Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-1000 Let y = -49 - -40.5. Let b = -9 - y. Let p = b - -0.549. Round p to 2 decimal places. 0.05 Let s = 3078 - 3093.898. Let j = s - -16. Let n = j - 0.10200061. Round n to 6 dps. -0.000001 Let z = -170 + 170.0605. Let b = 5725 + -5725.05579. Let u = z + b. What is u rounded to 3 dps? 0.005 Let j be -9178(-8)/16-1. Round j to the nearest 1000. -5000 Let n(r) = -2r2 + 17r - 43. Suppose 6h - 9h + 45 = 4q, 2h + 5q - 30 = 0. Let o be n(h). Round o to the nearest 10. -240 Let b = -337627 + 1098027. What is b rounded to the nearest ten thousand? 760000 Let c = -97468 + 97468.0041769. What is c rounded to 4 dps? 0.0042 Let m = -647 + 1070. Suppose 2n = -4z - 300, 0 = 3n + z - 4z + m. Let o be (-1)/6 - 24/n. Round o to 2 decimal places. 0 Let h = -12187239 - -2470391. Let n = h - -9716858.900146. Let r = n - 10.9. What is r rounded to five decimal places? 0.00015 Let m = 2.216605 + -2.222. What is m rounded to three dps? -0.005 Suppose 4d + 6022406 = 3i, -5d + i - 608813 = 6919189. Round d to the nearest one hundred thousand. -1500000 Let o = -101819.2116 - -101622.4. Let u = o - -197. What is u rounded to two dps? 0.19 Let n be 0 + 1 + (-12 - -3). Let p(m) be the first derivative of -2m3 - 15m*2/2 - 13m + 250. Let g be p(n). What is g rounded to the nearest 10? -280 Let w = 2.0956 + -2.09561893. What is w rounded to 7 dps? -0.0000189 Let f = -266.7956 - 5.6379. Let l = 271.8 + f. What is l rounded to one decimal place? -0.6 Let g = -85 + 99. Let h = g + 74. Let m = h + -88.0285. Round m to 2 decimal places. -0.03 Let d = 0 + -0.062. Let t = d - 0.208. Let c = 0.270031 + t. Round c to five decimal places. 0.00003 Let x = 1.097587 + 192.913813. Let a = -194 + x. Round a to three dps. 0.011 Suppose 3d - 5w - 51 = -2w, -3d + 49 = -2w. Let b = 15 - d. Suppose bf - 12 = -f. What is f rounded to the nearest 10? 10 Let y = -345 + 422. Let s = -77.00017 + y. Round s to four decimal places. -0.0002 Let l = 47.6 + -28.38. Let u = -0.1099 - -19.1099. Let n = l - u. Round n to 1 dp. 0.2 Suppose 4b - 3 = 4q - 7, -5q + 3b + 7 = 0. Suppose -qa + 23558 = -2s - 2368, -5a = s - 64797. What is a rounded to the nearest 100? 13000 Let p = 8323.834 + -8328. Round p to the nearest integer. -4 Let v = -10.327 - -10.1. Let l = v + 0.2270259. Round l to 6 decimal places. 0.000026 Let g = 12 + -8. Let l(q) = 5q + 37. Let d be l(-7). Suppose -s = ds + 9, gk + s + 2403 = 0. Round k to the nearest 1000. -1000 Let n = 605673306 - 605672883.001521. Let i = n - 423. What is i rounded to four decimal places? -0.0015 Suppose g - 191 = 5t + 13, -g = -3t - 194. Suppose -2d + 15 = 3d. Suppose 0 = 3z + dk + 561, g = -z - 0z - 5k. What is z rounded to the nearest ten? -190 Let i = -3270 + 16226. Suppose -n = 3h + 9713, -4n = h + 3h + i. Round h to the nearest 100. -3200 Let u = 788281 - 788149.1883. Let r = 0.2883 + u. Let w = r - 117. Round w to the nearest integer. 15 Suppose -5r = l + 681535, 132r - 136r = l + 681538. Round l to the nearest one thousand. -682000 Let q = 6143.47533 - 0.77533. What is q rounded to the nearest 1000? 6000 Let y = 10547588 + -6479888. Round y to the nearest 10000. 4070000 Suppose -5v - 2u + 4u + 22 = 0, 5v = -u + 34. Suppose -4l + 10 = v. Let k = l - 12. What is k rounded to 0 decimal places? -11 Let v = 605.4 - 607.2873. Round v to 1 decimal place. -1.9 Let g = -932 + 932.418. Let k = 66.918 - g. What is k rounded to the nearest integer? 67 Let a be 1 - ((0 - 0) + 6). Let h be (-66)/15 - (-3)/a. Let p be h + 167 - (-2)/(-1). What is p rounded to the nearest one hundred? 200 Let u = 127 - 69. Let b = 101 - u. Let d = b + -43.66. What is d rounded to 1 decimal place? -0.7 Let k = -25.058 - -0.058. Let d = -29.5 - k. Let m = -4.50014 - d. Round m to 5 dps. -0.00014 Let a = 34 - -328. Let m = -361.99794 + a. What is m rounded to four dps? 0.0021 Suppose 4g + 464294 = 5d + 19494802, 0 = -d + 4g - 3806108. Round d to the nearest one hundred thousand. -3800000 Let u be 6/(-9) + -606773/(-9). Suppose 0l - l - 2s = -4032, -3s = -5l + u. Let h = l - 2042. What is h rounded to the nearest one thousand? 2000 Let v = -14 - -78. Let q(s) = -s + 11. Let u be q(-5). Suppose -vc + u = -60c. What is c rounded to the nearest one hundred? 0 Let g = 358.92 + -358.92007955. What is g rounded to 6 decimal places? -0.00008 Suppose 5o + 3v = 501508, 4v = -4o - 44041 + 445249. Round o to the nearest ten thousand. 100000 Let o(g) = 57794g*2 + 11g - 89. Let u be o(6). Suppose -5c - 4w - 32650012 = 0, -u = 4c - 3w + 24039430. What is c rounded to the nearest one million? -7000000 Let p = -2.201 + 2.11. Let j = -45 - -44.969. Let t = j - p. What is t rounded to two dps? 0.06 Let d = -1.078 - -2.451. Let y = d + -0.013. What is y rounded to 1 decimal place? 1.4 Let b = 982.998656493 - 299.998656058. Let h = 683 - b. Round h to 7 dps. -0.0000004 Let o = -313.451 - 2.539. Round o to the nearest integer. -316 Let u = -1051.64 - -1076. Let h = u + 0.64. Let x = h - 24.977. What is x rounded to 2 dps? 0.02 Let k = 731 - 734.57. Let y = k - -3.57805. Round y to three decimal places. 0.008 Let a(z) = 4381z2 + 6z - 29. Let g be a(-8). Let o = -147330 + g. Suppose 21777 = 8x + o. What is x rounded to the nearest one thousand? -14000 Let w(t) = -101688t - 48. Let s be 17/5 + (48/(-20) - -3). Let d be w(s). What is d rounded to the nearest 100000? -400000 Let u(j) = -706782j - 820. Let a be u(-10). What is a rounded to the nearest one hundred thousand? 7100000 Let p(g) = -5g*3 + 21g*2 - 20g + 16. Let f = 100 + -98. Suppose -fl = d + 34, -2l + 6 = 8. Let m be p(d). Round m to the nearest one hundred thousand. 200000 Let c(a) = 224696a3 - 6a + 7. Let u be c(1). Suppose -3d + u = 3l, 0 = 6l - l - 5d - 374505. Round l to the nearest 10000. 70000 Let i = -0.7144 + 239.5944. What is i rounded to zero decimal places? 239 Let u = 4537.08 - 360.91. Let w = 4158 - u. Let d = w + 18. What is d rounded to two dps? -0.17 Let j = 3.95 - 0.33. Let a = -911 - -910. Let d = a + j. What is d rounded to zero decimal places? 3 Let o(c) = 593c - 1095. Let k be o(9). Round k to the nearest 1000. 4000 Let p = 1020788 - 721015. Let j = p - 299773.0979912. Let o = 0.098 + j. What is o rounded to 6 dps? 0.000009 Let u = 15117.032518 - 15117. Round u to 4 dps. 0.0325 Let r = 3478.009 + -3476. Let k = r + 0.091. Let w = -0.17 - k. What is w rounded to one decimal place? -2.3 Let s = 2193732929.99998975 - 2193733241. Let f = s + 311. What is f rounded to 6 decimal places? -0.00001 Let u = 292.9511 - 293. What is u rounded to 3 decimal places? -0.049 Let b = 80189.00037213 - 80189. What is b rounded to 5 dps? 0.00037 Let m be 1/(11/5 - 2). Suppose mb + 30278 = 5g - 11782, 2g + 8406 = -b. Round b to the nearest one thousand. -8000 Suppose 20 = 4d + 2p, -3d + 5p = -11 - 4. Suppose -h - dq = -0h - 22055, 4q = -3h + 66198. What is h rounded to the nearest one thousand? 22000 Let l = 2620213192 + -2620211783.000619. Let b = l + -1409. What is b rounded to 5 decimal places? -0.00062 Let i = -0.721497 + 0.6979. Let z = i + 0.023. Round z to five dps. -0.0006 Let f be 3142469/(-33) + 2/61. Let v = 165526 + f. What is v rounded to the nearest one thousand? 70000 Let m = 49.059835 - 49.04. What is m rounded to four decimal places? 0.0198 Let k be 48153388/(-18) - 2/(-9). Let a = -55984 + 131172. Let h = k + a. What is h rounded to the nearest 1000000? -3000000 Let c = -26741 + 26727.763. Round c to the nearest integer. -13 Let z = 84038.41509 + -84038. What is z rounded to 1 dp? 0.4 Let w = -258 - -509. Let a = w + -251.000189. What is a rounded to 5 decimal places? -0.00019 Let i(p) = -9p + 110. Let x be i(8). Let w be 2100120/(-56)x. What is w rounded to the nearest ten thousand? -170000 Let n = -196 - -150. Let c = n + 46.159. Round c to 2 decimal places. 0.16 Let n = 7098 - 7241.95. Let j = -0.05 + n. Let g = -143.99999923 - j. Round g to 7 dps. 0.0000008 Let u = 32 - 52. Let n = 26 + u. Let a be 1/(-1) - (-26507 + n). Round a to the nearest one thousand. 27000 Let d = 7.6487888764381 - 1087770.8687886164381. Let b = -1087762.7 - d. Let u = 0.52 - b. Round u to seven decimal places. 0.0000003 Let s = -8 - 6. Let	{ "pile_set_name": "DM Mathematics" }
s y(-5)? -286 Let y(f) = 2f2 - 1571f + 266218. Calculate y(247). 199 Let n(c) = -781c + 223354. Determine n(286). -12 Let v(n) = -58n*3 + 40n*2 + 3n. Calculate v(2). -298 Let x(m) = 10389m - 4082870. Determine x(393). 7 Let r(h) = h2 + 284h + 16205. Calculate r(-205). 10 Let y(p) = -161p3 - 6p*2 + 513p - 506. What is y(1)? -160 Let u(z) = -10z3 + 254z*2 - 140z + 986. Give u(25). -14 Let o(w) = w*3 - 236w*2 + 13135w + 110. Determine o(90). -340 Let g(b) = -25b3 + 301b*2 - 109b + 1185. What is g(12)? 21 Let b(f) = -1419f + 72265. Calculate b(51). -104 Let n(h) = -h3 - 1033h*2 + 7225h - 57197. What is n(-1040)? 3 Let z(v) = 11v2 + 29796v - 209006. Determine z(7). 105 Let a(c) = -148c + 12709. Determine a(86). -19 Let k(q) = 101q - 19571. Calculate k(194). 23 Let r(g) = -g*3 + 39g*2 - 638g + 8384. Calculate r(27). -94 Let a(p) = -6743p + 6439548. Give a(955). -17 Let i(o) = 76o*3 - 532o*2 + 790o - 5524. Determine i(7). 6 Let l(y) = -y*3 + 218y*2 - 1098y - 36898. What is l(212)? -10 Let k(t) = t*3 - 91t + 751. Give k(10). 841 Let r(k) = 516k + 239941. Determine r(-465). 1 Let r(z) = z3 + 4223z*2 + 188012z + 85. Determine r(-45). -5 Let v(k) = 5k2 + 255k - 2532. Determine v(9). 168 Let s(l) = 36l2 - 123l + 219. What is s(2)? 117 Let u(l) = l*3 - 17l*2 - 10l + 29. Determine u(7). -531 Let k(y) = 11y3 + 60y*2 + 199y - 9. Give k(-3). -363 Let y(d) = d*3 + 12d*2 - 161d + 4. Give y(9). 256 Let u(r) = -5r2 - 4786r - 1. Calculate u(0). -1 Let v(z) = 4730z - 16051. Give v(4). 2869 Let t(s) = 27967s + 5929012. Determine t(-212). 8 Let l(x) = 42x2 + 4058x - 40763. Give l(10). 4017 Let r(k) = -k*2 - 16k + 1755. Determine r(-55). -390 Let i(t) = t*3 - 12t*2 - 126t + 1041. Determine i(7). -86 Let d(t) = -16t2 + 2730t - 7198. What is d(168)? -142 Let x(d) = -5d3 + 639d*2 - 504d - 179. What is x(127)? 329 Let b(s) = -344s + 10027. Give b(32). -981 Let o(p) = 216p + 21070. What is o(-97)? 118 Let n(z) = 37z + 3319. Give n(-67). 840 Let g(k) = -20k*2 + 161k + 618. Give g(22). -5520 Let q(c) = -285c3 - 1307c*2 - 1311c - 3. What is q(-1)? 286 Let j(h) = -1385h - 9972. Determine j(-7). -277 Let h(x) = 4x*2 + 156x - 63507. Give h(-147). -3 Let p(b) = 49b2 + 511b + 3678. Calculate p(-6). 2376 Let z(l) = -1673l + 1311646. Give z(784). 14 Let a(f) = -39f - 6107. Calculate a(-179). 874 Let m(r) = -6r3 + 44r*2 + 252r - 1856. Determine m(7). 6 Let k(d) = 19d2 + 1955d + 10869. Determine k(-97). 5 Let o(j) = j*2 + 4026j - 20123. Calculate o(5). 32 Let d(m) = m*3 + 5m*2 - 13m - 72. Determine d(-7). -79 Let n(x) = 15x2 + 210x + 188. Give n(-13). -7 Let k(d) = 2d3 - 63d*2 - 1587d + 49617. Give k(32). -143 Let l(s) = 30s2 - 3578s - 2672. What is l(120)? -32 Let u(d) = -d*3 + 68d*2 - 463d - 102. Calculate u(8). 34 Let p(s) = 71s - 5075. Give p(80). 605 Let n(t) = -46841t - 983568. Calculate n(-21). 93 Let j(q) = 1586049q + 11102348. What is j(-7)? 5 Let g(n) = 64034n - 63910. Give g(1). 124 Let z(d) = -d*3 + 44d*2 - 173d - 2708. Determine z(39). -1850 Let f(n) = -2n3 - 124n*2 + 20n - 1187. Give f(-62). -2427 Let v(g) = -883g - 126293. Give v(-143). -24 Let q(m) = m3 + 500m*2 + 5398m + 9723. Calculate q(-489). 432 Let i(n) = 7n2 + 3234n - 9695. Calculate i(3). 70 Let k(m) = -m*3 + 20m*2 + 6m - 316. Calculate k(18). 440 Let x(y) = y*2 + 148y - 53844. Determine x(-316). -756 Let j(z) = 179z - 48963. Give j(274). 83 Let i(r) = 2r*2 + 58r - 549. Give i(10). 231 Let o(y) = 6y - 380. Give o(-35). -590 Let s(o) = 648o - 18982. Determine s(29). -190 Let x(q) = 36q - 1467. What is x(9)? -1143 Let g(v) = -2v*2 + 10998v + 110178. What is g(-10)? -2 Let s(k) = -214k2 + 3212k - 34. Calculate s(15). -4 Let p(x) = -2x3 - 16x*2 + 163x - 21. Calculate p(6). -51 Let x(b) = 280643b + 14874085. What is x(-53)? 6 Let a(o) = -7o - 393. Determine a(-32). -169 Let u(i) = 2903i2 + 2851i - 43. Calculate u(-1). 9 Let x(o) = -o*3 - 15o*2 - 47o - 481. Calculate x(-14). -19 Let h(r) = r*3 - 83r*2 - 379r + 38. What is h(88)? 5406 Let u(f) = 16068f - 15957. What is u(1)? 111 Let t(a) = 12a*2 + 5315a - 451. Determine t(-443). -8 Let l(t) = -t*3 - 4t*2 - 59t - 703. What is l(-7)? -143 Let a(l) = -l*3 - 9l*2 + 480l + 3454. Calculate a(-7). -4 Let f(b) = -221b - 153377. Give f(-694). -3 Let a(s) = 100s*2 - 5438s - 84. Give a(55). 3326 Let t(v) = 679v2 + 4856v + 732. Calculate t(-7). 11 Let f(b) = 117b3 - 14b*2 - 1125b - 2212. Determine f(-2). -954 Let n(r) = 584r + 154186. What is n(-264)? 10 Let q(c) = 17c3 + c2 + 136c - 8. What is q(0)? -8 Let d(o) = -12o*3 - 945o*2 + 933o + 12. Give d(1). -12 Let b(a) = -a*3 + 17a*2 + 78a - 1184. Give b(18). -104 Let p(j) = 8j3 + 151j*2 + 700j - 112. Determine p(-10). -12 Let u(b) = b*3 + 10b*2 - 285b - 3248. What is u(-13)? -50 Let q(k) = 763k + 122989. What is q(-161)? 146 Let k(m) = -14m*2 - 42434m - 127314. Determine k(-3). -138 Let u(f) = 2f2 - 103f + 2170. Determine u(20). 910 Let q(g) = -2g3 - 3g*2 - 233426g + 466859. Calculate q(2). -21 Let k(u) = -18u3 - 213u*2 + 319u + 3486. Calculate k(-12). 90 Let n(x) = -232x2 + 1160x - 11. Give n(5). -11 Let c(q) = -2q3 + 135q*2 + 647q + 29. What is c(72)? -43 Let j(v) = -v*3 - 20v*2 - 38v - 537. Give j(-19). -176 Let z(h) = -2444h - 3570. Give z(-1). -1126 Let f(b) = 15b*2 + 179b + 78. What is f(-15)? 768 Let g(i) = 31797i + 62572. Calculate g(-2). -1022 Let t(s) = -50s*2 - 417s + 199. What is t(-12)? -1997 Let r(v) = 2v3 + 171v*2 + 310v + 19126. Give r(-85). 1 Let z(m) = -m*2 + 3619m + 21775. Give z(-6). 25 Let l(y) = 32128y - 6329222. What is l(197)? -6 Let k(b) = -9b*2 - 263b - 402. Calculate k(-30). -612 Let f(y) = 42y3 + 296y*2 + 11y + 19. Calculate f(-7). 40 Let a(i) = 7i2 + 212i + 61. Give a(-28). -387 Let u(r) = -633r2 - 203830r - 1120. Give u(-322). 168 Let t(l) = 13l2 - 3549l + 106. Give t(273). 106 Let s(p) = p*3 - 45p*2 - 432p - 187. What is s(53)? -611 Let p(z) = 16z2 + 266z + 190. Give p(-24). 3022 Let b(p) = 22158p - 398839. Give b(18). 5 Let v(x) = -49754x - 746309. Calculate v(-15). 1 Let z(q) = -2q2 - 311q - 5630. Determine z(-21). 19 Let l(n) = n*3 - 22n*2 - 203n + 4589. What is l(20)? -271 Let m(b) = 104388b + 104387. Calculate m(-1). -1 Let k(r) = -34r*2 + 691r + 3304. Give k(-4). -4 Let q(w) = 153w + 2529. What is q(-18)? -225 Let h(n) = 1987n + 26146. Determine h(-13). 315 Let x(a) = a*2 - 1983a + 9836. Determine x(5). -54 Let x(o) = o*2 + 638o + 22222. Determine x(-601). -15 Let u(f) = 4182f - 514387. Give u(123). -1 Let v(c) = c3 + 19c*2 - 3984c - 79323. What is v(-20)? -43 Let f(s) = -1631s - 13205. What is f(-9)? 1474 Let v(t) = -169388t + 1524510. What is v(9)? 18 Let j(a) = -4a2 - 456a - 12978. Calculate j(-59). 2 Let g(p) = -12p2 - 437p + 934. What is g(2)? 12 Let x(h) = 7h2 + 228h + 2298. What is x(-10)? 718 Let r(c) = 846c2 - 245c - 237. What is r(-1)? 854 Let a(b) = 61186b - 61187. Calculate a(1). -1 Let r(u) = 4u*3 - 55u*2 + 19u. Determine r(0). 0 Let y(l) = -l*3 + 488l*2 + 25154l - 4746. Calculate y(535). 69 Let o(y) = -78y3 - 11y*2 + 19y + 36. Give o(-3). 1986 Let y(a) = 6427a + 25706. What is y(-4)? -2 Let x(l) = -l3 + 89l*2 - 1463l + 2359. Calculate x(68). -21 Let u(a) = a*3 - 118a*2 + 291a + 42680. What is u(112)? 8 Let n(s) = -155s2 + 1969s - 10. Determine n(12). 1298 Let h(o) = 330496o - 8923421. Determine h(27). -29 Let a(i) = -73966i - 739653. What is a(-10)? 7 Let y(a) = a*3 - 28a*2 + 143a + 71. Calculate y(21). -13 Let x(d) = 27d2 + 1596d + 7918. What is x(-5)? 613 Let w(p) = p*3 + 44p*2 - 2701p + 5054. Determine w(-79). -2 Let g(t) = 2t3 + 188t*2 + 4386t - 615. Give g(-44). 1 Let k(p) = 769p + 34358. What is k(-47)? -1785 Let x(u) = 23854u*2 + u - 17. Calculate x(0). -17 Let v(s) = -2s*2 - 2381s + 55771. Give v(23). -50 Let u(s) = 38116s - 3354126. What is u(88)? 82 Let r(i) = -1533i - 18733. Calculate r(-12). -337 Let a(	{ "pile_set_name": "DM Mathematics" }
Let c(y) be the third derivative of y*7/70 + 7y*5/60 + 4y*2. Find the third derivative of c(h) wrt h. 72h Suppose -36 = -6u + 3u. Find the second derivative of -n*2 + 7n + u - 7 - 5 wrt n. -2 Suppose -3 = f - 12. Suppose 0 = 4p - 7p + f. Find the second derivative of -5s + 4s + s*5 + ps wrt s. 20s3 Let a(k) be the third derivative of -k7/1680 - k6/360 - k5/12 - k2. Let p(t) be the third derivative of a(t). What is the derivative of p(f) wrt f? -3 Find the third derivative of 13h*2 - 3h*5 - 12 + 12 wrt h. -180h*2 Let w(u) = u + 4. Let q be w(-6). Let a be q/8 + 18/8. What is the third derivative of 2m*2 + 2m4 - ma + m*2 wrt m? 48m Let d(x) = -x*3 - 13x*2 + 5. Let a be d(-13). Let w be (2 - 1)(0 - -2). What is the third derivative of 0y - ay*2 - 2y*6 + 0y + y*w wrt y? -240y*3 Let i(l) be the second derivative of 1/3l*3 - l + 1/21l*7 + 0l*2 + 0l*4 + 0l*6 + 0 + 0l*5. What is the second derivative of i(w) wrt w? 40w*3 Let k = -1 + 6. What is the second derivative of -s + 3s + 0s + 3s + 6sk wrt s? 120s*3 Let u = -4 + 4. Let y(r) be the third derivative of -1/60r6 - r2 + u + 0r3 + 0r*5 + 0r + 1/8r4. Find the second derivative of y(l) wrt l. -12l What is the second derivative of -4i2 + 9i - 12i + 2 - 2 wrt i? -8 Let h(r) = 3 + 5r + 0r2 - 3r*2 + 2r*2. Let q be h(5). Find the first derivative of 3tq + 1 - t4 - 3t3 wrt t. -4t*3 Let x(m) be the second derivative of -7/12m*4 + 0 + 0m*2 - 6m + 0m3 - 1/10m5. What is the third derivative of x(f) wrt f? -12 Let f(o) = -o2 + 2o + 3. Let x be f(3). Find the second derivative of xp - 6p + p + p - 2p*5 wrt p. -40p*3 Find the third derivative of 2n*2 - 5n*2 - 9n*3 + 5n3 wrt n. -24 Let r(m) = -m3 + 3m + 2. Let p be (5 + -3)(-2 + 1). Let x be r(p). What is the third derivative of -4n3 + 3n*5 + xn3 + n2 wrt n? 180n2 Let x(r) be the third derivative of 1/84r*8 + 0r*3 + 0r*7 + 0r + 0r4 - 1/60r*5 + 0 - 2r*2 + 0r*6. Find the third derivative of x(q) wrt q. 240q2 Let m(j) = -j4 - j*3 - j. Let s(i) = 9i*4 - 2i*3 - 2i + 8. Let p(g) = -2m(g) + s(g). What is the first derivative of p(v) wrt v? 44v3 Let j(n) be the first derivative of -n6/360 + n4/24 + n3/3 - 2. Let o(q) be the third derivative of j(q). What is the derivative of o(r) wrt r? -2r Let q(f) be the first derivative of -7/2f*2 + 0f + 3 - 5/3f3. Find the second derivative of q(j) wrt j. -10 Let z(k) = -12k*4 - 10k - 2. Let g(p) = 25p4 + 19p + 5. Let n(y) = -2g(y) - 5z(y). What is the second derivative of n(f) wrt f? 120f2 What is the first derivative of p - p - 3p*3 - 3 + 8 wrt p? -9p*2 Let f be (32/20)/(6/15). Suppose -l = -0l - 4c - 23, 5l + 5 = -fc. Differentiate -lz*2 + 3z2 - z3 - 3 with respect to z. -3z2 Suppose 4z = 1 + 11, -3y + 2z = -12. Find the first derivative of -y + 5 - 7 - 8x2 wrt x. -16x Suppose 0 = 2k - 3k + 5w + 3, 2w + 9 = 3k. Differentiate -3u - k + 3u + 12 + 11u*2 with respect to u. 22u Let c be 21/5 + (-1)/5. Suppose 0 = -5j + c + 11. Find the third derivative of -3 + 3 + y2 - yj wrt y. -6 Let w(g) = 3g + 3. Let b(u) = -u. Let d(y) = 3b(y) - w(y). Differentiate d(v) wrt v. -6 Let n = 25 - 23. Find the third derivative of xn - 3x*2 - 7x*6 - 5x*2 wrt x. -840x3 Let o = -6 + -1. Let z(v) = v + 9. Let q be z(o). Find the third derivative of -n2 + 0nq + n3 - n2 wrt n. 6 Find the first derivative of 6 + 3 + 6 - 7i2 + i2 wrt i. -12i Let b(g) be the second derivative of 29g*8/56 + 37g*4/12 + 5g + 4. Find the third derivative of b(c) wrt c. 3480c3 Suppose -4l + b = -17, 0 = 5l - 2b - 18 - 1. Let y be 0 + l - (1 - 1). Find the second derivative of -3w3 + 3w + yw - 7w wrt w. -18w Let w = 19 + -12. What is the second derivative of -4l*3 + 5l + 3l - wl + l wrt l? -24l Let h(g) be the first derivative of 2g*2 - 11g + 8. Differentiate h(b) with respect to b. 4 Suppose 4l = 3w - 16, 5w - 4 = 2l - l. Suppose w = -o - o + 2. What is the third derivative of -x*3 - 2x*2 - 1 + o wrt x? -6 Suppose -2a + s + 7 = 0, -2a - 2a + 3s = -15. Find the third derivative of i3 + 0i2 - i3 - 3i2 - ia wrt i. -6 Let w(g) = -3g + 4 + 2g + g2 - 2g. Let c be w(3). Find the first derivative of -2k - 2k + ck - 2k*3 - 2 wrt k. -6k*2 Let b(h) = 4h*4 - 5h*3 - 5h*2 + 5h + 6. Let x(u) = 4u4 - 4u*3 - 4u*2 + 4u + 5. Let m(n) = 4b(n) - 5x(n). Differentiate m(d) wrt d. -16d3 Let q(b) = -4b*3 - 9b*2 - 2. Let s(v) = 9v*3 + 19v*2 + 5. Let u(m) = -5q(m) - 2s(m). What is the third derivative of u(h) wrt h? 12 Let j(k) be the third derivative of -k9/3024 + k5/60 - 5k*4/24 + 2k*2. Let y(q) be the second derivative of j(q). Differentiate y(z) with respect to z. -20z*3 Let k(u) = 1. Suppose 3c + 3p = 5c - 7, -5c + 8 = 2p. Let h = c - 1. Let x(i) = i*3 - 5. Let o(m) = hx(m) + 4k(m). Differentiate o(y) wrt y. 3y*2 Let b(w) be the first derivative of 1/3w*6 + 2 + 0w*4 + 0w + 1/3w3 + 0w*5 + 0w*2. Find the third derivative of b(p) wrt p. 120p*2 Let r be 1/(-4) + (-17)/(-4). Suppose -10 = -3d - 2d. Differentiate dk4 - 1 + k4 - rk4 wrt k. -4k*3 Let t(o) be the second derivative of -17o*6/30 - 41o*3/6 + 24o. Find the second derivative of t(p) wrt p. -204p2 Let a(z) = z2 + z + 1. Let k(s) = 7s4 - s2 + 8s - 1. Let p(f) = -a(f) - k(f). Find the second derivative of p(l) wrt l. -84l*2 Let j(f) be the first derivative of -46f*3/3 - 3f*2/2 + 2f - 50. Find the second derivative of j(x) wrt x. -92 Let t(y) be the third derivative of y6/360 - y5/60 - 5y4/12 - 7y*2. Let w(b) be the second derivative of t(b). What is the derivative of w(o) wrt o? 2 Find the second derivative of 2l - 41l2 + 41l*2 + 13l*3 wrt l. 78l Find the third derivative of 30o5 - o2 - 64o*5 + 31o*5 wrt o. -180o*2 Let a(s) be the second derivative of 11s7/210 + s5/6 + 2s2 + 10s. Let x(v) be the first derivative of a(v). What is the third derivative of x(k) wrt k? 264k Let t(f) = -26f*2 - 27. Let q(p) = -27p*2 - 27. Let o(x) = 5q(x) - 6t(x). Differentiate o(l) wrt l. 42l Suppose -1 = -2q + 9. Let y = q - 3. What is the derivative of 0 + 0 + 0 + 2 + yo wrt o? 2 What is the second derivative of 19x - 1 - 2x*3 - 5x3 - x2 - 2x2 + 0x wrt x? -42x - 6 Let o(h) be the first derivative of 4h - 2 - 4h + 3h - h*4 - h. What is the first derivative of o(p) wrt p? -12p*2 Let g(p) be the second derivative of -3p*4/2 + 9p*2 + 11p. Differentiate g(m) wrt m. -36m Let g(q) be the first derivative of 5 - 3/2q*2 + 0q*3 - 5/4q*4 + 0q. What is the second derivative of g(m) wrt m? -30m Let s(g) be the third derivative of 13g4/24 - g3/2 + 3g2. Let b(f) = -4f + 1. Let z(j) = 7b(j) + 2s(j). Differentiate z(x) with respect to x. -2 Let f be 6/(-18)30/2. Let u(d) = -d2 - 3d. Let n(q) = -q*2 - 3q. Let k(c) = fu(c) + 4n(c). Find the second derivative of k(m) wrt m. 2 Let k be (-1)/(5/2)-5. Find the first derivative of -1 + kv*2 - 1 - 6v*2 wrt v. -8v Let q(k) = 27k - 44. Let w(s) = 14s - 22. Let u(r) = 4q(r) - 7w(r). Differentiate u(a) with respect to a. 10 Let o = -10 - -13. Let t(n) be the first derivative of 0n + 0n*2 + 1/4n*4 - 2 - 1/3no. What is the third derivative of t(q) wrt q? 6 Let d(s) be the second derivative of s6/6 - s*3/6 + 2s. What is the second derivative of d(u) wrt u? 60u2 Let h be 4 + (-7)/2011. Let r(m) be the second derivative of -1/6m4 + 0m*3 + 0m*2 + 0 + hm5 - m. Find the third derivative of r(u) wrt u. 18 Let m(v) = -v2 + 5. Let n(l) = -l*2 + 3. Let u = 23 - 12. Let a(t) = un(t) - 6m(t). What is the first derivative of a(q) wrt q? -10q What is the second derivative of -5h3 - 9h + 12h - h wrt h? -30h Differentiate -16 - 4f3 - 22 + 2f2 + 32 - f2 wrt f. -12f2 + 2f Let j be (2 + -1)2/1. Let v be (-304)/(-80) + (-1)/(-5). What is the third derivative of -2u*j + 3u*2 - 3uv + u4 wrt u? -48*u Let n be (-2)/(-12) + 23/6. Let y(z) be the second derivative of -z + 0	{ "pile_set_name": "DM Mathematics" }
and r? 10 Let v be ((-10)/6 + 1)-6. Suppose v = -0u - 2u. Let j(h) = -4h + 2. Let o be j(u). What is the highest common factor of o and 90? 10 Suppose -4t + 2b + 80 = 0, 17b + 2 = t + 12b. What is the highest common factor of 66 and t? 22 Let d = 35 + -15. Calculate the highest common divisor of d and 100. 20 Suppose -23w = -28w + 5. Calculate the highest common divisor of w and 11. 1 Let o be 11/(-2(-1)/8). Suppose -4z = -2p - 44, 0 = 3z + p + 3p - o. Let x be (21)/(z/18). Calculate the highest common divisor of x and 24. 3 Suppose 0i + 770 = 5i. Let o = i - 0. Calculate the greatest common divisor of 14 and o. 14 Let v = 11 + -11. Let f be v + 0 + (51 - 3). Calculate the highest common divisor of 12 and f. 12 Let j(x) = x2 + 2. Let f(p) = -p2 + 4p + 2. Let y be f(5). Let v = -1 - y. Let a be j(v). What is the highest common divisor of a and 6? 6 Suppose 0 = -h - 3v + 24, 9v - 4v = -4h + 75. Let x be h/(-25) - (-36)/10. What is the greatest common divisor of 2 and x? 1 Suppose 130 = 3a + 5i, 0a + 2a - 74 = 3i. Let o(x) = 3x - 5. Let s be o(5). What is the greatest common factor of s and a? 10 Let d = -29 + 65. Suppose -5c - 7 + 67 = 0. What is the highest common divisor of d and c? 12 Suppose 3i - 844 = -4d, -3i + 3d = -7i + 1137. What is the highest common divisor of 36 and i? 36 Let p be (-352)/56 + (-2)/(-7). Let c = 16 + p. What is the greatest common factor of 10 and c? 10 Suppose 20v - 14v - 330 = 0. Calculate the highest common divisor of 11 and v. 11 Let z(j) = 17j*2 - 1. Let y be z(1). Calculate the highest common factor of 16 and y. 16 Suppose 10 = 2s, 0a + s = -5a + 20. Calculate the highest common factor of a and 27. 3 Let w(z) = 2z - 7. Let g be w(10). Suppose 4j + j - 650 = 0. What is the greatest common factor of g and j? 13 Let c = -449 + 684. Calculate the greatest common factor of c and 47. 47 Let s be (60/(-3))/(2/(-4)). Calculate the highest common factor of 100 and s. 20 Let o(h) = 87h2 + h. Let u(g) = -g2 + 3g - 1. Let k be u(2). Let x be o(k). What is the greatest common factor of 8 and x? 8 Suppose -5b - 4h = -117, -4b + h = -2h - 106. Let i be (-1)/3 - 80/(-6). Let n = i - 8. Calculate the greatest common factor of n and b. 5 Let s = -79 + 108. Calculate the greatest common factor of 87 and s. 29 Let i = -98 - -118. Calculate the highest common factor of 12 and i. 4 Suppose -12 + 0 = -2h. What is the highest common factor of h and 15? 3 Let a be (30 + 1)(1 - 2). Let b = a - -71. Suppose b = 6g - 2g. Calculate the greatest common factor of 110 and g. 10 Let i be (-1 - 1/1)-5. What is the highest common factor of i and 2? 2 Suppose 2 = 6m - 46. Calculate the greatest common divisor of m and 136. 8 Let p(q) = -q3 + q2 + q - 2. Let v be p(-2). What is the greatest common factor of v and 24? 8 Suppose -2i = 5h + 17, -2h = -2i + h + 23. Suppose 2w - 28 = 4z, 0w + 2z - 86 = -iw. What is the greatest common divisor of 30 and w? 10 Let t = -3 - -7. Suppose 25 = 2w - tb + 1, 0 = -3w + 5b + 31. Suppose -ws + 3s - 12 = 0. What is the highest common divisor of 12 and s? 12 Suppose -4r - 63 = -5z, -2r - 4z - 30 = -6z. Let d be (-43)/(-4) - 3/r. Let l be (25/(-10))/((-2)/88). Calculate the highest common factor of l and d. 11 Let a be (-1 + -3)(-4)/1625. What is the greatest common factor of 175 and a? 25 Suppose 4c - 14 = 14. Let t be c + -2 + 0/(-2). What is the greatest common factor of t and 5? 5 Let z be (18/8)/(6/16). Let i = -20 + 32. Calculate the greatest common divisor of i and z. 6 Let l = -5 + 15. Let y = 15 - l. What is the highest common factor of 45 and y? 5 Suppose 0h - 7 = -h + c, 2h + 3c - 39 = 0. Let a(o) = o*2 - 14o + 27. Let v be a(12). Calculate the greatest common factor of h and v. 3 Let n = 717 - 487. What is the greatest common factor of n and 46? 46 Let d(h) = 14h2 + 2h + 3. Let u be d(-2). What is the highest common factor of 11 and u? 11 Let m(j) = j*3 + 6j*2 + 6j + 2. Let v be m(-5). Let z be (-1 + 0)v - -19. Calculate the highest common divisor of z and 44. 22 Suppose -5m = 4c - 97, 3c + 5m + 15 - 94 = 0. Calculate the highest common divisor of 144 and c. 18 Let x = 7 - 4. Suppose -xb = 6, 5d - 20 = -5b - 5. What is the highest common factor of d and 2? 1 Suppose q + q = 5l + 12, 3l + 32 = -5q. Let h = -3 - l. Let o be 150/4(h + 1). What is the highest common divisor of 30 and o? 15 Suppose 24 = l - 5l. Let f be (-3)/l - 15/(-6). Calculate the highest common factor of 15 and f. 3 Suppose 0 = 2a + 5n - 22, -5a = -4a + n - 5. Suppose 0 = 4u - 4x - 36, 0u = u - 5x - 29. What is the highest common divisor of u and a? 1 Let u be (5 + -2)/((-9)/(-6)). Suppose 4b = 2y - y + 437, -5b = uy - 556. Calculate the greatest common divisor of 44 and b. 22 Let d(z) = -z + 1. Let q = -8 - -5. Let i be d(q). Let o = 15 + -7. Calculate the highest common divisor of o and i. 4 Let w(o) = 2o*2 + 4o + 17. Let k be w(-7). Calculate the highest common factor of k and 58. 29 Suppose 0 = -h + 1, 5h + 2 = -3w + 19. Suppose -3n - wy = -4n + 42, 5n = -y + 126. Calculate the greatest common factor of n and 286. 26 Suppose 80 - 3 = f. Let y = -39 - -76. Let n = -26 + y. What is the greatest common factor of f and n? 11 Let w(a) = -a3 - a2. Let n be w(-2). Let q = -112 - -116. Suppose -5 = -ns + 3c + 138, -qs + 4c = -148. What is the greatest common divisor of s and 8? 8 Let o be ((-44)/16 - -1)-92. Suppose w = 5h + 28 - 429, 2h - w = o. Suppose 95 = 4d + 3c - 45, 0 = -3c + 12. What is the highest common factor of d and h? 16 Suppose -2v + 5t - 434 = 0, 3v + t + 414 = -254. Let r be (-2)/7 - v/42. What is the highest common factor of 1 and r? 1 Suppose -3d = -i + 73, 212 = 7i - 4i - 2d. What is the greatest common divisor of 20 and i? 10 Let i be (0 + -2)/(7 + -9). Suppose 5g + 4r - 21 = 14, -g + 26 = -3r. Calculate the greatest common divisor of g and i. 1 Let w(k) = -3k - 17. Let u be w(-15). Calculate the highest common factor of 42 and u. 14 Suppose -3v + k + 78 = 2v, -4v + k + 62 = 0. Calculate the highest common divisor of v and 112. 16 Let w = 7 + 95. What is the highest common divisor of 17 and w? 17 Suppose 0 = 4s + 2 - 10. Let m = -2 - -5. Suppose -105 = -mh + sh. Calculate the highest common factor of 15 and h. 15 Let j = -7 - -42. What is the greatest common divisor of j and 5? 5 Let t be (-10)/(-1 - 3/(-9)). Suppose 36 = -13y + ty. Calculate the greatest common divisor of y and 2. 2 Let w = -15 + 19. Calculate the highest common divisor of w and 2. 2 Let t = 38 + -18. Calculate the greatest common factor of 4 and t. 4 Suppose 0m + 6 = 2m, -5m = 4z - 63. Let p be ((-132)/10)/(1/(-10)). What is the highest common divisor of p and z? 12 Suppose -h + 4j = -0j - 114, -5h + 627 = -j. Suppose 5p - h = 124. Suppose -a = -2a + 20. What is the highest common factor of p and a? 10 Let h be (5 + 87/9)/(4/6). What is the highest common divisor of h and 176? 22 Suppose 4v = 3v - 9. Let n = 23 + v. Let j = 13 - -8. Calculate the greatest common factor of j and n. 7 Let f(l) = -2l3 + 39l*2 + 22l + 16. Let n be f(20). What is the highest common factor of 42 and n? 14 Suppose 4a + 94 = 5l - 233, -2l + 123 = a. Calculate the highest common divisor of l and 9. 9 Let v = -73 - -95. Calculate the greatest common divisor of v and 132. 22 Suppose 3w + 3a = 51, -7w + 2w + 4a = -49. What is the highest common factor of w and 91? 13 Let c be (-6)/(-15) + (-126)/(-10). Let m = 29 + -3. What is the highest common divisor of m and c? 13 Let a be (-4)/(-10) - 56/(-10). Let k be 14(-6)/(-2 - 0). Let c = k - 30. What is the highest common divisor of c and a? 6 Suppose -5v = -2t - 3348, v - 664 = -0v - t. Let p be v/14 + 8/28. What is the highest common divisor of 6 and p? 6 Suppose 3q + 0q = -9. Let h = q + 2. Let z(j) = 6j2 + 1. Let c be z(h). What is the greatest common factor of c and 56? 7 Suppose 5w - 140 = -l, 3w - 354 - 42 = -3l. What is the greatest common factor of l and 13? 13 Suppose 12 + 6 = 2p. What is the highest common divisor of p and 18? 9 Suppose -7u = -2u - o - 42, -38 = -4u + 3*o. What is the greatest common factor of u	{ "pile_set_name": "DM Mathematics" }
e third derivative of 37f2 + 65f*3 - 110f*3 - 5f*2 wrt f. -270 Let n(w) = w - 1. Let s be (-14)/(-4) + (-1)/(-2). Let p = 7 - s. Let x(c) = -5c + 1. Let v(l) = pn(l) + x(l). Differentiate v(g) wrt g. -2 Let n(b) be the second derivative of -3b*5/20 - 13b*3/6 + 10b. Find the second derivative of n(z) wrt z. -18z Let f(d) be the second derivative of 41d*6/30 - 9d*2/2 + 5d. Differentiate f(j) with respect to j. 164j3 Let p(k) be the first derivative of 2k*5 + 16k - 11. What is the derivative of p(t) wrt t? 40t3 Let x = 4 + 4. Let w = 11 - x. Find the second derivative of -3t - 7t3 + 3t*2 + 3t*3 - wt*2 wrt t. -24t Let q(r) = -r + 1. Let m be q(-1). Suppose 2a = m - 0. What is the first derivative of 6z + a - 4 - 3z wrt z? 3 Let h be (-3 - (-4 + 0))0. Suppose 5d + 15 = h, 4d + 11 = 3g - 4g. Find the first derivative of g - 2o4 - 2 + 6o*4 wrt o. 16o*3 Suppose 5f + 0 - 10 = 0. Suppose s - 6 = -f. Find the second derivative of 3l2 - sl*2 + 0 - 3l + 0 wrt l. -2 Let u(j) = 8j3 - 3j2. Let y(a) = a3 - 3a3 + a3. Let s(t) = -u(t) - 4y(t). Find the third derivative of s(w) wrt w. -24 Suppose -5z = y + 4y - 20, 0 = -5z + 4y + 20. Let h be 7 - (z + -1 + -1). What is the second derivative of 2s5 - 4s*5 - s + 0s*h + 3s*5 wrt s? 20s3 Let f(o) = -o3 + 14o2 - 12o - 7. Let k be f(13). Differentiate p*2 - kp*2 + 3 - 2 with respect to p. -10p Let w(r) be the second derivative of r*5/20 - 15r*3/2 + 37r. Find the second derivative of w(z) wrt z. 6z Let b(r) be the first derivative of r6/24 + r5/15 + r2 + 5. Let q(x) be the second derivative of b(x). What is the third derivative of q(t) wrt t? 30 Let q(n) be the third derivative of -n8/336 - 7n*5/60 + 7n*2. What is the third derivative of q(w) wrt w? -60w2 Let m(r) be the third derivative of r5/5 - 2r3 + 18r*2. Differentiate m(j) wrt j. 24j Let c(m) = 3m3 - 5m*2. Let j(y) = 2y + 2y3 + 55y*2 - 2y - 59y2. Let p(f) = -3c(f) + 4j(f). Find the third derivative of p(r) wrt r. -6 Find the first derivative of -3 - l2 - 7 - l2 + 3l*2 wrt l. 2l Let y(i) = -9i2 + 14. Let n(w) = -3w*2 + 5. Let h(x) = 11n(x) - 4y(x). Differentiate h(o) wrt o. 6o Suppose 0 = -z - 3w - 10, -3z - 2 = -w + 8. Let j(c) = -2c - 6. Let o be j(z). Differentiate 4k*2 - ok*2 - 5k*2 - 3 with respect to k. -6k Let m(q) = q - 1. Let p(x) = -16x2 - 3x - 7. Let i(r) = 3m(r) + p(r). Find the first derivative of i(g) wrt g. -32g Let z(k) be the first derivative of 0k + 3/2k*2 + 4 + 5/3k3. What is the second derivative of z(i) wrt i? 10 Let g(v) = -v3 + 8v2 + 2. Let y be g(8). Differentiate -2 + 2x*2 - 1 + 0xy + x2 with respect to x. 6x Suppose -2u = 4g - 6, 0 = -5u - 5g + 10 - 0. Find the third derivative of 1 + 2m4 - u + 0 - m2 wrt m. 48m Let s(f) be the third derivative of 0 - 3f*2 - 1/6f*3 - 1/12f*4 + 0f. What is the first derivative of s(y) wrt y? -2 Suppose -2y = -8, 0 = t + 2y + y - 17. What is the second derivative of tv - 3v*2 - 5v + 3v wrt v? -6 Let s(j) = -3j*2 + 10j2 + j4 + 4j5 - 2j + j. Let u(i) = -i4 - i2 + i. Let z(o) = -s(o) - u(o). What is the third derivative of z(x) wrt x? -240x2 Let m(w) be the second derivative of 0w*6 + 0 + 0w*5 + 1/3w*3 + 3w + 0w2 + 0w*4 - 3/14w*7. Find the second derivative of m(y) wrt y. -180y*3 Let j(y) be the first derivative of -1/2y*2 + 0y - 2 - 3/5y5 + 0y*3 + 0y*4. Find the second derivative of j(k) wrt k. -36k*2 What is the derivative of 2 - 1 - 8 + 50t wrt t? 50 What is the third derivative of -2h5 + 5h*5 - 2h*2 + 0h*2 + 0h*5 wrt h? 180h*2 Suppose 6 + 36 = 3i. Let o(m) = -4m2 - m - 2. Let j(k) = -13k*2 - 3k - 7. Let t(w) = io(w) - 4j(w). What is the second derivative of t(s) wrt s? -8 Let h(f) be the second derivative of f6/30 - f3 + f*2/2 + 21f. Find the first derivative of h(y) wrt y. 4y3 - 6 Let i(w) be the second derivative of -w6/40 + w4/8 + w2 + 2w. Let r(q) be the first derivative of i(q). Find the second derivative of r(b) wrt b. -18b Let r(c) = -6c. Let o(h) = 50h - 9. Let x(d) = -25d + 5. Let f(t) = -6o(t) - 11x(t). Let n(q) = 6f(q) - 26r(q). Differentiate n(m) with respect to m. 6 Let p(x) = -x*2 + 10x - 11. Let k be p(8). Find the second derivative of 4ok + 6o*4 + 4o - 6o4 wrt o. 80o*3 Let x(i) be the second derivative of -19i*5/10 + 5i*4/3 - 9i. Find the third derivative of x(h) wrt h. -228 Let c be 6/(0/(-3) - -1). Let g = 10 - c. Differentiate 1 - 7 + 4 - 2og wrt o. -8o*3 Let k(b) be the first derivative of -7b6/120 + b5/20 + b*2/2 + 9. Let y(w) be the second derivative of k(w). Find the third derivative of y(x) wrt x. -42 Let r(z) be the second derivative of -2z*7/3 - 13z*4/4 - 3z. Find the third derivative of r(u) wrt u. -1680u2 Let h be (18/(-12))/(2/(-12)). What is the derivative of -h + 1 + 3 + 4r wrt r? 4 Let p(o) be the second derivative of 3o6/10 - 5o*3/3 + 8o. Find the second derivative of p(v) wrt v. 108v2 Let s = -13 + 19. Find the third derivative of -5q*2 - 3q3 + q2 + sq2 wrt q. -18 Let h(a) be the second derivative of 2a*3/3 - 3a*2/2 + 6a. Differentiate h(v) with respect to v. 4 Let u = 19 + -13. Let y be ((-1)/(-2) + -2)-2. What is the third derivative of -v6 - 2v*2 - yv*u + 5v*6 wrt v? 120v*3 Suppose -3 + 11 = -3a + 4d, -3a + 8 = 4d. Suppose l - 5s + 13 = 0, 2l - s = -as + 1. Differentiate -n*4 + 2n*4 - 1 - ln*4 wrt n. -4n*3 Let k(w) be the third derivative of 55w*4/24 + 8w*3/3 + 4w*2 + 2. Find the first derivative of k(q) wrt q. 55 Let o(y) be the second derivative of -9y5/20 + y3/2 + 10y. What is the second derivative of o(h) wrt h? -54h Let z(b) = -b*2 + 8b. Let j be z(8). Find the third derivative of 0w2 - 5w*5 + jw*5 - 4w*2 + 3w*5 wrt w. -120w*2 Let i(a) be the second derivative of -3a*5/20 + 3a*2 - a. Differentiate i(t) wrt t. -9t*2 What is the third derivative of 229o + 8o2 - 229o - o*4 wrt o? -24o Suppose 6 = -o - 2j, -3o + o = -4j - 20. What is the derivative of -a4 - 8a*2 - o + 8a*2 wrt a? -4a3 Let s(k) = k3 - k*2 - 1. Let o(m) = 24m*3 + 3m*2 + 6. Let z(r) = -o(r) - 6s(r). What is the third derivative of z(w) wrt w? -180 What is the third derivative of -6n2 + 0n*2 + 8n*5 + 3n*5 - 2n*5 wrt n? 540n2 Let h(c) be the second derivative of c6/6 + c*3 - 2c. Find the second derivative of h(m) wrt m. 60m2 Let o(m) = 8m*4 + 6m*2 - 5m. Let y(i) = i4 - i2 + i. Let n(q) = -o(q) - 5y(q). What is the third derivative of n(d) wrt d? -312d Let d(s) be the second derivative of -25s8/56 - 31s*4/6 - s + 1. What is the third derivative of d(v) wrt v? -3000v3 Let p = -21 + 23. What is the third derivative of -sp + 2s3 - s3 + 6s*2 + 4s3 wrt s? 30 Let z(h) be the third derivative of -h8/420 - h*6/60 + 7h*3/6 - 6h*2. Let i(d) be the first derivative of z(d). Find the third derivative of i(k) wrt k. -96k Let r(b) = 3b2 - 7. Let j = 6 - -1. Let k(p) = -p2 + 10 - j + 0p*2. Let t(n) = 5k(n) + 2r(n). What is the first derivative of t(m) wrt m? 2m Let n = 3 + 0. What is the third derivative of np2 - p2 - 4p3 + p2 wrt p? -24 Find the second derivative of -7x3 + 2x*3 + 18x*3 + 13x wrt x. 78x Let n(z) = 26z*3 - 4z*2 + 8. Let v(y) = -5 - 5y*2 + 9y*3 + 5 + 3 + 4y*2. Let g(a) = -3n(a) + 8v(a). Find the third derivative of g(j) wrt j. -36 Let q(b) be the second derivative of -b5 - b4/12 + 7b*3/3 + 26b. What is the third derivative of q(p) wrt p? -120 Let r(d) = d3 - d2 - d. Let f(b) = -9b3 - 6b*2 - 4b. Let l(m) = -f(m) + 4r(m). What is the third derivative of l(x) wrt x? 78 Let v = 8 + -3. What is the third derivative of -v + 4t*2 + 5 - 3t*5 + 7t*5 wrt t? 240t*2 What is the third derivative of -178s*3 + 0s*2 + 175s3 + s2 wrt s? -18 Let n(v) be the third derivative of 29v9/504 + 19v*5/60 - 38v*2. What is the third derivative of n(r) wrt r? 3480r*3 Let u(g) be the second derivative of 13g*5/20 - 13g*3/6 - 5g. Fi	{ "pile_set_name": "DM Mathematics" }
vative of -9099i5 - 5529i*3 + 81i*2 + 185884i? -545940i2 - 33174 Find the third derivative of -10803201h*3 + 175h*2 - 29h - 42. -64819206 What is the second derivative of 5903667q2 + 39764q + 282 wrt q? 11807334 What is the third derivative of 691a4 + 473a*3 + 8a*2 + 27898a - 3 wrt a? 16584a + 2838 Find the second derivative of 1432b*2d2 + b2d + 200b*2 + 2141551bd2 wrt b. 2864d*2 + 2d + 400 Find the third derivative of -49859726g3 - 20613g*2 + 87g - 2. -299158356 Find the first derivative of -12v3z - 723v3 + 7v*2 + 8185189vz + 8866v + 2 wrt z. -12v3 + 8185189v Differentiate -16964n4 - 4449n*3 - 342090524 with respect to n. -67856n*3 - 13347n*2 What is the third derivative of -21496229ls3 - 2ls2 - 294255ls - 14s*3 + 59s wrt s? -128977374l - 84 What is the third derivative of -1457203953tu4 - 111tu2 - 13tu + 241u*2 + 3u + 2 wrt u? -34972894872tu Find the second derivative of -425753523t4 - 65t + 625472 wrt t. -5109042276t2 Find the second derivative of -2585337b*3 - 2186259b wrt b. -15512022b What is the third derivative of 35u*4 - 641946u*3 + 821158u*2 + 65u + 1 wrt u? 840u - 3851676 Find the third derivative of -40081b*3y*2 + 4b*3y + 11b3 - 2b*2y*2 - 100b*2 + 40by2 - 4 wrt b. -240486y*2 + 24y + 66 What is the derivative of -1207849ry + 182r - 11y + 40225 wrt y? -1207849r - 11 Find the first derivative of 3d*3q + 126d3 - 19d*2 + 132065dq - 6q - 330 wrt q. 3d3 + 132065d - 6 What is the second derivative of 1044667195d2 + 934818202d wrt d? 2089334390 Differentiate a*2 - 31455535a - 19353004 wrt a. 2a - 31455535 Find the third derivative of 5077115a*6 + 2a*2 - 23230608. 609253800a*3 Find the third derivative of -844b*2k*3 - 10948b*2kp3 + 133b*2p*2 - 978bk3p*3 - 2bk2p*3 wrt k. -5064b*2 - 5868bp3 Differentiate 201369903a - 28394871. 201369903 Differentiate -41765874h + 94241695 wrt h. -41765874 Find the second derivative of 14879125l*2 - 12161392l. 29758250 Find the second derivative of 460557r3 + 7r*2 + 13293744r wrt r. 2763342r + 14 Find the third derivative of -9257b*4 + 708b*3 - 2b*2 + 65823390b wrt b. -222168b + 4248 What is the derivative of 484867395y - 245095992? 484867395 What is the third derivative of -177842353v3 - 3281v*2 - 11v + 26 wrt v? -1067054118 Differentiate 2a4 + 230050a*2p*2 + 5p*2 - 55p + 1700 wrt a. 8a3 + 460100ap2 Find the third derivative of -2452438n*3 - 131283644n*2. -14714628 What is the second derivative of -7rw3 - 4rw - 964r + 665648w3 + 3280w - 2 wrt w? -42rw + 3993888w Find the second derivative of -3n*4 - 14982247n*2 + 148886723n. -36n2 - 29964494 Find the second derivative of 9099439np2 + 820np - n - 2p + 56 wrt p. 18198878n What is the second derivative of -294445843g*4 + g - 366570118 wrt g? -3533350116g*2 Find the second derivative of 604a*2q*3 - 3547a*2q - 3a2 + 30aq3 + 258aq2 + aq - 400a wrt a. 1208q*3 - 7094q - 6 What is the third derivative of 6428985w4 - 6w*3 + 330437602w*2? 154295640w - 36 Find the second derivative of -118031898w3 + 115729360w wrt w. -708191388w What is the second derivative of -78905fw5 - 574fw4 - 3299571fw + f + 7w wrt w? -1578100fw*3 - 6888fw2 Find the second derivative of -5497674w*5 - 6w4 + w2 + 128600912w. -109953480w*3 - 72w*2 + 2 What is the first derivative of 8i*3r + 403016153i3 - 3682469ir2 wrt r? 8i*3 - 7364938ir What is the third derivative of 355s*5 - 7s*4 + 454s*3 - 9882s*2 wrt s? 21300s*2 - 168s + 2724 What is the first derivative of -148426572n4 + 6786237 wrt n? -593706288n*3 Find the third derivative of -6182qu6 - 20qu3 + 117qu2 + 2qu - 4q + 3u + 6 wrt u. -741840qu3 - 120q What is the derivative of -2f2g*3 + 20276f*2g + 19f + 15g*3 + 304g*2 - 61g - 1 wrt f? -4fg*3 + 40552fg + 19 What is the second derivative of -41450272j*2 - 49697469j + 2 wrt j? -82900544 What is the second derivative of 2uy*2z + 776912uy*2 - 3uy - 19991yz + 8y wrt y? 4uz + 1553824u What is the third derivative of -13f*3r*3 - 53495f*3 + 20569f*2r*3 + 10fr3 + 675fr2 wrt r? -78f*3 + 123414f*2 + 60f Find the third derivative of 15639534w3 + 4w*2 + 11464079 wrt w. 93837204 What is the first derivative of -2j*4 + 879j*3 + 2j*2 + 42j - 5124685? -8j3 + 2637j*2 + 4j + 42 Find the third derivative of lm5 + 2700353lm4 - 1878lm2 - 591m*2 - 18 wrt m. 60lm2 + 64808472lm What is the first derivative of -76482053x*3 - 2x*2 - x - 95644807? -229446159x*2 - 4x - 1 What is the second derivative of 909832f5 + 22f*3 + 49222558f wrt f? 18196640f3 + 132f Find the third derivative of 6336124t6 + 6t*2 + 75206 wrt t. 760334880t*3 What is the third derivative of 183574s*2w*3 - 582s*2w - 54sw*6 - 58251sw2 wrt w? 1101444s*2 - 6480sw3 Differentiate -3bt2 + 250477620bt - 178t*2 - 118341t - 1 wrt b. -3t2 + 250477620t What is the first derivative of 251805759d + 230799946 wrt d? 251805759 Differentiate -2600911h*2v*2 + 2h*2 + 3634736v*2 + 2v + 1 wrt h. -5201822hv*2 + 4h Find the second derivative of 2b2r*2 + 3b*2r + 95547571br*2 + 63br + 3503b + 2r2 + 2r + 1 wrt r. 4b2 + 191095142b + 4 What is the third derivative of 7384232c6 - c3 - 39c*2 + 360c + 357? 886107840c3 - 6 Differentiate -3440r*3t + 63r2t - 6rt - 5883t + 889 with respect to r. -10320r*2t + 126rt - 6t Find the third derivative of 23f*3lz + 5781f*3l + 391f3z*3 + 148f*3z*2 - 466flz*3 - 2fz2 - 4lz3 wrt z. 2346f*3 - 2796fl - 24l What is the derivative of -521004755k - 121994210 wrt k? -521004755 Differentiate 6593451y*3 - 7668891 wrt y. 19780353y*2 What is the derivative of -245374100r*4 + 316013851? -981496400r*3 What is the third derivative of 45234537g*3l*3 + 503g*3l*2 - 289664g*3 wrt l? 271407222g*3 Find the first derivative of -7386063d*3 - 1237891 wrt d. -22158189d*2 What is the third derivative of 14796256h*5 - 5h*4 + 463839186h*2 wrt h? 887775360h*2 - 120h What is the third derivative of -1066498201o4 - 951825433o*2 wrt o? -25595956824o What is the first derivative of -355911073f4 + 236985572 wrt f? -1423644292f*3 Differentiate 7022490w - 1699709. 7022490 Find the third derivative of -457ij*4q*2 - ij*2q - 2iq*2 - 289i - 222655j3 + 8j*2q*2 - 1473q - 2 wrt j. -10968ijq2 - 1335930 Find the third derivative of 417665917k*3 - 431313237k*2 wrt k. 2505995502 Find the second derivative of -445l*3s*2 + 125l*3 - 266l*2s*2 - 14334ls + 3l - 14s2 wrt s. -890l*3 - 532l*2 - 28 What is the second derivative of -37021253s*2 + 1552606s - 10 wrt s? -74042506 Differentiate 1062m2nq + 19m*2n + m*2 - 37395mnq - 408m + 6502n + 2 wrt q. 1062m2n - 37395mn What is the third derivative of a*2d*3p + 9a2d*3 + 4377a*2d*2 + 3a*2dp - 6a*2p + 2a - 113279d*3p - 2p - 2 wrt d? 6a*2p + 54a2 - 679674p Differentiate 51143692w2 - 67135461 wrt w. 102287384w What is the third derivative of -110067f6 - 182f*4 - 3220621f*2 - 27f? -13208040f3 - 4368f What is the second derivative of -b*2wy - 4b*2w - 13b2y*2 - 4230bwy + 7bw - 936by*2 + 2by + 8b - 5wy*2 - 158y*2 wrt y? -26b*2 - 1872b - 10w - 316 Find the third derivative of -6085662f*3g*2y - 3f3g*2 + 2f*2gy + 69f*2y + 7fg*2 + 2g*2y - 117gy - 20g wrt f. -36513972g*2y - 18g2 Differentiate -636284256s*2 - 870008282 with respect to s. -1272568512s What is the third derivative of 8u4z + 1580304u3z - 12u2z - 4u2 + 6u + 36491z wrt u? 192uz + 9481824z What is the third derivative of 8042931b4 + 3b*2 + 3b - 286404? 193030344b Find the first derivative of 6z*3 - 43662946z*2 - 13715909. 18z*2 - 87325892z What is the second derivative of -18067j3m - 7j*3 + 2	{ "pile_set_name": "DM Mathematics" }
/(-4))/(j/(-24)). Is c at least 3? True Let n be (((-40)/15)/(-8))/(2/36). Let g(w) be the first derivative of -w*4/4 + 2w*3 + 6w - 1. Let s be g(n). Which is bigger: 5 or s? s Let m(z) = z*2 + 6z. Let k be m(-5). Let v = -17 + 10. Let r be k/(-4)v/(-35). Are r and 1 non-equal? True Suppose g + 4g = -5. Suppose -5x + 6 = 1. Let q be -5 + x - (-2 - 0). Is g not equal to q? True Suppose -f = -3f - 4, 5q + 12 = -f. Let w = -0.3 + 0.31. Which is bigger: q or w? w Let l(y) = 8y - 1. Let o be l(1). Suppose -16 = 4n, -n = -2m - 0n + 20. Do o and m have different values? True Let b be ((-2)/(-3))/(2/(-6)). Let z be b/(-5)(-2)/(-4). Let q = 2 + -2. Is q != z? True Let t = 74 + -84. Is t less than 2/7? True Let b be 0/((-3)/(2 + 1)). Suppose 3r - 4v = b, -3r - v = v. Which is bigger: 1 or r? 1 Let j(x) = 9 + 0x - 4x2 + 5x*2 + 6x + x. Let l be j(-7). Let p = 10 - l. Which is smaller: p or 3/7? 3/7 Let d(z) = -z*3 + 5z*2 - z + 6. Let c be d(6). Let n be 22/18 + 8/c. Is n >= 2? False Suppose -5i - 3p = 0, 4i + p = -0i. Which is greater: -4/7 or i? i Suppose 3d = 3y + 48, -5d = 6y - y - 70. Let c be d/(-1000)(-334)/(-21). Let b = -2/175 + c. Which is smaller: b or 0? b Let l be 0(1 - 1/2). Let t be 5 - ((-18)/(-8) + 4). Which is bigger: t or l? l Suppose 0 = -5l - 3l + 120. Which is bigger: 3 or l? l Suppose 3x + 8 + 52 = 0. Is x greater than or equal to -20? True Suppose 3l = 8l - 4b - 12, -4l - 3b - 9 = 0. Suppose l = -2r - 3r. Suppose rd = 2d - 2. Are 1 and d equal? True Let j(x) = -x2 + x - 2. Let a be j(2). Let y = 46 - 95. Let z be 14/y - (-66)/(-14). Which is greater: z or a? a Let t(a) = a2 + a - 1. Let h be t(-1). Suppose -4k = -5l + 21, -5l + 23 = -2k - 0k. Which is bigger: k or h? k Suppose q - 2q + 7 = 0. Is 19/3 greater than or equal to q? False Let j = 0.79 + 4.36. Let q = j + -0.15. Is 0 less than or equal to q? True Let i = -113 - -87. Is -27 at least i? False Suppose 0a - 196 = -2a. Suppose -64 = -3t + a. Let m be (3/(-10))/(t/(-30)). Which is bigger: m or 1? 1 Suppose -a - 1 = f - 0a, -4f - 6 = 5a. Is 2/61 equal to f? False Let s = 43 + -25. Suppose -r = -t + 6, -r - 8t = -3t - s. Let h be (r/(-6))/(-4 + 3). Which is smaller: h or -1? -1 Let o = -11/20 - 1/5. Suppose g + 3 = 0, -4z + 4g + 24 = -0g. Suppose m + 2m - 6 = -zs, -2s + 8 = -2m. Is o greater than or equal to m? True Let g(z) = z*3 - 5z*2 - 9z + 12. Let p be g(6). Let m be 6/3 - (-36)/(-4). Which is smaller: p or m? m Let d be (-1)/(-10)(-711)/(-6). Let u = d + -49/4. Which is bigger: 2 or u? 2 Suppose -4x + 4 + 4 = 0. Let i be (-10)/x60/75. Let c(h) = h2 + 4h - 5. Let g be c(-4). Which is greater: i or g? i Let l = 0.9 + -0.2. Which is bigger: -1 or l? l Let w be (2/5)/((-4)/(-40)). Suppose 4h = -0 - w. Is h greater than or equal to -1? True Let m = -0.15 + 0.05. Which is greater: 1/17 or m? 1/17 Let c be (-5)/(-6)6/20. Let p be 10/(-35) - 29/(-28). Which is smaller: c or p? c Suppose 4g + 4d = 24, 0 = 2g - g - 3d + 6. Suppose -5 = -k - 2o, 8 = o + go. Is k at most as big as 1/20? False Let d = -8.6 + 1.6. Let b = d - -9. Which is bigger: b or -0.1? b Let t = 61/15 - 17/5. Which is smaller: 1/2 or t? 1/2 Let i = 1 - 1.03. Let y = i - -0.13. Let c = -1 - -0.8. Is c <= y? True Let k = 20 + -19. Is k smaller than 0? False Let z(f) = 3f2 + 4f + 5. Let m(t) = -2t2 - 3t - 4. Let c = 3 + -7. Let o(i) = cm(i) - 3z(i). Let w be o(1). Which is smaller: w or -1? -1 Let n(q) = -73q3 + 2q + 1. Let j be (-4)/6 - (-2)/(-6). Let f be n(j). Let p be (-3)/1 + f/28. Which is smaller: p or -1? -1 Let b = 1 - 0.1. Let n = -0.1 - b. Let l = 3 - 1. Is n smaller than l? True Suppose 5j + 0j = -5w, 5j - 4w - 27 = 0. Let l be (6/j2)/18. Let k be ((-1)/5)/((-2)/5). Which is greater: k or l? k Let p be (-3 - -1)/(36/201). Let g = -21/2 - p. Suppose 4l - 11 = -3. Which is smaller: l or g? g Suppose 3r + 3k = 21, 3k = 3r - k + 14. Suppose 6 = -6x + x + 4q, rx - 3q + 1 = 0. Is -7/5 at most x? False Suppose 11 = -11p + 11. Let q be 5 + 0/2 + -2. Is q less than p? False Let n = -2 + 4. Suppose -2r + d = -d + 2, 5d - 15 = 0. Is r at least as big as n? True Suppose 29 = -13g - 23. Suppose 4s + 25 = -s. Which is greater: g or s? g Let d = 0.08 - -0.01. Let g = d + -0.19. Which is bigger: g or -0.3? g Let g be (0 - -7) + -3 + -3. Are -3/29 and g nonequal? True Suppose 0 = -2f - v + 10, 4v + 13 = 4f + 5. Suppose 7y - fy + 3 = 0. Let u = 4 + -4. Which is greater: y or u? u Let v = -1.1 + 1. Which is smaller: v or 12? v Let t be (0 + -2)/((-8)/(-12)). Is t <= -3/2? True Let v be (-5)/1023. Suppose 0 = y - 1, -5m + 14 = -2m - y. Suppose h - k = 5h + 12, -3k = mh + 22. Which is greater: v or h? h Suppose 3s = 5s - 24. Is 12 at least s? True Let l = 6 - 5. Let t be 51/(-2) + -21. Let v = t - -28. Which is bigger: v or l? l Let d(u) = -6u - 15. Let m be d(-5). Is 13 <= m? True Let n = -21 - -9. Let y = 6 + n. Do y and 0 have the same value? False Let v(a) = -a - 5. Suppose 3z - 3k + 6k - 27 = 0, 5k = 25. Suppose f = -zf - 30. Let l be v(f). Is l > -1? True Suppose 6d = 2d. Is d smaller than 0? False Let j be 18/3 + -3 - -68. Let s = j + -356/5. Suppose -3w + 2w - 1 = 0. Are w and s nonequal? True Suppose 5d + 41 = -5v - 79, -2v - 26 = d. Let g = 65/3 + d. Does 1/4 = g? False Suppose f - 3o = -7, 9o = 5f + 4o + 5. Suppose fc = -0c. Are c and -2/3 nonequal? True Let c be (126/(-27))/(2/3). Is -7 > c? False Let x = 3.5 + 1.5. Let w = -6 + x. Which is greater: 3 or w? 3 Let r be 0/((1 + -3)/(-2)). Suppose v - 4a - 14 = r, -4v + 2a + 16 = v. Suppose -t - 28 = -29. Which is smaller: v or t? t Let o be (-2)/3(6 + -9). Which is bigger: o or 5? 5 Let p = -124/17 - -193/34. Let y = 3/170 + p. Which is bigger: y or -0.1? -0.1 Let r(y) = -y*3 - 2y*2 - y + 1. Let d be r(-2). Let p = 3 - d. Suppose j + 0j = p. Is j not equal to 1? True Suppose 3u = 1 - 1. Is u not equal to -1/9? True Suppose -5t + o = -35 + 7, -20 = -2t - 4o. Let h = -19 + 13. Let j be (-2)/t(-4 - h). Is 1 at most j? False Let k(x) = -25x*3 + 11x*2 + 3x + 2. Let m(p) = -13p3 + 6p*2 + 2p + 1. Let g(w) = 4k(w) - 7m(w). Let j be g(1). Is j < -9? False Suppose 0 = 4r + 2 + 2. Let y = 5 - r. Let g be (y/(-4))/(2/4). Which is smaller: -4 or g? -4 Suppose 0v = 2v - 3a + 1, -v - 3a + 4 = 0. Which is smaller: -2/25 or v? -2/25 Let i = 11 + -9. Suppose -14r + 3r - 44 = 0. Which is smaller: r or i? r Let q(y) = y2 + 16y + 27. Let a be q(-13). Are -12 and a unequal? False Let v = 175 + -1577/9. Let s = 3 + 6. Suppose -r = -4a - s, 4a + 7 + 1 = 0. Is r at most as big as v? False Let i be 6/(-8) - (-46)/8. Suppose 0 = 3w + 2 - i. Is 1 equal to w? True Let a be 2 + -1 + (-4 - -5). Let d be -421/(-2). Suppose -3x + 1 = 4s - 3, -2x - as = -d. Is x < 5? True Let z(t) be the second derivative of -t4/12 + 2t. Let o be z(0). Which is bigger: -0.4 or o? o Suppose 2r + 1 = o, -2r = -5o - 1 - 2. Which is smaller: o or 2/9? o Suppose s - 1 = r, 0 = -3r + r + s. Suppose 0h + 10 = 2h. Which is smaller: h or r? r Let w = -381/14 - -55/2. Let v = -18 + 15. Let a = -2 - v. Does a = w? False Let s = -9 - -7.6. Let w = -0.4 - s. Which is smaller: 1/5 or w? 1/5 Let l = -56/75 + -48/25. Is -3 less than l? True Let a = -67 + 70.7. Let y = a - -1.3. Which is smaller: 0.1 or y? 0.1 Let q be 2 + (2 - -2 - (-84)/(-15)). Is 7 greater than q? True Let k = -12/85 + -1/17. Let d = 3 + -2. Which is greater: k or d? d Let x = 6 - 3. Suppose -u + d = 1, -xu + 6u - 4d + 2 = 0. Is u not equal to -4? True Suppose 0 = -6i + 3i. Let h = -1 - i. Which is greater: h or -1/3? -1/3 Let z(y) = -y2 - y - 3. Let d be z(0). Let o be -3 + (d - (-3009)/168). Let l = o - 86/7. Is 0 <= l? False Let w = 1.8 + 0.4. Let r = 1.2 - w. Is -2 smaller than r? True Let a be (-16)/6(-3)/(-2). Suppose -f - 10 + 4 = 0. Let s be 22/(-5) - f/15. Is a less than s? False Let r be (-471)/237 + 0 + (1 - -1). Is 0 at least as big as r? False Let q(j) = j*2 - 9j + 7. Let f be q(8). Let y = f - -5. Suppose 4 = c - 3u + 5, 3c = -3u + 21. Are y and c non-equal? True Let l(p) be the second derivative of p5/20 + p4/12 + 4	{ "pile_set_name": "DM Mathematics" }
9)/70). -2/109 What is (27 + -42 + 24)((-419)/(-36) + (-3)/(-12))? 107 What is the value of 36 + 1910/(-90)9? 17 What is (-15)/180(-138)/((5 - 2)-1)? -23/6 What is 402/10(-67 + (-1612)/(-31))(-4)/36? 67 ((-115440)/(-105))/74 - 12 20/7 Calculate 2014/20143/345/(75/(-10)). -1/17 (-315/9)/(50/44) -22/5 ((-10)/6)/(-42 + 4305/140) 4/27 Evaluate ((-10)/(-6) + 2)/(2782/85811 + -36). -11 What is ((-4767)/540 - -6) + (-2)/(-72)? -14/5 Calculate (-9)/(-6) - (34344/48)/159. -3 What is the value of (18/15)/(86788/1105 + (-16)/(-272))? 2/131 Calculate -97 + 64 - 243/(-9). -6 What is the value of (38/(-2) - 0)(196 + -267 + 70)? 19 Calculate (-5711 - -5747)/(2(-2 - 5/(-3))). -54 Evaluate 16/40 + 483/(-630) + (-1)/3. -7/10 Calculate ((-44)/8)/(8/16) - -7(-3813)/(-287). 82 What is (-132)/(-5214) - 28456/632? -45 (-100)/(-42)-1(-35)/(-25)-2 20/3 -59 + (29 - -6) - -24 0 Calculate ((-27)/12)/((-1434)/(-40152)). -63 Evaluate (-16 + 15/1144512229)(9 + (-52)/6). 1/109 What is 10 + (0 + 39 - ((-28)/560)/((-7)/140))? 48 What is 23/(161/(-21))(-51)/((-33048)/48)? -2/9 Evaluate (-24288)/6578 - ((-24)/26)/(-3). -4 Calculate ((-30)/84)/((-16)/(-56) + 1720/(-1120)). 2/7 Calculate (-1014/(-40))/28 - 6/(-80). 1/5 What is the value of (5508/(-126) - -44)/(-1 - (-148)/140)? 5 What is 189/(-54)4/10155/(3/(-3))? 2/29 What is the value of (48/372)/((-6855)/(-14167))? 4/15 Calculate 0/(182/(-12))1. 0 Evaluate (-15102)/(-486) + 46/(-621). 31 Calculate (-35 + 12 - -53) + -5. 25 What is (-554)/(-3047)(-2420)/1672? -5/19 What is 260/(-182)((-16188)/1704 + 16/(-12))? 25 Evaluate 9/42 - (36850/2940)/55. -2/147 What is the value of (117/975)/(246/(-60) + 6 - (-2 + 0))? 2/65 ((-182)/260)/(-25 - 7 - -25) 1/10 -7 + (-6517)/(-203) - (92 + -67) 3/29 What is the value of ((-37595)/(-6205))/(27/459)? 103 Evaluate 1039554/2049366/36. 93 Calculate ((-14)/(-6) - (-355)/(-213)) + (-4)/3. -2/3 What is the value of (12662380/2013)/(-214)(-6)/(-35) + 5? -3/77 Calculate -517 + 543 + (377/(-15) - 1). -2/15 -5 + 6 + -11 - -3(-4 - (-928)/120) 6/5 What is (((-945)/(-18))/21)/(25/(-280))? -28 Evaluate 12/27(20/2000-6)/(2/(-10)). 2/15 What is the value of (-91)/(-78)(-36)/(-63)(-47 - -38)? -6 What is 50/(-225) - 2090/396? -11/2 What is the value of (-1692)/(-54)((-2)/(-12))/((-5)/45)? -47 Evaluate ((-1)/(-5))/(50639/(-551260) - (-1)/20) - -4. -7/9 (117/(-1287) - (-524)/(-44))(624/(-90))/(-8) -52/5 What is ((-14)/((-420)/(-50)))/(146/21 - 7)? 35 Calculate (-7)/(-3) - (-23464)/1257. 21 Calculate ((-47502)/10556)/(9/(-28)). 14 (-33)/(31/(2976/(-72))) 44 (-9844)/128 - (-1737)/(-18528) -77 Evaluate (-69)/(-5800 + 4)(-1 - 1). -1/42 (-2575)/721 - 12/(-7) -13/7 Calculate ((-84)/(-6) - 19)(-504)/2800. 9/10 What is 2660/(-420)(36 - 45)? 57 What is 16/(-1080) + 1192(-232)/(-4320)? 64 Evaluate (-464)/14 + (-18810)/(-399) + -46. -32 Calculate 156240/(-66960)(18/(-7) + 0). 6 What is (11305/(-19))/85 - (-1)/2-22? -18 (3/((-870)/(-4)))/(30264/(-520) + 59) 1/58 What is ((-18)/(-4))/(1474818/206992)? 12/19 What is the value of -30 - (36 - 271)/5? 17 Evaluate (-6)/(1008/(-3458)) - (-7)/((-35)/100). 7/12 Calculate (-31104)/24494437. -8/3 What is the value of ((-14000)/1500)/(12/(-72))? 56 What is ((-4)/12)/((-17290)/1470) + 4/(-38)? -1/13 91 + 33(114/22 + -5) + -22 -7 Calculate 155/341 - (1 + 14546/154). -95 What is (12/20)/((-2529)/2810)? -2/3 (2124/(-14160))/((42/455)/(-1)) 13/8 Evaluate (257 - 265)/(((-75)/(-18) + -4)24/(-42)). 84 What is the value of (-63)/70(-25)/(-60) + (13 - (-49374)/(-3888))? -2/27 (351336/(-292780))/(-22(-1)/(-5)) 3/11 161/294 - (-1)/(-2) - ((-21519)/567 + -21) 59 Calculate ((-339)/(-57))/(-285 + 283) + 3/1. 1/38 What is the value of ((-61)/(-244))/((-1)/92)? -23 Calculate (-912)/4256 - (2 - 349/126). 5/9 What is (-10)/26 - 6516/(-677664)? -3/8 Calculate (-66)/(-5)(460/20 - (-649)/(-33)). 44 Calculate 0 - -4(32 - (-49 - -100)). -76 Calculate (165/22)/((-39)/44 + 224/(-616)). -6 What is the value of (-813)/(-1897) + (10412/(-665))/2? -37/5 (2/2 + -31)((-1501)/57)/79 10 What is (-1588)/(-6749)(-34)/(-26)? 4/13 What is the value of 34 + -44 + ((-43195)/(-1995) + -11 - 4/6)? -2/133 Evaluate (-790)/26 + 2813146/14162. -18/13 What is 9/24(-11813 + 11815)? 36 (640/4)/8 - (-401 - -419) 2 Evaluate -5 + 728/80 - (-7)/210-3. 4 What is the value of (-3)/10 - (615/287)/(60/(-70))? 11/5 Evaluate ((-50)/(-4550))/((-35)/(-65)). 1/49 What is the value of 559580/79940(-1 + (-76)/(-7))? 69 (69 + -26)/((-8)/(-8 - 0)) 43 343/(-7203) + ((-1914)/(-504) - 2) 7/4 Calculate -3 - (2 + -4)/((-105)/105)22/(-4). 8 Evaluate (((-16)/42)/(5/75))/((-26312)/230230). 50 602 - 431 - (-10 - -86) 95 What is the value of 486 + (-3358442)/6001 - (12/34 + 0)? -74 What is the value of (-269378)/322960 - (-20)/22? 3/40 What is (-2)/8 - (2 - 1 - (-102312)/4704)? -23 Evaluate (54 - (-11968)/(-224)) + (0 - 750/14). -53 (0 + 10)/(9575/(-11490)) - 10(2 + -1) -22 ((-2)/6 - (-90)/(8100/(-330)))(10 + 1) -44 78 + 167/(2004/72) 84 Calculate (10/(-12)(-16)/96)/((-48)/(-72)). 5/24 What is 196/(-70) - (-7)/((-6090)/(-2496))? 2/29 Evaluate (-40)/8 - (-725)/29. 20 ((-19176)/1600 - -12)36/814 2/75 Calculate (-12 - (-104)/39)/((-2144)/603). 21/8 Calculate 10/1 + (4 - ((-1920)/340 - -20)). -6/17 Calculate -4((-6)/(-16))/((-18720)/(-960)). -1/13 Evaluate -52 + 25681/488 + (-129)/(-24) + (0 - -128). 134 Calculate (-53)/(1590/820) + 31. 11/3 What is the value of (-4)/2158/16 + 25515/(-11340)? -22 What is (1(-2)/(-13) - -2)-732/448? -14/13 7320/(-520) - -14 - ((-3532)/(-52))/1 -68 Evaluate 12/(-16) - ((-353)/1224 + (-1532)/(-6894)). -1/17 Calculate 29/(812/28)(-7 - 325/20). -93/4 (54/5)/(((-68)/16 + 4)48/(-60)) 54 (5728/12)/4 + 64558/(-14898) 115 What is 15 - (-10 + (-43)/(-301) + (-7695)/(-231) + -11)? 28/11 What is the value of (-52)/(-260)-15 - -11? 8 What is (2/(-10) - 18/(-40))/((-4172)/112 + 35)? -1/9 What is the value of 295137/21114 + (-6)/(-276)? 14 Evaluate (6256/(-1632))/((-1)/(-18)). -69 What is the value of (-13038)/(-164) + -80 + 6/20? -1/5 (-6858)/(-26289) - 6297/69 -91 What is ((-142)/(-5183))/(168/448 + 26/16)? 1/73 What is ((-410)/(-15))/((-46)/483-7)? 41 Calculate (-12)/(-58)426/2556-2. -2/29 Calculate 19/(342/(-12))186(-7)/(-28). -31 Evaluate (-140)/(-98)(-413)/(-649). 10/11 What is the value of (1624/(-609))/((-8 - (-1089)/135)/((-18)/(-10)))? -72 What is 8/14 - 1 - (-3237)/45530/78? 30/13 What is 70/(-14) - -35 - 72? -42 33824/(-348810)(-45)/(-12) -4/11 16776/712982/(-8) -1/17 What is 11/(231/(-2)) - (54 + 2296998/(-42525))? -2/25 What is the value of (-2 + -5)(-49 + 4485/92)? 7/4 Calculate ((-16)/24)/(23075/(-1278) + 18). 12 (-159)/(-12)-1(-3 + 4)(-1677 + 1673) 53 Calculate ((-16)/2 - -2) + (-5640)/(-1080). -7/9 What is 101/303-54 - 18? -36 What is (-12)/27(136 + -125 - (-313)/(-26))? 6/13 Evaluate (4/(-110) + (-8732)/207570)(-26 + 23). 4/17 Evaluate 8190/1476 + (-891)/(-54) + 4/(-82). 22 Evaluate (2/286/60)/(59 + (-3339)/56). -2/175 What is the value of -10 + 14 - 24/((-336)/(-182))? -9 20 + 8246/(-403) - 656(-1)/13 50 Calculate 418/44(-874)/(-361) + -83. -60 Evaluate 148 + -96 + 154/(-1). -102 (-12 + 576/54)/(50/6)-10 8/5 Evaluate ((-4)/(-3))/((-1924)/164502). -114 What is the value of -30(19 + (-444)/20 - (2 - 10))? -144 What is the value of 5360/(-899676)(-9)/(-15)-6(-1)/4? -2/373 Evaluate -98((-1 + 2)/6)/(-90 + (-18157)/(-201)). -49 Evaluate -10 + (13 - 210/10) + -14. -32 ((-79875)/4050 - (-3 + 75/27))(-2)/4 39/4 What is the value of (-26)/(-25350)5012? 8/13 Evaluate (-2516/100)/(6/(-63)). 42 Calculate (-53)/3445013-4. 2/25 19 + (-10724)/564 - (-1249982)/(-8742) -143 Evaluate (170676/(-93096))/(((-4)/(-6))/(14)). -11 What is the value of (200/9760)/(27 + 3798/(-144))? 2/61 (340 - 339)((-3 - 1)1 - 36/(-20)) -11/5 Calculate ((-184)/108)/(114/(-1539)). 23 What is the value of (-1)/11 + (-9)/33582(-15)/(-540)? -9/2 What is (18/1995)/(282/6580)? 4/19 What is the value of 1(4 + 132/(-28)) - (-10411)/7539? 2/3 Calculate 14/(-6)(-2889)/5778. 7/6 (-14 + 1216/84)/(-8*(-6)/42) 5/12 -2 + (-463)/(-42) + 949/(-78) + (-18 - -30) 62/7 3/((5313/552)/(-77)) -24 -7 + (218 + -248 - (53 - 5)) -85 7 - (2164 - 2167)/(4/(-18) - 129/(-216)) 15 21084	{ "pile_set_name": "DM Mathematics" }
82 for f. -42 Solve -49j - 31j + 8j + 125 = 701 for j. -8 Solve 111y + 2629 + 1665 = -2699 for y. -63 Solve -50f - 27737 = -64f - 27009 for f. 52 Solve 11w - 1859 = -928w - 291w + 1831 for w. 3 Solve 13994 = 1275l + 109619 for l. -75 Solve -254b = -4301 - 2557 for b. 27 Solve -73l - 257l + 10548 - 7484 = -22676 for l. 78 Solve -113121 - 167491 = 3844w for w. -73 Solve 0 = 4178a - 4213a + 735 for a. 21 Solve 2060g + 9271 + 6138 - 6880 + 14131 = 0 for g. -11 Solve 144c + 280467 = 280035 for c. -3 Solve 85w + 2219 + 656 = 70 for w. -33 Solve 596d = 8864 - 2308 for d. 11 Solve 29363y + 18352 = 29611y for y. 74 Solve 670j + 39708 + 31312 = 0 for j. -106 Solve -523f = 98f - 106f + 21115 for f. -41 Solve -2985m + 12m - 28035 = 778m - 636m for m. -9 Solve 10z + 18599 = 18349 for z. -25 Solve -6444 - 3553 = 558q - 1069 for q. -16 Solve -2334c + 2333c + 26 = -45 + 11 for c. 60 Solve 3968 = -1339f - 11567 - 8567 for f. -18 Solve 27w + 30w + 15120 = 537w - 48w for w. 35 Solve 0 = 3a + 54a - 2196 + 372 for a. 32 Solve 82720 = -1367m + 4304m + 823m for m. 22 Solve 0 = -627d + 5538 + 24845 - 1541 for d. 46 Solve -397n + 12137 - 3006 = 0 for n. 23 Solve -432w + 858w + 90 = 432w for w. 15 Solve -38995 - 1978 = 887z - 171 for z. -46 Solve 2765n + 60311 + 225910 = 6956 for n. -101 Solve 211z + 14 = -14 + 40 - 12 for z. 0 Solve -41b - 327b - 334b = 358b - 44520 for b. 42 Solve -570y + 20946 = -1854 for y. 40 Solve -2848 = -1619x + 1530x for x. 32 Solve -144677l - 12464 = -288974l + 144601l for l. -41 Solve -288t - 355t - 11935 - 6898 = -1472 for t. -27 Solve -641y - 37180 - 87644 = -826y - 1301y for y. 84 Solve -670c - 13376c = -463518 for c. 33 Solve -233g - 22943 - 10744 = 164g + 1376g for g. -19 Solve 842w = -1402 + 33398 for w. 38 Solve 289l = 4556 + 4060 + 120 + 4847 for l. 47 Solve -49a = 2a + 17a - 4a + 1344 for a. -21 Solve -664c + 622c + 75992 = 1246c for c. 59 Solve 0 = 2584b - 578b - 22066 for b. 11 Solve -15731g + 15934g = 3045 for g. 15 Solve 273580 - 286069 = -543g for g. 23 Solve 100c = -c - 32c - 12103 for c. -91 Solve -127h = -15416 + 12114 for h. 26 Solve -14935p + 14790p = 5945 for p. -41 Solve -1513h - 3391 = -4904h for h. 1 Solve -934v - 11089v + 478128 = -2062v for v. 48 Solve 0 = 3h - 1271h + 243h - 30750 for h. -30 Solve 152x + 161x + 140x + 1700 = 385x for x. -25 Solve 42037q - 4629 = 42122q + 981 for q. -66 Solve -4317o + 144495 = 133518 - 239409 for o. 58 Solve 10799 = 38z + 9013 for z. 47 Solve 35738k - 3801k + 3864377 = 0 for k. -121 Solve 1593 - 13113 = -491n + 15485 for n. 55 Solve 321z = 808z + 6570 + 5605 for z. -25 Solve -34631 = -2112q - 2471q + 52446 for q. 19 Solve -96m - 379m + 111m - 22820 = 451m for m. -28 Solve -2391v + 32319 = -24177 - 8025 + 11919 for v. 22 Solve 5015y - 85079 = -397017 - 64187 for y. -75 Solve 549 + 4677 = -2613u for u. -2 Solve 6305g + 5694 = 2164g + 2305g + 2055g for g. 26 Solve -768257j + 2690 = -768526j for j. -10 Solve -1586a - 16607 + 72770 = -46927 for a. 65 Solve 21977 - 21177 = 200q for q. 4 Solve -876w - 140598 = -2739w - 958w - 24937 for w. 41 Solve 56302 - 67182 = 145g + 15g for g. -68 Solve -98j + 210 = 41j - 2848 for j. 22 Solve -365q = -130q + 124q - 23335 for q. 65 Solve -89t = 131t - 282t + 1612 for t. 26 Solve 319v + 366 - 4666 = -43v + 4388 for v. 24 Solve -909j + 958j - 2499 = 0 for j. 51 Solve 0 = 528f - 3330f + 148506 for f. 53 Solve 2604 = -106g - 433 - 5549 for g. -81 Solve 1809 = 3051g - 3252g for g. -9 Solve -577s - 10925 - 16305 = -1289s - 2011s for s. 10 Solve 2595g = 2427g + 3696 for g. 22 Solve 29645 = -37448w + 36601w for w. -35 Solve 0 = -813u - 101946 + 69426 for u. -40 Solve 201r - 4r = -709r - 192r - 5490 for r. -5 Solve 31436u + 7 = 31467u - 861 for u. 28 Solve 3668z + 20601 = 2687z for z. -21 Solve 6463o - 133 = 6564o + 69 for o. -2 Solve 1187g + 68979 + 39337 = 7421 for g. -85 Solve 7x + 191 = -5x + 107 for x. -7 Solve 260d = -11520 + 87 - 6507 for d. -69 Solve -2272p - 2989 = -1845p for p. -7 Solve 193f - 853 = -3555 for f. -14 Solve -12808n + 12134n + 17524 = 0 for n. 26 Solve -22152v + 24019v - 52276 = 0 for v. 28 Solve -78806t + 79000t = 5238 for t. 27 Solve -2430r - 3798r - 1900r + 808r = -376r for r. 0 Solve -25d + 2093 = 42d - 2004 - 1464 for d. 83 Solve 157j + 3715 = 4971 for j. 8 Solve 37u - 24u - 11136 = 188u - 34586 for u. 134 Solve -121k - 2124 - 1839 = 2934 for k. -57 Solve 14g - 30g - 2352 = 29g - 6267 for g. 87 Solve 10g - 212 - 324 - 186 = -122 for g. 60 Solve 5894 + 5850 = -3k + 11663 for k. -27 Solve -3060g - 2177g = -272324 for g. 52 Solve 26071a - 38744 = 26739a for a. -58 Solve 242f = -208f - 648f + 4392 for f. 4 Solve -128921q = -128912q + 396 for q. -44 Solve 3800z + 360899 = -887z for z. -77 Solve 216w + 16237 = 295w + 1170w for w. 13 Solve 92s - 93769 = -87053 for s. 73 Solve -317567 = -27044s + 1845953 for s. 80 Solve 1137h - 3289h = 3410h - 94554 for h. 17 Solve -1673g = 1448g - 3357g - 14868 for g. -63 Solve 0 = 808g - 786 + 436 - 5306 for g. 7 Solve 189f - 69f + 129f = 1494 for f. 6 Solve 30p + 31833 - 4863 = 507p - 42p for p. 62 Solve -7710j + 3224j = 462058 for j. -103 Solve -5766 = -484v + 39682 + 13719 - 13187 for v. 95 Solve 30680t - 812836 + 909933 = 2428777 for t. 76 Solve 45w + 23703 - 23478 = 0 for w. -5 Solve 6589 - 5052 = 13429y + 7020 + 7946 for y. -1 Solve 20q - 106314 - 18224 = 2847q - 2977 for q. -43 Solve 0 = -145p - 3047 - 5363 for p. -58 Solve -23r - 17r - 9066 + 17476 = 6770 for r. 41 Solve 4250043y + 84501 = 4249356y for y. -123 Solve -515o = 714o + 21359 + 8137 for o. -24 Solve -118 = -1576l - 12167 + 1017 for l. -7 Solve 3943g - 5421g = 6184 + 15986 for g. -15 Solve -961z + 133z - 155z - 81928 = 95z for z. -76 Solve 1916528i - 1916302i - 13108 = 0 for i. 58 Solve 205b - 5074 + 13923 = -16623 + 5382 for b. -98 Solve 385x = 4033 + 14062 for x. 47 Solve -21g = 407 - 327 + 424 for g. -24 Solve 32u + 155u - 460u - 11193 = 0 for u. -41 Solve -14y + 1270 = 53y + 35y + 25y for y. 10 Solve -290r + 38595 = 232r + 40 - 12601 for r. 98 Solve -283u = 237u + 20u + 11u - 8265 for u. 15 Solve -2384p - 65342 - 131250 + 86287 = 159087 for p. -113 Solve 879574q - 9653 = 879771q for q. -49 Solve 4809l - 4185l + 6443l = 297450 + 190173 for l. 69 Solve 4375t + 98712 = -115663 for t. -49 Solve -214c - 4513 + 30769 = -1855c for c. -16 Solve 12 - 10 = 18g + 2 for g. 0 Solve -417r + 25010 = 942r + 1907 for r. 17 Solve -439o + 240o - 49910 = 289o + 597o for o. -46 Solve 4824 + 3848 = 67j + 455 - 761 for j. 134 Solve 76z = 108z - 86z + 2 + 700 for z. 13 Solve 503030 = 3613r + 1274r + 1031r for r. 85 Solve 2958 = 160n - 2759 - 5803 for n. 72 Solve -183260 - 365710 = 6310d for d. -87 Solve -105616t + 105872t = 14592 for t. 57 Solve -18910l + 19188l - 27766 = -800 for l. 97 Solve 12215 = -124p - 158p - 67p for p. -35 Solve 8266o + 7917o + 3716947 = -1168o - 9780o for o. -137 Solve 40h - 381408 = 13872h - 680h for h. -29 Solve 3192p - 2787p - 590 = -4816p + 9852 for p. 2 Solve -3348l - 78395 = -114599 - 107760 for l. 43 Solve 49g + 3677 = 3005 + 1946 for g. 26 Solve -53154s - 14839 = -53363s for s. 71 Solve 576d - 11690 = -1872d + 42166 for d. 22 Solve 1568z = -2240 - 10304 for z. -8 Solve -8878g + 8654g + 13715 = 947 for g. 57 Solve -1539 = -7489y - 7495y + 15011y for y. -57 Solve -250478 = 182q - 241196 for q. -51 Solve -3991c + 6036 + 67628 = -149832 for c. 56 Solve 14r + 10408 - 20771 = -10223 for r. 10 Solve -3674r - 8198 = -989r + 2126r - 46686 for r. 8 Solve 91p + 7602 = 382p - 29355 for p. 127 Solve -39702n - 15028 = -40144n for n. 34 Solve -67810f - 9316 = -67536f for f. -34 Solve 13r - 26849 = 80r - 28591 for r. 26 Solve -1416 = -48r + 166r for r. -12 Solve 251m + 7m + 194m - 33804 = -174m for m. 54 Solve -31293 = 1731x + 67374 for x. -57 Solve 36538188d - 36538230d = 42 for d. -1 Solve -721v = 2645 - 31842 - 50113 for v. 110 Solve 197c - 63c + 120c = 34c - 23540 for c. -107 Solve 344*h +	{ "pile_set_name": "DM Mathematics" }
Round 1.3322167 to 1 decimal place. 1.3 What is 73164.22 rounded to the nearest 10000? 70000 What is 0.499183 rounded to 1 dp? 0.5 What is 2779423 rounded to the nearest 1000? 2779000 Round 1348.948 to the nearest ten. 1350 Round -0.02191493 to two dps. -0.02 What is 0.0002373173 rounded to 6 decimal places? 0.000237 What is 0.0002164855 rounded to 7 dps? 0.0002165 What is 0.001114143 rounded to five dps? 0.00111 What is -39762.58 rounded to the nearest one hundred? -39800 Round 87.329 to zero decimal places. 87 Round -54540830 to the nearest one million. -55000000 Round -8211698000 to the nearest one million. -8212000000 What is -1340165 rounded to the nearest 1000? -1340000 Round -4.537205 to 3 decimal places. -4.537 Round -232.166 to the nearest one hundred. -200 What is 0.123789 rounded to 3 decimal places? 0.124 What is 6.56151 rounded to 1 dp? 6.6 What is 479813 rounded to the nearest one hundred thousand? 500000 Round -0.15661782 to five decimal places. -0.15662 Round -0.0002806435 to six decimal places. -0.000281 Round -578625 to the nearest 100000. -600000 Round 0.000005538254 to six dps. 0.000006 Round -1795063 to the nearest one hundred thousand. -1800000 Round 1356.144 to the nearest integer. 1356 What is -38282.94 rounded to the nearest ten? -38280 What is 0.0000455535 rounded to 7 decimal places? 0.0000456 What is 0.020021 rounded to 4 dps? 0.02 Round 965154.1 to the nearest one hundred thousand. 1000000 Round -2514770 to the nearest ten thousand. -2510000 Round 6328.461 to the nearest one thousand. 6000 What is -2665.2157 rounded to the nearest 10? -2670 Round -122807120 to the nearest 100000. -122800000 Round -24833 to the nearest 100. -24800 Round -72.290796 to 2 decimal places. -72.29 Round -5.97089 to zero decimal places. -6 What is -949.24604 rounded to the nearest 10? -950 Round 0.00003479969 to five dps. 0.00003 Round -0.000277188 to 5 decimal places. -0.00028 Round 0.0533169 to two decimal places. 0.05 What is 67064.84 rounded to the nearest one thousand? 67000 What is 0.0630515 rounded to four decimal places? 0.0631 Round 0.00041571812 to 6 decimal places. 0.000416 Round 0.00006495989 to 5 dps. 0.00006 Round -2768.871 to the nearest 10. -2770 What is -7397360 rounded to the nearest 1000000? -7000000 What is 24896.31 rounded to the nearest one hundred? 24900 What is 776869500 rounded to the nearest 1000000? 777000000 Round 0.00057543048 to 7 decimal places. 0.0005754 Round 153.3322 to the nearest ten. 150 What is -0.01440127 rounded to 3 decimal places? -0.014 Round -10258.454 to the nearest 10. -10260 Round -291591.7 to the nearest one thousand. -292000 What is 119477.8 rounded to the nearest 10000? 120000 Round -4.105253 to 2 dps. -4.11 What is 1.15842 rounded to one dp? 1.2 Round 2.6305 to the nearest integer. 3 Round -0.0362914 to 3 dps. -0.036 What is -1543.68 rounded to the nearest one hundred? -1500 Round 371.7474 to the nearest ten. 370 What is 4.2307761 rounded to one dp? 4.2 What is 33437 rounded to the nearest 1000? 33000 Round -0.025080653 to four decimal places. -0.0251 What is 20538120 rounded to the nearest ten thousand? 20540000 Round 0.000120746 to 5 dps. 0.00012 What is -0.0001036937 rounded to six dps? -0.000104 What is 981650 rounded to the nearest one hundred thousand? 1000000 Round 2650300 to the nearest 100000. 2700000 What is -0.00231964 rounded to 5 decimal places? -0.00232 Round 0.0000063943 to 6 dps. 0.000006 What is -22973610 rounded to the nearest 1000000? -23000000 What is -3044.6731 rounded to the nearest one hundred? -3000 Round -182980100 to the nearest 1000000. -183000000 Round -837912 to the nearest 100000. -800000 What is -305162900 rounded to the nearest 100000? -305200000 Round -0.00005079012 to five dps. -0.00005 What is -539665.73 rounded to the nearest 1000? -540000 What is 28822205 rounded to the nearest ten thousand? 28820000 What is -0.018681 rounded to 5 dps? -0.01868 Round -791241.4 to the nearest 100. -791200 What is -789760 rounded to the nearest 100000? -800000 What is -0.0847607 rounded to 2 dps? -0.08 Round 321330.3 to the nearest one thousand. 321000 Round 0.000355649 to 4 dps. 0.0004 What is 0.0031970499 rounded to 5 decimal places? 0.0032 What is -766.321 rounded to the nearest ten? -770 What is 0.003464713 rounded to 4 decimal places? 0.0035 Round -0.0000203165 to 6 decimal places. -0.00002 Round 0.00001592681 to seven dps. 0.0000159 Round -68357100 to the nearest one million. -68000000 Round -125.86141 to zero dps. -126 What is -6058660 rounded to the nearest 1000000? -6000000 Round -0.0001983074 to seven decimal places. -0.0001983 Round 0.05690379 to 3 decimal places. 0.057 Round 299743.59 to the nearest 100000. 300000 Round 167773 to the nearest 10000. 170000 What is 244363.8 rounded to the nearest 1000? 244000 What is 0.00586052 rounded to three dps? 0.006 Round -74550210 to the nearest 100000. -74600000 What is 6.8091 rounded to two decimal places? 6.81 Round -410.26828 to the nearest ten. -410 Round -2073.1417 to zero decimal places. -2073 What is 29.70243 rounded to 1 decimal place? 29.7 Round -19999510 to the nearest 1000000. -20000000 What is -0.0000226871 rounded to six dps? -0.000023 Round 0.0023406185 to 6 dps. 0.002341 Round 281564.37 to the nearest one hundred. 281600 What is 0.00020713 rounded to 5 dps? 0.00021 What is 4.56943 rounded to 0 decimal places? 5 What is -20.74 rounded to the nearest 100? 0 Round 0.0877738 to four dps. 0.0878 Round 0.000590828 to six dps. 0.000591 Round 138.689 to the nearest 10. 140 What is 21611100 rounded to the nearest one million? 22000000 What is -0.0002115508 rounded to seven decimal places? -0.0002116 Round -36205.56 to the nearest 1000. -36000 Round 14.310928 to 1 dp. 14.3 What is 0.0858202 rounded to 2 decimal places? 0.09 What is 59335.7 rounded to the nearest 100? 59300 What is -277667510 rounded to the nearest 1000000? -278000000 What is 0.15188623 rounded to 4 dps? 0.1519 What is -225.5969 rounded to the nearest ten? -230 Round -0.006839883 to 6 dps. -0.00684 Round -0.00000769267 to six decimal places. -0.000008 Round 32715350 to the nearest one hundred thousand. 32700000 What is 1.586301 rounded to 2 dps? 1.59 Round 2563.557 to the nearest one thousand. 3000 What is 0.0011292418 rounded to five dps? 0.00113 Round 0.02727636 to 4 decimal places. 0.0273 Round 7532217 to the nearest 1000000. 8000000 Round -1.86873 to one decimal place. -1.9 Round -0.001146752 to 4 decimal places. -0.0011 Round -382.564 to the nearest integer. -383 What is -5054.8867 rounded to 0 dps? -5055 What is 14.02439 rounded to the nearest 10? 10 Round -0.544878 to four decimal places. -0.5449 Round 0.1500626 to 2 decimal places. 0.15 What is 479838400 rounded to the nearest 1000000? 480000000 Round -66.08145 to 0 dps. -66 Round 46775238 to the nearest one hundred thousand. 46800000 What is 639342200 rounded to the nearest one million? 639000000 What is 0.007389821 rounded to three decimal places? 0.007 Round 0.1097471 to 4 dps. 0.1097 What is -46977962 rounded to the nearest 100000? -47000000 What is 0.00001721155 rounded to 7 dps? 0.0000172 What is 51939400 rounded to the nearest 100000? 51900000 What is -255.5521 rounded to the nearest ten? -260 Round 375989980 to the nearest 1000000. 376000000 Round -2146.71 to the nearest ten. -2150 What is 0.5355588 rounded to two decimal places? 0.54 What is 0.000010835201 rounded to seven decimal places? 0.0000108 Round -29616530 to the nearest 100000. -29600000 Round -15.948 to the nearest integer. -16 Round -0.0000786584 to 7 dps. -0.0000787 Round -0.00653298 to five decimal places. -0.00653 What is 6.5149 rounded to one dp? 6.5 Round 0.0013644 to two decimal places. 0 What is 42888.89 rounded to the nearest 10000? 40000 What is 0.2102289 rounded to 2 dps? 0.21 Round -1.834579 to two dps. -1.83 Round 913.6599 to the nearest 10. 910 What is -525.0905 rounded to 1 decimal place? -525.1 Round -0.00423362 to five dps. -0.00423 Round -360411000 to the nearest 1000000. -360000000 Round 0.0005120637 to 4 decimal places. 0.0005 Round 4970.9 to the nearest 10000. 0 What is 0.000303277 rounded to four decimal places? 0.0003 What is 0.1749805 rounded to 4 dps? 0.175 Round 0.77336 to one decimal place.	{ "pile_set_name": "DM Mathematics" }
))/((-19)/38). -7 Calculate (6/(-9))/(20/(-9) - -2). 3 What is 124/(-44) - 415/(-20)? 2/11 280/42 + -6 - 4/8 1/6 Calculate (-4)/(-3(-100)/(-15)). 1/5 What is the value of (3/(-6))/((-3)/2)? 1/3 (6 - 10 - 3)/(21/(-18)) 6 (-132)/(-36) + 1(-1)/(-3) 4 (-32)/24((-2)/4 - 1) 2 20/(-4) + -43/(-12) -4 Calculate (3 - 80/28)/(18/(-126)). -1 Evaluate 24/(-9)3/36. -2/9 ((-3)/2)/((-567)/(-42) - 17) 3/7 Evaluate (-40)/(-8) + 51/(-9). -2/3 What is (5/(-12))/((-146)/(-584))? -5/3 Evaluate (-13 - (-87)/7) + 25/7. 3 Evaluate 6/(-40 - 2)-1. 1/7 What is the value of (375/(-50))/(31)? -5/2 Evaluate -4 - ((-46)/12 + (-19)/(-57)). -1/2 What is ((-27)/(-243))/((-3)/(-45))? 5/3 What is -1-112/3? 4 Evaluate (-74)/14 - (-9 - (-61)/7). -5 Calculate -11 + (-11 - 1332/(-60)). 1/5 Calculate (248/155)/(4/10). 4 112/(-4) + 5 -1/2 What is the value of -3 + ((-11)/(-2) - 0)? 5/2 -1 + -2 + 4 + 0/(-2) 1 What is the value of (5 - 124/28)(-42)/(-108)? 2/9 What is 2 + (-10 - 2)4/(-16)? 5 What is the value of ((-150)/40)/((-12)/16)? 5 Calculate 5 + -1 + 25/(1 + -6). -1 What is the value of (-22)/(-33)2 - 28/(-6)? 6 Calculate 4 - (1210/264 + (-1)/3). -1/4 Evaluate (-56)/(-63)27/(-36). -2/3 What is (-40)/126 - 2(-3)/(-54)? -3/7 What is (-41)/(-123)(0 + -1)21? -7 Calculate (-2)/(-5) - ((-645)/75 + 4). 5 Evaluate ((-6)/81)/(-2 + (-65)/(-30)). -4/9 What is the value of 364/22755/2? 2/5 What is the value of (2/8)/((-42)/(-63))? 3/8 Calculate -2 + 6 + -2 - 0. 2 ((-6)/35)/(26/65) -3/7 What is -8 + 3/(3/5)? -3 Evaluate -20 - -3 - 1(-7 - 0). -10 What is the value of (-1)/(9 - (-132)/(-15))? -5 What is the value of (-4 + (-18)/(-4))/((-27)/72)? -4/3 What is the value of 5 + 508/(-96) - (-9)/(-24)? -2/3 Calculate 135/162 + (-51)/72. 1/8 6/(-15)(-10)/(-1) -4 ((-4)/12)/(-9 - 160/(-24)) 1/7 What is the value of (1 + 3)/(8 + -6)? 2 What is the value of 2 + (63/35 - (1 + 3))? -1/5 Calculate 0 - (-9 - (-2 + -1) - 0). 6 What is the value of 1/(-6) + (-170)/(-300)? 2/5 What is the value of (66/36)/(12/(-21))? -7/4 What is the value of (4/12)/(115/(-138))? -2/5 What is (-6 - (-77)/14)0? 0 30/(-9)(-9)/(-6) -5 Evaluate 0 + 1 - (-2 + 4). -1 12 + 98/(-6) + (-2)/3 -5 What is (-36)/(-9)63/36? 7 0/(-115) + 4/42 2/21 24/(-20)20/6 -4 1 + (42/(-280))/(5/36) -2/25 Evaluate ((-144)/(-240))/(((-2)/2)/1). -3/5 3/(-4)(-600)/675 2/3 Calculate -1 + 3/12 - (-119)/204. -1/6 Evaluate ((-6)/(-10))/((-2)/10). -3 Calculate 80/(-5) - 407/(-37). -5 2288/312 - 14/(-4)-2 1/3 Calculate ((-1)/(-7))/((16/(-12))/4). -3/7 Evaluate (-1)/(((-16)/12)/(-4)). -3 What is the value of 5/4 + -4 + (-1)/4? -3 Evaluate (-150)/(-18)(-30)/(-50). 5 (-1)/((-6)/(-20)) + 2 -4/3 What is (4 + 39/(-6))/(2/(-4))? 5 Evaluate (-10)/(-105)1 - 34/(-84). 1/2 Calculate (3 + -18 - -13) + (-34)/(-16). 1/8 What is (-121)/143 + -3 + 4? 2/13 What is 14/8(-32)/(-40) + -1? 2/5 What is (-5)/252(-3)/(-6)? -1/5 What is (2 + -1)134/(-871)? -2/13 Calculate -1 + 2 + (0/5)/(-9). 1 (0 + -5)/(3 + (-1 - 1)) -5 What is -2 - (-6 - -12)/(-1)? 4 (6/540)/(-4) 0 What is -3 + -1(-70)/21? 1/3 What is (-7)/(-6 + -1)8? 8 What is (15/18)/((39/9)/(-13))? -5/2 What is the value of ((-1)/4)/(37/296)? -2 What is 4370/(-1995) - 4/(-3)? -6/7 What is the value of (35/(-15) + 2)9/(-21)? 1/7 What is the value of 14/(-28)2/7? -1/7 What is the value of (1 - 6)(-208)/(-130)? -8 Evaluate 16/14 + (-1)/7. 1 What is the value of 216/(-280) + (-5)/(-25)? -4/7 (-90)/60 + (-14)/4 -5 3(25/6 + -4) 1/2 What is (5/4)/(24/48)? 5/2 Calculate ((-24)/(-32))/((-2)/8). -3 Evaluate (2/2)/(14/(-70)). -5 What is (28/(-245))/((-3)/((-84)/(-4)))? 4/5 (-96/(-324))/(5/6) 1/5 (-1 + (-3)/(-2))/((-2)/(-16)) 4 What is the value of (-1)/(-425/(-20))4? -4/5 Evaluate (3 - -2)((-1373)/(-125) - 11). -2/25 4 - 6/(-12)2 5 1 + -1 - (-2)/16 1/8 Calculate 4380/600 - (-6)/(-20). 7 (10/(-7))/(-2) + -1 -2/7 What is (4/6)/(3/(-18))? -4 What is the value of (2 - (1 - -2))/((-28)/(-140))? -5 Evaluate ((-2)/(-4))/((-49)/(-14)). 1/7 Evaluate (6/20)/(36/(-30)). -1/4 What is (-1)/((-6)/(-9) + (-6)/(-9))? -3/4 75/15 + -9 + 11/2 3/2 2/4 + 213/260 3/5 Calculate (-2 + -3 - -9)(-14)/84. -2/3 Calculate 10 + (-618)/48 + 2/(-16). -3 Calculate (-133)/147 + (-5)/(105/9). -4/3 Evaluate 15/6012/39. 1/13 Evaluate -2 + 4/(-2) + 126/27. 2/3 Evaluate 6 + (-3 - (-10 - -7)). 6 What is the value of (-4)/(-8)(-2 + 2)-1? 0 (-48)/642/(-12) 1/8 Evaluate -6 - ((-2)/10)/(27/855). 1/3 What is 1 + (4/12)/(2/6)? 2 Calculate (30 - 20)(-1)/(30/4). -4/3 What is -25(-3)/(-5)14/(-42)? 5 (-3)/8(-44)/33 1/2 What is the value of (-96)/(-440) + 2/11? 2/5 -1 + (-3)/18 + 76/24 2 What is the value of -5 + 227/10? 2/5 Calculate 1178/558 - 12/27. 5/3 Evaluate 5/(-12 + 7)8. -8 (-3)/(-2)60/405 2/9 Calculate 8/(-16)0/3. 0 Evaluate (4/2)/(((-15)/2)/15). -4 What is the value of 105/(-280) - 30/176? -6/11 Calculate (2/(-2))/((-23)/(-23)). -1 Calculate 1/(1 - 6/4). -2 What is the value of (-3)/(-18)-8 - (-2)/6? -1 (-4)/2(-4)/(-24) -1/3 2-1 - (-1501)/790 -1/10 Calculate -2(-3)/(3 + 2 + -4). 6 What is the value of (-12 - (-1287)/110)2/6? -1/10 Evaluate 36/(-54)18/(-20). 3/5 What is (11 + -11)/((2 - 0)/2)? 0 What is the value of (1908/(-272) - -7)-4? 1/17 Calculate (-16)/(-72) + (0/1)/(-4). 2/9 Calculate 32/(-36)10. -5/3 What is the value of 0 + (28/8 - 3)? 1/2 Evaluate 8((-2)/(-8))/(19/38). 4 Calculate 8/2 + (44/(-10) - 0). -2/5 What is the value of (-4)/(24/(-6)) + 12/(-8)? -1/2 Evaluate 12(4 - 5). -2 What is the value of 6/(-16) - (-3 + (-424)/(-64))? -4 Evaluate 18/(-117) - (-180)/3251. 2/5 What is the value of -312/8 + -17 + 24? -3/4 Evaluate 78/(-19) - (-61)/(793/52). -2/19 Calculate 8 - ((-60)/(-8) + 0). 1/2 7/(28/(-18))10/(-9) 5 What is ((-4 - -6) + -2)(2 - 3)? 0 24/10 - (8 + 418/(-55)) 2 What is the value of (-66)/44(-8)/(-3)? -4 6/(-21)((-2 - -1) + 0) 2/7 What is 1 + -1 - (-78)/(-741)? -2/19 Calculate (-3 - (-910)/300)4. 2/15 Evaluate ((-1)/18)/(330/(-24) + 14). -2/9 Calculate (-120)/99 - (-1 + (-10)/(-30)). -6/11 Evaluate ((-6)/(-12))/((-2)/4). -1 Calculate (4/((-32)/2))/((-13)/78). 3/2 What is (-120)/16(-4)/(-6)? -5 2107/441 + -1 + (-22)/(-18) 5 Evaluate -166 + 164 - -31. 1 What is the value of 3(2 + (0 - 1))? 3 What is the value of 4/34 - 118/1003? 0 (-6)/(-4)(-2 - (-590)/285) 2/19 Calculate 943/(-161) - (-2 + -2 + -1). -6/7 6/4125/75 5/2 What is the value of 6/(-156)-134? 2 ((-10)/8)/((-21)/(-84)) -5 What is 8/10 + (-7)/(-35)? 1 Evaluate -3 + 8 - (-6)/14-7. 2 18/126(0/2)/(-1) 0 (-8)/(-10)(-90)/(-36) 2 What is the value of -3-32/(-6)? -3 What is -4 + 15 - 3 - 5? 3 Evaluate (-2)/(-4 - -5)(-6)/78. 2/13 Calculate ((-5)/(-4)-2)/((-145)/58). 1 Calculate (-3)/((-4)/((-8)/(-10))). 3/5 Calculate 98/(-147) - (0 - 22/42). -1/7 5/(-4) + 493/116 3 ((-12)/(48/(-4)))/(1-1) -1 Evaluate (213/568)/(1/(-1)). -3/8 What is (-24)/(-228) + 112/(-342)? -2/9 Evaluate (-24)/(-15) + (3/(-5) - -1). 2 What is (-1)/(0 + 4/20)? -5 Evaluate 8/9 - 124/93. -4/9 What is the value of (-5 + 273/26)4/22? 1 (-24)/(-10) - ((-12)/10)/2 3 What is the value of 34/323 + (-7)/((-1197)/96)? 2/3 What is the value of 258/(-170) - 52/(-442)? -7/5 What is (0 + 0)/(16/(-14 + 6))? 0 What is 4/3264/176? 2 Evaluate (-2)/(-7)71/(-142). -1/7 What is the value of (2 - 2)(-4)/(-8)? 0 Evaluate (-2)/11 + -197/539. -3/7 What is 142/(-60) + 1 - (-72)/48? 2/15 2/(-1)51/34 -3 What is 8/56(5 + -6)? -1/7 (4/(-24))/(-1)(-18)/(-4) 3/4 What is 4/(-22) + 0 + 1017/(-1243)? -1 Evaluate (-1 - 0)2 + (-358)/(-716). -3/2 What is (2/24)/((-35)/(-56))? 2/15 What is ((-1)/2)/(35/(-20))? 2/7 What is (-84)/8(-66)/99? 7 Evaluate 2 - -1 - 26/10. 2/5 What is the value of -11 + 7 + 21/5? 1/5 Evaluate -4 + (-85)/80-4. 1/4 Calculate 192/(-216) + 2/3. -2/9 Evaluate 12/(-14)42/(-12). 3 What is the value of 9/(-6)8/(-66)? 2/11 Evaluate 1 + (12/(-16))/((-3)/(-12)). -2 Evaluate (-19)/(380/8)10/6. -2/3 What is the value of (-40)/(-4) + -9 + 5? 6 -2 - ((-180)/(-21))/(-4) 1/7 What is the value of 488/322 + 8/(-92)? 10/7 Evaluate 1 - (1 + -1) - 45/35. -2/7 2/41(-25)/(-225)-9 -2/41 (-33)/2574 + (-4)/26 -1/6 Calculate 2/(-8) + (105/196)/(-15). -2/7 Calculate 4/14 - (-1817)/(-8295). 1/15 (-1 - -5)*(24 - 1235/52) 1 What is 30/112 + (-82)/574? 1/8 What is 20/(25760/(-207))	{ "pile_set_name": "DM Mathematics" }
08)) + -1 - 1sqrt(108)-5))*2. 288sqrt(3) + 6921 Simplify 4 + (sqrt(180) + 1 + sqrt(180) + 0 + sqrt(180) + -4 + sqrt(180)-2)2. -36sqrt(5) + 193 Simplify (sqrt(912) + sqrt(912) + sqrt(912)2 + sqrt(912) - sqrt(57)-1-5)/((2sqrt(6)4)/sqrt(2)). 15sqrt(19)/8 Simplify 6((sqrt(245) + -1)2)*2 - ((sqrt(245) + (sqrt(245) + (sqrt(245)3 + sqrt(245))4 - sqrt(245)))2 + -2). -64899 - 336sqrt(5) Simplify 3 + (sqrt(3) - sqrt(75)) + -2 + ((sqrt(192)3)/sqrt(4))2. -4sqrt(3) + 433 Simplify (-2(sqrt(3600) - (-1sqrt(3600) - sqrt(3600))))/((sqrt(144) + sqrt(144) + sqrt(144) + (sqrt(144)1 - sqrt(144)))/sqrt(12)3). -20sqrt(3)/3 Simplify ((sqrt(624)4)/(sqrt(3) + sqrt(3) + (sqrt(9)-1)/sqrt(3)) - (-2sqrt(1573)-1 + (sqrt(1573) - (-1 + sqrt(1573))) + 1))2. 24sqrt(13) + 472 Simplify -2-2(-1 + (sqrt(1300) + (sqrt(1300) - (sqrt(1300) - sqrt(1300)-2)4))*2). 519996 Simplify (sqrt(396) + -4(-1sqrt(396) - sqrt(396) - sqrt(396)) + 4(sqrt(396) - (-2 + sqrt(396))))*22-3. -401928 - 7488sqrt(11) Simplify (3sqrt(56))/(sqrt(14)/sqrt(32)) - (sqrt(24) - (sqrt(288) - -1sqrt(288) - sqrt(288))/sqrt(12))/(sqrt(108) - 1sqrt(108) - sqrt(12)). 24sqrt(2) Simplify (3 + -2sqrt(208) + ((1(2 + sqrt(208)))*2 - sqrt(208)))-5. -1075 - 20sqrt(13) Simplify ((-3sqrt(6)/sqrt(2))2 - (-4 + (sqrt(27))2)) + -5 + sqrt(363) + 0. -1 + 11sqrt(3) Simplify -1 + -2 + 5 + (sqrt(1053) - (sqrt(1053)3)*2). -9475 + 9sqrt(13) Simplify ((sqrt(110) - 5sqrt(110)-2)/sqrt(10) + (-1sqrt(22)5)/sqrt(2))*2. 396 Simplify (2(-2 + sqrt(38)/sqrt(18) - 5sqrt(152)/(sqrt(8) - (sqrt(8) + sqrt(8) + (sqrt(8) - (sqrt(8) + -1sqrt(8)))))))*2. -136sqrt(19)/3 + 5635/9 Simplify (31sqrt(130) + (sqrt(130) - (sqrt(130) + sqrt(130)-2 + sqrt(130))-1))/((sqrt(640) + sqrt(640)3)2). sqrt(13)/16 Simplify 2 + (sqrt(612)1)2 - (sqrt(153) + 0 - (-5 + sqrt(34)/sqrt(2))). -2sqrt(17) + 609 Simplify ((sqrt(3) + 0)2 + 2)2 - ((sqrt(30)/(sqrt(20)/sqrt(2)))2 + 6sqrt(9)/sqrt(3)). 2sqrt(3) + 13 Simplify (sqrt(704) + 1 + sqrt(704))24 + sqrt(704) + ((-1sqrt(121)-4)/sqrt(11))*2 + 5. 136sqrt(11) + 11449 Simplify -2-4(sqrt(931) - (sqrt(931)3 + -5)2 - sqrt(931)). -67232 + 1680sqrt(19) Simplify (3(4 + sqrt(700)1)-4)2. 11520sqrt(7) + 103104 Simplify (sqrt(825)16 + sqrt(825))/((sqrt(66) - (sqrt(66)1 + sqrt(66))3)/sqrt(6)). -7sqrt(3) Simplify ((sqrt(2401)2 + sqrt(1764)1)/(sqrt(84)/(sqrt(108)/(sqrt(63)/sqrt(7)))))2. 2800 Simplify ((-2 + sqrt(833) - sqrt(17)) + 3sqrt(153) - (sqrt(204) + sqrt(204) + ((sqrt(204) - sqrt(204)-2)-6 - sqrt(204)))/(-1sqrt(12)4))*2. -43sqrt(17) + 31497/16 Simplify (-5(sqrt(85) - 6sqrt(85)-1))/(sqrt(20)/(-3sqrt(400))). 1050sqrt(17) Simplify -15sqrt(9)/sqrt(3)-64. 120sqrt(3) Simplify ((1-44(sqrt(72) + -1) + 0)2)*2. -12288sqrt(2) + 74752 Simplify (-2 + sqrt(700) + sqrt(700) + 1)*2 + 4 - 3((sqrt(700) - (sqrt(700) - -3(sqrt(700) - (sqrt(700) + 1)))2) + sqrt(700)). -280sqrt(7) + 4932 Simplify (4((1sqrt(2057) - sqrt(2057)) + sqrt(17) + 1) + 1)4. 20 + 16sqrt(17) Simplify ((4 + 0 + sqrt(117) - (sqrt(117) + (sqrt(117)6 - sqrt(117))-6 - sqrt(117)))-4)2. 11904sqrt(13) + 1799248 Simplify 6-6(sqrt(637) - ((sqrt(637) + -2)*2 + sqrt(637))) + (1sqrt(637) - sqrt(637))*2 + -4 + (-3 + 1sqrt(637))*2. -1050sqrt(13) + 23718 Simplify ((sqrt(1296)2 - sqrt(16))/(sqrt(968)-1)4 + 5)2. -680sqrt(2)/11 + 12273/121 Simplify -3 + (0 + sqrt(147) + 4 - (4sqrt(108)/sqrt(4))2). -431 + 7sqrt(3) Simplify 0 + -3((-4 + sqrt(28)/sqrt(4))-1 - 31sqrt(175))*2. -5424 + 384sqrt(7) Simplify (-2 + (3 + -2sqrt(275) - sqrt(275)) + (1 + sqrt(275))-3 + -5)*2-3. -29847 - 1260sqrt(11) Simplify (sqrt(495)2-3)/((-1sqrt(35))/sqrt(7) + sqrt(5) + sqrt(495)/sqrt(11)). -6sqrt(11) Simplify (2(sqrt(88) - ((sqrt(88) - (sqrt(88) + sqrt(88) + 3sqrt(88)))-2 - sqrt(88)))/((sqrt(96)3)/sqrt(12)))2. 176 Simplify 0 + sqrt(45) + 5 + (sqrt(250)/sqrt(5))/sqrt(10) + -5. 4sqrt(5) Simplify (-5 + -6-1sqrt(891)-1)2. 540sqrt(11) + 32101 Simplify (-6(-1sqrt(245)5 - sqrt(245)) + 1 + sqrt(605)1 + (1 + sqrt(605) + sqrt(605) - sqrt(605)) + 5)*2. 3836sqrt(5) + 375429 Simplify -1(3sqrt(1872)-1 + 3 + -4)2. -16849 - 72sqrt(13) Simplify (((sqrt(180) - (-3 + (sqrt(180) + 0 - sqrt(180)) - sqrt(180))) + 2 + 1 + sqrt(180) + 5)-2)2. 1584sqrt(5) + 6964 Simplify (-6sqrt(102)1 + 2sqrt(102)3)/(sqrt(72)/(sqrt(12) - sqrt(108)/(sqrt(9) - sqrt(81)))). 0 Simplify (-5-2(sqrt(200) - (sqrt(200) + 4)) + (sqrt(200) + 3 + -3 + sqrt(200))-1)2. 1600sqrt(2) + 2400 Simplify -4 + sqrt(33)/(-2sqrt(11)) - (sqrt(33)/(sqrt(11)2)5)2. -91/4 - sqrt(3)/2 Simplify (-1 + -1sqrt(704) - -5sqrt(704)1) + 4. 3 + 32sqrt(11) Simplify (-1sqrt(26)/sqrt(2) - sqrt(13))-2 - 4(sqrt(156)/sqrt(3) + sqrt(52)). -12sqrt(13) Simplify (sqrt(432)-1-6)/((sqrt(120)/(sqrt(9)/sqrt(3)))/sqrt(10)). 36sqrt(3) Simplify -5 + ((sqrt(72) + 0)*2 - sqrt(2)) + (sqrt(72) - (sqrt(72) - sqrt(72)1))*2 + sqrt(20)/sqrt(40) + sqrt(2). sqrt(2)/2 + 139 Simplify ((sqrt(168)/(sqrt(7)2))/(sqrt(8)1-5))*2. 3/100 Simplify ((sqrt(2299)-4)*2 - (sqrt(1539) + -1))-5. -183925 + 45sqrt(19) Simplify ((-1 + sqrt(175))-4)*2 - (0 + sqrt(175) + -1) - (sqrt(175) + -2sqrt(175) + 1sqrt(175) + 3)2. -165sqrt(7) + 2808 Simplify sqrt(133)/((sqrt(21) + sqrt(21)1)/sqrt(3))4 + ((6(sqrt(76) - (sqrt(76) - 1sqrt(76))))/sqrt(4))*2-6. -4104 + 2sqrt(19) Simplify -3sqrt(252)62-2-6 + -4. -2592sqrt(7) - 4 Simplify (sqrt(576)-2)/(5sqrt(392) + sqrt(8) + sqrt(8)) + -1. -1 - 12sqrt(2)/37 Simplify 4((sqrt(80)-1)*2 + sqrt(80)) + (0 + sqrt(5) + -5)-6. 10sqrt(5) + 350 Simplify (sqrt(2496) + 5(sqrt(2496) + 2sqrt(2496) - sqrt(2496)) + sqrt(2496))/(sqrt(3)-2-2 + -5sqrt(27) + sqrt(3)). -48sqrt(13)/5 Simplify (-4sqrt(336))/sqrt(7) + 2 + ((sqrt(60)/sqrt(4) - sqrt(15))3 - sqrt(15))/((2sqrt(45))/sqrt(9)). -33sqrt(3)/2 + 2 Simplify -3 + (sqrt(245) + (2 + (sqrt(245) - (sqrt(245) + -1)) + sqrt(245) - sqrt(245))2 - (-3 + 4sqrt(30)/sqrt(6))). 3sqrt(5) + 9 Simplify (sqrt(1100) + (sqrt(1100) + 5(2sqrt(1100) - sqrt(1100)))2 - (-5(-1 + sqrt(1100))*2 + sqrt(1100))) + -2. -100sqrt(11) + 45103 Simplify 1(sqrt(2448) - (1sqrt(2448))*2) + sqrt(2448)2 + 5 - (sqrt(2448) - (sqrt(2448) - ((sqrt(2448) + -1 + 5 - sqrt(2448)) + sqrt(2448))*2))2. -7371 - 156sqrt(17) Simplify (2sqrt(3168))/(sqrt(121)/(sqrt(44)/sqrt(4))). 24sqrt(2) Simplify sqrt(2448) - 3(sqrt(2448) + -1) - 25sqrt(2448). -144sqrt(17) + 3 Simplify ((2 + sqrt(245))-1 + (sqrt(245)2 + 3 + sqrt(245) - sqrt(245)))23. 42sqrt(5) + 738 Simplify (sqrt(84)/(sqrt(252) + sqrt(252) + sqrt(252) + sqrt(252)-1 + sqrt(252)))/(sqrt(48)/(sqrt(512)1)) + -3. -3 + 4sqrt(2)/9 Simplify 5 + -4(sqrt(2448) + (sqrt(2448) + -3)-3)*2. -39487 + 1728sqrt(17) Simplify ((sqrt(85) - ((sqrt(85) + 2sqrt(85) - sqrt(85)) + sqrt(85))3) + 2(sqrt(85) + sqrt(85)1) + sqrt(85))/(sqrt(30)/sqrt(54)2). -9sqrt(17)/2 Simplify (sqrt(88)/(sqrt(8) - sqrt(288)) - sqrt(55)/(sqrt(5)-2)) + -4 + (sqrt(275) - ((sqrt(275) - (-4 + sqrt(275)2)) + sqrt(275))*2) + sqrt(275). -20 + 103sqrt(11)/10 Simplify ((sqrt(325) + (sqrt(325) - (sqrt(325) + sqrt(325)2 + sqrt(325))))-5 + 4 - ((sqrt(325) - (4 + sqrt(325)-4)) + -2))2. 500sqrt(13) + 8225 Simplify (1 + -3(-2 + sqrt(297)/sqrt(3)))2-6. -5640 + 756sqrt(11) Simplify 4((-2(sqrt(72) + 4))2 - (sqrt(72)3-5 - sqrt(72))2). -72320 + 768sqrt(2) Simplify (-5 + -3 + ((sqrt(2) + 1 - sqrt(2)) + 4 - sqrt(98)2) + 5)2. -56sqrt(2) + 396 Simplify ((5(sqrt(1700) + 1) + 5(sqrt(1700) + -1) - 3(sqrt(1700) - (sqrt(1700)-1 + -3) - sqrt(1700))) + -4)*2. -1820sqrt(17) + 83469 Simplify (1 + 6(-1 + 1sqrt(605) + -5 + sqrt(605))*2)-2. -29474 + 3168sqrt(5) Simplify ((sqrt(1224)-3)/sqrt(2) + 6(1sqrt(153) + sqrt(153))/sqrt(9))*2. 612 Simplify -1 + (((-2sqrt(833))*2 + sqrt(833))1 - sqrt(833) - -6(sqrt(833) + 1 - sqrt(833) - sqrt(833)) - (3 + 1 + sqrt(833)2)). -56sqrt(17) + 3333 Simplify 2(2 + sqrt(125) + 1 + 3). 12 + 10sqrt(5) Simplify (2sqrt(243))*2 - sqrt(3) - ((sqrt(3) - sqrt(12)) + 1) - (2(5 + 1sqrt(3)))2. -40sqrt(3) + 859 Simplify -4(5 + -6(sqrt(208) + 2(0 + sqrt(208)) - sqrt(208)))	{ "pile_set_name": "DM Mathematics" }
t the terms in -19z3 - 11z*3 + 1 - 1. -30z*3 Collect the terms in 5c*3 + 3c*2 - 3c*2 - 18c*3. -13c*3 Collect the terms in 2d - 6d3 - 6d + 3d. -6d*3 - d Collect the terms in -3t*2 - 13t*2 + 10t*2. -6t*2 Collect the terms in 23o2 + o2 - 47o + 24o + 23o. 24o*2 Collect the terms in -95b*3 + 53b*3 + 48b*3. 6b*3 Collect the terms in -4q*2 - 4q2 - q2. -9q2 Collect the terms in -22y*2 - 13y*2 - 800y + 800y. -35y*2 Collect the terms in -56k + 28k + 28k + 209k2. 209k*2 Collect the terms in 7j*3 - 12j*3 + 92j + 3j3 - 92j. -2j3 Collect the terms in -12p3 - p2 - 2p - p2 + 2p. -12p3 - 2p*2 Collect the terms in 127 + 24m - 127. 24m Collect the terms in 0 - 7 + 14v*3 + 1 + 6. 14v*3 Collect the terms in -11562720x*2 + 11562720x*2 + 9x*3. 9x*3 Collect the terms in -8 + 8 + 14k*3. 14k*3 Collect the terms in 35q + 43q - 114q + 38q. 2q Collect the terms in -3354 - 40h2 + 3354. -40h*2 Collect the terms in k + 2k - 3k - 3k. -3k Collect the terms in -19m - 20m + 59m - 18m. 2m Collect the terms in 14q - q + 11q - 15q. 9q Collect the terms in 25v + 29v - 42v. 12v Collect the terms in 4u - 7u*3 - 4u. -7u3 Collect the terms in 0 + 436m*3 + 375m*3 + 0. 811m3 Collect the terms in 0 + t3 + 0 - 174268t + 174268t. t*3 Collect the terms in 13 + 47f - 25 + 12. 47f Collect the terms in 234g + 533g + 45g. 812g Collect the terms in 8s - 680 - s + 680. 7s Collect the terms in 4 - 10i + 11i - 4. i Collect the terms in -4d + 4d - 332d*2 + 334d*2. 2d2 Collect the terms in -c2 + 3c2 - 2 + 2c*2 - 2c*2. 2c*2 - 2 Collect the terms in 4v*3 + 6v*3 - 4v3 + v3. 7v3 Collect the terms in -55a2 - a3 + 55a2. -a3 Collect the terms in 2t2 - t2 + 6t2 - 2t*2 + 3t*2. 8t*2 Collect the terms in 958l - 8l2 + 9l*2 - 958l. l*2 Collect the terms in -52s + 154s - 52s - 56s. -6s Collect the terms in 33 - 33 + 112i. 112i Collect the terms in 90b2 - 39b*2 + 1 - 1 - 54b*2. -3b*2 Collect the terms in -13876c*2 - 1 + 1 + 13858c*2. -18c2 Collect the terms in x2 + 22x2 + 17x*2 + 6x*2. 46x*2 Collect the terms in 17y - 52 + 52. 17y Collect the terms in -85 + 2o*2 + 85 + 4o*2. 6o*2 Collect the terms in -94u*3 - 89u*3 + 200u*3. 17u*3 Collect the terms in 35p*2 - 20p*2 - 20p*2. -5p*2 Collect the terms in -7z*2 - 5z*2 + 8z*2 + 5z2. z2 Collect the terms in j*3 + 483j + 489j - 972j. j*3 Collect the terms in 62i + 15i + 137i. 214i Collect the terms in 1287u*3 - 2579u*3 + 1290u*3 + 3u - 3u. -2u*3 Collect the terms in 3y + y - y. 3y Collect the terms in -6m*2 + 0m2 + m2 + 8m2. 3m*2 Collect the terms in 18j - 41j + 10j - j*2 + 9j. -j*2 - 4j Collect the terms in 1812y2 + 1057y*2 + 1956y*2 + 2y. 4825y2 + 2y Collect the terms in 6f3 + 4f*3 - 6f*3. 4f*3 Collect the terms in 14 - 3 - 2 - 9 - 3n*2. -3n*2 Collect the terms in -41 + 41 + 12k. 12k Collect the terms in -17l*3 - 16l*3 - 15l*3 + 57l*3 - 14l*3. -5l*3 Collect the terms in -6n - 3n + 15n. 6n Collect the terms in 262q*3 + 3 - 260q*3 - 3. 2q*3 Collect the terms in -7s - 36s + 46s. 3s Collect the terms in 6p + 11p - 18p - p + 11p. 9p Collect the terms in 175 + 26c2 - 175. 26c*2 Collect the terms in 15j*2 + 0 + 7 + 1 - 4. 15j*2 + 4 Collect the terms in 2n*3 - 11n*3 + 6n*3. -3n3 Collect the terms in g2 + 24g + 15g - 39g. g2 Collect the terms in 9 - 3 - 6 - s2. -s2 Collect the terms in 22t - 13t - 7t. 2t Collect the terms in 405l*2 - 30l*2 + 544l*2 + 75l*2. 994l*2 Collect the terms in -2n + 5n - 44n. -41n Collect the terms in -3s*3 + 4s*3 + 4s*3 - 12s*3. -7s*3 Collect the terms in -6d*3 + 15d*3 + 3d*3 - 15d*3. -3d*3 Collect the terms in 12c*2 + 0 + 1 - 1. 12c*2 Collect the terms in 3v*3 - 7v*3 + 246 - 246. -4v*3 Collect the terms in 114 + 82y - 114. 82y Collect the terms in -18l*3 - 4l*3 + 2l*3. -20l*3 Collect the terms in -31237120 - 4i*2 + 31237120. -4i*2 Collect the terms in 0 + 3p*3 - 11p*3 + 0. -8p*3 Collect the terms in -3p - 2p - p. -6p Collect the terms in -483k2 + 1924k*2 + 336k*2. 1777k*2 Collect the terms in 5 - 7 + 2 + 4r - r. 3r Collect the terms in 41u + 18 - 3 - 15. 41u Collect the terms in -126l*2 + 46l*2 + 42l*2 + 36l*2. -2l*2 Collect the terms in -23c + 44c - 22c. -c Collect the terms in -1 + 11j2 - 6j*2 - 3. 5j*2 - 4 Collect the terms in 10n - 18n - 5 + 6n + 27. -2n + 22 Collect the terms in 34y*3 - 2 - 2 + 1. 34y*3 - 3 Collect the terms in 2t + 4t + 4t + 3t. 13t Collect the terms in 21k2 + 1 + 1 - 2. 21k*2 Collect the terms in -1255b + 2499b - 1247b. -3b Collect the terms in 8 - 8 + 0 - 519l. -519l Collect the terms in 7m + 3m - 10m - 7m3. -7m*3 Collect the terms in 4n + 22n - 12 + 14. 26n + 2 Collect the terms in 0j - 10j - 2j. -12j Collect the terms in -28 - 24 + k + 2k + 52. 3k Collect the terms in -47 + 21 - 90g + 26. -90g Collect the terms in 6r2 - 19r*2 + 10r*2 + 4r*2 + 10r*2. 11r*2 Collect the terms in 35h*2 + 1 + 11h*2 + 17h*2 - 13h*2. 50h*2 + 1 Collect the terms in -n - 121 - 3n + 7 + 0n. -4n - 114 Collect the terms in 6r - 3r + 6 + 0 + 6r. 9r + 6 Collect the terms in -4m + 0m + 44m - m. 39m Collect the terms in 11b + 12b - 2b - 20b. b Collect the terms in -10a2 + 5 - 6a*2 - 1. -16a*2 + 4 Collect the terms in -87c*2 + c + 3c*3 - c + 87c*2. 3c*3 Collect the terms in 15f - 24f + f - 24f. -32f Collect the terms in o - 19o*2 - o + 9o*2. -10o*2 Collect the terms in -40 + 22 + 19 - 5l*3 - 8l*3. -13l*3 + 1 Collect the terms in -2 - 30i + 2. -30i Collect the terms in 3t*2 - 12t*2 - 7t*2. -16t*2 Collect the terms in -9j + 4j - 2j + 3j. -4j Collect the terms in -2z2 + 5z2 + z2 + 4z2. 8z*2 Collect the terms in 33z - 18z - 17z. -2z Collect the terms in 511 + 8y*3 - 511. 8y*3 Collect the terms in 65u*2 - 25u*2 - 23u*2 - 16u2. u2 Collect the terms in -3r2 + r2 + 47r + 53r - 110r. -2r2 - 10r Collect the terms in 2l2 - 7l*2 + 5l*2 + 4l*3. 4l3 Collect the terms in m - m - m3 + 55 + 20. -m*3 + 75 Collect the terms in -14p*3 - 8p*2 + 2p*2 + 6p*2. -14p*3 Collect the terms in -37 + 14b*3 - 36 - 15b3. -b3 - 73 Collect the terms in 11z - 13z - 4z - 3z. -9z Collect the terms in -11b*2 + 2b*2 + 15b*2 + 23b*2. 29b*2 Collect the terms in 125w - 62w - 51w. 12w Collect the terms in -28p + 27424 - 27424. -28p Collect the terms in 12n + 2n - 8n + 7n. 13n Collect the terms in 6 + 0 - h - 6. -h Collect the terms in 546j - 272j - 273j. j Collect the terms in 10 - c2 - 2c*2 - 8. -3c*2 + 2 Collect the terms in 3883d3 + d2 - d*2 - 3875d*3. 8d*3 Collect the terms in -4o + 302o2 + 4o. 302o2 Collect the terms in -110 + 24u*2 + 110. 24u*2 Collect the terms in 421 - i - 210 - 211. -i Collect the terms in 8c3 - c3 - 11c3. -4c*3 Collect the terms in -3s - 5 - 2s + 5. -5s Collect the terms in -8894z3 + 4451z*3 + 4445z*3. 2z*3 Collect the terms in -4u - u - 3u. -8u Collect the terms in -5y3 - y3 - 3y*3. -9y*3 Collect the terms in -19s + 19s + 0s*2 + 5s*2. 5s*2 Collect the terms in -25463g*2 + 2g*3 - 4 + 4 + 25463g*2. 2g*3 Collect the terms in 3u + 8u + 5u + u. 17u Collect the terms in -104n + 88n + 46n. 30n Collect the terms in -1369 + 1369 + 6z. 6z Collect the terms in -22k*3 - 28k*3 + 81k*3 - 23k*3. 8k*3 Collect the terms in 3y3 + y3 - 8y3. -4y*3 Collect the terms in -3a*2 + 0a*2 + 4a*2 - 31a. a*2 - 31a Collect the terms in -6o2 + 6o*2 - 4o*2 - 3o*2. -7o*2 Collect the terms in -53x*3 - 36x*3 - 33x*3 - 2x*3. -124x*3 Collect the terms in -64k*2 - 202k*2 - 68k*2. -334k*2 Collect the terms in -29l + 9l + 11l + 14l. 5l Collect the terms in -27b2 + 81b*2 + 136b*2. 190b**2 Collect the	{ "pile_set_name": "DM Mathematics" }
