Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
ns digit of k? 6 Suppose 5h + 2601 = -2i + 4i, -2h = -5i + 6555. What is the tens digit of i? 1 Suppose -40 = -6d - 34. What is the units digit of 87/d + (-1)/26? 4 Let l be (80/24)/(4/(-6)). What is the tens digit of (-75)/1(5 - (-31)/l)? 9 Suppose -4u = 2a - 44, -5a + 58 = 5u - a. Suppose up - 192 = 58. What is the units digit of p? 5 Suppose 3s - 6s - 525 = 0. Let p = s - -122. Let l = -31 - p. What is the tens digit of l? 2 Suppose -6396 = -2i - 2g, 4g + 4644 - 1461 = i. What is the tens digit of i? 9 Let q be (-1)/((2/10)/(-1)). Let c = 2 + 54. Suppose 3j = qj - c. What is the tens digit of j? 2 What is the hundreds digit of ((-24236)/(-365))/((-4)/(-10))? 1 Let i(p) = -2p3 - 70p*2 - 48p - 56. What is the tens digit of i(-35)? 2 Let p(a) be the first derivative of -a*4/4 + 2a*3 + 3a*2/2 - 3a - 6. Let u be p(3). Let s = -20 + u. What is the tens digit of s? 1 Suppose -5a + 3f + 838 = 5f, -5a = 5f - 835. What is the units digit of a? 8 Let a(v) = -3 + 5v + 5 + 8v3 - 3 - 5v*3. What is the units digit of a(3)? 5 Suppose 0 = 3u + 3n - 912, u - 6u + 1520 = 4n. What is the units digit of u? 4 Let y(x) = -11x - 5. Suppose -3o + 12 = -6o. What is the units digit of y(o)? 9 Let x = -1988 + 3112. What is the units digit of x? 4 Let k be (-2)/2(-5 + (-10)/5). Let c(y) = y3 - 7y*2 + 15y - 5. What is the tens digit of c(k)? 0 Let j(y) = 84y2 + 7 - 161y*2 + 8y + 79y2. What is the units digit of j(4)? 1 Suppose -2k = 2r - 1477 - 2849, 0 = 3r + 4k - 6486. What is the units digit of r? 6 Suppose 0 = -0z + 2z - 182. Let x be 6/(-8)(-7 + z). What is the tens digit of (5 - 1) + (-16 - x)? 5 Let r(u) = 2u2 + 26u + 191. What is the hundreds digit of r(-17)? 3 Let s(d) = d*2 - 6d + 5. Let w be s(5). Suppose w = 8g - 3g - 455. What is the tens digit of g? 9 Let v(t) = -t*2 + t + 5t*2 + 4 + 5t*2 - 1. Let g be v(3). Suppose 34 = -i + g. What is the units digit of i? 3 Let b = -277 + 495. What is the units digit of b? 8 Let r(h) = -14h + 4h - h3 + 13h*2 - 2h*2. Let s be r(10). Suppose 3 = 5p + 2x - 19, x + 4 = s. What is the units digit of p? 6 Let f(o) = 6o*2 - 4o - 6. Let l be f(6). Suppose 5k = -w - l, -2k = -w - 28 + 101. Let u = k - -56. What is the units digit of u? 9 Let v(r) = r*3 - 28r*2 + 51r + 44. What is the units digit of v(26)? 8 Suppose 7 = 4w + 55. Let t(h) = h2 - 4h - 11. Let c be t(w). Suppose -5m + 3o - 19 + c = 0, -5m = 5o - 130. What is the tens digit of m? 3 Suppose -7b = -5v - 2b + 5, 0 = -3v + 5b + 1. Let x be (-18)/(-4) - v/(-4). Suppose 2a - 4c = 26 + 14, -a + xc = -20. What is the units digit of a? 0 Let t = 12 + -7. Suppose -4z + 17 = 5c, 2z - c = -2 + 7. Suppose -g - ty = -42, -zg - y = 2y - 138. What is the tens digit of g? 4 Suppose 19s - 10241 = -2090. What is the tens digit of s? 2 Let m = 1366 + -878. What is the tens digit of m? 8 Let j(o) = 2o*2 - 4o + 2. What is the units digit of j(15)? 2 Let f(p) = 2p - 5. Let m be f(3). Let r = 20 - m. Suppose -u + 2u = r. What is the tens digit of u? 1 Let l be 14 - (3(-3)/9 - -3). Let o(i) be the second derivative of i5/20 - i4 + i3/6 - i2 - i. What is the tens digit of o(l)? 1 Let u = 113 + -118. Let i(r) = -29r + 50. What is the hundreds digit of i(u)? 1 Suppose 99 = 13j - 18. Suppose -q = 2, -8q = -2f - jq + 296. What is the hundreds digit of f? 1 Let d(b) = -b*3 - 5b*2 + 6b + 2. Let o(j) = -j*3 + 5j*2 + 7j - 13. Let z be o(6). What is the units digit of d(z)? 8 Let r = -46 - 1. Let k = r + 135. What is the units digit of k? 8 Let u(b) = b - 4. Let a be u(10). Let m(p) = p*2 - 4p - 7. Let r be m(a). What is the units digit of r6/1532? 4 Let y = -4568 - -10356. What is the tens digit of y? 8 Let c(s) = -1510s + 8. What is the tens digit of c(-1)? 1 Let r = -25 - -19. Let j(h) = 4h + 13 - 3 - 3h. What is the units digit of j(r)? 4 Let f(p) = -p3 - p2 - 5p. What is the units digit of f(-2)? 4 Suppose 2j - 1148 = 3c, j - 140 = c + 433. What is the units digit of j? 1 Let a(b) = -41b + 3 - 4 - 6 + 15b*2 - 2b*2. What is the tens digit of a(5)? 1 What is the units digit of -2(-1956)/(-24)-3? 9 Let w = -5 - -10. Let i(t) = w + t - 3t*2 - 4 + 4t*2 + 1. What is the units digit of i(-4)? 4 Let s be 3/((-12)/8 - -3). Suppose -x - 4 = o, 0x - s = 3o - 2x. What is the units digit of o22(-12)/16? 3 Let h(r) = r*2 + r - 3. Let s be h(-4). Suppose -sz + 505 = -4z. What is the units digit of z? 1 Let z be ((-2)/3)/(8/12). Let o be 2 - (z + -16 + -1). What is the units digit of (o/6)/23? 5 Suppose -6l + 49 = -3l + 2t, -l + 12 = 5t. Let u(b) = -b + 17. Let j be u(l). Suppose j = w + m - 34, -5w = -5m - 55 - 95. What is the units digit of w? 2 Suppose 15a - 8273 = 6037. What is the units digit of a? 4 Let t(v) = 3v - 9. Suppose -3p - p = -24. What is the units digit of t(p)? 9 Suppose c = -3i + 2i + 31, -i + 28 = 2c. Suppose 14 = 4u - i. What is the units digit of (-21 + -1)/((-6)/u)? 4 Suppose 0 = 10m + 108 - 168. Let t(c) = 35c2 + 2c - 1. Let n be t(1). Suppose -m + 0 = -i - 4w, 4w = -4i + n. What is the units digit of i? 0 Suppose 2b = b + 5. Suppose 0 = bx - 268 - 137. What is the tens digit of x? 8 Let h(i) = -3i - 10. Suppose -3z + p = 47, -z + 0p = 5p + 5. Let s be 1/(-3)(-3 - z). What is the units digit of h(s)? 2 Suppose 0h + 2h - 4 = 0. Suppose r + 13 + 5 = hg, 12 = 3r. What is the units digit of g? 1 Let f be 22/(-4)2. Let g = f + 7. Suppose gl - 3l - 6 = 0. What is the units digit of l? 3 Let h = 4064 + -2312. What is the hundreds digit of h? 7 Let r = -219 + 360. What is the units digit of r? 1 Suppose 2g = 6g - 8. Suppose 2d + 2y + 0y + 272 = 0, -3d - gy - 407 = 0. What is the tens digit of (-12)/(18/d)? 1 Let i(f) = 4f2 - 7f + 10. Let t be i(-10). Let z be ((-60)/(-16))/(3/t). What is the tens digit of ((-2)/3)/((-16)/z)? 2 Let t(i) = -i*2 - 10i + 10. Let g = 29 + -25. Suppose a = ga - 2q + 16, 20 = -5q. What is the tens digit of t(a)? 2 Suppose -4g = -4x - 6576, g + x - 1749 = -113. What is the hundreds digit of g? 6 Let k(g) = 0 - 9 + 0 + 4g*2 + 3g + 0g2. What is the tens digit of k(-5)? 7 Let d(c) = -1 - c3 - 5c*2 - 3 - 6c + 5. Let j be d(-5). Suppose 4q - 115 = -3s, 2q + j = 3q + 3s. What is the units digit of q? 8 Suppose 5a - 4g - 807 = 0, 3a + g = 3g + 485. Suppose 3x - a = 2f, -5x = -2f - f - 273. What is the tens digit of x? 5 Suppose -5z + x + 4 = 0, z + 3z - 2x = 2. Let o(y) = 77y + 4. Let d be o(3). What is the tens digit of z/(-6) + d/6? 3 Let j = 55 + -27. Suppose j + 36 = 4u. What is the tens digit of u? 1 Let r be (54/(-36))/(3/(-4)). What is the units digit of r/(-11) - 904/(-11)? 2 Suppose 0 = -3r + 3z + 30, 4r - 2z - 28 = -4z. Let b(f) = -3f + r - 3f - 2. What is the units digit of b(-5)? 6 Suppose 0 = -52c + 41393 + 28911. What is the units digit of c? 2 Let w(d) be the first derivative of -d7/840 + d6/360 + 65d4/24 - 2d3 - 4. Let o(n) be the third derivative of w(n). What is the tens digit of o(0)? 6 Let y = 4 + 46. Let o = y - 41. What is the units digit of o? 9 Let g(x) = x2 - 7x + 6. Let y be g(6). Suppose y = -4q + 22 + 14. Suppose -4h + q = -11. What is the units digit of h? 5 Let a(n) = -n3 - n2 + 5n + 448. What is the hundreds digit of a(0)? 4 What is the units digit of 12/(-20) + 18972/20 + -5? 3 Let s(r) = 2r - 14. Let z(b) = -b2 + b - 1. Let n(u) = s(u) - z(u). What is the units digit of n(6)? 9 Suppose -3a + 16a = 5317. What is the hundreds digit of a? 4 Suppose -5j + o - 1 = 0, -4j - 11 = 5o + 13. What is the tens digit of (10/5 - 28)j? 2 Suppose -2o = 6, 3o - 26 + 73 = f. What is the units digit of f? 8 Let a(p) be the third derivative of 13p6/24 + p5/60 + p4/12 - p3/3 + 92p2. Suppose 3o + 6 = h + 20, 8 = 3h + o. What is the tens digit of a(h)? 6 Let f = 495 + -237. What is the hundreds digit of f? 2 Suppose 4m = m - 39. Let z = m - -15. Suppose 3p = zp + 75. What is the tens digit of p? 7 Suppose 4 - 15 = i. Let w = 9 + -6. Let q = w - i. What is the tens digit of q? 1 Let g = -16 - -19. Suppose -4w - gj + 14 = 0, 4j - 14 = -3w -	{ "pile_set_name": "DM Mathematics" }
ate j(3). 188 Let o(n) = -29n3 - 68n*2 - 2n - 12. Determine o(-4). 764 Let z(q) = -3q3 + 9q*2 + 13q - 19. Determine z(6). -265 Let w(o) = 2o2 + 57o - 1025. Determine w(17). 522 Let k(d) = 2d2 - 295d + 1011. Give k(140). -1089 Let v(f) = 6436f - 12969. Give v(2). -97 Let x(h) = -14h*3 - 137h*2 - 214h + 116. Determine x(-2). 108 Let i(h) = -h*3 + 20h*2 + 216h - 1542. Calculate i(26). 18 Let u(o) = -o*3 + 57o*2 - 12o + 2695. What is u(58)? -1365 Let m(w) = 11w2 - 419w - 1874. Give m(-4). -22 Let t(o) = -841o3 + 14o*2 - 29o + 16. What is t(1)? -840 Let t(z) = 2516z - 128851. What is t(51)? -535 Let g(k) = 13k*3 - 9k*2 + 34k + 98. Determine g(-2). -110 Let s(y) = -2285y2 - 6850y - 4. What is s(-3)? -19 Let u(f) = 550f2 - 20895f - 186. Determine u(38). 4 Let n(k) = 11k3 - 873k*2 + 319k - 237. Determine n(79). 0 Let p(h) = -4071h - 240198. Determine p(-59). -9 Let k(l) = -9l*3 + 490l*2 - 695l + 320. What is k(53)? 2 Let i(p) = -9p3 + 32p*2 - 124p + 750. Calculate i(5). -195 Let t(j) = j*2 - 1129j + 26687. Calculate t(24). 167 Let c(g) = -64g3 + 21g*2 + 94g + 57. What is c(-3)? 1692 Let u(x) = 11x2 - 1139x + 468. Give u(104). 988 Let y(q) = 2q3 - 133q*2 - 12849q + 959. Determine y(120). -121 Let s(x) = -x*2 + 196x + 31339. Determine s(-105). -266 Let m(s) = -99s2 + 917s - 106. Give m(9). 128 Let a(l) = 137l2 - 834l - 87. Calculate a(6). -159 Let t(l) = 201l3 + 1004l*2 - 33l - 160. Calculate t(-5). -20 Let v(n) = 5n - 18. What is v(5)? 7 Let k(m) = -m3 - 40m*2 - 366m + 280. Calculate k(-24). -152 Let c(q) = 2q2 + 8066q - 64585. Calculate c(8). 71 Let x(i) = -i*3 + 117i*2 - 1071i + 115. Determine x(107). 8 Let s(l) = 137l2 - 257l + 116. Determine s(1). -4 Let p(z) = -115z2 - 18124z + 120708. Give p(-164). 4 Let v(w) = 7w3 - 10w*2 - 20610w - 20600. Give v(-1). -7 Let n(y) = -4y3 - 61y*2 - 2y - 1859. Calculate n(0). -1859 Let l(a) = 2028a - 70173. Calculate l(35). 807 Let d(t) = -10t*2 + 3455t + 13678. Give d(349). 1463 Let x(z) = -1044z + 52126. Determine x(50). -74 Let m(v) = -6903v + 158718. Calculate m(23). -51 Let i(v) = -5331v - 5192381. What is i(-974)? 13 Let f(d) = -17d*3 + 18d*2 - 17d - 14. Calculate f(-4). 1430 Let j(o) = -o*3 - 61o*2 - 267o + 12322. What is j(-51)? -71 Let a(m) = m*3 - 590m + 295. Give a(24). -41 Let q(i) = -i*2 - 35i - 118. Calculate q(12). -682 Let w(f) = -f*2 + 477f + 9424. Determine w(-19). 0 Let p(w) = 2w2 - 1033w - 11350. Give p(-11). 255 Let i(f) = -4f3 - 75f*2 - 321f - 6445. Give i(-19). 15 Let y(b) = 12b2 - 9024b - 54585. What is y(-6)? -9 Let f(a) = -a*3 - 30a*2 + 4149a + 121308. What is f(-29)? 146 Let m(y) = -y*3 + 168y*2 + 2472y + 13822. What is m(182)? -10 Let y(c) = -15349c + 168873. What is y(11)? 34 Let w(r) = 3r*2 + 4820r + 52757. Calculate w(-11). 100 Let y(c) = -309c2 - 8341c + 55. What is y(-27)? 1 Let p(s) = -283s + 53. What is p(-11)? 3166 Let i(y) = 31y*3 - 2019y*2 + 219y + 2684. Give i(65). 19 Let g(a) = a*3 + 65a*2 + 133a + 1143. Give g(-63). 702 Let i(q) = 4439q + 426143. Determine i(-96). -1 Let h(n) = -26n*3 - 859n*2 - 31n - 109. Give h(-33). -175 Let m(n) = 11n3 - 128n*2 + 379n - 42. What is m(6)? 0 Let g(l) = -323l + 26076. Calculate g(82). -410 Let u(o) = 2o*2 + 3460o + 1444621. Determine u(-1026). 13 Let d(s) = 2s3 - 69s*2 - 75s - 201. Determine d(35). -1601 Let i(j) = -36j2 + 1867j + 12464. Give i(-6). -34 Let y(m) = 4212m - 10399427. What is y(2469)? 1 Let y(b) = b2 - 132b + 1736. Give y(14). 84 Let i(m) = -9807m - 48973. Give i(-5). 62 Let u(r) = 198883r + 1193274. Calculate u(-6). -24 Let q(o) = -o*3 - 36o*2 - 360o - 173. What is q(-19)? 530 Let d(a) = 35a3 + 3777a*2 - 322a + 180. What is d(-108)? -36 Let p(b) = 6b3 - 22b*2 - 130b + 449. What is p(5)? -1 Let g(m) = -16002m + 160073. What is g(10)? 53 Let u(m) = 3333m + 1603168. Give u(-481). -5 Let t(m) = -7m2 + 10070m + 302411. Calculate t(1468). 3 Let m(q) = 82q2 + 9q + 11. What is m(-1)? 84 Let h(r) = -21482r - 13. Calculate h(0). -13 Let r(z) = -2z*2 + 4916z - 19678. What is r(4)? -46 Let v(k) = 3k3 - 446k*2 + 310k - 2142. What is v(148)? -70 Let b(s) = -s*2 - 1213s - 24155. What is b(-20)? -295 Let n(r) = -33r3 + 19236r*2 + 1743r + 3442. Calculate n(583). -56 Let y(i) = 3063i + 23867. What is y(-8)? -637 Let o(h) = -5h*2 - 313h - 1050. Determine o(-59). 12 Let x(s) = -30s3 + 975s*2 - 481s + 23. Calculate x(32). -9 Let y(p) = -1673p - 4236. What is y(-2)? -890 Let k(d) = d3 + 40d*2 + 197d + 718. What is k(-35)? -52 Let a(q) = 12q2 + 5877q + 35261. Calculate a(-6). 431 Let o(w) = 14772w - 590888. Calculate o(40). -8 Let w(d) = 79d*3 - 790d*2 + 142d - 1441. Determine w(10). -21 Let t(i) = 2i3 - 132i*2 + 1374i + 426. What is t(53)? 214 Let w(u) = 2u2 + 1217u - 206024. What is w(138)? 10 Let m(z) = -916z - 13512. What is m(-15)? 228 Let q(j) = -33260j + 66532. Calculate q(2). 12 Let i(a) = -31a2 + 55761a - 111513. Give i(2). -115 Let y(c) = -25565c - 358090. What is y(-14)? -180 Let z(s) = -s3 - 45s*2 + 356s - 443. Determine z(-52). -27 Let n(w) = 933w - 42919. What is n(46)? -1 Let f(w) = -50499w - 51086. Give f(-1). -587 Let m(d) = -d*3 + 160d*2 - 126d + 19945. Calculate m(160). -215 Let r(x) = 2x3 - 1180x*2 + 6974x + 19838. Determine r(584). -18 Let c(u) = 6u3 - 111u*2 - 348u + 3390. What is c(20)? 30 Let o(a) = -713983a + 2855936. Give o(4). 4 Let u(r) = 4737r - 18. What is u(0)? -18 Let s(z) = 75z2 - 686z - 1370. Calculate s(-2). 302 Let z(d) = -35280d + 34893. Determine z(1). -387 Let u(b) = 64b*2 + 133b + 107. Determine u(-5). 1042 Let c(p) = 450p2 - 5402p + 16. Determine c(12). -8 Let r(y) = -4484y + 67284. Calculate r(15). 24 Let h(l) = 3237l + 29878. What is h(-9)? 745 Let m(c) = -5c2 + 1896c - 17021. Calculate m(370). -1 Let a(p) = -p*3 - 357p*2 - 862p + 70795. What is a(-354)? -5 Let z(p) = 8064p - 80758. Calculate z(10). -118 Let l(c) = 39c*3 + 5c*2 - 6c - 28. Calculate l(-3). -1018 Let b(k) = k*2 - 95k - 224. Determine b(9). -998 Let t(l) = 4l2 + 83l - 1703. Give t(-33). -86 Let b(y) = 6y2 - 79y + 257. Determine b(6). -1 Let h(z) = -591z + 2154. Calculate h(2). 972 Let j(m) = m3 - 180m*2 + 258m + 17063. What is j(178)? -381 Let n(g) = 11921g2 + 23843g + 1. Give n(-2). -1 Let a(i) = -30661i - 1349092. What is a(-44)? -8 Let c(t) = 32t - 1911. Determine c(56). -119 Let w(g) = -171g2 + 19503g - 1050. Give w(114). -24 Let v(z) = -3z2 + 1830z + 1713591. Give v(-510). -9 Let p(d) = 600d2 - 12d + 42. Calculate p(0). 42 Let b(v) = -v*3 + 7v*2 + 385v + 325. Calculate b(-16). 53 Let q(h) = 10h2 + 5507h + 63074. Determine q(-539). 11 Let k(v) = 223151v - 446315. Give k(2). -13 Let q(f) = -f3 + 21f*2 - 17f + 72. Calculate q(22). -786 Let x(t) = t*3 + 40t*2 + 1824t + 69614. Calculate x(-39). -1 Let o(m) = m*3 + 2m*2 - 52m + 91. Determine o(5). 6 Let k(i) = -30i3 - 4501i*2 - 166i - 2324. Calculate k(-150). 76 Let k(p) = -92385p - 1662934. Determine k(-18). -4 Let c(g) = g2 + 140950g + 1268472. Give c(-9). 3 Let l(b) = 697b - 12974. Determine l(19). 269 Let m(c) = -17013c - 561438. Give m(-33). -9 Let y(b) = -17b3 + 156b*2 - 35b + 112. Calculate y(9). 40 Let f(i) = 16i2 + 231i + 631. Calculate f(-7). -202 Let g(j) = 101221j - 1012154. Determine g(10). 56 Let z(b) = -22b*2 + 814b - 47. What is z(37)? -47 Let f(m) = 4m2 + 1358m + 22373. Determine f(-17). 443 Let n(k) = -4179k + 25263. What is n(6)? 189 Let m(j) = 16044j - 3625924. What is m(226)? 20 Let z(y) = -244y - 15091. Give z(-62). 37 Let s(c) = 769c + 232452. Determine s(-302). 214 Let w(s) = 4s3 + 15s*2 - 74s + 54. What is w(5)? 559 Let c(r) = -r*3 - 13r*2 - 312r - 5056. Calculate c(-16). 704 Let l(s) = 2703s2 + 335210s + 4711. Give l(-124). -1 Let l(p) = 2p3 + 265p*2 + 408p + 1835. Determine l(-131). -130 Let w(v) = v*2 - 11863v + 319567. Calculate w(27). -5 Let t(y) = -1245*y - 58536. Give t(-47).	{ "pile_set_name": "DM Mathematics" }
t j(t) = -t*3 + 7t*2 - 11t + 12. Let h be j(6). Let d = h - -25. Calculate the least common multiple of u(d) and 15. 60 What is the lowest common multiple of 56 and 6/22 - 13800/(-220)? 504 Let c(y) = -143y + 10. Let i be c(-5). Find the common denominator of 5568/i - (0 + 6) and 31/14. 350 Suppose -r - 4 = -3y + 8, 4y - 16 = 0. Suppose r - 18 = -2l. Calculate the common denominator of 150/35(48/l)/4 and 16/3. 21 Let k be ((-28)/(-35))/((-6)/(-5))3. Suppose -67 = kl - 3q, 0 = -4l + 3q - 15 - 104. Find the common denominator of (0 + l/20)3 and -44/5. 10 Suppose 0 = -10o + 13o - 414. Suppose 0 = -on + 127n + 1760. What is the lowest common multiple of n and 128? 640 Let s = -215/554 - -58895/132129. What is the common denominator of -83/24 and s? 3816 Let o = 1025056 - 266514243/260. Let u = o + 2/65. Calculate the common denominator of 48/53 and u. 212 Let u = 4684 + -18685/4. What is the common denominator of u and (1/(-3))/(18/(-513))? 4 Let t = 3204882367725007/49014 - 65387080591. Let l = t - -6/2723. What is the common denominator of l and 65/63? 126 Let r = -54 + 58. Suppose rv - 3 = 25. Calculate the least common multiple of 93 and v. 651 Let o(r) = -2r3 - 8r*2 + r - 7. Suppose -c + 13 = 17. Let b be o(c). Let k(a) = a + 47. Calculate the smallest common multiple of 12 and k(b). 36 Suppose 0 = -17j + 12j + 50. Calculate the common denominator of (-14)/j + (-5424)/(-12960) and 35/48. 432 Suppose 0 = -10z + 4z + 108. Let h(t) = -2t + 58. Let m be h(27). Suppose mf - z = 46. What is the lowest common multiple of f and 14? 112 Suppose 3n = -22 + 106. Suppose -2d + 4k = 77 - 269, 0 = -5d - 4k + 424. Suppose 0 = 5q - d + n. Calculate the smallest common multiple of q and 30. 60 Find the common denominator of -47/285 and ((-55)/(-2280))/((-11)/44). 570 Let l = -225523/24 + 9401. Calculate the common denominator of l and (120/160)/(36/63). 48 Find the common denominator of ((-174)/8)/(-3) + -1 and (-429)/(-377)(-102)/340. 580 Let f = -3136115/9303 + 4719/14. What is the common denominator of f and -13/22? 29238 Let x(p) = 2p3 - 29p*2 + 11p - 7. Let s be x(14). What is the lowest common multiple of -770/s + 1 + -1 and 70? 70 Suppose -3128p = -3048p - 1200. What is the lowest common multiple of p and -2 + 1 - (-1 - 60)? 60 Suppose 26j + 11252 = 2048. Let x = 364 + j. Let p(z) = -z + 1. What is the smallest common multiple of p(-5) and x? 30 Find the common denominator of 2 - 0 - (-254)/(-144) and (-303552)/77004 + (-6)/(-2 + 0). 1656 Suppose -584j = -581j + 5z - 164, 0 = -2j + 3z + 8. Let k(t) = -t3 - t2 - t + 16. What is the smallest common multiple of j and k(0)? 112 What is the common denominator of -115/264 and 2 - 1/(-110) - 11/(-33)-9? 1320 Let y = 7 - -33. Suppose 5f - 60 = 3d - 28, d = -f. What is the least common multiple of f and y? 40 Let s = 931 - 905. What is the least common multiple of s and 453? 11778 Let u be (-17328)/30352 + 8/14. Let q = -138448/62601 - u. What is the common denominator of q and 64/3? 33 Let n = 18 + 22. Suppose -7w + 10w = 60. Calculate the lowest common multiple of w and n. 40 Let c be ((-140)/(-25) - 2)5 - 4. Suppose cv - 542 = -122. Calculate the lowest common multiple of 9 and v. 90 Calculate the common denominator of (-2060)/90 - -23 - (-164)/63 and (-2)/(22/(-65)). 14 Let s(o) = 15o*3 - 14o*2 - 13o - 16. Let m(y) = 7y3 - 6y*2 - 7y - 8. Let c(v) = 13m(v) - 6s(v). What is the least common multiple of 7 and c(-6)? 70 Let z = 41735/14 + -2979. Find the common denominator of z and 17/(680/(-16)) + (-2061)/(-315). 14 Let p(h) = -h*3 + 3h - 5. Let u be ((-2)/(-3))/(0 + (-3)/(-9)). Let j be p(u). Let b(y) = y + 18. What is the least common multiple of b(j) and 9? 99 Let p = 1050 - 545. Calculate the common denominator of -2 + (-3 - p/(-30)) and -47/9. 18 Let v = -1469 - -1479. Suppose 175 = 2z + g, 2z + 3z = -2g + 437. Calculate the smallest common multiple of v and z. 870 Let m(h) = -14h + 672. Calculate the lowest common multiple of 972 and m(-6). 6804 Let f = 3411 + -3347. What is the lowest common multiple of 88 and f? 704 Suppose 0t = -4t. Suppose t = -6d + 14 - 2. Calculate the smallest common multiple of 6 and 25 + 9/6d. 84 Let i = 30470 + -975141/32. Let x = -80939/91900 + 65/919. Calculate the common denominator of i and x. 800 Let p be 6/9(-6)/2. Calculate the common denominator of 1(p + 77/27) and 566/(-126) + 1304/27384. 27 Let k(b) = -b3 + 13b*2 - 10b + 20. Let j be k(9). Let p = j + -226. Calculate the least common multiple of p and 20. 140 Let a be 2-1 + (-4 - -1). Let h(n) = -n2 - 7n + 10. Let o be h(1). Calculate the least common multiple of 20 and (a + 6)o/(-6)-24. 40 Let h(i) = 8i2 - 14i + 44. Let s be h(8). Calculate the least common multiple of ((-10)/8)/((-37)/s) and 27. 135 Let o = 0 + -9/2. Suppose -4k + 2z + 200 = 0, 5k + 12z = 7z + 265. Find the common denominator of o and (61/75)/(k/(-153)). 50 Find the common denominator of (-30)/(-375) - 9105/(-6500) and (5/7)/((-12)/119). 156 Suppose 216z - 756 = 394z - 199z. Let j = -16 + 70. Calculate the least common multiple of j and z. 108 Suppose 0 = 11g - 554 - 777. Suppose 0 = -122o + go + 88. What is the smallest common multiple of o and 22? 88 Suppose -200 = -0r + 5r. Let g = -5911 + 5921. Calculate the smallest common multiple of g and (1/(-2))/(2/r). 10 Calculate the common denominator of -63/8 and (-100)/60 - 126163/(-75786). 101048 Let a = 1612 + -1592. What is the smallest common multiple of a and 14? 140 Suppose q + 6 - 12 = 0. Find the common denominator of 2238/(-180) - (-2)/q and 167/60. 60 Let a(w) = -w2 - 11w + 52. Let v be a(-14). What is the common denominator of 465/90(-4)/v + 5 and -67/50? 150 Let c be 81/6(-124)/93. What is the smallest common multiple of (-9)/(-2)8/3 and (-42)/4963/c? 12 Let f = -9855 - -630747/64. Find the common denominator of f and -61/24. 192 Suppose 28 = 5r - 22. Suppose -y = y - r. Suppose -g + 99 - 83 = 2j, -4g + 2j + 24 = 0. Calculate the lowest common multiple of g and y. 40 Let m(b) = -b*2 - 18b - 78. Let t be m(-10). Find the common denominator of 10/41 and 2546/(-18)t/8. 246 Let q(f) = -f3 + f2 + 4. Let x be q(0). Let l = 44831/1850 + -887/37. Find the common denominator of l and x/(-10) + (-94)/50. 50 Let l = 1831/92820 - 3/4420. Calculate the common denominator of -53/161 and l. 2415 What is the common denominator of 15 + -13 - (-4 + 58/(-16)) and 4/110468/(-16)? 440 Let z be -2(-2)/((-6)/(-3)). Suppose 15 = zc - 5. Suppose -8b + 80 = -3b. What is the least common multiple of b and c? 80 What is the common denominator of 7 + 0 + 2(-116380)/32640 and -57/2? 816 Let b(i) = 23i2 + 1. Suppose 31 = -111f + 142f. What is the least common multiple of f and b(-1)? 24 Suppose 0 = -3k - 0k - r + 2028, -5k + 3394 = -3r. Calculate the least common multiple of 6 and k. 4062 Suppose -290002 = -637k + 139336. What is the lowest common multiple of 16 and k? 5392 Let y = -374411/376800 + 16/3925. What is the common denominator of -37/400 and y? 2400 Calculate the least common multiple of 9 and 13226/90 - 12/(-270). 441 Let k(g) = -5g - 46. Let y be k(-9). Let t be y/(21/6) + (-440)/(-70). What is the smallest common multiple of (136/t)/(2 - (-8)/(-6)) and 5? 170 Let x = -1640/9 - -183. Find the common denominator of ((-26)/(-12))/13 + 78/(-228) and x. 171 Let s(q) = 321q3 + q2 - 3q + 1. Let z be s(1). Calculate the common denominator of 53/128 and (1/(z/670))/(-1). 128 Let r(j) be the first derivative of j3/3 + 5j*2/2 - 14j - 17. Let i be r(0). Let p = 19 + i. What is the smallest common multiple of 11 and p? 55 Find the common denominator of (-116)/(-290) + (-4636)/11515 and -43/63. 20727 Let o be 5 - 129/27 - (-3396)/27. Calculate the lowest common multiple of 12 and (2/(-14)-18)/(18/o). 36 Calculate the lowest common multiple of ((-619)/4 + -1)-164 and 6. 153258 Suppose -4n = -d + 61 - 192, -n = -4d - 14. What is the lowest common multiple of n/(-204) + (-194)/(-12) and 62? 496 Let y be 4 + (-21)/((-6)/(-2)). Let s = -752 - -753. Calculate the lowest common multiple of s and ((-219)/y)/(-2 + 3). 73 Let u = 56227/12 + -4691. Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
a - 6a. Suppose 3p - 5p - f = 6414, 4p = 2f - 12836. What are the prime factors of (-4)/a + p/(-24)? 7, 19 Let w be (-2)/5 + 6(-664)/(-60). Let p be 16/40 + w/10. Let x = 75 + p. What are the prime factors of x? 2, 41 Suppose -9w + 14w + 20 = 5f, 3w = -4f + 2. What are the prime factors of (-347)/(-2) - w4/16? 2, 3, 29 Let p = 1764 + -806. Suppose 2z - c = 669 + p, 5z - 4069 = 4c. What are the prime factors of z? 3, 271 Suppose 5d + 2a = -2a + 2924, -3d - 3a = -1755. Suppose y + z - 138 - d = 0, 2y - 1444 = z. What are the prime factors of y? 2, 19 Suppose -4555b = -4554b - 3866. What are the prime factors of b? 2, 1933 Suppose -10m = -2m - 816. Suppose -5b + m = -2l, -6b = -b + 5l - 95. What are the prime factors of ((-48)/b)/(-6)235? 2, 47 Suppose -h = 2x - 219, 0h - 432 = -2h + 2x. Suppose 17113r - 17090r + 450 = -631. Let t = r + h. What are the prime factors of t? 2, 5, 17 Let v = -1 - -4. Suppose -144 = -vb + 2p + 349, 0 = 2b - 2p - 328. What are the prime factors of b? 3, 5, 11 Suppose 0 = 2c - 4l - 19154, 114c + 28725 = 117c - 3l. What are the prime factors of c? 3, 3191 Suppose 2438912 - 154067 = 189u - 217137. What are the prime factors of u? 2, 6619 Let s be ((-20)/(-8) - 3)(1 - 1). Suppose s = -13i + 9350 - 2174. What are the prime factors of i? 2, 3, 23 Let l = 2025 + 2402. What are the prime factors of l? 19, 233 Let j(f) be the first derivative of 3f*2 + 6f - 19. Let m(a) = -6a - 7. Let q(b) = 4j(b) + 5m(b). List the prime factors of q(-4). 13 Suppose 4s - 2o = 217690, -o - 430947 + 49987 = -7s. What are the prime factors of s? 3, 6047 Suppose 3520w + 3463152 = 3586w. List the prime factors of w. 2, 7, 937 Suppose 15n - 11n = 1008. Suppose -3d = d - n. Suppose 5r = -2u + 185 + d, 0 = r + 2u - 56. List the prime factors of r. 2, 3 Let w(h) = -h*3 - 9h*2 + 19h + 42. Let b be w(-12). Let f = b - -267. What are the prime factors of f? 3, 19 Let s = 19 - 13. Suppose -5i + 4543 = si. Suppose -h = 6h - i. List the prime factors of h. 59 Let h = 1 - -35. List the prime factors of (-6592)/(-36) + (-4)/h. 3, 61 Let v(q) be the first derivative of 3q*4/2 - 11q*3/3 + 4q*2 - 8q + 88. List the prime factors of v(4). 2, 29 Let m = -219 - -223. What are the prime factors of m - -375 - 9/(45/(-20))? 383 Suppose 52028 = 7d - 28234. Suppose -d = 104s - 117s. What are the prime factors of s? 2, 3, 7 Let w(d) = 2d + 5. Let f be w(-9). Let k = 1007 - f. List the prime factors of k. 2, 3, 5, 17 Let h(f) be the first derivative of -f*4/4 + 13f*2 - 3f - 182. List the prime factors of h(-11). 2, 521 Suppose 0c = -4o + c - 5, 4o + 11 = -c. List the prime factors of (-31)/o6 + 3. 2, 3 Suppose 63n - 113552 = 61n - 4b, -2b = 2. List the prime factors of n. 2, 3, 9463 Let u = -1 - -3. Let z(a) = 71a + 427. Let h be z(-6). List the prime factors of (h + -8 - -5)(-77)/u. 7, 11 Let p(d) = -10d - 4. Let r(y) = -81y - 32. Let c(k) = 51p(k) - 6r(k). List the prime factors of c(-8). 2, 3, 5 Let o be (-6)/(-24) + (-15230)/(-8). Let m = o - 1344. What are the prime factors of m? 2, 5, 7 Suppose 0 = 40a - 42a + 6. Suppose -5j + 424 = 3g, -2j = -7j + ag + 436. Suppose -t = -2b + j, 174 = -b + 5b - 3t. List the prime factors of b. 2, 3, 7 Let a(r) = 49r2 + 13r + 466. List the prime factors of a(18). 2, 7, 37 Suppose -2b + 8 = h, -5b - 4 = 2h - 24. Let k = 600 + -595. Suppose 0v + 2v + 75 = 5s, ks - bv = 85. What are the prime factors of s? 13 Suppose -c + 2133 - 2125 = 0. Let i(z) = 3z3 - 10z*2 + 9z - 62. List the prime factors of i(c). 2, 3, 151 Let r(q) = 40q3 + q2 + 3q + 2. Let h be r(-1). Let s = 46 + h. Suppose -5z = i - 54 + s, 3i = -3z + 96. List the prime factors of i. 2, 7 Suppose 8f - 167131 = 6f - 3k, 0 = 3f + k - 250721. What are the prime factors of f? 2, 31, 337 Let z be 400/24 - (0 + (-2)/6). Suppose -2w - 2n = 4, 4w + 5n - z = 6n. Suppose wu = 2l + 2l - 423, -3u = -9. What are the prime factors of l? 2, 3 Let u(y) = -y*2 - 22y + 2. Suppose -7o - 198 = 2o. Let j be u(o). Suppose 1 = ja - 9, -258 = -g - 2a. List the prime factors of g. 2, 31 Suppose g = 3k + 688, -2g = 3k - 771 - 614. Let z = g - 431. Suppose 0 = -5x + 980 + z. What are the prime factors of x? 2, 31 Let j = -31 - -35. Suppose -l = 4z + 5, 0l + j = z + 2l. What are the prime factors of (z - -3)/(7/679)? 97 Let h(w) = -w3 + 6w*2 + 9w + 8. Let b be h(6). Suppose l + 2v = -0l + b, l - 72 = -4v. What are the prime factors of l? 2, 13 List the prime factors of (396-58)/(-6) - (-18)/6. 3, 1277 Let w be (-12)/714/(-4). Suppose 25 = -wo + 7. List the prime factors of (-236)/o + 5/15. 79 Let t(p) = 9p2 - 3p + 3. Let j(d) = 19d2 - 6d + 7. Let g(f) = -4j(f) + 9t(f). Let a = -1019 + 1016. What are the prime factors of g(a)? 53 Suppose -5t - x - 118 = 0, -5x + 48 + 34 = -3t. Let z be (t/(-9))/((-4)/(-6)). What are the prime factors of (220/8 - 0)(2 + z)? 3, 5, 11 Let r = 1951 + -862. Suppose 0 = 9a - 0a - r. List the prime factors of a. 11 Let r = 33568 + -23374. What are the prime factors of r? 2, 3, 1699 Let o be 9/1(43 - 2). Let l(u) = -2u*3 - 92u*2 + u - 142. Let w be l(-46). Let h = o + w. List the prime factors of h. 181 Suppose -21v = 19138 - 199087. List the prime factors of v. 11, 19, 41 Let a be (131512/30)/1. Let s = 927 - a. List the prime factors of s. 401 Let q = 53369 - 28416. List the prime factors of q. 24953 List the prime factors of (32/(-24))/(4/12) - 20726/(-2). 3, 1151 Let s(x) = x + 6. Let a be s(-3). Let l be (0/3)/((-6)/a). Suppose 4t - w = 565, 5t + lw = -2w + 716. List the prime factors of t. 2, 71 Suppose 0 = 9d - 50 + 95. Let w(a) = -2a3 + 10a*2 + 11a - 3. List the prime factors of w(d). 2, 13, 17 Suppose -15z + 112646 - 16346 = 0. What are the prime factors of z? 2, 3, 5, 107 Let u = 272 + 1348. What are the prime factors of u? 2, 3, 5 Let i(d) = d2 - 24d. Let z be i(0). Let g(w) = 2w2 + 62 + 0w*2 - 3w*2. What are the prime factors of g(z)? 2, 31 Let a = -245 + 265. Let x(f) = 23f - 166. List the prime factors of x(a). 2, 3, 7 Let f = 98 + -77. Suppose 0 = -2u + 259 - f. Suppose 0 = 4m - 835 + u. What are the prime factors of m? 179 Suppose -i - 6i = 0. Let n(x) = 0x + 2x + 12 - 2x*2 + 3x*2. What are the prime factors of n(i)? 2, 3 Suppose h + 34 = 5n, 3n = 5n + h - 15. List the prime factors of 1/(-3)-2637 + n. 2, 443 Suppose -5n = 5a - 1150, -5n = -4a + 637 + 301. Let q = 482 - a. Let z = q + -141. List the prime factors of z. 109 Let v(b) be the first derivative of -17b + 11/2b2 + 8. What are the prime factors of v(8)? 71 Suppose 0 = -4w + v + 35, -4v - 30 = -3w - 7v. Suppose 15f - 12576 = -wf. What are the prime factors of f? 2, 131 Let c be 2/(-6)1205(7 + -1). What are the prime factors of (c/5 - 2)(-1)/2? 2, 11 Let g = -41 - -63. Let f(m) = 53m - 92. What are the prime factors of f(g)? 2, 3, 179 Let i(p) = -318p - 664. What are the prime factors of i(-14)? 2, 947 Let r = 6273 + 5697. List the prime factors of r. 2, 3, 5, 7, 19 What are the prime factors of (1 + (-5845)/14)/((-1)/38)? 7, 17, 19 Let k(c) = c*3 - 14c*2 + 46c + 65. List the prime factors of k(19). 2, 7 Suppose -37i + 1013566 = -189972 - 742329. List the prime factors of i. 7, 11, 683 Suppose 184 = -3r + 7r. Suppose -r = -4i - 30. Suppose -x + ix - 4a - 727 = 0, -3x + 5a = -722. What are the prime factors of x? 3, 83 Let t(a) = -3728a3 + 6a*2 + 8a + 2. Let d be t(-1). Suppose -5x = 4o - 3597, -d = -4o + x - 137. What are the prime factors of o? 2, 449 Let m = -3548 - -7312. What are the prime factors of m? 2, 941 Suppose -54t = -53t - 4. Suppose 0 = -tf + 205 + 7. List the prime factors of f. 53 Let f(h) = 34h2 + 195h - 42. What are the prime factors of f(-10)? 2, 11 What are the prime factors of (-77270)/(-16) + (-138)/368? 11, 439 Suppose -919201 + 6837818 + 12713111 = 216z. List the prime factors of z. 2, 17, 43, 59 Let t = -636 + 595. Let r(n) = -5n + 85. List the prime factors of r(t). 2, 5, 29 Suppose 245140 = 19q + 66q. List the prime factors of q. 2, 7, 103 Let i be (-4)/(-36) - (51/(-27) - 1). Suppose -3a + 4d	{ "pile_set_name": "DM Mathematics" }
Let a be (4/6)/((-2)/(-15)). Let t = o + a. Let z(w) = w*2 + 4w - 3. What is z(t)? 9 Let u = 6 + 2. Suppose -s - 3 = -u. Let i(z) = -z - 9. Let n(l) = l + 8. Let o(w) = sn(w) + 4i(w). Calculate o(-5). -1 Let r(f) = -16f + 3. Let z(v) = -8v + 1. Let q = 4 + -6. Let i(w) = qr(w) + 5z(w). What is i(-1)? 7 Let f(h) be the third derivative of -h*2 - 5/24h*4 + 0h + 1/15h5 + 1/120h6 + h3 + 0. Give f(-5). 6 Suppose 8 = q - 3. Let u = q + -8. Suppose -2b - 14 = 5s, 0s + ub + 16 = -5s. Let l(z) = -z2 - z. Give l(s). -2 Let g(y) be the third derivative of y4/24 + y3/2 - 9y*2. Determine g(-5). -2 Let r be 0/10 + 1 + -2. Let c(x) = -10x2 + x + 1. What is c(r)? -10 Let t be 2 + (-36)/21 - (-46)/(-14). Let k(r) = -r2 - 8r - 4. What is k(t)? 11 Let k(m) be the third derivative of -m6/120 + m5/15 + 7m*4/24 - 7m3/6 - m2. Suppose -2l + 3z = 2z - 6, -2l - 3z + 22 = 0. Calculate k(l). 3 Let l(i) = 0 - i - i3 - 9i*2 + 3i*2 + 9i2 - 2. What is l(3)? -5 Let s(t) = t3 - t + 2. Let m be s(-2). Let p(v) be the first derivative of -4v - 5/3v*3 - 5/2v*2 - 1/4v*4 - 11. What is p(m)? 0 Let o(k) be the second derivative of 7k3/3 + k2/2 - 16k. Calculate o(-1). -13 Let f(z) = z3 + 7z*2 + 6z + 2. Suppose 2h - x + 38 = x, -x - 19 = h. Let k = h + 13. What is f(k)? 2 Let u = -19 + 12. Let s = u - -3. Let l(i) = i + 4. Let p be l(s). Let h(a) = -a2 + a + 1. What is h(p)? 1 Let m(f) = f3 - 5f*2 - f - 1. Suppose -4i + 0q = 4q + 12, q = 4i + 7. Let p = i - -2. Let z be (10/2)/(p - -1). What is m(z)? -6 Suppose -2n + 5 = -1. Suppose 0 = c - n + 2. Let s(p) = -9p + 1. Give s(c). -8 Let y(q) = q + 3. Let l(a) = 6a + 26. Let k be l(-5). Calculate y(k). -1 Let f(n) = -n + 1. Let h(o) = o*2 - 3o + 3. Let l(j) = -5f(j) + h(j). Let s = -37 - -35. Give l(s). -2 Let g(y) be the third derivative of -y4/24 + 7y*3/6 - 4y*2. Calculate g(7). 0 Let x(z) = -4z*2 - 6z + 13. Let f(k) = 2k2 + 3k - 7. Let d(o) = -11f(o) - 6x(o). Determine d(-3). 8 Let z(g) = 5g. Suppose -5f - 34 = 5k + 11, -5f + 2k = 38. Suppose 0p = -4m + 5p + 37, -4p = 20. Let w be f/(-4) + (0 - m). What is z(w)? -5 Let g(x) = x2 - 6x - 8. Suppose -5a = 15, l = -a - 2a - 1. Let k be (-4 - -2) + (l - 0). What is g(k)? -8 Let p be 2(0 + (0 - 1)). Let j be (-4)/8 - 21/p. Suppose -5t + 2n + j = -0n, n = -2t + 4. Let x(b) = 2b*3 - 3b2 + b - 1. Calculate x(t). 5 Let d(c) be the second derivative of -c7/840 + c6/72 - c5/20 + c4/6 - c3/3 + c. Let n(s) be the second derivative of d(s). What is n(4)? -4 Let t(u) = -3u + 1. Suppose 0 = 8z - 4z. Suppose z = -5k + k + 8. Determine t(k). -5 Let g(p) = p*3 + 5p*2 + 3p - 2. Let t(n) = n*3 - 8n*2 + 8n - 7. Let c be t(7). Let a = 21 + -9. Suppose 4f + a = -c. Calculate g(f). 7 Let k(m) = 4m + 2. Let b be 0 + (0 - 1 - 4). Let t be 28/10 + (-1)/b. Suppose -4 = -tp - 13. Calculate k(p). -10 Let x(h) = 3h + 24. Let u(w) = w + 7. Suppose l - 6l = -90. Let q(d) = lu(d) - 5x(d). Suppose -20 = 4n - 4f, -6 + 0 = n - 2f. Determine q(n). -6 Let p = -5 - -4. Let i(t) = 5t2 + 5t + 5. Let j(d) = 2d2 + 3d + 3. Let z = 11 - 8. Let b(f) = zi(f) - 5j(f). Give b(p). 5 Let x(g) = -9g - 1. Let s be ((-36)/(-54))/(2 - 10/6). Determine x(s). -19 Let q(c) be the second derivative of c5/20 - c4/3 - c3/6 - 5c*2/2 + 10c. Suppose -2 + 14 = 3o. What is q(o)? -9 Let m(n) = 3n - 4. Let o(k) = -6k + 8. Let a(b) = -5m(b) - 2o(b). What is a(3)? -5 Let i be (1/2)/(4/(-16)). Let s be (i - -1) + (-8)/2. Let k = s - -10. Let x(q) = -q2 + 3q + 3. Give x(k). -7 Let h be (-216)/99 + 2/11. Let b(g) = -g*3 - 2g*2 - 3g - 1. Calculate b(h). 5 Let j(a) = a2 - 9. Let l(m) = -m3 + 4m2 - m + 4. Let k be l(4). Give j(k). -9 Let n = 137 + -131. Let y(s) = -6s + 6 + s*2 + 0s*2 + 0s*2. Calculate y(n). 6 Let v(b) = b + 1. Let i be v(0). Let h(c) = -4c3 - c2 + 1. Let m be h(i). Let t(u) = u*2 + 4u - 2. Give t(m). -2 Let s(n) = 2n2 + 3n - 4. Let c be ((-1)/(-3))/((-2)/(-78)). Let m be c/(-5) + (-4)/10. Determine s(m). 5 Let n(g) = g*3 - 4g*3 + 3g*3 + 2g2 + 1 - g3. Determine n(2). 1 Let h(c) = c*2 + 4c. Let k(n) = n*3 - 7n*2 - 8n + 3. Let a be k(8). Let j be (0 + -1)(-4 + a). Let o = -4 - j. What is h(o)? 5 Let i(o) = -o + 5. Suppose 64 = -4p - 12p. Give i(p). 9 Let b = -9 + 11. Suppose -b = m + m. Let q(x) = x3 + x2 + x. Calculate q(m). -1 Let j = 3 - 2. Let c(u) be the first derivative of -3u3 - u2/2 - 71. What is c(j)? -10 Let i(t) = 0 + 39t2 - 3t - 1 - 41t2. Give i(-2). -3 Suppose g = 4r - 3, -4 = -2r - 0g - 2g. Let k(a) = -1 + r - a + 2 + a2. Calculate k(-2). 8 Suppose -m = 2m + 3h + 6, 0 = -2m + 4h + 2. Let n(p) = -11p*2. Determine n(m). -11 Let m(g) = 5g + 8. Let k(i) = -i - 1. Let h(f) = -4k(f) - m(f). Give h(3). -7 Let b(w) be the second derivative of w5/20 + w4/4 - w3/3 + 3w*2/2 - 11w. Give b(-3). 9 Suppose 6 = 4g - 6. Let t(c) be the first derivative of -1 - gc - 3/2c2 + 1/3c3. Give t(3). -3 Let g(u) be the third derivative of -u4/8 - u*3/2 + 2u2. Let r(n) = -n2 - 14n - 26. Let a be r(-12). Determine g(a). 3 Let f(x) = -6x*2 - x - 1. Let c = 1 + 1. Let g(a) = 2a + a*3 - 8a*2 - 6a*2 - 1 + 0a*2 + 11a*2. Let h be g(c). Calculate f(h). -6 Let t(k) = -13k + 42k - 14k - 16k - 2. Calculate t(5). -7 Let o(w) be the first derivative of 1/2w*2 - 9w - 2. Suppose 3x + 2x - 5 = 4v, 3v + 3 = 3x. What is o(v)? -9 Suppose 2w = -2w - 40. Let j be 0 + w + -5 + 5. Let i be 24/(-15) + (-6)/j. Let q(n) = 8n3 + n2 - n - 1. What is q(i)? -7 Let t(m) = -35m3 - 14m*2 + 14m - 3. Let z(d) = 5d2 + 1 - 6d*3 + 9d*3 - 5d + 9d3. Let b(c) = -6t(c) - 17z(c). Give b(-1). -7 Suppose -4l - 18 = 2v, -2v + 1 = -3l - 16. Let y(q) = v - 20q + 8q + 11q. Determine y(1). 0 Let a(r) = -3r3 + 9r*2 + 3r - 9. Let g(o) = 7o3 - 19o*2 - 6o + 19. Let k(m) = -5a(m) - 2g(m). What is k(7)? -14 Let g(n) = -4n + 1. Let p be g(-1). Suppose -5z - 14 = pr - 4, 2z = -5r + 5. Let i(b) = rb*3 - 2 + 4b3 + b3 + 3 - 2b. Determine i(1). 7 Let y(o) be the first derivative of o3/3 - 2o*2 + 3o - 3. Calculate y(4). 3 Let b(j) = -j2 - j + 1. Let x(r) = r3 - r + 8. Let i(a) = a - 9. Let w be i(5). Let c(f) = wb(f) + x(f). Suppose 2m + 1 = -7. Determine c(m). -8 Let w(s) = s - 3. Let l(m) = m - 4. Let f be l(10). Calculate w(f). 3 Let c(r) = 21r2 + r + 1. Let a be 3(-49)/168 + (-1)/8. Determine c(a). 21 Let p(r) = -r + 1. Let x(n) be the second derivative of n4/12 - n3/6 + 4n2 - n. Let s(z) = 5p(z) - x(z). Determine s(-3). 0 Let y(a) = -2a3 + 4a*2 - 2a - 2. Let l(f) = -f - 4. Let z be l(-6). Calculate y(z). -6 Let r(g) = 3 - 6g - 1 - 2g - 1. Give r(1). -7 Let n(x) = x*3 - 8x*2 + x - 9. Let s be n(8). Let g be (-2 + 3)(1 - s). Let f(i) = -g - 1 - 3 + i. Determine f(6). 0 Let r(m) = m*2 + m - 8. Suppose 0 = -3s - 0s - 9, -6 = -3u + s. Let a be (-2)/u(1 + -2). Let y be 6/(-9) + a/3. What is r(y)? -8 Let r(f) = 14f*3 + 2f*2 + 2f + 1. Let h be 2/6 - (4 + (-40)/15). Give r(h). -13 Let q = -12 + 18. Let v be (-17)/(-3) - q/(-18). Let d = v - 3. Let u(w) = -w*2 + 2w + 1. What is u(d)? -2 Let a = 11 + -16. Let u(z) = -4z - 7. Calculate u(a). 13 Suppose -3 = -2w + 5s - 4s, w - 3s + 11 = 0. Let i(u) be the second derivative of u3/6 - 4u. What is i(w)? 4 Suppose -3d + 2d - 2w = -7, -3w = -d - 8. Suppose -2m = m - 6, -2m - 8 = -3t. Let x(l) = -2l + tl - l. Calculate x(d). 1 Let n = -2719/20 - -136. Let a(s) be the second derivative of -3s + 1/2s2 + 0 - 1/3s*3 + ns*5 + 1/4s*4. Give a(-4). -7 Let p be 66/8 + (78/(-24) - -3). Let s(r) = r - 6. Calculate s(p). 2 Suppose 3z + g + 19 = 0, -4z = -6z + 4g - 8. Let x(i) = -i2 - i + 7. What is x(z)? -23 Let y(x) = 2x3 - x2 - 3x + 2. Let k = 2 - 4. Let f be k/33 + 4. Give y(f). 8 Let o(d) = -d2 + d. Let a(w) be the third derivative of -w4/12 - w3/3 + w2. Let q be a(-2). Let y = 0 + q. Determine o(y). -2 Let h(t) be the third derivative of 0 - 1/6t3 + 3t*2 + 1/12t*4 + 1/60t*5 + 0t. Calculate h(2). 7 Let s be	{ "pile_set_name": "DM Mathematics" }
(-3) assuming l is positive. l*(-44/3) Simplify (((ff/(f/f*(1/3))f)/f)(8/13))(-41) assuming f is positive. f(-1312/39) Simplify ((v/v(-5))/(v/v*5v))25 assuming v is positive. v225 Simplify (x(3/13))(16/5) assuming x is positive. x(48/65) Simplify (p(-2/11))(8/3) assuming p is positive. p(-16/33) Simplify pp(-1/21)ppp(-22) assuming p is positive. p(-400/21) Simplify (qq(-1/6)q)/(q*2/qq)q(-2)/q(5/3) assuming q is positive. q(-23/6) Simplify (z/(z/(zz*25))z)/((z*(-17/6)z)/z) assuming z is positive. z(179/6) Simplify m(-1/14)(m(m/m(1/15))/m)/m assuming m is positive. m(-29/210) Simplify ((gg(-2/5))/g)(2/11) assuming g is positive. g(-4/55) Simplify (q1)(-12)(q/q(-1/4))/(q0/q) assuming q is positive. q(-39/4) Simplify j(4/9)jj*7(j(-1))(-4/5) assuming j is positive. j(416/45) Simplify o/o21o(6/11) assuming o is positive. o(-214/11) Simplify (k(-8))49 assuming k is positive. k(-392) Simplify (t/(t(-31)t)t)/(tt*(-28)tt) assuming t is positive. t57 Simplify (k/k(-2)kk(kk(3/11))/kk)(-50) assuming k is positive. k(-3450/11) Simplify j*(3/13)j/(j/j(-1/11)) assuming j is positive. j(20/143) Simplify (h*(-1/3)h/h2)/(((((h/h(-3/5))/h)/h)/h)/(hh/(h/h(-3/7)))) assuming h is positive. h(67/105) Simplify ((lll2ll)(-1/21))(6/19) assuming l is positive. l(-12/133) Simplify (y(((yy(-1/12))/y)/y)/y)(-14) assuming y is positive. y(91/6) Simplify (x18x)(5/3) assuming x is positive. x(95/3) Simplify (g*1g)(-2/125)/(g5/ggg4) assuming g is positive. g(-1129/125) Simplify (t(4/7))(-3/20) assuming t is positive. t(-3/35) Simplify q(-4/5)/(qqq27) assuming q is positive. q(-149/5) Simplify (aa1aa)/a(a/((a/(a*(7/4)a))/a))/a(aa(2/25)/a)/a(3/4) assuming a is positive. a*(127/25) Simplify (((ff/(f/((f/(fff/f*(-4)))/ff)))/fff)18)3 assuming f is positive. f*(-216) Simplify gg*(-6)(ggg(g/(gg*(-4/21)g)g)/gg)/gg assuming g is positive. g(-38/21) Simplify ((o1)12)8 assuming o is positive. o96 Simplify ((c/(c/(c/(cc*(2/3)/c))))/cc)*(-21)/(cccc/(c*(-1/3)/c)cc)(-4/19) assuming c is positive. c(-311/57) Simplify ((l/(l/l(2/5)))/(l(2/9)/l))(11/2) assuming l is positive. l(583/90) Simplify (d(-1/5)((dd(-3/4))/d)/d)/((d1/d)/d4) assuming d is positive. d(41/20) Simplify r(r/(r/(r*(2/45)/r)))/rr/(rr(-4/9))r assuming r is positive. r(22/45) Simplify (u(-2)uu)/uu(-2/55)u assuming u is positive. u*(-2/55) Simplify f/(f/(ff*(-6)/f)f)ff(2/15) assuming f is positive. f(-88/15) Simplify (w/w*(-1/13)w/(w/((w/w(-3/5))/w)))(3/5) assuming w is positive. w(327/325) Simplify (h(2/5)/h)(-39)/(h(-7/3)h/h(-9/2)h) assuming h is positive. h(577/30) Simplify (m(-2/15)mm*(-1/7)m)/(((mm/(m/((mm(-3/4)/m)/m)))/m)/m(2/13)) assuming m is positive. m(19807/5460) Simplify ((y/(y(-2)y))/y(-1/2))/(y(-2))(-44) assuming y is positive. y(-171/2) Simplify (r/r(-2/37))/((r0r)/r) assuming r is positive. r*(39/37) Simplify ((i/((ii*20)/ii))/i)/i(-29) assuming i is positive. i8 Simplify dddd(3/10)d/(d/(d/d(-20))) assuming d is positive. d(243/10) Simplify (x/x*(2/7)x)/(xx/((x(x/((x*(-21)/x)/x)x)/xxx)/x)xxx) assuming x is positive. x(159/7) Simplify (q/((qq*(-2/33))/q)q14)(-2/11) assuming q is positive. q(-994/363) Simplify ((t/(t(-2/7)t)t)/(t*(-2/39)tt))36 assuming t is positive. t(-2172/91) Simplify pp*0/ppp/((p(2/41)/p)/p) assuming p is positive. p(162/41) Simplify (c(-1/26)c)43 assuming c is positive. c(1075/26) Simplify b(-3/5)/b(7/3)(b(1/4))(-6) assuming b is positive. b(-133/30) Simplify (x(2/9)/(((x/(x/(x(x/x*(-9))/x))x)/x)/x))0 assuming x is positive. 1 Simplify i(1/8)i/(i(ii(-2/31))/ii) assuming i is positive. i*(-201/248) Simplify ((u/(uu(2/9)))(1/14))(-18/11) assuming u is positive. u(2/77) Simplify i*6(ii/i(-11))/ii assuming i is positive. i19 Simplify (o/(o/o(-3/11))oo*9o)6 assuming o is positive. o(708/11) Simplify (mmm/((m*24m)/m)mmm)(2/79) assuming m is positive. m(-36/79) Simplify (o/(oo*(-19)/o)o/o(1/13))4 assuming o is positive. o(1088/13) Simplify (u1u(-6/5)/u)/((uu*(-5/2)u)/(u/(uu(4/9)u))) assuming u is positive. u*(-193/90) Simplify pp*22pp/(p/p(-15)) assuming p is positive. p9 Simplify n(-3/7)n*(2/23)n*(1/5)nnn*(3/7)n assuming n is positive. n*(378/115) Simplify ((r/((rr/(r/(r*10/r)r))/r))/(r*(2/7)r))/(r/r1)(2/119) assuming r is positive. r(-58/7) Simplify u(-1)/(u/(uu(-8))u) assuming u is positive. u(-10) Simplify i/i(-5/7)(ii/(i*(-11)ii))/i assuming i is positive. i(82/7) Simplify ((tt/((t(t2tttt)/t)/t))/(t/(tt*0)t))(-2/11) assuming t is positive. t(8/11) Simplify (v/(v(v/v0v)/v)v)36/(vv/v1)33 assuming v is positive. v*(-33) Simplify ((k/((kk*(-17)k)/kk))/kk)(-21) assuming k is positive. k(-336) Simplify (t/t(1/4))(-27)((tt/(t*(2/7)/ttt))/tt)(-1/30) assuming t is positive. t(-1703/84) Simplify (b*1/bb)/b(-4/7) assuming b is positive. b(11/7) Simplify (c(-1/3)/c)/c15 assuming c is positive. c(-49/3) Simplify v(-4)v13v assuming v is positive. v*10 Simplify uu*(1/12)u(-1/24) assuming u is positive. u(25/24) Simplify s/((ss/(s/(s/(s/(sss8))))s)/s)s(9/4)/ss assuming s is positive. s*(-31/4) Simplify ff*(-2/15)/ff(-1/54) assuming f is positive. f(-41/270) Simplify (y*(-1/5)y1)(-14) assuming y is positive. y*(-56/5) Simplify (hh*(-4/5)h)/(h*(-31/2)h) assuming h is positive. h(157/10) Simplify (r(1/2)/r)*(2/21)/((r(rr7)/r)/r(4/5)) assuming r is positive. r(-761/105) Simplify t(-2/23)t(2/17) assuming t is positive. t(12/391) Simplify (r/(r/(r*(-1/3)/r))r)(2/17)/((r/((r(-1/7)/r)/rr))/(r(r/(r/(r*(-4)/rr)r))/r)) assuming r is positive. r(-2564/357) Simplify g/(gg*14)gg(g/g*(-3/11))/gg assuming g is positive. g*(-118/11) Simplify ((s/(sss1s))/(ss/((s/(s/s(-1/4)))/s)s))/(s*(-3/7)(s/(s((ss/s*(-1))/s)/s)s)/s) assuming s is positive. s(-163/28) Simplify m(-2/5)/(m*7/mm) assuming m is positive. m(-37/5) Simplify (v2/(vv/(v(-2/19)/v)))(1/37) assuming v is positive. v(-21/703) Simplify hhh/h(2/21)h*6/h(hh(2/3))(-29) assuming h is positive. h(-283/7) Simplify (mm(1/8))/m(1/4) assuming m is positive. m(7/8) Simplify (p/p(-6)ppp)/(ppp(-6)pp)(p1)(6/5) assuming p is positive. p(66/5) Simplify (t/t(2/9)t(-2/5))/(t(-1/2)/((t/(t(-1/8)t)t)/t)) assuming t is positive. t(361/360) Simplify (q/(qq*4)((qq(qqq*7/qq)/qqq)/q)/q)/(q*(3/5)qqq(-3/10)) assuming q is positive. q(37/10) Simplify h(-1/5)/((h(2/7)h)/h)(h*(-1/2)h)6 assuming h is positive. h(88/35) Simplify ((a/a(-10))/(a(2/15)a))/(a(-2/31)a(-2/17)) assuming a is positive. a(79436/7905) Simplify ((p/(p*(-2)p))/p)12 assuming p is positive. p12 Simplify (i/(ii6)iii/i*(-6/5)i)/(((ii(3/4)/i)/i)/(i/(i/(i/(ii/(i/i*(1/3))))ii))) assuming i is positive. i(-173/60) Simplify l(6/23)ll(3/16) assuming l is positive. l(533/368) Simplify (ff(-1/2))/f(1/3)f/(f/(f(-1/6)f))f/(f2ff)f assuming f is positive. 1/f Simplify (q(-6)/q7)(-36) assuming q is positive. q468 Simplify (oo(-1/5)oo)/o(-9/4) assuming o is positive. o(101/20) Simplify ((ll(2/3))/(l/l6))/(l/(l/((l/(l*2/l))/l))(lll*(1/4)l)/l) assuming l is positive. l(65/12) Simplify l(10/7)l7 assuming l is positive. l(59/7) Simplify (m(-1/3))(2/79)((mmm*(-2/7)mm)/m)/(m/(((mm*4)/mmmm)/m)) assuming m is positive. m*(12784/1659) Simplify a/(aa*(-4))aa(1/2)/aaa assuming a is positive. a(13/2) Simplify b/(bbb/b19)b22 assuming b is positive. b39 Simplify w(-36)/(w(-2/11)/w) assuming w is positive. w(-383/11) Simplify (g(1/4))27 assuming g is positive. g(27/4) Simplify (a*(-8)a(-2/13))(-2/71) assu	{ "pile_set_name": "DM Mathematics" }
9.6 Multiply 0.0681 and 0.13. 0.008853 Calculate 1-4.2. -4.2 5 times 12.1 60.5 What is -0.093 times -0.15? 0.01395 Calculate 5432. 1086 What is 3.17 times -0.5? -1.585 Calculate 14.7-3. -44.1 Calculate 4-49. -196 What is -0.006 times -0.5? 0.003 -0.6258-5 3.129 0.1 times 6.4 0.64 Product of -0.096 and 4. -0.384 Product of 0.021 and -5. -0.105 0.6 times -2 -1.2 -4.510.7 -48.15 2.5 * -5 -12.5 Product of -178 and -1. 178 5 * 0.56 2.8 -1-436 436 38 -28.7 -1090.6 Product of 767 and 0.4. 306.8 Work out -0.5 * -4.6. 2.3 Calculate 0.3112. 0.622 What is 18.89 times -2? -37.78 163 0.24 39.12 11 * -2.55 -28.05 -11 times -16 176 10 times -0.1 -1 Multiply -6 and -0.39. 2.34 Calculate -12.21.4. -17.08 3-0.183 -0.549 What is -7822 times 5? -39110 Work out 4 * -108. -432 0.2 * 141.2 28.24 2-82 -164 Product of 38.12 and -5. -190.6 37 -0.01 -0.37 Product of 0.093 and 0.3. 0.0279 Product of 0.011 and 18. 0.198 What is the product of 28 and 3? 84 Multiply 0.5 and -0.5. -0.25 What is the product of -537 and 1? -537 -2415 * -0.1 241.5 0.4 times 0.3 0.12 Calculate 63.6-7. -445.2 Work out -3 0.6. -1.8 -2-0.1699 0.3398 Work out 188 5. 940 1 times 6.52 6.52 69-0.021 -1.449 0.244 times -2 -0.488 What is 0.0038 times 1.5? 0.0057 Product of -133 and -3.2. 425.6 Work out -11409 5. -57045 20 * -0.043 -0.86 0.5 times 1346 673 -9 * 0.36 -3.24 -0.0407 times 1.6 -0.06512 Work out 3 * 40. 120 0.21 times -1.27 -0.2667 Multiply 0.07 and -1364. -95.48 What is -3755 times 4? -15020 Product of 6.81 and 0.21. 1.4301 Work out 18 * -0.06. -1.08 -1.49-14 20.86 -835 times 2 -1670 Calculate 6090.3. 182.7 Calculate -3.9153. -207.23 -1.3 -3 3.9 -2 * 17.1 -34.2 -1 * 1498 -1498 Multiply 1270 and 0.1. 127 What is the product of 2.5 and 0.08? 0.2 Multiply -0.09 and -266. 23.94 4 * 3.96 15.84 What is 0.4 times -0.013? -0.0052 What is the product of 1 and 637? 637 Product of -1590 and 0.1. -159 -0.659 * -0.07 0.04613 Calculate -11423-0.2. 2284.6 -2 4.5 -9 1 times 0.46 0.46 What is the product of -47 and 0.12? -5.64 Calculate -65-43. 2795 -3.11-1 3.11 0.35 times -0.11 -0.0385 Work out 126 * 0.05. 6.3 Multiply -5 and 0.216. -1.08 What is the product of 537 and 0.4? 214.8 What is -0.3 times -0.055? 0.0165 Product of 0 and -3492. 0 2.9 times -10 -29 Calculate -6860. 0 0.3 times -388 -116.4 Multiply 0.3 and 0.43. 0.129 What is the product of -45 and -3? 135 What is the product of 84 and 268? 22512 Calculate 487. 348 Calculate -4-11. 44 -0.42 times -0.07 0.0294 What is 10069 times 0.4? 4027.6 0.379 0 0 0.8 times 0.485 0.388 Product of 2 and -23. -46 Multiply -10 and -0.1444. 1.444 Calculate -0.120.4. -0.048 Work out 632 0. 0 What is -0.0069 times 0.26? -0.001794 Product of 201 and 18. 3618 0.02 * -309 -6.18 256.6 * 0.1 25.66 Work out -0.4 * -0.118. 0.0472 Multiply 16 and 11.5. 184 156 * -0.12 -18.72 -5 * 3031 -15155 Multiply 0.0625 and 0.2. 0.0125 Work out -5.38 * -0.5. 2.69 -0.108 times -0.66 0.07128 What is -1 times -0.0384? 0.0384 Product of -5 and 113. -565 0 * -3.7 0 Work out -2.04 * -0.5. 1.02 Calculate 1190.128. 15.232 161 times 2.2 354.2 Product of -16 and 0.09. -1.44 Multiply 0.2 and 0.1401. 0.02802 What is 0.011 times -0.016? -0.000176 -0.048 -4.5 0.216 Multiply -0.42 and 10. -4.2 Multiply -6.4 and 0.1. -0.64 1-197 -197 0.2025 -0.3 -0.06075 Work out -93.5 * -0.4. 37.4 Multiply 0.026 and 0.49. 0.01274 What is -0.082 times 5? -0.41 Multiply 25 and -2. -50 Multiply 4 and -1569. -6276 -0.4 times 1 -0.4 Calculate 0.9-0.086. -0.0774 Multiply 42 and -0.03. -1.26 Work out -0.07 1.473. -0.10311 Work out 0.3 * 12. 3.6 What is the product of -398 and 50? -19900 What is 0.3 times -67? -20.1 Calculate 1-474. -474 Work out -0.14 -1426. 199.64 What is the product of -0.037 and 1.6? -0.0592 What is the product of -0.5 and -0.245? 0.1225 -449 -196 Work out 0.4 6586. 2634.4 Multiply -1 and 123. -123 Calculate -120-0.022. 2.64 Calculate 0.130.072. 0.00936 What is the product of 2.2 and -3? -6.6 Product of 0.3 and 0.1794. 0.05382 Calculate -5-1188. 5940 -32752 -1 32752 What is the product of 530 and 1? 530 Multiply -1 and 528. -528 0.08 times -0.02 -0.0016 Calculate -5.10.044. -0.2244 Calculate -1.895. -9.45 What is the product of -0.5932 and -0.1? 0.05932 -5 times 1 -5 -0.2163 times -5 1.0815 7 * 1233 8631 Multiply -68 and 0.2. -13.6 0.1 * -0.171 -0.0171 Work out 0.11 * 1.6. 0.176 Work out -0.4 * 3.2. -1.28 -0.11 * -278 30.58 What is 0.05 times 0.67? 0.0335 -0.29 * -42 12.18 -69 times 0.1 -6.9 -712.9 times 0.02 -14.258 What is -0.0398 times -0.4? 0.01592 Product of -8.6 and 30. -258 Product of 0.04 and 4. 0.16 Product of -0.3826 and 0.1. -0.03826 What is the product of 60 and 5? 300 0.1 * -352 -35.2 -4.6 times -2 9.2 0.5-10 -5 What is -34 times -0.5? 17 -0.11152 -16.72 Calculate -1-1017. 1017 What is the product of 0.07 and -0.072? -0.00504 Product of 6 and -149.2. -895.2 Multiply -6 and -0.04. 0.24 Calculate -0.030.8. -0.024 Work out -4 * -0.36. 1.44 Work out 19 * -0.036. -0.684 Work out -0.17 * 0.09. -0.0153 What is -140 times 0.25? -35 What is -12 times 45? -540 What is the product of -1.571 and -0.5? 0.7855 -769 -483 What is the product of 9 and -8.6? -77.4 1.06 0.04 0.0424 -8-156 1248 Multiply -0.1892 and 2. -0.3784 Work out 6 -61.57. -369.42 What is the product of 259.8 and 0.1? 25.98 371 * -0.26 -96.46 Multiply -0.3 and -184. 55.2 0.1150.16 0.0184 Multiply -0.2 and 6. -1.2 What is -2 times 18? -36 Product of -242 and -7. 1694 Calculate 0.088-0.8. -0.0704 Multiply 1 and -1725. -1725 -409 -360 Work out 0.5 -0.2815. -0.14075 What is the product of -0.33 and -50? 16.5 What is -15 times -407? 6105 Work out 3.802 * 0.5. 1.901 -4 * -15.7 62.8 -0.23 times 41 -9.43 Product of 5.1 and -3. -15.3 2115 230 Work out -188 -2. 376 What is the product of 9.59 and 4? 38.36 -0.3 * -495 148.5 -0.3-1.06 0.318 0.39 -1.12 -0.4368 What is the product of 2 and -560? -1120 Calculate -0.18715. -0.9355 1.10.415 0.4565 What is the product of -3 and 0.083? -0.249 -0.067 * -2.4 0.1608 Work out 0.2 * -0.114. -0.0228 Multiply -0.1 and -255.5. 25.55 -2 times 1661 -3322 1.4 * -42 -58.8 -3845 -1920 Product of -0.5 and -412. 206 6.9 times 0 0 Multiply 5 and 0.03. 0.15 What is 0.1 times 18? 1.8 Work out -0.31 2.7. -0.837 -2-88 176 -0.7 167 -116.9 Work out 11 * -0.01. -0.11 Multiply 128.3 and -1. -128.3 What is 0.2 times 2929? 585.8 Work out 1.2 * 4. 4.8 -1 * 3.1 -3.1 -5-21 105 What is 162 times 0.2? 32.4 3 times 18 54 0 -1.552 0 Multiply -0.4 and 4.35. -1.74 0.4 * 7698 3079.2 10.668-4 -42.672 Multiply 8 and 70. 560 Product of -9.7 and -1. 9.7 Work out 0.3 0.086. 0.0258 16.324 * -2 -32.648 0.5 times -3 -1.5 Calculate 2.7580.5. 1.379 What is 891 times 0.5? 445.5 942 188 What is -405 times 1.7? -688.5 Product of 0.4 and 4.7. 1.88 What is the product of -14.57 and -0.6? 8.742 What is -3053 times 0.1? -305.3 Calculate 0.0654. 0.26 Calculate 0.395-0.3. -0.1185 Multiply 0.2 and -35. -7 -0.94 times -26 24.44 What is -3211 times -2? 6422 Product of -7358 and -2. 14716 Product of -0.5 and -5.36. 2.68 Multiply 4380 and -0.3. -1314 Multiply -185.8 and -0.2. 37.16 What is -0.1 times -0.22? 0.022 What is -746 times 3? -2238 Work out -2 * -0.03. 0.06 What is -5 times 5.5? -27.5 Product of 0.2 and -1.6. -0.32 0.140.013 0.00182 0.1109 times -2 -0.2218 6.4470.5 3.2235 3 times 71 213 Product of -4563 and 3. -13689 Multiply 0.4 and 764. 305.6 0.2968 * 0.4 0.11872 423.7 94.8 -0.0132-5 0.066 Product of -0.12 and 2. -0.24 26-0.123 -3.198 What is the product of 3348 and 0? 0 135 5 675 Product of 0.08 and 0.17. 0.0136 Multiply 1316 and 0.3. 394.8 What is -0.3 times -3.5? 1.05 -2-0.06 0.12 Calculate -30.092. -0.276 Calculate 55.60.04. 2.224 What is -1472 times 5? -7360 What is the product of 0.043 and 77? 3.311 Calculate 5.90.5. 2.95 2 times -91 -182 -10 * -0.21 2.1 What is the product of -202 and 232? -46864 0.61-289 -176.29 What is 6.4 times -0.18? -1.152 Multiply 0.006 and 14. 0.084 Multiply -1 and 3.8. -3.8 -213-4 852 Product of -25 and -0.37. 9.25 Work out 0.03 * -25. -0.75 Product of -74 and 7. -518 -0.1485 times 2 -0.297 49 * 8 392 Product of 320 and 0.2. 64 What is 4 times 8.7? 34.8 What is 0.5 times -18.61? -9.305 Product of 146 and 4. 58	{ "pile_set_name": "DM Mathematics" }
19334. Is m prime? False Let q = 18 - 54. Let s = -126 + 176. Let k = q + s. Is k composite? True Let y(b) = -2b2 + 2b + 2. Let s be y(0). Is 17/s(-5 + 11) prime? False Let p be (0 - 27/(-6))2148. Suppose 5a + 0f - 2f - 9642 = 0, -4f = 5a - p. Suppose a = m + m. Is m a prime number? False Let j = 27 + -24. Suppose 3m - 559 = -2m + 4v, 333 = 3m - jv. Is m composite? True Let s = 99 - 37. Suppose 2b + b + 31 = 5v, -8 = 4b. Suppose 0 = vl - s - 8. Is l composite? True Is (16843-2)/(8 - (-52)/(-6)) prime? False Let z be -3 + 1 - 2801. Let j(s) = -133s + 38. Let k be j(-9). Let t = k + z. Is t a composite number? False Suppose -b + 3b + 33075 = 3u, 4u - 4b = 44096. Is u a prime number? True Let w = -62 - -59. Is w(-337)/1212 composite? True Suppose w = -4w - 2230. Let k = w + 817. Is k a prime number? False Let p(r) = -15r3 - 3r*2 + 4r - 3. Suppose 6h = 4h - 10. Is p(h) composite? False Let l(u) be the third derivative of u*6/120 - 7u5/30 + u4/6 + 11u3/3 - 14u*2. Is l(15) a composite number? False Let m(n) = 3n*3 + 5n*2 - 6n + 9. Let h be m(-6). Let o = 894 + h. Is o a composite number? True Let p = -20 + 22. Let i(g) = 1 + 0g2 - 5 + 2g - 1 + pg2. Is i(-12) composite? True Suppose 63463 = 2f - 3p, 0 = p - 8 + 3. Is f a composite number? True Let z = 12029 - 4402. Is z a composite number? True Let b(z) = 11z*2 + 1. Suppose 12 = 2s - 0s. Let x be b(s). Let j = -196 + x. Is j composite? True Let t be 2965/4 - 5/20. Let h = t + -368. Suppose 445 = 2c - h. Is c a composite number? False Is (-6)/27 + (-5372)/(-36) a prime number? True Suppose 3o - 67 = -5m, 0 = 5m + o - 6 - 63. Let g = -11 + m. Suppose -gi + z + 423 = 0, -3i - i - 4z + 564 = 0. Is i composite? True Let g = 159 - -32. Is g prime? True Let g be 129/(-15) + 10/(-25). Is 2/g + 55221/27 composite? True Let a(z) = -28z + 16z - 9 + 15z. Let x be a(3). Suppose x = -y + 117 + 24. Is y a prime number? False Let d = 56 - 62. Is 1637/436/(d - -15) composite? False Let f = 14493 + -5802. Is f a prime number? False Suppose 4o = r - 20457, -2r = -0r - 2o - 40908. Suppose -10d = -r - 6257. Is d a composite number? False Suppose -24999 = 79j - 82j. Is j a prime number? False Let k = -28 - -25. Let o(a) = -548a + 7. Is o(k) a prime number? False Is ((-479)/(-2))/(51/102) a prime number? True Let l = 14591 + -3992. Is l a prime number? False Let c(m) = 23431m3 + 3m*2 - 8m + 5. Is c(1) composite? False Suppose 11 = 4g - 1. Suppose 0 = -n + gq - 1, 4n = n + q + 5. Is (-19)/(-38) - (-1569)/n a composite number? True Let m(l) = 992l - 41. Let v = 15 - 10. Is m(v) composite? False Let t = -42 + 26. Let s(g) = g*2 + 13g + 1. Is s(t) prime? False Suppose -22 = u - 5l, u + 17 = -0l + 4l. Suppose ud - 3c - 273 = -0c, -3c = 3d - 261. Is d a prime number? True Let z = -742 + 157. Let p = z - -1352. Is p a prime number? False Let f be 2797/((1 + 0 + -2)/(-3)). Suppose -9o + 3714 + f = 0. Is o prime? False Let z(y) = -y3 + 9y*2 - 8y + 3. Let o be z(6). Let g = o + 54. Suppose 2h - g = -h. Is h a prime number? False Let x = -12 + 20. Is (-3388)/(-112) - (-6)/x prime? True Suppose 32 = 2i + 2c, 2c = 3c. Suppose ir + 1676 = 18r. Is r a prime number? False Let o(y) = 15428y + 13. Let r(l) = 3857l + 3. Let b(c) = -2o(c) + 9r(c). Is b(2) a composite number? True Let q(m) = -48m - 1. Let n(z) = -z*2 - 3z + 2. Suppose 0 = 2p + 5 + 3. Let c be n(p). Is q(c) composite? True Let y = -1147 + 2036. Is y composite? True Suppose -110n - 28067 = -127n. Is n composite? True Let w be 11 + -9 + (0/2 - -3). Suppose 111 = t - 4v, 0t = 3t - wv - 347. Is t a composite number? True Let y(v) = -7v*3 + 5v - 183. Let a(o) = -10o3 + 7o - 275. Let f(g) = -5a(g) + 7y(g). Is f(0) a composite number? True Let q = -657 - -2138. Suppose -10i + 629 = -q. Is i a composite number? False Let p(v) = -11v*2 + 13v + 2. Let a(h) = 6h2 - 7h - 1. Let m(j) = -5a(j) - 3p(j). Suppose 3x + 40 = 4u, 4u + 2x - 10 - 10 = 0. Is m(u) composite? True Let h = 34 - 45. Let z(p) = -p*3 + 5p*2 + 15p - 2. Is z(h) composite? True Let c = 58636 + -4527. Is c a composite number? True Suppose 4n - 1522 - 2390 = 0. Suppose 3v - m = -5m + n, 5m + 326 = v. Is v prime? False Suppose 33u = 41u - 50824. Is u a composite number? False Is ((-3156543)/408 - (-6)/(-16))/(-3) prime? True Suppose -5j = 5w - 7w + 13186, -4w = -2j - 26388. Is w composite? True Let r(u) = u3 - 11u*2 + 8u + 22. Let y be r(10). Suppose -9510 = -5h - g, -h + 1911 = -0h + yg. Is h a prime number? True Let u = -10 + 16. Let t(c) = c - 9. Let d be t(u). Is d/(-6) - (-229)/2 a prime number? False Let r be (2176/(-10))/((-15)/75). Let x(n) = -29n*3 + 3n*2 + 2n - 3. Let o be x(3). Let m = o + r. Is m prime? False Suppose -395t + 384t = -194227. Is t a composite number? False Let o = 5878 - 3557. Is o composite? True Suppose -5v - 22 = -2, -5y - 2v + 7 = 0. Suppose 0 = s + 3j - 10 - 9, 0 = -ys + 3j - 3. Suppose 0 = sr - 2r - 278. Is r prime? True Let d = 1057 + -1647. Is (d/(-5))/(5/((-195)/(-6))) a prime number? False Suppose -8j = -5j + 7278. Let f = -1383 - j. Is f prime? False Suppose 2d = 8d + 24. Is (12 - -3106)(-2)/d a prime number? True Let z = -1181 - -1768. Is z a composite number? False Suppose -3b = 4t + b - 1788, -906 = -2t + b. Is t a prime number? False Let f(s) = -s*2 - 2s + 6. Let o be f(-3). Suppose ob + 151 + 287 = 0. Let k = -95 - b. Is k a composite number? True Let m = -1393 - -2470. Is m prime? False Let y = -2405 + 3728. Let b = y + 184. Is b prime? False Is (-52)/1019260/(-72) a composite number? True Let t(l) = l*3 + 2l*2 + 3491. Is t(0) a composite number? False Let f = -5151 - -13160. Is f prime? True Let b(s) = 15s*2 - 4s - 2. Let x be b(-6). Suppose -4i + x = -106. Is i composite? False Let h(t) = 4842t3 + 1. Is h(1) composite? True Let x(i) = -i3 - i*2 + 13i + 4. Let l be x(3). Suppose -lz - 3s = -3z - 10245, 5z = 2s + 12789. Is z prime? False Is (1 - -5518)(-2 - -3) composite? False Let x be -2(-3 + 2 - -1880). Let r = x - -8261. Is (-16)/6r/(-76) a prime number? False Suppose -9452 = -3i - 5z, -z + 9676 = 5i - 6070. Let c = i + -1608. Is c a composite number? True Let g be (5/(-20))/(3/(-1812)). Suppose -d - g = -526. Is d/1 - (-4 - 0) a prime number? True Let o = -119 - -119. Suppose -4j + j + 904 = w, o = j - 5. Is w composite? True Suppose 3958w - 3957w = 94. Is w prime? False Let p be (-2 + (-12)/(-8))88. Is 7/(11/p(-4)/97) composite? True Let a(r) be the second derivative of -3r3/2 + 4r*2 + 3r. Let d be a(-4). Let u = 67 - d. Is u composite? False Suppose 17 = 2d - 3a, -2d + a = -a - 14. Let c(z) = 3z*2 + 0z*2 + dz - 7 - 2z. Is c(-6) composite? False Let p = -467 - -798. Is p composite? False Let g(s) = -157s - 8. Let b(z) = 313z + 16. Suppose 2r + 10 + 2 = 0. Let x(u) = rb(u) - 13g(u). Is x(7) composite? True Suppose 0 = 2b - 3b + 11. Let g(x) = x*3 - 10x*2 - 10x - 7. Let l be g(b). Suppose -828 = -2z - 2n - 124, -1417 = -lz - n. Is z composite? True Let k(n) = n3 - 15n*2 + 28n - 23. Let y be k(13). Let v(w) = -w*2 + 2w. Let u be v(4). Is ((-223)/y)/(u/24) prime? True Let p(r) be the second derivative of r*4/3 + 4r*3 - 3r*2/2 - 14r. Is p(-17) composite? True Let w(n) = n*2 - 9n. Let g be w(13). Suppose 2c = 4a - 46, 3c = -2c - 3a - 154. Let p = c + g. Is p composite? False Let h = 3 + -9. Let x = h - -8. Suppose -4c - 390 = -2l, xl - 2c = 4l - 378. Is l a prime number? True Suppose -30 = -10s + 5s + 5q, 4s - 16 = 2q. Suppose -2x = -2d - 170, -5d = -x + sx + 443. Let p = d + 797. Is p composite? False Let k be (-200)/606/(-4). Let w(x) = 4x - 15. Let b be w(k). Suppose -3h + 328 = -5o, -bh + 393 = -4o - 145. Is h composite? True Let i = 8684 - 4291. Is i a prime number? False Suppose 3y + 5s - 8545 = 115318, 8 = 2s. Is y a composite number? False Let k(y) = 19 + 7 - 43y - 11. Let n(j) = -1. Let v(f) = -k(f) - 6n(f). Is v(4) prime? True Let a be 13(1 - 0 - -2). Suppose 0 = 4j + 3t - 1009, 2j + 2t - a = 465. Is j prime? False Let h be 27480/27 + (-2)/(-9). Suppose 4k = -2	{ "pile_set_name": "DM Mathematics" }
