Let j = -24 + 28. What is the least common multiple of j and b? 20 Suppose k - 5 - 5 = 0. What is the smallest common multiple of 4 and k? 20 Let v be (35 + -3)/((-22)/276). Let c = v - -401. Calculate the common denominator of (290/(-14))/((-12)/(-14)) and c. 66 Suppose 0 = -2q - 2f + 12, 4f = 7q - 3q. Calculate the smallest common multiple of q and -2 - (-1 + 0) - -11. 30 Suppose -4q + 8 = -0q. Suppose 32 = -0j + qj. Find the common denominator of -83/12 and 6/j50/6. 24 Suppose -3v - 2u + 6u + 34 = 0, -5v - 5u = -80. What is the lowest common multiple of (-2 - -2)/1 + (10 - -2) and v? 84 Let u = 9 + -5. Let x = 19 + -17. What is the lowest common multiple of x and u? 4 Calculate the common denominator of 58/5 and 940/1675 + 33/15 + -2. 335 Suppose 0i + s + 55 = -i, -s - 155 = 3i. Calculate the common denominator of -39 and 30/i + (-388)/(-30). 3 Let c be (-4528)/10 - (-2)/(-10). Suppose -2h - 2 = -h. Calculate the common denominator of 2 + h + c/18 and 31/20. 60 Let q(y) = -y3 - 5y*2 - y - 6. Let c be q(-5). What is the smallest common multiple of 7 and 4 + 8 + 3/c? 63 Let v = -18997/6 + 3148. Let j(f) = -3f*2 + 7f - 5. Let i be j(-7). Find the common denominator of 2/(-4)i/(-18) and v. 12 Let k = -5 + 5. Suppose i + k = 2. Suppose 14 = 2m + i. Calculate the smallest common multiple of m and 11. 66 Suppose 5l - 75 = 5s, -2l + 3s - 32 = -6l. Suppose -2k - 3 = p, 2k + l + 2 = p. Calculate the least common multiple of 10 and p. 10 Suppose -19 = -3r + 2v, -1 - 3 = -v. What is the smallest common multiple of r and 18? 18 Suppose m - 2w = -1 - 3, 5m - 2w + 12 = 0. Calculate the common denominator of 7/18 and (9/(-28))/(m/(-4)). 126 Suppose j = -3j + 16. Suppose jb - 124 = 3a, -7b + 2b = -2a - 148. What is the common denominator of 10/9 and (-21)/((-36)/b)? 9 Let s = -209/28350 - -2/2835. Let v = -97/450 + s. Find the common denominator of v and -61/2. 18 Suppose 4x = r + 40, r + 35 = 3x - r. Let i(p) be the third derivative of 2p*5/15 - 2p*2. What is the lowest common multiple of i(-1) and x? 72 Suppose -3 - 5 = -y. Suppose g - 2 + 15 = 4f, f + 4g = -1. Calculate the lowest common multiple of y and f. 24 Let m(s) = -20s3 - s2 + 1. What is the lowest common multiple of 8 and m(-1)? 40 What is the common denominator of (1/2)/(1/22) and (296/3)/(-4) + 1? 3 Suppose 3o - 5 = 13. Let s(h) = -36h + 16. Let m(z) = -7z + 3. Let a(v) = -16m(v) + 3s(v). Calculate the lowest common multiple of o and a(4). 48 Calculate the common denominator of 137/12 and 1442/(-231)3/4. 132 Suppose 19 = 2u + u - 2b, 2u + 5b = 38. What is the smallest common multiple of u and 11? 99 Suppose t = -t + 16. Suppose 5y - 48 = y. Calculate the least common multiple of -1(t + -2)-2 and y. 12 Let y = -3820/7 - -549. Find the common denominator of y and (5/(-6))/(2/(-66)). 14 Let j(m) = -m + 3. Let d be j(6). What is the smallest common multiple of (9/d)/((-6)/20) and 3? 30 Calculate the common denominator of ((-67)/(-3))/(8/(-6)) and 5/12. 12 Let a be (0 - -3) + 4 + 15. Suppose -2m + 16 = 5o - 4m, 3m = -4o + a. Let j = -16 - -22. Calculate the least common multiple of j and o. 12 Let c(h) = -h3 + h2 + h + 12. Let z(x) = -x + 6. Let w(g) = -g*2 - 5g. Let o be w(-5). What is the smallest common multiple of c(0) and z(o)? 12 Calculate the lowest common multiple of 63 and (18/(-21))/(7/(-147)). 126 Let t be 21(0 - -17). Suppose 3h + 3 = 4i, 0i + i + 4h + 23 = 0. Find the common denominator of 71/2 and (i/(-8))/((-3)/t). 4 What is the common denominator of 59/20 - 33/55 and -47/6? 60 Suppose 2o = -0o - 6. Let l = -1012 - -3977/4. Calculate the common denominator of 6/o(-60)/21 and l. 28 Suppose 0g + 14 = 2g. Let d be 0(1/3)/(-1). Suppose 10 + d = 5w. What is the least common multiple of w and g? 14 Let v(l) = 5l*2 - l. Calculate the lowest common multiple of v(-1) and 2/6 - (-295)/15. 60 Let v be (-2)/(-3)63/6. Let w = 11 - v. Calculate the common denominator of 4/10 - (-15)/w and -57/8. 40 Suppose -28 = -k + 4i, 5i = 5k + 3i - 68. Calculate the least common multiple of 4 and k. 12 Let y be -1(-2)/452. Suppose -y + 2 = -2n. Let t(o) = -o + 13. Calculate the smallest common multiple of t(-9) and n. 132 Let a = -9887/651 + 9/434. Find the common denominator of a and -49/3. 6 Calculate the common denominator of -39/7 and (10/(-21) - -1)(-144)/(-16). 7 Let z(y) = y*3 + 7y*2 - 2y - 9. Let n be z(-7). Suppose -ni = -58 - 22. Calculate the least common multiple of 18 and i. 144 Calculate the lowest common multiple of 22 and 6/(-13/(-8)). 176 What is the common denominator of 33/16 and (-42)/(-980)(-7)/(-2)? 80 Let o be (-7 + 4)/(6/(-4)). What is the common denominator of (-9)/(-3)-1 - 348/(-88) and 2 + (-102)/40 + o? 220 Let r = -4/1221 - -89173/12210. Let g(u) = 22u2 - 3u - 5. Let h be g(-2). Calculate the common denominator of (h/3)/(16/(-3)) and r. 80 Let f(p) = -2p2 + 2 - 7 - 3p*2 + 4p*2 - 6p. What is the smallest common multiple of 9 and f(-4)? 9 Suppose -4j = -2y - 3378, y - 2j + 1689 = 2j. Let m = -10087/6 - y. Calculate the common denominator of 29/8 and m. 24 Let t(g) = -g*3 + 4g*2 + 4g + 7. Let f = 32 + -22. Suppose 0 = -w - 9 + f. What is the least common multiple of t(5) and w? 2 Let m be -21(5 + -1). Find the common denominator of -51/8 and 2/(-8)(-324)/m. 8 Calculate the common denominator of (2/(-5))/(32/(-2680)) and ((-200)/(-35))/(-1) - 2. 14 Let f = -4 + 39. Calculate the smallest common multiple of 7/f + 24/5 and 5. 5 Let u(q) = -17q*2 + 3. Let i be u(3). Find the common denominator of ((-57)/12)/(18/84) and 2 - 4 - i/44. 66 Let d = 266 + -787/3. What is the common denominator of -44/21 and d? 21 Let a be (-13)/(-3) + (-12)/(-18). Suppose -3t = 5z + 1104 - 3669, z - 3t = 531. Calculate the common denominator of z/(-40) - (-2)/a and -67/4. 4 Suppose -y + 12 = -4y. Let z be (y/1)/(-2) + -3. Let h = z + 17. What is the least common multiple of 22 and h? 176 Let x = -67 + 95. What is the least common multiple of 4 and x? 28 Let h(y) = y2 - 2y - 6. W	{ "pile_set_name": "DM Mathematics" }
n -14, -71, -220, -503, -962? -1639 What comes next: -135218, -135217, -135216, -135215, -135214, -135213? -135212 What is the next term in -7352, -14720, -22088? -29456 What is the next term in 1069, 2141, 3213, 4285, 5357, 6429? 7501 What is next in 144, 173, 202, 231, 260, 289? 318 What comes next: 836, 781, 674, 503, 256, -79, -514? -1061 What is next in 891, 3543, 7955, 14127, 22059? 31751 What is the next term in 331, 504, 677, 850, 1023, 1196? 1369 What is the next term in -1078995, -1078996, -1078997, -1078998, -1078999? -1079000 What is the next term in 12, 155, 540, 1293, 2540, 4407, 7020? 10505 What is next in 25983, 25994, 26017, 26052, 26099? 26158 What comes next: -375, -1211, -2593, -4515, -6971, -9955? -13461 What is next in -16428, -16443, -16472, -16521, -16596, -16703? -16848 What is next in 398, 281, 94, -157, -466? -827 What is the next term in -3755, -3782, -3825, -3884, -3959, -4050? -4157 What is the next term in -1170, -4495, -9974, -17607, -27394, -39335, -53430? -69679 What is next in 666, 2589, 5782, 10239, 15954, 22921, 31134, 40587? 51274 What comes next: -2433, -3721, -5009, -6297, -7585? -8873 What is next in -1042, -1138, -1238, -1342, -1450, -1562? -1678 What is next in 159, 775, 1815, 3291, 5215, 7599, 10455? 13795 What is next in 22630, 45258, 67886, 90514? 113142 What comes next: 10, -14, -28, -26, -2, 50, 136? 262 What is the next term in -2284, -2230, -2176, -2122, -2068, -2014? -1960 What is the next term in -138, -266, -394, -522, -650? -778 What is next in -6762, -27131, -61104, -108681, -169862? -244647 What comes next: -617, -2519, -5697, -10157, -15905, -22947, -31289? -40937 What comes next: 478, 495, 512, 529, 546? 563 What is the next term in 8794, 17577, 26362, 35149, 43938? 52729 What comes next: -173804, -347608, -521412, -695216, -869020? -1042824 What is the next term in 419, 823, 1211, 1583, 1939, 2279? 2603 What is the next term in -77, -122, -133, -110, -53, 38? 163 What is next in 210, 748, 2202, 5028, 9682? 16620 What comes next: -907, -888, -845, -766, -639, -452? -193 What is the next term in 370, 1326, 2866, 4990, 7698, 10990, 14866? 19326 What comes next: -403, -1749, -4033, -7249, -11391? -16453 What is the next term in 171, -39, -249, -459, -669, -879? -1089 What is next in -1, 53, 225, 575, 1163, 2049, 3293? 4955 What is the next term in -2005, -4111, -6219, -8329, -10441, -12555, -14671? -16789 What is the next term in 959, 1079, 1199, 1319, 1439? 1559 What is next in 3302, 26431, 89200, 211427, 412930, 713527, 1133036? 1691275 What is next in -354, -114, 126, 366, 606, 846? 1086 What is next in 126, 515, 1162, 2067, 3230, 4651, 6330? 8267 What is the next term in 2975, 2965, 2957, 2957, 2971, 3005, 3065, 3157? 3287 What is the next term in 10, 44, 78, 112, 146? 180 What comes next: 79617, 79616, 79615, 79614? 79613 What comes next: 145, -18, -173, -314, -435? -530 What comes next: -25, 16, 91, 206, 367, 580, 851? 1186 What is the next term in -26435, -52869, -79303, -105737, -132171? -158605 What is next in 557, 1320, 2083, 2846, 3609? 4372 What is the next term in 2507, 10038, 22589, 40160, 62751, 90362, 122993? 160644 What comes next: -20188, -40372, -60556, -80740? -100924 What is the next term in 439, 1157, 2351, 4021? 6167 What is the next term in 14422, 14970, 15520, 16072, 16626? 17182 What is next in -1420074, -2840148, -4260222, -5680296, -7100370? -8520444 What is next in -375, -757, -1139, -1521, -1903, -2285? -2667 What is the next term in 1385088, 2770176, 4155264, 5540352? 6925440 What is the next term in 1498, 1611, 1724, 1837, 1950? 2063 What comes next: -7042, -28171, -63386, -112687, -176074, -253547, -345106? -450751 What is the next term in -7790, -15433, -23076, -30719? -38362 What is the next term in -260, -1173, -2694, -4823, -7560, -10905? -14858 What is next in 64800, 518386, 1749558, 4147110, 8099836, 13996530, 22225986? 33176998 What comes next: 2961, 5902, 8843, 11784, 14725? 17666 What comes next: 102563, 205125, 307687, 410249? 512811 What comes next: -177, -796, -1857, -3384, -5401, -7932, -11001? -14632 What is next in 25, 54, 47, -38, -243, -610, -1181, -1998? -3103 What is the next term in -1734, -1776, -1846, -1944, -2070, -2224, -2406? -2616 What comes next: -383, -735, -1061, -1361, -1635? -1883 What is the next term in -155, -321, -499, -695, -915? -1165 What is the next term in 475473, 475474, 475475, 475476, 475477? 475478 What is the next term in 2249247, 2249248, 2249249, 2249250, 2249251, 2249252? 2249253 What is next in -2437, -3264, -4091, -4918? -5745 What is next in 787, 1494, 2201, 2908, 3615, 4322? 5029 What comes next: -353, -598, -845, -1094, -1345? -1598 What comes next: -450, -876, -1560, -2496, -3678, -5100? -6756 What is next in -182, -380, -578, -776, -974? -1172 What is next in -25, -116, -385, -922, -1817, -3160, -5041, -7550? -10777 What comes next: 53, 284, 689, 1268, 2021, 2948? 4049 What comes next: -5212, -5220, -5228? -5236 What is next in -17394, -17393, -17392? -17391 What comes next: -50322, -50317, -50300, -50265, -50206? -50117 What is next in 1691, 3445, 5199, 6953, 8707? 10461 What comes next: -48, -362, -1192, -2796, -5432, -9358? -14832 What comes next: 35, -269, -1223, -3151, -6377, -11225? -18019 What comes next: 142, 93, 14, -95, -234, -403, -602? -831 What is the next term in 865, 790, 703, 598, 469, 310, 115, -122? -407 What is next in -1976748, -1976747, -1976746, -1976745? -1976744 What is the next term in -23494, -23462, -23418, -23356, -23270, -23154? -23002 What is next in -8536, -8557, -8578? -8599 What comes next: -101, -385, -859, -1523, -2377, -3421? -4655 What is next in -6570, -6379, -6058, -5601, -5002? -4255 What is next in -103, -943, -3361, -8191, -16267, -28423, -45493? -68311 What is next in -33, -160, -389, -720, -1153, -1688, -2325? -3064 What comes next: -7160, -14323, -21486, -28649, -35812? -42975 What is the next term in 19010, 19008, 19006, 19004, 19002? 