ose -3o + 277 = 4b + d, -o = 2b - 87. What are the prime factors of o? 89 Let y be (9/4)/((18/976)/(-3)). Let c = y + 551. List the prime factors of c. 5, 37 Let w = 6 + -5. Suppose -p = 3 + w. List the prime factors of (-94)/p + 3/2. 5 Let w(s) = s3 - 9s*2 - 9s - 9. Let i be w(10). List the prime factors of 0/(-4 - i) - -49. 7 Let x(g) = g - 1. Let y(j) = 36j - 3. Let s(q) = -5x(q) + y(q). Suppose 0a - 4n + 16 = 4a, -4a - 5n = -19. List the prime factors of s(a). 3, 11 Let b(a) = 2 - a2 - a2 - 4 - a + 3. Let n be b(1). What are the prime factors of (26 - -3)n/(-2)? 29 List the prime factors of (-2 - (0 - 1))/((-4)/2596). 11, 59 Let w = -92 - -90. List the prime factors of w/((-340)/332 + 1). 83 Let s be 3443/(-99) - (-4)/(-18). Suppose 20 + 33 = -u. Let h = s - u. List the prime factors of h. 2, 3 Suppose -10 = -v - 1. Suppose -vf + 4f + 405 = 0. What are the prime factors of f? 3 Let y = 59 - 65. Let u(a) = 4a2 + 2a - 8. List the prime factors of u(y). 2, 31 Let h(v) = 29v2 + 34v - 145. What are the prime factors of h(5)? 2, 3, 5 List the prime factors of (-221)/(-2) + 69/46. 2, 7 Suppose -b = -0b + 81. Let v = -30 - b. What are the prime factors of v? 3, 17 Let m be (-5)/5-1-2. What are the prime factors of (-91 - (3 - 4))/m? 3, 5 Let o(c) = 7c + 8. Let d be o(4). Let r be (2 - 1)(4 - 1). Suppose -5l + d = -rl. What are the prime factors of l? 2, 3 Let p = 6 + -5. Let c = p + 13. List the prime factors of (-1015)/(-49) - (-4)/c. 3, 7 Let t(p) be the first derivative of 24p*2 - 70p + 24. What are the prime factors of t(7)? 2, 7, 19 Suppose -5 = t - 25. Let g = t + -5. List the prime factors of g. 3, 5 Suppose -7v + 5v - 4c = -1644, 0 = -v + 5c + 857. What are the prime factors of v? 2, 13 Let z(a) = 2a2 - 3a + 12. Suppose -d - 21 = -4d. Let b be z(d). Suppose -3m + b = f, 7m - 124 = 3m + 4f. List the prime factors of m. 2, 3, 5 Suppose -31 + 186 = 5k. Let a = k - 14. List the prime factors of a. 17 Let f(a) = -a*2 - 3a - 15. Let c be f(0). Let r(i) = i*3 + 17i*2 + 6i - 32. List the prime factors of r(c). 2, 41 Suppose -8311 = -3r + z, 6z + 11072 = 7r - 3r. List the prime factors of r. 17, 163 Let v(r) be the first derivative of 3r4/4 - 5r*3/3 + 3r*2/2 + r - 1. Let x be ((-68)/51)/((-8)/18). List the prime factors of v(x). 2, 23 List the prime factors of ((-276)/(-16))/(-2 + (-38)/(-16)). 2, 23 Let d(i) = -4i + 4. Suppose -8 = -g - g. Let w be d(g). Let v(r) = -3r + 2. What are the prime factors of v(w)? 2, 19 Let m be (-88)/(-22)(-2)/(-4). Suppose -4j - w + 911 = -mw, -3 = w. What are the prime factors of j? 227 Let d = -2 + 4. Suppose 54 + 112 = dq. What are the prime factors of q? 83 Let l(x) be the second derivative of 1/20x*5 - 2x*3 + 0 + 5x + 7/12x4 - 3x*2. List the prime factors of l(-8). 2, 13 Let m = 5630 - 2082. What are the prime factors of m? 2, 887 Let g(q) = 8q*2 - 25q - 26. What are the prime factors of g(12)? 2, 7, 59 Let a be (6 + 4)/(-5) + -1. Let c(v) = -30v - 12. List the prime factors of c(a). 2, 3, 13 Let o(k) = -k3 - 15k*2 - 15k - 10. Let d be o(-14). Suppose -3g = -4q - 62, 0q = -dg + 2q + 96. What are the prime factors of g? 2, 13 Suppose -5c - 212 = -4p, -5p + 266 = -c + 1. Let w = 638 + -642. List the prime factors of p/((-1)/4w). 53 Let l(q) be the second derivative of q5/20 - 5q*4/12 - 5q3/3 - q2/2 + 3q. What are the prime factors of l(8)? 3, 37 List the prime factors of 3354/8 + 4 + (-12)/(-16). 2, 53 Suppose b + 3h = 267, 0b + b - 237 = 3h. What are the prime factors of b? 2, 3, 7 Suppose a - 1139 = 688. What are the prime factors of a? 3, 7, 29 Let s(w) = -w*3 - 2w*2 + 6w + 6. Let n be s(-3). Let z = -16 - n. Let b = 17 - z. List the prime factors of b. 2, 3, 5 Let i = -34 - -60. Let s be 2/7 - i/(-7). List the prime factors of (21)/(s/24). 2, 3 Let k(x) be the first derivative of x3/3 + 2x*2 + 3x - 15. List the prime factors of k(-4). 3 Let c = -27 - -38. Let w be c/((4/(-6))/(-2)). Suppose -4l + 5l - w = 0. List the prime factors of l. 3, 11 Let v be (-3)/15 + 32/10. Suppose -113 - 1303 = -4n - 4p, -vn + 3p + 1056 = 0. What are the prime factors of n? 353 Let t(r) = 6r - 39. Let p be t(8). Let s(x) be the first derivative of 2x*2 - 5x + 2. List the prime factors of s(p). 31 Suppose 3a - 5a = -4. Suppose 66 = -0g + ag. Let v = -9 + g. List the prime factors of v. 2, 3 Let m = 935 - 664. What are the prime factors of m? 271 Let y(s) = 13s + 22. Let l be y(-3). Let j(h) = h2 - h - 9. What are the prime factors of j(l)? 3, 11 List the prime factors of 1019 + -3 + 8/(16/6). 1019 Let a(k) = k3 - 4k*2 + 4k - 9. Let b be a(4). Let n be (-19)/5 - b/35. What are the prime factors of 489/15 - n/10? 3, 11 Let a(k) = k*2 - 174. List the prime factors of a(30). 2, 3, 11 Suppose -q = 5o - 2778, -1 + 5 = -2q. What are the prime factors of o? 2, 139 Let l = 140 - -467. List the prime factors of l. 607 Suppose 0p = -4p + 16. Suppose -2h = w + 8, ph = 2w + 2h - 2. What are the prime factors of (-12)/(-3)5 + w? 2, 3 Let w = 32 - 15. List the prime factors of (-9045)/(-153) - 2/w. 59 Let b(y) = 8y2 - 2 - 3y - 5y2 - 8y - y*2. List the prime factors of b(8). 2, 19 Let o(i) = 50i + 13. Let r be o(4). Suppose -r = -5g + 2n, 0 = -3g + 3n + 126. What are the prime factors of g? 43 Let y(r) = 20r2 - 82r + 2. What are the prime factors of y(9)? 2, 13, 17 Suppose -3l = -3d + 2007, -3792 = -5d + 3l - 443. List the prime factors of d. 11, 61 Let d = 58 - 77. Let h = 49 - d. What are the prime factors of h? 2, 17 Let q = -1287 + 2564. What are the prime factors of q? 1277 Let s be (1 - 1) + (-4 - -13)/(-3). What are the prime factors of (-9)/s + (-1 - -137)? 139 Let s = 5 - 3. Suppose -w - 1 - 2 = -sn, 2w - 4 = -n. Suppose 33 = nl + l. What are the prime factors of l? 11 Let w be (-1)/(-3) - 227/(-3). Let n = 21 - 17. What are the prime factors of 1n/(16/w)? 19 List the prime factors of -571(27 - 22 - (7 - 1)). 571 List the prime factors of 5 + (-13)/(52/(-7868)). 2, 17, 29 Suppose 38b + 85b = 479331. List the prime factors of b. 3, 433 What are the prime factors of 17/(4 + 135/(-35))? 7, 17 Let h = 2 - 18. Let o = h - -16. Suppose 2k - 43 - 25 = o. What are the prime factors of k? 2, 17 Let f(m) = 2m + 6. Let w be f(-8). Let h be ((-36)/(-10))/((-2)/w). Suppose 0 = z - h - 3. What are the prime factors of z? 3, 7 Let u(h) = 60h. Let d(l) = l. Let q(o) = -20d(o) + u(o). Let y(k) = -k2 - 3k - 1. Let m be y(-1). What are the prime factors of q(m)? 2, 5 What are the prime factors of (-21)/(4722/(-1344) - (-14)/4)? 2, 7 Suppose 2v = -3v - 4a + 666, 4v = 4a + 540. Suppose 2m - 4m = -v. What are the prime factors of m? 67 Let j = 912 - 613. Suppose -j = -7u + 1150. What are the prime factors of u? 3, 23 Suppose 176k - 179k + 3d = -450, 5k - 729 = -2d. What are the prime factors of k? 3, 7 Let r be ((-1)/(-3))/(7/273). Let u = -8 + r. Suppose -ua + o = -12, -5a - 2o + 13 = -8. What are the prime factors of a? 3 What are the prime factors of 93(-5 + 6)4? 2, 3, 31 Let m = 160 - -102. What are the prime factors of m? 2, 131 List the prime factors of (-12)/((-130)/6695). 103 Let q be (0 - 3/3) + 1. Suppose q = -9t + 1070 + 226. What are the prime factors of t? 2, 3 Let d(v) = -22v - 62. List the prime factors of d(-25). 2, 61 Suppose z - 3v = 6, -z + 6 = -0z + 5v. List the prime factors of z. 2, 3 Let h = 6 + 434. List the prime factors of h. 2, 5, 11 What are the prime factors of (-5)/(15/(-207))696/72? 23, 29 Let t = -4246 - -2227. What are the prime factors of t/(-33) + 12/(-66)? 61 Let h = 59 + -44. What are the prime factors of h? 3, 5 Let s be (-1 - (-4)/4) + 4. Suppose sv - 603 = 785. Suppose 5z - 3c + 114 - v = 0, 3c - 43 = -z. List the prime factors of z. 2, 23 Suppose 10563 = -71a + 132612. What are the prime factors of a? 3, 191 Let x = -640 - -1221. List the prime factors of x. 7, 83 Let z = 97 + -32. Let t = -40 + z. What are the prime factors of t? 5 Let u = 594 - 208. What are the prime factors of u? 2, 193 Let k = -10 + 11. What are the prime factors of -1 + k + -3720/(-27)? 2, 5 Let r(c) = 12c*2 - 77c - 1	{ "pile_set_name": "DM Mathematics" }
PM? 1:48 AM How many minutes are there between 2:32 AM and 1:54 PM? 682 What is 376 minutes before 7:19 AM? 1:03 AM How many minutes are there between 1:37 AM and 11:34 AM? 597 How many minutes are there between 1:55 AM and 4:59 AM? 184 How many minutes are there between 6:37 PM and 7:18 PM? 41 How many minutes are there between 12:21 AM and 12:35 AM? 14 How many minutes are there between 5:00 AM and 3:28 PM? 628 How many minutes are there between 2:46 PM and 6:15 PM? 209 What is 145 minutes before 8:50 PM? 6:25 PM How many minutes are there between 6:56 AM and 4:52 PM? 596 How many minutes are there between 9:33 AM and 2:33 PM? 300 What is 710 minutes before 1:35 PM? 1:45 AM How many minutes are there between 6:39 AM and 12:00 PM? 321 How many minutes are there between 6:37 AM and 7:16 AM? 39 What is 714 minutes before 7:58 AM? 8:04 PM What is 289 minutes after 3:38 PM? 8:27 PM How many minutes are there between 1:14 AM and 11:48 AM? 634 How many minutes are there between 11:21 AM and 8:19 PM? 538 How many minutes are there between 5:50 PM and 4:10 AM? 620 How many minutes are there between 11:26 PM and 6:11 AM? 405 What is 581 minutes after 3:36 AM? 1:17 PM What is 514 minutes before 4:14 PM? 7:40 AM How many minutes are there between 1:11 PM and 2:14 PM? 63 How many minutes are there between 9:35 PM and 4:44 AM? 429 How many minutes are there between 2:12 AM and 9:06 AM? 414 What is 612 minutes after 6:49 PM? 5:01 AM What is 82 minutes before 4:32 PM? 3:10 PM How many minutes are there between 11:16 AM and 12:52 PM? 96 How many minutes are there between 1:34 PM and 6:34 PM? 300 What is 400 minutes before 11:30 AM? 4:50 AM What is 620 minutes after 10:02 PM? 8:22 AM How many minutes are there between 4:37 PM and 12:58 AM? 501 How many minutes are there between 11:36 PM and 7:26 AM? 470 How many minutes are there between 6:31 PM and 4:54 AM? 623 What is 103 minutes after 7:23 AM? 9:06 AM How many minutes are there between 8:10 AM and 7:42 PM? 692 How many minutes are there between 3:15 PM and 5:55 PM? 160 How many minutes are there between 8:55 AM and 3:09 PM? 374 How many minutes are there between 2:51 PM and 9:59 PM? 428 How many minutes are there between 4:35 AM and 3:16 PM? 641 What is 11 minutes before 1:49 AM? 1:38 AM How many minutes are there between 9:50 PM and 5:28 AM? 458 How many minutes are there between 10:09 AM and 11:03 AM? 54 What is 670 minutes after 6:53 AM? 6:03 PM How many minutes are there between 8:58 PM and 10:01 PM? 63 How many minutes are there between 4:50 PM and 3:26 AM? 636 What is 665 minutes after 12:02 AM? 11:07 AM How many minutes are there between 3:36 PM and 9:03 PM? 327 What is 185 minutes before 3:04 PM? 11:59 AM What is 387 minutes before 8:02 PM? 1:35 PM How many minutes are there between 4:09 PM and 10:59 PM? 410 How many minutes are there between 11:37 AM and 2:30 PM? 173 How many minutes are there between 11:47 AM and 12:49 PM? 62 How many minutes are there between 11:28 AM and 4:17 PM? 289 How many minutes are there between 10:24 PM and 7:37 AM? 553 What is 293 minutes after 4:20 AM? 9:13 AM How many minutes are there between 4:39 PM and 7:08 PM? 149 What is 657 minutes after 7:03 PM? 6:00 AM What is 559 minutes before 5:09 PM? 7:50 AM How many minutes are there between 11:19 PM and 4:41 AM? 322 How many minutes are there between 2:47 PM and 8:46 PM? 359 How many minutes are there between 11:53 AM and 9:39 PM? 586 How many minutes are there between 10:41 AM and 4:53 PM? 372 What is 401 minutes before 12:03 PM? 5:22 AM What is 453 minutes before 12:57 AM? 5:24 PM How many minutes are there between 10:00 PM and 9:54 AM? 714 How many minutes are there between 12:40 PM and 12:30 AM? 710 What is 53 minutes after 7:00 PM? 7:53 PM How many minutes are there between 1:01 AM and 9:14 AM? 493 How many minutes are there between 4:09 PM and 3:26 AM? 677 How many minutes are there between 5:53 PM and 4:03 AM? 610 How many minutes are there between 6:44 PM and 4:54 AM? 610 How many minutes are there between 6:12 AM and 2:56 PM? 524 How many minutes are there between 1:31 PM and 12:46 AM? 675 How many minutes are there between 12:37 PM and 10:15 PM? 578 What is 568 minutes before 5:18 PM? 7:50 AM How many minutes are there between 8:26 PM and 11:17 PM? 171 What is 318 minutes before 2:34 AM? 9:16 PM What is 244 minutes after 11:47 AM? 3:51 PM What is 670 minutes after 11:25 AM? 10:35 PM How many minutes are there between 6:01 AM and 1:04 PM? 423 What is 641 minutes after 8:23 PM? 7:04 AM What is 631 minutes after 1:15 PM? 11:46 PM What is 453 minutes after 10:01 AM? 5:34 PM How many minutes are there between 10:30 PM and 2:36 AM? 246 What is 102 minutes after 7:09 PM? 8:51 PM How many minutes are there between 10:17 AM and 12:41 PM? 144 How many minutes are there between 4:43 PM and 6:25 PM? 102 What is 71 minutes before 3:30 PM? 2:19 PM What is 345 minutes before 4:37 PM? 10:52 AM How many minutes are there between 6:44 AM and 5:36 PM? 652 How many minutes are there between 11:41 PM and 6:20 AM? 399 What is 508 minutes after 9:51 AM? 6:19 PM How many minutes are there between 3:08 PM and 4:46 PM? 98 What is 444 minutes after 12:36 PM? 8:00 PM What is 283 minutes before 11:19 PM? 6:36 PM What is 424 minutes before 1:21 PM? 6:17 AM How many minutes are there between 4:16 PM and 1:14 AM? 538 What is 144 minutes after 11:58 AM? 2:22 PM What is 401 minutes before 2:33 AM? 7:52 PM What is 62 minutes after 7:09 PM? 8:11 PM What is 149 minutes after 9:09 PM? 11:38 PM What is 624 minutes after 1:32 PM? 11:56 PM What is 176 minutes before 7:05 PM? 4:09 PM What is 535 minutes after 3:52 PM? 12:47 AM How many minutes are there between 10:33 AM and 4:33 PM? 360 What is 706 minutes after 10:14 AM? 10:00 PM What is 360 minutes before 2:40 AM? 8:40 PM How many minutes are there between 9:15 PM and 11:12 PM? 117 What is 10 minutes after 4:53 PM? 5:03 PM What is 49 minutes before 8:20 PM? 7:31 PM How many minutes are there between 6:47 AM and 11:07 AM? 260 How many minutes are there between 6:29 PM and 4:01 AM? 572 How many minutes are there between 7:27 PM and 3:40 AM? 493 How many minutes are there between 9:54 PM and 5:20 AM? 446 How many minutes are there between 3:01 AM and 4:10 AM? 69 How many minutes are there between 5:14 PM and 8:04 PM? 170 What is 502 minutes after 4:52 AM? 1:14 PM What is 470 minutes before 3:57 PM? 8:07 AM How many minutes are there between 2:26 PM and 11:56 PM? 570 How many minutes are there between 12:32 AM and 4:15 AM? 223 What is 277 minutes before 1:16 AM? 8:39 PM What is 681 minutes before 9:54 AM? 10:33 PM What is 585 minutes after 3:19 AM? 1:04 PM What is 181 minutes before 2:22 PM? 11:21 AM What is 88 minutes before 3:50 PM? 2:22 PM How many minutes are there between 7:09 PM and 11:23 PM? 254 How many minutes are there between 2:02 AM and 3:04 AM? 62 How many minutes are there between 6:03 PM and 8:09 PM? 126 What is 96 minutes after 5:57 AM? 7:33 AM How many minutes are there between 5:12 PM and 8:49 PM? 217 What is 462 minutes after 2:01 AM? 9:43 AM What is 123 minutes before 9:08 PM? 7:05 PM How many minutes are there between 5:28 PM and 7:28 PM? 120 What is 400 minutes after 9:39 PM? 4:19 AM How many minutes are there between 1:15 AM and 3:47 AM? 152 What is 639 minutes before 10:48 AM? 12:09 AM What is 53 minutes before 6:36 AM? 5:43 AM What is 652 minutes before 4:56 PM? 6:04 AM What is 52 minutes after 9:51 PM? 10:43 PM What is 607 minutes after 8:34 AM? 6:41 PM How many minutes are there between 10:37 PM and 4:51 AM? 374 How many minutes are there between 10:11 AM and 5:21 PM? 430 How many minutes are there between 9:46 AM and 8:27 PM? 641 What is 546 minutes before 9:17 PM? 12:11 PM What is 482 minutes after 12:51 PM? 8:53 PM How many minutes are there between 4:56 PM and 5:07 PM? 11 How many minutes are there between 11:33 AM and 11:42 AM? 9 What is 457 minutes before 8:36 AM? 12:59 AM How many minutes are there between 7:52 PM and 12:29 AM? 277 What is 532 minutes after 9:41 PM? 6:33 AM How many minutes are there between 12:36 AM and 8:58 AM? 502 How many minutes are there between 12:40 AM and 8:19 AM? 459 How many minutes are there between 9:45 AM and 7:33 PM? 588 What is 612 m	{ "pile_set_name": "DM Mathematics" }
he nearest 10. -10 Round 1001887 to the nearest 1000. 1002000 Round -0.109556 to two decimal places. -0.11 Round 0.025806804 to 6 dps. 0.025807 What is 63201.3 rounded to the nearest 10000? 60000 What is -206070.08 rounded to the nearest 1000? -206000 What is 10.20597 rounded to 1 dp? 10.2 Round 0.0004066323 to 4 decimal places. 0.0004 Round -1050.295 to the nearest one hundred. -1100 Round 0.18873 to the nearest integer. 0 What is -0.00002536531 rounded to five dps? -0.00003 Round 74294.7 to the nearest ten thousand. 70000 Round 6843.97 to the nearest 1000. 7000 What is 0.059644611 rounded to five dps? 0.05964 What is -0.0001511194 rounded to six decimal places? -0.000151 What is 0.00001005773 rounded to six decimal places? 0.00001 Round -23.61039 to 1 decimal place. -23.6 What is 0.0062775952 rounded to four decimal places? 0.0063 What is 9279900 rounded to the nearest 100000? 9300000 What is -0.0000241381 rounded to five decimal places? -0.00002 Round -0.00000027522 to seven dps. -0.0000003 What is -11.99391 rounded to two dps? -11.99 Round 13929.05 to the nearest 10000. 10000 What is -1602.03 rounded to the nearest 10? -1600 Round 3133.141 to the nearest 1000. 3000 Round -33.0518 to the nearest 10. -30 What is 3940.15 rounded to the nearest one thousand? 4000 What is -374121.6 rounded to the nearest one thousand? -374000 What is 0.00000377906 rounded to seven dps? 0.0000038 What is -705121.8 rounded to the nearest ten thousand? -710000 Round 0.45825 to 2 decimal places. 0.46 Round -97406090 to the nearest one hundred thousand. -97400000 What is -883816 rounded to the nearest 1000? -884000 What is 0.0116468 rounded to four decimal places? 0.0116 Round 0.05053 to 2 decimal places. 0.05 Round 1.21473311 to 4 dps. 1.2147 What is 10224.434 rounded to the nearest ten? 10220 What is -0.009599 rounded to four decimal places? -0.0096 Round -144527.9 to the nearest 100000. -100000 Round -255975700 to the nearest one million. -256000000 What is -0.0000104953 rounded to 7 dps? -0.0000105 What is 23792.74 rounded to the nearest ten thousand? 20000 Round 21.40019 to 0 decimal places. 21 Round -0.08958991 to 3 dps. -0.09 What is -44216.3 rounded to the nearest one hundred thousand? 0 What is 0.02323829 rounded to 4 decimal places? 0.0232 Round -2284.578 to 0 dps. -2285 Round 24.36766 to two decimal places. 24.37 What is -0.001659163 rounded to four dps? -0.0017 What is -18131.211 rounded to the nearest ten? -18130 What is -647.201 rounded to 0 dps? -647 Round -383960.7 to the nearest 10000. -380000 Round 0.2349202 to two decimal places. 0.23 What is 24.7924 rounded to one dp? 24.8 What is -85.2077 rounded to the nearest integer? -85 What is -0.000012207911 rounded to six dps? -0.000012 Round -1767.128 to the nearest integer. -1767 Round -3.495804 to 2 decimal places. -3.5 Round -38.9074 to 1 dp. -38.9 What is -0.00001744761 rounded to 6 decimal places? -0.000017 What is 72982.71 rounded to the nearest 1000? 73000 What is -591.181 rounded to the nearest 100? -600 What is 0.0136256 rounded to two dps? 0.01 Round 0.0001456505 to four dps. 0.0001 What is -1741.284 rounded to the nearest integer? -1741 Round -0.0238845 to 3 decimal places. -0.024 What is 0.006381714 rounded to three dps? 0.006 Round 9027.3033 to the nearest ten. 9030 What is 0.0204191 rounded to three dps? 0.02 Round 6723794.7 to the nearest 100000. 6700000 What is 1.9454867 rounded to 1 decimal place? 1.9 Round -315.642 to the nearest one hundred. -300 What is 713780000 rounded to the nearest one million? 714000000 Round -0.00000163813 to seven decimal places. -0.0000016 What is -0.07846599 rounded to 5 decimal places? -0.07847 Round 465459 to the nearest 100. 465500 Round 0.0000899926 to 5 dps. 0.00009 What is 0.1684497 rounded to one decimal place? 0.2 What is -48.199437 rounded to 2 decimal places? -48.2 Round -113497.7 to the nearest 1000. -113000 What is -9.36759 rounded to 2 decimal places? -9.37 Round -0.0010773781 to six dps. -0.001077 Round -0.883727 to two decimal places. -0.88 What is 963.449 rounded to the nearest integer? 963 What is 37445.109 rounded to the nearest one hundred? 37400 Round -0.0000159909 to six decimal places. -0.000016 What is 179162.4 rounded to the nearest ten thousand? 180000 What is -308440500 rounded to the nearest 1000000? -308000000 Round 41360.9 to the nearest 1000. 41000 What is 1462506 rounded to the nearest ten thousand? 1460000 Round 275981900 to the nearest one hundred thousand. 276000000 What is -0.0216052 rounded to one dp? 0 Round 0.0040126 to three dps. 0.004 What is -0.08562443 rounded to 4 dps? -0.0856 Round 0.0000006103736 to 7 decimal places. 0.0000006 Round -189.32069 to 0 decimal places. -189 Round -587808 to the nearest 10000. -590000 What is 0.000003516777 rounded to 6 dps? 0.000004 What is -5115.09 rounded to the nearest 10? -5120 What is 0.00353894 rounded to four dps? 0.0035 Round -2416.1761 to one dp. -2416.2 What is -0.004456645 rounded to 4 decimal places? -0.0045 Round 22612.466 to the nearest one thousand. 23000 What is -0.0003892128 rounded to five dps? -0.00039 What is 0.001572865 rounded to 4 decimal places? 0.0016 What is 16.23481 rounded to 1 dp? 16.2 Round -5.607479 to three dps. -5.607 Round -31708813 to the nearest one hundred thousand. -31700000 Round -8856803 to the nearest 10000. -8860000 What is 0.282158 rounded to one decimal place? 0.3 What is -0.153161 rounded to 3 dps? -0.153 Round 0.0038276175 to six decimal places. 0.003828 What is -17375.85 rounded to the nearest 100? -17400 Round 5096650 to the nearest one million. 5000000 Round -0.000000295775 to 7 decimal places. -0.0000003 What is -33.4776 rounded to 1 dp? -33.5 Round -13.1583 to one decimal place. -13.2 Round -1153.4285 to the nearest 100. -1200 Round 229622600 to the nearest one million. 230000000 What is 14881730 rounded to the nearest one hundred thousand? 14900000 What is 7310.7 rounded to the nearest ten thousand? 10000 What is -95.97109 rounded to the nearest ten? -100 Round -0.0011296855 to six decimal places. -0.00113 What is -0.0000045535 rounded to seven dps? -0.0000046 Round -865036620 to the nearest one hundred thousand. -865000000 Round 4269392100 to the nearest one million. 4269000000 Round -8402.76 to the nearest 10000. -10000 Round 121137 to the nearest 1000. 121000 Round -180.0354 to the nearest integer. -180 What is 276531 rounded to the nearest 10000? 280000 Round 0.001898761 to 6 decimal places. 0.001899 What is -0.000236597 rounded to 4 dps? -0.0002 What is 3.497501 rounded to 3 decimal places? 3.498 What is -4.25871 rounded to two decimal places? -4.26 What is 0.0001282974 rounded to six dps? 0.000128 What is 623459 rounded to the nearest ten thousand? 620000 What is 4996195 rounded to the nearest one million? 5000000 What is -146953.59 rounded to the nearest 100? -147000 What is -4761980.4 rounded to the nearest one thousand? -4762000 What is 0.00341834 rounded to 4 dps? 0.0034 Round -70510.4 to the nearest 10000. -70000 Round 0.001968421 to three dps. 0.002 Round -0.001302956 to 5 dps. -0.0013 What is -913.4524 rounded to the nearest integer? -913 What is -29252800 rounded to the nearest 100000? -29300000 Round 9.6127 to two decimal places. 9.61 Round 21063489 to the nearest one million. 21000000 Round -0.931611 to three dps. -0.932 What is 3.404276 rounded to two dps? 3.4 Round 877319 to the nearest 10000. 880000 Round -0.01494192 to four dps. -0.0149 Round 585278.2 to the nearest 100. 585300 What is -0.0001106509 rounded to five dps? -0.00011 What is -4660.574 rounded to the nearest integer? -4661 Round 818616 to the nearest one hundred thousand. 800000 Round 0.0003048806 to five decimal places. 0.0003 What is 0.1040813 rounded to 2 dps? 0.1 What is -514.563 rounded to the nearest 10? -510 Round -164655100 to the nearest 1000000. -165000000 What is 5145.653 rounded to the nearest one thousand? 5000 What is -0.000000526843 rounded to 7 decimal places? -0.0000005 Round 2.528578 to three decimal places. 2.529 Round 47.01266 to the nearest one hundred. 0 What is 0.00294706 rounded to 4 dps? 0.0029 Round 0.0034838173 to 4 dps. 0.0035 Round 0.00020398 to 6 dps. 0.000204 What is -7384500 rounded to the nearest one hundred thousand?	{ "pile_set_name": "DM Mathematics" }
t is 8705463690 minus 34757? 8705428933 Calculate -21740008172 - 30. -21740008202 Calculate -6332.77010382 - 3. -6335.77010382 What is 17730897688 plus -124? 17730897564 Add 1.8 and -237486.241955. -237484.441955 Add together 1288798129 and -458.267. 1288797670.733 Total of 791.2 and -40.6605528. 750.5394472 Work out 1844304274 + -24.7. 1844304249.3 Sum -0.3308306428 and -0.23. -0.5608306428 What is the distance between 76758281776 and -2102? 76758283878 -223 + 755518618506 755518618283 What is -0.163 minus 128732716963? -128732716963.163 Work out -1471130985844 + 44. -1471130985800 What is 8176838607282 minus 5? 8176838607277 Calculate -1.1 - 99141721971. -99141721972.1 Total of -0.82 and -133.40367497. -134.22367497 What is the distance between 1368597952 and 41145? 1368556807 What is -58236683 minus 41.7107? -58236724.7107 Total of -101622141909 and 0.2. -101622141908.8 What is -20758375360 - 48? -20758375408 Work out -16492 - 15326372. -15342864 What is -12865.568 plus -100582? -113447.568 Sum -303442485.4116 and 3. -303442482.4116 What is the distance between 0.0339698 and 826239? 826238.9660302 What is 1.74 - 12860.2729? -12858.5329 Calculate -0.11 - 6742547925. -6742547925.11 Add -455791499 and 51489. -455740010 Subtract 8926892801 from 5575. -8926887226 1 - -1078817191789 1078817191790 What is 1 take away -75937649440? 75937649441 Work out 80109717962.49 + 5. 80109717967.49 Total of 478.6767 and -244. 234.6767 3 + -22464156581 -22464156578 What is 27399543509 minus -0.03? 27399543509.03 What is -0.3 - 149693779974? -149693779974.3 Total of 3 and -8128950078966. -8128950078963 What is the distance between -20 and 38550473245? 38550473265 Total of 154171486818 and 5. 154171486823 Add together -37776199192 and -26. -37776199218 What is 21009561472 take away -667? 21009562139 What is -25552 minus 7396256? -7421808 Put together -2 and 68873872633310. 68873872633308 2 + -10052858265642 -10052858265640 171430.55099 - -0.3 171430.85099 -1027799315+6213 -1027793102 Add together 0.6551158639 and 4844. 4844.6551158639 What is the difference between -1357968 and -8777422? 7419454 What is the difference between -257834306539 and 0.3? 257834306539.3 Calculate -191533018222 - -0.3. -191533018221.7 What is -6851.428 - -0.0857859? -6851.3422141 Work out 2940853506 - -0.0764. 2940853506.0764 Subtract 0.14559416667871 from 0.4. 0.25440583332129 What is the difference between 9 and -6.29911321? 15.29911321 What is 7.1494288 - -4742? 4749.1494288 Add together 0.3251 and 261650300. 261650300.3251 Subtract -0.5 from 815881892.59192. 815881893.09192 What is 237.9694555 - 733? -495.0305445 What is 601.7 minus -2406468.08? 2407069.78 Subtract -5 from 12936781702.3463. 12936781707.3463 Work out 2 + 111833172952751. 111833172952753 Add -4.5107 and -274454637. -274454641.5107 Add -177.69903921 and -0.1965. -177.89553921 Work out 2580 - 24.9399151. 2555.0600849 Work out -1.5 + 13580199.16435. 13580197.66435 What is 5801614.719 plus 486? 5802100.719 Subtract -0.2 from -37614711586. -37614711585.8 What is 1.2 plus -43389.163284? -43387.963284 Add -1311185903518 and -0.306. -1311185903518.306 What is the distance between -2453 and -228942846.8? 228940393.8 23 + 236034752281 236034752304 What is -3 less than -1565.7433695693? -1562.7433695693 Calculate -257156249384 - 4.1. -257156249388.1 207754327942 - -0.2 207754327942.2 What is 5009909681.18 less than -5? -5009909686.18 What is 1650.8926 - 1.1548? 1649.7378 What is the distance between -0.3505357779 and 0.034? 0.3845357779 Work out -74857541 + 60.6298. -74857480.3702 What is -1805435416409 minus -4? -1805435416405 What is -167.35 - -28932.15? 28764.8 -13 - 17637039696792 -17637039696805 What is 4643437.0594 take away 4? 4643433.0594 What is 33286858401.28 take away 0.18? 33286858401.1 1760507 - -242614 2003121 What is 98463283418490 less than -4? -98463283418494 What is -104.33855093687 minus -0.6? -103.73855093687 0.03 + 4911282083357 4911282083357.03 What is 194122 plus -0.097424128? 194121.902575872 What is 15796264 take away 183? 15796081 What is 288 less than -0.05950162163? -288.05950162163 What is 331.762 less than 9283170? 9282838.238 -1138033 - -60207 -1077826 Sum 3 and -4970074228680. -4970074228677 Work out 17055.443771 + 14.29. 17069.733771 What is the distance between -1396985640357 and 0.2? 1396985640357.2 -0.58 + 599099.6594845 599099.0794845 Calculate -177382.0038 - -76288.2. -101093.8038 3438.97+-19607473 -19604034.03 Work out -1430.2118 + -588946. -590376.2118 31.891 - 12863.71 -12831.819 What is -13139961 + 6691983? -6447978 What is 91.5 less than -3459001112? -3459001203.5 Subtract 3127 from -118266762. -118269889 What is 89996772 take away -306940.3? 90303712.3 Sum 311025 and 0.766703594. 311025.766703594 What is 0.18996 less than 0.0018599919? -0.1881000081 Add together 0.00970379 and 2748.7563. 2748.76600379 What is 7257 less than 861.9048? -6395.0952 Work out -17771.9 + 298.380995. -17473.519005 Total of -335 and 5044.7218. 4709.7218 Add together 5.46165 and -388215. -388209.53835 191574111 - -12314 191586425 Work out -684762.3 - -81796. -602966.3 Add together -27 and -62515409.253. -62515436.253 Total of -7755341506 and -6.84. -7755341512.84 Calculate -2028.8629988318 + -0.3. -2029.1629988318 What is 2609366 minus -51925215? 54534581 Work out -0.5 - -4398071133488. 4398071133487.5 -0.017 + -67903015740 -67903015740.017 Calculate -12.4 - 429622763240. -429622763252.4 30727.347+0.381932 30727.728932 7185+186797.95 193982.95 Sum 0.7 and 0.42381091378. 1.12381091378 Add together 0.4 and -54724022363. -54724022362.6 Add 4.1515 and 54150.17613. 54154.32763 What is 12640.43695 + -1602? 11038.43695 Subtract -285464411 from 43.2. 285464454.2 Sum 5072.95121 and -872. 4200.95121 Total of -4.2 and 31886437.02. 31886432.82 Calculate -4219512564.6 + 10.15. -4219512554.45 What is 331523902384 minus -0.1? 331523902384.1 Calculate 6654724 + 27.43539. 6654751.43539 Sum -0.0583936 and 119362.258. 119362.1996064 What is -137 less than -18007619537? -18007619400 Work out 19862 + 0.1430847. 19862.1430847 What is 0.03 + -71713098528? -71713098527.97 Calculate 0.1 - 157562.1415463. -157562.0415463 What is 39828753112238 - -0.4? 39828753112238.4 Calculate 0.24257 - -143.38938. 143.63195 What is 215924434877 minus 1162? 215924433715 What is -0.52 less than 41.3534140019? 41.8734140019 Subtract 12547 from -4668.403141. -17215.403141 Subtract 1845008783 from 0.683. -1845008782.317 Work out -8584.0915 - -785.01. -7799.0815 Sum 97518 and 372.8888009. 97890.8888009 Subtract -0.9367 from 11.27461. 12.21131 Work out 5 - -45762568613. 45762568618 12418873 - -3518.4 12422391.4 Add -99.6 and -241750745. -241750844.6 -210137.2615933 + -3 -210140.2615933 What is -409629593158 + 0.7? -409629593157.3 1564733855021+-0.1 1564733855020.9 Total of 3408 and -356636.146. -353228.146 190626812510 - 2.43 190626812507.57 What is the difference between 0.168071231 and 18962? 18961.831928769 3856 - -30920982 30924838 Sum 664376 and 46000.4. 710376.4 Work out 21476382119 + -8. 21476382111 What is the difference between -3790077 and -4550801? 760724 What is -2092 + 6515986? 6513894 What is 5 + -38729067221? -38729067216 What is 998591624.04 plus -407? 998591217.04 What is the distance between -0.4 and 158613.0700074? 158613.4700074 What is -154134262 less than -331283? 153802979 780436+-368.908 780067.092 Subtract 168 from -360853620. -360853788 Add 21.74 and -0.0006183522. 21.7393816478 Work out 1854.5239240399 - -9. 1863.5239240399 Put together 849614074 and -41335. 849572739 What is the distance between -1031298198 and 11128? 1031309326 Subtract 137600952 from 512.77. -137600439.23 What is 1366 + 1563865.5744? 1565231.5744 What is 5 + -53579283072? -53579283067 Calculate -0.0103403 + -40997715. -40997715.0103403 Work out 2087677685.4685 - 0.2. 2087677685.2685 What is -0.01657779 - -273? 272.98342221 What is -1742 take away 556600.346467? -558342.346467 -73071437555 + -0.14 -73071437555.14 Add together -2616.28 and 0.0536169. -2616.2263831 What is 96.4 minus -226409512? 226409608.4 -0.86 - 514294.073626 -514294.933626 Calculate -251518372126 - -0.01988. -251518372125.98012 What is -405563663386 take away -0.5? -405563663385.5 Work out 0	{ "pile_set_name": "DM Mathematics" }
sqrt(216) + sqrt(216)-1))/(sqrt(6) + sqrt(6) + (sqrt(54)/sqrt(36) - sqrt(6) - sqrt(6))))/((3sqrt(432)-3 - sqrt(432))5))*2. 0 Simplify 1 + (1 + (sqrt(192) + 0 + sqrt(192) + -1 + sqrt(192) - sqrt(192)) + 1(sqrt(192) + 4 + (sqrt(192) + -1sqrt(192) - sqrt(192))))2. 128sqrt(3) + 785 Simplify 2 + (sqrt(16) - (sqrt(128) + sqrt(128)-2)/sqrt(8) - sqrt(1296)-2)/(5(2sqrt(72) - sqrt(72))) + -3. -1 + 4sqrt(2)/3 Simplify (sqrt(114)/(sqrt(2) - 4sqrt(2)) - sqrt(342)/sqrt(6)-5)/(sqrt(108)/sqrt(36) + (sqrt(162)2 - sqrt(162))/sqrt(6)). 7sqrt(19)/6 Simplify ((sqrt(5)13 - sqrt(125)1)-1 + 5 + -1)2 + -2 + 3. 16sqrt(5) + 37 Simplify (-1((sqrt(144) - sqrt(144)-3)-1)/sqrt(8))/((sqrt(6) + (sqrt(486) + 3sqrt(486) - sqrt(486)) + sqrt(6))66). sqrt(3)/261 Simplify 3 + ((-2 + sqrt(15)/sqrt(3) - (sqrt(20) + -2)) + -2 - (sqrt(125)2-4 + -3))*2. 78sqrt(5) + 7609 Simplify (-6(0 + -6sqrt(931) + 2) + 0)*22. -12096sqrt(19) + 2413440 Simplify (sqrt(315)/sqrt(81) - (sqrt(140) + sqrt(140)1))/(sqrt(80)-14 + sqrt(80) + sqrt(80)) + -1. -1 + 11sqrt(7)/24 Simplify -4(-2(-2 + sqrt(1377) - sqrt(1377)))21 + 4((sqrt(1377) - (sqrt(1377) + -3))-4)*2-4. -2368 Simplify (sqrt(180)/(sqrt(12)/sqrt(2)6)-4)/(((sqrt(120) + (sqrt(120) - sqrt(120)1))-4)/(sqrt(12) - sqrt(48)-3)). 7sqrt(3)/6 Simplify (5(sqrt(1200) - (-1sqrt(1200) + sqrt(1200)))-4)/(sqrt(150)6 - (sqrt(6) + (sqrt(486) + sqrt(6) - sqrt(6)) + sqrt(6))-5). -40sqrt(2)/17 Simplify (2-4sqrt(102) - (sqrt(102) - (6sqrt(102)-3 + sqrt(102) + sqrt(102))))/(4(sqrt(96) + sqrt(96)24)). -25sqrt(17)/144 Simplify -5 + -2 + (1 + (sqrt(8)/sqrt(4) + -3 + sqrt(2)2-5 + 6sqrt(12)/(sqrt(6)-2))*2)1. 72sqrt(2) + 291 Simplify (-1 + -2sqrt(171) + 1 + sqrt(171)3 + sqrt(171) + sqrt(171) + (-1sqrt(171)-2 + sqrt(171) - -2(sqrt(171) + -1)))*2. -96sqrt(19) + 10948 Simplify 4((sqrt(704)26)2 - ((sqrt(704) + 0)2 + sqrt(704) + -5)) - -4(-5 + 1 + sqrt(704) + -1)*2. -352sqrt(11) + 405624 Simplify (-4(-4(sqrt(425) + 2) - 2(0 + sqrt(425) - sqrt(425)) - ((sqrt(68) - sqrt(68)1)-3)/(-5sqrt(20)/sqrt(5))))*2. 5120sqrt(17) + 109824 Simplify 1(sqrt(288) - 2(sqrt(288) + sqrt(288) + -1))*2 + 4 - (-3 + 4sqrt(288)-1 + (sqrt(288) + 0)-2)*2. -7777 - 576sqrt(2) Simplify (sqrt(260)/sqrt(5)4 - sqrt(520)/(sqrt(20)/sqrt(2))) + 5 + -55(2 + sqrt(13))2 + -1. -421 - 94sqrt(13) Simplify ((-1sqrt(95)-1 - ((sqrt(95) + sqrt(95)2 + sqrt(95))-1 + sqrt(95)))/(1(sqrt(45) - sqrt(315)/sqrt(7)) + sqrt(45)))2 + -3. 277/9 Simplify (sqrt(7) + -2 + sqrt(7) + 2 - (-6(sqrt(7) + sqrt(28)/sqrt(4)))*2) + (-1(0 + sqrt(700)))*2 + (sqrt(700) + (-1 + sqrt(700))4)*2 + sqrt(700) + -5. -388sqrt(7) + 17203 Simplify ((sqrt(105) + -3sqrt(105) + sqrt(105))/sqrt(7) + sqrt(735)5)/(sqrt(108) - (sqrt(108) - (1sqrt(108) - sqrt(108)))-6 - 1-1sqrt(108)). 17sqrt(5)/24 Simplify (((-2(2 + sqrt(252)) - (sqrt(42)/(sqrt(12)/sqrt(2)) + -1)) + 3 + -3)-5)2. 1950sqrt(7) + 29800 Simplify (-3((sqrt(11) + -1)-2 + 3) - (1 + sqrt(275) + 5 - 1(sqrt(275) - sqrt(275)2))*2) + -2. -1153 - 114sqrt(11) Simplify 5 + -1 + (-5 + sqrt(242) + -5)*2 + -3 + 4 + 1(sqrt(242) + -3). -209sqrt(2) + 344 Simplify (sqrt(13) - (1 + sqrt(13) + 0) - ((sqrt(78)1 - sqrt(78))/sqrt(6))*2) + 4(-1 + sqrt(117)3). -5 + 36sqrt(13) Simplify sqrt(95)/(sqrt(5)4) + (sqrt(95)/(sqrt(20)/sqrt(4) + sqrt(5)))2 - (2sqrt(114)/sqrt(6) - (-1sqrt(133))/sqrt(7))2. -665/4 + sqrt(19)/4 Simplify (2(1 + (sqrt(48) + (4(sqrt(432) + sqrt(48)) - sqrt(48)) - sqrt(48)))12)2. 1920sqrt(3) + 172816 Simplify 3((sqrt(66)/sqrt(18) - sqrt(33))/(sqrt(88)/sqrt(2)) + (-1(-3 + (0 + sqrt(192) - sqrt(192))))*2). -sqrt(3) + 27 Simplify ((0 + sqrt(304)-2 - (sqrt(304) + sqrt(304) + 1 + 5 - sqrt(304))) + 5)*2 - -4((-3 + 1 + sqrt(2299))*2 - 6-2sqrt(2299)). 376sqrt(19) + 11949 Simplify ((sqrt(147) + -5 + 3 - (sqrt(147) - sqrt(147)1)-4) + -2 + -3)*2-4. -784 + 392sqrt(3) Simplify (sqrt(204)-22 + sqrt(204))/(sqrt(48)/(sqrt(12)/sqrt(3))) + ((sqrt(136)/(sqrt(200) + 2sqrt(200)))*2 - 3(sqrt(153) + -1)*2). -103933/225 + 15sqrt(17) Simplify 1sqrt(52)/sqrt(4) + sqrt(65)/(sqrt(20)/sqrt(4)) + -5 + -4 - (-54(sqrt(1872) - (-2 + sqrt(1872))2) + -1). -37528 + 1202sqrt(13) Simplify (4 + (-2(sqrt(1100) + 1) - ((sqrt(1100) + sqrt(1100) + -1)3 - sqrt(1100))))*2 - (1 + (3(1sqrt(1100))2 - 3(-1 + sqrt(1100) + sqrt(1100)))). -640sqrt(11) + 50621 Simplify (((sqrt(616) - -5-1sqrt(616))/((sqrt(22) + sqrt(88)/sqrt(4))/sqrt(2)))/((1sqrt(968) + sqrt(968))3 + sqrt(968)26))2. 7/9801 Simplify (2 + (5 + sqrt(243) + sqrt(243) + 1 + 0 + sqrt(243) + sqrt(243) + 2sqrt(243)5)1)*2. 2016sqrt(3) + 47692 Simplify 0 + (0 + 2 + sqrt(208) + 3 - (-3sqrt(208) + 0 + -3))2. 256sqrt(13) + 3392 Simplify (3(-2(4 + (-1 + sqrt(176) - sqrt(176)) - 1(1 + sqrt(176))) + sqrt(176)3-3 + (-3 + sqrt(176))4))*2. 3456sqrt(11) + 16560 Simplify (-2-1sqrt(85) + 4sqrt(85)-4)/(sqrt(5) + sqrt(55)/(sqrt(22)/sqrt(2)) - 1sqrt(500)). 7sqrt(17)/4 Simplify (sqrt(2200) + -1sqrt(2200))/(sqrt(10)/sqrt(5)5) - (-2 + sqrt(396) + (sqrt(11) - sqrt(110)/(sqrt(80)/sqrt(8)))). -6sqrt(11) + 2 Simplify 2 + 3 + (sqrt(304)-2 + 4)*2 + (sqrt(1216) - (1 + sqrt(1216))3)*2. 32sqrt(19) + 6110 Simplify 4 + (-31(sqrt(104) - ((sqrt(104) - sqrt(104)3) + sqrt(104))))/(sqrt(24)/((2sqrt(27))/sqrt(9))). -12sqrt(13) + 4 Simplify 3(1 + ((-2sqrt(126) + sqrt(126))/sqrt(3) - sqrt(42))/sqrt(6) + (2sqrt(700)1 - (sqrt(700) - (2sqrt(700) + sqrt(700)))-5))2. -492sqrt(7) + 141207 Simplify ((sqrt(55) + sqrt(220)/sqrt(4)-2 + (sqrt(385) - (sqrt(385) + sqrt(385) + sqrt(385)2) - sqrt(385))/sqrt(7))4)/((-2-2sqrt(99))/sqrt(9)1). -5sqrt(5) Simplify (-4sqrt(2)1 - (sqrt(72) + 5)) + sqrt(64)/sqrt(8) + (-4sqrt(162))*2. -8sqrt(2) + 2587 Simplify (-6(-3 + ((1 + -2sqrt(128))-1 + -4 - (0 + (sqrt(128) - 1sqrt(128)) + 3)-2)))2. -2304sqrt(2) + 18576 Simplify (sqrt(7) + -1 + sqrt(35)/sqrt(5) - (5 + sqrt(112))) + 5 + (1sqrt(112) + -1)26. -50sqrt(7) + 677 Simplify (4(6((sqrt(7) - (sqrt(7) + sqrt(7) + 1 + -3)) + 1 + 0 + sqrt(7)) + 5(sqrt(504)/(-1sqrt(8)) + sqrt(63))))2. 5184 Simplify ((-4sqrt(78)4 - sqrt(78)) + sqrt(78) + 3(sqrt(78)2 + sqrt(78)) + sqrt(78))/(-6(sqrt(54) + (sqrt(7776) + -3sqrt(7776) + sqrt(7776) - sqrt(54)))). -sqrt(13)/36 Simplify (2 + (sqrt(288) + sqrt(288)4)-5)2 - -6(2sqrt(288))2-6. -1200sqrt(2) + 138532 Simplify 4(-1 + -1 + sqrt(1100) + 4 + 0 + 5)*2 + 0. 560sqrt(11) + 4596 Simplify (5(5 + sqrt(76)/sqrt(4))2)*2 - (2(sqrt(190) + (sqrt(190) - -1sqrt(190))))/(-2sqrt(360) - sqrt(360) - sqrt(360)). 4001sqrt(19)/4 + 4400 Simplify (2 + -6(2sqrt(539) - sqrt(539)) + sqrt(539)1 + 0 - (-2 + (sqrt(539) - (sqrt(539) + -1sqrt(539)3))4))2. -952sqrt(11) + 155787 Simplify (1-3sqrt(68) + sqrt(68) + (sqrt(68) - (sqrt(68) - (sqrt(68) + (sqrt(68) - -6(sqrt(68) - -1sqrt(68)))))))/((2sqrt(2800))/(sqrt(77)/sqrt(176))). 3sqrt(17)/20 Simplify (52sqrt(196) - 1sqrt(196)-1)/(2(-1sqrt(96))/sqrt(3)). -77sqrt(2)/8 Simplify (2sqrt(110)/sqrt(40)3)2 + sqrt(88)/(sqrt(16)/sqrt(2)) + sqrt(99)-2 + -4. -5sqrt(11) + 95 Simplify -5((sqrt(76) + 2 + sqrt(76) + -1 - ((-2sqrt(76))2 + 0)) + (sqrt(76)-2 + -3 + sqrt(76) + (sqrt(76) - sqrt(76)-25))*2). -36530 + 580sqrt(19) Simplify 2 + (-1sqrt(133)1)/sqrt(7) - (sqrt(190)/sqrt(5)4)/(-2sqrt(200) + sqrt(200)). -3sqrt(19)/5 + 2 Simplify -6(-1(-2 + sqrt(252) + 3) - 1(3 + (sqrt(252) - -4sqrt(252))))2. -54528 - 1728sqrt(7) Simplify -2 + (-5 + (sqrt(304) - 4sqrt(304))2 + (sqrt(1539)-3-5)2)-1. -349008 Simplify -3(sqrt(384)/sqrt(2) + sqrt(432)/sqrt(4)) - ((sqrt(9)/sqrt(12))2 + (sqrt(300)3)*2 + -1). -10799/4 - 42sqrt(3) Simplify (-2(-2 + sqrt(252)) + (sqrt(252) + sqrt(252) + -32sqrt(252) - sqrt(252)) - (3(-1 + sqrt(252)) - (sqrt(252)-1 + -2)))2. -660sqrt(7) + 30517 Simplify 4 + (-1(5 + 3sqrt(405)) + (2sqrt(5) + 0 - ((sqrt(5) - sqrt(80)) + -2 + sqrt(5)))5)*2. -70sqrt(5) + 274 Simplify (-2sqrt(144))/sqrt(12) + sqrt(12) + (sqrt(12) - (-3 + sqrt(12)-1)) - -4-4(-1 + sqrt(48)). -62sqrt(3) + 19 Simplify (sqrt(14) + sqrt(1134) + (sqrt(1134) - sqrt(1134)4 - sqrt(1134)) +	{ "pile_set_name": "DM Mathematics" }
3w5x*2 - 9w*2 - 8x*2 wrt w? 1200w*3x*2 + 180w*2x*2 Differentiate 260m*4 + 200. 1040m*3 What is the first derivative of 2p*4 + 171p*3 + 1281 wrt p? 8p*3 + 513p*2 What is the third derivative of 371f*3r2 - f3r - 8f*3 + 47f*2r2 - f2 wrt f? 2226r2 - 6r - 48 What is the derivative of 5v2x*2 + 143v*2 + 2vx - 3x*2 wrt x? 10v*2x + 2v - 6x Find the first derivative of -121u4 + 2u - 455. -484u3 + 2 Find the third derivative of tx*5 + 12tx2 - 6x6 - x4 + 3x2 wrt x. 60tx2 - 720x*3 - 24x Differentiate 17fry - fy + 13f - 5r - 3y2 wrt y. 17fr - f - 6y What is the third derivative of 91sx*3y + 4sx*2y - 3sx*2 - 5x*3y - x*2y + 9xy wrt x? 546sy - 30y Find the second derivative of -33q*3x*2 - 34q*3 - 19qx + 15x*4 wrt x. -66q*3 + 180x*2 Find the second derivative of -3d*3 + 4d*2k*2 - 4d*2y + 2d2 - 106dk2 + dy + ky wrt d. -18d + 8k2 - 8y + 4 What is the second derivative of q*3r + 30q3 - 3q*2r + 5q2 + 2qr + 1071q + 8 wrt q? 6qr + 180q - 6r + 10 Find the third derivative of -8h3s*4 - 4h*3 + 24h*2s*4 + 38s*2 wrt s. -192h*3s + 576h2s What is the third derivative of -2b6 - 3b*4 - 41b*3 - 1234b*2 + 9b + 2? -240b3 - 72b - 246 Find the third derivative of 156al*2m*3 + 2al2 + am*3 - 2am + 5a - 7l2m*2 wrt m. 936al2 + 6a What is the second derivative of -1276y2 + 110y - 27 wrt y? -2552 Differentiate 893r2 + 2053 with respect to r. 1786r What is the third derivative of -1327z5 + 843z*2? -79620z*2 Find the third derivative of 3591hs3 + 94hs2 + 35s*2 wrt s. 21546h Find the second derivative of 110f2 - 12f - 12 wrt f. 220 Find the second derivative of g*5 - 61g*3 - 177g + 3 wrt g. 20g3 - 366g What is the second derivative of 38j4m + j*4 - jm + 3j + 6m wrt j? 456j2m + 12j2 Find the second derivative of -127h*2py2 + 2h*2py + 4hpy*2 + 2hy3 - 2py + 426y wrt y. -254h2p + 8hp + 12hy Differentiate 358jpu3 - 4ju + j - 44u*3 with respect to p. 358ju3 Find the first derivative of -222mw - 2m - 210w + 2 wrt m. -222w - 2 What is the derivative of -15jv*2w*2 - 65jvw*2 + 1463jw + w2 + w wrt v? -30jvw*2 - 65jw2 What is the second derivative of 28l*2z*3 + 126l*2z*2 - 7l*2z - 1180lz wrt z? 168l2z + 252l2 What is the first derivative of -143u*2 + 35? -286u What is the third derivative of -2c6w + 19c5w*2 - 3c*2w - 5w2 wrt c? -240c*3w + 1140c2w*2 Find the third derivative of -51k*3r*2 + 169k*3 + 388k*2r*2 + 3k*2r + 7k2 wrt k. -306r*2 + 1014 What is the second derivative of 4jo3 - 3jo2 + 2jo - 319j - 11o3 wrt o? 24jo - 6j - 66o What is the derivative of 3hn - 20hq3 - 62nq3 - q wrt n? 3h - 62q3 Find the third derivative of -10713a*3bp - a3b + a*2 - abp - 246bp + 2b wrt a. -64278bp - 6b Find the first derivative of -51an3x - 2an*2x - 10n3x - 2nx wrt a. -51n3x - 2n2x What is the third derivative of k*4s*3 - 170k*4 + 5k*2s*3 - 50ks3 wrt k? 24ks3 - 4080k Differentiate -qv4 + 817qv2 + 1703q + v with respect to v. -4qv*3 + 1634qv + 1 Differentiate 167s - 62 with respect to s. 167 Find the third derivative of 343g3n*3 + 1015g*3n2 + g2n2 - 29gn3 wrt n. 2058g*3 - 174g Find the third derivative of -3g6 - 20g*4k + 5g3k + g*2 + 212k wrt g. -360g3 - 480gk + 30k Find the third derivative of v*3y*5 + 4779v*3y*4 - 153v*3y - 2y2 wrt y. 60v*3y*2 + 114696v*3y What is the second derivative of -13f3 - 6f*2 - 169f? -78f - 12 Find the second derivative of 357j*2 - 79j - 1. 714 Find the third derivative of -41l4 - 105l*2 wrt l. -984l What is the third derivative of -2g4 - 527g*3 + 23g*2 + 4? -48g - 3162 What is the second derivative of 28d2j3 + d2 - 29dj + 2j3 wrt j? 168d*2j + 12j Find the second derivative of 1620h*3u2 - h3 + 2h2 + 119hu wrt u. 3240h*3 What is the first derivative of 2441n*4 + 3375? 9764n*3 What is the derivative of 131mw + 13mx2 + 193wx2 - 5 wrt m? 131w + 13x2 What is the third derivative of -241u*5 - 90u*2? -14460u*2 Find the second derivative of -102d*2 + 194d. -204 What is the second derivative of 2k2l*2 - 421k*2l - k - 18l2 wrt k? 4l*2 - 842l Find the second derivative of -4a3w2 + a3 + 2aw*2 + 4601aw + 372w*2 wrt w. -8a*3 + 4a + 744 Find the first derivative of 1353g - 5715. 1353 Differentiate op*3w*3 - 1267ow3 + 47p*3w*2 + 2pw3 + w with respect to o. p3w*3 - 1267w*3 Find the third derivative of 25474m*3 + 108m*2 + 17m wrt m. 152844 Find the second derivative of -119j3m3 - j3m + j3 + jm*3 - 136j - m*3 wrt j. -714jm3 - 6jm + 6j What is the first derivative of -3hkn2 - 3hkn + 21hk + 206kn*2 wrt h? -3kn2 - 3kn + 21k What is the third derivative of 3448p4 - p2 - 14p - 31? 82752p What is the third derivative of 141i*5 - 4i*2 - 2i? 8460i2 What is the second derivative of b2i*3 - 3b*2i - b*2 + 2bi - 26i*4 wrt i? 6b*2i - 312i2 What is the derivative of a2 - 3a + 162 wrt a? 2a - 3 What is the third derivative of 3988k*3 - 2130k*2 wrt k? 23928 What is the third derivative of 28r*6 - 43r*3 + 11070r*2 wrt r? 3360r*3 - 258 What is the second derivative of -194h*2 + 1236h? -388 Find the third derivative of 165b3k*2 + 12b*3k + 888b2k*2 + 2b*2 wrt b. 990k*2 + 72k Find the second derivative of -99h5 - 3h*2p + hp + h + 2p wrt h. -1980h3 - 6p Find the second derivative of 6l3p*2 - 4l*3p - 5l2p*3 - 22lp2 + 2l + 6p wrt p. 12l*3 - 30l*2p - 44l What is the first derivative of 1706df2 + 2d + f*2 + 1051 wrt f? 3412df + 2f Find the second derivative of -692h3x*2 - 1446h*3x wrt x. -1384h3 Differentiate -48pr - 9373p - 33r3 wrt r. -48p - 99r2 Differentiate -s4 + 123s + 225 with respect to s. -4s3 + 123 Differentiate 8624p - 7166. 8624 Find the third derivative of -2x6 - 20x*3 + 24x*2. -240x3 - 120 What is the first derivative of g2i3x + 118g2i*3 + 2g*2ix - 3i*3 + 17ix wrt x? g2i*3 + 2g*2i + 17i Find the first derivative of -b3w - 57b3 + 2345b*2w - 24 wrt w. -b*3 + 2345b*2 Find the third derivative of -2m*3p*3 - 91m*3 + 200m*2p*3 wrt m. -12p*3 - 546 Find the third derivative of -12507r*5 + 52r*2 - 7. -750420r*2 Differentiate 7h*3 + 142h - 2637 wrt h. 21h2 + 142 Find the first derivative of -2a*3iy2 + 6318a*3i + 996a3y - 2ay*2 wrt y. -4a*3iy + 996a*3 - 4ay Differentiate 79i + 309 with respect to i. 79 What is the second derivative of 7841f2k*2 - 561f*2k + 8f2 wrt k? 15682f*2 What is the second derivative of -150l*3u*2 - 3l3 + l2 - lu3 + 10lu wrt u? -300l*3 - 6lu What is the third derivative of 9h*3k*2 + 40h*2k - h*2 + 3hk2 wrt h? 54k*2 What is the third derivative of -394i*3 + 16i*2 + 4i? -2364 What is the second derivative of -2275k3n*2 - 25k*3 - 2k*2n - 139n wrt n? -4550k*3 Find the second derivative of 1154k*2 - 11915k. 2308 What is the second derivative of 1305m5 + 189m + 6? 26100m3 Find the third derivative of -462h*3 - 284h*2 wrt h. -2772 Find the second derivative of 958w*5 - 130w wrt w. 19160w3 Find the second derivative of 2714u*5 + 888u. 54280u3 Differentiate -165k*4 + 369 with respect to k. -660k*3 What is the third derivative of -2b*4c*3 + 256b*4c + b*3c3 - b2c3 + 3c*3 - 39 wrt b? -48bc3 + 6144bc + 6c*3 Differentiate 2dm2 + 41dm + 551d - 4m3 with respect to m. 4dm + 41d - 12m2 What is the derivative of 3b*3f*2 + 203b3 + f4 + f wrt f? 6b3f + 4f3 + 1 Find the first derivative of 17b*3 - 167 wrt b. 51b*2 Find the first derivative of 1233c*2 - 2052. 2466c Find the first	{ "pile_set_name": "DM Mathematics" }
= zw + 24 for w. -7 Let q = -576 + 605. Suppose s - 3c = -6c + 11, 5s + 2c = q. Solve sv - 10 = 5 for v. 3 Let g(m) = -2m2 + 58m - 16. Let f be g(29). Let l be -6(f/6)/2 - 3. Solve 3k - l - 1 = 0 for k. 2 Let p = 444 - 462. Let k be 12 + (p/12)/((-1)/(-2)). Solve 4t - 25 = kt for t. -5 Let x(z) be the first derivative of z*2/2 - 10z + 4. Let k be x(13). Let i be (9/9)/((-2 - -3)/2). Solve km + i = m for m. -1 Suppose -2407f = -2427f + 80. Let i(c) = -c2 + 7c. Let s be i(7). Solve s = -v - f + 3 for v. -1 Suppose a - 17 = 5n, -34a - 2n = -39a + 39. Solve 13i - a = 97 for i. 8 Let m(j) = j3 - 4j*2 - 6j + 9. Let h be m(5). Suppose -5d = -hs + 79, s + 1 - 2 = 0. Let b = -11 - d. Solve v = bv for v. 0 Let b be (((-12480)/(-91))/32)/(5/42). Solve -69 = -59x + bx for x. 3 Let k(f) = -38f*3 - 6f*2 - 4f + 2. Let x be k(-1). Suppose 32y - x = 13y. Solve 4r + 12 = -yr for r. -2 Let s = 87 - 67. Suppose -40 - s = -20n. Solve -5r = -nr - 2 for r. 1 Let l(n) = n3 + 88n*2 + 1206n - 8. Let h be l(-71). Solve -21 = 21c - h for c. 2 Let w = -24 + 28. Suppose 4o - 8 = wl, 3o - 8 + 4 = 5l. Let i be (l - (-5)/15)/((-4)/(-18)). Solve 5d - i = 4 for d. 2 Let z(r) = r*2 - 22r + 87. Let n be z(5). Let t be 4/(-5)(-10)/4. Suppose -tk = -0k. Solve nb + 6 = -k for b. -3 Suppose -4w = 4i + 28, -5i + 3i + 2w - 6 = 0. Let x be (-2(-1)/i)/((-1)/10). Suppose 0q + 12 = -3q, 2k + q = -x. Solve -4c + c = k for c. 0 Let l(a) = 5a + 10. Let d be l(5). Suppose 34r = dr. Let y be (-20 - r)42/(-105). Solve 4s - y = 6s for s. -4 Let l = 43 + -205. Let t = l - -164. Solve m - 3m + t = 0 for m. 1 Let f = -49 + 48. Let l be (f/(-2))/((-1)/(-2)). Suppose -w - 12 = -5r, -w - l - 1 = 0. Solve -16 = 2n + rn for n. -4 Let a(b) = 25b - 146. Let h be a(6). Suppose 3r + 21 = 3o, 2r = -4o + 2 - h. Solve og - 7g = -20 for g. 4 Let s be -5 + 3/(-18)2 + 1734/153. Solve 126h = 128h + s for h. -3 Let r = -4473 - -4518. Solve -27 + r = -6b for b. -3 Let c be 1130/35 - 6/21. Suppose i + z = 8, z - 16 - c = -5i. Solve -3f - i - 2 = 0 for f. -4 Suppose -7 = -22u + 20u + 5t, 4u + 5t = 89. Suppose 5p + 17g - ug - 186 = 0, g = -p + 34. Solve -37y + py + 2 = 0 for y. -2 Let b = 63 - 41. Let y be (-43)/(-5) - 12/20. Suppose -3x + 2l = -44, b = 2x - yl + 3l. Solve g = -3g - x for g. -4 Suppose -5j + 3l + l + 308 = 0, 2j + 2l = 116. Solve ja = 63a - 3 for a. 1 Let z = -16 - -10. Let p(g) = -7g - 18. Let c be p(z). Let h = c - 18. Solve 2i = -i + h for i. 2 Suppose -5c = 4505 - 4505. Solve -2p - 3p = -cp for p. 0 Suppose -5c - 4d = d - 40, -d = -4c + 7. Let x(a) = -24a2 - 177a + 125. Let l be x(-8). Solve 2b + l = cb for b. 5 Suppose -2l - m = -185, 393l - 392l - m = 91. Solve 14j + l = 78 for j. -1 Let i = 1904 + -1895. Solve 8v + 5 = iv for v. 5 Let y(h) = -h*3 + 8h*2 + 48h + 5. Suppose -u + 2 = -5x, -4u = 3x - 35 - 19. Let v be y(u). Solve -vj + 5 = 25 for j. -4 Suppose 0 = -7y + 68 - 47. Let l(h) = 6h - 8. Let p be l(4). Let g = 22 - p. Solve -yr + g = -r for r. 3 Let k be 800/(-70)(-1)/(8/28). Solve 9g = g + k for g. 5 Let m = 0 + -8. Let q be -3(-1 + -3 + m/(-6)). Suppose 0 = 2o + q, -5u + 5o + 21 + 94 = 0. Solve 5w + 4 = u for w. 3 Suppose -x = -b - 89, x - 79 = -138b + 137b. Solve -90k = -xk for k. 0 Let z = 20664 - 20454. Solve -40w + 10w = -z for w. 7 Let c = 25603 - 25529. Solve 54 = 20y + c for y. -1 Suppose 50v + r = 44v + 5427, -15 = 5r. Solve 913a = va - 32 for a. -4 Let l = -6 + 9. Suppose k - 5 = 2s, 4s + 13 = 5k - 0s. Suppose -6j = -11 - k. Solve -5 = lt + jt for t. -1 Let v(m) = 451m + 2283. Let k be v(-5). Solve 6 = -34b + kb for b. -1 Suppose -o = 4y - 14, 102y - 100y = -5o - 2. Solve -626 = yj - 622 for j. -1 Let y(l) = 7 + 33 + 2l + l - 8. Let o be y(-10). Solve 0 = 11r - or - 27 for r. 3 Let w = 0 + -5. Let j(d) = -d*2 - 7d - 10. Let r be j(w). Suppose rp + 15 = 5p. Solve -1 - 5 = -pn for n. 2 Suppose 3k - 829 = -814. Let p be 8 + (2 - 4) + 4. Solve -pq + 11q = k for q. 5 Suppose -4w = 2a - 4, 0a - 4a = 3w - 3. Suppose a = -190b + 189b + 3. Solve 18 + b = -7l for l. -3 Let h = 3 - 3. Let d = -162 + 281. Suppose -d = -17l - 34. Solve 5 + h = lx for x. 1 Let r(o) = o*3 + 25o*2 - 28o - 71. Let a be r(-26). Let b(t) = t*3 + 21t*2 + 40t + 42. Let w be b(a). Solve -3g - w + 1 = 0 for g. -1 Let k = -56 + 73. Let l(c) = -3c - c*3 - c + 16c + 4c + 39 + kc*2. Let u be l(18). Solve -2i + i = u for i. -3 Suppose 0 = 32o - 1242 - 70. Solve 8 = -ol - 197 for l. -5 Let l be (0/2)/(5 - 6). Suppose 2n + ly - 2y - 4 = 0, -3n - 2y = -6. Let w(f) = -f3 + 15f*2 + 10. Let o be w(15). Solve nv = 4 - o for v. -3 Let w = -27 + 27. Suppose w = 25b - 22b - 18. Solve 0 = -bi + 5i - 5 for i. -5 Let o = 223 + -223. Suppose 3 = 5s - 3s + r, -s - r + 1 = o. Solve 0 = -sp - 4 - 4 for p. -4 Let l(f) = -8f*3 + 4f*2 + 6f - 2. Let t be l(1). Solve t = 441k - 446k - 20 for k. -4 Let y(t) = t*3 - 6t*2 - 4t - 18. Let z be y(7). Suppose g - z - 1 = 4x, 4x - 16 = -4g. Suppose 0 = 2f + 2f - 20. Solve fd - 5 - 15 = x for d. 4 Let g be (-28)/12(-8607)/133. Solve gp - 21 = 144p for p. 3 Let q(j) = j - 12. Let y = 113 - 44. Suppose -2u - 6 = 0, 0b - 4b = -3u - y. Let w be q(b). Solve -m - w = -2 for m. -1 Let g = -13 + 22. Suppose -2y - g = -j - 5y, 0 = -3y + 6. Suppose -jv - 10 = -49. Solve -3i + v - 1 = 0 for i. 4 Suppose 4d - 2 = 2f, d + 2f = -0 - 12. Let a(i) = -i3 - 2i*2 - 2i - 1. Let m be a(d). Let l = 262 + -244. Solve 6 = mx + l for x. -4 Suppose 0 = 17069f - 17094f + 2432 + 543. Solve 20y - 3y = -f for y. -7 Let o(x) = 13x*2 + 22x - 22. Let y be o(1). Suppose 15k = 4c + 13k - 14, -y = -2c - k. Solve -17 = cd + 8 for d. -5 Let j be (20 + -18)/((-4)/(-6)(-60)/(-260)). Solve -19w + 120 = -j for w. 7 Let p be 3/2 + 8/(32/38). Suppose 12 = d + 3d, -2d - 19 = 5f. Let u = f + p. Solve 0g - 2g = u for g. -3 Let t(n) = 14 - 4 + 9n2 + 3n*3 - 4n*3 - 4 - 8n. Suppose -22w - 8 = -23w. Let h be t(w). Solve -hz - 5 = -5z for z. -5 Let b = 3775 - 3617. Solve 0 = -12u + b - 98 for u. 5 Suppose 0 = 3q + 34x - 35x - 2, 10 = -5x. Solve q = 33r - 18r - 21r for r. 0 Suppose 0 = 2o + 2s + 86, 0s - 1 = s. Let j = o + 48. Let q = 6 + -3. Solve -qw = -jw for w. 0 Let t(m) = -20m - 865. Let s be t(-45). Solve 0 = -103h + 108h - s for h. 7 Suppose -191 - 155 = -147x - 52. Suppose -1 = 5y + 2z + 2, -y = 4z + 15. Solve -3b + x = -y for b. 1 Suppose -y - 6 = 0, h + 272y = 268y - 21. Solve 27 = 8z + h for z. 3 Let t(q) = 10q + 5. Let l be t(0). Let j(x) = -x3 + 3x*2 + 2x - 2. Let o be j(3). Suppose os - 9 = -3z, -s = -z + 2z - 3. Solve -ln + 2n = s for n. 0 Let s = -5145 - -5302. Solve -167h + 30 = -sh for h. 3 Let x = 1902 + -1895. Solve -117j - x = -110j for j. -1 Suppose -5v = 1 - 16. Let s(a) = -5a + 4a + va - a - 8. Let d be s(11). Solve 3h = 2h - d for h. -3 Let z be ((-1)/69)/(2/(-4)). Suppose -9 - z = -3q + 4p, 0 = 4p. Solve -4s + 0 = q for s. -1 Let z be (100/(-3) - 26/39) + 1. Let o = z - -35. Suppose -l + h + o - 5 = 0, 0 = 5h - 15. Solve -y - 3 + 0 = l for y. -3 Suppose -3f = -0f. Suppose 42 = 2r + r. Suppose 19g - rg = f. Solve -n + 2 + 0 = g for n. 2 Suppose 761 = 13v - 513. Solve 0 = -6o - v + 128 for o. 5 Let y(q) = 2q2 - 30q + 7. Suppose 6 = d + 2. Suppose -2r + 72 = dx + 2r, 2r = 2x - 24. Let w be y(x). Solve 0 = -5a + 3 + w for a. 2 Let v be -8 + 8(6/(-12) - -3). Solve 0 = 32k - 30k + v for k. -6 Let m(s) = -5s*3 - 14s*2 - 8s - 4. Let n be m(-3). Suppose -11 = -l + 4t, n = 5l + 4t - 2. Solve 9 = -2p + l for p. -1 Suppose -2p = -n - 53, 221n + 25 = 216n. Solve 0 = -pg + 33 - 9 for g. 1 Let w be ((-54)/36)/(6/(-2552)). Let f = w - 614. Solve 20u = fu - 12 for u. 3 Let j(o) = -7o2 + 67o - 28. Let y be j(9). Solve yp + 13p = 0 for p. 0 Suppose 7 = -46t + 69 + 76. Solve 0 = -3h - th - 18 for h. -3 Let w(o) = 17 + 463o - 461o + 5o*2 + 4o*2 + 3. Let t be w(0). Solve -3c = 2c - t for c. 4 Let w(g) = -g2 + 48g - 232. Let z be w(42).	{ "pile_set_name": "DM Mathematics" }
c3 - 10c*3. -10c3 Expand -1 - q3 + 1 + 3q3 - 4q*3 + 0q*3 + (-1 + 1 - 2q*2)(0 + 0 - 2q) - q3 + q2 - q2 + 23q + 3q3 + 30q - 46q. 4q*3 + 7q Expand (-h - 2h + 2h)(-2h*3 + 4h3 + h3) + (2h3 + 5h*2 - 5h*2)(-3h + 3h + h). -h*4 Expand (0 + 2p*2 + 0)(-6 + 2 - 2). -12p2 Expand ((2 - 2 - w)(-3w + 0w + 2w) + 3w*2 - 3w*2 - 3w*2)(4 - 2 + 0). -4w2 Expand (-2m - m + 4m)(0 + 0 + 3)(-m + 1 - 2 - m). -6m*2 - 3m Expand (3 - 3 + 1)(-13t - 26 + 26). -13t Expand (3j*2 + 8j*2 + 7j*3 - 5j*3)(-j + 2j + j)(-1 - 5 + 4). -8j4 - 44j3 Expand (g2 + g2 - g2)(5g - 4g - 2g) - g3 + g - g - g3 + 5g3 - g3 + 3g*3 + 0g*3 - 1 - 1. 4g*3 - 2 Expand (-12 + 16 + 22)(y - 4y + y). -52y Expand (s - 2s + 3s)(3 - 84s*3 + 83s*3 - 2s - 5). -2s4 - 4s*2 - 4s Expand (25l - 15l - 9l)(l3 - l3 - 3l3). -3l*4 Expand (2z*2 - 2z2 - z2)(5z + 2z3 - 5z). -2z5 Expand -j2 + 2j*2 + 0j*2 + (3 - 3 - 2j)(-4j + j + 2j) - 5j*2 + 0j*2 + 3j*2 + 6j*2 - 21 + 21 + (-2 + 2 - j)(3 - 3 + 2j). 5j*2 Expand (2m*5 - 4m5 + m5)(-4 - 5 + 0). 9m*5 Expand (4 + 4c*2 - 4)(7c2 - 7c*2 + 4c*3). 16c5 Expand (0 + 4 - 3 - d2)(-d + 5d + 0d + (4d - d - 2d)(5 - 6 - 1)). -2d3 + 2d Expand (-8 - 2w + 6w + 6)(4 + 3 - 2). 20w - 10 Expand (0 + m*3 + 2 + 4)(2 + 3 - 2). 3m3 + 18 Expand ((4 + 2 - 15)(4z - 2z - 3z) - 4z + 0z + 6z)(-5z*3 + 3z3 + z3). -11z4 Expand -3g2 + g2 - 2g2 + (-3g - 2g + 4g)(-g - 4g + 3g) - g2 + 0g*2 + 0g*2. -3g*2 Expand -4k*4 - 3k4 + k4 - 6k4 + k4 - 3k*4 + (4k + 0k - 2k)(-5k3 - k3 + 5k3). -16k*4 Expand (3k*2 - 2k*2 - 2k*2)(-2k + 5k - 2k) + 3k*3 - 3 + 3 + 0k*3 + 0k*3 + 2k*3. 4k*3 Expand (y - 4 + 4)(4 - 4 + 3)(-4 + 4 - 1) + (4 - 2 + 0)(-2y - 3 + 3) + 0y + 6y - 4y + 3 - 7y - 3. -12y Expand y4 - y4 - y*4 - 6y*4 + 4y*4 + 4y*4 - 3y4 + y4 + 4y4 + (0y*2 + 4y*2 - 5y*2)(3y2 - 5y2 + y2) + 4y4 + y - y. 8y*4 Expand (1 - 2 + 2)(0 - 1 + 0)(5 + 0 - 1)(-t + 4t - 2t). -4t Expand 0b3 + b3 - 3b3 + b3 - b3 + b3 - 4b*3 - 2b*3 + 5b3 + (-b2 + 3b2 + 7b*2)(2 - b - 2) - 2b3 + 4b3 - b3. -10b3 Expand (0k + 6k - 4k)((-k3 + 2k*3 + 2k*3)(-k + 4k - 5k) - 5k4 + 5k*4 - 3k*4). -18k*5 Expand (-2i*3 - 5i*3 + 6i*3)(i - i + 3i) + (-i3 - i3 + i3)(-3i + 1 - 1) - 3i4 - i4 + 3i4. -i4 Expand (0d + d - 4d)(-d - 3d + 5d) + 4d2 - 6d*2 + 0d*2 + (0d + 2d2 + 0d)(-3 + 1 + 0). -9d2 Expand f5 - 6f5 + 3f*5 - 4f5 + f5 + 5f5 + (-2f2 - f4 + 2f2)(-2f - f + f). 2f*5 Expand (-1 - 1 + 5)(-6h3 + 13h3 - h3) + (-5h2 + 4h2 - h2)(-2h + h + 2h). 16h*3 Expand (46z*2 + 10z*2 - 28z*2)(-z - 5 + 2 + 1) + 3z3 - 6z*3 + 2z*3. -29z*3 - 56z*2 Expand (-6n*5 + 3n*3 - 3n*3)(-4 + 5 + 7). -48n5 Expand 0b3 - b3 - 2b3 + 5b3 + b3 - b*3 + (-3b*2 + 2b - 2b)(b + 0 + 0). -b*3 Expand (-2t*3 + 5t*3 - 4t*3 + (t - 3t + 0t)(0t2 - 4t*2 + 5t2) - t3 + 4t3 - 4t*3)(3t + 2t - 2t) + 4t - 4t + t4. -11t*4 Expand (-1 - 5 - 3)(-7a4 - 4a + 4a). 63a*4 Expand (-2 + 5d + 4 - 3d)(78d2 - 16d*2 - 12d*2 + (0d + 4d - 3d)(-d + d + d) - d2 + 2d2 + d2). 106d3 + 106d*2 Expand (4v*2 + v - v)(2 - 2 - 2v). -8v*3 Expand (1 - 4 + 1)(-7 + 7 - 4x - 4). 8x + 8 Expand (-6 + 6 - 28l4)(-l - 3l + 5l). -28l5 Expand (21 - 11 + 4)(-v + 4v - 2v). 14v Expand (-4y - 4y2 + 4y)(9y - 32 + 32). -36y3 Expand (0c*4 + 4c*4 - 3c*4)(3c + 7c - 5c) - 2c5 - c5 + 4c5 + (0c4 + c4 + 0c4)(2c + 3c - 4c). 7c*5 Expand (-23 + 50 - 31)(-4c + c + 1 + 1). 12c - 8 Expand (-2y - y + y)(4y - 3y*4 - 4y) + 5y5 - y5 - y5. 9y*5 Expand (-6y*2 + 3y2 + y2)(-y + y - y) + 3y*3 - 3y*3 + 2y*3 - 9y + 9y + 6y*3. 10y*3 Expand (2o + 0 + 0)(9 + 4o - 8 - 3o + o2). 2o*3 + 2o*2 + 2o Expand c - 6c + 2c + 0 + 2c + 0 + (c + 1 - 1)(0 - 2 + 1) + 3 + 5c - 3. 3c Expand (-2f - 3f*2 + 2f)(0f*2 - 6f*2 + 3f*2)(-1 + 4 - 2). 9f4 Expand (-2 + 5 - 4)(-2i + 0i + 0i)(-3 + 3 + 2)(-3 + 0 + 1) - i - i - i. -11i Expand (-2p2 - p2 + p2)(-3 - 2p + 3) - 2p*3 + 2p*3 - 2p*3 + (3p - 5p + 4p)(0 - 2p*2 + 0). -2p*3 Expand (2u - 2u + u)((-6 + 0 - 1)(-5u + 5u + u) + 3u - u - u). -6u2 Expand (-n2 + 3 - 3)(3n - 2 + 2) + (0 + 0 - 2n*2)(1 - 2n - 1). n3 Expand (-2 - 2 + 6)(1 - q - 1) + 2q + 0q + 3q. 3q Expand (-2u4 + 0u*3 + 0u*3)(4u - u + 8u) + (4 - 2 - 1)(0u*5 + 0u5 - u5). -23u5 Expand (-21z + 6z + 0z)(-2 + 6 - 3). -15z Expand ((1 - 1 + 2)(-7 + 2 + 3) + 3 - 2 - 2)(0o + o + o). -10o Expand (l - 4l + 0l)(-2l*2 + 0l + 0l). 6l3 Expand (-n2 + 0n2 - n2)(-n + 0n - 2n) + 70 - 70 - 26n3. -20n*3 Expand (-2s*3 - s + s)(2 - 3 + 0)(0s + 0s + 2s*2). 4s*5 Expand (5i - 5i + i)(i + 2i - i)(3 - 3 - 3)(6i2 - i2 + 2i2). -42i*4 Expand 13 - 6p*2 - 13 + (5p - p - 3p)(2 - p - 2). -7p2 Expand -2c2 - c2 + 2c2 + c2 - 2c*2 + 3c*2 + (0c + 0c + c)(4c - 3c + 0c) - 5c*2 + 5c*2 - 2c*2 - 19c + 19c - 6c*2. -6c*2 Expand (1 - 3 + 6)(-4c + 30 - 30). -16c Expand 18p2 + 19p*4 - 18p*2 + (p + 2p - 2p)(2p3 - 3p*2 + 3p*2). 21p*4 Expand (-2y2 - y3 - 6 + 0 - 2y3)(2 + 2y - 2). -6y*4 - 4y*3 - 12y Expand (4 + 1 - 4)(-9y*2 - 15y*2 + 13y*2). -11y*2 Expand (3y + 2y - 6y)(-y2 + 0 + 0) + (1 + 0 + 0)(-4y + 2y - 4y)(-2y2 + 2y - 2y). 13y*3 Expand (0 - 1 + 3)(-231 - 13z5 + 231). -26z*5 Expand -6k*3 - 12k*3 + 10k*3 - 9k*2 - 3k*3 + 9k*2 + (-2k*2 - 4k*2 + 5k*2)(-k - k + 0k) + 0k*2 + 0k*2 + 2k*3 + 2k3 - k3 - 3k3. -9k*3 Expand (5 - 2 - 4)(-2l - l + 4l + (-1 + 2 + 1)(1 - 1 + l) - l + 0l - l). -l Expand 0 - 2y3 + 0 - 2y + y*3 + 2y + (-1 - 2y2 + 1)(y + 0y - 3y) - y*3 + 5y*3 - 2y*3 + (-10y*2 + 16y*2 - 8y*2)(3y - y + 0y). y*3 Expand (10t - 37t - 33t - 60t)(2t2 + 3 - 3). -240t*3 Expand 4f*2 + 2f*3 - 4f*2 + (-f + 3f + 0f)(f*2 - 2f*2 + 2f2) - 6 + 6 + f3. 5f3 Expand (0 + 0 + k)(2k + k - 2k) + 55k2 + 70k - 70k. 56k2 Expand s2 - 4s2 + 2s*2 + (-3s - s + 6s)(2 - 2 + 2s) - 2s*2 + 3s*2 - 3s*2 + (-2s + s + 0s)(-3s + 6s - s). -s*2 Expand j - j + 5j*4 + (-j - 2 + 2)(14 - 14 - 16j3). 21j*4 Expand (-12 - 6t + 3t + 2t)(-5t*4 - 3t*4 + 15t*4). -7t*5 - 84t*4 Expand (0o - 3o + o)(o + o + o) + (1 - o - 1)(3o + 2o - 3o). -8o2 Expand (-1 + 1 - 2v)(8 - 5 + 3)(2 - 1 - 2). 12v Expand (0c*4 + 2c*4 + 0c*4 + (-3c + 1 - 1)(-2c*3 + 5c*3 - 2c*3) + 3c4 - c4 - 4c4)(c - 4c + 5c). -6c5 Expand (-3h*2 + 0h2 + h2)(-3 + 7 - 2)(-1 + 2 - 2) + 7h2 - 17 + 17. 11h*2 Expand (31i + 5i - 19i + (4i - 4i - i)(-1 + 2 + 1) - 3i - 2i + 3i)(-i + i + i). 13i*2 Expand 0c + 0c - 3c*5 + (-2 + c + 2)(-3c + c + c)(-3c3 + 3c*3 + 2c*3). -5c*5 Expand (-3r*3 + 3r*3 - 2r*3)(-2 - 15 + 0). 34r3 Expand (-3g - g + 5g)(-3 + 2 - 3). -4g Expand (-23k*2 + 44k2 - k2 - 2)(2k + 0k - 4k). -40k3 + 4k Expand 0c2 + 0c*2 - 2c*3 + (2c + 1 + 1 - 24)(2 - 2 - c2). -4c*3 + 22c*2 Expand -4b - 2b + 1 + 0 + (1 - 3 + 0)(b + b - b). -8b + 1 Expand (-c2 - 4c*2 + 4c*2 + (5c - c - 3c)(0c - 4c + 2c))(0 - 4 + 2). 6c2 Expand (2i*2 - 6i*4 - 3i*2 + 2i*2)(-1 - 2i + 1). 12i*5 - 2i*3 Expand (-4 + 2q + 4 + 0q - 5q + 4q + (-q + 2q - 2q)(1 + 3 - 6) + q + 3 - 3 + 2 + 2q - 2)(0 + 0 + q)(-1 + 1 + q). 6q*3 Expand (7 + 9 - 4)(-u5 + u5 + 2u5). 24u5 Expand (-h5 - 2h5 + h5)(-20 - 19 + 69) + (-2h + 2h + 2h2)(0 + 0 + 2h3). -56h*5 Expand (1 - 2 - 1 + (-2 + 4 - 4)(3 + 1 - 2))(21 - 21 + 12a). -72a Expand (-2 - 1 + 1)(-2*r - 2 + 2) + (0 - 2 + 3 + (-1	{ "pile_set_name": "DM Mathematics" }
128012? False Is 411 a factor of 1657585? False Is 160 a factor of 144141? False Is 72 a factor of 557990? False Is 210665 a multiple of 91? True Does 119 divide 1161202? True Does 117 divide 23970960? True Is 3 a factor of 134927? False Is 70813 a multiple of 59? False Is 3499489 a multiple of 2? False Is 271 a factor of 219327? False Is 297432 a multiple of 6? True Does 877 divide 3850907? True Does 103 divide 10015013? False Does 61 divide 1048106? False Is 2 a factor of 37508? True Is 6379692 a multiple of 51? True Does 25 divide 6619008? False Does 6 divide 548168? False Does 46 divide 39150? False Does 108 divide 4883652? True Is 1463595 a multiple of 21? True Is 1107901 a multiple of 26? False Is 1066847 a multiple of 27? False Is 285293 a multiple of 31? True Is 92 a factor of 66191? False Is 447412 a multiple of 14? True Does 13 divide 3935100? True Is 13 a factor of 47825592? False Is 12 a factor of 2497248? True Is 119145 a multiple of 18? False Is 77 a factor of 2229535? True Does 7 divide 29134? True Does 48 divide 861840? True Does 6 divide 634260? True Does 1454 divide 8292609? False Does 28 divide 6967156? True Does 466 divide 8504034? True Is 13113 even? False Is 136527 a multiple of 173? False Does 29 divide 3324676? True Does 267 divide 358644? False Is 190 a factor of 38878? False Is 38064 a multiple of 13? True Is 115 a factor of 65119? False Is 12 a factor of 145566? False Does 44 divide 44123? False Does 186 divide 41993? False Does 361 divide 54511? True Is 32 a factor of 498752? True Is 2418468 a multiple of 601? False Does 147 divide 887288? False Does 18 divide 1776384? True Is 215941 a multiple of 19? False Is 60475 a multiple of 59? True Is 25 a factor of 649394? False Does 8 divide 360696? True Is 102 a factor of 3542897? False Is 5051828 a multiple of 965? False Is 2085680 a multiple of 13? False Is 488560 a multiple of 16? True Is 108775 a multiple of 77? False Is 201 a factor of 118446? False Is 71 a factor of 136674? False Is 66 a factor of 527283? False Does 5 divide 306059? False Is 208 a factor of 113935? False Is 88 a factor of 28248? True Is 392 a factor of 764633? False Does 124 divide 3211848? True Is 33 a factor of 418242? True Does 40 divide 231680? True Does 25 divide 11150? True Is 157 a factor of 268131? False Is 600 a factor of 3934200? True Does 41 divide 348466? False Does 5 divide 37505? True Is 7224 a multiple of 56? True Is 137371 a multiple of 36? False Does 202 divide 1906261? False Does 2617 divide 22476555? False Is 9627 a multiple of 15? False Is 32 a factor of 66848? True Is 1294 a factor of 2155156? False Is 267 a factor of 254985? True Does 13 divide 590928? True Is 1434765 a multiple of 505? False Is 11689920 a multiple of 288? True Does 575 divide 1783305? False Does 77 divide 35137? False Does 301 divide 976444? True Is 3057244 a multiple of 24? False Does 3 divide 103343? False Is 355630 a multiple of 55? True Does 5 divide 310191? False Does 6 divide 120860? False Is 47150 a multiple of 82? True Is 620 a factor of 1034092? False Is 6446486 a multiple of 23? True Does 117 divide 1310166? True Is 121272 a multiple of 732? False Does 26 divide 5248880? True Is 82663 a multiple of 63? False Does 20 divide 21080? True Is 63752 a multiple of 13? True Is 1271504 a multiple of 52? True Is 3141461 a multiple of 101? False Is 17947171 a multiple of 341? True Does 30 divide 4410630? True Is 469 a factor of 157584? True Does 29 divide 10767? False Does 3 divide 409303? False Is 66 a factor of 343217? False Is 121 a factor of 17261160? False Is 103725 a multiple of 45? True Does 375 divide 384048? False Is 77 a factor of 1243935? True Does 435 divide 9345540? True Is 33 a factor of 27951? True Does 194 divide 1401844? True Is 123582 a multiple of 43? True Is 5 a factor of 1474580? True Is 434 a factor of 634? False Does 220 divide 248804? False Is 39 a factor of 583299? False Does 14 divide 313540? False Is 267177 a multiple of 208? False Is 1547136 a multiple of 48? True Does 74 divide 2639109? False Is 869085 a multiple of 15? True Is 654007 a multiple of 289? True Is 3448675 a multiple of 216? False Is 755220 a multiple of 614? True Does 268 divide 144513? False Is 26 a factor of 221364? True Is 6004576 a multiple of 283? False Is 277 a factor of 18836? True Is 38266 a multiple of 4? False Is 41157 a multiple of 70? False Is 267466 a multiple of 27? False Is 517276 a multiple of 17? True Is 35 a factor of 22266267? False Is 847763 a multiple of 163? True Does 10 divide 99826? False Is 23 a factor of 43378? True Does 5 divide 13570? True Does 40 divide 100667? False Is 10475 a multiple of 3? False Is 101799 a multiple of 9? True Is 253 a factor of 1197072? False Is 223 a factor of 619401? False Is 24 a factor of 291960? True Does 97 divide 310206? True Does 19 divide 414523? True Is 48 a factor of 8448? True Is 20 a factor of 572760? True Is 27 a factor of 19873? False Is 48 a factor of 7372741? False Is 335888 a multiple of 112? True Is 8 a factor of 95646? False Is 14 a factor of 55272? True Is 12 a factor of 177288? True Does 255 divide 3946957? False Is 5 a factor of 11356680? True Is 1566086 a multiple of 32? False Is 882170 a multiple of 238? False Is 21469831 a multiple of 1372? False Is 842 a factor of 5947888? True Is 110 a factor of 95942? False Is 4 a factor of 2465158? False Is 88012 a multiple of 305? False Is 10 a factor of 88200? True Is 1680 a multiple of 21? True Is 27 a factor of 845386? False Is 4938670 a multiple of 44? False Does 960 divide 6018314? False Is 31 a factor of 6014? True Does 12 divide 18286209? False Does 759 divide 646668? True Is 194 a factor of 2534487? False Is 561098 a multiple of 71? False Is 7 a factor of 381745? True Is 714 a factor of 3682098? True Is 208950 a multiple of 175? True Does 17 divide 9523706? True Does 455 divide 1071525? True Does 11 divide 4917873? False Is 5193 a multiple of 105? False Is 1011514 a multiple of 52? False Is 80352 a multiple of 162? True Does 215 divide 391515? True Does 12 divide 72540? True Does 150 divide 1342925? False Is 113490 a multiple of 154? False Does 55 divide 308545? False Does 4 divide 808859? False Is 915740 a multiple of 35? True Is 362 a factor of 7964? True Is 293 a factor of 3669014? False Is 2 a factor of 2099315? False Is 25475 a multiple of 9? False Is 442 a factor of 2137954? True Is 132 a factor of 384120? True Is 391363 a multiple of 659? False Is 548 a factor of 9491360? True Is 83 a factor of 16012775? True Is 503078 a multiple of 14? False Is 274008 a multiple of 176? False Does 12 divide 1426362? False Is 60 a factor of 1002023? False Is 98383 a multiple of 8? False Is 372500 a multiple of 25? True Is 1271945 a multiple of 20? False Does 3 divide 421415? False Does 10 divide 435830? True Is 271 a factor of 263387? False Is 18 a factor of 277148? False Is 4 a factor of 44236? True Does 3 divide 21004? False Is 366160 a multiple of 191? False Is 3 a factor of 92183? False Is 907 a factor of 1299971? False Is 15 a factor of 811890? True Is 8156 a multiple of 2? True Is 544183 a multiple of 7? False Is 25409539 a multiple of 29? True Does 40 divide 542348? False Does 21 divide 16738144? False Does 13 divide 3717332? False Is 95 a factor of 853005? True Is 50 a factor of 664350? True Is 167807 a multiple of 360? False Does 261 divide 674418? False Is 2402357 a multiple of 168? False Does 62 divide 1138010? True Does 41 divide 854337? False Is 79 a factor of 1709560? True Is 26308717 a multiple of 23? False Does 4 divide 50024? True Is 155826 a multiple of 33? True Is 56544 a multiple of 19? True Is 2609355 a multiple of 35? True Does 90 divide 305531? False Is 51 a factor of 133459? False Is 708 a factor of 2519772? True Does 616 divide 4987191? False Is 62 a factor of 66836? True Is 15904 a multiple of 295? False Is 25048786 a multiple of 14? True Does 176 divide 434016? True Does 25 divide 46225? True Does 4 divide 111612? True Is 176232 a multiple of 171? False Is 22 a factor of 18286246? True Does 49 divide 14680169? False Is 25947 a multiple of 6? False Does 9 divide 1566963? True Does 13 divide 385372? True Is 10 a factor of 8990? True Is 9 a factor of 23220? True Does 417 divide 89	{ "pile_set_name": "DM Mathematics" }
rt k. 240k3 Suppose 15 - 13 = n. Differentiate 8w*2 - 6 + 1 - 12w*n wrt w. -8w Let a = -2 + 2. Differentiate -h*3 + ah - 2 + h - h with respect to h. -3h2 Let v(r) = -23r*6 + 6r*5 + 6r*4 + 7r*2 + 6r + 6. Let q(d) = d5 + d4 + d + 1. Let f(i) = 6q(i) - v(i). What is the third derivative of f(g) wrt g? 2760g*3 Suppose b - 3m = 1 + 5, 3b = 5m + 14. Suppose -y + 22 = 4t, 3y + t = -0t + 11. Differentiate qb - 3q*3 - y + 4 wrt q. -6q*2 Let h be 0 + 6 + 3 + -6. Differentiate 2r*2 - 31r*h + 7 + 26r*3 - 2r*2 wrt r. -15r*2 What is the first derivative of 4 + 6 + 2 + 6n*2 - 5 wrt n? 12n Let p be ((-6)/5)/((-6)/20). Find the third derivative of 6t3 - 3t3 + t3 + pt2 wrt t. 24 What is the second derivative of 2n3 - n3 - 5n + n3 wrt n? 12n What is the second derivative of -c + 2 + 4c4 - 2c - 2 wrt c? 48c2 Let v(a) be the third derivative of -a9/72 + a5/10 - a2. What is the third derivative of v(d) wrt d? -840d*3 Let g = 6 + -2. Suppose 5 + 11 = gb. Find the third derivative of -4f3 + bf*3 - 2f*5 - 2f*2 wrt f. -120f2 Let x(f) = -f3 - 8f2 - 8f - 5. Let b be x(-7). What is the first derivative of 3l3 + 0 - bl + 2 + 2l wrt l? 9l*2 Let g(v) be the third derivative of 0 + 0v*4 - 1/120v6 - v2 + 1/2v3 + 0v + 0v5. Differentiate g(h) wrt h. -3h*2 Let j(i) = 0 - 2i + i - 1 - i*2. Let l(q) = 6q*2 + q + 3. Let w(g) = -3j(g) - l(g). What is the second derivative of w(f) wrt f? -6 Let w(d) be the second derivative of d*4/4 + 15d*2 + 44d. What is the first derivative of w(h) wrt h? 6h Let r(j) be the third derivative of -31j*7/210 - 29j*5/60 - 3j*2. Find the third derivative of r(n) wrt n. -744n Let j = -1 + -1. Let p(u) = -5u - 3. Let v be p(j). What is the third derivative of -i2 + 5i*4 - vi*4 - 2i*2 wrt i? -48i Let o(g) = -g + 5. Let j be o(3). What is the second derivative of 2x + jx - 2x3 - 8x + x wrt x? -12x Let p be ((-4)/(-8))/((-1)/2). Let y = 3 + p. What is the second derivative of 5i*2 + yi - 4i - 2i2 wrt i? 6 Let t(q) = q4 - q3 - q2 - q. Let z(l) = 16l4 - l3 - l2 - 15l. Let h(b) = t(b) - z(b). What is the second derivative of h(c) wrt c? -180c2 Suppose -4p + 4 = -2p. What is the second derivative of q - pq + 2q2 + 2q wrt q? 4 Find the first derivative of 17 + k*3 + 4k*3 + 4 - 26k*3 wrt k. -63k*2 What is the third derivative of 3o*2 - 11o*2 + 5o*2 + 4o*5 + 2o*2 wrt o? 240o*2 Let p(r) be the first derivative of -3r*7/7 - 19r*3/3 + 3. What is the third derivative of p(l) wrt l? -360l*3 Let k(t) be the third derivative of 11t*7/210 + 7t*4/12 - 4t*2. Find the second derivative of k(c) wrt c. 132c2 Let w = -20 - -6. Let a be (-4)/w - 33/(-7). What is the second derivative of ua + 0u5 + 4u - 2u wrt u? 20u3 Let r(n) = -n3 - 6n2 - 4n - 9. Let m be r(-6). Suppose -5 = -5s + m. What is the third derivative of d2 - 3d*2 - 2d*3 + 4d*2 - sd2 wrt d? -12 Let r(s) be the second derivative of -s9/3780 + s6/360 + s4/4 + s. Let a(d) be the third derivative of r(d). Find the second derivative of a(y) wrt y. -48y2 Let g(j) = 5j - 1. Let p(f) = -11f + 2. Let m(r) = 10g(r) + 4p(r). Let d(t) = -3t + 1. Let b(h) = -9d(h) - 4m(h). Differentiate b(n) wrt n. 3 Let p(h) = -3h - h + 9h - 12h3 - 8h. Let i(q) = -23q3 - 6q. Let n(o) = -4i(o) + 7p(o). Find the second derivative of n(s) wrt s. 48s Let k be ((-6)/4)/((-6)/8). Let r(v) = -kv + 3 - 2v + 0. Let g(f) = 21f - 16. Let c(p) = 2g(p) + 11r(p). Find the first derivative of c(o) wrt o. -2 What is the second derivative of 13v + 8v*5 + 2v*5 + 5v*5 + 2v wrt v? 300v3 Let z(w) = -9w - 3. Let k(a) = a*2 - 10a - 4. Let h(d) = -3k(d) + 4z(d). Find the second derivative of h(v) wrt v. -6 Suppose 0 = -2i + 3i - 3. Let l = i + 0. Find the third derivative of 12t2 - 15t*2 - 4t6 - t3 + t*l wrt t. -480t3 Let a = -8 + 11. Differentiate -5 + 3 - t2 + a + 3t2 with respect to t. 4t Let b(u) = 31u5 - 2u*3 - 25u*2 - 2. Let r(f) = -62f*5 + 5f*3 + 51f*2 + 5. Let q(g) = 5b(g) + 2r(g). What is the third derivative of q(y) wrt y? 1860y*2 Let l be (-6)/4(-24)/9. Let t be 1/(2/l) - 0. Find the third derivative of -3n5 + n5 - nt + n5 wrt n. -60n2 Let l(r) = -r5 - 2r4 + r2 - r. Let k(g) = 19g*5 + 2g*4 + g - 24. Let i(d) = -2k(d) - 2l(d). What is the third derivative of i(v) wrt v? -2160v*2 Let q(r) = -51r*3 - 5r*2 - 7r + 49. Let w(j) = -26j3 - 3j*2 - 4j + 25. Let d(t) = -6q(t) + 10w(t). Find the first derivative of d(i) wrt i. 138i2 + 2 Let s be -1 + 2 + -1 + 2. Suppose -m - 5 = 3g, 0 = -m - 0m + 2g + 5. Differentiate -y*s + 1 + m + 2y*2 wrt y. 2y Let d(o) be the third derivative of 13o6/120 + 7o*5/10 - 31o*2. What is the third derivative of d(t) wrt t? 78 Let y be (3 - 4)/(1/1). Let m be 2/2 - (0 + y). Find the second derivative of mz + 4z3 - z - 3z*3 wrt z. 6z Let o(k) = k*2 + 8k - 3. Let c be o(-8). Let l be (1 + c)5/(-2). Find the second derivative of -4f*5 + 3f + 10f5 - 9f*l + 0f wrt f. -60f3 Let l(r) = 6r*4 + 3r3 + r2 - 3. Let x(o) = -o3 + o2 + 1. Let k(t) = l(t) + 3x(t). What is the third derivative of k(g) wrt g? 144g Let w(y) = 5y6 + y3 - 4y2 - y. Let j(i) = i6 - i3 - i2 + i. Let x(p) = j(p) + w(p). Find the third derivative of x(n) wrt n. 720n3 What is the third derivative of 5l*3 - 50l + 2l2 + 50l + 8l2 wrt l? 30 Let u(g) = -12g*2 + 3g - 3. Let d(s) = s*3 + 71s*2 - 17s + 17. Let c(l) = -6d(l) - 34u(l). What is the third derivative of c(x) wrt x? -36 Let k(a) = -11a4 - 13. Let q(x) = -12x*4 - 14. Let n(z) = 6k(z) - 5q(z). Differentiate n(o) wrt o. -24o3 Let z(b) be the third derivative of b7/105 + b*5/60 - 6b*2. Find the third derivative of z(d) wrt d. 48d Let u be (-22)/(-18) + 4/(-18). Let m be u/(-2)-16. What is the second derivative of -3g2 - g4 + 4g*4 + mg*2 - 2g wrt g? 36g2 Let o(x) be the second derivative of x6/90 - x4/6 - x3 + 2x. Let w(k) be the second derivative of o(k). Differentiate w(j) wrt j. 8j Let n be 8 - 1 - (9 - 7). Let b be (1 - -1 - -1)1. What is the second derivative of 2yn + 3y + 2y - by wrt y? 40y3 Let p(d) be the third derivative of 0d + 0d5 - 2d*2 - 1/3d*3 + 0 + 0d*4 + 1/120d*6. Differentiate p(z) wrt z. 3z*2 Let k(x) be the second derivative of 3x*5/2 + 37x*3/6 - 3x + 8. Find the second derivative of k(h) wrt h. 180h What is the first derivative of 734j + 1 - 734j + 37j*2 - 7 wrt j? 74j Let v be ((-10)/(-6) - 2)-9. Find the third derivative of 3t*2 - 4t*2 + 7t*2 + vt*5 wrt t. 180t*2 Let f = -5 - -1. Let k = f + 6. What is the third derivative of 5d*6 - kd2 + d2 - 3d6 wrt d? 240d3 Find the third derivative of -o2 - 6o2 - o6 + 5o*6 wrt o. 480o3 Let g(p) be the third derivative of -p4/24 - p*2. Let w(b) = 4b - 1 + 1 - b*2. Let y(k) = 5g(k) + w(k). What is the second derivative of y(m) wrt m? -2 Let j(c) = -3c - 2. Let z be j(2). Let n = z + 11. Find the third derivative of 3q2 - q2 - 2q4 + 4q*4 - nq*2 wrt q. 48q Let c(k) be the first derivative of 5k - 2k*2 + 5k*2 + k + 4. Differentiate c(s) wrt s. 6 Let w(m) be the first derivative of 0m + 4 + 0m4 + 0m*5 - 4/3m*3 + 0m*2 + 1/2m*6. What is the third derivative of w(x) wrt x? 180x2 What is the third derivative of z5 - 9z2 + 13z*2 + 15z*2 wrt z? 60z*2 Let g(s) = -s - 2. Let t = 1 - -4. Let a(q) = 2q + 3. Let m(o) = ta(o) + 7g(o). Differentiate m(y) with respect to y. 3 Find the third derivative of n*3 - 4n*2 + 19n*3 - 8n*3 wrt n. 72 Let z = 179 - 174. Let j(y) be the first derivative of 0y*z + 0y*2 + 1/3y*6 + 1 + 0y*4 + 0y - y*3. What is the third derivative of j(o) wrt o? 120o*2 Let s(u) be the first derivative of 6u*7/7 - 2u*3/3 - 6u - 40. Find the third derivative of s(n) wrt n. 720n3 Differentiate -9 + 556x - 556x - x4 wrt x. -4x*3 Let c(v) be the second derivative of 11v8/28 - v5/20 - 10v4/3 - 9v. What is the th	{ "pile_set_name": "DM Mathematics" }
2. -1772928sqrt(5) + 75634704 Simplify -3 + ((-3sqrt(228))/((sqrt(108) + sqrt(108)1 + sqrt(108) - sqrt(108)) + sqrt(108)) + sqrt(1216)1-5 + sqrt(1216) + -5)2. 970sqrt(19)/3 + 178969/9 Simplify ((-5 + -3 + sqrt(1088) + 3 - (sqrt(1088) - (-1sqrt(1088) + -4 + sqrt(1088)))1)-1)2 + 0. 81 Simplify (sqrt(50)/sqrt(320) + sqrt(490)5)/(-5(sqrt(605) - (sqrt(605) + -5(sqrt(605) + -2sqrt(605) - sqrt(605))) - sqrt(605))). 281sqrt(2)/4840 Simplify sqrt(68)/(sqrt(36)/sqrt(9)) + (sqrt(1088)-6)2 + (((sqrt(153) - sqrt(153)1) + sqrt(153))-2)/(sqrt(54)/sqrt(54)). -5sqrt(17) + 39168 Simplify (1(-6sqrt(110)-1 - (4(sqrt(110) + sqrt(110) + 2sqrt(110) - sqrt(110)) - sqrt(110) - sqrt(110))))/(4(sqrt(1000) - sqrt(10)) - sqrt(360)4). -sqrt(11)/3 Simplify ((-4(sqrt(180) - (-2sqrt(180) - sqrt(180) - sqrt(180))) + sqrt(180))/(sqrt(30)/sqrt(3)-1))/(-6sqrt(12)/((sqrt(22)-2)/sqrt(11))). 19sqrt(3)/3 Simplify -5(0 + sqrt(208) + 1 + sqrt(208) + 3 - -3(3sqrt(208) + 4)) + -4. -220sqrt(13) - 84 Simplify ((1sqrt(192))/sqrt(8) + 2sqrt(1944))/(1sqrt(392)-2 - 1(sqrt(392)-2 + sqrt(392))) + -5. -5 - 19sqrt(3)/7 Simplify 5((sqrt(847) + -1)23 + 2 + -2sqrt(847) + 5(1 + sqrt(847) + 2)*2). 1210sqrt(7) + 34130 Simplify ((sqrt(385)/sqrt(448) + (((sqrt(275)-4 + sqrt(275) - sqrt(275)) + sqrt(275))/sqrt(5) - sqrt(55)))/((2sqrt(88)3)/(1sqrt(648))) + -4)*2. 93sqrt(5)/2 + 47341/256 Simplify 6(((sqrt(200)-3)/sqrt(8))/sqrt(5) - -1sqrt(720))24. 9720 Simplify -1((sqrt(108) + -2)-1-5 - 2(sqrt(108) + 3sqrt(108))5)*2. -132400 - 4200sqrt(3) Simplify (3 + sqrt(891) + 1 + -5 - (-2 + sqrt(176) + -2)1)2. 30sqrt(11) + 284 Simplify ((-4sqrt(1260))/(-6sqrt(252)))*22 + 1. 49/9 Simplify 1 + ((-3sqrt(300)1 - sqrt(300))/(sqrt(100)/(sqrt(160) - sqrt(10))))/(-4sqrt(160) + (sqrt(300)/sqrt(6))/sqrt(5)). 1 + 4sqrt(3)/5 Simplify (-62sqrt(66)-64)/((sqrt(384) - (sqrt(384)2 - sqrt(384)))-3 + (sqrt(384) - sqrt(384)1 - sqrt(384))1 + sqrt(384) + sqrt(384))1-3. -108sqrt(11) Simplify ((2 + (sqrt(5) - sqrt(10)/(sqrt(2) + sqrt(72))))1 - -3-4(-5 + -3 + sqrt(5)))*2. -2184sqrt(5) + 501016/49 Simplify 0 + -5((-2sqrt(208) + -5)5 + (sqrt(208) - (1 + sqrt(208) + 1))-2). 105 + 200sqrt(13) Simplify sqrt(99) + -2 - sqrt(22)/sqrt(72) - (-2sqrt(891)-4 + -2). -415sqrt(11)/6 Simplify 5(sqrt(220)/sqrt(5) + 3) + 52sqrt(539) + 5. 20 + 80sqrt(11) Simplify (sqrt(95) + (sqrt(95) - sqrt(95)1)2 + (sqrt(95)-1 + sqrt(95) + sqrt(95))1)/((sqrt(40) + sqrt(640)1 - sqrt(40))/(sqrt(800)-1 - sqrt(800))). -10sqrt(19) Simplify (-3(3(-1 + sqrt(1100)) + 2sqrt(1100)2) - (-5sqrt(1100) + -4 - -3(sqrt(1100)1 + sqrt(1100))))*2. -5720sqrt(11) + 532569 Simplify 1((sqrt(16)/(sqrt(56)/sqrt(7)) + (4-2sqrt(2) - sqrt(2)))2 + -2sqrt(242) + sqrt(2) + 2 + sqrt(2) + (sqrt(18) - sqrt(2))*2 + sqrt(2) + 0). -19sqrt(2) + 138 Simplify (1(2sqrt(1300)-1 - ((-2 + sqrt(1300))-3 + sqrt(1300))) + -1 + 4)*2. 9 Simplify (sqrt(1400)6 + 1sqrt(56)-2)/(4sqrt(80)/(sqrt(10) + 3sqrt(20)/sqrt(2))). 28sqrt(7) Simplify ((sqrt(320)-1 - sqrt(320))6 - (-1sqrt(320)2 + sqrt(320)))/(((1sqrt(48) - sqrt(48))-3 - sqrt(48))/(1sqrt(12)6)). 264sqrt(5) Simplify 2((-5 + sqrt(108)2)5 - (sqrt(72)/(1sqrt(12)))/sqrt(288))*2-3. -546961/8 + 17975sqrt(3) Simplify 1 + ((-5 + 6(sqrt(275) - (sqrt(275) + sqrt(275) + 5 + sqrt(275) + -1sqrt(275))) + -1)-6)*2. 77760sqrt(11) + 403057 Simplify -3(((sqrt(30)/(sqrt(600) - -3sqrt(600)))*2 - 52sqrt(5)3) + -4). 3837/320 + 90sqrt(5) Simplify -6(-46-61sqrt(104))/(sqrt(800)2 - -2sqrt(392)). -432sqrt(13)/17 Simplify (4(-4 + -2 + sqrt(176) + 2 + 5)4)2-1. -45312 - 2048sqrt(11) Simplify (3(-2 + (2sqrt(475) + -3 - (sqrt(475) + -1 + sqrt(475))-2 - ((sqrt(475) - (sqrt(475) + -1 + -4)) + 3 + sqrt(475) + 0 + sqrt(475)))))*2. -5400sqrt(19) + 70425 Simplify -3 + ((sqrt(153) - sqrt(153)2) + -3)2 + (sqrt(153) + 1 + 5)2 + (-3 + sqrt(153)1 + 5)*2. 66sqrt(17) + 505 Simplify (-1 + sqrt(20)1)-5 + (2sqrt(5)2 + sqrt(315)/sqrt(7))*2. -10sqrt(5) + 250 Simplify -2(1(5 + sqrt(2448)-4)4 + -5)*2. -1253826 + 11520sqrt(17) Simplify ((-2sqrt(24) + sqrt(24) + sqrt(24))/sqrt(2) - (sqrt(144)3)/sqrt(12))/((sqrt(180)5)/(sqrt(20)-1)). 2sqrt(3)/5 Simplify -3sqrt(832)-5 + -4 + 0 + sqrt(832) + 0 + -6(sqrt(832) + sqrt(832)2)-3 + -2. -6 + 560sqrt(13) Simplify (sqrt(104)1-6 - (((sqrt(104)3 - sqrt(104))-6 - sqrt(104)) + sqrt(104)))/(5-2sqrt(1152) + 2sqrt(1152)6). sqrt(13)/4 Simplify ((3 + sqrt(2448) + 0 + -1 - (4 + (sqrt(2448) - (0 + sqrt(2448)))2))-61)*2. -1728sqrt(17) + 88272 Simplify (-3sqrt(1836)2)/(6-1sqrt(9)/sqrt(3)). 6sqrt(17) Simplify 3((((sqrt(77) - 4sqrt(77))/sqrt(7) - sqrt(11)) + sqrt(11) - (sqrt(1331) + -4)) + (0 + sqrt(121)/sqrt(704))2 + -4). -42sqrt(11) + 33/64 Simplify (2-4sqrt(1225)-2)/(sqrt(240)/sqrt(3) - 2sqrt(5)-1). 56sqrt(5)/3 Simplify -1 + ((0 + 1sqrt(162)2 + (1 + sqrt(162) + 4 - sqrt(162)) + sqrt(162) + sqrt(162) + 1 + 5)-3)21. 7128sqrt(2) + 24416 Simplify 1((6(sqrt(204)-1 + sqrt(204)) + sqrt(204) + sqrt(204))-3)/(sqrt(12) + (sqrt(432) - sqrt(432)-1) + (sqrt(132)-1)/sqrt(11)). -sqrt(17)/2 Simplify ((-4sqrt(480))/(sqrt(98)-1))/(sqrt(5)11-32). -8sqrt(3)/21 Simplify 3(5(sqrt(1584) + -2sqrt(1584)) + sqrt(1584) + -1 + sqrt(1584) + 4 - (-4(sqrt(1584) + -1) + -2sqrt(1584)1))*2. -216sqrt(11) + 42771 Simplify 3((-5 + (1(4 + -2sqrt(11) + sqrt(11)) - (sqrt(704) - (2 + sqrt(704))-3)))*2 + -3). 1386sqrt(11) + 36075 Simplify ((sqrt(121) + -2sqrt(121))-3 - sqrt(121))/(sqrt(1584)-1) - (sqrt(495) + (-1sqrt(495) - sqrt(495) - sqrt(495)))/(sqrt(5) - sqrt(10)/sqrt(8))-1. -73sqrt(11)/6 Simplify (-5 + (6sqrt(6)2)/(sqrt(192)-1))2 + -1(-3 + (sqrt(242) - (2 + (-1 + sqrt(242) + sqrt(242))*2))). -40sqrt(2) + 2007/2 Simplify (((sqrt(125) + -4)4 + sqrt(125))6)*2 + (4 + (sqrt(495)/sqrt(11) - 5(-1 + sqrt(5))))*2. -28836sqrt(5) + 121817 Simplify -5 + ((2sqrt(156) + sqrt(156))/sqrt(12) - (-2 + sqrt(1872) + sqrt(13))) + (-1 + (sqrt(104) - (sqrt(104)1 + sqrt(104))3 - sqrt(104))/sqrt(8))2. 2sqrt(13) + 466 Simplify 4 + 1 + -5(sqrt(5) + -1) - ((sqrt(15) + sqrt(15)2)-3 + sqrt(15))/(5sqrt(3)-1). -33sqrt(5)/5 + 10 Simplify (-4 + 1(sqrt(180) + sqrt(180) + 0 + -3) + 4 + (sqrt(180) + 2 + sqrt(180))-5)*2. 1248sqrt(5) + 11689 Simplify 5((4 + (sqrt(176) - (sqrt(176) + 3sqrt(176))) + 1)-1 + -1 + 4)2. -240sqrt(11) + 7940 Simplify ((2 + 3 + 2 + (sqrt(1539) - (1 + sqrt(1539) + -5)) + -2)-2)2. 324 Simplify 0 + ((-5-2sqrt(78))/(sqrt(6) - 3sqrt(24)/sqrt(4)) + ((sqrt(143) + sqrt(143)-1)2)/(sqrt(11) + (sqrt(11) - sqrt(176))-2))2. 325 Simplify (sqrt(76) + 2sqrt(76)2 + sqrt(76))/(sqrt(4) - (sqrt(36)-1)/sqrt(9)) - (6(-5 + sqrt(1216) + 1 + -1))2. -44676 + 2883sqrt(19) Simplify -42((3sqrt(352)-1)/(1(sqrt(36)/sqrt(2))/sqrt(9)))2. -12672 Simplify ((sqrt(1100) + sqrt(1100) + -1)-6)*24 + (sqrt(11) - (1 + sqrt(11) + -1)) + -3 + 5. -5760sqrt(11) + 633746 Simplify 5(-2 + 0 + sqrt(80) + 0)*2 - (5(sqrt(320) + 1) + 4(sqrt(320) + 0 + sqrt(320) + sqrt(320)) + sqrt(320))2. -103285 - 1520sqrt(5) Simplify ((0 + sqrt(1100))-4 - (sqrt(704) - (4 + (sqrt(704) - sqrt(704)2))))*2 + -2 + 0. -448sqrt(11) + 34510 Simplify -5(3 + (sqrt(1152)5 - sqrt(1152)) + -1)*262. -1106160 - 23040sqrt(2) Simplify (sqrt(156) + 1(sqrt(156)1 - sqrt(156)))/((-1sqrt(432) - sqrt(432)) + sqrt(432)) - (sqrt(52) + (sqrt(6292)1)*2 + sqrt(52))-2. 47sqrt(13)/6 + 12584 Simplify -5 + (sqrt(2736)1 - sqrt(2736))*2 + -2 - (((sqrt(76) + (sqrt(76) - ((sqrt(76) + (1sqrt(76) - sqrt(76)) - sqrt(76)) + sqrt(76))))4)/sqrt(4) + -1). -4sqrt(19) - 6 Simplify (3(-3 + 5(-1-3sqrt(200) + sqrt(200) + 5(sqrt(200) + 1 + sqrt(200))))-2)*2. 1108800sqrt(2) + 35297424 Simplify 1((((sqrt(9) + sqrt(81) + sqrt(9))-4 - sqrt(9))/(2(sqrt(12)/sqrt(4) + sqrt(3))))2 + -2(-3(sqrt(48) + sqrt(1200)))2). -496341/16 Simplify -4 + -6((sqrt(1573) + 2)-43 + 0 + sqrt(1573) + -1sqrt(1573) + (sqrt(1573) - ((sqrt(1573) - -1sqrt(1573)) + -3)) + sqrt(1573))*2. -1361722 - 33264sqrt(13) Simplify -2((sqrt(171) - 2(2*sqrt(171) - sqrt(171) - sqrt(171)) - sqrt(171)	{ "pile_set_name": "DM Mathematics" }
5/(-18)35746/(-845)? 17 What is the value of ((-21)/(-3))/1441/1029? 3 What is the value of ((-9)/(-273))/(327/1526)? 2/13 What is ((20/(-6))/5)/((22/(-39))/11)? 13 Evaluate 1/(638/(-7524)). -33 What is the value of 3211/132(-315)/60? -14 (-3216)/5896(-22)/6 2 What is -2436/(-108)(-1)/(-6)-8? -18 What is (-8)/821515/(-585)? 10/13 What is (-2)/12(-840)/(-760)19? -7/2 What is the value of 1(924/(-22))/(-21)? 2 Evaluate ((-527)/316263/4)/((-2)/16). 21 Evaluate ((-324)/(-45)1/(-4))/((-24)/160). 12 Calculate (-50)/(-350)(-21)/18-3-20. -10 Calculate 44/(15/((-120)/(-32)))1/(-1). -11 Calculate (-70)/(-15)(-52)/(-52). 14/3 Evaluate (32/(-24))/((-660)/(-45)). -1/11 What is (-108)/((-2)/(-1))1/(-12)? 9/2 What is (4/(-16))/((-1)/((-1)/(-2)30))? 15/4 Evaluate (10186/(-926))/(22/(-42)). 21 Evaluate (-10)/380-190. 0 What is (-4)/10(-675)/(-405)? -2/3 Evaluate (9(-16)/288)/(4/(-152)). 19 Calculate 21/(-3150)107/(63/30). -2/9 What is the value of (60/72)/(-100(-15)/(-540))? -3/10 Calculate (-1)/(-2)-17162/(-153). 9 Calculate (-1)/3180/(-420). 1/7 (((-120)/68)/(-5))/(7/7) 6/17 What is the value of (-1)/(1/2)(-3460)/1384? 5 Calculate (13/12)/(87204/2064). 1/39 ((28/7)/(24/36))/(-8) -3/4 What is (-198)/(-330)100/18-3? -10 -3815/(-20)-128/(-144) 19 Calculate 25(8484/56)/(-101). -15 Calculate 1/(198/88)(-18)/(-192). 1/24 Evaluate 231/(-88)(-200)/75. 7 Evaluate ((-32)/32)/((-2)/(-9)-3). 3/2 What is the value of (19/((-950)/(-60)))/(2/10)? 6 Evaluate 630/701/(-31). -3 ((-8)/30)/(-1231/310) 2/9 Evaluate ((-656)/336)/(-41)-9. -3/7 Evaluate (-15)/(-45)4/17/126. 2/27 What is the value of 1(-1)/6(-2583)/(-574)? -3/4 (-906)/151(-31)/(-6) -31 Calculate (-14)/(-21)(-2)/4(-60)/(-10). -2 What is the value of ((-171)/(-12))/19-24/165? -2/55 ((-8)/(-96))/(-311/66) -1/6 Evaluate (1/(-2))/((3/(-18))/(4/(-12))). -1 Calculate ((10/(-1260))/(2/(-20)))/((-10)/(-12)). 2/21 Calculate 120/3(-11)/((-110)/18). 12 Calculate ((-2)/(-2))/((470/(-1064))/5). -19 Calculate (4368/(-572))/21-12/(-28). -2/77 Calculate 38(-40)/(-380)(-2)/20. -2/5 What is (((-64)/(-12))/16)/(4/964)? 2 (196/(-35))/2(-10)/804 7/5 What is the value of ((-4)/70-20)/(50/70)? 8/5 (4/13)/((-41)/((-3198)/12)) 2 What is the value of ((15/(-5))/9)/(3485/205)? -1/51 What is 4/46216/541/4? 2/23 What is the value of 8/(-6)(-2)/8-21? -7 Calculate ((-1)/5)/(8/360). -9 Calculate 3/(-2)-15(-6)/(-45). 3 Evaluate 4/((-140)/(-15))(-238)/340. -3/10 What is the value of 6/(192/(-40))(-88)/165? 2/3 What is (24/168415/(-20))/3? -1/7 Evaluate (12/60)/(38/10). 1/19 ((-22)/448)/((-10)/4) 8/5 (-7)/(-4)220/10784/(-5) -2/7 Calculate (-55)/4(-500)/625. 11 Evaluate 3(-4)/(-30)(-135)/7938-6. 2/49 Calculate 30/(-35)1/10(-56)/16. 3/10 Calculate 1/(3/24)495/(-1320). -3 What is the value of 182/4154/539? 13 What is 1(3(-4)/48)/((-28)/(-112))? -1 Calculate ((-21)/21)/(((-24)/68)/6). 17 (1/(5/(-2)))/((-5)/(-150)) -12 6/(-1)5/22551 -2/3 What is (10/(630/49))/(189/(-81))? -1/3 What is -5(-2691)/(-195)((-2)/(-3))/2? -23 (-2)/7(-39)/140463 1/2 What is the value of (-11)/(220/24)(-6)/((-1470)/175)? -6/7 What is ((-35)/(-10))/((-9)/(-18))? 7 What is the value of 42/(-18)28710/2233? -30 What is 800/(-16)16/(224/7)? -25 What is the value of (((-570)/(-7600))/((-3)/(-2)))/((-4)/(-10))? 1/8 What is the value of (54/(-10))/((-9306)/5170)? 3 Evaluate 8/(-240)-3(-15)/5. -3/10 Evaluate (24/(-54))/(((-8)/(-28))/(12/(-14))). 4/3 Evaluate 3/(((-2793)/190)/49). -10 Calculate (-43)/(3096/54)70/15. -7/2 Calculate ((-8)/760)/((-29)/(-435)). -3/19 Calculate 8((-2)/4)/1. -4 ((-312)/360010)/(1/(10/(-4))) 13/6 What is 26/510/24156/(-26)? -13 Evaluate ((-99)/132)/((-5)/40). 6 Evaluate ((-24)/32)/((-162)/(-27)(-18)/(-32)). -2/9 What is (2880/2448)/((-2)/(-17))? 10 ((-4)/3)/((-82)/(-1476)12/(-15)) 30 What is (-11)/(-308)-7-5? 5/4 (32/336)/(((-140)/(-45))/(-7)) -3/14 What is the value of (55/132)/(-5)(81/(-12))/(-3)? -3/16 10(-117)/49511 -26 What is the value of (-52/90)/((-3)/135)? 5 Calculate (8/12)/(6/(-3)(-3)/(-63)). -7 Evaluate (((-1008)/90)/(-28))/11. 2/55 What is the value of 220/84228/190? 4/7 What is the value of 3/(-6)311/(5445/90)? -3/11 What is 26/3(-8)/(-24)45/10? 13 Calculate (-2)/(-12)4725/(-420)(-84)/175. 9/10 Calculate (((-126)/4)/(-7))/((75/(-40))/5). -12 What is the value of (4/(-14))/((-860)/(-33110))? -11 Evaluate (5456/992)/((-27)/12). -22/9 Calculate ((8/(-2))/((-70)/77))/((-2)/(-5)). 11 What is -1135/(75/5)? -9 Evaluate (64/144)/((-14)/441). -14 What is (-146)/(-584)(-60)/3? -5 Calculate ((-33)/1)/(10396/(-720)). 6 What is the value of (-255)/(-51)15/(-650)? -3/26 Evaluate (8/(-3)(-310)/(-620))/((-2)/(-6)). -4 What is the value of (-2)/(-1)((-2)/(-2))/((-266)/(-399))? 3 Calculate 27/(-6)(-56)/(-126)10/(-65). 4/13 What is (4/6)/(12/(-5))3/(-5)? 1/6 (3(-3)/49)/((-762)/1778) 3/7 What is 6/(((-1)/((-28)/(-18)))/(294/343))? -8 Calculate (-220)/726-22(-3)/(-8). 5/2 Evaluate 4/((25/(1350/(-18)))/(2/(-588))). 2/49 ((-9)/(-90))/((-2)/50) -5/2 1(-34)/(-51)180/(-264) -5/11 What is ((-1)/2)/((-208)/52)24/4? 3/4 Calculate (((-17)/12138-14)/(-1))/((-1)/6). 2/17 What is 675/(-2430)12/10? -1/3 Evaluate (-3)/(-2)480/72. 10 Calculate (6/(-16))/((-2520)/(-420)). -1/16 What is ((1/4)/(73/(-146)))/((-2)/52)? 13 What is the value of (-6)/(-4)4/3(-6864)/528? -26 What is the value of (-1)/(-110)268/(-469)42/(-6)? 2/55 Calculate ((-6)/((-144)/30))/((-27)/432). -20 (-18)/12(-8)/(-36)48/(-2) 8 Evaluate (-172)/68816/(-86). 2/43 Calculate ((-72)/112)/(-9)6/(-6). -1/14 Evaluate 144/24((-4)/48)/(1/(-8)). 4 What is the value of 5/(60/66)202/55? 4 What is 216/(240/(-10))4/2? -18 Evaluate ((-6)/28)/(177/413). -1/2 Evaluate 1(17860/(-40))/47. -19/2 What is ((-2)/(-8))/((-2035)/244200)? -30 Calculate 237/(-395)(-6)/(36/70). 7 What is the value of 4((-68)/40)/17(-15)/36? 1/6 What is the value of (-6)/((-93)/217581)? 2/83 (-81)/(-180)4(-350)/42 -15 What is 11/(((-1)/9)/(7(-4)/252))? 11 ((-28)/(-12))/(21/90) 10 3((-4)/(-34))/((-1680)/(-2040)) 3/7 What is the value of 4/((9/(-15)2)/(315/350))? -3 Calculate (-5)/913046/(-1725). 4/9 (65/(-6)369/2460)/(5/(-40)) 13 What is 63/(-14)78/2808? -1/8 33/143044(-30)/(-48) 3/13 What is the value of ((-18)/(-432)-12)/((-4)/31)? 3/8 ((-6000)/(-70))/20(-42)/12 -15 Evaluate (-6)/(-28)154/264. 1/8 3/((-19)/(1596/(-945))) 4/15 Evaluate (((-9)/27)/(14/(-180)))/((-82)/574). -30 Calculate (-45)/9360-163. 3/13 Evaluate (675/90)/((-10)/(-44)). 22 Evaluate 21/(-54)-6(-6)/(-10). 7/5 What is the value of ((-2)/(-14))/(3850/(-8085))? -3/10 2(-1)/5((-360)/(-44))/18 -2/11 What is ((-2)/10)/((-344)/8600)? 5 Calculate (-56)/276(-6)/162854/9989. 1/46 (-147)/(-49)3/(-2)90/495 -9/11 (-35)/20146/8687 -1/34 Evaluate ((7/(-6))/((-140)/160))/((-44)/(-6)). 2/11 Evaluate (738/287)/(3/1128). 12 What is 3((-240)/(-9))/16? 5 Evaluate ((-203)/1421)/((-1)/(-21)). -3 7-5(-13)/((-286)/22) -35 Evaluate (60/40(-2)/5)/(2/5). -3/2 What is 328/(-738)(-396)/(-8)? -22 Evaluate (14/168)/(3/12). 1/3 ((-1)/2)/(-8(-561)/(-544)) 2/33 What is the value of (105/10)/((-775)/620)? -4 Calculate (1(-8)/(-4))/(1/((-35)/30)). -7/3 (((-400)/15)/10)/254/(-8) 9 Calculate (7/2812)/((-27)/99). -11 Calculate 10/(-920)16(-33)/44. 3/23 Evaluate 24/(-12)86/(-43). 4 What is the value of 20/(-9)(-1848)/(-280)(-3)/2? 22 (2992/(-204))/(32/12) -11/2 (17/((-374)/(-44)))/(-4) -1/2 What is 12/322(-133)/(-57)? 2/23 (-3)/(-7)(-121)/(169884/(-1456)) 4/9 What is the value of ((-44)/(-22))/(2/42014)? 30 Calculate ((-8)/(-504))/((-17)/51). -1/21 (-14)/(-77)187/(-51) -2/3 Calculate (1/(-3)378/63)/((-20)/(-2)). -1/5 What is the value of ((-5)/7360/(-100))/((-6)/28)? -12 What is 2/(-4)(-3)/((-132)/16)? -2/11 Calculate (780/28665)/((-2)/(-7)). 2/21 What is the value of ((-4)/(-6)(-2)/2)/((-880)/30360)? 23 What is ((-4)/(-6))/((-42)/69322)? -1/2 ((472/59)/(126))/(-1) -4/13 What is the value of ((-12)/10(-424)/(-636))/((-4)/(-90))? -18 Calculate (132/(-96))/11-2. 1/4 What is (-5)/103(-12)/3? 6 (1270/(-1143))/((-4)/9) 5/2 Evaluate (6/(1(-52)/13))/(2/(-12)). 9 What is (17/205718)/((-36)/(-264))? 12/11 Evaluate (-1)/(-4*	{ "pile_set_name": "DM Mathematics" }