. 5452 Rearrange 6752m + 4614m + 4339m to the form fm + y and give y. 0 Express 279s - 279s + s*2 - 116s3 + (s2 + 1 - 1)(-s - 2s + s) + 3s3 - 2s*3 - 4s*3 as ps + cs2 + r + ts*3 and give c. 1 Rearrange (15 - 2 + 3)(2w2 - 9w*2 - 2w*2) + (-4w + w + w)(2w - w + 0w) to the form uw + d + iw2 and give i. -146 Express -189 + 60 + 2z*4 + 32z*3 + 60 + 60 in the form n + qz*4 + az*3 + jz*2 + mz and give q. 2 Express -17m - 1416m*2 + 29m + 42 - 12m + 1425m*2 as r + im*2 + om and give r. 42 Express (108 + 20c - 108 + (0 + 3 - 1)(-2c + c - c))(26c + 79c - 52c) in the form qc*2 + i + nc and give q. 848 Express (-10s2 - 6s2 - s2)(220s - 3235 + 3235) in the form l + bs3 + ts*2 + ms and give b. -3740 Rearrange ((0 - 2 + 1)(-9d*3 + 16d*3 + 19d*3) + 16d*3 + 19d*3 + 125d*3)(0 - 3 + 5) to the form sd + cd*3 + ud*2 + x and give c. 268 Rearrange 158n*2 - 139n*2 - 134n*2 + 9n - 2 - 7n to the form vn*2 + in + z and give v. -115 Rearrange -169311d - 215d*2 + 338550d - 169283d to the form rd*2 + i + zd and give r. -215 Express (0a + a - 2a + 5a - 3a - 3a + (-5 + 3 + 4)(-2a + 3a - 2a))(35a + 8a - 5a) as pa + ua2 + l and give u. -152 Express 242j*2 - 1 + 255j*2 + 148j*3 + 0 - 496j*2 - 6j*3 in the form bj*3 + nj + l + wj2 and give l. -1 Express -1184 - 4o + 59o2 - 157o*2 + 96o*2 + 333 in the form m + qo + ro2 and give q. -4 Express (1 - 1 + 3)(62l - 1615l*3 + 1605l*3 + 101l) in the form ml3 + tl*2 + wl + o and give w. 489 Express (-1 - 3j + 1)(253433 - 42j2 - 253433)(0j - j - 2j) as qj4 + ij*2 + z + wj + cj3 and give q. -378 Express -6t*3 - 2t*2 - 18t + 2 - 9t + 33t - 4 in the form l + nt2 + jt*3 + ht and give l. -2 Express -6 + 6 - 19m + (-18 - 108 + 17)(-m - 5m + 5m) in the form b + um and give u. 90 Rearrange -2317 + 1171 + 2y*2 + 1149 - 606y*3 to the form g + zy*3 + cy + hy2 and give z. -606 Express 274 + 2m*2 - 2m + 489 + 49 + 4m3 as n + ym + gm3 + lm*2 and give y. -2 Express -164 - 92 + 0n - 3n2 + 2n + 474 as cn + an*2 + y and give y. 218 Express 13437 - 2n2 - n2 - 13458 - 3n in the form yn*2 + g + jn and give j. -3 Express -47b - 249411 + 4b*2 + 249411 + (1 - 3 + 3)(b - 3b + 4b)(b + 0b - 7b) in the form i + wb*2 + nb and give n. -47 Express (y - y + y)(3 - 2 + 8) + 0y - y + 2y + (-1 + 3 + 2)(0y + 0y - 2y) in the form q + my and give m. 2 Express 418 - 15x - 17x + 59x - 25x + 2810 in the form vx + y and give y. 3228 Rearrange (-547 - 63a + 270 + 275)(-5 - 2a + 5) + (-1 + 3 - 3)(-1 + 4 - 2)(51 - 17a2 - 51) to the form n + ra*2 + la and give l. 4 Rearrange 143 + 2i4 - i - 8591i*3 + 8591i*3 + 0i + i*2 to the form ki*3 + ai + wi4 + b + gi*2 and give b. 143 Express 3c + 25256 + 2c3 - c2 - 25264 - 8c*3 + 6c*2 as uc*3 + o + gc + vc2 and give v. 5 Rearrange (990r + 209r2 - 337r*2 + 125r*2)(-r*2 + 2 - 2) to wr*4 + or*2 + yr + c + nr3 and give o. 0 Express (-171269 + 171269 - 902p)(-3p*3 + 3p*3 - 4p*3) - 3p*4 - 4p*2 + 4p*2 as fp*2 + dp + rp3 + l + bp*4 and give d. 0 Express -2554m4 - m2 - 3817m4 - 2m + 7242m4 - 2 in the form b + fm + qm2 + xm*3 + rm*4 and give q. -1 Rearrange -57414d*2 + 19 + 57412d*2 + 566d - d*4 - 19 to the form v + zd*3 + md*2 + nd + yd4 and give m. -2 Express (-405p*2 + 11556 - 11556)(-13 + 5 - 17) in the form q + tp + zp2 and give z. 10125 Rearrange 431 + u2 + 238 - 7u - 2u*3 - 194 to hu*3 + z + nu + vu2 and give n. -7 Rearrange ((2g - 2g - 2g)(8g*3 + 0g3 - g3) + 22g4 + 22g*4 + 29g*4)(31 + 22 + 22 + 10) to ng4 + cg*2 + z + ug*3 + og and give n. 5015 Rearrange 14b2 + 29 + 9b*3 + 3b + 35 - 89 + 30 - 3 to kb3 + wb*2 + t + lb and give l. 3 Rearrange -342f2 - 5 - 694f*2 + 2001f*2 - 590f*2 to the form vf*2 + lf + c and give c. -5 Express (315 + 52x3 - 87x*3 - 244)(-2x + 0x + 3x) in the form yx*2 + lx*3 + bx + ix4 + m and give l. 0 Rearrange 2m*2 + 2m*3 + 3 - 106m*4 - 2m*3 + 208m*4 - m - 3m*3 - 103m*4 to im*4 + rm*2 + w + qm*3 + vm and give v. -1 Rearrange 23062m + 23018m + 3m2 - 45991m - 9m3 to the form w + cm + lm3 + qm*2 and give c. 89 Rearrange (-z + 2 + 3 - 7)(125 + 98 - 38) to the form k + hz and give h. -185 Rearrange -191h*2 - 1 - 170h*2 + 162h*2 - 388h*2 - 49h*2 to ih*2 + th + d and give i. -636 Express (-9 - 5j2 + 9)((-2 + 5 - 1)(3 - 3 - 2j) - 10j - 22j - 7j) as t + gj*3 + bj*2 + uj and give g. 215 Rearrange (-5358q + 6588q + 9684q)(q*2 + 0q*2 + 0q*2) to u + yq + dq3 + hq*2 and give y. 0 Express 82235 - 82235 + 6637i in the form li + u and give l. 6637 Rearrange (-2 - 2 + 5)(901g2 - 468g*2 - 430g*2 + 362g*3) to the form ig*2 + vg*3 + m + pg and give v. 362 Express 149u + 149u - 2955 - 425u + 130u as cu + o and give c. 3 Express (1 - 1 + 2b*2)(2b + 3b + b)(-227b - 15b - 113b) as wb2 + xb*3 + q + sb + kb4 and give k. -4260 Rearrange (-2l2 + l2 + 2l2)(-1 + 2 - 2) - 1 + 1 - l*2 - 1956l + 3806l - 1854l + 12379l2 to the form ul*2 + vl + w and give u. 12377 Rearrange 71n - 117n + 46n - 15324n*2 to xn + l + yn2 and give y. -15324 Express 9170 - 4582 - 4590 - 1680u as o + mu and give o. -2 Rearrange -318z + 299z - 1144z + (2 - z - 2)(-1 + 1 + 1) - 8z - 6z - 2z to f + uz and give u. -1180 Express 2o - 2290 + 804 + 793 + 746 as k + zo and give z. 2 Express (18q*2 + 22q*2 - 2q*2)(3 - q - 3) + 205q2 + 124q*2 - 123q2 - q3 + 1 - 2q as fq*3 + iq*2 + m + sq and give f. -39 Express 1973i - 1737005 + 1737005 + (-i - i + i)(-1 + 3 + 0) in the form t + di and give d. 1971 Rearrange 20 - 5 + 548n - 20 + 5 to the form p + jn and give j. 548 Express (-1 + 1 + i)(13 + 22 + 15) + (-1 - 3 + 5)(0i - 3i + 2i) + 2i - i - 2i in the form oi + u and give o. 48 Rearrange -9138p + 11481p + 8206p + 11922p to the form tp + r and give r. 0 Express ((3 - 3 - 1)(0 - 2 + 1) - 1886 - 5910 + 3209)(-c2 + c3 + c*2) as l + vc*3 + tc + ac2 and give a. 0 Rearrange 10a + 32 - 3a + 69 + 92 - 30 to the form ya + t and give t. 163 Express -135758w + 135758w - 68w3 - 114 + (4w + 2w - 5w)(w2 - 2w2 - w2) as uw3 + mw*2 + s + iw and give s. -114 Express (-269 + 269 + 196y)(3y2 - 1 + 3 + 1241y - 1216y) as ky*2 + by + oy3 + h and give k. 4900 Express (-2o + 2 - 4o + 4o)(o + 1 - 1)(24860 - 24860 - 2o2 - 1777o) in the form do + xo*4 + jo*3 + b + ro*2 and give x. 4 Express 1340f*2 - 1692f2 + f3 - 2f - 2f*3 - 2589f*2 in the form rf + of3 + a + wf*2 and give r. -2 Rearrange 31 + 386t*2 + 34 - 65 - 1673t*2 + (-1 - t + 1)(5t + 6t + 10t) to zt + x + ht2 and give h. -1308 Rearrange 53y*2 - 846y*2 + 158y*2 + y - 102y*2 + 2 to z + ly*2 + jy and give l. -737 Express -3m - m - m + (-4m - m + 3m)(1 - 4 + 1) + 11m - m + 9m - 13 + 6 + 8 + 15m in the form c + zm and give c. 1 Rearrange -3x4 - 3192x*2 + 1563x*2 + 2x*4 - 1 + 1459x*2 - 2x*3 + 2x to the form gx3 + y + fx*4 + rx + nx2 and give n. -170 Express 452d*2 - 9d + 59d3 - 425d*2 - 76d*3 in the form l + qd + ud3 + nd*2 and give u. -17 Rearrange -42h - 41h + 15h + 1 - 3h2 - 4h*2 - h to the form mh*2 + gh + a and give a. 1 Rearrange (2 - 5 - 2)(-5881j - 5130j - 4426j) to y + vj and give v. 77185 Express (13180 - 13180 - 22u)(-2 - u2 - 1 + 1 - 2u)(-u + 6u - u) as h + ku + mu*3 + bu*2 + ru*4 and give m. 176 Express 16 + 12 - 8247b*3 - 2b*4 + 8245b*3 + 6b as db2 + w + fb*4 + zb*3 + gb and give g. 6 Rearrange -1479b2 + 4b - 339b2 + 681b*2 - 3b - 1425b2 to x + kb + fb2 and give k. 1 Express -14247c*2 + 2905c*2 - 1523c*2 in the form oc + a + fc2 and give o. 0 Rearrange -5212p + 1656p + 2482p - 8759p to c + kp and give k. -9833 Express (-7c + 4c + 16c)(2 + 3 - 2)*(10 + 15	{ "pile_set_name": "DM Mathematics" }
ird smallest value in -0.3, 12.5, 7, 0.4, 5? 5 Which is the second biggest value? (a) 0.3 (b) -5 (c) 351 a What is the third smallest value in 59, -0.27, 5, -9, -1, -2? -1 Which is the third smallest value? (a) 3/5 (b) 0.141 (c) -18 a What is the biggest value in -1/9, -227, 72.3? 72.3 Which is the second smallest value? (a) -25 (b) -4 (c) -1116 a What is the second smallest value in -54, -23, 1.2? -23 What is the fourth smallest value in 0.4, -0.07, -2/25, -4, 0.09, -0.2? -0.07 What is the third smallest value in -42, -137, -212? -42 Which is the third biggest value? (a) 2/5 (b) 0 (c) 0.3 (d) 4 (e) 0.8 a Which is the fifth smallest value? (a) -5 (b) 1/24 (c) -2.65 (d) 0.1 (e) -5/4 (f) 0 b What is the smallest value in 4, -9, 6554, 16? -9 Which is the third smallest value? (a) -0.13 (b) -0.1 (c) -11 (d) 135 b What is the smallest value in 2/3, 0.1, -1271, -1/5? -1271 Which is the second smallest value? (a) 3.2 (b) -2/3 (c) 47 (d) -0.3 (e) -1 (f) -0.4 b What is the biggest value in -3, -0.2, -1/14, 1/7? 1/7 What is the fifth biggest value in 2, 217, -2/25, -1, -4/7, 109? -4/7 What is the fourth smallest value in 10, 6, -52, -5? 10 What is the biggest value in -3/98, -13, -144? -3/98 What is the third smallest value in -63, 12, 0.5, 2/29? 0.5 What is the second smallest value in 4.71, 1/2, -0.41? 1/2 What is the biggest value in -0.166, 28, 1/3, 0.4, -0.5? 28 What is the third biggest value in -1, -4, -20601? -20601 Which is the fifth smallest value? (a) 0 (b) -0.06 (c) -2/13 (d) 0.07 (e) -0.3 d What is the third biggest value in 3, -1/4, 1/4, -3/10, 5? 1/4 Which is the second smallest value? (a) 4487 (b) -1 (c) 3 (d) -0.1 (e) -0.5 e Which is the second biggest value? (a) 12 (b) 37 (c) -3 (d) -5 a What is the third smallest value in 2/11, -1/10, -2/5, 5/3? 2/11 What is the biggest value in 129, -0.24, 2, -5? 129 What is the smallest value in 4, -1, -1/2, 5, 123, 1? -1 What is the second biggest value in 1, -2.1, 159? 1 Which is the fifth biggest value? (a) -1/5 (b) 15 (c) 3/4 (d) -2/9 (e) -0.4 (f) 5/6 d What is the fourth smallest value in -15, 2, 16, 0.1, -5? 2 What is the fourth biggest value in -1, 1.15, 0.2, -61/12? -61/12 What is the biggest value in 7, 34976, -1/5, -1/6, -0.5? 34976 What is the fourth biggest value in -2/5, 1164, -0.27, 4? -2/5 What is the fourth biggest value in 1, 0.5, -14, 0.3, -42, -0.3? -0.3 Which is the fifth smallest value? (a) -171/4 (b) -0.4 (c) -4/7 (d) -1 (e) -2/7 (f) -6 b What is the biggest value in 1/9, -31704, -3/4? 1/9 What is the biggest value in 2/9, -5, 410, 0? 410 What is the third biggest value in 142, 2/3, -1/9, -2/17? -1/9 What is the third smallest value in -0.4, 5.1, 1320? 1320 Which is the third biggest value? (a) 23 (b) -55/64 (c) 5 (d) 10 c What is the fifth biggest value in -7, -0.5, 106, -5, -2, 0.2? -5 What is the second biggest value in -2, 0.2, -4/7, 5, 1, -0.06? 1 Which is the second biggest value? (a) 2/413 (b) 0.09 (c) 8 b Which is the third smallest value? (a) 1/5 (b) 3 (c) -764/185 b What is the fourth biggest value in -15, -482, -5, 3/7? -482 Which is the fourth biggest value? (a) 253 (b) -2 (c) 4 (d) -2/3 b Which is the smallest value? (a) -7 (b) 1 (c) 1314 a What is the second smallest value in -0.5, 9, -568, 3? -0.5 Which is the fourth smallest value? (a) -22 (b) -2 (c) -5 (d) 38 (e) 2/3 (f) 2 e What is the fourth smallest value in -4/5, -4, -100, 7/25, -2/9? -2/9 What is the second biggest value in 0, 0.2, 2669, 4? 4 What is the fourth smallest value in -1, -1/8, 0.4, 72, 2/3? 2/3 What is the third smallest value in 0.02, 3, -8, -34? 0.02 Which is the smallest value? (a) 10/9 (b) 0.05 (c) -5/3 c Which is the biggest value? (a) -0.3 (b) 5379 (c) -6/5 b Which is the smallest value? (a) -68 (b) -0.012 (c) 2/11 a Which is the biggest value? (a) -0.5 (b) 4/5 (c) 4 (d) 61 (e) 464 e What is the smallest value in -0.05, -352, 3, -2/43? -352 Which is the fourth biggest value? (a) -6/5 (b) 1.4 (c) -6 (d) 0 (e) 144 (f) -3 a Which is the third biggest value? (a) 1.9 (b) 3 (c) -4 c What is the fifth biggest value in -1, -0.5, -173, -83, 5, 2? -83 What is the biggest value in -1094, -0.3, -4/25, -5, 0.5? 0.5 Which is the third smallest value? (a) 8 (b) -15 (c) -1/5 (d) 2 (e) -56 c Which is the third biggest value? (a) 0.5 (b) 10/7 (c) 0 (d) -7 (e) -0.008 (f) 2/15 f What is the fourth smallest value in 22, -3, -0.15, -0.11? 22 Which is the smallest value? (a) -3 (b) -15/4 (c) -688 (d) -1/5 c What is the third biggest value in 1, 16, -2/17, -1/3, 6? 1 Which is the second biggest value? (a) -4 (b) 1037 (c) 84 c What is the fourth biggest value in 40/11, -4, -2, 0.1, 16.7? -2 What is the third biggest value in 13, -1/294, -1? -1 What is the biggest value in 4, -326, 2/7? 4 Which is the fifth biggest value? (a) 4 (b) 1 (c) 1549 (d) -5 (e) 1/5 d Which is the fifth smallest value? (a) -4.17 (b) -1/4 (c) -0.4 (d) -0.062 (e) 0.5 (f) 2/9 f Which is the third smallest value? (a) 3/5 (b) 514848 (c) 1 b What is the fourth biggest value in 0.1, -2/9, 4, -3, -3436? -3 What is the third biggest value in 3, 0.3, -12014, -4, 0.2? 0.2 Which is the second biggest value? (a) 2/17 (b) 8 (c) 7114 b What is the fourth biggest value in -1/7, -5, -4, 3, 183? -4 Which is the fifth biggest value? (a) 487 (b) -0.56 (c) 4 (d) 10 (e) 0.5 b What is the third biggest value in 17, 51, -11, 2? 2 What is the fourth biggest value in 0.34, 1.3, -135, 1/3? -135 Which is the second smallest value? (a) -1/408 (b) 1/8 (c) 4/3 b Which is the fourth smallest value? (a) 763 (b) -5 (c) -0.01 (d) 3/7 a Which is the fifth smallest value? (a) -244 (b) 0.4 (c) -0.1 (d) 5 (e) -1.8 d What is the biggest value in -12, -271, -1? -1 Which is the sixth biggest value? (a) 2 (b) -4 (c) -0.5 (d) -4.64 (e) 15/8 (f) 4 d Which is the smallest value? (a) -13490 (b) -5 (c) 16 a What is the second smallest value in -2, -0.09, 6751/5, -3/4, -1/3? -3/4 Which is the fourth smallest value? (a) 1 (b) 3/7 (c) -7093 (d) -0.1 a Which is the biggest value? (a) -5/2 (b) 58 (c) 17 (d) -0.02 b Which is the fifth smallest value? (a) -35.58 (b) -0.5 (c) 0.003 (d) -3 (e) 4 e Which is the third smallest value? (a) 2 (b) -0.4 (c) 0.1 (d) -899 c Which is the smallest value? (a) -787 (b) -4 (c) -1.9 a Which is the second biggest value? (a) 7039 (b) -0.1 (c) -1 b What is the fourth biggest value in 5/6, 6, 4, -34? -34 Which is the fourth biggest value? (a) -0.09 (b) 0.301 (c) -2/7 (d) 11 (e) 0 a What is the second smallest value in -3, 3/13, 1/284? 1/284 Which is the second smallest value? (a) -0.3 (b) 4 (c) -2 (d) 181674 (e) -2/3 e Which is the smallest value? (a) -7/5 (b) 0.06 (c) -0.9 a What is the second smallest value in -0.3, -3, -1848, -145/3? -145/3 Which is the fourth biggest value? (a) 1.059 (b) 0 (c) -20 (d) -3 (e) 5 d Which is the second biggest value? (a) -0.5 (b) -0.2 (c) -14 (d) -50 (e) 4/5 (f) -2 b What is the smallest value in 19/5, 31, 0, 2, -74, -3? -74 Which is the third biggest value? (a) -1/14 (b) 9.7 (c) -4 (d) 3/8 a Which is the second smallest value? (a) -0.16359 (b) -11 (c) 3 a What is the second biggest value in -4, 2/7, -2/21, 4/9, 27? 4/9 Which is the third smallest value? (a) -16/3 (b) -0.3 (c) 5/2 (d) -0.5 (e) -0.1 (f) 12/5 b What is the third smallest value in 5, -3, 478/3? 478/3 Which is the fourth biggest value? (a) 0.011 (b) -61.7 (c) 0.2 (d) 4 b What is the fourth smallest value in 2/9, 0.04, -2/13, 4, 2/5? 2/5 Which is the third biggest value? (a) -15060 (b) -0.1 (c) 0.3 (d) 5 b What is the second biggest value in -0.3, 1/3, 1/4, 18, 2.18? 2.18 What is the third biggest value in -1/274, -1/2, 15/8, 1? -1/274 Which is the third smallest value? (a) 0.3 (b) 4 (c) 5 (d) -13 (e) -840 a Which is the biggest value? (a) 58 (b) -18 (c) -3/11 a What is the fifth biggest value in 6, 0, -47, 9, -3? -47 What is the third smallest value in -891, 0.3, 0? 0.3 Which is the fifth smallest value? (a) -311 (b) 2/13 (c) -1/13 (d) 3 (e) 0.5 d Which is the second smallest value? (a) -39968 (b) 0 (c) -1 (d) 4 c What	{ "pile_set_name": "DM Mathematics" }
- -0.0174. Is s >= 7? False Let f be (-22)/(-99)(-15)/10. Is 133 < f? False Let q(o) = 2o - 4. Let p be q(-3). Which is greater: p or 7? 7 Suppose 0 = -8v - 49 + 225. Let z = 44 - 28. Let x = z - v. Is x at least as big as -0.2? False Let j = -42 + 66. Suppose -3d - j = -4u + 14, -20 = 2d - 4u. Suppose 0 = -4f + 36 - 104. Is d at least f? False Let p(c) = -2c - 2. Let j be (0 + 6)(-17)/34. Let b be p(j). Suppose bk - 4 = 8k. Is -1 greater than or equal to k? True Let c be (966/(-20))/(5/10). Let b = 97 + c. Which is bigger: b or 1? 1 Suppose 0 = -36f + 33f. Suppose w + 176 = 7. Let n = 3212/19 + w. Is n at least f? True Let n be 1 - -4 - (-15)/(-1). Let s be (n/(-15))/(2/1). Do s and -1/2 have the same value? False Let s = -117 + -45. Let z = s - -159. Which is smaller: 2/13 or z? z Suppose -3k + 3 = -0k. Suppose 0 = 4r - 3 - k. Let w be 12/2 - (-3 - -7). Do w and r have different values? True Let o = 224 + -224. Is -1/223 at most o? True Let c be ((-20)/(-740))/((-1)/(4/14)). Let i = 219/5180 - c. Which is bigger: i or -1? i Let c = -57 + 82. Let t = c + -27. Let v be t/(-33)(-12)/(-8). Does v = 0? False Let x be (522/5)/((-54)/360). Is -696 <= x? True Let b = -10 + 42. Suppose -v + 3g = -6v + b, 25 = 3v - 4g. Which is smaller: v or 8? v Let r = 32.76 - 7.6. Let v = -25 + r. Let z = v - 0.16. Which is greater: 8 or z? 8 Let t = -255 - -254.8. Is t at least as big as 0.22? False Let h = 20/9 + -13/6. Let p = 38 - 38. Are h and p nonequal? True Let v(c) be the first derivative of -c*3/3 + 2c*2 + 9c - 23. Let m be v(-5). Is -110/3 bigger than m? False Let s = 8.6 + -8.6. Is -7 <= s? True Let o(z) = 2 + 1 + 70z - 71z - 4. Let u be o(-2). Does 5/8 = u? False Let t(p) = 2p2 - 54p + 142. Let f be t(3). Let l = -90/49 - 15/49. Which is bigger: f or l? f Let i = 75.646 - 76. Do i and -1/5 have different values? True Let c be ((-26)/(-10))/(2/(-5)). Let f = -1994 - -1994. Which is smaller: f or c? c Let p be ((6 - 4) + -2)-11. Is p at most as big as -1/1253? False Let o be -2 + (112/(-15))/(-4). Let h = 104 - 105. Which is greater: h or o? o Let c = 65512/39 - 1680. Which is bigger: 1 or c? 1 Suppose 2j = 8, 0 = -3a + 3j - 0 - 9. Which is bigger: a or -10? a Let o = 382 + -382. Is o < 1/545? True Let r = -27 - -28. Let s(p) = 15p + 10. Let q be s(9). Let t = -3334/23 + q. Which is bigger: r or t? r Suppose 2a - 6 - 8 = 0. Suppose as + 55 = -15. Are s and -11 non-equal? True Suppose -z = -r + 1, -r - 4z + 16 = -0. Let c be (6/(-10))/(r/(-20)). Is c < 5? True Suppose -4s + 2q = -6, -s + 2q + 9 = 15. Which is bigger: s or 2/21? s Let a be (-17)/(-1) + -3 + -4. Let d be 44/a + 3/5. Suppose -m - 3 = 4y - 13, 5m - 50 = -dy. Which is bigger: 11 or m? 11 Suppose -3o - 3a = -60, 2o - 3a + 5 = 30. Suppose -g = -4d + o, -2 - 2 = -3g + d. Let r be (-2 - -1)g1. Which is greater: r or -5/3? -5/3 Suppose 3j = 3s - 6, 5s - 20 = j - 6j. Which is smaller: -2/173 or j? -2/173 Suppose -2t - 3w = -36, -5t - 3w = 40 - 121. Suppose 4d - i = -25, -4i - t = 4d - 3i. Is d >= -5? True Let r = -2/2409 - -80569/1606. Let l = 81/2 - r. Which is smaller: -0.1 or l? l Let z be 22/14 + 75/(-50). Let n be ((-2)/6)/(2/18). Let v(w) = -w - 4. Let m be v(n). Is m at least as big as z? False Suppose 5c = 2m - 12, -2m = 2c - 28 + 30. Which is greater: c or -16.4? c Let w(a) be the first derivative of a3/3 + 3a*2/2 + 12a + 11. Let c(j) be the first derivative of w(j). Let b be c(-3). Which is greater: b or -5? b Let t = 0.266 + -0.166. Which is smaller: t or -0.2? -0.2 Let u be ((-21)/9)/((-6)/(-324)). Let z be (-316)/u + (-6 - 80/(-14)). Which is greater: 2 or z? z Let m(v) = v*3 - 2v*2 - v + 2. Let c be m(2). Let p be 20/(-175) - 2 - -2. Is p at most as big as c? True Let i = 393/1504 + -7/32. Which is smaller: 0 or i? 0 Suppose -9 = -3v + 6. Let d = v + 1. Let l be 0/(-2) + 66/d. Are l and 11 nonequal? False Let a be (-34)/(-153) + 824/18. Suppose 121 = 4q - 71. Which is smaller: q or a? a Let r(z) = 10z*2 + 4z + 1. Let p be r(-5). Is p > 230? True Let n = 13 - 8. Suppose -15 = nb - 2f - 0f, -4f - 12 = 4b. Let l be (b/4)/(54/(-9)). Is l >= 0? True Let v = 1743 + -1793. Which is greater: v or -65? v Let x(d) = -d2 + 32d + 1. Let n be x(0). Is 1/893 smaller than n? True Let x = 30 + -29.9. Is -233 at most x? True Suppose -3o - 2j + 14 = o, -o = 3j - 11. Let g be o/(-4) + (-54)/(-28). Do g and 1 have different values? True Suppose t + 0 = -l + 2, -3l + 10 = -t. Suppose -27 = -5x - 2. Let y be (l - 7) + 1x. Which is greater: y or 1/18? y Let n be ((-2)/1)/(2/(-3)). Suppose 0 = 2m - d, m - 5d = 4m. Suppose 5q - 7 - n = m. Do q and 3/5 have different values? True Let h(z) = -z*3 - 22z*2 + 23z + 4. Let i be 3/(-3)22 - 1. Let j be h(i). Is j less than or equal to 17/4? True Let l = 0.94 - -0.06. Let o = -1.1 + l. Suppose 0 = -3m - r + 7, 3m + 5r + 14 = 25. Are o and m unequal? True Suppose 0 = -2z - p - 51, -7p - 163 = 6z - 6p. Let j(s) = -3s2 + s + 4. Let l be j(-3). Is l at least z? True Let l = -2.89 - -4.29. Which is greater: l or -3? l Suppose 3v = -3i + 1578 - 6189, i + 2v + 1532 = 0. Which is smaller: i or -1541? i Let v = 19163689/29469 - 30606/47. Let l = -1/57 + v. Suppose 6a = 3a. Which is smaller: a or l? l Let g(w) = 8w3 + w2 - 2w + 1. Suppose -4x = 4m + 16, m + 5 - 3 = -3x. Let f be g(x). Suppose 3u - fu = 25. Do u and -5 have the same value? True Let c = 155 + -156. Is -13/22 bigger than c? True Let a = 20.6 - -0.4. Let u = a + -13. Let f = 8.2 - u. Which is smaller: 0.3 or f? f Suppose -36c = -31c - 75. Let d be (-92)/(-21) + 5/c. Are 4 and d unequal? True Let l = -88 - -266/3. Let o = -50 - -46. Are l and o nonequal? True Let h be 36/60(-5)/(-1). Suppose 0k - 2k - 210 = -4j, -2j = hk + 339. Which is smaller: -112 or k? -112 Let t(w) = 4w*3 + 3w*2 - 5w - 1. Let h(b) = b*3 - b - 1. Let d(i) = 2h(i) - t(i). Let l be d(1). Which is greater: l or -1? -1 Let w = -37/72 - 115/144. Let u = 745/592 + w. Let d be (-2)/((-1 - -1) + 2). Is d bigger than u? False Let c = 85 + -106. Which is smaller: -18 or c? c Let o = 73 - 583/8. Suppose 3c + 3v - 12 = -2v, 0 = 3c + 2v - 3. Which is smaller: c or o? c Let t = 453 - 4072/9. Let l be (1 - 1)/(4 - (1 - 0)). Do t and l have the same value? False Let r be (-1 + -45)/(-2) - (-15 + 18). Let s be -2 + 25/r - -2. Which is greater: 0 or s? s Let i(y) = y + 1. Let x(d) = 12d - 6. Let o(g) = -15i(g) + x(g). Let n be o(-7). Does n = 1? False Suppose -2p = -m - 124, -228 = 3m - 4p + 148. Is -128 < m? False Suppose 64 = 5j + 19. Let i = -4 + j. Suppose l = ig + 3, 0 = -0g - 2g - l + 3. Is -7/5 greater than or equal to g? False Let r(x) = 41x - 55. Let u be r(2). Is u smaller than 450/17? False Let g(k) = 2k*3 - 37k*2 - 21k + 37. Let r = 69 - 50. Let i be g(r). Which is greater: 2/435 or i? 2/435 Let o be -6 + (-4)/(0 - 1). Let k be (1 - 1)/(o + 1). Which is greater: k or -7? k Let g = 0.6 - 0.7. Let n = g - 1.9. Let k = n - -2.1. Which is smaller: k or 2/5? k Let b be (-50)/153 - (0 - 4). Let m be 42/(-12)(-12)/(-7). Are m and b nonequal? False Let t be (2297/14)/(0 + -32). Let u = t - -36/7. Which is smaller: u or 0? 0 Suppose 3p + 2h = -2 - 20, -5h = -3p - 29. Let u be p/(-77) + (-6)/21. Let x(s) = -s*2 - 3s + 3. Let m be x(1). Is u at least m? True Let d be -3 - 4 - 6/(-1). Let p be (-17)/3 + 2/(-6). Let i be p/281/(-3). Which is smaller: i or d? d Let p = -9 - -264. Is p less than 254? False Let q = -1150 + 1044. Is -108 less than q? True Suppose 258 = 2o + 36. Let q be (-26)/(-39) + (-76)/o. Does -1 = q? False Let w = -47.07 - -48.9. Are 1 and w unequal? True Let v(l) = -l*2 + 8l + 28. Let y be v(12). Let o be (1/4 - 0)/((-5)/y). Are -3/134 and o equal? False Let j(v) = v*3 + 4v*2 - 2v + 7. Suppose -3m = -4m - 5. Let x be j(m). Let l be (-16)/(-21) + x/24. Is 1 equal to l? False Let t = -16441/87 - -189. Let s(g) = -g*2 + 11g - 18. Let k be s(9). Which is smaller: k or t? k Let x be (-14)/2(-8)/4055. Is x > 9? True Let c be ((-136)/2288)/(2/(-41822588)). Let m = c - 1242970. Let b = -100/11 + m. Which is greater: 0.1 or b? 0.1 Let z be 1085/410 + (-10)/4. Whic	{ "pile_set_name": "DM Mathematics" }
lculate 58 + 9 - 47 - (61 + (-4 - 5)). -32 (2 - (-2 + 0 - 2)) + (-687 - -715) 34 1 + -19 + -81 + 100 - 12 -11 Calculate 0 + (18 - 11) + (-10 - -9 - -5). 11 Evaluate -37 + -12 - (-48 - -11 - -22). -34 What is the value of 7 - (-13 + -9 + -12 + 24 - -66)? -49 -33 + 0 + 153 + -128 + 0 + -14 -22 What is -56 + 23 + (-16 - -30) - -134? 115 Calculate -1 - 125 - (842 + -909). -59 What is the value of (3 - 3) + (-50 - -33 - -15)? -2 Evaluate 23 + 33 + -39 + -3 + -38 + 13. -11 Calculate (17 - 46 - -52) + -46 + 12. -11 What is the value of 45 + (2 - ((8 + 4 - 15) + 10)) + 9? 49 Evaluate 20 + (-53 - -18) + (0 - -27) - 61. -49 Evaluate 88 + 23 + (-140 - -66). 37 Calculate 3 + (-36 - -55) - (-1 + 60). -37 What is the value of -6 + (35 + 13 - 18) - -24? 48 Evaluate -9 + (-110 - 29) + (17 - -1). -130 Calculate 52 + -48 - 10 - -23. 17 Calculate 163 - 16 - (-190 + 266). 71 Evaluate -13 + 3 + -8 + -6 + -8 + 8. -24 -52 - (-11 + 48 + -18 + -35) -36 What is the value of 26 + -21 - 14 - 51 - 18? -78 (50 - 80 - -13) + (0 - -61) 44 Calculate 4630 - 4658 - (15 + 1). -44 Evaluate -20 - (11 + -3 + 9 - 20). -17 What is -10 + (-1649 + 1746 - (-14 + (1 - 2)))? 102 Evaluate (-6 - (-20 + -1)) + -66 + 28. -23 (-22 - -22 - 57) + 51 -6 What is (0 - 2) + -3 + (-5323 - -5308)? -20 Calculate 126 + 1 + (-6682 - -6614). 59 What is the value of (4 - (-3 + -12 + -4)) + (323 - 309)? 37 What is the value of (8 - (133 - 99 - (-9 - 111))) + 1 + -8? -153 Evaluate (-4 - 1) + (-12 - (32 + -54)) - (-46 + 0). 51 What is -10 + 5 - (12 + 12 - 11)? -18 (-12 - -1 - 0) + 10 - (38 + 4 + -8) -35 Evaluate 14 - 4 - 14 - -9 - -6. 11 Calculate -2 - (47 + 61 + -54 + (-4 - -2)). -54 Calculate (-7 + 0 - (0 - 2)) + 1457 + -1468. -16 What is 33 + (-54 - -3) + 18? 0 Evaluate (7 + -16 + 12 + -1 - 1) + -68. -67 Evaluate 1 - 56 - (3515 - 3546). -24 Calculate -142 - (-20 - (-72 + 117)). -77 26 + -20 + 105 - 106 5 What is the value of 35 + -3 + -16 - -2 - -14? 32 What is the value of (20 - -1 - (-477 + 503)) + -12? -17 -17 - (15 - (-8 - -18) - 10) - -15 3 Calculate -2 - ((-3 - 22 - -16) + -29). 36 Evaluate 7 + (6 - -119) + (0 - -14) + -32. 114 What is 57 + -32 + 92 - 39? 78 Calculate 3 + (-1 - -4) + -17 + -5 + 2 + -1. -15 Calculate -114 + 17 + 63 + -41. -75 Calculate -16 - -86 - ((-1 - -5) + (3 - (10 - 7))). 66 Evaluate (-9 - -4 - -44) + -21 + (38 - 9). 47 -111 + 25 + 60 - (0 - 10) -16 Calculate (18 + 23 - -22) + -50. 13 Calculate (-16 - (0 + -5)) + (86 - 68). 7 Evaluate 123 - (44 + 3 - 1). 77 38 - ((78 - 0) + -73 + (1 - (9 + -1))) 40 Calculate 560 + -588 - (-10 - 0). -18 26 + (142 - (-147 + 280)) 35 Evaluate 20 + 13 + (11 + 2 - (0 - -7) - 5). 34 What is the value of (0 - (35 + (-8 - 24))) + (0 - -53)? 50 Evaluate 3 + -97 + 428 + -348. -14 What is -8 - (23 - (36 - 12))? -7 What is -428 + 413 - (2 + 0 - -30)? -47 What is -1 + -45 - ((68 - 58 - -50) + -46)? -60 -77 + -138 + (39 - -152) -24 2 + 16 + -3 - ((41 - -42) + -42) -26 What is (-2 - (6 + (5 - 3))) + -69 + 67 - 7? -19 Calculate -68 + 125 + -49 + -13. -5 What is 187 + -17 + -211 - (-14 - -1)? -28 Evaluate 229 + -202 + 77 + -19. 85 Evaluate -6 + 66 + (-10 - -1 - -9) + 3 + 10. 73 What is the value of -47 - (11 - (-8 + 55))? -11 Calculate -99 - (-20 + -21 + (56 - (7 - 3))). -110 What is 8 + (-9 - (-20 + 19)) - (-48 + 4)? 44 -31 + 9 - (0 + -24) 2 Evaluate (-7 - (-7 - -18) - -8) + 6 + -10 + 33. 19 What is -59 + (379 - 371) + -5 + (3 - 0) + 3? -50 What is 31 - (78 + -12 - -10)? -45 -47 - (-51 - 40) - 107 -63 Evaluate -6 + 90 - (16 + (-17 - -17) - 22). 90 Calculate 23 + -26 + (3 + (0 - 1) - 4) - 25. -30 What is 27 + 18 + -46 + (1 + -7 - 1) + 33? 25 What is the value of 0 - -13 - (21 - (37 - -20)) - 11? 38 Evaluate (-34 - 4) + (24 - -6 - 26). -34 What is (11 - (-1 + 6)) + -6 + (-1 - (-5 + 11))? -7 92 + -38 + (78 - 92) 40 What is the value of (-19 + 52 - 28) + (4 - (1 + 5) - -57)? 60 What is -82 - (3 + 0 + 0) - (-298 + 282)? -69 (-31 + -8 - (12 + -34)) + 1 - -47 31 What is the value of -6 - (5 - (52 - -1)) - (-91 + 92)? 41 What is the value of 43 + (29 - 211) - -109? -30 Calculate -814 + 822 + -1 + -1 + 33. 39 What is (0 - -15) + 16 + -31 + 15 + -10? 5 1 - (81 + -63 - (11 + -4)) -10 Calculate 15 - ((-21 - (14 + 1)) + 2 + -7). 56 Evaluate -63 + 175 + -155 - (15 - 1). -57 What is -10 - (-25 - (30 + -17))? 28 (110 - 116 - -20) + (-1 - 0) 13 What is the value of (1 + (1 - 2) - -49) + 8 + 1 + -3? 55 Evaluate -5 + -7 - ((-1 - -20) + (-10 - 9)). -12 Evaluate -33 + (32 - (-16 - -30)) + 26. 11 What is the value of -4 + 0 - (-35 + 33 + 26 + -3)? -25 Calculate -33 + 27 + (30 - 43). -19 Calculate (-114 + 222 - 125) + 8 + -1 + -1. -11 What is the value of 11 + (-16 - (-23 + (-5 - (-14 - 1)))) - -7? 15 What is the value of 63 + 41 - (118 - 44)? 30 Evaluate (12 - 1) + (20 - -47 - 57). 21 0 + 101 + (-13 - 0) + (-64 - -127) + -55 96 Evaluate (-132 - -113) + (-20 - (-5 - 0)). -34 Evaluate (242 - 82) + -19 + (23 - 15). 149 What is the value of 36 + -25 + 45 + (2 - 14) - -8? 52 (0 - 64) + (-100 - 128) + 182 -110 (-340 + 334 - (0 + -12)) + (-1 - -4) 9 -44 + (23 - (-29 - -37)) -29 What is 6 + 12 + -7 + 39 + -44? 6 (92 - 111) + (7 - 9) + -1 -22 What is -12 + 309 + -385 + (-17 - 4 - -5)? -104 (-11 - -2) + (-274 - -258) -25 What is the value of (0 - 2 - 2) + (2423 - 2387)? 32 Evaluate 14 + -1 + -176 + 117. -46 -20 + 34 + -4 + 102 - 25 87 Calculate 36 + -1 + 8829 + -8846. 18 What is the value of -3 + (-8 - -24) + 7 - -9? 29 36 + 64 + -155 + (2 - 11 - -2) + 1 -61 What is (-10 + 26 - (15 - (12 - 13))) + -54? -54 Evaluate 200 + -113 - 115 - (-28 - 0). 0 What is 2 + -46 + -1942 + 1959? -27 Calculate (9 + 6 + 0 - -2) + (0 + 1 - -5). 23 Evaluate 107 + -96 - -19 - (25 - 1). 6 Calculate -645 + 628 - (-32 + -3). 18 Evaluate 137 - (253 - 119) - (17 - (0 + 1)) - 7. -20 Calculate -12 - ((-95 - -1) + (-16 - -43)). 55 What is 37 + 4 + 5 - (61 + (-37 - 8))? 30 Calculate 1 + 27 - (2 + 140 + -138). 24 Evaluate -129 - (-226 - (22 - 108)). 11 Calculate 13 + (-23 - -22) + -13 - -21. 20 Calculate -10 + 2 - (-6 + 36 + 48 + -37). -49 Evaluate 17 - 20 - 27 - (-20 + 16). -26 What is the value of -59 + -138 + 112 + 93? 8 What is -61 + (3 - (19 - 13)) - 2? -66 Calculate -2 + 5 + -3 + 20 + -7 + -28. -15 What is the value of -19 + (14 - (-3 - 12)) + -34? -24 What is the value of (256 + -238 - (-33 + 1)) + 26? 76 (-1 - 5) + -5 + 4 + (292 - 365) -80 Calculate 10 - (-18 - -9 - -7) - (37 - 22). -3 Calculate 41 + (-46 - -19) + 16. 30 What is 23 + 68 + 13 + -122? -18 What is the value of 66 + 87 + (-138 - -44)? 59 What is -20 + -119 + -20 + 76 + 0 + -4? -87 Calculate -128 - (14 + (-36 - -4) + -12). -98 Calculate (62 + (-15 - -4) - 10) + -8. 33 Calculate 29 - (-30 - -110) - -4. -47 What is (-196 - -69 - -68) + 78? 19 Calculate (18 - (-4 - (12 + -8))) + -4 + (-5 - -17). 34 Calculate -9 - (-15 + 1 + -17 - -9). 13 What is the value of -59 + (-9 - -71) + -4? -1 Calculate -36 + 45 - ((54 - (-2 + 2)) + 11) - 3. -59 -36 - (-70 + (42 - -5)) -13 -39 - (-2 + 7 + (-36 - -32)) -40 What is 181 - (28 + -13) - (33 + 18 + -28)? 143 What is the value of 5 + -47 + (206 - 103)? 61 Evaluate 4 - (40 + (9 + 1 - 23 - (-14 + 4))). -33 -3 + (24 + -10 - 24) + (-2 - -1) -14 Calculate 94 + -31 - (41 + 20). 2 Calculate (1 + 0 - 108) + -25 + 204 + -182. -110 What is the value of 1755 + -1681 - (-2 + -6)? 82 -7 - (30 + -20 + -9) - (0 - (-4 - 18)) -30 Calculate -2 + -102 + 69 + (19 - 8). -24 Evaluate -6 - ((-9 - -20) + -21 + -8) - -1. 13 What is -10 + -7 + (-17 + 19 - 15)? -30 6 - -40 - (-215 - -250) 11 What is the value of 38 - (-14 + 10 + (3 - -2))? 37 Calculate 29 + -23 - (-129 + 110). 25 Calculate 23 + 44 - 43 - (1 - 18). 41 Calculate -960 - -887 - (-1 + 5). -77 Calculate (-747 - -750) + 0 + -2 + 30. 31 What is the value of -9 + 51 + -5 + (-11 - (-14 + 11)) + 10? 39 Evaluate 2 - (1 + -135) - (11 + -1 + -168 + 169). 125 What is the value of -31 - (-1 + ((8 - 10) + 14 - -5))? -47 8 - 23 - -16 - -32 - -10 43 What is (16 - 10 - -18) + (-131 - -108)? 1 (4105 - 4095) + (0 + -7 - -1) - 17 -13 Calculate -6 - (5 + 8) - (64 - 44). -39 What is the value of 43 + 145 + -213 + 66 + (2 - 1) + -10? 32 144 + -67 - 149 - -116 44 What is the value of 0 - (-24 + -6 + 15 + 38 - 6)? -17 What is the value of 2 + -34 + (235 - (-25 - -160))? 68 Evaluate 61 + 96 + (-35 - 170). -48	{ "pile_set_name": "DM Mathematics" }
2/5 Let h be ((-39)/12 - -4)-1. Which is the closest to -2/7? (a) h (b) -2 (c) 5 a Let s be (4 - (-55)/(-15))18. Let z be s + -4 - -4 - 3. Let v be (-2)/(-3) - (-2)/(-6). What is the closest to z in v, 0.1, -3? v Let k(o) = 9o3 + 4o - 13. Let p be k(2). Which is the closest to -1? (a) 2/13 (b) 0.3 (c) p a Let p be (26/351 - 424/(-108)) + -6. Let j = 0.2 + -0.2. What is the closest to 5/6 in j, p, 0.5? 0.5 Let m = 0.4246 + -0.0246. Which is the closest to 0? (a) -2/11 (b) 4 (c) 1/5 (d) m a Let l(g) = 2g2 - 27g - 255. Let x be l(21). Which is the nearest to 4? (a) -4 (b) x (c) 0.1 (d) -2 c Let f = -377 - -372. Which is the nearest to 0? (a) f (b) 32/7 (c) 3/4 c Let v = -4.6 + 11.2. Let a = 6.4 - v. Let t = 0.6 - 0.3. What is the closest to 5 in t, a, -3? t Let n = -110 - -78. Let d = n - -32.3. Which is the nearest to 1/2? (a) d (b) 1/5 (c) 0.4 c Let o = -0.11 - -1.21. Let m = o - 1.5. Let s = 0.2 + -1.2. Which is the closest to s? (a) 2 (b) m (c) -3 b Let w = 8 - 10.65. Let c = w - -0.65. What is the closest to 2/7 in -1/9, 3, c? -1/9 Let o = 0.29 + -0.7. Let j = 0.01 + o. Which is the nearest to -0.1? (a) j (b) 4 (c) -3 a Let x = -0.268 + 0.268. What is the closest to x in -3, 0.3, 0.1, 7/5? 0.1 Let m = 38 + -38.4. What is the closest to 0 in 1, 1/5, m? 1/5 Suppose 379 = -4u + 367. Let k = 0 - 2. What is the nearest to -0.1 in k, 2/15, u? 2/15 Suppose -2n + 2j + 4 = -2, n + 5j = -3. Let k = -303 - -2119/7. What is the nearest to -2 in 0.2, n, k? k Let x = 62 + -61.974. Let b = x + -6.026. What is the closest to -0.1 in b, 4, -0.3? -0.3 Let d = -11327 - -11325. Let u(t) = t*2 - 2t + 1. Let r be u(1). Let k = -469 + 6101/13. Which is the nearest to d? (a) r (b) k (c) 0.5 a Let q(g) = -2g + 24. Let l be q(8). Suppose -4k - 4f = -20, -5k + 18 + 7 = 2f. Suppose -3 = ku - l. Which is the nearest to u? (a) -4/5 (b) 0.2 (c) 0 b Let j = -2.1 + 1.1. Let t be 6/(2 - 2 - -4). What is the closest to t in j, 2/7, -0.3? 2/7 Let t be (-664)/(-96) + -7 + 1/(-6). Which is the closest to t? (a) -4 (b) -0.1 (c) 2/11 b Suppose -1 = 75j + 74. Which is the nearest to -39/8? (a) -5 (b) j (c) -3 a Let d = -2 - -1. Let j be 7 + 845/(-234)2. What is the closest to j in d, 8, -0.2? -0.2 Let d = -95.4 + 95. What is the closest to 0 in 2/3, -54, 0.5, d? d Let u be (-7 - -4)/(3 - 81/30). Let h = 10 - 15. Let g be (h/(-5))/(2/u). What is the closest to -1 in -2/9, -2/19, g? -2/9 Let v(p) = 7p + 52. Let f be v(-8). Let z(b) = -2b - 3. Let q be z(-2). What is the nearest to q in 3, f, 0.3? 0.3 Let o be ((-1)/8)/(2/6). Let c = -0.1 - 0.9. Let g = -87 - -92. What is the nearest to c in o, g, -0.2? o Let i = -88 + 77. Let s = -18 + 19. What is the nearest to s in i, -4, 0.2? 0.2 Let i = -32 + -17. Let x = 44 + i. Which is the nearest to -0.2? (a) -1 (b) -0.8 (c) x b Let i = -1405 - -1404. Which is the closest to 0.03? (a) -1/8 (b) -3 (c) i (d) 0 d Let p = -152 + 29. Let o = -120 - p. Let q = 0.3 - 0.4. Which is the closest to q? (a) 2 (b) -0.1 (c) o b Let n = 130.02 + -127. Let z = n - 3. Let t = -0.08 - z. Which is the nearest to 1? (a) -4 (b) -3 (c) t c Let a = 1.97 + 0.03. What is the closest to -19 in a, -0.5, -4? -4 Let d = -17.08 + 1.78. Let f = d + 15. Which is the closest to 1/7? (a) f (b) -5 (c) 2/11 c Let p = -204 - -204.1. Let m be (-4)/(-8) + 3/(-22). What is the nearest to p in 4, m, 1/4? 1/4 Let w be 6/8 + 2094/(-2760). Let m = -47/115 - w. What is the closest to -1/5 in 2/17, m, 4? m Let h = -0.47 + 3.47. What is the closest to 0.2 in -4, 0.7, h? 0.7 Let w = 124/3 - 42. Let m(g) = -22g - 132. Let v be m(-6). Which is the closest to w? (a) 0.2 (b) v (c) -3 b Let b be (13/(-3003)7)/(1/6). Let u = -1 - 0. What is the closest to u in 4, -0.4, b? -0.4 Suppose -3m - 39 = -4t, 22 = 2t + m + 15. What is the nearest to 1 in t, 0.3, -0.2? 0.3 Let l be 4/63/(-13). Let s = 290 - 293. Which is the nearest to 1? (a) l (b) s (c) -1/4 a Let d = -0.948 + -0.052. What is the nearest to 46 in d, 5, -2? 5 Let o = 0.772 - 0.172. What is the nearest to 3 in -2/17, o, 0? o Let x = -140 + 137. Which is the nearest to -22? (a) 5 (b) x (c) -1 (d) 1/4 b Let w = 0.4 + -0.5. Let z = w - -0.14. Let y = 1.96 + z. What is the closest to 3/2 in -0.5, y, 3? y Let y(v) = 5v. Let h(g) = 10g. Let t(x) = 4h(x) - 7y(x). Let s be t(2). Let m = s - 9. Which is the nearest to 0? (a) m (b) 0.5 (c) -2 b Let x be 4 + (-3)/33. Let c = 0 - -2. Let j = 84 + -88. What is the nearest to x in j, 0.5, c? 0.5 Let u = 1 - -2.5. Let y = 4 - u. Let d be (-3 - 3)/((-27)/(-18)). Which is the closest to 0.3? (a) y (b) 1/8 (c) d b Let a = 783 + -783. What is the nearest to a in -1/2, -2/7, -65? -2/7 Let q = -1569 - -1574. What is the nearest to 1 in -28/5, -6, q? q Let u = -2.8 + 84.8. Let k = 81.7 - u. Which is the nearest to k? (a) 5/2 (b) 3 (c) -3 c Let x = 13 - -39. Let z = -46.6 + x. Let a = z + -0.4. What is the closest to 1 in -1/2, a, 1? 1 Let l = -2430 - -2430.1. Suppose i - 5c = 2i - 22, -2i + 2c - 16 = 0. What is the closest to -0.05 in l, 2, i? l Let g = 29 - -56. Let t = -87.8 + g. Which is the nearest to 0? (a) 3 (b) t (c) 1 c Suppose -2i = -d + i - 9, 0 = -2d - 2i + 22. Let u(s) = s*3 - 5s*2 - 8s + 13. Let h be u(d). Which is the closest to 1? (a) -4 (b) -1 (c) h c Suppose 3u - n + 21 = 0, -4u - 2n - 9 - 19 = 0. Which is the nearest to u? (a) 3 (b) -5 (c) 5 b Let z = -98 - -101. Which is the nearest to 0.2? (a) -2/9 (b) -1 (c) z a Let g = 4 - 2. Let x be 8/(-12)-3 - 0. Let i be x2/(-28)1. Which is the closest to -2/3? (a) i (b) -1 (c) g b Let t = -7.9 - -11. Let k = 2.9 - t. Which is the nearest to 1/3? (a) k (b) 1 (c) 0.1 c Suppose -5t - i = -t + 81, t = i - 24. Let c be (-14)/t - (-14)/(-12). What is the closest to c in -0.4, 0.4, 3? -0.4 Let b = 0.4 + -3.9. Let s = 3.6 + b. What is the nearest to s in -0.2, -0.4, -3/4? -0.2 Let p = -1096 + 1099.995. Let j = p + 0.005. Which is the closest to -2/9? (a) -0.5 (b) 3 (c) j a Let o be 6/(-10)(-155)/(-465). Let k = -31/120 - -2/15. What is the nearest to k in o, -3/8, -0.4? o Suppose 0d = 5d. Let h = -6 - -5.4. Which is the nearest to d? (a) 2 (b) h (c) -1/3 c Let m = 18 + 59. Let v = -77 + m. Which is the nearest to 1? (a) 3 (b) v (c) 5 b Let k = -53.08 - -35.2. Let v = -41 - -23. Let j = v - k. What is the nearest to -0.1 in j, -2/13, 1/2? j Let l = 561 - 562. Which is the closest to 7? (a) -2/7 (b) 5 (c) 0.5 (d) l b Let g be (-57 - -54)(-8)/(-18)3. What is the closest to -3 in -3, 0.4, -2/13, g? -3 Let j(t) = -60t + 484. Let i be j(8). Which is the closest to -1/2? (a) i (b) -2 (c) -12/7 c Suppose 0 = -6q + 20 - 14. Which is the nearest to -2/7? (a) q (b) -14/3 (c) -2 a Let k = 176.3 + -31.3. Let h = 144.8 - k. What is the closest to 1/3 in 3, h, -5? h Let i be 10/4 + (-115)/46. What is the closest to 0.1 in -4/5, 0.5, i, 4? i Let i = -6/329 - -100/329. Let p(c) = c + 9. Let n be p(-8). What is the closest to 1 in 5, i, n? n Let u = 158/815 + 1/163. Which is the closest to 0.1? (a) -1/4 (b) -0.1 (c) u (d) -0.3 c Suppose -2j - 58 + 58 = 0. Let t = 1.1 + 0.6. What is the closest to 0 in t, j, -3? j Let x be (-3 + (2 - 0))(-9)/(-21). What is the nearest to 0.1 in 1/4, -3, x? 1/4 Let h be 48/7 + (-2 - 5). What is the nearest to 1 in 2/3, -0.2, h? 2/3 Let t = -3 + -2. Let d = 908 + -910. Which is the closest to -1? (a) t (b) -11/5 (c) d c Let h = 2.227 + -0.227. What is the closest to 1 in 5, h, -1? h Let x = -32.7 + 32. Let m = -0.74 - x. Which is the nearest to 0? (a) 3 (b) m (c) -2 b Suppose 0x = -5r + 4x - 13, -4 = -2x. Let p = -0.86 + -1.14. What is the closest to r in p, 5, -0.1? -0.1 Let t be (-8)/(-18) - (-266)/(-315). Which is the nearest to 1/4? (a) 0.11 (b) t (c) 0.05 a Let u = 339 + -338. What is the nearest to u in 1/6, -3, 1/3? 1/3 Let t be (-2)/1 + 73335/35. Let z = -2098 + t. Let o = z - -179/35. Which is the closest to 2/7? (a) -5 (b) 0 (c) o c Let j = 2757.8 + -2757. What is the nearest to 0 in j, 7/3, -2/15? -2/15 Let h = -19.94 + 20.37. Which is the closest to -2/5? (a) 0.5 (b) -5 (c) h c Let m = 0.78 + -0.38. Let h(i) = -i*3 - 3i*2 + 5i + 5.	{ "pile_set_name": "DM Mathematics" }
, 1. -3, 1, 5, 35 Put -1, -3, 1, -13 in decreasing order. 1, -1, -3, -13 Put -27, -3, -1, 0.5 in decreasing order. 0.5, -1, -3, -27 Put -4, 5, -23 in increasing order. -23, -4, 5 Sort -10, 0.4, -0.4, -0.03 in decreasing order. 0.4, -0.03, -0.4, -10 Put -0.3, 0.017, 1/2, -3 in ascending order. -3, -0.3, 0.017, 1/2 Put 6, 2, -0.05 in increasing order. -0.05, 2, 6 Put 8, 3, 3/4, -0.3, -6 in descending order. 8, 3, 3/4, -0.3, -6 Sort 5, 4, 19 in increasing order. 4, 5, 19 Put 7, 5, 2, -3 in descending order. 7, 5, 2, -3 Sort -8, 2, -11, -1, 1 in descending order. 2, 1, -1, -8, -11 Sort 1, -4, 0, -35 in decreasing order. 1, 0, -4, -35 Sort -4, 429, -1 in descending order. 429, -1, -4 Put 1.2, -124, 0.5, 1 in ascending order. -124, 0.5, 1, 1.2 Sort -84, 5, 10, 0 in ascending order. -84, 0, 5, 10 Sort 32, -17, 4, 2. -17, 2, 4, 32 Put 4, -332, -4, -2, 2 in ascending order. -332, -4, -2, 2, 4 Put 2/7, 17, -33 in increasing order. -33, 2/7, 17 Put -2.8, 1/2, 0.1, 1 in decreasing order. 1, 1/2, 0.1, -2.8 Sort 3, -4, -0.2, -0.4. -4, -0.4, -0.2, 3 Put 5, -846/11, 3/2 in decreasing order. 5, 3/2, -846/11 Put 4, -0.36, 0 in descending order. 4, 0, -0.36 Put 3, 0, -2, 5, -35 in ascending order. -35, -2, 0, 3, 5 Sort 4/187, 3/7, -0.2, -1/4, -3/5 in ascending order. -3/5, -1/4, -0.2, 4/187, 3/7 Sort -11, 1, 5, -2, 52 in decreasing order. 52, 5, 1, -2, -11 Sort 6, 62, -3, -4 in descending order. 62, 6, -3, -4 Sort 1, -2, 5, -4 in decreasing order. 5, 1, -2, -4 Put -4, 2171, -3 in ascending order. -4, -3, 2171 Sort 3, 5, -4, -2. -4, -2, 3, 5 Put -2/49, -3, 5/2, 8 in ascending order. -3, -2/49, 5/2, 8 Sort 5, -4, 42 in increasing order. -4, 5, 42 Sort -1, -3, 146, 2 in decreasing order. 146, 2, -1, -3 Sort -1/6, 5, 625, -0.1 in increasing order. -1/6, -0.1, 5, 625 Sort -5, 5, 30, 4 in descending order. 30, 5, 4, -5 Put -69, -8, 0 in descending order. 0, -8, -69 Sort 3, 28, -15 in decreasing order. 28, 3, -15 Sort -0.5, -4, -2, -5 in descending order. -0.5, -2, -4, -5 Sort -0.4, 8/5, 0.4, -2, -18 in descending order. 8/5, 0.4, -0.4, -2, -18 Sort 4, 27, 12, 5. 4, 5, 12, 27 Sort -4, 2, 4, -5, 142 in increasing order. -5, -4, 2, 4, 142 Sort -4, 66, 4 in increasing order. -4, 4, 66 Sort -4, 3, -2, -39, -41 in decreasing order. 3, -2, -4, -39, -41 Sort 1, 131, 13, 2, -1 in ascending order. -1, 1, 2, 13, 131 Sort 1, -0.4, 0.11, 0.2, 1.1 in decreasing order. 1.1, 1, 0.2, 0.11, -0.4 Put 4, -1349, -4 in increasing order. -1349, -4, 4 Put -7, -3, -5, -35 in ascending order. -35, -7, -5, -3 Sort -0.22, 1/2, -0.17 in ascending order. -0.22, -0.17, 1/2 Sort -1, 17, -49 in descending order. 17, -1, -49 Put -0.2, 0, 26, 0.2, 0.1 in ascending order. -0.2, 0, 0.1, 0.2, 26 Put 0, 5, 89 in increasing order. 0, 5, 89 Sort 3, -5, 5 in increasing order. -5, 3, 5 Sort 5, 12, 0 in increasing order. 0, 5, 12 Sort -5, -2, 173, 2, 0. -5, -2, 0, 2, 173 Sort 127, 5, 1. 1, 5, 127 Sort 28, 3/2, 4. 3/2, 4, 28 Sort -2, 5, 754 in decreasing order. 754, 5, -2 Sort -5, 18, 5, -1 in decreasing order. 18, 5, -1, -5 Sort 106, -4, 4, 1 in descending order. 106, 4, 1, -4 Sort -4, -9, 4. -9, -4, 4 Put 1, 0.051, 2 in decreasing order. 2, 1, 0.051 Sort 0.2, -48, -5. -48, -5, 0.2 Sort 2, 1/67, 0 in increasing order. 0, 1/67, 2 Sort -60, 1/4, -2/13 in ascending order. -60, -2/13, 1/4 Put -0.05, -2/5, 19 in decreasing order. 19, -0.05, -2/5 Sort -1, 0.3, 4, -3.1 in decreasing order. 4, 0.3, -1, -3.1 Sort 24, -1, 0, 0.4. -1, 0, 0.4, 24 Put 248, -5, 14 in ascending order. -5, 14, 248 Put -6/17, -2/23, 2/63 in decreasing order. 2/63, -2/23, -6/17 Put 0, -0.3, 1, -1 in descending order. 1, 0, -0.3, -1 Put -0.07, -1, 13, 0.4 in increasing order. -1, -0.07, 0.4, 13 Sort 2, 7, 0.8. 0.8, 2, 7 Sort 3.4, 3, -20/3 in ascending order. -20/3, 3, 3.4 Sort 0, 4, 379, 1 in descending order. 379, 4, 1, 0 Sort 2, 0.4, 1/2, 0. 0, 0.4, 1/2, 2 Put -7, 74, 0, 3 in decreasing order. 74, 3, 0, -7 Sort 5, 4, -1501 in descending order. 5, 4, -1501 Sort -4/3, -1, -0.111, 4, -2/3 in increasing order. -4/3, -1, -2/3, -0.111, 4 Put 2/37, -754, -2/7 in increasing order. -754, -2/7, 2/37 Sort -5, 1, 5, 2/11, -3/2. -5, -3/2, 2/11, 1, 5 Sort -0.1, -4, -4045 in decreasing order. -0.1, -4, -4045 Sort 1/3, -1, 0.117 in decreasing order. 1/3, 0.117, -1 Put 6, 2, 1/11 in increasing order. 1/11, 2, 6 Put 4, -6374, 0.2 in descending order. 4, 0.2, -6374 Put 2, 62, 0 in decreasing order. 62, 2, 0 Put 0.2, 0.038, 0 in decreasing order. 0.2, 0.038, 0 Put 25, 3/7, 0.2, 0.5, 1/7 in descending order. 25, 0.5, 3/7, 0.2, 1/7 Put 2, 6, -5 in descending order. 6, 2, -5 Sort -1, 4, -2694, -2 in decreasing order. 4, -1, -2, -2694 Sort -28, 5, 2, -5 in ascending order. -28, -5, 2, 5 Put 0.4, -1/3, -4, 30, -3 in increasing order. -4, -3, -1/3, 0.4, 30 Put 3, 0, 2, -4 in descending order. 3, 2, 0, -4 Sort 2, 0.3, 7 in increasing order. 0.3, 2, 7 Put -3, 0, -295 in decreasing order. 0, -3, -295 Put 0.8, 0, -2, -1 in ascending order. -2, -1, 0, 0.8 Sort -75, -3, 3 in increasing order. -75, -3, 3 Sort 5/2, 0, 2, 4. 0, 2, 5/2, 4 Put -1/3, 2/71, 1 in descending order. 1, 2/71, -1/3 Sort 3, -583, -3. -583, -3, 3 Put 362, -5, 2 in descending order. 362, 2, -5 Put -1, -14, -3, 23 in increasing order. -14, -3, -1, 23 Sort 8, 13, -3, 2, -4. -4, -3, 2, 8, 13 Sort 3, -3, -5, 1/7, -0.2 in decreasing order. 3, 1/7, -0.2, -3, -5 Sort -3, -1/6, 0.034, -1, 1. -3, -1, -1/6, 0.034, 1 Sort -0.5, 1/2, 6, 1/89, 3. -0.5, 1/89, 1/2, 3, 6 Sort -3, 8, 3, 6 in decreasing order. 8, 6, 3, -3 Put -5, 0, 1, -17, 5 in increasing order. -17, -5, 0, 1, 5 Sort -6, -1, 2, 8 in increasing order. -6, -1, 2, 8 Sort -195, -5, -16 in decreasing order. -5, -16, -195 Sort -0.2, 1/7, -527 in decreasing order. 1/7, -0.2, -527 Put -2/7, 0.5, 0.7, -2/39 in decreasing order. 0.7, 0.5, -2/39, -2/7 Sort -3, 4, -2, 0.5, 14 in descending order. 14, 4, 0.5, -2, -3 Sort -1, -4, 5, 0 in descending order. 5, 0, -1, -4 Put -3, -2, 3, 16, -4 in increasing order. -4, -3, -2, 3, 16 Put 5, 3, -12, 0, 42 in increasing order. -12, 0, 3, 5, 42 Sort 3, -5, -93, 1. -93, -5, 1, 3 Sort -10, -4, 3 in decreasing order. 3, -4, -10 Sort -76, -5, -14 in ascending order. -76, -14, -5 Sort -0.5, 0.4, -3/8, 1/16, 0.1 in ascending order. -0.5, -3/8, 1/16, 0.1, 0.4 Sort 10, 0, 4. 0, 4, 10 Sort 4, 12, 20. 4, 12, 20 Put 4, 2, -7, 1 in decreasing order. 4, 2, 1, -7 Put -43, 2, -0.1 in decreasing order. 2, -0.1, -43 Sort -1, -55, 4. -55, -1, 4 Put -0.3, -0.5, -4, 14/9 in decreasing order. 14/9, -0.3, -0.5, -4 Sort 0.097, -2/9, 1 in ascending order. -2/9, 0.097, 1 Sort 3, 5, 47, 4 in ascending order. 3, 4, 5, 47 Sort 4, -20, -4 in ascending order. -20, -4, 4 Put -3, -14, 2, -15 in increasing order. -15, -14, -3, 2 Put 3, -37, 1, -6 in decreasing order. 3, 1, -6, -37 Sort -5, 1, -1, 40 in descending order. 40, 1, -1, -5 Put -31, -4, 29, -2, 2 in decreasing order. 29, 2, -2, -4, -31 Sort -4, 3015, 1, -2 in decreasing order. 3015, 1, -2, -4 Sort 0.3, -5, 3. -5, 0.3, 3 Put -2/11, -1/4, -3, 0.4 in descending order. 0.4, -2/11, -1/4, -3 Sort 2/9, 1, -0.5, 4, 1/32 in descending order. 4, 1, 2/9, 1/32, -0.5 Put 29, -2, 0, 2/15 in decreasing order. 29, 2/15, 0, -2 Put -19, -35, 3/7 in increasing order. -35, -19, 3/7 Sort 0.3, 1, 82/31 in decreasing order. 82/31, 1, 0.3 Put -3, 0, 5, 10.7, 2/11 in ascending order. -3, 0, 2/11, 5, 10.7 Put -0.4, -3, 71, -0.5 in increasing order. -3, -0.5, -0.4, 71 Sort 0.09, -3, 3, -0.4, -0.5. -3, -0.5, -0.4, 0.09, 3 Sort 0, 1, 231. 0, 1, 231 Put 6, -2, 743 in increasing order. -2, 6, 743 Put 13, 2/5, 207 in increasing order. 2/5, 13, 207 Sort -3, -4, -1/254, -1/2 in increasing order. -4, -3, -1/2, -1/254 Sort 1/2, -1/6, -1/23, -2 in decreasing order. 1/2, -1/23, -1/6, -2 Put 2/5, -0.1, -2/21, -1 in decreasing order. 2/5, -2/21, -0.1, -1 Put 5, 4, 8, -13, -2 in ascending order. -13, -2, 4, 5, 8 Put 1444, -4, 0 in increasing order. -4, 0, 1444 Put 0, -10, -4, -1 in increasing order. -10, -4, -1, 0 Put 4, 68, 9 in decreasing order. 68, 9, 4 Sort -1, -164, 0. -164, -1, 0 Put -1, 0, -5, 23 in descending order. 23, 0, -1, -5 Sort 0, 1, 16 in descending order. 16, 1, 0 Put -3/4, -2/9, -60, -4, -5 in increasing order. -60, -5, -4, -3/4, -2/9 Sort -5, -4, 5, -8. -8, -5, -4, 5 Sort 3, -0.1, 1/2, 2/9 in increasing order. -0.1, 2/	{ "pile_set_name": "DM Mathematics" }
24 = -703g + 508g - 1297g for g. 47 Solve -1069 + 3630 = -197t for t. -13 Solve -30o - 368o - 153o + 31407 = 0 for o. 57 Solve -942y = 16523 + 73909 for y. -96 Solve 0g + 123g - 12g + 4551 = 0 for g. -41 Solve -891a + 190a = 103a - 14524 + 4072 for a. 13 Solve -51l - 10l = 51l - 6l - 2120 for l. 20 Solve -46r - 3808 = 13r + 34r + 5678 for r. -102 Solve 0 = -569o - 168o - 13o - 648o + 30756 for o. 22 Solve 136500 = -7391w - 129576 for w. -36 Solve 500y + 213512 = -371y - 1182y for y. -104 Solve 0 = 417v + 3631v - 73v - 99381 - 27819 for v. 32 Solve 0 = 77135w - 77107w + 980 for w. -35 Solve 184 + 230 = -18j for j. -23 Solve 17335j - 858703 = 146727 for j. 58 Solve 10510 + 4306 - 4615 + 2734 = 199s for s. 65 Solve -12514 = 731f + 386f - 17818 - 18153 for f. 21 Solve 229y - 92469 - 165051 = -2826y + 95y for y. 87 Solve -1459285 - 184425 = 23553k - 245717 + 863095 for k. -96 Solve 487c + 99372 = -129c - 658c for c. -78 Solve -17374 = 3152k + 14146 for k. -10 Solve -274d + 23300 = 476d - 517d for d. 100 Solve 62677 = -925u + 19202 for u. -47 Solve 2321u + 83u = -239u - 105720 for u. -40 Solve -111h - 308670 + 311001 = 0 for h. 21 Solve 0 = 1036694h - 1036649h - 225 for h. 5 Solve -1517y - 7285 = -90y - 55803 for y. 34 Solve -1000n - 858n - 878n + 2592n = -6192 for n. 43 Solve -5586 = -106w - 1346 for w. 40 Solve 1917 = 333z - 12069 for z. 42 Solve 0 = 1440m - 5699 + 57539 for m. -36 Solve 0 = 3293i - 20994 - 48159 for i. 21 Solve 1004l - 1576l = -764l - 8832 for l. -46 Solve -53k + 1907 = -478 for k. 45 Solve -390z + 1166z = 357z + 360z - 649 for z. -11 Solve 127v + 137 = -9v - 14v + 13v for v. -1 Solve 49731 = 11617v - 10173v - 2253 for v. 36 Solve 86j = 3j - 39j - 155j + 29639 for j. 107 Solve 548020 - 546484 = -96w for w. -16 Solve 34980 = -511a + 48266 for a. 26 Solve -6525p - 133059 = -22134 for p. -17 Solve 6720 = -93784l + 94008l for l. 30 Solve -587f - 204f + 96f - 13781 + 48531 = 0 for f. 50 Solve 0 = -6436k + 1785k + 306966 for k. 66 Solve -99498 - 67887 = -2319q + 15816 for q. 79 Solve -11894 - 907 = -462s + 1521 for s. 31 Solve -11040 = 15a - 11625 for a. 39 Solve -25r - 73r - 1707 - 1857 = 1924 for r. -56 Solve -81j - 155 = -884 for j. 9 Solve -898 + 726 = -1039f + 2059 + 1925 for f. 4 Solve 0 = 730s + 12375 + 22665 for s. -48 Solve 236388q - 235959q = -23166 for q. -54 Solve -116v = -5041 + 4345 for v. 6 Solve -210 - 40 = -19s + 87 - 14 for s. 17 Solve 0 = 48188l + 48104l - 96402l - 5390 for l. -49 Solve -45b = 84b + 120b + 9b - 516 for b. 2 Solve 89p = -51p - 198 + 2998 for p. 20 Solve -11211 = 2458a + 1395a + 1669a + 5355 for a. -3 Solve -241v + 16382 - 15418 = 0 for v. 4 Solve 41c + 19c - 990 = 5c for c. 18 Solve -8414f - 8763 = -8345f for f. -127 Solve -198359 = -1756j - 49099 for j. 85 Solve -2857c - 25589 = 185615 - 45498 for c. -58 Solve -160v - 851v = -260v for v. 0 Solve 0 = 46l + 21833 - 20775 for l. -23 Solve -74m - 90050 = -89014 for m. -14 Solve 3015 = -90x - 55x + 22x - 78x for x. -15 Solve 56b + 2574 = 200b - 1007 - 883 for b. 31 Solve 0 = -627g - 39354 - 1151 + 8528 for g. -51 Solve 105s + 1785 + 304 - 978 = -1619 for s. -26 Solve -806b + 2248b + 28840 = 0 for b. -20 Solve -1163 = -82d + 426 + 611 + 998 for d. 39 Solve -125t + 212t - 1470 = 136t for t. -30 Solve -35574 = -589f + 148f + 78f for f. 98 Solve 31925i - 30946i = -50908 for i. -52 Solve 474312n - 110000 = 476312n for n. -55 Solve 354l + 114l + 401l = -146l - 48720 for l. -48 Solve 35330042 = -269p + 35291306 for p. -144 Solve -77289v + 76987v - 12080 = 0 for v. -40 Solve -19x - 184 + 6 = -45 for x. -7 Solve 986w + 4184 = -3839 - 5781 for w. -14 Solve 13156 = -9123g + 9031g for g. -143 Solve -118m - 8514 = 337m + 344m + 147m for m. -9 Solve 140q - 164q + 65q = -39q for q. 0 Solve -33t + 1140 = -16t + 21t for t. 30 Solve 11124 = 71b + 321b + 20b for b. 27 Solve -79168 = -315j + 43j - 965j for j. 64 Solve 613 + 375 = -31a + 197a - 8 for a. 6 Solve 112o - 333o = 7514 for o. -34 Solve 0 = 2228214s - 2228482s + 20904 for s. 78 Solve 10915a + 4914 = 10978a for a. 78 Solve 1032v + 443404 = 543508 for v. 97 Solve 0 = -156j - 604j - 5021 - 29939 for j. -46 Solve -178w - 9451 = 267 - 118 + 3928 for w. -76 Solve -978298g - 18354 = -977976g for g. -57 Solve 44a + 140 = -10a + 68a for a. 10 Solve -814p + 28138 - 19022 = -39724 for p. 60 Solve 2020 + 15630 = -1090f - 1256 - 3984 for f. -21 Solve -249n + 1403 = -167 + 76 for n. 6 Solve -94c + 610c = -433c + 11388 for c. 12 Solve 0 = 30z - 368 - 472 for z. 28 Solve -1736 + 7211 = -219x for x. -25 Solve -79v - 317v - 12960 = 273v + 195v for v. -15 Solve -3229r + 55354 - 6257 = -1536r for r. 29 Solve 0 = -104k - 149721 + 158769 for k. 87 Solve -1789v - 140196 = -5076v - 1720v for v. 28 Solve -928878 = 85n + 183n + 7046n for n. -127 Solve -4174 = 299418w - 299253w + 1931 for w. -37 Solve 8463y - 39183 = 8816y for y. -111 Solve 77544d + 271490 = 74350d for d. -85 Solve -119x - 57018 + 1794 = 648x for x. -72 Solve -80k - 3605 = 30k + 24k + 3363 for k. -52 Solve -3403x = 5208x + 284163 for x. -33 Solve -171g + 122g + 37630 = 524g + 137g for g. 53 Solve -169y = 38y + 9561 + 263 - 95 for y. -47 Solve 1042o + 24247 + 90373 = 0 for o. -110 Solve 1553m + 15369 = 1226m for m. -47 Solve 3169924 = -56y + 3169532 for y. -7 Solve 6917b - 54425 + 59368 = -617587 for b. -90 Solve 191369y + 1211 = 191196y for y. -7 Solve 1354x + 110792 = -1164x for x. -44 Solve -570t + 20556 = 103t + 128t - 63549 for t. 105 Solve 0 = 404886r - 404860r + 988 for r. -38 Solve -24395s - 11952 = -23731s for s. -18 Solve -7254h - 2550h = 3151h + 909h + 69320 for h. -5 Solve 209i - 591i - 1886 = -296i + 694 for i. -30 Solve 364g + 349485 = 4235g + 101741 for g. 64 Solve 0 = -7322v - 253382 - 376773 - 387603 for v. -139 Solve 1568 = -335u - 2452 for u. -12 Solve 70v + 3060 = -59v + 27v for v. -30 Solve 0 = -2833o + 1202o for o. 0 Solve -12040l + 484896 + 285039 = -492799 + 323614 for l. 78 Solve -1987s - 8697 = 932s + 45160 + 48308 for s. -35 Solve 5505n - 4950n + 15529 + 11666 = 0 for n. -49 Solve 1528s + 62321 + 58250 - 1681 = -69054 for s. -123 Solve -876b + 135699 - 8190 = 3993 for b. 141 Solve 89032v - 84123v = -250359 for v. -51 Solve 45223 + 7432 = 2264b - 18366 - 71611 for b. 63 Solve -140x + 6622 = 48x - 68x + 34x for x. 43 Solve 3358 = 116m - 1597 - 1483 - 1914 for m. 72 Solve 379a + 1498 - 410 = -807 for a. -5 Solve 1138t - 45124 = -782t - 192964 for t. -77 Solve -219070g + 219366g - 12002 = -41602 for g. -100 Solve 31q + 443q = -1754q - 374q + 26020 for q. 10 Solve -977b + 513b - 1275 - 7924 - 1473 = 0 for b. -23 Solve 45466 = 82s + 46532 for s. -13 Solve -550o - 676o = 481o + 56331 for o. -33 Solve -341z + 118z = 1830z + 117021 for z. -57 Solve -761222 = 186o - 759176 for o. -11 Solve 569011 - 6908 = -2257u - 2724u + 9212 for u. -111 Solve 0 = -178u + 238u - 1856u + 95188 for u. 53 Solve 135x + 2977 = 637x + 15954 + 11119 for x. -48 Solve 182c + 6834 = -254c - 6876 - 242 for c. -32 Solve 0 = -154i + 71038 - 60566 for i. 68 Solve 0 = 359m + 977472 - 967061 for m. -29 Solve 39h = 149h + 51h + 96h - 2827 for h. 11 Solve -257l + 269l = 24 for l. 2 Solve -2021v + 52466 - 6662 = -633v for v. 33 Solve -7364 = 252r - 3171 + 7903 for r. -48 Solve 0 = -442o - 1319731 + 1373655 for o. 122 Solve -238u - 2155 - 4491 = 18 for u. -28 Solve 468x + 5084 - 6001 + 11573 = -9468 for x. -43 Solve 233l + 2841 + 8791 = 789 + 1290 for l. -41 Solve -427a - 26a - 19422 = 89a + 537a for a. -18 Solve -2968o - 612044 = 8409o - 2614o - 182657 for o. -49 Solve 185446 = 134i - 178897 + 350273 for i. 105 Solve 20677n + 1553998 = -2517n for n. -67 Solve -1259h + 627h + 636h - 1 = -117 for h. -29 Solve 1537 - 6565 - 7798 = -393o + 3680 for o. 42 Solve -615j - 76536 = 74j - 2124 for j. -108 Solve -5965o = 8724o + 977972 + 250282 + 5622 for o. -84 Solve 507j - 285j = -141j for j. 0 Solve 66a + 3094 - 778 = -127a for a. -12 Solve 0 = -310a -	{ "pile_set_name": "DM Mathematics" }
111 What is ((-125895)/44)/(-109)44/11? 105 What is (170/16(-11220)/(-47685))/(745/(-4))? -2/149 Calculate (-38)/589-314. 8 Evaluate (-57)/228384/(-40). 12/5 What is (2/16)/(35/350390/(-36))? -3/26 What is (-13)/(326/(3614/378))? -2/163 What is the value of (6300/4050)/(42/9)-225? -75 What is (-4526/(-4095))/(((-2192)/(-14))/(-8))? -2/137 Evaluate 3(-147)/(568890/172)(6/16)/3. -1/60 (75/(-6))/(-5)936/(-3510)351/(-130) 9/5 (-1935)/1548(3/(-90))/((-5)/(-140)) 7/6 What is (76/3(-165)/88)/(((-1504)/64)/(-47))? -95 Evaluate (-1704)/(-1988)10/(340/(-14)). -6/17 What is the value of 22/((-418)/(-380)6)? 10/3 37/((-4218)/(-9))9/(108/32) 4/19 What is the value of 15/((-80)/37440-270)? 26 Evaluate 6160/(-768)(-4)/(-6). -5/6 What is the value of (-9)/(-1)53/((-63918)/(-2278))? 17 5/(-5)((-38)/228)/(2/(-72)-2) 3 (36/(-30))/(54/72) -8/5 Calculate (-2)/(-1)378/1386187/(-14382). -1/141 What is 30(-68)/(-600)(-10)/(-22)22? 34 What is (1/(-2)16)/(2009/287)? -8/7 Calculate (280/(-392))/(((-44)/14)/22). 5 Calculate (-3)/(55/20(-1)/((-5)/(-20))). 3/11 What is (-441)/(-18)(-230)/805? -7 Calculate 587048/10483(-2)/208. -7/13 Evaluate ((364/(-65))/7)/((-7)/(-140)(-56)/4). 8/7 Calculate (-29120)/(-3920)7/2. 26 Evaluate 1-4345/1803. -23 What is ((-560)/(-25))/2(-10)/(-44)-11? -28 What is the value of (-104)/104019/(1045/22)? -1/25 Calculate ((27/(-42))/(-3))/((2/10)/(18/315)). 3/49 (((-9)/(-9))/((-21)/28))/((-14)/1428-17) -8 Calculate (-3)/(9/7)-6075/750. 14 ((60/32)/(-5))/((-3)/(-10))52480/3312800 -2/101 What is the value of (71148/(-882))/(33/(-9))? 22 Calculate (111)/(7(-54)/2079(-22)/16). 44 (32(-47)/(-3760))/((-1)/((-20)/(-24))) -1/3 1377/(-1377)((-4)/8-12)/37 -6/37 What is the value of 48/(-63)-1(-216)/288? -4/7 Calculate -5(-442)/(-340)-126/(-585)-5. 4 Calculate ((-6)/4)/((124/(-174406))/((-120)/2610)). -97 Evaluate 17/((-459)/(-18))51/(-4)226/(-113). 17 ((-102)/68)/((-2)/42)12/(-7) -54 15(-52)/112710-17 2/17 806/(-4030)220/(-2) 22 Evaluate (((-3)/(-6))/(9(-4)/(-72)))/(294/(-12)). -2/49 Evaluate (20930/(-780))/((-14)/(-6)). -23/2 What is ((-28)/6((-3456)/112)/36)/(-298)? -2/149 Calculate 10/159/2(-1210)/(-330). 11 Calculate ((-8)/(1026/(57/(-3))))/(1/(-30)-8). 5/9 Evaluate (252/12)/211(-10)/(-145). 2/29 What is the value of (1/((-126)/(-15)))/(((-36855)/324)/91)? -2/21 Calculate (-43)/(2236/(-1092))5/607. 49/4 What is the value of (1(-4)/12)/(970/5820)? -2 What is 23520/5602/(-12)10? -70 Evaluate (((-68)/23)/1)/((-15786)/181539). 34 Calculate ((-18)/(-39))/(1110/(-312650)). -130 What is (4/(-66))/(-1240/5280)? 2/3 ((-25)/((-7475)/117))/((-15)/35(-105)/(-30)) -6/23 Evaluate (-4)/(-45)(-12)/(-1214)(-3822)/(-728). 1/30 What is the value of 1/(238/(-560)-20)? 2/17 What is 15((48/1020)/(-2))/((-27)/(-45))? -10/17 Evaluate (2811/5153540/(-6))/((-6)/22). 4/3 What is the value of (1/3-14332/3610)/((-4)/110)? 11 90/13202822/231 2/11 What is the value of ((-385)/693)/((-37)/(-666))? -10 Calculate ((-4480)/(-620))/(-56)-31. 4 Evaluate 62128/105918/(-48). -22 (-5)/(-9)-192(-111)/5920 2 Calculate (72/15)/(388/776(-8)/(-30)3). 12 Calculate (-92/(-51))/(-77(-780)/23205). 3/22 What is (-22320)/1302014/(-20)? 6/5 What is the value of ((-9)/1449)/((-881)/20263)? 1/7 (((-1007)/6042)/((-5)/(-9)))/((-6)/1) 1/20 Calculate -238/(-644)-3196/12. -14 What is 3((-68)/48)/1721/(-420)-5? -1/16 What is (54/(6264/(-1450)))/(-40)? 5/16 What is the value of ((-17038)/4868)/(14/(-400))? 100 What is the value of ((-3)/4)/(23/((-621)/36)7/(-224))? -18 What is the value of (1/14-6)/((-6030)/2345)? 1/6 (((-63)/343)/9)/((4/(-4))/119) 17/7 Evaluate ((20/(-200))/(66/2970))/(-1(-1)/12). -54 What is -76(-88)/(-35112)(-14)/(-1)? -8/3 Calculate ((-1)/(-4))/(25/(3500/(-35)))23. -23 (-24)/4511970/(-1140)40/2 112 What is (((-8)/33)/4)/(((-5880)/189)/(-140))? -3/11 (-481)/(-6734)1470/7 15 What is the value of ((-2715)/(-180))/(-181)2/4? -1/24 What is the value of (((-31720)/52)/122)/(50/(-8))? 4/5 20(4175/(-7500))/167 -1/15 Calculate 13/(-25)(-232760)/(-3933644). -2/65 ((-44)/(-88))/((8/44)/((-20)/10)) -11/2 Evaluate 125/(156250/600)-55/(-122). 6/61 What is (-32600)/(-5216)((12/5)/(-3))/(1/(-5))? 25 What is (105/(14490/3496))/(60/(-135))? -57 Calculate (39/(3783/194))/(-2(-3)/267). 89 575/603756/(-5) -2/175 What is the value of (610/31110(-51)/(-12))/3? 1/36 What is the value of ((-1260)/111930)/((-10)/(-410))? -6/13 What is the value of (-6)/88(-688600)/7512? 25/4 What is 22/(-6270)430/(-12)? 2/57 What is the value of (24/32(-10)/(-9)-2)/((-1)/1)? 5/3 Calculate (10/(-6)(-72)/(-24))/((-3685)/2814). 42/11 Calculate (8/13974)/((-21212)/540906). -2/137 (11/(-40))/((17389/(-591226))/((-4)/341)) -11/10 What is (408/1530)/((-4)/(-55))? 11/3 What is (-18275)/2150(-16)/289? 8/17 What is the value of ((-24)/(-108)2)/((-623)/801)? -4/7 What is the value of (32/2(-16)/((-320)/(-45)))/(3/(-2))? 24 What is the value of (-4180)/(-3762)(-5)/((-75)/(-9))? -2/3 Calculate (-626)/(-30361)19/(-76). -1/194 What is the value of (8/(-92))/(((-550)/120)/(-11)(-56)/70)? 6/23 Evaluate (((-790)/100)/79)/(((-10)/(-124))/5). -31/5 (15/(-207))/(113300/(-12360)) 2/253 What is the value of (2236/(-301))/((-186)/(-217))? -26/3 Calculate (-3)/22(-1418)/3545215. 18/11 Calculate (12269/(-135576))/(23/8). -2/63 Evaluate ((1716/3003)/(((-216)/28)/(-1)))/4. 1/54 Evaluate -14(78/(-312))/(1/(-2)). -7 What is the value of ((-288)/(-2376))/((-35)/25288/(-275))? 30/11 Calculate 6/(925/150-12). -3/37 Evaluate (1/(-2))/(((-180)/6150)/((-16)/(-20))). 41/3 7((-32)/8)/2(-55)/35035 2/91 Evaluate -4((-56)/(-36))/((-2)/(-9))1. -28 Evaluate 98/704/(-2)(-595)/(-34). -49 30/(-33)409717/(-239445) 14/9 Evaluate ((-1110)/140-7)/(126/(-84)). -37 Calculate ((-1820)/13104)/(15/126). -7/6 What is the value of ((-27)/1444)/(13/((-8320)/10))-1? -48 276/(-2024)(-5)/((-150)/(-55)) 1/4 What is ((-2)/6-83)/(118/(-177)4/8)? -83 What is (21/(-5))/((52/((-14560)/20))/(10/(-28)))? -21 -3-1068(-35)/(-1260) 89 What is the value of ((-2)/(-102))/((327/218)/(-61-6))? 8/17 Calculate (808/(-6464))/((-20)/(-16)). -1/10 What is (-56097)/2439(18/69)/(-3)? 2 What is the value of (99(-14)/252)/12? -3/8 Evaluate -5(-6)/2258(-95)/(-133)-7. -16/3 Evaluate 2/(-8)-2(-157)/((-802584)/288). 2/71 Calculate (776/(-2037)(-3)/(-14))/(5/5). -4/49 What is 448/64(-400)/70? -40 Calculate 2/((-172)/5)4/(-60)(-2892)/(-241). 2/43 -500-6(-122)/(-6100) 60 Calculate (12/246041)/((-6)/12). -2/5 Evaluate 41409/1840412/(-1). -27 What is (-1359)/42284/6? -3/14 What is 17/10(-1)/(-1445)255? 3/10 What is the value of 10/(480/(-72))((-60)/18)/((-1)/8)? -40 Evaluate (-3804)/8876(-21)/(-6). -3/2 ((8/118)/((-44)/(-33)))/(-6(-15)/20) 2/177 Evaluate (((-378)/420)/(6/170))/((-45)/120). 68 (938/(-804))/(((-1071)/(-36))/17) -2/3 (83880/(-13980))/(2/(-27)) 81 Evaluate (139/(21406/(-1496)))/(3/(-21)). 68 Calculate ((-112)/70)/(61/((-327875)/1204)). 50/7 What is the value of ((-2)/(135/(-165)-1))/((4/30)/1)? -55/3 -26/(-184)243/(2916/(-8)) -1/23 -359/(-48)(-68900)/(-120575) 15/4 What is ((-315)/1806/7)/(48/448553)? -2/79 Calculate (2/761)/(3038/1519). 1/76 What is the value of ((-550)/2200)/((-1)/(10/(-15)-8))? 4/3 Evaluate ((-160)/(-1960)-28)/((-16)/392). 56 14/(252/(-15))(-405)/(-300) -9/8 (46956/3354)/((-2)/8) -56 What is the value of ((1104/10304)/((-9)/21))/((-2)/48-507)? -2/169 What is the value of ((-417430)/(-6591))/((-20)/6)? -19 ((-12)/(-12))/(8/2-13(-8)/13728) 33 Calculate -69/4(230/1242)/(-5). 1/2 What is (2/(6/(2100/(-14))))/(16/(-8))? 25 Calculate (76/(-10355))/(-12(-4)/40)216/72. -2/109 (-9)/(-6)-1520/675 -2/3 (-777)/23311(-105)/104 14 What is the value of 6/12-2158/26122/35? -22/15 What is ((-771)/1285)/(1/(-110))? 66 What is the value of 3((-12)/9)/(784/196)? -1 (((-4)/(-200))/(20/200))/(2260/200) 2/113 What is the value of 1550/(-930)2/40(-10)/8-6? -5/8 Calculate ((-602)/215(-10)/7)/((-15)/90). -24 What is the value of (-3)/155700/(-20)36/54? 38 What is the value of 76/13300-50((-1)/1)/24? 1/84 (1024/(-50688))/((2/21-3)/(60/(-28))) -5/33 Evaluate (51/170*88/(-33))/((-64)/20). 1/4 What is the	{ "pile_set_name": "DM Mathematics" }
out replacement from wwwddwwdwwd. 28/165 Three letters picked without replacement from {n: 18, s: 2}. What is prob of sequence ssn? 1/190 Three letters picked without replacement from qwqwqq. What is prob of sequence qqw? 1/5 What is prob of sequence sk when two letters picked without replacement from {s: 7, b: 2, k: 1, h: 7}? 7/272 Four letters picked without replacement from {l: 4, m: 6, t: 5, z: 5}. What is prob of sequence zmtl? 5/969 Two letters picked without replacement from cjicbbcimibcc. Give prob of sequence cb. 5/52 Four letters picked without replacement from ustgstusbus. What is prob of sequence gsbb? 0 Four letters picked without replacement from qqqfqqqqqfqqqqqf. What is prob of sequence ffqq? 3/140 Four letters picked without replacement from jjjzajjjjhjljahalhah. Give prob of sequence hzah. 2/4845 Two letters picked without replacement from qqqqww. What is prob of sequence qq? 2/5 Three letters picked without replacement from {f: 6, p: 3, a: 4, t: 4}. What is prob of sequence fat? 2/85 Two letters picked without replacement from dffcc. What is prob of sequence cf? 1/5 Three letters picked without replacement from {a: 2, e: 2, j: 2, k: 1, t: 1}. Give prob of sequence akt. 1/168 Three letters picked without replacement from {v: 2, h: 1, o: 1, b: 1, l: 1, s: 1}. Give prob of sequence lvb. 1/105 What is prob of sequence lbbe when four letters picked without replacement from eblb? 1/12 Three letters picked without replacement from {j: 4, i: 2}. Give prob of sequence jjj. 1/5 Two letters picked without replacement from {w: 4, k: 2, b: 6}. Give prob of sequence kw. 2/33 Calculate prob of sequence pk when two letters picked without replacement from {p: 3, d: 2, k: 3, g: 2, z: 6}. 3/80 Three letters picked without replacement from {s: 6, f: 12}. What is prob of sequence ssf? 5/68 What is prob of sequence iir when three letters picked without replacement from {i: 8, r: 5}? 70/429 Two letters picked without replacement from {s: 5, w: 14}. What is prob of sequence ss? 10/171 Four letters picked without replacement from kbbkjjkjzkbtbjtkztyb. What is prob of sequence btjb? 2/969 What is prob of sequence wc when two letters picked without replacement from bwuwcwc? 1/7 Two letters picked without replacement from qqqqqqqzqqqqq. What is prob of sequence qq? 11/13 Two letters picked without replacement from mrbzzzr. Give prob of sequence zb. 1/14 What is prob of sequence eaeq when four letters picked without replacement from {i: 1, m: 8, h: 1, e: 3, a: 2, q: 1}? 1/3640 Three letters picked without replacement from bbrbbprbbb. What is prob of sequence brr? 7/360 Four letters picked without replacement from qqqqqqqqqvqq. What is prob of sequence qqqv? 1/12 Calculate prob of sequence ff when two letters picked without replacement from {f: 2, x: 1}. 1/3 What is prob of sequence gp when two letters picked without replacement from dkpkkpdgngppdpg? 1/14 Two letters picked without replacement from ooooo. What is prob of sequence oo? 1 Two letters picked without replacement from tjttjjtttttjjjjtjtj. What is prob of sequence tt? 5/19 Three letters picked without replacement from qqiqqiiqqiqqiqiiiii. Give prob of sequence qqi. 40/323 What is prob of sequence um when two letters picked without replacement from ympyyuduymymyydmu? 3/68 Calculate prob of sequence vpp when three letters picked without replacement from {v: 6, p: 6}. 3/22 Calculate prob of sequence jjj when three letters picked without replacement from jjajjjjj. 5/8 Two letters picked without replacement from {r: 2, c: 2}. Give prob of sequence cr. 1/3 What is prob of sequence nnr when three letters picked without replacement from rnnn? 1/4 Three letters picked without replacement from {y: 5, f: 3, a: 3, t: 3, h: 1, u: 3}. Give prob of sequence hty. 5/1632 Four letters picked without replacement from {r: 5, x: 5, i: 8}. What is prob of sequence ixii? 7/306 Calculate prob of sequence yo when two letters picked without replacement from {o: 2, y: 1}. 1/3 Calculate prob of sequence ps when two letters picked without replacement from {k: 3, s: 1, j: 4, v: 1, p: 2, i: 1}. 1/66 Three letters picked without replacement from tythhht. What is prob of sequence tyt? 1/35 Three letters picked without replacement from {w: 2, u: 2, z: 2, m: 1, c: 1}. Give prob of sequence zuz. 1/84 Calculate prob of sequence hwh when three letters picked without replacement from hwhjijjjjjjhjejjwjh. 4/969 Three letters picked without replacement from bbkbbbk. What is prob of sequence bkb? 4/21 Calculate prob of sequence ov when two letters picked without replacement from xueeeoveuoo. 3/110 What is prob of sequence ii when two letters picked without replacement from tiitit? 1/5 Calculate prob of sequence kk when two letters picked without replacement from bbknxbbxnnxnekbeb. 1/136 Two letters picked without replacement from llclllcll. What is prob of sequence cl? 7/36 Three letters picked without replacement from {x: 2, w: 1, b: 1}. What is prob of sequence bwx? 1/12 Three letters picked without replacement from aaahaahhaah. Give prob of sequence haa. 28/165 Calculate prob of sequence jjjf when four letters picked without replacement from {f: 2, h: 1, j: 1}. 0 Calculate prob of sequence qm when two letters picked without replacement from {k: 1, q: 1, m: 10, e: 2}. 5/91 What is prob of sequence px when two letters picked without replacement from {x: 8, w: 2, r: 1, p: 5}? 1/6 What is prob of sequence kkgk when four letters picked without replacement from kkkggkggggggggkkggg? 65/3876 Calculate prob of sequence tt when two letters picked without replacement from {g: 7, t: 3, y: 2, q: 3}. 1/35 What is prob of sequence mt when two letters picked without replacement from {m: 6, t: 4}? 4/15 Four letters picked without replacement from {p: 1, g: 2, h: 1}. What is prob of sequence gppp? 0 Calculate prob of sequence qahq when four letters picked without replacement from {q: 2, a: 5, h: 3}. 1/168 Two letters picked without replacement from {l: 2, a: 1, q: 2, r: 8}. What is prob of sequence lq? 1/39 Four letters picked without replacement from rkrkkkrkwwrrrr. What is prob of sequence wkkw? 5/3003 Two letters picked without replacement from mmvpvfrvvvfvvv. Give prob of sequence mp. 1/91 Three letters picked without replacement from llfrlqqmrqq. What is prob of sequence mqr? 4/495 Calculate prob of sequence yl when two letters picked without replacement from ljyjyjjjnjljj. 1/39 What is prob of sequence ylyt when four letters picked without replacement from tylyyolyldyoohool? 1/714 Two letters picked without replacement from {s: 2, j: 4, f: 2, d: 3}. Give prob of sequence dj. 6/55 Calculate prob of sequence zqn when three letters picked without replacement from {r: 1, q: 1, a: 2, z: 2, n: 1}. 1/105 Four letters picked without replacement from {t: 1, i: 2, o: 2, z: 3, a: 2, u: 4}. Give prob of sequence uutu. 1/1001 Calculate prob of sequence cyy when three letters picked without replacement from nnyynnnygyc. 2/165 Two letters picked without replacement from xsbsxxy. What is prob of sequence sb? 1/21 Two letters picked without replacement from {u: 1, d: 2}. What is prob of sequence ud? 1/3 Four letters picked without replacement from {c: 4, p: 3, v: 3, l: 1}. What is prob of sequence cpvp? 1/110 Calculate prob of sequence ll when two letters picked without replacement from {j: 2, l: 9, k: 6}. 9/34 Calculate prob of sequence btx when three letters picked without replacement from bxxxbtu. 1/35 What is prob of sequence tppr when four letters picked without replacement from prrpjtpjjrejeepr? 1/910 What is prob of sequence baaa when four letters picked without replacement from {b: 3, a: 13}? 33/280 What is prob of sequence bkb when three letters picked without replacement from {k: 5, b: 5}? 5/36 Two letters picked without replacement from {s: 7}. What is prob of sequence ss? 1 Calculate prob of sequence aq when two letters picked without replacement from hqphhaadh. 1/36 Three letters picked without replacement from uhhhwwssuwlsclsswhls. Give prob of sequence lch. 1/570 Two letters picked without replacement from pwljlwjllplpjwljwll. What is prob of sequence lj? 16/171 What is prob of sequence xt when two letters picked without replacement from {x:	{ "pile_set_name": "DM Mathematics" }