19000 What comes next: -976, -1949, -2920, -3889, -4856, -5821, -6784? -7745 What is next in -3240, -3233, -3224, -3213, -3200, -3185? -3168 What comes next: 4199, 8395, 12591, 16787? 20983 What is next in -7950, -16224, -24498, -32772, -41046, -49320? -57594 What is next in -91, -179, -423, -907, -1715? -2931 What is the next term in 29, 80, 165, 290, 461, 684, 965, 1310? 1725 What comes next: 127, 289, 461, 643, 835, 1037? 1249 What is next in -7564, -15145, -22726, -30307? -37888 What comes next: 1932, 2350, 2764, 3174, 3580? 3982 What is next in 491, 979, 1469, 1961, 2455, 2951? 3449 What is the next term in 2323, 4657, 7013, 9403, 11839, 14333, 16897, 19543? 22283 What is the next term in 13, -84, -333, -806, -1575, -2712? -4289 What comes next: -38153, -76290, -114405, -152486, -190521, -228498, -266405? -304230 What is the next term in 50027, 50023, 50015, 50003? 49987 What is next in -837, -1206, -1837, -2736, -3909, -5362, -7101, -9132? -11461 What comes next: -23012, -23027, -23052, -23093, -23156, -23247? -23372 What comes next: 14312, 14310, 14298, 14270, 14220, 14142, 14030? 13878 What is next in 56744, 113489, 170234, 226979? 283724 What is next in 23171, 92691, 208557, 370769, 579327, 834231? 1135481 What is next in -69, -169, -275, -387, -505? -629 What is the next term in -77, -149, -197, -209, -173? -77 What is next in -411, -383, -343, -297, -251, -211, -183, -173? -187 What comes next: 5887, 11770, 17653, 23536, 29419? 35302 What is the next term in -346, -296, -246? -196 What is next in 13391, 26773, 40159, 53549, 66943? 80341 What is next in -48245, -192948, -434105, -771704, -1205733, -1736180, -2363033? -3086280 What is the next term in -11141, -11132, -11101, -11036, -10925, -10756, -10517, -10196? -9781 What comes next: 351, 404, 537, 786, 1187, 1776, 2589, 3662? 5031 What comes next: 7058, 6928, 6704, 6380, 5950? 5408 What comes next: -420, -807, -1214, -1653, -2136? -2675 What is the next term in 1433, 5809, 13121, 23363, 36529, 52613, 71609, 93511? 118313 What comes next: 1708016, 1708015, 1708014, 1708013, 1708012? 1708011 What is next in -467040, -467041, -467042, -467043, -467044, -467045? -467046 What comes next: -3334, -13433, -30266, -53833, -84134, -121169? -164938 What comes next: -74,	{ "pile_set_name": "DM Mathematics" }
d by -9. 2 What is -99 divided by 3? -33 Calculate -122 divided by -122. 1 Calculate 3280 divided by 328. 10 220 divided by 44 5 380 divided by -4 -95 What is 392 divided by 4? 98 Divide 458 by 2. 229 45 divided by -75 -3/5 -4719 divided by 143 -33 What is 2 divided by -17? -2/17 What is -420 divided by -140? 3 350 divided by -14 -25 What is 12 divided by -44? -3/11 Divide -966 by 6. -161 What is 1572 divided by -12? -131 Calculate -154 divided by -22. 7 528 divided by -22 -24 7 divided by -402 -7/402 -915 divided by -61 15 1242 divided by -6 -207 Calculate -18372 divided by -4593. 4 What is -243 divided by -5? 243/5 Calculate 1 divided by 121. 1/121 Divide -5 by 186. -5/186 Calculate -1152 divided by -6. 192 -1725 divided by 75 -23 69 divided by -4 -69/4 What is -4508 divided by 4508? -1 Divide -93 by -31. 3 Divide -20 by -122. 10/61 -396 divided by -6 66 -2011 divided by -4 2011/4 What is 4 divided by -407? -4/407 Divide 539 by -3. -539/3 1276 divided by -2 -638 Calculate -14272 divided by 223. -64 Calculate 21 divided by 67. 21/67 -7194 divided by 327 -22 What is -3 divided by 1039? -3/1039 166 divided by 83 2 What is 0 divided by -838? 0 Calculate 2 divided by -4941. -2/4941 Calculate 9 divided by -48. -3/16 Calculate 5 divided by -154. -5/154 What is -148 divided by 2? -74 -5 divided by -302 5/302 Calculate -6152 divided by -3076. 2 What is -222 divided by 111? -2 Divide -220 by -26. 110/13 What is 5747 divided by 821? 7 Calculate -258 divided by 3. -86 Calculate 2 divided by 42. 1/21 -40 divided by -39 40/39 2 divided by -20 -1/10 What is 42 divided by 2? 21 Divide -13448 by -5. 13448/5 Divide 3990 by -57. -70 Calculate 750 divided by -75. -10 Divide 81 by 6. 27/2 244 divided by 61 4 Divide 28 by 4. 7 Calculate -1052 divided by -263. 4 What is -154 divided by 11? -14 Calculate 250 divided by -50. -5 Divide -4122 by 9. -458 Divide 315 by -15. -21 What is -1345 divided by 269? -5 Divide 0 by -5989. 0 What is 5 divided by -32? -5/32 -604 divided by -302 2 -5667 divided by 3 -1889 What is 2744 divided by -3? -2744/3 What is 4 divided by 4? 1 Divide -1 by -3441. 1/3441 Divide 13 by 15. 13/15 What is 5 divided by -171? -5/171 What is 0 divided by -14? 0 Calculate 184 divided by -6. -92/3 -566 divided by -6 283/3 What is -6865 divided by -5? 1373 Divide -176 by -2. 88 What is 0 divided by 556? 0 Calculate -2 divided by 803. -2/803 Divide 596 by -4. -149 What is -83 divided by -3? 83/3 What is -3708 divided by 4? -927 1788 divided by -4 -447 34636 divided by 4 8659 435 divided by -1 -435 Divide -2020 by -5. 404 Calculate -11304 divided by -3768. 3 -64 divided by 8 -8 Divide 13 by 4. 13/4 What is 7132 divided by -1783? -4 What is 7 divided by -22? -7/22 -216 divided by 1 -216 Calculate 140 divided by -4. -35 Divide 234 by 5. 234/5 What is 13 divided by 8? 13/8 245 divided by 12 245/12 Divide -272 by -4. 68 -1215 divided by -15 81 Calculate 80 divided by 16. 5 Divide -1 by 54. -1/54 What is 38 divided by 38? 1 876 divided by -15 -292/5 Divide -6 by 3. -2 67 divided by -49 -67/49 What is 5 divided by 9? 5/9 Calculate 126 divided by -9. -14 Calculate 2 divided by 33. 2/33 Calculate -2 divided by -23. 2/23 Divide 3570 by -51. -70 What is 10060 divided by 5? 2012 Divide 1449 by 3. 483 84 divided by 1 84 Divide -284 by -89. 284/89 What is 53 divided by -35? -53/35 Calculate 648 divided by -216. -3 -20 divided by 12 -5/3 Calculate 1870 divided by 5. 374 What is -2 divided by 2649? -2/2649 Divide 947 by 1. 947 28 divided by 6 14/3 What is -2 divided by 20? -1/10 Calculate -931 divided by -5. 931/5 Calculate -6970 divided by -34. 205 Calculate -4 divided by -43. 4/43 -15 divided by 515 -3/103 Divide 112 by -32. -7/2 -244 divided by 2 -122 10 divided by -896 -5/448 Divide -9130 by -1826. 5 What is 1 divided by -97? -1/97 What is -195 divided by 3? -65 Divide 3 by 173. 3/173 Calculate 196 divided by -4. -49 Calculate 294 divided by -98. -3 -1701 divided by 3 -567 2984 divided by 1 2984 What is 15850 divided by -3170? -5 2316 divided by -579 -4 What is -2 divided by -1288? 1/644 Divide -4 by -97. 4/97 -392 divided by -98 4 Calculate 3716 divided by -5. -3716/5 What is -847 divided by 7? -121 What is -12 divided by 168? -1/14 Calculate 909 divided by -303. -3 Calculate 4522 divided by 119. 38 Divide -2246 by 2. -1123 Calculate 32064 divided by -2004. -16 Calculate -10 divided by 5. -2 What is 156 divided by -78? -2 Calculate -1326 divided by -26. 51 What is 159 divided by -53? -3 Calculate 0 divided by -236. 0 14 divided by -14 -1 Divide 5524 by -4. -1381 Calculate -5 divided by -294. 5/294 Calculate -22326 divided by 122. -183 -154 divided by 7 -22 Calculate -5 divided by 48. -5/48 Divide -25 by 400. -1/16 Calculate 2916 divided by 243. 12 What is -22376 divided by 8? -2797 Divide -2 by 39. -2/39 1860 divided by 2 930 Calculate 14168 divided by -5. -14168/5 Calculate -845 divided by 28. -845/28 What is -684 divided by 5? -684/5 294 divided by 2 147 Calculate 650 divided by 130. 5 -11 divided by 475 -11/475 Calculate 1005 divided by -201. -5 -578 divided by 5 -578/5 What is 227 divided by 3? 227/3 Divide 39 by 14. 39/14 What is 4484 divided by -2? -2242 Calculate 1 divided by -73. -1/73 -943 divided by -1 943 2735 divided by -3 -2735/3 19 divided by 20 19/20 320 divided by -64 -5 2 divided by 653 2/653 What is 23 divided by 11? 23/11 14124 divided by 1 14124 Calculate -40 divided by -20. 2 What is 1012 divided by -506? -2 What is 1927 divided by -8? -1927/8 Calculate 2 divided by 271. 2/271 Calculate -12 divided by 10. -6/5 What is -4 divided by -1039? 4/1039 276 divided by -46 -6 What is 1519 divided by -8? -1519/8 Calculate -47 divided by -11. 47/11 Calculate 888 divided by 8. 111 Calculate 95 divided by -19. -5 Divide 640 by -128. -5 Calculate 3 divided by 1. 3 Calculate 88 divided by 8. 11 What is -348 divided by 2? -174 Calculate 1 divided by 282. 1/282 What is -540 divided by -6? 90 Divide -16 by -145. 16/145 -6 divided by 1978 -3/989 Divide 218 by -109. -2 Calculate -181 divided by 7. -181/7 Divide -6533 by -3. 6533/3 Calculate -259 divided by 4. -259/4 Calculate -307 divided by -6. 307/6 Calculate 888 divided by -296. -3 Divide -1294 by -4. 647/2 Calculate 4993 divided by -1. -4993 Divide 3 by -113. -3/113 Calculate -391 divided by 391. -1 Calculate 896 divided by 2. 448 -18984 divided by -6 3164 Divide 135 by 19. 135/19 What is -786 divided by -6? 131 2744 divided by 3 2744/3 Calculate 1332 divided by -18. -74 What is 4 divided by 22? 2/11 -1043 divided by -7 149 132 divided by 12 11 Divide -527 by 30. -527/30 4 divided by -2327 -4/2327 What is -14535 divided by 15? -969 Divide 3980 by 4. 995 Divide 4024 by 4. 1006 Calculate 0 divided by 4335. 0 186 divided by 186 1 Divide 8384 by -8. -1048 376 divided by -2 -188 What is 62 divided by 1? 62 230 divided by 5 46 -8 divided by -23 8/23 Divide 8 by 54. 4/27 Divide -2916 by -6. 486 What is 26 divided by -202? -13/101 Calculate 34 divided by -62. -17/31 What is 85 divided by 5? 17 What is 5460 divided by 130? 42 Calculate -8 divided by 6. -4/3 158 divided by 21 158/21 What is 2755 divided by -551? -5 36 divided by 9 4 Divide 74 by 32. 37/16 -6 divided by 886 -3/443 What is 5 divided by -446? -5/446 Divide 1209 by 1. 1209 Divide 6 by 41. 6/41 Divide -7 by -324. 7/324 What is -224 divided by 32? -7 What is 1410 divided by 141? 10 Calculate 793 divided by 61. 13 Calculate 66 divided by 19. 66/19 Calculate 1428 divided by -238. -6 9596 divided by -2399 -4 Divide -80 by 20. -4 Calculate 9618 divided by -1603. -6 Calculate -16719 divided by -5. 16719/5 Divide 40 by -20. -2 11 divided by -1 -11 What is 0 divided by -12? 0 -47410 divided by 5 -9482 5900 divided by 295 20 Divide -608 by 19. -32 3 divided by 18 1/6 Calculate -3944 divided by -986. 4 Divide -38 by -6. 19/3 What is 381 divided by 6? 127/2 Divide 1069 by -1. -1069 Divide 81 by 50. 81/50 What is -174 divided by -2? 87 What is 4 divided by 2? 2 What is 1236 divided by -5? -1236/5 What is 9748 divided by 4874? 2 Calculate -288 divided by -22. 144/11 What is 138 divided by 1? 138 -2719 divided by 1 -2719 Divide -12487 by -3. 12487/3 Divide -792 by -6. 132 -918 divided by -18 51 -54 divided by 18 -3 -755 divided by -5 151 Divide 3333 by -3. -1111 Calcu	{ "pile_set_name": "DM Mathematics" }