g Let c(q) = -q*3 - 3q*2 + 6q + 4. Let i be c(-4). Let m be (-5 + 0)/((-20)/12). Suppose 0 = -mt + 11t + 24. Sort 4, t, i. i, t, 4 Suppose 0 = -4n - 16, -5n + 61 = 3o - 0. Sort -3, 0, -5, o in decreasing order. o, 0, -3, -5 Let t be (-3)/(-2(-6)/(-16)). Let s(h) = 2h + 22. Let u be s(-13). Put u, t, -1 in ascending order. u, -1, t Suppose -3k + 50 - 53 = 0. Put -5, -36, k in descending order. k, -5, -36 Let x = 2.008 + 0.382. Let i = x + -1.33. Let a = i + -0.06. Sort a, 3, 9 in decreasing order. 9, 3, a Let c = -219 - -217. Sort 2, c, -66. -66, c, 2 Let w = -37/56 - -3/8. Let b = -229 + 218. Sort -5, b, w in decreasing order. w, -5, b Let f be 50/966/(-132). Sort f, -1, 2/3, 2/13 in descending order. 2/3, 2/13, -1, f Let j = 0.303 + 0.697. Put j, -1, 14.6, 0 in descending order. 14.6, j, 0, -1 Suppose 0m = -3m - 18. Let j be ((m + 0)/(-18))/(1/(-3)). Put 0.1, j, -2 in descending order. 0.1, j, -2 Let a = -110 + 338/3. Sort a, -2/7, 0.3. -2/7, 0.3, a Suppose -12k + 15k = 4j + 23, 14 = -3j - k. Sort 3, j, -1, -6 in decreasing order. 3, -1, j, -6 Let i be 915/(-244) - 1/4. Let u(y) = y3 + 6y*2 + 8y + 3. Let h be u(-5). Put i, h, 2 in ascending order. h, i, 2 Suppose 2 = 3h - 2g, -2g + 3 = -1. Suppose -a = -2a + 1. Suppose -2 - a = -3z. Put -2, z, h in increasing order. -2, z, h Let y = -19 - -65. Let v = y + -49. Put -5, 0.5, -1, v in descending order. 0.5, -1, v, -5 Let i = -2 + 2.03. Let n = 3404.5 - 3404. Put i, -1/5, n in increasing order. -1/5, i, n Suppose 2a - 3 = -2q - 5, 4a + 31 = 5q. Let h be (-10)/a(-8)/(-10). Let z be 1/(-3) - h/(-12). Sort 0, -3/8, z in increasing order. -3/8, z, 0 Let r(w) = w*2 + 7w + 6. Let x be r(-5). Let f(t) = -t*2 + 31t + 1323. Let k be f(55). Sort x, -1, k, -3 in decreasing order. k, -1, -3, x Suppose 25t + 56 + 44 = 0. Put t, 3, 99 in ascending order. t, 3, 99 Let o = 0.188 - 11.288. Let v = -12.16 - o. Let i = v - -0.06. Sort 0, 0.2, i in descending order. 0.2, 0, i Let r be (-11)/(-9) + (-14)/63. Suppose 3n = -5c - 5, 3n - 2n = -c - r. Put c, 5, -2, 1 in increasing order. -2, c, 1, 5 Suppose 4h + 203 = 179. Put 0, h, 7 in decreasing order. 7, 0, h Suppose -4 = 2v - 6v. Let h = -1131.5 - -1131. Sort h, -1, v. -1, h, v Suppose -17y + 20y - 6 = 0. Suppose 10 = -4x - 2o, 0 = 5x - yo - 3o + 5. Sort x, -1, 1, -3 in increasing order. -3, x, -1, 1 Let h be (-161 + 160)/(1/(-3)). Put -3, h, 4, -15 in ascending order. -15, -3, h, 4 Let l(r) = r3 + 7r*2 + 11r + 12. Let a be l(-6). Let d = a - -18. Put d, -3, -2 in decreasing order. d, -2, -3 Let p(m) = -m*2 - 6m + 2. Let k be p(-7). Let z be 2 + (-4 - -2) + 2. Let b(t) = t - 9. Let l be b(6). Put l, k, z in decreasing order. z, l, k Let c = -4 - 2. Let y = -16 + 4. Let g = y + 14. Put 5, c, g in ascending order. c, g, 5 Let d = 3 + 0. Suppose -ds = -0s + 2y + 7, -2y - 10 = 0. Suppose 3j = 4j + v + 6, -26 = j + 5v. Sort j, -5, s in increasing order. -5, j, s Let b = -21 - -27. Let p = b - 5.8. Let g(x) = x - 3. Let i be g(5). Put i, p, 0.05 in decreasing order. i, p, 0.05 Let d = 0.32 - -0.1. Let p = d + -1.42. Let c = -2 + -2. Sort p, -0.5, c in increasing order. c, p, -0.5 Let a = 110 + -768/7. Let t = 0.086 - -0.914. Sort -0.04, -2, t, a. -2, -0.04, a, t Let p = 749 - 1499/2. Put p, 0, 69, 0.1 in descending order. 69, 0.1, 0, p Let y(x) = 2x*2 - 88x - 1086. Let h be y(54). Let k be (2/4)/((-15)/(-6)). Put k, 0, h, -2/13 in descending order. k, 0, -2/13, h Let a = -0.14 - -0.01. Let m = 0.12 - a. Let q = m + -0.55. Sort q, 0.2, 1 in decreasing order. 1, 0.2, q Let p = -0.11 - 2.29. Let r = -2.6 - p. Suppose 0v = -3v + 12. Put 0.1, v, r in ascending order. r, 0.1, v Let v = -7 + 9. Suppose -2m = 2 + v. Let i be 4/(-18) + 6/27. Sort -3, i, m in descending order. i, m, -3 Let y = -0.1 + -3.9. Let g = 20.7 + -19.7. Sort y, g, 12/5, 5 in ascending order. y, g, 12/5, 5 Let c be (75/30)/((-1)/(-2)). Sort -4, -21, c in descending order. c, -4, -21 Suppose -2t + 0t + 4 = 0. Let b = -87 + 85. Put t, 4, b in ascending order. b, t, 4 Let p be 51(2 - (-2 + 0)/(-2)). Suppose -pt + 10 = -49t. Sort t, -1, -4 in increasing order. -4, -1, t Let m be (6/(-35))/((-66)/154). Sort m, -0.4, -8, -4/11 in decreasing order. m, -4/11, -0.4, -8 Suppose -4g + 117 - 5 = 0. Let q be 30/(-14) - (-4)/g. Let z = -7 + 12. Put z, q, -4 in descending order. z, q, -4 Suppose -216j = -192j - 456. Sort j, -1, -0.6 in ascending order. -1, -0.6, j Let j = -64.653 - -65. Let g = -0.153 - j. Put -13, 3/5, g in descending order. 3/5, g, -13 Let z = 1.032 - 0.772. Put 4, -4, z in decreasing order. 4, z, -4 Let g = 261 - 1565/6. Sort -11, -0.1, -2/7, g in increasing order. -11, -2/7, -0.1, g Let f be (1/(-1))/(-1)22/22. Put f, 3, 6, 0 in decreasing order. 6, 3, f, 0 Suppose -2o = o - 378. Let d = 194 - o. Let h be 2/8 + (-17)/d. Put 4, h, 0.1 in increasing order. h, 0.1, 4 Let s = 22.71 + -26.698. Let g = s - 0.012. Suppose 5w = -2f - 1, -2w - 7 = -f + 4f. Sort g, w, 0 in ascending order. g, 0, w Suppose 252 = -q - 3q. Let d be q/(-27) - 2/6. Suppose 3g - 12 = -g. Put d, 1, g in descending order. g, d, 1 Suppose -4r + 34 = 14. Let z = 122 - 125. Put -0.3, 4, z, r in increasing order. z, -0.3, 4, r Suppose 5q = -4h + 16, 4q + 0q = 2h - 8. Let v = 3 - h. Let o be v/7 - 204/42. Sort -4, o, 2. o, -4, 2 Let o = 20.5 + -10.5. Put -1, 0.5, o in increasing order. -1, 0.5, o Let a = -0.1171 - -0.4171. Let x = -91 - -911/10. Sort a, x, -37 in descending order. a, x, -37 Let h be (-18)/244/5. Let a = 6.3 + -1.3. Let o = a - 2. Put h, o, 0.1 in decreasing order. o, 0.1, h Suppose -8 = 7p - 3p - 3v, -2v = 0. Put 2/7, -2/7, -4, p in ascending order. -4, p, -2/7, 2/7 Let r = -0.09 - -0.59. Let f be 2/10 - 14/(-30). Put r, f, -0.3 in decreasing order. f, r, -0.3 Let u = 3 - 1. Let a be (-4)/(-14) - 209/(-77). Put u, a, -2 in descending order. a, u, -2 Let z be -1 + -4 + (0 - 2). Let d be 4/z - (-16)/56. Put -4, 11, d in descending order. 11, d, -4 Let x = -3 - -5. Let h be -2 + -2x/2. Let r = 41 - 289/7. Put 1, h, r in decreasing order. 1, r, h Let m(d) = -2d*3 - 3d - 3d + 3d*3 + 1 - 4 - 5d*2. Let q be m(6). Suppose 5r - p - 4p = -5, 4r + 4p = 28. Sort r, 4, q in descending order. 4, r, q Let f = 28.4 - 28. Let l = f - 0.9. Let j = -2 - -1. Put l, j, -5 in descending order. l, j, -5 Let n = 2 - 4. Let d = -8 + 10. Suppose -du - 11 = -1. Sort n, u, -0.1 in ascending order. u, n, -0.1 Let h be (4 - 168/45)/(12/(-10)). Let x = 25/3 - 169/21. Put -0.5, h, x in decreasing order. x, h, -0.5 Let t be ((-30)/(-12) - 2)8. Sort 5, 7, t in ascending order. t, 5, 7 Suppose -120 = 40z - 197 - 123. Let o be (-4 - -2)/(-2)-22. Sort 0, o, z in increasing order. o, 0, z Let b = -193 + 112. Let j = 80.6 + b. Let d be -3 + 1 + (-3)/(-2). Put j, d, -5 in decreasing order. j, d, -5 Let s(y) = -y - 5y + 2 + 3y + 4. Let o be s(-7). Let v = o - 30. Sort -2, v, 2 in decreasing order. 2, -2, v Let k be ((-55)/110)/((-26)/28 + 1). Put k, -1, 1, -9 in descending order. 1, -1, k, -9 Suppose -6o + o - 4b + 10 = 0, -3b + 8 = 4o. Let f be 4-5(-4)/((-8)/(-4)). Let a = 38 - f. Sort o, 4, a in ascending order. a, o, 4 Let t = 191.9 + -180. Let h = t + -12. Let q = -9 + 14. Put q, -4, h in decreasing order. q, h, -4 Let w = 575 + -577. Sort w, -1, 152. w, -1, 152 Let f = -33 + 35. Suppose x = 3 - f. Sort -2, -1, x, 3 in decreasing order. 3, x, -1, -2 Suppose 3k + 38 = 4k. Let r = k + -38. Let b be (2/(-3))/((-18)/(-27)). Sort b, 4, r in ascending order. b, r, 4 Suppose -z = -5h + 5 - 1, 4h + 8 = -2z. Let k be h + (-1)/(-2)0. Suppose -o + 5i - 14 = k, 5i + 0i - 22 = 3o. Put o, 0, 0.2 in ascending order. o, 0, 0.2 Let a = 0.124 + 1.876. Put -0.3, -4/15, 1/7, a in ascending order. -0.3, -4/15, 1/7, a Let a(s) = -s3 - 5s*2 - 2. Let q be a(-5). Let t be (q + 3/6)/(-6). Let d(r) = -4r*2 - 25r + 63. Let x be d(2). Sort x, -7, t. -7, x, t Let k be (66/(-154))/((-12)/21). Sort -0.4, k, -5 in decreasing order. k, -0.4, -5 Let j(y) = y*2 + 7y - 7. Let n be j(-9). Sort 4/3, -3/2, n, 2 in descending order. n, 2, 4/3, -3/2 Suppose -6b + 50 + 4 = 0. Suppose 4w + 1 - b = 0. Sort w, 20, -1/4 in decreasing order. 20, w, -1/4 Let q	{ "pile_set_name": "DM Mathematics" }
t the prime factors of 672807. 3, 137, 1637 What are the prime factors of 5974479? 3, 7, 41, 257 What are the prime factors of 564798? 2, 3, 13, 557 What are the prime factors of 682115? 5, 7, 19489 List the prime factors of 389121. 3, 129707 List the prime factors of 6579094. 2, 61, 53927 List the prime factors of 83035. 5, 16607 List the prime factors of 541354. 2, 11, 2237 What are the prime factors of 1561355? 5, 23, 13577 List the prime factors of 283374. 2, 3, 7, 13, 173 What are the prime factors of 3843094? 2, 41, 46867 What are the prime factors of 28382475? 3, 5, 11, 34403 List the prime factors of 19918. 2, 23, 433 What are the prime factors of 3986928? 2, 3, 11, 839 List the prime factors of 330965. 5, 37, 1789 What are the prime factors of 60971? 19, 3209 List the prime factors of 1072720. 2, 5, 11, 23, 53 What are the prime factors of 9087492? 2, 3, 757291 What are the prime factors of 11655291? 3, 521, 7457 List the prime factors of 5504047. 191, 28817 What are the prime factors of 755320? 2, 5, 23, 821 List the prime factors of 4189254. 2, 3, 383, 1823 List the prime factors of 7447237. 7, 1063891 List the prime factors of 984394. 2, 331, 1487 List the prime factors of 305772. 2, 3, 83, 307 List the prime factors of 185695. 5, 37139 What are the prime factors of 3265295? 5, 11, 59369 What are the prime factors of 1517774? 2, 758887 What are the prime factors of 2555174? 2, 97, 13171 What are the prime factors of 774398? 2, 387199 What are the prime factors of 15770? 2, 5, 19, 83 What are the prime factors of 6398757? 3, 197, 401 List the prime factors of 503244. 2, 3, 7, 1997 List the prime factors of 3033239. 11, 47, 5867 List the prime factors of 838404. 2, 3, 7, 1109 What are the prime factors of 1250059? 47, 26597 What are the prime factors of 720224? 2, 71, 317 What are the prime factors of 18576? 2, 3, 43 List the prime factors of 490226. 2, 11, 22283 List the prime factors of 218072. 2, 27259 What are the prime factors of 2047758? 2, 3, 341293 What are the prime factors of 107875? 5, 863 List the prime factors of 107334. 2, 3, 67, 89 What are the prime factors of 26647182? 2, 3, 181, 8179 What are the prime factors of 2240480? 2, 5, 11, 19, 67 What are the prime factors of 231831? 3, 25759 What are the prime factors of 732822? 2, 3, 37, 3301 What are the prime factors of 1252574? 2, 61, 10267 List the prime factors of 288613. 13, 149 List the prime factors of 11914363. 197, 307 List the prime factors of 755396. 2, 127, 1487 List the prime factors of 2528444. 2, 17, 19, 103 What are the prime factors of 826007? 7, 13, 29, 313 What are the prime factors of 2279346? 2, 3, 23, 83, 199 What are the prime factors of 127042? 2, 63521 What are the prime factors of 12928134? 2, 3, 149, 14461 What are the prime factors of 499795? 5, 19, 5261 What are the prime factors of 6473725? 5, 258949 List the prime factors of 139975. 5, 11, 509 List the prime factors of 1470793. 29, 41, 1237 List the prime factors of 24439473. 3, 2715497 What are the prime factors of 2171068? 2, 67, 8101 List the prime factors of 1425354. 2, 3, 7, 33937 What are the prime factors of 826014? 2, 3, 7, 71, 277 What are the prime factors of 1722424? 2, 11, 23, 37 What are the prime factors of 2469323? 53, 46591 List the prime factors of 7226856. 2, 3, 7, 13, 1103 What are the prime factors of 322661? 229, 1409 What are the prime factors of 802044? 2, 3, 22279 What are the prime factors of 5506325? 5, 11, 20023 List the prime factors of 195557. 167, 1171 List the prime factors of 3409053. 3, 101, 11251 What are the prime factors of 207787? 47, 4421 What are the prime factors of 25451532? 2, 3, 706987 What are the prime factors of 4159839? 3, 107, 12959 List the prime factors of 146755. 5, 7, 599 What are the prime factors of 1379516? 2, 17, 20287 List the prime factors of 747876. 2, 3, 62323 List the prime factors of 2115801. 3, 8707 What are the prime factors of 650252? 2, 162563 What are the prime factors of 1529102? 2, 764551 List the prime factors of 153149. 29, 5281 List the prime factors of 4810445. 5, 647, 1487 What are the prime factors of 460068? 2, 3, 7, 5477 What are the prime factors of 8201063? 13, 48527 What are the prime factors of 920136? 2, 3, 7, 5477 What are the prime factors of 1448983? 1448983 List the prime factors of 1001054. 2, 500527 List the prime factors of 69481. 69481 List the prime factors of 7999788. 2, 3, 666649 What are the prime factors of 6170131? 11, 41, 13681 What are the prime factors of 441227? 433, 1019 What are the prime factors of 434988? 2, 3, 43, 281 List the prime factors of 245374. 2, 79, 1553 List the prime factors of 639185. 5, 127837 What are the prime factors of 182219? 47, 3877 What are the prime factors of 1796193? 3, 7, 4073 List the prime factors of 270957. 3, 181, 499 List the prime factors of 2256277. 23, 263, 373 List the prime factors of 537535. 5, 107507 List the prime factors of 234186. 2, 3, 23, 1697 What are the prime factors of 3570633? 3, 11, 36067 List the prime factors of 10577661. 3, 19, 9767 What are the prime factors of 879558? 2, 3, 47, 3119 What are the prime factors of 144160? 2, 5, 17, 53 List the prime factors of 14435948. 2, 1609, 2243 What are the prime factors of 3176? 2, 397 What are the prime factors of 3309312? 2, 3, 31, 139 What are the prime factors of 8367791? 17, 23, 21401 List the prime factors of 547382. 2, 11, 139, 179 What are the prime factors of 2545827? 3, 317, 2677 List the prime factors of 305319. 3, 7, 31, 67 What are the prime factors of 503228? 2, 11, 11437 What are the prime factors of 692021? 11, 53, 1187 What are the prime factors of 29390851? 7, 743, 5651 List the prime factors of 3881349. 3, 53, 79, 103 What are the prime factors of 2663994? 2, 3, 443999 What are the prime factors of 14080541? 31, 454211 List the prime factors of 110872. 2, 13859 What are the prime factors of 949311? 3, 11, 43, 223 List the prime factors of 249209. 31, 8039 List the prime factors of 259937. 259937 What are the prime factors of 1957874? 2, 19, 67, 769 What are the prime factors of 2127867? 3, 7, 19, 5333 List the prime factors of 982545. 3, 5, 31, 2113 List the prime factors of 3767557. 17, 221621 List the prime factors of 4949881. 4949881 List the prime factors of 2200999. 941, 2339 What are the prime factors of 456526? 2, 7, 32609 What are the prime factors of 11349308? 2, 19, 149333 List the prime factors of 680877. 3, 75653 What are the prime factors of 73969? 7, 10567 What are the prime factors of 107249? 23, 4663 What are the prime factors of 12355275? 3, 5, 257, 641 List the prime factors of 622598. 2, 311299 What are the prime factors of 200605? 5, 53, 757 What are the prime factors of 36979? 36979 What are the prime factors of 597416? 2, 53, 1409 List the prime factors of 406139. 53, 79, 97 What are the prime factors of 1692604? 2, 367, 1153 List the prime factors of 842532. 2, 3, 61, 1151 What are the prime factors of 7028217? 3, 7, 15937 List the prime factors of 26590. 2, 5, 2659 List the prime factors of 1215727. 31, 39217 What are the prime factors of 505363? 79, 6397 What are the prime factors of 397688? 2, 49711 What are the prime factors of 2219785? 5, 109, 4073 List the prime factors of 334940. 2, 5, 16747 List the prime factors of 9074602. 2, 4537301 What are the prime factors of 3287187? 3, 227, 1609 List the prime factors of 894871. 894871 What are the prime factors of 2234051? 47, 47533 What are the prime factors of 3274971? 3, 7, 277, 563 What are the prime factors of 272994? 2, 3, 173, 263 What are the prime factors of 17081183? 7, 1307, 1867 What are the prime factors of 5771250? 2, 3, 5, 19 What are the prime factors of 22189960? 2, 5, 13, 139, 307 List the prime factors of 189512. 2, 23689 What are the prime factors of 196121? 23, 8527 What are the prime factors of 92466? 2, 3, 11, 467 What are the prime factors of 7790713? 7, 1112959 List the prime factors of 859032. 2, 3, 41, 97 What are the prime factors of 1082345? 5, 11, 1789 What are the prime factors of 1011694? 2, 29, 17443 What are the prime factors of 17496643? 47, 372269 List the prime factors of 5846444. 2, 37, 39503 What are the prime factors of 191352? 2, 3, 7, 17, 67 What are the prime	{ "pile_set_name": "DM Mathematics" }
ve of a3/3 - a2 - 2a - 3. Give j(3). 1 Let o(a) = 11a - 6. Let i(w) = 10w - 5. Let p(s) = -6i(s) + 5o(s). What is p(-1)? 5 Let o be ((-16)/(-12))/(4/12). Let q(p) = -p + 5. Give q(o). 1 Let t = -5 + 7. Let q(l) = 1 + 5l*2 + 0l*t + 1 + 5l - 4l2. Calculate q(-3). -4 Let l(h) = -h3 + 10h*2 - h + 14. Let p be l(10). Let f(b) = 3 - b - 6 - p. What is f(-4)? -3 Suppose -n + 4n + 3 = 0. Let c(d) be the third derivative of -d8/5040 - d6/720 - d5/30 - d2. Let z(y) be the third derivative of c(y). Determine z(n). -5 Let j(b) = b*2 - 4b + 1. Suppose 3u + 21 = 4x - 0u, 3x + 4u + 3 = 0. Suppose 2s - f - 13 - 1 = 0, -xs + 5f + 35 = 0. What is j(s)? 6 Let k(p) be the first derivative of 2 + 0p + 1/120p*5 + 1/3p*3 + 0p*2 + 0p*4. Let o(y) be the third derivative of k(y). Determine o(3). 3 Let m(p) = -1 + 5 + 3p*2 - 2p2. Calculate m(-3). 13 Let x(s) = -s2 + 7s. Let i be x(6). Let y(h) = -3 + h + 0h + 6h2 - 5 + h - h3. Determine y(i). 4 Suppose -c + 4 = -1. Suppose 0 = -0p + cp + 25. Let u(s) = s3 + 5s*2 - 5. Give u(p). -5 Let c be (14/56)/((-2)/8). Let n(r) = -12r*3 + 1. Give n(c). 13 Let s(f) = -2f - f*2 - 40 + 6f + 41. What is s(5)? -4 Let p(d) = -d*2 + 2d - 2. Let v(l) = -l + 4. Let r be v(4). Suppose -5g + 10 = -r. What is p(g)? -2 Let p(r) = r3 - 6r*2 + 2r + 3. Let l = 30 + -24. Determine p(l). 15 Let z(k) be the second derivative of 0 + 3k - 1/2k*3 + 1/12k4 - k2. Give z(5). 8 Let u(d) = -3d + 0d - 3d + 1. Let b = -3 + 2. Let x be 1 - (b + 2)0. Give u(x). -5 Let m(y) = -29y2 - 5 + 3 + 24y*2 + 6y - y*3. Let p = 2 - 8. Calculate m(p). -2 Suppose -3a - 6 = 4n, -n + 3n = -2a - 2. Let g(q) = aq - 3q - q + q. Determine g(-1). 1 Suppose -18 = 3s - 9. Let j(p) = p*3 + 4p*2 + 2p - 1. Give j(s). 2 Let t(m) be the third derivative of -1/15m5 - 3m*2 + 0 + 1/120m*6 - 1/24m*4 + 2/3m*3 + 0m. Let d(g) = -2g - 7. Let j be d(-5). What is t(j)? -8 Let y(o) = -6o + 1. Let p be 2/(-8) + 25/20. Let s be (-6)/3 + 2 + p. Determine y(s). -5 Suppose 0 = 2z + 9 - 1. Let j(t) = -7t + 2t - 3t - 1 + 9t. Calculate j(z). -5 Suppose -4 = -5y + 16. Suppose -8h = -11h. Let m(l) = h - y + 2 + 3l. Give m(3). 7 Let v(d) = -d3 - 4d*2 - 3d. Suppose 0 = 2g - 2n - 2, -g - 4n = -3g + 10. Let h = g + -2. Let x(c) = 2c + 7. Let k be x(h). Determine v(k). 0 Let v = -3 + 3. Suppose 0 = -vl - l + 6. Let u(i) = -13i2 - 13i - 2. Let o(g) = -7g2 - 7g - 1. Let f(t) = lu(t) - 11o(t). Determine f(-2). -3 Let w(s) = s*2 - 7s + 3. Let f = -40 - -46. Determine w(f). -3 Let u(p) = -p - 4. Let k be u(-7). Suppose k = 3d - 3. Let l(y) = 3y*2 - 4 - 2y + 3y - dy*2. Calculate l(3). 8 Let l(k) be the third derivative of 1/2k*3 + 1/120k*6 + 0 + 0k + 1/30k5 + 0k4 - k2. What is l(-3)? -6 Let h be (-160)/(-28) + 2/7. Let j be -2 + h + (-2)/2. Let c(p) = -p + 6 - p*j + p. Calculate c(0). 6 Let o(i) be the second derivative of 0 - 1/6i*3 - 3/2i*2 + 3i. Calculate o(3). -6 Let b(z) = -z - 3. Let y(m) = -m - 4. Let x(l) = -4b(l) + 3y(l). Give x(1). 1 Let q(l) be the second derivative of 0 - 2l - 2l*2 + 1/12l*4 + 1/2l*3. Calculate q(-4). 0 Let w = 1 - -1. Suppose i + w = 4. Suppose -i = 2x + 2. Let h(v) = v + 2. Determine h(x). 0 Let z(b) = -b*3 + 3b*2 + 3b + 1. Let j(q) = -2q3 + 5q*2 + 7q + 3. Let r(o) = -2j(o) + 5z(o). Let v be r(5). Let k(p) = -p + 2. Give k(v). -2 Let i(y) = -8y + 4 - 10y + 13y. What is i(3)? -11 Let y(v) = -v2 - 5v - 3. Let n be y(-3). Let d(r) = 2 + r - 3r + 0 - r. What is d(n)? -7 Let a be (-2 - 2)2/(-4). Let c = -3 + a. Let j(f) = -f + 1. Give j(c). 2 Let x = -7 + 3. Let t(k) be the second derivative of -k5/20 - k4/4 + k*3/3 - 8k. Determine t(x). 8 Let z(h) = -h. Let l(r) = -r - 1. Let o(y) = -2l(y) + z(y). Let b be o(-5). Let p(w) = -6 - w3 + 4 - 3w*2 - 4w - 2w2. Determine p(b). -8 Suppose -57 + 21 = -6n. Let y(w) = -w*3 + 7w*2 - 5w - 4. Determine y(n). 2 Let v(w) = 5w2 + w3 - 9w*2 + 4w + 5w3 - 5w3 - 1. Give v(3). 2 Let y(i) be the second derivative of i4/3 + i3/6 - i2/2 + 20i. Calculate y(1). 4 Suppose -10 = 4l - 22. Let x(c) be the first derivative of 1/4c4 - 2/3c*l + 1 - 3/2c*2 - 2c. Give x(3). -2 Let v(q) be the third derivative of q*5/12 - 19q*4/24 - 5q*3/2 - 2q2. Let s(o) = o2 - 5o - 4. Let c(y) = 9s(y) - 2v(y). Give c(-4). 6 Let x(c) = -c. Let b = 10 - 9. Let w(v) = 5v - 4. Let y(g) = bw(g) + 4x(g). Give y(3). -1 Let z(q) = 4q2 + 3q + 2. Let r(w) = -w*2 + 0w + 10w2 + 6w + 5. Let s(o) = -2o - 7. Let v be s(-7). Let g(t) = vz(t) - 3r(t). Give g(-5). 9 Let s be (1 - 0)/(1/2). Let m(t) = s - 4 - 5t*2 + 4t + t3 + t2. What is m(2)? -2 Let a(w) = 3w + 6. Let g(p) = -2p - 3. Let i(o) = -3a(o) - 5g(o). Give i(3). 0 Let w(h) = -5h3 + 2h*2 - 2h + 1. Let l(m) = -6m3 + 3m*2 - 2m + 1. Let p(c) = -2l(c) + 3w(c). What is p(1)? -4 Let l(t) = t*3 - 7t*2 + 5t + 8. Let y be l(6). Let i(p) = 3p2 - 4p + 3. Calculate i(y). 7 Suppose -2l = -3k + 4, 5k + 2l - 6 = 6. Suppose ka - 4 = -2a. Let d(z) = 13z3 - 2z2 + z. Determine d(a). 12 Let f(u) = u2 - 7u + 1. Let p be f(7). Let w(q) = -9q3 + q2 - q. What is w(p)? -9 Suppose 1 = -3z - 2. Let c(u) = u2 + u - 2. Let p be c(-3). Let y(q) = 1 + pq + 5q - 5q. Calculate y(z). -3 Let l = 6 + -10. Let y = 6 + l. Let i(r) = 0 - 3r + 3 - r. Give i(y). -5 Let k(j) be the third derivative of -1/60j*5 + 0 - 1/3j*3 - 4j*2 + 0j - 1/4j4. Determine k(-5). 3 Let w(b) = 3b - 2. Let t(o) = 3o - 14. Let q be t(6). Calculate w(q). 10 Let t(j) be the first derivative of j4/4 + 4j*3/3 - 2j*2 + 6j - 6. Let o(v) = -v - 5. Let s be o(0). Calculate t(s). 1 Let k(g) = 5g2 + g3 + 2g - 11g2 - 6g - 10. What is k(7)? 11 Let j(d) be the second derivative of 0 - 2d + 0d*3 - 3d*2 + 1/12d4. Calculate j(0). -6 Let p(u) be the second derivative of -u5/20 - u4/12 + u3/2 + u*2 + u. Let n(k) = 4k3 - k2. Let g be n(1). Suppose -g = 5b + 7. Give p(b). 0 Let k(r) = -2r*2 - 5r - 4. Let z be (8 - 6)(-9)/6. Give k(z). -7 Let w = -1 + -3. Let z(j) = 3j - 180 - 180 - 171 + 536. Give z(w). -7 Let x(n) = 3n + 5. Let z = -69 + 65. Determine x(z). -7 Let k = 9 - 15. Let m(j) = j3 + 5j*2 - 8j + 1. Give m(k). 13 Suppose -3p = -7p - 24. Let s(b) be the first derivative of -b*4/4 - 7b*3/3 - 2b*2 - 3b - 1. What is s(p)? -15 Let c(z) = -2 + 0 - z + 3. Suppose -4a + 2a + h + 2 = 0, 4a = h + 6. Calculate c(a). -1 Let t(w) be the third derivative of -w4/8 + 17w*2. What is t(2)? -6 Suppose 2g = -4u + 2, 2g - 2u + 7 = -3. Let k(l) = 4 + 0l*2 + 1 + 2l*2 - 2 - 3l + l*3. What is k(g)? 3 Let v be 95/120 + 3/(-4). Let m(w) be the third derivative of 1/120w*6 + 0w + 3w2 + 0 - vw*4 + 1/60w*5 + 0w3. What is m(0)? 0 Let a(u) be the third derivative of u8/6720 + u7/840 - u6/240 + u5/30 - u4/8 + 2u2. Let c(t) be the second derivative of a(t). Determine c(-4). 0 Let a(g) be the second derivative of -g5/20 + g4/4 - g3/6 + g2 - 20g. Determine a(4). -18 Let x(v) = -v. Let j(d) = -d*2 - 5d + 8. Let k be j(-6). Let u(y) = -2 + ky + 3 + 0y. Let a(r) = 2u(r) + 6x(r). Determine a(3). -4 Suppose -5v + 7 = -13. Let p(l) be the first derivative of -l2 + 3l - l*3 + 1/4l*v - 2. What is p(3)? -3 Suppose 3h - 6h - 3 = 0. Let m = -1 - h. Let d(c) = mc3 - c + 1 - c3 - 6. Determine d(0). -5 Let m be (-3)/122(4 - 4). Let g(j) = -j3 + j2 - j - 8. Give g(m). -8 Let c(n) = -n + 5. Let t be 2/((-52)/28 - -2). Determine c(t). -9 Let s = -121 - -123. Let i(j) = -3j2 + 3j - 2 - 2 + 3. Determine i(s). -7 Let w be (3 - 5) + (4 - 1). Let r be (3 + -3)1/w. Let n(h) = 5h*2 - 6h - 4h2 + rh2. Calculate n(5). -5 Let t(p) = p3 - 5p2 + p + 2. Suppose 0d = -2d - 6. Let u = 2 - d. Give t(u). 7 Let g(h) = 12h. Let u(i) = 2i. Let t(f) = 6g(f) - 34u(f). Let p be t(1). Let y(o) be the third derivative of o4/24 + o3/3 - 3o2. Give y(p). 6 Let j(w) = -w3 + w - 1. Suppose 13 = 11i - 9. Give j(i). -7 Let l(y) = 5y*2 + 3y - 4. Let m = -3 - -5. Let n be m-2(3 - 4)	{ "pile_set_name": "DM Mathematics" }
0 = -4i + 4y + 28. Suppose -59 + i = -3u. Does 8 divide u? False Let b = -3 + 6. Suppose bw = t - 4t - 9, -5 = -w. Let c = 17 + t. Does 8 divide c? False Suppose -4c + 9c + 5 = 0, -4r - 3c + 461 = 0. Suppose -6q = -2q + 4w - 244, -5w + r = 2q. Is q a multiple of 23? False Let x(l) = 4l + 5. Suppose 0 = 2c + 3c + 5w, 3c = -5w. Suppose 2y - 6 - 4 = c. Is 15 a factor of x(y)? False Suppose 9t + 152 = 11t. Suppose -3m - 25 = -u - t, 60 = 3m - 4u. Does 5 divide m? False Let i(h) = h*3 - 2h*2 - 2. Is 30 a factor of i(4)? True Let v = -35 + 51. Does 8 divide v? True Suppose 10u - 15 = 5u. Let g be (u - 21)/(3/(-16)). Suppose 2i + i = g. Does 14 divide i? False Let f = 11 - -52. Is 21 a factor of f? True Let s(n) = 2n - 3. Let i be s(4). Suppose 5m - 14 = 3o, -3m + 4m = -io + 14. Let g = m - -5. Does 6 divide g? False Let y = -46 - -68. Is y a multiple of 15? False Let b be (-4)/6 + 250/15. Let x be 1b(3 + -2). Suppose x = -2t - 3g - 2g, 5t + 6 = -4g. Is t a multiple of 2? True Let j(w) = w3 + w2 + 5w + 3. Let x be j(-3). Let g = -6 - x. Is 8 a factor of g? True Let j(g) = -11g2 - 2g + 3. Let q be j(2). Let w = -30 - q. Is 15 a factor of w? True Suppose r = -7 + 27. Is 10 a factor of r? True Let j be 33/12 + (-4)/(-16). Suppose -n + 80 = n - 4d, -n + jd + 44 = 0. Does 7 divide n? False Let o = 5 + -7. Let a(h) = 5h2 - h - 2. Is 20 a factor of a(o)? True Suppose 2u + 3u = 40. Suppose 0 = -4s + 2s + u. Does 12 divide 164/14 - s/(-14)? True Suppose -y - 2y - 3 = 0. Let a be 31/3 - y/(-3). Suppose a = 2j - 3z, 4j - 31 = -4z + 29. Does 10 divide j? False Suppose n - 2n - 5 = 0, 0 = 2u + 2n + 8. Let z(w) = 17w*2 - 1. Does 16 divide z(u)? True Let d(q) = 6q*2 - q. Let b be d(-1). Does 15 divide b/((-7)/2) + 50? False Let m = 0 + 2. Let g(x) = 3x*2 + 5x*2 - 3x*m. Is 5 a factor of g(1)? True Let a = -3 + 11. Suppose 0 = -2v + 6v - a. Is (-3)/(v/((-156)/9)) a multiple of 9? False Is 20/(-8)(-888)/30 a multiple of 16? False Let m(l) = -l*3 - 6l*2 - 5l + 2. Let i be m(-5). Let p(a) = ia + 8a - a + 2. Is 10 a factor of p(3)? False Let z = 3 + 0. Suppose -zy - 35 = -5v, -v + 4y - 10 = -0v. Is v a multiple of 4? False Let o(r) = -120r + 1. Let n be o(-1). Let d = -82 + n. Is d a multiple of 10? False Suppose -36 = -6n + 168. Is n a multiple of 3? False Let i(n) = -2n3 - 6n*2 + 5n - 4. Does 21 divide i(-5)? False Suppose -17 = 3n - 485. Does 14 divide n? False Let g = 6 + -63. Does 28 divide 5 - 4 - (g + 2)? True Suppose -5w = -3f - 346 - 52, -f - 5w = 166. Let m(d) = -6d2 + 8. Let l be m(-4). Let g = l - f. Is 14 a factor of g? False Suppose 5 = -4z + 25. Let u = z - 1. Suppose 144 = 3p + 3f, 0p + up - f = 167. Does 15 divide p? False Let w(d) be the first derivative of -3 - d*2 + 1/3d*3 + 6d. Is w(4) a multiple of 14? True Let a(s) = s*2 + 14s + 7. Is a(-14) a multiple of 2? False Let t(f) = -f*2 - 2f - 10f3 - 1 + 0f*2 - 6f*3. Suppose 4 = -u, -2x - 2u - 5 = -5x. Does 9 divide t(x)? False Let g(m) = -m*3 + m - 3. Let o be g(0). Let h = 2 - o. Suppose 5i - h = 3i - s, i + s = 0. Is 5 a factor of i? True Is 6 a factor of (-8)/(2 - (-28)/(-12))? True Let t(i) = -i3 + 4i*2 - 3i + 6. Let d = -9 - -13. Let p be t(d). Let c(f) = f*3 + 6f*2 - 2f - 5. Is c(p) a multiple of 7? True Let b(a) be the third derivative of a5/60 - a4/6 + 3a3/2 - 9a*2. Is 18 a factor of b(-5)? True Does 9 divide -3(-20)/15 - -86? True Is 16 a factor of (-4 - -44) + 1 + 1? False Suppose -4i = 5l - 2i - 136, 5i = 4l - 89. Let d = l + -10. Does 16 divide d? True Suppose 0x - 35 = -x. Suppose 0 = 5o - x - 0. Is o a multiple of 3? False Suppose z - 4 = 52. Does 56 divide z? True Let z be -1 + -2 + -10 + 17. Suppose -d - 25 = za, 3a - 22 = 3d + 68. Let c = 43 + d. Is c a multiple of 7? True Let n(f) = 5f2 - 3f - 2. Is 8 a factor of n(-2)? True Let p be 3 + 6 + -1 + -3. Suppose 0s = s - 3. Suppose sr - 2m - m - 30 = 0, -pr = 5m - 90. Is r a multiple of 14? True Suppose -3l + 8 = -l. Is 2 a factor of -2(-6)/(-1 + l)? True Let z(c) = c2 - 7c - 7. Let y be z(7). Let w = y - -12. Suppose -ws + s + 64 = 0. Does 15 divide s? False Suppose 2z + 0z = -5g - 25, -3g = -4z + 15. Suppose -4x = -24 - z. Is x a multiple of 2? True Suppose 2 - 6 = 4l + 2c, 5l - c = -5. Does 14 divide l - -69 - (-12)/6? True Suppose -2f - x + 64 = -3x, -x = 4. Is f a multiple of 23? False Let o = 10 + -1. Is 5 a factor of (o - 3)(-20)/(-6)? True Let q(f) = 90f*2 - 5f - 4. Is 20 a factor of q(-1)? False Let f(i) = -5i3 - i2 - 8i - 7. Is 13 a factor of f(-3)? True Let u be (-3)/4 + 42/(-8). Let g(p) = p*2 + 6p + 6. Is 3 a factor of g(u)? True Let i(z) = 3z3 + 3z*2 - 6z + 6. Does 16 divide i(3)? True Let g be (45/4)/(18/(-48)). Does 6 divide 4/(-6) - 890/g? False Suppose 0 = 5g + 4f - 426, 3g - 87 = 2g + f. Suppose -g = -x - x. Is x a multiple of 15? False Let s be 0/(-2) - 1 - -33. Let q = s + -7. Is 9 a factor of q? False Let n(q) = -2q + 1. Let r be 0 - ((-6)/2 + 1). Let g be (3/r)/(3/(-12)). Does 9 divide n(g)? False Suppose -5z = -3v + 115 - 10, -140 = -4v - 3z. Is v a multiple of 9? False Let i(r) = 2r*2 + 8r - 5. Let h = 2 + -9. Does 15 divide i(h)? False Let c = -51 - -73. Suppose c = -4u + 90. Is u a multiple of 14? False Let o(p) = p - 1. Is o(11) a multiple of 9? False Suppose 2k = -3k + 160. Does 5 divide k? False Suppose 580 = 4b + 2v, -3b - 4v + 440 = -0v. Is b a multiple of 24? True Let j(u) = -45u + 2. Does 8 divide j(-1)? False Suppose -127 + 17 = -v. Is v a multiple of 11? True Suppose 0 = 3u - 361 + 52. Does 23 divide u? False Is 14 a factor of (-6)/(-6)(0 + 74)? False Let z(i) = -i2 - 33i - 22. Is 20 a factor of z(-26)? True Suppose 13 = 2p + 3. Let i(n) = -n3 - 7n*2 + n + 9. Let k be i(-7). Suppose -4 = kt, -4x - t + 184 = -pt. Is 22 a factor of x? True Suppose 3o = 11 + 1. Suppose -i + oa = 4, 0 = -i + 3a - 3 - 0. Suppose z + 4z - 200 = i. Does 16 divide z? False Let y(z) = 28z - 32. Is y(4) a multiple of 8? True Let m = 333 - 36. Is 33 a factor of m? True Does 16 divide (-2 - -1) + (74 - 1)? False Suppose 106 = 4h - 94. Does 8 divide h? False Let c be 8/(-12)12-15. Does 12 divide (c/9 + -2)3? False Does 7 divide 3/5 + 24/1021? False Let h be 68/14 + 5/35. Suppose j + 64 = hj. Is j a multiple of 9? False Suppose 8x = 4x + 8. Let s(b) = -b2 - bx - 1 - b2 + 5b*2 - 4b. Does 10 divide s(5)? False Is 24 a factor of 12(12/15 + -2)-5? True Let s(j) = 4j + 6. Does 6 divide s(5)? False Suppose -2n + 11 = 115. Let a = 23 + -31. Let q = a - n. Is 22 a factor of q? True Let d = 0 - 0. Let i = d - -1. Let c = 9 - i. Is c a multiple of 6? False Let f = 50 - -60. Suppose 3t = 4w - 72, 4t + 10 = -4w + f. Let h = w - 8. Is h a multiple of 13? True Let h be (0 + 10)7/(-14). Let i(n) = 4 - n2 - n2 + n3 - n + 7n*2. Is i(h) a multiple of 9? True Suppose -5l - 15 = -5t, -t + 4l + 6 = -0t. Suppose -31 = -2y + s, -2y - 30 = -4y + ts. Suppose -4n - y = -228. Does 18 divide n? False Let j(x) = -8x + 1. Suppose 4c = 8 - 0. Let t be -2c/(-2 + 4). Is j(t) a multiple of 6? False Let f = 10 - 8. Suppose -f = z - 4b + 3, 20 = 4b. Is z a multiple of 15? True Let u(g) = g2 - 4. Suppose l - 15 = -2l. Let q be u(l). Suppose 4h - 75 = -2r - q, 2h + 88 = 4r. Is 8 a factor of r? False Suppose -2k = -0k. Let q = -4 - -7. Suppose qs = 12, k = 2y + 2y - 2s - 148. Does 19 divide y? False Let p = 11 + -22. Let j = p - -30. Suppose -u + 4w + 17 = -j, -2u + 69 = -5w. Is 12 a factor of u? False Let n = 347 - 247. Does 31 divide n? False Let q = 6 + 4. Suppose -5j - 4p + q = 0, p - 6 = -3j - 0p. Suppose 12 = jz - 4. Is z a multiple of 4? True Let q = 25 + 25. Is 5 a factor of q? True Suppose -2j = -0j - 5i - 8, -5j = -i + 3. Let w be 54(j + (-3)/(-9)). Does 10 divide ((-6)/4)/(2/w)? False Suppose 0v = 5v. Does 15 divide 0 + 19 + -4 + v? True Suppose -3a - 3 + 63 = 0. Is a a multiple of 6? False Suppose -3v + 5v = 50. Does 15 divide v? False Let p be 444/10 + 4/(-10). Suppose -2z + 74 = 4k, -z - p = -k - 18. Is k a multiple of 14? False Let	{ "pile_set_name": "DM Mathematics" }
actor y(q). -2(q + 1)(25q + 1)/5 Let s(t) be the first derivative of t5/5 + 15t*4/2 - 67t*3/3 - 48t*2 - 4329. Determine k so that s(k) = 0. -32, -1, 0, 3 Let r(b) = -17b*3 - 45b*2 - 42b - 4. Let z be 132/88(-2 + (-4)/(-6)). Let m(w) = -35w*3 - 89w*2 - 87w - 8. Let h(x) = zm(x) + 5r(x). Factor h(a). -(a + 1)(a + 2)(15a + 2) Let b(i) = 8563i - 25687. Let y be b(3). Factor -15/2r - 6r*y - 3/2r*3 - 3. -3(r + 1)*2(r + 2)/2 Let b(s) be the second derivative of 17s + 13/36s*4 - 4 + 5/2s*2 + 29/18s*3 - 1/60s5. Find d, given that b(d) = 0. -1, 15 Let v(c) be the third derivative of -c5/12 - 12445c4/12 - 30975605c*3/6 - 340c*2 - 2c - 1. Determine g, given that v(g) = 0. -2489 Let w = -232939/4 + 58236. Solve 15 + 25t - 45/4t*3 + wt*2 + 5/4t*5 - 5/4t*4 = 0 for t. -2, -1, 2, 3 Let o(u) = -2u*2 - 66u + 70. Let v be o(-34). Determine i so that 0 + 2iv + i4 - 9i3 + i2 + 0 + 5i3 = 0. 0, 1, 3 Factor 1/6n*3 - 6n*2 - 45 + 63/2n. (n - 30)(n - 3)2/6 Let c(n) be the second derivative of -n7/8820 - n6/2520 + n5/210 + 31n4/12 + n3/6 - 107n + 1. Let d(s) be the third derivative of c(s). Factor d(t). -2(t - 1)(t + 2)/7 Factor 0i - 2/9i4 + 0i*2 + 380/9i*3 + 0. -2i*3(i - 190)/9 Let s(j) = 5j4 + j3 - j2 - 1. Let r(y) = -4y*4 + 220y*3 + 369y*2 + 8. Let b(o) = 5r(o) + 40s(o). Factor b(t). 5t*2(6t + 19)2 Let l = -919036 + 919041. Let 64/5 - 44/5o*2 - 4o*4 - 2/5o*l + 64/5o - 62/5o3 = 0. Calculate o. -4, -2, -1, 1 Let 64 - 310/7t*2 - 8/7t*3 - 1714/7t = 0. Calculate t. -32, -7, 1/4 Let h be (-6 + (-11288)/(-1870))/(8/280). Determine n, given that 2/11n3 + 14/11 - 2/11n - hn2 = 0. -1, 1, 7 Let d(o) be the second derivative of 10/3o*4 + 0o*2 + 4/5o*6 + 30 - 2/21o*7 - 2o*3 - 12/5o*5 + 2o. Determine g so that d(g) = 0. 0, 1, 3 Let w(f) be the second derivative of -f*7/21 + 154f*6/5 - 70209f*5/10 + 560430f*4 + 7373808f*3 + 34167744f*2 + f + 8. Factor w(s). -2(s - 156)*3(s + 3)*2 Suppose -6 = 3t, -7u + 4u = -5t - 7. Let m be (-3)/(u/230)4. Find n, given that -36/5n - 3n4 - 82/5n*3 + 28/5n*5 + m + 101/5n*2 = 0. -2, 1/4, 2/7, 1 Let b(k) be the first derivative of 36/7k*2 + 216/7k + 6/35k5 - 22/7k*3 + 16 - 3/7k*4. Factor b(p). 6(p - 3)*2(p + 2)*2/7 Let o be (-128)/(-28) - (-28)/(-49). Factor -115d*4 + 4d*5 - 1061d*2 + 985d3 - do - 89d3 + 277d*2. 4d*2(d - 14)*2(d - 1) Suppose 0 = -12q + 80 - 92. Let l be ((-14)/(-12) - q) + 10/(-20). Solve -7/3s - 2/3 - ls3 - 1/3s*4 - 3s2 = 0 for s. -2, -1 Let n(q) = q3 - 30q2 - 259q + 24. Let v be n(-7). Let i(c) be the third derivative of vc2 + 0c - 25/16c3 - 5/32c*4 - 1/160c*5 + 0. Factor i(t). -3(t + 5)*2/8 Let t(z) = -40z + 40. Let g be t(1). Let h(f) be the first derivative of 6f5 + 0f + gf2 + 9 - 4f*4 + 2/3f3. Find m, given that h(m) = 0. 0, 1/5, 1/3 Let p(v) = v2 + 25v + 56. Let f be p(-23). Factor -22k + 12 + 0k - fk - 30k3 + 35k*3 + 3k*2. (k - 2)(k + 3)(5k - 2) Factor 4u3 + 1400895u + 226951 + 312785 - 3131836 + 6436u2 + 1184765u. 4(u - 1)(u + 805)*2 Let k be 3 + -3 + 31. Suppose -352 - 512 = -32s. Suppose 13l + kl2 - 20l*2 + 32 + 5l*2 + sl = 0. Calculate l. -2/3, 4 Factor 0 - 33/2w + 1/2w*3 + 4w*2. w(w - 3)(w + 11)/2 Let v = -536 + 1609/3. Let y(z) be the second derivative of -z2 - 1/10z*5 + 0 - 8z + 1/6z4 + vz*3. Factor y(u). -2(u - 1)*2(u + 1) Let z(j) = 16j2 - 214j - 464. Let u(c) = -5c2 + 71c + 154. Let t(y) = -7u(y) - 2z(y). Factor t(x). 3(x - 25)(x + 2) Let r(s) be the second derivative of s*6/10 + 603s*5/20 + 247s*4 + 786s*3 + 1176s*2 - 2s - 240. Find k such that r(k) = 0. -196, -2, -1 Suppose 785i = 58i. Factor -9f2 + i - 24f + 3/2f3. 3f(f - 8)(f + 2)/2 Let l be (-180)/(-22) + (-18)/99. Let w be 2/l168/210. Factor 0 - 1/5o*2 - wo. -o(o + 1)/5 Factor 152/3 + 26z + 1/3z2. (z + 2)(z + 76)/3 Let l(n) be the third derivative of 5/54n4 + 2n + 21n2 + 0n*3 + 0 - 1/30n5. Find h, given that l(h) = 0. 0, 10/9 Let p(c) be the third derivative of -c5/54 - 257c4/36 + 620c*3/27 + 2c*2 - 51c + 2. Factor p(r). -2(r + 155)(5r - 4)/9 Suppose 90j2 + j3 + 3243 - 103j - 857j - 8j3 - 1163 + 12j*3 = 0. What is j? -26, 4 Let o(i) be the second derivative of 2i*3 + 31i - 1/5i5 - 1/6i*4 + 1/30i*6 + 0 + 9/2i2. Factor o(y). (y - 3)2(y + 1)2 Suppose -18k - 186/23k3 + 324/23 - 914/23k*2 - 10/23k*4 = 0. Calculate k. -9, -1, 2/5 Let f(j) be the third derivative of -1/80j*5 + 2 + 0j*3 + 3/32j*4 - 41j*2 + 0j. Find q such that f(q) = 0. 0, 3 Factor 350r - 89/4r*2 + 6875 + 1/4r3. (r - 50)2(r + 11)/4 Let u(p) be the third derivative of 1/100p*5 + 14p*2 + 441/10p*3 + 0 - 21/20p*4 + 0p. Factor u(k). 3(k - 21)2/5 Let o(k) be the second derivative of -3k*5/20 - 215k*4/4 - 427k*3/2 - 639k*2/2 + 1266k. Factor o(r). -3(r + 1)2(r + 213) Suppose 0 - 1/4d3 - 18225d - 135d2 = 0. Calculate d. -270, 0 Let n be (-6)/(-6)(-3 + 3)-1. Let a(u) be the second derivative of -1/3u*4 + 14u + nu3 + 0 + 0u*2. Factor a(b). -4b2 Let w(a) be the second derivative of -a4/32 - 905a3/8 - 2457075a*2/16 + 7394a. Determine o, given that w(o) = 0. -905 Let u(w) be the second derivative of -16w3 + 39 + 13/3w*4 - w - 8w*2. Suppose u(d) = 0. Calculate d. -2/13, 2 Let k(u) be the third derivative of 0 - 23/48u*4 + 0u - 13/120u5 - 77u*2 - 11/12u*3 - 1/240u6. Factor k(r). -(r + 1)2(r + 11)/2 Let g(t) be the second derivative of t4/4 - 231t*3 + 160083t*2/2 - 152t + 1. Factor g(o). 3(o - 231)2 Let j(u) = 2u*2 + 13u - 22. Let d be j(-8). Solve -120c3 - 50c*2 + 0c*d + 34c*4 - 13c - 5c5 + 138c + 16c4 = 0 for c. -1, 0, 1, 5 Let r = 150391 + -150389. Factor 1/2b*5 + r - 1/2b*3 + 11/2b*2 - 3/2b*4 - 6b. (b - 2)(b - 1)3(b + 2)/2 Suppose -111 + 273 = 6h. Suppose 79 + 29 = hy. Find d such that -4/3d5 - 4/3d*y + 0d*2 + 0 + 8/3d*3 + 0d = 0. -2, 0, 1 Factor -553 + 1105/2s + 1/2s*2. (s - 1)(s + 1106)/2 Let -10f4 - 5 + 417f - 25f3 - 5f*4 - 392f + 15 + 5f4 = 0. Calculate f. -2, -1, -1/2, 1 Let x = 8407/40 + -1675/8. Factor xo*4 + 0 + 2/5o*3 - 2/5o*2 + 0o. 2o2(o + 1)(2o - 1)/5 Let j be -95 - -77 - (8 + -28 + 2). Factor 6/13m3 + 4/13m*2 + j + 0m - 10/13m4. -2m*2(m - 1)(5m + 2)/13 Suppose -5y - 3713 + 3733 = 0. Let g(i) be the second derivative of -1/6i*3 - 1/10i5 + i2 + 0 + 3i - 5/12i*y. Factor g(j). -(j + 1)(j + 2)(2j - 1) Let w(g) be the first derivative of -188 + 0g - 1/30g*6 + 0g*3 + 0g*2 + 6/25g*5 + 7/20g4. Factor w(x). -x3(x - 7)(x + 1)/5 Let t be ((-444)/1036)/(4/98)12/(-63). Find f, given that 16/7f - 2/7f5 + 0 - 8/7f*4 + 4f*t + 6/7f*3 = 0. -4, -1, 0, 2 Let l(j) = 4j*3 + 126 - 5j*3 - 125 + 3j*2 - 11j. Let r(o) = 4o3 - 9o*2 + 34o - 1. Let n(v) = 21l(v) + 6r(v). Find d, given that n(d) = 0. -5, 1 Find a, given that 32/11a4 + 148/11a*3 + 40/11 + 158/11a + 232/11a2 - 2/11a*5 = 0. -1, 20 Let j(g) = -g + 5. Let f be j(3). Let a(p) = -3p*2 - 26p + 23. Let l be a(-9). Factor lq + 8 - 22q*f + 15q + 11q. -2(q - 2)(11q + 2) Suppose -10 = -11l + 6l. Let v = -550 - -552. Factor -12 + 0q + 32q - 7qv + 4q*4 + 2q*2 - 19q*l. 4(q - 1)*3(q + 3) Let g(k) be the third derivative of 5/9k3 + 0 - 101k*2 + 0k - 1/72k6 + 1/10k*5 + 11/24k*4. Factor g(j). -(j - 5)(j + 1)(5j + 2)/3 Let 75/4g3 + 3/4g*4 - 186 - 261/2g*2 + 273g = 0. Calculate g. -31, 2 Suppose 24c = 26c - 54. Suppose -32l = -cl - 25. Find r such that -4r2 - 6r - 6 + 2r2 + lr*2 - 3 = 0. -1, 3 Find i, given that -42/11i - 2/11i2 - 108/11 = 0. -18, -3 Factor 85d*2 + 171066d*4 - 171070d*4 + 35d*2 - 4d*3. -4d*2(d - 5)(d + 6) Let m be 9 - 1204/77 - -7. Factor 2/11i*4 - mi*2 + 2/11i*3 + 0 + 0i. 2i2(i - 1)(i + 2)/11 Let c(z) be the first derivative of -2z*3/3 - 3966z*2 - 7864578z - 9429. Factor c(y). -2*(	{ "pile_set_name": "DM Mathematics" }
in micrometers? 300 How many millilitres are there in ninety-one halves of a litre? 45500 What is 7/8 of a kilometer in meters? 875 How many kilograms are there in 3/40 of a tonne? 75 How many grams are there in 0.4140657 kilograms? 414.0657 How many milliseconds are there in 0.786853 days? 67984099.2 What is thirty-four fifths of a litre in millilitres? 6800 What is fifty-three fifths of a century in years? 1060 How many milligrams are there in 49/5 of a gram? 9800 What is 930.5693 centuries in months? 1116683.16 How many nanometers are there in thirty-two fifths of a micrometer? 6400 How many millilitres are there in eighteen fifths of a litre? 3600 How many months are there in twenty-nine thirds of a year? 116 How many kilograms are there in 686477.8t? 686477800 How many centimeters are there in 7/2 of a meter? 350 Convert 10.15051mm to kilometers. 0.00001015051 What is eleven halves of a tonne in kilograms? 5500 What is 62815.9ml in litres? 62.8159 How many decades are there in twenty-six fifths of a century? 52 How many centimeters are there in 4560.609km? 456060900 What is eleven halves of a day in minutes? 7920 What is twenty-five quarters of a tonne in kilograms? 6250 Convert 27.88678 millennia to decades. 2788.678 How many litres are there in 38992.92 millilitres? 38.99292 What is 3/25 of a litre in millilitres? 120 What is five eighths of a micrometer in nanometers? 625 Convert 37.52743 hours to minutes. 2251.6458 How many kilometers are there in 988.9233 meters? 0.9889233 How many micrograms are there in 0.9840496 milligrams? 984.0496 Convert 66.14336 micrograms to nanograms. 66143.36 What is 392969.1 months in decades? 3274.7425 What is 4762.406m in kilometers? 4.762406 What is 0.4348684t in micrograms? 434868400000 What is 7/8 of a tonne in kilograms? 875 How many weeks are there in 12425.6307 hours? 73.9620875 How many millimeters are there in three fifths of a meter? 600 Convert 724931.2 millilitres to litres. 724.9312 How many microseconds are there in 3/25 of a millisecond? 120 How many seconds are there in 0.0101946 nanoseconds? 0.0000000000101946 How many millilitres are there in 3/8 of a litre? 375 What is seven quarters of a millisecond in microseconds? 1750 What is 977.6112 nanometers in millimeters? 0.0009776112 What is 4.056767 micrograms in kilograms? 0.000000004056767 What is 0.7778102 kilometers in nanometers? 777810200000 What is 9.893975t in milligrams? 9893975000 Convert 0.4536716 micrometers to millimeters. 0.0004536716 How many millilitres are there in 5.249924 litres? 5249.924 How many years are there in 1/4 of a millennium? 250 How many millilitres are there in twenty-one fifths of a litre? 4200 Convert 26.12151 litres to millilitres. 26121.51 How many micrograms are there in 34/5 of a milligram? 6800 How many nanograms are there in fourty-four fifths of a microgram? 8800 What is 21/2 of a millimeter in micrometers? 10500 What is 8.416261 tonnes in kilograms? 8416.261 Convert 75882.57 micrograms to grams. 0.07588257 How many microseconds are there in six fifths of a millisecond? 1200 How many hours are there in eight thirds of a week? 448 What is 19/4 of a year in months? 57 How many seconds are there in sixty-two ninths of a hour? 24800 How many micrometers are there in 87.68376km? 87683760000 Convert 32739.82ug to milligrams. 32.73982 What is 5.283793kg in nanograms? 5283793000000 How many microseconds are there in 0.1609907 days? 13909596480 What is 49/4 of a year in months? 147 How many minutes are there in 29/6 of a week? 48720 How many months are there in 9/10 of a millennium? 10800 What is seven sixths of a week in hours? 196 How many tonnes are there in 562970.6 micrograms? 0.0000005629706 Convert 0.0015727 micrometers to centimeters. 0.00000015727 Convert 2541.34 grams to tonnes. 0.00254134 What is 11/2 of a millimeter in micrometers? 5500 How many hours are there in seven quarters of a day? 42 Convert 3893.822ml to litres. 3.893822 What is 21/8 of a day in minutes? 3780 Convert 13.54366 decades to months. 1625.2392 What is twenty-one fifths of a milligram in micrograms? 4200 What is 757647.5ml in litres? 757.6475 What is 0.067035 centuries in millennia? 0.0067035 Convert 0.0558642 months to decades. 0.000465535 Convert 478300.9 minutes to microseconds. 28698054000000 How many millilitres are there in five quarters of a litre? 1250 How many minutes are there in 1/60 of a hour? 1 Convert 968151.3km to nanometers. 968151300000000000 What is 91950.03g in kilograms? 91.95003 What is eleven halves of a tonne in kilograms? 5500 How many centuries are there in 55581.6 millennia? 555816 What is 56024.58 milligrams in kilograms? 0.05602458 How many milliseconds are there in 69.84603 minutes? 4190761.8 What is 1/5 of a century in months? 240 How many nanograms are there in five eighths of a microgram? 625 Convert 21790.19 decades to months. 2614822.8 How many millilitres are there in one twentieth of a litre? 50 What is three eighths of a gram in milligrams? 375 What is 3/28 of a week in seconds? 64800 What is 18/5 of a litre in millilitres? 3600 Convert 7.794653 millilitres to litres. 0.007794653 What is 4.934304 litres in millilitres? 4934.304 How many years are there in three fifths of a decade? 6 How many seconds are there in thirteen quarters of a hour? 11700 What is three tenths of a day in seconds? 25920 What is 927.1546g in tonnes? 0.0009271546 Convert 9.763065km to meters. 9763.065 How many millilitres are there in 7/2 of a litre? 3500 How many grams are there in twenty-five quarters of a kilogram? 6250 What is 3/8 of a kilogram in grams? 375 What is 810.0937 millimeters in kilometers? 0.0008100937 Convert 401.4252 years to millennia. 0.4014252 Convert 0.733148 meters to kilometers. 0.000733148 How many years are there in 349638.4 decades? 3496384 Convert 0.4653405 kilograms to tonnes. 0.0004653405 What is 1/5 of a day in minutes? 288 What is 3590.607us in nanoseconds? 3590607 What is 66.21655 nanometers in micrometers? 0.06621655 How many millilitres are there in 12/25 of a litre? 480 Convert 975.0925kg to milligrams. 975092500 How many millennia are there in 7.29811 years? 0.00729811 What is seven eighths of a millisecond in microseconds? 875 What is thirty-four fifths of a milligram in micrograms? 6800 Convert 0.7947282ng to kilograms. 0.0000000000007947282 What is 6/5 of a millimeter in micrometers? 1200 What is one fifteenth of a decade in months? 8 How many minutes are there in seven sixteenths of a day? 630 What is 1/10 of a kilogram in milligrams? 100000 How many micrograms are there in one fifth of a milligram? 200 Convert 0.6678531 nanograms to tonnes. 0.0000000000000006678531 Convert 49.60902 millimeters to nanometers. 49609020 What is 37/2 of a week in hours? 3108 Convert 430.6051 decades to millennia. 4.306051 What is 26.33014 centuries in decades? 263.3014 Convert 9.574081kg to milligrams. 9574081 How many micrometers are there in seven eighths of a centimeter? 8750 How many decades are there in 24249.34 centuries? 242493.4 How many days are there in 3862.521 minutes? 2.68230625 How many years are there in 23161.929 months? 1930.16075 How many centuries are there in 1090.564 millennia? 10905.64 What is 5684.891 days in seconds? 491174582.4 What is 21/4 of a kilogram in grams? 5250 What is 13/5 of a microsecond in nanoseconds? 2600 What is 703148.4 decades in years? 7031484 What is five quarters of a second in milliseconds? 1250 What is thirteen quarters of a gram in milligrams? 3250 How many tonnes are there in 0.6155525 milligrams? 0.0000000006155525 How many grams are there in five quarters of a kilogram? 1250 What is five eighths of a litre in millilitres? 625 How many kilograms are there in thirteen quarters of a tonne? 3250 How many millimeters are there in three fifths of a centimeter? 6 How many litres are there in 0.3512982ml? 0.0003512982 What is 1828.453 kilometers in millimeters? 1828453000 How many milliseconds are there in 651662.9 days? 56303674560000 Convert 44017.6 kilometers to centimeters. 4401760000 How many millilitres are there in 3/40 of a litre? 75 Convert 36141.44kg to milligrams. 36141440000 What is 25/2 of a minute in seconds? 750 What is 19.390221 months in	{ "pile_set_name": "DM Mathematics" }
60)) 10 10 + -8 - (8 + 3) -9 What is (9 - 9) + (-1 - 2 - 3)? -6 Calculate 6 + -10 + 4 + 0. 0 What is (10 - 1) + -24 + 19 + 6? 10 2 + 5 + -4 - 3 0 1 - (-15 + 11) - 7 -2 Calculate 0 + (-7 - -8) + 6. 7 Calculate -2 + 1 + 11 + -4. 6 What is the value of (-1 - -5) + 0 + -1 + 0? 3 Calculate -1 - 3 - (-4 + -2 - -3). -1 (-5 - (0 - (-5 + 5))) + -2 -7 Evaluate 0 + -6 - (1 + 1). -8 Calculate (-2 - 1) + 4 - 2. -1 Evaluate 3 + -5 - (-4 + 0 + -3). 5 4 + 0 - (20 - 16) 0 11 + (9 - 9) - 14 -3 What is the value of (9 - 3) + (0 - 5)? 1 Calculate (0 - 4) + 28 + -24. 0 What is the value of (5 - 5) + (-1 - -1)? 0 Evaluate -6 - -2 - ((-4 - -2) + 1). -3 Evaluate 1 - (-3 + (2 - 0)). 2 What is the value of -3 + 0 + -2 + (2 - -1)? -2 9 + -9 + -4 + -1 -5 What is the value of (6 - (11 - 1)) + 6? 2 Evaluate 6 + -1 + -3 + -5. -3 What is 0 - (-3 + 5 + -3)? 1 Calculate -2 + 6 + (-3 - 1). 0 What is the value of -2 + 0 + -11 + 13? 0 0 - (-7 - (-7 - (2 + -4))) 2 Calculate -5 - (1 + 1 + 0) - 1. -8 What is (-16 - (-13 - -5 - 1)) + 17? 10 What is (0 - 2) + (34 - 32)? 0 What is the value of -7 - (-7 + (8 - 10))? 2 What is the value of 9 + -9 + (-12 - -6)? -6 Evaluate 5 + (-12 + 5 - (5 - 11)). 4 What is 6 - 3 - (0 + 5)? -2 Calculate 6 - -3 - 21 - -6. -6 What is the value of 1 + (-4 - -2) + -3? -4 What is the value of (47 - 45) + 4 + -2? 4 Calculate 3 + (5 - 5) - 7. -4 Evaluate (-13 - 1) + 0 - -19. 5 What is the value of -3 - (-9 - -1) - 5? 0 What is the value of 1 + -9 - (3 + -19)? 8 Calculate 1 - 1 - (69 + -72) - 11. -8 What is -6 + 2 + 2 + 0 + 1? -1 What is the value of 6 + (13 - 19) + (-4 - -1)? -3 (12 - 17) + 14 - 17 -8 Evaluate 0 + (8 + 0 - (3 + 1)). 4 Evaluate (-3 - -2) + 0 - (13 + -13). -1 What is -6 + 2 + 3 + 1? 0 Evaluate (-3 - 0) + (43 - 36) - -2. 6 What is the value of (0 - -9) + -17 + 1? -7 What is 1 + 0 + (4 - (0 - -2))? 3 Calculate -2 + -1 + (1 - (-4 - -3)). -1 What is 2 + (4 + -15 - -4)? -5 Evaluate 0 + 0 + -2 + -3. -5 What is 4 + 2 + -11 - -10? 5 Evaluate (8 - -1) + (-2 - (4 - 4)). 7 What is the value of 5 - (5 - 3) - -2? 5 Evaluate (4 - 5 - -5) + 1. 5 Evaluate -5 + 10 + 2 + -3. 4 What is the value of 9 + -3 - (-17 + 33)? -10 What is (-2 - -2) + 1 - -4? 5 Evaluate -7 - 1 - -1 - -2 - -5. 0 What is 0 + (9 - 6) - (3 - 0)? 0 Evaluate 13 + -9 + -4 - (1 + -1). 0 -9 + (3 + 6 - 1) -1 Calculate 1 + -9 + 1 + 0. -7 Evaluate -1 - (-3 + -4 + 12 + -3). -3 -5 + 4 - (0 + -7 + 2) 4 Evaluate (-3 - -1) + 7 + -3. 2 What is (-4 - -2) + (1 - -2)? 1 7 - (-1 + 3 + 3) 2 Calculate 1 - (8 - (-4 - -5)). -6 Evaluate (2 - 13) + 15 - 2. 2 (-28 - -35) + -3 + 2 6 Calculate 8 - 3 - (-13 + (8 - 0)). 10 0 + -3 + 12 + -8 1 What is the value of (1 - 2) + -4 + -2? -7 -14 - -7 - -8 - 6 -5 What is 17 + (8 - 9) + -9? 7 2 + -17 - -6 - (7 - 7) -9 Evaluate -3 - -5 - (8 + (2 - 9)). 1 What is the value of 7 - (4 + 3 - -4)? -4 3 + 1 + 3 + -4 3 7 - ((6 - 6) + 2) - 5 0 What is the value of (0 - 8) + 274 + -264? 2 Evaluate 7 + (-4 + -5 - 0). -2 Calculate -7 + 12 + -10 + 4 - 3. -4 Evaluate 1 - -2 - 9 - -3 - -5. 2 Evaluate 25 + -26 - (0 + (3 - 0)). -4 Evaluate ((-3 - -21) + -3 - 7) + -7. 1 1 + -4 - (2 - 6 - 3) 4 -2 - (-12 - (-14 - -5)) 1 4 - (8 + 4 + -9) - -4 5 Evaluate 7 + -7 + 6 + -8. -2 What is 17 - 15 - (0 + (-3 - -2))? 3 Calculate 0 + 2 - ((-9 - -2) + 4). 5 What is (0 + 3 - 6) + -4 + 8? 1 Calculate 6 + 4 - (0 + 6). 4 Calculate -9 + (-4 - -2) + 4 + 3. -4 Calculate -11 + 5 + 0 + 2. -4 Evaluate (-4 + 12 - -1) + -6. 3 Calculate -1 + -6 + 3 + 9. 5 3 + (2 - -1 - 7) -1 7 + -15 + 4 - -4 0 What is the value of 0 + -4 - (-3 - -1)? -2 Calculate 6 + -4 + 0 + 1. 3 Calculate (-32 - -37) + (-5 - -1) + 4. 5 1 + 1 + -2 + 4 4 What is 10 + 1 + -1 + (215 - 220)? 5 Calculate -1 + 1 - (9 + -7). -2 Calculate (-27 - -4 - -22) + -4 + -1. -6 -2 + (0 - (-3 - 3)) 4 Calculate (6 - -1) + 7 + -10 + -4. 0 Calculate 6 + -1 + -5 - 5 - -1. -4 Calculate 2 - (10 - (-15 + 25)). 2 Calculate 5 + (1 - 4) + (0 - -4). 6 What is (-17 - -15 - -10) + -5? 3 Evaluate 5 - 10 - ((2 - 17) + 7). 3 What is -4 + 9 + -8 + 2 + 4? 3 What is the value of 4 + (7 - (0 + 3)) - 4? 4 What is the value of 1 + -1 + (-14 - -12)? -2 What is the value of -42 + 41 - (0 + -2 + 5)? -4 Calculate -4 - 1 - (3 - (-3 - -12)). 1 What is the value of -1 + 5 + (-1 - 1) + -1? 1 What is the value of (4 - 7 - -1) + 2? 0 Evaluate 6 + -6 - (-1 - 2). 3 What is the value of -3 - (2 + 2 + (0 - 11))? 4 0 - -2 - (26 - 16 - 15) 7 81 + -86 + (2 + -1 - -3) -1 Calculate 11 + (-1 - 3) + (-33 - -31). 5 What is -1 + -4 + 1 - -9? 5 What is the value of 3 + -5 + 0 + (-14 - -15)? -1 What is -3 + 1 + -5 - -3 - -2? -2 (-4 - (3 - 11)) + (-4 - -2) 2 Evaluate 2 + -1 + -7 + 11. 5 Evaluate 0 + (1 - 3) - (7 + -5). -4 What is the value of -4 - (-6 + -5 + 4 + -2)? 5 Evaluate (-7 - -3 - 0) + 6. 2 Evaluate -3 - -4 - (4 + -1). -2 What is 3 + -2 - (0 + -4)? 5 What is -1 + (-22 - -16 - (-9 - -2))? 0 (3 - 7) + 8 + (-1 - 0) 3 Evaluate (5 - 2) + (-8 - -5). 0 Calculate -2 - (1 + -9 + 4). 2 Evaluate 0 + (4 - (4 + -3)) - 7. -4 9 - (10 + 6 + -1) -6 Evaluate -6 - (-6 - -3) - -7. 4 What is the value of 6 + (-10 - -3) - -4? 3 What is the value of 16 + 5 + (4 + -20 - -3)? 8 What is the value of (11 - 0) + -72 + 54? -7 Calculate 1 + (-11 - -6) - (-2 + 2). -4 Evaluate 0 - 0 - (4 - (3 - -1)). 0 What is the value of 0 + (0 - -3) + -4? -1 What is the value of 3 + (-13 - -4) + 2? -4 What is the value of 8 + (-1 - -1 - (20 - 4))? -8 Evaluate (2 - 4 - (-4 - 0)) + -1. 1 -8 + (-10 - -7) - (-8 - -7) -10 What is the value of -2 + -6 - (-44 - -42)? -6 What is 12 + (-22 - (0 + -7))? -3 Evaluate (-7 + 0 - -3) + 8. 4 Evaluate (-2 - 2) + (22 - 12) + -3. 3 Calculate (1 - 0) + (0 - (4 - 3)). 0 Evaluate -1 + -3 - (5 - 2) - -16. 9 What is the value of 22 + -21 - (4 + 1)? -4 -2 - (0 - (-5 + 0 + 1)) -6 (-14 - -10) + 5 + -4 -3 Calculate (0 - -2) + (-18 - -18). 2 2 + (4 - -2) + -2 6 Evaluate -5 + 8 + -4 + 2. 1 Evaluate 0 + -1 - (5 + -3 + -6). 3 What is the value of -1 - ((-1 - 2) + 3) - 1? -2 Calculate 3 - (0 - (-7 - 4 - -3)). -5 What is the value of (-14 - -6) + 4 + -1? -5 Evaluate 2 - (-1 - 3 - (-4 + 2)). 4 Evaluate (4 - 6) + (1 - 0 - -2). 1 Calculate 1 + 1 - -1 - (13 - 9). -1 5 + 1 + -7 + -4 -5 Calculate 1 + -5 + 0 - (-5 - -6). -5 (3 - 0) + -4 - (-1 - -3) -3 -2 - (-2 + 3) - 0 -3 (-11 - -3) + (2 - -4) + -5 -7 What is the value of 9 + (11 - 14) + 0? 6 Evaluate -1 + -7 - (-25 + (19 - 11)). 9 Calculate -19 + -17 + 3 + 28. -5 Evaluate 1 - (-1 + 1 - (-15 + 18)). 4 0 - (-2 + 5 + -3 + 2) -2 What is 6 + -8 + 10 - 10? -2 8 + -8 + (2 - 4) + 5 3 What is (-14 - 1) + 8 + 8? 1 What is (6 + 2 - (10 + -4)) + 4? 6 What is -2 - -1 - (-4 + (-4 - -3))? 4 Evaluate 1 - 9 - (-32 + 26). -2 What is 5 - (0 + (-4 - (-1 - 4)))? 4 Calculate 21 + -23 + 1 + -2. -3 Calculate 6 + -2 + (-13 - -12). 3 What is -7 - -8 - 2 - -4? 3 Calculate -6 + (5 - 2) + -2 - -5. 0 1 + 1 + (11 - 13) + 1 1 Calculate -18 + 17 - (-1 - 1) - 0. 1 What is -2 + -5 + -2 + 3 + 1? -5 5 + -1 - (17 + -16) 3 What is -1 + (-29 - -25 - (-10 + 1))? 4 What is -3 + -6 + -3 + 4 - -6? -2 What is the value of 5 - 1 - (-2 - -4) - 3? -1 Evaluate -1 + 0 + (36 - 33). 2 2 - 0 - (-9 + 4) 7 What is (1 - -2) + -1 + -4 + -1? -3 Calculate 1 + -6 + 19 + -11. 3 What is 1 + 1 + 0 + -1 + -5? -4 -1 + 3 - (6 - 3) - 1 -2 What is -5 - (-1 - (11 - 6))? 1 Evaluate 0 - (1 - -2 - 0) - -6. 3 -10 + 5 - ((-5 - -3) + -5) 2 What is the value of -10 - (7 - 19 - -3)? -1 Evaluate -2 - (10 + (-3 - 1)). -8 What is -5 + 8 + -3 + 2 + -2? 0 Calculate (1 - (1 + -5) - -3) + -1. 7 1 - (-2 - -4 - (1 + 3)) 3 -19 + 4 - (-7 + -4) -4 Calculate -2 + (4 - 6) - (0 - -1). -5 What is (1 - 2) + 5 + 0? 4 Evaluate -2 - (-7 + -1 + 4). 2 What is the value of -3 + 1 - (1 + -6)? 3 What is the value of -2 + 2 + -7 - (-11 - -8)? -4 Calculate (-6 + (-7 - -7) - -2) + 7. 3 Calculate (-4 - (-2 + -2)) + 0. 0 Evaluate 4 - ((0 + 1 - 2) + 1). 4 What is the value of 9 + (-4 - 3) + 3? 5 What is (-8 - (2 + -6)) + 3? -1 -4 - (-3 - 0 - 1) 0 What is the value of -11 + 13 + 0 + -2 + 4? 4 What is 1 + 1 - (8 + -9)? 3 0 - 2 - (0 - (3 + -4)) -3 1 + 3 - (7 - 4) - -6 7 Calculate (2 + -7 - -2) + -2. -5 -4 + 17 - (0 + 3) - 6 4 Evaluate 4 + (-2 - -4) + -1 + -2. 3 What is the value of 6 + -10 - (2 + -2)? -4 What is the value of -3 + 2 + 0 + (-2 - 1)? -4 What is 4 + -2 + -3 + 2? 1 What is -18 + 26 - (2 - (-5	{ "pile_set_name": "DM Mathematics" }
rue Let z(h) = -h*2 - 7h - 6. Let u be z(-6). Let r(k) = 7k2 - 89k - 20. Let j be r(13). Let p be 8 + ((-48)/27 - j). Which is greater: p or u? p Let r be 3/(1 + 29) + 816175/(-8166750). Is -1 less than or equal to r? True Suppose 4j + 4x = -90308, 112927 = -5j + 9x - 7x. Is j > -22583? False Suppose -4b + 25858 = 3d, -24559 - 9860 = -4d + 3b. Which is greater: d or 8609? d Let v = 76227976410122/16775490453 - -44/73900839. Let d = 4544 - v. Is d at least 0? False Let k(o) = -o3 + 9o*2 + 13o + 6. Let x be k(10). Let z = 37 - x. Let t be z - (-6 + 3) - 3. Is 13/6 at least t? True Suppose 0 = 207q - 209q + 10. Suppose qf - 4w - 8 = -39, -3w = 4f. Let g be (-6)/(-4)(10/f + 4). Which is smaller: 2/129 or g? 2/129 Suppose -56m - 4002 = -271811 - 53015. Which is greater: m or 5728? m Let s(r) = 58r + 41. Let f be 6545/605 - 3/(33/(-2)). Let l be s(f). Let k = 10169/15 - l. Is k < 0? True Suppose 0 = -21l + 19l - 6. Let z(b) = b2 - 11b - 42. Let c be z(l). Let v be (-4)/(-22) + (-1 - -1). Which is greater: c or v? v Let f = 358 + -331. Suppose -fr + 583 = -848. Which is greater: r or 3? r Let j(n) = -n3 + 6n*2 + 6n + 8. Let t = 6 - -1. Let o be j(t). Let r(m) = m*2 - 14m + 42. Let w be r(12). Which is smaller: o or w? o Let x be (0 + (-5 - -2))32/(-24). Let o be (29 - 31)/(10/x). Which is smaller: o or -2? -2 Suppose 0 = -2y + y - 30. Suppose -84t + 32256 = -120t. Let c be (-242)/t + y/105. Is c less than or equal to 1? True Let i = -13.2 + 13.133. Let q = i + -0.033. Which is bigger: 0.021 or q? 0.021 Let w be (((5/2)/(-1))/(-5))/(-13 - -8). Which is bigger: 1.07 or w? 1.07 Let d be (0 - (-3)/7) + 70169(-1)/(-1386). Is 51 at most d? True Let f = 1/1334 + 46019/5336. Suppose 29p - 397 + 165 = 0. Is f at least p? True Let m be 1013956/5742 + (-4)/18. Let i = -494722/2805 + m. Which is bigger: i or 1? 1 Let c(y) = 3y3 + 50y*2 + 33y + 12. Let f be c(-16). Let x be 1(-7)/14 + (-2)/f. Is x less than or equal to 1/970? True Let x = 969/298631 + -77487379501/31057624. Let m = x - -2495. Which is smaller: m or 0? 0 Let x(l) = -156l - 1644. Let o be x(-10). Which is smaller: o or -81? o Let v = 29562 + -29560. Which is smaller: -379/8 or v? -379/8 Let a = 2/5111 + 5021/229995. Which is bigger: -0.02 or a? a Let k be (-716 - -728)/((-12)/(-1)). Let r be 4/(-42)(-18)/1. Which is smaller: k or r? k Let t = -388.87553 + -0.12447. Is t >= -0.14? False Let m be 53(13285/(-25) + -8)/(-1). Which is smaller: m or 8092? m Suppose 4o = 6j - j + 26, 5j - o + 14 = 0. Let q be j/(-4)(-124)/(-93). Which is smaller: -0.14 or q? -0.14 Let x = 261 - 10704/41. Do x and 3 have the same value? False Suppose -23t + 24 = -21t. Let y be (0 - -1)/(2/18). Suppose -37 = -3p + r, yr + 17 = p + 4r. Is p equal to t? True Let z = 94.9 + -95. Let r = -0.1 - -10.1. Let p = r + -16. Is p bigger than z? False Let f = -256 - -129. Let q = f - -131. Which is smaller: 3/7 or q? 3/7 Let s be 8/(-32) - 23/4. Let v(i) = -i*2 - 4i + 14. Let w be v(s). Suppose -c - c = 5m - 144, wm + 5c = 66. Which is smaller: 27 or m? 27 Let b(m) = -38m + 721. Let w be b(19). Is w at least as big as 411? False Let x(k) = -3k + 79. Let j be x(20). Suppose 0 = p + a - 2 + 3, -5p - j = -2a. Which is smaller: p or -13/3? -13/3 Let o(k) = 2k*2 + 7k - 103. Let h be o(12). Suppose 267g = hg - 18. Which is smaller: g or -11? -11 Let k be (285/(-7) - (3306/203 + -16))-6. Which is greater: k or 282? 282 Suppose 333n - 130490 = 157n + 89862. Is 1252 < n? False Let d = -17566/63 + 2512/9. Which is greater: d or -548? d Let o = 21038 - 21039. Is o at most 495? True Suppose 5n - 252 = 113. Let q = -50 + n. Let m = q + -70/3. Is m equal to 2? False Let p = 1928 + -1112. Let w = 425 - p. Which is bigger: w or -389? -389 Let i be (-2 - 126/(-5))378/(-216). Which is smaller: i or -42? -42 Let i = -4948.1 - -4969. Is i at least 11/5? True Let h = -19941/7 + 2849. Let w = -38 - 33. Which is smaller: w or h? w Let l = -2446/31115 + 24/635. Which is smaller: 51 or l? l Let f = -10 - -119. Let x = f - 127. Let p = -47/5 - -193/20. Which is greater: p or x? p Suppose -2y + 9y = 315. Let z be 20983/y - (-12)/(-30). Let a = z + -465. Is 1 greater than or equal to a? True Let s be ((-8)/(-146))/((16/(-24))/(13/39)). Which is smaller: s or -1? -1 Suppose 49m - 52m = -3k - 18, -3k = -m + 10. Is -3606 bigger than k? False Suppose 5i = -41b + 46b + 25, i = -6. Let r be 2 + -4 - (-112)/(-12). Which is greater: r or b? b Let i be 2(-27)/9(-22)/4. Let n be i/774/(-6). Is 13 < n? False Let a be 1/4((-7 - -11) + -8). Is a less than -10/1301? True Suppose -s + 1 - 4 = 0, 3c - 4689 = -4s. Suppose 3d + 1070 = -4g, -5d - 2g = c + 207. Let o be 1059/d - 9/(-3). Are o and 0 equal? False Let m = -3258 + 3256. Which is smaller: -67/24 or m? -67/24 Suppose 0 = 33f + 99f - 441 - 879. Let m(g) = g*2 - 8g + 8. Let s(w) = w*3 + 3w*2 - 6w - 1. Let u be s(-4). Let i be m(u). Are f and i non-equal? True Let o = 16517671/16632 - 7945/8. Let a be (-41275)/8316 - (-4)/(-14). Let h = o - a. Is h at least as big as 4? True Let a be 4/(-10) - 30608/(-4520). Let f = 59709/791 + a. Let g = f - 82. Are g and 0.2 equal? False Suppose -5a + 4q + 4783 = 1234, -3a = 4q - 2155. Let d = -10703/15 + a. Are 0 and d equal? False Let u = -2.8462 - 0.1538. Let n = 12.12 + -0.12. Which is bigger: u or n? n Let c(n) be the first derivative of -n*3/3 - 2n*2 + 3n - 45. Let q be c(1). Let m = -0.02 + 0.09. Which is greater: m or q? m Suppose f = -s - 172, 0 = 2f + s + 263 + 88. Is -171 greater than f? True Suppose -11h + 5c = -7h + 24, 3c - 19 = 7h. Are h and -1/1361 nonequal? True Let v = 18971 - 20538. Which is smaller: 3/5 or v? v Let j = 5 - 2. Suppose 121 = 5l - x, 3l - 68 = -x - jx. Suppose -7k + l = k. Is 1 bigger than k? False Let u(z) = -4z2 - 14z + 15. Let v be u(-5). Let o be v/12-4 + 1899/(-380). Which is smaller: o or 0? 0 Suppose 1190d + 3872 = 1311d. Let n(a) = -2a*3 - 2a*2 + 2. Let p be n(-2). Do p and d have the same value? False Let u = -203.107 - -203. Let s = u + -0.893. Let g be 6(-2)/18-1. Which is smaller: s or g? s Suppose -3p = 52 + 50. Let t be 5/((-525)/3438) - -7286/(-15480). Is p smaller than t? True Suppose -2 = -3i - 2m + 15, -4i = -4m + 4. Suppose x + ix = 4. Let t(v) = 3v3 - 11v*2 - 5v + 2. Let l be t(4). Which is greater: x or l? x Let n(u) = -3u2 + 26u - 27. Let y be n(14). Let x = y + 752/3. Are -18 and x equal? False Suppose -g + 127 = 2y, -2y = 4g - 9g - 133. Which is greater: 70 or y? 70 Suppose -12 - 58 = -5b. Let k = -59 - -89. Suppose 17z - k = 11z. Is b less than z? False Let j be 33000/198 + (-1)/(-3). Suppose -m + 6m = 830. Is m greater than or equal to j? False Suppose 0 = -p - 3p + 1027 - 863. Which is greater: -11 or p? p Suppose 22l - 314 = 60. Let c = l - 17. Is 5/17 greater than c? True Let t(y) = -y*3 + 31y - 28. Let l be t(5). Suppose -3v - j - 16 = 0, 40 = -3v - lv - 5j. Is 1.2 at most v? False Let d = -29/12 - -8/3. Let h be 12/(-22)7700/(-1400) - 62/17. Is d <= h? False Let t(a) = -3a*3 + 19a*2 - 24a - 14. Let m be t(6). Let z(d) = -4d2 - 3d - 6. Let l be z(5). Which is bigger: m or l? l Let h = 27828/59884987 + 2/17363. Which is smaller: h or -1? -1 Let c be (-16)/(-12)218/(-2) - 55/(-165). Let n(a) = a2 + 4a - 6. Let o be n(-5). Which is bigger: o or c? o Let w(o) be the third derivative of o*4/24 + 31o*3/6 - 2o*2 - 10. Let b be w(-13). Which is bigger: b or 7? b Suppose 0 = -3p + 3f + 743 - 2534, -p - 577 = 4f. Let w = -405 - p. Which is bigger: 189 or w? 189 Let q = -5951/26 + 229. Let o = 835 + -834. Do o and q have the same value? False Let y be (-7134)/(-1044) + (-20)/(-6). Is y less than 10? False Let k(y) = -y*3 - 54y*2 + 37y + 480. Let l be k(-54). Which is greater: -1517 or l? -1517 Let b = 62 - 59. Let a be -1(-5 - (b - 6)). Suppose ax + 1 = -o, -3o = 3x - 0o. Is 1 less than x? False Suppose -17 = 198g - 33 + 16. Let x = -5855/36 - -1468/9. Is g bigger than x? False Let f = 53101 + -53124. Let t be -31 + 6/(6/3). Which is bigger: t or f? f Let d = -758 - -774. Suppose -dv - 2000 = 9v. Which is smaller: v or 0.5?	{ "pile_set_name": "DM Mathematics" }
t most w? False Suppose 2757 = 22d - 27d - b, 3b = -5d - 2761. Is d < -552? False Suppose 0 = q + 2i + 2, q = 2q - 3i - 3. Which is bigger: q or 141? 141 Let v be 138/30 - (-2)/5. Suppose -vx - 282 = -77. Which is greater: x or -40? -40 Suppose -2g + u = -5, -13g + 9g - 2u = 10. Let b be -1 - 1 - (g - 168/68). Which is greater: 0 or b? b Let w be -2 - ((-12)/20 + -1). Let h = 0.98 - -1.02. Are h and w nonequal? True Let f = 1017 + -1016. Let p be (16/6)/((-3)/9). Let b be 3/(-36)p/(-3). Is f != b? True Let b = 641509/38 - 16883. Is b != -1? True Let w be 822((-1)/(-5))/(15/(-25)). Which is smaller: w or -273? w Let k = -400 + 390. Is k > -1/3? False Let c = 1023 + -1024. Is c equal to 1/1788? False Let o(x) = 4x3 + 17x*2 - 17x - 21. Let w(t) = 3t3 + 15t*2 - 17t - 20. Let k(f) = 2o(f) - 3w(f). Let y be k(-12). Is -42 at most y? True Let a be 110/(-726)842/(-10). Let o = a - 78/11. Which is bigger: 6 or o? 6 Suppose 309 = 2a - 5c, -6c = 4a - 3c - 553. Is 143 not equal to a? True Let n = 0.0115 - 27.0115. Which is smaller: n or 5/3? n Let a = -86.62 + 87. Let j = a - 0.28. Are j and 5/6 unequal? True Let d = 5/3 + -1. Suppose 14t - 12t - 4 = 0. Let m be 6/t - (-116)/(-36). Is d less than or equal to m? False Suppose 2k = 5s - 15, -s - 4s = -3k - 15. Let u be ((-981)/216)/(70/8). Let o = u - -2/105. Is o bigger than k? False Let k = -33 - -58. Let f = 16 - k. Which is bigger: -2/5 or f? -2/5 Suppose 0 = 3w + 3j + 228, j = -0j - 4. Let q = -77 - w. Which is smaller: q or -4? q Suppose -c + 2b + 18 = b, 3b = 2c - 38. Let l = c + -13. Let p be (-30)/l(-3 + 4). Is p > -11? True Let j(a) = -a3 + 22a*2 + 23a + 8. Suppose 12i - 322 = -2i. Let t be j(i). Is t > 8? False Let d(h) = 6h + 38. Let g be d(-6). Suppose 38b = 39b + g. Is 1.6 at most b? False Suppose 0 = 3g - 2g - 4. Suppose 3q + 2q = 0, b + gq = -9. Let a be (-1)/(0 - 1/(-9)). Is a less than or equal to b? True Let w(h) = h*2 + 9h - 5. Let x(k) = 39k2 + 3k - 2. Let y be x(1). Let d be (y/15)/((-1)/3). Let p be w(d). Is -1 <= p? False Let q be ((5/(-2))/(-5))/((-29)/(-696)). Do q and 21 have different values? True Suppose -7g = -2g + 45. Let b be (-426)/84 + g/(-6). Is b != -4? True Let f be 0(9 + (-51)/6). Suppose 3 - 7 = k. Which is smaller: k or f? k Suppose -6r - 38 = 70. Let c be (0/3 + -26)/(-2). Let a = c + r. Do a and -11/3 have the same value? False Suppose 3k + 1010 - 201 = -c, 2k + 545 = 5c. Which is smaller: k or 1/3? k Let a be 0/(2 + 20/(-5)). Suppose a = 10s + 16 + 4. Which is greater: -6 or s? s Let u(m) = 6m + 104. Let w be u(-17). Is w equal to 9/5? False Suppose 5p + 29 = 4r, -2r - 2r = 4p + 52. Which is smaller: p or -8? p Let j = 36 + -26. Suppose -5c = -jc. Is -5/7 equal to c? False Suppose -4f = 4f + 6f. Let b be (-106)/322 + (-2)/(-7). Is b equal to f? False Let i be ((-3)/4)/(30/382). Let w be 3/(-4)(-172)/(-12). Let h = i - w. Which is smaller: 2 or h? h Suppose -5n - 1 - 4 = 0. Let m = n + 5. Suppose 0 = -s + mi - 1, 2i - 14 = s + s. Is s bigger than -9? False Let f(u) = u2 - 9u + 15. Let g be f(7). Suppose 0 = 3a + 4 - g. Is a less than -1/5? True Suppose -3u - 5x - 99 = -295, -u - 5x + 52 = 0. Let i = u + -54. Is 18 greater than i? False Let g(f) = f*2 + f - 1. Let p be g(-2). Suppose v - 4 = -6. Let d be (-10)/(-4) + v + 15/10. Is d < p? False Let u be (3354/(-1935))/(-11(-2)/70). Does -7 = u? False Let g be (0 - 0)/(-1 - -2) - -1. Let q be g/1 + (-8)/2. Are -5 and q non-equal? True Suppose 2y = 7 + 5. Suppose -yz = 14 - 2. Let i be (-1)/(-4) + z/8. Which is smaller: 1/2 or i? i Suppose q - 148 = -3q. Let b = q - 36. Which is smaller: b or -1/10? -1/10 Let v be 12/(-346)-3. Let l = -305/7612 + v. Which is smaller: 0 or l? l Suppose 7 = -5g + 3h, -3g + 5g + 4h - 18 = 0. Let w = -4341/10 + 434. Is w greater than or equal to g? False Let u = 29635/21 - 1410. Which is bigger: u or 1? u Let k(h) = -h*2 - 5h - 4. Let r be k(-4). Let s(v) = -2v3 + 7v*2 + 5v - 16. Let b be s(5). Let u = 131/2 + b. Do u and r have different values? True Let g be (-2893)/413 + 7/1. Which is bigger: g or 1? 1 Suppose -8 = 4q, -2q - 4 = 3x - 27. Suppose 5b - 5 = 0, -5b + x = -2h - 2h. Which is greater: -2 or h? h Let d be 21 - (10 + 0). Let u = -36 - -27. Do u and d have different values? True Let v be (-300)/936 - (-2)/13. Is 0.057 smaller than v? False Let l = -132 - -139. Suppose lr + 0 = 28. Let t be 23/148. Is r < t? False Let a = -392911 + 6677174/17. Let d = -136 - a. Is d less than 0? False Let n = -126.9 + 128. Is n at least as big as -4? True Let z(w) = -3w - 50. Let g(u) = u*2 - 5u + 6. Let m be g(3). Let s be z(m). Which is bigger: s or -49? -49 Let y = -38.49 + 9.49. Is 7 less than or equal to y? False Let y(s) = -3s - 17. Let u be y(-8). Let h = u - 7. Which is smaller: 1/2 or h? h Let c be (-7 - (-242)/33)-12. Are c and -1.52 nonequal? True Let t = -40.1 + 53. Let z = -25 + 38. Let g = t - z. Is g < -0.1? False Suppose 1 = q, 5t - q - q = -52. Is -53/5 > t? False Let m = -4 - 10. Let v be (m/(-4))/((-2)/4). Are v and -7 nonequal? False Let o = 36/5 + -466/55. Does o = 0? False Let m(c) = -c3 - 31c*2 - 58c + 4. Let l be m(-29). Does -7 = l? False Suppose -5f - 3h = -5 - 100, 2f + h = 41. Let j(y) = 18y*2 - 2y + 2. Let o be j(1). Are f and o non-equal? False Let o = 171455/913 - 2752/83. Let f = 155 - o. Is f at least as big as 0? True Let l = 13 + -3. Suppose 0 = -5o - 15s + 13s + 45, 0 = -4o + 2s + 54. Is o smaller than l? False Suppose 2i + 89 = -v, -35v - 445 = -30v - 2i. Is -91 less than v? True Let u be 22/(-14 - (-9 + 9)). Let o(v) = v3 - 2v*2 - v. Let n be o(-1). Is n >= u? False Let j = 29.99 - 30. Let r = j - 0.29. Are r and 9 equal? False Suppose -15 = -5m - 5x, -5x = m - 2 - 1. Suppose 3r - m = 3z, 3r + 5z = 23 - 4. Is r at least as big as -3? True Let t = 62 + -87. Let y = 8 - t. Which is bigger: 34 or y? 34 Let c(a) = -92a - 503. Let h be c(-8). Is h at least 227? True Let f = -2/2353 - 3464/1461213. Do 0 and f have the same value? False Let h be 10 - (-2 - -3) - -11. Let t be (-2)/(-1)h/(-20). Let o be 4 - 5 - (-34)/26. Is t less than o? True Let h = -268318/11 - -24416. Which is bigger: 24 or h? 24 Suppose 2g - x + 27 = 0, -4g - 2x = -0g + 58. Let s be 56/(-6)(-42)/(-28). Is s < g? False Let b be 4/(-3)(-6)/4. Let q be 66/8 + 16/(-64). Suppose ql - 9 = 5l. Which is smaller: b or l? b Suppose -5n + n + 12 = 0. Let r be ((4 - 3) + 2)/n. Let c be (r + -2)/(2/4). Are c and -3 non-equal? True Suppose -4w - 48 = -0w. Suppose 0 = 4d + y - 53, -2y + 9 = -1. Let b = d + w. Is b at least as big as -1/7? True Let u = -1418 - -2303. Which is smaller: u or 884? 884 Let w be (-1 + 2 - 1)1. Let h be -2 - (w + -3 + -2). Suppose -4d = -3v - 24, hv = -3d - 52 + 7. Which is smaller: -13 or v? -13 Let f = 4587/4 + -1137. Suppose 0 = 4m + c - 49, -7c + 2c + 25 = 0. Is m not equal to f? True Let f = -0.816 + 1.016. Is -40 less than f? True Let d = 95 - 90. Let t be 24-5(d + (-11)/2). Which is bigger: -0.1 or t? t Let k = 50.8 + -50.78. Is k equal to -1? False Let z(w) = w - 7. Let u be z(8). Let s = 36 + -38. Let h be (0 - s) + 132/(-69). Is h at most u? True Let j = 3.4 - -9.6. Let t = j + -12.6. Suppose 2b - 4 = 2a, 2b - a = -3a. Which is smaller: t or b? t Suppose 3x - 7 = 35. Suppose 0 = 2n + 2b + x, -2n - n = 5b + 29. Let c = 16 + -16. Is n less than or equal to c? True Suppose -21v + 8v = 0. Let o = -1 + 3. Let p be (6/(-36))/(o/(-8)). Is p not equal to v? True Let q = -7 - -11. Let z(i) = -i2 - 107i - 1127. Let f be z(-95). Is f at least as big as q? True Let o = 2 - 0. Let d be 3/135-2 + (-24)/60. Which is greater: d or o? o Suppose -10d + 72 = -8d. Let z be 1000/d - ((-20)/9 + 2). Is 29 greater than z? True Let c = -1.934 + 9.934. Let u be 3/(-14)12/9. Which is smaller: c or u? u Let v(y) be the third derivative of 6y2 + 0y*3 + 0y + 1/60y5 + 0 - 5/24y*4. Let z be v(6). Are z and 6 nonequal? False Let w = -0.19 + 1.29. Let n = w + -1. Let k = -286 - -284. Is k equal to n? False Let v be 190/4 - (-123)/82. Is v <= 51? True Let u be 2/(-4)(0 - -1). Let m be 1	{ "pile_set_name": "DM Mathematics" }
ctor of 45743 and 42057465? 307 Calculate the highest common factor of 319514 and 24271. 13 Calculate the highest common factor of 549 and 90459. 9 What is the highest common factor of 70425 and 72? 9 Calculate the highest common factor of 1905574 and 1221. 407 Calculate the greatest common divisor of 39853842 and 42. 42 What is the greatest common factor of 70093967 and 1880? 47 Calculate the greatest common divisor of 93252 and 572318. 38 Calculate the highest common divisor of 2583699 and 19833. 1803 Calculate the greatest common divisor of 173984896 and 25265. 5053 Calculate the greatest common divisor of 2355727 and 12940. 647 What is the greatest common factor of 12517638 and 4557? 147 Calculate the greatest common divisor of 10046046 and 42. 6 Calculate the greatest common divisor of 336663 and 20609. 37 What is the highest common divisor of 66761 and 743625? 661 Calculate the highest common divisor of 3480 and 24400020. 1740 Calculate the highest common divisor of 46335074 and 6284. 3142 What is the highest common divisor of 2589 and 72670641? 2589 What is the greatest common divisor of 19842768 and 3168? 1584 What is the greatest common factor of 12791092 and 353596? 3244 What is the highest common divisor of 8725358 and 5038? 458 What is the greatest common divisor of 25 and 33171135? 5 Calculate the highest common factor of 268926 and 54894. 42 What is the highest common factor of 22991 and 756487? 277 Calculate the greatest common factor of 864 and 14946864. 48 Calculate the greatest common divisor of 137323 and 28673. 53 Calculate the highest common divisor of 276179 and 11174. 151 What is the highest common factor of 530691 and 1665111? 777 Calculate the highest common factor of 93555 and 10355499. 2079 Calculate the greatest common factor of 498309 and 1059387. 1281 Calculate the highest common factor of 4460 and 25834327. 223 What is the greatest common divisor of 1789 and 52530407? 1789 What is the greatest common factor of 18822890 and 4495? 155 Calculate the highest common divisor of 204884 and 16. 4 Calculate the greatest common factor of 266939 and 2279011. 1543 What is the highest common factor of 1242 and 5819598? 414 What is the greatest common factor of 7470450 and 45825? 975 Calculate the highest common divisor of 1614 and 1519459143. 807 Calculate the highest common divisor of 655160 and 11440. 440 What is the greatest common factor of 39151 and 10957486? 799 What is the highest common factor of 1221 and 13967167? 37 Calculate the greatest common factor of 59136 and 1900569. 33 Calculate the greatest common divisor of 17854680 and 4756. 164 Calculate the highest common factor of 133056 and 314406. 18 Calculate the greatest common divisor of 4009 and 1942532887. 4009 Calculate the highest common factor of 401507470 and 260. 130 Calculate the greatest common divisor of 1449 and 167710158. 1449 Calculate the greatest common factor of 80 and 3514896. 16 Calculate the greatest common divisor of 8375 and 1614825. 25 Calculate the greatest common divisor of 3480 and 318721600. 1160 What is the highest common factor of 4137 and 1860163438? 1379 What is the greatest common divisor of 80852840 and 9? 1 Calculate the greatest common factor of 3952248 and 2. 2 Calculate the highest common divisor of 14807888 and 16072. 328 What is the highest common factor of 3456 and 1132416? 1152 Calculate the highest common factor of 1312304450 and 50. 50 Calculate the greatest common divisor of 18360518 and 22. 22 Calculate the highest common divisor of 69284175 and 2850. 75 What is the greatest common divisor of 4567540 and 2224? 556 Calculate the greatest common factor of 123 and 67681488. 123 Calculate the highest common factor of 189 and 1746171. 189 Calculate the highest common divisor of 1108712511 and 612. 153 Calculate the highest common factor of 5796 and 709492. 28 Calculate the highest common factor of 7884 and 2873961. 27 What is the highest common factor of 13 and 304056883? 13 Calculate the highest common divisor of 1696 and 22483872. 1696 What is the highest common factor of 1956 and 7859697? 489 Calculate the greatest common factor of 251765 and 25198. 43 Calculate the greatest common divisor of 14238 and 809532. 2034 Calculate the highest common divisor of 2242 and 43218090. 118 What is the highest common factor of 24 and 733464876? 12 Calculate the greatest common factor of 248 and 32548543. 31 Calculate the greatest common factor of 1022 and 868189. 511 Calculate the greatest common divisor of 2241 and 214218. 27 What is the highest common factor of 389136219 and 167? 167 Calculate the greatest common factor of 11366 and 413102953. 5683 What is the greatest common divisor of 162 and 357241068? 18 Calculate the highest common factor of 3180 and 88120. 20 Calculate the greatest common divisor of 475036 and 24926. 206 Calculate the greatest common divisor of 207834 and 129578. 134 What is the greatest common divisor of 58 and 215187946? 58 Calculate the greatest common factor of 1130 and 254519505. 565 Calculate the highest common divisor of 14303627 and 26. 13 Calculate the greatest common divisor of 2637048 and 25080. 456 What is the greatest common factor of 346806 and 216? 18 Calculate the highest common divisor of 65 and 164005465. 65 Calculate the greatest common factor of 9685024 and 1334. 46 Calculate the greatest common factor of 11983757 and 145. 29 Calculate the highest common factor of 187 and 303545. 11 Calculate the greatest common divisor of 6003504 and 156. 156 Calculate the greatest common divisor of 56547184 and 212. 212 What is the greatest common divisor of 2 and 2009741? 1 Calculate the greatest common divisor of 45062867 and 202. 101 What is the greatest common divisor of 3666022 and 54522? 466 What is the highest common factor of 46243662 and 36? 6 Calculate the greatest common divisor of 60172157 and 241. 241 What is the highest common divisor of 8265 and 9799535? 2755 What is the highest common divisor of 1329 and 275979? 3 Calculate the highest common factor of 37324 and 11984. 28 Calculate the greatest common factor of 5646390 and 1110. 30 Calculate the highest common factor of 5837 and 1139113. 449 What is the highest common factor of 6642323 and 6769? 967 Calculate the highest common divisor of 13454 and 87026238. 1922 What is the greatest common factor of 208615 and 130130? 55 What is the greatest common factor of 721526785 and 105? 35 What is the highest common divisor of 180931 and 245021? 493 What is the greatest common factor of 450221211 and 297? 99 Calculate the greatest common divisor of 1472 and 2633332928. 1472 Calculate the highest common divisor of 50 and 86931350. 50 Calculate the highest common factor of 665572 and 156. 4 What is the greatest common divisor of 984000 and 256? 64 What is the greatest common divisor of 77140 and 203406? 406 Calculate the greatest common divisor of 6173856 and 952. 136 Calculate the highest common divisor of 9611570 and 10. 10 What is the greatest common divisor of 36459 and 6141316? 4051 What is the greatest common factor of 7013593 and 213? 71 Calculate the highest common divisor of 4147590 and 4830. 690 Calculate the highest common factor of 1011 and 20204835. 1011 Calculate the highest common divisor of 183975 and 1351603. 2453 What is the greatest common divisor of 63000 and 252462? 42 What is the greatest common divisor of 1173237 and 1570413? 2613 Calculate the greatest common factor of 209667 and 23547. 141 What is the highest common factor of 16040639 and 204? 17 What is the greatest common factor of 6270 and 149446? 22 Calculate the greatest common factor of 109791098 and 23. 23 What is the greatest common divisor of 301856380 and 210? 70 Calculate the greatest common divisor of 316 and 1117159540. 316 What is the highest common divisor of 129183 and 4917? 447 Calculate the highest common divisor of 2945218 and 12895. 2579 Calculate the highest common factor of 99 and 1124453286. 99 What is the greatest common divisor of 153285 and 4356? 33 What is the greatest common factor of 9751012 and 1589? 227 What is the highest common divisor of 104333 and 133926? 101 What is the highest common factor of 3351 and 115256528? 1117 Calculate the grea	{ "pile_set_name": "DM Mathematics" }
212332 Convert -108 (base 11) to base 14. -93 What is -3aa9 (base 11) in base 13? -2565 Convert -27bb (base 12) to base 6. -33155 Convert 13267 (base 13) to base 5. 2114300 -2333 (base 11) to base 4 -233311 What is -54404 (base 6) in base 5? -214432 What is 3330 (base 5) in base 10? 465 Convert -a21 (base 11) to base 9. -1620 -38a (base 12) to base 7 -1366 2495 (base 10) to base 6 15315 2421 (base 11) to base 3 11100101 Convert -1097 (base 11) to base 14. -749 What is 11023203 (base 4) in base 3? 1002002220 What is 23b8 (base 15) in base 4? 1312232 739 (base 12) to base 10 1053 Convert -618d (base 14) to base 12. -9869 -32b (base 14) to base 4 -21303 Convert 427 (base 13) to base 2. 1011000101 What is a1 (base 14) in base 11? 119 Convert 81a (base 12) to base 13. 6c4 -501 (base 10) to base 2 -111110101 Convert 271 (base 16) to base 5. 10000 Convert -202 (base 15) to base 11. -381 What is -331 (base 5) in base 6? -231 What is 6477 (base 14) in base 13? 7b8b Convert -32021 (base 4) to base 3. -1020112 What is b2 (base 16) in base 15? bd Convert 296 (base 10) to base 2. 100101000 What is -1bc0 (base 13) in base 11? -318a Convert -122211222 (base 3) to base 10. -13013 What is 116505 (base 7) in base 2? 101010000001100 1110010 (base 2) to base 9 136 What is 5130 (base 7) in base 16? 6f9 2784 (base 12) to base 7 16210 What is 102022 (base 3) in base 5? 2210 What is -c9 (base 15) in base 13? -117 What is -1088 (base 10) in base 15? -4c8 What is 3505 (base 6) in base 16? 341 Convert 213 (base 8) to base 7. 256 What is -1100000 (base 2) in base 13? -75 What is -222022111 (base 3) in base 15? -5a3d What is 248 (base 9) in base 10? 206 -65405 (base 10) to base 16 -ff7d Convert -2003 (base 4) to base 3. -11212 -40440 (base 7) to base 15 -2da3 -2002121 (base 5) to base 12 -16300 Convert 4463 (base 7) to base 11. 1237 Convert -220111 (base 3) to base 4. -22111 What is -3602 (base 10) in base 3? -11221102 34000 (base 5) to base 8 4507 225 (base 15) to base 14 269 What is -12133 (base 4) in base 16? -19f What is 2656 (base 13) in base 15? 1954 -2d5 (base 15) to base 14 -346 What is -5d1 (base 16) in base 8? -2721 Convert -34612 (base 9) to base 16. -5a38 22b0 (base 14) to base 11 4596 -530 (base 7) to base 5 -2031 Convert 12222 (base 5) to base 16. 3a9 -111300 (base 4) to base 10 -1392 What is -18b (base 14) in base 6? -1251 -615 (base 9) to base 8 -764 Convert 42b (base 14) to base 11. 689 Convert 1011211100 (base 3) to base 15. 6d1c Convert 10011110111101 (base 2) to base 5. 311143 Convert 40510 (base 6) to base 10. 5370 Convert 39aa (base 12) to base 7. 25162 Convert 2001101112 (base 3) to base 16. 9dbb 111002 (base 3) to base 13 212 584 (base 16) to base 5 21122 21128 (base 12) to base 3 2012111112 Convert 40 (base 14) to base 3. 2002 Convert 333 (base 15) to base 8. 1323 Convert 279 (base 10) to base 11. 234 837 (base 9) to base 12 48a -210 (base 10) to base 16 -d2 -11110113 (base 4) to base 8 -52427 -125351 (base 8) to base 14 -11d33 What is -20310333 (base 4) in base 8? -106477 -2b48 (base 12) to base 11 -3913 1112022212 (base 3) to base 15 8dd8 -6237 (base 8) to base 4 -302133 Convert -3024 (base 8) to base 16. -614 560 (base 10) to base 2 1000110000 -120210 (base 3) to base 14 -226 -325 (base 14) to base 8 -1155 18578 (base 9) to base 6 135325 b114 (base 14) to base 3 1112200212 14170 (base 12) to base 14 a232 201142 (base 5) to base 9 8725 Convert 14e9 (base 15) to base 9. 6143 What is -33331 (base 4) in base 16? -3fd -32d (base 14) to base 11 -522 Convert 19a4 (base 15) to base 11. 419a What is 314532 (base 6) in base 10? 25688 What is 352 (base 16) in base 10? 850 -761 (base 11) to base 5 -12124 What is -251030 (base 7) in base 16? -b39f 112311 (base 4) to base 5 21321 Convert -401 (base 9) to base 11. -276 What is -2333 (base 11) in base 9? -4171 -15335 (base 6) to base 11 -197a 400 (base 11) to base 16 1e4 Convert -23158 (base 11) to base 4. -20022303 Convert c15c (base 14) to base 4. 20012312 Convert 1000100 (base 3) to base 9. 1010 What is 1020021222 (base 3) in base 14? 8bba What is 1110110101000100 (base 2) in base 6? 1145112 What is 11011000 (base 2) in base 5? 1331 Convert 10111001 (base 2) to base 7. 353 What is 50 (base 7) in base 5? 120 Convert 4310 (base 6) to base 13. 5a3 -1893 (base 12) to base 3 -11002210 27f (base 16) to base 14 339 -3202 (base 5) to base 13 -26b Convert -898 (base 13) to base 8. -2705 Convert 1585 (base 9) to base 14. 627 What is -1000100 (base 2) in base 11? -62 Convert 202434 (base 6) to base 9. 24134 Convert 100101111110 (base 2) to base 12. 14a6 512 (base 10) to base 2 1000000000 -5869 (base 14) to base 13 -7002 What is -22341 (base 5) in base 2? -11000111100 100d (base 14) to base 11 2087 Convert a86 (base 11) to base 4. 110120 Convert -43182 (base 9) to base 15. -870b -222101 (base 3) to base 6 -3144 2425 (base 10) to base 3 10022211 -376 (base 12) to base 6 -2230 -24 (base 14) to base 3 -1012 -1001101000110011 (base 2) to base 16 -9a33 103 (base 12) to base 15 9c What is -1012201 (base 3) in base 4? -31303 What is -10037 (base 8) in base 14? -170b What is 1f8a (base 16) in base 2? 1111110001010 60500 (base 8) to base 2 110000101000000 -4a9a (base 12) to base 4 -2010112 What is -101000 (base 3) in base 14? -154 Convert 11e5 (base 15) to base 10. 3815 What is 1814 (base 16) in base 12? 3698 What is 100100000110110 (base 2) in base 8? 44066 -1100000 (base 2) to base 16 -60 -2533 (base 11) to base 8 -6347 Convert 101011111 (base 2) to base 5. 2401 Convert -2095 (base 11) to base 3. -10210110 -2364 (base 7) to base 10 -879 What is a330 (base 13) in base 14? 82c4 What is 5585 (base 10) in base 8? 12721 4fc (base 16) to base 6 5524 -3d4 (base 15) to base 16 -36a Convert 313224 (base 5) to base 13. 49a0 Convert 12005 (base 9) to base 7. 32252 What is -b1a (base 14) in base 16? -884 1010010100 (base 2) to base 11 550 What is -38680 (base 11) in base 4? -31201121 2870 (base 10) to base 13 13ca Convert -101551 (base 6) to base 10. -8203 Convert 7a38 (base 14) to base 15. 6448 What is 10010010 (base 2) in base 15? 9b What is -11000000 (base 2) in base 4? -3000 What is -3267 (base 8) in base 13? -a23 2442 (base 5) to base 4 11310 11002310 (base 4) to base 11 14582 -f6a (base 16) to base 12 -234a 1614 (base 9) to base 7 3403 -7711 (base 8) to base 3 -12112200 What is 3b0 (base 15) in base 14? 440 Convert -1487 (base 11) to base 9. -2552 Convert 101111000000 (base 2) to base 8. 5700 What is -515 (base 12) in base 6? -3225 What is 12131213 (base 4) in base 15? 7c9b What is -2321222 (base 4) in base 8? -27152 What is -202011 (base 3) in base 15? -264 -31302 (base 5) to base 13 -c3a What is -11411 (base 6) in base 10? -1663 Convert -121232 (base 6) to base 3. -112122102 -7d70 (base 16) to base 12 -16700 2535 (base 7) to base 16 3bd -3435 (base 7) to base 9 -1640 Convert -25f4 (base 16) to base 15. -2d2b -16a (base 11) to base 7 -401 -2ab (base 13) to base 2 -111011111 4032 (base 6) to base 4 31310 Convert -6417 (base 8) to base 5. -101333 What is 1a5 (base 11) in base 2? 11101100 What is 17715 (base 8) in base 4? 1333031 -54 (base 16) to base 4 -1110 11000111 (base 2) to base 11 171 Convert -5278 (base 9) to base 8. -7446 -4821 (base 10) to base 16 -12d5 241 (base 10) to base 6 1041 What is 244 (base 6) in base 10? 100 What is dc1 (base 14) in base 16? a9d Convert -6b2 (base 12) to base 15. -468 What is 1231240 (base 5) in base 12? 11a35 -1324131 (base 5) to base 12 -13607 What is -121433 (base 7) in base 11? -15727 -202120011 (base 3) to base 12 -8811 Convert 12210 (base 4) to base 13. 264 -1036 (base 10) to base 3 -1102101 What is -122210 (base 4) in base 10? -1700 6132 (base 11) to base 3 102011120 Convert 1a68 (base 13) to base 5. 111343 Convert -12216 (base 8) to base 14. -1cbc 333 (base 5) to base 2 1011101 What is 671 (base 10) in base 3? 220212 Convert -210221 (base 3) to base 9. -727 What is -12a3 (base 12) in base 4? -201123 Convert 1212 (base 12) to base 10. 2030 112122 (base 4) to base 7 4116 Convert 1715 (base 8) to base 7. 2560 What is -7495 (base 16) in base 2? -111010010010101 59c0 (base 13) to base 7 51626 What is -20331 (base 4) in base 13? -351 -3120010 (base 4) to base 5 -420303 20002211 (base 3) to	{ "pile_set_name": "DM Mathematics" }
se -1 = 3p - 5o + 4, -5p + 4o = 17. Suppose 0 = y + 5s + 16, -5y - 13 = 2s - 2. Sort y, p, g in decreasing order. g, y, p Let g = 0.738 - 0.638. Sort 3, g, 19, -2. -2, g, 3, 19 Let x be (-36)/(-10) + -6 + 3. Let d = -54.3 - -54. Put -5, x, d in descending order. x, d, -5 Suppose 5p - 243 + 158 = 0. Suppose -pm = -18m + 1. Sort -0.3, -1/11, 0.3, m in ascending order. -0.3, -1/11, 0.3, m Let o = 1590 - 1585. Put 3, o, -10, -22 in increasing order. -22, -10, 3, o Let h be ((-3)/2)/(4 - 2). Let d be ((-65)/10 - -7)1/2. Put 0, 0.05, h, d in ascending order. h, 0, 0.05, d Let o(q) = -q3 - q2 + 3q - 5. Let d be o(0). Put 10, d, 5 in increasing order. d, 5, 10 Let p be (-6)/(-4) - 63/14. Let d = -1.2 + 0.9. Sort -1, d, p in increasing order. p, -1, d Let n = -0.04 + 0.04. Sort 2/9, -8, n in decreasing order. 2/9, n, -8 Let i = -311 - -321. Put i, -3, 1, 3 in decreasing order. i, 3, 1, -3 Let b be (-4 + 2 + 0)-1. Suppose bl + l = -66. Let y be 8/(-44) + (-70)/l. Sort -4, y, -3. -4, -3, y Let x = -21.06 - -21. Let h = x - 3.94. Sort -2/5, -1, h in descending order. -2/5, -1, h Suppose -i + 3 = 2h - 1, 2h - 4 = 5i. Put 1/8, -4, h in increasing order. -4, 1/8, h Let b = -1 - -1.2. Let x = -0.12 + 0.52. Let d = 0.01 - -0.29. Put d, b, x in decreasing order. x, d, b Let r be (-4)/(-18) + 4/(-18). Let u(s) = -s3 + 15s*2 - 13s - 12. Let o be u(14). Sort o, 8, r in increasing order. r, o, 8 Let m = 131 - 126. Let k = -11.2 + 11. Sort k, 1, m in increasing order. k, 1, m Suppose k - 6 = -4b, 89b - 18 = 87b + 2k. Suppose 3n + 0n - o = 15, -2o = -2n + 14. Put b, 10, n in ascending order. b, n, 10 Let w = -169.9 + 155. Let t = -15 - w. Let c = 5/88 - 377/440. Sort -0.06, t, c in increasing order. c, t, -0.06 Let w be (-3)/(-54) - 8/(-72). Let q = 13/231 + -5/21. Sort q, w, 2 in decreasing order. 2, w, q Suppose 3z = 9 + 3. Suppose zs = -s - 20. Let m(n) = n - 2. Let q be m(1). Sort s, -3, q in ascending order. s, -3, q Let o = 3.64 - 5.64. Suppose -2h + 3h = -3. Put -5, h, o in descending order. o, h, -5 Let l = 863 + -904. Put 7, 2, l in increasing order. l, 2, 7 Suppose 3 = 4z - 1, 3z - 123 = -3m. Suppose -11j = -15j - m. Sort j, -3, 3, 1. j, -3, 1, 3 Suppose -d = -78 + 44. Let k be 21/d + 3/(-6). Sort -2/9, -0.5, -5/2, k in descending order. k, -2/9, -0.5, -5/2 Suppose 3b - 4y = 332, -3b - 5y = -5b + 226. Let k be 1/(-6) + (-414)/b. Put -5, k, -3 in descending order. -3, k, -5 Let u = -1896 + 1889. Sort 4, u, -5, 2. u, -5, 2, 4 Let t = -19148/9 - -2128. Put -5, -1, t in ascending order. -5, -1, t Let r = -34.3173 + -3.6827. Let m = 0.4 - -2.6. Sort m, 0.5, r in descending order. m, 0.5, r Suppose 0 = 19w + 7w + 52. Let k = 17.5 + -17. Sort 3, -2/7, k, w. w, -2/7, k, 3 Let a be (15 + -19)(-2 + 4) + 3. Let j = 3 - 5. Put a, -1, 3, j in decreasing order. 3, -1, j, a Let i = 106/75 + -2/25. Let a = -14 + 14.4. Sort a, -6, 5, i in decreasing order. 5, i, a, -6 Let a = 20 - 17. Suppose u + 2 = a. Let t = 12 - 7. Sort u, t, -3 in decreasing order. t, u, -3 Suppose 0 = -5i + 18q - 20q - 31, -q - 18 = 3i. Sort 6, i, 0 in decreasing order. 6, 0, i Suppose -l + 1 = p - 29, 2p = 2l - 76. Sort l, 0, 1 in decreasing order. l, 1, 0 Let p be (-6)/((-2)/((-4)/(-3))). Suppose -2w + 44 = -2k, 3k = -w - 2w + 42. Let b = 19 - w. Sort 5, b, p in increasing order. b, p, 5 Let u be 1 - 12/(-2)16/(-24). Suppose 2z - 6z - 28 = 0. Sort 0, u, z, 1. z, u, 0, 1 Let t = -193/364 - -35/52. Sort t, 113, 4, -1/3 in decreasing order. 113, 4, t, -1/3 Let f = 66 - 135/2. Let n be -5 + 1/((-24)/(-126)). Sort -21, n, f, -1 in descending order. n, -1, f, -21 Let b(z) = -z*3 + 17z*2 + 19z + 3. Let n be b(18). Let i = n - 26. Put -3, i, 3 in ascending order. i, -3, 3 Let f(z) = z*3 + 13z*2 + 21z - 79. Let y be f(-10). Put y, -11, 3 in descending order. y, 3, -11 Let r = -4 + -20. Let p be (-5)/4(-48)/30. Put -1, 4, p, r in descending order. 4, p, -1, r Let c(s) = 2s*3 - 87s*2 - 45s + 6. Let f be c(44). Put f, 4, -5 in increasing order. f, -5, 4 Let h = 3.53 - 4.03. Sort -0.2, h, 0.9, -1/3 in increasing order. h, -1/3, -0.2, 0.9 Let k be (-220)/275-51. Let m = 22 + -6. Suppose 2f = -2f - m. Sort k, f, -5. -5, f, k Suppose 45 - 25 = 10q. Sort -5, q, 0.4 in descending order. q, 0.4, -5 Suppose -143 = -10n - 183. Let u(s) = s*2 + 2s + 1. Let k be u(-3). Sort k, 2, n in descending order. k, 2, n Suppose -2o = -118 + 112. Sort -1, 0, -3, o. -3, -1, 0, o Let n = 53 - 54. Suppose 0 = 2m + 6 - 18. Sort n, m, 5 in decreasing order. m, 5, n Suppose 5w = -5p, -2 = -p + 4w + 8. Suppose b + q = -1, 0b - 34 = 4b - pq. Let f = -7 - b. Sort f, -2, -5. -5, -2, f Let k be (-1)/(38/10 + -4) - 0. Put 142, k, 4, -2 in ascending order. -2, 4, k, 142 Let l(j) = j*3 - 8j*2 - 8j - 6. Let q be l(9). Let r be 4((-3)/(-4) + -2). Put r, 0, q in descending order. q, 0, r Let h(a) = 4a*2 - 2a - 1. Let m be h(-1). Suppose k + k - 11 = -g, -5k = 4g - 26. Suppose 0 = v + k - 9. Put 0, v, m in ascending order. 0, v, m Let w be (15/9)/(26/3 - 7). Sort 0, -0.5, w, 11 in ascending order. -0.5, 0, w, 11 Let v be (-2)/8 + 3/36. Let k(l) = l - 9. Let x be k(7). Let p be (x/(-8))/(-1 - -3). Sort p, -2/9, v in decreasing order. p, v, -2/9 Let l = 344 - 344. Put -4, -0.2, l, 1 in increasing order. -4, -0.2, l, 1 Let q be 33 + -52 + 43. Put -28, 4, q, 1 in descending order. 4, 1, q, -28 Suppose -3 = 4c + 5m, -m + 6 - 13 = 4c. Let x = -284 - -313. Suppose 22 = -31n + xn. Put c, n, 3 in descending order. 3, c, n Let p(f) = 7f + 360. Let o be p(-50). Sort -10, 2, o. -10, 2, o Let u = 35 - 35. Suppose u = 2j - 0j. Suppose -5n - 13 - 7 = j. Sort 6, 5, n. n, 5, 6 Let x = -20 + 14. Let j = 6.143 - 0.043. Let i = x + j. Put i, 4/15, 5 in ascending order. i, 4/15, 5 Let k = -296 + 295.8. Sort 68, -2/7, 0, k in decreasing order. 68, 0, k, -2/7 Let s = -0.014 + 4.714. Let r = -0.7 + s. Let k = -1909/3 - -635. Sort 1/5, r, k in decreasing order. r, 1/5, k Let a(s) = -2s2 - 13s + 3. Let c be a(-6). Let x = -0.411 + 0.111. Sort x, c, 3, 0.3 in decreasing order. c, 3, 0.3, x Let g(b) be the first derivative of b*2/2 - 2b - 12. Suppose -2w - 5n - 4 = w, -4w + 3n + 43 = 0. Let t be g(w). Sort -1, 0, t. -1, 0, t Let g be 16/(352/(-33))4/(-3). Sort g, -6, 1, -4 in descending order. g, 1, -4, -6 Suppose -4q + 11 = 2d - d, -4 = 4d. Suppose -8c = -4c - 108. Suppose 18 = 3j + c. Sort 0, q, j. j, 0, q Let i(p) = -p3 + 2p - 2p + 3p*2 + 3p - 1 - 3. Let l be i(3). Let b be (2/(-10))/(6/(-12))30. Put b, l, 2 in increasing order. 2, l, b Suppose -3w = -5x + 14, 2w - 4 = -2x + 8. Sort 0, -444, -2, x in descending order. x, 0, -2, -444 Let k = -2.29 - 0.71. Sort 0.01, k, -16, 5 in ascending order. -16, k, 0.01, 5 Let a = 4/145 + -173/1015. Sort -1/3, 0.4, 1/2, a in decreasing order. 1/2, 0.4, a, -1/3 Let g(h) = h3 - h2 - h + 1. Let c(w) = -4w*3 - 2w*2 + 4w. Let f(k) = c(k) + 3g(k). Let v be f(-5). Put v, -4, -1 in descending order. -1, v, -4 Let z = 2811/80 - 176/5. Let r = z + -3/16. Let g be 10/(-6) + 0 - (-4100)/2100. Sort g, r, 4. r, g, 4 Let p = -2.5 - -3. Suppose 0 = -4s - 4, 2z - 3s - 3 = -0z. Let a = -6013/15 + 401. Sort a, p, z. z, a, p Let z = -43.1 + 38.1. Let b(i) = -i3 - 6i*2 + 7i + 8. Let v be b(-6). Let w = v + 100/3. Sort 5, w, z in increasing order. z, w, 5 Suppose 0 = -2z - 3z + 60. Let g be (0 + z)(-2)/(-30). Put g, 1/5, -4/5 in decreasing order. g, 1/5, -4/5 Let j = 305.6 - 306. Sort -7, -6/11, j in increasing order. -7, -6/11, j Let h = 0.11 + -2.91. Let c = h + 35.8. Let w = -32.8 + c. Put w, -1, -5 in increasing order. -5, -1, w Let h(u) = -u2 + 2u + 3. Let j = -8 - -24. Suppose -4g = -2a - j, -5g + 13 = -2a - 6. Let c be h(g). Put -5, c, 3 in descending order. 3, c, -5 Let g(m) = m*2 - 8m - 8. Let z be g(9). Suppose z = -9j + 10. Let r(d) = -d2 + 5d + 6. Let y be r(6). Put j, y, -5 in descending order. j, y, -5 Let r be (-470)/3 + 45/(-60). Sort r, 1, 4 in increasing order. r, 1, 4 Suppose 0 = -4s + 110 - 114. Let w(d) = d*2 + 8d + 3. Let p be w(-8). Put p, s, -4, 4 in decreasing order. 4, p, s, -4 Let o = 2.03 + -0.03. Let n = 48.997 + 0.003. Let u = n + -50. Sort o, 2/	{ "pile_set_name": "DM Mathematics" }