rth biggest value in 128, 5634, -2/7, 1, 0.01, 3/4? 3/4 What is the second smallest value in 32111, -3, -5, -0.063? -3 What is the biggest value in -5, -1, 0, -18, 10, 3/67? 10 Which is the fourth smallest value? (a) 4.8 (b) 6 (c) -8 (d) -2 (e) 21 (f) 0.02 a Which is the third smallest value? (a) 1311 (b) -1/40 (c) 13/4 (d) -9/2 c What is the fifth biggest value in -2, 0.5, -7/17, -5/2, 5, 3/11, 437? -7/17 What is the sixth smallest value in 0.4, 8/13, -35, 3/2, 6, 1/3? 6 Which is the sixth biggest value? (a) 30 (b) 1/4 (c) 1 (d) 3 (e) 3/28 (f) -0.1 (g) 49 e Which is the third biggest value? (a) -56/19 (b) 5/8 (c) 0.1 (d) 5/4 (e) -0.3 (f) -5 c What is the third biggest value in 6, -647, 4188? -647 What is the third biggest value in 3/4, -6, 59/141? -6 What is the fifth biggest value in -4, -1.21, -12, 2/13, -2/55? -12 What is the fourth biggest value in -7, 5, -49647, -2, -2/3, -3/5, -2/15? -2/3 Which is the fifth biggest value? (a) -12/341 (b) 3/2 (c) -5 (d) -0.1 (e) 0 (f) -0.5 f Which is the biggest value? (a) -4 (b) -33 (c) -0.5 (d) 0.1 (e) -2/11 (f) -475 d What is the fourth biggest value in -1/3, 0.2, 2/9, 3, 44, 1, 0.36? 0.36 What is the fifth smallest value in -17, -1.7, -4/11, -2/21, -0.126? -2/21 What is the third smallest value in 3.42, 994, 2.2? 994 What is the sixth smallest value in -2/23, -2, -218, 0.5, -0.01, -7? 0.5 Which is the fourth biggest value? (a) 9/5 (b) 0.1 (c) 38/5 (d) 0.3 (e) -5 (f) 0.5 d Which is the biggest value? (a) -3/10 (b) 498 (c) -1/4 (d) -0.05 (e) 309 (f) -5 b Which is the fourth smallest value? (a) 14 (b) -0.9 (c) -0.1 (d) -92 (e) 12 (f) 4 (g) -2 c Which is the third smallest value? (a) 56/87 (b) 0.5 (c) 1 (d) -2/1717 a What is the second smallest value in -13, 3/88571, 0.04? 3/88571 Which is the fourth smallest value? (a) 33 (b) 4/13 (c) -116 (d) 4 (e) -2/27 d What is the fourth biggest value in 1/17, 18, 1, -5, 0.39, -20, -6? 1/17 Which is the third biggest value? (a) -2089 (b) -269 (c) 21 a What is the third biggest value in 0.4, 11.5, -0.2, -5, -0.1, -3, 9/8? 0.4 Which is the fourth smallest value? (a) -0.45 (b) -3.9 (c) 6 (d) 7 (e) -6 (f) 1 (g) 5 f Which is the second biggest value? (a) 54 (b) -3/4 (c) 7/11 (d) -0.5 (e) 28 e Which is the fifth biggest value? (a) -6 (b) 4 (c) -15/2 (d) -2/61 (e) 1/5 c Which is the second biggest value? (a) 258.91 (b) -13 (c) 9 c What is the second biggest value in -21.226, 17, -0.1? -0.1 Which is the second biggest value? (a) -0.13 (b) 114 (c) 9 (d) -0.03 (e) -4 (f) 5 c Which is the second biggest value? (a) 0.054 (b) 26 (c) 0 (d) 0.5 (e) -17 d Which is the smallest value? (a) 66 (b) -1/5 (c) -180023 c Which is the smallest value? (a) 4822 (b) -2 (c) 2.07 (d) -5/3 (e) -6 e Which is the third smallest value? (a) -0.4 (b) -1/4 (c) 0.078 (d) 140/437 c What is the fourth biggest value in -2/15, -20/13, 0.38, 3, -12? -20/13 Which is the fifth smallest value? (a) 8184/7 (b) 5 (c) 1 (d) -0.4 (e) -18 a What is the third biggest value in 1, 0.0458, 50, -37/3? 0.0458 Which is the third smallest value? (a) 2 (b) -235 (c) -3/2 (d) -126 c Which is the fifth biggest value? (a) 4.6 (b) -5 (c) 34/15 (d) 1 (e) 6 (f) -1/4 (g) 1/5 g Which is the third biggest value? (a) 0.691 (b) 0.32 (c) -29 c What is the sixth biggest value in 1, -83/2, -0.1, -2/11, 23/5, -5? -83/2 Which is the fourth smallest value? (a) -2071/13 (b) -1 (c) 0 (d) -1/117 (e) -3 d Which is the third smallest value? (a) 22 (b) 601.22 (c) -5 b Which is the fourth biggest value? (a) 5 (b) -5 (c) -740129 (d) 0.3 (e) 1 b What is the second smallest value in -1/25, 0.01, -0.1, 6/89, 23, -0.4? -0.1 Which is the third biggest value? (a) 0 (b) 1/2 (c) -15 (d) -2 (e) -1/667 (f) 5 a Which is the sixth smallest value? (a) -0.2 (b) -2 (c) 1 (d) -89 (e) -3/5 (f) -0.036 (g) 0.1 g What is the biggest value in -1/4, -0.253474, -7? -1/4 Which is the third smallest value? (a) -19507 (b) 89 (c) -2 b Which is the smallest value? (a) -43/7 (b) -65 (c) 4657 b What is the smallest value in 7/5, 3, 155020, 1, 0? 0 Which is the third biggest value? (a) 0.2 (b) -1 (c) 4 (d) 2/3 (e) 0.5 (f) -112433 e Which is the second biggest value? (a) -3 (b) -36 (c) -29369 (d) 1 (e) -1/10 e Which is the biggest value? (a) 3 (b) -18/7 (c) -61.75 (d) 12 d Which is the smallest value? (a) 17 (b) -1/8 (c) 49 (d) 0.1 (e) 1343 (f) 0.2 b Which is the third biggest value? (a) -1/3 (b) -0.2 (c) 3 (d) 1 (e) 3/4 (f) -2145 e Which is the second smallest value? (a) 96 (b) -4 (c) 3/8 (d) -1096 b What is the fourth biggest value in 2, -4/3, 7, -1/4, 97, -112, -0.3? -1/4 What is the second biggest value in -5, -4, 4/15, 69/40, -0.1, 1, -1? 1 What is the fourth biggest value in -3/2, 1/5, 5, -14, -42, 0.4, 6? 1/5 What is the biggest value in 5, 5.925, -575? 5.925 What is the smallest value in 1/8, -57/4, 12, 1487? -57/4 Which is the fourth smallest value? (a) -0.1 (b) 3 (c) -1 (d) 307 (e) 167 e Which is the fifth smallest value? (a) -2037563 (b) -3 (c) -0.03 (d) -2/5 (e) -5 c Which is the fourth smallest value? (a) -0.5 (b) -4 (c) -28 (d) 5 (e) 0.1 (f) 0.0359 f What is the fourth smallest value in 2/11, -2/7, 17/5, 3/4, 2/3, -0.02, 4? 2/3 What is the third biggest value in -4/15, 3723, -51, -5? -5 Which is the smallest value? (a) -4 (b) -12 (c) 7.6 (d) -67 d Which is the seventh smallest value? (a) -66 (b) 2/11 (c) 3 (d) -2.4 (e) -0.5 (f) 2/7 (g) 1 c What is the second biggest value in -0.4, 718/51, -31, -0.01? -0.01 Which is the second smallest value? (a) -5 (b) -20.48 (c) -1203 b Which is the third biggest value? (a) 5 (b) 1 (c) -99 (d) -2/11 (e) 1.57 (f) 0 b Which is the seventh smallest value? (a) 0.1 (b) -1.8 (c) 1 (d) 3 (e) 26 (f) -30 (g) -3/2 e What is the third smallest value in -2/7, -1/5, 3/2, 0.07, -2/13, -2/3073? -2/13 What is the biggest value in 3/4, -50, 44/5, -0.02915? 44/5 Which is the third biggest value? (a) -3329 (b) 33/256 (c) -1/2 a What is the sixth biggest value in -0.5, -4, -3/4, -3/7, 21, 1.4, -102? -4 Which is the sixth smallest value? (a) 2/15 (b) 1 (c) 3/5 (d) 1/33 (e) -115 (f) -76 b What is the third biggest value in 0.5, 212870281, 1? 0.5 Which is the smallest value? (a) 11/6 (b) 2 (c) -8/9 (d) 2485 c What is the fifth smallest value in 3/2, -0.1, -3, 710.9, -2006, 1, -5? 1 What is the fifth smallest value in -5, 6286, 0.9, 0.1, -4/9? 6286 Which is the seventh biggest value? (a) 3 (b) 3.6 (c) -3 (d) -0.2 (e) 1/42 (f) 4 (g) -29 g Which is the second biggest value? (a) -1/23 (b) -6 (c) -375/19 b Which is the third biggest value? (a) 15 (b) 0.15 (c) 1039 b Which is the fourth smallest value? (a) 3 (b) 2.9723 (c) -341 (d) -0.1 (e) -0.3 b What is the third smallest value in 1.584, 13650, -0.3, -4? 1.584 Which is the smallest value? (a) -419 (b) 2/9 (c) -3 (d) -2752 (e) -0.02 (f) 3 d What is the second smallest value in -8/9, -119.4, 2/13, 1, 5? -8/9 What is the third smallest value in -0.19, 5, -0.2, 1306, 4, -0.07? -0.07 Which is the biggest value? (a) -2039 (b) -0.1 (c) -3 (d) -0.2 b What is the fourth biggest value in 3, -12265, 1/3, -2707? -12265 What is the third biggest value in 0.1, 0.03, 0.06, -16.3276? 0.03 What is the fifth smallest value in -1, -1/2, 0.28, -5, -14.459, 0.09? 0.09 What is the sixth smallest value in 6/43, 1285/8, 1, -0.4, -0.1, -0.17, -2? 1 Which is the fourth biggest value? (a) 0 (b) 1/8 (c) -11485 (d) -0.5 (e) 4 (f) 2 (g) -0.4 a Which is the third smallest value? (a) 0.1 (b) -5 (c) -0.4 (d) -17029 (e) 7 (f) 4 c Which is the third biggest value? (a) 462 (b) 1/34 (c) 5/2 (d) -0.9 (e) -0.1 b Which is the fourth biggest value? (a) 0.04 (b) -1.2 (c) -3 (d) 0.1 (e) -22/219 b Which is the third biggest value? (a) 1.7 (b) -278 (c) -0.0224 (d) 14 c What is the sixth smallest value in 51, -1, -0.4, 50, 0, 1099? 1099 What is the fifth biggest value in -3, 0.06, 0.2, 35/8, -1? -3 Which is the smallest value? (a) 0.359 (b) -216/265 (c) -4 c What is the biggest value in -3/4, 3/2, 2908, -3, 0.3, 0, 1/4? 2908 Which is the second bigges	{ "pile_set_name": "DM Mathematics" }
= x + -1.35. Round y to three decimal places. 0.053 Let r = -855.3 - -855.307506. What is r rounded to four decimal places? 0.0075 Let f = -22.05 + 22.05006705. What is f rounded to five decimal places? 0.00007 Let p = 546 + -545.9775. Let m = 0.022967 - p. What is m rounded to four decimal places? 0.0005 Let q = 0.01591823 - -0.32804307. Let b = q + -0.344. What is b rounded to five decimal places? -0.00004 Let v = 153.03354 - 152.91. What is v rounded to 3 decimal places? 0.124 Suppose -i + 25 = -2f - f, 0 = f + 4i + 4. Let k be 4/f + 9/(-6). Let a be (k - 882/(-1))5 - 0. What is a rounded to the nearest 1000? 4000 Suppose 7030 = 41m - 40m. Suppose 105508 = 5o + 2y, -2o - 5y = -35190 - m. Round o to the nearest one thousand. 21000 Let m = -90 + 134. Let q = m + -12.5. Round q to the nearest ten. 30 Let n = 10.398 - 10.53117. Round n to 2 decimal places. -0.13 Let p(o) be the first derivative of -55005o*2/2 - 40o - 24. Let j be p(-8). Round j to the nearest 1000000. 0 Let x = 2.7701 - 0.4611. Let r = x - 2.3. Let m = r + -0.00952. Round m to four dps. -0.0005 Let t = -268.54 + -5.46. Let z = 274.00036 + t. What is z rounded to 5 dps? 0.00036 Let c = 1.6 - 0.1. Let k = -0.076 + -3.624. Let u = k + c. What is u rounded to zero decimal places? -2 Let x = 686 + -345. Suppose 6l = 8659 + x. What is l rounded to the nearest 10000? 0 Suppose -2p + 4491 = -11p. Let i = -224 - p. Let q = i - 98. What is q rounded to the nearest ten? 180 Suppose 2v - d - 6554004 = 0, -d = 4 - 0. What is v rounded to the nearest one million? 3000000 Suppose 0 = -305y + 309y - 1628. Let u = 386 - y. Round u to the nearest ten. -20 Suppose -78197 = -4r - w, 2r = w + 21590 + 17513. Suppose -25m + r + 36450 = 0. What is m rounded to the nearest 100? 2200 Let j = 662906686.999221 - 662906108. Let a = -579 + j. What is a rounded to 4 decimal places? -0.0008 Let j be ((-6570)/(-4))/(32 + (-40444)/1264). Round j to the nearest 1000. 519000 Let s = -3963163.300392 - -3962769.3. Let x = s - -394. Round x to four dps. -0.0004 Let q = -3 - -66. Let k = q - 60. Suppose -kb - 184 + 121 = 0. What is b rounded to the nearest integer? -21 Let d = -3031 - -3030.9957552. Round d to 5 decimal places. -0.00424 Let f = 2650.49 + -2669. Let s = -243.69 + 244. Let b = f + s. What is b rounded to 0 dps? -18 Let z = 6798803 + 6981197. Round z to the nearest 100000. 13800000 Let z be (-8)/(16/(-54)) - 4. Suppose 354123 - 1419023 = -zs. What is s rounded to the nearest 1000? 46000 Suppose 0 = -20v + 28v - 24. Suppose 0 = -5f + g - 18799995, -vg + 1429269 = -2f - 6090716. What is f rounded to the nearest 1000000? -4000000 Let k = 39 - 82. Let n = k - -48. Let t = 5.03 - n. What is t rounded to one decimal place? 0 Let p = 5111.67 + -341.97. What is p rounded to the nearest 100? 4800 Let b = -14.6860022188 - -14.686. Round b to 6 decimal places. -0.000002 Let f = 4775.999874672 + -4776. What is f rounded to 6 dps? -0.000125 Suppose -3y = -4i - 93115, -2i + 9y - 8y = 46557. Let m be i/6 - 1 - 6/(-9). What is m rounded to the nearest one thousand? -4000 Let g = 22934997 - 22932870.57962. Let y = g + -2399.4242. Let u = -273 - y. Round u to 3 decimal places. 0.004 Let p = 2752272 - -2222128. Round p to the nearest one million. 5000000 Suppose -215 = 3g - f - 53, -f = -5g - 272. Let x be 6/5 + 11/g. Let t be (1 + -39)(-94 - x). Round t to the nearest one thousand. 4000 Let q = -3.5 + 101.5. Let t = -98.82 + q. Let p = t - 16.08. Round p to zero dps. -17 Let m = 235456.99904319 - 235457. Round m to five dps. -0.00096 Let y = -4017815190.99999985 + 4017814971. Let b = y - -220. Round b to seven decimal places. 0.0000002 Let l = 114.20001064 + -114.2. What is l rounded to seven decimal places? 0.0000106 Let r = -28694 - -28985.02. Round r to the nearest integer. 291 Let c = -0.6729 + -21.5271. Round c to the nearest 10. -20 Let f = -0.4226 + 0.422602864. What is f rounded to 6 dps? 0.000003 Let x = -0.3258428 - -0.3276. Round x to four decimal places. 0.0018 Let k = -47 + 51. Let x be (9 + -11)(-54)/k. Let d be 9/(x/(-6)) + 12500002. What is d rounded to the nearest one million? 13000000 Let w = 3.801 - 0.201. Let a = -100.4 + w. Round a to the nearest 10. -100 Let j = 6154261 - 11679342. Let i be 2(-2)/(12/51075243). Let f = i - j. What is f rounded to the nearest one million? -12000000 Let a = 0.1011 - 0.06375. What is a rounded to 3 dps? 0.037 Let u = 8.08903 + -29.09112. Let a = -28 + 7. Let t = u - a. Round t to 3 decimal places. -0.002 Suppose -251785821 + 442746127 = -68c - 761583694. What is c rounded to the nearest 100000? -14000000 Let a = -3754.0008797 + 3754. What is a rounded to 4 dps? -0.0009 Let c = -0.0182 - -0.3762. Let g = c + -57.958. What is g rounded to zero dps? -58 Let k = -302.7618 + 299.66. What is k rounded to two decimal places? -3.1 Suppose 139a + 55 = 150a. Suppose 5763775 + 2816230 = 2d + h, 0 = -ad + 3h + 21449985. Round d to the nearest 1000000. 4000000 Let g = -0.41 - 0.36. Let d = g + 3.66. Let x = d - 1.07. What is x rounded to 1 dp? 1.8 Let y = -15994 + 16048.671. Round y to 1 decimal place. 54.7 Let u = 61 + -61.98. Let a = u + 2.7. Let g = -2.32 - a. What is g rounded to one decimal place? -4 Let n be 4 - (105/(-12) + 0)4. Let v(t) = -23 - 38112t*2 - 36 - 2t + n. Let c be v(14). Round c to the nearest one million. -7000000 Let b = -2.17737 - -1.6504. What is b rounded to 2 dps? -0.53 Let t = 67961.02 - 67963.3200142. Let a = t - -2.3. What is a rounded to 5 dps? -0.00001 Let y = -531 + 530.9498. Let o = y - -0.4352. Round o to 2 dps. 0.39 Let p = -530.3 + 535.432. Round p to 1 decimal place. 5.1 Let l = -0.405 + -287.595. Let r = l - -287.9999647. What is r rounded to five dps? -0.00004 Let b = 2824.58 - 16044.68. Round b to the nearest 1000. -13000 Let g = -5205.396106 - -5205.5. Round g to two dps. 0.1 Suppose 2l - 8x + 4x = -3682, 4l - 2x + 7394 = 0. What is l rounded to the nearest one hundred? -1900 Let b = -233688.1007 - -233702. Round b to 1 dp. 13.9 Let w be (-560 + 435)/((-1)/(-19544)2). What is w rounded to the nearest one hundred thousand? -1200000 Let l = 10647822.0198 + -10648866. Let s = l - 0.0198. Let g = s - -1043.999457. What is g rounded to five dps? -0.00054 Let a(m) = -13m3 + 109m*2 + 122m + 32. Let k be a(-13). Round k to the nearest one thousand. 45000 Let j = -625.969 + 626. Let o = -0.252 - j. What is o rounded to 2 dps? -0.28 Let y = 208.95 + -239.538. What is y rounded to the nearest 10? -30 Let p = 5.438 + 0.502. Let w = p + -6.38. Round w to 1 dp. -0.4 Let j = 2582 + -2582.2874. Let z = 1.6164 + j. Round z to 1 decimal place. 1.3 Let c = -7193211 - 884955. Let r = c - -8078165.39999728. Let x = r - -0.6. What is x rounded to 7 decimal places? -0.0000027 Let q(a) = a*3 + a - 4168. Let b be q(0). Let m = b + 2368. What is m rounded to the nearest one hundred? -1800 Let n = 48208.000087188 - 48208. Round n to five decimal places. 0.00009 Let i = -5109609.95286614 - -5109610. Let n = i + -0.04719. What is n rounded to 6 decimal places? -0.000056 Let f be (((-12)/10)/((-8)/750))/(12/(-2328)). Round f to the nearest 1000. -22000 Let q be (2/6)/((-4)/12). Let r be (-2)/q - (6 - 4). Suppose -3m - 353165 - 42835 = r. Round m to the nearest ten thousand. -130000 Let s = -40697.49 + 40516. Let n = s - -179. What is n rounded to one dp? -2.5 Let a = -0.241 + 0.268. Let k = a - 0.199. What is k rounded to 2 decimal places? -0.17 Suppose -4f = f, 5f + 274140 = -2p. Round p to the nearest one thousand. -137000 Let q be (1/(49/504))/((-4)/(-24986906)). Let h be 0 + -2 + -347262686. Let g = h + q. Round g to the nearest one million. -27000000 Let y = -349.624173 - -307.58342586. Let h = y + 0.04080314. Let a = 42 + h. Round a to 5 dps. 0.00006 Let k = -0.065 - -0.065. Let d = 71 - k. Let w = d + -71.16. What is w rounded to two dps? -0.16 Let t = -733 + 732.9529. Let y = -0.07 + -0.002. Let z = y - t. What is z rounded to 3 decimal places? -0.025 Let x = -17.2 - -14.4. Let y = x + 2.800098. Round y to 5 dps. 0.0001 Let i(z) = 18332z + 12. Suppose 2v + 3p = -2p + 38, 4p + 20 = 4v. Let l be i(v). Suppose 0x - l = 3x. What is x rounded to the nearest ten thousand? -60000 Let q = 465	{ "pile_set_name": "DM Mathematics" }
biggest value? (a) -491 (b) 0.5 (c) n c Let d = 128 - 127.854. Let t = d + -0.036. Let u = -0.21 + t. What is the smallest value in 4, -2/3, -3/7, u? -2/3 Let g be (-57)/(-3) + -34 + 0. Which is the third biggest value? (a) -1/7 (b) -5/3 (c) g c Let w = -1788/5 - -358. Let l = 281/8 + -35. What is the smallest value in l, -4, w? -4 Let l = -0.2 + 1.6. Let k = 43326 - 43328. What is the third smallest value in l, -1/3, k? l Let z = -98 - -74. Let n be 24 + z - ((-32)/(-14) - 2). Suppose 4m = 2 + 30. Which is the second biggest value? (a) m (b) n (c) 5 c Let s be ((-492)/20)/((-7)/245). Let v = -856 + s. Which is the biggest value? (a) -3 (b) 3 (c) 0.29 (d) v d Let f be (-31 + 0)/((-3)/(-60)-15). Let r = 38 + -38.3. Which is the second smallest value? (a) r (b) f (c) -17 a Let g = -966 - -966.7. What is the second biggest value in g, 0.064, -2/5? 0.064 Let o = 215183/14 + -15370. Let x be 6/95/(-4). Which is the fourth smallest value? (a) -4 (b) 0.1 (c) o (d) x c Let g be (18 - ((-1 - -5) + 2)) + -5. Let t be 42/(-40) + (-2)/(-8). What is the third smallest value in t, 3, g? 3 Let l = -1135 + 5674/5. What is the third smallest value in 4, l, 462, 0.5? 4 Let n = 13.5 + -14.8. Let m = 1.6 + n. What is the fourth smallest value in 4, m, -1, -1.4? 4 Let o = -453 + 457.99. Let s = 2.99 - o. Let i = 2 + -2.5. Which is the third smallest value? (a) s (b) -3 (c) -1 (d) i c Let p be (0/149)/(-1 + 2). What is the second smallest value in 0.3, -529, 1/2, p? p Let n = 647.7 - 648. Suppose 3 = 5t - 7. Suppose 0g = -3k + tg - 11, 5k + 2g + 13 = 0. What is the third smallest value in -0.39, k, n? n Suppose 1 + 5 = 6r. Let p be (0 - 2/4)/(417/556). Which is the biggest value? (a) -0.3 (b) r (c) -3 (d) p b Let g be (9 - 5)(-1)/7 + (-209)/(-378). Let y = 1.3 + -0.9. What is the third smallest value in y, -1, g? y Suppose -x - 125 = -236. Let u be (14/(-147))/(2/x) + 5. Which is the biggest value? (a) u (b) -5 (c) -6 a Let p = -268.7 + 211.7. Which is the third smallest value? (a) -0.5 (b) p (c) 1 c Let r = 212.5 - 212.8. Let y = -14/17 - 23/34. Which is the smallest value? (a) 0.3 (b) r (c) y (d) 4 c Let z = 30 + -18. Suppose 0 = 2v + z + 8. Let m(j) = j*3 - 16j*2 - 16j - 14. Let p be m(17). What is the third smallest value in -3/7, v, 1, p? 1 Let x = 13 - 12.7. Let u = 47 + -69. Let m = u + 15. Which is the biggest value? (a) x (b) -0.4 (c) m (d) -5 a Let r = 301 + -300.13. Let k = -0.97 + r. Let x be (1 + 0)/((-10)/4). What is the third biggest value in 1/3, x, k? x Let y = -5.18 - -0.18. Suppose -8a + 369 = -247. Let w = 73 - a. What is the second biggest value in 4, -1, y, w? -1 Let u = -22774 - -22773. Which is the third biggest value? (a) 1/18 (b) 0 (c) u (d) -0.08 (e) 1/3 b Let z = 128.4 + -113. Let q = z + -15.29. Which is the second smallest value? (a) 2/11 (b) 4 (c) q a Let q = 1.1 + 3.9. Let j = -279 - -46. Let k = 232.6 + j. Which is the second biggest value? (a) q (b) -0.3 (c) -3 (d) k b Let b(s) = s3 - 11s*2 + 11s + 8. Let f be b(10). Suppose f = -3g - 3q, -7g + 5q + 14 = -4g. What is the fourth smallest value in -3, -1/9, 0.6, g? 0.6 Let c = 2.58 + -2.6. Let q = -4.02 - c. Let t = -0.188 - -0.098. What is the third biggest value in 0.1, q, t? q Let q = -24.855 - -24.855. Which is the second biggest value? (a) -1/3 (b) 1/5 (c) q (d) 1/8 d Let m be (4/(84/(-9)))/((-48)/64). Let n = 0.3 - 0.2. Which is the third biggest value? (a) -0.3 (b) -5 (c) n (d) m a Let x = -5315 - -5316. What is the third biggest value in 13, x, -1/12? -1/12 Let u be ((99/9)/(-176))/((-2)/(-2)). Which is the smallest value? (a) u (b) -5/6 (c) -0.06 (d) -1/3 b Suppose -q = 1, -6k + 2q = -2k + 3462. Let u = -44164/51 - k. What is the third biggest value in 1/2, u, -4? -4 Let z be ((-252)/(-56))/(-9)(-2)/7. What is the biggest value in z, 1/4, 2/9, 5, -0.042? 5 Let d = -42.1 + 42. Let r be -1-15(-5)/(-60)4. What is the third biggest value in 0.1, r, d, 3/2? 0.1 Let k be (2/(-6))/((-2)/24). Suppose 0 = f + 3 - k. Let p = -1735/3 - -579. Which is the fourth biggest value? (a) -1/5 (b) -3 (c) f (d) p b Let j be 9 - (24/132 - (-1885)/220). Let v = 2 - 1.8. Which is the third biggest value? (a) j (b) v (c) 4 b Let o = -67790 - -67789.74. Let m = -1 - -1. Which is the third smallest value? (a) m (b) 5 (c) o b Suppose 115y = 112y + 2262. Let d = y - 2261/3. What is the third biggest value in 2, d, -143, 1/6? 1/6 Let j be 9/(-6)(-2)/(-6). Let z = -57 - -58. Let i be (-256)/(-40) + 4/(-10) - 6. What is the third smallest value in j, z, i? z Let t = 21 - 21.13. Let k = -2.13 - t. Let h = 32 - 125/4. What is the smallest value in -11, k, h, -1/6? -11 Let b be (-186)/(-465)590/4. What is the third biggest value in -2, b, 0? -2 Suppose 10 = -4g + i, -15g - 5i + 33 = -18g. Which is the smallest value? (a) g (b) -34 (c) -13 (d) -5 (e) -3 b Let m = 303 + -307. Let v(p) = -p*2 - 13p - 32. Let z be v(-9). Which is the biggest value? (a) -10 (b) m (c) z c Let n = 328 - 220. Let z = n - 106. Which is the fourth smallest value? (a) -9/5 (b) 0.3 (c) z (d) -2 c Let x = -125.029 + 0.029. Let y = 129 + x. Which is the fourth biggest value? (a) 0 (b) y (c) 12 (d) -4 d Let o(u) = -u*2 - 5u - 1. Let j be o(-3). Suppose -3l + 60 = -2v + 11, 0 = 3v - 2l + 61. Which is the third smallest value? (a) -0.3 (b) v (c) j c Let n = 22.036 - 22.036. Let p = -37.943 + -0.057. Which is the fourth smallest value? (a) 1/2 (b) p (c) -0.1 (d) n a Suppose 102z + 211 = 1129. What is the second biggest value in -0.5, z, -3/25? -3/25 Let l = 13 + -14. Suppose 113 = 4n + 33. Suppose 20 = -8x - n. Which is the second biggest value? (a) l (b) 3 (c) -4 (d) x a Let h be (-16)/(-6) + 38/(-57). Let o be h/6 + 10154/(-78). Let n = o - -130. What is the second biggest value in 5, n, 1/10, -2/9? n Let c = -6 - -6.3. Let v = -99/74 - 6/37. Let s = 121 - 116. What is the third biggest value in s, c, v? v Let c = -303 - -166. What is the third smallest value in 1/2, c, -0.2? 1/2 Let q = -1 + -1. Let f = -1225675 + 1225677. Which is the second smallest value? (a) 0.06 (b) q (c) f a Let f = 0.031 - 33.031. Let v = f + 33. Let j be (-10)/(-66) + (-14)/(-77). What is the third biggest value in j, v, 0.2? v Let d = 28.76 - 220.06. Let o = 192 + d. Which is the third biggest value? (a) o (b) 4 (c) 2 a Let j be ((-16)/(-20))/(1/(-5)). Suppose 0 = -6w - 35923 + 35953. Which is the second smallest value? (a) j (b) 0.26 (c) w (d) -2 d Let z(v) = -v*3 - 26v*2 - 78v + 565. Let g be z(-21). Let b = -12 + 6. Let l be 8/b(-3)/26. What is the smallest value in l, 0.5, g? g Let y(k) = -k3 - 8k*2 - 37k - 213. Let m be y(-7). What is the third biggest value in m, 0.17, -0.4? m Let i be (-616)/96 + (-2)/8. Let d = -62/9 - i. What is the biggest value in d, -0.3, -9/13? d Let n = 1.7 + 0.3. Let u = -4 + n. Suppose -3s - 6w - 19 = -4w, -5w - 10 = 0. Which is the second biggest value? (a) s (b) u (c) 5 b Let w = -1.91 + -135.09. Let b = w + 96. Let j = -34 - b. What is the smallest value in 3, j, 0.4, -1/2? -1/2 Let f = -6.012 + 8.012. Which is the smallest value? (a) -0.4 (b) f (c) -0.2027 (d) 1/3 a Let c = 5514.78 + -5510. What is the second biggest value in -3/2, c, 2? 2 Let r = 52.17 + -51.77. Let d = 30437 - 364999/12. Let h = 87/4 - d. Which is the second biggest value? (a) r (b) h (c) 2 b Let h be (-5148)/(-54) - ((-8)/6)/2. Let i = h - 86. Suppose -1 = n + 5v - 4v, -4n - 2v = i. What is the biggest value in -2, 0, n? 0 Let u = -1 + -742. Let v = u + 6685/9. Which is the third biggest value? (a) 0.5 (b) -4/9 (c) v (d) 1 c Let h = 55.087 + -0.087. Let u = h + -55.5. Which is the biggest value? (a) u (b) 1 (c) 1/23 b Let v = -37/27 + 1/27. Let x = -297/16 - -1453/80. Which is the biggest value? (a) v (b) 1 (c) x b Let o = -182 - -182.1. Suppose 3k - 10 = -d, -36 = -2d + 2k - 0k. Let z = d + -18. Which is the second biggest value? (a) z (b) o (c) 3 b Let w = 554 + -553.924. Let m = 0.046 - w. Which is the smallest value? (a) m (b) -0.06 (c) -0.5 c Let v = -0.1354 - 10.8646. Let y = 4.03 - -0.97. Which is the third smallest value? (a) y (b)	{ "pile_set_name": "DM Mathematics" }
2 - 39q - 39. Calculate -4g(d) + 39n(d). -13d3 Let x(n) = 51n*2 + 2n + 32. Let u(v) = -27v2 - v - 15. Let w(o) = 11u(o) + 6x(o). Let h(k) = 14k*2 + 2k + 40. Calculate -5h(b) + 8w(b). 2b2 - 2b + 16 Let c(u) = -18u. Suppose -43l = 74l - 135 + 603. Let i(m) = 18m. What is li(k) - 3c(k)? -18k Let k(f) = -26f*2 + 1. Let q(n) = 25n*2. Let s be (1258/136 + 20/(-2))-4. What is sq(u) + 2k(u)? 23u2 + 2 Let a(p) = -6p + 1. Let i(n) = 13n - 1. Let o(f) = -9a(f) - 4i(f). Let u(k) = 508 - 2052 + 513 + 520 + 512. Let v = -6 + 7. Give vo(w) + 5u(w). 2w Let p(v) = 8v2 - 11v. Let k(t) = -4t2 + 6t. Let g(a) = 7a - 122. Let b be g(19). Suppose 4s - 35 + b = 0. Calculate sp(c) + 11k(c). 4c2 Suppose -9x - 18w + 57 = -16w, 4x - 2w = 34. Let y(h) = -58h + 7. Let i(g) = 29g - 4. Determine xi(n) + 4y(n). -29n Let b(l) = 61l + 17. Let h(y) = 20y + 6. Suppose -50s + 51 = 9j - 55s, -8 = -5j - 4s. Calculate jb(d) - 11h(d). 24d + 2 Suppose 2v = 7v + 25. Let x(i) = 11i*2 + 5i - 6. Let w(l) = -3l + 5 + 2309307939l*2 - 1 - 2309307946l*2. Calculate vx(j) - 8w(j). j2 - j - 2 Let r(h) = -h + 1. Suppose 0 = 4i - o + 1, -i + 4o - 24 = -o. Suppose f + 5 + i = 3a, 0 = 2a - 3f - 4. Let y(d) = 8d - 5. Give ay(m) + 10r(m). 6m Let b(o) = -4o3 + 165o + 170o - 2 + 173o - 691o + 174o - 5o2. Let s(y) = -6y*3 - 7y*2 - 13y - 3. Give 7b(u) - 5s(u). 2u3 + 2u + 1 Let i(z) = -z + 3. Let t(f) = 91f2 - 5f + 2. Calculate 5i(x) - t(x). -91x*2 + 13 Let z = -10 - -16. Let l(x) = -13x. Let f(k) = -23k + 4 - 5 - 2k + 1. Calculate zf(d) - 11l(d). -7d Let o(m) = -2m - 2. Let l(n) = 10n + 10. Suppose 0 = -44b + 331 + 153. Give bo(p) + 2l(p). -2p - 2 Let s(g) = -174g*2 - 5g + 16. Let j(o) = 86o2 + 2o - 7. Calculate 7j(f) + 3s(f). 80f2 - f - 1 Let w(g) = -3g - 5. Let q(v) = -30v - 117. Let r(i) = 12i + 46. Let x(y) = -7q(y) - 18r(y). Calculate 11w(z) - 6x(z). 3z - 1 Let h(x) = -2x + 6. Let u(v) = 2v + 5. Let f(k) = k + 5. Let n(p) = -4f(p) + 3u(p). Suppose -78 + 104 = 4i - 6s, -5i + 3s + 1 = 0. Give ih(t) - 5n(t). -2t + 1 Let m(u) = -u*3 + 6u - 6. Let h(p) be the third derivative of p6/40 + p5/60 - 11p4/24 + 11p*3/6 + 4p*2 + 33p - 8. Determine -6h(d) - 11m(d). -7d3 - 6d*2 Let q(t) = 730t*3 + 55. Let l(v) = 27v*3 + 2. Suppose 33z - 32z = 2. What is zq(x) - 55l(x)? -25x*3 Let q(i) = 14i*2 - 826. Let r(u) = 8u*2 - 404. Give 6q(k) - 11r(k). -4k*2 - 512 Let b(o) = 96o*2. Let h be 10/(424/(-265) + (-171)/(-60)). Let x(g) = -32g*2. Determine hx(q) + 3b(q). 32q*2 Let h(q) be the first derivative of 1/2q*2 - q - 42. Let n(b) = 2b - 2. Suppose -3 - 1 = g. Give gn(s) + 10h(s). 2s - 2 Let k(p) = -174p*2 + 48p. Let x(o) = 70o2 - 20o. Calculate -5k(d) - 12x(d). 30d2 Let s(n) = 7n*2 - 2n + 2. Let h(c) = 35c2 - 11c + 11. Suppose -10 = 4z - 2. What is zh(k) + 11s(k)? 7k*2 Let d(w) = -1212w*3 - 24w*2 + 28w - 16. Let b(j) = j*3 + 3j*2 - 3j + 2. Determine -8b(l) - d(l). 1204l*3 - 4l Let z(i) = -2i3 - 7i*2 + 6. Suppose -3u + 6r + 4 = 10r, 2u = 5r - 28. Let d = -1 + u. Let l(m) = 3m3 + 8m*2 - 7. Determine dl(y) - 6z(y). -3y*3 + 2y*2 - 1 Suppose 3177 + 24227 = -1612g. Let u(h) be the first derivative of -3h2/2 - 5h - 3. Let j(c) = -8c - 14. Give gu(b) + 6j(b). 3b + 1 Let h(r) = -6r3 + 3r*2 - 10r + 898. Let s(x) = 4x3 - 2x*2 + 7x - 599. Determine -5h(l) - 7s(l). 2l3 - l2 + l - 297 Let h be 24/128 + 1215/1296. Let b(y) = -y*2 - 1. Let m(k) = -3k*2 - 3. Let p(t) = 11b(t) - 4m(t). Let u(c) = 2c*3 + 7c*2 + 6. Give hu(o) - 5p(o). 2o*3 + 2o*2 + 1 Let z(o) = -10o*2 + 2o + 2. Let t(n) = 30n2 - 6n - 5. Suppose 330r + 272 = 296r. Give rz(f) - 3t(f). -10f2 + 2f - 1 Let b(d) = -5d2 + 6d - 16. Let h(w) = -8w2 + 10w - 33. Calculate 7b(m) - 4h(m). -3m2 + 2m + 20 Let x(a) = -55a3 + 7a*2 + 6a. Let q(p) = -82p3 + 10p*2 + 9p. Give 5q(v) - 7x(v). -25v3 + v2 + 3v Let v(d) = d3 + d2 - 4d. Let i(u) = 6u*3 + 4u*2 - 5u + 26. Give -i(b) + 5v(b). -b3 + b2 - 15b - 26 Let p(j) = j - 567486 + 567486. Let a = -4 - -3. Let h(d) = -1 + d - 3 + 2 - 2. Give ap(t) - h(t). -2t + 4 Let i(l) = -4l2 - 1. Let y(g) = -25g*2 - 64g - 8. Give -7i(f) + y(f). 3f*2 - 64f - 1 Let g(d) = -d + 4. Let m = 248 - 247. Let s(j) = -j - 9. Let t(f) = 3. Let h(i) = ms(i) + 4t(i). What is -4g(o) + 3h(o)? o - 7 Let h(b) = -253b - 4. Let x(r) = -761r - 14. What is 10h(y) - 3x(y)? -247y + 2 Let o = -7 + 1. Let l(q) = -q. Let a(g) be the first derivative of 7/2g*2 - 2/3g*3 + 0g - 67. Give ol(j) - a(j). 2j*2 - j Let r(f) = -2f*2 - 7f + 7. Let j(x) be the third derivative of x5/60 + x4/6 - x*3/2 + 10x*2 - 65x - 2. Determine 7j(h) + 3r(h). h*2 + 7h Let s be 11 - (-90)/(-24)4. Let v(t) = 2t + 8. Let y(j) = 8j + 69. Let q(f) = 3f + 23. Let x(p) = 7q(p) - 2y(p). What is sx(h) + 11v(h)? 2h - 4 Let j(d) = -86d + 2913. Let l(q) = -150q + 5829. Give 7j(f) - 4l(f). -2f - 2925 Let j(s) = -2s + 1. Let k(h) = -372h - 3. Calculate 4j(t) + k(t). -380t + 1 Let p(k) = k + 1. Suppose -x = 5r - 6, -38x = -43x - 4r + 9. Let z(y) = 8y + 3. Let q = 93 + -99. What is qp(i) + xz(i)? 2i - 3 Let k(d) = 4d2 + 29d - 15. Let i be k(-8). Let j(o) = 5o + 5. Let z(x) = 2x + 3. What is iz(l) - 4j(l)? -2l + 7 Let r(z) = 2z2 - z + 1. Let v(n) = n2 - n. Let o be (-19)/(-3) + -4 - 220/165. Determine or(d) - 4v(d). -2d2 + 3d + 1 Let l(d) be the third derivative of -d6/120 + d4/8 + d*3/6 - 83d*2 + d. Let k(s) = 2s3 - s2 - 4s - 1. Determine 3k(f) + 4l(f). 2f*3 - 3f*2 + 1 Let q(x) be the first derivative of 3x + 21939. Let l(s) be the third derivative of s*4/24 - 2s*3/3 + 2s*2. Give -4l(g) - 6q(g). -4g - 2 Let b(i) = -2708i3 - 2i*2 + 6i - 2. Let p(c) = -10831c3 - 9c*2 + 27c - 9. Give -9b(l) + 2p(l). 2710l3 Let o(w) = 3w + 5. Let c(n) be the third derivative of n4/24 + n3/6 + n*2. Suppose 57 = 3g + s, 11422g - 7s = 11420g + 15. What is gc(b) - 4o(b)? 6b - 2 Let t(x) = 1433x3 + 5x*2 - 15x - 38. Let c(d) = -2150d3 - 8d*2 + 24d + 60. What is 5c(q) + 8t(q)? 714q3 - 4 Let z(b) = -4b*3 + 2b - 5. Let y(n) be the third derivative of n6/30 - n4/8 + 2n3/3 + 60n*2 - 3. Determine 2y(t) + 3z(t). -4t*3 - 7 Let f(r) = -5r*2 - 4r + 349. Let h(y) = 12y2 + 10y - 697. Determine -5f(m) - 2h(m). m*2 - 351 Let t(n) = -23n*2 + 501n - 2. Let i(w) = -13w2 + w. Determine 2i(p) - t(p). -3p2 - 499p + 2 Let o(j) be the second derivative of 5j3/6 - j2 + 2j. Let v(p) = 14p - 6. Let m = 90 + -58. Suppose -mk - 20 = -37k. Determine kv(c) - 11o(c). c - 2 Let j(p) = -p2 - p. Let a(r) = -4r*2 - 4r + 28. Let v be (((-48)/14)/4)/(43/(-84)). What is vj(b) - a(b)? -2b2 - 2b - 28 Let q(h) = 3h3 + 3h*2 - 3. Let d(j) = -13j*3 - 11j*2 - j + 14. Determine -2d(o) - 9q(o). -o3 - 5o*2 + 2o - 1 Let d(v) = v*2 + v + 1. Let o(l) = 3l*3 - 3l*2 - 1 - 5304l + 5301l - 4. Let r be 2 - 3 - (2 + 0). What is rd(w) - o(w)? -3w3 + 2 Let f(k) = k - 1. Let b(x) = 7x + 11. Let s = 27351 + -27395. What is sf(a) - 4b(a)? -72a Let j(n) = 973n - 41. Let l(c) = -961c + 51. Give -5j(g) - 4l(g). -1021g + 1 Let a(y) = 7975908y2 - 4944. Let o(s) = -11292s*2 + 7. Calculate 7a(q) + 4944o(q). 3708q*2 Let b(q) be the second derivative of -258q - 1/3q3 + 0 + 0q*2 + 1/5q*5 + 5/12q*4. Let f(k) = -3k*3 - 4k*2 + k. Give -4b(u) - 5f(u). -u3 + 3u Let p(q) = 3q3 + 5q*2 + q + 5. Let j = 373 - 463. Let h be (j/12)/(-5)(-2 + 0). Let c(t) = 2t3 + 3t*2 + 3. Calculate hp(n) + 5c(n). n3 - 3n Let p(g) be the first derivative of -g*2/2 + 4191. Let s(y) = 2y*2 + 8y - 1. Give -3p(k) - s(k). -2k*2 - 5k + 1 Let l(t) = 6t2 - 2. Let g(m) = 54m*2 + 42m - 36. Let f(d) = -14d2 - 10d + 9. Let a(u) = -21f(u) - 5g(u). Give -2a(y) + 9l(y). 6y2 Let c(y) = y3 - 9y*2 + 27y - 157. Let r be c(8). Let x(p) = 2p2 - 6p + 5.	{ "pile_set_name": "DM Mathematics" }
tg + 1 + 3 for g. -2 Let u be (80/(-25))/((-1)/5). Suppose -9 = 13i - ui. Let c be (-2(i - 4))/1. Solve o = c - 1 for o. 1 Let h(r) = -r*3 - 23r*2 + 18r - 124. Let y be h(-24). Solve 10 = 6i - y for i. 5 Suppose -2r - y + 16 = -4r, -4y - 56 = 4r. Let x be (-6)/15 + 166/r. Let s(i) = -i - 17. Let a be s(x). Solve -3k - 3 = -ak for k. -1 Let d = 29 - 23. Suppose 2q - 35 = -7. Suppose 4k + 2h = q, -dh + 4h + 10 = 3k. Solve k + 0 = 4w for w. 1 Let m = 4 - 16. Let s = m - -15. Solve -sw + 6 = -w for w. 3 Let v = -148 + 160. Solve 8 - v = -2j for j. 2 Suppose 4w + 9 = 29. Let c(b) = -15b + 34. Let m(n) = -7n + 17. Let i(q) = -4c(q) + 9m(q). Let s be i(w). Solve -sk = k for k. 0 Suppose -3p = -0p. Suppose -4 = 2s - 10. Suppose -sb - 4 = -19. Solve -2y + by = p for y. 0 Let g(a) be the second derivative of a*5/20 - 2a*4/3 + 3a*3/2 - 4a*2 + 36a. Let p be g(7). Solve 2 = 4h - p for h. 2 Let i be (-26)/(-325) + (-523)/(-25). Solve -i = 8n - n for n. -3 Let c(l) = -3l2 - 64l - 106. Let q be c(-18). Solve -qy + 5 = -79y for y. -1 Suppose -2o + 4v = -12, -3o + 3v = 2o - 37. Suppose 0 = -2y - 26 + o. Let t = y + 11. Solve 0 = -tk - 1 + 7 for k. 3 Suppose -j = 2j + 48. Let f = -7 - j. Solve -3u = -f - 6 for u. 5 Suppose -7l - 12l + 494 = 0. Solve m - l = -29 for m. -3 Let z(r) = r + 1. Suppose s + 2 - 7 = 0. Let m be z(s). Solve -v + m = v for v. 3 Let r = -59 + 63. Suppose 5s - 16 = -ri, -2i + 3s - 16 = -6i. Solve -ic = -4 - 16 for c. 5 Let n be -1 - (-2)/40. Let h be (-122)/4(3 - n). Let z be (-2)/8 - h/8. Solve -y - 4y = -z for y. 3 Let q be -9 - -20 - -8 - -9. Solve -q = -6w - w for w. 4 Let j(f) = -2f - 9. Let c be j(9). Let h = c + 44. Let o = h - 13. Solve -3u = -7u + o for u. 1 Let a be -60(35/10)/(-7). Let v = a - 25. Let l(s) = s3 - 4s*2 + 2s - 2. Let x be l(4). Solve vf = 4 + x for f. 2 Suppose 2b = -6l + 3l + 23, 3b = -2l + 22. Solve -j + 2 = l for j. -3 Suppose -5z = -25, h + 3z - 13 = z. Suppose p = -4 + 6. Suppose 3d - pi = -d + 2, d + 5i = 17. Solve 0 = dm - hm - 3 for m. -3 Suppose 29 = -5n + 59. Suppose -v = nv - 105. Solve y - v = -4y for y. 3 Suppose -2g + 7 + 7 = 0. Let u be (-3)/(3 + 7/5 - 5). Solve 0 = uv - gv for v. 0 Let m be -2 - (0 + 0) - (-18 + 13). Solve 12u = mu for u. 0 Suppose -2m = -i - 0i - 21, 0 = -4i - 12. Solve 0 = 6x - m - 3 for x. 2 Let j = 20 + -18. Suppose jy = 0, y - 14 + 4 = -2a. Solve 2u + 1 + a = 0 for u. -3 Let p = -49 - -85. Suppose 7n = 19n - p. Solve 0 = 2l + n + 3 for l. -3 Suppose 0 = 2i - 10, 2i = 4w - 2 - 24. Solve 0 = -s + 14 - w for s. 5 Let r = -2 - -2. Suppose -j + 0j + 5 = r. Solve o - j = -0 for o. 5 Suppose 2a + 2a - 12 = 0. Suppose -am = -5x + 63, 3x - m = 4x - 11. Suppose x - 29 = -2j - 3z, 11 = -j + 5z. Solve 0t + jt = -4 for t. -1 Let c be (-2)/(-4) + (-135)/6. Suppose 119 = -4t - 3d, -2t + d + 109 = -6t. Let s = c - t. Solve 6 = -5h - s for h. -2 Suppose 2b = -3x - b + 12, -3x - 4b + 16 = 0. Solve 5v + x = 5 for v. 1 Let c be 1 + (-1)/(-2 + 82/42). Suppose -ch + 20h = -24. Solve 3 = 3y - h for y. 5 Suppose 25 = 4b - 3g, -2b - 4g + 16 = -24. Solve 15 = -7a + ba for a. 5 Let l(s) = -5s + 25. Let m be l(3). Let d = -28 + 34. Solve h + m = dh for h. 2 Let g = 32 + -30. Suppose -g = -b - 2n, -n + 6n = -b - 1. Solve -bz = -0z - 8 for z. 2 Suppose -32b - 19b = -2040. Solve i + 41 = b for i. -1 Let v(q) = -q3 - q2 - 7q - 2. Let u be v(-5). Let a = -65 + u. Let m be a/18 - 2/(-9). Solve -b = b - m for b. 2 Let s(m) = -4m2 - 30m - 2. Let f be s(-5). Solve 17l - f = 5l for l. 4 Let m(g) = -g*3 - 3g*2 + 8. Let i be m(-2). Solve i = 5z + 9 for z. -1 Suppose 11 - 9 = i. Let m(a) = -ia - 1 - 2a + 2a + 3a. Let d be m(1). Solve d = -2v - 3v for v. 0 Let n be 0 + 1 + 1 + 16. Suppose 55x = 49x + 30. Suppose 2w - 12 = -2w, -b - xw + n = 0. Solve bp = 7p + 4 for p. -1 Suppose 0 = 5n - 3q - 218, n - q - 12 = 30. Suppose -4f - 3j + 7 = -n, 2j + 30 = 2f. Suppose 11o = fo. Solve o = -3h - 10 - 2 for h. -4 Let b = -5174 + 5177. Let t be 2 - ((-2)/(-2))/1. Solve t = bv - 4v for v. -1 Let b be (-112)/(-252) + 442/18. Solve 6d + b = d for d. -5 Let r = -24 - -24. Solve r = -3z - 8 + 20 for z. 4 Suppose -5u + 3y - 3 + 18 = 0, 25 = -5y. Suppose u = 2t + 9 + 31. Let h be ((-3)/(-6))/((-2)/t). Solve 5k = -h - 0 for k. -1 Suppose 0 = k + 2k + 4a, 0 = -3k - 2a. Suppose k = -4i - 3n + 14, -2n - 6 = -3i - 2i. Suppose 0 = -20x + x. Solve x = -im - 3m for m. 0 Suppose 5b = -g - 10, 0 = 2g - b + 3b + 4. Let y = 9 + -7. Solve 0 = -go + yo + 4 for o. -2 Let m = -3 - -5. Let c be ((-36)/5)/(69/(-230)). Suppose 0 = -cd + 19d. Solve -q - mq = d for q. 0 Let x = 59 - 39. Suppose 0 = -4p - x, -2f = 3f + 5p + 10. Solve -j = fj - 12 for j. 3 Let g(s) = s*2 - 3s - 5. Suppose -8 - 2 = -2z. Let i be g(z). Solve 8 + 2 = ia for a. 2 Suppose 0 = 6s - 196 + 172. Solve sj = 10j for j. 0 Suppose 3h = i - 6 + 13, -5i + 5h + 15 = 0. Let a = 12 - i. Solve -s = 1 + a for s. -5 Let h(t) = 89t - 178. Let v be h(2). Solve v = 2c + 4c for c. 0 Let h = -6 + 10. Suppose 5y - 13 = 3c - 2, -2c = -hy + 10. Let t = -8 - -12. Solve -ci - t = i for i. -1 Suppose 4k - 487 + 163 = 0. Suppose -2u - u + k = 0. Solve -5o = -2 + u for o. -5 Let y = -323 - -333. Solve 10z = 8z + y for z. 5 Let p be (-4)/(-22) - (-3088)/(-44). Let h = 49 + p. Let z = h + 23. Solve -6u - z = -4u for u. -1 Suppose 22o - 15o - 49 = 0. Solve oi = -13i for i. 0 Let v = 19 + -14. Suppose 0 = o + 10 - 12. Suppose 0j + n = -3j + 9, 5j - 14 = -on. Solve 9k = jk - v for k. -1 Let g(k) = 6k - 348. Let t be g(58). Suppose 0 = -4q - x + 5x, -3q - x + 8 = 0. Solve tp + q = -p for p. -2 Let l(z) = 2z3 - 16z*2 + 19z - 16. Let k be l(7). Solve 9j = k - 1 for j. 2 Let s = 21 + -21. Suppose s = j - 2 + 1. Suppose 0l = 2l. Solve l = -3b + j - 4 for b. -1 Suppose -6 = 7k - 5k. Let b = k - -25. Let z = b + -18. Solve zr - 10 = -r for r. 2 Let o(i) = 2i*2 - 22i + 3. Suppose z = -3z + 3s + 56, 4z = -2s + 36. Let y be o(z). Solve -yl + 0 = 3 for l. -1 Let o = -163 + 165. Solve 0 = -op - 10 for p. -5 Let d(p) = p*3 + 4p*2 - 2p - 1. Let a be d(-4). Solve 0 = -8v + a + 25 for v. 4 Suppose -3n - 5w = -33, 11n - 12n - 3w = -15. Solve 5 = nx + 23 for x. -3 Let l(u) = u3 - 8u*2 + 7u + 4. Let y be l(7). Solve -6v + yv = 10 for v. -5 Let z = -68 - -31. Let s = z - -45. Suppose 0 = -sy + 7y + 1. Solve 4q = 5 - y for q. 1 Suppose 6 = 5c - 3j, 0 = -2c - 0c + j + 3. Suppose -f = -cf + 18. Let l be 3((-12)/f + 3). Solve 4d = -d - l for d. -1 Let h(w) = w*3 - 29w*2 + 30w - 54. Let n be h(28). Solve 5 = np + 1 for p. 2 Suppose -3p - 2o - 16 = 0, -5o = -p - 4 - 7. Suppose -4z - 18 + 50 = 4d, 2z - 13 = -5d. Let a be (-20)/pz/6. Solve ab - b + 12 = 0 for b. -3 Let k = 442 + -214. Solve -6 = -231d + kd for d. 2 Let a(l) = l*2 - 10l + 27. Let j be ((-18)/(-8))/((27/(-8))/(-9)). Let x be a(j). Solve 3u - 9 = -x for u. 2 Let i(s) = -s. Let z(d) = -2d - 12. Let l(n) = 2i(n) + z(n). Let u be l(-3). Solve u = 4j + j + 25 for j. -5 Suppose -3f - f = -0f. Let y be (-10)/(-2) - -2 - f. Solve y - 22 = 5d for d. -3 Let n = 55 + -55. Suppose f + n = q - 9, 0 = -5q - 4f. Solve z + 12 = qz for z. 4 Let l = 102 + -102. Solve l = 12n - 10n for n. 0 Let g = -2929 + 2929. Solve -3s = -gs for s. 0 Let g = 695 + -689. Solve gd - d = -25 for d. -5 Let v = -2870 + 2870. Solve v = -2j + j - 3 for j. -3 Let g(k) = -k*2 + 34k + 38. Let h be g(35). Solve hd - 8d = 0 for d. 0 Let u(d) = -2d3 - 18d*2 - d - 4. Let l be -8 - (-5)/(-3 + -2). Let w be u(l). Solve -16 = wt - 6 for t. -2 Let q be 2/6 + (-2216)/(-12). Let j = 311 - q. Suppose 0 = 4k + 3k - j. Solve -3s - 3 = -k for s. 5 Suppose -45 = -3n - 0n. Suppose 0 = -3u + n, y + u - 18 = -0y. Solve 3o + 1 = y for o. 4 Suppose 0 = -3o + 15, 11o = 4j + 9o + 18. Let u be (-32)/64 - j/4. Solve ug - 4 = -4g for g. 1 Let o = 5 + -3. Let d(k) = -12k + 3 - k2 - 4k*2 + 4k*o. Let u be d(-12). Solve -v = -uv for v. 0 Let g be 70/910 - 64/(-13).	{ "pile_set_name": "DM Mathematics" }
*2. What is the second derivative of g(k) wrt k? -200k*3 Let f(h) = -8h*3 - 3h*2 - 3h + 14. Let l(k) = -9k3 - 2k*2 - 2k + 14. Let c(s) = -2f(s) + 3l(s). Find the first derivative of c(z) wrt z. -33z2 Suppose -2v = 2v - 8. Find the third derivative of 0k + vk2 + 0k - 2k3 + k3 wrt k. -6 Let x = -1 - 0. Let b = x - -6. Find the second derivative of -3s*5 - 4s + 7s + sb wrt s. -40s3 Let c(y) be the first derivative of -y7/210 + y*6/180 - 5y*3/3 + 2. Let f(z) be the third derivative of c(z). What is the third derivative of f(l) wrt l? -24 Let b(s) be the first derivative of -16s*5/5 - 8s*2 - 38. Find the second derivative of b(l) wrt l. -192l*2 Let i(p) be the second derivative of 5p*3/6 - 4p*2 + 13p. Find the first derivative of i(u) wrt u. 5 Suppose 0 = -l - 3o - 11, 0 = -3l - 0o + 2o + 11. Let v = l - 0. What is the first derivative of -2r4 + v + 2 - 1 wrt r? -8r*3 Suppose -4n = -5n + 3. Let d(c) be the second derivative of 0 + 0c*n - 1/10c*5 + 1/6c*4 + c + 0c*2. Find the third derivative of d(v) wrt v. -12 Find the second derivative of 12z*2 + 26 - 5z*2 - 26 + 3z wrt z. 14 Let w(f) = -3f4 + 4f*2 + 3f + 4. Let c(n) = -9n4 + 11n*2 + 8n + 11. Let r(b) = -4c(b) + 11w(b). Find the second derivative of r(h) wrt h. 36h2 Suppose 7w - 5w = 0. What is the third derivative of wt + 0t + 3t2 + t4 wrt t? 24t What is the third derivative of -90a*4 + 74a*4 + 11a2 - a2 wrt a? -384a Let t(r) = 2r*3 - 9r*2 - 3r - 3. Let g(x) = -10x3 + 44x*2 + 14x + 14. Let i(p) = 6g(p) + 28t(p). Find the third derivative of i(q) wrt q. -24 Let s(i) = -9i3 + 5i + 3. Let p(n) = -n*3 + n. Suppose g + 6 = 5j, 2g - 3 = -5. Let l(x) = js(x) - 5p(x). Differentiate l(f) with respect to f. -12f*2 Suppose 0 = -7x + 5x. Differentiate 1 + 7d*4 - 4d*4 - 3 + x with respect to d. 12d3 Let b(t) be the third derivative of t6/24 - 5t3/6 + 7t*2. Differentiate b(a) wrt a. 15a*2 Let k(r) = -r + 1. Let g(d) = -6d - 2. Let z(m) = -g(m) + 5k(m). Let o be z(-5). What is the derivative of 5s - os + 3 + 0 wrt s? 3 Suppose 0 = -4c - 2l + 12 + 16, 0 = c + l - 6. Suppose -2d = v + 4, 5d + 0d + c = -3v. Differentiate a4 - a4 - 1 - av + 2 with respect to a. -4a*3 Let z(v) be the first derivative of -4v*3/3 + 14v - 8. Differentiate z(p) with respect to p. -8p Let a(t) = 2t*2 + 4. Let u(o) be the second derivative of 2o*4/3 + 17o*2/2 - o. Let v(g) = 9a(g) - 2u(g). What is the derivative of v(l) wrt l? 4l Let x(h) = h*2 - 4h + 2. Let u be x(4). What is the second derivative of 3b5 + 4b - 5b5 + 6b*5 - ub*5 wrt b? 40b3 Let f(w) = -w2 + w + 1. Let j(p) = -5p6 - 9p*2 + 4p + 4. Let q(l) = -4f(l) + j(l). What is the third derivative of q(m) wrt m? -600m*3 Find the third derivative of -6p*2 + 28p*2 - 740p*3 + 778p*3 wrt p. 228 Let k be 1 - 3 - (-1 + -1). Let u be 1 - (-8)/(2 + k). What is the third derivative of 3f*6 - 2f6 - f5 + fu - f2 wrt f? 120f3 Suppose -3v + 4r + 10 = 0, 0 = -r + 1 - 2. Suppose -3c = vb + 4, -3b - 4c + 24 = -7c. What is the first derivative of -6x4 + 4 + 4x*b - 6 wrt x? -8x*3 Let f(k) = 6k + 2. Let n(l) = -7l - 1. Let p(v) = -4f(v) - 3n(v). Find the first derivative of p(m) wrt m. -3 Let a(t) = -t4 - t3 - t2 + 1. Let i(w) = w4 + 6w*3 + 6w*2 - 12. Let s(v) = 6a(v) + i(v). What is the first derivative of s(o) wrt o? -20o3 What is the second derivative of -3l*2 + 2l + 0l - 5l wrt l? -6 Let y(s) be the first derivative of -5s3/3 + 7s + 1. Find the first derivative of y(t) wrt t. -10t What is the derivative of 15z*3 + 20 + 7z*4 - 15z*3 + 12z*4 wrt z? 76z*3 Let t be (35/3)/(-5) - (-6 - -3). Let y(w) be the first derivative of 0w + tw3 + 3 - 3/2w2. Find the second derivative of y(r) wrt r. 4 Let l(j) be the third derivative of -j8/56 + 3j5/20 - j2. What is the third derivative of l(m) wrt m? -360m*2 What is the third derivative of 3x*3 - 37x*5 - 1 + 78x*5 - 46x*5 + 6x*2 wrt x? -300x*2 + 18 Let u be (-15)/6(2 + -4). Let i(s) be the first derivative of -2/5su + 2s + 0s4 + 0s*2 + 0s*3 - 2. Differentiate i(x) with respect to x. -8x*3 Let q(w) = -4w*3 + 22w*2 + 11w + 11. Let t(x) = -2x3 + 11x*2 + 6x + 6. Let v(l) = -6q(l) + 11t(l). Find the third derivative of v(i) wrt i. 12 Find the third derivative of 2l5 - 39l + 39l + 15l*2 wrt l. 120l*2 Let g = 75 + -71. Let d(r) be the third derivative of 1/6r*3 + 0 + 0r - 3r2 + 1/24r*g. Differentiate d(p) with respect to p. 1 Let c = 6 - -1. Differentiate -cz + 4z + 7z - 3 wrt z. 4 Let r = 2 - -2. Find the second derivative of 6u4 + ru*4 - 10u - 3u4 - u4 wrt u. 72u*2 Let b be 5/4(-20)/(-750). Let n(x) be the third derivative of 0x3 + 0x + 2x2 - bx*5 + 1/24x*4 + 0. Find the second derivative of n(c) wrt c. -4 What is the second derivative of -64w*5 + 20w*5 + 24w + 24w5 wrt w? -400w3 Let x = 3 + 0. What is the third derivative of z3 - 2z3 + 3z*2 + xz2 wrt z? -6 Let i(p) = -p5 + p4 - p3. Let h(m) = 19m5 + m4 - m3 - m2. Let f(j) = -h(j) + i(j). What is the third derivative of f(w) wrt w? -1200w*2 Let z = 14 + -8. Find the third derivative of x - zx*2 + 3x*5 - x + 10x*2 wrt x. 180x*2 Let m(b) = 3b*3 - 2b*2 + b. Let y be m(1). Suppose 0 = 3v - yv - 2. Find the third derivative of -4j*2 + 2j*2 - vj*4 + 4j*2 wrt j. -48j Suppose 0 = -6t + t. Suppose ty + 9 = 3y. What is the second derivative of -f + f2 + 3 - y wrt f? 2 Suppose 0 = -6k + 12k + 7k. Let v(i) be the first derivative of -2 + 0i4 + 0i*2 + ki - i*3 - 3/5i*5. Find the third derivative of v(z) wrt z. -72z What is the third derivative of 22q2 - 86q*4 + 91q4 - q2 wrt q? 120q Let z = -9 + 11. Differentiate -4h*3 - 25h*z + 25h*2 + 3 with respect to h. -12h*2 Let o(z) = -5z*3 + 11z2 - z + 1. Let x(w) = w2 + w - 1. Let j(y) = -o(y) - x(y). Find the third derivative of j(a) wrt a. 30 Suppose 5c = -5m + 30, 2c + 24 = 6c - 4m. What is the third derivative of -w6 - w6 - wc + w2 wrt w? -360w*3 Let f(z) = 17z*6 + 43z*2 + 5z - 5. Let w(s) = 8s6 + 21s*2 + 2s - 2. Let m(t) = -2f(t) + 5w(t). Find the third derivative of m(u) wrt u. 720u3 Let i(w) = 19w*4 + 8w. Let d(p) = 5p4 + 2p. Let l(q) = 9d(q) - 2i(q). What is the second derivative of l(z) wrt z? 84z2 Let s(n) = 51n*4 + 13n*3 + 8n - 13. Let o(y) = -25y4 - 6y*3 - 4y + 6. Let r(j) = 13o(j) + 6s(j). What is the second derivative of r(b) wrt b? -228b2 Let q(z) = -16z - 5. Let h(w) = -11w - 3. Let l(k) = -7h(k) + 5q(k). What is the derivative of l(c) wrt c? -3 Let i(s) be the first derivative of -5s*6/2 + 14s*3/3 - 27. Find the third derivative of i(p) wrt p. -900p*2 Let o(z) = -3z*4 + 2z3 + z2 - 2. Let y(x) = 12x4 - 9x*3 - 4x*2 + 9. Let p(l) = 9o(l) + 2y(l). What is the third derivative of p(w) wrt w? -72w Let l(d) = -48d4 + 32. Let f(w) = 47w*4 - 31. Let v(o) = 6f(o) + 5l(o). What is the first derivative of v(c) wrt c? 168c*3 Let g be (-22)/(-5) + 12/(-30). What is the third derivative of -6t*3 + 6t*3 - 5t*4 + 0tg - t2 wrt t? -120t Let r(l) be the third derivative of -l6/20 - l4/3 - l2. What is the second derivative of r(z) wrt z? -36z Differentiate p*2 - 3 - 9p*2 + 7p*2 - 7 wrt p. -2p Let l(v) = -v*2 + 11v + 2. Let u be l(11). What is the third derivative of -xu + x2 - 2x2 - 3x*3 wrt x? -18 Let t = -8 - 25. Let s(c) = 3c*4 - 2c3 - c2. Let n(d) = 48d4 - 33d*3 - 15d*2. Let p(a) = ts(a) + 2n(a). Find the third derivative of p(g) wrt g. -72g Let j(l) be the third derivative of -l*8/336 + 7l*5/30 + 3l*2. What is the third derivative of j(g) wrt g? -60g*2 Let i(o) = 28o + 21. Let q(f) = -1. Let c(n) = -i(n) - 6q(n). What is the derivative of c(j) wrt j? -28 Let m be 1/630. What is the third derivative of 3t*6 + mt2 - t2 - 3t2 - t6 wrt t? 240t*3 Let z be -1(5 + -2) + -2. Let y = z - -7. What is the derivative of 3r + yr**4 + 3	{ "pile_set_name": "DM Mathematics" }
v*4 - 3v*4 + 0v*4)(2 - 9 - 2)(v - 2v + 0v - 43 - 5v + 43 + (-4v + v + 2v)(-2 + 1 + 0) - 2v + 5v - 2v). -36v5 Expand (4 + 1 + 0)(-a*3 + 0a*3 + 2a*3) + (3a - 9a - 3a)(-3a*2 - 4a*2 + 2a*2). 50a*3 Expand (-10 + 28 - 3v - 13)(2v4 - v4 + 0v4 + (4v*3 - 5v3 - v3)(-2v + 3 - 3)). -15v5 + 25v*4 Expand ((-2 - n + 2)(-3 + 2 + 3) - n - n - n - 4n + 4n - n)(25n - 9n - 6n) + 0n + 0n + 2n2 + (n + 0n + 0n)(1 - 1 + n). -57n2 Expand (15654 - 15654 - 236r*3)(0r2 - 3r2 + r2). 472r5 Expand (-p + 3p + 0p)(-p2 + p2 + 2p3) + 0p*3 - 2p*4 + 0p*3 - 66p*4 + 16p*4 - 36p*4 + (-2p*2 - 2p*2 + 6p*2)(p2 + p2 - p*2). -82p*4 Expand (0 - 2 + 4 + (5 - 3 + 0)(1 - 2 + 2) + 2 - 2 + 2)(46 - 12 - 4)(13 - 4 + 0)(0x + 0x + x3). 1620x*3 Expand (-4x + 6x - 3x)(-2x + 4761x2 - 11x - 4744x2). -17x*3 + 13x*2 Expand (4 - 5 + 0)(-116 + 3o - 2o + 26). -o + 90 Expand 2333m + 30m*3 - 2333m + 2m3 - 2m3 + m3 + (1 - m - 1)(0m*2 + 0m*2 + 2m*2). 29m*3 Expand 0 + 0 + 2 + 2c*3 - 22c*2 - 2c*3 - 3c*3 + 7c*3 - 4c*3 + 3c - 3c + (-3c*2 + 3c2 - c2)(-2c + 0c + 3c). -c*3 - 22c*2 + 2 Expand ((1 + 0 + 0)(-3 + 0 + 4) - 1 + 2 - 2 - 1 + 5 - 2 + (3 + 0 - 2)(2 - 2 - 1) + 0 + 5 - 3)(-38u2 + 78u*2 + 2 + 72u*2 - u). 336u*2 - 3u + 6 Expand (d + d - 3d)(22 - 30 + 114). -106d Expand (n - 6n + 3n)(-40 + 40 + 3n2) + (1 + 0 - 2)(3 - 3 - 2n3). -4n*3 Expand (2 - 2p - 2)(0 - 2 + 0) + 71p + 62p + 10p + 3 - 3 - 3p. 144p Expand (2k4 + 0k + 0k)(0k + 0k - 2k) - 4k2 - k5 + 4k2 - k5 - 4k*3 + 4k3 + (k2 + 0k + 0k)(-4k*3 + 5k3 - 8 + k3). -4k5 - 8k*2 Expand 7s - 2s - 3s + (4s + 5s - 24s)(0 + 10 - 3). -103s Expand (-206 - 259 + 455 - 241)((i + 0i - 3i)(-2 + 4 - 3) - i + 3i + i). -1255i Expand (2g - 4g + 0g)(2g + 2g - 2g)(3g*2 + g - g) + (1 - 2g*3 - 1)(-15 + 15 - 7g). 2g*4 Expand (31 - y + 25 - 44 + 2y*2)(-10y + 11y + 7y). 16y*3 - 8y*2 + 96y Expand (-11q - 11q - 3q)(0q2 - 3q2 + q2) + 4q3 - q2 + 7q*2 - 5q*2. 54q3 + q2 Expand (3h2 - 3h*2 - 2h*3)(-328h2 + 310h*2 + 207h*2) + (0h + h + 0h)(h*4 - h + h) + 0h*5 - 4h*5 + 6h*5. -375h*5 Expand (-25g*4 + 15g4 + g4)(3g + 0g - g)(1 + 1 - 5). 54g5 Expand ((0x + x + 0x)(-4x2 + x2 + x2) - 2x*2 + 2x*2 - 2x*3 - 3 - 3x*3 + 3)(-2 + 111x2 + 1 - 122x*2). 77x*5 + 7x*3 Expand (3 - 3a - 3)(-3a*3 + 3a*3 - 7a*4) + 0a*5 - 2a*5 - 3a*5. 16a*5 Expand (-2a*2 - 2a*2 + 2a*2)(-1 + 1 + 2a3) - 3 + 3 + a5 + a5 + 0a*3 + 0a*3 + (3a + 0a - a)(-a*3 + 2a4 + a3) + 2a4 - 2a4 + a5. 3a5 Expand 117 - 117 + 55c*2 + (-c + 2c*2 + c)(3 - 5 + 1). 53c2 Expand -3g*4 - 8g*4 + 4g*4 + (8g - 5g + 25g)(-g3 + 2g*3 + 0g*3). 21g*4 Expand (2w - 3w + 0w)(-2 + 2 + 1) - 2w - w + 2w - 12w - 5w + 6w + (-3 + 0 + 5)(2w - 3w - w) + w - w - w - 3w + 7w - w. -15w Expand 27 - 27 + 36k5 - k + k5 + k + (2 - k - 2)(4k4 - k4 - 4k*4). 38k*5 Expand 3r*4 + 2r*4 - 3r*4 + (1 + r - 1)(r2 - r2 - 3r3) + 6r*2 + 8r*4 + 6r*4 - 4r*2. 13r*4 + 2r*2 Expand -190d + 54d + 13d + 0 + 0 - d + (-3 + 3 - d)(2 - 2 + 1) + d - 1 + 1 + 2d - 3d + 3d + 2d + d - d. -120d Expand (-275x2 + 569x*2 + 46x*2)(0x3 + 4x*3 - 5x*3)(-2 + 1 - 1). 680x5 Expand (-4 + 0 + 3)(-12r + 12r - 5r2) + (3r - 10r - 21r - 10r)(-1 - 2r + 1). 81r*2 Expand (-48h + 48h + 4h*3)(33 + 28 - 98). -148h3 Expand (-a2 + 2a - 2a)(-113a3 - 4a*3 - 37a*3) - 3a + a*5 + 3a. 155a5 Expand (3871d - 3871d + 74d*3)(3d2 - d2 - d2 + (5d + d - 4d)(-2d - 2d + 3d)). -74d*5 Expand -4n*3 + 2n*3 + 11n*3 + (2n + 3n - 3n)(2n2 + 0 + 0) + n2 - 2n3 - n2 - 28n*3 + 48n*3 - 21n*3 + 86n. 10n3 + 86n Expand -4c4 + 4c*4 - 2c*5 + (-216c*2 + 216c*2 - 68c*4)(0 - c + 0). 66c5 Expand (-3j2 + j2 + 0j2)(2j2 + 1 - 1) + j4 + 0j + 0j + (-j - 2j + 2j)(-3j3 + j3 - 5j*3). 4j*4 Expand (-3 + 3 + q)(3 + 3 + 1)(-74 + 74 - 11q). -77q2 Expand -2c*5 + 5c*5 - 4c*5 + (c + 3c - 6c)(0c4 + 0c*4 - 2c*4) + 395c*5 - 147c*4 + 147c4 - c3. 398c5 - c3 Expand (4v*2 + 0v*2 - 3v*2)(5v2 - 4v2 + v2)(-118v - 51v + 25v) + (v*3 + 4v*3 - 3v*3)(2v + 2v*2 - 2v). -284v5 Expand (3u + 10u + u)(-3u + 3u + u) + (3 + 0 - 2)(-3u*2 + 2u*2 + 3u*2) - 3u*2 + 4u*2 + 0u*2. 17u2 Expand (-q2 + 3q2 - 4q*2)(q - 2 + 2)(11q - 39q - 19q). 94q4 Expand -17r*2 + 25r*2 - 9r*2 - 4r - r*4 + (2 - 3 + 3)(r*4 + 3r*4 + 0r*4). 7r4 - r2 - 4r Expand (36v + 18v + 1 - 21v)(0 - 2 + 5). 99v + 3 Expand -10r4 + 7 - 5 - 2r*2 + 1 - 6r*4 + 2r*4 + 3r*4 + (0r - 3r + r)(2r - 2r + 2r3). -15r*4 - 2r*2 + 3 Expand (y + 3y - 5y + 3)(30y2 + 5y*2 + 65y*2). -100y*3 + 300y*2 Expand (3z*3 + 0z3 - z3)(-2 + 4 - 9) + z3 + 35z - 35z. -13z*3 Expand (-2258 + 2347 - 3g3 + g3)(-2 + 1 + 0)(0 + 2 + 4). 12g3 - 534 Expand (-4 + 4 - 3q*4)(-1 - 1 - 1)(3q - q + 0q + (2 + 1 - 1)(-q + 6q - q) + 8q - q + 1 - 3q). 126q*5 + 9q*4 Expand 7s*4 + 3s - s*5 - 7s*4 - 1 + (-3s + 2s + 0s)(6s*3 - 6s*3 - 3s*4). 2s*5 + 3s - 1 Expand 2g5 + 2g*5 - 3g5 + (-g2 + g*2 + 2g*5)(-2 - 1 + 4) + g*5 + 3g*4 - 3g*4 - g - 63g*4 - 3 + 43g4 + g5 + 27g4. 5g*5 + 7g*4 - g - 3 Expand (-5 - 2y*2 + 5)(3y2 - 5y*2 + 4y*2)(-112 + 76 - 101). 548y4 Expand (10 - 10 + 4l)(-l3 - 5l*3 + 4l*3 + (-6 + 2 + 3)(5l3 - 6l*3 - 2l*3)). 4l*4 Expand (0 + 0 - 1)(79s - 8s + 8s)(-s3 + s3 + 2s4). -158s*5 Expand (5m + 7m - 3m)(0 - 1 - 1) + (2 + 3 - 3)(-2m + 0m + 0m) + 2m - 5m - m. -26m Expand s2 + s2 - s*2 + (-11s - 3s - 12s)(-s + 3s - 42 + 66). -51s2 - 624s Expand (-u + 8u - 4u)(-17 + 6 + 4) + u + u - 3u. -22u Expand (9r - 9r - 3r*3 + 3)(-3r + 4r + r)(0r + r + 2r). -18r*5 + 18r*2 Expand (-5 + 3r*3 + 5)(0r - r + 0r) - r*4 - 6r*4 + 5r*4 + 0r*4 + 0r*4 - 2r*4 + (-3r2 - r2 + 5r2)(2r2 + r - r) + 0r - r*4 + 0r. -6r4 Expand (0m + 7m2 + 0m)(-17 + 5 + 15). 21m*2 Expand (-1714 + 3310 - 1763)(-1 + 0 + 3)(4j - 3j - 2j). 334j Expand (-210y*2 + 112y*2 + y + 1 + 100y*2)(y - y*3 - y). -2y5 - y4 - y3 Expand (g2 - 2g2 + 4g*2)(-14 + 28 - 11)(-2 - 2g*2 - 5 - 13). -18g*4 - 180g*2 Expand 2b*4 - 3b4 - b4 + (339b - 339b - 16b2)(3b2 - b2 + 5b*2). -114b*4 Expand (2w - 28 + 28 - w - 3w + 5w + (7w - 2w - 3w)(2 + 0 - 3) - 4w + 2w + w - w - w + w + 4w - 5w + 0w)(4 + 3 - 6)(0 - 5 + 3). 4w Expand (-3s - s2 - 10s + 6s)(-2s3 - 5s*3 + 6s3). s5 + 7s4 Expand 2w - 3w2 - 395 - 374 + 725 + w2 + 0w2 + w2 + (-2w - 2w + 3w)(4w + w - 4w) - 2w2 - 1 + 1. -4w*2 + 2w - 44 Expand (1 - 1 - 2h)(2 - 2 - h*3) + (56 + 9h*2 - 56)(-10h2 + 2h*2 - 7h*2). -133h*4 Expand -b - 1 + 1 + (1 - 1 - 2)(-1 + 1 - 2b) + 3b - 5b + 3b + 2b + 4b - 3b + (12b + 31b - 21b)(-1 + 4 - 2). 29b Expand 0u + 3u - 4u + (2 - 1 - 2)(-u + 0u + 7u) + 14u + 13u - 10u. 10u Expand 5q4 + q4 - 4q4 + (3 - 3 + q2)(9 - 9 + 7q*2) - 2q*4 + 20q*3 - 20q*3. 7q4 Expand (-2 + l3 + 2)(12l + 32 - 32)(0 + 2 + 1). 36l*4 Expand -9l*5 - 2l*4 + 2l4 - l5 + l*5 + 2l*5 + (4l*3 + 2l*3 - 4l*3)(-2l2 - 5 + 5) - 5l2 + l5 + 5l2 + 0l*4 + 2l*5 + 0l*4. -8l*5 Expand (-1 - 2 + 0)(5s + 2s - 3s) - s - 10s - 14s - 2. -37s - 2 Expand (2h5 - 14h*5 - 4h*5)(-2 - 4 - 7 - 1 + 4 - 1 + (1 - 1 + 1)(-1 + 4 - 5) + 0 + 0 + 1 + 2 + 0 - 1) + 2h5 + h3 - h*3. 178h5 Expand -l4 - l - 3l2 + l + (-24l + 14l - 26l)(-l2 - l3 + l2). 35l*4 - 3l*2 Expand -24h - 87 + 87 - 2h - h + h + (1 + 1 - 3)(-h - 3h + h) - 2h + 2h + 2h + 2 - h - 2.	{ "pile_set_name": "DM Mathematics" }
3y + i = -w - o, y - 31 = -4w. List the prime factors of w. 3 Let a(z) = z. Let o(y) = y*2 + 6y + 1. Let n(l) = 5a(l) - o(l). Let v(u) be the first derivative of n(u). What are the prime factors of v(-5)? 3 Suppose 0 = -0y + y - u - 14, -5u = -4y + 53. What are the prime factors of y? 17 Let n = -16 - -16. Suppose n = -5s - 3 + 43. List the prime factors of s. 2 Suppose -45 - 39 = 4x + 4f, -2x - 39 = f. Let u = x + 37. What are the prime factors of u? 19 Let n = -1 + 6. Suppose 2k = np + 57, 3k - 42 - 36 = 5p. List the prime factors of k. 3, 7 Let h(u) = u + 2. Let m be h(3). Suppose m = o - 2x - 5, -4x = -o + 10. What are the prime factors of o? 2, 5 Suppose -2t + 12 = 2c, -c + 2 = t + 2t. List the prime factors of c. 2 Let u(j) = -j3 - 5j*2 + 6j + 6. List the prime factors of u(-7). 2, 31 Let u(k) = -k*3 - 18k*2 + 16k - 14. List the prime factors of u(-19). 43 Suppose -h - 5s - 164 = -5h, -s - 4 = 0. List the prime factors of h. 2, 3 Suppose 5g - 9 = 2g. Suppose gq = 26 + 31. List the prime factors of q. 19 Let v = 80 - 41. Suppose 0 = -0h - 3h + v. List the prime factors of h. 13 Let k = 6 + -6. Suppose 0 = -h - 2i - 5 + 31, 2h - 2i - 22 = k. What are the prime factors of h? 2 Let d = 34 - 30. List the prime factors of d. 2 Let h(i) = -i*3 - 9i*2 + 10i. Let q be h(-10). Suppose 3u + u - 2t + 34 = q, -3u = t + 13. Let o = 8 + u. List the prime factors of o. 2 Let m = -8 + 3. Let p = -8 - m. What are the prime factors of 1(7-3)/p? 7 Let j be (-9)/(-11) + (-12)/(-66). Let a be j/(-1) + 0 - -2. Suppose -l + a + 6 = 0. List the prime factors of l. 7 Let d = 19 + -27. Let r be (-106)/d - (-3)/4. Suppose -5n + r + 46 = 0. What are the prime factors of n? 2, 3 Let c be (-5 - 1/(-1))-1. Suppose -5a + ca = -16. What are the prime factors of a? 2 Suppose 3n - 62 = -c, 0c - 4n - 264 = -4c. What are the prime factors of c? 5, 13 Let r(g) = -g3 - 8g*2 + 9. Let a(t) = 2t. Let i be a(-4). Let c be r(i). Suppose 5o - c = 1. What are the prime factors of o? 2 Suppose -3r + r + a + 12 = 0, -2r - 5a - 12 = 0. Suppose -4m + r + 12 = 0. List the prime factors of m. 2 Let g = -33 - -120. List the prime factors of g. 3, 29 Let w(y) be the third derivative of y5/60 - 2y3 + y2. Let j(k) = k*2 - 13. Let b(u) = -6j(u) + 5w(u). List the prime factors of b(0). 2, 3 Let i = -6 - -10. Let t(w) be the second derivative of w3/3 + 5w*2/2 + w. List the prime factors of t(i). 13 Let j = -16 + 101. What are the prime factors of j? 5, 17 Let h = -25 - -70. Suppose 10a + h = 5a. Let v(u) = -u - 5. List the prime factors of v(a). 2 Suppose 209 - 14 = 5c. List the prime factors of c. 3, 13 Let t = 228 + -116. What are the prime factors of t? 2, 7 Let a(d) = d*2 - 6d + 6. List the prime factors of a(6). 2, 3 Let k(u) = -u*3 - 3u*2 - 3u + 4. What are the prime factors of k(-4)? 2 Let z(c) = -2c - 2. Let f(g) = g2 + 7g + 2. Let j be f(-6). Let u = -7 - j. What are the prime factors of z(u)? 2 Let z = -27 + 18. List the prime factors of (42/z)/((-8)/12). 7 List the prime factors of 14 - 2/55. 2, 3 Suppose -6y = -y. Suppose y = -x + 5 - 2. What are the prime factors of x? 3 Suppose 2 = 3y - y. Let f be y - 17(0 - 1). Suppose -2c + f = -0c. List the prime factors of c. 3 Suppose -3h - 4u = -2u - 57, 3h = -5u + 57. Suppose -3z + h = -5. List the prime factors of z. 2 Let d(f) = -2 - 2 - 4f - 3f + 2f - f2. Let w be d(-4). Suppose 2s + 2s - 32 = w. List the prime factors of s. 2 Let z(y) = -y2 + 3y + 2. Let t be z(2). Suppose -2m + 2f = -6m - t, -4f = 4m. List the prime factors of 8 + (m - (1 + -3)). 2 Suppose -4l + 3l + 1 = 0. Let g be l-1(2 + -3). What are the prime factors of 9 - (1 - 1/g)? 3 Let l(v) = v3 + 9v*2 - 2v + 13. List the prime factors of l(-9). 31 Let a = -2 + 5. Let u = a + -1. List the prime factors of u + -1 - (1 + -6). 2, 3 Suppose -390 = -5t - 0t. Let c = t + -43. Suppose 3u + 5m - 55 = 0, -c = -2u - 4m + m. What are the prime factors of u? 2, 5 Suppose -131 = -5d - 4h + 6h, -3d + 75 = -3h. Suppose -m + 2a + d = 10, 0 = -2m + 5a + 37. List the prime factors of m. 11 Let v(g) be the first derivative of -g*2/2 + 3g - 2. Let t be v(0). Suppose 4n - tx = 74, 3x + 0x + 57 = 3n. List the prime factors of n. 17 Let f(c) = -c3 - 12c*2 - 11c - 7. Let z be f(-11). Let v(a) = a*3 + 6a*2 - 9a - 8. What are the prime factors of v(z)? 2, 3 Let f(i) = -5i + i + 1 + 0. Let t be f(-1). Suppose -ts + 5n = 6 + 4, s + n - 8 = 0. List the prime factors of s. 3 Let q = -14 + 10. Let a be (-12)/(-9) - q/6. Suppose -r = -ar + 4. What are the prime factors of r? 2 Let j(h) = -h - 1. Let g be j(-1). Let u(a) = 4 - 5a - a + g - a2. What are the prime factors of u(-6)? 2 Suppose 0 = 5f + b - 8, 1 + 3 = -f - 3b. What are the prime factors of f? 2 Let z(m) = -9m*3 + 1. Let c be z(-1). Let r = -5 + c. What are the prime factors of r? 5 Let b(y) = 3y - 4. Let s be b(2). Suppose -sk - 6 = -20. List the prime factors of k. 7 Let n(m) = m2 + 25. What are the prime factors of n(8)? 89 Let z be 3/240/15. Let h(c) = -c*3 + 7c*2 - 6c + 2. List the prime factors of h(z). 2, 13 List the prime factors of 24/92370/20. 2, 79 Suppose -4n = 8, n + 12 = 4i + 2. Suppose -3f - if - 2b = -15, 5b = 0. Suppose fp + 1 - 7 = 0. List the prime factors of p. 2 Suppose d + 1 = 3. List the prime factors of 3 - 6(-3)/d. 2, 3 Let w = 17 + -1. List the prime factors of 9/(-6(-1)/w). 2, 3 Suppose 0 = 6f - 11f + 375. List the prime factors of f. 3, 5 Let d = 135 - 46. What are the prime factors of d? 89 What are the prime factors of -42(-108)/24? 2, 3 Let r(v) = -13v2 - 2v - 1. Let u be r(-1). Let o be u(0 - (-3)/(-12)). Suppose od - 13 = 38. List the prime factors of d. 17 Suppose -2t = -4t + 8. Let m = t + -2. Suppose 5g - 5s = 0, -mg = 2s - 4 - 16. What are the prime factors of g? 5 Let b(x) = -x*2 - 12x - 6. Let w(j) = -3j2 - 35j - 18. Let v(h) = -17b(h) + 6w(h). Let i be v(-6). Let n = i - -11. What are the prime factors of n? 5 Let y = -11 - -99. List the prime factors of y. 2, 11 Let u(w) be the third derivative of w6/120 - w5/20 - w4/8 + w3/2 - w*2. Let n = 15 + -11. What are the prime factors of u(n)? 7 Suppose -3i + 1 + 11 = 0. Let b = i + -2. List the prime factors of 2 - (-3 + b)9. 11 Suppose -s + 75 = -5z, 0s + s = z + 15. Let m = z + 30. What are the prime factors of m? 3, 5 Suppose 43 = 3r - 32. What are the prime factors of r? 5 Suppose 0u = -4u - 4, -q + 49 = -5u. List the prime factors of q. 2, 11 Suppose z = -2z + 6. Suppose 0n - zn + 74 = 0. What are the prime factors of n? 37 Let n(j) = -j*3 + 5j*2 + 6j + 5. Let i(p) = -p*3 + 9p*2 + p - 13. Let c be i(9). Let q = 10 + c. What are the prime factors of n(q)? 5 Suppose 4 = d + 2z - 7z, 0 = 4d + 2z + 28. Let g(n) = -n + 2. List the prime factors of g(d). 2 Suppose 0z + z + 22 = 0. Let o = -10 - z. What are the prime factors of o? 2, 3 Let g be (4/(-12))/((-3)/(-9)). Let f = g - -22. List the prime factors of f. 3, 7 List the prime factors of ((-65)/(-10))/((-1)/(-14)). 7, 13 Suppose -6 = 2z + 4m, 5z - 7m = -4m + 37. What are the prime factors of z? 5 Let g(c) = -3 + c + 5c + c*2 - 2. Suppose -4y - i - 8 - 20 = 0, 0 = 3y - 4i + 21. List the prime factors of g(y). 2 Let q(c) = -5c2 + 4c - 14. Let u be q(3). Suppose 18 = -3k + 4l - 51, -4k - 93 = -5l. Let z = k - u. List the prime factors of z. 2, 5 Suppose 0 = -5h + 15, 4v + 4h + 3 = 23. Suppose v = 5l - 33. List the prime factors of l. 7 List the prime factors of 2 - ((2 - 4) + 2). 2 Let z = 20 - -22. Suppose 3y - 5y + z = 0. What are the prime factors of y? 3, 7 Let d(x) = x*3 - 3x + 1. Let k be 8/(-6)(-6)/4. Let q be d(k). Suppose 26 = qi + 5. What are the prime factors of i? 7 Let j = -3 - -8. Suppose 5b = -jr - 25, 1 = 3b - 2r + 6. What are the prime factors of b((1 - -2) + -10)? 3, 7 Suppose 0 = 5p - 6 - 39. List the prime factors of (p/(-6))/((-6)/8). 2 Let d(u) = u*2 - 2u + 23. List the prime factors of d(0). 23 Let u = 17 + 15. Suppose g + 2g - u = 2m, 2g - 24 = 4m. List the prime factors of g. 2, 5 Suppose 0 = 4u - 0d -	{ "pile_set_name": "DM Mathematics" }
