Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
4f = 325 + 111, 0 = -2l - 4f + 216. Calculate the greatest common divisor of n and l. 10 Suppose -6f - 3580 = 20f - 15410. Calculate the greatest common divisor of f and 1105. 65 Let k(p) = -p3 + 4p*2 + 39p - 2. Let n be k(-7). Calculate the highest common factor of n and 2328. 24 Suppose 4l = 12, 4z + 5l - 154 = 3l. Suppose zj - 42j = -2340. Calculate the highest common factor of 52 and j. 52 Let o(b) = -2b + 13. Let m be 130/396/4. Let i be o(m). Suppose -ih + 32 + 478 = 4p, -636 = -5p - 3h. What is the highest common factor of 14 and p? 14 Suppose 51t = 13t + 3914. What is the greatest common divisor of t and 927? 103 Let u be 146/10 + 63/(-105). Suppose -ut + 11t - 420 = 0. Let v = t + 257. Calculate the greatest common divisor of v and 39. 39 Let j = 70 + -66. Let h(d) = 38d - 6. Let t be h(j). Let u = t - 94. What is the highest common factor of 65 and u? 13 Let t(i) = 5i*3 - 9i*2 + 1135i - 3408. Let b be t(3). Suppose o = 4o - 54. Calculate the greatest common factor of b and o. 3 Let y = 10028 + -10019. Suppose 25 = 3x - 0x + 2b, -3b = 4x - 33. Calculate the highest common divisor of y and x. 9 Suppose 368706 = -10p + 97p. What is the highest common divisor of 26 and p? 26 Let t(q) = 4q2 + 8q + 8. Let g be t(-4). Let i = g + -28. What is the highest common divisor of i and 156? 12 Suppose -3w + 21o - 24o = -357, -4w + 458 = 2o. Suppose -5n = -h - 10, 5h - 2n = -4n + 58. Calculate the greatest common divisor of h and w. 10 Let l be ((-4)/(-16) + (-17256)/32)-1. Suppose -j + f + 2f + 20 = 0, 0 = -2j - 3f + 13. What is the greatest common divisor of j and l? 11 Suppose -127m + 3306 + 1192 = 46m. What is the greatest common divisor of m and 14456? 26 Suppose -6x + 0 = 282. Let o = -15 - x. What is the greatest common factor of 112 and o? 16 Suppose -22 = 3w - 16. Let o be w + (72/8 - -11). What is the highest common factor of 54 and o? 18 Suppose 40x = 653 + 3347. Calculate the highest common divisor of 500 and x. 100 Let n(v) = -3 + 2 - 1 + 16v2 - 5v. Let p = -1021 + 1025. Let f be n(p). Calculate the highest common factor of f and 26. 26 Let h be 3 + 16/(-8) - -1. Suppose -g - 2s = -374, -3s - hs = 4g - 1493. Calculate the greatest common divisor of g and 12. 12 Let z be 3 - 4/(-8)(20 - 12). Calculate the greatest common divisor of 1792 and z. 7 Let r(l) = 6l*3 - 7l*2 + 14l + 73. Let p be r(8). Calculate the greatest common divisor of 318 and p. 53 Let g = 7156 + -2586. What is the highest common factor of g and 40? 10 Let w(i) = 4i2 - 23i - 462. Let v be w(-12). Calculate the greatest common divisor of 2184 and v. 78 Let h(f) = -2f2 - 7f. Let d be h(-3). Suppose -5k + 4v - 258 = 0, dk + 126 + 51 = -5v. Let i = k - -87. What is the greatest common factor of 22 and i? 11 Suppose -1275i = -1273i - 24. Suppose 0 = -4z + 285 - 45. What is the highest common factor of z and i? 12 Let c(r) = -r3 - 53r*2 - 155r + 290. Let p be c(-50). Calculate the highest common divisor of 255 and p. 15 Suppose -118 = 3y - 373. Let k be ((-204)/y)/((-4)/(-10)). Let o = k - -18. Calculate the highest common factor of o and 3. 3 Let w be (9 - (-444)/(-42))19544/(-8). Calculate the greatest common factor of 22 and w. 11 Suppose a - 5a + 60 = -3s + 7s, s = 0. What is the greatest common divisor of a and 7635? 15 Let r(y) = -y + 13. Let b be r(9). Let k(u) = u - 2. Let l be k(6). Suppose 0s = ls + ba - 220, 4 = a. Calculate the highest common divisor of 17 and s. 17 Let r be (-1)/(-5) - 717/(-15). Suppose u + g - 230 = 397, -10g - 12 = -14g. Calculate the greatest common factor of u and r. 48 Suppose 7j - 11 = 3. Let y be j/(-3) - -3(-4)/9. Let c be ((-12)/12)/(y/1561). What is the highest common divisor of 39 and c? 39 Suppose 0 = -6j + 34 - 16. Suppose -4b = -jb + 4k - 104, 3b + k - 279 = 0. Calculate the greatest common divisor of b and 4. 4 Let c = 1722 - 1542. Calculate the highest common divisor of 306 and c. 18 Let w(k) = k*3 - 26k*2 + 27k + 73. Let r(b) = -5b + 5. Let j be r(-4). Let t be w(j). What is the highest common factor of t and 41? 41 Let r = 202 - 198. Suppose rd - 13 = -a, 0 = -0a - 4a + 4. Calculate the highest common factor of d and 51. 3 Suppose -659 = -3l - s, -17l = -12l + 3s - 1105. Let b = -108 + l. Suppose 0 = f - 4 - 6. What is the greatest common factor of b and f? 10 Let f be (6/(-4))/((-5)/110). Let c be f/(-2)40/(-30). Suppose -3m - 4 = -c. Calculate the greatest common factor of m and 66. 6 Let o be 2212/26 - (4427/(-247) + 18). Let x(k) = -10k - 6. Let j be x(-4). Calculate the highest common divisor of j and o. 17 Suppose 4q - 4b - 112 = 0, 10q - 2b + 112 = 15q. What is the highest common factor of q and 2616? 24 Let v = 7 - -8. Let x(q) = -8q - 7q + 7q + 9. Let h be x(-12). What is the highest common divisor of h and v? 15 Suppose 2988 = 6z - 3u, 48z - 52z - u = -1986. Calculate the greatest common factor of z and 49. 7 Suppose n - 4d - 425 - 69 = 0, 5n = -4d + 2470. What is the greatest common divisor of n and 26? 26 Let z be (-19716)/(-15) + (-6)/15. Calculate the greatest common factor of z and 72. 18 Let h be 721 - ((-25)/(250/12) + (-18)/(-15)). Calculate the greatest common factor of 14 and h. 7 Suppose -55c = 50c - 106c + 3468. What is the greatest common divisor of 255 and c? 51 Let r(l) = 3l + 107. Let d be r(-29). Let g = 16 + d. What is the greatest common factor of 24 and g? 12 Let f be (2 + -90)(-12)/((-384)/(-112)). Suppose 4d - i - 11 = 46, 33 = 2d - 5i. What is the highest common divisor of f and d? 14 Let z be (-47)/(-329) + 36222/21. What is the highest common factor of z and 138? 69 Suppose -m + 22445 = 5u, 16u - 20u - 3m = -17967. Calculate the highest common factor of u and 66. 66 Let a(o) = -10 - 2o - o - 11o + 7o. Let n be a(-2). Suppose 4h = ng - 180, 5g = 3h + 228 - 9. What is the highest common factor of 63 and g? 21 Suppose 0 = 4t - 8t - 2x + 42, -t = 2x - 6. Suppose -tl + 13l = 0. Suppose 3z + 5z - 8 = l. What is the greatest common divisor of z and 4? 1 Let x(i) = 2i*3 + 26i*2 - 21i + 147. Let j be x(-14). Calculate the highest common divisor of 1953 and j. 7 Let f = 2559 - -7181. Calculate the highest common divisor of 20 and f. 20 Suppose 5a + 138 = 4d, -4d + 1541 - 1417 = 2a. What is the greatest common factor of 296 and d? 8 Let b(d) = -9d3 - 13d*2 - 23d + 15. Let z be b(-5). What is the highest common factor of z and 72? 6 Let d = 3 - 7. Let a be d9/12 + 19. What is the greatest common factor of 80 and a? 16 Let q be (-97722)/(-20) - 16/160. What is the highest common factor of 28 and q? 14 Suppose -163 + 173 = 5p, 4916 = 4m - 2p. What is the highest common divisor of 90 and m? 30 Let d = 79 - 79. Suppose -3l - 5t + 4 + 29 = 0, d = 2l - 3t - 22. Suppose 0 = -lm + 58 + 8. Calculate the highest common factor of 4 and m. 2 Suppose -j + 112 = 307. Let o = j - -233. Calculate the highest common divisor of o and 19. 19 Let w = -96 - -109. Suppose 5y = 5f - 60, -9f = -wf + 2y + 48. What is the highest common factor of 48 and f? 12 Suppose -56g + 3b + 36 = -53g, -2g = b - 15. Calculate the greatest common divisor of g and 2250. 9 Let k = -577 - -751. Let j = 293 - k. What is the highest common factor of j and 34? 17 Let y = 44 - 33. Let i(f) = -37f - 1329. Let x be i(-38). Calculate the greatest common divisor of y and x. 11 Let l = 375 - 362. Suppose -t + lg = 9g - 70, 4g - 30 = -t. What is the highest common divisor of 250 and t? 50 Let t(u) = -u*3 - 10u*2 + 33u - 10. Let n be t(-15). What is the highest common divisor of n and 837? 31 Let l(m) = -906m - 12040. Let o be l(-14). Calculate the highest common factor of 16 and o. 4 Let r = 420 - 204. Suppose 0 = -2p - 6k + 66, 3k - 60 = 7p - 9p. What is the greatest common divisor of p and r? 27 Suppose 6030 = 17w - 532. Suppose 1704 + w = 5n. What is the highest common divisor of 38 and n? 38 Let a(v) = 86v - 6. Let l be a(1). Suppose 76 = w - 3c, w - 5c - l = -0c. What is the greatest common factor of w and 5? 5 Suppose 0 = 46m - 19m - 4671. Let z = 183 - m. Calculate the greatest common divisor of z and 320. 10 Suppose -4*p -	{ "pile_set_name": "DM Mathematics" }
11y - 6y - 2y - 4y. Let j(f) = f. Let a(h) = 2j(h) - l(h). Let o(p) = -8p*2. Give a(o(t)). -24t*2 Let n(p) = 2p*2. Let a be -1 + 192/27 - 15/135. Let v(o) be the third derivative of -ao*2 + 0o + 0o3 + 1/12o*4 + 0. Give n(v(b)). 8b*2 Let i(q) = 2q. Let z(m) = -870m2. Determine i(z(t)). -1740t*2 Let b(k) = -37k*2 + 40k. Let p(a) = 46a2 - 41a. Let f(v) = 5b(v) + 4p(v). Let n(l) = 2l2. Give n(f(s)). 2s*4 - 144s*3 + 2592s*2 Let h be 344/3 + (-8)/12. Let b be (-22)/77 - h/(-7). Let v(w) = -44w*2 + 16w*2 + bw*2. Let l(p) = -2p. Give v(l(t)). -48t2 Let l be ((-3)/6)/((-2)/8). Let t(p) = lp + 4 - 4 + p. Let w(d) = -5d. Let o(g) = -5g. Let z(q) = 4o(q) - 5w(q). What is t(z(k))? 15k Let k(i) = 319360i*2. Let c(b) = 2b*2. Give k(c(u)). 1277440u*4 Let f(l) = 2l. Let z(p) = p + 1. Let v = -49 - -53. Let s(y) = -3y - 2. Let x(w) = vz(w) + 2s(w). Give f(x(m)). -4m Let f(a) = -2a. Let i be f(-1). Let c = 6 - i. Let w(p) = -p - p + cp. Let t(q) = -q. Give w(t(z)). -2z Let f(p) = -5p*2. Suppose 3t - 4l + 12 = t, 4t - 3l + 19 = 0. Let j(g) = -g2 - 2g - 2. Let k(u) = u + 1. Let q(w) = tk(w) - 2j(w). Determine f(q(y)). -20y4 Let k(s) = 11s*2. Let i(b) = -3b*2 - 68982. Give i(k(d)). -363d*4 - 68982 Let m(b) = -7b*2 + 12b. Let d(y) = -12y2 + 20y. Let o(w) = 3d(w) - 5m(w). Let f(a) be the third derivative of -13a5/60 + a2. What is o(f(g))? -169g*4 Suppose -7b + 6b + 2 = 0. Suppose 13 = 3w - k, w - 2 = 3w + 2k. Let j(o) = wo + 6o - bo. Let l(q) = 2q. Give l(j(h)). 14h Let c = -68 + 67. Let k(f) = 5f*2 + f. Let n(d) = -d. Let r(i) = ck(i) - n(i). Let u(o) = 11o2. What is r(u(t))? -605t*4 Let n(r) = -2r*2. Let a(u) = -1535u*2 - 436u. Calculate a(n(v)). -6140v4 + 872v*2 Let y(h) = -35h - 10. Let x(t) = -52t - 16. Let u(g) = -5x(g) + 8y(g). Let b(d) = 7d. Calculate b(u(l)). -140l Let k(z) = -11z*2. Let o(r) be the second derivative of -7r*3/6 - 9r. What is o(k(u))? 77u2 Let d(l) be the first derivative of -17l*2/2 - l - 223. Let z(w) = 3w. Determine d(z(n)). -51n - 1 Let m(c) = 4c2. Let h = 2 + -8. Let o(z) = z3 + 7z2 + 6z + 2. Let u be o(h). Let x(a) = a*2 - 2a*2 - 2a*u. Determine m(x(b)). 36b*4 Let m(d) = -17d - 374. Let f be m(-22). Let j(x) be the second derivative of 7x + fx*2 - 7/6x3 + 0. Let g(n) = n2. Calculate j(g(s)). -7s2 Let u(d) = -9d + 3d + 5d. Let h(b) = 15b. Determine u(h(n)). -15n Let b(p) = 2p2 - 7p2 + p2. Suppose -2t = -6, 0z = 2z + 4t - 4. Let u(q) = -6q. Let g(w) = 2w. Let l(j) = zu(j) - 11g(j). Give l(b(d)). -8d2 Let f(p) = 5p. Let b(u) = 49u. Let j(n) = -145n. Let r(g) = -8b(g) - 3j(g). Give f(r(h)). 215h Let j(n) = n - 4 + 4. Let h = 31 + -37. Let y(f) = -12f + 7. Let s(q) = 11q - 6. Let u(t) = hy(t) - 7s(t). Calculate u(j(z)). -5z Let o(s) = -4s + 2. Let a(d) = 1174d. Determine a(o(g)). -4696g + 2348 Let o(z) = -3z*2. Let c(a) = -376608a. Give c(o(s)). 1129824s2 Let q(x) = -2x. Let r(g) = g*2 + 11g + 13. Let d be r(-10). Let k(f) be the second derivative of -8f + 5f3 - f3 - df3. Give q(k(p)). -12p Let m(z) = 3z2 - 5. Let q(u) = u2 - 1. Let y be (2 + 3)/((-6)/6). Let g(t) = yq(t) + m(t). Let c(r) = -3 + 5r2 + 3. Calculate c(g(a)). 20a*4 Let o(u) = -2u*2. Suppose 0b - 12 = 2i - 5b, 0 = 4i + 5b - 36. Let s(r) = -6r + ir + 2r + 2r. Calculate o(s(t)). -8t2 Let a(v) = -2v*2 - 11v. Suppose 0 = 4n - 0n - 8. Let q(m) = -172 + 172 + nm2. What is a(q(c))? -8c*4 - 22c*2 Let r(n) = 2n*2. Let z(x) = 36x + 58x - 1 + 1. Give z(r(w)). 188w*2 Let b(m) = 123517m. Let v(r) = -2r. Determine b(v(q)). -247034q Let x(m) = 2m2. Let s(r) be the third derivative of 0 - 11r*2 + 13/24r*4 + 0r*3 + 0r. Calculate x(s(a)). 338a2 Let j(t) = 20t - 2. Let l(s) = -21s + 3. Let a(f) = -3j(f) - 2l(f). Let w(d) be the first derivative of 2d*3/3 + 25. Determine a(w(o)). -36o*2 Let z(k) = 9k. Let u(r) = 3r2 - 4r + 2. Let b(i) = -i*2 + 2i - 1. Let p(o) = -4b(o) - 2u(o). Determine z(p(x)). -18x2 Let r(j) be the second derivative of 0j*2 + 0 + 1/6j*4 + 4j + 0j3. Let a(x) be the second derivative of -x4/12 - 21x. Calculate a(r(n)). -4n4 Let i(h) = -2h*2. Let d(x) = 22 + 16x - 60 + 20 + 18. Calculate i(d(w)). -512w2 Let d(k) = -3608k*2. Let g(v) = -48v. Calculate d(g(o)). -8312832o2 Let j(p) be the second derivative of 5p*4/6 + p. Let c(d) be the first derivative of -6d*2 + 0 + 5d*2 - 6 + 4. Give c(j(g)). -20g*2 Let t(h) = -h - 5. Let g(p) = -1021p. Determine t(g(i)). 1021i - 5 Let p(j) be the first derivative of -7j*3/3 - 95. Let k(c) = -8c + 4. Let w(x) = -1. Let a(m) = -k(m) - 4w(m). What is a(p(h))? -56h*2 Let y(c) be the third derivative of -1/24c*4 + 0c*3 - 2c*2 + 0c + 0. Let v(n) = 2876 - 1438 - 4n - 19n - 1438. Calculate v(y(z)). 23z Let z(d) = 2 + 3 - 2d - 5. Let q(g) = -5g - 18g*2 + 5g + g*2. Determine q(z(o)). -68o*2 Let p(d) = -8d*2 - 10. Let y(q) = -105q + 16. What is p(y(k))? -88200k2 + 26880k - 2058 Let y(q) = -90q - 40. Let t(a) = 7a + 3. Let p(j) = 40t(j) + 3y(j). Let r(i) = 28i2 - 3i*2 - 20i*2 - 7i*2. Calculate p(r(c)). -20c*2 Let s(b) = -7b - 2. Let n = 2923 - 1921. Let r(z) = -z - n + 1002. What is s(r(i))? 7i - 2 Let b(j) = -j + 1. Let m(r) = 12r - 6. Suppose 3z + 2 = z. Let d be 3/(-12) + (-69)/12. Let c(f) = db(f) + zm(f). Let k(a) = 2a*2. Calculate k(c(g)). 72g*2 Let q(i) = -7i - 31i + 72i. Let n(u) = 2u. Give q(n(h)). 68h Let q(v) = -v. Let h = -235 - -236. Let p(l) be the first derivative of 0l + 3/2l*2 - h. Give q(p(j)). -3j Let f(v) = -v + 214. Let w(x) = 54x - 30x - 22x. Determine f(w(s)). -2s + 214 Let x(s) = 37s. Let n(g) = 34g*2 - 17g*2 - 19g*2. Give n(x(h)). -2738h*2 Let o(w) = 2w*2. Let v be ((-12)/(-21))/(4/14). Suppose 0 = 5h - 0h - 200. Let j(a) = -40a + ha + 8a*v. Determine j(o(y)). 32y*4 Let k(q) = 456484q*2. Let b(w) = -2w*2. Calculate k(b(y)). 1825936y*4 Let v(q) = 22q + 4. Let o(p) = 45p + 9. Let n(g) = -3o(g) + 7v(g). Let b(c) = -c. Determine n(b(r)). -19r + 1 Let y(q) = -6q2. Suppose m + g - 3g = 6, m = 3g + 8. Let c(o) = -31o*2 + 17o*m + 11o*2. Calculate c(y(s)). -108s*4 Let c(m) = 76m*2. Let s(x) = -3x*2 - 6x + 6. Let q(f) = -2f + 2. Let h(n) = 3q(n) - s(n). Calculate c(h(z)). 684z4 Let v(q) = q - 5. Let a(i) = 0i + 4i - 8 - 3i. Let r(c) = 5a(c) - 8v(c). Let k(w) = -w. Determine k(r(y)). 3y Let w(p) = -2p2. Let g(k) = -k2 + 27. Let d be g(-5). Let v(y) be the first derivative of -5/2yd + 0y - 6. Give v(w(s)). 10s2 Let w(m) = 2m + 65. Let f(u) = 18u2 - u. Determine w(f(s)). 36s*2 - 2s + 65 Let k(n) = -77n2 + 95n*2 - 20n*2. Let b(s) = -100s*2. What is b(k(p))? -400p*4 Let t(r) = -8135r*2. Let p(m) = -14m*2. What is p(t(k))? -926495150k*4 Let a(l) = 10l. Let g(o) = 44o + 5. Let c(b) = -742b - 84. Let s(f) = 5c(f) + 84g(f). What is a(s(j))? -140j Let z(p) be the second derivative of p4/6 - 189p. Let a(r) = -3r2 + 1. Give z(a(y)). 18y*4 - 12y*2 + 2 Let l(p) = -13 - p + 13. Let m = 24 + -15. Let q(f) = m + 0f*2 - 9 - 5f*2. What is l(q(r))? 5r*2 Let d(m) be the first derivative of 53 - 30 + 3m*3 - 5m*3. Let b(t) = -4t - 2t + 4t. What is d(b(q))? -24q2 Let w(b) = -4b + 6b + 4 - 1. Let x(y) = -4y. Determine w(x(t)). -8t + 3 Let x be 0(-3 - (-30)/9). Let u(k) = -k3 - k2 - k + 2. Let v be u(x). Let d(j) = -4j2 + 0j*2 + vj*2. Let f(s) = 11s*2. Determine f(d(t)). 44t*4 Let g(j) be the second derivative of -5j*3/6 - j. Let d(z) be the second derivative of 30z + 0 + 0z3 + 0z*2 + 1/3z*4. What is d(g(t))? 100t*2 Let s(h) = -7h + 12. Let k(d) = d - 2. Let g(f) = 6k(f) + s(f). Let y(p) = 3p. Let i(t) = t*2 - t. Let m(b) = -3i(b) - y(b). What is g(m(j))? 3j2 Let x(q) = -21897q + 2. Let v(d) = d. Give x(v(u)). -21897u + 2 Let o(k) = -9k*2. Let f be (6 - 10)/(-3 + 1). Let w(h) = -6hf + h2 + 3h2 - h2. Calculate o(w(q)). -81q*4 Let p(m) = -4m + 48. Let t be p(11). Let	{ "pile_set_name": "DM Mathematics" }
at is the remainder when x is divided by 21? 19 Suppose h = -5u + 21, 3u = -5h - 7 + 2. Suppose 5b + 73 = 3c + 4b, -5c + 135 = -ub. Calculate the remainder when 114 is divided by c. 22 Let n(k) = 16k - 136. Calculate the remainder when 1453 is divided by n(15). 101 Let k = 26 + 391. Suppose -332 = -7o + k. Calculate the remainder when o is divided by (3/(-2))/(1/(-18)). 26 Let k(s) = s*3 - 13s*2 + 2s - 3. What is the remainder when 108 + (315/60 - 2/8) is divided by k(13)? 21 Let m(k) = 99k2 - 23 + 3k + 21 - 3k. Calculate the remainder when m(-1) is divided by 34. 29 Let f(w) be the second derivative of -w5/20 - w4/12 + w3/2 - w2 - 18w. What is the remainder when f(-4) is divided by 18? 16 Let g(d) = -2d2 + 8d - 5. Suppose 3m = -2c - 8, 7 = 3c + 5m + 21. What is the remainder when 18 is divided by g(c)? 0 Suppose a - 2f - 198 = 0, a - 3f + 603 = 4a. Suppose -a - 121 = -3p. What is the remainder when p is divided by 27? 26 Let i(x) = -x + 7x - 5 + 2x*2 + 0x + 0x2. Suppose v + 4r + 3 = 2v, 11 = -v - 3r. What is the remainder when 28 is divided by i(v)? 13 Let v(f) = f*2 - 5f - 11. Calculate the remainder when v(7) is divided by 1. 0 Let t(l) = -4l - 7. Let o be -2 + 2/(-4)-14. Let y be (o/2)/(3/(-6)). Calculate the remainder when 37 is divided by t(y). 11 Let c = -14 - -16. Suppose -m + cs = -22 - 8, 4s = 4m - 136. Calculate the remainder when m is divided by 14. 10 Let l(t) = t + 4. Let y be 3 - 124/(-4)-1. Calculate the remainder when y/(-6)9/6 is divided by l(-2). 1 Suppose -l - 2 = 0, 2a - 2l - 2l + 278 = 0. Let q = -93 - a. Let f = -12 - -25. Calculate the remainder when q is divided by f. 11 Suppose 3x + 7 = -2m, -4m + 7 = 5x + 16. Let r be 360/10m/6. Let t = r + -14. What is the remainder when 28 is divided by t? 8 Let y = -760 - -952. What is the remainder when y is divided by 5? 2 Suppose 9y - 5k = 4y + 95, -5y + 95 = -2k. Suppose -5x + 3i + 23 = -15, 5i + 33 = 4x. Calculate the remainder when y is divided by x. 5 Suppose -q + 601 = 3l, 2l = 4l + q - 401. What is the remainder when l is divided by 20? 0 Let d(y) = -y + 22. Suppose 2f - 34 = 3k, -3f + 5k - 17 = -70. Calculate the remainder when d(3) is divided by f. 8 Calculate the remainder when 263 is divided by (4 - 30/4)504/(-49). 11 Suppose -64v - 1467 = -4219. What is the remainder when 82 is divided by v? 39 Let b be 9/(((-1)/(-6))/1). Let j = 70 - b. What is the remainder when j is divided by 6? 4 Let v = -34 + 68. Let q(i) = 14i*2. Let g be q(-1). Let x = 26 - g. Calculate the remainder when v is divided by x. 10 Let m = 79 - 69. Suppose -267 = -mk + 7k. What is the remainder when k is divided by 18? 17 Suppose b + b + 8 = 0. Let n = -1 - b. Suppose 3u = -0u + 12. Calculate the remainder when u is divided by n. 1 Suppose 3194 + 2446 = 15a. What is the remainder when a is divided by 93? 4 Let v = 285 + -265. What is the remainder when 298 is divided by v? 18 Let b(c) = c*3 + 9c*2 + 11c - 26. Let a(x) = -x*2 + 2x - 1. Let p(n) = 5a(n) - b(n). What is the remainder when p(-14) is divided by 18? 17 Let h(b) = 2b*2 - 34b + 92. Calculate the remainder when h(16) is divided by 14. 4 What is the remainder when 58 is divided by -4 + 8 + 3 + (-3)/(-1)? 8 Calculate the remainder when 15/18 + 1446/36 is divided by 22. 19 Let o = 1449 + -1398. What is the remainder when o is divided by (2 + 11)/((-2)/(-2))? 12 Let w be (-796)/(-18) - 2/9. Suppose 5l = -4q + 201, -2q + l + 39 = -w. Suppose -7h + q = -3h. What is the remainder when h is divided by 6? 5 Suppose 0 = 264y - 527y + 271y - 104. What is the remainder when y is divided by 80/14 + 6/21? 1 Let z be (-28)/(-6) + 12/(-18). Suppose zx = -3m - m + 348, 0 = 2x + m - 170. Suppose 2h - x = -23. Calculate the remainder when 118 is divided by h. 28 Suppose 4a - 4 = -2u, -2u + 11 = 11a - 14a. Suppose -5t - 13 + 38 = 0. Suppose um = tm - 7. What is the remainder when 27 is divided by m? 6 Suppose -2l + 5l = 5b - 438, 2l + 89 = b. Suppose -4v + 209 = -b. Calculate the remainder when v is divided by 19. 17 Suppose 2t - 2 = 8. Suppose tb - 2 - 113 = 0. Calculate the remainder when 91 is divided by b. 22 Suppose 3f - 4f = -61. Let r(z) = 2z*3 + 19z*2 - 12z + 1. What is the remainder when f is divided by r(-10)? 19 Suppose 2231 = 19t + 825. What is the remainder when t is divided by 7? 4 Suppose 3v - 50 = -35. Suppose 2c - v = 3. What is the remainder when c is divided by 1? 0 Let b = -54 + 56. Suppose -bt = -w - 48 + 1, t - 26 = w. What is the remainder when 82 is divided by t? 19 Suppose 2t = 3 + 1. What is the remainder when (-58)/(-145)(-30)/(-4) is divided by t? 1 Suppose 14b - 10 = 12b, -3b + 25 = 2q. Calculate the remainder when 189 is divided by q. 4 Let r = 19 + -24. Calculate the remainder when (0 + 1)/(r/(-115)) is divided by 8. 7 Let k = 143 - 78. Suppose -k = 6g - 215. Calculate the remainder when 97 is divided by g. 22 Suppose -5o + 2s + 146 = -2s, 0 = 2o + 2s - 44. Let v(a) = -o + 2a - 4a + 25. Calculate the remainder when 40 is divided by v(-6). 7 Let x = -693 + 746. What is the remainder when x is divided by 29? 24 Suppose 24t + 2130 = 34t. What is the remainder when t is divided by 27? 24 Let p = 2025 - 1314. What is the remainder when p is divided by 120? 111 Suppose -c + 0 + 4 = 0. Suppose -4n - 1 = -s, -2n - 2n = -5s + 69. Calculate the remainder when s is divided by c. 1 Let p = 124 - 97. Suppose 6a - 1077 - 39 = 0. What is the remainder when a is divided by p? 24 Suppose 2m = 4x + 96, 3m - 144 = 5x - 2x. What is the remainder when m is divided by 17? 14 Calculate the remainder when 0 + 88 - 50/25 is divided by ((-117)/(-12) - -1) + 1/4. 9 Suppose 0 = -3t - 133 + 157. What is the remainder when 26 is divided by t? 2 Suppose -3g - 8t = -7t - 1176, 5t + 1587 = 4g. Calculate the remainder when g is divided by 138. 117 Let j = -209 - -252. Calculate the remainder when 557 is divided by j. 41 Let m = -41 - -45. Calculate the remainder when 50 is divided by 114/m - 42/28. 23 Suppose -11k = -215 - 2425. Calculate the remainder when k is divided by 82. 76 Let i(v) = 38v*2 + v. Let m(f) = 3f + 5. Let z(j) = -j + 11. Let k be z(6). What is the remainder when i(-1) is divided by m(k)? 17 Let k(l) = l*3 + 3l*2 + 2l - 11. Let z(s) = -2s3 - 3s*2 - s + 12. Let p(v) = -3k(v) - 2z(v). What is the remainder when p(4) is divided by 7? 2 Let l = 10 - 5. Suppose 0 = 4q - 5 - 23. Suppose -2r - q = -3r. What is the remainder when r is divided by l? 2 Let o = -10 + 15. Let k(u) = -2u - 6. Let m be k(-3). Suppose mp = -op + 75. Calculate the remainder when 42 is divided by p. 12 Suppose -9j + 189 - 9 = 0. What is the remainder when 132 is divided by j? 12 Let y = -792 - -870. Calculate the remainder when 211 is divided by y. 55 Calculate the remainder when 30/405172/9 is divided by 31. 28 Suppose 0n - 3j = -4n - 17, 19 = -3n - 4j. Let x(f) = 16f - 4. Let c be x(2). Let u = n + c. Calculate the remainder when 68 is divided by u. 22 Let m(k) = k3 - 21k*2 - 29k + 50. Let f be m(22). Let h = f + 197. What is the remainder when h is divided by 16? 13 Suppose 3f = -5n + 403, 4f - 547 = -19n + 22n. Calculate the remainder when f is divided by 46. 44 Suppose -2w + 14 = -2t + 4, 5t + 21 = 4w. What is the remainder when (t/(-3))/(3/243) is divided by 6? 3 Let w(m) = -16m + 90. Calculate the remainder when 129 is divided by w(4). 25 Calculate the remainder when 69 is divided by 2/(-4)(-196)/7. 13 Suppose 6j - 5 - 37 = 0. Suppose -jo = -77 - 35. Calculate the remainder when 31 is divided by o. 15 Let x be 3 + -2 - -280. Let h = x - 96. Calculate the remainder when h is divided by 4/(-18) + (-620)/(-36). 14 Suppose -36z = -31z - 50. Suppose -4r - 5l + 41 = -2r, -4r = l - 73. Calculate the remainder when r is divided by z. 8 Suppose -2s = 4m - 0m + 90, -40 = 3m - 4s. What is the remainder when 29 is divided by (48/m)/((63/60)/(-7))? 13 Suppose 3l = 117 - 36. Let t(o) = -o*3 + 13o*2 + 32o - 24. Let f be t(15). Suppose -fg + 50 = -5g. What is the remainder when g is divided by l? 23 Calculate the remainder when (-1 + (-4)/(-6))*-87	{ "pile_set_name": "DM Mathematics" }
n 2376.48? True Are -154669 and -4 equal? False Is 91882 not equal to 91883? True Is 0.1 smaller than 1150/579? True Which is smaller: -82348 or -82350? -82350 Do -14 and -1239/83 have different values? True Which is bigger: 189/25840 or -1? 189/25840 Is -319/11929 at least 0? False Which is bigger: 4 or 389457? 389457 Does 102 = 17498? False Which is smaller: -88162 or -88160? -88162 Which is bigger: -11788 or -11793? -11788 Is -15906 equal to -47722/3? False Which is smaller: 180 or 11380/63? 180 Is 2/5 greater than or equal to -8816? True Which is smaller: -1 or 30/2327? -1 Which is smaller: 3454 or 3387? 3387 Do -744112 and -744112 have the same value? True Which is smaller: 172893/5 or -0.1? -0.1 Which is smaller: 2/9 or -236205? -236205 Are 1/6 and -141800 non-equal? True Which is smaller: 1 or 2/1961703? 2/1961703 Is 1419 bigger than -0.1? True Which is greater: 15425 or 169670/11? 15425 Which is smaller: 242211 or 242212? 242211 Is 1473 at least 1211? True Do -2/851 and 112 have different values? True Is -80591 smaller than -80591? False Is -24251/4 at most 0.7? True Which is smaller: -566/1577 or 1? -566/1577 Which is smaller: 0 or 2/1042917? 0 Is 350 greater than 1010? False Is 5 <= 574/89? True Is 3490 at most as big as 3497? True Do -183188 and -183190 have different values? True Is 193014 != 193014? False Which is greater: -315 or -209? -209 Is -2642 not equal to -29074/11? True Which is bigger: 462 or 41060/89? 462 Do 331502 and 331510 have different values? True Which is greater: 111 or 99? 111 Which is smaller: -1022 or -973? -1022 Is -258 greater than -261? True Which is smaller: 0 or -1/40764? -1/40764 Which is bigger: -12 or -748? -12 Which is greater: -2442 or -9? -9 Is 111/24758 >= -1? True Which is smaller: -326 or -327? -327 Which is smaller: 28125 or 28126? 28125 Is -16910 not equal to -16910? False Is 93577 equal to 1590828/17? False Which is smaller: -2 or 26641? -2 Is 2192/9 equal to -58/7? False Which is bigger: -4/9 or 11338? 11338 Is 26492 less than 26485? False Which is smaller: -10661 or -10676? -10676 Which is bigger: -635 or -395? -395 Which is smaller: -83 or 695? -83 Is -963/362 less than -4? False Is -304456 >= -304449? False Is -33/7372 >= -1? True Is -900/691 at most as big as 0? True Are 141153 and -1 nonequal? True Which is smaller: -1 or 1/1523356? -1 Is -278 >= -0.6? False Which is smaller: 652292 or 652285? 652285 Is 334503/11 != 30408? True Which is smaller: 3/10 or 2599.14? 3/10 Is 0.02706 at most as big as -2/3? False Are -1 and -46/3315 unequal? True Is -24 at least as big as -13720/579? False Do 2230520 and 2230520 have the same value? True Are 117357 and -0.1 unequal? True Which is smaller: 0.028834 or -3/20? -3/20 Which is greater: 10843 or 10844? 10844 Which is smaller: -8186 or 3? -8186 Which is smaller: -798131 or -798128? -798131 Is -2853 > -2852? False Is 5278 at least as big as -1? True Is 7/13945 bigger than 0? True Is 10909/402 < 26? False Is -71 greater than 2942? False Which is greater: -1 or 20/57137? 20/57137 Which is greater: 0 or -1/48554? 0 Which is bigger: 723 or 777? 777 Is 4719 greater than 4719? False Which is smaller: -10493/87 or -122? -122 Do -135808 and -135790 have the same value? False Is -255 equal to -5833/23? False Which is greater: 39264/103 or 380? 39264/103 Which is greater: -2301 or -2331? -2301 Is 740 < 732? False Which is bigger: -13791 or -13797? -13791 Are -1 and 1/55887 non-equal? True Are -51 and -1144/23 non-equal? True Do -12665 and -12679 have the same value? False Is 78852 > 78825? True Is 1 greater than 1/850941? True Do 23197 and -0.1 have different values? True Is -33/6491 bigger than 1? False Is -1 at least -354/13? True Are -84513 and -84516 unequal? True Is 230 at most 5545/24? True Is 2.7 greater than or equal to 3.117? False Which is greater: 448 or 10? 448 Which is bigger: 1 or -3/33580? 1 Which is smaller: -0.2 or 13741? -0.2 Is -93093 smaller than -93091? True Is 2/2128193 at most as big as 1? True Is 46101 at most 46101? True Which is bigger: -5/73 or -41? -5/73 Which is bigger: 86/201 or 1? 1 Are 1 and 5/1961 non-equal? True Is 68374 less than or equal to 1.3? False Are -98716 and -98732 equal? False Which is bigger: -44026 or -44037? -44026 Which is smaller: 1 or -8/259707? -8/259707 Is -2/45539451 at most as big as 1? True Is -11396 greater than or equal to -22791/2? False Is 341962 at most as big as 341962? True Which is bigger: -1119 or -1106? -1106 Is 0 equal to -4/7851? False Which is greater: 44449 or 44447? 44449 Are -111 and 57 equal? False Is 4519 at most 4513? False Is 968.01 != 0? True Which is smaller: 1435/71 or 19? 19 Which is smaller: -1/11811199 or 1? -1/11811199 Which is smaller: 0 or -3/4184168? -3/4184168 Which is greater: 2/19943 or 1? 1 Do 0.9362 and -1 have different values? True Which is smaller: -20385/7 or -2912? -20385/7 Which is bigger: -110985 or -110987? -110985 Which is greater: 190 or -8.869? 190 Which is bigger: 810 or 427? 810 Which is bigger: 0 or 14/11353? 14/11353 Which is smaller: -909 or -1493? -1493 Is -253604 at least 0.1? False Is -629795 < -629795? False Which is bigger: -4 or 16586? 16586 Which is smaller: 13450 or -25.4? -25.4 Is 1103/9233 <= 1? True Is 315/383 at least as big as 2? False Is -38206 not equal to -38198? True Which is smaller: 1277130 or 2554259/2? 2554259/2 Which is smaller: 540 or -0.897? -0.897 Which is bigger: 4632/107 or 42? 4632/107 Is 1/46054 at most -1? False Which is smaller: 0 or -2/30441? -2/30441 Which is smaller: 6352 or 6331? 6331 Is -326 smaller than -11767/36? False Which is greater: -35152 or -35192? -35152 Which is smaller: 0.2 or 10/23497? 10/23497 Is 0 at least 83/7658? False Which is greater: 123043/37 or 3324? 123043/37 Are 182/1229 and -1 equal? False Is 57897 greater than or equal to 57896? True Which is bigger: 292 or -683? 292 Which is smaller: -53/74 or 0.94? -53/74 Which is smaller: 7894 or 7889? 7889 Is 3597595 at least 3597594? True Is -14145 at least as big as 51? False Is 2457 not equal to 2449? True Is 0.3 at least -1054568? True Which is smaller: -314.2 or -1/2? -314.2 Is 195509 less than or equal to 195511? True Is 0.4956 greater than or equal to 43? False Is 48365 at least 48361? True Are 15468/205 and 76 nonequal? True Which is smaller: -1 or -3/33539? -1 Are 71589/13 and 5508 nonequal? True Which is smaller: -1 or -47/13084? -1 Is -1.3492 at least as big as -10? True Which is smaller: 21842 or 21804? 21804 Is -555/779 bigger than -2? True Is -282 greater than 1052? False Which is smaller: -293 or 5/1259? -293 Which is smaller: 1 or 50/51? 50/51 Which is smaller: 1 or -87/358? -87/358 Which is smaller: -47649 or -1/29? -47649 Is -1 != 138/160927? True Which is smaller: 48707 or -3? -3 Is 273 < -4359? False Which is greater: 793 or 855? 855 Is 0 less than 2083.63? True Is 2399091 at least as big as 2399091? True Is 1 greater than 71/490? True Is -3 bigger than -1844/507? True Is 2/5 bigger than -26.663? True Which is bigger: 328/339 or 0? 328/339 Which is greater: 2552 or 170934/67? 2552 Is -6229/14 > -445? True Is -39234 <= -78467/2? True Which is greater: 0 or -2/1418947? 0 Which is smaller: -11296 or -0.15? -11296 Which is bigger: 0 or 391286? 391286 Is -6/287 less than 0.01? True Is -2271 greater than or equal to -2268? False Which is greater: 3625959 or 3625958? 3625959 Is 1 bigger than 2/15365291? True Which is greater: 1873759 or 1873760? 1873760 Is 477 bigger than 136? True Which is smaller: -19 or 53040? -19 Which is smaller: 15078/163 or 93? 15078/163 Which is bigger: -3594341 or -3594342? -3594341 Is 230878/3 != 76960? True Are 1039 and 118573/114 equal? False Which is smaller: -4 or -75345? -75345 Which is bigger: 30664 or 30666? 30666 Which is bigger: 1 or 2189/8? 2189/8 Which is greater: 19/111077 or -1? 19/111077 Which is bigger: 3 or 10675? 10675 Is 90404 bigger than 0.09? True Which is bigger: -20 or -9991? -20 Which is greater: 2930 or 2915? 2930 Is -3/1370 > -489? True Which is greater: -5.79 or -5080? -5.79 Which is greater: 357 or 75? 357 Is 1 at most -100/2593? False Are 606002 and 606002 equal? True Is 705736 <= 705735? False Which is bigger: 2/35 or 2077/4? 2077/4 Which is greater: 134916 or 134914? 134916 Is 3046/17	{ "pile_set_name": "DM Mathematics" }
of (-1)/((3/3)/(-1))? 1 What is (3/(-30))/((308/35)/11)? -1/8 (2/(-5))/((-12255)/(-1425)) -2/43 Evaluate (-1)/((-1)/(-1)-1)-6. -6 What is 13/(-6)0? 0 Calculate (20/(-10)1)/(-1). 2 What is 12(-5)/50-15? 3 Calculate 20/1402/(24/7). 1/12 (-12)/((22/(-2))/33) 6 Evaluate (-3(-1)/12)/(-1). -1/4 What is ((-1)/15)/(285/950)? -2/9 What is the value of ((-4)/4)/(2/(-140)-10)? -7 What is the value of 0/((-7)/(-14)6)? 0 What is ((-27)/18)/((-2)/45)? 3/5 (45/(-6))/5(-4)/30 1/5 Evaluate (164/287)/(12/(-14)). -2/3 Evaluate 1/(-5)30/3. -2 Evaluate 548/(-40)(-10)/12. 5 Calculate ((-1)/(-3))/((-2)/(-15)-5). -1/2 What is the value of (64/24)/(-8)3-1? 1 What is 4/6(12/(-8))/3? -1/3 What is (-5)/(-5)(-2)/(-2)? 1 What is ((-67)/268)/(5/12)? -3/5 Calculate (-8)/2121/(-28). 2/7 Calculate ((-2)/(-2))/((-105)/(-7))6. 2/5 Calculate 3(-10)/(-330)-3. -3/11 Evaluate (114/133)/((-8)/(-7)). 3/4 Evaluate (-2)/138/24. -2 Evaluate (-6)/(-9)-415/(-80). 1/2 -22/(-7)(-105)/60 -1 Evaluate (-2)/(-6)(-86)/43. -2/3 Calculate 24/186/(-32)-4. 1 ((-2)/(56/(-35)))/(1/4) 5 Calculate 28/(-42)(-9)/6. 1 Evaluate ((-2)/6)/((-9)/(-90)5). -2/3 What is the value of 5/(-2)576/(-360)? 4 Evaluate -22(-4)/40-2. -4/5 Evaluate ((-9)/54(-2)/(-2))/1. -1/6 What is the value of (-1)/(4/4)8/4? -2 Evaluate (32/48)/((-5)/(-5)). 2/3 (32/20)/(2/(-10)) -8 (-12(-6)/(-918))/(2/3) -2/17 ((-288)/(-108))/(1/6-2) -8 Calculate 4/(16/(-2))76/(-19). 2 Calculate (0/(-54))/((-2)/4-4). 0 Evaluate 0((-9)/27)/((-2)/3). 0 16/4(-5)/(-70) 2/7 Evaluate 6(((-15)/(-3))/(-10))/1. -3 What is the value of 1-119/(-76)? 1/4 What is the value of 0(-4)/(48/4)? 0 Evaluate ((-1)/3)/(15/(-5))2. 2/9 Calculate (81/(-18))/(3/4). -6 Calculate -37/(-7)(-2)/10. -3/5 Calculate ((-14)/(-49))/((-32)/(-14))-14. -7/4 What is (-56)/210(-15)/24? 1/6 What is the value of 4/10-84/64? -1/5 Evaluate (-42)/1214/(-7). 2 (-8)/(-63/3) 4/3 What is 40/(-420)28/6? -4/9 Evaluate (-32)/(-160)3/3. 1/5 Evaluate 0/(2/33). 0 22/2(-3)/(-75) 2/25 (6/6)/(1/(6/2)) 3 6/10(-105)/21 -3 Evaluate 3/2(-8)/(-3). 4 Calculate (((-3)/(-36))/(2/(-8)))/2. -1/6 Evaluate (-3)/6(-184)/(-23). -4 ((-4)/(-16))/(1/16-4) -1 Evaluate (1/14)/((-1)/21). -1/7 Evaluate (6/(-16))/(31/2). -1/4 Evaluate (-12)/4214/8. -1/2 Evaluate (20/(-15))/(4/6). -2 Evaluate 3/(-3(-10)/5)-1. -1/2 270/816/(-8) -5/2 What is 7/(-6)(-27)/(-189)? -1/6 What is 12((-28)/(-16))/(-7)? -3 Evaluate (6/(-18))/(1/6). -2 Calculate ((-5)/(-70))/(36/378). 3/4 Calculate ((-6)/240)/(-3). 0 Calculate ((-1)/2)/((-22)/220). 5 (-8)/((4/(-4))/((-3)/6)) -4 What is (-3)/(-36)-43? -1 What is (1/(8/24))/((-2)/1)? -3/2 Calculate (60/(-50))/((42/(-20))/(-7)). -4 (-36)/(-8)(-12)/(-9) 6 What is the value of ((-128)/12)/169/(-2)? 3 ((-2)/(-20))/((55/30)/11) 3/5 Calculate -5((-18)/(-270))/((-2)/(-24)). -4 Calculate (((-224)/21)/16)/(1/(-3)). 2 Calculate 3(-4)/3966. -2/11 Evaluate (-17)/(-34)(1-18)/(-3). 3 What is the value of (-1)/1-4(-5)/5? -4 68/(-72)6/(-40) 1/10 Evaluate 3/28/3. 4 What is the value of (-1)/(-1)(-63)/(-84)? 3/4 Calculate ((-126)/(-10))/95. 7 What is ((-55)/(-990))/(2/(-9))? -1/4 What is (40/30)/(2/(-1))? -2/3 (-85/(-5))/(-2) -4 Calculate (13)/((-45)/60). -4 ((-48)/(-144))/(-12/6) -1 Calculate 7/12(-174)/(-812). 1/8 What is (7(-3)/6)/((-11)/22)? 7 Evaluate 56/36318/21. 4 Calculate (9/(-6))/((9/(-6))/(-3)). -3 Evaluate (2/55)/(36/(-180)). -2/11 What is 4/(-8)-68/(-6)? -4 What is the value of (3/(-2))/30? 0 Evaluate (83/332)/(1/(-1)). -1/4 Calculate (2/(-20))/(8/(-32)). 2/5 Calculate (8/66011)/(4/(-5)). -1/6 Calculate (-32/(-4))/(102/68). 1 Calculate (-1)/(9/(-6)9/(-81)). -6 Evaluate (1/(30/(-4)))/(3/9). -2/5 ((-1)/(-21))/((-267)/(-1246)) 2/9 Calculate -3(-8)/(-60)20/2. -4 What is ((-7)/(-56))/((-8)/96)? -3/2 2/1238/(-40) -1/10 What is the value of 22(-1)/4? -1 Evaluate 6/44/54. 1/9 (((-45)/21)/(-5))/1 3/7 What is the value of (-2)/(-5)(-63)/84? -3/10 61/(-6)0 0 What is ((-12)/(-42))/(20/105)6? 9 Calculate ((-294)/(-980))/(4/(32/6)). 2/5 What is the value of 540/(-189)(-7)/(-2)? -10 What is ((-40)/100)/(4/10)? -1 Calculate 6/(-9)(-1)/(4/30). 5 ((-309)/412)/(3/16) -4 What is 8/2-2(-2)/4? 4 -8-6(-3)/36 -4 Evaluate 30/(-25)7/21. -2/5 What is the value of 4/(-51)(-87)/(-58)? -2/17 Calculate ((-48)/(-64))/((30/4)/(-3)). -3/10 Calculate (5/(-40)-4)/((-2)/20). -5 (-1)/(-18)6(-36)/2 -6 -12((-15)/3)/5 2 Evaluate (-4)/(-32)204/5. 2 What is the value of (0/1)/(16/8)? 0 Evaluate ((-23)/((-161)/42))/3. 2 (6/10)/(-2(-3)/(-15)) -3/2 Evaluate ((-6)/(-2))/(8/((-48)/(-117))). 2/13 What is ((-4)/6)/(((-352)/99)/4)? 3/4 Calculate (-6)/(-3)5/10. 1 What is 1(64/36)/(-8)? -2/9 What is the value of 1239/(-531)(-9)/7? 3 What is the value of (3/4)/(48/(-32))? -1/2 Calculate (30/18)/((-1)/(-3)). 5 (20/(-70))/(20/7)-2 1/5 What is 32/(-40)6/(-8)? 3/5 Evaluate ((-2)/(-8))/((-4)/(-16)). 1 Calculate (1/((-42)/24))/(5/(-7)). 4/5 What is (-420)/29414/(-5)? 4 What is the value of (11/((-110)/(-10)))/((-2)/8)? -4 ((-4)/12)/(5/75) -5 ((-10)/(-12))/(1250/(-375)) -1/4 (12/(-14))/(2/14) -6 ((-1)/2)/((-10)/(-20))-3 3 (-5)/(3(-6)/(-6)) -5/3 Evaluate 12(-5)/(-440)4. 6/11 ((-276)/(-207))/((-4)/(-18)) 6 -6(16/(-96))/((-1)/(-3)) 3 ((-5)/(-2))/((-126)/84)-1 5/3 Calculate (9/(-9))/(20/5). -1/4 What is ((-165)/44)/(3(-36)/(-32))? -10/9 Evaluate ((-39)/182)/((-6)/14). 1/2 4(-6)/26/(-18) 4 What is 8/(224/(-12))4/6? -2/7 Evaluate (-1(-20)/(-5))/10. -2/5 Calculate 1/144(-9)/(-6). 3/7 4(-2)/((-16)/6) 3 What is 2/2((-126)/24)/21? -1/4 (-4)/(28/1(-11)/(-22)) -2/7 Calculate 1/(((-13)/(-2))/(-13)). -2 Calculate ((-1)/4)/(((-27)/(-12))/3). -1/3 Calculate (-21)/(-6)32/28. 4 Evaluate (70/50)/((-5)/(-25))-1. -7 ((-2)/(-8))/((-84)/(-48)) 1/7 Evaluate (-75)/(-20)(-88)/(-55). 6 What is (6(-15)/45)/(-9)? 2/9 ((-15)/(-25))/(((-2)/(-2))/(-5)) -3 What is ((-200)/250)/((-2)/(-10))? -4 Evaluate 6/(-24)(-40)/(-6). -5/3 Calculate (2/(-11))/((-6)/6). 2/11 What is 3(10/(-10))/45? -1/15 What is 61228/(-152)? -9 What is the value of ((-6)/8)/(3/(-24)-2)? -3 Calculate (68/272)/(2/48). 6 What is 16/(-24)9/(-6)2? 2 23/(30/35) 7 8/(-2)103/(-206) 2 Calculate (-16)/41(-1)/(-2). -2 What is 3((-704)/(-99))/(-16)? -4/3 Evaluate -10/(8/(-1)). 0 Calculate (3/(-1))/(45/(-5)). 1/3 (-6)/502/(36/45) -3/10 (2/1)/((-60)/5) -1/6 What is (-513)/4564/6? -3/4 2/(4/(-2))1 -1 What is -93/(-9)3/9? 1 What is ((-3)/(-1))/((-3)/126)? -2 What is the value of ((-3825)/(-30))/(-17)(-8)/(-6)? -10 Evaluate (6/7)/(78/273). 3 1321/((-378)/24) -4 What is the value of (-2)/(-3)1823/828? 1/3 Calculate (8/6)/((-9)/(351/(-52))). 1 What is the value of 1(-120)/7510/4? -4 Evaluate 7/1114/(-49). -2/11 Evaluate 174/(-145)5/7. -6/7 Calculate (5/(-30))/((-2)/(-12)-4). 1/4 (1/(6/(-4)))/(22/264) -8 Evaluate (30/18)/(6/(48/20)). 2/3 Evaluate (-27)/((-405)/(-2))30/(-8). 1/2 What is ((-10)/4)/(75/(-12))? 2/5 What is the value of ((-42)/(-84))/(2/(-12))? -3 Evaluate ((-10)/(-30))/(2/((-108)/(-3))). 6 32/10350/(-140) -8 What is ((-15)/(-6))/((-16)/32)? -5 What is (4/6)/(120/135)? 3/4 What is the value of (2/12-1)/((-586)/(-2637))? -3/4 Calculate 10/(15/(-3))(-1)/(-1). -2 Evaluate ((-252)/420)/((-2)/(-30)). -9 Calculate (-16)/10(-9)/((-72)/(-20)). 4 What is the value of (2/((-90)/3))/(18/54)? -1/5 Calculate ((-4)/(-44))/((-20)/(-110)). 1/2 What is 1(-5)/(420/9)-4? 3/7 (-273)/(-273)-1(-16)/(-2) -8 ((-18)/(-45))/(8/(-25)) -5/4 (27/(-36))/((-1)/4) 3 What is 6/(-45)165/99? -2/9 (-1)/((-1)/216/8) 1 Calculate 21(-4)/(-8)-2. -2 (-170)/68(-12)/(-25) -6/5 Calculate 4/(-3)(2/2)/(-2). 2/3 What is (-1)/4329/(-47)4? 7 (42/(-147))/((-15)/(-21)) -2/5 Evaluate ((-4)/(-10))/(8/5). 1/4 Evaluate (-5(-1)/4)/((-17)/(-68)). 5 What is ((-8)/14)/(11/((-99)/(-18)))? -2/7 What is the value of (-5)/(5/2)(-7)/63? 2/9 What is the value of (-112)/(-168)3/(-4)? -1/2 What is (45/60)/((-18)/16)? -2/3 Calculate (6/(-192)-24)/(150/(-16)). -2/25 24/(-63)9(-2)/(-24) -2/7 ((-4)/6)/((-130)/(-117)) -3/5 Calculate (-8)/(-2)(-9)/(-36). 1 Evaluate ((-10)/8)/((54/8)/27). -5 2((-66)/54)/(-11) 2/9 Evaluate (-2)/((-1)/(-6)6). -2 Evaluate (2/(32/36))/((-57)/(-152)). 6 What is the value o	{ "pile_set_name": "DM Mathematics" }
rd derivative of b4/12 - b3/6 + 2b2. Let o be z(4). Suppose og - 4g - u = 16, 16 = -g - 5u. What are the prime factors of g? 2 Let b(n) be the third derivative of n5/20 - n4/24 - n3/3 + n2. What are the prime factors of b(-2)? 2, 3 Let s(v) = v*2 - 1. Let d be s(0). Let u = d + 4. Suppose -2f - um - 2m = 3, -f + 4m + 31 = 0. List the prime factors of f. 11 Let y(q) = -q3 + 20q*2 + 22q + 4. List the prime factors of y(21). 5 Suppose -r + 562 = 3y + 3r, -y = -3r - 209. List the prime factors of y. 2, 97 Suppose -5t + 38 = 2x, 4t - x = -4x + 29. List the prime factors of (9/(-12))/((-2)/t). 3 Let o(h) = -12h - 6. List the prime factors of o(-7). 2, 3, 13 Suppose 5o - 13 = 22. Let f be o + 5/(10/(-6)). Suppose -10 = -5x + fx. List the prime factors of x. 2, 5 Suppose -270 = -4m - 5m. What are the prime factors of m? 2, 3, 5 Let d = 1 + -7. Let h = d - -13. List the prime factors of h. 7 Let y = -7 + -54. Let h = -41 - y. What are the prime factors of h? 2, 5 Suppose 0 = 4j - o + 6o - 363, -96 = -j - 3o. What are the prime factors of j? 3, 29 Let y(d) = -d*3 - 13d*2 - 13d + 10. Let l be y(-12). Let z = l - 7. What are the prime factors of z? 3, 5 Suppose 104 + 16 = 8q. What are the prime factors of q? 3, 5 Let s(d) = d3 - 5d*2 - 5d - 5. Let y be s(6). Let p be y/(-5) - 28/35. Let l(g) = -12g3 - g2. What are the prime factors of l(p)? 11 Let h = 12 + -6. Let d = h + -12. What are the prime factors of (28/d)/((-8)/12)? 7 Suppose -7l = -10l. Suppose 5c + y = 43, -31 = -5c + 3y - ly. List the prime factors of c. 2 Let y = 306 - 140. List the prime factors of y. 2, 83 Let i be (((-10)/4)/5)/(11/(-110)). Let g(s) = s2 + 4s - 8. Let v be g(-6). List the prime factors of (i/v)/((-3)/(-24)). 2, 5 Let v(p) = -2p3 - 9p*2 - 5p + 3. What are the prime factors of v(-7)? 283 Suppose -7k - 408 = -10k. What are the prime factors of k? 2, 17 What are the prime factors of -772/(-21)3? 2, 11 Let l be 10/((-1)/(2/(-4))). Suppose 0 = lg - 40 - 10. What are the prime factors of g? 2, 5 Suppose -3p + 15 + 6 = 0. Suppose pz = 9z - 46. List the prime factors of z. 23 Let v = 47 - 1. List the prime factors of v. 2, 23 Suppose -3d + 6 = -d. Let k be ((-4)/4)/1-3. Suppose -kf - x + 25 = 0, -df - 2x + 8 = -18. List the prime factors of f. 2 Let a(p) = -p. Let k be a(-3). Suppose -2j = 2w - 8, k = -5w - 2. List the prime factors of j. 5 Let a be 0 - (-2 - (10 - 3)). Let u = 15 - a. What are the prime factors of u? 2, 3 Suppose 0 = -8i + 5i - 120. What are the prime factors of 30/8 + (-10)/i? 2 Let f(c) = 10c - 17. What are the prime factors of f(13)? 113 Suppose 3w - 5z = 18, -3z + 5z + 9 = 3w. Let u(m) = 4 + m2 + w + m - 4. What are the prime factors of u(-2)? 3 Let n(l) = l2 - l + 30. Let w be n(0). Let h = w - 9. What are the prime factors of h? 3, 7 Let k = -57 + 86. What are the prime factors of k? 29 Suppose 0 = x + 2x - n - 112, 4x + 5n - 181 = 0. Let o = x - 16. What are the prime factors of o? 23 Suppose 20 = -4h, -8x - 2h + 110 = -5x. List the prime factors of x. 2, 5 Let t = -23 + 27. List the prime factors of 2/t + (-79)/(-2). 2, 5 Let b be ((-16)/(-12))/(4/(-6)). Let v(i) = i2 - 4i - 3. What are the prime factors of v(b)? 3 Suppose 4i - 5z = 10, 3i - 2 = z - 0. Suppose i = 3u + 2 - 41. List the prime factors of u. 13 Let v(y) = 12. Let i(c) = c - 24. Let f(z) = -3i(z) - 7v(z). List the prime factors of f(-5). 3 What are the prime factors of (-12)/(-2) - 0/2? 2, 3 Let t be -2 - (0 - (4 + 1)). Suppose -ts + 0s = 0. Suppose 30 = 3x + 4o, 0 = -x - sx - 4o + 10. List the prime factors of x. 2, 5 Let u be 5/2(-8)/(-4). Suppose -4n + 4l + 12 = 2l, 0 = 3n + ul + 17. Let q = 8 + n. List the prime factors of q. 3 Let t be 7/(-2) - (-1)/2. List the prime factors of 2 + t + 3 - -2. 2 Let s = 2 + 3. Let a be (-2)/8 + 202/8. Suppose 3x - a = s. List the prime factors of x. 2, 5 Suppose 5h - 6h + 35 = 0. Suppose h = -3f - 2f. Let x = f - -9. What are the prime factors of x? 2 Suppose -4 = -2k + 5u - 3u, 2k + 3u - 29 = 0. Suppose 8 = 3m - km. List the prime factors of -2(-2)/m - -11. 3 Let r be (-10)/1542/4. Let n = 9 + r. What are the prime factors of n? 2 Suppose -2c = -10, 0p - 64 = -p + 2c. What are the prime factors of p? 2, 37 Suppose -2k + 14 = -2f + 3k, 4 = -4f + 4k. Let b be (2/f)/(8/180). Let d = 21 - b. What are the prime factors of d? 2, 3 Let t(l) = -11l3 - 8l*2 - 6l + 43. Let n(j) = -4j3 - 3j*2 - 2j + 14. Let r(i) = -8n(i) + 3t(i). List the prime factors of r(0). 17 Let l = 71 - 19. What are the prime factors of l? 2, 13 Suppose 44 + 100 = 4q. List the prime factors of q. 2, 3 Suppose 0 = 5a + c - 1469, a - 280 = 5c - 7. What are the prime factors of a? 293 Let h(t) = -t3 + 7t*2 + 7t + 11. Let i = 2 + 0. Suppose -7a = -ia - 40. What are the prime factors of h(a)? 3 Let t = -13 + 21. Suppose -b = -9 - t. What are the prime factors of b? 17 Suppose 33 = i - 4y, i - 121 = -i - 3y. Let q = -31 + i. Suppose 0 = -4s + 6 + q. List the prime factors of s. 7 Let t = 117 + 117. What are the prime factors of t? 2, 3, 13 Let r be (-10)/4 - (-2)/(-4). Suppose g + 3g = -5o - 60, -5o + 5g - 15 = 0. Let b = r - o. What are the prime factors of b? 5 Suppose -22 - 16 = -2h. List the prime factors of (-1 - 1) + h + 0. 17 Let b = 65 - 33. List the prime factors of b. 2 Let k(o) = -o - 5. Let f be k(-9). Let b = f - 7. List the prime factors of (30/9)/((-1)/b). 2, 5 Let w(v) = -v*2 + 14v + 3. Let i be w(6). Let o = i + -18. List the prime factors of o. 3, 11 Let x(c) be the second derivative of -3c3/2 - 5c*2 - c. List the prime factors of x(-4). 2, 13 Let m be (-2 - (-36)/15)20. Suppose 16 = 3y - m. Let k = 14 - y. List the prime factors of k. 2, 3 Let f = 155 - 64. What are the prime factors of f? 7, 13 Suppose 5f = 19 + 91. What are the prime factors of f? 2, 11 Suppose -2w = -g - 21, 2w + 3g - 2 - 7 = 0. Let c = -5 + w. What are the prime factors of 2/c - (-10)/4? 3 Suppose 7 - 287 = -4k. List the prime factors of k. 2, 5, 7 Let c = 4 - -1. Suppose -ci + 33 = 3p, -3p + 1 = i - p. List the prime factors of i. 3 Let m(x) = 646x*3 + 153x*2. Let d(q) = 17q*3 + 4q*2. Let u(b) = -153d(b) + 4m(b). What are the prime factors of u(-1)? 17 Let q(f) = f2 - 7f + 6. Let a be q(6). Let i = a - 12. Let z = 28 + i. What are the prime factors of z? 2 Suppose -5g - 3a = -3, 0g + 21 = 3g - 3a. Let n be (-2)/(2/(-47))1. Suppose -2q = 5i - n, -i = -gi + 5q + 13. List the prime factors of i. 3 Suppose 28p - 29p + 34 = 0. List the prime factors of p. 2, 17 Suppose 2v - a = 51 - 12, 4a - 104 = -5v. Suppose 5l = 4l + v. List the prime factors of l. 2, 5 Suppose 4q + 8 = 2r, 0 = 5r - 3q - 27 + 7. Suppose -v - 3m + 14 = v, -rm - 4 = -3v. What are the prime factors of ((-6)/v)/((-15)/140)? 2, 7 Let c = 8 - 6. Suppose 3n + 61 = cr, 5r = -2n + 115 + 47. What are the prime factors of r? 2 Let d(v) = -v*3 + 8v*2 - 7v - 4. Let p be d(7). Let u(o) = -4o - 6. Let b be u(p). Let j = 21 - b. What are the prime factors of j? 11 Suppose -3t + 146 = 2n - 6t, -238 = -3n - 5t. List the prime factors of n. 2, 19 Let x(q) = q*3 - 5q*2 + 3q + 10. What are the prime factors of x(5)? 5 Let z(d) be the third derivative of -d6/120 - d4/24 + 2d3/3 - 8d*2. Let i be 2/2 + (1 - 2). What are the prime factors of z(i)? 2 Let w be 6/(-8) + (-9)/(-12). Suppose w = 3o + o. What are the prime factors of 1 + o - 15/(-1)? 2 Let q = 39 - 27. Suppose -3p + q = p. Let i(y) = y3 - 2y*2 - 1. List the prime factors of i(p). 2 Let r = 7 - 1. Suppose -9 = -5j + r. Let c(n) = -n*3 + 2n*2 + 5n - 4. List the prime factors of c(j). 2 Suppose 2q - 12 = -0q. Suppose 0 = 3d - 5i + 1 - q, -i - 13 = -3d. Suppose 0 = -3c + dc - 24. List the prime factors of c. 2, 3 Let b be 1 + (-1 - 3) + -2. Let r(n) = -3n - 7. Let f be r(b). Suppose f = -4a + 6a. What are the prime factors of a? 2 Let f = -19 - -30. Suppose f = p - 0p. What are the prime factors of p? 11 What are the prime factors of (0 - 2)4/((-24)/141)? 47 Let s(y) be the second derivative of 3y5/20 - y4/12 + y*3/6	{ "pile_set_name": "DM Mathematics" }
4/2 + 105n*3 + 33n*2 - 639n/2 - 459/2 = 0. -17, -1, 3 Factor -4510134o4/5 - 353736o*3/5 - 10404o*2/5 - 136o/5 - 2/15. -2(51o + 1)*4/15 Let -2j*5 + 5j*4 + 3j*3 - 19j*2 + 19j - 6 = 0. What is j? -2, 1, 3/2 Factor 2b2 + 96b + 1152. 2(b + 24)2 Let -y3/2 + 25y*2 + 387y/2 + 342 = 0. What is y? -4, -3, 57 Factor 2s3 - 300s*2 + 15000s - 250000. 2(s - 50)3 Let -p2 + 10p + 39 = 0. What is p? -3, 13 Factor -4d3/3 + 153d*2 + 1051d/3 + 78. -(d - 117)(d + 2)(4d + 1)/3 Factor 75y*3 + 37380y*2 + 14943y + 1494. 3(y + 498)(5y + 1)2 Find o, given that 8o*5 - 420o*4 - 1996o*3 - 3156o*2 - 2044o - 456 = 0. -2, -1, -1/2, 57 Let -6i4/7 + 225i*3/7 + 2049i*2/7 - 1080i/7 = 0. Calculate i. -8, 0, 1/2, 45 Let 9a5/4 + 93a*4/4 + 355a*3/4 + 603a*2/4 + 108a + 27 = 0. Calculate a. -3, -2/3 Solve -33v4 - 13041v*3 - 1283034v*2 + 1060884v + 235224 = 0 for v. -198, -2/11, 1 Solve -3y3 - 15y*2 - 12y = 0 for y. -4, -1, 0 Factor 5j5 - j4 - 16j*3/5 - 4j2/5. j2(j - 1)(5j + 2)2/5 Find x, given that x2/4 - 7x/2 + 6 = 0. 2, 12 Determine m so that 2163841m2 + 5884m + 4 = 0. -2/1471 Factor -2a3/9 - 640a*2/3 - 154238a/3 - 917764/9. -2(a + 2)(a + 479)*2/9 Determine q so that -3q*3/8 + 33q*2/8 - 39q/4 + 6 = 0. 1, 2, 8 Find d such that -4d4/7 + 36d*3/7 + 4d*2 - 276d/7 + 216/7 = 0. -3, 1, 2, 9 Factor -u*3/3 - 4u*2 + 277u/3 - 88. -(u - 11)(u - 1)(u + 24)/3 Suppose -2d5 - 10d*4 - 4d*3 + 16d*2 = 0. Calculate d. -4, -2, 0, 1 Determine h so that 5h*5 + 90h*4 + 595h*3 + 1790h*2 + 2400h + 1120 = 0. -7, -4, -2, -1 Suppose 84k5 + 3452k*4 + 3268k*3 - 16268k*2 + 8504k + 960 = 0. Calculate k. -40, -3, -2/21, 1 Let 9d2 + 1563d + 1554 = 0. What is d? -518/3, -1 Determine j so that -2j2/7 - 596j/7 - 44402/7 = 0. -149 Factor -v*2 - 12v + 85. -(v - 5)(v + 17) Suppose 6u*3 + 35u*2 + 48u + 16 = 0. Calculate u. -4, -4/3, -1/2 Factor -4a4 - 148a*3 - 408a*2. -4a*2(a + 3)(a + 34) Determine g, given that -g2/2 + 19g/2 - 44 = 0. 8, 11 Factor -2a4/5 - 14a*3/5 + 16a*2/5. -2a*2(a - 1)(a + 8)/5 Factor -3u*2/7 - 6u - 39/7. -3(u + 1)(u + 13)/7 Factor 14j2 + 4j/5. 2j(35j + 2)/5 Factor 3c*2 + 3036c + 768108. 3(c + 506)2 Let -2t*3/5 - 2t*2/5 + 92t/5 - 32 = 0. Calculate t. -8, 2, 5 Factor 3s4/5 - 21s*3/5 + 51s*2/5 - 51s/5 + 18/5. 3(s - 3)(s - 2)(s - 1)2/5 Solve -3h*4/8 - 9h*3/8 + 9h*2/4 + 21h/2 + 9 = 0 for h. -2, 3 Factor i*4/4 - 7i*2/4 + 3i/2. i(i - 2)(i - 1)(i + 3)/4 What is w in -4w*5 + 313w*4 - 7266w*3 + 44357w*2 - 69440w + 14700 = 0? 1/4, 2, 6, 35 Factor -5g4 + 380g*3 - 1095g*2. -5g*2(g - 73)(g - 3) What is l in -2l*4/9 - 16l*3/9 - 40l*2/9 - 32l/9 = 0? -4, -2, 0 Find t, given that 2t2/7 - 460t/7 + 458/7 = 0. 1, 229 Factor -5o3 - 575o*2 - 17360o - 47040. -5(o + 3)(o + 56)2 Solve -j3/5 + 56j2/5 - 11j = 0. 0, 1, 55 Suppose -18b3 - 4928b*2 + 1096b = 0. What is b? -274, 0, 2/9 Let -8n5 - 32n*4 + 186n*3 - 184n*2 - 22n + 60 = 0. Calculate n. -15/2, -1/2, 1, 2 Factor b*3/2 + 55b*2/2 + 364b - 392. (b - 1)(b + 28)2/2 Let 612w*4 + 5500w*3 + 16452w*2 + 16308w - 216 = 0. Calculate w. -3, 2/153 Factor 9g3 - 3534g*2 + 5871g - 2346. 3(g - 391)(g - 1)(3g - 2) Factor o5/3 + o4/3 - o3 - o2/3 + 2o/3. o(o - 1)*2(o + 1)(o + 2)/3 Factor -12m*4 - 72m*3 + 81m*2 - 21m. -3m(m + 7)(2m - 1)2 Factor n4 - 38n3 - 163n*2 - 208n - 84. (n - 42)(n + 1)2(n + 2) Factor -90m2 - 3512m/3 - 26/3. -2(m + 13)(135m + 1)/3 Factor 3v*3 + 24v*2 + 36v. 3v(v + 2)(v + 6) Determine p so that 2p*5/5 + 24p*4/5 + 14p*3 + 48p*2/5 = 0. -8, -3, -1, 0 Determine a so that -2a*2/3 + 34a/3 - 20 = 0. 2, 15 Factor 3c3 + 54c*2 + 180c + 168. 3(c + 2)2(c + 14) Find w, given that -3w2 + 15w - 18 = 0. 2, 3 Factor 2g3/15 + 152g*2/15 - 158g/15 - 308/15. 2(g - 2)(g + 1)(g + 77)/15 Let 52a*3 - 96a*2 - 16a = 0. What is a? -2/13, 0, 2 Find s, given that 3s3 + 90s*2 - 507s + 630 = 0. -35, 2, 3 Solve -p*2 - 101p/5 - 4 = 0. -20, -1/5 Factor 6n4 - 75n*3 + 306n*2 - 435n + 150. 3(n - 5)2(n - 2)(2n - 1) Factor 27a5/4 + 27a*4/2 - 18a*3 - 56a*2 - 32a. a(a - 2)(3a + 4)3/4 Factor 5x*4 + 5x*3 - 50x*2 - 20x + 120. 5(x - 2)2(x + 2)(x + 3) What is w in w5/2 - 23w4/2 - w3/2 + 23w2/2 = 0? -1, 0, 1, 23 What is g in -g5/4 + 3g*4 - 5g*3 = 0? 0, 2, 10 What is o in -8o*5/7 - 2o*4 + 60o*3/7 + 146o*2/7 + 8o - 24/7 = 0? -2, -1, 1/4, 3 Determine w so that -w*2/3 - 37w = 0. -111, 0 Solve 4z3 - 140z*2 + 616z - 480 = 0. 1, 4, 30 Let 3h4 - 618h*3 + 42519h*2 - 1101276h + 9526572 = 0. Calculate h. 22, 81 Factor 5u3 - 125u*2 + 520u - 400. 5(u - 20)(u - 4)(u - 1) Solve v3/6 - 79v*2/6 + 836v/3 - 722 = 0. 3, 38 What is z in -2z5 + 60z*4 - 544z*3 + 1344z*2 = 0? 0, 4, 12, 14 Factor 14p*3 - 36p*2 + 16p. 2p(p - 2)(7p - 4) Factor 2q3 + 28q*2 + 98q. 2q(q + 7)*2 Find p such that 3p*3/5 + 102p*2 + 21156p/5 - 44376/5 = 0. -86, 2 Solve -4n2 - 292n - 568 = 0. -71, -2 Determine t so that -t*4 + 62t*3/5 - 129t*2/5 + 92t/5 - 4 = 0. 2/5, 1, 10 Factor -3n5/5 - 87n*4/5 + 102n*3. -3n*3(n - 5)(n + 34)/5 Find y, given that -627y*2/2 - 624y + 6 = 0. -2, 2/209 Factor 19683x4 - 43740x*3 + 36450x*2 - 13500x + 1875. 3(9x - 5)4 Solve w2 - 260w + 16900 = 0. 130 Factor -2i*3 + 34i*2 - 94i - 130. -2(i - 13)(i - 5)(i + 1) Solve 3u*5 + 27u*4 + 51u*3 - 99u*2 - 270u = 0. -5, -3, 0, 2 Factor 3r4 + 36r*3 + 153r*2 + 264r + 144. 3(r + 1)(r + 3)(r + 4)2 Factor -2m*4 - 236m*3 - 6672m*2 + 20160m + 172800. -2(m - 6)(m + 4)(m + 60)2 Suppose 4p*2 - 4p - 120 = 0. What is p? -5, 6 Suppose -n5/5 - n4 + 7n3/5 + n2 - 6n/5 = 0. Calculate n. -6, -1, 0, 1 Factor a*2/7 - 580a/7 + 1156/7. (a - 578)(a - 2)/7 Solve 3r*3 + 54r*2 - 63r - 114 = 0. -19, -1, 2 Let 5f2 - 70f + 65 = 0. Calculate f. 1, 13 Determine a so that -3a5/8 - 39a*4/4 - 111a*3/8 + 207a*2/2 + 108a = 0. -24, -4, -1, 0, 3 Factor -2v3 - 26v*2 - 88v - 64. -2(v + 1)(v + 4)(v + 8) Factor -2a*2/7 + 332a/7 - 13778/7. -2(a - 83)2/7 What is d in -11d*4/4 + 375d*3/4 - 1777d*2/2 + 1488d - 128 = 0? 1/11, 2, 16 Factor 5b3/12 + 23b*2/12 + 9b/4 + 3/4. (b + 1)(b + 3)(5b + 3)/12 What is v in 2v*4 - 54v*3 - 118v*2 + 54v + 116 = 0? -2, -1, 1, 29 Factor 8k3/5 + 12k*2 - 212k/5 - 24. 4(k - 3)(k + 10)(2k + 1)/5 What is j in -j*3/8 - 5j*2/8 - j/2 = 0? -4, -1, 0 Solve 4c*3 - 40c*2 + 36c = 0 for c. 0, 1, 9 Factor -2j4/5 - 252j*3/5. -2j*3(j + 126)/5 Factor 2i3 - 4i*2. 2i*2(i - 2) Factor -3d4/4 - 345d*3 - 38979d*2 + 160080d - 161472. -3(d - 2)2(d + 232)*2/4 Find r, given that -2r*5 - 324r*4 - 14656r*3 - 125312r*2 - 379392r - 369664 = 0. -76, -4, -2 Find c such that c*4/10 + 3c*3/2 + 11c*2/10 - 279c/10 + 126/5 = 0. -12, -7, 1, 3 Factor 9g5/7 + 46g*4/7 + 94g*3/7 + 96g*2/7 + 7g + 10/7. (g + 1)*4(9g + 10)/7 Factor -2b*2/13 + 2480b/13 - 2478/13. -2(b - 1239)(b - 1)/13 Determine c so that -4c3 - 2292c*2 - 327180c + 329476 = 0. -287, 1 Find b, given that 2b3 + 4b*2 - 8b - 16 = 0. -2, 2 Factor 53969305q3 + 6593535q*2 + 268515q + 3645. 5(221q + 9)*3 Solve -3c*2/5 - 51c/5 - 18 = 0. -15, -2 Let 2r2/13 - 4r + 96/13 = 0. Calculate r. 2, 24 Factor b5/2 - b4 + b*2 - b/2. b(b - 1)*3(b + 1)/2 What is p in p*4 + 434p*3 + 433p*2 = 0? -433, -1, 0 Factor 4y*2/5 - 4912y/5 - 4916/5. 4(y - 1229)(y + 1)/5 Let -2a4/9 + 22a*3/9 + 176a*2/9 - 160a/9 - 512/3 = 0. What is a? -4, 3, 16 Factor 2o4/9 + 350o*3/9 + 6844o*2/3 + 410408o/9 + 390224/9. 2(o + 1)(o + 58)*3/9 Let 3o*5/2 + 15o*4/2 + 12o*3 + 6o*2 = 0. What is o? -2, -1, 0 Factor 3t*3/8 - 25965t*2/8 + 74909025t/8 - 72037512375/8. 3(t - 2885)3/8 Factor -5h*2/2 + 615h/2. -5h(h - 123)/2 Solve -l*3/2 - 3009l*2/2 - 3018027l/2 -	{ "pile_set_name": "DM Mathematics" }
base 5, what is -120 - 12331? -13001 In base 13, what is -aa05 - -2? -aa03 In base 15, what is -2c1e7 - -4? -2c1e3 In base 16, what is -2 - -5f268? 5f266 In base 10, what is 39 - -21457? 21496 In base 6, what is -3052 - -4320? 1224 In base 3, what is 102222120122 - 2? 102222120120 In base 7, what is -11 - 622? -633 In base 3, what is -21 - 1101121222? -1101122020 In base 7, what is 203 + -205? -2 In base 13, what is -18a6 - -37? -186c In base 8, what is -116765 - 1? -116766 In base 3, what is 1220221200 - -21? 1220221221 In base 5, what is 30322420 - 2? 30322413 In base 16, what is 38a - -2c? 3b6 In base 13, what is 5a0c1 - 2? 5a0bc In base 12, what is 8b2 + 9? 8bb In base 11, what is 3 + 15865? 15868 In base 7, what is 333 - -620? 1253 In base 13, what is 21 - -169a0? 169c1 In base 7, what is -140 + 1116? 646 In base 8, what is 1017 - -13463? 14502 In base 6, what is 1220030 - 3? 1220023 In base 16, what is -1 - 2834f? -28350 In base 4, what is 1330031203 - -10? 1330031213 In base 3, what is -1 - 1210002000? -1210002001 In base 13, what is 15 - c25? -c10 In base 16, what is -1 - -17bca2? 17bca1 In base 10, what is -2121 + 936? -1185 In base 4, what is 122320 + 33010? 221330 In base 4, what is 1202120 + 102232? 1311012 In base 7, what is -3 - -152411? 152405 In base 9, what is 48466 + -3? 48463 In base 11, what is 59247 - -8? 59254 In base 15, what is -5 + 8553? 854d In base 13, what is -4381 + bc? -4292 In base 4, what is 1212123 - -203? 1212332 In base 13, what is 4a32 + 5? 4a37 In base 3, what is -1010001211 + -2? -1010001220 In base 15, what is e + -57b6? -57a7 In base 3, what is -120001 + 100212? -12012 In base 11, what is 1470a8 + -2? 1470a6 In base 4, what is -10110310211 - -10? -10110310201 In base 8, what is -253076 - -12? -253064 In base 13, what is -54c2 + 9? -54b6 In base 10, what is 4 + -45046? -45042 In base 15, what is 46861 + 16? 46877 In base 6, what is -251524 + 22? -251502 In base 5, what is -31003 + -434? -31442 In base 6, what is -405351 - 15? -405410 In base 2, what is 101001 - -100101111? 101011000 In base 7, what is 524 + -302? 222 In base 12, what is -99425 - 4? -99429 In base 13, what is -123 + 217? c4 In base 15, what is -2 - -24e88? 24e86 In base 11, what is 68 - -8941? 89a9 In base 6, what is -114520 - 50? -115010 In base 2, what is 111000001100 - -10000111? 111010010011 In base 6, what is -31 + 554225? 554154 In base 6, what is -3 + -1132315? -1132322 In base 11, what is 155 - 1114? -a6a In base 14, what is 1 + 2a01? 2a02 In base 6, what is -5 + -10013004? -10013013 In base 10, what is 3 - -35564? 35567 In base 2, what is 1010101111 + 1011010011? 10110000010 In base 9, what is 18 + -1664? -1645 In base 6, what is 133 - -1005? 1142 In base 4, what is -11003302 + 103? -11003133 In base 6, what is -13 - 352110? -352123 In base 10, what is 6786 + 14? 6800 In base 5, what is 14224 - 20302? -1023 In base 13, what is 1 + -b665? -b664 In base 16, what is 7f8 - -a3? 89b In base 7, what is 21002 + -6? 20663 In base 15, what is 66 + -1820? -17a9 In base 9, what is 7258 + 71? 7340 In base 11, what is -73a8 + -4? -7401 In base 4, what is 1300333 + -103? 1300230 In base 2, what is -1011110011011111000 + 0? -1011110011011111000 In base 9, what is 1 - -416175? 416176 In base 8, what is 152455 - 6? 152447 In base 16, what is 19443 + -1? 19442 In base 13, what is -14172 - 7? -14179 In base 5, what is -1034233 - 31? -1034314 In base 15, what is 11e + -182a? -170b In base 13, what is 97 + -250? -186 In base 2, what is -1001001011111101000 + 10? -1001001011111100110 In base 4, what is 2112133 + 0? 2112133 In base 14, what is -5 - 9364? -9369 In base 8, what is -5 + -41664? -41671 In base 13, what is 25bb + -424? 2197 In base 3, what is -2 - 22111020121? -22111020200 In base 15, what is -1277 + 3? -1274 In base 9, what is 5274 + -27? 5246 In base 6, what is 12 - 5432433? -5432421 In base 8, what is -135 - 12? -147 In base 14, what is 314c17 + -5? 314c12 In base 16, what is -2 - 18e78? -18e7a In base 3, what is -11120220 + -20221? -11211211 In base 2, what is 1100011101110110111 - 11? 1100011101110110100 In base 7, what is 5 + -2553454? -2553446 In base 8, what is -256231 - 0? -256231 In base 6, what is -55 - -10214? 10115 In base 14, what is 1070 + -26? 1048 In base 14, what is 535d - 0? 535d In base 14, what is -33 - ab? -100 In base 15, what is 1937d + 4? 19382 In base 11, what is -5054 + 3? -5051 In base 14, what is 0 + -db82c? -db82c In base 3, what is 102 + -111020101101? -111020100222 In base 13, what is 669c + 0? 669c In base 5, what is 24204101 + 24? 24204130 In base 13, what is -376cb + 0? -376cb In base 12, what is -4b + 896? 847 In base 13, what is 3aa + 26? 403 In base 3, what is -1002022 + -112? -1002211 In base 11, what is 100a12 - -5? 100a17 In base 5, what is 2140012 - 0? 2140012 In base 5, what is 214213 - -1? 214214 In base 10, what is 326 + 18? 344 In base 2, what is 1101110011000011110111 - 10? 1101110011000011110101 In base 7, what is -226 - -3145? 2616 In base 8, what is 33456 - 5? 33451 In base 12, what is -77b1b - -3? -77b18 In base 3, what is -11202221 + 2? -11202212 In base 7, what is -556 - 55? -644 In base 15, what is b - a3b4? -a3a8 In base 9, what is 277284 + -34? 277250 In base 8, what is 124 - 3454? -3330 In base 3, what is 12002 - 2022101? -2010022 In base 16, what is -2e01d + 5? -2e018 In base 8, what is 3056 + 462? 3540 In base 7, what is 61 - 152? -61 In base 3, what is 1211001 + -120022? 1020202 In base 12, what is -4 - -b8? b4 In base 16, what is -ba00 + -4? -ba04 In base 2, what is -1001011000 + 1101111? -111101001 In base 2, what is -10001100111011001010 - -101? -10001100111011000101 In base 5, what is -140 - -120? -20 In base 3, what is -120222210 - -1010? -120221200 In base 13, what is 9680 - -9? 9689 In base 10, what is -1 + -291426? -291427 In base 11, what is 580 - -448? a18 In base 14, what is -631d32 + 1? -631d31 In base 16, what is 108 + 10d5? 11dd In base 13, what is 41 - -7c38? 7c79 In base 10, what is 2 - -39761? 39763 In base 16, what is -5bf7e - -1? -5bf7d In base 12, what is -54ab + -174? -5663 In base 6, what is 1 - 22244512? -22244511 In base 5, what is 11144 + 23332? 40031 In base 3, what is -12 - -101211201? 101211112 In base 12, what is -2a - 139? -167 In base 10, what is -155478 + -5? -155483 In base 6, what is -1500 - 224? -2124 In base 4, what is -122133 - 2302? -131101 In base 4, what is 111011 - -23? 111100 In base 16, what is 4f + -3b? 14 In base 10, what is 2 + 56531? 56533 In base 12, what is 3124 - 7? 3119 In base 5, what is 1141434 - -220? 1142204 In base 4, what is -302330332 + -3? -302331001 In base 16, what is -3 - d6a49? -d6a4c In base 12, what is -a + -b11? -b1b In base 15, what is 259 + -1b? 23d In base 5, what is -144 - -130434? 130240 In base 6, what is -1 + 2422441? 2422440 In base 4, what is -12 - 211010111? -211010123 In base 15, what is 4ea9e + 1? 4eaa0 In base 3, what is -1 + 22002101012? 22002101011 In base 3, what is -101 - -2120111201? 2120111100 In base 11, what is 18 + -2737? -271a In base 14, what is -d + -2110a? -21119 In base 11, what is -a6a - -29? -a41 In base 13, what is 37 + -aaa1? -aa67 In base 16, what is 4c3 - 267? 25c In base 11, what is -a - -627? 618 In base 3, what is -221110 + -111000? -1102110 In base 3, what is -2 + -102101020110? -102101020112 In base 12, what is 332 + -1599? -1267 In base 16, what is 11fd3 + 2? 11fd5 In base 12, what is -47 - -1619? 1592 In base 14, what is -aa12 - 4c? -aa60 In base 6, what is 20 + 25411? 25431 In base 5, what is 32 - -1310242? 1310324 In base 8, what is 0 + -1361352? -1361352 In base 8, what is -15 + 1726? 1711 In base 9, what is -328 + -38? -367 In base 16, what is 5 - -e078? e07d In base 5, what is -4 + 21112? 21103 In base 6, what is 3 + -4534052? -4534045 In base 8, what is 453 + 104? 557 In base 5, what is -234 + 123142? 122403 In base 3, what is -112 - 1020001200? -1020002012 In base 13, what is -6 - -112c11? 112c08 In base 7, what is 3634 - -42? 4006 In base 14, what is -3 + -43c3b? -43c40 In base 2, what is -101010110011100101 + 100? -101010110011100001 In base 4, what is -101 - -1113031? 1112330 In base 15, what is 22c7a - -1? 22c7b In base 16, what is -5 + a550? a54b In base 15, wha	{ "pile_set_name": "DM Mathematics" }
f 2756692? False Is 213004 a multiple of 206? True Is 190 a factor of 23370? True Does 321 divide 126795? True Is 270751 a multiple of 59? True Is 43 a factor of 4812560? True Is 81 a factor of 321118? False Is 101 a factor of 117362? True Does 407 divide 1579160? True Is 10 a factor of 70350? True Does 7 divide 204068? False Does 3 divide 147163? False Is 243 a factor of 5652180? True Is 584 a factor of 2534279? False Does 7 divide 400794? False Is 7 a factor of 4960741? False Is 6 a factor of 72653? False Is 15 a factor of 1348275? True Does 222 divide 130317? False Is 22 a factor of 12243352? True Is 1302048 a multiple of 864? True Does 56 divide 259738? False Does 124 divide 299336? True Does 66 divide 1775400? True Is 11 a factor of 1304927? False Does 83 divide 229080? True Is 49998 a multiple of 114? False Is 1074840 a multiple of 77? False Is 81 a factor of 1614122? False Does 13 divide 5664670? False Is 475501 a multiple of 13? True Is 123310 a multiple of 55? True Does 3 divide 49641? True Does 18 divide 1325353? False Does 149 divide 68506? False Does 31 divide 1648644? False Does 256 divide 1189120? True Is 1110306 a multiple of 798? False Is 36 a factor of 1334844? True Does 266 divide 196093? False Is 76 a factor of 56653? False Is 356780 a multiple of 266? False Is 210728 a multiple of 371? True Does 245 divide 138774? False Is 165 a factor of 40755? True Is 37 a factor of 122389? False Is 4261472 a multiple of 20? False Is 11 a factor of 143185? False Is 64928 a multiple of 32? True Is 142844 a multiple of 3? False Is 7547636 a multiple of 174? False Does 248 divide 8186232? True Does 59 divide 12980? True Does 11 divide 2777613? False Is 182975 a multiple of 11? False Is 358362 a multiple of 387? True Is 1464930 a multiple of 90? True Does 51 divide 64413? True Is 154114 a multiple of 251? True Does 19 divide 2276286? False Does 208 divide 67158? False Is 637 a factor of 434434? True Is 11 a factor of 317552? False Is 1132261 a multiple of 116? False Does 19 divide 92112? True Does 203 divide 2907405? False Is 267 a factor of 1426652? False Is 3995352 a multiple of 216? True Is 154 a factor of 146671? False Is 172385 a multiple of 171? False Does 78 divide 948012? True Is 1439836 a multiple of 220? False Is 16 a factor of 12721810? False Is 178099 a multiple of 27? False Does 17 divide 11207760? True Is 11270 a multiple of 35? True Does 397 divide 4767176? True Is 13 a factor of 357325? False Does 292 divide 1182661? False Is 154908 a multiple of 18? True Is 35619 a multiple of 2? False Does 3 divide 81925? False Is 135249 a multiple of 48? False Is 53201 a multiple of 4? False Does 166 divide 2587770? False Does 23 divide 6085731? True Is 65 a factor of 71251? False Is 38986 a multiple of 101? True Is 21 a factor of 892416? True Does 215 divide 9043115? True Is 3641448 a multiple of 1046? False Is 6 a factor of 30080? False Does 1420 divide 1067840? True Is 213180 a multiple of 317? False Is 19 a factor of 810388? True Does 11 divide 5726187? False Is 10 a factor of 9710970? True Does 1198 divide 2249145? False Does 11 divide 627484? True Is 2 a factor of 224349? False Is 50 a factor of 275439? False Is 281 a factor of 731004? False Is 11 a factor of 710983? False Is 1337132 a multiple of 4? True Is 30 a factor of 13280? False Is 27 a factor of 105003? True Does 45 divide 1992541? False Is 125 a factor of 1108437? False Is 51 a factor of 18082? False Is 36936 a multiple of 243? True Is 38 a factor of 4766932? False Is 55 a factor of 62205? True Is 21 a factor of 656964? True Is 69992 a multiple of 336? False Is 22 a factor of 1139138? True Is 44 a factor of 79492? False Is 338 a factor of 565474? True Is 2 a factor of 114720? True Is 784068 a multiple of 28? False Is 2 a factor of 6598? True Does 130 divide 12561380? True Is 12 a factor of 516211? False Does 43 divide 770845? False Is 50 a factor of 76430? False Is 361710 a multiple of 18? True Is 13 a factor of 10603324? False Is 8 a factor of 509481? False Is 2985212 a multiple of 4? True Is 15 a factor of 15306? False Does 45 divide 129185? False Does 12 divide 2342856? True Does 7 divide 176667? False Is 33704 a multiple of 22? True Is 201 a factor of 1952738? False Does 159 divide 284982? False Does 13 divide 1903941? True Does 17 divide 3597724? False Does 15 divide 2690508? False Is 186 a factor of 349122? True Is 3976170 a multiple of 11? True Does 688 divide 10659088? False Does 38 divide 20178? True Is 467082 a multiple of 63? True Does 4 divide 44660? True Is 8520 a multiple of 12? True Is 660 a factor of 28779033? False Is 250315 a multiple of 7? False Does 355 divide 5440005? False Is 460155 a multiple of 58? False Is 50682 a multiple of 18? False Is 29 a factor of 343278? False Is 7642004 a multiple of 283? False Is 8 a factor of 3071992? True Does 35 divide 420210? True Does 42 divide 331968? True Does 22 divide 1870495? False Does 20 divide 47200? True Does 6 divide 90049? False Is 44 a factor of 682572? True Is 36273 a multiple of 42? False Is 44166 a multiple of 102? True Is 51 a factor of 478431? True Is 1591 a factor of 16016427? False Is 72358 a multiple of 179? False Does 217 divide 241872? False Is 8315420 a multiple of 92? True Is 21 a factor of 882982? False Is 282 a factor of 2375850? True Does 33 divide 151569? True Is 355176 a multiple of 12? True Is 63800 a multiple of 8? True Does 113 divide 366346? True Is 9 a factor of 491400? True Does 25 divide 3576550? True Does 14 divide 1139824? True Does 59 divide 7715548? True Does 35 divide 1783355? True Does 699 divide 4517637? True Is 5280 a multiple of 55? True Is 538408 a multiple of 26? True Is 388620 a multiple of 204? True Does 361 divide 8339822? True Is 65 a factor of 31265? True Is 507109 a multiple of 17? False Does 11 divide 47126? False Is 1264 a factor of 9292928? True Does 23 divide 48016? False Does 73 divide 1314365? True Is 18 a factor of 14387429? False Is 100974 a multiple of 6? True Does 19 divide 267557? False Does 133 divide 646513? True Is 7090812 a multiple of 457? True Does 529 divide 8043445? True Is 94 a factor of 551686? True Does 102 divide 785406? False Is 7897114 a multiple of 767? False Is 78 a factor of 253032? True Is 12 a factor of 55188? True Is 630308 a multiple of 28? True Is 36 a factor of 6296544? True Is 7 a factor of 9942999? False Is 293592 a multiple of 49? False Does 121 divide 3012120? False Does 654 divide 1587912? True Is 50 a factor of 194958? False Does 14 divide 3611678? True Is 23155 a multiple of 13? False Does 84 divide 19824? True Does 660 divide 3991020? True Is 6 a factor of 904094? False Does 201 divide 836949? False Is 12 a factor of 47845? False Is 612 a factor of 772956? True Does 21 divide 94752? True Is 9 a factor of 2143737? True Does 169 divide 2618993? True Does 30 divide 329760? True Does 74 divide 2386625? False Does 211 divide 2304120? True Does 1769 divide 17046084? True Does 634 divide 3836334? True Is 6 a factor of 473425? False Is 108664 a multiple of 17? True Does 5 divide 471749? False Is 269 a factor of 1841036? True Is 3 a factor of 7157? False Is 89 a factor of 8720289? False Is 49 a factor of 418566? False Is 106 a factor of 604624? True Is 204 a factor of 5749? False Is 225 a factor of 6326008? False Is 885849 a multiple of 148? False Does 210 divide 444208? False Is 43357 a multiple of 191? True Is 3902262 a multiple of 10? False Is 6 a factor of 5317? False Is 759006 a multiple of 8? False Is 3 a factor of 42463? False Is 15 a factor of 5880? True Is 96096 a multiple of 6? True Does 6 divide 1083150? True Is 129 a factor of 1877764? False Is 493950 a multiple of 150? True Is 230973 a multiple of 46? False Does 5 divide 221059? False Is 38 a factor of 3150317? False Is 367691 a multiple of 11? False Is 126 a factor of 107730? True Is 4342041 a multiple of 61? True Does 18 divide 2628954? True Is 418 a factor of 11789254? False Does 378 divide 25155900? True Is 69 a factor of 5016300? True Is 33 a factor of 556336? False Is 156293 a multiple of 6? False Is 125 a factor of 178594? False Is 754 a factor of 889917? False Is 3795 a multiple of 82? False Does 138 divide 100740? True Is 402891 a multiple of 14? False Is 2788	{ "pile_set_name": "DM Mathematics" }
picked without replacement from {j: 3, p: 12}? 1/35 Calculate prob of sequence pj when two letters picked without replacement from {p: 1, s: 2, w: 1, r: 3, j: 3, q: 1}. 3/110 Two letters picked without replacement from {x: 2, r: 3}. What is prob of sequence xx? 1/10 Two letters picked without replacement from ccchchhccccchcclhclc. Give prob of sequence ll. 1/190 Calculate prob of sequence iv when two letters picked without replacement from zzvzizbizvibzbizz. 1/34 Two letters picked without replacement from {f: 3, z: 7, q: 4}. What is prob of sequence zq? 2/13 Three letters picked without replacement from eeceyegq. Give prob of sequence yqg. 1/336 What is prob of sequence pp when two letters picked without replacement from {p: 4, l: 6}? 2/15 What is prob of sequence cp when two letters picked without replacement from qqfgqcqcfgpgqgq? 1/105 Calculate prob of sequence yp when two letters picked without replacement from {y: 2, d: 3, i: 1, u: 1, h: 5, p: 1}. 1/78 Calculate prob of sequence mb when two letters picked without replacement from {m: 5, b: 9}. 45/182 What is prob of sequence ddm when three letters picked without replacement from dmkdmmmddmpmmmpm? 9/280 Calculate prob of sequence qq when two letters picked without replacement from uqqqu. 3/10 What is prob of sequence qs when two letters picked without replacement from qsmqdqsqdd? 4/45 What is prob of sequence xb when two letters picked without replacement from xubpxxbpbbbbtb? 3/26 Two letters picked without replacement from xqoxcrxqcqoxqqfqfoc. Give prob of sequence qq. 5/57 Two letters picked without replacement from {a: 2, f: 1, n: 1, i: 6, j: 2, k: 7}. Give prob of sequence ka. 7/171 Four letters picked without replacement from pthiv. Give prob of sequence piip. 0 What is prob of sequence qqq when three letters picked without replacement from qqsasqapq? 1/21 Four letters picked without replacement from mujddvmjjjdummjuuum. What is prob of sequence vuuj? 25/23256 Two letters picked without replacement from frfrfrrhr. Give prob of sequence fr. 5/24 Two letters picked without replacement from {g: 9, i: 2, j: 3, n: 2}. Give prob of sequence gg. 3/10 Two letters picked without replacement from {b: 2, h: 1, o: 7, m: 3, z: 6}. What is prob of sequence zz? 5/57 Four letters picked without replacement from {r: 2, e: 1, m: 1, v: 1}. Give prob of sequence mver. 1/60 What is prob of sequence ih when two letters picked without replacement from {i: 5, q: 2, w: 5, m: 2, p: 1, h: 1}? 1/48 Calculate prob of sequence hb when two letters picked without replacement from hqbhbrd. 2/21 Three letters picked without replacement from {s: 2, u: 1, v: 2, y: 8, o: 2, g: 2}. What is prob of sequence ysy? 7/255 Four letters picked without replacement from {i: 6, q: 1, f: 4, b: 1, p: 6}. What is prob of sequence fiqi? 1/612 Three letters picked without replacement from {f: 4, n: 7, p: 7}. What is prob of sequence nff? 7/408 Four letters picked without replacement from kkkqxqxqkfxkkxxk. Give prob of sequence qkxq. 1/208 Two letters picked without replacement from {w: 1, p: 1, u: 9, y: 3}. Give prob of sequence yp. 3/182 Two letters picked without replacement from uuaaquuuuaauqua. Give prob of sequence ua. 4/21 Three letters picked without replacement from {n: 2, p: 8}. Give prob of sequence pnp. 7/45 What is prob of sequence od when two letters picked without replacement from {d: 12, o: 3, a: 2}? 9/68 What is prob of sequence cf when two letters picked without replacement from {c: 5, j: 3, f: 3, v: 1}? 5/44 Three letters picked without replacement from {m: 5, e: 15}. What is prob of sequence eme? 35/228 Calculate prob of sequence gg when two letters picked without replacement from {i: 2, g: 7}. 7/12 What is prob of sequence zww when three letters picked without replacement from {w: 6, z: 2}? 5/28 Calculate prob of sequence zd when two letters picked without replacement from {n: 2, z: 2, d: 2, t: 6}. 1/33 Three letters picked without replacement from ycryyyryyccyyyrryy. What is prob of sequence rrc? 1/136 What is prob of sequence lh when two letters picked without replacement from htkglhukhluguuk? 1/35 What is prob of sequence so when two letters picked without replacement from sddddoddddzzsddsdods? 2/95 Four letters picked without replacement from odooord. What is prob of sequence rooo? 1/35 What is prob of sequence jjjj when four letters picked without replacement from {i: 3, j: 4}? 1/35 Calculate prob of sequence ck when two letters picked without replacement from yycyycccccckkkck. 2/15 Three letters picked without replacement from evqenehqdddqdhh. Give prob of sequence dqq. 4/455 Calculate prob of sequence wttw when four letters picked without replacement from {w: 14, t: 5}. 455/11628 Three letters picked without replacement from fwwwfavwwvwav. Give prob of sequence vvw. 3/143 Four letters picked without replacement from {u: 4, e: 3, k: 2, z: 2}. Give prob of sequence ueuk. 1/110 What is prob of sequence hv when two letters picked without replacement from shskkhksxv? 1/45 Three letters picked without replacement from {p: 1, c: 1, x: 1, z: 1, i: 1}. What is prob of sequence zpc? 1/60 Two letters picked without replacement from uouma. What is prob of sequence uu? 1/10 Two letters picked without replacement from {u: 1, t: 2, z: 1, l: 2, o: 1, a: 2}. What is prob of sequence oz? 1/72 Two letters picked without replacement from {v: 3, y: 1, g: 3, c: 3, p: 2, e: 1}. Give prob of sequence gg. 1/26 Three letters picked without replacement from sbcfqns. Give prob of sequence fbc. 1/210 Two letters picked without replacement from cjxjmdjjjdcrd. What is prob of sequence rd? 1/52 What is prob of sequence vz when two letters picked without replacement from vvzztzztzzztztuz? 3/40 Four letters picked without replacement from {z: 1, o: 3, p: 2, b: 4, a: 6}. What is prob of sequence ozbp? 1/1820 Two letters picked without replacement from vktkknkvtvkvkhnnv. Give prob of sequence tv. 5/136 What is prob of sequence ll when two letters picked without replacement from laalll? 2/5 Calculate prob of sequence pe when two letters picked without replacement from laepllppel. 1/15 Four letters picked without replacement from {c: 1, k: 1, r: 1, n: 2, o: 1, q: 1}. What is prob of sequence knnr? 1/420 What is prob of sequence upun when four letters picked without replacement from upjppujpjpnp? 1/990 Calculate prob of sequence mccc when four letters picked without replacement from {c: 15, m: 3}. 91/816 What is prob of sequence ii when two letters picked without replacement from yyeyiyi? 1/21 Three letters picked without replacement from nnnnoonnonnnnononnn. What is prob of sequence nnn? 364/969 What is prob of sequence aa when two letters picked without replacement from {a: 6, p: 7}? 5/26 Three letters picked without replacement from dddddddpwrdddbdbbdg. Give prob of sequence wdg. 2/969 Calculate prob of sequence fnj when three letters picked without replacement from ffjfbfbnnfccfcffnbff. 1/228 Three letters picked without replacement from {o: 4, m: 6}. Give prob of sequence mom. 1/6 What is prob of sequence gb when two letters picked without replacement from gkbkgbggj? 1/9 What is prob of sequence kq when two letters picked without replacement from {q: 4, k: 3}? 2/7 Calculate prob of sequence lllt when four letters picked without replacement from lllt. 1/4 Three letters picked without replacement from ompppomo. Give prob of sequence omp. 3/56 Calculate prob of sequence vg when two letters picked without replacement from {v: 1, y: 10, a: 4, g: 2}. 1/136 Calculate prob of sequence hqqq when four letters picked without replacement from hqqqqhh. 3/35 What is prob of sequence vmr when three letters picked without replacement from {l: 1, v: 2, f: 2, r: 2, m: 1}? 1/84 Calculate prob of sequence vldd when four letters picked without replacement from {u: 6, v: 3, t: 5, l: 2, d: 2}. 1/6120 Four letters picked without replacement from hhuhhhuhuhhh. Give prob of sequence uhhu. 2/55 Three letters picked without replacement from {m: 1, q: 1, g: 1, d: 2, y: 2}. What is prob of sequence dgm? 1/105 What is prob of sequence cr when two letters picked without replacement from {h: 2, c: 1, r: 2}? 1/10 Calculate prob of sequence yyu when three letters picked	{ "pile_set_name": "DM Mathematics" }
9. 2309 What are the prime factors of 1547? 7, 13, 17 What are the prime factors of 36848? 2, 7, 47 What are the prime factors of 25283? 131, 193 What are the prime factors of 740? 2, 5, 37 What are the prime factors of 3473? 23, 151 What are the prime factors of 1255? 5, 251 What are the prime factors of 10268? 2, 17, 151 List the prime factors of 5200. 2, 5, 13 What are the prime factors of 3582? 2, 3, 199 List the prime factors of 16095. 3, 5, 29, 37 What are the prime factors of 14686? 2, 7, 1049 List the prime factors of 632. 2, 79 What are the prime factors of 9? 3 List the prime factors of 29244. 2, 3, 2437 What are the prime factors of 30931? 30931 What are the prime factors of 56475? 3, 5, 251 List the prime factors of 206. 2, 103 What are the prime factors of 129853? 129853 What are the prime factors of 110? 2, 5, 11 What are the prime factors of 2114? 2, 7, 151 List the prime factors of 88105. 5, 67, 263 List the prime factors of 1317. 3, 439 What are the prime factors of 73758? 2, 3, 19, 647 List the prime factors of 566. 2, 283 List the prime factors of 1393. 7, 199 What are the prime factors of 24222? 2, 3, 11, 367 List the prime factors of 17888. 2, 13, 43 List the prime factors of 3291. 3, 1097 What are the prime factors of 69242? 2, 89, 389 List the prime factors of 3468. 2, 3, 17 What are the prime factors of 979? 11, 89 What are the prime factors of 1861? 1861 List the prime factors of 4416. 2, 3, 23 List the prime factors of 5967. 3, 13, 17 List the prime factors of 2808. 2, 3, 13 What are the prime factors of 3233? 53, 61 List the prime factors of 52394. 2, 17, 23, 67 What are the prime factors of 7302? 2, 3, 1217 List the prime factors of 7476. 2, 3, 7, 89 List the prime factors of 681. 3, 227 List the prime factors of 7310. 2, 5, 17, 43 What are the prime factors of 4825? 5, 193 List the prime factors of 1443. 3, 13, 37 List the prime factors of 3171. 3, 7, 151 List the prime factors of 15740. 2, 5, 787 What are the prime factors of 1543? 1543 What are the prime factors of 2538? 2, 3, 47 What are the prime factors of 1814? 2, 907 What are the prime factors of 2522? 2, 13, 97 List the prime factors of 15516. 2, 3, 431 What are the prime factors of 71134? 2, 7, 5081 List the prime factors of 20601. 3, 7, 109 List the prime factors of 4226. 2, 2113 What are the prime factors of 4684? 2, 1171 What are the prime factors of 139? 139 List the prime factors of 1434. 2, 3, 239 What are the prime factors of 20? 2, 5 List the prime factors of 6011. 6011 List the prime factors of 9060. 2, 3, 5, 151 What are the prime factors of 1172? 2, 293 List the prime factors of 519. 3, 173 List the prime factors of 83. 83 List the prime factors of 5319. 3, 197 What are the prime factors of 11479? 13, 883 What are the prime factors of 2327? 13, 179 What are the prime factors of 221? 13, 17 What are the prime factors of 24809? 24809 What are the prime factors of 2852? 2, 23, 31 What are the prime factors of 18134? 2, 9067 List the prime factors of 42609. 3, 7, 2029 List the prime factors of 10763. 47, 229 What are the prime factors of 2862? 2, 3, 53 List the prime factors of 504. 2, 3, 7 List the prime factors of 18358. 2, 67, 137 What are the prime factors of 18008? 2, 2251 What are the prime factors of 9951? 3, 31, 107 What are the prime factors of 11880? 2, 3, 5, 11 What are the prime factors of 57424? 2, 37, 97 List the prime factors of 21570. 2, 3, 5, 719 What are the prime factors of 2325? 3, 5, 31 What are the prime factors of 35457? 3, 53, 223 What are the prime factors of 346? 2, 173 What are the prime factors of 9562? 2, 7, 683 List the prime factors of 10430. 2, 5, 7, 149 List the prime factors of 12922. 2, 7, 13, 71 List the prime factors of 3374. 2, 7, 241 List the prime factors of 4879. 7, 17, 41 What are the prime factors of 1918? 2, 7, 137 List the prime factors of 15782. 2, 13, 607 List the prime factors of 795. 3, 5, 53 What are the prime factors of 35057? 11, 3187 What are the prime factors of 47818? 2, 23909 List the prime factors of 39032. 2, 7, 17, 41 What are the prime factors of 13810? 2, 5, 1381 List the prime factors of 78983. 19, 4157 List the prime factors of 9924. 2, 3, 827 What are the prime factors of 133235? 5, 26647 List the prime factors of 428. 2, 107 What are the prime factors of 73? 73 What are the prime factors of 2128? 2, 7, 19 What are the prime factors of 728? 2, 7, 13 List the prime factors of 963. 3, 107 What are the prime factors of 37397? 37397 What are the prime factors of 35288? 2, 11, 401 What are the prime factors of 136541? 136541 List the prime factors of 85. 5, 17 List the prime factors of 143051. 19, 7529 List the prime factors of 831. 3, 277 What are the prime factors of 1899? 3, 211 List the prime factors of 1292. 2, 17, 19 What are the prime factors of 4833? 3, 179 What are the prime factors of 5078? 2, 2539 List the prime factors of 88. 2, 11 What are the prime factors of 43186? 2, 11, 13, 151 What are the prime factors of 3639? 3, 1213 List the prime factors of 26877. 3, 17, 31 List the prime factors of 61111. 23, 2657 List the prime factors of 48770. 2, 5, 4877 What are the prime factors of 13176? 2, 3, 61 List the prime factors of 11635. 5, 13, 179 List the prime factors of 20922. 2, 3, 11, 317 What are the prime factors of 17595? 3, 5, 17, 23 What are the prime factors of 49? 7 What are the prime factors of 15452? 2, 3863 List the prime factors of 9093. 3, 7, 433 What are the prime factors of 22499? 149, 151 What are the prime factors of 132? 2, 3, 11 List the prime factors of 18528. 2, 3, 193 What are the prime factors of 618? 2, 3, 103 What are the prime factors of 55957? 11, 5087 What are the prime factors of 55953? 3, 6217 What are the prime factors of 174300? 2, 3, 5, 7, 83 What are the prime factors of 11165? 5, 7, 11, 29 List the prime factors of 14854. 2, 7, 1061 List the prime factors of 1954. 2, 977 What are the prime factors of 23708? 2, 5927 List the prime factors of 4121. 13, 317 What are the prime factors of 226? 2, 113 What are the prime factors of 89509? 7, 19, 673 What are the prime factors of 4026? 2, 3, 11, 61 List the prime factors of 68993. 68993 List the prime factors of 1402. 2, 701 List the prime factors of 667. 23, 29 What are the prime factors of 377? 13, 29 What are the prime factors of 4022? 2, 2011 What are the prime factors of 3527? 3527 List the prime factors of 12175. 5, 487 List the prime factors of 413. 7, 59 List the prime factors of 975. 3, 5, 13 What are the prime factors of 241? 241 What are the prime factors of 5060? 2, 5, 11, 23 What are the prime factors of 17572? 2, 23, 191 List the prime factors of 41557. 29, 1433 What are the prime factors of 28386? 2, 3, 19, 83 What are the prime factors of 2514? 2, 3, 419 List the prime factors of 48566. 2, 7, 3469 What are the prime factors of 552? 2, 3, 23 List the prime factors of 2843. 2843 What are the prime factors of 3115? 5, 7, 89 What are the prime factors of 2403? 3, 89 List the prime factors of 3531. 3, 11, 107 List the prime factors of 169709. 169709 What are the prime factors of 172969? 172969 What are the prime factors of 2115? 3, 5, 47 List the prime factors of 2077. 31, 67 List the prime factors of 2056. 2, 257 What are the prime factors of 966? 2, 3, 7, 23 What are the prime factors of 782? 2, 17, 23 List the prime factors of 101374. 2, 7, 13, 557 List the prime factors of 13096. 2, 1637 What are the prime factors of 3242? 2, 1621 List the prime factors of 9527. 7, 1361 List the prime factors of 114588. 2, 3, 1061 What are the prime factors of 1869? 3, 7, 89 What are the prime factors of 5482? 2, 2741 List the prime factors of 14112. 2, 3, 7 List the prime factors of 2561. 13, 197 What are the prime factors of 1217? 1217 List the prime factors of 10222. 2, 19, 269 List the prime factors of 6840. 2, 3, 5, 19 List the prime factors of 2135. 5, 7, 61 List the prime factors of 7749. 3, 7, 41 List the prime factors of 1229. 1229 List the prime factors of 608. 2, 19 List the prime factors of 48009. 3, 13, 1231 What are the prime factors of 2334? 2, 3, 389 What are the prime factors of 5988? 2, 3, 499 List the prime factors of 557. 557 What are the prime factors of 11164? 2, 2791 What are the	{ "pile_set_name": "DM Mathematics" }
et b(j) = -7j2. Let w(h) be the third derivative of -h7/252 + 7h*4/3 - 9h*2 - 3h. Let s(q) be the second derivative of w(q). What is b(s(v))? -700v4 Let r(u) = 4u. Let s(x) = 7x2 - 9x*2 - 43x*2 - 23x*2. What is r(s(n))? -272n*2 Let q(l) = -59l. Let o(u) be the first derivative of 3u3 - 468. Give q(o(f)). -531f*2 Let i(f) = -3f2. Let c(m) be the third derivative of m4/12 + 29m3/6 + 345m*2. Calculate c(i(x)). -6x*2 + 29 Let t(g) = -2g. Let u(i) = 359i2 - 11i. What is t(u(o))? -718o2 + 22o Let f(r) = -r*2 + 4r + 8. Let c be f(5). Let b(y) = 0y - cy - y + 3y. Let k(d) = 27d. Determine k(b(s)). -27s Let k(y) be the second derivative of -y7/630 - 19y*4/6 - 36y. Let o(s) be the third derivative of k(s). Let j(f) = 5f2. Determine o(j(g)). -100g*4 Let n(d) = 3d*2 + 70d. Let j(b) = -192b2. Calculate n(j(y)). 110592y*4 - 13440y*2 Let g(v) = 18v + 21. Let a(z) = 326z2 - 325z*2 - 6z + 6z. What is g(a(c))? 18c*2 + 21 Let w(f) = -2f. Let a(n) = -102570n2. What is w(a(p))? 205140p*2 Let g(x) be the second derivative of -31x*4/12 - 8x. Let j(t) be the third derivative of -t*4/24 - 18t*2 - 4t. Calculate j(g(n)). 31n2 Let i(n) = n. Let s(w) be the second derivative of 0 + 7/3w*4 - 9w + 0w2 + 0w*3. Give i(s(j)). 28j*2 Suppose -5o - p = -9 - 4, -5p = -15. Let j(l) = -6l*2 - 9l*2 + 3l*o. Let c(y) = -3y. Determine c(j(f)). 36f2 Let r(p) = -p2 - p + 5. Let d be r(0). Let o(t) be the first derivative of 3t*2 + 0t*2 - d - 2t*2. Let h(z) = 4z*2. Give h(o(a)). 16a*2 Let u(a) be the first derivative of 0a + 25 + 11/2a2. Let g(m) = m2. Determine g(u(t)). 121t*2 Let r(v) = -15v*2. Let t(u) be the first derivative of -19u*3/3 - 24. Calculate r(t(k)). -5415k*4 Let z(p) = -9p. Let j(d) be the first derivative of d*5/60 - 13d*2/2 + 18. Let o(i) be the second derivative of j(i). What is o(z(l))? 81l*2 Let g(b) = -63525b*2. Let t(h) = 3h - 14. What is t(g(x))? -190575x2 - 14 Let y(i) = 4i - 7i + 2 + i - 2. Let m(u) = -46u - 6. Let k(l) = 137l + 17. Let g(q) = 6k(q) + 17m(q). Determine g(y(t)). -80t Let g(k) = 6k2. Let p(s) = -3394s*2. Determine g(p(o)). 69115416o4 Let h(w) = w + 1. Let t(i) = -i2 + i + 1. Let v(a) = -h(a) + t(a). Let k(s) = -75s2 + 140s*2 - 63s*2 - 36s*2. Determine k(v(p)). -34p*4 Suppose 2g - 7g + 30 = 5i, -i = -2g - 15. Let t(o) = -9 - o - o + i. Let x(v) = v2 + 1. Let q(s) = -4s*2 - 1. Let k(b) = q(b) + x(b). Calculate t(k(p)). 6p*2 Let c(y) = 15y*2 - 13y + 13. Let u(j) = 7j2 - 6j + 6. Let h(l) = -6c(l) + 13u(l). Let b = 10 + -3. Let q(k) = 10k + bk - 10k. Calculate q(h(z)). 7z2 Let u(n) = n2. Let z(a) = 11a + 7. Let m(p) = -4p - 2. Suppose 3b = 4j - 75, -4j + 93 = b + 2b. Let y(s) = jm(s) + 6z(s). Calculate u(y(h)). 324h2 Let x(q) = q3 + 4q*2 + 3q + 5. Let r be x(-3). Let d(v) = 18 - 18 + rv. Let m(k) = -k. Calculate m(d(a)). -5a Let f(c) = 107c2. Let u(y) = 421y*2. What is u(f(x))? 4820029x*4 Let o(k) = 2k. Let f(z) = -4z2 + 1680z - 2. What is f(o(r))? -16r2 + 3360r - 2 Let n(o) = 4 - 1 - 3 + o. Let j(f) = 7f - 6. Let s(u) = -13u + 11. Let i(r) = 11j(r) + 6s(r). Calculate n(i(y)). -y Let g(o) = -186o - 27. Let d(c) = 14c + 2. Let l(a) = 27d(a) + 2g(a). Let z(f) = 14f. Give z(l(j)). 84j Let y(i) = -5i. Let w be 1/8 + ((-252)/(-32) - 4). Let r(g) = g. Let b(q) = 5q. Let x(s) = wr(s) - 2b(s). Give x(y(m)). 30m Let x(k) = -5k. Let z(u) be the third derivative of 0u4 - 1/5u*5 + 0u + 0u3 - 31u*2 + 0. Give z(x(d)). -300d2 Let x(o) = -o2 + o. Let d(z) = 2z2 - 51z. Let k(f) = -d(f) - 4x(f). Let h(v) = v. Calculate k(h(i)). 2i*2 + 47i Let p(o) = 3o. Let s(m) = -8510m*2 + 777. Let n(t) = -99t*2 + 9. Let h(a) = -259n(a) + 3s(a). What is h(p(c))? 999c*2 Let c(t) = 10t + 9t - t - t. Let r(z) = -3z*2. Give r(c(p)). -867p2 Let a(s) be the second derivative of -s4/12 - 7s2 - 2s. Let f(r) be the first derivative of a(r). Let w(k) = 8k. Calculate f(w(b)). -16b Let p(g) = -2g - 3715. Let m(z) = -12z. Calculate p(m(d)). 24d - 3715 Let u(t) = -26t*2. Let k(a) be the third derivative of 0a*4 + 0 - 1/30a*5 + 0a*3 - 3a*2 + 0a. Determine k(u(l)). -1352l4 Let a(l) = l3 - 4l*2 - 9l - 4. Let u be a(6). Let q(f) = 15f2 + uf*2 - 27f*2. Let d(s) = -12s*2. Give d(q(b)). -48b*4 Let o(w) = -w + 18. Let a(v) be the third derivative of -7v*5/60 - 476v*2. Calculate o(a(n)). 7n*2 + 18 Let s(z) be the first derivative of -14z*3/3 - 137. Let k(u) = -17u. Calculate k(s(a)). 238a2 Suppose -b - 4w - 4 = -3w, -20 = 5b + 4w. Let z be -1(1 + 0) - b. Let m(j) = -zj - 67 - 3j + 67. Let o(h) = -h*2. Calculate o(m(n)). -36n*2 Let s(v) = 12v. Let o(t) be the second derivative of t7/1260 + t4/12 + 9t. Let a(y) be the third derivative of o(y). Give s(a(r)). 24r*2 Let l(t) = 72379t*2. Let p(u) = -4u. Give l(p(a)). 1158064a2 Let y(v) = -2v. Let j(d) = -875d2 - 210d. Let k(f) = 4f2 + f. Let w(m) = j(m) + 210k(m). Determine w(y(s)). -140s2 Let i(y) = 302y. Let a(h) be the second derivative of -h*4/12 - 207h. Give a(i(b)). -91204b2 Let y(u) be the second derivative of -u5/60 - u3/3 + 8u. Let k(a) be the second derivative of y(a). Let i(v) = -8v. What is i(k(n))? 16n Let a(g) = 6g2. Let f(c) = 68c*2 - 9c + 3. Determine f(a(q)). 2448q4 - 54q2 + 3 Let w(t) = -t2 - 93. Let c(r) be the third derivative of -r*4/24 + 230r2. Determine w(c(u)). -u2 - 93 Let w(s) = -17528s2 + 3s. Let t(g) = -3g. Determine w(t(x)). -157752x*2 - 9x Let u(v) be the second derivative of v*4/3 + 27v. Let w(k) = -23k2 + 58k*2 - 27k*2. What is u(w(i))? 256i*4 Let m(p) = -31p - 1. Let z(j) be the third derivative of -j*4/24 + 180j*2. What is m(z(q))? 31q - 1 Let x(i) = 1156i. Let q(a) = -17 + a2 + 30 - 13. What is x(q(m))? 1156m*2 Let z(r) = 2r*2. Let i(a) = -a + 9. Let x(o) = 25o - 180. Let d(q) = 20i(q) + x(q). What is d(z(v))? 10v*2 Let j(h) = 1173 + 4h - 1172 + 9h. Let x(z) be the third derivative of z5/60 + 3z*2. What is x(j(l))? 169l*2 + 26l + 1 Let a(w) = 3w2. Let u(x) be the third derivative of 0x*4 + 0x + 14x2 + 1/30x*5 + 0x*3 + 0. Calculate a(u(c)). 12c*4 Let p(y) = -3y*2. Let c(v) be the third derivative of -2v*2 + 0 + 0v + 0v3 + 1/24v*4. What is c(p(s))? -3s2 Let n(z) = z2. Let o(s) = 8092698s2. Calculate o(n(y)). 8092698y4 Let y(k) = -k2. Suppose -1880u - 14 = -1887u. Let j(f) be the first derivative of -3/2fu - 10 + 0f. Calculate y(j(d)). -9d2 Let l(m) be the second derivative of 1/2m*3 + 6m + 0 + 0m2. Let g(b) = -3b*2. Calculate l(g(h)). -9h*2 Let x(c) = 4c*2 - 12c2 - c2. Let s(b) be the third derivative of 0b3 + 0 + 58b - b*2 + 1/60b*5 + 0b*4. Calculate s(x(j)). 81j*4 Let v(g) be the third derivative of 0g*4 + 1/30g*5 + 0g*3 + 0 + 0g - 18g2. Let m(k) = -3k - 5 + 5. What is v(m(x))? 18x2 Let z(y) = 796y*2 - 1 - 793y*2 + 1. Let m(f) = 6f + 5. Determine m(z(x)). 18x2 + 5 Let q(h) = h. Let l(d) = -549d + 1464d + 329d + 759d. What is q(l(p))? 2003p Let l(f) = 136f - 40f - 82f + 223f + 189f. Let q(a) = 2a*2. Give l(q(j)). 852j*2 Suppose 3 = i - c, 3i + 0i - 2 = -4c. Let g(n) = 6 + n - 6 - in. Let b(s) be the third derivative of -11s*5/60 - 4s*2. Give g(b(k)). 11k*2 Let f(a) = -76a. Let m(b) = -b*2 + 5b - 5. Let i(t) = -t*2 + 3t - 3. Let q(c) = -5i(c) + 3m(c). What is q(f(r))? 11552r2 Let h(w) be the second derivative of w4/6 - 3w + 2. Let x(b) = 35b2. Calculate x(h(k)). 140k*4 Let t(j) = 608j. Let a(h) = 19h2 + h. What is a(t(w))? 7023616w*2 + 608w Let k(v) = -3v. Let t(h) = 0 - 2h + h - 3. Let s be t(-5). Let c(w) = -2ws + 5 + 0w*2 - 5. Give k(c(f)). 6f*2 Let b(g) = -g. Let z(q) = -2q + 3q + q + 25. Calculate b(z(k)). -2k - 25 Let w(a) = a*2 - a + 4. Let s be w(0). Let q(i) = -si*2 - 166 + 166. Let c(o) = 4o*2. Determine c(q(p)). 64p*4 Let f(q) = 26q*2. Let m(b) be the first derivative of -2b**2 - 57. D	{ "pile_set_name": "DM Mathematics" }