for t. 1 Solve 3p - u = 1, -4p + 0u = -4u - 12 for p. -1 Solve -10f + 13f = -o + 8, 0 = 2o + 11f - 31 for o. -1 Solve 2y + 2w - 10 = 0, 8 = 3y - w - 7 for y. 5 Solve 3p = -2v + 11, 5v + 2p - 1 = 21 for v. 4 Solve -2u = -6, -3r + 4r - 3u = -7 for r. 2 Solve 0 = -5u - 10, 3o + 17 = 407u - 411u for o. -3 Solve -2b - 3 = -5b, 4c = -3b + 11 for c. 2 Solve 2z - z + 5l = 29, -5z + 5l = 5 for z. 4 Solve 4c = -3o - 23, c + 3o = -4c - 25 for c. -2 Solve 4y - 9y - 3b + 37 = 0, 12 = 3b for y. 5 Solve 3m = w, 0w - 3w + 14 = 5m for w. 3 Solve 5c + 5z = -25, -103c + 98c = 4z + 17 for c. 3 Solve 0 = -4f - 3q - 19, 4q + 3 = -f - 5 for f. -4 Solve -y - 3 - 6 = -5x, 0 = 2y - x for y. 1 Solve 2k + 10 = 0, 2k - k = -3w - 5 for w. 0 Solve -4u + 5z + 5 = 0, -15 = -24z + 19z for u. 5 Solve -7i = -12i + s + 23, -s = -2i + 11 for i. 4 Solve u - 3a = -2a, 0 = -4u - 4a for u. 0 Solve 19v = 17v - 4x - 24, -1 = 3v - x for v. -2 Solve -3b - 4m - 5 = 0, 21m = 18m - 6 for b. 1 Solve 2d + 17t - 20 = 13t, -2d = -t + 10 for d. -2 Solve 0 = 61z - 66z - 3v + 8, 0 = -4z + 3v + 28 for z. 4 Solve -2w = -4l + 4, -7l - 4w = -4l - 14 for l. 2 Solve -19u + s = -18u - 1, 3u - 5s = 9 for u. -2 Solve 4h - 12 = -2a, 5a + 18 = 2h + 9a for h. 1 Solve -10f - 6a + 40 = -3a, -5a + 20 = 5f for f. 4 Solve -3q - 4z + 24 = 0, -5q + 20z = 17z - 11 for q. 4 Solve -4b - b = 3r - 7, -3b = -2r + 11 for r. 4 Solve 4o = 12, w - 11 = -167o + 164o for w. 2 Solve -5v = -4s - 17, v + 8s - 10s = 7 for v. 1 Solve t + 5i - 14 = 0, -3i + 6 = 2t - 8 for t. 4 Solve -2b + 2q - 10 = 0, 3q = 4b + 7q - 20 for b. 0 Solve -4 = 4y - 5p, 2y + 67 = -3p + 65 for y. -1 Solve 3a + 12 = 3n, 4n + 3a = 5a + 18 for n. 5 Solve -j - 5 = -2o, -6 = 3o - 3j - 15 for o. 2 Solve l - 17m = -22m + 14, l = 5m - 6 for l. 4 Solve 2g + 2c = -4, 2c = 6c + 20 for g. 3 Solve -2d + 14 = -q + 11, -d - 6q = 31 for d. -1 Solve 3x - 4z = z - 14, -6 = -5x + z for x. 2 Solve 4w = 2b, b + 4w = -4b - 28 for b. -4 Solve 13w - 10w = 3f + 18, -2f - 5w = -16 for f. -2 Solve 3q = 4t + 18, t - 5q = -10 - 3 for t. -3 Solve -4k = 2n + 1 + 9, -5 = 4k + n for k. 0 Solve -4n + 8 - 2 = 3q, 3n + q = 2 for n. 0 Solve 3h = 2p, 6 + 10 = 5h + 2p for h. 2 Solve -5c - 33 = -90d + 86d, -2d - 4c = 16 for d. 2 Solve -a = -4j + 70 - 63, -10 = 5j - 5a for j. 3 Solve 4c - 5m = 15, -39 = -4c - 3m - 16 for c. 5 Solve 18i = -c + 18, -2i + 6i = 4c + 4 for i. 1 Solve -5t + 2h = 26, -10t - 2 = -11t - 2h for t. -4 Solve -12 = 5w - 3v - 18, 2v + 4 = -2w for w. 0 Solve 4l + 2 - 9 = 5s, -5l + 13 = -2s for l. 3 Solve s + 1 = -3x, 5s = 3x + 8s + 9 for x. 1 Solve 2z + 2m = -m + 13, 3m - 18 = 3z for z. -1 Solve -1 = 2i + 2c - 3, -4i = 5c - 5 for i. 0 Solve 0 = -2u, -3a + 4u + 2 = -13 for a. 5 Solve -3l + 5b - 34 = -12, b - 22 = 5l for l. -4 Solve -6 + 7 = s, -4s = -5a + 21 for a. 5 Solve -5i - 9p + 10p = -30, -5p - 25 = 0 for i. 5 Solve -3l = -3v + 15, -6v = -5v - 5l - 25 for v. 0 Solve -10u + 5k = -13u - 30, -u + 4k + 24 = 0 for u. 0 Solve -5k - 11b = -12b - 24, -4 = 3k + 4b for k. 4 Solve -4n + 9r - 12 = 7r, -2n + 5r - 6 = 0 for n. -3 Solve 2x = 56v - 61v + 2, 0 = 4x - 4v + 24 for x. -4 Solve 70 = -2t - 3z + 53, -5t + 3z = -10 for t. -1 Solve -21 = 5i + 15d - 14d, -2i = -3d + 22 for i. -5 Solve 2t + 3 - 23 = -4v, 3v - 10 = t for v. 4 Solve -3v + 0o - 22 = 4o, 3v - 2o = 2 for v. -2 Solve d - 2 - 3 = 0, 3y = -2d - 5 for y. -5 Solve 605p - 4a - 19 = 608p, 9 = 3p - 3a for p. -1 Solve -2s + 3t = 1 + 12, 0 = 4s - 5t + 25 for s. -5 Solve -5q + 20 = 0, 0h + 30 = 2h + 5q for h. 5 Solve -y + 5 = 5d, 3d = -2y - y - 9 for y. -5 Solve -102b - 28 = -98b + 4m, -5b + 5m - 5 = 0 for b. -4 Solve 18 = -2x - 5v, 390x - 391x + 2v = 0 for x. -4 Solve 0 = -2h - 2j + 4, 0 = 2h + 15j - 16j + 5 for h. -1 Solve 5u - 4u = -3, -4y - 24 = 4u for y. -3 Solve -3g = 2g + 4t + 9, -5g - 7 = 2t for g. -1 Solve 5h + 20 = 4q, 16 = -4h + 9q - 12q for h. -4 Solve -4m - 5 = -3y + 8, 2m = 2y - 8 for y. 3 Solve -2d + 12 = 5u, 32 = 5u - 5d + 27 for u. 2 Solve 0 = -5h, -5d - 2h - 8 - 2 = 0 for d. -2 Solve -3y - 9 = 5q + 13, -5y - 22 = q for y. -4 Solve 2a + 2j + 2 = 0, 2a + 5 = j + 15 for a. 3 Solve x + 5 = n + 2, -3n + 11 = -4x for x. -2 Solve 4j - 20 - 6 = -3a, -22 = -a - 4j for a. 2 Solve -6q + 10 = -5q + 3h, 2q = h + 6 for q. 4 Solve -5j + u - 14 = -11, 0 = -j - 2u + 6 for j. 0 Solve -4g - 5j = -4 + 19, -4g + 4j = -12 for g. 0 Solve -4v - 20 = -4k, -2v - 8 = 4k - 16 for v. -2 Solve -x = t - 7, 0 = -6t + 5t + 5x - 5 for t. 5 Solve 4n + 3i = -7, n + 5i + 0 = -6 for n. -1 Solve a - 3a = 2, 0 = -5c - 4a - 14 for c. -2 Solve 3s = -5c - 0s + 31, 0 = 2c - 3s - 4 for c. 5 Solve -2r = -4r + 5z + 27, -2r - 5z - 23 = 0 for r. 1 Solve 4o + 4 = -2y + 6y, 2o = -4 for y. -1 Solve 4f - 236 = q - 232, f = -q - 4 for q. -4 Solve p - 19 = -4z, 10p - 12p + z = -2 for p. 3 Solve 91q + 26 = -3l + 87q, q = -4l - 13 for l. -2 Solve 5v - 14 = 3r - 6r, 5v + r = 8 for v. 1 Solve -2p + 6p = -3m + 7, 0 = p + 2m - 8 for p. -2 Solve 4f - 10 = -2s, -2f + 7 = -3s + 6s for s. 1 Solve -f + 5b = -20, 5f + 16 = -38b + 34b for f. 0 Solve 8g - 10g = -p - 11, 0 = 3p - 2g + 21 for p. -5 Solve 7 = -k + 4n, k + 3k + 2n - 8 = 0 for k. 1 Solve 2z + 2 + 2 = h, 0 = -3h + 5z + 11 for h. 2 Solve -2l + 6 = 5u, 25l = 28l + 3u - 9 for l. 3 Solve -7v + 21 = -3c - 10v, -29 = 3c + 5v for c. -3 Solve -4r - 3 = 3z - r, z + 4 = -4r for z. 0 Solve 3r - 20 = 5p, -r = 4p - 5p - 6 for p. -1 Solve -3x + 9 = 0, 5p - 5x = -0p + 5 for p. 4 Solve 6 = z + 2, 5t + 35 = 5z for t. -3 Solve -5n + 0k + 5k = -30, 3k = 5n - 28 for n. 5 Solve -29r - 5k - 10 = -34r, 4r + 2k - 8 = 0 for r. 2 Solve 0 = d + d - 2g - 12, 4g = -4d for d. 3 Solve -3r - 18 = 3q, -14r = -12r + 4q + 18 for r. -3 Solve 0 = -n + 2o - 4 + 11, 0 = 5n - 4o - 5 for n. -3 Solve -5u = -w + 2, -5w - 4 - 15 = 4u for w. -3 Solve -16t - 5 = d - 14t, -3 = t for d. 1 Solve -3n + 13 = -m, -5 - 7 = -4n for m. -4 Solve 3 = -g + 4l, g + 11l - 8l - 11 = 0 for g. 5 Solve -s = 2m - 5, 5 = -6m + 9m + 2s for m. 5 Solve 3i = 2h - 3 - 7, -i - 10 = -4h for h. 2 Solve 5t + 45 = -7a + 3a, -4a - 2t - 30 = 0 for a. -5 Solve q + 14 = 3x, 3q = -156x + 155x + 8 for q. 1 Solve -4q + c - 9 = 0, 15 = q + 4c + 13 for q. -2 Solve -3b - 7 = 2n, -5n - 8b = -5b - 5 for n. 4 Solve -5r - 20 = -5t, 2r - 9t = -5t - 6 for r. -5 Solve 0 = 4t + 2g + 2, 11t - g = 7t - 11 for t. -2 Solve -4u + 3 = -3d - 0, 2u + 2d = 12 for u. 3 Solve -5g + 5x + 15 = 0, -2g - 12x + 13x = -5 for g. 2 Solve -50 = -5w + 5u, -w + 2u - 4u = 5 for w. 5 Solve -g + 20 = -3v - 2g, 4v = 4g for v. -5 Solve -4y + 4u - 4 = 0, -3y + 2u + 2 = -0 for y. 4 Solve 29x - 26x - 2 = -4d, 3d - 4x + 11 = 0 for d. -1 Solve -2x + 5w = -3x - 25, -2w = 8 for x. -5 Solve 2 = 2o - x + 6x, -3x = 0 for o. 1 Solve 4m = 2d - 6, -3d + 4d = -2m + 7 for d. 5 Solve 3t + 10 = g, 7t = -5g + 5t - 1 for g. 1 Solve -q = -60j + 59j, -3q = 2j - 20 for j. 4 Solve 2o = -3k - 14, -4k + 2o = -0k for k. -2 Solve m = -3p + 14, p + 110m - 6 = 109m for p. 4 Solve -4 = u, 4b - 2u = u for b. -3 Solve -4f = 4d - 8f - 12, -d - 2f + 3 = 0 for d. 3 Solve 5z + 6 = -4p, -z - 5p = -3z - 9 for z. -2 Solve -v + 4j = -12, 5v - 4j - 11 - 1 = 0 for v. 0 Solve -g - 4l = -l + 17, g - 4l - 11 = 0 for g. -5 Solve f - i + 3 = 0, 0f - 2f + 4i = 8 for f. -2 Solve 5y + 17 = -23z + 20z, z - 5y - 21 = 0 for z. 1 Solve 4k - 17 = -3i + 8i, -i - 9 = 2k for k. -2 Solve 0 = 2v - 2p + 16, -v - 103 = -4p - 83 for v. -4 Solve 4j - 2t = 0, 1 + 8 = 3j + 3t for j. 1 Solve -4a - 28 = -4r, -217 = -4a - 225 for r. 5 Solve z = -o - z + 1, -3o = 2z - 11 for o. 5 Solve -o - 4m = 3o + 36, 0 = -2m - 10 for o. -4 Solve -t + 2z + 12 = 0, -t = 4t + 5z for t. 4 Solve 5l - 25 = 3s, 2s + 5 - 3 = -4l for l. 2 Sol	{ "pile_set_name": "DM Mathematics" }
72d Differentiate -9 + 63r*2 + 44 + 48r*2 + 78 + 8 with respect to r. 222r Let y(d) = d4 - d3 - d*2 + d - 3. Let q(b) = -25b*4 - 3b3 - b2 - 37b - 19. Let m(l) = -q(l) + 3y(l). What is the second derivative of m(i) wrt i? 336i2 - 4 Let s(v) = 33v*3 - 20v. Let m(o) = -21o - o3 + 17o*3 - 5o*3 + 21o*3. Let r(k) = 6m(k) - 5s(k). Find the second derivative of r(b) wrt b. 162b Let b(g) = -2g4 + g2 + g + 1. Let x(a) = 14a*4 - 17a*3 - 5a*2 - 64a - 5. Let y(k) = 5b(k) + x(k). What is the second derivative of y(r) wrt r? 48r*2 - 102r Suppose -5f = 4q - 30, 3f - 1 + 10 = 3q. What is the second derivative of 3gq - 10g*5 + 11g - 9g wrt g? -140g3 Let l be (-20)/(-4) + (-1)/1. Let c(b) = -b2 + 4b + 2. Let x be c(l). What is the third derivative of -d2 - 4d*5 - 4d*x + 6d*5 wrt d? 120d2 Let c(d) = d4 + 4d3 + 4d*2 + 3. Let q(n) = -2n3 + n3 + 210n4 - n2 - 1 - 211n*4. Let u(z) = -c(z) - 4q(z). Differentiate u(b) wrt b. 12b3 Let u be (4 + -2)(2 - 0). Let g = u - 1. What is the second derivative of -2y5 + gy - y - 2y5 + y wrt y? -80y*3 Let m = 73 - 72. Differentiate -2 + 7g*3 - 3g*3 - m + 7g*3 with respect to g. 33g*2 Let v(s) be the second derivative of 0s*3 + 3/2s*2 + 11s + 0s5 + 0s*4 - 1/3s*6 + 0. Differentiate v(b) wrt b. -40b*3 Let o(y) be the second derivative of -22y*5/5 + 37y*3/6 + 5y + 19. What is the second derivative of o(v) wrt v? -528v Let q(w) = -5w - 6. Let k(y) = -4y - 7. Let a(o) = -7 + 3o - 12o + 8o. Let u be a(-4). Let t(p) = uk(p) + 4q(p). Differentiate t(c) wrt c. -8 Let x(n) = -11n3 - 2n. Let f be (9/(-3) - -1) + 0. Let y(p) = 12p3 + p2 + 3p. Let q(l) = fy(l) - 3x(l). Find the third derivative of q(a) wrt a. 54 Let o(q) = -q*2 + 45q - 41. Let c be o(44). Let d(m) be the first derivative of 3/2m2 + 7 + 2m*c + 0m. Find the second derivative of d(w) wrt w. 12 Find the second derivative of -12m2 + 849m*4 - 2m*3 + 12m*2 - 849m*4 - 455m - 20m5 wrt m. -400m*3 - 12m Suppose 0 = n + 4l + 2, 3l + 26 = 3n - 28. Find the second derivative of 3o*5 + 20o*5 - 6o + no5 wrt o. 740o*3 Let z(j) be the first derivative of 0j*3 + 23/4j*4 + 0j*2 - 14 + 21j. What is the first derivative of z(v) wrt v? 69v2 Let w(l) be the third derivative of 0l + 0l4 + 9l*2 - 3l*3 + 0l*5 + 17/120l*6 + 0. Differentiate w(v) wrt v. 51v*2 Find the second derivative of -3f*3 + 43 - 5f*4 + 61f - 105 + 62 wrt f. -60f2 - 18f Let j(q) be the third derivative of -659q5/60 + 79q*4/3 - 491q*2. Find the second derivative of j(d) wrt d. -1318 Find the first derivative of 10 + 13 + 2 + 0 + 340r + 10 wrt r. 340 Let m(y) be the first derivative of 9 - 9/2y2 + 4/3y*3 + 0y. What is the second derivative of m(u) wrt u? 8 Let i(p) be the second derivative of 39p - 43/30p*6 + 0p*3 + 0 + 0p*2 + 0p*5 + 31/12p*4. What is the third derivative of i(m) wrt m? -1032m Let u(q) be the second derivative of -q*8/56 + 11q*5/30 - 2q*2 + 22q. Let g(r) be the first derivative of u(r). Find the third derivative of g(v) wrt v. -360v2 Let b(d) be the third derivative of -4d*2 - 2d*3 + 0d + 0d4 + 0 - 1/15d*5. What is the derivative of b(r) wrt r? -8r Let x(t) = 13 + 0t - 3t + 6t2 + t. Let u = 1795 - 1796. Let r(i) = i2 - i + 1. Let v(q) = ux(q) + 2r(q). Differentiate v(j) wrt j. -8j Let w(o) be the first derivative of 0o3 - 11/2o*2 + 9o + 2 + 2/3o4. Let l(h) be the first derivative of w(h). What is the derivative of l(f) wrt f? 16f Let n(h) be the first derivative of 29h4/4 - 2h*3/3 - 7h*2/2 - 6h + 150. What is the second derivative of n(b) wrt b? 174b - 4 Let k be (-3)/(18/4) - 308/(-66). What is the third derivative of 10s*2 + 2s*4 - 12s*5 - 2s*k - 20s*2 wrt s? -720s*2 Find the second derivative of -2 - 2u*3 + 8u*3 + 11u*3 - 4u*3 - 16u wrt u. 78u Let g(n) = n2 + n - 2. Let k(v) = -v. Let i be k(-2). Let o be g(i). Find the third derivative of -2l*3 + 2l*3 + 7lo - l2 - 8l4 wrt l. -24l Let i(n) be the third derivative of n5/20 - n4/12 - n*3/6 - 7n*2. Let k be i(2). What is the third derivative of -kt2 - t5 - 5 + 5 + 0 wrt t? -60t2 Let n(o) be the third derivative of -o5/60 + 7o*4/24 + 2o*3/3 + 2o*2. Let x be n(7). Find the third derivative of 2 + xl*2 + 2 - 9l*5 - 4 wrt l. -540l*2 Suppose 0 = l + 2l + 3y - 9, -4l - 3y + 14 = 0. What is the third derivative of lp - 17p2 + 7p*4 - 5p + 15p2 wrt p? 168p Find the first derivative of 7 + 60k4 - 25 - 2 wrt k. 240k*3 Let y(r) be the second derivative of -47r*3 + 697r*2/2 - 175r + 3. What is the first derivative of y(a) wrt a? -282 What is the third derivative of 89u3 + 155u*2 + 0 - 5u*4 + 96u*3 + 0 - 201u*3 wrt u? -120u - 96 Suppose a = j - 4, -12j = -17j - a + 8. Suppose 4o - o + 2q = 20, -20 = -5q. Find the first derivative of -j - 4i*o - 5 - 3i*4 wrt i. -28i*3 Let v(x) be the second derivative of 9x7/2 - x4/6 - 3x3 + 2x - 51. Find the third derivative of v(z) wrt z. 11340z2 Let g(a) = -37a*3 + 12a*2 + 642a + 17. Let m(k) = -13k3 + 4k*2 + 214k + 6. Let j(o) = 6g(o) - 17m(o). What is the second derivative of j(t) wrt t? -6t + 8 Let c(a) = 7a*3 - 51a*2 - 98. Let l(r) = 10r*3 - 76r*2 - 147. Let w(u) = 7c(u) - 5l(u). Differentiate w(d) wrt d. -3d*2 + 46d Let q(z) be the third derivative of -z*4/24 - 75z*3/2 - 64z*2 - 1. Find the first derivative of q(f) wrt f. -1 Let t(g) be the first derivative of -18 + 23/2g*2 + 44g. Differentiate t(h) wrt h. 23 Find the second derivative of 22m - 60m*4 - 2m*4 - 8m*4 - 1 + 2 wrt m. -840m*2 What is the first derivative of -57s + 379 - 2s - 124s wrt s? -183 Let k(m) = 131m3 - 3m*2 - 14m + 394. Let x(h) = 130h3 - 4h*2 - 19h + 394. Let a(u) = 4k(u) - 3x(u). Differentiate a(z) wrt z. 402z2 + 1 Let u(v) be the second derivative of -731v*5/20 - 121v*3 - 7v - 13. Find the second derivative of u(p) wrt p. -4386p Let h be (-192)/183-2. Let o = h - 44. What is the second derivative of -oz*3 + 22z*3 + 0z + 10z wrt z? 12z Let q(d) be the first derivative of -15d4/2 + 7d*3 - 2d - 151. What is the third derivative of q(h) wrt h? -180 Let l(p) = 92p6 + 94p*2 - 6. Let d(f) = -183f*6 - 187f*2 + 14. Let v(m) = -3d(m) - 7l(m). Find the third derivative of v(w) wrt w. -11400w*3 Let a(y) be the second derivative of 0 + 0y*5 + 0y*3 - 5/3y*4 - 20y + 0y6 - 5/28y*8 + 0y*2 + 0y*7. What is the third derivative of a(x) wrt x? -1200x*3 Let a = 8 - 7. Let h(r) = 6 + 6 + 0 - 6r + 6r2. Let b(n) = n2 + 1. Let s(m) = ah(m) - 12b(m). What is the second derivative of s(x) wrt x? -12 Find the first derivative of -u - 49 + 39u*4 - 6 - 85 + 21 wrt u. 156u*3 - 1 What is the first derivative of -19d*2 - 13d*2 + 57 - 746d + 745d wrt d? -64d - 1 Let i(o) be the second derivative of 91o3/3 - 84o*2 - 11o - 4. What is the derivative of i(v) wrt v? 182 Let q(c) be the first derivative of -5c4/2 - 77c*2/2 - 118. Find the second derivative of q(r) wrt r. -60r Suppose 5p = -4p + 36. Find the third derivative of 3i - 3i4 - i3 + 13i2 - i3 + 5i*4 - pi*4 wrt i. -48i - 12 Let y be (-7)/4(-48)/56. Let b(i) be the first derivative of 0i*3 + yi*4 + 0i + 1 + 7/2i2. What is the second derivative of b(k) wrt k? 36k Find the second derivative of -1016v2 + 1016v*2 + 144v + 187v4 - 5v*4 + 673v wrt v. 2184v2 Let l(q) be the third derivative of -2q*7/15 + 17q*5/60 - 24q*2 - 3. What is the third derivative of l(o) wrt o? -672o Let j(h) be the second derivative of -4/3h3 + 0 + 6h + 0h2 - 7/4h*4. What is the second derivative of j(r) wrt r? -42 Let v(j) = 255j*4 - 39j*2 + 5. Let a(l) = 170l*4 - 26l*2 + 3. Let w(p) = -8a(p) + 5v(p). Find the third derivative of w(q) wrt q. -2040q Suppose 4a + 0a - 136 = 0. What is the second derivative of -1397t2 + at + 1397t2 + 21t*5 wrt t? 420t*3 Find the third derivative of -501a6 + 63 + a2 + 2a2 + 14a6 - a2 wr	{ "pile_set_name": "DM Mathematics" }
3. Let d(s) = -11s - 6. What is the remainder when d(-5) is divided by a(j)? 24 Calculate the remainder when 87 is divided by 24 - (-11 + 11)/(0 + 1). 15 Let j = -24 + 83. Calculate the remainder when j is divided by 17. 8 Suppose 0 = 2s - s - 3w - 27, -4s + 4w = -76. What is the remainder when 359 is divided by s? 14 Suppose -6h = -237 - 27. Suppose 0 = -3q - 6, g - 5q = -g + 40. What is the remainder when h is divided by g? 14 Let n(l) = l*3 - 9l*2 - 11l - 8. Let h be n(10). What is the remainder when 14 is divided by (-104)/h - 4/(-18)? 2 Let t(v) = v3 - v2 + 3. Let b be t(0). Let d = 22 - b. Let x = -1008 - -1012. Calculate the remainder when d is divided by x. 3 Suppose 2t = 3h - 42, 2t - 70 = -5h - 2t. What is the remainder when ((-46)/(-23))/(4/50) is divided by h? 11 Let t(b) = -17b - 104. What is the remainder when t(-7) is divided by 3? 0 Calculate the remainder when 37 is divided by 6/15 - (-559)/65. 1 Suppose 67a + 5478 = 150a. Let r(l) = l*3 + 10l*2 + 11l - 6. Calculate the remainder when a is divided by r(-8). 32 Let d = 78 - 51. Let j be (-2)/(-12) - 5/(-6). Let c(i) = 8i2 + 2i. Calculate the remainder when d is divided by c(j). 7 Suppose -6s = -5s - 40. What is the remainder when s is divided by 9/3(-14)/(-3)? 12 Let v(a) = a2 - 10a - 2. Let w be v(10). Let u = 4 + w. Suppose 5i - ui - 34 = -2k, 4k - 60 = -4i. What is the remainder when k is divided by 4? 3 Let n = 1988 + -1971. Let c = -353 + 164. Let j = 290 + c. What is the remainder when j is divided by n? 16 Suppose -33t + 31t + 192 = 0. Suppose 4d = 2d + t. Let b = 71 - d. Calculate the remainder when b is divided by 13. 10 Suppose 0 = -4x - y - 2 + 4, 0 = 3x + y - 2. Suppose -27 = -xa + a. Calculate the remainder when a/(-2)(-4)/(-6) is divided by 5. 4 Let y(i) = i3 + 2i*2 - 4i. Let o be y(-3). Let h(v) = 5v2 + 4. What is the remainder when h(o) is divided by 17? 15 Suppose -5p - 181 = -471. Suppose -2o + 2j = 3o - 35, 0 = 2o + 5j + 15. Suppose c + o = p. Calculate the remainder when c is divided by 18. 17 Let w(r) be the first derivative of 131r*4/4 + 2r*3/3 - r - 2. What is the remainder when w(1) is divided by 45? 42 Suppose -57i = -6558 + 1257. Suppose p = -2p + 57. Calculate the remainder when i is divided by p. 17 Let x = 394 + -383. Calculate the remainder when 50 is divided by x. 6 Calculate the remainder when (5/(15/897))/(15/45) is divided by 43. 37 Suppose 4s = 667 + 613. Suppose -3u = u + s. Calculate the remainder when 62 is divided by (140/u)/((-2)/24). 20 Let t(v) = -2v*3 + 20 + 0v*3 + 3v - 27 + 7v2 + v3. Calculate the remainder when t(7) is divided by 8. 6 Let j(m) = m2 + 13m - 28. What is the remainder when 9 is divided by j(-15)? 1 Let q = 101 + -66. Let s be (-8)/(-52) + (-516)/(-26). What is the remainder when q is divided by (s - 8) + -1 + 1? 11 Let f(j) = 6 - 2j2 - 3 + 5j*2 - 3j. Let w(a) = -a*3 + 13a*2 - 11a + 10. Calculate the remainder when f(5) is divided by w(12). 19 Suppose 7u - 10u = -57. What is the remainder when 187 is divided by u? 16 Let j(u) = u*2 + 8u - 13. Let h be j(-9). Let n be -13 + h + 6. What is the remainder when 1/n1 + 10 is divided by 5? 4 Let p = -2479 + 2557. Calculate the remainder when p is divided by 24. 6 Suppose z - 6z = -40. Suppose -30 = -u - 5x, -2u + 0u + 30 = 4x. What is the remainder when z is divided by u? 3 Suppose -158z + 165z - 1799 = 0. Calculate the remainder when z is divided by 43. 42 Let l = -97 - -151. Let k = -42 + l. Calculate the remainder when 56 is divided by k. 8 Suppose w - 7r + 9r - 75 = 0, -219 = -3w - 4r. Let d(q) = 4q - 4. What is the remainder when w is divided by d(4)? 9 Let k(j) = j*3 + 18j*2 - 2j - 26. Suppose 0 = -4u - 20, 5d - 4 = 4u + 1. Calculate the remainder when (-3)/((-1)/(-16)d) is divided by k(-18). 6 Suppose -38 = -f - 32. Suppose 260 = 2i - 4l, i - 5l = fi - 605. What is the remainder when i is divided by 21? 19 Suppose 2p - 3z + 8 = 2z, 4p - 4z - 8 = 0. Let i be (-1440)/(-38) + 2/19. Let v = 55 - i. What is the remainder when v is divided by p? 5 Let z = 173 - 144. Calculate the remainder when 40 is divided by z. 11 Suppose -3x + a - 5 = 0, -2x - 15 = x - 3a. Suppose 8k - 11 - 197 = x. Calculate the remainder when 100 is divided by k. 22 Let d(u) = -u3 - 19u*2 - 17u + 22. Let y = -4 + 22. What is the remainder when y is divided by d(-18)? 2 Let d(p) = 4p2 - 12p - 16. Calculate the remainder when 163 is divided by d(6). 51 Suppose -3o = -2 - 22. Suppose -5u + 0b + 2b + 45 = 0, -3u - 2b = -27. What is the remainder when (u/(-6))/(3/(-28)) is divided by o? 6 Suppose -19g + 12 = -17g. What is the remainder when 53 is divided by g? 5 Let r = 103 + -28. Suppose -5g + g = 5b - r, -2b - g + 30 = 0. What is the remainder when b is divided by 8? 7 What is the remainder when (928/(-630))/((-2)/690) is divided by 11? 6 Let y(d) = d*2 + 12d - 1. Let x be y(-11). Let f be x/(-6)(-42)/4. Let n = f - -31. What is the remainder when 27 is divided by n? 7 Suppose -3o + 82 = -29. Calculate the remainder when o is divided by 7. 2 Let h be 18/(-24) + 62/8. Suppose 5y - 1 = -3n, y + 39 = hn - 2n. Let v(r) = r*3 + 2r*2 - 4r + 1. Calculate the remainder when n is divided by v(-3). 3 Let l = -322 + 221. Let j = -27 + 18. What is the remainder when 41 is divided by 2/j - l/9? 8 Let h(y) = y*2 + 7y + 1. Let o be h(-7). Let m = o + 4. Suppose -d + 17 = -t, 0 = 3d - 2t - 65 + 14. What is the remainder when d is divided by m? 2 Let d(a) be the first derivative of 0a - 1/4a*4 + 6 - 2a3 - a2. Calculate the remainder when d(-6) is divided by 7. 5 Let p(n) = -7n - 6. Let l be (40/(-2))/(18/27). What is the remainder when (-588)/(-10) - 6/l is divided by p(-3)? 14 Let c = -1 - -1. Suppose c = 2n - 44 - 98. Suppose -3z - 4h = -183, 0z + z = 2h + n. Calculate the remainder when z is divided by 22. 21 Let b = -14 - -23. Let y(l) = -l*3 + 9l*2 + 6. Suppose 2k = -236 + 280. What is the remainder when k is divided by y(b)? 4 Suppose o = -4z + 20 + 14, 0 = 5z + 5o - 50. Suppose -48 = -2i + z. What is the remainder when i is divided by 18? 10 Suppose -1145 = -38v + 3263. Calculate the remainder when v is divided by 108. 8 Suppose 3u = 4y + 30, 50 = 5u + y - 3y. Calculate the remainder when 67 is divided by u. 7 Let w(c) = 2c*2 + 2c - 1. Let z be w(-2). Let b = 29 + 7. Suppose 6 = zy - b. What is the remainder when 55 is divided by y? 13 What is the remainder when (-4)/(8/(-9))50/3 is divided by 26? 23 Let g(c) = -2c + 11. Let q be g(9). Let f(m) = m3 + 7m*2 - 2m - 10. Let h be f(q). Suppose -hi = -2 - 6. What is the remainder when 6 is divided by i? 0 Let t(k) = k3 - 6k*2 + 7k + 18. Calculate the remainder when 85 is divided by t(5). 1 Let c be 3 - (1 + 0 + 2). Suppose 0k + 4k + 296 = c. What is the remainder when -14/8k is divided by 10? 7 Let p = -52 + 89. Let g(n) = n*3 - 4 + 5n*2 + 2n*2 - 4n - 1 + 7n. What is the remainder when p is divided by g(-6)? 11 Suppose -60 = -4i + u + 50, -2i - 2u = -60. What is the remainder when 165 is divided by i? 25 Calculate the remainder when 75 is divided by -24(3 + -7 + (-15)/(-6)). 3 Suppose 17b - 654 = 2049. Calculate the remainder when b is divided by (-3)/(-12) + 318/8. 39 Let z be 4 + -5 - 3 - -120. Suppose 6q + z = 10q. Let n = 1 - -15. Calculate the remainder when q is divided by n. 13 Let i(f) = 35f + 1. Let j = -113 - -150. What is the remainder when i(3) is divided by j? 32 Let q(t) = t2 + 6t - 23. Let i(a) = a*2 - 5a + 7. Let r be i(4). Let v be 11/(-33) - 29/r. What is the remainder when 63 is divided by q(v)? 12 Let a(l) = l*3 - 3l + 2. Let j be a(2). Suppose 0c - t = -5c + 267, jc = 4t + 220. What is the remainder when c is divided by 8? 5 Suppose -181 = -13l + 196. What is the remainder when 111 is divided by l? 24 Suppose 2s = 6s - 12. Suppose 12p = 9p + 6. Calculate the remainder when s is divided by p. 1 Suppose 0 = -15y + 14y - 33. What is the remainder when 2/11 - 192/y is divided by 2? 0 Calculate the remainder when (-20)/10 + 6 + 1 - -81 is divided by 45. 41 Suppose -1904 = 20k - 4184. What is the remain	{ "pile_set_name": "DM Mathematics" }
23 = -5h - 2w, 4h + 4w = kw + 20. Factor 3x*4 + 3x4 - x3 + hx3 - 6x*2 - 4x + 2x5. 2x(x - 1)(x + 1)*2(x + 2) Let y(c) be the third derivative of 0c3 + 0c - 1/720c6 + 1/1260c*7 + 0 - 1/360c*5 + 1/144c*4 + 45c*2. Factor y(u). u(u - 1)*2(u + 1)/6 Suppose o - 3o + 3f + 179 = 0, f - 3 = 0. Determine t, given that -ot + 1452 - 38t + 5t2 - 2t*2 = 0. 22 Determine f so that 38 - 84f + 90f2 - 26f3 + f4 + 14f3 - 11f*3 - 13f - 9f2 = 0. 1, 2, 19 Let z be ((-15)/((-1050)/(-20)))/((-15)/105). Solve -16/5 + 4/5a + 2/5az = 0. -4, 2 Let a(l) = -5l*2 + 11l - 6. Let j(n) be the first derivative of 16n3/3 - 17n*2 + 18n - 68. Let o = -1 + -9. Let s(g) = oa(g) - 3j(g). Factor s(h). 2(h - 3)(h - 1) Let x be 10/8112(-15)/(-1050) - 15/8. Factor -57/8l2 + 105l + xl3 - 98. (l - 28)2(l - 1)/8 Let x(u) = -2u3 + 21u*2 + 12u - 9. Let b be x(11). Let 2l3 + 524l - 136l2 - 89l*2 - 260 - 29l*b + 2l*3 - 14l*2 = 0. Calculate l. 1, 65 Let h = 2 - -2. Suppose -l - 3l + 6 = -5d, 4d = 2l. Let -4w*5 - 15w*3 + 2w*2 - 33w*3 - 34w*d - 24w*h = 0. What is w? -2, 0 Suppose -5 = 3n - 14. Suppose -51 = nv - 20v. Factor 6r2 - 627r + vr2 - 3r*4 + 3r*3 - 6 + 624r. -3(r - 2)(r - 1)(r + 1)2 Let x be 20/(69/(-1647)). Let a = x - -612. Factor -22/9j - 4/9 - aj*2. -2(j + 1)(9j + 2)/9 Suppose 3848z - 925444 + 70z*2 - 39z*2 - 35z*2 = 0. What is z? 481 Let v(f) = 4f*4 - 8f*2 - 4. Let j be (13/(-3) + 3)/(4/12). Let s(y) = -4y*4 + 9y*2 + 5. Let n(a) = js(a) - 5v(a). Factor n(h). -4h*2(h - 1)(h + 1) Suppose 4a = 5v + 8, -a = 2a - 4v - 6. Determine r, given that -7r*a + 11r*2 - 3r*2 - 3r + 2 = 0. 1, 2 Let j(g) be the first derivative of g*4/42 - 86g*3/63 - 142g*2/21 + 368g/21 + 3230. Find k such that j(k) = 0. -4, 1, 46 Let u(i) be the second derivative of -i*4/90 - 29i*3/15 - 84i*2/5 + 3639i. Solve u(o) = 0 for o. -84, -3 Let v(k) be the second derivative of k5/210 - k4/6 + 8k3/7 + 167k*2/2 - 11k. Let t(i) be the first derivative of v(i). Suppose t(a) = 0. Calculate a. 2, 12 Let g(i) be the third derivative of -1/112i8 + 17/280i*7 + 0 - 64i*2 + 11/40i*5 - 1/4i*4 + 0i + 1/8i3 - 7/40i*6. Solve g(y) = 0 for y. 1/4, 1 Let f(a) be the third derivative of -11/120a*5 + 1/1344a*8 + 7/160a*6 + 40a*2 + 1/12a*4 + 0a + 0a3 + 0 - 1/105a*7. Let f(m) = 0. What is m? 0, 1, 2, 4 Suppose 38 = -87s + 91s - 3n, -3s - 4n = 9. Factor -3d4 - 1/3d*s + 2/3d*2 - 14/3d*3 + 5d + 7/3. -(d - 1)(d + 1)3(d + 7)/3 Let k(n) be the third derivative of -1/24n4 + 69 + 1/60n*6 - 1/2n*3 - 1/70n*7 - 1/336n*8 + 0n - n*2 + 1/10n5. Factor k(v). -(v - 1)2(v + 1)2(v + 3) Let w = -584 - -202. Let o = w + 1531/4. Let 0 + b*2 + 1/4b*3 + ob = 0. What is b? -3, -1, 0 Suppose 4n = -0 - 4, 0 = -5z + 2n + 12. Suppose 5g - 2g + 4x = 4, 0 = -3g + 2x - z. Factor 2/7s2 + 4/7s*3 + g + 2/7s*4 + 0s. 2s2(s + 1)*2/7 Let -4/7 + 34/7u + 4/7u2 - 34/7u*3 = 0. What is u? -1, 2/17, 1 Let i(s) be the first derivative of 4/5s*5 + 0s*2 + 8s*4 + 0s - 75 + 64/3s3. Factor i(u). 4u*2(u + 4)*2 Let i(z) be the first derivative of 9/2z - 3z2 - 1 + 1/2z*3. Factor i(k). 3(k - 3)(k - 1)/2 Suppose -98/3 - 77/3s + 1/3s4 + 13/3s*3 + 11s*2 = 0. Calculate s. -7, -1, 2 Suppose 816 = 2r + 2s + 822, -2r = -s - 12. Let c(w) be the second derivative of -20w + 0 + 1/2w*r + 3/4w*4 - 3w*2. Factor c(n). 3(n + 1)(3n - 2) Let q be (30/20)/(3/4)1. Find j such that 15j - 45 - 20j3 - 7j*2 + 28j + 17j + 17j*q - 5j*4 = 0. -3, 1 Let o be (1/(-6))/((-13)/78)0. Let x be (-2)/(-9) - (-8)/36. Find h, given that 2/9h5 + o + 2/3h*4 - 2/3h*2 - xh + 2/9h3 = 0. -2, -1, 0, 1 Factor -100p*3 + 0 + 35/2p*4 + 1/2p*5 + 0p*2 + 0p. p*3(p - 5)(p + 40)/2 Let m = 4/2897 - -150632/8691. Let w(r) be the first derivative of -96r*2 - 144r - mr3 - r4 - 29. Factor w(q). -4(q + 1)(q + 6)2 Let d = -1086 - -1089. Let u(r) be the second derivative of -5r + r*2 - 1/8r*4 + 0r*d - 1/40r*5 + 0. Factor u(l). -(l - 1)(l + 2)2/2 Let r(p) be the first derivative of -p5/10 + 23p4/30 - 9p*3/5 + 9p*2/5 - 28p - 38. Let s(h) be the first derivative of r(h). Factor s(q). -2(q - 3)(q - 1)(5q - 3)/5 Let n(m) be the second derivative of m*2 + 6m - 5/12m5 + 5/2m*4 - 10/3m*3 + 0. Let j(h) be the first derivative of n(h). Solve j(i) = 0 for i. 2/5, 2 Let y be -2(0 - -2 - 3). Let c be (-82)/440/(-410). What is f in 0 + yf*4 - 4/9f*3 - 8/9f*5 + 0f + 0fc = 0? 0, 1/4, 2 Let b(l) = -72l*3 - 36l*2 - 12l + 168. Let o(t) = -10t3 + t. Let n(p) = -b(p) + 8o(p). Determine u so that n(u) = 0. -2, 3, 7/2 Let c be 100/(-6) + (14 - (-40 + 37)). Factor -7/3 - 2u + cu*2. (u - 7)(u + 1)/3 Let o be 1/(-1)(-4)/28. Let v be -3 + (-10)/14 - (-11 + 7). Factor -3/7j + 3/7j3 + 1/7j*2 + oj*4 - v. (j - 1)(j + 1)*2(j + 2)/7 Let n = -476656 + 476658. Factor z + 9/5zn + 3/5z*3 - 1/5z*4 + 0. -z(z - 5)(z + 1)2/5 Let s = -1/97882 - -73412/48941. Suppose 15v + sv2 + 63/2 = 0. Calculate v. -7, -3 Suppose 4s*2 + 3 + 65s*4 - 6s4 - s2 + 18s - 11s*4 - 72s*3 = 0. What is s? -1/4, 1 Solve 28/5y*2 + 1/5y*3 + 141/5y + 198/5 = 0. -22, -3 Factor -2465a + 165 + 5a*2 - 46 + 2570a + 71. 5(a + 2)(a + 19) Let z(h) be the first derivative of 2h3/33 + 71h*2/11 + 810. Factor z(o). 2o(o + 71)/11 Let b(h) be the third derivative of -h6/120 + h5/6 + 19h*4/2 + 132h3 + h2 + 14h + 12. Solve b(k) = 0. -6, 22 Suppose -14 = 3p + 4m, -p + 4m + 28 - 6 = 0. Suppose p + 158 = 4t. Let -12u*2 + u - tu*4 - 16u*5 - 64u*3 + 7u - 20u4 = 0. Calculate u. -2, -1, 0, 1/4 Let t(j) be the first derivative of 6j - 2j3 + j2 - 1/2j*4 + 77. Factor t(v). -2(v - 1)(v + 1)(v + 3) Let b be (-2 - -3)/((-2)/(-46)). Suppose 22w + 2 = bw. Factor 6d - 15d + 24d + 5d*w + 10. 5(d + 1)(d + 2) Let w(m) be the third derivative of -m7/210 - 7m*6/30 - 23m*5/12 + 399m*2 + 3. Suppose w(b) = 0. What is b? -23, -5, 0 Let z be (-15)/65 + (3819/494 - 6). Let -1/2c5 - c3 + zc4 + 0 + 0c + 0c2 = 0. Calculate c. 0, 1, 2 Suppose -17 - 11/2b*2 - 45/2b = 0. What is b? -34/11, -1 Let r(i) = -5i2 + 52i + 100. Let x(p) = 6p2 - 53p - 100. Let f(t) = 5r(t) + 4x(t). Factor f(q). -(q - 50)(q + 2) Find h such that 160/3 - 12h*2 - 712/3h = 0. -20, 2/9 Let l = 6869235/4 - 1717308. Factor lg2 + 7/4g - 1/2g4 + 3/4 - 3/4g3. -(g + 1)3(2g - 3)/4 Let v(y) be the third derivative of 4y2 - 3/4y*3 - 1/672y*8 + 0 + 5/16y*4 + 3y + 1/60y7 + 1/60y*5 - 7/120y*6. Find f such that v(f) = 0. -1, 1, 3 Let q be (21/(-35))/((-11)/5 - -2). Suppose -13t*q + 21t - 3t4 - 4t - 47 + 53 - 7t2 = 0. Calculate t. -3, -2, -1/3, 1 Let o be 29/58(-2 + -322). Let u be (0 - -2)(-36)/o. Factor 2/9j - 2/9j5 + 0j*3 + 4/9j*2 + 0 - uj*4. -2j(j - 1)(j + 1)3/9 Let a(n) be the first derivative of n6/15 + 8n5/25 - 8n*4/5 - 128n3/15 - 524. Suppose a(i) = 0. Calculate i. -4, 0, 4 Let i(u) be the second derivative of -u4/12 + 19u3/6 - 30u*2 + 70u - 3. Factor i(d). -(d - 15)(d - 4) Let f = -6483 + 6486. Let b(h) be the third derivative of -1/330h*5 + 0h + 1/66h4 + 0 - 1/33h*f - 23h*2. Factor b(g). -2(g - 1)*2/11 Let u be (5 - 1)((-293832)/(-352))/159. Determine f, given that -3/2f3 - uf*2 + 3/2f + 21 = 0. -14, -1, 1 Factor 6903/5d3 + 6348/5d + 12972/5d2 + 0 + 282/5d*4 + 3/5d*5. 3d(d + 1)2(d + 46)*2/5 Let m be (-139106)/15270 + (-52 - -63). Let r = m - 12/509. Let 2z + 6/5z4 - 2/15z*5 - rz*3 - 14/15 - 4/15z*2 = 0. Calculate z. -1, 1, 7 Let v = 6968 - 20903/3. Let w(t) be the third derivative of 0t - 1/60t5 + 0 - vt*4 - 13t*2 - 8/3t3. Factor w(z). -(z + 4)2 Let d(f) be the second derivative of f*5/4 - 35f*4/12 + 35f*3/6 + 75f*2/2 + 5196f. Let d(m) = 0. What is m? -1, 3, 5 Suppose -2w + 11w = 90. Let -9l3 + 20l*2 + 5l*3 + wl*2 - 60l + 28 + 6l*2 = 0. Calculate l	{ "pile_set_name": "DM Mathematics" }
-4t + t = -18. Let k be 1/6 + 23/t. Suppose 3 = g + k. Which is the third biggest value? (a) -1/5 (b) g (c) 1 b Let r(v) = -21v - 445. Let x be r(-21). Let p be (4/10)/((-1)/2). What is the smallest value in x, 1, p? x Let k = -87 - -59. Let d = -25.6 - k. Let v = 2.8 - d. Which is the third biggest value? (a) 1/3 (b) v (c) 1/13 c Let v = 908.6 + -909. Which is the third smallest value? (a) v (b) -15 (c) 3 (d) -3/5 a Let m be (1-10)/21. Let b(d) = -d*3 + 4d*2 - d + 1. Let u be b(3). Let l be (-8)/2016/(-32). What is the third smallest value in l, u, m? u Let j = -12.7 - -1.7. Let o = -2.069 + 0.069. What is the second biggest value in -2/11, o, j? o Suppose 2h = -18 + 54. Let j = -13 + h. Let f be (2/2)/(j/5). Which is the biggest value? (a) f (b) 3 (c) -0.4 b Suppose 2h = -9k + 4k + 84, 3k = 3h + 63. Let j be (-22)/k + 2/9. Let d be j/48/(-5). What is the third biggest value in -2/9, d, 1? -2/9 Let a = -0.03 + -5.97. Let b = 0 + a. Let g = -6.2 - b. What is the biggest value in g, -3/4, 1? 1 Let z = -0.639 + 0.139. Let y = -45 + 44. What is the third biggest value in y, -5, z? -5 Let w(v) = -4v*2 + 21v - 4. Let p be w(5). Let r = -9/4 + 3. What is the second biggest value in r, p, 0.1, -2/17? r Let k = 1 - 1. Let y be ((-14)/8)/(1/(-4)). Suppose y - 1 = h. Which is the smallest value? (a) k (b) 0.3 (c) h a Let b(g) = 13g - 148. Let a be b(11). What is the second smallest value in -20, 0.08, a? a Let t = -334.96 - -335. Which is the third smallest value? (a) -0.2 (b) t (c) 0.09 c Let g = 2.0893 + -0.0893. Which is the biggest value? (a) -1/4 (b) -4 (c) g (d) -110 c Let n = -214402/47 - -4562. Let c = n + -414/517. Let m = -0.94 + 0.54. What is the smallest value in 2, c, m? c Let k = 0.522 - 10.522. Which is the third biggest value? (a) 0.3 (b) k (c) 4 b Let y(l) = -l - 2. Let h be y(-3). Let z be (7/(-3) + 2)3/h. Let g = -3 + 2.6. What is the biggest value in z, g, 0.3? 0.3 Let f = 0.8 - 0.7. Let g = 4.5 - 5. Which is the third smallest value? (a) 3/4 (b) g (c) f a Let x = 20.6 + -23. Let u = 4.4 + x. Which is the second biggest value? (a) 1/5 (b) 0.4 (c) u b Let h be -5(-4 - -5) - (-48)/9. What is the second smallest value in h, -5, -3, -0.3? -3 Let v = -2.5 - -3. Let k = 25.2 + -3.2. Let j = 21 - k. Which is the second smallest value? (a) v (b) -1/5 (c) j b Let l = -66.71 + 67. Let y = -25.71 - l. Let m = y - -26.2. What is the second smallest value in 2/15, -3, m? 2/15 Let u = 2.97 - -0.03. Let o = 23.2 + -21.2. Which is the biggest value? (a) o (b) u (c) 1/5 b Let n = -19/15 + 7/15. Let t = 61/60 + -4/15. Suppose -i + 3z = -4, -i - 2z = -0z + 1. Which is the second smallest value? (a) t (b) i (c) n a Let u = -0.3 - -0.1. Let t = u - -0.3. Let s be 43/(-18) - 77/(-66). Which is the third smallest value? (a) s (b) t (c) -1 a Let x = -0.03 - -0.33. Let k = -1078 + 1078.2. What is the third biggest value in k, 2, x? k Let s(m) = -m2 - 3m - 6. Let h be s(-4). Let k be -7 + 5 + (-14)/h. Let n be 2/(-4) + 6/(-4). Which is the third smallest value? (a) -0.3 (b) n (c) k a Let o = -3 - -5. Let t = -45.79 + 45.69. Which is the second biggest value? (a) t (b) -3 (c) 6 (d) o d Let q = 17/15 + -4/5. Let s = -5.1 - -4.7. Which is the second biggest value? (a) s (b) -4/3 (c) q (d) 0.6 c Let v = -0.0487 - -0.3487. Which is the biggest value? (a) -3 (b) v (c) 3 (d) -1 c Let n be (1/(-2 - -3))/((-22)/(-4)). Suppose -20h - 357 = -3h. What is the third smallest value in n, h, 2? 2 Let g = -2.047 - -0.047. Suppose 11 = 5r - o - o, -5o = -10. Which is the biggest value? (a) 0.3 (b) r (c) g b Let o = -31 - -32. Let j = 94 + -90. Which is the third biggest value? (a) 0.2 (b) j (c) -1/4 (d) o a Let r = 22.6 - 18. Let x = 5 - r. Let j = 213 - 218. Which is the second biggest value? (a) x (b) -2/15 (c) j b Let d = 0.8 - 1. Let h = -3.1 + 2. Let o = h - -5.1. Which is the smallest value? (a) d (b) -2/7 (c) o b Let g be 2 - ((-3 - -2) + -2 - -4). Let r = -0.05 - -0.15. Which is the second smallest value? (a) g (b) r (c) 2 a Let k = -292/7 - -42. Which is the smallest value? (a) -30 (b) 5 (c) k a Let s = 2.999 - 0.189. Let j = -0.19 - s. What is the second smallest value in j, 0.3, 1? 0.3 Let b = 476 - 475.4. What is the smallest value in 0.16, 1, b? 0.16 Let m = -158 + 1583/10. What is the third biggest value in m, -5, 2? -5 Let w = 1.43 - -34.47. Let n = -36 + w. What is the second biggest value in 1, 5, n? 1 Let k be 100/(-66)(-3)/(-12) - 336/(-616). Let i be 5/33 + (-1)/3. Which is the smallest value? (a) k (b) 3/5 (c) i c Let l = 5 + -5.4. Let i = 102 + -104.6. Let q = i - -3.6. Which is the biggest value? (a) 0.1 (b) q (c) l b Let h = 322 + -318. Which is the fourth biggest value? (a) -1/4 (b) h (c) -7 (d) -4 c Let o = -98 - -98. Suppose 0 = -2s + s + 3. Suppose 0h - x + s = -2h, -5x = 15. Which is the second biggest value? (a) h (b) -0.4 (c) o b Let t = 283 + -276. Which is the second biggest value? (a) t (b) -1/2 (c) 0.1 (d) -0.3 c Let l = 27 + -25.3. Let f = l + -1.5. Let x = -3 + 2. Which is the third smallest value? (a) x (b) -0.1 (c) f c Let t = -128 - -898/7. Let p = -4762 + 4760. Which is the fourth smallest value? (a) t (b) -3 (c) p (d) -4 a Let g = 0.4 - -3. Let m = 0.5 - -1.1. Let x = m + g. What is the biggest value in -0.4, x, 0.4? x Let q = 5.0229 + -0.0229. Let k be (-2)/4 - 38/(-60). Which is the smallest value? (a) k (b) 2/7 (c) -3/4 (d) q c Let j = 84.3 + -82. Let z = -2.7 - j. What is the second smallest value in 1/5, z, -0.3? -0.3 Let m = -36/17 - -358/153. Let l(t) = t3 + 9t*2 + 10t + 17. Let s be l(-8). Which is the smallest value? (a) s (b) m (c) 0 (d) 12 c Let f = 32.2 - 32.7. What is the third smallest value in -0.2, -11, 2/7, f? -0.2 Let k = -127/3 - -42. Which is the second biggest value? (a) 67 (b) k (c) -0.1 c Let q = 1.2 + -1.07. Let s = -0.31 + q. Let f = 2.82 - s. Which is the third smallest value? (a) f (b) 2 (c) 1 a Let l = -1105 - -1100. What is the smallest value in 10/17, -3, -1/6, l? l Let j be 5 + -9 + 13 - -7. Which is the fourth smallest value? (a) -0.3 (b) j (c) -4/7 (d) -4 b Suppose 2k + 5p = 0, -p + 3p + 24 = 4k. Let a = -7307/45 - -813/5. What is the third biggest value in 3, a, k? a Let d = 0.1 + -0.22. Let w = -0.88 + d. What is the second smallest value in w, 2/11, -2/3? -2/3 Let k = -1950 + 1949.9. What is the smallest value in k, 756, -0.5, 4? -0.5 Let n = 0.166 - 3.166. Let o(x) = -x*2 - 6x + 4. Let z be o(-6). What is the biggest value in n, -0.3, z? z Suppose -m + 2p + 7 = 0, -5p - 19 + 0 = -3m. Let u = 22 + -10. Let t = -10 + u. What is the second smallest value in -3, m, t? t Let o = -11.09 + 0.09. Let z = 11.5 + o. Let d = 30 + -32. Which is the second smallest value? (a) d (b) -3 (c) z a Let z = -184 + 194. Which is the third biggest value? (a) 0 (b) -5 (c) z b Let m be ((-46)/(-2) + -1)/(-2). Let y be -2 + -1 - 67/(-5). Let a = y + m. What is the biggest value in 0.05, a, -2? 0.05 Let r = 2 + -6. Suppose 4b = 4l + 12, -4l - b + 32 = 9. What is the fourth smallest value in -2/5, r, l, 0.4? l Let h = 32 + -53. Let y = 21.2 + h. What is the second smallest value in 0.3, 15, y? 0.3 Let r = 264 + -3962/15. What is the smallest value in -0.16, r, 4, -2? -2 Let i = -289 + 297.02. Let m = -8 + i. Let d = -1/61 - 56/305. Which is the third biggest value? (a) 0.2 (b) d (c) m b Suppose 3j = 6j - 750. Let k = j + -757/3. Let g = k - -2. Which is the third biggest value? (a) -1/7 (b) 0 (c) g c Let y = -0.114 - -1.114. What is the second smallest value in y, 0.2, -1? 0.2 Let m(d) = d*3 + 4d*2 - 5d + 2. Let o be m(-5). Let h be (0 + -1)o + 10. What is the third smallest value in -0.2, h, -3? h Let u(q) = q3 + 7q*2 - 4q - 9. Let w(x) = -x*3 - 8x*2 + 5x + 10. Let l(v) = 3u(v) + 2w(v). Let a be l(-5). What is the biggest value in -1/40, 0, a? a Suppose -p = -b + 3b + 134, 2b - 2p + 122 = 0. What is the second biggest value in b, 3, -1/3? -1/3 Let l be 1736/(-42). Let x be -9 + -1(l - -3). Let m be (-7 - x) + 45/51. Which is the second smallest value? (a) -1/7 (b) m (c) 6 b Let z(h) = -2*h - 12. Let x = 23 - 3	{ "pile_set_name": "DM Mathematics" }
578y + 17. Determine t(-4). 9 Let z(m) = 87m*2 + 5786m - 147. Determine z(-67). 2734 Let l(p) = -1141p2 - 66p - 1. Give l(-1). -1076 Let q(l) = 404l2 + 12119l - 91. Give q(-30). -61 Let u(s) = -15s2 + 242s + 253. Give u(-1). -4 Let y(s) = 408s - 3137. What is y(8)? 127 Let g(u) = -6u*2 - 88u + 2551. Give g(15). -119 Let m(r) = -53307r - 426454. Calculate m(-8). 2 Let i(o) = 292o + 22229. Give i(-76). 37 Let h(s) = 18934s - 227139. Determine h(12). 69 Let m(h) = -h3 - 107h*2 + 3677h - 9421. Calculate m(25). 4 Let n(a) = 114168a - 3767552. Determine n(33). -8 Let k(y) = 6y3 + y2 - 2199y - 4391. Give k(-2). -37 Let b(t) = t2 + 8384t + 770990. Calculate b(-93). -73 Let p(y) = -y*3 + 11y*2 + 203y - 1593. Give p(8). 223 Let j(z) = 12z2 - 32z - 434. What is j(-7)? 378 Let z(d) = 51d2 - 1638d + 271. Give z(32). 79 Let k(y) = -2y2 + 287y + 288. Determine k(145). -147 Let s(b) = 26b3 + 30b*2 + 221b + 210. What is s(-1)? -7 Let n(u) = 276069u + 276088. Give n(-1). 19 Let f(m) = 50676m - 10. Calculate f(0). -10 Let c(p) = -p*3 - 21p*2 - 53p - 953. Determine c(-18). -971 Let x(n) = -35558n + 1884582. Determine x(53). 8 Let s(f) = -124f + 557. What is s(-5)? 1177 Let x(o) = -62o - 1031. Give x(8). -1527 Let i(n) = 2n*2 + 572n - 25895. Determine i(43). 2399 Let j(d) = 8604d + 6590647. What is j(-766)? -17 Let g(k) = -19k*3 + 162k*2 + 800k + 18. Calculate g(-5). 2443 Let u(k) = 1824k + 1926. Give u(-2). -1722 Let g(j) = j2 - 1383j - 25211. Give g(-18). 7 Let y(i) = 3i3 + 73i*2 - 52i - 1925. What is y(-24)? -101 Let z(w) = -873w + 515689. Determine z(591). -254 Let y(r) = 18974r - 56735. Give y(3). 187 Let p(o) = -176o2 + 13557o - 329. Calculate p(77). 56 Let p(b) = b*3 - 133b*2 + 1042b - 4. Determine p(9). -670 Let d(x) = x*3 - 77x*2 - 242x + 13046. Give d(78). 254 Let v(a) = -3a2 + 619a + 67661. Determine v(-79). 37 Let p(m) = -m*3 - 95m*2 - 876m - 260. Calculate p(-10). 0 Let r(w) = -8w2 + 163w - 455. Determine r(17). 4 Let k(d) = 4427d + 305330. What is k(-69)? -133 Let i(g) = -g3 - 34g*2 - 211g - 1204. What is i(-28)? 0 Let y(w) = w*3 - 183w*2 - 29w - 63228. Calculate y(185). -143 Let w(i) = -i*3 - 36i*2 + 250i - 7. Calculate w(5). 218 Let g(t) = t*2 + 672968t + 1. What is g(0)? 1 Let v(h) = -15021h + 420589. Determine v(28). 1 Let g(j) = 177711j - 533117. Give g(3). 16 Let s(h) = h*3 + 10h*2 - 422h + 143. Calculate s(16). 47 Let s(i) = -42204i + 35577983. Determine s(843). 11 Let d(w) = 20273w + 709549. Determine d(-35). -6 Let s(i) = -23166i + 277976. Determine s(12). -16 Let u(c) = 3c*2 + 684c + 1951. Give u(-220). -3329 Let n(i) = i*3 + 11i*2 - 281i - 2. Give n(13). 401 Let s(u) = -u*3 + 17u*2 - 111u + 1344. Determine s(16). -176 Let h(g) = g*3 + 2g*2 + 1183g + 35683. Give h(-22). -23 Let v(d) = -d*3 - 221d*2 - 25d - 5522. What is v(-221)? 3 Let r(h) = -2h2 - 4414h + 17692. What is r(4)? 4 Let v(z) = -767z - 9074. Calculate v(-12). 130 Let r(i) = 21i*2 - 13803i - 265660. Calculate r(676). 8 Let l(x) = -199x + 7777. Give l(25). 2802 Let p(g) = 494g + 43560. Calculate p(-88). 88 Let q(b) = 655b + 119848. Give q(-183). -17 Let v(t) = -3875t + 1368. What is v(1)? -2507 Let y(j) = j*3 - 322j*2 - 5055j - 128. What is y(337)? -128 Let t(u) = -11u3 + 151u*2 + 4u - 44. Calculate t(14). -576 Let z(b) = -b*3 + 74b*2 + 241b - 798. Determine z(77). -28 Let o(m) = -m*2 - 1977m + 611724. What is o(272)? -4 Let k(q) = 123q + 105. Calculate k(-4). -387 Let n(r) = 70r*2 + 1488r + 1768. Give n(-20). 8 Let a(h) = -2621866h + 13109334. Determine a(5). 4 Let d(m) = -m2 - 51163m + 2458116. Calculate d(48). -12 Let d(c) = c*2 + 40c - 10555. Give d(-125). 70 Let y(g) = -15757g + 204911. Determine y(13). 70 Let t(h) = 25h*2 + 2209h + 895. What is t(-88)? 103 Let j(l) = -3l2 - 419l - 1124. Calculate j(-137). -28 Let i(c) = -20c3 - 2577c*2 + 389c + 279. Give i(-129). 21 Let g(d) = -9d2 + 1541d - 9239. Give g(165). 1 Let g(d) = -4d2 - 120d - 579. What is g(-5)? -79 Let u(k) = -13k2 - 1183k - 1175. Give u(-90). -5 Let f(s) = 85s2 + 258s + 142. Calculate f(-2). -34 Let h(d) = 2511d - 117994. Calculate h(47). 23 Let s(y) = y2 - 32110y - 546157. Calculate s(-17). 2 Let m(y) = 3106y - 24647. Give m(8). 201 Let s(u) = -6u*3 + 10503u*2 - 10510u + 7. What is s(1)? -6 Let p(x) = x*3 + 96x*2 - 134x - 3463. Determine p(-97). 126 Let v(m) = m*3 - 2m*2 + 1140m - 3429. Calculate v(3). 0 Let h(s) = -678s - 5117. Give h(-8). 307 Let f(r) = -7197r - 79209. Give f(-11). -42 Let t(g) = 10g3 + 247g*2 + 183g + 285. Give t(-24). -75 Let z(s) = -2s3 + 25s*2 + 37s - 224. Calculate z(17). -2196 Let h(d) = 54553d - 818295. Determine h(15). 0 Let m(u) = u2 + 623u + 61881. What is m(-124)? 5 Let r(y) = 5y3 + 16y*2 - 13y - 194. Give r(-6). -620 Let f(m) = -m*3 - 118m*2 + 626m - 290. What is f(-123)? -1643 Let b(u) = 6u3 + 11u*2 - 59u - 61. Give b(-1). 3 Let w(c) = 10c2 - 536c + 5505. Determine w(12). 513 Let o(q) = -7058432q - 56467451. Determine o(-8). 5 Let u(f) = -3895f + 12111. Calculate u(3). 426 Let n(t) = 3t2 + 1187t + 5911. Calculate n(-5). 51 Let l(j) = 3j2 - 440j - 6836. Give l(-14). -88 Let o(l) = l*2 + 173l + 386. Determine o(-188). 3206 Let u(y) = 185y - 9133. Calculate u(55). 1042 Let l(y) = 2y*3 + 4y*2 - 4042y - 12112. Determine l(-3). -4 Let g(u) = 1089u - 238492. Determine g(219). -1 Let f(x) = 27932x + 1787643. Determine f(-64). -5 Let i(p) = -48550p - 291291. Determine i(-6). 9 Let i(w) = -27w*2 + 1050w + 8882. Determine i(46). 50 Let s(a) = -4a3 - 26a*2 + 92a + 342. What is s(-8)? -10 Let p(d) = -d*2 - 34d + 279. Calculate p(-59). -1196 Let b(g) = 19g3 + 7g*2 - 31g - 67. Calculate b(-2). -129 Let n(k) = 5678k - 806205. What is n(142)? 71 Let d(j) = -2j*2 + 428j + 9361. Determine d(234). 1 Let c(n) = n*3 - 77n*2 - 4130n + 313780. What is c(79)? -8 Let x(k) = 1804666k + 28874662. Calculate x(-16). 6 Let r(h) = h3 + 41h*2 + 21h - 2600. Determine r(-39). -377 Let a(q) = 2q2 + 5298q + 2513125. Give a(-619). -15 Let c(i) = 3653i + 40198. Determine c(-11). 15 Let a(y) = 4y*3 + 1350y*2 + 2021y + 1689. Calculate a(-336). 9 Let q(r) = r*2 - 142r - 2607. Calculate q(-18). 273 Let l(n) = n*3 - 1170n*2 + 326097n - 708. Calculate l(712). 4 Let r(n) = 160n2 + 69276n - 1362. Give r(-433). 370 Let d(a) = -2a3 - 19a*2 + 630a + 10043. Give d(-16). 3291 Let i(p) = p*3 + 352p*2 + 27718p - 2087. Give i(-233). 10 Let x(s) = s*3 - 21s*2 - 295s - 264. Calculate x(-9). -39 Let p(x) = -2x2 + 14371x + 215934. What is p(-15)? -81 Let o(x) = -17x3 - 58x*2 - 17x + 72. Determine o(4). -2012 Let u(o) = 3o2 + 1650o - 10042. What is u(6)? -34 Let m(b) = -2b2 - 161b + 40212. Determine m(112). -2908 Let s(l) = -9278l - 1428762. Give s(-154). 50 Let h(t) = t2 + 847t + 120075. Give h(-180). 15 Let h(s) = -s*3 - 118s*2 + 2450s - 107. What is h(18)? -71 Let p(h) = -3447h + 768705. Give p(223). 24 Let h(j) = -j3 - 39j*2 - 273j - 12. What is h(-9)? 15 Let d(v) = 355v2 - 76028v + 87960. Give d(213). -9 Let f(q) = 2q3 + 143q - 42. What is f(0)? -42 Let h(w) = -25259w - 1995458. Give h(-79). 3 Let o(x) = -46x*2 + 1443x - 1896. What is o(30)? -6 Let p(u) = u*3 + 121u*2 + 573u - 599. Calculate p(-116). 213 Let h(r) = -1379r + 12487. What is h(10)? -1303 Let z(i) = i2 + 374i + 19. What is z(0)? 19 Let u(g) = -g*3 + 103g*2 - 1038g + 95502. Calculate u(102). 30 Let j(t) = -2t3 + 57t*2 + 4684t - 135014. Give j(29). -19 Let z(y) = y*2 + 497y + 59810. What is z(-294)? 128 Let j(q) = 382821q + 1914099. Determine j(-5). -6 Let n(k) = 3k*2 - 14052k - 126690. Calculate n(-9). 21 Let m(g) = -4g3 + 42g*2 - 51g + 786. Calculate m(11). -17 Let l(x) = -1961x2 - 156885x - 391. What is l(-80)? 9 Let a(s) = -22s3 - 2s*2 + 52s + 204. Give a(-4). 1372 Let s(c) = 3c3 + 92c*2 + 30c - 368. Give s(-30). 532 Let d(b) = -549b + 149318. Give d(272). -10 Let m(t) = -t3 + 136t*2 - 222t - 23540. What is m	{ "pile_set_name": "DM Mathematics" }
3/1128? 12408 What is the common denominator of 19/24 and 151/2508? 5016 Find the common denominator of -27/269 and 18. 269 What is the least common multiple of 3 and 347? 1041 What is the least common multiple of 4 and 102? 204 What is the lowest common multiple of 8820 and 12? 8820 Calculate the least common multiple of 8 and 32. 32 Find the common denominator of 115/144 and -43/96. 288 Calculate the least common multiple of 126 and 8. 504 Calculate the common denominator of 5/3 and 71/2205. 2205 What is the least common multiple of 9 and 5? 45 What is the smallest common multiple of 93 and 33? 1023 What is the smallest common multiple of 156 and 42? 1092 Calculate the smallest common multiple of 96 and 30. 480 What is the common denominator of 38/27 and -47/12? 108 Calculate the smallest common multiple of 16 and 75230. 601840 What is the common denominator of 4/33 and 41/66? 66 Calculate the lowest common multiple of 1282 and 14. 8974 What is the least common multiple of 110 and 19206? 96030 Find the common denominator of 107/10 and -42/3415. 6830 Calculate the lowest common multiple of 490 and 14. 490 Find the common denominator of -47/72 and -53/8. 72 Find the common denominator of -143/2736 and -29/3420. 13680 Calculate the least common multiple of 216 and 864. 864 Find the common denominator of 71/387 and -101/378. 16254 Find the common denominator of -73/1820 and 79/455. 1820 What is the least common multiple of 20 and 480? 480 Find the common denominator of -31/165 and 9/110. 330 What is the least common multiple of 3248 and 20? 16240 Find the common denominator of -1/1670 and -16/167. 1670 What is the smallest common multiple of 872 and 109? 872 Calculate the common denominator of -179/30 and -25/2958. 14790 What is the common denominator of -26/385 and -23/462? 2310 Find the common denominator of 29/55 and 151/12. 660 What is the smallest common multiple of 2100 and 2100? 2100 What is the least common multiple of 12 and 7806? 15612 Calculate the common denominator of 117/12796 and -51/140. 63980 What is the least common multiple of 5355 and 45? 5355 What is the lowest common multiple of 624 and 26? 624 Find the common denominator of 109/4334 and 19/22. 4334 What is the common denominator of -127/240 and -7/192? 960 What is the common denominator of 5/32 and -81/88? 352 What is the smallest common multiple of 332 and 7? 2324 Calculate the common denominator of 67/12738 and 13/15. 63690 Find the common denominator of 25/6 and 109/30. 30 Calculate the common denominator of -21/8 and 41/272. 272 What is the least common multiple of 32 and 12? 96 What is the common denominator of 23/15 and -151/30? 30 Calculate the common denominator of -13/184 and 63/20. 920 What is the common denominator of 39/148 and 17/74? 148 Find the common denominator of -47/496 and -11/28. 3472 What is the common denominator of 13/12 and -97/24? 24 Calculate the smallest common multiple of 576 and 1504. 27072 Calculate the common denominator of -2/265 and 59/212. 1060 What is the common denominator of -47/252 and -107/1428? 4284 Find the common denominator of 37/60 and 93/4. 60 Calculate the least common multiple of 231 and 21. 231 Calculate the common denominator of 79/1248 and 85/156. 1248 What is the common denominator of -87/10 and -19/2530? 2530 What is the common denominator of 18/121 and -60/77? 847 What is the common denominator of -29/10 and -103/2004? 10020 Calculate the common denominator of -173/90 and 17/10. 90 Find the common denominator of 99/832 and -91/6. 2496 What is the common denominator of 16/663 and -95/4? 2652 Calculate the lowest common multiple of 828 and 612. 14076 What is the least common multiple of 12 and 648? 648 What is the smallest common multiple of 10 and 864? 4320 Calculate the common denominator of 53/1436 and 65/24. 8616 What is the least common multiple of 1584 and 1980? 7920 What is the common denominator of 56/285 and -51/380? 1140 What is the lowest common multiple of 100 and 3140? 15700 Calculate the common denominator of 55/3 and -86/2277. 2277 Calculate the common denominator of -43/36 and -107/48. 144 Find the common denominator of -47/8 and 29/46. 184 What is the common denominator of -29/40 and 79/988? 9880 Calculate the smallest common multiple of 3340 and 70. 23380 Calculate the smallest common multiple of 200 and 112. 2800 What is the smallest common multiple of 2 and 1791? 3582 What is the least common multiple of 244 and 22? 2684 What is the least common multiple of 665 and 7? 665 What is the lowest common multiple of 1264 and 28? 8848 Find the common denominator of -145/96 and -17/48. 96 Calculate the smallest common multiple of 189 and 63. 189 Calculate the common denominator of 101/210 and 83/80. 1680 Calculate the least common multiple of 12 and 604. 1812 Calculate the smallest common multiple of 4 and 87. 348 Find the common denominator of -95/24 and -37/216. 216 What is the lowest common multiple of 5594 and 6? 16782 What is the smallest common multiple of 2828 and 70? 14140 What is the common denominator of -71/904 and 101/904? 904 Find the common denominator of 25/478 and -7/6. 1434 Calculate the common denominator of -47/31040 and -25/6. 93120 Calculate the common denominator of -99/146 and 67/18. 1314 What is the least common multiple of 21 and 77? 231 Calculate the lowest common multiple of 105 and 18. 630 Find the common denominator of -99/490 and 76/105. 1470 What is the least common multiple of 7854 and 6006? 102102 Find the common denominator of -73/1580 and 101/5056. 25280 Find the common denominator of -29/1350 and 86/1215. 12150 Calculate the lowest common multiple of 6 and 119. 714 What is the least common multiple of 147 and 33? 1617 Calculate the common denominator of -62/5 and 44/4621. 23105 What is the lowest common multiple of 1200 and 40? 1200 Calculate the lowest common multiple of 78 and 360. 4680 What is the common denominator of 133/130 and 1/91? 910 Calculate the lowest common multiple of 207 and 2277. 2277 Find the common denominator of 157/228 and -25/1006. 114684 Calculate the lowest common multiple of 292 and 4. 292 Find the common denominator of -179/30 and 133/30. 30 What is the lowest common multiple of 6 and 36? 36 What is the smallest common multiple of 4 and 4158? 8316 What is the common denominator of 97/88 and 109/14? 616 Find the common denominator of -17/2 and 87/68. 68 Calculate the common denominator of -19/49 and 4/35. 245 What is the smallest common multiple of 6 and 2373? 4746 What is the least common multiple of 124 and 16? 496 Calculate the smallest common multiple of 1575 and 675. 4725 What is the lowest common multiple of 5 and 11? 55 Find the common denominator of 51/5 and 73/220. 220 What is the least common multiple of 1 and 7? 7 What is the smallest common multiple of 20 and 23890? 47780 Calculate the smallest common multiple of 8 and 14216. 14216 Find the common denominator of 58/77 and 95/1232. 1232 Find the common denominator of -51/350 and 7/53. 18550 What is the least common multiple of 462 and 1722? 18942 What is the lowest common multiple of 115 and 585? 13455 Calculate the smallest common multiple of 1276 and 154. 8932 What is the common denominator of -13/8 and -93/8? 8 Find the common denominator of -43/107 and 77/2. 214 What is the smallest common multiple of 84 and 2946? 41244 Calculate the common denominator of 93/178 and 47/624. 55536 What is the smallest common multiple of 70 and 3815? 7630 What is the smallest common multiple of 36 and 14? 252 Calculate the common denominator of -11/138 and 47/345. 690 Calculate the lowest common multiple of 5928 and 12. 5928 Calculate the common denominator of 17/135 and -133/150. 1350 Calculate the least common multiple of 430 and 5. 430 Calculate the common denominator of 2/495 and -79/21. 3465 Calculate the common denominator of -27/5 and -103/10. 10 What is the least common multiple of 8 and 506? 2024 What is the common denominator of -56/1977 and -68/21? 13839 What is the lowest common multiple of 68 and 136? 136 Calculate the common denominator of 11/345 and 121/138. 690 Find the common denominator of 71/266 and 83/20. 2660 Calculate the least common multiple of 2958 and 33. 32538 What is the l	{ "pile_set_name": "DM Mathematics" }
tors of m. 2, 3, 23 Suppose -46 = -10s + 144. Suppose sj - 5j - 3850 = 0. What are the prime factors of j? 5, 11 Let r = -39 - -41. Suppose 5t = 2v + r - 3, -2v - 2t + 8 = 0. Suppose -2z = -h + 8, -3z = -2z + v. List the prime factors of h. 2 Suppose -4123311 - 362963 = -338i. What are the prime factors of i? 13, 1021 Let h(d) = 12d*2 - 5d - 89. Let b(t) = 11t2 - 6t - 89. Let g(r) = 6b(r) - 5h(r). List the prime factors of g(-8). 383 Let i = 297 - 294. Suppose -x + 106 = -4t, -4x - it = t - 464. List the prime factors of x. 2, 3, 19 Let y = -56388 - -82398. What are the prime factors of y? 2, 3, 5, 17 Let m be 18/(10 - 7) - 4. Let x = 1 - 1. Suppose x = f - m - 66. What are the prime factors of f? 2, 17 Suppose 3l - 7 = 3z + 23, 5z = 5. Suppose 8i = -li + 8284. What are the prime factors of i? 2, 109 Suppose 0 = -5y + 5v + 25, -3y - 5v + 0v = -15. Suppose -18s - yd = -19s + 68, 0 = -5s - 5d + 370. What are the prime factors of s? 73 Suppose -14l - 315472 = -34l + 338268. List the prime factors of l. 32687 What are the prime factors of (-50(-32)/120)/(6/3753)? 2, 3, 5, 139 Let g = 87 + -91. List the prime factors of (8/4)/(g/(-326)). 163 Let t = 15527 + -8719. List the prime factors of t. 2, 23, 37 Suppose 63 = 14o - 91. What are the prime factors of -6 + o/((-33)/(-96))? 2, 13 Let a be (-1 - 0)/(-1) + (-80 - -151). Suppose -az + 46z = -20514. List the prime factors of z. 3, 263 Suppose 6v - v - x = 2, -3x = v + 6. Let q(m) = -m*2 - 2m + 4. Let s be q(v). Suppose w = -1, 5w = st - 406 + 113. List the prime factors of t. 2, 3 Let w = -2237 - -4682. Suppose 0 = -0f - f - 5, -w = -5t + 5f. What are the prime factors of t? 2, 11 Suppose 8 = -46m + 50m. Suppose 0 = -mo + 3t - t + 1288, -4t = 4o - 2536. What are the prime factors of ((-9)/(-27))/(1/o)? 3, 71 Suppose v + 8 = 3, 0 = -2d + 2v + 18. Suppose -10 = t - d. List the prime factors of (-2)/(18/69)t. 2, 23 Let o(c) = 1010c2 + 88c + 179. List the prime factors of o(-2). 13, 311 Suppose 86o = 93o - 7077. Let i = o + -689. What are the prime factors of i? 2, 7, 23 Let j(y) = 1298y - 444. List the prime factors of j(2). 2, 269 Let v(s) = -s3 + 15s*2 - s. Let b be v(16). Let d be 2/(-14) + b/56. Let l(n) = -12n + 9. List the prime factors of l(d). 3, 23 Suppose -5j + 6j - 1717 = -3b, b - 577 = -5j. Let i = b - 893. Let z = i + 482. What are the prime factors of z? 7, 23 Let v = -404 + 682. Suppose 9b + 5445 = 15525. Suppose -3r = -5t + b, t - 2r + 47 - v = 0. What are the prime factors of t? 13, 17 Let n(z) = 99z2 - 8z - 12. What are the prime factors of n(-3)? 3, 7, 43 Suppose -2k + 131 = 5u, 3k + 4u - 219 + 26 = 0. Let b be (2/4k)/(6/8). Suppose 0 = -2d + 5i + b, -5i = 4d - 2i - 32. List the prime factors of d. 11 Suppose -4h = -8h + 4j - 164, 2h + 78 = -2j. Let x(k) = -k2 + 21k + 13. Let b be x(18). Let p = b + h. What are the prime factors of p? 3 Let a(i) = 266i3 - i2 - 13i - 51. List the prime factors of a(4). 3, 5, 7, 23 Let o = -73 - -91. Let j be ((-136)/(-24) - 3)o/(-8). Let k(y) = 3y*2 - 12. What are the prime factors of k(j)? 2, 3 Let r(z) = 93z*2 + 25z - 63. Let n be r(3). Let c = n - 493. List the prime factors of c. 2, 89 Suppose -5m + 5g + 7773 - 248 = 0, -3m + 4536 = 4g. List the prime factors of m. 2, 13, 29 Suppose -15 = -85a + 82a. Suppose -y + 0y - 18 = 5q, 4y = -aq - 12. Suppose -140 = -yb + 114. List the prime factors of b. 127 Suppose 17 - 26 = -3v. Let s be (3 - v/2 - 2)4. List the prime factors of s - 27/(-6)64/3. 2, 47 Suppose 5f - w - 59 = 0, 3f - 28 - 4 = 4w. Let d be (1/(-3))/(6 - 7)f. What are the prime factors of (-4 - -5 - (-49)/d)12? 3, 53 Suppose 874 = 8k - 1278. Let y = 1846 - k. List the prime factors of y. 19, 83 Suppose 0 = 3z + 5a + 10 - 25, z + 4a - 5 = 0. Suppose zq = 6 - 616. Let y = 211 + q. List the prime factors of y. 89 Suppose 0 = 173t - 118t - 44165. List the prime factors of t. 11, 73 Let m be 8/(-28) + (9/7 - -2). Suppose 0 = -3v - 4h + 707 + 953, 0 = 4v + mh - 2218. What are the prime factors of v? 2, 139 Let j be (((-1665)/6)/(-5))/((-1)/2). List the prime factors of (j/(-5)2)/((-6)/(-20)). 2, 37 Let k(g) = 309g*2 - 29g + 143. List the prime factors of k(5). 7723 Let x(q) = -q + 4. Let z be x(4). Suppose p = c + 2, -20c + 40 = -19c + 5p. Suppose z = cl + 108 - 1348. List the prime factors of l. 2, 31 Let n = 339 + 511. Let q = 2105 - n. List the prime factors of q. 5, 251 Let n(p) = p*2 + 15p + 23. Let a be n(-14). List the prime factors of 2/(-8) + (9384/32 - a). 2, 71 List the prime factors of (1 + -19167)((-14)/5 + (-28)/140). 2, 3, 7, 37 Suppose 0 = -a + 3. Let c = -277 + 275. List the prime factors of 4 + (-2 - c) + a. 7 Let b = 29 + 5. Let s = -31 + b. Suppose -sy + 15 = 0, 3l + 3y + 48 = 4l. List the prime factors of l. 3, 7 Let a be (2 - 24/18) + (-2)/(-6). Let j be ((-1 - -1 - 1)2)/a. What are the prime factors of j/17 + 2860/34? 2, 3, 7 Let t = -50 + 57. List the prime factors of (-2 + t)(-1964)/(-20). 491 Suppose -5a + 112b + 20744 = 108b, 0 = -b - 6. What are the prime factors of a? 2, 7, 37 Suppose -4g - 43 = -v, 10g + 3v = 12g + 29. List the prime factors of (932/12)/(g/(-120)). 2, 233 Suppose 1542070 = 207h - 12094676. List the prime factors of h. 2, 32939 Suppose 2n + 1093g - 1095g = 3360, 0 = 5n + 4g - 8355. List the prime factors of n. 5, 67 Let q(u) be the second derivative of 571u5/20 + u4/12 - u3/2 + u2 + 7u. Let h be q(1). Suppose 7t = h + 199. List the prime factors of t. 2, 5, 11 What are the prime factors of 1/(5/88158) - 40/(-100)? 2, 19, 29 Let l(o) = -o3 + 11o*2 - 3o - 22. Let f(d) = d*2 + 20d + 71. Let w = -166 + 150. Let k be f(w). List the prime factors of l(k). 3, 17 Let s = -15670 + 25588. List the prime factors of s. 2, 3, 19, 29 Suppose -2c - 8 = -0c. Let j(r) = 18r - 3. Let t be j(c). Let q = 101 + t. List the prime factors of q. 2, 13 Let p(q) = 112q*2 - 173q - 721. List the prime factors of p(-4). 41, 43 Let x = 9842 + -4799. What are the prime factors of x? 3, 41 Suppose -u + 169 = -4y, -155 = -u + 5y - 8y. Let h = 218 - u. List the prime factors of h. 3, 19 Let i = -224 + 86. Let q = -105 - i. Suppose qn - 28n = 1000. What are the prime factors of n? 2, 5 Suppose -4h - h = 5l - 165125, 66032 = 2l - 4h. What are the prime factors of l? 2, 11, 19, 79 Let v = 5005 + -3511. Let p = -357 + v. List the prime factors of p. 3, 379 Let h be ((-12)/(-9))/((-8)/(-7524)). Suppose -48a + 4q + h = -46a, -3a + 1883 = -4q. List the prime factors of a. 17, 37 Suppose 23p - 32532 = 21p + 2n, n + 1 = 0. What are the prime factors of p? 5, 3253 Suppose 3a - 15950 = -5222. Suppose 0 = 60l - 64l + a. What are the prime factors of l? 2, 3, 149 Suppose 44q + 25q + 6q = 3299925. List the prime factors of q. 23, 1913 Suppose -f + 9u = 4u + 10, 4f - u + 2 = 0. Let v(q) = 8 + 1 - 4 - 2q + 3. List the prime factors of v(f). 2 Let z be 1/(7/(-280)-8). Suppose -315 = -2r - c, r - c = zr - 631. What are the prime factors of r? 2, 79 Suppose 16 = -x + 3x - 2m, 6 = -3m. Suppose -xs + 3s = 1554. List the prime factors of ((-7)/(-5) - 1) + s/(-5). 2, 13 Let a = -28 + 28. Let w = a - -1. List the prime factors of w/(1/4 - 276/1168). 73 What are the prime factors of (47320/21)/(-13)-12(-164)/(-40)? 2, 13, 41 Let o be (6/(-6)2)/((-2)/(-7)). List the prime factors of ((-4)/o)/(2/1561). 2, 223 Let t = -17907 + 27186. What are the prime factors of t? 3, 1031 Suppose 3m + 0i + i - 5 = 0, -2i + 2 = 2m. Let c(l) = 6 - 9l - 2l - l*m + 33 + 3l. List the prime factors of c(-9). 2, 3, 5 Suppose -11b + 970 - 211 = 0. List the prime factors of b. 3, 23 What are the prime factors of (-18)/(-15)-1 + (-5892960)/(-300)? 2, 7, 23, 61 Suppose -4r = 5g + 30, 5r - 4g + 4 = -54. List the prime factors of r/(-105) - (-146839)/147. 3, 37 Let z be 0/21 + 2 + 3 + -2. List the prime factors of (z + (-104)/6)/((-5)/195). 13, 43 Suppose -1500393 = -5c - 107c + 547191. What are the prime factors of c? 2, 3, 11, 277 Suppose -220 = -18h + 29h. What are the prime factors of (118 + 8)/(-2 - 44/h)? 2, 3, 5, 7 Suppose 4*d +	{ "pile_set_name": "DM Mathematics" }
3 - 5)) + s is divided by -1(1 + -15 - -1). 11 Let v = 2 + -2. Suppose 0 = -i - 0o - o + 7, 2i + 4o - 6 = v. Suppose -q + 25 = 3w, -3w = 4q - 4w - 126. What is the remainder when q is divided by i? 9 Suppose 238 = 4o + 42. What is the remainder when o is divided by 25? 24 Let b = 58 + -44. Let w be (-4)/(-18) + (-6)/27. Suppose wf - 3f = -78. What is the remainder when f is divided by b? 12 Suppose -4x - 11 - 5 = 5f, -12 = 3f + 3x. Suppose ft - 3t = q - 91, 5t = -3q + 149. Let r = 35 + -18. What is the remainder when t is divided by r? 14 Let g = 10 + -2. Suppose 4w - 5r = 11 + g, 3w = -3r + 21. What is the remainder when 23 is divided by w? 5 Let s = -15 - -10. Let x = s - -7. What is the remainder when x is divided by 1? 0 Let x(o) = -o2 + 2o. Let h be x(1). Calculate the remainder when 23 is divided by -16(h + (-7)/4). 11 Let p(v) = -20v + 7. Suppose 6 = -0y - y. Calculate the remainder when p(y) is divided by 32. 31 Let a = -148 - -150. What is the remainder when 41 is divided by a? 1 Calculate the remainder when 83 is divided by ((-12)/(-8))/(2/28). 20 Let s(v) = -v + 9. Let f = 8 - 8. What is the remainder when 24 is divided by s(f)? 6 Let t(a) = 4a*2 + 2a. Let q = 5 + -3. Let g = 0 + q. Calculate the remainder when 38 is divided by t(g). 18 Suppose 2s + 0 = 6. Suppose 3 = 2h + 5p - 3, 0 = sp. Calculate the remainder when 6 is divided by h. 0 Suppose -3i + b - 5 = 3b, 4b = -3i - 13. Calculate the remainder when 6 + 15 + (-2)/i is divided by 5. 4 Let t = -9 - -11. Suppose 5 = 3u - tu. Suppose ud - 158 = -2l, 5d - 146 = 4l - 3l. Calculate the remainder when d is divided by 8. 6 Let r be -36((-2)/(-3))/(-1). Suppose -2i + r = -6. Calculate the remainder when 43 is divided by i. 13 Let i(g) = -g2 + g + 98. Calculate the remainder when i(0) is divided by 25. 23 Let m be (-38)/(-5) + (-6)/(-15). Let f be 36/m(-2 - 0). Let y = -6 - f. What is the remainder when y is divided by 2? 1 Suppose -45 = -10h + 5h. Let w(m) = 2m2. Let f be w(4). What is the remainder when ((-12)/8)/((-3)/f) is divided by h? 7 Calculate the remainder when 33 + -4 + (-20)/(-5) is divided by 12. 9 Suppose -42z = -40z - 30. Calculate the remainder when z is divided by 3. 0 Let v(i) = -i2 + i + 29. Let c be v(0). Suppose w + 6 = -5z, z = w - z - c. Suppose 0 = 5s - w - 46. What is the remainder when 24 is divided by s? 11 Suppose -345 = -4q - q. Suppose q - 15 = 3g. What is the remainder when 51 is divided by g? 15 Suppose 184 = -75a + 83a. Calculate the remainder when a is divided by (-4)/10 + (-67)/(-5). 10 Suppose -5q + 39 = -61. Suppose -4x + 67 = -85. Calculate the remainder when x is divided by q. 18 Suppose 5q - 13 - 2 = 0. Suppose -i = -1 - 2. Suppose 5f - 25 = 2j, 0 = 2f - j - 12 + i. What is the remainder when f is divided by q? 1 Let v(l) = l2 + 9l + 10. Let m be v(-8). Suppose 14 = mc - 86. Suppose -18 = 3g + p - c, 0 = 5g + p - 54. What is the remainder when g is divided by 6? 5 Let q(g) = -g2 - g + 2. Let k be q(-3). Let y be k/(-2 - 256/(-130)). Suppose 2z + 3z = y. Calculate the remainder when z is divided by 14. 12 Suppose 2b - 10 = 52. Let n = -3 + 7. Let q(x) = x*2. Calculate the remainder when b is divided by q(n). 15 Suppose -5o + 2s = 31, -s - 19 = 5o + s. What is the remainder when 15 is divided by (-1)/o + (-39)/(-5)? 7 Suppose 6d = 7d - 3p - 260, -3d = p - 750. Calculate the remainder when d is divided by 42. 41 Let k(b) = b*3 + 7b*2 - 8b - 14. Calculate the remainder when 124 is divided by k(-7). 40 Calculate the remainder when 6 is divided by (3 - (-72)/(-20))-5. 0 Suppose 3r + 3 = -4a - 4, -2r = 5a. Let k(g) = -g3 + g2 + 2g. Let l be k(a). Let y = 30 + l. What is the remainder when y is divided by 16? 14 Suppose 0 = -b + 3, 2i - 2b = 66 + 14. Let o = i + 9. Suppose -2z + 65 = 5s + 2z, -2z + o = 4s. Calculate the remainder when 51 is divided by s. 12 Suppose -4z + 40 = -0z. What is the remainder when 36 is divided by z? 6 Let m(c) = -2c3 - c2 + 2c - 2. Calculate the remainder when m(-4) is divided by 26. 24 Suppose 0 = 4j + 3y - 21 - 0, -5y = 4j - 27. Let c = 29 - 24. Calculate the remainder when c is divided by j. 2 Suppose 0 = -3a + 3 + 33. Suppose 3u + a = 7u. What is the remainder when 5 is divided by u? 2 Let w(x) = -x*3 - 6x*2 + 5x - 9. Let u be (0 - -1) + 1-21. Let d = u - -34. Calculate the remainder when d is divided by w(-7). 4 Let f = -72 - -101. Calculate the remainder when f is divided by 16. 13 Let o be ((-2)/6)/(2/(-24)). Suppose -v - o + 1 = 0. What is the remainder when 13 is divided by (-13)/v - (-6)/9? 3 Let o(c) be the second derivative of 13c4/12 - c3/6 + c*2/2 - 8c. What is the remainder when 36 is divided by o(1)? 10 Let s(k) = k + 5. What is the remainder when 15 is divided by s(3)? 7 Let l = 30 + -16. What is the remainder when (-632)/(-24) - 1/3 is divided by l? 12 Suppose 0 = -4f + 3z + 49, 10 = -4f + z + 53. What is the remainder when 16 is divided by f? 6 What is the remainder when 37 is divided by (-27)/18(-8 + 2)? 1 Let l(a) = -a*2 - a + 8. Let v(i) = 7i. Calculate the remainder when v(3) is divided by l(0). 5 Let o(g) = -6g + 55. Calculate the remainder when o(7) is divided by 5. 3 Let l = 0 - 4. What is the remainder when (-624)/(-15) + l/(-10) is divided by 22? 20 Let n(v) = 22v3 - v2 + v - 1. What is the remainder when 81 is divided by n(1)? 18 Calculate the remainder when 10 is divided by (3/6 + 1)(-1 - -5). 4 Let y(g) = g2 + 8g - 6. Let d be y(10). Suppose -d = -7i + 2i + v, -2i + 5v = -65. Calculate the remainder when i is divided by 12. 11 Let b(j) = -2j2 + 3j*2 + 9 + 4j + j. Let d be 0 + (-14)/2 - 0. What is the remainder when b(d) is divided by 12? 11 Let n = -76 + 235. Suppose 5y + q + 32 = n, 4q = 8. Suppose -6o + o = -3k + 59, -o = 3k - 35. Calculate the remainder when y is divided by k. 12 Let b(v) = 6v - 2. Let k(r) = -5r + 2 - 1 - 1. What is the remainder when k(-6) is divided by b(3)? 14 Suppose -3c + 2u + 54 = 0, 4u + 19 - 1 = c. Calculate the remainder when (18/(-12))/((-1)/46) is divided by c. 15 Let k(d) = -d*3 - 7d*2 - 2d - 4. What is the remainder when k(-7) is divided by 6? 4 Suppose -2i = -34 - 70. Calculate the remainder when i is divided by 27. 25 Suppose -40 = -z - 3k - 17, 18 = 2z - k. What is the remainder when 41 is divided by z? 8 Let v be (-70)/(-21)36/(-10). Let c = v + 21. What is the remainder when 25 is divided by c? 7 Let x(z) = 34z2. Let i be (-3 + 0)(4 + -5). Suppose -y + 3 = -a, -5a - 16 = iy + 7. Calculate the remainder when x(y) is divided by 18. 16 Suppose 0 = -3m + m + 72. Suppose 3w - 2q - 37 = 0, -5q = 2w - 24 - 7. What is the remainder when m is divided by w? 10 Suppose -5n = -z + 2z - 24, 0 = n + 4z - 1. What is the remainder when 7 is divided by n? 2 Suppose -m + 5m + 88 = 5k, 5k - 74 = -3m. Suppose g = -5w + 32, -3w - w + k = -4g. What is the remainder when 17 is divided by w? 5 Let c(r) = -6 + r2 + 6 + 6r - 9. Let q be c(-7). Calculate the remainder when 13 is divided by -2 + 11 + q - 2. 3 Let w = 22 + -10. Suppose -25 - 38 = -3q. Calculate the remainder when q is divided by -1 + (1 + 0)w. 10 Suppose 0q - 5q + 109 = t, 0 = 4q + t - 88. Calculate the remainder when 82 is divided by q. 19 Let m = 179 + -78. What is the remainder when m is divided by 17? 16 Let w(c) = -6c3 - 1. Let d(k) = k3 - 7k2 + 9k - 8. Let h be d(6). Let a = h + 3. What is the remainder when a is divided by w(-1)? 3 Suppose -l = 5u - 17, -u + 45 = -6l + l. Let d = l + 18. What is the remainder when 29 is divided by d? 9 Suppose 0 = 2x - 1 - 1. Let r = 8 - 14. Let o(z) = -z3 - 5z*2 + 6z + 1. Calculate the remainder when o(r) is divided by x. 0 Let k(x) = -x*3 + 7x*2 + 10x - 8. Calculate the remainder when 23 is divided by k(8). 7 Suppose -x = 2x - 30. Calculate the remainder when (3/(-2))/(3/(-56)) is divided by x. 8 Let g(m) = -m3 - 16m*2 + 15m - 21. What is the remainder when 23 is divided by g(-17)? 10 Let p(s) = -9s3 + s2. Calculate the remainder when p(-1) is divided by 6. 4 Suppose 4d = 3d. Let k(p) = -p3 + 4p*2 + 7p + 2. What is the remaind	{ "pile_set_name": "DM Mathematics" }
et r = -23 + 27. Suppose k + k - 4d = 938, -4k + rd = -1896. Is k a prime number? True Let t(f) = -121f - 29. Let k(i) = 81i + 19. Let s be (-16)/36/4. Let r(a) = sk(a) - 5t(a). Is r(-6) a composite number? False Let s = -4363 + 7302. Is s composite? False Let p(f) be the second derivative of 55f4/12 + 5f*3/6 + 5f*2/2 + 10f. Is p(-2) composite? True Suppose -10f = 4s - 12f - 51294, -s = 3f - 12806. Is s a prime number? True Suppose -219b + 13894 = -217b. Is b composite? False Let t(j) = 102j2 - j + 1. Suppose 18 - 5 = -2a + 5l, l = 1. Is t(a) composite? False Let a(t) = t3 + 10t*2 - 11t - 8. Let f be a(-11). Let p = f + 12. Suppose -b - 2j - j = -169, pj = -4b + 644. Is b prime? True Suppose 0 = -2x - 0 - 8, -5c = -5x - 434435. Is c prime? False Let t(m) = -89m. Let u(f) = -f2 - 5 - 7f - 4f - 6. Let j be u(-10). Is t(j) composite? False Let y(p) = 64p*3 - p. Let v be y(-1). Let l = v + 148. Suppose -3o + l = -146. Is o a composite number? True Let o(a) = 19a3 + 11a*2 - 5a - 11. Is o(4) prime? True Let m be ((-6296)/(-6))/(10/15). Let u = 134 + m. Suppose 2i + 2i = u. Is i composite? True Let x(g) be the third derivative of -g*5/60 - 17g*4/24 - 13g*3/6 - 62g*2. Let i(q) = 13q3 + q2 - q - 1. Let y be i(-1). Is x(y) composite? False Let u be 3/(-18) - (-129)/18. Suppose 0 = -4t - 2z + 658, -8 = -5z + u. Is t prime? True Is 0 + -5(-59766)/70 a prime number? False Suppose -7w = -18w + 466719. Is w a prime number? False Suppose -3w - 3a = -36, -w = -2a + a - 10. Suppose 9t + wt = 12820. Is t a composite number? False Let l be -2 + 3 - (5 - 4). Suppose 0 = 2o - lo. Suppose -3k + 1999 = 3s + k, o = -2s + k + 1351. Is s a composite number? False Let r(m) = -178m3 - 62m*2 - 326m - 3. Is r(-5) a composite number? True Let i(c) = -176c3 - 2c - 1. Let s be i(2). Let f = 1432 + -3612. Let l = s - f. Is l a prime number? False Let n = 50 - 26. Is 41091/18 - (-4)/n a prime number? False Let m be (24 - 22)(-1 - -7). Suppose -s = -4r - 165, -4 = -4r - m. Is s prime? True Let m = 1002 + 2689. Is m composite? False Let f(n) = 102n*2 + 2n - 3. Is f(-5) a composite number? True Let o be (3/3)/30. Suppose -g = a - 29, o = 2a - 3a + g + 39. Suppose -5i = 3x - 161, i - 2x + 7 - a = 0. Is i a prime number? True Let w be (-1 - 10/(-6))-12. Is (w/4)/(6/(-921)) a composite number? False Let v = -2885 - -7132. Is v composite? True Let u = 4505 - 3214. Is u a composite number? False Suppose -2g + 19 = 3. Let u be 0/(-3g/12). Suppose 12l - 13l + 395 = u. Is l a composite number? True Let g = -16 - -18. Suppose -876 = -gr - 3r + 3p, 0 = -4p - 8. Suppose 5f = -5w + 290, -3f - 2w + r = -0w. Is f a composite number? True Suppose y + 2s - 1519 = 0, -2 = -2s - 12. Let c = 2160 - y. Is c a prime number? True Let k(j) = -214j + 89. Is k(-12) a composite number? False Let l(c) = -19c + 403. Is l(8) prime? True Let h = 36753 - 14450. Is h a prime number? True Let s(f) = 34f - 10f - 25 + 12f. Is s(6) prime? True Suppose 37r + 43r - 4098320 = 0. Is r prime? True Is 4/6 + 32497280/384 a prime number? True Let g = 3287 + 2148. Is g prime? False Suppose 0 = -35v + 33v. Is (v + -1553)/(1/(-1)) a composite number? False Let l(z) = 144z*2 + 20z + 27. Is l(-4) composite? False Let n be (-9)/(-6)(-1 + 14/6). Let t(f) = 734f + 3. Is t(n) a prime number? True Let a be (-6)/((-4)/166). Suppose z - 219 = 3f, -az + 166 = 3f - 740. Suppose -t + z = o, -661 = -3t + o + 3o. Is t composite? False Let t = -2834 - -4735. Is t prime? True Suppose 2s - 9152 = -o, -5o + 14146 = 2s + 4978. Is s composite? True Suppose 8c - 12c + 89468 = 0. Is c composite? False Let q = 3750 - -4243. Suppose 4h = -5a - 25309, 5a - 5h + 17352 = -q. Is a/(-20) + (-1)/4 a composite number? True Suppose -k + 6k = 2x - 1, -3k - 3x - 9 = 0. Let j(o) be the first derivative of -167o4 - o2 - o + 2. Is j(k) a composite number? True Let u be 6/2 + -3 + 503. Let w = 1132 - u. Is w a prime number? False Let z = -9 + 17. Is ((-1780)/z)/((-1)/2) composite? True Suppose 3r - 2421 = -3i, -2i - 4773 = -5r - 745. Let t = 10 + -15. Is 7/(-35) - r/t a prime number? False Suppose 0 = -4y - 8 + 16. Suppose 0 = -yl + 5z + 2325, -10 + 1180 = l + 5z. Let i = -792 + l. Is i a composite number? False Suppose -2b + 41990 = 4n, 0 = -b + 4n + 12674 + 8339. Is b a composite number? False Let q = 49 + -61. Is (-3014)/q + (-12)/72 a prime number? True Let h be (4/6)/(((-2)/(-1))/(-60)). Let q = 11 - h. Is q prime? True Let w(d) = d3 - 9d*2 - 24d + 26. Let j be w(16). Suppose 5f = 1271 + j. Is f composite? False Suppose -3 = 3b + 9. Is (-5322)/(-9)(-6)/b prime? True Suppose 2h - 4v + 36013 = 134883, 197707 = 4h + 3v. Is h composite? False Is (-3525)/(-100)652/3 prime? False Let f(c) be the third derivative of 3c4/8 + 2c*3 - 3c*2. Let k be f(7). Suppose -6j - k + 303 = 0. Is j composite? True Suppose 4a - 30408 = -n, -4n - 18 = -2. Is a prime? True Let q = 7 - 2. Suppose -qj + 2x + 2035 = 0, 4x - 86 = -3j + 1161. Is j composite? False Is (-5(-1 + 3))/((-6)/5793) prime? False Suppose 0 = -5q + 2z + 11532 + 1043, 10 = -2z. Suppose -3l - 2154 = 2m + q, -3l - 3 = 0. Is 4/18 - m/36 a prime number? False Suppose 25h = 22h + 606. Let n = -125 + h. Is n a prime number? False Suppose 5u - 6u - 76980 = -5g, 0 = 3g + 4u - 46165. Is g a composite number? True Suppose -4z - 109396 = -32z. Is z a composite number? False Let x = -16 + 14. Let k = x - 7. Is 93/k-3 + 2 a prime number? False Let w be ((-1)/(-1))/((-3)/6). Is w + 4 + -4 + 33 prime? True Let v(u) = 2u - 32. Let j be v(16). Suppose j = 5t - 4t - 614. Is 2t/123 prime? True Let h(f) be the second derivative of 41f4/12 + 14f3/3 - f2 + 7f. Is h(7) composite? False Let t(b) = -21b + 2. Let w be t(-2). Let l(f) = -f*3 - 13f*2 - 2f - 27. Let d be l(-13). Is (1 + w/(-2))/d a prime number? False Let q(c) = 2c3 - 13c*2 + 10c + 8. Suppose -35 = -9v + 4v. Is q(v) a prime number? True Let t(f) = 33f2 + 23f - 119. Is t(9) prime? False Suppose 2f + 3f - 175 = 4j, -5f = 2j - 175. Let r = f - -110. Is r a composite number? True Let w be (-2)/((-798)/(-270) + (0 - 3)). Is (15/w)/(((-2)/(-201))/2) a prime number? True Suppose 0 = -2s - 2w + 10806, -2s - w = 3285 - 14087. Is s composite? False Let p(j) = 125j2 + 12. Let s be p(-7). Let z = -3204 + s. Is z composite? True Let x be 2390/14-1 - (-4)/(-14). Let n = 25 + -47. Let t = n - x. Is t prime? True Suppose 42l - 49l = -1778. Let k = -135 + l. Is k a prime number? False Let y be ((-2)/(-7))/(17/357). Suppose -yg + 35755 = -g. Is g a composite number? False Let m be 1 + -272 + (-1 - 14)/(-5). Let u = m + 4115. Is u a composite number? False Let q(a) = -a3 + 2a*2 + 4. Let s = 15 + -20. Is q(s) composite? False Let l = 44690 + -24529. Is l a composite number? False Let w(z) = -303z + 2. Let n be w(-2). Suppose -u + n = -3c, 2u + 0u + 5c - 1271 = 0. Is u composite? True Let h(d) = 587d - 392. Is h(17) a composite number? False Suppose -2z = 4t - 46396, 0 = -12t + 7t + 4z + 57969. Is t a prime number? True Suppose 0 = -26k + k + 75475. Is k a prime number? True Suppose -4c + 10 = 2l + 3l, l + 2c - 2 = 0. Suppose -lk + 5k = 0. Is k - 446/(4/(-2)) composite? False Let a be ((-6)/2)/(-9)12. Suppose -f + 5m = -143, -134 = -0f - f - am. Suppose -3w + f = -w. Is w a composite number? True Suppose 5j - 10 = 0, -4f - 5j + 822 = -216. Is f a composite number? False Suppose -5z + 4x = 76, -3x + 4x = 4. Let b be (z/(-3))/(-12)-9. Is b(390/9 + 3) composite? False Suppose -2a = -4a + 24. Let o be (125 + -35)(-3)/(-18). Is 106/a2o composite? True Suppose 24p - 16p = 69712. Is p a prime number? False Let u = 6 - 1. Suppose ua - 5q = 13975, 0 = -2a + 5a - 4q - 8381. Suppose 6b - a - 3387 = 0. Is b a prime number? True Let t = -8 - -13. Suppose 1 = -ts + 31. Is s/(-2) + 2 - -332 a composite number? False Let b be 177 + 51 - 3/((-3)/(-4)). Suppose 1778 - b = 14y. Is y prime? False Suppose -5m - 24g = -21g - 4397, -3m + 2g + 2623 = 0. Is m a prime number? True Let j(n) = 25 - 86n + 46*n + 3	{ "pile_set_name": "DM Mathematics" }
Solve -3s2 + 106s/3 + 8 = 0 for s. -2/9, 12 Solve 214n5 - 10886n*4/7 + 14776n*3/7 + 20824n*2/7 - 6464n/7 - 128/7 = 0 for n. -1, -2/107, 2/7, 4 Let -3z5/5 + 171z*4/5 - 720z*3 + 33996z*2/5 - 139104z/5 + 202176/5 = 0. Calculate z. 4, 13, 18 Let 3j2 - 345j + 2568 = 0. What is j? 8, 107 Suppose 5f3 - 118475f*2 - 592500f = 0. Calculate f. -5, 0, 23700 Factor 3n3 - 25692n*2 - 772785n - 5800950. 3(n - 8594)(n + 15)*2 Solve 8s*4/3 - 7106s*3 + 14315654s*2/3 - 50460502s - 38740438/3 = 0 for s. -1/4, 11, 1327 Factor 1838v3/9 - 1220v*2/3 + 602v/3 + 16/9. 2(v - 1)2(919v + 8)/9 Determine a so that 5a*2 - 107250a + 575128125 = 0. 10725 Factor 18z3 - 3478z*2 + 112948z - 24928. 2(z - 152)(z - 41)(9z - 2) Factor -21o2/8 - 4245o/8 - 12078. -3(o + 176)(7o + 183)/8 Factor 3r*3/7 - 2217r*2/7 + 13218r/7 - 17592/7. 3(r - 733)(r - 4)(r - 2)/7 Factor -f3/9 - 754f*2/3 + 2016f - 36320/9. -(f - 4)*2(f + 2270)/9 Let -3h5/5 - 17781h*4/5 + 14232h*3 - 71172h2/5 = 0. Calculate h. -5931, 0, 2 Factor -u3 - 53u2 - 579u - 1287. -(u + 3)(u + 11)(u + 39) Find b, given that 3b2/4 + 20937b + 146119323 = 0. -13958 Solve -w*2/7 + 17939w/7 + 17940/7 = 0. -1, 17940 Suppose -10o3/3 + 1288o*2/3 + 2870o/3 + 524 = 0. What is o? -6/5, -1, 131 Find n, given that -8n3/7 + 125640n*2/7 + 125646n/7 + 31412/7 = 0. -1/2, 15706 Let 2z4/7 + 179720z*3/7 + 4037230076z*2/7 - 8074999320z/7 + 4037589522/7 = 0. What is z? -44931, 1 Factor 14z2 + 1255722z - 1255736. 2(z - 1)(7z + 627868) Factor 3i*3/2 - 10689i*2/2 + 4747224i + 23869920. 3(i - 1784)2(i + 5)/2 Factor -c*2/4 - 42659c/4 - 21329/2. -(c + 1)(c + 42658)/4 Suppose 8f*3/3 - 110f*2/3 + 332f/3 + 30 = 0. What is f? -1/4, 5, 9 Determine c so that -12c5 + 6972c*4 + 15c*3 - 8715c*2 - 3c + 1743 = 0. -1, -1/2, 1/2, 1, 581 Determine u so that 2u5 - 570u*4 + 43604u*3 - 423348u*2 + 718154u - 337842 = 0. 1, 9, 137 Suppose 6a3/7 - 1380a*2/7 + 44454a/7 + 45840/7 = 0. Calculate a. -1, 40, 191 Suppose 2p4/13 + 864p*3/13 + 1720p*2/13 = 0. What is p? -430, -2, 0 Factor -4k*3/7 - 1760k*2/7 - 190032k/7 + 788544/7. -4(k - 4)(k + 222)2/7 Factor -d3/3 - 8109d2. -d2(d + 24327)/3 Suppose 780r5 + 7145r*4 - 7390r*3 - 7745r*2 + 6610r + 600 = 0. Calculate r. -10, -1, -1/12, 12/13, 1 Let 3p4 + 15126p*3 + 45360p*2 + 45354p + 15117 = 0. Calculate p. -5039, -1 Factor -3w3 + 186w*2 - 1623w + 3276. -3(w - 52)(w - 7)(w - 3) Let -28k*5/5 + 482k*4/5 - 1362k*3/5 + 1474k*2/5 - 130k + 84/5 = 0. What is k? 3/14, 1, 14 Suppose 2x5 + 1980x*4 + 17682x*3 + 23384x*2 - 157344x - 376704 = 0. Calculate x. -981, -4, 3 Factor -4p3 + 11740p*2 - 23468p + 11732. -4(p - 2933)(p - 1)2 Factor -r3/3 + 1962r2 - 2887083r. -r(r - 2943)2/3 Determine p so that -p3/3 + 19p*2 - 356p/3 + 100 = 0. 1, 6, 50 Factor -x*2 - 2509x - 2508. -(x + 1)(x + 2508) Let s4/8 - 21s*3/8 - 97s*2/8 - 75s/8 = 0. What is s? -3, -1, 0, 25 Find m, given that -6m3 - 6782m*2 - 9034m - 2258 = 0. -1129, -1, -1/3 Factor -2u2/13 + 66828u/13 - 558247698/13. -2(u - 16707)2/13 Factor 4r*3/5 - 948r*2/5 + 15024r/5 - 2816. 4(r - 220)(r - 16)(r - 1)/5 Factor 3x*5 + 33x*4 + 60x*3 - 96x*2. 3x*2(x - 1)(x + 4)(x + 8) Determine c so that 162c5 - 666c*4/5 - 13112c*3/5 - 18496c*2/5 - 2752c/5 + 32 = 0. -2, -2/9, 2/45, 5 Factor 5j2 - 2005j - 8100. 5(j - 405)(j + 4) Solve l*5 + 13l*4 + 50l*3 + 50l*2 - 51l - 63 = 0 for l. -7, -3, -1, 1 Factor -212b2 - 2344b - 132. -4(b + 11)(53b + 3) Factor -2o*2/5 - 1846o/5 + 34272. -2(o - 85)(o + 1008)/5 Suppose -2g3/7 + 100874g*2/7 - 181684880g - 3816290400/7 = 0. What is g? -3, 25220 Let 2c3/5 - 484c*2/5 + 3232c = 0. What is c? 0, 40, 202 Factor 5611243656483c4 - 16836463496187c*3 + 8198023770c*2 - 1330692c + 72. 3(c - 3)(12321c - 2)3 Factor -2k*3/15 + 48k*2/5 - 574k/5 + 5684/15. -2(k - 58)(k - 7)*2/15 Solve -5z*5/8 + 463z*4/4 - 15375z*3/8 + 14879z*2/4 - 668z = 0 for z. 0, 1/5, 2, 16, 167 Factor z*5/6 - 22763z*4/6 + 28785078z*3 - 218363594120z*2/3 - 218449960736z/3. z(z - 7588)3(z + 1)/6 Factor w*4 + 69w*3 + 975w*2 + 4879w + 7644. (w + 3)(w + 7)2(w + 52) Suppose -3f3 - 9840f*2 + 29547f = 0. What is f? -3283, 0, 3 Factor g*3/2 - 1445g*2/2 + 1439g + 5772. (g - 1443)(g - 4)(g + 2)/2 Factor -121u4 + 20548u*3 - 851566u*2 - 1765260u - 893025. -(u + 1)*2(11u - 945)2 Factor -405b*3 - 2462175b*2 - 1094240b - 121580. -5(b + 6079)(9b + 2)2 Let -m5 + 9m*4 + 458m*3 - 5184m*2 - 5632m = 0. What is m? -22, -1, 0, 16 Factor -2s2/9 + 52s/3 + 1014. -2(s - 117)(s + 39)/9 Solve 3h5 + 14568h*4 - 29184h*3 - 174834h*2 + 262413h + 393498 = 0 for h. -4858, -3, -1, 3 Factor s*2/4 + 28971s + 839318841. (s + 57942)2/4 Suppose b4/4 - 279b3/4 + 16527b*2/4 + 33895b/4 + 4272 = 0. What is b? -1, 89, 192 Factor -5t2 - 1590t - 118405. -5(t + 119)(t + 199) Factor 4o4 - 28o*3 - 15204o*2 - 131652o. 4o(o - 69)(o + 9)(o + 53) Factor 14g3 + 246415g*2 + 17601g. g(g + 17601)(14g + 1) Solve o2/8 + 101o/2 + 403/8 = 0. -403, -1 Factor 3k4 + 57k*3 - 624k*2 - 14592k - 36864. 3(k - 16)(k + 3)(k + 16)2 Factor -b2 + 6120b + 36756. -(b - 6126)(b + 6) Suppose -q5/5 + 13q*4/5 + 2426q*3/5 - 10588q*2 - 175576q/5 - 120224/5 = 0. What is q? -52, -2, -1, 34 Solve 5y2 + 1163575y - 2327170 = 0. -232717, 2 Determine o so that 32o2/3 + 366o - 770/3 = 0. -35, 11/16 Factor 3i2/4 - 10647i + 37786203. 3(i - 7098)2/4 Find j such that -3j*2/2 - 570j + 5775/2 = 0. -385, 5 Solve v*2 + 230466v + 13278644289 = 0. -115233 Suppose k*3 + 18k*2 - 193k - 450 = 0. Calculate k. -25, -2, 9 Suppose o*2/4 + 393o/2 + 392 = 0. Calculate o. -784, -2 Factor -5o4 + 390o*3 + 1625o*2 + 1230o. -5o(o - 82)(o + 1)(o + 3) Solve -2t2 + 22922t/9 - 10184/9 = 0 for t. 4/9, 1273 Determine o so that 5o5 + 545o*4 + 3440o*3 - 13620o*2 - 36720o = 0. -102, -9, -2, 0, 4 Factor -2t2/7 - 902260t/7 - 101759138450/7. -2(t + 225565)2/7 Factor 5i*4 - 460i*3 + 1780i*2 - 1760i. 5i(i - 88)(i - 2)2 Factor -w4 + 8591w*3 - 51515w*2 + 42925w. -w(w - 8585)(w - 5)(w - 1) Factor 33v*2 - 70617v - 218586. 3(v - 2143)(11v + 34) Solve l3/2 - 8633l*2/10 - 1727l/5 = 0. -2/5, 0, 1727 Solve 5u2/4 + 401355u/4 - 401365/2 = 0 for u. -80273, 2 Factor 4z3/5 + 24z*2/5 - 5724z/5 + 5504. 4(z - 32)(z - 5)(z + 43)/5 Factor -2t*2 - 1142t + 78492. -2(t - 62)(t + 633) Factor 299r2/7 - 733r/7 + 270/7. (r - 2)(299r - 135)/7 Determine l, given that -l*5/8 + 81l*4/8 - 661l*3/8 + 891l*2/8 + 1645l/4 - 450 = 0. -2, 1, 5, 72 Determine s, given that 8100s2 - 10080s + 3136 = 0. 28/45 Factor 5u2 + 38115u + 114300. 5(u + 3)(u + 7620) What is y in 4y4/5 + 604y*3/5 - 1864y*2/5 - 2464y/5 = 0? -154, -1, 0, 4 Factor -5a4 - 71635a*3 - 256614475a*2 - 256542845a. -5a(a + 1)(a + 7163)2 Let 5x*2 + 1890x + 154800 = 0. Calculate x. -258, -120 Factor 2q4/15 - 1234q*3/5 - 32422q*2/5 - 634426q/15. 2q(q - 1877)(q + 13)2/15 Factor -5s*3/4 - 38s*2 + 1695s/4 + 351/2. -(s - 9)(s + 39)(5s + 2)/4 Let 484r*5 - 213576r*4 + 1530736r*3 - 1322592r*2 - 1610240r - 333312 = 0. Calculate r. -4/11, 2, 6, 434 Suppose 33m3 - 824346m*2 + 149880m = 0. Calculate m. 0, 2/11, 24980 Let -5a5 + 340a*4 + 1860a*3 - 2530a*2 - 1855a + 2190 = 0. Calculate a. -6, -1, 1, 73 Find m, given that 9m4 + 960m*3 + 4323m*2 + 3960m - 1836 = 0. -102, -3, -2, 1/3 Factor q*4/2 + 14q*3 + 115q2/2. q2(q + 5)(q + 23)/2 Determine w so that -2w3/11 - 600w*2/11 + 28998w/11 + 92340/11 = 0. -342, -3, 45 Let -2b2/7 + 482b/7 - 19380/7 = 0. What is b? 51, 190 Let 4j2 - 3320j + 36036 = 0. What is j? 11, 819 Let 2k3/5 - 54k*2/5 + 228k/5 - 176/5 = 0. What is k? 1, 4, 22 What is w in w*3 - 21w*2 + 71w - 51 = 0? 1, 3, 17 Factor 3t2/4 + 1146405t/2 + 438081474	{ "pile_set_name": "DM Mathematics" }
3 Suppose -7 = -3p + 2. Let a = -1 - p. Let f(s) = 3s - 3. Let x(u) = -u + 1. Let z be 1141/(-105) - 4/30. Determine af(k) + zx(k). -k + 1 Let v = -22215 + 22216. Let x(j) = -6j3 - j2 - 2j - 3. Let h(o) = o*3 + o + 1. Calculate vx(r) + 4h(r). -2r3 - r2 + 2r + 1 Let o = -36 - -44. Let j be 2 + 2/2 - (-16)/o. Suppose 22 - 7 = -jl. Let u(a) = 4a2 - 4a - 1. Let h(v) = 5v2 - 5v - 2. Determine lu(t) + 2h(t). -2t2 + 2t - 1 Let d(i) = -4i2 - 2i. Let s(t) = -33t3 - 8t*2 - 4t - 22. Determine -2d(y) + s(y). -33y*3 - 22 Let o(t) = -6t + 1. Let l(z) = -2z2 + 220z + 911. Let j be l(114). Let u(n) = -n. Determine jo(s) - 3u(s). 9s - 1 Let l(n) = 58932n*3 - 81n*2 + 54n + 54. Let q(d) = 8419d3 - 12d*2 + 8d + 8. Determine 4l(z) - 27q(z). 8415z3 Let z(q) = 4q*2 - 1. Let v(d) be the first derivative of 32d*3 + 6d - 64d3 + 25d*3 + 17. Give 2v(p) + 11z(p). 2p*2 + 1 Let j(k) = 48k - 1232. Let n(v) = 23v. What is j(w) - 2n(w)? 2w - 1232 Let c(i) = -2i2 + 17. Let u(l) = l2 - 8l + 11. Let k(z) = -2z*2 + 8z - 3. Let w(h) = 2k(h) + 2u(h). Calculate -5c(f) + 6w(f). -2f2 + 11 Let l(d) = -6d + 6. Let k(v) = 1. Let y(h) = -8k(h) + l(h). Let x(p) = 18p + 6. Let s be 65/(-75) - -1 - (2300/375 + 0). What is sx(j) - 17y(j)? -6j - 2 Let m(k) = 14k + 1. Let f(s) = -18s + 10. Let n(l) = -f(l) - 3m(l). Let d(w) = -4w - 2. Give 39d(t) - 6n(t). -12t Let n(k) = 26k2 - 44k - 132. Let v(z) = 5z2 - 8z - 26. Calculate -2n(q) + 11v(q). 3q2 - 22 Let b(s) = -4s*3 - 9s*2 - 17s + 7. Let q(i) = 2i3 + 4i*2 + 8i - 3. Let t(m) = -m*3 - 9m*2 + 55m + 42. Let v be t(-13). Give vb(a) + 7q(a). 2a3 + a2 + 5a Let j(s) = 59s2 + 4s - 94. Let u(r) = -101r2 - 7r + 157. Determine -12j(t) - 7u(t). -t2 + t + 29 Let o(g) = -g2 - g + 1. Let v(x) = -2x3 + 2x*2 + 2x + 1. Suppose -95a = -110a - 5520. Let f = -366 - a. Calculate fo(p) + v(p). -2p*3 + 3 Let f(x) = 9x*2 - 20x - 1107. Let n(h) = 2h2 - 5h + 1. Give -f(y) + 4n(y). -y2 + 1111 Let l = -43203 + 43197. Let v(w) = -4w*2 - 5w + 27. Let m(t) = 5t2 + 6t - 28. Calculate lv(x) - 5m(x). -x*2 - 22 Let d(r) = -4r. Suppose 17w + 117 = 49. Let a be 1 + (6 - (4 + 12) - w). Let v(p) = 21p. Determine av(l) - 24d(l). -9l Let g(v) = -547 + 548 - 59v + 55v - 5v*2 + 9v2. Let h(n) = -n2 - n + 1. Give g(a) - 2h(a). 6a*2 - 2a - 1 Let c(f) = -8156f - 20. Let v(w) = 2724w + 7. Determine -6c(a) - 17v(a). 2628a + 1 Let q(f) = f3 - 8f - 3. Let z(d) = -5d3 + 67d*2 + 16d + 6. Calculate 2q(n) + z(n). -3n*3 + 67n*2 Let j(h) = -109h*2 - 12h - 6. Let v(n) = -330n2 - 39n - 20. Calculate 13j(w) - 4v(w). -97w2 + 2 Let z(p) = -7 + 4 + p2 + 0p*2 + 24p - 20p. Let g be (-204)/(-18) - 2/(-12)-2. Let q(c) = 4c2 + 21c - 16. Determine gz(u) - 2q(u). 3u2 + 2u - 1 Let n(l) = -l + 7. Let h(x) be the second derivative of 5x3/6 - 17x*2 + 6x + 141. Determine -2h(p) - 11n(p). p - 9 Let v(o) be the second derivative of 60o3 - 81o*2/2 - 1084o. Let u(w) = -9w + 2. Give 81u(q) + 2v(q). -9q Let t(o) = 13. Let h(j) = j + 25. Let n(s) = s*3 + 85s*2 + 84s - 5. Let a be n(-84). What is at(v) + 2h(v)? 2v - 15 Let g(n) = 7n*3 + 4n*2 + 5n + 6. Let o(y) = -8y3 - 5y*2 - 6y - 7. Let f be (-890)/(-30) + 3/9. Let x be 2 + f/(-4) + 22/(-44). Give xo(c) - 7g(c). -c*3 + 2c*2 + c Let x(j) = -33j*3 - 3j*2 - 8j + 2. Let v(i) = -34i3 - 4i*2 - 12i + 1. Give 3v(l) - 4x(l). 30l3 - 4l - 5 Let u(v) = -2v2 - 16v - 11. Suppose -8423 = 2d - 8435. Let f(k) = -k2 - 8k - 6. Calculate du(i) - 11f(i). -i*2 - 8i Let y(n) = 14n - 1. Let t(i) = -139i + 11. Give -2t(r) - 14y(r). 82r - 8 Let q(k) = k2 - 34k - 94. Let h(t) = -17t - 42. Determine -9h(z) + 4q(z). 4z*2 + 17z + 2 Let k(g) be the first derivative of 2g3/3 + 7g*2/2 - 13. Let c(x) = x. Let m = 16 + -13. Suppose -ml - 24 = -2f, 2l - 3 = -5f + 19. Give fc(r) - k(r). -2r2 - r Let h(y) = 7y + 3. Suppose 22r - 14r + 24 = 0. Let i(k) = 6k + 4. Calculate ri(u) + 4h(u). 10u Let v(a) = 7a + 359. Let k(z) = -13z - 729. Give -6k(i) - 11v(i). i + 425 Let a(t) = -t - 3145. Let f(z) = -4z - 15710. Calculate -14a(s) + 3f(s). 2s - 3100 Let v(i) = 20i2 + 8i + 488. Let t(h) = 7h2 + 3h + 158. Determine -11t(j) + 4v(j). 3j2 - j + 214 Let z(y) = -y + 1. Suppose 161 = h + 165. Let d(p) = -10p - 39. Let c be d(h). Let s(b) = 12b - 6. Give cs(v) + 6z(v). 6v Let v(n) = n*2 + 15n - 68. Let u be v(5). Let q(m) = -11 - 25m + u - 32. Let k(y) = -8y - 4. What is 11k(b) - 4q(b)? 12b Let c(j) = -3j*3 - 24j*2 - 12j + 113. Let g(x) = -3x3 - 20x*2 - 10x + 114. What is 5c(p) - 6g(p)? 3p3 - 119 Let h(q) = 3q + 5. Let c be 561/34(-4)/(-6). Let x(y) = -3y - 11. Let b(r) = r + 10. Let w(i) = 3b(i) + 4x(i). Calculate ch(l) + 4w(l). -3l - 1 Let i(t) = -85t + 14. Let v(r) = -167r + 23. Determine 11i(y) - 6v(y). 67y + 16 Let s be ((-96)/(-10))/(4/10). Suppose 0 = su - 33u - 99. Let d(o) = -6o + 5. Let t(m) = -2m + 2. What is ut(v) + 4d(v)? -2v - 2 Let v(y) = 25y*3 + 22y*2 - 6y - 2. Let z(g) = -27g3 - 27g*2 + 7g + 3. Determine 6v(b) + 5z(b). 15b3 - 3b*2 - b + 3 Let w be 2 + (3 + -5)(-2 + 1). Suppose -a - w = -15. Let s(g) = g - 4. Let y be s(a). Let v(l) = 4l + 7. Let k(o) = 5o + 8. Give yv(j) - 6k(j). -2j + 1 Let p be (-35)/(-21) - (-3 - (-4)/6). Let v(r) = -r2 + r - 1. Let t be 2/9 + 84/108. Let c(h) = h2 - 3h + 4. Calculate pv(l) + tc(l). -3l2 + l Let l(g) be the second derivative of g3/6 + g2/2 + 3529g. Let w(i) = 21i. Give -l(k) + w(k). 20k - 1 Let d = 3942 - 3948. Let t(q) = -2q + 25. Let b(j) = j - 13. Determine dt(m) - 10b(m). 2m - 20 Let q = 2 - 1. Let t(r) = -5r. Let d(j) = -4j. Let z(k) = 6d(k) - 5t(k). Let w(y) be the third derivative of -y3/3 - y2. Calculate qw(l) + z(l). l - 2 Let b(c) = 306c - 80. Let f(l) = -51l + 14. Calculate -6b(h) - 34f(h). -102h + 4 Let r(h) = -1728h - 14. Let k(a) = 5184a + 38. Give -3k(c) - 8r(c). -1728c - 2 Let o(c) = c3 + 2c*2 + c. Let f(r) = 3r*3 - 4r*2 - 12r - 2. Let d(i) = -f(i) - 5o(i). Let t(j) = -4j*3 - 3j*2 + 4j + 1. Give -4d(g) + 7t(g). 4g3 + 3g*2 - 1 Let r(x) be the first derivative of -13x4/4 + x3 + 5x2/2 - 3x + 1621. Let p(q) = 66q3 - 16q*2 - 26q + 16. What is 3p(o) + 16r(o)? -10o3 + 2o Let u(x) = 11x2 + 17x*2 - 50x*2 + 11x*2. Let d(b) = -144b*2. Calculate -4d(h) + 54u(h). -18h2 Let k(q) be the third derivative of q4/3 + q*3/3 - 984q*2 + 2. Let j(p) = -p. Calculate -6j(l) - k(l). -2l - 2 Let i(z) be the second derivative of -4z*4/3 + 5z*3/3 + 51z*2/2 - 6607z. Let v(j) = 11j2 - 7j - 34. Determine -5i(n) - 7v(n). 3n2 - n - 17 Let g(k) = -k3 - k2 - k + 1. Let r(i) = i3 - 25i*2 - 67i - 2. Let o(l) = l*3 - 36l*2 - 98l - 2. Let w(m) = 5o(m) - 7r(m). Give -4g(t) + w(t). 2t3 - t2 - 17t Let a(r) = 11r + 9. Let i(w) = 4264w - 2134w + 4 - 2125w. Suppose 0q - 18 = 3q. What is qa(k) + 14i(k)? 4k + 2 Let q(g) = -1166g - 5. Let z(f) = -1771134f - 7596. Give -7596q(j) + 5z(j). 1266j Let v(n) = 30n + 3964. Let i(t) = -7t - 1006. What is -9i(o) - 2v(o)? 3o + 1126 Let o(z) = 5z2 - 6z - 5. Let r = 35 - 22. Let g(v) = 0 - 13v + 4 - 6 - 1 - 8 + 10v*2. Determine ro(a) - 6g(a). 5a*2 + 1 Let n(p) = 14p*3 - 11p*2 - 11p. Let s = 20887 - 20876. Let w(c) = -7c2 + c - 5c + 3c2 + 5c*3 + 0c. Determine sw(r) - 4n(r). -r*3 Let a(v) = 4v*2 + v - 3. Let d(m) = 15m*2 - 2m*2 - 16m*2 + 2m*2 - 1 + 2. Determine a(s) + 3d(s). s*2 + s Let m(x) = 2x*2 + 2x - 1. Let q(s) = 10s2 + 16s + 397. What is 6m(p) - q(p)? 2p*2 - 4p - 403 Let v(d) be the first derivative of d*2/2 - d - 4013. Let k(u) = 20u*2 + 6u - 8. Give -k(r) + 6v(r). -20r*2 + 2 Let t(j) = -3j + 3. Let w = 53714 + -53711. Let l be 1/(22/10 + -2). Let q(b) = 6b - 6. What is lt(m) + wq(m)? 3m - 3 Let p(b) = b*3 - b + 1. Let h(r) = 2r*3 - 59r*2 - 355r + 6. Let a be h(-5). Let l(d) = 5	{ "pile_set_name": "DM Mathematics" }
er? True Let c(q) = 83q2 + 13q + 143. Is c(-15) a prime number? False Let z be (3 - 3)(-3)/3. Suppose 5d + 454 = -zd + 2t, 5t + 383 = -4d. Is 1/(2/d-2) prime? True Suppose -6j = 7j - 48295. Is j composite? True Suppose -4m = 4f, 2m + 10f + 6 = 5f. Suppose 5t + ma = 5524 + 4137, -5a = -15. Is t a composite number? False Is 36/(-126) + (-11601)/(-7) a prime number? True Suppose 4888 = i - 5w, -3i + 0w - w + 14648 = 0. Is i composite? True Let r be (-212 + -11)/(2/(-6)). Suppose 393 = 3u - 3s - 0s, 5u + 2s = r. Is u a composite number? True Let s(j) = 1099j*2 + 7j + 7. Is s(-1) a composite number? True Suppose -4v = 7y - 10y - 604, 0 = 2y + v + 399. Let x be 3/((-92)/(-94) - 1). Let o = x - y. Is o composite? False Suppose -4r + 4w + 9400 = 0, -87r + 82r - 3w + 11758 = 0. Is r a prime number? True Let o(r) = 7r*3 + 7r2 - 9. Is o(4) a prime number? False Let x = 1156 + 481. Is x prime? True Let c = 3662 - 723. Is c prime? True Let n(x) be the third derivative of -x6/120 - x*5/6 - 29x*3/6 - 12x*2. Is n(-13) a prime number? False Suppose -5b - 20m + 24m = -516613, 3b + 5m = 309953. Is b prime? False Let u(p) = 6531p3 + 5p*2 - 6p + 5. Is u(3) a prime number? True Suppose -3h + 94p + 32348 = 93p, 0 = -3h + 2p + 32353. Is h a composite number? False Let o = 1209 + 1588. Is o a composite number? False Let n = 44 - -67. Let f = n + -54. Is f composite? True Let c(i) = -i + 1. Let q(o) = -1. Let w(h) = 2c(h) + q(h). Let y be w(-2). Suppose 7x - 2x + b = 2158, -3b + 2164 = yx. Is x a prime number? True Let i be (465/4)/(12/48). Let o be (22/33)/(((-5)/222)/5). Let c = i + o. Is c prime? True Suppose 0 = i + 4i - 30. Let b be 63 + (1 - (2 + -1)). Is (2 + 0)/(i/b) prime? False Let z = 47909 + 17492. Is z a composite number? True Let w(s) be the third derivative of s6/120 + s5/12 - s4/4 + 7s*3/6 + 14s*2. Let a be w(-6). Suppose -af - 446 = -9f. Is f prime? True Suppose 5t - 23 = -0t - m, t - 3 = -m. Suppose x = tx. Suppose 3n - 1240 = 5c, xn - 420 = -n - 5c. Is n composite? True Let l be -2 - (-6)/44. Suppose lt - 20 = -t. Suppose -tk + 7k = 753. Is k prime? True Suppose 0 = 64w - 2564323 + 552227. Is w composite? True Let i(n) = -4 + 0n + 2n + 1. Let u be i(3). Is ((-3)/(-6))/(u/54) prime? False Suppose -1041 = -3b + 2k + 2k, 0 = -5k. Is b a prime number? True Let k(c) = 11c*2 + c + 39. Is k(8) a composite number? False Suppose 0 = -a - 909 - 371. Let c = -618 - a. Is c prime? False Suppose -26 = 6c - 4c. Let s = c + 11. Is (-28 - -2)/(s/5) a prime number? False Let h(g) = 4g - 1. Let c be h(1). Suppose cz = 7z - 844. Is z prime? True Let n(x) = -60x + 21. Let k(o) = 20o - 7. Let j(h) = 7k(h) + 2n(h). Let c = 718 + -715. Is j(c) a composite number? False Let u(d) be the second derivative of 9/2d2 - 1/10d5 + d3 + 0 - 4d - 3/4d*4. Is u(-8) composite? False Suppose 7t + 2m + 2715 = 10t, 0 = t + 5m - 922. Is t a composite number? False Let b(o) = 20o + 5. Let c(z) = 100z + 26. Let l(i) = -16b(i) + 3c(i). Let t be l(9). Let u = t - -313. Is u a composite number? False Suppose 20 = -5b, 5b + 24 = -r + 1352. Suppose -2w - r = -6w. Is w a composite number? False Is (-6594)/(-2) + -324/(-36) a composite number? False Let w be (-4440)/912/(-5). Suppose -3591 = -5i + w. Is i prime? False Is (454/(-2)11)/(2 + -3) composite? True Suppose 0 = 2w - 5t - 598 - 128, -1848 = -5w - 4t. Let k = -4 - -4. Suppose kf + 2f - 149 = 5r, -4f + w = 4r. Is f composite? True Suppose 0 = 5k + 8 - 3. Let x be (-105 + -11)(k - 10). Suppose 4u = -0u + 20, 3p - u - x = 0. Is p composite? True Let j(k) = 9k + 6k - 14 + 0. Let d be j(12). Suppose 0 = -3o + d + 467. Is o composite? False Suppose 8u + 1524 = 9u. Let m = 2491 - u. Is m a composite number? False Let m = -4 + 8. Let z be (30/m)/((-12)/(-1824)). Is (-2)/(-4)(-14 + z) prime? True Let m = -179 + 251. Let j = 11 + 273. Suppose -4f + m = -j. Is f composite? False Let k(t) be the third derivative of -2/3t4 - 3/2t*3 + 0t - t*2 + 0. Is k(-7) a composite number? False Let c be (-1 - -113)/((-61)/20 + 3). Let v = -1179 - c. Is v a composite number? False Is ((-4)/(-4))/(11/240570) + -1 a prime number? False Let q = -80 - -143. Is 12047/q - 4/18 a prime number? True Let d = 56 - 48. Suppose 8870 = -dm + 18m. Is m composite? False Let a(p) = -29p*3 - 4p*2 + 4. Let j be a(-13). Suppose 596 + j = 7c. Is c prime? True Let h(i) = -271i - 26. Let g(z) = 54z + 5. Let j(q) = 11g(q) + 2h(q). Is j(5) composite? False Let k = 1828 - -26113. Is k composite? False Let c(p) = 2977p - 1. Is c(2) prime? True Let o(n) = -n3 + 4n*2 + 2n + 9. Let a be o(5). Let d = 10 - a. Suppose 11u - du = -155. Is u prime? True Suppose 2c + 6 = 5c. Suppose 541 - 4187 = -ch. Is h a prime number? True Suppose -2w = 4j - 3 + 13, -4w = -4j - 16. Is 660 + 5 + (4 - w)/(-1) prime? False Suppose 3 = -2i + 3n, -15 = -3i - 4n + 6. Suppose ig = -2g - 10. Is ((-1)/g)/((-5)/(-1690)) prime? False Let m = 5991 + -4258. Is m prime? True Is (3282 - -1) + (-30 - -24) a prime number? False Is (-39)/(-91) + 29404/7 prime? True Is (3 - -1796) + (-4)/(-8)-8 composite? True Let y(b) = 8578b + 19. Is y(1) a composite number? False Let o(b) = -b2 - 1. Let g(w) = -189w3 - w2 - 2w - 1. Let p(f) = -g(f) + o(f). Is p(1) prime? True Let a(t) = 2835t - 80. Is a(11) composite? True Let b = 21 - 16. Suppose -bc + 8t + 204 = 5t, 2t = 3c - 122. Is (c + 1)/((-3)/(-15)) a prime number? False Suppose -d - 5o + 1363 = 0, -3d + 5o = 933 - 5022. Is d composite? True Let t(p) = -14p + 27. Let w be t(13). Let a = 24 - w. Is a composite? False Let t(n) = -n3 + 9n*2 + 12n - 13. Let o(c) = 8c + 58. Let g be o(-6). Is t(g) a composite number? False Let f = -11 + 15. Suppose -fw = -5p + w + 1185, 10 = -5w. Is p composite? True Let x be 3 + 2 + -2 - -945. Let q = 1427 - x. Is q prime? True Let c = -85 + 77. Let s(i) = 15i2 - 10i - 31. Is s(c) composite? False Let c = -48 + 46. Is -4 + (686 - -1 - c) prime? False Let m(t) be the third derivative of t5/4 - t4/24 - 13t3/6 - 14t*2. Is m(6) a prime number? True Let n be 3/6 - (-14)/4. Let g be n/6(-15)/(-2). Suppose -85 = -q - gz, 5z - z - 276 = -4q. Is q a prime number? False Suppose -2s + 14 = 5x, 0 = 4x - 5 - 3. Suppose 4y + 4o - 1644 = 0, 0y + y - so - 417 = 0. Is y a prime number? False Let j(a) = -4a2 - 9a. Let x be j(-13). Let g = x + 873. Is g(-1 - (-9)/6) prime? True Let k be (-1 + 0 + (2 - -4))/1. Suppose 0f = -4f - 4t + 1872, -kf + 2346 = -t. Is f prime? False Let h(c) = c2. Let w be (2/5)/(16/80). Let k be h(w). Suppose 0 = 3b + 5 + 4, -24 = -4z - kb. Is z a composite number? True Let w = 8 - 14. Let n be (-479)/(-2) - (-3)/w. Is -1 + 1 - (2 - n) prime? False Suppose -4t + 20 = 2w - 4, 2t - w - 8 = 0. Suppose -ti = 2y - 390 - 131, 4i - 403 = 3y. Is i composite? False Suppose 3o - o = -2v, 3v - 3o = 18. Suppose -4517 = -vc - 0j + j, -4j + 3002 = 2c. Suppose 0 = m + 4m - c. Is m composite? True Suppose -739 - 367 = -14o. Is o prime? True Let w(b) = -b3 - 13b*2 + 16b + 29. Let f be w(-14). Is f/(-3) - (-2758)/21 a prime number? True Suppose 0 = -3u + t + t + 1069, -3u + 3t = -1071. Suppose -4c + 393 = -u. Is c a prime number? False Let v = -1553 + 2773. Suppose -w + v = w. Suppose -w = -4d + 538. Is d a composite number? True Let l(h) = 14h*2 + 47h + 34. Let a(p) = 7p2 + 23p + 17. Let c(y) = 13a(y) - 6l(y). Is c(-14) composite? False Let t(s) = -5s3 + s2 + 6s + 4. Let m(i) = -i*3 + i - 1. Let y(a) = -4m(a) + t(a). Let w be y(6). Let x = w - -489. Is x a prime number? False Suppose 4j = n + 2j - 4, 5n = -3j + 20. Is 211(n + -2) + (-1 - -1) prime? False Let f = 13 + -11. Is (2/3)/(f + (-760)/381) a composite number? False Suppose -n - n - 26 = 0. Let f = 31 - 21. Let k = f - n. Is k a composite number? False Let g = 5108 - 3177. Is g a composite number? False Suppose -3y - 5q + 206 = 0, y = 2q - 14 + 90. Let z = y + 14. Let c = z + -37. Is c composite? True Let a(q) = 9q2. Suppose 4c - 5y - 1 = 0, 3c - y + 3 = -c. Let l be a(c). Let o(d) = 2d*	{ "pile_set_name": "DM Mathematics" }