20 + 5i4/6 + 2i - 28. Find the third derivative of h(v) wrt v. -24v + 198 Let s(i) be the third derivative of 1/6i*3 - 2i*2 + 0i + 0i4 + 0 + 0i*5 + 1/120i*6. Differentiate s(k) with respect to k. 3k*2 Suppose -5c + 3c = -20. Let j(y) = 2y*4 + 7y*2. Let f(k) = 6k*4 + 22k*2. Let s(a) = cj(a) - 3f(a). Find the third derivative of s(q) wrt q. 48q Let u(c) = 28c5 - 17c*3 + 25c*2. Let i(z) = -9z*5 + 6z*3 - 8z*2. Let o(a) = -17i(a) - 6u(a). What is the third derivative of o(p) wrt p? -900p2 Let f(p) = -p5 + p4 + p3 - p - 1. Let m(x) = 22x5 - 4x*4 - 4x*3 + 11x + 4. Let z(u) = -4f(u) - m(u). Find the second derivative of z(h) wrt h. -360h*3 Let p(a) be the first derivative of 0a - 1/3a3 + 0a*4 + 0a*5 + 4 - 1/2a*6 + 0a*2. Find the third derivative of p(v) wrt v. -180v*2 Let r = 10 + -5. Let g be r((-6)/(-10))/1. Differentiate -5n3 + 2n*3 + 3 + 0n*g + 1 with respect to n. -9n*2 What is the first derivative of 41v - 22v - 16v + 11 - 18v wrt v? -15 Let m(y) be the second derivative of -y7/70 + y5/10 - y2/2 - y. Let l(v) be the first derivative of m(v). Find the third derivative of l(b) wrt b. -72b Suppose -11 + 7 = -g. Let h(m) be the first derivative of -1/2mg - 1/3m*3 + 0m + 0m2 - 2. Find the third derivative of h(q) wrt q. -12 Let u(d) be the third derivative of d7/210 + d6/20 - d4/12 + 2d*3 + 51d*2. What is the second derivative of u(v) wrt v? 12v*2 + 36v Let y(w) = -26w3 - 2w*2 + 5. Let v(q) = 26q*3 + 3q*2 - 6. Let d(r) = -2v(r) - 3y(r). Differentiate d(k) wrt k. 78k*2 Let q(p) = 14p + 10. Let v(y) = -y - 1. Let k(b) = -2q(b) - 6v(b). Differentiate k(m) with respect to m. -22 Suppose 0 = -0g + g - 2. Find the third derivative of 3i*6 + 7i*3 - gi*2 - 7i*3 wrt i. 360i*3 Let t(z) be the second derivative of 3z*5/5 - 5z*4/4 + 12z. Find the third derivative of t(k) wrt k. 72 Let a = 10 - 6. Let u = 8 - 4. Find the second derivative of -2p - 2pa + pu + 2p4 wrt p. 12p*2 What is the third derivative of 7h*4 + 9h*2 + 6h*2 - 21h*2 wrt h? 168h Let u(b) be the first derivative of -5b5 + 7b - 24. What is the first derivative of u(y) wrt y? -100y3 Let l(f) = -2898f*2 + 253f + 3151. Let u(d) = 23d2 - 2d - 25. Let o(c) = -2l(c) - 253u(c). What is the derivative of o(q) wrt q? -46q Suppose x - 3 = 1. Let v be (-4)/10 + (-12)/(-5). What is the third derivative of xt2 - t4 - 4t2 - vt*2 wrt t? -24t Let g(x) = -5x2 - 5x - 3. Let r(o) = -11o2 - 10o - 7. Let q(a) = -7g(a) + 3r(a). What is the second derivative of q(s) wrt s? 4 Let b(u) = 159u4 + 7u*2 + 7u + 118. Let h(p) = -106p4 - 5p*2 - 5p - 79. Let y(k) = 5b(k) + 7h(k). Differentiate y(i) wrt i. 212i3 Let j(o) be the first derivative of 6o*5/5 - o + 8. What is the first derivative of j(c) wrt c? 24c*3 Find the second derivative of -c - 17c*2 - 21c + 3c wrt c. -34 Suppose 0 = s - 2s + 5. Suppose sn = -0 + 15. What is the third derivative of -2f*3 + 2f*3 + 0f*2 - 4f*2 - 4f*n wrt f? -24 Let n = -1 - -3. Suppose -2j + 3k = -j, -2 = -nk. What is the derivative of -1 + ja2 - 3a2 + a2 wrt a? 2a Let k(o) be the third derivative of 0o + 0o4 + 1/2o*3 + 0o*5 + 5o*2 + 0 - 3/40o*6. Find the first derivative of k(q) wrt q. -27q*2 Let f be 34/10 - (-8)/(-20). Suppose -fk - v - 9 = -4v, 7 = k + v. Find the second derivative of kt5 + t5 + t + 0t wrt t. 60t3 Let m(l) be the third derivative of -l7/105 - l*5/30 - 6l*2. What is the third derivative of m(a) wrt a? -48a Find the first derivative of 6t - 13 - 18 - 6t + 20t4 wrt t. 80t3 Let l(x) be the first derivative of -x9/504 + x5/60 + x2/2 + 4. Let m(s) be the second derivative of l(s). Find the third derivative of m(j) wrt j. -120j3 Let l = -18 - -21. What is the second derivative of -11c + 4cl + 14c + 4c3 - 4c*3 wrt c? 24c Let c(z) be the third derivative of z8/336 + z5/40 - z*3/3 + 3z*2. Let w(s) be the first derivative of c(s). What is the second derivative of w(d) wrt d? 60d2 Let u(c) be the second derivative of -c5/20 - c*4/3 - 2c*3/3 + 3c. Let j be u(-3). What is the derivative of -5 - 2n + n + 0 + j wrt n? -1 What is the third derivative of 11p*3 - 7 - 5p*2 + 74p*5 - 75p*5 + 4 wrt p? -60p*2 + 66 Suppose 3q + 4 = r + 3, 3q - 2 = -2r. Find the second derivative of -7t4 + qt + 5t4 - t wrt t. -24t*2 What is the third derivative of 2v*5 + 22v*6 - 20v*2 - 30v*6 - 2v*5 wrt v? -960v3 Let p(t) be the second derivative of -t5/10 + 11t2/2 + 30t. What is the first derivative of p(u) wrt u? -6u2 Let x(i) = -4i*2 + 7i. Let c(v) = 4v2 - 8v. Let g(z) = -4c(z) - 3x(z). What is the second derivative of g(j) wrt j? -8 Let p(y) = y - 4. Suppose x + 7 = -4a - 3, 0 = x + 3a + 6. Let v be p(x). Find the third derivative of o5 - o2 + o*2 - vo*2 wrt o. 60o2 Let g(q) = -25 - q + 25 + q2. Let s be g(-1). What is the third derivative of -5ds + 4d2 - d2 + 4d3 + 3d*2 wrt d? 24 Let w(c) be the second derivative of -7c6/30 - c4/2 - 3c. What is the third derivative of w(g) wrt g? -168g Let p = -4 - -2. Let j = 3 + p. What is the derivative of -j - q - 1 + 4q wrt q? 3 Suppose -t - 15 + 0 = 4d, -d - 7 = -3t. Let w be 4/d0/2. What is the first derivative of -2 + wb4 - 2b*4 + 0 wrt b? -8b*3 What is the second derivative of 37p*4 + 40p*4 - 81p*4 - 17p wrt p? -48p2 Suppose 5y + 9 - 24 = 0. What is the first derivative of y + 2w3 - 4 - 2w3 - w3 wrt w? -3w2 Let i(a) = a + 5. Let h(u) = u + 4. Let o(k) = 5h(k) - 4i(k). Let d be o(2). What is the third derivative of -2j*3 - dj*2 - 2j*2 + 7j*2 wrt j? -12 Let r(x) = -x + 4. Let u be r(-2). Find the third derivative of up4 + p4 + p*4 - 3p*2 wrt p. 192p Suppose 0 = -d + 1. Let f = 3 - d. Find the third derivative of 5u2 - 3u2 - u6 - 6uf wrt u. -120u*3 Suppose -82 = -5v - 2y, -4y + 36 + 16 = 3v. Let h be (-11)/(-4) + 4/v. Find the second derivative of 0s3 + s + s2 - s*2 - hs*3 wrt s. -18s Let r(u) = u*2 + 0 - 9u - 2 - 1 + 13. Let s be r(8). Find the second derivative of 4k5 - 3k*5 + 3k + sk5 - 5k wrt k. 60k3 Let b(l) be the first derivative of l6/6 + 4l*3/3 + 10. Find the third derivative of b(h) wrt h. 60h*2 Differentiate -22 + 19y*4 + 62 - 29y*4 + 11y*4 wrt y. 4y*3 Let b(q) = -3q*2 + 6q + 4. Let x(u) be the first derivative of -u*2/2 - 3. Let i(y) = -b(y) - 6x(y). What is the first derivative of i(g) wrt g? 6g Let h(r) be the third derivative of 3r*7/35 - 3r*4/2 - 5r*2 - 4r. Find the second derivative of h(w) wrt w. 216w2 Let w be -2(-2 + (-2 - -3)). Find the third derivative of 5d5 - 7d5 + d2 + 2dw wrt d. -120d*2 Let n = 14 + -30. Let p be (18/8)/((-3)/n). What is the second derivative of 12 - p - 2c + 3c5 wrt c? 60c*3 Let s(k) = -15k*4 + 13k*2 + 4. Let p(g) = 7g*4 - 6g*2 - 2. Let m(v) = 13p(v) + 6s(v). Find the first derivative of m(f) wrt f. 4f3 Let a(j) be the second derivative of j11/13860 - j7/840 - j4/12 + j. Let r(c) be the third derivative of a(c). Find the third derivative of r(d) wrt d. 480d3 Let n(l) = -l3 - l2 - l + 1. Let a(p) = 5p*4 + 2p*3 + 2p*2 + 2p + 3. Let t = -5 + 6. Let w(x) = ta(x) + 2n(x). Differentiate w(g) wrt g. 20g3 Let l = 138 - 688/5. Let k(u) be the first derivative of 0u4 + 2 - u2 + 0u3 + 0u - lu5. Find the second derivative of k(p) wrt p. -24p2 Let a be 19/4 - (-12)/(-16). Find the third derivative of -i4 + ai2 - 10i*3 + 10i*3 wrt i. -24i Find the second derivative of -33n + 7n - 15n + 24n*3 wrt n. 144n Find the second derivative of -4f3 - 16 + 3 - 5f*3 - 47f*3 + 2f wrt f. -336f Let z(p) be the second derivative of -5p7/7 - p4/12 + 32p. Find the third derivative of z(f) wrt f. -1800f2 Let i(s) be the first derivative of s6 - 3s2/2 + 1. Find the second derivative of i(v) wrt v. 120v*3 Let g(y) be the second derivative of 13y*6/30 + 5y*4/12 + 7y. Find the third derivative of g(p) wrt p.	{ "pile_set_name": "DM Mathematics" }
16/(-64)12). -1/3 What is the value of ((-32)/44)/(-4)8910/162? 10 What is ((-2)/(-12))/((4453/(-1220))/73)? -10/3 What is 1(-14)/(-3)(-112)/983? -16 What is (-92)/(-1104)84/25(-4)/14? -2/25 What is (-1)/(4/72)-16(-5)/80? -18 ((84/32)/21)/((-2)/(-4)) 1/4 Calculate (181/198)/(4/22). 1/2 What is the value of (-19)/(-228)-20(-4)/(-90)-3? 2/9 What is the value of ((-5)/1515)/(-1)? 5 Calculate ((-1984)/(-7688))/(16/6). 3/31 What is ((-300)/(-126))/5(-27)/(-15)? 6/7 Calculate 13(792/(-27))/8. -11 What is (48/36)/(17/(306/40))? 3/5 ((-12)/72)/(7/714) -17 What is the value of 14/(392/14)28/(-4)2? -7 Evaluate (-2)/((-24)/44)672/1120. 11/5 Evaluate 8/(-3)(6/(-4))/(188/(-564)). -12 What is the value of (713/65)/(7(-6)/(-42))? 7/5 Calculate ((-168)/44)/(3(-19)/418). 28 Calculate 21((-275)/33)/25. -7 Calculate 320/12601. 1/21 Evaluate (4/(-36))/(((-3)/(-36))/(5/10)). -2/3 What is the value of (6922/506)/12? 1/4 (1131/(-9))/(3393/(-783)) 29 Calculate (2133/(-948))/(1/4). -9 Evaluate (-14)/6189/(-1764). 1/4 Evaluate (255/(-170))/(3/9). -9/2 Calculate (420/(-1323))/((-62)/(-558)). -20/7 Evaluate (3(-1)/(-4))/(((-5673)/248)/61). -2 Evaluate -42((-80)/(-15))/16. -14 What is (((-150)/(-12))/25)/((-3)/(-18))? 3 Calculate 14/(14(-52)/(-208)). 14 What is 48/80((-2)/(-24))/((-26)/260)? -1/2 (10584/2205)/((-12)/(-15)) 6 Evaluate (4/(5/(-3)2))/((-324)/(-4050)). -15 Calculate -423(-22)/5060. 2/5 (36/144)/((-22)/(-24)) 3/11 (-32)/(-70)70(-38)/(-1064) 8/7 50/(-1)((-3168)/180)/44 20 ((-2)/((-408)/9))/(18/(-144)) -6/17 (-500)/300(-3)/(-5)36 -36 (1-11/(-1))/(648/54) 1/12 What is the value of ((-2)/(-9))/(10330/27891)? 3/5 Calculate ((3/82)/3)/((12308/272)/(-181)). -2/41 (1/63)/(-1)0/(-14) 0 What is (-2)/(3/(336/8)4/4)? -28 What is the value of (-1566)/1566(-1)/(-13)? -1/3 ((-9)/7)/(38148/(-10472)) 6/17 What is ((3/(-5))/(-3))/(547/1094)? 2/5 Evaluate ((1-2)/(-4))/(598/(-3588)). -3 Evaluate (-1(-9)/3)/(13/((-195)/3)). -15 What is ((-1)/(1/2))/((-10)/(-240)-4)? 12 What is ((-28)/1995)/((-8)/(-14)56/80)? -2/57 Evaluate (-48)/252(-18)/8. 3/7 What is the value of 4/615774/(-956)? -11 (-48)/672497/((-343)/(-12)) -6/7 Evaluate (13/(-78))/((-15)/182/(-5)). -1/2 Calculate 99/66(-12)/(-45)-210. -8 Evaluate (2/(-60)5)/((-3)/126). 7 Calculate 1/(-56)8-713. 13 5-122/((-34)/(-51)-15) 11 Evaluate (569/(-1138))/(1/42). -21 (-40)/(-110)891/(-3078) -2/19 Calculate 18/(-170)(1/9)/((-82)/(-2460)). -6/17 Calculate 4/(-6)(-234)/(-1092). -1/7 ((2/(-1))/((-8)/3))/((-2)/24) -9 Calculate (12/(-418))/(81/(-594)). 4/19 Evaluate (132/57)/(-22)12/6. -4/19 Calculate -124/8(-3)/126. 9 Evaluate -1341/(2829/46). -2 What is the value of ((-100)/(-25))/((-162)/(9/(-1)))? 2/9 Evaluate (-1000)/(-3000)(-4)/5-6. 8/5 Evaluate (1/(5/(-4)))/(8/(-6))5. 3 Evaluate ((-4)/112)/((-44)/462). 3/8 What is the value of ((-280)/(-840))/(17/(-3))? -1/17 (2/(-1))/((-143)/(-39)) -6/11 What is the value of (140/(-15))/(((-64)/(-240))/(10/25))? -14 Calculate ((-1)/(-38))/(107/(-428)). -2/19 5/(-120)-4756/14 9 Calculate (-4)/(4/15)(546/26)/(-63). 5 ((-2)/12)/((-1)/(-2))-1 1/3 Evaluate 27(-12)/840. -1/5 Calculate (20/(5/(-5)))/((63/(-7))/9). 20 Calculate (3/19210)/((110/40)/11). 5/8 (9282/(-2652))/((-7)/4) 2 Calculate 46(-6)/108(-3)/7. 4/7 What is the value of ((39/(-18))/((-27)/(-81)))/((-3)/(-6))? -13 ((-100)/200-314)/3 7 Calculate 308/11050/35. 4 Evaluate (-2)/(594/108(-2)/88-4). -4 What is the value of ((-2)/(-50)20)/(10/(-525)-3)? 14 What is the value of (29/(-29))/((-4)/20)? 5 Calculate (4/(-10))/((10/(-100))/(1/4)). 1 What is the value of -2230/(-30030)13? 2/7 Evaluate (4/(256/48))/(-56/120). -3 What is the value of ((-152)/1368)/(1/2)? -2/9 4/6(-61)/(-427) 2/21 Evaluate ((-5)/(-10))/((-70)/(-56))(-10)/2. -2 (690/40)/(-23)15/(-9) 5/4 Evaluate ((-3)/(64))/((-20)/360-3). -3/4 Evaluate ((-16)/(-2))/(-74(-140)/16835). 13 Evaluate (-20)/(-60)60/(-1). -20 Evaluate (-18)/6(16/15)/(28/(-70)). 8 What is ((-4)/(-24))/(22/(264/58))? 1/29 What is (6(-35)/28)/(108/(-16))? 10/9 ((-2)/24)/((464/(-16))/(-87)) -1/4 Calculate ((-22)/(22528/48))/((-48)/(-32)). -1/32 Calculate (6/(-7))/((-1570)/(-2198)). -6/5 Evaluate 10/12(-258)/172. -5/4 Evaluate 1/(-23/(-6))2. 2 What is the value of (3/(-34))/(1048/(-2227))? 3/16 7(2002/(-98))/(-13) 11 What is the value of ((-96)/(-16))/(-3(-21)/(-27)3)? -6/7 What is (-16)/((176/(-33))/(-2))? -6 What is the value of 66/(-1)(20/88)/((-170)/408)? 36 Evaluate 51((-1120)/(-32))/(-105). -17 What is the value of ((-3321)/1476)/((-18)/(-4))? -1/2 (-24)/2400-25(-112)/(-2) 14 Calculate ((-5)/12)/(4/(-14)(-112)/64). -5/6 (8/224)/((-3)/12)(-7)/6 1/6 What is the value of (48/9)/(634/951)? 8 (-5)/(45/(-9))1/((-14)/(-18)) 9/7 (((-136)/40)/(-17))/(5/(-25))-7 7 Evaluate 1/1-4(-11)/(-132). -1/3 Calculate (2261/1938)/((-2)/(-2)1/(-3)). -7/2 Evaluate (-12)/(((-330)/(-110))/((-1)/(-1)2)). -8 What is ((-22)/(-8))/(9(-50)/(-1800))? 11 Evaluate (-396)/(-7722)2/(-2). -2/39 What is the value of (-465)/310(-1)/(-6)? -1/4 What is the value of (-55)/50144/132? -6/5 Evaluate ((-112)/56)/(2/4)5/(-2). 10 What is 11/2(3072/88)/24? 8 What is -2-2225/(-405)(-1)/20? 1/9 What is (75/(-9))/((-22)/990125/10)? 30 Calculate (35/(-84))/((14/105)/((-8)/10)). 5/2 ((-14)/98)/(-1(-6)/(-84))4 8 Evaluate ((-112)/((-1652)/59))/((-22)/6). -12/11 Evaluate (-2336)/(-28032)42/4. 7/8 What is (2-11)/((-18)/3186-59)? -6 Evaluate (11/44)/((-12)/(-16)). 1/3 (-25)/15(-912)/800-10 -19 (-39)/15155/(-93)-13 -13 What is ((-12)/(-98))/((164/(-41))/(-28))? 6/7 Evaluate (1152/(-512))/((-3)/(-2))(-44)/6. 11 What is the value of ((-2)/1)/(9/189)(-16)/(-32)? -21 What is ((-16)/(-24))/(9/((-4374)/(-18)))? 18 What is the value of (-1116)/(-4278)1/(-3)? -2/23 What is the value of (-1(-4)/8)/(-1317/(-3536))? 8 What is 27/(-243)-112/3? 4/9 What is (-98)/(-98)(8/2)/(-1)? -4 Evaluate 9/(-180)2-8(-3)/(-3). 4/5 Evaluate 35/(-30)(-423)/(-94). -21/4 Evaluate 800/(-30)(-7)/(-525)5. -16/9 What is the value of 40/(-50)(-12)/(-32)? -3/10 What is the value of (18/((-414)/115))/((-1)/(-1))? -5 What is (-221)/34(-30)/(-45)? -13/3 ((-26)/10)/(53/75) -13 What is the value of (-4)/(-2)2/1(-7)/(-70)? 2/5 Calculate ((-24)/(-52))/((-341)/403). -6/11 What is 51(-4)/(-68)(-4)/(-9)3? 4 What is the value of 400/42007/9? 2/27 What is (4/(-10))/((-45)/(-100))? -8/9 Evaluate (12(-2)/28)/((-44)/(-14)). -3/11 ((-5)/(-2))/(286/(-572)) -5 (20/49)/((-3902)/13657) -10/7 What is the value of (-21)/(-98)1-4? -6/7 Calculate 28/364(-182)/(-84). 1/6 What is (-20)/(-80)-226? -13 What is (-375)/300(-16)/710? 2/71 What is 27(-2)/30480/24? -36 What is the value of (((-920)/598)/(-5))/(62/26)? 4/31 Calculate 11-42/32-11. 11/4 Calculate ((-4)/(-66))/((-2)/(-44)). 4/3 What is the value of (-8)/(-5)160/(-192)? -4/3 5/((-1)/((-11)/55-15)) -15 What is (-792)/(-1155)45/36? 6/7 Evaluate -1654/129645/2. -15 What is (64/(-72))/(-2)-36? -8 What is (1/(-5)-1)/((-17)/(765/3))? -3 Evaluate (-3)/(55/446/15). -6 Evaluate (-3380)/52(-10)/(-50). -13 Calculate (117/(-52))/(2/823/(-23)). 9 1/((847/14)/(-11)) -2/11 Evaluate (-8)/(-564)(-17)/(170/(-30)). 2/47 What is the value of ((-6)/(-12))/((-10)/(-30)-9)? -1/6 Evaluate (-81)/(-864)176-1(-2)/(-3). -11 What is the value of (-76)/(-5)(-250)/(-200)? 19 Calculate ((-164)/3693/2)/1. -2/3 What is -1((-2)/(-24))/((-39)/(-234))? -1/2 What is the value of ((-24)/168)/(10/70)? -1 ((-10)/(-12))/((-1)/(-6)) 5 Calculate (1/9)/(85/9945). 13 What is the value of (1/(-14))/(353/(-10590))? 15/7 ((618946/201)/149)/((-2)/3) -31 What is (9/16)/(141/188)3/(-6)? -3/8 Calculate (-43)/(-43)4/(-6)-15. 10 What is ((-29)/((-290)/20))/(16/24)? 3 What is -78/(-840)138/23? 2/5 Calculate (11/2)/((714/(-252))/(-17)). 33 Calculate (405/(-243))/(((-42)/36)/(3/6)). 5/7 What is ((-6)/975-13)/1? 2/25 (-20)/(((390/(-9))/(-26))/((-15)/(-9))) -20 Calculate ((-19)/76)/(5/(-4)). 1/5 What is ((-6)/((-648)/(-10)))/(75/(-45))? 1/18 25/(-10)(-760)/(-100)1 -19 What is ((2/75)/(2/6))/((-8)/(-40))? 2/5 (72/336)/((-60)/(-14)) 1/20 What is (-8)/7(-136521)/(-7092)? -22 Evaluate (-28)/(-50)*(270/(-432))/(4/16). -7/5 Evaluate (-3	{ "pile_set_name": "DM Mathematics" }
s gq2 + mq + w and give g. 18 Rearrange -12a - 4a - a to ua + v and give u. -17 Rearrange -c4 - 17c*3 - 4 + 3c*2 + 46c*3 - 13c*3 - 17c*3 + 2c to the form ic4 + oc*2 + b + xc + rc3 and give x. 2 Rearrange (-3 + 0 + 2)(-h - 4h + 3h) - h - 2h + 4h - 4h + h + h + (-3h + 4h + h)(-26 + 80 - 34) to the form ih + q and give i. 41 Rearrange 6w*2 + 2w - 2w - 5w*2 to the form q + jw + xw2 and give x. 1 Express -1 - l2 - 2 + 2l2 + 8 - l3 in the form fl + yl*2 + vl*3 + h and give h. 5 Rearrange 2q3 - q2 + 2q4 + q - 5q*2 + 1 + 6q*2 to the form kq*2 + yq*3 + g + cq + aq4 and give g. 1 Express 7a - 7a + 2a*2 - 2a as ha + u + qa*2 and give q. 2 Rearrange (4k - 2k - 3k)(0 + 0 + 1)(2 - 1 + 1) to the form sk + m and give s. -2 Express -l + l + 2l + 3l in the form h + ql and give q. 5 Rearrange -25 + 25 - 8m2 to the form b + fm + sm2 and give s. -8 Rearrange 2j*2 + 88 - 88 + 4j to t + vj2 + mj and give v. 2 Express (-z - 2z + 5z)(-3z + 1 - 1) + (-5z + 3z + z)(4 + 6z - 4) in the form cz + nz2 + x and give n. -12 Express (-10 + 17 + 18 + t2)(-t2 + t - t) in the form dt*4 + it*2 + k + ht*3 + st and give i. -25 Express (-45 + 45 + 2y)(0 - 2y + 0) + 2y*2 - 2 + 2 in the form ry*2 + my + q and give r. -2 Express -107 + 31l2 + 109 + 27l*2 in the form u + pl*2 + sl and give p. 58 Rearrange (m*3 - 5m + 5m)(3 + m - 3) + m2 - m2 - 2m4 to u + fm*2 + km + wm3 + cm*4 and give c. -1 Express (8 + 7 - 4)(2 + 1 - 4)(4v + 0v - 2v) as nv + a and give n. -22 Rearrange -6 + 8 - 3i - 11 + 2i2 to di*2 + g + bi and give g. -9 Rearrange 699 - 699 + 13m to the form hm + x and give h. 13 Express (u - 17u - 11u)(4 + 0 - 2) in the form yu + j and give y. -54 Rearrange 5 - 17c2 + 13c + 22c - 35c to the form wc2 + g + ac and give w. -17 Rearrange 4t3 - 4 - 3t*3 + 1 + (-2t + t - 3 + 5)(-2t2 + t2 + 0t2) to f + lt + at3 + nt*2 and give f. -3 Express 31a + 3 + 10 - 13 in the form i + fa and give i. 0 Express (2a*2 + 3a - 3a)(20a - 84 + 84) in the form za*3 + ta + q + ca2 and give z. 40 Express 3 - 3 - 2l*2 + (-4 + 4 - 6l*2)(0 + 0 - 2) in the form nl + ml*2 + a and give m. 10 Rearrange -3p + 13p3 - 8 + 4p - 14p3 to kp + yp2 + b + op*3 and give b. -8 Rearrange 0w*3 + 2w2 + w3 - 2w3 to the form k + iw*3 + pw + vw2 and give v. 2 Express 43 - 2k*3 + 3k*3 - 24 - 64 as o + vk + bk2 + yk*3 and give o. -45 Rearrange -24p*2 - 29p + p*3 + 24p*2 to ip + k + rp3 + gp*2 and give r. 1 Express -o + 8o*2 - 6o*2 + o - 52 in the form co + g + zo2 and give g. -52 Express (-2 + 2 + 2)(0 + 0 - 2)((-2c + 4c + 0c)(2 + 2 - 3) - 2 - c + 2) in the form l + xc and give x. -4 Rearrange 439a - 439a + 8a2 to ya*2 + s + qa and give q. 0 Express -4h3 + 6h3 + 2 - h4 - 13h4 + 6h*4 in the form w + ph*3 + ch + th2 + uh*4 and give w. 2 Rearrange (-3 + 0 + 2)(4q3 + 2q*3 - 4q*3) + (-3q + 2q + 5q)(4 - 2q - 4)(2q + 0q + 0q) to j + cq + pq*3 + iq*2 and give p. -18 Rearrange (35 - 2 - 100)(u - u - u)(4 - 1 - 1) to t + pu and give p. 134 Express (4w3 - 3 + 3)(-1 - 3w - 2 + 0w) in the form o + cw2 + bw*4 + lw*3 + hw and give o. 0 Express 1 - 1 - w + 2w - 3w + 6w + (2w - 2w - w)(-2 + 0 + 4) - 3w + 4w - 2w + 2w + 0 + 0 - w + 0w - w in the form p + mw and give m. 1 Express 3 + 8r2 - 5 + 36r*4 + 4r*2 + 2r - 35r4 as xr + o + dr3 + qr*2 + ir*4 and give o. -2 Rearrange -2q + 3q2 + 62q*3 - 25q*3 + q - 35q*3 to pq + h + nq3 + cq2 and give c. 3 Rearrange u2 - 51u - 3 + 0u*2 + 0 + 50u to the form su + tu*2 + p and give p. -3 Express -651n*2 + 651n*2 - 2n*3 + 1 - 2n in the form cn + pn*2 + tn*3 + y and give c. -2 Rearrange (-2 + 2 - p + (-4p + 4p + 2p)(-1 + 0 + 0) - p + 1 - 1 - p - p + 0p)(-1 - 3 + 2)(-4 + 7 - 5) to the form a + fp and give f. -24 Express (26 - 23 - 19 + 2 + 1 - 5 + (4 + 2 - 4)(3 - 5 + 1))(-6p*4 + 3p4 + p4) in the form l + ap + qp*3 + dp*2 + xp*4 and give l. 0 Express 2d*2 - 6d*3 - 5d*2 + 2d*2 + 4d*3 + 2d*4 as ud*4 + rd*2 + td + gd3 + c and give u. 2 Rearrange (-2d + d + 2d + (-5d - 6d - 5d)(-6 + 2 + 2) - 4d + d + 2d)(2 + 4 - 4) to gd + o and give g. 64 Rearrange 4 + 36j*3 - 34j*3 + 10j - 2j to the form f + bj*2 + yj*3 + nj and give f. 4 Express (-1 + 3 - k - 3)(-2k - 4k + 4k) + 5k2 - k2 - 3k*2 in the form vk + c + rk2 and give r. 3 Express 2h*2 + 0h*2 - 4h*2 + (-4h*2 + 4h*2 + 2h*2)(-3 + 0 + 1) - 18 + 18 - 7h2 in the form mh + vh2 + u and give v. -13 Rearrange 0o*2 - 3o*2 + 7o*3 - 6o*3 - 3o*2 to the form ro*3 + ho + s + ko2 and give k. -6 Express 262 - 262 + 2c + c*2 as fc*2 + qc + m and give f. 1 Rearrange -5a2 + 4a*2 - 189a - 4a to the form ma + wa2 + c and give w. -1 Rearrange -3u - u*4 + 3u - u*4 + 1 - 1 + (-3u*3 - 19u*3 - 11u*3)(-2u - u + u) to nu*4 + fu*2 + h + bu + vu3 and give n. 64 Express 3z2 + z2 - z*3 - 2z*2 + 16z - 11z as xz*2 + g + iz + bz3 and give x. 2 Express (-4a + 4a + 2a)(6a3 - a3 - 4a3 + (-6a*3 - 4a*3 + 14a*3)(1 - 1 + 1)) as b + qa + ca*2 + sa*4 + za*3 and give s. 10 Rearrange 753 - 753 + 32a + 87a to the form y + la and give l. 119 Express 3r - 1 - 2r*4 - 3r*4 - 2r in the form vr2 + ir + cr3 + gr*4 + a and give g. -5 Rearrange 3s - 30s2 - 4s + 32s2 + 18 to m + ts + qs2 and give m. 18 Express -9v*2 + 4v + 11v2 - 9 + 6 as hv + a + dv2 and give d. 2 Express (-w - w2 + w)(1 + 8 + 4) in the form gw + b + kw*2 and give k. -13 Express 8p*2 - 3p*2 + 2 + 4p4 - p3 + 138p - 138p as ap3 + kp + np4 + q + jp*2 and give q. 2 Rearrange -8w*4 + 7w*4 - 2w3 + w3 + 5 - 4 to the form k + cw4 + vw*2 + jw*3 + nw and give k. 1 Rearrange (2y + 8y - 4y)(3 + 1 - 1)(-1 + 0 + 2 + (-4 + 1 + 2)(-2 + 2 + 2) - 1 + 2 + 1) to the form zy + c and give z. 18 Rearrange (-2m*2 + 5m*2 - 5m*2)(3 + 0 - 2) - m2 - m2 + 0m2 + 5m*2 - m + 17 - 17 to the form vm + sm2 + p and give v. -1 Express (-5 + 3 - 1)(7o - 2o*3 - 7o) in the form do2 + i + jo*3 + vo and give j. 6 Rearrange -11l + 13l*3 + 2 + 14l - 3l to vl + pl2 + a + bl*3 and give a. 2 Express (-2 + 0 + 14)(-3a2 + 0a*2 - 5a*2)((1 - 4 + 2)(-6a + a + 3a) + a + 3 - 3 + 0a - 2a + a) as b + ta*2 + va*3 + ca and give b. 0 Express (28 - 41 - 115)(-2d*3 + 2 - 2) as rd*3 + ud + x + gd2 and give r. 256 Rearrange 2v - 2v + 26v*2 to the form sv + y + gv2 and give y. 0 Rearrange 4 + 26z*3 - 24z3 - z2 + 3z4 - 2 to the form s + bz + vz3 + lz*4 + dz*2 and give d. -1 Rearrange (-86 - 56g - 95 + 183)(-3g*2 + g - g) to the form o + ig*2 + pg*3 + wg and give p. 168 Rearrange (-14a2 + 63a - 63a)(3 + 2a - a - 3a) to the form ya3 + la + oa2 + f and give y. 28 Express (-4d + 8d + 3d)(4d3 - d3 - d*3) + (d + d + 0d)(-1 - d3 + 1) in the form od*4 + v + kd*2 + id*3 + qd and give o. 12 Express 148 - 148 - 27s4 + 2s4 + s2 - s2 + (-s2 - 4s + 4s)(-2s2 + s2 + 0s2) in the form as*4 + us*2 + g + xs + ns3 and give a. -24 Express 5o*4 + 0o2 - o2 + o*4 - 3 - 2o*4 as x + to*3 + io + wo4 + jo*2 and give j. -1 Express (q + 4 - 4)(-3q + 2q + 2q) + (3 + 1 - 2)(-7q2 + 15q*2 - 7q*2) as tq + n + lq2 and give l. 3 Rearrange (-f + 2f - 3f + (1 - 3 + 4)(-9f + 10f + 9f))(-1 + 0 + 3) to the form v + sf and give v. 0 Rearrange 24b + b*2 - 9b*2 + 5b*2 + (-2b - 1 + 1)(2b - 4b + 3b) to c + hb2 + sb and give h. -5 Express -110 - 3v + 110 in the form y + qv and give q. -3 Express ((1 - 2 + 2)(-y + 0 + 0) + 5y - 4y + y + 2 - 2y + 2 - 2)(0 - 5 + 1 + (-5 + 3 + 8)(9 - 2 - 3)) in the form hy + u and give u. 40 Rearrange -g - 2g - g - g*3 + g + 2 to the form x + jg*3 + yg + qg*2 and give y. -3 Rearrange (f + f	{ "pile_set_name": "DM Mathematics" }
117m2 + 972m. m(m + 9)(m + 108) Find d, given that -d*5 - 1245d*4 - 390607d*3 - 1930683d*2 - 2694520d - 1153200 = 0. -620, -3, -1 Find q such that 10q4/3 + 19135q*3/3 - 28750q*2 + 115055q/3 - 47950/3 = 0. -1918, 1, 5/2 Factor -q*2/2 + 659q/2 - 329. -(q - 658)(q - 1)/2 Factor 3k*3/5 - 576k*2/5 + 26028k/5 + 22704. 3(k - 110)(k - 86)(k + 4)/5 Solve -2x*4/7 + 5136x*3/7 - 629520x*2 + 181703872x - 1067718624 = 0. 6, 854 What is o in 9o5 - 75o*4 + 123o*3 + 147o*2 - 60o = 0? -1, 0, 1/3, 4, 5 Let 3f4/4 - 153f*3 + 30255f*2/4 - 14823f/2 = 0. What is f? 0, 1, 81, 122 What is l in 3l2 - 636l + 21801 = 0? 43, 169 Find m such that -5m4 - 20050m*3 - 20160185m*2 - 120420300m - 180360180 = 0. -2002, -3 Find j, given that 3j2 - 78144j + 508873728 = 0. 13024 Factor -z*3 + 1368z*2 + 30459z + 168190. -(z - 1390)(z + 11)2 Factor 4a*4 + 8976a*3 + 5053456a*2 + 20106240a + 20070400. 4(a + 2)2(a + 1120)2 Determine j so that j2 - 224824j + 12636457744 = 0. 112412 Solve 3f*5 - 74f*4 + 494f*3 - 652f*2 + 103f + 126 = 0 for f. -1/3, 1, 9, 14 Factor -2f3/9 + 131362f*2/3 - 6470924960f/3 - 19413168968/9. -2(f - 98522)2(f + 1)/9 Let -3u2/2 - 1749u + 53145/2 = 0. What is u? -1181, 15 Factor -5n2 + 93720n + 187460. -5(n - 18746)(n + 2) Factor 4h2/7 - 13584h/7 + 1940. 4(h - 3395)(h - 1)/7 Find b such that 58038245b4/4 + 2518791693b*3/4 + 497650279b*2/2 - 292785b + 86 = 0. -43, -2/5, 2/3407 Factor -471a4 + 1581a*3 - 1917a*2 + 975a - 168. -3(a - 1)3(157a - 56) Let -4f*5 - 358f*4/3 - 704f*3 - 358f*2/3 + 4440f - 2200/3 = 0. Calculate f. -22, -5, 1/6, 2 Let -c*4/3 - 17363c*3/6 - 6279980c*2 + 6281427c/2 = 0. Calculate c. -4341, 0, 1/2 Let -o*2/5 - 4183o/5 - 70822/5 = 0. Calculate o. -4166, -17 Let -2n4/11 - 288n*3 - 1238588n*2/11 + 1147680n - 31760450/11 = 0. Calculate n. -797, 5 Let 45b4/2 + 2307b*3/2 + 306b*2 = 0. Calculate b. -51, -4/15, 0 Factor 229p*3 + 4120p*2 - 36p. p(p + 18)(229p - 2) What is y in -12y*4/5 - 182y*3/5 - 866y*2/5 - 1528y/5 - 832/5 = 0? -8, -4, -13/6, -1 Determine h so that h*4/2 + 128h*3 + 5657h*2/2 + 10267h - 13224 = 0. -232, -19, -6, 1 What is i in -2i5/5 + 684i*4/5 - 59154i*3/5 + 22712i*2 + 34680i = 0? -1, 0, 3, 170 Find x such that 3x2 - 5484x - 167220 = 0. -30, 1858 Factor -39o2/5 - 15441o/5 + 3096. -3(o - 1)(13o + 5160)/5 Find k, given that -2k*4/3 - 1592k*3 - 2827292k*2/3 + 9544040k - 71880050/3 = 0. -1199, 5 Factor 2f2/9 + 492034f/9 + 492028/3. 2(f + 3)(f + 246014)/9 Find r, given that -r*3 + 116r*2/3 - 76r/3 = 0. 0, 2/3, 38 Suppose 3y3/4 - 123y*2 + 4395y/4 + 17325/2 = 0. Calculate y. -5, 15, 154 Let -273s3/4 + 453s*2 + 687s/4 + 21/2 = 0. Calculate s. -2/7, -1/13, 7 Let 5p4/2 + 35734p*3 - 142951p*2/2 + 35739p = 0. What is p? -71478/5, 0, 1 Find l such that 1472l3 - 48580l*2 + 47236l - 128 = 0. 1/368, 1, 32 Let -f*4 + 8630f*3 - 34499f*2 - 43130f = 0. What is f? -1, 0, 5, 8626 Factor 4d4 - 27320d*3 + 46648900d*2. 4d*2(d - 3415)*2 Factor 3k*2/4 + 10929k/4 + 526167. 3(k + 204)(k + 3439)/4 Determine m so that -3m5/5 - 4428m*4/5 - 1638354m*3/5 - 3263436m*2/5 - 1629507m/5 = 0. -737, -1, 0 Factor 106y3 - 438y*2 - 64y + 480. 2(y - 4)(y + 1)(53y - 60) Factor -d*4 - 201d*3 - 2988d*2 - 5180d. -d(d + 2)(d + 14)(d + 185) Solve -2b*5/7 + 340b*4/7 + 50b*3/7 - 8500b*2/7 = 0. -5, 0, 5, 170 Factor -3c*3/7 - 18c*2/7 + 1935c/7 - 1914/7. -3(c - 22)(c - 1)(c + 29)/7 Let 4c*5/11 + 98c*4/11 + 624c*3/11 + 1330c*2/11 + 800c/11 = 0. What is c? -16, -5, -5/2, -1, 0 Solve o*2/3 - 1313o/3 + 43380 = 0 for o. 108, 1205 Let 15o2 + 6249o/2 + 6219/2 = 0. What is o? -2073/10, -1 Factor -14j3/5 + 197388j*2 + 281984j/5. -2j(j - 70496)(7j + 2)/5 Determine u, given that -28u4 + 128u*3 - 92u*2 - 152u + 96 = 0. -1, 4/7, 2, 3 What is h in -h*3/4 - 126h*2 = 0? -504, 0 Factor -4g*3 - 53196g*2 - 176623776g + 1593925776. -4(g - 9)(g + 6654)2 Find t, given that t3/2 + 719t2 + 259198t + 515524 = 0. -718, -2 Let -3z2/7 - 1626z/7 - 128448/7 = 0. Calculate z. -446, -96 Let 4w3 - 2416w*2 + 415888w - 14838528 = 0. What is w? 48, 278 Determine j, given that j*4/5 - 138j*3/5 + 4139j*2/5 + 4278j/5 = 0. -1, 0, 46, 93 What is t in -5t2 + 43790t + 306775 = 0? -7, 8765 Factor -5n4 + 1790n*3 - 193500n*2 + 3494610n + 311269905. -5(n - 129)3(n + 29) Solve -h*4 - 1362h*3 - 421681h*2 + 29321580h + 29741900 = 0. -710, -1, 59 Factor -o*2 - 1505o - 3006. -(o + 2)(o + 1503) Suppose 4d*2/5 + 56512d/5 + 33900 = 0. Calculate d. -14125, -3 Factor -4s3 + 17664s*2 + 247884s + 868280. -4(s - 4430)(s + 7)*2 Factor 3a*4 - 417a*3 - 12162a*2 - 22632a. 3a(a - 164)(a + 2)(a + 23) Determine p so that p*3 - 150p*2 + 2039p - 1890 = 0. 1, 14, 135 Find x such that -2x4 - 2484x*3 - 14818x*2 + 17304x = 0. -1236, -7, 0, 1 Factor -4f2 - 1284f - 12440. -4(f + 10)(f + 311) Factor -2k4/9 - 20k*3/3 - 128k*2/3 + 1024k/9. -2k(k - 2)(k + 16)2/9 Suppose 2w*3/7 - 104w*2/7 + 154w + 1184/7 = 0. Calculate w. -1, 16, 37 Let 2f5/13 + 138f*4/13 + 1438f*3/13 - 1818f*2/13 - 45360f/13 = 0. What is f? -56, -9, 0, 5 Find i such that 348i3 + 1816i*2 + 1196i - 3360 = 0. -280/87, -3, 1 Solve -5k2 - 345180k - 5957461620 = 0. -34518 Factor 2p5 - 9178p*4 + 10534048p*3 - 10524872p*2. 2p*2(p - 2294)*2(p - 1) Suppose 2z4/11 + 10z*3/11 - 1094z*2/11 - 10z/11 + 1092/11 = 0. What is z? -26, -1, 1, 21 Let -332d4/5 + 1654d*3/5 + 362d*2/5 - 1654d/5 - 6 = 0. What is d? -1, -3/166, 1, 5 Let 3f2/5 + 5358f/5 - 5361/5 = 0. Calculate f. -1787, 1 Suppose 12o5/5 + 69o*4/5 + 6o*3 - 84o*2/5 - 42o/5 + 3 = 0. Calculate o. -5, -1, 1/4, 1 Find v such that -3v2 - 3739v/2 - 623/2 = 0. -623, -1/6 Find s such that 9s4 - 421s*3 - 15142s*2 + 711040s + 158752 = 0. -41, -2/9, 44 Factor 2f3 + 3586f*2 - 2f - 3586. 2(f - 1)(f + 1)(f + 1793) What is b in -3b*2/2 - 41541b - 575218227/2 = 0? -13847 Find q, given that 3q5/4 + 49q*4/4 - 191q*3/2 - 41q*2 + 66q = 0. -22, -1, 0, 2/3, 6 What is i in -2i3/3 - 114632i*2 + 229266i - 343900/3 = 0? -171950, 1 Factor -2w2/17 + 556w/17 + 34320/17. -2(w - 330)(w + 52)/17 What is w in -4w5/5 - 3856w*4/5 - 15372w*3/5 - 2304w*2 = 0? -960, -3, -1, 0 Let -3z*2 + 2535z - 2532 = 0. What is z? 1, 844 Factor -2l5 + 612l*4 - 43658l*3 - 483480l*2 - 1248200l. -2l(l - 158)*2(l + 5)*2 Suppose 2y*3/5 - 2742y*2 = 0. What is y? 0, 6855 Factor -2c*2/7 - 4406c/7 - 13200/7. -2(c + 3)(c + 2200)/7 What is u in 36u5/5 + 192u*4/5 - 4187u*3/5 + 2621u*2/5 + 1226u/5 + 112/5 = 0? -14, -1/6, 1, 8 Suppose 3u4 - 4212u*3 + 1474167u*2 + 2998998u - 11861016 = 0. Calculate u. -4, 2, 703 Determine u so that -2u2/3 - 151904u/9 - 354410/9 = 0. -25315, -7/3 Determine d, given that 4d2 - 3080528d + 593103297424 = 0. 385066 Determine t so that t*4/2 - 605t*3/2 + 58167t*2 - 3473766t + 6717276 = 0. 2, 111, 246 Let -5l3 + 79945l*2 - 239790l = 0. What is l? 0, 3, 15986 Let -34476n5/5 - 552136n*4/5 + 115692n*3 + 3976n*2 - 11184n/5 - 544/5 = 0. What is n? -17, -2/17, -2/39, 2/13, 1 Factor -2x3/7 + 27204x*2/7 - 3886x. -2x(x - 13601)(x - 1)/7 Factor 5u*2/3 - 342955u/3 - 1029000. 5(u - 68600)(u + 9)/3 Find h, given that -4h3 - 29068h*2 + 2054084h - 2025012 = 0. -7337, 1, 69 Suppose -b*4/5 + 846b*3/5 - 8367b*2/5 + 5834b/5 + 15048/5 = 0. Calculate b. -1, 2, 9, 836 Find t such that -2t2 + 146t - 1904 = 0. 17, 56 Find a, given that a*5/8 - 151a*4/8 + 435a*3/8 + 1355a*2/8 - 427a + 222 = 0. -3, 1, 4, 148 Determine b so that 20b2 + 229115b - 57280 = 0. -11456, 1/4 Suppose 2j3/9 - 328j*2/9 + 17864j/9 - 107648/3 = 0. What is j? 48, 58 Suppose -4k2 + 7796k + 31248 = 0. Calculate k. -4, 1953 Determine d so that 6d3 - 226d*2 + 748d = 0. 0, 11/3, 34 Suppose c*3 - 1440c*2 + 5748c - 5744 = 0. What is c?	{ "pile_set_name": "DM Mathematics" }
Let i = -11 + 11. Is i bigger than 14? False Let z(r) = -6r2 + 2r - 3r + 3 - 2. Let u be z(1). Let c = -8 - u. Is -2 less than or equal to c? True Let n = -0.044 - 0.056. Is 0.6 greater than n? True Let k(a) = a3 + 4a*2 - 7a - 12. Suppose 21 = -4w + 1. Let u be k(w). Is u > -1? False Let g = -15/2 + 47/6. Is g greater than 19? False Suppose -n = -6n. Let x = 51 + -49. Suppose 0 = -t + xp + 1 + 8, 5t - 5p - 20 = n. Are t and -1/7 unequal? True Suppose 2j = 3z - 49, -2j = -5z + 2j + 85. Suppose 0 = -5d + 7 + z. Is d equal to 4? True Suppose 2x - 5o + 9 = 0, -2x - 2o = 2o. Let n be (x - (-36)/21)-7. Suppose -7 = 2f - 3a - 22, -nf - a - 5 = 0. Which is smaller: -1 or f? -1 Let h(d) = d*2 + 8d + 2. Let g be h(-7). Which is bigger: -6 or g? g Let q = -2.3 - -3.3. Which is greater: -1.2 or q? q Let t be ((-16)/(-18))/4 - (-2)/(-9). Which is bigger: t or 4/37? 4/37 Let x = -0.3 - 15.7. Let t = x - -15.82. Let y = 0.02 - t. Which is greater: y or 0.1? y Let l = -0.17 - 5.83. Let i = 5.03 + -0.03. Let v = l + i. Is v less than -2? False Let v = -1 + 1. Let o = 2/27 - -16/27. Which is smaller: o or v? v Suppose 2c - 10 = -0c. Suppose 0z = cu - 2z + 8, 2u = 4z. Is -3/4 < u? False Let s = 323/7 + -46. Which is smaller: s or 3? s Let i = 0 + -2. Let l = -2 - i. Suppose c + 0c + 1 = l. Is 0 at most c? False Let z be 1(-2 + 1/1). Let x = 1 - -5. Let u = -5.9 + x. Which is greater: z or u? u Suppose 0o = o + 4. Let m be (o/27)/(2/3). Let r be 7 + (-6 - (0 - -1)). Which is smaller: m or r? m Let g(l) = 3l - 10. Let y be g(5). Let s = y - 8. Which is bigger: -9/4 or s? -9/4 Let b(v) = -51v - 2. Let c(a) = -26a - 1. Let o(t) = 3b(t) - 5c(t). Let d be o(-1). Suppose 3x - d = x. Which is smaller: -0.1 or x? -0.1 Suppose 0 = x + 6 - 3. Let o be 2 + x + (-76)/(-12). Which is greater: 6 or o? 6 Let n = 986 + -18738/19. Which is bigger: 1 or n? 1 Let y be (-3 - -12) + -4 + 5 + 2. Which is smaller: -1 or y? -1 Let r(o) = 7o + 21. Let u be r(-7). Which is bigger: -27 or u? -27 Let v(p) = -2p. Let c(u) = 5u - 1. Let t(i) = -3c(i) - 7v(i). Let s be t(3). Let j be ((-6)/(-20))/((-9)/(-5)). Is s <= j? True Let w(b) = -2b*2 - 24b - 4. Let c be w(-12). Is -27/5 less than or equal to c? True Let a = 0.19 - 0.39. Is a smaller than 1? True Suppose 0k - 3k = -3. Let s = 6 - 5. Suppose -k = -2f + s. Which is smaller: 3/2 or f? f Suppose -4 = 3x + v - 10, 10 = -5x + 5v. Let m(w) = 3w + 1. Let u be m(x). Suppose -uf = -0f. Which is greater: -2/11 or f? f Let i = 0.53 + -0.6. Let d = -0.07 - i. Is 0 smaller than d? False Let i = -14 + 16. Let x(d) = -d3 + 3d*2 + 2d - 3. Let c be x(2). Suppose ia = ca. Are -2/17 and a nonequal? True Let q(b) = -4b2 + 50b*2 - 2b - 1 - 4b + 4b. Let c be q(2). Let y = c + -1255/7. Is 0 equal to y? False Suppose -7o + 2o = -100. Let w be (-6)/o(-4)/6. Let d = 5 + -6. Which is bigger: w or d? w Let v = 26 + -26.9. Which is bigger: v or 0? 0 Let c = -12 - -10. Let n = c + -3. Let q = -2 - -3. Is n not equal to q? True Let k(a) = 7a - 8. Let s be k(-15). Let v = s - -793/7. Is v < 1? True Suppose 0 = -5o + 2q - 102, 4o - q = -0q - 84. Which is greater: o or -23? o Let l = -27 - -25. Is -16/7 less than l? True Let y(o) = -o + 4. Let f be y(8). Let d be 4(-6)/(-8) + -7. Is d bigger than f? False Let v be (-1)/5 + 30/25. Suppose -2o - 3f - 3 = 0, -3 + 1 = 5o + 2f. Does o = v? False Let v be 0 + 0 + (-76)/(-10). Let c = 124/15 - v. Suppose 2l - 1 = 1. Is c greater than l? False Let f(k) = k + 1. Let p be f(1). Suppose -ph = h + 3. Is h at most 1/4? True Suppose -3r + 45 + 3 = 0. Is r greater than or equal to 17? False Let k = 2 + -1. Let r(y) = 4y3 + y2 - 2y + 1. Let w be r(k). Is w not equal to 4? False Let g = 66 - 44. Suppose -3w = 2a + w - 28, g = 3a + w. Let s = a - 3. Which is bigger: s or 1? s Let b = -21 + 30. Suppose r = 2r + b. Which is greater: r or -8? -8 Let t = 5 - 5. Let c = t - -8.2. Let s = 8 - c. Which is greater: s or 2? 2 Let t(r) = r*3 - 7r*2 + 6r. Let h be t(6). Let n(k) = -5k2 + 1 + k2 + 3k2 - k. Let p be n(h). Is p greater than -2/5? True Let p be 820/(-24) - (-1)/6. Let o = p - -205/6. Are 0 and o non-equal? True Let z = 3.8 - 0.8. Let s(x) = -x3 + 10x2 + 12x - 14. Let y be s(11). Let j = 3 + y. Is j at least as big as z? False Suppose 0 = 3n + 1 + 5. Let c be (-2 + 4)/(n/3). Let r = 2 + c. Is -2/7 < r? False Let x(s) = s - 4. Let a be x(7). Let d be (-4)/(-2) + (2 - a). Which is smaller: 0 or d? 0 Let m = 7 + -6. Let b = m + 0. Let n = 1 - 2. Is b equal to n? False Let t = 61 - 303/5. Let n = -0.7 - -0.75. Let z = 1.05 - n. Is z at most as big as t? False Let d = 0 - -2. Let u be 6/(-4) - 42/(-12). Is u > d? False Let p = -0.12 + 4.82. Let t = -5 + p. Which is bigger: t or 0.2? 0.2 Let o = 10 - 15. Let b be o/10 + (-2)/(-16). Which is greater: b or 0? 0 Let i = -1195/19 - -63. Is i bigger than 1? False Suppose -2q + c - 79 = -0c, 0 = -q - 2c - 47. Do q and -40 have different values? True Let c = 11.3 + -10. Let t = -2.3 + c. Which is smaller: t or -2/21? t Let p = -46 - -45.77. Let k = -0.73 - p. Is 0 at most as big as k? False Suppose 0 = -t - t + 4. Let x = 6 - -1. Let n(i) = i*2 - 6i - 4. Let d be n(x). Which is smaller: d or t? t Let y = -4 + 0. Let c = -4 - y. Which is smaller: c or -1? -1 Let n(g) = -g*2 - g - 2. Let w be n(0). Is w at most as big as 0? True Let r be (-51)/(-18) + (-1)/(-6). Let x = r - 4. Which is smaller: x or 1/13? x Let z(j) = -j + 1. Let g be z(1). Let o = 1 - g. Let f be 20/9 + (o - 3). Is f at least as big as 1? False Suppose -3n + 2 = 11. Is n > -3? False Suppose 1 + 2 = 3d + 3y, -5d = y - 17. Is d > -0.2? True Let s(y) = -y. Let q be s(2). Let i = q + 12. Suppose -5r + i = 5t, -2r + 4t - t - 6 = 0. Which is bigger: -2/3 or r? r Let y(h) = h - 7. Let n be y(6). Let l be (3/4 + n)2. Let b = 8 - 9. Is b < l? True Let f(a) = a*2 + 10a + 12. Let x be f(-9). Let w = 5 - x. Suppose 0 = 3h - w - 1. Is -1/5 greater than or equal to h? False Let m be 0 + -1 + 8/6. Let t = -210 + 2728/13. Which is greater: t or m? m Let f = 131.34 - 131. Is f less than -1? False Let p = -5/8 - -9/8. Let z = 159/4 - 40. Is z bigger than p? False Let s(w) be the third derivative of -w4/24 + 2w*3/3 - 4w*2. Let i be s(6). Is -3 < i? True Suppose -h - 9 = 2h + 3x, -2h = x + 1. Which is smaller: h or 4/3? 4/3 Let j be 4 + (0/3 - -4). Do 8 and j have different values? False Let i = 16.4 - 12.4. Which is greater: -13 or i? i Let k = 92 - 87. Let u be (-1)/3 - (-57)/9. Is k < u? True Suppose -2z + 9 - 1 = 3l, -2z - 28 = -3l. Let b be l/(-35)(-3 - -8). Do b and -2 have the same value? False Let t = 15 - 7. Suppose -3l + 1 = -t. Let n be -5 - (1 - (1 + l)). Is -3 greater than n? False Let q = 14 + -27/2. Which is smaller: q or -3? -3 Let b = -99/7 + 97/7. Let p be -2 + 2/(-52)4. Let d = p + 88/65. Which is smaller: b or d? d Let w be (-18)/(-14) - (-30)/(-105). Which is greater: w or -2/9? w Let k = -4 - -3. Let s = k + 0. Which is smaller: 2 or s? s Let k be (4 - 7) + 102/33. Is k smaller than -1? False Let u be (-96)/(-40) + 6/10. Which is smaller: 5 or u? u Let y be 2(15/(-2))/(-3). Suppose 0 = -j - 4v + 2v - 6, 5j + v = -3. Suppose -2z - z + 18 = j. Which is smaller: y or z? y Suppose 3d + 8 = -d. Let y = d + 2. Let t be 2/(-7) - (-9)/7. Which is smaller: y or t? y Let i = -5.15 - 0.1. Let v = -0.25 - i. Which is smaller: v or -1/4? -1/4 Let u = -6 - -8. Let t be 1(0 + (-1 - -3)). Let k = u - t. Which is smaller: 1 or k? k Suppose 4q = -45 - 223. Which is smaller: q or -68? -68 Let s(b) = 9b*3 + b - 1. Let k be s(1). Let o = k - 8. Suppose 2n - 3 = 4y - o, -3y = n - 1. Is 1 at most n? True Let h(r) = r*2 + 8r + 8. Let i be h(-6). Is i >= -0.1? False Let b = 1 - 0. Suppose 0 = -4c - 20, -4c - 30 = -5j - 0c. Which is smaller: j or b? b Let r = 41 - 41. Which is smaller: -2/17 or r? -2/17 Let r be (-82)/(-56) + (-10)/(-35). Is 0 less than r? True Let z be (-2)/89 + 4/(-10). Let x = -2/89 - z. Let v(c) = -c*3 - 5c*2 - 5c - 3. Let a be v(-4). Which is smaller: a or x? x Suppose -4r - 4x = r - 6, 3r - 5x = 11. Suppose rd + 0f = 2*f + 10, -d - f = 5. Which i	{ "pile_set_name": "DM Mathematics" }
/(-8)? 4 Let k = 4 - 2. Let v(m) be the third derivative of -m5/60 + m4/8 - m3/6 - m2. What is the units digit of v(k)? 1 Let a(y) = 4y2 - 4y + 1. What is the tens digit of a(-3)? 4 Suppose -7f + 9f = 36. What is the units digit of 21/2 + f? 9 Let m(o) = 268o*2 + 2o + 1. Let z be m(-1). Suppose 4b = -91 + z. What is the units digit of b? 4 Suppose 0 = -5p + q + 373, 3q - 133 = -2p - 2q. What is the units digit of p? 4 Let t be ((-43)/4)/((-6)/24). Let h = t + -19. What is the tens digit of h? 2 Suppose -4z - 2k + 896 = -6k, -4z = 4k - 872. What is the tens digit of z? 2 Let h be 25(16/10 - 2). What is the tens digit of 3/(-3)(h - 0)? 1 Let u(k) = -k - 3. Let r be u(-8). Suppose -c + 0c + 5 = 2z, -4z + 3 = -rc. What is the units digit of c? 1 Let i = 752 + -529. What is the tens digit of i? 2 Suppose -169 = -2h + 5g - 2g, 0 = -2h - g + 173. What is the units digit of 1/4 - h/(-8)? 1 Suppose -2o = 5u - 33, 5o = -0o + u + 42. What is the units digit of o? 9 Let g = -56 - -80. What is the tens digit of g? 2 Suppose -r + 280 = r. Suppose -5a + 20 = -r. What is the tens digit of a? 3 Let r = -10 - -16. Suppose 3w - rw = 18. Let f = w + 8. What is the units digit of f? 2 Suppose 6i = 2i + 164. What is the tens digit of i? 4 What is the units digit of (-95 - -1)(-7)/14? 7 Let d = -52 + 196. What is the tens digit of d? 4 Suppose 0y = -y. Suppose 9g - 4g - 3q - 55 = y, 4q = 0. What is the units digit of g? 1 Let x = 65 - 43. What is the tens digit of x? 2 Let n(g) be the first derivative of 3g*2/2 - g + 2. Suppose o + 4 = -3x + 2, x - 2 = -3o. What is the units digit of n(o)? 2 Let w(j) = -j3 - 14j*2 - 12j + 16. Let n be w(-13). Let g be (n/2)/((-27)/72). What is the units digit of ((-36)/(-10))/(g/(-10))? 9 Suppose 0 = -2a + 12. Suppose j - 4b + 16 = -2j, -3b + 12 = -5j. Let f = a - j. What is the units digit of f? 6 Let q = 7 + -15. Let b(s) = -3s - 10. What is the units digit of b(q)? 4 Let o = -112 - -202. What is the units digit of o? 0 Suppose -1 = -2m + 7. Suppose g - 4 = -5l, 2g - 3l + l = -m. What is the units digit of g/4 + (-122)/(-8)? 5 Let c be 4((-2)/4)/(-1). Suppose 2d + cd - 17 = -b, 0 = d + 4b - 8. What is the units digit of d? 4 Let t(x) = -x + 2. Let q be t(0). Suppose -qw - 3 = -7, -p + w = -5. What is the units digit of p? 7 Let w(u) = u + 10. What is the units digit of w(-8)? 2 Let d(c) be the second derivative of -c4/12 - 5c3/3 - c2/2 + c. What is the units digit of d(-7)? 0 Let p = 0 - -2. What is the units digit of 0 + -3 + p - -5? 4 Suppose -5 = 5m - 0. Let c be 1 - m/(1/4). Suppose -4 = ci - 39. What is the units digit of i? 7 Suppose 6z - 23 = 37. Suppose 0 = -l - 3l + t + 19, 0 = 2l - 2t - 8. Let k = z - l. What is the units digit of k? 5 Let c = 7 + -5. Suppose -cx - x - 15 = 4w, 2x - 36 = 5w. What is the units digit of 2/w - 22/(-3)? 7 Let o be (-9)/6(-4)/(-3). What is the units digit of o/(-1) - -82? 8 Suppose -3g - 5f + 144 = -40, -4g + 4f = -192. Let b = g + -36. What is the tens digit of b? 1 Let x(u) = -4u3 - u2 + u + 2. Let v be x(-2). Suppose 0 = 4f - v - 12. Suppose 0y + y = f. What is the tens digit of y? 1 Let d(f) = f2 + 14f - 28. What is the units digit of d(8)? 8 Suppose 0 = -5u - 36 + 131. What is the units digit of u? 9 Suppose 4b + b = 50. Suppose -by + 8 = -8y. What is the units digit of y? 4 Let j(h) be the second derivative of -h*4/12 - 5h*3/6 + 3h*2/2 - h. Suppose 0 = 2a + 2t - 2, 0 = -5a + t - 4 - 15. What is the units digit of j(a)? 9 Let t(q) = -q*3 - 3q*2 - 2q + 2. Let j be t(-2). Suppose -ja = -6 - 20. What is the tens digit of a? 1 Let n(z) = -3 + 2z + 0z - 4z + z*2. Let v be 49/(-14)(-4)/(-7). What is the units digit of n(v)? 5 Let t be (-1)/((-1 - -3) + -1). What is the units digit of (t + 5 + -3)4? 4 Let x(m) be the first derivative of -m3/3 + 5m*2/2 + 2m - 3. What is the units digit of x(5)? 2 Suppose 67 = -5y + 7. Let n = y - -8. Let h = n + 10. What is the units digit of h? 6 Suppose 4o = 2o. Let g = 1 - -1. Suppose 2u - g = -o. What is the units digit of u? 1 Let k(q) = -6q - 8. Let t be k(-7). Let h = 56 - t. What is the units digit of h? 2 Let f(w) = -5w + 4. Let i be f(-6). Suppose 2z + 3k - 8 = 0, 4z = k + 2k + i. What is the units digit of z? 7 Suppose -32 = 3z - s, -3 = -z + s - 15. Let u = 2 - 3. Let b = u - z. What is the units digit of b? 9 What is the units digit of 15/6(-376)/(-10) + 0? 4 Suppose 5u + 25 = 0, 0u - 5u = -3s - 11. What is the units digit of -9s/455? 2 Suppose -h + 27 + 6 = -4r, r - 3 = -2h. What is the units digit of 26/(-6)21/r? 3 Suppose -200 - 514 = -6k. What is the tens digit of k? 1 Suppose 7o = 12o. Suppose ob + 82 = 2b. What is the tens digit of b? 4 Suppose -6c + 576 = -132. What is the tens digit of c? 1 Suppose 0 = 5s - 2s - 252. Suppose 4f + 4x = s, -x = -5f + 114 - 9. Let j = f + -15. What is the units digit of j? 6 What is the hundreds digit of 199 - (4 + (1 - 2) + -5)? 2 What is the units digit of ((-50)/20)/(1/(-12))? 0 Let f(v) = 1 + 6 + v*2 - v + 0v - 1. What is the units digit of f(0)? 6 Let i(d) = d*3 + 7d*2 + 7d + 3. Let s be i(-6). Let h = 1 - s. Let b = -3 + h. What is the units digit of b? 1 Let u(c) = c3 - c2 + 7c - 4. What is the units digit of u(3)? 5 Suppose l - 2 - 34 = 0. What is the units digit of l? 6 Let i(c) = 6c*2 + c + 4. What is the units digit of i(-2)? 6 Suppose 3o + 2 = -7, 4o + 12 = -m. Let k(s) = -s2 + 4. What is the units digit of k(m)? 4 Let y = 57 + -36. What is the units digit of y? 1 Suppose -9f - 4f + 3302 = 0. What is the tens digit of f? 5 Let y be 0 + -1(2 - 4). Suppose 0 = -4u + yu + 4. Let b = u + 5. What is the units digit of b? 7 Let r be 3/(-4) + 62/8. Let c(m) = -4 + m + rm2 - 3m + m*3 - 6m*2 + 3m*2. What is the tens digit of c(-3)? 1 Suppose -d - 2d + 36 = 0. What is the units digit of (-456)/(-10) + d/30? 6 Let l(k) = -k*2 + 12k - 8. Let x = 12 + -1. What is the units digit of l(x)? 3 Let c(z) = -2z + 1. Let g be c(-2). Suppose u - 64 = gu. Let q = 23 + u. What is the units digit of q? 7 Suppose -4n - v = -162 - 97, 329 = 5n - 4v. What is the tens digit of n? 6 Suppose -3c = c + 20. Let u(l) = l*3 + 6l*2 + l - 6. What is the tens digit of u(c)? 1 Let u = -4 + 9. Let h be (3 + 4/(-2))u. Let v(j) = -j*3 + 4j*2 + 5j + 1. What is the units digit of v(h)? 1 Let p(r) = r*3 + 15r*2 + 12r - 36. What is the hundreds digit of p(-13)? 1 Let z(d) = -5d3 - 2 + 2d - 3 + 6. Suppose -2m = -4l - 14, -3m + 2l + 0 = -5. What is the units digit of z(m)? 4 Let p(z) = -12z - 3. What is the tens digit of p(-4)? 4 Suppose -2v = -2k + 72, -2k + 38 = 2v - 18. Let n = -18 + k. What is the units digit of n? 4 Let f be 11 + -7 - (-4)/(-2). Suppose 5h = fh + 147. What is the tens digit of h? 4 Let i(q) = 2q*2 + 2q + 1. Let p be i(-2). Suppose pk + 4 = -m + 119, -3k + 81 = 3m. Suppose -4g + 2 + k = 0. What is the units digit of g? 6 Suppose -23y = -8y - 2100. What is the units digit of y? 0 Let z be (-15)/9-13. Suppose -5l - zu + 20 = 0, 5l = -u + 6u + 50. Suppose 0 = -2t + 3 + l. What is the units digit of t? 5 Let i = -15 - -57. What is the tens digit of i? 4 Let j(z) = -z2 + 4z + 4. Let p be j(4). Let x be 1/p + (-18)/8. What is the units digit of x/3 + 33/9? 3 Let s(x) be the first derivative of -2x2 + 12x - 4. What is the units digit of s(-5)? 2 Suppose -3v = -4f - 32, v + 2v + 3f + 3 = 0. Let w = 1 + 0. Let b = w + v. What is the units digit of b? 5 Let x be 0 - 3 - -4 - 0. Suppose 5 = b + x. What is the units digit of b? 4 Suppose -30 + 0 = -5w. Let i(p) = -p2 + 7p - 1. Let s be i(7). What is the units digit of w + (-2 - s) - 0? 5 Let k = 152 + -56. What is the units digit of k? 6 Suppose 2d - 9 = -d. Suppose 0 = 5b - 2o + 1, 2o = -1 - d. Let s = 2 + b. What is the units digit of s? 1 Let o = -4 + 2. What is the tens digit of o/(4/(-42))1? 2 Suppose -2u = -5u. Suppose l + ul = -3, 5l = -3r + 9. What is the units digit of r? 8 Let l = -2 - -1. Suppose -r + 10 - 17 = 0. Let z = l - r. What is the units digit of z? 6 Let d(g) = g*3 + 13g*2 + 7g + 2. Wh	{ "pile_set_name": "DM Mathematics" }
Convert -b75 (base 15) to base 3. -10112202 Convert -1995 (base 11) to base 10. -2524 Convert 10350 (base 7) to base 15. b73 -1100211 (base 3) to base 9 -1324 Convert 1255 (base 9) to base 7. 2513 What is -382 (base 9) in base 14? -189 Convert 1554 (base 10) to base 3. 2010120 -101135 (base 8) to base 13 -12262 Convert -1001010000110110 (base 2) to base 11. -26563 Convert -120210 (base 3) to base 8. -652 Convert -21112222 (base 3) to base 5. -134012 27a3 (base 13) to base 8 13116 What is -6c8 (base 14) in base 16? -548 -13 (base 8) to base 7 -14 Convert 637 (base 10) to base 12. 451 Convert -7062 (base 8) to base 2. -111000110010 -10262 (base 11) to base 14 -563d What is -1720 (base 14) in base 12? -2494 -1330 (base 6) to base 11 -291 What is 103103 (base 4) in base 3? 1200202 Convert -20133210 (base 4) to base 11. -24156 What is 413a (base 11) in base 12? 3214 Convert -131132 (base 4) to base 8. -3536 What is 32011 (base 5) in base 11? 1668 101010010 (base 3) to base 4 1303032 Convert -7534 (base 8) to base 14. -160c What is -8de6 (base 15) in base 11? -20711 -1146 (base 12) to base 6 -12530 -315 (base 8) to base 12 -151 Convert 4707 (base 16) to base 13. 8379 Convert -1102002 (base 3) to base 6. -4432 Convert -345 (base 13) to base 14. -2c4 What is 863 (base 15) in base 14? 993 Convert 1455 (base 16) to base 13. 24a5 What is 10122020021 (base 3) in base 15? 16341 -1313 (base 15) to base 8 -7744 What is 7b (base 12) in base 9? 115 Convert -13a28 (base 12) to base 15. -81b2 454b (base 13) to base 9 14263 453415 (base 6) to base 13 1461b Convert -1467 (base 14) to base 13. -1855 281 (base 16) to base 8 1201 What is -3 (base 9) in base 8? -3 Convert 1102200 (base 3) to base 8. 2024 34423 (base 5) to base 12 1534 3c6 (base 15) to base 3 1011220 What is -10120022 (base 3) in base 4? -220220 -13329 (base 10) to base 8 -32021 What is 23301 (base 5) in base 12? b99 What is 611 (base 12) in base 10? 877 Convert -1534 (base 8) to base 9. -1155 What is -12223 (base 5) in base 14? -4b0 -101001 (base 4) to base 10 -1089 Convert 1093 (base 14) to base 16. b39 -10202 (base 5) to base 15 -302 1022120 (base 4) to base 2 1001010011000 What is 2737 (base 8) in base 15? 6a3 -1b94 (base 12) to base 4 -311200 Convert 27cd (base 14) to base 12. 40a9 -11110011 (base 2) to base 10 -243 664 (base 7) to base 13 202 What is -137 (base 13) in base 3? -21222 Convert 1313 (base 5) to base 14. 10c What is 1695 (base 10) in base 9? 2283 Convert 5067 (base 9) to base 13. 18c1 What is 3856 (base 13) in base 5? 224024 What is -353 (base 13) in base 6? -2355 What is 131 (base 6) in base 8? 67 Convert 7831 (base 10) to base 14. 2bd5 Convert 12200222 (base 3) to base 15. 1372 -1100011 (base 3) to base 10 -976 33511 (base 9) to base 8 53415 12433 (base 6) to base 15 863 Convert 2020 (base 6) to base 5. 3234 Convert 1111001001011 (base 2) to base 16. 1e4b Convert -1532 (base 9) to base 14. -5d1 -420032 (base 5) to base 6 -143423 -228 (base 16) to base 10 -552 44302 (base 5) to base 9 4188 Convert 1712 (base 9) to base 4. 110123 Convert 2cd (base 14) to base 16. 23d -242 (base 5) to base 4 -1020 What is 144 (base 10) in base 12? 100 What is 4343 (base 5) in base 16? 256 -421 (base 5) to base 2 -1101111 -40344 (base 5) to base 12 -1607 What is 1112551 (base 6) in base 14? 16787 Convert -8442 (base 15) to base 6. -333242 What is -238 (base 16) in base 13? -349 Convert 39d0 (base 15) to base 2. 11000000111001 Convert 3185 (base 9) to base 14. bd7 70 (base 16) to base 8 160 What is 2771 (base 10) in base 14? 101d -23070 (base 8) to base 10 -9784 Convert 10010111011 (base 2) to base 4. 102323 Convert a44 (base 11) to base 7. 3445 1ac6 (base 13) to base 7 14543 Convert 6 (base 10) to base 9. 6 What is -319 (base 10) in base 5? -2234 5415 (base 7) to base 2 11110000011 Convert -667 (base 9) to base 6. -2311 Convert -cc (base 14) to base 6. -500 1053 (base 6) to base 10 249 Convert -1503 (base 10) to base 9. -2050 1220134 (base 5) to base 3 1011210010 What is -587 (base 11) in base 6? -3124 What is 131220 (base 4) in base 13? b2b Convert -1001001110000 (base 2) to base 9. -6424 Convert 10010010 (base 2) to base 8. 222 -210120 (base 3) to base 6 -2410 What is -2032213 (base 4) in base 12? -5347 16a (base 15) to base 16 145 What is -8aa (base 15) in base 13? -b7a Convert -1112212210 (base 3) to base 15. -90a6 -1000000111000 (base 2) to base 5 -113102 Convert -232020 (base 4) to base 8. -5610 -4584 (base 11) to base 7 -23361 What is 900 (base 12) in base 6? 10000 -1b3 (base 12) to base 16 -117 Convert -2150 (base 13) to base 10. -4628 -2182 (base 9) to base 12 -b25 -14833 (base 10) to base 7 -61150 What is 542 (base 10) in base 7? 1403 Convert 40b (base 12) to base 9. 722 What is 315 (base 6) in base 9? 142 -1258 (base 16) to base 13 -21a3 -33522 (base 6) to base 14 -1a1c Convert 12133 (base 6) to base 15. 7e0 Convert -5055 (base 6) to base 14. -599 Convert -66123 (base 7) to base 14. -604a What is -1110010110010111 (base 2) in base 6? -1132035 Convert -20024 (base 6) to base 9. -3517 What is 25211 (base 9) in base 7? 100246 What is 1bb89 (base 12) in base 11? 29147 What is 1404 (base 7) in base 5? 4133 Convert 465 (base 12) to base 5. 10103 Convert -59f9 (base 16) to base 5. -1214113 -1745 (base 14) to base 15 -1387 What is 6218 (base 9) in base 11? 346a -13410 (base 6) to base 3 -2212120 Convert -1020354 (base 6) to base 7. -263665 Convert -1313120 (base 5) to base 16. -65b3 What is -144d4 (base 15) in base 16? -fec8 Convert -7543 (base 8) to base 6. -30123 What is 310f (base 16) in base 11? 9488 -403 (base 16) to base 2 -10000000011 c29b (base 13) to base 2 110100011001110 2a0 (base 11) to base 7 1012 28e (base 15) to base 9 718 -23c1 (base 16) to base 10 -9153 Convert 7628 (base 9) to base 11. 4245 What is -2bc8 (base 13) in base 9? -8720 Convert 4279 (base 13) to base 14. 3510 -60742 (base 10) to base 12 -2b19a -204300 (base 8) to base 16 -108c0 -5028 (base 11) to base 4 -1220131 What is 5517 (base 8) in base 11? 21a2 What is 26828 (base 10) in base 9? 40718 Convert -12e0 (base 15) to base 11. -3039 94 (base 10) to base 3 10111 -35666 (base 7) to base 10 -9260 Convert -18427 (base 12) to base 4. -20211133 200210021 (base 3) to base 15 40d1 What is 98aa (base 15) in base 9? 48317 What is -324123 (base 5) in base 7? -44355 56a (base 14) to base 2 10000110010 Convert -54b (base 12) to base 7. -2162 Convert 51131 (base 9) to base 3. 1201011001 What is 2e7 (base 15) in base 8? 1233 What is 36 (base 8) in base 2? 11110 What is 4003 (base 5) in base 11? 418 What is -8763 (base 10) in base 6? -104323 What is -1680 (base 11) in base 10? -2145 What is 163 (base 13) in base 8? 372 Convert -5067 (base 8) to base 10. -2615 Convert -1781 (base 14) to base 13. -1c04 -48b (base 12) to base 13 -407 Convert 11332 (base 6) to base 9. 2222 -710 (base 15) to base 5 -22330 -74b0 (base 12) to base 4 -3020010 -1123 (base 9) to base 16 -33f Convert 9793 (base 10) to base 3. 111102201 cdc (base 15) to base 11 2203 What is -3311 (base 10) in base 6? -23155 2120010 (base 3) to base 14 974 Convert -14545 (base 7) to base 10. -4051 Convert 111110011010110 (base 2) to base 12. 165b2 346 (base 13) to base 4 20311 Convert -7115 (base 10) to base 14. -2843 What is -c4f6 (base 16) in base 7? -300001 -1110201 (base 3) to base 16 -430 Convert -1424 (base 8) to base 6. -3352 -12311 (base 6) to base 10 -1843 What is 4125 (base 7) in base 6? 10400 13344 (base 6) to base 13 c40 What is b313 (base 12) in base 15? 5b70 Convert 2ba1a (base 13) to base 8. 242072 What is -11000100000 (base 2) in base 13? -938 245 (base 10) to base 4 3311 What is 25344 (base 8) in base 9? 16050 950 (base 16) to base 4 211100 3891 (base 16) to base 2 11100010010001 -5036 (base 9) to base 6 -25010 What is -66 (base 11) in base 8? -110 What is 204 (base 14) in base 9? 480 What is 2d (base 16) in base 9? 50 Convert -200122 (base 5) to base 12. -377b Convert 11535 (base 6) to base 13. a1c What is 3143 (base 8) in base 13? 98a -3232 (base 12) to base 14 -2018 1184 (base 12) to base 9 2631 What is 2112122 (base 3) in base 14? 965 -3b (base 14) to base 2 -110101 Convert 1101110011 (base 2) to base 12. 617 Convert 6497 (base 16) to base 9. 38282 Convert -	{ "pile_set_name": "DM Mathematics" }
o for v. 0 Solve 0 = 144a - 142a - n - 12, 2a + 48 = -5n for a. 1 Solve -2v + 31 = -5m - 8, 2v - 41v = -37v + 388m + 3498 for v. -3 Solve 4t - 205 = -11v, 6v + 96t - 91 = v + 92t for v. 19 Solve -35 = 4564y - 4565y + 2k, 5y - 75 = 5k for y. -5 Solve -12v + 548 = 12v + 14049w - 14044w, v + w = 26 for v. 22 Solve 3x - 28 - 49 = -4w, 5w - 9x + 295 = w for w. -4 Solve 9b - 433 = 12b + 4u - 212, -229 = 3b - 4u for b. -75 Solve p + 115 = 2p + 5x, 12p - 10x - 51 = -13x + 18 for p. 0 Solve -5x = -4z + 48, -4x + 3z - 9794 = -3259 - 3229 - 3269 for x. -4 Solve -15v + 51v + 2i + 22 = 0, 11v - 4i + 32 = 7v for v. -1 Solve -209d - 20 = -211d + 5q, -3d = -5q - 35 for d. 15 Solve -5s - 2q = -50, -6019q + 6021q = -12s + 134 for s. 12 Solve 10281424q + 2 = 10281421q + 8k, -52 = -4q - 3k for q. 10 Solve -5z - 5x + 30 = 0, -16z + 27z - 15 - 9 = 15z - 2x for z. -2 Solve 4z - 35o = -9o + 4, 11o + 209 = 7z - o + 17o for z. 27 Solve 4c + 4 = 0, -2c - 114 = -d - 92 for d. 20 Solve -162f + 633 = -48r - 165f, 0 = -3f - 9 for r. -13 Solve 0 = 4z - 3g + 41, 0 = z - 1571288g + 1571291g + 29 for z. -14 Solve 0 = 2r - 5y - 112 + 312, 11r = -2y + 21 for r. -5 Solve -15 = -3m, 4f + 206833m - 206832m = 21 for f. 4 Solve 8 = 2g - 4g, 3f + 88 = -0f + 5g - 27g for f. 0 Solve -27d - 169x = 173x - 347x + 437, -3x = -d - 19 for d. -16 Solve -h - 6v + v + 223 - 6 = -46, 9v - 477 = 0 for h. -2 Solve 601d + 64u + 58u = 123u - 3001, 5u = 4d for d. -5 Solve 3566w + 3f - 38 = 3559w, -3f = 4w - 41 for w. -1 Solve -179 = 16596d - 16591d + 4y, y = -d + 4d + 121 for d. -39 Solve -4f = 4376b - 4377b - 56, -32 = -4f - 5b for f. 13 Solve -5u = 3c - 125, -209u + 420u = 215u + 6c - 118 for u. 22 Solve -3u - 5h - 24 = 0, -u + 23h + 375 = 309 for u. -3 Solve -a - 10 = a, 3j - 35a = -36a - 76 - 7 for j. -26 Solve 2b - 3b - 29 = -n + b - 7b, -20b = -3n + 17 for n. 19 Solve 0 = t - 5m - 44, -4t + 2m + 73 - 78 = -3t - 43 for t. 34 Solve k = -21v + 37, -26895k + 26897k - 24 = 8v for v. 1 Solve 106w + 3b - 9 = 0, 2 - 8 = 5w + 5b - 21 for w. 0 Solve 0c = -2l - l + 7l + c, 186c = 168c for l. 0 Solve -10 = -4n - 5p - 34, -208n + 213n + 30 = -95p for n. -6 Solve -281 + 658 + 302 = y + 169u, 5y - 7 = 2u for y. 3 Solve -3117y + 3112y + 5g - 32 + 12 = 0, 0 = g - 3 for y. -1 Solve 0 = 2t + x + 12, 3x = 17897t - 17859t - 36 for t. 0 Solve -6i + 7i + 4 = 4w, 3w - 101i + 82i - 441 = 0 for w. -5 Solve n = 10d + 48, 93 + 76 = -5n - 5d + 134 for n. -2 Solve -1081i + 1083i = 4, 81r = -i - 808 for r. -10 Solve -h = 4z - 675 + 753, 0 = 2h + z + 16 for h. 2 Solve 6685p - 6683p = -3j + 8, j - 2p + 24 = -0p for j. -4 Solve j = -3s - 0j + j - j - 62, 349j = s - 678 for s. -20 Solve 50 = -3k - k + 2v, -60k - v = -k + 97 for k. -2 Solve -3f + 4b + 158 = 0, -3f - 244b = 2f - 169b + 3085 for f. -2 Solve -c - 21 = 4a + 8c - 143, -2a + 2c = -4a + 26 for a. -1 Solve -4o = 8x + 3x - 12x - 75, -x = 52o + 131 for o. -1 Solve -5p = -z - 50, -78p - 71p + 3z = -212p + 69p - 51 for p. 11 Solve 0 = 4v - 3d - 67, -2d + 105 + 26 = 3v - 7d + 12 for v. -2 Solve r - 3r - 2 = 0, -36c - r - 99 = -40c + 2r for c. 24 Solve -24 = -5856d + 5855d - 2o, 2o = 4d + 4 for d. 4 Solve 24k - 3k - 253 = -4b + 16k, -5b - 5k = -255 for b. 2 Solve -5b = -1738g + 1739g + 37, -4b - 6g + 2g = 36 for b. -7 Solve -166a = -162a - 3j + 112, 0 = 3a + 7j - 286 for a. 2 Solve -p + 52s = 55s + 7, -2s - 49439 = p - 49432 for p. -7 Solve -92l + 7t - 3t + 428 = 0, -11l + 2l + 5l - 2t - 6 = -42 for l. 5 Solve -3t - 19 = 2s, -123s + 127s - 5t = -5 for s. -5 Solve -4o - 2r + 3r - 258 = 0, -2r = 85o + 3756 + 1680 for o. -64 Solve 147 = c + 2k, -874c + 1743c = 869c + k - 71 for c. 5 Solve -4g - 5f = 10, 82g + 2f + 4 = 29g + 49g for g. 0 Solve -4k = -116, -297695 = -3s + k - 297715 for s. 3 Solve -m - 4w = 0, -33m + 0w + 4w - 31 = 14 + 41 + 50 for m. -4 Solve 2a - 304o = -300o - 50, -9a + 50 = -13a + 3o for a. -5 Solve 33f - 10z = 32f - 9z - 7, 0 = -f - z - 3 for f. -5 Solve -3g = -2m - 76, -m + 32124 - 32019 = 5g for m. -5 Solve -4l = 2f - 34, -103l - 83 = 21f - 101l for f. -5 Solve 5x + 174g + 248 = 178g + 247, -x - 10g + 43 = 0 for x. 3 Solve 12a - 2i + 96 = 0, -5a - 5i + 137 = 37 for a. -4 Solve -3l - 28 + 4 = 0, -7t = -12t - l + 2 for t. 2 Solve -7l = -4k - 127, 62k - 2l + 176 = 57k + l for k. -37 Solve 4f - 87 = 5m, 39 = -m - 104f + 106f for m. -3 Solve -4d + 53 = -5j, -42d + 130d + 119d + 2j = 36d - 49d + 1530 for d. 7 Solve 15 = 3q, y + 161 + 136 + 52 = 79q for y. 46 Solve -4v - 71 = w, -6067w = 6v - 6072w - 277 for v. -3 Solve -3m - 80 = -134d + 129d, -98 = 5d - 178 for m. 0 Solve 280j = -5z + 24j - 868, -3z - 5j = -8j + 23 + 28 for z. -20 Solve -4j + 3v + 14 = 12 + 21, 0j + j + 199 = -64v for j. -7 Solve 14s - 3f - 82 = -3s, 5s - 3s - 4f - 4 = 2f for s. 5 Solve -g = -6x + 6x + 5x - 5, x + 4g - 96 = 0 for x. -4 Solve -2a - 3 = -3s, -1 + 17 = -31s - 162a + 167a for s. -1 Solve 4s - 2z = 28, 32s - 3z = 46s + 2z + 46 for s. 1 Solve -5n = 2l - 39, 320l - 330l = -n - 65 for n. 5 Solve 75i = 12i + 7m - 4m - 132, -5i + 3m = 16 for i. -2 Solve 12m = -15b + 2b + 16b - 33, m + b - 3b + 8 = 0 for m. -2 Solve 0 = 34f - z - 189, -5f - 2025z + 2020z = 245 for f. 4 Solve 4v + z - 87 + 267 = -140, 3v = -52z - 240 for v. -80 Solve l - 18 = 4270y - 4272y, -18l + 200 = 5y for y. 4 Solve 0 = -2a + 5i + 26 + 8, -2i = 3i - 2i + i + i + 10 for a. 12 Solve -4s + 62 = 3d, 12 = -195d - 339d + 519d + 3s for d. 2 Solve 5o - 4a - 10a - 15 = -11a, -4a - 688 + 679 = -3o for o. 3 Solve -351j - 2b - 74 = -349j, 0 = -j - 2b - 78 for j. 4 Solve -4c + y = -0c + 29, 2c + c - 8y + 70 = -17 for c. -5 Solve 4y + 29 = 5w + 3w - 15, 3y + 25 = 4w for y. -3 Solve -3q = 5v - v - 129, -8v + 109q - 357 = -9v for v. 30 Solve 3c = -1929i + 1933i + 11, -5i = -2c + 12 for i. -2 Solve 54 = 3p + 3l, -197230l - 21 = -p - 197228l for p. 19 Solve 2u + i - 73 = -4i, -32446i + 32444i - 14 = -u for u. 24 Solve -36r + 251 + 306 = 5t, 12r - 491 = -5t + 9r for t. 97 Solve -98w = -f - 175w + 81w + 9, -6 = 3w for f. 1 Solve 5655 = 6c + 5h + 5256, 95 + 100 = 3c + 4h for c. 69 Solve 3x = -4z - 23, -5z = 1979361x - 1979363x - 23 for x. -9 Solve -16j + 19 = -15j + 12g, -4j + 5g - 30 = -0j for j. -5 Solve -22l + 37l - 2m - 429 = 0, 3l - 75 = 4m for l. 29 Solve r + 541d - 44 = 3r + 545d, 0 = -11r - 3d - 337 for r. -32 Solve 257l - 255l - 34 = 4z, 0 = -13l + 195 for z. -1 Solve 415d - 419d = -7w - 0w + 164, -4d + 789w - 152 = 785w for d. -34 Solve -92l - 159 = 5f - 537, 4f + 0f + 5l = 28 for f. 2 Solve -3z + 806816 = 3f + 806915, 0 = 2f - 5z - 137 for f. -4 Solve -10r + 94 = 6z - 0z, 3z = 19r - 47 + 70 for r. 1 Solve -5x - 4c = 60, -3c - 2296982 = -58x - 2297431 for x. -8 Solve -3q = -0u - 2u + 38, 271q - 3u = 267q - 51 for q. -12 Solve 4i - 2a + 22587 = 22613, 5i + 4a + 26 = 0 for i. 2 Solve 5c - 13136u = -13141u + 5, 15u - 31 = c for c. -1 Solve 3g + 4m - 18 = -m - 114, 5m = -0m - 90 for g. -2 Solve -3f = -2u - 18, -12u + 10u - 201 = -f - 187 for u. -6 Solve -i + 247m + 250m - 492m = i + 129, -2i - 2m - 136 = 0 for i. -67 Solve 4s - 2m = -447 + 399, s = 3m - 12 for s. -12 Solve 2x + 175 + 5 = -45g, 14x - 4 = g + 13x + 5x for g. -4 Solve 4a - 46 = -5i + 89, -65i - 54i - 109 = -8a - 122i for a. 5 Solve 3p - 3u + 4 = -23, 5u + 189 + 646 = -215p for p. -4 Solve 5c = -p + 3c + 3, 5005p - 19 = 5010p - 7c for p. -1 Solve 14m = -33m + 61m - 56, -318 = -7z + m for z. 46 Solve 3i + 5 = 5w, -2w + 585i = -5w + 581i - 55 for w. -5 Solve 12v + 306 = -3c, -2v - 271 = -c - 217 for c. 2 Solve 2w - w + 0 + 9 = -3b - 18, -54w - 454 = 17w + 4b for w. -6 Solve 2a - w - 33 = -54, -2w = 72a - 0w + 718 for a. -10 Solve -3a + 176 = 8a - 7k, -3a - 57k - 11 = -54*k + 49 for a. 2 Sol	{ "pile_set_name": "DM Mathematics" }