2 (b) 5 (c) -3 a Which is the nearest to 4? (a) -2/5 (b) -4003/3 (c) 0 c Which is the nearest to -0.02? (a) 0 (b) -0.074 (c) -2/13 (d) -0.2 (e) 1/4 a What is the closest to 80 in 1/2, -1, -20/3? 1/2 What is the closest to -12/5 in 1/5, -2/9, -247? -2/9 Which is the nearest to -0.34? (a) -2 (b) 0 (c) 25/4 (d) -4/9 (e) 1 d Which is the nearest to -3/7? (a) 4/45 (b) 192 (c) -4 a Which is the nearest to 0.1? (a) -257.4 (b) 1/8 (c) 1 b What is the nearest to -856 in -0.5, 0.2, -2/5, 0.5, -2/3? -2/3 Which is the nearest to 50/3? (a) 2 (b) 0.5 (c) -20/9 a What is the nearest to -0.8 in 13/3, 3, -115? 3 Which is the closest to -2.7? (a) 0.01 (b) -0.12 (c) 17/6 b Which is the closest to -2? (a) 3 (b) -1 (c) 324527 b What is the closest to -2 in 94, 0.1, 0.5, 121/3? 0.1 Which is the closest to 0? (a) 3.34 (b) -2/17 (c) -5 (d) 3/2 b Which is the nearest to 0.1? (a) 0.5 (b) 9/52 (c) -5 b What is the nearest to -0.1 in 145, 2, 4, -2/9, -7/64? -7/64 What is the closest to -1 in 0.4, 2, -117? 0.4 What is the closest to -0.02 in -0.071, 10, 5/4? -0.071 Which is the closest to 2/7? (a) -1 (b) -0.2 (c) 0.04 (d) -55/54 c Which is the nearest to -2.9? (a) 1/2 (b) 0 (c) -1 c What is the nearest to 4 in -2/3, -36/11, 1/29, -0.9? 1/29 Which is the nearest to -1? (a) -3/7 (b) -64/277 (c) 2 (d) 3 (e) 5 a Which is the nearest to -0.13? (a) 4.8 (b) 2 (c) -1/3 (d) 2/17 (e) 0.06 e Which is the closest to 1? (a) -6 (b) 0 (c) 7 (d) 1 (e) 35 d What is the nearest to 3 in 2/7, 234, -2/3, -0.14? 2/7 What is the closest to -2/61 in 10, -0.1, 4, -0.3, -4? -0.1 Which is the nearest to -43496? (a) 3 (b) -1/9 (c) -2/13 (d) 1/10 c Which is the nearest to -6? (a) 23/10 (b) 0.17 (c) -4 (d) -2 (e) 0 c Which is the closest to 4/5? (a) 0.1568 (b) 5 (c) -1/5 (d) -7 (e) -3/4 a What is the closest to -1/5 in -0.1, 2/15, -217, -27? -0.1 What is the nearest to 2/7 in -4, -0.8, -1/8, -0.5? -1/8 What is the nearest to -33 in 9/65, -0.5, 5/4? -0.5 What is the nearest to 1/6 in 2, 3, -0.04, -4? -0.04 What is the nearest to 27.7 in -5, -6/11, 1, 0, -1/8? 1 What is the nearest to -0.1 in -4, -13/6, 32? -13/6 Which is the nearest to 2/5? (a) -1 (b) 3 (c) -11 (d) -2 a Which is the nearest to 3? (a) -47/3 (b) 1 (c) 0.7 b Which is the nearest to -4? (a) -0.13 (b) -1/8 (c) -1/3 (d) -1/9 c What is the closest to 2/7 in 324, 0.6, -1/10, -1.6, 5/2? 0.6 What is the nearest to -15 in 9, -10, 0.5? -10 Which is the closest to -132? (a) 114 (b) 3/4 (c) -1/4 (d) -0.2 c What is the closest to 0 in -1/6, 2, -4/3, 15/4? -1/6 What is the nearest to -0.8 in -5, 1, -0.028, -4? -0.028 What is the closest to -1 in -0.3, 0.1, 1188, -1, 0.5? -1 Which is the closest to 4? (a) -2 (b) 6/7 (c) 4469 b What is the nearest to 1 in 5, -3/5, 67.55, 1/10? 1/10 Which is the nearest to -0.3? (a) 1 (b) -1 (c) 171 (d) 17 b Which is the closest to -7? (a) -0.2 (b) -5 (c) 4/13 (d) 2/109 b What is the nearest to -3/2 in 4, 1/95, -5/3, 0.78, -0.6? -5/3 What is the nearest to 2 in -948, -60, 0.4? 0.4 Which is the closest to 0.38? (a) 0.04 (b) -0.09 (c) -2/11 (d) 1/2 d Which is the closest to -145? (a) 74/7 (b) -5 (c) -2/13 b Which is the nearest to -0.2? (a) 1845 (b) 50 (c) 2 c Which is the closest to -85.8? (a) 0.5 (b) -3 (c) -0.1 (d) 1/5 b Which is the closest to 2? (a) -0.3 (b) -0.5 (c) -145.5 (d) 4 d Which is the closest to -1/2? (a) 809 (b) -4 (c) -6 (d) -5 b Which is the nearest to 1? (a) 2/7 (b) 90 (c) -3 (d) 0.3 d Which is the closest to 0.1? (a) 2317/2 (b) -0.3 (c) 0.1 c Which is the nearest to 0.2? (a) 1/3 (b) 0 (c) -7/3 (d) 7/2 (e) -1/4 a Which is the nearest to 1? (a) 2 (b) 38 (c) -0.3 (d) -45 (e) 4 a What is the nearest to -9 in -5, -419/3, 5? -5 Which is the nearest to 40? (a) -8 (b) -69 (c) -4 c Which is the nearest to -1/4? (a) 2 (b) 7/4 (c) -5 (d) 1 d What is the closest to 2/9 in 41, 1.5, 8? 1.5 Which is the closest to 0? (a) 3 (b) 193 (c) 2/5 (d) 0 d Which is the closest to -5? (a) 0.8 (b) 358 (c) 1/4 (d) 0.1 d Which is the nearest to -1? (a) 7.5 (b) -5/21 (c) -4/7 (d) 5 (e) -1 e Which is the nearest to 13? (a) -2/11 (b) 2 (c) 8 (d) -6 c What is the closest to 0 in -47/4, -2.6, -0.2, 0, 3? 0 What is the closest to -0.4 in 2/7, 0.4, 34358? 2/7 What is the nearest to 3/2 in -207, -84, 5, -4, -0.4? -0.4 What is the closest to -1121 in 21/4, 1/5, -0.3? -0.3 What is the closest to 0 in 0.0052, 1.39, -0.28? 0.0052 Which is the nearest to -13? (a) -8 (b) 0.4 (c) -1/108 (d) 6 a Which is the nearest to 1/4? (a) -25/6 (b) -3/7 (c) 3 (d) -3/8 (e) 6/5 d Which is the nearest to -2/5? (a) 0.2 (b) -2/11 (c) 1723 (d) 3 (e) -0.1 b Which is the nearest to 0? (a) 2/9 (b) 0.03 (c) 23.39 (d) 2/11 (e) 0.1 b Which is the nearest to -1/4? (a) 11.9 (b) -6/11 (c) -0.2 (d) 2 (e) -4 c Which is the closest to -16? (a) 1/6 (b) -2/7 (c) 4/5909 b Which is the nearest to 0? (a) -39 (b) -2/3 (c) 1/2 (d) -3 (e) -17 c Which is the closest to -41? (a) 11 (b) -0.38 (c) 0.2 b What is the closest to 2/7 in -695, 2, 8, 1/2, 3/7? 3/7 Which is the nearest to -1.53? (a) -2 (b) 4/7 (c) 19 a Which is the closest to -199? (a) -6/5 (b) 0.14 (c) 3/2 a Which is the nearest to -3? (a) 931 (b) 1/3 (c) 19 b Which is the nearest to 0? (a) -0.029 (b) 0.3 (c) 5/2 (d) -0.7 (e) -3 a What is the closest to 0 in 0.3, -400, -6? 0.3 What is the closest to -1/2 in -6/7, -3, 5, -1, -0.06? -6/7 What is the nearest to 20/537 in 3/2, 4/9, 12? 4/9 What is the nearest to -22 in -0.2, -0.1, -3, 163? -3 What is the nearest to 0.6 in -0.9, 0.18, -2? 0.18 What is the closest to 0.6 in 1/4, -30/209, -0.5? 1/4 What is the closest to 3 in 1, -5, 4/5, 0.051, 1/2? 1 Which is the nearest to -3? (a) 9 (b) 2/13 (c) -1/5 (d) 0.013 c Which is the nearest to 0.1? (a) 0.3 (b) 7 (c) -39 a What is the nearest to 1 in -10, -10.8, 0.1? 0.1 Which is the closest to 2/5? (a) -4/15 (b) -95 (c) -2 (d) -3 a What is the nearest to 2/29 in 1/3, 1/4, -2/143, 4, -4? -2/143 What is the nearest to 4 in -3/4, 5, -1/3, -2/51, -5? 5 What is the closest to -0.07 in -16, -35, 0? 0 Which is the nearest to 0? (a) 2/21 (b) 368.9 (c) 3 a What is the closest to 20 in -42, -1, -2? -1 Which is the closest to 4? (a) -7 (b) -12 (c) 21 (d) 9 (e) -4 d Which is the closest to 2? (a) -1418/13 (b) 0.8 (c) -1 b What is the closest to 2/3 in -2, -1/3, -21/2, 4, 6/13? 6/13 Which is the nearest to 13? (a) -3/10 (b) -0.5 (c) 11 c Which is the nearest to -3727? (a) -3 (b) 6 (c) -2/13 a What is the nearest to 40 in -0.1, -1/4, 3, -0.2? 3 Which is the nearest to 0? (a) -2/91 (b) -1/3 (c) 253 (d) 0.07 a What is the nearest to 1 in 1267, -2/49, -2/7, 0.5? 0.5 What is the closest to 0 in 4, 5, -0.200937? -0.200937 What is the closest to 2/3 in 3, 0.1, 2.4253? 0.1 Which is the closest to 2/7? (a) -5 (b) 4 (c) 1/11 (d) -531 (e) 0.02 c What is the nearest to 1 in 12, -3, 4, -1/3, 1? 1 What is the nearest to -11 in -9, -0.04, 0.6? -9 Which is the closest to 0.08? (a) -7 (b) 0.4 (c) 4/3 (d) 2/13 d What is the closest to 1 in 2, -907, -8, 11? 2 What is the closest to -101 in 3, 2/15, 370, -0.1? -0.1 Which is the closest to 0? (a) -3 (b) -1/3 (c) -36/13 (d) -2 (e) 8 b Which is the closest to 3? (a) -3/2 (b) 4 (c) 0.4 (d) 1/8 (e) -7051 b Which is the closest to 1? (a) 1 (b) -1 (c) -2 (d) -711 a Which is the closest to 0.3? (a) -3 (b) -0.04 (c) -2/15 (d) -5 (e) -8 b Which is the closest to 1.85? (a) -2/11 (b) 0.06 (c) 404/9 b What is the closest to 4 in 3, 1/7, 2/19, -2, 4? 4 What is the nearest to 0 in 0.3, 4, -94, -1? 0.3 What is the closest to 1 in -1/2, 1, 1/13? 1 Which is the nearest to -0.3? (a) -0.2 (b) 5 (c) 0.4 (d) 90 a Which is the nearest to -0.1? (a) -22 (b) -0.02 (c) -30 b Which is the nearest to 0.01? (a) 0.2 (b) -7 (c) 0.1 (d) -75 (e) -2 c What is the nearest to 0 in 0.3, 2, 6/7, -0.112, -0.6? -0.112 Which is the nearest to 2/3? (a) -1 (b) 0.3 (c) -5388 b Which is the closest to 3? (a) -0.95 (b) -1/2 (c) -2/7 (d) 7 c Which is the closest to 14? (a) -0.4 (b) 8/13 (c) 2/9 (d) 1/7 b What is the closest to 1522 in -1/3, -1, 0.1, 0, 3/4? 3/4 Which is th	{ "pile_set_name": "DM Mathematics" }
rd smallest value? (a) 6 (b) -3 (c) -87 (d) -3/8 d What is the third biggest value in -38, -3, -0.5, -1? -3 What is the fourth biggest value in 5, -1/4, 1/3, 23, -4/7? -1/4 What is the fourth smallest value in -385, 0.2, 1/6, 5? 5 Which is the third smallest value? (a) -36/11 (b) -3 (c) -4 b What is the smallest value in 5, -0.07, 0, -0.3? -0.3 Which is the fourth smallest value? (a) -5/6 (b) 0.5 (c) -3 (d) -0.4 b What is the third smallest value in -4, 1/8, 0.05? 1/8 What is the third biggest value in 7/5, 1/189, -3, 0.3, 0? 1/189 Which is the smallest value? (a) -0.4 (b) -2/7 (c) -12 (d) 0.12 c What is the second biggest value in 0.2, -4, -1, -4/143? -4/143 Which is the third smallest value? (a) -35 (b) -0.2 (c) 0.2 (d) -4 b What is the smallest value in -2/15, -0.06, -2/3, -0.5? -2/3 Which is the second biggest value? (a) -0.3 (b) -2/7 (c) -3/7 (d) 150 (e) -0.5 b Which is the third smallest value? (a) -0.5 (b) 0.4 (c) 83 c Which is the second biggest value? (a) -7 (b) 1/179 (c) 4/3 b Which is the second smallest value? (a) 10 (b) -217 (c) -1 c Which is the second smallest value? (a) -2/19 (b) 0.28 (c) -0.5 (d) -40 c Which is the biggest value? (a) -0.2 (b) 21 (c) 12 b Which is the third biggest value? (a) 0.3 (b) -15/13 (c) 2/11 (d) -1/3 d What is the fourth biggest value in -7/17, 1, -0.2, -4? -4 Which is the second biggest value? (a) 0 (b) 1.4 (c) -1 (d) 2/5 (e) 62 b What is the third smallest value in -3, 1/11, -1/5, -5? -1/5 What is the fourth biggest value in 0.4, 1, -3, 4? -3 Which is the third biggest value? (a) -0.118 (b) 0.5 (c) -2 (d) 4 a Which is the smallest value? (a) 100/3 (b) -3 (c) -0.5 b Which is the biggest value? (a) 65 (b) -2/5 (c) 0 a What is the second smallest value in -0.2, -0.1, 0.15, 5, -1? -0.2 What is the third smallest value in 4/9, 11, 2/3? 11 Which is the fourth smallest value? (a) -4 (b) -12 (c) -2 (d) -29 c Which is the fourth biggest value? (a) 2/9 (b) 2/5 (c) -1/4 (d) 4 (e) -2/17 e Which is the third smallest value? (a) 3 (b) -0.4 (c) 348 (d) 1/10 a Which is the second smallest value? (a) 0.007 (b) 4 (c) -4 (d) 9 (e) -1/3 e What is the third biggest value in -6, -2/19, -4, 1/5? -4 What is the fifth biggest value in -5, 44, -0.2, -28, 2? -28 Which is the second smallest value? (a) -2/23 (b) -1/3 (c) 5 a Which is the third smallest value? (a) 0.02 (b) 1/5 (c) -4 (d) 0.5 b Which is the second smallest value? (a) 18 (b) 5 (c) 1/5 (d) -4/3 c What is the second biggest value in 4, 3, -3, -4/9? 3 Which is the smallest value? (a) -4/5 (b) 5 (c) -1 (d) 116/3 c What is the second biggest value in 0.4, 0.06, 0.5, -2/17? 0.4 Which is the second biggest value? (a) -1/3 (b) -39 (c) -7 (d) -0.1 a Which is the third smallest value? (a) -89 (b) -0.4 (c) 3 c What is the third biggest value in 0.4, 3/196, 11, -2? 3/196 What is the fourth biggest value in -2/11, 0, 1/10, -19? -19 What is the second biggest value in -30, 0.03, 0.5, -2/11? 0.03 Which is the fourth smallest value? (a) 0.418 (b) 3 (c) 1/4 (d) 4 d Which is the biggest value? (a) -3 (b) 0 (c) 2 (d) -14 c What is the third smallest value in 0.055, -5, -13? 0.055 What is the second smallest value in -1/4, 2, -0.3, 22? -1/4 Which is the smallest value? (a) 0.4 (b) -8/377 (c) -1/3 c What is the smallest value in 85, -1, -0.4? -1 What is the third biggest value in -3.7, -0.4, 0? -3.7 What is the smallest value in 0.3, -4, 0.01? -4 What is the third biggest value in -0.5, 5, 1/4, 8? 1/4 What is the third smallest value in -0.429, 5, 0.2? 5 What is the smallest value in -1/15, -2, -34? -34 What is the smallest value in -326.9, -3, 0.4, -4? -326.9 Which is the smallest value? (a) -5 (b) 0.5 (c) -0.1 (d) -1/5 a Which is the third biggest value? (a) 4 (b) -268 (c) 8 (d) -2/5 d What is the third biggest value in -0.1, 7, -0.4, 1, -20? -0.1 What is the smallest value in -2, 0.5, -1, 12, 1? -2 What is the second biggest value in -2, -1, 540? -1 Which is the biggest value? (a) 0.25 (b) 16 (c) 2/7 b What is the second biggest value in 3/4, 379, 2/5, 2? 2 Which is the fifth smallest value? (a) 0.2 (b) -4 (c) -0.1 (d) -117 (e) -1 a Which is the smallest value? (a) -2/63 (b) 4 (c) -0.06 c What is the fifth smallest value in 2, -3, 1/6, 0.23, -3/5? 2 What is the second biggest value in -35, 1/5, 3, 0? 1/5 Which is the fourth smallest value? (a) -3 (b) -71 (c) 0.4 (d) 1 d Which is the third smallest value? (a) -1944/13 (b) 3/4 (c) -0.4 b What is the biggest value in -1707/7, 1, -6? 1 What is the second biggest value in -3, -989, 0.1? -3 What is the third biggest value in 5/4, 0.4, 3, 4? 5/4 What is the third biggest value in -5, -0.2, 0, -19? -5 What is the biggest value in -2, -0.2, -2/3, 89/5? 89/5 What is the third biggest value in -1/5, 85, 3? -1/5 Which is the smallest value? (a) 338 (b) 1 (c) 14 (d) 0.4 d Which is the smallest value? (a) -1.2 (b) 2/9 (c) -2/13 a What is the smallest value in 4, -4, 7, -122, -0.4? -122 What is the second smallest value in -2/35, -6/7, -0.9? -6/7 What is the smallest value in 4, -6, 7, 5? -6 Which is the second smallest value? (a) 5 (b) 2/99 (c) -1 b What is the fourth biggest value in -5, 0.23, 0, 2/21, -0.1? -0.1 What is the biggest value in -1, -2, -5, 2? 2 Which is the third smallest value? (a) 0.3 (b) -56 (c) 2/7 (d) 0.1 c What is the fourth biggest value in -2/9, -0.4, 12, 1/8? -0.4 Which is the third biggest value? (a) 3/7 (b) 1/4 (c) -3/49 (d) -4 (e) -2/7 c What is the fourth smallest value in 10, -2/15, 2, 0.46? 10 Which is the smallest value? (a) 22 (b) -5 (c) 0.5 (d) 0 (e) 21 b Which is the second smallest value? (a) 2/21 (b) 0.05 (c) 5 a Which is the second smallest value? (a) 0.25 (b) 1/3 (c) 7 b What is the second biggest value in -2, -5, 445? -2 Which is the third biggest value? (a) 253 (b) 2/7 (c) 5 (d) -1/2 b What is the second biggest value in 2, -5/4, -6, -3? -5/4 Which is the third biggest value? (a) 1/3 (b) 3/5 (c) 0.043 (d) 4 (e) 2 b What is the third biggest value in -5, -0.11, 4, 3? -0.11 What is the third biggest value in 3, -2/7, 8, -5, 1/2? 1/2 What is the third smallest value in 2/11, 2, -3/5, 0.3, 0.7? 0.3 What is the fourth biggest value in 72, -2/7, 2/5, -1/3? -1/3 What is the fourth biggest value in -4, -26, 3/2, -0.051, -0.4? -4 What is the second smallest value in -0.01, -13, 4? -0.01 What is the fifth smallest value in 4, 9, 1/3, -7/2, -0.03? 9 Which is the second smallest value? (a) -1/3 (b) -35 (c) -2/9 a What is the third biggest value in 24, -3/2, 298, 0.5, 3? 3 Which is the third biggest value? (a) -5 (b) 70 (c) -0.28 (d) -0.5 d What is the third biggest value in 6/5, 217, -5/3? -5/3 What is the smallest value in 5, -11/5, -0.2, -5? -5 What is the fourth smallest value in -3, 4, 1, -42? 4 What is the smallest value in -0.05, -2/5, -1.2, 2? -1.2 Which is the second biggest value? (a) -1/40 (b) -0.12 (c) -0.5 b What is the fourth smallest value in -2/9, 0.05, -1, 0? 0.05 Which is the second smallest value? (a) -0.4 (b) -2 (c) 16 (d) -8 (e) -5 e Which is the fifth biggest value? (a) 0.3 (b) 0.4 (c) -3/37 (d) -2/15 (e) 5 d What is the biggest value in 1, 16, -0.1, -19, -4/3? 16 What is the second smallest value in 3, 0.4, 13/7? 13/7 What is the third biggest value in 19, 1, -4, -27, 1/3? 1/3 Which is the third biggest value? (a) -1/84 (b) 4 (c) 0.4 (d) -0.9 a Which is the fifth biggest value? (a) -0.4 (b) -2 (c) 0.5 (d) -4/3 (e) 5 b Which is the second biggest value? (a) -3/7 (b) 0.2 (c) -0.7 (d) -2/5 (e) 7 b What is the fourth smallest value in -4, 0.1, 1, 12/227? 1 What is the biggest value in -0.04, 0.05, 3/2, 1/5? 3/2 Which is the smallest value? (a) 0.254 (b) -1 (c) 0.2 b Which is the biggest value? (a) 4 (b) 10/17 (c) -0.5 a Which is the second smallest value? (a) -5 (b) 1 (c) 4.1 b Which is the smallest value? (a) -5 (b) 10 (c) -106 c What is the biggest value in 0.4, 151, -2/5? 151 What is the fourth smallest value in -4, -39, -2, 3? 3 What is the fifth smallest value in 4, -2, -43, -4, -1/5? 4 Which is the third smallest value? (a) -72 (b) 2 (c) -0.4 b Which is the smallest valu	{ "pile_set_name": "DM Mathematics" }
+ 1, -13 = -3z - z - 5i. Let x be (-9)/z(-4 + (-60)/(-18)). Let u(a) = 790a - 790a + xa*2. Let l(r) = 2r. Calculate u(l(j)). 12j2 Let c(h) = -3h. Let i(x) be the first derivative of 15/2x2 - 2x + 68. What is i(c(j))? -45j - 2 Let l(f) be the first derivative of 0f + 10 + 0f4 + 0f*2 + 1/20f*5 + 11/3f*3. Let b(s) be the third derivative of l(s). Let i(j) = -4j. Give i(b(k)). -24k Let g(s) be the second derivative of 7s6/360 + s3/6 + 95s2/2 + 40s. Let b(h) be the second derivative of g(h). Let q(u) = 2u - 8. Give b(q(x)). 28x*2 - 224x + 448 Let z(j) be the second derivative of -1/6j3 + 15j + 0 - 1/2j2. Let v(y) = y2 - 5y - 5. Let x(c) = v(c) - 5z(c). Let w(b) = 2b. Calculate w(x(u)). 2u2 Let q(y) = -38y*2. Let j(u) = 583498u. Determine q(j(c)). -12937856808152c2 Let r(m) = 31m. Suppose -36o = -31o - 15. Suppose -4s - 3p + 5 = -11, 0 = op. Let f(k) = sk - 5k + 5k - k. Give r(f(y)). 93y Suppose -273f + 272f + 2 = 0. Let y(j) = -124j + 124j - 5j*f. Let z(s) = 13s. What is y(z(q))? -845q2 Let x = -103 - -102. Let n be x + 206/4. Let i(s) = -12s - 15s + ns. Let k(m) = 5m. Determine k(i(u)). 10u Let s(y) = -2y*2 - 16y + 18. Let x be s(-9). Suppose c = -3c + 2k + 8254, x = 3k + 9. Let g(u) = -18u - c + 2062. Let o(v) = 2v. Determine g(o(w)). -36w Suppose g - 3g = z - 8, 2g - 8 = -3z. Suppose 0 = -gf - 0 + 84. Let j(q) = fq + 21q - 31q. Let k(m) = 2m*2. Calculate k(j(h)). 242h*2 Let c(q) = 595q. Let z(t) be the first derivative of t*2 + 1945. Calculate c(z(o)). 1190o Let r(z) = -z*2. Let x(g) = -157410g - 220. Let i(l) = 2156l + 3. Let n(j) = 220i(j) + 3x(j). What is r(n(m))? -4368100m*2 Let b(f) = 293f*2 - 2f - 62 + 344f2 - 630f*2. Let r(z) = -2z. What is r(b(l))? -14l2 + 4l + 124 Let i(u) be the first derivative of -u*2 - 82. Let v(t) = 8 + 0t*2 - 5t*2 + 7t*2 - 7. Calculate v(i(b)). 8b*2 + 1 Let y(q) be the second derivative of q + 0q*2 + 1 - 3/2q*3. Let z(r) = 7r. What is y(z(j))? -63j Let q(v) = 4751v + 11. Let f(l) = 432l + 1. Let h(x) = 22f(x) - 2q(x). Let p(y) be the second derivative of -17y*4 - y. Give h(p(t)). -408t*2 Let x(l) = -7122l*2 + 0 + 0 + 3616l*2 + 3554l*2. Let o(k) = -6 + 6 - k. Calculate x(o(u)). 48u*2 Let z(w) = 15 + 21w*2 + 1300w - 431w - 432w - 437w. Let m(r) = 2r. Give m(z(c)). 42c2 + 30 Let z(r) be the first derivative of r5/60 + r4/24 + 15r2 - 18. Let b(v) be the second derivative of z(v). Let k(l) = -l2. What is k(b(x))? -x*4 - 2x3 - x2 Let u(v) be the second derivative of -v*4/12 - 47v. Let a(f) be the first derivative of -47f2/2 - f - 2. Give u(a(d)). -2209d*2 - 94d - 1 Let w(j) = 13j2 + 3. Let k(r) = -46r + 4. Let y(x) = 222x - 19. Let t(d) = 19k(d) + 4y(d). Give w(t(i)). 2548i*2 + 3 Let x(w) = 3909819w. Let s(k) = 4k2. Give x(s(d)). 15639276d*2 Let u be -16((-20)/(-8))/(-5). Let i(n) = -un - 6n + 13n. Let j(a) = -195a. Calculate j(i(o)). 195o Let x(q) be the first derivative of -2q*3/3 - 495. Let g(o) = -13o*2 - 29. Determine x(g(l)). -338l*4 - 1508l*2 - 1682 Let n(o) = -39o + 420. Let k(u) = -4u + 40. Let r(l) = -21k(l) + 2n(l). Let y(x) = 105x. What is r(y(z))? 630z Let o(z) = 5z. Let b(y) = y*3 + 32y*2 - 34y + 7. Let q be b(-32). Let m(i) = -1095 - 7i + q. Give o(m(t)). -35t Let m(j) = 2 + 247j2 - 218j*2 - 2. Let r be (-156)/(-32) - -1(-2)/(-16). Let x(q) = -q + rq + 5q - 8q. Calculate x(m(i)). 29i*2 Let c(m) = 205m - 570. Let d(g) = -30g2 + g. Give c(d(a)). -6150a*2 + 205a - 570 Let w(p) be the second derivative of 7p2 + 0 + 0p*3 + 1/12p*4 + 11p. Let z(o) be the first derivative of w(o). Let x(v) = -11v. Calculate z(x(l)). -22l Let j(z) = -3z2. Let y(u) = 198367825u*2. Calculate j(y(h)). -118049381985691875h*4 Let x(g) = -21g + 2. Let j(w) = w*2 - 152w + 59. Calculate x(j(f)). -21f2 + 3192f - 1237 Let j(y) be the second derivative of -5y4/12 + 1338y. Let k(x) = 471x. Calculate k(j(r)). -2355r*2 Let y(f) be the third derivative of -73f*2 + 0 + 0f - 11/30f5 + 0f*4 + 0f*3. Let p(i) = -5i. Calculate p(y(d)). 110d2 Let q(x) = -4x*2. Let v(i) = -4528i + 4 + 4528i + 328i*2 - 4. Calculate v(q(b)). 5248b*4 Let n(d) = 0d + 87d2 + 0d + 16133 - 16133. Let g(q) = -9q2. Calculate n(g(b)). 7047b*4 Let w(b) = 21b*2 + 12b - 6. Let r(s) = -120s2 - 70s + 35. Let k(n) = -6r(n) - 35w(n). Let l(g) = 5g2 + 12g. Give l(k(a)). 1125a4 - 180a*2 Let d(z) = 67562z. Let o(p) = -401p. Determine d(o(q)). -27092362q Let c(p) = -2187p + 10. Let k(j) = 24057j - 108. Let z(n) = -54c(n) - 5k(n). Let b(f) = f*2. What is z(b(s))? -2187s*2 Let x(t) = -t. Let r be -3 + 6 - (-8 + 0). Let q(k) = -4k + 10k - 2 + 4 - 8k - k. Let h(g) = -13g + 10. Let a(w) = rq(w) - 2h(w). Determine a(x(l)). 7l + 2 Let h(d) = -192d. Let t(z) = -10z - 1. Let r(f) = 33f + 2. Let c(g) = -r(g) - 2t(g). Calculate c(h(j)). 2496j Let a(p) = -217p. Let x(f) be the first derivative of 19f3/3 - 1461. What is a(x(i))? -4123i*2 Let y = 27 + -21. Let r(l) = 2l - 2l - yl. Let t(d) = -23d - 11. Let a(v) = 8v + 4. Let j(z) = -11a(z) - 4t(z). Determine r(j(w)). -24w Let z(l) be the third derivative of -5l*6/8 + 25l*3/3 - 4l*2 + 37l. Let g(q) be the first derivative of z(q). Let b(u) = -u*2. Calculate b(g(t)). -50625t*4 Let r(w) = -141754w. Let l(m) = 21m2. Determine r(l(p)). -2976834p*2 Let p(v) = -v. Let i(y) = -7y + 15120. Give p(i(f)). 7f - 15120 Let w(z) = -83z*2. Let r(o) = -19o + 5. Let c = -174 - -168. Let b(j) = -23j + 6. Let u(t) = cr(t) + 5b(t). What is u(w(q))? 83q*2 Let c(h) = 4h. Let l(y) be the second derivative of 95y + 0y*2 - 1/6y*3 + 0. Calculate l(c(w)). -4w Let a(w) = -2w2. Let v(i) = 191i + 20. Let z(n) = 766n + 85. Let c(d) = -17v(d) + 4z(d). Determine a(c(b)). -66978b*2 Let h(u) = -2u2. Let s(l) = l3 + 13l2 + 9l - 13. Let k be s(-12). Let m(b) = -9 - 4b + 14 - k - 14 + b. Determine m(h(g)). 6g*2 - 32 Let z(y) = 4y. Let i(j) be the first derivative of -499j3/3 + 2406. Give i(z(c)). -7984c*2 Let h(o) = -11o + 5. Let r(c) = -11c + 6. Let u(y) = -6h(y) + 5r(y). Let k = 148 + -136. Let z(w) = 23 - 53 + k + 3w*2 + 18. Calculate u(z(l)). 33l*2 Let f(n) = 78n*2. Let i(u) = -951u*2 + 460u*2 + 495u*2. Calculate f(i(r)). 1248r4 Let k(r) be the second derivative of -r7/280 + 3r4/4 + 3r*2/2 + 3r - 4. Let x(q) be the third derivative of k(q). Let s(g) = 3g2. What is s(x(y))? 243y*4 Let i(d) = -10718d. Let c(k) = -141k2 + 4. Give i(c(l)). 1511238l*2 - 42872 Let s(h) = 11h. Let z(n) = 7396n - 903. Let d(c) = -231c + 28. Let x(f) = 129d(f) + 4z(f). Determine s(x(t)). -2365t Let k(m) = -6155m*2. Let a(b) = -81b. Determine k(a(c)). -40382955c2 Let j(b) = -7b*2 + 94b. Let k(i) = 39i + 64. What is k(j(h))? -273h*2 + 3666h + 64 Let x(f) = -693f2 - f. Let y(l) = 86084l. Determine y(x(i)). -59656212i2 - 86084i Let r(t) = -1527t2 - 594t*2 + 591t*2 - 5 + 5. Let f(q) = 3q*2. Calculate r(f(l)). -13770l*4 Let h(m) = 54m*2. Let p(s) = 139s - 873. Calculate p(h(b)). 7506b2 - 873 Let y(p) = -3p. Let n(a) = 204 - 411 + 206 - 59a. Calculate y(n(d)). 177d + 3 Let v(a) = -a*3 + 20a*2 + a - 11. Let h be v(20). Let i(l) = -22l*2 + 21l*2 + hl*2. Let o(p) = 10p*2. Calculate o(i(s)). 640s*4 Let z(d) = 5d*2. Let s(w) be the first derivative of -85w*3/3 - 459. Give z(s(u)). 36125u4 Let v(k) be the second derivative of k3/3 - 5k. Suppose x - 7 + 5 = 0. Let b(i) = -xi + 2 + 4 - 6. Calculate v(b(p)). -4p Let j(n) be the second derivative of 0 + 210n - 125/6n3 + 0n*2. Let x(k) = 4k. Calculate j(x(g)). -500g Let z be -41((-6255)/(-10))/(-9). Let j(w) = z + 4w*2 - 278. Let k(c) = 21c*2. Calculate k(j(o)). 336o4 Let m(f) be the third derivative of f5/10 + 1744f2. Let o(g) be the first derivative of 16g*3/3 - 2g*2 + 3. Give m(o(b)). 1536b*4 - 768b*3 + 96b*2 Let m(t) = t - 229. Let r(h) = -14h*2 - 6h + 42. Let w(y) = -3y2 - y + 7. Let a(j) = -r(j) + 6	{ "pile_set_name": "DM Mathematics" }
-bs, -3q - 2q + 4s = 2. Is 1 bigger than q? False Let i be 3/(((-9)/(-3))/3). Suppose 2k = ik. Suppose 0 = 4y - ky - 12. Does y = 3? True Let v = 20 - 39/2. Let m be 1 + 5/((-15)/(-6)). Suppose -2a - q + 5 = 3, -3q + 6 = ma. Are v and a nonequal? True Let c(p) = -2p - 13. Let f be c(-10). Which is smaller: f or 20/3? 20/3 Let p = -0.8 + 0.3. Let n = 6 - 6.4. Let b = p - n. Which is greater: b or 0? 0 Suppose -42 = 2z + z. Are -14 and z equal? True Suppose -3g + 0g + 56 = -2x, -5x - g - 140 = 0. Let o be 2/x(0 - 2). Which is smaller: -1 or o? -1 Suppose -2c + 5w + 16 = 0, 4c + 4w - 10 = 3w. Suppose 0 = -3g - 12 + c. Let i = 18.1 - 18. Is g equal to i? False Suppose -4f = f + 25. Let a = f + 7. Is 2 less than a? False Suppose -6t = -t + 35. Let c = t + 7. Do c and 1/3 have the same value? False Suppose 3d = -0d + 36. Which is bigger: 13 or d? 13 Let s(k) = -k - 5. Let i be s(-7). Let y be (-3)/(-6) - i/4. Suppose ym = o - 3m - 14, 4o + 5m = -12. Which is smaller: 3 or o? o Let u = -2 - -2. Let h be 10 + 3/(-5 + 2). Let m = h + -17/2. Which is greater: u or m? m Let v = 0.14 + 0.16. Which is smaller: -2 or v? -2 Let v be 0/((-4)/82). Which is smaller: 1 or v? v Let g = 16 + -28. Let a = g - -8. Which is bigger: -18/7 or a? -18/7 Let f = -1539 + 1559.06. Let v = f - 20. Is 0 <= v? True Let d be (-2 - -2)/(0 - -1). Let n(b) = b + 15. Let l be n(-15). Is d at least as big as l? True Let u = 18 - 19.3. Which is smaller: u or 0? u Let u = 2 - 2. Let j(d) = -d2 + d + 1. Let o be j(u). Let n be -7(-3)/84 + (-5)/28. Is n < o? True Let m = 3271184 - 1079492449/330. Let n = m + 53/10. Are n and 0 non-equal? True Suppose -5 - 4 = 3k. Let c be 3 + 2 + k + -1. Let f be 2 - 1 - (-1)/(-2). Which is bigger: f or c? c Let x be 2/(-2) - 3/(21/28). Which is smaller: x or -8? -8 Let v(w) = w3 - 2w*3 + 0 + 5w*2 - 5w - 3. Let z be v(4). Let c(t) = t*2 + 8t + 4. Let j be c(z). Are -3 and j non-equal? False Let n be -4 + 66/15 + 1. Is 1 >= n? False Let x be (24/18)/(56/(-132)). Which is greater: x or -0.1? -0.1 Let x = -35.7 + 34. Let g = x - 0.3. Let a = 0.086 - 0.186. Is g at most a? True Let y(r) be the second derivative of r4/12 - r3/3 - 2r2 + 2r. Let n be y(3). Let c be 1/((-1 - -2)n). Which is smaller: c or -1/4? c Let m be ((-12)/(-20))/(24/80). Is 10/7 smaller than m? True Let u(t) = -t3 - t2 + 2t - 2. Let v be u(2). Let y be 13/v2 - -3. Are y and -1 nonequal? True Suppose 4h - h = 2h. Let r = 1266/7 - 180. Is h greater than or equal to r? False Let m = -45 - -10. Which is smaller: -109/3 or m? -109/3 Let g be (2 - 0)/((-10)/5). Let m(p) = p3 + 5p*2 - 2p - 5. Let x be m(-5). Let i = 4 - x. Do g and i have the same value? True Let i be (4/18)/(2/6). Let s be 1((-3 - -2) + 2). Which is bigger: i or s? s Suppose 0k + k - 2 = 0. Suppose -4z + 2 + k = 0. Let m be z/(1 + (-3)/4). Are 4 and m equal? True Suppose -9a - 80 - 73 = 0. Do -15 and a have different values? True Suppose -22 = 3k - 97. Suppose -4q = -5m - k, -4m - 19 = -3q + 1. Is q != 0? False Let v(a) = a2 + 7a - 3. Let n = -15 - -8. Let w be v(n). Let f = 1 + w. Is f at most -2? True Let v = 3 + -13/4. Which is greater: v or 0? 0 Let k = 3 + -5. Let x = k - 0. Let p = 23.2 + -23. Which is bigger: x or p? p Let m(k) = 18k - 28. Let q be m(7). Is q at most 0.1? False Let u = -5/18 - -53/126. Let n(x) = -2x*3 + 2x2 + x - 2. Let h be n(1). Is u less than or equal to h? False Let b(q) = q3 - 2q2 - 5q - 2. Let m be b(4). Is m greater than 8? True Let h = 8 + -7. Let i(n) be the third derivative of -n6/120 + n5/60 - n4/24 + n3/2 - 2n2. Let y be i(0). Which is smaller: y or h? h Let t be -1 - 20/(-25)10/4. Is t equal to 1/188? False Let q = -8675 + 53105/6. Let n = 175 - q. Which is smaller: n or 1? n Suppose -2i - 3i + 45 = 0. Is 10 != i? True Suppose 0 = k - 0k + 32. Let j = k - -23. Are j and -10 non-equal? True Let o = 3.97 + -4. Let n = -3.97 + o. Let y = 3 + n. Which is bigger: y or 1? 1 Let c be 15/20 - 1/(-4). Suppose -3 = -2y + c. Is y <= 5/2? True Let u be 324/987 + (-4)/14. Is 0 less than or equal to u? True Let h = -60 + 67. Let o be ((-3)/(-2))/((-4)/(-16)). Is o at least as big as h? False Suppose 0d - 22 = -2d. Which is bigger: d or 12? 12 Let m be 5(-2)/8 - -1. Suppose 0 = 4b - 2b + b. Is b equal to m? False Let x = 87.9 - 88. Let o = -2.94 - 0.06. Let a = o + 4. Which is bigger: a or x? a Let y = 8/13 - 66/65. Which is bigger: -3 or y? y Suppose 19 = -4b - 13. Let k be b/(-20)15/(-12). Which is bigger: -2 or k? k Let v(m) = -m3 + 2m*2 - m + 91. Let c be v(0). Does c = 92? False Let a = -165 - -144. Is -2/7 smaller than a? False Let f be -6(-2)/(3 - -1). Suppose -4a = -fv - 21, -11 = -2a + 3v + 4. Suppose -6 = -aw + 6w. Is w < 0? True Suppose 4i = i + 48. Suppose q + i = -q. Let r be q/15 + 2/6. Are r and -1 nonequal? True Let i = 5 + -5. Let c = i - -1. Is c < -1? False Let s be (-2)/41-14. Suppose -4w + o = -2 - s, -5o - 28 = -3w. Let y = 13/4 + -31/12. Is w less than y? False Let k = 8 - 6. Let t = k - 3. Is 0 less than t? False Suppose 3k - 3 = 12. Suppose 4t = -t - k. Which is bigger: 2/81 or t? 2/81 Let s = -147 - -281/2. Do s and -6 have different values? True Suppose -f + 0f = 2f. Is -1/41 greater than or equal to f? False Suppose 3k = 6k + 12, 4k + 56 = 4f. Let b be (-1448)/f3/6. Let z = 72 + b. Which is bigger: z or -1/4? -1/4 Let k(q) = -q + 15. Let n be k(-12). Let c = -64/3 + n. Is c >= 6? False Let d be (-1(2 - 2))/1. Let w(x) = -x - 5. Let n be w(-4). Is d equal to n? False Suppose 4z + 2 = 2j - 0, j + 4z = 7. Suppose j = -b + 1. Let w be (-1)/(-2) + 2/(-4)3. Which is greater: b or w? w Let o = -1.74 + 0.74. Which is smaller: -10 or o? -10 Suppose -2p + 26 = 5u, -2u - 4p = 3u - 22. Suppose 0h + 12 = 4v + 4h, -2v = 5h. Suppose -vi + 14 = -u. Is 2 greater than or equal to i? False Let x be 3/93 + -1. Let r = -1 - x. Let i be (1 - (-8)/(-6))0. Which is smaller: i or r? r Suppose 2x = 3x + 6. Let l be x/(-15)10/(-8). Is l equal to 4? False Suppose -4o + 0o = -12. Suppose 17 = f + 4. Suppose -f = -4l + s, 0l = 2l - s - 9. Which is smaller: l or o? l Let y be (-2)/4 + (-39)/(-6). Suppose -5o + 4o = 3t + y, 12 = 3o - t. Suppose -o = 4p + 1. Is 2/11 bigger than p? True Suppose u + 3u + 24 = 4g, 5u + 4g - 6 = 0. Let z be u/(-3) + 20/(-21). Suppose 2n + 0 = 5r + 1, 6 = 2n. Is z > r? False Suppose 2d + 0 = -6. Let s be 1((-9)/(-24))/d. Which is greater: s or 0? 0 Let l = 5 - 0. Let c(w) = w2 + 7w - 2. Let d be c(-8). Is l bigger than d? False Let y(s) = -s*3 + 8s*2 + 8s + 13. Let i be y(9). Suppose -8 = 5x + im, 0m + 22 = -4x + 2m. Does -4 = x? True Let w = -3.14 - -0.14. Let t = -0.05 - -0.15. Is t greater than w? True Let q(p) = -p2 + p + 2. Let o be q(2). Suppose o = -5t - 2 - 3. Which is smaller: t or -11? -11 Let r = 30 + 72. Let j be 2/(-11) + r/(-44). Is j > -3? True Let z = -24 - -38. Which is smaller: z or 11? 11 Let a(j) = -j*3 + 2j*2 + 2j - 3. Let u be a(2). Suppose -k + 2k + u = 0. Let z be k/(1(0 - 1)). Which is greater: z or 0? z Suppose w + 2 + 24 = 5r, 0 = 5w - r + 10. Are -12/7 and w equal? False Let o = 7 - 0. Let y = 7 - o. Which is smaller: y or 4? y Let m = -2/13 + 20/299. Is 1 less than or equal to m? False Let w be (-1106)/10 - 4/10. Let s = -889/8 - w. Is s <= 0? True Let w = 5 + -10. Let u be -1 + 4/w + 2. Is u <= 1? True Suppose -3a - 25 = 5j - 0a, a = -5. Suppose -v + 1 = h, 5h + 3v - 1 = -0. Which is greater: h or j? h Let i(d) = d3 + 7d*2 - d - 9. Let f be i(-7). Let y = 5 + 1. Let n be 2 - (22/y + -1). Is f at most n? True Let h be -3 - (0 - 42/4). Which is greater: h or 8? 8 Let p = 7.8 + -8. Let h = 9/32 - -3/32. Do h and p have different values? True Suppose -30 = 2w + 4w. Which is greater: w or -23/5? -23/5 Let j(i) = -i3 + 8i*2 - 3i + 17. Let b be j(8). Which is greater: b or -5? -5 Let i(m) be the first derivative of -m*3/3 + 9m*2/2 - 11m + 2. Let j be i(7). Which is smaller: 1/4 or j? 1/4 Let k = 0.1 - -0.1. Let h = 4.2 - k. Let i = h - 6. Which is smaller: i or 2/7? i Let d = 0.02 + 0.03. Let f = d - 1.05. Let n = -0.1 + 0.3. Which is	{ "pile_set_name": "DM Mathematics" }
ng m is positive. m(-73/20) Simplify ((c(-3)/(c(-3/4)/c))/(c/c(-3/4)cc6))/((c1)(-21)/(c/(c/(((c(-3)/c)/c)/c)c)(cc(-2/3))/c)) assuming c is positive. c(10/3) Simplify (v(1/4)v*6/vv)*(-29)(v/v*(-2/13)v(vv(2/3))/v)(-29) assuming v is positive. v*(-41035/156) Simplify ((ww/(ww(-1)w)w)8/(w0w)*30)/((w(ww(3/2))/w)(-1/3))13 assuming w is positive. w(-19/6) Simplify ((y/(y/y(7/5)))/((y(1/14)y)/y))*(-38)((yy5/yyy)/yy*(-3)y)/(y/(y(y/((yy*(-2/3)y)/y))/yy))18 assuming y is positive. y(-1207/35) Simplify (z(-2/5)z)/((z/z*(-2/17))/z)(z*(-1/6)/z)/(zz*(-2/5))(z(-1))(-2/65)/((zz/z2zz)/(zzz/(z8z)z)) assuming z is positive. z(-54721/6630) Simplify ((m(1/4)m*(2/5)(m(-3)/m)(3/29))(-12/5))(-9/10) assuming m is positive. m(3699/7250) Simplify (k(-6/7)k/(((k(1/3)k)/k)/kk))(-6/11)((k*9k)/((kk10kk)/k))(-9) assuming k is positive. k(1394/77) Simplify ((o/(o(-6)oo)o)/o2)(-12/5)(o1o(-3/5)/o)(-9/2) assuming o is positive. o*(-69/10) Simplify ((q/(qq*(-3/2)q)q)15q*(-1/9)q12/q)(-44) assuming q is positive. q(-13222/9) Simplify t(-6)/t*4((t*(-2/13)t)/tt)/(t(1/11)tt)(t*(-3/8)/(t/(t(t/((tt(2/13))/t)ttttt)/t)))/((tt(-1/2)t)/t)26 assuming t is positive. t(-22621/1144) Simplify ((f*(3/31)f(3/26))(2/69))7 assuming f is positive. f(399/9269) Simplify (m*1/mm)/m*(-3/7)(mm1)(-44)(m*7m)/mm(((m/m*2)/mm)/m)/mmm*(2/17)m/(mm/(m/m(-7)m))m assuming m is positive. m(-8503/119) Simplify (((i/(i/i(-2/9))i)/(i*(1/4)i))(-28))(22/5) assuming i is positive. i(2618/45) Simplify (s(-7)/(s/s(-2/7)))(-19/5)s0ssssss/s(-2/3)ss/(s/s(-7)sss)ss(1/3) assuming s is positive. s(1067/35) Simplify ((m*(-5)/mm(2/53))/((m34m)/m(-1/2)))(-9) assuming m is positive. m(39555/106) Simplify ((z/(z/((zz/(z*(-3/11)z))/z))zzz)/z(5/4)(z(-8))(-18/11))(6/7) assuming z is positive. z(285/22) Simplify ((d/(dd/d(-1/3)))(2/3))(-46)/((d2d/d*6d)/(d*(-5)d(-2))) assuming d is positive. d(323/9) Simplify (n*(-3)/(nn*(1/3)n))*(1/82)(n*1/nnn(-4))/(n(-1/3)/n)(-34) assuming n is positive. n(-5953/123) Simplify ((cccc*(-9)c)/(c/(c/(c*(-1/9)c)))(c/(cc/(c/(c/(c/((cc/c(-4)cc)/c)c))))c)/ccc(-10))(-26) assuming c is positive. c(4888/9) Simplify ((h/(hh*(-3)))/hh((h/(h/(h/(hh*(9/7)/h))))/hh)/h((h(10/9)/h)/h)/hhh9)(-3/10) assuming h is positive. h(-619/210) Simplify (((pp(-1/5))/p0(p(1/7))3)29)32 assuming p is positive. p(39904/35) Simplify ((j(3/5))18)39(j*(1/7)/j)/(jj*(3/4))((j(-2)/j)/j)/j(-2/3) assuming j is positive. j(174409/420) Simplify ((r(-8)r/(r(-1/8)r))/(r*(-1/14)/(rrr21rr)))(-21) assuming r is positive. r(-2889/8) Simplify (y(-20/7))(3/13)(y(3/4)/y)/(y(-32)y) assuming y is positive. y(10953/364) Simplify ((dd2)/d(-3/5))*(-6/31)ddd/(d*(3/7)/d)d*(2/21)(d/(d/d(1/8)))/d(-2/5) assuming d is positive. d*(13001/3720) Simplify ((nn/(nnn/n*(2/5)n))37)6/(((n/n(2/9))/n)(-4/19))(-21) assuming n is positive. n(-100952/285) Simplify ((p/(p(p/(ppp/(p/(p(1/4)p))))/p))/p3)(-6/29)/((p/(p/p*0p)p)(-41))(2/3) assuming p is positive. p(-3/58) Simplify ((b(-2/9)b)*14((b/(b(b/(bbb(4/13)b))/b))/b)29)(1/5) assuming b is positive. b(9104/585) Simplify a(5/3)aa*(-2/17)(a/(a2/a))(-7)(a(-1/2)/a(-6))/(a6a(-1/12)) assuming a is positive. a(145/68) Simplify (((((uu(uuuu(-4/7))/uu)/u)/(u*9u))(-9))(5/4))(2/19) assuming u is positive. u(1035/133) Simplify ((j/(jjj*(1/3)jj))(3/17))47(j*(7/2)(((j/(jj/j(-5)jj))/jj)/j)/j)/(j*(-5)j*6/jj) assuming j is positive. j(-1195/34) Simplify (b8(b(-6/17)b)/b(bb/(b*(-3/4)b))/(bb/b(-11)b))48 assuming b is positive. b(-3756/17) Simplify ((s/(s/s*0))/ss)(-5/8)/((s/(s(1/3)s))/s)49(s/s(-1))(-1/38)(s/(ss1))(-4/23) assuming s is positive. s(85811/1311) Simplify (((u0)*(-24)(u/(uu(-6)u)u)/u5)(-3/4))(26/9) assuming u is positive. u(-13/6) Simplify (qqqqq/(q/(q/(q/(qq/(q*(-20)q))q)))q*(-3/13)/qq*17/(qq*(-2)q))(-1/27) assuming q is positive. q(-517/351) Simplify ((jj(-1/7)j)/jj(-7)(j/(j(jj/(((jjjj(2/5)j)/j)/jj))/jj)j)(-6/11))/((j(-1/2))(-50)j*(2/5)j2) assuming j is positive. j(-13418/385) Simplify ((i(1/16))36/(i*(-16/5)i/(i/(i(-8)/i))))(-11) assuming i is positive. i(-3179/20) Simplify y(3/8)/((yy0)/y)(y1)(-5/7)y/y(1/11)yy(y*(2/33)y)/y(y0/y)22 assuming y is positive. y(-35795/1848) Simplify ((jj*(-8)jj)(-5)/(j/(j/(j/(j(2/7)jj))))(10/11))7 assuming j is positive. j(2015/11) Simplify ((a0/a)(2/29))(-38)((aa9/aa)/aa(-10))4 assuming a is positive. a(-40/29) Simplify (rrr2r(((((r/r(-1/7))/r)/r)/r)/r)/rrr/(r(-13)r)r(r/r(2/35))/r)21 assuming r is positive. r(1689/5) Simplify ((y(2/17))33)(33/2)((y/y(-5)y)(2/53))(-46) assuming y is positive. y(46769/901) Simplify ((o/o6o/(o(-1)/o))/(ooo(-8)o*(-1/5)))/(((oo*(1/2)/oo)/o*(-4/5))/(o(oo/(oo/o*(-3/5)oo))/oooo*(2/3)o)) assuming o is positive. o(89/30) Simplify ((y/((y/(y/(y/y(2/5))))/y))/y)*(-1/67)/((yy(2/5))/y)(6/13)(y(1/4)/(y(-2/3)/yy))/(y(1/3))(-8/7) assuming y is positive. y*(80995/73164) Simplify (dd/d*17d*19d*(-2)dd(-16/3)dd)(2/57) assuming d is positive. d(-2/171) Simplify ((((a(2/7)/a)/a)/aa)*(2/127)/(((aa*1)/a)/(a(a(1/4)/a)/a)))/(a3/a(2/5))(-2/73) assuming a is positive. a(-2213979/1297940) Simplify (((o(-2/3)o)/o)/o(-2/9)o*(2/9)oo/o(3/2))/((o2)(5/7)/(o(2/7)/oo)(-37)) assuming o is positive. o(-211/18) Simplify ((((g(5/3)/g)/g)/g)(15/4)(g(-7))(-2/81))(-4/27) assuming g is positive. g(1564/2187) Simplify ((d0)(-1/10)d*3/(dd*(-2/9)))/((d/(ddd(-5)))/d1d*1/ddd3) assuming d is positive. d(-43/9) Simplify (t/(t/(t2tt)t)tt)(-23)/(t1/t)*9((t/(tt(5/3)))18)(-8) assuming t is positive. t125 Simplify ((g(-6)/g)/(g4/g)(g/(g/g*(-5)))/((g/(gg(g/(g/g(-2/7)))/g))/g))/((g1)(-13)/(g(-5)/((gg(5/4))/g))) assuming g is positive. g(-211/28) Simplify (q*(-3)q*1/qq)(14/11)/((q/q(-4/11))/q(2/3))5 assuming q is positive. q*(-199/33) Simplify (ooo/o(1/5)ooo/o(2/5))40((o(2/5))(3/2))36 assuming o is positive. o(1188/5) Simplify ((hh/(h(-1/2)/h))(-44)/(h1)(-37))/(hh(1/12)h(-2/7))(1/2) assuming h is positive. h*(-19723/168) Simplify ((dd*(5/2))/(d(d/d(-1/3))/d))/(((d/(d/d6)d)/dd)/(d*1/d))((d(d/(d(dd(-2/9))/d))/dd)(2/111))15 assuming d is positive. d(-2999/666) Simplify (d(-4)/d*(-2/3)(d/(dd/d(3/10)d)d)/(d(d/(dd(-5)/dd))/d))/(d(dd/(d/(d/d*(-3/11)))d)/dd(-3/2))(-2/15) assuming d is positive. d(-2903/330) Simplify ((j/(jjjjjj(2/9)))/j)/j0(jj/((jjjjj*(-7)jj)/j))/(jj*(-1)/j)(jj4)/(j/j(2/5))(j(2/7))23 assuming j is positive. j*(3386/315) Simplify ((h/((h/(((hh(2/7))/h)/h))/h))(8/7)h/h3h*(1/6)h)/((h(1/4))(4/31))0 assuming h is positive. h(-149/294) Simplify ((oo18/o)3o12/(o32/o))(1/6) assuming o is positive. o(35/6) Simplify ((m*21/(mm*(3/8)mm))/(m8/mm(m7m)/m))(-3) assuming m is positive. m(-63/8) Simplify (jj(2/9))40j*5/jj/(j*2/j)(j*(1/5)jj/(j6j))/(j*3j3) assuming j is positive. j(1894/45) Simplify ((g*26g*(3/13))/(g/(g(g/(g/(g*(-1/17)/g)g))/g)g(-2/41)))(4/25) assuming g is positive. g(841612/226525) Simplify ((v/(vvv/(v/(v/(v/(vv*(-15)))vv)))v(-6))/((v/(v(-2/7)/v)v)/v(-1/5)))39 assuming v is positive. v(2067/35) Simplify ((r/(r/r(-1/13)))/(r/r(-3)))/(r/r(-5))(-8/3) assuming r is positive. r(155/13) Simplify ((d/((d/((dd(5/4)/d)/d))/d))(-3/2)d0dd(7/2))(-39) assuming d is positive. d(-819/8) Simplify (v*(-2/11	{ "pile_set_name": "DM Mathematics" }
is the third derivative of b(d) wrt d? -48 Let a(c) = -6c2 + 3. Let m(t) = t2 + t - 1. Let d(y) = -a(y) - 3m(y). What is the second derivative of d(j) wrt j? 6 Let c(n) = -n - 2. Let g be c(-4). Let x be (-36)/10(-5)/2. Find the second derivative of -go + xo2 - 9o2 + o4 wrt o. 12o2 Let t(r) be the first derivative of r5/30 - r3/6 + r2 - 2. Let i(v) be the second derivative of t(v). What is the first derivative of i(s) wrt s? 4s Let j(c) = -10c4 - 5c*2 + 21c - 3. Let h(z) = -15z4 - 8z*2 + 31z - 5. Let w(f) = 5h(f) - 8j(f). What is the second derivative of w(x) wrt x? 60x2 Let a(t) be the third derivative of t6/20 - 7t*4/24 - 3t*2. What is the second derivative of a(d) wrt d? 36d Let l(y) be the third derivative of -y*7/35 - 2y3 + y2. Differentiate l(h) with respect to h. -24h3 Let f be ((-5)/2)/(7/(-14)). Find the second derivative of 2v + 3v + fv3 + v3 - v*3 wrt v. 30v Let m(i) = i3 + i2 - 1. Let f(v) = -14v3 - 3v*2 + 4v + 2. Let n(t) = -f(t) - 3m(t). Find the second derivative of n(b) wrt b. 66b Let u(n) be the second derivative of n7/70 - n5/60 - 3n2/2 - 6n. Let d(z) be the first derivative of u(z). What is the third derivative of d(g) wrt g? 72g Let f(w) = -5w + 2. Let u(a) = -a*2 + 5a - 3. Let r be (-3)/(((-9)/(-3))/3). Let q(h) = rf(h) - 2u(h). Find the second derivative of q(m) wrt m. 4 Let v(i) = -i - 1. Let u be v(-3). What is the second derivative of p + 11p2 - 2 - 4p*2 + u wrt p? 14 Let b(r) = 40r*3 - 24r*2 - 40. Suppose -4i - 15 = -i. Let d(o) = 8o3 - 5o*2 - 8. Let s(f) = ib(f) + 24d(f). What is the derivative of s(q) wrt q? -24q*2 Let s(q) be the second derivative of -7q*6/30 - 23q*3/6 + 11q. What is the second derivative of s(r) wrt r? -84r2 Let m(l) = -7l - l*3 + 4l*2 - 7 + 0 - 10l2. Let q be m(-5). What is the third derivative of -o2 - 4o - 2o*q - 2o + 6o wrt o? -12 Let i(c) be the third derivative of -c7/140 - c6/60 - 5c3/6 - c2. Let q(b) be the first derivative of i(b). What is the third derivative of q(j) wrt j? -36 Let t(c) = -2c4 - 2c*2 + 25c. Let j(p) = -2p4 - 3p*2 + 24p. Let y(d) = 2j(d) - 3t(d). Find the second derivative of y(w) wrt w. 24w2 Let u(f) be the first derivative of -f6/60 - 2f*3/3 + 5f*2/2 - 3. Let x(l) be the second derivative of u(l). What is the first derivative of x(a) wrt a? -6a*2 Differentiate 6 + 1 + 3h + 0 - 2h with respect to h. 1 Let m(j) be the third derivative of 0 - 1/3j*3 + 0j*4 - 3j*2 + 0j + 1/30j5. What is the first derivative of m(c) wrt c? 4c Let g = 70 + -68. Let v(f) be the first derivative of 0fg - 1/2f*4 + 0f*3 - 3 + f. Find the first derivative of v(c) wrt c. -6c*2 Let s(u) be the third derivative of -3u*2 + 0u*4 + 0u*7 + 0u + 0u3 + 1/60u*5 + 0u*6 + 0 + 1/112u*8. What is the third derivative of s(h) wrt h? 180h2 Let x(a) = -a4 + a*2 - a + 1. Let v(d) = 10d*5 + 3d*4 - 3d*2 + 10d - 3. Let m(w) = v(w) + 3x(w). Find the second derivative of m(z) wrt z. 200z3 Let j(a) be the second derivative of a7/168 - a*5/15 + 2a*3/3 + 8a. Let p(w) be the second derivative of j(w). Find the second derivative of p(l) wrt l. 30l Let v(r) = -r2 + 6r + 1. Let m be v(5). Find the third derivative of -3u5 + 6u*2 + 3u*5 - 3u*6 + 6u*m wrt u. 360u*3 What is the second derivative of 45h - 4h3 + 52h - 103h + 32h*3 wrt h? 168h Let b(i) = 3i3 - 2i*2 - 2. Suppose 7u = 10u + 6. Let g(w) = 3w*3 - 3w*2 - 1. Let j(t) = ug(t) + 3b(t). What is the first derivative of j(k) wrt k? 9k2 Find the second derivative of -1 - b3 + 169b2 + 3 - 145b*2 + b wrt b. -6b + 48 Let u(v) = -v*3 + 3v*2 + v + 1. Let g be 2 + (-2)/2 + 2. Let r be u(g). Find the third derivative of -5k*4 - 2k*6 + 5k*r - 2k*2 wrt k. -240k3 Let s(q) be the third derivative of -q6/60 - q*5/30 - 3q*2. Find the third derivative of s(g) wrt g. -12 Let f(z) be the second derivative of 0z*4 + 0z*5 - 1/30z*6 + 1/3z*3 + 0 - z + 0z*2. Find the second derivative of f(x) wrt x. -12x*2 Suppose j - 28 = -3j. What is the second derivative of f*5 - 3f*5 - jf + 2f + 4f wrt f? -40f3 Let p be (1/3)/((-6)/(-270)). Let w be ((-9)/p)/(1/(-5)). Find the third derivative of -5z*w - 4z*3 - 3z*2 + 2z*2 + 6z*3 wrt z. -18 Let f(z) = z - 2 + 31z*3 - 28z*3 + 3z. Let q(x) = 4x + 11x*3 - 4x*3 - 5 + 5x. Let y(u) = -5f(u) + 2q(u). Find the second derivative of y(v) wrt v. -6v Let k(w) be the first derivative of 19w*3/3 + 15w*2/2 - 24. Find the second derivative of k(s) wrt s. 38 Let d(u) = 23u*3 + 19u*2 + 11u + 11. Let z(c) = 12c3 + 9c*2 + 6c + 6. Let o(y) = 6d(y) - 11z(y). Find the third derivative of o(x) wrt x. 36 Let p(h) = -36h - 43. Let n(o) = 36o + 42. Let j(a) = 6n(a) + 7p(a). Differentiate j(l) wrt l. -36 Find the third derivative of 9w3 + 7w*2 - 9w3 - w4 + 21w2 wrt w. -24w Let d be (-7)/(-7) - (-1 - 2). Find the third derivative of -du2 + 4u3 - u3 - 6u3 wrt u. -18 Suppose 3g + 0g = -3g. Let n(c) be the third derivative of 1/2c3 + g + 0c - 1/30c5 + 0c*4 - 4c*2. Differentiate n(l) with respect to l. -4l What is the first derivative of -100d + 2d*4 + 100d + 10 wrt d? 8d3 Let j(t) = 11t*5 - 3t*4 + 9t2. Let k(g) = -g4 + g*2. Let v(u) = -j(u) + 3k(u). What is the third derivative of v(o) wrt o? -660o2 Suppose 5q - 28 = -g, -q + 2 = -g - 0. What is the second derivative of 21n5 - n - 14n*q + 4n wrt n? 140n3 Let h(d) be the third derivative of 11d*7/70 - 25d*4/12 + 7d*2. What is the second derivative of h(f) wrt f? 396f*2 Let o be (1 - 1)/((-3)/1). Suppose o = -4y + 27 - 11. Find the second derivative of 0m4 - 4m - 3my + 3m + 3m wrt m. -36m*2 Let y be 9/(-2)8/(-12). Find the second derivative of -m*3 + ym*3 - 3m*3 - 4m wrt m. -6m Let s(c) = 154c*3 - 28c*2 + 217c + 28. Let l(j) = 17j3 - 3j*2 + 24j + 3. Let z(k) = -28l(k) + 3s(k). What is the second derivative of z(f) wrt f? -84f Suppose -5 = g, 11 + 4 = -5d - 5g. What is the third derivative of 4j*d - 5j*4 - 3j*3 + 5j*3 - 2j*3 wrt j? -120j Let i(p) be the third derivative of -2p2 + 1/20p*5 + 0p*6 - 1/84p*8 + 0p*4 + 0p*3 + 0p*7 + 0 + 0p. What is the third derivative of i(t) wrt t? -240t2 What is the first derivative of -32n + 11n + 16n - 11 wrt n? -5 Let w(c) = -19c4 + 5c*3 + 89c*2. Let i(v) = -9v*4 + 2v*3 + 45v*2. Let g(a) = 7i(a) - 3w(a). What is the third derivative of g(o) wrt o? -144o - 6 Let d = 19 - 19. Find the second derivative of 7g - 14g + dg3 - 2g*3 wrt g. -12g Let j(y) = -y*2 + 13y - 7. Let u be j(12). What is the derivative of 6 - uw3 + 2w*3 - 2 - 2w*3 wrt w? -15w*2 Let f = 45 - 43. Let h(i) be the second derivative of 0i*3 + 1/10i*5 + 1/12i*4 + 0i*f + 0 - 2i. What is the third derivative of h(m) wrt m? 12 Suppose -15 = -2g - 3. What is the third derivative of 18f*2 - 10f2 + fg - f*2 wrt f? 120f3 Let r(u) = u2 + u + 5. Let t be r(0). Find the third derivative of -3d2 - 9dt + d4 + 6d5 - d4 wrt d. -180d*2 Let p(t) = 13t*3 + 6t - 9. Let b(f) = -6f3 - 3f + 4. Let v(i) = -9b(i) - 4p(i). Find the second derivative of v(d) wrt d. 12d Let u(x) be the first derivative of -12x*2 - 18x - 20. What is the derivative of u(z) wrt z? -24 Let m(i) be the third derivative of i9/5040 - i7/360 - i*4/24 - 7i*2. Let v(u) be the second derivative of m(u). Find the third derivative of v(k) wrt k. 72k Let f(n) be the third derivative of 0n - n2 + 1/24n*4 + 0n*3 + 0 - 1/30n*5. What is the second derivative of f(h) wrt h? -4 Find the second derivative of -24 + 6y*3 - 2y - 2y5 + 1091y*4 - 1091y*4 - 2 wrt y. -40y*3 + 36y Let i(s) be the first derivative of 0s5 + 0s + 1 + 0s6 - 1/3s*3 + 1/7s*7 + 0s*2 + 0s*4. Find the third derivative of i(m) wrt m. 120m*3 Let b(c) be the second derivative of 17c*7/14 + 8c*4/3 - 38c. What is the third derivative of b(q) wrt q? 3060q2 What is the derivative of 23 - 2g + 20*g + g wrt	{ "pile_set_name": "DM Mathematics" }
0l - 3l)(-5l + 3l + 3l) - 6l2 - 3l*2 + 3l*2 + (-3l + 4l + 3l)(-3l - 2l + 4l). -9l2 Expand (-1 - 4 + 3)(-2 + 2 + 2)(-g2 - g4 + 2g*2 + 2g*4). -4g*4 - 4g*2 Expand (r - 3r + 3r)(-24 + 22 - 8r - r). -9r*2 - 2r Expand (-7l + 3l + 2l)(-l - 2 + 2 - 2) - 13l2 - l2 + 0l*2. -12l*2 + 4l Expand (2v - 3v - 5v)(5v + 7 - 7). -30v*2 Expand ((-v + 5v - 2v)(-3 + 3 + 1)(-9 + 13 + 0) - 5 + 5 + v)(v*4 + 0v*4 - 4v*4). -27v*5 Expand (2 + 0 + 0)(8 + 5 - 5)(-2r*5 + 0 + 0). -32r5 Expand (k3 - 2k3 + 2k*3)(-2k - 2 + 2 + (6 - 4 + 0)(-k + 2k - 7k) - k + 0k - k). -16k*4 Expand (2b - b + 2b)((-2 - 2 + 6)(12 + 2b - 12) - b - 2b + 4b). 15b2 Expand (3 - 3 + 2t)(2 + 2 + 1) - 3t + t + t - 4t + 4t - t + 2t - 4t + 3t. 9t Expand -3z4 - 2z4 + z4 + (3z + 2z - 3z)(2z - 2z - z3) - z4 + 4z4 - 4z*4 + (2z - 2z + 2z*4)(3 + 3 - 5). -5z4 Expand (-49d - 119d - d)(2d4 + 2d*2 - 2d*2). -338d*5 Expand (4 - 6 + 7)(2m4 + 7 - 7 - 2m). 10m4 - 10m Expand -3u3 + 16u*2 - 18u2 + u3 + (3u - 7u + 2u)(-u*2 + 3u*2 + 0u*2). -6u*3 - 2u*2 Expand (-2t4 + t3 - t*3)(-6 - 2t + 4 + 10). 4t*5 - 16t*4 Expand (-5n*3 - 5n*3 + 3n*3 - 7n)(0n + 4n - 5n). 7n4 + 7n*2 Expand 4f*4 + 0f*4 + 0f4 - f4 - f4 - f4 + (-f*2 - 3f*2 + 2f*2)(0f + 2f*2 + 0f). -3f4 Expand (0y2 - y2 - 5y2)(3y2 - 2y*2 - 3y*2)(-5y + 4y + 3y). 24y5 Expand m5 + 4m5 - 3m*5 + (-2m*2 + 0m2 - m2)(-6m - 6m + 11m)(0 + 0 + m2). 5m*5 Expand ((0 - 4 + 2)(2 + 0 - 4) - 10 - 7 + 7)(-l - l - l). 18l Expand (82t - 18t - 23 + 21)(1 - 2 + 2). 64t - 2 Expand -f3 + f3 - 2f4 + (1 - 1 - 2f)(73 + 98 - 5f*3 - 194). 8f*4 + 46f Expand (-1 + l + 1)(2 + 4 + 0)(3l2 - 3 + 3). 18l*3 Expand (2w*3 + 3w*3 - 4w3 + w2)(-2 - 1 + 8). 5w*3 + 5w*2 Expand (-10s + s*3 + 10s)(-2 + 1 - 2) + 2s*2 - 2s2 + s3. -2s3 Expand (-5u + 5u - u)(3 + 1 - 3u - 1). 3u*2 - 3u Expand (6i3 - 4i*3 + 0i*3)(-4i - 4 + 4)(2 - 2 - 2i). 16i*5 Expand (0v + 5v - 8v)(-4v + 3v + 0v). 3v2 Expand -6l*4 + 3l4 + l4 + 0 - 2l4 + 0 + (0l - 3l + l)(-l*3 + 0l*3 - 3l*3) + 0l*4 + 2l*4 + 0l*4. 6l*4 Expand (7 + 0 - 3)(-j*5 + 3j*5 - 3j*5). -4j*5 Expand (-7 + 4 - 1)(0r + 2r + 1 - 3). -8r + 8 Expand y + 0y + 3y + 0y + 0y + y + (-1 + 1 + 2)(6y + y - 5y) + y - 4y + 0y. 6y Expand n2 - n2 - n5 + (-3n*4 + 0n*4 + 5n*4)(-2n + n + 3n) + 0n5 - n5 + 0n*5 - 2n3 - n5 + 2n3. n5 Expand (2b*5 - 3b*3 + 3b*3)(295 - 142 - 90). 126b5 Expand (m + 9 - 9)(-1 + 0 + 2m + 0m). 2m2 - m Expand (-2 - 1 + p2 + 0)(0p2 + 3p*2 - 2p2). p4 - 3p2 Expand (-3 + 3 + o2)(2o - 7 + 7). 2o*3 Expand (4t + 18t + 30t)(-2t - 2t3 + 2t). -104t4 Expand (g - 2g + 2g)(-3 - 10 - 19)(0 + 0 + 2). -64g Expand -w*5 + 0w*2 + 0w*2 + (2 - 9w*4 - 2)(-4 + 4 - w). 8w5 Expand -3t*2 + 6t - 6t - 3t2 + t2 - t*2 + (0t + t + t)(0t + 5t - 3t) + 0 + 3t2 + 0. t2 Expand (g + 0g - 2g)(-2 + 2 - g)(-65 + 65 + 52g) - 1 + 1 + g*3. 53g*3 Expand 2k + 2k - 2k + (k + 2 - 2)(-5 + 1 + 1) - 2k + k - k + (-5 + 3 + 3)(-2k + 3k - 2k). -4k Expand (-1 + 2 - 2 + (-4 + 0 + 2)(2 - 3 + 2) + 3 + 1 - 2)(-2o + 7o - 2o). -3o Expand (-15 - 11 - 2)(3n - 3n + 3n). -84n Expand ((-3q + 0q + 4q)(q - 1 + 1) - 2q2 - q + q)(1 + 2q - 1). -2q*3 Expand (-17l + 3l - 16l + 13l)(-4 + 3 + 4). -51l Expand (0s3 + s3 - 4s3)(1 - 2 + 4). -9s3 Expand (-48 - 23 + 33)(4s - s - s). -76s Expand (-q + 4q - 2q + 22)(0q3 - q3 + 3q3). 2q*4 + 44q*3 Expand (d + 2 - 2 + (-2 + 2 + 1)(2 - 2 + d))(4d - d + 4d). 14d*2 Expand (8 + 30 + 0)(0 + 3i + 0). 114i Expand 5b + 4b*2 - 5b + (b*2 - 2b2 - b2)(1 - 3 + 0) - 2b*2 + 0b + 0b + 5 - 3b*2 - 5. 3b*2 Expand (-2u*2 - 13 + 13)(-3 + 2 + 2 + (-2 + 1 + 0)(-1 - 2 + 2) + 2 + 1 - 1). -8u*2 Expand (o + 3o*3 - 4o + 5o)(4o - 3o - 3o). -6o*4 - 4o*2 Expand -3a*5 + 0a*5 - 2a*5 + (-a + 3a - 3a)(-a*4 + a - a) + 5 - 5 + 3a5. -a5 Expand (c*3 - c + c)(0 + 8 + 0)(-5 + 0 + 6)(2c + 4c + 2c). 64c*4 Expand (-3m + 0m + 4m)(-2m + 3m - 2m) - 10m2 - 3 + 0 + 9m*2. -2m*2 - 3 Expand (58c + 38c + 70c)(-4c*2 + c + 5c*2 - 2c*2). -166c*3 + 166c*2 Expand (0 - 5 + 4)(2 + 3q2 - 2)(q*2 + 0q*2 - 3q*2). 6q*4 Expand -2g*3 - 2g3 + g3 - 2g3 + 3g*3 - 2g*3 + (-5g + 5g - 2g*2)(5g + 0g - 4g) - 1 + 1 + 2g3 - g3 + 0g3 - g3. -6g3 Expand -2 + 2 + o5 - 4o5 + 2o*5 - 2o*5 + 4o5 + o5 - 4o5 + (2o*3 - 2o3 - o4)(0o + 4o - 2o). -4o5 Expand -5h4 - h4 + 2h4 - 3 + 3 + 2h*4 + (0 - 2 + 4)(3h - 3h - 2h4). -6h*4 Expand (1 - 14 - 3)(-5k2 + 3k*2 + 0k*2)(0 - 2k + 0). -64k*3 Expand (190 - 190 + 6q)(0q - 4q + 2q). -12q2 Expand (-d + 3d*2 + 5d - 3d)(-d*2 - 3d*2 + 5d*2). 3d4 + d3 Expand (-5x + 0x - 2x)(x + 0x + 0x + (0x + 3x - x)(0 + 0 - 2) + 2x - 2x - x). 28x*2 Expand -2n2 + n2 + 0n2 + (0 + 3 - 4)(3n2 + 0n2 - n2) - 6n2 + 2n2 + n2 + 6. -6n2 + 6 Expand (4 + 3 - 5)(-1 + b*2 + 1 + (-3b + b + 3b)(3 - 2b - 3) - b2 - 4 + 4 + b2 + 2b*2 + 0b*2). 2b*2 Expand (5a + 41 - 41)(2 - 3a*2 - 2). -15a*3 Expand (4x - 4x + x)(0x + 2x + 5x) + 0x - x + 2x2 + 0x. 9x2 - x Expand -2x2 - x2 + 4x2 - 6x*2 + 2x*2 + 2x*2 + (-2 + 1 - 1)(x*2 - 3x*2 + 3x*2) - 3x2 + x2 + 4x2 - 2x*2 - 5x*2 + 3x*2. -5x2 Expand -i3 - 2i3 + 2i*3 + 2i*3 + 2i - 2i + (2i2 + i2 - 4i2)(-i - 2i + 0i) - 2 + i*3 + 2. 5i*3 Expand -20z5 + z5 + 0z5 + (0z*3 - 2z*4 + 0z*3)(0 + z + 0). -21z5 Expand (-143y*3 + 8946y - 8946y)(2 - y - 2). 143y4 Expand (0k*3 - 2k*3 - 2k*3)(4k - 3k + 0k). -4k*4 Expand (o - 1 + 0 - 2o)(2o*2 + 4o*2 - 4o*2). -2o*3 - 2o*2 Expand 12j*3 - 12j*3 - 4j*5 + 0 + 0 + 2j*5 + (2j*3 + 0j*3 + 0j*3)(j*2 - 3j*2 + 4j*2) + 0j*5 + 2j*5 - 3j5 + j5 + j*5 - 4j5. -j5 Expand -o*3 - 2o*3 + 5o*3 + 5o*3 + 0o*3 - 4o*3 + (3 - 3 - o)(6o2 - 2o*2 - 2o*2) - 6o*3 + 5o*3 + 4o*3. 4o3 Expand j3 - 4j3 - 2j3 - j3 + j3 + j3 - 3j2 - 3j*3 + 3j*2 - j + j - 2j*3 + (-2j*2 + 3j2 + j2)(2j - 5j + 2j) + 2j3 - 1 + 1. -9j*3 Expand ((q - 1 + 1)(-4 + 1 + 5) + 5q + 0q + 5q)(-2q + 2q + q). 12q2 Expand (-m2 - m2 + 3m*2 + (0m + 4m - m)(-2m + 0m + 0m))(0 + 2 + 2). -20m2 Expand (-j3 + j3 + j3)(3 + 3 - 5) - 17j3 - 37j*2 + 37j*2. -16j*3 Expand (4g - 10g + 2g)(-4 + 5 + 0). -4g Expand (3 - 1 - 1)(-x + 0x + 2x)(-x - x - 1 + 3x). x2 - x Expand (2i*3 + 3i*3 - 4i*3)(-i - i + 4i) + 2 - i4 - 2 + (-i + 0i + 0i)(i*3 + 4i*3 - 6i3) + i3 + 2i4 - i3 - i4 + 4i*4 - 2i*4. 5i*4 Expand (-2 - 1 + 5)(3y - y + 2y)(-2y*2 - 3y*2 + 4y*2). -8y3 Expand (x2 + 3x3 - 2x*2 - 5x*3)(-7x2 + 2x - 2x) + 3x*5 - 8x*3 + 8x*3. 17x*5 + 7x*4 Expand (2u*2 + 0u*2 + 0u*2)(1 + 2 + 0)(2u - 4u + 4u). 12u3 Expand (-108t - 146t + 89t)(-t + t - t2 + 0t2 + t2 + 0t2 - 2t*2 + 2t2 - t2 + (-3t - t + 2t)(t - t - t)). -165t*3 Expand (2p - 2p + p)(p - 2p + 0p + (-2p - 1 + 1)(-3 + 1 + 0) + 0 - 4p + 0 - p - 3 + 3). -2p*2 Expand (-2 - 2p + 2)(-p4 + p4 + 2p4) + (p5 + 2p5 - 4p*5)(-3 - 1 + 2) - 2p5 + 0p*5 + 3p5. -p5 Expand (0 + 0 - 2w2 - w)(0w2 - 5w*2 + 2w*2). 6w*4 + 3w*3 Expand (3y*4 - 3y4 + y5)((-1 + 1 + 2)(1 + 2 + 0) + (0 + 0 - 1)(-1 + 1 - 1)). 7y*5 Expand (3 + 2 - 3)(2 - 2 + j) - 2j + j + 0j - 2j + 3j - 3j + (0 + 1 + 0)(-2 + 2 + j) - 2j + 4j - 4j. -2j Expand (-f + 0f + 2f)(2 - 2 - 1)(-3f4 + 2f4 - f4). 2f5 Expand (3q + 2q + 0q)(0q + 0q + 3q*2 + (0 + 2q + 0)(0 - q + 0)). 5q**3 Expand (	{ "pile_set_name": "DM Mathematics" }
(y) be the second derivative of y7/2520 - y6/90 + y*5/30 + 5y*4/12 - y. Let n(x) be the third derivative of m(x). Give n(5). -11 Suppose z - 2i = -6, -2i + 5i = 5z + 30. Let c(w) = -2w*2 + 0w3 + 3 - w3 - 4w2. Determine c(z). 3 Let g(i) be the third derivative of -2/3i*3 + 0i + 0 + 2i2 - 1/30i*5 + 1/8i4. Give g(3). -13 Let l(x) be the second derivative of x3/3 + 9x2/2 - x. Determine l(-6). -3 Let v(l) = -5 + 7 - 5l + 4l2 + l3 - 1. Give v(-5). 1 Suppose 0 = -3b + 4w - 2w - 7, 2b - 4w + 2 = 0. Let j(g) be the second derivative of -g4/12 - g3/2 - 2g. What is j(b)? 0 Let t(d) = -d2 + 9. Let v = 5 - 4. Let w be 0/(-1(v + 0)). Calculate t(w). 9 Let d(b) = 36 - 16 + b*3 + 4b + 4b2 - 7 - 10. Calculate d(-4). -13 Let u(y) = 26y*2 + y + 2 - 3 - 24y*2. Suppose -4i = -2i - 12. Let z(w) = w - 8. Let m be z(i). Determine u(m). 5 Let p(t) be the second derivative of -5t3/6 + t2/2 + t. Let q(u) = 2u - 2u3 + u3 + 2 - 3u2 + 3u + 3. Let z be q(-4). What is p(z)? -4 Let x(i) = 6i2 - 3i + 2. Let l(k) = -5k2 + 4k - 2. Let h(c) = -5l(c) - 4x(c). What is h(5)? -13 Let y(t) = -t*2 - 6t - 2. Let b be y(-6). Let u = b - -9. Let m = u - 10. Let f(a) = -a*2 - a - 2. Give f(m). -8 Let n(v) = -9 - 8 - 2v2 + 15 + v3. Give n(2). -2 Let y(n) = -n*2 + n + 3. Let w(o) = 3o*2 - 3o - 8. Let l(p) = -2w(p) - 7y(p). Let b(f) = f*2 + f - 1. Let z be b(-2). Let a = 5 - z. Determine l(a). 7 Suppose 0 = 5z - a + 2a + 40, 0 = -5z - 3a - 30. Let i = z - -6. Let y(n) = n + 1. What is y(i)? -2 Let q(r) = 9r - 4. Let s(h) = -3h + 1. Let w = 10 + -7. Let g(j) = wq(j) + 8s(j). Determine g(3). 5 Let k(p) = -8p - 2. Let y be k(-2). Suppose -4i + w + 1 = 0, w = -2i - 3w + y. Suppose -i + 4 = -3x. Let r(z) = -4z3 - z2. What is r(x)? 3 Let a(g) = g2 + 5g + 4. Let v(p) = 5p3 - p2 - p. Let l be v(-1). Give a(l). 4 Suppose 0 = -4i - 0 - 8. Suppose 5v = -u + 20, -5u + 3u - 4v = -22. Let x(y) = -uy + 0y - 1 - 1. What is x(i)? 8 Let a(c) be the second derivative of -c*4/12 - 2c3/3 + c2 + 9c. Give a(-4). 2 Let w(b) be the second derivative of -b5/20 - b4/3 - b3/2 - 3b*2 + b. Let u(o) = 6o + 2. Let i be u(-1). Calculate w(i). 6 Let z(h) = h*3 + 8h*2 + 8h + 10. Let c = -6 + -1. Calculate z(c). 3 Suppose -5k + 4 + 1 = 0. Let y(n) = 3n + 9. Let v(z) = 1. Let g be 18/14 - 2/7. Let h(s) = gy(s) - 9v(s). Determine h(k). 3 Let w(f) be the second derivative of f*3/2 + 4f*2 - 20f. Calculate w(-7). -13 Let t = -15 + 19. Let k(n) = n*2 - 3n - 1. What is k(t)? 3 Let i(f) = -2f + 6. Let l(k) = -7k + 23. Let q(j) = 22i(j) - 6l(j). Calculate q(-6). 6 Let i(o) = -o3 + o + 1. Let p be (-2)/11 - (-756)/44. Let y = -15 + p. Determine i(y). -5 Let f(u) = u2 + 2u - 7. Let a be -7 - ((1 - -1) + 1). Let l be (a/(-4))/(2/(-4)). Calculate f(l). 8 Let j = 5 + -8. Let p = j - -8. Let d(f) = 1862f*2 - 1863f*2 + 3f + 3f. Give d(p). 5 Let p = 2 + -2. Suppose -1 = -z - pz. Let g(y) = -7y3 + y2 - 2y + 1. Determine g(z). -7 Let c be 0/((1 - -1) + 0). Suppose 4d = -c + 4. Let z(t) = -10t*2 - 2t + 1. Give z(d). -11 Suppose 0 = 3c + 3 - 12. Suppose cr + 4 = -g, 2r = -r + g + 4. Let z(y) = y3 - y2 + y + 1. Determine z(r). 1 Let c(r) be the third derivative of -r6/120 - r5/15 - r4/12 - r3/3 - 15r*2. Suppose 3g - 7 = 3b + 8, -4g + 12 = 0. Give c(b). -6 Let m(x) = x*3 - 4x*2 - 6x + 6. Let q be m(5). Let a(z) = z*3 + 1. What is a(q)? 2 Let f(b) = -b + 4. Let i = -17 + 24. Give f(i). -3 Let a(v) = 9v + 11. Let p(s) = 5s + 6. Let n(k) = -6a(k) + 11p(k). Suppose 2x - 2 = 7x + 4z, 3x + 12 = 3z. What is n(x)? -2 Suppose f + 3f - 4 = 0. Let r be 0/(3/f) + 1. Let z(x) be the first derivative of -3x*2 + x + 4. Give z(r). -5 Let x(g) = -g - 1. Let o(y) = 6y. Let a(z) = -o(z) - 8x(z). Give a(-7). -6 Let l(p) = 5p*2 + 8p + 2. Let r(o) = o*2 + 7o - 3. Let k(j) = j*2 + 4j - 1. Let z(v) = -7k(v) + 3r(v). Let d(n) = -5l(n) - 6z(n). Give d(3). -1 Let s(r) = -146r3 + 145r*3 + 0r - 3r + 2r*2 + 2r. Suppose -2x = -4x. Suppose -b + 3b - 4 = x. What is s(b)? -2 Suppose 15 = 3y, 3g - y - 34 = -9. Let v = 15 - g. Let c(n) be the first derivative of -n3/3 + 3n*2 - 6n - 2. Determine c(v). -1 Let r(w) = w3 - w2 - w. Suppose 4h - 5 = 3. Let y(k) = 6k*2 + 5k + 1. Let a(x) = hr(x) + y(x). Give a(-2). -5 Let s = 18 + -12. Let n(y) = -y + 3. Give n(s). -3 Let q = 22 - 12. Let z be (12/q)/(2/5). Let b(f) = f - 2 + f + z. What is b(-4)? -7 Let k(i) = i3 - 7i*2 + 5i + 6. Suppose x - 3 = 3. Let l be k(x). Let a(o) = -o*2 + 1. Let p(j) = -2j*2 - j + 5. Let v(q) = -3a(q) + p(q). Give v(l). 2 Let g(y) = y - 5. Let d(s) = -3s - 9. Let m(c) = 4c + 10. Let p(z) = 5d(z) + 4m(z). Suppose -41 = -5u - 11. Let h(o) = ug(o) - 7p(o). Determine h(4). 1 Let z(m) = -5m - 4. Let k(j) = 1. Let n(w) = -7. Let y(h) = 6k(h) + n(h). Suppose 2c + 0x + 18 = 2x, c - 3x = -17. Let o(t) = cy(t) + z(t). Give o(-1). 6 Let t(n) = -n2 - n - 3. Let x(l) = -l2 - 2l - 4. Let v(a) = 3t(a) - 4x(a). Give v(-6). 13 Let z(n) = -9n. Let y(w) = 2w3 + w2 - w - 1. Let t be (4/(-6))/((-2)/(-3)). Let d be y(t). What is z(d)? 9 Let m(z) = z2 - z. Let u(o) = -o3 - o2 + 3o - 3. Let d(i) = -6m(i) - u(i). What is d(3)? -6 Let o(l) = -14 + 0l - l - 3. Calculate o(-7). -10 Let w(n) = n*2 + 13n + 14. Let m be w(-12). Let q(x) = 3x2 + 6x + 2xm - 4x - 2x2. Determine q(-2). 8 Let a(u) = -3u. Let m be ((-2)/(-1) - 4) + 1. Determine a(m). 3 Let x be -5 - 2-1 - 152/(-19). Let f(c) = c3 - 6c*2 + 5c - 7. What is f(x)? -7 Suppose 2c - 5c = -12. Let b(i) = ci2 + i3 + 6i*3 - 3i*2. Determine b(1). 8 Let x(t) = 9t + 3. Let l(f) = -2 - f - f - 3f + f. Let w(u) = -u - 9. Let d be w(-4). Let v(c) = dl(c) - 3x(c). What is v(1)? -6 Let y(c) = -c - 4 + 2 - 3c + 0. What is y(2)? -10 Let t(p) = p3 + p2 - p + 1. Let g(d) = 3d3 + 5d*2 - 3d + 1. Let z(s) = -g(s) + 4t(s). Calculate z(0). 3 Let n(d) = -9d + 7. Let j(i) = -5i + 4. Let x(p) = 7j(p) - 4n(p). Let g(u) = -u. Suppose 0 = -3a - a + 4. Let f(o) = ax(o) - 6g(o). What is f(-1)? -7 Let d(k) = k + 1. Let f(n) = 2n + 4. Let o(j) = 5d(j) - f(j). Calculate o(-2). -5 Let q(o) = 39o2 - 1 - 34o2 + o3 + 2 - 2o3 + 2o. What is q(4)? 25 Let t(p) = -10p2 + 28p + 18. Let c(x) = -7x2 + 19x + 12. Let q(o) = -7c(o) + 5t(o). Give q(8). -2 Let r = 18 - 23. Let g(b) = -b*2 - 7b - 4. Give g(r). 6 Let q(g) = 7g - 10. Let h(a) = -4a + 5. Let n(m) = -5h(m) - 3q(m). Give n(5). 0 Let a(r) = -4 + 3r2 + r - 5r*2 + 3r2. Let d(b) = 4 + b2 + 2b - b - 8. Let n(x) = -5a(x) + 6d(x). Calculate n(-3). 2 Let p(z) = 4z - 4. Let t(s) = -3s + 4. Let w(o) = -5p(o) - 6t(o). Determine w(-3). 2 Let j(g) = -g3 - g2 + g. Let u(r) = -2r*3 - 6r*2 + 5r - 2. Let d(q) = 3j(q) - u(q). What is d(2)? 2 Let v(i) be the first derivative of i2/2 - i + 16. What is v(8)? 7 Let b(y) = -3y*3 + 19y*2 + 18y + 4. Let r(x) = 2x3 - 13x*2 - 12x - 3. Let u(m) = 5b(m) + 7r(m). Let q(j) = 3j + 5. Let c be q(0). What is u(c)? 4 Let a(x) = -x3 + 2x*2 + 4 - 7x*2 + 0x*2. Determine a(-4). -12 Let t be -6 - -4 - 32/(-12). Let q(k) be the second derivative of -1/12k*4 + 0 + 1/2k*2 - 2k + tk3. Give q(2). 5 Suppose 7c - 2c - 30 = 0. Let n(l) = l2 - 8l + 3. Determine n(c). -9 Let p be (20/(-2))/(1-2). Let c(v) be the first derivative of v3/3 - 5v*2/2 + 4v - 3. What is c(p)? 4 Suppose 2 = -a, 2z + 1 = a + 13. Let j(t) = -t2 + 6t - 4. What is j(z)? 1 Let b(d) = d + d*3 + 17d*2 - 5 + 0d*3 - 11d*2. Calculate b(-5). 15 Let o(f) = -6f2 - 2 + 6 + f3 + f*2 + f - 2. Suppose 23 = 4r + 7. Suppose -4h + 28 = -0v + rv, -4h = -5v - 10. Calculate o(h). 7 Suppose -3q = 2 - 11. Suppose -2l = 3r + 5, -qr - 11 = -l - 0l. Suppose -lo = -o. Let g(m) = -m - 6. What is g(o)? -6 Let u(i) = -i2 + 11i + 7. Let z(q) = -q*2 - 14q - 36. Let c be z(-8). Give u(c). -5 Let b = -25 - -31. Let w(t) = -t + 1. Determine w(b). -5 Let u(j) = -j*3 + 4j*2 + 3j + 3. Suppose -2n + 4 = 8. Let o(y) = -5y + y - 3 + 0*	{ "pile_set_name": "DM Mathematics" }
c) = 4c2. Let b be d(1). Let n(l) = 6l*2 + 4l - 4. Let a(y) = -5y2 - 3y + 3. Let w(z) = ba(z) + 3n(z). Let q(x) = 7x2. What is q(w(o))? 28o*4 Suppose 0 = 2g - 4g + 4. Let q(l) = -4l*g + 7l*2 - 2 + 2. Let d(o) = 2o - 4o + o. Calculate d(q(b)). -3b*2 Let s(n) = -n. Let g be 0/(3 + (-4)/1). Let a(o) = g + 0 - 9o*2. What is a(s(u))? -9u*2 Let x(d) = 3d*2. Let w(s) = -99s*2. Give x(w(b)). 29403b*4 Let a(w) = -2w. Let b(t) be the second derivative of 17t4/12 - 32t. Determine a(b(u)). -34u2 Let l(v) = -2v*2. Let b(c) = 403 - 2c - 403. What is b(l(s))? 4s2 Suppose 0f + 4u = -f + 6, 0 = 2f - 4u - 36. Let i(j) = -14j + fj + 3j*2. Let h(q) = 2q*2. What is i(h(g))? 12g*4 Let s(k) = 21k*2. Let l(d) = 64d + 2. Give s(l(c)). 86016c2 + 5376c + 84 Let c(r) = 6r2. Let u(n) = 6n*2 - 3n - 3. Let b(s) = 6s2 - 4s - 4. Let z(y) = 3b(y) - 4u(y). Calculate z(c(a)). -216a4 Let d = 8 + -6. Let z(k) = 6k2 - k2 - 2kd. Let h(i) = -6i*2 + 4i - 4. Let b(p) = 5p2 - 3p + 3. Let w(j) = 4b(j) + 3h(j). Give w(z(a)). 18a4 Let h(i) = -7049i*2 + 318. Let y(x) = -111x*2 + 5. Let o(f) = -5h(f) + 318y(f). Let l(u) = -u2. Determine o(l(z)). -53z*4 Let v(c) = -3c. Let u(r) = -2r2 - 3r*2 + 6r*2. Give v(u(s)). -3s*2 Let t(a) = -2a. Suppose 28k - 2 = 27k. Let f(h) be the second derivative of 0h3 + 1/4h*4 + 0 - h + 0h*k. Give t(f(c)). -6c2 Let k(d) be the third derivative of -d7/1260 + d*4/6 + 3d*2. Let h(o) be the second derivative of k(o). Let g(b) = -2b*2. What is h(g(y))? -8y*4 Let c(u) = -2u*2 - 56u + 56u. Let m(r) = 4r. Determine m(c(q)). -8q2 Let t(r) = -46r. Let i(s) = 27s. Determine t(i(h)). -1242h Let p(a) be the second derivative of 11a3/6 + 9a. Let r(g) = -g*2. Determine p(r(z)). -11z*2 Let c(d) = 413d. Let l(o) = 4o2. Determine l(c(s)). 682276s*2 Let b(d) be the first derivative of 0d*2 - 1/4d*4 + 0d*3 - 4 - 2d. Let g(n) be the first derivative of b(n). Let o(i) = i*2. Calculate o(g(q)). 9q*4 Let a(h) = -10h. Let n(k) = 748k. Give a(n(z)). -7480z Let x(w) be the third derivative of w4/6 - w2. Let r(y) be the third derivative of -2y2 + 0y*3 + 0 + 0y + 1/12y4. What is r(x(a))? 8a Suppose 3z + 4h = 39, 0 = -2z + 5h - 0h + 3. Let s(o) = -6 - 3o*2 - 3 + z. Let t(x) = 6x. Determine t(s(u)). -18u2 Let l(b) = -2b. Let y(c) be the second derivative of 7c3/3 + 32c. Calculate y(l(h)). -28h Let h(b) = -31b*2. Let x(f) = 9f*2. Calculate x(h(g)). 8649g*4 Let v(b) = 2. Let r(q) = -20q - 36. Let x(l) = 2r(l) + 36v(l). Let a(w) = 2w2. Determine x(a(n)). -80n2 Let w(u) = u - 1897. Let b(p) = p2. What is b(w(m))? m*2 - 3794m + 3598609 Let h(g) = 118g2. Let c(w) = -7w + 2w + 3w. Give h(c(t)). 472t2 Let p(c) = -109c. Let w(a) = 16a2. What is p(w(l))? -1744l*2 Let w(i) = 7i*2. Let j(a) = 4a*2 + 3a. Calculate w(j(y)). 112y4 + 168y*3 + 63y*2 Let g(a) = 2a. Let n(f) = -96f. What is n(g(h))? -192h Let c(w) = -2w2. Let z(p) = 4p*2 - 2p*2 + 15p*2. Give c(z(r)). -578r*4 Let c(j) = -3j + 5. Let i(l) = 2l - 3. Let n(t) = 6c(t) + 10i(t). Let k(r) = r - 1. Let z be k(4). Let s(d) = -zd + 0d + d. Calculate s(n(p)). -4p Let j(w) = 7w2 + 10w + 5. Let g(n) = -4n2 - 6n - 3. Let l(y) = -10g(y) - 6j(y). Let o(m) = m - 5m + 0m. Calculate l(o(a)). -32a2 Let y(l) = -4l + 5l + 5l - 3l. Let u(h) = -h2. What is y(u(f))? -3f*2 Let m(d) = 381d*2. Let u(k) = 3k*2. What is m(u(t))? 3429t*4 Let r(h) = 4h*2 - 2. Let d(q) = 35q*2. Give r(d(v)). 4900v*4 - 2 Let a(d) = 3 - 1 - 1. Suppose 7f + 4 = 3f. Let y(p) = -p + 3. Let z(r) = fy(r) + 3a(r). Let k(x) = -2x*2. Calculate z(k(q)). -2q*2 Let p(v) = -5v. Let z(o) = -3o - 10. Let j be z(-4). Let h(k) = -33 + jk*2 + 33. Give p(h(d)). -10d2 Let v(z) = z2 - 2. Let f(n) = n*2 - 1. Let k(b) = -2f(b) + v(b). Let t(i) be the third derivative of -i5/20 + i2. Give k(t(y)). -9y4 Let g(s) be the third derivative of -s5/30 + s2. Let o(t) = 0t + 0t - 21t*2 + 28t*2. Give g(o(i)). -98i*4 Let k(t) = t + 0 + 0 + 0. Let d(g) be the first derivative of 1/3g*3 + 0g - 1 + 0g2. Calculate d(k(s)). s2 Let c(b) = -15b*2 + 2b - 2. Let d(w) = -16w2 + 3w - 3. Let a(k) = 3c(k) - 2d(k). Let q(i) = i*2. Determine q(a(y)). 169y*4 Let h(d) = 4d. Let u(z) = -4z2 + 6z. What is h(u(n))? -16n2 + 24n Let w(z) be the second derivative of 0z3 + 0 + 1/4z*4 - 2z + 0z2. Let n(p) be the first derivative of -p2/2 + 3. Give w(n(d)). 3d*2 Let y(a) = -a. Let k(j) = 2j*2 + 28j*2 - 2j*2. Calculate y(k(p)). -28p*2 Let w(c) = 4c. Let n(l) be the first derivative of -l*3/3 + l + 3. Let i(t) be the first derivative of n(t). Determine i(w(m)). -8m Let t(z) = -21z2 + 27z - 27. Let j(q) = -3q2 + 4q - 4. Let v(u) = 27j(u) - 4t(u). Let s(g) = 2g. Calculate s(v(d)). 6d*2 Let v(i) = 6i. Let u(o) = 32o2. What is u(v(q))? 1152q2 Let m(y) = y2. Let f(p) = 25p2 - 9p + 9. Let r(z) = 12z2 - 4z + 4. Let g = -26 - -17. Let s(w) = gr(w) + 4f(w). Give s(m(d)). -8d4 Let l(j) = j3 + 3j*2 - 1. Let h be l(-2). Let w(i) = hi + 2i - 4i. Let o(y) be the second derivative of y*4/12 + 3y. Determine w(o(u)). u2 Let v(j) = -j2. Let w(l) = 11l - 48. Calculate v(w(u)). -121u*2 + 1056u - 2304 Let h(j) = -j*2 - 6j - 6. Let c be h(-4). Let l(q) = -q*2 - 2q + 2q + 2q*c. Let k(n) = 6n. Give l(k(y)). 36y2 Let j(z) = z2. Let i(o) = 1269o*2. Calculate i(j(y)). 1269y*4 Let j(q) = -2q*2. Let a(z) be the first derivative of 2z*2 + 2z*2 + 5 - 2 - 2z*2. Determine j(a(s)). -32s2 Let g(x) be the first derivative of x2/2 + 2. Let o(j) = -2j. Determine o(g(l)). -2l Let j(r) = 4r. Let t = 24 - 12. Let o(i) = -12 + i + t. What is o(j(a))? 4a Let i(v) = 11v - 7. Let m(b) = -7b*2. Determine m(i(t)). -847t*2 + 1078t - 343 Let n(f) be the third derivative of f5/10 - f2. Let v(d) = -2d2 + 12d - 12. Let r(y) = y*2 - 5y + 5. Let p(j) = -12r(j) - 5v(j). Calculate p(n(i)). -72i4 Let n(m) be the third derivative of -m4/12 + 2m*2. Let w(z) be the second derivative of -1/3z*3 + 2z + 0z2 + 0. Calculate n(w(p)). 4p Let q(m) = 15m2. Let n be 67/(-4) - 2/8. Let f(k) = -23k. Let r(t) = -8t. Let i(u) = nr(u) + 6f(u). Determine q(i(a)). 60a*2 Let q(b) = b. Let o = -12 + 12. Let j(m) be the third derivative of 0 - 1/12m*4 + 0m*3 + om - m*2. What is q(j(r))? -2r Let h = -23 - -23. Let v(g) be the third derivative of 0g3 + hg - 1/12g4 + 0 + 2g*2. Let y(w) = 2w. Determine v(y(x)). -4x Let z(u) be the first derivative of -5u*3 - 2. Let j(a) = 2a*2. Determine z(j(o)). -60o4 Let q(y) be the third derivative of y5/60 - 2y2. Let j(t) be the third derivative of 0t*3 + 1/20t*5 + 0t*4 - 3t*2 + 0t + 0. Give q(j(g)). 9g4 Let m(h) = -5h*2. Let w(k) = -2794k. Give m(w(z)). -39032180z2 Let w(i) = 43i. Let g(v) = -19v. Determine w(g(q)). -817q Let g(i) = 6i2 + 52. Let n(b) = -2b. Determine n(g(r)). -12r2 - 104 Let m(t) = -10t*2. Let f(b) = -3b*2 + 2b. Let a(q) = -4q2 + 3q. Let z(l) = -4a(l) + 6f(l). Determine z(m(k)). -200k4 Let x(z) = -3z - 344. Let d(t) = -2t. Give d(x(k)). 6k + 688 Let s be (-28)/(-8) + (-2)/(-4). Let z(t) = -5t2 + st2 - t2. Let y(u) = 4u2. Determine y(z(f)). 16f*4 Let t(n) = 4n. Let d = 59 - 11. Let g(s) = d + 2s - 48. Calculate g(t(l)). 8l Let w(t) = 0 + 0 - 2t2. Let y(r) = -4r*2. Let i(p) = -5p*2. Let s(h) = -6i(h) + 7y(h). Give w(s(o)). -8o4 Let i(l) = -l2. Let n(z) be the second derivative of z7/630 - z4/4 + z. Let p(w) be the third derivative of n(w). What is p(i(m))? 4m4 Let o(f) = -1. Let t(p) = 6p + 24. Let g(d) = -120o(d) - 5t(d). Let b(i) = 2i2. What is b(g(r))? 1800r*2 Let c(u) = 2u*2. Let v(m) = 447m*2. Give c(v(q)). 399618q*4 Let x(s) = 16s*2. Let z(m) = -2m. What is z(x(w))? -32w2 Let r(y) = 193y - 2. Let s(w) = -67w2. Give s(r(c)). -2495683c*2 + 51724c - 268 Let f(w) = 2w. Let u(h) be the second derivative of -h*4/6 - 4	{ "pile_set_name": "DM Mathematics" }
Let k = -127.99999085 - -128. What is k rounded to 6 decimal places? 0.000009 Let f(a) = a + 8. Let y be f(-6). Suppose 3r + r + 112 = yu, -2u = -2r - 112. Round u to the nearest 10. 60 Suppose -60832 = -5n + 174168. Round n to the nearest ten thousand. 50000 Let q = 0.12 + 0. Let b = -0.4 + 0.43. Let t = b + q. What is t rounded to one dp? 0.2 Let b = -1366 - 13934. What is b rounded to the nearest one thousand? -15000 Suppose -2 = -5q + 8. Suppose 0 = s - 6 + q. Suppose -st - 192 = 4c + 136, -4c = 3t + 324. What is c rounded to the nearest ten? -80 Let y = -43.127282 - -44.3274. Let k = 0.5 - -0.7. Let g = k - y. What is g rounded to five dps? -0.00012 Let r = 100 + -99.999937. Round r to five dps. 0.00006 Let k = -10 + 12. Suppose -8t + 3t = -3v - 45499994, kt = -4v + 18200008. What is t rounded to the nearest one million? 9000000 Suppose -5d = 1796507 + 1853493. What is d rounded to the nearest one hundred thousand? -700000 Let y = -12.0328 - -12. What is y rounded to three decimal places? -0.033 Let z = 6.925 + -2.812. Let i = -4.2 + z. Round i to 2 dps. -0.09 Let u = -28 - -50. Let f = 91 + u. What is f rounded to the nearest ten? 110 Let q = -2.52 + 1.9. Round q to one dp. -0.6 Suppose 0k - 232000 = -8k. Round k to the nearest ten thousand. 30000 Let a = -86 - -85.9892. What is a rounded to three dps? -0.011 Let d be 275941/4 + (-8)/32. Let o be (-2 - 13)/(1 + -2). Suppose -2u + o = u, -3t = 3u + d. What is t rounded to the nearest 10000? -20000 Let b(v) = -2080v - 20. Let d be b(6). Round d to the nearest ten thousand. -10000 Let z = -0.068 + 0.062. What is z rounded to two dps? -0.01 Let b = 164 + -165.134. Let o = -1.3 - -0.2. Let t = o - b. What is t rounded to 2 decimal places? 0.03 Suppose 11 = 4z - 1. Suppose -zc - c = 0. Suppose -2g = -v + 8, 5v - 4 = g - c. Round v to 1 dp. 0 Let u = -0.38 - -0.3. Let z = u - -0.106. Round z to 2 decimal places. 0.03 Let h = -11306 + -7694. Round h to the nearest 10000. -20000 Let j = 277 + -468. What is j rounded to the nearest ten? -190 Let k = -14754394 + 43149040. Let o = 19894646 - k. What is o rounded to the nearest 1000000? -9000000 Suppose -13800000 = -3b + 6b. Round b to the nearest one million. -5000000 Let q(l) = -106665l2 - 6l + 3. Let m be q(3). Round m to the nearest one hundred thousand. -1000000 Let q = -5 - -5. Suppose 4z + qz = -11600000. What is z rounded to the nearest one million? -3000000 Let s = -385 + 457.6. Let v = s - 65. What is v rounded to the nearest integer? 8 Let n = 11 + -10.872. What is n rounded to 2 dps? 0.13 Suppose 2f = 2t - 58, 3t + 2f = -0f + 72. What is t rounded to the nearest 10? 30 Let v(q) = -3335q - 5. Let p be v(-3). Round p to the nearest 10000. 10000 Let q = -88189.76101 + 88189. Let m = q - -0.76. What is m rounded to 4 decimal places? -0.001 Let a = 61819 + -61794.80183. Let u = a + -24.2. What is u rounded to four dps? -0.0018 Let f = -0.09 + 1.89. Let l = 1.7 - -0.072. Let q = l - f. What is q rounded to 2 dps? -0.03 Let k = 2 + 2. Suppose 0 = kx - 3 - 1. Let j(a) = 28a. Let s be j(x). Round s to the nearest 10. 30 Let t = -6.5128 + -1.4862. Let h = -8 - t. What is h rounded to 3 dps? -0.001 Let h = 21 + -20.99999972. Round h to 7 decimal places. 0.0000003 Let m = -512.05 - -531. Let w = 18 - m. Round w to one dp. -1 Let p = 7 + -3. Suppose -pa = 5j - 34, -4j - 10 = -3a - 31. Let q = j + -6. What is q rounded to seven dps? 0 Let p = -1.529 + 0.219. Round p to the nearest integer. -1 Let v = -104146 - -217146. Round v to the nearest 10000. 110000 Let n = 21.4 + 2.6. Let w = n + -24.0011. What is w rounded to 3 decimal places? -0.001 Let y = 163.00000688 + -163. What is y rounded to six dps? 0.000007 Suppose -234 = 3a - 5l + l, 0 = 5l. What is a rounded to the nearest 10? -80 Let g be (-3)/(-5) - (-10)/25. Let v be 2/(4/(-24)g). Round v to zero dps. -12 Let x = -92491 + 92492.40079. Let h = x - 1.4. Round h to four decimal places. 0.0008 Suppose j = -2j - 22500000. Round j to the nearest one million. -8000000 Let v = 19 - 49. Let n be (-62004)/10 - 12/v. Round n to the nearest one thousand. -6000 Suppose -5p + 421105 = -822290. Suppose 0 = i - 3v - p - 281330, 4i = 4v + 2120012. What is i rounded to the nearest 100000? 500000 Let m = -440 - -683. Let i = 246.673 - 5.043. Let j = m - i. What is j rounded to 1 decimal place? 1.4 Let s(v) = v. Let h be s(3). Let z be (8/12)/(8/60). Suppose -zf - 31 = -3t + 58, -4f = ht - 53. Round t to the nearest 10. 20 Suppose 53 + 7 = 3h. What is h rounded to the nearest ten? 20 Let l = -3.274 - -3.4211. Let w = 1.16 + -1.3. Let x = l + w. Round x to 3 dps. 0.007 Suppose 4a = 3j - 10499978, -3a = 3j - 2486582 - 8013424. Suppose f + j = 5m - 0f, 5f + 699990 = m. Round m to the nearest one million. 1000000 Let r be ((-2)/4)/((-1)/14). Suppose 5l + 10 = rd - 2d, -5l + 5 = 0. Suppose -du + u = 0. Round u to the nearest 100000. 0 Let n = 128.00000222 - 128. Round n to seven dps. 0.0000022 Let i be (2/(-2))/((-2)/4). Let j be i/6 - (-10283)/21. What is j rounded to the nearest 100? 500 Suppose u - 1180006 = -2k, -u = -4k + 791320 - 1971308. What is u rounded to the nearest 100000? 1200000 Let r = 0.33 - 0.52. Let j = -5 - -5.26. Let c = r - j. Round c to 1 decimal place. -0.5 Let b = 13 + -31. Let h = -17.99999964 - b. Round h to seven dps. 0.0000004 Let h = 3.9 - 4. Let q = h - -0.36. Let c = q + -0.25999911. What is c rounded to 7 decimal places? 0.0000009 Let z = -4.82 - -5. Let x = 0.17938 - z. Round x to four decimal places. -0.0006 Let u(g) = g*2 - 6g + 5. Let h be u(6). Suppose -11595 = -hl + l + x, 3l + x - 8705 = 0. Round l to the nearest one thousand. 3000 Let d = -549.958 - 0.042. Let n = d - -289. Let o = n - -260.999831. Round o to five decimal places. -0.00017 Let k = -0.3 + 0.451. What is k rounded to 2 dps? 0.15 Let p = -42.040983 + 44.04098319. Let a = p + -2. Round a to 7 decimal places. 0.0000002 Let q = -388 - -544. Let h = q - 144.9. Round h to 0 dps. 11 Suppose -23996 = -2q - y, 0q + 3q + 3y - 35988 = 0. Round q to the nearest 10000. 10000 Let v be (-200)/((-3)/(-2250)-3). Round v to the nearest 100000. 100000 Let u(g) = g3 - 4g*2 - g + 1. Let r be u(4). Let s be r/(9/(-6)) + -1. Let b(l) = -53l*3 + 2l*2 - l. Let t be b(s). What is t rounded to the nearest 10? -50 Let a = 115631 + 3004381. Suppose 6m + a = 3m - 4q, 0 = -4q - 12. Round m to the nearest 100000. -1000000 Let f(z) = z3 - 5z*2 + 2z + 4. Let x be f(3). Let g(d) = d*2 + 7d - 3. Let u be g(x). Suppose 2c - q - 19999 = c, u = 5q. Round c to the nearest 10000. 20000 Let m = -501 - -583.6. Let x = m + -98. What is x rounded to 0 decimal places? -15 Let s = -21 - -21.036. Let c = -0.03554 + s. What is c rounded to 4 dps? 0.0005 Let t = -6.9475 + -0.0825. Let y = t - -7. Let w = -0.03055 - y. Round w to 4 dps. -0.0006 Let v = 150750 - 150750.400002. Let f = 0.06 + -0.46. Let u = f - v. What is u rounded to 5 decimal places? 0 Let p = 56119 + -15119. What is p rounded to the nearest 10000? 40000 Let l = 215 - 214.9652. Round l to three dps. 0.035 Let q = -0.9 + -5.1. Let p = q + 5.8. What is p rounded to two decimal places? -0.2 Let l = -170 - -100. Let a = -17368.72246 - -17438.7224719. Let n = a + l. What is n rounded to six decimal places? 0.000012 Let g = 78176.853 + -118.853. Let m = g - 78014.097. Let r = m + -44. Round r to 2 dps. -0.1 Let w = 6 + -2. Let o(i) = i + 4. Let f be o(-4). Suppose f = wj + 139 + 1261. Round j to the nearest 100. -400 Let b be (-2)/(-12) - (-11099995)/30. What is b rounded to the nearest 100000? 400000 Let i = -29.5 - 44.3. Let k = i + 56. Round k to 0 decimal places. -18 Let p = -111.0239 - -111. What is p rounded to 3 decimal places? -0.024 Let d(n) = 101n*2 - 7n + 6. Let t be d(6). What is t rounded to the nearest 1000? 4000 Let a(w) = w*3 - 6w*2 - 7w + 15. Let x be 0 + 12 - (-2 - -2). Let y be a(x). Let o = y - -785. What is o rounded to the nearest one hundred? 1600 Let c(d) = 7d2 + d + 6. Let w be c(5). Let x = w + -10. Suppose -i - 2924 = x. Round i to the nearest 1000. -3000 Suppose 4 = -2i + 3i. Suppose -5m + 2q = q - 11990, -2q = m - 2398. Suppose -iw = -3d - 7196, 3d = 2	{ "pile_set_name": "DM Mathematics" }
t is -1 + 54? 53 In base 10, what is -17 - -215? 198 In base 5, what is -12 - 412? -424 In base 5, what is -1444 + 4? -1440 In base 11, what is -62 + -6? -68 In base 8, what is 453 - 24? 427 In base 2, what is -111101010 - -1100? -111011110 In base 4, what is -2 - -32011? 32003 In base 10, what is 115 + -2? 113 In base 12, what is -44 + 51? 9 In base 14, what is 6a + 14? 80 In base 4, what is -3 + -22030? -22033 In base 14, what is 11 - 132? -121 In base 8, what is -347 - 11? -360 In base 14, what is 5 + b6? bb In base 4, what is 0 - 30222? -30222 In base 6, what is -24 + -130? -154 In base 7, what is 2 - -100? 102 In base 16, what is -4 - -15e? 15a In base 6, what is -4 - -10300? 10252 In base 3, what is 2 - -10? 12 In base 13, what is -ba - -a? -b0 In base 6, what is -1432 + 1? -1431 In base 6, what is 1 - -15335? 15340 In base 6, what is 0 - 54? -54 In base 4, what is 203 + -32? 111 In base 4, what is 332 - -1? 333 In base 4, what is 11 + 10222? 10233 In base 16, what is 3 + 224? 227 In base 2, what is 10011001101 + 1000? 10011010101 In base 9, what is 4 + -72? -67 In base 15, what is 0 + -6e? -6e In base 11, what is -16611 + 3? -16609 In base 3, what is 2 + -10102? -10100 In base 9, what is 2 - 5583? -5581 In base 12, what is -1 + -77? -78 In base 5, what is 1 + -332? -331 In base 6, what is 115250 + 4? 115254 In base 3, what is -11 - -121? 110 In base 6, what is -4 + -31124? -31132 In base 12, what is 2 - -1895? 1897 In base 9, what is -405 + 30? -365 In base 11, what is 8 - 17? -a In base 11, what is 7 - -120? 127 In base 3, what is 21000 + 11? 21011 In base 9, what is -73 - -22? -51 In base 16, what is -3 - -b2e? b2b In base 5, what is -1042 - -110? -432 In base 14, what is -caa + 4? -ca6 In base 10, what is -140 - 3? -143 In base 10, what is -1 + -796? -797 In base 10, what is 2 - -4600? 4602 In base 13, what is -4 - -3c? 38 In base 11, what is 3a + 41? 80 In base 4, what is 10 - -110? 120 In base 10, what is 176 - 18? 158 In base 11, what is -66 - 1? -67 In base 7, what is -3 + -1641? -1644 In base 12, what is 5 - 26? -21 In base 15, what is -e - 8? -17 In base 11, what is 11 - 122? -111 In base 16, what is -224 - 5? -229 In base 14, what is 98a + 3? 98d In base 8, what is -62330 - 0? -62330 In base 16, what is 459 - 2? 457 In base 12, what is 4 - -61a? 622 In base 2, what is 11001100 - 11? 11001001 In base 13, what is 0 - 50c? -50c In base 3, what is -2101 + -200? -10001 In base 7, what is -155 - 10? -165 In base 16, what is 73e - 1? 73d In base 12, what is -94 - 1? -95 In base 7, what is -15 - -545? 530 In base 7, what is 1416 - 2? 1414 In base 15, what is 2 - 7d? -7b In base 6, what is 23454 + 2? 23500 In base 10, what is -3 - -34? 31 In base 2, what is 11110 + -101? 11001 In base 15, what is 9c9 + -3? 9c6 In base 13, what is 31 - 241? -210 In base 5, what is 0 + -13014? -13014 In base 12, what is 5 - a03? -9ba In base 10, what is -66 - 14? -80 In base 2, what is 100 + 10000000? 10000100 In base 8, what is 344 + -5? 337 In base 3, what is 1001 - -10110? 11111 In base 13, what is 13 - -1? 14 In base 9, what is 103 - -5? 108 In base 8, what is 41 + -31? 10 In base 11, what is -25 - -a? -16 In base 5, what is -30223 + -1? -30224 In base 13, what is 14 - -3? 17 In base 4, what is 233131 + 2? 233133 In base 13, what is -1 - -c3? c2 In base 11, what is 6234 + -3? 6231 In base 4, what is 120 + -10? 110 In base 11, what is -3 - -5? 2 In base 9, what is -7 - 306? -314 In base 6, what is 0 + 42? 42 In base 10, what is 289 - 5? 284 In base 12, what is 195 - 2? 193 In base 5, what is -1 - 121? -122 In base 12, what is b + 9? 18 In base 9, what is 15428 - 0? 15428 In base 13, what is 31 - -5? 36 In base 15, what is -9 + 12? 8 In base 9, what is 3 + 773? 776 In base 2, what is 100 + 101010? 101110 In base 12, what is 2 + 254? 256 In base 4, what is 31220 + 3? 31223 In base 11, what is 1a2 - -2? 1a4 In base 6, what is -51 - 1522? -2013 In base 6, what is -2001 + -2? -2003 In base 5, what is -1 - -1031? 1030 In base 12, what is -13b + -28? -167 In base 2, what is 0 + 110001? 110001 In base 16, what is 0 - 11? -11 In base 6, what is 2 - -252? 254 In base 4, what is -23 - -1313? 1230 In base 14, what is 2 - -2c? 30 In base 5, what is -11110 - 0? -11110 In base 11, what is -443 + 0? -443 In base 10, what is 5 + 713? 718 In base 16, what is 3be + -2? 3bc In base 9, what is 64 - -5? 70 In base 9, what is 5 - -12? 17 In base 10, what is -498 - -3? -495 In base 6, what is -5 - -2045? 2040 In base 6, what is 2301 - 1? 2300 In base 4, what is 1302 + 2? 1310 In base 11, what is 12 + -2a? -18 In base 5, what is -114 + -3402? -4021 In base 16, what is -33 - 2? -35 In base 4, what is -1321 + 122? -1133 In base 11, what is -20 - -4? -17 In base 16, what is 9 + 76? 7f In base 4, what is -20 + -2020? -2100 In base 14, what is -15a + -3? -15d In base 4, what is 1211313 - 1? 1211312 In base 15, what is -b1 - 33? -e4 In base 8, what is 46 - -5? 53 In base 4, what is 1012 - -11? 1023 In base 8, what is -5 + -100? -105 In base 14, what is 5 + 1a? 21 In base 11, what is 6 + -1880? -1875 In base 4, what is -20030 - -12? -20012 In base 13, what is 2 - 86? -84 In base 11, what is 212 + 1? 213 In base 11, what is -206 + 49? -168 In base 7, what is -4156 + -3? -4162 In base 4, what is 2 + -102? -100 In base 15, what is 3444 + 5? 3449 In base 3, what is -20 - -101? 11 In base 14, what is 5 + -61? -5a In base 14, what is -9 + -2? -b In base 11, what is -3 - 602? -605 In base 3, what is 110102211 - -11? 110102222 In base 9, what is 70 - -172? 252 In base 13, what is 4 + -300b? -3007 In base 4, what is -2113321 - -1? -2113320 In base 10, what is 149 - 4? 145 In base 10, what is 191 - -1? 192 In base 5, what is 1410 + 21? 1431 In base 16, what is 230 + -5? 22b In base 15, what is 11 + -5? b In base 7, what is 122 + 201? 323 In base 11, what is 18 - -6? 23 In base 2, what is -110101111 + 11? -110101100 In base 9, what is 31 + -36? -5 In base 14, what is 0 + 3a? 3a In base 2, what is -101 - 101010? -101111 In base 2, what is 10000 + -101001? -11001 In base 6, what is -1 + 420? 415 In base 9, what is 1034 + 1? 1035 In base 11, what is -12 + -42? -54 In base 9, what is 355 + 3? 358 In base 7, what is -24 + 46? 22 In base 2, what is -100111 - 100? -101011 In base 5, what is 13 - 2424? -2411 In base 4, what is 11 - 3102? -3031 In base 14, what is 4 - a3? -9d In base 5, what is -33 + -2? -40 In base 6, what is 20 - -2052? 2112 In base 6, what is -32 + -312? -344 In base 13, what is -10b + 4? -107 In base 2, what is 10100000 + 101? 10100101 In base 6, what is 23 - -103? 130 In base 5, what is -13 - -144? 131 In base 3, what is 2 + 10121? 10200 In base 9, what is 347 - 2? 345 In base 10, what is 5 + 127? 132 In base 15, what is -326 + 5? -321 In base 3, what is -210111102 + 0? -210111102 In base 11, what is 2 - -5860? 5862 In base 7, what is -212 + -21? -233 In base 11, what is 51 - 12? 3a In base 8, what is -5 - 626? -633 In base 2, what is 1000111 + 10? 1001001 In base 16, what is 32 + 5? 37 In base 14, what is 4 - -8? c In base 14, what is -61 + 1b? -44 In base 9, what is 2 - 1560? -1557 In base 5, what is 10010 + -10? 10000 In base 16, what is -2 - 82? -84 In base 8, what is -4 + 42? 36 In base 10, what is 3571 - -2? 3573 In base 9, what is -104 - 41? -145 In base 12, what is 168 + -2? 166 In base 7, what is 4 + 545? 552 In base 10, what is 1 - -1746? 1747 In base 7, what is 33 + -11? 22 In base 8, what is -337 - -1? -336 In base 9, what is 22 + 244? 266 In base 16, what is 0 + 63? 63 In base 10, what is -23 - 15? -38 In base 13, what is 97 - -3? 9a In base 6, what is -12 + 44? 32 In base 5, what is -4 - 2233? -2242 In base 14, what is 3 - 184? -181 In base 16, what is 86 + 2b? b1 In base 8, what is -32 - 60? -112 In base 8, what is 0 + -1220? -1220 In base 2, what is -11100 - -101? -10111 In base 10, what is -406 - 2? -408 In base 3, what is 11 - 100? -12 In base 10, what is -8 - 28? -36 In base 11, what is 4a - 5a? -10 In base 16, what is -2 + -b5? -b7 In base 10, what is 7 + 79? 86 In base 10, what is 8408 - 3? 8405 In base 14, what is 54 + -33? 21 In base 6, what is -4 - 25? -33 In base 9, what is -3 - -1685? 1682 In base 16, what is 0 + -40? -40 In base 9, what is -2 - 170?	{ "pile_set_name": "DM Mathematics" }
+ 43 = 0. Let u be s(x). Let k(l) = -l*2 - 4l + 5. Give k(u). -7 Let r(o) = -o*3 + 5. Suppose 0 = -n - 19 + 8. Let x = n + 2. Let d = x - -9. Determine r(d). 5 Let m(f) be the second derivative of 0 + 1/20f*5 - 1/4f*4 - 6f - 1/2f3 + 2f2. Give m(3). -5 Let l(u) be the first derivative of u3/3 + 7u2/2 + 6u + 5. Let m be l(-5). Let x(c) be the first derivative of 2c2 + 5c + 31. Determine x(m). -11 Let r(c) = -c*3 - 8c*2 + 5c - 10. Let j be -5 - (24/12)/(3/6). Give r(j). 26 Let n(f) = -343 - 2f + 123 + 103 + 120 + f2 - 6f*3. Determine n(1). -4 Suppose -9a - 10 = -11a. Suppose -3j = au - 45, 0 = u - 3u - 2j + 14. Suppose 2n + 4n - u = 0. Let k(m) = 2m - 1. Determine k(n). 3 Let j = -1700 + 1710. Let h(m) = m*2 - 7m - 28. Calculate h(j). 2 Let p(k) = -6k + 3. Let m(u) = -1. Let g(t) = 3m(t) + p(t). Suppose 0 = -4n - 2a - 14, -n - 17 = 5a + 9. Give g(n). 6 Let b be (1 + -21)/(2 + -4). Let j(f) = -f2 + 8f + 9. Determine j(b). -11 Suppose 11d - 14 = 9d. Let l(k) = -2 - 3k - 4k + 0 + k*2 - 7. Give l(d). -9 Let c(p) = 19p + 725. Let f be c(-38). Let t(i) = 9i2 - 2i - 2. Determine t(f). 73 Let w(c) = -3c + 4. Let m be 16/((-4)/(-2 + 6)). Let g = -12 - m. Determine w(g). -8 Let q be (-6)/8 + 11/4. Suppose qm - 32 = 3m - 5j, -5j = m - 8. Let v = m - -11. Let h(a) = 3a + 1. Determine h(v). -2 Let s(w) = w + 2. Let o(a) = -a*3 - 9a*2 - 2a - 13. Let l(c) = -c*3 + 8c*2 - 6c - 4. Let u be l(7). Let k be 3(-1)/1u. Let p be o(k). Give s(p). 7 Let d(h) = h*3 + 4h*2 + 2h + 6. Let k(m) = m - 3. Let f be k(-1). Calculate d(f). -2 Let t(g) = -g - 2. Let l be (0 - 0) + (-2 - -29). Suppose -l = 10z + 13. Calculate t(z). 2 Let f(n) be the third derivative of -7n4/24 + n3/6 - 24n2. Calculate f(-1). 8 Let k = 49 - 38. Let m(o) = o3 - 10o*2 - 12o + 6. Determine m(k). -5 Let f(x) = -11 + 6x - 2x - x - 4x. Calculate f(-15). 4 Suppose j - n + 3 = -j, 2n - 2 = 0. Let s(o) = o*2 + 25o - 6. Let l be s(-25). Let k(u) = -2u + 1. Let t(d) = -d + 1. Let q(b) = lk(b) + 5t(b). Give q(j). -8 Let o(j) = 191j - 376. Let b be o(2). Let m(w) = 2w - 7. Calculate m(b). 5 Let m(g) = -g3 + 2g*2 + 3. Suppose 3c + 2s + 4 = -0c, -2c + s - 12 = 0. Let v = c - -7. What is m(v)? -6 Let j(z) be the third derivative of -z6/120 + 3z*5/20 + 7z*3/6 + 4z2 - 10. Determine j(9). 7 Let r(d) = d2. Let k be r(2). Let t(v) = v*2 - 6. Let g be t(3). Let q(f) = -4f*2 + 0 + 4f - 2f + f3 - 3f + g. Determine q(k). -1 Let k(x) = -x + 15. Let g(z) = -z3 - z2 + z + 11. Let c be g(0). Determine k(c). 4 Let y = 8 + -4. Let g be y(-1)/4-2. Let l(s) = 7s3 + 3s*2 - 5s - 5. Let n(t) = -3t3 - t2 + 2t + 2. Let v(x) = -4l(x) - 10n(x). Calculate v(g). 8 Suppose -5o = -2t - 15, 13o - 12o = 3t - 10. Let z(n) be the second derivative of n5/20 - 5n4/12 + n3/3 - n*2/2 - 2n. Calculate z(o). 9 Suppose -21s + 3 = -102. Let q(n) be the second derivative of 0 + 4n + 1/2n4 - 1/2n*3 - 1/20n*s - 2n2. Determine q(5). 6 Let c(y) = -y3 + 5y2 + 6y + 7. Let r(k) be the third derivative of k6/120 - k5/30 + k4/12 + k3/3 - 39k2. Let j be r(2). Determine c(j). 7 Let d(c) = -c - 9. Let q be d(-7). Let w be 8/24 + q/6. Let y(b) = b + wb + 8 + 0b. What is y(-5)? 3 Let w(n) = -5 - 111n*2 + 223n*2 - 9n - 113n2. Calculate w(-7). 9 Let o(n) = 10n - n*2 - 29n + 13n + 7n + 4. Give o(-4). -16 Let p(r) = -22r2 + 52r*2 - 5 + 2 + 4r - 17r2 - 19r*2. Determine p(1). -5 Suppose -2g + v + 3v + 28 = 0, -2g - 5v + 19 = 0. Let p(x) be the first derivative of x3/3 - 11x*2/2 - 11x - 2. Determine p(g). 1 Suppose -4a + 17 = m, 0 = 2m - 3a + 8a - 22. Let g(r) = 4r - 1. Give g(m). 3 Let p(d) be the third derivative of d5/60 - 7d*3/6 + 33d*2. Give p(3). 2 Suppose -2j - 2 = -3i - j, -8 = 4i + 4j. Suppose -2b + 0b + 6 = i. Let g(c) = 0 - 2 + 4 - c + 4c - c*2 - 3. What is g(b)? -1 Let h = -25 - -30. Suppose 24 = hu - u. Let s(d) = 5d - 2d*3 + 5d*3 + 7 - 7d*2 - 2d*3. Calculate s(u). 1 Suppose 0 = 7j - 3j. Let h(y) be the third derivative of y4/24 + 4y3/3 + y2 - 9. What is h(j)? 8 Let o(h) = -9h + 6. Let y(p) = -5p + 3. Suppose -3q + 2 - 35 = 0. Let x(s) = qy(s) + 6o(s). Let i(w) = w2 + 6w + 5. Let u be i(-5). What is x(u)? 3 Suppose 39m - 6m - 66 = 0. Let t(u) = 3u3 - 3u*2 + 3u - 4. Calculate t(m). 14 Let f(c) = -6c3 - c + 1. Let i be (12/16)/((-15)/(-20)). What is f(i)? -6 Let a(b) be the first derivative of -b3/3 - 8b*2 - 9b + 1. Let l be a(-8). Let w be 210/l + (-4)/(-22). Let g(s) = s*3 - 3s*2 - 5s + 1. What is g(w)? -3 Let h(r) = 2r + 2. Suppose 4n = n + 6. Calculate h(n). 6 Let c(x) = -20x2 - x + 1. Let b(s) = 3s + 13. Let q be b(-4). Let z be 2 + q + -4 + 2. Calculate c(z). -20 Let h(z) = -294 + 144 + 3z + 152. Let w be (-6)/(-2 + 2 + -1). Suppose -3f - 2v = -8, v - 5v + w = f. Determine h(f). 8 Let o(d) = d*2 - 7d - 8. Suppose -2p - 6 = m - 0, 4m - 2p - 16 = 0. Let i(a) = 2a*2 - 4a + 7. Let g be i(m). Calculate o(g). -8 Let h be (-3 + (-7)/1)/2. Let u = 7 + h. Let j(v) = 2v2 - 2v + 3. What is j(u)? 7 Let o(j) be the third derivative of j4/6 - j3/2 - 19j2. Determine o(2). 5 Suppose 7o - o + 36 = 0. Let a(i) = -13i - 29. Let w(d) = -3d - 7. Let y(x) = -2a(x) + 9w(x). Give y(o). 1 Let k(i) be the second derivative of 2i3/3 - i2/2 + 56i. Determine k(-6). -25 Let h(j) = -12j - 1. Let m(q) = q2 + 3q - 2. Let f be m(-4). Let y be (6/(-12))/(f/(-4)). Calculate h(y). -13 Let s be 17/3 + 1/3. Let c(i) = 2i2 - 7i + 3. Let j be c(s). Let k(g) = g*2 + 2g + 26 + g - 2g - j. What is k(0)? -7 Let c(u) be the first derivative of -1/4u*4 + 11 + 2u*3 + 5u - 7/2u2. Suppose 2k = -0k + 10. Calculate c(k). -5 Suppose -37m + 43m - 54 = 0. Let i(f) = f3 - 11f*2 + 12f + 13. Determine i(m). -41 Let w be 1/(1 - (-10)/(-8)). Let i = 52 + -50. Let q(j) = ij2 - 2 - 2 - j2 - 647j + 649j. What is q(w)? 4 Let j(y) = -y3 - 5y*2 - 6y + 2. Suppose 37n + 233 = 48. Determine j(n). 32 Suppose -2f + 35 = 5f. Let r(j) = -fj + 21j2 + 5 - 20j*2 + 6j. Suppose 6 = 3z - 3y, 2z - y - 10 = 4y. Give r(z). 5 Let a(r) = r*3 - 10r2 + r + 1. Let w(d) = d3 - 15d2 - 17d + 16. Let v be w(16). Suppose v = 2k - 1 - 19. Determine a(k). 11 Let v(g) be the second derivative of g3/3 - 7g*2/2 - 537g. Give v(8). 9 Let t(k) = 15k3 - 354k + 4 + 348k - 2k*2 - 14k*3 + 0k2 - k2. Calculate t(4). -4 Let u(o) = -o*3 - 4o*2 + 3o + 4. Let g(b) = b*2 - 4b - 25. Let z = 103 - 106. Let x be g(z). What is u(x)? -8 Let b be (-4 - (-3 + 4))(-6)/(-30). Let d(a) = 14a + 7. Calculate d(b). -7 Let r(z) = -z*2 + 9z - 9. Let n be 65/(-25) - (-3 - 36/(-15)). Let s be (2/4)/(n - 29/(-14)). Determine r(s). 5 Let x(n) = n*2 - 8n + 15. Let r be x(5). Let m(k) = k3 + k - 2. Let g be m(r). Let w(o) = o2 + 3o + 2. Calculate w(g). 0 Let t(g) = -g3 + 3g*2 + 6g + 7. Let h = -7 - -9. Let m be 5 + h + -3 + 0. Suppose -m - 6 = -2k. What is t(k)? -13 Let m(x) = -x - 8. Suppose 0s - 5s + 95 = 0. Let w(p) = p2 + 19p + 37. Let v be w(-17). Suppose -4l = -t + 38 - 16, vl = 2t - s. Give m(l). -3 Let j(o) = -o - 1. Let v(r) = -2r - 1. Let n(z) = 5j(z) - v(z). Calculate n(3). -13 Let v = 4 + -2. Let n be (5/(-2))/(2/(-4)). Let c(m) = -2m + 1. Let a(i) = -2i + 1. Let d(b) = nc(b) - 6a(b). Determine d(v). 3 Let o(n) be the first derivative of 6 - 1/2n*2 + 8n. What is o(5)? 3 Let o(r) = r*2 + 7r + 4. Let q be 68/(-12) - (-9)/(-27). Give o(q). -2 Let f(c) = c - 6. Let w(h) = 5h - 23. Let d be w(7). Let v = -2 + 4. Suppose -2g + 14 = 3n, 2n + 2g = -vg + d. Give f(n). -2 Suppose -2n = 4 + 2. Let r(v) be the third derivative of v7/2520 - v6/360 + 7v*5/60 - 8v*2. Let w(q) be the third derivative of r(q). Determine w(n). -8 Let x(g) = -7g*3 - 3g - 4. Let r be x(-1). Suppose 0 = -23d + rd + 102. Let b(w) = 2w - 8. What is b(d)? 4 Let x(j) = -11 + 10j + 8 - 7j + 7j*2 + 2j2. Determine x(2). 39 Let l(q) be the second derivative of -q6/360 + q*5/60 + 8q*4/3 + 25q. Let n(v) be the third derivative of l	{ "pile_set_name": "DM Mathematics" }
4l2. Determine q(f(p)). -144p*2 Let c(t) = 80t*2. Let b(d) = 1360d. Calculate b(c(p)). 108800p2 Let s = 14 - -8. Let d(o) = -so + 8o + 12o. Let b(z) = -17z2. What is b(d(p))? -68p*2 Let b(p) = -p - p - 2p + p. Suppose -3z = -2z. Let g(l) = -l - l + l + z. Calculate g(b(x)). 3x Let d(x) = 13x. Let u(f) = -2 + 3f + 1 + 3 - 5. Let b(g) = g2 - 7g + 7. Let z(i) = -3b(i) - 7u(i). Determine d(z(p)). -39p2 Let r(y) = -2y*2. Let b(l) be the third derivative of 3l4/4 + l3/2 + 4l2 - 7. Determine r(b(v)). -648v*2 - 216v - 18 Let a(f) be the third derivative of -f8/1260 + f5/20 - 10f2. Let s(v) be the third derivative of a(v). Let p(o) = -o2. What is p(s(d))? -256d*4 Let g(d) = -309d*2. Let s(v) = 848v + 1. What is s(g(m))? -262032m2 + 1 Let j(w) be the third derivative of 2w*5/5 + 18w*2. Let r(u) = -2u + 2u + 3u*2 - 2u*2. What is r(j(f))? 576f*4 Let x(g) = 3g*2 + 19. Let w(i) = 2679i. What is x(w(z))? 21531123z2 + 19 Let s(u) = 7 - 7 + 3u*2. Let m(o) be the third derivative of 0 + 6o*2 + 0o*3 + 1/30o*5 + 0o*4 + 0o. Determine m(s(h)). 18h4 Let a(z) = -33z - 34z - 36z + 103z + 84z*2. Let c(p) = 3p. Determine c(a(q)). 252q2 Let m be (-2 - -7)(-2)/(-5). Let x be (-1)/m(-3 - 1). Let n(v) = -2 + 2 + 3v*2 - 4v*x. Let h(g) = 14g. Determine h(n(b)). -14b2 Let x(q) be the third derivative of -q5/15 + 89q*2. Let d(s) = -4s*2. Calculate d(x(o)). -64o*4 Let n(u) = 59u. Let c be 2/(-2 - 40/(-15)). Let b(r) = 2r2 - 3r + 3. Let h(k) = -2k2 + 2k - 2. Let p(l) = ch(l) + 2b(l). Determine p(n(w)). -6962w2 Let d(l) = -2l - 5l + 9l. Let n(s) be the first derivative of 3s3 - 17. Calculate d(n(k)). 18k*2 Let i(s) be the third derivative of 0 - 9s*2 + 0s + 1/12s4 + 0s*3. Let x(a) = -a - 5. Let o(f) = 1. Let n(g) = -5o(g) - x(g). Determine n(i(j)). 2j Let i(k) = -11k - 8k + 18k. Let q(j) = -49j2 + 2. Determine q(i(n)). -49n*2 + 2 Let d(t) = 3t. Let n be (-2)/6-320. Let u(y) = 2 - 2 + ny - 13y. Let o(h) = -13d(h) + 6u(h). Let m(a) = 2a2. Determine m(o(i)). 18i*2 Let l(q) = 2q + 4q - 4q - q. Let b = -16 + 38. Let i(y) = -7y2 - by + 22y. What is l(i(h))? -7h*2 Let c(t) = -2t*2. Let l(b) = 636028b*2. Give c(l(r)). -809063233568r4 Let j(s) be the first derivative of s2/2 + 766. Let p(c) = c - 1. Let q(n) = -6n + 1. Let z(h) = 2p(h) + 2q(h). What is j(z(f))? -10f Let h(o) = -11o. Let b(m) = -8m*2 + 5m*2 - 5m*2 + 4m*2. Determine b(h(c)). -484c2 Let o(h) be the third derivative of -h5/60 - 126h2. Let d(k) = 78k*2. Calculate o(d(u)). -6084u*4 Let u(m) = 11m*2 - 7m - 100. Let d(h) = 3h2 - 2h - 33. Let a(n) = 7d(n) - 2u(n). Let y(o) = 7o. Determine y(a(r)). -7r*2 - 217 Let q(d) = -9d*2. Suppose 4w - 2 = 2h, -4w + 3h = 5h - 14. Let a(k) = -8k2 + 6k*w + 5k*2. Determine a(q(l)). 243l*4 Let o(j) = -875j. Let g(y) = -y*2 - 148y + 148y + 0y*2. Determine g(o(c)). -765625c*2 Let p(o) = -2o*2. Let y(r) = 18097r*2. Calculate p(y(w)). -655002818w*4 Let f(d) = 7906d*2. Let q(m) = 10m + 1. Determine q(f(n)). 79060n2 + 1 Let u(c) be the second derivative of c4/6 + 2c. Let q be 19 - 1/(-2)0. Let b(o) = 19 - 2o2 - q + o2. Determine b(u(d)). -4d4 Let z be 1/((16/(-20))/(-4)). Let c(l) = zl - 5 - 7 + 12. Let s(v) = 4v2. What is s(c(p))? 100p*2 Let f(c) = c + 20330. Let l(z) = 5z. Give f(l(r)). 5r + 20330 Let d(f) = f + 1. Let u(b) = 4b - 4. Let i(g) = 4d(g) + u(g). Let l(n) = 6n*2. Calculate i(l(t)). 48t*2 Let b(l) = -5l*2 - 24l - 8. Let i(x) = -9x2 - 42x - 14. Let q(a) = -7b(a) + 4i(a). Let p(z) = 207z. Calculate q(p(r)). -42849r*2 Suppose -4 = -6b + 4b. Let a(x) = 10x*b - 633x + 1269x - 636x. Let m(v) = 7v. Let i(h) = -3h. Let k(y) = -9i(y) - 4m(y). Determine k(a(t)). -10t2 Let r(z) = -3z2 + z2 - z*2. Let l(o) = 14o*2 - 27o*2 + 11o*2. Calculate l(r(t)). -18t4 Let w(i) be the second derivative of i4/24 + 5i2/2 - 3i. Let f(n) be the first derivative of w(n). Let u(h) = -2h + h + 2h. Determine u(f(t)). t Let y(c) = -c - 3. Let m be y(-6). Suppose 0 = -4g - m + 11. Let d(v) = -6v*2 + 3v*2 - 3v*2 + 5v*g. Let n(p) = -5p. Calculate d(n(b)). -25b2 Let x(r) = -2r2. Let p(m) = m2 - 12732m + 2. What is p(x(y))? 4y*4 + 25464y*2 + 2 Let a(l) = 2l*2. Let w(o) = 2o*2 + 4o2 + o2 + 5o. Let h(x) = -55x - 70x2 + 1 - 1 + 6x. Let n(p) = 5h(p) + 49w(p). Calculate n(a(f)). -28f4 Let p(j) = -7j*2. Let l(m) be the third derivative of 7m*4/8 + 5m*3/2 - 4m*2. Let c(z) = 3z + 2. Let o(f) = 15c(f) - 2l(f). Calculate p(o(h)). -63h2 Let a(r) be the first derivative of -11/3r*3 + 19 + 0r*2 + r. Let n(k) = -k. Calculate n(a(t)). 11t*2 - 1 Let m(w) = 2w. Let o(h) be the first derivative of h*2/2 + 71h + 34. What is m(o(z))? 2z + 142 Let n(j) = 1114j*2. Let r(h) = -19468 - 2h*2 + 19468. Calculate n(r(p)). 4456p*4 Let h(u) be the first derivative of -73u*2 + 73u*2 - 2u3 - 17. Let f(d) = -d2. What is h(f(z))? -6z4 Let f(m) = -4m2. Let x be (-3 - 3)/(-2 - -3). Let k(d) = -d2 - 7d - 1. Let v be k(x). Let s(u) = 4u - 2u - vu + 2u. What is s(f(j))? 4j2 Let w(v) = -v2 + 399522v. Let j(p) = -5p. What is j(w(a))? 5a2 - 1997610a Let t(s) = -4s - 12. Let f(o) = 15o + 44. Let x(q) = -6f(q) - 22t(q). Let l(m) = -25m. Give x(l(j)). 50j Let m(f) = -4f. Let t(w) be the first derivative of w5/6 - w2/2 + 37w - 33. Let u(b) be the second derivative of t(b). Give m(u(n)). -40n2 Let k(y) = -7y*2 + 4y + 8. Let h(o) = -9o2 + 5o + 10. Let v(j) = -4h(j) + 5k(j). Let p(x) = 53x2. What is p(v(d))? 53d*4 Let c(h) = -2629h - 1. Let l(u) = -2u. Determine c(l(y)). 5258y - 1 Let d(t) = t*2. Let z(x) = -94x*2 - 234x*2 - 100x*2 + 40x*2. Give z(d(y)). -388y*4 Let b(t) = -9t*2. Let d(i) be the second derivative of 17i*3/6 - 7i - 3. Give d(b(l)). -153l2 Let o(r) = -r2 - 2r - 3. Let d(b) = 9b2 + 12b + 18. Let f(c) = -d(c) - 6o(c). Let s(w) be the first derivative of -7w*2/2 + 1. Calculate f(s(g)). -147g*2 Let m(w) = 41w. Let z(n) = -11n + 3n + n - 2n + 8n. Determine m(z(c)). -41c Let f(v) = 21v. Let h(x) = 585x. Give f(h(p)). 12285p Let b be 5 + 0 + (-88)/44. Let g(c) be the first derivative of 0c2 + 5/3c*b + 0c - 1. Let w(l) = 2l2. Calculate w(g(u)). 50u*4 Let v(p) = 2p. Let w(u) = -26u2 + 890. Give v(w(b)). -52b*2 + 1780 Let v(d) = -60799d*2 - 25d. Let j(k) = 2k. Determine v(j(m)). -243196m*2 - 50m Let o(w) = 2w. Let m(b) = 5. Let h(x) = -54x - 180. Let n(c) = h(c) + 36m(c). Give n(o(u)). -108u Suppose 0 = 4b - 2h - 24, 15 = -2b + 3b + 4h. Let m(a) = ba + 6a - 24a + 9a. Let k(i) = 2i + 4. What is m(k(l))? -4l - 8 Let b(l) = -2l. Let k(h) = 3136h2 - 11h. Calculate b(k(r)). -6272r2 + 22r Let c = -31 - -44. Let h = -1 - -3. Let r(u) = h - cu2 - 2 + 4u2. Let s(i) = -i2. What is r(s(k))? -9k4 Let c(r) = 192r*2. Let y(n) = -158n + 1. Calculate y(c(u)). -30336u2 + 1 Let v(f) = -67f*2. Let k(u) = 49u + 48. Calculate k(v(a)). -3283a2 + 48 Let f(d) = -19d. Let u(s) = -s3 + s2 + s + 2. Let k be u(0). Let p(y) = ky2 - 3y - 4y + 7y. What is f(p(m))? -38m2 Let s(i) = -i + i + i2. Let l(c) = c3 - 11c*2 + 3c - 16. Let n be l(11). Let t(j) = nj + 21j - 36j. Calculate s(t(f)). 4f*2 Let f(v) = 19v*2 + 28v*2 - 3 - 81v*2 + 31v*2 + 5. Let i(b) = -b + 2b - 2b. Calculate f(i(a)). -3a*2 + 2 Let m(z) = -z. Let q(c) = 45c + 30. Let k(n) = 15n + 11. Let g(p) = -11k(p) + 4q(p). Give g(m(i)). -15i - 1 Suppose -t - 29 = -5j + 2t, -5j + 45 = 5t. Let k(p) = j - 10 + 6p + 3. Let w(g) = -g2. What is w(k(z))? -36z*2 Let t = 444 - 440. Let k(h) be the third derivative of -1/24h*t + 0 + 0h + 5h2 + 0h*3. Let u(x) = 3x. Calculate k(u(d)). -3d Let r(t) = -3t + 7. Let p(v) = -v + 2. Let i(g) = -7p(g) + 2r(g). Let f(j) be the third derivative of j5/20 + j2. Calculate i(f(m)). 3m2 Let y(v) be the second derivative of -v7/2520 + 5v*4/4 - 10v. Let w(k) be the th	{ "pile_set_name": "DM Mathematics" }