rime factors of 56677595? 5, 13, 871963 What are the prime factors of 6659539082? 2, 7, 2741, 173543 What are the prime factors of 814998523? 79, 10316437 What are the prime factors of 3683847544? 2, 13, 1327, 26693 List the prime factors of 386161169. 18379, 21011 List the prime factors of 65936483. 439, 150197 What are the prime factors of 266209393? 266209393 What are the prime factors of 5497692480? 2, 3, 5, 7, 90901 List the prime factors of 12297652. 2, 3074413 What are the prime factors of 645069711? 3, 11, 13, 1503659 List the prime factors of 798780364. 2, 2437, 81943 List the prime factors of 1409036043. 3, 469678681 What are the prime factors of 519090775? 5, 7, 131, 22643 What are the prime factors of 1562147923? 7, 223163989 List the prime factors of 72589790. 2, 5, 7, 13, 79769 List the prime factors of 57371589. 3, 11, 43, 13477 List the prime factors of 291383963. 13, 1093, 20507 List the prime factors of 1179026864. 2, 73689179 List the prime factors of 81525767. 81525767 What are the prime factors of 174748042? 2, 7, 61, 204623 What are the prime factors of 336265388? 2, 84066347 What are the prime factors of 39706899? 3, 13235633 What are the prime factors of 10387619? 11, 944329 List the prime factors of 1533140685. 3, 5, 19, 1793147 What are the prime factors of 136712833? 127, 151, 7129 What are the prime factors of 107028602? 2, 53514301 List the prime factors of 771609696. 2, 3, 11, 13, 56207 List the prime factors of 85535797. 85535797 What are the prime factors of 104169198? 2, 3, 7, 354317 List the prime factors of 134106646. 2, 59, 71, 16007 List the prime factors of 4694762575. 5, 37, 43, 118033 What are the prime factors of 76214874? 2, 3, 313, 40583 List the prime factors of 192695478. 2, 3, 32115913 List the prime factors of 14723340. 2, 3, 5, 245389 What are the prime factors of 692250580? 2, 5, 7, 139, 35573 What are the prime factors of 35671501? 113, 315677 What are the prime factors of 18688727? 107, 389, 449 What are the prime factors of 24529555? 5, 17, 288583 What are the prime factors of 44014450? 2, 5, 19, 107, 433 List the prime factors of 336487651. 61, 599, 9209 List the prime factors of 552075290. 2, 5, 13, 941, 4513 List the prime factors of 945025585. 5, 7, 89, 303379 What are the prime factors of 269092452? 2, 3, 43, 521497 What are the prime factors of 769727463? 3, 61, 239, 17599 List the prime factors of 38849212. 2, 29, 53, 71, 89 List the prime factors of 55184780. 2, 5, 7, 56311 What are the prime factors of 64297426? 2, 32148713 What are the prime factors of 58069103? 659, 88117 What are the prime factors of 2685246834? 2, 3, 173, 2586943 List the prime factors of 58415686. 2, 7, 29, 143881 What are the prime factors of 221875780? 2, 5, 7, 1584827 List the prime factors of 26255354. 2, 59, 101, 2203 List the prime factors of 193651090. 2, 5, 3253, 5953 What are the prime factors of 925600? 2, 5, 13, 89 List the prime factors of 95021216. 2, 47, 63179 List the prime factors of 3629379412. 2, 223, 4068811 What are the prime factors of 6224744400? 2, 3, 5, 7, 105863 What are the prime factors of 624472812? 2, 3, 17346467 What are the prime factors of 2847633067? 131, 21737657 What are the prime factors of 85951839? 3, 19, 89, 16943 What are the prime factors of 89454833? 13, 17, 404773 What are the prime factors of 139334707? 139334707 List the prime factors of 2537440565. 5, 11, 46135283 What are the prime factors of 28333578? 2, 3, 7, 13, 51893 List the prime factors of 657148869. 3, 13, 659, 947 What are the prime factors of 439589825? 5, 17, 47, 59, 373 List the prime factors of 17463174. 2, 3, 59, 49331 What are the prime factors of 177207345? 3, 5, 7, 62507 List the prime factors of 187934623. 47, 3998609 List the prime factors of 528534141. 3, 149, 1182403 What are the prime factors of 148892979? 3, 263, 188711 What are the prime factors of 4127173562? 2, 839, 2459579 List the prime factors of 502504328. 2, 401, 156641 List the prime factors of 40133012. 2, 37, 271169 List the prime factors of 287972850. 2, 3, 5, 11, 37, 53, 89 List the prime factors of 219645305. 5, 11, 311, 12841 List the prime factors of 3514183491. 3, 7, 13, 277, 46471 What are the prime factors of 4603849? 41, 112289 What are the prime factors of 102300661? 29, 443, 7963 What are the prime factors of 184656444? 2, 3, 7, 2198291 List the prime factors of 23152475. 5, 926099 What are the prime factors of 34147063? 283, 120661 List the prime factors of 198735826. 2, 173, 613, 937 What are the prime factors of 26016340? 2, 5, 7, 185831 List the prime factors of 169630326. 2, 3, 31, 303997 What are the prime factors of 143692466? 2, 17, 4226249 What are the prime factors of 80534518? 2, 61, 660119 List the prime factors of 200559050. 2, 5, 4011181 List the prime factors of 1208428298. 2, 7, 11, 31, 36161 What are the prime factors of 7277458899? 3, 59, 2417, 17011 What are the prime factors of 1151190041? 9733, 118277 List the prime factors of 1880573950. 2, 5, 37611479 What are the prime factors of 179353399? 179353399 List the prime factors of 860543927. 17, 71, 712961 What are the prime factors of 24550794? 2, 3, 1363933 List the prime factors of 51478725. 3, 5, 211, 3253 What are the prime factors of 26509482? 2, 3, 173, 8513 What are the prime factors of 61988659? 19, 1531, 2131 List the prime factors of 44128139. 11, 4011649 What are the prime factors of 52661260? 2, 5, 23, 239, 479 List the prime factors of 27028940. 2, 5, 43, 53, 593 List the prime factors of 309901689. 3, 59, 583619 What are the prime factors of 56257431? 3, 18752477 What are the prime factors of 7492977827? 3001, 2496827 List the prime factors of 5503069553. 53, 103831501 List the prime factors of 48298560. 2, 3, 5, 50311 List the prime factors of 8423461. 8423461 What are the prime factors of 3336587835? 3, 5, 7, 31777027 List the prime factors of 160944469. 7, 197, 16673 What are the prime factors of 23332086? 2, 3, 1296227 What are the prime factors of 4110575936? 2, 64227749 What are the prime factors of 257680133? 1571, 164023 What are the prime factors of 544907109? 3, 181635703 List the prime factors of 1451091245. 5, 31, 179, 52301 List the prime factors of 2318628820. 2, 5, 115931441 List the prime factors of 4951783749. 3, 11, 17, 97, 90997 List the prime factors of 156939778. 2, 8521, 9209 What are the prime factors of 339595832? 2, 953, 44543 What are the prime factors of 544305133? 17, 32017949 List the prime factors of 99914517. 3, 199, 55787 List the prime factors of 411952833. 3, 2269, 20173 List the prime factors of 2115061013. 13, 162697001 What are the prime factors of 105678632? 2, 13209829 What are the prime factors of 64970668? 2, 7, 17, 31, 37 What are the prime factors of 3568454325? 3, 5, 293, 18043 What are the prime factors of 174893862? 2, 3, 11, 13, 47, 4337 What are the prime factors of 229646121? 3, 3929, 19483 List the prime factors of 3223872926. 2, 59, 1997, 13681 What are the prime factors of 15963206? 2, 7, 37, 30817 List the prime factors of 58282763. 7, 11, 756919 List the prime factors of 1776486091. 1776486091 List the prime factors of 5895424750. 2, 5, 163, 199, 727 List the prime factors of 272817919. 11, 24801629 What are the prime factors of 499102? 2, 61, 4091 What are the prime factors of 221781813? 3, 11, 17, 19, 20807 What are the prime factors of 4141718492? 2, 1035429623 List the prime factors of 2263544980. 2, 5, 31, 773, 4723 What are the prime factors of 8427155? 5, 11, 17, 9013 What are the prime factors of 51223140? 2, 3, 5, 284573 List the prime factors of 685494133. 109, 6288937 List the prime factors of 22352940. 2, 3, 5, 124183 List the prime factors of 2119645793. 257, 719, 11471 List the prime factors of 7045143974. 2, 11, 320233817 List the prime factors of 49768820. 2, 5, 419, 5939 What are the prime factors of 173545729? 7, 1723, 14389 List the prime factors of 464570619. 3, 31, 4995383 What are the prime factors of 79981858? 2, 11, 61, 107, 557 List the prime factors of 309128184. 2, 3, 1431149 What are the prime factors of 893076190? 2, 5, 19, 4700401 What are the prime factors of 6492108121? 17, 349, 1094237 What are the prime factors of 153750349? 953, 161333 What are t	{ "pile_set_name": "DM Mathematics" }
h(0). Let g be (-4 + 3 + 7)2/n. Which is the biggest value? (a) z (b) g (c) 3 c Suppose 10 - 30 = 5v. Let x = -243/4 - -61. Let d be (0 + 0)(4 - ((-88)/16 + 9)). What is the third smallest value in d, v, x? x Let t be 32/30 - 6/15. Let o = 126 - 1388/11. Suppose 3k = 2g + 3, -2k = 3g - 8g + 9. Which is the second smallest value? (a) t (b) o (c) k a Let m be (-962)/396 + 6/(-12). Let o be 3(-3)/(81/(-28)). Let f = o + m. Which is the second biggest value? (a) -1 (b) f (c) 2/7 b Let p = -156069/111485 + -2/22297. Let l be (-2)/1-1 + -2. Which is the fourth smallest value? (a) p (b) -0.2 (c) l (d) 4 d Let g = 0.774 - -0.026. Let k = -1 + g. Let v = 1 + -0.8. What is the biggest value in -5, v, k? v Let f = 30 - 7. Let j = 23.42 - f. Let s = 0.12 - j. What is the third smallest value in -2/9, s, -0.1? -0.1 Let r = -0.695 - 3.305. Which is the fourth smallest value? (a) r (b) 0.5 (c) 34 (d) -7 c Let a be 0 + 24/15 + -2. Suppose -h - 7c + 3c = 397, -400 = h + c. Let v = h - -2011/5. What is the biggest value in v, a, 2/5? v Let m = -9 - -29. Let u be 4/m - (-36)/20. Let f be ((-8)/(-15))/(u/5). Which is the smallest value? (a) f (b) -2/7 (c) 5/3 b Suppose -9z + 15z - 12 = 0. Let g be ((10/70)/(1 - z))/1. Which is the biggest value? (a) 4/3 (b) g (c) -0.01 a Let g = 0.6 + -1. Let q = -0.0611 + 0.4611. Which is the second smallest value? (a) g (b) q (c) 1/5 c Let o = 274 + -299. Which is the biggest value? (a) -5 (b) o (c) 4 c Let y = -8.95 + 4.95. What is the second smallest value in y, -1.7, -32? y Let a = 0.0024 - 1.0024. What is the third biggest value in 21, -2/7, -4, a? a Let k be (-1 - -2) + (2 - 1). Let y be 1 + (k - (-70)/(-22)). Let n be -3 + (4 - 2) + 1. Which is the second biggest value? (a) -5 (b) n (c) y c Let s = 1.81 - 0.91. Let q = -8 + 4. What is the smallest value in -0.5, q, s? q Let v(l) = l*3 + 16l*2 + 57l + 24. Let w be v(-11). Which is the second biggest value? (a) -5 (b) 10 (c) w c Let r = 27.5 + -24.5. Let t = 1.2 - -0.7. Which is the third biggest value? (a) t (b) 2 (c) -2 (d) r a Let o = 24 + -27. Let d = 0.59 - -5.01. Let y = d + -6. What is the smallest value in o, y, 0.5? o Let r = -15.96 + 16. Let j = -0.04 + r. Which is the fourth biggest value? (a) -5 (b) -0.3 (c) j (d) 0.2 a Let x = 8.5 - 9. What is the third smallest value in -2/19, x, -2/7? -2/19 Let g = -1.676 - 17.324. What is the third smallest value in 2, -23, g, 0.4? 0.4 Let j = 14.4 - 18.4. What is the biggest value in j, 5/3, -3/5? 5/3 Let p = 63.6 - 64. Let d be -1 + 44/82. Let u = d - 11. Which is the second smallest value? (a) u (b) 7 (c) p c Let x = -18.2 - -18. Which is the biggest value? (a) 4/5 (b) x (c) 2/5 a Let h be (-2)/(-14(-10)/30). What is the third biggest value in -0.1, 377, h? h Suppose -3 = 2n - 13. Suppose n + 3 = -2m. Which is the biggest value? (a) -5 (b) 0 (c) -2 (d) m b Let l = -36 - -5. Let p = 46 - 76. Let x = p - l. Which is the second smallest value? (a) -0.4 (b) x (c) 0.2 c Let w = 0 - 0.1. Let y = w - 2.9. Let n be (-1 + (-14)/(-12))/((-10)/(-12)). What is the second smallest value in n, y, 5? n Let w = -0.5 - -0.2. Let z = -506 + 507. Which is the smallest value? (a) 1/3 (b) z (c) w (d) -5 d Let g = 143 + -144.7. Let d = -11 - -11.7. Let u = g + d. Which is the second smallest value? (a) -1/4 (b) -0.5 (c) u b Let j = -0.3 - -3.3. Let r = -0.7 - -1. What is the second biggest value in j, r, -5? r Let o be (-2)/(-2) + 5(-18)/60. What is the second smallest value in 11, -2/9, o, 1/4? -2/9 Let q = 2.35 + -24.95. Let o = -23 - q. Which is the second biggest value? (a) -4 (b) -0.02 (c) o c Let m be -3 - (-12)/2 - 341/195. Let h = -18/13 + m. Let w = -4/25 - -41/100. Which is the second biggest value? (a) h (b) w (c) 4/7 b Suppose -h = -3, 0 = -5s + 4h - 0 - 22. Let l = 218 + -217. What is the biggest value in l, s, 2/3? l Let l = -0.05 + -4.95. Let v = 0.198 - 28.198. Let j = -23 - v. What is the smallest value in 2, j, l? l Let s = 1353/2 + -676. What is the third smallest value in -2/7, -21, s? s Suppose 28 = -3d + 7. Let w be d/(49/(-26)) - 4. Which is the second smallest value? (a) w (b) 1/4 (c) 0.3 b Let w = 24 - 18. Suppose 3q - 18 = -2x, -3q - 4x + w = -6. What is the third smallest value in -1/5, -1, q? q Suppose -2w - 11 = -i - 9, -5w - 4 = -3i. Let j = -3 - -2.5. Which is the second smallest value? (a) i (b) -0.4 (c) 3/2 (d) j d Let t be (-2)/16(0 - -6). Let u = 110 - 99. Which is the second smallest value? (a) t (b) 3/2 (c) u b Let p be (-130)/26 - 486/(-98). Let m = -0.4 + 0.7. What is the third smallest value in m, p, -2? m Let r be 1(-2 - -2)/(-3). Suppose r = 2w - 15 - 27. Let t = w + -61/3. Which is the second smallest value? (a) 0.3 (b) t (c) -1 a Let v = 10.62 - 0.62. Let u = -10.3 + v. What is the third biggest value in -2/9, u, 0? u Let x = 8805/4 + -2201. Which is the smallest value? (a) x (b) -0.2 (c) 84 b Let t = -5.5 - -5. Let k be 2 - 16/(-1) - 3. Suppose -2q = q - k. Which is the second biggest value? (a) q (b) t (c) 1 c Let x = -238 - -237.8. What is the biggest value in -1.4, x, 1? 1 Let j = 1168 - 1172. Which is the third smallest value? (a) j (b) -3 (c) 42 (d) 0.4 d Let m = 978 - 3911/4. Let n be (-46)/14 + (-2 - -5). Which is the smallest value? (a) m (b) -1/5 (c) -0.4 (d) n c Suppose 4l - 16 = p, 5l + 23 - 43 = -p. What is the third smallest value in l, 0, -2? l Let l be (-3)/(45/80) - (-3 + -2). Which is the third biggest value? (a) l (b) 0.3 (c) 22/5 (d) 3 b Let f = -1379 + 1374. What is the fourth smallest value in -1/3, f, -2/13, -4/5? -2/13 Suppose 5g = 4n + 5, 0 = n + 3g + 2g + 20. Let z = 9 + -5. Which is the third biggest value? (a) -1/6 (b) z (c) n c Let q be ((-1)/2)/(18/(-12)). Let r be (8/(-10))/((-4)/(-10)). Let v be (r - -4)1 - 6. What is the second smallest value in v, 0.1, q? 0.1 Let s = -461 + 461.03. Which is the second biggest value? (a) -0.2 (b) s (c) -2/7 (d) 0 d Let p be (4 - 2) + (0 - 162/87). Which is the fourth biggest value? (a) -0.2 (b) p (c) -1 (d) -0.4 c Let l = -43.07 + 0.07. Let s = -47 - l. Which is the second smallest value? (a) 4 (b) s (c) -5 b Let y = -13.65 + -0.35. Let w = -0.14 + 14.14. Let i = y + w. What is the third smallest value in i, -2/11, -3/4? i Let o = 0.55 + -38.55. Let m = o - -38. Let v = -10 - -7. Which is the third biggest value? (a) v (b) m (c) -1/5 a Let f = 605 + -601. Which is the third biggest value? (a) 1/7 (b) f (c) -0.5 c Let n = 204.3 - 204. Which is the smallest value? (a) 0.021 (b) n (c) 0.2 (d) -3 d Let v = 18.3 + -14. Let j = 0.3 - v. What is the smallest value in -5, -2/11, j? -5 Let y = -0.154 - 26.446. Let b = -27 - y. Let o = 274/5 + -55. What is the smallest value in o, b, 0.3? b Let h(r) = -4 + r*3 + 5r - 4 - 8r2 + 15. Let w be h(7). Let i = w + 9. What is the third biggest value in 0.4, -5, i? -5 Let v = 0 - -1. Let n be -10 + 2040/(-48)2/(-10). What is the biggest value in 0.2, n, -13, v? v Let s = -1170 + 1170.049. What is the biggest value in 0.1, -4/3, s? 0.1 Let r = -188.543 - -189. Let p = r + 0.043. Which is the third biggest value? (a) p (b) 5 (c) 0.06 c Let q = 451/2 - 225. Which is the smallest value? (a) q (b) -3/7 (c) -3 (d) -13 d Let u = -17.01 - -11.072. Let i = u - 0.062. Let h = 6 + -9. Which is the smallest value? (a) h (b) -5 (c) i c Let t be 100/125(-15)/18. Which is the third smallest value? (a) t (b) 34 (c) -9/7 b Let k(r) = r2 + 11r + 13. Let d be k(-9). Which is the third biggest value? (a) d (b) 0.5 (c) -0.37 a Let j = 0.17854 - 0.67854. Let w = -15 - -10. Which is the second smallest value? (a) 4 (b) j (c) -2 (d) w c Let s = -782 - -787. Which is the third smallest value? (a) -2/9 (b) s (c) 28/17 b Let f = 0 + 0.5. Let p(y) = -16y - 711. Let h be p(-46). Which is the second biggest value? (a) 0.2 (b) h (c) f c Let d = 43/3 + -313/21. Let r = 2 - 1.85. Let k = r - -0.05. Which is the smallest value? (a) k (b) d (c) 1 b Let i be ((-4)/(-6))/((-1)/(-69)). Let z = i - 50. Which is the second biggest value? (a) -8 (b) 2/5 (c) z c Suppose 2r + 7 = 3c - 10, -3c = -3r - 21. Suppose 14 = 5d - 5*m +	{ "pile_set_name": "DM Mathematics" }
y, 22 = g + 5y. Solve v - 1 = 4, 0 = -3o + gv - 7 for o. 1 Suppose 3v = -109 - 35. Let l = -48 - v. Solve l = 4z + 3x - 32, 2z = 6z + 4x - 36 for z. 5 Let u be (-18)/(-63)(280/4)/5. Solve ua - 3h = -7, -a - 5h = -2a - 6 for a. -1 Suppose 0 = -5q - 4p + 23, 0 = -3q - 0q - 5p + 6. Suppose 5t - 43 = h - 0h, q = t - h. Solve -4b + a + 15 = 0, -b = 5a - a + t for b. 3 Suppose -5 = -3a + 2a. Let i be (-6)/(-27) + 7548/54. Suppose 0 = -5g - 3m + 5m + i, -4g = 4m - 140. Solve aj + 25 = 0, -3j = 4x - j + g for x. -5 Let j = 19 + -14. Suppose 4m - 8 = 0, 2w - 4m = -w - j. Let z be 1 + (w + -3)/(-2). Solve 3r - 6 = q - 20, -5r - 27 = zq for q. -1 Suppose f - 91b = -86b - 10, -2f - b = -13. Solve 4c - 5w - 36 = 0, 7 - 3 = fc + 4w for c. 4 Let v(d) = 4d - 27d*2 + 3 - 13d + 28d2. Let s be v(9). Let b = 8 - s. Solve 5u - 3y + 16 = 0, 2u + by + 22 = y for u. -5 Let d(v) = -v2 - 22v - 17. Let s be d(-17). Let b = 71 - s. Solve 3c - 5r + 13 = 0, c - br = -4r + 1 for c. -1 Let u(b) = 5b - 16. Let p be u(10). Let k = p - 31. Solve 4r = t + 2t + 2, 0 = -2t - kr + 10 for t. 2 Let o(k) = 2k*2 - 43k + 97. Let z be o(19). Solve -2v + n = -2, -zv - 2 = v + n for v. 0 Let f(o) = o - 4. Let k be 84/8 + 6/(-4). Let g be f(k). Let b(s) = s - 3. Let a be b(g). Solve -4j - ac + 7 = c, -15 = -3j + c for j. 4 Let l be 36/4(-2 - (-60)/27). Solve 0 = -lc + 3p - 19, -c + 3 + 5 = 2p for c. -2 Let x be (-60)/(-14)28/6. Suppose 4d - 18 = -4h + 2, 0 = -4h + 2d + x. Solve 6i + 2l = hi + 2, i = 4l + 2 for i. 2 Let o(s) = -s*2 + 52s - 177. Let d be o(48). Solve 5a + 1 - 3 = -4j, -d = -5j for a. -2 Let t(d) = 22d + 1. Let u be t(1). Let a = u + -18. Let m = -2 + 4. Solve 5z = -aw, 4w - mz + 18 = 3z for w. -2 Let a = 59 - 156. Let x = -93 - a. Solve 0 = -xr + 7k - 2k + 29, 3r + 2k = -7 for r. 1 Suppose 5t + 113 = -3x - 138, 0 = 2t + 4x + 92. Let q be ((-1)/(-1))/((-13)/t). Suppose 6 + 6 = qi. Solve d - i = -3b + 1, 3d - 3b - 12 = 0 for d. 4 Let k be (2/(-1))/(1/(-2)). Suppose 4m - k = -r + 12, -5m = -r - 11. Suppose mn - 8 = n. Solve -3p + 25 = -5o, -p - np + 15 = 5o for p. 5 Let c(o) = 2 - o - 3o - 2 - 17. Let b be c(-5). Solve -bh + 16 + 5 = 4y, -2y + 9 = h for y. 3 Let z = -68 + 79. Solve 5q - 2v = -27, -3q - v = 3v + z for q. -5 Let d = -506 + 518. Solve 3m = -5l - 7 - 24, 0 = 4l - 4m + d for l. -5 Let a(g) = g3 + 2g*2 + g - 2. Let u be a(-2). Let l = -13 - u. Let d = -6 - l. Solve 0 = 2q - y + 7 + 3, dq + y = -10 for q. -4 Let z(v) = 3v + 11. Let o be z(-12). Let n be o/(-2)(-24)/(-20). Let x = n - 12. Solve -2k + 4 - 10 = 3p, xp + 3 = -3k for k. 3 Let c(k) = 6k*2 - 59k + 121. Let f be c(7). Let i = 1 + 4. Solve 2u + im = 9, 0 = -fu + 5u - m + 12 for u. -3 Suppose 7 = 2x - 1, -4x = b - 18. Solve 5g - 6 = -bv + 3v, v + 3 = 2g for v. -1 Let i = -4 - -1. Let q be i/5 + (-54)/(-15). Solve -4 = 2j, 0 = -qo + 2j - 8 + 27 for o. 5 Let h = -115 - -173. Let z be h/14 + 19/(-133). Solve -2j - 3j = zb - 36, 0 = -b - 5j + 24 for b. 4 Suppose i = -h + 1, h = -2i + 4i - 2. Solve -2u - 5 = 5w, h = -4u - 4w + 13 - 5 for u. 5 Let k(f) = f2 + 6f + 2. Let h be k(-6). Suppose 2 + h = z. Solve 4l + 14 = 2m, l + 4l = zm - 19 for m. 1 Suppose -19 = -4x + 1. Suppose -h - 4j = -20, 2h + 0j = 4j - 8. Suppose -hz + 11 = -x. Solve 2p - 2 = 2c, -zp + 0c = c + 21 for p. -4 Suppose r + 0r + 12 = 5k, -3r + 5k = 16. Let d be (-3)/((-10 - -8)(-1)/r). Solve -l + 18 = 5i, di = -5l - 2i + 10 for l. -2 Suppose 5m - 10 = -5i, i + 8 = -4i + 4m. Suppose iv + 60 = 2v. Suppose v = 4f - 50. Solve 4k - f = -l - 5, -12 = -2k + 4l for k. 4 Suppose 30 = -2z - 3z. Let y be 1/((-10)/(-65)) - z/(-4). Solve 4b + 15 = -i, -2i + 11 = yb + 29 for i. 1 Let d = -6 + 12. Let w(l) = -l*2 + 5l. Let j be w(4). Let g = d - j. Solve 2c = -4k + g, 15 = 2c - 7c for k. 2 Suppose 8 = -4t - 0t, 0 = -5g - 4t + 7. Solve -2s + 2z + 0z = -2, -3 = -2s + gz for s. 0 Let a = -242 - -247. Solve -x - 8 = -as, 4x - 7x - 2s = 7 for x. -3 Suppose 638 - 593 = 15a. Solve -14 = -2x + 4p, -2p = -ax - x + 16 for x. 3 Let m = -352 - -356. Suppose 4h = -h. Solve ml + g - 15 - 5 = h, 0 = -3g for l. 5 Suppose -13a = -7a - 234. Solve 11 - a = -4o + 3u, -u = o for o. 4 Suppose -27 = 2g + 33. Let v = g - -35. Solve 0z = vz - 5q - 35, 3z + 2q = 1 for z. 3 Let x = -12 + 40. Suppose -55q + 776 = 42q. Solve v + 0m = -m - q, -2v = 5m + x for v. -4 Let j(a) = -a + 8. Let n be j(6). Let q be 100/303/n. Let w = -4 + 7. Solve -2 = -5v + w, -qk = 2v + 13 for k. -3 Suppose 5z - 385 = 3r - 0r, 308 = 4z - 3r. Let i = -62 + z. Solve 2t + 7 = 5c - 23, -3t = i for c. 4 Let f(i) be the third derivative of i4/12 - i3/2 + 2i2. Let g be f(4). Suppose 297 = 48q - 21q. Solve -gz + 10 = -4d - q, z + 11 = -3d for d. -4 Let l(x) = x*3 + 5x*2 - 5x - 28. Let o be l(-4). Solve -4j - o = -3k - k, -5j = -2k + 16 for k. -2 Suppose 0 = s + 2q - 24, 0 = 2s - 3q - 27 - 0. Solve 4n - s = 2y, 0 = 8y - 6y - 5n + 20 for y. -5 Let q be (-2 - (-8 - -4))-1. Let t be (-2)/3 + q/(-3). Solve 3r - 5s + 5 = t, 3 + 0 = -r + 2s for r. 5 Let d = -241 - -249. Solve -3f + 6f = -4z - d, 5z = 2f - 33 for z. -5 Let n(f) = -2f*3 - 15f*2 - 8f - 1. Let t be n(-7). Let d = t + -3. Solve 0 = 4q - 5w + 6 - 14, -3q - dw - 21 = 0 for q. -3 Let i be (-2)/8 - 371/(-28). Let n = 17 - i. Let c be (1-20)/n-1. Solve -5y - 25 = -cz, 4z = 5y + 4 + 18 for z. 3 Suppose -4q + 4z + 21 = -7, 0 = q - 5z - 23. Solve -qy = 3v + 24, -5v - 4y = 30 + 5 for v. -3 Let n be ((51/(-2))/(-3))/((-10)/(-120)). Let g = n + -102. Solve -9 = -5a - d, g = -0a + 3a - 3d - 9 for a. 2 Let x be ((-15)/2)/((-5)/10). Suppose -2l - x = l. Let m be (-12)/l + 4/(-10). Solve -w - ma + 13 - 3 = 0, 0 = -a + 4 for w. 2 Let o(b) = b3 + 29b*2 + 3b + 91. Let s be o(-29). Solve 3p + s = -w, 2w = 5p - 3w for p. -1 Suppose -p + 15z + 11 = 17z, 55 = 5p - z. Solve n - 2d = 13, 5n - p = -d + 10 for n. 5 Let s(h) = h3 + 4h*2 - h - 2. Let g be s(1). Solve -p - gv + 3 = v, -p - 2v = -3 for p. 3 Suppose 2t - 16 = -6t. Suppose 9 = i - tr - 0r, -3i + r + 12 = 0. Solve 2 = -2q, 0 = -iw + q + 4 + 3 for w. 2 Let m(h) = h*2 + 3h - 26. Let i be m(-6). Let q = -8 - -4. Let p = q - i. Solve -4d + 0d + 16 = pj, j = -2d + 5 for d. 1 Suppose 6x + 3n = 10x - 604, -2x = 5n - 302. Let s = x - 149. Solve -d - sd - w - 14 = 0, 4w = -4d - 32 for d. -3 Suppose -2n = -0 - 2. Suppose 2q - n - 47 = 0. Solve 3p + q = 2a - p, 2a + 4p = -16 for a. 2 Let o(u) = -19u + 2. Let c be o(3). Let j be c/11(-4)/1. Solve 0 = 2s - 2v - v - 13, 5s + 5v - j = 0 for s. 5 Let w = 27 - 25. Let m be (16/32)/(w/12). Solve 4v = 2x + 16, -mx - 12 = -0x - 3v for x. 0 Let x(c) = -2c - 4 + 0c + c. Let a be x(-6). Let m = 577 + -575. Solve -4b = -mv + 6, -av + 13 = 2b + b for v. 5 Suppose 26x + 56 = 34x. Solve -2v - 4n = 15 - x, 9 = -4v - n for v. -2 Let x be ((-4 - 0) + 6)/1. Solve 4t - xu = -0u - 14, -6 = 2u for t. -5 Let n be ((-50)/(-35))/((-6)/(-21)). Let j(c) = -2c3 + 10c*2. Let m be j(n). Solve 22 = -5y - q, mq = -2y - 4q + 2 for y. -5 Let u = -165 + 166. Suppose 0 = 2w + 5k - 3, -2w - 3k = -4 - u. Solve -p - wz - 8 = 0, -2p = -4p + 3z - 5 for p. -4 Let l be 269/2 + 9/(-6)1. Let q = 165 - l. Solve 3y - 7 = 4r, y + 3y + q = -5r for y. -3 Let u(t) = 5t - 1. Let n be u(1). Suppose nq = -0q + 52. Let l(y) = y3 - 6y*2 + y - 3. Let z be l(6). Solve 9 = zk, -1 + q = 3s + 3k for s. 1 Let m(x) = -9x2 - 29x - 2. Let j be m(-3). Solve -jg - 3i + 0 = 6, 0 = 3g + i + 7 for g. -3 Let o = -447 - -451. Solve -3w = -i + 4 + 2, -3w = oi - 9 for i. 3 Suppose -x = -2x. Suppose x = 2i - 4i. Solve 2k + 2l - 6 + 2 = i, 0 = 3k - 3l - 6 for k. 2 Let h(m) = -m3 - 3m*2 + 2m. Let u be h(1). Let f(n) = -n - 4. Let c be f(0). Let i be (c/u)/((-10)/(-20)). Solve -ir = -0k - 4k, -r - 1 = -2k for r. 1 Suppose -97h - 18 = -103h. Solve -hu - 3p - 6 = 0, 3p + 6 = 3u - 0u for u. 0 Suppose -m + 3d + 4	{ "pile_set_name": "DM Mathematics" }
0 divide b? False Suppose -5q + 156 = -2q. Is 12 a factor of q? False Let z = 6 + -1. Suppose 42 = zq - 193. Does 13 divide q? False Let c = 18 + -16. Is -3 + (5 - c - -84) a multiple of 14? True Let a(d) = d3 - 9d*2 - d - 15. Let x(j) = j + 1. Let w(c) = a(c) + 2x(c). Let u be w(9). Is 8 a factor of 3/u - 150/(-8)? False Let i(p) = 58p2 + p - 1. Let c be i(1). Let z = c - 2. Let d = z + -29. Is d a multiple of 7? False Suppose 5l - 393 - 102 = -5d, 0 = 2l - 5d - 177. Does 8 divide l? True Let n(f) = f2 - 11f + 8. Let v be n(10). Let l = v + 25. Is l a multiple of 9? False Let b = 18 - 15. Suppose -3k + 117 = bf, 2f - 2k = -6k + 82. Is f a multiple of 12? False Suppose -r = 3t - 113, 3t = -0t - 2r + 109. Is 13 a factor of t? True Let d(c) = -c2 - 8c + 3. Let g be d(-9). Is (-235)/g + (-5)/30 a multiple of 10? False Let q(a) = -a - 1. Let l be q(-7). Suppose 0 = 2r + n + n - 158, -2r = n - 159. Suppose 0 = lk - 2k - r. Does 10 divide k? True Let y(h) = -h*2 - 7h + 2. Let j be y(-7). Does 6 divide 3 + j/((-6)/(-27))? True Let i(r) = r*2 - 4r. Let f be i(3). Is 3 a factor of (-10)/3f/2? False Suppose 40 + 23 = 3p. Is p a multiple of 14? False Suppose 2f - 1 = -3, -3d + 25 = -4f. Is d a multiple of 7? True Let h = -8 + 13. Let l = h + -1. Is (-1304)/(-36) - l/18 a multiple of 12? True Let i(a) = 16a - 16. Is 24 a factor of i(13)? True Suppose m = 6m, 0 = -5g - 3m - 65. Let v(q) = -q2 - 14q + 2. Does 13 divide v(g)? False Let j(w) = w. Let v(m) = -m + 5. Let q be v(6). Let c(y) = y*2 + 9y - 4. Let h(f) = qc(f) + 3j(f). Is h(-6) a multiple of 3? False Does 5 divide (0 + -1)/(-1)5? True Is (3 - -87)/((-4)/(-6)) a multiple of 15? True Suppose m + 3u + 0 - 1 = 0, -3m + 3u = -15. Suppose -4s = -mb + 32, 2s - 4s = -5b + 34. Does 3 divide b? True Let x = 139 + -1. Does 25 divide x? False Suppose 2s = 4a + 10, -s + 0a + a = -3. Suppose n = 4t - s - 3, 0 = 4n + 3t - 3. Suppose n = -3z + 5w + 22, z = -4z + 5w + 50. Does 11 divide z? False Let b(p) = p + 2 + 14 + 1 + 2. Does 9 divide b(0)? False Is (3 - 0 - 5)/((-1)/11) a multiple of 3? False Suppose -a = -0a - 64. Suppose 4w = a - 4. Does 6 divide w? False Suppose -2h + 3h = 5j + 20, -4j - 4h = 40. Let r = 9 + j. Suppose 0 = g - rg + 30. Does 10 divide g? True Suppose -3s + 65 = 5g, g + 3g = -8. Suppose -l + 2l - 5z = 13, l - s = -z. Is 6 a factor of l? False Suppose -4m + 2l + 94 = 0, -3m = -6m - 3l + 48. Is m a multiple of 5? False Suppose -5c + 206 = p, -p - 3p + 3c = -893. Is p a multiple of 14? False Let l(j) = j*3 + 3j*2 - 4j + 6. Let d be l(-5). Let o = 50 + d. Does 26 divide o? True Let w(l) = l*3 + 6l*2 - 8l - 7. Let o be (-2 + 3)-17. Let j be w(o). Suppose -6n + 3n + 60 = j. Is n a multiple of 10? True Let b(z) = z*2 + 16z + 4. Is 20 a factor of b(-18)? True Let m(f) = -f*3 - 4f*2 - f + 7. Suppose -3c - 6 - 6 = 0. Does 10 divide m(c)? False Let r be ((-24)/(-30))/((-1)/5). Let b = 36 + r. Does 13 divide b? False Let g(t) = -t*3 + 3t*2 + 4t + 3. Let r be g(4). Does 22 divide (-4)/(-12) + 65/r? True Let a = -3 + 8. Does 2 divide a? False Let a be 6 - 1-2 - (-2)/1. Let b be (-4)/(4/(-2)) + 2. Let i = a - b. Is 6 a factor of i? True Suppose -3c + c + 118 = 0. Is 26 a factor of c? False Let r = -8 - -53. Is 9 a factor of r? True Let z(l) = -4l2 + 5l + 7. Let c(a) = 7a2 - 9a - 14. Let r(b) = 3c(b) + 5z(b). Is 14 a factor of r(-5)? True Let o(a) = -2a + 18. Is 9 a factor of o(0)? True Let t = -67 + 95. Is 4 a factor of t? True Let h be 1/(-3) - (-11740)/(-15). Does 27 divide ((-2)/3)/(6/h)? False Let p be 8(2 + 9/(-12)). Let q be 5/(10/16) + 2. Is (-4)/q + 134/p a multiple of 13? True Suppose 4x = 6x + 8, 0 = 3p + 3x - 30. Suppose n = -p + 38. Is n a multiple of 8? True Let y(i) = i*3 + 2i*2 - i + 2. Let x be y(-2). Suppose 0 = xt - 0t. Suppose 3s - 5s - 2o = -32, t = -s + o + 6. Is s a multiple of 5? False Suppose 6j - 3j - 36 = 0. Is 6 a factor of j? True Let h(a) = 4a3 - a + 1. Let p be h(1). Suppose pt - 25 = -t. Is t a multiple of 5? True Let s(r) = -24r + 2r*3 - 4r2 - r3 + 22r + 2. Is 11 a factor of s(5)? False Suppose 3c - 2v = -0c - 56, -2v = 4. Let n = 0 - c. Let x = n - 4. Is 7 a factor of x? False Let a(t) = t3 - 4t2 + t - 4. Let q be a(3). Is (q/25)/(2/(-80)) a multiple of 8? True Let o(m) = m2 - 4m - 30. Is 15 a factor of o(-6)? True Suppose 1 = -3p + 2v, -4v = -2p - p + 7. Let c = p - -6. Does 15 divide 15 - 0/(c/1)? True Let w(x) = -x3 + 5x. Does 22 divide w(-4)? True Let l(x) = 14x - 3. Let g(p) = -85p + 17. Let q(n) = -3g(n) - 17l(n). Let s be q(1). Let i = 27 - s. Is i a multiple of 8? False Suppose -4y + r + 9 = 0, -y = 3y + 4r - 4. Suppose yq = 5 + 3. Suppose -qt = 3n - 41, 0 = -5t + t - 16. Is 19 a factor of n? True Let m(o) = o2 + 6. Let d(z) = -z2 - 5. Suppose -2g + 4 = -3g. Let w(k) = gd(k) - 3m(k). Is 7 a factor of w(-3)? False Let z(r) = -2r*2 - r - 3. Let h be z(-6). Let b = -41 - h. Is 13 a factor of b? False Suppose -x + 0x = 0. Suppose -3r + xr = -z - 165, 2r - 100 = 4z. Suppose -v + 5v = r. Does 14 divide v? True Let m(u) = 2u*2 + 25u + 6. Does 26 divide m(-17)? False Let n = -67 - -114. Suppose -n = -3m + 22. Is 6 a factor of m? False Let r(n) = n2 + 5n + 7. Let z be r(-6). Let j = z - 8. Suppose 4f + 12 = -y, -jy - 3f = -6f - 32. Does 2 divide y? True Suppose 8v = 2v + 12. Suppose vw - 12 + 4 = 5k, -k = 0. Is 4 a factor of w? True Let a(u) = u*2 - u - 2. Suppose 2d - 3 = 7. Does 9 divide a(d)? True Let o = 0 + 0. Suppose -2d + 0d + 4y - 4 = o, 0 = 2d + 2y - 26. Let r(n) = n2 - 6n. Does 9 divide r(d)? False Let u be ((-8)/(-1) - 3) + -3. Suppose 2t - 7t + 7 = -k, -uk = -4t + 8. Does 17 divide 2/(k(-1)/18)? False Suppose 5n + 5a = 70, -34 = -0n - n + 3a. Is n a multiple of 17? False Suppose 0 = -v - 2d - 0d + 10, -3v = 4d - 22. Let m be (-1 - -2)/((-1)/(-2)). Suppose 0 = x + v - 3, -ms - 2x + 18 = 0. Is 4 a factor of s? True Let j(h) = 3h - 1. Let m be j(1). Suppose mw = -3w + 265. Is w a multiple of 24? False Let u be 6/9 - (-29)/(-3). Is 9(-2 - 84/u) a multiple of 22? True Let c = -5 + 5. Suppose 4b = -cb - 4. Does 11 divide -66(-3)/(-6)b? True Suppose 3 = 2f - 5. Suppose 0y = 4y - 5g - f, 22 = 5y - 2g. Is 4 a factor of y? False Let l = 15 - 10. Let f = 29 - l. Suppose -x - 6 + f = 4h, 2x - 24 = -2h. Does 10 divide x? True Let c(x) = x*2 + 2x + 1. Let v be c(-3). Suppose d = -d - v, -5t = -d - 392. Suppose 0 = -h - 2h + t. Does 13 divide h? True Let o = 71 - -107. Is o a multiple of 32? False Suppose 0 = -2w - 13 + 1. Is 27 a factor of ((-552)/9)/(w/9)? False Suppose 0w = -7w + 546. Does 13 divide w? True Let w = -39 + 59. Is 6 a factor of w? False Is 137 + 11 + -15 a multiple of 7? False Let i be ((-10)/(-4))/((-17)/(-68)). Is 4 a factor of ((-2)/4)/(i/(-340))? False Does 39 divide (-5764)/(-22) + 2/(2/(-2))? False Let j(o) = 11o - 7. Let i(b) = -6b + 3. Let q(n) = -15i(n) - 6j(n). Let s be q(-3). Let h = -26 - s. Is h a multiple of 24? False Suppose -4h = 3u + 39, -3u + 0h - 30 = h. Does 6 divide (-98)/(-6) + 3/u? False Let j be 112(0 + (-6)/(-7)). Suppose w = -3w - 2o + 128, j = 3w + 4o. Is 16 a factor of w? True Let d be 2 + -1 + -5 + 3. Is (d/(-3))/((-4)/(-228)) a multiple of 19? True Let h = 1 + 4. Suppose 9 - 51 = -w - q, -4w - hq = -173. Does 13 divide w? False Let l(g) = 39g*2 - g + 3. Let b be l(3). Let s = -197 + b. Suppose -5x = 2z - 54, 5z + 0x + 3x = s. Is z a multiple of 16? True Suppose -3k = -3o - 2o + 357, -4k = -2o + 140. Is 24 a factor of o? True Suppose 0 = m - 2b, -5m + 8 = -0b - 2b. Let l be (6/(-9))/(8/228). Is 9 a factor of (l/(-2))/(m/4)? False Let x be -67 + (-2 - -1)/1. Is 17 a factor of (x/6)/(6/(-18))? True Suppose -3i - 4 = 4f - 3f, -4f - 2i - 46 = 0. Let h = f + 37. Is h a multiple of 12? True Let j = 52 + -6. Does 23 divide j? True Suppose -82 = -2i + 5m, -2m - 27 = -3i + 118. Does 17 divide i? True Suppose -5y + 2j = 16, -2 = -2y - 4j + 6. Let f = y + 6. Is 3 a factor of f? False Suppose 2s = 4a - 4 - 12, 5a + 3s - 20 = 0. L	{ "pile_set_name": "DM Mathematics" }
475) - (-1 + sqrt(475))))*2 - -6(sqrt(19) - sqrt(76))*2. 10sqrt(19) + 590 Simplify ((sqrt(22)/sqrt(2))*25 + 1)-5-3. 840 Simplify (2 + sqrt(396) + sqrt(396) + ((2sqrt(396) - sqrt(396)) + sqrt(396) - sqrt(396)))2 + (51sqrt(55))/sqrt(5). 77sqrt(11) + 3568 Simplify ((sqrt(975) - sqrt(39))6 - sqrt(39))/(-5sqrt(21)/sqrt(7) + sqrt(3)). -23sqrt(13)/4 Simplify (sqrt(684) + -5 + sqrt(19) + (4sqrt(171))/sqrt(9))*2. -110sqrt(19) + 2324 Simplify (((sqrt(480)2 + sqrt(480))/sqrt(8) - sqrt(60))/(sqrt(24)/sqrt(2)3 - sqrt(12)))*2. 5 Simplify (sqrt(567) - -2sqrt(567))2 + sqrt(56)/sqrt(32). sqrt(7)/2 + 5103 Simplify 5 + (sqrt(13) - (sqrt(13) + (sqrt(1300) + sqrt(1300) + 2)2)). -5199 - 80sqrt(13) Simplify -5sqrt(38)/sqrt(2)-1. 5sqrt(19) Simplify ((sqrt(1100) + 4 + -3 + sqrt(1100) + sqrt(1100))-1)2. 60sqrt(11) + 9901 Simplify -1 + (sqrt(112)1)2 - sqrt(112). -4sqrt(7) + 111 Simplify sqrt(17) + sqrt(17) + -5sqrt(17) + 0 + -3sqrt(17)-2. 3sqrt(17) Simplify (sqrt(117)4 - (-5 + sqrt(325) - sqrt(325)))2. 120sqrt(13) + 1897 Simplify (3 + sqrt(114)/sqrt(54))6. 2sqrt(19) + 18 Simplify ((sqrt(130)/(sqrt(40)/sqrt(4)))*2 - sqrt(13)) + -4. -sqrt(13) + 9 Simplify (sqrt(133) - (sqrt(133) + -2sqrt(133)2))/sqrt(7) + 0. 4sqrt(19) Simplify (-3 + sqrt(99)/((-1sqrt(72))/sqrt(8)))1. -sqrt(11) - 3 Simplify sqrt(24)/(1sqrt(512)) + 3. sqrt(3)/8 + 3 Simplify ((sqrt(76) - 1sqrt(76))/sqrt(4) + -4)*2. 16 Simplify ((-3 + sqrt(539) - sqrt(11))6)*2. -1296sqrt(11) + 14580 Simplify ((sqrt(104) - 1sqrt(104))-4)/(sqrt(8) + sqrt(24)/sqrt(12)). 0 Simplify -2 + -1sqrt(5) - (-4 + sqrt(405)). -10sqrt(5) + 2 Simplify 5(4(-1 + sqrt(1900)))*2. -1600sqrt(19) + 152080 Simplify 2 + (sqrt(612)1)2. 614 Simplify 1(2sqrt(13) + -1 - sqrt(13)) + 4. 3 + sqrt(13) Simplify (43sqrt(228))/(sqrt(432)-3). -2sqrt(19)/3 Simplify ((-3sqrt(60)5 + sqrt(60))/sqrt(12))2. 980 Simplify ((sqrt(405) + 4 + sqrt(405) + -1)-5)*2. 2700sqrt(5) + 40725 Simplify (sqrt(121) + 2sqrt(121)2 + sqrt(121))/(sqrt(121)/sqrt(44)). 12sqrt(11) Simplify (sqrt(170)/(sqrt(30)/sqrt(3)-3 - sqrt(10)))*2. 17/16 Simplify ((sqrt(320) + 5 + sqrt(320)-2)*2 - (sqrt(320) + sqrt(320) + -3 + sqrt(320)1)*2) + 0. -2544 + 64sqrt(5) Simplify (sqrt(2) + sqrt(10)/sqrt(5)-3 + sqrt(2) + (sqrt(8) - 2sqrt(8) - sqrt(2)))*2. 32 Simplify (sqrt(28) + -1)3. -3 + 6sqrt(7) Simplify ((sqrt(14)-2)/sqrt(7) + sqrt(882))*2. 722 Simplify (((sqrt(38) - sqrt(152)/sqrt(4))3)/(sqrt(90)/sqrt(5)))*2. 0 Simplify (sqrt(12) + 1sqrt(108) - (sqrt(192) + sqrt(12))3)2. 1452 Simplify (sqrt(228) - (sqrt(228) - -1sqrt(228)))/sqrt(12) - -2sqrt(171). 5sqrt(19) Simplify (1 + (2sqrt(500) - sqrt(500)))2. 20sqrt(5) + 501 Simplify ((sqrt(833) + 1)4 - sqrt(833)) + -3. 1 + 21sqrt(17) Simplify (5 + 3 + sqrt(13)-3)2. -48sqrt(13) + 181 Simplify sqrt(95)/(4sqrt(25)/sqrt(5)). sqrt(19)/4 Simplify sqrt(84)/sqrt(300) - (3sqrt(343) - sqrt(343)). -69sqrt(7)/5 Simplify (5sqrt(49)/(sqrt(84)/(sqrt(108) + sqrt(12))))*2. 2800 Simplify (sqrt(39) - sqrt(351)3 - sqrt(39))/sqrt(3). -9sqrt(13) Simplify (sqrt(396) + (sqrt(396)-1 - sqrt(396)))*25. 1980 Simplify sqrt(204)/(sqrt(36)/sqrt(3)) - (sqrt(17) + (sqrt(17) - (sqrt(153))*2) + 2). -sqrt(17) + 151 Simplify -5 + (((sqrt(196) - sqrt(196)-2) + sqrt(196) + sqrt(196) + sqrt(196))/((sqrt(32) + sqrt(2))-1 - sqrt(2)))2. 93 Simplify (-1 + 3sqrt(208))*2 + 1. -24sqrt(13) + 1874 Simplify (-1((1sqrt(99) + sqrt(99))5 - (1sqrt(99) - sqrt(99))-4))2. 9900 Simplify sqrt(275) + (-5(sqrt(275) + 4))*2. 1005sqrt(11) + 7275 Simplify -2(sqrt(468) + 4)23. -2904 - 288sqrt(13) Simplify (sqrt(187)33)/(33sqrt(11)). sqrt(17) Simplify 5 + ((1 + sqrt(117) + -5)2 - sqrt(117)) + (-1 + sqrt(117))5. -12sqrt(13) + 133 Simplify (3 + sqrt(76))2 + sqrt(19) + 3 + 4. 13sqrt(19) + 92 Simplify 1 + (sqrt(17) - (6sqrt(85))/sqrt(5)). -5sqrt(17) + 1 Simplify (sqrt(121)/(sqrt(11) - (sqrt(99) - (sqrt(99)2 + sqrt(99)))))2. 11/49 Simplify sqrt(14)/((sqrt(162)/sqrt(9))/sqrt(9)). sqrt(7) Simplify -3 + (sqrt(19) + sqrt(38)/sqrt(2))2 + (sqrt(19) - -2(0 + sqrt(19))). 3sqrt(19) + 73 Simplify sqrt(34)/(sqrt(512) + sqrt(32)). sqrt(17)/20 Simplify (1 + (sqrt(220)/sqrt(4))/sqrt(11))2. 2sqrt(5) + 6 Simplify (sqrt(153) - (-6(-3sqrt(153) - sqrt(153)) - sqrt(153)))/sqrt(9). -22sqrt(17) Simplify (-4sqrt(12))*2 + 2. 194 Simplify -3(3 + (sqrt(36)/sqrt(2))/sqrt(9))*2. -33 - 18sqrt(2) Simplify (5sqrt(18)/sqrt(3))/sqrt(3). 5sqrt(2) Simplify -2 + (sqrt(85)2 - sqrt(85))/sqrt(5) + (sqrt(2057) + -2sqrt(2057)-1)2. sqrt(17) + 18511 Simplify (sqrt(195)/(sqrt(5)-3))/(sqrt(75) - (sqrt(75) - -1sqrt(75)) - sqrt(75)). sqrt(13)/30 Simplify 53-1(3 + -2 + sqrt(11)). -15sqrt(11) - 15 Simplify (-1sqrt(245) + sqrt(245))-2. 0 Simplify (sqrt(104) - 5sqrt(104)-2 - sqrt(104))/(-2sqrt(72)). -5sqrt(13)/3 Simplify -3(sqrt(19) + 2 + -3). -3sqrt(19) + 3 Simplify -3(2sqrt(6))/sqrt(2). -6sqrt(3) Simplify (((sqrt(375)-2 - sqrt(375)) + sqrt(15) - sqrt(15)) + sqrt(15))/sqrt(5). -14sqrt(3) Simplify (sqrt(160) + -1sqrt(160))/(sqrt(2)-1-2). 0 Simplify (sqrt(126)3 - sqrt(126))/sqrt(7) + -1. -1 + 6sqrt(2) Simplify -6(sqrt(140)/sqrt(7))*21. -120 Simplify (sqrt(99) - (sqrt(99)2-3 + sqrt(99)))/(sqrt(27)/sqrt(3)-5). -6sqrt(11)/5 Simplify (sqrt(25)/sqrt(5) - sqrt(5))6 + -4. -4 Simplify 3 + (sqrt(500) - (3 + sqrt(500) + -1)) + 4. 5 Simplify (sqrt(1377) - sqrt(1377)-2) + 5. 5 + 27sqrt(17) Simplify -4(sqrt(17) + 0 + sqrt(17) + 1 - (sqrt(119) + sqrt(119)1 + sqrt(119) + sqrt(119))/sqrt(7))2. -276 + 16sqrt(17) Simplify (sqrt(1872) - sqrt(1872)-1)2-6. -44928 Simplify (sqrt(1300) - (-1 + 0 + sqrt(1300)))*2. 1 Simplify (sqrt(55) - sqrt(110)/sqrt(2))/sqrt(11) - (42sqrt(5) - sqrt(5)) - (5(sqrt(720) + 0))*2. -18000 - 7sqrt(5) Simplify ((51sqrt(156))/(1sqrt(192)))2. 325/16 Simplify (1 + sqrt(272) + 4 - (1sqrt(272) + 2))*2. 9 Simplify (sqrt(25)/(sqrt(5)2) - (sqrt(5) - ((sqrt(25) + sqrt(100)/sqrt(4))/sqrt(5))*2 - sqrt(5) - sqrt(5))) + (-1 + sqrt(320) + sqrt(320) + -1sqrt(5)4)2. -45sqrt(5)/2 + 741 Simplify (1sqrt(500))/(sqrt(512)/sqrt(8)) + 5. 5sqrt(5)/4 + 5 Simplify (4 + sqrt(99))-1-6. 24 + 18sqrt(11) Simplify (-3 + 1 + (sqrt(13) - (sqrt(13) + -2 - sqrt(13))) + (sqrt(13) + -3)1)*2. -12sqrt(13) + 61 Simplify sqrt(75) - ((sqrt(75) - (sqrt(75) - (sqrt(75) + (sqrt(75)1)2))) + sqrt(75) + -1). -74 - 5sqrt(3) Simplify (sqrt(76) + sqrt(76)14 - sqrt(76))/sqrt(4). 4sqrt(19) Simplify (-5(0 + sqrt(17)) - (3 + -1sqrt(17)))2. 24sqrt(17) + 281 Simplify ((sqrt(243) + sqrt(243) + (sqrt(243) + 1 - sqrt(243)) - sqrt(243))*2 - sqrt(120)/sqrt(10)) + 4. 16sqrt(3) + 248 Simplify sqrt(35)/sqrt(5) + 3 + -2 + 0. 1 + sqrt(7) Simplify (sqrt(720) - (sqrt(720) + -1)6 - (-1 + sqrt(720))-4)*2. -48sqrt(5) + 724 Simplify sqrt(128) - -6sqrt(128)5. 248sqrt(2) Simplify -6-3(-1 + sqrt(2299))3. -54 + 594sqrt(19) Simplify ((sqrt(405) - (sqrt(405)3 + sqrt(405) + sqrt(405)))/sqrt(9))/((sqrt(18) + sqrt(90)/sqrt(5))/sqrt(2)). -2sqrt(5) Simplify ((2sqrt(78) + sqrt(78) + sqrt(78))-5)/(sqrt(216)3). -10sqrt(13)/9 Simplify -4sqrt(133)/(sqrt(1008)2). -sqrt(19)/6 Simplify (-3(0 + sqrt(320)) - (sqrt(320) + -1)4)-2. -8 + 112sqrt(5) Simplify (2((1sqrt(833) - sqrt(833)) + sqrt(833))1)*2. 3332 Simplify sqrt(18)/(sqrt(6) + sqrt(6) + -5sqrt(24)). -sqrt(3)/8 Simplify (sqrt(448) + 0 + 2)*2 - sqrt(448). 24sqrt(7) + 452 Simplify sqrt(180) + (sqrt(180) + -1)2 + (2 + 1 + sqrt(5))2 - (1sqrt(5)5 - sqrt(245)-1)2. -525 Simplify -2 + ((sqrt(1377) + 1)-3)*2. 162sqrt(17) + 12400 Simplify (sqrt(19) - (1 + sqrt(76))) + 2 + sqrt(19)2. 1 + sqrt(19) Simplify 5 + 2sqrt(2) + (2 + sqrt(2))3. 5sqrt(2) + 11 Simplify (sqrt(70) - ((sqrt(70) + 1sqrt(70))4 - sqrt(70)))/(2sqrt(1000)). -3sqrt(7)/10 Simplify ((sqrt(1701)-2 - sqrt(1701))/sqrt(300))2. 5103/100 Simplify -6(sqrt(1573) + (sqrt(1573) + (0 + sqrt(1573))*2 - sqrt(1573))) - (4 + -2sqrt(117) + sqrt(117)). -9442 - 63sqrt(13) Simplify (4 + (sqrt(252) - sqrt(7)) - (sqrt(35) + sqrt(1260))/sqrt(5))2. -16sqrt(7) + 44 Simplify ((sqrt(66) + sqrt(66) + sqrt(66) + 3sqrt(66) - sqrt(66))4 + sqrt(66))/sqrt(6). 21*	{ "pile_set_name": "DM Mathematics" }
*5 + 14o + 0o4 + 0o*3 + 0o*2 - 1/294o7. Factor l(c). -c3(c - 1)2/7 Let l(h) be the third derivative of -h6/600 + h5/50 + 7h*4/120 + 11h2 - 5. Suppose l(x) = 0. What is x? -1, 0, 7 Let i(q) be the second derivative of q6/15 - q5/10 - q4 - 609q. What is t in i(t) = 0? -2, 0, 3 Let z = -65504 + 65519. Factor -zr + 9/2r2 + 6 + 27/4r*3. 3(r + 2)(3r - 2)*2/4 Let a(l) be the first derivative of 2l*3/15 + 11l*2/5 - 952l/5 + 2122. Let a(i) = 0. Calculate i. -28, 17 Let p(k) = 2k3 - 24k*2 - 28k + 30. Let z be p(13). Suppose 0 = -3x - 0x - 4r + 22, 0 = -5x - r + 14. What is l in 12l + zl*x - 9 - 8l - 39l = 0? -1/4, 9 Suppose 3a - 127 - 14 = 0. Suppose f*5 - af*3 + 8f*2 + 4f*5 - 47f*4 + 81f*4 = 0. Calculate f. -8, 0, 1/5, 1 Let m(z) = 42z*3 - 166z*2 + 88z + 46. Let w(t) = 14t3 - 55t*2 + 29t + 15. Suppose -70 = -10x + 17x. Let h(q) = xw(q) + 3m(q). Factor h(f). -2(f - 3)(f - 1)(7f + 2) Let y(q) be the second derivative of -q*7/483 + 2q*6/69 - 14q*5/115 + 4q*4/23 + 282q. What is s in y(s) = 0? 0, 2, 6 Determine d, given that -152/5 - 2/5d2 - 46/5d = 0. -19, -4 Suppose 334p + 372p = -191p + 9p. Find k such that 128/7k4 + pk + 0 - 96/7k3 + 18/7k*2 = 0. 0, 3/8 Suppose 0 = -19f + 68 + 27. Suppose -8b = fz - 3b - 25, 2b + 10 = 3z. Determine v, given that 6 + 63/2v*2 - 105/4v*z - 177/4v*3 + 33v = 0. -2, -2/5, -2/7, 1 Let b(g) = -15g + 13g*2 - 6 - 4 + 6 + 6g. Let w(i) = 16i2 - 9i - 5. Let v(p) = 5b(p) - 4w(p). Factor v(l). l(l - 9) Let a = -599 - -601. Let u be (a + (-104)/48)-52. Determine v so that 0 - uv3 - 8/3v*4 - 2v*2 + 0v = 0. -3, -1/4, 0 Let w(q) = -35q3 - 275q*2 + 6215q + 50. Let z(m) = -3m3 - 23m*2 + 518m + 4. Let x(r) = -2w(r) + 25z(r). Factor x(k). -5k(k - 8)(k + 13) Let p(r) be the second derivative of r5/20 - 3r*4/4 - 41r*3/3 - 60r*2 + 965r + 2. Solve p(c) = 0. -4, -2, 15 Let f be (-30)/(-4)(-208)/(-260). Suppose 6v*4 - 4v*5 - fv*2 + 2v*3 - 7v*5 + 13v*5 - 4v - v5 + v5 = 0. Calculate v. -2, -1, 0, 1 Suppose 22500 - 890r3 + 33498r + 33546r - 8922r*2 - 32176r*2 - 10194r + 8852r2 - 6r*4 = 0. Calculate r. -75, -1/3, 2 Let g(m) be the third derivative of -7m6/180 - m5/18 + 43m4/18 - 8m*3/3 + 882m*2. Determine r so that g(r) = 0. -4, 2/7, 3 Let o(s) = 139s*3 + 61s*2 + 560s + 570. Let w(y) = 49y3 + 20y*2 + 187y + 192. Let g(p) = -6o(p) + 17w(p). What is n in g(n) = 0? -13, -12, -1 Let d(c) = -c*3 - 589c*2 + 6c + 336. Let i(s) = s*3 + 1179s*2 - 11s - 616. Let t(n) = 11d(n) + 6i(n). Factor t(v). -5v2(v - 119) Let r(t) be the third derivative of -t*6/160 - 1109t*5/80 - 2215t*4/32 - 1107t*3/8 + 2t*2 + 922t. Suppose r(k) = 0. Calculate k. -1107, -1 Let u = -60978 + 60978. Solve 66/7v3 + 2v + u - 72/7v2 - 8/7v*4 = 0 for v. 0, 1/4, 1, 7 Factor 0 + 2739/5c*2 - 3/5c. 3c(913c - 1)/5 Let l(n) be the second derivative of -n4/78 + 295n*3/39 - 294n*2/13 + 93n. Factor l(w). -2(w - 294)(w - 1)/13 Let v(b) be the second derivative of 1 + 1/10b4 + 3/100b*5 + 0b*2 + 11b + 1/10b3. Factor v(s). 3s(s + 1)2/5 Let 6 - 62t - 251t2 - 158t*2 + 609t*2 - 180t*2 = 0. Calculate t. 1/10, 3 Let a be ((-35)/(-10))/(3948/75214/6). Suppose 16/7i + 0 - ai*2 = 0. What is i? 0, 8 Let o(m) = -33 + 7 + 67m - 57m2 + 1. Let x(p) = -13p*2 - 9 - 3 + 33p + 0p - 15p*2. Let c(z) = 6o(z) - 14x(z). Factor c(n). 2(5n - 3)2 Solve -12y*2 - 256/3 - 64y - 2/3y3 = 0 for y. -8, -2 Let w(r) be the first derivative of 3/4r*3 - 3/4r*4 + 2 - 3r + 3/20r5 + 3/2r*2. Factor w(f). 3(f - 2)*2(f - 1)(f + 1)/4 Let o be (-9)/10 + -21/(-2). Let p(l) be the third derivative of 4/3l3 + 0l - 10l2 - 11/12l*4 - ol*5 + 0. What is i in p(i) = 0? -4, 1/3 Let y = -1050/19 + 4257/76. Let l(z) be the first derivative of yz*2 - 13 + 1/2z - 2/3z3. Determine x, given that l(x) = 0. -1/4, 1 Let q be (290/(-36) + 3000/400)/(10/(-42)). Find z such that -1/3z*4 - qz*3 + 7/3z + 2 - 5/3z2 = 0. -6, -1, 1 Factor q3 - 40q*2 + 4 - 9q + 86q - 14 - 28. (q - 38)(q - 1)2 Let p(q) be the first derivative of -q5/10 - 39q4 - 24335q*3/6 + 78q*2 + 12168q - 7177. Find o, given that p(o) = 0. -156, -1, 1 Let t(i) be the first derivative of -26 - 6i - 7/3i*3 - 13/2i*2. Factor t(g). -(g + 1)(7g + 6) Suppose 2f - 32 = -0f. Let q be 3/4 - ((-148)/f - -1). Factor 16c*4 - qc*3 + 5c*3 - 16 + 20 + 12c - 20c2 - 8c*3. 4(c - 1)*2(c + 1)(4c + 1) Factor -6o5 - 89o*3 - 114o*4 - 199o*3 - 5o2 + 144 - o2 - 24o4 + 285o + 9o5. 3(o - 48)(o - 1)(o + 1)3 Let b(q) = -q2 + q + 1. Let u(p) = -21p2 + 24p - 294. Let i(a) = -6a2 + 7a - 84. Let y(l) = -18i(l) + 5u(l). Let k(z) = -6b(z) - y(z). Factor k(f). 3(f - 4)(f + 4) Let l(k) = 1484k - 209239. Let p be l(141). Find s such that 10/13sp + 12/13s - 22/13s3 - 58/13s*2 + 0 + 58/13s*4 = 0. -6, -1, 0, 1/5, 1 Suppose -o + 195 = 186. Factor ox*3 + 13x*2 - 12x*4 + 9x*2 + 3x*5 - 12x - 10x2. 3x(x - 2)2(x - 1)(x + 1) Let j(l) be the second derivative of -l5/10 + 593l*4/30 + 838l*3/15 + 48l*2 + 4532l. Suppose j(t) = 0. Calculate t. -1, -2/5, 120 Let t be ((-32)/24-3)/((-270)/(-162) - 50/(-24)). Factor tk*3 + 32/15 + 64/15k + 16/5k2 + 2/15k*4. 2(k + 2)4/15 Let h(o) be the first derivative of -o5/70 + 4o4/21 - 5o*3/7 - 206o - 177. Let n(b) be the first derivative of h(b). Factor n(u). -2u(u - 5)(u - 3)/7 Let p(r) = 2r*2 + 23r - 8. Let a be p(-12). Factor -36k2 - ak*3 - 144k - 16k2 - 5k*2 + 9k*2. -4k(k + 6)2 Suppose -15k + 37 = -113. Let i be 5/(k/(-60)-45). Let 28/3w*2 + iw*5 - 2w - 10/3w4 + 4/3w*3 - 6 = 0. What is w? -1, 1, 3 Suppose 15 + 0 = 3k + 2x, -4x = -2k - 6. What is y in -130y + 75y2 - 5y*k + 44 + 295y + 16 + 25 = 0? -1, 17 Let q(t) be the third derivative of 2t6/255 - 31t*5/510 + 5t4/51 + t3/17 + 3931t2. Find l such that q(l) = 0. -1/8, 1, 3 Let n = 184122 + -184122. What is h in -4/3h*3 + n + 1/6h*5 + 2h*2 + 0h - 1/6h4 = 0? -3, 0, 2 Let k(u) be the third derivative of 1/16u*4 + 0u + 0 - 110u2 + 1/4u*3 + 1/160u*5. Let k(f) = 0. Calculate f. -2 Suppose 21k - 283 = 452. Factor -204t + 0t*3 + 4t*4 + 31t*4 - kt*2 + 10t*3 + 194t. 5t(t - 1)(t + 1)(7t + 2) Let q be 7/42 - (208/520 + (-26)/60). Let -3/5z*4 - 3/5 + 6/5z*2 - qz*5 + 2/5z*3 - 1/5z = 0. What is z? -3, -1, 1 Suppose -16/3 - 176/3o2 - 32o - 140/3o3 - 17o*4 - 7/3o*5 = 0. Calculate o. -2, -1, -2/7 Let t(m) = -5m*2 - 16m - 9. Let r be ((-76)/(-6) + 4/(-6))/(-2). Let o(q) = 4q2 + 15q + 6. Let f(i) = ro(i) - 5t(i). Find v such that f(v) = 0. 1, 9 Let l be (6/5)/((-6)/(-15)). Suppose -7 + 8z + 4z*2 - 29 - 8z*l + 36 - 4z*4 = 0. What is z? -2, -1, 0, 1 Let z = -38789 - -38800. Let q(m) be the second derivative of 21m*2 - 1/4m*4 + 0 + 13/2m*3 + zm. Factor q(n). -3(n - 14)(n + 1) Let d(k) be the second derivative of k*4/4 + 39k*3 + 4563k*2/2 - k - 66. Factor d(u). 3(u + 39)*2 Let x = 96557 + -96557. Let -9/5p - 21/5p2 - 3p*3 - 3/5p4 + x = 0. Calculate p. -3, -1, 0 Let q(t) = -t2 + t + 2. Suppose -11k + 22 = 33. Let m(d) = d2 + d - 1. Let i(f) = kq(f) - 2m(f). Let i(l) = 0. What is l? -3, 0 Let u(s) = -2s*2 + 166s + 2940. Let v be u(98). Let r(h) be the third derivative of 1/20h5 + 10h*2 + 1/8h*4 + 0h - h*3 + v. Solve r(l) = 0. -2, 1 Let x(z) = -992z + 45636. Let q be x(46). Solve -24/13s + 140/13s*5 - 8/13 + 366/13s*q + 62/13s*2 + 304/13s*3 = 0 for s. -1, -1/2, -2/5, 2/7 Let o = 1444/159 + -22/53. Let i(v) be the first derivative of 22v + ov3 + 45 + 1/2v*4 + 23v*2. Solve i(m) = 0 for m. -11, -1 Let t = 1856 - 27838/15. Let h(m) be the second derivative of tm*2 + 1/225m*6 + 1/30m*5 - 4m + 0 + 1/10m4 + 7/45m*3. Factor h(x). 2(x + 1)*3(x + 2)/15 Let f(x) be the second derivative of -x*4/6 - 5386x*3/3 - 7252249x*2 + 658x - 4. Determine p, given that f(p) = 0. -2693 Suppose -	{ "pile_set_name": "DM Mathematics" }
r. 81, 2, -41, -619 Put -5, -2, 27, 3, 5, 4, -1329 in descending order. 27, 5, 4, 3, -2, -5, -1329 Sort -6, 80, 1727, 6, 1 in decreasing order. 1727, 80, 6, 1, -6 Put -103, 8, 147832 in descending order. 147832, 8, -103 Sort 7148, 3, 4, 2343 in increasing order. 3, 4, 2343, 7148 Sort 1273977, 3, 72. 3, 72, 1273977 Sort -5, 5, -8, 61, -2, 237 in descending order. 237, 61, 5, -2, -5, -8 Sort 5/12968, 0.01, -5, 8 in increasing order. -5, 5/12968, 0.01, 8 Sort -4, -1, 13, 15, -45 in increasing order. -45, -4, -1, 13, 15 Sort 0.2, 2/13, 4, -12, 2, 5, 2937 in decreasing order. 2937, 5, 4, 2, 0.2, 2/13, -12 Put -4, -1053, 2, 3, -11, 5, -2 in increasing order. -1053, -11, -4, -2, 2, 3, 5 Put 5, 0.05, 4664.514 in decreasing order. 4664.514, 5, 0.05 Sort 3, 4, -1, -2, 64, -18, 5 in descending order. 64, 5, 4, 3, -1, -2, -18 Put -2/17, 2/98893, -0.5 in ascending order. -0.5, -2/17, 2/98893 Put 0.1, -30269, -3, 0.5, -34/15 in increasing order. -30269, -3, -34/15, 0.1, 0.5 Put 96/299, 3, 1/2898 in increasing order. 1/2898, 96/299, 3 Sort 340, -5, -3, -240 in descending order. 340, -3, -5, -240 Sort 9, -0.09, -0.029, -2649/5 in decreasing order. 9, -0.029, -0.09, -2649/5 Sort 5, -3, -322, -2, -5, 3420. -322, -5, -3, -2, 5, 3420 Sort 32/45, -2/23, 101 in ascending order. -2/23, 32/45, 101 Put -7904, -4, 292, 1, 3, 0 in decreasing order. 292, 3, 1, 0, -4, -7904 Sort -5, -866, 7674 in increasing order. -866, -5, 7674 Sort 30, 77, 33, 5, -88 in descending order. 77, 33, 30, 5, -88 Put -3, -1318, -2, 67, 0 in increasing order. -1318, -3, -2, 0, 67 Put -1, 3, -4, -53, 14, 4, -92 in decreasing order. 14, 4, 3, -1, -4, -53, -92 Put -2, -34252, -1, -19, 13 in descending order. 13, -1, -2, -19, -34252 Sort -1, -2, 1, 730, 0, 83. -2, -1, 0, 1, 83, 730 Put 10, -1, -214681 in ascending order. -214681, -1, 10 Sort 3, 5/424, 890 in increasing order. 5/424, 3, 890 Sort -2, 2920, 3, 2488 in descending order. 2920, 2488, 3, -2 Put -12, 636, 10636 in descending order. 10636, 636, -12 Put 12, 81, 2, 20, 32 in ascending order. 2, 12, 20, 32, 81 Put -0.1, -1, -5.7, 1, -2/161 in decreasing order. 1, -2/161, -0.1, -1, -5.7 Put 0.01, -1855, -10, 0 in decreasing order. 0.01, 0, -10, -1855 Sort -4, 56, 9, -2774. -2774, -4, 9, 56 Put -671, -6, -4110 in ascending order. -4110, -671, -6 Sort -1.9, 2/9, 4/5, -1/708850 in decreasing order. 4/5, 2/9, -1/708850, -1.9 Sort 7, -2, -1043, -4, -1099. -1099, -1043, -4, -2, 7 Sort 1748059, -2, 4 in decreasing order. 1748059, 4, -2 Sort 18, -94, 8471, 2, -2 in decreasing order. 8471, 18, 2, -2, -94 Sort -4, -93, 25, -2, 5, 28, -8 in ascending order. -93, -8, -4, -2, 5, 25, 28 Put 75, -631, 5, -7, 0, -6, -3 in ascending order. -631, -7, -6, -3, 0, 5, 75 Sort -0.3, -0.024, -0.5, -155/8 in descending order. -0.024, -0.3, -0.5, -155/8 Sort 13, -26, 2753, 5. -26, 5, 13, 2753 Put 5, -4, -0.2, -46, -0.03667 in ascending order. -46, -4, -0.2, -0.03667, 5 Sort 94, 1, -127, 5, 51, -4 in ascending order. -127, -4, 1, 5, 51, 94 Sort 6, 2, 1122, 53, -4. -4, 2, 6, 53, 1122 Sort -33, 8, -1719, 4 in decreasing order. 8, 4, -33, -1719 Sort 4, 31, -5, 5, 9250 in ascending order. -5, 4, 5, 31, 9250 Sort 17, -128, -2, -34, 3 in increasing order. -128, -34, -2, 3, 17 Put -1/5, 5285.7, -2/17, -45 in increasing order. -45, -1/5, -2/17, 5285.7 Sort -0.01, -2/7, 49.8, 189 in descending order. 189, 49.8, -0.01, -2/7 Sort -0.5, -1, 2/99, -13353, 1/5 in ascending order. -13353, -1, -0.5, 2/99, 1/5 Sort 1/6, -4, 5, -9/20, -1, -3, 2 in descending order. 5, 2, 1/6, -9/20, -1, -3, -4 Sort -3, 0, -880, 35, -1, 3, -4 in ascending order. -880, -4, -3, -1, 0, 3, 35 Put 4, -3/13, 4/3, -6, 4.8 in decreasing order. 4.8, 4, 4/3, -3/13, -6 Sort -3, -139, -5, 34, -23, -2 in descending order. 34, -2, -3, -5, -23, -139 Sort -59, 7, -5212, 5. -5212, -59, 5, 7 Put 2/3041, 2/7, -1, -30, 2, 0.2 in ascending order. -30, -1, 2/3041, 0.2, 2/7, 2 Sort -5, -21, -188, -1, -3724 in ascending order. -3724, -188, -21, -5, -1 Sort 0, 5, -7, 253, -30 in decreasing order. 253, 5, 0, -7, -30 Put -47, -4231, -4, 0, -22, 3 in increasing order. -4231, -47, -22, -4, 0, 3 Sort -6, 165, 0, 3, -58. -58, -6, 0, 3, 165 Put 539089, 19, -1.1 in descending order. 539089, 19, -1.1 Sort -7, -4042.6, 27, -1/11, 0.9 in descending order. 27, 0.9, -1/11, -7, -4042.6 Sort 1, 8, 3, 20, -92, -5, 7 in decreasing order. 20, 8, 7, 3, 1, -5, -92 Sort -12, 1, 4, -5, -2/25, 14, -5/4 in increasing order. -12, -5, -5/4, -2/25, 1, 4, 14 Sort 471, 16953, 0.3 in ascending order. 0.3, 471, 16953 Sort 18, -2, 1, -2496, 5, 4, 3 in increasing order. -2496, -2, 1, 3, 4, 5, 18 Put -2/11, -3, 272/11, 0.5 in increasing order. -3, -2/11, 0.5, 272/11 Sort 1, -4, 3, -2, -25, 15. -25, -4, -2, 1, 3, 15 Sort 36, -3628, -74 in decreasing order. 36, -74, -3628 Put -3/34, -7/6, 819 in decreasing order. 819, -3/34, -7/6 Sort -194, 48, 1/5, 0.5, 0.04, -1/8 in decreasing order. 48, 0.5, 1/5, 0.04, -1/8, -194 Sort 42, -160/67, 5, -5. -5, -160/67, 5, 42 Put 997, -8, 3, -24 in decreasing order. 997, 3, -8, -24 Put -3, -8, -5, 5441, 9 in descending order. 5441, 9, -3, -5, -8 Sort 1, 5, -5, -4, 48949. -5, -4, 1, 5, 48949 Put 3, -75132, -6 in decreasing order. 3, -6, -75132 Put 2, -51667, 3322 in decreasing order. 3322, 2, -51667 Sort -1537, -3, 97, 1, 4 in decreasing order. 97, 4, 1, -3, -1537 Sort -2, 1317, 0, 4, 235 in increasing order. -2, 0, 4, 235, 1317 Sort -3, -145, 4, -43439, -4. -43439, -145, -4, -3, 4 Sort -256325, 31, -6 in increasing order. -256325, -6, 31 Sort 23, -2, 209, -17, 50 in decreasing order. 209, 50, 23, -2, -17 Put -1, 1, -1849186, 3, 5 in increasing order. -1849186, -1, 1, 3, 5 Sort 5, 4, 3, -4, -319882, 2 in descending order. 5, 4, 3, 2, -4, -319882 Sort 5, 12, 52586, -3, 0, 6, 2 in increasing order. -3, 0, 2, 5, 6, 12, 52586 Put 3, 24, 38, 2, -25, 0 in ascending order. -25, 0, 2, 3, 24, 38 Sort -13, 295, -144, 1/4, 5 in descending order. 295, 5, 1/4, -13, -144 Put 2, 1, 152, 10, -6, -20, -15 in descending order. 152, 10, 2, 1, -6, -15, -20 Sort 20834, 4, -18 in descending order. 20834, 4, -18 Sort 4/5, 4, -139, -2/5 in decreasing order. 4, 4/5, -2/5, -139 Put -6, -8, -3, -0.21, -0.02, 22 in ascending order. -8, -6, -3, -0.21, -0.02, 22 Put 1/269, 1, 2/13, -0.09 in descending order. 1, 2/13, 1/269, -0.09 Put 5, 4, 0, 953, -80, -117 in ascending order. -117, -80, 0, 4, 5, 953 Sort -2250, 4915, 5 in decreasing order. 4915, 5, -2250 Sort 1, 165, -0.06, -2, -1, -0.149 in decreasing order. 165, 1, -0.06, -0.149, -1, -2 Put -3, -39, -117440 in increasing order. -117440, -39, -3 Sort -21, 17249, -28 in descending order. 17249, -21, -28 Sort 1, -111, -3, 54, 0, -338, -5 in increasing order. -338, -111, -5, -3, 0, 1, 54 Sort 1, -3/2, 34.21, 4 in decreasing order. 34.21, 4, 1, -3/2 Put 1/4, -96043, 4 in ascending order. -96043, 1/4, 4 Sort -52, 1/2, -2/9, 2249, 2/43 in decreasing order. 2249, 1/2, 2/43, -2/9, -52 Sort -2, -1553, -3, -16, 3, 4, -33. -1553, -33, -16, -3, -2, 3, 4 Put 34, 3, -3, 616 in ascending order. -3, 3, 34, 616 Sort 12, -23905, 2/9. -23905, 2/9, 12 Sort 23, 3, 7881, -2, 0. -2, 0, 3, 23, 7881 Put 46562, 8.5, -1 in ascending order. -1, 8.5, 46562 Put 2, -17, -10932, -4 in descending order. 2, -4, -17, -10932 Put -5, -1, -26, 0.03, 856, -3 in decreasing order. 856, 0.03, -1, -3, -5, -26 Sort -542/55, -0.4, -5, 2/25. -542/55, -5, -0.4, 2/25 Sort 7, 3, 0, 2, 75, -4, 4 in ascending order. -4, 0, 2, 3, 4, 7, 75 Put 10, -9, 1, -256, 2, -7 in decreasing order. 10, 2, 1, -7, -9, -256 Put 1392963, 13, 3 in ascending order. 3, 13, 1392963 Sort -25, -2, -1893, 148 in increasing order. -1893, -25, -2, 148 Sort 5, 2/15, 48, 1, -11988 in descending order. 48, 5, 1, 2/15, -11988 Sort -214, -0.2, 138/1931 in increasing order. -214, -0.2, 138/1931 Put 2.8, 544, 4/3 in descending order. 544, 2.8, 4/3 Put 152, 3, -4, 1980 in increasing order. -4, 3, 152, 1980 Put -6890, -7, 961, 2, 0, -2 in descending order. 961, 2, 0, -2, -7, -6890 Sort -3, -15, -1, 127, -5. -15, -5, -3, -1, 127 Put -67334, 2, 120 in decreasing order. 120, 2, -67334 Put -23194354, -1, 5 in increasing order. -23194354, -1, 5 Sort -2348, 1, 1429, 39 in increasing order. -2348, 1, 39, 1429 Put -0.1, -367235, 8 in increasing order. -367235, -0.1, 8 Put -0.5, 0.4, -71565/1003 in i	{ "pile_set_name": "DM Mathematics" }
2/2 + 10d + 1. Let y = -3 + 3. List the prime factors of t(y). 2, 5 List the prime factors of (-4)/12 + (-75)/(-9). 2 Let c(x) be the second derivative of -x*5/20 + 5x4/12 + x3 + 5x2/2 + x. List the prime factors of c(6). 5 Let v(a) = 10a - 20. What are the prime factors of v(5)? 2, 3, 5 Let x = 7 + -3. Suppose 5p = -2y + 6p + 1, 0 = xy + 5p + 5. Suppose yg + 56 = 4g. What are the prime factors of g? 2, 7 Let y(k) = -3k*2 + 5k + 4. Let c be y(4). Let u be (c/15)/((-2)/10). Suppose 3w = 2w + u. List the prime factors of w. 2 Let t(r) = r*2 + 9r - 6. Let h be t(-10). Let p(v) = 3v3 + 3v*2 + v. Let q be p(-2). List the prime factors of h/q + (-74)/(-14). 5 What are the prime factors of (-4)/(-14) + 76/28 - -123? 2, 3, 7 Suppose -c - 5r = 3 + 4, -4c + 16 = -2r. List the prime factors of -9c(-5 - -4). 3 Let d(b) = -b*3 + 3b - 3. Let u be d(2). Let w = -43 - -31. Let p = u - w. List the prime factors of p. 7 Suppose 5n + 0o - 4o = 435, -o = -5n + 450. What are the prime factors of n? 7, 13 What are the prime factors of -1342(-9)/12? 3, 67 Let r = -6 - -7. Let u(n) = 17n3 - n2. Let x be u(r). Suppose 4h = 2t + 42, -h - h = 4t - x. List the prime factors of h. 2, 5 Let w(x) = x*3 + 14x*2 + 10x - 13. List the prime factors of w(-13). 2, 13 Suppose 0 = -3c - 5i + 475, 4i + 183 = 2c - 97. List the prime factors of c. 2, 3, 5 Let x = 8 - 5. Suppose 0 = -o + 3a - x, -3o + 2a + 8 = o. List the prime factors of (-12)/(-8)20/o. 2, 5 Let q be (-3)/(22/12). What are the prime factors of (-57)/q + 6/9? 7 Let y(v) = 12v*3 + 2v*2 - 1. Let w be y(-1). Let s = -4 - w. What are the prime factors of s? 7 Let x = 12 + -7. Suppose -xu + 64 = -101. Suppose -3l + 3q + u = 0, -46 = -4l + 3q + 2q. List the prime factors of l. 3 Let o = 9 + -3. Let u = o + -3. Suppose -uv + 19 + 14 = 0. List the prime factors of v. 11 Let h = -40 + -14. What are the prime factors of ((-22)/(-4))/((-9)/h)? 3, 11 Let c(k) = -k*3 - 6k*2 - 6k - 3. Let u be c(-5). Suppose 4n - 2z - 16 = 0, un - 12 + 0 = 3z. Let s = 11 - n. What are the prime factors of s? 2 Suppose -u = -3u + 38. Let m = u + -11. What are the prime factors of m? 2 Let g = -6 - -9. What are the prime factors of g? 3 Let o(a) = 13a*2 - 1. Let u be o(-1). Let w be 166/8 - 9/u. Suppose -4p = 4f - 0f - w, 26 = 5f + 4p. List the prime factors of f. 2, 3 Suppose -8 = -5z + 12. List the prime factors of z. 2 Let o be 5/(10/636)-3. List the prime factors of (-4)/(-18) - o/81. 2, 3 Let y = -3 + 1. Let c be 1 - -15 - y - 2. Suppose k = -4t + c, -k = k + 2t - 20. List the prime factors of k. 2 Suppose 3h - 33 - 69 = 0. What are the prime factors of h? 2, 17 Suppose -3p + 7 = 1. Let f(x) = x*2 + 2x + 5. Let g(r) = -2r2 - 2r - 6. Let m(t) = -4f(t) - 3g(t). What are the prime factors of m(p)? 2 Let c = -453 - -881. List the prime factors of c. 2, 107 Let s = 3 + -1. What are the prime factors of -28s/(-4)1? 2, 7 Let v = 100 - 49. What are the prime factors of v? 3, 17 Let k = -21 - 53. Let c = k + 119. List the prime factors of c. 3, 5 Suppose 2m + 2m - 40 = 0. Suppose 3j = j + 3l + 9, -l - 13 = -4j. Let b = m - j. What are the prime factors of b? 7 Let d be (-652)/(-28) - 2/7. Suppose 2x = -5 - 1, -5x = -2y + d. What are the prime factors of 21/(-2)y/(-6)? 7 Let n be (-5)/1(-168)/30. Let p = n - 18. List the prime factors of p. 2, 5 List the prime factors of (2/3-3)/((-29)/1856). 2 Suppose 3s + 20 = -16. Suppose 3g = -g + 92. Let r = g + s. List the prime factors of r. 11 Let h(d) = d3 + 10d*2 + 10d + 5. Let g be h(-9). Suppose q + 1 = -j + 22, -4q = 5j - 107. Let b = g + j. List the prime factors of b. 19 Let h(d) be the first derivative of -d*4/4 - 2d*3 + 4d - 2. List the prime factors of h(-6). 2 Let v(q) = 2q - 6. Let u be v(8). List the prime factors of u10/(-6)-3. 2, 5 Let k = 11 + 9. List the prime factors of k. 2, 5 Let n(a) = -a3 - 6a*2 - 6a. What are the prime factors of n(-5)? 5 Let n be -2(24)/(-2). Let f(d) = d*3 - 9d*2 + 9d - 5. Let p be f(n). Suppose 4u + 3b - 32 = b, -5u + 38 = pb. List the prime factors of u. 2, 5 Let s = -11 - -15. Let c be ((-2)/(-6))/(10/270). Suppose cy = sy + 25. What are the prime factors of y? 5 Let u(v) = v*2 - 7v - 12. What are the prime factors of u(10)? 2, 3 Let b(v) = 2 - 8v + 0 - 2. What are the prime factors of b(-3)? 2, 3 Let h = 25 - -1. Suppose -4r = -h - 18. What are the prime factors of r? 11 Let a(g) = -g*3 + 4g*2 + g - 4. Let j be a(4). Let c = j + -5. Let n(b) = -3b - 7. List the prime factors of n(c). 2 Let k = 1 + 1. Suppose 0 = -2y + k + 2, -u - 6 = -4y. Suppose 0 = -ui + 5i - 15. What are the prime factors of i? 5 Let p(l) = l*3 + 11l*2 + 10l - 1. Let y be p(-9). Suppose 2k - y = -1. List the prime factors of k. 5, 7 List the prime factors of 64 + (-3 + 1)/(-1). 2, 3, 11 Let k = 145 + -80. What are the prime factors of k? 5, 13 Let k be 0/(-5) + 8/2. Let p(a) = a2 - 3. What are the prime factors of p(k)? 13 Let x = -3 - -4. Suppose -3 = -a + x. What are the prime factors of 2(-9)/(-8)a? 3 Let v be ((-7)/1 + -1)-4. Suppose 0 = -2x + 2i + 82 - v, 2x + 5i = 15. Let o = x + -9. What are the prime factors of o? 11 Let i be (3/2)/(1/40). Suppose 7j - 2j - i = 0. List the prime factors of (j/(-10))/((-4)/30). 3 Let m(b) = -b*2 - 3b. Let t be m(-3). Suppose -5g + 0g - 3o + 63 = t, 0 = 5g - 5o - 95. What are the prime factors of g? 3, 5 Let f be -1 + (-14 + -2)/(-2). Suppose fb + 50 = 9b. List the prime factors of b. 5 Suppose a = -0a + 7. Let y be (a/4)/(1/(-8)). List the prime factors of 5/(-10) + y/(-4). 3 Let l(g) = -g*3 + 6g*2 + 3g - 6. Let t be l(4). Suppose t = 3n - 34. List the prime factors of n. 2, 3 Let l(x) = 3x - 2. Let o(c) = -2c + 1. Let y(i) = 4l(i) + 7o(i). Let k = 3 - 7. What are the prime factors of y(k)? 7 Let f = -60 - -115. What are the prime factors of f? 5, 11 Let g(r) = r3 - 3r*2 + 2r - 1. Let t be g(3). Let d(k) = k + 6. Let f be d(t). Let w(h) = -h*2 + 12h - 2. List the prime factors of w(f). 3 Let u = -7 - -1. Suppose -2s + 10 = -4s, 2x - 5 = -3s. Let n = u + x. List the prime factors of n. 2 Suppose -w + 4l - 10 = -38, -5w - 2l + 52 = 0. List the prime factors of w. 2, 3 Let k(z) = 9z*2 + 2z + 1. Suppose -3h + h - 8 = 3v, -3h + 1 = -2v. List the prime factors of k(h). 2 Let r be 13/3 + (-3)/9. Suppose 3j - rw - 22 = 0, 5j - 30 = 4w + w. List the prime factors of j. 2 Let n(v) = 11v - 35. List the prime factors of n(10). 3, 5 Suppose -5u + 21 = 1. Let s = u - -28. What are the prime factors of s? 2 Let s = -1 - -4. Suppose -sr + 41 = 14. List the prime factors of r. 3 Let t be 100/(-1) - (-4 - -2). Let b = t - -69. Let m = -17 - b. List the prime factors of m. 2, 3 Suppose 10g - 666 = 7g. List the prime factors of g. 2, 3, 37 List the prime factors of (-7)/((-332)/(-172) - 2)3. 7, 43 Let v be -2 - 2/(-1) - -3. Suppose -p = 2r - 5p - 106, -3r + 114 = vp. List the prime factors of r. 43 Let n = 80 + -34. Suppose 0 = 3r - 14 - n. Suppose -t + r = 3t. List the prime factors of t. 5 Let c be 18 + 0 + (3 - 1). Let o = c + 1. List the prime factors of o. 3, 7 Let u(m) be the third derivative of -m*6/120 - 7m5/60 - m4/4 + m3/3 + m2. Let h be u(-6). List the prime factors of ((-12)/5)/(h/(-10)). 2, 3 Let y = 27 - 1. Let c = 62 - y. What are the prime factors of c? 2, 3 Let r(q) = 12q - 4. Let t be r(-3). Let y = t - -58. What are the prime factors of y? 2, 3 Suppose 0 = y - 5g - 387, -4y - 8g + 1620 = -4g. What are the prime factors of y? 2, 3, 67 Suppose 0 = -4f + 2u + 10, -4f + 2u - 5u = 15. Suppose w = -fw. Suppose w = -6a + a + 75. List the prime factors of a. 3, 5 Suppose 3h - 8 = 2o, -h - 7o + 8 = -5o. Let j = -10 + 14. Suppose -i - 13 = -2k, 8k - jk = hi + 20. What are the prime factors of k? 2 Let t be 5(-58)/(-20)6. Let b(p) = -p*3 - 4p*2 + 4p - 1. Let h be b(-5). Suppose -5q + 3u = -t, -hq + 56 = 2u - u. List the prime factors of q. 3, 5 Let k = -54 + 87. List the prime factors of k. 3, 11 Let v(x) = -x*3 + 9x*2 - 6x + 5. List the prime factors of v(7). 61 Let k(x) = 34*x - 2. What are	{ "pile_set_name": "DM Mathematics" }
, 3, 5, 17 List the prime factors of 16435. 5, 19, 173 List the prime factors of 11950. 2, 5, 239 What are the prime factors of 7349? 7349 List the prime factors of 940. 2, 5, 47 What are the prime factors of 360? 2, 3, 5 List the prime factors of 2127. 3, 709 What are the prime factors of 9189? 3, 1021 What are the prime factors of 154? 2, 7, 11 What are the prime factors of 25976? 2, 17, 191 What are the prime factors of 90217? 90217 List the prime factors of 3877. 3877 What are the prime factors of 2474? 2, 1237 What are the prime factors of 17225? 5, 13, 53 What are the prime factors of 41983? 41983 What are the prime factors of 20378? 2, 23, 443 List the prime factors of 8374. 2, 53, 79 What are the prime factors of 1176? 2, 3, 7 What are the prime factors of 3465? 3, 5, 7, 11 List the prime factors of 33882. 2, 3, 5647 What are the prime factors of 948? 2, 3, 79 What are the prime factors of 16927? 16927 What are the prime factors of 47325? 3, 5, 631 List the prime factors of 22588. 2, 5647 List the prime factors of 5769. 3, 641 What are the prime factors of 6876? 2, 3, 191 List the prime factors of 3568. 2, 223 What are the prime factors of 2078? 2, 1039 What are the prime factors of 774? 2, 3, 43 List the prime factors of 42856. 2, 11, 487 List the prime factors of 11282. 2, 5641 What are the prime factors of 43948? 2, 10987 What are the prime factors of 4083? 3, 1361 List the prime factors of 1881. 3, 11, 19 List the prime factors of 78888. 2, 3, 19, 173 List the prime factors of 3459. 3, 1153 What are the prime factors of 40459? 40459 List the prime factors of 1214. 2, 607 What are the prime factors of 55174? 2, 7, 563 What are the prime factors of 715? 5, 11, 13 What are the prime factors of 835? 5, 167 List the prime factors of 672. 2, 3, 7 What are the prime factors of 15271? 15271 What are the prime factors of 1210? 2, 5, 11 What are the prime factors of 485? 5, 97 What are the prime factors of 2055? 3, 5, 137 What are the prime factors of 9379? 83, 113 List the prime factors of 3042. 2, 3, 13 What are the prime factors of 58906? 2, 29453 What are the prime factors of 2296? 2, 7, 41 List the prime factors of 4639. 4639 What are the prime factors of 1135? 5, 227 What are the prime factors of 22922? 2, 73, 157 List the prime factors of 3011. 3011 List the prime factors of 929. 929 What are the prime factors of 11890? 2, 5, 29, 41 What are the prime factors of 2076? 2, 3, 173 List the prime factors of 3508. 2, 877 What are the prime factors of 2897? 2897 What are the prime factors of 6375? 3, 5, 17 What are the prime factors of 190? 2, 5, 19 What are the prime factors of 117? 3, 13 What are the prime factors of 55161? 3, 227 What are the prime factors of 155471? 107, 1453 What are the prime factors of 15628? 2, 3907 List the prime factors of 32532. 2, 3, 2711 List the prime factors of 135309. 3, 23, 37, 53 List the prime factors of 14676. 2, 3, 1223 List the prime factors of 1743. 3, 7, 83 What are the prime factors of 985? 5, 197 What are the prime factors of 45984? 2, 3, 479 What are the prime factors of 29195? 5, 5839 List the prime factors of 48157. 48157 List the prime factors of 3131. 31, 101 List the prime factors of 21354. 2, 3, 3559 List the prime factors of 8815. 5, 41, 43 List the prime factors of 498. 2, 3, 83 List the prime factors of 200. 2, 5 What are the prime factors of 144832? 2, 31, 73 List the prime factors of 146064. 2, 3, 17, 179 What are the prime factors of 15327? 3, 13, 131 What are the prime factors of 18852? 2, 3, 1571 List the prime factors of 734. 2, 367 What are the prime factors of 1875? 3, 5 List the prime factors of 15113. 7, 17, 127 List the prime factors of 63468. 2, 3, 41, 43 List the prime factors of 8629. 8629 What are the prime factors of 2971? 2971 List the prime factors of 14495. 5, 13, 223 What are the prime factors of 16351? 83, 197 List the prime factors of 1449. 3, 7, 23 What are the prime factors of 13153? 7, 1879 What are the prime factors of 52280? 2, 5, 1307 List the prime factors of 1214. 2, 607 What are the prime factors of 25142? 2, 13, 967 What are the prime factors of 689? 13, 53 What are the prime factors of 6671? 7, 953 List the prime factors of 22930. 2, 5, 2293 What are the prime factors of 6905? 5, 1381 List the prime factors of 51598. 2, 25799 List the prime factors of 26381. 23, 31, 37 What are the prime factors of 77077? 7, 11, 13 List the prime factors of 40914. 2, 3, 2273 List the prime factors of 96152. 2, 7, 17, 101 List the prime factors of 2638. 2, 1319 List the prime factors of 17719. 13, 29, 47 List the prime factors of 127. 127 List the prime factors of 56653. 181, 313 List the prime factors of 3278. 2, 11, 149 List the prime factors of 43311. 3, 14437 What are the prime factors of 116620? 2, 5, 7, 17 List the prime factors of 20152. 2, 11, 229 List the prime factors of 60550. 2, 5, 7, 173 What are the prime factors of 3642? 2, 3, 607 What are the prime factors of 23549? 23549 What are the prime factors of 5247? 3, 11, 53 What are the prime factors of 83398? 2, 7, 23, 37 What are the prime factors of 14407? 14407 List the prime factors of 5604. 2, 3, 467 What are the prime factors of 4226? 2, 2113 List the prime factors of 21201. 3, 37, 191 What are the prime factors of 11117? 11117 List the prime factors of 137. 137 List the prime factors of 3693. 3, 1231 What are the prime factors of 5360? 2, 5, 67 List the prime factors of 11806. 2, 5903 What are the prime factors of 10427? 10427 List the prime factors of 40593. 3, 7, 1933 What are the prime factors of 2898? 2, 3, 7, 23 What are the prime factors of 5348? 2, 7, 191 What are the prime factors of 3788? 2, 947 What are the prime factors of 2269? 2269 List the prime factors of 10973. 10973 What are the prime factors of 2360? 2, 5, 59 What are the prime factors of 53067? 3, 7, 19 List the prime factors of 7461. 3, 829 List the prime factors of 658. 2, 7, 47 What are the prime factors of 7659? 3, 23, 37 What are the prime factors of 51412? 2, 12853 List the prime factors of 177. 3, 59 What are the prime factors of 7925? 5, 317 What are the prime factors of 825? 3, 5, 11 List the prime factors of 300. 2, 3, 5 List the prime factors of 24766. 2, 7, 29, 61 List the prime factors of 24943. 24943 What are the prime factors of 2524? 2, 631 List the prime factors of 1376. 2, 43 List the prime factors of 3844. 2, 31 List the prime factors of 1789. 1789 What are the prime factors of 3380? 2, 5, 13 List the prime factors of 2747. 41, 67 List the prime factors of 9401. 7, 17, 79 List the prime factors of 1547. 7, 13, 17 List the prime factors of 4446. 2, 3, 13, 19 What are the prime factors of 4467? 3, 1489 List the prime factors of 107. 107 List the prime factors of 3793. 3793 List the prime factors of 1011. 3, 337 List the prime factors of 66422. 2, 33211 List the prime factors of 18749. 18749 List the prime factors of 5115. 3, 5, 11, 31 What are the prime factors of 4039? 7, 577 What are the prime factors of 11007? 3, 1223 What are the prime factors of 24905? 5, 17, 293 List the prime factors of 987. 3, 7, 47 What are the prime factors of 76444? 2, 29, 659 List the prime factors of 13504. 2, 211 List the prime factors of 9978. 2, 3, 1663 List the prime factors of 6368. 2, 199 List the prime factors of 1840. 2, 5, 23 What are the prime factors of 2218? 2, 1109 List the prime factors of 15781. 43, 367 What are the prime factors of 8858? 2, 43, 103 What are the prime factors of 86233? 7, 97, 127 List the prime factors of 449. 449 What are the prime factors of 16714? 2, 61, 137 What are the prime factors of 1700? 2, 5, 17 What are the prime factors of 54102? 2, 3, 71, 127 What are the prime factors of 1841? 7, 263 What are the prime factors of 748? 2, 11, 17 List the prime factors of 4845. 3, 5, 17, 19 What are the prime factors of 1183? 7, 13 What are the prime factors of 86925? 3, 5, 19, 61 What are the prime factors of 160? 2, 5 What are the prime factors of 1444? 2, 19 List the prime factors of 1018. 2, 509 List the prime factors of 470. 2, 5, 47 What are the prime factors of 108710? 2, 5, 7, 1553 What are the prime factors of 73778? 2, 37, 997 What are the prime factors of 9112? 2, 17, 67 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
))(0 - 5 - 3t + 4). -108t - 36 Expand (l + 8l - 2l)(447 + 677 + 1243 + 3611 + 233 - 123). 42616l Expand (-397 + 11 - 114)(-12w + 5w*3 + 12w). -2500w3 Expand (-i - 3i + 2i)(-8i + 2i - 16i)(-2i + 4i - i + (-3 + 5 - 1)(22i + 66i - 19i)). 3080i3 Expand ((-3 - 5 + 5)(7w - 121 + 121) + 179w + 1552 - 1552)(-1 + 0 + 0). -158w Expand (2 + 1 - 1)(0 - 3 + 2)(-622 + 622 + 23h) + (-6 + 6 + h)(1 + 1 - 3). -47h Expand (4 - 2c - 4)((-1 + 2 + 0)(-29 + 44 + 28) + (-2 + 3 - 5)(4 + 3 + 0)). -30c Expand (-2016 - 1974 + 4944)(s + s - 3s - 2 + s + 2 + (1 - 1 - 2)(2s + 2s - 2s)). -3816s Expand (3f + f*3 - 3f)(17f - 12f - 11f)(96 + 7f - 96 + (3 - 3 - 2)(-3f + 2f + 0f) + 4f + f - 3f)(0 + 1 + 5). -396f*5 Expand 6w*3 - 3w*3 - 2w*3 - 2w + 2w - w3 - 4w3 + w3 + 4w3 + (0w*2 - 2w*2 + 0w*2)(w - 3w + w) - 476w*3 + 9152 - 9152. -473w*3 Expand 200k*4 - 28k*4 - 386k*4 + (-k + 0k + 0k)(4 + k*3 - 4). -215k*4 Expand -2n*3 + 3n3 + n3 - 2n + 2n + 2n3 + (5 + 0 - 4)(n*3 - 4n*3 + 2n*3) - 5n*2 + 5n2 + n3 - 184n3 + 4005 - 4005. -180n*3 Expand (0l*2 - 2l*2 + 0l*2)(188l + 331l + 371l - 95l) + 131 - 10l3 - 131 + (2 + 2l - 2)(0l + 3l2 + 0l). -1594l3 Expand 3345a*2 - 1228900a + 1228900a - 9358a*2 + 3a*2 - 2 + 2 + (3 - 4 - 1)(-2a2 - 3a*2 + 4a*2). -6008a*2 Expand -9 - 31 + s + 21 - 11 + (-4 + 1 + 5)(-2s - 8s + 5s). -9s - 30 Expand (3m2 + 2m*2 - 3m*2)(-7 - 11 - 13)(534 + 707 + 275 + 416 - 170). -109244m*2 Expand 30161i - 30161i + 6i*5 + 2i5 + i5 - 5i5 + (2i + 0i - 3i)(-3i + 3i - i4) - 5i5 + i5 + 5i5. 6i*5 Expand (-4p*3 + 4p3 - p3)(-5p + 2p + 5p) + p2 - p2 + 5p4 + 30p + 135581p3 - 135581p*3 + 4p*4. 7p*4 + 30p Expand ((-4v + 6v - 4v)(3 - 5 + 0) - 43 - 11v + 43)(41v - 5v + 73v). -763v*2 Expand (492i*2 - 990i*2 + 443i*2)(0i3 + 2i3 - i2 + 0i3). -110i*5 + 55i*4 Expand (-7g + 1 - 1)(-58 - 9 - 20)(0g4 + g4 + 0g*4). 609g*5 Expand (j - 3j + 0j)(-3 - 1 + 2) - 2j + 5j - 4j - 3j - j + 7j + 4j + 0j - 2j - 4j - 2j + 4j + (-4 + 0 + 5)(-1 - j + 1)(-51 - 19 - 98). 174j Expand (0h - 4h + 2h)(1233h + 1917h + 1985h). -10270h*2 Expand (258d*2 + 405d*2 - 75d*2)((0 + 0 + d)(4 - 2 - 1) + 6d + 0d - 4d). 1764d3 Expand (0 + 1 - 9)(j*3 + 1187j*2 - 1183j*2 + 2j + 3j). -8j*3 - 32j*2 - 40j Expand (13g2 + 8g*2 - 8g*2)(-47g - 44g + 26 + 90g). -13g*3 + 338g*2 Expand (177w + 255w + 194w)(4 - 2 + 0) - w - 9w + 14w. 1256w Expand (-2i + 0i + 0i)(-5 + 4 - 2) - 1 + 1 - i + (-1 + 5 - 1)(-2i + 2i + i) + (-3 + 0 + 4)(-3i + 3i - 6i). 2i Expand (13 + x*4 - 4x*2 - 13)(113 + 181 + 12). 306x4 - 1224x*2 Expand ((4 - 3 - 2)(0 + 1 - 3) - 3 - 3 + 0)(4f - 7f + 4f)((4 + 0 - 6)(122f - 47f - 64f) - 2 + 2 - 2f) + f*2 + 2f*2 - 4f*2. 95f*2 Expand (1444s*3 + 4128s + 4127s + 2 - 8253s)(-2s - s + s). -2888s4 - 4s*2 - 4s Expand (0 - 12 - 5)(7 - 777h + 775h + 175). 34h - 3094 Expand 3p + p - 2p - 3p - 2p - p + 4p - 3p - 3p + (-3 + 0 + 4)(p + 0p - 3p) - p - 3p + 5p + p + 0 - 2p + 2 + 19p + 13p - 59p. -35p + 2 Expand 5h + h + 0h + (8 - 7 + 13)(-h + 5h - 3h). 20h Expand (-p2 - p2 + 0p*2)(-19 + 3206 + 326) + 2 - 2 + 3p2. -7023p*2 Expand (0 - 3 + 4)(-1270p - 791p - 81p)(1 + 1 - 4). 4284p Expand (-2 + 4 - 3)(-9g + 7 - 7) - 40g + 169g - 57g - 3g + 3g - 2g. 79g Expand (3716i - 139 - 22 + 161)(2 + 2 - 6)(1 + 2 - 5). 14864i Expand (-12 + 12 + 12n)(-2 - 2n + 2) + 228n - 52n2 - 228n. -76n2 Expand (2190 - 4646 + 2334)(2x - 3x + 2x)(-x + 2x + 2x). -366x2 Expand -5k*3 + 3k*3 + 0k*3 + (-1 + 1 + 2k)(-4 + 4 - 2k*2 + 2 + (-k + 82k + 75k)(-12k - 6k + 6k)). -3750k*3 + 4k Expand (-34n - 6217 + 6217)(4 + 0 + 7)(2 + 1 + 0)(-3n3 + 4n3 + n3). -2244n4 Expand (-80 + 80 - 9r*2)(36r - 18r - 17r + 19)(-1 - 2r2 + 1). 18r*5 + 342r*4 Expand (s - s - 2s*2)(1066s3 + 318s - 318s). -2132s*5 Expand (-14 - 9 - 11v + 10v)(-8v - 6 + 6) + 9v*2 + 27 - 27. 17v*2 + 184v Expand (3n - 2 + 2)(2 + 5 + 1) + (3 - 1 - 1 + (-4 + 2 + 3)(-4 + 0 + 2))(2 - 3 + 2)(-52n - 25n + 17n). 84n Expand 111o*2 + 106o*2 - 398o*2 + (2o - 4o + 3o)(-2o + 5o - o) + 5o2 + o2 - 4o2 + 0o + o*2 + 0o - 8o2 + 2o*2 + 4o*2. -178o*2 Expand 5i*2 - 5i*2 + 3i*2 + 5i - 5i - 2i*2 + (13066 - 4187 + 4113)(-1 - 2i2 + 1). -25983i*2 Expand (0 - 2 + 4)(66445 + 2o + 7033 + 54925 - 4o - 19021). -4o + 218764 Expand (-4l + l + l)(-702 - 108 - 47 + (3 - 4 + 3)((0 + 3 - 2)(1 + 0 - 2) - 4 + 1 - 3)). 1742l Expand (2p2 + 3p*2 - 3p*2 + (-2 + 0 + 1)(2p - 2p*2 - 2p) - p + p + 2p2)(-119p2 - 17p*3 + 119p*2)(-13 + 10 - 56). 6018p5 Expand (-2t + 5t + 0t)(55 - 133 - 7). -255t Expand -2 - 2l2 + 2 + (-1 - 2 + 1)(-6233 - 28l2 + 6233) + (-1 + l + 1)(-1 - 1 + 1)(-6l + 4l + 3l + (3l - 3l - 2l)(2 - 3 - 1)). 49l2 Expand (-2f - 3f + f)(3f - 2f - 4f + (-4 + 4 + 2)(5f - 7f + 23f) - 7f + 0f - 3f). -116f2 Expand -3q*2 + 3q*2 - 2q*5 + (-17 + 17 - 15q*3)(-4q2 + 4q*2 + 8q*2) + 14q*2 - 14q*2 - 5q*5. -127q*5 Expand (-8145z - 5094003 + 5094003)(0z*4 - 4z*4 + 2z*4). 16290z*5 Expand (s - s - 6s)((2s*2 - 2s2 - s2)(8 - 36 - 22) + 0s*2 - 2s*2 + 3s*2 + (2s - 2s2 - 2s)(0 + 0 - 2)). -330s*3 Expand (3a - 4a - a)(206 - 18195 + 3006). 29966a Expand (-15s*2 + 36s*2 - 46s*2 - 12s*2)(1 + 2 - 1)(-95 - 136 - 133). 26936s*2 Expand ((-1 - 2 - 2)(2j - 5j + j) + 110j - 21976 + 21976)(3j + 1 - 3j - j*3). -120j*4 + 120j Expand (-3 + 2 + 3)((245y + 230y - 446y)(-13 + 4 - 2) + (-1 + 1 + y)(2 - 1 + 1)). -634y Expand -4g*2 + 2g*2 + 0g*2 + (2g + 0 + 0)(-571g - 343g + 756g) + (-6g + 6g - 5g2)(3 + 1 - 5). -313g2 Expand (3f3 - f3 - f*3)(2f - 1 + 1)(3830f + 851f + 2670f). 14702f*5 Expand (-1 + 2 - 3)(1 + 67j - 122j + 84j)(9j + 5j + 5j). -1102j*2 - 38j Expand (-m*4 + 0m*4 + 0m*4)(7m - 10m - 6m) + (-1 + 1 - m3)(-290 + 290 - 130m2) + m5 + 0m*3 + 0m*3. 140m*5 Expand -4w*5 + 0w*5 + 2w*5 + (-2w5 - w5 + 2w5)(2 + 2 - 3) - 3w5 + 6w*5 + 0w*5 + 12292w*3 - 89w*5 - 12292w*3. -89w*5 Expand 261782 - 261782 - 499c + 2c - 2c - c + (-1 + 1 + 1)(5 - 5 - c) - 3c - 4 + 4 + 5c - 3c - c. -503c Expand (12 + 12 + 13 + 3 - 4 - 1 + (-3 + 1 + 3)(3 - 2 + 1) + 3 - 1 - 1 + 0 + 1 + 0 + (2 + 0 - 1)(-4 + 6 - 1) + 4 - 2 - 21)(-2o + o - 2o). -63o Expand (662i - 93i + 506i - 255i)(-90i2 + 37i*2 + 40i*2 + 2). -10660i*3 + 1640i Expand -7a + 29 - 29 - 3 + 3 - a + (-2 + a + 2)(2 - 2 - 1) + 56a + 212 - 217 + 6a. 53a - 5 Expand (1334 - 4v - 730 + 7v)(-v + 2v2 + v). 6v*3 + 1208v*2 Expand (3u2 + u2 + u*2 + (3 + 2u*2 - 3)(-3 - 1 + 5) - 46u2 - 130u + 130u)(-6 + 7 + 1). -78u2 Expand (8n*4 + 2n*3 - 5n*4 + 0n*3 + (-1 + 3 - 4)(-n*4 - 2n*3 + 2n*3))(-254n - 223n - 12n). -2445n*5 - 978n*4 Expand (-1002l - 1666l + 747l)(l - 2l + 2l). -1921l*2 Expand (0q + 0q - 4q)(-273 - 4q*2 + 268 - 9q*2 + 4q*2). 36q*3 + 20q Expand (-32 - 8 - 2)(4k - 11k + 2k). 210k Expand (-4 + 1 - 2)(-y*4 - 2y5 + y4 + (0y - 2y*2 + 0y)(2y*3 - 4y*3 + 0y*3) + 0y*3 + 2y*5 + 0y*3 + 14y*5 + 29y*5 + 23y*5). -350y*5 Expand (0 - 1 + 2)(-2g - 13g - 7g)(4 - 4 - 5). 110g Expand 2a5 + a5 - 2a5 + (-31a*3 - 93a*3 + 17a*3)(5a2 - 20 + 20). -534a*5 Expand (2 - 5 + 2)(-1 + 3 - 8)(-63w*3 - 5w*5 + 85w3 + w5 - 49w3). -24w*5 - 162w*3 Expand -3 + 4g + 3 + (-3 + 3 + g)(5 - 3 - 5) - 20g - 11g - 9g - g - g + g - g + 2g - 3g + (-3 - g + 3)(4 - 2 - 1) + 0g - 4g - g. -48g Expand (-a*3 + a - a)(-627 - 651 + 1279 + 2002a + 5a*2). -5a*5 - 2002a4 - a3 Expand (4q2 - 2q2 - q2)(-2140 + 770 - 4289). -5659q*2 Expand 7g*2 + 0g + 0*g + (	{ "pile_set_name": "DM Mathematics" }
ii(i/(ii(-3/13)i))/i)/(i0)(-17/3) assuming i is positive. i(-119/104) Simplify (b(-4)/(b*(-4/33)b))(-44) assuming b is positive. b(644/3) Simplify ((aa/a(-15/7)a)/a(-17))(-2) assuming a is positive. a(-310/7) Simplify ((u/(u(-1)uuuu))/u)17/(u(-6)u(-5)) assuming u is positive. u(-40) Simplify (q/(q3q)q(-9/5)q*(2/7)q(-1/10))(-4) assuming q is positive. q(646/35) Simplify (q7/qqqq/(qq/(qq/(qq*(-13)q))qq))/(((qq(-12)/q)/q)/qq/((qq(1/4))/q)) assuming q is positive. q(125/4) Simplify (dd*(-45)d37)32 assuming d is positive. d*(-224) Simplify (ii/i*(-3/2)i(-2/27))/(i(-5)ii(-1/8)/i) assuming i is positive. i(1847/216) Simplify q(7/10)/q30(q(((q*23/q)/q)/q)/qq)/(q/(q1/q)) assuming q is positive. q(-93/10) Simplify (w/w*11w)*(-29)ww(10/11)ww(1/6) assuming w is positive. w(17429/66) Simplify ((h/h(-8/11))50)(-2) assuming h is positive. h(-1900/11) Simplify ((r(-5/4)r)/r*(-15))/(rr*(-4)r(r(-7/4)/r)/rr) assuming r is positive. r*(39/2) Simplify ((bb*4b)/(bb(-7)/b))/(b(-3/4))(-27/4) assuming b is positive. b(127/16) Simplify ((b(-1))(-29)(b*1b)(-3/11))(-5) assuming b is positive. b(-1565/11) Simplify (v1)*(-1/30)((v/(v*(-3/13)v))/v)(1/9) assuming v is positive. v(-139/1170) Simplify (ss(-27)s(-3/7))12 assuming s is positive. s*(-2220/7) Simplify (w/((ww/((w(((w/w(1/5))/w)/w)/w)/w)w)/w)ww(-2))/(w/(w/(w/(w(-4/5)/w))w)ww/(ww(-11))) assuming w is positive. w(-18) Simplify (((t/t22)(-1/5))(2/3))(-6) assuming t is positive. t*(-84/5) Simplify (jjj10)(3/7)/(jj*6/jjjjj(1/12)j) assuming j is positive. j*(-415/84) Simplify k/(k/(kk/(k/(k*(-2/19)k))))k(2/25)(k(-2/11)/k)(19/2) assuming k is positive. k(-96689/10450) Simplify (c(1/5)cc*(1/2)c*3/(cc(1/8)))(16/3) assuming c is positive. c(286/15) Simplify ((l(-23)/ll)(3/19))(-11/2) assuming l is positive. l(759/38) Simplify ((ff/((fff/(f*14/f)ff)/f))/f)/(f16f)f(-1/11)f/((f*(-3/4)/ff)/f) assuming f is positive. f(-191/44) Simplify (w2w)(-1/68)w*(7/6)(w/(w/(w/((w*(-12)/w)/ww))))/ww assuming w is positive. w(3085/204) Simplify (b/b(2/61))/(bbb(-1))(b/b*16)/(bb21/b) assuming b is positive. b(-2198/61) Simplify ((z/(z*(-1/6)z))/z3)/(z7/zz(2/15)) assuming z is positive. z(-269/30) Simplify (z/(z/(zz*(-6))z))/(z/((zz/(z/z17))/z))(zz0)(1/4) assuming z is positive. z(41/4) Simplify ((f(2/13)f)/fffff)*(-28)(f*3f)(19/3) assuming f is positive. f(-3548/39) Simplify (z(-1/17))(-46)/(zz9)(13/7) assuming z is positive. z(-1888/119) Simplify d(2/5)/((d/(dd*14/ddd))/dd)(d(-3/4))(4/5) assuming d is positive. d(74/5) Simplify ((z/z(-2)zz3z)/((z/(z6/z))/z(4/7)))(-4/23) assuming z is positive. z(-352/161) Simplify (q*(-8)q*25/q)/(q/(qq*(-5/6))q/q(-12)) assuming q is positive. q(13/6) Simplify (((q/(qq(qq(16/3))/qqq))/q)/q)(-30)(q/(q*29/q)q)/(q/(qq23)) assuming q is positive. q307 Simplify (((b(1/2)b)/bbb2)/(b0)(-16/5))41 assuming b is positive. b*(287/2) Simplify (ll*(-3/4)/l)/ll*(1/44)(l*(4/5)l)(-2/43) assuming l is positive. l(-4283/2365) Simplify (d(-1))(43/3)/((d11/d)/(d(4/3)d)) assuming d is positive. d(-22) Simplify ((((((ii/(i/(i/(i/(ii(-7))))))/i)/i)/i)43)(-26))(-5) assuming i is positive. i(-44720) Simplify (g((gg/(g(-1)gg))/g)/gg)(9/4)/(g/g(5/6)g(-5/6)) assuming g is positive. g(35/12) Simplify u(4/5)u*(-18)(u/(u*20uu))/(uu(-1/19)) assuming u is positive. u(-3719/95) Simplify (a*(-13)(aa/(((a/(aa*(-2)))/a)/a))/a)/(aa(-2/3))43 assuming a is positive. a*(-79/3) Simplify ((ccc/c(-13)c)/c(-8))/(c4)(1/24) assuming c is positive. c(149/6) Simplify ((s*(-2/3)s)/(ss(1/5)s))(3/7) assuming s is positive. s(-4/5) Simplify (l*(-5/6)ll(-1/10))2 assuming l is positive. l(2/15) Simplify (h(-5)h*(2/47))/((((hh*13)/h)/hh)/hh(1/13)) assuming h is positive. h(-10408/611) Simplify ((k6)(-2/5))18 assuming k is positive. k(-216/5) Simplify (ccc6c*(6/5))/(cc*(-2/17)cc/(c/c(-7))) assuming c is positive. c(1217/85) Simplify (ll*(-1/7)/llll)/lll*10l(l2)21 assuming l is positive. l(391/7) Simplify (z(-1/3))7zzz*(2/3)(z/(zz/(z/z(-1))z)zz)/z assuming z is positive. z(4/3) Simplify ((a/(a/a(1/18)a))/aa)(-1/40)/(a12)(-41) assuming a is positive. a(354257/720) Simplify (k6)12/(k21/k(-1/11)) assuming k is positive. k*(560/11) Simplify (((fff/f(-10)f)/f)/(f/f(-4)))/(f(-1/20)ff/(f(-13/3)/f)) assuming f is positive. f(43/60) Simplify (h*(1/18)hhhh(h/h*(-23)h)/hhh)/(hhh*(4/7)hh)(-39) assuming h is positive. h(26251/126) Simplify ((n/n(-4)n*(3/5)/n)/(nn(-1/5))8)(1/3) assuming n is positive. n(-3/5) Simplify oo(1/2)oo(-27)o(o/(o18/o))/oo*15o assuming o is positive. o(-49/2) Simplify (x(9/4))*(2/55)(xx(xxx*(-25)/x)/xx)/(x/(xx(-1/3))) assuming x is positive. x(-7343/330) Simplify j3/j(-2/7)(j(-3/5)/j)(7/13) assuming j is positive. j(1103/455) Simplify a(3/4)/a*(3/5)(aa(-7/5)aa)/(a(-4/5)/a) assuming a is positive. a(71/20) Simplify ((r18r)/r(-24/5))/((r/(r/(r8/r)r))/r)(5/14) assuming r is positive. r(1541/70) Simplify (i(-26)ii(-7/5)i)(2/7) assuming i is positive. i(-254/35) Simplify vv(-4/13)/vv/(vv7)v/((v*15/vv)/vv)v(v(-2/63)vv)/vv assuming v is positive. v(-15020/819) Simplify ((n11/n(-9))(-5))(-17/2) assuming n is positive. n850 Simplify (jj(-5/4)/jjj/(jjjj/(j*6j))j)/(j/j(3/8)j(-4)) assuming j is positive. j(65/8) Simplify ((t/((t*(1/9)/t)/t)t)/(t*(-6/7)/t)t*3t*(-4/5)t)3 assuming t is positive. t(2818/105) Simplify ((m*(19/5)m)/(m/(m14/m)))/(m(-11)/(m*(-11)m)) assuming m is positive. m(89/5) Simplify ((g(-17)/g)(-38))(-15) assuming g is positive. g(-10260) Simplify g10gg/g*(4/7)g(g/((gg(gg(gg*(-1/6)gg)/g)/g)/g))/g(-4/3) assuming g is positive. g(153/14) Simplify ((cc*(3/7)((c*(6/7)cc)/c)/c)(-4))(2/5) assuming c is positive. c(-128/35) Simplify (r21/(r(-2/31)rrr))/(rr9r(rr*(-14))/rr) assuming r is positive. r*(622/31) Simplify ((dd/(d*2d)d)43d*(1/13)/(dd*(1/2)dd))(-1/2) assuming d is positive. d(89/52) Simplify ((((h/h(-7)h)/hh)/h)/(h(-7)/h))/(h(-8/11)/(h(3/10)h)) assuming h is positive. h(1983/110) Simplify (b12)*(-4/3)/(bb/(b(bb*(-8/3)b)/bbb)b)(-42) assuming b is positive. b54 Simplify (((a(2/3))(-43))(-30))(4/27) assuming a is positive. a(3440/27) Simplify (x/(x/x(5/4)))38x13/(x4x) assuming x is positive. x(111/2) Simplify ((s/(s/(sss(1/4)s)))*(-14/9)(((s/(s/s(-1/4)))/s)/s)/s7)(1/16) assuming s is positive. s(-515/576) Simplify (s2)36/((s/s(-2/3))/s5) assuming s is positive. s*(226/3) Simplify ((i/(ii*(-23)i))(2/7))9 assuming i is positive. i*(396/7) Simplify ((oo/(o*(4/9)/o)oo)/o)/o14o*23/(oo(-17)) assuming o is positive. o(257/9) Simplify (tt(-1/18))(-48)/(t/(t/t4t)t(-6/5)) assuming t is positive. t(-707/15) Simplify (m(7/2)mmmm(-1/5)/m(m2/m)/(((m/m(2/5))/m)/m))(-22/7) assuming m is positive. m(-121/5) Simplify (o/(o/((o*(2/3)o)/oo)o))/(((oo(1/16))/o)/o)(oo10)/(o/((o/o(-1/7))/o)) assuming o is positive. o(3947/336) Simplify (a6a/(a*(1/14)a)aa((a/(aa*(-2/7)a)a)/a)/aaa/a5)(-17/5) assuming a is positive. a(-153/14) Simplify (x(-4/5)/x)/(x/(x(-2/9)x))xx*(1/12)x*(-1/6)x assuming x is positive. x(-19/180) Simplify ((z24z)/z(-6))18 assuming z is positive. z558 Simplify (((s(-1/4))(-44/5))(11/3))17 assuming s is positive. s(2057/15) Simplify (u/u(-1/7)u(-13))/((u(-2/21)u)/u(-6/13)) assuming u is positive. u(-3610/273) Simplify (d/(d/d(-5)d)d)39d/d*(-4)dd(6/13)ddd assuming d is	{ "pile_set_name": "DM Mathematics" }
of 40432683. 3, 41, 328721 List the prime factors of 1690077764. 2, 422519441 What are the prime factors of 82879020? 2, 3, 5, 7, 65777 What are the prime factors of 1653627141? 3, 31, 5926979 What are the prime factors of 321465044? 2, 80366261 List the prime factors of 1042078772. 2, 7, 37217099 What are the prime factors of 1834355256? 2, 3, 197, 387977 List the prime factors of 3467871306. 2, 3, 83, 349, 739 What are the prime factors of 96980477? 11, 2333, 3779 What are the prime factors of 94471517? 7, 13495931 List the prime factors of 77805887. 77805887 List the prime factors of 62836094. 2, 433, 72559 What are the prime factors of 1259718206? 2, 37, 460087 List the prime factors of 157204879. 13, 19, 239, 2663 What are the prime factors of 198851441? 198851441 What are the prime factors of 20135100? 2, 3, 5, 41, 1637 What are the prime factors of 178384985? 5, 257, 138821 List the prime factors of 765630762. 2, 3, 13, 23, 426773 List the prime factors of 99095149. 2707, 36607 List the prime factors of 145921688. 2, 11, 1658201 What are the prime factors of 374285555? 5, 7, 23, 464951 List the prime factors of 3391207691. 863, 3929557 List the prime factors of 84160237. 7, 37, 53, 6131 List the prime factors of 32037639. 3, 17, 628189 List the prime factors of 6595660275. 3, 5, 113, 157, 4957 List the prime factors of 148671810. 2, 3, 5, 7, 47, 5021 List the prime factors of 12184131. 3, 4061377 List the prime factors of 16029458. 2, 61, 83, 1583 What are the prime factors of 433513889? 17, 31, 822607 What are the prime factors of 52478954? 2, 11, 283, 8429 List the prime factors of 86101949. 23, 1567, 2389 What are the prime factors of 1985857419? 3, 7, 13, 83, 87641 List the prime factors of 205501655. 5, 701, 58631 What are the prime factors of 2160465513? 3, 720155171 What are the prime factors of 31842911? 31842911 What are the prime factors of 2808583411? 61, 5209, 8839 What are the prime factors of 101977384? 2, 1123, 11351 What are the prime factors of 129081111? 3, 283, 152039 What are the prime factors of 58123913? 47, 863, 1433 What are the prime factors of 46623305? 5, 53, 175937 List the prime factors of 31787248. 2, 29, 68507 What are the prime factors of 35801730? 2, 3, 5, 97, 1367 List the prime factors of 116445834. 2, 3, 461, 14033 List the prime factors of 81369949. 719, 113171 List the prime factors of 2303965204. 2, 29, 337, 58937 What are the prime factors of 33041983? 13, 97, 26203 What are the prime factors of 2654134461? 3, 11, 61, 283, 1553 List the prime factors of 84362561. 599, 140839 List the prime factors of 14751474. 2, 3, 31, 79309 List the prime factors of 7502476728. 2, 3, 312603197 List the prime factors of 6123480324. 2, 3, 13, 5639, 6961 List the prime factors of 4084954891. 38287, 106693 What are the prime factors of 695274364? 2, 17, 10224623 What are the prime factors of 958873130? 2, 5, 37, 97, 26717 What are the prime factors of 113013889? 113013889 List the prime factors of 141961463. 7, 313, 64793 List the prime factors of 50815972. 2, 97, 130969 What are the prime factors of 37141342? 2, 7, 2652953 List the prime factors of 105197031. 3, 37, 315907 List the prime factors of 2489008182. 2, 3, 17, 1279, 19079 What are the prime factors of 8103169? 17, 109, 4373 List the prime factors of 12800012. 2, 3200003 List the prime factors of 416910813. 3, 11, 12633661 List the prime factors of 2951468441. 257, 11484313 List the prime factors of 7951766825. 5, 431, 577, 1279 What are the prime factors of 29472? 2, 3, 307 List the prime factors of 2746229548. 2, 686557387 List the prime factors of 101660644. 2, 23, 211, 5237 List the prime factors of 10035011. 7, 1433573 List the prime factors of 104003174. 2, 11, 4727417 List the prime factors of 590920211. 7, 29, 157, 18541 What are the prime factors of 2320613542? 2, 13, 89254367 What are the prime factors of 5286847153? 7, 17, 89, 499183 List the prime factors of 111183873. 3, 89, 416419 List the prime factors of 414492489. 3, 53, 868957 List the prime factors of 239374279. 239374279 List the prime factors of 337838775. 3, 5, 31, 145307 What are the prime factors of 1131711264? 2, 3, 103, 157 List the prime factors of 4274382995. 5, 3967, 215497 List the prime factors of 53045565. 3, 5, 3536371 List the prime factors of 1886814296. 2, 235851787 List the prime factors of 85382403. 3, 28460801 What are the prime factors of 579784629? 3, 193261543 List the prime factors of 2577030. 2, 3, 5, 17, 31, 163 What are the prime factors of 434766455? 5, 19, 863, 5303 List the prime factors of 42826840. 2, 5, 7, 152953 What are the prime factors of 82486582? 2, 41243291 List the prime factors of 84187031. 73, 1153247 List the prime factors of 182066641. 11003, 16547 What are the prime factors of 195195435? 3, 5, 151, 86179 What are the prime factors of 178868311? 178868311 List the prime factors of 1999106591. 157, 877, 14519 List the prime factors of 217593318. 2, 3, 167, 397, 547 List the prime factors of 19242929. 17, 1131937 What are the prime factors of 103238893? 67, 1540879 What are the prime factors of 3911618? 2, 1955809 What are the prime factors of 4970718381? 3, 197, 8410691 List the prime factors of 52725175. 5, 349, 6043 What are the prime factors of 220292347? 11, 20026577 List the prime factors of 165556565. 5, 41, 127, 6359 What are the prime factors of 47726309? 19, 2511911 List the prime factors of 42094707. 3, 991, 14159 What are the prime factors of 4135468550? 2, 5, 82709371 List the prime factors of 5470934842. 2, 89, 30735589 List the prime factors of 401245665. 3, 5, 797, 33563 List the prime factors of 259090216. 2, 7, 11, 23, 18287 List the prime factors of 794120339. 617, 1287067 List the prime factors of 985188222. 2, 3, 43, 569, 2237 List the prime factors of 3602808280. 2, 5, 4987, 18061 List the prime factors of 41925814. 2, 7, 2994701 List the prime factors of 1004589262. 2, 17, 23, 1284641 List the prime factors of 5342974744. 2, 17, 31, 223, 5683 What are the prime factors of 39033991? 31, 281, 4481 List the prime factors of 51379189. 51379189 List the prime factors of 163246456. 2, 23, 163, 5443 What are the prime factors of 98633273? 98633273 What are the prime factors of 613497497? 131, 4683187 What are the prime factors of 146313777? 3, 48771259 List the prime factors of 3465195682. 2, 13, 73, 1283, 1423 List the prime factors of 792178387. 7, 11, 13, 791387 List the prime factors of 243820807. 243820807 What are the prime factors of 36748676? 2, 157, 163, 359 What are the prime factors of 271689244? 2, 67922311 List the prime factors of 1847478463. 27407, 67409 List the prime factors of 1892276464. 2, 13, 229, 39727 What are the prime factors of 1622941644? 2, 3, 135245137 What are the prime factors of 7629576086? 2, 11, 43, 89, 90619 List the prime factors of 9720592. 2, 7, 229, 379 List the prime factors of 284458960. 2, 5, 17, 37, 5653 What are the prime factors of 856101629? 137, 2423, 2579 What are the prime factors of 1866629486? 2, 29, 2297, 14011 List the prime factors of 447601238. 2, 7, 83, 385199 List the prime factors of 1524186491. 73, 223, 93629 List the prime factors of 218006738. 2, 37, 2946037 List the prime factors of 179984117. 17, 727, 14563 List the prime factors of 63758849. 7, 11, 29, 4079 List the prime factors of 70446315. 3, 5, 541, 8681 List the prime factors of 30094239. 3, 7, 1433059 List the prime factors of 400683648. 2, 3, 47, 149 What are the prime factors of 674791875? 3, 5, 119963 List the prime factors of 16024405. 5, 1549, 2069 What are the prime factors of 78521626? 2, 4397, 8929 List the prime factors of 110648633. 307, 439, 821 List the prime factors of 71559145. 5, 7, 41, 47, 1061 What are the prime factors of 2982970350? 2, 3, 5, 31, 213833 What are the prime factors of 3388889021? 7, 17, 28478059 What are the prime factors of 328728405? 3, 5, 17, 19, 3571 List the prime factors of 49427696. 2, 3089231 List the prime factors of 69513754. 2, 29, 1198513 List the prime factors of 6745788856. 2, 157, 5370851 What are the prime factors of 13973502? 2, 3, 569, 4093 List the prime factors of 1863387848. 2, 7, 83, 97, 4133 List the prime factors of 45317471. 45317471 What are the p	{ "pile_set_name": "DM Mathematics" }
lse Is 194033507 a composite number? False Is 934260991 composite? False Is 48195335707 a composite number? True Is 3147321487 composite? True Is 9740941801 prime? True Is 152580601 a composite number? True Is 2310451369 a prime number? True Is 6259916297 a composite number? False Is 1032786797 a composite number? True Is 2498685253 prime? True Is 317858209 composite? False Is 141419749 prime? True Is 10339248077 composite? False Is 252148693 prime? True Is 3820501451 a composite number? True Is 4363799903 composite? True Is 20080842269 prime? True Is 210504949 a prime number? True Is 125085487 a prime number? False Is 333514907 a prime number? False Is 6036817634 composite? True Is 4968366899 prime? True Is 15174371 a prime number? True Is 233079257 prime? False Is 1337028521 a prime number? True Is 632238989 a composite number? True Is 2095178401 a composite number? True Is 2569276239 a prime number? False Is 15349297 a composite number? True Is 639261367 composite? True Is 910106077 a prime number? True Is 17622032419 composite? False Is 126019817311 a composite number? True Is 1173317227 prime? True Is 2444811409 a prime number? False Is 937574713 composite? False Is 43981431729 prime? False Is 11351488937 composite? True Is 618965723 a prime number? False Is 161649069463 a prime number? False Is 2090264327 a composite number? False Is 151775017631 a composite number? False Is 129177043 a composite number? False Is 566653819 a composite number? False Is 99706508327 a prime number? True Is 5671305449 composite? True Is 712137541 composite? False Is 288838757 prime? True Is 243994027 composite? False Is 3552674357 composite? True Is 101005445357 a composite number? False Is 6610576507 prime? False Is 575710543 a prime number? True Is 455891099 prime? True Is 2384288443 composite? True Is 3201022277 a composite number? False Is 801395503 a composite number? False Is 3300701 a composite number? True Is 538018729 a prime number? False Is 1573089809 a composite number? True Is 2098237429 a prime number? True Is 872981899 prime? True Is 17121620573 a composite number? False Is 86979682637 composite? False Is 1910058527 a composite number? True Is 8953340023 a prime number? True Is 150857183 prime? True Is 1388657653 a composite number? False Is 1796958133 a composite number? True Is 21919697933 a prime number? False Is 29664972157 prime? True Is 5694000271 a prime number? False Is 13538321521 a composite number? True Is 1682422591 composite? True Is 10255394119 a prime number? False Is 14142482327 composite? False Is 774564023 a prime number? True Is 3069068533 prime? True Is 48484245053 composite? False Is 262288225985 prime? False Is 31785746935 composite? True Is 36507882269 prime? True Is 31445907817 composite? False Is 849773623 composite? False Is 4730640613 prime? True Is 1069670143 a composite number? True Is 92124334369 composite? False Is 19766285719 a prime number? True Is 488740081 prime? True Is 55979625509 a prime number? True Is 567597781 composite? False Is 7113453709 prime? False Is 856364869 composite? True Is 125519622637 a prime number? True Is 704974243 composite? True Is 5485835023 a prime number? True Is 52807189 prime? False Is 89089149 a composite number? True Is 1106147807 prime? True Is 7860616969 composite? False Is 3827752537 a composite number? True Is 4974040061 a prime number? True Is 24506878481 a composite number? True Is 296193781 a prime number? False Is 2415684941 prime? False Is 1060260719 a prime number? False Is 4634149083 a prime number? False Is 133421084149 a prime number? False Is 14748891653 a composite number? True Is 23985037259 a composite number? False Is 65769786653 a composite number? False Is 50433536747 a composite number? True Is 10954694273 a composite number? False Is 753392353 a prime number? False Is 2157732749 a composite number? False Is 2991951151 a prime number? False Is 27859824787 a composite number? True Is 136032931 composite? True Is 4090925089 a prime number? False Is 35050217183 a composite number? False Is 2068407343 a composite number? False Is 24708220826 prime? False Is 181761652799 a composite number? False Is 9365732393 prime? False Is 1932782461 a prime number? True Is 5918859701 a prime number? True Is 15065668963 a composite number? False Is 2145285169 prime? True Is 1095164519 a prime number? True Is 271309921 a prime number? True Is 16518352757 a prime number? False Is 954394963 a composite number? True Is 1237180429 a prime number? True Is 989775503 a prime number? False Is 109168409 prime? False Is 4429382651 a composite number? False Is 1693977397 a composite number? True Is 151723183 prime? True Is 3245959483 a prime number? False Is 75601979 prime? True Is 1846335343 a prime number? True Is 3661410769 a prime number? True Is 573913985 composite? True Is 505201891 prime? False Is 15474302534 prime? False Is 19176525707 a prime number? True Is 2222422549 composite? True Is 1297798009 composite? False Is 2170875271 prime? False Is 240276713 composite? False Is 63025482733 a composite number? True Is 449705741 a prime number? True Is 25084429607 composite? False Is 1557444223 a composite number? True Is 234818599 a composite number? False Is 7201825363 composite? True Is 520026343 a composite number? True Is 94663965013 composite? False Is 378538547 composite? False Is 7614829909 a prime number? False Is 7083657355 composite? True Is 46973381113 a prime number? True Is 923312539 a prime number? True Is 43681190681 a prime number? True Is 3073301234 composite? True Is 431597407499 composite? False Is 114771323449 a composite number? True Is 3791758609 prime? False Is 2436671353 composite? True Is 7389433939 a composite number? False Is 29582454197 a prime number? True Is 601394557 a composite number? True Is 416351513087 composite? False Is 37717136999 a prime number? False Is 30419023 prime? True Is 227506836539 a composite number? True Is 219912003123 a composite number? True Is 12688891609 prime? False Is 18918777223 composite? True Is 5320637797 prime? True Is 40114491631 a composite number? True Is 693115799 prime? False Is 2011570657 composite? True Is 1720689515 a composite number? True Is 7348690237 composite? True Is 109284859207 a composite number? True Is 928323139 a prime number? True Is 4530118847 a composite number? True Is 9479504851 prime? True Is 5167598903 prime? True Is 111209229457 a prime number? True Is 1287248377 composite? True Is 410555657 a composite number? True Is 128359531 a composite number? False Is 1747177853 a composite number? True Is 1531989447 a composite number? True Is 750720657 a composite number? True Is 33847587871 a prime number? True Is 141982327 a prime number? True Is 1906899067 prime? True Is 2298204851 composite? False Is 9766053619 composite? True Is 5108241683 a prime number? False Is 168358433 prime? True Is 135223643 a prime number? False Is 987690341 a prime number? False Is 1867593877 a composite number? False Is 1131833423 prime? False Is 374173951 composite? False Is 674961041 composite? False Is 40664793601 a composite number? True Is 457094023 composite? False Is 111731959 a prime number? True Is 20434599421 prime? True Is 4298800417 a composite number? False Is 28091544671 prime? False Is 20100796753 a composite number? True Is 2946969537 composite? True Is 58498753 a prime number? True Is 368162109209 composite? False Is 62879319059 a composite number? True Is 5752672477 composite? False Is 46334465737 prime? False Is 45202584281 a prime number? True Is 262205813 a prime number? True Is 120588623 a prime number? True Is 3806035187 prime? False Is 5978750251 a composite number? True Is 196093548485 composite? True Is 4544106883 prime? False Is 12320645885 a composite number? True Is 10314103741 a composite number? False Is 1686888217 a prime number? False Is 264951559 prime? False Is 1138229501 a composite number? False Is 82923622853 composite? True Is 27454951637 a composite number? True Is 1996233167 prime? True Is 7055060351 composite? False Is 684036349 a prime number? False Is 104119853 a prime number? True Is 22763595671 a prime number? False Is 3262942391 a prime number? False Is 1255030879 a prime	{ "pile_set_name": "DM Mathematics" }