0 What is the least common multiple of 7564 and 1884614? 229922908 Calculate the common denominator of 28/5457 and -67/2219073. 37724241 Calculate the smallest common multiple of 1640058 and 1020. 16400580 Calculate the smallest common multiple of 14 and 3901114. 3901114 What is the lowest common multiple of 560490 and 7850? 2802450 Calculate the common denominator of 113/18438192 and -23/729. 165943728 Calculate the lowest common multiple of 690 and 1747218. 8736090 What is the common denominator of -109/112 and 197/64003380? 256013520 Calculate the smallest common multiple of 18454740 and 6220. 18454740 What is the common denominator of 64/351 and 5/22577? 7924527 What is the lowest common multiple of 41816112 and 304? 41816112 Calculate the common denominator of 129/912730 and 117/170510. 15516410 Calculate the least common multiple of 46980 and 465. 1456380 What is the common denominator of 67/42 and 23/670803? 1341606 Calculate the smallest common multiple of 900 and 565490. 50894100 Calculate the lowest common multiple of 6631962 and 66. 72951582 What is the least common multiple of 48824 and 318792? 5419464 Calculate the lowest common multiple of 323476 and 20587. 391729436 What is the smallest common multiple of 756952 and 4410? 34062840 Calculate the lowest common multiple of 570 and 1221612. 116053140 Calculate the least common multiple of 38940 and 757560. 8333160 Calculate the common denominator of -13/953856 and -85/29808. 953856 Find the common denominator of 79/9600 and -97/3706800. 29654400 Calculate the least common multiple of 1776432 and 1176. 12435024 Calculate the common denominator of -149/1164 and -50/22047033. 88188132 Calculate the common denominator of -37/5733640 and 53/73040. 11467280 Calculate the least common multiple of 78967395 and 260. 315869580 Calculate the common denominator of 59/405820 and -25/4728. 2434920 Calculate the common denominator of 16/29505 and -38/5285. 4455255 Calculate the common denominator of 71/81936351 and 25/255328. 2621963232 What is the least common multiple of 12279952 and 6? 36839856 Calculate the least common multiple of 12546 and 8317998. 8317998 What is the least common multiple of 180551995 and 1? 180551995 Calculate the lowest common multiple of 372064 and 89551. 432710432 What is the common denominator of 19/15608 and 169/222960? 434994960 Calculate the common denominator of -83/474576 and 179/360. 7118640 Calculate the common denominator of 23/123210531 and 4/41499. 123210531 Calculate the least common multiple of 2304027 and 25065021. 827145693 Calculate the common denominator of 99/18844 and -43/7820260. 7820260 Find the common denominator of -73/104370 and 133/1704. 417480 Find the common denominator of 41/144 and -113/896840. 16143120 Find the common denominator of 11/13419525 and -70/3. 13419525 Calculate the lowest common multiple of 12 and 30379669. 364556028 Calculate the smallest common multiple of 5539500 and 27143550. 271435500 What is the common denominator of -55/34428 and -9/324046? 36941244 Calculate the least common multiple of 23534200 and 6. 70602600 What is the lowest common multiple of 182307 and 626737? 125974137 Find the common denominator of 109/120250 and -49/14040. 12987000 Calculate the common denominator of -36/3591229 and 57/30826. 7182458 Find the common denominator of 67/60310 and -143/17152164. 85760820 What is the least common multiple of 103542542 and 12? 621255252 Calculate the lowest common multiple of 580634 and 18. 5225706 What is the lowest common multiple of 4212 and 154251? 24063156 Calculate the least common multiple of 4449603 and 5152. 996711072 What is the common denominator of 67/518 and -52/49501? 25641518 What is the common denominator of -89/49189182 and 68/63117? 147567546 Calculate the lowest common multiple of 18 and 16162526. 145462734 Calculate the common denominator of -19/6048 and -115/5992112. 323574048 Calculate the common denominator of -37/21588 and 133/124704624. 872932368 Calculate the smallest common multiple of 2387 and 2766082. 600239794 Calculate the common denominator of -103/4704280 and 11/14112840. 14112840 Calculate the lowest common multiple of 12 and 160203602. 961221612 What is the smallest common multiple of 1331820 and 55566? 83904660 Find the common denominator of -121/226104 and 143/1073994. 4295976 What is the common denominator of -47/1087936 and 59/6799600? 27198400 What is the lowest common multiple of 12456552 and 774136? 137022072 What is the lowest common multiple of 205380 and 1026085? 258573420 Find the common denominator of 97/42 and -58/258077211. 516154422 Find the common denominator of -5/4953091 and -129/5720. 198123640 What is the common denominator of 53/486903 and 53/808527? 88129443 Calculate the lowest common multiple of 1718265 and 34. 58421010 What is the smallest common multiple of 69810 and 1298? 45306690 What is the lowest common multiple of 1031700 and 1800? 6190200 Calculate the common denominator of 173/255414240 and -127/576. 510828480 Calculate the common denominator of -31/206475 and 139/2550. 7020150 Calculate the common denominator of 37/7971036 and -41/18. 23913108 What is the least common multiple of 52667160 and 5194? 52667160 Calculate the common denominator of 19/156644 and -65/532. 20833652 What is the smallest common multiple of 3758958 and 693? 41348538 Calculate the lowest common multiple of 7326 and 1364. 454212 Find the common denominator of 7/668896 and -8/2863711. 91638752 Find the common denominator of 76/1903095 and -64/92583. 17127855 Find the common denominator of 1/1022100 and -49/48900. 166602300 What is the least common multiple of 35068 and 2045102? 44992244 What is the common denominator of 31/10200170 and 93/10833284? 1570826180 What is the least common multiple of 98423166 and 82019305? 492115830 What is the smallest common multiple of 81144 and 1876? 5436648 Find the common denominator of -41/40749 and -131/1693880. 86387880 What is the common denominator of -37/71533 and 167/3696? 3433584 Calculate the smallest common multiple of 3508 and 455084. 399108668 Calculate the least common multiple of 20657962 and 13. 20657962 What is the least common multiple of 3177848 and 119968? 292362016 What is the common denominator of -173/2463150 and -33/476209? 71431350 Calculate the smallest common multiple of 33088 and 300800. 3308800 Calculate the common denominator of -59/251913 and 8/114739. 45092427 What is the common denominator of 3/2576 and 1/807024? 5649168 What is the smallest common multiple of 1611902010 and 3? 1611902010 What is the smallest common multiple of 121298355 and 1642995? 3517652295 Find the common denominator of -71/621000 and 151/69000. 621000 What is the least common multiple of 96138 and 504? 384552 What is the lowest common multiple of 8 and 5491983? 43935864 What is the lowest common multiple of 28905 and 243294? 57174090 Calculate the smallest common multiple of 2434 and 173518. 211171406 Calculate the common denominator of -43/29984 and -83/2540. 19039840 Find the common denominator of -59/6728056 and 5/7569063. 60552504 What is the lowest common multiple of 140044 and 1884? 420132 Calculate the common denominator of -109/274824 and -151/68706. 274824 What is the smallest common multiple of 274050 and 75600? 2192400 What is the common denominator of -43/34858 and -67/136416? 81986016 Calculate the least common multiple of 3213504 and 126. 3213504 What is the common denominator of 22/440657 and 181/966? 2643942 What is the smallest common multiple of 1881 and 14425560? 158681160 What is the least common multiple of 948129 and 206115? 4740645 Calculate the common denominator of -7/7764132 and -173/84. 54348924 Calculate the common denominator of 111/64553410 and -1/161115. 193660230 Calculate the least common multiple of 533022 and 245. 2665110 What is the lowest common multiple of 22 and 175024658? 1925271238 Calculate the least common multiple of 9259140 and 280580. 9259140 What is the common denominator of -17/1804650 and -4/15700455? 157004550 What is the common denominator of -129/4459040 and -79/12400? 22295200 Calculate the common denominator of 169/68904 and 89/36848328. 331634952 Calculate the smallest common multi	{ "pile_set_name": "DM Mathematics" }
kxk? 1/28 Calculate prob of sequence sld when three letters picked without replacement from {s: 1, l: 4, b: 2, d: 6}. 2/143 Four letters picked without replacement from {z: 1, d: 2, m: 1, t: 2, u: 1, q: 1}. Give prob of sequence tuzq. 1/840 Two letters picked without replacement from {j: 3, o: 7, q: 3}. Give prob of sequence oo. 7/26 Calculate prob of sequence iga when three letters picked without replacement from iizwgzazizdwz. 1/572 Four letters picked without replacement from ccheewwt. Give prob of sequence cewh. 1/210 What is prob of sequence immz when four letters picked without replacement from zmmiizizii? 1/168 Four letters picked without replacement from {s: 7, c: 5}. Give prob of sequence sssc. 35/396 What is prob of sequence rwr when three letters picked without replacement from rnrwnnaarrarnawnnr? 5/408 What is prob of sequence dodo when four letters picked without replacement from {d: 12, o: 7}? 77/1292 Four letters picked without replacement from llpllwnyznzpnynzp. What is prob of sequence zzlz? 1/2380 Two letters picked without replacement from jqbltttttbtl. Give prob of sequence lj. 1/66 Calculate prob of sequence luuu when four letters picked without replacement from {l: 3, u: 9}. 7/55 What is prob of sequence gg when two letters picked without replacement from iiiiigigi? 1/36 Four letters picked without replacement from hqtzjzt. Give prob of sequence ztqt. 1/210 Three letters picked without replacement from lrrrbharr. What is prob of sequence hlr? 5/504 What is prob of sequence la when two letters picked without replacement from {d: 1, a: 1, i: 1, v: 1, l: 5}? 5/72 Two letters picked without replacement from {k: 10, m: 9}. Give prob of sequence km. 5/19 What is prob of sequence twz when three letters picked without replacement from bwztwbwtbtbb? 3/440 Calculate prob of sequence xh when two letters picked without replacement from vvhxhvvvvhh. 2/55 Two letters picked without replacement from {o: 3, w: 2, f: 1, e: 6, c: 3}. Give prob of sequence ow. 1/35 Four letters picked without replacement from hhdhhdhhhhdhhhhhdhhh. What is prob of sequence dhhd? 8/323 What is prob of sequence ri when two letters picked without replacement from {h: 1, r: 1, y: 3, g: 2, i: 4}? 2/55 What is prob of sequence irq when three letters picked without replacement from {q: 6, y: 1, r: 2, g: 3, i: 2}? 1/91 Two letters picked without replacement from kkpikpppip. Give prob of sequence ii. 1/45 What is prob of sequence wd when two letters picked without replacement from {d: 7, w: 3, t: 4}? 3/26 Two letters picked without replacement from xvvpgxxxvxtcvxpv. What is prob of sequence vx? 1/8 Calculate prob of sequence nfgn when four letters picked without replacement from noffofnogooniofofgnf. 2/1615 Three letters picked without replacement from {g: 4, t: 5, f: 8}. What is prob of sequence ftt? 2/51 Three letters picked without replacement from {e: 11, l: 3, x: 1}. Give prob of sequence xle. 11/910 Two letters picked without replacement from pdnpzzwpnpwnpyppn. Give prob of sequence zw. 1/68 Calculate prob of sequence ccv when three letters picked without replacement from cccv. 1/4 Four letters picked without replacement from hzkpezhprpzr. What is prob of sequence ppkz? 1/660 Three letters picked without replacement from {h: 6, g: 2, z: 3, x: 1, e: 2, c: 1}. What is prob of sequence hxh? 1/91 Two letters picked without replacement from pgppgpgpgg. What is prob of sequence gg? 2/9 Two letters picked without replacement from {r: 4, s: 6, w: 6, y: 3}. Give prob of sequence ry. 2/57 What is prob of sequence vufv when four letters picked without replacement from vvufffvhfv? 1/105 Four letters picked without replacement from {d: 2, q: 4, l: 1, y: 1, v: 2}. Give prob of sequence lvvq. 1/630 What is prob of sequence dj when two letters picked without replacement from {d: 5, j: 5, r: 1}? 5/22 Three letters picked without replacement from {s: 1, b: 4, k: 2}. Give prob of sequence skb. 4/105 Calculate prob of sequence tt when two letters picked without replacement from wwwttww. 