6))*2-6. -1080605 + 36000sqrt(2) Simplify (5((sqrt(120) - 5sqrt(120))/sqrt(5) + sqrt(24)))/(sqrt(8) - (sqrt(96) - sqrt(96)2)/sqrt(12) - (sqrt(8) - sqrt(24)/(2sqrt(3)))). -10sqrt(3) Simplify 1(sqrt(2) + (sqrt(2048))2 + (-3 + sqrt(2) + 5)2). 5sqrt(2) + 2054 Simplify (3sqrt(224)/sqrt(4)-5)/(-4sqrt(32) + sqrt(8) - (sqrt(8) - (sqrt(128)/sqrt(4))/sqrt(4))). 15sqrt(7)/7 Simplify (2(4 + 2sqrt(304) - sqrt(304)) + -2sqrt(304)55 + 0)2. -3072sqrt(19) + 700480 Simplify -1sqrt(1024)/sqrt(8) - 6(2sqrt(6)/sqrt(3))2. -48 - 8sqrt(2) Simplify (sqrt(57) + (sqrt(57) - sqrt(285)/sqrt(45)) + sqrt(57))/(sqrt(300)-2). -2sqrt(19)/15 Simplify (sqrt(99) + 0)-2-1 - ((sqrt(44) - (sqrt(484)2)/sqrt(11))/(sqrt(24)/(sqrt(24)/sqrt(4))))2. -11 + 6sqrt(11) Simplify 3(2sqrt(21)/(sqrt(108)2 + sqrt(108) - sqrt(108)) + 4). sqrt(7)/2 + 12 Simplify ((-1sqrt(114)-1 - sqrt(114))/sqrt(6))2 + (sqrt(684) + (-3sqrt(684) - sqrt(684)) + 1)*2. -36sqrt(19) + 6157 Simplify (sqrt(624)2-1)/(sqrt(3) + -1sqrt(9)/sqrt(3) + sqrt(3) - sqrt(18)/(-2sqrt(6))). -16sqrt(13)/3 Simplify (6(1sqrt(204) + sqrt(204)) - (sqrt(204) - (sqrt(204) + (sqrt(204)1 - sqrt(204) - sqrt(204))))-4)/(3(sqrt(72)-2)/sqrt(6)). -8sqrt(17)/3 Simplify ((sqrt(170) - (sqrt(170) + (sqrt(170)2 + sqrt(170))-2))/((sqrt(80)/sqrt(2))/sqrt(4))-3)2. 5508 Simplify (-2(sqrt(3146) + -1sqrt(3146) + sqrt(3146)))/(sqrt(18) - -1sqrt(162))3. -11sqrt(13)/2 Simplify (sqrt(204) + (sqrt(204) - (sqrt(204)2 - sqrt(204))2) - (sqrt(204) + sqrt(204) + (sqrt(204) - -1sqrt(204)-4)))/(2-3sqrt(588)). -sqrt(17)/42 Simplify (sqrt(77) - 3sqrt(77)4 - sqrt(77))/(sqrt(11) - ((sqrt(33) - sqrt(132)/sqrt(4))/sqrt(3) - sqrt(11))). -6sqrt(7) Simplify (sqrt(99) + sqrt(99)-2 + 1 + sqrt(99) - sqrt(99))*2 - (((sqrt(99) + -1)1)*2 + sqrt(99)) - (sqrt(99)22 + sqrt(99) + -4). -18sqrt(11) + 4 Simplify (-5 + ((sqrt(125) - (2 + -2sqrt(125) + sqrt(125))) + 4 + sqrt(125)4)-2)2. 1080sqrt(5) + 18081 Simplify (sqrt(357)/(sqrt(7) + (sqrt(7) - sqrt(175)) + sqrt(7)))/sqrt(3) - (sqrt(561)/(1sqrt(11)))/sqrt(3). -3sqrt(17)/2 Simplify 5(sqrt(378)/(sqrt(18)/sqrt(3)))/(sqrt(144)3) + 0. 5sqrt(7)/12 Simplify 3 + sqrt(1088) + 2 + 4 - 5(-1 + sqrt(425)6). -142sqrt(17) + 14 Simplify (sqrt(153)1-4)/(-1sqrt(81)) - 4((2sqrt(68))2 + 2(sqrt(17) - -1sqrt(17))). -1088 - 44sqrt(17)/3 Simplify (-2sqrt(180)1)/((-2sqrt(18))/sqrt(2) + sqrt(63)/sqrt(112)). 16sqrt(5)/7 Simplify 4 + 4 + ((sqrt(7) + 0 + -1)*2 - sqrt(7)) + -2. -3sqrt(7) + 14 Simplify (sqrt(750) + (sqrt(750)-3 - sqrt(750))-1)/(6(sqrt(294) - -2sqrt(294))). 25sqrt(5)/126 Simplify ((-1sqrt(55)/sqrt(5))2 - (sqrt(11) + -4 + sqrt(44)/sqrt(4))2) + sqrt(176) + 0 + 2. -47 + 20sqrt(11) Simplify ((-1 + sqrt(68))6 - (-1 + sqrt(68) + -1 + sqrt(68))*2)4 + 2. -1126 + 112sqrt(17) Simplify 3(sqrt(76) + sqrt(76) + 1 + -2)*2 + -4. -24sqrt(19) + 911 Simplify (-4(2sqrt(121)12)/((sqrt(121) + (-2sqrt(121) - sqrt(121)) - sqrt(121))/sqrt(11) - sqrt(132)/(-1sqrt(12))))*2. 704 Simplify ((sqrt(36)/((sqrt(14)2)/sqrt(7)))/(sqrt(225)-2-6))*2. 1/7200 Simplify 0 + sqrt(30)/(sqrt(810)-1) + (1 + 2sqrt(300) + sqrt(300))2. 539sqrt(3)/9 + 2701 Simplify sqrt(1872)1-5 + ((sqrt(13) - 2sqrt(13))-4 - (sqrt(13) + (sqrt(208))*2)-4). -52sqrt(13) + 832 Simplify (2sqrt(228)4-2)/(4(sqrt(12) + (2sqrt(60))/sqrt(5))). -4sqrt(19)/3 Simplify sqrt(68) + -2 + sqrt(2448) + -3 + sqrt(204)/(sqrt(12)-1) + sqrt(51)/sqrt(48). -5 + 53sqrt(17)/4 Simplify (-1(0 + sqrt(52) + sqrt(13) + (sqrt(78)-2 - sqrt(78))/sqrt(6)) + (3sqrt(156)-1)/((sqrt(84)2)/sqrt(7)))*2. 117/4 Simplify ((sqrt(99) + (-1sqrt(99)6 - sqrt(99)))3)/(-4(sqrt(27)/sqrt(3)-4 - sqrt(9))). -9sqrt(11)/10 Simplify -2(-6(-4 + sqrt(891))2 + sqrt(891))4 + 1. -3528sqrt(11) + 43537 Simplify ((3sqrt(153)2 - (sqrt(153)-2-3 + sqrt(153)))/(-2sqrt(1296) - sqrt(1296) - (sqrt(90)1)/sqrt(10)))2 + -4. -5459/1369 Simplify (5sqrt(76)/sqrt(4) + sqrt(190)/(sqrt(10)-2) + -4)-5. -45sqrt(19)/2 + 20 Simplify ((sqrt(68) + -2 + sqrt(68) + 0 - sqrt(68)) + -2)2 - ((sqrt(68)-14)2 + ((2sqrt(68) - sqrt(68)) + -1)*2). -1073 - 12sqrt(17) Simplify -5(4 + 4(sqrt(110) - -4sqrt(110)-2 - sqrt(110))/sqrt(10) + 1). -25 + 160sqrt(11) Simplify (((sqrt(4500) - 5sqrt(4500)) + sqrt(4500))/(sqrt(9) + (sqrt(9) - 3(sqrt(9) - sqrt(72)/sqrt(8)))))2. 1125 Simplify ((sqrt(6) - (sqrt(240)/sqrt(4))/sqrt(10)) + (sqrt(18)/sqrt(3) + sqrt(6) - sqrt(6))-3)/((sqrt(180)/(sqrt(10) + sqrt(90)))/sqrt(6)). -12sqrt(2) Simplify ((-2 + sqrt(7) + sqrt(28))-6 + -3 + (sqrt(112))*2 + sqrt(7)1 + 1)2 + 1. -34sqrt(7) + 245 Simplify (4sqrt(300))2 + -1 + sqrt(300) + -2 + (sqrt(105)/sqrt(7))/sqrt(5). 11sqrt(3) + 4797 Simplify -2 + (sqrt(30)/(sqrt(15)/sqrt(3)))/(-4(2sqrt(3) - sqrt(3))). -2 - sqrt(2)/4 Simplify (sqrt(10) + (2sqrt(90))/sqrt(9))/((sqrt(72) - sqrt(8))/sqrt(4)). 3sqrt(5)/2 Simplify 1((sqrt(704) + 4)2 + 2 + sqrt(396)). 70sqrt(11) + 722 Simplify -6(-1-5(-3sqrt(700) + 2))*2. -945600 + 18000sqrt(7) Simplify ((-6sqrt(165)-2)/sqrt(3))/(sqrt(405) - ((-5sqrt(405)-2 - sqrt(405)) + sqrt(405))). -4sqrt(11)/27 Simplify ((-1-1sqrt(112))2 - (0 + sqrt(7) + 3-3sqrt(7))) + 4. 8sqrt(7) + 116 Simplify ((sqrt(162) - -2sqrt(162))-1)*2-3 - 1(sqrt(162) - (sqrt(162) - (sqrt(162) + 0)1)). -4374 - 9sqrt(2) Simplify (sqrt(45)/(-2sqrt(324)) - (-4 + -2 + sqrt(180)))*2. -73sqrt(5) + 31829/144 Simplify ((sqrt(130) - (sqrt(130) + 4(sqrt(130) - (sqrt(130)-2 + sqrt(130)))) - sqrt(130)) + -2sqrt(130)3)/(5(sqrt(1000)-2 + sqrt(1000))) + 5. 3sqrt(13)/10 + 5 Simplify (sqrt(84)/(sqrt(33)/sqrt(44)))/((sqrt(16) + sqrt(4))5 + -2sqrt(12)/sqrt(3)). 2sqrt(7)/13 Simplify -3 + (-1sqrt(152)-3)/((sqrt(36)/sqrt(2))/sqrt(9) - sqrt(18)/sqrt(144)). -3 + 8sqrt(19) Simplify (sqrt(4) + sqrt(576)-2 + sqrt(576))/sqrt(2) + ((sqrt(198)2)/sqrt(9))/sqrt(11). -9sqrt(2) Simplify 2 + (4 + sqrt(252) + (sqrt(252) - ((sqrt(252) + 2)*2 + sqrt(252))) - sqrt(252)) + (sqrt(252)3-1)2. -24sqrt(7) + 2018 Simplify (4 + sqrt(162))*2 - ((-1sqrt(16))/sqrt(8)3)2. 72sqrt(2) + 160 Simplify 1(1sqrt(48) - ((sqrt(3) - (sqrt(3) + (sqrt(3) - sqrt(12)))) + -4)). 4 + 3sqrt(3) Simplify (sqrt(1872) + (sqrt(1872) - (sqrt(1872) - -1sqrt(1872))))/(1(sqrt(4) - sqrt(4)-2))-6. 0 Simplify (2-1sqrt(78) + sqrt(78) + (sqrt(78) - (sqrt(78)-1 - sqrt(78))-1) + sqrt(78) + sqrt(78))/(sqrt(54) + sqrt(108)/(sqrt(2) - (sqrt(2) + sqrt(32)))). 0 Simplify (5 + sqrt(1088)4 + -3sqrt(1088) + -1)2. 64sqrt(17) + 1104 Simplify -5 + (0 + sqrt(32) + 3 + sqrt(8))*2 + 2(sqrt(12)/sqrt(6))*2 + sqrt(6)/(sqrt(3) - sqrt(3)-3). 145sqrt(2)/4 + 80 Simplify -5-3sqrt(28)/sqrt(4) - (sqrt(63) + 2 + -2)2. -63 + 15sqrt(7) Simplify ((-4sqrt(133)2 + sqrt(133) + sqrt(133))-3)/(4(sqrt(392)/sqrt(7))/sqrt(8)). 9sqrt(19)/2 Simplify 2((sqrt(60)/(sqrt(972) + sqrt(12)))*2 + (sqrt(125)-1 - sqrt(125))*2). 10001/10 Simplify -4 + 3 + -3(sqrt(1053) + 3sqrt(1053) - sqrt(1053)). -81sqrt(13) - 1 Simplify 2(sqrt(133)/sqrt(7) + -5)2 - (3sqrt(475) - ((sqrt(228)1 - sqrt(228))/sqrt(12))2). -35sqrt(19) + 88 Simplify -4 + 3 + (sqrt(78)26)/((sqrt(144)/sqrt(4))/sqrt(6)). -1 + 12sqrt(13) Simplify (3 + (1 + sqrt(128))2)-1 + (sqrt(800) + sqrt(4)/sqrt(2) + 2)*2. 68sqrt(2) + 754 Simplify (2(-6(sqrt(132) + -1sqrt(132)))/(sqrt(12)2))*2. 0 Simplify sqrt(832)23 + (-2sqrt(1872) - sqrt(208)-5). 44sqrt(13) Simplify ((sqrt(4900) - ((sqrt(4900) - sqrt(4900)2) + sqrt(4900) + sqrt(4900) + sqrt(4900))-1)/(sqrt(42)/((2sqrt(72))/sqrt(12))))2. 25200 Simplify 1 + (sqrt(65) - (-1sqrt(65) + sqrt(65))-5)/(sqrt(5) - (-1sqrt(55))/sqrt(11)). 1 + sqrt(13)/2 Simplify 2((-5(sqrt(17) + 0))*2 - -3sqrt(17)-1). -6sqrt(17) + 850 Simplify 6-5((sqrt(189)2)/sqrt(7))/(sqrt(1125)/sqrt(5)). -12sqrt(3) Simplify 2(3(1 + 0 + sqrt(396) - sqrt(396) - (sqrt(396)21 - sqrt(396))))*2. -216sqrt(11) + 7146 Simplify 3(-1-2sqrt(76) - (sqrt(209) + 14sqrt(209) + sqrt(209))/sqrt(11)). -6sqrt(19) Simplify ((-2sqrt(216))/((2sqrt(24))/sqrt(8))-2)2. 288 Simplify (sqrt(1573) + 0 + sqrt(1573))2 + sqrt(13) + 2 + -1sqrt(13) + (1 + sqrt(13) + sqrt(13)-1)-3. 62	{ "pile_set_name": "DM Mathematics" }
603u + 1. What is the third derivative of b(f) wrt f? -120f*3 + 27900f*2 - 6 Let x be 4 - (5 + -2) - ((-5)/5 - 0). Let q(w) be the first derivative of 0w*x + 0w*3 - 15/4w*4 - 9 - 4w. What is the first derivative of q(k) wrt k? -45k2 Suppose 4p - 249 = -c, -4p + 203 = 3c - 56. Let t = -58 + p. Find the third derivative of 5qt + 5q*2 + 22q*2 - 10q*3 - 10q*3 wrt q. -90 Find the second derivative of 7i*2 - 16i*2 + 9i*2 + 457i - 577i - 2458i*4 wrt i. -29496i*2 What is the third derivative of -1173h*2 - 1 + 128h*2 - 961h*5 - 2478h*5 wrt h? -206340h*2 Let g(n) = -19n*2 - 5n - 11. Let p(f) = 8 + f*2 + 0 - 6 - 1. Let d(b) = g(b) + 3p(b). What is the second derivative of d(m) wrt m? -32 Let x(u) = u*3 - 17u*2 + 24u - 79. Let o be x(16). What is the third derivative of -ov2 - 11v*6 - 29v*2 - 11v*6 wrt v? -2640v*3 Let l(r) be the first derivative of 0r*3 - 1/5r*5 + 33/2r*2 - 7r*4 - 9 + 0r. What is the second derivative of l(b) wrt b? -12b2 - 168b Find the second derivative of 41 - 439o3 - 26 - 15 + 110o*3 - 292o - 2o2 wrt o. -1974o - 4 Suppose 24 = -5u - 2q - 195, 4q = 5u + 237. Let z = -43 - u. Find the third derivative of 25 + 11az - 25 + 15a*2 - 13a*3 wrt a. -78 Suppose 4r + 3b + 1 = 3, 5b = -3r - 4. Suppose -x - 41 = -rh, 10 = h - 5x + 3. Differentiate 4q*4 - 15 + h + 3q*4 with respect to q. 28q*3 Let o(y) be the second derivative of -7655y*4/12 + 2875y*2 + 7349y. Find the first derivative of o(z) wrt z. -15310z Let i(c) be the third derivative of 0 + 66c*2 + 0c*3 + 0c + 0c5 + 0c*6 + 44/105c*7 - 17/6c*4. What is the second derivative of i(s) wrt s? 1056s*2 Let s(y) be the first derivative of 0y*5 + 69/2y*2 + 25/2y*4 + 10 - 1/3y*6 + 0y + 0y3. What is the second derivative of s(n) wrt n? -40n*3 + 300n Let l(f) = f*3 + 4f*2 - 12f + 4. Let y be l(-6). Suppose 0 = b + y - 6. What is the third derivative of 2h4 - 26h*b + 8h*4 + 16h*2 wrt h? 240h Let b(s) = 627s3 + 387s*2 + 5s - 1. Let k(v) = 628v3 + 390v*2 + 4v - 1. Let c(t) = 4b(t) - 5k(t). What is the third derivative of c(u) wrt u? -3792 Let o be 0 + ((-2)/186)/((-8)/116). Let p(g) be the first derivative of 7g - 3 + 0g2 + og*3. What is the derivative of p(n) wrt n? 58n Let l(y) = -6y - 20. Let f = 26 - 30. Let q be l(f). What is the third derivative of 0m*4 + 16m*2 + 9m*q + 10m*2 - 2m*4 wrt m? 168m Let x(i) = 4275i - 4586. Let b(k) = 2144k - 2293. Let w(l) = 5b(l) - 3x(l). Differentiate w(s) wrt s. -2105 Let h(n) = 7074n5 + 8n*4 - 128n. Let o(x) = 7075x5 + 6x*4 - 128x + 1. Let a(d) = -3h(d) + 4o(d). Find the second derivative of a(l) wrt l. 141560l3 Let q(c) be the first derivative of 0c*5 + 3/2c*6 + 0c*3 + 0c + 0c4 + 99 - 14c*2. What is the second derivative of q(m) wrt m? 180m*3 What is the derivative of 11860 - 14120 - 119o*3 - 79o*3 wrt o? -594o*2 Let h(q) = -2406q*3 - 4q*2 + 9q + 6588. Let p(l) = -602l3 - l2 + 2l + 1647. Let o(z) = -2h(z) + 9p(z). What is the third derivative of o(u) wrt u? -3636 Let p be 33/(-55) + (-48)/(-5). Suppose 3j + 3h = 6h + p, j - 4h = 6. Find the third derivative of -3n2 - 7n*2 + 26n*3 - jn*2 - 8n*2 wrt n. 156 Find the first derivative of -1110 - 3314j + 8130j - 4008j wrt j. 808 Let u(j) = -3j3 - 37j + 1361. Let r(q) = -2. Let v(x) = 3r(x) - u(x). What is the first derivative of v(n) wrt n? 9n2 + 37 Find the second derivative of 1 + s4 + 441s2 - 158s*3 - 461s + 1385s - 440s*2 wrt s. 12s*2 - 948s + 2 Find the first derivative of 2320 + 3431t + 9726t + 557 - 8557t wrt t. 4600 Let f(y) be the third derivative of y6/120 - 1463y*5/60 - 73y4/3 + y3/6 - 8y2 - 54y. Find the second derivative of f(h) wrt h. 6h - 2926 Let d(n) be the first derivative of -101n*6 - 71n*2/2 - 2n - 1209. Find the second derivative of d(z) wrt z. -12120z3 Let z(n) be the third derivative of -19n*6/120 - 19n*5/60 - 2113n*3/6 - 398n*2. What is the first derivative of z(v) wrt v? -57v*2 - 38v Let s = 43 + -105. Let b = s + 99. What is the derivative of bf3 - 9 + 54 - 19 wrt f? 111f*2 Suppose 4q = -29 + 49. Suppose 5m + 1 = 4g - 1, 23 = 4m + qg. What is the second derivative of -17k5 + 13k*5 + k + mk wrt k? -80k3 Suppose -2p = 2n - 512, 2p + 11n = 8n + 509. What is the third derivative of -pb2 - 19b*3 + 9737 - 9737 wrt b? -114 Let v(s) be the first derivative of 0s*2 - 81s - 1/2s4 + 84 - 21/5s*5 + 0s*3. Differentiate v(p) with respect to p. -84p*3 - 6p*2 Let z(a) be the third derivative of -151a9/252 + a6/60 - a*5/30 - 3239a*3/6 + 1254a*2 + 3a. What is the third derivative of z(b) wrt b? -36240b3 + 12 What is the third derivative of 5j5 + j4 - 6578j3 + 6563j*3 - 4j + 254j + 2j*2 wrt j? 300j*2 + 24j - 90 What is the second derivative of -8f3 - 826f - f*4 - 83f - 415f + 89f*3 + 100f*3 wrt f? -12f*2 + 1086f Let h(a) be the first derivative of 1103a6 + 26a*3 + 71a + 4121. Find the third derivative of h(b) wrt b. 397080b2 Let b(x) = -60x*5 - 2x*2 + 1330x + 2. Let a(w) = 2w5 + w2 + w - 1. Let f(d) = 2a(d) + b(d). Find the second derivative of f(z) wrt z. -1120z3 Let a(w) be the second derivative of 0w*2 + 1/6w*7 + 3 + 15w + 0w3 + 1/20w*5 - 31/12w*4 + 0w*6. Find the third derivative of a(z) wrt z. 420z2 + 6 Let d(w) = w3 - 21w2 + 9w - 69. Let o be d(21). What is the third derivative of 635v6 - 993v*6 + 518v*6 - ov*2 wrt v? 19200v*3 Suppose 31 = 3q - 2c, -4c + 3 = 5q - 12. Find the second derivative of 34j - 21j2 - j5 + 4j*5 + 21j*2 - qj*3 wrt j. 60j*3 - 42j Find the second derivative of 46o - 1 - 45o + 1749o3 + 19o + 183o wrt o. 10494o Let f(s) be the third derivative of 5s3/2 - s2 - 45s. Let r(v) = -1 - 14v + 13v + 0. Let t(q) = -3f(q) - 24r(q). Differentiate t(x) with respect to x. 24 Let a be ((-3)/15)/(1/(-5045)). Find the second derivative of -z*2 + 14z*5 - az + 1071z - z2 wrt z. 280z*3 - 4 Let m(w) be the third derivative of 7w*6/40 - 13w*5/60 - 169w4/24 - w3/3 - 131w2 + 1. What is the second derivative of m(c) wrt c? 126c - 26 What is the second derivative of -130g - 192g - 119g - 24g*2 + 20g*3 wrt g? 120g - 48 What is the third derivative of -1 + 16u4 + u4 + 0u - 2394583u5 + 0u - 585u2 + 2394581u*5 wrt u? -120u*2 + 408u Let k(i) be the first derivative of 2097i4/2 - 9479i - 6710. Differentiate k(s) wrt s. 12582s2 Let u be 22/44(5 - 1) + 22. What is the third derivative of 24 - v*2 + 66v*4 - 4v*4 + 244v*2 - u wrt v? 1488v What is the second derivative of 112v4 - 578v + 2014v + 88v*4 - 200v*4 + 9196v*5 wrt v? 183920v*3 Let l(c) be the first derivative of -153 - 129/4c*4 + 12c*2 + 0c*3 - c. Find the second derivative of l(x) wrt x. -774x Let y be (-1 - -3)(-4 + 75/6). What is the derivative of -4o*4 + yo*2 + 2 + 8 + 59 + 0o*4 wrt o? -16o*3 + 34o Find the third derivative of -1112p3 + 1449p*2 - 31p*3 - 908p*2 + 1642p*2 - 204p*3 wrt p. -8082 Let n(g) = g + 35. Suppose 5q = -5t - 140, -7t + 8t + 32 = q. Let a be n(t). Find the third derivative of 18b*a + 134b*2 - 96b*2 - 47b*5 wrt b. -1740b*2 Let c(w) = 6070w*3 - 18w*2 + 6w + 4476. Let y(q) = -6074q3 + 15q*2 - 5q - 4476. Let u(f) = -5c(f) - 6y(f). Differentiate u(s) wrt s. 18282s2 Suppose 14t - 6 = 13t. Let q(s) be the first derivative of -46s*2 - 47s*2 + 105s*2 - 3 - ts + 10. What is the first derivative of q(n) wrt n? 24 Let q(n) = n*3 + 349 + 3n - 348 - 10n2 - n. Let h be q(10). What is the third derivative of -hr*5 - 16r*5 - 2r*2 + 34r*5 wrt r? -180r*2 Suppose a + 3v = -0a - 7, -v - 5 = 0. What is the first derivative of 8b*3 + 70 + ab - 19 - 12b - 10b*3 wrt b? -6b*2 - 4 Let o be (15 - 10)1/1. Suppose 3u - 3 = op - 17, 4u - 2p = 0. What is the first derivative of uc - 9c + 5 + 4 wrt c? -7 Let q(k) be the second derivative of -k - 23/2k2 + 1/6k*4 + 0k*3 + 2 - 1/20k**	{ "pile_set_name": "DM Mathematics" }
Simplify (sqrt(133) - 3-1sqrt(133) - (-4-1sqrt(133) + sqrt(133)))/(1(sqrt(448) + sqrt(448) + sqrt(448)-2 + sqrt(448)))5. -5sqrt(19)/8 Simplify (5sqrt(52)-5 + 0)*2 + ((sqrt(13) - 4sqrt(13)) + 4 - sqrt(13))*2 + 4sqrt(13) + -4. -28sqrt(13) + 32720 Simplify (((sqrt(1100)-2 + sqrt(1100))/sqrt(4))*2 + 4 + (1 + sqrt(11) + sqrt(176) - (sqrt(539) + 0)))-4. -1120 + 8sqrt(11) Simplify sqrt(1700)21 + (sqrt(1700) + 2 + 0)2 + (sqrt(1700) + -3 + sqrt(1700))2 + 1 + 1 + -2. -60sqrt(17) + 8513 Simplify ((-1 + sqrt(2736) + 5 + 1sqrt(2736))-3 + (sqrt(2736) + sqrt(2736) + (1 + sqrt(2736) - sqrt(2736)))6 + (-1 + sqrt(2736)3 - sqrt(2736)))*2. -1344sqrt(19) + 175153 Simplify -13(3 + (-2(sqrt(119) + sqrt(119) + (-3sqrt(119) - sqrt(119))))/(sqrt(21)/sqrt(3)2)). -6sqrt(17) - 9 Simplify (-5 + -4 + (sqrt(128) + (sqrt(128) - (sqrt(128)-1 + 2)) + -1 + sqrt(128) + 2)-6 + 3)*2. 73728 Simplify (((sqrt(495)-2)/sqrt(9) - sqrt(55)) + (4sqrt(550) - sqrt(550))/sqrt(10))/(-3(4sqrt(20)/sqrt(4) - sqrt(60)/(sqrt(12)-2))). 0 Simplify 4 + 2 + (3(0 + -61(sqrt(275) + sqrt(275)1)))*2 + 0. 356406 Simplify ((sqrt(833) + (sqrt(833) + 0)1 - sqrt(833) - sqrt(833)) + sqrt(833) - ((sqrt(833) + 1)-4)2) + (-2-5(-1 + sqrt(833) + 3))2 + 4. 2583sqrt(17) + 70360 Simplify (1sqrt(130)-5 + sqrt(130) + sqrt(130) + sqrt(130)-3-1)/((sqrt(810) - ((sqrt(810) - sqrt(810)2) + sqrt(810)) - sqrt(810) - sqrt(810))-5). 0 Simplify 6(((-1sqrt(360))/sqrt(6))/sqrt(10))/(sqrt(6)/sqrt(2)-3 - (2sqrt(18))/sqrt(6)). 6sqrt(2)/5 Simplify ((-6(1sqrt(76) + sqrt(76)))/(sqrt(32)/(-1sqrt(8)) - sqrt(4)) - -4(sqrt(19) - (-3 + sqrt(19) + 2))2)*2. 96sqrt(19) + 748 Simplify (-5(((sqrt(192) + sqrt(192)-2)-2 - sqrt(192)) + sqrt(192)))/(sqrt(12)/(sqrt(2) - -1sqrt(2))-5)-5. -80sqrt(2) Simplify -5((((sqrt(9) - sqrt(27)/sqrt(3))-4 + sqrt(9) + sqrt(45)/(sqrt(5)-1))5)/(sqrt(243) + (sqrt(243) - -2sqrt(243))5 - -41sqrt(243)))2. 0 Simplify 2 + (2 + (-4 + (sqrt(147))2 - sqrt(3)) - (-2sqrt(108) - (sqrt(3) + (sqrt(3) - (sqrt(3) + sqrt(9)/sqrt(3)3)2))))-2. -192 - 26sqrt(3) Simplify (2 + sqrt(80) + -2 + -6(-1 + sqrt(80) + sqrt(80)) - (sqrt(80) + sqrt(5) + 3 + -6sqrt(405)))2 + 5. 30sqrt(5) + 139 Simplify 2(sqrt(4)/sqrt(2) + sqrt(2)) - (sqrt(2) - sqrt(32)1) - (-6sqrt(2)-4 - (sqrt(2) + (sqrt(112)/sqrt(7))/sqrt(8))). -15sqrt(2) Simplify ((sqrt(78) - sqrt(78)2)2 - sqrt(78) - (sqrt(78) - (sqrt(78) + 2(sqrt(78) + 1sqrt(78)))))/(sqrt(324)/(sqrt(24)/sqrt(4)))-3. -sqrt(13) Simplify (2(sqrt(66) + sqrt(66) + (sqrt(66)2 + sqrt(66))4)1)/(sqrt(486) + -1(sqrt(486)2 + sqrt(486)) - 2sqrt(486)4). -14sqrt(11)/45 Simplify (-4sqrt(156)-2 - (1sqrt(156)-1 + sqrt(156)))/(sqrt(1200)1 - sqrt(108)1) + 3. 3 + 8sqrt(13)/7 Simplify (sqrt(385)/(((sqrt(84) - sqrt(84)-2) + sqrt(84) - sqrt(84))/sqrt(12)))/(25sqrt(99)) + 0. sqrt(5)/90 Simplify 0 + 2 + ((sqrt(51) - (sqrt(561)/(2sqrt(11)) - sqrt(51))) + 5sqrt(204)/sqrt(4))/(6(sqrt(432) + 1sqrt(432) + sqrt(432))). 13sqrt(17)/432 + 2 Simplify 2((2 + (sqrt(170) + 6(sqrt(170)2 - sqrt(170) - sqrt(170)))/sqrt(10))2 - 4(-3(sqrt(612) - sqrt(612)-2))*2). -396534 + 8sqrt(17) Simplify (sqrt(189)/(sqrt(9) + (-1sqrt(441) - sqrt(441) - sqrt(441))))/((sqrt(24)/(sqrt(8)2) + sqrt(3))-6)2 + -3. -3 + sqrt(7)/90 Simplify (2(sqrt(170) - (-4sqrt(170) + sqrt(170))) + sqrt(170))/(sqrt(30)/sqrt(12)) + (sqrt(51) + (-4sqrt(510))/sqrt(10))/(sqrt(3) - -2sqrt(15)/sqrt(5)). 17sqrt(17) Simplify (15sqrt(136)-61)/((sqrt(200) + (sqrt(200) + sqrt(200)-5)2 + sqrt(200) + sqrt(200) + sqrt(200))-5). -3sqrt(17)/10 Simplify -5 + ((-6((sqrt(128)2 - sqrt(128)) + -4))2 - ((sqrt(128)-2)*2-3 - (2sqrt(128)1)*2)). -2304sqrt(2) + 7227 Simplify 3(sqrt(208) + 3)3 + 2-4sqrt(208)1 + 5. 4sqrt(13) + 32 Simplify (-1 + ((-5(sqrt(126) - (sqrt(126) + 2sqrt(126) + sqrt(126))))/sqrt(7))/(sqrt(90)/sqrt(160) + 2sqrt(441)) + 4)2. 120sqrt(2)/19 + 4049/361 Simplify (5(sqrt(104)-53 - sqrt(104))/sqrt(8) - (4sqrt(13)-1 + sqrt(104)/(sqrt(200) - sqrt(8)) + -2))2. -305sqrt(13) + 1209389/16 Simplify 5(-6((sqrt(891)31)2 + ((sqrt(11) - sqrt(66)/(sqrt(24)/sqrt(4))) + -5)2) + 0). -241320 Simplify (5-2sqrt(110)-1-6)/(1sqrt(30)/sqrt(3) + sqrt(640)-2). 4sqrt(11) Simplify (4 + (3(5(1sqrt(72) - sqrt(72)) - sqrt(72)) - (3 + 1sqrt(72) + sqrt(72) + (2(sqrt(72) + 1) - sqrt(72) - sqrt(72))))5)2 + 1. 6300sqrt(2) + 45442 Simplify (0 + ((sqrt(1539) + 0)1-3 - 2(0 + sqrt(1539) + -4)) + -5)2. -270sqrt(19) + 38484 Simplify -5 + sqrt(425) + -4(0 + sqrt(425)) + -3 - (sqrt(425) + sqrt(425) + -2 + 1 + (1 + -2 + sqrt(425) + sqrt(425))2). -1708 - 5sqrt(17) Simplify 3sqrt(170)/(sqrt(360)2) + (5(sqrt(68) + -1sqrt(68)))/(sqrt(4) + -1sqrt(8)/sqrt(2) + sqrt(4) + sqrt(4)). sqrt(17)/4 Simplify (sqrt(1960)-5 - sqrt(640)4)/(sqrt(8)36 + sqrt(8) + sqrt(72)-2). -51sqrt(5)/13 Simplify (-2(sqrt(102)/(sqrt(2) + 2sqrt(128) + sqrt(128) + sqrt(128) + sqrt(128)))/(sqrt(27)-6 - (sqrt(165)/sqrt(5))/sqrt(11)))*2 + 2. 1213750/606841 Simplify (-2 + (sqrt(1300) + 4 + sqrt(1300)-1 - (5 + (1 + sqrt(1300) - sqrt(1300)))))*2 - (sqrt(39)1-1)/(-4sqrt(75)). -sqrt(13)/20 + 16 Simplify -1(-6(4sqrt(171)3 + sqrt(171)))/(4(3sqrt(63))/sqrt(7)). 13sqrt(19)/2 Simplify ((sqrt(85)-3-46-3)/((sqrt(50) - -2sqrt(2450))/(-1sqrt(160))))2. 1410048/25 Simplify (-1 + 1sqrt(612)-1)2 + ((-3(sqrt(102) + 1sqrt(102)))/(sqrt(600)2))*2 + 2 + -3. 12sqrt(17) + 61353/100 Simplify (4(-1sqrt(2736) + sqrt(2736) + -2 - (sqrt(2736) + sqrt(2736) + 1)-4) - (-1 + 0 + sqrt(2736) + 3-1sqrt(2736)))2. 7344sqrt(19) + 3162897 Simplify 5 + -3(1 + (sqrt(280)-2-1)/(-4sqrt(30)/sqrt(3))1)2. -19 + 6sqrt(7) Simplify 4(0 + (sqrt(110) - (sqrt(110) - (sqrt(110) - -1sqrt(110)6) - sqrt(110) - sqrt(110)))/(sqrt(250)-6)6 + 0). -36sqrt(11)/5 Simplify 1sqrt(68) + sqrt(68) - (3sqrt(153))*2 - ((sqrt(17) - (sqrt(17) + sqrt(85)/sqrt(5))) + 5 - (sqrt(272)4 - sqrt(17))). -1382 + 20sqrt(17) Simplify (-1 + sqrt(44)/(1sqrt(8)/sqrt(2)) - (-4 + (-1sqrt(11) - sqrt(11)) + sqrt(11) - (sqrt(11) - sqrt(77)/(sqrt(7) - sqrt(252))))2) + 3. -1681/25 - 83sqrt(11)/5 Simplify (-2sqrt(2673)2)/(1(sqrt(30)/sqrt(490) - sqrt(3))). 42sqrt(11) Simplify 6(5 + -3(sqrt(1331) + sqrt(1331) + 1 + sqrt(1331) + 4) + 3(sqrt(1331) + sqrt(1331)1 + -5))*2. 9900sqrt(11) + 75624 Simplify sqrt(77)/sqrt(112) + (sqrt(11) - (sqrt(539) + sqrt(539) + 4)) - (5 + ((-2sqrt(396) - sqrt(396) - sqrt(396)) + 0 - sqrt(396)))2. -9929 + 1149sqrt(11)/4 Simplify ((sqrt(153)-1 + 5)2 - (sqrt(153) + 0 + 2) - (-2 + sqrt(153) + 4 - ((2sqrt(153) - sqrt(153))-4)2)) + -5. -36sqrt(17) + 2617 Simplify (sqrt(3800) - (sqrt(3800) + sqrt(3800)1 + sqrt(3800)))/(3sqrt(8)) - ((-2 + 5 + sqrt(76)/sqrt(4) + sqrt(114)/sqrt(54))-2)2. -1540/9 - 106sqrt(19)/3 Simplify (4sqrt(320)1 + sqrt(320) + -2sqrt(320)2)/((sqrt(4) - (sqrt(4) + sqrt(16))-2) + sqrt(28)/sqrt(448)). 32sqrt(5)/57 Simplify ((-3(sqrt(108) - -2sqrt(108))4)/(4sqrt(18)/(sqrt(14)/sqrt(7))))*21. 972 Simplify (-11(1-2sqrt(847) - 2-2sqrt(847)))*2-3. -10164 Simplify (2sqrt(520)-3 - 1sqrt(520)-5)/(-3(1sqrt(490) - sqrt(490)) - sqrt(490)). 2sqrt(13)/7 Simplify (sqrt(228) + 2sqrt(228)-1 + sqrt(228)-32)/(sqrt(12) + sqrt(84)/(2sqrt(7)) - sqrt(84)/sqrt(63)). -6sqrt(19) Simplify 3((1 + sqrt(125)-1 + sqrt(125) + (-2 + 1sqrt(125))2 + sqrt(125) + sqrt(125) - (5 + (1 + sqrt(125))2)-4) + 4). 90sqrt(5) + 1974 Simplify ((0 + 1 + sqrt(1331) + 1 + sqrt(1331) + -4 + sqrt(1331) + 4 + 1)-2)2. 792sqrt(11) + 47952 Simplify (((sqrt(120)-21)/(sqrt(392)-2))/(sqrt(108)4 - sqrt(27)/(-4sqrt(9))))2. 80/461041 Simplify (sqrt(256)-61)/(sqrt(96)/(sqrt(12) - -1sqrt(12)))1. -48sqrt(2) Simplify (4sqrt(136)-6 - -4(sqrt(136) - 4sqrt(136)))/(sqrt(8) + sqrt(288) + (sqrt(288) - (sqrt(288) + -4sqrt(288))) - (sqrt(80) - sqrt(80)1)/sqrt(10)). -36sqrt(17)/31 Simplify (5sqrt(91)/(32sqrt(7)))*2 + 5 - (1(-3sqrt(13)3 - (0 + sqrt(91)/sqrt(7))))*2. -46295/36 Simplify (6(2 + sqrt(75) + (sqrt(75) + 0)-1 + -3 - 5-1(sqrt(75) + ((1sqrt(75) + -1 - sqrt(75)) + sqrt(75) - sqrt(75)))))*2. -10800sqrt(	{ "pile_set_name": "DM Mathematics" }
w(c) = -6c - 24. Let i be w(-5). Let t(l) be the third derivative of -l4/24 + l2. Let s(d) = 8d. Determine it(z) + s(z). 2z Let a(v) = -2v + 2. Let o = 12 + -4. Let y(h) = -3h - 7. Let m(b) = 5b + 11. Let i(l) = 5m(l) + 8y(l). Let q = 2 - -1. Determine oi(u) + qa(u). 2u - 2 Let b = -4 - -7. Let m(x) = x*2. Let d(o) = 2o - 1. Let v = 5 - 4. Let i be d(v). Let j(t) = -5t2. Calculate bm(g) + ij(g). -2g*2 Suppose h = r - 8, 0 = -5r - h - h + 33. Let k(b) = -11b - 13. Let m(n) = -6n - 7. Determine rm(q) - 4k(q). 2q + 3 Let n(c) = c + 1. Let k(g) = -6. Give k(w) + 5n(w). 5w - 1 Suppose -13 + 5 = -4n. Let o = n + 2. Let f(j) = -5j3 + 6j - 6. Let r(q) be the first derivative of q*4 - 5q*2/2 + 5q + 3. What is or(b) + 3f(b)? b*3 - 2b + 2 Let l(s) = 2s2 - 5s + 11. Let z(f) = -f*2 + 3f - 6. Let a = 17 + -6. What is az(v) + 6l(v)? v*2 + 3v Suppose -2w + 5c = -0w - 10, 34 = 3w + 2c. Let u(h) = 3h*2 - 4h*2 - 8h + wh + 2h*2. Let b(r) = 4r*2 + 9r. Calculate 2b(i) - 9u(i). -i2 Let q(k) be the first derivative of k4 + 5k3/3 - 3k + 30. Let m(l) = 2l3 + 3l*2 - 2. What is -5m(h) + 3q(h)? 2h*3 + 1 Suppose -5s = 2x + 31, 3s - 2x = -8 - 1. Let o(a) = -8a*3 + 14a*2 + 8a - 6. Let t(w) = 3w3 - 5w*2 - 3w + 2. Give so(m) - 14t(m). -2m3 + 2m + 2 Suppose 4r - 9r = 25. Let g(o) = -2o3 + 5o - 5. Let a(y) = -y*3 + 2y - 2. Give ra(w) + 2g(w). w*3 Let x(y) = -y - 1. Let w(d) = -3d - 4. Let g(m) = 2w(m) - 7x(m). Let j(b) = -2b2 - b3 + 2b*2 + 1 - 3b. What is -3g(o) - j(o)? o3 + 2 Let b(u) = -16u*3 + 8u*2 - 8u. Let z(n) = 11n3 - 5n*2 + 5n. Calculate -5b(i) - 8z(i). -8i3 Suppose l - k - 8 = 0, 3k = -13 + 1. Suppose -2j - 9 = -4s + 7, s - 13 = -lj. Let n(t) = -j + 1 + 2t - 3. Let d(p) = 2p - 3. Give 6d(b) - 5n(b). 2b + 2 Let d be (-3)/1 - -6 - 14. Let n(x) = -x*3 - 12x*2 - 13x - 16. Let l be n(d). Let b(q) = -9q2 - 7. Let a(k) = -26k*2 - 20. Give la(w) - 17b(w). -3w*2 - 1 Let p(w) be the first derivative of 3 + 0w - w*2 + 2/3w3. Let k(d) = -d3 - 9d2 + 9d. What is -2k(j) - 9p(j)? 2j3 Let t(s) = -2s - 2. Let o(c) be the third derivative of c4/24 - c3/3 - c*2. Let d be o(4). Let y(l) = 3l - d + 3 + 3. What is 5t(m) + 3y(m)? -m + 2 Let t(c) = 28c3 + 6c*2 - 10c + 28. Let u(r) = 9r3 + 2r*2 - 3r + 9. Calculate 3t(q) - 10u(q). -6q3 - 2q*2 - 6 Let f(q) = -5q*2 + q - 4. Let i(y) = -9y*2 + y - 7. Calculate 5f(c) - 3i(c). 2c*2 + 2c + 1 Suppose -3m = -4m + 12. Suppose -v = v + m. Let s(p) = -8p3 + p + 4. Let o(j) = -7j*3 + j + 3. Calculate vo(l) + 5s(l). 2l*3 - l + 2 Let g(s) = 4s*3 - 7s*2 + 5s + 5. Let y(a) = -2a3 + 4a*2 - 3a - 3. What is 3g(u) + 5y(u)? 2u3 - u2 Let g(v) = -3v - 7. Let i(m) = -m + 6. Let p(c) = -3c + 12. Let a(h) = -9i(h) + 4p(h). Determine 7a(s) - 6g(s). -3s Let r(k) be the first derivative of -3k2 + 5k + 1. Let q(p) = -7p + 6. Determine -5q(y) + 6r(y). -y Let x(n) = -n2 + 1. Let d(u) = -3u*2 - 2u + 5. Let m be 19/133 + (-16)/14. Give mx(s) + d(s). -2s*2 - 2s + 4 Let t(k) = 0k2 + k + 4k*2 - 3k*2 - 1 + 0k*2. Let d(w) = -5w*2 - 8w + 6. Calculate d(f) + 6t(f). f2 - 2f Let i(w) = -w. Let v(j) = 2j2 + 4j + 2. Suppose 10 = 56q - 58q. Determine qi(s) - v(s). -2s*2 + s - 2 Let m(r) = 19r + 18. Let n(p) = -10p - 9. What is 6m(g) + 11n(g)? 4g + 9 Let q(w) = -27w - 11. Let l(b) = 14b + 6. Calculate 7l(i) + 4q(i). -10i - 2 Let m(d) = d - 3 + 2 + 2. Let x(h) = -4h - 4. Let p(t) = 16t + 16. Let z(y) = -4p(y) - 18x(y). Calculate -6m(v) + z(v). 2v + 2 Let p(g) = -3g*2 + 3g - 1. Let x(a) = 3a2 - 4a + 1. Suppose -3 = -3m - 15. What is mp(v) - 3x(v)? 3v*2 + 1 Let y(m) = 6m*3 + 17m*2 + 14m + 17. Let b(t) = -2t3 - 6t*2 - 5t - 6. Determine 17b(w) + 6y(w). 2w3 - w Let b(y) = 4y*3 + 4y. Let h(s) = 3s3 + 5s. Give -5b(l) + 4h(l). -8l3 Let o(r) = 0 - 2r*2 - r + 4r2 - 8. Let j(a) = a2 - 1. Let m(q) = 3q2 + q + 2. Let x(d) = 5j(d) - m(d). Give -6o(i) + 7x(i). 2i2 - i - 1 Let y(i) = 8i + 5i - 3 - 11i. Let d(x) = 3 + 2x - 1 - 1 - 3x. Give 3d(r) + y(r). -r Let i(b) = b + 1. Let k(q) = -4. Give -3i(r) - k(r). -3r + 1 Let w(i) = -6 + 13i2 - i3 - i*3 - 7. Let u(f) be the first derivative of -6f + 0f2 - 1/4f*4 + 2f*3 + 2. Give -13u(p) + 6w(p). p3 Let j(p) = -3p*3 + 9p*2 + 5p + 9. Let c(s) = s*3 - 2s*2 - s - 2. Calculate -9c(n) - 2j(n). -3n*3 - n Let u(q) = 7q. Let k(x) = -11x. What is -5k(v) - 8u(v)? -v Let p(s) = -23s*2 + 2s + 2. Let a(x) = 47x2 - 4x - 5. What is 4a(v) + 9p(v)? -19v2 + 2v - 2 Let d(j) = 6j + 3. Let o(v) = -9v - 5. Let a(n) = 9n + 5. Let z(y) = 7a(y) + 6o(y). Calculate 8d(w) - 5z(w). 3w - 1 Let q(l) = 4l2 + 4l + 2. Suppose 19 = 5t - 101. Suppose -2v = -0v - 4r - t, 31 = 3v - 5r. Let p(o) = -o*2 - o - 1. What is vp(g) + q(g)? 2g2 + 2g Let i(n) = 23n2 - 4n + 2. Let d(o) = -12o2 + 2o - 1. Calculate -5d(u) - 3i(u). -9u2 + 2u - 1 Let x(d) = 4d2 + 4d - 5. Let f(u) = -9u2 - 7u + 11. Determine -6f(r) - 13x(r). 2r2 - 10r - 1 Suppose 4o - 1 = 3o. Let z be -10 - (6/(-2) + o). Let p(n) = -5n. Let t(d) = 3d. Let l(s) = -s*3 + 2s - 1. Let c be l(2). Give cp(v) + zt(v). v Let t(y) = 11y + 1. Let k(p) = -10p - 1. What is -4k(r) - 3t(r)? 7r + 1 Let p(k) = -21k2 + 15. Let l(q) = q2 - 1. Determine -12l(r) - p(r). 9r*2 - 3 Let t(w) = 8w*3 - 15w + 2. Let b(q) = 4q3 - 8q + 1. Determine -5b(v) + 3t(v). 4v3 - 5v + 1 Let z(y) = -10y + 1. Let i(n) = 51n - 6. What is -2i(r) - 11z(r)? 8r + 1 Let v(x) = -2x*2 + 5x + 4. Suppose -13f - 12 = -17f. Let p(c) = -c*2 + 4c + 3. What is fv(i) - 4p(i)? -2i2 - i Let u(j) = 8j + 11. Suppose 2f + 2f - 8 = -4r, 4f - 26 = 5r. Let k = -7 - f. Let h(d) = 3d + 4. Determine kh(l) + 4u(l). -l Let n(v) = v*2 - 2v - 8. Let d(g) = 3g2 - 4g - 21. Let w(q) = 6q2 - 7q - 41. Let u(o) = 5d(o) - 2w(o). What is 17n(a) - 6u(a)? -a*2 + 2a + 2 Let h(n) = -n3 - n2. Let q(f) = 3f2 - 3f*3 - 5f*2 - 2f3 - f3. What is -4h(b) + q(b)? -2b*3 + 2b*2 Let r(t) = 3t*2 + 1. Let d(f) = -7f*2 - 2f - 7. Let j(g) = 3g2 + g + 3. Let a(z) = 4d(z) + 9j(z). Calculate -a(c) - r(c). -2c*2 - c Let b(v) = -20v + 59. Let t(p) = 4p - 12. Let d(y) = 2b(y) + 11t(y). Let j(m) = -m + 3. Determine 6d(r) + 28j(r). -4r Let o(r) = r*2. Suppose 9a - 4a = 3b + 4, 4b - 4a = 0. Let l be 6/4 + (-1)/(-2). Let x = l + b. Let i(g) = -3g2 - g + 1. Calculate xo(p) + i(p). p2 - p + 1 Let w(q) = -q3 - q*2 + q + 1. Let c(v) = -7v*3 - 5v*2 + 8v + 5. Give c(f) - 5w(f). -2f*3 + 3f Let n(v) = -v. Suppose -5z = 9d - 12d - 10, -15 = -2z - d. Let s(p) = 3p - 4. Let w(h) = 4h - 3. Let l(q) = 2s(q) - 3w(q). What is zn(f) - l(f)? f - 1 Let u(m) = 19m + 3. Let y(b) = 10b + 1. Give -3u(h) + 7y(h). 13h - 2 Let x(b) = -7b + 5. Let k(l) = 8l - 6. Let r(c) = -6k(c) - 7x(c). Let w(y) = -5 + 3 - 1. Give -2r(a) - w(a). -2a + 1 Let q(z) be the third derivative of z4/6 + z3/6 + z*2. Let x(i) = -9i - 2. Let a = -94 + 91. What is ax(b) - 7q(b)? -b - 1 Let z(s) be the second derivative of 7s3/6 - 5s*2 - 28s. Let d(k) = -15k + 21. Give 6d(c) + 13z(c). c - 4 Let m(s) = 0s - 2 + 3s - 4 - 3s2. Let z(x) be the first derivative of -x3/3 + x*2/2 - x - 3. Let a be (15/(-9))/((-1)/(-3)). Give az(h) + m(h). 2h2 - 2h - 1 Let r(b) = 10b2 - 4b. Let x(g) = -g*2 - g - 1. Calculate r(q) - 4x(q). 14q2 + 4 Let k(n) = -2n - 9. Let u(r) be the third derivative of r*4/8 + 13r*3/6 - 16r*2. Determine 7k(q) + 5u(q). q + 2 Let z(a) = -43a*2 - 5a + 5. Let x(w) = 21w2 + 2w - 2. Give 5x(o) + 2z(o). 19o2 Let m(x) = 6x*2 - 3. Let a(u) = 5u*2 - 4. What is 3a(q) - 4m(q)? -9q*2 Let f(r) = -4r*2 + r - 2. Let p be 1(-7)/((-21)/9). Let g(b) = 2 - b*2 + 5b*2 - 4b*2 + pb*2 - b. Determine -2f(u) - 3g(u). -u2 + u - 2 Let w(p) = -7p*3 + 3p*2 + 3p + 3. Let i(j) = 14j3 - 5j*2 - 5j - 5. Give 3*i(	{ "pile_set_name": "DM Mathematics" }
f k? False Let a be (102/(-8))/((-54)/288). Suppose 5w = 6w - a. Is 13 a factor of w? False Let k(y) be the first derivative of y*4/4 + 13y*3/3 + 7y*2/2 + 10y + 9. Is 6 a factor of k(-12)? False Let a be 5 - (3 + -2 - -2). Suppose -ak = -v + 21, 3k + 40 = 2v - 2k. Let n = v + -10. Does 10 divide n? False Let t = -11 - 3. Is 34 a factor of 34/3(t + 17)? True Suppose -i + 3i = -2i. Suppose 2u + 0f - 197 = f, 2u + 4f - 182 = i. Is u a multiple of 6? False Let r = 217 - 93. Is r a multiple of 12? False Let w(n) = -104n + 8. Let y be w(-10). Does 48 divide (45/30)/(6/y)? False Let k(v) = 0v2 + 2v*2 + 0 - 10v - 2. Let w be (-44)/(-6) - (1 - (-4)/(-6)). Does 13 divide k(w)? True Let m = 136 + -146. Is 5 a factor of (545/(-10))/(5/m)? False Suppose -12u + 23u - 902 = 0. Does 33 divide u? False Let g(v) = -24v + 4. Suppose 2d + 5 + 2 = w, -5d = -4w + 16. Is g(d) a multiple of 29? False Let t(q) = q*2 - 36q - 25. Let y be t(34). Let x = y + 247. Is 18 a factor of x? False Is 11650/14 + 33/(-231) a multiple of 8? True Let t(u) = -10u - 33. Let f be t(-14). Suppose -5v + f = r, 0 = 3v - 7v + 2r + 80. Does 7 divide v? True Suppose n - 4n - 312 = 0. Let y = -43 - n. Is y a multiple of 7? False Let z be (-1)/(-8) + (-6)/(-16)-1643. Does 44 divide (z/(-6))/(-7)-3? True Suppose 0t = -4t + 84. Suppose -8a = -9a + t. Is 9 a factor of (-98)/a(-54)/7? True Suppose 18 = -m + 3m. Suppose 3z = 5l - 0l + m, -3z - 5l = -9. Suppose zg - 91 = -22. Is 7 a factor of g? False Suppose 0 = -5g + 3 + 7. Suppose 3 = w + 2i, 24 - g = 4w - 2i. Suppose -2k = -wk + 159. Does 32 divide k? False Suppose -t = 3q - 632, -3t - q - 2q + 1902 = 0. Does 14 divide t? False Suppose 2r + r - 4m + 1 = 0, 0 = 4r - 4m. Let j be (57/(-15))/(r/(-5)). Suppose -ji = -14i - 275. Is 11 a factor of i? True Let v = 25 - 4. Suppose q = 17 + v. Is 18 a factor of q? False Let z(d) = d2 + 11d + 6. Let s be z(-8). Let i be (-14)/63 + (-940)/s. Let h = 88 - i. Is 19 a factor of h? False Suppose 2h = 4h - 58. Let j = h + 1. Suppose -3c + j = -0c. Is 3 a factor of c? False Suppose 4 = -4s, -5q + 3q = -2s - 202. Does 13 divide q? False Suppose -2s - 35 + 13 = 0. Let z be 2 + -1 + s/(-1). Let h(x) = x2 - 10x - 16. Does 4 divide h(z)? True Let w(t) = 221t2 + 51t + 106. Is 8 a factor of w(-2)? True Let o(b) be the first derivative of 2b3/3 + 6b*2 - 13b - 70. Let v = -17 - -8. Is 9 a factor of o(v)? False Let z = -287 + 495. Is z a multiple of 42? False Let t(w) = 16w2 - 12w + 6. Does 10 divide t(3)? False Let s(j) = j*2 - 2j + 13. Let l be s(9). Suppose 4o = -0o + l. Is o + (-1 - -2)-3 a multiple of 16? True Suppose -5z - 25 = 0, -4z - 2435 = 187v - 188v. Is 115 a factor of v? True Let b(t) = 3t + 43. Let u be b(-15). Is (9/(-72)u)/((-2)/(-568)) a multiple of 4? False Suppose 2 - 5 = -p. Suppose -2j + 9 = -pw, -2j = 2w + 2j + 6. Let x = 7 - w. Is x a multiple of 7? False Suppose 0 = 3u + u + 3h - 11476, 4u + 4h - 11472 = 0. Is u a multiple of 19? False Suppose -64j - 5t - 339 = -68j, -2j - 4t = -150. Is 9 a factor of j? True Suppose 0 = -3b - 13f + 16f + 1218, 0 = -b - 5f + 382. Is b a multiple of 93? False Let y be 3 - (-5)/(5/(-3)). Let n = y - -10. Is 17 a factor of (-5)/n(0 - 34)? True Let z = 9 + -6. Suppose 4f + 77 = zf. Let m = -41 - f. Is 12 a factor of m? True Let m(s) = 6s3 - s2 + 1. Let z be m(1). Let q be z/(-8) - 335/(-20). Let y = 34 + q. Is y a multiple of 10? True Suppose -2x = -0x + 3c + 9, 2x - 5c - 15 = 0. Suppose x = -3u - 0u + 54. Is 11 a factor of -1(3 + -1) + u? False Let x(f) = 25f + 14. Let s be x(7). Let y = s + -115. Is y a multiple of 13? False Suppose -3t = -2l - 2t + 230, -2l = -3t - 234. Suppose 3h + 30 = l. Does 6 divide h? False Let q be (1 + 0)(-14 - 8). Does 7 divide (-15)/(-15) - (1 + q)? False Suppose -10d + 5672 = -928. Suppose -5f + d = -c - c, 5c = -2f + 235. Is 15 a factor of f? False Let y(p) = -57p - 3. Let k be y(-1). Let m = k - 42. Is m a multiple of 12? True Let u be (5 - -53) + 2 + -1. Let v = u - 54. Does 2 divide v? False Let f = 32 + -20. Let d be 16/6 + (-8)/f. Suppose -2l = 0, l = 5z - dl - 85. Is z a multiple of 15? False Is 12 a factor of 12/9(-3924)/(-24)? False Let l(f) = 11f + 262. Is l(39) a multiple of 7? False Let d be 0 + 2 + 4 - (1 - -3). Is 26 a factor of ((-1)/d + 1)(136 + -14)? False Let s = 23 - -57. Does 2 divide (4/14 - s/35) + 11? False Let v(w) = 10w2 + 10w*2 - 13w*2 - 3w + 0w. Is 32 a factor of v(5)? True Let y = 4 - 0. Suppose 2b = -o + 29 - 169, yo + 8 = 0. Let c = -13 - b. Does 14 divide c? True Suppose 474l + 1485 = 477l. Is l a multiple of 19? False Suppose 12x - 380 = 17x. Let r = -71 - x. Does 5 divide r? True Let a(r) = -r - 9. Let o be a(-10). Does 11 divide 318/2 - (o + -1)? False Let j be (26/(-3))/((-5)/(-30)). Does 11 divide (-4 + j/(-2))/((-3)/(-12))? True Let r(o) = -2o*3 + 41o*2 - 12o - 9. Is r(19) a multiple of 6? True Suppose -y + 12 = y. Suppose -u - 4s = -s - 6, -3u + y = -3s. Is (90 - -2 - u) + 0 a multiple of 18? False Suppose 2g - 330 = -y - 90, 0 = -4g - 4. Let x = y - 143. Is x a multiple of 11? True Let s(c) = -c3 + 26c*2 + 24c + 83. Let u be s(27). Let i = 3 + 0. Suppose -5z = -3d + 140, uz = -id - d + 178. Is d a multiple of 12? False Let x be (-8327)/33 - (-1)/3. Let j = -180 - x. Is j a multiple of 24? True Let j(n) be the third derivative of -n*4/12 - 8n*2. Is j(-4) a multiple of 5? False Suppose 0 = 4g - 22 + 2, -392 = -3p + 2g. Suppose 0 = -8i + p + 34. Does 14 divide i? False Suppose 8j - 3a - 75 = 3j, -5a = 3j - 79. Let o = -24 + j. Is 27 a factor of ((-10)/o)/(3/63)? False Let z = 57 + 6. Suppose -327 = -5v + z. Is 13 a factor of v? True Let j(v) = -27v - 14. Does 11 divide j(-1)? False Let q = 7 - 15. Let c(f) be the third derivative of -5f4/24 - 7f*3/3 - 6f*2. Does 13 divide c(q)? True Is 2 a factor of (-11)/(-33) + 3382/6? True Suppose -6m + 253 - 31 = 0. Is m a multiple of 13? False Let y = 348 - 61. Is 9 a factor of y? False Suppose -15a = -6a - 36. Is 8 a factor of (5 - (-5 + a)) + 3? False Let x = -20 + 22. Suppose -xa = 5p - 200, a = -0p - 5p + 110. Is 15 a factor of a? True Suppose 35i - 33i = 4. Suppose h = -ih - 4d + 170, 0 = 3h + 2d - 166. Is h a multiple of 9? True Let d be 4-175/(-60). Suppose 2x + s = 14, -ds - 2 = 2x - 0s. Does 2 divide x? False Let r = 210 - -1134. Does 27 divide r? False Let a(s) = s*3 - 4s*2 - 5s + 11. Let u be a(6). Suppose i = -2p + u, -i - 69 = -3p + i. Does 8 divide p? False Suppose -94 - 489 = -3u + 2a, 0 = 5u + 4a - 979. Is 5 a factor of u? True Let u(a) = 2a2 + 27a + 270. Is u(-18) a multiple of 18? True Suppose 4t = 150 + 106. Suppose 0 = 4d - t - 64. Is d a multiple of 12? False Let v be (0 - 158)/(-1) - 1. Let k be (-3)/(-2) - (-48)/(-32) - -5. Suppose kr - v + 32 = 0. Does 6 divide r? False Let c(x) = 143x*2 - 2x - 1. Let z be (-3)/(-9)-3 - 0. Does 16 divide c(z)? True Suppose -26 = o - 3o. Let y = 16 - o. Is 69 + (8 - -1)/y a multiple of 12? True Let z be 78/(-54)5 + 4/18. Let g(d) = 2d*2 + 14d + 21. Does 7 divide g(z)? True Let q(z) = -7z2 + 10 - 7z*2 + 2z + 7z + 15z*2. Is 20 a factor of q(-10)? True Suppose 3o + 7 - 16 = 5z, 4o = 3z + 12. Suppose 166 = -ok - 2. Let w = k + 150. Is w a multiple of 32? False Suppose 3c + 6 = 5d + 1, 3c - 3d = -3. Suppose 3g - 5x - 139 = c, 6g - g - 236 = 4x. Is 12 a factor of g? True Suppose -4s + 348 = 40. Suppose -52q - s = -53q. Does 14 divide q? False Let b = -187 - -274. Is 79 a factor of b? False Let u(h) = 4h - 10. Let m be u(6). Is 836/m - 24/(-84) a multiple of 12? True Suppose -4j - 476 = -2c, j + 2c = 2j + 116. Let m = 12 - j. Does 11 divide m? True Suppose -2q = -g + 6g + 22, -4q - 5g = 44. Let j be (q - 1)(-316)/16. Suppose -j = -3a - 39. Does 14 divide a? False Let z be 8(-1 - 9/(-6)). Suppose -zr - 12 = -0r. Is 17 a factor of (-76)/r - (-6)/9? False Let r = 879 + -519. Is r a multiple of 10? True Let s(m) = 2m - 3. Let b be s(3). Let h(f) = -f*3 + 4f*2 - f - 3. Let k be h(b). Suppose 0 = w - 5l - 4, -w - k*w	{ "pile_set_name": "DM Mathematics" }
+ 240885. Let f be b(0). Suppose k - f = 30877. Suppose -8j - k - 79438 = 0. Round j to the nearest ten thousand. -40000 Let k = 165 + -171. Let w(c) = -30648c*3 + 2c*2 + 7c + 2. Let o be w(k). Round o to the nearest one hundred thousand. 6600000 Let a(m) = 353803m - 3. Let r be a(1). Let h = r + 15200. What is h rounded to the nearest one hundred thousand? 400000 Let y = 143 + -259. Let o = 115.999302 + y. What is o rounded to five decimal places? -0.0007 Suppose 13u - 54600 = -u. Suppose 0 = 230f - 226f + u. What is f rounded to the nearest 100? -1000 Let o = -43035778.01302 - -43035206. Let r = o - -572. What is r rounded to 4 dps? -0.013 Suppose 38o = 63 + 13. Suppose 0 = 3h - 4m - 74009996, 2h - 6h + 98679998 = -om. Round h to the nearest 1000000. 25000000 Suppose 3c - t = 8, -1 = -c + 4t + 9. Let z = 1214 + -1211. Suppose -2r + 23258 - 855 = zn, 0 = -cr + 2n + 22398. Round r to the nearest one thousand. 11000 Let m = 904863718 + -904864192.000033. Let r = m - -474. What is r rounded to 6 dps? -0.000033 Let u = -133986 - -133985.42447. What is u rounded to three decimal places? -0.576 Let q = -0.869 + 6.408. What is q rounded to the nearest integer? 6 Suppose -2o - 5z + 557890 = 0, 4o + z + 240212 = 1355938. Round o to the nearest one thousand. 279000 Let t = -15 - -112. Let a = 241.9431982 + -338.943194. Let q = t + a. Round q to 6 dps. 0.000004 Suppose 4 = -2l, 23d - 21d - 4l + 21978 = 0. What is d rounded to the nearest 100? -11000 Let r = 5511 + -5510.449. What is r rounded to 1 decimal place? 0.6 Let h = -37.04 - -0.04. Let t = 66 + h. Let z = t - 28.825. Round z to 2 decimal places. 0.18 Let l = -20277 - -20277.0000030318. Round l to 7 dps. 0.000003 Let r be 2/1 + (-4 - 0) + 5. Suppose -2 = -u - a, -3u + 2 = ra - 4a. Let p be -7499 + 1 + (-8 + u - -5). Round p to the nearest one thousand. -8000 Let n be (401736/266)/((-4)/70). Let m be (75/(-9))/((-20)/n)80. What is m rounded to the nearest one hundred thousand? -900000 Let d = -1619 + 1610.6. Let t = 61 + -35. Let g = t + d. Round g to the nearest integer. 18 Let z = -42709.00072102 - -42709. Round z to 4 decimal places. -0.0007 Let x = -8321.2 - -6274. Round x to the nearest 100. -2000 Let h = -0.026 - -0.0592. Let l = h + -0.033199174. What is l rounded to seven decimal places? 0.0000008 Let r = -378.408 - -0.408. Let d = 377.999998932 + r. What is d rounded to seven dps? -0.0000011 Suppose 3u + 2y - 503 = 0, 0 + 2 = 2y. Suppose -uv + 266700000 = -160v. What is v rounded to the nearest 1000000? 38000000 Let k = 6.117 - 56.343. Round k to 0 dps. -50 Let h = -48 + 172. Let p = -136.5 + h. Let u = -12.4928 - p. What is u rounded to three dps? 0.007 Let g be 139946412/22 - ((-920)/(-6325) - 2/(-5)). What is g rounded to the nearest one hundred thousand? 6400000 Let k = 149.5 - 158. Let y = -8.5468 - k. Round y to 3 dps. -0.047 Let b be (58282 - -3)(-12 + 16). What is b rounded to the nearest 10000? 230000 Let x = 17.3126 + -17.3. Let c = x + -0.01261385. What is c rounded to six decimal places? -0.000014 Let t = 51.33 - -2082.67. Let b = -2248.7 + t. Let y = b + 106. Round y to the nearest integer. -9 Let w = 16.332 - 3806.832. Round w to the nearest ten. -3790 Suppose 0 = 75n + 41n + 11047072738 - 3241432738. Round n to the nearest 1000000. -67000000 Let u = -172 - -173.44. Let l = u + -1.439999713. What is l rounded to seven decimal places? 0.0000003 Let p = 0.2272 + 0.8818. Let c = p + 0.181. What is c rounded to one dp? 1.3 Let w(a) = 18781a - 43. Let t be w(14). Let r = t - 121691. Round r to the nearest 10000. 140000 Suppose f - 260 = 2615. Suppose 5a - 680 = -f. Let t be a - (6/(-3) + 4). What is t rounded to the nearest one hundred? -400 Suppose 16l + 375 = l. Let g = 33 + l. Suppose 86000 = 6a - ga. Round a to the nearest 10000. -40000 Suppose 5s - 4l = 7087488 + 319053, 5s + 3l - 7406548 = 0. Suppose 35t - 3716191 = s. What is t rounded to the nearest ten thousand? 150000 Let l = 18 - 18.148. Let j = 30979348 + -30979347.85199813. Let t = j + l. Round t to 7 decimal places. 0.0000019 Let x = 51 - 51.28. Let p = x - -0.27912. Round p to 4 dps. -0.0009 Let p be -2(4032743 - -3) + (-19 - -11). What is p rounded to the nearest one million? -8000000 Let z = 2110.06 - 2375. Let l = z - -275. What is l rounded to 0 dps? 10 Let l = -0.0531 + 22.0531. Let c = 137844470.9999998 + -137844449. Let m = l - c. What is m rounded to seven decimal places? 0.0000002 Let w = -8.539 - -6.9928. What is w rounded to one decimal place? -1.5 Let m = -135.0799 - -135. Let t = m + -0.0721. Round t to the nearest integer. 0 Let p = 2737 - -7221. Let s = -9957.93969 + p. Let x = s + -0.0574. What is x rounded to 4 dps? 0.0029 Let v = -362 - -432. Let t be 675993 + (-10)/(v/(-49)). What is t rounded to the nearest 10000? 680000 Let s = 2625 - 2650.909. What is s rounded to the nearest integer? -26 Let t = -16188.93782 - -16188. Round t to one dp. -0.9 Suppose -4t = -3c - 9168014, 5c + 15280029 = 4t - 3t. Let z be c/(-16) - (-51)/(-136). What is z rounded to the nearest 100000? 200000 Let u = 93.6903751 + -93.69. Round u to 5 dps. 0.00038 Let g = -77634 - -77634.0227138. What is g rounded to 4 dps? 0.0227 Let s = -2348 - -2348.0000023261. What is s rounded to 7 dps? 0.0000023 Suppose -4k + 13439 = -0b - b, 2k = -3b + 6709. Suppose -7f + k = -3655. Suppose r = -4n + 11285, n - 4r = f + 1798. Round n to the nearest 100. 2800 Let w = -1119.24 - -1050. What is w rounded to zero dps? -69 Let i(p) = 126p + 45. Suppose 16v = 140 - 12. Let u be i(v). Round u to the nearest one hundred. 1100 Let w = -100890 + 100759.114. Let i = -129 - w. What is i rounded to one decimal place? 1.9 Let j = 2979.85 + -2986. Round j to the nearest integer. -6 Let z = -1.241 + 827.241. Let f = z + -819.82. Round f to 0 dps. 6 Let w(n) be the third derivative of -105650n6/3 + n5/20 - n4/8 - n3 - 81n*2. Let s be w(-1). What is s rounded to the nearest 1000000? 4000000 Let p be (5/(-30)-10 + -1)21. Suppose 5868 = pz - 18z. Round z to the nearest 100. -1500 Let c(t) be the second derivative of -44661t*3/2 - 19t*2/2 - 10t. Let a be c(4). Let h = a + 1775951. Round h to the nearest 100000. 1200000 Let x = 23314065345.0000763 + -23314067197. Let p = 1852 + x. What is p rounded to 6 decimal places? 0.000076 Suppose m = -2t - 4, -2t = 3t - 3m + 10. Let b be (3 - -537498 - (1 + 1)) + t. Let y be (-2 + -6)(b + 3). Round y to the nearest one million. -4000000 Let z = 224.667 + -19.407. Round z to the nearest 100. 200 Let l = -11.375099 - 0.245801. Let i = l - -11.5. What is i rounded to 2 decimal places? -0.12 Suppose -4167072 = 37v + 26v. Let j = v - -116834. Round j to the nearest 10000. 50000 Let v = -74.301769 + 74.3. What is v rounded to 4 decimal places? -0.0018 Let m = -34623850 - -49603850. Round m to the nearest 100000. 15000000 Let q = 610593 + -922713. What is q rounded to the nearest one hundred thousand? -300000 Let q = -290.1 + 290.0996453. What is q rounded to 3 decimal places? 0 Let k = 333.25 - 418.9. Let a = k - -91.547. Let h = a - -0.343. Round h to the nearest integer. 6 Let v = -969 - 25. Round v to the nearest 10. -990 Let n = -6.7 + 6.519. Let y = -54.419 + n. Round y to the nearest ten. -50 Let p = -120848 + 20888. Let q = p + 224360. Round q to the nearest 1000. 124000 Let t = 31 - 31. Suppose -5s + 2297 = -d - 37304, -d - 1 = t. Round s to the nearest one hundred. 7900 Let p = 36 - 22. Suppose 0 = py - 8y. Suppose 4q = 4r - r - 327994, y = -5q - 3r - 410006. Round q to the nearest ten thousand. -80000 Let w = -18793.2757 + 18791. What is w rounded to one dp? -2.3 Let n(j) = 2j2 + 2j - 2. Let v be n(3). Let p = 3161172 + 338828. Suppose p = -17m + vm. What is m rounded to the nearest 100000? 700000 Let k = -36627.025729 + 36627. What is k rounded to four dps? -0.0257 Let k(b) = 4868b + 88. Let h = 220 + -236. Let f be k(h). Round f to the nearest ten thousand. -80000 Let n be (-2 + 0)/(14/(-273)). Suppose -1677 = 11d - 11907. Let h be -2 - d/n - (-10)/(-65). Round h to the nearest integer. -26 Let q = 0.228686 + 4.248934. Let u = q + -0.04062. What is u rounded to one dp? 4.4 Let r = 36344357 - 36344707.99	{ "pile_set_name": "DM Mathematics" }
be h(o). Let r be (a/6)/((-7)/21). Solve -g - 2g - 6 = -rp, 2g - 3p = -4 for g. -2 Let f = 7 + -5. Suppose fr = 3 + 5. Solve 0 = -rs - 4y + y, s = -5y - 17 for s. 3 Suppose -2 + 0 = -2k. Let b(r) = 4 - 5 - k + 0 - r. Let u be b(-4). Solve -4s = 3i + 4 + 4, 5s + 10 = -ui for i. 0 Suppose 6 = 7m - 5m. Solve 2 = 2a + 4q, 5q - m = -a - 2 for a. 1 Suppose -3j + 2 = -x - 0, 5x + 10 = -4j. Solve -2n - 4z - 26 = 0, jn + 4z = n - 11 for n. -5 Let r(t) = -t2 - 15t + 2. Let b be r(-15). Solve bg + 5 = 3x, 0 = -4x + 3g - 3 + 8 for x. 5 Suppose 4z = -z + 15. Let m = 7 - z. Solve -2t - t + 6 = -3r, 3t = 5r + m for t. 3 Suppose 0z - 2z = 2t + 6, -13 = 3t + z. Let c be 2/t + 82/5. Solve 2f + 3d + 8 = -0d, 2d + c = 4f for f. 2 Suppose 0 = -5c + 10c - 35. Suppose 5j - cj = -26. Solve 2d - 5w + j = 0, d + 1 = -3w - 0 for d. -4 Let l be (-1)/(((-7)/(-6))/7). Let k be (24/(-18))/(4/l). Solve 0 = 5t - 15, -3j - kt = t - 12 for j. 1 Let q = 42 - 24. Suppose q = 5r - 2. Suppose 0 = 4b + a - 5a - r, -3a = -6. Solve bs - 2 = z, 3s + z + 4 = -z for s. 0 Suppose -71 + 27 = -4x. Let l = 19 - x. Solve 2y = 3q + 10, 12 = -5q - l for y. -1 Let d = -16 - -19. Solve -2h + da + 3 = -7, 5h + 3a = 4 for h. 2 Let q = 5 - 2. Let f be 0 - (-4)/q3. Solve 5l = -4d - 19 - 2, 0 = -3d + fl + 23 for d. 1 Let d(m) = 3m + 1 - 6m - 5 + m. Let n(x) = -x2 + x - 4. Let o be n(0). Let a be d(o). Solve 4q + g + 15 = ag, -q - 5 = -g for q. 0 Suppose -4x + 4d + 192 = -260, 4x - 2d = 446. Let l = x - 75. Solve 5g - 5k = l, 1 = -g - 4k - 7 for g. 4 Suppose 7l + 2 = 23. Solve 0c - 3 = g + c, -lc - 10 = 2g for g. 1 Let r be (24/9)/(6/9). Solve -3 = -3a - 0a + 3s, s = -ra + 14 for a. 3 Suppose i - 5y - 4 = 0, 3y + 14 + 2 = 4i. Solve 0 = -2p + 6p + 3b - 3, 2p + ib - 4 = 0 for p. 0 Suppose q - 5q = -0q. Solve 5l - h = -ql + 11, -11 = -4l + 3h for l. 2 Let r be -220/24-3. Suppose ro - 24 + 19 = 0. Solve -b - o = l + 2, 2 = 4b - 3l for b. -1 Let m(k) = k2 - k + 5. Let d be m(0). Suppose 4p = 3y + 99, -dy - 36 = -5p + 94. Solve -3o + p = 3u, 3o - 5u + 2 - 7 = 0 for o. 5 Suppose -9d + 36 = -9. Solve -v + 9 = v - f, df + 10 = 3v for v. 5 Suppose t = 2g - t - 10, 0 = -g + 3t + 3. Let a = 7 - g. Solve -4y - 12 = 0, -4l - 4y + a = -3 for l. 4 Let s(p) = -p3 - 5p*2 - p - 1. Let o be s(-5). Let z be (-3)/(12/(-248)) + 2. Suppose -3f + z = o. Solve 2i - 3n = 0, -5i + f = 4n - 3 for i. 3 Let k = -30 + 40. Solve 2n - k = 4x + 16, -2 = -4n - 2x for n. 3 Let c be (0 + 0)/(0 + 1). Let o(t) = -t - 1. Let q be o(-7). Suppose -2a + q = -c. Solve 5g + 3y = 5y + 24, -ay = -3g + 18 for g. 4 Let t(q) = q + 3. Let k be t(0). Let z = 1 + k. Let w(u) = -2u3 + 1. Let h be w(-1). Solve -zp + y = -8, hp - y = 1 + 5 for p. 2 Let o be 2(-2)/(-8)6. Let z be 5 - (0 + 1) - -1. Solve oh + 2k = -2k - 28, zh = 5k for h. -4 Let k be (-20 - -19)2/6-9. Let s(v) = 5v - 1. Let c be s(1). Suppose f - 2x = -3x, 5x = -f. Solve f = -6p + kp - ci, -19 = -p + 5i for p. 4 Suppose 22 = 2n + 4y, 0 = n + n - 4y - 30. Suppose -5k - 5s + 11 + 24 = 0, -3s + n = k. Solve -4m - m - 2 = -o, 8 = 4m - ko for m. -1 Let z = 52 + -29. Solve 0 = -x + 3f - 1, -z = -5x - 5f - 8 for x. 2 Suppose -1 = 4x - m - 21, -5m - 20 = 0. Let u be 9 + x/(-2) - 2. Solve 0 = -uq - 3h + 19, 2q - 5q + 21 = -3h for q. 5 Let j be (-7 - -5) + (-6)/(-2). Let y be 7 - (2 - j - -2). Solve 2a = -3n + 10, a = ya - 3n - 15 for a. 5 Let w(k) = 1 - k2 + 0 + 0k*2. Let d be w(0). Solve 3y = l - 4, -4l + 2 = y - d for l. 1 Suppose 4l = 4 + 12. Suppose -3v - 6 + 3 = 0. Let x be (-2 + -1 + -2)v. Solve xh - 4o + 25 = -9o, lo = -4 for h. -4 Let s(y) = 2y + 1. Let k be s(1). Suppose -2m + 40 = km. Solve -3c = 3t + 15, -2c = -4t - 4 + m for c. -4 Let r = 9 - 12. Let g(w) = -3w*2 - 3w. Let v be g(r). Let k = -13 - v. Solve 4z + 5h - 1 = 0, -z + kh + 0 = 6 for z. -1 Suppose 0z = -4z + 12. Let x(d) = 2 + d2 + 0d*2 + 3d - 2d2. Let o be x(z). Solve -w = -r - 1, 0 = w + ow for r. -1 Suppose -4 = -5n + 6. Suppose 0m = m + b + 1, 2b = 2m - 10. Solve 4q - m - 14 = nz, 20 = -2z + 5q for z. 0 Let z(k) be the third derivative of k6/120 + k5/20 - k4/24 + k3/6 - 4k2. Let a be z(-3). Solve -p = 2j - 14, -2j - 4 = -6j + ap for j. 5 Suppose -4z = m + 9, -3m + 4z + 1 = 12. Let h be -1(m - (-3 - -1)). Solve d = o - 0o - 4, -ho - 12 = 5d for o. 1 Let r be (-3)/(-2 + (-11)/(-7)). Let p be 33/(-7) - 4/14. Let b = p + r. Solve 4t + o - b = 4o, -o + 12 = 5t for t. 2 Suppose -11 = 5y + 14. Let w(x) = -x*3 - 5x*2 + 2. Let p be w(y). Solve 0 = -3s - d + pd + 16, 2d = -s + 3 for s. 5 Suppose -5n + 6n = 5a + 34, 20 = -5a. Solve q = 4v - n, 2q - 2v = 3q - 4 for q. -2 Suppose -4o + 7o = 9. Suppose -ob = -4 - 5. Solve -bt - 2w = -0t + 9, 5t = 3w - 34 for t. -5 Let t = -9 - -9. Suppose -18 = -5q - 2g, t = 4g - g - 12. Solve 2v = q, -j - 11 = -5j + v for j. 3 Suppose -r = -3 - 22. Solve -6m + d = -m + r, d = -5m - 15 for m. -4 Let v(b) = 9b - 2b2 + b + 0 - 6. Let a be v(6). Let p = a - -26. Solve 3i - y - y + 4 = 0, -2y = p for i. -4 Let z be (16/(-14))/((-2)/7). Let m = -12 + 17. Solve v + z + 14 = -4o, -mo - 27 = -v for o. -5 Suppose -9v = -4v - 80. Let q = v - -2. Solve -q = 5a - 3d + 2d, 4d - 12 = 0 for a. -3 Let c(l) = 2l - 5. Suppose -2h = 4u - 22, -29 = 3u - 8u - 4h. Let o be c(u). Suppose f - of = -8. Solve fa + 4g = 2, 2g - 3g - 2 = -2a for a. 1 Let v(p) = -2p - 6. Let y be (5 + -2 + 2)/(-1). Let z be v(y). Solve 4s = 3m - 18, 5s + 25 = 3m + z for m. 2 Suppose -6p + k = -2p - 14, k - 6 = -p. Solve j - 3q = -5q + 6, pj - 15 = -5q for j. 0 Let m be (-245)/(-20) + (-1)/4. Suppose -5j = -37 + m. Solve -jf + 21 = w, 4f - 2w = -w + 15 for f. 4 Suppose 4x = 5b + 6, -2b + 14 = -5b + 5x. Let s be (-10)/(-3)(b + 4). Solve 4q + 0j = -j + s, -4j = 0 for q. 5 Let l(r) = -r2 + 6r + 1. Let q be l(6). Let g = 3 - q. Solve 0 = 2y - ga - 0 + 2, -y = 4a - 24 for y. 4 Suppose -u - 16 = -0s + 4s, -2s = 4u + 8. Suppose -6 = -2x - ux. Solve r + xg = -2r - 6, 2r = -3g - 5 for r. -1 Let h be -1 - (-9 + 3 + 0). Solve 4r = 3t - 5t + 8, 0 = -hr - 4t + 4 for r. 4 Suppose 0 = -2r - 3r + 175. Suppose -3w - w + 2j = -4, -10 = 3w + 5j. Solve -4l = -4d, -2d = -wd + 5l + r for d. -5 Suppose y + 4i = -y + 26, 5i - 16 = 3y. Solve -14 = -4c + yw, -c - w + 10 = -5w for c. 2 Let h = -3 + 6. Suppose h + 1 = f. Suppose fb + b = 20. Solve -3w + bk - 21 = 0, 0 = 5w - 0k - 2k + 21 for w. -3 Let m(q) = -q3 - 3q*2 + 5. Let l be m(-3). Solve -lw = -n - 26, -5n - w = -4w + 20 for n. -1 Suppose 0 = 2l - 4n - 8, l + 16 = 5l - 5n. Solve 3h = -3g + 9, -g - 6 + 24 = lh for g. -2 Suppose -7t = -3t - 4s, 2s - 8 = -2t. Solve 4a + 25 = 5o, -to + 2a + 12 = -0o for o. 1 Let k(g) = 4 - 4 + 0 - g - 2. Let q be k(-3). Let o be q/2(-6 - -16). Solve 3h + 1 + 3 = -x, 16 = -oh + 3x for h. -2 Let g = 2 + -1. Suppose -4l = -7 - 9. Solve -g = 2y + i - 6, -5 = -ly - 3i for y. 5 Suppose 7 = 4n - 5q - 21, 0 = 3n - 4q - 20. Solve -4z - 4h = n, 2z - h - 2h = -11 for z. -4 Suppose 2l + 5a = 25, -a - 20 = -5a. Solve 13 = -5k - d + 4d, 5k + 4d + 41 = l for k. -5 Let h be 32/(-4)1/(-2). Solve -4b + l + 18 = 0, hb - 3l = 2l + 10 for b. 5 Suppose 9w = 5w + 8. Let x be (-4)/39/(-6). Solve 0 = l + xs - 3, -5l - 5s - 13 = -ws for l. -5 Let f be 1-19/3. Let t be f - (-1 - (-2)/(-1)). Solve -k = -0g + g + 8, -3k - 15 = t for g. -3 Suppose 5h = -4o + 6o + 4, 3o - 5h = 4. Let n be 18/4 - (-4)/o. Solve -4r + 0c - nc = 16, -3c - 17 = -5r for r. 1 Let r(g) = 3g - 5. Let h be r(3). Solve 0 = -5k - 5q + 10, hq + 15 + 4 = 5k for k. 3 Let w be (-3)/652-1. Let k be 386/w + (-6)/(-39). Solve 2h + 2d + 2d - 10 = 0, k = 2h + 5d for h. -5 Let i(g) = 2g2 + g. Let c be i(-3). Suppose -c = -5f + 2f. Let k be (-2 + f)1 - 1. Solve -4m + 3t + 5 = 0, t + k = 3 for m. 2 Let i = 9 - 5. Suppose 4j - 11 - 12 = -5h, j = h - 1. Suppose h*g + 21 = 72. Solve -d	{ "pile_set_name": "DM Mathematics" }
n the form pa + w and give p. 58 Rearrange -7 + 0 + q2 + 10 to x + mq + iq2 and give x. 3 Express 2 - 2j - 29j3 + 31j*3 + 3j - 3 as mj3 + vj*2 + r + aj and give m. 2 Express 2p2 + 14p*3 - 1 - 11p*3 - 2p*2 - 15p in the form np + y + rp*3 + bp*2 and give r. 3 Express 5s*2 - 2s*4 + 11s*2 - 3 - 15s*2 + 2s*3 in the form o + ds*2 + ms + us4 + ls*3 and give u. -2 Express 200h + 0h2 - 200h + 3h2 + 6 in the form ch + xh2 + p and give p. 6 Express 6c*2 + 6c*3 - 6c*2 + (-3c - 9 + 9)(c2 + 2 - 2) as yc*3 + jc + wc2 + k and give y. 3 Express (2i - 3i + 2i)(3i*3 + 2i*3 + 0i*3) - 5i2 - i2 + i*4 + 4i*2 as ci*3 + ti + j + ni4 + bi*2 and give b. -2 Rearrange -9m + 7m + 1 + m + 2 to the form f + nm and give f. 3 Rearrange (-3 + 8j2 + 3)(0j - 2j + 4j) to k + lj + xj2 + yj*3 and give y. 16 Rearrange (-2i*3 + 2i*3 - 2i*2 - 2i*3)(-8 + 19 + 24) + 3i3 - 4i*3 + 2i*3 to the form qi*3 + mi*2 + r + ci and give q. -69 Rearrange (2n2 + n2 - n2)(n*2 + 0n2 + n2) + (15 + 5 - 1)(2 + 2n*4 - 2) to the form kn*4 + xn*3 + sn + a + ln2 and give k. 42 Rearrange (0r - 5r + 3r)(4r - r + 5r) + 4r*2 - 2r*2 - 3r*2 to the form i + jr*2 + gr and give j. -17 Rearrange 362 + 109o - 362 + 2o to the form p + vo and give p. 0 Express (-12s + 6s - 9s)(3 - 3 + 5s) in the form w + rs + ns*2 and give n. -75 Express 21j - 79 + 79 as zj + q and give z. 21 Express (5 - 5 + 6l)(-2l + 3 + 0l + 0) in the form il*2 + g + nl and give i. -12 Express 38i + 92 - 48 - 44 - i3 in the form di*3 + s + ci*2 + hi and give d. -1 Rearrange (-9m + 11m + 21m)(-6m2 + m2 + 3m*2 - 2m*3) to the form pm*3 + fm*4 + s + om*2 + hm and give h. 0 Rearrange -b + 0b2 - b2 - 3b*2 + 6 - 13 to fb*2 + sb + i and give f. -4 Express (0 + 2 - 6)(0 + 2 - 1)(2 + 0 + 1)(-3 + y + 3) as zy + n and give z. -12 Express -3v3 - 2v - 10v3 + 4v - v*3 as ov + iv2 + f + bv*3 and give b. -14 Express (166 - 4v - 166 + 167v)(-v*2 - 4 + 4) in the form w + mv*2 + iv*3 + jv and give i. -163 Rearrange (-g + 0 + 0)(-46 + 46 - 43g + (g + 0g - 3g)(2 - 3 + 2)) to the form ug*2 + ag + j and give u. 45 Rearrange (-1 + 6v - 3v - 5v)(-2v - 3v + 4v) to the form wv*2 + qv + l and give q. 1 Rearrange (-2k2 - 2k*2 + 0k*2)((-2 + 3 + 1)(-2k + 0k + 0k) + 2 - 2 + k) to wk + q + vk*3 + rk*2 and give v. 12 Express -b + 2b - 5b + 0b in the form p + jb and give p. 0 Express -1 + 17n*2 - 9n*2 - 2n*2 in the form dn + v + hn2 and give v. -1 Express (-1 + 3 - 4)(6 - 6 + 2f) in the form nf + q and give q. 0 Express (0 - 2 + 0 + (1 - 1 - 1)(-2 + 0 + 0) + (1 - 5 + 0)(-4 + 2 + 3))(-3v - v - v) as dv + k and give d. 20 Rearrange -13p + 7p + 14p + (2 + 1 - 2)(-2 + 2 - p) to the form yp + s and give y. 7 Express -61 - 18p + 61 + (-p + 0p - p)(-1 + 0 - 1) as l + ap and give a. -14 Rearrange -5s3 + 2s*3 + 2s*4 - 2s - 6s4 + 2s*4 to the form cs + rs2 + ks*3 + is*4 + p and give i. -2 Express 2f2 - f2 + 2f2 + 3f*2 in the form yf + o + sf2 and give y. 0 Express -9m + 49 - 18 + 8m as wm + g and give w. -1 Express (16 - 25 + 12)(-1 + 1 - d) + (0 + 0 - 2)(2d + 2d - 2d) in the form j + rd and give r. -7 Express 5k3 + k4 + k - 5k + 5k + 2k*2 as c + qk*3 + gk + jk4 + uk*2 and give q. 5 Express -41z*3 + 3z*4 + 81z*3 - 33z*3 + 1 as uz*4 + lz + x + cz2 + bz3 and give b. 7 Rearrange 0 - n2 + 3n3 - 2n*3 - 3 - 1 to the form ln*2 + d + fn + cn3 and give l. -1 Express (-2 + 4 - 3)(0p - 2p + p) + 952 + 15p - 952 - 2p + 0p + 4p in the form mp + a and give m. 18 Rearrange 10g*2 - 2g*2 + 4g*2 to the form n + wg*2 + vg and give n. 0 Rearrange 0f2 + 2f + 3f2 - 21f*3 + 19f*3 to lf + of3 + wf*2 + a and give o. -2 Express (-4n + 3n + 3n)(-7 + 20 - 15) + n - n - 2n + n - 6n + 3n + (6 - 2 - 3)(-4n - 2n + 5n) as cn + w and give c. -9 Rearrange (-2k + 1 - 1)(-2k + k*2 + 2k) - 6k3 - k3 + 5k*3 + 2 + 2k*3 - 2 - 30k + 37k - k3 - 4k*3 to vk*2 + rk*3 + x + gk and give g. 7 Express (-1 + 1 - 3)(0 + 5 - 2)(4s + 7s - 3s) in the form bs + d and give b. -72 Rearrange 9s + s - 30s - 20s to the form m + js and give j. -40 Express 34 - 34 - 44o in the form qo + u and give q. -44 Express (-7q + 5q*4 + 7q)(4 - 3 - 2) in the form gq*2 + dq + bq4 + xq3 + l and give b. -5 Express -118 - r2 + 88 - r - r in the form ir2 + pr + h and give i. -1 Rearrange -c + 3c + 10c*3 + 11 - 12c*3 to ac*2 + f + nc + wc3 and give n. 2 Express 8 + 4m - 3m + m in the form p + sm and give p. 8 Express -5r4 - 163r*3 + 2 + 8r*4 - 2r*2 + 160r*3 as i + hr + fr4 + pr*2 + dr*3 and give f. 3 Rearrange 33u + 614 - 614 to b + qu and give q. 33 Express 20 + 18v + v*2 - 9 - 13 + (3v + 1 - 1)(-2v + 0v + 3v) as hv + g + wv*2 and give h. 18 Rearrange (3l + 2l - 4l)(1 - 5 + 1) - 4l - l + 9l to the form t + gl and give g. 1 Rearrange 1962 - 32i - 1962 to the form p + oi and give o. -32 Rearrange (-3q3 + q3 - 5q + 3q)(q - 2q + 2q) - 9q4 - 3q*4 - 2q*4 to the form oq*2 + a + uq + fq4 + iq*3 and give o. -2 Rearrange 2 + 8n*3 + 3n - 3n + 113n*2 - 115n*2 to the form y + jn + zn2 + bn*3 and give y. 2 Express (2 - 1 - 3)(-3u - 2 - 8u + 5u) + 2u + 3 - 3 + (-3 + 1 + 3)(1 - 1 + u) + 2u - 2u + 2u as f + ru and give f. 4 Express -16b*2 - 3b + 18b2 + 5b - 3b + 6 + 2b*3 in the form t + qb*3 + yb + wb2 and give w. 2 Rearrange (-68 + 68 - 5l*2)(3l2 + 0l*2 - 2l*2) + (0l*2 - 3l*2 + 2l*2)(4l - 4l - 2l2) to wl*3 + dl*4 + jl*2 + xl + t and give d. -3 Rearrange 3u4 - u4 + 7u + 2 - 2 + 2u2 to the form l + zu + gu4 + tu*2 + ju*3 and give g. 2 Rearrange (-7 + 10d + 7)(-1 - 5 + 5) to rd + n and give r. -10 Rearrange (w*2 + 2w*2 - 4w*2)(-4 + 2 - 4) + w - 7w + w2 - 3w to sw + hw2 + y and give h. 7 Rearrange q3 - 11q3 - 1 + 8q3 + q4 to w + cq + uq*3 + nq*4 + bq*2 and give w. -1 Rearrange (5 - 4 + 0)(-5k + 3 - 3)(1 - 6 + 3) to c + ak and give c. 0 Rearrange -3p3 - 1 + 3 + p2 + 6p3 + p2 + p4 to qp*4 + a + xp*2 + kp*3 + hp and give k. 3 Express (-3d - 6d - 13d)(-d*2 + 5d*2 - 5d2) - d3 + 3d2 - 3d*2 in the form b + pd*3 + td + fd2 and give p. 21 Rearrange 25y - 14y + 17y to p + uy and give u. 28 Express 2 - 4 + 2j*2 - 1 + 0 as b + sj + gj2 and give g. 2 Rearrange -2 + 2 + 0x3 + x3 - 3 + 8x to the form kx*2 + px + b + ox3 and give b. -3 Express -78r3 + r4 + 3r4 + 3r - 2 + 79r3 - 5r as mr4 + kr*3 + a + hr*2 + ir and give i. -2 Express -6q2 - q2 + q - 10q*2 + 15q*2 in the form l + wq*2 + cq and give l. 0 Express -223f - 22f*2 + 223f in the form jf + n + xf*2 and give x. -22 Express b - 7 - 1 - 5 - 11 in the form xb + y and give x. 1 Express -8h + 42h + 26h as a + nh and give n. 60 Express (1 + 8 - 2)(3 - 3 - y3) in the form w + ly*3 + vy + zy2 and give l. -7 Rearrange -20q*2 + 15q - 15q to the form t + lq + jq2 and give j. -20 Rearrange (h - 4h + 2h)(4h - 46h + 2h2 - 88h) to uh2 + sh*3 + n + jh and give u. 130 Express -8n + 0n + 3n + n2 + 2n*2 as fn + sn2 + z and give f. -5 Rearrange -10 + 16 + 7q*2 - 2q - 6 to the form dq + uq*2 + k and give u. 7 Express (g + 111 - 111)(g - 4 + 4) in the form mg + yg*2 + l and give y. 1 Express (-3r*2 - 3r*2 + 4r*2)(-23r + 4r - 3r) + (4r*2 - 3r2 + r2)(0 + 0 - 2r) in the form qr2 + fr + kr3 + v and give k. 40 Express (-3g - 2g + 4g + 2)(-11 + 12 + 1) in the form r + mg and give r. 4 Express (0 + 3 + 0)(6t - 3t - t) - 3t + t + 0t - 2 as c + at and give a. 4 Express -3 + 32s + 3 in the form ws + l and give w. 32 Express (u*2 + 28 - 34 - 8u*2)(2 + 1 - 4) as o + yu + vu*2 and give o. 6 Express 3 - 3 - 99i*2 + 88i*2 in the form ri*2 + pi + f and give r.	{ "pile_set_name": "DM Mathematics" }
) assuming d is positive. d*(-1849/234) Simplify (f/(ff/f*(-17/2))f/(f/(f/(f*(1/34)/f)))f*15ff(-29))(-3/17) assuming f is positive. f(1047/289) Simplify (((w/(w/((w((w*0wwww)/w)/w)/w)))/w)(-7/5))12((w/(w/(ww0)))(2/19))(-26/9) assuming w is positive. w(-14624/855) Simplify ((n(-1/7)/(n/(nnn(-3/2)/n)))/(n/(((nn(-13))/n)/n))(-9))(2/47) assuming n is positive. n(1867/329) Simplify (((p*(-3)/(pp/(p/(pp(6/7)))p))/((p*(2/5)/pp)/pppp/(((p3/ppp)/p)/pp)))(2/89))(-4/7) assuming p is positive. p(1752/21805) Simplify (o1)*(-4/13)(o(o6o)/o)/(o(oo/(o*(-3)o))/o)(o(-2/7)(((o*(1/2)o)/oo)/o)/o)/(o/o(3/4)oo/o0) assuming o is positive. o(-125/364) Simplify (w/(www(-9/8))w)*(2/29)/((ww/(w/(ww21)))/(ww*(-47)/ww)) assuming w is positive. w*(-7995/116) Simplify ((((nn(-2/9))/n)/n)47(nn/(nn7n)nn)(-18))(-22) assuming n is positive. n(-6446/9) Simplify (k/k(1/3))*(-10)(k*(-1/2)k)/(k*(-3/7)/k)k/k*(-1)k*4(k/k*(-1/5))/(kk7) assuming k is positive. k(-1163/210) Simplify (q*(2/3)(qqq5)/q)(-34)/(q*(2/7)/((qq*(-2)q)/q))(-7) assuming q is positive. q(-653/3) Simplify (b*2/(bb/((bb(-1/17)/b)/b))(b*0b)42)(16/5) assuming b is positive. b(11136/85) Simplify ((y(-2)y)/y)/(y/y(-2/3))(yy(-1)yy)(5/3)y*(1/2)/yy*(1/4)/y(y/y1)(-22/3) assuming y is positive. y(-19/12) Simplify ((c/c(5/3))/(ccc/(cc4cc)c)c/(c/(c/(c/(c(-2/11)/c))))ccc(-1/8))/((c(-2/7)ccc(-2/5))/(c(-1)/c(-1))) assuming c is positive. c(15821/9240) Simplify (g/(g/g8)gg(-5))(-32)/(g(-6)g*(-1/4)(g/(g/(g/(gg(2/5))))g)(-10/9)) assuming g is positive. g(-1453/12) Simplify (((q*1q*(-2))/((q/(qq(qq*(-5)q)/q)q)/(q/((qq/((qq(-1)q)/q))/q))))(4/15))(-2/23) assuming q is positive. q(8/69) Simplify (((m/m2)/m1)/(m5/mm(-1/10)m))/((m(2/5))43/(m*(-3/7)m*(-6)m)) assuming m is positive. m(-2067/70) Simplify ((x(1/2)/x)/(xx(-9)))(-36)/((x(2/3)/x)(-45)xx/(x(-2)/xxx)xxxx(-7)) assuming x is positive. x(-284) Simplify ((k19k*15/k)/(kk*7k)(5/3))(2/173) assuming k is positive. k(36/173) Simplify (i(1/19)iii/(((i(-3/4)/i)/i)/ii))*(-8)(i(-2/7)/i)(-20)/(iii*(-1)i)(14/9) assuming i is positive. i(-28510/1197) Simplify (mm/(m/(mm*(-1/40)mm))(mm/m(-21))/m(m/(mm(23/5)))(-5))(-31) assuming m is positive. m(-60729/40) Simplify ((h/(hhh/(h((h/(h*0/h)h)/h)/h)))(-11/4))48/((h*(1/2)h)/(h(h/(hh(1/2)))/h))(4/15) assuming h is positive. h(-8/15) Simplify ((b22/b*(-20))/((((((bb/(b*(-3/13)b))/b)/bb)/b)/b)/(b36/b)))(1/4) assuming b is positive. b(256/13) Simplify (t0)(2/47)/(tt/(t/((t(t(-2/7)tt)/t)/t))t*4)(t(tt(1/3))/t)(-4/3)(t/(ttt/(t/t0)))27 assuming t is positive. t(-2173/63) Simplify w(-1)w*(-6/11)w(ww/(((w*(5/2)w)/ww)/w))/(w(3/4)/w)(w/(ww/(ww*3))w/(w(-8)/w))(-2/3) assuming w is positive. w*(-1249/132) Simplify ((o/((oo/o*44o)/o))*(-1/27)o*38o(-1/10))36 assuming o is positive. o*(19606/15) Simplify (zz(-6))/(z/((z(-1)z)/zz))z/(z(-3/7)/z)z/((zz/((z(3/4)zz)/z))/z)(z/z(-1))(-3/4)(z1)(-28) assuming z is positive. z(-877/28) Simplify (y(-5/2)y*0y(-1/3)/y(-1/10))/(y*0yy(-4)((y/(y/(y*(-5)/y))y)/y)/(yy/(y(-4/9)yy))) assuming y is positive. y(302/45) Simplify ((p/p2)2(p*(-1/3)p)*(-45))/((p/(pp*8))/pp*0p*(1/4)pp7) assuming p is positive. p(-125/4) Simplify ((h3)50/(h/h(-11))16)(-1/14) assuming h is positive. h3 Simplify ((hh/(h*(-1/8)h)((hh*7)/hh)/h)/((h/h(-2))/(h(1/6)/h)))/((h1)(2/63)(h(2/3))11) assuming h is positive. h(-1549/504) Simplify ((((vv8/v)/v(2/27))/((v(-1)/v)/v)(2/17))(1/12))10 assuming v is positive. v(9500/1377) Simplify (c/c(-2/13)c5)/(c/(c2c)c)(13/3)c*(-2)c*(-2/19)(c(2/5)/c)(-18) assuming c is positive. c*(71069/3705) Simplify (qqq(-6)q*(-1/5)(q2)(-19))44 assuming q is positive. q(-9284/5) Simplify ((z(-2)/z4)/(z*(-8)z/z*(-2/5)))/((zz(2/9))1)(38/5) assuming z is positive. z(-391/45) Simplify (aaa*(-2/7)(a*(-2)a)/a(((a(a/(aa/a(-4/5)))/a)/a)/a)/((aa*6a)/a))/((a(-2/5))43)22 assuming a is positive. a(12856/35) Simplify ((d*(1/9)d)*(-7/2)(d4/d)(-28))16 assuming d is positive. d(-12656/9) Simplify ((d/(d/d*7))/dd/((d*(-1)d)/dd)d)/(d/((d(-1/4)/d)/d))31((d1)18)34 assuming d is positive. d(2077/4) Simplify (ff/(f*(-3/8)f)f)/f(f/(f/f*5))/f((ff/(f/(f3f))ff)/f)/ff(-2)f*(2/3)f*5(f/(f/f(2/7)))(34/3) assuming f is positive. f*(2903/168) Simplify ((((l/(l/(l/(ll*(-4/3)/l))l))/l)/(ll0l)lll(-4)l/(ll8))(-32))(-40) assuming l is positive. l(-44800/3) Simplify (((s/(ss(s/(s/(s/((ss/s*(-2/15))/s))))/ss))/s)/(s*(1/2)/ss))*(-1/12)((s*(3/4)/s)/ss/(sss(-2/17)))/(s1)(-7/5) assuming s is positive. s(-655/1224) Simplify ((y*(4/7)yy)/y3(y(-2/3)/y)(-5/7))/((((y*6/y)/yy)/y)/(yy(-6)))(-45) assuming y is positive. y(8521/21) Simplify (s0/s(-1/5)((s/s(-2/7))/s)(-45))/(s(2/7)/(s/s(1/8))(ss/(ss/(ss(-2/3))))(11/3)) assuming s is positive. s(-33491/2520) Simplify ((n(4/5)n1(n(2/7))(-15))(-36))(-13/3) assuming n is positive. n*(-13572/35) Simplify ((jjj/j(-1))/j)(2/19)/(j0/j)(-1/6)(jj(2/7))38j*(-6)jj/(j/j(1/7)) assuming j is positive. j(5033/114) Simplify (h4/(((h(1/5)h)/h)/hh))(1/18)/((((h/((h(4/7)h)/h)hhh)/h)/h(1/7))/(hh*(-2/15)h/(hh(3/4)))) assuming h is positive. h(-2467/1260) Simplify (u(-1))45u*2/(uu*(-6))((u*(2/11)u)/(uu/u8u))(13/4) assuming u is positive. u(-197/11) Simplify ((c*(1/6)/cc)/(c/(c/((c/(c(1/2)/c))/c))))(2/3)c(-2/5)c/(c*6/cc)c(c(-2/3))(3/28) assuming c is positive. c*(-2957/630) Simplify (y/(y/(y((yy/(y(-5/3)y)y)/y)/yy))yy*(-10)yy(2/3)/y(-4))(4/35) assuming y is positive. y(4/105) Simplify (v(-5)v/((vv/((v/v(1/3))/v))/v))(-17/6)vv/v(1/11)vv(-3)vvvv(-1)v/v(2/5) assuming v is positive. v(8722/495) Simplify ((ii/(i(-1/3)i)i)24)(7/4)/((i/i(-4/3))/(i1i))(1/3) assuming i is positive. i(881/9) Simplify (((k/((kk0/kk)/k))*(-9/2)(k*(-7)k)/((k/(kk/k(-6)))/k))(1/16))(-20) assuming k is positive. k(25/8) Simplify (((i/(i/(i(17/3)i)))/(i/i(-6)))/(i/(i9i)i(-2/17)/i))(-1/38) assuming i is positive. i(-499/1938) Simplify ((c(-2/19)/c)/c*(1/4))/(c(c/(c*1/c))/cc)*7(((c*(-1/2)c)/c)/c)(20/7)/((c(1/2)ccc)/cc)(-42) assuming c is positive. c(67755/532) Simplify ((gg0g)*(18/7)(gg/g(-2/5))/g(-2/13))/((g(-1))(-12)/(g(g*(2/3)g)/gg0/gg)) assuming g is positive. g*(-3599/1365) Simplify (ff*(-10)(f*4/f)/fff)(4/29)/((f(2/13)/(f(-2/15)/f))/(f(-2/5)f((f/f(-2/15))/f)/ff)) assuming f is positive. f(-2344/1885) Simplify ((c(1/2))*(-1/9)(c(-2/3))(10/3))/(c/(c/(c/(cc/(cc/(c*(4/9)c)))))(cc/(c/(c/(cccc/(c(1/3)/c)))))/c)(12/13) assuming c is positive. c(355/234) Simplify ((a(-1/4)/a)37)41(a*2/aa/a8)/(a0a)(-28) assuming a is positive. a(-7497/4) Simplify ((m(-1)/m)/((m/(mm*5m))/m))*14(m5/m(2/15))/(m/(m/((mm/(m/(mm/(m/m*(2/7))mmm)))/m))m/(m/m(-6))) assuming m is positive. m(8041/105) Simplify (((ww(w(-2/7)/w)/w)/w)/(w/w(-1/6)))28/((w/(ww/w*(2/5)w)w)(-5/2))(2/31) assuming w is positive. w(-6395/93) Simplify (c(-1/4)cc/(c/c(1/4)))(-1/32)/((c(2/17)/c)/(cc1))(-1/19) assuming c is positive. c(-1891/10336) Simplify f(-2)/f*(2/3)f4/f(3/8)f/(ff*(-5))f*(-1/6)f(f(((fff0/f)/f)/f)/f)(27/5) assuming f is positive. f(167/120) Simplify ((p(-9))(-49)/((p(-13/2)p)/p13))30 assuming p is positive. p13785 Simplify (dd0)6dd*(-2/5)d*6(d6/d6)(-8/7) assuming d is positive. d(63/5) Simplify ((z0)(10/3)/(z(-1/3))18)/((z(-2/5))(-5/	{ "pile_set_name": "DM Mathematics" }