divided by -3. 695/3 What is 2458 divided by -1229? -2 Calculate 4 divided by -93. -4/93 30 divided by -3 -10 Divide -280 by 20. -14 Calculate -658 divided by 12. -329/6 2840 divided by -4 -710 Divide 5 by -50. -1/10 -4760 divided by -140 34 23 divided by -3 -23/3 Divide -122 by 26. -61/13 Divide -52 by -3. 52/3 Divide 44 by -4. -11 Divide 3105 by 621. 5 Calculate 1 divided by -762. -1/762 Divide -39 by -2. 39/2 Divide 8 by -116. -2/29 26 divided by 4 13/2 Calculate 3692 divided by 923. 4 What is -6864 divided by 48? -143 What is -571 divided by 1? -571 Divide -2317 by 6. -2317/6 Divide 4 by 137. 4/137 Calculate -16659 divided by -5553. 3 615 divided by 205 3 What is 35 divided by 13? 35/13 What is -674 divided by -2? 337 Divide 11373 by -3791. -3 Calculate -4 divided by 3777. -4/3777 What is 258 divided by -7? -258/7 Divide -90 by 10. -9 Divide 285 by 57. 5 Calculate 49 divided by 1. 49 What is 14681 divided by 6? 14681/6 What is -2880 divided by 10? -288 Calculate 3016 divided by 58. 52 What is -12720 divided by -530? 24 253 divided by 1 253 Divide 58 by 1. 58 Divide 492 by 4. 123 Calculate -3765 divided by -5. 753 Divide 14 by -7. -2 What is -4936 divided by 6? -2468/3 What is 4 divided by -3570? -2/1785 Calculate -3 divided by 512. -3/512 What is -4608 divided by -288? 16 Divide -95 by 95. -1 -75267 divided by 3 -25089 Calculate 80 divided by -2. -40 Calculate -44 divided by 11. -4 Divide 270 by 6. 45 357 divided by 1 357 Calculate 85 divided by -3. -85/3 What is 347 divided by -1? -347 Divide 2628 by -4. -657 Divide 750 by -3. -250 666 divided by 2 333 18 divided by -135 -2/15 10 divided by -207 -10/207 Calculate -3072 divided by 128. -24 What is -56 divided by -1? 56 Divide 871 by -1. -871 Divide 23064 by -5766. -4 -29 divided by -13 29/13 Divide 345 by 1. 345 Divide -1188 by 198. -6 Calculate -576 divided by -8. 72 -2524 divided by 3 -2524/3 Calculate -1365 divided by -455. 3 -300 divided by 50 -6 Divide -50 by 2. -25 Divide -803 by -7. 803/7 What is 8 divided by -139? -8/139 Calculate 84 divided by -2. -42 What is -36054 divided by 6? -6009 -10180 divided by -4 2545 What is -6952 divided by -8? 869 Calculate -724 divided by 724. -1 Calculate 459 divided by 27. 17 Calculate -1 divided by 144. -1/144 Divide 0 by 1069. 0 Divide 6 by 13. 6/13 -5538 divided by 6 -923 Calculate -1366 divided by 1366. -1 213 divided by -71 -3 -3 divided by 1061 -3/1061 Calculate 0 divided by -1296. 0 Calculate -738 divided by -3. 246 5 divided by -260 -1/52 Divide -2198 by 2. -1099 -2 divided by 29 -2/29 Calculate 1930 divided by -386. -5 What is -45 divided by 1? -45 Divide -20 by -10. 2 What is 17 divided by 10? 17/10 Divide -1404 by -3. 468 Calculate 120 divided by -3. -40 What is -69 divided by 4? -69/4 Divide -432 by 4. -108 What is 3 divided by -1850? -3/1850 -624 divided by -208 3 Divide -1 by -93. 1/93 -300 divided by 3 -100 Calculate -3612 divided by 42. -86 Divide -4095 by -35. 117 What is -232 divided by 58? -4 Divide 2484 by 138. 18 Calculate 9 divided by 435. 3/145 Divide -606 by 2. -303 Calculate -2189 divided by 5. -2189/5 -972 divided by -324 3 6066 divided by 1011 6 Calculate -4606 divided by -14. 329 Divide 415 by 4. 415/4 What is -25988 divided by -6497? 4 Divide 433 by -4. -433/4 Divide 0 by -1368. 0 -3139 divided by -10 3139/10 Calculate -344 divided by 344. -1 What is -4430 divided by 5? -886 What is -72 divided by 8? -9 -1973 divided by -3 1973/3 What is -2 divided by -3129? 2/3129 What is -7 divided by -1? 7 Calculate 5 divided by 116. 5/116 Divide 105 by -21. -5 Calculate 10880 divided by -680. -16 Calculate 600 divided by -150. -4 What is -51 divided by -2? 51/2 415 divided by -5 -83 Divide 4828 by 1207. 4 Calculate -380 divided by -76. 5 -372 divided by 5 -372/5 Divide 13330 by -2666. -5 Calculate -105 divided by 15. -7 Calculate 1168 divided by 8. 146 -1 divided by -163 1/163 What is -2675 divided by 2? -2675/2 2061 divided by -3 -687 -271 divided by 4 -271/4 What is 1744 divided by 16? 109 -1900 divided by 10 -190 Calculate 17475 divided by 5. 3495 Divide -58158 by 3. -19386 Divide 14736 by -3. -4912 -732 divided by -122 6 What is 31 divided by -15? -31/15 -3967 divided by 4 -3967/4 What is -111 divided by 15? -37/5 What is 0 divided by -152? 0 What is 2 divided by 116? 1/58 What is -1062 divided by -2? 531 Calculate -24 divided by 4. -6 Calculate 138 divided by 23. 6 Calculate 64 divided by -32. -2 What is 166 divided by 5? 166/5 4 divided by 18 2/9 -19 divided by 9 -19/9 Calculate 3114 divided by 1038. 3 Divide 19 by 19. 1 Divide -42 by 1. -42 Calculate 4 divided by 271. 4/271 What is -8428 divided by -4214? 2 What is 4237 divided by -1? -4237 Calculate -39 divided by 5. -39/5 Divide -182 by -13. 14 Divide -17 by -303. 17/303 Calculate -722 divided by 26. -361/13 Calculate -8199 divided by -5. 8199/5 -7880 divided by 197 -40 570 divided by -7 -570/7 Calculate 3 divided by 10. 3/10 Divide 43 by 45. 43/45 Calculate 45 divided by 29. 45/29 Divide -1026 by -4. 513/2 Calculate -1150 divided by 12. -575/6 Calculate 0 divided by 51. 0 What is 1752 divided by -876? -2 What is 13 divided by -60? -13/60 Calculate -3243 divided by -1081. 3 11 divided by -27 -11/27 Divide 1 by 49. 1/49 Calculate -687 divided by -3. 229 9 divided by -7 -9/7 -4162 divided by -2081 2 Divide -4844 by 4. -1211 What is 3 divided by -573? -1/191 Divide -38910 by 5. -7782 Divide -114 by -19. 6 Calculate -40212 divided by 4. -10053 -42 divided by 6 -7 Calculate 386 divided by 6. 193/3 What is 25 divided by -35? -5/7 What is 29727 divided by 3? 9909 164 divided by 39 164/39 Calculate -2079 divided by -7. 297 Divide 0 by 131. 0 Calculate -1258 divided by 2. -629 What is 900 divided by -25? -36 Divide 3 by -5007. -1/1669 Divide -25998 by 7. -3714 What is -361 divided by 5? -361/5 10 divided by -5 -2 What is 1974 divided by -658? -3 What is -4746 divided by -1582? 3 Calculate 4 divided by 1012. 1/253 Divide -192 by -2. 96 Divide -34 by -1. 34 300 divided by -6 -50 Divide -272 by 68. -4 What is 1 divided by -318? -1/318 Calculate 2278 divided by 2. 1139 -3209 divided by 5 -3209/5 Calculate -882 divided by -6. 147 Divide 1452 by -22. -66 What is -261 divided by 87? -3 Calculate 134 divided by -9. -134/9 -4 divided by -1968 1/492 Calculate 3 divided by 103. 3/103 118 divided by -59 -2 Divide -42 by 5. -42/5 Calculate -14 divided by -14. 1 What is 2301 divided by -3? -767 What is 16 divided by 8? 2 Divide 0 by -496. 0 0 divided by 169 0 Divide 633 by -2. -633/2 What is -53 divided by -1? 53 What is -684 divided by 4? -171 What is 508 divided by 254? 2 -40149 divided by -3 13383 Calculate 0 divided by 176. 0 Divide 230 by 23. 10 Divide -3 by 51. -1/17 Divide 80 by -16. -5 Calculate 5 divided by -31. -5/31 -4 divided by -5 4/5 What is -657 divided by 1? -657 Calculate -2828 divided by 4. -707 2912 divided by 4 728 -333 divided by -37 9 Calculate 2 divided by -192. -1/96 Divide -3 by -401. 3/401 Calculate 788 divided by -4. -197 What is 354 divided by -1? -354 What is -450 divided by -150? 3 Divide -135 by -6. 45/2 5970 divided by 30 199 Calculate 4 divided by -27. -4/27 Calculate -2204 divided by -4. 551 Divide -7728 by 7. -1104 Calculate -525 divided by 25. -21 Divide 33 by -11. -3 Calculate 1 divided by 11. 1/11 Divide 2136 by 712. 3 0 divided by 525 0 What is 2 divided by 2123? 2/2123 What is -7 divided by 240? -7/240 What is 112 divided by -28? -4 Divide -1 by -48. 1/48 Divide -780 by 1. -780 What is -1 divided by 237? -1/237 19 divided by 26 19/26 Calculate 0 divided by -708. 0 Calculate -150655 divided by 5. -30131 -12 divided by 70 -6/35 Calculate 1316 divided by -7. -188 Divide 12 by 12. 1 Calculate 38 divided by 19. 2 What is 3 divided by -3? -1 What is 3 divided by -27? -1/9 -105 divided by 1 -105 What is 20 divided by 74? 10/37 Divide 922 by 3. 922/3 Divide 0 by 74. 0 Calculate -2 divided by -66. 1/33 Calculate 5 divided by 59. 5/59 Calculate -262 divided by 25. -262/25 Calculate 2 divided by -185. -2/185 What is -8 divided by 63? -8/63 Divide -1991 by -11. 181 93 divided by 2 93/2 What is 206 divided by 1? 206 What is -2216 divided by -4? 554 Calculate 9 divided by 25. 9/25 -264 divided by 24 -11 -260 divided by 2 -130 What is 5 divided by -2948? -5/2948 Wha	{ "pile_set_name": "DM Mathematics" }
n decreasing order. 2/7, k, -0.3, -21 Let v = 11 + -9. Sort -29, -5, v in increasing order. -29, -5, v Let h(g) = g*3 - 1. Let p be h(1). Let m be (36/42)/(3/14). Sort 1, 5, p, m in decreasing order. 5, m, 1, p Let i be 19/(-57)(17 - -1). Let y be 38/(-88) - i/33. Let b be 1/(-4) + (-14)/8. Sort 0.2, y, b in ascending order. b, y, 0.2 Let l(v) = -50v + 505. Let w be l(10). Let m = 10 + -10. Sort -2, w, m, 4. -2, m, 4, w Let n = -67.87 - -68. Sort 0.1, 1, n. 0.1, n, 1 Suppose 13j + 45j + 116 = 0. Suppose 4 = 5s - 3s. Sort s, -5, j in descending order. s, j, -5 Let d = 0.915 - 1.415. Put -5.7, d, -2/3, -0.2 in increasing order. -5.7, -2/3, d, -0.2 Let q be ((-136)/51)/((-4)/6). Let l = -697/4 + 174. Sort -4, l, q in increasing order. -4, l, q Let f = 8.3 - 8. Let j = 2.0794 - 0.0794. Put -1/3, f, j, -0.1 in decreasing order. j, f, -0.1, -1/3 Let g = 41/132 - 2/33. Suppose -4u - 12 = 0, -3c - 3u + 39 = -6u. Put c, -3, g in descending order. c, g, -3 Let w be (30/(-9))/(4/(-6)). Let a be 20/w + 31-1. Let o be 48/a - (-12)/(-54). Sort o, 4, 2 in increasing order. o, 2, 4 Let m = 3 - 3.5. Let u = -6 + 2. Let y(z) = -z2 + z + 11. Let p be y(3). Sort p, u, m in decreasing order. p, m, u Let w(l) = l3 + 17l2 - 34l + 80. Let j be w(-19). Put -0.4, j, -10, 7 in ascending order. -10, -0.4, j, 7 Let r(c) = c*2 - 9c - 53. Let a be r(-4). Suppose 0 = 4x + 12, -3x - 10 = l + 2x. Sort 1, a, 2, l in increasing order. a, 1, 2, l Suppose -15 = -2z - p - 4, -4z = 5p - 13. Put z, 25, -4 in descending order. 25, z, -4 Let k = -77 + 85. Suppose r - k = -13. Sort 1, -4, r, -2. r, -4, -2, 1 Let d(z) = -z - 4. Let g be d(-6). Let w(v) = -v*3 - 4v*2 + 6v. Let j be w(-5). Sort g, 5, j in decreasing order. 5, g, j Let p be (-116)/290 + (-12)/(-30). Suppose 2o - 5 = 5. Put p, 14, o in increasing order. p, o, 14 Suppose 2l + 57 = -0l - i, 0 = 5l - 4i + 136. Let q be -6(l/6 + 4). Let t be (2/(-3))/(18/81). Put t, 1, q in decreasing order. q, 1, t Let f = 149 - 146. Sort -6, f, 1. -6, 1, f Let c = -820 - -825. Sort 1, c, -1, 16 in increasing order. -1, 1, c, 16 Let q be (-2 + 3)/(-6) + 5/(-150). Let z be (11/(-4) - -3)3. Sort -2, z, q in ascending order. -2, q, z Suppose 0 = k + 4y + 1444, -k + 3y + 0y = 1437. Let u = k + 404638/281. Let w = u + 1409/562. Put -3, w, -0.4 in decreasing order. w, -0.4, -3 Let q(r) = -r + 7. Suppose 3w = -5z + 4, -w + 8 = -4z - z. Let n be q(w). Suppose -nb = b. Put b, -4, -5 in increasing order. -5, -4, b Suppose 2m + c = 35, -71c + 74c = -5m + 90. Sort m, -7, 5 in decreasing order. m, 5, -7 Let p = -148.7 + 149. Let d = -978/7 - -140. Put 3, d, -0.1, p in descending order. 3, p, d, -0.1 Let g = 78 + -94.5. Let p = g - -16. Sort -10, p, 4/5 in decreasing order. 4/5, p, -10 Let j(l) = -l*2 + 10l - 4. Let z be j(6). Suppose 4g - z = 8g - 4u, -u = -5g - 21. Let i be (2/1)/g0. Sort i, 1/5, 0.3 in decreasing order. 0.3, 1/5, i Let t be (1 + -10)(-2)/6. Suppose -tf + 5 + 1 = 0. Suppose 4n + 3c - 6 = 8n, 2n = -4c + 8. Put n, 4, f in descending order. 4, f, n Suppose 0 = -5l - 4q + 47, 3l + 7 = -4q + 40. Let z be l/((-14)/3)(-4)/(-6). Suppose 0 = 2t + 9 - 1. Sort 5, z, t in decreasing order. 5, z, t Let k = 4.68 - 4.78. Sort k, -0.4, 865. -0.4, k, 865 Let o be 117/(-21) + (108/42)/(-6). Put 6, o, 5 in decreasing order. 6, 5, o Let t = 18.45 + -19.45. Let n be (2/(-10))/((-2)/(-5)). Sort n, -0.3, t, -0.4 in decreasing order. -0.3, -0.4, n, t Let z = 3 - 2. Let c = 0.52 + -39.72. Let t = c - -39. Sort 2, z, t in increasing order. t, z, 2 Let x(r) = 13r - 413. Let k be x(32). Put 2, -8, k, 0 in decreasing order. k, 2, 0, -8 Let u(w) be the second derivative of w3/2 + 21w*2/2 - 6w. Let q be u(-6). Sort 1, q, -9 in descending order. q, 1, -9 Suppose 52 = 4s - 0s. Let r = s - 18. Let y be 2 + -6 + 6 + 1. Put r, 2, y in descending order. y, 2, r Let g(f) = -8f - 180. Let k be g(-23). Put k, -13, -3, -5 in increasing order. -13, -5, -3, k Suppose 2u + x - 6 = -3x, 3u - 9 = x. Suppose -1448 = 7w - 1693. Put -2, w, u in decreasing order. w, u, -2 Let m = 0.43 - 34.43. Let i = -31 - m. Let x = -0.02 + 5.02. Sort x, -1, i in increasing order. -1, i, x Let w be 8/45 - ((-36)/10)/(-9). Let k = 9 - 8. Let z = 1.02 - k. Put -4, z, w in decreasing order. z, w, -4 Let d(g) = -7g + 70. Let s be d(10). Sort -3, s, -4, 5. -4, -3, s, 5 Let h = -2 + 2.5. Sort 0.3, 6, h, 1/7 in ascending order. 1/7, 0.3, h, 6 Suppose l = -x + 5, -52l + 54l = -5x + 22. Put x, -2/15, -5, -9/5 in descending order. x, -2/15, -9/5, -5 Let s = 50 + -70. Let w = -18 - s. Suppose 5h = v + 15, -wh = 5v + 12 - 45. Sort -2, 0.2, v in descending order. v, 0.2, -2 Let n be 8/6 - (-1 + 1/3). Suppose -2g = -n - 8. Sort g, 2, -1, -2 in descending order. g, 2, -1, -2 Suppose 4h - 20 = 2o, 2o - 2h = -0 - 16. Put -5, 1, o in increasing order. o, -5, 1 Let v be (6 - 7)(0 + -1 + 0). Let a(i) = -7i + 6. Let f be a(v). Sort 4, -4, f, -2 in decreasing order. 4, f, -2, -4 Let b = -118 + 114. Let s = -20 - -15. Sort s, -0.2, b, 0.5 in increasing order. s, b, -0.2, 0.5 Let z = 187 + -190. Sort 15, z, 1, -5 in descending order. 15, 1, z, -5 Let k(t) be the first derivative of t3/3 - 7t*2/2 + 6t - 4. Let d be k(6). Let m = -6.2 - -1.2. Sort m, d, -1 in descending order. d, -1, m Let a(u) be the first derivative of u*2/2 - 4u - 1. Let i be a(0). Suppose -5m - 3 = -26w + 22w, 0 = 2w - 4. Sort m, 4, i. i, m, 4 Let q be (-2)/(-12 + (-39)/(-3)). Put 4, 85, q, 2 in increasing order. q, 2, 4, 85 Let i be (81/6)/(-9)24/9. Sort -3, -59, i, 5. -59, i, -3, 5 Let z = -0.337 - -156.337. Let n = z - 151. Sort n, -25, 0.4 in increasing order. -25, 0.4, n Let r(s) = -s3 - 7s*2 - 8s + 6. Let l be r(-5). Let o = -18 + 15. Put -5, o, l in decreasing order. o, l, -5 Let d(p) = -28p + 285. Let r be d(10). Put 3, r, -4, -43 in increasing order. -43, -4, 3, r Let z(l) = l + 4. Let d be z(-2). Suppose -25 = -5o, -y = 3y + 3o - 11. Let v(t) = 3t + 1. Let i be v(y). Sort i, d, 5 in decreasing order. 5, d, i Suppose 2a - 24 = 3p - a, -3a = -9. Let o = p + 5. Let w = 1 - 0. Put 3, w, o in increasing order. o, w, 3 Let l(t) = t - 17. Let g be l(8). Let s be 15/(-3) - g/(-3)-1. Sort -5, 0, s. -5, s, 0 Let f = 3 - 0. Suppose 4n - fn = 4. Let y = -1.3 - 0.7. Sort y, 2, n in ascending order. y, 2, n Suppose 25 = -22w + 17w, 0 = -p + 5w + 12. Sort -0.1, p, 0.05 in decreasing order. 0.05, -0.1, p Suppose 251x - 261x = -30. Sort -4, x, 4, 22. -4, x, 4, 22 Let a = -857 - -853. Sort -3, a, -1 in descending order. -1, -3, a Suppose -s + 5s = -p - 18, -p = -2s - 6. Sort 3, 4, s, -1. s, -1, 3, 4 Let m(a) = -5a2 + 153a - 93. Let r be m(30). Sort 21, r, -5, 13. -5, r, 13, 21 Suppose 2z - 24 = 6z. Let j = z - -17/3. Let b = -53.5 - -50.5. Sort -0.2, j, b in increasing order. b, j, -0.2 Suppose 2k - 18 = -4k. Let p be (-1512)/(-810) - (-4)/30. Let j = -3.1 - 0.9. Sort k, j, p. j, p, k Let o = -22 + 22.44. Let w = 0.06 + o. Let m = 0.5 + 0.5. Sort w, m, -22. -22, w, m Let t(b) = -b*2 - 36b - 8. Let o(n) = -n*2 - 18n - 4. Let z(m) = 5o(m) - 3t(m). Let a be z(9). Sort a, -1, -4, 2 in decreasing order. a, 2, -1, -4 Let t = 383/4180 - -3/220. Let w be -3 - ((-34)/9 + 1). Let x = 173 - 174. Sort x, t, w in ascending order. x, w, t Let w = 4 - 15. Let a(g) = g*3 + 10g*2 - 13g - 9. Let s be a(w). Suppose -3p = -b + s, -4p + 4b - 16 = -p. Sort 3, -1, p in decreasing order. 3, -1, p Let t be (-5)/206 - (-141)/70. Let p = -8/35 + t. Sort 3, p, -16. -16, p, 3 Let m = -83.6 - -68.4. Put -4, 2/7, m in decreasing order. 2/7, -4, m Let g = 4.026 - 0.026. Put g, -2/5, 5, 0.3 in ascending order. -2/5, 0.3, g, 5 Let b be (-2)/3 + (-28)/(-21). Let s = b - 0. Sort s, -0.5, 2 in descending order. 2, s, -0.5 Suppose 181c - 14 = 174c. Sort c, -6, 1, 7 in descending order. 7, c, 1, -6 Let s be (-6)/4(39/9 - 1). Put s, -47, 2 in descending order. 2, s, -47 Suppose -l = -4g - 44 + 56, g + 4l = 3. Sort -1, g, 2/49, 1 in decreasing order. g, 1, 2/49, -1 Let x = -284 + 287. Sort 26, x, 4 in decreasing order. 26, 4, x Let s = -0.1159 + 0.0159. Let d = 4 + -4.02. Put d, 0, s, 2 in decreasing order. 2, 0, d, s Suppose -17f - 8 = 49 - 6.	{ "pile_set_name": "DM Mathematics" }
+ 5l(h). h Let a(j) = -j2 - j - 1. Let y(k) = -310k*2 + 12k + 12. What is -12a(i) - y(i)? 322i*2 Let q(m) = 2m + 59. Let p(w) = -w - 59. Give 3p(b) + 2q(b). b - 59 Let j(w) = -5w2 - 6w - 4. Let f(d) = 2d3 - 7d*2 + 3d - 4. Let v be f(3). Let r(g) = -4g2 - 5g - 3. Determine vr(x) + 3j(x). x*2 + 2x Let b(n) = -n*3 - 3n*2 - 3n + 4. Suppose 6j - 32 = 34. Suppose 13 = c + 3i, 2c + j = 4c + i. Let v(x) = 2x3 + 4x*2 + 4x - 5. Give cb(q) + 3v(q). 2q3 + 1 Let i(j) = -j + 5. Let t(r) = -r + 4. Let d(s) = -6s - 51. Let q be d(-8). Give qt(k) + 2i(k). k - 2 Let i(t) = t - 3. Let r(f) = 2f - 20. Give -3i(u) + r(u). -u - 11 Let u(i) = 1. Let w(s) = -s. Let b(d) = 2u(d) + w(d). Let f be 1 + -2 - 2/2. Let n(k) = 4k - k - 14 + 0k + 5. Determine fn(l) - 9b(l). 3l Let s(a) = -2a2 - 5a + 5. Let v = -28 - -36. Suppose -2w + 2p = -12, 11p = -w + 7p + 1. Let o(k) = 3k2 + 8k - 8. Determine vs(f) + wo(f). -f*2 Let q = 773 + -779. Let d(g) = 2g. Let k(y) = 3y. Calculate qk(r) + 13d(r). 8r Let q(j) = -9j + 2. Let b(h) = -3h + 0h + 4h - 2h - 1 + 2h. Determine 5b(w) + q(w). -4w - 3 Let a(l) = -9l + 7. Let s(j) = -20j + 13. Calculate 5a(x) - 2s(x). -5x + 9 Let y(d) = -8 + 8d*2 + 2d - 2d - 17d*3. Let o(c) = -6c*3 + 3c*2 - 3. Let n be ((-1)/2)/(4/(-56)). Suppose 3l - 31 = -n. Give lo(b) - 3y(b). 3b3 Let k(b) = -6b*3 - 3b*2 - b - 3. Let z(u) = 11u*3 + 5u*2 + 3u + 5. What is 5k(w) + 3z(w)? 3w3 + 4w Let m be -6(-2)/(-40) - 1007/(-190). Let i(f) = f3 + 2f2. Let x(j) be the third derivative of j5/60 + j*2. Determine mx(a) - i(a). -a*3 + 3a2 Let o(m) = m3 + 2m2 + m - 3. Let b(h) = 15h*3 + 9h*2 + 3h - 15. What is -b(y) + 5o(y)? -10y3 + y2 + 2y Let n(c) = 6c*2 + 8c. Let i(q) be the first derivative of q3/3 + q2/2 + 284. Let j be ((-3)/1)/(18/48). Calculate ji(k) + n(k). -2k2 Let m(x) = x2. Let r(v) = 2v2 - 32v + 1. Give -m(t) - r(t). -3t2 + 32t - 1 Let q(f) be the third derivative of -5f4/24 + 4f*2. Let p(v) = -5v. Calculate -6p(m) + 7q(m). -5m Let i(w) = -5w - 9w + 5 + 13w. Let t(c) = 3c - 11. Calculate 9i(a) + 4t(a). 3a + 1 Let l(j) = -6j + 7. Let p(d) = -5d + 8. Determine 6l(q) - 5p(q). -11q + 2 Let a(y) = -y + 1. Let x(b) = -4b*2 - 2b - 28. Let u(r) = r*2 + r + 2. Let m(f) = 10u(f) + x(f). Determine -8a(q) - m(q). -6q*2 Let x(q) = -60q*3 - 19q*2 - 31q. Let l(v) = -20v3 - 7v*2 - 11v. Give -17l(z) + 6x(z). -20z3 + 5z*2 + z Let n(s) = -4s - 13. Suppose 0 = 2v - 4, -4y - 4 = -5y - 5v. Let o(m) = -m - 1. Calculate yo(z) + n(z). 2z - 7 Let m(v) = -2v + 7v + 2 + 15v2 - 14 + 18 - 1. Let u(x) = -x2 - x - 1. Give -m(o) - 5u(o). -10o2 Let t be 3/9 - (34/(-6) + 3). Let i be ((-44)/(-12) - t)(-15)/2. Let v(m) = -7m3 + m2. Let a(c) = -8c3 + c2. Determine ia(r) + 6v(r). -2r3 + r2 Suppose -5y + 0r - 27 = r, -3y + r = 13. Let z(s) = -2s - 14. Let c be z(y). Let l(b) = 4b - 4. Let p(h) = -1. What is cp(f) + l(f)? 4f Let z(n) be the first derivative of 0n2 - 5n + 5/3n3 + 13 - 1/4n4. Let d(f) = f2 - 1. Calculate -5d(l) + z(l). -l3 Let h(m) = -26m*3 - 3m*2 - 2. Let q(t) = -2t3 + t2 + t + 1. Calculate h(s) + 2q(s). -30s3 - s2 + 2s Let b(t) = 2t + 4. Let z(p) = -4p3 - 21p*2 - 5p + 5. Let m be z(-5). Let x(c) = -3c - 6. Give mx(f) + 8b(f). f + 2 Suppose 3 = -a + 4a. Let y be -51 - a(0 + -3). Let s be 3 + y/(-4) + 2. Let v(q) = -q2 - 6q - 8. Let t(o) = 3o2 + 17o + 23. Give sv(m) + 6t(m). m*2 + 2 Let h(f) = 2f*2 + 3f. Let m(u) = 5910 - 2957 - 3u - 2953 - u2 - 2u*2. Determine -6h(o) - 5m(o). 3o*2 - 3o Let u(o) = 4o3 + o2 + 1. Let j(a) = 13a*3 + 3a*2 + 4a - 45. What is j(n) - 3u(n)? n3 + 4n - 48 Let c(s) = -9s2 - 4s + 36. Let a(w) = -5w2 - 2w + 19. Give -7a(g) + 4c(g). -g*2 - 2g + 11 Let f(r) = 2r2 - 2r. Let l(c) be the first derivative of 11 + 0c - 1/2c*2. Calculate -f(v) + 2l(v). -2v2 Let p(u) = -6u*2 + 2u - 6. Suppose 5g - 45 = 5l, -5l - 81g + 78g - 21 = 0. Let f(r) = -7r*2 + 2r - 7. What is lp(m) + 5f(m)? m*2 - 2m + 1 Let n(c) = c + 1. Let p be (2 - (-4 + 4)) + -2. Let u(t) = p + 2t + 8 + 6t - 4. Calculate -6n(y) + u(y). 2y - 2 Let v(p) = 10p - 4. Suppose 62 = -2c + 4c. Let q = -17 + c. Let m(u) = 41u - 24u - 15u - 1. What is qm(h) - 3v(h)? -2h - 2 Let i be 12/6 + (0 - 12). Let q(u) = -4u*2 - 13u*2 + 11u*2 - u + 6u. Let n(a) = -a*2 + a. Give in(p) + 2q(p). -2p*2 Let h(z) = 51z*2 - 2z + 4. Let m(p) = -52p2 + 3p - 3. Calculate 3h(c) + 4m(c). -55c2 + 6c Let g(h) = 5h2 + 3h - 3. Let u(b) = -44b2 - 28b + 28. Let k be (-4 - (-80)/15)(-21)/1. Calculate kg(v) - 3u(v). -8v*2 Let i(u) = 3u*2 + 10u - 3u + u - 4u - 17u + 5. Let j(c) = 5c*2 - 19c + 8. Calculate -8i(p) + 5j(p). p*2 + 9p Let y(k) = 3k3 + 4k*2 - 6. Let c(u) = -8u*3 - 11u*2 + 17. Let x be 6 - (2 - (1 - -1)). Suppose 84 = -10j + 254. Determine jy(r) + xc(r). 3r3 + 2r*2 Suppose 3 - 3 = -8y. Suppose 4h = -5c - 39, -5c + 1 + 4 = y. Let p(d) = d2 + 3d + 4. Let a(v) = 3v2 + 8v + 11. Give hp(n) + 4a(n). n*2 - n Let z(f) = -5f - 20. Let n(d) = -21d - 79. Give 2n(r) - 9z(r). 3r + 22 Let k(z) = 4z - 26. Let v(y) = -y + 5. Let m = -1440 + 1429. Give mv(w) - 2k(w). 3w - 3 Let u(s) = 3s + 1. Suppose 0 = -33b + 25b - 32. Let j(l) = 5l + 2. Calculate bj(t) + 9u(t). 7t + 1 Let i be (0 - 3)(-4 + 3). Let x(k) = 4 - 5 - k + 1. Let p(m) = -4m. Calculate ix(o) - p(o). o Let l(j) = 50j - 365. Let x(o) = -43o + 365. What is 6l(h) + 7x(h)? -h + 365 Let f(i) = -i*3 + i - 1. Let z(y) = -7y*3 - 3y*2 + 8y - 9. Let u(p) = 7p3 + 2p*2 - 9p + 11. Let m(a) = -2u(a) - 3z(a). Calculate 6f(o) + m(o). o3 + 5o*2 - 1 Let t(m) = -11m*2 - 11m. Let n(k) = -6k2 - 6k. Let b(c) = -5n(c) + 3t(c). Let x(u) be the third derivative of u*5/60 + 7u*2. What is -b(w) - 2x(w)? w*2 + 3w Let g(r) = r*2 + r - 1. Let j(a) = -8a*2 + 7a + 4. Calculate -3g(z) - j(z). 5z*2 - 10z - 1 Let q(i) = -2i3 + 2i + 12. Let d(o) = -o*3 + 3o + 9. What is 3d(h) - 4q(h)? 5h3 + h - 21 Let b(h) = -h2. Suppose 0 = -13y + 8y + 35. Let i(a) = -2a*2. Give yi(c) - 6b(c). -8c*2 Let r(p) = 4p*2 - 4p + 1. Suppose 43z - z - 42 = 0. Let j(m) = m3 - m2 + m. Calculate zr(u) + 4j(u). 4u*3 + 1 Let q(o) = 3o*2 + 5o. Let k(c) = -c2 - c - 1. Let a(w) = w3 - 9w2 - 11w + 9. Let p be a(10). Let h be (-4 - -8) + p - -1. Determine hk(i) + q(i). -i2 + i - 4 Let v(k) = -k3 - k2 - k. Let y(d) = -5 - 2d - 5d3 - 4d*2 + 3 + 1. Let p = -6530 + 6531. Give py(a) - 4v(a). -a3 + 2a - 1 Let p(f) = 24f3 + 9f*2. Let r(q) = 6q*3 + 2q*2. Let h = 162 - 144. What is hr(w) - 4p(w)? 12w*3 Let j(n) = 194n3 + n2. Let a(v) = v*2. Determine 3a(z) - j(z). -194z3 + 2z*2 Let h(d) = 38d - 264. Let u be h(7). Let l(m) = m*3 - 2m*2 - 4m + 2. Let r(f) = 3f3 - 7f*2 - 13f + 7. Calculate ur(i) - 7l(i). -i*3 + 2i Let a(x) = 7x3 - 11x*2 + 10x - 1. Let l(n) = -8n3 + 10n*2 - 12n + 2. Calculate -6a(z) - 5l(z). -2z3 + 16z*2 - 4 Let d(f) = 45f*3 + 9f - 9. Let o(x) = -11x3 - 2x + 2. Let a(y) = y*3 - 23y*2 - 24y + 9. Let c be a(24). What is co(i) + 2d(i)? -9i3 Let i(t) = -t + 2. Let q(k) = -k2 + 1. Let w(r) = 7r*2 - 5r - 1. Let n be w(1). Calculate ni(b) - 2q(b). 2b2 - b Let k(y) = -74y*2 - 2y + 5. Let h(z) = -38z2 - z + 2. Determine 9h(i) - 4k(i). -46i2 - i - 2 Let a(b) = b3 - b + 1. Let g be (2/(-4))/((-2)/12). Let l(o) = 0o2 - 4 + 4og + o2 + 6 - 4o. Let v be 10/(-4)24/(-30). Calculate va(t) - l(t). -2t3 - t2 + 2t Let t(z) = 3z*3 + 9z*2 + 5z. Let o(m) = m*3 + 4m*2 + 2m. Suppose -24s + 22s + 10 = 0. Determine so(f) - 2t(f). -f*3 + 2f*2 Let p = 35 - 31. Let d(t) = pt + 3t + 10 - 5. Let v(c) = -11c - 8. Give -8d(y) - 5v(y). -y Let y(u) = 316721u2 - 2569u. Let p(w) = -370w2 + 3w. Calculate -2569p(v) - 3y(v). 367v2 Let d(g) = -5g*3 - 6g*2 + 8g -	{ "pile_set_name": "DM Mathematics" }
the closest to 1/2? (a) 3/23 (b) -2 (c) -0.16 (d) -10 (e) -0.06 a Which is the nearest to -0.1? (a) 6 (b) -1/24 (c) 5 (d) 0.2 (e) 5.01 b Which is the closest to -127? (a) 31 (b) 24 (c) -2/9 (d) 5 (e) -9 e Which is the closest to 10? (a) 3/7 (b) -0.2 (c) 0.3 (d) 25.87 a Which is the closest to -37/4? (a) -32 (b) -55 (c) 0 (d) -3/11 d What is the nearest to 0.1 in 2/3, 1, -2/19, -768, -0.06? -0.06 What is the nearest to -21 in -5/8, 4/47, 0, -0.5? -5/8 What is the closest to 2.7 in 2, -13/103, -5? 2 Which is the closest to -0.13? (a) 5/7 (b) 6 (c) 1/2 (d) 23.62 c Which is the nearest to 36.8? (a) 0.4 (b) -56023 (c) 17 c Which is the closest to -9? (a) -1.78 (b) -2/9 (c) 1.9 (d) -14 d Which is the nearest to 1? (a) 1/2 (b) -103291 (c) 0.1 (d) -0.1 a What is the nearest to 184 in 1, 345, -4? 345 Which is the nearest to -1? (a) -4/5 (b) 0.5 (c) 5 (d) 596 a What is the closest to 99261 in -3, 31, 0? 31 What is the nearest to -1/2 in -0.02, -13/4, 4, -2.81982? -0.02 What is the closest to 0 in -90, 0.4, -0.05, 2, -0.63? -0.05 What is the nearest to 2/5 in 4, -0.7346, -0.7, 1, -1, -0.01? -0.01 Which is the nearest to -0.3? (a) 642 (b) -3 (c) -0.01 (d) 81 (e) 0 c Which is the closest to -1? (a) 1/6 (b) -1078 (c) 5 (d) 87 (e) 0.2 a Which is the closest to 0.178571? (a) -7 (b) 1/125 (c) -2/11 b Which is the closest to -0.5? (a) -2 (b) -324.9 (c) -0.1 (d) 0.2 c What is the nearest to -1617 in -8, 5, 0.5, -0.2, -1/23? -8 What is the closest to 1 in -0.4, 97, -2.5, 10/173? 10/173 What is the nearest to 2/7 in 0.04262, 9, -265? 0.04262 Which is the nearest to -7/32? (a) -3/7 (b) -0.5 (c) 2/3 (d) 14/47 (e) 12 a Which is the closest to -103.924? (a) -2/9 (b) 0 (c) -3435 a What is the closest to 7/45 in -1, 1, 5/11, 0.1, 2/13? 2/13 What is the closest to -7 in -1/15, -0.05, -37? -1/15 What is the nearest to 1/2 in 40, -309.5, -0.03? -0.03 What is the closest to 0 in 4, 836/5, 0.2, 0.0341, -3? 0.0341 Which is the closest to 8/3? (a) 1/4 (b) 236350 (c) 0.3 c What is the nearest to -4 in 302/3165, -0.1, -1? -1 What is the closest to 0.1 in -0.3, 9, -6124, -2/3? -0.3 What is the nearest to 9.8 in -7316, -4/15, 0.04? 0.04 What is the closest to -2/5 in 2/7, -3, -2, 1.3, 18.7? 2/7 What is the nearest to -2 in -1629, 6, 1/2, 3, 4? 1/2 What is the nearest to -2/29 in 2/13, -19977, -0.09? -0.09 Which is the nearest to 0? (a) 0.8 (b) -44 (c) -6/17 c Which is the nearest to -0.2? (a) 1 (b) -276 (c) 3 (d) 2/35 (e) 0.5 (f) -0.11 f Which is the closest to 2? (a) -2/11 (b) -9752 (c) -0.2 (d) 4 (e) -5 (f) -19 d What is the nearest to -10 in -7, 5, 5023, 45? -7 What is the nearest to 99.08 in 2/77, -2/3, -2? 2/77 Which is the closest to -246? (a) -4 (b) 0.2 (c) 2/3 a Which is the closest to 4.6? (a) -5 (b) 0.1015 (c) -17 (d) 0.11 d Which is the closest to 3/4? (a) -8 (b) 0.3 (c) -79 (d) 5/2 (e) -5/4 b What is the nearest to 2.49 in -3, -12.57, -0.009? -0.009 Which is the nearest to -4? (a) 4 (b) 2/29 (c) -1782 b What is the nearest to -2/19 in -0.3, 0.822, -742? -0.3 What is the closest to 11 in -2/9, -1/3, 3/5, 58, -2/135, -0.4? 3/5 Which is the closest to 0? (a) -17815 (b) -433 (c) 1/3 (d) -0.2 (e) 0.5 d What is the nearest to -0.2 in -7, -3, 3/4, 0, 9/19, -18? 0 Which is the closest to -0.1? (a) 2.1 (b) -3 (c) -0.42 (d) 2 (e) -2 c What is the closest to 0 in -4153.16, 1, -2? 1 Which is the closest to -1016? (a) 4 (b) -1061 (c) 10 b Which is the closest to -1? (a) -2/5 (b) 2 (c) -9/19 (d) -9 (e) 11 c Which is the nearest to -47? (a) 0.1 (b) 125 (c) -2430 (d) -2 d What is the closest to -1 in -3589, -0.127, 0.3, 1? -0.127 Which is the closest to -15/2? (a) 134 (b) -0.2 (c) 21/4 b Which is the closest to 81.531? (a) 3/25 (b) -2 (c) 1 c Which is the closest to 7? (a) -9 (b) -408/5 (c) 3/2 (d) -0.3 c What is the closest to 1/2 in -2, 3/7, -3/24821? 3/7 What is the nearest to 1 in 2, 5, 4, -119, 79.91, -5? 2 Which is the closest to 2/375? (a) -1 (b) -0.5 (c) -1/4 (d) -209 (e) 2 c Which is the nearest to 66483? (a) 1/4 (b) -1.3 (c) -3 a What is the nearest to -1/3 in -0.1, 1/2, -2, -2845, 36? -0.1 Which is the closest to -1974? (a) -8 (b) -3/4 (c) 4 a Which is the nearest to -2? (a) -1/7 (b) 1 (c) 5 (d) 181/4 (e) 1/8 a Which is the closest to 3? (a) -0.2 (b) 21 (c) 0.05 (d) -67 (e) -2 c Which is the closest to -1? (a) -2 (b) -0.06 (c) -18 (d) -1/32 (e) -429 b Which is the nearest to -1? (a) 1/8 (b) -4 (c) -2 (d) 1.86 c What is the nearest to 0 in 5, -1076, 2/5, 0.3, 4? 0.3 Which is the closest to 0.02? (a) 22.9 (b) -1.1 (c) -0.09 c What is the closest to -8/17 in 5.15, 4/5, 0.05, -0.1? -0.1 Which is the nearest to 214? (a) 4 (b) 5528 (c) -4 (d) 1 (e) 0.3 (f) 0.4 a Which is the closest to 2/3? (a) 1 (b) 3 (c) 2 (d) -6/7 (e) -1/86 (f) -1/779 a What is the nearest to -2/43 in -5, -97, -1/8, 0.18, 384? -1/8 What is the nearest to -3 in -25/3, 4, -40, -2/19, -2? -2 Which is the nearest to 1/6? (a) -140 (b) -2 (c) 2096 (d) 2 d Which is the nearest to 0? (a) -2/5 (b) -60 (c) 35/6 (d) 2/19 (e) 4 d Which is the closest to -1? (a) 1 (b) 2332 (c) 4 (d) 25.2 a What is the closest to 0.1 in -7, 0.2, -0.07, -1.099, -4/3? 0.2 Which is the closest to 1? (a) 1/22 (b) -948 (c) -69 a Which is the nearest to 2/7? (a) -1135 (b) 17 (c) 5 (d) 2/7 (e) -1/2 d What is the closest to -1/12 in -6, -645, -0.1, 0.5, 2? -0.1 Which is the closest to 0.1? (a) -0.43 (b) 443 (c) -3 (d) 1 (e) 0.5 e Which is the nearest to -2/21? (a) -1.2 (b) -10.9 (c) -12 (d) -7 (e) 7 a Which is the closest to 0.1? (a) 4699 (b) 0.5 (c) 1/12 (d) -2 c What is the closest to 0 in -9, 5, 69, 0.2, 3.53, -2/5? 0.2 Which is the closest to 2/5? (a) 3/7 (b) 0.2 (c) 1/4 (d) 47603/7 (e) 4 a Which is the nearest to 25? (a) -3 (b) 13.459 (c) -0.34 b What is the closest to 0.3 in 2/83, 0.04, 1/5, -3, -0.018? 1/5 Which is the closest to 35/9? (a) -0.2 (b) -1/7 (c) -1/35 (d) 0 (e) -1/14 d What is the nearest to 32 in -0.170923, 2/19, 0.17? 0.17 What is the closest to -1 in 17, -800, 117, -1, 0.1? -1 Which is the closest to -4397? (a) 5 (b) 1.53 (c) 0.16 c What is the closest to 0 in -7, -8/3, 1/2, -296? 1/2 Which is the nearest to -2? (a) -2/5 (b) 35 (c) -19415/2 (d) -2/7 (e) -4/7 e Which is the nearest to -2? (a) 619/2725 (b) -0.2 (c) -5 b Which is the nearest to -0.2? (a) -3.3108 (b) -0.02 (c) -13 b Which is the closest to -2? (a) 1/3 (b) 5 (c) 0.8 (d) -1 (e) 0.3 (f) 16223 d Which is the closest to 0.1? (a) 1 (b) -4 (c) -4/11 (d) 41 (e) -21 c Which is the nearest to -0.7? (a) -4 (b) 0.16 (c) -149 (d) 2/15 (e) 0.05 e What is the closest to 11 in 0.02, 9/7, 6, 1.5, -3? 6 Which is the closest to -1? (a) 1/2 (b) -53/2723 (c) 0.2 (d) 0 b Which is the closest to 1/3? (a) 0.037903 (b) 0.33 (c) -1/3 b Which is the closest to 2/19? (a) 34/5 (b) -4 (c) 1.14 (d) -3 (e) 0.4 (f) -4/7 e What is the nearest to -54 in 2/39, -2, 3, 0.08, -0.042? -2 What is the closest to 1/8 in -21/4, -0.2, -0.0509, 3/8? -0.0509 Which is the closest to -0.1? (a) -5 (b) -15 (c) -275.594 a Which is the nearest to -1/8? (a) 22 (b) -0.1 (c) -0.8 (d) -1/11 (e) -9 (f) -3 b What is the closest to 0 in -31, 435, -0.12? -0.12 Which is the nearest to 1176? (a) 0 (b) -4 (c) -3/7 (d) 1/4 (e) 460 e Which is the nearest to 23? (a) 0.2 (b) 1 (c) -38 (d) 20 d Which is the nearest to 2? (a) -3 (b) 39 (c) 75/4 (d) -0.4 (e) 6/11 e Which is the closest to -0.065? (a) 1/9 (b) 0.07 (c) -0.3 (d) -0.46 (e) -5 (f) 1 b What is the nearest to -5 in -19077, 0.5, -4, -1/3, 19? -4 What is the nearest to 6.5 in -4, 2, 0.088, -5, 2/19? 2 Which is the nearest to 1463? (a) -1/6 (b) -0.211 (c) 5 c Which is the nearest to -2? (a) 1.241 (b) 278 (c) 0.04 c Which is the closest to 0.1? (a) 2 (b) -0.3 (c) 0.071 (d) 2.3988 (e) -2 c Which is the closest to 1? (a) -4 (b) 1653 (c) -65 (d) 1 d What is the nearest to -151 in 1/4, 23, -3, 39/5? -3 Which is the nearest to -398? (a) 3/4 (b) 1/5 (c) -3 (d) -25 (e) -1/2 d Which is the nearest to 2? (a) -0.08 (b) -1.09 (c) 0.0641 (d) 0.4 d What is the closest t	{ "pile_set_name": "DM Mathematics" }
Let f be 26 - s(-3 + 4). Suppose -10t + 540 + 40 = 0. What is the highest common factor of t and f? 29 Suppose -4p = w - 1329, p - 388 + 40 = 5w. What is the highest common factor of p and 37? 37 Let q(l) = -15l + 10l + 6l - 2l*2 + 5l*2. Suppose 4s + 3 = 5s. Let r be q(s). What is the highest common factor of 15 and r? 15 Suppose 387 = 2n - 2s + s, 4n + 2s - 762 = 0. Calculate the greatest common factor of n and 12. 12 Suppose 3o + 11 = 5x, -6o = -o - 15. Suppose -22 = -xc + 2. Let j = 34 - 25. Calculate the highest common divisor of c and j. 3 Let r be 10/(-8)12(-2 - -1). Let a(y) = -y3 + 15y*2 + y - 3. Let g be a(r). Calculate the greatest common factor of 3 and g. 3 Let g be -15 + 16 + -6 + -1. Let l = g - -17. What is the highest common factor of l and 11? 11 Suppose 2x - 5c = 4x - 2, 3x - 3 = 2c. Let o be x2 + (8 - 10) - -72. What is the highest common divisor of 4 and o? 4 Suppose 6 = -4h - a, 5h - 2 = 4h - 2a. Let q(g) = 3g*2 - 5g - 10. Let x be q(h). What is the greatest common divisor of x and 132? 12 Suppose 0 = 9r - 64 - 125. Suppose p = 0, -n - 3p = -6p - r. What is the greatest common factor of n and 231? 21 Let r be 1 - 10/(0 + -5). Suppose 69 + 36 = rp. What is the highest common factor of p and 5? 5 Let u = 8 + 166. What is the highest common divisor of 12 and u? 6 Let u(g) = -g*2 + 4g - 5. Let j be u(4). Let k be ((-8)/(-6))/(j/(-105)). Suppose -31 = -2h - 3. What is the greatest common factor of k and h? 14 Suppose -1148 = -9x - 1067. Calculate the highest common factor of x and 981. 9 Let n = -694 - -710. Calculate the highest common divisor of n and 2240. 16 Suppose -77q = -67q - 200. What is the highest common factor of 10 and q? 10 Let y(g) be the first derivative of g*3 - 15g*2/2 + 45g - 60. Let f be y(5). Suppose 3d - 10 = 35. Calculate the highest common factor of d and f. 15 Let c = 1234 - 554. What is the highest common divisor of 40 and c? 40 Let s = 91 + -97. Let t be (18/(-3))/(s/405). What is the greatest common factor of t and 45? 45 Let h(c) = -8c*2 - c - 3. Let n be h(2). Let t = n - -52. Let a = -100 + 160. Calculate the greatest common factor of t and a. 15 Suppose -53 = -5t + 127. Let a be ((-540)/50 - -9)/((-1)/5). Calculate the greatest common factor of a and t. 9 Suppose -8g + 4g - 4j = -612, 3j + 619 = 4g. What is the highest common divisor of 126 and g? 14 Let o(x) = -8x + 4. Let m be o(-4). Let y = 108 - 96. What is the greatest common divisor of m and y? 12 Let h be -2 + -2 + 2 + -128. Let f be h/13(2 - 3). What is the greatest common divisor of f and 30? 10 Let d = -845 - -958. What is the greatest common factor of 678 and d? 113 Suppose -13y + 8 + 421 = 0. What is the highest common factor of y and 1551? 33 Let r be ((-14)/(-6) - 3)/((-72)/59724). Calculate the highest common divisor of 14 and r. 7 Let l be 348/8128/12. What is the highest common divisor of l and 32? 16 Suppose 17 = -z - 40. Let i = -21 - z. Let r = 60 - i. What is the greatest common divisor of 8 and r? 8 Let p be -34 - (3 + -7 + 4). Let b = 39 + p. Suppose bu - 160 = 50. Calculate the highest common factor of u and 14. 14 Let h(o) = 8o3 + 71 + 4o - 71 - 2o3 - 6o*2. Let u be h(4). Calculate the highest common factor of 38 and u. 38 Suppose v + 26 = -0v. Let h = 65 + v. Suppose x + 4a = -11, h = x - 5a + 5. Calculate the greatest common divisor of x and 63. 9 Let j be (-2)/17 - (11022/17)/(-3). Calculate the greatest common factor of j and 144. 72 Let h = 16 + -14. Suppose l + 3z = -0l + h, 4z = l - 9. Suppose lf - 133 = 497. What is the highest common factor of f and 18? 18 Let w(p) be the first derivative of -9p2 + 4p - 1. Let d be w(-1). Calculate the highest common factor of 132 and d. 22 Suppose 2m - 2 - 8 = 0. Suppose -h - 481 = -4n, 363 = 5n + mh - 207. Suppose -4v - 85 = -9v. What is the highest common divisor of v and n? 17 Suppose -7 = -4a + 9. Suppose -4o + 54 = 2d, -2d + 6d - 88 = -ao. Calculate the greatest common divisor of d and 153. 17 Let l(j) = j - 54. Let g be l(64). Let f be (-402)/(-5) - 6/15. Calculate the highest common divisor of g and f. 10 Let n(o) = -o + 9. Let a be n(0). Suppose 0 = -5q - t + 9, a = -5q + 4t - 2. Let k be 21/14(-32)/(-6). Calculate the highest common divisor of q and k. 1 Let c = -4 - -64. Let v = c - 35. Calculate the greatest common factor of 25 and v. 25 Let j be (4 - 1) + (7 - 49)/(-6). What is the greatest common divisor of 105 and j? 5 Let y(a) = 30a + 75. Let v be y(14). What is the highest common divisor of 297 and v? 99 Let m be 3/(60/(-8))-65. Calculate the greatest common factor of 65 and m. 13 Let p be (-30 - -5) + 7 + -3. Let s = -17 - p. Let l(h) = 8h2. Let n be l(2). What is the greatest common divisor of s and n? 4 Let y = 23 - 19. Let w = -2 + y. Suppose wi - 28 = -2i. Calculate the highest common factor of 56 and i. 7 Let a be (((-336)/7)/2)/(-2). What is the highest common factor of 42 and a? 6 Let t(k) = 100k + 647. Let j be t(-4). Calculate the highest common factor of 39 and j. 13 Let f be -1 + 68 - (0 - -3). Suppose -f = -4b + 4. What is the highest common factor of 119 and b? 17 Suppose 2l + 16 = 6l, -89 = -3u + 4l. Let r be (u/(-14) + 4)/(2/48). Calculate the highest common factor of r and 12. 12 Suppose -2076a = -2084a + 1584. What is the greatest common factor of a and 36? 18 Let k = -92 + 92. Let p be (1 + k)1(-29 - -42). What is the highest common divisor of p and 52? 13 Let t be (-6)/12 + (-3)/2. Let d be (3/(12/8))/(-1)t. Calculate the greatest common divisor of 52 and d. 4 Let m = 540 - 500. What is the highest common divisor of m and 440? 40 Let r be 1 - (-11 + (1 - -3)). Suppose -3c + r = -37. What is the highest common divisor of 90 and c? 15 Let x(s) = -s2 - 44s - 330. Let a be x(-10). Suppose 3j - 12 - 19 = -4r, 3j + 5 = 5r. Calculate the highest common divisor of a and r. 2 Suppose 3p + 144 = 2h, 3h + 3p + 0p - 246 = 0. Let f(j) = j3 - j2 - 56j + 202. Let m be f(4). Calculate the greatest common factor of h and m. 26 Let r(o) = -o*3 + 12o*2 + o - 10. Let h be r(12). Let n be -3(h + -3) - 2. What is the highest common factor of n and 1? 1 Suppose -3x - 2 = 10. Let u be (1 - -2)/(x/132). Let z be (u/12)/(12/(-32)). What is the highest common divisor of 110 and z? 22 Suppose -3h = 3q - 426, -q - h + 139 = h. Suppose c + 32 = q. Suppose -c = -3l - 29. What is the greatest common factor of 70 and l? 14 Suppose -2z + f + 6 = 0, -z - 1 = 5f + 7. Suppose 0 = 3c - c - 216. Suppose zo = -o + c. What is the greatest common divisor of 12 and o? 12 Let s = -3 + -18. Let b be 1 + -2 - 6s/6. What is the highest common factor of b and 8? 4 Suppose 7 = -4q + 3x + 2x, -4q = x - 11. Let l be 63/14(-4)/(-9). Calculate the greatest common divisor of l and q. 2 Suppose -278k - 156 = -281k. What is the greatest common factor of 286 and k? 26 Suppose -4m = -393 - 2447. Calculate the highest common divisor of 10 and m. 10 Suppose -1 = u + 2m, 4m + 20 = -0u + 4u. Suppose -uz + 102 = -0z. Let d = -41 + 92. Calculate the greatest common factor of d and z. 17 Let z be (-4)/(12/(-279)) + (5 - -1). Calculate the highest common factor of 33 and z. 33 Let p = -290 + 292. Calculate the highest common factor of 2 and p. 2 Suppose 3c - j - 15 = 11, -10 = -c + j. Let t(r) = r*2 - 6r + 8. Let l be t(6). What is the greatest common divisor of c and l? 8 Let f(b) = 2b3 - 9b*2 - b - 5. Let i be f(9). Calculate the greatest common divisor of i and 165. 55 Let j be 633/12 + (-8)/(-32). Calculate the highest common factor of j and 318. 53 Let z = -54 - -51. Let x = 20 - z. What is the highest common divisor of x and 92? 23 Suppose 181 = 4b + w, -2b - 2w = 3w - 113. Suppose 4y = b + 24. Let x = y - 14. Calculate the greatest common divisor of x and 3. 3 Suppose 88 = -6a + 352. What is the greatest common divisor of 858 and a? 22 Suppose -558 = 7p - 3p - 3a, 0 = -a + 2. Let h = p + 264. Calculate the greatest common divisor of h and 14. 14 Suppose 5t = 5f - 30, -3f - t + 13 = t. Suppose 2z + z - fh = 59, z + 4h = 48. Calculate the highest common factor of 98 and z. 14 Suppose -17 = -4*w - 1. Suppose 69	{ "pile_set_name": "DM Mathematics" }
6f - 21f*2 - 36f*3 + pf*3 = 0. Calculate f. -2, -1, 0 Determine w, given that -12 - 7w*2 - 202w*2 + 418w*2 - 66w*3 - 200w + 13w3 = 0. -3/53, 2 Suppose -2r = -0r - 5x - 48, -5r - 3x = -151. Suppose -6t = -r + 5. Solve 456 + tw + w - 456 + 5w2 = 0. -1, 0 Let u be -1-733/9. Suppose 10j - 15 = uj. Factor 10s4 + 0s*5 + 18s - 13s - 10s*2 - 5s*j. -5s(s - 1)3(s + 1) Find l, given that 27456l + 5832/7l*3 - 165/7l*4 - 278784/7 + 1/7l*5 + 80924/7l2 = 0. -6, 1, 88 Let h(i) be the third derivative of i5/20 + 63i4/8 - 65i*3 - 29i*2 + 3i. What is r in h(r) = 0? -65, 2 What is u in -1 - 5/3u2 - 7/3u - 1/3u3 = 0? -3, -1 Let t = -30533/21 + 1454. Let m(s) be the second derivative of ts*4 + 0s*2 + 0s*3 + 0 + 3/70s*5 + 6s - 1/147s7 + 0s*6. Factor m(o). -2o*2(o - 2)(o + 1)2/7 Let c(o) be the second derivative of -o8/2016 + o7/1260 + o6/720 - o5/360 + 53o*2/2 + 73o. Let k(g) be the first derivative of c(g). Factor k(i). -i*2(i - 1)*2(i + 1)/6 Suppose 684023 + 1873997 - 8070z - 481139 + 57z*2 + 1179364 - 52z*2 = 0. Calculate z. 807 Let g = 474 - 459. Suppose 16z = 11z + g. Factor -55/6a - 5a2 - 5/6a*z - 5. -5(a + 1)(a + 2)(a + 3)/6 Suppose -4r - 10 = 2v, -4v + 12 = -2r - 8. Let g(j) be the third derivative of 0j + 0 - 3/10j*v - 16/75j*5 - 2/5j*4 + 7j*2. Factor g(c). -(8c + 3)*2/5 Let z(n) = -2n*3 + 190n*2 + 140n - 196. Let y(w) = 6w3 - 572w*2 - 397w + 589. Let a(m) = -6y(m) - 17z(m). Factor a(p). -2(p - 101)(p - 1)(p + 1) Let v(k) be the first derivative of -k6/18 + 2k*5/5 - 3k*4/4 + 4k*3/9 + 3667. Solve v(f) = 0. 0, 1, 4 Let n(f) be the second derivative of 3f*5/5 + 14f*4/3 + 16f*3/3 + 1677f. Solve n(d) = 0 for d. -4, -2/3, 0 Let u be (-38 + 19448/510)250/8. Factor -u - 1/6n*3 - 35/6n - 11/6n2. -(n + 1)(n + 5)*2/6 Find w, given that 12 - 1/4w*5 + 13/4w*4 + 139/4w*2 - 34w - 63/4w3 = 0. 1, 3, 4 Determine g so that -34/7g + 32/7g3 + 27/7g*4 + 2/7g*5 + 24/7 - 51/7g*2 = 0. -12, -2, -1, 1/2, 1 Solve 9203n + 11304n3 - 8912n + 28n4 - 14826n + 7996n2 + 6448 - 11241n = 0. -403, -2, 2/7, 1 Let i(c) be the first derivative of 5c3/3 + 190c*2 - 1600c - 5442. Factor i(k). 5(k - 4)(k + 80) Let v(d) be the third derivative of -d*5/30 + 605d*4/3 + 807d*3 - 11525d2. Let v(u) = 0. What is u? -1, 2421 Let c(p) be the third derivative of -p8/1680 - p*7/210 + 3p*6/200 + 13p*5/300 - 7p*4/30 + 2p*3/5 - 5918p2. Factor c(j). -(j - 1)3(j + 2)(j + 6)/5 Determine p, given that -734p + 1004p + 75p2 + 200 + 5p*3 + 0 = 0. -10, -4, -1 Let u be 629/185 - (-1 + (-14)/(-10)). Suppose ui - b - 5 = -0, -2i = 4b - 8. Factor 7p + ip*2 - 100 - 47p - 6p2. -4(p + 5)*2 Let a(r) be the first derivative of 75/7r*3 - 5625/14r*2 + 46875/7r - 6 - 3/28r4. Suppose a(n) = 0. What is n? 25 Find a, given that -31a*3 + 6a*3 - 80a*2 - 96a + 114a5 - 9a*4 + 65a*3 + 29a*4 - 118a*5 = 0. -2, -1, 0, 2, 6 Let t = -4 + 61. Suppose t = 4z + 3x, 23 = -5z - 4x + 95. Solve 19 - 5 + 2 + zq*2 - 4q*4 + 32q - 8q3 = 0. -2, -1, 2 Let m(d) be the second derivative of -d6/90 + 7d*5/20 - 2d*4 - 24d*3 + 2d - 91. Determine v, given that m(v) = 0. -3, 0, 12 Let o(l) be the third derivative of 19683/5l3 + 1/100l*6 + 0l + 2187/20l4 + 81/50l*5 + 0 + 25l2. Solve o(p) = 0 for p. -27 Let u(z) be the first derivative of z4/26 + 12z3/13 + 81z2/13 + 891. Determine w, given that u(w) = 0. -9, 0 Let n(d) be the third derivative of d7/6300 + d*6/200 + 2d*5/75 - 7d*4/3 + 2d*2 - 3d. Let p(m) be the second derivative of n(m). Solve p(c) = 0 for c. -8, -1 Let v(o) = -2o3 + 14o*2 - 5o - 45. Let i be v(6). Let b be -8 + 4 + i - -9. Find y, given that -64/5y - 2/5yb - 512/5 = 0. -16 Let o(w) be the third derivative of w7/84 + w6/20 + w5/20 - w*4/12 - 185w3/6 - w2 + 35. Let y(l) be the first derivative of o(l). Factor y(t). 2(t + 1)2(5t - 1) Let d(h) be the second derivative of -5h*3/6 - 3h*2/2 + 24h. Let l be d(-2). Factor -lg2 + 8g*2 + 20g - 6g2. -5g(g - 4) Let z be 8 - 2/(12/30). Determine d so that -50d*2 - 4d*4 - 121d*2 + 91d*2 - 48d - 36dz = 0. -6, -2, -1, 0 Let d(k) be the third derivative of k8/2016 - 9k*7/140 + 77k*6/720 + 241k*5/360 - 13k*4/24 - 40k*3/9 - 4866k*2. Suppose d(u) = 0. Calculate u. -1, 1, 2, 80 Let w = -83793 + 83795. Solve -2/9 - 2/9a*w - 4/9a = 0 for a. -1 Let j(k) be the first derivative of k*6/600 - 13k*5/100 + 49k3/3 + 6. Let a(q) be the third derivative of j(q). Suppose a(b) = 0. Calculate b. 0, 26 Let k(j) be the second derivative of j4/14 + 2066j3/7 + 3201267j*2/7 - 2171j - 2. Factor k(i). 6(i + 1033)2/7 Let l(j) = j3 + 108j*2 - 243j + 130. Let v(m) = -3m2 + 2. Let b(z) = l(z) - 4v(z). Factor b(k). (k - 1)*2(k + 122) Let j(i) be the second derivative of i*4/12 + 5i*3/2 - 8i*2 + i + 25. Let b be j(-16). Factor b - 6/11t - 2/11t2. -2t(t + 3)/11 Factor 69y*4 + 441 + 570y*3 + 1450y*2 - 141206y*5 + 1365y - 24y4 + 141207y5. (y + 1)3(y + 21)2 Suppose 3o + 3b + 11 = 32, -3o - 19 = -5b. Factor -6q*2 - 38q - 42q + 2q*o + 60q. -4q(q + 5) Solve 16y - 56y*3 + 2y*4 - 2384y*2 + 2382y*2 + 40y + 0y4 = 0. -1, 0, 1, 28 Let s(x) = 11x*3 + 879x*2 + 39588x + 38714. Let r(d) = -12d3 - 878d*2 - 39586d - 38713. Let m(c) = 6r(c) + 7s(c). Factor m(o). 5(o + 1)(o + 88)*2 Let d = 20 - 17. Let p be ((-6)/5)/(d/(-5)). What is s in 7s*4 + 3s*4 - 35s*5 - 10s*p + 40s*5 - 5s = 0? -1, 0, 1 Let m be ((24/20)/3)/((-1089)/165 - -8). Suppose -4 = -5w - 2z, -3z - 6 - 13 = -5w. Factor k*3 + 12/7k*w - m + 3/7k. (k + 1)*2(7k - 2)/7 Let p be 2461/69 - (10 + 21). What is i in 2i + 0 + pi2 + 10/3i*3 + 2/3i4 = 0? -3, -1, 0 Let l(z) be the second derivative of z4/4 + 305z3/2 - 230z - 3. Factor l(h). 3h(h + 305) Let d(q) be the third derivative of q*5/60 - 59q*4/6 - 79q*3/2 + 1001q*2. Solve d(k) = 0 for k. -1, 237 Let y = -6859 - -6861. Let m(g) be the first derivative of -2/9g*3 - 7 + 4/3g*y - 8/3g. Solve m(p) = 0 for p. 2 Let a(q) = 5q4 + q2 + q + 1. Let i(u) = -8u*4 + 28u*3 + 126u*2 + 226u + 124. Let d(k) = 2a(k) + i(k). Determine w, given that d(w) = 0. -7, -3, -1 Let v(c) be the third derivative of c11/665280 + c10/151200 + c9/120960 + 7c5/15 + c2 - 28. Let q(s) be the third derivative of v(s). Factor q(j). j*3(j + 1)*2/2 Let q(n) be the second derivative of 0 - 4/21n*7 + 5/4n*5 - 105n + 5/12n4 - 7/30n*6 - 17/6n3 + n2. Solve q(k) = 0 for k. -2, -1, 1/8, 1 Suppose 1206 = -6u + 1446. Suppose -3p + u = 37. Find t, given that -2t + 1/4t*5 - p - 1/4t*2 + 5/4t*4 + 7/4t*3 = 0. -2, -1, 1 Let f be (-18)/8 - 273/(-26). Determine t so that 0 + ft*4 - 3t - 105/4t3 + 21t*2 = 0. 0, 2/11, 1, 2 Let l(i) be the second derivative of -1/15i*5 + 7i + 16/3i2 + 1 + 8/9i*3 - 2/3i*4 + 2/45i*6. Factor l(o). 4(o - 2)*2(o + 1)(o + 2)/3 Let q(g) be the second derivative of 0 + 34g*3 - 1/15g*6 + 45g*2 + 164g + 34/3g4 + g5. Factor q(u). -2(u - 15)(u + 1)2(u + 3) Let u(l) be the second derivative of l*6/120 + 81l*5/20 - 979l*4/48 + 109l*3/4 - 8621l. Solve u(x) = 0. -327, 0, 1, 2 Factor 100/3m2 - 800/3m + 2000/3 - 4/3m3. -4(m - 10)*2(m - 5)/3 Determine u so that 13u3 + 220u*2 - 39u + 2u4 - 67u*3 + 12u + 27u = 0. 0, 5, 22 Let l be (-20)/(-9) - (-18)/(-81). Let h be ((-6)/(-2) + -3)/l. Factor 0 - 1/8q*5 + 0q + hq4 + 3/8q*3 - 1/4q2. -q2(q - 1)2(q + 2)/8 Let a(q) be the first derivative of q3/3 - q2 - 2q - 2. Let r(o) = -7 - 7o2 + 5 - 2 + o2 + 8o2 - 5o. Let j(m) = 7a(m) - 3r(m). Factor j(d). (d - 1)(d + 2) Let h(y) be the second derivative of -11y*5/40 - 35y*4/24 + 7y*3/12 + 39y*2/4 - 3y + 1. Factor h(r). -(r - 1)(r + 3)(11r + 13)/2 Let c(a) be the second derivative of -5a*4/36 + 1990a*3/9 - 396010a*2/3 + 1151a. Factor c(p). -5(p - 398)*2/3 Let p(l) be the first derivat	{ "pile_set_name": "DM Mathematics" }
Suppose 4s - s + 2l + 29 = 0, 40 = -4s - 3l. Let z(c) = -c*3 - 8c*2 - 6c + 6. Let y be z(s). Which is bigger: r or y? y Let s be ((-2)/8)/((-3)/444). Suppose 3m = -5w + s, -8 = -2w + 2. Is m greater than or equal to 7? False Let c be (-4 - (-5 - -1))/((-2)/(-2)). Let b be (1 - 10/5)c. Let m be (-14)/(-30) - 4/6. Is m less than or equal to b? True Suppose -4x = 4 + 28. Is x != -9? True Let w = -54 + 29. Let p = w + 40. Suppose -p = -3z - 3. Is z at most as big as 4? True Let z = -319.561 - -321. Let t = -0.061 - z. Which is bigger: 0.2 or t? 0.2 Suppose 9a + 35a + 44 = 0. Is 3/218 < a? False Let t be 28/4 + (-6 - -3). Suppose ty + 15 = -21. Let b be 2/y + (-10)/(-45). Are -3/14 and b unequal? True Suppose 0 = -4y + 23 + 113. Let l = y + 4. Let z = 60 - l. Do z and 23 have different values? True Let l = -1382.99 - -1389. Let r = 0.4 + -6.4. Let p = l + r. Is p <= -0.2? False Let j be (-1)/((-141)/(-176)) + (-164)/(-123). Which is smaller: j or 0? 0 Let f = -240 + 323. Which is bigger: f or 86? 86 Suppose 24 = -30p + 33p. Suppose 7a - 3a + 5c = 29, -3a - c + p = 0. Are a and 1/33 nonequal? True Let a be ((1 - -2) + -7)60/(-345). Which is greater: 0 or a? a Let q(w) = 14w*3 + 4w*2 + 4w + 14. Let o be q(-3). Is -340 < o? False Let l = 169 - 161. Are 3/2 and l non-equal? True Let f(v) = -57v2 + 2v + 1. Let c be f(-1). Let p = 100 + c. Let j be (4/p)/(8/(-24)). Which is greater: j or -8/9? j Let x = -1538 - -1538. Let k be (2/(-124))/(1/(-12)). Is x at most k? True Suppose -n + 3k = 165, 5n + 6k = k - 805. Let o = n - -490/3. Let r = 175/3 - 59. Which is bigger: o or r? o Let q = -14 + 13. Let g be (-1 - q - -1)-1. Which is bigger: 3/7 or g? 3/7 Let c = 0.111 + -1.511. Which is greater: c or -7? c Suppose -b = -5v + 3v + 14, 5b = -3v + 34. Suppose i = 3s - i + 7, 4s = 4i - v. Let f = s - 3. Which is greater: f or 1? 1 Suppose 0 = 40j - 395 + 75. Is j less than or equal to 14? True Let o(w) be the second derivative of -w*4/12 + 4w*3/3 - 6w*2 + 2w - 1. Let r be o(6). Which is greater: r or 2? 2 Suppose 82 = -5z - 178. Which is greater: -53 or z? z Suppose -5q = -5f, 4q = 2f - q. Let g = 1.6 + -4.9. Which is smaller: f or g? g Let j be 10/(-18)(-444)/(-370). Is j smaller than 2/217? True Let g = 5.153 - 0.153. Is g >= -22? True Let b be (-2 + (-78)/51)/(-2). Let r = b - 175/51. Is r > -1? False Let m be 5 - (807814/11543)/14. Is 0 > m? False Suppose -2w + 148 = -l, 58 = 2w - 3l - 90. Is 74 at least w? True Let s = 7168 + -7168.2. Let v = -0.5 + 1.2. Let c = v + -5.7. Is c less than or equal to s? True Suppose 2w - 5b + 17 = 0, -13 = 36w - 38w - 5b. Are w and -20/43 non-equal? True Let s be 92/6(76/8 - 11). Is -24 >= s? False Let x be 5 + 0 + (-3 - -1). Let w be x + (-35 + -1)/4. Let k be (-6)/9w/(-4). Are -5 and k unequal? True Let p = -22 - 123. Do p and -147 have the same value? False Let v = 15111 - 15790993/1045. Which is smaller: v or -1? -1 Let q = -789 + 386. Is q smaller than -403? False Let j(o) = -2o3 + 4o*2 + o + 17. Let h be j(8). Let c = 1459/2 + h. Is c greater than or equal to -13? False Let v(h) = 8h - 105. Let z be v(13). Are z and -4/17 unequal? True Let q be 6/15 - 792/(-45). Suppose 0 = -37l + 34l + q. Let o be 66/10 - (-4)/10. Is l >= o? False Let q be ((-111)/2)/(((-36)/(-8))/9). Is -109 >= q? True Let j(a) = 25a - 484. Let u be j(-6). Is u at least as big as -635? True Let x be -19/684-5. Is x less than or equal to -1? False Let s = -2240 - -71683/32. Which is greater: s or 5? 5 Let d = 10 - 16. Suppose 0 = -5h - 3p + 8p, 4h = p - 3. Let y be ((-1)/h)/(5/(-45)). Is d bigger than y? True Suppose -69i = -65i + 412. Is i less than -106? False Let p = 1 - 43. Let g = p - -45. Does g = 0? False Suppose -5w + w = 0. Suppose -4q - 81 = 5t, 5q = 3t - 0t + 19. Let v = t - -53/4. Which is greater: w or v? v Let l be (2 + -2)/(-22/2). Is l >= -4/31? True Suppose 15z - 17z - 40 = 0. Let r = z + 26. Suppose 5t = rt. Which is smaller: t or -2/45? -2/45 Let b be (-1)/(-13/15). Suppose -3 + 0 = 2s + 3p, bs = 2p + 21. Let z be (0(-1)/s)/(-2). Which is greater: z or -1? z Let h = 16 + 22. Let o = 37 - h. Let d be (-8)/31010/4. Which is smaller: o or d? o Let f be -1 - (-2 + (-33)/(-15)). Let c(j) = -j3 + 11j*2 - j - 6. Let i be c(11). Let w = -17 - i. Is f less than or equal to w? True Let h(t) = t + 41. Let g be h(0). Let y be (4/g)/(10 + -12). Which is greater: y or -1? y Let l be 5/20 - 447/12. Which is smaller: -36 or l? l Let m be (2/24)/((-690)/(-120)). Which is smaller: 1 or m? m Let y = -0.049 - -2.949. Let l = -0.9 + y. Let i = 9.1 - 9. Which is greater: i or l? l Let f = -1.5 + 2. Let x = 57 + -57.74. Let q = 0.84 + x. Is f smaller than q? False Let p be (1/(0 - -1))/(7/210). Is 3 at most p? True Let h = -286 + 563/2. Suppose 0 = -b + 5s + 17, -b = -0b + 2s + 18. Let v = -13 - b. Is h at least v? True Let w = 3.1 + -0.1. Let t = 12 - 16. Which is smaller: t or w? t Let r be 2 + (-427)/(-140) - 5. Which is greater: 1 or r? 1 Let x(l) be the second derivative of 1/20l5 + 0l*2 + 2/3l*3 + 0 - l + 1/3l*4. Let a be x(-4). Are a and -0.1 non-equal? True Let i = 1.6 + -18.6. Let p = 12 - i. Let x = 28.9 - p. Which is smaller: 2 or x? x Let w = 865 - 862. Is w at most -1/61? False Suppose -2y + 6y - 64 = 0. Suppose y = q + 4d, -6d = 5q - 2d - 32. Let t be 4/6 + q/(-6). Is t at least as big as 1/6? False Suppose 2k = 3h + 2, h + 0k = -k - 4. Which is bigger: -51/62 or h? -51/62 Suppose -4d + 8 = 4n - 0n, 0 = d - 2. Let g = 11/106 - -51/530. Which is bigger: g or n? g Let x be 10/(-20) - 26/(-4). Let j = 61 - 54. Does x = j? False Let x = 1317/580 - 3/145. Let c = -43 - -49. Let f be ((24/(-21))/4)/(c/(-42)). Do x and f have the same value? False Let s = 1335 - 1336. Is 2/651 != s? True Let u = -5 + 21. Suppose 0j = 4j - u. Suppose y + 2y = -jx - 1, 3y = -5x + 1. Does y = -3? True Let h = 1639/2 + -3328813/4062. Which is smaller: 1 or h? h Suppose 0 = 7t - 2t - 60. Let c(a) = -13a + 114. Let l be c(8). Is l less than or equal to t? True Let i be (-3 + -1)5/(-11 - -6). Let c be (i/1604)/(15/6). Which is smaller: c or -1? -1 Let a be ((-6)/8)/(7/(-56)). Let j be (-3)/a21. Let u be (-3)/1 - (-78)/27. Which is bigger: j or u? u Let q(z) = -2z2 + 4. Let u be q(2). Let o = u + 9. Which is smaller: 0.2 or o? 0.2 Let o = 65 - 66.24. Let u = o - 0.26. Is 2 at least as big as u? True Suppose 0 = -3b - 405 + 402. Let a = 544 + -10340/19. Which is bigger: a or b? a Suppose 0 = 10t + 21t. Let i = -41 + 13. Which is greater: t or i? t Let f = 0.6 + -1. Let k = -3 + -12. Let j = k + 13. Is f at most j? False Suppose 2x - 6 = -x. Suppose 0 = -3f - t + 16, 5t - 3t = 8. Suppose -3c - x = -fc. Is c at most as big as 10/11? False Let f(s) = -12s + 16. Let g be f(11). Let m be (-3)/(-5) + g/(-15) + 0. Which is greater: 7 or m? m Let m(u) = 3u*3 - 39u*2 + 19u + 100. Let x(t) = -t*3 + 13t*2 - 6t - 33. Let a(h) = 3m(h) + 8x(h). Let o be a(12). Let q be 2/(-7) + 24/133. Is q < o? True Let i = 128 + -125. Let o be (-20)/i((-22)/(-4) - 5). Is -3 less than o? False Let z = -3013 - -21127/7. Which is greater: 4 or z? z Let i(f) = f3 + 7f*2 + 2f - 22. Let s be i(-6). Suppose -3 = 3y + sd - 1, 2y - 4 = -4d. Suppose -c + 5 = -6c. Is c bigger than y? True Suppose 4223r = 4219r - 456. Which is bigger: -4 or r? -4 Suppose -g - 4g + 60 = 0. Let y be g/(-54) - (-2)/9. Suppose -8x + 13x = y. Is -2 greater than or equal to x? False Let r be (1 - -2) + 8/(-2). Let n be (-42)/(-45) - r/(-3). Let y be (-2)/5 + 6/15. Are n and y non-equal? True Let z = -3.3 - -1.4. Let f = z + 2. Let w = 1.43113 - -0.06887. Which is smaller: w or f? f Let m = -36 - -27. Let r(b) = b*2 + 14b + 21. Let f be r(m). Which is smaller: f or -23? f Let u be (-20)/(-90) - 1580/(-18). Suppose -2l + u = l - 4a, 56 = 2l - 4a. Suppose 7n = -n - l. Is -1 > n? True Let r = -216.06 - -216. Is 28 greater than or equal to r? True Let z = 12.5 + -123.5. Let i = z + 111.88. Is -0.1 != i? True Let s = 43 - 40. Let r be s + 532/(-108) - -2. Which is smaller: -1 or r? -1 Let i = 32 - 75. Let u = i - -43.1. Let j(g) = -g3 - g*2 - g + 1.	{ "pile_set_name": "DM Mathematics" }
ided by a. 0 Suppose -2l + 60 = l. Suppose -2t + 6t - l = 0. Calculate the remainder when t is divided by 2. 1 Let p = 22 - 15. Let l(z) = 2z - 8. What is the remainder when l(p) is divided by 4? 2 Let x = 18 - 4. Let m = -78 + 203. Suppose -o - 4o = -m. What is the remainder when o is divided by x? 11 Let v(y) = y3 + 4y*2 - 2y + 2. Let h be v(-3). Let q be (-1 + h)/(2/4). Let t = q - 20. What is the remainder when 35 is divided by t? 11 Let c(h) = 12h - 4. What is the remainder when c(3) is divided by 17? 15 Let f(h) = h3 + 13h*2 - 17h + 17. Calculate the remainder when f(-14) is divided by 20. 19 Suppose 112 = 4v - 88. Let o be (-3 - 0)/(-3)-16. What is the remainder when v is divided by (-1 + o)(-2 - -1)? 16 Suppose -42 = -5n + 2n. Calculate the remainder when 69 is divided by n. 13 Calculate the remainder when 21 is divided by 82(-7)/(-14). 5 Let r = 154 - 99. Calculate the remainder when r is divided by 28. 27 Let d = -119 - -134. Calculate the remainder when 69 is divided by d. 9 Suppose -9g + 4g = 3h - 82, -5h - 22 = -3g. Let k(y) = -8y - 42. Calculate the remainder when k(-12) is divided by g. 12 Suppose 14 = 3k + o, 6 = -5k - o + 28. Suppose z = -ki + 13, -i - 4i + 5 = 0. What is the remainder when 17 is divided by z? 8 Let n(i) = -i3 + 4i*2 + 5i - 12. Let t be n(5). Let u = 30 + t. What is the remainder when 32 is divided by u? 14 Let b = 48 - 38. Calculate the remainder when 27 is divided by b. 7 Let z(u) = -u*3 + 14u*2 - 12u - 1. What is the remainder when 22 is divided by z(13)? 10 Let y(k) = 9k + 18. What is the remainder when y(9) is divided by 35? 29 Suppose -27 = -3v + 162. What is the remainder when v is divided by 11? 8 Suppose 34 - 12 = t + 5n, 0 = 3t + 5n - 96. Suppose -4f + 4 = 0, -f - 18 = -4c + t. Calculate the remainder when 39 is divided by c. 11 What is the remainder when 34 is divided by 9/4(-48)/(-9)? 10 Suppose 3s + 2b - 180 = 0, 3s + s - 2b - 254 = 0. What is the remainder when s is divided by 13? 10 Let j(w) = 9w + 2. Let o be j(2). Suppose 4n + 4x = -0n + o, -10 = -2n - x. Calculate the remainder when 7 is divided by n. 2 Suppose 2f - 184 = -g - 3g, 2g - 2f - 98 = 0. Calculate the remainder when g is divided by 12. 11 Suppose 0u + 5u = 0. Suppose -s + us + 49 = 0. Calculate the remainder when s is divided by (-5 + 22)(0 + 1). 15 Let g = -41 - -68. Let q(n) = -2n*2 + 2n + 10. Calculate the remainder when g is divided by q(0). 7 Suppose 2j = -j + 30. Let s = j + -6. Suppose -3r + 114 = -4q, r - 195 = -sr + 5q. Calculate the remainder when r is divided by 11. 9 Suppose 2a - 7a - 45 = 0. Let m(s) = 7 + 9 - s - 15. Calculate the remainder when 19 is divided by m(a). 9 Let b = 84 - 68. What is the remainder when 159 is divided by b? 15 Let m = 28 - 42. Let n = m + 48. What is the remainder when n is divided by 12(-3 - -2)-1? 10 Let u(b) = -2b*2 - 2b*2 + 133 + 3b*2. Let k be u(0). Suppose 0 = 4y - k + 53. What is the remainder when 38 is divided by y? 18 Suppose -2f = -w - 0w + 34, 0 = -f - 5. What is the remainder when 44 is divided by w? 20 Let i = 4 - 1. Calculate the remainder when i/9(-45)/(-3) is divided by 2. 1 Let g(i) = 7i2 - i - 2. Calculate the remainder when g(-2) is divided by 1/4 - 351/(-36). 8 Let g = -62 - -75. Calculate the remainder when 23 is divided by g. 10 Let i be (1/(-2))/((-5)/70). Let h = i + -1. Calculate the remainder when 10 is divided by h. 4 Let y(m) = -m3 + 6m2 + m + 1. Let k(g) = g2 - 12g + 12. Let u(x) = -x + 6. Let w be u(-6). What is the remainder when k(w) is divided by y(6)? 5 Let s(c) = -12c + 7. Calculate the remainder when 53 is divided by s(-1). 15 Let b(o) = o3 + 5o*2 - 8o - 3. Suppose 4f - 76 = 24. What is the remainder when f is divided by b(-6)? 7 Let d be (12/(-8))/((-2)/4). Let w(l) = 3l - 4. Calculate the remainder when w(d) is divided by 2. 1 Suppose 9w - 4w - 210 = 0. Calculate the remainder when w is divided by 11. 9 Let v = -9 + 15. What is the remainder when v is divided by 3? 0 Suppose -4m + 13 = 5l - 31, 0 = m - l - 2. Calculate the remainder when 30 + m(-2)/4 is divided by 15. 12 Suppose 5w + 45 + 90 = 0. Let t = -13 - w. What is the remainder when 39 is divided by t? 11 Let u be (-8)/12(-16 - -1). Suppose 4x - 42 = -u. What is the remainder when 21 is divided by x? 5 Let i(n) = -n*3 - 6n*2 - n + 6. Let k be i(-7). Let u = -44 + k. What is the remainder when u is divided by 7? 4 Suppose -3 = 7m - 8m. What is the remainder when 13 is divided by m? 1 Suppose -3q - 5n + 21 = 0, 5q - n = 35 - 0. What is the remainder when 25 is divided by q? 4 Suppose 2o + 2o = 5w + 257, o - 38 = -4w. Calculate the remainder when 107 is divided by o. 49 Let i = 23 + -9. Calculate the remainder when i is divided by 5. 4 Let q = 51 + -19. Let t be (-4)/6 - 740/(-12). Suppose -4j + t = 17. Calculate the remainder when q is divided by j. 10 Suppose 20 = 5t - 0. Let d = 7 + t. What is the remainder when 20 is divided by d? 9 Let l be (-1)/(-3) - (-1)/(-3). Suppose -3d + 81 = -ld. Suppose -17 = -2m + 11. Calculate the remainder when d is divided by m. 13 Let u(o) = -2o + 8. Let v be u(5). Calculate the remainder when v - (3 - (0 + 37)) is divided by 7. 4 Suppose -2b = 10, -2n + 4b = 3n - 70. Let w be 29/(-5) - 1/5. Calculate the remainder when 2 + 25 + w/(-3) is divided by n. 9 Let m = 15 + 5. Let c be (-2)/(-3) + m/6. Suppose 5n - 4z - 28 = 2n, 5z + c = -4n. Calculate the remainder when n is divided by 2. 0 What is the remainder when 45 is divided by ((-54)/(-8))/(108/32 + -3)? 9 Let x be (-12)/(-2)4/3. Let b(d) = -d*2 + 6d + 6. Let p be b(x). What is the remainder when 84/((-16)/p) is divided by 7? 6 Suppose -2p - 130 = -164. What is the remainder when 100 is divided by p? 15 Suppose -2l + 160 = 2l. Let r = l + -17. Let v = r + -6. What is the remainder when v is divided by 9? 8 Let b(k) = -k + 0 - k - 5. Suppose 2d + 9 + 1 = 0. Calculate the remainder when b(d) is divided by 3. 2 Let n(h) = -2h*2 + 2h + 18. What is the remainder when n(0) is divided by 7? 4 Suppose 5o - 109 = -14. Suppose c - 40 = -0c. Suppose -x = -5q - o, -4x - q = -3q - c. Calculate the remainder when 26 is divided by x. 8 Let m = -19 - -31. Let p be (-1180)/(-6)6/(-5). Calculate the remainder when p/(-7) + 4/14 is divided by m. 10 Let x be (-416)/(-14) - (-2)/7. Suppose 2t - 42 - 24 = -4v, -v + 4t + x = 0. What is the remainder when 70 is divided by v? 16 Suppose -4v - v - 4f = -45, -25 = -5f. Suppose -5 = -c - 3c - u, -vu - 13 = c. Calculate the remainder when 2 is divided by c. 0 Let b(n) = 8n - 7. Let u be b(10). Let r = 118 - u. What is the remainder when r is divided by 12? 9 Let l(y) = y + 14. Calculate the remainder when 13 is divided by l(-10). 1 Suppose 0 = 5q - 5o + o - 73, -3q + 42 = -3o. What is the remainder when q is divided by 10? 7 Suppose -3x - 2i = -55, 0 = x - 2i - 3i - 41. What is the remainder when 66/132 - 322/(-4) is divided by x? 18 Suppose -3p = -4p + 2. Calculate the remainder when 5 is divided by p. 1 Suppose 8b - 16b + 48 = 0. Calculate the remainder when 125 is divided by b. 5 Suppose -4d + 6d - 310 = 0. Calculate the remainder when d is divided by 39. 38 Suppose 0 = 12i - 13i + 54. What is the remainder when i is divided by 19? 16 What is the remainder when -5 + (-456)/(2 - 8) is divided by 8? 7 Suppose -3p + 49 = -98. Let r = 16 + -3. Calculate the remainder when p is divided by r. 10 Let s = -87 + 121. What is the remainder when s is divided by 9? 7 Suppose 3g = 2x + 4g - 25, x - 5g = -4. Suppose 4d + x + 12 = 5h, -4h = d - 31. Suppose a + 3a = 76. What is the remainder when a is divided by h? 5 Suppose -5n + 1 = -3r, 0 = -7n + 2n - 2r + 16. Let a = 2 + n. Calculate the remainder when 15 is divided by a. 3 Let g = -87 + 113. Calculate the remainder when 102 - (-2)/2-1 is divided by g. 23 Suppose 6c = 7c - 23. Suppose -3p + 15 = 0, -61 + 250 = 3v - 3p. Calculate the remainder when v is divided by c. 22 Suppose 3o + 2l - 29 = 0, -4o + 72 = -6l + 2l. Let k be 1/(-2) - (-33)/(-6). Let g(t) = -3t + 6. What is the remainder when g(k) is divided by o? 11 Suppose 3r - r = 94. Wh	{ "pile_set_name": "DM Mathematics" }
er? 151 What is 3320825 to the power of 1/2, to the nearest integer? 1822 What is the seventh root of 15988743 to the nearest integer? 11 What is the fourth root of 4040455 to the nearest integer? 45 What is the cube root of 579324 to the nearest integer? 83 What is the cube root of 580577 to the nearest integer? 83 What is 3951069 to the power of 1/2, to the nearest integer? 1988 What is 129985 to the power of 1/7, to the nearest integer? 5 What is the seventh root of 13345689 to the nearest integer? 10 What is the cube root of 2231947 to the nearest integer? 131 What is the eighth root of 622200 to the nearest integer? 5 What is the square root of 755722 to the nearest integer? 869 What is the ninth root of 5785523 to the nearest integer? 6 What is the square root of 3894558 to the nearest integer? 1973 What is 345878 to the power of 1/2, to the nearest integer? 588 What is the cube root of 968784 to the nearest integer? 99 What is the sixth root of 103795 to the nearest integer? 7 What is the sixth root of 3372510 to the nearest integer? 12 What is the fifth root of 9658832 to the nearest integer? 25 What is the square root of 2579007 to the nearest integer? 1606 What is 456434 to the power of 1/3, to the nearest integer? 77 What is 1575355 to the power of 1/3, to the nearest integer? 116 What is the third root of 7599523 to the nearest integer? 197 What is the cube root of 5556534 to the nearest integer? 177 What is the fifth root of 1333208 to the nearest integer? 17 What is 19910063 to the power of 1/4, to the nearest integer? 67 What is the cube root of 13900246 to the nearest integer? 240 What is the third root of 11324048 to the nearest integer? 225 What is the fourth root of 3573267 to the nearest integer? 43 What is the third root of 5179346 to the nearest integer? 173 What is the cube root of 15299 to the nearest integer? 25 What is 783074 to the power of 1/2, to the nearest integer? 885 What is the fifth root of 36391 to the nearest integer? 8 What is the cube root of 434267 to the nearest integer? 76 What is the ninth root of 160326 to the nearest integer? 4 What is the square root of 15331176 to the nearest integer? 3916 What is the fifth root of 1177537 to the nearest integer? 16 What is 296422 to the power of 1/3, to the nearest integer? 67 What is the square root of 4369742 to the nearest integer? 2090 What is 142325 to the power of 1/6, to the nearest integer? 7 What is 376267 to the power of 1/7, to the nearest integer? 6 What is 855958 to the power of 1/5, to the nearest integer? 15 What is the third root of 171876 to the nearest integer? 56 What is 191678 to the power of 1/9, to the nearest integer? 4 What is 3448159 to the power of 1/4, to the nearest integer? 43 What is 734411 to the power of 1/9, to the nearest integer? 4 What is 72262 to the power of 1/9, to the nearest integer? 3 What is the tenth root of 6524897 to the nearest integer? 5 What is the cube root of 18938185 to the nearest integer? 267 What is the third root of 34653245 to the nearest integer? 326 What is 379820 to the power of 1/2, to the nearest integer? 616 What is the cube root of 9133632 to the nearest integer? 209 What is the third root of 17065190 to the nearest integer? 257 What is the third root of 733989 to the nearest integer? 90 What is the eighth root of 305289 to the nearest integer? 5 What is 9500972 to the power of 1/3, to the nearest integer? 212 What is 100918 to the power of 1/2, to the nearest integer? 318 What is the tenth root of 6571686 to the nearest integer? 5 What is the square root of 277008 to the nearest integer? 526 What is 358280 to the power of 1/2, to the nearest integer? 599 What is the third root of 372149 to the nearest integer? 72 What is the square root of 727365 to the nearest integer? 853 What is the third root of 581139 to the nearest integer? 83 What is 82567 to the power of 1/2, to the nearest integer? 287 What is 1861146 to the power of 1/3, to the nearest integer? 123 What is 3681653 to the power of 1/10, to the nearest integer? 5 What is 1155852 to the power of 1/6, to the nearest integer? 10 What is 5360697 to the power of 1/2, to the nearest integer? 2315 What is the sixth root of 140915 to the nearest integer? 7 What is 30756487 to the power of 1/8, to the nearest integer? 9 What is 339642 to the power of 1/7, to the nearest integer? 6 What is the square root of 721356 to the nearest integer? 849 What is the third root of 179309 to the nearest integer? 56 What is 234122 to the power of 1/3, to the nearest integer? 62 What is the square root of 96330 to the nearest integer? 310 What is the square root of 9609307 to the nearest integer? 3100 What is the third root of 4509951 to the nearest integer? 165 What is the fourth root of 1321134 to the nearest integer? 34 What is the fifth root of 12044770 to the nearest integer? 26 What is 2909925 to the power of 1/6, to the nearest integer? 12 What is the cube root of 16845062 to the nearest integer? 256 What is 5565214 to the power of 1/3, to the nearest integer? 177 What is the ninth root of 16287645 to the nearest integer? 6 What is 224758 to the power of 1/3, to the nearest integer? 61 What is 7920578 to the power of 1/3, to the nearest integer? 199 What is 25465618 to the power of 1/4, to the nearest integer? 71 What is the eighth root of 454719 to the nearest integer? 5 What is 800590 to the power of 1/3, to the nearest integer? 93 What is the fourth root of 5418147 to the nearest integer? 48 What is the third root of 4458414 to the nearest integer? 165 What is the third root of 1607862 to the nearest integer? 117 What is the ninth root of 308535 to the nearest integer? 4 What is the square root of 417302 to the nearest integer? 646 What is 466921 to the power of 1/2, to the nearest integer? 683 What is 1353224 to the power of 1/2, to the nearest integer? 1163 What is 27328496 to the power of 1/4, to the nearest integer? 72 What is the sixth root of 135791 to the nearest integer? 7 What is the ninth root of 629964 to the nearest integer? 4 What is the third root of 223561 to the nearest integer? 61 What is the cube root of 6829597 to the nearest integer? 190 What is the square root of 228278 to the nearest integer? 478 What is the cube root of 41748 to the nearest integer? 35 What is 10737987 to the power of 1/2, to the nearest integer? 3277 What is 528182 to the power of 1/2, to the nearest integer? 727 What is the tenth root of 18011623 to the nearest integer? 5 What is the square root of 2467509 to the nearest integer? 1571 What is 4042030 to the power of 1/9, to the nearest integer? 5 What is the square root of 9616749 to the nearest integer? 3101 What is 28469 to the power of 1/10, to the nearest integer? 3 What is the third root of 3376044 to the nearest integer? 150 What is 15619695 to the power of 1/2, to the nearest integer? 3952 What is 341815 to the power of 1/3, to the nearest integer? 70 What is the ninth root of 223541 to the nearest integer? 4 What is 4325226 to the power of 1/4, to the nearest integer? 46 What is 1020583 to the power of 1/6, to the nearest integer? 10 What is the third root of 252385 to the nearest integer? 63 What is the square root of 2217302 to the nearest integer? 1489 What is the cube root of 326947 to the nearest integer? 69 What is the third root of 5572820 to the nearest integer? 177 What is 29173952 to the power of 1/2, to the nearest integer? 5401 What is the third root of 449148 to the nearest integer? 77 What is the third root of 4540144 to the nearest integer? 166 What is the square root of 2774657 to the nearest integer? 1666 What is 768293 to the power of 1/4, to the nearest integer? 30 What is the cube root of 6985441 to the nearest integer? 191 What is the cube root of 11419 to the nearest integer? 23 What is 229921 to the power of 1/10, to the nearest integer? 3 What is 142238 to the power of 1/4, to the nearest integer? 19 What is 363068 to the power of 1/3, to the nearest integer? 71 What is the square root of 17753188 to the nearest integer? 4213 What is 700324 to the power of 1/2, to the nearest integer? 837 What is the seventh root of 1136671 to the nearest integer? 7 What is the fourth root of 141	{ "pile_set_name": "DM Mathematics" }
19 Sort -3, -2, 0.4, 0, -16613 in decreasing order. 0.4, 0, -2, -3, -16613 Put 7/3, -2/11, 6, -4, 1271 in decreasing order. 1271, 6, 7/3, -2/11, -4 Put 1, -0.3, -0.2, 3/4843, -4 in descending order. 1, 3/4843, -0.2, -0.3, -4 Sort 3970/13, -3/5, 2/9 in decreasing order. 3970/13, 2/9, -3/5 Sort -3, 1, -5, 5, 15 in increasing order. -5, -3, 1, 5, 15 Sort 5, 1107, -4, 0, -1, -13 in decreasing order. 1107, 5, 0, -1, -4, -13 Sort 13, -4, 14, 1 in descending order. 14, 13, 1, -4 Sort -154, 3, 14, -6, 0 in descending order. 14, 3, 0, -6, -154 Put 12, -3, 1, -2, -10, -4 in ascending order. -10, -4, -3, -2, 1, 12 Sort 12, -157, 102 in increasing order. -157, 12, 102 Sort -1, 10, -6098. -6098, -1, 10 Put -60, -3, -4, -7, 1 in descending order. 1, -3, -4, -7, -60 Put -1268, 0, 2, 61 in decreasing order. 61, 2, 0, -1268 Put 3, 0, -3, -7, 17 in decreasing order. 17, 3, 0, -3, -7 Put 0.2, 3/7, -4/7, 128, -1/2 in decreasing order. 128, 3/7, 0.2, -1/2, -4/7 Put -749, -36, 1 in descending order. 1, -36, -749 Sort 1, 0, 0.9, 5, -6 in ascending order. -6, 0, 0.9, 1, 5 Sort 0.2, 149, 2/21, -2/9, 4 in decreasing order. 149, 4, 0.2, 2/21, -2/9 Sort 0, -1, -5, -20649, -18 in decreasing order. 0, -1, -5, -18, -20649 Sort -0.01094, -2, -2/9 in ascending order. -2, -2/9, -0.01094 Sort -44983, 1, -1 in ascending order. -44983, -1, 1 Sort 0, 4, -89, -22, 5, -2 in ascending order. -89, -22, -2, 0, 4, 5 Sort 33/10, 0.1, 4, -13, -1, 2/3. -13, -1, 0.1, 2/3, 33/10, 4 Put -2, -9, -5, 10, 0 in decreasing order. 10, 0, -2, -5, -9 Put -146, 5, -1051, 4 in increasing order. -1051, -146, 4, 5 Sort -0.4, 2, 0.0651, -0.1, -3.3 in descending order. 2, 0.0651, -0.1, -0.4, -3.3 Sort -5, -126, 11, 0, 6. -126, -5, 0, 6, 11 Sort 125, 423, 2. 2, 125, 423 Put -0.13, -0.4, 3, -3/4, 2.6 in increasing order. -3/4, -0.4, -0.13, 2.6, 3 Sort 4, 0.05, -2/37, 0.2, -2 in descending order. 4, 0.2, 0.05, -2/37, -2 Put 3, 6, -2, -208, 2, -3 in ascending order. -208, -3, -2, 2, 3, 6 Put -1/3, -0.24, 8.756 in increasing order. -1/3, -0.24, 8.756 Sort 9, 1, 3, -28. -28, 1, 3, 9 Sort 0.3, -2/11, -8, -2/5, 0.12. -8, -2/5, -2/11, 0.12, 0.3 Put -13, -2/11, 2, 25, -1, 0.6 in descending order. 25, 2, 0.6, -2/11, -1, -13 Put 2/7, 56, 0.07 in descending order. 56, 2/7, 0.07 Sort 3, 11, -160, 5, 2 in decreasing order. 11, 5, 3, 2, -160 Sort 23, 492, -3 in descending order. 492, 23, -3 Put -2, 4, 0, 3, 2/69 in decreasing order. 4, 3, 2/69, 0, -2 Sort 5, 17, -1, 11, 2 in increasing order. -1, 2, 5, 11, 17 Sort 58/3, -0.4, 4, -4, -30 in decreasing order. 58/3, 4, -0.4, -4, -30 Sort 29251/2, -4, 0.5. -4, 0.5, 29251/2 Sort 3, -1.4, -1, 336 in ascending order. -1.4, -1, 3, 336 Put -1, -2, 24, 310 in descending order. 310, 24, -1, -2 Sort -3, 0.159, 0, 2/7, 3, 2/5 in ascending order. -3, 0, 0.159, 2/7, 2/5, 3 Put -0.2, 11, 0.4, -5, -67, 0 in descending order. 11, 0.4, 0, -0.2, -5, -67 Put 5, -3253, -2, 4 in descending order. 5, 4, -2, -3253 Put -4, -11, -68, -15, 4 in ascending order. -68, -15, -11, -4, 4 Sort 5, 616, -2/7, -5 in ascending order. -5, -2/7, 5, 616 Put 879, 1, 0 in descending order. 879, 1, 0 Sort 3, 1, 5, -28, -5 in ascending order. -28, -5, 1, 3, 5 Put 0.6, -23, -2/9, -4/7 in increasing order. -23, -4/7, -2/9, 0.6 Put -164/9, 5, -3/5, 0.4, 1/3, 2 in decreasing order. 5, 2, 0.4, 1/3, -3/5, -164/9 Put -4, 16, 2/15, -4/35, 2/3 in descending order. 16, 2/3, 2/15, -4/35, -4 Sort 12, 70908, -3 in decreasing order. 70908, 12, -3 Put -5, -3, 2/21, -2/39, -1, -0.66 in decreasing order. 2/21, -2/39, -0.66, -1, -3, -5 Put 0, -1, 2, -232 in descending order. 2, 0, -1, -232 Put -23, -2, 327, 0 in descending order. 327, 0, -2, -23 Put 1.4, -75, 3, 0.547 in decreasing order. 3, 1.4, 0.547, -75 Sort -4, -18, 1, 5, 4, -3 in descending order. 5, 4, 1, -3, -4, -18 Put -102, 19, 2, 5, 0 in ascending order. -102, 0, 2, 5, 19 Sort -2, 2, 911 in decreasing order. 911, 2, -2 Sort -0.05, 1, 4/9, 45/4, -20. -20, -0.05, 4/9, 1, 45/4 Sort 3/2, 8, -1.6, 1/2. -1.6, 1/2, 3/2, 8 Sort -2, -1, 2, -4, 8, 664 in decreasing order. 664, 8, 2, -1, -2, -4 Put 146, 165, -2, 3, 0, 1 in increasing order. -2, 0, 1, 3, 146, 165 Sort 9, 61, -3, 83 in increasing order. -3, 9, 61, 83 Sort -1/6, 667/4, 0 in ascending order. -1/6, 0, 667/4 Put 2/3, 0, -1/6, 5, -127/11 in increasing order. -127/11, -1/6, 0, 2/3, 5 Sort -100, 2, 0, 4, -5, 5. -100, -5, 0, 2, 4, 5 Put 6, -1594, 133 in decreasing order. 133, 6, -1594 Sort 42, 2/5, 15, 0.5 in decreasing order. 42, 15, 0.5, 2/5 Put 1303, 4, -2, 13 in descending order. 1303, 13, 4, -2 Put -1, -2/5, -1947 in descending order. -2/5, -1, -1947 Sort -233, -2, -35, 4 in decreasing order. 4, -2, -35, -233 Put 0.2, 32607, -2 in descending order. 32607, 0.2, -2 Sort 2, -6, -1, -30, 1, -20 in descending order. 2, 1, -1, -6, -20, -30 Sort 0, -1, 1, -398, -5, 2 in ascending order. -398, -5, -1, 0, 1, 2 Put 8, 3, -107, -24 in decreasing order. 8, 3, -24, -107 Put -0.3, 61, -5/12, -0.9, -2 in decreasing order. 61, -0.3, -5/12, -0.9, -2 Sort 31/2, -104, -2/5 in increasing order. -104, -2/5, 31/2 Sort -2, -1, 554, 1, -6 in increasing order. -6, -2, -1, 1, 554 Sort -4, -5, -0.1, -2, -11984. -11984, -5, -4, -2, -0.1 Put -2/13, 1/4, 0.148 in descending order. 1/4, 0.148, -2/13 Put 43, -2, -4, -55 in descending order. 43, -2, -4, -55 Put -23, -2, 8, -5, 13 in descending order. 13, 8, -2, -5, -23 Sort 1, -10922, -36 in increasing order. -10922, -36, 1 Sort 39/11, -3/2, 40, 4 in descending order. 40, 4, 39/11, -3/2 Sort 211, 58, -2/7 in decreasing order. 211, 58, -2/7 Put -0.5, 2/7, 3/4555 in increasing order. -0.5, 3/4555, 2/7 Sort 0.271, 19/6, 3, -4 in decreasing order. 19/6, 3, 0.271, -4 Sort -31, -30, -3, 2, 4, 1 in increasing order. -31, -30, -3, 1, 2, 4 Sort 322, -3, -53 in ascending order. -53, -3, 322 Sort 4, 122, -1/3, 601, 5. -1/3, 4, 5, 122, 601 Sort 0.3, 49, -1/75, 4, -0.3 in decreasing order. 49, 4, 0.3, -1/75, -0.3 Sort 4, 145, 16, 5 in ascending order. 4, 5, 16, 145 Put 31, 2/11, 2/7, 5, -0.0475 in increasing order. -0.0475, 2/11, 2/7, 5, 31 Put -279, -2, 0.3 in descending order. 0.3, -2, -279 Put 3, 152, -5, -3/8, -1/14 in decreasing order. 152, 3, -1/14, -3/8, -5 Sort -11, 32, 10 in descending order. 32, 10, -11 Sort -1/2, 0, 2.9, 5.573 in decreasing order. 5.573, 2.9, 0, -1/2 Sort 3, 0, 710, -60. -60, 0, 3, 710 Put 0.19475, -3, 12 in decreasing order. 12, 0.19475, -3 Put -1, -4, -17570 in ascending order. -17570, -4, -1 Put 0.08, -3, -1, 4, -2/5 in descending order. 4, 0.08, -2/5, -1, -3 Sort -1, 5, -14, -5, -67, 8 in descending order. 8, 5, -1, -5, -14, -67 Sort 4/169, 3/313, 0.06. 3/313, 4/169, 0.06 Put 0, 1/3, 15, -0.3, -0.079, 4 in descending order. 15, 4, 1/3, 0, -0.079, -0.3 Sort -310, -4, 4, 55 in ascending order. -310, -4, 4, 55 Sort 4, 3/5, 6/65, -3. -3, 6/65, 3/5, 4 Sort -0.2, -5/9, 10004, -2. -2, -5/9, -0.2, 10004 Sort -1/5, 0.17, 2/13, -3.7, 0.2 in decreasing order. 0.2, 0.17, 2/13, -1/5, -3.7 Sort 0, -7, 3898. -7, 0, 3898 Put 2, 1, 400, 5, -1, -3 in decreasing order. 400, 5, 2, 1, -1, -3 Put -0.2, -43, 1/5, 2/5, -1.2, 4 in decreasing order. 4, 2/5, 1/5, -0.2, -1.2, -43 Sort -2/5, 418, 3 in decreasing order. 418, 3, -2/5 Sort 5452, 1, 2, -5 in descending order. 5452, 2, 1, -5 Sort -5, -7, -2, -1023 in descending order. -2, -5, -7, -1023 Put -3/7, 2/11, -0.394 in increasing order. -3/7, -0.394, 2/11 Put 18825, 15, 2, -2 in descending order. 18825, 15, 2, -2 Sort 5, 6796, -0.04. -0.04, 5, 6796 Sort 5, -5, 3, 6, -21217 in descending order. 6, 5, 3, -5, -21217 Put 4369, 4, 1 in increasing order. 1, 4, 4369 Sort -0.2, -0.3, -1/8, 1.9, 0.4 in decreasing order. 1.9, 0.4, -1/8, -0.2, -0.3 Sort 0, 2.5, 48, 1/4. 0, 1/4, 2.5, 48 Sort -1193, -1, -3, 2, 5 in descending order. 5, 2, -1, -3, -1193 Put 2, -2306, -1, 10 in ascending order. -2306, -1, 2, 10 Sort -0.2, 6, 3, -2/3, 0.361. -2/3, -0.2, 0.361, 3, 6 Sort -1931, 5, -14. -1931, -14, 5 Sort -40, -50, 13, -4, 1 in decreasing order. 13, 1, -4, -40, -50 Put -4565, 4, -5 in increasing order. -4565, -5, 4 Sort 3, -497, -73, 1, 5 in decreasing order. 5, 3, 1, -73, -497 Sort -0.02, -1, -4651 in ascending order. -4651, -1, -0.02 Sort -0.8, 3, 0.17, 0.196 in descending order. 3, 0.196, 0.17, -0.8 Put -1, 1/5, 10.4, -11 in descending order. 10.4, 1/5, -1, -11 Put 0.26,	{ "pile_set_name": "DM Mathematics" }
False Which is smaller: -7/308012 or -1? -1 Do -182.3 and 6/755 have different values? True Are -22 and 97 non-equal? True Which is bigger: 38640 or 38664? 38664 Does 1 = -95/8468? False Is -14716 >= -14705? False Which is greater: 123 or -4153? 123 Which is bigger: 1 or 5/29336? 1 Is 3 greater than -3804? True Which is smaller: 607/38 or -0.08? -0.08 Which is smaller: 150 or -154? -154 Is -238/5 equal to 67? False Is -422158 < -11? True Is -0.0308 > -11? True Which is smaller: 0 or 29/5992? 0 Which is smaller: 2.0544 or -0.01? -0.01 Is 1/31873 less than or equal to 8? True Which is smaller: 142/7 or 21? 142/7 Does -0.09 = -2657? False Which is smaller: -477056 or -477055? -477056 Which is smaller: 72158 or 72162? 72158 Is 5981121 greater than 5981121? False Are 1 and -2/7427289 equal? False Which is smaller: 0.3 or -168540? -168540 Which is greater: -12761 or -12792? -12761 Is 15335 > 56? True Is 64191 bigger than 64193? False Is -837508 less than or equal to -837510? False Is -175 greater than or equal to -787? True Which is smaller: 36730 or -16? -16 Which is smaller: 0 or -1677/148? -1677/148 Which is smaller: -112/5 or 0.002? -112/5 Is 216082 smaller than 216082? False Which is bigger: -2/7 or -0.23689? -0.23689 Which is smaller: -2408 or -1336? -2408 Which is bigger: -74683 or -74680? -74680 Which is smaller: 2423/64 or 39? 2423/64 Is -1056784 smaller than -1056783? True Which is greater: 4/19 or 522? 522 Is 1963695 <= 1963694? False Is 0 at least as big as 44770/21? False Which is bigger: -773284 or -773286? -773284 Which is smaller: 1 or -73/8942? -73/8942 Is -0.50441 at least as big as -1/3? False Which is bigger: 838144 or 838145? 838145 Is -25289/336 < -76? False Which is smaller: -376 or -131? -376 Which is smaller: 32/193 or -1? -1 Is -247 >= -13653/55? True Is -4681 less than or equal to -4673? True Are -201753 and 0.1 equal? False Which is bigger: 0 or 1/24050? 1/24050 Which is bigger: 1668/77 or 22? 22 Is 472565 at most as big as 472567? True Which is bigger: -12068/15 or -805? -12068/15 Is 5447016/13 at most 419000? False Is 1 <= -24/15385? False Is 14/667 at least -0.6? True Which is smaller: -3384/67 or -52? -52 Which is smaller: -1/14 or 1720/11? -1/14 Does -1448 = 926? False Is 1081057 greater than 1081057? False Which is smaller: 21166 or 2? 2 Is -6/7 less than or equal to -458/41? False Which is smaller: 1 or -3/73694? -3/73694 Which is smaller: -8004 or -6? -8004 Which is bigger: 413035 or 413036? 413036 Is -19832 < 0? True Is 6918 less than or equal to 6899? False Is -282/2533 < -1? False Do 333064 and 333063 have different values? True Is 1204425 equal to -3? False Is -8166 != -0.085? True Which is bigger: 41010/953 or 42? 41010/953 Which is bigger: 2/2467681 or 0? 2/2467681 Which is smaller: -1147 or 41? -1147 Is -50874 >= -50880? True Is 2678 <= 0.94? False Which is smaller: -957 or 9/8? -957 Does -2567 = -3? False Which is smaller: 59484 or 59481? 59481 Is 46 at most -9192? False Which is smaller: 1 or 388/54543? 388/54543 Which is bigger: 50675/7 or 0? 50675/7 Which is greater: 7619 or 7622? 7622 Are 322902 and 0.1 non-equal? True Is 0.05 smaller than 236652? True Is -9969/23 at most as big as -432? True Is 194150/9 != 21572? True Which is smaller: -1 or 76/11879? -1 Which is smaller: -1333 or -109? -1333 Which is greater: -9825 or -167012/17? -167012/17 Which is bigger: -1279 or -23035/18? -1279 Which is greater: -677860 or 1/3? 1/3 Is 239460 at least 6? True Which is bigger: -118843 or -118848? -118843 Is 28552 smaller than 85658/3? True Does 13 = -5698? False Does -99136 = -99146? False Is 2 at least as big as 14668? False Are -6/633043 and 1 non-equal? True Do 0.0281 and 1146 have the same value? False Which is smaller: 55338 or 2/23? 2/23 Which is bigger: -2/11 or 13.25? 13.25 Is 1.21283 at most -8? False Which is bigger: 3/5 or 45509? 45509 Is -686 less than -1086? False Are -11539/34 and -340 equal? False Is -0.8632 equal to 1.4? False Is -122273 at most as big as -122272? True Which is greater: 125/71 or 2? 2 Which is smaller: -1 or 4511/11? -1 Which is smaller: -166/5 or 14? -166/5 Is -2/5 at least as big as -974774? True Do 214105/3 and 71369 have the same value? False Is 2132829 not equal to 2132829? False Which is smaller: -455/8221 or -1? -1 Is -127108 <= -127108? True Is -119225 >= 1/3? False Is 667/1070 < 0? False Is -3/101 greater than or equal to 75? False Are 1265/21 and -2 unequal? True Is -558 bigger than -93067/167? False Is -31260/97 < -322? True Are -57/115955 and 0 equal? False Which is smaller: -669 or -6/23? -669 Which is smaller: -151455 or -1211631/8? -151455 Which is smaller: -25686 or -25590? -25686 Are 6478/77 and 83 non-equal? True Which is bigger: -152 or -9240/61? -9240/61 Is -1293133 != -1293132? True Do -71 and -544 have the same value? False Do 29 and 2548/89 have the same value? False Which is smaller: -2563 or -2561? -2563 Is 4.78 equal to 1008? False Is -224 < -1/1222? True Is 4106 bigger than 191? True Are -3 and -394683 non-equal? True Is -0.3 at least -3393? True Is 1 >= 478/841? True Which is smaller: 5117 or 5335? 5117 Is -22120 bigger than -22120? False Which is greater: 14443 or 14484? 14484 Which is greater: -30/1087 or -1? -30/1087 Is 290878 greater than or equal to 290881? False Is 1033754/7 <= 147679? False Which is greater: 2/3 or -441619? 2/3 Is -91 at least as big as 23/15? False Is 65/152 at most 0? False Is 0 >= -1/1027201? True Which is bigger: -594 or -1/406? -1/406 Which is smaller: -1 or 29/730? -1 Is 4194974 at most as big as 4194973? False Which is bigger: 57909 or 57932? 57932 Is -736254 > -736253? False Which is bigger: 4.4 or 6/71? 4.4 Which is smaller: 27 or 13724/501? 27 Is 1601/121 less than 13? False Which is bigger: -1960 or -2024? -1960 Which is smaller: 43/98 or -53? -53 Are -1 and 0.0425009 nonequal? True Does 2131 = 22? False Which is smaller: 170505 or 170508? 170505 Are -65 and 1.2533 equal? False Are 584286 and 584285 unequal? True Is 0 greater than 20/4741? False Which is greater: 105331 or 105322? 105331 Is 1989 <= 13/3? False Is -52952 at least -52940? False Is 62111 != 310556/5? True Which is greater: 224/757 or 1? 1 Is -1 equal to -4/312429? False Which is smaller: -687 or -7551/11? -687 Is 2/9 less than 3.875? True Is 90/2699 at least 1? False Which is bigger: 2/8122557 or -1? 2/8122557 Which is bigger: -2 or -100138? -2 Is -1167199 not equal to -1167199? False Which is smaller: 4079/3 or -8? -8 Is -95 greater than 63? False Is 0 < -11/12098? False Is 2/3 > -27466? True Which is smaller: -262101.3 or 1/2? -262101.3 Which is smaller: 0.2 or -2/1451751? -2/1451751 Are 5 and 4304/877 nonequal? True Is 2061199/16 < 128825? True Are 0 and -2/908295 unequal? True Is 2 smaller than 330/487? False Which is smaller: 1 or 1/120304? 1/120304 Is 1686 < 38759/23? False Which is greater: -119/19240 or 0? 0 Which is smaller: -7126 or 0.01? -7126 Is 2.1 smaller than 201122? True Which is smaller: 1007219 or 1007220? 1007219 Which is smaller: -11887 or -11894? -11894 Do 0 and -2/268563 have the same value? False Is 1963010 at least 1? True Which is smaller: -0.1965535 or 2/5? -0.1965535 Is -5741 smaller than -5312? True Which is smaller: -121/127047 or -1? -1 Which is greater: -19 or -62? -19 Is 329438 smaller than 329432? False Is 1 at most 135/664? False Is 642809 greater than or equal to 642813? False Is 3.7209 >= 3/4? True Is -1 > 21/234683? False Which is greater: -843393 or 0.06? 0.06 Is -2521 at most as big as -2520? True Which is smaller: 986631 or -1/4? -1/4 Is 4695 equal to 4717? False Is 0 smaller than -806/1763? False Which is smaller: -6373/1430 or -4? -6373/1430 Are -211283 and -211290 non-equal? True Is 208 bigger than 1096? False Which is smaller: 5728 or -27.7? -27.7 Are -3 and -453/263 non-equal? True Which is smaller: 637/738 or 1? 637/738 Which is bigger: -18095 or -90478/5? -18095 Which is smaller: -1 or -1/25220? -1 Is 0.41 smaller than -22592? False Which is smaller: 8268 or 8270? 8268 Do -2003678 and -2003679 have the same value? False Which is greater: -13397 or -13402? -13397 Is -0.1 at least as big as -13915? True Which is smaller: 2 or 9140/7? 2 Is 1048 <= 1100? True Which is smaller: 31641 or 31642? 31641 Which is b	{ "pile_set_name": "DM Mathematics" }
as tn + i + kn*2 and give k. -2 Express (6y*2 + 5y*2 - 34y*2 + (2y - 4y + y)(0y - 2y + 3y))(0 + 2 - 4) in the form q + ly + iy*2 and give i. 48 Rearrange 2 - 11d - 9d + 6d to the form o + kd and give k. -14 Rearrange ((-1 + 4 - 1)(-2 + 4 + 0) + 4 - 6 - 4)(-5k*2 - 5k*2 - 5k*2) to the form ck + qk2 + i and give q. 30 Rearrange 0q4 - 2 - q + 2 - q4 + q*3 - 2 to wq*2 + gq + lq4 + n + mq*3 and give l. -1 Express -5p*4 + 7p*4 + 11p*4 + (-p + p - 2p*2)(-1 + 1 - p*2) as hp*3 + v + rp*4 + cp + gp2 and give c. 0 Rearrange -4 + 14 + 3h - 7 - 8 to the form rh + s and give r. 3 Express 2a2 - a3 + 2a4 - 3a*4 - 3 + 0a*4 + 2 as ra*4 + y + ba*3 + xa*2 + ga and give y. -1 Express 4u3 - u2 - 14u + 14u - u2 in the form mu*2 + hu*3 + b + ju and give m. -2 Rearrange -4d - d - 8d to z + rd and give r. -13 Express 5d + 9d + 12d - 9d as id + u and give i. 17 Express 13t - 20t - 7t as bt + y and give b. -14 Express 4y + y + 7y*2 + 2y*2 - 7y*2 in the form u + py + iy2 and give p. 5 Express 5i*4 + i + 7i*4 - 15i*4 - 2 + 6i*4 as r + ti*3 + ki + qi4 + xi*2 and give t. 0 Rearrange (1 - 2 + 0)(0x + 3x + 11x) + 0x + 2x - x + 2x - 2 + 2 + (0 + 1 + 0)(-x + 0x + 0x) to the form r + sx and give s. -12 Rearrange (-x + 6x - 2x)(2x*2 + 2 - 2) - 5x*3 - 5 + 5 to h + rx + tx3 + kx*2 and give t. 1 Express 83k - 83k + 79k*2 in the form xk*2 + s + zk and give z. 0 Rearrange (45 + h - 24 - 27)(1 - 1 - h) to the form ch + a + zh2 and give z. -1 Rearrange 3 + 7d*3 + 2d2 - d2 + 0d2 + d to the form s + td + yd2 + gd*3 and give t. 1 Rearrange (-1 - 3 + 3)(-4p2 + 4p2 - p2) - 2p + 2p + 2p2 + 0p*2 - 2p*2 + 4p*2 to t + lp + cp2 and give c. 5 Express -13o - 22o + 5o as n + xo and give x. -30 Rearrange -40v + 39v + 66v + 57v to the form p + nv and give n. 122 Express (0 - 2 + 7)(2 - 2 + 2o)(-4 - 3 + 0) in the form f + co and give c. -70 Express 5h4 + 4h*2 - 4h*2 + (-2h*2 + 2h*4 + 2h*2)(-1 + 0 + 0) - 3h4 - h4 + 3h*4 in the form vh*4 + oh*3 + j + ah*2 + th and give v. 2 Rearrange -3j3 + 0j + 13j - 14j + 14j2 + 0j*3 to the form ij*2 + vj + qj3 + a and give i. 14 Express (9 - 30 - 15)(c - 6c + 3c)(2c*3 + 0c*3 - 3c*3) as lc*2 + vc + rc4 + k + wc*3 and give r. -72 Express (2k + 3k - 3k)(-18k + 18k - 21k*2) as yk + rk2 + q + pk*3 and give p. -42 Rearrange -4p*3 - 2p + 2p4 - 2p + 6p to the form xp*2 + qp + kp4 + up*3 + g and give q. 2 Express (6y - 2y + 0y)(0y*3 + 2y3 - y3 + 11y3) as sy + py4 + i + oy*2 + dy3 and give p. 48 Rearrange -m2 - 2m2 + 0m2 + m2 to the form rm2 + h + vm and give r. -2 Rearrange (-7 + 10 + 13)(j - j - 6j) to pj + b and give p. -96 Rearrange -4 + 2 - 11o + 8o + 4 to the form ro + t and give r. -3 Express (1 - 4 + 5)(-1 + 2 + 0)(4z - 2 + 2) as l + nz and give n. 8 Rearrange -8v2 + 10v*2 + 2v*3 + 4v - 2v to the form kv + g + mv2 + jv*3 and give j. 2 Express 2n*2 + 2n*2 + 8n*2 + 6n*2 - 4n*2 + 0n2 + (n2 - 2n2 + 0n*2)(2 - 3 + 0) as qn2 + on + d and give q. 15 Express ((4r - 5r + 2r)(3 - 6 + 1) + 3 - 2r - 3 - 6r + 5 - 5)(-2 - 1 - 2) in the form ir + p and give i. 50 Express (-2i4 + 7 - i2 - 7)(0 - 3 + 1) as wi2 + ri*3 + yi*4 + ni + k and give y. 4 Express -7f + 5f*3 + 2f*4 - 8f + 14f in the form qf + mf3 + k + af*2 + df*4 and give q. -1 Express 4s*4 - 2s*2 - 2s4 - s2 - 2s3 - s + 0s*3 as as*3 + v + ks*4 + cs*2 + ns and give c. -3 Rearrange (0 + 1 - 4)(25y + 14y - 18y) to the form c + sy and give s. -63 Rearrange 16v - v2 - v3 + 4v4 - 4v4 + v4 - v to u + ov2 + dv*4 + mv*3 + iv and give m. -1 Rearrange 7d2 + 1 + 2d2 + d2 - 4d - 18d*2 to the form bd + ld2 + m and give l. -8 Express 10o*2 - 9o*2 - o - o + o in the form lo*2 + c + ko and give k. -1 Rearrange 2 - 5 - t*2 + 0 to ut*2 + xt + a and give x. 0 Rearrange 12u2 + 10u*2 + 1 - 1 to m + pu*2 + vu and give m. 0 Rearrange (138 - 138 + 16b)(0b - 3b + 4b + (4 - 4 - 2b)(-1 + 2 + 3)) to the form kb*2 + sb + g and give k. -112 Express 12v2 - 22v*2 - 5 + 11v*2 in the form hv*2 + z + jv and give h. 1 Rearrange 26c2 - 27c*2 - c - 2c*4 - 3 - 4c3 + c4 to the form b + lc4 + vc*2 + jc*3 + qc and give l. -1 Rearrange -40g2 + 77g*3 + 14g*2 - 75g*3 to fg*2 + wg + h + bg3 and give f. -26 Rearrange -90r + 81r + 1 - 1 to the form f + cr and give c. -9 Rearrange (-4 + 8 + 9)(-3g + 3g - g) to the form ng + k and give n. -13 Rearrange 3u + 19u*3 + 2u - 3u - u2 to the form pu*3 + r + fu + cu2 and give f. 2 Express -45a + 0 - a*3 - 2 + 52a as za2 + g + ua*3 + xa and give x. 7 Rearrange 2i - 6i + 2i + 3i3 - 4 - 3 + i2 to ri + xi*2 + s + ki*3 and give x. 1 Rearrange 3 + 0 - 1 - 42w to the form nw + d and give n. -42 Express v3 - 55 + v2 - 12v + 55 as yv + z + lv*2 + sv*3 and give l. 1 Express 8 - 17u*2 - 2u*3 + 37u*2 - 12u*2 - 10u*2 in the form g + iu*2 + wu + tu3 and give i. -2 Rearrange (-29 + 29 - 2t)(-7t + 7t + 4t*3) to v + nt*2 + jt + rt4 + dt*3 and give n. 0 Rearrange (0h + 2h + 0h)(4 - 7 + 2)(-2 + 2 - 1)(0 + 0 + 8h*2) to mh*3 + uh*2 + rh + a and give m. 16 Rearrange 1068n + 1 - 536n - n2 + n4 - 531n + 2n*3 to the form wn + ln4 + jn*2 + x + yn*3 and give j. -1 Express 2v*4 - 5v4 + v4 + (-3 + 3 - 2v2)(-5v + 3v + 0v)(-145 + 145 + 3v) as uv*3 + dv + f + tv2 + kv*4 and give k. 10 Express (4 - 6 - 7)(-2u + u + 0u) + u + 0u - 2u + (0 + 5 - 4)(0 - 2u + 0) - 5u + 2u + u in the form cu + k and give c. 4 Rearrange -h3 - 4h*3 + 3h*3 + (-2h2 - h2 + h*2)(3h - 2h + 2h) to the form kh*2 + g + yh + nh3 and give n. -8 Express 8v + 8v2 - 8v + (-4v2 + 4v2 + v2)(2 - 4 + 0) as yv + b + tv2 and give t. 6 Rearrange (-12 + 12 + 22)(-2l + 4l - l) to kl + z and give k. 22 Express 5m*2 + 7m3 - m3 - 5m3 in the form um*3 + g + sm + qm2 and give u. 1 Rearrange (4x*3 + 0x*3 - 2x*3)(-2x + 2x - 3x) - 5x*4 + 8x*4 - 8x*4 to the form dx*2 + bx*3 + jx*4 + mx + z and give j. -11 Rearrange -9l2 - 43l*2 + 15l*2 to il + c + bl2 and give b. -37 Express 24 - 23 - 3f + 4f as x + cf and give x. 1 Express -13r3 - 9r + 7r + 1 + 4r as h + or + zr*2 + wr*3 and give o. 2 Express (-2 - 1 - 3)(18x - 57x + 11x) as kx + u and give k. 168 Rearrange 666 - 23p4 - 666 + (-3 + 1 + 0)(-2p2 - 2p*4 + 2p*2)(1 + 3 - 3) to f + ap4 + mp + jp3 + tp*2 and give a. -19 Express 5j - 7j + 5 - 26 in the form xj + y and give x. -2 Express (2m + 2m - 3m - m + m + m + (-5 + 3 + 3)(-5m + 2m + 4m))(1 - 10 + 1) as im + d and give i. -24 Express 0 + 3k3 - k2 + 9 - 4k3 in the form rk + yk2 + nk*3 + w and give w. 9 Rearrange (1 - 5 + 3 + (2 + 0 - 4)(2 + 1 - 1))(-2 + 2x + 2 + (2 + 4 - 3)(0x + x - 2x))(x + x + x) to the form px + kx*2 + q and give k. 15 Express 1 + z - 1 + (0z + 3z - 4z)(-3 - 3 + 5) + 6z - 4z + 3z + z - z + 2z + (2z - 2z - z)(0 - 3 + 1) in the form tz + m and give t. 11 Express 69n - 21n + 32n in the form q + bn and give b. 80 Rearrange (-2 + 3 + 0)(-44 - 17u + 44)(1 + 0 + 0) to the form vu + o and give v. -17 Express k - 3k - 4 + 0k + 16 - k3 as dk*2 + s + qk + yk3 and give y. -1 Rearrange -87 - d2 + 87 to the form hd + id2 + m and give i. -1 Rearrange -11p - 5p + 0p to jp + m and give j. -16 Rearrange 42y*2 - 18y*2 + 44y*2 to dy + qy2 + r and give d. 0 Rearrange (2k - 2k + k)(-k*3 + 3k3 + k3) + 0k2 + 0k2 + k4 to qk + wk*3 + sk*2 + d + vk*4 and give v. 4 Rearrange 5 + g - 2g + 1 - 1 to ug + w and give u. -1 Express 22h + 2h + 4h in the form k + bh and give b. 28 Express -z3 + 153 - 153 + (3z - 3z + 2z*2)(2z + z - 4z) + z*3 - 3z + 3z as bz + c + g*	{ "pile_set_name": "DM Mathematics" }