the form s + bq and give b. 5 Express 4 - 161a + 282a - 166a in the form b + ga and give g. -45 Rearrange -16g*2 + 28g*2 - 48g*2 + 4g to kg2 + tg + i and give t. 4 Express -1418y - 349y + 223y in the form vy + d and give v. -1544 Express (1 + 4 - 6 - 23a)(3a + 3 - 3) as qa + k + ba2 and give q. -3 Express -9a + 129 - 59 - 2a3 - 69 - 2a*2 + 2a*2 as ia*3 + fa + w + na2 and give f. -9 Rearrange -9 + 0 + 3v - 2v + 0 to n + dv and give n. -9 Express -2q - 3q + 6102q4 + 1 - 6107q*4 in the form tq*3 + o + kq*4 + xq + vq2 and give k. -5 Rearrange 9u*3 + 9u*3 + 12u*3 - 28u*3 - 114 to zu + p + lu2 + hu*3 and give p. -114 Express (u + 0u2 + u2 + 4u2)(-2u2 - u2 - 3u*2)(-4 - 3 + 6) as w + fu2 + xu + bu4 + ku3 and give b. 30 Rearrange -z4 - 4408 - 2z2 + 4408 - z3 + 13z to the form nz2 + dz*3 + pz + j + mz4 and give n. -2 Rearrange -171f + 62 - 32 - 30 to the form n + hf and give h. -171 Rearrange (-3 + 1 + 3 + 3 - 1 - 1 + (4 - 2 - 4)(-1 + 6 - 3) - 1 + 0 + 2 - 62 + 103 - 54)(2n - 3n + 0n) to qn + k and give q. 14 Rearrange i3 + 6 + 67i*2 - 35i*2 - 2 - 36i*2 to vi*2 + ki + s + wi3 and give s. 4 Express -t2 - 3 - 3t + 14 + 7 + t - 1 as q + rt + ht*2 and give h. -1 Express 6u - 14u - 6 + 5u + 7u in the form i + ru and give r. 4 Express (-121f2 - 118f*2 + 385f*2)(-f + f + 2f)(-6f + 0f + 4f) as n + wf*4 + of*2 + hf + rf3 and give w. -584 Rearrange (-35 - 106 - 4)(4h2 + 4h - 9 + 7 - 5h2) to the form oh*2 + nh + s and give n. -580 Express 3c2 + 3c*3 - 3c*2 + (64c*2 - 3 - 142c*2 + 82c*2)(c - 3c + 0c) in the form qc3 + rc*2 + w + gc and give g. 6 Rearrange -2792m + 7640593 - 7640593 to the form im + a and give i. -2792 Rearrange -x + 278x2 - 316x*2 + 971x*2 + x to the form px*2 + dx + g and give p. 933 Express c*2 + 10 - 36 - 18 - 29 + 3c - 7c as gc*2 + bc + d and give d. -73 Express 1226c3 - 3c*2 - 4 + 4c*2 - 1542c*3 as vc + o + fc3 + pc*2 and give p. 1 Express 181z + 188z - 6 - 370z + 14z2 as pz + y + mz2 and give m. 14 Rearrange 2 + 54 - 60 + 233j*2 to nj + cj2 + w and give w. -4 Rearrange (-2t2 + t2 - 4t2)(27t - 73t + 113t)(2 - t - 2)(0 + 4 - 2) to ot*2 + m + at + dt3 + ht*4 and give h. 670 Rearrange -21 + 2z*3 - 2z*2 + 2z*2 + 340z - 338z to the form nz*2 + v + cz + dz3 and give v. -21 Express -2z*3 - 3z*2 - 5z*2 + 3z*3 + 5z*2 - 15z + z*2 + 3z*4 in the form tz*2 + vz + mz4 + iz*3 + j and give t. -2 Express (-2a*3 + 4a*3 + 4a - 7a)(-1 - 1 + 10) as ya3 + ra + na2 + i and give y. 16 Express (-2 + 12 - 47z - 10)(12z + 3 - 3) as n + kz2 + az and give k. -564 Express 5h3 + 2h*4 - 216569 + 216569 + h as z + ph + th3 + gh*4 + vh*2 and give g. 2 Rearrange (-20i + 73564 - 73564)(0 - 3 + 5) + 0 - 2i + 0 to di + l and give d. -42 Rearrange (3i - 2i + 0i)(133i - 133i - 93i*2) - 2i + i*3 + 2i to the form c + vi + wi*2 + qi*3 and give q. -92 Express 138x - 278x + 11 + 145x as n + hx and give n. 11 Rearrange (-o + 7o - 2o)(1 - o - 1)(-2 - 2 + 5)(33 + 30 - 64) to the form ro2 + wo + i and give r. 4 Express (3p - 4p + 2p)(8p + 8p + 0p)(-3p + p + 4p) as up + qp*2 + z + mp*3 and give z. 0 Express (148f*2 - 2239f + 2239f)(3 - 4 - 3 + (1 - 3 + 3)(-1 + 2 - 3) - 2 + 1 - 1 + 1 - 3 + 1) in the form gf + d + xf2 and give x. -1332 Rearrange (-5o + 13o - 46 + 43)(16o + 4o + 4o) to the form a + go + jo2 and give j. 192 Rearrange (-102m*2 + 4 + 92m*2 + 1)(4 - 1 + 2) to the form dm2 + tm + w and give w. 25 Express 3u4 - 3u*3 + 23896 - 2u*2 - 23895 - 5u*4 as du*2 + xu*4 + vu*3 + fu + n and give n. 1 Rearrange 87t - 98t + 52t + (-4 + 1 + 2)(5t + 0t - 3t) - 3t + 2t + 0t to the form f + yt and give y. 38 Express 218u - 441u + 222u - 2u3 + 2 + u2 + 6u*4 in the form xu*3 + z + su + lu4 + mu*2 and give m. 1 Rearrange 28v*4 - 10v*3 + 12v3 + v2 + 9v - 11v to sv2 + cv*4 + a + mv*3 + lv and give m. 2 Rearrange (2228g - 393365 + 393365)(-g2 + g2 + 2g2) to cg*2 + p + tg + bg3 and give p. 0 Rearrange -4u + 2u + 4u + 5u - 2u - u + 0u + 3u - 2u + (1 + 4 - 3)(2 - 2 + 2u) + 17u + 36u + u - 13 - 5u + 13 to the form ru + a and give r. 58 Express (-4814 - 4820 + 10382)(-1 + 1 - 1)(2u - 6u + 2u) in the form z + pu and give p. 1496 Rearrange (6m - 4m - 3m + (3 - m - 3)(1 - 5 + 0))(8m - 4m + 6m) to the form xm*2 + sm + z and give x. 30 Express i*2 - 30 + 2i*2 + 27 + 2i*2 in the form vi*2 + gi + d and give v. 5 Express -7 + 7b - 35b*2 + 16b*2 - 2b*3 + 20b*2 - 3b as fb3 + k + jb + ob2 and give k. -7 Express (53 - 101 + 50 - 149b)(2b2 - b2 + 0b2) in the form o + ub*3 + db + gb2 and give g. 2 Rearrange 2h*2 - 6h*2 - 4h*2 + (0 - 1 + 0)(-2h2 - 3h*2 + 6h*2) + 11h*2 - 31h*2 + 9h*2 to w + bh + yh2 and give y. -20 Rearrange (229 + 209 + 173)(0b + b - 2 + 3) to xb + w and give w. 611 Rearrange (1 + 4 - 2)(-3h*2 + 5h2 - h2)(43h*2 - 4h*2 + 6h*2) - 2h*4 + 0h + 0h to the form yh*3 + dh*2 + j + th*4 + qh and give t. 133 Rearrange (-1427 + 56x - 1430 + 2858)(x3 + x3 - x*3) to dx*3 + ux*2 + c + tx + mx4 and give m. 56 Rearrange (33 - 10 + 5957o - 5945o)(-3o2 + 2o*2 + 0o*2) to no + v + fo3 + so*2 and give f. -12 Rearrange 1 - 116l*3 + 2l*2 - 3l - 11l4 + 116l*3 to kl + ql3 + u + xl*2 + fl*4 and give f. -11 Express -17 + 26 + 84k + 2k2 - 12 + 2k*3 in the form pk*3 + tk + m + rk2 and give p. 2 Express h3 - h3 - 2h*4 + (-142h*3 + 12h*3 + 22h*3)(0 + 0 - 3h) - 4h*4 + 0h*4 + 2h*4 as uh*2 + bh*4 + a + qh + ph3 and give b. 320 Express -5n - 6n2 - 36n*2 + 5n as gn + i + un*2 and give u. -42 Rearrange (-4o*2 + 5o*2 + 4o*2)(-43o - 11o - 10o)(-1 - 1 + 4) to the form do + p + ho*3 + ao*2 and give a. 0 Rearrange 4t + 2t2 + 4t + 0t2 + 9t - 4t to the form at*2 + ot + z and give o. 13 Express -2u3 + 3u*3 + 2u*2 - 12 + 20u + 0u2 - 3u*3 - 19u as iu + h + ou*3 + gu*2 and give h. -12 Express q - 4 - 5q + 3q - 5q as wq + g and give g. -4 Express 9j*2 - 5j*2 - 39 - 2j + 2j2 - 4j*2 in the form yj*2 + k + oj and give k. -39 Rearrange 3t2 + 13t*2 + 15t*2 to the form nt*2 + yt + z and give n. 31 Rearrange -16c + 13c*3 + 10c + 2 - 1003c2 + 1002c*2 to the form a + rc*2 + oc + ic3 and give i. 13 Rearrange (-1 + 0 + 3)(-396r2 + 910 - 910 + (2r + 1 - 1)(-r + r - 2r) + 3r2 - 2r2 + r2) to o + pr2 + ar and give p. -796 Rearrange -4m + 0m + 2m + 0m + 22m + 0m + (2m - 3m + 3m)(5 - 3 - 4) - 3 - m + 3 - 5m + 0m + 2m to rm + u and give r. 12 Rearrange 0v4 - v4 + 0v*4 + (3 - 3 - 2v*2)(10v2 - 13v*2 - 10v*2) to the form lv*3 + kv + tv2 + nv*4 + x and give n. 25 Rearrange -17k + 27k - 15k - 337k2 + 6k to the form p + bk + fk*2 and give b. 1 Rearrange 148s*3 + 14s - 147s3 - 11s - s*2 + 53 to the form is + ws2 + cs*3 + b and give i. 3 Express 550u*2 - 290u*2 + 13 - 277u*2 as su*2 + z + mu and give z. 13 Rearrange -30p2 + 102p*2 + 278p*2 - 38p*2 + 164p*2 to gp + ap2 + z and give a. 476 Rearrange -b - 2b*3 + b + (-13b + 12 - 12)(3b - 3b + b)(-8 + 26b + 8) to jb*2 + nb + o + lb3 and give l. -340 Rearrange 0v*2 - 1131v*3 + 3v*4 - 4 - 4v*2 - 2v + 1129v3 to nv*3 + pv + jv4 + k + cv*2 and give c. -4 Rearrange (-y - 4y + 2y)(-126 - 598 - 108 + 153) to the form m + gy and give g. 2037 Express (-3 + 4 - 2)(6z - 9z + 5z - 3)(-43 - 12z2 + 43) as u + kz + mz2 + iz*3 and give m. -36 Rearrange 1 - 892h + 29h - 1 - h2 to th + b + lh2 and give t. -863 Rearrange -108f - 27f4 + 108f + (-1 + 5 - 2 + (4 - 1 - 5)(-1 - 3 + 6))(-3f4 + 7f*4 - 2f*4) to jf*3 + of + nf4 + bf*2 + m and give n. -31 Express (-4 + 5 - 2)(-2	{ "pile_set_name": "DM Mathematics" }
12)/2 + -41. Let w = 63 + a. Let z = 34 - w. Solve -5o = -2g + z, 2 = 5o + g + 17 for o. -3 Let j(s) = s2 - 2s - 10. Let u(b) = 2 - 3b2 + b3 - 4 + 7. Let r be u(3). Let y be j(r). Solve 3a - 5a + 18 = 4i, yi = 2a + 18 for a. 1 Suppose p + 2w = 1, -3p = 4w + 6 - 13. Solve 0 = -pl - 5z - 20, 35l = 31l + 5z - 25 for l. -5 Suppose 4r = 13r - 162. Solve 5o + r = -3a + 3, -2o = -4a - 20 for a. -5 Let d = -2 - -8. Suppose -ds - 2m - 8 = -4s, -3m = -2s + 12. Solve 5h = 5o - 5, h + sh - 5o = 15 for h. -5 Suppose 0 = 2f + 2b, 2f - 25 = b + 2b. Suppose -28 = -4o + 2p, 4o - 36 = -14p + 18p. Solve -2t - o = fa, 3t + 19 = 5a - a for a. 1 Let o be (-27)/(-3)6/18. Solve o = -j - 2j - 3k, -3k + 5 = j for j. -4 Suppose o - 439 = -427. Solve c + o = -4w, c - 3 = w - 0 for w. -3 Let h = 8 + -2. Suppose 0 = -0g + 4g + z - h, 3g - z - 8 = 0. Solve -g = 5p - 2y - 9, -4p + 3y = -7 for p. 1 Suppose 0 = -5d - 5c + 135, -82 + 21 = -2d + 5c. Let j = 30 - d. Solve -2w - j = -z - 4w, -5z = w + 8 for z. -2 Suppose 10 = -3l + 5c, -3l - 2c + 40 - 15 = 0. Solve -k = lo - 6, 2k - 2 = -0k for o. 1 Suppose 3a - 289 + 274 = 0. Solve d = -5c + 2, d = ac - 0d + 2 for c. 0 Suppose 0 = 5w + 3x - 12, -3w + w + 8 = 2x. Solve 0 = 5y - y, w = -4f - 3y + 20 for f. 5 Suppose 2 = 2r - 4. Suppose 0 = -ra + 5a - 8. Let q be (-56)/(-20) + 12/(-15). Solve -at = s + 2 + 12, 2 = 5s + qt for s. 2 Suppose 0y + 16y - 48 = 0. Solve j - y = -f, -f + 4j = -3f + 8 for f. 2 Suppose -5o - 14 = 3f - 0o, f - 3o = 14. Suppose -2x = -5p + 17, 2x - 13 = -3p + fp. Solve -xt = -4j + 8, -4t - 14 = -2t + 3j for t. -4 Let w be 4 - 0 - (6 - 7). Let h be (w + -2)1 - 2. Let f be 5 - 3/((-3)/h). Solve 0 = d - 4y - f, 2y - 5y = -2d + 2 for d. -2 Suppose o = -l - 24 + 23, 3o = 4l - 24. Solve -5h = -lr - 12, 3h - 5r + r = 16 for h. 0 Suppose 8m - 4m = g + 15, 0 = -3g - 4m + 35. Solve -4d - 3 + 8 = gs, 4s = -d - 7 for s. -3 Suppose 4c = -4c + 120. Let k = 22 + -20. Solve -2r + c = -5i, -2i = r - kr + 7 for r. 5 Suppose 6j = -y + j + 30, 5y - 5j = 0. Suppose -ym + 18 = 3. Solve 2u - 5k = 5u - m, k = u + 7 for u. -4 Let t = 26 + -78. Let m = 55 + t. Solve 2j = 4c + 12, mj - 2j + c + 6 = 0 for j. -2 Suppose 3d = -4d + 4d. Suppose 4c - 21 - 31 = 0. Solve 2m = 4m - 3w - c, d = -4m - 4w - 24 for m. -1 Let d(z) = 4z2 - z. Let o be d(1). Let y(s) = s3 - 9s2 + s - 7. Let g be y(9). Let m be 1/(54/26 - g). Solve -3k - 5 = x + 3, ok = 4x - m for x. 1 Suppose -5z + c + 14 = 0, -5c + 3c - 1 = -z. Solve -4t + 7 = -zx, 0 = -3t - 3 + 6 for x. -1 Let s = 1184 - 1180. Solve 3u = sa + 13, 10 = 5u - 3u - 3a for u. -1 Let w(c) = c3 - 4c + 6. Let i be w(3). Let g = 8 + i. Let n = g + -24. Solve -3z = -ny + 13, -2z + 23 = 5y - 10 for y. 5 Let f(l) = l*3 + 6l*2 - 3l - 15. Let r be f(-6). Suppose rd = -2d + 45. Suppose 0 = -3o + d + 3. Solve 0 = -k + p, 4k = 2k - op for k. 0 Let d(c) = -6c - 66. Let y be d(-11). Solve -l - 3 = -2a + 6a, l + 3a + 3 = y for l. -3 Let h be 0 + (-3 - -1)12/(-4). Solve -5s + 5x + 8 = hx, -2x = 4s - 10 for s. 1 Let n = 225 + -222. Solve -3i + 8 = 4k, 5 - 14 = -ni - 3k for i. 4 Let w be (1 - 3)2 - -9. Suppose -2t + 14 = h + h, 0 = 3h - wt - 29. Solve 5b = 7j - 4j - 10, 0 = 2j - 4b - h for j. 0 Let n(q) = q2 - 4q - 3. Let b = 8 + -14. Let d = b - -11. Let v be n(d). Solve -7 = 4k - m, 0 = 4m - v + 22 for k. -3 Let o be 12/42 - (-19)/7. Let s(z) = -3z + 20. Let i be s(5). Solve p = -iy + 10, 2p = 2y - o + 11 for p. 5 Let z be 4 + (-9)/21 + (-44)/77. Solve 4p + 4 = -zb, 5p + 3b - 1 = -9 for p. -4 Suppose 2o - 4 - 12 = -2k, -5k = o - 28. Suppose or + 1 = m - 2m, -4m + 9 = -r. Solve -y = mv + 2, 0v = -v - y for v. -2 Suppose -d + t + 6 + 7 = 0, 4t = 16. Let y = d + -12. Solve 2g = -yu + 3g - 10, 4g = -4u - 32 for u. -3 Let p be 187/348(-4)/(-88). Solve -4o = -3s - p, o + 3s + 1 = 6o for o. -1 Suppose 14s - 4s - 60 = 0. Suppose j + s = 4j. Solve c + 8 = 3g + jc, -16 = -4g - 4c for g. 2 Suppose -j + 12 = -s, 28j - 4s + 6 = 30j. Solve -2x - 5y + 16 = 0, x - 3y = -4x + j for x. 3 Let l(u) = -u*2 - 9u - 3. Let c = -64 + 56. Let y be l(c). Solve 2m + 4 = 2w, w - 6 = -2m + y for m. 3 Let t be 9 + 0 + (-2)/1. Let k(o) = o3 - 6o*2 + 4o + 7. Let h be k(6). Let y = h + -26. Solve -2w - yj = -tw + 5, w = 5j - 11 for w. 4 Suppose 215 = 11j - 6j. Let x = j - 43. Solve -14 + 4 = 4b - s, x = 4b + 3s + 2 for b. -2 Suppose -2k = 10, -5k = -3y - 3k - 26. Let n = -14 - y. Let a be (-5 + 2)(1 + n). Solve -ai = 3v - 0v + 18, i = v for v. -3 Let c = 38 - -86. Let r be (-812)/(-21)(-9)/(-2). Let k = r - c. Solve -2a + 17 = 5u, -4a + 3u + 19 - k = 0 for a. -4 Let l(i) = -34i + 1. Let v be l(-6). Suppose -70 + v = 9r. Solve p + 5g = 6p - r, 0 = -3p - 3g + 21 for p. 5 Let n(v) = -3v - 17. Let a be n(-25). Suppose 7h - a = 26. Solve 0 = 4t - 0t - 4r + h, 2t - 3r = -4 for t. -5 Let j = -2 - -3. Suppose f + 8 = 2v, 5v - 4f = 7 + 19. Let k = v + j. Solve 5s + kw = -0 + 9, 4w + 5 = -s for s. 3 Let d = 24 - 46. Let s be (-6 + 1)/(-5) - d. Suppose -3 + s = -4q, 2q = 3n - 16. Solve -m + 9 = 5w - nm, 4m - 4 = 0 for w. 2 Let w be -20 + -3 + (-6)/(-2). Let n be (-1)/(15/(-18)(-6)/w). Solve -5y - 2s - 18 = 0, -7 = 3y - ns - 17 for y. -2 Let f = 578 - 575. Solve -j + 0k - k + 8 = 0, 0 = j - fk + 8 for j. 4 Let d(p) = p*3 + 21p*2 + 41p + 59. Let b be d(-19). Solve -bn = 3f - 0n - 4, 2f + n = 3 for f. 2 Let h be 10/(-15) + (3 - 213/(-9)). Suppose 4n + 2 = 6. Solve 4g + h = 2z, z + 5g = -16 + n for z. 5 Let n = -29 - -50. Suppose 4w + 0w - 60 = 5f, -n = f + w. Let b = f + 18. Solve bc + 14 = -m, -m - 19 = 3c - 0c for c. -5 Suppose -4t + t = -3c, 5t = 0. Suppose -12 = 3f - 3h, -3h + 8 + 7 = c. Solve -w = b - f - 0, 3w = -2b + 7 for w. 5 Let r(x) = -x*3 + 3x*2 + 5x - 2. Suppose -4p + i = p - 15, -2p + 3i - 7 = 0. Let b be r(p). Solve 28 = 4o + 3g, -2o - bg + 24 = 2o for o. 4 Let u(k) = -4k + k3 + 2k - 3k + 4 + 6k. Let x = -12 + 12. Let c be u(x). Solve -cn - 6t + t = 7, t = -3 for n. 2 Suppose -2w - 5 = -9. Suppose z = wf + 6z - 15, z = 2f - 9. Solve 5b - 12 - 13 = 0, 5g = -fb for g. -5 Let b(i) = 15i3 + i2 - 5i + 5. Let c be b(2). Let m = -119 + c. Solve m = 3y + 2f + 4, 4f - 4 = -2y - y for y. -4 Let n = 667 + -667. Let a be (1/(-2))/(2/(-20)). Solve n = -ap + 15, -b - 2b + 21 = 4p for b. 3 Suppose 381 = 71h + 26. Suppose 0 = 3o + 5c - 11, -3o + c = -8 + 3. Suppose -oj = -4 - 2. Solve -10 = ht - jn + 1, 4n + 12 = 0 for t. -4 Let l(b) = -b*2 + b. Let d be l(3). Let h be ((-2)/6)/(1/d). Solve k - h = m - 1, 4k = -2m + 28 for m. 4 Let p(u) = 3u*2. Let s be p(1). Suppose 0 = -4z - 8, z - 3z - 28 = -2k. Suppose -2o = -4o + k. Solve -12 = -2g + 3j - 1, -o = -sg + j for g. 1 Suppose c = -3, c + 21 = -2r - 0c. Let k be 14/3 + (-3)/r. Solve kp + 2z = 15, 2p - z = 4p - 7 for p. 1 Let v = -7 + 11. Suppose 3q + v = 4q. Let x(c) = 2c - 5. Let g be x(5). Solve 5u = -j + 5j + 40, qu + gj + 9 = 0 for u. 4 Let o(j) = -j - 7. Let v be -1(6 - (-3 - -2)). Let u be o(v). Solve 3p = h - 11, -2h - 3h - 4p - 21 = u for h. -1 Suppose -2s - 3q - 124 = 0, -4s + q = s + 344. Let m be 2/9 + s/(-18). Suppose -m = 3f - 19. Solve 25 = -5d + n, 0 = n - 0 - f for d. -4 Suppose -g - 37 = -4. Let p = g + 37. Let c be (2 - 1) + 2 - -4. Solve 2o + c + p = -b, 0 = o - 5b - 11 for o. -4 Suppose i - 1 = 3. Suppose 13 = 4s - 5s. Let f = s - -16. Solve il + 9 = l, -24 = 5z + fl for z. -3 Let q(l) = l + 2. Let g be q(-4). Let b be 59 - (g + 1 - -2). Let h = 103 - b. Solve -h = -5s + 2i + 3i, 3i = -s - 11 for s. 4 Let q be (6/(-4))/((-2)/(12/(-3))). Let g be (14 - (-1 + 3)) + -1. Let u = q + g. Solve 2k - y - u = 0, -4y + 14 - 1 = k for k. 5 Let p = 27 + -24. Let u be 2/p + 504/54. Solve -2n - 10 = -4k, -4n - k = -3k - u for n. 5 Suppose 39g = -3g + 546. Solve 3q + o + g = 0, -2q - 4o = -3o + 8 for q. -5 Let p be 17 - (12 + -9). Solve 8 = 4o - 0o + p*	{ "pile_set_name": "DM Mathematics" }
picked without replacement from dbbdddddddbdddbdddd. Give prob of sequence bb. 2/57 Four letters picked without replacement from fefeefe. Give prob of sequence effe. 3/35 Three letters picked without replacement from cccccccccccccgc. What is prob of sequence ccg? 1/15 What is prob of sequence duu when three letters picked without replacement from {t: 2, u: 7, d: 3}? 21/220 Calculate prob of sequence bb when two letters picked without replacement from {z: 2, b: 2}. 1/6 What is prob of sequence xxlx when four letters picked without replacement from {w: 4, x: 4, l: 2}? 1/105 Two letters picked without replacement from pogrooofofjfff. Give prob of sequence jf. 5/182 Calculate prob of sequence ie when two letters picked without replacement from {s: 4, y: 3, v: 2, i: 1, e: 2}. 1/66 What is prob of sequence yyy when three letters picked without replacement from {y: 9}? 1 Four letters picked without replacement from slllsssslslss. What is prob of sequence llls? 4/143 Four letters picked without replacement from qqqqqsqs. Give prob of sequence qssq. 1/28 Four letters picked without replacement from zezzzmrmpdmze. Give prob of sequence zdpm. 1/1144 What is prob of sequence fzpf when four letters picked without replacement from ofmfzpd? 1/420 Four letters picked without replacement from {x: 9, b: 2, e: 3, q: 1, w: 3, i: 1}. Give prob of sequence ixxq. 1/1292 Four letters picked without replacement from {d: 1, x: 1, s: 1, v: 1, p: 1}. Give prob of sequence pxvd. 1/120 What is prob of sequence yi when two letters picked without replacement from iwyhhiaky? 1/18 What is prob of sequence fck when three letters picked without replacement from fkfkgekcqfkfkf? 25/2184 Calculate prob of sequence hee when three letters picked without replacement from gehgghelgggg. 1/330 What is prob of sequence lyl when three letters picked without replacement from {y: 1, u: 3, z: 3, l: 3, p: 2, a: 1}? 1/286 What is prob of sequence rprr when four letters picked without replacement from {r: 11, p: 1}? 1/12 What is prob of sequence ff when two letters picked without replacement from fjfddfffdjddfjj? 1/7 Two letters picked without replacement from {g: 5}. Give prob of sequence gg. 1 Calculate prob of sequence mt when two letters picked without replacement from {a: 2, q: 1, y: 1, t: 1, m: 1, k: 1}. 1/42 Three letters picked without replacement from qeqeeeqheveeqeeqqeq. What is prob of sequence hvq? 7/5814 Calculate prob of sequence iq when two letters picked without replacement from qqqqiiiiiqqi. 3/11 What is prob of sequence uuou when four letters picked without replacement from {o: 2, m: 4, u: 4}? 1/105 Calculate prob of sequence uc when two letters picked without replacement from {c: 2, j: 1, u: 4, a: 2}. 1/9 Three letters picked without replacement from {e: 1, x: 1, t: 5, p: 1, b: 1}. What is prob of sequence txe? 5/504 What is prob of sequence ghhg when four letters picked without replacement from {g: 8, h: 2, o: 9}? 7/5814 Three letters picked without replacement from msccssicumcscssss. Give prob of sequence smu. 1/255 What is prob of sequence ez when two letters picked without replacement from {k: 4, e: 1, z: 4, v: 2}? 2/55 What is prob of sequence zhn when three letters picked without replacement from alnbnzlbh? 1/252 Two letters picked without replacement from {s: 1, c: 3, d: 4, y: 1, p: 1, i: 4}. Give prob of sequence ic. 6/91 Calculate prob of sequence kttt when four letters picked without replacement from bpktu. 0 Calculate prob of sequence ueu when three letters picked without replacement from cueuchccuehohchuo. 1/170 Two letters picked without replacement from jmwcwftc. What is prob of sequence cj? 1/28 Calculate prob of sequence wrbe when four letters picked without replacement from erlwwvlb. 1/840 Calculate prob of sequence mmqq when four letters picked without replacement from mmmmqmq. 1/21 Calculate prob of sequence nzsu when four letters picked without replacement from {n: 3, z: 2, u: 6, h: 1, s: 2}. 3/1001 Calculate prob of sequence nh when two letters picked without replacement from {h: 2, n: 1, g: 1, l: 1, e: 2, d: 2}. 1/36 Calculate prob of sequence gx when two letters picked without replacement from ggxggx. 4/15 Four letters picked without replacement from zzvzvzzvvz. Give prob of sequence vvzv. 1/35 Four letters picked without replacement from {v: 4, n: 6}. What is prob of sequence nvnn? 2/21 What is prob of sequence hdat when four letters picked without replacement from ddddhhtthffdfhhtah? 1/816 Four letters picked without replacement from qqqqq. Give prob of sequence qqqq. 1 Calculate prob of sequence vvj when three letters picked without replacement from {v: 5, j: 5}. 5/36 Four letters picked without replacement from eeaaveeaaeaaebveevab. Give prob of sequence vvee. 14/4845 Four letters picked without replacement from djtdtaddjetadha. Give prob of sequence aajj. 1/2730 Three letters picked without replacement from wwwwwwoowwwwwwowwo. What is prob of sequence wow? 91/612 Calculate prob of sequence xq when two letters picked without replacement from {q: 2, x: 4}. 4/15 Calculate prob of sequence babb when four letters picked without replacement from {b: 15, a: 3}. 91/816 Four letters picked without replacement from {l: 2, m: 5, s: 7}. Give prob of sequence sllm. 5/1716 Four letters picked without replacement from {p: 1, e: 1, k: 2, f: 4, q: 2}. What is prob of sequence efkk? 1/630 Calculate prob of sequence ccb when three letters picked without replacement from {b: 1, c: 1, k: 1}. 0 Four letters picked without replacement from uuuummuuuuumum. Give prob of sequence muuu. 120/1001 Two letters picked without replacement from xxpxxpppxxppxxxmxpxx. Give prob of sequence pp. 21/190 Two letters picked without replacement from {t: 4, p: 3, g: 7}. What is prob of sequence pp? 3/91 Two letters picked without replacement from {y: 3, j: 9}. Give prob of sequence jj. 6/11 Four letters picked without replacement from {m: 1, x: 6, w: 3, f: 2}. Give prob of sequence xmfw. 1/330 Two letters picked without replacement from wvhfhwhxwhzwxvwxwx. What is prob of sequence zw? 1/51 What is prob of sequence ljl when three letters picked without replacement from {j: 6, u: 9, l: 3, c: 1}? 2/323 Calculate prob of sequence llll when four letters picked without replacement from llllll. 1 Calculate prob of sequence tc when two letters picked without replacement from tccttcttctcc. 3/11 Two letters picked without replacement from {f: 5, s: 5}. Give prob of sequence ss. 2/9 Calculate prob of sequence sync when four letters picked without replacement from {y: 4, s: 3, j: 1, n: 2, m: 2, c: 2}. 2/1001 Two letters picked without replacement from pawpfapaaava. What is prob of sequence pv? 1/44 Calculate prob of sequence yyky when four letters picked without replacement from yyyk. 1/4 What is prob of sequence jjcx when four letters picked without replacement from jjxcwvcwcwwwccwvcw? 1/6120 Calculate prob of sequence gfi when three letters picked without replacement from {f: 1, g: 1, i: 1}. 1/6 Two letters picked without replacement from {s: 2, p: 5, l: 1, h: 6, b: 2}. Give prob of sequence bb. 1/120 Two letters picked without replacement from xnxx. What is prob of sequence xx? 1/2 Four letters picked without replacement from {b: 5, a: 4, i: 2, t: 2}. Give prob of sequence abai. 1/143 Two letters picked without replacement from {y: 1, k: 2, b: 1, i: 5}. What is prob of sequence yk? 1/36 Two letters picked without replacement from {c: 1, k: 4, n: 3, s: 3}. Give prob of sequence kc. 2/55 Four letters picked without replacement from {b: 2, i: 9, m: 7}. What is prob of sequence mbii? 7/510 Calculate prob of sequence uu when two letters picked without replacement from uwuuwwuuwuuwuu. 36/91 Calculate prob of sequence kr when two letters picked without replacement from rrpnrggkr. 1/18 Calculate prob of sequence or when two letters picked without replacement from rorrorrorrrrro. 20/91 Four letters picked without replacement from llnwwllwnnnwww. What is prob of sequence lwwl? 15/1001 Three letters picked without replacement from {z: 4, m: 10}. What is prob of sequence mmm? 30/91 Two letters picked without replacement from kkwkkkkkkwgkkwtkkkg. What is prob of sequence wt? 1/114 Three letters picked with	{ "pile_set_name": "DM Mathematics" }
- v/3 - 2/3. (v - 2)(v + 1)/3 What is j in 2j*3 - 263j*2/4 - 897j/4 - 27 = 0? -3, -1/8, 36 Factor 5w4 + 25w*3 + 15w*2 - 45w. 5w(w - 1)(w + 3)2 What is y in -3y*3/4 - 921y*2/4 = 0? -307, 0 Suppose -2t*2/3 + 88t/3 - 152 = 0. Calculate t. 6, 38 Factor -2z2/5 + 236z/5 - 6962/5. -2(z - 59)2/5 Suppose -5v*5 - 4v*4 + 5v*3 + 4v2 = 0. What is v? -1, -4/5, 0, 1 Factor -a3/3 + 43a2 - 1273a - 22445/3. -(a - 67)*2(a + 5)/3 Factor -15i3 - 246i*2 + 159i + 102. -3(i - 1)(i + 17)(5i + 2) Determine z so that z*5 - 16z*4 + 12z*3 + 46z*2 - 13z - 30 = 0. -1, 1, 2, 15 Factor -2y3/5 + 48y*2/5. -2y*2(y - 24)/5 Factor -22o3/7 + 48o*2/7 - 8o/7. -2o(o - 2)(11o - 2)/7 Find o, given that -o*4/2 + 5o*3 - 21o2/2 = 0. 0, 3, 7 Solve n4/2 - 7n2/2 - 3n = 0 for n. -2, -1, 0, 3 Determine d, given that 3d3 + 9522d*2 + 7555707d = 0. -1587, 0 Determine h, given that h5/5 - h4/5 - 3h3/5 + h2/5 + 2h/5 = 0. -1, 0, 1, 2 Factor -2r2 + 1652r + 1654. -2(r - 827)(r + 1) What is n in -3n3/5 + 3n*2/5 + 3n/5 - 3/5 = 0? -1, 1 Let 12a5 - 81a*4 + 111a*3 - 27a*2 - 15a = 0. What is a? -1/4, 0, 1, 5 Solve -2x3 + 136x*2 + 278x + 140 = 0. -1, 70 Determine r so that r*3 + 87r*2 + 1551r - 15463 = 0. -47, 7 Find n such that -2n5 - 12n*4 + 214n*3 - 240n*2 - 1400n = 0. -14, -2, 0, 5 Find x such that -33x2 - 195x + 18 = 0. -6, 1/11 Factor 5g2 - 670g + 22445. 5(g - 67)2 Find a, given that -2a*4/9 - 8a*3/9 + 58a*2/9 - 16a/3 = 0. -8, 0, 1, 3 Factor 60o2 - 308o - 456. 4(3o - 19)(5o + 6) Let 3p4 - 21p*3 - 12p*2 + 84p = 0. What is p? -2, 0, 2, 7 What is c in -5c5 - 260c*4 + 1110c*3 - 580c*2 - 1105c + 840 = 0? -56, -1, 1, 3 Suppose 3s5 + 951s*4 + 4701s*3 + 6561s*2 + 2808s = 0. Calculate s. -312, -3, -1, 0 Find l, given that -l*2/2 + 328l - 53792 = 0. 328 Determine d so that -3d4 + 192d*3 - 3072d2 = 0. 0, 32 Factor -z4 - 8z3 + 20z2. -z2(z - 2)(z + 10) Let -3l2 - 3l + 396 = 0. Calculate l. -12, 11 Find f such that -3f4/7 - 51f*3/7 - 279f*2/7 - 75f - 42 = 0. -7, -2, -1 Factor -4d2 - 2352d - 345744. -4(d + 294)2 Let h2/4 + 11h/4 - 21/2 = 0. What is h? -14, 3 Factor -f*2 + 59f - 58. -(f - 58)(f - 1) Solve v4/11 + 177v*3/11 - 362v*2/11 - 708v/11 + 1432/11 = 0 for v. -179, -2, 2 Solve 70p3 - 75p*2 - 415p + 30 = 0. -2, 1/14, 3 Factor 2j3/17 - 4j*2/17 - 46j/17 + 120/17. 2(j - 4)(j - 3)(j + 5)/17 Let 405m*2 - 35460m + 776180 = 0. Calculate m. 394/9 Factor -o*4/9 - 11o*3/3 - 7o*2 - 31o/9. -o(o + 1)2(o + 31)/9 Factor 5k2 - 15k. 5k(k - 3) What is s in 3s2 - 20244s + 34151628 = 0? 3374 Factor 4p3 + 1684p*2 - 4p - 1684. 4(p - 1)(p + 1)(p + 421) What is b in 2b*3/7 - 226b*2/7 + 6270b/7 + 6498/7 = 0? -1, 57 Factor t*4 + 19t*3 + 129t*2 + 365t + 350. (t + 2)(t + 5)2(t + 7) What is w in -3w2 - 138w - 504 = 0? -42, -4 Determine a, given that -2a2/3 + 4a = 0. 0, 6 Let -2g5/13 + 16g*4/13 - 30g*3/13 - 16g*2/13 + 32g/13 = 0. Calculate g. -1, 0, 1, 4 Suppose q*3 + 507q*2 + 1011q + 505 = 0. Calculate q. -505, -1 Let 2o2 - 24o + 22 = 0. Calculate o. 1, 11 Find b, given that -6b5/13 - 578b*4/13 - 14556b*3/13 - 29604b*2/13 + 31490b/13 + 13254/13 = 0. -47, -3, -1/3, 1 Determine w, given that 2w2/7 + 276w/7 = 0. -138, 0 Factor -q*2/3 - 4q/3. -q(q + 4)/3 Suppose -2h*2/7 + 744h/7 - 2944/7 = 0. Calculate h. 4, 368 Solve -4w2 + 4600w - 4596 = 0. 1, 1149 Factor 2m2/19 + 60m/19 - 128/19. 2(m - 2)(m + 32)/19 Solve -7q3/6 + 419q*2/3 - 4160q - 1200 = 0 for q. -2/7, 60 Factor 50b4/3 - 1280b*3/3 + 10352b*2/3 - 9216b + 7776. 2(b - 2)2(5b - 54)2/3 Factor -4i*5 - 60i*4 - 108i*3 - 52i*2. -4i*2(i + 1)*2(i + 13) Solve -2y2/9 - 114y + 1028/9 = 0. -514, 1 Let -t*5/2 - 69t*4 + 721t*3/2 + 429t*2 = 0. Calculate t. -143, -1, 0, 6 Determine j, given that -3j*5 - 684j*4 - 49704j*3 - 957954j*2 + 14547771j + 32540574 = 0. -79, -2, 11 Factor s*4/4 - 93s*3/2 + 369s*2/4 - 46s. s(s - 184)(s - 1)2/4 Solve -v3/4 - 1607v2/2 = 0 for v. -3214, 0 Suppose -5g*3/2 + 135g*2/2 - 185g + 120 = 0. Calculate g. 1, 2, 24 Let -z3/5 + z2 - 7z/5 + 3/5 = 0. What is z? 1, 3 Factor -g5/2 - 3g*4 - 9g3/2. -g3(g + 3)2/2 Factor -4w*2 + 28w + 32. -4(w - 8)(w + 1) Factor -2u4/5 + 978u*3/5 + 196u*2. -2u*2(u - 490)(u + 1)/5 Find j, given that 8j*4 + 252j*3 + 364j*2 + 120j = 0. -30, -1, -1/2, 0 Factor 4s4 - 228s*3 - 16s*2 + 912s. 4s(s - 57)(s - 2)(s + 2) Suppose m*3 - 60m*2 + 117m - 58 = 0. What is m? 1, 58 Solve b*2/4 - b/2 = 0 for b. 0, 2 Let 2x*2 - 82x = 0. What is x? 0, 41 Determine d, given that 2d5/7 - 12d*4/7 + 20d*3/7 - 22d/7 + 12/7 = 0. -1, 1, 2, 3 Solve 1071n3 - 804n*2/5 + 12n/5 = 0 for n. 0, 2/119, 2/15 Suppose -o*2 + 13o + 68 = 0. Calculate o. -4, 17 Solve -3844o2 - 496o - 16 = 0 for o. -2/31 Factor -4r3/5 - 12r*2/5. -4r*2(r + 3)/5 Suppose 12w5 + 44w*4 - 628w*3 + 1284w*2 - 360w = 0. Calculate w. -10, 0, 1/3, 3 Factor -3u2/7 - 4134u - 9969141. -3(u + 4823)2/7 Factor -w5/7 - 9w*4/7 - 26w*3/7 - 34w*2/7 - 3w - 5/7. -(w + 1)*4(w + 5)/7 Factor h*5 - 121h*4/2 + 1230h*3 - 8600h*2 + 4000h. h(h - 20)3(2h - 1)/2 Factor -885b*2 - 40b + 420. -5(3b - 2)(59b + 42) Factor -2z5/9 - 14z*4/9 + 16z*3/9. -2z*3(z - 1)(z + 8)/9 Factor -3q*2 - 33q - 72. -3(q + 3)(q + 8) What is r in -2r3/7 - 4r*2/7 + 46r/7 + 120/7 = 0? -4, -3, 5 Solve 2v5/17 - 138v*4/17 - 284v*3/17 - 4v*2/17 + 282v/17 + 142/17 = 0 for v. -1, 1, 71 Solve -9h3 + 438h*2 - 285h - 144 = 0 for h. -1/3, 1, 48 What is u in 7u4 + 45u*3 + 14u*2 - 24u = 0? -6, -1, 0, 4/7 Determine g so that 4g3 + 4g*2 - 40g + 32 = 0. -4, 1, 2 Factor 3v4/7 - 12v*3/7 - 15v*2/7. 3v*2(v - 5)(v + 1)/7 Solve -v3 + 14v*2 + 77v - 90 = 0. -5, 1, 18 Factor -r*2/6 + 7r/3. -r(r - 14)/6 Let t5/4 - t3 = 0. What is t? -2, 0, 2 Factor -2s*3/13 + 10s*2/13 - 16s/13 + 8/13. -2(s - 2)2(s - 1)/13 What is i in i*5/4 - 251i4/4 - i3/2 + 251i2/2 + i/4 - 251/4 = 0? -1, 1, 251 Suppose -5n*3 - 23n*2 + 40n - 12 = 0. What is n? -6, 2/5, 1 Factor -t*2 - 4t + 5. -(t - 1)(t + 5) Factor -2s*3 + 44s*2 - 106s - 152. -2(s - 19)(s - 4)(s + 1) Factor 3a*5 - 9a*4 + 3a*3 + 9a*2 - 6a. 3a(a - 2)(a - 1)2(a + 1) Let -3b4 - 291b*3/4 - 1023b*2/4 - 6b + 180 = 0. What is b? -20, -4, -1, 3/4 Factor 90c2/11 - 124c/11 - 32/11. 2(5c - 8)(9c + 2)/11 Determine p, given that 4p4/7 - 12p*3 + 632p*2/7 - 1968p/7 + 288 = 0. 2, 6, 7 Factor 2o5/5 + 6o*4/5 - 8o*2/5. 2o*2(o - 1)(o + 2)2/5 Find j, given that -3j*2 - 24j - 21 = 0. -7, -1 Let -6q4/11 + 120q*3/11 + 72q*2/11 - 1344q/11 - 1920/11 = 0. What is q? -2, 4, 20 Let -243y3/4 + 120y*2 - 231y/4 - 3/2 = 0. Calculate y. -2/81, 1 Factor 4v2 + 65904v + 271458576. 4(v + 8238)2 Suppose z3/2 - 7z/2 + 3 = 0. Calculate z. -3, 1, 2 Factor z*3/3 + 140z*2/3 + 1679z + 3174. (z + 2)(z + 69)2/3 Find r, given that -28r*2 + 724r - 600 = 0. 6/7, 25 Find f such that 4f3 - 116f*2 + 984f - 2016 = 0. 3, 12, 14 Factor 16m3 - 148m*2 + 260m - 56. 4(m - 7)(m - 2)(4m - 1) Determine m so that 2m3 + 18534m*2 + 57251526m + 58949987938 = 0. -3089 Determine c, given that -5c3 + 320c*2 + 3575c + 9250 = 0. -5, 74 Find z such that z*4/3 - 2z3/3 + z2/3 = 0. 0, 1 Factor 18t3 + 400t*2 + 2266t + 484. 2(t + 11)2(9t + 2) Factor -d3/4 - 291d*2/2 - 85833d/4 - 83521. -(d + 4)(d + 289)2/4 Factor -5n*3 - 15n*2 + 20n + 60. -5(n - 2)(n + 2)(n + 3) Let -46b*5 - 4b*4 + 92b*3 + 8b*2 - 46b - 4 = 0. Calculate b. -1, -2/23, 1 Let -5h3 - 460h*2 - 10105h + 22090 = 0. Calculate h. -47, 2 Factor -2b5/7 - 4b*4/7 + 6b*3/7 + 8b*2/7 - 8b/7. -2b(b - 1)*2(b + 2)*2/7 Let 4q*3/5 + 27q*2 + 98q/5 - 33/5 = 0. What is q? -33, -1, 1/4 Factor -4m3 + 484m*2 - 1852m - 2340. -4*(m -	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {y: 2, u: 2, p: 1, o: 3, b: 2, s: 2}. 1/660 Two letters picked without replacement from {i: 3, g: 4, d: 5, p: 7}. What is prob of sequence gg? 2/57 What is prob of sequence ukwj when four letters picked without replacement from wukwwkkwkkkjwkkkwu? 1/680 Three letters picked without replacement from qoqqqoqoqqq. What is prob of sequence qqo? 28/165 Three letters picked without replacement from kckkouzokukcekkokkk. Give prob of sequence kkz. 5/323 Calculate prob of sequence yy when two letters picked without replacement from {d: 1, y: 2, k: 4, x: 1}. 1/28 Two letters picked without replacement from znnmmnmnsxnmnxml. Give prob of sequence lm. 1/48 Two letters picked without replacement from iiiau. What is prob of sequence au? 1/20 Two letters picked without replacement from ggggwgwggww. What is prob of sequence ww? 6/55 Calculate prob of sequence dpp when three letters picked without replacement from rppeuuueerprpdprw. 1/204 Three letters picked without replacement from rtiitrccrncriitgtt. What is prob of sequence gtg? 0 Calculate prob of sequence zu when two letters picked without replacement from {u: 3, r: 1, p: 2, z: 2, d: 2, s: 4}. 3/91 Three letters picked without replacement from {f: 8, x: 2}. What is prob of sequence fxf? 7/45 What is prob of sequence udvv when four letters picked without replacement from ddvuv? 1/30 Two letters picked without replacement from yygkkpvgvxvvgkxgvxxv. Give prob of sequence yg. 2/95 Calculate prob of sequence gqo when three letters picked without replacement from {u: 3, g: 3, q: 2, o: 6, c: 1}. 6/455 Four letters picked without replacement from fjfhfhfjjfjdddfufjf. What is prob of sequence jufd? 5/3876 Calculate prob of sequence lz when two letters picked without replacement from bzblz. 1/10 What is prob of sequence bmx when three letters picked without replacement from {y: 3, w: 3, z: 3, x: 1, b: 2, m: 1}? 1/858 Calculate prob of sequence faf when three letters picked without replacement from {a: 1, f: 2, o: 2}. 1/30 Calculate prob of sequence txp when three letters picked without replacement from xktafapttfxfxftfa. 1/340 Four letters picked without replacement from yusuvuuuuuyyyyvyuqy. What is prob of sequence ysqy? 7/15504 What is prob of sequence dhh when three letters picked without replacement from {d: 2, n: 1, b: 1, h: 2}? 1/30 What is prob of sequence hxn when three letters picked without replacement from mnxnrhm? 1/105 Three letters picked without replacement from {l: 15, f: 4}. What is prob of sequence llf? 140/969 Three letters picked without replacement from {n: 11, y: 2}. What is prob of sequence nny? 5/39 What is prob of sequence dddd when four letters picked without replacement from ddddd? 1 Two letters picked without replacement from qjjqjxxqbxi. Give prob of sequence bx. 3/110 Calculate prob of sequence hk when two letters picked without replacement from {e: 11, h: 2, r: 1, k: 1}. 1/105 What is prob of sequence nj when two letters picked without replacement from xhnnnkjhn? 1/18 Three letters picked without replacement from {w: 2, t: 4, b: 4}. What is prob of sequence bbt? 1/15 Two letters picked without replacement from {f: 1, p: 3, r: 1}. Give prob of sequence pr. 3/20 Three letters picked without replacement from mam. Give prob of sequence mam. 1/3 Four letters picked without replacement from wgddqdewdd. What is prob of sequence eddg? 1/252 Calculate prob of sequence ee when two letters picked without replacement from eett. 1/6 Two letters picked without replacement from {n: 1, g: 1, d: 1, u: 6, w: 1, f: 1}. Give prob of sequence gn. 1/110 Four letters picked without replacement from orhcr. Give prob of sequence cror. 1/60 Two letters picked without replacement from {v: 5, j: 2, z: 2, i: 2, c: 1, d: 8}. Give prob of sequence vj. 1/38 Two letters picked without replacement from {k: 4, e: 3, p: 3, s: 3}. Give prob of sequence sk. 1/13 What is prob of sequence aco when three letters picked without replacement from xafco? 1/60 What is prob of sequence iirr when four letters picked without replacement from {r: 9, i: 9}? 6/85 Two letters picked without replacement from fllffll. What is prob of sequence fl? 2/7 Two letters picked without replacement from vmrvvvr. Give prob of sequence rv. 4/21 Calculate prob of sequence cwcc when four letters picked without replacement from wcwcccc. 1/7 Four letters picked without replacement from {v: 2, o: 1, p: 1, e: 1}. What is prob of sequence vvvv? 0 Calculate prob of sequence hhii when four letters picked without replacement from {i: 4, v: 1, h: 3}. 3/70 Two letters picked without replacement from ookgdogoookdooodg. What is prob of sequence dd? 3/136 Calculate prob of sequence gd when two letters picked without replacement from {d: 4, g: 16}. 16/95 Three letters picked without replacement from jxjjjxylpjjxjxjyjx. What is prob of sequence jpy? 1/272 What is prob of sequence bbb when three letters picked without replacement from {b: 9}? 1 Calculate prob of sequence lkl when three letters picked without replacement from {l: 6, k: 4}. 1/6 Four letters picked without replacement from juuuutffu. What is prob of sequence ujut? 5/756 Three letters picked without replacement from {f: 2, z: 2, v: 8, m: 5}. What is prob of sequence mfv? 1/51 Three letters picked without replacement from ywayaywayaa. Give prob of sequence ayy. 2/33 Three letters picked without replacement from ooqqqqoqqqoozo. What is prob of sequence oqq? 3/26 What is prob of sequence fr when two letters picked without replacement from {f: 1, a: 1, t: 1, e: 1, d: 2, r: 1}? 1/42 Two letters picked without replacement from llllwllwlll. What is prob of sequence ll? 36/55 What is prob of sequence bcc when three letters picked without replacement from {c: 16, b: 4}? 8/57 Calculate prob of sequence iyo when three letters picked without replacement from {i: 3, b: 4, y: 1, o: 3, m: 1, j: 6}. 1/544 Calculate prob of sequence ce when two letters picked without replacement from iiiecicigigggggcem. 1/51 Three letters picked without replacement from ttwwtwqqttwqrqtttq. What is prob of sequence rwt? 1/153 Two letters picked without replacement from {t: 1, l: 3, p: 4, n: 3, z: 3, s: 1}. Give prob of sequence lz. 3/70 Two letters picked without replacement from kukkkjptukuj. Give prob of sequence tu. 1/44 Three letters picked without replacement from {q: 2, j: 1, p: 1, n: 4}. What is prob of sequence njq? 1/42 Calculate prob of sequence zhk when three letters picked without replacement from sdskddddjddddddzdhdh. 1/3420 Three letters picked without replacement from {j: 4, w: 3, i: 6, t: 2}. Give prob of sequence iwj. 12/455 Four letters picked without replacement from {q: 11, c: 1}. What is prob of sequence cqqq? 1/12 Three letters picked without replacement from {u: 1, s: 2, k: 1, x: 1, b: 2}. Give prob of sequence bbu. 1/105 Calculate prob of sequence ee when two letters picked without replacement from {v: 1, s: 5, c: 1, e: 4, n: 1}. 1/11 Three letters picked without replacement from {y: 2, x: 1, k: 6, s: 2}. Give prob of sequence sxy. 2/495 What is prob of sequence hh when two letters picked without replacement from shzzsh? 1/15 What is prob of sequence pd when two letters picked without replacement from sepdsjj? 1/42 Calculate prob of sequence kvvv when four letters picked without replacement from {c: 2, v: 7, h: 6, k: 1, m: 4}. 7/3876 Four letters picked without replacement from fgzfzzzzffzfzfzfzff. Give prob of sequence fzzz. 63/1292 Four letters picked without replacement from lddldhldllldddllllll. Give prob of sequence llhl. 11/969 What is prob of sequence hh when two letters picked without replacement from hhhhhhhhhh? 1 What is prob of sequence ecxe when four letters picked without replacement from gxegfxefxggggcexfxg? 5/15504 What is prob of sequence dvtt when four letters picked without replacement from {d: 4, f: 1, v: 1, i: 1, t: 2}? 1/378 Calculate prob of sequence yyyy when four letters picked without replacement from jjjyyyyyyyjjyjjjyj. 7/170 What is prob of sequence pz when two letters picked without replacement from {s: 1, e: 4, m: 4, p: 3, z: 4}? 1/20 Calculate prob of sequence ttjf when four letters picked without replacement from fftqtfqssqsffffjtft. 1/969 Calculate pr	{ "pile_set_name": "DM Mathematics" }
se Let o = -87 - -89. Suppose ok - 3k = 36. Let p = 193 + k. Is p a composite number? False Suppose 2m - 34430 = -3w, 10m = 8m - 5w + 34438. Is m a composite number? False Is 63172 - -1 - (5/((-65)/91) - -1) a composite number? False Let t = 59252 - 21535. Is t a prime number? True Let g be (-1)/(1755/875 + -2). Let h = g + 504. Is h composite? True Suppose 5n - 243 = 117. Suppose 4206 = 75k - nk. Is k a prime number? False Let s(p) = 3p3 - 19p*2 + 9p - 15. Let y be s(6). Suppose q = -2x + 10533, yx - 8 = -x. Is q prime? True Suppose -2u - 4x + 37678 = 0, 0 = 5u - 10x + 9x - 94195. Is u a prime number? True Is (187304/(-16))/(((-110)/(-20))/(-11)) a prime number? False Suppose 406a - 441a + 3450755 = 0. Is a a prime number? False Let s = 20 - 16. Suppose -j = -0i - si + 14, 0 = 2i + 4j + 2. Suppose -ih + 6h = 333. Is h a composite number? True Suppose -3k = -2k - 15. Let o(w) = -134w*3 - 3w*2 - 2w + 1. Let l be o(-1). Let j = l + k. Is j a composite number? False Let a = -18 - -13. Let p = 134 - 135. Is 99 + a + 1/p composite? True Let m be 1/(-5) - (-4)/10374083. Suppose -5j - 107048 + 481096 = g, 5g = -2j + m. Is j composite? True Let s = 84 - 84. Suppose s = 2t + t - 4x + 40, -x - 25 = t. Let l(u) = -u*3 - 18u*2 + 22u - 29. Is l(t) prime? True Let a(y) = 216y2 - 7. Let t(q) = -215q*2 + 6. Let r be ((-3)/(-9) - 0) + 64/(-12). Let o(z) = ra(z) - 6t(z). Is o(-2) prime? True Let a be (-2)/12 - 38/(-12). Suppose 2b + 37 = -a. Is 2426((-8)/b + (-1)/(-10)) prime? True Suppose -219t = -184t - 20944735. Is t a prime number? True Let m(q) = -26q + 25. Let g(a) = 4a - 157. Let j be g(37). Is m(j) prime? False Let c(j) = 337 - 333 + 0j - 2j. Let f be c(1). Suppose 5i - 1590 = i + a, 393 = i + fa. Is i a prime number? True Let z(f) = 3 + 3189f - 7 - 3353f. Let j be z(-1). Suppose j + 119 = 9h. Is h a composite number? False Let g be (13 - 12)(1 - 93)-1. Is 6/8 + 235175/g a prime number? True Suppose -134l = -136l. Suppose 5w - 976 - 543 = 4i, -2i + 8 = l. Is w prime? True Let a = -25837 + 31911. Is a composite? True Let m = -149 - -151. Suppose 0 = 2j + 4f - f - 1438, -mj = 2f - 1434. Is j a prime number? False Let u = -232 + 232. Suppose -2w + 6 = u, -2w - 11392 = -5i + 19437. Is i a composite number? True Let w(k) = -k*2 - 14k + 3. Let z be w(-11). Let x = 34 - z. Is 2/6(-27045)/(-5) + x a composite number? False Suppose -2p = -19 + 239. Let d = -90 - p. Is (652/(-10))/(-2) + d/50 composite? True Let a be 72/92/4. Let u(l) = al2 - l2 - 2l + 5 + l3 - 2l. Is u(6) a composite number? True Let y = 36562 - 21443. Is y prime? False Let k(u) = 16u2 + 16u - 11. Let b(r) = -r*3 + 7r*2 - 3r - 18. Let l be b(4). Is k(l) a prime number? False Let b(j) be the first derivative of 12 + j*2 + 15j + 1/4j4 + 10/3j*3. Is b(-8) composite? False Suppose -3779 = -2n - 5o, 83o = 85o - 6. Is n prime? False Suppose 0 = 4r - 12, -n + 5r - 12 = 0. Suppose -10 = u - nu. Suppose 4g = ug - 1637. Is g composite? False Suppose -124n - 4f + 313984 = -120n, 5n = -2f + 392465. Is n composite? True Suppose 3i - 2219 = 5k - 368, -2k = -i + 617. Let x = i - 15. Suppose 3m = -5y + 1013, 0 = 4y - m - x - 222. Is y composite? True Let o be (-105)/6(94/(-10) + 1). Let k = 1115 + o. Let i = -571 + k. Is i a prime number? True Is 521210 - (-27 + (-28)/(-7)) prime? False Let f = -12702 + 24699. Suppose 0 = 9n - f - 4590. Is n a prime number? False Let t(c) = 2c*2 - 7c - 1. Let m be t(4). Suppose -ms + 3l + 5 = 11, s - 10 = -3l. Is (5 - 941)/(-4) - (0 - s) a composite number? True Let y(a) = a3 - a - 4. Let z be y(2). Suppose -8307 = -h + 2j - 6j, -zh = 5j - 16599. Is h prime? True Suppose 84f = 91f - 234352 - 251637. Is f prime? True Suppose -8z - 213834 = -514606 - 363348. Is z composite? True Suppose 0 = 47a - 48a + 4. Let c(k) = k*3 - 4k*2 + k + 3. Let g be c(a). Suppose gd - 1389 = 1096. Is d a composite number? True Let p(y) = -2y3 - 3y*2 - 23y - 26. Let t be p(-11). Is t/4 - (-39)/(-78) prime? True Let v = -16 - -195. Let p = v + -75. Let f = 35 + p. Is f composite? False Let m = -442 + 470. Let x(h) = 4h2 - 15h - 55. Is x(m) prime? False Let q(r) = 3r3 - r2. Let s be q(1). Suppose 0 = -4n - 5m - 280 + 2901, 1983 = 3n - sm. Is n prime? True Let v(p) = 3p*2 + 15p - 72. Let x be v(8). Is 1426416/x15 prime? True Suppose -163f - 20 = -167f. Is (-16)/4 + -63(f - 48) prime? False Let c = 67 + -62. Suppose 0 = -3n, 0q = 5q - cn - 3810. Let l = -509 + q. Is l a prime number? False Let g = -102 - -113. Let f(c) = 4c*2 - 6c - 37. Is f(g) composite? True Let v be -7 - (-20)/5 - -40. Is (v - 35) + 0 + (5476 - -1) a prime number? True Let o(a) = -2679a + 5717. Is o(-12) a prime number? False Suppose -24153911 = -207g - 5703622 + 20165768. Is g a composite number? False Let c(b) = -b*2 - b + 52. Let z be c(-7). Suppose -26u - zu = -15804. Is u prime? True Suppose 0 = 2f - 542 + 38. Suppose 248w = fw - 1204. Is w composite? True Let i = -6927 - -34898. Let u = i - 10129. Suppose -5l + 3f = -u, -l + 10709 = 2l + 2f. Is l prime? False Suppose 4l - 10 = 10. Suppose -lb - 6061 = -4a, 3a - 5b - 1519 = 2a. Suppose -2s + 300 = -a. Is s a prime number? True Is (3 - -5 - (-3755331)/(-19))-1 a prime number? True Suppose -4z - 240 = -12z. Suppose 0 = -zd + 14d + 108880. Is d prime? False Let k be 1 + (2 - 2) + 1. Suppose -kj = j - 3747. Is j a prime number? True Suppose 680554 - 377076 = 28j - 6494670. Is j a composite number? True Suppose 5v = -4 + 14. Let g be ((-5)/(20/16))/v. Is (98/(-21))/(g/1191) composite? True Let k(t) = -3t*3 - t - 5. Let b be k(-2). Let z = b - 12. Suppose -2d + zd = 3731. Is d a composite number? True Let h(k) = -292k + 91k + 39 - 142k. Let b be h(4). Let a = b + 2984. Is a a composite number? True Is ((-2)/8)/((-37)/4285636) a prime number? False Is -3 + (0 - 1) - (-8149 - 44) a composite number? True Let q be (-2)/(-14) + 616075/(-133). Let j = q + 10013. Is j a composite number? False Suppose 2z + 7n - 2n - 24 = 0, -4z - 8 = -4n. Suppose -u - zw + 3589 = 0, u - 4w = -2w + 3589. Is u prime? False Let x = 44 - -686. Let w = -619 + x. Is w a composite number? True Let y(f) = 57f - 8. Let l(v) = 59v - 8. Let d(w) = 3l(w) - 2y(w). Is d(9) a prime number? False Let i = -7953 + 11262. Suppose 0 = 7d - i - 25454. Is d composite? True Let q = -1644 - -35684. Suppose -14y + 29618 = -q. Is y a prime number? True Let d = 7758 - 13257. Let r = -3421 - d. Let a = r + 843. Is a a composite number? True Let t = 259380 - 150043. Is t composite? True Let l = -94 + 2701. Suppose -147d + 92300 = -82d. Let w = l - d. Is w prime? True Let w(p) = -800p - 3191. Is w(-35) composite? False Let q(t) = t3 + 51t*2 + 51t + 60. Let z be q(-50). Is (-33488)/35-17 + (-6)/z a prime number? False Let c = -29726 - -1269969. Is c a prime number? False Suppose 255l - 4897164 = 154813671. Is l a composite number? False Is -8 - ((-14)/5)/((-10)/(-1272325)) composite? False Let s(h) = 25h3 - h2 + 7h - 4. Let w be s(7). Suppose w + 45540 = 3x. Is x composite? True Suppose -n + 992 = 989, -n = -5m + 1640182. Is m a composite number? False Suppose 0 = -2w - 3w + 4n - 1003, -4w = 5n + 786. Let u = w - -254. Is u a prime number? False Suppose 0 = -3p + 112 - 2038. Let b = p - -1075. Suppose -7j - b = -2666. Is j composite? True Suppose 9868 = -4j + 4i, 4j + i + 13026 = 3133. Let d = 4265 + j. Is d a composite number? True Let m = 1181 + -630. Let y = m + -44. Suppose y = 3r - 0r. Is r a prime number? False Let h(w) = 291w2 - w - 3. Let v be h(2). Let q = v + -536. Is q prime? False Let h(n) = 400n*2 - 159n - 3826. Is h(-25) prime? False Suppose 4 + 5 = -3n. Let w(h) = -542h + 15. Is w(n) prime? False Suppose 0 = -5x - 3v + 1022068, -4v = 6x - x - 1022069. Is x prime? False Let d(b) = 93b2 - 104b - 1920. Is d(-41) composite? True Suppose -11l + 232803 = -9l + 7l. Is l a prime number? True Suppose 2j + 2y - 1118727 = -3y, 0 = -2y - 14. Is j a composite number? True Suppose -1321811 + 4180339 = 32j. Is j a prime number? True Let d(m) = m**3 -	{ "pile_set_name": "DM Mathematics" }
3, 46093 What are the prime factors of 404098143? 3, 17, 73, 108541 What are the prime factors of 1923423166? 2, 7, 19626767 List the prime factors of 14084631. 3, 11, 47, 1009 List the prime factors of 5547377749. 25229, 219881 List the prime factors of 137476149. 3, 263, 174241 What are the prime factors of 258962206? 2, 129481103 What are the prime factors of 7720382911? 59621, 129491 What are the prime factors of 2630264618? 2, 21163, 62143 List the prime factors of 141956412. 2, 3, 13, 909977 List the prime factors of 12998392. 2, 11, 147709 List the prime factors of 46868784. 2, 3, 113, 8641 List the prime factors of 46757566. 2, 37, 631859 List the prime factors of 401746499. 7, 11, 17, 27901 What are the prime factors of 223975240? 2, 5, 5599381 List the prime factors of 165255922. 2, 13, 6355997 List the prime factors of 115100392. 2, 11, 653, 2003 What are the prime factors of 53899835? 5, 11, 29, 47, 719 List the prime factors of 244516448. 2, 11, 694649 What are the prime factors of 122819022? 2, 3, 113, 60383 What are the prime factors of 959369158? 2, 11, 43607689 List the prime factors of 6288212368. 2, 239, 479, 3433 List the prime factors of 37371552. 2, 3, 389287 What are the prime factors of 5390757? 3, 598973 What are the prime factors of 84042146? 2, 42021073 List the prime factors of 20957025. 3, 5, 23, 12149 List the prime factors of 212788765. 5, 7, 89, 68311 What are the prime factors of 3674866345? 5, 734973269 List the prime factors of 38481388. 2, 11, 43 List the prime factors of 716889104. 2, 239, 187471 List the prime factors of 19818691. 19, 1043089 What are the prime factors of 2247823334? 2, 17, 37, 67, 26669 List the prime factors of 437261225. 5, 499, 35051 What are the prime factors of 374671823? 17, 22039519 What are the prime factors of 520316325? 3, 5, 770839 List the prime factors of 17306393. 13, 1331261 What are the prime factors of 1097071480? 2, 5, 23, 1192469 List the prime factors of 1568144142. 2, 3, 87119119 What are the prime factors of 1660078300? 2, 5, 16600783 List the prime factors of 27462975. 3, 5, 366173 List the prime factors of 20820579. 3, 13, 29, 41, 449 List the prime factors of 1130655782. 2, 47, 12028253 List the prime factors of 184938668. 2, 2851, 16217 What are the prime factors of 3834817126? 2, 7, 17, 2301811 List the prime factors of 2903105487. 3, 17, 113, 137, 3677 What are the prime factors of 290238084? 2, 3, 8062169 List the prime factors of 90361400. 2, 5, 37, 12211 List the prime factors of 1919072225. 5, 7, 139, 78893 List the prime factors of 21564859. 523, 41233 List the prime factors of 536814166. 2, 7, 31, 47, 26317 List the prime factors of 3066398503. 7, 438056929 What are the prime factors of 852191825? 5, 29, 1175437 List the prime factors of 264399683. 264399683 What are the prime factors of 205665799? 41, 59, 85021 List the prime factors of 2607812744. 2, 43, 59, 128489 What are the prime factors of 14648254? 2, 17, 25343 List the prime factors of 2125264950. 2, 3, 5, 19, 248569 List the prime factors of 10949870. 2, 5, 17, 41, 1571 What are the prime factors of 1392867500? 2, 5, 191, 2917 What are the prime factors of 81037827? 3, 13, 17, 503 List the prime factors of 166270974. 2, 3, 27711829 What are the prime factors of 361582558? 2, 180791279 List the prime factors of 30187365. 3, 5, 13, 154807 List the prime factors of 2812041675. 3, 5, 277, 45119 List the prime factors of 24487899. 3, 8162633 What are the prime factors of 498558771? 3, 31, 1786949 List the prime factors of 141145364. 2, 457, 77213 List the prime factors of 74853005. 5, 59, 89, 2851 What are the prime factors of 197290519? 197290519 What are the prime factors of 148918849? 83, 1794203 List the prime factors of 32910662. 2, 83, 198257 List the prime factors of 438366367. 438366367 What are the prime factors of 1073257063? 167, 6426689 List the prime factors of 97229707. 19, 727, 7039 What are the prime factors of 651855341? 397, 1641953 List the prime factors of 818555749. 11, 151, 461, 1069 List the prime factors of 215457408. 2, 3, 2309 What are the prime factors of 6736370262? 2, 3, 683, 1643819 What are the prime factors of 221333288? 2, 11, 271, 9281 List the prime factors of 17448459. 3, 7, 29, 4093 What are the prime factors of 458037360? 2, 3, 5, 11, 151, 383 List the prime factors of 441455057. 16981, 25997 What are the prime factors of 513123868? 2, 293, 437819 What are the prime factors of 114631132? 2, 7, 11, 372179 List the prime factors of 7170289841. 11, 13, 139, 181, 1993 What are the prime factors of 104687966? 2, 52343983 List the prime factors of 369398032. 2, 17, 23, 137, 431 List the prime factors of 40903212. 2, 3, 7, 486943 What are the prime factors of 86525465? 5, 13, 102397 List the prime factors of 264634860. 2, 3, 5, 7, 29, 21727 List the prime factors of 195423098. 2, 13, 71, 105863 List the prime factors of 2239239826. 2, 409, 647, 4231 What are the prime factors of 106560861? 3, 11, 3229117 List the prime factors of 108442882. 2, 331, 163811 List the prime factors of 256391589. 3, 85463863 What are the prime factors of 42861635? 5, 71, 120737 What are the prime factors of 25154267? 73, 317, 1087 What are the prime factors of 576331663? 576331663 What are the prime factors of 1855315661? 389, 4769449 What are the prime factors of 237248083? 237248083 List the prime factors of 332220244. 2, 19, 1543, 2833 What are the prime factors of 1543674592? 2, 307, 157133 List the prime factors of 1744777. 1744777 What are the prime factors of 19636729? 7, 2805247 What are the prime factors of 1961849152? 2, 1723, 17791 List the prime factors of 2025656499. 3, 59, 11444387 What are the prime factors of 5034676580? 2, 5, 37, 113, 60209 What are the prime factors of 53616082? 2, 13, 23, 89659 List the prime factors of 92713570. 2, 5, 97, 95581 List the prime factors of 46664848. 2, 2916553 List the prime factors of 21963518. 2, 53, 383, 541 What are the prime factors of 84528351? 3, 31, 302969 List the prime factors of 621344514. 2, 3, 7, 14793917 List the prime factors of 1595282657. 21347, 74731 List the prime factors of 82980164. 2, 20745041 List the prime factors of 676943249. 31, 21836879 List the prime factors of 55900899. 3, 1153, 5387 What are the prime factors of 691364438? 2, 19, 257, 70793 What are the prime factors of 1865440258? 2, 11, 53, 1599863 List the prime factors of 1326379083. 3, 17, 1529849 What are the prime factors of 52864974? 2, 3, 43, 7589 List the prime factors of 7234800. 2, 3, 5, 6029 What are the prime factors of 4755041303? 1423, 3341561 List the prime factors of 2566861421. 37, 69374633 What are the prime factors of 14048317? 14048317 What are the prime factors of 5431210244? 2, 83, 16359067 What are the prime factors of 3982008061? 3982008061 What are the prime factors of 2831234740? 2, 5, 17, 489833 List the prime factors of 1982776. 2, 247847 What are the prime factors of 282723596? 2, 31, 2280029 List the prime factors of 50351029. 131, 384359 What are the prime factors of 59904129? 3, 2339, 8537 What are the prime factors of 760071213? 3, 11, 7677487 List the prime factors of 1636441018. 2, 47, 1163, 14969 List the prime factors of 1383102629. 1213, 1140233 List the prime factors of 2714149673. 3049, 890177 List the prime factors of 327371849. 7, 67, 698021 What are the prime factors of 2302862592? 2, 3, 43, 137, 509 What are the prime factors of 977688585? 3, 5, 89, 101, 2417 What are the prime factors of 134554708? 2, 33638677 What are the prime factors of 55338351? 3, 29, 636073 List the prime factors of 633735829. 633735829 What are the prime factors of 102799289? 17, 1543, 3919 What are the prime factors of 140177438? 2, 103, 457, 1489 What are the prime factors of 1046483294? 2, 47, 347, 32083 List the prime factors of 1564326136. 2, 41, 1667, 2861 List the prime factors of 38855991. 3, 12951997 What are the prime factors of 289987217? 13, 71, 211, 1489 List the prime factors of 526126003. 13, 149, 271619 List the prime factors of 247012053. 3, 29, 71, 39989 What are the prime factors of 2592498462? 2, 3, 37, 11677921 List the prime factors of 6218349779. 6218349779 What are the prime factors of 180037902? 2, 3, 11, 272784	{ "pile_set_name": "DM Mathematics" }
s*3 + b + us*2 + ws and give u. -44 Rearrange 2m2 - 5m*2 - 36 + 0m*2 + 5m*2 to the form hm*2 + f + pm and give h. 2 Rearrange (-4 + 4 - 12v)(0 - 1 + 3) + 9v - 31 + 64 - 35 to hv + t and give t. -2 Rearrange (24o - 610o - 313o)(-2o3 + 0o + 0o) to the form ao*2 + zo*4 + f + ko*3 + po and give z. 1798 Rearrange -2k4 - 5k*2 + 29 + 3k3 + k2 + 6k2 to yk + gk2 + hk*4 + ok*3 + j and give j. 29 Express -2h + 2h3 - 2768 + 5h + 2736 as xh + vh*3 + o + wh*2 and give v. 2 Express (1432k - 313 + 313 - 386k)(k - 3k - k) in the form ak*2 + ok + b and give a. -3138 Rearrange -t2 + t3 + 264t - 265t - 34t3 + 2t*4 to the form ut*4 + bt*3 + g + ot*2 + wt and give o. -1 Express -g3 + g3 - 2g3 + 3g3 - g2 + g - 10g4 in the form ig*4 + jg + a + pg2 + wg*3 and give a. 0 Express (-h + h + h)(-h*2 + 3850 - 3850 + (2h - h + 3h)(-h + 0h + 0h)) as v + lh2 + jh + dh3 and give d. -5 Rearrange 2f*2 - 566 - 7f - 17f + 24f - 4f2 to the form a + if*2 + gf and give a. -566 Express y - 12y2 + 0y + 4y + 183 - 183 as w + ny + vy2 and give w. 0 Rearrange x3 - 11x*3 + 2797x - 2800x - 6x*2 to nx + ux2 + m + gx*3 and give n. -3 Express (-60 + 1 - 73)(-z + z + z)(-6z + z - 8z) as y + gz + bz2 and give b. 1716 Rearrange -12m*3 - 3 + 6 - 1 - 3 - 5m*4 + 4m*3 - 2m + 2m2 to dm*4 + gm + lm2 + k + pm*3 and give l. 2 Rearrange -32y*2 + 18y*2 - 50 + 23 to the form py + ty2 + o and give o. -27 Rearrange -j3 - 116j + 229j - 15j*2 - 116j to the form vj2 + g + hj + yj3 and give v. -15 Rearrange (-8u + 11u - 17u)(-3 + 3 + 2 + (-1 + 0 - 2)(5 - 2 - 1))(3u2 - u2 + 0u2) to the form wu*2 + f + cu + pu3 and give p. 112 Rearrange (105 + 97 - 9)(-x*2 + 3x*2 + 3x*2) + 2x*2 - 2x*2 - 2x*2 to nx + t + lx2 and give l. 963 Express 17 - 30 + 9 + a2 + 0a3 - a3 as ja + oa*3 + p + na*2 and give n. 1 Express (-8 - 2w - 2w + 3w)(-80 - 13w + 80) in the form d + zw + fw*2 and give f. 13 Rearrange (0 + 0 - 1)(6 + 0 - 4)(24p - 9p + 49p) to dp + n and give n. 0 Rearrange 2078i*2 - 2069i*2 + 4 - 3 to x + qi + li2 and give l. 9 Rearrange (276c + 58c - 104c)(-2 + 0 + 3)(-2c - 5c + 4c + c3) to the form sc*2 + yc*4 + zc + mc3 + d and give y. 230 Rearrange (-3a + 3 - 3)(-76a - 44a + 7a) to oa + j + na*2 and give o. 0 Rearrange 87d + 301d - d2 + 82d to bd + zd*2 + p and give b. 470 Express 10z*2 - 11 - 15 - 10z*4 - 12 + 6z4 - z3 + 40 as kz2 + hz*4 + nz*3 + c + dz and give h. -4 Rearrange 8h3 - 15 - h2 + 15 - 2h*2 + 45h*3 to the form zh*2 + wh*3 + yh + l and give z. -3 Express -29 - 65 - 2x - 33 as i + fx and give i. -127 Express -29n2 + 62n*2 - 34n2 - n + n4 - 2 as fn + ln*2 + yn*4 + qn*3 + k and give k. -2 Express -105 + 189 + 0d - 468 - 2d as h + cd and give h. -384 Express 97 + i*3 + 12 + 188 - 41i + 41i as y + ai + qi2 + pi*3 and give p. 1 Rearrange -12s*2 + 65s*2 + 52s*2 + 43s*2 to is + ps2 + o and give p. 148 Express (-11o*4 - 36o*3 + 36o*3)(3 + 0 - 2 + (-3 + 2 - 1)(1 + 1 - 4)) in the form y + ro + vo4 + ko*2 + go3 and give v. -55 Express (-y3 - 2y3 + 2y*3)(0y + 0y + 2y) + 176y*3 - 178y*3 - 3y*4 + 2y - 5y in the form ty + vy2 + r + oy*4 + ay*3 and give t. -3 Express -314 + 2h*2 - 206h + 314 - 390h in the form gh + xh2 + p and give x. 2 Rearrange -88j - 110j2 + 50j + 37j - 1 to sj*2 + t + qj and give q. -1 Rearrange -143 - 70 - 40 - 12h2 - 25 + 14h*2 to the form kh + sh2 + x and give s. 2 Rearrange -1227b*2 + 1228b*2 - 16 - 26 to the form ib*2 + j + kb and give i. 1 Rearrange (109 - 42 + 37)(4 + 3 - 5)(0 + 0 + j - j - 2 + 2 + (j - j + j)(-1 - 2 + 1) + (-7 + 6 - 2)(-1 + 1 - j)) to c + xj and give c. 0 Rearrange -79k + 34k + 103k + 61k + 103k to u + ik and give i. 222 Express 0 - 26 - 2s - 7s - 2 as ds + t and give d. -9 Express 627j + 22 + 6 - 28 as a + zj and give a. 0 Express (-192b3 - 99b*3 - 63b*3 + 117b*3)(-2b + 4b + 0b) as vb + w + gb2 + lb*3 + kb*4 and give k. -474 Rearrange -t - 7 + 1 + 0 - 4t2 - t4 - 68t3 + 70t*3 - 1 to rt*4 + c + bt*3 + nt + at2 and give c. -7 Express 4n - 4n - 2n + 0n + 4n + 557 in the form qn + g and give g. 557 Rearrange (-2j - 1 + 1)(-33j*2 - 53678j + 53678j - 4) to the form vj + ij3 + bj*2 + p and give i. 66 Express (-2098v - 1001v - 2668v - 5459v + 1762v)(-3v + 5v - 3v) as a + pv + qv*2 and give p. 0 Rearrange (2b - 67 + 18 + 28)(-3 + 5 - 3 - 2b) to m + ib2 + kb and give i. -4 Rearrange h - 10868 + 5341 + 5246 - 5h2 - h to the form lh + mh2 + x and give x. -281 Rearrange (2 - 2 + k - 2k + 4k + 0k + (1 + 0 - 3)(-k + k - 2k) - k + 1 - 1)(5 - 4 + 3) to qk + b and give q. 24 Express -1 - 1 - 21d + 2 + 2 - 5 in the form a + zd and give a. -3 Express (0 + 0 - 2)(-2785q - 625q + 321q + 177q) in the form y + oq and give o. 5824 Express 3w2 - 5w*2 - 3w*2 + (4w - 5w + 2w)(0w + 0w + w)(0 + 5 + 1) in the form sw + c + qw*2 and give q. 1 Rearrange -13817c*2 + 7 + 13817c*2 - 10c*3 to hc*3 + q + oc + xc2 and give q. 7 Express 4f*2 - 8f + 2 + 6f - 6f*2 + 17f*3 - 4 in the form gf*3 + yf + uf2 + t and give t. -2 Express 11x + 11x - 27x + 44x2 + 10x as ax + mx*2 + u and give a. 5 Express -9y + 32y2 + 7y - 5y3 + 5y3 + 2 + y4 - 6y3 + 4y*3 as wy*2 + hy*4 + gy*3 + vy + r and give g. -2 Rearrange 0 + 153o + 1 - 2 - 6o - 5o to the form q + to and give t. 142 Express -48f + 7 - 47f + 97f - 58 as h + uf and give h. -51 Express -116a2 - 209a*4 + 212a*4 - 72a + 115a2 - 1 as wa*2 + t + va + ra4 + sa*3 and give t. -1 Express (7 - 4 - 13 + (0 - 1 - 1)(4 - 4 + 2) + 0 - 1 + 0 + 2 - 2 - 1)(-16 - 11v + 16) in the form pv + u and give p. 176 Rearrange -2v4 - v4 - v*2 - 16v - 6v4 + 2v*2 to iv*4 + a + gv + jv2 + mv*3 and give i. -9 Express (-5 + 3 + 5 + 8 + 3 - 1 + (-1 - 3 + 6)(1 - 1 + 1))(r - 4r + 0r) in the form qr + i and give q. -45 Rearrange 3d + 0d - d + 1 + (-2d + d - d)(-7 - 3 - 16) to the form wd + c and give w. 54 Express (2r + 0r + 3r)(31r + 58r + 2r) - 2r + 2r*2 + 2r in the form s + mr2 + zr and give m. 457 Rearrange -13 + 6 + 6 - 39f - 42f to the form lf + n and give n. -1 Express 4q*3 + 4 - 435q + 435q + q2 as t + nq*3 + xq*2 + zq and give t. 4 Express 34 + 591u2 - 36 + 2 in the form j + mu*2 + au and give m. 591 Express (-147 + 147 - 4d)(-2 + 3d + 20d - 51d) as t + ad*2 + cd and give a. 112 Express (-439h - 1672 - 1675 + 3347)(0h + 0h + 6h) as wh*2 + ah + k and give w. -2634 Rearrange (-7i2 - 6 + 6)(16 - 17 - 5i + 3i) to the form ki2 + w + bi + ai3 and give k. 7 Express 139g - 44g + 61g as u + yg and give u. 0 Rearrange (-139 + 58 - 57 - 19)(-123 + 5v2 + 123) to uv + h + cv2 and give c. -785 Express 1807n*4 + 2n*2 + 28n3 + n2 - 1805n4 + n - 2 - n2 in the form on + kn3 + c + dn*2 + vn*4 and give k. 28 Express (-232r*4 + 118r*4 + 121r*4 - 2r*2)((3 + 0 + 1)(1 + 0 + 0) + 1 - 1 - 1) in the form qr*3 + dr*4 + k + ur*2 + xr and give d. 21 Rearrange -71 + 149 - 455i - 78 to p + ni and give n. -455 Rearrange (0 - 2 - 3 + (2 + 2 + 2)(1 + 2 - 1))(2y - 4y - y)(-2 - 1 + 1) to the form p + ly and give l. 42 Rearrange -80i + 33i - 7 - 11 + 35i to d + ci and give c. -12 Express 296l2 - 715l*2 + 53l*2 - 324l*2 - 1366l*2 in the form rl + q + il2 and give i. -2056 Express -24b*2 + 0b3 + 2 - b3 + 0 + 3b4 - 5b*4 in the form rb*3 + ob + ab4 + t + fb*2 and give t. 2 Rearrange 18d - 2d2 + 34 - 7 - 11 - 15 to fd + l + qd2 and give q. -2 Express p3 + 10p*4 - 4p2 + p2 - 4p2 - p + 6p*2 + 15p*4 as tp + wp3 + kp*4 + y + gp*2 and give g. -1 Rearrange (-3 + 0 + 0)(-3 + 5 + 3)(-14 + 14 - i) to the form zi + a and give z. 15 Express -87x + 16 + 91x	{ "pile_set_name": "DM Mathematics" }
rt(2) + 660 Simplify (-5((2sqrt(130))/sqrt(5))/(sqrt(18)6))2. 325/81 Simplify -3 + ((sqrt(76) + sqrt(76) + (sqrt(76) - (sqrt(76)21 + sqrt(76))) + sqrt(76))/sqrt(4) - -1sqrt(2299)6)2. 85288 Simplify ((0 + sqrt(1216) + sqrt(19) - (3(sqrt(19) + sqrt(19) + 0))*2) + -5)-5. -45sqrt(19) + 3445 Simplify (-1sqrt(224)3 + sqrt(224))/((-5(-2sqrt(64) - sqrt(64)))/sqrt(8)). -4sqrt(7)/15 Simplify (4(sqrt(425) - sqrt(425)4))2 - ((sqrt(425) - (sqrt(425) + 3 + sqrt(425) - sqrt(425)) - sqrt(425)) + sqrt(425) + sqrt(425) + sqrt(425) + 4)2. -20sqrt(17) + 59499 Simplify (3(1((sqrt(175) + -2 - sqrt(175)) + sqrt(175)) + -2(sqrt(175) + 0))6)2. 6480sqrt(7) + 57996 Simplify -2 + (-5sqrt(1300))2 + 0 + (4sqrt(1300))*2. 53298 Simplify ((1 + sqrt(243))-4 - (sqrt(243) + 1(sqrt(243) + 1))) + 2. -54sqrt(3) - 3 Simplify (3(sqrt(192) - sqrt(192)-2)/sqrt(12))/((sqrt(80) + 2sqrt(80)6)/sqrt(10)). 9sqrt(2)/13 Simplify ((sqrt(2057) - -3(sqrt(2057) - (-1 + sqrt(2057)) - sqrt(2057))) + 1sqrt(2057) + 0 + -4)2. 22sqrt(17) + 2058 Simplify (3 + (-5 + sqrt(1100) + (1 + (sqrt(1100) - (sqrt(1100) + 2)) - sqrt(1100)) + sqrt(1100) + -3 + sqrt(1100)2)4)*2. -7920sqrt(11) + 159489 Simplify ((-5sqrt(30)2)/(1(sqrt(10) + sqrt(40)/sqrt(4) - sqrt(10))))22. 600 Simplify (sqrt(19) + sqrt(2736))1 + -5 - (-3 + 1 + sqrt(304)). -3 + 9sqrt(19) Simplify -21((sqrt(42)/sqrt(96)-4)2 + 2)6. -108 Simplify (sqrt(432)-3)2 + (sqrt(12)/sqrt(4)-2)*2 + 2. 3902 Simplify -3 + -3 + (11sqrt(2057) + -4(sqrt(2057) + 1))*2. 264sqrt(17) + 18523 Simplify ((sqrt(6)/sqrt(3) + -2 - sqrt(2) - sqrt(18)1) + -1 + 6(sqrt(4)/sqrt(2) - sqrt(2)))*2 + -1. 18sqrt(2) + 26 Simplify ((sqrt(204) - 2sqrt(204))1 - 2sqrt(204)-5)/(sqrt(108)/(sqrt(9)-2-6)). 108sqrt(17) Simplify (4-2(sqrt(119) + sqrt(119)-3))/((sqrt(7) - (sqrt(700) - sqrt(700)1)) + 1sqrt(28)/sqrt(4)). 8sqrt(17) Simplify -4((2 + sqrt(11))*23 + (sqrt(110)/sqrt(5))/sqrt(2))2. -360 - 104sqrt(11) Simplify -2sqrt(12) + 0 + sqrt(75) - ((sqrt(432) + -3)2 + sqrt(432)). -441 + 61sqrt(3) Simplify (5(sqrt(88) - ((5sqrt(88)-1 - sqrt(88)) + sqrt(88)))/(sqrt(88)/sqrt(11)-3 - sqrt(8)))*2. 2475/4 Simplify -5 + -4 + (-4sqrt(63)5)/sqrt(9) + 0. -20sqrt(7) - 9 Simplify ((sqrt(18)/(4sqrt(12) + sqrt(3)))/((sqrt(27)/sqrt(36) - sqrt(3)) + (sqrt(108) - sqrt(108)-1) + sqrt(108)))*2. 8/99225 Simplify (sqrt(931) - -2sqrt(931)-5)2 + ((-4sqrt(133)2)/sqrt(7))2 + -5. 76622 Simplify (-2(-2 + 3 + (-1sqrt(98)-4 + sqrt(98) - (-4(sqrt(98) + -1) - sqrt(98)))))2. -1680sqrt(2) + 39236 Simplify -3 + (-3 + 1sqrt(1100))2 + (sqrt(1100) + (-3sqrt(1100) - sqrt(1100))4)2 + 3. -60sqrt(11) + 248609 Simplify (sqrt(468) + 1 + sqrt(468))-5 + sqrt(468) - (sqrt(468)1 + -5) - (sqrt(52)-1-5)/(-2sqrt(16) + sqrt(16)). -115sqrt(13)/2 Simplify ((sqrt(240)1 + sqrt(135)2)/((sqrt(108) - 1sqrt(108) - sqrt(108)) + sqrt(3) + (sqrt(3) - (sqrt(3) - sqrt(6)/(sqrt(8)/sqrt(4))))))2. 125/4 Simplify (-4sqrt(300) + sqrt(3) + -5)*2 + sqrt(9)/(3sqrt(363) - sqrt(3)). 12481sqrt(3)/32 + 4588 Simplify 3 + (sqrt(108) + sqrt(108) + (-1 + sqrt(108))22 - -2(sqrt(108) + (sqrt(108) - sqrt(108)1))). 221 Simplify (2sqrt(216)6)/(-1sqrt(512)2). -9sqrt(3)/4 Simplify sqrt(30)/(sqrt(24) + sqrt(6)) + (sqrt(50)/sqrt(90))2 - sqrt(80)4-3. 5/9 + 145sqrt(5)/3 Simplify (-1sqrt(16))/sqrt(8)3 - (-4 + 6(1sqrt(2) - sqrt(2)))*2. -16 - 3sqrt(2) Simplify sqrt(1800)-3 - (-5sqrt(128)-4)2. -51200 - 90sqrt(2) Simplify ((sqrt(132) - 1sqrt(132)3)/sqrt(4))/(sqrt(99)-24). sqrt(3)/12 Simplify 2 + sqrt(2) + -4 - sqrt(2) - sqrt(2) - sqrt(18)/(sqrt(27)/sqrt(3)) - (-5 + 1sqrt(72)). -8sqrt(2) + 3 Simplify (sqrt(44)-1 - -1sqrt(1584))*2 - 35(sqrt(11) + 0). -15sqrt(11) + 1100 Simplify (sqrt(13) + sqrt(1300)/sqrt(4) - (1sqrt(117))2 - ((sqrt(117) + -3)2-6 - sqrt(117))) + 3. -99sqrt(13) + 642 Simplify 0 + (1 + (sqrt(605) - ((-2 + sqrt(605) - sqrt(605))2 - sqrt(605))) - -3(sqrt(605) + -1)*2). -44sqrt(5) + 1815 Simplify (-5 + ((sqrt(832) + sqrt(832)1)1 + sqrt(832) - (-1 + -2 + sqrt(832) + sqrt(832))) + 3)*2. 16sqrt(13) + 833 Simplify (0 + sqrt(60)/(sqrt(12)1-4))*2-4 + 2. 3/4 Simplify 5 + (1(-2 + sqrt(2736)) - (4sqrt(2736) + 5 + sqrt(2736))). -48sqrt(19) - 2 Simplify (3 + sqrt(1584))23 + sqrt(1584) + (1(sqrt(1584) + sqrt(1584) + -3sqrt(1584) + sqrt(1584)))*2. 228sqrt(11) + 4779 Simplify (5 + (sqrt(250) - sqrt(10))/sqrt(2)-6 + 5)25. -2400sqrt(5) + 14900 Simplify ((sqrt(208) + -1)2 + -1 - sqrt(208))2 + 2(sqrt(208) + sqrt(208) + 2)2-4. -6272 - 280sqrt(13) Simplify 6((sqrt(1573) - (sqrt(1573)-1 + sqrt(1573) - sqrt(1573)))1 - (((1sqrt(1573) + 0)2 - sqrt(1573) - sqrt(1573)) + sqrt(1573))). -9438 + 198sqrt(13) Simplify 3(sqrt(80)-2 + (sqrt(60)/sqrt(2))/sqrt(6) + sqrt(15)/sqrt(3)-3 + sqrt(25)/(sqrt(5)-2)). -63sqrt(5)/2 Simplify (sqrt(119) - (sqrt(119) - (((sqrt(119) - (sqrt(119) + -3sqrt(119)) - sqrt(119))-5 - sqrt(119)) + sqrt(119))))/(sqrt(175)4) + 5. -sqrt(17)/2 + 5 Simplify -2 + 1 + (3 + sqrt(2057) + 2 + 4 + 1)*2. 220sqrt(17) + 2156 Simplify 0 + -5 + sqrt(7) + sqrt(28)/sqrt(4) - (((sqrt(252) - 1sqrt(252)) + sqrt(252))2 + -2). -255 + 2sqrt(7) Simplify -2 + (sqrt(26) - sqrt(260)/(sqrt(10) - sqrt(10)2))/(sqrt(2) + -4-3sqrt(2) + sqrt(2)). -2 + sqrt(13)/7 Simplify ((-1sqrt(4455) + sqrt(4455))1)/(3sqrt(1584)-1 - sqrt(1584)). 0 Simplify -3 + -5 + 2sqrt(252) + sqrt(77)/(sqrt(11) + (sqrt(11) - (sqrt(11) - sqrt(99)/(sqrt(27)/sqrt(3)) - sqrt(11)) - sqrt(11))). -8 + 25sqrt(7)/2 Simplify (5((sqrt(567) - (-2 + sqrt(567)))2 + 2))2. 900 Simplify (-6-4((-3 + sqrt(175))5 + 3))*2. -345600sqrt(7) + 2602944 Simplify sqrt(187)/(sqrt(22)/sqrt(2)) + sqrt(816)/sqrt(3) - 1sqrt(1700)-4. 45sqrt(17) Simplify (sqrt(343)/(-2sqrt(63)))/(sqrt(14)/(sqrt(384)/sqrt(12))). -2sqrt(7)/3 Simplify (6(sqrt(72)-1)/sqrt(3))/(-3sqrt(16)/sqrt(2)5) + 0. 2sqrt(3)/5 Simplify 3((-2 + sqrt(500)1)*2 + 3). -120sqrt(5) + 1521 Simplify (3sqrt(320) + sqrt(320) - sqrt(20))/(sqrt(144)4). 5sqrt(5)/8 Simplify ((2sqrt(49) + sqrt(49) + sqrt(49))/sqrt(7) + (sqrt(7) + (sqrt(7) - sqrt(28)) - sqrt(7)) + 1 + (-3 + -1 + sqrt(7) - sqrt(847)-1))2. -90sqrt(7) + 1584 Simplify (sqrt(77) - sqrt(77)-23 - sqrt(77))/(65sqrt(11) - sqrt(11)). 6sqrt(7)/29 Simplify (5sqrt(171)-1 - (sqrt(171) - -3sqrt(171)1 - sqrt(171)))/(sqrt(36)/(sqrt(16)/sqrt(4)5)). -40sqrt(19) Simplify (-2sqrt(228)2)/(sqrt(132)/(sqrt(11)2 + sqrt(11))) + -1. -12sqrt(19) - 1 Simplify (-5sqrt(110)5 + sqrt(110) + sqrt(110))/(sqrt(320)/sqrt(2)). -23sqrt(11)/4 Simplify (sqrt(200)/sqrt(160)-3)/((sqrt(484) - 2sqrt(484) - sqrt(484))6). sqrt(5)/176 Simplify (sqrt(3) - 1sqrt(192))*2 + 3 + (sqrt(648) + -2sqrt(648) - sqrt(648) - sqrt(18))/sqrt(6). -13sqrt(3) + 150 Simplify ((4 + ((sqrt(684) + 5)4 - sqrt(684)))1)2. 864sqrt(19) + 6732 Simplify 3 + (sqrt(49)/(sqrt(7) - 3sqrt(7)))2 + (5sqrt(63))/sqrt(9). 19/4 + 5sqrt(7) Simplify 0 + (3 + -2 + -2sqrt(1331) + -1)*24. 21296 Simplify (5 + (sqrt(12)/sqrt(4) + -2 + 2)-6 + 4)2. -108sqrt(3) + 189 Simplify -6((6((sqrt(3) - sqrt(3)5) + sqrt(3)))2 - sqrt(216)/sqrt(8)). -5832 + 18sqrt(3) Simplify 1(-3((sqrt(243)1 - sqrt(243)) + sqrt(243)) + -4 + 2sqrt(243))2. -18sqrt(3) - 8 Simplify (4 + -1sqrt(1573)31)-1. -4 + 33sqrt(13) Simplify 4(sqrt(99)2 + -1 + -5sqrt(99) + -5)*2. 432sqrt(11) + 3708 Simplify (sqrt(33) + 5sqrt(528))/(sqrt(1584) + sqrt(1584)2). 7sqrt(3)/12 Simplify ((5(sqrt(156) + sqrt(156)-2)1)/((sqrt(120)1 - sqrt(120) - sqrt(120))/sqrt(10) + (sqrt(12) - (sqrt(96)2 + sqrt(96))/sqrt(8))))*2. 325/9 Simplify -3-4((sqrt(1700)3)*2 + sqrt(1700)) + -3. 120sqrt(17) + 183597 Simplify ((2sqrt(5082) - sqrt(5082))-3)/(sqrt(18)/(1sqrt(27))). -99sqrt(7) Simplify -5 + ((4(sqrt(5) + sqrt(10)/sqrt(2)) + sqrt(10)/sqrt(2)-2)-3)2. 1615 Simplify (-3(sqrt(147)-2)/sqrt(7))/(-22sqrt(147) + sqrt(147) - sqrt(147)) + -2. -2 - 3sqrt(7)/14 Simplify (sqrt(252)/(-5-2sqrt(12) + sqrt(12) - sqrt(12)))/((sqrt(24) + sqrt(48)/sqrt(2)-6 - sqrt(24))/sqrt(8)). -sqrt(7)/60 Simplify ((3(sqrt(384) + -2sqrt(384)))/(sqrt(64)/(sqrt(72)-6 - sqrt(8))) + 3)	{ "pile_set_name": "DM Mathematics" }
is the eighth root of 162652 to the nearest integer? 4 What is 117685 to the power of 1/7, to the nearest integer? 5 What is 3294655 to the power of 1/4, to the nearest integer? 43 What is the square root of 8691818 to the nearest integer? 2948 What is the square root of 15890764 to the nearest integer? 3986 What is the tenth root of 11554220 to the nearest integer? 5 What is the fifth root of 7169445 to the nearest integer? 24 What is 2942105 to the power of 1/7, to the nearest integer? 8 What is 4554049 to the power of 1/2, to the nearest integer? 2134 What is 275429 to the power of 1/2, to the nearest integer? 525 What is 288527 to the power of 1/8, to the nearest integer? 5 What is 72008 to the power of 1/2, to the nearest integer? 268 What is 1400690 to the power of 1/2, to the nearest integer? 1184 What is the third root of 542460 to the nearest integer? 82 What is the square root of 496790 to the nearest integer? 705 What is 8885909 to the power of 1/9, to the nearest integer? 6 What is the square root of 16032274 to the nearest integer? 4004 What is the cube root of 733094 to the nearest integer? 90 What is 30590527 to the power of 1/3, to the nearest integer? 313 What is 437140 to the power of 1/5, to the nearest integer? 13 What is 73156 to the power of 1/2, to the nearest integer? 270 What is 155760 to the power of 1/3, to the nearest integer? 54 What is the eighth root of 633833 to the nearest integer? 5 What is the fourth root of 27525897 to the nearest integer? 72 What is the cube root of 6506855 to the nearest integer? 187 What is the seventh root of 384284 to the nearest integer? 6 What is the third root of 16082757 to the nearest integer? 252 What is 892926 to the power of 1/8, to the nearest integer? 6 What is 2744019 to the power of 1/2, to the nearest integer? 1657 What is 1739540 to the power of 1/7, to the nearest integer? 8 What is the cube root of 9131241 to the nearest integer? 209 What is 726878 to the power of 1/10, to the nearest integer? 4 What is the ninth root of 2041469 to the nearest integer? 5 What is 5042254 to the power of 1/2, to the nearest integer? 2245 What is 6170889 to the power of 1/4, to the nearest integer? 50 What is the fourth root of 1786262 to the nearest integer? 37 What is the sixth root of 154153 to the nearest integer? 7 What is the square root of 208988 to the nearest integer? 457 What is 4275110 to the power of 1/6, to the nearest integer? 13 What is the third root of 192351 to the nearest integer? 58 What is the seventh root of 2971019 to the nearest integer? 8 What is the square root of 796944 to the nearest integer? 893 What is the seventh root of 25102569 to the nearest integer? 11 What is 119832 to the power of 1/3, to the nearest integer? 49 What is 951013 to the power of 1/2, to the nearest integer? 975 What is 3294019 to the power of 1/2, to the nearest integer? 1815 What is the square root of 3850450 to the nearest integer? 1962 What is the square root of 4736887 to the nearest integer? 2176 What is the third root of 5145663 to the nearest integer? 173 What is 36842959 to the power of 1/8, to the nearest integer? 9 What is the cube root of 497597 to the nearest integer? 79 What is 13064932 to the power of 1/8, to the nearest integer? 8 What is the third root of 1020707 to the nearest integer? 101 What is 7467623 to the power of 1/3, to the nearest integer? 195 What is 8760953 to the power of 1/3, to the nearest integer? 206 What is the ninth root of 2472668 to the nearest integer? 5 What is 1972932 to the power of 1/2, to the nearest integer? 1405 What is the third root of 2897846 to the nearest integer? 143 What is the sixth root of 418594 to the nearest integer? 9 What is the square root of 26800 to the nearest integer? 164 What is the ninth root of 5682170 to the nearest integer? 6 What is 6412854 to the power of 1/10, to the nearest integer? 5 What is the fourth root of 959985 to the nearest integer? 31 What is 3472714 to the power of 1/2, to the nearest integer? 1864 What is the cube root of 233425 to the nearest integer? 62 What is 181969 to the power of 1/2, to the nearest integer? 427 What is the square root of 12887649 to the nearest integer? 3590 What is the seventh root of 698733 to the nearest integer? 7 What is the cube root of 261916 to the nearest integer? 64 What is 579079 to the power of 1/10, to the nearest integer? 4 What is the eighth root of 8042762 to the nearest integer? 7 What is the fifth root of 12556566 to the nearest integer? 26 What is 2654971 to the power of 1/8, to the nearest integer? 6 What is the ninth root of 1814954 to the nearest integer? 5 What is 1553318 to the power of 1/10, to the nearest integer? 4 What is 623182 to the power of 1/2, to the nearest integer? 789 What is the square root of 282714 to the nearest integer? 532 What is the third root of 945983 to the nearest integer? 98 What is the square root of 186830 to the nearest integer? 432 What is 128084 to the power of 1/3, to the nearest integer? 50 What is 1957122 to the power of 1/3, to the nearest integer? 125 What is 5201544 to the power of 1/5, to the nearest integer? 22 What is 2443909 to the power of 1/2, to the nearest integer? 1563 What is the eighth root of 172104 to the nearest integer? 5 What is 1764882 to the power of 1/3, to the nearest integer? 121 What is the third root of 27721996 to the nearest integer? 303 What is the ninth root of 19374865 to the nearest integer? 6 What is 255300 to the power of 1/9, to the nearest integer? 4 What is 10637106 to the power of 1/8, to the nearest integer? 8 What is 157000 to the power of 1/9, to the nearest integer? 4 What is 5803037 to the power of 1/9, to the nearest integer? 6 What is the cube root of 7282441 to the nearest integer? 194 What is 242334 to the power of 1/7, to the nearest integer? 6 What is the cube root of 160947 to the nearest integer? 54 What is the square root of 4284340 to the nearest integer? 2070 What is 5630060 to the power of 1/2, to the nearest integer? 2373 What is 1409929 to the power of 1/6, to the nearest integer? 11 What is the third root of 3189467 to the nearest integer? 147 What is 427132 to the power of 1/2, to the nearest integer? 654 What is the sixth root of 311584 to the nearest integer? 8 What is the third root of 72422 to the nearest integer? 42 What is 761702 to the power of 1/8, to the nearest integer? 5 What is 970469 to the power of 1/9, to the nearest integer? 5 What is the eighth root of 190163 to the nearest integer? 5 What is 5795757 to the power of 1/3, to the nearest integer? 180 What is the cube root of 166642 to the nearest integer? 55 What is 32614160 to the power of 1/6, to the nearest integer? 18 What is 4058178 to the power of 1/2, to the nearest integer? 2014 What is 1212599 to the power of 1/3, to the nearest integer? 107 What is the cube root of 3342249 to the nearest integer? 150 What is the fourth root of 30552084 to the nearest integer? 74 What is the cube root of 96605 to the nearest integer? 46 What is the square root of 4007890 to the nearest integer? 2002 What is the ninth root of 4546655 to the nearest integer? 5 What is the square root of 2785592 to the nearest integer? 1669 What is the third root of 4088321 to the nearest integer? 160 What is 375835 to the power of 1/8, to the nearest integer? 5 What is 4128324 to the power of 1/2, to the nearest integer? 2032 What is the third root of 1340666 to the nearest integer? 110 What is the sixth root of 2491902 to the nearest integer? 12 What is the sixth root of 44182 to the nearest integer? 6 What is 7359702 to the power of 1/2, to the nearest integer? 2713 What is the cube root of 8456080 to the nearest integer? 204 What is the fifth root of 15877945 to the nearest integer? 28 What is the eighth root of 27051295 to the nearest integer? 8 What is the third root of 2409557 to the nearest integer? 134 What is the fourth root of 801645 to the nearest integer? 30 What is the square root of 10769337 to the nearest integer? 3282 What is the square root of 2877190 to the nearest integer? 1696 What is the fourth root of 345623 to the nearest integer? 24 What is 599419 to the power of 1/6, to the nearest integer? 9 What is	{ "pile_set_name": "DM Mathematics" }
hat is the next term in 447, -333, -1113, -1893? -2673 What is next in 2306545, 4613088, 6919631, 9226174? 11532717 What is the next term in 80645, 80642, 80639, 80636? 80633 What is the next term in 191939, 191676, 191239, 190628, 189843, 188884? 187751 What is the next term in -2878794, -2878792, -2878794, -2878800, -2878810? -2878824 What is next in -9, 136, 615, 1614, 3319, 5916, 9591? 14530 What is the next term in 1492, 1348, 1244, 1180, 1156? 1172 What comes next: -51642, -108928, -166214, -223500? -280786 What is next in 207458, 207448, 207438, 207428, 207418, 207408? 207398 What is the next term in 25812, 25577, 25182, 24627, 23912, 23037, 22002? 20807 What is next in 12240163, 24480327, 36720491? 48960655 What is the next term in 258, 80, 12, 102, 398, 948, 1800, 3002? 4602 What is the next term in 1673, 6485, 14499, 25709, 40109, 57693? 78455 What is next in 1120, 8161, 27288, 64543, 125968, 217605, 345496? 515683 What is the next term in -65923, -131368, -196813, -262258, -327703, -393148? -458593 What comes next: 905, 2023, 3591, 5843, 9013, 13335? 19043 What comes next: -179936, -179829, -179722, -179615, -179508? -179401 What comes next: 128712, 128684, 128686, 128718, 128780? 128872 What is next in 3119429, 6238738, 9358043, 12477344, 15596641? 18715934 What is the next term in -779, -1981, -3601, -5639, -8095, -10969? -14261 What is next in -4440, -9315, -14190, -19065, -23940, -28815? -33690 What comes next: 1210, 2573, 4090, 5761, 7586, 9565? 11698 What is next in 5621, 45755, 154909, 367595, 718325, 1241611, 1971965, 2943899? 4191925 What comes next: -17685, -35639, -53593? -71547 What is next in 2208, 4388, 6608, 8862, 11144, 13448, 15768, 18098? 20432 What comes next: 287988, 578246, 868504? 1158762 What is next in 8209, 16445, 24729, 33073, 41489, 49989, 58585? 67289 What is the next term in -27466736, -109866934, -247200598, -439467728, -686668324? -988802386 What is the next term in -79986, -159962, -239928, -319890, -399854, -479826, -559812, -639818? -719850 What is the next term in -166159, -331668, -497177, -662686? -828195 What is the next term in 5535, 5636, 5877, 6330, 7067, 8160, 9681, 11702? 14295 What comes next: 151105, 143168, 135231, 127294, 119357? 111420 What is next in -226099, -452206, -678303, -904384, -1130443, -1356474, -1582471? -1808428 What is the next term in -481, -664, -979, -1432, -2029? -2776 What comes next: 7331, 14444, 21253, 27608, 33359, 38356, 42449, 45488? 47323 What comes next: 1041, 3701, 8143, 14367, 22373, 32161, 43731? 57083 What comes next: 4769, 6527, 8285? 10043 What comes next: -2278, -1284, 372, 2690, 5670, 9312, 13616? 18582 What is next in 6298, 25275, 56954, 101335? 158418 What is the next term in 22257191, 22257192, 22257193? 22257194 What is next in 599, 948, 1303, 1664, 2031? 2404 What is next in -676013, -1352046, -2028079, -2704112, -3380145? -4056178 What is next in -9690036, -19380075, -29070114, -38760153? -48450192 What is next in -13015126, -13015131, -13015140, -13015153, -13015170, -13015191? -13015216 What is the next term in 26675, 52208, 77741, 103274, 128807, 154340? 179873 What comes next: 27276573, 54553174, 81829775? 109106376 What is the next term in -2141723, -2141720, -2141717, -2141714, -2141711, -2141708? -2141705 What comes next: 187869, 375740, 563611, 751482? 939353 What is the next term in 150993021, 150993029, 150993037, 150993045, 150993053, 150993061? 150993069 What comes next: 3168, 5522, 9438, 14910, 21932, 30498, 40602? 52238 What is next in -4951551, -4951544, -4951537, -4951530, -4951523, -4951516? -4951509 What is next in 25751, 25789, 25843, 25913? 25999 What is the next term in 14226883, 28453766, 42680653, 56907544, 71134439, 85361338? 99588241 What is the next term in -3862263, -7724324, -11586385, -15448446? -19310507 What is the next term in -27364, -25601, -22670, -18577, -13328, -6929, 614, 9295? 19108 What is next in -2641, -2690, -2845, -3160, -3689? -4486 What is next in -1875612, -3751223, -5626834? -7502445 What comes next: -10157, -14613, -19057, -23483, -27885, -32257, -36593, -40887? -45133 What is the next term in 30004, 60031, 90076, 120139, 150220, 180319, 210436? 240571 What is the next term in 8094, 8082, 8070? 8058 What is the next term in 66148, 66181, 66258, 66397, 66616, 66933, 67366, 67933? 68652 What comes next: 5847165, 5847162, 5847159, 5847156, 5847153? 5847150 What is the next term in 55590, 222965, 501916, 892437, 1394522? 2008165 What is the next term in -107109246, -214218490, -321327734? -428436978 What is next in -7266, -55656, -187018, -442842, -864618, -1493836, -2371986, -3540558? -5041042 What is next in 169005644, 338011287, 507016930, 676022573? 845028216 What is next in -145, 907, 3193, 6713? 11467 What is next in -71947, -144452, -216899, -289258, -361499, -433592, -505507, -577214? -648683 What is next in -52113, -52104, -52071, -52002, -51885, -51708? -51459 What comes next: 23826, 23778, 23730, 23682, 23634? 23586 What is next in -2327, -3426, -4303, -4850, -4959, -4522, -3431, -1578? 1145 What comes next: -73348932, -73348930, -73348928, -73348926, -73348924? -73348922 What comes next: -15622, -18593, -21564, -24535, -27506? -30477 What is next in 4094, -2714, -14060, -29944? -50366 What is the next term in 1481311342, 1481311343, 1481311344, 1481311345, 1481311346, 1481311347? 1481311348 What is the next term in -182902, -1463154, -4938122, -11705164, -22861638, -39504902? -62732314 What is next in 2540, 10229, 23164, 41441, 65156, 94405, 129284, 169889? 216316 What is the next term in -108, -776, -2562, -6012, -11672, -20088? -31806 What is next in -1666, -6606, -14810, -26266, -40962, -58886, -80026, -104370? -131906 What comes next: 284, 757, 1650, 3173, 5536, 8949, 13622? 19765 What is next in -1580, -6055, -13742, -24827, -39496, -57935, -80330? -106867 What is next in -1506, -8259, -19474, -35151, -55290, -79891, -108954? -142479 What is next in 1011, 2854, 4717, 6600, 8503, 10426, 12369? 14332 What is the next term in -5606, -5433, -4968, -4067, -2586, -381? 2692 What is next in -1244, -9895, -33404, -79199, -154708, -267359, -424580? -633799 What comes next: 51744, 206984, 465740, 828036, 1293896, 1863344, 2536404? 3313100 What comes next: -2711, -5213, -7715, -10217? -12719 What is the next term in -24044, -24225, -24506, -24869, -25296, -25769, -26270? -26781 What comes next: -2190, -2685, -1446, 1527, 6234, 12675? 20850 What is the next term in -3543, -3509, -3467, -3429, -3407, -3413? -3459 What is next in 6093, 6167, 6271, 6417, 6617? 6883 What is next in -154, -280, -462, -676, -898? -1104 What is the next term in 3561, 1304, -4723, -16404, -35623, -64264, -104211? -157348 What is the next term in -78187, -79444, -81539, -84472, -88243, -92852, -98299? -104584 What is the next term in 638, 1200, 2442, 4616, 7974? 12768 What is next in 51524, 205969, 463376, 823745, 1287076, 1853369, 2522624? 3294841 What comes next: -261770, -1047106, -2356006, -4188470? -6544498 What is the next term in 297499, 297496, 297491, 297484, 297475, 297464? 297451 What is next in 28061422, 56122846, 84184270, 112245694, 140307118, 168368542? 196429966 What is the next term in -26029, -26114, -26343, -26788, -27521, -28614? -30139 What comes next: -7218, -28973, -65234, -116001? -181274 What is the next term in 3040, 12114, 27246, 48436, 75684, 108990, 148354? 193776 What comes next: 175426, 350838, 526250, 701662, 877074, 1052486? 1227898 What is next in 106301, 213208, 320127, 427064, 534025? 641016 What is the next term in -2655817, -2655815, -2655813, -2655811, -2655809? -2655807 What is next in 25312371, 25312366, 25312361? 25312356 What is the next term in -3346, -6003, -8664, -11329, -13998, -16671, -19348? -22029 What is next in 44077, 43962, 43847? 43732 What is next in 16578, 66280, 149126, 265122, 414274, 596588, 812070, 1060726? 1342562 What comes next: 266873, 533828, 800783, 1067738, 1334693? 1601648 What is the next term in 25288, 49233, 73178, 97123? 121068 What is next in -5690, -25734, -59140, -105908, -166038? -239530 What is the next term in -38321, -152918, -343803, -610976, -954437, -1374186? -1870223 What is next in 16648040, 66592110, 149832214, 266368346, 416200500, 5	{ "pile_set_name": "DM Mathematics" }
-1/2? -1/2 What is the third smallest value in 0, 0.11, 7? 7 Which is the second smallest value? (a) 7 (b) 0.7 (c) -3 b What is the second biggest value in -1, -5/6, -12? -1 Which is the smallest value? (a) -3 (b) -2/5 (c) -1.6 (d) 0.2 (e) 1/4 a Which is the third smallest value? (a) 5 (b) -3 (c) 0.15 (d) -0.3 c What is the third smallest value in 4/3, -0.24, -0.1, -0.4? -0.1 What is the biggest value in 4, -0.1, 0.033? 4 What is the third biggest value in -5/2, 0.3, 2, -102? -5/2 What is the biggest value in 0.2, -0.05, -24/71? 0.2 Which is the second smallest value? (a) 0.04 (b) -0.7 (c) 1 (d) 4 a Which is the second biggest value? (a) -11/3 (b) 4/3 (c) -2/3 c What is the second smallest value in -65, 5, 2/7? 2/7 Which is the second smallest value? (a) -3/4 (b) -5 (c) 6.8 (d) -10 b Which is the fifth smallest value? (a) 3/11 (b) -0.3 (c) -4 (d) 2/9 (e) -0.1 a Which is the second biggest value? (a) -2 (b) -8/3 (c) -0.02 a Which is the second biggest value? (a) -4/25 (b) 2 (c) -0.3 (d) 5 (e) 12/11 b What is the second smallest value in -305, -2/3, -0.4? -2/3 Which is the biggest value? (a) 1/2 (b) -1 (c) 9/101 a Which is the third smallest value? (a) -3 (b) 1/3 (c) 0.5 (d) -2 b What is the third smallest value in -1/11, -1, -17? -1/11 What is the biggest value in 2/7, -106, 0? 2/7 Which is the third smallest value? (a) 4/3 (b) -4 (c) 16 (d) -17.4 (e) 0.5 e What is the biggest value in 0.04, 3/4, -5? 3/4 Which is the second smallest value? (a) 5/2 (b) -0.4 (c) 161 (d) 0 d What is the second biggest value in -68, -1, -2/9? -1 Which is the smallest value? (a) 256 (b) -3 (c) -5 c What is the fourth biggest value in -48, -0.3, 2/5, 3, 1? -0.3 What is the third biggest value in -133, 2, 0.5? -133 Which is the second biggest value? (a) 0.05 (b) -0.5 (c) -1 (d) 0 (e) 1 a Which is the biggest value? (a) -2/9 (b) 0.5 (c) 3/25 (d) -2/7 b What is the second biggest value in -4, 0.4, 3, 0.55? 0.55 Which is the fourth biggest value? (a) -2/47 (b) 0.3 (c) 0.06 (d) -19 (e) -2 e Which is the third biggest value? (a) -2/7 (b) -0.2 (c) -5 (d) 0.5 a What is the fourth smallest value in -0.4, 1/5, -0.3, 1/2? 1/2 What is the second smallest value in -0.066, 1, -0.1? -0.066 What is the smallest value in -7/8, -3, -0.2, -1, 9? -3 Which is the third smallest value? (a) -9 (b) 3 (c) 0.1 (d) 6 b What is the third biggest value in 0.2, 3/5, -1/5, 1? 0.2 What is the second biggest value in 6, -4/39, 0.2, -0.5? 0.2 What is the smallest value in 4, 58, -3? -3 What is the smallest value in 2, -2/19, 2.2? -2/19 Which is the fourth smallest value? (a) -0.3 (b) -5 (c) 0.29 (d) -0.05 (e) -7 d Which is the third smallest value? (a) 0 (b) -1/10 (c) 99 c Which is the third biggest value? (a) -3 (b) 0 (c) -15 (d) 15 a What is the smallest value in -21, -1, 10? -21 Which is the smallest value? (a) -3 (b) 0.5 (c) -168 c What is the second biggest value in 1, 1/8, 24, -0.5? 1 What is the second smallest value in 1/2, -0.06, 6, -1? -0.06 What is the second biggest value in -37, -7, 0, -3? -3 Which is the second biggest value? (a) 2 (b) 1/4 (c) 5 (d) -1/6 (e) 49 c Which is the third biggest value? (a) 0 (b) -7 (c) 17 b Which is the second smallest value? (a) 8 (b) 5 (c) 0.2 (d) -1/3 (e) -5 d What is the third smallest value in -3, 27, 0.13? 27 What is the second biggest value in -0.2, 0.3, -1.73, 53? 0.3 What is the fourth biggest value in -0.3, -4, -2/181, -5? -5 What is the second smallest value in -1/4, -1, 17, 43/4? -1/4 Which is the third smallest value? (a) -2 (b) 944 (c) 1/6 b What is the third smallest value in -5, -74, 0, 2/15? 0 Which is the fourth smallest value? (a) -0.4 (b) -1 (c) -4 (d) 2/53 d What is the third biggest value in -2, -4/9, 8, 2/3? -4/9 What is the third biggest value in 16, -5, 14? -5 Which is the second biggest value? (a) 0.5 (b) 2/15 (c) 17 a What is the smallest value in 4, -2, 3, -0.5? -2 Which is the second biggest value? (a) -0.01 (b) 2 (c) 10 (d) 1 b Which is the smallest value? (a) 2 (b) 1 (c) 3 b Which is the second biggest value? (a) 1 (b) 3/16 (c) 3 (d) 8 c What is the third smallest value in 0.08, -1/2, -27.6? 0.08 Which is the biggest value? (a) 1/5 (b) -6 (c) -18 (d) 3/5 d Which is the fourth biggest value? (a) 1 (b) 0 (c) -0.1 (d) -0.31 (e) 0.5 c Which is the second smallest value? (a) 5 (b) -0.1 (c) -1/8 b Which is the third smallest value? (a) -5 (b) 0.4 (c) -4647 (d) 5 b Which is the biggest value? (a) 0.1 (b) -334 (c) -5 a Which is the second smallest value? (a) 0.4 (b) -2 (c) 15/22 (d) 5 a Which is the biggest value? (a) -3 (b) 23/3 (c) -1.5 b What is the biggest value in -12, -0.5, -0.2? -0.2 Which is the second biggest value? (a) 5 (b) -94 (c) -0.5 (d) 4/3 d What is the third biggest value in -1/527, -3, 0? -3 Which is the smallest value? (a) -0.5 (b) 98 (c) -0.3 (d) -2/7 a Which is the third smallest value? (a) -1/3 (b) -0.3 (c) -1.1 (d) -0.5 (e) 3 a Which is the fourth biggest value? (a) -27 (b) -2/11 (c) 0.1 (d) -0.4 (e) -1.8 e What is the fourth biggest value in -1.4, -3, -0.4, 3/8? -3 Which is the second biggest value? (a) 2 (b) -0.1 (c) -83 (d) -1/5 b Which is the third biggest value? (a) -0.193 (b) -2/7 (c) -4 c Which is the second smallest value? (a) 59 (b) -0.46 (c) -4 b What is the third smallest value in -0.06, 1/3, 2/7, -1/11? 2/7 Which is the second smallest value? (a) -3/5 (b) 489 (c) -1 (d) -0.4 a What is the third smallest value in -86, -3, -1? -1 What is the third smallest value in 1/2, 28, 5? 28 What is the smallest value in 0.04, 1/5, 0.87? 0.04 What is the second smallest value in 0.1, 2/5, -29, 13, -2? -2 What is the fifth biggest value in -3, -0.5, 2/7, 0, 0.0294? -3 What is the fourth smallest value in -0.3, -457/5, -2/3, 5, 0.4? 0.4 What is the smallest value in -130, 80, -0.4? -130 Which is the biggest value? (a) -0.2 (b) 0.1 (c) -0.06 b Which is the second smallest value? (a) -3 (b) -0.1 (c) 8 (d) -1 d Which is the biggest value? (a) -2 (b) 1/5 (c) 10/3 (d) 12 (e) -3/8 d What is the second biggest value in -1, 4/9, -3, -2/3? -2/3 What is the biggest value in -33, 0.3, 2? 2 Which is the biggest value? (a) -30 (b) 1 (c) -24 (d) 0 (e) 2/21 b What is the third smallest value in 0.4, -2/5, -11, 4? 0.4 What is the third biggest value in 1/2, -2/15, 10? -2/15 Which is the third smallest value? (a) -0.2 (b) -2 (c) 0.2 (d) 14/5 c What is the second smallest value in 7/4, 4, 23? 4 What is the third biggest value in 3/5, -13, -23, 3? -13 What is the biggest value in 0, -0.2, 10/17, -3? 10/17 What is the biggest value in -4/9, -18, 1/2, 0? 1/2 Which is the second smallest value? (a) 0.078 (b) -0.6 (c) -4 b What is the second smallest value in 0.1, 0, 4/69? 4/69 Which is the second smallest value? (a) -4 (b) -58/7 (c) 7 (d) 0.4 a What is the biggest value in -0.5, -1.56, 1? 1 What is the third smallest value in 0, 7, 7/4, -1? 7/4 Which is the fourth smallest value? (a) 3 (b) 202 (c) 0.2 (d) -2/5 b What is the third smallest value in 6, 3, -0.11? 6 Which is the second smallest value? (a) 3 (b) -2/5 (c) 0.15 (d) -2/9 d What is the third smallest value in 2, -1, 52? 52 What is the biggest value in -2/35, -2/7, -1, 1/9? 1/9 What is the smallest value in -7, 2/5, -0.3, 3, -5? -7 Which is the third biggest value? (a) -3/7 (b) 2/9 (c) -2/3 (d) -1/6 a What is the third smallest value in 1, -723, 1/6? 1 What is the smallest value in -1, 0, 27, 1? -1 Which is the fourth biggest value? (a) 5 (b) 3 (c) -2 (d) -3 d Which is the third biggest value? (a) -0.5 (b) -1/4 (c) -23 (d) 1.2 a What is the fourth biggest value in 2, 5/9, -7, -3? -7 Which is the second smallest value? (a) -0.5 (b) 0.3 (c) -4 (d) 0.4 (e) 19 a What is the third biggest value in -1/4, -2, -6, -20, 4? -2 What is the second smallest value in 7, 0.5, -1/6? 0.5 Which is the third smallest value? (a) -1 (b) 240 (c) -4 (d) -2/5 (e) -3 a Which is the second smallest value? (a) -1/7 (b) -53 (c) 0.07 a Which is the second smallest value? (a) -10/47 (b) 5 (c) 0.2 c Which is the third smallest value? (a) -9/2 (b) 3 (c) 0.1 (d)	{ "pile_set_name": "DM Mathematics" }