1/21 Two letters picked without replacement from effkoufoekone. What is prob of sequence oo? 1/26 Four letters picked without replacement from wwhh. Give prob of sequence wwhh. 1/6 Four letters picked without replacement from oookkkoooooooookoook. Give prob of sequence kooo. 455/3876 Four letters picked without replacement from {x: 4, c: 2, t: 7, s: 5, e: 1, l: 1}. Give prob of sequence ttse. 7/3876 Three letters picked without replacement from cbblcccbbclccb. What is prob of sequence cbb? 5/78 Two letters picked without replacement from {w: 5, d: 1, h: 4, z: 8}. Give prob of sequence hz. 16/153 Calculate prob of sequence ffti when four letters picked without replacement from {f: 2, t: 2, i: 1}. 1/30 Calculate prob of sequence ss when two letters picked without replacement from {a: 3, s: 11}. 55/91 Two letters picked without replacement from {v: 2, l: 4, j: 1, h: 1, m: 10}. Give prob of sequence vl. 4/153 Calculate prob of sequence nhn when three letters picked without replacement from nnnnnnhh. 5/28 Calculate prob of sequence qww when three letters picked without replacement from {w: 5, j: 2, z: 3, q: 9}. 10/323 Three letters picked without replacement from {c: 4, v: 5, t: 4, d: 3}. What is prob of sequence tdt? 3/280 Two letters picked without replacement from ccccccccc. What is prob of sequence cc? 1 What is prob of sequence dqzq when four letters picked without replacement from qqdqqddqzdzqdqq? 2/117 Two letters picked without replacement from opodnon. Give prob of sequence do. 1/14 What is prob of sequence ye when two letters picked without replacement from nyneb? 1/20 Three letters picked without replacement from {f: 2, v: 7, q: 4}. Give prob of sequence fvv. 7/143 Calculate prob of sequence na when two letters picked without replacement from mznmamllalnnuum. 1/35 Calculate prob of sequence hhhh when four letters picked without replacement from {n: 1, v: 6, q: 3, l: 2, h: 5}. 1/476 Calculate prob of sequence xm when two letters picked without replacement from {y: 2, m: 2, k: 1, x: 1, i: 1}. 1/21 Four letters picked without replacement from xixxxxxxxppxi. What is prob of sequence pxix? 12/715 Calculate prob of sequence mcgm when four letters picked without replacement from cccmccmgcccccc. 1/1092 What is prob of sequence rpvw when four letters picked without replacement from {v: 5, r: 2, w: 1, p: 1}? 5/1512 What is prob of sequence fb when two letters picked without replacement from {l: 1, f: 2, v: 13, b: 1}? 1/136 What is prob of sequence dgo when three letters picked without replacement from ddgdoddoood? 4/165 What is prob of sequence ocsq when four letters picked without replacement from {s: 2, c: 4, o: 1, q: 1, a: 9}? 1/7140 What is prob of sequence xttz when four letters picked without replacement from zzxttoototoxootwoow? 5/5814 Calculate prob of sequence qzqq when four letters picked without replacement from zzqzqzqzzzz. 1/165 What is prob of sequence uwu when three letters picked without replacement from uurpppwruwp? 2/165 What is prob of sequence ff when two letters picked without replacement from {f: 3, c: 2, h: 5, n: 1, q: 6}? 3/136 Calculate prob of sequence fdnf when four letters picked without replacement from {x: 6, d: 1, n: 2, f: 2}. 1/1980 Calculate prob of sequence kg when two letters picked without replacement from ngztggkgg. 5/72 Three letters picked without replacement from {z: 7, s: 1, g: 2}. What is prob of sequence szg? 7/360 What is prob of sequence mtt when three letters picked without replacement from {l: 1, m: 4, q: 1, n: 2, c: 4, t: 6}? 5/204 Three letters picked without replacement from kkvwbwpbskkkb. What is prob of sequence wsv? 1/858 Three letters picked without replacement from {a: 7, j: 1, p: 12}. Give prob of sequence aaa. 7/228 What is prob of sequence hdhd when four letters picked without replacement from {d: 2, h: 4}? 1/15 Four letters picked without replacement from {o: 1, j: 6, g: 2, x: 2}. Give prob of sequence ggxo. 1/1980 Four letters picked without replacement from rrrrfrrrrrrfrrfrrr. What is prob of sequence rfrr? 91/816 Three letters picked without replacement from iiirrriereiriine. What is prob of sequence eie? 1/80 Calculate prob of sequenc	{ "pile_set_name": "DM Mathematics" }
second derivative of 79o2 - 67o*4 + ao*4 - 49o - 79o2 wrt o. -180o*2 Suppose -4r + r + 3 = -d, -3r = -9. Let c = -28 - -31. Find the first derivative of 13w3 + wc - 4w3 - w3 + d wrt w. 27w*2 Suppose 3f - 16 - 26 = 0. What is the second derivative of 21u + 86u - fu3 - 4u*3 + 0u3 - u2 + 16u wrt u? -108u - 2 What is the third derivative of -15 + 3 - 1769f6 - 514f*2 - 53f + 512f2 + 12 wrt f? -212280f3 Let c(y) be the second derivative of -y7/14 - 22y5/5 + 185y*3/2 - 48y + 53. Find the second derivative of c(b) wrt b. -60b3 - 528b Let p(o) = -o*3 - 4o*2 - 2. Let r(m) = 1206m*3 + 8m*2 + 489m + 4. Let s(f) = -2p(f) - r(f). Find the second derivative of s(v) wrt v. -7224v Let d(q) be the first derivative of -q*3/3 - 7q*2/2 + 3q - 1. Let p be d(-6). What is the third derivative of -i*2 + 10i - 20i5 - 10i + pi2 wrt i? -1200i*2 Suppose -20958 - 34590 = -36u. Find the third derivative of 20w2 - 5w*5 + uw*3 - 1543w3 - w4 + 5w wrt w. -300w*2 - 24w What is the first derivative of 3392j4 + 3j*2 + 3560j4 + j3 - 6602j4 - 9990 wrt j? 1400j*3 + 3j*2 + 6j Let n(d) = 2d2 + 2d - 10. Let l be n(2). What is the third derivative of -31ql + 30 + 18q*3 + 33q*2 + 4q*3 wrt q? 132 Let p(g) = -2g - 34. Let m be p(-18). Find the third derivative of -6xm - 1 + 2x*2 - 41x2 + x2 + 9x3 wrt x. 54 Let r be 0 + 0 + (-3 - -3)/(-2). Let b(d) be the first derivative of -21/2d*2 + 15 - 37/4d*4 + 0d*3 + rd. What is the second derivative of b(n) wrt n? -222n Let t(x) be the second derivative of -x7/42 - x6/10 - 219x*5/20 - 5495x*4/12 - 2701x. What is the third derivative of t(z) wrt z? -60z2 - 72z - 1314 Let w be 790/11 - 12/(-66). Let n = 74 - w. What is the third derivative of -146y - 39y*n - 8y*6 + 146y + 53y6 wrt y? 5400y*3 What is the first derivative of -362x - 6765x4 - 6767x*4 - 2x*3 - 6759x*4 + 4327 + 20289x*4 wrt x? -8x*3 - 6x*2 - 362 Let w(f) = 2019f*3 - 2f*2 - 2f + 1451. Let g(d) = 4038d3 - 5d*2 - 5d + 2896. Let c(q) = 2g(q) - 5w(q). Differentiate c(b) with respect to b. -6057b2 Suppose -f + 2d + 20 = 0, f - 3d = 4 + 21. What is the second derivative of 141j - 5j2 + fj*4 - 39j + 1 - 73j wrt j? 120j*2 - 10 Let a = -137 - -138. Let g(d) = 72d*2 + 12d - 5. Let y(r) = r. Let p(h) = ag(h) - 6y(h). What is the second derivative of p(x) wrt x? 144 Let a(u) = -4u - 12. Let t be a(6). Let g = 51 + t. Find the second derivative of -9r - 9r + gr - 35r2 wrt r. -70 Let b(d) be the first derivative of 2d*5/5 + 43d*2/2 - 3615d + 616. What is the first derivative of b(i) wrt i? 8i3 + 43 Find the second derivative of -10131d*2 + 2122d - 2115d + 10121d*2 + 87 + 264d*3 wrt d. 1584d - 20 Let g(h) = 4129h - 26892. Let r(f) = -824f + 5377. Let p(n) = 2g(n) + 11r(n). Find the first derivative of p(t) wrt t. -806 Let w = -382 + 479. Find the second derivative of 55f4 - 285f - wf - 296f*4 + 155f wrt f. -2892f2 Let w(q) = -169q + 126. Let c(z) = 55z - 184 + 120z - 70 + 190z - 26z. Let x(y) = 4c(y) + 7w(y). What is the derivative of x(s) wrt s? 173 Let g = -700 + 702. Find the third derivative of 2t4 + 41549t + 2t6 - 41549t - 3 - 28tg wrt t. 240t*3 + 48t Let v(n) be the third derivative of 47n5/6 - 71n*3 + 421n*2. Find the first derivative of v(o) wrt o. 940o Let n = 71 + -89. Let k = n - -21. Find the first derivative of -5 - 2m3 - 9 - 3m*k + 4m*3 wrt m. -3m*2 Let o(w) be the first derivative of -3011w3/3 + w2/2 - 568w - 1184. What is the second derivative of o(i) wrt i? -6022 Let j(y) be the second derivative of -y6/15 + 13y*4/6 + 1211y*2/2 + 6y + 20. Differentiate j(w) with respect to w. -8w3 + 52w Let y(r) be the third derivative of -r*7/210 + 19r*6/60 - 401r*5/30 - 40r*2 - 15. What is the third derivative of y(k) wrt k? -24k + 228 Let n = 16 + 108. Suppose 8p = -28 + n. Find the first derivative of -5 - pi - 6i + 8 - i wrt i. -19 Let w(z) be the third derivative of -601z*6/120 + 293z*5/60 + 426z*2. What is the third derivative of w(m) wrt m? -3606 Suppose -12u = 8u - 20. What is the second derivative of 57i - u - 30i3 + 51i*3 + 58i + 175i3 wrt i? 1176i Let v = 351 - 344. Find the third derivative of -700i2 - 211i*3 - vi + 904i2 + 7i wrt i. -1266 Let y(a) be the first derivative of 2030a4 + 3162a*3 + 5567. Find the third derivative of y(z) wrt z. 48720 Let f(i) = -2i*3 - 23i*2 - 17i - 19. Let w be f(-11). Differentiate -46t3 + 35t*2 + 22 + 2 + wt*3 + 115 wrt t. 3t*2 + 70t Suppose -2m - 5x - 27 = 0, 5x + 7 = -m - 14. Let s = 15 + m. What is the third derivative of sv*2 - 8v4 - v4 - 9v4 + 3v*4 wrt v? -360v Let m(w) = 3w. Let s be m(2). Let x be s(-2)/(-3) + 1. What is the second derivative of -45p + 16p - 3p4 + 26p*x + 3p*4 wrt p? 520p*3 Suppose 0 = 25n - 21 - 54. What is the third derivative of -6j2 - 2j*3 + 5 + 0j3 + j5 + 6j3 + 7j*n wrt j? 60j*2 + 66 Let g(x) = 13x*2 + 2x + 1. Let u be g(-1). Suppose -uf = -f - 165. What is the second derivative of 17i*4 - f + 15 + 5i + 0 wrt i? 204i2 Let p(x) be the third derivative of 93/112x*8 + 2x*2 + 0x + 0x6 + 3/8x*4 + 35 - 2/3x*3 + 0x*5 + 0x*7. Find the second derivative of p(u) wrt u. 5580u*3 Find the second derivative of 28r*2 + 545r + 1894r5 - 1896r*5 - 2440r + 2 + 55r2 wrt r. -40r*3 + 166 Let f(n) be the first derivative of 143/4n*4 - 114n*2 + 0n*3 + 0n + 11. What is the second derivative of f(z) wrt z? 858z Let h(u) be the first derivative of 38u - 2u2 - 5u*2 - 11u*3 + 6u*2 + 53 + 39u. Differentiate h(l) wrt l. -66l - 2 Let j(n) be the third derivative of 0n*5 - n - 5/6n*3 + 0 + 15n*2 + 0n*4 + 49/120n*6. Differentiate j(t) wrt t. 147t*2 Let y be -22/((-28)/77). Find the second derivative of -y - 95k2 - 27k + 80k - 29k - 28k wrt k. -190 Let u(h) = -2060h - 1386. Let z(q) = -1030q - 704. Let n(g) = -4u(g) + 9z(g). What is the derivative of n(c) wrt c? -1030 Let d = 91/164 - -8/41. Let n(h) be the second derivative of 0h*3 + 14h + 0h5 + 0 - dh*4 - 8/15h*6 + 0h*2. Find the third derivative of n(a) wrt a. -384a Let o(x) be the second derivative of -5883x5/20 + 407x*3/2 + 200x - 2. Find the second derivative of o(n) wrt n. -35298n What is the third derivative of -2541l*2 - 420l*3 + 2139l*2 - 376l*3 + 2918l*2 wrt l? -4776 Let k(c) = -3c*3 + 2c + 2. Let g(v) = -23v3 - 8v*2 + 4v - 1621. Let i(f) = -g(f) + 3k(f). Find the first derivative of i(p) wrt p. 42p*2 + 16p + 2 Let r(a) = -5838a + 1628. Let o(k) = -2915k + 817. Let b(h) = -7o(h) + 3r(h). What is the first derivative of b(m) wrt m? 2891 Suppose 0 = -4r - 82 - 102. Let g = 61 + r. What is the second derivative of 15 - 8f + 5f4 - 6f - g wrt f? 60f2 Suppose 19d - 29d = -60. What is the third derivative of -df*6 - 90f*2 - 3290f*4 + 0f*6 + 3287f*4 wrt f? -720f*3 - 72f Suppose 20g + 2150 - 2230 = 0. Let s(c) be the second derivative of 0 - 32c - 4/3c3 - 5/4c*g + 0c*2. What is the second derivative of s(u) wrt u? -30 Let o(g) be the first derivative of -1211g*4/2 - 2g3/3 - g2/2 + 31g - 639. Find the third derivative of o(y) wrt y. -14532 Suppose i = -5j + 30, -j = -2i - 4j + 25. Find the third derivative of -m*5 - 2 + 0m*i - 8m*2 - 18m*3 + 18m*3 wrt m. -60m2 Let j(n) be the second derivative of n4/12 - 175n3/6 - 319n*2 + 624n - 1. Differentiate j(h) wrt h. 2h - 175 Let o(z) be the third derivative of 199z5/5 + z4/12 + 97z3/3 + 215z*2. What is the second derivative of o(m) wrt m? 4776 Let m = -245 + 251. What is the third derivative of 18y*6 - 83y*2 + 2y*m + 85y*2 + 5y*6 - 2y wrt y? 3000y3 Suppose -3o + 11 = o - l, 0 = o - 2l - 1. Suppose 2c - 2z = 3c + 5, -oz = 5c - 3. Differentiate -19 + 28j3 + 33j*3 - 40j*c wrt j. 63j*2 Let j = 128 - 110. Find the second derivative of -30k*3 + jk*3 - 2k*3 - 24k*3 - 69k wrt k. -228*k Let c = 861 + -849. Let	{ "pile_set_name": "DM Mathematics" }