38 Let w(t) = -75t - 603. Give w(-11). 222 Let i(u) = -210u*2 + 12u + 2. What is i(-1)? -220 Let i(r) = r*3 - 55r*2 - 166r - 412. Give i(58). 52 Let z(f) = -102f - 5852. Calculate z(-57). -38 Let l(s) = s3 + 25s*2 - 3s - 23. What is l(-25)? 52 Let z(h) = -48h - 594. Give z(-13). 30 Let s(o) = 11o - 45. Determine s(13). 98 Let z(p) = -p*2 + 469p - 2315. Determine z(5). 5 Let i(b) = 72b - 75. Give i(3). 141 Let c(z) = z2 + 182z + 2160. Calculate c(-169). -37 Let g(t) = -3t3 - 25t*2 + 3t + 1. What is g(-4)? -219 Let b(v) = v*2 + 65v - 209. Give b(3). -5 Let c(f) = -f*3 - 36f*2 + 449f + 101. What is c(10)? -9 Let b(l) = -18l2 + 113l - 64. Determine b(6). -34 Let d(s) = -10s2 + 14s - 4. Give d(-6). -448 Let p(f) = 494f + 10328. Give p(-21). -46 Let p(t) = t2 - 3t + 104. Calculate p(0). 104 Let o(y) = 82y + 186. Give o(-3). -60 Let o(j) = -j2 - 111j - 1536. Determine o(-87). 552 Let g(i) = -i*3 - 4i*2 + 8i - 23. Determine g(-6). 1 Let q(l) = 61l2 - 9l + 2. What is q(1)? 54 Let z(q) = -q*3 + 50q*2 + 70q + 2013. What is z(52)? 245 Let f(a) = 254a - 14234. Determine f(56). -10 Let r(s) = s2 + 23s - 121. Give r(-28). 19 Let k(u) = 2u3 - 6u*2 + 42u - 105. Give k(3). 21 Let d(q) = 108q - 866. What is d(8)? -2 Let d(p) = p3 + 82p*2 - 823p - 417. What is d(-91)? -53 Let p(y) = y*2 + 46y - 855. Give p(14). -15 Let d(c) = 144c + 425. Determine d(-3). -7 Let q(s) = s3 + 10s*2 + 27s - 4. Determine q(-4). -16 Let v(q) = -131q + 7206. Give v(55). 1 Let k(i) = -10i - 98. Determine k(47). -568 Let i(m) = 32m2 - 163m + 4. Give i(5). -11 Let x(g) = 11g - 233. Give x(17). -46 Let s(f) = 36f*3 + 15f*2 - 10f - 5. Calculate s(1). 36 Let h(r) = 2r2 - 1314r + 3952. Determine h(3). 28 Let l(n) = n*3 + 98n*2 + 196n + 413. What is l(-96)? 29 Let m(r) = -r*2 + 25r + 19598. What is m(153)? 14 Let o(w) = -32w - 71. Determine o(-2). -7 Let s(k) = 55k*3 - 5k2 - k - 3. Give s(2). 415 Let t(l) = -l2 - 27l + 219. Calculate t(-34). -19 Let l(h) = -h2 + 310h + 21767. Calculate l(-59). -4 Let l(n) = -6n + 265. Determine l(41). 19 Let s(g) = 22g*2 - 65g - 189. Determine s(-5). 686 Let b(q) = -53q + 686. What is b(11)? 103 Let y(b) = 10b*2 - 62b + 184. Determine y(3). 88 Let k(w) = w*3 + 68w*2 + 67w + 63. Determine k(-67). 63 Let y(g) = 2319g - 2328. Determine y(1). -9 Let b(t) = -t2 + 75t - 298. Determine b(55). 802 Let a(l) = -20l - 349. What is a(-18)? 11 Let m(b) = -b2 - 3b + 291. What is m(-20)? -49 Let j(d) = -d*3 + 13d*2 + 7d - 378. Calculate j(10). -8 Let c(o) = -o*2 - 19o + 1177. Give c(27). -65 Let m(p) = -p*2 + 127p - 744. Give m(6). -18 Let v(y) = 7y2 - 22y - 169. Calculate v(-7). 328 Let d(x) = 12x3 + 17x*2 - 13x - 26. Give d(-3). -158 Let w(m) = 96m - 3711. Calculate w(39). 33 Let o(n) = -6n*2 + 42n - 14. What is o(8)? -62 Let y(x) = -x*2 + 43x - 310. What is y(10)? 20 Let w(u) = u*3 + 12u*2 + 13u + 28. Give w(-5). 138 Let u(g) = -56g2 + 1218g + 317. Calculate u(22). 9 Let t(l) = -4l2 - 2l - 8. Calculate t(5). -118 Let y(h) = 2615h - 20922. Calculate y(8). -2 Let b(w) = 2w*2 + 152w + 568. Determine b(-72). -8 Let q(p) = -12p3 - 275p*2 + 28p + 110. Calculate q(-23). -5 Let k(s) = -5s - 21. Calculate k(11). -76 Let i(a) = 13a - 108. Determine i(2). -82 Let z(p) = 168p + 17367. Calculate z(-103). 63 Let o(h) = h3 - 14h*2 - 1971h + 178. Give o(-38). -12 Let k(a) = 24a2 + 111a - 55. Give k(-5). -10 Let x(o) = 10o - 94. Calculate x(4). -54 Let f(n) = n3 + 32n - 9. Determine f(0). -9 Let x(h) = -4h2 - 115h + 36. Give x(-31). -243 Let s(r) = 259r - 1965. Determine s(8). 107 Let l(o) = -190o + 4935. Determine l(26). -5 Let i(p) = 32p - 3337. Determine i(104). -9 Let f(w) = 13097w*2 - 91676w - 9. Give f(7). 12 Let y(a) = 12a + 241. Determine y(-19). 13 Let x(t) = -4t*2 + 19t - 21. What is x(2)? 1 Let u(f) = -f*3 - 4f*2 + 14f + 21. Give u(-7). 70 Let a(o) = -13o2 - 23o + 44. Give a(-3). -4 Let r(b) = 144b + 16. Calculate r(-1). -128 Let v(m) = -m3 + 151m*2 + 10050m - 1. Calculate v(-50). -1 Let q(r) = 4r3 + 83r*2 + 54r - 124. What is q(-20)? -4 Let f(k) = k*3 - 8k*2 + 9k - 16. Determine f(6). -34 Let p(d) = -32d - 1560. Calculate p(-49). 8 Let g(w) = -47w - 367. What is g(-8)? 9 Let n(h) = h*2 + 25h - 150. What is n(-33)? 114 Let s(l) = -l*2 + 11l + 20. Give s(14). -22 Let m(l) = -4l3 + 38l*2 - 2l - 73. Give m(9). 71 Let u(q) = 60q + 19. Determine u(-4). -221 Let s(q) = 55q + 275. Give s(-2). 165 Let y(p) = -4p2 + 171p + 751. Determine y(-4). 3 Let f(p) = -8p3 - 4p*2 - 4p - 19. Calculate f(-4). 445 Let g(i) = 9i2 + 163i + 390. What is g(-15)? -30 Let a(p) = 1258p - 89320. What is a(71)? -2 Let z(n) = -n3 - 9n*2 - 20n + 54. Give z(-11). 516 Let h(t) = -t*3 + 21t*2 + 103t - 75. What is h(25)? 0 Let n(r) = r*3 - 8r*2 - 65r - 30. Determine n(13). -30 Let i(o) = -63o - 450. What is i(-8)? 54 Let p(n) = -n2 + 370n - 6006. Calculate p(17). -5 Let a(c) = 2c2 + 222c + 6159. What is a(-58)? 11 Let b(r) = 2r3 + 29r*2 + 6r - 93. What is b(-14)? 19 Let a(q) = q*3 + 54q*2 - 102q + 563. What is a(-56)? 3 Let q(t) = 10t2 - 269t - 43. What is q(27)? -16 Let a(b) = b*2 + 56b - 1597. Calculate a(-77). 20 Let c(l) = 3l - 32. Determine c(8). -8 Let w(j) = -1171j - 12885. What is w(-11)? -4 Let i(v) = -v*3 - 10v*2 + 127v + 794. Give i(-15). 14 Let i(n) = -n*2 + 45n - 42. Determine i(45). -42 Let a(n) = 22n2 + 337n - 730. Determine a(2). 32 Let r(n) = -22n2 - 529n - 8. Determine r(-24). 16 Let v(h) = -3h + 106. What is v(47)? -35 Let o(a) = 27a - 723. What is o(30)? 87 Let d(z) = 2z2 + 91z + 512. Give d(-39). 5 Let p(y) = 10y2 + 84y + 86. Determine p(-1). 12 Let r(m) = m*2 + 7m - 131. Calculate r(6). -53 Let x(y) = y*2 + 83y + 1366. Calculate x(-21). 64 Let m(f) = -f*2 + 52f + 652. Determine m(-10). 32 Let i(j) = j*3 - 11j*2 - 58j - 9. What is i(-4)? -17 Let r(y) = -5y2 + 45y - 20. Determine r(4). 80 Let u(l) = 67l - 751. Calculate u(11). -14 Let n(t) = 18t*2 + 42t + 3. What is n(-2)? -9 Let f(c) = 3c2 - 192c + 374. Determine f(62). 2 Let k(v) = 2v2 + 89v - 642. What is k(-51)? 21 Let h(i) = 8i3 + 105i*2 + 12i + 12. Calculate h(-13). 25 Let c(v) = 4v2 + 8. Give c(2). 24 Let c(z) = z3 - 128z*2 + 1064z + 37. Calculate c(9). -26 Let r(u) = -42u2 - 2u - 28. Determine r(-3). -400 Let b(f) = 113f + 2946. What is b(-26)? 8 Let p(u) = 8u - 30. What is p(-6)? -78 Let d(z) = 559z + 9497. Determine d(-17). -6 Let a(y) = -119y - 363. Calculate a(-4). 113 Let b(n) = 118n - 1081. Give b(9). -19 Let v(t) = -t2 + 90t - 1074. Calculate v(76). -10 Let x(n) = n*3 + 27n*2 + 40n + 144. Calculate x(-25). 394 Let m(f) = -2f2 - 205f - 1175. Give m(-6). -17 Let k(c) = 5c3 - 2c*2 + 4c + 4. Calculate k(2). 44 Let f(r) = -399r - 2455. Give f(-6). -61 Let v(i) = -i2 + 5i - 10. What is v(9)? -46 Let f(d) = d*2 + 114d + 443. What is f(-110)? 3 Let f(v) = 17v - 2363. What is f(140)? 17 Let c(s) = -26s*2 - 7358s + 7360. What is c(1)? -24 Let z(h) = h*3 + 8h*2 + 29h + 74. Calculate z(-4). 22 Let c(m) = -m*3 - 15m*2 + m + 16. Calculate c(-15). 1 Let o(d) = -274d - 243. What is o(-1)? 31 Let g(a) = -2a3 + 102a*2 - 101a + 52. Calculate g(50). 2 Let y(d) = -2d3 - 25d*2 + 13d + 20. What is y(-12)? -280 Let o(q) = 4q3 - 30q*2 - 16q - 18. Calculate o(8). -18 Let z(t) = -t*2 - 26t - 95. What is z(-19)? 38 Let i(t) = 2t2 + 74t + 13. Give i(-37). 13 Let u(z) = -z*3 + 41z*2 + 48z - 254. Determine u(42). -2 Let q(h) = -3h3 - 48h*2 - 25h + 178. Give q(-15). -122 Let z(i) = 33i + 245. Give z(-10). -85 Let g(k) = -92k*2 + 4234k - 92. What is g(46)? 0 Let n(j) = -j*3 + 48j*2 + 107j + 84. Determine n(50). 434 Let q(f) = f*2 + 26f - 65. What is q(-29)? 22 Let u(j) = -j*2 - 97j + 4827. Give u(-134). -131 Let i(d) = -3d2 - 26d - 57. Determine i(-15). -342 Let l(q) = -q*2 + 2978q + 35877. Calculate l(-12). -3 Let y(u) = -u*3 - 7u*2 - 2u + 20. What is y(-6)? -4 Let h(c) = 2c3 + 281c**2 - 144	{ "pile_set_name": "DM Mathematics" }
}. What is prob of picking 2 a? 1/51 Four letters picked without replacement from wwiiwiiwwiiwwiwwwww. What is prob of picking 3 i and 1 w? 35/323 Three letters picked without replacement from iiizpiiipiiiziiip. Give prob of picking 1 i and 2 p. 9/170 Calculate prob of picking 4 k when four letters picked without replacement from {k: 16, u: 2}. 91/153 What is prob of picking 3 f when three letters picked without replacement from fjjiijfjffjfj? 5/143 Calculate prob of picking 1 u and 1 x when two letters picked without replacement from uuuuuuuuuuuuuuuxxuuu. 18/95 Calculate prob of picking 2 f and 1 i when three letters picked without replacement from jisfhasfijfj. 3/110 Three letters picked without replacement from wrrwrrrwrrrwrrwrwrr. What is prob of picking 1 w and 2 r? 156/323 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from {k: 1, p: 3, d: 4, o: 1, n: 1, m: 2}. 1/66 Three letters picked without replacement from kdoukffkuokokkff. What is prob of picking 1 o, 1 k, and 1 d? 9/280 What is prob of picking 1 z and 1 a when two letters picked without replacement from zzzzzzza? 1/4 Four letters picked without replacement from {c: 3, y: 1, b: 7, j: 2, h: 3, t: 2}. What is prob of picking 2 b and 2 j? 7/1020 Two letters picked without replacement from fnegybe. What is prob of picking 1 n and 1 g? 1/21 Two letters picked without replacement from eimmmeim. Give prob of picking 1 i and 1 e. 1/7 What is prob of picking 2 f when two letters picked without replacement from {o: 7, f: 3}? 1/15 Three letters picked without replacement from vvvvvxxxxvvvvvxvxv. Give prob of picking 1 v and 2 x. 15/68 Four letters picked without replacement from {b: 9, f: 7}. What is prob of picking 3 b and 1 f? 21/65 Calculate prob of picking 1 j, 1 f, and 1 q when three letters picked without replacement from {i: 1, q: 4, f: 1, y: 1, j: 1}. 1/14 Two letters picked without replacement from {y: 7, h: 1, m: 5}. Give prob of picking 1 m and 1 h. 5/78 Calculate prob of picking 4 i when four letters picked without replacement from {i: 2, r: 9}. 0 Three letters picked without replacement from {y: 3, c: 7, u: 1, j: 6}. Give prob of picking 2 c and 1 y. 63/680 Calculate prob of picking 3 o when three letters picked without replacement from {o: 4, e: 1, w: 3, i: 6}. 1/91 Calculate prob of picking 1 e and 3 w when four letters picked without replacement from ewqagegegggegwwwww. 4/153 Two letters picked without replacement from bluubzu. What is prob of picking 1 u and 1 b? 2/7 Three letters picked without replacement from {k: 12, f: 1, c: 1}. Give prob of picking 3 c. 0 What is prob of picking 1 i and 1 k when two letters picked without replacement from {v: 1, h: 6, k: 7, i: 6}? 21/95 What is prob of picking 2 v and 1 u when three letters picked without replacement from uvvvvvvvvvvvvvvvvv? 1/6 What is prob of picking 3 r when three letters picked without replacement from rirrrrrriririr? 30/91 What is prob of picking 3 h when three letters picked without replacement from {h: 7, c: 2}? 5/12 Calculate prob of picking 2 h when two letters picked without replacement from zzzihhizi. 1/36 Two letters picked without replacement from fwfwwwffwww. Give prob of picking 2 f. 6/55 Two letters picked without replacement from {u: 3, o: 7, t: 4, r: 5}. Give prob of picking 2 r. 10/171 Calculate prob of picking 3 i when three letters picked without replacement from bbibbibb. 0 Three letters picked without replacement from nllllnl. What is prob of picking 2 l and 1 n? 4/7 What is prob of picking 3 x and 1 g when four letters picked without replacement from vxnxvvkbxbvbvvbg? 1/1820 What is prob of picking 3 p and 1 y when four letters picked without replacement from pppttruttuturyt? 1/1365 Calculate prob of picking 1 w, 2 p, and 1 c when four letters picked without replacement from wcwccwnpphc. 2/55 Two letters picked without replacement from wbbiwibwwwwsisi. What is prob of picking 1 b and 1 s? 2/35 What is prob of picking 3 e when three letters picked without replacement from {v: 3, e: 11}? 165/364 What is prob of picking 3 y when three letters picked without replacement from {y: 13, e: 3}? 143/280 What is prob of picking 2 p when two letters picked without replacement from {p: 5, h: 9}? 10/91 Two letters picked without replacement from {n: 10, t: 2}. Give prob of picking 2 n. 15/22 What is prob of picking 1 a and 2 y when three letters picked without replacement from {a: 8, y: 3}? 8/55 Calculate prob of picking 1 i, 1 p, and 2 o when four letters picked without replacement from {j: 4, i: 2, p: 2, l: 1, o: 9, t: 2}. 48/1615 What is prob of picking 1 u and 3 f when four letters picked without replacement from fufuf? 2/5 Four letters picked without replacement from {u: 1, d: 1, o: 2, z: 4}. What is prob of picking 2 z and 2 u? 0 Four letters picked without replacement from {i: 3, a: 2, w: 1, c: 1, y: 5}. What is prob of picking 4 y? 1/99 Two letters picked without replacement from tmtmmmtmmmtmmmtttmtt. Give prob of picking 2 t. 18/95 Three letters picked without replacement from quqqeuquuqeeqeueleq. What is prob of picking 3 u? 10/969 Two letters picked without replacement from {h: 1, r: 2, i: 3, z: 7, a: 5, v: 2}. What is prob of picking 1 a and 1 z? 7/38 What is prob of picking 1 h and 1 u when two letters picked without replacement from {m: 2, u: 2, z: 1, h: 2, b: 5, t: 5}? 1/34 What is prob of picking 1 w and 2 c when three letters picked without replacement from {w: 3, j: 3, q: 3, l: 3, c: 4}? 9/280 What is prob of picking 2 h when two letters picked without replacement from {e: 4, h: 2}? 1/15 Calculate prob of picking 1 y and 2 o when three letters picked without replacement from nncnnyncnoon. 1/220 Two letters picked without replacement from {i: 2, q: 9, b: 5}. What is prob of picking 1 b and 1 i? 1/12 Two letters picked without replacement from gpppgp. Give prob of picking 2 g. 1/15 Two letters picked without replacement from {j: 1, v: 1, c: 2}. What is prob of picking 2 c? 1/6 What is prob of picking 3 a when three letters picked without replacement from aeaa? 1/4 Four letters picked without replacement from {q: 3, x: 5}. What is prob of picking 1 x and 3 q? 1/14 What is prob of picking 2 w and 1 r when three letters picked without replacement from {y: 4, r: 3, x: 2, w: 6}? 9/91 Four letters picked without replacement from zymhmhzmhmhzzmhm. Give prob of picking 3 z and 1 h. 1/91 Two letters picked without replacement from kkninisiqmmn. Give prob of picking 1 n and 1 m. 1/11 What is prob of picking 1 l and 2 s when three letters picked without replacement from lssllslllslllllllls? 140/969 Calculate prob of picking 2 t when two letters picked without replacement from ittuuuttttiuti. 3/13 Calculate prob of picking 1 z, 2 h, and 1 v when four letters picked without replacement from hvbvvsvhhvshasbszb. 1/102 Two letters picked without replacement from {p: 2, r: 2, k: 1}. Give prob of picking 1 r and 1 k. 1/5 What is prob of picking 2 c when two letters picked without replacement from qwnwcc? 1/15 Two letters picked without replacement from beisg. Give prob of picking 1 i and 1 b. 1/10 Calculate prob of picking 1 h and 1 w when two letters picked without replacement from {w: 2, h: 2}. 2/3 What is prob of picking 3 f when three letters picked without replacement from {x: 4, f: 4, t: 2, y: 1, n: 3, m: 1}? 4/455 Four letters picked without replacement from {b: 4, o: 7, u: 2}. Give prob of picking 1 b and 3 o. 28/143 Calculate prob of picking 2 k when two letters picked without replacement from kkttbkkttt. 2/15 Four letters picked without replacement from yssyyyyyyy. What is prob of picking 3 y and 1 s? 8/15 What is prob of picking 1 t, 1 b, and 1 r when three letters picked without replacement from btkrikrrbxxbxrr? 3/91 Two letters picked without replacement from {j: 1, t: 7, g: 5}. Give prob of picking 1 g and 1 j. 5/78 What is prob of picking 2 a when two letters picked without replacement from {k: 7, a: 7}? 3/13 Two letters picked without replacement from nne. What is prob of picking 2 n? 1/3 Four letters picked without replacement from {w: 2, o: 4, t: 8}. Give prob of picking 4 o. 1/1001 Two letters picked without replacement from qiaiifqiafiqiaiqiiai. Give pro	{ "pile_set_name": "DM Mathematics" }
cement from fxgfgwufgwwugufx. What is prob of sequence wg? 1/20 Two letters picked without replacement from {d: 2, e: 1, l: 1, m: 1, w: 4}. Give prob of sequence lw. 1/18 What is prob of sequence wx when two letters picked without replacement from xxxxxxxxxxxxxxxxxxw? 1/19 Four letters picked without replacement from {v: 3, a: 3, j: 8, s: 3, m: 1}. Give prob of sequence jaas. 1/510 Four letters picked without replacement from {h: 1, r: 1, l: 1, i: 1, e: 1}. What is prob of sequence lhie? 1/120 Three letters picked without replacement from inpxxpyixxinntn. What is prob of sequence tyn? 2/1365 Three letters picked without replacement from {g: 2, o: 4, v: 3}. Give prob of sequence oog. 1/21 Three letters picked without replacement from muaukauuuuuukuku. Give prob of sequence kku. 1/56 Three letters picked without replacement from {o: 2, v: 10}. What is prob of sequence vov? 3/22 Four letters picked without replacement from thnntntutunhph. Give prob of sequence hupu. 1/4004 Two letters picked without replacement from {b: 2, p: 1, k: 2, d: 1}. What is prob of sequence dp? 1/30 Three letters picked without replacement from {p: 4, x: 2, m: 3, k: 4, v: 1}. What is prob of sequence mxp? 1/91 What is prob of sequence oc when two letters picked without replacement from {w: 3, p: 12, c: 2, o: 3}? 3/190 Three letters picked without replacement from ppvvvwvnnppvvppvvp. Give prob of sequence vvv. 7/102 Three letters picked without replacement from {r: 10, q: 10}. Give prob of sequence rrq. 5/38 Three letters picked without replacement from wwtwwtwwtw. Give prob of sequence wtw. 7/40 Calculate prob of sequence ib when two letters picked without replacement from {h: 1, b: 2, p: 1, f: 2, i: 1}. 1/21 What is prob of sequence bw when two letters picked without replacement from bbbbbbbbbbbw? 1/12 What is prob of sequence el when two letters picked without replacement from crteyrl? 1/42 Calculate prob of sequence bo when two letters picked without replacement from obkobobboobobb. 3/13 What is prob of sequence kkpm when four letters picked without replacement from {m: 1, k: 5, h: 3, p: 1}? 1/252 Two letters picked without replacement from {x: 2, r: 2, n: 1, w: 4, c: 1}. What is prob of sequence cn? 1/90 What is prob of sequence eh when two letters picked without replacement from {h: 9, e: 3}? 9/44 What is prob of sequence rbh when three letters picked without replacement from {h: 1, b: 1, r: 1}? 1/6 Three letters picked without replacement from vvfhvvvhvv. What is prob of sequence hvh? 7/360 Three letters picked without replacement from xekx. What is prob of sequence xek? 1/12 Calculate prob of sequence vrj when three letters picked without replacement from {j: 3, v: 10, z: 2, r: 1, x: 3}. 5/969 Three letters picked without replacement from {w: 7, a: 2, d: 4}. What is prob of sequence awd? 14/429 What is prob of sequence fhh when three letters picked without replacement from ihyfhfiwii? 1/180 Two letters picked without replacement from tjnrtnjnttn. What is prob of sequence rt? 2/55 Calculate prob of sequence ll when two letters picked without replacement from {e: 1, o: 3, l: 8, n: 2, r: 1, a: 1}. 7/30 Two letters picked without replacement from {o: 1, u: 2, c: 6, j: 3}. What is prob of sequence jo? 1/44 Three letters picked without replacement from aakakkkakkakkk. What is prob of sequence kaa? 15/182 Calculate prob of sequence uduu when four letters picked without replacement from ddduuduuduudduduud. 21/340 Calculate prob of sequence eke when three letters picked without replacement from {e: 9, k: 2, n: 3, y: 3}. 3/85 What is prob of sequence ppga when four letters picked without replacement from {g: 2, a: 4, p: 4}? 2/105 Four letters picked without replacement from offoffoffo. What is prob of sequence fffo? 2/21 What is prob of sequence tvl when three letters picked without replacement from bblzvbtblbzz? 1/660 Three letters picked without replacement from {e: 2, o: 1, w: 1, n: 4}. Give prob of sequence one. 1/42 Three letters picked without replacement from {j: 9, x: 10}. Give prob of sequence jxx. 45/323 Calculate prob of sequence xh when two letters picked without replacement from {x: 2, y: 1, h: 1}. 1/6 What is prob of sequence gu when two letters picked without replacement from {w: 3, g: 1, e: 1, o: 3, u: 2}? 1/45 Calculate prob of sequence ilz when three letters picked without replacement from aizializaaaz. 3/440 What is prob of sequence ssj when three letters picked without replacement from {s: 11, c: 1, r: 3, j: 4}? 220/2907 What is prob of sequence jqj when three letters picked without replacement from {r: 1, z: 4, j: 6, q: 5}? 5/112 Two letters picked without replacement from {l: 1, d: 8, z: 6}. Give prob of sequence dz. 8/35 Two letters picked without replacement from {e: 4, a: 3, s: 3, p: 2, j: 2, u: 2}. Give prob of sequence aa. 1/40 Calculate prob of sequence sss when three letters picked without replacement from ssggssg. 4/35 Four letters picked without replacement from ospvsvog. Give prob of sequence vsvs. 1/420 Three letters picked without replacement from {s: 3, u: 1, b: 2, p: 3, r: 1}. Give prob of sequence rpb. 1/120 Two letters picked without replacement from pvttptvptppppvptpvtp. Give prob of sequence pt. 3/19 Three letters picked without replacement from {y: 16, l: 1, i: 1}. What is prob of sequence yiy? 5/102 Four letters picked without replacement from ddgppgddcc. Give prob of sequence dgcg. 1/315 Calculate prob of sequence sp when two letters picked without replacement from sqssnzsnnpqzp. 2/39 Four letters picked without replacement from idxxxed. What is prob of sequence iedd? 1/420 Two letters picked without replacement from jjjjjjjkjkjjjkjjkk. Give prob of sequence jj. 26/51 Two letters picked without replacement from {j: 1, l: 1, f: 2, v: 2, t: 1}. What is prob of sequence fl? 1/21 Three letters picked without replacement from lplpllpplz. Give prob of sequence lll. 1/12 Three letters picked without replacement from ttggtgpgtgrgxggxggg. Give prob of sequence xrg. 11/2907 Three letters picked without replacement from aaaasssaaaias. What is prob of sequence sas? 8/143 Calculate prob of sequence ty when two letters picked without replacement from {p: 2, a: 1, t: 1, y: 4, z: 3}. 2/55 Calculate prob of sequence jh when two letters picked without replacement from {v: 1, h: 5, m: 1, j: 13}. 13/76 Calculate prob of sequence cz when two letters picked without replacement from cczzzzzczzzzzczczzz. 35/171 Calculate prob of sequence wwyy when four letters picked without replacement from wwwywwyywywwww. 45/1001 What is prob of sequence fxex when four letters picked without replacement from {e: 3, f: 1, x: 7, i: 1}? 7/660 Three letters picked without replacement from {g: 8, i: 2}. What is prob of sequence gig? 7/45 Two letters picked without replacement from ozvnzvzzvzzzzzzvozo. Give prob of sequence zn. 11/342 Calculate prob of sequence ipq when three letters picked without replacement from piqubqe. 1/105 Calculate prob of sequence ge when two letters picked without replacement from gweeeowelywo. 1/33 Two letters picked without replacement from lyyuyylxxxylsxl. What is prob of sequence ly? 2/21 What is prob of sequence nn when two letters picked without replacement from rnrnnnnrnrnr? 7/22 Four letters picked without replacement from {h: 4, z: 1, y: 2, w: 2}. Give prob of sequence hhyh. 1/63 Calculate prob of sequence nw when two letters picked without replacement from wwrwfnrnrwn. 6/55 Four letters picked without replacement from {v: 4, a: 7}. What is prob of sequence vvva? 7/330 Three letters picked without replacement from {b: 6, j: 7, z: 4}. What is prob of sequence jbj? 21/340 Two letters picked without replacement from ymmympypym. What is prob of sequence yp? 4/45 Two letters picked without replacement from sxelxseseexe. What is prob of sequence ex? 5/44 Calculate prob of sequence qhz when three letters picked without replacement from szsxzqqxqsxgh. 1/286 Calculate prob of sequence qqqu when four letters picked without replacement from {u: 1, q: 19}. 1/20 Four letters picked without replacement from hhhhhhhhhh. Give prob of sequence hhhh. 1 What is prob of sequence siis when four letters picked without replacement from sisiiiiiiiiisiii? 3/14	{ "pile_set_name": "DM Mathematics" }
eplacement from vwccavwwa. Give prob of sequence vwwv. 1/252 Four letters picked without replacement from {m: 7, v: 12}. What is prob of sequence mmmm? 35/3876 Two letters picked without replacement from gmwgxim. What is prob of sequence ii? 0 Three letters picked without replacement from cvvcccccc. Give prob of sequence vcc. 1/6 Four letters picked without replacement from aqujqyuyjjyquuia. Give prob of sequence jyjq. 9/7280 Three letters picked without replacement from ugaaugavonau. Give prob of sequence vug. 1/220 What is prob of sequence bkm when three letters picked without replacement from bmmbmkymmyyymyyyyby? 1/323 Three letters picked without replacement from uzuzruzrzzzz. What is prob of sequence zru? 7/220 Calculate prob of sequence mkll when four letters picked without replacement from {m: 1, y: 1, l: 1, k: 3, x: 1}. 0 Four letters picked without replacement from ccxsxjhs. Give prob of sequence ccjs. 1/420 Four letters picked without replacement from {j: 3, p: 12}. What is prob of sequence jjjp? 1/455 What is prob of sequence rr when two letters picked without replacement from {b: 7, r: 2}? 1/36 Calculate prob of sequence mvm when three letters picked without replacement from mmmmmmmtvmmmmmmm. 13/240 Calculate prob of sequence ppcc when four letters picked without replacement from pcppcccppppcpppp. 55/1092 What is prob of sequence igts when four letters picked without replacement from {t: 2, g: 1, i: 1, s: 1}? 1/60 What is prob of sequence ymui when four letters picked without replacement from {i: 4, u: 10, m: 2, y: 3}? 5/1938 What is prob of sequence nz when two letters picked without replacement from zzznzzznznznznznzzz? 13/57 What is prob of sequence yyvv when four letters picked without replacement from vvvyyvy? 3/35 Three letters picked without replacement from {v: 2, z: 4, s: 1}. Give prob of sequence vvz. 4/105 Calculate prob of sequence px when two letters picked without replacement from {y: 2, u: 5, p: 1, x: 2, o: 2, v: 1}. 1/78 What is prob of sequence npno when four letters picked without replacement from {o: 7, n: 5, p: 7}? 245/23256 Four letters picked without replacement from xzlzlllzzzzlzldzz. Give prob of sequence zzdl. 9/1190 Two letters picked without replacement from {q: 3, a: 1, f: 3, z: 6, u: 1, h: 3}. What is prob of sequence uq? 3/272 What is prob of sequence na when two letters picked without replacement from nnnnnnnnnnann? 1/13 Two letters picked without replacement from {o: 5, r: 3, x: 3, b: 2, d: 5}. What is prob of sequence rb? 1/51 Three letters picked without replacement from lllrllrlll. Give prob of sequence rrl. 1/45 Four letters picked without replacement from {b: 3, o: 1, w: 6, j: 1, m: 2, k: 2}. What is prob of sequence bjwk? 1/910 Calculate prob of sequence oo when two letters picked without replacement from ooooccooooocooocooc. 91/171 Four letters picked without replacement from {f: 1, g: 4, q: 1, v: 9}. Give prob of sequence gvfv. 4/455 Calculate prob of sequence aa when two letters picked without replacement from gaafgafaaagagaaaaf. 55/153 Two letters picked without replacement from {e: 2, d: 7, s: 11}. What is prob of sequence ee? 1/190 Calculate prob of sequence aap when three letters picked without replacement from {u: 1, w: 1, a: 3, o: 1, p: 3, n: 2}. 1/55 What is prob of sequence uud when three letters picked without replacement from dgguud? 1/30 What is prob of sequence ak when two letters picked without replacement from ffahhrk? 1/42 Two letters picked without replacement from {s: 2, b: 4, y: 4, h: 2}. What is prob of sequence bs? 2/33 Calculate prob of sequence udmp when four letters picked without replacement from rucdmmp. 1/420 What is prob of sequence ogy when three letters picked without replacement from {y: 2, o: 2, g: 2}? 1/15 Two letters picked without replacement from nhhnnnnnnnnnnhhnnnh. What is prob of sequence nh? 35/171 Calculate prob of sequence tttt when four letters picked without replacement from ttttt. 1 What is prob of sequence aki when three letters picked without replacement from {i: 2, r: 3, a: 1, k: 12, z: 1}? 4/969 What is prob of sequence qt when two letters picked without replacement from {q: 1, y: 1, t: 1, s: 1, d: 2, u: 1}? 1/42 What is prob of sequence dds when three letters picked without replacement from {n: 4, d: 2, s: 3, g: 10}? 1/969 Two letters picked without replacement from auuunnuuuuuunuuuuauu. Give prob of sequence nn. 3/190 Two letters picked without replacement from {d: 6, x: 1, t: 1, w: 3, h: 3}. What is prob of sequence dd? 15/91 Calculate prob of sequence qx when two letters picked without replacement from {x: 2, q: 1}. 1/3 What is prob of sequence nm when two letters picked without replacement from mumpmrrmumpnpnpppppp? 1/38 Two letters picked without replacement from yjfjjjffvfffffl. What is prob of sequence vy? 1/210 Four letters picked without replacement from ppxpcxkepcxkxepeccx. What is prob of sequence peck? 5/3876 What is prob of sequence pps when three letters picked without replacement from pmpmpmsp? 1/28 Four letters picked without replacement from ebebebbebbbbbb. What is prob of sequence ebbe? 45/1001 Four letters picked without replacement from {u: 5, a: 15}. What is prob of sequence uuau? 5/646 Two letters picked without replacement from kaakzaazaaakkkk. Give prob of sequence aa. 1/5 What is prob of sequence bbbb when four letters picked without replacement from nnnnnbnbnbb? 1/330 Calculate prob of sequence jjjf when four letters picked without replacement from {t: 3, j: 7, f: 1, b: 5, v: 2}. 7/2448 Calculate prob of sequence pfp when three letters picked without replacement from {c: 3, f: 4, p: 8, h: 2}. 14/255 Three letters picked without replacement from drnnd. What is prob of sequence dnd? 1/15 What is prob of sequence ya when two letters picked without replacement from uysppsaspsssupu? 1/210 Calculate prob of sequence iat when three letters picked without replacement from {m: 3, a: 2, c: 1, i: 1, t: 3, h: 2}. 1/220 Calculate prob of sequence ccc when three letters picked without replacement from cxxxcxxxxxccxxcx. 1/56 Calculate prob of sequence sfba when four letters picked without replacement from {b: 1, a: 1, s: 1, f: 1, k: 1}. 1/120 Calculate prob of sequence uu when two letters picked without replacement from qququqqqqqqqqququq. 2/51 What is prob of sequence cp when two letters picked without replacement from uuzpcpuczzcpz? 3/52 What is prob of sequence rx when two letters picked without replacement from {b: 1, r: 7, x: 5}? 35/156 What is prob of sequence hk when two letters picked without replacement from {k: 6, m: 2, h: 9}? 27/136 Two letters picked without replacement from jrjnrnnyrrjyjjj. Give prob of sequence jn. 3/35 Calculate prob of sequence ccc when three letters picked without replacement from ccccggcgcg. 1/6 What is prob of sequence wnw when three letters picked without replacement from wknkgwvgwg? 1/120 What is prob of sequence mffa when four letters picked without replacement from {a: 2, d: 1, f: 2, o: 1, m: 1}? 1/210 Three letters picked without replacement from {k: 5, o: 4, v: 5, r: 1, d: 1}. What is prob of sequence rkd? 1/672 Three letters picked without replacement from {y: 1, e: 1, m: 6, j: 6, o: 6}. What is prob of sequence mmo? 1/38 Four letters picked without replacement from tdtthtttththtttththn. Give prob of sequence tnht. 13/1938 Four letters picked without replacement from {o: 2, k: 4, s: 8, w: 1}. What is prob of sequence kwks? 4/1365 What is prob of sequence lglg when four letters picked without replacement from {l: 7, g: 5}? 7/99 Calculate prob of sequence acc when three letters picked without replacement from ayzzczziz. 0 What is prob of sequence mz when two letters picked without replacement from mzzwwzzm? 1/7 What is prob of sequence llbl when four letters picked without replacement from {l: 5, b: 2}? 1/7 Four letters picked without replacement from {v: 3, l: 4, a: 2}. Give prob of sequence aalv. 1/126 Three letters picked without replacement from {b: 1, c: 2, l: 5, g: 1}. Give prob of sequence bcc. 1/252 Calculate prob of sequence rz when two letters picked without replacement from {a: 1, r: 1, d: 1, z: 1, j: 1}. 1/20 What is prob of sequence dc when two letters picked without replace	{ "pile_set_name": "DM Mathematics" }
ose 2h = gv - 4, -5h = -v - 5 - 5. What is the units digit of v? 5 Suppose 4k + n = 2851, -4n + 406 = k - 318. What is the tens digit of k? 1 Let z = -798 - -1468. What is the units digit of z? 0 Suppose -237 = 6v - 1557. Suppose 0s = -4s + v. What is the tens digit of s? 5 Suppose -3x = -2x - 2b - 13, -4x + 22 = -2b. Suppose -xp - 54 = 30. Let z = -15 - p. What is the units digit of z? 3 Suppose 0 = 44m - 42m - 660. What is the units digit of m? 0 Let s be (-18)/(-1) + (-3 - -5). Let z be (s/50)/(2/(-20)). What is the units digit of z/3(-39)/2? 6 Let j(h) be the first derivative of -h4/4 + h3/3 - h2/2 + 41h - 4. Let n be j(0). Let p = n - 17. What is the units digit of p? 4 What is the units digit of 630/(-189)6627/(-5)? 8 Let q(y) = -8y - 33. Let j(v) = -32v - 133. Let c(l) = 2j(l) - 9q(l). What is the hundreds digit of c(19)? 1 Suppose -5v = -8v - 24. Suppose -3u - 3 = 0, 6f - 51 = 2f - u. Let h = f + v. What is the units digit of h? 5 Suppose 6i - 14 = 22. Suppose -2o - i = 0, -3o - 619 = c - 6c. What is the hundreds digit of c? 1 Suppose -4d + 50 = -7w + 2w, 0 = 2w - 3d + 27. Let u(h) = -7h + 12. What is the units digit of u(w)? 4 Let l(j) = -j*3 - 4j*2 + 9j + 8. Suppose 2o - 19 = 5x - 0x, 3x + 3o + 3 = 0. Let w be (15 + x)2/(-4). What is the tens digit of l(w)? 2 Suppose -11 + 23 = 3d. Suppose 141 = 4c + y, -3c - dy - 48 = -5c. What is the units digit of c? 4 Let a(i) = -i3 + 19i*2 - 19i - 10. Let w(j) = -j*2 + j - 2. Let g(m) = -a(m) - w(m). What is the tens digit of g(17)? 2 Let r = -2 + 20. Suppose -c + r = -5x, -2c = -0c + 4x + 6. Suppose -9 = -3h + cu, 6h - 2u = 2h + 16. What is the units digit of h? 5 Let a(k) = -k*2 + 9k - 15. Let n be a(10). Let l = n - -88. What is the units digit of l? 3 Let f = -21 - -24. Suppose 2b + fb - 135 = 0. Suppose 6o = 117 - b. What is the units digit of o? 5 Suppose -3u - 27k + 32k = -10106, -6748 = -2u - 2k. What is the tens digit of u? 7 Let p(u) = -u*2 - 13u - 10. Let x be p(-9). Suppose -6v - x = -38. What is the units digit of v? 2 Let b = 106 + 536. What is the units digit of b? 2 Let s(p) = -p3 + 4p*2 + 15p + 27. What is the units digit of s(-8)? 5 Let k(a) = -a*3 + 8a*2 - 6a - 3. Let h be k(7). Suppose j - 209 = -4j - 3q, 0 = -hj - q + 163. What is the tens digit of j? 4 Suppose 0 = -5b - 23 - 17. Let m be ((-341)/44)/(2/b). Suppose -2s + 17 = -m. What is the units digit of s? 4 Let f(d) = -4d + 17. Let q be f(7). Let c = q + 34. What is the tens digit of c? 2 Let b = 17 + -17. Let l be b/(1 + (-3)/1). Suppose 3z - 39 = -3f, l = 4f - 0f - z - 32. What is the units digit of f? 9 Let u = 9 + 288. What is the units digit of u? 7 Let o(n) = -5n - 4. Let y(k) = k + 1. Suppose m - 30 = -4m. Let v(a) = my(a) + o(a). What is the units digit of v(5)? 7 Suppose -191 = -3c + 346. What is the tens digit of c? 7 Suppose -26w - 2 = -522. What is the units digit of w? 0 Suppose -4l + 7820 = -4c, -2l = -4c - 1352 - 2554. What is the units digit of l? 7 Let i(b) = 8b*2 - 25b + 180. What is the hundreds digit of i(6)? 3 Let b = -52 - -49. What is the units digit of ((-1)/(-4)131)/(b/(-12))? 1 Let t = 0 - 4. Let z(v) = -10v - 4. What is the tens digit of z(t)? 3 Suppose -186 - 48 = -9x. What is the tens digit of x + -2 + 12/(-4)? 2 Let q be ((-2)/3)/((-14)/357). Suppose q = 5z + 2. Suppose zu - 2p = -u + 130, -3p = -4u + 133. What is the tens digit of u? 3 Let z(s) = 3s2 - 6s - 57. What is the units digit of z(-4)? 5 Suppose -49c = -47c. Suppose cu + 192 = 3n + 3u, 3n - 187 = -4u. What is the tens digit of n? 6 Let x = 165 - 63. Suppose 5i - 10 - 10 = 0. Suppose ik - 3d + 17 = x, 0 = -3d + 15. What is the tens digit of k? 2 Suppose 4r + 2k = 3k + 2193, 532 = r + 3k. What is the units digit of r? 7 Let k be (-6)/(3/(-6) + -1). Let l be 2(k/8 - 1). What is the tens digit of l/214-5? 3 Suppose 2s + 3468 = -10s. Let d = s - -504. What is the hundreds digit of d? 2 Suppose 5v = -w + 3138, -w + 4v = -2280 - 867. What is the tens digit of w? 4 Let v(n) = 38n2 - n - 1. Let j be v(-1). Let k be (-322)/(-42) + 2/(-6)2. Suppose -j - k = -3x. What is the units digit of x? 5 Let j(n) = 0 + 0n - n + 12. Let h be 105/20 - 1/4. What is the units digit of j(h)? 7 Let u(d) be the second derivative of d*3/2 + 7d*2 + 11d. What is the units digit of u(15)? 9 Suppose 27940 = 14v - 4v. What is the units digit of v? 4 Suppose -h + 3 - 4 = 0, -11 = -2z + 5h. Suppose 0 = -zx - 43 + 460. What is the tens digit of x? 3 Let t = -65 - -6. Let q = -37 - t. What is the units digit of q? 2 Let p = 42 - 39. Let c = p + 39. What is the tens digit of c? 4 Let m(a) = -17a - 7a - 30 + 36a. What is the units digit of m(12)? 4 Let n = -10 + 51. Suppose -9 + n = 4m. Suppose 3q - mq = -70. What is the units digit of q? 4 Suppose 3y = 5s - 35, 7s - 3s + y - 11 = 0. Suppose -2 = -2m + m. Suppose -25 = -2t + 5h, mt - s = -0h - 2h. What is the units digit of t? 5 Let t(r) = -r3 - 11r*2 + 2. Let y be t(-11). What is the tens digit of (y + -3 + (-6)/(-8))-148? 3 Let i(d) = -1126d + 23. Let k be i(5). What is the units digit of (-33)/(-12) - 3 - k/28? 0 What is the hundreds digit of (-29)/116 + 5498/8? 6 Suppose 187y + 3824 = 195y. What is the hundreds digit of y? 4 Suppose 5661 = 4y - 3c, 0c + 4c = 2y - 2818. What is the tens digit of y? 1 Suppose 5m + 962 = 2w, -w - 6m + 483 = -9m. What is the hundreds digit of w? 4 Let x(k) = 2k + 2. Let h be x(-1). What is the units digit of 38/36/1 - h? 6 Let w = 2788 + -1685. What is the hundreds digit of w? 1 Suppose 3p - 920 = -5p. Suppose 365 = 5o - p. What is the units digit of o? 6 Suppose 0c - 5c = f - 12, -5c = 2f - 9. Let v = f + 7. Suppose vi - 3u - 8 - 47 = 0, 0 = 2i + 4u. What is the units digit of i? 0 Let n = 169 + -70. What is the tens digit of n? 9 Suppose -7i + 4i = 0. Suppose i = -7w - 779 + 1997. What is the units digit of w? 4 Let g(z) = 5z2 - 23z - 7. Let j be g(5). Suppose -3f + 10 = -5. Suppose -x + 4 = 2l - 56, jl - 293 = -fx. What is the units digit of x? 8 What is the units digit of (953/(-3))/(((-14)/6)/7)? 3 Let p(o) = -90o - 1. Let w be p(-1). Let d = w - -17. What is the units digit of d? 6 Suppose 15 = -4s + 7s. Suppose 3 = -p - 3j + 12, sj = p + 7. Suppose pz - 10 = 41. What is the units digit of z? 7 Let j(l) = l*3 + 15l*2 - 14l + 16. What is the tens digit of j(-15)? 2 Let i = 854 - 461. What is the tens digit of i? 9 Let l = -18 + 25. Let z(q) = -3q - 2q*2 + 3q*2 - 2q + 2q + 5. What is the tens digit of z(l)? 3 Suppose 0 = -0q - 2q + 4. Suppose 2b + qb - 204 = 0. What is the units digit of b/(-2)24/(-18)? 4 Let o be (6/8)/(2/8). Suppose -5 = -ot + 13. Suppose -2f = -t - 12. What is the units digit of f? 9 Suppose 5x - 4 = 4x. What is the tens digit of x + 250/(-65) + (-1660)/(-26)? 6 Suppose -54a - 29069 + 154673 = 0. What is the tens digit of a? 2 Let o = -110 + -16. Let t = -99 - o. What is the tens digit of t? 2 What is the units digit of (2/(-6))/(2/(-1542))? 7 Suppose -3p = -6p - 87. Suppose 5g - 64 + 419 = 0. Let f = p - g. What is the tens digit of f? 4 Let f(b) = -1108b + 13. What is the thousands digit of f(-1)? 1 Suppose 0f = -3f - 390. Let p = 254 + f. What is the hundreds digit of p? 1 Let w(k) = 8k*2 - 2k + 3. Let f be w(4). Suppose f = 5l - 4i - 541, 0 = -5l - 2i + 688. What is the hundreds digit of l? 1 Suppose -60z - 138 = -61z. What is the hundreds digit of z? 1 Let o be (-16)/(-10)(-17 + 12). Let z = o - 9. Let v = z - -35. What is the tens digit of v? 1 Suppose -2q + 6 = 0, -2n + 5q = -0n + 7. Suppose 189 = nw - 35. What is the tens digit of w? 5 Let w(r) = -r*2 - 46r + 107. What is the hundreds digit of w(-36)? 4 Let o(l) = -13l + 65. What is the hundreds digit of o(-17)? 2 What is the units digit of ((-16)/4 - 1938)(-2)/4? 1 Let c = -9 - -18. Let j be (-220)/(-12) + (-3)/c. Let q = -9 + j. What is the units digit of q? 9 Let q = -88 + 51. Suppose 0 = 59o - 3219 - 498. Let r = o + q. What is the tens digit of r? 2 Suppose 858m - 91056 = 834m. What is the tens digit of m? 9 Let t(n) = -2n	{ "pile_set_name": "DM Mathematics" }
63? -59423.297 Subtract -1662.49 from -17879. -16216.51 Calculate -689.40025 - 0.3. -689.70025 Calculate 1.238 - 1088827. -1088825.762 Add together -135 and -7632163. -7632298 What is the difference between -8335 and 1231515? 1239850 What is -1434978 + -0.3? -1434978.3 What is -1.7 minus -238277.3? 238275.6 Work out 1005845 + 1790. 1007635 What is the difference between -447.6 and 72? 519.6 Calculate 2484 + 0.16754. 2484.16754 2.16495 + -1673 -1670.83505 What is the distance between -1802.13 and -2858? 1055.87 Put together 963874 and -9326. 954548 Work out 2304371064 + -4. 2304371060 Add 4485050 and 16.19. 4485066.19 Add 3613505 and 1. 3613506 Work out -63.28930044 + -0.2. -63.48930044 What is 14 minus 3391987? -3391973 What is 0.576384 less than 8739? 8738.423616 38167419 + -3 38167416 Work out -1.62 - 18257003. -18257004.62 What is -499152 - 1? -499153 Sum 25.3993 and 662. 687.3993 What is -8 - 214.5441? -222.5441 What is -29941 take away 0.1468? -29941.1468 Add together 206567.9 and 197.1. 206765 Work out -679.090837 + 1.6. -677.490837 Put together -14703252 and 257. -14702995 Sum 0.0268 and 111.933. 111.9598 What is 99.7369 + 56? 155.7369 What is the difference between 0.359359428 and -19? 19.359359428 What is -0.01 minus -14.32788849? 14.31788849 What is -6 + -19675869578? -19675869584 -75.94 + 82.7 6.76 What is 0.707 - 6702.67? -6701.963 -15.488567 - -3 -12.488567 Subtract 3 from 2057418402.9. 2057418399.9 Calculate -248.3365 - 16.7. -265.0365 Total of -0.5 and 5042805. 5042804.5 Work out 3.23285983 - -1. 4.23285983 -454717434 + -5 -454717439 What is -1306 take away -17359201? 17357895 Add -312 and 7.522. -304.478 Sum -0.0572 and -93074. -93074.0572 Sum -2049440 and 0.5. -2049439.5 Calculate 72 + 28.739716. 100.739716 -16873+-1345 -18218 7 - 11024209 -11024202 Subtract 14543.635 from 0.112. -14543.523 Subtract -5 from -114.005183. -109.005183 What is -15216 minus 0.392? -15216.392 -0.3488508146+-3 -3.3488508146 What is -1.2 - 14.66167? -15.86167 What is -2.25 less than -2461277? -2461274.75 Add 0.1 and -14960125. -14960124.9 Calculate 2247921227 + 0.03. 2247921227.03 What is the difference between -0.4 and 3.3650189? 3.7650189 Add together -48.5610753 and 0.9. -47.6610753 Put together -0.069 and 3569.0125. 3568.9435 Add together -5 and 1192204.525. 1192199.525 What is -14.695545 - -1.3? -13.395545 Add together -4 and 0.34206061. -3.65793939 -1.1 + 6457072 6457070.9 Work out 1.321 + 0.101114. 1.422114 What is -2615 less than 2289839? 2292454 Total of -366 and 339839052. 339838686 Sum 174 and 22413.5. 22587.5 What is -1.1 plus -631023532? -631023533.1 Calculate 0.628 - 2884433. -2884432.372 What is 10.923496 take away 63? -52.076504 Put together -1.19298756 and 38. 36.80701244 Add -40577 and 234262. 193685 Sum 512066.2 and 0.4. 512066.6 What is -0.1191165 - 0.06276? -0.1818765 What is 6330618 less than -505? -6331123 What is 143685 + 53? 143738 Subtract 0.3 from 0.06080812. -0.23919188 What is -0.31 plus 14.060956? 13.750956 Calculate 0.67 - 174379593. -174379592.33 -0.7 + 27.24078 26.54078 What is 1169212 take away -0.32? 1169212.32 What is the distance between 113030743 and -3? 113030746 What is -1.692131 minus 3.02? -4.712131 Work out -128.17 - -2.95. -125.22 What is the distance between -5881723 and 2? 5881725 Work out 211637 + 90486. 302123 3100.7 - 1.3538 3099.3462 What is -0.36727 plus 163.3? 162.93273 What is the difference between 0.08 and 351.79006? 351.71006 Work out -40838.85 - -677. -40161.85 -0.012433760959+-0.4 -0.412433760959 What is 16129 - -5491.3? 21620.3 Subtract 994850 from -1283. -996133 Work out -41133.33 + -2.5. -41135.83 Total of -3124 and -181974. -185098 Total of 40 and -49698683. -49698643 What is the distance between -734.5736 and 4? 738.5736 Calculate 11714.4 - -174. 11888.4 Work out -20 - 0.382991694. -20.382991694 What is -1013087 plus 2600? -1010487 What is the distance between 23 and 6614538? 6614515 What is the difference between 0.1 and -936392.58? 936392.68 Total of 0.2 and 562.2568. 562.4568 Work out 193800 - 980. 192820 What is -35.5669 - 3.7? -39.2669 Put together 2323 and -639705. -637382 0.1 - 2.81659625 -2.71659625 What is -0.04 plus -55673? -55673.04 21430 - -0.8 21430.8 What is the difference between -15.0529698 and -75? 59.9470302 -1988609+17013 -1971596 What is 20.147427 take away -0.3? 20.447427 Work out 1078885 + 1.78. 1078886.78 Sum 4686 and 0.7978692. 4686.7978692 -119674 + 54.07 -119619.93 Total of -3183968 and -0.04. -3183968.04 -121789945.75+0.4 -121789945.35 2551196 + 36 2551232 Total of -7586 and 18404. 10818 What is -0.12 plus -891147? -891147.12 Work out 2095941630 + -1. 2095941629 What is 164060395 minus 5? 164060390 Total of 43.3 and -22444. -22400.7 What is the distance between 65375 and 5366? 60009 Work out -3467 + 11606889. 11603422 What is -20238887785 plus 0? -20238887785 -105944258.7 - 5 -105944263.7 Work out 1443 - 34516316. -34514873 What is 0.03 + 0.200835527? 0.230835527 What is -738122732 - 0.06? -738122732.06 What is -2 plus 0.08146448? -1.91853552 Sum 24611.24 and -0.11. 24611.13 What is 58374703 minus 1? 58374702 Work out 0.4 - -218749192.98. 218749193.38 Work out 18 - 917881. -917863 0.12 + 1108443232 1108443232.12 What is the difference between -49078 and 129? 49207 What is 0.026 take away -1716510? 1716510.026 What is 16 less than 60584? 60568 Work out -34 - 25.00997. -59.00997 What is -0.558 + 29382? 29381.442 Work out 3025141 - 0.11. 3025140.89 What is 412 plus -1574020? -1573608 What is -57 take away -27903.358? 27846.358 Work out 582.758 - 0.5. 582.258 -100025 + 0.0147719 -100024.9852281 Add -14.263 and -126.9. -141.163 What is the difference between 3 and 372674? 372671 What is the difference between 0.64485 and 4284? 4283.35515 Sum -21 and -19525229. -19525250 -3161.8702 + -2 -3163.8702 Subtract -339702 from 3.45. 339705.45 What is the difference between 748.5 and 296.6? 451.9 Work out 33433.4 + 440. 33873.4 What is 6701338 minus -2? 6701340 333435574 + 3 333435577 -7341327 + 9.1 -7341317.9 Put together -9.7794 and -58. -67.7794 Add together 147067.78 and 4. 147071.78 Add together -0.263 and 37863. 37862.737 19719.5 - -111 19830.5 Add together 15 and 24215238. 24215253 2.7 + 798.28072 800.98072 What is -75238906 - 0.2? -75238906.2 What is the difference between 4.83 and 7289055? 7289050.17 What is 305301.9 less than -0.1? -305302 What is the difference between 295778167744 and -0.5? 295778167744.5 -228006+1026.13 -226979.87 What is -281633607 take away -0.3? -281633606.7 0.4 - -0.30344617685 0.70344617685 What is 985476 less than -0.016139? -985476.016139 Work out -17 + 45.76955. 28.76955 What is the distance between 26 and -1654473.597? 1654499.597 Add -5154.43 and -6. -5160.43 534192880+0.5 534192880.5 Calculate -12.793 + 75.5. 62.707 What is the difference between -327772 and 140.47? 327912.47 Calculate 0.4 + -15437348. -15437347.6 What is the distance between -0.1 and 227.07412? 227.17412 What is 7243.26 - 2175? 5068.26 Add together -492 and -16412944. -16413436 Add together -684.19 and 6444. 5759.81 -0.12 - 2471.22 -2471.34 Calculate -2 + 758011.74. 758009.74 4470.67+1320 5790.67 3.0381 + 13670 13673.0381 What is 506.66 take away -212504? 213010.66 What is -3 minus -1042037577? 1042037574 Work out -37637 + -46612. -84249 -1158 + 0.88958 -1157.11042 What is -3 minus 55642419? -55642422 28677 + -1 28676 Add together -5354757245 and 0. -5354757245 Add 4 and -275263.4. -275259.4 Sum 154 and 215125484. 215125638 What is the distance between 54341 and -0.3? 54341.3 Work out -16 + 417467578. 417467562 What is 9241 take away 1332? 7909 Sum -141.956 and 28. -113.956 What is -0.9 plus 0.7001845? -0.1998155 Calculate 766220 + 1987. 768207 What is -0.79433 + 5.77? 4.97567 Work out 69 - 0.01772323. 68.98227677 What is -186780 - -0.023? -186779.977 Work out -43 + -64098346. -64098389 Sum 6441 and -46275. -39834 -6452 + -13987 -20439 Subtract -7301737 from -5.4. 7301731.6 Total of 306045 and 0.09298. 306045.09298 Work out -114.4660435 - -0.59. -113.8760435 What is the difference between 2808608 and 193? 2808415 Work out 39737268215 - -1. 39737268216 Work out -0.1355 + 1.90835. 1.77285 Subtract -243268 from -15.1. 243252.9 Calculate -260 - 104213. -104473 Work out	{ "pile_set_name": "DM Mathematics" }
)). Suppose 12t - 158 + 14 = y. Solve 0 = -2h - 2 + t for h. 5 Let y = -203 + 205. Solve 0 = -yp - 2 - 0 for p. -1 Suppose -3p + 0f + 19 = 2f, 0 = 3f - 15. Solve -pi - 11 = -5 for i. -2 Let v(z) = 4z2 + 138z + 27. Let h be v(-35). Solve 100 = l + h for l. 3 Suppose -4v + 16 = -3a, -2a + v = 4v - 12. Solve m + 27 - 32 = a for m. 5 Suppose -2g - 300 = 5n, n + 2g + 0g + 68 = 0. Let c = 63 + n. Solve -3k + ck = -10 for k. -5 Suppose 16u - 40 = -24u. Suppose w - 38 = -6. Suppose -4f - w = -12, f = 3z - 5. Solve z = -0p - p - u for p. -1 Let g = -16 + 7. Let j = -9 - g. Solve j = 3c + 3 - 6 for c. 1 Suppose 0 = f - 10 + 5. Suppose -a - 9 = -4k, -3k = k + fa - 3. Solve kn - 3 = 3n for n. -3 Suppose -13q + 80 = 3q. Let j = -13 - -9. Let m(f) = 2f*2 + 6f + 1. Let x be m(j). Solve qo = -1 - x for o. -2 Let g(t) = t + 36. Let y be g(-26). Let z be 5/(-10) + y/4. Solve 5 = -zv - 1 for v. -3 Suppose 2v - 19 = -1. Let l be (0/8)/(-2(-9)/6). Solve l = 5k + 16 + v for k. -5 Suppose -f - 4m = -3f - 32, 0 = -f - 5m - 30. Let n = 23 + f. Solve 2t - n = 5 for t. 4 Suppose -2t - 2c = -10, c = -3 + 2. Solve -3z = t - 3 for z. -1 Let o be (9(0 + -2))/1. Let u = o - -14. Let l be 0 + (0 - 4/u). Solve b + 0 + l = 0 for b. -1 Let r(x) = -x2 + 3x - 4. Let a be r(4). Let z = 13 + a. Suppose zs = 8 + 2. Solve 1 = g - sg for g. -1 Suppose -t + 4c + 31 = 0, 2t = 7t - 3c - 121. Suppose 0 = 5u - 7 - t. Solve -2q + 4 = -uq for q. -1 Let z = -1029 - -1035. Solve -o + 2 = z for o. -4 Let c be 0 - 8 - (-40 + 9). Solve 10s - cs = 0 for s. 0 Suppose -8j + 8j = -5j. Solve j = -18o - 32 - 40 for o. -4 Suppose 0m + 4 = m. Let n be (24/(-10))/(2/60). Let h = n + 73. Solve -mt - 3 = h for t. -1 Let k = 21 + -13. Let q = 8 - k. Suppose q = -3b - 5y + 1, -4b - 2y - y + 5 = 0. Solve -n - n + b = 0 for n. 1 Suppose -160 = -6x - 46. Solve 15 = 22t - xt for t. 5 Let k = 15 + -10. Suppose 4r = 4p + 116, -kp = 2r - 35 - 23. Let m = r - 27. Solve -x = -m + 4 for x. -2 Let d(g) = -3g + 1. Let l be d(-4). Solve -lb - 4 = -9b for b. -1 Suppose 3 = -3x + r - 4r, 18 = 2x - 2r. Let f be 8/12 + (-2)/3. Let l = f + x. Solve -la = -9 - 3 for a. 3 Let d(v) = -2v3 - 67v*2 - 32v + 33. Let a be d(-33). Solve a = -24o + 19o - 20 for o. -4 Let b = -597 - -764. Solve -bu + 3 = -164u for u. 1 Let w(d) = -d*3 - 6d*2 + 6d - 2. Let g be w(-7). Suppose 0 = 4a + gv + 12, -2a = -0a - 4v - 20. Suppose 4o - a - 10 = 0. Solve 5 = -4j - o for j. -2 Let k = 0 + 28. Suppose -4f = -8f + k. Solve 5g + 8 = -f for g. -3 Suppose -15s = -17s + 8. Let n = 1 + s. Solve -2x = 3x - n for x. 1 Suppose -5f = 2s - 22, 7f - s - 11 = 4f. Suppose b - 16 = -t, -3t + 0t - 2b + 51 = 0. Let v = t - f. Solve w + v = 6w for w. 3 Let v(s) = -11s + 86. Let y be v(6). Let b = -21 + 23. Solve -3f - y = bf for f. -4 Let g be (-1)/(((-18)/(-32))/(-9)). Let a(k) = 0k - g - k + 2k + 2k. Let f be a(7). Solve -fr - 4 = 16 for r. -4 Let m(g) = 7g - 39. Let q be m(6). Suppose s - 9 = 5n - 23, 18 = 3n - qs. Solve no + 1 = 3 for o. 1 Let u = 261 + -259. Solve uz + 3 = -z for z. -1 Let f(l) = -3l + 16. Let s be f(4). Suppose -2k = -3k + 2. Suppose kg - 2b - 10 = 0, -2b = 4 + 6. Solve -u - s = -gu for u. -4 Let m(n) = -3n2 + 6n - 2. Let w be m(3). Let h be 93/33 - 2/w. Solve 0 = hl - l + 8 for l. -4 Let h be 9/(-18)(-6)/(-1) + 3. Solve -3t + 2t - 3 = h for t. -3 Let f = -454 - -466. Solve 5u + u = -f for u. -2 Let i = -4 + 18. Let b be (-12)/i70/(-20). Solve 0 = -bj - 0j for j. 0 Let v(l) = 14l2 - l. Let c be v(1). Let b(h) = h - 3h + 2h + c + h. Let n be b(-10). Solve -5m + 2 + n = 0 for m. 1 Let s(p) be the third derivative of -p4/12 + p3/3 - 9p2. Let r be s(-4). Solve -2z + r = 3z for z. 2 Suppose -16y + 38 + 42 = 0. Let k = -18 + 20. Solve 7 - k = yb for b. 1 Suppose 3r - d = -5d + 89, -r + 31 = d. Suppose r = -6f + f. Let o = 5 - f. Solve o = z - 4z for z. -4 Suppose 5l + 10 = q, -25 = 4l - 5q + 4. Let w be (3 - -4) + l + 2. Solve -g - 3g = -w for g. 2 Suppose 4r - 9r = -5c, -c = 5r - 12. Solve 0v - rv - 2 = 0 for v. -1 Let b(n) = 2n3 + n2 + 18n - 28. Let s be b(2). Solve 0 = -35h + sh for h. 0 Suppose -131c + 123c = -24. Solve -cr + 28 = 4r for r. 4 Suppose -f + 80 - 346 = 0. Let y be f/10 - (-39)/65. Let x = -26 - y. Solve x = 3j - 6j - 12 for j. -4 Suppose 44 = 65g - 54g. Solve s - 3s - g = 0 for s. -2 Suppose 5l + 33 - 163 = 0. Let g = l - 21. Solve 0 = -4z + 17 - g for z. 3 Let m(s) = -11s + 95. Let b be m(6). Solve -4w + b = 37 for w. -2 Let d(k) = k*3 - 49k*2 + 48k + 2. Let f be d(48). Solve -9s - 22 = fs for s. -2 Let v = -90 - -92. Solve -5i - 3 = v for i. -1 Suppose 0 = 2y - 5k - 772 + 191, 582 = 2y - 4k. Solve yz + 25 = 288z for z. -5 Let t = -941 - -952. Solve -ta = -16a - 25 for a. -5 Suppose -11n = 4l - 16n, 4l = n. Let y(r) = -r2 + 6r - 3. Let w be y(2). Suppose -20 + w = -5f. Solve f + l = h for h. 3 Let q be (-64)/48(-3)/(2 + -1). Solve 2 + 10 = -ql for l. -3 Let p be (-2)/(-12) - 6254/(-708). Solve -q = -p + 5 for q. 4 Let d(c) = -5c*3 + 2. Let z be d(-2). Suppose -2b = -b - 2k + 21, 4k = -2b - z. Let a be 8/28 + 6/b. Solve a = -p - p + 10 for p. 5 Suppose -3k + 4u + 9 = -u, 3 = k + 2u. Suppose ki = 6 - 0. Solve -i + 5 = v for v. 3 Let u be ((-78)/15)/(((-50)/(-5))/(-150)). Solve -3j + 81 = u for j. 1 Suppose 93x - 11x = 820. Solve xw = 19w - 18 for w. 2 Suppose -123b = -118b - 10. Solve s = bs for s. 0 Let r be 0/(2 + 0/1). Let f be 8/12 - (-2)/(-3). Let y(q) = -q2 - q + 2. Let s be y(f). Solve -5h + s - 22 = r for h. -4 Let u = 1116 + -1112. Solve -5j - u = 1 for j. -1 Let h be (-6)/(-21) - (-4)/(-14). Solve 8v + h - 8 = 0 for v. 1 Let q be (-4)/14 - (-1270)/(-14). Let r = -70 - q. Solve -r = -5i - 1 for i. 4 Let p be 6/(-21) - 2268/(-49). Suppose p + 34 = 4f. Solve -3j + f = j for j. 5 Suppose -n + 3n = 5i - 8, 4n + 16 = -3i. Suppose -2q = -iq - 16. Let s = q + -5. Solve 3 = -sd - 3 for d. -2 Let i(j) be the third derivative of -j6/120 + j5/30 + j4/8 + j3/3 + 13j2. Suppose 0 = f - 1 - 2. Let n be i(f). Solve n = 2v - 2 for v. 2 Suppose -4q + 2x + 4 = 0, 14x = 13x + 4. Solve -d - 8 + q = 0 for d. -5 Let k be 0 + (-16)/(-4) - 0. Suppose 3i + 4o = 9, 0 = -ki + 3i - 2o + 3. Let u = 1 + i. Solve ur - 9 = -1 for r. 2 Suppose 7v - 37v + 210 = 0. Solve 5s + 8 = vs for s. 4 Let m be (-27)/(-12) - (-4)/(-16). Suppose -mv = v. Suppose -3w - 4 = -a, 3w + 4a = -vw + 16. Solve 2h - 7h - 20 = w for h. -4 Suppose q + 60 = -5q. Let j be 24/(-20) - 2/q - -3. Solve -jy + y = -2 for y. 2 Suppose 46 = 5o - 2a, 7o + 3a = 4o + 15. Let g = o + 6. Let t = 17 - g. Solve tq - 7q + 16 = 0 for q. 4 Suppose -34u = -5u - 290. Solve -us + 12s = -6 for s. -3 Let h(z) be the first derivative of -z*2/2 + 13z + 13. Let o be h(5). Solve 0 = -2c + 4c + o for c. -4 Suppose 11u - 10u = 4. Suppose 3t - 5t - 6 = 2s, us + 12 = -5t. Solve -2f = -tf - 10 for f. 5 Let q(f) = 3f + 24. Let j be q(-7). Suppose n = -5p + 23, -jp + 8 - 5 = -3n. Solve 5v - 6 = nv for v. 3 Let f be (1 + -5)/(-2) - 42-1. Let o = 45 - f. Solve r + 2 = -o for r. -3 Suppose -4b + 18 + 22 = 0. Suppose -b = 2k - 0. Let g(x) = x*3 + 5x*2 - 2x - 1. Let l be g(k). Solve 0 = -5z - 1 - l for z. -2 Suppose 3f - 19 = 8. Let l be 3/(f/21 + 0). Let v = l + -4. Solve i = vi - 2 for i. 1 Let i = 73 + -70. Let f = 7 - 0. Suppose -f - 17 = -ip. Solve 4h = -0h + p for h. 2 Let t(y) = -y*3 + 10y*2 + 2y - 6. Let f be t(10). Suppose 3w - w = -p + 7, -2p = -3w + f. Solve 2k - wk = -8 for k. 4 Suppose 2r - 4s - 2 + 6 = 0, 4r + 2s = 12. Solve rz = -4z - 6 for z. -1 Suppose -5i + 11 = 4s - 49, -3i = 12. Solve 25c = 30c + s for c. -4 Let f = 9 + -137. Let j = 132 + f. Solve jx = 2x for x. 0 Suppose 8 = -4y + 3y. Let m be 2 - 2/y-4. Let x be 18/6(m + 0). Solve -r - xr = 20 for r. -5 Suppose 3c = 2u - 12, c + 1 = -u + 2. Suppose -f - 4n - 4 = 0, uf = 2n + 3 - 1. Solve -3i - 12 = -fi for i. -4 Let j be (-8700)/(-70) + 2/(-7). Let u = -121 + j. Solve 15 = -0	{ "pile_set_name": "DM Mathematics" }
+ 339068 = 1808y for y. 74 Solve 21711r + 922 = 21671r - 1638 for r. -64 Solve -86 = -72q + 6q - 1251 + 241 for q. -14 Solve -128n + 591 = -34n - 3357 for n. 42 Solve -154q + 321q = -446q - 3418 - 2712 for q. -10 Solve 181s - 10074 + 364 - 2710 = -89s for s. 46 Solve -57l - 2334601 + 2336482 = 0 for l. 33 Solve 16146j - 16398j = 13608 for j. -54 Solve 4709u + 25224 - 30781 = -42172 - 29311 for u. -14 Solve -10k = -61k - 11k + 637 + 665 for k. 21 Solve 6034350 = 29u + 6035249 for u. -31 Solve -83182k + 83174k = 608 for k. -76 Solve -10w - 1059696 + 1063920 = 56w for w. 64 Solve -89m + 2559 - 53 + 652 = 221 for m. 33 Solve -8f + 2732 = 58f - 2218 for f. 75 Solve 1317r = -1021r - 9254 + 27958 for r. 8 Solve 0 = 912m - 5694 - 18018 for m. 26 Solve 2478v + 83954 = -147134 + 74974 for v. -63 Solve 0 = 637538c - 636822c - 3580 for c. 5 Solve -1902f + 19400 + 20979 + 7714 + 45105 = 0 for f. 49 Solve 12569y + 4588y - 477238 - 502331 = -224661 for y. 44 Solve -1260z - 1332z - 153134 = 737z for z. -46 Solve 0 = -8860m + 2765 + 212858 + 50177 for m. 30 Solve -65p - 61p - 52p = -101p + 3234 for p. -42 Solve 122940 = -5x + 122945 for x. 1 Solve 70k + 98k = -4k - 4988 for k. -29 Solve 366500 = 16917b - 13252b for b. 100 Solve -330j - 652 + 1236 + 11296 = 0 for j. 36 Solve 189b - 93b = -8b - 189b + 25198 for b. 86 Solve 2362o - 40559 = -2789o - 109675 - 142075 for o. -41 Solve -238z + 309z = 3137z - 82z - 95488 for z. 32 Solve 869u + 2260 + 35976 = 0 for u. -44 Solve 17219 = 59m - 353m - 2324 + 2785 for m. -57 Solve -646f - 4641f - 597f - 405996 = 0 for f. -69 Solve -607 - 145 = -1390j + 685j + 689j for j. 47 Solve 43m = -m + 3m + 33m - 424 for m. -53 Solve -83i - 93886 = -5175i + 119978 for i. 42 Solve 438c - 1169 = 1124c - 489c + 210 for c. -7 Solve -66z - 77z - 3740 = -58z for z. -44 Solve 0 = 221v + 109440 - 114965 for v. 25 Solve -17216 = 379j - 110j for j. -64 Solve -474q - 3884q - 256758 = 14301q - 51509 for q. -11 Solve -6086v + 169895 = 11977 - 94886 - 112356 for v. 60 Solve -369 = -38t + 331 - 1217 + 403 for t. -3 Solve 363736 + 65756 - 113452 = 11924q - 292084 for q. 51 Solve -1379f + 988 = -768 - 1002 for f. 2 Solve -2455 - 11540 = 1501l + 32616 + 40447 for l. -58 Solve 152s - 500 = 927 + 5565 for s. 46 Solve 45a - 61a - 16a + 16125 = 93a for a. 129 Solve 37477n = 37633n - 8736 for n. 56 Solve 2352f + 83628 = 5988f for f. 23 Solve 2642z - 250437 - 33043 = -1412z - 68618 for z. 53 Solve 0 = 105o - 539o + 5208 for o. 12 Solve -5236 + 46925 = 854s + 58s - 25s for s. 47 Solve -153y - 5585 = 86y + 5887 for y. -48 Solve 2097r + 845 - 364 = -40 - 1576 for r. -1 Solve 18i + 336 = 26i - 16i for i. -42 Solve -251z - 1015z + 258633 = 1515z for z. 93 Solve -780m - 114m = 176m - 14980 for m. 14 Solve 1999c + 27588 = 3854c - 2482c for c. -44 Solve -102829y + 23835 = -102439y - 4245 for y. 72 Solve -599c - 1100c + 4294 = 448c for c. 2 Solve 120q - 779 - 1107 + 2958 = -14q for q. -8 Solve -413z + 39z + 528843 - 482467 = 0 for z. 124 Solve 1903l + 13936 + 25375 = 6877 - 37977 for l. -37 Solve -6948770y + 6948927y = -20567 for y. -131 Solve -46v = -1454146 + 1455250 for v. -24 Solve 60251a - 61730a + 69513 = 0 for a. 47 Solve -586h - 35769 = -6469 for h. -50 Solve -4771m + 5465m - 26372 = 0 for m. 38 Solve -321u + 1046u + 882u + 112684 = -560u for u. -52 Solve 6377j - 5807j = -9120 for j. -16 Solve 2401n + 521n - 324342 = 0 for n. 111 Solve 28697 = 147c + 1041c - 4221 - 6286 for c. 33 Solve 16121i - 2520 = 16211i for i. -28 Solve -87i + 452 = 25i + 739 + 833 for i. -10 Solve 3472v - 4083 = 1336v - 27579 for v. -11 Solve -2009j - 6688 = 2177j - 65329 - 205077 for j. 63 Solve -420 + 738 - 3691 = 210b + 407 for b. -18 Solve 696p + 6613 = 138p - 152p - 60127 for p. -94 Solve 0 = -3700b + 3464b - 11328 for b. -48 Solve -426639 + 313715 = 763w for w. -148 Solve -3954p = 5165p + 4526p - 502942 - 711463 for p. 89 Solve -331x = -22818 + 8585 for x. 43 Solve -5901 + 3335 = 188m + 3450 for m. -32 Solve -39q - 516325 = -84q - 80q - 505825 for q. 84 Solve 0 = -224575m + 224258m - 8559 for m. -27 Solve -4704u = -4625u + 3160 for u. -40 Solve -69f - 569 + 713 - 831 = 1521 for f. -32 Solve -32369o = -38595o - 522984 for o. -84 Solve -73 - 53 = -636v + 678v for v. -3 Solve 110s + 140s = -182s + 20736 for s. 48 Solve -18549p + 1247295 = -1015683 for p. 122 Solve 1293j + 101j + 63495 = 149j for j. -51 Solve 57 = 63a - 510 for a. 9 Solve 13a - 964 = 182a + 2431 + 999 for a. -26 Solve 236c - 246c = 157c + 6680 for c. -40 Solve -4218d + 130843 = 1024d - 110289 for d. 46 Solve 40c - 303c - 11662 = 80c for c. -34 Solve 143 = 112y + 320y + 15263 for y. -35 Solve 1511o + 4623 = 2073o + 4061o for o. 1 Solve -182b + 3280b - 10574 - 42092 = 0 for b. 17 Solve 17w - 13200 = 12w - 117w - 142w for w. 50 Solve -8359g - 440503 = 3659g + 324154 + 100639 for g. -72 Solve -3239c - 5353c + 1552c - 135155 = -832115 for c. 99 Solve -1242 = 1060g - 1033g for g. -46 Solve -1093999x + 3515 = -1093904x for x. 37 Solve 3293 = -6m + 33m + 3m + 7m for m. 89 Solve -292d + 908d + 65205 = -833d for d. -45 Solve 104680 = 2021z - 22723 - 20130 for z. 73 Solve -148b - 180b + 90b - 19662 = 440b for b. -29 Solve 0 = -271z + 1475 - 1947 + 6163 for z. 21 Solve 852g + 236g + 50g - 18296 = -88 for g. 16 Solve -146376 = 6194o - 10046o for o. 38 Solve -116t + 261t - 380 = 107t for t. 10 Solve 2835y - 78874 = -1895y + 15726 for y. 20 Solve -236b - 65b - 4519 - 39427 = 0 for b. -146 Solve -1596f = -1046f + 12651 + 13221 + 37928 for f. -116 Solve 3504z + 13757 = -40 + 2476 - 6199 for z. -5 Solve -45s + 50s - 478 = -55s + 1622 for s. 35 Solve 30067 - 85634 = 7322z - 17854 + 240523 for z. -38 Solve -39g = -159g + 3000 for g. 25 Solve -9q + 836 + 158 = -72q + 238 for q. -12 Solve 583 - 2271 = -422v + 16880 for v. 44 Solve 2234s = 1864s + 28860 for s. 78 Solve 742z + 18674 = 1287z - 6118 - 11723 for z. 67 Solve 4865l + 5218 = -58027 for l. -13 Solve -194f - 24f - 3083 + 5164 = -6421 for f. 39 Solve 0 = 289i - 17147 + 1830 for i. 53 Solve 2148k - 3936k = -2180k + 9800 for k. 25 Solve 15028 = -4841n + 6379 - 10715 for n. -4 Solve 6v - 15024 = -307v for v. 48 Solve -440a + 108655 = -646a + 5077a - 32604 for a. 29 Solve -1753 = -2856q + 21387 + 8276 for q. 11 Solve 9440 = 53c + 32c - 243c + 78c for c. -118 Solve -56 - 787 = -68d + 721 for d. 23 Solve 2236 = -164b - 311 - 2373 for b. -30 Solve 1690x + 1217x + 3552x = 497343 for x. 77 Solve 1376o - 1518o - 284 = 0 for o. -2 Solve -24349 = -10t - 20t - 25429 for t. -36 Solve -251k - 1372 = 60k + 8580 for k. -32 Solve 315g = -380g + 621g + 4144 for g. 56 Solve -4093k + 2013k - 12299 = -2331k for k. 49 Solve -2767 + 36625 = -594h for h. -57 Solve -414n = 1665n - 76923 for n. 37 Solve -3825592b + 1311 = -3825611b for b. -69 Solve -299410 = -3755m + 371m - 5264 + 23950 for m. 94 Solve -440p = 765p + 443p - 71663 + 216687 for p. -88 Solve -313x - 1515 = -757x + 38889 for x. 91 Solve 1181 = 52u - 639 for u. 35 Solve -12n - 68n + 6716 = 61n + 5n for n. 46 Solve -288q - 341q - 9922 = -508q for q. -82 Solve 51n - 3493078 = -3492364 for n. 14 Solve -1455z + 5063z + 1087z + 42974 + 327931 = 0 for z. -79 Solve 26445 = -622v - 17427 - 12108 for v. -90 Solve -68796 = 5228k - 481808 for k. 79 Solve 1360662c = 1361005c + 24353 for c. -71 Solve 2994s + 9905s - 89444 - 233031 = 0 for s. 25 Solve 1099o + 480o - 81000 - 51636 = 0 for o. 84 Solve 10934q - 10627q = 8903 for q. 29 Solve -59454i + 59456i - 86 = 0 for i. 43 Solve -405c + 1686c - 157320 = -2652c for c. 40 Solve 175u = 10u - 11u - 65u + 17593 for u. 73 Solve 1058j + 1534j = -630j + 454302 for j. 141 Solve -239b + 1396 = -66b + 5908 + 1543 for b. -35 Solve 206135c = 206089c + 1012 for c. 22 Solve 0 = -104y - 7043 - 549 for y. -73 Solve 42g - 271 = 1074 - 127 for g. 29 Solve 206k - 4640 = 53k + 5152 for k. 64 Solve -1316 = 5140c - 5093c for c. -28 Solve 1010f + 767602 = -4498*f + 128674 for f. -116	{ "pile_set_name": "DM Mathematics" }