- 4 - 6 - -8? 1 Evaluate 3 + -3 - (4 - (4 + 0)). 0 What is 6 + -3 + (-6 - -2) + 2? 1 What is 4 + -3 - 1 - -3? 3 What is the value of 1 + 0 + -2 + -5 + 6? 0 Calculate -1 + 5 + -4 + -2 + -4. -6 What is the value of (6 - (5 + 5)) + 2? -2 Evaluate 0 + -6 + (44 - 43). -5 Calculate 1 - (-10 + -11 + 20). 2 What is the value of -30 + 36 - (4 + -1 + -1)? 4 What is the value of 2 - 2 - (0 + 0)? 0 What is the value of (-7 - -3) + 6 + 0? 2 Evaluate 1 - ((-3 - -9) + -1). -4 (3 - 5) + -3 + 3 + 0 -2 What is the value of (-7 - (-6 + -11 - 0)) + -8? 2 What is the value of 4 + -2 + 2 + -5 + -1? -2 Calculate -4 - ((-2 - (8 + -3)) + -7). 10 What is -2 + -4 - (-9 + -8)? 11 (1 + (3 - 1) - 2) + 3 4 Calculate (4 - -1) + (-4 + -17 - -15). -1 What is the value of -1 - (1 + -2) - (-20 - -18)? 2 What is the value of -7 - -2 - -4 - -4? 3 5 - -1 - (5 - (-10 + 7)) -2 What is 4 + (-10 - -7) + 1? 2 What is 6 + (-6 - (-4 - -1))? 3 Calculate (-6 - (-1 + -2)) + (4 - 2). -1 Calculate 1 - (6 + 1 + -3 - 7). 4 Calculate 2 + -3 - (1 - -1 - 0). -3 What is the value of -3 - (6 - 9 - -9)? -9 What is -2 + -2 + -1 + 4 + -2? -3 Calculate 4 + 6 - (-1 + 7). 4 Calculate 0 - -1 - (5 + -4 - -5). -5 What is the value of -3 - -5 - (6 + -9)? 5 Calculate 1 + 0 + 1 - 2. 0 What is the value of -10 + 16 + -1 + (0 - 1)? 4 (-58 - -59) + -3 + 1 -1 Evaluate (10 - 14) + (2 - -5). 3 What is 15 - (9 - -5) - 6? -5 -2 - 0 - (16 + -20) 2 What is the value of (3 + (-5 - -8) - 12) + 0? -6 What is the value of (2 - 2) + (-4 - (-13 - -10))? -1 (20 - 22 - (2 - 4)) + -5 -5 (-2 - 6) + 6 - (2 + -4) 0 What is the value of (10 - (-2 - -8)) + -8? -4 -1 + 0 - (2 - (-1 - -1)) -3 Calculate 0 + -2 + 5 + -8. -5 Evaluate (2 - 0 - (-18 + 10)) + -4. 6 What is -3 + 6 + 7 + -13? -3 What is the value of 0 + 1 + (6 - 4)? 3 What is the value of (4 - -2) + -1 + -10? -5 What is the value of -1 - (-6 + (5 - 0))? 0 What is (-31 - -19) + 2 + 10? 0 0 + (0 - ((1 - 1) + -2)) 2 What is the value of -1 - (1 + 2 + -1) - -3? 0 Evaluate (-5 - -5) + -2 + -1 + -1. -4 Evaluate -4 + 3 + -5 + 2. -4 10 + 0 - (-88 - -91) 7 Calculate 1 + (16 - 8) + -12. -3 Calculate (-3 - 1) + -29 + 30. -3 What is -10 - ((-1 - -4) + (-3 - 5))? -5 Evaluate -3 - (2 - (2 - 2)). -5 What is the value of -5 + 2 + -4 + 5 + 0? -2 What is the value of 2 + 8 + (5 - 10)? 5 Evaluate -4 + 3 - (8 - 6). -3 Evaluate (-1 - -4) + 2 + (-4 - -5). 6 (-5 + 6 + -4 - -2) + 0 -1 Calculate -34 + 27 + (0 - -4). -3 Evaluate 43 + -47 - (1 + -1). -4 Evaluate 3 + 2 + -6 + 1 + 4. 4 Calculate -2 - (-6 + (14 - 15)). 5 Calculate 7 + -6 - 3 - (-3 - -1). 0 What is (-10 - (-12 - -6)) + 4? 0 Calculate -2 - -9 - 1 - (1 - -9). -4 (4 - (14 + -4) - -12) + 0 6 Calculate 4 + (0 - -5) + -7. 2 -11 + 1 + -1 + 8 -3 Evaluate -2 + -4 + (1 - -7). 2 Evaluate (-4 - (2 + -4)) + 1. -1 What is 1 + 7 + -4 + -1 + 3? 6 What is (-1 - 3) + (-4 - (3 + -7))? -4 What is (11 + -2 - (5 - 1)) + -3? 2 What is the value of (6 - (2 + -8)) + -12? 0 What is 1 + 1 + 3 + -4? 1 What is -6 - (-14 + 18 - 2)? -8 Calculate -2 + (-6 - (1 + -11)). 2 Calculate (-5 - -3) + 4 + 2 + -5. -1 Calculate 2 - 1 - (13 + (-24 - -20)). -8 What is (0 - 4) + (2 - -1) - 4? -5 -24 + 21 + (-1 - (-1 + 2)) -5 Calculate -1 + -7 - (-17 + 16). -7 -4 - (-3 + 0 - (44 - 40)) 3 Evaluate -6 + -7 + 8 + 6 - 6. -5 What is -1 + 6 + (8 + -9 - -4)? 8 What is the value of 9 + -5 + (-4 - -1) + -3? -2 What is the value of -2 - -10 - (7 - 2 - 2)? 5 What is -2 - ((-5 - 7) + 9)? 1 Calculate -1 - -8 - (-3 - -6) - 6. -2 What is the value of -1 + -2 - (15 - 23)? 5 Calculate (0 - (-3 + -1)) + (245 - 255). -6 Evaluate -5 + 1 + (-1 - 9 - -8). -6 (-8 - -13) + 13 + -23 -5 What is the value of -5 + -4 + 10 + -3 + 1? -1 What is -5 - (-10 + 9) - (-1 + 0)? -3 0 + (1 - (3 + 1) - -2) -1 Evaluate 6 - (4 - -7) - -9. 4 Calculate -2 + 0 - ((5 - 7) + -5). 5 What is the value of (6 + -13 - -12) + -7? -2 Calculate 19 - (9 - (2 - 0)) - 6. 6 Evaluate 3 - 1 - 4 - (-3 - 0). 1 -13 + 23 + (2 - 7) - 1 4 What is the value of (31 - 14) + -11 + 0 + -11? -5 What is the value of -5 + (-2 - (-7 + 1 + 5))? -6 Evaluate 5 - 7 - (0 + 1). -3 Evaluate 1 + -2 - (-1 - 2). 2 Calculate (20 - 6) + (8 - 13). 9 What is (10 - 7) + 1 + -4? 0 What is the value of (-6 + 5 - -4) + -3? 0 Calculate (1 - 4) + -3 + -1 + 5. -2 What is the value of (2 - (0 - 1)) + (0 - 6)? -3 Evaluate 1 + -2 - ((-18 - -7) + 7). 3 What is -8 + 7 + (-1 - 0)? -2 Calculate -9 + 14 - (1 - -1 - 2). 5 Evaluate -13 + 11 + -1 + 0 + -3. -6 Evaluate 3 + (-3 - 9 - -5). -4 What is (2 - (-3 - (0 + -10))) + 2? -3 What is 0 + 5 + -3 - 5? -3 Evaluate -3 + (-2 - -9) + -7. -3 Calculate 4 - (1 - (1 - (1 + 4))). -1 Calculate 3 - (-3 + 2 + 1 - -2). 1 What is the value of 5 - (8 - (9 - 8))? -2 What is -4 - (-2 - 3) - 1? 0 30 - 36 - (1 - 2) -5 What is 7 + (-3 - (5 + -4))? 3 Calculate -9 + (6 - (4 + -2 - 0)). -5 What is the value of -5 + (6 - (2 + (5 - 4)))? -2 -4 - ((4 - 8) + 4) -4 What is (2 + 1 - (1 + -3)) + -5? 0 Calculate -2 + (-7 - -11 - (-1 + 9)). -6 -5 + (4 + -1 - -2) 0 What is 0 - (-4 - (9 - 10))? 3 Evaluate 3 - 0 - (0 - 1 - -1). 3 What is the value of -4 + 3 - 0 - (0 + -5)? 4 Calculate 17 + -8 + (11 - 13). 7 5 + -1 + 4 - 7 1 Calculate 0 + 7 + -1 + -6 + 6. 6 5 + -2 - (1 + 1 + 1) 0 What is the value of -7 - (1 - 2 - (2 - 1))? -5 -1 - -2 - (0 - 2) - -1 4 -2 - 1 - (-6 + 3 + -2) 2 0 + 4 + -4 + 5 5 What is the value of -3 + (8 + (-2 - -1) - 5)? -1 Evaluate -1 + (-6 - (1 - 3 - 0)). -5 Evaluate (-29 - -25) + (0 - (0 - -1)). -5 What is -2 + (14 + -12 - (-1 - 1))? 2 What is the value of -2 - (-4 + 0) - 1? 1 What is the value of 20 - (0 + 10) - 8? 2 Evaluate (5 + 6 - -1) + -3 + -2. 7 What is the value of 0 - -5 - (4 + 0)? 1 What is the value of 4 - 2 - (-44 - -49)? -3 1 + 12 + (-9 - -3) + -9 -2 (-27 - -26) + (-6 - -2) - -3 -2 -1 + 3 - ((2 - 0) + 2) -2 What is the value of 5 + -13 + 10 + -5? -3 (6 - -1) + (9 - 12) - 6 -2 Calculate 0 + -5 - -1 - (-2 + 3). -5 Evaluate 0 + 6 + -15 + 12 + -8. -5 What is the value of -105 + 101 + (1 - 0 - 1)? -4 What is (7 - 1) + 5 + -5 + -2? 4 (-11 - (-9 - 6)) + -5 + -1 -2 What is the value of -2 - (2 - (12 + (-3 - 1)))? 4 Calculate 2 - (11 - -6) - -9. -6 4 - (2 + (-6 - -10)) -2 1 + -6 - (-3 - 5) 3 What is the value of 3 + -3 - (8 - 0)? -8 Evaluate -2 - (-4 + (1 - 1)). 2 Calculate -1 - 1 - (-26 - -29). -5 What is the value of 10 - (-6 + 6 - -5)? 5 What is 3 - (7 + (-3 - (0 - 0)))? -1 What is the value of 6 + -7 + 2 - 4? -3 What is -11 + 16 + (-2 - 2)? 1 Evaluate 4 + -9 + 1 + 2. -2 Evaluate -4 + (-2 - -2 - -8). 4 Evaluate 7 + (-7 - (-2 + -3)). 5 Evaluate 3 - (5 + -4 + 0). 2 Evaluate 4 - (2 + 1) - 3. -2 What is 4 - 7 - 1 - -1? -3 What is the value of (13 + -3 + -5 - 4) + 7? 8 Evaluate 5 - ((5 - 2) + 0 + 1). 1 Calculate 0 - (2 - 2) - (-2 + 2). 0 What is -8 + (0 + 7 - 2) + 2? -1 Calculate -1 + -3 + 6 + 2. 4 Evaluate (16 - (7 - 2)) + -7. 4 Calculate (12 - (9 - 9)) + -8. 4 (65 + -59 - (6 - 1)) + 5 6 Calculate (0 - -5) + -1 + (4 - 4). 4 What is the value of -2 + 2 - (10 + (2 - 7))? -5 What is the value of -3 + 8 + -6 + -5 - -10? 4 (-1 - 2) + 2 + 4 3 Calculate -1 - -9 - (39 - 30). -1 What is the value of -4 - (4 - 5 - (-3 + 1))? -5 What is the value of -1 - (4 - -2) - -11? 4 What is the value of -1 + -6 + -6 + 10? -3 Calculate -25 + 20 - (0 - (-2 + 4)). -3 Evaluate (-5 - (4 + -6)) + -2. -5 What is 3 - (0 - -3) - 1? -1 Calculate (-9 - (-7 + -9)) + -13. -6 0 - (-2 + 0 - -2 - 3) 3 What is the value of 2 + 0 + -2 - -4 - 7? -3 Evaluate -4 + -5 + (8 - 3). -4 What is the value of 0 + 9 + 7 + -8? 8 Calculate (-31 - -32) + (-4 - 1). -4 0 + 8 + -5 - 6 -3 What is the value of -5 + 0 - (5 - 8)? -2 What is 17 + -19 + 8 + 0 - 10? -4 1 + 2 - (-9 - (-10 + -1)) 1 What is the value of (4 - 13) + (-5 - -6)? -8 Evaluate 3 + (-2 - 2) + 2. 1 Calculate 3 + (-11 - -10 - (-1 - -6)). -3 What is 5 - (8 - -5) - -3? -5 What is -3 - -4 - (2 + -6)? 5 Calculate 0 + (-2 - (-3 + 4)). -3 Calculate 3 - (10 + -4) - (3 + -12). 6 What is (-133 - -137) + 0 + (0 - 0)? 4 Evaluate -1 - 0 - (3 - (1 - 3)). -6 (-12 - -3) + 8 - (4 - 7) 2 7 + -2 - 1 - (-11 - -18) -3 3 + (-3 + -2 - (-19 + 17)) 0 What is 1 + -1 - (-21 + 20)? 1 What is -10 + (1 - (-6 + 4))? -7 What is the value of 7 + (1 - (11 - 5))? 2 -5 - 2 - (0 - 13) 6 What is (5 - -4) + -21 + 17? 5 What is -7 + 1 + -4 + 8? -2 62 - 59 - (-2 + 1) 4 Calculate (-3	{ "pile_set_name": "DM Mathematics" }
earest to 1/5 in 0.3, 1/3, 2/13? 2/13 Which is the nearest to 11? (a) -8 (b) 0 (c) -2/7 b Which is the closest to -1/2? (a) -0.4 (b) 1/3 (c) 0 (d) 2/7 a Which is the closest to 0.5? (a) -2 (b) 4.2 (c) -0.5 (d) -3 c Which is the nearest to -0.1? (a) 0.4 (b) -2 (c) -1/4 (d) 3 c Which is the nearest to -0.05? (a) 0.01 (b) 3 (c) -1/2 (d) 5 a Which is the nearest to 1? (a) 4 (b) 10 (c) -7 (d) 0.2 d Which is the closest to -1/7? (a) -20 (b) -2/11 (c) -6 b Which is the nearest to -1? (a) -5 (b) 0.1 (c) 0.3 (d) -3 b Which is the nearest to -2? (a) 3 (b) 163 (c) 2 c What is the nearest to -10/3 in 0.36, 0.7, 1? 0.36 What is the nearest to -0.03 in 3/4, 9, -1, -0.5? -0.5 Which is the nearest to -2? (a) 1 (b) 0.09 (c) -4 (d) -2 d What is the closest to 1 in 12, -3, 0, -0.4? 0 What is the closest to 21 in 39, 2/17, -2/17? 39 What is the nearest to -1/5 in 4/7, 5, 3, -2? 4/7 Which is the closest to -13? (a) -6.9 (b) 0 (c) 6/7 a What is the closest to 2/7 in -38, 5/3, 5, -0.3? -0.3 Which is the closest to 2/3? (a) -1 (b) -1527 (c) 1 c Which is the nearest to 1? (a) 25/8 (b) 0.5 (c) -2 (d) -3 b What is the closest to 0 in 22, 0.2, -2/11? -2/11 Which is the closest to 1/2? (a) -8 (b) -3 (c) -0.5 (d) 27 c What is the closest to 1 in -30, 4, -0.1, -5? -0.1 Which is the closest to 4? (a) -5 (b) 0.3 (c) 0.4 c What is the nearest to -1 in 2/3, 1/9, 5, -2/5? -2/5 What is the closest to 0 in 1/10, -0.4, 5/14? 1/10 Which is the closest to 1.4? (a) 1/3 (b) -0.2 (c) -3 (d) -1 a Which is the nearest to 0? (a) 2/7 (b) 9 (c) -1/3 (d) -4 a Which is the nearest to 2? (a) -506 (b) -0.2 (c) 4/9 c Which is the closest to -1? (a) 2 (b) -0.5 (c) 28 b Which is the closest to -4/9? (a) -0.1 (b) -2 (c) 1/6 a Which is the closest to 1/38? (a) 3/4 (b) 2/13 (c) 0 (d) -4 c Which is the closest to -1? (a) 3 (b) -5/4 (c) -3 (d) 15 b Which is the nearest to 5? (a) -4 (b) -2/15 (c) 4.43 c Which is the nearest to -0.4? (a) 21 (b) -26/5 (c) 0.3 (d) 0.2 d Which is the nearest to 0? (a) -1/2 (b) -2/9 (c) 7/3 (d) 4/7 b Which is the nearest to -1? (a) 7 (b) -2/57 (c) 1 (d) 2 b Which is the nearest to -0.3? (a) -44 (b) 0.5 (c) -3 b What is the nearest to 2/7 in 0.04, -1, -0.04? 0.04 Which is the closest to -1/5? (a) 5 (b) 2/3 (c) -2/5 (d) -0.1 d What is the nearest to -0.1 in -2, 2/11, 10/9, 2/23? 2/23 What is the nearest to 0.2 in -0.2, 3, -0.05? -0.05 Which is the nearest to 0.1? (a) 3 (b) 6/5 (c) 2/3 (d) 0 d What is the closest to -0.08 in -1, 0.6, 0? 0 What is the closest to 0.1 in -129, -0.1, 2/15, 5/4? 2/15 Which is the nearest to -0.2? (a) 3/4 (b) -3 (c) 3 a What is the closest to -3 in -9, -3, 5/3, 0? -3 What is the nearest to 2/7 in -2/3, -47, 3/8? 3/8 What is the closest to 26 in -0.1, 12/11, 0.1? 12/11 Which is the nearest to 0? (a) 3/499 (b) -0.02 (c) -1/4 a What is the closest to 8 in -1/4, 0, 7/5? 7/5 Which is the closest to -0.1? (a) -1 (b) 1/20 (c) -3/8 (d) 35 b Which is the nearest to -1? (a) 0 (b) 4 (c) -1/3 (d) 5 c What is the nearest to 0.4 in -3, -0.51, 2/9? 2/9 What is the closest to 3 in 0.4, -1/4, -17, -2? 0.4 Which is the nearest to -1? (a) -52 (b) 0 (c) -1 (d) 0.1 c What is the nearest to -1 in 3, -41, 2? 2 Which is the nearest to -6? (a) 0.5 (b) 12 (c) -4 (d) 0.4 c What is the nearest to 2 in -0.5, 1/4, -0.06? 1/4 What is the nearest to 0.4 in -2/5, 130, -3? -2/5 What is the closest to 3809 in -0.2, 2, -0.1? 2 Which is the nearest to 6/17? (a) 3 (b) 1 (c) 2 (d) 4/3 b What is the nearest to 1 in -5, -1, -3/8, -0.1? -0.1 Which is the nearest to 5? (a) 0.1 (b) 2/3 (c) -2/5 b What is the nearest to -0.6 in -3, -4, -2, -0.1? -0.1 Which is the nearest to -7? (a) -12 (b) 2 (c) -0.7 a Which is the nearest to -0.2? (a) -2/5 (b) 3/8 (c) -139 a Which is the closest to -0.1? (a) -0.2 (b) 27/2 (c) 7 a What is the closest to 0.2 in 1/6, -0.07, 0.2, 0? 0.2 What is the closest to -1 in 0.2, -1/10, 5/4, 1? -1/10 Which is the nearest to -1? (a) 1 (b) 3/2 (c) 0.1 c What is the nearest to -91 in -1, -1/3, 3/7, 1? -1 Which is the nearest to -27? (a) -1/5 (b) 4 (c) -3 (d) -2/5 c What is the closest to 3/7 in 1, -1/3, 16/7, -3? 1 What is the closest to -5/11 in 0.2, 0, -2/19? -2/19 Which is the nearest to 1? (a) 1/54 (b) 0.3 (c) 5 b What is the nearest to 2 in 0.1, -0.2, 2/5, 25? 2/5 What is the closest to -2/7 in 5, 6/13, -2, 1? 6/13 Which is the closest to -0.1? (a) 5 (b) 0.33 (c) -7 b What is the nearest to 0.01 in 2, 6, -2/7, 0? 0 Which is the nearest to 13? (a) 2/21 (b) -1 (c) 4 c What is the nearest to 1 in 0.1, 1/5, -5, -0.03? 1/5 What is the nearest to 0.4 in 0.2, 2/3, -3, 0? 0.2 Which is the nearest to -0.1? (a) 5/2 (b) -4 (c) -0.5 (d) 2/7 d Which is the nearest to -1? (a) -0.1 (b) 4 (c) -2/119 (d) -4 a Which is the closest to -3/2? (a) 2 (b) 6 (c) -0.4 (d) 3 c What is the nearest to -0.1 in 2/5, 1, -6, -1/6? -1/6 What is the nearest to -305 in 4/7, 2, 0.3? 0.3 What is the closest to -1 in -0.059, -5/3, 9/7? -5/3 What is the nearest to -0.2 in 3, 0, -0.01? -0.01 Which is the nearest to 1/3? (a) -38 (b) -1 (c) -1/4 c What is the nearest to -1 in -2, 0.2, 0.04, -0.1? -0.1 What is the nearest to -23.2 in -1/7, 5, -0.3, 0.5? -0.3 Which is the nearest to 4? (a) 1 (b) -3 (c) 0.5 (d) 4/5 a What is the nearest to 1 in 0.3, 0.4, -7, -4? 0.4 Which is the closest to 0.1? (a) -2/3 (b) 4 (c) 1/2 (d) 0.1 d Which is the nearest to 12? (a) -1/67 (b) -0.3 (c) -0.5 (d) -3 a Which is the nearest to 1? (a) 2 (b) 2.8 (c) -3 (d) 2/15 d What is the nearest to -2 in -11, -0.1, 5, -20? -0.1 What is the nearest to -2/7 in 4/7, -0.01, 2? -0.01 Which is the nearest to -32? (a) 2/21 (b) -3 (c) 32/5 b Which is the nearest to 1? (a) -0.5 (b) 0.5 (c) 1 (d) -40 c Which is the closest to 2/3? (a) -1 (b) -2/5 (c) -131 (d) 6 b What is the closest to -0.1 in 1, 0.1, 2/3? 0.1 What is the nearest to 0.1 in 4/7, -29/2, 0.3? 0.3 What is the nearest to 1 in -5, 2/493, 5, 0.2? 0.2 Which is the nearest to 2/23? (a) 7 (b) 6 (c) -3 c Which is the nearest to 2/19? (a) 0.43 (b) -0.2 (c) 3/4 b Which is the nearest to -0.2? (a) -2/15 (b) 0.4 (c) -224 a What is the closest to -2/7 in 39, -1, 3? -1 What is the closest to 1 in 18, 0.3, -0.1, 0.4? 0.4 Which is the closest to -1? (a) -3/7 (b) 0.047 (c) 1/5 a What is the nearest to -0.1 in 366, -0.4, -3/4? -0.4 What is the nearest to -0.2 in 3, -0.1, 0.5, 0.3? -0.1 Which is the closest to -2/3? (a) -2 (b) -0.3 (c) 13 (d) 3 b Which is the closest to 1/5? (a) 0.03 (b) -0.1 (c) -0.03 (d) 4 a What is the nearest to 2 in 1/4, 475, 5, -2/5? 1/4 Which is the closest to 0.1? (a) 10 (b) -14 (c) -2/7 c Which is the closest to -2? (a) -5 (b) 0 (c) 0.3 (d) -0.1 d What is the closest to 0 in -0.2, -0.8, 2/7, -2/5? -0.2 Which is the closest to -1? (a) 0.4 (b) -12/23 (c) -3 (d) 4 b Which is the closest to 0? (a) 0 (b) 1 (c) -3/7 (d) 3 a Which is the closest to 1/3? (a) -4 (b) -1/7 (c) 0.9 (d) -2 b Which is the nearest to 2? (a) -2/13 (b) 2/15 (c) 2 (d) 4/5 c Which is the nearest to -1.9? (a) 3 (b) 2 (c) 0.1 (d) -0.5 d What is the nearest to 0.32 in -0.2, 2/5, -4? 2/5 Which is the nearest to -2/7? (a) -1/6 (b) 28 (c) 0.3 (d) -3 a Which is the closest to -0.013? (a) -0.04 (b) 3 (c) -4 (d) -3 a What is the nearest to 0 in -2/3, -0.2, 2, 13/10? -0.2 Which is the nearest to 2/9? (a) -772 (b) 0.07 (c) 5 b Which is the nearest to 2? (a) -66 (b) -0.4 (c) -4 (d) 0.5 d Which is the closest to -1/2? (a) -0.5 (b) 0 (c) -1.4 a What is the closest to 0 in 0, -5, -1, 28.8? 0 Which is the closest to 0? (a) -2 (b) 0.4 (c) -52 b What is the nearest to 0 in 0, 2/19, -8? 0 What is the nearest to 0.13 in -1, 0, 3/5, 0.4? 0 Which is the closest to 0.2? (a) -0.5 (b) 0.5 (c) -2/7 b Which is the nearest to -1? (a) -1 (b) 5 (c) -94 a Which is the nearest to 0.2? (a) -425 (b) -3/7 (c) 5 b Which is the nearest to 1? (a) 1 (b) -24 (c) -1/6 a Which is the nearest to 2? (a) -2/11 (b) 0.5 (c) -12 (d) -2/19 b What is the closest to -2 in -5, -4, 0.48? -4 What is the closest to 0.1 in 0.4, 0.3, -0.02, 0.14? 0.14 Which is the nearest to -1/4? (a) -2 (	{ "pile_set_name": "DM Mathematics" }
1? (a) -5 (b) 2/33 (c) -4 b What is the closest to -2/5 in -17, -4, 0.1, -1/2? -1/2 Which is the closest to 1? (a) -2 (b) 5 (c) 0 (d) 0.2 d Which is the nearest to 2.53? (a) -0.3 (b) 2/5 (c) -4 b What is the nearest to 3 in -3, -0.062, 0? 0 What is the nearest to 0.1 in 49/2, -2/5, -0.5, 2? -2/5 What is the closest to -1/3 in -1/9, 3, 2/5? -1/9 Which is the closest to 0? (a) -62 (b) -0.1 (c) -0.4 b What is the closest to -2/5 in -1/2, 0, -4, 2? -1/2 What is the nearest to -2/7 in -3, -0.59, 1/4? -0.59 Which is the nearest to -18? (a) -0.1 (b) -0.3 (c) 1 b Which is the nearest to 1? (a) 0.4 (b) 12/7 (c) 2 a Which is the closest to 2? (a) -4 (b) 2/3 (c) -1.4 (d) 2/9 b Which is the nearest to -0.1? (a) 8.1 (b) -7 (c) 0.2 c Which is the nearest to -3? (a) 0.247 (b) 0.2 (c) 3 b Which is the nearest to 1/3? (a) 0.08 (b) -3/4 (c) -0.06 a Which is the nearest to 0.03? (a) 0.1 (b) -0.1 (c) -2/127 (d) -2/7 c What is the closest to -11 in -1/37, 1/5, -0.3? -0.3 What is the nearest to -1 in -0.06, 1.4, -4/5? -4/5 What is the closest to 2/3 in 0.4, -0.4, 3, 1/6? 0.4 Which is the nearest to -1? (a) 0.4 (b) 36/7 (c) 0 c What is the closest to -17 in -2/17, -2/55, 1/6? -2/17 What is the nearest to 1/4 in 2/7, 3/7, -5/3, -4? 2/7 Which is the nearest to 1/3? (a) -1 (b) -1/3 (c) 0 (d) 3 c Which is the closest to 77? (a) -4/9 (b) -4 (c) -2 (d) 0.5 d Which is the nearest to 0.1? (a) -0.1605 (b) 1/4 (c) -2 b Which is the nearest to 0? (a) 0 (b) -2/5 (c) -0.1 (d) -1 a What is the closest to 1/2 in 1, -5, 11? 1 What is the nearest to 0.141 in -2/11, 1/3, 0.3? 0.3 What is the closest to -1 in -2/13, 1, 0.32, 0.1? -2/13 Which is the closest to -5? (a) 0.2 (b) -3 (c) -2.2 (d) -2 b What is the nearest to 0 in 9.4, 2, -0.3? -0.3 What is the nearest to -3 in 0.4, -0.4, 3? -0.4 Which is the closest to 0.1? (a) 1 (b) 4 (c) 0 (d) 19 c Which is the nearest to -0.1? (a) 26 (b) 1.03 (c) -1/5 c What is the nearest to 50 in 0.3, 2, 3? 3 What is the closest to -2/9 in 0, 2/11, -3? 0 What is the nearest to 1 in -0.3, 0.4, -2/19, 2? 0.4 Which is the closest to 3? (a) 5 (b) -4 (c) -23 a Which is the nearest to -1? (a) -2/47 (b) -0.3 (c) -5 (d) -2/5 d Which is the nearest to 0? (a) 1/3 (b) -0.4 (c) -1 (d) 1/12 d What is the closest to -4 in 0.4, -5/11, 4? -5/11 Which is the closest to -3/61? (a) 2/11 (b) -1/3 (c) 0.03 (d) -0.1 d What is the nearest to -0.1 in 4/5, 3/7, -53? 3/7 What is the closest to 2/3 in -0.54, -7, -0.3? -0.3 Which is the closest to 27/7? (a) 0.5 (b) -0.13 (c) 0.2 (d) -0.3 a What is the closest to -0.1 in 3, -2/5, -5, 1/3? -2/5 What is the closest to -1 in 8, 0, -0.5, 0.5? -0.5 Which is the closest to 0? (a) 3 (b) 6 (c) 2.3 c What is the nearest to -7/5 in -0.4, -12, 10? -0.4 Which is the nearest to 1/38? (a) -4 (b) -2 (c) 5 b Which is the closest to 0.1? (a) -0.09 (b) 8 (c) 0.5 (d) 1/11 d Which is the nearest to -1? (a) -2 (b) -2/279 (c) -12 (d) -1/3 d Which is the nearest to 1/4? (a) -1 (b) 6 (c) -1/5 c Which is the closest to 1/4? (a) 59 (b) -0.3 (c) -2 (d) -0.103 d What is the nearest to 0.7 in 2, 2/3, -0.4, 0.2? 2/3 What is the closest to 0.1 in -0.24, 0.4, 0.3? 0.3 Which is the nearest to -0.1? (a) -0.4 (b) 3 (c) 1/4 a What is the closest to -0.4 in 2, -2, 0, 3/5? 0 What is the nearest to 3 in -0.5, 4, 2/5, -2/13? 4 What is the closest to -0.2 in 2, 5, -67.2, -0.1? -0.1 What is the closest to 4 in -1, 4/3, 0.5, -0.01? 4/3 Which is the nearest to 2? (a) -7 (b) 5 (c) -0.02 (d) 0.4 d Which is the nearest to -1? (a) 0.4 (b) -1/7 (c) -2.5 (d) 0.7 b What is the nearest to -0.1 in 1/3, 0.1, -4, 6/31? 0.1 What is the nearest to 1/4 in 2/5, -1, 4/253? 2/5 What is the closest to 9 in -0.9, 0, 2? 2 Which is the nearest to 0.1? (a) 0 (b) 2 (c) -77 (d) 1 a What is the nearest to -0.0383 in -2, 3, -3? -2 What is the closest to 1 in -0.4, 0, -403? 0 What is the closest to 3 in 4, 1/2, -1.5? 4 What is the nearest to -2 in 1, -2, 3/7, -3/2? -2 What is the closest to 1 in 55, 2/7, -3? 2/7 Which is the nearest to 5/4? (a) 3 (b) -0.04 (c) 5 b Which is the nearest to -0.1? (a) -0.5 (b) 9 (c) -1/14 c What is the nearest to 12 in -5, 0.4, 5? 5 Which is the closest to 3? (a) 11 (b) -0.4 (c) 2/5 (d) -0.03 c What is the closest to 1/2 in -0.1, 0.4, 33/23? 0.4 What is the nearest to -2/7 in 9, -4.1, -2/9? -2/9 What is the nearest to -2/11 in 4, -197, 1/5? 1/5 Which is the nearest to 2/5? (a) 1 (b) 14 (c) -5 a What is the closest to 2/7 in -0.02, -1, -5/2, 1? -0.02 What is the closest to 11 in -0.3, -1, 2/27, -3? 2/27 Which is the closest to 1? (a) 12 (b) 6 (c) 0.4 (d) -0.1 c Which is the nearest to 0.4? (a) 18 (b) -4 (c) -8 (d) 4 d What is the closest to 0.2 in -0.02, 0, 1.4? 0 What is the nearest to 2 in 3, -3/4, -3? 3 What is the closest to -2/9 in -7.18, -2, -0.4? -0.4 What is the nearest to -0.1 in -1.22, -2, 2/3? 2/3 Which is the nearest to 1/4? (a) -4 (b) -1/3 (c) 0.3 (d) 3/4 c What is the closest to 0 in 3/62, -3, -4? 3/62 Which is the nearest to -1? (a) 4/3 (b) -5 (c) 0.1 (d) -1/4 d Which is the nearest to -2/7? (a) 24 (b) 5 (c) -0.1 c Which is the closest to -2/9? (a) -2/9 (b) -0.1 (c) 0.4 (d) 0.2 a What is the nearest to 0 in -0.4, -2, -8? -0.4 Which is the closest to -0.2? (a) -2/9 (b) -5 (c) 0.1 (d) -0.52 a What is the nearest to -4 in -1.8, 0.2, 37? -1.8 Which is the closest to -3? (a) -4 (b) -35 (c) 1/2 (d) -0.5 a Which is the nearest to -26? (a) 0.9 (b) -1 (c) 0.2 (d) 5 b Which is the closest to -0.1? (a) 1.3 (b) 6/11 (c) 2/21 (d) 1 c Which is the closest to -3/5? (a) -0.01 (b) -5 (c) 2/7 (d) 19 a Which is the nearest to -2? (a) 3 (b) -0.64 (c) -0.4 (d) -0.2 b What is the nearest to -1 in -2, 5, -6, 1/630? -2 What is the closest to -3/2 in -15, -2, 0.06, 0.2? -2 What is the closest to 17 in 3/5, -1, -4? 3/5 What is the closest to 3 in -0.5, -11, 26? -0.5 What is the closest to -0.1 in -698, -0.2, -4? -0.2 Which is the closest to -1/2? (a) 20 (b) -2/19 (c) -0.3 c What is the closest to 1 in -0.1, -1/2, 245? -0.1 Which is the nearest to -0.1? (a) -0.3 (b) -0.7 (c) 2 (d) 1 a What is the closest to 2/65 in -4, 1/3, -2? 1/3 Which is the closest to -23/2? (a) 0.1 (b) 5 (c) 1 (d) 0 d What is the nearest to -1 in -0.4, -7, -8? -0.4 What is the nearest to 0 in 3, -2/11, -2/9? -2/11 What is the nearest to -0.1 in 0.3, -2, -16/3, -2/13? -2/13 What is the nearest to -0.4 in 4/7, 1/6, -2/17, 0.3? -2/17 What is the closest to 1/2 in -7/2, 4, 2? 2 What is the nearest to 1 in -0.2, 1/2, 28, 25? 1/2 Which is the nearest to 6/17? (a) 0.1 (b) 1/7 (c) -2/5 (d) 3 b Which is the closest to -1/4? (a) 1 (b) -1/4 (c) -0.7 b What is the nearest to -5 in -0.16, 0.3, 0.1, -4? -4 What is the closest to -7/3 in 84, -4, -1/5? -4 Which is the closest to 1/3? (a) -1/4 (b) 1 (c) 0.4 (d) -9.1 c What is the nearest to 0.3 in -0.3, 4, -4, 1? -0.3 Which is the nearest to -2? (a) -0.3 (b) -2 (c) -31/4 b Which is the closest to 0.2? (a) -5 (b) -2 (c) 0 (d) -3 c What is the nearest to 3/2 in -225, -0.1, 0? 0 What is the nearest to -2 in 4/3, -0.4, -6, 3? -0.4 Which is the nearest to 0.1? (a) 13 (b) 3.3 (c) 2 c Which is the closest to 151/2? (a) -5 (b) -2/3 (c) -3 b Which is the nearest to -12? (a) 0.4 (b) -0.1 (c) -4 c Which is the closest to 0.1? (a) -0.1 (b) -2/11 (c) -560 a Which is the nearest to -2/11? (a) 0.11 (b) 4 (c) 3/5 (d) 1 a Which is the nearest to 0.05? (a) 4 (b) -2/9 (c) 8 (d) -0.3 b What is the closest to 4 in -4, 4, 3/98, 5? 4 What is the nearest to 0.43 in 2, -4, 2/17, 3/8? 3/8 Which is the closest to -0.9? (a) -2 (b) 0.02 (c) 2/3 (d) -0.3 d What is the closest to -1/3 in 3, -1, 0.2, 2/35? 2/35 Which is the nearest to 1? (a) -1/138 (b) -3/5 (c) 4/7 c Which is the nearest to 235? (a) -4 (b) 0.09 (c) -2 b Which is the closest to -1? (a) -2 (b) -0.08 (c) 2/7 b Which is the closest to -5? (a) -4/13 (b) 5 (c) 2 a What is the nearest to 0 in 0.05, 0, 4, -0.1? 0 What is the nearest to 33 in -2/7, -1, 5, -0.2? 5 Which is the nearest to 663? (a) -4 (b) -2/5 (c) 1 c Which is the closest to 15? (a) -0.4 (b) 8/7 (c) -0.2 (d) 0 b Which is the closest to 1	{ "pile_set_name": "DM Mathematics" }
e the third derivative of 0w7 + 0w*4 + 0w*3 - w - 1/24w*6 - 1/48w*8 + 0 + 37w*2 + 13/4w*5. Find the third derivative of j(q) wrt q. -420q*2 - 30 Let s(c) be the first derivative of -3/2c*2 + 7/5c*5 + 1/2c*4 + 0c*3 - 8 + 0c. What is the second derivative of s(w) wrt w? 84w2 + 12w Let h(d) = 2d3 + 7d*2 - d - 17. Let x be h(6). Differentiate -27s*4 + 661s - 184 - xs wrt s. -108s*3 Let a = 507 - 407. Find the first derivative of -233k*4 - 7k + 7k + 401k*4 - a wrt k. 672k*3 Let x(y) = 54y*3 + 45y*2 + 19y - 21. Let z(t) = -54t3 - 38t*2 - 20t + 24. Let i(o) = 5x(o) + 6z(o). Find the second derivative of i(s) wrt s. -324s - 6 Suppose 220 = -0q + 5q + 3o, -4o - 144 = -4q. Let g = -36 + q. Find the third derivative of -177l2 + 3l*5 + 11l*g + 184l*2 wrt l. 840l*2 Suppose 3x - 61 + 49 = 0. What is the third derivative of 0 + 6o3 - 3o*2 - 5o*3 + 20o + 0 + xo2 - 65o*4 wrt o? -1560o + 6 Let y(q) be the second derivative of 0 + 140q + 37/10q*6 + 201/2q*2 + 0q*4 + 1/3q*3 + 0q*5. What is the second derivative of y(i) wrt i? 1332i*2 Let g = 16 - 37. Let d be (-13 - g)(0 + 1). What is the derivative of 31k4 - 8 - 27 + dk*4 + 10 wrt k? 156k*3 Let v(p) = 3p + 2. Let s be v(9). What is the derivative of -11m - 9m + 27 - sm - 8 wrt m? -49 Let o be 7 - (-1 - -7 - 2). Suppose -of + f = -6. What is the derivative of 21if + 11 + 25i*3 - 62i*3 wrt i? -48i2 Let l(d) be the first derivative of d5/5 + 263d4/4 + 5d*2/2 - 87d + 762. Find the second derivative of l(f) wrt f. 12f2 + 1578f Let k(m) = 828m2 + 12m - 1089m2 + 18 + 2. Let j(t) = 783t*2 - 37t - 55. Let p(f) = -4j(f) - 11k(f). Find the second derivative of p(a) wrt a. -522 What is the third derivative of -43398j2 + 0j*4 + 102j + 0j4 + 43409j*2 + 4j*6 - 9j - 3j3 wrt j? 480j*3 - 18 What is the derivative of 195f*4 + 247 - 500 + 381f*4 - 992 - 693 wrt f? 2304f*3 Let c = -28 + 27. Let s be (c + 3)/(-1) - 60/(-6). What is the second derivative of 2a - sa + 2a*5 + 3a*5 + 13a*5 wrt a? 360a*3 Let h(d) = -6895d - 6722. Let v(b) = 985b + 960. Let x(s) = 4h(s) + 27v(s). What is the first derivative of x(k) wrt k? -985 Let m(w) be the first derivative of -472w*4 - 13w*3/3 + 65w*2/2 - 1449. What is the third derivative of m(q) wrt q? -11328 Suppose 4 = -15i + 109. Find the third derivative of 6r6 + 87r*6 - 2 - 4 + ir*6 - 13r*2 wrt r. 12000r*3 What is the third derivative of -7995p*2 - 8635p*2 + 2p*5 + 18623p*2 - 672p*6 wrt p? -80640p*3 + 120p*2 Let d = 100 - 96. Differentiate 55 + 20g*2 + 5gd - g2 + 7 - 4g4 with respect to g. 4g*3 + 38g Let q = 277 - 275. Differentiate 476dq - 4d*3 - 5d + 26 + 477d2 - 953d*2 wrt d. -12d*2 - 5 Let q(h) = 667h*3 - 3h*2 - 16h - 311. Let a(r) = -666r3 + 2r*2 + 10r + 312. Let g(j) = 3a(j) + 2q(j). What is the derivative of g(c) wrt c? -1992c2 - 2 Suppose 100 - 98 = -2r. Let x(a) = -19a - 63. Let v(j) = -2. Let m(p) = rx(p) - 3v(p). What is the first derivative of m(g) wrt g? 19 Let i(n) = n + 0n*2 - 4n - n*2 + 4. Let q be i(-3). Find the second derivative of -9s*q + 15s - 17s4 + 28s*4 wrt s. 24s*2 Let b = 2566 + -15385/6. Let l(f) be the first derivative of 0f + 13 + 0f2 + 2f*3 + 0f*5 + 0f*4 + bf*6. What is the third derivative of l(n) wrt n? 660n*2 Suppose 0r + 648 = 18r. What is the derivative of -168 + 41s + 55s + 16s + rs + 41s wrt s? 189 Let q be 15/3-1 + -2 + 10. Find the second derivative of 5y*3 + 2y + qy4 + 5y*3 + 6 + 2y + 6y3 wrt y. 36y*2 + 96y Find the third derivative of -4g5 + 3g*5 + 22g*5 - 2g*5 - 12g*5 - 188g*6 - 4212g*2 wrt g. -22560g*3 + 420g2 Let t = -520 + 12497/24. Let o(h) be the third derivative of 0 + h3 - 10h2 + th*4 + 0h. What is the first derivative of o(q) wrt q? 17 Suppose 0 = -5n - 5y + 230, 3n - 4y = -28 + 145. Find the second derivative of -nb + 19b*5 - 21b + 5b4 + 15b - 3b4 wrt b. 380b*3 + 24b*2 Let l(n) be the third derivative of -257n*4/6 - 383n*3/6 - 54n*2. What is the derivative of l(k) wrt k? -1028 Let f = 17921 + -17919. Let z(j) be the first derivative of 0j - 5 + 0j3 + 0j*5 + 0j*4 + 3/2j*6 - fj*2. Find the second derivative of z(b) wrt b. 180b*3 What is the derivative of -257u*3 + 1193u*3 + 27 + 500u*3 + 269u*3 + 2u*3 wrt u? 5121u*2 Suppose -195k = 52k - 3705. Let w(y) be the second derivative of -14y + 0 - ky2 + 0y*3 - 5/2y*4. Find the first derivative of w(a) wrt a. -60a Let p(i) = i*3 + 11i*2 + 20. Let a(l) = -3l*3 - 21l*2 - 40. Let m = 70 - 77. Let o(x) = mp(x) - 3a(x). Find the first derivative of o(k) wrt k. 6k*2 - 28k Let b = 11677 + -4331. Suppose -5v + b = -n - 0n, 5v - 7362 = -3n. Find the third derivative of 11p5 - vp*2 + 10p*5 + 1455p*2 wrt p. 1260p*2 Find the first derivative of -21j*3 - 55j*3 - 36j*3 - 19j*3 - 3641 + 17j*3 wrt j. -342j*2 What is the second derivative of 5k - 24 - 6k + 32 - 16 - 424k*2 wrt k? -848 Let b be (-5 - -5)/3 + 29/1. Let q = b + -26. What is the third derivative of 22x*2 - 11x*3 + 31x*6 + 11xq + x6 wrt x? 3840x3 Let a(i) = -4185i - 4312. Let x(k) = -1394k - 1445. Let u(b) = 2a(b) - 7x(b). Differentiate u(m) with respect to m. 1388 Let c(q) = q2 - 3q - 4. Let s be c(5). Suppose 27426 + 167706 = 101h. Find the third derivative of -hn + sn4 + 1932n + 28n2 wrt n. 144n Let z(k) = 85k3 + 103k2 - 6. Let q(p) = p2 + 1 + 2p + p3 - 4p + 2p. Let v(o) = -6q(o) - z(o). Find the third derivative of v(r) wrt r. -546 Let f(h) be the first derivative of 79h6/3 - h3/3 + 96h - 1526. Find the third derivative of f(g) wrt g. 9480g2 What is the derivative of -17i*4 - 30477i*2 - 3i + 2846 + 60895i2 - 30475i*2 wrt i? -68i*3 - 114i - 3 Let i(k) be the second derivative of 0 + 0k3 - 81/2k*2 + 8k - 107/6k4. Differentiate i(a) wrt a. -428a Suppose 41l - 35l = 504. Differentiate 32y4 - 2y*4 + 6y*4 + l wrt y. 144y*3 Let n(h) = 2h. Let f(d) = -6d2 - 444d + 516. Let w(c) = -f(c) + 8n(c). Differentiate w(g) with respect to g. 12g + 460 Let w(b) = -1784b + 1259. Let p(c) = 3570c - 2518. Let g(l) = 6p(l) + 11w(l). What is the derivative of g(z) wrt z? 1796 Let u(i) be the second derivative of 2323i6/30 - i3/6 - 65i*2/2 + 12i - 19. What is the second derivative of u(z) wrt z? 27876z2 Let u(v) be the third derivative of 14/3v*3 + 0v*6 - 1/30v*5 + 83/210v*7 - 8v + 0 + 0v4 + 15v*2. What is the third derivative of u(a) wrt a? 1992a Let u(s) = 942s2 - 252s + 6. Let q(t) = -15t2 - t - 2. Let b(w) = -3q(w) - u(w). What is the second derivative of b(f) wrt f? -1794 Let f = 5482 - 5482. Let p(q) be the first derivative of 21 - 2/3q3 + fq*4 + 0q*2 - 14/5q*5 + 0q. Find the third derivative of p(o) wrt o. -336o Let y(c) = 23c + 118. Let u be y(-5). Differentiate 112au - 181 + 2a + 53 - 161a3 + 92a*3 wrt a. 129a*2 + 2 Suppose 10q - 14q = -12. Suppose 2u - 6 = 2p, u = 4p - 0p + q. Find the second derivative of -18k - 8ku + 2k + 14k + 11k wrt k. -48k Let m(i) = 4i + 10. Let a be (5/(100/(-8)))/(2/(-20)). Let n be m(a). Differentiate n + 3y3 - 7y*3 - 9y*3 - 3y*3 wrt y. -48y*2 Find the third derivative of -16g*2 - 58g*3 - 974g + 980g + 302g*3 wrt g. 1464 Let q(t) be the first derivative of 13t7/168 + t5/30 - 5t3/3 + 111. Let d(k) be the third derivative of q(k). Find the second derivative of d(b) wrt b. 390b Let n be 10 + (-9 - -4) - 7 - -791. Find the second derivative of d*2 - 2d + 764d5 + nd*5 - 1460d*5 + 1 - 2d*2 wrt d. 1860d*3 - 2 Let o(y) be the second derivative of -218y6/15 + y5/20 - 95y2 - 1462y. What is the first derivative of o(g) wrt g? -1744g3 + 3g*2 Let w be (-1)/3 + (-26)/(-6). Suppose -5o - 336 = wu - 8u, -4u + 336 = -o. Find the first derivative of -4q*2 - 55 - 52 + 11q*2 + u wrt q. 14q Differentiate 288618z4 - 569 + 3z*2 - 288706z*4 - 4z*2 with respect to z. -352z**3 -	{ "pile_set_name": "DM Mathematics" }
6. Let p(v) = 2v2. Calculate m(p(z)). -60z*4 + 6 Let i(l) = -2l - 3. Let a(m) = -5m - 7. Let y(n) = -6a(n) + 14i(n). Let o(x) = 0x2 + x2 + x*2 - 8x*2. What is y(o(s))? -12s*2 Let p(d) = -2d*2 + 1159d. Let t(m) = -2m2. Calculate p(t(g)). -8g*4 - 2318g*2 Let g(x) = 21x. Let s(v) be the third derivative of v*4/8 - 3v*2 + 13v. Determine s(g(q)). 63q Let v(c) = -14c*2. Let h(s) = 7s. Determine v(h(t)). -686t2 Let a(j) = -4j. Let o(b) be the third derivative of -b4/12 - b2. Calculate a(o(l)). 8l Let j(r) be the second derivative of r7/2520 - 2r*4/3 - 5r. Let b(d) be the third derivative of j(d). Let m(x) = 18x2. What is b(m(a))? 324a*4 Let j(l) be the first derivative of 2l2 + 2. Let o(y) = -y2 + 2y2 - 4y*2 + 4y*2. Give o(j(r)). 16r*2 Let i(c) = -9c. Let m(q) = 51q. Calculate i(m(n)). -459n Let q(h) be the first derivative of h*5/30 - 2h*2 - 1. Let d(m) be the second derivative of q(m). Let u(b) = 4b*2. Calculate u(d(s)). 16s*4 Let q(v) = 6v. Let f(m) = m + 4. Let y(l) = -l - 5. Let w(r) = -5f(r) - 4y(r). Give q(w(k)). -6k Let y(c) = 0 + 0 + 6c*2. Let w(j) = -48j + 48j - j2. Calculate w(y(a)). -36a*4 Let u(r) = r - 5. Let b be u(11). Let n(m) = 4m - 10m + 7m*2 + bm. Let f(v) = v*2. Determine n(f(x)). 7x*4 Let x(r) = 17r2. Let w(y) = y2 - 260. Give x(w(t)). 17t4 - 8840t*2 + 1149200 Let p(h) = -3h. Let i(a) = 3a + a - 3a + 0a. Let n(x) = -12x. Let z(v) = -6i(v) - n(v). What is z(p(d))? -18d Let i(t) = 5t2. Let z(d) = -6721 - 9d*2 + 6721. Calculate i(z(y)). 405y4 Let f(a) be the first derivative of a2/2 + 2. Let t(o) = 2o2. Let m(i) = -3i*2. Let d(r) = -5m(r) - 7t(r). Determine d(f(y)). y2 Let k(g) = -7g. Let y(h) = 8h. Let f(q) = -4k(q) - 3y(q). Let b(w) = 10w*2. What is f(b(d))? 40d*2 Let q(j) = 3 - 3 - 7j*2 - 5j. Suppose -5k + 20 = -3k. Let n(i) = -4i2 - 3i. Let w(z) = kn(z) - 6q(z). Let c(b) = -3b2. Give w(c(t)). 18t*4 Let a(y) = -2y. Let d(o) = 18o2 - 2o. Give d(a(n)). 72n2 + 4n Let d(p) = 8p. Let u(j) = -188j. What is d(u(r))? -1504r Let b(o) = -4o. Suppose 5 - 17 = -4a. Let q(i) be the second derivative of -3i - 1/3ia + 0i*2 + 0. What is b(q(u))? 8u Let n(b) = 6b - 4. Let h(v) = -5v + 3. Let x(c) = 4h(c) + 3n(c). Let r(w) = 11w2 + 13. Let k(y) = 5y*2 + 6. Let f(q) = 13k(q) - 6r(q). Give f(x(s)). -4s2 Let k(m) = m2. Suppose -h = 2h - 6. Let s(n) = nh + 4n*2 - 6n*2 + 6n*2. What is s(k(t))? 5t*4 Let p(g) = -8391g. Let q(w) = w*2. What is p(q(j))? -8391j*2 Let f(k) = k. Let m(z) = 2z*2 + 3z*2 - 5z*2 - 3z*2. Determine m(f(n)). -3n*2 Let i(b) = 0b2 - b2 - b*2. Let n = -15 - -25. Let m(o) = 8 - 18 + n + 2o. Calculate m(i(d)). -4d2 Let r(y) = -3y. Let p(z) = -2392z. Determine p(r(q)). 7176q Let n(x) = -9x. Let k(b) = -b - 1. Let u(d) = 9d + 5. Let o(y) = -5k(y) - u(y). Determine n(o(l)). 36l Let p(h) = 29h2. Let u(c) = 7c*2 - 3c + 3. Let l(d) = 9d2 - 4d + 4. Let x(y) = -3l(y) + 4u(y). Calculate x(p(m)). 841m4 Let y(o) = -4o*2. Let l(b) = -6b. Let s(q) = -5q. Let v(t) = -2l(t) + 3s(t). What is y(v(k))? -36k*2 Let m(p) = 5p - 2. Let v(t) = -2t. Determine m(v(n)). -10n - 2 Let q(n) = -2n2. Suppose 2t - 2r = 2r - 12, -4r + 8 = 0. Let y be -1(0 - t)-2. Let d(h) = -yh + 2h + h. Calculate q(d(u)). -2u*2 Let w(d) = -3d + 0d + 5d - d. Let f(h) be the first derivative of -2h3 - 1. What is f(w(r))? -6r*2 Let w(f) be the first derivative of 38f3/3 + 8. Let b(m) = -m2. Calculate b(w(h)). -1444h4 Let s(d) = 2d. Let i(z) = -2z. Let m(k) = -2i(k) - 3s(k). Let l(v) = -v + 5. Let b(t) = t - 7. Let f(x) = 5b(x) + 7l(x). Give m(f(p)). 4p Let y(i) = 3i2. Let c(s) = 10s*2 - 43. What is c(y(r))? 90r*4 - 43 Suppose -2j + 2n = -34, j + 2n = -0n + 20. Suppose -4 = -4g + y + 7, 0 = -5g - 3y + j. Let t(o) = o*2 - g + 3. Let b(z) = 2z. Calculate b(t(h)). 2h2 Let m(h) = 4h. Let j(w) be the first derivative of w + 2. Let v(f) = -f - 6. Let k(q) = -6j(q) - v(q). Determine m(k(y)). 4y Let f(m) = 5 - m - 5. Let p(z) = -8z + 8z + 0z + 2z. Determine p(f(j)). -2j Let b(p) = -p2. Let d(z) = 7z + 8z - 10z. Calculate b(d(i)). -25i2 Let x(o) be the third derivative of 7o*4/12 + 9o*2. Let j(z) = -z. Give j(x(q)). -14q Let x(a) = 2a2. Let v(w) = -w - 3 - 1 + 4. Give v(x(p)). -2p*2 Let m = 22 - 20. Let w(k) = -10k*2 + mk*2 + 6k*2. Let h(u) be the second derivative of -5u*4/12 + u. Give w(h(o)). -50o*4 Let f(w) = -8 + 8 + 2w*2 + 0w*2. Let q(v) = -9v*2. Calculate f(q(g)). 162g*4 Let h(y) = 10y + 2y - 14y + y. Let t(r) = 36r. Calculate h(t(k)). -36k Suppose -7d - 20 = -5b - 2d, 0 = -4b - 5d - 20. Let g(y) = y + y + y + b. Let s(z) be the third derivative of z4/24 + 35z*2. Calculate g(s(a)). 3a Let p(k) be the third derivative of k*5/30 + 2k*2 - 3. Let w(n) = 4n*2. What is w(p(z))? 16z4 Let w(k) = k2. Let r(h) = 314h. Determine r(w(s)). 314s*2 Let z(q) = -3q + 5q - 3q*2 - 2q. Let j(h) = -8h. Determine j(z(g)). 24g*2 Suppose 0p + 5p - 5 = 0. Let w(g) be the first derivative of -p + 1/2g*2 + 0g. Let c(j) = -j. What is c(w(f))? -f Let d(w) = 2w2 + 0 + 2 - 2. Let q(f) be the second derivative of -f4/2 - f. What is q(d(s))? -24s*4 Let h(m) = 4m*2. Let p(j) = -10j. What is h(p(k))? 400k2 Let j(l) = -3l + l + 0l. Let h(w) = 7w*2 - 6w - 6. Let d(z) = 2z2 + z2 + z + 1 - 3z2 - z2. Let f(s) = 6d(s) + h(s). Calculate j(f(r)). -2r*2 Let n(s) = -3s2. Let l(b) be the third derivative of b4/24 + 3b2. Give l(n(u)). -3u*2 Let g(h) = 4h - 2. Let u be g(3). Let k(b) = -22b + 11b + ub. Let a(i) = -9i*2. Give k(a(q)). 9q*2 Let c(f) = 2f*2. Let y(q) = -2q*2 + 3q - 3. Let k be y(2). Let l(o) = 6o2 + 5. Let d(g) = -5g*2 - 4. Let m(w) = kd(w) - 4l(w). What is m(c(u))? 4u4 Let f(k) be the first derivative of -k2/2 - 5. Let q(m) = 4 - 4 + 2m2. Determine q(f(r)). 2r*2 Let s(v) = 2v. Let k(l) = -116l - 2. What is s(k(a))? -232a - 4 Let w(v) = -2v2. Let o(j) = j2 - 742. Calculate w(o(a)). -2a*4 + 2968a*2 - 1101128 Let z(j) = -3j*2 + 11. Let x(w) = 32w. Give x(z(h)). -96h2 + 352 Let t = -10 - -12. Let j(u) = -4u2 + u2 + 6ut. Let c(x) = 2x. Calculate c(j(k)). 6k2 Let x(g) = g. Let m(q) = 7 - 7 - 4q*2 + 2q*2. What is m(x(s))? -2s*2 Let b(d) = -2d. Let k(c) = 15 - 36 + 22c + 21. Give k(b(x)). -44x Let v(p) = -4p2. Let j be (-2)/10 + (-72)/(-10). Let b = j - 5. Let m(u) = 4u*2 - 4u2 - ub. Calculate m(v(i)). -16i4 Let x(r) = r. Suppose 2u + 14 = 9u. Let i(f) be the second derivative of 0 + 0f*2 + uf - 1/2f3. What is x(i(o))? -3o Let q(f) = -1139f. Let b(s) = s2. Determine b(q(t)). 1297321t*2 Let j(k) = -k + 160 - 160. Let t(x) = 20x*2. Give t(j(l)). 20l*2 Let l(c) = -4c*2 - 41c. Let b(o) = 2o2. Determine l(b(j)). -16j*4 - 82j*2 Let l(k) = 844k. Let v(q) = q. What is l(v(m))? 844m Let o(m) = -m + 9. Let w be o(7). Let i(z) = 2z2 - w + 1 + 1. Let u(f) = f2. What is i(u(x))? 2x4 Let t(s) be the third derivative of -s5/60 + s2. Suppose -2y - 10 = -4h - y, -4h + 14 = -3y. Let g(p) = -hp2 + p2 + 0p2. Determine t(g(c)). -c4 Let p(o) be the second derivative of -o4/6 + 46o. Let r(w) = -55w2. What is p(r(n))? -6050n*4 Let s(h) = 3h. Let m(k) = 2k. Let d(n) = 4m(n) - 3s(n). Let y(t) = -7t + 7t - 7t. What is d(y(i))? 7i Suppose -3k = k - 52. Suppose -g = -s - k, 4 = -g - 2s + 5. Let d(q) = gq - 9q - 3q*2. Let o(n) = n. Give o(d(v)). -3v*2 Let r(p) = 4p*2. Let h(b) be the second derivative of -11b*4/12 + 8b. Give h(r(d)). -176d4 Let y(q) = -141q + 5. Let t(o) = -2890o + 102. Let b(c) = -5t(c) + 102y(c). Let i(h) = h. Calculate i(b(z)). 68z Let w(d) be the second derivative of d*3/2 - 2d*2 - 14d. Let c(u) = -u*2. Give w(c(g)). -3g2 - 4 Let d(p) = -p2. Let h(o) = -32o2. What is h(d(b))? -32b*4 Let a(l) = 7l2. Let q(i) be the second derivative of -i3/6 + 4i. What is q(a(j))? -7j*2 Let o(c) = c. Let p be 6/93/2.	{ "pile_set_name": "DM Mathematics" }
Four letters picked without replacement from uuucuuuu. Give prob of sequence uuuu. 1/2 Two letters picked without replacement from {d: 2, e: 3, m: 4}. What is prob of sequence em? 1/6 Three letters picked without replacement from {j: 4, b: 2, d: 7}. What is prob of sequence ddd? 35/286 Two letters picked without replacement from jttbtjttjffbt. What is prob of sequence jb? 1/26 Four letters picked without replacement from oohhkomohhokhozoh. Give prob of sequence kmok. 1/4080 Three letters picked without replacement from toog. What is prob of sequence gto? 1/12 Two letters picked without replacement from {n: 1, q: 5, o: 3, u: 1, x: 1}. What is prob of sequence un? 1/110 Three letters picked without replacement from yyyyyyyyyy. Give prob of sequence yyy. 1 Calculate prob of sequence lra when three letters picked without replacement from {r: 1, a: 1, l: 2, x: 1}. 1/30 Three letters picked without replacement from {n: 3, v: 4, e: 1, z: 7, r: 1}. Give prob of sequence zze. 1/80 Four letters picked without replacement from xxxxx. What is prob of sequence xxxx? 1 Calculate prob of sequence pvjk when four letters picked without replacement from jkjkjjkkjkkyvjjpkyj. 7/11628 Three letters picked without replacement from {p: 2, g: 2, f: 1, l: 6, b: 1}. What is prob of sequence lpf? 1/110 Two letters picked without replacement from zhzzzddhzhhzhzhh. What is prob of sequence hh? 7/40 Three letters picked without replacement from tbtbqttbttwqtztb. What is prob of sequence qtz? 1/210 Three letters picked without replacement from saqadub. What is prob of sequence qud? 1/210 Calculate prob of sequence dw when two letters picked without replacement from gwndwwtw. 1/14 Three letters picked without replacement from myyymyyymyymyyymyyy. Give prob of sequence ymm. 140/2907 Two letters picked without replacement from {b: 2, z: 1, u: 2}. What is prob of sequence bz? 1/10 Calculate prob of sequence rmqc when four letters picked without replacement from {q: 7, c: 1, m: 2, r: 10}. 7/5814 Calculate prob of sequence tcdc when four letters picked without replacement from rzddzrdrtrrrrtzdzrc. 0 Three letters picked without replacement from {k: 6, x: 1, q: 3, n: 3, f: 5, c: 1}. What is prob of sequence cxq? 1/1938 What is prob of sequence juv when three letters picked without replacement from {v: 5, j: 1, e: 9, u: 1}? 1/672 What is prob of sequence iggg when four letters picked without replacement from giggggiggggggggiggig? 112/969 Two letters picked without replacement from xxxxxxjxxxxxxxxxxxxx. Give prob of sequence xx. 9/10 What is prob of sequence zjjv when four letters picked without replacement from {j: 2, w: 2, z: 1, y: 1, l: 2, v: 1}? 1/1512 What is prob of sequence mtt when three letters picked without replacement from {m: 6, t: 6}? 3/22 Three letters picked without replacement from owwwwoohwoooo. What is prob of sequence who? 35/1716 Four letters picked without replacement from {c: 5, a: 14}. Give prob of sequence aaca. 455/3876 Two letters picked without replacement from vrrrqhrhurvrrdhdh. Give prob of sequence uv. 1/136 Calculate prob of sequence kzk when three letters picked without replacement from zkzzzzzzkzzz. 1/66 Calculate prob of sequence vj when two letters picked without replacement from {v: 2, j: 3}. 3/10 Four letters picked without replacement from vvooeovvveo. What is prob of sequence evev? 1/198 Three letters picked without replacement from uyxxkhdy. What is prob of sequence ydu? 1/168 Calculate prob of sequence ec when two letters picked without replacement from ecececccceec. 35/132 Two letters picked without replacement from {m: 5}. Give prob of sequence mm. 1 Three letters picked without replacement from {c: 1, q: 3, k: 1, y: 5, i: 1}. Give prob of sequence kyc. 1/198 Two letters picked without replacement from nuxhnhzhzsznnzxxnz. Give prob of sequence ns. 5/306 Four letters picked without replacement from {w: 3, s: 3, h: 3, a: 2, o: 5}. What is prob of sequence wwaw? 1/3640 Calculate prob of sequence zqbo when four letters picked without replacement from {y: 2, o: 2, z: 4, q: 4, b: 2}. 8/3003 Calculate prob of sequence as when two letters picked without replacement from assasaasaasaasaaaa. 4/17 What is prob of sequence aat when three letters picked without replacement from {t: 1, x: 8, a: 7, j: 4}? 7/1140 Calculate prob of sequence xx when two letters picked without replacement from {x: 15, d: 5}. 21/38 Two letters picked without replacement from kieggfi. Give prob of sequence kg. 1/21 Two letters picked without replacement from {z: 3, f: 1}. What is prob of sequence zf? 1/4 Calculate prob of sequence fe when two letters picked without replacement from {w: 1, f: 1, q: 2, e: 4}. 1/14 Calculate prob of sequence czci when four letters picked without replacement from eeezizwcqeeczcceez. 1/1530 Calculate prob of sequence uuuu when four letters picked without replacement from {u: 9}. 1 What is prob of sequence cw when two letters picked without replacement from {z: 2, c: 6, g: 1, w: 2, k: 8, s: 1}? 3/95 Two letters picked without replacement from beztvov. What is prob of sequence zt? 1/42 Two letters picked without replacement from llblbllbldld. Give prob of sequence lb. 7/44 Four letters picked without replacement from mmmmhllmklkkl. What is prob of sequence khlk? 1/715 Two letters picked without replacement from {v: 6, z: 3, n: 1, h: 4, b: 1}. Give prob of sequence hh. 2/35 What is prob of sequence rfrh when four letters picked without replacement from {h: 3, w: 2, r: 8, f: 4, s: 2}? 7/969 What is prob of sequence vxhh when four letters picked without replacement from hxhhhhhqqxv? 1/132 What is prob of sequence agg when three letters picked without replacement from saaglgv? 2/105 Three letters picked without replacement from {x: 1, u: 2, p: 4, i: 1}. Give prob of sequence xip. 1/84 Four letters picked without replacement from {c: 8, g: 3}. Give prob of sequence cgcc. 7/55 Two letters picked without replacement from {p: 4, v: 3, m: 6, d: 2, t: 2}. What is prob of sequence dv? 3/136 Calculate prob of sequence oooo when four letters picked without replacement from {z: 4, o: 16}. 364/969 Two letters picked without replacement from {a: 4, q: 3, w: 2, l: 3, d: 3, x: 1}. Give prob of sequence wl. 1/40 Four letters picked without replacement from hghhghh. What is prob of sequence ghhh? 1/7 Two letters picked without replacement from {n: 2, h: 2}. Give prob of sequence nn. 1/6 Two letters picked without replacement from {s: 2, r: 3, i: 3, v: 7, x: 1, h: 2}. Give prob of sequence ix. 1/102 Three letters picked without replacement from ururaprlnrlp. What is prob of sequence lrr? 1/55 What is prob of sequence vvss when four letters picked without replacement from {v: 6, s: 2}? 1/28 What is prob of sequence mm when two letters picked without replacement from {d: 15, m: 5}? 1/19 What is prob of sequence qqq when three letters picked without replacement from qqqqqqqqqq? 1 Calculate prob of sequence aan when three letters picked without replacement from nnnannan. 1/28 Three letters picked without replacement from pppipppipppiiciiiip. Give prob of sequence cii. 28/2907 Two letters picked without replacement from {i: 3, g: 3, y: 2, r: 1, a: 4, o: 2}. What is prob of sequence oy? 2/105 Two letters picked without replacement from {b: 1, m: 1, r: 3}. Give prob of sequence mb. 1/20 Calculate prob of sequence vttj when four letters picked without replacement from {t: 2, j: 1, v: 2}. 1/30 Two letters picked without replacement from {m: 3, l: 2, w: 10}. What is prob of sequence lm? 1/35 What is prob of sequence pp when two letters picked without replacement from {c: 4, p: 7, r: 4}? 1/5 Four letters picked without replacement from qxxxxqxqqxxxxxxxqxxx. What is prob of sequence qqqx? 5/646 Three letters picked without replacement from jllxlbiuillui. What is prob of sequence ubi? 1/286 Three letters picked without replacement from lwlq. Give prob of sequence lqw. 1/12 What is prob of sequence lee when three letters picked without replacement from peqpeel? 1/35 Four letters picked without replacement from {z: 1, j: 2, u: 1, c: 1, y: 5}. Give prob of sequence zjyc. 1/504 Two letters picked without replacement from ffff. What is prob of sequence ff? 1 Four letters picked with	{ "pile_set_name": "DM Mathematics" }
89? -1065 -325 + -1.8 -326.8 What is 233.2833 take away 9? 224.2833 Add 2373108 and 5. 2373113 What is the difference between 0.39 and -351? 351.39 What is 0.165 take away 17? -16.835 1633 + -3977 -2344 5.1+-0.02 5.08 -1040081 + 3 -1040078 Calculate 0.6 + -1246. -1245.4 What is 7033 - 1.2? 7031.8 Add together -248295 and -0.4. -248295.4 98.7+58 156.7 What is the difference between -31769 and 0.2? 31769.2 What is the distance between -117 and -606? 489 What is -1793 minus -93.8? -1699.2 What is 1 plus 0.0322? 1.0322 Subtract 2 from 93958.36. 93956.36 Add -1429 and -0.4. -1429.4 Work out -646 - 1.4. -647.4 Add 0.02381 and 2.8. 2.82381 -92.4+5 -87.4 What is -1 + 0.3082? -0.6918 Work out 376 - -8. 384 Add together 8753.18 and 0. 8753.18 Calculate -0.1 - 32702. -32702.1 Work out 96.688 + -0.5. 96.188 Sum -0.01 and -1.407. -1.417 Subtract 0.4 from 513. 512.6 -0.6 - -2.54 1.94 What is 10665 - -406? 11071 Calculate 541.22 + -1. 540.22 Sum 0.5 and 7339. 7339.5 What is -1.42 take away -20.3? 18.88 What is 16429 minus -9? 16438 What is the difference between 1141458 and 0.1? 1141457.9 Add 139 and -107. 32 Put together 20 and 13.08. 33.08 0.4+-144 -143.6 What is the distance between 0.00324 and 0.2? 0.19676 What is the distance between -0.5 and 76.81? 77.31 Calculate -326 + 2.257. -323.743 1.5 - 138 -136.5 -0.41+-142 -142.41 What is -0.6 - 306819? -306819.6 Add together -974 and 0.04475. -973.95525 What is -0.0028 take away 341? -341.0028 What is -6305 take away -70? -6235 What is 10 take away -4439? 4449 9.56+56.49 66.05 Sum 149 and 8. 157 What is -0.5 - 14.33? -14.83 What is 6 minus -1612454? 1612460 Work out -8191 - -1. -8190 Subtract 17597 from -0.5. -17597.5 Total of 0 and 377.48. 377.48 Subtract 239 from -0.5. -239.5 Add together -0.5 and -9223. -9223.5 Add -1093 and 3.523. -1089.477 Total of -38.54 and -0.77. -39.31 What is 0.128 - -505? 505.128 What is 1.92 - 45.1? -43.18 -41.648 - -0.3 -41.348 Sum -0.1 and -14572. -14572.1 What is the difference between -0.0129 and 0? 0.0129 Add together 0.2 and 2789558. 2789558.2 What is the difference between 794 and 0.7? 793.3 Sum 0 and 22191.8. 22191.8 What is 0.05808234 minus 0.4? -0.34191766 What is the difference between 615 and 1.7? 613.3 Calculate 2 + -55.241. -53.241 What is -4 take away -0.0316907? -3.9683093 Add together -3.6 and 9926. 9922.4 What is 0.3 + 20243? 20243.3 What is the difference between 6 and 7371.46? 7365.46 Calculate 21 + -57540. -57519 What is -0.121 plus 5.82? 5.699 What is -729 minus -297? -432 Put together -5 and -208.2. -213.2 What is 0.4 take away -104.1? 104.5 What is -225 - 2? -227 Put together 68235 and 1. 68236 -3+-5922 -5925 What is -7 minus -0.0495? -6.9505 What is 2482 + -0.3491? 2481.6509 What is -0.022 plus -63323? -63323.022 5+210314.1 210319.1 Subtract 0.06544 from -3. -3.06544 What is -223.2 take away 0.2? -223.4 Total of 440.5 and 5. 445.5 What is the difference between 0.5 and 5269? 5268.5 Calculate 0.04 - 9. -8.96 Subtract -0.6 from 2. 2.6 Work out 499673 + 5. 499678 Work out 1.61 - 0.03. 1.58 What is -2 take away -427992? 427990 Calculate -196 - 1.52. -197.52 Subtract 0.756 from 111. 110.244 Subtract -270.5 from -24.3. 246.2 What is 523.1 minus 13? 510.1 Calculate 0.16 - -181. 181.16 What is the distance between -3 and 4812687? 4812690 Sum 6039 and 0.3. 6039.3 Total of -4 and 0.719. -3.281 Add -0.17 and -0.094. -0.264 -1854 - 0.02 -1854.02 11773+-0.2 11772.8 Subtract -154 from 1067. 1221 Add together -39059 and -2. -39061 Put together -0.901 and -0.2. -1.101 Calculate -2 + 2380. 2378 -0.1 - 33639 -33639.1 What is -28737 minus 0.4? -28737.4 What is 9 take away 14047? -14038 -0.4 + 25297 25296.6 What is 1 minus -0.1801? 1.1801 Add together 0.4 and 18.6. 19 -1.31197 - -5 3.68803 What is -54 - -0.118? -53.882 Sum -219.5 and 261. 41.5 -1374 + 0.392 -1373.608 -0.0689 + -0.1 -0.1689 Add 283989 and 14. 284003 What is 103919 take away 0.2? 103918.8 What is the difference between 0.069944 and 0.02? 0.049944 What is 1841 take away -1.7? 1842.7 Calculate -6374 + 4. -6370 4+-3.9701 0.0299 -0.4 + 216250 216249.6 17.5786 - -0.051 17.6296 -1637 - 69 -1706 Subtract 0.273 from -0.00492. -0.27792 What is -1.601704 minus 0? -1.601704 Calculate 0.1 + -12.11. -12.01 What is 0.26 minus 21? -20.74 What is -0.1 take away 0.0064? -0.1064 What is the distance between -0.37 and 5.65? 6.02 What is -2.7 + -0.81473? -3.51473 What is -2786 minus 0.2? -2786.2 Add 0.5 and -5719. -5718.5 Total of -0.1189 and 30. 29.8811 Total of -5 and -0.0948. -5.0948 Work out -559.66 - 5. -564.66 21 - -0.032 21.032 Total of -1 and -1529. -1530 Add together 9725797 and -1. 9725796 What is the distance between 1949 and 20? 1929 What is 1 less than -14376? -14377 Work out 38 - -1842. 1880 Calculate -0.4 - -8.99. 8.59 What is -322 minus 79.6? -401.6 Calculate -119017 + -33. -119050 Total of -1260 and -0.6. -1260.6 9698 - -0.199 9698.199 Total of 3 and -0.271. 2.729 What is -6.08487 take away 5? -11.08487 Work out -1564 - 1.87. -1565.87 -0.3+-21.47 -21.77 Subtract -0.2329 from 203. 203.2329 What is the distance between -0.5 and -465? 464.5 Work out -16452 - 1. -16453 Calculate 44 - 0.0189. 43.9811 What is the difference between -192890 and -0.4? 192889.6 Subtract -110 from -14. 96 Subtract 3381 from -0.34. -3381.34 Work out 21451 - -0.277. 21451.277 Work out 0.0934974 - 3. -2.9065026 What is 3.3 - 6507? -6503.7 What is 0.208 plus 0.126? 0.334 What is 0.6 less than 305.2? 304.6 Add -3 and 9.89326. 6.89326 What is the distance between -0.17 and -0.108? 0.062 What is -0.4 + -337533? -337533.4 What is -490 - 11.1? -501.1 Work out 0 - -1316.9. 1316.9 What is -6 take away 1256122? -1256128 Sum -0.2055 and 658. 657.7945 -14532 - -1.1 -14530.9 What is 1.19 - 1.2? -0.01 Work out -478 - 0.4. -478.4 Work out -2514923 + -2. -2514925 What is 2 plus -52.3? -50.3 What is -605291 - 0.5? -605291.5 4+0.00789 4.00789 Put together 0.5 and 0.138504. 0.638504 What is 31.134 minus -0.19? 31.324 Work out -0.05 + -409541. -409541.05 Add together 39.903 and -0.4. 39.503 What is 3 - 19141? -19138 7+4.59 11.59 Subtract -1.3009 from -5. -3.6991 Sum 1.72 and 1121.4. 1123.12 What is -5.583 minus -0.3? -5.283 Add together -0.5 and 1110. 1109.5 What is the distance between 0.1214 and 2? 1.8786 What is 8223 + 0.5? 8223.5 What is 10 minus 0.0363? 9.9637 -2810.45 - 2 -2812.45 What is -3 take away 15881? -15884 -168.3 + 205 36.7 Calculate -389 + -278. -667 What is -38381 + -0.3? -38381.3 What is the difference between -258 and -0.1? 257.9 What is 0.1498 plus 3? 3.1498 What is -1.5 plus -352? -353.5 What is 1 take away 118437? -118436 Put together 0.8 and 0.43757. 1.23757 Calculate -2 - -1368. 1366 Sum -2.1076 and 0.1. -2.0076 What is 0.1 minus 238.25? -238.15 -61 - 4186 -4247 What is 317040 + -2? 317038 What is -21 less than -0.253? 20.747 What is -1 minus -57156? 57155 Calculate 0.36 - 27.5. -27.14 What is 0.1 plus 0.0099? 0.1099 What is -973 take away 0.391? -973.391 What is the distance between -3 and 4033? 4036 Add -2 and 4.2049. 2.2049 Put together 7 and -995. -988 Add together -46 and 0.081. -45.919 Calculate -743 + 147.7. -595.3 Sum -5 and 506652. 506647 What is the distance between 847 and 1? 846 Subtract -0.3 from -691.802. -691.502 Calculate -42.1104 - -3. -39.1104 Subtract -0.83 from 0.038. 0.868 What is the difference between -123 and -0.049734? 122.950266 Add together -3 and 0.069769. -2.930231 Put together 3 and 0.61287. 3.61287 What is -2.29395 + -2? -4.29395 -0.1 - 25.6 -25.7 1.9 - -0.052 1.952 What is -15696 plus -0.06? -15696.06 Calculate 0.2 - -0.0561036. 0.2561036 0.3+-0.26442 0.03558 What is -1526 minus -0.3? -1525.7 What is -5 + -3919? -3924 What is -340375 plus 0.4? -340374.6 What is -0.2 minus 471? -471.2 What is 162 less than 0.201? -161.799 Subtract -0.4 from 0.0179. 0.4179 What is the distance between -143.47 and -0.81? 142.66 What is 1740 + -1.622? 1738.378 Work out 0.88 + 134.8. 135.68 Total of -11.38 and -0.148. -11.528 -0.12+-0.035 -0.155 Subtract 3 from -159495. -159498 0.041+-53619 -53618.959 What is 0 less than 1.338? 1.338 Calculate -0.1 - 36459.4. -36459.5 Calculate -0.18 + -12.74. -12.92 Work out 14 + 7. 21 Calculate 2615 + 0.1. 2615.1 What is the difference between -15 and -3164? 3149 Work out -416902 + -4. -41	{ "pile_set_name": "DM Mathematics" }
2127 is divided by 4151? 3631 Calculate the remainder when 10361 is divided by 10345. 16 What is the remainder when 22061310 is divided by 127? 13 Calculate the remainder when 106576 is divided by 627. 613 What is the remainder when 2275291 is divided by 568738? 339 Calculate the remainder when 3619952 is divided by 689. 635 What is the remainder when 102742 is divided by 9? 7 What is the remainder when 540872 is divided by 4545? 17 What is the remainder when 870306 is divided by 2619? 798 Calculate the remainder when 1520468 is divided by 16175. 18 What is the remainder when 1088333 is divided by 1575? 8 What is the remainder when 838517 is divided by 82? 67 Calculate the remainder when 220404 is divided by 1900. 4 Calculate the remainder when 537644 is divided by 14933. 56 Calculate the remainder when 35332917 is divided by 56. 53 Calculate the remainder when 217835 is divided by 1433. 19 Calculate the remainder when 4933097 is divided by 25. 22 What is the remainder when 2018241 is divided by 504541? 77 What is the remainder when 38568 is divided by 1051? 732 Calculate the remainder when 252105 is divided by 31508. 41 Calculate the remainder when 1309757 is divided by 1019. 342 Calculate the remainder when 85726 is divided by 20381. 4202 Calculate the remainder when 26489874 is divided by 2204. 2202 What is the remainder when 41867 is divided by 41690? 177 What is the remainder when 2772686 is divided by 396089? 63 What is the remainder when 75061379 is divided by 23? 5 What is the remainder when 2716171 is divided by 533? 3 What is the remainder when 2546239 is divided by 2585? 14 Calculate the remainder when 19661791 is divided by 1598. 1597 What is the remainder when 266223 is divided by 20443? 464 What is the remainder when 5531503 is divided by 9? 4 What is the remainder when 2177299 is divided by 362881? 13 What is the remainder when 1079491 is divided by 16343? 853 Calculate the remainder when 70250 is divided by 2217. 1523 Calculate the remainder when 6006243 is divided by 3096. 3 Calculate the remainder when 14671987 is divided by 320. 307 Calculate the remainder when 17191 is divided by 2902. 2681 What is the remainder when 3005491 is divided by 1502342? 807 Calculate the remainder when 50306614 is divided by 138. 94 What is the remainder when 6292427 is divided by 794? 771 What is the remainder when 55539 is divided by 2772? 99 What is the remainder when 338853 is divided by 338336? 517 What is the remainder when 86412 is divided by 249? 9 Calculate the remainder when 348798 is divided by 1561. 695 What is the remainder when 6505 is divided by 2841? 823 Calculate the remainder when 400325788 is divided by 8781. 8779 What is the remainder when 75600 is divided by 1495? 850 What is the remainder when 346015 is divided by 5481? 712 Calculate the remainder when 12056 is divided by 3924. 284 Calculate the remainder when 972472 is divided by 2827. 2811 What is the remainder when 20555 is divided by 3116? 1859 Calculate the remainder when 3866488 is divided by 966618. 16 Calculate the remainder when 55992072 is divided by 4. 0 Calculate the remainder when 30265829 is divided by 163599. 14 What is the remainder when 2170146 is divided by 120540? 426 What is the remainder when 61190488 is divided by 1227? 1225 Calculate the remainder when 4826272 is divided by 18. 4 Calculate the remainder when 653252 is divided by 58. 56 Calculate the remainder when 337516 is divided by 84378. 4 What is the remainder when 5157948 is divided by 11696? 12 Calculate the remainder when 191595184 is divided by 1514. 1512 Calculate the remainder when 44147790 is divided by 47. 32 What is the remainder when 48474 is divided by 22809? 2856 Calculate the remainder when 384342 is divided by 40. 22 What is the remainder when 983150 is divided by 98300? 150 What is the remainder when 10248347 is divided by 22? 21 Calculate the remainder when 729887 is divided by 2128. 2111 What is the remainder when 1392637 is divided by 228? 13 Calculate the remainder when 64909134 is divided by 2796. 2790 What is the remainder when 1261546 is divided by 6711? 6589 Calculate the remainder when 79003 is divided by 526. 103 What is the remainder when 38328 is divided by 12757? 57 Calculate the remainder when 323215 is divided by 8120. 6535 Calculate the remainder when 145448 is divided by 72084. 1280 Calculate the remainder when 43647906 is divided by 29. 6 Calculate the remainder when 1248582 is divided by 40274. 88 Calculate the remainder when 1097773 is divided by 1751. 1647 What is the remainder when 264561 is divided by 88167? 60 Calculate the remainder when 1366585 is divided by 65. 25 Calculate the remainder when 2756975 is divided by 344615. 55 Calculate the remainder when 2817534 is divided by 937. 912 What is the remainder when 4497947 is divided by 2746? 2745 What is the remainder when 22345091 is divided by 17? 2 Calculate the remainder when 846257 is divided by 95. 92 Calculate the remainder when 681588 is divided by 170373. 96 What is the remainder when 2097121 is divided by 2951? 1911 What is the remainder when 566471 is divided by 33297? 422 What is the remainder when 923634 is divided by 9236? 34 Calculate the remainder when 5333100 is divided by 3238. 114 Calculate the remainder when 20600891 is divided by 52. 51 What is the remainder when 506608823 is divided by 819? 812 What is the remainder when 107031 is divided by 549? 525 Calculate the remainder when 3151683 is divided by 96. 3 Calculate the remainder when 18166939 is divided by 24. 19 What is the remainder when 57651 is divided by 56294? 1357 Calculate the remainder when 40743 is divided by 86. 65 What is the remainder when 1049927 is divided by 776? 775 What is the remainder when 917028 is divided by 83? 44 What is the remainder when 3543056 is divided by 3543025? 31 What is the remainder when 175432 is divided by 29214? 148 What is the remainder when 72955 is divided by 250? 205 What is the remainder when 2718143 is divided by 242? 241 Calculate the remainder when 91748589 is divided by 4743. 4740 Calculate the remainder when 30200 is divided by 9708. 1076 What is the remainder when 8818417 is divided by 27? 1 Calculate the remainder when 77419 is divided by 1218. 685 Calculate the remainder when 3856762 is divided by 428528. 10 What is the remainder when 745966 is divided by 248? 230 Calculate the remainder when 104618 is divided by 1468. 390 Calculate the remainder when 24278930 is divided by 7. 4 What is the remainder when 25879707 is divided by 5? 2 What is the remainder when 1038550 is divided by 51? 37 Calculate the remainder when 8634422 is divided by 536. 534 What is the remainder when 4868576 is divided by 202844? 320 Calculate the remainder when 88466 is divided by 3. 2 What is the remainder when 240253 is divided by 30029? 21 Calculate the remainder when 64705 is divided by 3817. 3633 What is the remainder when 19652298 is divided by 29? 13 Calculate the remainder when 16093960 is divided by 5364653. 1 Calculate the remainder when 781866 is divided by 390896. 74 What is the remainder when 12954427 is divided by 2606? 1 Calculate the remainder when 62390 is divided by 415. 140 What is the remainder when 4059794 is divided by 13443? 8 Calculate the remainder when 25036 is divided by 3934. 1432 Calculate the remainder when 130603 is divided by 2665. 18 Calculate the remainder when 1736776 is divided by 7060. 16 Calculate the remainder when 692639 is divided by 322. 17 Calculate the remainder when 7681193 is divided by 17577. 44 What is the remainder when 866605 is divided by 1311? 34 Calculate the remainder when 15147299 is divided by 726. 35 Calculate the remainder when 17434421 is divided by 4156. 1 Calculate the remainder when 317384 is divided by 78823. 2092 What is the remainder when 45184486 is divided by 283? 140 Calculate the remainder when 217642 is divided by 2722. 2604 Calculate the remainder when 1771404 is divided by 44285. 4 What is the remainder when 516463 is divided by 1467? 79 Calculate the remainder when 144236 is divided by 47955. 371 Calculate the remainder when 8139821 is divided by 189298. 7 Calculate the remainder when 5606348 is divided by 311. 262 Calculate the remaind	{ "pile_set_name": "DM Mathematics" }
d i? 204 Let y be 2/(-6024)40176752/(-17864). Let s = -16145 - -12157181/753. Let c = s + y. What is the common denominator of c and 151/6? 174 Let h = -66/107 - -7835/16692. What is the common denominator of 29/204 and h? 2652 Let r = -41448 - -209552/5. Let t = -464 + r. Find the common denominator of t and 70/9. 45 What is the common denominator of (-61744)/119680 + (-1)/(-4) and 131/220? 440 Find the common denominator of (-157)/75 - ((-70)/525)/((-2)/(-20)) and -89/1000. 1000 Let s = -172 - -195. What is the lowest common multiple of 50 and s - (-2)/(5/5)? 50 Let n = -33628/4545 + -23/505. What is the common denominator of -75/2876 and n? 25884 Suppose 5v + 1062 = r, 3r + 2v = 380 + 2874. Let h be ((-128)/60-6)/(4/r). Let d = h + -3450. Calculate the common denominator of 26/29 and d. 145 Suppose -d + 72 = 3d. Suppose -22y + 4 = -84. Calculate the lowest common multiple of d and ((-2)/y)/(24/(-144)). 18 Let q = -552491 + 3297997/6. Let t(c) = 13c3 - c2 - 4c + 5. Let b be t(-6). Let g = b - q. Calculate the common denominator of 23/3 and g. 6 Suppose 9c + 2841 = 4502 + 5359. What is the smallest common multiple of c and 468? 2340 Let l = -1382 - -2012. Find the common denominator of 37/126 and (6 - 3789/l)/(8/(-1070)). 504 Find the common denominator of 332/(-432) - 298/(-18) - -4 and -10/1131. 1131 Suppose -29 = -5f + 31. Let h(x) = 3x3 - x + 1. What is the smallest common multiple of h(1) and 3/((-9)/f)(-22)/8? 33 Let g be 549/(-12)(-56)/(-6). Let v = -262 - g. What is the least common multiple of 5 and v? 165 Calculate the least common multiple of 79 and 16/3242. 316 Suppose 2g = -5t + 3526, -27 = 2g - 43. Calculate the lowest common multiple of 48 and t. 5616 Let q(m) = -49m2 + 6m + 5. Let s be q(-1). Calculate the smallest common multiple of (-2 - 1)(-4 + s) and 10. 810 Let u = -127 - -135. Let y(x) = 3x*2 - 17x - 26. Suppose -110 = -o - 4o. Calculate the lowest common multiple of y(u) and o. 330 Let u(t) = 461t + 1168. Calculate the least common multiple of u(-2) and 1025. 6150 Let t = 5489 - 120721/22. Let r be (-58414)/1871466/40. Let c = -1/3119 - r. Calculate the common denominator of t and c. 220 Calculate the common denominator of -2 - (1 - (-164)/(-52)) - 58811/53820 and -101/270. 540 Suppose 7p = 2p + 70. What is the lowest common multiple of -21 + (14 - (-26 + 15)) and p? 28 Suppose 2371 + 2095 = 7r. Let h be (1/14)/(4 + (-2555)/r). Let c = h - -181/7. Calculate the common denominator of c and 25/7. 21 Let j(a) = -a + 11. Suppose 3z + 8 = -1. Calculate the lowest common multiple of 539/702 + z/(-5) and j(7). 16 Let p = -64594 + 9882955/153. Find the common denominator of p and -7/1257. 64107 What is the common denominator of 59/24 and (34/190)/((-484)/300 - (-7)/21)? 1824 Suppose c + 32 = 4c + 4l, -29 = -c - 5l. Suppose -3m + v + 361 = 0, 0 = 3m - 0m - cv - 364. Calculate the lowest common multiple of m and 135. 1080 Let h be -1 + ((-6)/(-4) - (-898)/4). Let t = -2504/11 + h. Find the common denominator of 1/11 and t. 11 Calculate the common denominator of 8/(-36) - (10 + 40179/(-3888)) and 55/104. 16848 Let o(g) = 2g - 44. Let t be o(25). Suppose -7l - tl + 832 = 0. Let d = 70 - l. Calculate the lowest common multiple of 4 and d. 12 Suppose q + 1 = 0, d - 2q = -0q + 536. Suppose d = 3k - 402. Calculate the lowest common multiple of ((-1)/(-3))/(13/k) and 20. 40 Let o = -19277/4886 - 44/349. What is the common denominator of -53/406 and o? 406 Let b(i) = i3 + 9i*2 + 10i + 19. Let t be b(-8). Suppose ts - 38 = -2. Let m(d) = d2 + d + 2. Calculate the least common multiple of m(-2) and s. 12 Let g(b) = 4195b - 6026. What is the lowest common multiple of g(2) and 44? 26004 Let c = -10 + 15. Let s be 55/11-2(-3)/10. Suppose sj + 1 = -5, 2j - 41 = -5g. Calculate the least common multiple of g and c. 45 Calculate the common denominator of 1(-1)/27(-34608)/2240 and -73/240. 720 Let c(a) = -3a*2 - 23a + 24. Suppose -24 + 60 = -3m. What is the least common multiple of m + 8 + 211 and c(-8)? 144 Let x(n) = -5n + 298. Let r be x(52). Suppose 9w + r - 236 = 0. What is the least common multiple of w and 196? 2156 Let j be ((-300)/(-14) + 1)(-10 - -17). Let s = 189 - j. What is the lowest common multiple of s and 44? 352 Let o = 79455 - 38456207/484. Find the common denominator of o and -77/6. 1452 Let m(a) = a3 + 4a*2 + 2a - 1. Let k be m(-3). Suppose 0 = 3v - 15, -kv - 55 = -4z - 5v. What is the lowest common multiple of z and 16? 80 Suppose 1599b + 10 = 1594b + 5g, -2b - 5g = -45. Calculate the smallest common multiple of b and 737. 3685 Let f(u) = u3 + 15u*2 - 9u - 15. Calculate the smallest common multiple of 613 - ((-18 - -17) + 4) and f(-15). 600 Let u = 5341/880 - 147/22. Let w = -79332 + 8726419/110. What is the common denominator of w and u? 880 Suppose -7j + 71 = 1. Let g(n) = -n*3 + 9n*2 + 20n - 9. Let o be g(j). Suppose -5x - 31 = -o. Calculate the smallest common multiple of x and 27. 108 Let s(y) = 10y*3 + 28y*2 - 10y - 8. Let l(v) = 3v3 + 9v*2 - 3v - 3. Let t(a) = -16l(a) + 5s(a). What is the lowest common multiple of 16 and t(3)? 80 Suppose 4i - 18 = 62. Suppose -136p + 22015 = -21207 + 14934. Calculate the smallest common multiple of p and ((-3)/(-1))/(3/i). 1040 Let p = 672336 - 4680432/7. Let i = p - 3709. Find the common denominator of i and 76/63. 63 Let t = 501428/81 - 6190. Calculate the common denominator of t and 0 - (2 + 132/(-270)). 405 Let h be 33490/(-3720) - -10 - (0 + 1). Let s = h - 14693/372. Calculate the common denominator of -21/50 and s. 50 Let k(n) = 2n2 - 51n + 270. What is the least common multiple of 50 and k(20)? 50 Let c be (16 - 13) + (-6902229)/180. Let w = c + 38344. Find the common denominator of -89/45 and w. 180 Let s be ((-170738591)/92)/((-405)/(-12)). Let a = -54988 - s. What is the common denominator of -47/63 and a? 945 Let f be -1 + 0 + 2/(-6)-9. Suppose 3r - 24 = 2w, -fr + 15 = -2w + 1. Suppose 0 = -4y - y + 35. Calculate the least common multiple of y and r. 70 Let n = -10307 + 10403. What is the smallest common multiple of n and 240? 480 Suppose x = -2x - 15516. Let z be (27/68)/(75/(-977050)). Let o = z - x. Find the common denominator of o and -101/16. 272 Let b = 2314073/64 - 36162. Let v = b + -2269/320. What is the common denominator of v and 2/5? 10 Let v = 220773797/378 - 584058. Find the common denominator of v and 67/2052. 14364 Let s = -59278 + 21577211/364. What is the common denominator of s and -139/2660? 34580 Suppose q - 448 + 467 = 0. Let v = q - -7/3. Calculate the common denominator of v and -45. 3 What is the least common multiple of 2 + 1 - (66/(-6) + -604) and 618? 618 Let y = -3966 - -111227/28. Let w = 4/309 + 8945/1236. Let o = y - w. Calculate the common denominator of o and -9/29. 203 Calculate the common denominator of (9/(-2))/(164/8) and ((-3)/(-22))/(4/(-1536)-12). 451 Let y(n) = n*3 - 4n*2 - 1. Let r = -2/5413 - 205688/16239. Let j = -28 - r. What is the common denominator of j and y(5)? 3 Let j be (282/(-235))/((-2)/10). Calculate the smallest common multiple of 60 and 8/j378/8. 1260 Suppose -3d = -9q + 10q - 924, -1760 = -2q + 5d. What is the smallest common multiple of q and 900? 900 Let f be (-39)/263/((-18)/8). What is the common denominator of ((-402)/81)/(1f/(-3)) and ((-3)/12)/((-6)/(-67))? 72 Let g be (3 - 1) + 24/4 + -16. Calculate the common denominator of 10/g + 444/(-432) and -45/2. 18 Let v = -21627 + 21795. Calculate the least common multiple of 1120 and v. 3360 Suppose 5y + 2 = 12, -16 = -2f - 3y. Calculate the smallest common multiple of 1299 and f. 6495 Let t be (-31)/50866 - (0 + 2). Suppose 4p - 2v + 1351 + 813 = 0, 5v = 20. Let b = t - p. Find the common denominator of 79/4 and b. 100 Let z = 3423/2 + -1681. Let w be 14/70-574-7. What is the common denominator of w/(-124) + -39 + 42 and z? 62 Suppose 60 = -55d + 57d. Calculate the common denominator of 101/3408 and d. 3408 Suppose 5u = -16 + 41. Suppose -n - un = -n. Suppose 0 = 5c - j - 30, -c - j + 6 = -nc. Calculate the lowest common multiple of c and 24. 24 Let a(u) = -3 - 23u*2 + 37u*2 - 2u*3 + 10u - 33u*	{ "pile_set_name": "DM Mathematics" }
ppose 1 = -z + 7. Let r(a) = -4a + 9. What is the lowest common multiple of z and r(-6)? 66 Let a(c) = -5 - 6c + c - 19 + 3c. Suppose d = -4p + 24, -5d + 5p + 32 = 3p. Calculate the least common multiple of a(-17) and d. 40 What is the common denominator of -68/1467 and 90032/36512 - 10/4? 10269 Let v = -276 - -281. What is the smallest common multiple of (14/5)/(2/5) and v? 35 Let s(d) = 239d + 1463. What is the smallest common multiple of 149 and s(-6)? 4321 Suppose 0 = 13s - 14s + 3d + 235, 3s + 3d = 645. Suppose -3f = -5k - 130, 5k = 2f + 3f - s. Calculate the smallest common multiple of f and 35. 315 Let u(b) = -b*3 - 6b*2 + 3. Let v be u(-6). Suppose -vx + 5q + 50 + 5 = 0, -102 = -5x - 2q. Calculate the smallest common multiple of 10 and x. 20 What is the common denominator of (19 - 4 - 11) + (-74)/24 and (-4 + (-485)/(-10))/(40 + -1)? 156 Calculate the common denominator of 17/1278 and (10 - 12)9/5346111. 14058 Suppose -4a - 635 = -5a + 277. Calculate the least common multiple of 570 and a. 4560 Let g = 3/590 + 5289/4130. What is the common denominator of g and 7/(-560)-713 + (2 - 10)? 560 Let j(d) = -8d3 + d2 + 4d + 2. What is the least common multiple of 1587 and j(-1)? 11109 Calculate the common denominator of (-5)/220(-5358)/(-11115) and 59/660. 8580 Let h(b) = b2 - 20b + 15. Let g be h(17). Find the common denominator of (-121)/g - (6 - 2) and ((-11)/44)/(9/(-256)). 36 Calculate the common denominator of 8/16 + ((-2586)/(-2640) - (-8)/(-20)) and 67/12. 264 Suppose 7997 + 17995 = 142k - 212568. Calculate the lowest common multiple of 560 and k. 1680 Let b(z) = -2z + 30. Let g be b(15). Let v be ((-12)/4)/(1/(-4)). Suppose 3t + v = -s, -5t + gt - 22 = s. Calculate the lowest common multiple of 12 and s. 12 Let j = 1878 - 1086. Calculate the smallest common multiple of j and 18. 792 Suppose -5851f + 3090 = -5645f. Let b be 12/7 + (-4)/(-14). Calculate the lowest common multiple of (3/b)/((-3)/(-12)) and f. 30 Let x be 862/(-2) + (1 - 1) + -4. Find the common denominator of (20/375)/((-10)/x) and -17/12. 300 Suppose 21x = -32 - 10. Find the common denominator of x/205 - (-9)/(-6) and 25/6. 6 Let v(h) = -2h - 2. Let b be v(-1). Let p be (-2 - 171) + (b - -4). Find the common denominator of 20 and 3/2p/(-78). 4 Let m be -139072/4 - 1/2. Let x = m - -229507/33. Calculate the common denominator of -41/6 and x. 66 Let l = 18/10211 + 835849/6616728. What is the common denominator of 133/432 and l? 1296 Suppose 0 = -m - 3v - 3, -7m - 22 = -3m + 2v. Let o(g) = g*2 + 8g + 11. Let n be o(m). What is the common denominator of -51/10 and (-5)/6 + 2n? 30 What is the lowest common multiple of 869 + -4 - (-14)/2 and 22? 9592 Let m = -1/2534705 + 13079117/99360436. What is the common denominator of 99/80 and m? 3920 What is the common denominator of -67/1372 and (-4)/28(-930)/(-360)? 4116 Let a = 294053/18 + -16335. Find the common denominator of -71/1248 and a. 3744 Suppose -1356 = 86u - 1644 - 2550. Calculate the least common multiple of 4242 and u. 46662 Suppose 158j - 156j = -64. What is the common denominator of -73/1564 and j? 1564 What is the lowest common multiple of 189 and (-122)/(-183)(-22428)/(-8)? 16821 Suppose -2j + 3783 = -z, 2j + 5z + 1628 = 5417. Calculate the least common multiple of j and 12. 5676 Let l(p) = -p2 + p + 1. Let w(j) = 3j - 3j2 + 0j + 0j + 22. Let d(a) = -4l(a) + w(a). Calculate the lowest common multiple of d(0) and 16. 144 Suppose -5s - 8k = -5k - 896, 0 = -2s - 2k + 356. Suppose 0 = p - 4q - 59, 4p + 2q = 7q + s. What is the smallest common multiple of p and 3? 39 Let q(p) = 17p*2 - 151p - 9. Suppose 5l = l + 8. What is the least common multiple of q(9) and 2 + 3 + l + 2? 9 Let z = 72 + -62. Let c(a) = 3a3 - a2 - a + 2. Let y = -5 - -7. What is the least common multiple of c(y) and z? 20 Let p = 1/109398 + -1713977/8204850. Calculate the common denominator of 26/3525 and p. 10575 Let m(q) = -8q + 58. Suppose -4y + 5y - 1075 = 0. Let w = y - 7566/7. What is the common denominator of w and m(6)? 7 Let i be 6/(-9)(-2412)/8. Let v be i/68 + (-9)/36. Let a = v + -244/153. Calculate the common denominator of -5/11 and a. 99 Let h = -5 - -12. Calculate the least common multiple of 63/(-28)168/(-126) and h. 21 Suppose 5i = 5z - 0z - 9805, 5z - 4i = 9806. Find the common denominator of -3/224 and z/1322/(-6). 2464 Suppose 34 = 3g - 5y, -2g + 40 = -6y + 12. What is the smallest common multiple of g and 27634? 110536 Suppose 15a = -500 - 250. Calculate the common denominator of (-30)/a - (-12)/(-21) and 16/35. 35 Let w(t) = 22t2 + 22t - 395. Calculate the lowest common multiple of w(10) and 1575. 14175 Let m(o) = -186o + 3367. What is the lowest common multiple of 57 and m(18)? 57 Let b be 71 - -7(-2)/7. Let p = b + -102. Find the common denominator of 67/455 and p. 455 Let v(h) = -170h + 5458. What is the smallest common multiple of v(32) and 7492? 67428 Let y = -33881 - -3252497/96. What is the common denominator of y and 2 - (-13)/(-168)46? 672 Suppose 0 = -5w - 9w - 14. Let s be 202/((-2)/w)(5 + 60). Find the common denominator of (-1)/(-5)s/1534 and 97/18. 1062 Let b be 5/(-96)-18932 - (-1 + 6). Let o = -1934 + 2917. Let c = b - o. Calculate the common denominator of c and 8/27. 216 Suppose h = 3w + 162, h - 2w - 292 = -124. What is the smallest common multiple of 396 and h? 1980 Let k = 105 + -81. Suppose 0 = -4p - 4m + 60, 4m = -4p + 3m + 51. Calculate the lowest common multiple of k and p. 24 Suppose 15m - 7r = 14m + 70, 364 = 3m + r. Calculate the least common multiple of m and 918. 6426 Suppose -5k + 0q - 3q + 493 = 0, -2k = -q - 195. Calculate the smallest common multiple of 63 and k. 882 Suppose -3n - 190 = -5f - 43, 4f + n - 138 = 0. What is the smallest common multiple of 165 and f? 165 Suppose -4f + 12 = w, 4w - 4f = 2w. Suppose -3j - j - 2z = -96, -j = z - 26. Calculate the lowest common multiple of w and j. 44 Let i = 9764903329967265/99502 + -98137759340. Let g = -2/3827 - i. Let l = 256933/18 + -14278. Calculate the common denominator of l and g. 234 Let l = 7/1637 - -103043/1551876. What is the common denominator of l and 33/8? 1896 Let g(n) = 3n*2 + n + 5. Let c(z) = -2z*2 - 3. Let q(d) = 5c(d) + 3g(d). What is the smallest common multiple of q(2) and 150? 150 Let z(o) = 123o - 2692. What is the smallest common multiple of z(22) and 494? 3458 Let f be (-1)/(-1775)(-61685)/(-22). Let v = -4/355 - f. What is the common denominator of (-15)/(-6)(-273)/165 and v? 22 Let w(r) = r*3 + 11r*2 - 2r - 18. Let y be w(-11). Suppose 25 = 5o - 5z, -o + z = -z - y. Calculate the lowest common multiple of 58 and o. 174 Suppose -2c + 30 = -5w, -3c - 3w = -2 - 1. Suppose 0 = ch + 4s - 63, 3s = 6h - h - 49. Calculate the lowest common multiple of h and 23. 253 Let w = 7 - 3. Let j = 760 - 740. Suppose -wd + 3l = -j, -2d + 6 = -l - 4. Calculate the least common multiple of 78 and d. 390 Let y(g) = 15g*2 + 1. Let h = -60 - -58. Let r be -1(h + 3/1). What is the smallest common multiple of y(r) and 2? 16 Let l = -1988387/44170 - -1576/35. What is the common denominator of -115/18 and l? 11358 Let i(v) = -v*2 - v + 1. Let x be i(-2). Let c be (x/3)/(6/(-1530)). Calculate the common denominator of 32/33 and (c/(-210))/(4/8). 231 Suppose 312 = 69d + 7d - 296. What is the lowest common multiple of 16 and d? 16 Let h = -198 + 188. What is the lowest common multiple of (-1)/(-2) + h/16-12 and 4? 8 Calculate the common denominator of -97/46 and ((-4)/(-690))/((-628)/48513). 230 Suppose -6t + 3220 = -t - 0t. What is the least common multiple of 1012 and t? 7084 Let z = 11 - 11. Suppose 0d + 4d + 2m - 22 = 0, -5d - 4m + 29 = z. Calculate the least common multiple of d and -4 - -1 - -141/2. 20 Let i = -756 - -774. What is the least common multiple of 10 and i? 90 Let k(n) = -n*2 - 5n + 108. Let p be k(-12). Suppose -14u + p = -60. What is the lowest common multiple of 166 and u? 498 Suppose 146 + 67 = 3j. Suppose 3b - 105 = 4c, 9c - 4c = 4b - 141. Suppose -b = -5q + j. Calculate the least common multiple of 14 and q. 154 Let y(t) = t**3 +	{ "pile_set_name": "DM Mathematics" }
n. 60 Express (3 - 2z3 - 3)(-2z - 2 + 2) + 0z*4 + 9z*4 + 9z4 + z2 + z*4 + 3z*4 - 6z*4 as dz*3 + rz + xz4 + w + cz2 and give c. 1 Express -o2 + 4o3 - 2o - 955o4 - 4o*3 + 950o*4 - 1 in the form ao*2 + xo*4 + u + fo + ro3 and give x. -5 Rearrange 0 - g + 0 + (-5 + 5 - 2)(0g - g + 0g)(3 + 2 - 6 + (-2 - 1 + 1)(-3 + 1 + 4) + 0 - 2 + 4) to the form bg + s and give b. -7 Rearrange 165j - 1065 + 1065 to the form zj + n and give z. 165 Express 3j2 + 1 + j3 + 0j2 - 5j*2 - 5j in the form t + mj + wj*2 + lj*3 and give w. -2 Express (-4z + z + 2z)(28 - 40 + 17) + (0 - 2 + 3)(z + 5z + 0z) in the form q + xz and give x. 1 Rearrange (5 - 2 - 4)(25612 - 25612 - 187g)(-2g + g + 0g) to the form wg*2 + x + zg and give w. -187 Express (4 - 3 + 0q - 2q)(1 - q - 1 + (2q - 4q + 3q)(2 + 1 - 4) + (3 - 3 + 2)(-7q + 2q - 14q)) in the form mq + lq2 + s and give l. 80 Express (1 - 6 + 11)(19 + 1 - 11 - 2m) in the form q + om and give o. -12 Express 128t + 50 + 52 - 102 as p + yt and give y. 128 Rearrange -6 + 3x - 2x*3 + 0x2 - x2 + 5 - 3x2 to the form bx + nx2 + t + wx*3 and give n. -4 Express ((9t + 5t2 - 9t)(-2t - 3t + 2t) + (0t2 + 2t*2 - 3t*2)(4t - t - 4t))(-6 + 0 + 14) as h + qt + jt3 + kt*2 and give j. -112 Rearrange 115p*2 - 15p*2 + 49p*2 + 20p*2 + 78p*2 to cp*2 + vp + k and give c. 247 Express -20r3 + 2r*2 + 59r + 35 - 33 + 22r3 as sr + y + ir3 + br*2 and give b. 2 Rearrange -27r*4 - 2r + r*2 - 4 + 23r*4 + 2 to the form f + cr*4 + dr*3 + kr*2 + hr and give f. -2 Express 478460g2 - 3g*3 + 122g - 478460g2 + 48g as kg2 + n + cg*3 + xg and give x. 170 Express 5 + 28u - 9 + 4 - 4u*2 + 10u*2 in the form xu + ku2 + r and give k. 6 Rearrange 3o*4 - 3o*4 + 2o4 + (-o2 + 2o3 + o2)(28o - 3o - 6o) to the form n + vo*3 + bo*4 + po + ho2 and give b. 40 Rearrange 2q - 2q - 3q + (-2 + 4 + 1)(-3q + 5q - 3q) - 5 - 6 - 6 + 2q to hq + j and give h. -4 Rearrange (-1 + 3 - 3 + 1 - 5 + 3 + (2 + 0 + 0)(-1 + 1 - 1))(-4 - 3 + 2)(-1 + 0 - 2)(-78 + 12w + 78) to the form r + uw and give u. -720 Express (1 - 1 - 4)(t + t - 3t)((-5t + 3t + 3t)(0 + 1 - 2) + 3t - 5 + 5) as q + lt2 + ct and give l. 8 Express (-3v + 0v - v)(65210 + 328v*2 - 65210) as xv + nv3 + zv*2 + j and give n. -1312 Rearrange -2t*2 + 0t + 0t + (233t*2 + 1340t - 1340t)(3 + 0 - 5) to nt + wt*2 + h and give w. -468 Express (-10c - 7c + 5c)((-3 + 2 + 3)(1 + 0 - 3) + (2 + 1 - 2)(-1 - 2 - 3)) as g + jc and give j. 120 Express (-721 + 20y + 721)(-3y - 2y + y)(1 - 2 + 2) in the form cy + u + py2 and give p. -80 Rearrange 2d*4 - 2d + d - 11 + 12 - 27d3 - 4d*4 - 29d*3 to the form vd*3 + sd + f + td2 + id*4 and give f. 1 Rearrange (-2m + 0m + 7m)(m2 + 0m*2 - 3m*2) - 2m*3 + 0m*3 + 4m*3 + (10m + 2m - 4m)(2 - 2 - 2m*2) to um*2 + wm + z + dm3 and give d. -24 Express -4v + 4v - 5v - 1 + 1 - 2v - v + 3v - v + 3v + 2v - 2v + (4 - 4 + 2)(0v + 2v - v) as fv + x and give f. -1 Rearrange (-3a2 - a2 - 3a2)(2a + 4a - 5a + 10) to la*2 + ba + n + ha3 and give l. -70 Express (2m*2 - 4m*2 + 0m*2)(2 + 4 - 3)(m + 2 - 2) + (-4m*2 + 6m2 - m2)(-2530 + 2530 - 73m) in the form b + um + am*2 + vm*3 and give v. -79 Rearrange 5k - 4k3 - 5k + (-4 + 5 - 2)(k3 - 3k*3 + 10k*3) to the form ak + uk2 + mk*3 + s and give m. -12 Rearrange 0b*2 + 2b*3 + 0b*2 + (6 + 1 + 15)(b + 3b - 2b)(0b*2 + 5b*2 - 2b*2) to the form qb + tb2 + y + fb3 and give y. 0 Express q3 - q*4 + 36 + q - 40 - 3q as bq2 + lq*4 + iq*3 + t + mq and give t. -4 Express 23 + 17 - 3j3 - 26j*4 - 41 as gj + lj3 + uj*2 + nj*4 + r and give n. -26 Express (-2o - 5 + 5)(73 + 274 - 169 + 942 + 389) as bo + k and give b. -3018 Rearrange (-1 + 4 + 9)(0 + 1 + 1)(27w2 - 7w + 7w) to the form lw + j + mw2 and give m. 648 Rearrange -1 + 21s - 2s4 - 13s + 5s3 - 10s + 3s4 to the form as*3 + ys + os4 + rs2 + l and give l. -1 Rearrange (-y2 - 2y2 + y2)(-11106y - 4 + 2 + 11111y) to the form ty3 + ay + c + fy2 and give t. -10 Rearrange -568y - 891y + 90y + 294y to the form m + iy and give m. 0 Express 49r2 - 66r*2 - 44r*2 - 83r*2 as ar*2 + lr + m and give a. -144 Express 7u4 - 9 - 10 + u + 13u*4 + 3u*3 + 16 as ku*2 + mu*3 + q + ju + wu4 and give m. 3 Express 2z + 2z - 3z + (1 - 4 + 0)(-1 + 1 + 2z) + 11z - z + 21z - 4 + 4 + 3z + (-2z + 3z + z)(-1 - 1 + 1) as yz + l and give y. 27 Rearrange -33 - 31 + 31f*2 + 90 - 28 to the form a + yf + mf2 and give a. -2 Express 2q2 + q2 - 4q2 + 650q - 650q - 55q*2 + (1 + q - 1)(-4q + 0q + 5q) - 5q*2 + 0q*2 + 3q*2 in the form jq + v + yq2 and give y. -57 Rearrange (-2h2 + h2 + 2h2)(1 - 2 - 1)(1 + 1 - 1) - 302h + 163h - 3h*2 + 8h*2 to the form ph + wh2 + r and give w. 3 Express 22f - 1 + 12 - 14 as if + d and give d. -3 Rearrange (-55 + 52 + 99)(-7 - 3 + 3)(9 - 9 + i) to the form b + ci and give c. -672 Express (-2b - 4 - 4 - 10)(-7b3 - 159b + 159b) in the form db*3 + jb + nb2 + qb*4 + r and give q. 14 Express -1 - 6 + 2p - 3p + 41p*2 + 9 as mp*2 + gp + b and give b. 2 Rearrange (-17z + 17z - 3z3)(-7 + 9 + 13 + (-1 + 2 - 2)(-5 + 0 + 2)) to bz*3 + j + mz*2 + oz and give b. -54 Express -o + o + 3o + (0 + 2 + 1)(27o - 5o + 36o) in the form t + ho and give h. 177 Rearrange -1408u - 1412u + 749u2 + 2820u to the form xu + ru*2 + w and give r. 749 Rearrange (-341 + 341 + 10d*3)(2d + 3d - 2d) - d4 + 32d*3 - 32d*3 to q + nd + cd4 + yd*2 + zd*3 and give c. 29 Express 2m + 3m3 + m3 + 26 + 2m*3 - 24 - 3m*2 in the form s + im*3 + jm*2 + nm and give s. 2 Rearrange 30 - 56 + 57c + 26 + 2c*2 to the form rc*2 + a + yc and give y. 57 Express (-5 + 0 - 6)(2 - 2 + p)(0 + 2 + 0)(-51 - 12 + 5) in the form h + tp and give t. 1276 Rearrange (5m2 - m - 4m*2 - m)((2 + 2 - 3)(-5 + m2 + 5) + (0m + 2m - 25m)(m + 2 - 2)) to am + k + sm4 + ym*2 + fm3 and give f. 44 Rearrange (-2 - o2 + 7o2 - 3o*2)(-12 + 12 + o)(1 + 3 - 1) to the form ko*2 + wo*3 + f + io and give w. 9 Express (0x + 2x - 4x - 2)(318 - 72x - 318) as px + o + jx2 and give j. 144 Rearrange 20m*2 + 2 - 10m2 - m3 - 10m2 + 329m to fm2 + s + im*3 + pm and give p. 329 Rearrange (2 - 3 + 3)(-25 + 25 + 21j*2) + 7j*2 + 316 - 316 + 3j*2 - 3j*2 + 2j*2 to nj*2 + mj + f and give n. 51 Rearrange -11s2 + 6s*2 + 7s*2 - 5s*3 + 15s*3 - 2s to the form xs + us*3 + zs*2 + d and give u. 10 Rearrange 1 - 48v - v*3 + 44v + 0v3 - 40v*2 + 4v to the form l + gv + xv*2 + av*3 and give l. 1 Express -9244 + 9244 - 391j in the form x + pj and give p. -391 Express (-2k + 6k + 0k)(742 + 913 - 180 + 70) as ck + i and give c. 6180 Express -3l + 0l*2 + 0l - l*2 - 46l*3 + 3l*2 + 4l*3 as b + wl*2 + nl*3 + al and give a. -3 Express (0m + 0m - m)(0 + 0 - 3) + 1 + m + 4m - 30m + (2 - 5 + 4)(0m - 2m + 3m) + 0 - 2m + 0 as xm + i and give x. -23 Rearrange (-12u - 8u + 4 + 13u)((3 - 1 - 4)(2 - 2u - 2) - u + 4u + u) to the form i + cu2 + gu and give g. 32 Express 10r2 + 90368r - 90429r + 0 + 0 in the form a + jr + cr2 and give c. 10 Express -888 + 888 - 162q + (-q + 2q - 3q)(2 - 2 - 1)(0 + 1 + 1) in the form hq + m and give h. -158 Express (7l - 7l + 2l*3)(5l - l - 2l + (-6 + 0 + 4)(2l + 0 + 0) - 22l - 5l - l - 5l + l + 3l) as t + ol + zl*4 + nl*3 + yl*2 and give n. 0 Rearrange 2g*2 + 0g*2 + 4g + 7g2 - 4g*3 - 3g*2 to the form lg + cg2 + rg*3 + y and give r. -4 Express -8s*4 - 4 + 23s*3 + 24s3 + 2 + s2 - 6s3 as f + ds*4 + ys + cs3 + bs*2 and give c. 41 Rearrange -59 + 110 - 2d*2 + 10 to the form xd + z + yd2 and give z. 61 Rearrange (34t*2 - 1027t + 1027t)(-t - 2 + 6*t	{ "pile_set_name": "DM Mathematics" }
0.14 (b) 1/10 (c) x (d) -0.2 b Let k = 3.88 - -0.12. Let n be 38/4 + 3/6. Let s be 2/n - 11/30. What is the third biggest value in -1, s, k? -1 Suppose -l - r = -10, -4r = -4l - 6r + 32. Let h be (0/(-2))/(l/2). What is the third biggest value in h, 3, 0.5? h Let l be (-1)/((-7)/(-31)) - -4. Let m = -0.9 + 1. What is the smallest value in m, l, -4? -4 Let g be (-14)/3 - (-1)/(-3). Let j = 12 - 11. What is the third biggest value in 0.1, g, j? g Let m = -0.285 + -0.115. Which is the smallest value? (a) m (b) 2/3 (c) 10 a Let y = 0.21 + -0.21. Let b(k) = k3 + k2 - k + 4. Let j be b(0). Suppose 0 = -5r - j + 29. What is the biggest value in r, 0.3, y? r Let a = 16 - 49/3. What is the third smallest value in -5, 5/4, a? 5/4 Let q = 0.1 + -0.12. Let f = -32 - -30.98. Let o = f - q. Which is the biggest value? (a) 4 (b) o (c) -5 a Let k = 208/321 - -2/107. Let r = -0.2 - -0.2. What is the second biggest value in k, -0.1, r? r Suppose -3p + 56 = -16. Suppose -n + 6n + 2z = -p, -3z + 10 = -4n. Which is the biggest value? (a) -0.3 (b) 1 (c) n b Let h be (-2 - 20/(-8))-4. Which is the smallest value? (a) h (b) 12 (c) -3 c Let j be 5-1 - (8 + -10). Which is the second biggest value? (a) 1/5 (b) -0.1 (c) j b Let y = -172.96 + 173. What is the third smallest value in -5, y, 0? y Let l = -55/2 - -28. Which is the second smallest value? (a) 2/7 (b) l (c) 1/3 c Let t = -14 + 14.5. Let q(y) = -y - y3 - 2 + 1 - 7y*2 - 5y. Let h be q(-6). Which is the biggest value? (a) h (b) -2 (c) t c Let u = -16 + 11.2. Let t = -0.2 + u. Let b = -5.4 - t. What is the biggest value in b, -1, 0.5? 0.5 Let f = -35 - -53. Suppose 2w + f = 4m, m - 7 = 6w - 5w. What is the smallest value in -0.4, w, -2? w Let y = 0.32 + 0.18. Let h = -0.02 - -2.02. Which is the biggest value? (a) y (b) h (c) -4 b Let c be (10/3)/((-20)/(-24)). What is the third smallest value in 3/5, c, 35, -1/4? c Let r = -13 + 14. Which is the smallest value? (a) -1 (b) 4 (c) r a Let o = -6/23 + 59/138. What is the biggest value in -0.3, o, 5/2? 5/2 Let m = 0.46 + 18.54. Let d = -18.8 + m. What is the second smallest value in d, 2, -1/3? d Let g = 0.01 + 1.99. Let a = -1 + g. What is the smallest value in a, 4/9, -2? -2 Suppose 7c - 3c + 4 = 0. Let w be ((-4)/c)/(-2) - 2. What is the biggest value in 3, 2/9, w? 3 Let l be (-2 + (-6)/(-4))-10. Let y be (-3)/l2/(-3). Let j = 3 + -1. Which is the smallest value? (a) j (b) y (c) -5 c Let j = 0.068 - 0.468. Which is the third smallest value? (a) 5 (b) j (c) 4 a Let k be 4/(-30) + 20/(-75). What is the biggest value in -0.2, 0.4, k? 0.4 Let w = -0.92 + 0.9. Which is the biggest value? (a) w (b) 3 (c) -0.5 b Let f be (-3)/(-6)2/1. Let o = 0.09 - 8.09. Let b = -7.6 - o. What is the smallest value in -2/23, f, b? -2/23 Let d = 0 + -1. Which is the smallest value? (a) d (b) -0.1 (c) 0 a Let m be (-2)/(-6) - (-40)/(-84). Which is the smallest value? (a) m (b) 2/7 (c) 0.1 a Let g(l) = l + 21. Let v be g(-17). Suppose 5m + 6 = -0o + 3o, -4o + vm = -8. What is the third smallest value in o, -0.6, -3? o Let u be ((-2)/(-6))/(-1 - 0). Let n = 0.28 - 0.2. Let j = -0.22 - n. Which is the third smallest value? (a) u (b) 0.4 (c) j b Let d = -23.17 - -24.2. Let c = 0.03 - d. What is the third smallest value in 0, c, 3/5? 3/5 Let w = -13 - -8. Let f = -23 + 19. What is the biggest value in 2/11, w, f? 2/11 Let t = -1.76 - 0.04. Let g = -1.97 - 0.03. Let s = t - g. Which is the third smallest value? (a) -2/3 (b) s (c) 2 c Let r = -1.67 - 0.33. What is the second biggest value in -0.9, -0.4, r? -0.9 Let l = 158 + -160. Which is the smallest value? (a) -0.5 (b) 0.06 (c) l (d) 0.4 c Let d be (12/45)/(20/54). Let y = d - -2/25. Let u be -1 + 3 + 3 + -4. Which is the third smallest value? (a) u (b) -2/9 (c) y a Let o = 5 - 5.3. Let y = 0 + -1. Let f = 0 + y. Which is the third smallest value? (a) 2 (b) f (c) o a Let q = -4.55 - -4. Let i = q - -0.05. Let z = 3 - 8. What is the smallest value in i, z, -2? z Let i = -12 - -18. Let m = -1 + i. Which is the biggest value? (a) m (b) -4 (c) 0.2 a Let g = -17 - -10. Let o = 9 + g. Which is the smallest value? (a) -3/5 (b) o (c) 1 a Let r = 0.1 - 1. Let b = r + 0.9. What is the biggest value in b, 2/17, 0.2? 0.2 Let g = -5 + 35/6. What is the second smallest value in 0.4, 7/4, g? g Suppose 3r + r - 5i = 183, 5r - 2i - 233 = 0. Let v = r + -26. Let c be 2/3 - 14/v. What is the smallest value in 2, c, 5? c Let f = -628/7 - -90. Which is the biggest value? (a) -3/4 (b) f (c) 1 (d) -2/11 c Let x be (-1)/3 - (-26)/6. Let r = 1 + 5. Let f = -3 + r. Which is the biggest value? (a) f (b) x (c) -2/5 b Let w be (1 + -1 + 14/210)6. What is the smallest value in -5, -0.2, w, -0.3? -5 Let j = 83 + -831/10. Suppose -5f + 5x - 1 = 4, -f = 2x - 11. Which is the smallest value? (a) j (b) f (c) -0.4 c Let j be 2/8(-136)/(-51). Let u = -1.5 + 1.43. Let t = u - 0.23. Which is the second biggest value? (a) j (b) t (c) 1/4 c Let n = -11 + 14. What is the second smallest value in 0.3, -5, n? 0.3 Let o be 3(-8)/12 + 2/4. Which is the second biggest value? (a) 0.2 (b) o (c) 2/7 a Let f = -3.82 + -0.18. Which is the smallest value? (a) -2 (b) f (c) -1/7 b Let v = 0.9 + 5.1. Let n = v - 6.6. Let f = -3.4 + n. What is the third smallest value in 0.3, 5, f? 5 Let t = 0.03 - 0.15. Let s = t + -4.88. Let n = s + 5.2. Which is the third smallest value? (a) n (b) 0.4 (c) -5 b Let a be -1 + -3 - 66/(-16). What is the second smallest value in 1/9, -3, a, -0.3? -0.3 Suppose d = -o, 0 = -0o - 4o - d + 6. What is the second biggest value in o, 0.3, 0.1, -1/3? 0.3 Let k = -9.8 + 9.8. Which is the third smallest value? (a) 2.5 (b) -1 (c) k a Let p = -0.6 - -0.3. Let q = -0.35 - 0.05. Let h = 3 - 7. Which is the smallest value? (a) h (b) p (c) q a Let s be 4/6(-9)/(-6). Let u = -3/2 - -3. Which is the third biggest value? (a) u (b) -1 (c) s b Let a = -4.4 - -2.4. Suppose 0 = 3w - 3. Let y be (-1)/(8/10 - w). What is the biggest value in y, -1/3, a? y Suppose -2o + v = -4v + 26, 19 = -5o + v. Let f be 126/8 + o. Which is the third biggest value? (a) -5 (b) 5 (c) f a Let k be (4/12)/((-2)/188). Let o = k - -31. Let v = -0.1 - -0.2. Which is the second biggest value? (a) o (b) 0 (c) v b Let t = 0.9 - 1.2. Let b(a) = a - 4. Let f be b(7). Suppose -h - 8y = -fy - 17, -4h + 5y = 32. What is the second biggest value in h, t, 4? t Let b = 0.21 + -0.71. Suppose 27 = -5v + 7. Let t be ((-9)/30)/(9/12). What is the third biggest value in t, b, v? v Let l = -4916/35 - -837416/5985. Let n = -6/19 - l. What is the biggest value in n, 0, -5? n Let d = -43 - -46. Let s be (2/3)/(7/3). What is the biggest value in 5, d, s? 5 Suppose -9 = 4v - 1. Let g = 37/8 - 103/24. Which is the smallest value? (a) 4 (b) v (c) g b Let b be 2/17 - (0 - 0). Let f = 17.5 + -13.5. What is the second smallest value in b, -1, f? b Let c = 6 + -6.3. Let y(u) = -u*2 - 2u - 1. Let z be y(-2). What is the third biggest value in -5, z, c? -5 Let b = -75 + 153/2. What is the smallest value in -1/3, b, 0.3? -1/3 Suppose -2z + z - 9 = 0. Let u be -2 + -141/z. Let x = -11 + 6. What is the third smallest value in -0.3, u, x? -0.3 Suppose 3q + 3q = 0. Suppose 9 = 3u - 3m - 18, 5u - m - 25 = q. Which is the smallest value? (a) u (b) 1/3 (c) -3 c Suppose 5d - 38 + 16 = 3q, 5d = 4q + 21. Let f be (2/5)/(3/5). Let z(x) = 2x2 + x. Let v be z(1). What is the third smallest value in f, v, d? d Let x = -3.05 + 0.05. Let o = 0.23 + 0.07. Let w = 0.5 - o. Which is the second biggest value? (a) w (b) 0.4 (c) x a Let x = -0.6 + 0.16. Let p = 1.96 - 2. Let o = p - x. Which is the second biggest value? (a) 1/9 (b) 0.5 (c) o c Let j be (-238)/(-60) + 8/(-12) + -3. What is the second biggest value in j, -0.5, 5? j Let m be 4/14 - (-1435)/(-49). Let f = m + 204/7. Let d = 15 - 29/2. What is the third biggest value in d, 6/5, f? f Let b = 388/5 - 78. Let k = -12 + 3. Let d = k - -9. What is the second smallest value in b, -4, d? b Let d(l) = -l2 - 7*l + 8. Let z be d(-9). Let p be (8/z)/((-3)/15). Let f = 3.7 + 1.3. Which is the second smallest value? (a) 0 (	{ "pile_set_name": "DM Mathematics" }