ked without replacement from {r: 1, u: 2}. What is prob of sequence uru? 1/3 What is prob of sequence aada when four letters picked without replacement from cocaaad? 1/140 What is prob of sequence dz when two letters picked without replacement from dzzddzeefdfd? 5/44 What is prob of sequence mq when two letters picked without replacement from qqqqqqqqqmmmmqmmqqq? 13/57 What is prob of sequence wl when two letters picked without replacement from qllwlsislls? 1/22 Three letters picked without replacement from huphupxfhfxumpx. Give prob of sequence uhp. 9/910 Calculate prob of sequence rr when two letters picked without replacement from {r: 11, a: 2}. 55/78 What is prob of sequence vqyk when four letters picked without replacement from ykkkyyykyyqvkkk? 1/780 Two letters picked without replacement from hkllhk. What is prob of sequence kh? 2/15 Two letters picked without replacement from ttvlltitttititxvtnt. Give prob of sequence xt. 5/171 Calculate prob of sequence nn when two letters picked without replacement from ncn. 1/3 Four letters picked without replacement from xkyzkykppkpykyzy. What is prob of sequence pyyz? 1/364 Calculate prob of sequence aba when three letters picked without replacement from ybyabyyyyybbabbyy. 1/340 Calculate prob of sequence rklk when four letters picked without replacement from {l: 1, o: 3, r: 2, k: 3, c: 1}. 1/420 Three letters picked without replacement from wqqw. What is prob of sequence wqq? 1/6 What is prob of sequence kt when two letters picked without replacement from {h: 6, k: 8, t: 1}? 4/105 Calculate prob of sequence lev when three letters picked without replacement from ivlliigigeiiivivi. 1/680 Four letters picked without replacement from uuuuuuu. What is prob of sequence uuuu? 1 Four letters picked without replacement from {b: 3, m: 4, c: 7}. What is prob of sequence bbcc? 3/286 Calculate prob of sequence ay when two letters picked without replacement from ryhap. 1/20 Calculate prob of sequence uuud when four letters picked without replacement from uuuuduuuduuu. 4/33 Two letters picked without replacement from {e: 2, g: 4, b: 3}. What is prob of sequence eb? 1/12 Four letters picked without replacement from {a: 11, t: 2}. What is prob of sequence aaaa? 6/13 What is prob of sequence ux when two letters picked without replacement from uyhhuyxxy? 1/18 Three letters picked without replacement from {k: 3, w: 1, g: 5, j: 3}. What is prob of sequence ggg? 1/22 Three letters picked without replacement from vccuuvvcvauuvv. What is prob of sequence cuc? 1/91 Three letters picked without replacement from hufphuhhhhhdhdhhfn. Give prob of sequence uud. 1/1224 Two letters picked without replacement from {s: 2, q: 1, r: 2, f: 1}. What is prob of sequence fr? 1/15 What is prob of sequence rurr when four letters picked without replacement from {r: 6, u: 2}? 1/7 Four letters picked without replacement from zfffzzzzfffff. What is prob of sequence fzzf? 28/429 Three letters picked without replacement from {n: 7, f: 1, z: 1}. What is prob of sequence zff? 0 What is prob of sequence abaa when four letters picked without replacement from {a: 3, v: 2, l: 8, b: 6}? 1/2584 Four letters picked without replacement from dddddfiddgidgnn. What is prob of sequence dinf? 4/4095 Three letters picked without replacement from {c: 8, z: 5}. Give prob of sequence czz. 40/429 What is prob of sequence dqo when three letters picked without replacement from duduqquouq? 1/120 Calculate prob of sequence pk when two letters picked without replacement from {y: 1, k: 2, p: 3, c: 6}. 1/22 Three letters picked without replacement from ddgggd. What is prob of sequence ggd? 3/20 Calculate prob of sequence kc when two letters picked without replacement from {q: 1, g: 2, d: 2, k: 1, c: 1, i: 1}. 1/56 What is prob of sequence fw when two letters picked without replacement from {w: 2, f: 3, j: 3, l: 7, b: 5}? 3/190 Four letters picked without replacement from {x: 4, c: 7, b: 2}. What is prob of sequence xbxb? 1/715 What is prob of sequence dgdd when four letters picked without replacement from ggddjggggjdjj? 3/1430 Four letters picked without replacement from bbbfbbnfenbbbbbnn. Give prob of sequence enfb. 1/714 Calculate prob of sequence zm when two letters picked without replacement from zlmsw. 1/20 Four letters picked without replacement from {q: 6, o: 6}. Give prob of sequence qoqo. 5/66 Three letters picked without replacement from ssobsosssooosbo. What is prob of sequence obs? 2/65 Three letters picked without replacement from ccccccbacccccaccaccc. Give prob of sequence aaa. 1/1140 What is prob of sequence yux when three letters picked without replacement from klryulrxxklk? 1/660 Four letters picked without replacement from {r: 13, o: 3}. Give prob of sequence ooor. 1/560 Calculate prob of sequence gzr when three letters picked without replacement from {r: 7, g: 1, z: 1, i: 5}. 1/312 What is prob of sequence uo when two letters picked without replacement from {n: 2, o: 1, u: 1}? 1/12 Calculate prob of sequence pp when two letters picked without replacement from ppppppppp. 1 Three letters picked without replacement from {x: 2, v: 2, y: 2, k: 2}. Give prob of sequence vkk. 1/84 Calculate prob of sequence on when two letters picked without replacement from nnonnnnno. 7/36 Two letters picked without replacement from {e: 1, w: 1, s: 10, k: 3}. What is prob of sequence ek? 1/70 Calculate prob of sequence xlu when three letters picked without replacement from ulx. 1/6 Four letters picked without replacement from myjyqyymmyqqmd. What is prob of sequence jdmy? 5/6006 Two letters picked without replacement from {i: 1, g: 11}. What is prob of sequence ig? 1/12 Three letters picked without replacement from {i: 5, e: 2, m: 5, b: 1, k: 1, y: 1}. What is prob of sequence eyk? 1/1365 What is prob of sequence evmv when four letters picked without replacement from pedhedpddvpdmvd? 1/8190 Four letters picked without replacement from {g: 3, e: 4, h: 3, i: 3}. What is prob of sequence gghg? 3/2860 Calculate prob of sequence pp when two letters picked without replacement from {p: 5}. 1 Four letters picked without replacement from ollollololloo. What is prob of sequence loll? 21/286 What is prob of sequence dqee when four letters picked without replacement from {q: 1, e: 4, u: 1, d: 1, p: 3, w: 2}? 1/990 Four letters picked without replacement from xdhhdbxbbhdbdbbhfwb. Give prob of sequence fbdd. 7/7752 Calculate prob of sequence zgi when three letters picked without replacement from igiiiiigiigigzigigz. 22/969 Three letters picked without replacement from caaacc. Give prob of sequence caa. 3/20 Four letters picked without replacement from pdpdpsspsssss. Give prob of sequence dsps. 14/715 Two letters picked without replacement from {e: 2, b: 7}. Give prob of sequence bb. 7/12 What is prob of sequence cb when two letters picked without replacement from crrbcccr? 1/14 What is prob of sequence by when two letters picked without replacement from fyrrffryfrrsssyssb? 1/102 Calculate prob of sequence ux when two letters picked without replacement from {u: 12, b: 6, x: 1}. 2/57 Two letters picked without replacement from {b: 2, x: 4, i: 6}. What is prob of sequence xb? 2/33 Two letters picked without replacement from {g: 9, b: 2, n: 1, v: 4, i: 3}. Give prob of sequence vb. 4/171 Calculate prob of sequence st when two letters picked without replacement from sstssts. 5/21 Four letters picked without replacement from jxxsjxssjxjxjxsx. What is prob of sequence sjjx? 1/78 What is prob of sequence szzz when four letters picked without replacement from {q: 7, z: 5, s: 1}? 1/286 Calculate prob of sequence mi when two letters picked without replacement from {l: 1, x: 1, i: 1, m: 1, f: 1}. 1/20 Calculate prob of sequence yyy when three letters picked without replacement from xxyyxyyyv. 5/42 Three letters picked without replacement from rszrrznr. What is prob of sequence rsn? 1/84 Two letters picked without replacement from aaatttaataaaaa. Give prob of sequence tt. 6/91 Three letters picked without replacement from {x: 1, j: 1, t: 2, f: 1, h: 2}. Give prob of sequence xxf. 0 Three letters picked without replacement from {f: 2, d: 1}. What is prob of sequence dff? 1/3 What is prob of sequen	{ "pile_set_name": "DM Mathematics" }
fter 8:45 PM? 11:06 PM What is 291 minutes before 10:01 AM? 5:10 AM What is 372 minutes after 3:03 AM? 9:15 AM What is 296 minutes after 4:22 PM? 9:18 PM How many minutes are there between 11:47 PM and 12:54 AM? 67 What is 625 minutes before 2:03 PM? 3:38 AM How many minutes are there between 6:22 AM and 2:15 PM? 473 What is 371 minutes before 11:52 AM? 5:41 AM How many minutes are there between 2:58 PM and 6:04 PM? 186 How many minutes are there between 8:00 AM and 6:23 PM? 623 What is 77 minutes after 12:31 AM? 1:48 AM What is 152 minutes before 6:15 PM? 3:43 PM What is 610 minutes before 3:02 AM? 4:52 PM How many minutes are there between 1:16 AM and 1:52 AM? 36 What is 110 minutes after 8:40 PM? 10:30 PM What is 90 minutes after 5:45 PM? 7:15 PM How many minutes are there between 1:00 PM and 9:58 PM? 538 How many minutes are there between 12:37 PM and 8:47 PM? 490 How many minutes are there between 7:40 AM and 7:30 PM? 710 How many minutes are there between 5:16 AM and 7:49 AM? 153 What is 142 minutes before 2:06 PM? 11:44 AM What is 480 minutes after 12:51 AM? 8:51 AM How many minutes are there between 4:25 AM and 5:07 AM? 42 How many minutes are there between 9:08 PM and 11:18 PM? 130 What is 634 minutes after 6:26 PM? 5:00 AM How many minutes are there between 9:06 PM and 11:42 PM? 156 What is 448 minutes before 12:33 PM? 5:05 AM What is 444 minutes before 12:11 AM? 4:47 PM How many minutes are there between 8:31 PM and 1:27 AM? 296 What is 467 minutes before 11:58 AM? 4:11 AM What is 51 minutes before 4:03 PM? 3:12 PM How many minutes are there between 3:38 AM and 9:45 AM? 367 What is 191 minutes before 5:19 PM? 2:08 PM How many minutes are there between 5:57 PM and 2:07 AM? 490 What is 160 minutes before 9:08 AM? 6:28 AM What is 286 minutes before 11:26 AM? 6:40 AM How many minutes are there between 2:18 AM and 10:30 AM? 492 What is 9 minutes before 3:50 AM? 3:41 AM What is 126 minutes before 11:16 PM? 9:10 PM How many minutes are there between 11:30 PM and 3:41 AM? 251 How many minutes are there between 9:40 AM and 12:13 PM? 153 How many minutes are there between 11:08 AM and 1:47 PM? 159 How many minutes are there between 6:39 PM and 4:46 AM? 607 What is 120 minutes after 5:11 AM? 7:11 AM How many minutes are there between 8:20 AM and 12:18 PM? 238 What is 132 minutes after 3:58 AM? 6:10 AM How many minutes are there between 4:31 PM and 8:02 PM? 211 What is 359 minutes after 8:24 PM? 2:23 AM What is 634 minutes before 8:46 AM? 10:12 PM How many minutes are there between 11:16 PM and 8:59 AM? 583 What is 337 minutes after 9:57 PM? 3:34 AM What is 14 minutes after 12:46 AM? 1:00 AM How many minutes are there between 5:07 AM and 12:17 PM? 430 What is 291 minutes before 7:42 PM? 2:51 PM What is 587 minutes after 1:25 AM? 11:12 AM How many minutes are there between 1:43 AM and 1:00 PM? 677 What is 687 minutes before 2:40 AM? 3:13 PM What is 492 minutes before 6:52 AM? 10:40 PM What is 610 minutes after 7:43 PM? 5:53 AM How many minutes are there between 8:52 PM and 5:00 AM? 488 How many minutes are there between 8:37 PM and 8:31 AM? 714 What is 406 