2064 = 1002t. Let n(i) = 2 + i - 1 - 2i. Give tn(h) - y(h). -h Let f = -17 - -20. Let b(q) = -3 + 6 + 6405773q*2 - q - 6405770q*2. Let l(d) = -7d*2 + d - 5. Give fl(s) + 5b(s). -6s*2 - 2s Let y(f) = -3f - 4. Let l(t) = 1. Let u be 8/16 - (2 + (-28)/(-8)). What is ul(h) + y(h)? -3h - 9 Let s(h) = 12h*3 + 6h*2 - 37h - 30. Let o(b) = 26b3 + 13b*2 - 82b - 61. Give 5o(w) - 11s(w). -2w3 - w2 - 3w + 25 Let f(m) = -m3 - m2 + m + 1. Let z(u) = -30u3 + 55 - 45u*2 - 48u - 66u + 159u - 10. Give -90f(x) + 2z(x). 30x3 Let c(y) = 8425469y*3 - 14671y*2 + 29342y + 29342. Let w(b) = -1723b3 + 3b*2 - 6b - 6. Calculate -6c(u) - 29342w(u). 3452u3 Let b(d) = 2d*3 - 4d*2 + d + 2. Let v(p) = -1929p*3 + 12860p*2 - 3215p - 6430. Determine 3215b(t) + v(t). 4501t*3 Let r(q) = -43q. Let b(z) = -644z. Suppose h + 3m + 43 = 0, -203m - 94 = 2h - 205m. What is hr(u) + 3b(u)? 46u Let x(y) = 11y - 27. Let r(k) = -6k + 14. Suppose 49c + 404 = 18c - 70c. What is cx(o) - 7r(o)? -2o + 10 Let w(o) = 30o3 - 3o*2 - 18o + 1. Let s(y) = -29y3 + 3y*2 + 21y - 1. What is 6s(q) + 7w(q)? 36q3 - 3q*2 + 1 Suppose 0 = 2v - 2y + 2, -38y - 3 = 3v - 39y. Let b(n) = -6n + 3. Let k(w) = w - 1. Calculate vb(j) - k(j). 5j - 2 Let i(z) be the third derivative of z5/60 - z4/4 - 11z3/6 - z2 - 121z. Let v(o) = 3o*2 - 17o - 32. What is -17i(l) + 6v(l)? l*2 - 5 Let i = 12 - 14. Let y(v) be the first derivative of -11/2v*2 - 11v - 43 - 3v3. Let d(l) = -2l*2 - 2l - 2. What is iy(t) + 11d(t)? -4t2 Let n(v) = -v2 - 17v. Let l(w) be the second derivative of w*4/4 + 25w3/3 - w2/2 + 5299w. What is 2l(k) + 7n(k)? -k2 - 19k - 2 Suppose -2 = -3w + 67. Suppose -4 = -9q + w. Let h(m) = -705m + 716m - 2m3 - qm*3. Let l(g) = 2g*3 - 4g. Give -3h(k) - 8l(k). -k*3 - k Let s(r) = 29r - 173. Let u be s(6). Let d(y) = -y - 1. Let z(v) = v + 6. Give uz(j) - d(j). 2j + 7 Let p(g) = -g*3 + 98g*2 + 1082g + 25. Let z be p(-10). Let m(x) = -2x2 - x + 3. Let w(q) = 2q*2 + q - 4. Calculate zw(y) + 4m(y). 2y*2 + y - 8 Let d(b) = -1543b + 2. Let w(k) = 1525k - 2. Determine 2d(l) + 3w(l). 1489l - 2 Let l(p) = 2p - 3. Let d(r) = 22r*2 - 4r - 19. What is d(i) + 2l(i)? 22i*2 - 25 Let l(w) = -3w*2 - 7w - 39. Let u(v) = 2v2 + 5v + 26. Determine 5l(d) + 8u(d). d*2 + 5d + 13 Let y(h) = -2 - 686h2 + 1 - 760h*2 + h + 1445h*2 + 0. Let n(k) = -4k*2 + 3k - 5. Suppose -5w = -4w - 5. Calculate wy(s) - n(s). -s2 + 2s Let m(n) = -338n2 + 133n + 8. Let t(k) = -85k2 + 31k + 2. Calculate -2m(p) + 9t(p). -89p2 + 13p + 2 Let w(y) = -59y2 + 2y - 1. Let u(n) = 2n2 - 4n. What is 2u(m) + w(m)? -55m*2 - 6m - 1 Let t(y) = 880y3 - 19y*2 + 5y - 17. Let s(m) = 1320m3 - 30m*2 + 8m - 27. What is 5s(j) - 8t(j)? -440j3 + 2j2 + 1 Let o(g) = g3 - 2g2 + g - 1. Let b(x) = 122x*3 - 10x*2 - 2. Determine b(r) - 5o(r). 117r3 - 5r + 3 Let c(h) = -7h2 + 15 - 12h*2 + 5h - 15 + 18h2. Let x(y) = y2 - 11y. What is 5c(s) + 3x(s)? -2s2 - 8s Let j(f) = -f + 998. Let c(p) = p - 499. What is -11c(s) - 6j(s)? -5s - 499 Let k(b) = -2250b - 10. Let q(x) = -1687x - 7. Determine -11k(a) + 15q(a). -555a + 5 Let o(x) = 22x3 + 70x*2 - 13x - 5. Let n(p) = 26p3 + 72p*2 - 15p - 6. What is -5n(r) + 6o(r)? 2r3 + 60r*2 - 3r Let v(x) = 9x2 + 40x - 237. Let b(h) = -h*2 - 5h + 1. Calculate 16b(w) + 2v(w). 2w2 - 458 Let g(x) = -2x2 - 6. Let w(n) be the third derivative of n5/60 - n*3/6 + 2834n*2. Give -g(a) - 3w(a). -a*2 + 9 Let m(w) = 8w*3 - 4w - 1. Suppose -245 = -55v + 104v. Let c(z) = -9z3 + 5z + 1. What is vc(k) - 6m(k)? -3k3 - k + 1 Let w(m) = -m + 7. Let t(k) = 4k - 73 + 49 - 3k + 18. What is -3t(y) - 2w(y)? -y + 4 Let p(a) = -5a*2 + 3282a - 56. Let l(d) = 14d2 - 9846d + 154. Determine -4l(q) - 11p(q). -q*2 + 3282q Let j(m) = -36m2 + 436m + 51. Let w(h) = -13h2 + 144h + 18. Give 6j(d) - 17w(d). 5d2 + 168d Let d(n) = -n*2 + 1. Let q = -1095 - -1094. Let a(i) = -60i*2 + 30. Give qa(p) + 30d(p). 30p*2 Let n = 4454 + -4449. Let g(i) = 3i*2 - 6i + 1. Let z(k) = 4k2 - 7k + 1. What is nz(l) - 6g(l)? 2l2 + l - 1 Let v be (-1)/(-18) - ((-120785)/522)/119. Let q(z) = 4 + 7 - 5z + 3z2 - 12z*2. Let u(i) = 4i*2 + 2i - 5. Let h = -8 + 13. Determine hu(g) + vq(g). 2g2 - 3 Let n(x) be the second derivative of -x5/20 + x4/4 - x3/6 + 2374x - 1. Let l(z) = -2z2 + 4z*2 - 3z*2. What is 3l(c) + n(c)? -c*3 - c Let f(u) = -1353u - 399. Let z(w) = 104w + 30. Give 2f(v) + 27z(v). 102v + 12 Let v(x) = -x - 1. Let c(o) = 14o + 4. Let p(w) = -c(w) + 6v(w). Suppose -d = -30d - 87. Let k(m) = 4m + 2. Calculate dp(s) - 16k(s). -4s - 2 Suppose -4t - 11 + 15 = 0. Let b be (1 - (-2 + t))9/18. Let s(l) = -3l*2 + l - 2. Let y(z) = z + 17z*2 - 37z*2 + 19z*2 + 0z. Determine bs(g) - y(g). -2g*2 - 2 Let j(l) = 161566819l*3 + 59741l*2 + 59741l + 59741. Let n(o) = 5409o3 + 2o*2 + 2o + 2. Determine -2j(a) + 59741n(a). 5431a3 Let f(g) = 2g*2 + 1726g + 5. Let t(w) = 3w2 + 1728w + 6. Give 6f(n) - 5t(n). -3n2 + 1716n Let q(d) = -2. Let y(f) = f - 142. Give 6q(p) + y(p). p - 154 Let g(q) = -4q - q*2 + 7 - 7 + 3q. Let z(k) = -4k2 - k + 2. Let c(d) = d3 - 16d*2 - 20d + 56. Let x be c(17). What is xg(s) - z(s)? -s2 - 4s - 2 Let y(v) = 20v3 - 8v*2 + 89v + 17. Let g(a) = -6a3 + 3a*2 - 30a - 5. Determine -7g(s) - 2y(s). 2s3 - 5s*2 + 32s + 1 Let p(a) be the first derivative of 17a3/3 - 5a*2/2 - 5a + 2. Let h(v) = -357906 - 38v2 + 7v + 357913 + 13v2. Calculate -5h(j) - 7p(j). 6j*2 Let m be 60 - (-6 + 4 - -2). Let y be (m/(-35))/(3 - 38/14). Let k(t) = t - 20 - 2t + 9. Let l(j) = -j - 10. What is yl(n) + 5k(n)? n + 5 Let s(u) = -7u + 3. Let y = -159867 - -159851. Let z(f) be the first derivative of 18f*2 - 16f + 1. Determine ys(t) - 3z(t). 4t Let n = -51 - -54. Let c be (n/9)/(3/18). Suppose 4a + cm - 3 = 11, -2a + 3m = 13. Let i(v) = -2v*2 - 5v - 2. Let h(f) = f + 1. What is ai(k) + 3h(k)? -2k2 - 2k + 1 Let k(h) = 2h + 405. Let x(r) = -10r - 1621. Calculate 9k(t) + 2x(t). -2t + 403 Let h(s) = 226s*2 + 9s - 3. Let f(z) = -453z2 - 22z + 8. Calculate -2f(t) - 5h(t). -224t2 - t - 1 Let n(v) = -10v - 2. Let m be n(0). Let k(i) be the first derivative of -i*2 - 3i - 3. Let p(o) = -o - 1. Give mk(g) + 5p(g). -g + 1 Let s(z) = -366z3 + 10z*2 + 5z - 5. Let v(w) = -1834w3 + 55w*2 + 27w - 27. Give 11s(n) - 2v(n). -358n3 + n - 1 Let o(f) = -88f*2 + 440f - 3. Let m be o(5). Let j(i) = 3i2 + i + 3. Let q(g) = -g + 1. Calculate mq(z) - j(z). -3z2 + 2z - 6 Let p(q) = 20q3 - 9q*2 + 11q - 6. Let t(d) = 20d3 - 12d*2 + 11d - 8. Calculate 4p(z) - 3t(z). 20z3 + 11z Let g(r) = 2371r + 48. Let t(s) = -4741s - 88. Give -11g(v) - 6t(v). 2365v Suppose 0 = 2q - 155 + 159. Let l(r) = -2r - 5. Let v(u) = u3 - 5u - 10. Suppose -55 = -12m + 5. What is ml(x) + qv(x)? -2x*3 - 5 Let b(d) be the third derivative of 17d6/120 + d5/4 - 11d4/24 + 2d*3/3 - 5587d*2. Let h(v) = -9v*3 - 8v*2 + 6v - 2. Give 6b(a) + 11h(a). 3a3 + 2a*2 + 2 Let c(s) = 84s + 28. Let f(n) = -34n - 15. Let l(z) = -2c(z) - 5f(z). Let r(y) = -4y - 39. What is 7l(v) + 4r(v)? -2v - 23 Let k(c) = -c3. Let l(t) = -872t + 5233. Let f be l(6). Let y(s) = 19s3 - s2 + 2s. Calculate fk(m) + y(m). 18m3 - m2 + 2m Let s(m) be the first derivative of m3/3 - 2m + 8228. Let d(h) = h + 4. Let r(n) = -n*2 + 1. Let a(z) = -d(z) - 3r(z). What is -2a(g) + 7s(g)? g*2 + 2g Let s(t) = -t*2 + 5t + 34. Let l(g) be the third derivative of g5/60 - g4/4 - 35g3/6 - 66g*2 - g - 11. What is 3l(w) + 4s(w)? -w2 + 2w + 31 Suppose 2t + 32 = -4o, 0 = 6t - 5t + 3o + 20. Let x(r) = r2 - r - 1. Let v(p) = 16p*2 + 8p + 8. Determine tx(u) - v(u). -24u*2 Let r(c) = 14c*2 - c - 3. Let s(m) = -12000m*2 - 4m - 18.	{ "pile_set_name": "DM Mathematics" }
1)/(-2))/((-2)/4). Let v be (-2 - (-24)/3) + m. Suppose l + vk = 22, 2l + k - 31 = -2l. Calculate the least common multiple of l and 3. 21 Suppose 27 = f + 19. Let i = -5 + 13. What is the lowest common multiple of f and i? 8 Suppose -7f + 2f = 5w - 80, 0 = 3f - 6. Calculate the lowest common multiple of 18 and w. 126 Let z(i) = i2 + 3i + 2. Let k be z(-2). Let w(g) = g2 - g + 4. What is the least common multiple of 8 and w(k)? 8 Let k(y) = -y2 + 2y + 3. Let m be k(3). Find the common denominator of (156/8 + m)/(-1) and -79/22. 22 Let p(j) = j3 + 11j*2 + 8. Let d be p(-11). Calculate the common denominator of 89/10 and (-180)/(-21)3/d. 70 Calculate the common denominator of 17/8 and 4/(-18) - 2631/432. 16 Suppose -m + 28 = 3m. What is the smallest common multiple of (11 + (-2)/(-2))/1 and m? 84 Let g = -104 - -125. What is the lowest common multiple of g and 9? 63 Let o = -4 + -5. Calculate the common denominator of o and 2/(44/(-32) + 2). 5 Let o = 23 - 68/3. Find the common denominator of o and (8/84)/((-6)/532). 9 Let i(s) = s3 + 3s*2 - 9s - 5. Calculate the least common multiple of 3 and i(-4). 15 Let d = 55 + -35. What is the least common multiple of 14 and d? 140 Find the common denominator of ((-93)/(-8))/(2/(-8)) and -71/20. 20 Let a = 166032 + -660699/4. Let k = -664 + -206. Let v = k + a. What is the common denominator of v and 137/6? 12 Let r = -6 + 20. What is the smallest common multiple of 6 and r? 42 Let m = 3549017/1322620 - -2/198393. Calculate the common denominator of m and (-5 - 235/20) + (6 - 4). 60 Let n = -384353/24 + 16009. Calculate the common denominator of n and 53/48. 48 Suppose -4j + 5v = 15, -2j - 4 - 1 = -5v. Let h(u) = -u + 13. Calculate the smallest common multiple of h(j) and 10. 90 Suppose -3s = -4c - 74, 4s = 3c + 53 + 41. What is the smallest common multiple of s and 2? 22 Suppose a - 2u + 0u = 20, 5u = 5a - 75. Suppose 4x - 39 = x. Let c = 19 - x. What is the smallest common multiple of c and a? 30 Let p(w) = -w + 2. Let q be p(-6). Suppose 0 = -2n + q + 10. Calculate the least common multiple of 5 and n. 45 Let f = -130 - -418/3. Calculate the common denominator of f and (-4)/(-6) - (-247)/(-6). 6 Let w = 48 - 76. Let y be 46780/w - (-2)/(-7). Let o = -11722/7 - y. What is the common denominator of o and 13? 7 Let o be ((-1)/(-7))/(16/(-155464)). Let y = 1381 + o. Find the common denominator of y and -35/4. 28 Let a(y) = -10y2. Let q be a(-1). Let k = -12841/7912 + -2/989. Calculate the common denominator of ((-17)/q)/((-16)/(-30)) and k. 16 Suppose 2h + 4r + 6 = -4, -20 = 5h + 5r. What is the least common multiple of 18 and (0 - (h - 15)) + -2? 144 Suppose 40 = -0b + 5b. Suppose 0 = -u - 2z - 12, -2z + 0z = -4u - b. Find the common denominator of 87/16 and (-2)/8(-58 - u). 16 Find the common denominator of -2 - (-4 + (-310)/(-12)) - -1 and 127/6. 6 Suppose -96 = -21p + 13p. Let o(q) = 5q - 1. What is the least common multiple of o(3) and p? 84 Suppose b - 1 = 1, 2l - 5b = -6. Let k = 4 + l. Calculate the smallest common multiple of 6 and k. 6 Suppose 13 = 2t - 27. What is the least common multiple of 12 and t? 60 Let q(i) = i*3 - 10i*2 + 12i - 5. Let t = 3 + 6. What is the lowest common multiple of 10 and q(t)? 110 Suppose -5n + n = 108. Calculate the lowest common multiple of (3 + n/15)5 and 6. 6 Suppose -4b - f = 47, -3f = 3b - 4b - 2. Let d = b + 12. What is the smallest common multiple of 8 and d? 8 Suppose -5v - 5h + 20 = 0, -4v - 3h = -6h - 37. Suppose 112 - 24 = 11p. What is the smallest common multiple of p and v? 56 Let u(g) = 2g - 12. Calculate the lowest common multiple of u(11) and 1. 10 Find the common denominator of -83/18 and 3/2329/(-210). 180 Suppose 23 = -2b - 21. Let q = 25 + b. Calculate the least common multiple of 2/(-8) - (-45)/4 and q. 33 Let r be 0 - ((-579)/147 - -3). Let p = -59/49 - r. Find the common denominator of p and (-22)/(-10)(-15)/9. 21 Let h be (-18)/42/(-3). Let d be (-2 + (4 - h))131. Calculate the common denominator of d/(-6) + 0 + 2 and 1/8. 24 Let n = 11757/11 - 1070. Suppose -4p + 2p = 2g - 328, -4g + p = -661. Suppose -g = -0d + 5d. Calculate the common denominator of n and d. 11 Suppose 4o + 228 = -4k, -o - 3k = 39 + 20. Let i be 6/2 - (-1 + o). Calculate the common denominator of 63/10 and (-2)/(i/(-249)) - -3. 10 Let v = 218 - 110. Calculate the common denominator of -2 + (1419/v)/11 and 19/10. 180 Let h = 5 + -3. Suppose -hy + 8 = -y. Let x = 4 + -1. Calculate the least common multiple of x and y. 24 Let a be 2/((-1)/2 - -1). Suppose 0 = 3k - ak + 9. Find the common denominator of 2/4 - (-56)/k and 57/10. 90 Suppose 9b - 168 = -3b. What is the least common multiple of b and 22? 154 Calculate the common denominator of 101/22 and (9/2)/((-10)/(-13)). 220 Let n be -1 + -5064/(-2040). Let q = n + 3217/510. What is the common denominator of 248/(-45) + 6/15 and q? 90 Let g(a) = a + 2. Let r(k) = k2 - 6k + 7. Let j be r(5). Let x be g(j). What is the common denominator of -49/10 and ((-2)/12)/(x/294)? 20 Calculate the common denominator of (-23)/(20/2-1) and 67/6. 30 Let d be (-2)/(-1) - 0 - -2. Let f be (d/(-30))/(316/(-22062)). Let c = f + 23/79. Find the common denominator of 23/3 and c. 15 Suppose -s + 0s = -2. Let n(a) = -a. Let r(k) = k - 2. Let j(w) = -4n(w) + r(w). What is the least common multiple of 9 and j(s)? 72 Find the common denominator of -101/4 and -4 + (-1)/(-18)(-3927)/(-14). 12 Suppose p + a = 4a + 193, p = -4a + 214. Calculate the common denominator of p/(-8) - 4/(-2) and -3/8. 8 Let o be 2/((2 - 3)-1). Let k = -779/204 - 1/68. Calculate the common denominator of 55/10 - o/6 and k. 6 Let s be 2 + -366/(-9). Let p be 2/((s/15)/4). Suppose 2w - 33 = -p. What is the lowest common multiple of w and 14? 14 Suppose k = m - 3k - 17, 5k + 90 = 4m. Suppose o - 4q + 10 = 0, 3q = -3o + 4q + m. What is the least common multiple of 10 and o? 10 Let m = -2931 + 23405/8. Let q = 59/40 + m. Find the common denominator of q and -107/14. 70 Let i(f) = 3f2 + 4f - f*3 - 3f - 2 - 4f. Let g be i(3). Let x(o) = o3 + 11o*2 - o - 10. What is the least common multiple of 4 and x(g)? 4 Suppose -5n + 5y = -30, 2n + 2y = -8 - 0. What is the common denominator of 97/(-20)(174/12 - 12) and n + -8(-8)/6? 24 Let i(y) = -2y - 9. Suppose 4u + 32 = 8u. What is the lowest common multiple of i(-8) and u? 56 Find the common denominator of -91/2 and (-17)/5 + (-8)/10. 10 Let t be 274/20(-321)/(-6). Let z = -735 + t. Calculate the common denominator of z and -73/6. 60 Calculate the smallest common multiple of ((-36)/(-42))/(5/210) and 12. 36 Let p = -297683019977/1947 - -152893175. Let g = p + 10/177. Find the common denominator of g and ((-4)/6)/(18/129). 99 What is the least common multiple of 266 and 2/(56/12) + 302/14? 2926 Let p be 3/15 + 83198/10. Let g = p - 83109/10. Find the common denominator of g and 5/(-8)20/(-3). 30 Suppose -3b + 56 = 3p - 5b, 5p - b - 84 = 0. Find the common denominator of 67/2 and (-4)/(-10)(-410)/p. 4 Let x be (1/3 + 1)3. Suppose 39 = 4y + 2m + 13, 2y - xm = 28. What is the lowest common multiple of 14 and (-2)/y + 445/20? 154 Find the common denominator of -36/5 and (-501)/(-84) + (-8)/4. 140 Suppose -7c - 9 = -3l - 3c, l - 5c - 3 = 0. Suppose -i = lt - 10, -5t + 6 = -5i - 44. Let u = -19 + 22. What is the smallest common multiple of u and t? 15 Let q(h) = -2h + 2. Calculate the lowest common multiple of q(0) and 14. 14 Let q be ((-992)/(-6))/(4/(-24)). Let c = 5722004413/5755257 + -1/639473. Let t = c + q. Find the common denominator of t and 25/7. 63 What is the common denominator of 29/24 and (-6)/(-4)(-250)/18? 24 Let n = -283459/16 + 17722. What is the common denominator of n and -71/22? 176 Let j = 37408/9 - 4149. Calculate the common denominator of -13 and j. 9 Let c(j) = -j3 + 5j*2 - 6j - 5. Let a(l) = -l*2 + l + 1. Let f(k) = 3a(k) - c(k). Let n = -11 - -18. Calculate the lowest common multiple of 6 and f(n). 66 What is the common denominator of (113/(-36))/(42/(-9) - -5) and -7/12? 12 Find the common denominator of -3 - (-5)/(40/61) and -85/12. 24 Let w = 1294/9 + -21379/14	{ "pile_set_name": "DM Mathematics" }
- r. Let k(w) = 2w. Calculate p(k(c)). -104c*2 Let z(l) = -3l. Let r(b) = -1141b2 + 756b*2 - 1163b*2. Give r(z(v)). -13932v*2 Let a(p) = 474p2. Let d(n) be the second derivative of -n4/4 - 1200n. What is d(a(x))? -674028x*4 Let u(t) = -779t. Let h(f) = -680 - 682 + f + 1362. Calculate h(u(d)). -779d Let g(h) = -10h*2. Let q(l) = -757964l. Give g(q(o)). -5745094252960o2 Let x(g) = -3g*2 - 82654. Let l(n) = 36n. Give x(l(i)). -3888i2 - 82654 Let d(g) = -21g - 78. Let m(a) = -5a - 18. Let l(p) = 2d(p) - 9m(p). Let v(s) = -18s*2. Determine v(l(j)). -162j*2 - 648j - 648 Let u(b) = 3b. Let w(q) = 2784410q + 5. Determine w(u(f)). 8353230f + 5 Let h(a) = 125a + 15. Let v(y) = 18y + 2. Let j(k) = -4h(k) + 30v(k). Let l(o) = -6o. Let p(f) = 19f. Let u(s) = -3l(s) - p(s). Calculate j(u(b)). -40b Let v(i) = 89i. Let m(n) = -4188n - 183. Determine m(v(j)). -372732j - 183 Let v(z) be the third derivative of -z*5/10 + 4z2. Let j(p) be the second derivative of p4/4 + 14p - 3. Calculate v(j(q)). -54q*4 Let o(i) = 4i - i + 2i2 - 3i. Let n(m) be the third derivative of -77m5/30 - 3391m*2. Determine n(o(l)). -616l*4 Let f(j) = 9j - 34. Let s(r) = 254r2 + 5r - 25. Give s(f(z)). 20574z2 - 155403z + 293429 Let p(q) = 13q2. Let j(r) = 3r*2 - 17 - 2 + 19r + 19 - 2r2. Calculate p(j(b)). 13b*4 + 494b*3 + 4693b*2 Let o(b) = -8b. Let j(i) = 572i + 260. Let w(s) be the second derivative of 13s*3/3 + 6s*2 - 30s + 1. Let g(u) = -3j(u) + 65w(u). What is g(o(n))? 208n Let o(q) be the first derivative of 7q*2 - 1425. Let v(a) = 284a*2. Determine o(v(b)). 3976b*2 Let x(o) = 5o. Let z(a) = -a*2 + 10222a + 37. What is z(x(m))? -25m2 + 51110m + 37 Let s(d) = 66d2 + 3d. Let p(j) = -117j - j2 - 63j + 180j. What is p(s(t))? -4356t*4 - 396t*3 - 9t*2 Suppose -8l + 3l = -15. Suppose -3o = -2o - l. Let r(c) = 52c - oc - 2c. Let y(f) = f. Calculate r(y(x)). 47x Let b(k) be the first derivative of 23k*2 - 2073. Let y(v) = -2v*2. Calculate y(b(i)). -4232i*2 Suppose -d = -4z + 16, 4z - 8 = -9d + 12d. Let h(j) be the second derivative of 0j*2 + 0j*3 - 11j - 29/12jd + 0. Let t(n) = -2n. What is t(h(r))? 58r2 Let i(y) = -y + 8. Let x(s) = 9s - 53511. What is x(i(h))? -9h - 53439 Let k(i) be the second derivative of -i3/3 + 276i. Let h(n) = -21n + 39n + 1 + 11n. What is k(h(w))? -58w - 2 Let i(n) be the second derivative of n*4 + 5n*3/2 + 1461n. Let h(d) = d. What is h(i(m))? 12m2 + 15m Let o(n) be the second derivative of -n*4/12 - 109n*2/2 + 251n. Let k(w) be the first derivative of o(w). Let f(p) = -18p2 + 1. Calculate f(k(l)). -72l*2 + 1 Let k(h) = 2h. Suppose -6t = 6t - 48. Suppose -c = c - t. Let w(a) = 105ac - 31a*2 - 50a*2. Give w(k(p)). 96p*2 Let p(k) = 1739k*2. Let g(c) = -4333348c + 4333348c - c2. Give p(g(d)). 1739d*4 Let f(n) = -17n*2 + 1. Let k(d) = -26d*2 + 26d + 13. Let o(r) = 7r2 - 6r - 3. Let t(l) = 3k(l) + 13o(l). Calculate f(t(v)). -2873v4 + 1 Let d(b) = -25b - 2 + 2 - 6 + 6. Let s(a) = 1. Let j(w) = w + 11. Suppose 2 = 3n - 4. Let o(x) = nj(x) - 22s(x). What is o(d(y))? -50y Let q(x) = -1 - 6 - 48x + 8 - 1. Let v(w) = 25w. Determine q(v(f)). -1200f Let u(o) = -o2. Let t(y) = 250650y + 32306. Let c(f) = 1124f + 145. Let a(s) = -1114c(s) + 5t(s). Determine u(a(h)). -1240996h*2 Let b be 1 + 86 + -2 + 3. Suppose n + 3n - b = 0. Let u(d) = -n + d + 48 - 26. Let z(m) = -6m2 - 5m. Determine u(z(g)). -6g2 - 5g Let s = 767 + -763. Let m(q) = 36q + 5 - 2q*2 - 37q - 5 - sq2. Let l(w) = -9w. Give m(l(i)). -486i2 + 9i Let q(m) = -35m + 7490. Let k(u) = 18u*2 - 2u. Determine q(k(p)). -630p2 + 70p + 7490 Let w(s) = 4s2. Let p(r) = -36r*3 - 2r*2 - 5r - 3. Let u be p(-1). Let q(a) = -96a2 + 5 - 5 - ua + 36a. What is q(w(y))? -1536y*4 Let b(y) = -3y. Let i(u) = 780u2 + 992u. Determine i(b(f)). 7020f2 - 2976f Let v(u) = 225u. Let j(y) = 205y + 360. What is j(v(q))? 46125q + 360 Suppose -12u + 21 = -5u. Let m(b) = 0b - 2b + ub. Let i(j) = 9j2 + 4. Let c(h) = -28h*2 - 11. Let p(k) = 4c(k) + 11i(k). Give m(p(v)). -13v*2 Let u(j) = -2j*2 - 150j - 22724. Let z(h) = 3h. Determine u(z(o)). -18o*2 - 450o - 22724 Let q(h) = 8h - 18. Let r(m) = -45m + 102. Let k(i) = -34q(i) - 6r(i). Let o(j) = -355j2 - 10j + 2. Determine k(o(u)). 710u2 + 20u - 4 Let i(a) = a + 3. Let u(r) = 2r + 7. Let f(m) = 7i(m) - 3u(m). Let y(j) = 1074j. Calculate y(f(z)). 1074z Let h(c) = 19c*2. Let p(y) be the second derivative of -23y4/4 - y3/3 + 14y - 333. Determine p(h(g)). -24909g*4 - 38g*2 Let a(t) be the first derivative of 1163t*2 - 3t + 12645. Let p(m) = 2m2. Give p(a(l)). 10820552l*2 - 27912l + 18 Let v(q) = -132120724q. Let h(k) = 4k. What is v(h(i))? -528482896i Let q(i) = 5i*2 + 153. Let s(m) = -3m*2 - 68. Let z(g) = -4q(g) - 9s(g). Let h(k) = 3k - 1201. What is h(z(v))? 21v2 - 1201 Let c(m) = 2m. Let b(f) = 21f + 34. Let y(x) = -22x - 28. Let t(j) = 5b(j) + 6y(j). Let z(q) = -q - 1. Let n(u) = t(u) + 2z(u). Calculate c(n(g)). -58g Let g(i) = -303i + 33. Let r(j) = -19j + 2. Let f(h) = -2g(h) + 33r(h). Let o(k) = -42 - 2k2 + 136 - 43 - 51. Determine o(f(l)). -882l*2 Let f(z) be the first derivative of -5z*2/2 - 1067. Let m(l) = 2l - 348. Determine m(f(w)). -10w - 348 Let o(w) = -18w. Let x(s) = -2s - 3. Let j(g) = 143g + 231. Let i(z) = 4j(z) + 308x(z). Determine i(o(l)). 792l Let u(c) = -c2. Let n(b) = 2 - 2 + 9 - 6 + 3 + 14b. Determine u(n(p)). -196p2 - 168p - 36 Let o(h) = -27h. Let q(m) = -18m*2 + m + 91. Calculate q(o(k)). -13122k*2 - 27k + 91 Suppose -164 = -24w + 76. Let c(i) = -w + 47i + 10 - 10i. Let v(g) = -4g*2. Determine v(c(s)). -5476s*2 Suppose -156r + 18 = -301r + 151r. Let f(a) be the third derivative of 0a - 2a*2 + 0 + 11/60a*5 + 0a*4 + 0a*r. Let b(g) = -2g. Give b(f(k)). -22k2 Let d(q) = -3q*2 + 21. Let l(n) = -114n + 20. Calculate d(l(y)). -38988y2 + 13680y - 1179 Suppose 10 = y + 5d - 6d, 0 = -4y + 5d + 44. Let i(g) = g - 6g + yg + g. Let x(r) = -r - 7r - 9r + r. Calculate x(i(b)). -32b Let k(w) = -2 + 4 - 7w + 2w - 5w. Let g(h) = -20h + 5. Let u(d) = -4g(d) + 10k(d). Let i(l) = 13l + 13l - 27l. Calculate i(u(j)). 20j Let r(a) = 83a + 19. Let t(p) = -71p - 18. Calculate r(t(n)). -5893n - 1475 Let u(v) = 11v - 8382 + 8382. Let m(x) be the second derivative of -x3/6 + x. Give u(m(h)). -11h Let r(z) = 18 + 6 - 3 - 3z + z. Let m be r(3). Let h(x) = -5 + m - 23x + 25x. Let y(w) = w2. What is y(h(l))? 4l*2 + 40l + 100 Let g(i) = 2i2. Let p(j) = -1184837j*2 + j + 5. Determine p(g(h)). -4739348h*4 + 2h*2 + 5 Let w(d) = 29d*2 - 392330d. Let r(f) = -10f. Give w(r(m)). 2900m*2 + 3923300m Let g(y) = 8664y2 - 26y. Let t(j) = -406j2. Calculate g(t(r)). 1428139104r*4 + 10556r*2 Let i(o) = 3o*2. Suppose 67p = 36p + 35p - 32. Let x(q) be the first derivative of 5/3q3 + 0q + 0q2 - p. What is i(x(h))? 75h*4 Let b(h) = -h + 0h + 11 + 2h - 2h. Let o(j) be the third derivative of j*4/24 - 23261j*2. What is o(b(t))? -t + 11 Let o(y) = 4y. Let n(z) = -5z. Let v(r) be the third derivative of -34r*2 + 0r*3 + 0r + 5/24r4 + 0. Let g(x) = -5n(x) - 4v(x). What is g(o(i))? 20i Let f(m) be the first derivative of m*2 - 9873. Let u(k) = -24k*2 - 39k + 2. Determine u(f(g)). -96g2 - 78g + 2 Let r(n) = -1008n2 + 3282. Let p(x) = 2x. Determine p(r(q)). -2016q2 + 6564 Let j = 36 - 34. Let z be j((-14)/(-4) - 2). Let a(i) = -3 + 3 + 0 + zi. Let q(w) = -5w*2. Calculate q(a(r)). -45r*2 Let i(n) = -5393n. Let f(g) = -3g2 + 67. What is f(i(j))? -87253347j*2 + 67 Let m(o) = -42o*2. Let l(k) be the third derivative of 10k + 0k3 + 1/24k*4 + 2k*2 + 0. Determine m(l(g)). -42g*2 Let v(i) be the third derivative of -17i*5/60 - 22i*2 + 45i. Let n(k) = 2k2 + 28k. Determine n(v(l)). 578l4 - 476l*2 Let b(t) be the second derivative of 19t*5/12 - 133t*2/2 + 31t +	{ "pile_set_name": "DM Mathematics" }
2}? 0 Calculate prob of sequence ee when two letters picked without replacement from {k: 2, c: 6, f: 1, u: 2, e: 3}. 3/91 Calculate prob of sequence nznp when four letters picked without replacement from {z: 8, p: 7, n: 3}. 7/1530 Calculate prob of sequence dw when two letters picked without replacement from uwuduuwuulzdppuuduu. 1/57 Two letters picked without replacement from rppuprr. Give prob of sequence pr. 3/14 Three letters picked without replacement from {a: 3, k: 3}. What is prob of sequence akk? 3/20 Three letters picked without replacement from ufj. What is prob of sequence uuf? 0 Calculate prob of sequence iib when three letters picked without replacement from {i: 5, b: 2}. 4/21 Calculate prob of sequence jo when two letters picked without replacement from uuuujuuvuiixuovuuu. 1/306 Two letters picked without replacement from vvvtvvnhhvdthdvhg. What is prob of sequence hg? 1/68 Calculate prob of sequence mm when two letters picked without replacement from mmmhmmxmmmmmm. 55/78 What is prob of sequence md when two letters picked without replacement from {q: 3, m: 4, f: 3, d: 1}? 2/55 What is prob of sequence bxx when three letters picked without replacement from {b: 5, x: 9}? 15/91 Three letters picked without replacement from rgrrgrugrruru. Give prob of sequence ggg. 1/286 Calculate prob of sequence rtr when three letters picked without replacement from ttttfrfrt. 5/252 Calculate prob of sequence xs when two letters picked without replacement from grgrrwxsxzrgr. 1/78 Three letters picked without replacement from iitzisiiviqisvtq. Give prob of sequence vvz. 1/1680 What is prob of sequence ln when two letters picked without replacement from sqnqqqnmml? 1/45 Three letters picked without replacement from {q: 5, v: 2, g: 9}. Give prob of sequence vqg. 3/112 Four letters picked without replacement from {d: 2, o: 9}. What is prob of sequence oooo? 21/55 Two letters picked without replacement from dhkbkjhbz. What is prob of sequence kj? 1/36 Two letters picked without replacement from {q: 2, v: 4, n: 9, k: 3}. What is prob of sequence vn? 2/17 Two letters picked without replacement from {c: 2, i: 3}. Give prob of sequence ci. 3/10 Two letters picked without replacement from {f: 6, v: 2}. What is prob of sequence fv? 3/14 Two letters picked without replacement from {o: 1, t: 1, f: 1}. What is prob of sequence tf? 1/6 Two letters picked without replacement from {b: 6, p: 13}. What is prob of sequence pp? 26/57 Two letters picked without replacement from {t: 9, h: 2, q: 3, g: 5}. What is prob of sequence qg? 5/114 Calculate prob of sequence mmg when three letters picked without replacement from {m: 3, g: 2, v: 5}. 1/60 Calculate prob of sequence sff when three letters picked without replacement from {s: 2, g: 6, a: 3, f: 3, p: 1, v: 5}. 1/570 Calculate prob of sequence pepp when four letters picked without replacement from {p: 8, e: 3}. 7/55 Two letters picked without replacement from aqqaajaooqqqaaaa. Give prob of sequence oj. 1/120 Three letters picked without replacement from {a: 2, b: 7, g: 9}. Give prob of sequence gab. 7/272 Four letters picked without replacement from {e: 5}. Give prob of sequence eeee. 1 Four letters picked without replacement from hkkrkhkkllkhkkhkklkh. Give prob of sequence hhrl. 1/1938 Calculate prob of sequence jdj when three letters picked without replacement from {d: 8, j: 6, l: 1}. 8/91 What is prob of sequence ur when two letters picked without replacement from {z: 1, r: 1, y: 1, u: 1, p: 1}? 1/20 Calculate prob of sequence xkty when four letters picked without replacement from pppxppppypnpktpnptnp. 1/58140 Calculate prob of sequence uc when two letters picked without replacement from {u: 8, a: 7, w: 1, c: 1}. 1/34 What is prob of sequence qqh when three letters picked without replacement from eheqqheeeeeeqeeheqh? 8/969 Two letters picked without replacement from {b: 15, t: 2, p: 3}. Give prob of sequence pb. 9/76 Calculate prob of sequence wb when two letters picked without replacement from {p: 5, h: 1, b: 2, w: 1}. 1/36 Two letters picked without replacement from tyjxytf. What is prob of sequence xf? 1/42 Three letters picked without replacement from qqyqqtqyhttyqqthyyq. Give prob of sequence htt. 4/969 Four letters picked without replacement from {e: 8, g: 5}. What is prob of sequence gege? 28/429 Calculate prob of sequence xyxo when four letters picked without replacement from {y: 1, o: 3, w: 1, x: 2}. 1/140 Four letters picked without replacement from {x: 4, y: 4, z: 4, u: 3}. What is prob of sequence yzxx? 8/1365 Three letters picked without replacement from {r: 5, n: 5}. Give prob of sequence nnr. 5/36 What is prob of sequence jc when two letters picked without replacement from jjjjjcjjccjcjjjcjc? 4/17 Calculate prob of sequence fp when two letters picked without replacement from mpmfppppmppmmpppmp. 11/306 Three letters picked without replacement from {o: 1, l: 6, x: 4}. What is prob of sequence xlo? 4/165 Two letters picked without replacement from {k: 2, m: 4}. Give prob of sequence kk. 1/15 Three letters picked without replacement from adlddfdbdbddbbxd. What is prob of sequence dxa? 1/420 Two letters picked without replacement from {s: 4, t: 5, q: 5}. What is prob of sequence qs? 10/91 Three letters picked without replacement from {o: 1, h: 1, b: 3, d: 1, a: 11, e: 3}. What is prob of sequence ohd? 1/6840 Calculate prob of sequence lqlq when four letters picked without replacement from wlwwqlqwwwvlb. 1/1430 Two letters picked without replacement from arrarrrr. Give prob of sequence ar. 3/14 Four letters picked without replacement from {j: 7, z: 7}. Give prob of sequence jjjz. 35/572 Calculate prob of sequence jjq when three letters picked without replacement from wwiijijiwwqiji. 1/364 Four letters picked without replacement from {a: 3, r: 4, p: 1}. What is prob of sequence rrpr? 1/70 Three letters picked without replacement from {y: 5, a: 5, o: 3}. Give prob of sequence yao. 25/572 Calculate prob of sequence zzz when three letters picked without replacement from zzztzoozo. 5/42 Two letters picked without replacement from {f: 6, c: 13}. What is prob of sequence fc? 13/57 What is prob of sequence zps when three letters picked without replacement from ezppsepespe? 4/495 Four letters picked without replacement from {k: 3, f: 12}. Give prob of sequence kfff. 11/91 Two letters picked without replacement from {q: 4, p: 9, e: 2, s: 1, a: 2, c: 2}. What is prob of sequence as? 1/190 Calculate prob of sequence mh when two letters picked without replacement from dsehhemdhhhd. 5/132 Four letters picked without replacement from {p: 4, m: 10}. Give prob of sequence pmmm. 120/1001 What is prob of sequence ee when two letters picked without replacement from {e: 11, f: 1, g: 1}? 55/78 Two letters picked without replacement from qmmqmbqbjq. What is prob of sequence jb? 1/45 Calculate prob of sequence yg when two letters picked without replacement from {g: 3, y: 3}. 3/10 Two letters picked without replacement from bbhhhbbbhbhhb. Give prob of sequence hh. 5/26 Three letters picked without replacement from kkqkwww. What is prob of sequence www? 1/35 Three letters picked without replacement from {g: 1, v: 1, m: 3, p: 3, o: 4, n: 3}. What is prob of sequence vpm? 3/910 Four letters picked without replacement from fjjdd. What is prob of sequence djdf? 1/30 What is prob of sequence rb when two letters picked without replacement from qlpllqxlqbrbxr? 2/91 What is prob of sequence jhh when three letters picked without replacement from hhjhhhhh? 1/8 Three letters picked without replacement from iibiiiibbbbbbbbi. Give prob of sequence iii. 1/16 What is prob of sequence ibq when three letters picked without replacement from {b: 4, q: 1, i: 3}? 1/28 What is prob of sequence hz when two letters picked without replacement from hdohodddhfohodzzhddh? 3/95 Calculate prob of sequence unjj when four letters picked without replacement from auuajnnjnjjcnnxxn. 3/1190 Three letters picked without replacement from iggggggigi. What is prob of sequence igg? 7/40 What is prob of sequence tut when three letters picked without replacement from {t: 6, n: 3, u: 8}? 1/17 Four letters picked without replacement from {c: 1, r: 1, f: 2}. Give prob of s	{ "pile_set_name": "DM Mathematics" }
5b In base 9, what is -5 + 754? 748 In base 6, what is 32 + -314? -242 In base 8, what is -2 - -5? 3 In base 13, what is -25 + -5? -2a In base 10, what is 2 - -35? 37 In base 2, what is -100010 + 11010? -1000 In base 9, what is -57 + -1? -58 In base 8, what is -5 + 2264? 2257 In base 6, what is 15140 + -5? 15131 In base 9, what is -7507 - 3? -7511 In base 10, what is 10 - -18? 28 In base 14, what is 176 - -1? 177 In base 10, what is 76 - 5? 71 In base 9, what is -1 + 0? -1 In base 3, what is -101 + -10020111? -10020212 In base 15, what is -2357 + 4? -2353 In base 6, what is 45551 + -5? 45542 In base 2, what is -1100 - -1101010? 1011110 In base 10, what is 124 + -1? 123 In base 3, what is -1012221 - 11? -1020002 In base 7, what is 3 + -21153? -21150 In base 14, what is 1ad - 3? 1aa In base 8, what is 15 + -12? 3 In base 8, what is -215 - 5? -222 In base 5, what is -330 + -21? -401 In base 15, what is 673 + 1? 674 In base 16, what is 479 + 4? 47d In base 9, what is 370 + -11? 358 In base 11, what is 516 + -3? 513 In base 9, what is 7 - -463? 471 In base 15, what is b70 + 4? b74 In base 11, what is 105 - 3? 102 In base 4, what is 3211 + -11? 3200 In base 15, what is -2b7 + 1? -2b6 In base 10, what is 5 + -33? -28 In base 8, what is 1 + -10? -7 In base 14, what is -666 - 0? -666 In base 6, what is -5 + 125? 120 In base 2, what is -101 - -1111101101? 1111101000 In base 8, what is 1 + -4365? -4364 In base 15, what is 365 + -c? 358 In base 3, what is 10 - -21202020? 21202100 In base 3, what is -12 - 1111022? -1111111 In base 7, what is -5 - -3264? 3256 In base 11, what is -2 + 36? 34 In base 13, what is -51 + 39? -15 In base 15, what is -13 - -2? -11 In base 10, what is -129 + 0? -129 In base 5, what is 2203 - -10? 2213 In base 14, what is 736 + -2? 734 In base 9, what is -7 + -1? -8 In base 10, what is -317 - 0? -317 In base 8, what is -1 - 136? -137 In base 15, what is -41 - 13? -54 In base 15, what is -9 - 4? -d In base 8, what is -6 - -2246? 2240 In base 13, what is 51 - 5? 49 In base 12, what is 0 - 578? -578 In base 6, what is -3 - -323? 320 In base 12, what is -5b - 5? -64 In base 12, what is -4 + -203? -207 In base 10, what is 7053 + 5? 7058 In base 4, what is 23 + 102100? 102123 In base 11, what is -1 - 156? -157 In base 2, what is -100110110 + -101? -100111011 In base 6, what is -14252 + 3? -14245 In base 7, what is 1155 - 5? 1150 In base 6, what is 34 + 1? 35 In base 6, what is -11124 - 15? -11143 In base 2, what is 0 + 100010000? 100010000 In base 5, what is 1 - -322? 323 In base 10, what is 83 + -58? 25 In base 8, what is 14 - -24? 40 In base 10, what is -10 - -22? 12 In base 6, what is -13 - -11? -2 In base 2, what is -10 + 1010001110? 1010001100 In base 6, what is 2 - -1030? 1032 In base 8, what is -4 - -717? 713 In base 4, what is 0 + -12213? -12213 In base 10, what is 222 + 0? 222 In base 9, what is -3523 - 2? -3525 In base 12, what is -656b + -4? -6573 In base 15, what is 52 + 4? 56 In base 4, what is 0 + 122? 122 In base 9, what is 22 + 16? 38 In base 5, what is 3 - 23112? -23104 In base 16, what is -334 + -4? -338 In base 7, what is 1356 - -15? 1404 In base 14, what is 0 + 3c? 3c In base 7, what is 5 + 545? 553 In base 11, what is -4 - 18? -21 In base 4, what is -1020 + 2223? 1203 In base 15, what is -29 - 2? -2b In base 9, what is -187 + -4? -202 In base 16, what is 5 - -1f? 24 In base 16, what is -2c1 - -1? -2c0 In base 14, what is -6 - 4? -a In base 3, what is 102 - -11122? 12001 In base 10, what is 4 - 102? -98 In base 8, what is -12 - -4063? 4051 In base 3, what is 0 + -2021? -2021 In base 14, what is -21b2 - -4? -21ac In base 11, what is -4 - 647? -650 In base 3, what is -2 + -11221122? -11221201 In base 5, what is 1 - 2322? -2321 In base 2, what is -1110 + 111011? 101101 In base 4, what is 201111 - -3? 201120 In base 2, what is -100101 + 10? -100011 In base 14, what is 1a6 - -2? 1a8 In base 11, what is -16 + 28? 12 In base 11, what is -5 - 178? -182 In base 12, what is -3 - -a? 7 In base 13, what is 8 + c7? 102 In base 9, what is 8 - -3? 12 In base 5, what is -4 + 344? 340 In base 15, what is -c - 134? -141 In base 12, what is -5 + -1? -6 In base 4, what is 2 - -2130? 2132 In base 11, what is -25 + 410? 396 In base 10, what is -1 + -28? -29 In base 6, what is 43 - 5? 34 In base 5, what is -1221 - 2? -1223 In base 10, what is -14 + 8? -6 In base 3, what is 0 + 12010? 12010 In base 3, what is -11112 - 0? -11112 In base 4, what is -3310 - 12? -3322 In base 16, what is 14 + 36? 4a In base 9, what is 13 - 77? -64 In base 9, what is -50 + -111? -161 In base 12, what is -3 - 10? -13 In base 7, what is 2 + 22? 24 In base 11, what is -2521 + -4? -2525 In base 3, what is -1210 - -12? -1121 In base 4, what is 110202 + 2? 110210 In base 7, what is 10 + -5? 2 In base 9, what is -11 + 14? 3 In base 5, what is -3 - -140301? 140243 In base 14, what is d - 36? -27 In base 2, what is 10 + -11100? -11010 In base 3, what is -1002 + 1012? 10 In base 5, what is 404342 - 4? 404333 In base 10, what is 1 - 152? -151 In base 7, what is 5325 - -2? 5330 In base 14, what is -6 + b9? b3 In base 7, what is 5 + 1050? 1055 In base 2, what is -100101100001 + -101? -100101100110 In base 13, what is 42 + -ca? -88 In base 5, what is 1034 - -10? 1044 In base 5, what is -320 + 421? 101 In base 13, what is -79 + 8? -71 In base 7, what is -11 + -151? -162 In base 13, what is -b - 106? -114 In base 6, what is -154201 + 3? -154154 In base 16, what is -e - -7? -7 In base 11, what is -5 + -231? -236 In base 4, what is 2200 - -120? 2320 In base 10, what is -42 - -67? 25 In base 2, what is -110011011 + -101? -110100000 In base 2, what is -1000101001101000 - -1? -1000101001100111 In base 14, what is 49 - -3? 4c In base 2, what is -111 - 1001001? -1010000 In base 5, what is -1024 + -1? -1030 In base 14, what is 7b - 1? 7a In base 3, what is 20100020 - 0? 20100020 In base 3, what is -12 + -10022? -10111 In base 8, what is -2 + -1163? -1165 In base 3, what is 20 - -102? 122 In base 16, what is 2 + 228? 22a In base 5, what is 0 + 23? 23 In base 8, what is -1323 + 4? -1317 In base 12, what is 1 - -138? 139 In base 14, what is 18d - -3? 192 In base 16, what is 2 + -8e? -8c In base 9, what is -4402 - 3? -4405 In base 5, what is 4 + 432? 441 In base 8, what is 0 + 7? 7 In base 15, what is -11 + -1b? -2c In base 14, what is 2a7 - -3? 2aa In base 16, what is 75 + -2? 73 In base 3, what is 1021 + 12? 1110 In base 2, what is 11011 - 1010100? -111001 In base 5, what is 1 - 24010? -24004 In base 7, what is 3602 - 1? 3601 In base 5, what is 23040 - -4? 23044 In base 10, what is -209 + -14? -223 In base 3, what is -20010121 + 11? -20010110 In base 4, what is -3 - 223023? -223032 In base 12, what is 25 - 0? 25 In base 10, what is 29 - 548? -519 In base 2, what is -10010 - 1000? -11010 In base 13, what is -5 - 1c? -24 In base 16, what is -5d - -23? -3a In base 14, what is -1 - 17? -18 In base 5, what is -1 + -3211? -3212 In base 8, what is 1 + 0? 1 In base 14, what is 5 - -244? 249 In base 11, what is -415a + 3? -4157 In base 16, what is -6 + f? 9 In base 11, what is -5 - -52? 48 In base 11, what is -231 - -15? -217 In base 15, what is -12 + -1d? -30 In base 7, what is 4032 + -3? 4026 In base 10, what is 250 + 7? 257 In base 14, what is -17 + 11? -6 In base 9, what is -667 - 4? -672 In base 6, what is 503 + 2? 505 In base 2, what is -101 - 1011100? -1100001 In base 8, what is 351 - -34? 405 In base 11, what is -17 - -6? -11 In base 16, what is -69 - 1a? -83 In base 10, what is -90 + -107? -197 In base 5, what is -14 - -402? 333 In base 11, what is 4 + -6? -2 In base 6, what is -1103 + -2? -1105 In base 9, what is 7 + 187? 205 In base 5, what is 100410 + 4? 100414 In base 6, what is 23 - 135? -112 In base 9, what is -5 + -63? -68 In base 11, what is -99a + 3? -997 In base 12, what is -5 - 373? -378 In base 12, what is -1 + 342? 341 In base 3, what is -21 + 10111100? 10111002 In base 6, what is -35415 + 4? -35411 In base 7, what is -42 + 1? -41 In base 5, what is 10 - 4230? -4220 In base 13, what is -a - 1? -b In base 16, what is f - 1? e In base 13, what is -c4 - 0? -c4 In base 2, what is -101 + -101011101000? -101011101101 In base 5, what is 20 + 10? 30 In base 7, what is -2 - -14464	{ "pile_set_name": "DM Mathematics" }
= -16m + nm + 10 for m. 1 Let k be (-37)/111 + (-50)/(-6). Solve kl + l = -5l for l. 0 Suppose -10 = -5t + 5. Suppose -ti = -6i + 15. Suppose 5o - im = 20, -4o - 2m - 5 = 3. Solve o = 5f - 12 - 8 for f. 4 Suppose 4v - 4c + 7 = -9c, 4v - 20 = 4c. Solve 23 = -vf + 25 for f. 1 Let d = 2015 - 2015. Solve 14m - m + 26 = d for m. -2 Let l be (-13 - -4) + 30 - (-15)/(-3). Solve -lh = h - 68 for h. 4 Let q(u) = 7u + 545. Let b be q(-27). Solve 6v = -b + 368 for v. 2 Let h(o) be the first derivative of -o*3/3 - 10o*2 - 26o + 11. Let v be h(-18). Solve -4w - v = w for w. -2 Let m = -2 - -4. Let n be ((-50)/(-20))/(m/4). Suppose no + 4 - 14 = 0. Solve 0 = -oa + 4a - 10 for a. 5 Let d be (-5)/10 - (-67)/2. Let u = 36 - d. Solve k - uk = 6 for k. -3 Let v(r) = 2r*2 + 3r - 2. Suppose 2g - 1 = -5s - 9, -4s - 8 = 0. Let u be v(g). Solve 0 = 2b - 1 + u for b. -1 Suppose -4m = 82 - 2. Let t be (-5)/m + 22/8. Suppose 0 = -3i - 9, -ti + i = b + 3. Solve 10 = -bx + x for x. -5 Suppose 4n - 15 = 33. Solve -13 = 5c + n for c. -5 Let g be (-8)/(-48)46 + 2/(-3). Solve -2 + g = -5h for h. -1 Let m(v) = 2v + 2. Let w be (-3)/(9/3)1. Let b be m(w). Suppose 4h + 2p = 11 + 3, 2h + 5p = 11. Solve ht = -bt for t. 0 Suppose 8r - 10r = -8. Suppose -2h + 4 = -4f - r, -2f = 3h - 12. Solve -6 = -hl + 6 for l. 3 Let o = 11 + -34. Let d = 27 + o. Solve -d = 4y - 24 for y. 5 Let a = -1040 - -1048. Solve at = 56 - 16 for t. 5 Let a = 1161 + -1127. Solve 31p = ap + 12 for p. -4 Let v(u) = u - 3. Let i be v(3). Suppose i = -4s + s. Let a = 219 - 218. Solve c + a = -sc for c. -1 Suppose -3h + 2h = -3. Suppose -i - h = -8. Suppose -a + 6 = w - 0a, 5w - ia = -10. Solve r - wr = -5 for r. 5 Let x(d) = d3 + 11d*2 + 9d - 2. Let n be ((-6)/(-2) - 4)-3. Suppose j + 13 = n. Let t be x(j). Solve -3q + q = t for q. -4 Let r = 8 - 8. Let a(p) = p + 2. Let b be a(r). Suppose -3w + 41 = 4n, 19 = 3n - 2w + 1. Solve -n = -0l + bl for l. -4 Let r(w) = -2w2 - 24w - 37. Let f be r(-10). Suppose 4c - 5s = 76, -5c + 5s = -fc - 28. Solve 0 = 4d + c - 8 for d. -4 Suppose -4n + 5 = -31. Suppose 0 = 79o - 85o. Solve o = -2u + n - 1 for u. 4 Let a(r) = -r*3 - 6r*2 + 3r + 3. Let g(w) = -3w + 14. Let y be g(6). Let q be a(y). Let n = 56 + q. Solve n = 2t - 5t for t. -5 Let y be -4948/(-32)(-2)/(-3). Solve 3t + y = 85 for t. 2 Suppose 0 = 2y - 5p - 37, -5y - 3p + 10 + 5 = 0. Let w(t) be the second derivative of -t*3/6 + 6t*2 - 2t. Let i be w(y). Solve 0m - 2m = -i for m. 3 Suppose 4r = 4m - 32, 2r - 4r - 16 = 3m. Let y = -5 - r. Suppose f - 27f = -3f. Solve fz = yz - 6 for z. 2 Let b be -46/3-1. Let n(g) = -g2 + 7g + 4. Let w be n(b). Let i be ((-9)/(-2))/(w/(-8)). Solve -11 - i = 4z for z. -5 Let m = 1253 - 1249. Solve 93 - 81 = -mp for p. -3 Let z be (-8)/192-3 + 30/16. Solve 2a - z = 4a for a. -1 Suppose -10m = 24m - 544. Solve 8y - 4y = -m for y. -4 Suppose 3h + 4p + 50 = 0, 2h - 2 = -4p - 38. Let l be 451/7 + 6/h. Solve -l = w - 5 for w. -1 Suppose -2l + 6 + 18 = 0. Suppose -4c - 3w + l = w, -c - 5w = 9. Suppose 9 = q + c. Solve -a = -qa for a. 0 Suppose 0u = j + u - 6, 0 = 2j + 5u - 18. Solve -js - s = 0 for s. 0 Let m(w) = -w + 1. Let c be m(-4). Suppose 0 = -co + 3o. Let g be (2 - 1)(4 - 1). Solve o = -gh - 2h - 10 for h. -2 Suppose 10s = 11s - 5, -24 = -t - 4s. Solve 5c - 4c = -t for c. -4 Suppose 2 = -2p, -n = -3n - 5p - 5. Suppose nt + 2t - 6 = 0. Suppose -ti = -8i. Solve i = -o + 3o for o. 0 Let t be 42/16 + (-12)/(-32). Solve t = 3p + 12 for p. -3 Let t(y) = -2y + 2. Let g be t(-1). Suppose 3a + 38 = gk - 23, a + 3 = 0. Solve 2 = 5f - k for f. 3 Suppose 12 - 2 = 5t. Let i be (-1)/(-3) + 51/9 + -4. Let k be i/(-7) + (-172)/(-28)2. Solve 5s = ts + k for s. 4 Suppose 3n - 8n - 150 = 0. Let v be (-176)/n + 14/105. Solve -3l - 18 = -v for l. -4 Suppose -4v + 11g + 24 = 7g, -2g = -5v + 36. Solve -vc = -38c for c. 0 Suppose 59l - 54l - 185 = 0. Solve 33p + 20 = lp for p. 5 Let d = -8 - -6. Suppose 7 = -3r - 5k, -k - 1 = -2k. Let s = d - r. Solve t = st for t. 0 Let k(f) = -f*2 - f - 2. Let q be k(-4). Let r = 14 + q. Suppose -3b - 2m + 7 = r, -b + 2m + 3 = -2. Solve 0 = bt + t + 12 for t. -3 Let x be (2 - (-5 - -2) - -2) + -4. Solve xg = -9 + 3 for g. -2 Let z = 285 - 264. Solve -33 = 3h - z for h. -4 Suppose 0 = 5d + 10, -5d + 15 = -0a + 5a. Suppose 5j + 3 = 3. Suppose ji = ai - 10. Solve 0 = -2x - 12 + i for x. -5 Let r(t) = t3 - 7t*2 + 11t + 1. Let f be r(5). Suppose 0 = 3s - 59 - 1. Solve -j - s = -fj for j. 4 Let i = -31 + 47. Suppose 18g - ig = 6. Solve 3b + g + 12 = 0 for b. -5 Let g be (((-5)/15)/(-1))/(2/12). Let w be 33/9 + 4/(-6). Suppose v = 5v + 5s - 11, ws = -v + 1. Solve 2a - g = v for a. 3 Let v(h) = 4h - h*2 - 2h - 2 - 8h. Let o be v(-4). Let t be (-8)/6(-9)/o. Solve -3c - tc = 15 for c. -3 Let d = 425 + -416. Solve -v = dv for v. 0 Suppose 2 = -3o + 14. Suppose 4 = -ok + 84. Suppose -5a = -4t, 2a + a - 5t = 0. Solve 4d + ad + k = 0 for d. -5 Let x be 0/(2(-4 - -2)). Solve -4z + 6z = x for z. 0 Let v(k) = -3k + 4 - 3 - 5. Suppose 5o - 17 = q, 0 = o + 3o - 12. Let s be v(q). Solve -su = -0u - 10 for u. 5 Let v(b) = -b3 + 15b*2 - 13b + 13. Let z be v(14). Suppose z = 2c + 19. Solve -cn = 7 + 13 for n. -5 Let s(w) = -26w2. Let x be s(-1). Let o be (0 - (-1)/(-1)) + 30. Let p = x + o. Solve pz - 4z = -3 for z. 3 Suppose 4w + 32 = 8w. Suppose w = 4d, 4j + d = -0 + 10. Solve -f = jf for f. 0 Suppose -5r + 5x = -305, -6x + 8x - 198 = -3r. Solve rj + 6 = 61j for j. -2 Let z be 1/5 - 63/(-35). Solve 4a - z = 3a for a. 2 Let r = 320 + -311. Solve -r = -7j - 23 for j. -2 Let q = -134 + 138. Let k(g) = 2g - 3g + 0g. Let w be k(-2). Solve -6x = -qx - w for x. 1 Suppose -13u - 17 = -14u. Solve -ui = -13i - 20 for i. 5 Let m be (-2)/(-10)-15(-1 + 0). Solve 2 = mw + 14 for w. -4 Suppose -4g - 92 = -164. Solve -6m + g + 12 = 0 for m. 5 Let n(r) = -3r2 + 16r + 13. Let o be n(6). Let f be 28/14 + (1 - 1). Solve -3w - o = f for w. -1 Suppose 4q = a - 19, 21 = -36a + 39a - 3q. Solve -3j = -2j + a for j. -3 Let f = 26 - 23. Let u = 204 + -203. Solve f = 2r - u for r. 2 Let z = 15 - 7. Suppose -zd - 5 = -37. Solve d = w + 3w for w. 1 Let r = -34 + 39. Suppose 2y = y - 4n + 7, rn = -3y + 14. Solve 0 = yu - 6u - 6 for u. -2 Let d be ((-39)/(-12) + -1)-4. Let f = d - -13. Suppose 2y - 13 = -3. Solve -u - y = fu for u. -1 Let p = -129 + 159. Solve 6n = -0n + p for n. 5 Let f(k) = -k3 + 8k*2 + 26k - 146. Let h be f(9). Solve -4m - hm + 22 = 0 for m. 2 Suppose 5w + 60 = a, 11w - 44 = -a + 12w. Solve a = -5k + 20 for k. -4 Suppose -a = -5x + 12, 2a + 8 = x - a. Suppose -xg + 16 = 10. Solve -b + g = -0 for b. 3 Let r be -8(-4)/(-16)-2. Suppose -3d - 3 - 24 = 3m, -36 = rd + m. Let p = d - -11. Solve 5z = 8 + p for z. 2 Let o(m) = m2 + 6m + 4. Let g be o(-5). Let u = -3 + 0. Let j = g - u. Solve 0s = -js for s. 0 Suppose -3 = -g - 0. Let i be 11/30 + 80/(-480) + 118/10. Solve -gf + i = -7f for f. -3 Let u(g) = 7g - 3. Let y be u(5). Suppose -29d + yd - 6 = 0. Solve di + i + 9 = 0 for i. -3 Suppose -i - 3 = -2i. Suppose 2g = -ig - 4r - 15, -5g - 5r = 20. Solve -g + 5 = m for m. 4 Let d = 196 - 189. Solve -10 = -dm + 5m for m. 5 Let d(x) = -x3 + x2 - x - 32. Let q be d(0). Let i = -27 - q. Solve 0 = l + 4 - i for l. 1 Suppose 0 = 2s + j - 2, 2j + j = -3s. Suppose -3y - 5m + 205 = 2y, -5m = -5y + 175. Let a be y/14 + (-4)/(-14). Solve 0 = sb + ab for b. 0 Let n(k) = -2k + 2. Suppose 5s - z - 46 = 1, -2s + 5z + 28 = 0. Let r be n(s). Let c = r + 24. Solve -4x = c + 4 for x. -3 Let d(k) = -k2 - 3k + 13. Let m be (24/(-2))/3 - 3. Let h be d(m). Let j be (-56)/(-12) - (-10)/h. Solve x - 6 = jx for x. -2 Suppose 0 = -r + 3u - 5, -26 = -5r - 3u + 39. Suppose -3v + 3m + 27 = 0, -v - 4m - 24 = -3v. Solve f - r = vf for f. -2 Let m = -256 + 268. Solve -2d = -6d - m for d. -3 Suppose 2w + 5s - 6 = 0, 3 = -3s - 3. Let u(t) = -t*2 + 7t + 9. L	{ "pile_set_name": "DM Mathematics" }
6/225 - f5/50 - f4/10 - f3/9 + 1398f. Factor s(w). 2w(w - 5)(w + 1)2/15 Let s(u) be the third derivative of -25u*7/42 + 155u*6/12 - 121u*5/12 + 5u*4/2 - 2507u*2. Factor s(i). -5i(i - 12)(5i - 1)2 Let t(o) be the first derivative of 4o*3/9 - 1352o*2/3 + 900o - 12094. Factor t(d). 4(d - 675)(d - 1)/3 Let m = -10463 - -115095/11. Factor 0 + 6/11t2 + 8/11t*3 - mt. 2t(t + 1)(4t - 1)/11 What is b in -54b - 2b*3 - 240b + 362b + 412b - 86b2 = 0? -48, 0, 5 Let k(b) = -17b + 70. Let s be k(4). Let -5a2 + sa*2 - 18a + 15a = 0. What is a? -1, 0 Let v be 04/(-36)3. Factor -5b*3 - 10b*4 + 4b*5 + vb*5 + 10b2 + b5. 5b2(b - 2)(b - 1)(b + 1) Let b(n) be the second derivative of n*4/24 + 53n*3/4 - 243n*2/2 + 8916n. Let b(u) = 0. Calculate u. -162, 3 Let h(x) be the third derivative of -50/3x3 + 0x + 0 - 1/15x5 + 43x*2 - 5/3x4. Solve h(t) = 0 for t. -5 Let s(x) be the third derivative of x7/1365 + x6/780 - x5/65 - 186x2. Factor s(f). 2f*2(f - 2)(f + 3)/13 Let b = 131137867/383164 + 3/95791. Suppose -1295/4h - 73/4h2 - 1/4h*3 + b = 0. Calculate h. -37, 1 Let m = -264 - -234. Let d(z) = 23z*2 - 10z - 33. Let c(j) = -4j2 + 2. Let x(r) = mc(r) - 5d(r). Factor x(h). 5(h + 3)(h + 7) Factor -3/4w*2 - 81/2 - 63/4w. -3(w + 3)(w + 18)/4 Suppose -3r + 8 = -3w - 16, -3r - 3w = 0. Solve 2hr - 72h*3 - 416h - 2176h + 648h2 + 3888 + h4 = 0 for h. 6 Suppose -325/3y + 164/3y*2 + 54 - 1/3y*3 = 0. Calculate y. 1, 162 Factor 2/7a*3 + 0a + 96/7a2 + 0. 2a*2(a + 48)/7 Find r, given that 4/5 + 24842205r2 + 8916r = 0. -2/11145 Let l(c) = 10c - 29. Let k be l(-30). Let f = k - -331. Factor -b + 0 + 3b*f + 9/4b*3 - 7/4b*4. -b(b - 2)(b + 1)(7b - 2)/4 Let w(s) = s2 - 5s + 3. Let c(v) = -3. Let x(f) = -2. Let i(p) = -c(p) + 2x(p). Let y(o) = 3i(o) + w(o). Factor y(d). d(d - 5) Determine l so that -2l*4 - 883l - 4109l - 5408 - 92l*2 - 852l*2 + 96l*3 = 0. -2, 26 Factor 13/5u*4 + 0 - 8/5u*3 - 6/5u*5 + 0u + 1/5u2. -u2(u - 1)*2(6u - 1)/5 Suppose -84 = -20l + 16. Let i(u) = 8u2 + 326u - 4042. Let r(x) = -3x2 - 109x + 1347. Let w(o) = li(o) + 14r(o). Let w(c) = 0. Calculate c. 26 Suppose -12p - 3194 = -3266. Let l(o) be the second derivative of 0o*2 + 0o*p - 20/3o*3 - 17/10o*5 + 0 + 16o + 1/21o7 + 6o*4. Factor l(b). 2b(b - 2)2(b - 1)(b + 5) Let o(u) be the first derivative of -6u*2 - 3/20u*5 - 4u*3 - 5/4u*4 - 14 - 19u. Let k(r) be the first derivative of o(r). Factor k(f). -3(f + 1)(f + 2)*2 Factor -6/5x - 27/5 + 1/5x2. (x - 9)(x + 3)/5 Let n(r) = -r*2 + 14r + 12. Let y be n(16). Let g be (-6)/y(6 - (-248)/(-48)). Determine t so that 0 + 0t*2 - 3/4t*3 - gt*4 + t = 0. -2, 0, 1 Solve 2/9k*5 + 868562/9k*3 + 0 + 0k*2 + 0k + 2636/9k4 = 0 for k. -659, 0 Solve -5v*2 + 107v*3 + 3v*4 - 4v*2 + 19v*3 - 234 - 357v - 9v3 = 0. -39, -1, 2 Let p = 194231 + -971107/5. Find q such that -42/5q*5 + 0 - pq*2 + 54/5q*3 + 68/5q*4 + 8/5q = 0. -1, 0, 2/7, 1/3, 2 Let s(k) be the third derivative of -k*7/350 - 81k*6/200 - 2187k*5/100 - 19683k*4/40 - 256k*2. Factor s(y). -3y(y + 27)3/5 Suppose -29z + 6z + 1656 = 0. Let d be (z/120)/(3 + -2). Factor -9/5o*2 + 0o + 0 - do3. -3o*2(o + 3)/5 Let 37805z2 - 66 + 75 + 294z - 37806z2 + 286 = 0. What is z? -1, 295 Let v(g) be the third derivative of -g5/30 + 8g*4 - 704g3/3 + g2 - 4432g. Factor v(t). -2(t - 88)(t - 8) Let f be 110/(-16) + 43/344 - -8. Suppose -4 = 5a - 2n, 4n = -4a - 2 + 10. Factor a - 5/2x + 25/4x2 + fx*4 - 5x*3. 5x(x - 2)(x - 1)*2/4 Suppose 2058 = 4h + 3y, -5y + 8y + 2046 = 4h. Suppose hb = 517b - 144. Factor -3/2z4 - 12z*3 - 33z*2 - 27/2 - bz. -3(z + 1)2(z + 3)*2/2 Let a(j) = 11j - 6. Let c be a(1). Factor 42 + 39h + ch + 20h2 + h - 23h*2 - 6h. -3(h - 14)(h + 1) Let n(u) be the first derivative of -8/7u2 - 2/7u*3 + 1/7u*4 + 75 + 2/35u*5 - 8/7u. Factor n(f). 2(f - 2)(f + 1)*2(f + 2)/7 Factor 9/2p - 7 - 1/2p*3 + 3p*2. -(p - 7)(p - 1)(p + 2)/2 Let v = 14175 - 98775/7. Let h = -1765/28 + v. Factor 1/4f*3 - hf - 1/4f4 + 1/2 + 3/4f2. -(f - 1)3(f + 2)/4 Let d(t) = t3 + 11t*2 + 11t + 9. Let x be d(-7). Solve 19p - 58p + x - 12p2 - 145p = 0 for p. -16, 2/3 Factor -14m3 - 50/13m*4 - 246/13m*2 - 32/13 - 146/13m. -2(m + 1)3(25m + 16)/13 Let z(x) be the third derivative of 0x*3 - 1/672x*8 - 7/120x*5 + 0x - 123x2 - 1/48x*6 + 1/8x*4 + 1 + 1/60x*7. Find r such that z(r) = 0. -1, 0, 1, 6 Let n(f) be the first derivative of 2f*6/15 - 26f*5/5 + 25f*4/3 - 71f + 90. Let o(i) be the first derivative of n(i). Factor o(u). 4u2(u - 25)(u - 1) Suppose 10h = 40 + 100. Suppose 5w = 4u + h, 5w + 41u = 46u + 15. Factor -16/9s - 16/9s3 - 8/3s*w - 4/9s*4 - 4/9. -4(s + 1)*4/9 Let f be 494/382/13. Find v, given that -4v2 + 88v + 3316 - 5v - 964 + 85v + 7vf = 0. -28 Let r(n) be the second derivative of -1/10n*3 - 36n - n*2 + 1/60n*4 + 0. Find l, given that r(l) = 0. -2, 5 Let b = 1212 + -1189. Suppose 39m - 55 = b. Factor 0 + 2/11p3 + 4/11p*m + 2/11p. 2p(p + 1)2/11 Let a(v) be the second derivative of -v6/165 - v*5/110 + 26v*4/33 + 160v*3/33 + 48v - 7. What is r in a(r) = 0? -5, -4, 0, 8 Let a = 84889 + -84887. Suppose -2/13za + 0 - 12/13z = 0. What is z? -6, 0 Let p(q) = 8q3 + 70q - 208q - 30q*3 - 26 - 132q*2. Let s(a) = -24a*3 - 133a*2 - 139a - 27. Let n(r) = 3p(r) - 2s(r). Factor n(o). -2(o + 1)(o + 6)(9o + 2) Suppose -3l = 2u - 0u - 83, -5u - 5l + 200 = 0. Suppose -80 = us - 41s. Let -s + 0d + 22d - 2d - 2d2 - 3d*2 = 0. Calculate d. 2 Let 24/5v*5 - 114/5v*2 + 36/5v + 0 + 142/5v4 - 32/5v3 = 0. What is v? -6, -1, 0, 1/3, 3/4 Let i(r) be the third derivative of -r6/60 - 121r5/20 + 137r*4/6 - 61r*3/2 - 922r*2 + 2. Factor i(w). -(w - 1)(w + 183)(2w - 1) Solve 82/15k - 2/15k2 - 252/5 = 0 for k. 14, 27 Let f(g) be the third derivative of -g5/60 - 95g4/4 - 27075g*3/2 + 11g2 - 4. Factor f(w). -(w + 285)2 Let 919g3 - 160000 - 168000g + 2461g3 + 52g*4 - 4400g*2 + 0g*5 - 268g*4 + 4g5 = 0. What is g? -5, -1, 20 Let k(b) be the second derivative of b7/21 + 7b6/15 + 7b5/5 + b4/3 - 5b3 - 9b*2 + 1169b. Suppose k(h) = 0. What is h? -3, -1, 1 Let k(v) be the second derivative of -4/15v4 - 4/75v*6 - 1/210v*7 + 0v*2 + 2 - 1/6v*3 - 9/50v*5 - 55v. Determine o, given that k(o) = 0. -5, -1, 0 Let w be (24 - 714/28)/((-54)/(-24)-2). What is t in 10/3t*3 + wt*4 + 40/3t + 11t2 + 16/3 = 0? -4, -1 Let b be (-2528)/(-364) + 2 + 586/2051. Solve 2400/13w + 16000/13 + 2/13w3 + bw*2 = 0. -20 Let i(q) = -37q - 962. Let l be i(-26). Let x(j) be the first derivative of lj3 + 0j*2 + 35 + 0j - 1/10j4. What is b in x(b) = 0? 0 Let v(z) be the third derivative of 5z*2 + 25/4z*5 + 0 + 15/2z*4 + 0z + 18/5z3. Factor v(o). 3(25o + 6)2/5 Suppose 0 = -261i + 256i + 10. Factor -33y - 37y2 + 9057y3 + yi - 9060y3. -3y(y + 1)(y + 11) Let r(y) be the second derivative of y*5/30 + 38y*4/9 + 149y*3/9 + 74y*2/3 + 1737y. Determine v so that r(v) = 0. -74, -1 Factor -1946l + 3886l + 6 + 3l2 - l4 + 3l*3 - 1951l. -(l - 3)(l - 1)2(l + 2) Suppose -4v - 306 - 458 = -5j, j - 4v = 156. Let -37x - 80x2 - 28x + 70 + jx2 - 77x*2 = 0. Calculate x. -14, 1 Let u(z) be the first derivative of -55 - 24/5z*5 + 0z*3 + 0z*2 - 2/3z*6 + 0z - 5z4. Factor u(v). -4v*3(v + 1)(v + 5) Suppose -3d = -3u, -u = -0u - 2. Let j(y) = y*2 - y - 2. Let x(l) = -16l*2 + 32l + 36. Let g(t) = dx(t) + 36j(t). Suppose g(w) = 0. What is w? -7, 0 Let k = 113 + -258. Let u = -142 - k. Suppose 9/4r - 3/4 + 3/4r*2 - 9/4r*u = 0. What is r? -1, 1/3, 1 Let k(c) be the third derivative of -60c*2 + 1/48c*5 + 0c + 375/8c3 + 0 + 25/16c*4. Determine p, given that k(p) = 0. -15 Let d(v) = -14v - 16. Let q be d(-38). Let l = q + -	{ "pile_set_name": "DM Mathematics" }
r*4 + 13r*2 + 0r - 11/6r3 + 0 + 8/105r*7 + 0r*5 + 0r*6. Find the first derivative of h(k) wrt k. 64k*3 Find the first derivative of 98n*2 - 60 + 9n*4 - 98n*2 - 19n*4 wrt n. -40n*3 Let s(q) be the first derivative of -31/4q*4 - 21q + 0q2 + 0q*3 + 39. Find the first derivative of s(z) wrt z. -93z*2 Let h(q) = 9q - 15. Let k be h(2). Let b(u) be the second derivative of 0 - 5u - 9/2u*2 - 3/2u*k. Differentiate b(p) wrt p. -9 What is the derivative of 5s*3 + 7005s - 7005s - 36 wrt s? 15s*2 Let n(o) = 233o*2 - 9o - 3. Let t(x) = -3x2 - x - 1. Let y(v) = n(v) - 2t(v). What is the second derivative of y(c) wrt c? 478 What is the second derivative of -16 + 1 - 2 + 18 - 269q4 - 100q wrt q? -3228q2 Let a(t) be the first derivative of -5t4/4 - t3 - 23t2 - 159. What is the third derivative of a(c) wrt c? -30 Let m(q) be the third derivative of -4q*2 - 13/210q*7 + 0q + 0q6 + 0 + 0q*5 + 0q*3 - 19/24q*4. What is the second derivative of m(i) wrt i? -156i*2 What is the second derivative of -315t - t*2 + 11 + 13 - 40 + 16 - 13t*3 wrt t? -78t - 2 Let g(p) be the first derivative of -p*5/20 + 5p*3/6 + 14p + 6. Let y(x) be the first derivative of g(x). Find the second derivative of y(o) wrt o. -6o Let g(p) be the second derivative of p6/15 - 61p*5/20 - 61p*4/12 + 92p. What is the third derivative of g(v) wrt v? 48v - 366 Let x = -123 + 134. Let h be ((-2)/(-2) - 1) + 2. Find the second derivative of x + hi - 11 - 4i2 wrt i. -8 Let q(o) = 293o*2 + 374o + 5. Let h(u) = 587u2 + 742u + 11. Let p(m) = 5h(m) - 11q(m). What is the second derivative of p(v) wrt v? -576 Let u(h) be the second derivative of -15h3 + 3h*2/2 - 87h. Find the first derivative of u(t) wrt t. -90 Differentiate 66y3 + 36 + 46y*3 - 139 with respect to y. 336y*2 Suppose -11 - 7 = -3n. Let u = -68 + 75. Differentiate -o + n + 9o - uo with respect to o. 1 What is the first derivative of -123 - 5w4 - 5w - 7w4 - 252 + 3w*4 wrt w? -36w*3 - 5 Let f(n) be the third derivative of 23n7/840 - n4/12 - 31n3/6 + 38n*2. Let t(h) be the first derivative of f(h). Differentiate t(b) wrt b. 69b2 Let q(s) = -s2 + 12s - 10. Let h be q(10). Let v = h - 6. Find the third derivative of vx - 4x + 0x*3 + 6x*2 - 2x*3 wrt x. -12 Let p = -6 + 8. What is the derivative of 2 + p - 23w*3 + 7w*3 wrt w? -48w*2 Let h(l) be the third derivative of -17l*8/336 - 2l*7/105 + 3l*4/8 + 4l*2 + 13l. What is the second derivative of h(s) wrt s? -340s3 - 48s2 Let q(k) = -1. Let h = -31 + 26. Let v = -2 - h. Let f(u) = u3 + 6u2 + 3. Let y(z) = vq(z) + f(z). What is the third derivative of y(s) wrt s? 6 Let w(o) be the first derivative of -87o4/4 + 97o*3/3 - 114. Find the third derivative of w(d) wrt d. -522 Differentiate -38k - 11 + 70k - 4k wrt k. 28 Differentiate 1324g + 573g - 957g + 935 with respect to g. 940 Suppose -a + 7 = 3. Suppose i - 4j - 16 = 0, 5j + 10 = i - a. What is the third derivative of 9z*6 + iz*2 + 26z*2 - 52z*2 wrt z? 1080z*3 Let n(i) = 27i*2 + 81. Let f(h) = -83h*2 - 242. Let y(a) = 3f(a) + 8n(a). What is the derivative of y(j) wrt j? -66j Let y(z) be the first derivative of -3 + 0z5 + 11/3z*6 + 25/2z*2 + 0z*3 + 0z + 0z4. What is the second derivative of y(l) wrt l? 440l*3 Let o(v) = -7 + v - 4v + 2v - 3v. Let c(t) = -8t - 13. Let g(m) = -4c(m) + 9o(m). Find the first derivative of g(k) wrt k. -4 Let m(p) be the second derivative of 0 + 0p*3 - 1/2p*2 - 3/20p*5 + 32p + 0p4. What is the derivative of m(j) wrt j? -9j*2 Let c(b) be the second derivative of -521b*4/12 + 475b*3/6 - 2b - 640. What is the second derivative of c(t) wrt t? -1042 Let h(z) = -391z3 + 3z*2 + 470z - 18. Let f(a) = 392a3 - 4a*2 - 470a + 24. Let b(n) = -3f(n) - 4h(n). What is the second derivative of b(w) wrt w? 2328w Let d = 5 + 0. Suppose 0 = dw - 63 + 18. What is the derivative of -1 + wq - 18q + 5 + 7q wrt q? -2 Let q = 99 + -83. What is the third derivative of 38p*2 - 6p*4 - qp*2 - 5p*4 - 9p*4 wrt p? -480p Let z(l) be the second derivative of 0 + 0l2 + 0l*6 + 0l*5 + 0l*3 - 43/12l*4 - 31l - 11/14l7. Find the third derivative of z(a) wrt a. -1980a2 Let l = -4 + 11. Let p = -4 + l. Find the third derivative of a2 + a*2 - pa5 + a2 wrt a. -180a2 Find the third derivative of 15o*2 - 16o*2 - 3o - 47o3 + 0o - 2o wrt o. -282 Let r(d) = -d3 + 8d*2 - 2d - 58. Let s be r(6). Let f = -3 + 7. What is the third derivative of 2v2 + fv*2 + 3v*s - 5v*3 + 10v*3 wrt v? 30 Find the second derivative of -115k*2 + 24k - 465k2 + 209k wrt k. -1160 Let q(h) = -129h3 - 68h*2 + 3h. Let f(u) = -131u3 - 69u*2 + 2u. Let n(a) = -3f(a) + 2q(a). Find the third derivative of n(z) wrt z. 810 Let m(h) be the second derivative of 0 + 53/2h2 + 13/12h*4 + 0h*3 + 35h. Differentiate m(u) wrt u. 26u Let l(a) = 3a + 10. Let z be l(-4). Let h be (z - (-15)/9)-18. Find the third derivative of 7y*2 + 1 + 3 - 4 - hy*4 wrt y. -144y Let a(z) = -1387z2 + 100z + 26. Let f(c) = 462c2 - 34c - 10. Let p(t) = 3a(t) + 8f(t). What is the second derivative of p(u) wrt u? -930 Let v(x) = 2x2 + 3x + 2. Let n be v(-2). Let q be (57/38)/(((-15)/8)/(-5)). Find the third derivative of 4u2 - nu*4 + 3u*q + 12u5 + u4 wrt u. 720u2 What is the second derivative of 3 - 260t*4 + 40t*4 + 213t - 94t wrt t? -2640t*2 Let g(k) = -4k + 7k - 5k. Let a be g(-1). Find the first derivative of 2ba - b + 26 - 31 + b wrt b. 4b Find the third derivative of -12441l - 312l*6 - 307l*6 - 8l*2 + 12454l wrt l. -74280l3 Let i = -27 - -24. Let x(n) = 4n*2 + 117n + 8. Let v(k) = -k*2 - 39k - 3. Let p(u) = ix(u) - 8v(u). Find the second derivative of p(a) wrt a. -8 Let a(p) be the first derivative of 0p5 + 0p*4 + 10 + 0p*6 + 0p*2 + 17/3p*3 + 2/7p*7 + 0p. Find the third derivative of a(n) wrt n. 240n3 Let l(t) be the third derivative of t8/56 + 4t4 - t2. What is the second derivative of l(f) wrt f? 120f3 Let a(h) = -155h*3 - 10h*2 + 3h - 1. Let l(m) = -m*3 - 2m*2 + m. Let d(j) = -a(j) + 5l(j). Find the second derivative of d(z) wrt z. 900z Let s be 4/(-24) + 10/60. Let c(k) be the first derivative of 5/2k*2 + 3 + sk - 7/3k3. What is the second derivative of c(j) wrt j? -14 Let q(x) be the second derivative of -1/2x*7 + 0x*5 + 0x*3 + 0 + 19/12x*4 + 0x*2 + 32x + 0x6. Find the third derivative of q(j) wrt j. -1260j*2 Let f(n) = -192n*3 + 396n. Let c(x) = -x. Let q(t) = 24c(t) - f(t). What is the second derivative of q(w) wrt w? 1152w Let u(t) = -t*2 + 1. Let v(b) = 132b*2 + 44b - 2. Let w(m) = -3u(m) - v(m). What is the second derivative of w(g) wrt g? -258 Let q(z) be the third derivative of 0z*5 + 1/15z*7 + 0z*6 + 20z*2 + 0z*4 + 7/3z*3 + 0 + 0z. Differentiate q(u) wrt u. 56u3 Suppose -19o + 6o = -6o. Let h(y) be the first derivative of 6 + 8/3y3 + 0y*2 - 4/5y*5 + oy*4 + 0y. What is the third derivative of h(q) wrt q? -96q Let k be (-10)/15 - 21/(-18). Let y(z) be the first derivative of 0z*2 - kz*4 + 5 + 5/3z*3 + 0z. What is the third derivative of y(j) wrt j? -12 Let c(d) = -56d2 + 49d + 7. Suppose 2 = -2q + 6. Let h(j) = -j2 + j. Let i(t) = qc(t) - 98h(t). What is the first derivative of i(o) wrt o? -28o Let q be 1/((-8)/28)-2. Suppose qg - 8g = -3. Find the second derivative of -z3 - 5z - 5 + 5 + 6zg wrt z. 30z Differentiate -22v2 - v2 + 78 - 29 - 33v*2 + 2v*3 with respect to v. 6v*2 - 112v Let w(h) be the first derivative of 17h4/24 + 11h*3/6 + 15h*2/2 - 20. Let c(i) be the second derivative of w(i). Differentiate c(n) wrt n. 17 Let b(l) be the first derivative of 45l7/7 + l6/2 - 60l3 + 208. Find the third derivative of b(c) wrt c. 5400c*3 + 180c*2 Find the second derivative of -117 + 579v*2 + 664v + 238 - 121 wrt v. 1158 Let m(i) be the first derivative of 0i3 + 12 + 0i + 13/2i2 - 9/2i**4. Find the second derivative of m(s) wrt s. -10	{ "pile_set_name": "DM Mathematics" }