3 = 1597c, 4c - 2r = -16 for c. -1 Solve 538p - 535p + 15 = 0, -10 = -3x + 2p for x. 0 Solve 2t - 85 + 139 = -3u, 4u + 37 = -t for u. -4 Solve 3 - 19 = -2g - f, 22 = 4g + f for g. 3 Solve -345r + 10 = -348r - 4u, -2u - 12 = -2r for r. 2 Solve m + t = 0, -92m - 4t + 6 = -94m for m. -1 Solve 0 = 4o - 2s + 78 - 56, -o - 9 = -4s for o. -5 Solve k + 9 = 4c, 0 = 2c + 66k - 62k - 36 for c. 4 Solve 29174o + 70 = -14t + 29172o, 3t - 2o = -15 for t. -5 Solve -4f - h + 84 - 88 = 0, 2f = 4h - 20 for f. -2 Solve -4t - 21364u + 2 = -21365u, 5t = 2u + 4 for t. 0 Solve o + 7 = 4g, 19843g - 19848g - 2o = -12 for g. 2 Solve -2g - 2 = 2m, -8g = m + 1 + 35 for m. 4 Solve -q + 4n + 23 = -21, 9q = -5n - 55 for q. 0 Solve 0 = -5c - 2d + 58 - 43, -3c - 2d = -5 for c. 5 Solve 0 = 113s - 114s - 20g + 383, -3s = -g + 10 for s. 3 Solve -3s = -4d - 10, -991d + 5s = -990d + 11 for d. -1 Solve -3m - 40 = -26p, 2m + 187p - 191p = 0 for m. 4 Solve -z - 11 = 2x, 83z - 87z + 21 = -5x for x. -5 Solve 7y - 3l = 10y - 12, 10y + 2l = -0l for y. -1 Solve 4v = j - 1, -4j + 4 = 1406v - 1408v for v. 0 Solve -5h + 20 = 0, -3h = 2y + 128 - 136 for y. -2 Solve 2y + 13 = 5, 3y + 6 = 7v - 4v for v. -2 Solve 6l = 5u - 34, -4u + 89 = -3l + 69 for u. 2 Solve 2d + 4 = -w, 5w - 4d + 265 = 287 for w. 2 Solve 4i - 5 = -v, -5i + 8v + 1 = 4v for i. 1 Solve -40 = -4h - 2s, -19h + 216 = -0s - 3s + 76 for h. 8 Solve 0 = -2t + 1812q - 1814q - 10, -5t - 4q = 21 for t. -1 Solve 569i - 5 = -8a + 568i, -2a + 5i = 25 for a. 0 Solve -4v + w = -19, 0 = 5v + 5w - 104 + 99 for v. 4 Solve -n - 3 = 4c, -57 = -5n + 363c - 365c for n. 13 Solve 8h - 5o + 13 = 0, 38h = 43h + o + 4 for h. -1 Solve -5x = -4h - 22, 4x = 16 - 8 for h. -3 Solve 0 = -34f + 36f - 6, -73 = 4n + 5f for n. -22 Solve 2q - 6z + 26 = 0, 108 - 131 = 3q - 5z for q. -1 Solve 52z + 30 = 49z - 3f, -6 = f for z. -4 Solve -6o + 13o - 4k = -17 - 16, 0 = -3o - 3k for o. -3 Solve -r + 3h - 2 = -19, -2h = r + 3 for r. 5 Solve 2p - 435 = 2m - 431, -5m + 2p = 4 for m. 0 Solve 5x - 10 = -5f - 30, -65 = 10f + 5x for f. -9 Solve -15 = -10t - y, 0 = 411t - 416t + 3y - 10 for t. 1 Solve 2t + 3z - 4 = 0, z + 137 - 130 = t for t. 5 Solve 3r - 296 = 100t - 11, -9r = -12r + 5t for r. -5 Solve 0 = -4f + 5a - 27, 4a = 4f + 7 + 17 for f. -3 Solve -3 = -3t + 5x - 8x, 4t - 12 = -2x for t. 5 Solve 154c - 159c + 5 = -5t, 0 = 3c - 3 for t. 0 Solve -19u + 4q = -15u - 64, 3u - 40 = 5q for u. 20 Solve -t + l - 736 + 755 = 0, -5l - 104 = 4t for t. -1 Solve 3l - 43 = 4m, -3m - 26021l - 26 = -26022l for m. -7 Solve 5z + 55 = -4p, z = -758p + 765p + 67 for z. -3 Solve 3v + 3b = -18, -4b - 86 + 80 = -2v for v. -3 Solve -4d + 64 = -7771v + 7767v, -9v = -d + 16 for v. 0 Solve -d - 2u + 9 = -3u, 5u + 15 = -d for d. 5 Solve -10 = 2v - 2l, 0 = 24v + 2l + 249 - 129 for v. -5 Solve -22p + 17p + 45 = 5h, -3h + 41 = 5p for h. 2 Solve -119 = -2q + 4j - 127, -13 = 3q - 5j for q. -6 Solve -1613a - 4p = -1611a + 16, -31p - 58 = -a for a. -4 Solve 5p = 2g + 3, -40 + 13 = 3p + 2g for p. -3 Solve -8n + 4f - 48 = 0, 3666n - 3659n - 3f + 38 = 0 for n. -2 Solve 4p + 5 = -b, 3 = 11b - 10b - 4p for b. -1 Solve 0 = 5v + 5, -78 + 102 = -5u - 4v for u. -4 Solve -20 = 3l - 8l, 9l = 5y + 4l + 6l - 54 for y. 10 Solve k + 13 = -3r, 1081k - 38 = 1077k + 3r for k. 5 Solve -t = -20r + 43, 4341t - 4r + 23 = 4336t for t. -3 Solve -17 = 3h - 5c, -2c - 2048 = -3h - 2062 for h. -4 Solve -4k - b = 0, -495k + 3b = -493k + 14 for k. -1 Solve -5j + 33 = 2l + 27, 14j = l - 3 for j. 0 Solve 12 = -3z, -z - 122 = 2c - 108 for c. -5 Solve 3a + 363 = -x + 362, -4x = -2a - 24 for x. 5 Solve -2 = -r - 4i, -2r + 5i + 141 = 163 for r. -6 Solve -301r - 9 = -301r + 3m, 3r = -5m - 24 for r. -3 Solve 10w = -4r + 70, -5w = -5r - 0r + 35 for r. 10 Solve -10w + 1874r = 1869r + 15, -3w - 18 = 3r for w. -3 Solve 5k = v - 24, -71749k = -71751k + 2v - 16 for k. -4 Solve -23 + 2 = -3p - 2x, 2p - 5x + 5 = 0 for p. 5 Solve -2x + x - 110 = -27z, -5x + 3z = 22 for x. -2 Solve 0 = 2o + 6, 15o = s - 21o + 38o + 7 for s. -1 Solve -g - 6 = 4s - 4, -3g - s - 6 = 0 for g. -2 Solve x - 8 = -4o, 0 = 4x + 153o - 157o - 12 for x. 4 Solve 14f + 2k = 12f - 10, 20 = -4f + 5k for f. -5 Solve 229h = 222h - 2r + 32, 3h - 10 = r for h. 4 Solve 0 = 3z - 3y, 16z = 32z - 17z + 4y + 9 for z. -3 Solve -7 = 4x - 3m, -5x + 3710 = m + 3733 for x. -4 Solve 2p = 5x + 13, 148p - 153p - 5x = -3 - 12 for p. 4 Solve -2r - 3a - 5 = 0, -2 = -2r + 6a + 20 for r. 2 Solve -23j + n - 1 = -21j, -3j + 3n = -3 for j. -2 Solve -l = 5y - 20, -2y - 14 = 5l - 22 for y. 4 Solve -88 = -5d + 2i - 96, -12 = -3d + 4i for d. -4 Solve -44i + 49i + 13k - 37 = 0, 1 = i + k for i. -3 Solve 8x = 64, -14x = 5w - 10x - 42 for w. 2 Solve -2z = 91g - 89g, -2g = z + 5 for z. 5 Solve 0 = a - 2a - 2f + 3, 27 = a + 7f + f for a. -5 Solve -405y + 407y = -3o + 2, -13o + 15o = -3y + 8 for y. 4 Solve 6o - 5g - 10 = 9o, 9 = -2o - g for o. -5 Solve 4g + 5b = -74, b - 13180 = g - 13193 for g. -1 Solve 0 = -s + 2i - 203 + 188, -5s + i = 30 for s. -5 Solve -4b = -3a + 13, 307b - 297b + 1 = 3a for b. 2 Solve 21 = -5d + 7j - 27, 7d - 15j + 64 = 6d for d. -4 Solve 2 = -2v, 51l - 48l + 17 = 4v for l. -7 Solve 14v - 952 = 240f + 12v, -2v = 2f + 16 for f. -4 Solve -a - 12 = t, 3a = 4t - 40940 + 40953 for a. -5 Solve -4c + 2o + 12 = 0, 375c - 15 = 370c - 5o for c. 3 Solve 1545b + 29 = 1544b - 3w, 4b - 54 = 5w for b. 1 Solve -1502 = -4o - 4h - 1506, 9 = -3h for o. 2 Solve -3z - 46q = -42q + 26, 5q + 46 = 3z for z. 2 Solve -2n = 3r + 27, 33r + 33 = 36r - 8n for r. -5 Solve 4p + 5h - 16 = 0, 753p - 749p - h = 16 for p. 4 Solve -45s = -54s + 27, 0 = 4k + 3s - 69 for k. 15 Solve 77d + 30 = 7t + 75d, 2t = -5d + 3 for t. 4 Solve -2o = 70j - 74j + 38, -2j + 5o + 39 = 0 for j. 7 Solve -t + 3v - 17 = 0, 4v - 48 = 5t - 7 for t. -5 Solve -314 = 3o - 326, -4s = 4o + 4 for s. -5 Solve i = t - 3, 0 = i + 357t - 360t + 3 for i. -3 Solve 3t + 5841y - 5836y - 80 = 0, -y + 16 = 3t for t. 0 Solve -2a - 28 = -3b, -62a - 11b + 46 = -58a for a. -5 Solve -245b = -247b + 2, -j - 4b + 34 = 4j for j. 6 Solve 51o = 174o, -4s + 3s - 3o + 5 = -6o + o for s. 5 Solve -5x - 44 = 3y, 29y - 34y + 30 = -2x for x. -10 Solve -11u + 12u + 2m = 6, -20u - 36 = m for u. -2 Solve 3j + 181 - 187 = -2k, -2j = 4k - 12 for j. 0 Solve j + 327 = -r + 330, -6j = 3r - 12 for j. 1 Solve 4v = -5w + 14, 2326w = 4v + 2322w + 4 for v. 1 Solve 4c = -5y + 48, -4y + 175c - 12 = 174c for y. 0 Solve 0 = 3r - 6, 193a - 191a - r = 0 for a. 1 Solve -2x + 20 = 2x, -x + 92 = 33b - 12 for b. 3 Solve -139w + 140w = 3q - 7, 19 = 3q + 5w for q. 3 Solve 2s = 18n + 86, 3s + 11 = -2s - 5n - 24 for s. -2 Solve -5w + 25 = 0, -p - 3w = 703 - 720 for p. 2 Solve -u = -5q + 2u - 204 + 175, 5u = -3q + 3 for q. -4 Solve -2z = -2y - 14, 8z - 28 = 3y + 13 for y. -3 Solve 0 = -2u + q + 9, -3u + 9q - 27q - 45 = 0 for u. 3 Solve 2p = -4u, 955p - 2u + 10 = 951p for p. -2 Solve 0 = 3a - 5s + 39 + 10, -a + 4s - 35 = 0 for a. -3 Solve 0 = 5f + 5m - 16653 + 16708, 0f = 4f - 2m + 14 for f. -6 Solve -5y - 320a + 7 = -319a, 1 = -4y - 3a for y. 2 Solve -2005 + 2015 = 4n + 3r, -9 = -n - 4r for n. 1 Solve -2j - 3l + 9 = 0, -28 = 3j - l - 14 for j. -3 Solve 25w - p + 8 = 27w, -48 = -4w + 6p for w. 6 Solve -69 + 56 = 3w + 4a, -4w - 13 = a for w. -3 Solve 5j - 52 = -v, 2372j + 34 = 2v + 2368j for v. 27 Solve -5i = 3g - 0 + 11, 0 = 2i - 4 for g. -7 Solve 0 = -3q - 5v - 54, 28v = 5q + 27v + 6 for q. -3 Solve -2s = -3h + 22, 5s = 87h - 89h + 40 for s. 4 Solve -14j + 19j - 3n + 49 = 0, 3j + 2n + 37 = 0 for j. -11 Solve 2r - 5 = -5a, 68r + 1 = 65r + a for r. 0 Solve 0 = 3h - 23x + 40 - 38, -4h + 2x = -26 for h. 7 Solve 29 = 9h + 3d + 8, 0 = 5h + 4d -	{ "pile_set_name": "DM Mathematics" }
Let x = 24 - l. What is the third derivative of -2c3 + 2453 - 2453 + 11cx wrt c? -12 Let u(j) = j4 + j3 - j2 + j - 1. Let h(x) = 1184x4 + x3 + 41x*2 + x - 1. Let k(y) = h(y) - u(y). What is the third derivative of k(d) wrt d? 28392d Let a(k) be the first derivative of -4268 - k*2 - 58k + k*2 + 15k*3 + 4203. Differentiate a(m) wrt m. 90m What is the third derivative of -362o2 + 600o*6 + 3266o*6 + 2726o*6 - 392o*2 wrt o? 791040o*3 Let w(h) = -46h - 95. Suppose -23x = -32x - 18. Let k(r) = -91r - 187. Let j(u) = xk(u) + 5w(u). Differentiate j(v) wrt v. -48 Let w(x) be the first derivative of 68 + 0x*4 + 0x*2 - 41x + 4/5x5 + 2/3x*3. What is the third derivative of w(f) wrt f? 96f Let j(p) = 585p3 - 7p*2 + 6p - 76. Let y(d) = -1171d3 + 16d*2 - 15d + 151. Let h(k) = 10j(k) + 4y(k). Find the third derivative of h(g) wrt g. 6996 Let v(b) be the first derivative of -2/7b7 - 68b + 0b4 + 0b*5 + 16/3b*6 + 2/3b*3 + 0b*2 + 12. What is the third derivative of v(c) wrt c? -240c*3 + 1920c*2 Let d(l) = 2l*3 - 24l*2 + 27l + 10. Let x be d(11). Find the first derivative of -88 + x - 100 - q*4 + 2q*4 + 38q wrt q. 4q3 + 38 Let q(d) = 260d*2 + 85d - 16631. Let t(w) = -65w2 - 20w + 4158. Let b(s) = 2q(s) + 9t(s). Differentiate b(o) with respect to o. -130o - 10 Let u(h) be the first derivative of 34 - 2h + 81/2h2. What is the derivative of u(b) wrt b? 81 Suppose 5z - 8 - 17 = 0. Differentiate -w*3 - 15 + 26w + 55 + 13 - zw wrt w. -3w*2 + 21 Let v(u) = 570u*2 + 568u - 11. Let z(n) = 285n2 + 288n - 5. Let s(c) = -6v(c) + 13z(c). What is the second derivative of s(m) wrt m? 570 Let p(u) = -2u3 - u2 - 2u + 2. Let c(j) = -19j3 - 25j*2 - 717j - 2. Let h(f) = -c(f) - p(f). What is the second derivative of h(o) wrt o? 126o + 52 Let a(r) = 91r*3 - 6r*2 - 3048r + 6. Let p(i) = 181i3 - 13i*2 - 6113i + 11. Let w(j) = 9a(j) - 5p(j). Find the second derivative of w(d) wrt d. -516d + 22 Let j be ((-1)/(-1))/(52/572). Let l(k) = -8k*2 - 59k + 37. Let w(q) = -15q2 - 117q + 74. Let u(m) = jl(m) - 6w(m). Differentiate u(r) wrt r. 4r + 53 Let c be 8/(3 + -7) - (-7 + -5). Differentiate 4 + cr - 2 + 10r wrt r. 20 What is the derivative of 6073 + 77r + 548r3 - 77r + 666r3 + 582r*3 wrt r? 5388r*2 Let f(t) be the third derivative of -91t*6/24 - 1433t*5/15 + 4t*2 + 63t - 2. Find the third derivative of f(h) wrt h. -2730 Suppose w + 1 = -2v - 1, 4w + 3v - 2 = 0. What is the derivative of 296c*w - 54 - 376c*2 - 20 wrt c? -160c What is the derivative of 894 - 530m + 260m - 139m - 570m wrt m? -979 Let t(c) = -c + 24. Let y be t(15). Suppose y = 32j - 29j. What is the first derivative of 22 + 16a3 - a3 - 5a*3 + 8a*j wrt a? 54a*2 Let h(q) be the first derivative of -1/4q*4 + 0q*2 - 5/3q*3 - 51 + 41q. Differentiate h(z) wrt z. -3z2 - 10z Let u(f) = 4f3 - 2. Let v(j) = 8j*3 - 11j*2 - 95j - 6. Let c(m) = 6u(m) - 2v(m). Find the second derivative of c(n) wrt n. 48n + 44 Find the third derivative of -1399x + 1399x + 2 - 12x*3 + 105x*2 + 2 - 9x*3 + 32x*4 wrt x. 768x - 126 Let g(x) = 2x2 + 42x - 9. Let k be g(-22). Find the second derivative of 213d4 + kd - 268d4 + 37d wrt d. -660d2 Let z(g) be the second derivative of 0g*2 + 2g - 103/30g6 - 17 + 0g*3 + 11/2g*4 + 0g*5. Find the third derivative of z(o) wrt o. -2472o Let f(o) be the first derivative of 6o2 + 2o - 7 + 79/3o3. Find the second derivative of f(d) wrt d. 158 Let l(j) = -2j*2. Let w be (-2)/(-4)(-1)/((-5)/10). Let o(k) = -83k2 + 68k. Let x(h) = wo(h) - 3l(h). What is the second derivative of x(s) wrt s? -154 Let r = 495 + -252. Suppose 4v = -7 + 47. What is the first derivative of rs*2 + 34 - 243s*2 - vs*4 wrt s? -40s*3 Find the first derivative of 2505x*4 + 209 + 1542 - 282x*4 wrt x. 8892x*3 Let j be 1/(-2) - ((-30)/4 + 5). Let x(m) = 11m - 6. Let r be x(j). What is the second derivative of -rs5 - 2s + 2s - 2s + 3s wrt s? -320s*3 Let f(r) = -1629r*3 - 6r*2 + 1665r - 50. Let u(y) = -3y3 - y2 - 10. Let b(p) = f(p) - 5u(p). What is the second derivative of b(q) wrt q? -9684q - 2 Let c(t) = 3830t*2 - 3021t - 3. Let l(q) = 11491q2 - 9055q - 8. Let i(h) = -8c(h) + 3l(h). Find the second derivative of i(y) wrt y. 7666 Suppose -5f + 43 = 33. Suppose 2a + t - 5 = 0, -t = -fa + 6 - 3. Differentiate -42z*4 - 1037z*a - 6 + 1037z*2 with respect to z. -168z*3 Let k(h) be the second derivative of -3h*6/10 + 27h*5/20 + 1532h*2 + 46h - 1. What is the derivative of k(v) wrt v? -36v3 + 81v*2 Find the second derivative of 376o + 1101o + 3o*5 + o - 192o + 73o2 + 65o*2 wrt o. 60o*3 + 276 What is the derivative of 714k*2 - 1555k - 1312 + 1555k - 186k*2 wrt k? 1056k Suppose -4o - o - 10 = 0. Let d be 4 - 6(o - -1). Find the third derivative of -19k3 + 12k3 - k4 - dk2 + 7k*3 wrt k. -24k Let w be (0 + -124)/(5/4 + -1). Let d be w/(-28) - 2/(-7). What is the derivative of dn - 55n + 8n + 34 wrt n? -29 Suppose 57j - 48j + 576 = 297j. Let x(c) be the third derivative of -17/3c3 + 0c + 8cj + 4/3c*4 + 0. Differentiate x(o) with respect to o. 32 Let q(j) = -20j - 97. Let l be q(-5). Find the third derivative of -44n4 + 59n*4 + 68n*4 + 54n2 - nl wrt n. 1992n - 6 Find the third derivative of -249y*2 + 0 - 40y - 5 - 68y - 5055y*3 + 246y2 - 2 wrt y. -30330 Let j(y) = -3 + 4 - y2 + 10y2. Let g(f) = 18f*2 + 3. Suppose 44 = -8o + 76. Let x(t) = og(t) - 9j(t). Differentiate x(u) with respect to u. -18u Find the third derivative of -952c*3 + 989c*2 - 407c*4 - 412c*4 - 409c*4 + 137c*3 + 1227c*4 wrt c. -24c - 4890 Let r(v) be the second derivative of -39v - 3v*3 + 0 - 21/2v*2 + 7/20v*5 + 0v*4. Let s(z) be the first derivative of r(z). Differentiate s(a) wrt a. 42a Let b(s) be the third derivative of 0s - 1/20s*5 - 5/24s*4 - 10s*2 - 5/3s*3 + 0. Let f(n) be the first derivative of b(n). Differentiate f(i) wrt i. -6 Find the first derivative of 740s*3 - 375s*3 - 839s*4 - 365s*3 + 952 wrt s. -3356s*3 Suppose -2a - 64 = -4h, -3a + 3 = -3. Let s(u) be the first derivative of h + 2u5 + 4 - u2 + 3u*2 - 8u*2. Find the second derivative of s(k) wrt k. 120k*2 Let a(t) be the third derivative of 295t9/84 + t5/30 - 767t3/6 + 1233t*2. Find the third derivative of a(g) wrt g. 212400g*3 Let w = 17 + -6. Suppose -k + 12 = 5u, 2k - 3u - u = -4. Find the second derivative of 6lk - 2l*2 - wl - 8l wrt l. 8 Let p(j) be the second derivative of 5j*8/336 - 7j*7/360 - 9j*4 - 64j. Let y(o) be the third derivative of p(o). Find the third derivative of y(s) wrt s. 600 Let a(g) be the second derivative of -484g6/3 - 1213g*4/3 + 27g + 27. Find the third derivative of a(z) wrt z. -116160z Let u(a) be the third derivative of 0 - 103a*2 + 0a - 41/6a3 + 77/12a*4. What is the derivative of u(o) wrt o? 154 Let x(z) be the third derivative of -41/120z*6 + 0z*5 + 1/8z*4 + 5/2z*3 + 0z + 0 - 31z2. Find the second derivative of x(p) wrt p. -246p Let q(c) = 4c - 18. Let x be q(5). Find the first derivative of 7 + rx + 20 - 2r*3 - 62 wrt r. -6r*2 + 2r Let k(n) = n*3 - 16n*2 + n - 14. Let i be k(16). What is the second derivative of 17z*3 - 3z*i + 39z + 18z3 - 57z*3 + 17z*3 wrt z? -30z - 6 Let f(j) = j*2 - j. Let m(g) = -15g*2 - 23g. Let h = -3 + -6. Let z = -8 - h. Let d(x) = zm(x) - 6f(x). What is the second derivative of d(u) wrt u? -42 Let w(c) be the first derivative of 1043c4/4 - 2c*3/3 - 3c*2/2 - 11825c - 5175. Find the first derivative of w(u) wrt u. 3129u2 - 4u - 3 Let j(i) = 2i3 - 3i*2 + i + 2. Let a(m) = 2220m*3 + 7m*2 - 3m + 267. Let x(k) = -a(k) - 3j(k). What is the third derivative of x(s) wrt s? -13356 What is the second derivative of 3642w - 6796w + 8896w*2 + 1 + 974w wrt w? 17792 Let b(t) = -t*2 - 9t + 17. Let z be b(-8). Suppose 20 + z = 3r. What is the third derivative of 4 - 2w*2 - 8w*6 + rw*	{ "pile_set_name": "DM Mathematics" }
at is the greatest common divisor of 4324 and 1? 1 Calculate the greatest common divisor of 739480 and 3192. 1064 What is the highest common divisor of 69657 and 963? 321 Calculate the greatest common divisor of 3316 and 2368. 4 What is the greatest common factor of 869225 and 175? 175 What is the highest common factor of 81328 and 460? 92 What is the greatest common divisor of 33 and 1743? 3 What is the greatest common divisor of 14527 and 803? 73 Calculate the greatest common divisor of 77421 and 124701. 591 What is the greatest common divisor of 279 and 66991? 31 Calculate the highest common divisor of 78 and 102531. 39 Calculate the greatest common factor of 8950 and 70. 10 Calculate the highest common divisor of 356 and 931474. 178 Calculate the greatest common divisor of 3100 and 4516. 4 Calculate the greatest common divisor of 408 and 6876. 12 What is the greatest common divisor of 3513 and 1272877? 1171 Calculate the highest common factor of 16 and 1258296. 8 What is the highest common divisor of 6501 and 231? 33 Calculate the greatest common factor of 477 and 31217. 53 What is the highest common divisor of 8672 and 462868? 1084 What is the highest common divisor of 368 and 30383? 23 What is the highest common factor of 660 and 42540? 60 What is the highest common factor of 114768 and 432? 144 Calculate the greatest common factor of 338 and 89895. 13 What is the highest common divisor of 3240 and 195? 15 Calculate the greatest common divisor of 210 and 134960. 70 Calculate the highest common divisor of 1691925 and 187. 17 Calculate the greatest common factor of 98486 and 92. 46 Calculate the greatest common factor of 345464 and 14. 14 Calculate the greatest common factor of 2030472 and 72. 72 Calculate the greatest common factor of 42552 and 756. 108 Calculate the greatest common divisor of 73593 and 1776. 111 What is the highest common divisor of 54963 and 1488? 93 What is the highest common divisor of 236 and 751188? 236 Calculate the highest common factor of 88088 and 1430. 286 What is the highest common divisor of 756 and 7168? 28 What is the highest common divisor of 3867079 and 367? 367 What is the highest common divisor of 2793 and 392? 49 Calculate the highest common divisor of 1207 and 7313. 71 Calculate the highest common divisor of 127441 and 31. 31 Calculate the highest common divisor of 11960 and 20345. 65 What is the highest common factor of 46312 and 532? 28 What is the highest common divisor of 295 and 89090? 295 What is the greatest common factor of 167 and 229792? 167 Calculate the greatest common divisor of 3224 and 909974. 806 Calculate the highest common factor of 2106 and 240. 6 Calculate the highest common divisor of 22544 and 848. 16 What is the greatest common divisor of 4875 and 234? 39 Calculate the highest common divisor of 3555 and 3285. 45 Calculate the greatest common factor of 12 and 44553. 3 What is the greatest common factor of 890746 and 219? 73 Calculate the highest common factor of 38148 and 396. 132 What is the highest common divisor of 781126 and 46? 46 Calculate the greatest common divisor of 370560 and 64. 64 Calculate the greatest common divisor of 10412 and 2945. 19 Calculate the greatest common factor of 5265 and 3845. 5 What is the highest common divisor of 176 and 3864? 8 Calculate the highest common divisor of 86310 and 135. 45 What is the highest common divisor of 3 and 4085? 1 Calculate the greatest common factor of 51 and 439331. 17 What is the highest common factor of 1594 and 1776513? 797 What is the highest common divisor of 71677 and 5321? 313 Calculate the highest common factor of 305097 and 39. 39 Calculate the greatest common divisor of 253470 and 35. 35 What is the greatest common factor of 25594 and 3350? 134 What is the highest common divisor of 590 and 555485? 295 Calculate the highest common divisor of 756 and 174069. 189 Calculate the greatest common factor of 30780 and 135. 135 Calculate the greatest common factor of 154 and 968198. 154 Calculate the highest common factor of 137380 and 30. 10 Calculate the highest common factor of 4689354 and 6. 6 What is the greatest common divisor of 99 and 246? 3 Calculate the highest common divisor of 5699 and 13622. 139 What is the greatest common divisor of 185939 and 13? 13 Calculate the greatest common divisor of 13300 and 196. 28 Calculate the greatest common divisor of 102784 and 3796. 292 Calculate the greatest common divisor of 15597 and 801. 9 Calculate the highest common divisor of 1782 and 13284. 162 What is the highest common factor of 8418 and 234186? 138 What is the highest common factor of 397419 and 33? 33 Calculate the highest common divisor of 1258 and 612. 34 What is the highest common factor of 1710 and 835335? 855 What is the greatest common divisor of 252 and 383292? 252 What is the greatest common divisor of 1365 and 37843? 13 Calculate the highest common divisor of 44 and 6022280. 44 What is the highest common divisor of 200585 and 110? 55 What is the greatest common factor of 17968 and 4240? 16 What is the greatest common factor of 80 and 681040? 80 What is the highest common divisor of 1905 and 32639? 127 Calculate the greatest common divisor of 22078 and 2. 2 Calculate the highest common factor of 89880 and 80. 40 Calculate the greatest common factor of 3813 and 2883. 93 What is the highest common factor of 1236 and 1284? 12 Calculate the highest common divisor of 12838 and 1048. 262 Calculate the greatest common divisor of 724 and 817577. 181 What is the greatest common divisor of 242 and 13178? 22 What is the highest common factor of 5069 and 333? 37 Calculate the greatest common divisor of 1328 and 8048. 16 What is the greatest common divisor of 13 and 231478? 13 Calculate the greatest common factor of 224 and 81452. 28 Calculate the highest common divisor of 48400 and 31823. 121 Calculate the highest common factor of 333 and 236097. 333 Calculate the greatest common divisor of 2030763 and 21. 21 What is the greatest common divisor of 1105 and 663? 221 Calculate the highest common divisor of 2298231 and 10577. 1511 What is the greatest common divisor of 810 and 148380? 30 Calculate the highest common divisor of 623 and 7539. 7 Calculate the greatest common factor of 2398 and 286. 22 What is the highest common factor of 132410 and 50? 10 Calculate the greatest common factor of 476 and 992426. 34 Calculate the highest common factor of 126 and 601362. 18 What is the greatest common factor of 619 and 5228074? 619 Calculate the highest common divisor of 443169 and 2583. 369 What is the greatest common factor of 280467 and 2673? 99 Calculate the highest common factor of 96 and 2429088. 96 Calculate the greatest common divisor of 1560 and 2505. 15 What is the highest common divisor of 282667 and 77? 77 Calculate the greatest common factor of 17493 and 459. 51 What is the highest common factor of 21 and 1148? 7 Calculate the highest common divisor of 1255 and 3255. 5 What is the highest common divisor of 257834 and 1233? 137 Calculate the greatest common factor of 486 and 582. 6 Calculate the highest common factor of 300 and 163350. 150 What is the highest common divisor of 140328 and 333? 9 Calculate the greatest common factor of 694 and 1962979. 347 What is the highest common factor of 2812 and 1258? 74 Calculate the highest common divisor of 204 and 4386. 102 What is the highest common factor of 627 and 2739? 33 Calculate the highest common divisor of 314796 and 296. 148 What is the highest common factor of 420 and 8390? 10 Calculate the highest common divisor of 157421 and 121. 121 What is the highest common divisor of 618657 and 174? 87 What is the greatest common divisor of 1900 and 3020? 20 What is the greatest common factor of 17 and 213911? 17 Calculate the greatest common factor of 61623 and 1599. 123 Calculate the greatest common factor of 290 and 1568030. 290 Calculate the greatest common divisor of 32 and 7624. 8 Calculate the greatest common factor of 463620 and 120. 60 What is the highest common factor of 115797 and 253? 11 What is the greatest common factor of 16785 and 7083? 9 What is the highest common divisor of 180036 and 432? 108 Calculate the highest common factor of 206480 and 8455. 445	{ "pile_set_name": "DM Mathematics" }
4022. What is the third derivative of u(j) wrt j? 332940j2 Let p(g) be the first derivative of 147 + 31g - 49g3 + 1/2g*4 + 0g*2. What is the derivative of p(t) wrt t? 6t*2 - 294t Let c(d) be the third derivative of -2/3d4 + 0 - 1/40d*6 + 0d*5 + 16/105d*7 + 0d + 0d3 - 107d*2. Find the second derivative of c(p) wrt p. 384p*2 - 18p Let w(n) be the third derivative of 2161n6/120 - n5/60 - 176n*3/3 + 1113n*2. Find the third derivative of w(x) wrt x. 12966 What is the second derivative of -9063v*2 + 3 + 281v + 5 + 11845v2 - 4 wrt v? 5564 Let l(w) = 113w*3 + 16w*2 + 4w - 3690. Let h(q) = 227q3 + 31q*2 + 7q - 7382. Let z(f) = -4h(f) + 7l(f). What is the first derivative of z(g) wrt g? -351g2 - 24g Let a(p) be the second derivative of -163p5/2 + 13p*3/6 - 11p*2/2 + 623p. Find the second derivative of a(l) wrt l. -9780l Let b(x) = 5615x*4 + 1386x*2 + 11x - 10. Let l(o) = 1123o4 + 278o*2 + 2o - 2. Let n(h) = -2b(h) + 11l(h). Find the third derivative of n(c) wrt c. 26952c Let m(c) be the first derivative of 47/3c*3 + 26 + 0c - 27c2. What is the second derivative of m(x) wrt x? 94 Let h(v) be the second derivative of -149v*3/3 + 683v*2/2 - 2276v. Differentiate h(w) with respect to w. -298 Let b(i) be the second derivative of -1201i4/6 + 915i*2/2 + 1915i. What is the derivative of b(l) wrt l? -4804l Let d = 203 - 198. Find the second derivative of 168f*d - 9f + 2 + 8 + 22f - 15f + 32 wrt f. 3360f3 Let i(h) = 5h*3 + 26 + 12h - 5h3 - 3h*3 - 144. Let u(w) = 4w*3 - 12w + 118. Let q(v) = -7i(v) - 6u(v). Differentiate q(t) with respect to t. -9t2 - 12 Let n = 138 - 118. Suppose 3h - n = -2h, -4h = 3k - 22. What is the first derivative of -1 + 8 + k + 3 - 6t wrt t? -6 Let x(y) be the first derivative of 3209y5/5 - 9y*2 - 17y - 688. Find the second derivative of x(m) wrt m. 38508m2 Let g(m) = 33504m*3 - 2266m + 297. Let f(h) = -22336h3 + 1511h - 212. Let r(p) = 7f(p) + 5g(p). Find the second derivative of r(z) wrt z. 67008z Let c(f) be the first derivative of 12f*5/5 - 49f*4/4 + 3037f + 1621. Differentiate c(t) with respect to t. 48t3 - 147t*2 Let m(z) = 1085z*3 + 24z*2 + 131z - 1. Let j(n) = -1085n3 - 26n*2 - 122n + 2. Let c(t) = 12j(t) + 13m(t). Find the second derivative of c(f) wrt f. 6510f Suppose 3g - 5g - 2j + 6 = 0, 0 = -2g + 4j + 18. Find the third derivative of 4w2 - 5w*5 - 34w*g - 29w*5 + 10w wrt w. -4080w2 Let r = 173 - 97. Suppose 2k = -4v + 106, -4v = k - 5k - r. Find the second derivative of -vh*3 - 2h + 20h2 - 20h*2 wrt h. -144h Let a(p) = 1278p2 + 221p - 8. Let t(h) = 1274h2 + 224h - 7. Let b(z) = 5a(z) - 6t(z). What is the second derivative of b(w) wrt w? -2508 Let l(p) be the first derivative of -1809p2 - 2970p - 563. Find the first derivative of l(k) wrt k. -3618 Find the second derivative of -290882r4 + 292002r*4 - 5 + 3r*3 - 310r - 3r3 wrt r. 13440r*2 Let r = 6 + 10. Suppose rd - 132 = 4d. What is the second derivative of ds*2 - 6s + 5s2 + 16s wrt s? 32 Let n(a) be the second derivative of -31a5/4 + 2a*4/3 + 1705a*3/2 - 128a - 12. What is the second derivative of n(t) wrt t? -930t + 16 Suppose 4h - 3 = 3v - 0, 0 = 2h + 2v + 2. Suppose 4i - 18 + 6 = h. Find the first derivative of 2r2 - 10 - 2r*2 + 2r*i wrt r. 6r*2 Let j(c) = -6c + 392. Let g be j(65). Let t(n) be the first derivative of 0ng - 12n - 2/3n3 - 19. Differentiate t(v) wrt v. -4v Find the third derivative of 632g6 - 523g + 487g - 72g*2 + 73g*2 wrt g. 75840g*3 Let d(p) = 163p*2 - 19p + 1644. Let c(w) = -81w2 + 8w - 822. Let f(o) = 7c(o) + 3d(o). Differentiate f(m) with respect to m. -156m - 1 Let m(a) be the second derivative of 0a*4 + 0a*3 - 22a*2 - 2 - 18/5a*5 - 225a. Differentiate m(j) with respect to j. -216j2 Let a(n) be the second derivative of 0n*6 + 23/42n*7 - 6n*3 + 3/2n*2 + 61n + 0 + 0n4 + 0n*5. Find the second derivative of a(l) wrt l. 460l*3 Suppose -5j + 5 = 5a - 0, -15 = 3a. Find the third derivative of 14b5 + 2b2 + bj - 7 + 0 + b*5 wrt b. 120b*3 + 900b*2 What is the second derivative of 201 + 75u*5 + 4u + 467u5 - 202 + 18u - 110u5 wrt u? 8640u3 Let l(u) = -u6 + u*3 + 5u*2 - 1. Let q(z) = -3z*6 - 37z*5 - 5z*3 + 18z*2 - 730. Let b(s) = 5l(s) - q(s). Find the third derivative of b(y) wrt y. -240y3 + 2220y2 + 60 Let g(d) = -d2 - 5d. Let v be g(-5). Let z(p) be the first derivative of -15 + 0p + vp3 - 11/2p2 + p4. What is the second derivative of z(j) wrt j? 24j Let d(o) = 12o*3 + 3o*2 - o. Let f(i) = -59i*3 + 3288i*2 + 4i + 5106. Let j(q) = -5d(q) - f(q). What is the second derivative of j(r) wrt r? -6r - 6606 Let a(p) = 1874p3 + 2p*2 - 7p - 8. Let k(m) = m3 - m2 - m - 2. Let b(c) = -a(c) + 7k(c). Find the third derivative of b(g) wrt g. -11202 Suppose -3m + 6m = 0. Suppose -27v + 32v - 15 = m. What is the derivative of 20 + 8 + vj - 4j - 7 wrt j? -1 What is the second derivative of -996l + 906680l4 - 2l*2 - 906629l*4 - 713l wrt l? 612l2 - 4 Suppose -37b + 28 = -83. Find the second derivative of 98 + 89 - 189 - 3u2 - 22u*b + 4u wrt u. -132u - 6 Let t be (-6)/((2/(-10))/((-90)/(-25))). What is the second derivative of -36o*2 - 72o - 72o - to*2 - 5 + 143o + 36 wrt o? -288 Let c be 4(-4)/(-10)(-15)/(-6). Find the first derivative of -122xc + 256x*4 + 100 - 132x*4 + 169x*2 - 46x*2 wrt x. 8x*3 + 246x Find the first derivative of 3227 - 1711u2 + 1716u*2 - 176u*3 + 112u*3 - 466u*3 wrt u. -1590u*2 + 10u Let y(i) = 3i3 + 21i*2 + 5i - 44. Let b(c) = 2c + 420c*3 - c - 419c*3 + 2c*2. Let s(f) = 5b(f) - y(f). Find the first derivative of s(w) wrt w. 6w2 - 22w Differentiate -688 - 913 - 498d2 - 951d*2 wrt d. -2898d Let v(p) be the second derivative of -p6/15 + p5/5 + p*4/6 + 371p*3/2 + 3302p. What is the second derivative of v(a) wrt a? -24a2 + 24a + 4 Find the second derivative of 141 - 170m4 + 32m*3 + 2m*2 + 4190m - 139 + 136m4 wrt m. -408m*2 + 192m + 4 Let r = 94 + -92. Suppose ru + 130 = 3p, 138 = 3p - 4u - 2. Differentiate -65 + 70 + 9o3 + 34o*3 - p with respect to o. 129o2 Let j = 190 - 186. Find the second derivative of p4 - 5 - jp2 + 12 - 9 - 32p wrt p. 12p2 - 8 Suppose 21 = -5i + 36. Differentiate 40fi + 58 + 6 - 5f*3 wrt f. 105f*2 Let z be (12/(-15))/((-8)/(-760)). Let p = z + 78. Find the third derivative of 8w*5 + 8w*2 + 8w*2 + 7w*p + 0w*2 wrt w. 480w*2 Suppose 0 = 2d, 2v + 7d = 3d + 8. Find the second derivative of -20b - 26b + 35b + 7bv - 53b*4 - 3 + 1 wrt b. -552b*2 Let u be 220/(-18) + ((-120)/54)/(-10). Let g = 29 + u. What is the second derivative of -17t + t*2 - gt*2 - 2t*2 wrt t? -36 Suppose 35 = u + 6u. Suppose 5s + r - ur - 6 = 0, s - 4r + 2 = 0. Find the third derivative of 3i*4 + 7i*s + 0i + 10i2 + 0i wrt i. 72i Let h(d) be the third derivative of 127d*6/12 - 1555d*4/24 - 1872d*2. Find the second derivative of h(s) wrt s. 7620s Let d(b) be the second derivative of 1641b5/4 - 331b*4/2 - 13647b. What is the third derivative of d(r) wrt r? 49230 What is the third derivative of -9327o3 - 240o*2 - 39421o - 302o2 + 39424o wrt o? -55962 Let a(m) be the second derivative of -2m6/3 + 3m*5/20 - 8m*3/3 + 349m*2 - 84m - 1. What is the first derivative of a(b) wrt b? -80b3 + 9b*2 - 16 Let q = -20 + 24. Suppose 120 = ql + 32. Find the third derivative of -2c3 - lc*3 + 5c*3 + 24c*2 - 7c*2 wrt c. -114 Let u be 1 + -6 + 3/(-3 - 0). Let q be u + 5 - (1 - 4). What is the first derivative of -5 + 6w*2 - q + 0 + 1 wrt w? 12w Suppose 68 = 5t - t. Let f be (14/(-6))/(16/(-48)). What is the third derivative of -tj*5 + 7j*5 + 24j*2 - fj*5 wrt j? -1020j*2 Let r(o) = 4414o*3 + 15o*2 - 13o + 74. Let u(l) = 2211l3 + 7l*2 - 6l + 37. Let f(g) = -6r(g) + 13u(g). Find the third derivative of f(y) wrt y. 13554 Let k(v) = 3v*3 -	{ "pile_set_name": "DM Mathematics" }
*6 - 482t*2 + 479t*2 + 3 - 3 wrt t? -1440t*3 Let m(c) be the third derivative of -9/2c*3 - 1/30c*5 + 0 + 2c + 0c4 - 135c*2 - 1/60c*6 - 1/7c*7. What is the third derivative of m(y) wrt y? -720y - 12 Suppose 4 = -2x + 3q - q, x + 4q - 18 = 0. What is the second derivative of -2m + 236mx - 1119 + 571 + 571 wrt m? 472 Find the third derivative of 742q*3 + 148q*3 + 365q*3 + 5 + 47q*2 + 3 + 26q2 wrt q. 7530 Let y(f) = -f3 - f*2. Let b be y(-2). What is the second derivative of 10d*4 - 95 + 115d*b - 2d + 16d4 + 88 wrt d? 1692d*2 Suppose -t + 20 = 9t. Find the third derivative of 126k - 125k - 140k4 - 24k*t + 6 - 6 wrt k. -3360k Let p(h) be the second derivative of 993h5/4 - 5483h*3/6 + 3h + 469. What is the second derivative of p(u) wrt u? 29790u Let b(r) = 335r*3 - 315r*2 + 4r. Let k(a) = -a*3 + 4a*2 + 2a. Let w(z) = -5b(z) + 10k(z). Find the third derivative of w(o) wrt o. -10110 Let m(k) be the first derivative of 9k4 - 304k - 1929. What is the derivative of m(f) wrt f? 108f2 Let o(q) be the first derivative of -645q4/2 + q3 + 31q + 252. Find the third derivative of o(k) wrt k. -7740 Find the second derivative of -14289p - 6p5 - 11p*5 - 12868p + 28503p wrt p. -340p*3 Let g = 25603 - 25587. Let v(f) be the first derivative of 16/5f*5 + 6f*3 + 0f + g + 0f2 + 0f*4. Find the third derivative of v(y) wrt y. 384y Let m(n) be the second derivative of 453n8/56 - 431n*4/12 - 200n + 1. What is the third derivative of m(c) wrt c? 54360c3 Find the second derivative of -357 - 3240j*5 - 859j*5 + 233 + 9j wrt j. -81980j3 Find the second derivative of -13 - 110s - 41s + 4 + 342s - 550s5 + 229s wrt s. -11000s3 Let j = -66 - -68. Suppose -jr + 5r = 5s + 137, 0 = -4s - 4. What is the first derivative of -8n*4 - rn*3 + 44n*3 + 8 wrt n? -32n*3 Let i(l) be the second derivative of 0 + 15/4l*4 + 3/2l*5 + 57l + 0l2 + 0l3. Find the third derivative of i(n) wrt n. 180 Let p(d) be the third derivative of d7/40 + 59d6/720 - 43d*5/12 - 244d*2. Let a(k) be the third derivative of p(k). Differentiate a(t) wrt t. 126 Let h(n) = 6n*2 + 2n - 82. Let c(j) = 3j2 + j - 42. Let f be -1 - (0 + 15)/(-3). Let i(d) = fh(d) - 9c(d). Differentiate i(m) with respect to m. -6m - 1 Let a(u) be the second derivative of -u*8/840 + 49u5/60 - u4/3 + u*2/2 - 36u + 1. Let k(r) be the third derivative of a(r). Differentiate k(j) wrt j. -24j2 Differentiate -362 + 24d + 90d2 - 58d*2 - 194d - 229 - 22d2 with respect to d. 20d - 170 Let i(f) = 17 - 34f3 - 14 + 721f*2 - 728f2. Let b(m) = m3 + m*2 + m - 1. Let h(x) = -3b(x) - i(x). What is the third derivative of h(q) wrt q? 186 What is the third derivative of -3643n2 + 20n - 20n + 970n*3 - 220n*2 - 5085n*3 wrt n? -24690 What is the second derivative of 262085c + 1549c2 + 929c*2 - 266713c wrt c? 4956 Let q be ((-3)/(-4))/((-1)/(-24)). Let r = -14 + q. Differentiate 3ur + 0u4 + u4 + 18 wrt u. 16u3 Let s(x) be the second derivative of 557x7/14 + x3/2 + 135x2 + 69x. What is the second derivative of s(b) wrt b? 33420b3 Let o(p) = 5925p*2 - 8950p - 20. Let z(x) = -96x - 1. Let j(s) = -o(s) + 20z(s). What is the second derivative of j(r) wrt r? -11850 Find the first derivative of 1701 - 3v2 - 34 + 459v3 + v2 wrt v. 1377v2 - 4v Let o(s) be the third derivative of -72s2 + 19/24s*6 + 53/24s*4 + 0s + 0s5 + 0 + 0s*3. What is the second derivative of o(d) wrt d? 570d Let m(l) be the third derivative of l*4 + 1/20l*5 + 1/6l*3 - 3l + 0 + 1/15l6 + l2. What is the second derivative of m(z) wrt z? 48z + 6 Let w(z) = -32z3 + 3z + 38. Let p(c) = 63c3 - 7c - 75. Suppose -8u + 53 = -3. Let b(i) = uw(i) + 3p(i). Differentiate b(o) with respect to o. -105o*2 Find the second derivative of 2911j*4 + 5199j*4 - 115j*2 - 1656j*4 - j - 109j*2 + 226j*2 + 182 wrt j. 77448j*2 + 4 Let j be -3 - 0 - (-2 + 0 - 1). Find the second derivative of -262v*4 + 501v*4 + 30v - 249v4 + j + 2 wrt v. -120v*2 Let q(k) be the first derivative of 69k*4/4 + 2k*3/3 + 26k*2 - 314. What is the third derivative of q(x) wrt x? 414 Let f(t) be the second derivative of -6 - 5/6t*3 - 127/12t*4 + 0t*2 + 10t. What is the second derivative of f(c) wrt c? -254 Let a(w) be the third derivative of -7397w7/210 + w4/12 + 1961w*3/6 - 3w*2 + 292w. Find the second derivative of a(f) wrt f. -88764f2 Let z be (11 + -13)/((-3)/(-12)). Let k(b) = -19b + 567. Let q(x) = 13x - 378. Let w(i) = zq(i) - 5k(i). Differentiate w(n) with respect to n. -9 Let i(g) be the first derivative of -239/4g*4 + 0g + 0g2 - 59 - 209/3g*3. Find the third derivative of i(z) wrt z. -1434 Let u = -441 + 466. What is the derivative of 74g*4 + 7 + 52 - 34g*4 + 48 - u wrt g? 160g*3 Let w(t) be the first derivative of 642t*2 - 989t + 1716. Differentiate w(h) with respect to h. 1284 Find the third derivative of -398h2 - 28h*2 + 6h*5 - 215h2 + h3 + 225h5 wrt h. 13860h*2 + 6 Let p(r) be the second derivative of -187r5/10 - r4/12 - 15r2/2 - 44r + 15. Find the third derivative of p(j) wrt j. -2244 Let q(v) = -2 + 65v2 - 1015v + 1044v - 14v*2. Let g(o) = 102o*2 + 60o - 5. Let x(f) = -2g(f) + 5q(f). What is the second derivative of x(n) wrt n? 102 Let v(d) = d*3 + 12d*2 + 4d + 16. Let y be v(-10). Let c be 106/22 + 32/y. Find the first derivative of -c + 4 - 11k + 6 wrt k. -11 Suppose 14 + 6 = 4v. Suppose -3w = -12 - 3, 0 = -4p + vw - 9. What is the second derivative of -ap - 9a*4 + 34a - 35a wrt a? -120a*2 Differentiate 2099 - 3399 - 2507 + 5081x - 2896 with respect to x. 5081 Let m be (-357)/(-1) + -2 - 36/455. Let g = -36 + 54. What is the second derivative of -gk + 31k4 - 351k*2 + mk*2 wrt k? 372k*2 Suppose -2i + 622 = 556. What is the derivative of -8 + 80 + 113 + id - 8d - 183d wrt d? -158 Let m(q) be the first derivative of 26q*3/3 + 129q*2/2 - 5q + 84. Let n(p) be the first derivative of m(p). Differentiate n(g) with respect to g. 52 Find the second derivative of -1 - 2806k3 + 1 + 4 - 36k - 41k3 wrt k. -17082k Let y(m) be the first derivative of -5m6/3 + 125m*4/4 - 1068m*3 + m + 2007. What is the third derivative of y(t) wrt t? -600t*2 + 750 What is the derivative of 1168t + 714 + 565 - 214 wrt t? 1168 Let z(j) = -j*3 + 11j*2 - 10j + 2. Let m be z(10). What is the derivative of 459s2 + 28 - 459s*m - 66s*3 wrt s? -198s*2 Let g = -586 + 698. What is the derivative of 3a - g - 102a3 - 3a + 134a3 + 87a*3 wrt a? 357a*2 Let q = -42 - -48. Suppose -5j = 3v - 145, -4j - q = -5v - 122. What is the derivative of 10i*3 + 60 - ji*3 - 57 wrt i? -57i*2 Find the second derivative of -6642k*2 + 14240k*2 - 4325k - 6777k2 wrt k. 1642 Let w be 8/(-48) + ((-290)/(-12))/1. What is the third derivative of -6a*4 - 21a*2 + wa2 + a3 - 83a2 wrt a? -144a + 6 Let n = 8764/5 - 1751. Let l(f) be the first derivative of nf5 + 13 + 0f + 0f2 + 0f*4 + 2/3f*3. What is the third derivative of l(a) wrt a? 216a Suppose -2o + 2 = -o. What is the third derivative of 287y - 147y + 2y*o + 67y*3 - 154y wrt y? 402 Let z = -534 - -311. Let a = z + 479. What is the first derivative of -3n3 - a + 276 - 19n*3 wrt n? -66n*2 Differentiate 154 - 867i + 1859i + 420 - 78i + 33 wrt i. 914 Find the second derivative of -5473p - 1 + 2521p - 4 + 1 + 2712p - 4869p*2 wrt p. -9738 Let p(m) = -23m + 23m - 24 - 15m - m*2. Let z be p(-6). Find the second derivative of 6n + 5n4 - zn*3 - 38n*4 + 30n*3 wrt n. -396n*2 What is the first derivative of 7028a*2 - 1683 - 2638a*2 + 2074a*2 - 4656 wrt a? 12928a Find the second derivative of -613b5 - 78b*5 - 328b*5 - 44b - 64b5 - 4 + 15 wrt b. -21660b*3 Suppose -3f = -306 + 69. Differentiate 4i - 1 + 34 + fi - 7i wrt i. 76 Let u(w) be the second derivative of -758w*7/21 + 2813w*3/6 - 847w + 2. What is the second derivative of u(d) wrt d? -30320d*3 Let m(o) be the second	{ "pile_set_name": "DM Mathematics" }
a = 4k - 19. Solve -5q - 4v = -20, av - 8 = q + 7 for q. 0 Suppose 0 = 10i - 4i - 246. Let g = 45 - i. Solve -b = -g, -3h - h - 4b = -36 for h. 5 Let r = -60 + 64. Let s(c) = 2c3 - 8c*2 + 2c - 3. Let p be s(r). Solve 9 = -2n + d - 0d, d = pn + 18 for n. -3 Let a be 3 - 1 - (-14 - 15). Suppose -5p + a = 3d, -13 = d + 3p - 6p. Let l be (-6)/(-1) + (-2)/d. Solve -4j + 6 = lz, 0 = j + 3j + 2z - 12 for j. 4 Suppose -2h - 9 = -5h. Suppose -6s - 5s = 0. Let d be (-16)/(-12)15/10 + s. Solve 3a = -hg - da + 31, 5g + 3a = 25 for g. 2 Let d(c) = 6c*2 + c + 1. Let p be d(-7). Let h be (10/(-4))/((-120)/p). Solve 13 = f + 2z, -5z = -4f - hz + 24 for f. 5 Suppose 0 = 4z - 10 + 2. Suppose -3w + 6 = h, -2w - 5 = -zh - 1. Let u = 17 - 12. Solve -3p - 6 = ha, -ua - 26 - 14 = -5p for a. -5 Suppose 4l = -5k - 18, 2k + 5l + 12 = k. Let y be (-4)/(-6)-3 - k. Solve y = x - j - 0 + 1, 5j = 15 for x. 2 Let x be 4/6 + 24/6. Solve 4g + 1 = xk + 15, -k + 5g = 10 for k. -5 Let k be 0 + (3 - 3) + 4 + 0. Solve -u + 5q - 6 - 4 = 0, -4u - kq + 32 = 0 for u. 5 Suppose 6 = -2v - 4g, -4v - 4g + 5 + 3 = 0. Suppose -vi = -9i. Let q be 15/108/6. Solve i = -2y - y - 3n + 3, -28 = qy - 4n for y. -4 Let p be (-3)/(-2)(22/3 - 0). Let n = -9 + p. Solve 29 = -5z - 2w, -3 = 2z - nw + 3 for z. -5 Let g = 7 - 3. Let i be 43/g - (-2)/162. Solve l + 2j + i = 5j, 5j = -2l + 33 for l. 4 Let d = -2 + 4. Suppose 2r - 756 = -5k - 0r, -k - 5r + 165 = 0. Let v be (k/(-20))/((-6)/4). Solve -x = -4n + 20, dx = n - 0x - v for n. 5 Suppose -2y + 9 = 5k, -29k + 15 = -26k - 2y. Solve 0 = -5j - 3x + 17, kj - 7 = -x - 0 for j. 1 Let f(a) = 3a2 + a - 1. Let s be f(1). Suppose sd - 2v + 6 = 34, -3d + v + 26 = 0. Solve 0 = -j - 2r - 14, -4r - d = -j - 2j for j. -4 Let o(f) = 6f + 49. Let w be o(-8). Solve 5q - w = -4j, q - 2q - 23 = -5j for q. -3 Let f = 213 + -209. Solve -fa = -2d - 20, -4a - d + 8 = -0a for a. 3 Suppose -13 = -q + 5. Let f = q - 18. Solve 4r = 2r + 2m - 14, -2r - 2m - 2 = f for r. -4 Suppose -3o = -6o - 0o. Solve -4h - 5v - 5 = o, -2v - 3 = -5h + v for h. 0 Suppose -n = -6n + 45. Let q = n - 5. Solve -q = -2k + 7m - 2m, k - m = 2 for k. 2 Let u(k) = -k*3 + 7k*2 - 5k - 6. Let i be u(6). Suppose i = -2x - x + 39. Let t = x - -4. Solve -j = -3w + 7w - t, 2j - 19 = -5w for w. 5 Let r = 25 - 22. Suppose 0a + r = 3a. Let w(b) = b2 - 6b + 7. Let h be w(5). Solve 1 = ho + 2m - a, -m = -2 for o. -1 Let j be (135/36)/((-15)/(-40) + 0). Solve 3k + 5 = -j, 4d - 29 = 5k for d. 1 Suppose -6v = -28v + 44. Let q(s) = -16s - 1. Let r(p) = -3p. Let g(o) = 2q(o) - 11r(o). Let a be g(3). Solve 3w = 4l - 11, 3l - v = -5w - a for w. -1 Suppose 0 = 568a - 528a - 80. Solve 4w + 27 = 13f - 10f, 0 = -w - af + 7 for w. -3 Let b be -25 - -20 - 5/(-1). Solve 0g - 2g - 10 = -3x, 5x - 10 = b for g. -2 Let g = 298 - 296. Solve g = 2y, -t = -3t - 2y - 4 for t. -3 Suppose 38i - 164 = -50. Solve -ig - 9 = 2o - 8g, 5g = 5 for o. -2 Let l(s) = 6s - 128. Let o be l(23). Solve 2w = -2j - 2 - 8, 3w - o = 2j for w. 0 Let y(h) = -4h + 22. Let s be y(7). Let f(g) = -g2 - 8g - 10. Let k be f(s). Solve 0 = -5v - 5t + 15, -kt + 12 = -3v + 2v for v. -2 Suppose 109 = 5r + 64. Solve 6a - ra - 15 = 0, -2j - 2a = 2 for j. 4 Let o be (13/((-195)/(-6)))/(5/50). Solve 0 = -0a - oa - 16, 5g - 5a = 40 for g. 4 Let u(z) = -27z + 167. Let g be u(6). Solve -20 = go, 0b = 2b - 5o - 16 for b. -2 Suppose 5d + 21 = 4n + 2d, -2n = 2d. Let x be 6 + (12/2)/(5 - n). Solve f - 7r = -2r - x, 2f = r - 9 for f. -4 Let b be (10/6 - 2)-6. Solve 2l = -bk - 4, -4l + 3k = -k - 32 for l. 3 Let o = -761 - -765. Solve 31 = -p - op - 4a, 5p + 19 = -a for p. -3 Suppose -41 = -6w + 97. Suppose -w - 3 = -2u. Solve -5o = -3p - 22 - u, -5o = -p - 25 for o. 4 Suppose -3k = -0k - 15. Solve u = 2p - 4, -2p = ku - 0 + 20 for p. 0 Suppose 0 = 123f - 121f - 2. Solve f = -3m - 5, 5h + 4m = -23 for h. -3 Let y be 2/(3 + (-38)/12). Let c be (-37 - y)/((-2)/4). Let t be c/14 - 18/(-42). Solve 5o = tl + 25, 2o - l = 3l + 10 for o. 5 Let n(s) = s*2 - 3s - 4. Let h be n(4). Solve -2w + 10 = h, d - 3w = -2w - 2 for d. 3 Let d = 0 + 0. Suppose 0 = -18a + 20a - 34. Let k = 35 - a. Solve 3f - 15 = 0, -2y + k = 2f - d for y. 4 Suppose a - 20 = 3a. Let d be a/35 + 6/21. Solve -h - 1 = d, 12 + 14 = 5t - h for t. 5 Suppose 0 = 4c - 3c + 5b + 5, 0 = -c - 3b - 5. Let z be 0 - ((-4 - -7) + c). Solve -3q + q - 4 = 4t, 3q - 10 = zt for t. -2 Let m(t) = t*3 + 2t*2 - 2t + 2. Let c be m(2). Solve -y - k = 2y - 13, 2k + c = 4y for y. 4 Suppose 50 = -53s + 63s. Solve -sk + 5b + 5 = 0, -2k = -3b - 5 - 2 for k. -4 Let f = -197 + 197. Solve 0 = -3r + 2s - 18, f = -r + 4s + 3 - 19 for r. -4 Let z(p) = -p*3 - 37p - 8p2 + 18p - 7 + 17p. Let g be z(-8). Solve 5k + 25 = -5b, 3k - g = 5b - 2b for k. -1 Let q = -55 - -26. Let a = q + 32. Solve -5x + 11 = -ap + 32, -5p - 4x - 2 = 0 for p. 2 Let f be (-7)/(-3) + (-2)/6. Let z be (-2 + 2 + -2)/f. Let l be z/2 + (-1)/(-2). Solve 2i = -lw + 5w + 7, -2i = 2w for i. 1 Suppose -3s + 4 = -2. Let v(h) = h*2 - 9h - 8. Let b be v(12). Let a = b + -25. Solve az = -j + 1, 2z + 5j - sj = -11 for z. 2 Suppose -2z + 7 - 3 = 0. Suppose 3w + 2j = -j, 4w - j - 25 = 0. Suppose -l - 4b - 7 - 9 = 0, -b = w. Solve 15 + 1 = -lk, 3k + 6 = zf for f. -3 Let b = 71 - 68. Let h be (1 + -4)/b - (6 + -7). Solve hx = -x - 2p, -4x + 24 = -4p for x. 4 Let x be (-3 - -12) + 3 + -1. Suppose i - 13 = -x. Solve -4g = -4l + 40, -il - g = -1 - 4 for l. 5 Suppose 272k - 273k + u = -7, k = 5u + 27. Solve 3a + 15 = -ka - 3b, 0 = a + 3b + 15 for a. 0 Let s(h) = h*3 + 7h*2 + 4h - 8. Let q(i) = 2i - 22. Let n be q(8). Let a be s(n). Solve al + 1 = 3j, j - 7 = 4l - l for j. -5 Let s(k) = 2k2 - 3k. Let m be s(2). Suppose -2q + 0q + 4y + 12 = 0, -my + 6 = 5q. Solve 5j + 3o = -20, -2j - qo - 9 = 3 for j. -1 Let n = -27 - -28. Suppose -9 = -2h - n, -4v = h - 12. Solve -4 = -p - vq + 3q, 0 = -3p + 5q + 18 for p. 1 Let y(p) = -p2 - 3. Let t be y(0). Let b be 20/6t/(-2). Suppose 4g + 0f - 3f = 28, 4g - bf - 28 = 0. Solve -o - 3z - g + 0 = 0, -2z = 5o - 17 for o. 5 Let m be (6 + -4)(-237)/6. Let h = 94 + m. Solve f - k + 3 = 0, -6f + f + 2k - h = 0 for f. -3 Let j(v) = -2v + 10. Let o be j(2). Solve 0 = 4r - 0r - 2m + o, -m - 12 = 3r for r. -3 Let o be (0 - 2) + 628/(-4). Let b = 130 + o. Let f = 2 + 2. Solve 0 = 4v - 6v + 5h + 23, -4 = -fv - bh for v. 4 Let y = 151 - 151. Solve -3j + 3 = -2m - 4, y = m - 4 for j. 5 Let j be (26 + -2)(-6)/(-9). Suppose 5v - 3z = 75, 0z - 4z + j = 3v. Solve 2h = 4h + 5b + v, 4h + 14 = -5b for h. -1 Let c(o) = 3o - 2 + 2o + 5o*3 - 2o*3 + 5o*2 - 4o*3. Let n be c(6). Let u = 11 + n. Solve a - uh - 10 = 0, -2h - 3h = -5a + 10 for a. -2 Let w be (-12)/((-180)/270). Solve 3f + 8 + 1 = 3m, 4m = wf + 9 for m. 0 Suppose 0 = 460i - 459i - 2. Solve -3p - n + 12 = 0, p + 0n - 4 = -in for p. 4 Suppose -a - 7 = -9. Suppose k + 24 = -h - 0, ah = 3k - 38. Let q be 4/h + 204/33. Solve 2l = 3g - 5, l + 2g = 3l + q for l. -4 Let y be (-1554)/(-77) + (-4)/22. Suppose 5p - 3i = -6 + 4, 5i - y = 0. Solve 3d = -3g, p + 2 = -2d - g for d. -4 Let i be 2/(-12 - 0) - 558/(-108). Solve 0 = 5w - if + 10 + 10, -3f = 3w + 18 for w. -5 Suppose -12d + 125 = 101. Solve 4z = 2u - 12, -3z = du + 1 + 1 for z. -2 Let q(w) = -2 + w - 2 + 8 + 8. Suppose 5a + 17 = -3g, 0 = 5a - 10 - 0. Let k be q(g). Solve 8 = -4y + 2y, -km + 10 = -y for m. 2 Suppose -126i = -124i - 4. Solve 12 = 5b - c, ib + 0c + 3c - 15 = 0 for b. 3 Let u be 1/6 - (-490)/12. Let x(c) = -5c + 1. Let l be x(6). Let w = u + l. Solve -a = 5m - 13, -3m = 5a - w - 9 for m. 2 Let c be (-272)/(-34) - (7 - 0 - 1). Solve -1 = -r, -t = -cr + r for t. 1 Let m(j) = -6j + j + j*3 - 4j - 10 + 6j2. Let a be m(-7). Suppose d - 2 = ah - 5h, 3d = -2h + 4. Solve 0 = -z - 3g, -6z + z + 3g = d for z. 0 Let r = 152 +	{ "pile_set_name": "DM Mathematics" }
4d - 70, 0 = -3m + 377d - 378d - 26 for m. -2 Solve 0 = s - 14s + 11s - 13j + 40, -5j = 21s - 7j + 134 for s. -6 Solve -3i + 8l = 101, -71319l + 71320l = -2i + 15 for i. 1 Solve 2544l + 2d = 2539l + 33, -35l = d - 244 for l. 7 Solve -4y + 33 = 2q - 55, 2y = y + 22 for q. 0 Solve 2v = -3x, v - 272 + 258 = -5x for v. -6 Solve 4052 = -4v + b + 4066, -3b + 6 = 0 for v. 4 Solve -4z = -70c + 65c - 65, -4c - 202z = -58z - 684 for c. -9 Solve -2s + 6t = -0t + 48, s - 8s - t + 44 = -0s + 124 for s. -12 Solve -30610 = 12s + 2g - 30762, 2s = 3s + 2g - 9 for s. 13 Solve 62 = 18w - 17w + 4d + 96, -4w + 0d - 2d - 66 = 0 for w. -14 Solve -655j + 652j + 6 = 0, -4j + 24 = -4v for v. -4 Solve 9s = u - s, -7 = -2u - 4s + 17 for u. 10 Solve 3f - 281b = -282b + 62, 80f - 84f - 6b + 77 = b for f. 21 Solve -4v + 3n + 15 = 0, -3v = v - 8v + 2n + 6 for v. -3 Solve 2d - a = -4a - 55, 231 = -12d + 15d - 2a + 281 for d. -20 Solve 4y + 108 = -o + 9o, -2o = 3y - 20 - 3 for o. 13 Solve 2v - 48y = 5v - v + 250, 0 = -49y + 48y - 5 for v. -5 Solve 8m - 14m + 3d + 3 = 0, -26m - 4d = 30 + 8 for m. -1 Solve 5v + 5y = 0, 469v - 70 = 499v - 5y for v. -2 Solve 0 = -y + 3s + 46, 21y + 385s - 383s + 9 = 0 for y. 1 Solve -3a + 241 - 247 = -6a, -3w - 3a - 13 = -64 for w. 15 Solve -27c - 262z = -260z - 10, -c + 386 = 5z + 361 for c. 0 Solve 0 = -142w + 2n - 6399 + 6123, 3w - 3n - 6 = 0 for w. -2 Solve 0j - 3j + 83 = 4l, -48l - 3272 = -16l - 16l - 11l - 157j for l. 5 Solve 3c - 1919p + 1914p = -34, 0 = 3c + 17p - 76 for c. -3 Solve -5z = -5n + 50, -33z + n + 627 = -81z for z. -13 Solve 4k + 274 = x + 274, 7k - 25 = 3x for x. -20 Solve -5t + 540 - 542 = 4h, -4h = -4t - 0h + 56 for t. 6 Solve 12v + 0w + 48 = 2w, -4v + 8930 = -2w + 8938 for v. -5 Solve -3i - 3 = 0, -56d - 76d - 38d - 2i = -11d - 475 for d. 3 Solve 2g + 4l + 6431 = 6459, -l = 14g - 61 for g. 4 Solve 17757m + o = 17760m + 8, -o = -8m + 4m - 8 for m. 0 Solve 2h - 199 = -2r - 273, 0 = 2h + 3r + 107 for h. -4 Solve 0 = 4z + 4g - 45 - 51, 42g = 2z + 40g - 68 for z. 29 Solve -4j - 3v + 80 - 131 = 0, 75j + 5v + 700 = 0 for j. -9 Solve -38f + 20w + 123 = 17w, -3w - 15 = -f + 3w - 2w for f. 3 Solve 665 = -3w + 19g, 81 = 4w + 3g - 24 for w. 0 Solve 54b + 15 = -3t + 52b - 26, 4t = b - 40 for t. -11 Solve -5n = 15, -2m = -5n - 38 + 17 for m. 3 Solve -s + 7t + 3823325 = 3823338, -5t = -5s + 25 for s. 8 Solve -4865586 + 4865611 = x + 5k, -4x + 52 = 8k for x. 5 Solve 0 = -2i - 2u + 1048 + 1031 - 2119, -3i + 520 = -26u for i. 0 Solve 2i = 3f - i - 48, -5f - 2i = -6f + 14 + 20 for f. -2 Solve -12k + 6l = 5l + 2l - 5l + 28, 0 = 5l + 10 for k. -3 Solve -196 = 3c + 29r, c - 172r + 173r + 22 = 0 for c. -17 Solve 3 = 5r - 2n + 45, 0 = r - 4r - 45n + 19 + 2 for r. -8 Solve 2m - 104l - 83l + 53l + 658 = 0, 0m + m + 8l - 46 = 0 for m. 6 Solve 4m = -4n + 132, -2m + 641 = 8n + 587 for n. -2 Solve -4p - 10 = 2n, -37n - 35n - 7 = -70n + p for n. -3 Solve 3224 = 3c + u + 3167, 95 = -13c + 2u for c. 1 Solve 5w + 32 = 453521o - 453524o, 4w + 16 = 0 for o. -4 Solve 3q - 9l - 12860 = -12935, 5l = -q + 2l - 43 for q. -34 Solve 35j = 5i + 1679 - 74, 0 = -8j + 2i + 366 for j. 46 Solve -5j = -4b + 150, 4j = b + 160366 - 160475 for j. -26 Solve 166 = 2u - 34c, 0 = -3u + 2u - 2u - c - 11 for u. -2 Solve 79f - 2w = 128, -105f + 101f = -5w + 67 for f. 2 Solve -4b - 21253f + 21258f - 80 = 0, -b - 20 = -3f for b. -20 Solve 3g - 3014o + 35 = -3009o, -25 = g - 5o for g. -5 Solve 5t - 7 = 4a, 0 = -2t + 1436a - 1434a + 6 for t. -5 Solve 3291y - 2j = 3294y + 1, 3y = j - 4 for y. -1 Solve 114v - w - 585 = w + w, 2w + 80 = 14v for v. 5 Solve 126g = 5q + 348, 4q = -5q + 5q + 8q - 5g - 9 for q. 6 Solve -17p + 20p + 5t = -1, -6p + 5t + 3t + 34 = 0 for p. 3 Solve -159d - a = -131d + 2a - 57, 0 = -a - 0a - 9 for d. 3 Solve 4n + 71708p = 71695p - 70, n + 3 = 4p for n. -11 Solve 8u - 87 = -3x, -2x + 800u = 769u + 269 for x. 5 Solve -6u + 5u - 5w = -42 - 52, 0 = -78u - 5w + 17 for u. -1 Solve 2j - 10 = 2o, 1228 = -175o + 168o - 0j - j + 1233 for o. 0 Solve -2445490 = -14v - 2445532, -4f - 124 = 4v for f. -28 Solve -4p = 3l + 58, -7034l - 7029l - 41 = -14060l + 3p + 1 for l. 2 Solve -5c + 14x + 25x = 44x + 25, -4c = -3x - 15 for c. 0 Solve -4350 = -x + 161h, 0 = -x - h + 1535 - 1559 for x. 3 Solve 3r = 14p - 96, 0 = -202r + 201r + 3p - 22 for r. -4 Solve 2h - 5h - 2h - 55 = 5m, 0 = -5h + 4h + 10m - 11 for h. -11 Solve 0 = w + 3v - 29, -996v = -2w + 996v - 1987v - 30 for w. 5 Solve -c + 3277 - 3276 = -5u, 2c - u - 20 = 0 for c. 11 Solve 176h - 117 = 180h - u, -3h - 102u = -426 for h. -28 Solve -4r - i - 39 = 0, 123504i - 123507i - 117 = -4r for r. 0 Solve -3v - t = -20, 67v - 87t + 171t - 81t = 466 for v. 7 Solve u - 4b = 22, 1243u = 1251u - b - 21 for u. 2 Solve -42g + 13 + 39 = -41g + 3k - 19, 0 = 2g - 3k - 124 for g. 65 Solve 115l + 5i + 29 = 104l, -5 + 5 = 4l + 3i + 7 for l. -4 Solve 3x + 7z + 0z - 2z = -571, 0 = -5x + 54z + 3925 + 2354 for x. 3 Solve 141u = 143u + 4t + 12, 245 = -31u - 3t - 0t for u. -8 Solve 426d - 3w = -406d + 837d + 7, 0 = 53d - 3w + 283 for d. -5 Solve 5319t + 160 = 5321t + 5b, 8t - 4b = -176 for t. -5 Solve -2p - 4h = 5 - 34 - 9, 4h = -p + 41 for p. -3 Solve 4q - 5l - 27 = 0, -9q - 5l + 1270 - 1258 = 0 for q. 3 Solve 2x - a = 0, -1403150x + 1403144x - 5a = 0 for x. 0 Solve 5f = -2p - 298, -74546f - 699 = 5p - 74545f for p. -139 Solve -2n = 12r - 44, -31 - 5 = 2r + 124n - 128n for r. 2 Solve 27n - 279r + 139r + 449 = -138r, 0r + 3r + 83 = -4n for n. -17 Solve 4q - 4 = 0, -2k - 22169 + 22112 = -51q for k. -3 Solve 80 = -5g + 3u, -4g + 0u - 116 = 3u - 79 for g. -13 Solve 2c = -4k + 40461898 - 40461900, 1 = 15k - c for k. 0 Solve 0 = 5w + 45 - 25, -2z - 2z + 40 = 176w - 186w for z. 0 Solve -299d + 226d + 4l = 114, -26 = d + 3l for d. -2 Solve 39m = -5u - 2705, -16 + 79 = 5u - 2m + 27 - 129 for u. 5 Solve -14z + 46 + 492 = -16z + 31z + h - 244, 2h = -2 for z. 27 Solve 1067b - 1070b + 28 = m, 5m + 2b - 153 = 0 for m. 31 Solve -11y - 50y = 3b - 59y + 24, 0 = -2b + 4y - 32 for b. -10 Solve -4j + 3l - 35 = 0, 9j + 5l = -203 - 191 + 468 for j. 1 Solve -2b + 16304 = 3w + 16321, 47 = 13b - 12w for b. -1 Solve 0 = 4x + 8, -201m + 397m + x = 199m - 8 for m. 2 Solve -2b + 21g = 0, -4892b + 4890b + 2g - 45 - 31 = 0 for b. -42 Solve 6z = -4y + 46, -6z - 62965y + 33 = -62962y for z. -1 Solve 2394 = -114m + 3z - z, m + 3m - 3z + 84 = 0 for m. -21 Solve 4l + 4h = -12, -6l - 4l + 7 = -4l - h - 3 for l. 1 Solve 2b + 3h = h - 14, -b - 708 + 861 = -31h for b. -2 Solve 4g - 2o = -1948 + 1916, -3g = -5o + 59 for g. -3 Solve -3d + 12b + 10 + 25 + 1 + 3 = 0, b = -4 for d. -3 Solve -3a - 1110 + 367 + 370 = 9g - 367, 12 = -2g + 2a for g. -2 Solve 3f + 5b + 219 - 238 = 0, 3b = 4f - 2b - 72 for f. 13 Solve -5z - 47 = -3x - 66 + 133, 15z - 2x = -76 for z. 0 Solve -3d = 96x - 759, 636 - 665 = -4x - d for x. 8 Solve -4355z + 4399z + 1178 = 6g - g, -54 = 2z for g. -2 Solve 4c + 31514 = 2f + 31478, 5f - 105 = -5c for f. 20 Solve 14 = -r + t + 42 + 35, -r - 2t + 2290 - 2236 = 0 for r. 60 Solve 36h - 10 = -2r - 34h - 27h + 96h, -21r - 5h = -138 for r. 8 Solve 3 = 4o - 1, 2o - 3o = -2p - 502 + 491 for p. -5 Solve -6b - 85 = 5x, 164x + 159x + 4b = 321x - 42 for x. -11 Solve 0 = -500q + 504q - 9a - 59, 0 = 5q - 2a - 46 for q. 8 Solve 0 = -2i + 7y - 207, 0 = 4i + 170729y - 170728y - 21 for i. -2 Solve -8v - 2909 + 3030 = 3m, -4v - m + 39 = 0 for v. -1 Solve 2113a - 2118a + 90 = -5k, 4k + 12 = 0 for a. 15 Solve 5l = -3u + 30 - 47, 3l = -3u - 15 for l. -1 Solve 460n + 460n - 921n + 5l = 62, 0 = -26n - l - 1743 for n. -67 Solve 0 = -2j + 44a - 1138, -j + 704a - 705a = -29 for j. 3 Solve 0 = -3q - 4z - 116, -892q - 3z - 112 = -896*q for	{ "pile_set_name": "DM Mathematics" }
d(c) wrt c? -180c2 Let i(s) = -s3 + 7s*2 - 11s + 22. Let n be i(5). Differentiate -10k4 + 2k*4 + 21 + n wrt k. -32k*3 Let d(s) be the first derivative of 77s*6/6 - 3s*2/2 - 12s - 19. What is the second derivative of d(i) wrt i? 1540i3 Let y(h) = -3h*4 - 6h*3 + 4h*2 - 3h - 1. Let i(b) = b3 - b2 + b. Let o(w) = 4i(w) + y(w). Find the second derivative of o(v) wrt v. -36v*2 - 12v Let f(i) = -37i2 - i - 195. Let d(p) = 19p*2 + p + 96. Let j(x) = -5d(x) - 3f(x). What is the second derivative of j(k) wrt k? 32 Let n(o) = -119o*4 - 13o*3 - 88o*2 - 7. Let g(j) = 40j*4 + 4j*3 + 29j*2 + 2. Let c(q) = 7g(q) + 2n(q). What is the third derivative of c(m) wrt m? 1008m + 12 Let f(a) be the third derivative of 0 + 0a3 + 0a*6 + 0a*7 + 0a + 0a5 - 19/12a*4 - 5/42a*8 + 30a*2. What is the second derivative of f(r) wrt r? -800r*3 Find the first derivative of 20 - 18 - 168 - 3 + 43x*3 wrt x. 129x2 Let h(l) = l2 + 5l + 14. Let d be h(-5). What is the derivative of db - 6b - 8b + 3 - 10b2 wrt b? -20b Let u(y) be the first derivative of 0y2 - 11/3y*3 + 17 - 7y. Find the first derivative of u(r) wrt r. -22r Suppose 0a + 8 = a. Let f(r) = r*2 - 8r + 2. Let k be f(a). What is the first derivative of 7 + 4 - 4xk - 5 wrt x? -8x Let y(v) be the first derivative of 83v3/3 + 139v2/2 - 45. What is the second derivative of y(c) wrt c? 166 Let q(h) = -h3 - 13h2 - h - 6. Let s be q(-13). Suppose 4g + 4u - 24 = 0, 4g - 7 = 2u + 35. What is the derivative of 3f4 + g - s + f4 wrt f? 16f3 Let b(l) be the third derivative of 0l*5 + 0 + 0l*3 + 0l + 5/12l4 + 6/35l*7 + 11l*2 + 0l*6. What is the second derivative of b(r) wrt r? 432r*2 Let b be (-4 + 3 - 1)-1. Let w be ((-4)/1)/(1 - b). Differentiate -2j3 + 25 + wj*3 - 23 wrt j. 6j*2 Let c(x) = 5 + 4x - x + 0x2 + x2 + 9x. Let b be c(-12). What is the second derivative of -7p + 2p + 12p4 - bp - 4p wrt p? 144p*2 Find the second derivative of -193w - 22w5 - w2 + 8266w*4 - 8266w*4 wrt w. -440w*3 - 2 Let w(a) = 2a*2 + 16a - 16. Let g be w(-9). Find the third derivative of x2 + x3 + 12x2 + 18x*g + 5x*3 wrt x. 36 Let g be ((-6)/(-3))/((-4)/8). Let v = -1 - g. What is the first derivative of -5 - vf*2 + 6 - 6 wrt f? -6f Suppose 5i - 10 = -0i. Suppose 33 + 4 = 5k + 4x, 8 = k + x. What is the derivative of -ko2 + 5oi - 2 - o3 wrt o? -3o2 Let a(w) = 4w2 + w + 2. Let t(h) = h2 + 4h - 3. Let r be t(-4). Let o be a(r). Find the third derivative of 9d*6 - 35d + 2d2 + od + d*2 wrt d. 1080d*3 Let v(d) = -485d*3 + 6d*2 - 293d. Let p(a) = -2a3 - 2a*2. Let j(c) = 3p(c) + v(c). Find the second derivative of j(k) wrt k. -2946k Let h(r) be the third derivative of 23r*4/12 + 485r*3/6 - 49r*2 - 2. Differentiate h(s) with respect to s. 46 What is the second derivative of -260r - 254r + r + 244r*2 + 111r wrt r? 488 Let p(z) = -23z3 + 93z*2 - 19z + 28. Let s(c) = -8c3 + 31c*2 - 7c + 9. Let f(m) = -3p(m) + 8s(m). What is the second derivative of f(u) wrt u? 30u - 62 Let n = 7 - 5. Find the second derivative of -16u + 498u2 + 8u*3 - 498u*n wrt u. 48u Let w = -14 + 14. Let l be w/3 - (-2 - 0). Differentiate 2 - l + 1 - 3k4 + 9k*4 with respect to k. 24k*3 Suppose -4q = 2 - 10. Let b(c) = -c*2 - 8c - 12. Let v be b(-5). What is the third derivative of -w*6 + vw*2 - 6w6 + wq wrt w? -840w3 What is the second derivative of 5 - 3j + 23j2 + 41j*3 + 8j + j - 23j2 wrt j? 246j Let u = -14531/12 + 1211. Let k(r) be the second derivative of 0 - r + ur4 + 0r*2 - 9/20r*5 + 0r*3. Find the third derivative of k(f) wrt f. -54 Let l be 4/((-5)/(5/(-2))). Suppose lb - 4 - 4 = -2a, -2a = 4. What is the first derivative of -b - 2v3 + 0v*3 + 5v3 - v3 wrt v? 6v2 Let r(h) = 43h - 6h2 - 13h + h*2 - 4h*2. Let s(t) = 8t*2 - 31t. Let g(n) = -6r(n) - 5s(n). What is the second derivative of g(j) wrt j? 28 Let b(w) be the third derivative of -15w4/2 - 9w*3/2 - 133w2. What is the derivative of b(j) wrt j? -180 Let g(z) = z3 + 8z2 + 5z - 2. Let d be g(-7). What is the third derivative of -da2 + 27a*3 - 3a*2 - 27a*3 - 9a*6 wrt a? -1080a*3 Let f be 1 + -2 - -1 - -4. Differentiate -4 - 20d*4 + 3d*f - 3 - 16 wrt d. -68d3 Let o be (-1)/(3/(-2 - 1)). Let q = -1 + o. Find the first derivative of 1 + g4 + q + 5g4 - 2g*4 wrt g. 16g*3 Let m(c) be the first derivative of -7c5/40 - c4/12 - 10c3/3 + 10. Let p(q) be the third derivative of m(q). Find the first derivative of p(k) wrt k. -21 Let m(w) be the third derivative of 0 - 4w*2 + 0w - 1/4w4 + 3w*3. Differentiate m(b) with respect to b. -6 Let s(x) be the second derivative of 11x + 0 + 11/2x2 - 2/3x*3. Differentiate s(r) with respect to r. -4 Suppose 0 = -6c + 13 + 71. What is the third derivative of -c + 35w2 + 5 + 18w*6 + 9 wrt w? 2160w*3 Find the third derivative of 247q - 245q + 3q*2 + 6q*2 - 5q*4 + 2q*3 wrt q. -120q + 12 Let v(g) be the third derivative of 0g3 + 0g*5 + 5/336g*8 + 0g*6 - 1/8g*4 + 0 + 0g + 0g7 + 6g*2. Find the second derivative of v(d) wrt d. 100d*3 Let g(t) = -3t - 1. Let d be g(-1). Find the third derivative of -10pd - 10p*4 - 58p*3 + 58p*3 wrt p. -240p Let r(b) be the first derivative of -262b5/5 + 38b*3/3 + 324. What is the third derivative of r(t) wrt t? -6288t Suppose -2q + 5q = 9. Suppose 2g - qg + 113 = 0. What is the second derivative of -113 + g - 3y + y4 wrt y? 12y*2 Find the third derivative of -15y*3 - 5y*3 - 14y*4 + 21y*3 - 115y2 + y4 wrt y. -312y + 6 Let h(m) = -2m*2 - 9m - 1. Let n be h(-4). What is the derivative of 3c3 + 4c*3 - 12c*n - 11 wrt c? -15c*2 Let h(o) be the third derivative of -2/15o*6 - 1/8o*4 + 0o*5 - 5/3o*3 + 0o - 1/210o7 - 51o*2 + 0. What is the second derivative of h(k) wrt k? -12k*2 - 96k Let v(a) be the second derivative of -1/30a6 - 3a*2 + 0 + 0a*5 + 0a*3 + 0a*4 - 2a. Find the first derivative of v(f) wrt f. -4f3 Let z(w) be the first derivative of 22w*2 - 91w - 17. Let s(c) = -9c + 18. Let k(y) = 22s(y) + 4z(y). Differentiate k(u) wrt u. -22 Let t be 0/(-63/(-9)). Differentiate 4g3 + tg*3 + 3 + 5 with respect to g. 12g*2 Let y(w) be the third derivative of 79w*9/56 + 341w5/60 + w3/3 + 152w2 + 1. What is the third derivative of y(l) wrt l? 85320l3 Let s = -7 + 9. Let v(a) = -a3 + 2a2 + a + 1. Let n be v(2). Differentiate -3b*2 - nb*s + 4 + 6b*2 - 5b*3 wrt b. -15b*2 Let h be (-2 - 4/(-8))-2. Find the second derivative of -17 + 8r4 + 6 + hr + 11 wrt r. 96r2 Let p(j) be the second derivative of j5/4 - 17j*4/4 + 226j3/3 + j2 - 77j. What is the second derivative of p(u) wrt u? 30u - 102 Let c(b) be the second derivative of 17b6/60 - 7b*4/8 - 2b*2 - 39b. Let j(i) be the first derivative of c(i). Find the second derivative of j(z) wrt z. 204z Suppose 0 = 4j + 4 - 16. Let y be j/1 + 11 + -9. Find the second derivative of -3m + my - 208m*2 + 208m*2 wrt m. 20m*3 Suppose -6j = -4j - 26. Suppose -4i = q - j, i = 4q - 3 + 2. Find the second derivative of 5w - 2w - 16w*i + 16w*3 + 2w*5 wrt w. 40w*3 Let k(d) be the second derivative of 41d*6/15 + 115d*3/3 - 218d. What is the second derivative of k(o) wrt o? 984o2 What is the derivative of -5261z*2 - 82 + 5847z*2 + 18 - 29 wrt z? 1172z Let g(l) = 30l4 + 9l*2 + 45l + 971. Let k(v) = 8v4 + 2v*2 + 11v + 243. Let s(z) = 2g(z) - 9k(z). Find the first derivative of s(w) wrt w. -48w3 - 9 Let v(a) be the third derivative of a6/40 - a5/30 - 127a3/6 - a2 + 18. What is the first derivative of v(b) wrt b? 9b2 - 4b Let c be (-1199)/(-66) - (10/(-12) + 1). What is the first derivative of -15q + 11 + 8q - 30 - cq wrt q? -25 Let f(k) be the third derivative of -89k*8/112 + 7k*4/8 + 7k*3/6 + 135k*2. What is the second derivative of f(n) wrt n? -5340n*3 What is the third derivative of 11v*2 - 4v*4 + 8v**4 -	{ "pile_set_name": "DM Mathematics" }
PM and 3:22 AM? 493 What is 553 minutes after 6:13 PM? 3:26 AM What is 90 minutes after 6:33 PM? 8:03 PM How many minutes are there between 2:50 AM and 5:24 AM? 154 How many minutes are there between 7:38 PM and 11:00 PM? 202 How many minutes are there between 4:02 PM and 3:24 AM? 682 How many minutes are there between 4:23 AM and 7:24 AM? 181 How many minutes are there between 10:03 AM and 12:15 PM? 132 How many minutes are there between 3:37 PM and 1:18 AM? 581 How many minutes are there between 8:08 AM and 10:44 AM? 156 What is 689 minutes before 10:46 AM? 11:17 PM What is 576 minutes before 7:58 AM? 10:22 PM What is 496 minutes after 10:17 AM? 6:33 PM How many minutes are there between 9:58 PM and 6:19 AM? 501 What is 661 minutes after 9:42 AM? 8:43 PM How many minutes are there between 2:35 AM and 10:00 AM? 445 What is 238 minutes after 8:35 PM? 12:33 AM How many minutes are there between 6:14 PM and 6:23 PM? 9 What is 387 minutes after 10:59 PM? 5:26 AM What is 310 minutes after 11:03 AM? 4:13 PM How many minutes are there between 1:51 AM and 2:35 AM? 44 How many minutes are there between 2:02 AM and 12:13 PM? 611 How many minutes are there between 10:00 PM and 9:04 AM? 664 How many minutes are there between 12:24 AM and 5:29 AM? 305 What is 400 minutes before 3:52 AM? 9:12 PM How many minutes are there between 2:32 AM and 3:25 AM? 53 What is 627 minutes after 5:58 PM? 4:25 AM What is 490 minutes before 1:53 AM? 5:43 PM What is 353 minutes before 3:38 PM? 9:45 AM What is 706 minutes before 3:19 PM? 3:33 AM How many minutes are there between 7:44 AM and 10:40 AM? 176 How many minutes are there between 5:26 PM and 7:26 PM? 120 How many minutes are there between 12:30 AM and 11:30 AM? 660 What is 59 minutes after 7:52 AM? 8:51 AM What is 4 minutes before 8:59 AM? 8:55 AM What is 549 minutes before 9:46 PM? 12:37 PM How many minutes are there between 5:59 PM and 1:18 AM? 439 What is 298 minutes after 1:07 PM? 6:05 PM What is 20 minutes after 6:02 PM? 6:22 PM How many minutes are there between 9:18 PM and 3:25 AM? 367 How many minutes are there between 12:46 AM and 5:49 AM? 303 What is 503 minutes after 10:56 AM? 7:19 PM What is 300 minutes before 8:24 PM? 3:24 PM How many minutes are there between 6:45 AM and 2:33 PM? 468 How many minutes are there between 2:37 AM and 4:43 AM? 126 What is 421 minutes after 4:54 AM? 11:55 AM How many minutes are there between 9:48 AM and 12:12 PM? 144 How many minutes are there between 9:19 AM and 7:26 PM? 607 What is 77 minutes after 1:01 PM? 2:18 PM What is 549 minutes after 11:55 AM? 9:04 PM How many minutes are there between 12:14 AM and 9:23 AM? 549 What is 71 minutes before 2:22 PM? 1:11 PM How many minutes are there between 12:16 AM and 4:42 AM? 266 What is 137 minutes before 11:14 AM? 8:57 AM What is 313 minutes after 9:52 PM? 3:05 AM How many minutes are there between 1:47 PM and 9:15 PM? 448 How many minutes are there between 8:31 AM and 10:12 AM? 101 How many minutes are there between 4:03 PM and 1:44 AM? 581 What is 154 minutes before 7:41 PM? 5:07 PM What is 127 minutes before 5:02 AM? 2:55 AM What is 237 minutes before 5:36 PM? 1:39 PM What is 155 minutes before 6:31 PM? 3:56 PM What is 33 minutes after 5:02 AM? 5:35 AM What is 704 minutes after 1:11 PM? 12:55 AM What is 443 minutes after 1:05 PM? 8:28 PM What is 102 minutes after 11:26 AM? 1:08 PM What is 595 minutes before 2:57 PM? 5:02 AM How many minutes are there between 6:19 AM and 4:53 PM? 634 What is 60 minutes before 10:22 PM? 9:22 PM What is 706 minutes before 7:17 PM? 7:31 AM How many minutes are there between 6:49 PM and 2:31 AM? 462 How many minutes are there between 12:41 PM and 5:59 PM? 318 What is 587 minutes after 1:13 PM? 11:00 PM What is 92 minutes before 5:40 PM? 4:08 PM How many minutes are there between 1:19 AM and 11:06 AM? 587 What is 265 minutes before 6:20 AM? 1:55 AM What is 675 minutes after 1:30 AM? 12:45 PM How many minutes are there between 11:05 PM and 1:44 AM? 159 How many minutes are there between 4:53 AM and 9:45 AM? 292 What is 549 minutes after 1:25 AM? 10:34 AM What is 714 minutes before 6:30 PM? 6:36 AM What is 714 minutes after 8:32 PM? 8:26 AM How many minutes are there between 10:47 PM and 5:15 AM? 388 What is 504 minutes before 5:44 AM? 9:20 PM How many minutes are there between 9:57 AM and 5:45 PM? 468 What is 12 minutes after 7:39 PM? 7:51 PM What is 420 minutes after 7:53 PM? 2:53 AM How many minutes are there between 5:08 PM and 3:05 AM? 597 What is 634 minutes before 8:48 AM? 10:14 PM How many minutes are there between 1:45 AM and 11:40 AM? 595 What is 366 minutes before 6:56 AM? 12:50 AM What is 652 minutes after 2:05 PM? 12:57 AM How many minutes are there between 12:58 AM and 10:18 AM? 560 How many minutes are there between 4:58 AM and 12:06 PM? 428 What is 181 minutes after 9:28 PM? 12:29 AM How many minutes are there between 6:27 PM and 8:18 PM? 111 What is 139 minutes before 8:23 PM? 6:04 PM What is 401 minutes after 11:12 AM? 5:53 PM What is 419 minutes after 11:50 AM? 6:49 PM How many minutes are there between 11:31 PM and 2:35 AM? 184 What is 623 minutes after 12:27 AM? 10:50 AM How many minutes are there between 1:13 PM and 9:36 PM? 503 How many minutes are there between 10:15 PM and 5:01 AM? 406 What is 202 minutes after 7:37 PM? 10:59 PM How many minutes are there between 8:08 AM and 2:34 PM? 386 How many minutes are there between 1:20 AM and 6:30 AM? 310 What is 581 minutes after 1:49 PM? 11:30 PM What is 507 minutes after 8:55 AM? 5:22 PM What is 703 minutes before 12:26 AM? 12:43 PM What is 410 minutes before 5:42 PM? 10:52 AM How many minutes are there between 5:34 PM and 10:25 PM? 291 How many minutes are there between 8:41 AM and 4:31 PM? 470 What is 82 minutes after 8:21 AM? 9:43 AM How many minutes are there between 4:01 PM and 1:33 AM? 572 What is 502 minutes before 8:57 PM? 12:35 PM What is 186 minutes after 8:07 PM? 11:13 PM What is 634 minutes before 7:26 AM? 8:52 PM How many minutes are there between 4:25 PM and 8:28 PM? 243 What is 39 minutes before 7:45 PM? 7:06 PM How many minutes are there between 4:19 AM and 1:43 PM? 564 What is 317 minutes before 2:02 AM? 8:45 PM How many minutes are there between 2:33 AM and 1:17 PM? 644 What is 315 minutes after 7:33 AM? 12:48 PM What is 289 minutes before 8:51 AM? 4:02 AM How many minutes are there between 4:07 PM and 5:06 PM? 59 How many minutes are there between 4:22 PM and 2:08 AM? 586 What is 135 minutes before 4:01 PM? 1:46 PM What is 6 minutes before 5:09 PM? 5:03 PM How many minutes are there between 5:37 AM and 11:08 AM? 331 What is 154 minutes after 11:39 PM? 2:13 AM What is 625 minutes before 2:34 PM? 4:09 AM What is 223 minutes before 1:56 PM? 10:13 AM What is 456 minutes after 11:00 PM? 6:36 AM What is 616 minutes after 5:35 PM? 3:51 AM How many minutes are there between 12:05 AM and 11:26 AM? 681 How many minutes are there between 8:06 AM and 8:25 AM? 19 How many minutes are there between 3:48 AM and 2:13 PM? 625 How many minutes are there between 9:04 AM and 5:12 PM? 488 What is 126 minutes after 9:58 PM? 12:04 AM What is 394 minutes after 10:46 AM? 5:20 PM How many minutes are there between 12:18 PM and 8:20 PM? 482 How many minutes are there between 7:30 AM and 2:16 PM? 406 How many minutes are there between 9:10 AM and 3:04 PM? 354 How many minutes are there between 10:56 PM and 1:08 AM? 132 What is 453 minutes before 8:20 PM? 12:47 PM What is 693 minutes before 8:14 PM? 8:41 AM What is 458 minutes after 7:08 AM? 2:46 PM What is 296 minutes after 3:14 PM? 8:10 PM What is 303 minutes before 1:55 PM? 8:52 AM How many minutes are there between 2:48 PM and 6:57 PM? 249 How many minutes are there between 12:54 AM and 8:13 AM? 439 How many minutes are there between 12:55 PM and 9:47 PM? 532 How many minutes are there between 6:13 AM and 10:09 AM? 236 What is 195 minutes after 7:10 PM? 10:25 PM What is 501 minutes after 3:54 AM? 12:15 PM What is 675 minutes after 2:08 AM? 1:23 PM What is 503 minutes before 12:40 AM? 4:17 PM What is 507 minutes before 12:48 AM? 4:21 PM How many minutes are there between 5:32 PM and 8:06 PM? 154 How many minutes are there between 8:41 PM and 6:13 AM? 572 What is 371 minutes after 5:34	{ "pile_set_name": "DM Mathematics" }
d) = 4d + 1. Suppose 11m = 5m - 12. Determine a(m). -7 Suppose 8 = -4y + 8y. Let n(q) = -3 - q2 - qy + 2 - q2. What is n(1)? -4 Let d(z) = -2z*3 + 6z*2 - 6z - 2. Let g(r) = -6r3 + 17r*2 - 17r - 5. Let i(h) = 8d(h) - 3g(h). Suppose 16 = -9v + 17v. Give i(v). 9 Let s(z) = 4z3 - 3 + 1 + 233z*2 + 4z - 3z3 - 237z*2. Suppose 2 = k - 0k. Calculate s(k). -2 Suppose -400 = 109n + 80 + 174. Let f(j) = 11j - 5. Let y(q) = -5q + 2. Let z(t) = -6f(t) - 13y(t). Give z(n). 10 Let a(r) = 1. Let p(o) be the second derivative of o3/2 + 2o*2 - 14o. Let s(i) = -5a(i) + p(i). Give s(-1). -4 Let j(f) be the first derivative of -5f*3/3 + f + 209. Determine j(2). -19 Suppose 0 = -43l + 49l + 30. Let y(z) = z3 + 4z*2 - 7z - 8. Give y(l). 2 Let b(c) = 8c3 - 15c*2 - 3c - 1. Let k be b(2). Let q(o) = -2o2 + 3. Calculate q(k). -15 Let c(h) = 3 + 17h*2 - 19h*2 + 2h + h*2. Calculate c(5). -12 Suppose 0 = 10n + 17 + 53. Let k(b) be the first derivative of -b*2/2 - 9b - 1. Let i be k(n). Let z(w) = -9w - 2. Calculate z(i). 16 Let x(z) = -8z3 - z2 - z - 1. Let v be x(-1). Let h(u) = 11u + vu - 21u. Suppose 3p - 2p + 4 = 0. Calculate h(p). 12 Suppose -o - 4 + 36 = 0. Suppose 0 = 5s + 4a - 49, 3s + 3a = -2a + o. Let q(c) = 2c - s + 0 + 20 - 7. Calculate q(-5). -6 Let d(i) = i3 + 5i*2 + 5i. Let u be d(-2). Suppose 0j - 4 = -uy + 3j, 12 = 2y - j. Let f(o) = 2o2 - o2 + 1 - yo + 7. What is f(6)? -4 Suppose 4n - 2x - 2x - 8 = 0, -3n + 5x = -2. Let i(t) = -5t*2 + 5t - 5t + 5t + 3 - n - t*3. Let f(k) = k + 17. Let w be f(-23). What is i(w)? 5 Let c be 0/114 + (-2)/2. Let i(z) = 14z*3 + 2z2 - z - 2. Give i(c). -13 Let g(o) be the first derivative of -o4/12 - o*3 + 4o*2 + 2o - 7. Let k(j) be the first derivative of g(j). Suppose -2t - 17 + 5 = 0. Give k(t). 8 Let b(t) = -2t - 3. Let r(p) = -3p - 2p + 1 + p*2 - 5p*2 + 3p*2. Let k be r(-4). Suppose 3m + 17 = 5n, kn + 5m - m - 24 = 0. Give b(n). -11 Let r(d) = d3 - 10d*2 - 8d + 2. Let j = -82 + 93. What is r(j)? 35 Suppose d + 4m + 1 = -4, 5d - 19 = 2m. Let y(c) = -dc - 2c + 3c. Give y(1). -2 Let q be (-1 - (-1)/2)-4. Let z(x) = -6 + 8 + 2x*3 - 3 + qx*2. Calculate z(-2). -9 Let r be 3(-2 + 24/9). Let t(m) = 5mr + 8 + 5m - 3m - m3 - 11. Give t(5). 7 Let g = -61 + 63. Let r(x) = 11x*g + 8x2 + x3 + 7 - 9x2 + 9x. Determine r(-9). 7 Let b(t) be the first derivative of t5/60 - t4/8 - 2t3/3 + 18t*2 - 30. Let a(r) be the second derivative of b(r). What is a(4)? 0 Let w(y) = -3 - 12y*3 + 2 + 43y*3 - 24y*3. Give w(1). 6 Suppose 4c - 15 = 9. Let q(f) be the second derivative of -f4/12 + f3 - 2f2 - 462f. Calculate q(c). -4 Suppose 3i - 9 + 21 = 0. Let v(d) = -7d*3 - 5d*2 - 4d + 1. Let f(a) = a*3. Let l(k) = 6f(k) + v(k). What is l(i)? 1 Let u(o) = o + 1. Let c = 44 + -41. Suppose -cb + 2p - 20 = 0, 2b = -5p - 21 - 24. Let z be b-34/24. Give u(z). 6 Let a(w) be the second derivative of -w5/20 - w4/6 + w*2/2 + 2w - 34. Let l be 9-1 - (-3 - -2). Let f = l - -6. Calculate a(f). 1 Let c be (3/(-6) + 0)-2. Let f(i) = -c - 1 + 3 - 2i. Determine f(-2). 5 Let j be 118/14 + (-21)/49. Suppose g = 4g - 2b - j, 5b = -5g + 5. Let s(d) = -2d*2. Determine s(g). -8 Let s(f) = 3 + 4 - 8f - 1 - 4. Let a = 6 - 4. Calculate s(a). -14 Let a(t) = -5 - 13t + 3t*3 - 2t*3 + 3 + 11t*2 - 7t + 18t. Determine a(-11). 20 Let l(c) be the second derivative of c5/20 - c4/3 - c3/2 + 5c*2/2 + 29c. Let m be (0 - 1)/(15/(-60)). Calculate l(m). -7 Let o(n) be the third derivative of -n*6/120 + 3n*5/20 - 3n*4/8 + 11n*3/6 - 3n*2. Let f be 81/542/924. Give o(f). 3 Let o(k) = -k3 + 2k + 1. Let b = -27 - -29. Suppose -4m + 3q + 17 = 0, bm + q = 3m - 5. What is o(m)? -3 Let m(d) be the third derivative of -d*4/24 - 25d*3/6 + 120d*2 + 2d. Determine m(-18). -7 Let y(q) = 3q2 + q3 - 2q*3 + 6q - 2q + 0q*3. Let x be (2/5)/(2/20). Let c be y(x). Let v(j) = j - 1. Determine v(c). -1 Let c(q) be the third derivative of -5q4/24 + q3/2 - 3q2. Suppose b + 2b - 45 = 0. Suppose -2g + b = 9. Give c(g). -12 Let z(i) = -184i + 33 + 100i + 85i. Determine z(-14). 19 Let q(w) = -28w2 - w. Suppose -5j + 255 = 260. Calculate q(j). -27 Let c(p) be the third derivative of 13p6/60 - p5/30 + p3/3 + 118p*2. What is c(1)? 26 Suppose 2w + 300 = -w + 4k, -200 = 2w - 2k. Let d be (-2)/9 + w/(-45). Let y be 1 + 2/d + -4. Let t(f) = f3 + f2 + 2f + 3. Determine t(y). -5 Let g(h) = -h2 - 3. Let q(k) be the first derivative of k2/2 - 9k - 19. Let s be q(9). Give g(s). -3 Let v = -28 - -30. Let k(f) = -13f*2 + 5 + 2f + 4fv - 4. What is k(-1)? -10 Let q(a) = a2 - a + 2. Let o be q(3). Suppose z - o = -6. Let u(t) = t2. Give u(z). 4 Suppose -k - 2x = -8, -3k + 4 - 15 = -x. Let t = k + 5. Suppose -4r = -3r + t. Let b(a) = a + 3. Determine b(r). 0 Suppose 3m + 5c - 20 + 39 = 0, m = 3c + 17. Let t(i) = -2i3 + 2i*2 - 3i + 3. Give t(m). -11 Let i(p) = -6p3 + p2 - 1. Let u(f) = f + 15. Let d be u(-12). Let h = 2 + 0. Suppose m + d = h. Calculate i(m). 6 Suppose 4k - 1 = 7. Let m(h) = -1923h2 + 3834h*2 - 1909h*2. Give m(k). 8 Let q be 0/2 - (-2)/(-2). Let t(f) = -2f + 26. Let y be t(12). Let v(m) = -m*3 - 51m*y + 51m*2 - 2m*3 - 1. Calculate v(q). 2 Let o(g) = 3g*3 - 11g*2 + 10g - 18. Let c(a) = -10a3 + 32a*2 - 28a + 54. Let j(s) = 2c(s) + 7o(s). What is j(12)? 6 Let g(w) be the second derivative of w*4/12 + 3w*3/2 + 5w*2 + 69w. Calculate g(-6). -8 Let d(l) = -l*2 - 8l - 2. Let f = 4 - -1. Suppose 0 = 3t + 5i + 25, 2t + 55 = -3t + fi. Let k be 15/(-3)(-12)/t. Give d(k). 10 Let b(s) = -s2 - 2 - 2 - s3 + 3 + 3s. Suppose d = -3d + 4. Let r be -1-2d/1. Calculate b(r). -7 Let f(w) = w - 6. Let z be 2 - 2 - (-1 - -1). Let a be f(z). Let m(j) be the third derivative of -j6/120 - j5/10 - 2j3/3 - 7j*2. What is m(a)? -4 Suppose 4o = -4p - 44, 5o - 3p + 51 = -7p. Let g(c) = c*3 + 7c*2 - 2c - 7. Calculate g(o). 7 Let a(n) = n + 75. Let t(i) = 3i + 162. Let y(j) = 13a(j) - 6t(j). Calculate y(2). -7 Let l(p) = p + 7 + 0p - 15 + 26. Determine l(-15). 3 Let m(l) = -l*2 + 75 - 74 + 4l + 2l - 16l + 4l. What is m(-5)? 6 Let b(h) = 58h - 5 - 62h - 5h*2 + 0h2 - h3. Suppose -3g + 5 = -1. Suppose -gi + 19 = -7i - x, 0 = -5i - 4x - 16. Determine b(i). -5 Let w(i) be the first derivative of 14 + 26 - i2 - 4i - 27. Give w(-3). 2 Let o(f) be the second derivative of -f5/20 - f3/6 + 3f2/2 - 34f. Calculate o(3). -27 Let c(g) = g3 - g2 - g - 3. Let l be ((-18)/(-3))/(-2) - (-2 + -1). Let i be 6/120(-1 + l). What is c(i)? -3 Let m(i) = 3 + 3 + 4 - i + 10. What is m(-14)? 34 Let m(r) = 30r2 + 14r*2 - 2r - 2 - 56r2. Determine m(-2). -46 Let k(z) be the second derivative of -z + 5 + 0z*2 + 17/6z*3. Calculate k(-1). -17 Let z = -3 - 0. Let k(u) = 13u - 6. Let d(t) = 1 - 3 + t + 9t - 3. Let j(b) = -4d(b) + 3k(b). Give j(z). 5 Let j = -4 + 6. Let n(v) = 4v2 - 6 + v3 + jv - 4v*2 - 3v. Let l(s) = s*3 - 7s. Let a be l(0). Determine n(a). -6 Let c be 7(-3)/(-21)1. Let z(o) = 2o2. Calculate z(c). 2 Let d(p) = -p3 - 4p*2 - 2p. Let b(j) be the first derivative of j*2/2 - 3j - 11. Let x be b(0). Give d(x). -3 Suppose -4n = -5n + 12. Let l = -3 + 4. Let s be (-2)/(-4)nl. Let m(h) = h*2 - 7h - 4. Give m(s). -10 Let l be (6/12)/((-1)/(-4)). Let u(t) = 4t2 + lt - 3 - 2 + 0 - t*3 + t. Suppose 6g - 16 = 2g. Determine u(g). 7 Suppose -4c - 2 = -3c. Let k(v) = 3v + 9. Let s be k(c). Let x(w) = 2w - 1. Give x(s). 5 Let w(p) be the second derivative of p4/12 + 4p*3/3 + 5p*2/2 - 136p. Calculate w(-4). -11 Let z be (6/4)/((-5)/(-10)). Let x(t) = -5tz - 14t*2 + 1 - t + 13t*2 + 6t*3. What is x(2)? 3 Let a(m) = 9m - 3. Suppose -4w - b = b, 4b = -8. Calculate a(w). 6 Let j(z) = 8z + 3z2 + 5 - z2 - z*2. Let p = -8 - -8. Suppose p = -0f + 3f + 18. Determine j(f). -7 Let c be (-1)/((-93)/(-30) - 3). Let j(f) = 3f + 28. Give j(c). -2 Let k(g) = -6*g - 3. Let m(z)	{ "pile_set_name": "DM Mathematics" }
+ s + 1. (s + 2)*2/4 Factor 2w*5 + 128w + 28w4 + 66w*3 - 119935 - 224w*2 + 119935. 2w(w - 1)2(w + 8)*2 Suppose -26x = -88x - 14x. Factor -1/7b2 + x + 0b. -b2/7 Let a(n) be the second derivative of n6/360 - n*5/24 - 19n*3/6 - 9n. Let g(v) be the second derivative of a(v). Suppose g(u) = 0. What is u? 0, 5 Let i(x) = 2x2 + 70x - 1027. Let m(c) = -c*2 - 68c + 1026. Let q(l) = 2i(l) + 3m(l). Factor q(r). (r - 32)*2 Factor -16 + 16 - 6n + 0n + n2. n(n - 6) Let w be (4 + (-28)/(-7) - 8)/(2/1). Factor 0g2 + wg + 0 - 1/2g4 - 1/2g3. -g3(g + 1)/2 Let v = -626 - -630. Let d(a) be the second derivative of 2a + 1/4av + 0a*2 - 1/40a*5 + 0 - 3/4a*3. Factor d(o). -o(o - 3)2/2 Let o(g) be the third derivative of g9/6048 - g8/672 + g7/240 - g*6/240 + 23g*3/3 + 33g2. Let l(m) be the first derivative of o(m). Factor l(u). u2(u - 3)(u - 1)*2/2 Find u such that -2/11u*4 - 8/11u - 4/11u3 + 14/11u2 + 0 = 0. -4, 0, 1 Let p(g) = -g3 - 5g2 + 8g + 6. Let h be p(-6). Let n be 10/3 + 2/h. Find m, given that -4 - 2 + mn + 6 + m4 = 0. -1, 0 Let j(c) = 23c2 + 19c - 14. Let d(s) = 11s2 + 9s - 6. Let l(r) = -14d(r) + 6j(r). Find q, given that l(q) = 0. -3/4, 0 Let y(i) = -6i3 + 23i*2 + 6i - 37. Let b(n) = -2n3 + 8n*2 + 2n - 12. Let l(s) = -7b(s) + 2y(s). Factor l(w). 2(w - 5)(w - 1)(w + 1) Let h(p) be the second derivative of p6/24 + p5/12 + 6p*2 - 10p. Let x(b) be the first derivative of h(b). Find l, given that x(l) = 0. -1, 0 Let p = -14872/3 + 4958. Find x such that -2/3x5 + 4/3x*3 - 8/3x*2 + 4/3 + 4/3x*4 - px = 0. -1, 1, 2 Let q(x) be the second derivative of x7/42 - x6/15 + x*5/20 + 16x + 4. Find i such that q(i) = 0. 0, 1 Let j = -9 - -8. Let m be j - (0 + 3 + -6). Factor -3q2 + q + 2q*m + 1 + 4 - 3. -(q - 2)(q + 1) Factor 23r2 - 201r + 136r - 2r*2 + 6. (r - 3)(21r - 2) Let p(w) = 120w*4 + 10w*2 + 65w + 65. Let j(y) = -11y4 - y2 - 6y - 6. Let u(b) = -65j(b) - 6p(b). Determine x so that u(x) = 0. -1, 0, 1 Let t = 23080 - 23080. Factor -1/3i4 - 2/3i*3 - 1/3i*2 + 0i + t. -i*2(i + 1)*2/3 Let u = 220 - 220. Let n(i) be the third derivative of 0 + ui*4 - 1/210i*7 + 0i*5 + 2i*2 + 0i + 0i3 + 1/300i6. Factor n(k). -k3(5k - 2)/5 Factor -22/5a2 + 4/5a*3 - 8a - 14/5. 2(a - 7)(a + 1)(2a + 1)/5 Let w = 74173/173103 - -2/24729. Factor -3/7t3 - 12/7t*2 + wt + 12/7. -3(t - 1)(t + 1)(t + 4)/7 Let k = 579 + -579. Factor 1/4c*3 + 0c - 5/4c2 + k. c2(c - 5)/4 Let r = 94 + -91. Factor -3h4 + 16h*3 - 22h*r + 0h*2 + 0h*2. -3h*3(h + 2) Let l(g) = -8g + 133. Let r be l(22). Let j = 46 + r. Factor -6/5m - 2/5m4 + 2/5m*2 + 6/5m*j + 0. -2m(m - 3)(m - 1)(m + 1)/5 Let r(i) be the first derivative of 3i*4 - 38i*3/3 + 3i2 - 47. What is g in r(g) = 0? 0, 1/6, 3 Let z(t) be the first derivative of -t4/28 + t*3/7 - 3t*2/14 + 11t + 2. Let p(a) be the first derivative of z(a). Factor p(q). -3(q - 1)2/7 Factor -12z - 2z - 3z*2 - 12 - 15 - 4z. -3(z + 3)2 Solve -3x*3 + 5300x*2 - 75x - 42x3 - 5x*4 - 5415x*2 = 0 for x. -5, -3, -1, 0 Let r = 297443/44616 + -1/14872. Factor 92/3d + rd3 + 88/3d*2 + 8. 4(d + 1)(d + 3)(5d + 2)/3 Let j(a) be the first derivative of a6/420 - a5/105 - 7a2/2 + 5. Let m(z) be the second derivative of j(z). Determine d, given that m(d) = 0. 0, 2 Let a(z) be the third derivative of z5/15 - 11z4/120 - 3z*3/10 + 13z*2 - 2. Let a(y) = 0. What is y? -9/20, 1 Suppose 10 = -a + 3a. Let c be -21a/(-2). Factor 0 + 1 + 5m + cm*2 + m. (m + 1)(5m + 1) Suppose -5173 = 19l + 90. Let f = l + 280. Factor 0 + 4/5rf + 0r - 4/5r2. 4r*2(r - 1)/5 Factor -61j - 3j*5 + 66j*2 + 22j + 21j4 + 9 + 4j*3 - 58j*3. -3(j - 3)(j - 1)4 Let o(x) be the second derivative of 0x*4 - 49/5x*5 + 0 + 0x*3 - 27x + 0x2 - 2/21x*7 - 28/15x*6. Factor o(i). -4i*3(i + 7)*2 Let r(u) be the first derivative of 1/4u*4 - 9/20u*5 + 3/2u*3 - 2u - 3/2u2 + 5. Let n(l) be the first derivative of r(l). Solve n(h) = 0. -1, 1/3, 1 Let z be -14(-50)/(-160)18/(-15). Determine k, given that -zk*2 + 27/4k*3 + 0 - 3/2k = 0. -2/9, 0, 1 Factor -2/3r4 + 0 + 8/3r + 4r3 - 6r*2. -2r(r - 4)(r - 1)*2/3 Find o such that 3 - 2o*2 + 1/2o*3 + 1/2o = 0. -1, 2, 3 Let k be 15/(-3) - -7 - -11. Let -4z*4 - 16z*5 - 2z*4 + 10z*4 + 16zk + z2 - 5z2 = 0. What is z? -1, 0, 1/4, 1 Let q(v) be the third derivative of -v7/105 - v6/15 - 128v*2. Let q(a) = 0. Calculate a. -4, 0 Suppose 0 = -5i - 0 - 70. Let k be 1-25i/35. What is p in -4p3 + kp*4 - 9p*4 - 3p*4 - 2p*2 = 0? -1, 0 Let v(g) = 2g - 11. Let i be v(6). Let o(m) = 2m2. Let w be o(i). Factor 3aw - a2 + 269a - a3 - 270a. -a(a - 1)2 Let g(n) be the second derivative of 0 + 0n2 + n3 - 3/20n5 + 1/4n*4 + 8n. Suppose g(h) = 0. Calculate h. -1, 0, 2 Factor 4/7s4 - 28s*3 + 380/7s*2 - 188/7s + 0. 4s(s - 47)(s - 1)2/7 Let t(f) = f3 - f2 + f + 1. Let g(y) = -20y*3 + 95y*2 - 55y + 25. Let b = -60 - -85. Let s(r) = bt(r) - g(r). Factor s(j). 5j(3j - 4)2 Let g(z) be the third derivative of z7/1260 + z6/180 + z5/60 + z*4/8 - 7z2. Let q(j) be the second derivative of g(j). Suppose q(w) = 0. What is w? -1 Let c(h) be the third derivative of h5/20 + 5h4/4 + 39h*2 + 3. Find m, given that c(m) = 0. -10, 0 Let h = -43/130 + 119/65. Let -1 - 1/2r + hr2 + 1/2r*3 - 1/2r4 = 0. What is r? -1, 1, 2 Let m(k) be the first derivative of -k3/3 + 2k2 + 12k + 62. Factor m(b). -(b - 6)(b + 2) Let r(t) = -75t - 1 + 0 - t*3 + 74t. Let d(x) = 8x3 - 15x*2 + 23x + 5. Let y(p) = -d(p) - 5r(p). Factor y(f). -3f(f - 3)(f - 2) Let u(y) be the first derivative of 2y5/5 - y4/2 - 2y3 + y2 + 4y + 176. Suppose u(k) = 0. Calculate k. -1, 1, 2 Let j(d) = d3 - 6. Let t be j(2). Let y(v) be the second derivative of -v3 + tv + 9/20v5 + 1/4v*4 + 0v*2 + 0. Factor y(f). 3f(f + 1)(3f - 2) Let m(c) be the third derivative of -c2 - 25/6c*4 - 125/27c*3 + 0c + 0 - 2/5c6 - 2c*5. Factor m(r). -2(6r + 5)3/9 Let v(m) = -18m*3 + 15m*2 + 30m - 27. Let t(f) = -f + 1. Let h(u) = -12t(u) - v(u). Factor h(c). 3(c - 1)(c + 1)(6c - 5) Let o(m) be the first derivative of -7m*4/3 - 20m*3 - 16m*2 + 7m + 10. Let a(g) be the first derivative of o(g). Factor a(t). -4(t + 4)(7t + 2) Let a(y) be the first derivative of -2y*3/21 + 96y*2/7 - 4608y/7 - 71. Factor a(p). -2(p - 48)2/7 Factor 37/5j*2 - 33/5j + 2/5j4 + 9/5 - 3j3. (j - 3)2(j - 1)(2j - 1)/5 Let m(f) be the third derivative of f9/1008 + 3f*8/280 + 3f7/70 + f6/15 + 4f3/3 - 11f*2. Let v(x) be the first derivative of m(x). Factor v(y). 3y*2(y + 2)3 Let t(k) be the second derivative of k7/21 + 7k6/15 + 4k*5/5 - 8k*4/3 - k - 19. Factor t(i). 2i*2(i - 1)(i + 4)2 Suppose 8 - 14 = -3f. Let j(i) be the first derivative of 1/6if + 2 + 0i + 2/9i3 + 1/12i*4. Factor j(h). h(h + 1)2/3 Let n(d) be the first derivative of d4/10 + 14d3/15 + 3d*2 + 18d/5 - 9. Factor n(h). 2(h + 1)(h + 3)*2/5 Suppose 1 - 10 = -w. Let 9 + 4z*2 - 16z*2 + wz*2 - 3z - 3 = 0. Calculate z. -2, 1 Let q be 2/15 + (1324/(-30) - 4). Let u = q - -48. Solve uw + 1/2w*2 + 0 = 0. 0 Let v be (30/45)/(24/18 - 0). Factor -vj*5 + 5/2j*3 + 1/2j*4 - 4j - 2 - 1/2j2. -(j - 2)2(j + 1)*3/2 Factor -2/17z*2 - 144722/17 + 1076/17z. -2(z - 269)2/17 Suppose -6r - 6 = -3r. Let l be (-170)/(-60) - -1r/(-12). Factor 5/2p2 + 1/2p + 3/2p4 + 7/2p*l + 0. p(p + 1)*2(3p + 1)/2 Let u be 26/702 - (-115)/540. Factor -1/4k*3 + 0 + uk*4 - 1/2k*2 + 0k. k*2(k - 2)(k + 1)/4 Let 36/5k*4 + 84/5k*3 - 36/5k + 8/5 + 4/5k2 = 0. What is k? -2, -1, 1/3 Let x(f) = -2f*2 - f + 2. Let l be x(1). Let m(y) = 2y*2 + 2y - 6. Let u(o) = -o*2 - o + 1. Let t(j) = lm(j) + 2u(j). Let t(d) = 0. What is d? -2, 1 Factor 6 + 13a + 29/3a2 + 3a*3 + 1/3a*4. (a + 1)(a + 2)(a + 3)*	{ "pile_set_name": "DM Mathematics" }
Expand (v*3 + 0v3 + v3)(77 - 1816v - 214 + 1818v). 4v*4 - 274v*3 Expand (-t - 1 + 1 + (-2t + 3t - 3t)(3 - 2 - 3) + 2t - 2t + t + 5t + 29 - 29)(t2 - 2t*2 - 2t*2). -27t*3 Expand (5z - 4z - 2z)(-1 - 2z + 1 + 7z - 16z - 17z + (-1 + 5 - 2)(z - 4z + 4z)). 26z2 Expand (-4l*2 + 0l*2 + 20l*2 + (-2 + 2 - 2l)(2l + 5l - 4l) + 10l - 4l*2 - 10l)(-6l + l + 3l). -12l*3 Expand (2 - 2 + 2y)(y - 3y + 0y + (5y - y - 3y)(0 - 3 + 1) - 2y - 2 + 2). -12y*2 Expand (-27v - 14v + 6v)(-2 + 5 - 2) + 8 - 2v - 8. -37v Expand 7m - 4m + m + 1 - 1 - 3m + (-5 + 3 + 0)(-m - 5m + 4m) + 4m - m - 2m. 6m Expand (2n2 + 0n + 0n)(-3 + 3 - 4) + (2n - 2n - 5n)(4n - n - n) + 2n*2 + 0n*2 - 3n*2 + (-n + 2n + n)(5 - 2n - 5). -23n2 Expand (3w*2 - 20 + 20)(-2w2 + 5w2 - w2) + (-2w2 - 3w*2 + 3w*2)(-3w2 + 5w*2 - 4w2) - w4 + w*4 - 3w*4 + 2w*4 - 2w*2 + 2w*2. 9w*4 Expand (4n3 - n3 - n*3 + (0 - 3 - 2)(3n3 + 2n*3 - 3n*3) + (2n*2 - 4n*2 + 3n*2)(2n - 2 + 2))(0n + 2n + 0n). -12n*4 Expand (-11f - 17f + 24f)(-4 + 4 + 2) + 7f - 12f + 40f. 27f Expand (13 + 13 - 29)(-5f + 2f + 6f + (-3 + 0 + 1)(f + 3f - 2f)). 3f Expand (-2j*2 + 2j2 - j2)(0 + 2j + 0) - 4j2 + 4j*2 - 3j*3 + 0j3 - j3 + 0j3 + 0j - 6j3 + 0j. -12j3 Expand -j4 + 2j4 + j4 + (66j4 + 26986j*3 - 26986j*3)(-2 + 4 - 6). -262j4 Expand (129r + 1 - 44r - 57r)(-3r + 4 - 4). -84r2 - 3r Expand (138y - 11y*2 - 138y)(-2 + 2 - 3)(4y - y - y). 66y*3 Expand (7c + 9c - 31c)(2c*3 - 1 + 1 + (2c - 2c + c3)(2 - 4 + 3) + 3c3 - 7c3 - c3) + 3c2 - c4 + c2 - 3c*2. 29c4 + c2 Expand (-3d2 - 4d*2 - 4d*2)(5 - 5 - d*2 + 0 - 2d*2 + 0 + (-2d2 + d2 + 0d2)(-5 + 1 + 3)). 22d4 Expand (g + 4g - 2g)(2 - 4 + 0) + (-23 + 54 + 84)(3g + 5g - 5g). 339g Expand 88k*3 + 1 - 32k*3 - 5k*3 - 2k + k*3 - 3k*3 + 4k*3 + (-3k2 + k2 + k*2)(5k + 0k - 4k). 52k*3 - 2k + 1 Expand z*4 + 0z + 0z + 3z*2 - 2z*4 - 3z*2 + (564 - 564 - 7z)(z3 + 4z3 + z3) + 2z4 + z4 - 4z*4. -44z*4 Expand (-3s*2 + 9s*2 - 2s*2)(21 - 5 + 3)(-5 + 2 + 1)(-s + s + s*2). -152s*4 Expand (-2b*5 - 3b*5 + 6b*5)((-1 + 6 - 3)(3 + 0 - 1) + (-4 - 1 + 1)(0 + 3 - 5)) + 2b4 - 2b*4 - 4b*5. 8b5 Expand (-5 + s2 + 5)(180s - 23276 + 23276) + 4s3 - 3s*2 + 3s*2. 184s*3 Expand (-19d*3 + 5d*5 + 19d*3)(63 + 17 - 17). 315d5 Expand (0 + 0 + 4 + 0 - 4 + 2 + (3 + 3 - 5)(-2 + 2 - 2) - 1 + 4 - 2)(4h*2 - 35 + 35). 4h*2 Expand (t - 12 + 12 + (-1 + 2 + 0)(1 - 1 + 2t) + 2 - 2 - 2t + 53t - 96 + 96)(-t - 5 + 5). -54t2 Expand (2i3 - i3 + 2i3)(0i + 0i - i + i + 3i - i + (2i + 5i + 2i)(-3 + 0 + 4)). 33i*4 Expand (-1 + 1 + 1)(4p + 2p + 2p) + 2p + 0p + 4p + (-2 + 0 + 3)(2p + 3 - 3). 16p Expand ((-t + t + t)(0 + 0 - 2) + t - 4t + 0t)(5t - t - 2t). -10t*2 Expand (-30 + 34 + 26)(u + 14u - 5u). 300u Expand (1371 + 55i - 1371)(4i - 2i + i). 165i*2 Expand (-7j + 3j + 3j)(3j2 - j2 - j*2) + 720j + 138j3 - 720j. 137j3 Expand (-5p - 4p + 3p)(p - p + p) + (6p + 4p - 6p)(2p - p + 2p) + 1 + 3p*2 - 1. 9p*2 Expand -2k + 0k + 0k + (1 - 2 + 0)(3k + k - 2k) + 3k - 5k + k + 3k + 0k + k + 0 + 0 + 2k + 2k - 1 + 1. 3k Expand (-39f - 39f + 24f)(-2 + 1 - 1)(-4f + 0f - f). -540f*2 Expand 2m - 2m + m2 - 5m*2 + 3m*2 + 0m*2 + (4m - 3m - 3m)(5m - m - 3m) - 5m*2 + 4m*2 + 0m*2 + (m + 1 - 1)(76 - 120m + 41m + 73m). -10m*2 + 76m Expand (0q2 - q3 + 0q*2)(-12q - 14q - 30q)(3 + 4 + 0). 392q4 Expand (-g - 3g + 0g)(11 - 2 + 1)(5 + 2g*3 - 5). -80g*4 Expand (-1 + 3 + 1)(4u4 - 16 + 16 + 2u*3). 12u*4 + 6u*3 Expand 44z - 44z + 45z*2 + (-1 + 1 - 2z)(3z - z + 0z) + (-z + 2z + 0z)(-3z + 5z + 0z) + 5 - 5 + z2 - z2 - 4z2 + z2. 40z2 Expand (-5 + 1 + 6)(0k3 + k3 - 3k*3) + 2k*3 - 3k3 - k3 - 25860k + 25860k + 532k3 + (-2k*2 - 3k*2 + 3k*2)(-4k + 2k + 3k). 524k*3 Expand (134x*3 - 74x*3 - 83x*3)(3x - 3x - x) + x*4 - 7x*4 + 3x*4. 20x*4 Expand (202 + 18l - 202)((-2l*2 + 0l + 0l)(2 + 1 - 4) + 0l2 - 2l*2 + 3l*2). 54l*3 Expand -84l + 19l - 92l - 11l + 5l - 3l - l + 0l - 3l + 4l + (-3l + 2l + 2l)(-4 + 1 + 5) + l - 2 + 2. -163l Expand ((-1 - 2n + 1)(0n - 2n + 7n) - n*2 + 3n - 4n + 0n*2)(-2n - 3 - 2n + 3n). 11n*3 + 34n*2 + 3n Expand (-2m - 3m + 3m)(2m + 0m - m) + ((-1 - 1 + 3)(-5m - 2m + 5m) - 12m - 19m + 7m)(-2m + 1 - 1). 50m*2 Expand (-2a*2 - 47943 - 25a*2 + 47945)(3a2 + 3a - 3a). -81a*4 + 6a*2 Expand (1 + 4 - 3)(-j + 2j + j) - 3 + 2j + 3 + 2 - j - 2 - 126 + 2j + 126 + 3j + 4j - 4j. 10j Expand (-33 + 5 - 4 + (-2 + 6 - 3)(3 - 6 + 1))(-2 + p + 2). -34p Expand (k + 44 - 85 - 19k2 + 42)(-3k3 + 3k*3 + 2k*3). -38k*5 + 2k*4 + 2k*3 Expand (16s*3 + 24 - 24 + s - s + 2s*3 + (0s - 2s2 + 0s)(4s - s - 4s) + 0s*3 + 4s*3 - 3s*3)(0s + 0s - 2s). -42s*4 Expand (-3o3 + o + o3 - 4o)(-3o2 + 4o*2 - 3o*2 + (-5o - o + 2o)(15o - 4o + 2o)). 108o*5 + 162o*3 Expand (5w*3 + 16w3 - w3 + (w - 4 + 4)(0w2 - w2 - w*2))(w*2 - 13w + 13w - 10). 18w*5 - 180w*3 Expand (4c*3 + 3c*3 - 2c*3)(-3c + 3c + 2c) + (96c - 96c - 3c*3 + 1)(5c - 3c - 3c). 13c*4 - c Expand (-a + 2a - 2a)(-4 + 4 - a) + (2a - 4a + 4a)(6a - 40 + 40) + 2a*2 - 6 + 6 + 2a*2 - 3a*2 + 0a*2. 14a*2 Expand (-1 - 2m*3 + 1)(-3 + 2 - 4)(2 + 3m + 13m - 13m). 30m4 + 20m*3 Expand (-31r*2 - 4r*2 + 9r*2)(-53 - 2r + 54 + 9r). -182r3 - 26r2 Expand a3 + a3 - a3 + (a*2 + 0a2 + a2)(-18a - 39 + 39) + 4a3 - 3a*3 + 0a*3. -34a*3 Expand (-2c - 7 + 4c - 3c)((3c - 1 + 1)(-c - 2c + 4c) - 3c*2 + 0c2 + c2). -c*3 - 7c*2 Expand (-24j - 22j + 13j)(-3j - 2j2 + 3j) + (-2j2 + 3j2 + j2)(-j + 2j + j). 70j3 Expand (-17 - 9a + 17)(-2a*2 - 4a + 4a + a2 - a + a - 2a*2 + 0a*2 + 3a*2 + (-4a*2 + 2a*2 + 0a*2)(-3 + 0 + 2) - 4 + 4 + 2a2). -36a*3 Expand (2 + 2 - 6)(602m - 1207m + 604m - m2 - 20). 2m*2 + 2m + 40 Expand (-1 - 3b2 + 1)(-735b2 - 156390 + 156390). 2205b*4 Expand -9n + 14n + 1 + 0 + (-8 + 20 - 6)(n + 3n - 6n). -7n + 1 Expand -212b*3 + 212b*3 - 65b*5 - 2b5 + b5 - 3b5 + (b2 + 0b*2 + 0b*2)(-4b - 2b*3 + 4b) - 1 - b*5 + 1. -72b*5 Expand -4h - 3h + 7h*2 - 8h*2 - 2h*2 + 4h*2 - 4h*2 - 2h*2 + 5h*2 - 2h*2 + 5h2 - h2 - 3h2 + (2h2 - h2 + h*2)(2 + 1 - 5). -5h2 - 7h Expand (28i + 25i - 18i)((-3 + 2 + 2)(2 - i - 2) + i + 0i + 2i). 70i2 Expand (j4 - 2j4 + 3j*4)(13j - 53 - 19j + 5j)(-4 + 3 - 1). 4j5 + 212j*4 Expand (-4f*3 - 3f2 + f2 - 9f3)(-4 + 17 + 11). -312f3 - 48f*2 Expand -53s + 252 - 252 + (-1 + 1 - s)(1 - 1 + 1) - 4s + 5s + s + 3s + 2s - 4s - s + 4s - 2s. -50s Expand (2 + 3 - 4)(-110h - 2030 + 2030)(2h3 - 2h*3 + 2h*3). -220h*4 Expand 6 - 5l - 326153l2 + 326152l*2 + 93l + (-3 + 2 - 1)(-2l2 + l2 - l*2) - 2l*2 + 0l*2 + 0l2. l2 + 88l + 6 Expand (-3 + 3 + 1)(6t + 22t + 14t)(0 + 4 - 5). -42t Expand (3b - 3b - 2b)(0b - b*2 + 0b) - 113b3 - 9721b + 9721b + (2 - b2 - 2)(0b + b - 2b). -110b3 Expand (-5m - 6m - 3m)((m3 + 4m3 - m3)(2m - m + m) + (3 - 3 - 2m3)(0m - m + 0m)) + 2m5 + m - m. -138m*5 Expand (0 - 2 + 0)(63f + 29f + 11f)(f*2 + 3f4 - f2). -618f5 Expand (-3 + 3 + 1)(12 - 2k + k + 3k) - k + 8 - 8. k + 12 Expand (-2q2 - q2 - 2q*2)(-47 - 26 - 67). 700q2 Expand (-x - x + 4x)(-5 - 1 + 4)(416 - 185 - 163). -272x Expand (-1 - 2s + 1)(0s*2 + 3s*2 + 0s*2) + (81s - 81s + 5s*2)(-1 + 4 - 5)(-s - s + 3s). -16s3 Expand (4b*3 + 3b*3 - 4b*3 + 43b*3 + 3095 - 3095 + (-3b + 4b - 3b)(-2 + 2 - 2b**2	{ "pile_set_name": "DM Mathematics" }
easing order. 5, 2, -1, -5, -1203 Sort -18, -8, -14, 2 in descending order. 2, -8, -14, -18 Sort -2, 0.4, 70, -1/7, -1, 5/6. -2, -1, -1/7, 0.4, 5/6, 70 Sort 10670, -5, 56. -5, 56, 10670 Sort 4, 15, -1, -28, -3, 12 in decreasing order. 15, 12, 4, -1, -3, -28 Sort -0.1, -0.3, 0.5, -6/11905, 0.3. -0.3, -0.1, -6/11905, 0.3, 0.5 Sort -20, -16, -5. -20, -16, -5 Put 10, 4, 2, -1, 40, 13 in ascending order. -1, 2, 4, 10, 13, 40 Put 54, 0, 152 in ascending order. 0, 54, 152 Put 5, -6053, 0.5 in descending order. 5, 0.5, -6053 Sort 4, -2, -4, -60 in ascending order. -60, -4, -2, 4 Put -60, 3, -6/353 in descending order. 3, -6/353, -60 Sort -3, 37, 4, -5, 2, -23. -23, -5, -3, 2, 4, 37 Sort -22, -2, -5, 15, 7, -1 in increasing order. -22, -5, -2, -1, 7, 15 Sort 4, -0.5, -117, 5, -0.9 in decreasing order. 5, 4, -0.5, -0.9, -117 Sort -0.1, 47, 2/11, 0, 1 in decreasing order. 47, 1, 2/11, 0, -0.1 Sort 1827, 10, 2, -4 in decreasing order. 1827, 10, 2, -4 Sort 140599, 3, 4 in ascending order. 3, 4, 140599 Put -1.7, 1/8, 3/5, -2.71, 0.2 in descending order. 3/5, 0.2, 1/8, -1.7, -2.71 Put -90, -4, -3, 6, 5 in descending order. 6, 5, -3, -4, -90 Put -46113, -5, 0 in descending order. 0, -5, -46113 Put 0.5, 2/11, 5, 1106, 2/3 in ascending order. 2/11, 0.5, 2/3, 5, 1106 Sort -17, -5, 1/8, 3, -4254, 4. -4254, -17, -5, 1/8, 3, 4 Sort -96, -18, -3, 12. -96, -18, -3, 12 Sort 1202, -67, 0 in increasing order. -67, 0, 1202 Sort -5, -87, -152 in decreasing order. -5, -87, -152 Put 2, 9, 7806 in increasing order. 2, 9, 7806 Put -591, -1, -85 in decreasing order. -1, -85, -591 Put 4269, 7/12, 0 in increasing order. 0, 7/12, 4269 Sort 36, 8, -1, 5 in descending order. 36, 8, 5, -1 Sort -3, -0.007, -1/3176 in increasing order. -3, -0.007, -1/3176 Put 4, -25, -2, 38, -18 in ascending order. -25, -18, -2, 4, 38 Put -10, -1, -3, 9, -5 in increasing order. -10, -5, -3, -1, 9 Put 20, 1/5, -4/9, -2/11, 106 in decreasing order. 106, 20, 1/5, -2/11, -4/9 Sort 0, 819, -0.1, 51 in increasing order. -0.1, 0, 51, 819 Sort 23, -19034, 5. -19034, 5, 23 Sort -2013, -5, 1, -2 in ascending order. -2013, -5, -2, 1 Sort -1475/6, 129, 2/5 in descending order. 129, 2/5, -1475/6 Sort 2/3, -2, -0.2, 1/5, 0.243, 0.4. -2, -0.2, 1/5, 0.243, 0.4, 2/3 Sort -0.9, 0.4, -60, 0.3, -3, 0.1 in ascending order. -60, -3, -0.9, 0.1, 0.3, 0.4 Put 7, -1, 140, 4 in ascending order. -1, 4, 7, 140 Sort 370, -5, 0.3, 0.09, 0.5. -5, 0.09, 0.3, 0.5, 370 Sort 0, -16, 8, 14. -16, 0, 8, 14 Sort -3, -21, -82 in decreasing order. -3, -21, -82 Put -6, -11, 14, 21 in increasing order. -11, -6, 14, 21 Sort -0.1, 0.0961, 0.2, -0.3, 3/2. -0.3, -0.1, 0.0961, 0.2, 3/2 Sort 2, 3, 2030, 5, 1 in increasing order. 1, 2, 3, 5, 2030 Sort 3, -3, -9941, -5, 0 in descending order. 3, 0, -3, -5, -9941 Sort -58, -29, -2 in increasing order. -58, -29, -2 Sort 2, -4, -0.1, 38/3, 0.5. -4, -0.1, 0.5, 2, 38/3 Sort -69, -2, 51 in ascending order. -69, -2, 51 Sort -0.007, 13.1, -3 in descending order. 13.1, -0.007, -3 Sort 4, 1, -3, 3, -1, -31 in increasing order. -31, -3, -1, 1, 3, 4 Sort -1.75, 1/4, 1, 4, 1.2, -3 in increasing order. -3, -1.75, 1/4, 1, 1.2, 4 Put 151, -5, 1, 2, -0.3, -4 in decreasing order. 151, 2, 1, -0.3, -4, -5 Put -26, -4, 6, -33 in ascending order. -33, -26, -4, 6 Sort 4/7, -1, -2, 3, 0.3, -218 in decreasing order. 3, 4/7, 0.3, -1, -2, -218 Sort 15, -40, -1/2, 1/11, -2/15 in increasing order. -40, -1/2, -2/15, 1/11, 15 Sort -299, 4, 266, -4. -299, -4, 4, 266 Sort -2/11, 80, -4/5 in descending order. 80, -2/11, -4/5 Sort -3, -1, -8, 19, 71. -8, -3, -1, 19, 71 Sort -5, -1, 4, 1275 in descending order. 1275, 4, -1, -5 Sort -338, 4, 8, -4, -5, 2 in descending order. 8, 4, 2, -4, -5, -338 Sort 39, 3, 0, -13, -39 in descending order. 39, 3, 0, -13, -39 Put 859, -5, 6, 2 in descending order. 859, 6, 2, -5 Put -4, 1, 96, 191, 3 in decreasing order. 191, 96, 3, 1, -4 Sort 4, -5, -21, -69, 0. -69, -21, -5, 0, 4 Put -7, 13, -604, 5 in descending order. 13, 5, -7, -604 Put -0.1, 4, -1, -4, 1.1, 0.16 in ascending order. -4, -1, -0.1, 0.16, 1.1, 4 Sort 0, 2, 292955, 1 in descending order. 292955, 2, 1, 0 Put 9046, 0, 2, 1 in increasing order. 0, 1, 2, 9046 Sort 0.4, 2, 0.042, 15/13 in ascending order. 0.042, 0.4, 15/13, 2 Put 2, 5, 48, 136 in decreasing order. 136, 48, 5, 2 Sort 0, -5, -78, 4. -78, -5, 0, 4 Put -40, 0, -1/5, -17 in increasing order. -40, -17, -1/5, 0 Put 20, -1230, -2, 2 in increasing order. -1230, -2, 2, 20 Sort 3, -105, -110 in decreasing order. 3, -105, -110 Sort 2, 5, 0.2, 0.0151 in descending order. 5, 2, 0.2, 0.0151 Put 0.2, -2, -0.4, 58, 4, -0.3 in descending order. 58, 4, 0.2, -0.3, -0.4, -2 Put 592, -1, -128 in decreasing order. 592, -1, -128 Put -12.54, 0, 4, 0.4, 5, 0.07 in increasing order. -12.54, 0, 0.07, 0.4, 4, 5 Put -2/15, 12, 3/143, -10 in decreasing order. 12, 3/143, -2/15, -10 Sort 40, 1, 2, 6, 7, 0 in ascending order. 0, 1, 2, 6, 7, 40 Put -2, 166, -5, -13, 3 in descending order. 166, 3, -2, -5, -13 Sort -4, -0.033, 0, -14.5 in descending order. 0, -0.033, -4, -14.5 Sort 49, 13, 1, -1 in increasing order. -1, 1, 13, 49 Put 22, -0.4, -4, -0.15, 2, 37/4 in ascending order. -4, -0.4, -0.15, 2, 37/4, 22 Put 0, 0.3, -0.3, -3, 0.5, 0.14133 in increasing order. -3, -0.3, 0, 0.14133, 0.3, 0.5 Sort 1, -1, 1326, -1/2, -2/9. -1, -1/2, -2/9, 1, 1326 Sort -3, -2/671, -65. -65, -3, -2/671 Sort -46, 3, -2, -19, -18, 1 in decreasing order. 3, 1, -2, -18, -19, -46 Put 4, 2/11, 2, 6, 0.4, -87 in descending order. 6, 4, 2, 0.4, 2/11, -87 Sort 5, -160, 216, -4. -160, -4, 5, 216 Put -28, -4, 0, 5, 17 in decreasing order. 17, 5, 0, -4, -28 Sort -2/5, -2/9, -3, 16, 1. -3, -2/5, -2/9, 1, 16 Sort -3, -1330, 3, 5, -4 in descending order. 5, 3, -3, -4, -1330 Sort 1, -99, 5, -4 in descending order. 5, 1, -4, -99 Sort 1, 3, -2, -28, -92 in increasing order. -92, -28, -2, 1, 3 Sort -659, 4, 13, -2, 2, -4 in descending order. 13, 4, 2, -2, -4, -659 Put 2, 1/11, -2, 9/10 in increasing order. -2, 1/11, 9/10, 2 Sort -2, -25, 0.04, 10, -0.5, 1 in decreasing order. 10, 1, 0.04, -0.5, -2, -25 Put 2/11, -1, 0.03, 1883.76 in decreasing order. 1883.76, 2/11, 0.03, -1 Put -3, -128, -4, -2 in descending order. -2, -3, -4, -128 Put -7, 2, 9, 4 in decreasing order. 9, 4, 2, -7 Sort -2, 4, 717, -18 in increasing order. -18, -2, 4, 717 Sort 3, -4, 2, 459 in ascending order. -4, 2, 3, 459 Sort -9, -33, -18, 1, 2, -3. -33, -18, -9, -3, 1, 2 Put -7/3, -1/6, -0.9, -2/7 in ascending order. -7/3, -0.9, -2/7, -1/6 Put 898, -5, 13, 3, -1 in descending order. 898, 13, 3, -1, -5 Put 0, -72, -1, 1, 156 in ascending order. -72, -1, 0, 1, 156 Put -0.2, 1/341, 0.13, 1/3 in descending order. 1/3, 0.13, 1/341, -0.2 Sort -4, 0, 3, -17. -17, -4, 0, 3 Sort -7, -1/78871, -4 in decreasing order. -1/78871, -4, -7 Sort 21256, -3, -4 in increasing order. -4, -3, 21256 Sort 0, -431, -5, -9, 4 in increasing order. -431, -9, -5, 0, 4 Sort 2, 8579, -3, -4 in decreasing order. 8579, 2, -3, -4 Put -4, 11, 1197 in decreasing order. 1197, 11, -4 Put -0.4, -29, -0.3, 58, -0.5, 1 in ascending order. -29, -0.5, -0.4, -0.3, 1, 58 Put 5, -5, 7, -1, 99 in descending order. 99, 7, 5, -1, -5 Sort -1.4, -2, -4, 1, 2, 11. -4, -2, -1.4, 1, 2, 11 Put 4, 5248, 0, -3 in descending order. 5248, 4, 0, -3 Sort -1, -0.3, 2686 in descending order. 2686, -0.3, -1 Sort -33, -17, 241, 2, 4 in decreasing order. 241, 4, 2, -17, -33 Put 0, -2, -206, -377 in descending order. 0, -2, -206, -377 Sort 2/21, -0.2, -3, -97.4, -4 in ascending order. -97.4, -4, -3, -0.2, 2/21 Sort -2, 52769, 0.15 in decreasing order. 52769, 0.15, -2 Sort 15, 0, -3, 15033, 5 in decreasing order. 15033, 15, 5, 0, -3 Sort -55, 4/9, 22/3 in decreasing order. 22/3, 4/9, -55 Sort -1/2, -18, 4/5, -5, 4, 4/3 in descending order. 4, 4/3, 4/5, -1/2, -5, -18 Put 4, -10, -0.0841 in decreasing order. 4, -0.0841, -10 Put 58, 54, -2, 1, -5, -1 in increasing order. -5, -2, -1, 1, 54, 58 Sort -3, 15, 0, -19, 2 in descending order. 15, 2, 0, -3, -19 Sort 2091, -1, -3, -2 in ascending order. -3, -2, -1, 2091 Sort 1/3, 0.03, 0.172, -23, -2, 5. -23, -2, 0.03, 0.172, 1/3, 5 Sort -1, 43077, -5. -5, -1, 43077 Put 7, -8, 0, -1, -378 in increasing order. -378, -8, -1, 0, 7 Sort 105, 809, 3, -5 in descending order. 809, 105, 3, -5 Put 5, -1/10, 1252	{ "pile_set_name": "DM Mathematics" }