minutes before 12:12 PM? 5:26 AM How many minutes are there between 11:11 PM and 1:45 AM? 154 How many minutes are there between 9:53 AM and 10:04 AM? 11 How many minutes are there between 5:33 AM and 3:11 PM? 578 How many minutes are there between 8:35 PM and 2:35 AM? 360 What is 429 minutes after 4:41 AM? 11:50 AM How many minutes are there between 7:08 PM and 8:08 PM? 60 How many minutes are there between 1:50 AM and 2:42 AM? 52 What is 305 minutes after 8:43 PM? 1:48 AM What is 142 minutes after 3:16 AM? 5:38 AM How many minutes are there between 9:27 PM and 6:57 AM? 570 How many minutes are there between 10:41 AM and 6:57 PM? 496 How many minutes are there between 3:24 PM and 5:01 PM? 97 How many minutes are there between 11:50 PM and 6:44 AM? 414 How many minutes are there between 5:51 PM and 7:28 PM? 97 How many minutes are there between 8:48 AM and 11:03 AM? 135 How many minutes are there between 1:20 PM and 6:24 PM? 304 How many minutes are there between 4:35 PM and 7:57 PM? 202 What is 624 minutes before 2:49 PM? 4:25 AM How many minutes are there between 5:53 PM and 12:51 AM? 418 What is 153 minutes before 3:28 AM? 12:55 AM How many minutes are there between 2:26 PM and 12:50 AM? 624 What is 331 minutes after 7:02 PM? 12:33 AM What is 63 minutes after 2:25 AM? 3:28 AM How many minutes are there between 10:14 PM and 4:58 AM? 404 What is 309 minutes before 5:49 PM? 12:40 PM How many minutes are there between 3:46 PM and 9:28 PM? 342 How many minutes are there between 3:27 PM and 1:32 AM? 605 What is 14 minutes after 6:54 PM? 7:08 PM What is 165 minutes after 7:33 PM? 10:18 PM What is 376 minutes after 9:51 PM? 4:07 AM What is 342 minutes after 7:10 AM? 12:52 PM How many minutes are there between 3:28 AM and 7:23 AM? 235 What is 588 minutes after 9:52 AM? 7:40 PM What is 60 minutes before 12:45 PM? 11:45 AM How many minutes are there between 10:19 AM and 9:02 PM? 643 How many minutes are there between 12:01 PM and 3:23 PM? 202 What is 661 minutes after 6:55 AM? 5:56 PM What is 539 minutes after 2:04 AM? 11:03 AM What is 296 minutes before 4:26 AM? 11:30 PM How many minutes are there between 4:33 PM and 2:11 AM? 578 What is 401 minutes after 4:24 AM? 11:05 AM How many minutes are there between 4:12 PM and 9:16 PM? 304 What is 646 minutes after 7:44 PM? 6:30 AM How many minutes are there between 3:24 PM and 2:44 AM? 680 What is 310 minutes after 2:18 AM? 7:28 AM What is 97 minutes before 8:07 AM? 6:30 AM What is 203 minutes after 7:46 AM? 11:09 AM How many minutes are there between 11:44 AM and 6:00 PM? 376 What is 530 minutes after 6:33 AM? 3:23 PM What is 11 minutes after 10:26 AM? 10:37 AM What is 627 minutes after 2:19 PM? 12:46 AM How many minutes are there between 5:48 AM and 4:27 PM? 639 How many minutes are there between 12:11 PM and 6:04 PM? 353 What is 385 minutes after 10:20 AM? 4:45 PM What is 42 minutes after 6:19 AM? 7:01 AM What is 496 minutes after 12:21 PM? 8:37 PM What is 564 minutes before 1:19 PM? 3:55 AM What is 458 minutes after 11:25 AM? 7:03 PM How many minutes are there between 11:59 AM and 5:30 PM? 331 How many minutes are there between 9:51 PM and 4:04 AM? 373 What is 665 minutes before 1:59 PM? 2:54 AM How many minutes are there between 12:44 PM and 9:53 PM? 549 How many minutes are there between 11:04 PM and 2:31 AM? 207 How many minutes are there between 4:56 PM and 2:38 AM? 582 What is 661 minutes after 5:20 PM? 4:21 AM How many minutes are there between 9:28 PM and 7:13 AM? 585 What is 588 minutes before 9:35 AM? 11:47 PM What is 714 minutes after 1:05 PM? 12:59 AM What is 597 minutes after 8:10 AM? 6:07 PM How many minutes are there between 11:26 AM and 11:08 PM? 702 What is 543 minutes before 4:47 AM? 7:44 PM What is 324 minutes before 10:05 PM? 4:41 PM What is 144 minutes before 12:43 AM? 10:19 PM What is 142 minutes before 7:54 AM? 5:32 AM What is 101 minutes before 7:20 PM? 5:39 PM How many minutes are there between 7:20 AM and 3:43 PM? 503 What is 556 minutes after 4:17 PM? 1:33 AM How many minutes are there between 7:22 PM and 3:01 AM? 459 What is 481 minutes after 7:44 PM? 3:45 AM What is 152 minutes after 10:53 AM? 1:25 PM What is 508 minutes before 7:36 PM? 11:08 AM What is 111 minutes before 5:46 AM? 3:55 AM How many minutes are there between 2:55 PM and 4:12 PM? 77 What is 35 minutes before 5:42 AM? 5:07 AM What is 472 minutes after 5:45 PM? 1:37 AM What is 345 minutes after 2:44 PM? 8:29 PM How many minutes are there between 2:42 PM and 4:42 PM? 120 How many minutes are there between 5:47 AM and 9:43 AM? 236 What is 636 minutes before 8:11 AM? 9:35 PM How many minutes are there between 11:12 AM and 12:03 PM? 51 What is 391 minutes after 4:36 AM? 11:07 AM What is 663 minutes after 1:44 AM? 12:47 PM How many minutes are there between 3:07 AM and 11:28 AM? 501 What is 646 minutes after 1:44 PM? 12:30 AM How many minutes are there between 2:48 AM and 5:09 AM? 141 What is 71 minutes after 4:47 AM? 5:58 AM What is 553 minutes before 1:20 PM? 4:07 AM How many minutes are there between 10:24 PM and 3:34 AM? 310 What is 672 minutes before 1:39 AM?	{ "pile_set_name": "DM Mathematics" }
1 + 1 + x + (-3 + 2 - 6)(0x + x - 5x) to the form qx + f and give q. 29 Rearrange ((2 + 3 - 3)(-2 + 0 + 3) + 0 + 2 + 0 - 2 + 3 - 4)(-2 + h + 2)(4 - 5 - 3) to g + wh and give w. -4 Rearrange (0g + 0g + g*3)(3 - 6 + 4) + 10g3 + 11g*3 + 3g*3 to the form dg*2 + cg*3 + h + ag and give h. 0 Express (-2t2 + 2 - 2 + 2)(-1 + 1 + 2t2 + (6 - 2 - 2)(2t - 2t - 2t2)) as rt*2 + mt*3 + jt + dt4 + z and give d. 4 Express (-2b*3 + 4b3 - b3 + (-3 - 1 + 3)(-2b*2 + 2b*2 + 2b*3))(-b + 0b - 2b) in the form r + qb2 + kb + tb4 + vb*3 and give t. 3 Rearrange 7 + 13h - 7 + 0 to p + wh and give p. 0 Express k4 - k3 + k2 - k + 2 + k3 in the form t + rk*4 + zk*3 + ak + ik2 and give a. -1 Rearrange 5a3 + a2 + 0a3 - 4a*3 + 6a + 0a3 to the form l + va*2 + wa + qa3 and give v. 1 Rearrange -3u*2 - 21u + u*3 - 2u*4 + 2u*2 + 19u + 1 to the form nu4 + yu*3 + fu*2 + i + cu and give n. -2 Rearrange -38w2 - 7w*2 + 34w*2 - 55w*2 to the form rw*2 + dw + t and give r. -66 Express 43b4 - 4b + 4b - b4 - 2b*4 + 0b*4 + (0b - 3b + 5b)(2b - b*3 - 2b) in the form fb2 + nb*4 + zb*3 + o + ub and give n. 38 Rearrange 4n2 + 4 - 14n*2 - 3 to sn + hn2 + q and give q. 1 Rearrange (2k*3 - 2k*3 + 4k*3)(11 - 11k - 6 - 7) to zk*2 + ik*4 + nk + r + ak3 and give i. -44 Express (-2d + 3d + 2d)(-6 + 2 - 2) in the form ld + h and give l. -18 Express -2 + 0 + 3 - 6r3 + 3r*3 + 2r*4 as tr*4 + h + sr + br2 + dr*3 and give t. 2 Express (0 - 5 + 3)(2 + 4 - 4)(-3 + 3 + m) as i + sm and give s. -4 Express 0o + o - 6o - o + 1 as zo + j and give z. -6 Rearrange -1 + 6 + 29m - 5 to the form l + dm and give d. 29 Rearrange -95u + 95u - 2 - 14u*3 to q + cu + ju2 + nu3 and give n. -14 Rearrange (-b3 + 5b3 - 26b*3)(1 + 5 - 3) to the form ub2 + f + qb + hb3 and give h. -66 Rearrange -2 + 7 - 7n*2 - 4 to the form qn*2 + a + in and give q. -7 Express -18 + 27 + 12o2 - 9 in the form ro*2 + no + c and give r. 12 Express (1 + 1 - 11)(4 - 6 + 0)(-4 - 2q + 4) as r + pq and give p. -36 Rearrange -1 - 2b2 + 15 - 10 to ib + nb2 + k and give n. -2 Rearrange -490g + 490g - 4g*2 + 11 to the form b + yg*2 + zg and give b. 11 Rearrange -3i3 + 2i - 3i - 3i*2 + 0i to ai + pi*2 + h + ji*3 and give a. -1 Rearrange 34 + 13u + 5u - 20u + (2 - 3 + 2)(-5u + 3u + 3u) to bu + w and give w. 34 Rearrange 63k*2 - 2 + 3k3 + k4 - 122k2 + 61k*2 to dk*2 + fk*3 + t + wk*4 + ak and give d. 2 Express 2f2 + 5f - 2f2 + 0f3 - f3 in the form of3 + m + kf + qf2 and give k. 5 Express -15a*2 + 17a*2 - 23 - 7 - 29 in the form f + ma*2 + ba and give f. -59 Express (0 + 3 - 6)(-4 + n2 + 5n + 8n - 18n) as un2 + v + cn and give c. 15 Express (-y + 0y + 2y)(2 - 1 + 0)(0 - 4y + 2 - 1) as j + iy*2 + sy and give s. 1 Rearrange (-2c + 2c - 2c)(-2c + c - 2c) + 5c - 2c - 67c2 - 3c to the form oc + ic*2 + a and give i. -61 Rearrange (-73i*2 + 73i*2 - 13 + 2i*3)(2i + 0i - i) to the form bi + ji*2 + qi*4 + d + hi*3 and give j. 0 Express -8 - 23w - 4 + 12 in the form rw + v and give r. -23 Rearrange -2 - 26n*2 - 53n + 53n to the form t + fn + sn2 and give s. -26 Express -3d*2 + 5d*2 - 5d*2 - 2 in the form wd*2 + x + hd and give w. -3 Express (3 + 1 - 3)(2n*2 - 2n*2 - 4n*2) + 7n*2 - 7n + 10n - 4n*2 as pn + fn2 + b and give p. 3 Express -2n*3 + 6n*3 + 1 - 2 in the form rn*2 + k + zn*3 + xn and give x. 0 Rearrange (-1 + g + 1)(-340 - 13g*2 + 340) to the form ag*3 + og + d + tg2 and give a. -13 Express 3u*3 - 4u3 - u3 - 142 + 142 - 22u3 + (u - 2u + 2u)(3u2 + 3u*2 - 5u*2) + 2u*3 - 4 + 4 as su*2 + ru + c + wu3 and give s. 0 Rearrange (-2r + 7 + 8 - 13)(14r + 15 - 15)(0 + 0 + 2r) to the form u + fr2 + zr + wr3 and give w. -56 Express (5v - 4v + 2v)(-3v + 1 - 1) - v*2 + 0v*2 + 3v*2 in the form wv + r + yv2 and give r. 0 Express -9k*2 + 33k*2 + 22k*2 in the form l + rk*2 + pk and give r. 46 Rearrange (-41i - 51i + 11i)(2i - 4i + 0i) to ti*2 + qi + u and give t. 162 Rearrange 3h2 - h2 - h2 + (h2 - 2h*2 + 2h*2)(-2 + 2 + 1) + h*2 - 3h*2 + 4h*2 - 49h + 50h - 2h*2 - 3 + 1 to t + ih + ph2 and give p. 2 Rearrange -4 - 3w + 4 + 19w to t + hw and give h. 16 Rearrange ((1 - 1 - 2)(1 - 1 - 2j) + (-3 + 3 + 2)(-j - 2j + 2j) - 1 + 1 + j)(7 - 3 + 16) to the form a + xj and give x. 60 Express -u + 26u*2 - 28u2 + u4 + 2u3 + 2u as su3 + ju*4 + nu*2 + q + iu and give n. -2 Rearrange (0n + 0n - 2n)(-4n + 0n + 0n) + (-3n - 1 - 2 + 2n)(1 - 1 - 2n) to vn + t + sn2 and give s. 10 Express -1 - 73r + 90r + 1 as p + lr and give l. 17 Express -2i3 - 3i + 3i + (i + i - i)(2i - i2 - 2i) + (5 + 3 - 4)(i3 - 5i3 - i3) as xi + wi*3 + yi*2 + j and give w. -23 Rearrange (-1 - 2m*2 + 1 + 2m*2 + 2m*2 - 3m*2 + (-4m + m + m)(2m + 0m - 4m))(-m + 0 + 0) to o + km*2 + ym + wm3 and give w. -3 Rearrange 17k + 6 - 6 to l + wk and give w. 17 Rearrange (m4 - 3m4 + m4)(-1 - 4 + 1) + (-8m + 6m2 + 8m)(-3m*2 - 3m*2 - m + 3m) to nm2 + y + km*4 + bm*3 + jm and give b. 12 Express -420k2 + 420k*2 + 2k*3 - 1 - 5k*4 as pk*4 + tk*3 + c + sk*2 + yk and give s. 0 Express (3k2 + k - k)(2k2 + 5 - 5) + (-5k*4 + 10 - 10)(1 - 2 + 0) in the form hk2 + y + ck + sk4 + nk3 and give y. 0 Rearrange j3 + 0j - 3j - 1 - j*4 + 0j*3 + 4 to the form vj*2 + sj*4 + nj*3 + a + pj and give p. -3 Rearrange 3 + 50s - 21s - 3 to the form a + gs and give g. 29 Express (-2i + 0 + 0)(-i - i2 + 15i*2 + 2i) as di2 + gi + s + bi3 and give b. -28 Rearrange l2 - l2 - 4l2 - 2 - l2 - 1 + 1 + (3 - 3 - l)(2l + 4l - 4l) + 4l2 + 0l*2 - 3l*2 to the form yl*2 + dl + a and give y. -6 Rearrange 2g - g - 9 - g + 7g to jg + q and give q. -9 Express 4l*2 - 2l*2 - 4l*2 + (-3l + 9l - l)(-l + 2l + l) + 6l*2 - 2l*2 - 2l2 + 2 - l2 - 2 as il2 + g + dl and give i. 9 Express (-2 + 9 + 1)(-3u + 25u - 6u) as wu + j and give w. 128 Express (3 - 3 - 2h)(3h - 6h + 5h) - 3 + 3 + 2h2 - 3h2 - h2 + 2h2 + (2h + 0h - 4h)(6 - 6 + 5h) as ah2 + fh + n and give a. -14 Rearrange (-5 + 4d - 12 + 18)(8 - 8 + d) to the form w + sd2 + pd and give s. 4 Rearrange -55 + 55 + 50w + 51w to l + pw and give p. 101 Rearrange (2x*2 + 36565 - 45x - 36565)(-3x + 0x + 2x) to the form zx + nx*3 + q + vx*2 and give n. -2 Express 0l*4 - 6l*4 + 9l + 5l4 + (-2l - l + 4l)(-3l3 - 2 + 2) as ml + yl2 + p + dl*3 + cl*4 and give d. 0 Express -7n*2 - 2n*3 - 3n*2 - 833 + 2n + 834 + 4n3 as fn*3 + ln + w + dn2 and give d. -10 Express 4c - 2c - 3c + (-4 - 2c + 4)(1 + 5 + 5) as s + zc and give z. -23 Rearrange -b - 3b + 3b + (-4 + 6 - 4)(b + 2b - 2b) + 4 - 4 - 3b - 3b + b + b to hb + l and give h. -7 Express (14k*3 - 2k + 2k)(0k - 2k + 0k) - k2 + k2 + 2k*4 in the form ak*2 + yk*3 + sk*4 + g + xk and give x. 0 Rearrange 15d2 - 11d*2 + 17d*3 - 2d - 5d2 to the form ld + xd2 + g + zd*3 and give x. -1 Rearrange 3 + 6 - 111j*2 + 112j*2 to t + sj*2 + oj and give t. 9 Rearrange -2v - 3v*2 - 1 + 3 - 2v*4 - v to the form m + dv*2 + tv + jv4 + gv*3 and give t. -3 Express (-1 - 3 + 3)(2x + 3x - 4x) + 12x + 22x - 25x in the form u + mx and give m. 8 Express (13 - 13 - r + (-6 + 1 + 3)(0r + 0r + 2r))(1 - 3r2 - 1)(3 - 3 + 1) in the form y + jr2 + or + lr3 and give y. 0 Express (-2 + 2l + 2)(-2 + 2 - 2l + 2 + l - 2 + (-5 + 4 + 2)(-2l + 0l + 0l)) as il2 + hl + y and give i. -6 Rearrange (1 + 2 - 4)(106k*2 + 2k + 15k - 104k*2) to the form jk*2 + bk + l and give b. -17 Rearrange (-2 + 1 - 2)(-2f + f + 2f)(4 - 2f - 6 - f) to the form i + xf + df2 and give d. 9 Rearrange 0z - 6z - 5z - 2z*	{ "pile_set_name": "DM Mathematics" }