f 147356 and 7880. 1473560 Calculate the common denominator of -45/1652 and 143/29382. 411348 What is the common denominator of -83/48 and -119/10932? 43728 Calculate the least common multiple of 16 and 49256. 98512 Calculate the least common multiple of 128003 and 101055. 1920045 Find the common denominator of -17/254975 and 71/3525. 764925 What is the lowest common multiple of 16394 and 1890? 2213190 Calculate the least common multiple of 1936 and 1287. 226512 Calculate the common denominator of -1/365 and -36/11023. 55115 Calculate the least common multiple of 480 and 11260. 270240 What is the least common multiple of 128000 and 2880? 1152000 Calculate the least common multiple of 29759 and 71. 2112889 Calculate the least common multiple of 22 and 340648. 340648 What is the least common multiple of 1968 and 9717? 155472 Calculate the lowest common multiple of 3886 and 14964. 1002588 Calculate the least common multiple of 48405 and 1050. 484050 Calculate the smallest common multiple of 10354 and 5. 51770 Calculate the smallest common multiple of 33 and 12981. 142791 Calculate the common denominator of 89/4892 and 145/36. 44028 What is the smallest common multiple of 78255 and 111? 78255 Calculate the least common multiple of 13001 and 39003. 39003 Calculate the common denominator of -13/660 and 139/19536. 97680 What is the smallest common multiple of 101958 and 203916? 203916 What is the least common multiple of 508450 and 254225? 508450 Calculate the lowest common multiple of 1455 and 1940. 5820 What is the lowest common multiple of 8 and 127258? 509032 Calculate the common denominator of -46/8149 and 93/116. 32596 Calculate the smallest common multiple of 8480 and 16960. 16960 Calculate the common denominator of 11/97 and 77/291. 291 What is the common denominator of 21/592 and 19/7548? 30192 What is the common denominator of -46/165 and -77/102405? 1126455 What is the common denominator of 87/1148 and -7/23616? 165312 What is the common denominator of 29/152 and 1/76328? 1450232 What is the common denominator of 68/325 and 22/221325? 221325 What is the common denominator of 62/4199 and -7/17? 4199 Calculate the lowest common multiple of 32450 and 1826. 2693350 What is the lowest common multiple of 67 and 536? 536 What is the least common multiple of 92 and 277? 25484 Find the common denominator of 29/65002 and -70/13929. 195006 Calculate the common denominator of -91/88 and 23/39908. 79816 Calculate the smallest common multiple of 96 and 528768. 528768 What is the common denominator of 43/6 and -59/101462? 304386 Find the common denominator of -34/22347 and 61/2613. 1497249 What is the common denominator of 42/2215 and -71/118281? 591405 What is the common denominator of -23/25056 and 157/171216? 1027296 What is the smallest common multiple of 72045 and 63? 504315 Find the common denominator of -109/178332 and -27/21230. 891660 What is the lowest common multiple of 3726 and 3402? 78246 What is the common denominator of 31/150720 and -81/70336? 1055040 What is the common denominator of 51/19052 and -85/264? 114312 Find the common denominator of -29/33 and -80/409173. 4500903 What is the common denominator of -121/168 and -103/25158? 100632 What is the common denominator of 3/3400 and -69/100? 3400 What is the common denominator of -127/2840 and -32/701125? 5609000 Calculate the least common multiple of 16638 and 14852. 2628804 Calculate the lowest common multiple of 26352 and 879498. 7035984 What is the smallest common multiple of 148196 and 259343? 1037372 What is the least common multiple of 24 and 18168? 18168 Calculate the smallest common multiple of 9136 and 10278. 82224 Find the common denominator of 55/74786 and -37/1403. 1720078 Find the common denominator of 191/23700 and 151/270. 213300 What is the smallest common multiple of 535464 and 133866? 535464 Calculate the common denominator of 1/1001 and -17/131859. 1450449 Calculate the common denominator of 89/171488 and 73/5888. 1371904 What is the common denominator of 62/87 and -59/46255? 138765 What is the smallest common multiple of 225 and 462? 34650 What is the least common multiple of 2126500 and 2551800? 12759000 Calculate the lowest common multiple of 40 and 44998. 899960 What is the smallest common multiple of 4 and 126864? 126864 Calculate the lowest common multiple of 1845938 and 2. 1845938 What is the least common multiple of 4228 and 80332? 80332 What is the smallest common multiple of 78 and 247260? 247260 Calculate the least common multiple of 2499255 and 405. 2499255 Calculate the smallest common multiple of 567 and 455. 36855 Calculate the lowest common multiple of 9 and 20862. 20862 Find the common denominator of -73/8904 and 9/304220. 1825320 What is the least common multiple of 1442 and 140343? 28910658 Calculate the common denominator of 39/36386 and 29/5537. 254702 Calculate the smallest common multiple of 2418 and 1872. 58032 What is the least common multiple of 189 and 138942? 972594 What is the least common multiple of 197982 and 1377? 1781838 Find the common denominator of -46/519 and 4/7365. 1274145 What is the least common multiple of 50 and 441820? 2209100 Calculate the smallest common multiple of 49335 and 26910. 296010 Calculate the smallest common multiple of 48 and 11248. 33744 Calculate the lowest common multiple of 12 and 3576. 3576 What is the least common multiple of 3650 and 15330? 76650 Find the common denominator of -2/14067 and -41/3647. 98469 Find the common denominator of 47/12 and 125/302436. 302436 Find the common denominator of -121/3220 and 97/6440. 6440 What is the least common multiple of 1620 and 373977? 7479540 What is the least common multiple of 2481 and 10? 24810 What is the least common multiple of 764 and 428? 81748 What is the common denominator of 43/3962 and 5/51506? 51506 What is the common denominator of -31/283965 and -67/378620? 1135860 Calculate the smallest common multiple of 9420 and 3. 9420 What is the common denominator of -87/20 and -95/402544? 2012720 Find the common denominator of -29/202986 and 5/462. 2232846 What is the common denominator of 51/1106 and -83/22910? 160370 What is the least common multiple of 85314 and 241? 85314 Calculate the lowest common multiple of 1480 and 2886. 57720 What is the least common multiple of 1620 and 58680? 528120 Calculate the smallest common multiple of 42056 and 52570. 210280 What is the least common multiple of 156 and 35802? 71604 What is the lowest common multiple of 82431 and 1179? 10798461 What is the least common multiple of 3420 and 250? 85500 Calculate the common denominator of 95/104 and -11/15912. 15912 Calculate the smallest common multiple of 2 and 1212276. 1212276 What is the lowest common multiple of 80 and 33000? 66000 Calculate the common denominator of 145/144 and -64/2871. 45936 Calculate the smallest common multiple of 3432 and 149292. 298584 Calculate the smallest common multiple of 1519068 and 36564. 16709748 What is the common denominator of -30/6953 and 64/1227? 20859 Calculate the common denominator of 50/37 and 33/4958. 4958 Find the common denominator of -31/200386 and -91/12. 1202316 Find the common denominator of -151/652380 and 34/21615. 7176180 What is the least common multiple of 17472 and 14508? 1624896 What is the least common multiple of 1279 and 4? 5116 Find the common denominator of 125/15354 and 145/1085016. 3255048 Calculate the lowest common multiple of 856096 and 64. 1712192 Calculate the least common multiple of 1339 and 377. 38831 Calculate the smallest common multiple of 23574 and 30. 117870 Calculate the common denominator of -35/93022 and 65/4. 186044 Calculate the smallest common multiple of 17313 and 15. 86565 Calculate the common denominator of -101/13320 and -61/2664. 13320 What is the smallest common multiple of 22437 and 19944? 179496 What is the least common multiple of 1085252 and 33222? 3255756 What is the common denominator of 67/32 and -85/67104? 67104 Calculate the smallest common multiple of 77 and 458546. 3209822 Calculate the smallest common multiple of 2608 and 92. 59984 Calculate the common denominator of 55/138 and -61/42849. 85698 Calculate the smallest common multiple of 6084 and 4056. 12168 What is the com	{ "pile_set_name": "DM Mathematics" }
lify (s/((s*6s)/s)s)(32/7)(s(4/7)/s)20 assuming s is positive. s*(-188/7) Simplify (ww/((www/((ww(-3/14)w)/w))/w))*24(((ww/((((w/(w(1/44)w))/ww)/w)/w))/w)/w)/(ww*(-32)w) assuming w is positive. w(15671/308) Simplify ((w(-1/2)w(-1/6))(-44))13 assuming w is positive. w(1144/3) Simplify t(-1/5)t*10/t(ttt(-12))/(t(-6)t) assuming t is positive. t(19/5) Simplify qqq(5/8)qq(4/11)q*0/qqq/(q/(qq*(-21)qq)q) assuming q is positive. q(-1321/88) Simplify (k(-2)k/(kk*(-5)k))/(k3)(-3/19) assuming k is positive. k*(47/19) Simplify (y(yy(-3))/yy(-2))(8/9) assuming y is positive. y(-32/9) Simplify f(1/24)/((ff35/f)/f)(fff*(-14/11))/(ff(-1/37)) assuming f is positive. f(-334105/9768) Simplify ((d/(d*3d)dd/(d/(d/d(-2/19))))(-17))36 assuming d is positive. d(10404/19) Simplify u/(u/u*(-4))u*3(uuu(1/2))(-2/145) assuming u is positive. u(-30/29) Simplify ((t(-2/7))*42/(ttt/(t(-1)tt))33)(-18/7) assuming t is positive. t(1404/7) Simplify (((s/((ss((s2s)/s)/s)/s))(2/47))(-2/57))(-1) assuming s is positive. s(-4/2679) Simplify (((l/(l/l*(-2/7)l))/ll(6/11))/(ll/l*3l*(6/13)/ll))29 assuming l is positive. l(-34887/1001) Simplify (g*(3/5)/g)/(g/(gg*(-5)g))(gg/g11)/g(11/2) assuming g is positive. g(-189/10) Simplify b10/b*16(b(-2/11))(-3/7) assuming b is positive. b(-456/77) Simplify (z(-1/2)(z(-1/3)z)/z)(1/16) assuming z is positive. z(-5/96) Simplify ((ttt/t*(-3/8))/(ttt(20/9)ttt))11 assuming t is positive. t(-3047/72) Simplify (t(-26))(-1/8)t/((t(-8/9)t)/t)tt/(t/t*(-3/37))t assuming t is positive. t(9401/1332) Simplify ((q(-7)/(q*4q))/((q/q*(1/3))/(q(q/(qq(-2/9)))/q)))(10/7) assuming q is positive. q(-160/9) Simplify ((x/(x(2/3)x))/x)*(1/3)(x/(xx/x(-1))x)(-12) assuming x is positive. x(103/9) Simplify (y(11/5))(-8/7)/(y*(-11)y*(-12)y) assuming y is positive. y(682/35) Simplify t(6/17)ttt(-6/11)(t/t*(-4)t)/((tt/t(-19))/tt) assuming t is positive. t*(-2467/187) Simplify (bb(5/6))/b10(bb/(b*(-5)/b)b)(-42) assuming b is positive. b(-2317/6) Simplify (g(-2/9)/g)(-19/4)g(1/3)g/(g/(g(3/2)/g)) assuming g is positive. g(239/36) Simplify ((cc/(c/c(-38)))/(ccc/(cc(2/25))))(-2/43) assuming c is positive. c*(1946/1075) Simplify ((m/(mm*(2/117)))/(mm(m/((mm/(mm/m(-2))mm)/m))/m))/((mm*25)/(mm(-21))) assuming m is positive. m(-5735/117) Simplify (b/(b/(b/b*(-3/10))))/(bb/(b/(((b*(1/3)/bb)/b)/b)))(((bb*(-13/2)b)/b)/b)(-15) assuming b is positive. b(1492/15) Simplify (j(-1/7)/(j/((j/((j(-6)j)/jj)j)/j))(j(-1))(-15/8))(-30) assuming j is positive. j(-5655/28) Simplify k(-9)/k4(kk(-1/6))/k(9/8) assuming k is positive. k(-319/24) Simplify (d(-14)/d*(-19))/(d/(dd/d*5)((d*(-11)/dd)/ddd)/d) assuming d is positive. d12 Simplify (k(10/9)k/k(10/9))/((kkk(-1/11))/((k/(kk*(-2/7))k)/k)) assuming k is positive. k(-48/77) Simplify m/m(-4/15)mmm/(m13m)m8/(m(-2)m) assuming m is positive. m*(-11/15) Simplify (oo/(oo12o))/(o*(-13)/o)o(-36/11)/(o(-29)o) assuming o is positive. o(294/11) Simplify (g(-2/3)g/(gg(-6/7))g)/(g*5g11) assuming g is positive. g(-311/21) Simplify ((p(pp*(1/10)p)/p)/pp(7/5)p)(-12/11) assuming p is positive. p(-42/11) Simplify n/n*11(n/((n*(3/10)n)/nnn))/nn/n(-13)nn/(n/(n/n10)n) assuming n is positive. n*(-73/10) Simplify ((ccc/(cc(-11)))/(c4/cc))42 assuming c is positive. c378 Simplify (((b(5/3))(-3/7))(2/21))(-6) assuming b is positive. b(20/49) Simplify ((p((p*1p)/ppp)/p)*(-31)/((p/((p(ppp*5)/p)/p))/pp/((p*1p)/p)))(-13) assuming p is positive. p1131 Simplify ((yy(-6)/y)/y((((yy(-8/3)yyy)/y)/y)/y)/y)/(y*3y(2/5)) assuming y is positive. y(-196/15) Simplify ((yy(-15))/((y/(y(-5/2)/y))/y))/(y3)(-1/27) assuming y is positive. y(-313/18) Simplify r(5/3)r*(-3/2)/rrr/(r/(rrr(1/14)))rrr/(rr(-3/4)r) assuming r is positive. r*(335/84) Simplify ((((ww*1)/w)/ww)/w12)/(w0w9) assuming w is positive. w(-20) Simplify ((g/(g/g(-5/4)))/g3)/(g/g0)(-6/13) assuming g is positive. g(-197/52) Simplify (k(-10/7)/((k/k(-1/25))/k))/(k/(kk/k*(1/41))k0/k) assuming k is positive. k(3638/7175) Simplify (uu(-8/11)uu(-14/5)u)13 assuming u is positive. u(-377/55) Simplify ((b*7bb(1/5))(11/4))(8/19) assuming b is positive. b(902/95) Simplify ((f18)(1/7))(-1/41) assuming f is positive. f(-18/287) Simplify (l(-3)/l)9ll(-1/2)/ll/(l/(l(-2/19)/l)) assuming l is positive. l(-1429/38) Simplify (o/o(2/17))/o(-15)o(-12)o13/o assuming o is positive. o(270/17) Simplify (jj(4/9)j*10jj)/(jj/j*(-2/7)j/(j/j11)) assuming j is positive. j(10/63) Simplify ((t/(((t*(-2/15)t)/tt)/t))/t2)/((tt(-6/13))/(t(-3/19)t)) assuming t is positive. t(-2086/3705) Simplify ((rr(r(-2/3)r)/rr23/rr)(-25))(12/11) assuming r is positive. r(-7300/11) Simplify d11/dd(-11)d(d/d(2/3))(-2/45) assuming d is positive. d(-2/135) Simplify (((p1p)/p)*25(p(1/5))(-36))(-1) assuming p is positive. p(-89/5) Simplify ((c/((((c/(c*2c)c)/c)/c)/c))/c(-5/8))/(c(18/7)c/(c/(cc/(c/(c/c27))))) assuming c is positive. c(1571/56) Simplify (r(2/39)/(r/r(-14)))/(r(2/45)rr(-3/10)) assuming r is positive. r(-18361/1170) Simplify (z(-6)/((z(-2/11)/z)/z))/((z(-3/10)z)/(z/(zzz*(-8)z))) assuming z is positive. z(163/110) Simplify (t(-2/3)(t/(t/t(-6)tt))/t(((t*(-2/7)t)/t)/t)(-35))(-22) assuming t is positive. t(-2332/3) Simplify h(-1/11)/(h/(h/h*30))hh(((h/(h/h*(-1/41)))/h)/h)/hh/h*20h assuming h is positive. h(-22151/451) Simplify (s(1/10)ss((ss/s*(-22))/ss)/ss)/(((s/s(-4/23))/s)/(s12s)) assuming s is positive. s(8953/230) Simplify (v(-3/5)vv3)/(v/(v(-2)/v))25 assuming v is positive. v(-483/5) Simplify (v(-5/2)/(v/(v/(v/(v(-2/9)/v)v)))(vv(1/3))/((v/(v/(vv/(v*(2/5)/vv)v))v)/v))(1/5) assuming v is positive. v(-629/450) Simplify (yy(-4))50((((y*(1/7)y)/y)/y)/yyy)/y(-14) assuming y is positive. y(-951/7) Simplify ((h(-7)/h16)(16/5))9 assuming h is positive. h*(-3312/5) Simplify (f/(ff((f1f)/ff)/f))1/(f/f(-12))(1/2) assuming f is positive. f(-17/2) Simplify ((k/((kk/((k/k*(3/4))/k)k)/kk)kkk(-24))(2/75))39 assuming k is positive. k(-1287/50) Simplify n*(-8/5)/((nn/(n/((n((n/(n/(nn*(1/3))nn))/n)/n)/nn)))/n)(n/n(-2/41))/(((n/((n(-11)n)/n))/nn)/n) assuming n is positive. n(-6079/615) Simplify (x(-5)x*(2/11))/(x/(xx/x*(-4/3)x)x/x(-8)) assuming x is positive. x(-346/33) Simplify (((p/(p(3/5)/p))/p)/(p/(pp(pp/p*(-1/7))/p)pp))/(p(1/7)/p(-3/2)) assuming p is positive. p(-11/10) Simplify ((qq/q*(2/5)q)*(-20/9)(q(1/2)/q)/q1)39 assuming q is positive. q(-1703/6) Simplify (yy(-5/9))/(yyy(-12)y)y(4/7)yy8 assuming y is positive. y(1198/63) Simplify (jjj(-10)j/j2)/((j/(j2j))/jjj/(j/(jjj9/jjj))) assuming j is positive. j(-19) Simplify (a(-2/5)aa(-1/2))/(a/(aa/((a/(aa/a5a))/a))aa(-24)) assuming a is positive. a(221/10) Simplify ((g2)(-4/17)(g/(g/(ggggg(4/7)gg)))/(g((g/(g/(gg(-5/6)gg)))/g)/g))49 assuming g is positive. g(24661/102) Simplify (iii(-5/4))(-37)/(i(-1/5))(-17) assuming i is positive. i(-623/20) Simplify (l/l(2/7))/lll(5/6)(ll(-2/47)l)/(l(2/31)/l) assuming l is positive. l(271735/61194) Simplify ((b3)49b(4/11)b(-2/3)/b)(-8) assuming b is positive. b(-38464/33) Simplify m/((m/m(-1/2))/m)m/(m/m(7/4))m*1mm(-2/5) assuming m is positive. m(77/20) Simplify i2/(ii*(-12))i*(-8)i/i(-20) assuming i is positive. i26 Simplify (qq(2/15)/q)(6/7)q*(13/4)qq11 assuming q is positive. q(2151/140) Simplify (((uu(-1))(-9/5))(-4/25))(-4/15	{ "pile_set_name": "DM Mathematics" }
z - 128. Let i(t) = -51t2 - 5t + 10. Determine -64i(u) - 5k(u). -56u2 Let q(r) = 4r*3 - 3r*2 + 3r - 4. Let t(p) = -4p2 + 25p - 3. Let d be t(6). Let u(j) = -2 + 0 + j + j3 - j2 - d + 4. Give -q(n) + 3u(n). -n3 + 1 Let m(l) = 90l*2 - l + 1. Let q(h) = 181h*2 - 2h + 2. Determine -7m(n) + 4q(n). 94n2 - n + 1 Let v(d) = -3d. Let x(b) = 5b. Let g(t) = 8v(t) + 5x(t). Let j(u) = -6u + 4. What is 3g(m) + j(m)? -3m + 4 Let x(d) = d*3 - 4d*2 - 6d. Let a = -9 + 6. Let p(m) = -2m3 - 3m + m*3 + 8m + 3m2. What is ax(s) - 4p(s)? s3 - 2s Let z(f) = 31f - 5. Let m(g) = -1. Determine -3m(w) + z(w). 31w - 2 Let z(b) = -3b*2 + 1. Let y(g) = -329g*2 + 4. Calculate y(a) - 4z(a). -317a2 Suppose 5n - 2p - 2 = 0, n + 0n = p - 2. Suppose 2s = -5 + 9. Let b(o) = son + o3 - o - 6o - o2 - 5. Let f(k) = 3k + 2. Determine -2b(y) - 5f(y). -2y3 - 2y*2 - y Suppose -5r + z + 40 = -2z, -5r - 4z = -5. Let b be r - 7/((-14)/4). Let a(u) = bu + 1 + 0 + 0 + 5. Let t(x) = 20x + 17. Give 17a(g) - 6t(g). -g Let m(g) = -7g3 - g2 - 5g + 6. Let l(h) = -6h*3 - 2 - 2h*2 + 14 - 2 - 5 + 0 - 4h. What is -5l(i) + 4m(i)? 2i3 + 6i2 - 1 Let h(u) = u3 - 2u2 + 2u. Suppose -28 = -n - 33. Let y(z) = -z3 + z2 - z. Calculate nh(o) - 10y(o). 5o3 Let s(i) = -2i + 7. Let z = 392 + -395. Let f(y) = -y + 6. Give zf(d) + 2s(d). -d - 4 Let r be -32/(-4) + 20/40. Suppose 4n - 5u = -64, 4n + 4u + 28 = -0n. Let b(g) = -g*3 - 2g + 4. Let f(c) = -6c3 - 11c + 21. Give nb(l) + rf(l). -l3 - 2 Let r(q) = q3 + q*2 - q + 1. Let p(m) = -3m3 + m2 + 4m + 3. Let d(b) = 4b*3 - 2b*2 - 6b - 5. Let i(j) = 5d(j) + 8p(j). What is i(l) + 2r(l)? -2l3 + 1 Let k(f) = f - 5. Let l(i) be the third derivative of -i3/6 + 4i2. Let a = -47 + 46. Calculate ak(p) + 6l(p). -p - 1 Let l(u) = -109u*2 + 28u + 9. Let t(d) = 22d2 - 5d - 2. Determine 2l(i) + 11t(i). 24i2 + i - 4 Let s(g) = 7g + 118. Let a be s(-18). Let i(z) = z - 3. Let d(v) = -3v + 8. Let u(f) = f2 + 6f - 3. Let t be u(-6). Determine ai(q) + td(q). q Let y(l) = -114l - 5. Let j(z) = -344z - 14. Give 4j(a) - 11y(a). -122a - 1 Let r(m) = -5m - 7. Let v(s) = -10s - 15. Let w(f) = 9r(f) - 4v(f). Let y(k) = 16k - 151. Let l be y(9). Let z(x) = -11x - 6. Calculate lw(d) + 3z(d). 2d + 3 Let x(h) = 5 + 2 + 3222h - 3226h. Let w(r) = -r + 1. Calculate 5w(n) - x(n). -n - 2 Let r(j) = -8j - 5. Let g(c) = -19c - 12. Let q(n) = -2g(n) + 5r(n). Let y(u) = -4u - 4. Let t(h) = -1. Let p(f) = -3t(f) + y(f). Give 2p(o) - 5q(o). 2o + 3 Let u(c) = -12c - 2. Let w(x) = x. Let v(h) = -2h + 9. Let t be v(4). Determine tu(o) + 5w(o). -7o - 2 Let c(a) = -a2 - 3a + 19. Let b(u) = -5u2 - 18u + 106. Calculate 6b(d) - 34c(d). 4d2 - 6d - 10 Let m(x) = 41x3 + 941x*2. Let n(z) = 18z*3 + 471z*2. Determine 4m(g) - 9n(g). 2g*3 - 475g*2 Let n(d) = 6d*2 - 2. Suppose -2y + 7 = -f - 6, 2y = -5f + 7. Let p(m) = -m*2 + 1. Determine yp(c) + 3n(c). 12c*2 Let c(o) = -17o - 5. Let g(p) be the first derivative of 4p2 + 2p + 358. Calculate 4c(d) + 9g(d). 4d - 2 Let h(w) = 18w*2 - 2w - 1. Let k(n) = 71n2 - 9n - 4. What is 9h(v) - 2k(v)? 20v2 - 1 Suppose -c = 4c. Suppose c = -2z - z + 3. Let f(j) be the first derivative of -2j*2 - 2. Let t(q) = q. Determine zf(d) + 6t(d). 2d Let f(p) = 2p - 6. Suppose -6 - 19 = -5g. Suppose -8 = -ga - 3. Let u = -5 - a. Let q(t) = 1. Determine uq(w) - f(w). -2w Let k(z) = -4z. Let b(q) = -q + 0q + 20771 - 20771. Let h = -5 + 19. Suppose -15 = 3u + 2u. Calculate hb(f) + uk(f). -2f Let l(b) = 46b - 3. Let v(t) = 3t + 2. What is l(g) + 2v(g)? 52g + 1 Let v(r) = 7r3 - 6r*2 + 6r - 6. Let y = 7 + -1. Let a(x) = -x2 + x3 - 1 + 9x + 6 - 8x - y. Determine -6a(o) + v(o). o3 Let a(r) = -r. Let d(x) = 2x*2 - 6x + 1. Determine 14a(f) - 2d(f). -4f2 - 2f - 2 Let w = -59 + 57. Let r(g) = 3g2 - 3g - 2. Let a(c) = -7c2 + 6c + 3. Let u(y) = wa(y) - 5r(y). Let i(s) = 2s + 3. What is -4i(m) + 3u(m)? -3m2 + m Let l(c) = -c3 + 2c2 - 2c. Let b(u) = u*3 - 3u*2 + 4u. Suppose 2x - 4 = 0, 3d + 3x = -9 + 6. Determine db(a) - 5l(a). 2a3 - a2 - 2a Let l(h) = -116h3 + h2 - 2h. Let o(r) = -232r*3 + 2r*2 - 5r. Determine -5l(x) + 2o(x). 116x3 - x2 Let p = 5 - 3. Let j(t) = -4t*2 + 6t + 5. Let z(h) = -h*2 + 5h + 1. Let o(k) = -k. Let r(w) = 4o(w) + z(w). Calculate pj(v) - 10r(v). 2v*2 + 2v Let z be 1/(-6)-32. Let i be -2z/((-4)/(-6)). Let t(c) = -2c + 7. Let o(g) = -2g. Let v(u) = u + 1. Let y(x) = -2o(x) - 3v(x). Determine it(d) - 7y(d). -d Let b(x) = 2x*3 - 3x*2 - 3x + 2. Let p(g) = -3g3 + 7g*2 + 6g - 5. What is 5b(o) + 2p(o)? 4o3 - o2 - 3o Let d(x) = x*3 - 4x*3 - 8x + 5x2 + 0x*2 - 2. Let g(r) = 0r*2 - 22r*3 + 2r*2 - 21r + 18r + 0 + 21r*3 - 1. Calculate 3d(c) - 8g(c). -c3 - c2 + 2 Let i(w) = 2w + 2. Let j(q) = -9q + 284. Calculate -4i(h) - j(h). h - 292 Let m(q) = 3q2 + 4q. Let j(z) = -6z2 - 3z*2 - 11z + 0z2. Let b be (3 + -2)(-2)/(-1)-2. Determine bj(p) - 11m(p). 3p*2 Suppose -107 = 7s - 471. Let j = s + -56. Let c(h) = 3h2 - h - 3. Let b(p) = -4p*2 + p + 4. Give jb(d) - 5c(d). d2 + d - 1 Suppose 0p - 3p + 18 = 0. Let u(s) = -2s3 + s2 + 6. Let w(f) be the first derivative of -f - 1754. Give pw(q) + u(q). -2q3 + q2 Let d(m) = -m*3 + 5m + 5. Let c be 3((-42)/(-9) - 2). Let z(x) be the first derivative of x4/2 - 4x*2 - 8x + 369. Calculate cd(b) + 5z(b). 2b3 Let l(x) = -7x + 1. Let p = -40 - -44. Let v(c) = -6c + 1. Let b be 0/5 + -2 - 3. Determine bv(j) + pl(j). 2j - 1 Let f(u) = -5u3 - 6u*2 + 11u + 4. Let y(o) = -15o3 - 17o*2 + 31o + 13. Give 17f(j) - 6y(j). 5j3 + j - 10 Let b(i) = -2i*3 + 2i*2 - 2i + 2. Let s(c) = 3c3 - c2 + 2c - 3. What is -5b(d) - 4s(d)? -2d3 - 6d*2 + 2d + 2 Let c(h) = -7h2 - 3h - 5. Let t(x) = -69x - 71. Let z be t(-1). Let a(q) = 3q*2 + 2q + 2. Determine zc(l) - 5a(l). -l*2 - 4l Let q(m) = 179m3 + 3m - 3. Let w(s) = 179s3 + 4s - 4. What is 4q(r) - 3w(r)? 179r3 Let h(q) = -1. Let n(p) = -6 - 3 + 8p - 5p + p - 5p. Calculate 2h(s) - n(s). s + 7 Let w(x) = 24x*2 + 9x + 6. Let v(p) = -49p2 - 16p - 12. What is 3v(s) + 5w(s)? -27s2 - 3s - 6 Let i(w) = 2w3 + 5w - 2. Suppose 10g = 72g - 310. Let l(z) = -6z + 0 + 2 - 2z*3 + 2z. What is gl(a) + 4i(a)? -2a3 + 2 Let p(z) = z2 - 4z - 5. Suppose 0 = -2d + 3 + 1. Let o(s) = -2s + 4 - 2sd + 2 + 7s. Give -3o(w) - 4p(w). 2w2 + w + 2 Let w(y) = -6y*3 - 2y. Let k(n) = -2n3 - n. Let p(b) = -2b*3 - 2b + 1. Let z be p(1). Let l be (2 + (-1 - -3))(1 - -1). Give lk(o) + zw(o). 2o*3 - 2o Let f(h) = 18h2 - 3h - 14. Let w(m) = 6m2 - m - 5. Let k(r) = 6f(r) - 17w(r). Let d = 1746 + -1747. Let b(s) = -s2. Determine dk(l) - 5b(l). -l2 + l - 1 Let k(c) be the second derivative of -14c*3/3 - 5c*2/2 - 818c. Let l(d) = -14d - 3. Determine 3k(m) - 5l(m). -14m Let l(a) = a*2 + a. Let f(v) = -68v*2 + v. Calculate f(q) + 3l(q). -65q2 + 4q Suppose -26f = -24f - 2. Let m(z) = -z*2 + 1. Let k(l) = 7l*2 - 6. Determine fk(o) + 6m(o). o2 Let g(b) = 1. Let z(p) = 6 + 28p - 2 - 83p + 24p + 30p. Give 6g(a) - 2z(a). 2a - 2 Let g(s) = -16s3 - 3s*2 - 2. Let m(x) = -33x*3 - 5x*2 - 3. What is 7g(q) - 4m(q)? 20q3 - q2 - 2 Let k(p) be the second derivative of -p*3/3 - 3p*2 + 18p - 1. Let l(b) be the second derivative of b*3 + 17b*2/2 + 2b. Determine 17k(q) + 6l(q). 2q Let o(r) = -2r*2 - 3r. Let h be o(1). Let c(y) be the second derivative of 2y3/3 + 2y*2 - 2y. Let f(k) = -3k - 3. Give hc(a) - 6f(a). -2a - 2 Let f(j) = 5j2 + 2. Let h = 1 + 0. Let s be (6 - 23/3)/(h/3). Let k(p) = 11p2 + 5. Let q(z) = -z2 - 5z - 4. Let m be q(-3). Give mk(c) + sf(c). -3c*2 Let c(r) = -3r*3 + 4r*2 - 9r. Let b(s) = -5s3 + 7s*2 - 17s. Suppose 3x + 3z = 27, 18x = 23x - 5z + 5. Calculate xb(	{ "pile_set_name": "DM Mathematics" }
3 = 0. -1/27, 0, 1, 2 Suppose -n - 436 = -15i + 11i, -i = 4n - 92. Let a = -104 + i. Solve -2/5s + 2/5s2 - 2/5s*a + 2/5s*3 + 0 = 0 for s. -1, 0, 1 Let u(o) = -5o*3 - 490o*2 - 385o + 820. Let q(y) = y*3 + 123y*2 + 96y - 204. Let g(h) = 15q(h) + 4u(h). Solve g(l) = 0. -22, -2, 1 Let l(d) be the first derivative of -d*5 + 65d*4/8 - 10d*3/3 - 65d*2/4 + 15d - 1892. Suppose l(y) = 0. What is y? -1, 1/2, 1, 6 Suppose 240 = 29c + c. Suppose 0 = -4p - w + 8, -c = -0p - 4p - 5w. Let 2f*4 + 0f - 6/5f3 - 18/5f*p - 2/5f*5 + 0 = 0. Calculate f. -1, 0, 3 Let v(p) be the second derivative of 7p*3 - 1/20p*4 + 0 - 735/2p*2 - 34p. Let v(s) = 0. Calculate s. 35 Let a(c) be the first derivative of -c*4 - 172c*3/3 - 164c*2 - 1364. Find w, given that a(w) = 0. -41, -2, 0 Let z = -82 + 75. Let g be (z + 106/14)/((-2)/(-7)). Solve 37rg + 36 + r4 - 109r3 + 60r + 227r3 - 108r*3 = 0. -3, -2 Suppose -50/3x*4 + 90x + 28/3 + 598/3x2 - 90x*3 = 0. What is x? -7, -1/5, 2 Let u(z) be the first derivative of -36z*5/5 + 42z*4 - 100z*3/3 + 8z*2 - 2547. Factor u(x). -4x(x - 4)(3x - 1)2 Let f(v) be the third derivative of -v5/240 + 17v*4/96 + 55v*3/12 - 3855v2. Find p, given that f(p) = 0. -5, 22 Let b(k) be the third derivative of -k5/120 + 5k4/8 - 12k*3 - 2363k*2. Solve b(a) = 0. 6, 24 Let h be ((-182)/(-455))/(2/10). Factor 50 + 12w - 5wh - 45w - w - 11w. -5(w - 1)(w + 10) Suppose -p + 23 = 15a - 20a, 4a = 3p - 25. Let n(t) be the first derivative of -t + 1/4t*2 + 1/3t*p - 1/8t*4 + 9. Factor n(j). -(j - 2)(j - 1)(j + 1)/2 Let f be 138/(-3) + (-37947)/(-819). Factor 5/3q*3 - 8/3q*2 + fq + 2/3. (q - 1)*2(5q + 2)/3 Let r = 1821 - 1808. Let t(h) be the first derivative of 0h - r + 2/3h2 + 2/9h*3. Determine x so that t(x) = 0. -2, 0 Let p = -2 + 9. Let a be (21/(-42))/(p/(-6) + 1). Determine f so that 12f2 + f3 - 4f4 + 8 + 0f*3 + 20f - 5fa = 0. -1, 2 Suppose -n - 1 = -j, -4j + 5j + 5n = 31. Let b(k) = -50k + 300. Let s be b(j). Factor 1/4d3 + d + s - d2. d(d - 2)2/4 Suppose 50m - 14 = -5d + 52m, 0 = -8d + 2m + 44. Factor -2/3x4 - 18x*2 + 0 + dx*3 + 26/3x. -2x(x - 13)(x - 1)2/3 Let s(c) be the second derivative of 7c - 17/21c6 + 0c*2 - 527/70c*5 - 150/7c*3 - 1/49c*7 + 355/14c*4 + 16. Determine p so that s(p) = 0. -15, 0, 2/3, 1 Let i(l) be the first derivative of 39/4l*2 + 0l + 1/2l3 - 59. Factor i(o). 3o(o + 13)/2 Let l(b) = -b3 - b2 - 2b + 84. Let t be l(0). Let x = t - 81. Suppose -25hx - 20h*2 + 7 - 4h - 7 = 0. Calculate h. -2/5, 0 Let y(u) be the second derivative of -u*5/270 - 5u*4/18 - 29u*3/27 - 58u*2 - 2u - 86. Let k(q) be the first derivative of y(q). Factor k(w). -2(w + 1)(w + 29)/9 Suppose 3906574y2 + 1671y + 834 - 1045y4 - 3y*5 + 205y*4 - 3906568y*2 - 1668y*3 = 0. Calculate y. -278, -1, 1 Let n = 1723004/7 - 246142. Factor -n + 2/7l*2 + 8/7l. 2(l - 1)(l + 5)/7 Let t be (8/17)/(-4) - (-848)/4896. Let c(g) be the second derivative of -38g + 0g*5 - tg*4 + 0g*3 + 1/45g*6 + 0g2 + 0. Let c(a) = 0. What is a? -1, 0, 1 Let l(o) be the second derivative of o9/7560 - o8/3360 - o7/630 + o*4/6 + 9o*2 + 9o + 2. Let k(v) be the third derivative of l(v). Factor k(x). 2x2(x - 2)(x + 1) Factor 12372 - 5082o + 50o2 - 60288 - 6307o*3 - 125o*2 - 101o*2 + 6305o*3. -2(o + 22)(o + 33)2 Let d be -2(7 - 4 - 2). Let c be (-105)/(-42) - d/4. Let -3 + 0 - 9h - 1 - ch*2 - 2 = 0. What is h? -2, -1 Let q(x) be the second derivative of -11/3x*3 + 0 + 353x - 28x2 - 1/6x4. Find k, given that q(k) = 0. -7, -4 Let j(m) be the third derivative of m7/42 - 5m6/6 + 43m*5/12 + 145m*4 - 600m*3 + 3260m*2. Determine k so that j(k) = 0. -5, 1, 12 Let j = 592 - 672. Let y be (-1)/3 - j/24. Find p, given that -2p*2 + 2/3p*y + 4/3p + 0 = 0. 0, 1, 2 Let y(p) be the first derivative of 0p - 86p*2 - 4/3p*3 - 50. Factor y(c). -4c(c + 43) Let c(d) be the second derivative of -2d*6/45 - 59d*5/60 + 79d*4/36 - 8d*3/9 - 1303d. Find v, given that c(v) = 0. -16, 0, 1/4, 1 Suppose 4674 - 4534 = -5q. Let f be 66/q192/(-144). Factor 20/7y + f - 2/7y*2. -2(y - 11)(y + 1)/7 Let f(w) = -3w*2 + 1874w + 695. Let u(d) = 3d2 - 1877d - 682. Let x(j) = 4f(j) + 5u(j). Let x(t) = 0. Calculate t. -1/3, 630 Let s(m) be the second derivative of m*4/6 - 8m*3 + 95m*2 + 7629m. Factor s(v). 2(v - 19)(v - 5) Let x be (-21)/12 - 119/588-51. Let -x - 18/7j*2 - 274/7j = 0. Calculate j. -15, -2/9 Let t(i) = -205i2 + 5110i. Let v(f) = 33f2 - 852f. Let s(a) = 4t(a) + 25v(a). Factor s(o). 5o(o - 172) Let a = -1897/269 - -14837/807. Factor 0 + 14/9s2 + as. 2s(7s + 51)/9 Suppose 2b = -2a + 10, -14a + 18a = 8. Let n(f) be the second derivative of bf*2 + 0 + 1/2f*3 - 1/4f*4 - 16f. Factor n(y). -3(y - 2)(y + 1) Let n(d) be the first derivative of -111 + 1/2d3 + 0d - 27/4d2. Factor n(o). 3o(o - 9)/2 Suppose 9/2 + 9/4u - 1/4u3 - 1/2u2 = 0. Calculate u. -3, -2, 3 Let x(v) be the first derivative of v3/12 - 159v2/2 + 635v/4 + 8371. Determine o, given that x(o) = 0. 1, 635 Let s be (-18 + 16)2/248. Let b = s + 563/310. Factor -bi*2 - 3i*3 + 3/5i*5 + 0 - 3/5i*4 + 0i. 3i2(i - 3)(i + 1)2/5 Determine b, given that 2/9b*2 + 784/9b + 782/9 = 0. -391, -1 Let u(t) be the third derivative of -1/300t5 + 0 + 146t*2 + 2/15t*3 + 0t - 1/40t4. Factor u(y). -(y - 1)(y + 4)/5 Let s(v) be the second derivative of -v*5/10 - 16v*4 + 65v*3 - 98v*2 + 313v - 2. What is b in s(b) = 0? -98, 1 Let p be (5880/7056)/((-10)/(-72)). Factor pq2 + 8/3q*3 + 0 + 4/3q. 2q(q + 2)(4q + 1)/3 Let k(g) = -8g4 - 84g*3 - 176g*2 + 76g + 188. Let m(t) = t*4 + 2t*3 - 3t*2 + 1. Let f(o) = -k(o) - 4m(o). Determine s so that f(s) = 0. -16, -3, -1, 1 Let a = -135 + 143. Determine f, given that 0f2 + 3f*2 - af*2 - 4f3 + f2 = 0. -1, 0 Suppose -200n2 + 166n*3 + 860n*2 - 5n*5 - 5n - 330 - 156n3 - 330n*4 = 0. Calculate n. -66, -1, 1 Let z(h) = 4h*3 - 2h*2 + h + 1. Let p(a) = 83a*3 - 26a*2 + a - 379. Let x(v) = -2p(v) + 42z(v). Suppose x(q) = 0. What is q? -4, 10 Let a(z) be the third derivative of -z8/1344 + 31z*7/840 + 7z*6/80 - 41z*5/30 + 8z*4/3 + 7883z*2. Let a(v) = 0. What is v? -4, 0, 1, 2, 32 Let r = 4/9693 + 4304/9693. Determine x so that -2/9x*5 + 0x*4 - 2/9x + 0x2 + 0 + rx3 = 0. -1, 0, 1 Let p(v) = -v2 - 1. Let a be p(-1). Let o be (a/(-3))/2 + (-46 - -46). Factor 0i + oi3 - 4/3 + i2. (i - 1)(i + 2)2/3 Let s(w) = -210w*2 - 315w - 270. Let v(y) = -10y2 + 5y*2 - 35y - 7y2 - 30 - 10y2 - y2. Let i(h) = 6s(h) - 55v(h). Factor i(n). 5(n + 1)(n + 6) Let c(u) = -5u - 11. Let w be c(-3). Suppose d + 15 = wd. Solve 15ad + 46 - 30a*2 + 60a - 63 + 41 + 6a4 - 75a*3 = 0 for a. -2, -1, -2/5, 1, 2 Suppose -4w*3 + 1009 + 143 + 4w*4 - 351w + 176w + 175w - 152w2 = 0. What is w? -4, 3, 6 Let b(d) be the first derivative of 230d*3/3 + 15d*2/2 + 3853. Factor b(i). 5i(46i + 3) Let f(k) = -k4 + k3 + k - 3. Let o(d) = 11d4 + d3 + 2d*2 - 6d + 18. Let u(c) = -30f(c) - 5o(c). Suppose u(b) = 0. What is b? -1, -2/5, 0 Let s(h) be the third derivative of 2h7/105 + 22h*6/5 + 4966h*5/15 + 6710h*4 + 186050h*3/3 - 2536h*2. Factor s(f). 4(f + 5)*2(f + 61)*2 Let r(s) = -5s*3 + 2s*2 - 7s + 26. Let i(u) = -u3 + u2 - 2u + 6. Let j(p) = -4i(p) + r(p). Factor j(z). -(z - 1)(z + 1)(z + 2) Let r(n) be the first derivative of -n*5 + 5n*4 - 3 - 25/3n*3 + 5n*2 + 0n. Factor r(q). -5q(q - 2)(q - 1)2 Let i(w) be the first derivative of -3w*4 + 1364w*3/3 + 232w*2 - 912w - 6240. Determine z so that i(z) = 0. -1, 2/3, 114 Suppose 0 = -4l + 5y + 21, 3l = -2y + 33. Suppose 5g4 + 2g*2 + 4g - 7g2 - lg + 5g3 = 0. What is g? -1, 0, 1 Let c(m) be the first derivative of 1/16m*4 + 1/20m*5 - 1/12m*3 - 1/8m*2 + 26 + 0m. Factor c(k). k(k - 1)(k + 1)**2/4 Let s = 333 - 133. Determine	{ "pile_set_name": "DM Mathematics" }
d(6/5))/(d/(d/(d9/d)))) assuming d is positive. d(107/15) Simplify (p(-2/21)pp/p(-5))/(p10/p4) assuming p is positive. p(19/21) Simplify (i/(i/(i/i(1/5))))(10/11)/((i/i(-11/5))/i(1/2)) assuming i is positive. i(-217/110) Simplify (v6/v(3/17))/(v16v/(v/(vv(2/13)))) assuming v is positive. v(-2504/221) Simplify (((n/n(4/5))/(n(2/3)n))/(((nn*(1/6)nn)/n)/n(2/13)))(13/4) assuming n is positive. n(-1357/120) Simplify ((m2)7((m/(mm(2/11)m))/m)/mm(-1/3)m)(1/28) assuming m is positive. m(379/924) Simplify (rr(-5/6)rr(-4)(r(r(r/(rr/((r/(r/(rr*(3/2)rr)))/rr)r)r)/rrr)/r)/(r/r*(3/10)r))(-45) assuming r is positive. r(-87/2) Simplify (z*(-27)/(z/((zz/(z*(-24)/z)z)/z)))/(z4)(-5/9) assuming z is positive. z*(11/9) Simplify (((yy(1/2))17)(2/21))(-3/11) assuming y is positive. y(-51/77) Simplify w(-1/31)w/w12w*(2/3)w/(w/(ww(-20)/w)) assuming w is positive. w(-2824/93) Simplify (f/f5f*8)/(ff1)48 assuming f is positive. f*(-92) Simplify (ll*(-16/3)l)/(ll/l(-8))l*(-23)/ll(2/19)/l assuming l is positive. l(-2179/57) Simplify ((((k/k(-4))/k)/(k/k(-3/8)))(-42))46 assuming k is positive. k*(-10143/2) Simplify (d(d/d(1/2))/d)(-9)/((d(dd*4dd)/d)/(d(1/5)/dd)) assuming d is positive. d(-113/10) Simplify (n(2/5))*(1/19)(n/n(-12))/n(-14) assuming n is positive. n*(2567/95) Simplify yy/(yy/(((y26y)/y)/y))yyyyy(-2/7)(y(1/16))(-31) assuming y is positive. y(2999/112) Simplify (q/(q(2/17)/q)q/(q3/q))/((q(q*13q)/q)/(q/(q*(-7)q))) assuming q is positive. q(-104/17) Simplify (o(1/3)/o)/(((oo(-2/55)o)/o)/o)o(1/17)/o12 assuming o is positive. o(-35263/2805) Simplify s(-2/11)/(s(ss19)/ss)s(-5)/s(-24) assuming s is positive. s(-24/11) Simplify ((k(kkkk(-2))/k)/kkkk(-2/9))/(k(-2/7))(-2/71) assuming k is positive. k(7916/4473) Simplify (a/(a/a*(-31))aa/(aa/(a*(-20/9)a)))/(a(5/4)/a)47 assuming a is positive. a(-1583/36) Simplify (x(1/10)x28)/(xx*(2/7)xx)(-19/4) assuming x is positive. x(6119/140) Simplify (l(-11/2)l*(-1/2)ll)/((l(l/(l*(2/43)l))/ll)/(l7/l)) assuming l is positive. l(45/43) Simplify (s(-2/23)/s)39/(s14/(s/(s/s(-3/7)))) assuming s is positive. s(-9148/161) Simplify (((v(v*(-1)vv)/v)/v)/(v/(v/(vvv/v(-20/9)))))42 assuming v is positive. v(-658/3) Simplify m(4/9)/(m/m(-7))(mm(-5/6)m)(-9/7) assuming m is positive. m(-163/18) Simplify ((p/p*(2/9)p(2/7))/(p(-2/3)p(-5)))(-6/13) assuming p is positive. p(-848/273) Simplify (y(-3/4)(yy(-2/29)/yy)/y)/(y*(-5)(yy(2/9)y)/y) assuming y is positive. y(3089/1044) Simplify (a11a(-8/7))/(a12a*(-3/2)aa) assuming a is positive. a(-37/14) Simplify (u(-1/16)u(-7))(-34) assuming u is positive. u(1921/8) Simplify o(1/20)/o*12o*(-4/9)ooo(3/7) assuming o is positive. o(-12557/1260) Simplify p17/p7p19/p13 assuming p is positive. p16 Simplify i/(i/(i(i/i*(-18))/i))ii(-4/15)(i(-2/17))(8/15) assuming i is positive. i*(1672/85) Simplify ((tt*(-1/8)t)/t*(-3/5)t*(1/4)/t(t/t2)/t)(-5/3) assuming t is positive. t(11/24) Simplify (i(-2/7)i/i(-1/4)i*8iiii(-1)/i)(-1/48) assuming i is positive. i(-93/448) Simplify (f/(ff*(8/7)f)f/(f/f(-4/9)))/(f(-5/8)/f(5/6)) assuming f is positive. f(-569/504) Simplify (q(-2/5)qq(-3)qq/(qq*(3/7)/q)q/(q/(q/(q/(q*4/q))))q)(-24) assuming q is positive. q(-2664/35) Simplify (ff(f(((f/(ffff*4))/f)/f)/f)/ff/f*(-2/9)(f(2/5))(-10))5 assuming f is positive. f(-440/9) Simplify c*(-1/4)c*(2/23)/c((c((c(-1/6)c)/c)/c)/c)/c1 assuming c is positive. c(-919/276) Simplify (q*(-17)qq(-13))/((qqq/q(2/21))/(q/q(-10))) assuming q is positive. q(-439/21) Simplify (k(1/5)/kk)(7/3)/((k/k(-20))/kk/k(3/11)) assuming k is positive. k(-3343/165) Simplify (b(-10))(-2/93)/(b3bb/((b/b(-7/4))/b)b) assuming b is positive. b*(-1501/372) Simplify ((n/(nn(1/2)))(-44)(n/(n/n(1/6))nnnn)45)34 assuming n is positive. n7123 Simplify (v1vv/((v/(v/(v/(v/((v(2/17)/vvv)/vv)))v))/v))/((v/(v(vvv*9v)/v))/(((((v/(vv(-9)))/v)/v)/v)/vv)) assuming v is positive. v*(355/17) Simplify ((rr(-12/11)/r)/r(-6))(-43) assuming r is positive. r(-2322/11) Simplify ((s(-2/9))(-3/22))(1/14) assuming s is positive. s(1/462) Simplify (((kk(-23)/k)/k(k/(k*4/k))/kk)(-19))(-13) assuming k is positive. k*(-6422) Simplify tt*(-6/5)tt(2/23)(((t*(5/7)t)/t)/t)(-4/13) assuming t is positive. t(10202/10465) Simplify ((t2/t(-2/9))/(t(-7)/t(-1/3)))(-2/73) assuming t is positive. t(-160/657) Simplify (j(2/5))(-42)/(j10)(2/39) assuming j is positive. j(-3376/195) Simplify ((n(-1/31)nn(-1/2)/n)(-2/37))(-4) assuming n is positive. n(-132/1147) Simplify (y*(-2/13)/yy/(y8/y))/(y(5/2)y(1/8)/y) assuming y is positive. y(-913/104) Simplify ((r/(r/(rr*22r)r))/r(-13))9 assuming r is positive. r324 Simplify ((pp*(-4)p(2/9))(-2/37))(-1/48) assuming p is positive. p(-25/7992) Simplify ((((w*(1/4)/ww)/w)(-33))(2/57))(-6/11) assuming w is positive. w(-9/19) Simplify (mmm(3/7))35/(m10)(3/4) assuming m is positive. m*(155/2) Simplify ((mm*2/mm)/m)*(-22)m*(2/3)m/m(-5) assuming m is positive. m(-112/3) Simplify ((v/(vv/(v/v(-2)v)))/v)*3(v(-1/2))(1/39) assuming v is positive. v(467/78) Simplify (l10)*(-7)l/((l/(ll(l/(l/((ll/(l4/l))/l)ll))/ll))/l)l(-3) assuming l is positive. l(-74) Simplify (xxxx/x(-7))(5/2)x(-28)/(x(-2/83)/x) assuming x is positive. x(87/166) Simplify tt/((tttt(-1/4))/t)t*8t*(-4/3)t4/t assuming t is positive. t(119/12) Simplify ((v*4v5/v)20)(-7/8) assuming v is positive. v(-140) Simplify (x0)(-50)x2/x(-1/5) assuming x is positive. x(11/5) Simplify o(1/2)o/(o*(1/7)/o)oo(o(-1/4)/o)(-34) assuming o is positive. o(328/7) Simplify (x33/x31)/((x/(x/x7))/(xx/x(-20))) assuming x is positive. x17 Simplify ((x(-4)/xx)/x)*(-8/11)/(x/((x(xx1)/x)/x)xx8) assuming x is positive. x(-59/11) Simplify (z14)(11/2)(z(-1/11))(-21/5) assuming z is positive. z(4256/55) Simplify (x/x18xx(15/4))/(x(-20)/x2) assuming x is positive. x(39/4) Simplify (x*(-4)x*(1/5)((x/(x(3/4)/x))/x)/(x(-5/2)x))(-1/6) assuming x is positive. x(41/120) Simplify ((yy*(-2))/((y/(yy/(y/(y/y*(6/7))y))y)/y))/(y(-16)/y12) assuming y is positive. y(183/7) Simplify qq*(-7)qq/(q/q(-5/7)qq)q(qq*(-2/3))/((qq(-14))/q) assuming q is positive. q(160/21) Simplify (((i0)(-1))(2/11))9 assuming i is positive. 1 Simplify (f(-4/7))(-8)/(f(-5/11)/f(-21)) assuming f is positive. f*(-1230/77) Simplify (kk*9)/kk/k*(-20)(k*(-11)k)(-22/9) assuming k is positive. k(490/9) Simplify (((m*(-2/13)m)/m)*(-21/4)m*(-8)m/(mm/((mm(-8))/m)))14 assuming m is positive. m(-2947/13) Simplify i(-3/19)ii*(-2/5)ii(-5/3)ii(-14)i assuming i is positive. i*(-3484/285) Simplify (((pp(-2/3))(1/34))(-29))(-1) assuming p is positive. p(29/102) Simplify ((b13)42)(-4) assuming b is positive. b(-2184) Simplify ((g(10/9)/gg12g)(-1/2))(-26) assuming g is positive. g(1534/9) Simplify ((y6/y*(-10))/((yy*(2/11))/yyy7/y))(-12) assuming y is positive. y(-1164/11) Simplify ((b/(b/(b/(bbbbb(-1)/bbbb)))bb(-10))45)(4/27) assuming b is positive. b(-260/3) Simplify ((i*(-1/10)i(ii8)/i)/((i/((i/(i/i(-4/7)))/i))/i(-3/7)))(-2/35) assuming i is positive. i*(-59/175) Simplify ((z(zz0)/z)(-2/107)z9/(z/z7z))(20/9) assuming z is positive. z(29920/963) Simplify (f23ff7/f)10 assuming f is positive. f300 Simplify ((pp/(pp(-3/22)))/pp/(pp21p))(5/6) assuming p is positive. p(-2405/132) Simplify ((x(-2))(7/5)/(xx(-1/2)/x)(-41))(-28) assuming x is positive. x*(32	{ "pile_set_name": "DM Mathematics" }
, 12312463 What are the prime factors of 3356364658? 2, 47, 107, 333701 List the prime factors of 69076636. 2, 23, 41, 18313 List the prime factors of 6739256938. 2, 3369628469 What are the prime factors of 42238784? 2, 7, 13469 What are the prime factors of 1789029911? 19, 9539, 9871 What are the prime factors of 3290741767? 23, 7103, 20143 List the prime factors of 6299781889. 223, 28250143 What are the prime factors of 2964286? 2, 13, 23, 4957 List the prime factors of 1176066267. 3, 1979, 198091 List the prime factors of 8543554205. 5, 1708710841 List the prime factors of 156472441. 41, 937, 4073 What are the prime factors of 35608337? 19, 269, 6967 What are the prime factors of 979982230? 2, 5, 31, 619, 5107 What are the prime factors of 32081736? 2, 3, 1093, 1223 List the prime factors of 6745320422. 2, 239, 14111549 List the prime factors of 31126330. 2, 5, 97, 32089 List the prime factors of 43690014. 2, 3, 331, 7333 List the prime factors of 168968929. 53, 3188093 List the prime factors of 515982590. 2, 5, 51598259 List the prime factors of 213897597. 3, 59, 1208461 List the prime factors of 748942401. 3, 59, 4231313 What are the prime factors of 902283456? 2, 3, 4699393 What are the prime factors of 768564889? 768564889 List the prime factors of 338237677. 19, 131, 135893 What are the prime factors of 57069851? 57069851 List the prime factors of 5850858994. 2, 1277, 2290861 What are the prime factors of 896676574? 2, 23, 37, 526837 What are the prime factors of 653375096? 2, 11, 31, 53, 4519 What are the prime factors of 160913288? 2, 20114161 List the prime factors of 3804084513. 3, 311, 453029 List the prime factors of 859608921. 3, 491, 583577 List the prime factors of 2571168. 2, 3, 26783 What are the prime factors of 2940806? 2, 11, 133673 What are the prime factors of 4739103249? 3, 1579701083 What are the prime factors of 151603980? 2, 3, 5, 11, 229703 List the prime factors of 204155512. 2, 11, 97, 23917 What are the prime factors of 1415086? 2, 707543 What are the prime factors of 3860705554? 2, 2663, 724879 What are the prime factors of 273838343? 273838343 List the prime factors of 379055037. 3, 61, 2071339 What are the prime factors of 74437408? 2, 109, 21341 What are the prime factors of 342377155? 5, 139, 492629 List the prime factors of 1790873514. 2, 3, 331, 300583 What are the prime factors of 10141471? 10141471 List the prime factors of 166438158. 2, 3, 27739693 List the prime factors of 742517610. 2, 3, 5, 24750587 What are the prime factors of 6989935? 5, 223, 6269 List the prime factors of 255255601. 255255601 List the prime factors of 34731531. 3, 29, 44357 What are the prime factors of 17371389? 3, 7, 37, 79, 283 What are the prime factors of 117736211? 59, 1995529 List the prime factors of 678682798. 2, 67, 1871, 2707 What are the prime factors of 1349083727? 73, 18480599 List the prime factors of 297015751. 181, 1640971 List the prime factors of 73867509. 3, 8207501 List the prime factors of 118171447. 23, 271, 18959 List the prime factors of 760309172. 2, 7, 1091, 24889 List the prime factors of 25427017. 7, 11, 71, 4651 What are the prime factors of 105160784? 2, 23, 285763 List the prime factors of 2215024161. 3, 7, 19, 292181 List the prime factors of 1468454716. 2, 569, 769, 839 List the prime factors of 439293508. 2, 29, 127, 29819 List the prime factors of 895115436. 2, 3, 317, 235309 What are the prime factors of 3021187619? 3433, 880043 What are the prime factors of 76617964? 2, 83, 89, 2593 List the prime factors of 181761029. 31, 61, 277, 347 List the prime factors of 211182983. 11, 271, 70843 What are the prime factors of 462669148? 2, 359, 322193 What are the prime factors of 36188204? 2, 13, 695927 What are the prime factors of 443507828? 2, 110876957 What are the prime factors of 163336400? 2, 5, 408341 List the prime factors of 554258119. 554258119 What are the prime factors of 1601429080? 2, 5, 193, 283, 733 What are the prime factors of 27116246? 2, 13558123 List the prime factors of 1046396186. 2, 11, 37, 773, 1663 List the prime factors of 1690061663. 139, 12158717 List the prime factors of 8462334635. 5, 6359, 266153 What are the prime factors of 24705385? 5, 1061, 4657 What are the prime factors of 6988266215? 5, 7, 19, 337, 31183 What are the prime factors of 27075835? 5, 5415167 What are the prime factors of 194617557? 3, 887, 24379 List the prime factors of 671883780. 2, 3, 5, 11198063 List the prime factors of 13019201. 13, 193, 5189 What are the prime factors of 344447238? 2, 3, 19, 3021467 What are the prime factors of 20551020? 2, 3, 5, 7, 167, 293 What are the prime factors of 19368600? 2, 3, 5, 19, 1699 What are the prime factors of 20535908? 2, 5133977 List the prime factors of 442044809. 37, 1597, 7481 What are the prime factors of 2362149811? 7, 31, 677, 2297 List the prime factors of 793355153. 313, 2534681 List the prime factors of 21775043. 23, 946741 List the prime factors of 15622897. 15622897 What are the prime factors of 3943340453? 13, 29, 37, 282697 List the prime factors of 176892727. 11, 31, 518747 List the prime factors of 523196254. 2, 7, 37371161 What are the prime factors of 97812823? 79, 1238137 List the prime factors of 942027851. 17, 29, 1109, 1723 List the prime factors of 3334903787. 17, 59, 3324929 List the prime factors of 1193415591. 3, 67, 617, 9623 What are the prime factors of 27303655? 5, 487, 11213 What are the prime factors of 1774636876? 2, 11119, 39901 What are the prime factors of 1932368601? 3, 31, 20778157 What are the prime factors of 4038755790? 2, 3, 5, 17, 7919129 What are the prime factors of 395965488? 2, 3, 151, 54631 What are the prime factors of 541225499? 541225499 What are the prime factors of 936614? 2, 7, 149, 449 What are the prime factors of 74042508? 2, 3, 31, 199039 What are the prime factors of 495283389? 3, 17, 1759, 5521 List the prime factors of 4662563. 233, 20011 List the prime factors of 2583187115. 5, 97, 5326159 List the prime factors of 9308753. 9308753 List the prime factors of 174656437. 174656437 List the prime factors of 1660597163. 1660597163 What are the prime factors of 266811780? 2, 3, 5, 4446863 What are the prime factors of 1074865901? 5827, 184463 What are the prime factors of 785408490? 2, 3, 5, 8726761 List the prime factors of 1673956516. 2, 37, 11310517 What are the prime factors of 59045632? 2, 230647 List the prime factors of 32236526. 2, 7, 2302609 List the prime factors of 18157909. 7, 11, 31, 7607 List the prime factors of 478503339. 3, 23, 6934831 What are the prime factors of 1889089758? 2, 3, 71, 1478161 What are the prime factors of 37801505? 5, 7, 1080043 List the prime factors of 41532525. 3, 5, 197, 937 What are the prime factors of 25384623? 3, 11, 769231 What are the prime factors of 41476499? 421, 98519 List the prime factors of 96737879. 7, 53, 239, 1091 What are the prime factors of 237327130? 2, 5, 23732713 List the prime factors of 109372513. 853, 128221 What are the prime factors of 750186042? 2, 3, 125031007 What are the prime factors of 74454314? 2, 11, 3384287 List the prime factors of 24568144. 2, 331, 4639 What are the prime factors of 1039152611? 7, 148450373 List the prime factors of 62572598. 2, 11, 463, 6143 List the prime factors of 419434605. 3, 5, 1035641 List the prime factors of 227805284. 2, 7, 197, 41299 What are the prime factors of 628663580? 2, 5, 83, 378713 What are the prime factors of 1824015042? 2, 3, 79, 541, 2371 List the prime factors of 174570865. 5, 7, 29, 293, 587 What are the prime factors of 134662588? 2, 33665647 What are the prime factors of 46850398? 2, 7, 3346457 List the prime factors of 115897487. 115897487 What are the prime factors of 3666828322? 2, 569, 3222169 List the prime factors of 449337089. 421, 877, 1217 List the prime factors of 2282727761. 2282727761 What are the prime factors of 1648985307? 3, 67, 8203907 What are the prime factors of 12428133? 3, 1583, 2617 What are the prime factors of 1593154156? 2, 11, 23, 997, 1579 What are the prime factors of 4960730? 2, 5, 496073 What are the prime factors of 43895960? 2, 5, 23, 47713 What are the prime factors of 550633820? 2, 5, 11, 101, 24781 List the prime factors of 773637026. 2,	{ "pile_set_name": "DM Mathematics" }
f. 0 Let k(c) = -c*3 + 3. Let q be k(0). Let g = q - -2. Suppose -5y = -4y - g. Solve -2d + ya - 9 - 1 = 0, -16 = -4d + a for d. 5 Let u = 102 + -101. Let i(v) = -v*3 + 6v*2 - 3v + 2. Let y be i(5). Solve 4r - u = f, 0 = f + 4r - 3 + y for f. -5 Suppose -p - 6 = -3h, 5h - 2p = 2 + 7. Let d = 17 - 9. Suppose -d = -4g - 4w, 3g - 11 + 1 = -w. Solve 2y + 5 = u, -y - 1 = -gu + hu for u. -3 Let k(g) = -g2 + 4g - 3. Let i be k(3). Suppose -4j + q - 1 = i, 3j + 9 = 7j + q. Suppose -4h + 15 + 9 = 0. Solve 2v + h = 0, -3y + j + 14 = -v for y. 4 Let x = -200 - -500. Let q be (-2)/(-8) + x/80. Solve 0 = 3j - qb - 16 - 2, 5j - 22 = 4b for j. 2 Let v = 746 - 742. Solve r - 12 = 5l - r, 4r = v for l. -2 Suppose -25v - 116v + 11v = 0. Suppose -m - m - 2 = 0. Let j be -2 + 6 + (-2 - m). Solve 5o - 19 = -3p + j, v = -o + 3p + 8 for o. 5 Let k be 8/6 - (-2)/3. Let g = -8304 - -8309. Solve -3 - 3 = gd + 3f, -kd + 3 = 3f for d. -3 Let h be 2/(-4)-2-2. Let j be (0/(h/1))/2. Let o(p) = -p. Let b be o(j). Solve b = 3x + 4m + 1, -x - 9 = -5x + 5m for x. 1 Suppose -3g + 4l + 7 + 9 = 0, -4l = -8. Let u(x) = -2x + 0 + 0x - 5 - 3. Let c be u(-6). Solve 0 = -5o + cn - g, o = 3o - n + 2 for o. 0 Let x(s) = -13s2 - 131s - 6. Let a be x(-10). Solve 0k + ar = -3k - 9, 2r + 6 = 0 for k. 1 Let w be -7 + 1 + -315/(-5). Solve 0d + wh + 6 = -2d, d = -2h - 5 for d. 3 Let u(t) = -t2 + 6t + 0t2 + 3 - 19t. Suppose -3i - 26 = 13. Let v be u(i). Solve 3m = -k, 0k = vm - 5k for m. 0 Let z(m) = 2m*3 - 35m*2 - 16m - 23. Let t be z(18). Solve 4j + 3l = t - 2, 0 = -3j + 4l + 27 for j. 5 Let g be (-2)/(-5) + ((-477)/(-45) - 7). Solve 3t - 3h = -0t - 18, gh + 21 = -5t for t. -5 Suppose -2x = -8 - 6. Suppose -5y + b + 1 = 4, -4b - x = -y. Let h be (-3 - -9 - 3) + y. Solve hu + 5i = 3, 3i + 14 = 4u - 5 for u. 4 Let g(d) = d*3 + 8d*2 + 10d - 8. Let i be g(-6). Solve -5m - 2b = -2 - 0, -4 = -im - 4b for m. 0 Suppose -13o + 5 = -12o. Suppose f + 7 = x, -5f + 42 = ox - 3f. Solve 3n = -3u + 9, -xu + n - 3 = -3u for u. 0 Suppose -15 = -5i + 3j + 5, 5i - 4j = 20. Solve -3c - 37 = -5f, -3f = ic - 12 + 13 for f. 5 Suppose -4h = -15h + 22. Solve -2d - hd - 20 = 0, 5 = 4n + 3d for n. 5 Let d(a) = 3a*3 + 59a*2 - 23a - 59. Let p be d(-20). Let g = 28 + -15. Solve 4m - p = -3f + g, 5m + 3f - 19 = 0 for m. 5 Let j = 38 + -17. Let s = j + -17. Solve 0 = -5q - 15, sy - 5q = -2q + 25 for y. 4 Let o(z) = -4z + 4. Let a be o(-7). Let p be a3/126. Let l = p + -32. Solve -5c + 22 = u, -c - 4u = c - l for c. 4 Suppose 7f = 3f - 132. Let c = f - -35. Solve 0 = s - 3t + 8, -5s + cs = -t + 16 for s. -5 Suppose 1 = 3f - 2. Let s be 0 + 0 + (f - 1). Suppose 4k = -5b + 137, -27 = 4b - 5k - 112. Solve 4c + b = -5t - 0t, s = -2c - 10 for t. -1 Let t(j) = j2 + 2j - 20. Suppose x = 4r + 21, -3x = -7r + 2r - 21. Let z be t(r). Solve 0 = -3u - zp, -4u + 4p - 5p = 13 for u. -4 Suppose -11w = w - 120. Solve 2i + 21 = -2a - i, -i = -5a - w for a. -3 Let o(d) = 30d - 296. Let a be o(10). Solve -ar + 4h = 3h + 4, 4h = -r + 16 for r. 0 Suppose -15 + 13 = 2l - 4w, 0 = -5l + 5w + 10. Solve -m + 2b = 3m - 14, -21 = -4m - lb for m. 4 Let y be (2 + 30/4)2. Let r = -34 + y. Let s = -11 - r. Solve 0 = 5x + 2a + 21, x + sx = -5a - 30 for x. -3 Suppose -16 + 8 = 4k. Let w = 6 - k. Solve a = 3g - w, 0 = -3g + 3a - 8a + 32 for g. 4 Let f be 3 + -2 + (-4 - -1). Let k(g) = -4g. Let w be k(f). Suppose -2 = 3r - w. Solve -2t = -2a, rt - 5a = t + 8 for t. -2 Let h = -362 + 367. Solve 0 = 2o + j - h, -3j + 4 = 1 for o. 2 Let x = -22 + 26. Suppose -5l + 17 = a, l - 2a = xl - 13. Solve -p + 2p - 5 = 2o, -9 = 2o + lp for o. -3 Let p = 1462 + -1462. Let u be 39/4 - (-1)/4. Solve pv - 2v - u = -2l, 0 = -3l for v. -5 Let t = -130 - -131. Suppose -t = 4l - l - s, 3l = -5s + 5. Solve -4n = -4p - 4, l = n - 6n - 4p + 5 for n. 1 Suppose -8t = -3t - 125. Let w = 28 - t. Solve 2y - 5l + 31 = 0, -w + 2 = -3y - 2l for y. -3 Let y(g) = g*3 + 2g*2 + 3g + 1. Let h be y(-3). Let w = -10 - h. Suppose 7 = -3z - 4p, -2p - 14 = -5z + 3z. Solve m = -a - 3 - 0, w = -zm - a for m. -2 Let w = -157 + 170. Solve 3c - h - w = -2h, 1 = c + 2h for c. 5 Let d = -27 + 13. Let p = 22 + d. Solve -p = -4q - 0q, 4 = k + q for k. 2 Let x = 257 - 251. Solve 21 = 2s + 5j, -s + 4j - j - x = 0 for s. 3 Let h be (((-76)/(-20) + -4)0)/(-3). Solve 5f - 16 = -j - hj, 2j = 4f - 10 for j. 1 Let q be 10/(-155) + 1368/62. Suppose 0m + 20 = 5m, -5m = s - 22. Solve sk + 11 = 2c + 5, k = -4c + q for k. 2 Let k = -20 - -20. Suppose 2p + 4w - 28 = k, -w + 6w - 59 = -4p. Let r = 21 - p. Solve 0 = q - 6q - 4z - 5, 5z - 50 = rq for q. -5 Let v = 893 + -889. Solve -2u + 2h = h - 7, -vu + 5h = -23 for u. 2 Suppose 17 = -2v + 53. Suppose -v = -5l + 47. Solve -4t + 3s = -0s + 7, -t + 3s = l for t. 2 Let n be (0/5)/(3 + -9). Solve nj - j + 2m + 5 = 0, 0 = 5j - 3m - 25 for j. 5 Suppose -9f + 38 = -7. Solve 3z = -9n + 4n - 40, -fz = 4n + 45 for z. -5 Let a(y) = -4y2 + y + 4. Let q(f) = -f2 - f + 1. Let j(v) = a(v) - 3q(v). Let u be j(3). Solve -n = um - 17, 5n - 8 = n - 4m for n. -3 Let s(q) = q*2 + 12q - 12. Let m = 16 + -29. Let p be s(m). Suppose -3v + 22 = -5h, -4v = 5h - 0h - 6. Solve -5l - 29 = vy, -5y + 21 = -5l + p for l. -5 Let j(c) be the first derivative of -5c*4/4 - 2c3/3 - c2/2 + 8. Let z be j(-1). Solve 0n = n + 3a + 2, za - 2 = n for n. -2 Let v be ((-72)/(-10))/((-15)/(-50)). Suppose -v = -0c - 2c + 3j, 36 = 3c - 4j. Solve 5l - 2n - c = 2l, -8 = -2l - 3n for l. 4 Suppose -9s + 22 = -14. Solve -19 = sk - 3v, 3k - 4v - v = -17 for k. -4 Suppose -5m + 3o = -2o - 5, -4 = -4o. Suppose mg + 3 = 3g + 2q, 4g = 5q + 12. Solve -5y + 2u + 1 = 0, -u + 3 = -2y + gy for y. 1 Let r(c) = 4c. Let l be (3 + 9/(-3))/1. Let q = l - -1. Let y be r(q). Solve -2u - 2 = 3a, -2u = -a - y - 2 for a. -2 Let o(a) = -a - 17. Let q be o(-17). Suppose -3c + 5t = 95, -4c - 4t - 60 - 24 = q. Let h = 27 + c. Solve 3l = -3, l = -5m + 2 + h for m. 1 Let m = 33 + -33. Suppose m = 12j - 13j. Solve 0d = 3d - 5s + 1, -2s - 2 = j for d. -2 Suppose h = 4g + 252, 4g + 3h + 140 = 2g. Let a = g + 74. Solve -3o = 6, -2t - a + 2 = 4o for t. 0 Let z(p) = -p*3 - 3p*2 + 7p + 25. Let m be z(-3). Solve 2 + 6 = -mx + 4d, 4x = 3d - 5 for x. 1 Let u(f) = -19 + 0f2 - 3f*2 + 13f + 2f2. Let k be u(11). Solve 0 = -kp + 5i - 50 + 13, 0 = 2p - i + 13 for p. -4 Let m(k) = -k*3 - 28k*2 + 2k + 96. Let c be m(-28). Solve -3y + c = -2j + 18, -3y - 13 = 5j for j. -5 Let v(y) = y*2 - 3 - 10y + 8y + 0y. Let p be v(-2). Solve k - 5q = 20, -pk + 2q - 5 - 10 = 0 for k. -5 Let l = 84 + -81. Suppose -5f = 25, 2a + 0f = lf + 21. Solve -4c + 2c = -6, 0 = -au - c for u. -1 Let i(d) be the second derivative of d4/12 - d3/6 + d. Let u be 5(24/(-15))/(-4). Let s be i(u). Solve -n + 6h - 22 = sh, 33 = -4n + 5h for n. -2 Let q(h) = -5h + h*3 + 4 + 2h*3 + 2h*3 - 3h*2 - 2h*3. Let b be q(3). Suppose 0 = -4s + 65 + b. Solve 2k + 5i - 29 = 0, -7 = 4i - s for k. 2 Let r = 202 + -192. Solve 2y = z + r, -2y = -3z - 5y - 3 for z. -4 Let w be -4(8/4 - 15/12). Let i(c) = -c*2 - c + 8. Let v be i(w). Solve -2l - 23 = 2o - 9, -18 = 3o + vl for o. -4 Let p(z) = -z2 - 5z - 3. Suppose 0 = 7d + 21 - 0. Let t be p(d). Solve -3r + q - tq = 11, -q = r + 5 for r. -1 Let f(i) = -3i*2 + 53i + 20. Let w be f(18). Solve 4c = -5y + 12, -4y + 2y + w = 3c for c. -2 Let v be -2 - (10/(-5) - 5). Solve 5j - 5g + 5 = 0, 5j = vg - g - 4 for j. 0 Let u(t) = -16t - 174. Let w be u(-11). Solve 9v - 15 = -5o + 14v, -o + wv = -2 for o. 4 Suppose -4h = 3d - 14, 5h + 6 = -d + 18. Solve 0i - 3m = di - 1, 9 = 4i - m for i. 2 Let h = 545 - 543. Solve -2w - c = 2, -hw + 4c = -w + 19 for w. -3 Let k be (-309)/(-12) + 2/8. Suppose -15 = 2p + 3p - a, -k = 3p - 4a. Let i(c) = -c + 1. Let q be i(p). Solve -5g - t + 5 = -3g, -q*t = 9 for g. 4	{ "pile_set_name": "DM Mathematics" }
Give t(w). -8 Let w(k) = 11k + 2. Let q(m) = 5m. Let a(b) = -5q(b) + 2w(b). Calculate a(3). -5 Suppose -q + 4u + 7 = 0, 0 = 4q + 6u - 2u - 8. Let s(g) = -g*3 + 2g*2 + g + 4. Give s(q). -2 Suppose 0 = 13v - 17v + 12. Suppose -3k + 4w = 8, -vw = 3k - w - 4. Let z(u) = u2 - u. Give z(k). 0 Let i(g) = g2 - 4g + 8. Let c be (4 + 105/(-30))42. Determine i(c). 8 Let f(h) be the first derivative of -1/4h4 + 7/3h*3 - 3 + 5h - 4h2. What is f(5)? 15 Let r be (-18)/(4/2) - -6. Let n(a) = -3a*2 + 2a + 2. Calculate n(r). -31 Suppose -3u + 19 = -f, 2u - 24 = -0f - 5f. Suppose 5w - 46 = -1. Suppose -10v + uv + w = 0. Let c(p) = -p3 + p2 + 3p - 1. What is c(v)? -10 Suppose 0 = -12r + 17 + 19. Let b(d) = -dr + 16d + 3d2 - 2 - 17d - 3d2 + 3d*2. Let u(k) = 4k - 1. Let o be u(1). Calculate b(o). -5 Let j(a) = a + 7a + 1 + a2 + 3. Suppose u + 6p - 4p + 4 = 0, 0 = 2p - 2. What is j(u)? -8 Let x = -54 - -84. Suppose -x = -4f - 2p, p = -2f - 2p + 9. Suppose -f = u + 2u. Let z(o) = o3 + 3o*2 + o - 2. Determine z(u). -5 Let r be 211 - (-3 + (-12)/(-2)). Suppose 16 = 7z - r. Let f(i) = i2 - 3i + 2. Give f(z). 12 Let i(j) be the third derivative of 5/24j4 - 1/120j*6 - 7j*2 + 0j + 0 - 1/3j3 + 1/30j*5. Calculate i(3). 4 Suppose z = y + 3, 6z - 17 = 2z + 5y. Suppose -2 = 5q - 22. Let s(u) = u - 3u*3 - u + qu*3 + 2 - 2u*2 - u. Determine s(z). -12 Let x(h) be the first derivative of -2h*3/3 + 7h*2 - 5h - 186. What is x(9)? -41 Let z(j) be the second derivative of j*3/3 - 3j*2/2 - 2j + 1. Give z(2). 1 Let q(t) = -t*2 + 19t + 2. Let l be q(19). Let r(a) = -5al - 5a + 0 + 6a2 - 2. Calculate r(4). -6 Let b(v) be the second derivative of -v5/60 - 29v*3/6 + 6v. Let w(r) be the second derivative of b(r). Give w(7). -14 Suppose -2x - x = -2d + 65, 4d - 110 = 2x. Suppose 6g = d + 11. Let q(v) be the third derivative of -v5/60 + v4/3 - 3v*3/2 + 2v*2. Determine q(g). 3 Let a(y) = -2y + 11. Let u be (-3 - 33/(-12)) + 212/16. Give a(u). -15 Let s(i) = 3i + 46. Let v(a) = -3. Let j(n) = -s(n) - 6v(n). Determine j(-5). -13 Let x(d) = d*2 + 11d + 15. Let q be x(-10). Let s(c) = -3c + qc + 65 - 70. Let w be (1 - (-7 + 1)) + -1. Calculate s(w). 7 Suppose 2 + 2 = 2z. Let u(n) be the second derivative of -1/2n*z + 5n - 1/20n5 - 1/3n4 + n3 + 0. Calculate u(-5). -6 Let z(o) = -o + 3777 + 2o - 3788. What is z(16)? 5 Let q = 2 - 1. Let l(a) be the third derivative of a6/120 - a5/60 + a4/24 - a3/6 + 32a2 + 5. Determine l(q). 0 Let t(j) = j2 + 7j + 1. Let v be 68/20 + (-2)/5. Suppose -4w + vm - 18 = 0, -20 = 4w - 0w - 2m. Determine t(w). -5 Let x(z) = z*2 - 6z + 1. Let f be 151(-12)/(-30). Determine x(f). 1 Suppose p - 10 = -u, 5u = 5p + 1 - 61. Let n(v) = v*3 - 12v*2 + 10v + 10. Determine n(p). -1 Let z be 13/(-26)0/1. Suppose zn + 2n = 14. Let p(w) = -w3 - 2w*2 + 5 - n + 0w2 + w2. Determine p(-2). 2 Let o(g) = 4g2 - 5g2 + 1 + g3 - 5 + g. Let w(v) = -v*3 + 8v*2 - 7v + 5. Let x be w(7). Let y be 1 + 3 - (x - 1). Give o(y). -4 Suppose 2b + 3p + p = -16, -5b = -p + 40. Let a = b - -14. Let u(k) = 8k*2 + 2k - 13. Let w(r) = -5r2 + 7. Let s(x) = -3u(x) - 5w(x). Determine s(a). 4 Suppose -4d - 21 = -5. Let l(b) = -b*2 + b. Let g(j) = 2j*2 - 5j + 2. Let s(r) = -g(r) - 3l(r). Let q be s(d). Let i(c) = -c + 1. Calculate i(q). -5 Let u(g) = 7g*2 + 5g - 11. Let z(q) = -15q2 - 12q + 23. Let p(f) = -13u(f) - 6z(f). Determine p(7). 5 Suppose -3z + 0x - x = -104, -10 = -2x. Suppose h + 29 = z. Let t(v) = v - 1. Give t(h). 3 Let d(t) = -t2 - 15t + 2. Let i be d(-15). Let h(p) be the first derivative of 0pi + 4/3p3 + p - 5. Determine h(1). 5 Let h(x) = x3 + 12x2 - 11x + 32. Let b be 26/3(-414)/276. Calculate h(b). 6 Let y(k) = k2 - 30k + 84. Let f be y(3). Let b(h) be the third derivative of -1/60h5 + 1/8h*4 + 0 - 1/120h*6 + 0h + fh2 - 1/3h*3. Give b(2). -8 Suppose 5g + 3c = -28, 3c - 8 = 2g + c. Let w(h) = -7h - 6 + 2h2 - 4h2 + h2. Give w(g). 4 Let a(u) = -u*3 + 6u*2 + 7u + 9. Let z(i) = -5i - 108. Let o be z(-23). What is a(o)? 9 Let b = -1422 - -1421. Let p(a) = 5a*3 + 2a*2 - 1. What is p(b)? -4 Let v = 67 + -57. Let z(n) = -6n + 3 + 0n2 + 3n*2 - 2n*2 + vn. Calculate z(-3). 0 Let t(g) = -g*2 + 7g - 5. Suppose -7j + 4j + 540 = 0. Suppose 23f - 3f - j = 0. What is t(f)? -23 Suppose 46w - 48w = 16. Let h(u) = 7u2 - 11 + u3 + 0u*3 + 28u - 38u. What is h(w)? 5 Let p(f) = -11f*3 - 18f*2 - 34f - 11. Let z(c) = 7c3 + 12c*2 + 22c + 7. Let g(a) = -5p(a) - 8z(a). Determine g(-5). 4 Let q(c) = -c*2 + 5c - 1. Let w = 4 + 1. Let s = 253 - 243. Suppose s = 3a - w. What is q(a)? -1 Suppose -y = y + y. Suppose 28j - 27j + 7 = y. Let p(f) = -f3 - 7f2 + f. Calculate p(j). -7 Let n(d) be the third derivative of -d7/2520 - d6/360 + d5/120 + 7d4/12 - 17d*2. Let j(m) be the second derivative of n(m). Determine j(-2). 1 Let x(s) = 3s*3 - 2s*2 + 2s - 1. Let r be x(1). Suppose -3n = 5n - 80. Let g(h) = -n + 4 + 7 + 4h3 - 2h*2 - 3h - 3h3. Give g(r). -5 Let j(a) = 2a - 2. Let o be j(-3). Let v(t) be the third derivative of t5/60 + t4/3 + t*3/2 - 30t*2 - t - 52. What is v(o)? 3 Suppose 4k + 24 = -0k. Let l(c) be the third derivative of -c6/720 - 7c*5/60 - 3c*4/8 - 6c*2. Let m(w) be the second derivative of l(w). Give m(k). -8 Suppose 0 = 3p + 2p - 4u + 6, 0 = 3p + u - 10. Let m(x) = -px + 3x + 5x - 2x + 5. What is m(-6)? -19 Let z = -473 - -475. Let j(q) = 4q - 4. Determine j(z). 4 Let y = -454 + 9081/20. Let i(z) be the third derivative of 0z + 3z*2 + yz*5 + 1/12z*4 + 0 - 1/3z*3 + 1/120z6. Calculate i(-3). -8 Let y(w) = -w + w3 + 167w2 + 174w*2 - 340w*2. What is y(1)? 1 Let q(j) = 2j*2 + 2j - 7. Let p(d) = -d*3 - 9d*2 + 3d + 7. Let z be p(-4). Let x = z - -82. Give q(x). 5 Let k(q) = q*3 - 2q*2 - 4q - 2. Let m be k(3). Let o(a) = 5a2 - 2a - 1. Let w(u) = u*2 - 1. Let s(b) = o(b) - 6w(b). Give s(m). -10 Let u = 361/4476 + 1/373. Let o(j) be the second derivative of -1/2j2 + 0j*3 + 0 - 3j - uj4. Calculate o(1). -2 Let r be 2(16/(-12))/(-1)3. Let s(t) = t2 - 9t + 10. Determine s(r). 2 Suppose -6o + o = -30. Let j(x) = -5x3 + x2 + 3x - 12. Let u(f) = 9f3 - f2 - 5f + 23. Let d(c) = 11j(c) + 6u(c). What is d(o)? -12 Let u = 12 + -7. Let h(k) = 3k*2 - u - 8k + 4k + k3 - 2k. Give h(-4). 3 Let q(v) = 7v3 + v2 + 2v + 2. Let l be (7 - ((8 - 4) + 0)) + -4. Let f be q(l). Let x(z) = -2z2 - 8z + 6. What is x(f)? -18 Let a = -27 + 32. Let u(m) = m*2 + 8m - 11. Let k be u(-10). Let s(q) = -7q2 + 8q - 2q2 + q2 + a + kq2. What is s(-5)? -10 Let q be (-4)/(-18) + (-112)/(-63). Let t(u) = -u3 + 3u2 - u - 2. Let j be t(q). Suppose 2p - 4p - 2 = j. Let k(i) = 2i. Calculate k(p). -2 Suppose 20 = -2w - 2a, w - 2w = 4a + 22. Let f(t) be the second derivative of t*5/20 + 5t*4/12 - 4t*3/3 - 7t2/2 - t. Calculate f(w). 5 Let t(h) = h3 + 8h2 + 12h + 3. Let c be t(-1). Let p(u) = u*2 + 1. Give p(c). 5 Let f(h) = 4h + 8h + 3 - 17h + 4h. Let g(j) = j - 1. Let s(t) = -f(t) - 2g(t). What is s(-3)? 2 Let k = 46 - 44. Suppose kg - 6i - 14 = -2i, -3g + 2i = -21. Let u(o) = o2 - 7o + 5. Give u(g). 5 Let r(d) = 3d - 18. Suppose 5j = 4t - 27, -2t + 2 = 4j - 18. Give r(t). 6 Let w = 38 - 33. Suppose d - 2d + 16 = -5x, -4x = wd + 7. Let q(f) = -f3 - f2 + 2f - 4. What is q(x)? 8 Let o(l) = 4l2 - 2l - 1. Suppose 3v = 5f + 2 + 20, -5 = f. Determine o(v). 5 Let m(o) = 3o2 + 3o - 1. Let v(k) = -15k2 - 13k + 8. Let b(f) = 11m(f) + 2v(f). What is b(-2)? 3 Suppose 2v + 23 = 5u + 9, 4v = -4u. Let j be 2 + v + 2 + 2. Let a(t) = -t*3 + 5t + 0t - 61t*2 + 64t*2 + 5 - 3t. Calculate a(j). -3 Let t(w) be the second derivative of -w*4/6 + 4w*3/3 - 7w*2/2 - 278w. What is t(4)? -7 Let b(m) = m*3 + 7m*2 + 3m + 1. Let n be (3 - 2)(1 + (-16)/2). What is b(n)? -20 Suppose -494 = 6z - 548. Let a(t) = 4t - 2t - 17 - t. Wh	{ "pile_set_name": "DM Mathematics" }
lacement from {p: 5, w: 5}? 10/21 Three letters picked without replacement from yfffffffffffyyfyylff. Give prob of picking 1 l, 1 f, and 1 y. 7/114 What is prob of picking 1 o and 1 i when two letters picked without replacement from {j: 1, h: 2, m: 3, a: 1, o: 1, i: 3}? 3/55 Two letters picked without replacement from {d: 7, f: 5, g: 2}. What is prob of picking 2 d? 3/13 Two letters picked without replacement from {l: 1, i: 2, c: 1, a: 1}. What is prob of picking 2 i? 1/10 What is prob of picking 1 a, 2 m, and 1 f when four letters picked without replacement from {f: 3, a: 2, m: 4, s: 1}? 6/35 Two letters picked without replacement from {d: 3, e: 1, c: 5, n: 4, q: 1}. What is prob of picking 1 q and 1 n? 4/91 Calculate prob of picking 2 n and 2 q when four letters picked without replacement from qqxtnnrqqqn. 1/11 Three letters picked without replacement from {v: 4, t: 5, h: 2}. What is prob of picking 1 v and 2 t? 8/33 Two letters picked without replacement from {u: 1, e: 7, r: 1}. What is prob of picking 1 e and 1 r? 7/36 Calculate prob of picking 3 g when three letters picked without replacement from {s: 6, g: 7}. 35/286 What is prob of picking 1 i and 1 y when two letters picked without replacement from {i: 2, n: 1, l: 1, o: 1, y: 2, s: 1}? 1/7 Three letters picked without replacement from vmvrrvvmvyvzvr. Give prob of picking 1 v and 2 r. 3/52 Calculate prob of picking 1 g and 1 s when two letters picked without replacement from sjjssssgsggssgsg. 3/8 Three letters picked without replacement from tttmtm. Give prob of picking 3 t. 1/5 Three letters picked without replacement from aagqgaggbfgqgagf. What is prob of picking 1 b and 2 a? 3/280 Four letters picked without replacement from qbhtqctrqqtcrhc. Give prob of picking 1 t, 2 b, and 1 r. 0 What is prob of picking 2 i, 1 s, and 1 g when four letters picked without replacement from syifkysskggikgssss? 7/1020 What is prob of picking 1 v, 1 t, and 1 r when three letters picked without replacement from {t: 3, r: 5, v: 5}? 75/286 Three letters picked without replacement from sxssxyrsrqsbr. What is prob of picking 2 s and 1 y? 5/143 Four letters picked without replacement from kkynkhknhhkkykyk. What is prob of picking 1 h, 1 k, and 2 y? 18/455 Four letters picked without replacement from {b: 4, d: 2, w: 4}. Give prob of picking 4 b. 1/210 Two letters picked without replacement from qahtpeh. What is prob of picking 1 h and 1 p? 2/21 What is prob of picking 3 f and 1 c when four letters picked without replacement from {f: 3, c: 9}? 1/55 What is prob of picking 1 v and 1 a when two letters picked without replacement from iiiiaviivqiiktavq? 3/68 Four letters picked without replacement from zzzzzzzzzzzzzrrzrrz. What is prob of picking 4 z? 455/1292 What is prob of picking 3 l when three letters picked without replacement from {l: 3, b: 12, o: 1}? 1/560 Two letters picked without replacement from {t: 5, e: 3, d: 2, r: 6, k: 2}. What is prob of picking 1 t and 1 d? 10/153 Two letters picked without replacement from {n: 2, s: 4, e: 1, m: 1}. What is prob of picking 1 n and 1 m? 1/14 Calculate prob of picking 1 i, 1 l, and 1 e when three letters picked without replacement from mslfeife. 1/28 Calculate prob of picking 3 o when three letters picked without replacement from yooyooooyoo. 56/165 What is prob of picking 4 p when four letters picked without replacement from ppppppp? 1 What is prob of picking 3 h when three letters picked without replacement from {y: 7, q: 8, h: 3}? 1/816 What is prob of picking 1 s and 1 b when two letters picked without replacement from qsqbzbsbqbzqrzzqzsr? 4/57 Two letters picked without replacement from {m: 2, q: 8}. What is prob of picking 1 q and 1 m? 16/45 Two letters picked without replacement from iiickciiciiiicg. Give prob of picking 1 g and 1 i. 3/35 What is prob of picking 1 z and 1 k when two letters picked without replacement from ykewwkzkwwkeybwzw? 1/17 Two letters picked without replacement from dwddwwdd. Give prob of picking 2 d. 5/14 What is prob of picking 2 m when two letters picked without replacement from {d: 2, m: 2, y: 2}? 1/15 Four letters picked without replacement from {s: 7, v: 6}. What is prob of picking 3 s and 1 v? 42/143 Calculate prob of picking 2 p, 1 c, and 1 j when four letters picked without replacement from {p: 4, c: 2, j: 1, k: 4, x: 2, e: 2}. 4/455 What is prob of picking 1 e and 1 a when two letters picked without replacement from eaab? 1/3 Calculate prob of picking 4 p when four letters picked without replacement from {y: 8, p: 4, c: 8}. 1/4845 What is prob of picking 1 l and 1 m when two letters picked without replacement from mtrtrmrmdlrrb? 1/26 Calculate prob of picking 1 m and 1 j when two letters picked without replacement from jjmmjjmjjmmmm. 7/13 Two letters picked without replacement from kvvk. What is prob of picking 2 v? 1/6 Two letters picked without replacement from tttzztzttzztzz. Give prob of picking 2 t. 3/13 Four letters picked without replacement from {w: 5, z: 5, k: 4}. What is prob of picking 4 k? 1/1001 Calculate prob of picking 1 l and 1 m when two letters picked without replacement from {l: 10, h: 4, m: 2}. 1/6 Two letters picked without replacement from ikiiwwwiiiw. Give prob of picking 2 w. 6/55 Calculate prob of picking 1 q and 1 h when two letters picked without replacement from hqh. 2/3 What is prob of picking 1 e and 1 f when two letters picked without replacement from {i: 1, e: 4, f: 8}? 16/39 Calculate prob of picking 1 d and 1 x when two letters picked without replacement from {z: 2, d: 1, u: 6, e: 1, x: 2}. 1/33 Calculate prob of picking 2 v and 1 p when three letters picked without replacement from {p: 8, v: 3}. 8/55 Two letters picked without replacement from bdbdd. What is prob of picking 2 b? 1/10 Four letters picked without replacement from ccqqqcqqqqqqqq. What is prob of picking 2 q and 2 c? 15/91 Two letters picked without replacement from {m: 7, k: 11, g: 2}. Give prob of picking 1 k and 1 g. 11/95 Three letters picked without replacement from wrawjrrr. What is prob of picking 1 j, 1 a, and 1 w? 1/28 Calculate prob of picking 1 h and 1 r when two letters picked without replacement from hhhhhhrhrhrrrrrhhrr. 10/19 What is prob of picking 3 o when three letters picked without replacement from {o: 7, m: 5}? 7/44 Calculate prob of picking 2 m when two letters picked without replacement from xxxxmxmxxxxmxx. 3/91 What is prob of picking 2 f and 2 o when four letters picked without replacement from {f: 4, k: 2, j: 4, o: 2}? 2/165 Two letters picked without replacement from {p: 1, q: 4, s: 5}. Give prob of picking 2 s. 2/9 Two letters picked without replacement from {j: 2, b: 1, d: 1, q: 2, l: 3, w: 3}. What is prob of picking 2 j? 1/66 What is prob of picking 2 n, 1 x, and 1 w when four letters picked without replacement from ynyawxyyynxyyxxzz? 1/595 Calculate prob of picking 1 x and 1 j when two letters picked without replacement from jejxjuaeujjeujxuj. 7/68 Three letters picked without replacement from pimnnwsi. Give prob of picking 1 n, 1 w, and 1 m. 1/28 Two letters picked without replacement from xxxxxexx. What is prob of picking 1 e and 1 x? 1/4 What is prob of picking 1 e and 1 r when two letters picked without replacement from {o: 1, e: 1, r: 2, g: 2, h: 1}? 2/21 What is prob of picking 1 q and 1 w when two letters picked without replacement from {l: 3, q: 1, z: 4, v: 4, p: 3, w: 2}? 1/68 Two letters picked without replacement from ppzffpppfpppfpd. Give prob of picking 2 p. 12/35 What is prob of picking 1 d, 1 e, and 1 j when three letters picked without replacement from {p: 2, j: 1, d: 1, e: 3}? 3/35 Two letters picked without replacement from klfkkxflkkkk. What is prob of picking 2 k? 7/22 What is prob of picking 1 u and 1 v when two letters picked without replacement from {w: 3, a: 1, v: 2, o: 4, u: 2}? 2/33 Calculate prob of picking 2 v when two letters picked without replacement from {v: 2, a: 3, b: 7, l: 2, q: 4}. 1/153 Four letters picked without replacement from {c: 7}. What is prob of picking 4 c? 1 Three letters picked without replacement from xyyyytvvttvy. Give prob of picking 1 x and 2 t. 3/220 Two letters picked without replacement from jwrvrjvf. Give prob of picking 1 f and 1 v. 1/1	{ "pile_set_name": "DM Mathematics" }
Let h(y) = -35y2. Let u(t) = 9t. Calculate u(h(q)). -315q2 Let v(c) = 2c*2 - 28. Let k(t) = -3t*2. Calculate v(k(g)). 18g*4 - 28 Let l(f) be the first derivative of -2f*3/3 - 3. Let n(c) = 4c*2. Calculate l(n(t)). -32t4 Let m(s) be the third derivative of -s5/10 - 5s2. Let u(i) = i2. Determine m(u(q)). -6q*4 Let z(n) = -n. Let x(m) = 2m - 2. Let s(a) = a*2 - a + 1. Let l = 5 + -7. Let k = 3 + l. Let t(h) = kx(h) + 2s(h). Give z(t(i)). -2i2 Let j(w) = -w2. Let t(k) = -243k. What is j(t(p))? -59049p*2 Let u(g) = -15g*2 + 5g - 5. Let y(n) = -7n2 + 2n - 2. Let m(l) = -6u(l) + 15y(l). Let x(d) = 2d2. Determine x(m(v)). 450v4 Let k(v) be the second derivative of v4/12 + 4v. Let l(g) = 0g*2 + 6g*2 - 5g2 + g2. What is k(l(w))? 4w4 Let l(n) = -1 + 2 - 4n - 1. Let t(s) = -s*2 - s + 2. Let p be t(0). Let h(x) = -x - px + 4x. Give l(h(j)). -4j Let h(y) = 41203y. Let m(c) = -c2. What is h(m(q))? -41203q2 Let j(f) be the first derivative of f3/3 + 7. Let m(q) = -7q. Give m(j(r)). -7r2 Let d(s) = -s2 + 11. Let j(z) = -1. Let f(o) = 2d(o) + 22j(o). Let w(q) be the first derivative of 3q2/2 + 1. What is w(f(u))? -6u*2 Let w(r) = -7r. Let s(n) = -6n. Let a(m) = -6s(m) + 5w(m). Let g(j) = -5j. Give a(g(y)). -5y Let a(h) be the second derivative of 0h*2 + 0 - 3h + 1/3h3. Let f(k) be the third derivative of k4/24 - k2. What is f(a(r))? 2r Let t(g) = -10g2. Let i(h) = 3h - 4. Let n(w) = -1. Let x(k) = -i(k) + 4n(k). Give t(x(b)). -90b*2 Let d(b) = 3b. Let s(h) = 10h - 6. Let f(y) = 9y - 5. Let g(p) = -6f(p) + 5s(p). What is d(g(m))? -12m Let g(s) = 8s. Let a(r) = -26r. Give a(g(c)). -208c Let o(j) = -j2. Let f(z) = z2 + 6z2 - 8z*2 + 0z2. Determine o(f(b)). -b4 Let d(n) = -2n2. Let s(k) = k - 1. Let r(c) = -c2 - 2c + 2. Let j(l) = -3r(l) - 6s(l). Determine d(j(x)). -18x4 Let o(w) = -w - 5. Let u(s) = -2. Let k(h) = 2o(h) - 5u(h). Let l(j) = -j2 + 6j*2 - 3j*2. What is l(k(g))? 8g*2 Let b(l) = -4l. Let p(f) = -f. Let j(m) = -b(m) + 6p(m). Let a(d) = d2 + 4d. Let w(k) = -k. Let n(r) = a(r) + 4w(r). What is n(j(c))? 4c2 Let o(m) be the second derivative of -m3/3 - 5m. Let n(x) = 2x. Give o(n(f)). -4f Let s(g) = 5g + 6. Let i(a) = 3a2. Calculate s(i(h)). 15h*2 + 6 Let z(h) = -45h*2. Let q(k) = 4k. Give q(z(l)). -180l2 Let t(k) = k. Let i(o) = 12o + 3o + 11o - 30o. Give t(i(x)). -4x Let s(w) = -w*2 + 2w + 2. Let b(x) = -4x2 + 7x + 7. Let t(d) = 4b(d) - 14s(d). Let n(o) = -39o2 + 81o*2 - 40o*2. Determine n(t(f)). 8f4 Let a(i) = -i2. Let d(m) = -7m + 6m + 2m. Give d(a(v)). -v2 Let j(d) = -d2. Let m(c) be the second derivative of c4/12 - 7c. Calculate m(j(x)). x*4 Let a(w) = w - 2. Let n(k) = 4. Let p(j) = 4a(j) + 2n(j). Let h(f) = -8f. Calculate h(p(c)). -32c Let v(t) be the third derivative of t5/20 - 5t*2. Let i(y) = -2y*2. Calculate i(v(w)). -18w*4 Let z(n) = 145n. Let q(b) = 3b2. Give q(z(u)). 63075u*2 Let l(y) = -12927 + 25y + 12927. Let v(f) = f. Calculate l(v(g)). 25g Let r(x) = x. Let j(q) = -q2 - 42q. What is j(r(t))? -t*2 - 42t Let z(h) = -7h + 6. Let g(u) = u - 1. Let a(v) = -6g(v) - z(v). Let f(x) = -7x2. What is a(f(c))? -7c*2 Let a(k) = -4k. Let z(y) be the first derivative of y*3/3 + 3. What is z(a(q))? 16q2 Let c(a) = a2. Let g(i) be the second derivative of -5i4/12 - 5i. Let p(f) = 4f2. Suppose -9 = 3w + 9. Let l(o) = wp(o) - 5g(o). Determine c(l(b)). b*4 Let z(v) = 4245v2 + 1. Let q(a) = a2. Determine q(z(d)). 18020025d4 + 8490d*2 + 1 Let j(q) be the first derivative of 2q*3 + 2. Let k(w) = -2w. Calculate j(k(r)). 24r2 Let m(v) = v2 + 112v. Let l(o) = 8o2. Calculate m(l(d)). 64d*4 + 896d2 Let w(c) be the first derivative of -c2/2 - 2. Let l(n) = 2n - 3n + 0n. Give w(l(i)). i Let r(n) = n3 + 6n*2 - 7n. Let a be r(-7). Let p be a + (1 + 0)2. Let t(b) = 4b + pb - 5b. Let y(l) = l2. Determine y(t(q)). q2 Let b(g) be the third derivative of g*5/20 + 22g2. Let r(q) be the third derivative of -q5/60 + q*2. Determine b(r(h)). 3h*4 Let l(d) = 2d. Let y(k) = 12k. Determine y(l(j)). 24j Let n(m) = m + 1. Let o(y) = -2y - 3. Let u(j) = -6n(j) - 2o(j). Let t(z) = -7z. Give t(u(v)). 14v Let w(g) = 2g - 44. Let v(k) = 2k2 + 23k. Determine v(w(y)). 8y2 - 306y + 2860 Let w(p) = -3p. Let n(l) = 8l + 8l - 19l + l. Calculate n(w(h)). 6h Let m(p) = 7p + p - 4p. Let l(h) = -h. Determine m(l(u)). -4u Let w(m) = -m*2. Let s(u) = -u + 0 + 0 - 7u. Give s(w(r)). 8r2 Let s(w) = -2w2 - w2 + 5w2. Let p(g) be the third derivative of g5/20 + 34g*2. What is s(p(h))? 18h*4 Suppose 2d + 6t = 2t + 22, 5d = -5t + 35. Let a(n) = 5n - 5n - dn + 8n. Let h(p) = 2p. Give a(h(x)). 10x Let j(t) be the first derivative of -2t3/3 - 5. Let p(d) = -11d*2. Determine p(j(f)). -44f*4 Suppose -d = -1 - 1. Let k(f) = df*2 - 9 + 9. Let r(n) = n. Calculate k(r(b)). 2b*2 Let n(h) = 12h. Let c(d) = 933 - 933 - 2d. Determine c(n(f)). -24f Let d(m) = -7m2. Let p(s) = -2s - 8. Let t be p(-7). Let r(a) = -ta + 2a + 2a + 4a. What is d(r(i))? -28i2 Let f(v) = -v2. Suppose -2n + 6 = -3n + 2i, 12 = 3i. Let w(k) = nk + k - 5k. Give w(f(y)). 2y*2 Let c(l) = 2l*2. Let h(g) = 3g + 278. Give h(c(r)). 6r2 + 278 Let j(v) = -549v*2. Let d(o) = -2o. What is j(d(r))? -2196r2 Suppose -4h + h = -15. Let n(u) = 4 + hu - 4. Let p(d) = 2d. Determine p(n(z)). 10z Let c(n) be the second derivative of -n4/6 + 11n. Let q(p) = 3p + 3. Let d(w) = -6w - 5. Let x(i) = 3d(i) + 5q(i). What is c(x(f))? -18f2 Let u be (-6)/(2 + (-4 - 0)). Let c(r) = -ur + 3r + r. Let n(j) be the first derivative of -j3/3 + 3. Calculate c(n(v)). -v2 Let q(u) = 45u*2. Let v(p) = 31p. Determine q(v(y)). 43245y2 Let g(s) = 2s. Let q(u) be the first derivative of -2u2 - 5. Give g(q(a)). -8a Let c(q) = 12q. Let s(u) be the second derivative of u3/6 + 11u. Calculate s(c(o)). 12o Let s(f) = 5f*2 - 4f - 4. Let a(v) = -4v2 + 3v + 3. Let y(q) = 4a(q) + 3s(q). Let l(m) = -2m. Calculate y(l(g)). -4g*2 Let f(d) = 96d. Let r(a) = -12a. Give f(r(x)). -1152x Let o(d) = -5d2 - 6d + 6. Let g(s) = 6s2 + 7s - 7. Let f(k) = -6g(k) - 7o(k). Let q(x) = 20x. Give f(q(m)). -400m2 Let x(u) be the first derivative of u6/180 - 4u3/3 + 6. Let w(m) be the third derivative of x(m). Let d(y) = -2y. Calculate w(d(f)). 8f2 Let b(c) = 2c. Let x be (-4)/14(-2 - 5). Let h(q) = 2q*2 + 2q*x - 2q*2. Calculate b(h(a)). 4a*2 Let i(p) = -4p*2. Let m(x) = -3x*2 - 36. Determine i(m(j)). -36j*4 - 864j*2 - 5184 Let k(r) = -3r + r + r. Let l(b) = 2b2 - 5b*2 + 5b*2. Calculate l(k(s)). 2s*2 Let q(r) = r. Let s(f) = 21f*2 + 5f + 0f - 5f. Determine q(s(h)). 21h2 Let q(u) = -3u*2. Let t(i) = 52i*2 - 39i - 39. Let x(b) = -b*2 + b + 1. Let j(h) = -t(h) - 39x(h). Give j(q(p)). -117p4 Let w(o) be the first derivative of -o3/3 + 4. Let u(z) be the first derivative of -2z*2 + 2. What is w(u(p))? -16p*2 Suppose -3w = 4o + 8 + 9, 2w = 5o + 4. Let r be (o/(-2))/(2/4). Let a(b) = rb + 4 - 4 - 3b. Let y(f) = -f. What is y(a(l))? l Let h(o) = 8186o*2. Let i(r) = 2r*2. Calculate h(i(x)). 32744x*4 Let c be (-4 - (-28)/6) + (-2)/3. Let d(v) be the second derivative of 1/6v*3 + 0 + v + cv*2. Let h(b) = -b. Determine d(h(l)). -l Let p(h) = -h + 6. Let l(c) = -c + 5. Let w be (1 - -2) + 1-9. Let x(y) = wl(y) + 5p(y). Let q(g) = 4g2. Determine x(q(k)). 4k2 Let i(k) be the second derivative of -k3/6 - k. Let y(b) = -3b3 - 2b*2 - b. Let d be y(-1). Let u(g) = -4g*2 + 0g*d + 2g2 + g2. Give i(u(r)). r*2 Let m(f) = -4f. Let s(r) = -6r + 5. Let g(v) = v - 1. Let y(z) = 5g(z) + s(z). Give m(y(n)). 4n Let t(c) be the first derivative of c2/2 + 3. Let y(p) be the third derivative of -p5/30 + 5p*2. Calculate t(y(r)). -2r2 Let y(r) be the first derivative of -r6/360 + 2r*3/3 + 3. Let w(i) be the third derivative of y(i). Let x(q) = -4	{ "pile_set_name": "DM Mathematics" }
88t for t. -3 Solve 0 = 2w - 4r - 6, 0 = -22w + 17w - 5r - 15 for w. -1 Solve 15m = -s + 42 + 6, 6 = -3s + 5m for s. 3 Solve 5l - 13 = 7b, -675l + 4b + 25 = -678l for l. -3 Solve -5c + 3v = -2c + 24, -384 = 4c - 48v for c. 0 Solve -3 = -x - 3q, -16x + 627 = 5q + 622 for x. 0 Solve -4l - 5w + 10 = 0, 5l + 271w + 34 = 288w for l. 0 Solve 715o = 708o + 21, n = -5o + 18 for n. 3 Solve s - 438 = 4j - 437, 4 = 2j - 2s for j. -1 Solve -5l - 25a - 18a = 96, -3l + a - 4 = 0 for l. -2 Solve -i + 5z + 14 = 0, -2723i + z + 2 = -2722i for i. -1 Solve 0 = 2o + 3z, -3o + 29z - 51z = -21z - 14 for o. 6 Solve 0 = 14h - 4p + 44, -5h - p = -2h + 2 for h. -2 Solve -5i = -5c + 50, -5i - 66 = -c - 36 for i. -5 Solve -5l = 0, 460q - 456q - 2l = -4 for q. -1 Solve m = 4t + 5, 44t = 43t - m + 5 for t. 0 Solve -4b - 5n + 24 = 0, -2b = 67874n - 67867n - 30 for b. 1 Solve 5r = 20, -2r - 5291 + 5295 = 2g for g. -2 Solve 4a = 6731p - 6726p + 82, 2p = a - 22 for p. -2 Solve 4j = -409d + 408d + 21, -3d = -4j - 31 for d. 13 Solve 6 = 32r - 31r + 4j, -2j + 12 = 5r for r. 2 Solve -2m - 11 = -6u + 7u, 0 = u - 3m - 14 for u. -1 Solve 0 = 4a + 4v + 20, -9694a - v - 17 = -9689a for a. -3 Solve 58g = x + 55g - 15, 2x + 4g - 10 = 0 for x. 9 Solve y + 124 = -r + 125, 3 = 3r for y. 0 Solve 0 = -316k + 314k + 5f + 8 + 10, 15k - 64 = 2f for k. 4 Solve -188a = -2z - 184a - 18, -z = 9a - 2 for z. -7 Solve -a = -5k + 24, -20k + 4a = -25k - 21 for k. 3 Solve 3j + 857g = 859g + 14, -j = 5g + 18 for j. 2 Solve 0 = -f - 5n - 13, -5f + n - 64 = -77 for f. 2 Solve -4s = 2n - 6, 3n - 115 = 5s + 30n for s. 4 Solve 0 = 2y - 4u - 22, 21 = 4u + 5 for y. 19 Solve 0 = 5k + 3c - 11, 0 = -k + 8c + 18 - 33 for k. 1 Solve 40v - 43v + 3c = 15, -5 = v - 5c for v. -5 Solve 10i + 5z = -90, -5i + 4i + 3z - 16 = 0 for i. -10 Solve 0 = 5w - 45, -5v - 40w = -38w - 28 for v. 2 Solve -5u = 76f - 75f - 24, 0 = 2f - u - 4 for f. 4 Solve -7o = -5c + 35, -1609c - o = -1606c + 5 for c. 0 Solve -2z = -6z - 1550s + 1546s - 4, -3z = -7s + 3 for z. -1 Solve 5h - 103 = -140 + 142, 2a = -5h + 97 for a. -4 Solve -5t = 88g - 85g + 40, -4t - 5g - 45 = 0 for t. -5 Solve -4t + 5k = 34, -3t + 299 - 326 = -4k for t. -1 Solve -3q - 4j = 6, 391j = -3q + 388j - 6 for q. -2 Solve 0 = 527z - 529z - 2, -2z = -3w + 50 for w. 16 Solve 127328n - 3h - 12 = 127332n, -4 = h for n. 0 Solve -2d - 28 = -4f, -d - 59 = -19f + 23 for f. 4 Solve -362s + 366s - 8 = b, b - 1 = -5s for s. 1 Solve 0 = 2b - 5z + 13, -3b - 3z + 70 = 121 for b. -14 Solve -117o + 122o + 43k = -114, 3o - 3 = -2k for o. 3 Solve 25 = 3n + c, 2751n + 35 = 2752n - 5c for n. 10 Solve -4q + 9g + 8 = 7g, 0 = 6g + 12 for q. 1 Solve 166k - 167k - r = 2, -5r = -2k + 3 for k. -1 Solve 31n - 10 = 33n - 2x, 5n + x = -19 for n. -4 Solve 22z - 12 = 9z + 16z + 5c, -3z - 18 = 7c for z. 1 Solve -2s + 5x = -19, 0 = -5s - 31x + 28x - 30 for s. -3 Solve -3a + 21 = -2r, -6a = 4r - 36611 + 36593 for a. 5 Solve -400z = 2a - 399z - 11, -29 = -5a - 3z for a. 4 Solve 5b - 70 = 3c - 5c - 126, 5c = b - 5 for b. -10 Solve -5m = -h + 63, -5m - 4h - 108 + 35 = 0 for m. -13 Solve 0 = -3p - a, 0 = 13p - 8p - 6p - 2a for p. 0 Solve -2t = -g + 11, 4g - 5 - 7 = -0g for t. -4 Solve -24 = 4g - 13f + 17f, 3g - f = -6 for g. -3 Solve 5r + o = -17, 0 = -4r - 2o + 90 - 106 for r. -3 Solve -3z + 7 = -5u, -7z - 4 + 33 = u for z. 4 Solve 58l + 10 = 2u + 62l, 4l - 12 = -4u for u. 1 Solve 16 = 2r - 4w, -3022w + 3017w = r + 27 for r. -2 Solve -v - 7348 = -4w - 7358, -7 = 5v - w for v. -2 Solve 4 = -3n - v, 0 = 5n - 4v - 9 - 7 for n. 0 Solve -6i - 3s = -7i + 14, 3i + s - 12 = 0 for i. 5 Solve -7 = -2y + 3b, 0 = -72y + 70y - 4b - 28 for y. -4 Solve 2b - j = -11, -4b - j + 207 = 214 for b. -3 Solve -5m + 4t - 17 = 0, -5m + t - 889 + 881 = 0 for m. -1 Solve 4y - 22 = -2c, 0 = -y - 2c + 193 - 183 for y. 4 Solve 2a - 2611 + 2621 = 3z, -z + 26 = 5a for a. 4 Solve -2j = 5j - 10j, -12u + 15u + 12 = 2j for u. -4 Solve -h + 5i + 17 = 0, -466h + 464h + 20 = -3i for h. 7 Solve j = 3p + 1, -4j - 204p + 208p + 20 = 0 for j. 7 Solve -2c - 33 + 37 = -5w, c = -2w + 2 for w. 0 Solve 4w - 3i = -15, 188i + 15 = 190i + 5 for w. 0 Solve -16 = -0g - 2g + 2y, 5y + 28 = 2g for g. 4 Solve 0 = -4v + 9s + 13, -4v - 27 = 4s - 79 for v. 10 Solve -c = -l + 5, -2l - 4c - 12947 = -12921 for l. -1 Solve 2u + 14x + 19x + 11 = 30x, 0 = 2u - 5x - 45 for u. 5 Solve 4t + 283 = -2s + 253, -25 = 5s for t. -5 Solve -2d + 17 = 3a, -434a + 437a = 88d - 883 for d. 10 Solve 124i = 125i + 5z - 29, -5i = z - 25 for i. 4 Solve 16u + 5g + 1 = 14u, -3u - 3g - 6 = 0 for u. -3 Solve -13h = 2u + 3u - 15h, -h = 5u for u. 0 Solve -120v + 35 = -115v, 11 = b + v for b. 4 Solve 4w - 21 = -q, -2q = -719w + 716w + 13 for w. 5 Solve -12 = -114g + 104g - 3m, 2g - 2m + 8 = 0 for g. 0 Solve -2d + 5d - 4 = -o, -2254o - 5d = -2250o + 5 for o. -5 Solve 4s = 31x + 228, -16s + x - 16 = -16s + 3x for s. -5 Solve -4a = -3c - 5, -918a = -920a + c + 5 for a. 5 Solve -18 = 2w - 4j, -137w + 4 = -139w - 3j for w. -5 Solve -5g + 15 = 8d, 2d - 38g - 16 = -43g - 1 for d. 0 Solve -4q = 0, -2m = -4q - 226 + 218 for m. 4 Solve -3 = -3l + 16d - 19d, -3l = -5d + 13 for l. -1 Solve -5m - 36 = -3z - 61, m - 5 = -5z for m. 5 Solve -m = -2y - 39 + 38, 4y = -3m + 13 for y. 1 Solve 2n - m - 6 = 0, 15331 - 15330 = -3n - m for n. 1 Solve 6645x - 4 = 6641x - 5c, 0 = -4x + 2c - 24 for x. -4 Solve -9 = l + 2a, a + 17 = -27l + 24l for l. -5 Solve 58r = y + 53r + 7, 2r = 4 for y. 3 Solve 6945q = 6948q - 4v + 1, q + 13 = -5v for q. -3 Solve -x - 6p + 1 = 2p - 3p, -5x = -56p + 157 for x. -9 Solve 5z + 4s - 1 = 0, -1815z + s = -1811z + 16 for z. -3 Solve -2 = -2a, 2i + 11 = 7i - 4a for i. 3 Solve -6g + 5o + 68 = 0, -53g + 52 = -49g - 4o for g. 3 Solve -13a = -z + 21, -72a - 17 = -71a - 2z for a. -1 Solve -27 = 5g + 2i, -63 = 2g + 2i - 45 for g. -3 Solve -4437d + 4438d = -4a + 24, 0 = 4d + 2a + 2 for d. -4 Solve -6 = -v + 5a - 0, 0 = v - 2a for v. -4 Solve 33982g + 4 = 33980g + 4u, -5u = 5g - 20 for g. 2 Solve -2u + 4m + 6 = 0, -71m + 70m = 7u - 6 for u. 1 Solve -65d + 110 = 4z, -1408z + 10 = -1412z - 5d for z. -5 Solve 2784f = 2783f + 5x, -2x = 2 for f. -5 Solve 4r + 50 = 3l, 61r - 57r + l + 58 = 0 for r. -14 Solve -26y + 2k - 169 = -3, 5k - 25 = 0 for y. -6 Solve -q + 2524 = 4c + 2504, 32 = 5q + 3c for q. 4 Solve -9l + 7l - 16v - 33 = -7l, 3 = 2l - 3v for l. -3 Solve -t + 2n + 11 = 0, 512n = 5t + 508n - 31 for t. 3 Solve -2i = 12x - 54, 37i + 36i - 4x + 13 = 72i for i. 3 Solve 25o = -2d + 23o + 26, 2d = -4o + 52 for d. 0 Solve 3w - 8f + 111 = 134, -w + 3f + 9 = 0 for w. -3 Solve 0 = -5z - 3r - 335 + 345, -4z - 9 = -r for z. -1 Solve 3w + 6 = -4j, 5j + 3509w - 1 = 3501w for j. -3 Solve -3u + 4y = 39, -57 = 2u - 9y - 4y for u. -9 Solve 5g = -4w - 16, -2w - 148g + 153g + 22 = 0 for w. 1 Solve -141c = o - 144c - 5, -2c = -10o - 62 for o. -7 Solve 5y + 251 - 314 = 4i, y - 21 = 5i for i. -2 Solve 13 + 2 = -15t, -3j - 12 = -4t - 14 + 16 for j. -6 Solve -3l - 12 = -w, 4l + 16 = -619w + 620w for w. 0 Solve -5h + 73o + 30 = 70o, 0 = 5h - 5o - 40 for h. 3 Solve q - 3b + 17 = 0, b + 556 - 555 = -3q for q. -2 Solve 0 = g - 2d - 15, 42g - 21 = 39g - 2d for g. 9 Solve -3d + 20 = -11s + 15s, -4s + 4d + 20 = 0 for s. 5 Solve -2j + 16 = 4u, -2j = 48u - 49u - 1 for j. 2 Solve y + 7 = n - 2, 4y = -20 for n. 4 Solve f = 1115c - 1106c + 4, 5c - 3f + f - 5 = 0 for c. -1 Solve -g = -4z - 13, -z + 205g = 211g + 22 for z. -4 Solve a = -4w - 23, 2w - 27a + 13 = -28a for w. -5 Solve 0 = 3r + 34k - 38k + 20, 3r + 4 = -4k for r. -4 Solve -4s + 18 = -3w, -22s + 25 = -2w + 13 for s. 0 Solve 0 = -0d + 3d - 9, 5d - 730 = 4f - 723 for f. 2 Solve 8j - 53y = -56y - 60, y = -2j - 14 for j.	{ "pile_set_name": "DM Mathematics" }
t l be (2/(-6))/((-2)/(-3)). What is the second smallest value in -2/7, u, l? -2/7 Let d = -1116 + 1114. What is the third biggest value in -35, -4/7, d? -35 Let k = -27.6 + 22.6. Let w = 1185/7 + -169. Which is the biggest value? (a) w (b) 1/9 (c) 2 (d) k c Let r be (-2 + (1 - 1))/(-4). Let t be (-15)/4 + (-5)/20. Let u be -4 + t + (-165)/(-20). Which is the biggest value? (a) r (b) u (c) -0.4 a Let p = -30.7 + 33. Let b = -1.7 - p. Let h = 2 + b. What is the third biggest value in 2, 0.3, h? h Let v = -0.21 - -0.31. Let d = 40 + -24. Let x = d - 16.3. Which is the second smallest value? (a) 1/3 (b) v (c) x b Let l = -794.5 - -795. Let t be (-2)/2262/(-2). Let a = -1183/9 + t. What is the smallest value in 0, l, a? a Let c(b) = b2 - 20b - 22. Suppose 27 = g - 3m, g + 2m = 3m + 23. Let k be c(g). What is the second biggest value in 4/5, 0.2, k? 0.2 Let y = 2 + -2.6. Let s = 0.0531 + -0.2531. What is the biggest value in s, -0.4, y? s Let k be (66/88)/((-3)/(-8)). What is the biggest value in -3/4, -2, k? k Suppose 0 = 3i - 2t - 46, 20 = 2i - t - 13. Let r be 0 + 4/261. What is the second biggest value in r, -2, i, 4? 4 Let f = 0.21 - 0.01. Let r = -5.2 + f. Let q = -1 + 6. What is the biggest value in r, -0.5, q? q Let v = 2 - 2.5. Let i = 5.8 + 4.2. Let f = -11 + i. Which is the third biggest value? (a) v (b) -2 (c) f b Let p = 0.76 - 0.96. Which is the third smallest value? (a) 7.6 (b) 0 (c) p (d) 1 d Suppose 4z = 5l - 2, -3l - 6z + 9z + 3 = 0. Let j = -0.01 + 0.41. Let x = 0.4 - j. What is the second smallest value in x, l, -4? l Suppose -2c = 4d + 2c + 4, 5d - 40 = 4c. Suppose d = -a + 1. Let i be 35/10 + -3 - (-3)/2. What is the second biggest value in a, 6, i? i Suppose 0 = 6y - 3y + 117. Let w = -42 - y. What is the second biggest value in w, -0.9, -0.2? -0.9 Let c = -0.2 - -1.6. Let d = -1.1 + c. Let v = -0.7 + d. What is the biggest value in v, -5, 0? 0 Let t(q) = 72q - 288. Let c be t(4). What is the second biggest value in c, 39, -4? c Let g(y) = -2y2 - 53y - 102. Let j be g(-2). Which is the second smallest value? (a) j (b) 1.9 (c) 5 b Let x be ((-3)/(-9))/(3/(4 + 5)). Which is the fourth biggest value? (a) x (b) -0.2 (c) -0.1 (d) -1 d Let v = 73.42 - 73. Let l = v - 0.72. What is the smallest value in l, 4, -1? -1 Suppose j - 3j = 2j. Let q be (-12)/(-20) - 2/20. Let k = 0.08 - -4.92. What is the second smallest value in j, q, k? q Let x = 0.496 + -0.256. What is the second biggest value in x, 0.2, -0.2? 0.2 Let i = -43/4 + 12. Let d = 272 - 817/3. What is the third biggest value in -1/4, i, d? d Suppose q = 5k - q - 132, 0 = 4k - 2q - 104. Let h be (-2)/(-6) - k/(-6). Let u = -201 + 205. What is the smallest value in h, 1/2, u? 1/2 Let y(k) = 2k*3 - 15k - 6. Let z be y(-4). What is the second smallest value in 2, -5, 0, z? -5 Let f = -2163 + 2159. Let h be (-2)/6 - 8/(-42). Which is the biggest value? (a) h (b) f (c) -1 a Suppose 4n + n = 0. Let y = 12 - 16. Let b = 4 + -3.1. What is the biggest value in b, n, y? b Let w = 80/37 + -11206/5217. Let i = 92/141 + w. What is the third biggest value in -2, i, 0.4? -2 Let g be 2 - (-7 + (-65)/(-7)). Let u = 0.2 - 0.3. Which is the third smallest value? (a) u (b) 0.1 (c) g b Let u = 11.4 + -14.4. Let d = -2 - -5. Let v = -6 + -1. Which is the third biggest value? (a) u (b) v (c) d b Let o be (3/10)/(((-75)/20)/(-5)). Suppose 2s - 5s - 16 = h, 0 = -4s + 2h - 28. Let x be s/(-24) - 2/40. What is the second smallest value in 0.06, x, o? x Let z = -18212 + 18217. Let n(x) = 3x*3 + 2x*2 - 2x + 1. Let f be n(1). Which is the third smallest value? (a) z (b) 3/20 (c) -0.2 (d) f d Let i(n) = n*3 - 5n*2 - 50n + 324. Let j be i(7). What is the biggest value in -4, -3, j? j Suppose 0 = -0h + 3h - 12. Let m = -45.958 + -0.042. Let d = m - -46.5. Which is the second smallest value? (a) h (b) d (c) -0.2 b Let u = 2.5 - 2. Let n = -0.3 + u. Let r = -5 + 4. What is the second smallest value in r, -2, n? r Let j = 0.04 + 4.96. Let u = j - -10. Let o = 14.5 - u. What is the second biggest value in -5, o, -0.02? o Let j = -0.0367 + -3.9633. What is the second smallest value in j, -8, 2/11, -0.5? j Let z = -407 + 411. Which is the second biggest value? (a) 2/5 (b) -1/3 (c) -19 (d) z a Let l be 6/(-40)5/(-2). Let a = -4407 + 4605.1. Let k = -198 + a. What is the third smallest value in 2/7, l, k? l Let r = 863 + -8631/10. Which is the third smallest value? (a) 2 (b) r (c) 4 c Let f = 79.45 - -1.55. Let l = f - 80.6. Which is the third smallest value? (a) l (b) 2/3 (c) 15 c Let m be 3(-4)/(-63)35/30. What is the second biggest value in 1/3, m, -1? m Let o be 4512/480 - (1 - -9). Let h = 4 - 1. Let u be (1/(-14))/(h/(-18)). What is the biggest value in o, -3, u? u Let g be (-14 - (-4630)/330)/((-3)/18). What is the second biggest value in -0.9, g, -1/2, -5? -1/2 Let w = -1.92 - -202.92. Let z = w - 200.8. Let d = -1 + 0.7. Which is the third biggest value? (a) z (b) d (c) -0.5 c Suppose 0 = 3g - 4m - 8, -6g + 4g + 10 = 2m. Which is the second smallest value? (a) 5 (b) -2 (c) g (d) 1/21 d Let v be 3/((-243)/(-36)-4). Which is the fourth biggest value? (a) -2 (b) v (c) -0.11 (d) -0.5 a Let x = -5.582 + 1.582. Which is the second biggest value? (a) 2 (b) x (c) 16 a Let m = 55 + -41.5. Let x = 11 - m. Let k = x + 3. What is the third biggest value in k, -0.2, -1/3? -1/3 Let x = 0.4932 - 0.0932. What is the fourth biggest value in 0, 0.2, x, 1/7? 0 Let a = 26 + 19. Let h = a + -46. What is the third smallest value in h, -4, -2/5? -2/5 Let p be -1(4 + -2 + 109). Let u be p/(-21) - 2/7. Suppose 2f + 0 = -4z - 6, 0 = 5z - uf + 45. Which is the third smallest value? (a) 3/8 (b) z (c) -3 a Suppose 4t - 5y + 5 = -10y, 2y - 5 = -3t. Let d = 79/932 - 837489/6524. Let x = -128 - d. What is the biggest value in x, t, -1/4? t Let m = 1.2 - -12.8. Let t = -13.93 + m. Let q = t - -1.93. Which is the second smallest value? (a) 0 (b) q (c) -1 a Let y = -13825/11 - -1257. What is the second smallest value in y, 2, 62? 2 Let z = -229/350 + -3/50. Which is the third biggest value? (a) 0.2 (b) -0.5 (c) 0.4 (d) z b Let s = 32.03 + -32.4. Which is the smallest value? (a) -2/3 (b) 0.4 (c) -6 (d) s c Let q(m) = m3 - 3m*2 - 7m + 5. Let l be q(4). Let k = -69 - -42. Let s = k + 23. Which is the second smallest value? (a) 3/5 (b) l (c) s c Let q = -828 + 826. Let f = -5 + 9. What is the second smallest value in -5, f, q, -4? -4 Let s = -13.95 - -14. Let o = -0.19 + s. Let d = o - -0.14. Which is the biggest value? (a) -2 (b) d (c) -0.5 b Let y = -14.08 + 0.08. Let i = y + 13.88. Let p = 0.62 + i. Which is the smallest value? (a) p (b) 2 (c) -1/4 c Let n = 58 - 58.3. What is the second biggest value in n, 4, 0.05, -2/5? 0.05 Let z(w) = -8w2 + 259w - 339. Let m be z(31). Let o = -1 + -1. Which is the second biggest value? (a) -7 (b) o (c) m (d) 1 d Let j = -981 + 981. Which is the fourth biggest value? (a) -3/5 (b) -2/331 (c) -2/11 (d) j a Let w(a) = 32a + 325. Let n be w(-10). What is the fourth biggest value in 1, n, 6, 2/11? 2/11 Let t be ((-18)/(-15))/(56/(-35)). Let a(n) = -n2 - 5n - 3. Let i be a(-5). What is the smallest value in i, -5, -8, t? -8 Let t = 1.7 - 1.59. Let r = 2.89 + t. Let h = -4.07 + 0.07. What is the third biggest value in -2/13, h, r? h Let a be (75/(-45))/(-31/(-3)). What is the biggest value in 7, a, 2/17? 7 Let h = 268 - 266. Which is the third smallest value? (a) -2 (b) h (c) 2/13 (d) -4 c Let r = -185 - -155. Which is the fourth biggest value? (a) 2 (b) 0 (c) r (d) 4 c Let b = 0.38 + -0.08. Suppose 5v + 36 = 7v. Let c be 0 + (-3)/v-2. What is the second biggest value in b, -1, c? b Let v be ((-2)/8)/(5/(-80)). Suppose -8 = 2t, 28 = c - 5t + 4. Suppose 1 = -p + 2p - vz, cz = 5p + 11. What is the biggest value in p, 4, -4? 4 Let p(d) = d3 + d2 - d + 3. Let g be p(0). Let n be 4 - ((-256)/12 + g). Let w = n - 21. Which is the biggest value? (a) 1 (b) -1 (c) w c Let g = 34.5 + -34. Let y = -1.5 + g. What is the biggest value in 1/6, -0.1, y? 1/6 Let b = 6.3 - 6. Let d be (4/4)/(8/(-6)). Let o = d + 5/12. What is	{ "pile_set_name": "DM Mathematics" }
c). Suppose -4v - r = 13302887. Round v to the nearest 1000000. -7000000 Let o be 5 + (-83941)/(-44) - 2/(-8). Let k be (66 + -64)(1 + -1 + o). What is k rounded to the nearest one hundred? 3800 Let r(a) = 858a3 - 3a*2 + 4a - 15. Let f be r(8). Suppose -4n = -3b - f, 87001 - 416363 = -3n - 2b. Let j = 269784 - n. Round j to the nearest 10000. 160000 Suppose -44q + 180 = -47q. Let d be 9444((-100)/(-3))/((-12)/q). What is d rounded to the nearest 100000? 1600000 Let m = 0.22437091916 - 0.22437. Round m to 7 dps. 0.0000009 Let b = 657.7 - 657.7000004481. What is b rounded to 7 decimal places? -0.0000004 Suppose 0 = -p - 0p + 4m + 2, -4p - 5m + 8 = 0. Suppose -3 = -2b - n + 5, -2n = -5b + p. Suppose 4c - bc = -774. What is c rounded to the nearest ten? -390 Let z = 576 - 575.896. Let h = z + -0.10399801. What is h rounded to seven dps? 0.000002 Let p = -6359 + 6008.88. Let w = 350 + p. Round w to the nearest integer. 0 Suppose -7h = 7o - 10h - 7033615, 3h = 2o - 2009615. Round o to the nearest ten thousand. 1000000 Let d = -26917.99941518 - -26918. What is d rounded to 4 dps? 0.0006 Let u be (-1063)/(-5) - (4 - 66/15). Let n = 328 - u. What is n rounded to the nearest ten? 120 Let w = 52959.73811099 + -52930.73811. Let s = -29 + w. What is s rounded to seven dps? 0.000001 Let x = 1820.36 - -0.14. Round x to the nearest 10. 1820 Let h = -2312 + 2311.1747. What is h rounded to two decimal places? -0.83 Suppose -4938500 = 4u + 3898700. What is u rounded to the nearest one hundred thousand? -2200000 Let m = -21229.9993514 - -21230. What is m rounded to three dps? 0.001 Let a = 26554 - 26515.891. Let f = -9.47 - 28.43. Let h = f + a. What is h rounded to two dps? 0.21 Let t = -904.6568 - -905. Let q = 0.0606 - t. What is q rounded to two decimal places? -0.28 Let r = 664.2 - 614. Let n = 100.6 - r. Round n to the nearest ten. 50 Let w = -149955166.38428 - -149959234. Let j = -4089.61572068 + w. Let p = j + 22. Round p to seven decimal places. -0.0000007 Let v = 53.5 - -177.5. Let t = v - 229.06. Let s = t + -5.41. Round s to 1 dp. -3.5 Let b be (-1)/2 + 35/(-10). Let o be b/14 - (-240)/56. Suppose -20 = of, 5g + f = -1789188 - 8010817. What is g rounded to the nearest one million? -2000000 Suppose 194 + 51 = 7d. Suppose -dn + 12694746 - 3594746 = 0. What is n rounded to the nearest 1000000? 0 Let x = -44502.8302 + 44518. Let c = 15.2 - x. Round c to 3 decimal places. 0.03 Suppose 0 = -2r - 2c + 2, 2r + 3c - 5 = 2c. Let s(d) = -13308d*2 + 8d - 23. Let p be s(r). Let o = -1387081 + p. Round o to the nearest one million. -2000000 Let z(m) = 1223m3 + 2m*2 + m - 3. Suppose -2o = -3y - y + 12, -4o + 20 = 3y. Let g be z(o). Let r = g + -28391. Round r to the nearest 1000. -19000 Let a = -4422 - -6553. Suppose i + 1553 + 1991 = 5z, -3z - 4i = -a. Suppose 3o = -o - 4r + 1388, 0 = 2o - r - z. What is o rounded to the nearest 10? 350 Let v = 4237611305 - 4237611401.00000315. Let k = v - -96. What is k rounded to 7 dps? -0.0000032 Let i = -154.496 - 33.094. Round i to zero dps. -188 Let l = 1173.2192 + -0.2192. Let p = -1173.00000803 + l. Round p to 6 dps. -0.000008 Let n = 321 - 537. Let p = -216.00106 - n. Round p to 4 dps. -0.0011 Suppose -2s + 1705 = 5o, -o = 4o + 5s - 1690. Let f = 783 - o. What is f rounded to the nearest 100? 400 Let i = -2717.838 - -2839.9. What is i rounded to the nearest ten? 120 Let y = 95.49 + -37.71. What is y rounded to zero dps? 58 Let v = 1812195755.999613 + -1812194928. Let m = v + -828. Round m to five dps. -0.00039 Let w = 407 + -245.6. Let g = w + -160.593. Round g to 2 dps. 0.81 Let y = 130217 - 130216.99941031. Round y to 4 dps. 0.0006 Suppose 5r = 2u - 102644, -3r = -16u + 20u + 61602. Round r to the nearest 100. -20500 Let q(u) = 2 + 3u + 3u - 5u. Let v be q(3). Suppose 0h - 3h + 4y - 575996 = 0, 4y + 960004 = -vh. What is h rounded to the nearest 10000? -190000 Let d = 0.0784 + -383.0784. Let a = d + 424.3. What is a rounded to the nearest integer? 41 Let g = -431 + 501. Suppose -gb + 60b = 16880000. Round b to the nearest 100000. -1700000 Let z = -366 + 338.4. Let h = 2 + z. Round h to 0 dps. -26 Let r = 904.65 + 17.35. Let p = 921.999725 - r. What is p rounded to 4 decimal places? -0.0003 Let b = -8.892 - -8.8. Let f = b - -1.642. Let z = -1.55174 + f. What is z rounded to 4 dps? -0.0017 Suppose 0 = -120y + 198y - 105y + 253025100. Round y to the nearest 100000. 9400000 Let k = 31319.00824 + -31280. Let j = k - 39. Round j to 3 decimal places. 0.008 Let k = -20438 + 20324.93. What is k rounded to the nearest integer? -113 Let l = 153 + 597. What is l rounded to the nearest 100? 800 Let c = 184.49 - 15.69. Let s = c - 168.80001446. What is s rounded to 6 decimal places? -0.000014 Let r = -120 + 123.62. Let f = -0.06 - r. What is f rounded to 1 dp? -3.7 Let f = -2114.2 + 2114.2007078. Round f to five decimal places. 0.00071 Let i(o) be the third derivative of o5/2 + o4/2 + 5o*3/2 + 34o*2. Let c be i(-3). What is c rounded to the nearest ten? 250 Let b = 2934527.700746 + -2934536. Let p = b + 8.3. Round p to 4 dps. 0.0007 Let g = -288538 + 288439.2406. Let l = g + -0.1406. Round l to the nearest ten. -100 Let h be (-12)/840/(-5). Suppose -16r + 2680000 = -hr. What is r rounded to the nearest one hundred thousand? 700000 Let v = -192.41 - -192.80502. What is v rounded to 3 dps? 0.395 Let w = -11.2 - 33.8. Let f = -3652 - -3607.9. Let i = f - w. Round i to the nearest integer. 1 Let b = 25526 + -25525.99970358. Round b to 5 decimal places. 0.0003 Let v = -0.8933 + 0.1313. What is v rounded to 2 dps? -0.76 Let i = 0.12491987 + -0.12486. Round i to six dps. 0.00006 Let x(t) = -115962618t - 472. Let s be x(-4). What is s rounded to the nearest 1000000? 464000000 Let d = 399 + -989. Let j = d - -589.99999154. Round j to 7 dps. -0.0000085 Let s(o) = 172605o*2 + 9o - 16. Let c be s(4). Round c to the nearest ten thousand. 2760000 Suppose 16p - 55 = 25. Suppose 5r + 27862 = 3v, pr + 2v = 2r - 16702. Round r to the nearest one thousand. -6000 Let a = 483841 + -484089.841. Let b = 249 + a. Let z = b + -0.1428. Round z to 3 dps. 0.016 Let h = -720.62 + 704. Let o = 16.63029 + h. What is o rounded to 3 dps? 0.01 Let i = 3537.042 - 3532. Round i to one decimal place. 5 Let z = 103 + 57. Let p = -74 - z. Let r = -234.000000219 - p. Round r to seven dps. -0.0000002 Suppose -8v - 99 = -27. Let f = 11 + v. Suppose 2n = n + fl - 12299992, -3l = 12. Round n to the nearest 1000000. -12000000 Let p = -29 - -29.0117. Let y = p + -0.00022. What is y rounded to three dps? 0.011 Let s = -0.06412 - -59.24812. Round s to the nearest 10. 60 Let t = 5950550 - 14717550. Round t to the nearest 100000. -8800000 Suppose 5n - 176954 = 2a, 442415 = -5a + 28n - 23n. What is a rounded to the nearest 10000? -90000 Let d = 109.9978 - 110. Let q = -0.001779 - d. What is q rounded to 4 dps? 0.0004 Let j = 410.1234 - 414.31. Let c = 0.0166 + j. Round c to one decimal place. -4.2 Let i = 15.38 + -15.1. Let k = i + -1.01. Let z = k + -8.77. Round z to the nearest integer. -10 Let p = -55968.00047011 + 55968. Round p to 5 decimal places. -0.00047 Let s = -44240577 + 44238135.1007. Let x = s - -2442. What is x rounded to 2 decimal places? 0.1 Let s = 187 + -2165. Let i = 1922.68 + s. What is i rounded to the nearest 10? -60 Let v = -30.872 - -31.07. Round v to three decimal places. 0.198 Let n = -606428.3029 + 606402. Let f = n + 0.0029. Let y = -54.4 - f. Round y to zero decimal places. -28 Let z = -240 + 453. Let j = z + -213.0000645. What is j rounded to five decimal places? -0.00006 Let m = -2512.62 - -2473. Let a = m + -18.62. Let d = -2.74 - a. Round d to the nearest ten. 60 Let p = 1519.119 + -1518. Let r = -0.95 + p. Round r to one decimal place. 0.2 Let y be 2823-1*(28 - 31). Let x = y - 12649. What is x rounded to the nearest 1000? -4000 Let z = 99 + -99.238. Let v = 1.374 - z. Let y = 0.088 + v. What is y rounded to 1 dp? 1.7 Let z = -7618 - -7617.6213. What is z rounded to 1 decimal place? -0.4 Let g = 24755241513.981027 + -24755229864. Let i = -11650 + g. Let f = -0.019 - i. Round f to five dps. -0.00003 Let l = 11134 + -11167.996. Let j = -5	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.