and give y. -269 Express -246d - 11d*4 + 246d + (0d3 - d3 + 3d*3)(-5 + 5 - d)(-5 + 3 + 4) in the form hd*4 + cd*3 + xd*2 + p + vd and give h. -15 Rearrange (-3 + 0 + 2)(-3 + 3 - 2x) + x + 1 - 1 + 3x + 14 + 4 + 9 to p + yx and give y. 6 Rearrange (-3b3 + 0b3 + b3)(-1 + 3 - 1)(12 - 71 - 125) to g + ib2 + mb + cb3 and give c. 368 Rearrange -11 - 17 + 48 + 56 - 3q to m + rq and give m. 76 Express -1 + 22t - 117t - 398t in the form pt + n and give p. -493 Rearrange -31x*4 + 24x + 88x4 - 28x*4 - 31x*4 + 5 to dx*4 + o + jx*2 + cx*3 + qx and give o. 5 Rearrange (6 - 1 - 1)(2v + v + 0v) - 33 - 36v + 33 to the form c + wv and give w. -24 Express 96k4 + 5 + k - 3 + k3 + 3 - 4 + k*3 as w + tk + xk2 + vk*3 + zk*4 and give t. 1 Express 12251 + m - 565m*2 - m - 12251 as um + l + om2 and give o. -565 Express (-4 + 5 - 2)(-9 - 1 - 3 + (-3 + 2 + 2)(0 + 1 + 0))(-5p + p + 2p) as jp + d and give j. -24 Express (3m*2 - 2m*2 + 6m*2)(2m - 4m + m) + 13m - 8m*3 - 13m - 2m3 + 0m*3 + 4m*3 as o + im*3 + rm + lm2 and give i. -13 Rearrange (0c*3 + 0c*3 - 2c*3)(-393c - 392c - 1 + 780c) to ic*4 + gc*2 + ac*3 + l + yc and give i. 10 Rearrange 0d2 + 219d*2 + 1 - 1 to md*2 + u + id and give m. 219 Express (5m + 0m - 3m)(1 - 3 + 0) - 83m + 323m + 18m in the form r + gm and give g. 254 Rearrange (v + v + 0v)(34 - 103 - 147) to the form u + qv and give q. -432 Express (902 - 1481 - 123)(3t - 3t + 2t) as pt + d and give p. -1404 Express -26 - 2k - 3k*3 - 3 + 17k + 5k3 - k3 as n + wk*2 + qk + dk3 and give n. -29 Express 2926 + 3q*4 - 2925 + 3q - 7q2 - 4q + 3q2 as xq + zq2 + w + sq*3 + aq*4 and give x. -1 Rearrange -57j*4 + 2 - 3 + 41j4 + (-j2 + 2j2 - 3j*2)(-3j2 - 3j*2 + 4j*2) to the form sj*3 + aj*2 + bj + rj4 + n and give r. -12 Express -12j*2 - 19j*2 - 3336 + 3336 in the form vj + m + tj2 and give m. 0 Express (-i - i - 5i)(-2i - 5i + 2i) in the form zi + q + ti*2 and give t. 35 Express -2d*4 + 10d + 12d + 3d*3 + 0d3 - d2 - 24d + 5d as hd3 + kd + nd2 + a + xd*4 and give n. -1 Rearrange ((-5 + 6 + 4)(-23 + 23 - 3n) - 2n + 4n - 3n)(n2 - 1 + 1) to the form ln + p + an2 + cn*3 and give c. -16 Express x + 963x*3 - 22x - 970x3 + 0x2 - x2 + 2x4 as rx*4 + zx + tx2 + b + ix*3 and give b. 0 Express (0 + 0 - 2)(0 + 3 - 1)(-j2 + 102j3 - j2 - 166j3) in the form dj + aj2 + lj*3 + y and give d. 0 Rearrange -5h*2 + 0h*2 + 3h*2 + (-5 - 4h + 5)(3 - 2h - 3) + 224 + 38h2 - 224 to g + rh*2 + ah and give r. 44 Express -8 - 3 + 22 - 12 + 38o in the form ro + w and give w. -1 Rearrange -2p3 + 7p*3 - 9p*3 + 4p*3 + 26 + 3p*2 + 3p*3 to the form t + dp*2 + bp + gp3 and give t. 26 Rearrange (2 + 2f - 2)(-f2 + 4f*2 - 2f*2)(-4873f + 9865f - 4898f - 11) to the form yf*4 + rf*2 + jf*3 + zf + w and give z. 0 Express j*3 + 0j4 + j4 + 3 - 2j4 - 2j*2 + 5j*2 in the form tj*4 + aj*2 + dj*3 + lj + f and give f. 3 Rearrange -n - 5n3 + 29n*3 - 1 + 2n*3 + 3 to the form pn*2 + w + in*3 + an and give a. -1 Rearrange -114h2 + 232h*2 - 119h*2 - 214 - 67 to r + ah + sh2 and give r. -281 Rearrange -14t*2 - 28t*2 - 58t*2 - 231 + 232 to ht*2 + k + ut and give u. 0 Express 61 - 32731k2 + 32729k*2 - 277 as ik + v + ak2 and give i. 0 Express 2p + 4407 - 4p - 4409 + 3p*2 - 7p*4 - 2p*3 as gp*3 + bp*4 + op + x + yp2 and give y. 3 Rearrange -48f*3 + 11f - 42f3 - 52f*3 - 2f*2 + 141f*3 to mf*2 + z + tf + wf3 and give w. -1 Rearrange -4 - 6r*3 + 20r*4 - 3825r + 3823r + 3 - 3r*4 to fr + qr4 + hr*2 + jr*3 + a and give q. 17 Rearrange -264 + 132 + 38m*2 + 129 to k + pm + qm2 and give q. 38 Express -6b3 - b4 - 6 - 4 - 3 + 12 - 3b2 + b as fb*3 + h + ib*2 + gb + lb4 and give f. -6 Rearrange -263h - 50h + 101h - 282h to x + th and give t. -494 Express 1007r - 46 - 62 + 109 as kr + m and give k. 1007 Rearrange (2t - 2t - t*2 + (-2t + 2t + 2t)(-t - 2t + 4t) + 6t + 2t2 - 6t)(62 + 25 - 46) to at*2 + b + xt and give a. 123 Rearrange -60s2 + 110s*2 + 32 + 2s*4 - 49s*2 + 69 to the form as*3 + gs*4 + xs*2 + fs + m and give m. 101 Rearrange (-1 + o*2 + 1)((0 + 0 + o)(-o + 3o - 4o) + (7o + 9o - 11o)(-92 + 92 + 19o)) to xo4 + mo*3 + a + io*2 + qo and give x. 93 Rearrange 14r2 + 4r + 2 - 10r2 + 7r + 12r - 7r to the form vr2 + pr + z and give v. 4 Rearrange (3i - 3i - 2i)(1104 - 268 - 298) to the form j + li and give j. 0 Rearrange -2g*3 + 4g*2 + 2g + 11g2 - 3g*3 - 3g*3 to the form lg*2 + v + yg*3 + qg and give l. 15 Express (-3 + 1 + 5)(0r*2 + 9r*2 - 4r*2 + (5r2 - r2 - 3r2)(2 - 2 - 1))(91 - 11 + 17) in the form j + mr + sr2 and give s. 1164 Rearrange (-884g*2 + 5496g*2 + 2777g*2)(g - g + g) to kg3 + y + dg + qg2 and give k. 7389 Express (-2w2 - w2 + 0w2)(1 - 2 + 0) - 3w2 + 2 - 2 + (4 + 0 + 4)(15w2 - 5w + 5w) in the form u + hw*2 + iw and give h. 120 Rearrange 120t + 244t + 324t to the form v + st and give s. 688 Rearrange (-110l + 87l - 338l - 33l)(-1 + 0 - 3)(0 - 2 + 1) to jl + w and give j. -1576 Express -n3 + 2n + 9 - 32n4 + 41 + 3 + 2n*2 + 33n*4 in the form xn + y + gn4 + cn*2 + dn*3 and give c. 2 Rearrange 140q + 187q - 1959q to the form wq + l and give w. -1632 Rearrange 179w + 35w + 160w - 23w - 33w to y + pw and give p. 318 Express -120v*3 + v + 127v*3 + 7v*2 - 5v*2 + 2 in the form qv*2 + sv + cv3 + a and give c. 7 Express (2x*3 - 4x*3 + 4x*3)(-133x - 84 + 84) - 2x*4 + 0 + 0 as ux*4 + ix*3 + h + tx*2 + mx and give u. -268 Rearrange -2 - 1048z + 2 + 232z + 0 to the form w + bz and give b. -816 Express -1 + 152d - 77d - 72d + 4 in the form g + hd and give h. 3 Rearrange 1296i - 2875i - 282i - 847i + (-2 + 2 + 1)(-i - 2i + 2i) to di + s and give d. -2709 Rearrange 1 - 7d + 0d + 1 + 3d*3 + 5d*2 + 5d to ad3 + rd + gd2 + y and give r. -2 Express 2x + 587 - 4x2 - 291 - 290 - 5x*3 + 7x*2 as ax*2 + rx*3 + v + dx and give d. 2 Rearrange (1 + 2 - 2)(0 + v + 0) - 5v + 2v - 16v + 2v - 5v - 2 + 4 to b + dv and give b. 2 Rearrange (-26 + 1 + 59 - 4x)(12 + 2 + 2) to zx + a and give a. 544 Rearrange 7 - 7 + 2u4 + (12u + 5u - 6u)(-2u + 2u + 5u*3) - 2u*4 - 5u*4 + 4u*4 to gu*4 + au*3 + hu + w + iu2 and give g. 54 Rearrange 2 + j4 - 3j*4 + 83j*3 - 35j*3 + 41j*3 to the form mj*4 + b + rj*2 + oj + dj3 and give m. -2 Express 14k*2 - 180 + 2k*3 + 15k*2 + 8k*2 - 38k*2 - k - 5k*3 as hk*2 + i + sk + wk3 and give w. -3 Rearrange (29836 - j2 - j2 - 30772)(-j + 0j + 2j) to vj3 + hj*2 + qj + c and give h. 0 Express 14 - 502b2 + 988b*2 + b - 453b*2 in the form tb*2 + pb + k and give k. 14 Rearrange -120789v + 120789v - 180v2 to g + rv + xv2 and give x. -180 Express (-2g + 4g - 4g)(-3g*2 - 3g + 3g) + (123g - 326g - 238g)(-1 + g2 + 1) as og*2 + qg*3 + rg + l and give q. -435 Rearrange (20k - 23k + 53k)(1 - 1 + 7) to the form z + nk and give n. 350 Express -453 - 96a + 453 - 287a as qa + w and give q. -383 Express (-6 + 20 - 2)(13u - 36 + 36)(-4 - 4 + 3) as ju + m and give j. -780 Express -7v - 18v*4 + 48v4 - 4 + v2 + 0v2 - 28v*4 in the form j + mv*3 + lv*4 + hv + gv2 and give l. 2 Express -54 - 17f + 54 in the form uf + z and give u. -17 Express 131v - 36v + 129v in the form hv + j and give h. 224 Rearrange -5b*3 + 0b*3 + 360b + 152b + 4b*3 to the form ob*2 + zb*3 + fb + g and give o. 0 Express 1 - 16f3 - 15 + 2 - 2f + 10f3 + 8f*3 + 8f*4 as pf + w + uf3 + kf*2 + lf*4 and give w. -12 Rearrange 184d*2 - 190d*2 - 20d*3 - 18d + 18d to td*3 + nd + yd2 + r and give t. -20 Rearrange -2 + 50g - 93g + 46g - 11g2 to the form og +	{ "pile_set_name": "DM Mathematics" }
3 = 2. What is the tens digit of y? 1 Let b(m) = m + 6. Suppose 0 = 2s + x - 0 + 4, 0 = 4s + 4x. Let q be b(s). Suppose 2l + 0g - 206 = 2g, -4l = -qg - 408. What is the units digit of l? 1 Let u(s) be the second derivative of s*4/12 - 4s*3/3 - 17s*2 - 2s - 2. What is the hundreds digit of u(29)? 5 Suppose -2h - 4 = -14. Suppose -3z = 4f + 7, 6 = -2f - 3z + z. Suppose -fw + 4u = -0w - 108, 3u - 335 = -hw. What is the tens digit of w? 6 Suppose -6v + v = -22671 - 4514. What is the units digit of v? 7 Let q be ((-3)/4)/(17/(3131332/(-3))). Suppose -18l + q = 18653. What is the hundreds digit of l? 5 Let a(y) = 417y2 - 63y + 273. What is the units digit of a(4)? 3 Suppose -14c - 730 = -170. What is the tens digit of 55764/32 + 265/c + 7? 4 Let z = -333 - -34. Let l = z + 527. What is the tens digit of (15/9)/((-454)/l - -2)? 9 What is the units digit of 7 + 1452/(-204) + (-358281)/(-51)? 5 Let v(o) = o2 - 19o + 70. Let i be v(14). Suppose 5w + 1093 = 6w - 2f, i = 4f + 12. What is the tens digit of w? 8 Suppose 3h - 172571 = -3v + 15010, 5h - 312640 = -4v. What is the hundreds digit of h? 5 Suppose 196509 - 43077 = 5t + 3j, 5t = 3j + 153408. What is the thousands digit of t? 0 Let z = 158 + -154. Suppose -3b + 4d = 2b - 207, -zb + 162 = -5d. What is the units digit of b? 3 Let y be 1/(-3) + ((-10)/(-3) - -1). Suppose -u + 16 = ys + u, -3u = -3s + 21. Suppose sk - 852 - 628 = 0. What is the tens digit of k? 9 Let y be ((-17 - 0) + 2)36/(-5). Let g = y - -43. What is the tens digit of g? 5 Suppose -10l + 238 = -2482. Suppose l = 6k - 2k. What is the units digit of k? 8 Let v(r) = -r2 + 13r - 38. Let l be v(8). Suppose -lp = -427 - 369. What is the units digit of p? 8 Let u be 9/(-3) - 189(-1 - 0). Suppose -154c + 156c = -u. Let d = -65 - c. What is the units digit of d? 8 Let k = -33 + -31. What is the hundreds digit of (-8624)/k + (9/(-12))/(-3)? 1 Suppose -6a - 6a + 164868 = -a. What is the tens digit of a? 8 Let a(x) = -931x + 848. What is the tens digit of a(-3)? 4 Let w(m) = -5m*3 - 7m*2 + 8m - 7. Let o be w(-8). Suppose 4d - 1231 = -3t, -t + o = 4t - 4d. Let c = t + -291. What is the units digit of c? 8 Let c(n) = -n*3 - 6n*2 - 6n + 1. Let q be c(-5). Suppose -39i + 2079 = -qi. What is the units digit of i? 3 Suppose r + 5o = 3r - 25, 5o + 25 = -4r. Suppose 0 = y - ry + m - 6, 4y - 30 = -2m. Suppose 16k = yk + 910. What is the hundreds digit of k? 1 Let c = -873 + 874. Let a(y) = 923y + 2. What is the tens digit of a(c)? 2 Suppose 17 - 22 = w, 194855 = 5u - 3w. What is the tens digit of u? 6 Let l(u) = -235u3 + 6u*2 + 12u - 19. Let y be l(5). What is the units digit of (y/(-171))/((-1)/(-3))? 2 Suppose -4k + 0k + 12 = 0, -645 = -4s + 5k. Let p = -35 - s. Let m = p + 426. What is the hundreds digit of m? 2 Let v(p) = p + 9. Let d be v(-4). Suppose r + 22 - 79 = -s, 4s - 289 = -dr. What is the tens digit of r? 6 Suppose -36j = -38j - 466. Let l = j + 438. What is the units digit of l? 5 Suppose 4n = 4z + 16476, -3n - 4z + 7791 = -4587. Let a = n - 2543. What is the thousands digit of a? 1 Let u(m) = -35m3. Let p be 2/(-1(-3 - -1)). Let s be (2/(-6))/(p/3). What is the units digit of u(s)? 5 Let j(h) = 1133h2 + 34h + 38. What is the thousands digit of j(-6)? 0 Let p be 762/((-12)/3). Suppose -10b - 1780 = -30b. Let k = p + b. What is the tens digit of k? 5 Let f = -44053 + 91400. What is the hundreds digit of f? 3 Let g = 4895 - 2548. What is the tens digit of g? 4 Let y = 486 - -1240. Let g = y - 1031. What is the tens digit of g? 9 Let q(c) = 67c*2 - 4c - 3. Let j be q(-1). Suppose -u + 5u - 20 = 0. Suppose -ut = -r - j, t + 5r + 80 = 6t. What is the tens digit of t? 1 Let m be (-8)/405-2. Let z(t) = 4t2 - 10. Let k be z(9). Suppose -mj = -k - 40. What is the tens digit of j? 7 Suppose 2 = -u, 0 = 18i - 15i - 2u - 58801. What is the tens digit of i? 9 Let h = 176 - -493. Let k = h - 565. What is the units digit of k? 4 Let i(n) = n2 - 8n + 38. Let l be 264/27 + 6/27. Let a be i(l). Suppose ax - 242 = 56x. What is the tens digit of x? 2 Let f = 64 + -2. Suppose -105k - 1185 = -12315. Suppose -3t = -f - k. What is the units digit of t? 6 Suppose -2i = -2t + 2 - 0, 5i = -t - 17. Let n be (3((t - 3) + 4))/(-1). Suppose 274 + 140 = nh. What is the hundreds digit of h? 1 Suppose 4d - c = 265, -7c - 5 = -2c. Suppose -62 = -4n + d. What is the units digit of n? 2 Suppose 3f = 3h - 222, -h + 2f + 82 - 10 = 0. Suppose -z - h = -321. What is the tens digit of z? 4 Let x(o) = -o + 16. Let k be x(14). Suppose 4y + 10 = c, 6c + ky = c + 28. Suppose -4m - cn + 3n + 342 = 0, 257 = 3m + 2n. What is the units digit of m? 7 Let q(l) = 3l3 - 132l*2 - 104l + 37. Let o be q(45). What is the hundreds digit of o + 1 + -12 + (-2 - -3)? 4 Suppose 2z + 8 = -0, 3z = f - 1955. What is the units digit of f? 3 Let q(d) = 6d2 + 9d - 15. Let y(x) = x*2 + 22x + 112. Let i be y(-15). What is the units digit of q(i)? 2 What is the hundreds digit of (-22 - (-21 + 11)) + 23384? 3 Suppose 0 = -4x + 2x + 12. Let w(v) = 7v2 + 7v - 43. What is the hundreds digit of w(x)? 2 Let s = -2715 + 4719. Let j = -625 + s. What is the thousands digit of j? 1 Suppose r - 40 = 16m - 17m, -2r + 76 = m. What is the tens digit of 4/((r/10233)/((-2)/(-3)))? 5 Let k = 3532 - -2594. What is the thousands digit of k? 6 Suppose -329u = -335u + 18. What is the tens digit of u/(-2) - 14850/(-36)? 1 Let g be (-8)/24 + (-21)/(-9). Suppose -1024 = -0b + gb. Let j = b + 724. What is the units digit of j? 2 Let k = -19 - -62. Let n = 32 - 71. Let a = k + n. What is the units digit of a? 4 Let y(o) = -4o + 2. Let t be y(-7). Let r be t/(-135) + (-29)/(-9). Suppose ri + g - 485 = 0, -3i - i + 645 = g. What is the hundreds digit of i? 1 Suppose 4j - 12 = 2o, 4o + 0j + 6 = 2j. Suppose 4i - 12i + 3288 = o. What is the units digit of i? 1 What is the units digit of (3 - -165)/(-2)(-3038)/56? 7 Suppose -11440 = g - 14g. Let h = -580 + g. What is the tens digit of h? 0 Suppose -22u + 17u - q + 74005 = 0, -4u + 59204 = 3q. What is the hundreds digit of u? 8 Let k(a) = 293a*2 + 8a + 35. Let l be k(-11). Suppose -l = -25f + 11350. What is the thousands digit of f? 1 Suppose -196a + 8 = -192a. Let n = -20 + 14. What is the hundreds digit of (a/n)/((-6)/2754)? 1 Let m(a) be the second derivative of -7a*3/3 + 89a*2/2 + 4a. What is the units digit of m(5)? 9 Let a(y) = 10y3 + 5y*2 - 4y + 3. Suppose -5g = -4l - 0l - 18, -14 = -4g + 3l. What is the tens digit of a(g)? 9 Suppose 0 = -b, 4c - 14b - 206792 = -9b. What is the hundreds digit of c? 6 Let w be (-11)/(-44) - (-2)/(-8). Suppose w = 14v + 11v - 9350. What is the tens digit of v? 7 Suppose -280c + 261c + 496071 = 0. What is the tens digit of c? 0 Let v = 9 + 19. Suppose 13u = 15u - v. Let m(q) = 3q + 8. What is the tens digit of m(u)? 5 Let v be (-6 - 16/(-4)) + (-6)/1. Let i be 596/(-3)(-6)/v-2. Suppose 9c - 1909 = -i. What is the tens digit of c? 7 Suppose 0 = 4r - 5r + 5. Let d(z) = -rz3 + 1 + 2 + 0 + 5. What is the units digit of d(-3)? 3 Suppose -8 = 2i, 2i + 13 + 40 = q. Let x = q - 38. Suppose -xb + 821 = 51. What is the units digit of b? 0 Let w(m) be the first derivative of 4m4 - 2m3/3 - m2/2 + m - 7. Suppose 0n - 4r + 22 = n, -r + 5 = 0. What is the units digit of w(n)? 9 Suppose -o + d + 6050 + 2900 = 0, 3o - 26852 = 2d. Suppose 0 = 7j - o + 706. What is the tens digit of j? 7 Suppose 42y = 55y + 7358. Let n = y + 1167. What is the hundreds digit of n? 6 Suppose -2z = 4j - 168, 0 = 5z - 4j + 182 - 560. Suppose -f = q + 27, 4f - 5q + 50 = -85. Let w = z - f. What is the units digit of w? 8 Let v(y) = 3y2 - y2 - 47y - 3y*2 - 73. What is the tens digit of v(-18)? 4 Suppose -200 = -22h + 20h. Let o = 295 - h. What is the units digit of o? 5 Let h(s) = -521s*3 - 4s*2 - 21s - 18. What is the units digit of h(-5)? 2 Suppose 3q = 5v + 2q - 35, 0 = 3q - 15. Let c be 147/35 - v/(-10). Suppose -2s + cl + 255 = 0, -16 = 4*l + 4. What is the hundreds digit of s? 1 Let r = 74 + -78.	{ "pile_set_name": "DM Mathematics" }
= -6n(a) + 11o(a). Determine c(m(u)). -2u2 Let i(n) be the second derivative of 2n - 1/3n3 + 0n*2 + 0. Let v(u) = u. Calculate i(v(f)). -2f Let n(v) be the third derivative of -v*4/12 + 7v*2. Let h(p) = -4p. What is n(h(y))? 8y Suppose 102 = 4t + 2s, 3t + 5s - 135 = -2t. Let k(l) = 20l + 24. Let f(w) = 4w + 5. Let x(b) = tf(b) - 5k(b). Let g(c) = 2c. Calculate g(x(r)). -8r Let q(v) be the second derivative of v*3/3 + 2v. Let n(m) = 39m2 - 14m*2 - 15m*2. Give n(q(z)). 40z*2 Let n(c) = -2c2. Let r(v) be the first derivative of -v4/6 - 2v + 3. Let y(b) be the first derivative of r(b). What is y(n(i))? -8i*4 Let x(q) = 1 + 6q*2 - 7q*2 + 2q*2. Let l(z) = 10z*2 + 14. Let f(u) = 2l(u) - 28x(u). Let d(b) = 2b. Calculate d(f(p)). -16p2 Let d(l) = -3l. Let m(t) = 18t2 + 15t. What is m(d(f))? 162f2 - 45f Let c(f) = 2f2. Let n(m) = 138m. Calculate c(n(i)). 38088i2 Let c(n) = -6n. Let h(u) be the first derivative of -5 + 3 - u*2 - 3 + 4. What is c(h(l))? 12l Let g(b) be the third derivative of b*5/30 + 3b*2. Let d(o) = -3o*2. Calculate d(g(v)). -12v*4 Let y(p) = 141p2. Let j(n) = -n2. Calculate y(j(m)). 141m4 Let j(g) = 134g*2 + 2. Let r(i) = 4i. Give r(j(k)). 536k2 + 8 Let z(f) = -f2. Let w(u) = -2u*2. Let i(g) = -3g*2. Let c(m) = -3i(m) + 4w(m). Calculate c(z(b)). b4 Let g(b) = -2b. Let v(q) = 690q. Determine g(v(m)). -1380m Let v(g) = 2g. Let s(c) = -c2 + 4c - 5c + c. What is s(v(n))? -4n*2 Let y(u) = -3u. Let i(o) = 26o2 - 2o. Determine i(y(t)). 234t2 + 6t Let q(g) = g. Let l(a) = a*2 + a + 6. Let p be l(0). Suppose 6z = -2s + z - 17, 2z - p = -4s. Let o(k) = -sk + 4k - k. Determine q(o(t)). -t Let v = -4 + 6. Let h(p) = -2p*2 + 3p*v + 0p2. Let r(t) be the second derivative of -t3/3 - t. Calculate r(h(w)). -2w2 Let f(k) = -4k + 11. Let z(v) = 2v - 2v - 3 + v. Let i(y) = -6f(y) - 22z(y). Let g(n) = -4n2 - 2n*2 + 2n*2 + 7n*2. Determine i(g(q)). 6q*2 Let y(i) = -2i. Let g(k) = 2k. Let n(j) = 2g(j) + 3y(j). Let u(z) be the first derivative of -5z*3/3 + 29. Calculate n(u(b)). 10b*2 Let c(w) = 18w2. Let r(o) = -o2. What is c(r(j))? 18j4 Let m(o) = 5o - 7. Let q(g) = -3g + 4. Let n(b) = 4m(b) + 7q(b). Let z(y) = 2 - 2y - 2. What is n(z(r))? 2r Let n(m) = -13m + 2. Let o(k) = -210k + 33. Let u(a) = 33n(a) - 2o(a). Let d(x) = 2x. Determine d(u(c)). -18c Let p(o) = 8o + 5. Let m(a) = -a + 14. Determine m(p(x)). -8x + 9 Let x(v) = -12v*2. Let y(c) = -40c*2 - 1. What is y(x(s))? -5760s*4 - 1 Let x(z) = 4z*2 - 15z*2 + z - z. Let c(s) = -3s*2. Determine c(x(o)). -363o*4 Let d(t) = 4t. Let s(o) = 8o2 - 1. Calculate s(d(v)). 128v*2 - 1 Let g(y) = 8 - 8 - y. Let i(a) = -4a*2 + 9 - 17 + 8. What is i(g(n))? -4n*2 Let f(c) be the first derivative of -3 + 4 + 2c2 - c2. Let q(h) = h. Determine f(q(l)). 2l Let b be -1 + 1 - 18/(-2). Let d(f) = 7 - b + 2f*2 + 2. Let w(v) = 55v*2 + 45v. Let o(q) = -5q2 - 4q. Let m(p) = 45o(p) + 4w(p). What is m(d(z))? -20z4 Let o(s) = 4s. Let f(i) = -6i + 3i + 6i - 4i. Calculate o(f(u)). -4u Let f(i) be the first derivative of -4i*3/3 + 2. Let o(j) = j. Let z(m) = -5m. Suppose -3 = 3k - 0. Let g(p) = kz(p) - 3o(p). Determine g(f(y)). -8y*2 Let k(a) = 3a*2 + 0a + 0a. Let s(m) = 2. Let n(j) = j + 3. Let r(v) = -2n(v) + 3s(v). What is k(r(d))? 12d*2 Let w(g) = -6g*2. Let p(j) = 3871j*2. What is p(w(h))? 139356h*4 Let d(t) = 22t + 20t - 41t. Let n(h) = -3h2. Determine n(d(u)). -3u2 Let p(m) be the first derivative of -m2 + 8. Let o(u) = -38u. Give o(p(t)). 76t Let w(a) = 87a2. Let f(t) = -3t. Calculate w(f(v)). 783v2 Let g(f) be the second derivative of 1/2f*3 + 0f*2 + 0 + 2f. Let i(p) be the third derivative of p4/12 + p2. What is g(i(z))? 6z Let n(x) = 2x. Let y(m) = -514m. Calculate y(n(z)). -1028z Let l(w) = -12w2 + 5 + 11w*2 - 5. Let k(v) = 2v*2 - 8v. Let d(i) = -i*2 + 5i. Let o(n) = -8d(n) - 5k(n). Give l(o(j)). -4j4 Let d(p) = -49p + 3. Let l(n) = 13n2. Determine d(l(c)). -637c2 + 3 Let t(j) = j2. Let z be 4/(8/(-6)) - -5. Suppose -4g - 4 = -zg. Let o(p) = -39p - 27. Let i(r) = 3r + 2. Let w(b) = go(b) - 27i(b). Calculate t(w(q)). 9q2 Let m(f) = -74f + 2. Let s(z) = 1260z - 35. Let t(b) = 35m(b) + 2s(b). Let k(p) = 3p. Give t(k(o)). -210o Let b(j) = 8j*2. Let v(g) = 1964g. Give b(v(l)). 30858368l2 Let q(p) = -7p + 0p - 4p + 10p. Let n(w) = -10w. Determine q(n(y)). 10y Let g(r) be the second derivative of -2r*3/3 - 9r*2/2 + 22r. Let o(l) = l. What is o(g(u))? -4u - 9 Let k(r) = -5r + 67. Let y(m) = m*2. Calculate y(k(u)). 25u*2 - 670u + 4489 Let m(h) = 2h2. Let i(x) = 4 - 4 + 7x*2 - 4x*2. Give m(i(u)). 18u*4 Let j be 24/204 + (-4)/34. Let r(z) be the second derivative of -3z + jz2 + 0 - 1/2z*3. Let w(s) = 2s. Calculate w(r(y)). -6y Let l(a) = 12a + 11 + a + 7a. Let t(g) = -4g - 2. Let u(h) = 2l(h) + 11t(h). Let p(c) = -23c + 23c - 2c2. What is p(u(w))? -32w*2 Let z(d) = 5d - 6d - d. Let u(n) = n2 - 15. Give u(z(f)). 4f*2 - 15 Let r(k) = 2k*2. Let a(j) = 43j*2 + 6j. Let p(x) = x*2 + x. Let y(m) = a(m) - 6p(m). Determine r(y(n)). 2738n4 Let w = -9 - -12. Let q(d) be the third derivative of 0d - 3d2 + 0 + 0d*w + 0d*4 - 1/60d*5. Let y(g) = -2g*2. Determine y(q(f)). -2f*4 Let l(o) = o. Let u(a) be the first derivative of 3a*3 + 9. Calculate u(l(r)). 9r2 Let o(g) be the third derivative of -g5/5 - 9g2. Let r(a) = -2a. Give r(o(l)). 24l2 Let i(o) = 13o. Let q(d) = -d*2. Let b(m) = -3m*2. Let g(u) = -b(u) + 5q(u). What is i(g(x))? -26x2 Let c(l) = 2l*2. Let n(p) = -23p*2 + 12. What is c(n(a))? 1058a*4 - 1104a*2 + 288 Let z be (1/2)/((-2)/(-8)). Let v(g) = 2 + g - z + 5g. Let n(j) = -j*2. Determine n(v(o)). -36o*2 Let o(s) = 5s2. Let w(i) = i2 - 6. Calculate w(o(c)). 25c4 - 6 Let w(u) be the first derivative of 4u3/3 + 2. Let g(y) = y3 + 3y2 - 1. Let h be g(-2). Let v(d) = -d + hd + 0d. Determine w(v(f)). 16f*2 Let l(w) = 2w. Let y(x) = -6x. Let z(c) = 8l(c) + 3y(c). Let d(t) = -4t. Let k(r) = -23r. Let p(q) = 34d(q) - 6k(q). What is p(z(s))? -4s Let i(s) = s*2 + 2s + 2. Let q(w) = -2w2 - 5w - 5. Let h(r) = -10i(r) - 4q(r). Let d(a) = -2a2. Give h(d(z)). -8z*4 Let i(q) = -4q*2 + 16q + 4. Let k(m) = -m. What is k(i(z))? 4z2 - 16z - 4 Let x(y) be the first derivative of -y3/3 + 3. Let a(p) be the third derivative of -p5/60 + p2. Determine x(a(i)). -i4 Let i(p) be the third derivative of -p*4/8 - 10p*2. Let t(m) = 3m*2. Determine i(t(n)). -9n2 Let l(o) = -o2. Suppose 3s - 5p = 82, -5s = -0p + 2p - 116. Let c = 21 - -3. Let u(f) = -f2 - c + s. Determine u(l(i)). -i4 Let q(h) = -h2 - 10h. Let p be q(-10). Let j(l) = -3l2 + pl*2 + 4l2. Let u(v) be the first derivative of -v3/3 - 2. Determine u(j(n)). -n*4 Let d(a) = -4a + 3. Let i = 3 + -9. Let q(w) = -4w + 5 + 2w - 3 - w. Let h(r) = iq(r) + 4d(r). Let t(g) = -g*2. Give t(h(o)). -4o*2 Let u(l) = 0l*2 + 5l*2 - 3l*2 - 3l2. Let c(y) be the third derivative of -y5/20 - y*2. Give c(u(w)). -3w4 Let a(s) = -s2 - 2s. Let w(u) = 2u. Let v(m) = -3m. Let k(l) = v(l) + 3w(l). Let t(g) = -3a(g) - 2k(g). Let q(h) = -5h. What is q(t(c))? -15c*2 Let q(f) = f. Let u(b) = 14b + 119. What is q(u(h))? 14h + 119 Let u(q) = -2q*2 - 3q - 3. Let r(o) = 15o2 + 20o + 20. Let j(g) = 3r(g) + 20u(g). Let d(m) = -29m2 + 51m*2 - 24m*2. Calculate d(j(w)). -50w*4 Let q(p) = -5p. Let i(t) = -11t. Let b(m) = -4i(m) + 9q(m). Let n(v) = -1 + 1 + 4v*2. Give n(b(h)). 4h*2 Let n(h) = -2h + 0 + 3 + 0. Let z(f) = 3f - 5. Let v(w) = 10n(w) + 6z(w). Let g(a) be the third derivative of -a4/12 + a2. What is v(g(d))? 4d Let f(a) = -3a2. Let i(v) = -199v. Calculate f(i(j)). -118803j2 Let a(t) = 4 + 2t - 4. Let k(j) = -4j + 2j + 6j + 0j. What is a(k(d))? 8d Let i(f) = -f. Let d(n) be the third derivative of -n4/12 - 7n**2. Deter	{ "pile_set_name": "DM Mathematics" }
: 1, d: 4}? 4/91 Four letters picked without replacement from mfffwwmowm. What is prob of picking 1 m and 3 f? 1/70 Calculate prob of picking 1 z and 1 e when two letters picked without replacement from zeqznzeezjenqq. 16/91 Three letters picked without replacement from {g: 2, y: 1, w: 1, z: 7, r: 3}. Give prob of picking 1 w and 2 g. 1/364 Four letters picked without replacement from hkkhhhhkkhkhhkhkhhh. Give prob of picking 3 k and 1 h. 35/323 Four letters picked without replacement from {r: 15, k: 4}. Give prob of picking 2 r and 2 k. 105/646 What is prob of picking 1 v and 1 d when two letters picked without replacement from {d: 1, v: 1, e: 1}? 1/3 What is prob of picking 1 z and 2 t when three letters picked without replacement from tzzzzzttzzttttzttzz? 120/323 Three letters picked without replacement from {o: 6, a: 2, m: 1, p: 2}. Give prob of picking 2 p and 1 m. 1/165 Calculate prob of picking 1 k and 1 c when two letters picked without replacement from {m: 1, f: 1, v: 1, c: 1, k: 1}. 1/10 Three letters picked without replacement from ghhpihgdgdgpgphhhh. Give prob of picking 2 h and 1 i. 7/272 Three letters picked without replacement from vnnlyv. Give prob of picking 1 y and 2 n. 1/20 Four letters picked without replacement from {x: 4, s: 3, q: 2}. Give prob of picking 1 s and 3 x. 2/21 Four letters picked without replacement from cpwppccwcgwwpg. Give prob of picking 1 g and 3 p. 8/1001 What is prob of picking 2 w and 1 s when three letters picked without replacement from {w: 4, s: 10}? 15/91 Four letters picked without replacement from ocncnooc. What is prob of picking 2 c and 2 n? 3/70 Calculate prob of picking 2 t when two letters picked without replacement from {t: 9, r: 10, n: 1}. 18/95 Two letters picked without replacement from {t: 1, u: 1, k: 2, g: 1, v: 2}. What is prob of picking 1 k and 1 t? 2/21 What is prob of picking 3 s when three letters picked without replacement from nnsssnnnnn? 1/120 Calculate prob of picking 3 s when three letters picked without replacement from {s: 4, b: 16}. 1/285 Calculate prob of picking 1 z and 1 b when two letters picked without replacement from zqbzbkbb. 2/7 Three letters picked without replacement from {y: 4, r: 1, p: 3, e: 12}. Give prob of picking 1 y and 2 e. 22/95 Four letters picked without replacement from {t: 3, q: 4, w: 2}. Give prob of picking 2 t, 1 q, and 1 w. 4/21 Four letters picked without replacement from {b: 3, f: 6, c: 1, r: 3, x: 1, o: 4}. What is prob of picking 1 o, 2 b, and 1 f? 2/85 What is prob of picking 1 r and 1 b when two letters picked without replacement from {r: 4, a: 2, m: 1, u: 2, b: 7, k: 1}? 7/34 What is prob of picking 1 t and 1 f when two letters picked without replacement from xttrrlrxftrrrrrrlrr? 1/57 Four letters picked without replacement from {z: 2, r: 18}. Give prob of picking 4 r. 12/19 What is prob of picking 2 n when two letters picked without replacement from naen? 1/6 Two letters picked without replacement from {g: 1, v: 2, n: 2, j: 1}. Give prob of picking 1 j and 1 n. 2/15 Calculate prob of picking 1 f and 1 y when two letters picked without replacement from {w: 3, f: 4, y: 5}. 10/33 Two letters picked without replacement from jbjzzzpzhzhzjjjjzz. What is prob of picking 2 h? 1/153 Two letters picked without replacement from {c: 6, h: 4, b: 1, n: 5}. Give prob of picking 1 n and 1 c. 1/4 Three letters picked without replacement from {p: 9, w: 5}. What is prob of picking 1 w and 2 p? 45/91 Four letters picked without replacement from xxxxxexxeecxxxexxxex. Give prob of picking 2 x and 2 e. 182/969 Two letters picked without replacement from nlygpydn. What is prob of picking 1 n and 1 d? 1/14 Two letters picked without replacement from tttptttdbptbbppttt. Give prob of picking 2 b. 1/51 What is prob of picking 1 w and 1 r when two letters picked without replacement from wwwwwrww? 1/4 Four letters picked without replacement from xifixifixxixuxuuouxi. Give prob of picking 1 x, 2 i, and 1 o. 7/323 Two letters picked without replacement from {k: 3, c: 4, v: 5, e: 7}. What is prob of picking 1 v and 1 c? 20/171 Calculate prob of picking 1 b and 1 r when two letters picked without replacement from bbbrbrrrrrbrrrrr. 11/24 Calculate prob of picking 1 v, 1 d, and 1 q when three letters picked without replacement from qdiqyvdi. 1/14 Calculate prob of picking 1 s and 1 j when two letters picked without replacement from sysysyyyyyyyjjys. 1/15 Three letters picked without replacement from mtemmen. What is prob of picking 2 m and 1 t? 3/35 Two letters picked without replacement from {a: 2, k: 5, c: 5, g: 4, h: 3}. What is prob of picking 2 c? 10/171 Two letters picked without replacement from {s: 6, l: 12}. Give prob of picking 2 l. 22/51 Two letters picked without replacement from {t: 2, i: 3, k: 12}. Give prob of picking 2 i. 3/136 Three letters picked without replacement from {l: 2, e: 11}. Give prob of picking 3 e. 15/26 Two letters picked without replacement from aasssaaa. Give prob of picking 2 a. 5/14 Two letters picked without replacement from {d: 11, k: 2}. Give prob of picking 2 d. 55/78 What is prob of picking 1 j and 1 d when two letters picked without replacement from {k: 1, j: 12, z: 2, b: 1, d: 2}? 8/51 Calculate prob of picking 2 c and 1 n when three letters picked without replacement from {w: 4, n: 4, j: 1, c: 1, t: 1}. 0 Four letters picked without replacement from jjjjjjjjeje. What is prob of picking 2 e and 2 j? 6/55 Two letters picked without replacement from iifax. Give prob of picking 1 i and 1 a. 1/5 Three letters picked without replacement from xxxxxx. Give prob of picking 3 x. 1 What is prob of picking 2 k and 1 t when three letters picked without replacement from {l: 1, k: 2, t: 1}? 1/4 Four letters picked without replacement from wwwrrrr. What is prob of picking 4 r? 1/35 Calculate prob of picking 2 p and 1 f when three letters picked without replacement from aagggpasppaghaaf. 3/560 What is prob of picking 1 v and 3 o when four letters picked without replacement from {o: 3, l: 2, v: 3, p: 5, h: 5}? 1/1020 Two letters picked without replacement from ehjttj. Give prob of picking 2 t. 1/15 Three letters picked without replacement from zizzzzizzzz. Give prob of picking 1 z and 2 i. 3/55 Four letters picked without replacement from {c: 8, z: 6, x: 3, i: 2}. Give prob of picking 1 i, 2 z, and 1 c. 20/323 What is prob of picking 1 g and 2 c when three letters picked without replacement from nngcjjfcnjnggcjnngn? 4/323 Calculate prob of picking 1 r and 2 b when three letters picked without replacement from {r: 3, b: 9}. 27/55 Four letters picked without replacement from dtadfddfddqddftddf. What is prob of picking 2 d, 1 f, and 1 q? 1/17 Two letters picked without replacement from {h: 7, j: 3, z: 3, o: 7}. What is prob of picking 1 o and 1 h? 49/190 Two letters picked without replacement from {z: 9, r: 6, w: 4}. Give prob of picking 1 z and 1 r. 6/19 Calculate prob of picking 2 z and 1 j when three letters picked without replacement from {j: 11, s: 7, z: 2}. 11/1140 What is prob of picking 1 i, 1 y, and 1 a when three letters picked without replacement from {w: 3, a: 3, y: 1, e: 2, i: 2, h: 7}? 1/136 Calculate prob of picking 2 g and 2 r when four letters picked without replacement from rgggggrrrgg. 21/55 Two letters picked without replacement from {z: 2, y: 3, u: 3, d: 8}. What is prob of picking 2 u? 1/40 Two letters picked without replacement from ddqqdggq. Give prob of picking 1 d and 1 g. 3/14 Calculate prob of picking 2 a when two letters picked without replacement from eaeaaaaaaaaaaaeeaaaa. 12/19 What is prob of picking 4 q when four letters picked without replacement from qqqqqqqqqq? 1 What is prob of picking 1 i and 1 b when two letters picked without replacement from yiagqba? 1/21 Two letters picked without replacement from jvjksjbvjsjvvvv. Give prob of picking 1 v and 1 j. 2/7 Three letters picked without replacement from {g: 3, o: 3}. What is prob of picking 2 o and 1 g? 9/20 Calculate prob of picking 2 t when two letters picked without replacement from ggggtggggtggggggtggt. 3/95 Three letters picked without replacement from oooooooooohhoooooo. Give prob of picking 1 o and 2 h. 1/51 Three letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
? (a) -56738/5 (b) -0.5 (c) -2/9 b Which is the smallest value? (a) -1/2 (b) 0.087 (c) 5/3 a Which is the smallest value? (a) 4 (b) 2/13 (c) 0.7 (d) -3/8 (e) 2 (f) -1/8 d Which is the biggest value? (a) -4233 (b) -4 (c) 1.2 c Which is the fifth smallest value? (a) -1/8 (b) 4 (c) 2/9 (d) 0.05 (e) 3 (f) -9/2 e What is the fifth biggest value in 0.18, 4, -3, 1/2, 0.34, 1/5? 0.18 Which is the third smallest value? (a) -4 (b) -0.4 (c) -2/207403 c Which is the third smallest value? (a) 6 (b) -8/3 (c) -3/7 (d) -4 (e) -37 b What is the sixth smallest value in -1/2, 2/11, 2/9, 5/6, -2, -6.06? 5/6 What is the third smallest value in -662, -12, 1? 1 Which is the fourth biggest value? (a) -137 (b) 0.5 (c) 0.3 (d) 1 a Which is the smallest value? (a) 2 (b) -0.4 (c) -1408 c Which is the third biggest value? (a) -2/25 (b) -0.4 (c) 2.3 (d) -655 b Which is the fifth smallest value? (a) 7 (b) -0.3 (c) -3 (d) -0.1 (e) 1/3 (f) 2/5 f Which is the fifth smallest value? (a) 3/7 (b) 5 (c) 2/6133 (d) 1/2 (e) 0.2 b Which is the third biggest value? (a) -0.0918 (b) 5 (c) 0.5 (d) -1 (e) 39 c Which is the fifth biggest value? (a) 2/5 (b) 1/2 (c) 3/2 (d) 15 (e) 4 a Which is the smallest value? (a) -3/4 (b) 329 (c) 0.5 a What is the sixth smallest value in 37/7, -3, -1.6, -1/5, -0.5, -4? 37/7 Which is the fourth smallest value? (a) -2/9 (b) 2 (c) -1/24 (d) -0.034 b What is the fifth biggest value in -563, 1/8, -4, -1, 1/6? -563 Which is the second biggest value? (a) -2843 (b) 6 (c) -17 (d) 2/13 (e) 3/2 e Which is the second smallest value? (a) 10 (b) -5 (c) -93 (d) -8 (e) -4 d What is the second biggest value in -1/4, -38569, -2? -2 What is the fifth smallest value in 0, -24, -12, 1, -2/15? 1 Which is the smallest value? (a) -0.06 (b) 8/7 (c) 8 (d) 18 a Which is the third smallest value? (a) 2 (b) 256/7 (c) -0.2 b What is the second biggest value in 1/22, -0.2, 4, 1/4, 3? 3 Which is the biggest value? (a) 2/15 (b) -2 (c) 0 (d) -1.59 (e) 1/2 (f) -0.5 e Which is the second biggest value? (a) -0.3 (b) 0.07 (c) 402 (d) -0.1 (e) 0.3 e Which is the second smallest value? (a) -3 (b) 0.2 (c) -28676 a Which is the fourth biggest value? (a) -9 (b) 0.1 (c) 1/5 (d) 0.02 (e) 1/14 (f) 4 e What is the biggest value in -1, -0.4, 527756? 527756 What is the smallest value in -5/6, -1/17, 1.9, 0.04, -0.4? -5/6 Which is the smallest value? (a) 22 (b) 0 (c) 5 (d) 11 b Which is the third smallest value? (a) 29 (b) 17 (c) -0.4 (d) 2 (e) 0.053 d Which is the third smallest value? (a) 3/10 (b) 1659 (c) 1 (d) -2/11 c Which is the third biggest value? (a) 1686 (b) -255 (c) 0 (d) 2 c Which is the fifth biggest value? (a) 0.4 (b) 3 (c) -3 (d) 1 (e) 5008 c What is the smallest value in 2, -7, 4, 308, 1, 6/13? -7 Which is the smallest value? (a) 23/239 (b) 3 (c) -44 c What is the second biggest value in -8/7, -1057, 1/8? -8/7 Which is the third biggest value? (a) -42 (b) -2 (c) 1/3 (d) -13 d Which is the smallest value? (a) 4 (b) 75 (c) 1/123 c Which is the third smallest value? (a) 227 (b) -2 (c) 38 (d) 9/2 c Which is the second smallest value? (a) -0.2 (b) 4 (c) 0.4 (d) -3 (e) -2.64 e What is the biggest value in -200, 0.1, -2/51? 0.1 What is the second smallest value in 0, -0.1, 2/5, 212, -0.04? -0.04 Which is the fourth smallest value? (a) -1/5 (b) -1 (c) 4 (d) -4 (e) -1262 a What is the third smallest value in 0.1, 2, -128, 0.2, 115? 0.2 Which is the second smallest value? (a) 3/4 (b) 6 (c) 157414 b What is the third biggest value in -1/10, -0.2, -762/59? -762/59 What is the third biggest value in -7, -2/5, 0.08, 4, -1/5, 60? 0.08 Which is the second biggest value? (a) 0.15 (b) -4 (c) 6/25 a What is the biggest value in 3, -0.3, 1, -9, -5/2? 3 Which is the sixth biggest value? (a) -12/89 (b) 13 (c) -0.1 (d) 5 (e) 0.4 (f) 0.5 a Which is the biggest value? (a) 0.5 (b) 2621 (c) -3 b Which is the second biggest value? (a) -2/5 (b) 0.42 (c) 2/253 (d) 2 b What is the third biggest value in 30/59, 1.1, 20, 0.2, 4, 5? 4 What is the fifth biggest value in 1/4, 2, 0.4, 0.01, -3, -87? -3 What is the sixth biggest value in 0.4, -5880, 2, -22, -1/5, 0.3? -5880 Which is the fourth smallest value? (a) 3.9 (b) -2/3 (c) 0 (d) -6.2 (e) -3 c What is the second smallest value in 5, -44, 3419? 5 Which is the fifth smallest value? (a) 0.2 (b) 0.3 (c) 1 (d) -2/11 (e) -0.4 (f) -4.873 b What is the second smallest value in 4, 0.4, -2/9, 2/271, -1/2? -2/9 What is the second smallest value in -3, 24, 2.9, 1/9, -2? -2 What is the smallest value in 3, -2/5, -1/3, -43? -43 Which is the fourth smallest value? (a) -34 (b) -0.2 (c) -1/6 (d) -6/7 (e) -0.02 c What is the second biggest value in -2, -4, -0.01, 265, -17? -0.01 Which is the biggest value? (a) 0.012 (b) 0.04 (c) 3/2 (d) 1 (e) 12.5 e What is the fifth biggest value in -10, 0.1, 473.06, 1, 2/15? -10 What is the biggest value in -1.4, 46, 1, -2/13, -34, 0.2? 46 What is the smallest value in 97, -8, 8/103? -8 Which is the second biggest value? (a) 0.05 (b) 109 (c) -1/2 (d) 0.06 d Which is the second biggest value? (a) 1 (b) 0.03 (c) -0.2 b Which is the fifth smallest value? (a) -1/4 (b) 4 (c) 3 (d) -5 (e) -155.2 b Which is the smallest value? (a) -3/2 (b) 9 (c) -3.7 (d) 3 c Which is the third smallest value? (a) -2/59 (b) -8/9 (c) -1/3 (d) -4 (e) 7/6 c What is the fourth smallest value in 1/6, -42, -854, 3/4? 3/4 What is the fifth biggest value in 31, 6/89, -4, 0.1, 3, 4? 6/89 Which is the third biggest value? (a) 0.18 (b) 2/5 (c) 118 (d) -1/6 (e) -2/19 a Which is the third smallest value? (a) -37 (b) -4/7 (c) -42 (d) -1/4 b Which is the third smallest value? (a) 1/5 (b) -1449 (c) 3/19 (d) 4 a What is the smallest value in -0.57, -2/33, -0.2? -0.57 Which is the fourth biggest value? (a) -0.5 (b) 7 (c) 3 (d) 1 (e) 1469 d What is the third smallest value in 0.2, -1/10, 126, 2, -2/3? 0.2 Which is the smallest value? (a) 1/5 (b) -17/3 (c) -6/11 (d) -41 d What is the biggest value in -1/4, -1/8, -3, -32, -7? -1/8 What is the fifth biggest value in 3.044, 0.04, 0.5, 2, -0.3? -0.3 Which is the fourth smallest value? (a) -116 (b) 0.4 (c) -55 (d) 0 (e) 0.1 (f) 0.03 f Which is the smallest value? (a) -2.4 (b) -1432 (c) 7 b Which is the third biggest value? (a) -5874 (b) -1.1 (c) -3 a Which is the second biggest value? (a) -2/15 (b) -29 (c) -0.0014 a Which is the second smallest value? (a) -2 (b) 1.3 (c) -1 (d) -4 (e) -1/5 (f) -53 d Which is the third biggest value? (a) -45/4 (b) 1/8 (c) -1/39 a What is the smallest value in 5, -2/7, -0.4, 0.0834, -1? -1 Which is the third smallest value? (a) 5 (b) 0.3 (c) 9562 c What is the second biggest value in -616, 1/3, 29/6? 1/3 What is the third smallest value in -5, 5, -11447, -1/3, 0? -1/3 Which is the third smallest value? (a) -1 (b) 0.2 (c) -0.1 (d) 1/6 (e) -731/4 c Which is the smallest value? (a) -0.05 (b) 0.0205 (c) 3 (d) 2/7 (e) 2/3 (f) 5 a What is the biggest value in -339, -0.15, -5? -0.15 What is the fourth smallest value in 13, 19, 19/5, 0.2, -5? 13 Which is the second biggest value? (a) 1/162 (b) -10 (c) -3 c Which is the fourth smallest value? (a) -1/23 (b) 100 (c) -0.05 (d) -3 (e) -2/17 a Which is the fifth smallest value? (a) 3 (b) 0.1 (c) -7/2 (d) 2/3 (e) 0.5 (f) 0 d Which is the second biggest value? (a) 34 (b) 0.04 (c) 2 (d) 5 (e) -7 (f) 4 d Which is the second biggest value? (a) 9794 (b) 1 (c) 0.3 (d) -5/2 (e) -0.3 b Which is the second biggest value? (a) -0.1 (b) 8 (c) -8865 a What is the third biggest value in -14321, 2, -43? -14321 Which is the smallest value? (a) -3/532 (b) 0 (c) -3/19 (d) -4 d Which is the second smallest value? (a) 9 (b) 23 (c) -75 (d) 2/9 d What is the smallest value in 3662, 1/2, 4/5? 1/2 What is the smallest value in 2/9, -4303, -0.32? -4303 Which is the third biggest value? (a) -6/5 (b) -0.5 (c) -3588 c Which is the fourth biggest value? (a) 3 (b) 6.7 (c) 2 (d) -0.6 (e) -0.3 e What is the fourth smallest value in -1, -5, -0.5, 0.19, -21/4? -0.5 Which is the second smallest value? (a	{ "pile_set_name": "DM Mathematics" }
-5r3 - 25r*2 - 25r + 35. Let v(a) = -2m(a) - 9w(a). Let q be v(3). Sort 1, q, 5, -2 in ascending order. q, -2, 1, 5 Let t = 356 + -351. Suppose -646 + 681 = tn. Sort -2, -5, n in descending order. n, -2, -5 Let s(r) = 6r*2 + 2r + 2. Let i be s(-2). Suppose 0 = -3y + q - 15, -13q + 10q - 15 = 3y. Let w be (-20)/40(-12)/y. Put i, w, 5, -4 in increasing order. -4, w, 5, i Let c = 43.4592 - 43.4. Let b = c - -0.0408. Put -5, b, -0.05 in descending order. b, -0.05, -5 Suppose 13 = 2y - 17. Let o be y/52/12-2. Suppose -51h = -33h - 36. Sort -5, o, -4, h in decreasing order. h, o, -4, -5 Let m = 695 + -692. Let k = -4.1 - -3.1. Put -6/19, m, k in decreasing order. m, -6/19, k Suppose -54p + 47 + 9 - 2 = 0. Put 7, p, -1, -3, -8 in descending order. 7, p, -1, -3, -8 Let y be (10 - 16819570/1681300)/(42/256). Let o = y + 2/6923. Put o, 2, -2/3 in ascending order. -2/3, o, 2 Suppose 12u = 11u - 10. Let d be 4/2 - (-5 - -9). Let f be -32 + 39 - (-43)/(-7). Sort d, f, 1/5, u in descending order. f, 1/5, d, u Let y = -1.829 + -159.271. Let l = -161 - y. Put -3, 0.3, 3, l in ascending order. -3, l, 0.3, 3 Let j = -21600 - -21590. Sort j, 43, 0, 5 in descending order. 43, 5, 0, j Let c be (47 + 3 - -3) + -5. Suppose 0 = cl - 51l - 18. Sort -2, 5, l, -5. l, -5, -2, 5 Let f = -27.943 + -0.057. Let h = -26.4 - f. Let a = h - 1.5. Put a, 2, 2/11 in increasing order. a, 2/11, 2 Let m = 37655 + -37655. Sort -3, 3, 359, m in ascending order. -3, m, 3, 359 Let p = 64639.867 + -64563. Let j = 0.533 + p. Let h = j + -79. Sort h, -4, 0.4 in ascending order. -4, h, 0.4 Let x be (-4)/56 - 93/434. Put -2/9, -1, 4, -337, x in decreasing order. 4, -2/9, x, -1, -337 Let o be (2/(-13) - 10/(-65))/(3 - 6). Suppose y + 6 = -2. Sort -1, o, -2, y. y, -2, -1, o Suppose 3h = -h + 60. Let k = h + -13. Suppose -kg = 3z - 30, 0 = 6z - 2z - 2g - 26. Put 5, z, 0 in descending order. z, 5, 0 Suppose 0 = 24m - 22m + 2090. Let z be (-19)/m - (-4)/22. Suppose 0 = 2n + 4h - 12, -5n - 17 = -3h + 5. Put n, z, -0.4 in decreasing order. z, -0.4, n Suppose 125 = -56n + 175n - 232. Sort -0.02, n, 0.1, -8/5, -1/10 in descending order. n, 0.1, -0.02, -1/10, -8/5 Let r = 6486 - 6487. Sort r, 1, -5, -25 in descending order. 1, r, -5, -25 Suppose 0i - 124 = -5i + w, 0 = 5i - 2w - 128. Let b be -24/i + (-56)/12. Sort b, 4, 0, -9. -9, b, 0, 4 Suppose -2b + 3 = -4t + 1, 5t = 2b + 1. Let i(g) = g*3 - 32g*2 + 24g + 34. Let l be i(31). Let r = 187 + l. Sort -4, b, r in descending order. b, r, -4 Suppose -s - 286 = -4t, 5t = 4s + 502 - 150. Let d = t + -71. Sort -4, 5, 3, d in decreasing order. 5, 3, d, -4 Let l = 42.99063 + 0.00937. Sort -0.2, l, -1, -3/4 in decreasing order. l, -0.2, -3/4, -1 Suppose 66y + 63 = 59y. Let i be (((-108)/16)/y)/3. Sort i, -1, 3. -1, i, 3 Let f be -22(-2)/(15 + -11) + -10. Sort 8, 4, -27, f, -4 in descending order. 8, 4, f, -4, -27 Let n = -5.1 - -5. Let c = -208/21 - -74/7. Let f = -0.1 + 1.1. Put c, f, n in increasing order. n, c, f Let b = -150 + 151. Let w be 7 + b - (-4 + 8). Sort 26, w, -4 in decreasing order. 26, w, -4 Let u = -14.51 - -10.483. Let y = 4 + u. Let v = y - 0.073. Sort v, -1/2, -1. -1, -1/2, v Suppose 0 = 41x - 44x + 2u - 18, 4x = 2u - 22. Sort -20, 5, x. -20, x, 5 Let m = 5 + -9. Let x be 1 - 12 - 812/(-58). Suppose -k - 16 = -5d, 2k + 7d - 10 = 3d. Put m, x, k, -2/3 in ascending order. m, k, -2/3, x Let q = 1853 - 2041.4. Let l = -174 - q. Let g = 11.4 - l. Sort -6, -2, g. -6, g, -2 Suppose -16380 = 21u - 63u. Let i = u + -387. Sort -3, -2, 1, i in increasing order. -3, -2, 1, i Let s = 2.537 - 4.537. Put 44, s, -3/8, 10 in descending order. 44, 10, -3/8, s Let g = -512 + 512.2. Let m be (-3 - -460)/(-2 - 3). Let t = m + 92. Put -0.4, t, g, 5 in descending order. 5, t, g, -0.4 Let b = 7.9 + -2.9. Let a = 76 - 81. Put b, 1/8, -0.11, a in decreasing order. b, 1/8, -0.11, a Let o = 274 - 261. Suppose k - o = -10. Put k, 9, 5 in descending order. 9, 5, k Suppose -2c + 2c = -c. Suppose c = -13v + 18v - 5, -5l - 2v = -12. Sort l, -16, 0, 3 in decreasing order. 3, l, 0, -16 Let l(n) = -4n*2 + 94n - 93. Let t be l(1). Let h(y) = y*3 - 4y*2 - 4y - 1. Let z be h(5). Sort z, 5, t, 2 in descending order. 5, z, 2, t Let b = -0.22 - -0.06. Let u = -24322 + 24326. Sort b, -4, u. -4, b, u Let k be (-8 - (32 - -4))/(-2). Let m be k/(-3) + (14 - 7). Sort m, 0.5, -3, 23. -3, m, 0.5, 23 Let f = 261 - 261.5. Sort 1/2, f, -24, 0.3, 5 in descending order. 5, 1/2, 0.3, f, -24 Let s = -6 - -6. Let b be (-69)/2(-3 - (-52)/12). Let u = b + 49. Sort u, s, 1, 2 in decreasing order. u, 2, 1, s Let d(u) = -u3 + 10u*2 - u + 12. Let k be d(14). Let n = k + 798. Sort -5, n, -2, 0 in increasing order. -5, -2, 0, n Suppose -2y + 2 = 0, 33y + 23 = 4g + 32y. Put g, 36, -0.1 in descending order. 36, g, -0.1 Let h(i) = 54i + 162. Let a be h(-3). Sort 2, -8/15, 11, a, -0.1 in descending order. 11, 2, a, -0.1, -8/15 Let l be (0 + 3)/(3/(-4)). Suppose 491 = -5q - 149. Let z = 133 + q. Sort l, 11, z in descending order. 11, z, l Let f be -10 + 117/((-26)/(-2)). Put f, -4, 42 in increasing order. -4, f, 42 Let m be (-2)/27 + 3/(-2)(-128630)/7695. Let c be (6/1)/2 + 0. Put -0.3, 2, m, c in descending order. m, c, 2, -0.3 Let k(q) = -q*3 - 9q*2 - 7q + 11. Let m be k(-8). Suppose -3y + 30 = l, 0 = 2l - 4l - 2y + 16. Sort 4, m, l in descending order. 4, m, l Let u = -8 - -8.2. Let j(l) = 5l2 - 27l + 4. Let b be j(5). Let x = -7 + 5. Sort b, u, x in descending order. u, x, b Let l = -24845 - -24849. Suppose r - 4 = -3. Let p = -2 + 1.5. Sort l, -3/2, r, p in decreasing order. l, r, p, -3/2 Let r = 2497 - 2497. Sort r, 112, 4, -5. -5, r, 4, 112 Let n(h) = -h*3 - 5h*2 - 3h. Let f be n(-4). Suppose 0 = 3d + 2d + 15. Suppose 2z + 2k + 38 = -3k, -4z - 52 = 4k. Put 1, d, f, z in descending order. 1, d, f, z Let u = 17326/5 + -3465. Sort -3, 3, u, 5, 8 in increasing order. -3, u, 3, 5, 8 Let y = 7.159 + -92.159. Sort 0, y, 1 in descending order. 1, 0, y Let v(t) = -2t*2 + 23t + 106. Let y be v(15). Suppose -5i - 2a = -18, -5i - 6a = -11a + 10. Put 31, 3, i, y in descending order. 31, 3, i, y Let q = 3306 + -3305.6. Let y = 8 - 13. Sort 7, y, 4, q in descending order. 7, 4, q, y Suppose -5a + 0a - 15 = 0, 0 = -4m + 5a + 115. Suppose 4l - n = -m, 0 = 2l + 4n - 2n. Sort -3, 4, 2, l in descending order. 4, 2, -3, l Let s(k) = -k3 + 5k*2 + 2k - 18. Let q be s(4). Suppose -2b - 3c - 12 = 0, b + c = 6c - 32. Sort b, q, -2. b, -2, q Let l(i) = -i3 + 10i*2 - 7i - 13. Let s be l(9). Let q = 99.8 - 100. Let n = 19 + -16. Sort q, s, -3, n. -3, q, n, s Suppose -10q - 406 = -386. Sort 3, 49, q in increasing order. q, 3, 49 Let w = 0.298 + -0.166. Let k = 1.132 - w. Let d = 10 - 6. Sort d, -0.1, k, -2 in decreasing order. d, k, -0.1, -2 Let c = -2505 + 2502. Let r = -34 + 22. Let t = -2 - r. Put -7, t, c in ascending order. -7, c, t Suppose -4m + 4v = -8, -4m + 3v - 8v = 1. Suppose 6l - 40 = 5h + l, -l = 3h + 28. Let r = h - -8. Sort r, m, 2, 3. r, m, 2, 3 Let h be 18/(-81) + (-364)/(-18). Let c be (16/h)/((-4)/10). Let f(y) = 2y*3 - 13y*2 - 14y + 54. Let b be f(7). Put -3, b, c in descending order. b, c, -3 Let l = 516 + -514. Sort 0.19, 2/5, l in increasing order. 0.19, 2/5, l Let q(f) be the first derivative of -f3/3 - f2 + 16f + 49. Let w be q(-5). Sort -3, w, 3, -4. -4, -3, w, 3 Suppose 63 = -a + 2. Let i = a + 65. Let k be 0 - -1 - (9 - (-6 + 8)). Put i, -1, k in decreasing order. i, -1, k Let r = 102.39 - 101.89. Sort 2, r, -114.1 in increasing order. -114.1, r, 2 Let o be 8/(-18) + 15/810024. Let z = -0.02 + -17.98. Put z, -4, o in decreasing order. o, -4, z Let m(w) = 24w - 222. Let c(t) = 4t - 37. Let z(n) = -34c(n) + 6m(n). Let f be z(10). Let q = -0.44 + 0.04. Put f, 0, q in descending order. f, 0, q Let i be (3/(-7 - 2))/((-72)/(-864)). Put 15, 19, i in ascending order. i, 15, 19 Let c = 5.6 + -9. Let p = c - -3.9. Suppose -8m = -11m + 15. Sort 0, m, 0.07, p in ascending order. 0, 0.07, p, m Suppose 4b = -3r + 3, 74 - 83 = -2b - 3r. Put b, 0.1, 1/8, 2, 1/3 in decreasing order. 2, 1/3, 1/8, 0.1, b Let m = 0.1062 + 0.1838. Let r = -6 -	{ "pile_set_name": "DM Mathematics" }
hich is smaller: h or g? g Let o be 5/(-8) - -36/144. Which is smaller: 2/453 or o? o Suppose 3x - 4i = -0i + 29, 3x + i - 4 = 0. Suppose -n - x = -4v + 2n, -n - 1 = -v. Which is bigger: 2/3 or v? 2/3 Let n be 13/93. Let w be (-8)/(-37)n/12. Which is smaller: 1 or w? w Suppose -4p + 8 = 2k, -4p = k - 4 - 4. Suppose -3c + 10q - 5q - 34 = 0, -2q = c - 7. Let m be (1/c)/(p/(-30)). Is m smaller than 5? False Let r(x) = -3 + 3x*2 - 4x + 0x - 2x*2. Let n be r(5). Let u be n/(-4) - 6/(-8). Is u bigger than -3? True Let i be -22/6 + 17. Let a be -1 + (1/((-24)/(-428)) - 4). Let d = i - a. Which is smaller: -2 or d? -2 Let n = 22.6 - 22.473. Let x = n + 0.003. Which is smaller: 4 or x? x Suppose 5w = 3k - 215, -211 = -0k - 3k + w. Let s = -73 + k. Is s greater than -3? False Let y be (-210)/2625 + 2/25. Is 1/49 less than or equal to y? False Let m = -10 + 2. Let r be m/78(-1)/(-2). Let u be 3 - (3 + 4/(-4)). Which is bigger: u or r? u Let g = -316/3 + 4102/39. Let t = -2 - -1.9. Which is bigger: g or t? t Let o be ((-652)/44 + -2 + 2)/20. Let y = 1014 + -111539/110. Let g = y - o. Which is smaller: 1 or g? g Let z be ((-8)/(-6))/((-2)/180). Let d = z - -66. Do d and -53 have the same value? False Let n(g) = -g2 + 8g + 100. Let t be n(-7). Which is bigger: -7 or t? t Let j(c) = -c*2 + 3c + 3. Let l be j(4). Let t be 4/860/65. Is l greater than or equal to t? False Let c = -2 + 1. Let r = 7258 - 7257. Which is smaller: c or r? c Let j = 377 + -377. Is j != -286? True Let b(i) = -7i*2 + 19i + 5. Let v be b(3). Which is smaller: v or 1/298? v Let x be (140/(-34) + (-19 - -23))26. Is x > -4? True Let w(v) = v2 + 6v + 4. Let f be w(-5). Suppose -2u = 3u - 20. Suppose -un - 1 = 5q + 3, -2q + 5n + 5 = 0. Which is bigger: f or q? q Suppose l - 6l = 3t + 92, -5t = -3l + 176. Which is greater: -33 or t? -33 Let d = 2287/7 - 324. Which is smaller: -0.2 or d? -0.2 Suppose -158g = -159g. Which is smaller: g or -108? -108 Let i = 28 - 77. Which is smaller: -50 or i? -50 Let f(l) = -2l3 + 2l*2 - 2l + 2. Let r be f(4). Let i be ((-2)/r)/((-5)/15). Which is smaller: 1 or i? i Let z = -84 - -25. Is 1 less than z? False Let t be -257/38 - (-187)/(-1). Is -0.3 smaller than t? False Suppose -10y - 5r = -5y - 3180, -5r = 3y - 1912. Let u = y - 89392/141. Do 0 and u have different values? True Let l be -4 - (-1)/((-3)/(-18)). Suppose 0 = 3b + 5k - lk - 27, 3k = 0. Let g = 23 - 14. Do b and g have different values? False Let d = -56 + 30. Let j = 203 - 221. Let p = d - j. Is 2 greater than p? True Suppose 2f - 5b - 5 = 0, 7f - 2f = 2b + 2. Which is smaller: f or 2/9? f Suppose -2p + 14 = u + 3p, -5u + 3p + 14 = 0. Let i be (u + -5)/((-2)/(-24)). Let l = i + 11. Which is smaller: 2/9 or l? l Let y = 1674 + -1117. Which is smaller: 556 or y? 556 Let z(g) = g3 + 5g*2 - 52g - 76. Let o be z(-9). Which is bigger: 66 or o? o Let w be 2(-164)/(-14) + 6/(-14). Let y be (14/(-4) + 3)/(w/10). Is 1 greater than or equal to y? True Suppose 7w - 26 = 3k + 2w, 0 = -2w + 8. Let h = -1 - -4. Let v = h + k. Which is greater: v or -1? v Let i = -25 + 52. Let v = 25.92 - i. Let c = v + 1.1. Which is smaller: c or 1? c Let z be 44(-5)/(-80). Let v be (3/z)/(-3) - 20. Is v greater than -21? False Let y = -0.004 + 0.214. Let b = 0.2 - y. Let m = b - 2.99. Is m at most 0.3? True Let g be (12/(-99))/(2/(-3)). Let p = -13.1 - -11.84. Let j = -0.26 - p. Is g less than j? True Let j = 0.8 - -0.8. Let q = j - 1.88. Let s = 0.02 - q. Are 1 and s non-equal? True Let j = -55 - -13. Let o = j + 43. Do -3/19 and o have the same value? False Let g(f) be the second derivative of -f5/20 + f4/4 + 5f*3/6 - 5f*2/2 + f. Let p be g(4). Let k be (2/(-8))/(39/(-52)). Which is bigger: p or k? k Let z(k) = 17k + 173. Let v be z(31). Which is greater: v or 701? 701 Let p(m) = -m*2 - 10m - 1. Let q be p(-8). Let d = q - 10. Which is smaller: d or 4? 4 Suppose 3b = -5z + 21, 4z - 3b = -4b + 14. Suppose -5c - 5i - 5 = 0, -zc + 2i - 43 = -3i. Let r be (4/c)/(24/(-252)). Is r less than 7? False Let y = 2.5 + -2.7. Let c = -0.325 - -0.165. Which is greater: y or c? c Suppose 0 = 2o - z + 25, 12 + 2 = -o + z. Suppose -2i - 3u - 3 = 2u, 0 = -3i - 3u - 18. Which is smaller: o or i? o Let o = 781.1 + -781. Which is smaller: 470 or o? o Suppose -2h - 345 + 43 = 0. Which is greater: h or -303/2? h Let c(k) = 5k + 9. Suppose -5 = -4f + 11. Suppose -q - j - 2 = 0, fq + 11 + 0 = -j. Let n be c(q). Is n at most -1? True Let w = 3.571 - 1.571. Which is bigger: w or 110? 110 Suppose 0 = 13i - 18i - 5355. Let y be (-1)/(-2)i/18. Let w = 30 + y. Is w >= -0.3? True Let s be ((-2)/(-14))/(-5 + 4 - 2). Is s at least as big as -1? True Let n be 28/11935(-2)/(-4)-5. Which is greater: n or 0? 0 Let q be 10/4 + (-1)/(-2). Let w(z) be the first derivative of z2 - 3z - 6. Let y be w(q). Which is smaller: y or 0? 0 Let h = 19.955 + -18.9. Let n = -0.055 + h. Which is greater: -5 or n? n Suppose 20f - 114f - 1316 = 0. Is f smaller than 15? True Let i = 4/1121 + 814/3363. Is 1 less than i? False Let i be 2862/(-4)-1. Is i at least 144? False Suppose 7 = 4s + 3. Let y = 4447 + -4484. Is s not equal to y? True Suppose -p = -2p + 20. Suppose 2j = 5o + 12, -2o - p - 10 = -5j. Let v be (-1)/5 + j/30. Is 4/3 not equal to v? True Let n be 54/112 - 1/(-7). Suppose -t + 16 = -5t, -3p + 3t = -12. Let r = 2 - p. Which is smaller: r or n? n Suppose -10d - 3d - 3822 = 0. Let c = d + 4412/15. Which is smaller: -6 or c? -6 Let k be 4/(-6)(-2)/((-396)/(-27)). Which is smaller: k or -1? -1 Let h(a) = 10a2 + a - 4. Let v(z) = -21z*2 - z + 9. Let f(n) = 5h(n) + 2v(n). Let l be f(1). Is l < 6? False Let h = -3.2 - 0.8. Let r be 1372/(-120) + 2/4. Let b = r + 34/3. Do h and b have the same value? False Let a be -16(-1)/2 - 2. Let c = a - 5. Let d be 207/(-552)(1 + (-5)/9). Is c greater than d? True Let o = -814 - -363. Which is smaller: -452 or o? -452 Let p(m) = 4m + 33. Let q(l) = 2l + 4. Let s be q(-7). Let c be p(s). Suppose -5g - 18 = -2g. Which is smaller: g or c? c Let q = 2706 - 5605/2. Let w = 1265 - 4087/3. Let d = q - w. Which is smaller: 0 or d? 0 Suppose 40 = -12j + 8j. Let n = 0 + j. Is -10 smaller than n? False Suppose 0 = 4r - 5 + 1, -r = 5p - 271. Suppose -63c = -pc - 36. Which is smaller: 3/7 or c? 3/7 Suppose 0 = 3i - 9 - 0. Suppose 97 = 5h + 3n, -3n + 4n = 4. Suppose -19v + 4 = -hv. Is i <= v? False Let n(v) = v*3 - 3v*2 - 6. Let b be n(3). Let p be b/9(0 - 1). Is p at least as big as -1.8? True Suppose -165 = -5n + 4u, 4n - 3u - 72 = 59. Let h = n + -57. Let z be 4/14 - 76/h. Is 3 bigger than z? False Suppose 3i = 8i + 55. Let o = 46 + -59. Is i >= o? True Let c(f) = -2f + 2. Let k be c(1). Suppose -9 = -3p - kp. Suppose 3o - 5 = 1. Which is smaller: p or o? o Let u = -2505265 + 52621186/21. Let d = u - 506. Which is smaller: -1 or d? -1 Let u be 2 + -6 + 2 + 2. Suppose -2 = -2f - u. Which is smaller: -1 or f? -1 Let p = -17 - -43. Let t be p/(-4) + 3/6. Suppose 3v - j = -2v - 20, v - 5j = 20. Is t > v? False Let x be 0/(-1 - 0) - -33. Let o = 39 - x. Which is smaller: -1 or o? -1 Let k = 109.05 + -109. Which is greater: k or 61? 61 Let h(c) = 2c - 14. Let x be h(7). Suppose x = 5g - 5p + 20, 5p + 46 - 18 = -3g. Do -3 and g have the same value? False Let w = 0.293 + 45.707. Which is smaller: -0.05 or w? -0.05 Let b(f) = f2 - 14f - 15. Let m be b(14). Let t be -3 + (-6)/m + 1161/60. Is 18 at most as big as t? False Let o = 24 + -15. Let q be (-4)/(12/o) - (9 + -16). Suppose -5u + 3z = -11, 14 = -0u + 4u - 5z. Which is greater: u or q? q Suppose 21 = -3i + 10i. Suppose 3t - 5b = -10, -2 - 4 = 5t - ib. Are 19 and t non-equal? True Let b = -471.2 - -473. Is 4/9 >= b? False Let i = 25 + 4. Is i > 28? True Let l be ((-1)/(-4))/(5/(-4)). Let g = 5 - -13. Let y be (-4)/g((-30)/(-4))/5. Is l greater than or equal to y? True Let k = 42 - 28. Let o be 43*(1/(-2) - 7/k). Is -43 != o? False Let f = -0.032 + 6.782. Let l = f + 7.17. Let a = -14 + l. Is a less than or equal to 0.1? True Let s = -1765.9 + 1766. Is s <= -4? False Let p be (2/(-4))/((-8)/(-16)	{ "pile_set_name": "DM Mathematics" }
/4) assuming x is positive. x(-6) Simplify (y(-1/2)y)47/((y(-1/6)y)/(y/((yy/(((yyy(-1/5)yyy)/y)/y))/y))) assuming y is positive. y(382/15) Simplify m(2/13)mm*(-3)m/(m*(-1/8)/m)m(-5/3) assuming m is positive. m(-433/312) Simplify u*6uu(1/4)(u*(1/5)u)/((u/(uuuu1uuu))/u) assuming u is positive. u(309/20) Simplify ((w(5/4)w)/w)47 assuming w is positive. w(235/4) Simplify (c(11/4))(2/63) assuming c is positive. c(11/126) Simplify (p/(p(-4/7)p))(1/3) assuming p is positive. p(4/21) Simplify (z(-5/4))38 assuming z is positive. z(-95/2) Simplify y(-2/13)y(-3)y/y*(-3/8)y(-1/7) assuming y is positive. y(-1399/728) Simplify qqqqqq/q5q/q*(-10)q assuming q is positive. q13 Simplify k(2/13)((k/(kk*(2/7)/k))/k)/k(((k/(k(kkkk*(-1)/kk)/k))/kk)/k)39 assuming k is positive. k(-7201/91) Simplify ((a(-2/7)/a)(-11/8))(-2/9) assuming a is positive. a(-11/28) Simplify ((x(-1/3)/x)/x)(-15/7)(x/(xx(-1/3)))/x(-1) assuming x is positive. x(19/3) Simplify a12/(a(-1/5)a) assuming a is positive. a*(56/5) Simplify (x/(xx/(xx(-1/3))x))(1/69) assuming x is positive. x(-4/207) Simplify (k*6kk/(kk(2/21)))31 assuming k is positive. k(4495/21) Simplify ((y(1/4))50)44 assuming y is positive. y550 Simplify ((m/m1)3)(-9) assuming m is positive. 1 Simplify (v/(((v(-1)/v)/v)/v))(24/13)((vv(-1/6))/v)/v(-2/11) assuming v is positive. v*(7933/858) Simplify (ww*(-3)/www(1/2))/(ww/(w/((w((w(2/7)w)/w)/ww)/w)w)ww)(-6/7) assuming w is positive. w(45/98) Simplify q*(-7)q/q*28q assuming q is positive. q*(-33) Simplify (ff*(-9/4)f)/(ff(f*(-6)f)/f) assuming f is positive. f(15/4) Simplify (((l4l)/l)/(l(ll(-2/9))/l))(-13) assuming l is positive. l(-377/9) Simplify (g0/g1)/((gg/((gg(1/4)/g)/g))/(g(-3)g)) assuming g is positive. g(-23/4) Simplify (a(1/2))*(2/15)(aa(a/(a/(a*1a))a)/a)(-4/13) assuming a is positive. a(-227/195) Simplify ((p4p)(23/4))(1/24) assuming p is positive. p(115/96) Simplify n(1/2)nnn/(nn/(n/(nn(-2/5))))nnnn/n(1/4)nn5n assuming n is positive. n(253/20) Simplify (m(1/2)/m(3/2))(-2/49) assuming m is positive. m*(2/49) Simplify (b/((bb*1b)/b))(-23)/(b/b(-2/5)b)48 assuming b is positive. b(-461/5) Simplify (ww*(-4)w)(-23) assuming w is positive. w46 Simplify (hhh(hh*(6/5))/hhh)/(h/h(4/5))(hhh(-1))(-9) assuming h is positive. h(-3) Simplify (m/(m(8/11)m))(-7/9) assuming m is positive. m(56/99) Simplify s(-1/29)/(ss/(s((s/(s/((s/s5s)/s)s))/s)/s)s) assuming s is positive. s(-262/29) Simplify (i(-3/2))(-25) assuming i is positive. i(75/2) Simplify ((q*(-1/4)q)(-32))41 assuming q is positive. q(-984) Simplify b/(b/(b(-7)/b))b/((b/b(5/6))/b) assuming b is positive. b(-37/6) Simplify h(-22)/h((hhh*(-26)hh)/h)/h assuming h is positive. h(-47) Simplify (t(1/4)t)(-11/2)/(t/t(-2/13)t/(t/t(2/15))) assuming t is positive. t(-12733/1560) Simplify (((gg(-4))/g)/g)/(g/g3)g/(((g/(ggg(2/3)))/g)/g)g(1/8) assuming g is positive. g(43/24) Simplify i*6i(-16) assuming i is positive. i(-10) Simplify (gg/((g0g)/g)((g1gg)/g)/g)/(g(-2/11)/gg*7g) assuming g is positive. g(-42/11) Simplify t(-1/7)/t*(-4)((t*1t)/tt)/t(-7) assuming t is positive. t(90/7) Simplify (z(-5)z/z*(2/5))/(z/(z/(zz*(-2/3)z))zz)(13/3) assuming z is positive. z(-848/45) Simplify (g*35gg)/((g/(gg*(-3/22)g))/ggggg) assuming g is positive. g(767/22) Simplify ((h(-1/4))49)(9/7) assuming h is positive. h*(-63/4) Simplify f/(ff*(7/5)f)fff(2/7) assuming f is positive. f(-4/35) Simplify o(1/7)oo(1/4)(oo(-1)oo)(2/57) assuming o is positive. o(2335/1596) Simplify (s(-5)/(s/(ss*(-3)s)))/(s/s(-1/2))(4/7) assuming s is positive. s*(-55/7) Simplify bb*(6/5)bb(-20)b assuming b is positive. b(-79/5) Simplify (v(2/7))*(-40)/((v/(vv(4/3)/v))/v(2/3)) assuming v is positive. v*(-73/7) Simplify (cc7)/(c/c(-1/3))c(4/3)c(-3) assuming c is positive. c5 Simplify (ggg/(gg(3/7)))/(g/(g/((gg10)/g))) assuming g is positive. g(-59/7) Simplify (j/((j/j*(-8)j)/j))40 assuming j is positive. j(-320) Simplify (s(s(-2/5)s)/ss)34s/s*(-2/25)s/(s/(s/s*(-5/2)))ss assuming s is positive. s(3049/50) Simplify d4/(d(d/(d/(d/(d*(-4/9)/d)))d)/d)d(-7/3)d/(d*(-1)d) assuming d is positive. d*(-7/9) Simplify ((y(yy/((yy0)/y))/y)(2/59))(-6/31) assuming y is positive. y(-24/1829) Simplify f(-2/3)/(f/(f/(f/f(4/7))))f(-7)/((f/(f(-7)/f))/f) assuming f is positive. f(-338/21) Simplify (q/(qqq/(qq*(6/5))qq))/q(-1/17)(q*(1/5)q)(-2/29) assuming q is positive. q(-4496/2465) Simplify (h(1/4)/(h7h))/(h(-1/6)/(hh*0/hh)) assuming h is positive. h(-79/12) Simplify p(2/45)/(pp(-21)p) assuming p is positive. p(857/45) Simplify (((x(3/7)x)/xx)/(x(-2/9)/x))/((x(-3/5)/x)/x(-3)) assuming x is positive. x(394/315) Simplify (c0)28 assuming c is positive. 1 Simplify (g(9/5))16 assuming g is positive. g*(144/5) Simplify (ww/(w*(1/17)w))/(w/(w(-7/4)/w)) assuming w is positive. w(-191/68) Simplify kk/k(2/11)kk(-18) assuming k is positive. k(-167/11) Simplify ((q2q)/q)*(1/36)(q*5q)/q(-8) assuming q is positive. q(253/18) Simplify (m*41/mm)/mmm(-45) assuming m is positive. m(-4) Simplify (((((ddd/d*1dd)/dd)/d)/ddd)/d5)/(d(-2)/(d/(dd0d))) assuming d is positive. 1 Simplify (z(-4)/z(-2))/(zz(-2/7))(27/7) assuming z is positive. z(-233/49) Simplify (y4/(y(-4)y))(-12/13) assuming y is positive. y(-84/13) Simplify (p/(((p/(p(1/2)/p))/p)/p))(-2)p(-6)p/(pp4) assuming p is positive. p(-13) Simplify (l(-1))(2/77)(ll(1/15))/(l/(l(2/7)/l)) assuming l is positive. l(-778/1155) Simplify (u(2/5)uu)/(uuu(2/23)) assuming u is positive. u(36/115) Simplify ((w(-1)/w)(1/34))(6/25) assuming w is positive. w(-6/425) Simplify ((r/r(-8/5))/r)/r28 assuming r is positive. r(-132/5) Simplify ((uu/(u*(-3/2)uu))/u(3/7))/(u/u(-3)uu/(u(-1/5)u)) assuming u is positive. u(-289/70) Simplify (x(-2))*(1/23)x/((xx(-2/13))/x)xx(1/4)/x assuming x is positive. x(1575/1196) Simplify ((ff*(-2/9)f)/f)/f24 assuming f is positive. f(-209/9) Simplify (w*6ww/(w/((w9/w)/w)))(2/47) assuming w is positive. w(28/47) Simplify (b/b1)8/(b(1/12)(b(b(-5)/b)/bbb)/b) assuming b is positive. b(59/12) Simplify (p2)27 assuming p is positive. p54 Simplify (i/i(-3/7))(-34/5) assuming i is positive. i(-68/7) Simplify (iii(i/(i*(-18)i))/i)/iiiii*(-1/36)i assuming i is positive. i(827/36) Simplify p(-5/9)/(pp1) assuming p is positive. p(-23/9) Simplify z(-6)/(z/z(-21)) assuming z is positive. z(-28) Simplify (mm/((m*(1/2)m)/mmm))*(-7/2)/((m/(mmmm*1m))/(m*(-3/2)m)) assuming m is positive. m(21/4) Simplify (q6)(-2/9) assuming q is positive. q(-4/3) Simplify k*(-2/9)kk1/kk(k/k(-2/13))/(k/(k/((k/(k/k(-3/7)k))/kkk))) assuming k is positive. k*(2752/819) Simplify (r/(rr*(-1)r))(1/6)/(((r/(r3/r))/r)/(r*(-2/3)r)) assuming r is positive. r*(7/3) Simplify (r/(r/((rr*(3/4)r)/r)r))/r(-1/11)r*(-2/3)r*0/rr assuming r is positive. r(23/132) Simplify t(1/16)/((tt2/t)/t) assuming t is positive. t(-15/16) Simplify (c(c/((c/(ccc*(-2/7)c))/c))/c)/(c/c*(-3))(c/(c/((c*(-4)c)/c)))/c3 assuming c is positive. c(-51/7) Simplify a*(-3/5)a*(-5)a*5aa(-1/3) assuming a is positive. a(1/15) Simplify ((f1f)39)(-2/11) assuming f is positive. f(-156/11) Simplify (w/w(1/32)w)/(ww40) assuming w is positive. w(-1249/32) Simplify l*(-3)l/l*(1/6)(ll(-1/2))19 assuming l is positive. l(22/3) Simplify tt/((t*(1/5)t)/t)tttt(t/t(-2/9))/tt*2tt(1/3) assuming t is positive. t(421/45) Simplify (f(2/5)/fff(f*(2/3)f)/f)/(f*1f	{ "pile_set_name": "DM Mathematics" }
{f: 5, c: 9}. What is prob of picking 2 c? 36/91 Calculate prob of picking 2 d and 2 k when four letters picked without replacement from {n: 6, o: 1, k: 3, d: 3, g: 2}. 3/455 Four letters picked without replacement from {f: 1, t: 4, p: 1, y: 1, u: 4}. Give prob of picking 1 y, 1 t, and 2 u. 4/55 Four letters picked without replacement from {e: 2, p: 16}. What is prob of picking 2 p and 2 e? 2/51 Calculate prob of picking 1 l and 1 f when two letters picked without replacement from fffflfffffff. 1/6 Calculate prob of picking 1 n and 1 q when two letters picked without replacement from pnnhqhqhhhhnphhhq. 9/136 Four letters picked without replacement from szzgghhzsszzzghshzz. Give prob of picking 2 g, 1 h, and 1 s. 4/323 What is prob of picking 1 y and 2 i when three letters picked without replacement from {i: 10, b: 1, p: 3, r: 3, y: 3}? 9/76 Two letters picked without replacement from ggi. Give prob of picking 2 g. 1/3 Three letters picked without replacement from {x: 8, f: 8, u: 4}. Give prob of picking 3 x. 14/285 Three letters picked without replacement from {q: 2, n: 2, t: 7, w: 4, r: 5}. Give prob of picking 1 q and 2 w. 1/95 Three letters picked without replacement from kukkutkt. Give prob of picking 2 u and 1 t. 1/28 Three letters picked without replacement from oooo. Give prob of picking 3 o. 1 Two letters picked without replacement from {p: 4, k: 2, o: 3, d: 1}. What is prob of picking 1 k and 1 o? 2/15 Four letters picked without replacement from hszshj. Give prob of picking 2 j and 2 h. 0 Calculate prob of picking 2 a and 1 d when three letters picked without replacement from {m: 1, d: 1, p: 2, l: 2, a: 2, t: 1}. 1/84 Four letters picked without replacement from ngddngpgggnpcjnjgnj. What is prob of picking 1 c, 1 d, and 2 j? 1/646 Calculate prob of picking 3 c when three letters picked without replacement from {v: 8, f: 5, c: 5}. 5/408 What is prob of picking 2 l and 1 f when three letters picked without replacement from {l: 2, f: 4}? 1/5 Calculate prob of picking 2 o when two letters picked without replacement from ovvovvvvvvvv. 1/66 What is prob of picking 1 m and 1 g when two letters picked without replacement from gejmjgmmeem? 8/55 Calculate prob of picking 1 m, 1 s, and 1 d when three letters picked without replacement from {v: 4, w: 2, m: 1, d: 1, q: 3, s: 1}. 1/220 Three letters picked without replacement from {p: 6}. Give prob of picking 3 p. 1 What is prob of picking 1 c and 3 p when four letters picked without replacement from {p: 2, c: 7}? 0 Two letters picked without replacement from {h: 4, n: 6}. Give prob of picking 2 h. 2/15 Calculate prob of picking 1 i and 3 z when four letters picked without replacement from zzzizizzzzzziiiz. 165/364 What is prob of picking 2 r when two letters picked without replacement from {r: 10, l: 2}? 15/22 What is prob of picking 1 f and 2 m when three letters picked without replacement from qmfymymyyfyf? 9/220 What is prob of picking 4 s when four letters picked without replacement from sssxxxs? 1/35 What is prob of picking 4 g when four letters picked without replacement from {g: 13, n: 6}? 715/3876 Calculate prob of picking 1 i and 1 z when two letters picked without replacement from {o: 1, z: 3, i: 1}. 3/10 Four letters picked without replacement from {b: 2, j: 7, a: 1}. What is prob of picking 1 b, 1 a, and 2 j? 1/5 What is prob of picking 2 i and 1 l when three letters picked without replacement from illliile? 3/14 What is prob of picking 2 o and 2 x when four letters picked without replacement from {x: 3, o: 2}? 3/5 What is prob of picking 3 q and 1 r when four letters picked without replacement from {r: 3, q: 15}? 91/204 What is prob of picking 1 i, 1 h, and 1 n when three letters picked without replacement from hlhlhlhnlilihilihh? 7/204 Calculate prob of picking 2 c and 1 s when three letters picked without replacement from {c: 16, s: 3, u: 1}. 6/19 What is prob of picking 1 m and 1 f when two letters picked without replacement from fgggmfj? 2/21 Calculate prob of picking 2 u and 1 n when three letters picked without replacement from hhujnjjujjhjhnm. 2/455 Two letters picked without replacement from {t: 3, u: 1, g: 2, i: 1, x: 1, e: 3}. What is prob of picking 1 g and 1 i? 2/55 Two letters picked without replacement from {c: 6, g: 7, x: 4}. Give prob of picking 2 g. 21/136 What is prob of picking 2 s when two letters picked without replacement from {s: 5, g: 1, f: 4}? 2/9 What is prob of picking 1 w and 2 b when three letters picked without replacement from {w: 1, b: 5, p: 4, j: 3}? 5/143 Calculate prob of picking 1 e and 1 u when two letters picked without replacement from {u: 1, e: 1, g: 1, q: 1, o: 1}. 1/10 Calculate prob of picking 2 u when two letters picked without replacement from {u: 2, a: 1, f: 1, m: 2}. 1/15 Two letters picked without replacement from boxoobbxxlxmxmoxo. Give prob of picking 1 b and 1 o. 15/136 Calculate prob of picking 1 d and 1 t when two letters picked without replacement from {s: 4, l: 2, n: 1, t: 1, d: 2}. 2/45 Two letters picked without replacement from {v: 2, q: 5}. Give prob of picking 2 v. 1/21 Four letters picked without replacement from {x: 2, p: 1, a: 5, c: 1, w: 1}. Give prob of picking 1 w, 2 x, and 1 p. 1/210 Two letters picked without replacement from qjjfo. What is prob of picking 2 j? 1/10 What is prob of picking 1 v and 1 m when two letters picked without replacement from {b: 3, o: 9, m: 1, n: 4, v: 1}? 1/153 What is prob of picking 1 h and 2 e when three letters picked without replacement from {m: 3, h: 7, e: 2, g: 1, c: 1}? 1/52 Calculate prob of picking 1 o, 1 g, and 2 a when four letters picked without replacement from {a: 3, o: 2, s: 1, g: 1}. 6/35 What is prob of picking 1 p and 3 l when four letters picked without replacement from {m: 3, p: 2, l: 5}? 2/21 What is prob of picking 2 o when two letters picked without replacement from bbboyboyboyoyb? 6/91 Two letters picked without replacement from {x: 12, h: 7, o: 1}. Give prob of picking 1 o and 1 h. 7/190 Three letters picked without replacement from {l: 3, m: 3, g: 5, f: 2}. Give prob of picking 2 l and 1 g. 15/286 Two letters picked without replacement from {g: 2, p: 1, s: 3, z: 1, i: 5}. Give prob of picking 1 z and 1 g. 1/33 Calculate prob of picking 1 e and 1 v when two letters picked without replacement from {j: 1, t: 2, m: 1, e: 1, v: 2}. 2/21 Three letters picked without replacement from igillbilbv. Give prob of picking 1 b, 1 l, and 1 g. 1/20 Three letters picked without replacement from {h: 2, l: 2, d: 4}. Give prob of picking 2 d and 1 l. 3/14 Four letters picked without replacement from qqqqiiiiiqiiiqqiqq. Give prob of picking 2 i and 2 q. 36/85 What is prob of picking 1 r and 1 t when two letters picked without replacement from nwntnrrwnnnnrw? 3/91 Four letters picked without replacement from {v: 2, s: 1, u: 2, n: 3, z: 2, o: 2}. What is prob of picking 2 n, 1 z, and 1 o? 4/165 Calculate prob of picking 1 g and 2 y when three letters picked without replacement from {y: 16, g: 2}. 5/17 Calculate prob of picking 1 i, 1 v, and 2 b when four letters picked without replacement from {i: 3, b: 3, r: 5, v: 1}. 1/55 Four letters picked without replacement from {s: 3, b: 5, l: 2}. What is prob of picking 2 l, 1 b, and 1 s? 1/14 Three letters picked without replacement from {p: 1, t: 2, f: 1, h: 1, e: 1, k: 1}. What is prob of picking 1 p and 2 t? 1/35 Two letters picked without replacement from {a: 1, o: 1, s: 1, w: 2}. What is prob of picking 1 w and 1 o? 1/5 Calculate prob of picking 3 r when three letters picked without replacement from cpfpferfrrrrrc. 5/91 Four letters picked without replacement from {i: 2, v: 6, x: 1, o: 5, g: 1}. Give prob of picking 2 i, 1 x, and 1 g. 1/1365 Calculate prob of picking 2 x when two letters picked without replacement from dcdcdxcxdrdurrw. 1/105 Four letters picked without replacement from iosqosrssssq. Give prob of picking 2 q and 2 o. 1/495 Two letters picked without replacement from {g: 3, v: 1, f: 1, y: 3, b: 9, k: 2}. Give prob of picking 2 y. 1/57 Two letters picked without replacement from uukukuauiuuuuauauuu. Give prob of picking 1 a and 1 u. 13/57 Calculate prob of picking 3 d when three letters picked without replacement from {d	{ "pile_set_name": "DM Mathematics" }
common divisor of 610 and 80. 10 Calculate the highest common factor of 288 and 324. 36 What is the greatest common factor of 14 and 8? 2 Calculate the highest common factor of 19 and 95. 19 What is the highest common factor of 15946 and 1428? 238 Calculate the greatest common divisor of 10858 and 178. 178 What is the highest common factor of 120 and 36? 12 Calculate the greatest common factor of 8 and 88. 8 Calculate the greatest common factor of 73 and 1241. 73 What is the greatest common divisor of 4 and 52? 4 What is the greatest common factor of 2096 and 1441? 131 What is the highest common factor of 372 and 324? 12 What is the greatest common factor of 20 and 27830? 10 Calculate the greatest common factor of 377 and 39. 13 Calculate the greatest common factor of 60 and 165. 15 What is the highest common divisor of 25 and 525? 25 What is the highest common divisor of 384 and 9? 3 Calculate the greatest common factor of 99 and 110. 11 What is the greatest common factor of 105 and 6? 3 Calculate the highest common divisor of 84 and 196. 28 Calculate the highest common divisor of 16 and 41. 1 What is the highest common divisor of 102 and 906? 6 Calculate the highest common factor of 86 and 7654. 86 What is the greatest common divisor of 369 and 451? 41 Calculate the highest common divisor of 8 and 82. 2 What is the greatest common factor of 32 and 28? 4 What is the highest common divisor of 89 and 4183? 89 Calculate the greatest common divisor of 5405 and 940. 235 What is the highest common factor of 4891 and 201? 67 What is the greatest common divisor of 1352 and 104? 104 Calculate the highest common divisor of 651 and 1116. 93 Calculate the highest common divisor of 6 and 285. 3 Calculate the highest common factor of 169 and 1937. 13 Calculate the highest common divisor of 39 and 130. 13 Calculate the highest common factor of 12327 and 21. 21 What is the highest common divisor of 468 and 18? 18 What is the greatest common divisor of 451 and 44? 11 Calculate the highest common divisor of 13430 and 20. 10 Calculate the greatest common divisor of 284 and 8. 4 Calculate the greatest common factor of 86 and 688. 86 What is the greatest common factor of 43 and 387? 43 What is the greatest common divisor of 85 and 15? 5 Calculate the greatest common factor of 49 and 399. 7 Calculate the highest common factor of 106 and 583. 53 What is the greatest common divisor of 684 and 36? 36 What is the highest common factor of 672 and 14? 14 What is the highest common factor of 135 and 1935? 45 What is the greatest common factor of 40 and 30? 10 Calculate the highest common factor of 240 and 285. 15 Calculate the greatest common divisor of 45 and 285. 15 Calculate the highest common divisor of 912 and 570. 114 Calculate the greatest common divisor of 3 and 921. 3 What is the greatest common divisor of 126 and 6489? 63 What is the highest common divisor of 220 and 132? 44 Calculate the greatest common factor of 840 and 645. 15 What is the highest common divisor of 43 and 731? 43 Calculate the greatest common divisor of 30 and 105. 15 Calculate the greatest common divisor of 87 and 3. 3 What is the highest common factor of 9450 and 15? 15 Calculate the greatest common divisor of 87 and 12963. 87 What is the highest common factor of 1056 and 363? 33 Calculate the highest common factor of 18 and 10683. 9 What is the greatest common factor of 1606 and 22? 22 What is the highest common factor of 300 and 4150? 50 Calculate the greatest common divisor of 272 and 160. 16 Calculate the highest common divisor of 5 and 2605. 5 Calculate the highest common divisor of 64 and 832. 64 What is the greatest common divisor of 47861 and 209? 209 Calculate the greatest common divisor of 40 and 30. 10 Calculate the greatest common divisor of 8 and 1330. 2 What is the greatest common divisor of 260 and 5? 5 What is the greatest common factor of 184 and 115? 23 What is the highest common factor of 153 and 119? 17 Calculate the greatest common factor of 1254 and 858. 66 What is the greatest common divisor of 540 and 8040? 60 Calculate the greatest common factor of 4 and 26. 2 Calculate the highest common factor of 20 and 43140. 20 What is the greatest common factor of 157 and 4867? 157 Calculate the greatest common divisor of 335 and 45. 5 Calculate the highest common factor of 6526 and 26. 26 Calculate the greatest common factor of 285 and 75. 15 What is the highest common factor of 18 and 18? 18 Calculate the greatest common divisor of 492 and 60. 12 What is the greatest common factor of 129 and 1333? 43 What is the greatest common factor of 320 and 2720? 160 What is the greatest common factor of 275 and 11? 11 Calculate the highest common factor of 9 and 3231. 9 Calculate the highest common divisor of 494 and 76. 38 What is the highest common factor of 760 and 7828? 76 Calculate the greatest common factor of 14 and 3325. 7 What is the highest common divisor of 95 and 15? 5 Calculate the highest common factor of 120 and 60. 60 What is the highest common factor of 30 and 600? 30 Calculate the highest common divisor of 25 and 20. 5 What is the highest common factor of 25 and 5? 5 What is the highest common factor of 6438 and 30? 6 What is the greatest common divisor of 448 and 644? 28 Calculate the greatest common divisor of 105 and 42. 21 What is the highest common divisor of 209 and 55? 11 What is the greatest common divisor of 3070 and 30? 10 What is the greatest common factor of 24 and 3972? 12 What is the highest common divisor of 55 and 5255? 5 What is the highest common divisor of 666 and 12? 6 Calculate the greatest common factor of 782 and 2278. 34 Calculate the highest common factor of 387 and 36. 9 Calculate the highest common divisor of 182 and 4. 2 What is the highest common factor of 7 and 1673? 7 What is the greatest common factor of 156 and 36? 12 What is the greatest common divisor of 8 and 216? 8 What is the greatest common factor of 164 and 79868? 164 Calculate the highest common divisor of 555 and 1517. 37 Calculate the highest common divisor of 1 and 79. 1 Calculate the highest common factor of 64 and 3136. 64 What is the greatest common factor of 1343 and 79? 79 What is the highest common factor of 240 and 528? 48 What is the highest common divisor of 72 and 1080? 72 Calculate the highest common divisor of 83 and 27. 1 What is the greatest common divisor of 25 and 395? 5 What is the highest common divisor of 20 and 30920? 20 What is the greatest common divisor of 160 and 64? 32 What is the greatest common divisor of 77 and 22? 11 Calculate the greatest common divisor of 42 and 189. 21 What is the highest common factor of 168 and 132? 12 Calculate the greatest common divisor of 374 and 33. 11 What is the highest common divisor of 17940 and 230? 230 What is the highest common divisor of 66 and 110? 22 What is the highest common factor of 153 and 21369? 51 What is the greatest common factor of 60 and 405? 15 Calculate the greatest common factor of 882 and 18. 18 Calculate the greatest common divisor of 65 and 5. 5 What is the greatest common divisor of 61 and 1403? 61 What is the greatest common divisor of 14 and 14294? 14 Calculate the greatest common divisor of 1316 and 35. 7 What is the greatest common divisor of 82 and 5494? 82 What is the highest common factor of 260 and 80? 20 What is the greatest common divisor of 308 and 440? 44 Calculate the highest common divisor of 130 and 338. 26 Calculate the highest common factor of 330 and 198. 66 Calculate the greatest common divisor of 77 and 11. 11 Calculate the greatest common divisor of 41 and 1271. 41 What is the highest common divisor of 110 and 22? 22 Calculate the highest common divisor of 30 and 19860. 30 What is the greatest common factor of 156 and 6201? 39 Calculate the greatest common factor of 2 and 136. 2 Calculate the highest common divisor of 252 and 36. 36 What is the highest common divisor of 1105 and 130? 65 Calculate the greatest common divisor of 80 and 55. 5 What is the highest common divisor of 8633 and 89? 89 What is the highest common divisor of 506 and 9361? 253 What is the greatest common divisor of 4807 and 418? 209 Calculate the highest common divisor of 180 and 6030. 90 What is	{ "pile_set_name": "DM Mathematics" }
y3 + 9y Expand (-c + 3c + 0c)(-3c*3 + 53c*3 + 15c*3)(-2c - 3c + 4c). -130c5 Expand i2 + 2i2 + 0i*2 + (-i - 2i + 2i)(-4i - 2i + 2i). 7i*2 Expand (-3 + 4 + 2l + 0)(l + 3l - 5l) + (34 - 2 - 2)(4l2 - 2l*2 + 0l*2). 58l*2 - l Expand -3k*5 - 3k*5 + 2k*3 + 4k*5 - 8k*2 + (5 - 1 - 3)(0k3 - 2k*5 + 0k*3). -4k*5 + 2k*3 - 8k*2 Expand (2m + 1 - 1 + (2 - 1 + 1)(5 - 5 + 2m))(3 - 3 + m). 6m*2 Expand (-h + 2 - 2)(-5h2 + 2h*3 + 5h*2) + 2h*4 - 2h*4 - 2h*4 + 3h*4 - 2h*4 - 38h + 34h. -3h*4 - 4h Expand 1 - 2g - 1 + (1 - 2g - 1)(4 - 2 - 4). 2g Expand (2 + 2 - 3)(-q2 - 2 + 2) + 3q*2 - 4q*2 + 6q*2. 4q*2 Expand ((3 + 2 - 4)(1 + 2s - 1) - 2s - 3s + 6s)(46s*3 + 1239 - 1239). 138s*4 Expand (0 + y + 0 + (3 + 0 - 2)(4 - 4 + 2y) - 2 + 2y - 3y + 1)(1 + 5 - 4). 4y - 2 Expand (-3 + 9 - 2)(3 - 4 - 4)(1 + 1 + 0)(-2w3 + 0w3 + w3). 40w3 Expand (0c*2 - 3c2 - c2)(2 - 2 - 2c) + c*2 + 4c2 - c3 + 0c2. 7c*3 + 5c*2 Expand 4c - c*4 - 4c + (-3c3 + c3 - c3)(-c + c - c) + c*2 + 2c4 - c2 + c*4 + 4c*2 - 4c*2 + (-4c*3 + 0c*3 + 2c*3)(0c - c - c). 9c*4 Expand 3 - 3 - i + (-2 + 5 - 4)(-2i - 2i + 2i) + 3i - 3i - 2i - i + 1 - 1. -2i Expand (5n - 3n - 4n)(-n + 4n - n) - 9n2 - 582n + 582n + 4n*2 - 3n*2 - 2n*2 + (2n2 + n2 - 5n2)(-6 + 4 + 4). -18n2 Expand -14g*2 + 26g*2 - 8g*2 + (4g - 1 - 2g + 3)(0g + 0g + 2g). 8g*2 + 4g Expand (-3i + i + 1 + 1)(5i4 - 5i*4 - 3i*4). 6i*5 - 6i*4 Expand (j - 3j2 + j2 + 0j)(29 - 5j - 29). 10j*3 - 5j2 Expand a4 + 4a4 - 3a*4 + (2a*4 + 0 + 0)(-4 + 7 - 4) + 2a3 - 2a*3 - 2a*4 + 29a*3 - 29a*3 - 4a*4. -6a*4 Expand (-3 - 4 - 2)(6q4 - 3q4 - q4). -18q4 Expand (0 + 2 - 4)(-2 - 1 + 4)(3g - 4g + 0g)(-g2 - g3 + g2). -2g*4 Expand (4 - 5 - 2)(0 - 3 + 2)(-3 - 2 + 3)(-5p2 + 4p*2 + 5p*2). -24p*2 Expand (2 - 2r*4 - 2)(2 - 6 + 2) + (-12r2 + 2r*3 + 12r*2)(-2 + r + 2) + 0r4 + 0r4 + r4. 7r4 Expand (0r*2 + 3r2 - r2)(-2r - r + 2r). -2r*3 Expand (-40m + 21m + 14 + 21m)(2m + m - 4m). -2m*2 - 14m Expand (6u - 3u - 2u)(u + 7u - u) + (-4 - u + 4)(u - 4u + u) - u2 + 2u*2 + 0u*2. 10u*2 Expand (3r + 2r - 6r)(0r + r - 3r)(-r - 7r + r). -14r*3 Expand 0f + 5f - 2f - 3f + 2f + 2f + 4f + 0f - 2f + (-1 + 2 + 1)(3 - 3 + 2f). 10f Expand (s5 - 3s5 - s5)(2 + 0 + 1). -9s*5 Expand (3 + 2 - 3)(-2 - 2 + 3)(1 + 2 - 2)(-x*5 - 3x*5 - 4x*5). 16x*5 Expand ((-2 - 4 + 4)(-1 + 2 - 2) + 5 + 0 - 1 + (1 - 1 - 2)(-2 + 0 + 0) + 3 + 1 - 3)(4z3 + 2z*3 - 2z*3). 44z3 Expand (o2 + 3 - 3)(-2 + 1 + 3)(-2o + 2o - o2 + (-o2 - 4o + 4o)(5 + 1 - 4)). -6o*4 Expand (0 - 1 + 0)(-1 - 8k + 1)(-2 - 2 + 5). 8k Expand 2l - 2l + 2l*2 + (12l - 8l - 6l)(-10 + 10 - 2l). 6l2 Expand (-5 + 4 - 1 + (3 - 6 + 2)(-3 + 4 + 1) + 1 - 2 + 4)(-w3 - w2 + w2). w3 Expand -i2 + 2i - 2i + (-1 + 1 + 2i*2)(-1 + 2 - 3) + (-2 - 4 + 5)(-i2 - i2 - 4i2). i2 Expand 85o3 - 85o*3 + 11o*5 + (0o - 2o3 + 0o)(-3o*2 + 2o*2 + 2o*2). 9o*5 Expand (0 - n + 0)(0 + 0 + 14) + (-3 + 1 + 1)(3n - n - n). -15n Expand (y + 4y - 3y)((-3y - 5y + 6y)(-2 + 1 - 1) + 18 - 18 + y). 10y2 Expand (-r3 + 6r*3 - 4r*3)(3 - 1 - 4)(-r - 4r*2 + 2r*2 - 2r). 4r5 + 6r*4 Expand (-c + c - c)(0c + 0c - c) + 3c2 + 2c + 0c - 5c2. -c2 + 2c Expand (-k - 3k + 2k)(0 + 1 - 3) - k + 0k + 0k + 0k + k + 5k + (1 - 2 + 0)(2k + k - 4k). 10k Expand 0j5 - j5 + 0j5 + (-j4 - j*4 + 0j*4)(-2j + j + 0j) + (-3j3 + 3j3 + j3)(6j - 6j + 11j*2). 12j*5 Expand (-3v + 10v - v)(4 - 3 + 3) + (2 - 1 + 1)(-3v + v + 4v). 28v Expand (0 - 3 + 6)(7 - 5 - 54)(-3k4 + 3k4 - k4). 156k4 Expand h - 3h + 5h + (1 + 0 - 3)(0 + 0 - h). 5h Expand 0b*2 + 2b2 - b2 + (2b - 2 + 2)(3b - 4b - b) - 5b + 2b*2 + 5b + b + 10b2 - 3b - b*2. 8b*2 - 2b Expand (m3 + m3 - m*3)(1 - 1 + 1) - 2m3 + 11m*3 - 28m*3. -18m*3 Expand 242 + 0z - 240 + 5z + (0 + 2 + 2)(0z + z + 0z). 9z + 2 Expand 3i*4 + 3i*4 - 4i*4 + 1 - 2i*4 - 1 + 4i4 - i4 - i*4 + (3i3 - i3 + 0i3)(i + 1 - 1). 4i4 Expand (3x4 - 1 + 0 + x4)(x + 4 - 4). 4x*5 - x Expand (-15w - 27w - 5w)(-5w + 3w + 0w). 94w2 Expand (2x*2 - 2 + 3x + 2)(-3 + 4 - 3)(-7 - 3 - 5). 60x2 + 90x Expand (0 + 2 - 6)(h - 5h + 3h)(h - h + 7h) + 0h*2 - 5h*2 + 4h*2. 27h*2 Expand (-2f*2 - 4f + 4f)(7f + 8f + 17f + (-2 - 2 + 3)(4 - 4 - f)). -66f3 Expand (-8t*4 + 30 - 30 - 4t + 2t4 + 4t + (-t - 3t + 2t)(-t3 - 3 + 3) + 2t*4 + 0t*2 + 0t*2)((2 - 2 - 2t)(-3 - 3 + 5) + t + 5t - 4t). -8t5 Expand (0r + 3r3 + 0r)(-4 + 1 + 4)(4 + 0 - 7). -9r3 Expand 16m*4 + 183m - 183m + (0m + 3m - 2m)(4m*2 - 4m*2 + 2m*3) + 5m4 - m4 - 2m4. 20m*4 Expand (-2w*2 + 5w - 5w)(0 + 0 - 2w2) + 100 + w3 - 100 - 3w4 - w2. w4 + w3 - w*2 Expand -1 + 1 - 7g*3 - 4g*3 + 3g*3 + 0g3 + (-g2 - g*2 + 0g*2)(0g + 2g - g). -10g3 Expand (-9v + 6v - 7v)((0 + 1 + 0)(3v + 4v - 5v) + 3v - 2v - 2v) + 4v - 4v + 2v2. -8v*2 Expand 4p*2 - 4p2 + p2 + 2p2 + p2 - 2p*2 + 2p + 4p2 - 2p + (3p + p - 3p)(-4 + 4 - p) - 3p*2 + 0p*2 + 2p*2. 4p*2 Expand (2p2 - p2 - 3p2)(154p2 + 2p*3 - 3 - 154p*2). -4p*5 + 6p2 Expand p5 + 2p2 - 2p*2 + (2p*2 + 3p*2 + 2p*2)(-2p3 + 4p*2 - 4p*2). -13p*5 Expand (0 + y + 1 + 0y + (3y - 2y - 2y)(-1 + 2 + 0) + 3y + 3y - 4y + 2y + y - y)(6y + 2 - 2). 24y2 + 6y Expand (1 - 1 - 1)(0s*2 + 3s*2 - 9s2) + 2 - 2 - s2. 5s2 Expand n2 + 1 - 1 + (-1 + 1 + 2)(-n*2 + 3n*2 + 5n*2). 15n*2 Expand 3u + 1 + u*3 - 3u + 11u3 - 3u3 - u3 + (-2u2 - 3u*2 + 3u*2)(u - 2 + 2). 6u3 + 1 Expand (-2p + 4p2 - 3p*2 + 0p*2)(-571 + 571 - 23p3). -23p*5 + 46p*4 Expand (-4 + 0 + 16)(7l - 2l - 2l + 2) - 5l + 5l + l. 37l + 24 Expand (4f - 4 + 4)(-4f2 + 3f*2 + 3f*2) + (-3 + 6 - 1)(-4f3 + 0f*3 + 6f*3). 12f*3 Expand (0r*2 + 0r*2 + 2r*2)(4r3 + r3 + 2r*3). 14r5 Expand (h2 + 3h2 - 2h*2)(h*2 - 5h + 7h + 0h). 2h4 + 4h*3 Expand 6x - 6x - 5x*4 + (-2x3 - x3 + x*3)(1 - 1 + 2x) + (2x2 + x2 - 5x2)(4x2 + x2 - 4x*2). -11x*4 Expand (0l5 + l5 + l*5)(3 - 4 + 3). 4l5 Expand (2z - 3z2 - 2z)((1 + 1 + 1)(-4 + 9z + 4 - 1) + z - 3z + z). -78z3 + 9z*2 Expand 9d*4 + 16 - 16 + 4d4 + d4 - 3d4 + (-2d*4 + 2d - 2d)(-2 + 3 + 1). 7d4 Expand (-2s - s*5 + 6s*3 + 3s - 2s3)(-1 - 2 + 0). 3s5 - 12s*3 - 3s Expand (4l2 - l2 + 5l*2)(5l + 2 - 2). 40l*3 Expand -3n*3 + 6n*2 - 6n*2 + 2n*2 - 2n*3 - 2n*2 - 2n*3 - 4n*3 + 4n*3 + (0n*2 - 3n*2 + 2n*2)(4n - 6n + n). -6n3 Expand i3 + 0i*3 - 3i*3 + (2i + 3i - 3i)(1 - 1 - 2)(8i2 + 9i*2 - 22i*2). 18i*3 Expand -q + 2q + 0q + (-7 - 1 + 0)(-2q - 9 + 9). 17q Expand (-3p + 2p - p)(8p*3 - 2p*3 - 2p*3) + (-p - p + 0p)(4p - 4p - p3) - 2p4 + p4 + 2p4 - 4p + 4p - p4. -6p4 Expand (-r3 - 4 + 0 + 3)(r2 + 5r*2 + 3r*2). -9r*5 - 9r*2 Expand 0z + 2z2 + 0z + (z + 0 + 0)(2z + z - 2z) + 0z + z + 9z + z2. 4z*2 + 10z Expand (y + 0y + y)(4y2 + y2 - 3y*2 + y) + (2 - 2 + 1)(-4y2 + 4y2 + y3) - 15y3 - 5y*3 - 11y*3. -26y*3 + 2y2 Expand (t4 - 2t4 + 3t*4)(-6t + 4t + t) - 30t5 - 224t*3 + 224t*3 + 2t3 + t5 - 2t3. -31t*5 Expand (-2a - 5a + 2a)(0 + 0 - 4a)(-2a*2 + 3 - 3). -40a*4 Expand (5 - 6 - 2)(-13r + 2r + 3r + (4r + 0r - 2r)(-1 - 2 + 1) - r + 2r + 0r). 33r Expand (2o2 + 2o - 2o)((3 - 5 + 0)(0 + 2 + 0) - 5 + 2 + 4 - 1 - 1 + 4 + 5 + 9 - 6). 14o2 Expand -j2 - j + j + (-2j + 0 + 0)((2 + 3 - 4)(3j - 3j + 2j) + 6*j - 8	{ "pile_set_name": "DM Mathematics" }
+ 2 - 2 - 2s4 in the form ds*3 + ys + u + vs4 + ks*2 and give v. -2314 Rearrange -4p*4 - 3 + 7p*4 + 12025p*3 - 11994p*3 - 3p*2 to vp*4 + tp*2 + ip*3 + jp + q and give t. -3 Express (-18 + 34 - 5)(4 - 1 - 2)((-40k - 25k + 20k)(3k3 - 2k*3 - 3k3) - k4 - k*4 + 4k*4) as b + hk*4 + vk*2 + ok*3 + lk and give h. 1012 Express -3m3 - 236m*2 + 5m*3 + 562m*2 + 3m*2 as um*2 + rm*3 + zm + d and give r. 2 Rearrange -5o2 - 292 + 2475o*3 + 291 + 6o*2 to the form c + ko*2 + do*3 + to and give k. 1 Express 891p2 - 1865p*2 + 45 + 2p + 936p2 in the form sp + fp2 + i and give i. 45 Rearrange -2307607d*3 - 2d + 2307605d3 - 2d + 12d2 to the form ud*3 + bd + r + yd2 and give r. 0 Rearrange (-9y + 2y + 0y)(5 + y - 5 + (-1 + 2y + 1)(3 - 1 + 0) - 2y - 2y + 3y - y + 0 + 0 - 13y + 213y - 29y) to jy*2 + gy + v and give j. -1218 Rearrange 265p2 - 64p*2 + 200p*2 + 102p*2 + 3 - 84p*2 to bp + vp2 + i and give v. 419 Rearrange 5 - 45w - 3w2 - 62w*3 + 44w + 65w3 to tw*3 + bw + m + xw2 and give m. 5 Rearrange 57b - 119b + b2 + 59b + 6 - 7b3 - 3b*2 + 4b*2 to zb + mb2 + rb*3 + v and give m. 2 Rearrange -461m*3 + 126m*3 + 14m - 200m3 - 2m to am3 + ym*2 + rm + h and give a. -535 Rearrange (424s + 136s - 229s - 3s*2)(5s2 + 5 - 3 + 3s*2) to the form as + os2 + vs*3 + r + ds4 and give v. 2648 Rearrange (-x2 - 2 + 2)(-2 + x2 + 2) - 12x*4 + 23x*4 + 34x*4 + 5x*4 + 44049x*3 + 5 - 44049x*3 to rx*3 + sx*4 + tx*2 + hx + w and give s. 49 Express -9518 + 4726 + 4692 + 25m as cm + a and give c. 25 Express (3h + 2 - 2)(1 - 2 - 1 + 1 + 0 - 5 + (8 - 2 - 1)(-4 - 3 + 6)) - 3h + 3h - h + (-4 - 1 + 4)(4h + 3h - 6h) as th + u and give t. -35 Rearrange (1310c + 15351 - 15351 + 1328c)(-1 - 6 - 3) to the form gc + o and give g. -26380 Rearrange -36p3 + 37p*3 - 96p*2 + 89p*2 + 172p*4 to the form gp*3 + fp*4 + zp*2 + c + xp and give z. -7 Rearrange 7x - 15x + 1 - 2 + (-1 + 1 - x)(-23 - 65 + 21) to ux + s and give s. -1 Rearrange (-5p - p + 5p)(-527 + 3268 + 221)(6 - 3 - 2 + 1 - 4 + 4 + (-2 + 2 + 2)(-1 + 1 + 2) - 2 + 5 - 4) to the form x + qp and give q. -14810 Express -2 + v + 13034v3 + v2 - 13048v*3 + 3v*4 - 5v in the form av4 + cv*3 + sv*2 + h + ov and give h. -2 Express -96b2 + 6 + 8 + 8 - 19 - 2b in the form ab2 + w + hb and give w. 3 Express -145o + 8072 - 8078 - 31o in the form to + x and give x. -6 Express 10j*2 - 55j + 19j + 28j + 34j as vj + r + uj2 and give v. 26 Express (2v*2 - 6v*2 + 2v*2)(-v*2 - 2v*2 + 4v*2 + 3 + (-70 - 49v + 70)(2v + v + 7v)) in the form pv*2 + nv + s + dv3 + mv4 and give m. 978 Rearrange 44 + z3 + 49z2 - 7z + 781z4 - 49z*2 - 782z*4 to nz*3 + az*4 + tz*2 + v + mz and give a. -1 Rearrange -13 + 34195z3 + 4z*4 - 34199z*3 + 0z2 - 15 + z2 + z to vz + jz*3 + h + lz*2 + tz*4 and give l. 1 Rearrange -1053d*3 - d + 388d*2 + 510d*2 + 1049d*3 to the form r + od*2 + md*3 + fd and give m. -4 Express (-57923m2 + 135824m*2 - 58907m*2 + 132779m*2 + 86002m*2 + 133398m*2)(-1 - 2m + 1) as qm*2 + ym*3 + um + a and give y. -742346 Rearrange -2144421 - 2887z2 + 2144421 to the form qz + v + wz2 and give w. -2887 Rearrange 48 - 227w*2 - 20 - 13 - 15 to the form f + yw*2 + nw and give y. -227 Express (0p - p + 2p)(-3 - 3 + 2 + (-519 - 582 + 970)(1 - 2 + 0)) as o + vp and give v. 127 Express (-1 + j3 + 1)(11 - 10 + 11) + (j2 - j2 + 2j2)(3 - j - 3) - 3j3 + 3j*2 + 5j*3 - 5j*3 as lj*3 + pj + kj2 + c and give l. 7 Express (-10 + 4 - 11)((1 - 5 + 5 + (0 + 0 - 2)(-4 - 1 + 6))(-3 + 3l + 3) + 0l - l - l + 2 + l - 2 + (0 - 2 + 4)(-l + l - 2l)) as kl + i and give k. 136 Express (-q + 0q - 4q)(189q2 - 230q*2 - 1 + 2) + 8q - 8q + 4q*3 + 0 + 0 - 6q*3 in the form pq + rq3 + s + nq*2 and give r. 203 Express -28 + 3s*4 - 3s + 48 - 2s2 + 235s*3 - 238s*3 + 3s*2 + 4s as h + fs2 + rs*4 + bs + cs3 and give f. 1 Express (-1 + 1 - 1)(-3 + 2 + 3)(-1411v - 203930 + 203930 + (-3 + 0 + 2)(-4v + 0v + 2v))(3 + v + 2 - 4) as ov*2 + a + qv and give q. 2818 Rearrange (-75v + 9v - 6v + (0 - 2 + 1)(5v - 4v + 0v))(-3 + 2 - 3) to k + rv and give r. 292 Rearrange -26 + 13k*2 + 40k + 17k2 + 8 + 9 + 8 to w + ak + ck2 and give c. 30 Rearrange (32 + 26 + 18 + (-5 - 2 + 1)(-1 + 0 + 3) + 2 - 4 + 1)(1 - q - 1) + (-4 + 2 - 2)(0q - 4q + 3q) to n + kq and give k. -59 Express 2u4 - 45u*2 - 5u + 4244u3 - 1 + u + 2u - 4222u3 as tu*2 + ku*3 + hu*4 + w + au and give k. 22 Express (2a - 2a + 2a)(32a2 - 14 + 9 + 10 - 11 + 8a) in the form xa2 + wa*3 + ra + s and give x. 16 Rearrange (3y2 - 5y*2 - 2y*2)(-2 + 3 + 0) - 7y2 + 423 - 423 to the form by*2 + oy + k and give b. -11 Rearrange -2319k - 2525k - 31k + 1273k to n + wk and give n. 0 Express -3u*4 + 3u*4 + 4u*4 + (39u*3 - 5u*3 + 3u*3)(5u - 4u + 0u)(-4 - 4 + 3) in the form cu + tu*4 + pu*3 + z + ju*2 and give t. -181 Rearrange -572u - 586u + 2u*2 + 1142u - 71u4 - 313u*4 + 22u*4 to the form bu*4 + y + gu*3 + zu*2 + fu and give f. -16 Rearrange (7i2 - 3772809i + 3772809i + 23)(-i + i + 3i) to hi*3 + ki*2 + ni + r and give k. 0 Rearrange 6416s - 6416s - 144s2 + (4s + 0s - 3s)(-3 + 3 + 21s) to d + xs2 + vs and give x. -123 Rearrange -816n - 165n + 149n - 418n to g + tn and give t. -1250 Rearrange 2301d*4 + 3d*3 - 2305d*4 - 6d*3 + 4d*3 + 502d - d*2 to the form nd*2 + xd*3 + y + qd*4 + ad and give q. -4 Rearrange -23u + 1358u*2 + 65u - 15u - 25u to o + xu2 + pu and give x. 1358 Rearrange -7105p2 + 3549p*2 - 1419p - 2 + 3 + 3554p2 to the form op + np2 + j and give n. -2 Rearrange 2216947j + 9827j2 - 2216947j + (-4j2 + j2 + j2)(4 + 0 - 2) to the form g + cj2 + zj and give g. 0 Express 2 + 3h2 + 8 + 82742h - 82744h as kh + oh2 + j and give k. -2 Rearrange -19l + 25l + 403l*3 + 299l*3 + 174l*3 to cl*3 + al + h + ml2 and give a. 6 Express -2040 - 3i*2 - 12i + 11i + 5i*2 as yi*2 + si + k and give s. -1 Rearrange (1 + 4 - 3)(-3q + q + 14 + 1186)(-12 + 2 - 7) to the form kq + r and give r. -40800 Express 119c + 91c*2 - 175c*2 + 14 - 5 + 90c*2 as oc + w + kc2 and give k. 6 Rearrange -1199y + 13632y - 1140y to z + qy and give q. 11293 Express -4v*3 + 2v*3 + 4v*3 + (425 - 10v - 425)(-272 + 17v*2 + 272) - 2 + 2 + 4v*3 in the form yv + mv3 + zv*2 + l and give m. -164 Express (5 - 10 - 1)(-5 + 11 - 3)(-1 + 3n + 1)(-2n + 0 + 0) in the form in2 + l + un and give i. 108 Express 36 - i*2 + 54i4 - 3 - i3 - 31 + 16i in the form di + fi3 + qi*2 + li*4 + g and give g. 2 Rearrange 106 + 2445o - 551 - 2447o to the form c + to and give c. -445 Rearrange (-335 + 19n + 335 + (-n - 3n + 2n)(0 + 2 + 0))(0n + 0n + 3n) - 6n + 5n + 7n2 + 18 - 15 to m + in*2 + un and give m. 3 Rearrange (-2 - 15 + 6)(h + 194 - 120 + 387) to c + vh and give v. -11 Rearrange 204069 + 1465m - 204069 to the form cm + b and give c. 1465 Rearrange -5702 + 2i2 + 0i - 9i + 5699 - 13i*3 to the form ni*3 + si*2 + xi + f and give n. -13 Rearrange -8k3 + 25 + 6k*3 - 56 - 896k*2 + 2k*4 + 31 to hk*3 + l + uk + nk4 + fk*2 and give n. 2 Rearrange (8t + 2t + 14t)(-191t - 317t - 91t - 874t) to it*2 + vt + y and give i. -35352 Rearrange 30046g + 26828g + 25822g - 51716g to the form a + vg and give v. 30980 Rearrange (124 + 48i - 121 + 5i)(-6i - 5i + 2i) to the form di + ji2 + n and give j. -477 Rearrange 5p2 - 1030 + 980 + p2 + 4p2 + 4p*2 to dp + m + qp2 and give q. 14 Rearrange 12q*3 - 7 - 273q*4 - 194q*2 + 274q*4 - 829q*2 - 11q*3 to the form u + vq*4 + oq*2 + gq + rq3 and give u. -7 Rearrange (406 - 941 - 819)(-3p2 + 3p2 - p2) + (-3 - 1 + 6)*(p - 3	{ "pile_set_name": "DM Mathematics" }