u))u/(uu*2u))/(u*(1/10)u*(-5/4)u) assuming u is positive. u(-97/20) Simplify ((j/(j/(j/(j(-2/9)j))))(2/47))(5/11) assuming j is positive. j(20/4653) Simplify p(-2/21)p/(p/(ppp/(pp(-1/2)p))p) assuming p is positive. p(17/42) Simplify ((b1)(-2/53))(2/21) assuming b is positive. b(-4/1113) Simplify (l(-18))(-2/57) assuming l is positive. l(12/19) Simplify (q(q*6q)/qq)/q(1/6)(qq(q*(-3/10)q)/qq)/(q/(q/q(1/2))) assuming q is positive. q(301/30) Simplify (d/(dd*5d))/(d/(d/((dd/(d/(dd(d(-4/3)/d)/d))d)/d)d))(dd/(d(d/(d*(2/7)dd))/d)d)(1/2) assuming d is positive. d(-53/21) Simplify ((p*1p)46)29 assuming p is positive. p2668 Simplify (a(-1/3)/a(-7/2))/(a(1/5))(-17/2) assuming a is positive. a(73/15) Simplify i*(4/3)iii*1(((ii(ii(-1)/ii)/i)/i)/i)48 assuming i is positive. i(-131/3) Simplify (s(2/13)/(((s7/ss)/s)/s))(-6) assuming s is positive. s(378/13) Simplify ((n/((nn*(4/3))/n)n)/(n(nn/n(2/5))/n))23 assuming n is positive. n(-322/15) Simplify ((f/f3)(-2/5))(-45) assuming f is positive. f*(-36) Simplify (ss(-2))(17/2)(s/s(1/4)s)(-1/39) assuming s is positive. s(-1333/156) Simplify ((ff(-8)/f)/f(-1/8))/(f(-1/5))1 assuming f is positive. f(-307/40) Simplify (c(c*4cc)/ccccc(-2)c)13 assuming c is positive. c104 Simplify (b(2/9)/(b(-1)bb))/(b(-1/2))(-2) assuming b is positive. b(-16/9) Simplify ((f(-2/15))18)14 assuming f is positive. f*(-168/5) Simplify (ff(-2/5))(-5/14)(f/(f(1/4)f))/(f/f*(-4)f) assuming f is positive. f(-181/28) Simplify ((g(1/6)g)/g)/(gg(-10)) assuming g is positive. g(55/6) Simplify (w*(-2/3)w(-7/2))/(w5/(ww(-4))) assuming w is positive. w(-73/6) Simplify (uu(1/3))(-2/19)/(uu/(uuuu*0/uuuuu))(-45) assuming u is positive. u(-10268/57) Simplify r(1/28)/r(-19) assuming r is positive. r(533/28) Simplify (f(2/21)/ff(-2/19))(-1/8) assuming f is positive. f(403/3192) Simplify (d(9/8)/dd)/(dd/d*(3/7)dd) assuming d is positive. d(-137/56) Simplify (((b/(b/(bb((b/(b12b))/b)/b)))/b)/(b(2/7)/b))(-13) assuming b is positive. b(1118/7) Simplify t(2/5)/tt(-14)/t assuming t is positive. t(-78/5) Simplify (t13/t(3/10))(-23) assuming t is positive. t(-2921/10) Simplify ((n(-2/5)n)/n)/(nn/n(-9))n*(1/6)(n/(n/(n*5/nn)))/n assuming n is positive. n(-217/30) Simplify (n/n(-4/7)nn)(-3/4) assuming n is positive. n(-75/28) Simplify (k*(-3)k)(-49) assuming k is positive. k98 Simplify ((tt/(t/(tt*(-3)))t)/(t/(t(-7)/t)))/((t/t(1/2))/t)(6/19) assuming t is positive. t(-168/19) Simplify (m11)47 assuming m is positive. m517 Simplify (w(-1)/w(1/4))/(w(-7/2)ww/(w/(w/w*1)w)) assuming w is positive. w(9/4) Simplify o(-2/5)oo(2/7) assuming o is positive. o(31/35) Simplify (n(2/9))41/(nn(2/3)nn/((nn*(-2/25)n)/n)) assuming n is positive. n(1432/225) Simplify (u1)*15/((uu*(-6))/(uu1)) assuming u is positive. u22 Simplify j/j*(2/7)j(-5) assuming j is positive. j(-30/7) Simplify (kk1/k)(-31)(k(1/2)/k)(-31/4) assuming k is positive. k(-217/8) Simplify (u(2/15)/u(3/4))/((u(-4/5)/u)/uu(6/5)) assuming u is positive. u(59/60) Simplify (xx30)3 assuming x is positive. x93 Simplify r(-2/11)rr15 assuming r is positive. r(174/11) Simplify (g(2/9))(-30/13) assuming g is positive. g(-20/39) Simplify (o5/oo(1/4)o)(-31) assuming o is positive. o(-651/4) Simplify (o/(oo(2/11)))/ooo(-7)o(-7)/o(1/5) assuming o is positive. o*(-791/55) Simplify bb*(-25/2)b*(2/81)bb assuming b is positive. b(-1535/162) Simplify v/(vv/(v/((v(v/((v/(v0v))/v))/v)/v))v)v/v*7(v/v(-1))(6/11) assuming v is positive. v(-76/11) Simplify i(2/5)/i28 assuming i is positive. i(-138/5) Simplify (t(-10)/(t(-6)/t))(-29) assuming t is positive. t87 Simplify (nnn/(nn/n(-1/9)))/n(8/11) assuming n is positive. n(16/99) Simplify ttt14/ttt(tt5)/t assuming t is positive. t22 Simplify mm*(-12/11)mmm(3/20) assuming m is positive. m(453/220) Simplify (((aa(2/3)a)/a)/(a5/a))(-1/3) assuming a is positive. a(7/9) Simplify (n(1/2))*26(n5/n)/n7 assuming n is positive. n10 Simplify (o/(o(1/2)/o)o4)/(o/((o(-3)/o)/o)o/o(6/5)) assuming o is positive. o(-3/10) Simplify u/(u/((u/u*5)/u))uu3uu(-4)/(u(-4)u) assuming u is positive. 1/u Simplify (h(-2))(3/14) assuming h is positive. h(-3/7) Simplify x(2/3)(xxxxx(4/5)x)/xxxxx(x/((x(-1/2)/x)/x))2 assuming x is positive. x(247/15) Simplify (o/(o/(o/((o/(oooo/(oo(-11))o))/o))))(-35) assuming o is positive. o(-560) Simplify w*(23/4)/ww(-5/2) assuming w is positive. w(9/4) Simplify (s/(ss/(ss*(-17))))/(s/(s(s/(s*9/s))/s)s) assuming s is positive. s*(-26) Simplify (yy*12y)(5/3) assuming y is positive. y(70/3) Simplify s*5s*(-5/4)s(s(-1/4)/ss)/ss(2/5) assuming s is positive. s(39/10) Simplify ((i/(i/(i7i))i)(2/69))(-1/13) assuming i is positive. i(-6/299) Simplify ((d(-3/5))(-31))(-2/27) assuming d is positive. d(-62/45) Simplify (z2/(z/(zz2)))(-45) assuming z is positive. z(-180) Simplify s(1/6)/(((s/s8)/s)/s) assuming s is positive. s(55/6) Simplify p/p*(1/7)p/(pp(-3)/pp) assuming p is positive. p(27/7) Simplify v(-2)/((v*(1/17)/vvvv)/v) assuming v is positive. v(-52/17) Simplify d(-11)d(-2/51) assuming d is positive. d(-563/51) Simplify f(f/((f*(-18)/f)/ff))/ff/f(-12) assuming f is positive. f33 Simplify (b(-2/9))(-5/2)bb9/b(bb/((b((b/(b(b/b(-2))/bb))/b)/b)/b))/b assuming b is positive. b(140/9) Simplify (h0/h)/h*(1/4)h*(-1)/(h/(((hh/(h*(-3/4)h))/h)/h)) assuming h is positive. h(-7/2) Simplify b8bb/(bb(1/12))bb assuming b is positive. b(131/12) Simplify p(3/32)p(26/9) assuming p is positive. p(859/288) Simplify (i/(ii(-1/7)ii))/(ii/i*(-2/19))i*(-1)i((i(i/(ii7))/i)/i)/i assuming i is positive. i(-1724/133) Simplify (u(3/10)/uu)/(u*20u) assuming u is positive. u(-207/10) Simplify (p(4/3)p)/(p/(p/(p/p(2/21)))pp)(p(-1/3)/p)(-41) assuming p is positive. p(1136/21) Simplify (w(-8)w(-1/8))(-7) assuming w is positive. w(455/8) Simplify ((gg*(1/10)/ggg)/(gg*(-2)g))(-44) assuming g is positive. g(-462/5) Simplify (iii*(-24)ii)/(iii(2/23)) assuming i is positive. i(-508/23) Simplify ((g11)(-2/101))(16/9) assuming g is positive. g(-352/909) Simplify h(3/10)/(h/h36) assuming h is positive. h(353/10) Simplify (g(-4/3)/g(-2/3))(-38) assuming g is positive. g(76/3) Simplify ss*1s*1ss(1/5)s(1/2) assuming s is positive. s(47/10) Simplify (c*(-2/9)c)/(cc/((cc/c(-8))/c)) assuming c is positive. c(70/9) Simplify ((a/(aa3))/(aa*(2/13)/aa))/(a(-1))(1/80) assuming a is positive. a(-4307/1040) Simplify s/(s(-3)/s)s/(ss/(s/(s/(s/s*(-2/13)))s)s)((sss*(-2)/ss)/s)/(s*(-2/9)sss) assuming s is positive. s*(161/117) Simplify (((yyy(-2/55))/yy)/yy)50 assuming y is positive. y(1080/11) Simplify (r(r/(rrr*(-7)/rrrr))/r)/((rr(-3/4))/rr) assuming r is positive. r*(15/4) Simplify (oo/(oo2))(-9/10)/(o(1/2))(1/4) assuming o is positive. o(31/40) Simplify n/(n/(nn*15n))n7 assuming n is positive. n24 Simplify (pp/(pp13)p/(((p*12p)/p)/p))(2/33) assuming p is positive. p(-4/3) Simplify (vv(-6))/vvv/v9 assuming v is positive. v(-13) Simplify p13p(-2/17) assuming p is positive. p(219/17) Simplify j(-3)/j11 assuming j is positive. j*(-14) Simplify ((s(s/(s*(3/7)/ss))/s)/(s(2/21)/s))(-4) assuming s is positive. s(-124/21) Simplify ((k(-22)/k)/k)/k4 assuming k is positive. k(-28) Simplify f*4f*(-6)(fff(4/9))/f(2/19) assuming f is positive. f(58/171) Simplify (l/((l/l(-2/7)l)/l))/l(-9)l(-7)/(l(-1/12)/l) assuming l is positive. l(235/84) Simplify ((f/(f(6/7)fff	{ "pile_set_name": "DM Mathematics" }
ifferentiate s(m) with respect to m. -183m2 - 8m - 1 Let i = -116 + 129. What is the second derivative of -33q + 3q*2 + iq*3 - 23q*3 + 10q*3 - 24q*4 wrt q? -288q2 + 6 Let a(f) = -f2 - 2f + 1. Let i(z) = -7z*2 - 7z - 17. Let c(g) = -9g + 82. Let l be c(9). Let q(t) = li(t) - a(t). Differentiate q(k) wrt k. -12k - 5 Let q(r) be the first derivative of 0r*2 - 54 + 0r - 28/3r3 + 14/5r*5 + 5/4r*4. What is the third derivative of q(h) wrt h? 336h + 30 Find the third derivative of -22p6 + 3p*6 + 310p*2 + 81p*2 - 13p*6 wrt p. -3840p*3 Let j(g) be the first derivative of -1042g3/3 + g2/2 - 58g - 1591. What is the second derivative of j(o) wrt o? -2084 Let l(c) = c2 + c + 5. Let r(n) = -9446n*2 - 8047n + 15. Let h(j) = 3l(j) - r(j). What is the second derivative of h(z) wrt z? 18898 Let t(f) = -3f*3 + 2f*2 - 1. Let n(q) = -1194q*3 - 2q*2 - 13q - 115. Let d(y) = n(y) + t(y). What is the second derivative of d(u) wrt u? -7182u Let u be (-3)/(-1) + 3 - 2. Suppose -18 = -3o + 4r, 0o - 5 = -uo - r. Differentiate -137i*2 + 15i*4 + 6 + 137i*2 + o wrt i. 60i*3 Let c(g) be the first derivative of 8g*3/3 + 3g*2 - 460g - 872. What is the first derivative of c(f) wrt f? 16f + 6 Suppose -8 = -0o - 2o - i, -5o + i + 27 = 0. Let m = -928 - -931. What is the first derivative of -6 + o - 1 - 5h3 - 4h*m wrt h? -27h2 Let v(o) = -o3 - o*2. Let n be v(0). Let m(w) be the first derivative of nw5 - w5 + 14w2 + 4w*5 - 25. What is the second derivative of m(i) wrt i? 180i*2 Suppose 0 = -5g + 17 + 3. Suppose -gw - 2i + 8 = 0, 4i + 2 = 4w - 6w. What is the derivative of -8 - 22n*3 + 3n*2 - 3n*2 - 19n*w wrt n? -123n*2 Let w(p) be the first derivative of 22 - 2/3p3 + p4 + 0p + 31p*2. Find the second derivative of w(r) wrt r. 24r - 4 Let s(v) = v6 - v3 - v - 1. Let p(g) = -2425g6 - g3 - 186g*2 - g - 2. Let x(r) = p(r) - s(r). What is the third derivative of x(b) wrt b? -291120b*3 Let n(z) = 1251z*3 + 7z*2 - 1241z + 4. Let u(d) = -313d3 - 2d*2 + 310d - 1. Let w(p) = -2n(p) - 9u(p). Find the second derivative of w(h) wrt h. 1890h + 8 Find the third derivative of -224j*3 + 378j*3 + 449j*3 + 691j*2 + 323j*2 wrt j. 3618 Suppose -5j + 5 = -4j, 3z - 3j = 3. What is the derivative of -zc*3 + 145 + 56c*3 - 99 wrt c? 150c*2 Differentiate -1321q*4 - 1312q*4 - 854 + 2245q*4 wrt q. -1552q*3 Let l = -26701/6 + 4453. Let b(h) be the second derivative of lh*3 - 4h + 0 + 9/2h2. What is the first derivative of b(k) wrt k? 17 What is the third derivative of -83t*2 + 795t*3 - 5t - 548t2 + 5t - 791t3 - 35t*5 wrt t? -2100t*2 + 24 Let h(n) be the second derivative of 0n*6 + 1/6n*4 + 0n*5 + 0 - 37/42n*7 - 5n*2 + 68n + 0n3. What is the third derivative of h(x) wrt x? -2220x*2 Let u(z) be the third derivative of 0 - 7/10z*5 + 0z*4 + 0z - 65z2 - 1/15z*6 + 0z*3. What is the third derivative of u(a) wrt a? -48 Suppose 0 = 2f - 4o + 9o - 29, -4o + 28 = 4f. What is the third derivative of -4139g2 + 98g*4 + f - 2 + 4200g*2 wrt g? 2352g Suppose 0 = -3n - 0n - 21. Let j = 16 - n. Find the third derivative of -jh2 + 0h*2 + 2h*2 - 9h3 - h3 wrt h. -60 What is the second derivative of -3v + 938 - 538 + 54v*3 - 506 - 9v*2 wrt v? 324v - 18 Let t = -18 + 24. Let z(c) = -2c + 14. Let o be z(t). Find the second derivative of -10b - 10b + 2b*2 + 10b*o + 8b wrt b. 24 Find the third derivative of -196j5 - 352j2 + 15 - j3 - 1462j4 + 198j*5 + 432j*2 wrt j. 120j*2 - 35088j - 6 Suppose -3q = -p + 3, 0 = -3q - 4p + 12. Suppose qz + 4 = -z - 3t, 2t = -z. Differentiate -2d2 + 12d*2 - 4d*2 + 1 + zd*2 with respect to d. 28d Let s(l) = -1363l3 + 7l*2 - 6l + 244. Let