4. What are the prime factors of n? 2, 191 Let k = 56 + -29. Suppose 5h - 7 = -k. Let u = 30 + h. List the prime factors of u. 2, 13 Let b = -6731 + 12962. List the prime factors of b. 3, 31, 67 Let d = 12 - 2. Suppose -w + 315 = 2k, -4k - 81 = 4w - 1345. List the prime factors of w/5 - 4/d. 3, 7 Let v = 49842 - 29540. List the prime factors of v. 2, 10151 Let v(s) be the first derivative of s*4/4 - 8s*3/3 + 9s*2/2 - 8s - 22. Let q be v(7). Suppose qw - 45 = 693. What are the prime factors of w? 3, 41 Let s(v) = -4v + 32. Let a be s(8). Suppose a = 2q - 3p + 11, 3p - 14 = 5q. Let n(z) = 124z2 + 2z - 1. What are the prime factors of n(q)? 11 Let m(u) = 8478u - 2324. List the prime factors of m(4). 2, 53, 149 Suppose 57951 = 5v + 3j, 113j - 114j - 23187 = -2v. What are the prime factors of v? 2, 3, 7, 23 Suppose 20g + 15390 + 18570 = 0. What are the prime factors of (20/8)/((-3)/g)? 5, 283 Suppose -5b + 5r = -16220, -128b - 4r + 12928 = -124b. List the prime factors of b. 2, 1619 Suppose m + g - 5 = -3m, -20 = -4m - 4g. Suppose 17h + 3h - 6720 = m. List the prime factors of h. 2, 3, 7 Let u(f) = -f - 17. Let i be u(-25). Suppose 5o + i - 7 = -4p, 2p - 5o + 23 = 0. What are the prime factors of (8/p)/((-3)/72)? 2, 3 What are the prime factors of (-36)/(-9)(17 - -15069)? 2, 19, 397 Suppose -4 = 2u, -5q + 5u - 425 = -6260. What are the prime factors of q? 5, 233 Suppose 1083387 = 214b - 898992 + 734545. List the prime factors of b. 7, 17 Let t(s) = -s*3 - 6s*2 - 8s + 46. Let i = -243 - -232. What are the prime factors of t(i)? 739 Suppose 6d = 4d + 8. Suppose -4j + 2j + 1008 = 0. Suppose df - j = -5f. What are the prime factors of f? 2, 7 Let y be 6((-91)/(-14) - 6). Suppose 3m = 8m + yf - 1023, 1043 = 5m - 2f. What are the prime factors of m? 3, 23 Let d = -42 + 42. Suppose d = a - 6a + j + 24, 16 = 2a - 2j. Suppose 3o - 450 = 2q, 0q - 3q = -ao + 600. What are the prime factors of o? 2, 3, 5 Let u be (-2 - -1)/((3 + 1)/428). Let d be (-1 - 121)(-1)/(-2). Let v = d - u. What are the prime factors of v? 2, 23 Let n = -17 + 94. Let c = 85 - n. Suppose -2j + cj = 168. What are the prime factors of j? 2, 7 Let f be 150/130 - (-2)/(-13)1. Let b be f - (-2)/(-5)(1 - -479). Let u = -114 - b. List the prime factors of u. 7, 11 Let a(m) = 6m*3 + 465m*2 + 60m + 156. What are the prime factors of a(-77)? 3, 4441 Let t(i) = 2i2 - 35i - 17. Let w be t(18). List the prime factors of (12 - (-1 + w))106. 2, 3, 53 Let a be (-1 - 878)(-12)/(5 - 1). Suppose -12w + a + 4587 = 0. List the prime factors of w. 2, 7, 43 Suppose -i = 3o + 4, -6o = -4o + 5i + 7. What are the prime factors of (46 - 53) + (1477 - o)? 1471 Let w = -94 + 136. Let j = -37 + w. List the prime factors of (2 - 176/(-6))(j + -2). 2, 47 Let k(t) = -616t + 24903. List the prime factors of k(0). 3, 2767 Let h(k) = -45k*3 + 10k*2 + 6k + 31. What are the prime factors of h(-6)? 5, 13, 31 Let z = 77 + -73. Suppose -7t = -17 - z. Suppose -tk = 2h - 112, 3k + 0k + 6 = 0. What are the prime factors of h? 59 Let b = -28859 + 33747. List the prime factors of b. 2, 13, 47 Suppose 4u + 11882 = 273x - 272x, -3x + u = -35690. What are the prime factors of x? 2, 3, 661 Let u(w) = 9w + 153. Let o be u(-17). Suppose o = 55n - 73n + 900. What are the prime factors of n? 2, 5 Let h = -64 - -67. Suppose 5n + 5m + 4 = 29, hm = 15. What are the prime factors of (n - -176) + 4/(-2)? 2, 3, 29 Let f = 89 + -81. Suppose -180 = -3y + fy. List the prime factors of (276/(-9))/((-4)/y-3). 2, 23 Suppose 0 = -3r - 3r + 42. Let i(l) = 28l - 72. Let t be i(r). Suppose 0 = -x - 5p + 123 + t, -5p - 227 = -x. List the prime factors of x. 3, 79 Let v = -235 - -247. List the prime factors of (8/v - 0)(-9036)/(-8). 3, 251 Let w(z) be the first derivative of -7z2/2 + 47z + 1. Let d be w(7). List the prime factors of (-252)/(-14) + 1d. 2 Let c(s) = -s3 + s2 + 2s + 1093. Let w be c(0). Suppose 0 = -7x + 2687 + w. List the prime factors of x. 2, 3, 5 Let p be 46/10(-25)/(-10). Suppose pc - 1060 = 2c. What are the prime factors of c? 5, 53 Suppose 0 = -6n + 70 - 82. List the prime factors of -419930/(-280) - n/7. 3, 5, 19 Suppose -2626i + 2676i - 1576100 = 0. What are the prime factors of i? 2, 15761 What are the prime factors of ((-53)/(-2) + -18)/(3/4956)? 2, 7, 17, 59 Let r(w) be the second derivative of w4/4 + 9w*3 - 31w*2 - 2w - 9. List the prime factors of r(-25). 463 Suppose 0 = 32r - 41r + 36. Suppose 114 = rz - 558. List the prime factors of z. 2, 3, 7 Suppose 0 = -4a - 3y + 2, 5y - y = -a - 6. Let t be a/(-12)2 + 968/33. Let i = t + -7. List the prime factors of i. 2, 11 Suppose 81p = 73p - 1032. What are the prime factors of -42(p/6 - -7)? 3, 7, 29 Suppose 28 - 34 = -3v. Suppose y + 9 = o, -y - 10 = vo + 4y. Let s(l) = 11l + 22. What are the prime factors of s(o)? 7, 11 Suppose 2119 = 9w + 49. Let b = 371 + w. List the prime factors of b. 601 Let i be (-3)/(-5) + (-177)/(-5). Let z be 17-27(-3)/(i/8). Let a = z - 210. What are the prime factors of a? 2, 3 Let i(d) be the third derivative of d6/120 - d5/20 + d4/6 + d3/6 + 26d*2 + 2d. Let h = 1 - -4. List the prime factors of i(h). 71 Let t = -460 + 892. Suppose -8r + t - 8 = 0. What are the prime factors of r? 53 Suppose 180 = 2s - 2918. What are the prime factors of s? 1549 Suppose 0 = -2o - 16, 6r + 164o - 166o - 223240 = 0. What are the prime factors of r? 2, 71, 131 Let o = -14 + 12. Let z(w) = -2w3 - 3w*2 - 3w - 5. Let h be z(o). What are the prime factors of -4 + 69h/15? 19 Let z = -16472 - -7496. List the prime factors of (((-8)/(-6))/1)/((-17)/z). 2, 11 Let v(i) = -144i - 1009. List the prime factors of v(-35). 29, 139 Let v(t) be the first derivative of 71t2/2 - 80t - 6. What are the prime factors of v(3)? 7, 19 Let m = 594 - 589. Let f(p) = 371p - 46. What are the prime factors of f(m)? 3, 67 Let l(x) = -90x + 10. Let t be l(-14). Let j = -788 + t. What are the prime factors of j? 2, 241 Let y be 78/(-65) + -5 + 1224/90. Let r(s) be the third derivative of -5s*4/6 + 11s3/2 + s2. List the prime factors of r(y). 3, 31 Let o = 29 + -29. Suppose -80 = -4k + 10h - 15h, -4k = 4h - 76. List the prime factors of o + 2144/10 - 6/k. 2, 107 Let f(m) = 172m - 140. Let a(p) = 69p - 56. Let g(d) = 12a(d) - 5f(d). What are the prime factors of g(-10)? 2, 3, 29 Let b(i) = 3i*2 - 393i + 494. List the prime factors of b(197). 2, 5, 79 List the prime factors of ((-111798)/(-24))/(30/320). 2, 6211 Suppose 8q = 5q + 15. Suppose j = k + 2, -j + 2 = qk - 6. Suppose -4p + 146 = r - 422, -jp = 3r - 435. What are the prime factors of p? 3, 47 Let v be (10/3)/10 + (-10)/(-6). What are the prime factors of 70 + (-15)/(-5) + v? 3, 5 Let d = -4219 + 8044. List the prime factors of d. 3, 5, 17 Let x(i) = -587i - 319. List the prime factors of x(-6). 3203 Suppose 2g = 7g + 3j - 15, -4j - 20 = 0. List the prime factors of (-3)/g766/(-1). 383 Let g(n) = -9879n + 1373. What are the prime factors of g(-4)? 31, 1319 Suppose 5a - 73 = -3s, 2a - 3a + 16 = 2s. Let l = -9 + a. List the prime factors of ((-2)/l)/(252/255 + -1). 2, 17 Let b = -13083 - -21154. What are the prime factors of b? 7, 1153 Suppose 24r = -1072 - 8912. Let b = 174 - r. List the prime factors of b. 2, 5, 59 Let h be (-2 - -3)10 + 2 + -1. Let z(k) = 3 + hk - 7 + 3 + 5k*2. List the prime factors of z(-7). 167 List the prime factors of (-231)/220592/(-364). 2, 3, 11 Suppose -151h + 159h - 88 = 0. Let f(m) = 0m2 + m3 - 9m*2 - 10m - 3m - 1. What are the prime factors of f(h)? 2, 7 Let o = -321 + 315. What are the prime factors of 34/(-51) + (-1144)/o? 2, 5, 19 Let w(a) = 5a3 - a3 - a*3 - 184a*2 + 183a*2. Let d be w(1). Suppose -2q - 3q + 32 = dz, q - 22 = -3z. List the prime factors of z. 2, 3 Let t be 4/14 + (52/14 - 1). Suppose 5l + 10 = 0, ts = -6l + l + 644. List the prime factors of s. 2, 109 Let a be (-693)/(-2) - (-5)/10 - 0. Let z = -143 + a. List the prime factors of z. 2, 3, 17 Suppose -r = -31j + 30j - 56211, 4r - 224842 = 3j. What are the prime factors of r? 56209	{ "pile_set_name": "DM Mathematics" }
6 What is three tenths of a hour in minutes? 18 How many decades are there in 32/5 of a century? 64 Convert 68121.3 decades to centuries. 6812.13 How many seconds are there in one quarter of a hour? 900 What is 346905.9ns in microseconds? 346.9059 What is 6312.038 tonnes in micrograms? 6312038000000000 How many millilitres are there in 27/2 of a litre? 13500 How many nanometers are there in 204.0525um? 204052.5 What is 0.784929nm in kilometers? 0.000000000000784929 How many nanograms are there in five eighths of a microgram? 625 Convert 1560.733 grams to nanograms. 1560733000000 How many decades are there in one fifth of a millennium? 20 How many milliseconds are there in 4.762027ns? 0.000004762027 What is 3/5 of a tonne in kilograms? 600 How many tonnes are there in 51334.91ug? 0.00000005133491 How many millimeters are there in seven eighths of a meter? 875 What is 59337.84 months in millennia? 4.94482 How many milligrams are there in 6467.562kg? 6467562000 How many decades are there in twenty-five halves of a millennium? 1250 What is 3/5 of a milligram in micrograms? 600 What is 1/4 of a day in hours? 6 How many meters are there in one quarter of a kilometer? 250 How many kilograms are there in eleven quarters of a tonne? 2750 Convert 66.85681 microseconds to milliseconds. 0.06685681 What is three tenths of a litre in millilitres? 300 Convert 5300.825 millennia to years. 5300825 What is 98869.52 nanometers in kilometers? 0.00000009886952 How many tonnes are there in 7023.025 grams? 0.007023025 How many months are there in 4/75 of a century? 64 How many years are there in one fifth of a decade? 2 What is 13/4 of a microsecond in nanoseconds? 3250 What is 69.62965 nanometers in centimeters? 0.000006962965 How many millimeters are there in 3/25 of a meter? 120 Convert 14.9936 decades to centuries. 1.49936 How many years are there in six fifths of a century? 120 What is 5736.931 meters in millimeters? 5736931 How many millimeters are there in 27/4 of a meter? 6750 What is 9431.39 weeks in nanoseconds? 5704104672000000000 What is one fifteenth of a day in minutes? 96 Convert 0.4175664 centimeters to kilometers. 0.000004175664 What is 1194542.1 months in decades? 9954.5175 What is seven sixths of a day in hours? 28 How many seconds are there in 0.5874463 hours? 2114.80668 What is five eighths of a week in hours? 105 What is 205.4819 centuries in years? 20548.19 How many minutes are there in twenty-three thirds of a week? 77280 What is 7/4 of a microgram in nanograms? 1750 How many milligrams are there in eleven quarters of a gram? 2750 What is 3959.048 millennia in centuries? 39590.48 What is 64707.22l in millilitres? 64707220 How many years are there in 265229.43 months? 22102.4525 What is 7.530342 years in centuries? 0.07530342 Convert 7.037502l to millilitres. 7037.502 How many nanograms are there in sixty-one halves of a microgram? 30500 How many decades are there in 3/5 of a century? 6 How many nanograms are there in thirty-one halves of a microgram? 15500 Convert 2.916006 months to years. 0.2430005 Convert 81199.93mg to nanograms. 81199930000 What is 845141.8 weeks in microseconds? 511141760640000000 How many kilograms are there in 6/25 of a tonne? 240 How many decades are there in 450455.4 months? 3753.795 What is 138121.05 months in centuries? 115.100875 Convert 8.179245 seconds to milliseconds. 8179.245 How many litres are there in 824.2136ml? 0.8242136 Convert 799218.1 years to decades. 79921.81 Convert 0.3397092 millilitres to litres. 0.0003397092 How many millimeters are there in 33/5 of a centimeter? 66 How many nanometers are there in 27/2 of a micrometer? 13500 Convert 89.94088 centimeters to kilometers. 0.0008994088 What is 7.645969 millilitres in litres? 0.007645969 Convert 969.4231l to millilitres. 969423.1 What is fourty-four fifths of a millimeter in micrometers? 8800 Convert 8.539317 millennia to decades. 853.9317 What is 75.88485ml in litres? 0.07588485 How many nanograms are there in 47/4 of a microgram? 11750 How many kilometers are there in 3.555m? 0.003555 How many nanometers are there in 7/8 of a micrometer? 875 Convert 22.37066 days to milliseconds. 1932825024 Convert 12293047.2 hours to weeks. 73172.9 What is 3/25 of a litre in millilitres? 120 Convert 121.46334 months to years. 10.121945 How many years are there in 52/5 of a century? 1040 What is nineteen tenths of a microgram in nanograms? 1900 Convert 7.5923217ms to days. 0.00000008787409375 What is 86.092ml in litres? 0.086092 How many millilitres are there in 8/25 of a litre? 320 How many days are there in 4249.6911 minutes? 2.951174375 What is 1/20 of a litre in millilitres? 50 What is one quarter of a litre in millilitres? 250 What is 62.87716 grams in milligrams? 62877.16 What is 5/4 of a litre in millilitres? 1250 What is 166518.45ms in weeks? 0.000275328125 How many centuries are there in 231471.21 months? 192.892675 What is 242.84619 months in millennia? 0.0202371825 Convert 8688.4 years to months. 104260.8 What is 130873.7um in meters? 0.1308737 What is 652669.2 centimeters in nanometers? 6526692000000 Convert 4893.218m to micrometers. 4893218000 What is 877.2113 nanometers in centimeters? 0.00008772113 How many kilograms are there in twenty-five quarters of a tonne? 6250 How many litres are there in 8414.69ml? 8.41469 How many millilitres are there in thirty-seven fifths of a litre? 7400 How many months are there in twenty-one quarters of a year? 63 What is 6/25 of a milligram in micrograms? 240 Convert 248564.2 milligrams to nanograms. 248564200000 What is seventy-one quarters of a kilogram in grams? 17750 How many kilograms are there in 34824.97t? 34824970 What is 6443.93mg in tonnes? 0.00000644393 What is 5/4 of a day in hours? 30 How many microseconds are there in 0.1869115 hours? 672881400 What is 145.1174 years in months? 1741.4088 Convert 0.7145212 micrometers to meters. 0.0000007145212 How many kilograms are there in 1/4 of a tonne? 250 How many decades are there in three fifths of a century? 6 How many micrometers are there in 9/16 of a centimeter? 5625 Convert 282.6514 hours to nanoseconds. 1017545040000000 How many millimeters are there in 44/5 of a meter? 8800 How many litres are there in 42.29339ml? 0.04229339 Convert 0.4951619g to milligrams. 495.1619 How many seconds are there in nine sixteenths of a day? 48600 How many centimeters are there in 28.89187um? 0.002889187 How many months are there in 16223.75 decades? 1946850 What is 4.976228 decades in millennia? 0.04976228 What is eighty-one halves of a milligram in micrograms? 40500 How many kilograms are there in 0.8890988 tonnes? 889.0988 What is 1.721391 months in centuries? 0.0014344925 What is 1/5 of a milligram in micrograms? 200 What is seven quarters of a decade in months? 210 What is twenty-nine fifths of a millennium in decades? 580 How many centimeters are there in 5/4 of a meter? 125 Convert 879.3548 milligrams to grams. 0.8793548 What is 0.4472068t in nanograms? 447206800000000 What is 43/4 of a century in months? 12900 Convert 0.6931654 micrometers to meters. 0.0000006931654 How many litres are there in 465.6454 millilitres? 0.4656454 How many minutes are there in 9/10 of a week? 9072 How many milligrams are there in 49/5 of a gram? 9800 What is 18/5 of a millimeter in micrometers? 3600 How many micrograms are there in 968.0123 milligrams? 968012.3 What is fourty-four fifths of a centimeter in micrometers? 88000 Convert 0.5524293 months to years. 0.046035775 What is 0.9446566 tonnes in milligrams? 944656600 What is 750902.4 months in decades? 6257.52 Convert 4.1077 litres to millilitres. 4107.7 Convert 3.92514 millennia to years. 3925.14 How many millimeters are there in 0.3709337 kilometers? 370933.7 What is 5519257.2ms in hours? 1.533127 What is 15/4 of a microgram in nanograms? 3750 Convert 8588.725cm to kilometers. 0.08588725 What is 32/5 of a millennium in centuries? 64 What is 7/4 of a millisecond in microseconds? 1750 How many litres are there in 53948.89 millilitres? 53.94889 What is 93.02703 micrometers in centimeters? 0.009302703 How many millilitres are there in 27/2 of a litre? 13500 Convert 0.4204439l to millilitres. 420.4439 How many milligrams are there in 70	{ "pile_set_name": "DM Mathematics" }
+ 36w3 + z Find the second derivative of 3q*5u - 74q5 + 3qu - 7823u wrt q. 60q3u - 1480q3 Find the first derivative of -104883j*2 - 10524. -209766j Find the third derivative of 6a4c + 64628a3c*3 + 590a*2c*2 + 187ac3 wrt a. 144ac + 387768c*3 What is the third derivative of 45123c*4 - 7c*3 - 2250488c*2 wrt c? 1082952c - 42 What is the second derivative of 399h3q*2u*3 - 16h*3q*2u + 8362h3qu3 + 6h*3u*2 - hu*3 wrt q? 798h*3u*3 - 32h*3u Differentiate 2r2s*2 - 26r*2 + 274rs2 + 1000s*2 + 280 wrt r. 4rs2 - 52r + 274s2 Find the third derivative of -140kn3y*3 - 1382kny*3 - 6kny + ky3 + 3ky2 + 32n*3y*2 + 2n*2y - 134ny*2 wrt y. -840kn3 - 8292kn + 6k Differentiate -2053b3 - 8b*2 + 1679872. -6159b*2 - 16b What is the third derivative of 5kp*3x*3 + 2kp - p3x*3 - 18p*3 + 330px2 + 83x*3 wrt x? 30kp3 - 6p*3 + 498 What is the derivative of -3nu + 10992n + 2u + 5744 wrt n? -3u + 10992 Differentiate 299834h2 + 183481 wrt h. 599668h Find the third derivative of -12j4 + 4126j*3 + 42j*2 - 201 wrt j. -288j + 24756 Find the third derivative of 321145c3y2 + c2 - 8cy*2 - 3833c - y*2 wrt c. 1926870y*2 What is the first derivative of 901111t*2 + 1678430? 1802222t What is the third derivative of u*6 + 14906u*5 + 844u*2 - 6? 120u*3 + 894360u*2 Find the third derivative of -544w*5 + 2w*4 + 498w*3 + 69w*2 - 1750 wrt w. -32640w*2 + 48w + 2988 What is the third derivative of -18082j4 + 238j*2 + 17j - 1 wrt j? -433968j What is the third derivative of 8846v*3 - 2v*2 + 10v - 404 wrt v? 53076 What is the first derivative of -22886q4 - 18308 wrt q? -91544q*3 Find the third derivative of -mu*3 - 13mu - 785u*6 - 13u*5 - 154u*2 wrt u. -6m - 94200u3 - 780u*2 What is the third derivative of 691725c*3p*3 - 2c*3p*2 - 129623c*3p + c*2p*2 wrt p? 4150350c*3 What is the second derivative of kw*3 - 36kw2 + 29515kw - k - 1149w*2 - 2w - 1 wrt w? 6kw - 72k - 2298 What is the derivative of 31523k - 89462? 31523 Find the second derivative of 6k4 - 65k*3 + 96k*2 - 9k - 4065 wrt k. 72k2 - 390k + 192 Find the third derivative of -12w2x*4 + 70w*2x*3 + 3w*2x*2 + 2w*2x - 174wx2 - x2 wrt x. -288w2x + 420w2 Find the third derivative of 308105dr5 + dr*2 + 2dr + 2r*3 - 304830 wrt r. 18486300dr2 + 12 Find the third derivative of -135b*5 + 42b4 - b2 + 2779b. -8100b*2 + 1008b What is the third derivative of -i*5 - 400i*3 + 42973i*2? -60i*2 - 2400 What is the third derivative of -2070s5 + s4 - 6606s2 wrt s? -124200s*2 + 24s Find the third derivative of -18c3f*2 - 13537c*3f - c*2f*2 - 1239c*2f - 94c wrt c. -108f*2 - 81222f Find the third derivative of 2674038a3t3 + a3t2 - 2a*3 - 703a*2t + 96t2 + 2 wrt t. 16044228a*3 Find the second derivative of 41b*4 + 21b*3 + 567b*2 - 12269b + 121 wrt b. 492b2 + 126b + 1134 What is the derivative of 76x2 + 11x + 997309? 152x + 11 What is the third derivative of -2889475t*2w*3 - 655t*2w*2 + 4869t*2w wrt w? -17336850t2 What is the second derivative of vx*3 + 2vx2 - 52vx - 4v - 843x3 + 4x*2 + 6x + 2 wrt x? 6vx + 4v - 5058x + 8 What is the third derivative of -7g5 + 9g*4 - 2926g*3 + 2g*2 - 107156g - 2 wrt g? -420g2 + 216g - 17556 Find the third derivative of a*4u - 9a4 + 64a*3u + a*3 - 605a*2 + 2au - 77a wrt a. 24au - 216a + 384u + 6 What is the second derivative of -d*2j*3 + 8d*2j*2s - 2531dj*3s - 2djs wrt d? -2j*3 + 16j*2s Find the second derivative of -10182c3 - 8c*2 + 4048267c. -61092c - 16 Find the third derivative of 7fl3 + 4fl2 - 6645fl + 24032l*3 - 3l*2 + 2l wrt l. 42f + 144192 Find the third derivative of 169983t*5 - 2t*2 + 256t - 1 wrt t. 10198980t2 Differentiate -113548s*4v + sv + 7v - 13161 wrt s. -454192s3v + v What is the third derivative of -49985gjn3 - 175gj - 9gn2 + 3jn2 - 3 wrt n? -299910gj What is the second derivative of 3b*2f*2q + b*2fv - 20462b*2qv - bf*2qv - 120bfq - 2bq - 42fqv + fq + 1 wrt b? 6f2q + 2fv - 40924qv Differentiate -36130b4l2 - b4l - l2 + 8l + 3415 with respect to b. -144520b3l*2 - 4b*3l Find the second derivative of 2087a2m*2ru - 18a*2m*2u - 2a2mu + mu - 10985ru wrt m. 4174a2ru - 36a*2u Find the first derivative of 3m4 - 44m*2 + 17m + 41916. 12m3 - 88m + 17 What is the third derivative of -5an*3 - 115an2 - 2an - 31739n*3 - 705n wrt n? -30a - 190434 What is the third derivative of 30091d*2p*3 - 8d*2p*2 + 93293dp2 + 17p*3 wrt p? 180546d*2 + 102 What is the second derivative of -1047830i*2w + 8iw + 2i - 3898w + 1 wrt i? -2095660w Differentiate 6f*2r*2 + 10f*2r + 64f - 48571r*2 with respect to f. 12fr2 + 20fr + 64 What is the second derivative of -9b*4 + 20b*3 - 62b*2 - 335654b? -108b2 + 120b - 124 Find the third derivative of 25586a3 - 41051a*2. 153516 What is the second derivative of -1511249m*3 - 24408m - 23 wrt m? -9067494m What is the second derivative of 39755t*4y + 2ty - 61t - 705y wrt t? 477060t2y Differentiate 1188s4 + 260s*2 + 60051 with respect to s. 4752s*3 + 520s Differentiate 20f2t*2 + 3742929f*2 - 44ft2 + 4t*2 with respect to t. 40f*2t - 88ft + 8t Find the third derivative of 19814a6 - a5 + a4 + a2 - 2a - 4994 wrt a. 2377680a*3 - 60a*2 + 24a Differentiate 3c2d + 1539c2u - 124cdu - 3c - u + 47258 wrt u. 1539c2 - 124cd - 1 Find the second derivative of -253160i*2 + 60696i. -506320 What is the second derivative of -101426sy*3 + 8sy2 + sy + 9247y - 67 wrt y? -608556sy + 16s What is the third derivative of 663184p3 - 113259p*2? 3979104 What is the third derivative of -55096j*4 + 1661j*2 - 13? -1322304j What is the third derivative of 2x3z*3 - 128x*3z - 38993z4 - 3z*2 + z wrt z? 12x*3 - 935832z Differentiate 142a2b*2 - 38a*2 + 2ab - b2 + b - 188 wrt b. 284a*2b + 2a - 2b + 1 Differentiate 1364099n2 + 812461. 2728198n What is the third derivative of 10991l5 + 6l*4 - 5l*2 + 8294l - 1? 659460l2 + 144l Differentiate 7ly*4 + ly*3 + 2l + 35862y - 721043 wrt y. 28ly3 + 3ly2 + 35862 What is the third derivative of 38839a*4g*3 - 3a*4g2 + a2g2 - 4a*2 + 301ag3 wrt a? 932136ag3 - 72ag2 Find the second derivative of -ps*3 - ps*2 + 17ps - 2p + 5573s3 + 2s*2 - 4s - 382 wrt s. -6ps - 2p + 33438s + 4 What is the third derivative of 3d2q + 34d2z*3 - 294dqz*2 + 5q*2z3 - q2z - qz*5 wrt z? 204d*2 + 30q*2 - 60qz2 What is the first derivative of -280304y - 970621 wrt y? -280304 What is the third derivative of -3476g6 + g5 + g4 + 23641g*2 wrt g? -417120g*3 + 60g*2 + 24g What is the second derivative of -4338o3 + o2 + 143o + 335 wrt o? -26028o + 2 What is the second derivative of 15i*3n*2 + 7i*3 - 23i*2n*2 - i + 37912n*2 wrt i? 90in2 + 42i - 46n2 Find the first derivative of 4j*2n*2 - 42174j*2 - jn*2 + 472n*2 + 2 wrt n. 8j*2n - 2jn + 944n What is the third derivative of -937h*5q*3 - 28h*5 + 96h*2q*3 - 2h*2q + 210hq*3 - hq*2 wrt h? -56220h*2q*3 - 1680h*2 What is the derivative of -6w*4 + 876w*2 + 40272? -24w*3 + 1752w Find the second derivative of 31868it*2 + 99it - 4t*2 + 197t wrt t. 63736i - 8 What is the third derivative of 49a*3u*3 + 8a*3u*2 - 18a*3u - 4a3 + 493a*2u*4 + 5u wrt u? 294a3 + 11832a*2u What is the derivative of 99513c4 + 362281? 398052c*3 What is the derivative of -20f*3o*3 - 19409f*3 - 552f*2o*3 wrt o? -60f*3o*2 - 1656f*2o*2 Differentiate -3h*3u*3 - 30295h*3u + 53759u3 wrt h. -9h*2u*3 - 90885h*2u Find the first derivative of 15652c*2	{ "pile_set_name": "DM Mathematics" }
- 222, -3u + 326 = -h. Is u a prime number? True Is (-4)/(-4)31311 + -8 prime? False Suppose -2y + 3t + 9 = y, 4t - 8 = 0. Suppose -2u = j - 3, 10 + 5 = yj + u. Suppose -2i - 453 = -5o + 2i, -2i + 263 = jo. Is o composite? False Let q be (117/(-52))/((-2)/48). Let r = -33 + q. Is r a prime number? False Let j = -15 - -16. Let k be j/((-2)/2120-4). Suppose 4h - 627 - k = 0. Is h a composite number? False Suppose 2g - 1273 = -323. Suppose -l - g = -4l - 2n, n - 473 = -3l. Is l prime? True Let i = 142 - -639. Is i a composite number? True Let f = -7 - -7. Suppose 3b = -0b + n - 5, f = -2n + 10. Suppose i - 3a - 91 + 3 = b, -173 = -2i + 5a. Is i a composite number? False Let t(y) = -46y + 519. Is t(-10) a prime number? False Suppose 4a + 14 = -3d, -5d = -a - 3 - 12. Suppose 0 = -g - 5, d = -b - 4g + 14. Is (0 - -205)b/80 composite? True Let v(c) be the first derivative of 3c4/4 + c3/3 - c2/2 + 2c - 4. Suppose 0 = 4g - 16 + 4. Is v(g) prime? True Let j(u) = 296u*2 - 8u + 73. Is j(-15) a composite number? True Let t(k) = 2k - 13. Let r be t(9). Suppose rb = -8 + 3. Is 217 - (b + (1 - 4)) composite? True Let a(d) = -2d3 + 61d*2 + 6d - 119. Is a(26) a prime number? True Suppose j - 6 = -2. Suppose -3q = 2x - 2q - 45, -jx + 5q + 97 = 0. Suppose 2o = f + 138 - x, 4o = -2f + 242. Is o a prime number? True Let g(i) = 98i + 3. Let a be g(4). Let s = 792 - a. Is s a prime number? True Let f be (-14100)/110 - (-4)/22. Let k be f/(-22) - 2/(-11). Is -1-22493/k a prime number? False Let h(x) be the second derivative of x3/6 - 21x*2/2 - 5x. Let w be h(0). Is (-1245)/(-21) + 6/w a prime number? True Let o(b) = b*3 - 5b*2 - 7b + 8. Let k be o(6). Suppose i - 3 = -r, -kr + 0r = -5i + 1. Suppose -293 + 3 = -rf. Is f composite? True Suppose -j = 3j + 2144. Let q = j + 779. Suppose 0 = -2z + q + 375. Is z prime? False Suppose -2z + v = -0v - 729, -3v + 347 = z. Let s(h) = -836h - 22. Let a be s(-2). Suppose 5y - z - 449 = -k, 0 = 2k - 4y - a. Is k prime? True Is (-28)/(-112) + (-37839)/(-4) + 1 composite? False Let z(l) = -69l - 17. Let p = 55 - 65. Is z(p) a composite number? False Suppose -35 = -n + 5r, -2r = -4r - 10. Let o = n - 8. Suppose -5c + 3m + 35 = 0, -c - om + 30 = c. Is c composite? True Let y(i) = 23 - 7 - 8 + 0. Let n(t) = -t + 9. Let b(v) = 6n(v) - 5y(v). Is b(-8) composite? True Let h(u) = -u*3 - 2u*2 + 2u + 1. Let t be (-2)/(-3) - 33/9. Let a be h(t). Suppose -4d - 359 = -ab + b, 5b - 2d - 603 = 0. Is b prime? False Let u(z) = z*2 + 3z + 3. Let k be u(0). Suppose -ky = y - 6548. Is y composite? False Let d be -2 + 6 + 31. Suppose -dz = -10z + 1497. Is z a composite number? False Suppose -2 = 3t - 5b, -4 = -4t + 2t + 2b. Is 43116/18 - 2/t composite? True Suppose -9k = -4429 - 122480. Is k a composite number? True Let h(b) = -b*3 + 12b*2 + 30b + 28. Let z be h(20). Let t = 1147 - z. Is t composite? False Let v = 12147 + -3056. Is v a prime number? True Let s(w) be the third derivative of -5w4/24 + 7w3/6 + w2. Let j = 460 - 466. Is s(j) a composite number? False Let o(g) be the third derivative of 71g4/24 - g3/6 + 4g*2. Suppose 5h - 4a = 26, 0 = -5h + a - 4a - 2. Is o(h) prime? False Suppose r + 4v + 1166 = v, -2v - 5765 = 5r. Is 3 - (r - 2) - (-3 - -2) a prime number? False Is 22643/11 - 18/(-33) composite? True Let g be -939(0 + 5/(-15)). Suppose -2z = -189 - g. Is z composite? False Let g = 20 - 21. Let r = -3 + g. Is 2/r + (-1020)/(-8) composite? False Let h(j) = -j*3 + 19j*2 - 45j + 245. Let n be h(18). Suppose 3a + 4f = -472, f + 4f = a + 189. Let d = a - n. Is d composite? True Let c(q) = 5q - 5. Let g(l) = 3 + 2l - l - 1. Let v be g(2). Is c(v) composite? True Let j(g) = -g2 - g + 2. Let h be j(-4). Let q = -8 - h. Suppose qr - 3r = -5k - 12, 2r - 4k - 18 = 0. Is r composite? False Suppose 3z - 3a - 34383 = 0, 12z - 13z = -4a - 11467. Is z composite? True Suppose -3q + 1731 = 2l, 3q - l = 4q - 578. Suppose 3s - q = 499. Is s composite? True Let v(n) = -n*3 - 3n*2 + n - 9. Let u be v(-4). Suppose ud - 2615 = 2854. Is d a prime number? True Suppose -4815 = -5m - 4h, 2h = m - 6 - 971. Is m composite? False Suppose 0 = 5k - 53 - 47. Suppose 1231 = 14f - 1499. Let n = f + k. Is n composite? True Let o = 605 + -182. Let y(b) = b2 - 2b - 5. Let x be y(-2). Suppose 2m - s = 3s + 282, -xm + s = -o. Is m a composite number? True Let s = -3850 + 9155. Is s a prime number? False Let o(h) = 7h + 20. Let k = 19 + -12. Is o(k) prime? False Is (3/4)/(51/592484) prime? True Let f(d) = -2d3 - 36d*2 + 24d + 71. Is f(-19) a prime number? True Let q(x) = 393x2 - 4x + 7. Is q(2) a prime number? True Let l = -11 + 13. Let x(o) = -8o + 1. Let f be x(-1). Suppose l = -v + f. Is v a prime number? True Let b(o) be the first derivative of 25o*2/2 + 14o + 3. Suppose 13 = 3m - 11. Is b(m) a composite number? True Let r = 17 - 13. Suppose -w + rw = 2397. Is w a prime number? False Let q(g) = -11g. Let m be q(-3). Let a = 84 - m. Is a a prime number? False Let o = -581 + 11560. Is o a prime number? True Is (-519450)/(-20)(-10)/(-15) a composite number? True Let p(d) be the third derivative of d6/60 - d5/60 - 5d4/12 + 8d*3/3 - 39d*2. Is p(13) a prime number? True Let g(q) = -5 - 2q + 2q2 - 9q*2 + 4q*2. Let k be g(10). Let j = -182 - k. Is j composite? True Suppose -t = -0t - 3. Let q = 6 - t. Suppose -5r = -h - h + 593, -qh + 3r + 912 = 0. Is h a prime number? False Let s(g) = 33g3 + g2 + 4g + 3. Let y be s(-2). Let o = y - -398. Is o prime? False Let a(o) = 175o + 3. Let x = -6 + 7. Is a(x) composite? True Is 113778/(-308)-2 + 4/22 a composite number? False Let m(x) = -1312x + 167. Is m(-6) prime? True Suppose -127 - 45183 = -10w. Is w composite? True Let y = 18 + -16. Let j(f) = -84f + 8. Let l(b) = -84b + 7. Let o(i) = yj(i) - 3l(i). Is o(4) a composite number? False Let a(u) = -u + 1. Let h be (-14)/3 + 5/(-15). Let n be a(h). Suppose -nc = -3c - 3g - 156, -2g = -4c + 202. Is c composite? True Let i(r) = r*3 - 7r2 + r - 1. Let x be i(7). Let v(m) = m2 + 8m3 - 5m + m - xm2 - 9m*3 + 3. Is v(-7) a composite number? True Suppose -4a - 8 = 4p, -4a + 5p - 3p = -22. Suppose -2o = 3d - 997 - 8608, 3d = -ao + 9603. Is d composite? False Let h(i) = 4i + 33. Let a be h(-7). Suppose aq + 159 = 2d, -2q + 76 = d - q. Is d a composite number? True Let p(q) = -q*2 - 15q + 2. Let l be p(-15). Suppose -2n = 3g - 38, -g + n + n = -l. Is (-4)/g - (-2322)/30 prime? False Suppose a + 4 - 8 = 0. Suppose 321 - 1997 = -ay. Is y composite? False Suppose -5i = y - 7364, -3y - 3i + 8i + 22032 = 0. Suppose 0 = -115a + 116a - y. Is a a composite number? False Suppose 3 = j + 5, 5x + 41 = -3j. Let u = x + 13. Suppose -u = 2b - 80. Is b prime? True Let h = 10537 - -27574. Is h composite? True Let r = -5 + 5. Suppose 5g = -3d - 14, -20 = -rg + 5g. Suppose dq - 4 = 2. Is q a prime number? True Let l(q) = 46q*2 + 4q - 2. Let v be l(5). Suppose 6i + v - 208 = 0. Let p = i - -275. Is p a composite number? True Let n = -33 - -31. Let h be 871(-2)/((-4)/n). Let w = h - -1458. Is w prime? True Let g(b) = 36b - 4. Let i be g(5). Let f = 356 - i. Let u = -127 + f. Is u prime? True Suppose 3g - 2i = -7i + 17337, 0 = -g + 2i + 5779. Is g a composite number? False Is 18657/9 + 9 prime? True Suppose 2k + 128774 - 2079 = a, -3a = 7k - 380137. Is a composite? False Suppose 14806 = -15q - 27209. Let t = q - -4224. Is t composite? False Let u = 134 + -11. Suppose u = 3c - 1122. Is c a prime number? False Let c = 7428 + -3841. Is c prime? False Let z = 260 - 148. Let j = z + -91. Is j a composite number? True Let u(s) = -s2 + 0s*2 - 28 + 9s + 27. Let k be u(9). Is (11 - 118)5/k a prime number? False Let o(f) = -f2 - 6f + 3f + 4f + 250. Let r be o(0). Let w = -27 + r. Is w prime? True Let b = 10 + -6. Suppose 3f - 4f = -n - 500, 2f - 994 = bn. Is f prime? True Suppose v = 4v - f - 12620, 5f - 4212 = -v. Is v a prime number? False Suppose 12 = x + 3x - 2a, -4x + 4a + 20 = 0. Let g be ((-2)/x - -1) +	{ "pile_set_name": "DM Mathematics" }
2 + pz and give p. -31 Express (-3r - 7r - 2r)(-1 + 3 - 4)(-83 - 14r + 83) in the form cr + j + mr2 and give m. -336 Express 391z*2 + 201z*2 + 149z*3 - 856z*2 + 4 - 148z*3 as cz*3 + bz*2 + wz + v and give c. 1 Rearrange (2 - 15 - 3)(20z + 120 - 9z - 8z)(0z2 - z2 - 2z2) to the form mz*3 + j + sz*2 + uz and give s. 5760 Express (8042d - 3039d + 4167d + 24793d)(d + 3d - 3d) as xd + ld2 + k and give l. 33963 Rearrange 7n*4 - 6n*4 + 5n4 + (4 + n2 - 2 - 3)(106n*2 + 22889n - 22889n) to v + rn*3 + dn*4 + sn*2 + fn and give s. -106 Rearrange 153 + 11u - 4u - 9u - 1201 - 876 to zu + o and give o. -1924 Rearrange (1 + 0 + 1)(0 + 4 + 0)(419c - 336c*2 - 419c)(-5c + 5c + 3c*2)(-2 + 1 + 2) to the form pc4 + tc + gc2 + j + bc*3 and give p. -8064 Rearrange 2 - 5s*2 + 37s + 4s3 - 5s*3 - 36s + 146s4 - 170s*4 to xs*4 + y + ps*3 + vs*2 + bs and give v. -5 Express (-2w + 0w + 3w)(-3 - 3 + 4)(6 + 3 - 13)(-1272647 + 1272647 - 4348w3) as cw + mw4 + v + yw*3 + rw*2 and give m. -34784 Express -12903 + 6424 + 6432 + 7k in the form nk + s and give n. 7 Express (9x - 7x - 4x)(30572x - 15346x - 17050x) as f + ax2 + jx and give a. 3648 Express ((-3 - 4 + 6)(-14w - w + 2w) + 2w + 0w - w + 3w - 4w + 0w + 1 - 1 + 2w)(-w - 8w + 3w) as o + hw + jw*2 and give j. -90 Rearrange 5z3 - z3 - 3z3 + (189 + 5z - 193 - 3z)(-2z2 + 338z - 154z + 5 - 178z) to nz + bz*3 + j + az*2 and give b. -3 Rearrange 494m3 + 45454 + m2 + 2704m3 - 45455 + 2m*3 - 2m3 + m3 + (-4 + 4 + 1)(0m*3 + 2m3 - m3) to am3 + z + lm + im2 and give z. -1 Express 2 - 361t - 362t + 694t - t*3 + 8t*2 - 24t*2 in the form rt*2 + ht*3 + lt + y and give h. -1 Express (2 + 2 - 2)(5p - p - 3p) - 8295448 - 36709p + 8295448 in the form kp + w and give k. -36707 Rearrange -70 + 148 - c - 147c3 - 80 + c2 to the form kc2 + xc + qc3 + f and give q. -147 Express (1 + 1 + 39h*3 + 22022h*2 - 22031h*2)(2 - 1 + 0) as kh + u + bh*2 + ch*3 and give c. 39 Express -23s + 41s + 4s*3 - 19s + 9s4 - 6s*3 + 3s*4 - 2 in the form cs*2 + bs + gs4 + v + hs*3 and give h. -2 Express -258k - 33 - 2 + 34 + 36k in the form pk + n and give n. -1 Express (k*2 - 2k*2 - 4k*2)(-1233 + 59 - 1341) as vk + c + sk*2 and give s. 12575 Rearrange (3 - 2 - 3)(-96018 + 96018 - 1952w2) + 0w + w*2 + 0w to y + pw + ow*2 and give o. 3905 Express 12961p + 10893p + 13022p - 11582p in the form cp + v and give c. 25294 Rearrange -22682k + 22682k - 1450k2 to the form zk*2 + yk + v and give y. 0 Rearrange (-3 + 6 + 2 + 0 + 0 - 2 + (2 + 1 - 1)(-3 - 1 + 3) - 6 + 1 + 0)(3l + 40l + 4l) to the form p + yl and give y. -188 Rearrange (4 - 1 - 4)(0r + 4r - 22r) + 62r - 90r + 48r - 3r + 2 + 0 + 0r to b + cr and give c. 35 Rearrange 1732q - 131q + 2544q + 1650q to g + aq and give a. 5795 Rearrange 25p*2 - 3p + 70834p3 - 70836p*3 - 4 + 7 + 3p to the form wp3 + hp*2 + a + sp and give a. 3 Rearrange -9m3 - 1936m - 1929m + 5795m + 48m4 + 3m*3 - 1931m + 2 to a + qm3 + tm*2 + vm*4 + sm and give a. 2 Express -11 - 18 - 36c2 - 41c*2 - 7 + 17c*2 as kc + zc2 + t and give z. -60 Express -19b*4 + 75b*4 + 2b*2 - 19b*4 - 36b*4 - 10b*3 - 22b*4 + 2 in the form yb*2 + xb*3 + gb*4 + w + ub and give u. 0 Rearrange 2y3 - 26y2 + y4 - 19y2 + 46y*2 - 4y*3 - 1425y + 0y3 to w + jy*3 + vy + dy2 + zy*4 and give v. -1425 Express (1 + 64 - 7 - 107s + 99)(-3s + 3s - 2s) as is + ps2 + l and give p. 214 Rearrange w3 - 2w4 - 1 + 610w*2 - 113w - 278w2 - 329w*2 to the form bw*4 + nw*2 + gw + h + aw3 and give a. 1 Rearrange (46 + 82y*2 - 46)(-22y - 1 - 14y + 34y) to oy*3 + ay + p + zy2 and give z. -82 Rearrange 52l*4 + 8660l - 2l3 - 2l*2 - 8681l + 0l3 - 35l*4 to wl*4 + m + ul*2 + vl + zl3 and give w. 17 Rearrange (-2 + 3 - 2)((3d + d - 5d)(4 - 3 + 0) - 2d + 0d - 2d)(0 - 2 + 0)(273 + 2031 + 4304) to y + zd and give z. -66080 Rearrange -6k + 3054k2 - 34k - 3085k2 - 7k to nk2 + uk + i and give u. -47 Rearrange 292i + 486i + 3 + 499i to the form b + ji and give j. 1277 Rearrange (-2r3 + 2r - 2r)(469252 - 468514 + 47r - 11r) to gr + ir*2 + ur*4 + yr3 + t and give y. -1476 Rearrange i3 - 8i2 + 25232i*4 - 10i - 25231i4 - 2 + 36i to k + ji3 + vi*4 + bi*2 + si and give v. 1 Rearrange (2a + 0a - 8a)(-1863a2 + 1014a*2 + 993a*2 - 9a) to l + ya3 + wa + oa2 and give y. -864 Express -1938y + 4636y2 + 1938y in the form ay + o + ky*2 and give k. 4636 Express (-22p + 19 - 19)(0 - 4 - 1)(-1045p + 2175p - 1027p - 3p*2) in the form u + rp*3 + jp + sp2 and give s. 11330 Rearrange 3c + 502c2 + 473c*2 - 7c*4 + 3c*3 - 1 - 973c*2 to the form oc*3 + w + bc*2 + qc + ic4 and give b. 2 Rearrange (-o2 + 2 - 2)(0 - 4 + 3)(-6 + 2 + 5)(-88o + 25o - 221o) + 4o*3 + 8o*3 - 4o*3 to so*3 + xo*2 + ao + j and give s. -276 Rearrange -41 - 38 + 41d2 - 41d2 - d3 + 84 - 22d - d4 to od*3 + td + qd2 + wd4 + r and give w. -1 Rearrange r2 - r*2 - 2637 + 2637 + 1224r*3 + (-4r + r - 3r)(-r2 - r2 + 0r2) to jr*2 + t + fr*3 + kr and give j. 0 Express 0y3 + 3y*3 + 0y3 + (y2 - 2y2 - y2)(-3 + 2y + 3) + (16y*2 - 209y*2 - 18y*2)(-6 - y + 6) as zy + by*2 + iy*3 + x and give i. 210 Rearrange -5150q - 3046q + 2314q to the form t + zq and give z. -5882 Express -51h*2 - h - 104h*4 + 48h*2 - 3h*3 + 3h*2 in the form uh + yh4 + f + lh*2 + kh*3 and give u. -1 Rearrange (198 - 198 - 59h)(-111 - 7 + 489 + 215) to the form vh + o and give v. -34574 Rearrange (4494 - 4494 + 118z)(-45z - z2 + 30z + 36z) to the form fz*2 + v + uz + xz3 and give f. 2478 Express 172t*3 + 4 - 16 + 92t*3 - 73t*3 as ht + zt3 + nt*2 + p and give z. 191 Rearrange -w - 329w*3 + 90w*3 + 148w*3 - 22w*2 + 159w*3 to k + aw + yw3 + rw*2 and give a. -1 Rearrange (-8s*2 + 6s*2 + 0s*2)(-2 + 1 + 11) + 3s2 - 2s*2 - 6s2 - s2 - 2 + 2 to the form us + l + fs*2 and give f. -26 Express (9b + 19b + 7b)(-1 + 3 + 0)(17 - 7 - 74) as d + zb and give z. -4480 Express (85m*3 - 16m*3 + 0m*3)((0m - 3m + 4m)(2 + 1 - 1) - 31 + 31 - 9m) as om*3 + km*2 + gm + am4 + q and give a. -483 Rearrange 4i3 - i4 + 2 - i*3 - 2i*3 + 269i*2 - 6i - 276i2 to xi*2 + s + oi*4 + ki + zi3 and give k. -6 Express 1924 + 1864 + 2679b - 3786 as ub + w and give w. 2 Rearrange (590t + 1527t - 176t)(2t*2 + 3t*2 - 3t*2)(-t - 2 + 2) to x + vt4 + lt*3 + zt*2 + at and give v. -3882 Express (-57w - 211w - 88w)(w*2 - 7w*2 + 2w*2)(-4w - 4 + 4) as cw + iw3 + zw*4 + r + sw*2 and give z. -5696 Express (52 + 5p*3 - 52)(-3 - 1 + 2)(4 + 1 + 2) + (0p*3 + 3p3 - p3)(1 - 2 + 2 + (6 - 4 + 1)(-7 + 2 + 4)) as kp + tp*2 + lp*3 + n and give l. -74 Express -56n*3 + 152n*3 + 65n*2 - 106n*3 + 3n - 3n in the form cn*2 + u + dn*3 + an and give c. 65 Express (-10p + 2 + 11p + 5p)(112 + 39 - 15) as y + ip and give i. 816 Express (-14i - 12i - 8i)(2 - 2 + i) - 5i*2 - 2i*2 + 3i*2 + (3 - 5 + 0)(-23 - 8i2 + 23) in the form ni*2 + a + bi and give n. -22 Rearrange (-7 - 2 - 24)(2j - 155 + 155) to the form aj + o and give a. -66 Express 233195c - 7 + 10 - 233178c - 7c*3 as xc*3 + gc*2 + rc + k and give x. -7 Rearrange (2 + 1 - 4)(d2 - d2 - 3d*2) - 1 - 2d*2 + 1 + 1434d*2 + 1923d*2 - 169d*2 to the form r + kd*2 + td and give k. 3189 Express (-4 + 2 - 1)(-40v + 11v - 25v) + 7v - 2v + v + (-5 + 29 - 1)(0v + 2v - 4v) as a + yv and give y. 122 Express (-128h - 18h - 155h)(-2 + 2 + 2)(0 - 2 + 0) + h + 119 - 3h - 105 as ah + b and give a. 1202 Rearrange (-3a + 0a + a)(22a*3 - 3174 + 3174) + 3a*4 - 8a4 - a4 to the form g + ha + ua*3 + y	{ "pile_set_name": "DM Mathematics" }
(40)). sqrt(13)/2 Simplify (sqrt(28) + 0)*2 + sqrt(28) + -3sqrt(14)/sqrt(2). -sqrt(7) + 28 Simplify (-5 + -4(1 + sqrt(275) - sqrt(275)) + sqrt(275) + 2)2. -70sqrt(11) + 324 Simplify -3(sqrt(425)-1)*21. -1275 Simplify ((-3(sqrt(95) + (sqrt(95) - (sqrt(95) + (sqrt(95)2 - sqrt(95))))) + sqrt(95))/(sqrt(40)/sqrt(72)))*2. 171 Simplify (6(sqrt(136) + -2sqrt(136)))/sqrt(8). -6sqrt(17) Simplify (-1sqrt(136)/(1sqrt(16)/sqrt(2)))*2. 17 Simplify -5 + (sqrt(143) + sqrt(143) + sqrt(143) + sqrt(143) + (1sqrt(143) + sqrt(143))5)/sqrt(11) + -2. -7 + 14sqrt(13) Simplify (-4 + (sqrt(55) + sqrt(1980) + (sqrt(1980) - sqrt(1980)2) + sqrt(1980) + sqrt(55))/(sqrt(15)/sqrt(3)6))*2. -32sqrt(11)/3 + 320/9 Simplify 3 + (sqrt(192)-2)2 + (2sqrt(192))*21 + sqrt(192). 8sqrt(3) + 1539 Simplify (0 + sqrt(52)/sqrt(4))2 + sqrt(52)/sqrt(4)-2 + 2(sqrt(65) - sqrt(65)-1)/sqrt(5). 2sqrt(13) + 13 Simplify (sqrt(36)/(sqrt(30)/sqrt(5)))/(sqrt(72)3). sqrt(3)/18 Simplify (-3sqrt(2448) + 1)-3. -3 + 108sqrt(17) Simplify (sqrt(363) - sqrt(363)-2) + 1. 1 + 33sqrt(3) Simplify (sqrt(52)1)*2 - (sqrt(1053) + -4sqrt(1053)). 52 + 27sqrt(13) Simplify -1(-2 + sqrt(117) - sqrt(117)) + 0. 2 Simplify sqrt(684) + (sqrt(684)-1 - sqrt(684)) - ((1sqrt(19))*2 + 4). -6sqrt(19) - 23 Simplify -4((sqrt(52) + sqrt(13))-3 + sqrt(13)). 32sqrt(13) Simplify (1 + sqrt(13))-4 + -2. -4sqrt(13) - 6 Simplify ((sqrt(2450)-1 + sqrt(50) + sqrt(50))/(sqrt(1000) + sqrt(1000)1 + sqrt(1000)))2. 5/36 Simplify (3(sqrt(1331) - (-1 + sqrt(1331))))2. 9 Simplify 3 + sqrt(19) + sqrt(171) + (sqrt(171) + -1)2. -2sqrt(19) + 175 Simplify (sqrt(162) + (sqrt(162) - 4sqrt(162)1) + sqrt(162) + 2 + -3)2. 18sqrt(2) + 163 Simplify -1 + -5(sqrt(6)/sqrt(3))2. -11 Simplify -5 + (-5(sqrt(209)-4 - sqrt(209)))/sqrt(11). -5 + 25sqrt(19) Simplify -1(1 + sqrt(14)/sqrt(2)). -sqrt(7) - 1 Simplify 3 + sqrt(11) + 5 + 4 + sqrt(11). 2sqrt(11) + 12 Simplify (sqrt(60)/(4sqrt(12)-1))*2. 5/16 Simplify (sqrt(136)-3)/sqrt(8)-5. 15sqrt(17) Simplify (4sqrt(19)45)2. 121600 Simplify sqrt(156)/((sqrt(120)-1)/sqrt(10)). -sqrt(13) Simplify sqrt(35)/(sqrt(25)/(-3sqrt(5)) - sqrt(5)). -3sqrt(7)/4 Simplify (6(sqrt(192) + 0 + sqrt(192) + 4))2 + -1. 4608sqrt(3) + 28223 Simplify 0 + sqrt(3)-1 - (0 + sqrt(3)2). -3sqrt(3) Simplify -5 + (sqrt(5) - sqrt(5)-2) + ((sqrt(5) + -1)*2 + -3 - sqrt(5)) + sqrt(5). -2 + sqrt(5) Simplify 1((sqrt(190) + 5sqrt(190)-2)/sqrt(10))*23. 4617 Simplify 3 + (sqrt(1539) + -1)*2. -18sqrt(19) + 1543 Simplify -4(sqrt(99)/(sqrt(9)1))*2. -44 Simplify sqrt(152)/(-2sqrt(800)). -sqrt(19)/20 Simplify (-5(sqrt(80) + sqrt(80) + (sqrt(80) + 1)6)3)2. 86400sqrt(5) + 1160100 Simplify -2(sqrt(6)/sqrt(2))2 + (sqrt(12)/sqrt(4)-6)2. 102 Simplify ((sqrt(44) - sqrt(264)/sqrt(6))/sqrt(4) + (sqrt(66)/sqrt(3))/sqrt(2))2. 11 Simplify (sqrt(22)/((sqrt(121)4 - sqrt(121))/sqrt(11)))2. 2/9 Simplify sqrt(1700) + (0 + sqrt(1700) - sqrt(1700)) + -1. -1 + 10sqrt(17) Simplify 3-5(sqrt(3) + 4 + 0). -60 - 15sqrt(3) Simplify (sqrt(6171) - (sqrt(6171)-1 - sqrt(6171)) - sqrt(6171) - sqrt(6171))/sqrt(3). 11sqrt(17) Simplify sqrt(85)/(-3sqrt(5)) - (sqrt(17) + -1sqrt(1377)). 23sqrt(17)/3 Simplify ((sqrt(468) - sqrt(468)1) + -1 + sqrt(468)1 + -4)*2 + 5. -60sqrt(13) + 498 Simplify ((sqrt(108)-1)/sqrt(6))/(1sqrt(1296)). -sqrt(2)/12 Simplify (sqrt(99)-2 + -2 + sqrt(11) + 2)2. 275 Simplify ((2sqrt(1088))*2 + sqrt(17) - (sqrt(17) + -2 + 4))2. 8700 Simplify (-5(sqrt(204)2 + sqrt(204)) - sqrt(204))/(sqrt(1452)-1). 16sqrt(17)/11 Simplify ((sqrt(26) + (-2sqrt(26)-6 - sqrt(26)))/(sqrt(72) + sqrt(72)1 + sqrt(72)) + 2)2. 8sqrt(13)/3 + 88/9 Simplify 1(4 + sqrt(637)) + -1. 3 + 7sqrt(13) Simplify 1 + (sqrt(891)2 + 1 + (1(sqrt(891) + 0) + sqrt(891) - sqrt(891)))*2. 54sqrt(11) + 8021 Simplify (sqrt(119)2)/sqrt(7) - (sqrt(17) + (-3(sqrt(17) + sqrt(272)))*2). -3825 + sqrt(17) Simplify (-3 + (sqrt(242) + 0)5 + -1)*2. -440sqrt(2) + 6066 Simplify sqrt(320)-2 + -3. -16sqrt(5) - 3 Simplify (-2sqrt(3000))/(sqrt(40)/sqrt(36)). -60sqrt(3) Simplify (((sqrt(720) + (-1sqrt(720) - sqrt(720)))/sqrt(12))/(sqrt(24)/(-2sqrt(2))))*2. 20 Simplify (-4(3 + sqrt(11)) - sqrt(11) - sqrt(11))2 + ((sqrt(99))2 + -1 - sqrt(11)). 143sqrt(11) + 638 Simplify 5((sqrt(128) + 1 + sqrt(128) - sqrt(128))*2 + -5) + 0. 80sqrt(2) + 620 Simplify ((sqrt(3) + 2)-5)2 - (-1 + sqrt(108)). 94sqrt(3) + 176 Simplify (-2(sqrt(243) - (-4 + sqrt(12)/sqrt(4))))2. 256sqrt(3) + 832 Simplify sqrt(171)/(sqrt(54)/sqrt(96)). 4sqrt(19) Simplify ((-1sqrt(1200))/sqrt(6))*2 + 2. 202 Simplify (sqrt(84) + 3sqrt(84)1)/(sqrt(12) + sqrt(60)/sqrt(180)). 24sqrt(7)/7 Simplify 4 + -2 + 2sqrt(320). 2 + 16sqrt(5) Simplify 0 + sqrt(17)4 - (sqrt(612) - (sqrt(612) + -2)2). -26sqrt(17) + 616 Simplify (-2 + sqrt(117) - sqrt(13))-2. -4sqrt(13) + 4 Simplify 6(sqrt(1008) + -1) + 3. -3 + 72sqrt(7) Simplify sqrt(68)/sqrt(4) + 4 + -1. 3 + sqrt(17) Simplify sqrt(209)/((2sqrt(121))/sqrt(11)). sqrt(19)/2 Simplify sqrt(700) + -1sqrt(700) + 4. 4 Simplify (sqrt(104) + (sqrt(104) + -6sqrt(104)3 - sqrt(104)) + sqrt(104))/(-4(sqrt(72) - sqrt(8))). 2sqrt(13) Simplify (sqrt(132) + sqrt(132)-1)/sqrt(12) - 3sqrt(99). -9sqrt(11) Simplify -1(sqrt(26)/(3sqrt(2)) - sqrt(13))1. 2sqrt(13)/3 Simplify ((-1sqrt(110)2 - sqrt(110)) + sqrt(110))/(sqrt(20)/sqrt(2)-2). sqrt(11) Simplify (5 + (sqrt(700) - sqrt(700)-2-6) + 2 + sqrt(700)1)2. -1400sqrt(7) + 70049 Simplify 5 + 0 + sqrt(396) + 4 + 1. 10 + 6sqrt(11) Simplify 2-3sqrt(6)/sqrt(3). -6sqrt(2) Simplify (4(sqrt(11) + 0 + sqrt(11) + sqrt(11)))2 + sqrt(11) + (sqrt(396) + 0)2 + -3. sqrt(11) + 1977 Simplify ((22sqrt(78))/(-1sqrt(6)-3))2. 208/9 Simplify sqrt(14)/((sqrt(2) - sqrt(4)/sqrt(2)) + sqrt(2)) - 62sqrt(7). -11sqrt(7) Simplify 1(4 + sqrt(2) + 0). sqrt(2) + 4 Simplify (sqrt(91) + sqrt(91) + -2sqrt(91)3)/(sqrt(7) + sqrt(70)/sqrt(250)). -10sqrt(13)/3 Simplify (3sqrt(1377)-2)*2 - (sqrt(1377)2 - (sqrt(17) - (sqrt(68) - (sqrt(68) + (sqrt(68) - (sqrt(68) - (0 + sqrt(68) - sqrt(68))) - sqrt(68))))*2)). -17sqrt(17) + 49504 Simplify (sqrt(3) + (sqrt(12) - sqrt(12)-2))6 - (sqrt(3888) - (sqrt(3888) - sqrt(3888)2))/sqrt(9). 18sqrt(3) Simplify ((sqrt(90)-1)/sqrt(2))/sqrt(9). -sqrt(5) Simplify (sqrt(63)/sqrt(9)2 + (sqrt(567) + -2 - sqrt(567)))*2. -8sqrt(7) + 32 Simplify -5 + sqrt(24)/(sqrt(40)/sqrt(5)). -5 + sqrt(3) Simplify sqrt(128) + (5(-1 + sqrt(128)))2 - (0 + sqrt(128) + -1). -400sqrt(2) + 3226 Simplify -4 + sqrt(2448) + -2. -6 + 12sqrt(17) Simplify 5(sqrt(11) - (sqrt(11) + (1 + sqrt(11))*2))6 + -4. -364 - 60sqrt(11) Simplify (5 + 2sqrt(76)/sqrt(4))-5. -10sqrt(19) - 25 Simplify -5 + sqrt(24)/(sqrt(72)2). -5 + sqrt(3)/6 Simplify (sqrt(77) + sqrt(77)-11)/(-4sqrt(396)). 0 Simplify sqrt(110)/(sqrt(360)-4). -sqrt(11)/24 Simplify ((sqrt(110)4)/sqrt(2))/sqrt(5) + 5. 5 + 4sqrt(11) Simplify (sqrt(136)-2-5)/((sqrt(800) - sqrt(800)1) + sqrt(8)). 10sqrt(17) Simplify (sqrt(52))2-1 + sqrt(468) + sqrt(468) + sqrt(468)-2. -52 Simplify ((-3 + sqrt(19) + -2 - sqrt(19)) + (sqrt(152)-5)/sqrt(8))*2. 50sqrt(19) + 500 Simplify (1sqrt(20)/sqrt(4))2 + (sqrt(20)/sqrt(4) + 5)2. 10sqrt(5) + 35 Simplify (5-1sqrt(99))/sqrt(9). -5sqrt(11) Simplify (sqrt(120)/sqrt(80))/(6sqrt(48)/sqrt(4)). sqrt(2)/24 Simplify 2(1 + sqrt(243)) - 6(1 + sqrt(243)). -36sqrt(3) - 4 Simplify (-2(sqrt(300) + -1 + sqrt(300)) - -6(-1 + sqrt(300)))2. -160sqrt(3) + 1216 Simplify (sqrt(95) - (sqrt(95) - -51sqrt(95)))/((sqrt(20)/sqrt(4) - sqrt(5) - sqrt(5))3). 5sqrt(19)/3 Simplify sqrt(4)/sqrt(32)1. sqrt(2)/4 Simplify 4(sqrt(605) - ((sqrt(605) - (sqrt(605) - sqrt(605)2)2) + sqrt(605) - sqrt(605)))-32. -14520 Simplify 2sqrt(38)/(-1sqrt(14)/sqrt(7)). -2sqrt(19) Simplify (-3sqrt(88)1 + sqrt(88))/sqrt(8). -2sqrt(11) Simplify (3((-2sqrt(114) - sqrt(114)) + sqrt(114)) - sqrt(114))/(sqrt(216)-1 + sqrt(6)). 7sqrt(19)/5 Simplify -3(sqrt(3) - sqrt(12)-5)-2. 66sqrt(3) Simplify (-5(-5 + sqrt(931) + 1 - sqrt(931) - (sqrt(931) + -3 + -2sqrt(931))))2. -350sqrt(19) + 23300 Simplify (-2*sqrt(1539) + 5 + 1)	{ "pile_set_name": "DM Mathematics" }
mplify (((bb(-5)b)/b)*(-5/3)(b/(bb(2/17)))(-1/5))(6/31) assuming b is positive. b(3412/2635) Simplify (k(2/17)kkk(1/4))/(k(-2/3)/k)*50(k8/(k1/k))(-15) assuming k is positive. k(-6997/204) Simplify ((t*(-9)t*(-9)/t)/(tt(-1))39)/(t*4t*5t)(-39) assuming t is positive. t371 Simplify ((j*(1/6)j)/jj(-3))(-1/43)/((j(1/13)/(j0/j))/(j0j(-7)/j)) assuming j is positive. j(-30223/3354) Simplify (k1/k)(-5/14)k(-3)/k(-2/7)(k*(-1)k(-1/2))/(k1)(-19/6) assuming k is positive. k(-22/21) Simplify ((c/(c*5cc))/(c/c(2/9))c4/(c/c(-3)))/((c(2/5))43/(c1)(-39)) assuming c is positive. c(-2834/45) Simplify z(-1/4)/(((z/z*4)/z)/z)(z/z*3)/zzz(-4)(z(z/z0)/zzzz)*(-1/18)/(((zzz(2/5))/z)/z)(-40) assuming z is positive. z(523/36) Simplify ((hh*2h*(-6/5)h)/(hh4hh(-4)))/(h1/(h/(h/((hh(-5/4)/h)/h))))(-50) assuming h is positive. h(1633/10) Simplify ((a(-1/5)/a*(-2/7))/((aa/(a*4a))/aaa(1/9)))/(a(4/5)/a(aa*(-3/2)a)/a)(-2/23) assuming a is positive. a(4222/1449) Simplify (k*5/(kkkk*(5/4)kk))39/((k0)(6/7)/(k(4/7)/((kk7/k)/k))) assuming k is positive. k(-1517/28) Simplify (l(-15))(-4/11)/((l/(l/l*(1/50)l))/(l*(-17)l)) assuming l is positive. l(-5261/550) Simplify (((m(-2)m)/(m/(mmmm*(-1/5)))(mm/(m/(m(-1/4)/m)))/m(6/7))(-27))(5/9) assuming m is positive. m(129/28) Simplify ((l/((l/(l(1/5)ll))/l))/((ll*(-3))/l)(l0)(-37))/(ll/(l/(l/l(-3)))l*(-1/5)/l(l*(-1/4)l)(11/4)) assuming l is positive. l(27/80) Simplify (l(-2/7))17/(l*(3/8)ll1)(l*(1/2)l/(l/(ll(-3/4))))5 assuming l is positive. l(-195/56) Simplify ((((m(m/(mmm/m*6))/m)/(m/(m/(mm(2/9)))))(-2/15))(3/11))(-13) assuming m is positive. m*(130/99) Simplify (((jj/(j*(-9)/j)jj/(j/(jj(-7))))/(j(8/3)j6))(4/11))(-32) assuming j is positive. j(640/33) Simplify (((z/z(-3/5)z/(z*5z))/((z*(-6)/z)/zzz2))(3/5))34 assuming z is positive. z(816/25) Simplify ((m30)38m*(-3/28)/mm*49m)19 assuming m is positive. m(632491/28) Simplify ((y/y(-1/13))(-24)y(-1/2)y(-1/12))40 assuming y is positive. y(-41230/39) Simplify ((f(-21)/f38)/(f31/((f*(-20)/f)/ff)))7 assuming f is positive. f(-777) Simplify ((h*4h)/h(5/8))(-10)h(-5)/(h(h(h(h/(h*(-3/8)/h))/hhh)/h)/hh)(h1)(-30/13) assuming h is positive. h(-5869/104) Simplify ((m0m)(3/23))(-4/13)/((mm(m/m*(-2/7))/mmm)(-3/37)((mm/(m/(mm*(-6/7)m))m)/m)/m4) assuming m is positive. m(167621/77441) Simplify ((g(-1/3)/g)(-1/24)(g*(-3)g)/gg(ggg*(1/2)g)/g)/((g*(2/19)gg/(g/(gg*8gg)gg))/(g(-6)g(-6)/g)) assuming g is positive. g(-3856/171) Simplify (((b*(-2/17)b0)/(((b(-2/31)/b)/b)/b(5/4)))(-35))(3/16) assuming b is positive. b(-707595/33728) Simplify ((w(ww*(-1/3)w)/w)(2/71))(2/29)/(((ww(2/3))/w)(2/63)w*(-7)www/(ww(-6/7))) assuming w is positive. w(1605221/389151) Simplify (i1/(i(-1/15)i))/(i(-2/7))(-22)((i(2/9))(-14/5))(4/7) assuming i is positive. i(-2071/315) Simplify ((hh*1)/((hh*(-1/4))/h)(hh/h0hh)(-2/75))/(h/h(-10)h(-2/3))(-1/23) assuming h is positive. h*(5963/2300) Simplify (uu*(-1/2)u/u(-2/5))(2/23)(u(-2/5)/(uu0))/(u0)(-2/15) assuming u is positive. u(-142/115) Simplify ((r*(-1/4)r)22)(-8)(r/r(-2/5)r)*(2/83)/(((rrr(rr1)/rr)/r)/r)(-4/11) assuming r is positive. r(-597336/4565) Simplify ((z(-1))(-25)z/(z/(zzz(1/5)z)z)z/(z*(1/9)z))/((zz/z(-1/2)z)(-41))(-41) assuming z is positive. z(-527077/90) Simplify z(-28)/zz(-2)(z*(10/3)zz)/(zzz((z*31/z)/zz)/zzzz) assuming z is positive. z(-182/3) Simplify (((j4/(jj(-6)))41)(1/31))(15/11) assuming j is positive. j(5535/341) Simplify (u/u1u/u(-1/6)(u(2/9)/u)/u(-1/7))/((uu/u(3/7))/u(2/5)(uuu*(1/4)u)(-32)) assuming u is positive. u(65117/630) Simplify ((u2/u)17)*(-4/5)(u*(-6)uu(1/2))/(u/(u/(u/((uu*(-2/9))/uu))u)u)(-1/5) assuming u is positive. u(-325/18) Simplify (j*21/jj*(-7)(j/j*21)/(jj15))(1/21) assuming j is positive. j*(-23/21) Simplify (((u/(uu*(-3/7)u)u)/u)/(u/u0)(u/(u(1/3)/u))(-25))/(u*(-3/2)/uu(u(-6/7)u)/uuu(-7)/(u/(u1u))) assuming u is positive. u(-1507/42) Simplify ((d(-4/15)/(dd/(d/d(2/9))))/(d/(d/d(-1/17)))(14/9))(1/24) assuming d is positive. d(-1069/18360) Simplify ((q(2/35)/(qqq(-31)))41)(-7/8) assuming q is positive. q(-41697/40) Simplify ((bb(2/9)b)(25/3)/(b/(b(-16)/bb)b/(bb(9/2))))(13/2) assuming b is positive. b(4225/108) Simplify hh/h*(-25)(h/h*19)/h(h(9/5)/h)/h(2/3) assuming h is positive. h(122/15) Simplify ((s/(s/(s5s)s))*(2/11)/((sss7s)/(ss(2/15))))(-4) assuming s is positive. s(5252/165) Simplify (((z/(z(-1/3)z))/zz)(2/33))(-2/35)/(((z/(zz*(-4/7)zz))/z5)/(z((zz(-1))/z)/zzz/(z/z4z))) assuming z is positive. z*(32666/3465) Simplify (((qq*(-2/9)q)/(qqq*(1/13)qq))/(q8)(-48))(-25) assuming q is positive. q(-1116475/117) Simplify ((c/((cc*(-3/8)c)/c))/cc(-6))24/(c/(c(4/7)/c)c*(-6)c*(2/3)cc/((c3c)/c)) assuming c is positive. c(-3236/21) Simplify (((f/f0)/f)*(-4/9)f*(-4)/ff*(-1)/f)/((f(f/(f/(f/(f*3/f)ff)))/fff)(2/13))(-15) assuming f is positive. f(-1/13) Simplify (((p(16/7)pp)/((((p(-12)p)/p)/p)/p))/((p*(-4)p)/((p*(-1/18)p)/p)))(2/49) assuming p is positive. p(2675/3087) Simplify (o*(-4)o*33)/(oo*9((oo/(o(o*(-19)/o)/o))/o)/oo) assuming o is positive. o(-2) Simplify ((m(6/11)m)(-2/57)/((m/(m(-26)mm))/(m/m(6/17)m)))(-6/13) assuming m is positive. m(498994/46189) Simplify (l*(-2)l(-2/3))(-1/11)/(l*(3/4)ll(3/4)(l*7/l)/(l(l(ll/(l(-2/5)/l))/l)/l)) assuming l is positive. l(-1603/330) Simplify (((((oooo(-21)o)/o)/o)/o*(-1/35))/(o/(oo*(-2)o))(2/53))(-34) assuming o is positive. o(1198908/1855) Simplify (r(-2/17)/rr/(r/((((rr*(-7)r)/r)/r)/r))r)(-2)/(((r/r(-1)r)/(r/(r/(r5/r))))/(r(2/3))(1/10)) assuming r is positive. r(4412/255) Simplify ((h(-1)/h)37(h(h/(hhh/h(1/2)))/h)(32/7))/((hh/h(-5/2)h2)/(h(-2)/hh/(h/(h/(h/(hhh5h)))))) assuming h is positive. h(-1153/14) Simplify (o/o(1/4))45/((((o(-2/3)oo)/o)/o)/(o/((o*0o)/o)))(((o/o(-5)o)/o)/(o/(o14/o)))(5/4) assuming o is positive. o(695/12) Simplify ((f4f8)/(f5fff/f16))(-10/9) assuming f is positive. f(-200/9) Simplify ((k(-6))*3k*(2/5)k11/k)35 assuming k is positive. k*(-266) Simplify (((yy/(y/y*(-13/6)y))/(y(-2/37)/y))/(y(-26)y(1/4)/y))(2/85) assuming y is positive. y(11383/18870) Simplify ((t(-1))(-20))(-32/5)t/(tt/(t(4/3)/t)ttt)t(-1)(((tt(1/3))/t)/t)(8/9) assuming t is positive. t(-3598/27) Simplify (k(-17/5)/(kk*16)(k/(k/(kkk/k*8)k))(-10/13))9 assuming k is positive. k(-9234/65) Simplify ((r/r(-1)rr*21rr)(1/5))40 assuming r is positive. r208 Simplify (((aa/(a/(a/(aa/((aa*25)/a))a)))/a(15/2))/(a(-31))(-4/5))(-13) assuming a is positive. a(819/10) Simplify ((j(-1/4))(-24))(-14)/(((j/(j*1j))/j(-3))/(j(-3)/j2)) assuming j is positive. j(-91) Simplify (u*(5/7)uu11)26(u(2/7))(-15/2)u(-2)(u(-7)/u)/u assuming u is positive. u(2222/7) Simplify ((ii(-2/7))14/(i(2/5))33)/((i/(i/i(1/8)))/i(-2/11))(-17/3) assuming i is positive. i(-643/440) Simplify (((b(2/15)/(bb/(b(-1/11)/b)))(2/79))(-5/13))(2/25) assuming b is positive. b(1952/847275) Simplify (y(1/4)/(y*(2/5)y)y(-28)yy(3/8))(3/20) assuming y is positive. y(-3333/800) Simplify (ss*(-1/8)s*(-1/4)s*(5/2)s*(-2/9)/ss)/(s9/s(-2/33))(-48) assuming s is positive. s(346747/792) Simplify ((f(3/25)/(f19f))(14/15))(3/2) assuming f is positive. f(-3479/125) Simplify ((z/(z/z(-1)))(-30/7))(6/35)(z/(z*(-2)/z)zz2z)**(	{ "pile_set_name": "DM Mathematics" }
t f = 236 + -234. Suppose -4d = -fc + 7c - 32, -c = 2d - 10. Solve b - db = -10 for b. 5 Let z = 42 + -35. Let h(m) = 2m*2 - 9m - 10. Let c be h(z). Solve 0 = -5u - 0u + c for u. 5 Let d = 4080 - 4080. Solve -37 = -37g - d for g. 1 Let p be 13 + 171/38(-40)/(-18). Solve 11t = pt - 72 for t. 6 Let o(n) = -n - 8. Let a be o(-10). Let j = -2 + a. Suppose -4 = -jg - 2g. Solve gy + 3 = 9 for y. 3 Let n(f) = -f + 27. Let w(d) = 2d - 45. Let j(y) = 5n(y) + 3w(y). Suppose -4k = -9k + 10. Let h be j(k). Solve h + 2 = -4m for m. -1 Let f(b) = b3 - 13b*2 - b + 13. Let x(q) = 4q*2 + q - 5. Let o be x(2). Let s be f(o). Solve sd = 5d for d. 0 Let z = 4021 - 1602. Solve 2420r - 3 = zr for r. 3 Let k be (-3 - (-65)/25)-15. Suppose -p = -km + m + 15, -3m = -5p + 13. Suppose -2g = 5d - 62 + 24, g - m = 0. Solve -4x - 10 - d = 0 for x. -4 Let n be 1 + 11 - -25(-12)/(-30). Solve -92v = -103v - n for v. -2 Let o be (-736)/(-28) - (-4)/(-14). Let v = o + -23. Let p be (-2 - (-8)/(-8)) + 4. Solve vz = -8 - p for z. -3 Let a(w) = -w*2 + 3w. Let m be a(3). Let q = -100 + 95. Let i be (-1)/((-1)/10) - (q + 9). Solve m = -0j - 2j - i for j. -3 Suppose 9k - 112 = -40. Suppose 4m + k - 28 = 0. Solve mn = -15 - 5 for n. -4 Let j be (51 + -53 - (-2 - -8))(-3)/2. Solve -20s + 68 = -j for s. 4 Suppose -21k = 23k + 616. Let a(m) = 2m*3 + 32m*2 + 57m + 18. Let t be a(k). Solve -tl + 4 = -4 for l. 2 Let a(n) be the first derivative of -n3/3 - n2/2 + n + 1. Let y(d) = -4d*2 + 5. Let c(g) = 5a(g) - y(g). Let f be c(-4). Solve -8 + 0 = fw for w. -2 Let r = 12795 - 12726. Solve rk = 67k - 8 for k. -4 Let g(n) = -n3 - 25n*2 + 97n + 364. Let f be g(-28). Solve -126x + 75x + 102 = f for x. 2 Suppose 4m - 17 - 3 = 0. Let c(h) = h2 - 4h - 1. Let q be c(m). Solve -qb = -2b for b. 0 Suppose 47 = 5l - 48. Suppose -b + l - 13 = 0. Solve -b = 2o - 4o for o. 3 Suppose 0 = 7z + 266 - 77. Let u = 27 + z. Suppose u = -2s - 4n + 11 + 13, s - 24 = n. Solve c + 4c = s for c. 4 Suppose 10r - 3n = 12r - 17, 0 = -4r - n + 9. Let h(d) = -d2 - 8d + 7. Let y be h(-9). Let l be y + (-1)/1-5. Solve r = -lw + 4 for w. 1 Suppose 21n - 375 + 119 = -11n. Solve -100w + 102w = n for w. 4 Suppose -4 = 4n, 5j + 9n = 6n + 187. Solve jq - 18 = 20q for q. 1 Suppose -8a = -7a - 4. Suppose -2y = -3t - t - 2, -5t + a = 4y. Let d be 2/7 - 24/(-14). Solve -v - y = d for v. -3 Let g be 12/4 - (4 + -7). Suppose 2m = 5w - 40, -gw + w + 40 = 5m. Solve -3 = -wy + 13 for y. 2 Let p(f) = 25f*2 - 10f + 10. Let u be p(2). Let d be u/(-24)(4 - (18 + -2)). Solve d = 5a + 20 for a. 5 Let y = 432 - 436. Let m be (y/(-6))/((-2)/(-30)). Let n be (-1)/(-3) + 3/(-9). Solve 5f - m = -nf for f. 2 Let g be 2890/65 - 624/1352. Solve -44p - g = -132 for p. 2 Suppose 0 = 4u - u - 6. Let z = u + 1. Let a be ((-2)/(-4))/(9 + (-153)/18). Solve -zi + 5 = -a for i. 2 Let o = -6932 - -7092. Solve 153l = ol + 21 for l. -3 Suppose -97 = -q + 5i - 115, 3i = -q + 22. Solve -qc = -38 + 17 for c. 3 Suppose 176k + 1833 = 223k. Solve 34y + k = 5 for y. -1 Let q(v) = v3 + 10v*2 + 15v + 3. Let d be q(-2). Let l(k) = -3k3 + k2 + k. Let t be l(-1). Solve 0 = 4b - d - t for b. 2 Suppose 3z - 5v = 73, -2z + 16 + 42 = -v. Let m = z + -28. Solve 0 = -p + 4p + m for p. -1 Suppose -4n + 50 = -13d + 16d, 0 = 4d + 3n - 48. Solve -121m + 118m - d = 0 for m. -2 Let p(m) = -2m - 18. Let z be p(-5). Let r = z + 12. Suppose -v = -rq + 15, v = -0q - 2q + 9. Solve b - 15 = -qb for b. 3 Suppose -45g - 215g = -6760. Solve -gn + 52 = 234 for n. -7 Let n(d) = 3d + 2. Let m be n(0). Suppose x + l = 3, 4x = mx + 2l + 18. Suppose -2 - x = -2t. Solve 4 = -5p + tp for p. -4 Let i = 94 - 74. Let o be (7 + -3)(5 + (-55)/i). Solve 2z - oz + 21 = 0 for z. 3 Let m = -5 - -6. Let j(z) = -2z*3 - 13z*2 + 10z + 17. Let p be j(-7). Let x be (-9 - p - -5)2/8. Solve x = -6b + 5b + m for b. 1 Let n = 2545 - 2541. Solve ny - 17 = -37 for y. -5 Suppose -17991h - 135 = -17994h. Solve hb + 95 = -220 for b. -7 Suppose -3 = 4g - 5g. Suppose -4y - 11 = -4b - g, -4y = 3b - 13. Suppose -16 = -bh - 4r, 4r - 2 = -4h + 18. Solve -hi + 5 = 13 for i. -2 Suppose -4x - 165 - 55 = 0. Suppose 0 = -0b + b - 1. Let g be (-74)/(-10) - b - 33/x. Solve -p = 3 - g for p. 4 Suppose -95 = -5i - 4u, 4u + 45 = 4i + 5. Let n = -46 - -41. Let m be ((-96)/120)/(1/n). Solve -mo = 1 + i for o. -4 Let w(k) = k2 - 9k + 54. Let a be w(8). Suppose -26 = 5v - a. Solve 15t + v = 11t for t. -1 Let x(v) = v2 - 5v + 7. Let j(g) = g - 9. Let w be j(14). Let m be x(w). Let o = -171 + 174. Solve -m = -4s - o for s. 1 Let t = 186 - 186. Suppose 11d - 2 = 10d. Solve -dm - 6 - 2 = t for m. -4 Suppose 3d - y = 3y + 50, 2y - 2 = 0. Suppose u = 4g - 94, g + 134 = -10u - 16u. Suppose -gh + 12 = -dh. Solve -hi = -5i - 8 for i. -4 Let p(y) = 6y2 + 4y - 5. Let h(k) = -k*2 - k. Let z(g) = 5h(g) + p(g). Let t be 2/1(0 + 2). Let a be z(t). Solve -aj = -3j for j. 0 Let r = 3360 - 3357. Solve 0 = 6g + rg - 27 for g. 3 Suppose 6d + 14j - 132 = 19j, -2j = 5d - 110. Solve -53z + dz = 0 for z. 0 Suppose 4v - 5y - 564 = 0, 3v - 245 = 5y + 183. Solve -21d - v = 32 for d. -8 Let w(a) = -5a + 114. Let n be w(22). Suppose 4s = 2r - 56, s = -nr - 2s + 68. Solve 6q - 2q = r for q. 5 Let d be (2 + -3)/((-6)/462). Solve -21z - 35 = -d for z. 2 Let x be 2 + 1 - (4 + 1). Let u be (1/x)/(7/(-56)2). Solve uz - 6 = -z for z. 2 Let y(n) = 2n2 - 18. Let d be 7/((-77)/31) - (-4)/(-22). Let p be y(d). Let q(h) = h2 - 4h + 4. Let z be q(7). Solve 2m + 3m + z = p for m. -5 Suppose -1506a - 986860 = -1718a. Solve -11k = a - 4589 for k. -6 Let h(r) = -r*3 - 7r*2 - 8r + 7. Let v be h(-5). Let c be (v - 10/(-4))(-8 + 0). Suppose 0 = -cb + 2 + 6. Solve bf = -f for f. 0 Let f = -1742 - -1826. Solve 7g = -14g - f for g. -4 Let o be -318 - 3/(5/(-5)). Let z = o + 321. Solve -z = 4r - 26 for r. 5 Let p = 17684 - 17672. Solve pm = -30m + 168 for m. 4 Suppose 1070 = 5d - j - 1015, 4d = -5j + 1697. Let k = 422 - d. Solve -4 = kw - 0 for w. -1 Let f be 86/(-301) - (-1852)/14. Let u = 137 - f. Solve u = a + 3 for a. 2 Let l = -7959 + 8023. Solve -34c + 302 - l = 0 for c. 7 Suppose t = -0t. Let n be (-2)/4 - (-18)/(-36). Let i be ((-10)/(-2) - t) + n1. Solve 6q = 2q + i for q. 1 Suppose -2846d - 6570 = -2919d. Solve -26p - d = 92 for p. -7 Let x(h) = -h*2 - 53h + 1958. Let u be x(25). Solve -ul = -5l for l. 0 Let r be (-68)/(-20) + 2/10-2. Solve -14i = 73 - r for i. -5 Let t(f) = -2f2 - 60f + 16. Let d be t(-29). Solve 28 = du - 67u for u. 4 Suppose -2p - 12 + 148 = 3x, -3x + 4p + 124 = 0. Solve 0 = 2v - 52 + x for v. 4 Let k = -305 - -308. Suppose -24 = kp - 24. Solve py = 6y + 18 for y. -3 Suppose -73k + 115 + 125 + 1366 = 0. Solve 34 - k = -3h for h. -4 Suppose 0 = t + 2h, -4h - 20 = -3t - 0t. Suppose 7f + 6f - 12f = 10. Suppose -fw - tw = -84. Solve 5y = w + 14 for y. 4 Let n = 1028 + -1021. Let q = -231 + 231. Solve -11h + nh - 12 = q for h. -3 Let c = -60 + 62. Suppose -cq = 10, 3q + 1 = i - 14. Solve 3n - 2n + 2 = i for n. -2 Let l be 4/((40/208)/5). Let w be 52/l - (-1)/(-2). Solve 5a + wa + 10 = 0 for a. -2 Let r = -175 + 227. Suppose -rq = 3t - 48q - 26, -4q = t - 6. Solve -n = -t + 8 for n. 2 Suppose 2d + 5p - 57 = 0, 0d - 41 = -d - 5p. Suppose -5w + d = 3w. Suppose 5 = wi - 7. Solve 0n = -2n - i for n. -3 Let j(u) = u3 - u2 + 2u + 8. Let b(d) = -1 + 0 - d + 5 - 2 - d*2. Let x be b(1). Let i be j(x). Solve i = 2s + 4 for s. 2 Let k(b) = -b*3 - 24b*2 - 46b - 35. Let u be k(-22). Let q be -1 + -4 + u + (-2)/2. Solve qg - 20 = -26 for g. -2 Let c be 25 - 9/(-3)1. Suppose -4 = -2a + 4a + 5m, -a + 4m = c. Let i be 1(2 + (-8)/a-3). Solve 6 = -3n - in for n. -2 Let l = -10 + 30. Let d(b) = -b3 + b2 - 6b + 16. Let w be d(4). Let h be (32/w)/((-2)/14). Solve -8n + hn = l for n. -5 Suppose -1022 = -20t - 122. Solve -z + 10z = t for z. 5 Suppose 0 = 2c - 4d - 18, -c + 2d = 3*d. Let u be (0 - -6)/((3/(-2))/(-1)).	{ "pile_set_name": "DM Mathematics" }
c, 0? 1 Let n = -90 - -23. Let q = 5.05186 - 0.05186. Which is the biggest value? (a) -0.4 (b) -3 (c) n (d) q d Let o = 2.917 + -0.007. Let i = o + -2.41. Which is the second smallest value? (a) i (b) 28 (c) 0.1 a Let z = 4.55559 - -0.04641. Let t = 0.398 + z. Let o = -15/76 - 1/19. Which is the third biggest value? (a) o (b) -4 (c) t (d) 10/9 a Let j = 8556 - 8543. What is the third biggest value in j, 2/11, 31/5? 2/11 Let o = -730 + 737. Which is the second biggest value? (a) 23 (b) o (c) 2/3 b Suppose -17f + 93 - 518 = 0. Which is the second biggest value? (a) -2.9 (b) f (c) -0.5 a Suppose -137m = -141m - 40. Let o = 0.09 + 4.91. Let j = o + -5. What is the biggest value in m, -2/9, j? j Let q(b) = 5b - 132. Let l be q(-27). Let n = -276 - l. What is the second biggest value in -1, -3, 0, n? -1 Suppose -401 = 969o + 4541 - 234 + 137. Let x = 0 - 1. What is the fourth smallest value in 1, x, 0.3, o? 1 Let r = 0.147 - -238.853. Let q = r - 246. Which is the second biggest value? (a) -6 (b) 2 (c) q a Let m be 1/(-12) + (-4)/6. Let i = 1605.5 + -1606.8. What is the fourth biggest value in 0.3, i, -0.4, m? i Let y be (-4 + (16184/240)/17)-2. Which is the smallest value? (a) 0.02 (b) y (c) -0.1 (d) 1 c Suppose 0p + 8p = 32. Let j be (-6)/p(-60)/405. Let u = -0.7 + 0.3. What is the biggest value in 4, j, 16, u? 16 Let u = -695.1 - -708.1. Which is the smallest value? (a) u (b) -2.8 (c) -0.1 (d) -4 d Let w be 4/(-6) + 2/(-2). Suppose 5f = -4l + 4, -13l + 8l = 5f. Let h be (1/(-2))/(-1 - f/(-24)). Which is the biggest value? (a) h (b) 0 (c) -1 (d) w a Let x be -2((-3)/21 + -1). Let r = 13/21 - x. Let g = -2.77 + -0.23. Which is the second biggest value? (a) g (b) 0.3 (c) r (d) -4 c Let k = -5.3 + 10.3. Which is the smallest value? (a) k (b) 2/7 (c) 0.1 (d) -81 d Let p = 13075/4 - 3269. What is the third biggest value in p, 15, 0.3, -6, 0.2? 0.2 Suppose 0 = -4i - 6 - 10. Let a = -0.56 + 0.06. Let m be (63/546)/((-15)/20). What is the smallest value in i, a, m, 5? i Let y = -474.2 - -474.7. Suppose 0 = -3m + 6. Let c be (-6)/9m/6. What is the smallest value in 1, c, y? c Let l = 19.01 + 1.89. Let p = l - 15.9. Which is the second biggest value? (a) 1 (b) 0 (c) -2/3 (d) p a Let x = 3085.7 + -3089.7. Which is the third biggest value? (a) x (b) 0.2 (c) -3 (d) 246.3 (e) -5 c Let v = 4.6 - 0.6. Let g(m) = -m*3 + 2m*2 + 58m - 201. Let u be g(6). Which is the smallest value? (a) 0.3 (b) u (c) v a Suppose 1055 = 5d - 5p, 219 = -d + 2d + 3p. Let m = -210 + d. Which is the biggest value? (a) -0.4 (b) m (c) 0.1 b Let r = 320.9 + -43.9. Let m = r + -280. Which is the biggest value? (a) m (b) -2 (c) -0.1 (d) -2/3 c Let y = 0 - -4. Let l = 1.3002 + 1.6998. Which is the fourth biggest value? (a) -3/5 (b) l (c) y (d) 6 a Suppose -2q = 5h + 8 - 4, q - h - 12 = 0. Let w be 0 - (q/3 - 2). Let c = 18551/2 - 9277. What is the biggest value in -3, w, c, -1/4? -1/4 Let a = 4544.6 - 4545. What is the fourth biggest value in 3, -18.1, 1, 5, a? a Let p = 0.088967 - 0.088967. Let m = 83/6 - 27/2. Which is the smallest value? (a) -2 (b) m (c) -0.4 (d) p a Let k = 32/485935 + 20072831/91161406. Let u = 2/335 - k. Let x = 0 + 0.1. Which is the third biggest value? (a) u (b) x (c) 5 a Let m be 44/11 + (-16)/5. Let g = 0.46615 - -0.03385. Which is the smallest value? (a) m (b) 2/19 (c) g (d) 2 b Let n = 26 - 26.24. Let f = -154.3 + 154. Which is the fourth smallest value? (a) n (b) 0.1 (c) f (d) 0.2 d Suppose 23v - 5565 = 1703. Let f = 2215/7 - v. What is the third smallest value in -153, 5, -5, f? f Let l = -522.3 + 473. Let q = -47.3 - l. What is the second biggest value in q, 12, 3? 3 Let p = -0.8 - 4.2. Let m = 33.974 + -28.974. What is the smallest value in p, m, -4? p Let i = -11.889 - -11.689. Let r(l) = l2 - 2l - 3. Let p be r(3). Suppose p = -4u + 11 - 111. Which is the smallest value? (a) -4 (b) u (c) i b Let r = -0.2547 + -0.2453. Which is the third biggest value? (a) -3/4 (b) r (c) -107 (d) 1 a Let c = -14 - -10. Let v = -202.74 - -204. Let x = v - -1.74. What is the third smallest value in c, x, -1/4? x Let k = 339 - 372.6. Let z = 68.7 + k. Let r = z - 35. What is the third biggest value in 0.4, r, -2? -2 Let v = -95 - -94.92. Let z = 1613 + -24197/15. Which is the second biggest value? (a) v (b) z (c) 0 a Let n = -12 + 23. Let m = -121 + 116. Let j = 35.3 + -34.8. What is the third biggest value in j, n, m? m Let n = -0.0328 - 0.4672. What is the smallest value in n, 1/9, 126? n Let k = 31403 - 31403. Let q = -3.2 - -3. Suppose 0 = 5x + 4 + 21. Which is the fourth smallest value? (a) q (b) k (c) -6 (d) x b Let q = -709 + 727. Let s(f) = -4f + 71. Let w be s(q). What is the biggest value in -4, 4, 0.7, w? 4 Let p be 156/104(4 + 50/(-12)). What is the fourth biggest value in p, -1/7, 5, -1, -45? -1 Let l = -2.943 + 3. Let s = l - -73.943. Let j = 76 - s. What is the biggest value in 1/10, -1, j, 2/3? j Let i = -0.05 + -0.53. Let o = 1.38 + i. Which is the biggest value? (a) o (b) -3 (c) -5/6 a Let m(t) be the first derivative of t*3/3 + 9t*2 - 60t - 92. Let o be m(-21). What is the smallest value in o, -0.1, -33? -33 Let b = 28.73 - -38.93. Let a = b - 0.66. Let i = -72 + a. What is the smallest value in i, 5, -2? i Let t = 226 - 224. Let v be 348/108 + t + 5/(-1). Which is the third smallest value? (a) -1 (b) v (c) 4 c Suppose -h + 0w = -w - 3, 5w = -2h - 1. Suppose 0s - 3s = 0. Suppose sf = -4f - 20. Which is the second biggest value? (a) h (b) f (c) 3 a Let v = 30 - 17. Let g = -197.6 + 199.6. What is the third smallest value in 0, v, g? v Let s = 2440 - 36602/15. What is the smallest value in -0.5, s, 23, 2? -0.5 Let j = -145.54 - -145.44. What is the smallest value in j, 9/2, 3/7, 115? j Let f = -0.7615 + -1.3385. Which is the biggest value? (a) f (b) -2 (c) 759 c Let i be (39/130)/((-6)/5). Let o = -14309 - -14309.3. Which is the smallest value? (a) o (b) i (c) 0.06 (d) -1/7 b Let a = 0.66 + -0.36. Let z = 142 + -992/7. Let q = -499 + 14469/29. What is the third smallest value in 5, a, q, z? a Let t be 13/(-21) + 1/3. Let u = 1.02456 + -1.22456. Let z = -0.11 + 0.05. What is the second biggest value in u, 2, z, t? z Let c = 38 - -360. Let f = c + -397.9. What is the third biggest value in -0.04, f, -3, -0.1? -0.1 Let y = -34 - -59. Let r = 3.12 + 24.88. Let t = y - r. What is the second smallest value in -5, t, 1? t Let v = 74.8 + -75. Let f = 2/531 + 2114/2655. What is the fourth smallest value in -7, v, 0.1, f? f Let p be (-33)/9(-88)/(-484). What is the smallest value in -0.4, 0.3, p, -22? -22 Let h = 0.0179 - 2.0879. Let u = h - -1.57. Which is the third smallest value? (a) -0.1 (b) u (c) -6 a Let m = -11.554 + -0.246. Let u = m - -8.8. What is the third biggest value in u, 1/2, 13? u Suppose 0 = -5v + 10v - 525. Let p = 109 - v. Let h(u) = -3u + 2. Let t be h(2). What is the third smallest value in -1/3, 1, p, t? 1 Suppose 24s - 124 = -258 - 394. What is the biggest value in s, 77, -1? 77 Let q = 340 + -1702/5. Suppose 1 = 4s - 7. Suppose t + 3 = -4p + sp, 4t - 2p - 28 = 0. Which is the third smallest value? (a) t (b) q (c) -3 a Suppose 2r - 4o - 84 = 0, 2o + 170 + 28 = 4r. Suppose -r = -4p - 8. What is the third smallest value in -2, 1/10, p? p Let g = -527 + 416. Let t = g - -108.4. Which is the third smallest value? (a) -8 (b) -3 (c) t c Let i = -0.01033 + -0.38967. Which is the fourth smallest value? (a) -1/2 (b) -7 (c) -6 (d) 2 (e) i e Let z = -0.04971 - 185.90029. Let d = -186 - z. Let s = -5 - -7. Which is the third smallest value? (a) -4 (b) d (c) s c Let g = 0.21 - 2.21. Suppose 3m = 1 + 2, 4m - 94 = -5*y. Let r be -19 + 18 + y/14. Which is the fourth smallest value? (a) 0.2 (b) r (c) g (d) -0.3 b Let y = -164738/9 + 18304. Which is the second smallest value? (a) y (b) 1/5 (c) -5.91 a Let o be (-133)/28 + 66/6 - 10. Which is the second biggest value? (a) 1/6 (b) 0.4 (c) o (d) 3 b Let a = 6.323 + 1.677. What is the biggest value in -1/3, -2, 5, a? a Let w = 444 - 422.7. Let d = 26.3 - w. Which is the smallest value? (a) 0.2 (b) 1/18 (c) d b Let m	{ "pile_set_name": "DM Mathematics" }
t). 6 Suppose -4p - 7p = -121. Suppose 0l = pl - 44. Let d(h) be the second derivative of -h5/20 + h4/3 - h*3/2 + 3h*2 + h. Give d(l). -6 Let s(p) = -3p*2 + 1. Let u be 2(-3)/(-6)-10. Let t = 7 + u. Let g = t - -4. Calculate s(g). -2 Let j(h) = -h3 + 4h*2 - 5h + 3. Let u(k) = -k2 + 3. Let r(p) = -p2 - 2p - 1. Let i = -9 + 8. Let a be r(i). Let c be u(a). Determine j(c). -3 Suppose -c = 8 + 6. Let n = -15 - c. Let j(y) = -6y*2 + 2y + 1. Let z(x) = -7x2 + 3x + 1. Let f(b) = -3j(b) + 2z(b). Give f(n). 3 Let w be -4(-1 - 4/(-8)). Let v(u) = u3 - 707u*2 - 3 - 2u*3 + 713u*w - 3u. Give v(4). 17 Suppose 15 = 5x, x + 6 - 17 = -4b. Suppose 16 = -2y + 4u, 14 = 4y + 5u - 19. Let g(p) = 2p + 2 - 2pb - p3 + yp - p2 + 0p. Give g(-4). 2 Let w(d) = d*3 - 2d*2 + 3d. Let s(o) = -2o - 6. Let u(t) = -2t - 2. Let y be u(1). Let p be s(y). Determine w(p). 6 Let w(t) be the first derivative of -t6/40 + t5/60 - t*3/6 + 17t2 - 16. Let n(r) be the second derivative of w(r). Give n(1). -3 Let h(u) = -u2 + 23u - 15. Let k be h(22). Let c(b) = b + 1. Let p be c(1). Let o(z) = kz - 7z + zp + z + 3. Calculate o(0). 3 Let j(o) = 36o + 14. Let w(v) = -7v - 3. Let s(f) = -3j(f) - 14w(f). Suppose 3g + 24y - 20y = -15, -4 = -2g + 2y. What is s(g)? 10 Let m(l) = 3l2 + 47l - 17. Let s be m(-15). Let v = s + 47. Let p(i) = -i + 24. What is p(v)? 24 Let g(p) be the first derivative of -p5/5 - p4/12 + p*3/6 + 45p2/2 - 9. Let m(z) be the second derivative of g(z). Give m(1). -13 Let g be ((-2)/8)/((-38)/(-456)). Let q(z) = -z2 - 3z + 4. Calculate q(g). 4 Let s = -28 + 28. Let z(g) = -5g3 + g2 + g + 1. Let c be z(-1). Let b(o) = -4o3 - 3o*3 + 1 + co*3 + o. Give b(s). 1 Let v(q) = -5q*2 + 3q - 4. Suppose 9i - 3i = 36. Let f(c) = c*2 - c + 1. Let m(s) = if(s) + v(s). What is m(4)? 6 Let r(x) be the second derivative of -1/3x3 + 0 + 1/20x*5 + 3/2x*2 + 11x + 1/6x4. Determine r(-3). 0 Suppose -2w - 2l + 3 = -5, -w + 5l = 8. Let u(r) = 7 - 8rw + 2r - 9r + 0r - r3. What is u(-7)? 7 Let k(f) be the first derivative of f3/3 - 15f2/2 + 3f - 42. Calculate k(15). 3 Let j(w) = 12w - 5w - 3 + 5 - 11w + w2. Determine j(4). 2 Let t(r) = 5. Suppose -3n = -s + 3, 17 + 8 = -5s - 5n. Let v(f) = -f + 11. Let h(j) = sv(j) + 5t(j). Calculate h(6). 10 Let c(k) = -k. Let n be c(-6). Let u(m) be the third derivative of 0m + 7m*2 + 4/3m*3 - 1/24m*4 + 0. Determine u(n). 2 Let w = 5457 + -5467. Let q(d) = -2d + 20. Let p(x) = -x + 1. Let b(z) = -5p(z) + q(z). Give b(w). -15 Suppose -a + 2f = 2a - 12, 0 = 4f + 12. Suppose -4p + 13 = 5b, -4p + ab = -3 - 3. Let s(x) = 2x3 - 2x*2 - 3x + 3. Determine s(p). 5 Let j(w) be the second derivative of -4w3/3 + w2 - 20w. What is j(4)? -30 Let d = -17 - -23. Let l = -8 - -11. Suppose 0 = -f - lb - d, -4f - 4b - 11 = 13. Let o(i) = 2i. Calculate o(f). -12 Let s(j) = 4j3 + 2j + 2j2 + 4j*3 + 2 - 1. Suppose 2m = -3m + 20, 3m + 4 = 4o. Suppose 0 = v - 1 - 2, -v = ow + 1. What is s(w)? -7 Let w(q) = -2q + 8. Let o(m) = -m + 1. Let p(g) = 4o(g) - w(g). Let n be p(1). Let s(i) = i*3 + 7i*2 + 7i + 3. Calculate s(n). -3 Let g(f) = -10 - f*2 + 29f - 49f + 28f. Determine g(7). -3 Let s(z) be the third derivative of z*4/8 + 4z*3/3 - 2z*2 - 63z. Calculate s(7). 29 Let i = -48 + 56. Let o(m) = 5m - 5 - 31m + 9m + im - m2. Determine o(-8). 3 Let t(l) be the third derivative of l6/120 - 7l5/60 + 7l*4/24 + 3l*3/2 - 190l*2. Calculate t(4). -11 Let h(u) = 2u*2 + 5u + 6. Let l(f) = -3f - 2f*2 + 3 - f + 0 - 8. Let j(b) = 4h(b) + 5l(b). What is j(-1)? -3 Let k = -306 + 317. Let f(j) = -j2 + 12j - 2. Determine f(k). 9 Suppose 6d - z - 20 = d, 0 = -4z - 20. Let q be (-17)/2 + d + (-15)/6. Let o(m) = -m*3 - 9m*2 - 7m + 9. Determine o(q). 1 Suppose 4d = -0d. Let f = 49 + -47. Let a(p) = p*2 - 11 + 0p*f - 8 + 11. Give a(d). -8 Let q(s) = 2s - 3. Let b be q(3). Suppose -ba + 26 = k + 9, k = 2. Let c(u) = 0u*3 - a - 6u + u3 + u2 - 6u2 + 14. Give c(6). 9 Let a(r) be the first derivative of r4/12 - 3r*3/2 + 9r*2/2 - 2r + 2. Let f(y) be the first derivative of a(y). What is f(6)? -9 Let a(t) = -t - 11. Let m(n) = -218n + 213. Let p be m(1). Determine a(p). -6 Suppose 0 = 28x - 30x + 16. Let s(z) = z2 - 6z - 22. What is s(x)? -6 Let p = -6 + 12. Let y(w) be the first derivative of w*2/2 - 11w + 175. Determine y(p). -5 Let t(w) = 1. Let i(g) = -3g3 - 6g2 + 1. Let d(r) = r3 + r*2 - 1. Let k(x) = -2d(x) - i(x). Let c(z) = -k(z) + 5t(z). What is c(-3)? -5 Let u(a) = -a3 - 5a*2 - 3a + 2. Suppose 3d = -5g, 16d = 11d + 25. What is u(g)? -7 Let d be 9(33/44)/(81/48). Let n(m) = 6m - 5. Give n(d). 19 Let y be (76/(-57))/(2/(-9)). Let c(z) be the second derivative of z3/6 - z. Let u be c(y). Let n(q) = -q2 + 8q - 9. Calculate n(u). 3 Let t(w) = -3w - 10. Let j(o) = 4o + 11. Let s(d) = 2j(d) + 3t(d). Suppose -7c = -8 + 57. Determine s(c). -1 Let x(b) = -14b3 + 14b*2 + 14b + 19. Let j(p) = 5p3 - 4p*2 - 4p - 6. Let s(y) = -11j(y) - 4x(y). What is s(13)? 3 Let n(i) = i - 5. Let h(q) = q*3 - 8q*2 - 2q + 2. Suppose 24 + 16 = 5t. Let a be h(t). Let d(k) = k2 + 13k - 8. Let z be d(a). Give n(z). 1 Let k(c) = 20c3 - 2c2 + 1. Let g(u) be the second derivative of -u5/20 + 2u4/3 - 5u*3/6 - 13u*2/2 + 2u. Let o be g(7). Determine k(o). 19 Let q(x) = -14x + 13x - 15 + 9. Determine q(0). -6 Let j(z) be the second derivative of -z*3/6 - 3z*2/2 + 125z. What is j(-4)? 1 Let g(a) be the third derivative of -a*6/120 - 11a5/60 + a4/12 + 7a3/3 + 38a2. Calculate g(-11). -8 Let s(n) = n2 - n - 3. Let y be s(3). Let d = 6 - y. Let k(f) = -4f2 - 8f + 9. Let t(w) = -5w2 - 9w + 10. Let l(g) = 6k(g) - 5t(g). Determine l(d). 4 Let y = -142 - -147. Let a(c) = 2c2 - 6c - 4. What is a(y)? 16 Let o(d) = 2d2 - 2d - 3. Let a = -437 - -435. What is o(a)? 9 Let k(a) = 13a - 7a - a*2 - 5a. What is k(-3)? -12 Let x(m) = 428m - 214m - m*2 - 2 - 215m + 6. Give x(-6). -26 Let i(m) = -2 - 4m + 5m - 5m + 0m. Suppose 7x - 8x + 4 = -3r, 0 = 5x + 3r + 16. Calculate i(x). 6 Let m(w) = -w3 + w. Let a(g) = -5g*3 + 8g*2 - 5g + 2. Suppose 3i - 14 + 2 = 0, 2h - 3i = -4. Let j(s) = hm(s) - a(s). Calculate j(7). 12 Suppose 2d + 19 = 7. Let i(w) = 3 + 12w - 10w - 4w. Determine i(d). 15 Suppose -f - 215 = -219. Let y(p) = p + 1. Let c(w) = -w*2 - 7w - 4. Let s(q) = fy(q) - c(q). Determine s(-10). -2 Let a(v) = -5v*2 - 1. Let g = 7 + -10. Let z be (54/(-45))/(g/10). Suppose 0 = -x + 3w - 10, -4x + zw = 4 + 12. Give a(x). -6 Suppose -4b - 12 = h + 3h, -31 = 2h - 3b. Let n(u) = u - 7. Calculate n(h). -15 Let f be -8 - -2 - -13 - 7. Let t(i) be the third derivative of 1/24i4 + 5/6i*3 + 0 - 3i*2 + fi. Calculate t(-5). 0 Let v be 13/7 - (-6)/42. Suppose 36 + 1 = -5x + vh, -4 = -4h. Let n(t) = t3 + 7t*2 + t - 10. Determine n(x). -17 Let j be (-4)/(-18)(-117)/(-52). Let z(p) be the first derivative of p + jp2 - 3. What is z(-3)? -2 Let g(j) be the second derivative of -1/3j3 + 0 + j2 - 12j. Determine g(3). -4 Let l = 49 - 47. Let s(p) = 2 + 17p + p*l - 40p + 21p. Calculate s(2). 2 Let p(k) be the second derivative of -k5/60 - 5k*4/24 - 2k*3/3 - 4k*2 + 11k. Let n(t) be the first derivative of p(t). Calculate n(-3). 2 Let f(w) be the second derivative of -w3/3 + w2 - 7w + 7. Suppose 3x + 6 - 30 = 0. Give f(x). -14 Let w(h) be the third derivative of -h*4/8 - 4h*3/3 - 73h*2. Calculate w(-11). 25 Suppose 0 = -y + 4j - 2, 5y + 4j - 15 = -25. Let p(h) = -2h + 5. What is p(y)? 9 Let z(j) = -j3 - j2 + j - 1. Let i be ((-28)/20 - -1)/((-2)/20). Let l be (-3)/((-6)/i + 3). Give z(l). 1 Let d(q) = q3 + 3q*2 + q + 1. Let p = -31 - -36. Suppose 5g = 2k - 30, -g + 15 = pk - 60. Suppose 5c = -k - 0. What is d(c)? -2 Let x(k) = k2 + 3k + 2. Let i(y) = -17 - 3y + 15 + y2 - 3y*2. Let f(g) = 2i(g) + 3x(g). Determine f(-2). -8 Let r(u) = 5u*2 + 4u - 3. Suppose 30k + 0k - 60 = 0. Give r(k).	{ "pile_set_name": "DM Mathematics" }
x*3 - 3x Expand 0 + 2b2 + 0 + (-2b - 3b + 3b)(2b - 4b + b) + 11b*2 - 14b*2 + 15b*2. 16b*2 Expand (5m*2 - 3m*2 + 0m*2)(15 - 22 + 2m - 19). 4m*3 - 52m*2 Expand (-u + 0 + 0)(-4 + 3 + 2) - 3u + 4u - 3u + 50 - 34 + 0u + u. -2u + 16 Expand (0 + 2 + 1)(-3r3 + 5r*3 - 4r*3) + (1 - 1 - 2r*2)(2r + 1 - 1) - 2r*2 - 2r*3 + 2r*2 - 2r*3 + 4r3 - r3. -11r3 Expand (5j*2 - 3j*2 + 0j*2)(-4j2 - 4j*2 + 3j*2) + 5j*4 + 5j - 3j - 25 + 27. -5j*4 + 2j + 2 Expand 4z5 + 6z*5 - 3z*5 + (z - z - 2z*4)(6z + 2z + 0z). -9z*5 Expand 5p*3 - 3p*3 + 0p*3 + (-3p - 2p2 + 3p)(3p + 0p - p) + (-5 + 4 + 3)(5p3 - 21 + 21). 8p*3 Expand (6x*2 - 2x*2 - 3x*2)(-x + 3 - 3)(22 - 37 - 25). 40x*3 Expand ((-3 - 2 + 7)(3 - 4 - 1) + 0 + 2 - 4)(-2n*5 + n - n). 12n*5 Expand -195z*3 + 5z*5 + 195z3 - 2 + (z3 - 3z3 + z3)(-4z2 + 0z*2 + 2z*2). 7z*5 - 2 Expand (-5h + 0h + 3h)(-3h*4 + 2h*4 + 2h*4) + 3h5 - h5 + h5. h5 Expand (0 + 3 + 1)(-3 + 0 + 2)(3c5 - 4c*5 - 3c*5). 16c*5 Expand (-1 + 1 - 1)(3s + s - 5s) + 1 - 1 + 2s + (2s - 2s + 2s)(3 - 1 - 1). 5s Expand (0 + 2 + 0)(4y*3 - 58 + 58). 8y*3 Expand 0 - 2 - 4m*2 + 2m*2 + 3m*2 - 3m*2 + 3m*2 + 5m + 6m2 - 5m + (-3m2 + 2m2 - m2)(1 + 1 - 3) + m2 + 3 - 3. 10m*2 - 2 Expand (45y*2 - 47y - 95y2 + 51y*2)(0 + 0 - 1). -y*2 + 47y Expand (6 - 2z + 0 - 3)(3 - 1 - 4)(-z4 + 2z*4 + 2z*4). 12z*5 - 18z4 Expand (-u3 + 4u3 - u3)(5u - 6u + 5u + (2 - 2 + 1)(-2u + 2 - 2)). 4u*4 Expand 3l + 0l - 2l + (0 - 3 + 1)(5 + 2l - 5) + l + 2 - 2 - 3l + 5l - 4l + (-6 + 5 + 0)(-l + 3l - l) + 2l - 2 + 2 - 2l - 1 + 1 + 5l - 4l + l. -3l Expand (-3m + 7 + 14 - 22)((0 - 2 + 1)(1 - 3 + 1) + 2 - 2 - 2). 3m + 1 Expand (-1 - 3w2 + 2w*2 + 3)(-16w - 17w - 21w). 54w*3 - 108w Expand (-2y3 + 4y3 - y3)(2 - 4 + 6) + (-y + y + y)(-2y2 + 4y - 4y). 2y*3 Expand -4c*3 + 0c*3 + 0c*3 + 0c - 3c3 + 0c + (-4c + 4c - 2c)(5c2 - c2 - 2c*2) + 4c3 + c3 - 7c3 + 4c - 4c - 2c*3. -15c*3 Expand (4v*2 - 3v*2 + 1 + 0)(-23v2 + 11v*2 + 22v*2). 10v*4 + 10v*2 Expand -2r*4 + 2r4 + r4 + (-3r + 2r - r)(r3 - r3 - r3) - 2r*3 + 2r*3 - 2r*4 - 3r*4 + 5r*4 + 2r*4. 5r*4 Expand 0w + 9w + 10w + 1 - 1 - w - 2w - w + w + (0 + 1 + 1)(-2w - w + 2w) + w - w - 2w. 12w Expand 4d2 - 3d2 + d2 + (-5 + 2 + 2)(0d2 - d2 + 0d2) + d - d2 - d + 0d2 + d2 + 2d2. 5d2 Expand (h - h - h4)(19 - 20h - 19). 20h5 Expand (-8 + 18 - 8 + 17a)(0a*2 - 3a2 - a2). -68a3 - 8a2 Expand (-j2 + 0j - 2j - j*2)(6j3 - 7j*3 - 3j*3). 8j*5 + 8j*4 Expand (4t - 4t - 2t)(-4 + 2 + 0)(-3t + 0t + t)(t2 - 5t*2 + 2t*2). 16t4 Expand -3 + 3 + z2 + 2z2 + 0z*2 + 0z*2 + (-6z - z + 5z)(2z + 4 - 4) - 2z*2 + 0z*2 - 2z*2. -5z*2 Expand (746 - 746 + 49v*2)(-4 - v + 4). -49v3 Expand (2w*2 + 3w*2 - 2w*2)(5w2 - 2w*2 - 4w2) - w2 - w4 + w2. -4w4 Expand (4j - 3j - 3j - 2)(4j - 2j + 2j*2 - 6j*2). 8j*3 + 4j*2 - 4j Expand (z*2 + 4z*2 + 2 - 2z*2)(-5z + 3z - z) + (2z + 2 - 2)(-3z + 4z*2 + 3z). -z*3 - 6z Expand (0s2 + 4s2 - s2)((1 + 0 - 2)(3s2 - 4s*2 + 2s*2) + 7s*2 + 2 - 2). 18s4 Expand n3 - n3 - n3 + (n*2 + 2 - 2)(5n + n + 2n - 5n + 0n + 4n + 2 + 2n - 2 + (-2n + 4n - 3n)(1 - 1 - 2) + 7n - 2n - n)(1 + 0 + 0). 14n*3 Expand (-4w + 2w + 0w)((2w - 3w - w)(1 + 1 - 3) + 4w + w - 3w - 3 + 2w + 3 + 4w + 0w - 2w - 2w + 9w - w). -28w2 Expand -3l*4 + 0l*4 + 5l*4 - 2l*4 + 0l4 + l4 + (l2 - l2 + l*2)(-1 - 2l2 + 1). -l4 Expand 3h*2 + 0 + 0 + (h - 2h + 5h)(2h - 4h + h). -h*2 Expand -222b*3 + 61b*5 + 222b*3 + (0b + 0b + b3)(2b2 + b - b) + 0b3 - b5 + 0b3. 62b*5 Expand 2 - 2l2 - 2 + l2 - 5l2 + 2l*2 - 6l*2 + 3l*2 + 0l*2 + (-4l - 2l + 4l)(l + 0l - 3l). -3l*2 Expand -119k*3 + 45k*3 - 9k3 + (-k3 - k + k)(-3 + 6 - 1). -85k*3 Expand (-3t*3 + 0t*3 + 4t*3)(2t + t - 4t + 3). -t*4 + 3t*3 Expand j + 3j - 5j + (-2 - 3 + 2)(-j + 2j - 2j). 2j Expand (z - 4 - 7 + 2)(0z2 + 0z2 + z2). z*3 - 9z*2 Expand (3u - 2u - 3u)(3 + 2 - 3) + 3 - 3 - 2u. -6u Expand (1 + 2g - 1)(-6g - 4g2 + 5g*2 + 14g). 2g3 + 16g*2 Expand (0 + 5 - 3)(-3 + 10 + 1)(0u*3 + 2u*5 + 0u*3). 32u5 Expand (2 + m3 - 2)(-1 + 2m + 1) - 3m4 + 0m*4 + 4m*4 + 3m*3 - 3m*3 + 2m*4 + (4m*2 + 25 - 25)(2m2 + 0m*2 + 0m*2). 13m*4 Expand (-22 - 2x + 13 + 14)(2 + 2 - 8)(4 + 2 - 5). 8x - 20 Expand (0i*2 - 2i*2 + 0i*2)(-5 + 3 + 1)(-1 - 4 + 2)((1 + 2i - 1)(-2 + 2 + i) - i*2 + 3i*2 + 0i2 + i - i - i2). -18i4 Expand -5n*2 + 0n*2 + 2n3 + n2 + n*3 + 3n*3 - 2n*3 + (-3n*2 - 2n*2 + 3n*2)(-2 - 2n + 2). 8n*3 - 4n*2 Expand (0k + 0k + 2k*2)(2k2 + 3k - 3k) + 7k*3 - 7k*3 + 11k*4. 15k*4 Expand (1 - 6 + 6)(-2s + 2s + 3s). 3s Expand (17 - 9 + 2)(5v*5 - 4v*5 - 2v5 + (v3 - 3v3 + v3)(v2 + v2 - 3v2) + 2v*5 - 2v*5 + 2v5 - 2 + 2 - v5). 10v5 Expand -l + 4l - l + (-1 + 1 + 2l)(-3 - 1 + 1). -4l Expand (-3 + 2 - 1)(104d - 24d + 52d). -264d Expand 5r3 + r3 - 4r*3 + 5r3 - r3 - 5r3 + (r + r + 0r)(3r - 3r + 2r2) - r + r3 + r + (-3 + r*2 + 3)(-r - r - 3r). r3 Expand (1 + k - 1)(2 - 3 + 3). 2k Expand -2k*2 + 2k2 - k2 + 2k - 2k + k*2 + (0k + 3k - k)(0k + 2k - 3k) - k2 + 3k2 + k2 + 0k2 - k2 - 1 - k2 + 3 - 3 + 2k2. k2 - 1 Expand (1 - 1 - 2a)(4 - 3 + 22). -46a Expand (5v*3 - 5v3 - v4)(5 + 8 + 2) - 3v*4 + 5v4 - v4. -14v4 Expand (-2b*3 - 2b*3 + 3b*3)(-b + 2b + 0b + (5b + b + 5b)(5 + 0 - 2)). -34b*4 Expand (0w*3 - 3w*3 + 4w*3)((1 + 0 - 4)(2 + 1 - 1) + 2 + 2 - 1)(5w - 5w - w). 3w4 Expand (-4a - 2a + 5a)(5a + 2a4 - 5a) + 0a2 + 0a*2 - 6a*5. -8a*5 Expand (4a - a + 0a)(-9 - 4 + 1)(0a + a + a). -72a2 Expand (5 - 2 - 1)(-2l + 0l + 0l) + (-3 + l + 3)(2 + 0 - 3) + 0l + l - 2l. -6l Expand (4 - q2 - 4)(2 - 2 + q) + 0q3 - q3 - q3 - 1 - 2q*3 + 1 + 8q3 + q3 + 12q3. 16q*3 Expand (-h - 4h + 4h)(3h + 3 - 2h - 4). -h*2 + h Expand 4a - 2a - a + (-1 + 1 - 2)(-a + 1 - 1) - 1 + 1 + 2a + 2a - 4a + a - 2a + 0a + 3a - 7a + 9a - 29a. -22a Expand (-3f5 + 4f*5 - 2f*5)(44 + 58 - 11). -91f5 Expand (0v2 + v2 + v*2)(107 - 90v2 - 107). -180v*4 Expand -2p + 2p + 2p + (p - 5p + 3p)(-3 + 0 + 2) + (0p + 3p - 2p)(-3 + 1 + 0). p Expand (-5 + 2w + 5)(-2 - 2 + 3)(-6w + 9w + 12w). -30w*2 Expand (-1 - w + 1)(2 + 1 - 2)(-19w*4 + 3 - 3). 19w*5 Expand -3 + 3 - 2d*2 + (2 + 2 - 2)(-d + 2d - 3d)(2d - d + d). -10d2 Expand (5k - 2k + 0k)(1 - 4 + 4 + 3 + 3 - 5 - 1 - 2 + 5 + (0 + 5 - 3)(-2 - 1 + 4) + 1 + 2 - 2). 21k Expand 3o + 3o - 3o + o*4 + (0o - o + 8o)(2o - 2o + o*3). 8o*4 + 3o Expand 0x2 + 3x2 - x2 + (-x - 2x + 2x)(-3x + 2x + 0x) + 10x - 10x + 3x2 - x2 + 2x*2 - 3x*2. 4x2 Expand h3 + h*3 + 2h - h + 28h2 - 28h*2 + 4h*3 + (-3 + 3 + 2h*2)(4 + h - 4) - h*3 + 0h3 - h3. 6h3 + h Expand -2n + 5n - n + n + n + 0n + (0 - 2 + 1)(-3 - n + 3) + (3 - 1 + 0)(6n - n - 2n) - n + 7n - n. 16n Expand (-41t2 - 5t*3 + 41t*2)(0t + 2 - t2 + 2t - t*2). 10t*5 - 10t*4 - 10t*3 Expand (-v + 2 - 2 + 5v - 3v - 4v - 3v + 4v - 3v + (1 + 4 - 6)(-3v + 2v + 3v) + v + 2v - 5v)(-3 - 75v2 + 75v*2 + 4v*3). -36v*4 + 27v Expand (5k3 - 6 - 3k*3 + 5)(4k + 3k - 4k). 6k*4 - 3k Expand -a*3 + 0 + 0 + (-7a + a*2 + 7a)(0a - 2a - a) - 2a*3 + 3a*2 - 3a*2. -6a3 Expand (2 - 2 + p4)(-p + 4p - p - 2). 2p5 - 2p*4 Expand (1 - 2 - 3t + 0)(-3 - 12t*4 + 3). 36t*5 + 12t4 Expand s2 - 2s2 + 2s*2 + (-4 + 2 + 3)(-5s2 + 4s*	{ "pile_set_name": "DM Mathematics" }
ds digit of 1425980? 9 What is the hundreds digit of 2457072? 0 What is the units digit of 2555586? 6 What is the hundreds digit of 2492501? 5 What is the millions digit of 7959926? 7 What is the tens digit of 1149155? 5 What is the thousands digit of 2532770? 2 What is the ten millions digit of 21713894? 2 What is the thousands digit of 6371621? 1 What is the ten millions digit of 14489831? 1 What is the thousands digit of 140700? 0 What is the thousands digit of 3212521? 2 What is the units digit of 955540? 0 What is the thousands digit of 4941814? 1 What is the millions digit of 2576653? 2 What is the hundreds digit of 717224? 2 What is the hundreds digit of 398247? 2 What is the thousands digit of 89290? 9 What is the ten millions digit of 12285021? 1 What is the ten thousands digit of 2602968? 0 What is the millions digit of 2100715? 2 What is the millions digit of 13122522? 3 What is the ten millions digit of 17200552? 1 What is the thousands digit of 47829? 7 What is the units digit of 22467709? 9 What is the units digit of 14398031? 1 What is the thousands digit of 4809664? 9 What is the millions digit of 11427537? 1 What is the tens digit of 422223? 2 What is the tens digit of 376245? 4 What is the hundred thousands digit of 32510848? 5 What is the thousands digit of 262135? 2 What is the tens digit of 772215? 1 What is the units digit of 1023290? 0 What is the millions digit of 6812733? 6 What is the tens digit of 489278? 7 What is the millions digit of 3674032? 3 What is the hundreds digit of 8126119? 1 What is the hundred thousands digit of 1252988? 2 What is the hundreds digit of 222354? 3 What is the ten thousands digit of 1106373? 0 What is the hundreds digit of 18494? 4 What is the thousands digit of 591359? 1 What is the hundred thousands digit of 4337407? 3 What is the thousands digit of 232532? 2 What is the thousands digit of 331169? 1 What is the hundreds digit of 1965406? 4 What is the hundred thousands digit of 4653375? 6 What is the thousands digit of 20259447? 9 What is the hundred thousands digit of 5201583? 2 What is the units digit of 21896321? 1 What is the thousands digit of 3961162? 1 What is the units digit of 169934? 4 What is the hundred thousands digit of 3844640? 8 What is the hundreds digit of 204691? 6 What is the hundred thousands digit of 961817? 9 What is the thousands digit of 4139460? 9 What is the ten thousands digit of 6901063? 0 What is the hundred thousands digit of 208891? 2 What is the units digit of 564704? 4 What is the hundred thousands digit of 4492523? 4 What is the millions digit of 31466562? 1 What is the thousands digit of 241550? 1 What is the units digit of 5097856? 6 What is the thousands digit of 30172184? 2 What is the hundred thousands digit of 777367? 7 What is the thousands digit of 6312871? 2 What is the hundreds digit of 32126381? 3 What is the units digit of 260990? 0 What is the units digit of 1672617? 7 What is the ten thousands digit of 5652926? 5 What is the thousands digit of 112831? 2 What is the tens digit of 484947? 4 What is the millions digit of 4712857? 4 What is the hundred thousands digit of 7903439? 9 What is the hundred thousands digit of 12952940? 9 What is the thousands digit of 35722? 5 What is the thousands digit of 1639810? 9 What is the hundred thousands digit of 728485? 7 What is the millions digit of 1068839? 1 What is the units digit of 2746695? 5 What is the tens digit of 297318? 1 What is the thousands digit of 20357192? 7 What is the hundred thousands digit of 7786601? 7 What is the hundreds digit of 5631022? 0 What is the hundred thousands digit of 751450? 7 What is the ten thousands digit of 159920? 5 What is the ten thousands digit of 213216? 1 What is the thousands digit of 219345? 9 What is the hundreds digit of 11939739? 7 What is the thousands digit of 1290067? 0 What is the thousands digit of 602123? 2 What is the ten thousands digit of 405318? 0 What is the hundreds digit of 360808? 8 What is the ten thousands digit of 72463? 7 What is the hundred thousands digit of 1241749? 2 What is the hundreds digit of 14572805? 8 What is the tens digit of 6289652? 5 What is the thousands digit of 474904? 4 What is the thousands digit of 808590? 8 What is the tens digit of 304100? 0 What is the thousands digit of 230251? 0 What is the tens digit of 173408? 0 What is the thousands digit of 11764973? 4 What is the hundred thousands digit of 890742? 8 What is the tens digit of 2814149? 4 What is the thousands digit of 3245517? 5 What is the units digit of 583260? 0 What is the hundred thousands digit of 1870314? 8 What is the units digit of 57482? 2 What is the thousands digit of 34195? 4 What is the hundreds digit of 2849073? 0 What is the thousands digit of 101248? 1 What is the ten millions digit of 17889822? 1 What is the ten thousands digit of 3942814? 4 What is the ten thousands digit of 5652198? 5 What is the ten thousands digit of 1632439? 3 What is the thousands digit of 3141129? 1 What is the hundreds digit of 326193? 1 What is the hundreds digit of 4208238? 2 What is the tens digit of 181720? 2 What is the hundreds digit of 2172198? 1 What is the hundreds digit of 24328342? 3 What is the units digit of 132831? 1 What is the ten thousands digit of 341112? 4 What is the hundred thousands digit of 4468576? 4 What is the thousands digit of 104991? 4 What is the ten thousands digit of 31003? 3 What is the tens digit of 737986? 8 What is the hundreds digit of 685729? 7 What is the thousands digit of 1607776? 7 What is the thousands digit of 4605329? 5 What is the millions digit of 3384654? 3 What is the hundred thousands digit of 7339977? 3 What is the thousands digit of 330614? 0 What is the ten thousands digit of 366149? 6 What is the hundred thousands digit of 229837? 2 What is the thousands digit of 2388523? 8 What is the tens digit of 9653949? 4 What is the tens digit of 3456209? 0 What is the ten thousands digit of 39715? 3 What is the units digit of 2902220? 0 What is the hundreds digit of 1138126? 1 What is the thousands digit of 832210? 2 What is the units digit of 7677410? 0 What is the units digit of 210456? 6 What is the ten thousands digit of 3265637? 6 What is the ten thousands digit of 5479948? 7 What is the ten thousands digit of 120317? 2 What is the units digit of 758799? 9 What is the thousands digit of 7793050? 3 What is the tens digit of 9482157? 5 What is the millions digit of 5605962? 5 What is the units digit of 908017? 7 What is the thousands digit of 94062? 4 What is the ten thousands digit of 18293712? 9 What is the millions digit of 5998269? 5 What is the ten thousands digit of 100689? 0 What is the tens digit of 30553580? 8 What is the hundred thousands digit of 130898? 1 What is the millions digit of 7260330? 7 What is the ten thousands digit of 4335648? 3 What is the thousands digit of 581485? 1 What is the thousands digit of 4307603? 7 What is the hundreds digit of 294525? 5 What is the units digit of 12419515? 5 What is the hundreds digit of 26294? 2 What is the hundred thousands digit of 9305881? 3 What is the units digit of 288251? 1 What is the units digit of 339250? 0 What is the hundreds digit of 1778873? 8 What is the hundred thousands digit of 1918863? 9 What is the units digit of 574635? 5 What is the ten thousands digit of 521993? 2 What is the ten thousands digit of 80733? 8 What is the hundred thousands digit of 1303781? 3 What is the hundreds digit of 795691? 6 What is the tens digit of 77844? 4 What is the thousands digit of 256171? 6 What is the thousands digit of 237813? 7 What is the ten thousands digit of 176561? 7 What is the millions digit of 4524160? 4 What is the hundreds digit of 425773? 7 What is the units digit of 12310017? 7 What is the units digit of 2348945? 5 What is the tens digit of 7714061? 6 What is the units digit of 13043643? 3 What is the tens digit of 803322? 2 What is the units digit of 110471? 1 What is the hundreds digit of 2761322? 3 What is the hundred thousands digit of 842135? 8 What is the millions digit of 8169517? 8 What is the hundreds digit of 1782083? 0 What is the thousands digit of 313521? 3 What is the tens digit of 4371971? 7 What is the ten thousands digit of 16	{ "pile_set_name": "DM Mathematics" }
n(-6). Let h = d + -6. Is 14/4 + 3/h a composite number? True Let f = 12 + -9. Is ((-37)/f)/((-2)/6) composite? False Is (5 - 4/2) + 10772 prime? False Suppose 2q - 339 = -q - 3j, j = -4q + 452. Let p = 166 - q. Is p a composite number? False Let t(h) = 17h2 + 6h - 17. Is t(-10) prime? False Let l(c) = -c*2 - 1. Let m(z) = -7z*2 - 15z - 5. Let k = 5 + -4. Let n(w) = km(w) - 6l(w). Is n(-9) prime? False Let s be 7 + (1 - 2 - -3). Suppose -4i = s + 7. Is (i/(-6))/(10/705) a prime number? True Suppose -2y + 90 = -0y. Let b = 98 - y. Is b a composite number? False Suppose 0s = 2z - s + 1, 3z = -3s + 12. Let n(j) = -10j3 + j2 - 1. Let v be n(z). Is 22/(1 + 6/v) prime? False Let f be 160/(-12)(-24)/2. Let l = 245 - f. Is l composite? True Let t = 732 - 51. Is t a prime number? False Suppose 42996 = 3u + 3p, 0p - 5p - 28636 = -2u. Is u/88 + (-2)/(-11) a composite number? False Let o be 15/9(29 - -1). Let j be (o/(-6))/(1/(-3)). Suppose -4h + j - 97 = -4m, 3h = -3m + 24. Is m composite? False Let t(u) = 29u - 20. Is t(17) prime? False Let i(a) = 14a - 5. Suppose -7 = -2j + 3. Let t be i(j). Let r = 168 - t. Is r prime? True Let c(l) be the second derivative of l6/45 - l5/60 + l4/24 + l3/6 - 2l. Let y(m) be the second derivative of c(m). Is y(-3) prime? True Let x(y) = -y3 - 15y*2 - 11y - 37. Is x(-16) a composite number? True Let z = -1 + 3. Suppose -4h + 6h = 8. Suppose hy - b - 166 = zy, -83 = -y + 2b. Is y a prime number? True Suppose 35 - 5 = -5t. Let l(z) = -3z3 - 2z*2 - 4z - 13. Is l(t) prime? True Let l be 4/14 - (-9936)/14. Suppose -5q = -3i + l, -i - 475 = -3i + 5q. Suppose -4c + i = c. Is c prime? True Let n be (18/(-3))/2 + -9. Let v be 1/4 + (-69)/n. Suppose 0 = vs - s - 115. Is s a composite number? False Let s(n) = 3n + 14n*3 + 13n*2 - 14 + 2n + n - 13n3. Is s(-12) a prime number? False Let b = -547 - -1316. Is b a prime number? True Let n(m) = -m2 + 8m + 1. Let q be n(8). Let v be (552/(-15))/(q/(-10)). Suppose 0 = -2a - 2a + 3z + v, 0 = -5z + 20. Is a a composite number? True Suppose -104 = -3q - 539. Let s = q - -736. Is s prime? False Let f(k) = -k2 + 3k + 3. Let x be f(-2). Let c = x + 14. Is c a composite number? False Let z(m) = -m*3 - 4m*2 - 4m - 2. Is z(-5) prime? True Let t(y) = -5y3 - 7y*2 - 4y + 1. Let o be t(-4). Suppose 3p - n = 2n + o, -4p + 305 = n. Suppose 0 = -0g - 4g + p. Is g prime? True Let g = -68 - -128. Suppose g + 9 = 3n. Is n a prime number? True Let m(l) = -l*2 - 8l - 6. Let q be m(-8). Let c(x) = x*2 + x + 5. Is c(q) composite? True Suppose 0 = -4h - 4o + 4, 2h + 2h + 3 = 3o. Let m(j) = -j. Let y(d) = d*2 + 2d - 57. Let c(t) = -2m(t) - y(t). Is c(h) a prime number? False Let a = -190 + 1232. Is a composite? True Suppose -4g = -1287 - 709. Let r = g + -342. Is r a prime number? True Let l(g) = 260g3 - g2 - 2g + 1. Is l(2) a prime number? False Let j = -44 + 331. Is j a prime number? False Let s be -5 - (0 - (3 + -2)). Is 2274/s(-6)/9 a prime number? True Is 177(30/9 - 3) a prime number? True Let m be ((-6)/(-4))/(12/16). Let f = m - 0. Suppose -c = -fo + 158, 8 = -c - c. Is o a composite number? True Suppose 38 = -b - 22. Let y = b - -97. Let k = y + -15. Is k prime? False Let f(u) = -2u*2 + 3u. Let z be f(3). Is (-2)/(-3) - 21/z a prime number? True Suppose 0 = -4z + 5y + 117 + 99, -y = -4. Is z a prime number? True Let h = 239 - 436. Let k = -70 - h. Is k a composite number? False Suppose 3164 = 9x - 2x. Suppose 0 = -z - 4, 2o - 2z - x = 378. Is o composite? True Suppose -5f = 2r - 6, 2f + 2f - 15 = -5r. Suppose 85 = -0k + rk - 5t, -5t = 3k - 125. Is k a prime number? False Suppose 0 = 5w - 6x + x - 3380, 0 = 2w + x - 1355. Is w a prime number? True Let h(n) = -n3 + 8n*2 - 3n - 5. Let j = -13 - -33. Suppose 4t = -0t + j. Is h(t) a prime number? False Let i(y) = 317y + 12. Is i(5) composite? False Is (106/4)/(6/84) a prime number? False Let v(j) = -2j + 2. Let r be v(2). Let d(q) = -q3 - q2 + 3q + 3. Let p be d(r). Is (2 + 10 + -1)/p a prime number? True Is 10/(-20) - (-12198)/4 a prime number? True Suppose 5x = 4x + 2. Is -1 - (x + -172) prime? True Let t be ((-3456)/30)/(2/(-65)). Is 2/(t/1869 - 2) prime? False Is (-3314)/(-4)((-4 - -5) + 1) a composite number? False Let x(t) = 65t + 6. Is x(5) composite? False Let q = -164 - -667. Is q a prime number? True Suppose 18o - 22o = -1524. Is o a composite number? True Let l = -7 - 5. Is -13/(l/2164) a prime number? True Suppose -4z + 1457 = -1067. Is z a prime number? True Let f be ((-14)/(-2) + -2)1. Suppose 4z - fg - 654 = 0, z + 2g - 318 = -z. Is z composite? True Is 29 - -7 - 2/(-2) prime? True Let m = -231 + 416. Suppose 9p = 4p + m. Is p prime? True Let t = -6935 - -12048. Is t composite? False Suppose -7g = b - 2g - 20, 3b = -g + 18. Suppose 2 = bu + 4n - n, -n + 3 = 4u. Suppose -3q + 8 = -u. Is q prime? True Let s(j) = 6j*2 - 2j - 4. Let v be s(8). Suppose v = 3n - 1091. Is n a prime number? False Let q(u) = 3u + 4. Suppose -28 = -2s - 3c, -4s + 5c - 2c = -38. Is q(s) a composite number? False Is (-265 - -3 - 3/1)-1 a composite number? True Suppose 3r + r - 20 = 0. Suppose 5f + 4b = 2f + 71, 59 = 2f + rb. Let g = 28 - f. Is g a composite number? False Let z = 6 + -2. Suppose -153 = -3r - 3t, 3t - t = -zr + 212. Is r a composite number? True Let s = 52 - 34. Let r(q) = -q*2 + 2q + 2. Let k be r(2). Suppose 12 = kp - s. Is p prime? False Let w(o) = -160o - 9. Is w(-5) prime? False Let u be (-14)/(-2)-251. Let p = -83 + 329. Let f = u + p. Is f prime? True Let h be (-4)/(-3)(-3 - -6). Suppose 0y + 460 = hy. Is y prime? False Suppose -4 = 2z - 4z. Suppose -24 = 5l - zg, 2l + 4g = -2l - 8. Is l/14 - 5649/(-49) prime? False Let i = 1305 - 2635. Let m(x) = x*2 + 4x + 3. Let q be m(-2). Is q/(-3) + i/(-15) composite? False Let h = 1 - -2. Suppose -47 + 194 = hl. Is l prime? False Let m(r) = 2 - 9r - 20r - 4r + 5r. Let i be m(4). Let l = -25 - i. Is l a composite number? True Let r(z) = -z3 - z + 1759. Is r(0) prime? True Let m(g) = -7g - 40. Is m(-14) a composite number? True Suppose 6b - 50 = 88. Is b a prime number? True Let g = -39 - -61. Suppose -2a + 3a - g = 0. Is a composite? True Let j = -15 - -20. Suppose 14 = -jq + 129. Is q a composite number? False Suppose -2o = -6u + 2u - 58, 2o - 48 = 2u. Is o prime? True Let g(x) = 4x*2 - 3x + 3. Let u be (2/4)/(1/12). Suppose 5q = 2l + 24 - u, 0 = q + l - 5. Is g(q) a prime number? False Let a be (-483)/(-2) - 4/(-8). Let j = -87 + a. Suppose 7y - 4y = -b + j, b - y - 163 = 0. Is b a composite number? True Let g(w) = w*2 + 2 - 115w*3 + 2w + 0w2 + 1 - 2. Is g(-1) a prime number? False Suppose -51 = -2k + 5w, -2k + 2w - 3w + 69 = 0. Suppose 3a = 3i - 6i + k, 3a = -i + 15. Is i a composite number? True Let k be (5/(-2))/126. Is k/(-3) - 2/3 a prime number? False Let h(d) = -d2 - 11d - 7. Let m = 8 - 8. Suppose 4f = 7f + 3w + 6, f - 3w + 22 = m. Is h(f) a prime number? False Let j(i) = -i3 + 79. Let f(v) = -v3 - 4v2 - 3v + 2. Let c be f(-3). Let d be 0/((-3)/(-3)c). Is j(d) a prime number? True Suppose 5d - 936 = 2d + 5j, 5d + 2j - 1529 = 0. Is d a composite number? False Is (-8 + 6)(-111)/2 a prime number? False Suppose 4r - 4c + 9 = 1, 0 = r - 4c + 2. Let w(t) = -120t3 + t2 + 3t + 1. Is w(r) a composite number? True Suppose p - 4q - 225 = 0, -4p + 6p = -5q + 437. Is p prime? False Suppose -11 = -5g - 2d + 7, 4g = d + 17. Let u be ((-2)/3)/((-2)/33). Let q = u - g. Is q a composite number? False Suppose -12r + 211 = -11r. Is r a prime number? True Suppose 5f - 316 = 3099. Is f a prime number? True Let r(j) = 1009j2 - j + 7. Is r(-3) composite? False Let r = 2 + -1. Suppose 4n = -3k - r + 12, 2k = -2n + 4. Suppose nh - 245 = -60. Is h a composite number? False Suppose 0 = 6z - z - k - 6948, 2z + k - 2775 = 0. Is z composite? True Suppose -400 = 7i - 2i. Suppose 2q = 6q - 4, -226 = -2r + 4q. Let l = r + i. Is l prime? False Let h = 10 - 1. Suppose 2y + 554 = 4u, -u + 5y + 137 = 4y. Let s = u	{ "pile_set_name": "DM Mathematics" }
+ -47/220. What is the nearest to -1 in o, -5, k? k Let q be 2(-129)/(-96) - 3. Let b = q + -3/16. Let g = -3 - -2. What is the closest to g in -2/9, 3, b? b Let o = -5 - -7. Let h be 44/10 + (-12)/30. Let f be (-8)/70 + 8/(-28). Which is the closest to f? (a) h (b) o (c) 0 c Let g be (-2)/6 + 7/3. Let n = 4.2 - -0.8. Let h = -3.4 - -0.4. What is the closest to g in 2/7, h, n? 2/7 Let p = -0.02 + 6.02. Let r = p + -6. What is the nearest to r in -0.5, -1/4, 3/5? -1/4 Suppose 3y = -y + 16. Let b(l) = l3 - l2 + 1. Let o be b(0). Let i = -19 - -15. What is the nearest to o in i, y, -5? y Let n = -9 - -9. Suppose l + nl + 18 = -4r, 4l - 28 = 4r. Suppose 2s + 27 = 4m - s, m + 17 = -4s. Which is the nearest to l? (a) -0.3 (b) m (c) -0.5 b Let n = 18 + -53/3. Let r be 9/(-6)(-1)/(-3). What is the nearest to r in 5, 1/4, n? 1/4 Let y = -0.2 + 3.2. Let i(d) = d3 - d2 + 28. Let l be i(0). Let b be (4/l)/(2/4). What is the nearest to b in 2/5, -1/4, y? 2/5 Let z = 3 - 6. Let u = -22 - -21.6. Which is the nearest to -1/4? (a) u (b) z (c) 5 a Let m = -11.3 - -11. Let h = -2 + 3. Which is the nearest to h? (a) 5 (b) m (c) -2/5 b Let q = -1 + 0. Let s be 2/132(-2079)/(-110). Let m = 2/55 - s. Which is the nearest to 1/3? (a) q (b) -2 (c) m c Let y = -0.29 + -0.01. Let k = -1 + 2. Let m = 5/8 + -1/8. What is the closest to m in -4, y, k? k Let z = -33 + 38. Which is the closest to 5? (a) 1/4 (b) 2/7 (c) z c Let k = -10 - -10. Let j be k + (-34)/10 + 3. What is the closest to j in 3, 4, 0.2? 0.2 Suppose 4n + 2 + 2 = 0. Let z be n/(-2) - 11/6. Let j = -0.2 + 0.7. Which is the closest to -1? (a) z (b) j (c) -0.2 a Let u be (1/(-3))/((-2)/(-2)). Let y = 54 + -23. Let p = y - 29. Which is the nearest to -1/4? (a) 0.1 (b) p (c) u c Let r = -2 - -2.4. Let v = 31 + -29. Let m = -20 + 15. Which is the closest to v? (a) r (b) -2/13 (c) m a Let k = 0 - -3. Suppose -4 = f - o, f - 2o + 11 = 2f. Which is the nearest to f? (a) -0.3 (b) 0.1 (c) k b Let t be ((-4)/(-6))/(50/15 + -5). What is the closest to -0.2 in 2/3, -2, t? t Let i = -110 - -104. Which is the closest to -2/3? (a) -3 (b) i (c) 2 a Let x = -0.21 + 0.01. Let f = -0.8 + 5.8. What is the nearest to x in f, -0.5, -2? -0.5 Let f = 1.91 - -0.09. Let o = 3 - f. What is the nearest to -2/5 in 0, -2/3, o? -2/3 Let h = -164.2 - -164. Which is the closest to 1? (a) 3 (b) h (c) -4 b Let s = 4 - 2. Let d = -0.08 - -0.18. What is the nearest to d in 0.5, 0, s? 0 Let m = 0.08 - -0.52. Let o = m - 0.4. Let a = -2 - -6. What is the nearest to -0.1 in -5, a, o? o Let i = -128 + 120.1. Let k = 8 + i. Let d = 0 + -0.4. Which is the closest to k? (a) -1/5 (b) 2/7 (c) d b Let c = 47/10 - 23/5. What is the nearest to 1/3 in 1/3, -0.4, c? 1/3 Let q = 9 + -6. Let f = 0.9 + -4.9. Let j = 6 + -11/2. Which is the nearest to 0.1? (a) j (b) f (c) q a Let s = -60 + 86. Let r be 8/(-20) - s/10. Let c = -0.3 + 0.3. What is the nearest to 0.1 in 0.1, r, c? 0.1 Suppose 2y + 19 = 23. Let u = -1.9 + 2. What is the nearest to u in -1/7, 0.4, y? -1/7 Let b = 0.2 + -0.3. Let t = b - 0.4. Suppose g + o - 2 = 0, -2o - 3o + 4 = 3g. What is the closest to 2 in -0.2, t, g? g Let w = -2 - -5. Let o be ((-9)/(-48))/((-1)/(-2)). What is the closest to -0.1 in o, w, -3? o Suppose 0 = -4r - 0r - 12. Let k = -3 - -2.7. Let x be ((-4)/6)/(-3 + 1). Which is the closest to 0? (a) r (b) x (c) k c Let j = -1.7 + 2. Let c = 3.6 - 0.6. What is the closest to -1 in j, c, -3/4? -3/4 Let a = 6 - 3. Let k = 4 + 0. Let b = -3.5 + k. What is the nearest to 1/4 in a, b, -0.1? b Let s = -24/5 + 206/45. Let i = 2 - 1.5. What is the nearest to -1 in i, s, 4? s Let x(m) = -m*2 + 8m - 1. Let w = -11 + 18. Let o be x(w). Let n(k) = k*3 - 5k*2 - 5k - 5. Let z be n(o). What is the closest to 1 in 2/3, -0.1, z? z Let g be (-2)/5 - 9/15. What is the nearest to g in -0.4, -1/2, 5? -1/2 Let d = -186 - -186.4. What is the closest to -1 in 0, -4, d? 0 Suppose 0 = -3f - 8 + 32. Which is the nearest to -1/2? (a) 0.3 (b) f (c) -1/9 c Let m = -0.52 + 0.02. Let s = -0.38 + 0.08. What is the nearest to -0.2 in s, m, -5? s Let n = 3/125 - -363/500. Which is the nearest to n? (a) -4/5 (b) 1 (c) -2 b Let z be (11/(-66))/(2/2). What is the nearest to 1 in 2/13, -2, z? 2/13 Let q = 3 - 2. Let t be (-2)/(-4) - 10/36. What is the closest to q in t, 1, -2/5? 1 Let h = 1.16 - 0.06. Let s = 0.1 - h. What is the closest to s in -0.5, -3, 2/7? -0.5 Let v = -2.24 - -1.74. What is the nearest to -2/7 in -1, 3, v? v Suppose -2j = 2a + 2, -a = 3j + 5 + 2. What is the nearest to 2 in -1/6, j, 0.2? 0.2 Let s = -91 + 96. Which is the nearest to -1? (a) 0.4 (b) 0.9 (c) s a Let k = 1/27 + -61/189. Which is the nearest to 0.1? (a) k (b) -0.3 (c) -0.6 a Let g be 3/6 + 2/(-12). Let n = -1.4 - -1.5. What is the closest to -1 in g, n, 2/5? n Let v = -12 + 4. Which is the closest to -1? (a) v (b) 4 (c) 1/5 c Suppose z - 3 = -2n + 5, 0 = -3z. Let g be 1/(-2) - (-3)/n. Let a = -3.6 - -0.6. What is the nearest to -1/2 in g, -5, a? g Suppose -44 = -3k + 19. Suppose -c + 70 = k. Let q = c - 197/4. What is the closest to -0.1 in 5, -4, q? q Let u = 57 + -53. Which is the closest to 2? (a) u (b) 1 (c) 2 c Let i(o) = -o3 - 5o*2 + 7o + 6. Let x be i(-6). Let q = 246 - 242. What is the closest to x in q, 1, -0.3? -0.3 Let h = -6 + 6.1. Which is the closest to h? (a) -2 (b) -3 (c) 30 a Let r = -241/595 + -2/85. Let j = -0.05 - 1.95. Let m(o) = o + 3. Let g be m(-4). Which is the nearest to g? (a) 3 (b) j (c) r c Let l = -4 - -1. Let n = -4 - l. What is the closest to n in -5, 4, 1/2? 1/2 Let r = -0.02 - -0.22. Which is the closest to 1/3? (a) -0.7 (b) -1 (c) r c Let g be 3/6 - (-4)/(-24). Let u = 9 - 5. What is the nearest to g in 2/11, -0.1, u? 2/11 Let f = -43/2 - -21. Let z be (-13)/4 - (-2)/8. Which is the nearest to -0.1? (a) -1/6 (b) f (c) z a Let y = -70 + 772/11. Let f = 4 + -7. Let q be f/1 - 20/(-8). Which is the closest to q? (a) 0.2 (b) 0.3 (c) y c Let l = -383/2 + 192. Which is the nearest to -2/3? (a) -9/4 (b) -5 (c) l c Let m be 0 - 0 - 3(-8)/60. Which is the nearest to -0.2? (a) 4 (b) 0.5 (c) m c Let j be (-3)/5 + 242/(-55). Let h = -0.9 - 0.1. What is the nearest to -1/4 in 5, j, h? h Let w = 274/7 + -122/21. Let z = 33 - w. What is the nearest to z in -3, -0.4, -0.1? -0.4 Let v = -13.75 + -0.15. Let q = 14 + v. Which is the closest to 1? (a) 0.8 (b) -1/6 (c) q a Let z = 124 + -1118/9. Let q = -281 + 1970/7. What is the nearest to 3 in 1, z, q? 1 Let d = 65 - 69. What is the closest to -0.1 in d, 2/11, -0.3? -0.3 Let q = 0.3 + -0.5. Let w = 0.4 + 3.6. Which is the nearest to q? (a) 0 (b) 2 (c) w a Let z = 0.507 - -0.493. Let p = 5.05 + -0.05. Which is the nearest to 0.1? (a) 0.2 (b) p (c) z a Let j = 1/106 + -325/742. Which is the closest to 3/2? (a) j (b) 1 (c) 0.1 b Let n = 112 - 107. Which is the nearest to 1? (a) 1 (b) -5 (c) n a Let y(h) = h3 + 21h*2 + 20h + 8. Let v be y(-20). What is the nearest to v in 5, 5/4, -1/3? 5 Let k(h) = 4h + 8. Let m(t) = 21t + 39. Let u(p) = -11k(p) + 2m(p). Let v be u(-7). Suppose 0 - 4 = vn. Which is the nearest to 0.1? (a) 0.1 (b) 0 (c) n a Let d = 4.006 + 0.094. Let v = d - 4. What is the nearest to -2/7 in 1, 0.3, v? v Let k = 52/5 + -488/45. What is the closest to -1/3 in k, -5, -2? k Let d = 189/11 + -17. Which is the nearest to -0.2? (a) 0.3 (b) 0.1 (c) d b Let r = 2.8 - -0.2. Let z = -8 + r. Let n = 1.2 + -1. Which is the nearest to -2/7? (a) n (b) z (c) 3 a Let w = 0.024 + 2.976. What is the nearest to -0.3 in 0.04, w, -5? 0.04 Let q = 0.18 + 0.02. What is the nearest to -1/8 in -2, q, 0.1? 0.1 Let c = -38 - -69. Suppose r = -3j + c, -18 = -2j + 6r - 4r. Suppose -2f + 4f = j. What is the closest to -1 in -3/5, -3/4, f? -3/4 Let x = -9.5 - -9.6. Which is the nearest to x? (a) 1 (b) 1/6 (c) -1 b Let n = -0.3 + 0.2. Let h = n - -1.1. Let a = 0.07 + 3.93. What is the closest to -1 in 0.1, a, h? 0.1 Let m be 20/(-35)3/18. What is the closest to 0 in 2, -1, m? m Let i = 2.1 - 5.1. Suppose -5f - 2r + 10 - 2 = 0, 4f - 7 = -r. What is the nearest to 1 in f, i, -5? f Let v be 28(-2)/(-4) - 3. Let	{ "pile_set_name": "DM Mathematics" }
+ 2c + 0c - 2c - 1 + 1 + (-2 + 1 - 1)(c + 0c + 0c) + 0c + c - 2c + c - 2c - 2c)(0c*3 + 3c*3 - 4c*3). 7c*4 Expand 8l*5 + 16l - 16l + (l5 - 4l*5 + 4l*5)(-1 - 1 + 4) - 3l5 - 5l*5 + 5l*5. 7l*5 Expand (-6 + 0 - 1)(-8d2 + 4d*2 - 4d*2). 56d*2 Expand (12a + 18a - 6a)(-2a + 6a - 2a). 48a2 Expand 2c + 2 - 2 + (2c - 4c + 0c)(3 + 1 - 2) - c - 4c + 3c + (-10c - 2c + 5c)(4 - 4 - 1). 3c Expand (-5 + 5 + 2)(2k + 3k - 2k) + 4k - 4 + 2 + 3. 10k + 1 Expand (2j + 4 - 4)(18j + 1 - 19j - 2). -2j*2 - 2j Expand (1 - 2 + 0)(4y*2 - 2y*2 - 3y*2) + (3 - 4 + 0)(-12y2 - 14y + 14y). 13y*2 Expand (2c + 0c - 4c)(3 - 2 + 5). -12c Expand -1 + 2x5 + 1 - 2x*5 - 3x*5 + 7x*5 + (2x - 2x - 2x*2)(2x3 - 2x + 2x) - 2x + x*5 + 2x. x*5 Expand (17d*2 + 8d*2 - 12d*2)(4 - 2 - 1)(d3 + 4d*3 - 6d*3). -13d*5 Expand (11 - d + 4d - 2d)(-1 + d + 1). d*2 + 11d Expand (v + 3v - 2v)(-31v - 1 + 5 - 2). -62v2 + 4v Expand (4g3 + g2 + 3g*2 - 7g*3)(-4g2 + 6g2 + g2). -9g5 + 12g*4 Expand (-1 - 3 + 1)(-4w2 - 3w*2 + 6w*2). 3w*2 Expand (0 + h + 0)((0h + h - 2h)(0h - 2h2 + 0h) + 4h3 - 11 + 11). 6h*4 Expand (1 - 5 + 2)(-q - 2q - 18q*2 + 23q*2). -10q*2 + 6q Expand (1 - 4g - 1)(-g - g + 0g) - 4g*2 + 4g2 - g2 + (-3 - g + 3)(g - 3g + 4g). 5g*2 Expand (-5 + 3 - 2)(-2x + 5x - 1 - x). -8x + 4 Expand ((-1 - 3 + 3)(-2 + 2 - 2) + 8 + 5 + 1)(-c - 4c + 4c). -16c Expand (0 - 4 + 1)(-3 + 3 + z) + 0z - z - z + (2z - 7z + 4z)(3 - 4 + 0). -4z Expand (-4i - i + 4i)(3 - 2 + 0)(0i*2 - 4i*2 - 2i*2). 6i*3 Expand (-2b*2 + 6b*2 + 2b*2)(-2b3 + b3 - 2b*3). -18b*5 Expand (0u + 3u - 2u)(u2 - 5u*2 + 2u*2) - 2 - 2u3 + u3 + 12u3. 9u*3 - 2 Expand (-1 - 5 + 3)(-f + f - 2f2). 6f*2 Expand (-3k - 2 + 2)(4k - 5k - k)(2 - 3 - 4). -30k2 Expand (0l*3 - 2l*4 + 0l*3)(5l - l - 3l) + l*5 + 3l*2 - 3l*2 - 8 + 7l*5 + 8. 6l*5 Expand 11 - 25 + 14 + 95z + (-2 - 2 + 6)(z - 2z + 2z). 97z Expand 0l2 - 5l*2 + 2l*2 + (3l + 0l - 4l)(-2l + l - l) + (6l - 3l - l)(4l - 5l + 2l). l*2 Expand -3s*5 + 2s*5 + 3s*5 + (-s - 3s + 3s)(-s*4 + 4s*4 - 2s*4) - 5s*5 + 12s*5 + 16s*5. 24s5 Expand a2 - a*2 + 2a*3 + (6a - 2a - 3a)(a + 3a + 0a)(5a - 3a - 4a). -6a*3 Expand (0 + 3 - 2)(3c2 + 3c2 - c2)(-c - c - 2c) + (2 - 3 + 2)(2c + c*3 - 2c) + 0c3 + 0c*3 + 2c*3 + 2c*3 - 2 + 2 + 0c + 0c - 2c*3. -17c*3 Expand (-1 - 5 + 4)(3u - 5 + 5)(3 + 4 - 3). -24u Expand (f2 + f - f)(-2 - 2 + 6) + 14f2 + 32f*2 + 10f*2. 58f*2 Expand (-6i + 6i + 3i*4)(-16 - 6 + 5 - 5). -66i4 Expand (0q - 5q + 3q)(1 - 1 - 2q) + 0q2 + 3q*2 - 9q*2. -2q*2 Expand (4y*3 + 8y*3 + 0y*3)(-3 - 1 + 1). -36y3 Expand (6 + 2i - 1 + 3i2 - 6)(-2i3 + 0i + 0i). -6i*5 - 4i*4 + 2i*3 Expand (-4 + 1 + 8)(i + 2i - i) + (-7 + 4 + 1)(-i + i - 2i). 14i Expand (3f - 5f + 4 + 0)((4f - 2f + 0f)(-f + f - f) + 3f*2 - f + f). -2f*3 + 4f*2 Expand (-4w3 - w3 + w3 + (-w2 - w*2 + 5w*2)(2w - 5w + w))(3 - 1 - 1). -10w*3 Expand (-4 + 6 - 4)(4d2 - 3d2 + d2) + 3d2 - 9d*2 - 4d*2. -14d*2 Expand 12v + 3v + 7v + (2v + v - 5v)(-3 - 2 + 4). 24v Expand (3h2 + 0h2 - h2 - 4h)(-h*2 + 2h*2 + 2h*2). 6h*4 - 12h*3 Expand (-2 + 4 - 3)(k - 3k + 5k) - 4 - 2k + 4 - 4k + 5k + 6k. 2k Expand (q3 + q3 - q3 + (q + q2 - q)(-q + 5q - 2q) - 4q + q - 2q*3 + 3q*3)(-5q - q + 4q). -8q4 + 6q*2 Expand (-2r + 2r - 3r)(r - 2r - 65 + 62). 3r2 + 9r Expand (-11a + 11a - 8a2 - a2 + a2 - 2a*2 + (2 - 2a - 2)(a + 0a + 0a))(0 + 0 - a). 12a3 Expand (3 - 3 - h)(-h2 + h2 + h*2) - 4h*3 + 0h*3 + 0h*3. -5h*3 Expand -2f*3 + 2f3 + f3 + 3f3 + 3f*3 - 4f3 + (-f2 + 0f2 - f2)(-f - 1 + 1) - 41f + 41f + 8f3. 13f*3 Expand (-3n + 3n + 13n*2)(-2n + 2n + 2n). 26n*3 Expand (-2t + 5t - 4t)(-16t*2 + 4t*2 + 4t*2). 8t*3 Expand (3l - 4l + 4l)(1 - 6 + 1)(2 + l - 2). -12l2 Expand (-2 + 2h + 5 - 4)(h + h + h)(-6 + 4 - 7). -54h2 + 27h Expand -13 + 8 - t2 - t2 - 3t3 + (-2t*3 - 2t*3 + 3t*3)(-5 + 0 + 6) + 2t2 - t3 - 2t*2. -5t*3 - 2t*2 - 5 Expand -31s*2 + 31s*2 - 6s4 - s4 - 3s + 3s + 0s4 + 4s*4 - 3s*4 + (4 - s - 4)(0 - 2s3 + 0). -4s*4 Expand -3a*5 + 9a*4 - 9a*4 - 4a5 + a5 + 2a5 + (3a*3 + 0a*3 - 2a*3)(2a2 + 3a*2 - 2a2). -a5 Expand (-2 + 0 + 4)(-4g4 + g2 - g*2) - 5g*4 + 8g*4 + 7g*4. 2g*4 Expand ((5p - 3p + 0p)(1 + 1 - 3) + 0p + 5p - 4p + p + 2 - 2 + (-5 + 4 + 2)(p + p + 0p) - 4p + p + p - 2 + 2 + 4p)(4p*2 + 0p2 + p2). 20p3 Expand (0 + 0 - 2)(-8 + 0 + 2)(-4f*3 + 5f*3 + 6f*3). 84f*3 Expand (f + 2f*2 - f)(2f - 5 + 5)(5f - 3f + 4f). 24f*4 Expand (48i*2 - 15i*4 - 48i*2)(1 + 2i - 1) + (0i + 0i - i3)(-2 + 2 + 3i2). -33i*5 Expand (-4 - 2o + 4)(-3 + 3 + 5) + (-2o - 2o + 6o)(-2 - 1 + 4). -8o Expand (2 - 2 - 1)((3 - 4 + 2)(4k - 3k + 0k) - 2k - 3k + 2k). 2k Expand (4b - 3b + 0 - 4)(0b + 0b - b). -b*2 + 4b Expand 6k - 6k + 27k3 - k3 + 0k3 - k3 + (-k - 3k + 6k)(-2k - 2k2 + 2k) + k*3 + 4k*2 - 4k*2. 22k*3 Expand ((-3 - 3 + 7)(4 - 4 - 3a) - a + 0a + 0a + 0 - a + 0)(3a3 - 3a*3 - 3a*4). 15a5 Expand u4 + 0 + 2 - 1 + (-5u3 + 3u*3 + 7u*3)(2u + u - 5u). -9u4 + 1 Expand -3c3 - c3 + c*3 + (-6c + c + 3c)(-5c2 + 2c2 + c2). c3 Expand (q4 - 5q4 - 12q*4)(3 + 0 - 2). -16q4 Expand (-2j*2 - 2j + 2j)(4j3 - j3 - 5j*3) + 7j*5 + 0j5 - j5. 10j5 Expand (-3m*2 + 2m*2 + 3m*2)(-3 + 9 + 5)(6m - 2m - 2m). 44m3 Expand (-2 + 3 - 14)(-9x + 5 - 5). 117x Expand (-v*2 + 2v*2 + 0v*2)(77 + 32v - 77). 32v*3 Expand (0 + 2 - 4y - 3)(3 - 1 + 2). -16y - 4 Expand 4x3 + 15x3 + 69 - 67 + (x3 + 2x - 2x)(-1 - 1 + 3). 20x*3 + 2 Expand (-1 - 8 - 6)(2n5 + n5 - 5n*5). 30n5 Expand (p2 - p2 + p2)(-2 - 2 + 6) + (2 + p2 - 2)(-7 - 2 + 3) - 3p2 + 4p*2 - 2p*2. -5p*2 Expand (2d*2 + 2d*2 - 6d*2)(221 - 103 - 99). -38d2 Expand (-71 + 33 - 47)(b*2 + 0b*2 + 0b*2). -85b*2 Expand ((0 + 1 - 2)(2 + 1 - 5) + 0 + 1 - 6)(-2w - 2 + 2)(1 - 6 + 3). -12w Expand (3y3 - y3 - y3)(-5 - 2y + 5)(-7 - 1 + 0). 16y4 Expand (-j + 0j - 3 + 2)(2j*2 + 82j - 82j). -2j*3 - 2j*2 Expand (b + b + 0b)(4b*2 + 0b*2 + 8b*2) + (0b + 2b2 + 0b)(-b - 3b + 2b) + 2b*3 + 0b3 - b3. 21b3 Expand (2p*3 - 2p*3 - 3p*3)(-4p2 + 2p*2 - 3p*2) + 3p*5 - 2p5 + p5. 17p5 Expand (3 - 2i - 3)(-2i + 2i - 2i*2) + 2i*3 - 4i3 + i3. 3i3 Expand (-92 + 92 - 5p*4)(-3p + 3p - 2p) + (5p*5 - 2p5 - p5)(-1 + 4 - 5) - 3p5 + p5 + 0p5 - p2 + p2 + 2p*5. 6p*5 Expand (-3 + 3 - i)(8 - 3 + 3 + 6i). -6i*2 - 8i Expand (2 + 2 - 5)(4f - 17f + 5f)(0f*3 + 0f*3 - 2f*4). -16f*5 Expand -372a + 372a + 8a*4 + (-3 + 3 - a)(2a3 + 4a*3 - 5a3) + a4 - 4a4 + a4. 5a*4 Expand -10 + 8u + 10 - u + 5u - 2u + (4 + 0 - 3)(2u + u - u) + 0u - 2u + u. 11u Expand (2u*2 + 2 - 2)(5 - 5 - 2) + (u*2 - 4u + 4u)(1 + 0 + 1). -2u2 Expand (0 - 5 + 3)(-x - 2x - x) - x + 2x + 0x. 9x Expand (4u - 3u + 0u)(-3u - 3u + 5u) + 2u*2 - u + u + 3u + u*2 - 3u - u*2 + 3u*2 + 4u*2 - 2u*2 + 2u*2 - 2u*2. 6u*2 Expand (5z*2 - 13z2 + z2)(-1 - z + 1 + (-5 + 5 + 2)(3z - z - z)) + (-4z2 + z2 + 4z2)(z + 2z - z). -5z*3 Expand (0 - 2q + 0)(-3 + 3 + 11q) + (-q + 0q + 5q)(4q - 3q - 3q). -30q2 Expand (5a*2 + 8a*2 + 3a*2 + (-a + 0a + 0a)(a - 1 + 1))(-4a + 1 - 1). -60a3 Expand (-2n*2 + 6n2 - n2)(0n - 2n - 2 + 1). -6n*3 - 3n*2 Expand (2 + 2q - 2)(-3 + 4 + 2q - 6q). -8q*2 + 2q Expand (3 - 1 - 3)(-38 - 16 + 11)(-3w + 2w	{ "pile_set_name": "DM Mathematics" }
e second biggest value in i, 3, s? s Let t = 2609 + -2609.4. Which is the biggest value? (a) -34 (b) t (c) 3 c Let v = -3900 + 7795/2. What is the smallest value in 0.2, 6, v, -0.1? v Let n(t) = -18t - 94. Let k be n(-5). Let h be -4 + 3 - 8/20k. Which is the second smallest value? (a) 4 (b) 5 (c) h a Let y = 225 + -228. Let d = 19.091 - 19.1. Which is the third biggest value? (a) d (b) y (c) -2 b Let b = -33.26 + 220.96. Let i = b + -188. What is the third biggest value in i, -5, 1? -5 Let j = -23.5 + 48.2. Let o = 25 - j. Let l = 188 - 191. Which is the smallest value? (a) o (b) 23 (c) l c Suppose -367m + 806 = -517 - 512. What is the fifth smallest value in 1/17, 2, 3, 0.013, m? m Let o = 56 - 51. Let j = -0.1034 + -0.2966. What is the second smallest value in 21, -1, j, o? j Let w = -14692 - -14682. Which is the third smallest value? (a) 1/27 (b) w (c) 4 (d) 1 d Let h = -49.62 - -14.62. Let o = -34.972 + 0.372. Let q = h - o. Which is the third biggest value? (a) q (b) -5 (c) 35 b Let x(w) = 3w*2 - w - 3. Let z be x(3). Let f be (-1 + -2)1/z. Let l be 16/6(63/156)/7. Which is the fourth biggest value? (a) 1/11 (b) f (c) -5 (d) l c Let t = -10.145 - -10.245. Which is the biggest value? (a) -5/2 (b) t (c) 1/37 b Let y = 20.403 - 21.403. What is the biggest value in y, 5, 46.1? 46.1 Let z = -7145.5 - -7142. Which is the fourth biggest value? (a) z (b) -5/4 (c) 1 (d) 29 a Let u = -1157/778 + -5/389. What is the fourth smallest value in u, -0.2, 3, -3/5? 3 Let l = -327 - -178. Let x = -148.8 - l. Which is the second biggest value? (a) x (b) -0.1 (c) 0 (d) 3 a Let x = 1825 - 1825. Let i = -0.07 - 0.53. Let h = 6.211 - 0.211. What is the third biggest value in h, i, 4/7, x? x Let b = -79397/8 + 9925. What is the third biggest value in 2/33, b, 18, -4? 2/33 Let p = 7846.93 + -7847. Let i be 2/884-2. What is the third biggest value in i, 1/3, p? i Let b be (-2)/(-9)(-3)/(-4). Let c = 0.862 + -1.262. What is the third biggest value in b, 3/7, -2, c? c Let q = -78.6 - -246.1. Let s = -168 + q. Which is the second smallest value? (a) -5 (b) s (c) -5/4 (d) 0.19 c Let c = -3878.13 + 3878. What is the third biggest value in -5/113, c, 5? c Let r = -0.08386 - 4.91614. What is the biggest value in 19, -0.5, 5, r, -4/9? 19 Let z = 2203 - 2206. Which is the fourth smallest value? (a) z (b) 20 (c) -0.19 (d) 4/3 (e) 1/4 d Let u be (-3)/((3 + (-23)/3)/(24/486)). Let k be (2/3)/(2/9). Let g be 4/(-6)k/4. What is the biggest value in 1/4, g, u? 1/4 Let c = -10 + 76.2. Let u = -66 + c. What is the second smallest value in 6/11, -0.2, 1/3, u? u Let h = 0.667 + -55.867. Let q = h + 52.2. What is the second biggest value in -2.5, 3, q, 0.2? 0.2 Let n(o) = -6o - 141. Let g be n(-23). Let k = -59 + 54. What is the second smallest value in 1, g, k? g Let t = 2581.9 - 2582. Which is the fourth smallest value? (a) t (b) -51 (c) -1 (d) -8 a Let v = 2423 + -2424.7. Let p = 520688870/737 - 706498. Let i = p - -2/67. What is the biggest value in v, i, -0.1? -0.1 Let t = -9954 + 9951. Let w be (-2)/(-5)(-25)/(-30). What is the fourth biggest value in w, 2/7, -1/3, t? t Let s = -0.239 + -12.561. Let p = 12.6 + s. Which is the second biggest value? (a) p (b) 2/9 (c) -0.01 (d) 2/5 b Suppose -5f - 888 = -w + 5w, 186 = -f + 2w. Which is the second biggest value? (a) -1/12 (b) f (c) -3 c Let s = -22 - -152/7. Suppose 4m - 3x - 141 = m, 2x = 6. Which is the second biggest value? (a) s (b) -1 (c) m a Let d be (-341)/(-888) + (-81)/216. Let o = 0.6 + -0.2. Which is the smallest value? (a) d (b) o (c) -2/9 c Let b = -3.9729 - -4.3729. What is the second smallest value in -3, b, -4, 3, -13? -4 Let f = 2 - 3. Let g be (f/(-85))/(-15 + 14). Let j = 257/170 + g. Which is the second biggest value? (a) 3 (b) j (c) 0.2 b Suppose -6u + 172 = -4u. Let t = u + -91. Suppose 7 = -5f - h, -2h = 4f - 4 + 6. Which is the fourth biggest value? (a) f (b) t (c) -4 (d) 3 b Let x = 84 + -165/2. Let z be 198/1134 - (-1)/9. Which is the second smallest value? (a) z (b) -5 (c) x (d) 2 a Let y = -39895/11 + 3627. What is the third smallest value in y, -4, 2, 2/5, 16/9? 2/5 Let f = 19 + -19.5. Let c be 0 - (-1 + 9/11). Let z = -32794 - -32789. What is the second smallest value in 11/5, f, c, z? f Let h be (6/(-4))/((-6)/12). Let w = 0.01 + -18.01. Let x = w + 17.8. Which is the third biggest value? (a) x (b) -0.4 (c) h b Let w = -3/22 - 9/22. Let f be 237/18(-7 + (-76)/8). Let x = 218 + f. What is the smallest value in w, x, -5? -5 Let v = 0.321 - -15.879. Let j = 15 - v. Which is the fourth biggest value? (a) j (b) -4 (c) -1/5 (d) -3/8 b Let y(x) = -2x*2 + 15x - 20. Let i be y(5). Suppose iq - 50 = 15. Let s = 69/8 - 393/40. Which is the second smallest value? (a) q (b) s (c) -4 b Let v = 5.596 + -3.596. Which is the second biggest value? (a) -338 (b) -2 (c) v b Let j = -5790 + 5790.4. Which is the second smallest value? (a) -81 (b) 2/3 (c) j c Let u = -205.98 - -208.98. Which is the biggest value? (a) -6 (b) u (c) -2/7 (d) 0.4 (e) -0.5 b Let m = -111.085 + 0.085. Let x = 114 + m. Which is the smallest value? (a) x (b) -2/7 (c) -4 (d) -1/4 c Let h = 14.876 + -16.876. Which is the second smallest value? (a) h (b) -4 (c) 4/3 (d) 0.3 (e) 5 a Let t(s) = s + 4. Let v be t(-2). Let w = -3910.5 - -3911. Which is the second biggest value? (a) 4 (b) 0.4 (c) v (d) w c Let m be 22875/(-135) + (-36)/81-1. What is the fourth smallest value in -0.5, m, -3, -0.6? -0.5 Let a = 225 - 179. Let d be (a/414)/((-4)/6). What is the biggest value in 3, d, -9, -0.3? 3 Let l be (1 - -1)/((-66)/6). Let t be 2/6(-9)/(-9). Which is the second biggest value? (a) 1.9 (b) t (c) l b Let w = -0.182 + -0.018. Let y = 1820.6 - 1821. What is the second biggest value in -28, y, w? y Let h = -2.1 - -60.1. Let i = -64 + h. Which is the second biggest value? (a) -1 (b) 1/2 (c) i (d) 0.8 b Let p = -2.094 - 0.326. Let x = -2.22 - p. What is the smallest value in 5/6, x, -4? -4 Let o = 0.08049 + -0.28049. Which is the fourth smallest value? (a) o (b) -53 (c) -2 (d) 1/6 d Let l = -19757 - -19754. Which is the second smallest value? (a) l (b) -0.5 (c) -503 a Let a = 2910 + -2910.2. What is the fourth biggest value in -4, a, -0.22, -2? -4 Let i = -1269 + 1374.6. Let v = i - 106. Which is the second biggest value? (a) -3 (b) v (c) -0.11 b Let k = -33608.066 + 33608. Which is the smallest value? (a) -3 (b) 2/7 (c) 0.5 (d) k (e) 4 a Suppose 3n + 4b - 343 + 39 = 0, 3n - b = 329. Let g = -112 + n. What is the smallest value in g, -0.05, 3, -2? g Let u = -8867 + 8868. What is the third smallest value in u, -0.4, -3/5, -1/33, 0? -1/33 Let z = 1138 + -1142. Which is the biggest value? (a) 2/9 (b) z (c) 7 (d) -2 (e) -0.13 c Let o = 0.6 - 0.3. Let i = 77.74 - 78.04. Which is the second smallest value? (a) -55 (b) 3 (c) i (d) o c Let s = 90 + -1532/17. Let k = 8 - 4. Suppose -2 - 8 = -d + 4j, -5d + kj + 18 = 0. Which is the third smallest value? (a) -0.01 (b) d (c) s b Let p = 149 - 154. Let z(c) = c3 - 7c*2 + 6. Let q be z(7). Let y be ((-3)/18)/(4/q). What is the second smallest value in y, -0.01, p? y Let y = 9836.09 + -9836. What is the fifth biggest value in 2, -0.4, y, -2/9, 20? -0.4 Let f = 3784 + -3789. Which is the third smallest value? (a) 0.4 (b) 5/4 (c) f b Let y = -0.061741 + 0.161741. Let f = -0.07 + -0.03. Let i = 0.4 - f. What is the third smallest value in -0.5, y, 2/31, i? y Let w = 98 + -97.84. Let g be -12(4 - 4 - (-2)/(-6)). What is the third smallest value in 0.1, g, w? g Let w = -416/11 - -38. What is the biggest value in -3, 8, w, 3/7, 1/4? 8 Let z be 370/(-3145) - (-93)/1010/68. Which is the third smallest value? (a) -0.4 (b) z (c) 1/3 (d) 2/13 c Let s(q) = -23q - 8. Let w be s(-8). Let n be 1/4 - w/192. Let c = -75 + 75.4. What is the third biggest value in 13/5, c, n? n Let q = 3320 + -3316. Which is the fourth smallest value? (a) q (b) 21 (c) -5 (d) 1 b Let o be ((-1)/(-4))/(5/12). Let a = -66.5 + 67. What is the second biggest value in a, 15, o, 1/3? o Suppose 4v = -3o + 246, 5o + 4v = -40 + 450. Let m = o + -163/2. Which is the third sma	{ "pile_set_name": "DM Mathematics" }
sqrt(833) + -2 + -5)*2 + -2) + 1)51. -26515 + 2940sqrt(17) Simplify (-1 + -3 + ((sqrt(100)3)/sqrt(5) - (sqrt(55)/(-2sqrt(11)) - (sqrt(605) - 2sqrt(605)))))2 + -2. 36sqrt(5) + 461/4 Simplify (sqrt(11) - (-1sqrt(11) - sqrt(11))-3) + sqrt(110)/sqrt(10) + 4 - (3 + (3sqrt(396))2 + 4). -3567 - 4sqrt(11) Simplify (-5 + 2 + sqrt(1053))*2 + -4 + -5 + 1 + 3sqrt(1053)6-3. -540sqrt(13) + 1054 Simplify ((sqrt(196) + (sqrt(196) - (sqrt(196) - (sqrt(196)2 - sqrt(196)))))/sqrt(4))/(sqrt(21)/sqrt(3)-5) + ((0 + sqrt(28) - sqrt(63)-5) + -2)*2. -342sqrt(7)/5 + 2027 Simplify -4(sqrt(108)/sqrt(64) - sqrt(81)/sqrt(3)5)/(sqrt(45)/(sqrt(320) + sqrt(320)1))4. 1216sqrt(3) Simplify (-1(3(sqrt(19)2 + sqrt(19) + sqrt(19) + -5))*2 - -2sqrt(209)/(sqrt(1331) - (sqrt(1331)-2 - sqrt(1331)))) + -1. -2962 + 7921sqrt(19)/22 Simplify (-2 + (sqrt(1152) + 3 + 3 - (sqrt(1152) + -4 + -3sqrt(1152)))-3)*2. 13824sqrt(2) + 94336 Simplify 4((-2sqrt(1088))*2 + ((2sqrt(425) - sqrt(425))*2 - sqrt(17)) - (-2 + ((sqrt(2448)-2 + sqrt(2448) - sqrt(2448)) + 3)*2)). -20088 + 572sqrt(17) Simplify (1(sqrt(98)-2 + 2 + 3))*2 + -2sqrt(242)2 + (-4sqrt(242) - sqrt(242)) + -4. -239sqrt(2) + 413 Simplify 5 + (sqrt(304) + 3(-1 + sqrt(304) - sqrt(304)) - (sqrt(304) + -2sqrt(304) + -3)) + ((sqrt(304) + -1)4 + sqrt(304) + 0 + -3)*2 + 1. -272sqrt(19) + 7655 Simplify ((sqrt(40)2 + sqrt(40))/sqrt(8) + (sqrt(500) + -1)2 + (3(-1sqrt(180) - sqrt(180))-2)*2)2. -34sqrt(5) + 52842 Simplify -5((sqrt(448)4-4 + sqrt(448) - (-1 + sqrt(448) + -5))1 + 1 + 2)2. -573845 + 11520sqrt(7) Simplify ((-3sqrt(72)-4 + sqrt(72))/sqrt(2))/(((4sqrt(72)5 - sqrt(72) - sqrt(72)) + sqrt(72))/sqrt(6)). 13sqrt(3)/19 Simplify (sqrt(39)/(sqrt(3) - (sqrt(147) + sqrt(147)5)) + -4(sqrt(117) + sqrt(13))4)-6. 15750sqrt(13)/41 Simplify ((sqrt(1331) - (4(-1 + sqrt(1331)) + sqrt(1331) - sqrt(1331)))2 - (sqrt(1331) + -6-1sqrt(1331)))6 - (4 + sqrt(1331)21 + 5). -2068sqrt(11) + 71961 Simplify ((-1sqrt(63)3)/(sqrt(567)1))/(3(sqrt(27) + sqrt(432)) + -2sqrt(108)). -sqrt(3)/99 Simplify 6(0 + -21sqrt(1700) + 5 + -6((sqrt(1700) + 0)5)2). -1529970 - 120sqrt(17) Simplify (-1(sqrt(1053) + 1 + 4 + -1 + sqrt(1053) + -3 + -1sqrt(117) + 1sqrt(13) + -2))2. -32sqrt(13) + 3329 Simplify -5sqrt(2736)4 + 1 + (3(sqrt(475) + 1 + sqrt(475)) - (-1 + sqrt(475) - sqrt(475))3)*2. 120sqrt(19) + 17137 Simplify -3-5((sqrt(171)2-1 + (sqrt(171) + -3-1sqrt(171) - sqrt(171)))/((-1sqrt(99)1)/sqrt(11)) + -2). -15sqrt(19) - 30 Simplify ((2sqrt(352) + sqrt(352) + sqrt(352))2 - 22sqrt(352))/((sqrt(216)/(sqrt(36)/sqrt(4)) + sqrt(24))/(1sqrt(108) + sqrt(108))). 48sqrt(11) Simplify -3(sqrt(8)1)23 - -1((sqrt(2) + (2sqrt(6))/sqrt(3) - sqrt(2)) + sqrt(288) + 0). -72 + 14sqrt(2) Simplify ((-44(sqrt(136) - sqrt(136)2)-4)/(-1sqrt(968) + sqrt(72)-3))2. 4352/25 Simplify (2-1sqrt(133) + sqrt(133))/((sqrt(7)1 + sqrt(7))-6) - (-1 + sqrt(2736) + (sqrt(2299) + -1)2). -2299 + 121sqrt(19)/12 Simplify ((sqrt(3024) + 31sqrt(3024) + sqrt(3024) + -2sqrt(3024)-1)/(((sqrt(224)-1)/sqrt(8) - sqrt(28))-1))*2. 1323 Simplify -4sqrt(275) + sqrt(220)/sqrt(5) + 6(-4 + sqrt(275) + -2 + sqrt(275) + sqrt(275)). -36 + 72sqrt(11) Simplify (-1 + sqrt(3) + -3)*2 + (sqrt(24)/sqrt(8)-4)*2 + (6(sqrt(432) + (sqrt(432) - -3sqrt(432))))/sqrt(9). 67 + 112sqrt(3) Simplify (5(3 + sqrt(243)) + -3)2 + (-3(sqrt(27) + sqrt(108)/sqrt(4)))/(1sqrt(324)). 1079sqrt(3) + 6219 Simplify 3-3(-3 + (((sqrt(5) + -4)3 + sqrt(5))-6 + 5)5 + -5). -3393 + 1080sqrt(5) Simplify ((sqrt(77)36)/(sqrt(55)/sqrt(80)))*2 + (((sqrt(2268) - sqrt(2268)2) + sqrt(2268))/sqrt(9) - (-2(sqrt(252) + 0))2). 35280 Simplify (2(3 + sqrt(125) + -4 - sqrt(125))-1 - -6((1 + sqrt(125) + sqrt(125) - sqrt(125))3 - (5 + (sqrt(125) - -2sqrt(125)))))*2. 100 Simplify (-4 + 1 + -3(sqrt(637) + -4 + sqrt(637)-3 + sqrt(637) + 5))2. -252sqrt(13) + 5769 Simplify -3 + (23sqrt(2299) + 1 - (sqrt(2299)1 + 5 + -3 + sqrt(2299)-1))*2. -132sqrt(19) + 82762 Simplify 3 + (-4 + (1 + ((-4(sqrt(128) + 0 - sqrt(128)))2 - (2sqrt(128))*22))-6 + 2)5. 30683 Simplify ((sqrt(9)/(sqrt(12)/sqrt(4)) + (1sqrt(108) - sqrt(3)))-2 - (sqrt(1452) - sqrt(1452)3)2)*2. 17328 Simplify -5(-2 + (0 + 3 + sqrt(243) + -2sqrt(243) + 4)2)-66. -22680sqrt(3) + 52200 Simplify ((((sqrt(605) + sqrt(605) + 0)1 - sqrt(605)) + -1)-6 + 5(-2 + sqrt(80) + 1 + 3 + sqrt(80)))2. -832sqrt(5) + 3636 Simplify (sqrt(252) + -4(sqrt(252)-3 + sqrt(252) + sqrt(252) + sqrt(252)) + -2 + -5sqrt(252)44)2. 1896sqrt(7) + 1572736 Simplify -1(-1 + 0 + ((sqrt(165)/sqrt(5)11)/(1-2sqrt(12)))2). 5/16 Simplify (3sqrt(1500) - 2sqrt(240)/sqrt(4))/((5((sqrt(132) - 1sqrt(132)) + sqrt(132) + sqrt(132)) + sqrt(132))/sqrt(11)-1). -13sqrt(5)/11 Simplify ((2sqrt(180)-2)2-4 - (-1 + (4(1 + sqrt(180)))2))2-6. 2304sqrt(5) + 172980 Simplify sqrt(190)/(sqrt(1210)-1) + (-1-2sqrt(76))/sqrt(4) - ((6sqrt(304) - sqrt(19) - (3 + (sqrt(57)/sqrt(3) - sqrt(19) - sqrt(19)))) + 5)*2. -10948 - 1035sqrt(19)/11 Simplify 1 + (sqrt(135)13)/(52sqrt(500)). 9sqrt(3)/100 + 1 Simplify (-1 + -1 + (sqrt(405) + (sqrt(405) - (sqrt(405)2-5 + sqrt(405))) + 5 + sqrt(405) + 0 - -5(sqrt(405) - 1sqrt(405)-1 - sqrt(405))))*2. 918sqrt(5) + 117054 Simplify ((-2(sqrt(77)1 + sqrt(77) + sqrt(77) + sqrt(77)) - 4(sqrt(77) + (sqrt(77) - -1sqrt(77))))-2)/((sqrt(44)1-2)/(sqrt(4) - 1sqrt(100))). 80sqrt(7) Simplify (5((1sqrt(693)6 - sqrt(693))/sqrt(11) + sqrt(693)/((3sqrt(11) - sqrt(11))-3)))*2. 147175/4 Simplify ((sqrt(171) + -1sqrt(171) - sqrt(209)/(sqrt(11) + sqrt(33)/sqrt(3)))*2 - ((4 + sqrt(1900) + -1)4)*2)4. -122157 - 3840sqrt(19) Simplify (-3(sqrt(175) + 1 - sqrt(175))-66)*2 + 2 + (sqrt(1008) - -3(sqrt(1008) + -2sqrt(1008)) - (1sqrt(1008)-5 + sqrt(1008))). 24sqrt(7) + 11666 Simplify 0 + (((-5 + sqrt(1377))-3 + -2 + sqrt(1377) + (-4 + sqrt(1377) - sqrt(1377)))4)*21. -5184sqrt(17) + 89424 Simplify -6(-2 + -1sqrt(52) + -5) - ((-5 + sqrt(260)/sqrt(5))2 + -4(1sqrt(52) - sqrt(52)) + 2). -37 + 32sqrt(13) Simplify ((5(sqrt(1377) + 2sqrt(1377)) + 2)-5 - (5 + (sqrt(612)1 + -4 - (-1 + sqrt(612) + 3))))*2. 12150sqrt(17) + 7745706 Simplify (2(-2sqrt(100) + sqrt(100))65)/(2sqrt(162) - sqrt(14)/sqrt(7)5). -300sqrt(2)/13 Simplify (0 + 0 + sqrt(448) + sqrt(448)1 + -2)*2 - ((sqrt(343)3 - sqrt(343))*2-4 + -5 + (sqrt(343)-1)2). -64sqrt(7) + 6946 Simplify 2 + (sqrt(208) + sqrt(208) + 2 + 5)*2-2 + (1sqrt(208) + -4 - 1sqrt(208)1) + -3. -1767 - 224sqrt(13) Simplify (-3(3 + sqrt(245)-4) - (-4 + (sqrt(5) - (sqrt(5) + 2 + -3)*2) + -1)) + 3. 5 + 81sqrt(5) Simplify (-1 + sqrt(35)/(sqrt(7)-1)1 + -5)*2 + 3 + -6((sqrt(500) - (1 + sqrt(500) - sqrt(500)))*2 - sqrt(500)) + -2. -2964 + 192sqrt(5) Simplify (3(-1sqrt(68) + sqrt(68)) - (-34sqrt(68) + sqrt(68)))/((-4sqrt(8)/sqrt(2) - sqrt(800)/sqrt(8))-6). 11sqrt(17)/54 Simplify 6((1((sqrt(176) - (sqrt(176) + sqrt(176)-2)) + 3))2 - (5 + (-2 + sqrt(176) - sqrt(176))25))-4. -16512 - 1152sqrt(11) Simplify ((-1sqrt(891) + 0 + sqrt(891) + 3(sqrt(891) - (sqrt(891) + (sqrt(891) - -1sqrt(891))) - sqrt(891)))-5)2 + 5(0 + sqrt(891)) + 2sqrt(891) + -4. 63sqrt(11) + 1804271 Simplify (2sqrt(78)-1 + sqrt(78) - -6(sqrt(78) + sqrt(78)-2 - sqrt(78)))/(sqrt(60)/(sqrt(60)/sqrt(24) - sqrt(10))) + 5. 5 + 13sqrt(13)/2 Simplify ((-1sqrt(480)-3 - (6(sqrt(480) + (sqrt(480)2 + sqrt(480) - sqrt(480))) + sqrt(480)))/((sqrt(24) + sqrt(216)3)/(1sqrt(256))))2. 65536/5 Simplify ((sqrt(2112) + 4(sqrt(2112) + (2sqrt(2112) - sqrt(2112)) - sqrt(2112)))-1)/(sqrt(96)/sqrt(2) - sqrt(48) - 5(sqrt(3) - sqrt(3)2)). -8sqrt(11) Simplify 1((-5(sqrt(72) + (sqrt(72) - (sqrt(72) + -1))) - (5 + -1 + sqrt(72) + sqrt(72)))2 - (6(-2 + sqrt(72) + sqrt(72))6)2) + 1. -374822 + 62964sqrt(2) Simplify (sqrt(56)/(-2sqrt(8)))2 + (4 + sqrt(56)/sqrt(8))2 - ((sqrt(56) + -1(sqrt(168)/sqrt(3) - sqrt(56)))/(sqrt(32)/(sqrt(12)/sqrt(3))))*2. 71/4 + 8sqrt(7) Simplify ((sqrt(7) - (sqrt(7) + 2 + sqrt(7) + 5)) + -5(sqrt(7) - sqrt(63)/sqrt(9)) - (sqrt(28)4	{ "pile_set_name": "DM Mathematics" }
1232 Divide -13248 by 13248. -1 Calculate 10 divided by -2792. -5/1396 Calculate -6980 divided by 4. -1745 Calculate -230025 divided by -46005. 5 Calculate -5 divided by 675. -1/135 -84540 divided by -20 4227 Divide -12509 by 66. -12509/66 Calculate -84 divided by 207. -28/69 Divide 4572 by -2286. -2 What is 508 divided by -26? -254/13 Calculate -418548 divided by -8049. 52 Divide -1075865 by -2. 1075865/2 Divide 158521 by 1. 158521 Divide -5826 by -107. 5826/107 What is 1018668 divided by 7? 145524 Calculate 10 divided by -11175. -2/2235 What is 3601 divided by 93? 3601/93 What is 2 divided by -898362? -1/449181 What is 4 divided by -617? -4/617 -12571 divided by 967 -13 173510 divided by 2 86755 Divide 2 by 179864. 1/89932 Divide -187672 by -93836. 2 Divide 2845562 by 254. 11203 Calculate -24141 divided by 3. -8047 -53516 divided by -34 1574 Divide 22208 by -64. -347 What is 426490 divided by 5? 85298 13161 divided by 19 13161/19 -74298 divided by 12383 -6 What is 3 divided by -21144? -1/7048 Calculate -240436 divided by 2. -120218 -24 divided by -7562 12/3781 Divide 19 by -3126. -19/3126 What is 57723 divided by -3? -19241 Calculate 2483 divided by 21. 2483/21 Divide -39780 by 780. -51 What is -572622 divided by 1? -572622 What is -84609 divided by 17? -4977 Divide -75048 by -3127. 24 -88 divided by 360 -11/45 Divide 185122 by -4. -92561/2 What is 7845480 divided by 5? 1569096 49578 divided by -6 -8263 401 divided by -113 -401/113 Calculate 3946320 divided by -49329. -80 Divide -54252 by -2. 27126 -37973 divided by -7 37973/7 What is -10276 divided by 65? -10276/65 1 divided by 1239154 1/1239154 Divide 655408 by -4784. -137 -245 divided by 322 -35/46 0 divided by -10868 0 What is -3392408 divided by -848102? 4 What is 4 divided by -726500? -1/181625 Divide 1 by -7990. -1/7990 2484900 divided by 69025 36 Divide -93 by -426. 31/142 15113 divided by -889 -17 Divide 290 by -84. -145/42 What is -324765 divided by -3? 108255 170625 divided by -175 -975 What is -29304 divided by 1? -29304 Divide 484062 by -161354. -3 Divide 27 by -12496. -27/12496 What is -1030446 divided by 57247? -18 What is 3 divided by 23218? 3/23218 Calculate -2328054 divided by -5. 2328054/5 Divide -13 by -29477. 13/29477 -13365 divided by -6 4455/2 1162560 divided by -1211 -960 -81370 divided by 16274 -5 Calculate 1736 divided by 28. 62 Divide 17454 by -8727. -2 What is -39832 divided by 2? -19916 Calculate -91649 divided by 2477. -37 -177 divided by 10264 -177/10264 What is 0 divided by -116681? 0 Divide 3 by 1632. 1/544 What is 12022 divided by 1? 12022 Calculate -51226 divided by -7. 7318 59108 divided by -4222 -14 What is -55818 divided by -3987? 14 Calculate 423927 divided by 7. 60561 Divide 4908099 by -399. -12301 Divide 259656 by -93. -2792 Calculate 387936 divided by 288. 1347 -2642 divided by 71 -2642/71 What is 3505712 divided by -1582? -2216 Calculate 16 divided by -11306. -8/5653 What is 1922340 divided by 115? 16716 160402 divided by 7291 22 Calculate 82 divided by 1922. 41/961 Calculate -56452 divided by -4. 14113 Divide -90460 by -3. 90460/3 Divide 18 by -25523. -18/25523 Divide 1437825 by 479275. 3 Divide 57362 by 6. 28681/3 Divide 114820 by -22964. -5 What is 34832 divided by 7? 4976 What is 5773 divided by -124? -5773/124 Calculate 4689230 divided by -10. -468923 Calculate -18529 divided by 2647. -7 -3 divided by -293526 1/97842 Divide -470226 by -1. 470226 What is 5932038 divided by 6? 988673 What is 79050 divided by 155? 510 -276192 divided by -30688 9 -2216544 divided by 554136 -4 What is -10818 divided by 3? -3606 Divide -127590 by -5. 25518 33776 divided by -8444 -4 Calculate 439632 divided by -6. -73272 -2233887 divided by 4 -2233887/4 What is -105176 divided by -2? 52588 What is 132032 divided by -4? -33008 Calculate -171 divided by -1742. 171/1742 1027194 divided by 259 3966 Calculate 796944 divided by 398472. 2 1059442 divided by -529721 -2 -1661 divided by 11 -151 What is -6640 divided by -415? 16 Divide -7282300 by -4. 1820575 What is -90546 divided by -2? 45273 Calculate -45387 divided by -9. 5043 Calculate -11201 divided by -5. 11201/5 6021738 divided by 1003623 6 Calculate -24552 divided by 4. -6138 5 divided by 476474 5/476474 Calculate -5487 divided by -11. 5487/11 Calculate 52480 divided by 64. 820 Calculate 61478 divided by -521. -118 What is 5802480 divided by -5? -1160496 What is 8100 divided by 76? 2025/19 -321589 divided by 1 -321589 What is -4 divided by 28638? -2/14319 Divide 10 by 396. 5/198 Divide -6070 by -85. 1214/17 292866 divided by 57 5138 Divide 12600 by -450. -28 What is -174621 divided by -6? 58207/2 Divide 727808 by -90976. -8 Calculate 3 divided by 629134. 3/629134 What is 9440 divided by -2360? -4 -29646 divided by 3 -9882 1383668 divided by -2132 -649 Divide -273162 by -1718. 159 Divide 4580 by -2290. -2 What is 101376 divided by -18? -5632 -89726 divided by -221 406 What is -47958 divided by 15986? -3 13256 divided by 13256 1 What is -646 divided by -12? 323/6 What is 24 divided by 2579? 24/2579 What is -6 divided by 59245? -6/59245 Divide -443 by 6777. -443/6777 Calculate -182 divided by -26. 7 -23691 divided by 7897 -3 Divide 919576 by 14. 65684 Calculate -62348 divided by -1417. 44 What is 4080 divided by -408? -10 Calculate -48550 divided by 24275. -2 Calculate 0 divided by -357761. 0 Calculate 2 divided by 40527. 2/40527 Calculate 1791 divided by 3852. 199/428 264579 divided by 37797 7 Calculate 315144 divided by -6. -52524 -944 divided by 99 -944/99 -45 divided by -953 45/953 Divide 2133505 by -426701. -5 Calculate -584757 divided by -3. 194919 0 divided by -11996 0 Calculate 26 divided by -134626. -13/67313 Calculate 976 divided by -1541. -976/1541 What is -1650 divided by 67? -1650/67 1176 divided by -24 -49 Divide -68882 by 31. -2222 What is -126352 divided by -596? 212 Calculate -56448 divided by 18. -3136 What is 9 divided by 138812? 9/138812 What is 1683186 divided by 561062? 3 Calculate 376 divided by 166. 188/83 -3221845 divided by -1 3221845 What is -106640 divided by -155? 688 -33 divided by 4069 -33/4069 What is 140652 divided by -6? -23442 Calculate 11 divided by -84774. -11/84774 Calculate -74145 divided by -14829. 5 Divide -13 by 342468. -13/342468 Divide 164700 by -5490. -30 Divide 3 by -110750. -3/110750 What is 1660 divided by -54? -830/27 What is -823149 divided by 2127? -387 -360255 divided by 21 -17155 Calculate 403897 divided by 5. 403897/5 1682984 divided by -1 -1682984 -85 divided by -144 85/144 Calculate 6 divided by -1434688. -3/717344 Calculate 7143 divided by -11. -7143/11 Divide -973708 by -458. 2126 Calculate 439712 divided by 8456. 52 What is -16544 divided by -8272? 2 Divide -4544295 by -5. 908859 Calculate 492 divided by 3855. 164/1285 -1517426 divided by -2 758713 -8588 divided by 4294 -2 What is -4537 divided by 13? -349 Divide -867120 by 173424. -5 66080 divided by -224 -295 What is -5 divided by 2023? -5/2023 4 divided by -287771 -4/287771 22272 divided by -48 -464 1 divided by -145483 -1/145483 56782 divided by 979 58 Divide -4481 by -220. 4481/220 What is -27 divided by -97119? 1/3597 What is -2 divided by 6284? -1/3142 Calculate 4335 divided by -15. -289 Calculate 5293468 divided by -4. -1323367 -8748 divided by -63 972/7 Divide 95359 by -95359. -1 What is 2 divided by 4277? 2/4277 Calculate 6905 divided by 5. 1381 Calculate -6138 divided by 198. -31 Calculate -128172 divided by -10681. 12 What is 66640 divided by 560? 119 What is -1711 divided by 24? -1711/24 Divide -227 by -391. 227/391 Calculate -70378 divided by 1. -70378 136944 divided by -8 -17118 What is 1988 divided by -33? -1988/33 What is 57792 divided by -28896? -2 Calculate 1100312 divided by -275078. -4 -335 divided by -228 335/228 Divide 59750 by 5. 11950 What is -1739325 divided by 49695? -35 Calculate -9058 divided by -7. 1294 Divide -19774350 by -6. 3295725 What is 35385 divided by 7077? 5 Divide 3013938 by -167441. -18 Calculate -4 divided by 1533. -4/1533 What is 2181 divided by 2090? 2181/2090 Divide 16 by -5569. -16/5569 -112914 divided by -6 18819 What is -213689 divided by -4361? 49 Divide -2183896 by -198536. 11 What is 103007 divided by -6? -103007/6 95460 divided by 555 172 What is 181010 div	{ "pile_set_name": "DM Mathematics" }
7142696n2 + 13414404 wrt n. -14285392n What is the derivative of -232867874c4 - 124992174? -931471496c*3 Find the first derivative of 243030405u*3 + 569239781 wrt u. 729091215u*2 Find the second derivative of -288304517f*2 + 7265f - 16213. -576609034 Find the second derivative of 73549935m2 + 108939179m wrt m. 147099870 What is the second derivative of -69f4 - 352231f*3 + 44153f - 448? -828f2 - 2113386f What is the second derivative of 10579297x5 + 3256679x? 211585940x3 Find the third derivative of -5874k*5 + 29k*4 + 5k*2 - 4k + 7593. -352440k2 + 696k Find the second derivative of 92689d2o*5 - 6d*2 - 121do + 8o*5 + 2953o wrt o. 1853780d2o*3 + 160o*3 Find the second derivative of -137963k*5 - 5k*4 + 4k*3 + 51541812k wrt k. -2759260k3 - 60k*2 + 24k Differentiate 74o3t*2 + 27582o*3 + 974079t*2 - 3t with respect to o. 222o2t*2 + 82746o*2 Find the first derivative of 21939192d - 35451027. 21939192 Differentiate 802939q4 - 95q*3 - q - 501947311. 3211756q*3 - 285q*2 - 1 Find the third derivative of -13095937i*2q*6 + 7i*2q + 19759i2 + 3iq + q2 wrt q. -1571512440i*2q*3 What is the third derivative of -18602020b*3 + 649601b*2 - 2b + 3 wrt b? -111612120 Find the third derivative of 18094w6 - 1411w*4 - 3w*3 - 10487w*2 + 4933 wrt w. 2171280w*3 - 33864w - 18 Find the third derivative of 4826657f5 - 20f*3 - 7682f*2 - 322f + 1. 289599420f2 - 120 What is the first derivative of -67425358p - 125155694? -67425358 What is the second derivative of 127207t2y*2 + 22t*2y - 1813ty*2 + 2291y*2 wrt t? 254414y*2 + 44y Find the second derivative of -2170a2lo2 + 856a*2lo - a2l - 20alo + 2al + 2ao + 6554lo3 - lo wrt o. -4340a2l + 39324lo Find the first derivative of 7d3 + 659616d + 14117398. 21d2 + 659616 What is the third derivative of -1387h6 + h5 + 291h3 - 21928466h*2 wrt h? -166440h*3 + 60h*2 + 1746 Find the second derivative of 240a*3w*4 + 3a*3w - 90a3 - 45a*2w - 3a2 - 4591w*4 - 2w wrt w. 2880a3w*2 - 55092w*2 What is the third derivative of -is*2t*3v + 24is*2t*2v + is2tv + 2is2 + 44285ist*3 - it - 41s2t - 92st*2v + 4t3 wrt t? -6is2v + 265710is + 24 What is the third derivative of -5343584b6 + b2 - 184830b + 9? -641230080b3 What is the second derivative of 43298740h*2 + 46401642h + 2 wrt h? 86597480 Find the third derivative of -1377308z3 + 502z*2 + 5z wrt z. -8263848 Find the second derivative of -n*2s*2u - 2n2s*2 - 366n*2su2 - 21n*2s - n*2u - 1357nu*2 + 14nu - 2s*2u*2 - 3s*2u - 907u wrt u. -732n*2s - 2714n - 4s*2 What is the first derivative of 15283bh2z - 1421bz*2 - 3b - 12h2z*2 - 14h*2z - 20h2 - hz*2 + hz - 103 wrt b? 15283h2z - 1421z2 - 3 What is the second derivative of 162588745r*2 + 224226r - 55 wrt r? 325177490 Find the second derivative of uz2 - 10239uz + 5u - 16z3 - 556289z*2 + 255 wrt z. 2u - 96z - 1112578 Find the third derivative of 8110513d*3x - 65596028d2x wrt d. 48663078x What is the derivative of 12465u3 - u2 + 22u + 953823? 37395u*2 - 2u + 22 Differentiate -258b2 + 182441b + 1111188026 wrt b. -516b + 182441 What is the third derivative of -7480764i*6y - 17i2 - 9358y wrt i? -897691680i3y Differentiate 861852c + 37457497 with respect to c. 861852 Find the second derivative of -7a*2d*2 - 142450a*2dw + 3383352a*2w2 - d2w2 wrt w. 6766704a*2 - 2d*2 Differentiate 93c*2o*4 + 24172c*2o*2 - 295c*2 + 3621c + 3 wrt o. 372c2o*3 + 48344c*2o Differentiate -103639b3 - b2 - 26b - 54834634. -310917b2 - 2b - 26 Find the third derivative of -4q4 - 6212759q*3z*2 + 4q*2z2 + q2z - 89qz - 16737q wrt q. -96q - 37276554z*2 Find the third derivative of 194567kq3 - 2kq2v - 3kq*2 - 30911kqv - 50kv - 14q3v + 2q2 wrt q. 1167402k - 84v Find the second derivative of -1038187b*2n*2w*2 + 194b*2n*2w + 33b2 - 18bn2w*2 - 3bn2w - 15n2w + 2n wrt w. -2076374b*2n*2 - 36bn2 Find the third derivative of 7285229k*4 + 2k*2 + 10k + 2311. 174845496k What is the second derivative of -629690692k*3 - 584477696k? -3778144152k What is the second derivative of -49809544v*2 + 494v + 5288? -99619088 What is the first derivative of 23076458ar + 32a - 85735 wrt r? 23076458a What is the derivative of 11264423h - 18205548? 11264423 What is the first derivative of 3991374k + 8982028 wrt k? 3991374 What is the derivative of -545872b3 + 333b*2 - 518301966 wrt b? -1637616b*2 + 666b Find the third derivative of -2k3x*2 + 6273k*3x - 1143k3 + 4609k*2x*2 - 3k - x*2 - 115 wrt k. -12x*2 + 37638x - 6858 Differentiate -22l3 - 763l*2 - 38l - 567487568 wrt l. -66l2 - 1526l - 38 Differentiate -3m3 - 1511m*2 - 4660m - 159964321. -9m2 - 3022m - 4660 Differentiate -10076yz - 21095445y - 827z with respect to z. -10076y - 827 What is the third derivative of 15164d*2l*3 - 258315d*2l + 11dl*2 - 181l*4 wrt l? 90984d*2 - 4344l Find the second derivative of -fu2 - fu + f + 20345822u5 - 8324u - 63 wrt u. -2f + 406916440u*3 Differentiate -2rt3 + 2584566r + t*3 - 27696678 wrt r. -2t3 + 2584566 Find the third derivative of f6 - 38354043f5 - 33080587f*2 wrt f. 120f*3 - 2301242580f*2 What is the third derivative of 994519722r*3 + 542608858r*2? 5967118332 Find the third derivative of 672863012i*3 - 2305i*2 - 124629i wrt i. 4037178072 What is the second derivative of -23643919m2 - 90586122m? -47287838 Find the third derivative of 6233h2n*3 + 20634h*2n*2 - 8h*2 + 4hn3 - 3hn2 - 6n*3 wrt n. 37398h*2 + 24h - 36 What is the third derivative of -100579905q4 - 140922390q*2? -2413917720q Find the second derivative of 233f5 + 367031f*2 + 430f + 13885. 4660f3 + 734062 Find the third derivative of -719s*4 - 4822s*3 + 3s*2 + 312731. -17256s - 28932 What is the third derivative of 14694959r3 + 215r*2 - 3r + 4582? 88169754 Find the second derivative of 2v4 - 9638821v*3 + 302v - 297672. 24v2 - 57832926v What is the derivative of 6942876z - 2999817 wrt z? 6942876 What is the third derivative of -1520a*2c*3 - 2a*2c*2 + 39a*2c - 817ac*5 + 2a + 7c2 - 492c + 1 wrt c? -9120a2 - 49020ac2 What is the second derivative of 127c*4 + 325454c*2p - 2cp - 5c - 2572p + 49 wrt c? 1524c2 + 650908p Find the second derivative of 372451h5 - h3y + 2h2y + 4191hy + 5y + 27 wrt h. 7449020h*3 - 6hy + 4y Find the third derivative of 42kr*4 + 593kr3 + 2kr2 - 454728k + 23r6 wrt r. 1008kr + 3558k + 2760r3 What is the second derivative of -3771i*2o + 165i2 - 2i - 16056o + 187 wrt i? -7542o + 330 What is the third derivative of -516670231m5 - 49896m*2 - 2m - 105 wrt m? -31000213860m2 What is the second derivative of 30610769r*3z2 + r2z2 - 7062rz2 + 14r + 92z2 wrt r? 183664614rz2 + 2z*2 Differentiate -6856284ac2 + 20255c*2 - 48c + 1 wrt a. -6856284c2 What is the derivative of 101946bk2p + bkp + 211br3 + k2p + 2k*2r*3 + 4k*2 + 424kpr*2 - 2kp - 14k - pr3 wrt b? 101946k*2p + kp + 211r3 Differentiate -d3x - 1079d*3 - 20d*2x + d*2 - dx - 599d + 11767x + 2 with respect to x. -d*3 - 20d*2 - d + 11767 Differentiate -8z*2 - 1017890z + 11035884. -16z - 1017890 What is the first derivative of -i2w - 5i2 - 322i + 26821860w2 + 802 wrt w? -i2 + 53643720w Differentiate -2y2 + 641970y + 8573048 wrt y. -4y + 641970 What is the first derivative of 43540956u*4 - 56604292? 174163824u*3 Find the third derivative of -6038623l*3 + 8667209l*2. -36231738 What is the third derivative of 1975411u*3 - 2u*2 - 378579u wrt u? 11852466 Differentiate -31613010bs + 100b + 63281 with respect to s. -31613010b What is the second derivative of 11cvx2 - 3c	{ "pile_set_name": "DM Mathematics" }
t is f(k(u))? -2u Let y(p) = -26p*2. Let v(r) = 19r. Give v(y(i)). -494i2 Let o(b) = 13b2. Let l(f) = f2 + f - 1. Let g(x) = -4x2 - 3x + 3. Let a(s) = g(s) + 3l(s). Determine o(a(p)). 13p*4 Let h(w) = 96w*2. Let i(o) = 62o. What is h(i(m))? 369024m2 Let b(a) = a2. Let p(z) = -2z - 2z + 4z - 2z. What is b(p(q))? 4q*2 Let s(d) = -394d*2. Let b(i) = -4i*2. Calculate b(s(n)). -620944n*4 Suppose 4k - 3a - 7 = 2, 12 = 5k - 4a. Let o(q) be the third derivative of 0 - 4q*2 + kq + 0q3 + 1/24q*4. Let j(v) = 2v. What is j(o(c))? 2c Let z(i) be the second derivative of -i3/3 - i. Let k = -1 - -3. Let h(l) = -kl - l + l. Determine z(h(x)). 4x Let i = 11 - 25. Let c(w) = -w3 - 14w*2 - 4w - 7. Let p be c(i). Let h(a) = -49 + p - a. Let y(d) = -4d. Determine h(y(x)). 4x Let a(k) = -5k + 2k + 0k. Let n(y) = 3y - 3y + y. Determine n(a(o)). -3o Let q(z) = -z + 2. Let l(x) = -2x + 5. Let w(t) = 2l(t) - 5q(t). Let r(a) = -5a2 + a2 + a*2 - 3a*2. What is r(w(s))? -6s*2 Let c(d) be the third derivative of 0d + 1/60d5 + 0 + 2d*2 + 0d*3 + 0d4. Let q(t) = t2. Calculate q(c(g)). g*4 Let f(o) = 264o + 2. Let x(j) = -2j. Determine f(x(d)). -528d + 2 Let k(d) be the second derivative of -d*3/3 - 12d. Let w(u) = -u*2 + 2u - 2. Let h(c) = 3c2 - 9c + 9. Let v(z) = -2h(z) - 9w(z). Calculate k(v(i)). -6i2 Let q(r) = -r2 + 23. Let g(t) = t. Let i(j) = -j. Let h(s) = g(s) - i(s). Determine q(h(y)). -4y*2 + 23 Let h(l) = 5l*2. Let j(a) = -405 + 405 + a. Give j(h(r)). 5r*2 Let y(l) = 0l2 + l2 + l*2. Let g(w) be the first derivative of -6w*2 - 147. What is g(y(m))? -24m*2 Let k(j) = 2j*2 + 6j*2 - 3j2. Let s(l) be the first derivative of -l3/3 - 56. Give s(k(f)). -25f4 Let h(z) = -4z*2. Let r(w) = -1059w*2. What is r(h(v))? -16944v*4 Let l(a) = -a. Let w(n) = 12n. Calculate w(l(f)). -12f Let n(j) = 4j. Let m(h) = -5h - 4. What is m(n(i))? -20i - 4 Let i(g) = 6g2. Let j(v) be the first derivative of -4v*2 - 13. Give i(j(r)). 384r*2 Let o(p) = p. Let t(d) = 4d*2 - d - 2. Let a(r) = -9r*2 + r + 3. Let w(g) = 3a(g) + 7t(g). Let i be w(5). Let y(c) = -2c + 3c + ic. What is y(o(z))? z Let g(x) = x*2. Let i(z) = 3931z. Determine g(i(j)). 15452761j2 Let y(r) = -2r. Let v(b) = b*3 + 4b*2 + 4b + 3. Let z be v(-2). Suppose zq + 5t = 2t + 33, 31 = q + 5t. Let s(l) = -q + 6 - l. What is s(y(o))? 2o Let t(c) = c + 1. Let a(j) = -3j - 4. Let f(h) = a(h) + 4t(h). Let s(r) = 2 - 5 + 3 - r2. Give f(s(o)). -o2 Let k(y) = 1311y*2. Let s(r) = 2r. What is k(s(b))? 5244b2 Let j(x) = -x2. Let q(a) = -755a. What is j(q(l))? -570025l2 Let g be (-4 - 2)/(-3)1. Let r(s) = 0sg + 4s2 - s2. Let t(x) = -7x. Let f(u) = 10u. Let n(m) = -5f(m) - 7t(m). Calculate n(r(h)). -3h2 Suppose 3n - 30 = n. Suppose 2v - n = -v. Let u(t) = t - t - 2t*2 - vt*2. Let r(q) = -2q. Calculate r(u(w)). 14w2 Let x(l) be the first derivative of l + 0l*2 - 1 + 1/3l*3. Let f(s) be the first derivative of x(s). Let b(j) = j. Determine b(f(u)). 2u Let l(o) = -o. Let k(v) = 132v2. Give l(k(y)). -132y*2 Let i(u) = -58u*2 - 7. Let f(r) = -29r*2 - 3. Let w(p) = -7f(p) + 3i(p). Let c(x) = -2x. What is w(c(b))? 116b2 Let x(h) = 32h2. Let r(n) be the third derivative of -n5/20 - 32n2. What is x(r(k))? 288k*4 Let p(z) = -7z. Let n(i) = -11i + 8. Let r(s) = 4s - 3. Let k(h) = 3n(h) + 8r(h). Determine k(p(g)). 7g Let m(v) = 2v. Let i(t) = -55t2 - 44t - 44. Let p(f) = -f*2 - f - 1. Let y(r) = -i(r) + 44p(r). Determine y(m(c)). 44c2 Let u(k) be the first derivative of -k2 + 3k - 3k - 1. Let w(j) = -2j. Give w(u(n)). 4n Let c(b) = 2b*2. Let l(i) = 4i - 56. Determine l(c(m)). 8m2 - 56 Let h(b) = 4b - 1. Let d(f) = f. Let m(a) = -5d(a) + h(a). Let u(s) = 1. Let y(n) = m(n) + u(n). Let o(r) = 26 - 26 + 2r. What is y(o(z))? -2z Let o(l) = 2l. Let t(c) be the first derivative of -11c2 - 5. Determine t(o(j)). -44j Let u(o) = 48o2. Let d(c) = c2 - 50. Determine d(u(x)). 2304x*4 - 50 Let z(i) = 9i. Let j(v) = -20v2. Give j(z(k)). -1620k*2 Suppose 0 = -4b + 12 + 4. Let j = -5 - -7. Let y(d) = 2d2 + 3d*2 - bd*j. Let f(o) = -4o. Give f(y(k)). -4k2 Let m(l) be the second derivative of l4/3 + 3l. Let q(x) be the first derivative of -2x3/3 + 2. Determine m(q(k)). 16k*4 Let l(b) = -7b*2. Let s(z) = -46z*2. Determine l(s(v)). -14812v*4 Suppose 2v + 2v - 3k = -7, 27 = v + 5k. Let w(c) = -vc*2 + 7c*2 + 0c2 - c2. Let m(r) = r. Give m(w(z)). 4z2 Let p(f) = 4f. Let a(s) be the third derivative of -5s4/24 - 12s*2. What is p(a(v))? -20v Let n(h) = -h - 1. Let o(r) = -2. Let l(k) = 2n(k) - o(k). Let u(j) = 7j*2 - 2. Let c(w) = 6w*2 - 3. Let z(g) = -2c(g) + 3u(g). What is l(z(b))? -18b*2 Let m(o) = -3o2. Let z(j) = -j2 - 19. Calculate z(m(c)). -9c4 - 19 Let c(t) = -t. Let p(u) be the first derivative of 5u*3 - 3. What is p(c(z))? 15z*2 Let w(a) = 5043a*2. Let u(q) = -5q*2. Determine w(u(x)). 126075x*4 Let b(j) = 26j*2. Let a(q) = 4q*2. What is a(b(l))? 2704l*4 Let n(b) = -2b*2. Let i be (0/((-6)/6))/(-4 - -3). Let w(z) be the second derivative of i + 5z - 1/2z3 + 0z*2. What is w(n(g))? 6g*2 Let a(i) = 14i*2 + 12i*2 - 41i*2. Let x(t) = -t. Give a(x(s)). -15s*2 Let h(j) = 4j - 14. Let d(w) = 2w - 8. Let r(i) = 7d(i) - 4h(i). Let t(v) = -20v. What is t(r(o))? 40o Let u(p) = -p - 28. Let l(i) = 203i*2. Calculate u(l(f)). -203f*2 - 28 Let l(f) be the second derivative of -5f*4/12 - 2f. Let n(r) be the first derivative of -2 + 0r2 + 0r + 1/3r3. Calculate n(l(s)). 25s*4 Let x(n) = -1208n. Let l(v) = -2v2. Give x(l(c)). 2416c*2 Let j(c) = c. Let t(o) = -o. Let b(q) = 6j(q) + 5t(q). Suppose 0 = 5x - 3 - 12. Let u(w) = 0w + xw - 2w. Calculate u(b(s)). s Let q(u) = 2u. Let r(j) = 118j - 57j*2 - 57j - 61j. What is r(q(p))? -228p2 Let v(o) be the first derivative of -o5/30 + 3o2 - 6. Let s(n) be the second derivative of v(n). Let l(c) = -3c. Give s(l(d)). -18d2 Let a(w) = -4w. Let u(p) = 10p - 14. Determine u(a(r)). -40r - 14 Let y(s) = -7s2 + 7s. Let k(a) = -3a2 + 4a. Let q(z) = 7k(z) - 4y(z). Let n(h) = -18h. What is q(n(d))? 2268d*2 Let x(g) be the third derivative of -2g*5/15 + 10g2. Let p(w) be the first derivative of -w3 - 3. Give p(x(f)). -192f4 Suppose 0 = 2d - 4. Let t(q) = dq - 3q + q + 3q2. Let n(m) = -2m + 2. Let o(v) = 4v - 5. Let r(j) = -5n(j) - 2o(j). Determine r(t(k)). 6k2 Let i(f) = f2. Let k(z) be the first derivative of 1/12z4 - 1/2z*2 + 0z + 0z3 - 2. Let p(d) be the second derivative of k(d). What is p(i(u))? 2u*2 Let i(k) = 10k*2. Let l(m) = -3m + 10. Give l(i(r)). -30r2 + 10 Let z(w) = w. Let v(n) = -28n - 2. Give z(v(i)). -28i - 2 Let o(k) be the first derivative of 3k*3 + 2k2 - 31. Let r(n) = n2. Calculate o(r(t)). 9t4 + 4t*2 Let j(p) = -p. Let f(n) = 2n*2 + 17n. Calculate j(f(m)). -2m2 - 17m Let g(v) = -5v2. Let a(x) = -364x*2. What is g(a(k))? -662480k*4 Let n(t) be the second derivative of -t + 0t*2 + 0 + 0t*3 + 1/6t*4. Let o(a) = 3a + 2 - 2. What is n(o(y))? 18y2 Let v(q) be the second derivative of -q4/12 - q. Let k be 4 + 1 - (4 - 4). Let x(b) = k - b - 5. Give x(v(g)). g2 Let f(r) = -r2 - 4 + 4r*2 + 0 + 0r*2. Let b(m) = 4m*2 - 5. Let g(t) = -4b(t) + 5f(t). Let o(y) = -4y2 + y2 + 2y2. Calculate g(o(n)). -n4 Let l(j) = 2j. Let u(b) = -1440b. Calculate l(u(o)). -2880o Let g(l) = l. Let f(s) be the third derivative of -s*5/30 - 4s*2. What is f(g(k))? -2k*2 Suppose -1 = l - 5. Let m(x) = -x - lx + 4x. Let p(g) = -g2 - g. Let s(u) = -3u*2 - 2u. Let b(w) = -4p(w) + 2s(w). Calculate m(b(j)). 2j2 Let a(g) = 10g - 22. Let x(d) = 7d. What is a(x(w))? 70w - 22 Let a(j) be the third derivative of -j7/5040 + j5/60 + 2j2. Let q(g) be the third derivative of a(g). Let m(u) = -4u*2. Give q(m(z)). 4z*2 Let m(r) = 238r. Let f(j) = -83j2. What is f(m(t))? -4701452t**2 Le	{ "pile_set_name": "DM Mathematics" }
15 = -2k. Suppose 2q - n - 716 = k, 3n + 11 = -1. Let h = -61 + q. Is h composite? True Let a(w) = 667w - 25. Is a(12) composite? True Is 2/(-4) - (-135582)/4 a prime number? False Let r = 129441 + -70208. Is r a composite number? False Suppose 0 = -4n - l + 2l - 3, 5l - 15 = -2n. Suppose h = 2y + 109, n = -6h + h + 5y + 570. Is h a prime number? False Is (-1)/1065-3312 a composite number? True Let c be (1 + -35)(-65)/13. Suppose -5p + c + 2535 = 0. Is p prime? True Let q(m) = 2m - 4. Let r be q(-10). Let j = -35 - r. Let u = 20 - j. Is u a prime number? True Suppose -406y + 409y - 21849 = 0. Is y a composite number? False Suppose 0 = -2q + 2p + 12, 2q + q + 5p + 14 = 0. Suppose r + 2f = 15, 3r - 30 = -qr - f. Let x(k) = 19k - 4. Is x(r) a composite number? True Let a be (-3)/2 + (-13)/2. Let l = a + 10. Suppose -4b + 2b = -lk - 464, -230 = -b + 3k. Is b composite? False Let n(k) = 115k + 1. Is n(3) prime? False Let u(z) = 25z - 2. Let x = 12 - 11. Let k(s) = s - 1. Let p(q) = xu(q) + 2k(q). Is p(11) composite? False Suppose 10t - 5t = -n + 10412, 0 = 2n + 5t - 20829. Is n a prime number? False Let m(i) = -i2 + 7i + 1. Let o be m(5). Let u = 13 - o. Suppose 3t = un + 7t - 42, -4n + t = -75. Is n prime? True Let c = 9009 + 9260. Is c prime? True Suppose r + 3i = 3598 + 1030, -5r + 23179 = 2i. Is r a composite number? False Let f be (-4)/1 + (-3 - -4). Let a(v) = -2v + 15 - 29 + 18 + v*2. Is a(f) a composite number? False Suppose -311 = -4b - k, -b + 2k + 80 = -0k. Suppose 2n - 4c = b, 0c + 98 = 2n + c. Is n composite? False Let q(h) = 108h2 - 2h + 3. Let s be q(1). Let k = s + 126. Is k a prime number? False Let v(m) = -m*3 - 10m*2 - 9m - 1. Let y be v(-9). Let u be 657/((-21)/18 - y). Is u/(-15) - (-1)/5 composite? False Let u = 2200 - -157. Is u a prime number? True Let t be (0 + 3 - 4) + -2. Let a be 2/t - (-4674)/18. Suppose c - a = -p + 5c, 994 = 4p + 5c. Is p a composite number? False Let i(v) = v3 + 19v*2 + 25v + 48. Let o be i(-20). Let p = 4787 + o. Is p prime? False Let f(s) be the second derivative of -733s3/6 + 3s*2/2 - 5s. Suppose -4c + 1 - 9 = q, 3c + 6 = -4q. Is f(c) prime? False Let w be (-1 + 0/(-4))/1. Let y(c) = -5c + 2. Let i be y(w). Suppose -ig + 8g - 347 = 0. Is g a composite number? False Suppose 44 = 3w + w. Let v(x) be the second derivative of 16x*3/3 - 11x*2/2 - 25x. Is v(w) prime? False Is 98/(-441) - (-160049)/9 composite? False Suppose -5s = -3k - 25984, 5s + 3k = 8s - 15594. Is s composite? True Suppose -4i + a = 5a - 231892, 2a + 173919 = 3i. Is i composite? False Let p(h) = 6h*2 + 0h*2 + 1117 - 4h*2 - 4h*2. Is p(0) a composite number? False Let m = 115 - 195. Let s = m - -387. Is s a prime number? True Let d(b) = 2693b3 + b2 + 2b - 1. Let v be d(1). Let f = -1080 + v. Suppose -4p = p - f. Is p a composite number? True Suppose w = 1 + 2. Suppose 3z = -n + 3, -2n - z - 3 = -wn. Is 2 + (3 - n - -143) a composite number? True Suppose -2c = -4n - 6, 4c - 7 = 5n + 5. Suppose -z = 4u - 944 + 85, -cz + 1065 = 5u. Suppose 4y - u - 132 = 0. Is y prime? False Let a(b) = 2b*2 + 3b - 3. Let k be a(2). Let w(l) = -4l3 - 38 + 37 + 3l*3 + l + kl*2. Is w(6) composite? True Suppose 2y + 2y - 4 = 0, 0 = 3x - 3y - 33. Let n = x + 281. Is n prime? True Suppose 5g + 0g - 10 = 0. Is ((-6)/g)/((-21)/679) a composite number? False Let k(b) = 29b*2 + 4b - 20. Let h be k(10). Suppose -13u + 5u = -h. Is u prime? False Let k(x) = x*3 - 2x*2 + 2x + 4. Let d be k(2). Let n(w) = 2w3 - 3w*2 - 12w + 1. Is n(d) a composite number? True Let v(c) = 8729c2 + 57c - 231. Is v(4) prime? True Suppose -2j + 4354 = 2d, -5j - 3574 = 4d - 12280. Is d prime? True Let g be (-5)/(-15)(0 + 9). Suppose -3h + 73 = gl - 2l, -2h = -5l + 399. Is l a prime number? True Let b(j) = -j*3 - 4j*2 - 3j - 6. Let q be b(-4). Let x(u) = -22u. Let t(n) = -21n - 1. Let m(y) = qt(y) - 5x(y). Is m(-7) a prime number? False Let d(l) = -410l. Let w be d(-4). Suppose -805 = -2v - o + 9, -4v + o + w = 0. Is v a composite number? False Suppose -37z = -23089 + 6846. Is z composite? False Let b = -10 + 25. Suppose -by = -11y - 3148. Is y a composite number? False Let o = 566 + -259. Suppose 1298 = 4z + m, 20 = z - m - o. Suppose 5c - 5y = z, 9y - 20 = 4y. Is c a composite number? True Let u be 4 - (-3 - -10) - -6. Let w be (u/(-3))/((-4)/(-2060)). Let x = w - -814. Is x prime? False Suppose -3c = 2u - 2333, 0u - 775 = -c + 2u. Let b be -6(-2)/4 + 2. Suppose bg - c = 28. Is g a prime number? False Suppose -7s + 18548 = -31922. Suppose 0a - 3592 = -2a - 5p, s = 4a - 3p. Is a prime? True Let o = -30 + 62. Suppose 10 = 5j, j - o = -3i - 0j. Is (i/(-5))/(6/(-435)) prime? False Let t be (-1)/(25/(-15))10. Suppose v - 8 = 3w, 5v + 0v - t = -2w. Is 0 + (1 - -877)/v composite? False Suppose q = -1 + 3. Suppose qr + 0r = 2. Is -1 - (66/(-2) + r) composite? False Let d = -14 - -26. Suppose -4f = d + 4. Is f/1 - 0 - -131 a composite number? False Suppose 2b = 6b - 22788. Suppose -6r - b = -15r. Is r prime? False Let d be 22/6(3 - -3). Suppose 95 = 4a - 117. Let b = a - d. Is b prime? True Let o(b) = -b + 12. Let f be o(6). Let k = 0 + f. Let u(n) = 24n2 + 3n + 7. Is u(k) a prime number? False Let j(d) = d*3 - 18d*2 - 46d - 64. Is j(21) a prime number? True Let v(j) = 3j3 + 18j*2 - 71j + 13. Is v(10) a composite number? True Let w(j) = 1088j - 291. Is w(10) a prime number? True Let t be (0 - (1 - 1))/(6 - 7). Is t + 8 + 83 + 0/1 a prime number? False Let s(a) = -5a - 170. Let g(k) = -2k - 85. Let c(m) = -7g(m) + 3s(m). Let t be 6/4 - (-3 - 36/(-8)). Is c(t) composite? True Suppose -t - 5k = -4t + 33500, -t = -2k - 11166. Suppose 14n - 4n = t. Is n a composite number? False Let r(q) = 2q2 - 5q + 4. Let k(j) be the first derivative of j*2/2 - 16j + 2. Let g be k(11). Is r(g) a composite number? False Let y = -4359 - -9932. Let z = y - 1152. Is z composite? False Suppose -5b = -2p + 1314, 0 = 4p + 3b - 6b - 2600. Is p a prime number? True Let r be 5 + -2 + -2 + 3. Let j be -3r/(-18)3. Suppose 2332 = 4t + 2w, 2t - w = jw + 1150. Is t prime? False Is (-135)/180 + (-52094)/(-8) prime? False Let p = 79333 - 39264. Is p composite? True Let u(n) = 22n*3 - 67n*2 + 11n + 13. Is u(12) prime? True Suppose d + 0d = 0. Let u(k) = 16k + 105. Let z be u(-6). Suppose -b + 49 + z = d. Is b composite? True Suppose -9i + 4i + 192 = 3r, 0 = 5i - 5r - 160. Let y = 84 - i. Suppose y - 143 = -5l. Is l a composite number? False Suppose 16163 = 16b - 9b. Is b a composite number? False Suppose 4f + 2i + 23 - 265 = 0, -4i = 4f - 252. Is f composite? True Let b(v) = -55 - 1595v + 38 + 267v. Is b(-3) composite? False Let f = 16 - 10. Let a(c) = -c2 + c. Let m(l) = l3 + 3l2 - 7l + 1. Let s(r) = 2a(r) + m(r). Is s(f) a prime number? True Suppose 0 = -4m + 138 + 82. Let u = 3 - m. Let h = u + 123. Is h prime? True Let n = -12 - -14. Suppose 0 = -nv - 2v - 472. Is ((-3)/(-2))/((-1)/v) a composite number? True Suppose 7x + 4w - 3260 = 2x, 2x - 5w - 1304 = 0. Suppose -b + x = -225. Is b a prime number? True Let j(t) = 6t*2 - 9t + 14. Suppose 0 = -3c + 2x + 15, -2c - 2x + 26 = 2x. Let z be j(c). Let b = 438 + z. Is b prime? True Let w be (-22)/3 + (-1 - 4/(-3)). Is 2269/(-2)(w + 0 - -5) a composite number? False Let r(h) = 22h2 + 3h - 2. Let o be r(-4). Let s = o + -236. Let k = -71 + s. Is k a composite number? False Suppose 0 = 3g - 2g, 4o + 5g - 32324 = 0. Is o prime? True Let s(d) = d*2 + 8d - 4. Let y be s(-9). Suppose 0 = l - 4w - 442, -yl + 2333 - 213 = -2w. Is l composite? True Let l = -6 + 3. Let a(h) = -112h - 7. Let g(t) = -111t - 7. Let n(m) = la(m) + 2g(m). Is n(6) prime? True Suppose -5j - 5w = 35, 5w - 13 = -j - 4. Let m = 66 - j. Is m composite? True Let k be 2945/25 + (-4)/5. Let o = -81 + k. Suppose 4z - 1952 = -o. Is z composite? False Suppose -3k = 4l - 24113, -5k + 5l - 6105 + 46305 = 0. Is k a composite number? False Suppose 3f = 4k - 14746, f - 6k + k = -4919. Let d be (f/72)/(6	{ "pile_set_name": "DM Mathematics" }
i = -609 - c. Solve -2k + v - iv + 3 = 0, 5 = 4k + 5v for k. 0 Suppose 45 = -41d + 125 + 125. Solve -2x = y + 5, dy - 4x - 27 = -x for y. 3 Suppose 4s - 20 = 8s, -s - 5 = -3j. Let a(n) = -15n. Let y be a(j). Solve 5t = t + 5u - 14, -2t - u = y for t. -1 Let f(t) = -3t + 30. Let l be f(10). Suppose -3o = 3d - 12, 3o - 5d = -lo + 20. Solve 2w - 5 = 5m - 24, 4w = -om + 7 for m. 3 Let g = -1307 + 1309. Solve -gt - 4p = -131 + 139, -8 = -3t - p for t. 4 Let z be (7 - -112)((-4)/(-2) - 3). Let g = -47 - z. Let p = -72 + g. Solve 3y = p, -3o + 4y = -5o + 4 for o. 2 Let h be -1-526/65. Solve -3s + h = o - 6, 4o - 5s = -2 for o. 2 Suppose -37a = 4a + 4a - 225. Solve x + p = -2x + 2, -ap = -x + 6 for x. 1 Let m(i) = i3 - 19i*2 - 26i + 89. Let h be m(22). Let p = 972 - h. Solve -4 = po - 8o - 4g, 5o - 40 = 5g for o. 4 Let y(a) = 8a*2 - 31a + 265. Let o(g) = 7g2 - 32g + 267. Let c(x) = -7o(x) + 6y(x). Let b be c(28). Solve -r = -4s + 22 + b, -5r = 2s + 5 for s. 5 Suppose -11 = 14l - 123. Solve 3d + 5o + 5 = 0, -2d + lo - 4o + 4 = 0 for d. 0 Let t(b) = -b2 - b + 21. Let r be (-7)/(-3)(-2 - (1 - 0)). Let n be t(r). Let p = 34 + n. Solve 3x - 2y = -p + 5, 0 = -2x - 5y + 1 for x. -2 Let q(t) = -2t3 - 34t*2 - 86t + 9. Let z be q(-3). Solve zm + 6i = 16m - 25, -2i - 5 = 3m for m. 1 Let t = -566 - -848. Let y(j) = 0j*2 + 8j - 280 - j*2 + t. Let q be y(7). Solve l - 3r = -2r + 4, 3r = -4l + q for l. 3 Suppose 0 = m + 3d + 64 - 24, -164 = 5m - 3d. Let w be m/(-17)(-4)/((-8)/3). Let b = -4 - -6. Solve wo = -3r, r + br = -o - 4 for r. -2 Suppose -10 = -9k + 7k. Let u = 2 + 2. Let x be 17 + -17 + 133. Solve -3m - 4 = -m, um = kp - x for p. 5 Suppose -2j + c = -37, -15 = -3j - c + 28. Solve -42h + 44h + j = -3x, -4x - 3h - 23 = 0 for x. -2 Let a(b) = 2b*3 - 79b*2 + 44b - 187. Let c be a(39). Solve 3y = -4k + 12 - 8, -3y + c = 5k for k. 4 Suppose 19f - 15f - 64 = 0. Let a be 45/4 + 14/(-56). Let s = a - 7. Solve -2w - 4r - 19 = -3w, -sw + f = -r for w. 3 Let t(v) = -v*2 - 6v + 431. Let o be t(18). Suppose 3w - 6w = -6, 3r + 5w = 40. Let n be (8/6)/(r/(-15) - o). Solve 20 = 4q - 4g, q = ng + 2 + 9 for q. 3 Suppose -2j + 11 = y, 0y = 5y + 25. Let v(k) = -k*3 + 30k*2 + 69k - 156. Let l be v(32). Let p be 0/(2/jl). Solve -g - 6 = -5z, -4z - z + 5 = p for g. -1 Let x(f) = -f3 + 29f*2 - 27f - 23. Suppose -2i - 5 = -2t - 69, 0 = -3i - 4t + 68. Let j be x(i). Solve 15 = jg, 4z - 2g - g = 7 for z. 4 Let u(g) = 28 - 9 - 3g + 38 + 9. Let p be u(21). Solve 4n - pi + 31 = 0, -3n + 5i = 2n + 45 for n. -4 Let y be (-3)/(-4 - (-17)/5). Suppose -yr = -2r - 315. Let m be 2/(-10) + 336/r. Solve mb - 7b = 5k, 2b + 6 = -4k for k. -4 Suppose 3g = -21g - 12072. Let s = 505 + g. Solve 0 = -3r + st - 2 + 6, 3t - 16 = -r for r. 4 Let x = -22286 - -22297. Solve 2a - 2 = 3l, 8l = -4a + xl + 4 for a. 1 Let v = 1 - -5. Suppose -2p + 0 = -2n + v, 0 = 3p + n - 11. Solve po - l = 4o, 4l - 13 = 5o for o. -1 Suppose -2u - 9d - 37 = -10d, -u - 2d = 26. Let i be u/(-6) + 0 + 428/642. Solve -5 = -5f - 5q, 3f + 0q - iq = 31 for f. 5 Let y = 484 + -642. Let c = y - -163. Solve -2w - c = 3w - 4r, -2r + 4 = -4w for w. -1 Let a be (0 + 1)(94 - 94). Let l(y) = -5y + 4. Let h be l(a). Solve 3s + o - 6o = -10, 5o - 15 = hs for s. -5 Let n(b) be the first derivative of b3/3 + 6b*2 - 85b + 159. Let k be n(5). Solve 2a - 1 = -0a - h, k = -a - h for a. 1 Let k(u) = -6 - 2 + u*2 - 19u - 6 - 3. Let b be k(20). Solve bm = -2x - 19, m - 3m - 16 = 3x for x. -2 Let z(d) = -2d2 - 27d - 53. Let b be z(-11). Let q(o) = -o*3 + 6o*2 - o - 9. Let n be q(5). Solve bf + n = -3c, 2 + 7 = -3f - 2c for f. -1 Suppose 0 = 3s - 15 - 0. Let g = -4 - -18. Suppose 4z + 3z = g. Solve 0 = sn + 3b + 28, 2n + zb - 7b = -5 for n. -5 Suppose 14q + 455 = 105q. Solve -5x + 3x = -2s + 4, -qs = -2x - 7 for s. 1 Let p = 38 + -8. Suppose -5n = -2a + 160, 22n - 223 = -3a + 21n. Let g be 365/a + 4/p - -2. Solve -2z - 3b + g = -0z, 0 = 3z + 2b - 8 for z. 2 Suppose 0 = q + 5y - 3y + 8, 5y = -3q - 20. Let v be (-2 - q)/(16/(-376)). Let r = -44 + v. Solve -7n + 4n + 5b = -5, -n + r = -b for n. 5 Let t be (8/(-46))/((-1280)/14720). Let g = 6 + -2. Solve -2h - 4 = tm, gh - m = h + 14 for h. 3 Suppose g - 3g - 2 = 0, 2a - 7 = 5g. Let c be a/(-4) + 82/8. Let z = 243 - 240. Solve zp + 4y = 11, p + 4y = c + 7 for p. -3 Suppose 0 = -3p + 3n - 18, 2p + 249n = 248n + 12. Solve -4y + 24 = -2q, 24 = 3q - 6q + py for q. -6 Let m(s) = -415s - 1657. Let p be m(-4). Solve pn - 6 = 0, -2y + 68n - 66n + 2 = 0 for y. 3 Let r(t) = 2t*3 - 2t*2 + 9t + 20. Let z be r(-4). Let g = 179 + z. Solve o + gy = -17, -3o + 21 = -5y + 2 for o. -2 Suppose -4u + 54 = -u. Suppose 580 = -55n + 690. Solve 2r + u = -no, -4r = o + 4o + 40 for o. -4 Suppose 0 = 102o + 1948 - 3070. Solve 3j - 44 = -ot + 7t, j + 4 = t for t. 8 Let a(g) = 76g - 606. Let c be a(8). Solve -5d = i + 15, -d + i = -c + 5 for d. -3 Let p be ((-21)/(-6))/(12 + 1631/(-140)). Solve 0 = 3x + f - p, 0f - f + 8 = 2x for x. 2 Let l = -153 - -167. Suppose -2n = -5c - 11, -n = 4n + c - l. Solve -5 = -3i + q, -5i = -q + nq - 23 for i. 3 Let i(w) = 2w2 + 2w - 6. Let f be (-5)/((10/12)/(-1)). Suppose -2y = 12 - f. Let u be i(y). Solve 2q = -u, 5c - 2q = 2q + 37 for c. 5 Suppose -12b = -853 + 793. Solve 0y - 5y + 5q = b, -5y - 5q = -35 for y. 3 Suppose -2w - 19 = -301. Let y = -136 + w. Solve -16 = 3u - yu + 4v, -u = 2v for u. 4 Let q = 6690 - 6685. Solve qi + 5 = -3t, 3t + 10i + 13 = 9i for t. -5 Suppose 4c - k + 7 = 28, -3c + 32 = -4k. Solve 7n - 2t = 4n + 23, -ct = -3n + 31 for n. 5 Suppose -2x = s - 7, 5s = -5x + 30 + 20. Suppose 55 = sw - 2w. Solve 2f + 3y = 4y - 3, 0 = wf - 4y + 9 for f. -1 Suppose 5u + 15 = -y, 32 = 4y - 49u + 46u. Solve 0 = -b + 3c - 2, yb - 5c + 0c = 0 for b. 1 Suppose -9c - 10 - 34 = 2b, -2c = 2b + 2. Solve -10 = bg - 5x - 20, 3x + 15 = 0 for g. -3 Let r be (-46)/4(56/14 - 6). Solve -4q + 10 = 2t, -5q + 14t - 13t + r = 0 for q. 4 Let p = -879 - -882. Suppose 66o + p = 69o. Solve 0 = -4y + 3y - 4a - o, -4 = -3y - 5a for y. 3 Let d(s) = -2s*2 - 12s - 7. Let n(j) = -3j2 - 18j - 10. Let q(u) = -8d(u) + 5n(u). Let t be q(-7). Solve 3b + 5l + 5 = t, -5b = 3l - 8 for b. 1 Suppose 7u - 84 = -56. Solve 8 = 2o, -2w + uo = 1 + 23 for w. -4 Suppose 0 = -5f - 7 + 107. Let k be ((-8)/f)/((-1)/5). Solve 5a - 3a = -kr, -5r - 3a + 2 = 0 for r. 1 Suppose 5d - 8d - 250 = -13d. Solve 5i - 5g - d = 0, -2g - 27 = -5i - 2 for i. 5 Suppose 4a + 0a + 28 = 0. Let q(z) be the third derivative of z4/12 + 3z*3 + 2428z*2. Let r be q(a). Solve -3b + 8 = 2k - 5b, 3b + 12 = -rk for k. 0 Suppose 2m - 2f + 2 = 14, 0 = -3m - 4f - 10. Solve -5t = -d + 16, -mt = 3d + 2d + 1 for d. 1 Suppose 5d = -2s + 351, 96s - 647 = 92s + d. Solve -162f + 2 = k - sf, -4k + 5f + 8 = 0 for k. 2 Suppose -15y - 20 + 50 = 0. Solve d = 5b + 2d + 1, -2b - yd = 2 for b. 0 Suppose 4c = 4y + 316, 21c = 19c + 3y + 164. Solve q + 5o + c - 49 = 0, 5q - 2o + 12 = 0 for q. -4 Let g(w) = 195w + 1170. Let j be g(-6). Solve 0 = 5r + 4u - 0u - 13, j = -3r - 5u for r. 5 Let u = -180 + 183. Let h be (-10)/((-4)/(6/u)). Solve hi - 3k = -4k + 13, 5 = -i - 4k for i. 3 Let x = 13254 + -13219. Solve -u + 5b + 15 = 0, -41 + x = -2u + 4b for u. -5 Suppose 0 = 3a - 5a - 4, -d - a + 1 = 0. Let j = -42 + 32. Let q be 6/j10/4-2. Solve 0 = -2r - y - 7, -qr + 3y + 0y = -d for r. -2 Let q(r) = 2r3 - r2 + 6r - 6. Let j be q(3). Suppose 5h = 72 - j. Solve -9 = -2m + 2k - hk, -m + 4 = k for m. 5 Suppose 5i + 10 = 0, 2c - 1340 = -2i - 5424. Let t be (c/(-80))/(3/2). Solve 2d = -5n + 4d - t, 4d = 4n + 16 for n. -3 Suppose -6w + 8 = -2w, 0 = 4o + w + 54. Let q(a) = -a2 - 13a + 21. Let t be q(o). Solve -3n = 2r + 3 - 21, 5r - 2n - t = 0 for r. 3 Let b(l) = -10l3 - l2 + 3l + 3. Let h be b	{ "pile_set_name": "DM Mathematics" }
n -1, z, -2? z Let w = -2.1 + 0.1. Let z = -1.419 + 3.419. Which is the closest to z? (a) w (b) -0.5 (c) 1 c Let w(o) = 2o2 - 3o. Let m be w(2). Let t = 2 - m. Which is the closest to t? (a) -10 (b) 0.2 (c) 0.1 c Suppose 4i - 4l = 2i + 14, 0 = -5i - 5l + 35. Let n = -49.03 - -49. Let f = 0.53 + n. What is the closest to -1/3 in f, i, -1/5? -1/5 Let x = 1.155 + 3.845. Which is the nearest to -0.2? (a) 12/5 (b) 2 (c) x b Let h = 104 + -101. Let q = 2/35 - -3/35. Which is the closest to -0.2? (a) 0 (b) h (c) q a Let x = 13 + -12.7. Let t = -17.3 + x. Let q = 17.1 + t. Which is the nearest to 0? (a) 4 (b) -5 (c) q c Let s = -3 - -20/7. Suppose 693t = 709t - 64. What is the closest to -0.1 in s, t, -0.1? -0.1 Suppose -15 = -31g + 26g. Let l = -9 - -8.9. What is the nearest to 0 in g, l, -4/5? l Let y = -1 + 3/2. Let z be (-12)/78/(-32). Suppose k - 5a + 23 = 0, 14 = 5k - 3k + 5a. What is the nearest to -0.3 in z, k, y? z Let q = -179 - -897/5. Which is the nearest to q? (a) -1 (b) -6 (c) 7 a Let r = 65.5 + -65.5. Which is the closest to r? (a) -18 (b) 0.1 (c) -4 b Let i = -0.01 + 0.11. Let w = 116 + -247/2. Let o = 8 + w. What is the closest to 0 in -3, o, i? i Let m be 4/(-10) + 33/(-30). Suppose 202h + 470 + 129 = -7. Which is the closest to h? (a) 0.5 (b) m (c) -2 c Let h = 175.1 - 175. Let l = -27 - -24.8. Let q = 0.8 - l. Which is the closest to 0.1? (a) q (b) h (c) -4 b Let v = -88/13 + 90/13. Which is the nearest to 0.2? (a) v (b) 0.1 (c) -2/7 a Let k be 1020/(-1560) + (-4)/(-26). Let q be (3/(-27))/(3/(-36)). Which is the closest to 0? (a) k (b) q (c) 1 a Let t(n) = -2n + 66. Let v be t(0). Suppose k - 3k = -v. Let a = k - 65/2. What is the nearest to a in 5, -3, -2/7? -2/7 Let l = 0.45 - 0.44. Which is the nearest to l? (a) 5/3 (b) -3 (c) -0.5 c Let g = 66 - 97. Let q = g - -30.88. Let v = q - 0.88. Which is the nearest to -1? (a) -0.1 (b) v (c) -5 b Let z = -1634.6 - -1635. Let l = -3 + 5. What is the nearest to 4/11 in l, 1/2, z? z Let o = -13.23 - -11.23. Which is the nearest to -1/2? (a) -0.1 (b) o (c) -64 a Let i = -0.703 - -0.503. Let g = -2.3 + 1.1. Let s = -0.2 - g. What is the closest to s in i, -3, 2/11? 2/11 Let w = -113.3 - -108. Let z = w - -5.1. Let k(t) = -t2 - 2t - 1. Let d be k(-1). Which is the nearest to 1? (a) z (b) d (c) -0.05 b Let l be 1 + (-1 - 8/(-3)) + -1. What is the nearest to 2/11 in -2/9, l, 4? -2/9 Let j = 1.8 - 0.9. Let s = j - -0.5. Let g = -1.3 + s. What is the closest to 1 in -1/2, g, -5? g Suppose 0 = 15k - 89 + 44. Let l = 2 + -5. Let u be 0 + 2/15l. Which is the nearest to u? (a) 0 (b) k (c) 5 a Let f = -0.278 + -0.122. Let q = 37 + -41. Which is the nearest to 2? (a) -1 (b) q (c) f c Let p be (26/65)/((-2)/4). Which is the closest to p? (a) 0.1 (b) -2 (c) -0.5 c Let s be 64/(-80) + (-76)/(-20). What is the closest to -2 in -3/5, -1/3, s? -3/5 Suppose -6j + 1 = -4j + m, 20 = 4j - 4m. Let u be (j/(-14))/(4(-4)/56). What is the closest to -2/7 in u, 4, -7? u Let o(g) = -18g + 558. Let k be o(31). What is the nearest to k in -2, 1, 6? 1 Let o = -25 - -97. Let u be 2/(-3) + 12/o. Suppose -p - 2 = p. What is the nearest to p in -5, u, 2? u Let l = -1.124 - -1.164. Let o = 4032 - 342716/85. Let v = -6/17 - o. Which is the nearest to v? (a) -5 (b) l (c) 0.1 b Let l = 961/2 - 480. What is the nearest to -0.7 in l, -0.1, 5, 3? -0.1 Let x = -119.6 - -118.6. Which is the nearest to -1/8? (a) 2/3 (b) -1/18 (c) x b Let s = -41/24 - -11/8. Let d = -3/22 + -27/44. Which is the nearest to -0.1? (a) d (b) s (c) -0.3 c Let w = -2.972 - -2.872. Let q = 3 + -3.3. What is the nearest to 1 in -1/2, q, w? w Let d be 4/(-10) - (-4)/35. Suppose -4g - 20 = -9g. Let x be 2((-39)/10 + g). What is the nearest to -1 in x, d, 5? d Let i = -69 + 33. Let k = 73/2 + i. Which is the nearest to 0? (a) 3 (b) -2/5 (c) k b Let p be 147/(-42) + 2. Which is the closest to -2/7? (a) 49 (b) -0.1 (c) p c Let t be ((-2)/6)/((-7)/(-63)). Let s be ((-9)/12)/(t/8). What is the closest to s in 4, -1/2, 5? 4 Let s = 24.6 + -11.5. Let p = -13 + s. What is the closest to -2 in p, 5, 2/3? p Let r = -83 + 47. Let v = -41 - r. What is the nearest to -0.2 in -1, -0.3, v? -0.3 Let y = 4724 - 99229/21. Let g be 4/(-7) - (-9)/(-7). Let f = g - y. Which is the closest to f? (a) 0.5 (b) -1 (c) -0.1 b Let f = 3 - 7. Let j be (1/(-2))/((-9)/f). Let m = 2146 - 23608/11. Which is the nearest to j? (a) -3 (b) m (c) 4 b Let z = 0 - -1. Let p = -0.7 + 0.2. Which is the closest to 0? (a) -3 (b) p (c) z b Let w = -42 - -169/4. Let s = 1.62 + -0.02. Let x = s + -1.1. What is the closest to w in -1/6, x, 1/5? 1/5 Let q be ((-8)/(-10))/(26/26). Which is the nearest to 0? (a) 5 (b) q (c) -1 b Suppose 4h + 4q - 8 = 0, -5h - q + 4 = -2. Let s = 43 - 39. Which is the closest to h? (a) 0 (b) s (c) -7 a Let r = -3 - -3. Let y be ((-3)/21)/((-36)/42 - 0). What is the closest to r in 2/11, y, 4? y Let y = 97 - 482/5. Let p be ((-24)/15-1)/(4/(-30)). Let v be (p/(-30))/(-2) - (-2)/(-40). Which is the closest to y? (a) 3/2 (b) v (c) -0.5 b Let g = 2/147 - -47/147. Let r = 18297/628 - -18/157. Let p = 59/2 - r. What is the closest to g in p, 0.1, -2/7? p Let h be 170/40 + (-6 - -1). Let k = 0.1 + 0.1. Which is the closest to k? (a) 4 (b) h (c) 13 b Let n = 0.16 + -0.07. Let y = 0 - n. Let t = 0.39 + y. Which is the nearest to 1? (a) -1/3 (b) -0.1 (c) t c Let r = 601 - 596. Let s = 3.2 + 0.8. What is the closest to r in 2/15, -3, s? s Suppose -3w - 5q = 12, -5 = -w + 2q + 2. Let n = 0.494 - 0.094. Which is the nearest to w? (a) n (b) -1/3 (c) 4 a Suppose 35 = 6s + 11. Which is the closest to 0? (a) 0 (b) s (c) 0.79 (d) 3/5 a Let o = 62/5 + -12. Which is the closest to o? (a) -0.1 (b) -0.2 (c) -6 (d) -2/5 a Let t = 378.6 - 327.59. Let h = t + -51. Let v = 6 + -6.3. Which is the nearest to -1? (a) h (b) v (c) -5 b Let j = 0.5641 - 0.0641. What is the nearest to 6/11 in 1, j, -3? j Suppose -5k - 31 = a - 5a, 2a + 1 = -3k. Let g = -2 + 5. What is the closest to k in -3, 5/4, g? -3 Let i = -23.8 - -0.8. Let g = 22.6 + i. Which is the closest to 0.1? (a) g (b) -4 (c) 2 a Let s = -140 + 146. Which is the nearest to s? (a) 0.3 (b) 2/15 (c) -2 a Let t be ((-4)/(-6))/(((-3)/(-3))/(27/(-9))). Let g = 1 - 5. What is the nearest to -5 in t, 4, g? g Suppose 5h = -5s + 15, s + 3h - 8h - 15 = 0. Let f = -1 + 3. Let n = 52.1 + -52. Which is the nearest to n? (a) f (b) s (c) -3 a Let l = -12.3 + 0.3. Let u = -25 - l. Let s = u + 15. Which is the nearest to -2/7? (a) s (b) 5 (c) -5 a Let n = 0.04 + -1.04. Let i = -0.7 - n. Let w = -5 - -6. What is the closest to w in 0.2, -5/2, i? i Let y = 7/20 + 3/20. What is the closest to y in 0.2, -4, 0.3? 0.3 Let s = -101673/74 - -1374. Let p = 311/370 - s. Suppose -2t + 3 = y, y = -0y + 5. Which is the closest to t? (a) -0.3 (b) 0.5 (c) p a Let y be (-1)/4 + (-2)/(-8). Let k = 5/51 + -127/255. Let v = -2/39 + -64/273. What is the closest to v in -5, k, y? k Let y = 7.183 + -2.183. What is the nearest to 1/9 in y, 0.2, -6? 0.2 Let y be (1/(-16))/((-3)/(-18)). Let v = 188 + -162. Which is the closest to v? (a) 0.1 (b) y (c) -0.4 a Let h be (-5304)/(-378) - (7 - 2). Let x = -80/9 + h. Which is the nearest to -0.04? (a) -1/9 (b) -5 (c) x a Let r(d) = d - 5. Let t be r(0). Let s = 316 - 316.133. Let o = s - -0.133. What is the nearest to 2 in 2/9, o, t? 2/9 Suppose -59x + 54 = -5x. Let b be 4/(-6) + 17/3. What is the nearest to 3/8 in x, -1, b? x Let f be (-7)/3 - (-9)/(3 + 0). Let n = 31.9 - 27. Let v = 0.1 + n. What is the closest to -0.2 in v, f, 4? f Let t = 165 + -83. Let h be 3 - -1 - t/20. Which is the nearest to -1? (a) h (b) -0.5 (c) 1 b Suppose 2 = -m - 0m, 5u + 3m - 14 = 0. Suppose -2s + 13 = 2t - 3s, 4t + us - 8 = 0. Let r = 0.1 - -0.3. What is the closest to 0.1 in t, r, 3? r Let v = -4/3 - 0. Let g = 3.8 - -0.2. Which is the closest to -0.1? (a) g (b) 3/5 (c) v b Let p be ((-1)/28*-7)/(-2). Which is the nearest to -2? (a) p (b) -4/7 (c) 4 b Let l be (-15)/20 - 16/(-16). Which is the closest to l? (a) 0.4 (b) 4 (c) 0.5 (d) 2/9 d Let m = -0.2 + -0.8.	{ "pile_set_name": "DM Mathematics" }
q and 39/7. 77 Let a = 2 - -1. Suppose ay + 8 = 2. Find the common denominator of (-594)/4y/12 and -51/11. 44 Let f = -7 + 11. Let w = -4 + f. Find the common denominator of (-1)/(36/(-195)) - w and -59/12. 12 Calculate the smallest common multiple of 12 and (0 - -1)(-1 + 2 + 9). 60 Let k = 15 + -31. Let u = k + 25. Calculate the lowest common multiple of u and 1. 9 Let c(u) = -7u + 2. What is the smallest common multiple of 9 and c(-3)? 207 Let l = -343/200 - -9/100. Calculate the common denominator of l and 1/(31/(-61)). 24 Suppose -3y + 78 = -9. Suppose -y = -5k + 1. What is the lowest common multiple of 6 and k? 6 What is the least common multiple of 28 and ((-8)/(-3))/((-18)/(-216))? 224 Let g = -67823/10 + 6774. What is the common denominator of g and 85/24? 120 Let z(r) = 2r*2 - 28r + 31. What is the least common multiple of 2 and z(13)? 10 Let t = -278783/45828 - 1/11457. Find the common denominator of -85/8 and t. 24 Suppose -34 = 2c - 338. Let v be 1/((5/6)/5). Calculate the common denominator of 47/3 and v/(-9) - c/(-66). 33 Let r(c) = 8c*2 - 3c + 3. Calculate the smallest common multiple of 82 and r(1). 328 Let c(d) = -d*3 + 12d*2 + 12. What is the least common multiple of c(12) and ((-6)/(-15))/((-1)/(-50))? 60 Let o = 3002051/254825 + -17/20386. Let v = 152/25 - o. Calculate the common denominator of v and -133/6. 30 Suppose -2t = -2 - 4. Calculate the least common multiple of 2 and t. 6 Let y = -55 + 65. Let t(m) be the second derivative of m4/12 + m3/6 - 2m2 + 2m. Calculate the smallest common multiple of t(-4) and y. 40 Let w = -1132/9 - -126. Let p be 3/9 - 5431/3. Let r = p + 18061/10. Calculate the common denominator of r and w. 90 Suppose 2y = y. Suppose 4 = -g - yg. Calculate the lowest common multiple of 5 and 45/12 - 1/g. 20 Calculate the common denominator of -61/18 and (4 - 5)/4 - 188/(-240). 90 Suppose 5v - 12 = r, 4r - 2v = 3r. Suppose m = -m + r. Suppose -6 = c - 28. Calculate the least common multiple of m and c. 44 Let z be ((-801)/2)/(0 + 15). Let l = -999/20 - z. Calculate the common denominator of -79/14 and l. 28 Let o be -5 + 5 - (-439198)/44. Let x = 9985 - o. What is the common denominator of x and 97/16? 176 Let l be -258/92 + 1. Let d = l - -93/92. Let u = 4871 + -68113/14. What is the common denominator of d and u? 28 Suppose 2s + 2s - 4q = -1388, -690 = 2s + 2q. Let i = 6817/20 + s. Calculate the common denominator of -67/16 and i. 80 Let z(f) = f*2 - 37f - 70. Suppose -5m + 40 = 2o + 2o, -3m = 0. What is the smallest common multiple of z(39) and o? 40 Suppose -4c - 26 = 6. Let t = c - -16. Suppose 0 = -3x - 0g - 3g + 36, -48 = -4x - g. Calculate the smallest common multiple of t and x. 24 Let t = 27993/10 + -2802. Calculate the common denominator of t and 115/6. 30 Let l = 38/10485 + 75516767/1845360. Let o be -3 + 5/(110/(-712)). Let z = o + l. Calculate the common denominator of -149/12 and z. 48 Let h = 3586037/2020280 + -1/50507. Calculate the common denominator of 53/50 and h. 200 Let x = -1711 - -15433/9. Calculate the common denominator of -15/2 and x. 18 Let s(a) = -2a - 8. Let m be (2 - -1) + (-7 - -4). Suppose m = 2v + 2 - 6. What is the least common multiple of s(-7) and v? 6 Let c = 1278 - 12759/10. Let l = 18/5 - c. Calculate the common denominator of l and ((-15)/(-150))/(1/53). 10 Let m = -3 + 18. What is the least common multiple of 18 and m(48/15 + -2)? 18 Let t(n) = -5n - 2n - 7n. Let h be t(10). Find the common denominator of ((-2)/15)/(16/h) and 29/10. 30 Let j(r) = -r. Let g(f) = 745f + 1. Let w(y) = -g(y) - 6j(y). Let v be w(-4). Let c = -65023/22 + v. What is the common denominator of -41/14 and c? 154 Let b be (-94)/(-8) - (-2)/8. Suppose -f = g - b, -3g + 2f + 9 = -2g. Calculate the smallest common multiple of g and 7. 77 What is the common denominator of (-58)/(-12) + 4 + -4 and (4/10)/(22/(-60))? 66 Suppose -6g = -11g + 100. Calculate the smallest common multiple of 5 and g. 20 Let k = 1 - 2. Let q(o) be the second derivative of 5o4/12 - o2/2 - o. What is the least common multiple of 6 and q(k)? 12 Let y be -2 + -2 + 3 + 0. Let u = y + 4. Suppose -j - 4j + 50 = 0. What is the smallest common multiple of j and u? 30 Let k(r) = -5r2 + r + 6r*2 - 2r*2 + 13 - 11r. What is the lowest common multiple of 10 and k(-11)? 10 Let i = -9/5137 + -25593/2984597. Let x = -28451/1743 + i. Find the common denominator of x and 70/9. 9 Let v = 5 - 3. Suppose 4 = -3n - v. Calculate the smallest common multiple of 8 and (n(-3)/(-3))/(-1). 8 Suppose -15 - 7 = -2h. Suppose 5d = -5g + 10, -5g - 3 = -5d + 7. Calculate the lowest common multiple of d and h. 22 Let s = 52 - 30. What is the least common multiple of 12 and s? 132 Let a = 11/10 + 47/55. Let i = -4 + -2. Calculate the common denominator of ((-174)/12)/(8/i) and a. 88 Let z(r) = 4r*2. Let q be z(-1). Calculate the common denominator of (-86)/q3/6 and -113/18. 36 Find the common denominator of 44/(-3)(-21)/(-24) and 81/8. 24 Let o be (-6)/(-9) + (-2)/(-6). Suppose -o = 2k - 17. Calculate the least common multiple of 36 and k. 72 Find the common denominator of 2 - 1 - 21/(-16) and -11/14. 112 Let b(d) = -2d + 48. Let f = 66 + -44. Calculate the lowest common multiple of f and b(14). 220 Let y = 32334572/8645 + -1877301001951/500830785. Let b = y + -2/19311. Calculate the common denominator of b and (-148)/(-88) - (-2)/4. 99 Let k = 420 - 9245/22. Calculate the common denominator of -43/22 and k. 22 Let w be (-6)/(-2) + 260/(-10). Let a = w - -41. What is the lowest common multiple of a and 22? 198 Let k = 61669/8 + -3514939/456. Let f = -1/114 + k. Find the common denominator of f and (-29)/(0 + 4-2). 24 Let m(i) = i*3 - 3i*2 + 2. Let j be 7/3 - 2/(-3). What is the lowest common multiple of 20 and m(j)? 20 Suppose 0 = 2p + 2, -2i = -3i - 4p + 18. Calculate the least common multiple of 14 and i. 154 Let i = 5 + 2. Let a(z) = 4z - 16. What is the lowest common multiple of 7 and a(i)? 84 Let l = 526 - 8421/16. Calculate the common denominator of 51/16 and l. 16 Find the common denominator of -17/7 and -3 + 6 + 513/(-102). 238 Let q = 72/5 + -269/20. What is the common denominator of q and 3/10? 20 Let y be 2/(-1 + 3/6). Let j be (y/3414)/(2/6). Let c = j + 14231/1707. Find the common denominator of c and 47. 3 Suppose -15 - 10 = j. Let w = j - -37. Calculate the least common multiple of 14 and w. 84 Let t = 116623/22 - 5298. Suppose -6q + 2q - 32 = 4s, -2s - 28 = -4q. Calculate the common denominator of s/(-32) + (-6)/(-24) and t. 176 Let x = 115431416 - 12697693641/110. Let o = 10798/5 + x. Calculate the common denominator of o and -23/2. 22 Suppose 3p - m = -44, 2m - 6 = -2. Calculate the common denominator of 118/p + 3/6 and 13/14. 14 Suppose -3l + 3f + 62 = -f, -2f = 2l - 32. Calculate the lowest common multiple of l and 15. 90 Let z(g) = g2 - 4g + 2. Let o be z(5). Suppose -3v - o = -19. Let t(m) = m2 + 6m - 6. What is the smallest common multiple of v and t(-8)? 20 Let c = 1 + 1. Calculate the lowest common multiple of 20 and 1(c - -1) + 13. 80 Suppose -17 = -3h + 7. Let d = h - 6. Calculate the smallest common multiple of 13 and d. 26 Let x = -13 + 12. Let s = 1 - x. What is the lowest common multiple of 5 and s? 10 Calculate the least common multiple of 1 and -4(-4 - (-36)/16). 7 Let b be 20/(-12) - (-4)/6. Calculate the common denominator of -1/7 and (1 - (-132)/(-28))/b. 7 Let x = 44 - 34. Suppose -4p - o + 61 = -p, 76 = 4p - 4o. Calculate the smallest common multiple of x and p. 20 Let k(r) = r*3 + 6r*2 + 2r + 7. Let c(j) = j*3 + 7j*2 + 7j + 1. Let y be c(-6). Calculate the least common multiple of 20 and k(y). 220 Suppose -x - 4n - n = 22, 3x + 28 = 4n. What is the common denominator of (74/4)/(x/(-16)) and -113/10? 30 Let q = -79813/109 + 31986381/44690. Let m = q - 2/205. Let f = -11 + 5. What is the common denominator of m and f? 2 Suppose 5n - 73 - 62 = 0. Let t = n + -15. What is the least common multiple of 1(0 - -1) + 13 and t? 84 Let y = -11185/66 - -502/3. Let w = 20 - 13. Calculate the common denominator of y and 17/w - (-2)/(-4). 154 Let j(w) = -3w*2 + 2w. Let v be j(3). Find the c	{ "pile_set_name": "DM Mathematics" }
-4, -5 in descending order. q, f, -4, -5 Let i = -685 + 707. Suppose 4t + 5x - 15 = -0x, 5t + 3x - i = 0. Put -5, t, 6, 0 in decreasing order. 6, t, 0, -5 Let u be ((-12)/8)/(72/(-240)). Put -1, u, 1, -5.9 in ascending order. -5.9, -1, 1, u Let q(f) = -f2 + 65f + 5413. Let w be q(113). Put -6, 5, w, -3 in descending order. 5, -3, -6, w Let r = 1231 - 1225. Sort 0.03, -1/2, r in ascending order. -1/2, 0.03, r Let h(f) = f*2 - 135f + 1209. Let w be h(9). Sort w, -2, 1 in descending order. w, 1, -2 Let w = 14.5 - -79.5. Let a = 100 - w. Sort -8, -0.1, a. -8, -0.1, a Let w be 15/(-35) - (-68)/28. Let b = 1 + w. Sort -2, -3, b in descending order. b, -2, -3 Let j = -33.6 - -12.1. Let g = j - -23.5. Put 2/13, 0, 1/5, g in ascending order. 0, 2/13, 1/5, g Let b be 10/(-5)(7/(-2) - (-23 - -17)). Sort b, 144, 0. b, 0, 144 Suppose 288o - 293o + 3 = -6i, -5o = -3i - 9. Put 95, i, 1 in decreasing order. 95, i, 1 Suppose 265b = 260b + 4k + 12, 4k = 4b - 8. Put -0.065, -1, b in descending order. b, -0.065, -1 Suppose 5k = 3j + 333, 5k + j = 402 - 53. Sort 1/6, k, 4/3, 1 in ascending order. 1/6, 1, 4/3, k Let k = -92467 - -92468. Let c = 2/3 - 19/15. Put 0, c, k in descending order. k, 0, c Let l = -60733 - -60732.6. Let h = -8 - -11. Sort h, -1/14, l in decreasing order. h, -1/14, l Suppose 11p - 61 = -391. Let r be (-162)/p + 2/(-5). Sort r, 18, -2, 2 in descending order. 18, r, 2, -2 Let w = -231/2 - -579/5. Let s = 51029 + -51027. Put s, w, 5, -4 in descending order. 5, s, w, -4 Let p = 1077 + -1077.1. Put 1/9, 0.01, p in decreasing order. 1/9, 0.01, p Let k = 9.8 - 10. Let d = 34811/57985 + -4/11597. Put d, k, 0.2 in decreasing order. d, 0.2, k Let m(o) = o2 - 20o - 66. Let x be m(23). Let y be 1 + -1 - x/(6/(-8)). Sort 1, y, -1, 21 in descending order. 21, y, 1, -1 Let a = 1.13 + 110.87. Let c = a - 112.04. Let q be (-14)/5 + 1/(-5). Put q, c, -3/4 in descending order. c, -3/4, q Let c = 17543 - 17542.897. Put 0.01, c, -0.3, 4 in decreasing order. 4, c, 0.01, -0.3 Let p = 3815/3044 + -5/1522. Let a = 3/8 - 1/8. Let h = 3.93 - -0.07. Sort p, a, h in descending order. h, p, a Let v = -153 + 146.9. Let s = 4.1 + v. Let p = -1.9 - -6.9. Put p, s, 4/5 in increasing order. s, 4/5, p Let z = -178.83 - -178.43. Sort -3, 0, 1/27, z, -0.18 in decreasing order. 1/27, 0, -0.18, z, -3 Let t(g) = -g*3 + 6g*2 - g + 7. Let m be t(6). Let l(a) = 2a + 3. Let v be l(-2). Sort v, -2, m, -5 in ascending order. -5, -2, v, m Let l = 557 - 556.5. Sort l, -26/47, 2. -26/47, l, 2 Let h = -201 - -201.237. Let l = 0.237 - h. Sort 2, l, 0.1, -0.8. -0.8, l, 0.1, 2 Let d = 759.1 + -757.4. Let y = 0.2 + 0.8. Let c = -1.1 + 0.7. Sort c, d, y in descending order. d, y, c Let c = 6373 + -6401. Put -6, 5, c, 14, 2 in increasing order. c, -6, 2, 5, 14 Let d be ((-20)/1)/(-5) - (-10 + 11). Let y be ((-4)/(-6))/(2/6). Let f be d - (2(-2)/y - -2). Put 0, f, 1, 5 in decreasing order. 5, f, 1, 0 Let l = -26.7909 - -2.1909. Sort -0.2, 2/7, l in increasing order. l, -0.2, 2/7 Let n(i) = i3 + 94i*2 - 179i - 451. Let l be n(-96). Sort 0, 0.5, l in ascending order. l, 0, 0.5 Suppose -87 = -y - 5k, -3y = -k - 52 - 145. Suppose -ya + 70a + 9 = 0. Let z(v) = -v2 - v + 1. Let q be z(0). Put a, 6, q, -1 in descending order. 6, q, -1, a Let c(u) = -u3 + 10u2 - 11u + 10. Let q be c(9). Let a = 23 - 14. Let t be q/(-6)a/(-6). Put 3, 2, t in ascending order. t, 2, 3 Let y = 31453/7 - 4493. Sort -3/53, -0.3, 4, y in descending order. 4, y, -3/53, -0.3 Suppose -4m + 3m = 3d + 4m, 4d + 2m = 0. Let r(b) = -b2 - 7b - 2. Let o be r(-7). Sort 5, o, d in ascending order. o, d, 5 Let w = -5 - -3. Let t = 1859 + -1857. Let r be 0/(6 + w) - t/(-3). Sort -1/9, r, 2 in decreasing order. 2, r, -1/9 Let c = -1.6 + 0.6. Let b = 3.46 - 8.46. Sort b, c, 1, -1/6 in increasing order. b, c, -1/6, 1 Suppose -c + 12t - 9t - 11 = 0, 5c - 3t = -31. Suppose -5r - 17 = 3. Put c, r, 3 in descending order. 3, r, c Suppose -539 = -5v - 549. Put v, -453, 0 in ascending order. -453, v, 0 Let v = -14 + 9. Let a = -5 - v. Let x = -1004 - -1003.9. Put 4, x, a, -17 in increasing order. -17, x, a, 4 Let q = -642.2 - 40.8. Let f = q - -682.6. Put 0.21, 1, 5, f in decreasing order. 5, 1, 0.21, f Suppose -22i + 334 = 73 + 107. Sort -5, -6, 2, i, 5 in descending order. i, 5, 2, -5, -6 Let i be 18 + -5 + 159/(-12). Suppose 4b + 32 = 4s, -2s + b = -2b - 11. Sort i, -0.1, -11, s in decreasing order. s, -0.1, i, -11 Let j be (-4389)/105 - 8/(-10). Let s = j + 50. Suppose -r - s = -4r. Sort r, 1, 2/9 in ascending order. 2/9, 1, r Let c(q) = -q*2 - 4q + 19. Suppose 0 = -2a - 3o - o - 30, -5a - 30 = o. Let z be c(a). Let t be (-1)/12 - (2 + z/(-8)). Sort t, 0.1, 4. t, 0.1, 4 Let q be 10/3(-9)/(-16 - (0 + -10)). Put 6, 544, q in descending order. 544, 6, q Let h be 3/4(-2)/(-3)0. Suppose h = -3b + 13 - 25. Let g(c) = -4c - 14. Let r be g(-3). Put b, r, -1, 1 in descending order. 1, -1, r, b Suppose l = -5p + 39, 5 = 29l - 33l + 3p. Suppose 0 = k + 2k - 6. Put 3, k, l in increasing order. k, 3, l Let v = -2 + 5. Let m = -7083 + 7087. Put v, 5, -5, m in descending order. 5, m, v, -5 Let z be -3 - (564/6 - (2 - -1)). Let x = -90 - z. Suppose 0 = 3b + 1 + 14. Sort 0, 5, b, x in decreasing order. 5, x, 0, b Let d be (-82)/8 + (-2 - 18/(-8)). Let i be (5/d)/(1/(-18)). Suppose -io + 69 = 24. Sort o, 4, 3, 0 in ascending order. 0, 3, 4, o Suppose 0v = -4v + 12. Suppose 377k - 466 - 1419 = 0. Put 1, k, -4, v in descending order. k, v, 1, -4 Let g(n) = n*3 - 3n*2 + 2. Let q be (-138)/92((-4)/2)/1. Let o be g(q). Suppose -23 = -5c - p, oc + 2c - 4 = 4p. Sort -3, 2, -1, c in ascending order. -3, -1, 2, c Let g be 101/(-2)(2 - 48/20). Let w(q) = -q*2 + 10q - 14. Let v be w(9). Sort v, g, 0, 4 in decreasing order. 4, g, 0, v Let h(t) = t*2 - 6t - 18. Let j be h(9). Suppose -3l = -4l + 4a - 1, -4a = -4l + 20. Let r = l - j. Put -2/5, -5, r in decreasing order. -2/5, r, -5 Suppose 0 = -4i - 3x - 2x + 744, 372 = 2i - 5x. Let d = i + -189. Put d, 3, -5, -4 in ascending order. -5, -4, d, 3 Let p = -908 + 908. Let t = 28.8 + -29. Sort t, p, -4. -4, t, p Let j be ((-63)/136513)/((-2)/(-280)-1). Put -3, -4, j, 3 in increasing order. -4, -3, 3, j Let r = 10432 - 10437. Let x = -0.03 + -0.67. Let q = x - -0.2. Put r, q, 0.1 in descending order. 0.1, q, r Let p(a) be the first derivative of 6a2 + 159a - 58. Let w be p(-13). Let o(q) = -2q + 7. Let i be o(6). Sort i, 2, 4, w. i, 2, w, 4 Suppose 0 = -2q - 2h, 6q - 5h = 7q - 24. Put -3, q, -78 in increasing order. -78, q, -3 Let f(q) be the first derivative of -q*4/4 + 22q*3/3 + 23q*2/2 - 5q - 21. Let c be f(23). Sort c, -2, 3, -7 in descending order. 3, -2, c, -7 Let j = 1385.4 + -1385. Let m = 215 - 1931/9. Sort m, j, -3, 1/7 in increasing order. -3, 1/7, j, m Let j = -281/5 + 56. Let n be (-66)/(-20)(-5)/42. Let s = n + 3/28. Sort j, s, -2/5 in ascending order. -2/5, s, j Suppose -42p - 20p - 50 = -546. Put -4, -1, 5, 7, p in ascending order. -4, -1, 5, 7, p Let d be 4 + 0 + 1/(-1). Let v = -55 - -61. Suppose -5w + 4r = 17, -4w - 9r - 26 = -vr. Put 0.02, w, d in ascending order. w, 0.02, d Let n = 3311 - 3307. Sort n, 1.1, 5, 6, -1 in decreasing order. 6, 5, n, 1.1, -1 Let v be 6/(-15) - 104/(-210). Let l = 6850131/36292 - 4/9073. Let u = -188 + l. Put u, v, 0.1 in descending order. u, 0.1, v Let c be -7(-4)/705. Suppose 0 = 4f + 5z + 11, z = -f - cf. Sort 5, f, -8. -8, f, 5 Let x = -406 - -417. Let u = -9 + x. Put u, -3, -4, -4/5 in increasing order. -4, -3, -4/5, u Let t be (-1 - 9/6)2. Suppose 3n - 4n = 4. Let r = 26998 + -26998. Sort 2, t, n, r in ascending order. t, n, r, 2 Let z(t) = 381t - 8385. Let c be z(22). Sort -1, c, 1746 in ascending order. c, -1, 1746 Let r(a) be the third derivative of -a5/60 - 3a*4/2 - 55a*3/2 + 9a*2 + 5a. Let k be r(-31). Put -1.1, 2, k in increasing order. k, -1.1, 2 Let l be (28/7)/(((-42)/231)/(4/(-11))). Put l, 5, -7 in ascending order. -7, 5, l Let i(v) = -22v + 52. Let o be i(3). Let d(u) = -u - 1. Let r be d(-3). Put r, 3, o in increasing order. o, r, 3 Let g(f) = 93f + 277. Let p be g(-3). Let y(t) = 5*t - 1. Let w be y(1).	{ "pile_set_name": "DM Mathematics" }
3 l. 10/323 What is prob of picking 3 d and 1 f when four letters picked without replacement from {f: 2, x: 2, d: 6, n: 3}? 8/143 Three letters picked without replacement from iiiiiiiiiwiwi. Give prob of picking 1 i and 2 w. 1/26 What is prob of picking 1 u and 1 f when two letters picked without replacement from {l: 7, p: 5, f: 3, u: 1}? 1/40 What is prob of picking 2 x when two letters picked without replacement from wxxx? 1/2 Three letters picked without replacement from lffmklfkmllyyilkll. Give prob of picking 2 m and 1 l. 7/816 Calculate prob of picking 2 j when two letters picked without replacement from {n: 2, u: 7, j: 4}. 1/13 Four letters picked without replacement from apapaaaaaaaaa. What is prob of picking 2 a and 2 p? 1/13 Two letters picked without replacement from hlltqwr. What is prob of picking 1 w and 1 r? 1/21 Three letters picked without replacement from {k: 1, c: 4, h: 1, t: 5}. Give prob of picking 1 c, 1 k, and 1 t. 4/33 Three letters picked without replacement from tpidjjtptktpkpttjpip. Give prob of picking 3 t. 1/57 Three letters picked without replacement from {y: 2, v: 3, o: 2, n: 4, t: 7}. Give prob of picking 1 n, 1 t, and 1 y. 7/102 Two letters picked without replacement from sbeei. Give prob of picking 2 i. 0 Four letters picked without replacement from {d: 1, k: 2, x: 3, w: 4, f: 2}. Give prob of picking 1 w, 1 x, 1 d, and 1 k. 8/165 What is prob of picking 1 j and 1 m when two letters picked without replacement from {n: 2, f: 2, a: 1, m: 1, j: 1}? 1/21 Calculate prob of picking 1 x and 1 b when two letters picked without replacement from {i: 2, l: 5, b: 1, x: 1, t: 9}. 1/153 What is prob of picking 1 v and 1 j when two letters picked without replacement from vgj? 1/3 Two letters picked without replacement from {g: 6, w: 2}. Give prob of picking 2 g. 15/28 What is prob of picking 2 u and 1 g when three letters picked without replacement from uuuuuugugguuuguuuug? 455/969 Three letters picked without replacement from fffc. Give prob of picking 3 f. 1/4 Four letters picked without replacement from hhhh. Give prob of picking 4 h. 1 What is prob of picking 1 i and 1 o when two letters picked without replacement from oiahabahbbb? 1/55 What is prob of picking 2 c and 1 j when three letters picked without replacement from {w: 1, e: 1, j: 6, c: 6, t: 2, m: 2}? 15/136 Four letters picked without replacement from xyxxxxxyxx. Give prob of picking 3 x and 1 y. 8/15 Four letters picked without replacement from {u: 2, l: 3, j: 5, n: 1, t: 1, g: 1}. Give prob of picking 1 u, 1 t, and 2 l. 6/715 Four letters picked without replacement from ooggoogooogoog. Give prob of picking 4 g. 5/1001 Three letters picked without replacement from dpprrddvvprdrzbrpdp. What is prob of picking 1 d, 1 b, and 1 r? 25/969 Three letters picked without replacement from {a: 2, e: 6, i: 1, k: 5, g: 2, q: 3}. Give prob of picking 2 a and 1 q. 1/323 What is prob of picking 2 j when two letters picked without replacement from {h: 4, j: 2, m: 2, c: 1, w: 2, x: 1}? 1/66 Four letters picked without replacement from {g: 16, r: 2}. Give prob of picking 1 r and 3 g. 56/153 Four letters picked without replacement from {w: 2, k: 7, z: 3}. Give prob of picking 2 k and 2 z. 7/55 What is prob of picking 1 e, 1 j, and 1 p when three letters picked without replacement from jpeepjppejp? 3/11 Calculate prob of picking 1 r and 2 i when three letters picked without replacement from {i: 3, q: 2, l: 1, k: 3, r: 1, g: 7}. 3/680 Calculate prob of picking 1 h and 1 o when two letters picked without replacement from {o: 9, h: 9}. 9/17 Calculate prob of picking 1 w, 1 h, and 1 e when three letters picked without replacement from {m: 5, h: 1, e: 2, w: 1}. 1/42 Calculate prob of picking 3 y when three letters picked without replacement from {d: 9, y: 11}. 11/76 Four letters picked without replacement from {u: 6, v: 6}. What is prob of picking 2 v and 2 u? 5/11 Four letters picked without replacement from {g: 6, w: 4}. Give prob of picking 3 w and 1 g. 4/35 Four letters picked without replacement from fqqfqfqqqfqqqf. Give prob of picking 3 f and 1 q. 90/1001 Three letters picked without replacement from jmkkmmjmm. Give prob of picking 2 k and 1 j. 1/42 Calculate prob of picking 4 x when four letters picked without replacement from {d: 1, x: 7, p: 1}. 5/18 What is prob of picking 2 n when two letters picked without replacement from nsaggnsas? 1/36 Calculate prob of picking 3 x when three letters picked without replacement from {h: 1, m: 4, x: 4, i: 1}. 1/30 Three letters picked without replacement from {l: 1, q: 4, s: 1, r: 3, o: 5}. What is prob of picking 3 q? 1/91 Three letters picked without replacement from tttffftffftftt. Give prob of picking 3 t. 5/52 Calculate prob of picking 2 u when two letters picked without replacement from {u: 3, h: 4, a: 2, d: 1, i: 1, v: 4}. 1/35 Calculate prob of picking 1 j, 1 z, and 2 s when four letters picked without replacement from {c: 1, j: 1, i: 1, z: 2, p: 1, s: 2}. 1/35 Three letters picked without replacement from tlqyllswqyqltts. Give prob of picking 1 s, 1 l, and 1 q. 24/455 Calculate prob of picking 1 d, 1 s, and 2 j when four letters picked without replacement from {o: 1, p: 1, d: 3, j: 2, s: 2, b: 6}. 2/455 Calculate prob of picking 1 h and 2 x when three letters picked without replacement from {w: 1, h: 1, x: 5, k: 1, d: 1}. 5/42 What is prob of picking 1 n and 1 a when two letters picked without replacement from {g: 2, j: 1, a: 2, q: 1, i: 1, n: 1}? 1/14 Calculate prob of picking 1 d and 1 o when two letters picked without replacement from {f: 2, e: 1, d: 1, o: 1}. 1/10 Calculate prob of picking 1 n and 1 r when two letters picked without replacement from rrwrrrwmwdrn. 1/11 What is prob of picking 1 e and 1 r when two letters picked without replacement from esoorsosksrbosrssrer? 1/19 Calculate prob of picking 2 b, 1 t, and 1 n when four letters picked without replacement from bggbant. 1/35 Two letters picked without replacement from {k: 2, g: 1, j: 7, y: 4, z: 1, q: 2}. What is prob of picking 1 k and 1 q? 1/34 Two letters picked without replacement from {k: 2, j: 4, i: 2, b: 3, c: 3, w: 1}. Give prob of picking 2 k. 1/105 Four letters picked without replacement from {l: 2, f: 4, h: 2, v: 3}. What is prob of picking 3 l and 1 f? 0 Calculate prob of picking 1 l and 3 w when four letters picked without replacement from {w: 6, l: 4, q: 4, g: 3}. 4/119 What is prob of picking 2 l when two letters picked without replacement from llillii? 2/7 Calculate prob of picking 2 a and 1 t when three letters picked without replacement from {e: 1, z: 3, a: 2, t: 4}. 1/30 What is prob of picking 1 m and 2 d when three letters picked without replacement from {h: 2, m: 3, d: 7}? 63/220 Two letters picked without replacement from qqhhhhhh. Give prob of picking 2 h. 15/28 Two letters picked without replacement from {k: 1, z: 1, l: 1, w: 3, r: 1}. Give prob of picking 1 z and 1 l. 1/21 Two letters picked without replacement from {g: 2, r: 1, p: 1, n: 2, h: 7, q: 4}. What is prob of picking 1 h and 1 r? 7/136 Four letters picked without replacement from wqawyawwaqqwqwwwaa. What is prob of picking 1 y, 1 q, 1 a, and 1 w? 8/153 What is prob of picking 1 v, 1 k, and 1 f when three letters picked without replacement from {f: 1, n: 2, k: 1, v: 2, a: 1}? 2/35 Two letters picked without replacement from woaoclw. What is prob of picking 1 a and 1 w? 2/21 Calculate prob of picking 1 l and 1 u when two letters picked without replacement from {u: 1, m: 3, z: 2, l: 1}. 1/21 Two letters picked without replacement from eeeeeqeeeeeeueee. Give prob of picking 1 u and 1 e. 7/60 What is prob of picking 2 w when two letters picked without replacement from wbbwzn? 1/15 What is prob of picking 2 t when two letters picked without replacement from tfkxcykt? 1/28 Three letters picked without replacement from ciicci. What is prob of picking 1 c and 2 i? 9/20 Calculate prob of picking 2 x and 1 d when three letters picked without replacement from {d: 4, c: 2, x: 2, o: 1}. 1/21 Calculate prob of picking 2 i and 1 l when three letters picked without replacement from lllllliliiii. 7/22 What is prob of picking 2 v when two letters picked without replacement from vvwwvwwwwwwwvv? 10	{ "pile_set_name": "DM Mathematics" }