k(w) = -1364w3 + 7w*2 - 4w + 242. Let j(a) = 3k(a) - 2s(a). Find the third derivative of j(d) wrt d. -8196 Let n = -2121 - -2121. Let p(t) be the first derivative of -23/2t2 + 0t + nt3 + 22 + t4. What is the second derivative of p(k) wrt k? 24k Suppose 428 + 10 = 3m. Differentiate m - 6u*4 + 61 + 9u*4 + 6u*4 - 3u*4 - 9u*3 wrt u. 24u*3 - 27u*2 Find the first derivative of -2063o + 555 + 5072o - 2251 wrt o. 3009 Let d(t) be the second derivative of -97t*6/15 + 4t*4/3 + 124t*3/3 - 19t*2/2 - 6746t. Find the second derivative of d(n) wrt n. -2328n2 + 32 Suppose -25 = -13z + 53. Find the third derivative of 8x3 - 12x*z - 22x*5 + 114x*2 + 5x*6 + 22x*5 wrt x. -840x*3 + 48 Let t(s) be the first derivative of -113s*5/5 - 1607s + 332. What is the first derivative of t(x) wrt x? -452x3 Let x(w) be the first derivative of -w6/2 + 141w*4/4 + 231w*2/2 + w - 1051. What is the second derivative of x(j) wrt j? -60j*3 + 846j Let m(u) be the third derivative of -181u4/24 + 37u*3/3 + 7u*2 + 3u. What is the first derivative of m(t) wrt t? -181 Let a(k) be the second derivative of 0 - 27/2k2 + 0k*3 - 19/12k*4 - 35k. What is the first derivative of a(c) wrt c? -38c Let s(n) be the second derivative of 1331n*5/5 + 4259n*3/6 - 766n - 3. Find the second derivative of s(p) wrt p. 31944p Let t(j) be the first derivative of -5/2j*2 - 5j + 0j3 + 1/2j*4 - 28. Find the second derivative of t(u) wrt u. 12u Let h(g) be the second derivative of -2291g7/42 - 695g*3/2 + 1962g. What is the second derivative of h(k) wrt k? -45820k3 Suppose m - 2q - 2534 = -m, -m + 3q = -1275. What is the first derivative of -1263w - 39w4 + mw - 24 wrt w? -156w3 What is the first derivative of -35q*2 - 38q*3 - 62q*2 + 149 - 3124 + 36q*3 wrt q? -6q*2 - 194q Let g be ((-4)/3)/((-2)/9). Suppose 4c = g + 2. Find the third derivative of 4z + 5z2 + 6z*4 + 5z*c - 4z wrt z. 144z Find the third derivative of -41b*2 + 1 + 212b*2 - 912b*4 + 33b*2 + 72b*2 wrt b. -21888b Let v(k) be the third derivative of 136k4/3 + 1439k3/2 + k2 + 142k. What is the first derivative of v(w) wrt w? 1088 Let d(v) be the first derivative of 15 + 1/3v*4 + 0v + 1/2v3 - 3/2v*2. Let a(n) be the second derivative of d(n). Differentiate a(l) wrt l. 8 Let s(x) be the second derivative of 1357x*4/6 + 3310x*2 + 5x - 54. Find the first derivative of s(p) wrt p. 5428p Let b(n) be the first derivative of -233n*3/6 - 28n*2 - n - 183. Let o(h) be the first derivative of b(h). Differentiate o(a) with respect to a. -233 Let q(u) be the second derivative of -2/7u*8 + 0u*6 - 215/12u*4 + 0u*5 + 0u*7 + 0u*3 + 0u*2 + 2 + 166u. Find the third derivative of q(w) wrt w. -1920w3 Let z(m) be the first derivative of -877m4/4 - m3 + 888m + 1676. What is the third derivative of z(c) wrt c? -5262 Let b(u) = 1372u*3 + 13u - 3268. Let m(c) = 2c3 + 3c - 1. Let z(f) = -b(f) + 3m(f). Differentiate z(y) with respect to y. -4098y*2 - 4 Let i(f) be the first derivative of 730f*4 + 158f*2 + 1521. What is the second derivative of i(g) wrt g? 17520g Let w be 5/10(-85 + -1). Let u = w - -40. Let f(m) = m - 1. Let x(h) = 2h*2 + 3h - 20. Let s(d) = uf(d) + x(d). Find the first derivative of s(a) wrt a. 4a Let s(d) = -11d3 - d2 - 2d + 1. Let w(b) = 2565b3 + 2944b*2 - 8b + 4. Let g(a) = -4s(a) + w(a). What is the third derivative of g(h) wrt h? 15654 Suppose 4i - 261 = -d, 1239 = 5d - 23i + 21i. What is the first derivative of 31f - 2 - df3 - 49 + 251f*3 wrt f? 6f*2 + 31 Let o(m) = 7m*2 + 7m - 53. Let i(x) = -x - 1. Let c = 34 - 35. Let b(s) = co(s) - 5i(s). What is the first derivative of b(y) wrt y? -14y - 2 Let r(j) = 68j - 92. Let x(w) = -4w + 7w - 3w + w. Let z(k) = -r(k) + 5x(k). What is the first derivative of z(g) wrt g? -63 Let k(j) be the second derivative of 22 + 11/42j7 - j + 0j*4 + 0j*5 + 0j*2 + 0j*6 - 7/3j*3. Find the second derivative of k(i) wrt i. 220i*3 Suppose 3q - 508 = -g, 3q + 0g - 3g = 504. What is the third derivative of qb*2 - 558b*2 + 51b*3 - 143b*3 + 174b*2 wrt b? -552 Find the first derivative of -2j*2 - 37391j*3 + 417 + 37133j*3 - 6212 wrt j. -774j**2 - 4	{ "pile_set_name": "DM Mathematics" }
= 3o + 19. Let a(m) = 10m*2 - 2m + 2. Let w(q) = -21q2 + 5q - 5. Determine vw(l) + 5a(l). 8l2 Let m(b) = -b3 + 2. Let x = -3 - -7. Let r(j) = 8j*3 - 146 - 13j*3 + 147 + 4j*3. What is xr(y) - 2m(y)? -2y*3 Let m(l) = -11l*2 - 2l + 5. Suppose -2n = g - 21, 3g + n - 4973 = -4950. Let s(y) = -6y2 - y + 3. Let q be -32/(-4)-2. What is gs(p) + qm(p)? 3p*2 + p Let a(h) = 8h + 10. Suppose -670 = 566t - 567t. Let o = t - 676. Let r(b) = -7b - 9. Calculate or(z) - 5a(z). 2z + 4 Let c(b) = -123b3 - 7b*2 - 7. Let s(p) be the third derivative of 41p6/60 + p5/12 + 5p3/6 + p2 - 6p - 3. Determine 5c(d) + 7s(d). -41d3 Let v(m) = 2m*3 - 4m*2 - 4m - 3. Let o(p) be the first derivative of -p4/4 + p3 + 3p2/2 + 2p - 4735. Give 4o(w) + 3v(w). 2w3 - 1 Let x(p) = -3p*3 - 19p*2 + 4p - 81. Let l be x(-7). Let o(y) = -3y - 1. Let w(a) = 15a + 5. Calculate lo(k) - 2w(k). 3k + 1 Let c(i) = 5i*2 + 41i - 75. Let t(b) = 6b2 + 41b - 88. What is -7c(a) + 6t(a)? a*2 - 41a - 3 Let r = -456 + 284. Let n = r + 261. Let v = n - 84. Let t(k) = 7k3 - 2k. Let c(h) = h*3 - h. What is vc(g) - t(g)? -2g3 - 3g Let s(o) = -3o2 + 8o - 503. Let d(u) = u*3 - 5u*2 + 20u - 1005. Give -2d(q) + 5s(q). -2q3 - 5q*2 - 505 Let l(t) = -6t - 4. Suppose -233 = 2u - 223. Let f(y) = y - 5. Let m(s) = -3s + 7. Let p(x) = um(x) - 8f(x). Let r = 4 + -6. What is rp(a) - 3l(a)? 4a + 2 Let y(b) = -4b + 16. Let q(w) be the third derivative of -w3/6 - w2. Let f(d) = -6d2 - 1600d + 4838. Let j be f(3). Determine jq(i) - y(i). 4i Suppose -14 = -3n - 4n. Suppose -3z = 2s - 1 + 11, -ns + 22 = -5z. Let a(v) = 3v2 - 4v - 2. Let t(r) = r. Calculate sa(m) + 4t(m). 3m2 - 2 Let v(r) = 5864013r*2 + 6635r - 13270. Let b(k) = -2651k2 - 3k + 6. Calculate 6635b(d) + 3v(d). 2654d2 Let m = -431 - -434. Let n(z) be the third derivative of z4/6 - z3/2 + z2. Let g(x) = -4x + x - 2 + 6x. What is mg(f) - 2n(f)? f Let k(j) = 2j*2 + 4j. Suppose -36w = -41w. Let t(p) = -p - p + wp + p. Calculate k(y) + 4t(y). 2y2 Let r(p) = 2p*3 - 2p*2 + 2p. Let o(j) = -6j3 + 10j*2 - 9j - 41. Give o(m) + 5r(m). 4m*3 + m - 41 Suppose 4t = 40t + 7020. Let x = t - -199. Let h(f) be the first derivative of -f2/2 + 3f + 1. Let c(w) = -1. What is xh(a) + 11c(a)? -4a + 1 Let t(x) = -4x*3 - 19x*2 + 11x + 10. Let z(s) = 1 - 3 - 25s3 - 2s + 4s2 + 45s*3 - 19s*3. What is 2t(o) + 11z(o)? 3o*3 + 6o*2 - 2 Let r(q) = 259q*2. Let d(m) = 1651m*2 + 169m - 1521. Let u(g) = -59g2 - 6g + 54. Let h(c) = -6d(c) - 169u(c). Give -9h(p) + 2r(p). -67p2 Let n(a) = -88a + 3 - 82a + 171a - 4 + a*2. Let x be 15/(15/(-3)). Let l(j) = -j*3 - 2j*2 - 3j + 1. Calculate xl(d) - n(d). d3 + d2 + 2d Let f be -8 + 19/2 - (-9)/(-2). Let d be (-4)/(-24) - (-46)/12. Let b(g) = 9g + dg - 1 - 16g. Let m(h) = 4h + 2. Calculate fb(r) - 2m(r). r - 1 Let n be 14/2 - (-7 + 7). Suppose -3i = -3u + 3, -u + 6 = 2i - n. Let g(z) = 14z*3 + 5z*2 - 5. Let k(o) = -21o*3 - 7o*2 + 7. What is uk(h) + 7g(h)? -7h*3 Let k(x) = x - 1. Let u(d) = 108 + 600d + 602d - 1914d + 640d. What is 108k(s) + u(s)? 36s Let g(k) = -k - 205. Let a(b) = -4b - 220. What is 4a(r) - 6g(r)? -10r + 350 Let x(h) be the first derivative of -5h*2/2 - 8h - 6223. Let y(m) = 15m + 23. Calculate 17x(i) + 6y(i). 5i + 2 Let y(o) = o + 9. Let r(p) = -2p - 27. Let u(v) = 1. Let l(q) = -r(q) - 5u(q). Suppose 3s - 460 = 5. Let b = -150 + s. Calculate bl(t) - 12y(t). -2t + 2 Let g(y) = 2y2 + 18352 - 5y - 18352. Suppose 0 = -3t - 2c - 3 + 16, -5t + 4c + 29 = 0. Let d(n) = -2n2 + 6n. Calculate td(j) + 6g(j). 2j2 Let q(t) = -10t - 6135. Let p(s) = 3s + 2049. Give 7p(u) + 2q(u). u + 2073 Let i(x) = 23x*3 + 245x*2 - 10x - 2. Let q(v) = -19v3 - 245v*2 + 8v + 3. Calculate 5i(d) + 6q(d). d*3 - 245d*2 - 2d + 8 Let q(n) = 18n + 5n*3 + 6n*2 + 12n - 57n + 18n + 10n. Let u be (3(0 - 1))/(1/(-1)). Let x(p) = 9p3 + 11p*2 + p. Give ux(s) - 5q(s). 2s*3 + 3s*2 - 2s Let t be (-1 + -5 - (65 + -67)) + 0 + 8. Let m(c) = 2c2 - 3c - 7. Let y(u) = u + 10u2 - 4 - 3u - 9u2. Give tm(f) - 7y(f). f2 + 2f Let q(o) = -2o3 - 29o*2 + o - 12. Let r(t) = -5t*3 - 86t*2 + 4t - 33. Determine -11q(j) + 4r(j). 2j3 - 25j*2 + 5j Let b(l) = -12l2 - 2l - 2. Let a(p) = -265p2 - 45p - 45. Let d(w) = 803w - 12893. Let m be d(16). What is mb(v) + 2a(v)? 10v*2 Let q(i) = -24i*3 - 10i*2 + 4i + 4. Let t(z) = -3z3 + 4z*2 - 2z. What is q(g) + 2t(g)? -30g*3 - 2g2 + 4 Let o(g) = -g3 + 2g2 + g - 3. Let b(y) = -37944y*3 + 63240y*2 + 31620y - 94860. What is b(t) - 31620o(t)? -6324t3 Let x(v) = -v3 + 3v2 + 2. Let s(j) = -j3 + 2j*2 + 2. Let n = -2867 - -2873. Calculate nx(o) - 5s(o). -o3 + 8o*2 + 2 Let z = 27 - 23. Let i be ((11 - 9) + (-3)/z)4. Let v(c) = -8c3 - c2 + 7c - 5. Let g(r) = r*3 - r + 1. Determine ig(j) + v(j). -3j3 - j2 + 2j Let q(w) = 14w + 15. Let p(l) be the second derivative of -5l*3/6 - 5l*2/2 + 1362l. Give 8p(d) + 3q(d). 2d + 5 Suppose -4x + 21 = 1. Let q(u) = xu + 95 - 95 + 0u. Let i(c) = -4c - 3. Let b(f) = -7f - 5. Let w(o) = 3b(o) - 5i(o). Calculate -6q(v) - 33w(v). 3v Let r(u) = -18u*2 + 58. Let q(h) = 6h*2 - 21. Let f(d) = -11q(d) - 4r(d). Let k(s) = -2 + 1 + 5s*2 + 0s*2. Determine -3f(m) + 4k(m). 2m*2 - 1 Let y(x) = 34x*2 + 36x - 1. Let m(h) = 2h2 - 7h. What is 6m(z) + y(z)? 46z*2 - 6z - 1 Let h(b) = 8 - 6 + 2 + 10 - 6b. Let d(y) = 2y - 5. Let k be (-1)/983 + (-2)/(-9). Let l be -3-112/k. Calculate lh(j) - 11d(j). 2j - 1 Let m(h) = -3h + 3. Suppose 10f + 6 = 7f. Let t(q) be the first derivative of q2 - 4q - 280. Calculate ft(g) - 3m(g). 5g - 1 Suppose -6 + 42 = 12x. Let s be 96/16 + x + 2. Let r(d) = -2d + 8. Let p(b) = 3b - 15. Give sr(o) + 6p(o). -4o - 2 Let q(k) = -5k*3 + 130k*2 - 3k - 11. Let u(b) = -6b3 + 130b*2 - 2b - 15. Calculate -4q(x) + 3u(x). 2x3 - 130x*2 + 6x - 1 Let i(w) = -12w3 - 9w*2 - 7w + 9. Let d be -14 + (-9 + 0 - -19). Let q(o) = 6o3 + 4o*2 + 3o - 4. Calculate di(j) - 9q(j). -6j3 + j Let b(i) = -2i + 1134. Let f(m) = 2m - 1118. What is -4b(r) - 3f(r)? 2r - 1182 Let m(n) = -287n2 - 6n - 6. Let h(l) = 577l2 + 13l + 13. Give -6h(o) - 13m(o). 269o2 Let w(z) = 8z - 160. Let v(m) = -3. Determine -5v(t) + w(t). 8t - 145 Let c(g) = -5g - 1. Let f(d) = -d - 1. Let n be 16/(-12)(-105)/(-28). Let w be 0 - ((-12 - n) + 8). Determine wf(t) + c(t). -4t Let p(y) = 11y + 2762. Let v(l) = -300l - 74570. What is 55p(b) + 2v(b)? 5b + 2770 Let z(n) = -399n*2 + 2n + 34. Let a(s) = -395s2 + 3s + 41. What is 5a(t) - 6z(t)? 419t2 + 3t + 1 Let f(q) = 13q3 + 2q*2 + 5q - 5. Let c(p) = -p*3 - 3p - 3. Let k(t) = 4t3 + t2 - 7t - 11. Let j(r) = -3c(r) + k(r). Calculate 2f(n) - 5j(n). -9n3 - n2 Let f(r) = -18r3 + 2r. Suppose 0 = -5u - 35, -703b - 5u = -699b + 23. Let a(n) = 17n3 - 3n - 1. Give bf(c) + 2a(c). -20c3 - 2 Let k(o) = 10o + 5. Let x(n) = -9n - 4. Suppose -13p + 4l - 26 = -15p, -7 = -3p + 2l. Calculate pk(f) + 6x(f). -4f + 1 Let w(n) = -n + 4120. Let r(u) = -3u + 12354. Calculate 6r(x) - 17w(x). -x + 4084 Let c(m) = 8m2 - 2m - 5. Let p(w) = 3w2 - 568w - 1142. Let l be p(-2). Let z(b) = b*2. Calculate lz(n) - c(n). -2n2 + 2n + 5 Let f(u) = 7u3 - 143u*2 + 15u + 10. Let l(t) = -3t3 + 72t*2 - 6t - 4. What is 2f(a) + 5l(a)? -a*3 + 74a*2 Let a(r) = 19r + 2. Let d(p) = 9p + 1. Let w = -728 + 735. What is wd(b) - 3a(b)? 6b + 1 Let n(o) = o*2 + o. Let w(f) = 16f*2 + 3f. Calculate 18n(m) - 2w(m). -14m2 + 12m Let q(t) = -3t2 - 3t + 1. Let j(o) = -5o2 - 7o + 2. Suppose -104f - 73 = 863. Determine fq(b) + 4j(b). 7b*2 - b - 1 Let k(i) = -15i - 2. Let x(u) = -23u + 1. Let q(h) = 12h. Let j(g) = 5q(g) + 2x(g). Let w be (-2 - (-3)/1) + 18/3. Calculate wj(c) + 6k(c). 8*c	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.