+ 2n3 + 52852619n*2 wrt n. -600n*2 - 178512n + 12 What is the second derivative of 30136y5 + 2y*4 + 1607735y wrt y? 602720y3 + 24y*2 What is the second derivative of -4916548a*2t*3 + 5a*2t + 6at - 21211t wrt t? -29499288a*2t Find the third derivative of 119762784u4 - 160891872u*2 wrt u. 2874306816u What is the second derivative of u*4 + 255u*3 + 58870u*2 + 641292984u? 12u2 + 1530u + 117740 Find the second derivative of z*4 - 1567214z*2 + 1754183z wrt z. 12z2 - 3134428 Find the second derivative of 14p*5 + 497p*4 - 204p*2 + 166253257p wrt p. 280p3 + 5964p*2 - 408 What is the derivative of dop - 142do - 114371dx + 7opx - 2op - 2ox - 52o - px + 34p wrt d? op - 142o - 114371x Find the second derivative of 17106946r3 + 23r - 72026. 102641676r Find the third derivative of -2487360a*3v*3 + 361291a*3v*2 - 564a*3 - 4av3 wrt v. -14924160a*3 - 24a What is the third derivative of 71123738h4 + 901089h*2 - 2h - 4 wrt h? 1706969712h What is the third derivative of o5 + 13217872o*4 + 20o*2 - 89487 wrt o? 60o*2 + 317228928o What is the derivative of 30204681b - 401959662? 30204681 Find the second derivative of 747735l*3 + 5l + 1414738. 4486410l What is the second derivative of -20273465s*2u - 16866020su wrt s? -40546930u Find the second derivative of 279681627d*2 + 266461839d. 559363254 What is the third derivative of 1686f3p*2s*2 - 150f*3p*2s - 331f2s - fp2s*2 - 79p*2s*2 wrt f? 10116p*2s*2 - 900p*2s Find the third derivative of 5579472h2v*4w2 - h2v2 - 5h*2vw2 + 2hv2 + 749hw + 6vw wrt v. 133907328h*2vw2 Differentiate 77b*3u - 606b2 - bu - 48b + 8541117u - 2 with respect to b. 231b2u - 1212b - u - 48 Differentiate 8429020j*2v + 6091763v wrt j. 16858040jv Find the second derivative of 23958b*2fw2 + 44b*2fw - 2b*2w + 25574bf - 3bw - 25fw*2 - 48w*2 wrt w. 47916b*2f - 50f - 96 Find the second derivative of -265767477lq2 + 9lq - 92l + 844q + 19 wrt q. -531534954l What is the second derivative of 512wx*2 + 728607wx - 67w - 39315x2 wrt x? 1024w - 78630 What is the derivative of 107765qz + 2q - 74205876z wrt q? 107765z + 2 Find the second derivative of 560100l*4 + 2277013l - 2. 6721200l2 What is the second derivative of 4v*4 - 16366509v*3 + 390561175v? 48v2 - 98199054v What is the second derivative of -971z4 - 254z*3 - 16279z + 294? -11652z2 - 1524z Find the second derivative of a*3o*4 - 2851859a*3o*2 - 2a3 + a2o + 137o - 2178 wrt o. 12a3o*2 - 5703718a*3 Find the third derivative of 4059417b*3x*2 + 41b*2x*2 - 10871b*2x wrt b. 24356502x2 Differentiate 26095346fj + 3318450j + 8 with respect to f. 26095346j Differentiate 189042491h*2 + 194837757 with respect to h. 378084982h What is the second derivative of -274539j2x - 252j2 - jx - 5j + 147890x + 15 wrt j? -549078x - 504 What is the first derivative of -26351930g - 127982522 wrt g? -26351930 Find the first derivative of 1147403847y2 - 945520421. 2294807694y What is the first derivative of -422h2 + 19208h - 10591553? -844h + 19208 Differentiate 84146t*3 - 77t*2 - 23004173 with respect to t. 252438t*2 - 154t What is the first derivative of 84232g4 - 544g*3k*3 - 3619532k*3 - 3k*2 + 3k wrt g? 336928g3 - 1632g*2k*3 Find the second derivative of 64791845s*2 - 1747735s - 24 wrt s. 129583690 Differentiate -4ag*3 - 80ag2 + 12ag - 7a + 43770 wrt g. -12ag*2 - 160ag + 12a What is the third derivative of 6418987m4 - 7907003m*2? 154055688m Find the third derivative of -7835930l3 - 87l*2 - 16252l + 2. -47015580 Differentiate -159y4 + 1136508y*2 + 149206732. -636y*3 + 2273016y Find the third derivative of -183298469v3 - 322282688v*2. -1099790814 Find the third derivative of 631m*5s - 85m3s*3 + 3m*3 - 759m*2 - 3ms2 + 5s*3 + 2s wrt m. 37860m2s - 510s3 + 18 Find the second derivative of -9668288z*3 - 35z + 64156. -58009728z What is the third derivative of 1160426iq3x - 14iq*2x - 2iq*2 - ix + 2i + 7q*3x + 2q2x - 94qx + 2x wrt q? 6962556ix + 42x Find the second derivative of 3c4 - 3c*3 + 3364821c*2 - 5c + 7747538. 36c2 - 18c + 6729642 Find the third derivative of -73704z6 - 51z*3 + 13544027z*2 wrt z. -8844480z*3 - 306 Differentiate 7717ai2 - 22ai - 112368045a + 3i2 + 3i wrt i. 15434ai - 22a + 6i + 3 Find the second derivative of -292g3 - 220606g*2 - 64997707g. -1752g - 441212 Find the second derivative of -72272584b*3c*4 - 14b*3c - 3b3 + 812b*2c + 3c - 3 wrt c. -867271008b*3c*2 Differentiate -2284s*3 - 6s*2 - 24s + 7633853 with respect to s. -6852s2 - 12s - 24 Find the second derivative of -91501900u3z*2 - 5049u*3z - 18uz + 2u + 6z wrt z. -183003800u3 What is the first derivative of 5347999c + 33112684? 5347999 Find the third derivative of 55k5 + 55k*4 + 2826k*3 + 2k*2 + 3k - 11280020. 3300k2 + 1320k + 16956 Find the first derivative of 5213570w3z - 62976w3 - 5w*2 - 2w - z*2 wrt z. 5213570w*3 - 2z What is the third derivative of 6605761l5 + 2l*4 + 2l*2 + 370247 wrt l? 396345660l*2 + 48l What is the third derivative of -227783p5q - 412p3q*2 + 2p*2q*2 + 7p*2q + 347p2 + 4pq + 4230 wrt p? -13666980p*2q - 2472q2 What is the second derivative of -10a*3 + 3030473a*2 - 66844884a? -60a + 6060946 What is the derivative of 862a*2p + 197a2 - 1066ap + 3p - 1243 wrt p? 862a2 - 1066a + 3 Find the second derivative of -4b4 - 360b*3 - 1139b*2 + 49905682b. -48b2 - 2160b - 2278 Find the third derivative of -12y4 - 143234y*3 - 10467296y*2. -288y - 859404 What is the third derivative of 9115788m6 + 2459873m*2 - 3? 1093894560m*3 Find the first derivative of 53248jq2 + 306jq + 45073792j + 2 wrt q. 106496jq + 306j What is the first derivative of -67p*3 + 1784333p*2 - 59349819? -201p*2 + 3568666p Find the first derivative of 98d3 + 23d*2 - 4441d + 114850890 wrt d. 294d2 + 46d - 4441 Find the first derivative of 69056lt*2 + 2lt - 2221l + 91t2 - 4529 wrt t. 138112lt + 2l + 182t Find the first derivative of 8382k*3 + 5949k - 263599281. 25146k2 + 5949 Find the third derivative of 945775v*4 - 3209268v*2. 22698600v Find the third derivative of 421050805t5 - 4t*2 + 490911t - 2 wrt t. 25263048300t2 What is the third derivative of -4670w*3x*3 + 2w*3x*2 - 12w*3x + 802w2x*3 + 5wx3 + 4579wx2 + 28wx - 2x wrt x? -28020w3 + 4812w*2 + 30w What is the second derivative of 894c3 - 38868c*2 + 15170c - 5827? 5364c - 77736 Find the second derivative of -14399a*2b2 - a2b + 255253abw + 2ab - 7b3w - 2b3 wrt b. -28798a*2 - 42bw - 12b Find the second derivative of 26754c4 - 5874c*3 + 1041198499c wrt c. 321048c2 - 35244c Find the third derivative of -7980946dq*3y - 60dq*2 - dq - q*3y - 2q2y + 934q2 + 2qy - 3y wrt q. -47885676dy - 6y Differentiate 151372i*4q*2 - 929iq3 + 186q*3 - 506307 with respect to i. 605488i*3q*2 - 929q*3 Differentiate 3926732tv - 234t - 6 wrt v. 3926732t Find the second derivative of -24cj3 + 17115cj2 + 3cj - 330353c + 2j2 wrt j. -144cj + 34230c + 4 What is the derivative of -6338j2 - 152j - 39634120 wrt j? -12676j - 152 What is the second derivative of -7670704q*2 + 6q - 7195? -15341408 Find the third derivative of 836577i3l*2z2 - i2l2z*2 - 13i*2lz2 - 829i*2z*2 - 2il + 4l*2 - 7z*2 wrt i. 5019462l*2z*2 Find the third derivative of 35a*2o*3 + 353a*2o*2 + 1239a*2 + 29ao2 + 3a - 1689059o3 wrt o. 210a*2 - 10134354 Find the third derivative of -73556w*4 - 126w*3z*2 + 7w*2z*2 + 61w*2 + 11wz2 - wz wrt w. -1765344w - 756z*2 Differentiate -7156km2 - 16571210k + 140m2 wrt m. -14312km + 280m Differentiate -39016881nw -	{ "pile_set_name": "DM Mathematics" }
h*4 + 90h2 Let s(v) = -v + 2. Let o(q) = -q3 + 8q2 + 8q + 12. Let r be o(9). Let l(u) = -2u + 3. Let w(c) = rs(c) - 2l(c). Let f(z) = 5z*2. Determine f(w(k)). 5k*2 Let q(v) be the first derivative of 3v*2/2 + 1. Let o(d) = -2 - d + 2. Determine o(q(i)). -3i Let v(j) = j*2 - 4j*2 + 0j*2. Let x(u) = u - 1. Let k = 6 - 10. Let h(f) = 2f - 4. Let l(m) = kx(m) + h(m). Give l(v(d)). 6d*2 Let r(z) = -2z2. Let p(b) be the third derivative of b6/240 + b*4/6 + 4b*2. Let g(t) be the second derivative of p(t). What is r(g(l))? -18l*2 Let n(y) = 2y. Let r(w) = 0 + 0 + 13w. Let a(f) = -14n(f) + 2r(f). Let z(m) = 3m. What is a(z(v))? -6v Let f be 3/6(9 - -1). Let i(j) = -5 - j + f. Let z(p) = 2p2. Give i(z(k)). -2k*2 Let h(p) = -2p. Let g(x) = -15896x2. Give h(g(r)). 31792r*2 Let q(l) = 7l*2. Let c(m) = -26m*2. Determine c(q(z)). -1274z*4 Let c(j) = 4j. Let b(x) = -x*2. Let o(s) = -3s*2. Let k = -4 + 6. Let n(m) = ko(m) - 9b(m). Calculate n(c(a)). 48a*2 Let p(f) = 3f*2 - 726f. Let m(o) = -o*2. What is p(m(l))? 3l*4 + 726l*2 Let j(m) = 4m*2. Let q(z) = -z + 30. What is q(j(w))? -4w*2 + 30 Let z(q) = 3q. Let d(n) = -319n + 3. Give z(d(i)). -957i + 9 Let r = 12 + -12. Let g(u) = -2u + ru*2 + 2u - u2. Let f(p) = -p2. What is g(f(o))? -o*4 Let l(g) = -8g*2 - 4. Let d(u) = -32u*2 - 2. What is l(d(o))? -8192o*4 - 1024o*2 - 36 Let g(z) be the third derivative of 0 + 0z*3 + 0z*4 - 1/30z*5 - 3z*2 + 0z. Let x(f) = -f*2. Give x(g(d)). -4d*4 Let t(v) = -11v. Let d(f) = -19f. Give d(t(g)). 209g Let i(z) = 611z. Let p(v) = v. Calculate p(i(l)). 611l Let t(r) = -2r - 12. Let d be t(-7). Let z(c) = 0c*d + 2c2 + c2 + 0c2. Let s(b) = -4b*2. Determine s(z(y)). -36y*4 Let p(h) = -3h*2. Let m(g) = -3g*2. What is m(p(u))? -27u*4 Let g(u) = 1. Let v(j) = 3j - 3. Let h(f) = 3g(f) + v(f). Let o(b) = 5 - b - 3 - 2. Calculate o(h(y)). -3y Let a(y) = 2y. Let f(k) be the first derivative of 2k*3/3 + 7. What is f(a(r))? 8r*2 Suppose 0 = -2c + 16 - 2. Let b(i) = -2i2 - 4i*2 + 0i*2 + ci*2. Let d(w) = 2w*2. Determine b(d(z)). 4z*4 Let p(j) = -3j - 3. Let y(l) = -l*2 - l - 1. Let r(u) = p(u) - 3y(u). Let v(d) = 3d. Let k(w) = -4w. Let z(s) = 5k(s) + 6v(s). Calculate r(z(a)). 12a2 Let m(v) be the first derivative of 5v*3/3 + 23. Let w(s) = -7s*2. Give w(m(t)). -175t4 Let x(k) be the second derivative of k4/6 + k. Let s(r) = 2r2. What is s(x(q))? 8q*4 Let r(z) = -1 + 3z + 5 - 4. Let t(u) = -24u + 14. Let p(j) = 5j - 3. Let w(f) = 28p(f) + 6t(f). What is w(r(k))? -12k Let d(p) be the second derivative of p4/4 + 16p. Let h(u) = -3u. Calculate h(d(s)). -9s*2 Let s(j) = 2j. Let p(i) = i + 2. Let r = 3 + -5. Let v(w) = -2 + 1 - 1. Let h(x) = rv(x) - 2p(x). Give h(s(l)). -4l Let r(v) = 21v*2. Let k(t) = 8t. Give r(k(n)). 1344n2 Let v(s) = 12s*2 + 1. Let p(x) = 32x*2. What is p(v(l))? 4608l*4 + 768l*2 + 32 Let m(d) = -d. Suppose -5q = -4q - 4. Let r(x) = -x. Let s(p) = -4p. Let l(u) = qs(u) - 18r(u). Give m(l(w)). -2w Let g(j) = 24j*2 + 28j*2 - 29j*2. Let c(a) = 2a. What is g(c(w))? 92w2 Let b(x) be the first derivative of -24x*3 + 2 - 1 - 5 + 26x3. Let n(o) be the third derivative of o4/12 - o*2. What is n(b(p))? 12p*2 Let w(a) = -4a*2 - 5a - 5. Let v(l) = 5l2 + 6l + 6. Let t(o) = -5v(o) - 6w(o). Let y(h) = 7h2 - 11h*2 - 8h*2. What is y(t(i))? -12i4 Let p(y) be the first derivative of y5/120 - 2y3/3 - 1. Let h(c) be the third derivative of p(c). Let k(t) = 0t + 2t - t - 2t. Calculate k(h(d)). -d Let s(a) = a*2 - 35. Let t(f) = 3f. Calculate s(t(w)). 9w2 - 35 Let q(n) = 2n*2. Let b(j) = -33j - 34j - j + 0j. Give b(q(h)). -136h2 Let u(g) = 16g*2. Let i be 1/((-2)/6 - 0). Let h(p) = 5p*2. Let t(n) = iu(n) + 10h(n). Let r(l) = -4l2 - l2 + l2 - l2. Determine r(t(c)). -20c4 Let j(d) = -9d - 1. Let k(m) = 34m. Calculate j(k(q)). -306q - 1 Let d(p) be the second derivative of -p*3/6 - 2p*2 + 3p. Let t(z) = z + 3. Let f(g) = 3d(g) + 4t(g). Let a(j) = j2. Determine a(f(b)). b2 Let i(c) = -c. Let h(j) = 336j2 + 3. Determine i(h(f)). -336f*2 - 3 Let a(l) = -2l. Let h(c) be the second derivative of 17c4/12 - 9c. What is a(h(q))? -34q2 Let o(z) = -21z. Let j(b) = 108b. Determine j(o(q)). -2268q Let x(a) = -5a - 6. Let n(j) be the first derivative of 5j*2/2 + 5j + 4. Let r(z) = -6n(z) - 5x(z). Let i(v) = -v*2. Calculate i(r(d)). -25d*2 Let f(n) = 4n*2 - 5n - 10. Let p(a) = 2a2 - 2a - 4. Let g(j) = -2f(j) + 5p(j). Let h(i) = 73i. Determine h(g(r)). 146r*2 Let j(n) = n + 25 - 25. Let v(k) = 3k*2 - 5k*2 - 5k*2. Determine j(v(d)). -7d*2 Let x(l) = -10l. Let m(r) = 81r2. Calculate x(m(f)). -810f*2 Let y(d) = -17d + 5d + 5d - 11d. Let x(v) = 2v*2. Determine x(y(t)). 648t*2 Let n(z) = 2z*2. Let b(q) be the first derivative of 0q*2 + 0q + 5/3q3 + 2. Determine b(n(f)). 20f*4 Let r(h) = 2 + 6 - 8 + 2h*2. Let x(n) = -8n. Determine r(x(a)). 128a2 Let x(z) = -6z*2. Let l(i) = -501i + 1. What is l(x(c))? 3006c2 + 1 Let m(i) = 1352i*2 + 2i. Let r(a) = 2a2. Determine m(r(u)). 5408u*4 + 4u*2 Suppose 7 = -4i + 4j + j, 4j = -5i + 22. Let v(u) = 0u + 0u - iu. Let p(c) = 3c + 0c + 2c - 2c. What is v(p(n))? -6n Let u(w) = -3w*2 + 8 - 6 - 2. Let h(c) = -2c. What is h(u(d))? 6d2 Let u(n) = -n. Let m(a) = -5a2 + a2 - a*2 + 4a2. Calculate m(u(s)). -s2 Let t(b) = -10b2 + 6b*2 + 10b*2. Let i(a) = -4a. Calculate t(i(o)). 96o2 Let o = 0 - -2. Let k(l) = -ol + l - 6l + 3l. Let a(g) = -2g2. Determine k(a(r)). 8r2 Let m(n) = -n2 + 2. Let c be m(0). Let z(p) = 5pc - 5p*2 - 5p*2 + 2p2. Let w(t) be the first derivative of -t2 - 2. What is z(w(d))? -12d2 Let y(c) be the first derivative of 3c*2/2 - 18. Let z(r) = -6r*2. What is y(z(m))? -18m*2 Let y(i) = -5i2. Let b(s) be the second derivative of s3/2 + s. Determine b(y(u)). -15u2 Let a(g) = -g. Let v(c) = -4c + 5. Let r(o) be the first derivative of -o*2 + 2o - 3. Let h(q) = -5r(q) + 2v(q). Determine a(h(m)). -2m Let x = -9 + 11. Let p(u) = 0u*2 - 3u*2 + 0u*x + 4u*2. Let n(b) = 6b*2. Determine p(n(y)). 36y*4 Let s(g) = -16g - 20g + 38g. Let u(x) = 8x. Calculate s(u(r)). 16r Let g(k) = 6k2. Let z(v) = 7v - 8v + 2v. Calculate g(z(s)). 6s2 Let t = -13 - -38. Let p(i) = -ti + 11i + 16i. Let s(l) = l*2. Calculate p(s(m)). 2m*2 Let g(w) = -w. Let d(s) = 3s*2 + 1. Give g(d(v)). -3v*2 - 1 Let i(f) = 314f*2. Let j(g) = -12g*2. Give j(i(s)). -1183152s*4 Let i(v) = 15v*2. Let k(o) = -33o. Determine i(k(c)). 16335c2 Let w(q) = -22q. Let b(n) = -8n. Let a(x) = -8b(x) + 3w(x). Let f(j) be the first derivative of j2 - 1. Calculate a(f(o)). -4o Let t(l) = -1 + 5l - 13l + 1. Let n(y) = -10y + 0y + 9y. Determine t(n(f)). 8f Let i(x) = -7x. Let n be (2/6)/(1/12). Let b(z) = -z + n + 2 - 6. Give i(b(l)). 7l Let a(i) = 11i2. Let q(r) = -151r. What is a(q(f))? 250811f2 Let a(l) = -7l. Let f(q) = -780q2. Give f(a(c)). -38220c*2 Let h(n) = 21n*2 - 26n*2 + 2n - 2n. Let w(a) = 8a*2. What is h(w(z))? -320z*4 Let b(i) = 5i2 + i2 - 5i2. Let x(j) = j2 - 3 - 3 + 3 + j2 + 3j. Let s(c) = 2c2 + 4c - 4. Let z(m) = -3s(m) + 4x(m). What is b(z(r))? 4r4 Let k(u) = 2u - 9u + 0u. Let o(r) be the first derivative of -r*2 + 1. Give o(k(w)). 14w Let a(b) = 2b2 + 17. Let m(i) = -i2. Give m(a(p)). -4p*4 - 68p*2 - 289 Let r(a) = -2a*2. Let j(u) = 143u*2. Calculate r(j(n)). -40898n*4 Let w(u) = 2u. Let m(t) = 25t2 + 1. Calculate w(m(s)). 50s2 + 2 Let y(k) = -k. Let w(i) = -i2 + 0i2 - 11i*2. Give y(w(l)). 12l*2 Let x(p) = -5p. Let s(n) be the third derivative of 0n + 0n*3 - 1/12n*4 + 0 + 6n*2. What is x(s(w))? 10w Let d(b) = -2b2. Let w(h) be the third derivative of 4h*2 + 0h*4 + 0h + 0 - 1/15h5 + 0h*3. Give w(d(k)). -16k4 Let t(f) = f. Let x(b) = -b2 - 3b + 1 + 3b - b. Let g be (3 - (-15)/(	{ "pile_set_name": "DM Mathematics" }
2/3 - 1526676j + 315167328 = 0 for j. -1736, 369 Factor w3/4 + 4917w*2/4 + 5618151w/4 + 1870130867/4. (w + 737)*2(w + 3443)/4 Determine k so that -2k5 + 25624k*4 - 1252064k*3 + 16466564k*2 - 29279422k + 14039300 = 0. 1, 22, 25, 12763 Factor -2h2/15 + 28202h/15 + 4235404/5. -2(h - 14538)(h + 437)/15 Determine u, given that u*2 - 6445u - 410004 = 0. -63, 6508 Solve -3d5/4 + 18545d*4/4 - 55527d*3/2 - 166905d*2 + 1000458d = 0 for d. -6, 0, 6, 18527/3 What is y in 4y5 + 3320y*4 - 176448y*3 + 2870280y*2 - 13986756y = 0? -881, 0, 9, 21 Let -16o3 + 195614o*2 + 782904o - 2348136 = 0. What is o? -6, 2, 97839/8 Determine m, given that -m*3/7 + 654m*2/7 + 84591m/7 + 247860/7 = 0. -108, -3, 765 Factor n*4/4 + 876952n*3 + 769048318104n*2 + 6152344451200n + 12304660840000. (n + 4)*2(n + 1753900)2/4 Let m5 + 63m4 + 1098m*3 + 3604m*2 - 7224m - 9792 = 0. Calculate m. -34, -24, -6, -1, 2 Determine w, given that 4w4 - 160968w*3 + 2168163696w*2 - 9893928421472w + 1601745787294464 = 0. 168, 13358 Factor 5d2 - 16243220d + 162431700. 5(d - 3248634)(d - 10) Factor -82z2/7 - 2182918z/7 + 15212. -2(z + 26621)(41z - 2)/7 Factor -2w*2 - 93412522w - 186825036. -2(w + 2)(w + 46706259) Determine v, given that -5v4 - 2420v*3 - 115835v*2 + 916200v - 797940 = 0. -429, -62, 1, 6 Solve 4c5 + 652c*4 + 19456c*3 + 151792c*2 + 442240c + 422656 = 0. -127, -26, -4, -2 Suppose -k*3/2 - 385911k*2/2 + 192957k + 385912 = 0. What is k? -385912, -1, 2 Suppose z*4 + 2732030z*3 + 1865966927653z*2 - 41052264140580z + 225789270953796 = 0. Calculate z. -1366026, 11 Let 2r3/7 + 13154242r*2/7 + 3089897150810r + 64887721778886/7 = 0. What is r? -3288559, -3 What is o in -o*2 + 146019o + 1460290 = 0? -10, 146029 Let -h*5/3 + 473h*4/3 + 164279h*3/3 - 1167733h*2/3 + 1840742h/3 - 837760/3 = 0. What is h? -238, 1, 5, 704 Factor -3n2 - 294201288n - 7212866488404912. -3(n + 49033548)2 Determine u, given that -u4 + 387u*3/2 - 15813u*2/2 - 9274u + 48642 = 0. -3, 2, 121/2, 134 Suppose 605g4 + 82875g*3 - 5734350g*2 + 40344200g - 665280 = 0. What is g? -189, 2/121, 8, 44 Find t such that -3t2 - 10095t + 1858500 = 0. -3540, 175 Determine y so that -3011y2/2 + 3005y + 12 = 0. -12/3011, 2 Solve 2u2 + 49896u + 8916480 = 0 for u. -24768, -180 Factor -2p4 - 33688p*3 - 199902152p*2 - 488829589248p - 421108988332032. -2(p + 2416)2(p + 6006)2 Find r, given that -r3 + 12446575r2 - 199145008r + 796579776 = 0. 8, 12446559 Let -2k2 - 13508344k - 22809419702792 = 0. Calculate k. -3377086 Find h such that -3h4/5 + 273h*3/5 - 5982h*2/5 - 13512h/5 + 426816/5 = 0. -8, 9, 38, 52 Determine d so that -d*2/6 - 26688692d/3 - 356143140335432/3 = 0. -26688692 Solve 2p3 + 2524250p*2 - 20194096p + 40388256 = 0 for p. -1262133, 4 Find s, given that -5s2 - 808171330s - 32657044931698445 = 0. -80817133 Determine r, given that 5r4 - 890r*3 - 138505r*2 - 137610r = 0. -99, -1, 0, 278 Solve -4x2 - 290660x - 120796984 = 0. -72247, -418 Determine d so that 155d2 - 44670970d - 8646000 = 0. -6/31, 288200 Factor h*2 - 18665203h - 18665204. (h - 18665204)(h + 1) Find k, given that 2k*3/3 + 38824k*2/3 + 9807358k/3 - 9846184/3 = 0. -19156, -257, 1 What is f in 3f4/4 - 34629f*3/4 + 518661f*2/4 + 1141221f/4 + 146982 = 0? -1, 17, 11528 Factor 3u2/5 + 203352u/5 + 162672. 3(u + 4)(u + 67780)/5 Determine p so that p*2/3 + 740199p - 4441198/3 = 0. -2220599, 2 Solve -5a4/4 - 295a*3/2 - 4510a*2 - 40360a - 63840 = 0. -76, -28, -12, -2 Factor -53t4/6 - 12560204t*3/3 - 661462104660t*2 - 104504347993553200t/3 + 3943563127399000/3. -(t + 157990)*3(53t - 2)/6 What is x in 2x*2/5 + 3773600x - 18868002/5 = 0? -9434001, 1 Find n, given that 3n4/2 - 1365n*3 + 560805n*2/2 - 1373475n + 1094436 = 0. 1, 4, 303, 602 Factor 2m5 + 19718m*4 + 65556930m*3 + 75930750818m*2 + 8079023452628m. 2m(m + 118)(m + 3247)3 Factor 15b*2 - 275639b + 257250. (b - 18375)(15b - 14) Determine b, given that b*4 + 28b*3 - 27b*2 - 3222b + 9072 = 0. -21, -18, 3, 8 Solve 2x4/5 - 132x*3/5 - 1418x*2/5 + 5148x/5 - 720 = 0 for x. -12, 1, 2, 75 Let -h*4 - 2101h*3 - 708095h*2 - 3488075h = 0. Calculate h. -1681, -415, -5, 0 Factor -3t3 + 10568t*2 + 409593t - 277758. -(t - 3561)(t + 39)(3t - 2) Determine k so that -2k*4 - 80648k*3 - 1080063360k*2 - 4750408530400k + 716834172308000 = 0. -13490, 146 Solve 3b3/4 - 224175b*2/2 + 896664b - 1793304 = 0 for b. 4, 149442 Find o such that 2o2 - 79226o + 2691372 = 0. 34, 39579 Suppose -10p5 - 185p*4 + 360p*3 + 1235p*2 + 700p = 0. What is p? -20, -1, 0, 7/2 Find i, given that -3i4/5 - 8869233i*3 - 44346147i*2/5 + 221730801i/5 - 133038486/5 = 0. -14782054, -3, 1 Suppose 2f4 - 35494f*3 + 1909564f*2 + 22647040f = 0. What is f? -10, 0, 64, 17693 Factor 3y3 + 80352y*2 - 11957808y. 3y(y - 148)(y + 26932) Suppose 5f*5/3 + 5255f*4/3 - 53945f*3/3 - 941075f*2/3 + 3016360f + 3310320 = 0. Calculate f. -1061, -13, -1, 12 Factor 4476719662276a2/5 + 12694956a/5 + 9/5. (2115826a + 3)2/5 Factor 3s*3 - 4569342s*2 + 63970347s - 223895700. 3(s - 1523100)(s - 7)*2 Suppose 4r*2/5 - 1848776r/5 - 7395168/5 = 0. What is r? -4, 462198 Factor -3k2 + 46549656k - 180572539476528. -3(k - 7758276)2 Factor t2/4 + 509839t/4. t(t + 509839)/4 Determine s so that -2s*5/5 - 174s*4/5 - 4738s*3/5 - 4258s*2 + 840348s/5 + 8795072/5 = 0. -31, -22, -16, 13 Let -2w5 + 7138w*4 + 21426w*3 + 21430w*2 + 7144w = 0. Calculate w. -1, 0, 3572 Determine f so that 4f4/5 + 313569f*3/5 - 423356f*2 - 548793f/5 = 0. -78399, -1/4, 0, 7 Solve 2k4/9 - 3244k*3/9 - 150586k*2/3 - 636056k/9 + 1113734056/9 = 0. -86, 43, 1751 Let -3y3/2 - 7953y*2/2 - 126429y/2 + 134385/2 = 0. Calculate y. -2635, -17, 1 Determine u so that -u*2 - 7588064u - 53116399 = 0. -7588057, -7 Let -3c2 + 31618059c - 31618056 = 0. Calculate c. 1, 10539352 Find u, given that -411845u3 - 489300560u*2 - 34096100u - 594000 = 0. -1188, -10/287 Factor 12s2 + 1245150s + 129199876875/4. 3(4s + 207525)*2/4 Determine p so that 11055p*2 + 431120p + 78020 = 0. -7802/201, -2/11 Suppose 4k4/3 - 572k*3/3 - 619268k*2/3 + 206612k = 0. What is k? -329, 0, 1, 471 Solve -2g5/17 + 3048g*4/17 - 127450g*3/17 + 124404g*2/17 = 0. 0, 1, 42, 1481 Let 4g*2 + 19144g + 7695796 = 0. What is g? -4343, -443 Let 578z5 + 50014z*4 - 135186z*3 - 716350z*2 + 356944z - 42720 = 0. Calculate z. -89, -3, 4/17, 5 Let -q*5/4 - 23382q*4 + 6552227q*3/4 + 17175531q*2/2 + 13946177q + 7019850 = 0. What is q? -93598, -2, -1, 75 Solve a*4/4 - 265a*3 - 24933a*2/4 + 6498a = 0 for a. -24, 0, 1, 1083 Suppose -x*2 + 520684x - 33840235 = 0. Calculate x. 65, 520619 Find q, given that 2q2/11 - 218261140q/11 + 5954740654262450/11 = 0. 54565285 Factor 27x3 - 556512x*2 + 2868077295x - 4460107050. 3(x - 10305)2(9x - 14) Solve -2y*5/11 - 18050y*4/11 - 38187230y*3/11 + 1041075910y*2 - 810929161120y/11 + 799515531392/11 = 0 for y. -4649, 1, 136 Factor -3j2/7 + 4863648j - 13798791922944. -3(j - 5674256)2/7 Suppose -3t*2 - 6189t + 284580 = 0. What is t? -2108, 45 Solve -6199856658x5 + 588986159802x*4 + 6221013916x*3 - 588986159612x*2 - 21157258x - 190 = 0. -1, -1/55677, 1, 95 Factor -18p3 + 18651984p*2 + 49738720p + 33159168. -2(p - 1036224)(3p + 4)2 Suppose -89373d*4/2 - 95056906575d*3/2 - 27597156381d*2 - 5341384458d - 344605428 = 0. Calculate d. -1063597, -6/31 Let 64k5/5 - 2576k*4 - 1974807k*3/5 + 502326k*2/5 + 1207143k/5 + 278154/5 = 0. Calculate k. -102, -3/8, 1, 303 Factor a*2/6 + 13485383a/3 - 26970767/6. (a - 1)(a + 26970767)/6 Factor -4r*2 + 61788r - 10750784. -4(r - 15271)(r - 176) Solve 5z4/6 - 58124z*3/3 - 81379z*2/3 + 11624z/3 + 23251/2 = 0. -1, 3/5, 23251 Factor 3g2 + 23886g - 767424. 3(g - 32)(g + 7994) Suppose -5o5 - 7065o*4 + 95o*3 + 134385o*2 + 211950o = 0. Calculate o. -14	{ "pile_set_name": "DM Mathematics" }
t v(g) = -2g. Calculate a(v(n)). 2n Let j(u) = -126u2. Let a(v) = 11v*2. Calculate a(j(y)). 174636y4 Let k(r) = -r3 + r*2 + r + 8. Let n be k(0). Let m = 10 - n. Let x(t) = -mt - 2t + 3t. Let q(d) = 3d. Give q(x(j)). -3j Let n(f) = -4f. Let r(m) = -2m*2 - 3m. Let w(t) = t*2 + 2t. Suppose -9 = -k - 2k. Let z(g) = kw(g) + 2r(g). Determine n(z(o)). 4o*2 Let o(c) = -4c. Let y(h) = h*2 + 31h. Calculate o(y(a)). -4a2 - 124a Let q(d) = -4 - 2d - 10 + d - 5d. Let x(n) = 2n + 5. Let g(u) = -5q(u) - 14x(u). Let t(b) = 3b*2. Determine g(t(c)). 6c*2 Let k(x) be the third derivative of 5x*4/12 - 5x*2. Let d(w) = 2w. What is k(d(l))? 20l Let g(a) = -a - 207. Let l(k) = 3k*2. What is g(l(v))? -3v*2 - 207 Let m(x) = -5x + 2512. Let n(u) = 2u2. Give n(m(h)). 50h*2 - 50240h + 12620288 Suppose 0i - 3i = 0, 0 = -2z - 4i + 8. Let w(s) = 6s - 5. Let x(j) = 5j - 4. Let l(v) = zw(v) - 5x(v). Let f(t) = 5t2. Determine l(f(y)). -5y*2 Let q(g) = 9g. Let c(n) be the second derivative of n*3/3 + n + 13. What is q(c(b))? 18b Let b(n) = -2n. Suppose 12 + 17 = 3q - 5h, 5q - 3 = -3h. Suppose -ql = -4p - 2, -4p = -l - l. Let t(y) = 2yl + 0y + 0y. Calculate t(b(d)). 8d2 Let f(q) = q3 + 5q2 - 4q + 12. Let o be f(-6). Let b(i) be the second derivative of 0 + oi3 + 0i*2 + 1/12i*4 - i. Let r(u) = 2u. Give r(b(a)). 2a2 Let f(s) = -3s - 388 + 388. Let g(v) = 6v2. Give g(f(i)). 54i*2 Let v(o) = 2o*2. Let x(h) = 256h*2. What is x(v(c))? 1024c*4 Let m(c) = 2c - 49. Let x(k) = 3k2. Calculate m(x(v)). 6v*2 - 49 Let j(k) = -k. Let y(d) = -3d + 3d - 96d*2 + 104d*2. Give j(y(l)). -8l*2 Let x(v) = 2v2. Let t(c) = c2 + 40c - 40c. Determine t(x(p)). 4p4 Let d(r) = r2 - 3r - 3. Let u(o) = o*2 - 4o - 4. Let l = 3 - -1. Let b(f) = ld(f) - 3u(f). Let i(q) = -q2. What is b(i(z))? z4 Let b(j) = j + 3. Let z(g) = 2g2. What is z(b(k))? 2k*2 + 12k + 18 Let o(u) = 3u2. Suppose 5k - 16 = 4. Let g(i) be the first derivative of -1/3i3 - k + 0i*2 + 0i. Calculate g(o(f)). -9f4 Suppose -5d - 8 = -4q, 4 = 3d - 0q + 2q. Let u(h) = dh - 3h + h. Let z(m) = -3m. Give z(u(l)). 6l Let h(u) = 2u. Let f(k) = -190k*2. What is f(h(r))? -760r*2 Let v(h) = -h. Let l(x) = x. Let r(d) = 6l(d) + 5v(d). Let u(s) = -s. Let g be (2/3)/(6/(-9)). Let a(o) = -8o. Let c(q) = ga(q) + 12u(q). Give r(c(m)). -4m Let i(h) = h. Let g(v) be the second derivative of 0 + 0v*2 + 1/6v*3 + v + 1/120v*5 + 0v*4. Let a(m) be the second derivative of g(m). What is a(i(t))? t Let x(w) = 2w*2. Let g(y) = -4y*2. Suppose 29 - 4 = 5k. Let l(q) = kx(q) + 3g(q). Let t(j) = -5j. Give t(l(v)). 10v*2 Let a(b) = -5b2 + 2. Let d(v) be the third derivative of -v4/12 + 30v2. What is a(d(k))? -20k*2 + 2 Let k(d) = 31d. Let t(a) be the first derivative of a*2/2 - 5. Calculate k(t(j)). 31j Let r(g) = 2g. Let t be (-4)/(-2) + (-8 - -11). Let d(w) = 3w*2 - tw2 + w2. What is d(r(j))? -4j2 Let f(m) = 24351m. Let s(v) = v. Give f(s(t)). 24351t Let x(t) = -3t2. Let l(r) be the third derivative of r5/60 - 13r2. Calculate l(x(d)). 9d*4 Let d(r) be the third derivative of -4r*4/3 + 20r*2 - 2r. Let x(u) = 4u. Determine d(x(z)). -128z Let m(w) = 2w2. Let h(v) be the second derivative of 0 + 2v + 0v2 + 2/3v*3. What is h(m(d))? 8d*2 Let c(d) = -8d*2 - d. Let r(t) = 3t*2. Give r(c(y)). 192y*4 + 48y*3 + 3y2 Let b(q) be the first derivative of -q2 + 14. Let r(f) = f - 12. What is r(b(i))? -2i - 12 Let v(b) = 5b. Let z(i) = 8i + 14. Let d(c) = -3c - 5. Let w(n) = -14d(n) - 5z(n). Determine w(v(u)). 10u Let h(u) = 3u*2 - 239u. Let n(k) = -6k. Determine h(n(b)). 108b*2 + 1434b Let p = -1 + 1. Let z(a) be the first derivative of -1/3a3 - 2 + pa*2 + 0a. Let c(g) = -g2. Give c(z(w)). -w4 Let m(k) = -48k. Let o(v) = 3v. Determine o(m(f)). -144f Let j(p) = 660p*2 - 2p - 6. Let b(h) = h*2. Give j(b(s)). 660s*4 - 2s*2 - 6 Let g(a) = 78a2. Let z(h) = -h2. Calculate g(z(f)). 78f4 Let u(j) = 760j + 1. Let l(p) = 2p2. Determine l(u(o)). 1155200o*2 + 3040o + 2 Let a(p) = 5p. Let k(d) = 3393d - 3393d - 3d*2. Give a(k(m)). -15m2 Let i(b) be the third derivative of -b5/5 + 3b2. Let p(n) = 2n*2 - 2n*2 + 2n*2. What is p(i(s))? 288s*4 Let i(u) = -85u2. Let t(n) = n2. Give t(i(q)). 7225q4 Let r(f) be the first derivative of 2f*3/3 - 7. Let l(b) = b. What is l(r(m))? 2m*2 Let t(m) be the first derivative of 2m*3/3 + 3. Let a(v) = -2v + 4v - 4v. Determine a(t(q)). -4q2 Let b(p) be the first derivative of 2/3p*3 + 0p*2 + 2 + 0p. Let j(w) = 1. Let d(s) = s + 2. Let l(f) = -d(f) + 2j(f). Calculate l(b(c)). -2c*2 Suppose -2c - 2 = -2s, 2c = 2s + s - 4. Let a(f) = sf - 13f + 5f. Let d(p) be the first derivative of -p*3/3 - 1. Calculate a(d(r)). 6r*2 Let o(a) = -17a2. Let k(z) be the third derivative of -z4/12 - 2z2. Determine o(k(d)). -68d*2 Let h(g) = -23g. Let y(a) = 4a + 7. What is h(y(o))? -92o - 161 Let r(f) = -8f. Let v(c) = c. Let a(p) = -r(p) - 6v(p). Let k(j) = 1 - 1 + 3j. Calculate a(k(u)). 6u Let x(p) = -p2 - p2 + 0p2. Let t = 206 - -229. Let k(f) = 435f - tf - 3f*2. Calculate x(k(r)). -18r*4 Let m(z) = -1479z. Let h(v) = v. Calculate m(h(j)). -1479j Let g(i) = 19i - 63i + 18i + 19i. Let n(d) = d. What is n(g(u))? -7u Let g(p) be the second derivative of p4/4 - p. Let u(j) be the third derivative of j4/12 + 21j2. Determine g(u(f)). 12f*2 Let k(g) = -5g. Let j(s) = -28s - 26s + 52s. Calculate k(j(r)). 10r Let p(s) = 7s2 - 1. Let a(c) be the first derivative of 3c*2/2 - 58. Determine p(a(m)). 63m*2 - 1 Let m(t) = -t. Let n(o) = -149o. Calculate n(m(f)). 149f Let d(r) be the third derivative of r5/20 - 2r*2. Suppose -2x = -8, 2 + 4 = -5l + 4x. Let w(z) = -lz + 3 - 3. Determine w(d(a)). -6a*2 Let d(p) = 3p*2 - 8p. Let b(i) = i*2 - 3i. Let g(t) = -8b(t) + 3d(t). Let h(l) = 15l2. Give g(h(y)). 225y*4 Let w(i) = -7i. Suppose 0a - 2o = -3a + 4, -2a + o = -1. Let g be -3 + ((-2)/(-1) - a). Let h(l) = g - 2l + 2 - 3. What is h(w(n))? 14n Let w(r) = 2r. Let q(f) be the second derivative of -1/12f*4 + 0f*2 + 0f*3 + 4f + 0. Determine q(w(s)). -4s2 Let z(i) = -2i - 12. Let p(n) = 5n. Calculate z(p(g)). -10g - 12 Let b(y) = 51y2. Let f(z) = -21z. What is b(f(n))? 22491n2 Let k(h) = 9h*2 + 2. Let i(x) = 3x. Determine i(k(n)). 27n2 + 6 Let p(z) = 10120z. Let q(n) = n*2. Give q(p(m)). 102414400m*2 Let i(v) = -196v*2. Let s(w) = 2w. What is i(s(d))? -784d2 Let b(a) be the first derivative of -a2 - 1. Let c = 2 + -7. Let k(x) = 6x*2 + 5x. Let s(l) = -3l2 - 3l. Let t(r) = cs(r) - 3k(r). Determine b(t(w)). 6w2 Let u(i) be the third derivative of 1/30i*5 - 2i*2 + 0 + 0i*4 + 0i*3 + 0i. Let z(m) = 68 - m - 68 + 0m. Determine u(z(y)). 2y2 Let j = 8 + -18. Let q(n) = -n3 - 10n2 + n + 14. Let a be q(j). Let i(p) = -p2 + 4p - ap. Let c(m) = 2m. Determine c(i(z)). -2z2 Let f(m) be the first derivative of -2 - 1/6m*3 + 0m*2 - 2m. Let p(i) be the first derivative of f(i). Let h(t) = 2t. Determine p(h(j)). -2j Let w(k) = 2k2. Let d(i) = i. Let g be d(3). Let l(f) be the first derivative of -1 + 0f + 0f2 - 1/3f*g. What is w(l(v))? 2v*4 Let u(v) = -3v*2. Let g(n) = -58n*2 - 8. Calculate u(g(r)). -10092r*4 - 2784r*2 - 192 Let w(q) = -871q + 1. Let r(p) = p. What is r(w(k))? -871k + 1 Let g = 6 + -4. Let o(a) be the first derivative of a2/2 + 5a + 2. Let p(r) = 1. Let x(t) = go(t) - 10p(t). Let f(j) = -3j. Calculate x(f(k)). -6k Let u(k) = 3k. Let c be (-1)/6(-2 + -1). Let o(m) be the first derivative of -cm2 - 1 + 0m. Calculate u(o(j)). -3j Let l(z) = -4z + 0z + 0z. Let o(h) be the second derivative of 1/3h3 + 0h*2 + 0 + 2h. Determine o(l(i)). -8i Let c(h) = 2h*2. Let y(t) = 6t + 2. What is y(c(n))? 12n2 + 2 Suppose 4f = -2s - 2s - 4, -13 = -3s + f. Let b(q) be the second derivative of -1/12q*4 + sq + 0q3 + 0q**2 +	{ "pile_set_name": "DM Mathematics" }
2/11, 5, -459, -0.151? -2/11 Which is the nearest to 0.1? (a) 2/13 (b) -0.402 (c) 2/19 (d) 0.21 (e) 4/7 c What is the nearest to 181 in 0.6, -1, 0.5, -1/2, 6.8, -61/7? 6.8 What is the closest to 0.3 in -3/2, 0.09, 3.53, -1, 2? 0.09 What is the closest to -1 in -4, -2/81, 320.097, 4, 0.4? -2/81 What is the nearest to 2/3 in -401/2, -3/4, 0.045, -1? 0.045 Which is the closest to 11? (a) 0 (b) -2/3 (c) -2/9 (d) -0.2 (e) -3/1406 a What is the closest to -279 in -68, -5, -0.2, -0.1, -12/11? -68 What is the nearest to 2/3 in 1, -1626, 2/3, 0, -6? 2/3 What is the closest to 140 in 0.4, -2/9, -1/4, 5, -5567? 5 Which is the nearest to 15? (a) -2 (b) 671 (c) 13 (d) 0.3 c Which is the closest to 73? (a) 2 (b) 3 (c) 3/8 (d) -2 (e) 0.09449 (f) -4 b What is the nearest to 12.935 in -5, -20, -19/2? -5 Which is the closest to 0.79? (a) 131 (b) 17 (c) 44 b Which is the nearest to -0.2? (a) 1/2 (b) 1/5 (c) -24091 (d) -0.2 (e) 2/11 d What is the nearest to 0.2 in 8, -155989, 1/6, -1, 2/15? 1/6 What is the nearest to 8.995 in -12, -6/7, -31, -3, 1, -1? 1 Which is the closest to 0.1? (a) 8 (b) 0.142 (c) -2 (d) -656 (e) -5 b What is the nearest to -2/9 in -307, -0.07, -4/7, -1/295? -0.07 What is the nearest to -0.01 in 0.48, 504/5, 4, -10? 0.48 What is the closest to -1 in 2/15, -3/8, -67/4, -5? -3/8 What is the nearest to 1/5 in -75, 4/13227, -2/19? 4/13227 What is the closest to 6595 in -13, 1, -7? 1 Which is the closest to 89511? (a) 2 (b) -20 (c) 3 c What is the nearest to -6249 in 3, 2/31, 0.3? 2/31 What is the closest to 0 in 4/15, 1.5039, -28? 4/15 Which is the nearest to 0.1? (a) 6 (b) -0.1 (c) -292 (d) -2/5 (e) 1540 b Which is the closest to 0? (a) 336 (b) 26 (c) 0 (d) -0.34 (e) 27 c What is the nearest to 0.03962 in 4/9, 4, 3, -4, -2? 4/9 What is the nearest to 2/503 in 0.07, 0, 33, 0.3? 0 Which is the closest to 39? (a) -2 (b) 264 (c) 0.4 (d) 2 (e) -3 d Which is the nearest to 0? (a) -5 (b) 29947 (c) -4 c Which is the nearest to 4? (a) -0.2 (b) 6/11 (c) -26.9 (d) -32 b Which is the nearest to 1? (a) 82 (b) 76 (c) 0 (d) -97 (e) -3 c Which is the nearest to 2? (a) -5 (b) -4176 (c) -1/4 (d) -4/5 (e) 3 e What is the closest to -0.1 in -1, -2/11, -0.5, -41/13, -29/4? -2/11 What is the nearest to 0 in 7936/5, -9.2, 0.5? 0.5 What is the nearest to 2/6285 in 0.3, -0.16, -88? -0.16 Which is the closest to 1323.5? (a) 0.5 (b) 54 (c) 8 b What is the closest to -266 in 3, 36, 0.17, -2/15, -3, 1/4? -3 Which is the nearest to -4? (a) 0.5 (b) 2/65 (c) -62 (d) 60 (e) 8/3 b What is the nearest to -1/2 in -0.3, 31.2, 5, -104, -0.1, -0.16? -0.3 What is the closest to 8 in 1173, 11/4, 0.3, -0.5, 5? 5 What is the nearest to -1/4 in 1, 19, -0.403, 4, 8? -0.403 What is the closest to 5/437 in 3, -7, 4, -14, -0.1? -0.1 Which is the nearest to 1? (a) 2/13 (b) 0 (c) -6.9 (d) -4/9 a Which is the nearest to 7? (a) -2/9 (b) 11 (c) -40/9 (d) 4/5 (e) 60 b Which is the nearest to 1? (a) -33 (b) -0.46 (c) -5 (d) -2/17 (e) 7/50 e Which is the nearest to 0.047? (a) 4 (b) -1876 (c) 3 c Which is the nearest to -44.9? (a) 44 (b) 7 (c) -4 (d) 4 c Which is the closest to -1? (a) 3/2 (b) -2/5 (c) 5/3797 (d) -0.3 (e) 1/3 b Which is the nearest to 3? (a) -1 (b) 46/41 (c) -1/5 (d) -4/11 b What is the nearest to -3.2 in 0.4, 0.0253, 0.2, 0.1? 0.0253 What is the closest to 1.1 in -1, 1, 2716? 1 What is the closest to -1.96 in 1/7, -3/8, -39, -93? -3/8 What is the nearest to -1 in -2/15, -52, 2/7, 0.1, 0.2? -2/15 Which is the closest to -2/9? (a) 2 (b) -141 (c) 12064 (d) -2/3 d What is the nearest to 0.1 in -2/7, -2677, 0.2, 3, 21, -1? 0.2 Which is the closest to -3? (a) 3 (b) 16 (c) 17 (d) 1/3 (e) 0.636 d Which is the nearest to 0.1? (a) 4/3 (b) -3/7 (c) 5 (d) -1217 (e) 0 e What is the closest to -1 in 4, -2/5, 5, 7.54, 112? -2/5 Which is the nearest to 5? (a) -3 (b) -5/82 (c) -0.04 (d) -2 (e) 0.3 e Which is the closest to 0.162? (a) 0.7 (b) -5.5 (c) -2.5 a What is the nearest to 2/1633 in -3, -0.1, 5/4, 1/3? -0.1 What is the nearest to -1/8 in -113, -20, -1/6, 20/11, -0.3, 0.4? -1/6 What is the closest to 2/9 in 0.17, 2992.2, 5, 4? 0.17 Which is the closest to -112? (a) 0.2 (b) 2/5 (c) -216 (d) 5 (e) 20 c Which is the closest to 3/4? (a) -1/7 (b) 1/4 (c) 3 (d) 5/2 (e) -1248/73 (f) 0.05 b What is the nearest to 6 in 17, -12/13, -1679? -12/13 What is the nearest to -0.2 in -1, -1/10, -532045? -1/10 What is the closest to 0.14 in 1/4, 2/17, 1/6, 11/138? 2/17 Which is the closest to 12? (a) -6 (b) 1/8 (c) 1 (d) 1153 c What is the closest to -0.0815 in 1, 4, -1/4? -1/4 What is the closest to 0 in -1/68, 2/77, 197, 0? 0 Which is the closest to 43.767? (a) -54 (b) 2/17 (c) 4 c Which is the closest to 0? (a) -0.89 (b) 6/7 (c) 0 (d) -0.2 (e) -13463 c Which is the closest to -2/5? (a) 3/2 (b) 5 (c) 0.72 (d) -3 (e) 0.204 (f) -23 e Which is the closest to 41.11? (a) -0.5 (b) 895 (c) 0.1 c Which is the closest to -102? (a) 5 (b) -66 (c) -1 (d) -3/5 b Which is the nearest to -1? (a) -1/6 (b) -7 (c) -1 (d) -16 (e) 0.02 c Which is the nearest to -1/36? (a) 73 (b) 3 (c) 115.5 b Which is the nearest to -115/9? (a) -5 (b) 0.1246 (c) 0.3 (d) -2 a Which is the closest to 1097/3? (a) 368 (b) -3 (c) 1/2 (d) -6 a What is the closest to 0 in -5, -2/3, -5/199, -0.2, 162? -5/199 What is the closest to 1 in 21, 1.8, 23146/11? 1.8 What is the closest to 1 in -1/5, 0.4, -13730, 47/2? 0.4 What is the closest to -1 in 22, 4, 2, 0.145, 0? 0 Which is the nearest to 0.01? (a) 2/13 (b) 2 (c) -4227/2 (d) -15 a What is the nearest to 0 in 0.2, 26, 4/7, 65, -1/28, 0? 0 Which is the closest to -3? (a) -4/199 (b) -5 (c) -16373 b What is the closest to 0.3 in -5/4, 4, -2/44189? -2/44189 What is the closest to -129 in 1/3, 118, -11/3, -1? -11/3 What is the nearest to -1/2 in 1/2, 0.6, 2/5077, -514? 2/5077 What is the closest to 1/15 in 1, -241/8, 2.5, 0.01? 0.01 What is the closest to 0.08 in 9372, -2, 216? -2 Which is the nearest to 0.4? (a) 3/16 (b) -2/11 (c) 1 (d) 2/7 (e) 5505 d Which is the nearest to -4? (a) 4 (b) -8/9 (c) 3 (d) -20 b Which is the nearest to 0.02? (a) 1/9 (b) 4/31251 (c) 2/19 (d) -0.12 b Which is the nearest to 0? (a) 1.2 (b) -0.05 (c) 13 (d) -0.3 (e) -205 b Which is the closest to -1407? (a) 0.2 (b) 1/16 (c) -879 c What is the closest to 2/5 in 3/4, 8, -15.2185? 3/4 Which is the nearest to 0? (a) -6 (b) 0 (c) 127 (d) -2 (e) 25 b What is the closest to -10 in -2/1405, -15/17, -0.4? -15/17 What is the closest to 5.1 in -6.2, -4, 35, -3, 2/7? 2/7 What is the nearest to 0.057 in 0.4, -3, -1/2, 2/127, 466? 2/127 What is the closest to -3/29 in -17, -195, -0.6? -0.6 Which is the nearest to 56? (a) 0 (b) 18/23 (c) -11 b Which is the nearest to 2? (a) 2 (b) -1851369 (c) 1/2 a Which is the nearest to -76? (a) 0.1 (b) -6/5 (c) 1127 b Which is the nearest to 3.4? (a) 6676 (b) 0.3 (c) 10 b Which is the closest to -26? (a) 5 (b) -0.01314 (c) 3 (d) -0.3 d Which is the closest to -8? (a) 2 (b) 0.2 (c) 2/117 (d) 1/15 (e) -3.7 e Which is the nearest to -3? (a) -26/5 (b) -47 (c) 5/92 (d) -2/7 a Which is the closest to -5? (a) 0.5 (b) 0.3 (c) 4/37 (d) 1620 c What is the nearest to 0.11 in -0.22, -1/12, -2, 24? -1/12 Which is the nearest to 0? (a) -2/177 (b) -10 (c) 3 (d) -0.2 (e) 10022 a What is the closest to -4 in 0.5, 0.2, 40597, 5? 0.2 What is the nearest to -7/4 in 213, -31, 1/4, 0.1? 0.1 Which is the closest to 0.2? (a) -3 (b) 757 (c) -12/7 c Which is the nearest to -1/3? (a) -1 (b) -0.3 (c) -44/9 (d) -42 b What is the nearest to 0.5 in -0.36, -1/9, 8, -198, 3? -1/9 Which is the closest to 1? (a) -49 (b) -4/13 (c) -15/928 c Which is the closest to 7.9? (a) 381 (b) -3 (c) -4 (d) -1.3 (e) 0.1 e What is the nearest to 0 in -0.4, 0.11, -52, -8, 424, -2/7? 0.11 What is the nearest to 198569 in 89, 1, -2/3? 89 What is the nearest to -1 in -1/6, 2/141, 110444? -1/6 What is the closest to 1/3 in -1/2, -0.083, 0.1, -13, 4/3, -4/11? 0.1 Which is the closest to 2? (a) 2 (b) 3 (c) -122/16025 a What is the closest to 0.7 in 0.6, -9434, 21/4, -0.3, 0? 0.6 What is the nearest to -	{ "pile_set_name": "DM Mathematics" }
77? 167 Calculate the greatest common divisor of 33 and 3194202. 33 Calculate the greatest common divisor of 736 and 5748160. 736 Calculate the greatest common factor of 1529758 and 122. 122 Calculate the greatest common divisor of 2163 and 336. 21 What is the greatest common factor of 32618 and 11451? 347 What is the highest common factor of 28037 and 1643? 53 What is the highest common factor of 46 and 2783? 23 What is the highest common divisor of 309 and 627373? 103 What is the highest common divisor of 180 and 409380? 60 What is the highest common factor of 190694 and 182? 14 Calculate the highest common factor of 17175 and 67555. 1145 What is the greatest common divisor of 6708 and 387? 129 What is the highest common divisor of 886 and 518753? 443 Calculate the highest common divisor of 25 and 89500. 25 Calculate the greatest common divisor of 420 and 197295. 105 Calculate the highest common divisor of 77945 and 136. 17 Calculate the highest common factor of 153 and 2817. 9 What is the greatest common factor of 1016 and 200? 8 What is the highest common divisor of 76202 and 42? 14 What is the highest common factor of 1510 and 3170? 10 What is the greatest common divisor of 613260 and 20? 20 What is the greatest common factor of 723520 and 400? 80 Calculate the greatest common factor of 33843 and 348. 87 What is the greatest common divisor of 221 and 7939? 17 Calculate the highest common divisor of 261 and 63423. 261 What is the highest common factor of 82950 and 840? 210 What is the highest common factor of 3749 and 214345? 163 Calculate the highest common divisor of 2897579 and 1. 1 Calculate the highest common factor of 1220 and 1098. 122 Calculate the greatest common divisor of 15 and 848835. 15 What is the greatest common factor of 5750 and 144250? 250 Calculate the greatest common divisor of 10 and 43730. 10 What is the highest common factor of 38654 and 308? 154 Calculate the highest common factor of 34342 and 231. 77 What is the highest common factor of 1517 and 28167? 41 What is the highest common factor of 537344 and 256? 256 What is the highest common factor of 569668 and 6848? 428 Calculate the greatest common divisor of 64 and 999728. 16 What is the highest common factor of 31530 and 150? 30 Calculate the highest common divisor of 1934477 and 131. 131 Calculate the highest common divisor of 42160 and 105740. 340 What is the highest common divisor of 2356 and 4028? 76 What is the greatest common factor of 138023 and 34? 17 Calculate the greatest common divisor of 407 and 27214. 11 What is the highest common factor of 74562 and 18? 6 What is the greatest common factor of 76 and 25346? 38 What is the highest common divisor of 256 and 195936? 32 Calculate the greatest common divisor of 312 and 1664052. 156 What is the greatest common factor of 284501 and 42? 7 What is the highest common divisor of 316 and 3270442? 158 What is the highest common factor of 276 and 1372341? 69 Calculate the highest common factor of 1176 and 424. 8 Calculate the greatest common factor of 3652 and 35773. 83 Calculate the greatest common factor of 170187 and 282. 141 What is the greatest common factor of 88 and 24772? 44 What is the highest common factor of 3016 and 664? 8 Calculate the greatest common divisor of 210482 and 667. 29 What is the highest common factor of 49 and 16331? 7 Calculate the highest common divisor of 121 and 75020. 121 Calculate the greatest common factor of 8 and 49554. 2 What is the highest common divisor of 258692 and 56? 28 What is the greatest common factor of 64 and 119464? 8 Calculate the highest common divisor of 20 and 66205. 5 What is the greatest common factor of 490589 and 1299? 433 What is the greatest common divisor of 90 and 45790? 10 What is the greatest common factor of 2 and 43502? 2 Calculate the highest common divisor of 175 and 1175. 25 Calculate the greatest common factor of 112 and 10824. 8 Calculate the highest common factor of 10 and 170530. 10 What is the greatest common factor of 81 and 114291? 81 What is the greatest common factor of 37 and 81733? 37 Calculate the greatest common divisor of 5264 and 10199. 329 Calculate the highest common divisor of 224 and 51016. 56 Calculate the highest common divisor of 162 and 466560. 162 Calculate the greatest common factor of 8790 and 15780. 30 Calculate the highest common factor of 2682 and 497958. 894 Calculate the greatest common factor of 3772 and 1702. 46 What is the highest common divisor of 44 and 9559? 11 Calculate the greatest common factor of 960 and 143520. 480 What is the highest common divisor of 1375 and 395875? 125 What is the highest common factor of 516808 and 152? 8 What is the highest common divisor of 2147207 and 823? 823 Calculate the greatest common divisor of 110052 and 225. 9 Calculate the highest common divisor of 186 and 256029. 93 What is the highest common divisor of 676 and 16016? 52 Calculate the highest common divisor of 17432 and 824. 8 What is the highest common divisor of 2184 and 13923? 273 Calculate the highest common divisor of 1954701 and 46. 23 Calculate the highest common divisor of 250 and 3815500. 250 What is the greatest common divisor of 4309 and 36418? 139 What is the highest common factor of 351458 and 34? 34 Calculate the highest common factor of 15280 and 24. 8 Calculate the greatest common factor of 57741 and 2052. 57 What is the highest common divisor of 3504 and 2256? 48 Calculate the highest common divisor of 142779 and 156. 39 What is the greatest common divisor of 393267 and 6? 3 Calculate the greatest common factor of 1334 and 2254. 46 Calculate the highest common divisor of 258 and 77228. 86 Calculate the greatest common divisor of 108 and 396. 36 Calculate the highest common divisor of 7711235 and 5565. 1855 What is the greatest common factor of 688 and 1580336? 688 What is the greatest common factor of 70456 and 128? 8 What is the greatest common divisor of 73850 and 1750? 350 Calculate the greatest common factor of 904 and 577769. 113 Calculate the greatest common factor of 74 and 36667. 37 What is the highest common divisor of 11 and 8060811? 11 What is the greatest common factor of 48798 and 882? 18 Calculate the greatest common factor of 1960 and 107320. 40 Calculate the greatest common divisor of 198 and 19548. 18 Calculate the highest common factor of 26 and 5795621. 13 What is the highest common factor of 41433 and 42? 21 What is the greatest common divisor of 4071 and 42303? 177 Calculate the highest common divisor of 80 and 4625. 5 What is the greatest common factor of 87780 and 2695? 385 Calculate the highest common divisor of 28974 and 3894. 66 Calculate the highest common divisor of 1452 and 22704. 132 Calculate the greatest common divisor of 83435 and 410. 205 Calculate the highest common factor of 99294 and 11859. 201 Calculate the greatest common factor of 369 and 590277. 123 Calculate the greatest common factor of 3480 and 43080. 120 Calculate the highest common divisor of 2335680 and 180. 180 What is the greatest common divisor of 22468 and 6888? 164 Calculate the highest common factor of 1817 and 506. 23 Calculate the greatest common factor of 75 and 5725. 25 Calculate the highest common factor of 5655 and 91. 13 Calculate the highest common factor of 3182 and 11766. 74 Calculate the highest common divisor of 186 and 302002. 62 What is the highest common divisor of 28002 and 2598? 6 Calculate the greatest common divisor of 53701 and 166. 83 What is the highest common divisor of 4452 and 154389? 159 Calculate the highest common factor of 986 and 9106. 58 What is the highest common factor of 41446 and 986? 34 Calculate the highest common factor of 200 and 1040. 40 What is the greatest common factor of 51723 and 84? 21 What is the highest common divisor of 1518 and 10923? 33 What is the greatest common factor of 131045 and 35? 5 What is the highest common divisor of 203 and 163531? 29 Calculate the greatest common factor of 10025 and 5213. 401 What is the highest common divisor of 47672 and 88? 8 Calculate the greatest common factor of 8631 and 42. 21 What is the highest common divisor of 356 and 1364459? 89 What is the highest common divisor of 44980 and 4160? 260 What is the greatest	{ "pile_set_name": "DM Mathematics" }
in -0.5, 0, b? 0 Let g = 1.656 + 2.344. What is the closest to -13 in 3/4, g, -3, -12? -12 Let u be (42/(-70) - 26/40)8/(-15). Which is the nearest to -0.01? (a) u (b) 1/5 (c) -2 b Let i be (0/(7 - (-2 + 5)))/(-3). Let t = 902/543 + 1/181. What is the nearest to -2/5 in 3, -3, i, t? i Let v be (-6)/(-14)(-1)/(-4)7. What is the closest to -1/4 in v, 4.5, 3, -11? v Let t = 4.05 + -0.05. Let j = 5 - t. Suppose -18v - 100 = -388. Which is the nearest to 1? (a) v (b) j (c) -2 b Let o = -1.566 + 5.566. Which is the closest to -1? (a) 0.3 (b) -11 (c) o (d) -0.2 d Let k = 444/7 - 15117/238. Let z = -0.64 - -0.24. What is the nearest to -0.2 in -1, z, k? k Let g = 10.8217 + -10.4217. Let h = -5 - 0. What is the closest to 27 in 2, g, h? 2 Let o be -1 + 1 + 1 + -2. Let n = 65535/4 - 65537/4. Let z = -0.6 + -0.4. What is the closest to o in z, n, 3/8? z Let w be 0 - 1/15(3 - 9). What is the nearest to -2/7 in w, -2/11, 22, 0.03? -2/11 Let x = 5/32 + 167/160. Let o = -67.32 + 0.32. Let i = o + 68. Which is the closest to i? (a) x (b) -1 (c) 8 a Let o = -617 + -45. Let j = o - -661. Let p = 0.28 + -0.3. Which is the closest to p? (a) -3 (b) j (c) -3/4 c Let k be (-5)/150(-11 + -4) - 4/2. Which is the nearest to -13? (a) -30 (b) 1/8 (c) k c Let j be 6 + 54/(-10) + (-52)/120. What is the nearest to -1 in 0.6, j, -285/7? j Let u(p) = p - 2. Let l be u(4). Let j = -32/39 - -2/13. Let m = 1.775 - 1.375. Which is the nearest to j? (a) m (b) 1/3 (c) l b Let c = -12/4027 - -8234/60405. Let u be 3 - (-21)/36-4. What is the nearest to -1 in c, -4, u, -1/6? -1/6 Suppose -16 = 3v + 5j, -5v - 44j + 42j = 14. Which is the closest to 73? (a) 0.1 (b) v (c) -1/2 (d) 2 d Let x = -586 + 2917/5. Let h = -831 - -831.1. What is the closest to h in 2/3, x, -1/2? 2/3 Let o be (-21 - -23)6/8. Which is the closest to 4? (a) o (b) -2/11 (c) -71 a Let s = 11.12 - 11.12. Let h = 0.01 + 0.09. What is the nearest to h in 2, s, -5? s Let i = 6458 - 58124/9. Which is the nearest to -2? (a) -5 (b) -0.2 (c) 69 (d) i d Let p = -0.0386 + -3.9614. Let i = 0.26 + 0.14. Let u = i + -0.1. Which is the nearest to 0.1? (a) p (b) u (c) 0 c Let y = -615 - -615.2. Let l = y + 0.1. Which is the nearest to 1/3? (a) 0.4 (b) l (c) -4/9 (d) -4 b Let z = -0.5 - -2.5. Let i = 3209 + -3193.872. Let o = i + -0.128. What is the nearest to -1 in o, -0.1, z? -0.1 Let n = -0.00934 + -0.03066. What is the nearest to 14 in 1, n, -53? 1 Let t be (-144)/1288/6. Let s be (-351)/(-27) - (-252)/(-20). Let c = 0.1 + -0.6. What is the closest to s in 1, t, c? 1 Let l = -0.1 - -0.173. Let j = l + 0.027. Let y = 0.7 - -3.3. Which is the nearest to 0.1? (a) j (b) 0.2 (c) y a Let x = 4/4689 + -1571/9378. What is the closest to x in 1/7, 3/16, -5, -0.5? 1/7 Let g = 163/6 - 27. Let m be 8 + (-4 - -2) + 2 - (95 + -88). Which is the closest to 1? (a) m (b) g (c) 4 (d) 2/13 a Let l = -0.018 + 0.039. Let y = 0.12 + l. Let r = y + -0.041. Which is the closest to 0? (a) r (b) 2/3 (c) 0 c Suppose 14z = 16 + 40. Let f be 300/(-420) - z/14. Which is the closest to f? (a) 2/5 (b) 3 (c) -1/5 c Let o = 19.677 - 19.777. What is the closest to 1/23 in -18, 0.2, o, 0.4? o Let s = 1 - -4. Let n = -402 - -398. Let w be 8/n(-2)/(-4) - -3. Which is the nearest to w? (a) 0.4 (b) -0.6 (c) s a Let j = -2 + -110. Let n = -112.2 - j. Which is the closest to -0.1? (a) 8 (b) 2/7 (c) n c Let y = 32508 + -194995/6. Which is the nearest to -2/5? (a) -2/9 (b) y (c) -1 a Let l = 12090 - 12090. Let v = 1 - 0.6. Let a = 3.1 + -3. What is the closest to l in 4, v, a? a Let w = 0.12301 - -0.37699. Which is the nearest to -1? (a) w (b) 2/129 (c) -1/58 (d) 1/7 c Let m = 14 + -14.5. Let s = -3.5 - m. Let h be 0 + 0 + (-6 - -5). Which is the nearest to s? (a) h (b) 0 (c) 0.1 a Let a = -103855 - -103853. Let j = 0 - -1. What is the nearest to j in -1/9, -3/5, -1/2, a? -1/9 Let o = 2.259 + -2.659. What is the nearest to -2 in o, 0.2, 3/7, -5? o Suppose 86 = 46r - 89r. Let l be 5 + 6/(-3) + 0. Let k be (-2)/2(-4)/(-36). What is the nearest to k in l, r, -2/9? -2/9 Suppose -17t + 18 = 1. Let r be ((t + 0)/(-2))/1. What is the nearest to r in 0.5, -0.08, 0.3? -0.08 Let s = -224.7 + 224.7. Which is the closest to s? (a) -3/10 (b) 3 (c) 5 (d) 4 a Let g = -2121 - -2120.8. Which is the closest to 0.1? (a) g (b) -0.136 (c) 1 b Let r = 7898 - 7898. What is the nearest to r in -5/28, 0, 6, -1/6? 0 Let q(p) = 34p2 + 67p - 1. Let r be q(-2). Which is the nearest to r? (a) 0 (b) 1 (c) -0.4 b Let t be 616/(-96)1/3. Which is the closest to -0.2? (a) -1/6 (b) t (c) -0.4 a Let j = -7211/138 - -313/6. Let o = -4.07 + -13.63. Let l = o + 18. What is the closest to l in -1, j, -3? j Let w = -2788.8 - -2789.8. Which is the closest to 5? (a) -0.2 (b) -2 (c) w (d) 7 d Let j = -5 - -8. Let t be (10/(-15))/1 + 0. What is the closest to j in t, -77, 3? 3 Let n be (2/21)/(-11 + 1170/126)4. What is the closest to -1/4 in -112, -3, n? n Let t = 0 - -20. Let m = 89 + -70. Let n = m - t. What is the closest to -0.1 in -1/3, n, -3? -1/3 Let g be (-2)/6 + 44/6. Suppose -w + 4u + 226 - 204 = 0, -w - 23 = 5u. Let o = g - w. Which is the nearest to 2/9? (a) 1/6 (b) 0.3 (c) o a Let u = -0.022 - 2.978. Let p = -2.7 - u. Let l = 1 + -0.8. What is the nearest to l in 0.2, 3, p? 0.2 Let w = 5/174 + -21/58. Which is the nearest to w? (a) -1/3 (b) 1/7 (c) 5/8 (d) -0.1 a Let l = 637.052 - 636. Let t = -0.028 + l. Let x = -0.024 + t. Which is the nearest to -0.4? (a) -1 (b) 3 (c) x a Let f = 72277 + -866663/12. Let a = -166/3 + f. What is the closest to -1 in a, -0.3, 4, -2? -0.3 Let u = -97 + 98.38. Let k = u + 3.62. What is the nearest to -3 in -2/9, 2/11, k? -2/9 Let j = 172 + -169. Suppose -2y = -5x + 2 - 20, 3x + jy - 6 = 0. Let u be (-2)/(6/5) + 2. Which is the nearest to u? (a) -0.2 (b) 0.1 (c) x b Let t = -11.536 - -11.4. Let q = 0.7 - 0.736. Let i = q - t. Which is the closest to -0.2? (a) i (b) 0.4 (c) 1 a Let s = -0.06 + 2.06. Let v = -2184.5 - -2184.5. Let g = -3 + 3.5. Which is the nearest to v? (a) 5 (b) s (c) g c Let p = 157.6 - 156.6. Which is the closest to 0? (a) -4/5 (b) p (c) 1.3 a Let v be 5/(-101)(-41)/205. Let b = 409/505 - v. What is the closest to 4 in 0, b, 5? 5 Let d be (-4)/14 - (-5 + 1 + 4). Let j be (-167)/7 + 7/(-49). Let m be (6/(-16))/(j/16). Which is the nearest to 2? (a) m (b) -3 (c) d a Let r(q) = -q*2 + 13q + 23. Let k be r(10). Let g = k + -51. Suppose 0 = gw - w + 3. Which is the nearest to 2/23? (a) -2/3 (b) w (c) 0.5 c Let f = 286/23 + -1601/138. Which is the closest to 0.01? (a) -4/3 (b) 0 (c) 0.5 (d) f b Let f = -346721 + 346726. Let t = 0.1 - 0.1. What is the closest to -1/5 in f, 1, t? t Let g be 2/(-6) + 2/12. Let a = -266263 + 266263.2. What is the closest to 1.45 in 1/4, a, g? 1/4 Suppose 86r = 62r - 120. Let c(f) = -54f - 265. Let a be c(r). What is the closest to 0.1 in 59, 1/2, a? 1/2 Let d = 41776 - 41775. Let i = 12/5 - 11/15. What is the closest to -2 in i, 4, d? d Let x = -5928 + 5963. Which is the nearest to -0.1? (a) 4 (b) 2 (c) -2/33 (d) x c Let h = 0.4 - -0.1. Let z = -204316 - -204317. Which is the nearest to z? (a) h (b) -2/5 (c) 1/10 (d) 2 a Let i = 1330 + -1329. Let v = -2 + 2.2. What is the nearest to v in i, -1.2, 3, 4? i Let x = -2 - -1.5. Let h = -678.54 - -679. Let r = 3.54 + h. Which is the nearest to -0.1? (a) r (b) x (c) -2/5 c Let v be (-2)/15 + (-2)/10. Suppose -546z = -414z - 264. Which is the nearest to 0? (a) v (b) z (c) 1 (d) 0.2 d Let q = 2048.9 - 2170. Let w = q - -121. What is the closest to 2 in 4, w, -0.5? 4 Let g = 2476 - 2422. What is the closest to -1 in 2, 3/2, g? 3/2 Let i be (-12)/35 - 113/(-565). Which is the nearest to -0.13? (a) i (b) 1/4 (c) 5 (d) -6 a Let y = 4 + -4.2. Suppose -69l = 2l - 101*l - 120. What is the nearest to y in l, -3, -1/3, 0? -1/3 Let z = 1 + -0.9. Let q = 32.349 + -36.349. Let m = -4.01 - -0.01. What is the nearest to q in m, z, 4? m Let a = 3670 + -3684. Let k = -4 + -12. Let o = a - k. What is the closest to 1 in 2/9, -0.3, o? 2/9 Let p = -143.7951 + -0.2149. Let j = 144 + p. Which is the nearest to 3? (a) -1 (b) j	{ "pile_set_name": "DM Mathematics" }
Suppose -t = t - a. What are the prime factors of t? 2 Let k(f) = -f*2 + 5f + 3. Suppose 0l - 5l = 0, 2z - l - 6 = 0. Suppose 4i = -20, -5y + 6i = zi - 40. What are the prime factors of k(y)? 3 Let g(a) = -a3 - 7a*2 - 8a - 8. Let x be g(-6). List the prime factors of x(-5)/(-6)3. 2, 5 Suppose 0 = u - 4u. Suppose 0o - 3o + 57 = u. List the prime factors of o. 19 Let y(x) = 4x*2 - 4x - 4. List the prime factors of y(8). 2, 5, 11 Let l be (-1)/5 - (-42)/10. Suppose -17 = 3s - lq, 6 = -2s + 5q - 10. What are the prime factors of (-6)/(-2 - (-3 - s))? 3 Suppose 6 = v - y - 2, -2y = 10. Suppose 0 = c + v. What are the prime factors of (0 + -1)/(c/6)? 2 Suppose 4c = z + 23 + 14, -2c - 4z + 32 = 0. What are the prime factors of c? 2, 5 What are the prime factors of ((-98)/8)/(17/(-16) + 1)? 2, 7 Let w be 2 - ((-4 - -1) + 20). What are the prime factors of (-200)/w(-24)/(-10)? 2 Let y(o) = 6o. Suppose 0c = -2c + 6. Suppose -5u + 29 = 2g - 0u, cg = -4u + 26. List the prime factors of y(g). 2, 3 Let j(m) be the second derivative of 7m*3/6 - 11m*2/2 + 9m. List the prime factors of j(8). 3, 5 Let z be (40 - 6/3) + 4. Suppose -4 + z = 2x. What are the prime factors of x? 19 Let q be (-19)/(-3)1-3. Suppose 2x = -j + 2, -5x + 9 = 3j + 3. Let v = j - q. What are the prime factors of v? 3, 7 Let n = -12 + 4. Let c(u) = -u - 8. Let d be c(n). Suppose d = 4o - 2o + 3p - 20, -3o + 60 = -3p. List the prime factors of o. 2 Let d(o) = -2o*2 + 4o + 4. Let z be d(4). Let k = -5 - z. List the prime factors of k. 7 Let i = 102 + -155. What are the prime factors of 18/(-30) - i/5? 2, 5 Suppose p + s + 0s = 1, 1 = 3p + 4s. Let a = p + 0. Suppose -am + 7 = 5o + m, -5m - 13 = -o. What are the prime factors of o? 3 Let c(x) = x*3 - 14x*2 + 16x + 5. List the prime factors of c(13). 2, 11 Let j = 55 + -77. Let b = 36 + j. List the prime factors of b. 2, 7 Let a be (4/5)/((-14)/(-105)). Suppose -9x = -ax - 39. What are the prime factors of x? 13 Let g = 1 + 8. Let l = g + -6. Suppose -li + i + 14 = 0. What are the prime factors of i? 7 Let o = -7 + 12. Suppose -13 = -2w + v, -4v = -ov + 1. List the prime factors of w. 7 Suppose 0 = -2a, 2a - a + 20 = -5d. Let z(m) = -m2 - 3m. Let f be z(d). What are the prime factors of 1/f + (-84)/(-16)? 5 Suppose 700 + 788 = 6t. What are the prime factors of t? 2, 31 Let b(t) = -t2 - 15t + 8. What are the prime factors of b(-15)? 2 Suppose 4l + 4 - 35 = 5u, 5u = 2l - 33. Let r = 7 - u. What are the prime factors of r? 2, 7 Let d(u) = u*2 + 7u + 3. Let f be d(-5). Let r be -1 + 3 + -1 + f. Let w = 14 + r. What are the prime factors of w? 2 Let k = 7 + -16. Let y(q) = q + 2. Let h be y(-7). Let p = h - k. List the prime factors of p. 2 Let h be 2 - (-6)/(6/(-2)). Suppose -r - r + 22 = h. Let a = -5 + r. What are the prime factors of a? 2, 3 Suppose 0 = 3m - 5s - 60, -s - 2s = 3m - 36. What are the prime factors of m? 3, 5 Let g be 1/((1/(-19))/1). Suppose 1 = -2j + 3j. List the prime factors of (j - 2)2 - g. 17 Let f = -9 - -9. Suppose f = 8k - 3k - 20. Suppose -52 = -ka - 3y - y, -3a - y + 31 = 0. What are the prime factors of a? 3 Let k be (-64)/((-2 - 1) + 2). Let o = 31 - k. What are the prime factors of (o/(-9))/((-2)/(-6))? 11 Let x = -325 + 458. What are the prime factors of x? 7, 19 Let g(c) = c + 13. Let m be g(-9). Suppose -ma = -2z + 24, 2z = -2z - a + 66. List the prime factors of z. 2 Suppose 3c = 2c + 4. Suppose -3l = -l + ch - 4, 5l - 45 = -3h. List the prime factors of l. 2, 3 Let n(j) = -j + 15. Let f be n(0). Let p = -3 + 8. Suppose pr + f = 55. What are the prime factors of r? 2 Let t = -7 - -10. Suppose -8w = -tw - 15. Suppose g = -4j + 24, -3g + 0j = wj - 36. What are the prime factors of g? 2 Let y(r) = 2r*2 - 8r - 7. Let x(v) = 3v2 - 9v - 8. Let g(n) = -3x(n) + 4y(n). List the prime factors of g(-3). 2 Let i be (-4)/(-14) + (-148)/28. Suppose 2p - 9 = -43. Let n = i - p. What are the prime factors of n? 2, 3 Suppose -3u = -h + 27 - 4, -h - 5u = -55. List the prime factors of h. 5, 7 Let j(p) = -p2 - 8p - 2. Let o be j(-8). Let f be (-2 - (0 + o)) + 2. Suppose 0 = -fg - 4u + 8, 0u - 7 = -3g - u. What are the prime factors of g? 2 Let d be (9/(-6))/((-2)/(-4)). Let j(o) = -o*3 - 3o*2 + 2o + 4. Let u be j(d). List the prime factors of (u - -14)(1 - 0). 2, 3 Let n(q) = -3q. Let x be n(-1). Suppose -h - 2y - 6 = -5h, -2y = xh - 22. What are the prime factors of h? 2 Let f be ((-6)/4)/(2/4). Let v be 3/(-9) + (-49)/f. Let q = -7 + v. List the prime factors of q. 3 Let g(z) = -z*2 - 8z + 7. Suppose -11 + 3 = -i - 2x, 0 = 4x + 4. Suppose t + i = 2r, 3r = t + 11 - 0. List the prime factors of g(t). 7 Let q be (0(-3)/(-6))/1. Suppose i = -qi + 16. List the prime factors of i. 2 Suppose 0 = 5x - 123 - 117. Let h = -25 + x. List the prime factors of h. 23 Let i = 46 + -33. What are the prime factors of i? 13 Let t be (1 - -1)15/(-6). Let r(f) = -f*3 - 4f*2 + 6f + 6. Let p be r(t). Let y = p + 9. List the prime factors of y. 2, 5 Let j = -19 + 43. Suppose 4f - 2n = -n + 20, -j = -f + 5n. List the prime factors of f. 2 Suppose -2o - 2 = -0. What are the prime factors of (-21)/(-6)(o + 3)? 7 Suppose 0 = g + 4g - 50. Let n(r) = -r*2 - 11r - 6. Let x be n(-8). Let y = x - g. List the prime factors of y. 2 Let z(l) = 8l2 - 27l - 9. Let p(d) = -3d2 + 9d + 3. Suppose g - 16 = -3g. Let j(w) = gz(w) + 11p(w). List the prime factors of j(-7). 11 Suppose 4y - 48 = 40. What are the prime factors of y? 2, 11 Suppose 0 = -4l - 12, -3t + 7 = 5l - 5. Let g be 3(2 + 39/t). Let y = g - 9. List the prime factors of y. 2, 5 Suppose 4y - 4j = 28, -2y + 3y - 5j + 1 = 0. What are the prime factors of (y/6)/((-2)/(-56))? 2, 3, 7 What are the prime factors of 48/1 - -1 - -2 - 0? 3, 17 Let v(m) = -m + 1. Let f be v(1). Suppose f = 2r - 27 - 1. What are the prime factors of r? 2, 7 Let r(i) = 2i2 + i. Let f be r(-1). Suppose 0 = -5o + z - 4z + f, 0 = 3o + 2z. What are the prime factors of o? 2 Let o = -7 - -10. Suppose on - 157 + 25 = 0. List the prime factors of n. 2, 11 Let x = -1 + 5. Let k be 10 - 2/(-6)-3. Suppose -k = -s + x. List the prime factors of s. 13 Suppose g - 31 = -4t, -t + 5g = -2 + 10. Suppose -4j + 3j + t = 0. What are the prime factors of j? 7 Suppose 3r + 4o = 2o + 556, 0 = -r + 2o + 180. What are the prime factors of r? 2, 23 Let f = 100 - 65. Let p be (-671)/(-44) - (-2)/(-8). Suppose f - p = 2o. List the prime factors of o. 2, 5 What are the prime factors of -33/(-9) + (-2 - -62)? 61 Let s(a) = 5a3 - a2 + 3a + 2. Let t be s(-2). List the prime factors of -6(-44)/t-2. 11 Suppose -2z = -4o - 66, 24 - 86 = -2z + 2o. What are the prime factors of z? 29 Let i(f) = -1. Let m(r) = 9r + 6. Let q(s) = 5i(s) + m(s). Let z be 4/6 - (-1)/3. What are the prime factors of q(z)? 2, 5 Let b = -53 + 95. Suppose 3w + 44 = w. Let k = b + w. List the prime factors of k. 2, 5 Let s(u) be the first derivative of u4/2 + u3/3 + 4. Let x(o) = -o*2 + 2o + 4. Let z be x(3). What are the prime factors of s(z)? 3 Let x(k) = -18k. Let d(r) = -r. Let m(y) = -8d(y) + x(y). What are the prime factors of m(-1)? 2, 5 Let q = 4 + -5. Let v be (-8)/(q + 0 - -2). Let i = 18 + v. List the prime factors of i. 2, 5 Let n be (-2 - -4) + (0 - 2). Suppose -5u = -5z - 0z - 60, 5u + 2z - 88 = n. What are the prime factors of u? 2 Let g be 4/2 + (2 - 2). Let q(n) = n3 - n2 - 2n + 2. Let m be q(g). Suppose -4w - 6 + 2 = -mt, 3t + 2w = 38. What are the prime factors of t? 2, 5 Suppose -5y = 4p - 669, 3y = 3p + 6y - 501. List the prime factors of p. 2, 83 Suppose 5b - 14 + 4 = 0. Let j be 21/15 - b/5. What are the prime factors of j/(-2) - (-50)/4? 2, 3 Suppose 0 = -3m + 2m + 3, -m + 15 = 4c. Suppose -2u + 5t = -64, -u = -ct + 1 - 32. List the prime factors of u. 37 Suppose -4w + 3a = -2, 3a + 2 = 2w + 2a. What are the prime factors of w? 2 Let j(o) = 13o - 3o + 6 - 2o + 7o2 + 0o3 - o3. List the prime factors of j(8). 2, 3 Let w(j) = j + 55. What are the prime factors of w(16)? 71 Let x be (-1 - -4) + 12/(-4). S	{ "pile_set_name": "DM Mathematics" }
67, 507151 List the prime factors of 247239125. 5, 7, 282559 List the prime factors of 641664483. 3, 213888161 List the prime factors of 3043601471. 491, 2333, 2657 List the prime factors of 2375676899. 41, 47, 227, 5431 List the prime factors of 934786826. 2, 467393413 List the prime factors of 8136807. 3, 7, 19, 20393 List the prime factors of 1329323323. 607, 2189989 What are the prime factors of 40047543? 3, 191, 23297 What are the prime factors of 6671557767? 3, 7, 23, 593, 23293 What are the prime factors of 310034863? 239, 1297217 What are the prime factors of 50421412? 2, 47, 268199 List the prime factors of 167968886. 2, 97, 865819 What are the prime factors of 13475728? 2, 7, 120319 What are the prime factors of 168483200? 2, 5, 37, 1423 List the prime factors of 48877866. 2, 3, 2715437 What are the prime factors of 1286888080? 2, 5, 1483, 10847 What are the prime factors of 2951930? 2, 5, 163, 1811 List the prime factors of 701924885. 5, 19, 7388683 List the prime factors of 5252066776. 2, 11, 3673, 16249 What are the prime factors of 4236219821? 3557, 1190953 What are the prime factors of 1433621019? 3, 137, 167, 20887 List the prime factors of 41275219. 167, 439, 563 List the prime factors of 474800636. 2, 251, 472909 List the prime factors of 1003333734. 2, 3, 13, 61, 5407 List the prime factors of 1696307641. 7, 179, 199, 6803 List the prime factors of 685288789. 19, 36067831 List the prime factors of 54842515. 5, 7, 13, 67, 257 List the prime factors of 12879248. 2, 29, 41, 677 What are the prime factors of 1921454625? 3, 5, 5123879 What are the prime factors of 3147120440? 2, 5, 71, 653, 1697 List the prime factors of 53927754. 2, 3, 8987959 List the prime factors of 266796298. 2, 133398149 What are the prime factors of 1938462123? 3, 13, 443, 112199 What are the prime factors of 681365822? 2, 340682911 What are the prime factors of 39483870? 2, 3, 5, 23, 57223 What are the prime factors of 2149211640? 2, 3, 5, 281, 63737 What are the prime factors of 256645907? 7, 36663701 What are the prime factors of 171112452? 2, 3, 7, 137, 14869 List the prime factors of 63358491. 3, 7, 23, 47, 2791 What are the prime factors of 12466325? 5, 498653 List the prime factors of 28387318. 2, 14193659 List the prime factors of 4686820485. 3, 5, 229, 1364431 What are the prime factors of 548142202? 2, 41, 2087, 3203 What are the prime factors of 3888134792? 2, 486016849 List the prime factors of 438228623. 7, 41, 1526929 What are the prime factors of 749676575? 5, 71, 422353 What are the prime factors of 154882287? 3, 7, 39023 List the prime factors of 80479270. 2, 5, 929, 8663 List the prime factors of 163925296. 2, 73, 293, 479 What are the prime factors of 3180856329? 3, 7, 19, 29, 43, 2131 List the prime factors of 61808793. 3, 457, 45083 What are the prime factors of 141667991? 141667991 List the prime factors of 1956626846. 2, 41, 581983 List the prime factors of 20412770. 2, 5, 7, 331, 881 List the prime factors of 714137341. 714137341 List the prime factors of 15381825. 3, 5, 23, 37, 241 What are the prime factors of 339230080? 2, 5, 7, 75721 What are the prime factors of 1227891738? 2, 3, 204648623 List the prime factors of 38558680. 2, 5, 71, 13577 List the prime factors of 190462932. 2, 3, 11, 480967 What are the prime factors of 314514589? 281, 1119269 List the prime factors of 225769555. 5, 11, 617, 6653 List the prime factors of 249574176. 2, 3, 37, 211 List the prime factors of 706384375. 5, 19, 11897 List the prime factors of 36301179. 3, 181, 66853 What are the prime factors of 460218366? 2, 3, 25567687 What are the prime factors of 128369612? 2, 7, 107, 6121 List the prime factors of 1778387219. 7, 9661, 26297 What are the prime factors of 809620158? 2, 3, 134936693 What are the prime factors of 27108483? 3, 1607, 5623 What are the prime factors of 38954397? 3, 331, 39229 List the prime factors of 98969176. 2, 19, 599, 1087 What are the prime factors of 162036300? 2, 3, 5, 540121 List the prime factors of 247345217. 7, 35335031 List the prime factors of 518357817. 3, 57595313 List the prime factors of 185152948. 2, 19, 71, 34313 List the prime factors of 1177581678. 2, 3, 7, 13, 283, 7621 List the prime factors of 8757198623. 8757198623 What are the prime factors of 4270564457? 37, 5581, 20681 What are the prime factors of 93802939? 337, 278347 What are the prime factors of 399671674? 2, 199835837 What are the prime factors of 263019804? 2, 3, 2377, 9221 What are the prime factors of 832709683? 13, 29, 2208779 List the prime factors of 247101528. 2, 3, 17, 605641 What are the prime factors of 444927862? 2, 222463931 List the prime factors of 83522528. 2, 1307, 1997 What are the prime factors of 147783861? 3, 1439, 11411 List the prime factors of 187698193. 23, 199, 1783 List the prime factors of 87943494. 2, 3, 14657249 What are the prime factors of 1098963430? 2, 5, 109896343 What are the prime factors of 212630622? 2, 3, 229, 154753 List the prime factors of 4769855. 5, 19, 23, 37, 59 List the prime factors of 42482145. 3, 5, 2832143 List the prime factors of 813958093. 13, 79, 792559 List the prime factors of 64380215. 5, 12876043 List the prime factors of 136895209. 11, 19, 655001 List the prime factors of 252635354. 2, 126317677 List the prime factors of 40794183. 3, 1697, 2671 What are the prime factors of 346425217? 31, 109, 102523 What are the prime factors of 114277375? 5, 914219 What are the prime factors of 2493439103? 19, 67, 1958711 What are the prime factors of 97706068? 2, 239, 102203 List the prime factors of 486221130. 2, 3, 5, 66697 List the prime factors of 2671641833. 7, 381663119 List the prime factors of 2251772636. 2, 562943159 What are the prime factors of 38622996? 2, 3, 487, 2203 List the prime factors of 601741937. 601741937 List the prime factors of 2649763919. 11, 240887629 What are the prime factors of 38334710? 2, 5, 727, 5273 What are the prime factors of 1309505714? 2, 11, 5087, 11701 What are the prime factors of 25040488? 2, 11, 284551 What are the prime factors of 526377126? 2, 3, 11, 23, 131, 2647 What are the prime factors of 896670569? 896670569 What are the prime factors of 529624342? 2, 13, 20370167 What are the prime factors of 527713388? 2, 17, 37, 209743 What are the prime factors of 126727050? 2, 3, 5, 844847 What are the prime factors of 23836453? 23836453 List the prime factors of 13927582. 2, 127, 54833 What are the prime factors of 45363057? 3, 809, 18691 What are the prime factors of 580131132? 2, 3, 7, 6906323 List the prime factors of 142525724. 2, 11, 31, 104491 List the prime factors of 792761675. 5, 1031, 30757 What are the prime factors of 461111494? 2, 19, 12134513 List the prime factors of 82755296. 2, 13, 331, 601 What are the prime factors of 23152223? 23152223 What are the prime factors of 278185921? 13, 21398917 What are the prime factors of 3916039804? 2, 59, 2113, 7853 What are the prime factors of 51457200? 2, 3, 5, 137, 313 List the prime factors of 2896314625. 5, 23170517 What are the prime factors of 959541121? 7, 11, 947, 13159 List the prime factors of 2294569579. 127, 18067477 List the prime factors of 883662565. 5, 1787, 98899 What are the prime factors of 1137727466? 2, 31, 18350443 What are the prime factors of 3830589291? 3, 151, 367, 23041 List the prime factors of 2561741774. 2, 5783, 221489 List the prime factors of 1418885764. 2, 2801, 126641 What are the prime factors of 4169033065? 5, 3733, 223361 List the prime factors of 1158383134. 2, 29, 1571, 12713 What are the prime factors of 394128628? 2, 19, 991, 5233 List the prime factors of 120047941. 13, 9234457 What are the prime factors of 712991821? 712991821 List the prime factors of 880913076. 2, 3, 2281, 32183 What are the prime factors of 489225665? 5, 167, 585899 List the prime factors of 7286041901. 4523, 1610887 List the prime factors of 901777356. 2, 3, 25049371 List the prime factors of 467867080. 2, 5, 11696677 What are the prime factors of 108038215? 5, 71, 271, 1123 What are the prime factors of 329148976? 2, 13, 1582447 List the prime factors of 7066336183. 37, 41, 4658099 List the prime factors of 44198194. 2, 2797, 7901 List the prime factors of 1656310433. 1656310433 What are t	{ "pile_set_name": "DM Mathematics" }
4du wrt b? -96bu - 18d2 - 78 Find the first derivative of 9981s4 - s2 + 1265 wrt s. 39924s3 - 2s Find the second derivative of -7bn*2 + 2bn - 2b - 5n4 - 1 wrt n. -14b - 60n2 What is the third derivative of 798u6 + u5 + 4u2 + 276u? 95760u3 + 60u*2 What is the third derivative of 305a*4h*2 - 2a*4h + 97a2h*2 + 7a*2 wrt a? 7320ah2 - 48ah What is the second derivative of -23v*3 - 2v*2 - 265v wrt v? -138v - 4 Find the second derivative of 240b*2 - 622b. 480 Find the second derivative of -921w2 + 282w wrt w. -1842 Find the third derivative of -fk6 + 230fk4 - 6fk2 + 39k*2 wrt k. -120fk3 + 5520fk Find the third derivative of -45f*3w - 5f3 + 5f*2 + 24fw wrt f. -270w - 30 What is the third derivative of -3j3nu + j3u - 28j2n + 2j2u + jn wrt j? -18nu + 6u What is the third derivative of 1322d4 + 16d*2 + 6d - 5 wrt d? 31728d Find the second derivative of -1117h*4 + 28h + 11 wrt h. -13404h2 What is the second derivative of -50q*4 + 4q*2 - 83q wrt q? -600q2 + 8 What is the first derivative of 1436ac + 98a - 6 wrt c? 1436a What is the second derivative of -wz*2 + 17wz + 130z*3 + z wrt z? -2w + 780z Find the second derivative of 1392m*5 - 2m*3 - 2m*2 + 3m + 180. 27840m3 - 12m - 4 Find the first derivative of -15a2 - 247a + 16976 wrt a. -30a - 247 Differentiate 3a*2j*3 - 37a*2j + 430j3 wrt a. 6aj3 - 74aj What is the second derivative of 36t*4u + 3t4 - 3t*2 + 589tu - 2 wrt t? 432t*2u + 36t2 - 6 Differentiate -134o*2p*2 - 647o*2 - 3op4 wrt p. -268o*2p - 12op*3 Find the second derivative of 32b*2o + 20b2 + b - 382o - 15 wrt b. 64o + 40 What is the first derivative of -1918g*2 + 1719 wrt g? -3836g What is the third derivative of -10c3t3 - c3t2 - 218c*3t + 2c2t*3 + 10t*3 wrt t? -60c*3 + 12c*2 + 60 What is the third derivative of dk*3p*2 + 2dk2p*2 + 2dp2 - 3dp - 363k*3p - 2k2 wrt k? 6dp2 - 2178p Find the first derivative of p*2qs + 9p*2q + 29p2s + 6pqs + 4pq + ps + 21p wrt q. p2s + 9p2 + 6ps + 4p What is the third derivative of 12x4 + 3x*3 + 95x*2 + x wrt x? 288x + 18 What is the derivative of -5918d3 - 1098 wrt d? -17754d*2 What is the second derivative of 7561p*3 + 338p - 3? 45366p What is the third derivative of 49w6 + w3 - 53w2 wrt w? 5880w*3 + 6 Differentiate 347b*2d*4 + 2b*2d*2 + 246b*2 with respect to d. 1388b*2d*3 + 4b*2d What is the derivative of -422v2 + 14v - 987 wrt v? -844v + 14 What is the third derivative of -a4 - 6609a*3 - 93a*2 - a - 21 wrt a? -24a - 39654 Find the third derivative of 3j4y2 + j4y + j3y3 + j2y + 4y*3 + 2y*2 wrt j. 72jy2 + 24jy + 6y*3 Find the first derivative of 2f*3z + f3 - f2yz - 200fy - 19z wrt z. 2f3 - f2y - 19 What is the first derivative of 250l - 98 wrt l? 250 Find the third derivative of v*6 - 754v*4 + 194v*2 - 1 wrt v. 120v*3 - 18096v What is the second derivative of -273q2 - 17q? -546 What is the derivative of -1710a2 - a + 7791 wrt a? -3420a - 1 Find the third derivative of 104l3t*3 - 6l*3t - l*2t*5 - lt + 18t2 wrt t. 624l*3 - 60l*2t*2 Differentiate -465b - 383 wrt b. -465 Differentiate 3610nt - 6t - 30 wrt n. 3610t What is the third derivative of 326a4 - a3h*3 - 80a*2h*3 - ah*3 wrt a? 7824a - 6h3 What is the derivative of 108v3 - v2 - 245 wrt v? 324v2 - 2v What is the third derivative of 2n5 - 4n3 - n2 - 18? 120n2 - 24 What is the third derivative of 10m*2t*4 - 4m*2t3 + m2t2 + mt*3 + 10mt2 - 3 wrt t? 240m*2t - 24m2 + 6m What is the derivative of -mv2y - mv2 + 54mvy + 3mv - 4my + 21v2 wrt y? -mv*2 + 54mv - 4m Find the first derivative of 15889n - 4536. 15889 Differentiate -48a*2i + 1194a2 + 10ai wrt i. -48a*2 + 10a What is the third derivative of -3m2r*3 - 2m*2r - mr3v + mv - 300r*3v + 702r2 + 3 wrt r? -18m*2 - 6mv - 1800v Find the second derivative of l*5 - 60l*4 - 2l - 91. 20l3 - 720l*2 What is the first derivative of 2m*2tz3 + 2m*2t - mt + 13mz - 3t + 4z3 wrt m? 4mtz*3 + 4mt - t + 13z Differentiate -25940x - 20652 with respect to x. -25940 Find the second derivative of -58k*4x - 3k2 + 30kx + 5 wrt k. -696k*2x - 6 Find the third derivative of -3c2v*6 + 5c*2v*3 - 3c*2v*2 + 29c*2 wrt v. -360c*2v*3 + 30c*2 Find the third derivative of -98z*3 - 57z*2. -588 What is the third derivative of -2058s4 + s2 - 559s + 3 wrt s? -49392s What is the third derivative of -34ak*6 + 2ak4 + ak*3 + 7ak - 2k*2 - 4 wrt k? -4080ak3 + 48ak + 6a Find the second derivative of 7l5 + 602l*4 - 17l + 252 wrt l. 140l3 + 7224l*2 Find the second derivative of 2283y5 + y2 - 57y + 1. 45660y*3 + 2 Find the first derivative of 5cd2z + 10cd*2 + c + 6d*3z - 23d3 + 3z wrt z. 5cd*2 + 6d*3 + 3 What is the third derivative of -970a*3r - 5a2r - 4r wrt a? -5820r Differentiate d*3 + 191d*2 - 475. 3d*2 + 382d Find the second derivative of -5c3y*2 + 2c*3y - 113cq*2y*2 - 842cq2y - 3cy wrt y. -10c3 - 226cq2 What is the derivative of 16cy3 - 2cy2 - c - 87y*3 + 300 wrt y? 48cy2 - 4cy - 261y*2 Find the first derivative of 3m*2nt2 - m2 - 20mnt*2 - nt*2 + 2n wrt m. 6mnt2 - 2m - 20nt*2 Differentiate bu*4 + 399b - 140u4 + 1 wrt u. 4bu3 - 560u*3 What is the derivative of -346v*2 - 736? -692v Find the second derivative of 2h4 - 20h*3 + 3h*2 - 5h + 406 wrt h. 24h2 - 120h + 6 What is the third derivative of 2d2i*5 + 3d*2i*2 + 7di + 1317i*5 + 2i*2 - 14 wrt i? 120d*2i*2 + 79020i*2 Find the second derivative of 662b*2 + 876b + 1 wrt b. 1324 What is the third derivative of 76g3w2 - g2w2 - 24g*2 wrt g? 456w2 Differentiate b2ny + 2b2wy2 - 6b*2y*2 - 14bnwy - 44nwy*2 - 6wy2 - 2w wrt n. b*2y - 14bwy - 44wy2 Find the third derivative of 15537d*3z2 - d2 + 2dz*2 - 217dz wrt d. 93222z*2 Find the second derivative of -47c*2f*2 - 16c*2p*2 + 2c*2 - 2cf3p*2 + 2cf3 - fp wrt p. -32c2 - 4cf3 Find the second derivative of 2653b*4 + 186b + 1 wrt b. 31836b2 Find the third derivative of 10k*4 + 5k*3z + 1036k2z - 2 wrt k. 240k + 30z Find the second derivative of 4412p5 + 3p + 165. 88240p3 Find the first derivative of -325x*3 + 214. -975x*2 Find the first derivative of -868m + 954 wrt m. -868 What is the derivative of -7m4 + 6m*2 - 82? -28m*3 + 12m Differentiate -179v2 - v - 94 wrt v. -358v - 1 Find the third derivative of 3b4n + 11b4 - 12b*3n - b3 + b2n + 4bn + 198n + 2 wrt b. 72bn + 264b - 72n - 6 Find the third derivative of 19h3lw - 12h*3l - 10h2w + lw - l + 3w wrt h. 114lw - 72l What is the third derivative of -324k4 - k3z3 + 186k2 - z3 wrt k? -7776k - 6z*3 Differentiate -16b*2 - 15b + 85 with respect to b. -32b - 15 Find the first derivative of 20k*4q*3 - 2k*2q + 33kq*3 + 4q*3 + 62q wrt k. 80k3q*3 - 4kq + 33q*3 Find the first derivative of 96y*4 - 2y*2 + 124 wrt y. 384y*3 - 4y Find the third derivative of 6796r6 + 2r*2 - 60r - 4 wrt r. 815520r3 What is the third derivative of -2925c*6 - 2c*4y*3 - 87c*2y + 12cy*3 wrt c? -351000c*3 - 48cy3 What is the third derivative of 5f*6 + 4f*5 + 110f*3 + 3f*2 - 473f wrt f? 600f3 + 240f*2 + 660 What is the third derivative of -35k*5 + 6k*3 + 58k*2 + 2k? -2100k2 + 36 What is the third derivative of 268f*3ns3 - 2f*3ns + f3n + 4f2ns2 - 15f*2n + 2f2s*3 wrt f? 1608ns3 - 12ns + 6n Differentiate 2rz*3 + 10rz2 + 70z*3 + 2z*2 wrt r. 2z*3 + 10z*2 What is the second derivative of 13m*2n2 + m2u - 2mn + 2m*u + 54	{ "pile_set_name": "DM Mathematics" }
e third smallest value in a, -2/9, 0.03? a Let x = 49.1 + -49. Let k = 0.26 - 0.3. Let r = 0.34 + k. Which is the third biggest value? (a) x (b) 1/11 (c) r b Suppose -3j - u = 109, j + 27 = -52u + 54u. Which is the biggest value? (a) 5 (b) 3/5 (c) j a Suppose 5p - 15 = 12f - 11f, -4f + 40 = 5p. Which is the fourth biggest value? (a) f (b) 2 (c) -3 (d) -1 c Let h be (-50)/60(-6)/(-20). What is the third smallest value in -211, -0.4, h? h Let y = 1.8 + 0.2. Let i = y - 1.8. Suppose 0k = -4k. Which is the smallest value? (a) 2/13 (b) k (c) i b Let t = -190.4 - -189.1. Which is the third biggest value? (a) -7 (b) -3 (c) t a Let a = -1058 + 1055. Suppose -5w + 2m = 18, 3m + 2 = -1. What is the fourth biggest value in w, -5, a, 0.06? -5 Suppose 0 = -5y + 5 + 10. Let o be (y3/54)/(12/(-27)). Which is the third smallest value? (a) o (b) -4 (c) -0.4 a Suppose -9 + 8 = -5d - v, -4d = -3v + 3. Which is the smallest value? (a) d (b) -0.2 (c) -0.08 b Let u = 70.2 - 70. Which is the smallest value? (a) 3/2 (b) 38 (c) u c Let k = -0.063 + -0.037. Which is the smallest value? (a) 23 (b) 1 (c) k c Let k = 3744 - 3744.3. Let i be ((-2)/(-20))/((-7)/(-2)). What is the biggest value in -4, k, i? i Let l = 43 + -24. Let u = l - 16. Suppose d - 3d = 5j - 24, -ud = -4j + 10. What is the biggest value in 1, j, 2? j Let m = -77.1 + 80.1. Which is the second smallest value? (a) -1.61 (b) m (c) -3 a Suppose 8u + 76 = 36. Let t = 3.6 - -0.4. Which is the biggest value? (a) u (b) -2/11 (c) t (d) -2/5 c Let m = 163.4 - 159.4. What is the third biggest value in 2/7, -1/4, m, 7? 2/7 Let q = 29 - -14. Let l = -41 + q. Let v = -2/3 - -4/3. What is the third biggest value in v, l, -2? -2 Suppose 3x = 7z - 3z + 37, -z = -3x + 43. Let y be (-116)/20 + 12/x. Let n = -0.2 + 0.7. What is the third smallest value in n, y, 1/8? n Let u = 277 - 1105/4. What is the fourth smallest value in -0.2, 4/5, u, 1/10? 4/5 Let m = -713 + 712.7. What is the third smallest value in 12, -2/5, m? 12 Let i = -5.13 - -0.13. Let r be 14/36(-84)/4. Let n = 22/3 + r. What is the smallest value in n, i, 2? i Let d = -13 + 12.6. What is the second biggest value in 3, -45, d? d Let y(w) be the first derivative of w3/3 - 3w*2 + 6w + 13. Let t be y(3). What is the second smallest value in -0.5, -2/7, -0.2, t? -0.5 Let k = 17 + -25. Let f = -5 - k. Let x be 2 - (f + (2 - 3)). What is the biggest value in x, 1, -0.1? 1 Let l = 2 - 1.9. Suppose -53 - 171 = 14d. Let q be 39/(-9)(-12)/d + 3. Which is the smallest value? (a) l (b) 0 (c) q c Let r = 19.82 + -20. Let s = 0.08 + r. Let l = s - 3.9. What is the smallest value in -2/3, 1, l? l Suppose 0 = 3l - z + 1, -5l = -10l - 2z + 13. Let o = 1745 + -1756. What is the third biggest value in l, o, -3, 0.1? -3 Let x be (22/(-297))/(1/(-12)). Which is the smallest value? (a) 5 (b) x (c) 0.07 c Let v(t) = 3t + 17. Let i be v(-4). Suppose ip - 33 = -48. What is the fourth biggest value in p, -5, -1/2, -0.8? -5 Let c = 722 - 724. What is the second biggest value in 3/5, -4/7, c? -4/7 Let m be (4/(-6))/(1/12). Let l be 15/m + 3/(-24). What is the second smallest value in -5, l, -4? -4 Let m be (0 + 50/(-3))-9. Let n be 9/(-12) - 3765/20. Let a be m/n + (-4)/(-18). What is the second smallest value in 1/11, a, 2? 1/11 Let a = 284 - 366.2. Let n = a + 82. Let u = 201/5 + -40. What is the second smallest value in 0, u, n? 0 Let j be (12/3 - 3)3. Suppose 3t = -jt - 12. What is the third biggest value in -5, -0.2, t? -5 Let s = -331/603 - -7/67. Let r(o) be the first derivative of 2o3/3 - 7o*2/2 - 3o - 1. Let l be r(4). What is the biggest value in l, -0.3, s? l Let s = 3083/6 - 513. What is the smallest value in s, 20, -1/4? -1/4 Let k = -114 + 346. Which is the third biggest value? (a) 4 (b) k (c) -0.5 c Suppose 0 = v + 7 - 13. Let z be ((-9)/54)/((-8)/v). Let i be (-6)/(-8) - 9/28. Which is the second biggest value? (a) z (b) 0 (c) i a Let m = 8.42 - 4.44. Let q = 0.02 + m. Let b = 22 + -23. What is the smallest value in 0, q, b? b Let k = -1238/15 - -247/3. Let u = -19 - -18.6. Which is the third smallest value? (a) u (b) k (c) -20 b Let y = -303.66 - -301. Let f = -2.46 + y. Let r = 0.12 + f. Which is the second smallest value? (a) 1 (b) r (c) 2 a Let p = 10.94 + 0.06. Let w = 11 + 1. Let b = w - p. What is the smallest value in b, 5, -1/2? -1/2 Let m = 105.1 + -32.9. Let b = m - 73. What is the biggest value in b, 1, 0.4, -4? 1 Let s = -71 + 70. Which is the fourth biggest value? (a) s (b) -0.2 (c) 0.29 (d) -5 d Let p = 6.1 - 7.5. What is the second biggest value in 3/4, 1, p, 0.2? 3/4 Let r = 28 - 26. Let k be (-1 - 0)/(1 - r). Let d = -16 + 14. Which is the second biggest value? (a) k (b) -0.3 (c) d b Suppose 5j - q = 6, 5j - 12j = 3q - 26. Let v(x) = -x*2 + 3x - 1. Let o be v(2). Which is the second smallest value? (a) j (b) o (c) 5 (d) -2/5 b Let v be 32/4 - (1 - -2). Suppose 0 = -19q + 33q + 42. What is the third smallest value in 0.1, q, v? v Suppose 3w - 14 = -2. Let g = -3500.98 - -3501. Which is the fourth smallest value? (a) g (b) 2/9 (c) w (d) 5 d Let o = -1.64 + 0.04. Let d = o - -1.2. Let v = 6 - 6.1. Which is the third smallest value? (a) d (b) 2 (c) v b Let c be (4/(-3))/((-30)/9). Let h = 2.77 - -0.03. Let f = 2.8 - h. What is the second biggest value in c, f, 2? c Let o = 0.27 + 16.73. Let l = 17 - 30. Let m = l + 10. What is the third smallest value in o, -0.5, m? o Let p = 0.0615 - -2.9385. Which is the third smallest value? (a) -1/6 (b) -1 (c) p c Let n = 22.16 - 21.66. Which is the smallest value? (a) -1/18 (b) n (c) 5 a Let r = 29.2 + -29. What is the third biggest value in 0.5, -1/2, r? -1/2 Let s be -2 - (2445/(-410))/3. Let k = s - -85/246. What is the smallest value in -2/19, k, 12/5? -2/19 Let z = -1.4 + 2. Let h = 5062 + -5063. What is the fourth biggest value in -0.3, h, z, 1? h Let z = 2 + -5.7. Let t = z - 0.3. Which is the second smallest value? (a) t (b) -2 (c) -0.04 b Let o = -21 + 18. Let t = -3 - o. What is the biggest value in -1/4, t, 5? 5 Let w = 3.5 + -3.23. Let r = w + 0.03. Suppose -6n + 69 = 45. Which is the biggest value? (a) r (b) 1/3 (c) n c Let n = 119 + -224. Which is the smallest value? (a) n (b) -2/13 (c) -2/15 a Let q = -23.3 - -24.3. Which is the third biggest value? (a) q (b) -17 (c) 0.2 b Let y = 24.5 + -22.5. Which is the biggest value? (a) 0.3 (b) 3 (c) 5 (d) y c Let o = 0.1 - 2.1. Let l = 157 - 1417/9. What is the smallest value in o, -0.1, l? o Let l = -85 - -85.92. Let q = l - 0.52. What is the smallest value in q, 2, -5? -5 Let j be (-2)/6 + (-31)/(-3). Let r be ((-4)/(-5 + 25))/(1/(-2)). Let k = 2063/9 + -229. What is the second biggest value in r, j, k? r Let w = 14 - 11. Let g be (w/63)/6. Let x = 2.7 - 3. Which is the third smallest value? (a) x (b) g (c) 0.4 c Let z(u) = 2u*2 + 4u + 3. Let t be z(-2). Let p be t + -3(1 + 0). Suppose 0g + 2g = 12. What is the second biggest value in 0.5, p, g? 0.5 Let f = 95 - 92. Let q = f + 13. Which is the third smallest value? (a) -2/7 (b) 0.5 (c) q (d) 2 d Let c = -198.89 + 199. What is the third biggest value in c, 0.1, -3/4? -3/4 Let r = 83 - 82.8. Suppose 4x + 6 = 2v, -5 + 2 = 3x. What is the third biggest value in v, 5, r, -2/9? r Let r = -16.5 + 16. Let h = -19.21 - -19. Let g = h + -0.09. What is the biggest value in 1/14, g, r? 1/14 Suppose -15n = -10n + 5. Let r be 8/(-168)6/n. Let o be -4((-15)/(-24))/(-5). Which is the smallest value? (a) o (b) 0.01 (c) r b Let i = 5.42 - 9.42. Which is the second biggest value? (a) 2 (b) 4 (c) 9.4 (d) i b Suppose 0 = 8q - 3q + 25. Let o = 18 + -20. What is the second biggest value in q, 0.5, o? o Let j = 178 + -177.7. Which is the smallest value? (a) 1.1 (b) 0.4 (c) 2/11 (d) j c Let x = -13.8 - -10.8. What is the second biggest value in x, -0.2, 0.002, 2? 0.002 Let j = -117 - -117.08. What is the third biggest value in j, 4, -0.4? -0.4 Let x be (-7)/5(5 + 504/(-98)). Let h = -145/548 - -2/137. Which is the biggest value? (a) 1/4 (b) h (c) x a Let d = -6220 + 82197/13. Let p = d - 103. Suppose 6 - 18 = -4y. Which is the biggest value	{ "pile_set_name": "DM Mathematics" }
= -70 - -38. What are the prime factors of (-177)/(-2)x/(-24)? 2, 59 List the prime factors of (4 + 17493/14)2. 23, 109 Suppose i + 4t = 706, 130i - t = 128i + 1457. What are the prime factors of i? 2, 3, 11 Let l be (-1)/3 - 3/(-9). Let z(c) = 2c2 - c2 + 14 + 3c2 - 3c*2 - c. List the prime factors of z(l). 2, 7 Suppose -3o = 3p - 1374, -4o + 0p + 1844 = p. List the prime factors of o. 2, 3, 7, 11 Let g = -5852 + 9857. What are the prime factors of g? 3, 5, 89 Suppose -g = 2a - 4332, 2a + 10830 = 7a + 3g. List the prime factors of a. 2, 3, 19 Suppose -j - 1 - 2 = 0. Let t(h) be the third derivative of -h6/120 - h4/6 - 2h*3/3 + 16h2 + 4. List the prime factors of t(j). 5, 7 Let v(w) = -w2 - 2w + 7. Let z be v(5). Let d be (-8)/52 + z/(-13). Suppose -10 = -dn - 2l, -n + 23 = 2n + l. What are the prime factors of n? 3 What are the prime factors of (-2 - 1) + 1143 + (10 - 9)? 7, 163 Let c = -4 - 4. List the prime factors of (c/20)/(3/(-675)). 2, 3, 5 Suppose 13t - 11t = -4h + 4286, -4t = -2h + 2158. List the prime factors of h. 29, 37 Suppose -2j + 45 = 9. Let v = 20 - j. Suppose -3n + 3u + v = -25, 0 = -5n - 5u + 25. What are the prime factors of n? 7 Suppose 0j - 5t + 160 = -2j, j + 94 = -t. List the prime factors of (-1)/((-4 - -7)/j). 2, 3, 5 Suppose 3j - 9 = 0, 2j = 5a - 0j - 9. Suppose 225 + 451 = 13p. Suppose ao - o = p. What are the prime factors of o? 2, 13 Suppose -5w - 49 = -3u - 0, 2u + w = 11. Let x(t) = 4t + 10. List the prime factors of x(u). 2, 3, 7 Suppose -2a + 86 = -3n, -2n + 4n - a = -56. Let q = -41 - n. What are the prime factors of (73/3)/((-5)/q)? 73 What are the prime factors of 1487 + (-3)/(-6)-6? 2, 11 Let n = 277 - -2680. What are the prime factors of n? 2957 Suppose 3h - 16 + 88 = 0. Let x be (1 - h)2/2. Suppose 2d - x = 23. List the prime factors of d. 2, 3 Suppose -m - 2j = -43, -38 = -4m - 2j + 164. Suppose 0g = -g + 203. Suppose -3p = -g + m. What are the prime factors of p? 2, 5 Let f(c) = 44c*2 + 27c + 35. What are the prime factors of f(-10)? 5, 7, 17 Suppose -4d = -10d. Suppose d = -2j + 5q - 15 - 2, -q + 25 = 5j. Suppose x - 74 = -4f, jx - 212 = -0x + 5f. List the prime factors of x. 2, 29 Suppose -2c - 3i - 201 = 3c, -3c + 3i = 135. Suppose 3d - 5x = 41, 4x + 33 = 5d - 31. Let y = d - c. What are the prime factors of y? 2, 3 Suppose 0 = 2t + 5t - 21. Let v(b) = 2b2 + 8b + 5. Let w be v(-5). Let c = w - t. List the prime factors of c. 2, 3 Suppose -1034 = 59u - 61u. What are the prime factors of u? 11, 47 Let c = 77 - 56. Suppose -cl + 3l + 3276 = 0. What are the prime factors of l? 2, 7, 13 Let t(d) = 120d - 2. Let u be t(1). Let x be (-1 + -5)u/(-12). Suppose -3 - x = -2o. What are the prime factors of o? 31 Suppose -2c - h = -116, -3c - 4h - 35 + 199 = 0. Let j be 10/c + 1150/12. Suppose 5l = j + 54. What are the prime factors of l? 2, 3, 5 Let j(m) = -m3 - m2 + 9m - 3. Let s be j(-4). Let u = s - -1. What are the prime factors of u? 2, 5 Let j be -2(-64)/(-6)3. Let m = -34 - j. What are the prime factors of m? 2, 3, 5 List the prime factors of 6 + (-8 - -877) + -9. 2, 433 Let q be 4/14 - 720/168. Let n be (q - 0) + 14 - 2. What are the prime factors of (8/n)/((-2)/(-34))? 17 Let a be ((-1)/1 - -3)4. Let y(u) = 1. Let w(c) = -8c + 14. Let l(o) = -w(o) + 3y(o). What are the prime factors of l(a)? 53 Let l = 2020 + -1377. List the prime factors of l. 643 Let i = -3 - -5. Suppose im + 78 = 2z, 4m + 58 + 63 = 3z. What are the prime factors of z? 5, 7 Let p be ((-1)/2)/((-1)/4). Suppose 9 = v + pv. Suppose -2q - 5a = -23, 2a + va + 73 = 2q. List the prime factors of q. 2, 3 Let t(b) = 45 - 2b - 2b - 37. Let v be t(9). What are the prime factors of ((-30)/(-24))/((-1)/v)? 5, 7 Suppose 3o + 31 = p - 27, p - 54 = 2o. Suppose 0 = g - 4j - 23, -3g + 8g + 3j = p. List the prime factors of g. 11 Suppose 0b = -4h - 4b, -4b = -h. Suppose -4x + 242 = -hx + 2q, 184 = 3x + 4q. List the prime factors of x. 2, 3, 5 Let k be 0/(-2) + 2394/14. Suppose 7w = k + 81. What are the prime factors of w? 2, 3 Suppose -3r + 5r = -3m + 328, 0 = 3r - 2m - 505. Suppose 3s - r = 2s. List the prime factors of s. 167 Suppose 5o - 5b = 2o + 769, -4o + 987 = b. List the prime factors of o. 2, 31 Suppose -4r = -99a + 97a - 5886, 3a - 4428 = -3r. What are the prime factors of r? 3, 491 Let p(b) = 112b - 35. List the prime factors of p(22). 7, 347 Let b(w) = w*3 - 4w*2 + 3w. Let g be b(3). Let d(u) be the first derivative of -u*2 + 12u - 62. List the prime factors of d(g). 2, 3 Let v(l) be the second derivative of -l5/20 + l4/3 + 8l3/3 - 13l. What are the prime factors of v(6)? 2, 3 Let c = 1 + 0. Let h be 2/1 + (-11)/132-12. List the prime factors of c/h-3-30. 2, 3, 5 Let p(g) = -9g + 32. Let j be p(8). Let o = j + 52. List the prime factors of o. 2, 3 What are the prime factors of (248/651)/(4/14)555? 2, 5, 37 Let m = -115 - 31. Let d = -62 - m. Suppose -2h - 2h = -d. What are the prime factors of h? 3, 7 Suppose -18i + 450 = -17i. Let x be 6/(-24) - i/(-8). Suppose -a = a - x. What are the prime factors of a? 2, 7 Let r be (26/(-39))/(2/(-75)). Suppose 6z - r = z. Suppose o - 22 = -zf, -o + 0f - f + 22 = 0. List the prime factors of o. 2, 11 Let g be 2/(-11) + -92(-4)/88. Suppose 11d - 1267 = gd. List the prime factors of d. 181 Let b = 25 - 22. Suppose 2w + bc + 4 = 7c, w - 26 = -5c. Suppose -2p = k - 112, 5p + wk - 282 = 3k. What are the prime factors of p? 2, 3 What are the prime factors of (280/49)/(10/875)? 2, 5 Let y = -32 - -16. Let d be 12(y/(-12))/(-4). Let n(i) = -i*3 - 3i*2 + 6. What are the prime factors of n(d)? 2, 11 Suppose -3p = -8 - 7. Suppose -6m + 45 = pz - 2m, 5 = m. Suppose -3f + zf = 70. List the prime factors of f. 5, 7 Let i(w) = w3 + 6w*2 - 24w + 2. What are the prime factors of i(9)? 7, 11, 13 Suppose 0 = -3f - 0x + 2x + 38, -2f + 52 = 4x. Suppose 3c - 5c = -f. Let m = c + -3. What are the prime factors of m? 5 Let x(g) = 120g - 686. What are the prime factors of x(20)? 2, 857 Let d = -96 + 100. Suppose -2c = -dj + 912, 2c + 13 = -2j + 463. List the prime factors of j. 227 Suppose 2v - 44 = 6v. Let z = -1 - v. Suppose 80 = 3h - z. What are the prime factors of h? 2, 3, 5 Suppose -5w + 8w + 318 = 0. What are the prime factors of (w/(-6))/(6/18)? 53 Let s = 0 - -2. Suppose -2i + 6 = -s. Suppose 5r + b = ib + 135, 2r = -2b + 38. What are the prime factors of r? 2, 3 Let d(z) = -z*3 - 2z*2 + 4z + 3. Let r be d(-3). Let f be 12/(-3) + (5 - -2). Suppose 0 = -fs - rs + 42. What are the prime factors of s? 2, 7 Suppose 3t - 2p - 7 + 1 = 0, 3p = 0. Suppose 6 = -th, 5c + 4h - 372 = 3h. List the prime factors of c. 3, 5 Suppose -5v = -4b + 4, -2v - 3v + 2b = 2. Let c be (40/(-24) - -1)/(2/(-57)). Suppose -3x - 5s + c = v, 2x - 2s - 33 = 1. List the prime factors of x. 13 Let b be (140/42)/((-2)/6). Let y be 2/b + (-1053)/(-65). Suppose -13q - 192 = -yq. List the prime factors of q. 2 Let h(g) = -2g2 - 11g - 5. Suppose -4u - 31 = 3v, 4v + 4 = 3v + 5u. Let j be h(v). Let o = j - -118. List the prime factors of o. 2, 5 Suppose -39077 = -16j - 11893. List the prime factors of j. 1699 Suppose 4z + 778 = 2d - 0d, 5d - 1945 = -z. What are the prime factors of d? 389 Let o(w) be the third derivative of 2w3 - w2 + 0 + 1/24w*4 + 1/120w*6 + 0w + 0w5. List the prime factors of o(0). 2, 3 Suppose -4k + 2k - 2 = 0. Let l = 3 - k. Suppose 0 = -2i - 7o + 2o + 14, 4i - lo - 56 = 0. List the prime factors of i. 2, 3 Let w = -3284 + 6783. What are the prime factors of w? 3499 Let a(i) = 5i + 9. Let n(t) = t2 - 7t + 4. Let s be n(6). Let q be a(s). Let h = 24 + q. What are the prime factors of h? 23 Suppose 0 = 8f - 10f + 72. Let s = 76 - f. List the prime factors of s. 2, 5 Let y(h) = -112h - 609. What are the prime factors of y(-41)? 7, 569 Let o = -167 + 664. List the prime factors of o. 7, 71 Let g = -1152 - -2345. List the prime factors of g. 1193 Let a(w) be the first derivative of -w3/3 - 13w*2/2 - 6w - 10. Suppose -3y + h = -8y	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.