2890. 15 What is the greatest common factor of 11424 and 62118? 714 Calculate the greatest common factor of 13639 and 7709. 593 Calculate the highest common factor of 2159 and 578. 17 What is the greatest common divisor of 19224 and 432? 216 What is the highest common factor of 152172 and 108? 108 Calculate the highest common divisor of 165744 and 288. 144 What is the highest common factor of 355128 and 2? 2 Calculate the highest common factor of 221 and 138164. 13 What is the highest common factor of 25584 and 1296? 48 What is the greatest common factor of 78 and 367809? 39 What is the highest common divisor of 1632 and 14926? 34 What is the greatest common factor of 40083 and 343938? 1293 Calculate the highest common factor of 718 and 10. 2 What is the greatest common factor of 1875164 and 571? 571 What is the highest common factor of 93 and 7257255? 93 What is the highest common factor of 773122 and 1288? 322 What is the highest common divisor of 265 and 16218? 53 What is the greatest common factor of 2 and 160694? 2 What is the greatest common factor of 4968 and 113528? 184 Calculate the highest common factor of 6519 and 615. 123 What is the greatest common divisor of 316 and 904313? 79 What is the greatest common divisor of 215 and 452016? 43 What is the greatest common divisor of 85 and 667505? 85 Calculate the highest common factor of 1696 and 71338. 106 Calculate the highest common factor of 27092 and 104. 52 What is the greatest common factor of 224 and 250? 2 What is the greatest common factor of 32 and 282544? 16 What is the highest common factor of 45950 and 250? 50 What is the highest common factor of 269 and 64? 1 Calculate the greatest common divisor of 8 and 354964. 4 What is the greatest common divisor of 86483 and 1379? 197 What is the greatest common divisor of 6120 and 7004? 68 Calculate the highest common factor of 73963 and 74. 37 Calculate the highest common factor of 1095513 and 69. 69 Calculate the greatest common divisor of 90 and 1359. 9 Calculate the highest common factor of 12 and 122322. 6 What is the greatest common factor of 99136 and 48? 16 What is the greatest common divisor of 2316 and 177753? 579 What is the greatest common factor of 600264 and 1191? 1191 What is the greatest common divisor of 336893 and 261? 29 Calculate the greatest common divisor of 7098 and 210. 42 Calculate the greatest common factor of 1710 and 221985. 45 What is the greatest common divisor of 51935 and 442? 221 What is the greatest common factor of 567139 and 332? 83 Calculate the highest common factor of 28881 and 486. 9 What is the highest common factor of 50 and 64850? 50 Calculate the highest common divisor of 2089 and 25. 1 Calculate the greatest common divisor of 3035 and 25. 5 Calculate the highest common divisor of 12 and 432492. 12 What is the greatest common factor of 29 and 39005? 29 Calculate the greatest common factor of 5760 and 20. 20 What is the highest common factor of 39920 and 120? 40 Calculate the highest common divisor of 1 and 914803. 1 Calculate the greatest common factor of 536 and 17554. 134 What is the highest common divisor of 2009 and 5125? 41 What is the greatest common factor of 31120 and 24? 8 What is the highest common divisor of 444 and 481185? 111 Calculate the greatest common divisor of 1273 and 1742. 67 What is the greatest common divisor of 7990 and 19270? 470 What is the greatest common divisor of 6006 and 14322? 462 What is the highest common divisor of 1981999 and 172? 43 What is the highest common factor of 36289 and 55? 11 Calculate the highest common divisor of 4256 and 83657. 133 What is the highest common divisor of 462 and 51414? 66 What is the greatest common divisor of 102 and 37491? 3 Calculate the greatest common divisor of 5301 and 87552. 171 What is the greatest common divisor of 1729472 and 16? 16 Calculate the greatest common divisor of 165 and 15312. 33 Calculate the greatest common factor of 1887 and 548488. 629 What is the highest common factor of 21274174 and 1598? 1598 Calculate the highest common factor of 879747 and 12072. 1509 Calculate the highest common divisor of 784384 and 256. 256 Calculate the greatest common divisor of 94 and 185039. 47 What is the highest common divisor of 9836232 and 42? 42 What is the greatest common factor of 81821 and 102? 17 What is the greatest common factor of 21 and 6279? 21 What is the greatest common divisor of 120376 and 410? 82 What is the greatest common factor of 37177 and 18095? 329 What is the highest common divisor of 383300 and 25? 25 What is the greatest common factor of 21994 and 21? 7 Calculate the greatest common divisor of 147950 and 22. 22 What is the greatest common factor of 121257 and 423? 9 What is the greatest common divisor of 147100 and 100? 100 What is the highest common divisor of 998 and 1625742? 998 What is the greatest common factor of 48 and 13032? 24 What is the highest common factor of 7960 and 40? 40 What is the greatest common factor of 4450 and 1350? 50 What is the greatest common factor of 933560 and 40? 40 Calculate the highest common divisor of 808 and 766. 2 What is the highest common divisor of 8481624 and 24? 24 What is the greatest common factor of 1080 and 2213136? 216 What is the highest common factor of 282 and 8037? 141 What is the highest common divisor of 570624 and 1536? 768 Calculate the highest common divisor of 140 and 821772. 28 Calculate the greatest common divisor of 1377 and 544833. 459 Calculate the highest common factor of 403512 and 6072. 552 Calculate the highest common divisor of 2442 and 27841242. 2442 What is the highest common factor of 120 and 2430? 30 Calculate the greatest common factor of 62 and 483817. 31 What is the highest common factor of 2295 and 21675? 255 What is the highest common divisor of 162 and 824526? 54 What is the highest common divisor of 4388509 and 1388? 347 Calculate the greatest common divisor of 112 and 9656976. 112 Calculate the greatest common factor of 90 and 1230. 30 What is the highest common divisor of 1312 and 4576? 32 What is the highest common divisor of 60 and 245085? 15 What is the highest common factor of 1358 and 8386? 14 Calculate the greatest common factor of 2961 and 3807. 423 What is the highest common divisor of 23296 and 1053? 13 What is the highest common factor of 330 and 1920? 30 Calculate the highest common divisor of 9520 and 896. 112 What is the greatest common factor of 3330 and 66970? 370 What is the greatest common factor of 180 and 31824? 36 What is the greatest common divisor of 7 and 19019? 7 Calculate the highest common factor of 100 and 175650. 50 What is the greatest common divisor of 6426 and 141066? 306 What is the highest common divisor of 201 and 3436899? 201 What is the greatest common divisor of 1028852 and 10318? 1474 What is the greatest common factor of 2466 and 1746? 18 Calculate the greatest common divisor of 135 and 48447. 9 Calculate the greatest common factor of 6251 and 76. 19 What is the highest common factor of 14 and 2208619? 7 What is the highest common factor of 45 and 3040? 5 Calculate the highest common divisor of 78105 and 127. 127 Calculate the highest common factor of 10658 and 56940. 146 What is the highest common divisor of 4 and 89660? 4 What is the highest common divisor of 5720 and 5995? 55 What is the highest common factor of 243 and 39528? 81 What is the greatest common divisor of 65650 and 143420? 1010 What is the highest common divisor of 60016 and 35123? 341 Calculate the highest common divisor of 2762820 and 135. 45 What is the highest common factor of 32662 and 28? 14 Calculate the highest common factor of 700898 and 22. 22 What is the highest common divisor of 20559 and 33? 33 Calculate the highest common factor of 908336 and 132. 44 Calculate the greatest common divisor of 493 and 44341. 29 Calculate the highest common factor of 1305 and 3939795. 1305 What is the highest common divisor of 25235 and 34505? 515 What is the highest common factor of 39504 and 57? 3 What is the greatest common factor of 856416 and 12? 12 What is the highest common factor of 2295 and 305575? 85 Calculate the highest common divisor of 58093 and 91. 7 What is the highest common divisor of 90 and 108495	{ "pile_set_name": "DM Mathematics" }
v*2 + r and give d. 0 Rearrange -27r + 5r - 2r to the form h + wr and give w. -24 Rearrange -2c + 3c - 4c + (3 - 3 + 2c)(1 - 6 + 1) + 0 + 0 - 3c to mc + l and give l. 0 Rearrange 13f + 30f + 40f to the form l + xf and give x. 83 Express 2 + b3 + b2 - b*4 - 4b + 4b as cb*3 + s + xb + zb2 + ub*4 and give u. -1 Express -40h*2 + 19h*2 + 20h*2 - 7 as q + oh + rh2 and give q. -7 Rearrange -y2 - 2y + 0y + 4y + 2y4 + y + 2y*3 to iy + by4 + py*3 + f + ny*2 and give n. -1 Express (5 - 4 - 3)(-3v - 5v*2 + 3v) + 9v2 - 175 + 175 in the form zv + qv2 + u and give q. 19 Express -25 - 4v + 6 + 7 + 4 in the form gv + u and give u. -8 Express 2b*3 - 3b*3 - 4b*3 + 6b*3 + 20b*2 - 2b in the form o + tb2 + mb + ib3 and give i. 1 Rearrange (4 + 0 - 2 + (4 - 4 + 2)(1 + 0 + 1))(68z - 68z - 9z*2) to nz*2 + h + mz and give n. -54 Express 6 + 11 - 9c2 - 17 in the form lc*2 + d + zc and give z. 0 Rearrange 12 + d*4 - 309d + 307d - 5 to the form hd*2 + rd + od3 + gd*4 + x and give g. 1 Rearrange (4t - 4t + t2)(-52 + 165 - 76)(t - t + t) to ft + yt2 + lt*3 + d and give f. 0 Express 13p*2 - 20p*2 + 9p*2 + 23 + 2p*3 as dp*2 + op + qp3 + t and give t. 23 Express (-17j + 11j - 22j)(-j - j + j) in the form h + qj + mj2 and give h. 0 Rearrange 0 + 39z*2 - 36z*2 - 2 to gz*2 + s + kz and give g. 3 Express 0 + 23 + 6 - 1 - 2c2 in the form x + yc*2 + vc and give y. -2 Rearrange (-22 + 108 + 29)(b3 - 2b*3 + 3b*3)(2 - 2b - 2) to the form t + ab*2 + jb*4 + pb*3 + ib and give j. -460 Rearrange (m + 0m - 4m)((-1 + 2 + 0)(1 - 1 + 2) + (1 - 3 + 10)(-2 + 1 + 2)) to the form f + cm and give c. -30 Express (-4n + 4n - 2n2)(-4n - n + 3n) - 4n + n3 + 4n + 0 + 67 + 384n3 - 67 as gn + m + yn2 + xn*3 and give x. 389 Rearrange 5r - 6r + 3r to the form dr + a and give d. 2 Express -4 + 606v*2 - 5 - 609v*2 in the form mv*2 + lv + t and give m. -3 Rearrange 2i + 2i*2 - 3i*2 + 2i3 + i3 to the form oi2 + x + qi + bi3 and give o. -1 Express 625h3 + h4 + 2h + 1 - 625h*3 in the form uh*3 + qh + ih4 + g + lh*2 and give u. 0 Rearrange (q - 4 + 0q - 4q)(-q*3 - 21q*2 + 21q2) + (-q2 + 4q2 - q2)(q*2 - q + q) to sq*4 + nq*3 + l + cq*2 + kq and give s. 5 Express -l*2 + 0l2 - l2 - 3l - 12 as n + ul*2 + xl and give x. -3 Rearrange (-2o2 - 2o*2 + 9o*2 + (-2 - o + 2)(1 - 1 - 3o))(-1 + 0 + 2) to qo2 + po + l and give q. 8 Rearrange -5 + 9 - 4 + 18c to the form q + pc and give p. 18 Rearrange -2x3 - 19x*2 - 6x + 6x to the form q + sx + bx3 + ux*2 and give b. -2 Express 3q*4 + 2q3 + q4 + 2q - 4q + 1 - 3q3 as yq*4 + m + bq + rq3 + wq*2 and give m. 1 Express 3i + 7i - 3i as pi + b and give p. 7 Rearrange (0a + 0a + 2a)(3a - 3a + 3a*3) + 1 - 27a2 - a4 + 27a2 to ua*3 + o + ga*4 + va*2 + wa and give g. 5 Rearrange 0o - 11o - 15o - 18o to the form l + io and give i. -44 Rearrange 4d*2 + 12 + 19 - 4d*2 - 2d*2 to the form ld*2 + u + td and give l. -2 Express y2 - y4 - 2 - 200y + 401y - 202y in the form xy*4 + b + my*3 + ry + ty2 and give r. -1 Express -k4 + 276k2 - 2 - k3 - 276k2 as ck*3 + tk*2 + j + uk*4 + pk and give j. -2 Rearrange (50 + 52 - 101 + 24z)(-1 + 0z - 2z + 3z) to y + jz + oz2 and give j. -23 Rearrange (87 - 87 - 6j)(-3j + 5j + 0j) to the form kj + x + pj*2 and give p. -12 Rearrange x - x + 4x*4 + (3x + 4x - 4x)(-2x3 - x3 + 2x3) + 4x*4 - 5x*4 - 3x*4 to the form wx*4 + nx + hx2 + tx*3 + r and give w. -3 Express (-4 + 2 + 14)(27 - 27 + 2v)(1 + 2 - 1) in the form s + pv and give p. 48 Rearrange ((2 - 2 + z)(-3z - 2z + 4z) + 2z*2 + 2z - 2z - 53z + 53z - 12z*2)(1 - 2z - 1) to the form f + dz*2 + yz*3 + vz and give y. 22 Express 2l - 5l - 28l2 + 3l in the form pl2 + wl + f and give p. -28 Express -17j + 4j*2 - 33j*3 + 15j - 4j2 + j2 + 1 as o + dj*2 + gj*3 + xj and give g. -33 Express -9d - 4 + 4 in the form td + i and give t. -9 Express -2 + 2g - 2 + 57 + (-2 - 4 + 3)(-3g - 2g + 3g) as r + og and give r. 53 Express 2n2 - 14 + 3 + 2n + 5 - 3n3 + 4 as sn*3 + ln*2 + x + jn and give l. 2 Rearrange 12l3 + 3 - 5 - 1 - 10l*3 - 5l*2 to z + jl + bl3 + ql*2 and give b. 2 Rearrange (-4j*2 + 7j*2 - 2j*2 + (7j + j + j)(4j - j - 2j))(-j + 2j + j) to the form sj*2 + n + fj*3 + yj and give f. 20 Rearrange -3s4 + s4 - s3 + s2 - 4s2 + s2 to the form q + us3 + as*4 + ms*2 + hs and give m. -2 Rearrange -9s + 123 - 124 + 5s - 18s to a + ns and give n. -22 Express -4 - 2c3 - 5 - c + 2 - 4c4 + c2 + 8 in the form rc3 + uc*4 + nc*2 + f + oc and give r. -2 Express -4t2 + t2 - 2t + 0t2 - 4t*2 in the form at + h + zt2 and give a. -2 Rearrange 39k*2 - 12k*2 + 3k*2 - 17k*2 to the form s + bk*2 + rk and give b. 13 Express -4z4 + 3z*4 + 0z4 + z3 + 3z4 - 2z*3 - 4z*4 + (2 - 13z*4 - 2)(0 + 1 - 3) as lz3 + wz + uz4 + sz*2 + f and give u. 24 Rearrange (3j - 4j - j)(2j + j - 4j) + 0j2 + j2 + 0j*2 + (-3j + 12j + j)(0 - 3j + 0) to the form cj + l + tj2 and give t. -27 Express (3 - 1 - 4)(39 - 22 - 17 - 122m) in the form q + km and give k. 244 Rearrange -357c + 357c + 2c3 - 31 to pc + j + qc2 + kc*3 and give k. 2 Express -35 - 3y - 7y2 + 6y + 35 as qy + ty*2 + g and give q. 3 Rearrange 2f*3 + 2f*2 + 2 + 1 + 2 to the form rf*2 + k + jf*3 + of and give k. 5 Express (4 + 7 + 0)(4w2 + w2 - 3w2) as xw + k + yw2 and give y. 22 Rearrange (-19 + 3 - 10 + 2b*2)(4 + 2 - 4) to the form yb2 + g + sb and give y. 4 Rearrange (0i3 + 7i3 - i3)(-3 - 1 + 3)(3 + 0 - 4) to the form qi3 + x + mi + fi2 and give m. 0 Rearrange (-66 - 7u + 66)(u - u + 2u) + u*2 + 4u*2 - 4u*2 to ru*2 + p + gu and give p. 0 Rearrange (-4 - 5 + 1)(-a4 - 12a*3 + 20a*3 - 11a*3) to the form ha + r + ua2 + va*4 + la*3 and give v. 8 Express 14h + h*4 + 11h + h*4 - 7 - 2h*2 - 20h as ah2 + b + ph*4 + rh + gh3 and give a. -2 Express -g3 + 3g*3 - 1 + 5g*2 - 3g*2 - g - 2 in the form og*3 + fg + a + qg2 and give f. -1 Rearrange 3f*2 - 4f2 - f2 + (2f + 0f - 4f)(-f - 2f + f) + 18f*2 - 10f*2 - 17f*2 to the form pf + n + lf2 and give n. 0 Rearrange 136 + 3q*3 - q - 277 + 139 + 0q*3 to the form hq*2 + cq*3 + f + aq and give f. -2 Express r - 11 - 4r + 11 as i + qr and give q. -3 Express -s + 0s - s + 2s - 4s + s + (0s + 3s - 2s)(3 + 1 - 2) - 4s + 3s + 3s + 52 - 51 + 19s + 21s in the form js + r and give r. 1 Rearrange (-1 - g2 + 1)(-1 + 3 - 1) - g*2 - 26g + 26g to the form bg*2 + p + qg and give b. -2 Express (0 - 5 + 0)(3 - 3 + 6)(0 - 2 + 0)(-t - t2 + t) in the form ft + v + zt2 and give z. -60 Rearrange -1 + m + 0m*3 + 8m*3 - 11m*3 to the form om + gm3 + p + vm*2 and give o. 1 Express (4 - 3 + 1)(1 - 1 + 2z2) + (1 + 1 + 0)(2z + 2z - 10z)(-6z - 5z + 3z) in the form h + jz + xz2 and give x. 100 Rearrange (-1 - 3 + 5)(2c3 + c3 - c3) - 16c*3 + 33c*3 + 28c*3 to the form i + ac + oc3 + rc*2 and give o. 47 Rearrange 14q4 + q3 - 2q2 + 0q*4 - 16q*4 to oq*2 + iq*4 + fq*3 + kq + m and give o. -2 Rearrange 43q + 16q + 24q - 3q to the form o + jq and give j. 80 Rearrange 3 - 7j + 8j + 0j to k + xj and give x. 1 Rearrange -p - p - 10 - 7 + 6 to v + up and give u. -2 Rearrange g + 0g + g + (0g + g + g)(-25 - 9 + 1) to the form j + hg and give h. -64 Rearrange 1 - 1 - r*2 - 3r*3 + 205r - 204r to xr*3 + z + or*2 + kr and give o. -1 Express (-256 - 167l3 + 256)(-1 + 0 - 2) as pl2 + c + il*3 + fl and give i. 501 Express 0o3 + 10o*2 + 1 - 30o2 - o3 in the form d + jo2 + yo*3 + zo and give y. -1 Rearrange (0o - o + 2o)(3 + o - 3) + 28o*2 + 13o*2 - 2o*2 + (-2 + 2 + 2o)	{ "pile_set_name": "DM Mathematics" }
he third derivative of -549x4 - 26394x*2 - 563x*4 + 26775x*2 wrt x? -26688x Let t be 132/2-1 + 2. Let c = t + 66. Find the third derivative of -17p*4 + 11p*2 - 4p*c + 13p*2 wrt p. -408p Let q be (-6 - ((1 - 7) + -18))/4. Let x(o) be the second derivative of 3o3 + 0 - qo*2 + 5o. Differentiate x(c) with respect to c. 18 Let v(r) be the third derivative of -265r4/6 - 739r*3/3 + 5r*2 - 5r. Differentiate v(w) wrt w. -1060 Let z = 566 - 266. Differentiate -4o4 - zo + 19 + 304o + 2o*4 with respect to o. -8o*3 + 4 Suppose -26p + 54 + 24 = 0. Find the second derivative of -50f4 + 15f*p + 5f + 11f3 + 1 + 20f*4 + 26f*4 wrt f. -48f*2 + 156f Let w(s) = -s*3 - 2s*2 - 2s + 1. Let v be w(-2). Find the second derivative of -vl + 60l*2 + 1 - 13l + 9l2 wrt l. 138 Let t(j) be the third derivative of -2j + 0 - 1/24j4 + 0j*5 - 5/6j*6 + 43/2j*3 - 52j*2. What is the second derivative of t(k) wrt k? -600k Let d = -27 + 34. Let x be 1 - (0 - (1 + 1)). What is the second derivative of -dr4 - r4 + xr + 13r - r wrt r? -96r*2 Let o(z) be the second derivative of 29z*5/10 + 7z4/12 + z3/3 - 3087z2/2 + 6117z. What is the derivative of o(x) wrt x? 174x2 + 14x + 2 Let g(c) be the second derivative of -497c5/20 + 4243c*2/2 - 2c - 666. Differentiate g(i) with respect to i. -1491i2 Differentiate 761 + 963 - 2b + 0b + 151b2 - b3 + 2905 + 231 with respect to b. -3b2 + 302b - 2 Let d(l) = -4l2 - 9. Suppose 73 = 2p - 29. Suppose -p = -12c + 15c. Let b(z) = z*2 + 3. Let n(y) = cb(y) - 6d(y). Differentiate n(t) wrt t. 14t Let l(i) = -4i4 + 777i*3 - 3i*2 - 3i - 2025. Let k(g) = 3g4 - 778g*3 + 2g*2 + 2g + 2023. Let r(a) = 3k(a) + 2l(a). Differentiate r(b) wrt b. 4b3 - 2340b*2 Let b(i) be the second derivative of 49i*6/3 + 554i*2 - 2216i. What is the derivative of b(l) wrt l? 1960l3 Let q be (-28)/(-8)(-18)/(-21). Let b(z) be the second derivative of -2zq - 14z - 4/3z4 + 0z*2 + 0. What is the second derivative of b(t) wrt t? -32 Let v(q) be the first derivative of -12256q*3/3 - 5148q - 3071. Differentiate v(d) wrt d. -24512d Let d(w) be the first derivative of 5512w*7/7 + 7w*3 + 31w - 2206. What is the third derivative of d(x) wrt x? 661440x3 Let m(l) be the third derivative of l - 25l3 + l2 + 0 - 155/24l4. What is the first derivative of m(w) wrt w? -155 Let n(u) = 37u + 25. Let t(d) = -12d - 8. Let s = -18 + 14. Let w = s + 15. Let j(i) = wt(i) + 4n(i). Find the first derivative of j(z) wrt z. 16 Let m be (-1)/(-2) + 7105/58. What is the first derivative of -46r - 101 + 203r - m - 2 wrt r? 157 Let a(h) be the third derivative of 2893h*7/105 - 3541h*3/6 + 22h*2 + 2h - 75. What is the first derivative of a(m) wrt m? 23144m3 Suppose 4 = 21k - 23k, 5n - 405 = -5k. What is the third derivative of 96h*2 + 188h*4 + 117h*3 + 2 + 16h*4 - 117h*3 + nh*4 wrt h? 6888h Suppose 14 = 2x - x. Suppose 30l - 26l = 8. Differentiate 10k*l - 15 - x + 33 + 9k*2 wrt k. 38k Let k be (9/(3 - 2))/(8/(-8)). Let n be (-53)/(k/6). What is the third derivative of 26m*3 + 8m*3 + 9m*3 - nm*2 - 13m*3 wrt m? 180 Let w(f) be the first derivative of 0f*2 + 0f*3 + 180 + 37f + 0f4 + 49/5f*5. What is the derivative of w(k) wrt k? 196k*3 Let p(t) be the second derivative of 1617t*5/10 + 1068t*2 + t + 196. Differentiate p(q) wrt q. 9702q*2 Suppose 0 = -3m - 165 + 171. Find the third derivative of 12l5 + 408l*m - 329l*2 - 2l*4 - 4l*4 - 6l*5 wrt l. 360l*2 - 144l Let i(r) = 8r - 36. Let u be i(4). Let q be 9/(-4)u - -3. What is the derivative of 30g3 - 27 + q + 9 wrt g? 90g2 Let i(h) = -h4 + h3 + h2 - h - 2. Let a(w) = -25w4 + 7w*3 + 9w*2 - 46w + 29. Let r(o) = a(o) - 6i(o). Find the second derivative of r(u) wrt u. -228u*2 + 6u + 6 Let w(o) be the second derivative of 18o7/7 - 30o*4 + 946o. What is the third derivative of w(k) wrt k? 6480k2 Let s(i) be the second derivative of -29/30i*6 + 0i*3 - 8i + 1/10i5 + 43i*2 - 4 - 1/6i*4. Find the third derivative of s(a) wrt a. -696a + 12 Let b(k) be the second derivative of 5k7/42 + 181k6/30 - k5/10 - 31k3 - 3k*2/2 + 4930k - 2. What is the second derivative of b(p) wrt p? 100p3 + 2172p*2 - 12p Let g(k) be the third derivative of -23/4k4 + 0k + 2 + 114k2 + 16k*3. Find the first derivative of g(x) wrt x. -138 Let i(t) = -1. Let c(w) be the second derivative of -4w + 5w2 - 11/6w*3 + 0. Let l(n) = c(n) - 6i(n). Find the first derivative of l(r) wrt r. -11 Find the third derivative of -7d2 - 2d*2 + 581 + 8d*2 - 418d*5 - 732 wrt d. -25080d*2 Let x(y) = -259y*2 - 32y + 100. Let n(p) = 85p2 + 10p - 33. Let b(j) = -19n(j) - 6x(j). Find the second derivative of b(f) wrt f. -122 Let y(j) be the first derivative of -111j5 + 2074j + 521. Differentiate y(t) with respect to t. -2220t3 Let v(b) be the second derivative of -68b*2 - 10b + 52 + 26b - 4b*3 - 17b. Differentiate v(m) with respect to m. -24 Suppose 11 = m - 0. Let h be 8 - (-7 + -1)/(-2)1. Find the second derivative of -11c - 7ch + mc*4 + 10c + 7c4 wrt c. 132c*2 Let v(w) = 20w*3 + 5w*2 - 23. Let j(f) be the first derivative of 3f*4/4 + f - 93. Let m(b) = 5j(b) - v(b). Differentiate m(c) with respect to c. -15c2 - 10c What is the second derivative of -29 + 3453u2 - 276u*2 + 1681u*2 + 5 - 5u wrt u? 9716 Find the first derivative of 84m - 1057 - 52m + 134m + 5m wrt m. 171 Let a be 12492284/105 - (-2)/(-15). Find the third derivative of 44r2 + 184r*3 + 1 - ar + 118974r wrt r. 1104 Suppose -18j - 24 = -26j. Let v(t) = 2t*2 + 2t + 1. Let q(b) = 93b2 + 17b + 10. Let l(s) = jv(s) - q(s). Find the second derivative of l(x) wrt x. -174 What is the third derivative of 2b*4 - 251b*2 - 124b*2 - 2244 + 2243 - 246b*6 wrt b? -29520b*3 + 48b Let k(l) be the third derivative of -3l2 + 7/24l*4 + 0l*3 + 1/15l*5 + 29/60l*6 - 20l + 0. What is the third derivative of k(v) wrt v? 348 Differentiate 18p3 - 3280 + 94p2 - 1674 - p - p3 - 19p3 with respect to p. -6p*2 + 188p - 1 Let p be (-6)/(-24)16 - (-2)/(-2). Find the third derivative of 3k*2 - 2k*2 + 12k*p - 12k - 24k3 wrt k. -72 Let y = -2151 - -2151. Let x(g) be the second derivative of yg*2 + 4/5g*5 + 0g*3 + 0 + 20g + 1/12g4. Find the third derivative of x(n) wrt n. 96 Suppose k = -2q + 5, 0 = 3k - 2q - 18 + 11. What is the third derivative of -27s2 + 2688s - 2688s + 55s*3 - 312s*k - 12s*2 wrt s? -1542 Let g(j) = j - 7. Let l be g(7). Suppose 0 = -7k - lk + 28. What is the second derivative of 0q2 - q2 + 7q2 - 7q - kq wrt q? 12 Let i = -72 + 76. Suppose 2j + i = 4j. What is the third derivative of -4w*2 - 2w*5 - 6w*2 + jw*5 + 3w*5 wrt w? 180w*2 Differentiate -237 - 12p + 10p - 8p + 2p - 9p with respect to p. -17 What is the derivative of -6084l2 - 5l - 805 - 5l + 7439l*2 + 8l wrt l? 2710l - 2 Let v = -91 + 139. What is the second derivative of vh*4 - 28 + 53h*4 - 83h*4 - h - 4h*3 wrt h? 216h*2 - 24h Let i(c) = -3c + 13. Let k be i(12). Let j = -21 - k. What is the second derivative of 24u*3 + ju - 17u - 52u*3 wrt u? -168u Differentiate 103 - d + 27 + 139d3 - 5 - 84d*3 + 99d*3 with respect to d. 462d*2 - 1 Suppose -5x + 5c + 40 = 0, 3c + 40 = -14x + 19x. What is the first derivative of -5p + 5p + 90 - 12p + 2p + xp2 wrt p? 16p - 10 Let m(q) be the first derivative of -12 + 0q - 292/3q*3 + 0q*2 + 0q*4 - 302/5q*5. Find the third derivative of m(o) wrt o. -7248o Let b(i) be the third derivative of -247i6/40 - i5/30 + 43i*3/6 + 842i*2. What is the third derivative of b(a) wrt a? -4446 Let l be (2-1)/(-1(-2)/(-84)). Suppose -l + 88 = x. What is the second derivative of 14c - 2173cx + 2177c*4 + 3c wrt c? 48c2 Let b(g) = -2g - 3. Let x be (-1 + -2 + -3)1. Let m(t) = -5t + 5t - 2t - 3 + t. Let o(c) = xm(c) + 5b(c). What is the derivative of o(z) wrt z? -4 Find the second derivative o	{ "pile_set_name": "DM Mathematics" }
s = l + n. Which is the third biggest value? (a) -1 (b) s (c) -2 c Let h be (-21)/((-14)/(-4) - 2). What is the smallest value in h, -5, -1, -2? h Let m be (-12)/9-3 + -2. Suppose -o = -t, -t = -5o + m + 18. Let p = -902/9 + 100. Which is the second biggest value? (a) p (b) o (c) -0.2 c Let j = 1 - 1.2. Let z = 0.05 + -0.15. Let h = z - 1.9. What is the third smallest value in 0.5, h, j? 0.5 Suppose -20m + 17m = 3. Which is the second biggest value? (a) -0.5 (b) m (c) 2 a Let x be (-140)/(-63)12/(-32). What is the third biggest value in 0.5, x, 3/7, -5? x Suppose -17l + 15 = -12l. Which is the smallest value? (a) 1 (b) l (c) -0.5 (d) 3/5 c Suppose 0 = -2f + 5f - 3. Suppose f = -x + 2. Let v be ((-2)/(-4))/((-9)/(-6)). What is the second biggest value in x, 0.1, v? v Let q(r) = r2 - 3r + 4. Let v be q(4). Let d be 3 - ((-60)/v)/(-3). Let h = -0.6 - -0.1. Which is the biggest value? (a) 0.1 (b) d (c) h b Let o = 142 + -857/6. Let u(r) = -r + 4. Let i be u(8). Which is the biggest value? (a) 3 (b) o (c) i a Let z = 4.88 - 4.3. Let h = -0.08 + z. What is the third smallest value in -0.3, 0.1, h? h Let h = -1.7 + -5.3. Let y = -6.7 - h. Let i = -4.7 - y. What is the second biggest value in 0.3, -3, i? -3 Let s = -13 + 18. Let g = 5 + 0. Let d = g + -5.3. What is the second biggest value in d, s, -3/4? d Let f = -1.9 - -0.9. What is the third biggest value in f, -0.3, -1/2? f Let w = 51 + -46. Let v be ((-24)/75)/(4/10). Which is the third biggest value? (a) w (b) v (c) 0.3 b Let g = -3 - -2.5. Let o = g + -1.5. Let d = 0.25 + -0.45. Which is the smallest value? (a) d (b) o (c) 0.1 b Let s = 3.3 + -1.3. Which is the third biggest value? (a) -17 (b) 1 (c) s a Suppose -4c = 5p + 18 + 14, 2c = -p - 10. What is the third biggest value in p, 4, -1? p Let k = 6 + -4. Suppose r + 6 = h, kh - 22 = 4r - 0h. Which is the second biggest value? (a) 5 (b) -2/17 (c) r b Suppose -4 - 4 = 4d. Let p be 145/(-45) + d/(-9). What is the smallest value in 0.4, p, -0.2? p Let n be (1/(-5))/((-8)/(-10)). Let t be 27/(-2) + (-2)/(-4). Let f be (3/(-2))/(t + 1). What is the second smallest value in f, -1/5, n? -1/5 Suppose -5m - 4 = -3m. Let n be -7(-3)/15 - 1. What is the third biggest value in -0.4, m, n? m Suppose -4z + 20 = -0. Suppose -4h - 1 - 9 = 2j, -15 = -2h - zj. Suppose -17 + 7 = -2s. Which is the second biggest value? (a) s (b) 4/3 (c) h b Let x = -1.5 + 2. Let n = 34167/13 - 2627. Let a = -150/143 + n. What is the second biggest value in a, x, 0.3? 0.3 Let l = -8 + 37/4. Which is the second smallest value? (a) -0.1 (b) -5/4 (c) -4 (d) l b Let m = -22 + 10. Let r = m + 11.3. Let h = r + 0.2. Which is the third biggest value? (a) -0.2 (b) -3 (c) h b Let i be (10/(-6))/(8/(-24)). Suppose 10 = -ic + 3n, 0 = -n - 4n. What is the smallest value in 3, 2/9, c? c Let r = 1.4 - 1.8. Which is the biggest value? (a) -5 (b) r (c) 1 c Let d(c) = c3 + 3c*2 + 2c + 7. Let p be d(-3). What is the third smallest value in 2, p, -0.2, -3? p Let d = 3.8 - 0.8. Let q = -1376/13 + 106. What is the second smallest value in d, -2, q? q Let q(f) = -f*2 - 1. Let k be q(-2). Let p = 0.16 - -0.14. Let x = p - 0.7. Which is the smallest value? (a) k (b) x (c) -4 a Let h = -0.7 - -0.3. Let l = 0.5 + h. Which is the second smallest value? (a) l (b) 2 (c) 2/5 c Let d = 18/11 - 43/33. Let a = -6 + 5. What is the third biggest value in a, d, 3? a Let x = -17 - -22. Suppose 3l + 28 = -xf + 1, -4l - 13 = -f. What is the third smallest value in 0.2, f, 0? 0.2 Let s = 93 - 94.7. What is the smallest value in 0.5, -0.3, s? s Let k be (1/(-31))/((-7)/(-63)). What is the second smallest value in 2/17, k, 2, 4? 2/17 Let k = -31.2 - -31. Which is the smallest value? (a) 0.4 (b) k (c) 2 b Let d = -305/66 - -60/11. What is the second smallest value in -1, -0.1, d? -0.1 Let t be 8 + (-6)/(-12)-12. Which is the third smallest value? (a) 1/6 (b) t (c) 0.2 b Let c = 5 - 10. Let a = c - -4. What is the smallest value in a, 0.4, -4? -4 Let r = -724/7 + 103. Which is the second biggest value? (a) r (b) -2/25 (c) -0.2 (d) -4 c Let p = 12.72 + 0.28. Let j = 10 - p. Which is the smallest value? (a) j (b) -2 (c) -0.5 a Let f = 5.7 - -0.3. Let u = f - 6.2. What is the third biggest value in -1, 5, u? -1 Let m = -118/7 + 17. Let o = 6 + -4. What is the smallest value in -0.4, o, m? -0.4 Let z = 90 + -93. Which is the biggest value? (a) 0 (b) z (c) -5 a Let k = 129 + -133. What is the fourth smallest value in -1/6, -0.3, 2/9, k? 2/9 Let h = -1.8 - -2. Let g = 0 - -1/3. Let d be (-4)/22 - 32/(-660). Which is the second smallest value? (a) d (b) g (c) h c Let i = -1.83 - 0.17. Let p = 0.6 - 0.1. Let v = -0.8 + p. Which is the third biggest value? (a) v (b) i (c) -1/3 b Let m be 3 + 0 + (-35)/15. Which is the second smallest value? (a) m (b) 1/5 (c) 0.02 b Let p = 7 - 3. Let r be 10/p - (-1 + 4). Let x = 295/26 - 23/2. What is the third biggest value in x, 2, r? r Let f = -214/7 + 31. Let w = -15 - -17. Which is the third biggest value? (a) w (b) f (c) -3 c Let x(f) = f - 2. Let z be x(0). What is the biggest value in -2/7, 0.1, z? 0.1 Let p = -5.97 - 0.03. Let n = p + 5.5. Let h = 0.3 + n. What is the second biggest value in 0.3, h, 4? 0.3 Let w = -11.3 - -11. Suppose 4f + 8 = -3l, 0 = -5f - l - 11 - 10. What is the smallest value in 2, f, w? f Let n = -20 + 18. Let q = -3.2 + 3. What is the second smallest value in n, 0.4, q? q Let m = 10/9 - 152/153. Let o be 6/(-9) + (-15)/72. Let s = o - -19/40. Which is the third smallest value? (a) s (b) m (c) -5 b Let l be 44/77 - (-8)/(-14). What is the fourth smallest value in 4, l, 2, 1? 4 Let o = -1.5 - -7.9. Let h = -6 + o. Let n = h + -0.6. Which is the second biggest value? (a) -3/8 (b) -3/7 (c) n a Let r = 0.2 + -0.7. Let w = r - -0.4. Let n = w + 2.1. Which is the smallest value? (a) n (b) 0 (c) -5 c Suppose -g = -0g - 6. Let n = 3 + 0. Let p be 15(n + -2). Which is the second biggest value? (a) p (b) -5 (c) g a Let j be 10/(-17)(121/(-55) + 2). Let z = -233 - -3497/15. What is the biggest value in -0.2, z, j? z Let n = -7/11 + 17/44. What is the third smallest value in 3/5, 1/3, n, 1? 3/5 Suppose 6q = 5q + 5. Let d be ((-10)/4)/q - 0. Which is the third biggest value? (a) d (b) -1/4 (c) -0.2 a Let h(j) = j3 - j - 2. Let n be h(2). Suppose -2m + 3q - 27 = -4m, -m + 2q = 4. Let k = m + -3. Which is the second biggest value? (a) n (b) -3 (c) k c Let q be (-4)/(-2)(-2)/(-26). Let i(y) = -y + 2. Let g be i(4). Let z be 3/((-12)/g)0. What is the third smallest value in q, z, 0.3? 0.3 Let l be (9/(-6)-1)/1. Let g be (39/(-18) + 2)2. Let k be 3(-2 + (-560)/(-276)). What is the second biggest value in l, k, g? k Suppose 0 = 16o - 4 + 20. Which is the biggest value? (a) -5 (b) 2 (c) -1/4 (d) o b Let o = -32 - -29. Which is the smallest value? (a) -4 (b) 2 (c) o a Suppose 5l = -10, -7l + 4 = -2k - 10l. Let q = 1.4 - 1. Which is the smallest value? (a) k (b) -3 (c) q b Let h be (-2)/(-5) - 24/(-15). What is the biggest value in h, -14, -2? h Let r = -0.18 + 2.18. Which is the biggest value? (a) -2 (b) 0.2 (c) r c Let x be -2(0 + 36/8). Let t be (-2)/(-9) + 38/x. What is the second smallest value in t, -1/10, 5? -1/10 Let a be (-2)/2175/(-50). What is the second biggest value in a, -6, 0.1? 0.1 Let a be (-37)/222 + (-11)/42. Let y be 1/2(-1 - 1). What is the second biggest value in a, y, -0.3? a Let w be (-4 - (-20)/6)6. What is the second smallest value in w, -0.2, -6/7? -6/7 Let v = -2.9 + 3. Let u = -8.1 + v. Let z = u + 6. Which is the biggest value? (a) z (b) -2/3 (c) -5 b Let o = -103 + 103.2. Which is the third biggest value? (a) 9 (b) -1/4 (c) o b Let p = 286 - 2285/8. Which is the second biggest value? (a) p (b) -12 (c) -5 c Let w = -66 + 61. Which is the fourth biggest value? (a) -18 (b) w (c) 1 (d) -1/2 a Let g = -0.13 - -1.23. Let u = g + 2.9. Which is the second biggest value? (a) 2 (b) 0.2 (c) u a Suppose 585 = -5g - 1620. Let m be (-37078)/84 - (-1)/2. Let u = m - g. Which is the biggest value? (a) u (b) 1 (c) 0.3 b Let s = -0.3 - 0.2. Let t = -10 + 11. Which is the bi	{ "pile_set_name": "DM Mathematics" }
in -839 + 839 - 17s3 - 9s*3. -26s*3 Collect the terms in 174h*2 + 255650h - 255650h. 174h*2 Collect the terms in 2 + 4 - 570v + 576v - 2. 6v + 4 Collect the terms in 13y - 40y + 12y + 6 - 40 + 14y. -y - 34 Collect the terms in 535 - 535 - 2979i3. -2979i*3 Collect the terms in -12o - 9o + 21o + 273o2. 273o*2 Collect the terms in -8u*3 - 23u*3 + 31u*3 + 2u*3 + 35u. 2u3 + 35u Collect the terms in -1 + 44g2 + 46g*2 + 1 - 73g*2. 17g*2 Collect the terms in 14w*2 + 22w*2 - 8028w + 8028w + 32w*2. 68w*2 Collect the terms in 23r*2 - 31073r - 32r2 + 31073r. -9r2 Collect the terms in 111383755 - 111383755 + 19x*2. 19x*2 Collect the terms in -28o*3 + 93o*3 + 6o*3 - 6o*3 + 117o*3. 182o*3 Collect the terms in -122 - 123 + z + 245 - 4z. -3z Collect the terms in -10613j*2 + 5298j*2 + 5312j*2. -3j*2 Collect the terms in -36138o - 15290o - 37003o. -88431o Collect the terms in -1381k - 1458k - 593k. -3432k Collect the terms in 32 + 6 + 91 + 2t. 2t + 129 Collect the terms in 27v - 11366 + 11366 + 29v - 12v. 44v Collect the terms in 25j - 15j - 5j - 53j. -48j Collect the terms in -12q + 9q - 16 + 3. -3q - 13 Collect the terms in -30w*2 + 1 - 1 + 203w - 205w. -30w*2 - 2w Collect the terms in -2118j2 + 1221j*2 + 897j*2 + 2j - 2j - 10j*3. -10j*3 Collect the terms in 5599 + 184m - 2797 - 2802. 184m Collect the terms in -4 + 11o - o - 4o + 9 - o2. -o2 + 6o + 5 Collect the terms in 53p - 14p*3 - 105p + 57p. -14p*3 + 5p Collect the terms in -423b2 - 16944 + 425b*2 + 16944. 2b*2 Collect the terms in -246k*2 + 453k*2 - 44k - 1 - 209k2 + 1. -2k*2 - 44k Collect the terms in 14g2 - 2013 - 1963 + 3976 - 13g2. g2 Collect the terms in 62c3 + 86 - 40 - 46 - 61c3. c3 Collect the terms in 8m2 + 10 + 25344901m - 25344901m. 8m*2 + 10 Collect the terms in -3p*3 - 533p - 5p3 + 2p*3 - 9p*3 + 533p. -15p3 Collect the terms in 103593702y - 103593702y + 20y*2. 20y*2 Collect the terms in -192v*2 + 2112v*2 + 295v*2 - 123v*2. 2092v*2 Collect the terms in -667i*3 - 4530i*3 - 664i*3. -5861i*3 Collect the terms in -26 - 40 + 6u - 22 + 51. 6u - 37 Collect the terms in 645c*3 - 541c*3 - 1477c*3 - 743c*3. -2116c*3 Collect the terms in 1343 + 1338 - 330a - 2681. -330a Collect the terms in -13a - 114011 - 2a2 + 114011. -2a*2 - 13a Collect the terms in -19a3 - 29a*3 - 30a*3 + 82a*3 - 11. 4a*3 - 11 Collect the terms in -69r*2 + 130r*2 - 59r*2. 2r*2 Collect the terms in -800i*3 - 890i*3 + 1691i3. i3 Collect the terms in -4465576 + 4465576 + 8a. 8a Collect the terms in -14338 + 28v - 14357 + 28693. 28v - 2 Collect the terms in 2w - 15269 + 1650 - 18398. 2w - 32017 Collect the terms in -1873f3 + 1298 - 1298. -1873f*3 Collect the terms in 8r - 7r + 17r - 47r2 - 13r*2 - 18r. -60r2 Collect the terms in 157u*2 - 1 - 154u*2 + 1 - 35u*3. -35u*3 + 3u*2 Collect the terms in -174m*2 - 936m*2 + 35m*2 - 656m*2 - 433m*2. -2164m*2 Collect the terms in 42308 + 144v - 42308. 144v Collect the terms in 9398h - 4375h - 5020h. 3h Collect the terms in -607b - 102b + 705b. -4b Collect the terms in 11679a*2 + 11677a*2 - 23360a*2. -4a*2 Collect the terms in -11a + 28 + 30 + 8 + 27 - 93. -11a Collect the terms in 50 - 81 + 49 - 18 + 39x*3. 39x*3 Collect the terms in -12c*2 + 27c*2 - 30c*2 - 8c*2. -23c*2 Collect the terms in 407g - 30g + 3158 - 3160. 377g - 2 Collect the terms in 115l2 - 83l*2 - 63l*2. -31l*2 Collect the terms in 12v*2 - 236v*2 - 487v*2. -711v*2 Collect the terms in 21u*2 + 17u*2 + 19u*2 - 76u*2 + 20u2. u2 Collect the terms in -9559935n3 - 3n + 9559934n3 + 3n. -n3 Collect the terms in t3 - 247t2 + 63t - 185t2 - 63t. t*3 - 432t2 Collect the terms in c3 + 12872c + 237223c*2 - 12872c - 237223c2. c3 Collect the terms in 739s - 657s + 825s + 1618s. 2525s Collect the terms in -21386n + 2 - 2252n - 1 - 21983n. -45621n + 1 Collect the terms in 1255 + 7939 - w*2 + 1291 + 4w*2. 3w*2 + 10485 Collect the terms in 3669 - 3669 + 6q*3. 6q*3 Collect the terms in 850f + 800f - 2534f + 821f. -63f Collect the terms in -3s + 25s - 8s - 8s - 11s. -5s Collect the terms in -u - 1233542704 + 1233542704. -u Collect the terms in 4 + 85p + 75p - 224p + 65p. p + 4 Collect the terms in 133m + 69m + 139m. 341m Collect the terms in -4818b3 - 4964b*3 - 3898b*3. -13680b*3 Collect the terms in 31 - 36 + 30 + 8r*2. 8r*2 + 25 Collect the terms in -43b + 52b + 10b*2 - 9b. 10b2 Collect the terms in -31z*2 + 17z*2 - 111z*3 + 14z*2 - 44z*3. -155z*3 Collect the terms in -p - 279 - 19p + 279 + 3p. -17p Collect the terms in 78370j - 26117j - 26126j - 26125j. 2j Collect the terms in 86s + 2 - 2 - 8593s2 + 8592s2. -s2 + 86s Collect the terms in 131u*2 - 5u*2 - 12u2 - u3 - 31u2 - 29u*2 - 5u2. -u3 + 49u2 Collect the terms in 149d - 15d - 116d*3 + 114d*3 - 134d. -2d3 Collect the terms in 20t + 369762 - 48t - 369762 + 16t. -12t Collect the terms in -5u + u + u - 2u. -5u Collect the terms in -11 + 256k - 273k - 43k - 194k. -254k - 11 Collect the terms in 255m - 859m + 6m*2 + 303m + 301m. 6m*2 Collect the terms in 11l*2 + 60 - 6 - 23 + 13 - 12l2. -l2 + 44 Collect the terms in 65m3 + 33m*3 + 28m*3 + 18m*3. 144m*3 Collect the terms in -6372 + 3y + 6372 + 89y3 - y - 90y3. -y3 + 2y Collect the terms in -120y*2 - 1 + 45y*2 + 7y*2 + 1. -68y*2 Collect the terms in -9086118v + 9086118v + 35v*2. 35v*2 Collect the terms in -6 + 0d + 3d + 8 - 8 - 10. 3d - 16 Collect the terms in -18y2 + 6y*2 + 7y*2 - 4981y*3 + 4980y*3 + 5y2. -y3 Collect the terms in 2639 - 2639 + 10a2 + 16a*2. 26a*2 Collect the terms in 21814 - 10920 - 10894 + 7j. 7j Collect the terms in -7341373q*2 + 40q*3 + 7341373q*2 + 21q*3. 61q*3 Collect the terms in -34426f*3 + 68923f*3 - 34496f3. f3 Collect the terms in -26o - 19o + 103o - 20o - 22o - 13o. 3o Collect the terms in -1 - 121o + 41o - 256o - 152o. -488o - 1 Collect the terms in -277h + 82h + 68h + 75h + 68h. 16h Collect the terms in -455m3 - m3 + 5324718 - 5324718. -456m*3 Collect the terms in 138 - 125 - 3a + 4a. a + 13 Collect the terms in 470 - 470 - 11a + 0a. -11a Collect the terms in y*3 + 3y*3 + 2060 - 3y3. y3 + 2060 Collect the terms in -1 - 3527b + 1 - 6190b. -9717b Collect the terms in -5 - 25o + 19 - 4 - 5 - 2. -25o + 3 Collect the terms in -128q - 188q - 323q + 92q. -547q Collect the terms in -852o2 - 28o + 14o - 3o*3 + 14o. -3o3 - 852o*2 Collect the terms in -7r*3 - 42r*3 + 81r*3 - 29r*3. 3r*3 Collect the terms in 158f*3 - 70802 + 70802. 158f*3 Collect the terms in -51a + 91a + 269a*3 - 57a - 271a3. -2a*3 - 17a Collect the terms in -1698 - 2x3 + 860 + 838. -2x*3 Collect the terms in 37f*3 + 79 - 47 - 32. 37f*3 Collect the terms in -10k*2 - 78k + 10k2 + 5019k*3 - 5021k*3. -2k*3 - 78k Collect the terms in -22g2 + 2484 - 2484 - 10g*2. -32g*2 Collect the terms in 1101l*3 + 1107l*3 + 1102l*3 + 1105l*3 - 4416l3. -l3 Collect the terms in -f - 3f - 10f - 5f. -19f Collect the terms in -13i + 42 + 40i - 12i - 17i. -2i + 42 Collect the terms in 9 - 20g*2 - 32 - 4g*2 + 29g*2. 5g*2 - 23 Collect the terms in 20592x*2 - 4720x*2 - 15873x2. -x2 Collect the terms in 15845y3 - 5 + 5 + 3124y*3. 18969y*3 Collect the terms in -59a - 3a3 - 6536166 + 6536166. -3a*3 - 59a Collect the terms in 270m2 + 78m - 78m - 26m*2. 244m*2 Collect the terms in p + 4p + 22p - 552 + 552. 27p Collect the terms in 488z2 - 2z - 529z2 + 2z. -41z2 Collect the terms in 10k*3 - 42k*3 + 15k*2 + 1 - 15k*2 - 86k*3. -118k*3 + 1 Collect the terms in -7y*2 - 3y*2 + 6y*2 - 64y*3. -64y*3 - 4y*2 Collect the terms in -25127v**3 + 12	{ "pile_set_name": "DM Mathematics" }
git of j? 4 Suppose 4 = -2y, 0 = 3r - 0r + 2y + 25. Let a(j) = j*3 + 4j*2 - 9j - 14. Let o be a(-5). Let i = o - r. What is the tens digit of i? 1 Let g(i) be the third derivative of -i6/120 - i5/12 + i*4/6 - 7i*3/6 + 2i*2. Let q be g(-6). What is the units digit of q/25 - 34/(-5)? 7 Suppose l - 4644 = -5d + 4l, 5d + 5l - 4620 = 0. What is the tens digit of d? 2 Let d(x) be the third derivative of x5/12 + x4/12 + x3/3 - 4x*2. What is the tens digit of d(-3)? 4 Let u = 1818 - 1171. What is the hundreds digit of u? 6 Let j(a) = -2a - 8. Let p be 9/6 + (-13)/2. Let l be j(p). Suppose 3h - 4w - 115 = -lw, -3h - w = -109. What is the units digit of h? 7 Let y(j) = -j*2 + 4j - 1. Let k be y(3). Suppose kr = r + 35. Suppose 0 = 3x, d - x = -4x + r. What is the tens digit of d? 3 Let s(m) = m3 + 11m*2 - 14m + 12. Suppose -z = 2n + n + 3, 5z - 2n + 66 = 0. What is the tens digit of s(z)? 3 Let k = 1136 + -764. Suppose 9a - 5a - k = 0. What is the tens digit of a? 9 Let n be ((-36)/10 + 0)(-35)/14. Let w(m) = 14m - 18. What is the units digit of w(n)? 8 Let v(h) be the third derivative of 0 + 7/60h*5 - 1/6h*4 - 6h*2 + 0h + 1/3h3 + 1/120h6. What is the units digit of v(-7)? 0 Let n(s) = s3 + 27s2 + 19s - 79. What is the units digit of n(-25)? 6 Let m(w) be the third derivative of -w*5/60 + 7w*4/8 - 3w*3/2 + 7w*2. Suppose -4c - 7 = -2o + c, 4c - 84 = -4o. What is the tens digit of m(o)? 7 Suppose -3x = -4r + 22, 4r - 12 = 2x + 8. Suppose -4n + 424 = n - rd, 0 = 5n + 2d - 418. What is the units digit of n? 4 What is the hundreds digit of 3/7 + ((-1354700)/35)/(-10)? 8 What is the thousands digit of (-8)/((-16)/(-10)) + 1281 - 2? 1 Let g be 24 + 8/(-2) + 4. What is the units digit of g/13(-8)/(-9)? 4 Suppose 3j = -5k + k, 0 = 2k - 3j. Suppose o + ko = 45. What is the units digit of o/6 + 3/2? 9 Suppose 0 = -5j + 4j + 152. What is the tens digit of j/32(9 - 1)? 3 Let i(m) = -5m*2 + 6m - 11. Let c(n) = -11n2 + 12n - 22. Let u(q) = 6c(q) - 13i(q). What is the units digit of u(-4)? 9 Let d(i) = i*3 - 14i*2 - 8i - 41. What is the units digit of d(23)? 6 Let v(m) = -m*3 - 17m*2 + 17m + 62. What is the units digit of v(-19)? 1 Let s(z) = 1057z3 - 2z*2 + 3z - 1. What is the thousands digit of s(1)? 1 Suppose 6s + 36 = 228. Suppose p = -4f - f + s, 5f - p = 28. What is the units digit of f? 6 Suppose -10h + 10 = -5h. Let k = 58 + -26. Suppose hq + 2o + 0o - 68 = 0, -k = -q + o. What is the units digit of q? 3 Let x(r) = -r*3 + 7r*2 + 9r + 19. What is the hundreds digit of x(-6)? 4 Let t = 14 + -13. Suppose -i - 4a - t = -3, -i - 2a + 2 = 0. What is the tens digit of 158/6 - i/(-3)? 2 Let h(d) = 8d - 107. Let o be h(10). Suppose k - 185 = -4w, 5w - 99 = 3k + 128. Let z = o + w. What is the units digit of z? 9 Let h(n) be the second derivative of -13n3/6 + 9n*2/2 + 14n. What is the tens digit of h(-6)? 8 Let b(u) be the third derivative of 7u5/60 - u4/12 - u3/6 - 8u*2. What is the tens digit of b(3)? 5 Suppose 0 = -3i + t + 2, 0t + t + 2 = i. Let q be 1/3(75 + i). Suppose m - 11 = -o, 0 = 3m - 4o - o - q. What is the units digit of m? 0 Suppose -8 = -4l + 12, 558 = i + 5l. What is the tens digit of i? 3 Let x(y) = -2y - 6. Let r = 14 - 22. Let u be x(r). Let p = 12 - u. What is the units digit of p? 2 Suppose -550 = 11c - c. Let q = c + 64. What is the units digit of q? 9 Let s = -5 - -2. What is the units digit of -24(s - (0 - (-8)/12))? 8 Let r(p) = -3p*3 - 1. Let j be r(-1). Suppose 2i = -6, -3q + 170 = q + ji. Suppose 2m = -0m + q. What is the units digit of m? 2 Let s(h) = -4h + 108. What is the tens digit of s(19)? 3 What is the units digit of (-40)/(-1)(-2 + (-75)/(-12))? 0 Let a(x) be the second derivative of 3/2x2 + 5/12x*4 + 1/20x*5 + x + 0 + 1/2x*3. What is the units digit of a(-3)? 2 What is the tens digit of 1/((-1)/652)(-46)/92? 2 Suppose 2d + 245 = x, 4d - 652 = -4x + 328. Let r = x - 168. What is the units digit of r? 7 Let v = 794 - 279. What is the units digit of v? 5 Let z be (-50)/4224/(-35). Suppose 55 + z = 5x. Suppose -3t - 4h - x + 97 = 0, 0 = -3t + 2h + 64. What is the tens digit of t? 2 Let i(s) = 12s3 + 5. Let x(c) = c2 + 3c - 2. Let p be x(-4). What is the units digit of i(p)? 1 Suppose 0 = 179b - 165b - 26180. What is the tens digit of b? 7 Suppose -10r - 5 = -5r. Let l(p) = 17p2 - p. What is the units digit of l(r)? 8 Let d(g) = -g2 - 7g - 18. Let s be d(-3). Let f(l) = -37l - 39. What is the hundreds digit of f(s)? 1 Suppose 2o + 10o - o = 0. Suppose o = -p + 100 + 33. What is the tens digit of p? 3 Let o be 674/10 - 6/453. Let h = 30 + o. What is the tens digit of h? 9 Let h be (1/3)/(-1)-6. Suppose -5x - 252 = -hz - x, 123 = z - x. Suppose 0 = -5c - 5q + z, -83 = -3c - q - 15. What is the units digit of c? 2 Suppose -2f + 3f - 47 = -2m, -2m + f + 49 = 0. Suppose -o = -83 + m. What is the units digit of o? 9 What is the units digit of -5 + (75 + -9 - -8)? 9 What is the hundreds digit of (-31 - -30)/((-2)/1354)? 6 Suppose 2t = 10t - 24. Suppose -2w + 8p = tp - 81, -4w + 3p + 197 = 0. What is the units digit of w? 3 Let u be 147/(-14)(-4)/6. What is the hundreds digit of ((-3)/(-9))/((u/(-645))/(-7))? 2 Let a be (-2)/((-2)/(-63)-3). Suppose -3i + a = -3n, -n = 5i + 2n - 51. What is the tens digit of (12/6)/(1/i)? 1 Suppose 25 = 2n + 3n. Let x(u) = u*3 - 6u*2 - 6u - 3. Let s be x(7). Suppose f = -sb - 2f + 24, -b - f = -n. What is the units digit of b? 9 Suppose 7h - 243 = 2816. What is the units digit of h? 7 Let x be 2/(-4) - (-6)/12. Suppose x = -2t - o + 6, 0 = o - 3o - 4. Suppose -2z + tz = -5b + 95, b - 2z = 31. What is the units digit of b? 1 Suppose 2f - 2829 = -r, 3r = 47f - 42f - 7045. What is the thousands digit of f? 1 Let g = 1 - -8. Suppose 6r - g = 243. What is the units digit of r? 2 Suppose -2o - 19901 = -5q, -3q = -2o + 7o - 11953. What is the thousands digit of q? 3 Let x(c) be the first derivative of 11c*3/3 + 3c*2/2 + 2c + 2. Let r = 157 - 159. What is the tens digit of x(r)? 4 Suppose -5u = -5p + 7460, 4p + 3u - 5938 = u. What is the hundreds digit of p? 4 Let k be (-52)/(-6) - 5/(-15). Let x be (15/2)/(k/54). Suppose -3t = -b - x, -3t = 5b + 23 - 86. What is the tens digit of t? 1 Suppose -7h + 8h - 24 = 2q, 0 = -h - q + 39. What is the units digit of h? 4 Let r(l) = 286l + 744. What is the thousands digit of r(4)? 1 Suppose 2n + 5t - 3690 = 0, -4n - 4t + 7392 = -0t. What is the hundreds digit of n? 8 Let u = 2099 + -1118. What is the hundreds digit of u? 9 Suppose -4y + 302 = i - 873, 0 = -y + 5i + 278. What is the hundreds digit of y? 2 Let c(l) = -l*2 + 4l + 2. Let j be c(4). Suppose 4t + u = -ju + 5, u = -t. Suppose 4r = t + 3. What is the units digit of r? 2 Let b(j) = -j3 + 0 - 6 - j + 7j*2 + 4 - 1. Let v be b(6). What is the units digit of v - 8/(16/4)? 5 Suppose 67x - 72x + 85 = 0. Suppose -6w + 45 = -w. Let t = x - w. What is the units digit of t? 8 Suppose -5x = -i - 13, 3x - 8 - 7 = 3i. Let o be x/((20/8)/5). Suppose -107 = -on - m, -3n + 5m - 87 = -7n. What is the tens digit of n? 2 Suppose -39r = -38r. Let b = 9 - r. What is the units digit of b? 9 Let c be 4/(-10) + 774/(-90). Let x be 0/(c/3 - 1). Suppose -2b + xb = -76. What is the units digit of b? 8 Let f(v) = -6v*3 - 7v*2 - 8v - 10. What is the tens digit of f(-4)? 9 Let k(s) = 568s + 567. What is the tens digit of k(4)? 3 Let n(z) = -z2 - 13z + 5. Suppose -k - 21 = 2k. What is the units digit of n(k)? 7 Suppose 0 = 2v - 392 - 476. What is the units digit of v? 4 Let n(q) = 14q + 10. Let l be n(-8). Let c = l + 179. What is the units digit of c? 7 Let s(w) = -7w + 6. Let d be s(-4). Suppose -5n + 446 + d = 0. What is the tens digit of n? 9 Suppose u + q + 8 = -2q, -4u - 3q = -4. What is the hundreds digit of 6072/55 + u/(-10) + 4? 1 Let i = -5 + 6. Suppose r - 7 = -i. Suppose 2y = rm - 2m + 114, -m + 150 = 3y. What is the tens digit of y? 5 Let c be 52/14 - 4/(-14). Suppose -2u + 4u + 5 = -5m, 0 = -cm - 12. Suppose -3	{ "pile_set_name": "DM Mathematics" }
dq3 - 56dq2 - 55gq3 wrt g? 6dgq*2 - 2dgq - 55q3 What is the third derivative of 81q*2z*3 + 2q*2z - qt2z*3 + 4qt2z*2 - 2qt2z - 3qz wrt z? 486q2 - 6qt2 Find the third derivative of -716g*3s*4 + 214g*3s*2 - 3g*3s + 2g2s*6 + gs*2 wrt s. -17184g*3s + 240g2s3 Find the first derivative of -u4 - 2u2w - 639u2 + 5499w wrt u. -4u3 - 4uw - 1278u Find the first derivative of -5ijr3u - 438ijr3 + iru - 2jr2u + jr - 137r*3 - u wrt i. -5jr3u - 438jr*3 + ru Find the third derivative of 4p3z*4 - 74p*3z*3 - 107p*3 - 2p*2z*2 wrt z. 96p*3z - 444p3 What is the second derivative of -18r*3w*3x*2 + 3r*3w*2 - 2rw3x + 6rw*2x wrt x? -36r3w*3 Find the second derivative of -168a*2 + 17a - 1. -336 Find the second derivative of 4p3v*3 + 2p*3v*2 - 76p*3v + 2p3 + pv + 10v3 wrt v. 24p*3v + 4p3 + 60v Differentiate 4y3 - 1160y + 2928. 12y2 - 1160 Find the second derivative of 231o*5 + 163o. 4620o3 What is the third derivative of -19h*2n*2v + 3h2nv3 - 55h*2nv2 - h2n - 1279hn*2v*3 wrt v? 18h*2n - 7674hn*2 Find the second derivative of 1744c*2x*2 + 599c*2x + c*2 wrt x. 3488c*2 What is the third derivative of -12h*3o - 91h3u + 3h2o + 2hou + 244o wrt h? -72o - 546u Find the third derivative of -75o2q*3 + 3o*2q + 4oq*2 - 2oq - 4q*3 wrt q. -450o*2 - 24 Find the second derivative of -28g*4 + 11g*2 + 11559g wrt g. -336g2 + 22 Differentiate a2j + 2a2o - 3a2 + 720aj2o + 9aj*2 wrt o. 2a*2 + 720aj2 What is the second derivative of 19l*3x3 + l3x - 6lx3 - 164lx wrt x? 114l*3x - 36lx Find the first derivative of 57c - 87. 57 Differentiate -31a*2l*2 + 23a*2 - 2al3 + 15641l*3 with respect to a. -62al2 + 46a - 2l3 What is the second derivative of -1214a*3 - 853a wrt a? -7284a Find the second derivative of -68g*2r*3 + 5g*2ru - 7g*2r - 3gu + 2812r3 wrt g. -136r*3 + 10ru - 14r Find the first derivative of -140d + 1472 wrt d. -140 What is the second derivative of -4k*3 + 7k*2 + 2k + 33? -24k + 14 What is the derivative of 2jo4y*2 - joy + jy*3 - 10jy + 4oy3 - 2y*3 wrt o? 8jo3y*2 - jy + 4y3 Find the first derivative of -5797z + 2035 wrt z. -5797 Find the third derivative of -23v5 + 2v*4 + 90v*2. -1380v*2 + 48v Find the third derivative of o*5 - 36o*3 - 6o*2 - 19o - 5 wrt o. 60o2 - 216 What is the third derivative of 10b*3n*3z2 - b3nz*3 + 5b*3nz2 - 3b*2n*3z3 + b2z2 + bn*3 wrt z? -6b*3n - 18b2n*3 What is the derivative of -2m*3 + 352m*2 - 1182 wrt m? -6m*2 + 704m Find the third derivative of 167g4 - 6g*3 + 2138g*2 wrt g. 4008g - 36 Find the third derivative of -1543d6 - 2d*2 - 1338d. -185160d3 Differentiate -23hl3p*2 + 6hl3p + 9l3 - 3l*2p - 2p2 with respect to h. -23l*3p*2 + 6l*3p What is the third derivative of 184h2z*4 + 3h*2z - 37h2 - 2hz3 + 2hz + z5 - 3z*2 wrt z? 4416h*2z - 12h + 60z*2 Find the second derivative of -9n*2y + 5n2 + 2ny + 26n wrt n. -18y + 10 Find the second derivative of 205jo4 - 89jo - 5j - o*2 wrt o. 2460jo2 - 2 What is the second derivative of 6gk2y*3 + 3gky + 24k2y*3 - 4ky3 + 6y*2 wrt k? 12gy3 + 48y*3 What is the third derivative of -829h*3 + 1185h*2 wrt h? -4974 What is the first derivative of 27w*3x*3 - 1888w*3 + 46wx3 wrt x? 81w*3x*2 + 138wx2 What is the second derivative of -753o*2 + 16o wrt o? -1506 What is the third derivative of f*5j + f*2j + 46f2 - 2fj wrt f? 60f*2j What is the first derivative of -2l2x*3 + 37l*2x*2 + 3l*2 + 5 wrt x? -6l*2x*2 + 74l*2x What is the second derivative of 3034u2 + 2530u? 6068 What is the third derivative of -c*3n3 + c3n2 + 27cn4 - 2n*4 - 2n*2 - 69 wrt n? -6c*3 + 648cn - 48n Find the second derivative of 95n5p + n*3p*3 - 6np3 + 104p*3 wrt n. 1900n*3p + 6np*3 What is the third derivative of 3i*3p3 + i3p2 - i3 - 7i*2p*3 - 20i*2p*2 + 5p*2 wrt i? 18p*3 + 6p*2 - 6 Differentiate 29f*2k - 10869f2 + 11k with respect to k. 29f2 + 11 Find the second derivative of -2nu4 - 2nu + 45n - u*5 - 4u wrt u. -24nu*2 - 20u3 What is the second derivative of f2s3w - 5f2sw - 24f*2 - fs*3 - 47fsw - 4s3w wrt f? 2s3w - 10sw - 48 What is the first derivative of -59d4ox - 2d*2x + 3ox - 5o wrt d? -236d*3ox - 4dx Find the second derivative of 846o*2p*4 - 3o*2p*2 - 22o*2p - 73p wrt p. 10152o*2p*2 - 6o*2 What is the third derivative of -120i*3 - 181i*2 wrt i? -720 Find the first derivative of 23g*4r - 2g2r*3 + 25r3 - r2 wrt g. 92g3r - 4gr*3 Find the third derivative of -113x*3 - 2x*2 + 101 wrt x. -678 What is the second derivative of -115j*2z*3 - jz*3 + 58j - 1 wrt j? -230z3 Find the second derivative of -2b*2t*3 - 307b*2t*2 + 64b*2t - 1 wrt t. -12b2t - 614b2 What is the third derivative of -3d*6m*2 + 22d*4m*2 - 9d*2m*2 + 2dm2 wrt d? -360d*3m*2 + 528dm2 What is the derivative of -9a*3j + 49a3 + 91a*2j + 2a2 + 5a wrt j? -9a3 + 91a*2 Find the second derivative of -21h*2nw2 + h2nw + 20h*2 - 3hnw - hn + 2nw2 wrt w. -42h*2n + 4n What is the second derivative of 399p*2 - 7p - 4? 798 What is the first derivative of 6l3mv - 2l*3 - 1068lv3 + 84mv3 wrt m? 6l*3v + 84v3 What is the third derivative of -77o*4t - 3o3t + 2o2t - 2t - 1 wrt o? -1848ot - 18t What is the third derivative of 4i5 + 4i*4k + i*3k - 3i2k + 31ik wrt i? 240i2 + 96ik + 6k Differentiate -ij + 7iq3 - 27iq + 2jq3 + 22q*3 wrt i. -j + 7q*3 - 27q What is the second derivative of 3973i2 - 1120i + 2 wrt i? 7946 What is the third derivative of -101r2s5 + r2s4 + 2091r*2s*2 - 2s*2 wrt s? -6060r*2s*2 + 24r*2s Differentiate -280x3 + 44 with respect to x. -840x*2 Find the third derivative of 5w*4 - 448w*3 + 5w*2 - 269w. 120w - 2688 Differentiate 3406f*2 + 1243 with respect to f. 6812f Find the third derivative of -43rz*3 - 9rz2 + 11z*2 wrt z. -258r Find the second derivative of 2l5 + 6l*2q*2 - 15l*2 - 2l - 540q2 wrt l. 40l*3 + 12q2 - 30 Differentiate u4 + 46u + 255. 4u*3 + 46 What is the second derivative of -34h*2 - 2h - 7 wrt h? -68 Find the third derivative of 32d3o*3 - 2d*3o + 38d3 + 57do4 + 2do - 3o*2 wrt o. 192d*3 + 1368do Find the third derivative of 5768z*4 + 116z*2 + 22z. 138432z What is the second derivative of 1070r*2s*2 - 57rs2 + 4rs wrt r? 2140s*2 Find the second derivative of 14t*5 - 2t*3w - 2t2w*2 + 3tw2 + tw - 43 wrt t. 280t3 - 12tw - 4w2 What is the second derivative of -m3u5 - 5m*3u*2 + 24m*3u + 5mu wrt u? -20m3u*3 - 10m*3 What is the third derivative of -3y*6 - 22y*3 - 15y*2 + 8? -360y*3 - 132 Differentiate 2as2 - 2852a + 11s2 - 11s wrt a. 2s2 - 2852 What is the third derivative of -171l*5x*3 + 3l*5 + 2l*2x*2 - lx*3 - 27lx wrt l? -10260l*2x*3 + 180l*2 Find the third derivative of -2774t*3x*3 + 2t*3x - 24t2x3 + t2x - x3 - 21x wrt t. -16644x3 + 12x Find the second derivative of 24l2t*3 - 64l*2t*2 - 25l*2 - 2t + 8 wrt t. 144l2t - 128l2 Differentiate i4 + 12030i*3 + 4908. 4i*3 + 36090i*2 What is the derivative of 619a*2d*2 - 118a*2 + a wrt d? 1238a*2d What is the second derivative of -2v3 + 133v*2 - 5v + 8 wrt v? -12v + 266 Find the second derivative of 12j*5 + 52j*2 + 8149j - 1 wrt j. 240j3 + 104 What is the third derivative of -2504h*6 - 274h*2 + h? -300480h*3 Differentiate 309d*2o - 2459d2 + 2 wrt o. 309d**2 What is the third deriv	{ "pile_set_name": "DM Mathematics" }
= 1807t + 102. Let y(r) = 1808r + 76. What is -3w(f) + 4y(f)? 1811f - 2 Let q(x) = -6x*2 + 13x + 16. Let m(n) = -42n2 + 94n + 115. Calculate 4m(w) - 29q(w). 6w2 - w - 4 Let g(t) = 6t*2 - t + 2. Let o(z) = -17z*2 + 9z - 4. Let h(v) = -3g(v) - o(v). Let s(y) = -y - 1. Determine -h(a) + 4s(a). a*2 + 2a - 2 Let i(m) = 3m2 + 33m - 81. Let k be i(-13). Let j(w) be the first derivative of 2w - 3 + 5/2w*2. Let h(c) = 26c + 10. Determine kh(y) + 16j(y). 2y + 2 Let u(o) = -o2 - 1. Suppose 3q - q = 2. Let v(a) = 4380 - 4375 - 4298a + 10a*2 + 4298a. What is qv(w) + 5u(w)? 5w2 Let r(u) = -3u*2 - 54u - 38. Let l(j) = -3j2 - 41j - 36. Calculate -4l(z) + 3r(z). 3z2 + 2z + 30 Let p(g) = -3g3 - 208g*2 + 207g*2 + 2g3. Let w(l) be the third derivative of -l5/60 - l*3/3 - 180l2. Give -p(i) - w(i). i3 + 2i2 + 2 Let y(t) = -t + 1. Let d(k) be the first derivative of -2k*2 + 7k - 1544. What is -d(x) + 3y(x)? x - 4 Let g(p) = 2p*2 + 67p + 5. Let z(n) = 2n2 + 67n + 9. Calculate 3g(j) - 2z(j). 2j2 + 67j - 3 Let l(j) = -16j3 - 693j - 12. Let k(q) = -48q3 - 2084q - 42. Give 2k(r) - 7l(r). 16r3 + 683r Let l(u) = -10u2 - 136u - 2800. Let t(i) = 2i2 + 25i + 560. Calculate 2l(o) + 11t(o). 2o2 + 3o + 560 Let o(m) = 531m2 + 2m - 3. Let y(j) = -1062j2 - 5j + 7. Determine 14o(t) + 6y(t). 1062t2 - 2t Let b(a) = 88a - 180a*2 - 131a*2 + 88 - 96a*2. Let w(u) = -14u*2 + 3u + 3. Suppose z + 588r - 586r = -58, 5r - 163 = z. What is zw(k) + 3b(k)? 11k*2 Let y(c) = 4c*3 + 3c*2 - 5c - 2. Let l(f) = -2f3 - 2f*2 + 3f + 1. Let t(i) = i*2 + 56i + 162. Let j be t(-3). Determine jy(o) + 5l(o). 2o3 - o2 - 1 Let q(x) = 3x*3 + 4x*2 + 7x + 3. Let v(k) = -580k3 + 159 + 581k*3 - 81 + 2k*2 + 3k - 77. Calculate -2q(t) + 5v(t). -t*3 + 2t*2 + t - 1 Let t(l) = 35l - 13. Let g(f) = 8f - 108. Let n(y) = 7y - 134. Let d(x) = 5g(x) - 4n(x). What is -7d(q) + 2t(q)? -14q + 2 Let m(t) = 2t*3 + 8t*2 - 33t - 345. Let n(c) = -c*3 - 5c*2 + 22c + 229. What is -5m(x) - 8n(x)? -2x3 - 11x - 107 Let c(d) = 8d2 + 12d + 45. Let j be c(-6). Let p(o) = jo + 10o*3 + 243o - 496o. Let h(y) = 3y*3 + 3y. What is 8h(x) - 3p(x)? -6x3 Let x(a) = 3a*3 + 47a - 5. Let w(c) = c*3 + 24c - 2. Let p = 28130 - 28126. Give px(o) - 10w(o). 2o3 - 52o Let x(s) = 10s3 - 29s + 10s + 14s - 233s2 + 240s*2. Let t(h) = -11h*3 - 6h*2 + 4h. Give 5t(a) + 4x(a). -15a3 - 2a*2 Let i = -7 - -15. Suppose 7f - if = 3. Let t(r) = 6r*3 - 4r + 4. Let g(b) = 5b3 + 2 + 3 + 0 - 3b - 2. Calculate ft(k) + 4g(k). 2k3 Let k(s) = -6s*3 - 3s*2 + 428s - 14. Let d(f) = -3f3 - f2 + 215f - 8. Calculate 7d(y) - 4k(y). 3y3 + 5y*2 - 207y Let s(f) = 39f - 1514. Let h(c) = -32c + 1513. Give 6h(p) + 5s(p). 3p + 1508 Let p(c) = -5c + 16. Let o(m) = 9m - 32. Let s(q) = -2q*3 - 44q*2 - 4q - 95. Let t be s(-22). Determine tp(d) - 4o(d). -d + 16 Let m(l) be the first derivative of 17l4/4 + 2l*3 - 5l*2 - 6l - 7089. Let q(f) = -16f3 - 5f*2 + 9f + 5. Calculate 5m(p) + 6q(p). -11p3 + 4p Let j(v) = 273v + 783. Let y(d) = -403d - 782. Determine -3j(u) - 2y(u). -13u - 785 Let u(g) = -11922g + 24. Let b(c) = 4258c - 8. Let z(t) = 14b(t) + 5u(t). Let p = -2 + 5. Let a(q) = 1. Give pa(y) - z(y). -2y - 5 Let b(d) = -8d + 2. Let z(j) = -47j - 1415. Give 6b(v) - z(v). -v + 1427 Let m(v) = -v + 2 + 2 - 3. Let a(l) = 5l2 - 10l + 10. Let r = -443 - -448. Suppose ro = -5c + 60, c - 42 = 20o - 24o. Give om(n) - a(n). -5n*2 Let b(a) = -a + 7. Suppose -4z - 3y - 18 = -6, 0 = -z + 3y - 3. Let q(h) = 11h - 30. Let v(i) = zb(i) - q(i). Let u(m) = m - 1. Calculate -6u(o) - v(o). 2o - 3 Let n(x) = -76x3 + 6x*2 - 11x - 11. Suppose 250 + 526 = -180c - 14c. Let p(i) = -25i3 + 2i*2 - 4i - 4. Give cn(g) + 11p(g). 29g3 - 2g*2 Let k(c) = -c. Suppose -3v + 0m - m = -4, -v - m = 0. Suppose -3g + 115 = vg. Let f be (-10)/(-3) + g/(-69). Let i(b) = -2b + 1. Determine fk(a) - 2i(a). a - 2 Let i(d) = -4d2 - 7d - 14. Let l(x) be the second derivative of -x4/4 - x3 - 7x2 + 76x + 6. What is 6i(u) - 7l(u)? -3u2 + 14 Let u(t) = 3t*2 - 31t + 74. Let d be u(5). Let r(m) = 5m - 3. Let j(o) = 10o - 7. What is dj(a) + 14r(a)? 10a Let t(q) = 12q*3 + 5q*2 - 9q - 316. Let o(u) = 14u3 + 6u*2 - 11u - 317. What is -5o(c) + 6t(c)? 2c3 + c - 311 Let f(o) = 4o*2 + 49o - 92. Let u be f(-14). Let s(v) = 1. Let k(g) = 8g + 3. Calculate us(t) - k(t). -8t + 3 Let f(z) = -11z + 6. Let b(p) = 10p - 5. Suppose 5a - 3 = -3. Suppose -5w + 25 = -aw. Give wf(m) + 6b(m). 5m Let w = -4794 + 4789. Let u(m) = -2m*2 + 4m - 1. Let g(j) = -2j2 + 5j - 2. Determine wu(y) + 4g(y). 2y2 - 3 Let z(j) = 5j - 157. Let i(t) = -10t + 150. Calculate 5i(c) + 6z(c). -20c - 192 Let k(b) = 3b3 - 2b*2 + 2b. Let u(d) be the first derivative of 13d3 - 57/4d*4 + 0d - 39/2d2 - 37. What is -117k(r) - 6u(r)? -9r*3 Let o(i) = -36i*3 + 67i*2 + 7i - 14. Let u(p) = -38p3 + 51p*2 + 6p - 12. What is 5o(z) - 6u(z)? 48z3 + 29z*2 - z + 2 Suppose -5h - 3v - 22 = 28, 25 = -5v. Let p(c) = -2c + 3. Let o(k) = 8. Let d(n) = n - 9. Let g(f) = d(f) + o(f). Give hg(a) - 2p(a). -3a + 1 Let s(t) be the third derivative of t4/4 + t3/2 - 6t2. Let q(v) = 13v + 7. Let l(a) = 358a + 3225. Let d be l(-9). What is dq(z) - 7s(z)? -3z Suppose 0 = -4k + 27k - 1 + 139. Let s(m) = m*2 - m. Let g(h) = -2h*2 - 3h. Calculate ks(x) + g(x). -8x*2 + 3x Let j(g) = g*2 - g + 1. Let w(r) = 4r*2 - 11r + 5. Let k(p) = p*3 - 6p*2 + 5p - 22. Let i be k(9). Let c = 267 - i. Calculate cw(z) - 5j(z). -z*2 - 6z Let k(f) = -6f3 - 7. Let a(m) = m - 17. Let c be a(30). Let x be -21(2 - 3)c/(-39). Let v(h) = -3h*3 - 4. Determine xv(l) + 4k(l). -3l*3 Let y(g) = -3g - 5. Let j(o) be the third derivative of 4/3o3 - 34o*2 + 0 + 0o + 1/6o4. Calculate -5j(w) - 8y(w). 4w Let k(r) = -552r + 72. Let h(j) = -140j + 18. Calculate 9h(f) - 2k(f). -156f + 18 Let w(h) be the third derivative of -7h5/60 + h4/3 + 5h3/6 - 295h2. Let y(c) = c2 - c - 1. Let m = -329 + 335. Give my(x) + w(x). -x2 + 2x - 1 Let w(c) be the second derivative of -13c3/3 - 13c*2 - 19c + 8. Let v(b) be the first derivative of -5b2/2 - 5b + 2. What is 16v(a) - 3w(a)? -2a - 2 Let f(d) = -681d*3 + 4d*2 - 6. Let l(t) = -4089t*3 + 23t*2 - 34. What is 34f(g) - 6l(g)? 1380g*3 - 2g*2 Let v(m) = 11m + 9. Suppose 7g - 4g - 2g = 6. Let d(j) = -21j - 17. Give gd(a) + 11v(a). -5a - 3 Let w(m) = m2 + 1. Let j = 276 + -274. Let l be 112/63 - j/(-9). Let v(o) = 3o*2 + 2. Determine lw(t) - v(t). -t*2 Let o(v) = 1. Suppose 4b + h = -5, 8 = -4b - 3h - 7. Suppose b = i + 11 - 12. Let m be (2/6 - i)/((-12)/18). Let w(u) = -u + 4. Give mo(r) - w(r). r - 3 Let r(d) = -7d + 12. Let a(b) = -41b - 51b + 120b - 36b + 13. Give 5a(t) - 6r(t). 2t - 7 Let q(z) = 153z - 6. Let y(n) = 716n - 29. Calculate -11q(i) + 2y(i). -251i + 8 Let i be (4 - 29) + 26 - (1 + -6). Let h(w) = 210w2 - 35w + 35. Let u(d) = -35d2 + 6d - 6. Determine ih(k) + 35u(k). 35k2 Let h(f) = f2 - f + 1. Let o(q) = 5q*2 - 11q + 6. Calculate -3h(b) + o(b). 2b*2 - 8b + 3 Let z(y) = y + 1. Let v(p) = -4p + 4668593 + 3p - 4668586. What is v(j) - 4z(j)? -5j + 3 Let i(x) = -15x3 + 3x*2 + x + 1. Suppose -2f = 49b - 45b, -b = -4. Let s(z) = 45z3 - 8z*2 - 2z - 3. Calculate fi(w) - 3s(w). -15w3 - 2w + 1 Let p(s) = s - 5. Let z(g) = -2g3 + 19g*2 - 26g + 21. Let d be z(8). Let y be 6/(4/6-3). Let x(b) = -3. Calculate dx(m) + yp(m). -3m Let h(n) = -6n2 - 7n - 6. Let o(b) = -7b2 - 8b - 7. Let g = -5732 + 5737. Give go(q) - 6h(q). q*2 + 2q + 1 Let w(h) = 1. Let a = 3094 + -3098. Let f(n) = 3n + 5. Suppose -3v + 8 = -2b + 5, 0 = -3b. What is aw(k) + vf(k)? 3k + 1 Let m(d) = 8d*2 - 17d. Let y(l) = 15 + l - 3l - 5l - 2*l. Let o be y(	{ "pile_set_name": "DM Mathematics" }
(e) -0.4 a What is the nearest to 193 in -38/9, -5, 4, 5? 5 Which is the nearest to 2/9? (a) -39 (b) -8/9 (c) -3/8 (d) -5 (e) -5/6 c Which is the nearest to 1? (a) -74 (b) -2/5 (c) -2/17 (d) 37 c What is the closest to -20 in -2/5, -2, 4, 3168? -2 What is the closest to -10885 in 0.1, 3/2, 18, 4? 0.1 Which is the nearest to 0.1? (a) -3/5 (b) -25 (c) -1 (d) -50/17 a Which is the nearest to -2/11? (a) 35 (b) -1 (c) 1/6 (d) -4/3 c What is the nearest to -2/11 in -2, -3, -0.056? -0.056 What is the closest to 4 in 56, 0.08, 5, -4? 5 Which is the nearest to 0? (a) 0.5 (b) 0.1 (c) -78 (d) -1/6 b What is the nearest to -5 in 17, -4, 0.05? -4 What is the nearest to 1 in -0.4, 3, -3, -3282, -2/45? -2/45 What is the closest to 135 in -1/4, 7, 1? 7 Which is the nearest to -2? (a) 0.5 (b) -273 (c) -3097 a Which is the closest to -0.08? (a) -1/12 (b) -0.6 (c) 0 (d) -0.3 (e) -6 a Which is the nearest to -1/3? (a) 0.6 (b) -1 (c) -12.2 b What is the closest to -67 in 3, -0.02, -2, -1/4? -2 Which is the closest to -10.7? (a) 1 (b) 0 (c) -2 (d) 1/7 (e) 0.2 c What is the nearest to 0 in 1/24, 4, 346, -3? 1/24 What is the nearest to -5 in 3, -29, 1/4, -4/9? -4/9 What is the nearest to -0.02 in -2/5, -7, -136? -2/5 Which is the closest to -2? (a) -2/107 (b) 2/3 (c) 5/3 a Which is the closest to 1.6? (a) 0.03 (b) 0.1 (c) -2 (d) -2/367 (e) 0.3 e What is the nearest to 4 in -3, 4, -65, -9? 4 Which is the closest to -143? (a) -0.3 (b) -2/29 (c) -2 (d) -1/3 c What is the closest to -3 in -5, -10/117, -7? -5 Which is the nearest to 3174? (a) -0.3 (b) -18 (c) -1 a Which is the nearest to 6? (a) 3.5 (b) -2 (c) 103 a Which is the nearest to 1? (a) 2/7 (b) -7/10 (c) 5/11 (d) 0 c What is the closest to -1/47 in 5, -3/2, -11, 4? -3/2 What is the closest to 1/3 in 0.06, 44, 1/3, 4/7, 5/2? 1/3 Which is the nearest to 1? (a) 3 (b) 59 (c) -1/3 (d) 2 (e) 18/5 d Which is the closest to -0.3? (a) 4 (b) 84755 (c) -1 c What is the closest to -0.3 in -5, 0.5, -1, -40.7, -0.2? -0.2 Which is the nearest to 0.324? (a) 4/3 (b) -4 (c) 0.1 (d) -2 c Which is the nearest to 0? (a) 62 (b) 0.5 (c) -4 (d) 0.4 d What is the closest to -0.1 in 602, 5, -6? 5 What is the nearest to -9 in 1/3, 32, 0.4, -0.03? -0.03 Which is the closest to -1? (a) 6 (b) -4/873 (c) 0.2 b Which is the closest to 1.78? (a) 2/63 (b) 4 (c) -2 (d) -0.4 a What is the nearest to 25 in -1, -2/9, 3/8, -2/81, -2/3? 3/8 What is the nearest to 151 in -5, -1, -2, 5? 5 Which is the closest to -2? (a) 2/121 (b) 0.02 (c) 33 a Which is the nearest to 1? (a) -0.05 (b) 1/4 (c) -145 b Which is the nearest to -11? (a) 5/4 (b) 3 (c) 4/19 (d) 606 c What is the closest to 0 in -0.01, -1/510, 1/5? -1/510 What is the closest to -3/2 in -4/5, -0.6, -0.3, 3? -4/5 What is the nearest to -7 in -1, 4, 4/593, -5, -4? -5 Which is the nearest to 4? (a) 306 (b) 5 (c) 0.18 b Which is the nearest to -2? (a) 2 (b) 690 (c) 6 a What is the nearest to -51 in 4/11, -0.01, 2? -0.01 Which is the nearest to 0.2? (a) -1/17 (b) -7/3 (c) -1/3 (d) -4/7 a What is the nearest to 1/3 in 0.1, 10.78, -0.05, 4, -2? 0.1 What is the nearest to -920 in 2, -4/3, 0? -4/3 What is the closest to -0.3 in -1/3, -0.4, 0.3, 25/4? -1/3 Which is the nearest to -1? (a) 5/4 (b) -5.8 (c) 60 a What is the nearest to -627 in -4/9, 1/4, 1/11, 0.2? -4/9 Which is the closest to 0.2? (a) 0.19 (b) -16 (c) 11 (d) 2/21 (e) -1/4 a What is the closest to -1 in -74, -3, 16, -0.03? -0.03 Which is the closest to -6? (a) 0.1 (b) 0.2 (c) -3 (d) -3378 c What is the closest to 1 in 385, -0.6, -10, 5/3? 5/3 What is the closest to 2 in -4, 0.2, 53, -0.1, -3? 0.2 Which is the nearest to 65? (a) -5 (b) -3 (c) 1 (d) -0.105 (e) 0.1 c Which is the closest to -1/16? (a) 0.2 (b) -5/3 (c) 4/9 (d) 2/11 (e) 1/3 d Which is the closest to -0.1? (a) 2 (b) -1005 (c) 5 (d) 1 (e) -12/11 e What is the closest to -33 in -3/4, -1, 13/2? -1 Which is the closest to -0.7? (a) -5 (b) 0.3 (c) -0.29 (d) 3 (e) -1 e Which is the nearest to -70.4? (a) -0.2 (b) 3/2 (c) 6 (d) 3 a Which is the nearest to 0? (a) -2/47 (b) 0.2 (c) 0 (d) 89 (e) -1 c Which is the nearest to 0.9622? (a) 0.4 (b) 3/2 (c) -2 (d) -1 b Which is the closest to -17? (a) -5 (b) 4 (c) 66/59 (d) 1 a What is the closest to 2/5 in 0.006, 1/3, 0, 38? 1/3 Which is the nearest to 1/4? (a) -0.2 (b) 0.1 (c) 3 (d) -46/11 b What is the nearest to 0 in -1, -2/9, -3/7, -728, -1/10? -1/10 What is the closest to 0.06 in -0.0428, 1, -2/3? -0.0428 Which is the nearest to -1? (a) -132 (b) 5 (c) 9 (d) -0.2 d What is the closest to 3/13 in -3/5, 5, 14, -1.6? -3/5 Which is the nearest to -1/2? (a) -1 (b) -3 (c) -17 (d) -0.3 (e) 115 d What is the closest to -2 in -0.65, -0.05, 5, 3/2, -4/3? -4/3 What is the nearest to -5/3 in -15, -2/5, -5, 52, 1/2? -2/5 Which is the closest to 2? (a) -3 (b) 2/7 (c) 1 (d) -463 c What is the nearest to -1 in 5, 1620, -1/4? -1/4 Which is the nearest to 15? (a) -0.3 (b) 3 (c) 24893 b Which is the nearest to -1/4? (a) 5 (b) 5945 (c) 3 (d) -0.2 (e) -2/9 e What is the closest to 0.1 in -1/475, 1/4, -2/17, -2, 6.7? -1/475 What is the nearest to 1 in -7/17, 0.6, 23? 0.6 What is the closest to -67 in -2, -2/209, -2/7? -2 What is the nearest to 0.1 in -2, -3, -5, -2/3, 1/242? 1/242 Which is the nearest to 0? (a) -2/1289 (b) 5 (c) 3/5 a Which is the closest to -0.5? (a) 14/79 (b) 5 (c) 16/11 a Which is the closest to -0.2? (a) -0.122 (b) -4 (c) -30 a Which is the nearest to -0.2? (a) 3/13 (b) 4 (c) -1.1 (d) 0.4 (e) 5 a Which is the closest to -0.3? (a) 74 (b) -5 (c) -0.4 (d) 22/31 c What is the closest to -2 in -1/5, -3175, -66? -1/5 What is the closest to 1 in 0.05, -2/65, -2, 1.6, -3? 1.6 What is the nearest to -18 in 0.45, 75, 5? 0.45 Which is the closest to 20.7? (a) 0.2 (b) -5/2 (c) 7 c What is the nearest to -0.1 in -12, -2/3, 76, -1/4, 0.1? -1/4 What is the nearest to -0.1 in -0.1, -13432, -0.3, 3? -0.1 Which is the nearest to -3.1? (a) -32 (b) 7 (c) 5 c What is the closest to -0.2 in 24748, 2/5, -6? 2/5 What is the nearest to 21 in 1.2, -0.3, 5, 0.3? 5 Which is the closest to -6/5? (a) -1 (b) 0.23 (c) -0.4 (d) -9 a Which is the nearest to -0.32? (a) -5 (b) -1 (c) -16.4 b What is the nearest to 22 in 20, -3/17, -5? 20 What is the closest to 0.1 in -1/2, 0.1, 22, 156? 0.1 Which is the nearest to -1/4? (a) 2/5 (b) -8 (c) 1/2 (d) -51/16 (e) 2 a What is the closest to 0.1902 in 1/10, 360, 2? 1/10 Which is the nearest to 2/7? (a) 0.4 (b) 4 (c) 0 (d) -0.077 a What is the nearest to -7 in 0.4, 568, 4? 0.4 Which is the nearest to 0.2? (a) -39 (b) -40/3 (c) 0.2 c Which is the closest to 1/10? (a) -0.4 (b) -8 (c) -1823 a Which is the closest to -0.19? (a) 3 (b) -0.1 (c) 0.15 b What is the closest to 14 in -0.6, 199, -0.4? -0.4 Which is the nearest to 0.1? (a) 97 (b) -3/8 (c) 101 (d) 4/7 d What is the closest to 0.1 in -18/139, -4, -1/3, 2? -18/139 What is the closest to -46 in -0.2, -1/2, -3/23, -4, 5? -4 Which is the closest to 0.1? (a) 1 (b) 0.06 (c) -3 (d) -1/3837 b What is the closest to 0 in -1/2, -5, -2/4605? -2/4605 What is the nearest to -18 in -0.4, -2/17, 0.031? -0.4 Which is the nearest to 8/17? (a) -0.1 (b) -3 (c) 2/11 (d) 1022 (e) -1 c What is the nearest to 1/2 in -5, 0.2, 4, -0.0066? 0.2 Which is the closest to 8? (a) 1 (b) 4/3 (c) -2.7 (d) 0 (e) -2/5 b Which is the closest to -31/176? (a) -0.4 (b) 0 (c) -2 b Which is the closest to 1/116? (a) -2/59 (b) 0 (c) -2/11 (d) -3 b What is the nearest to 0.52 in 6/5, -5, -2, -10, 4? 6/5 What is the nearest to -2 in 155, 2, 0.03, 3? 0.03 Which is the closest to -4/7? (a) -2/275 (b) 3 (c) 5 a Which is the nearest to -0.14? (a) 2/3 (b) -0.2 (c) 0.216 (d) 1 (e) 0.3 b What is the closest to -19 in 64, -3, 3/4, 708? -3 Which is the closest to 0.07? (a) -0.3 (b) -1/35 (c) -13/24 b What is the closest to -0.04 in 0.3, -3, 17825, 4, 0.5? 0.3 What is the closest to 3595 in 0, -0.3, -3/7? 0 Which is the closest to 1/4? (a) -0.3 (b) -8 (c) -6 (d) 2/877 (e) 0.3 e Which is the closest to 2/9? (a) 1 (b) 2/6947 (c) -1/3 (d) -2/9 b What is the closest to -2/9	{ "pile_set_name": "DM Mathematics" }
12 = h for c. -2 Let x(n) = -n - 3. Let d be x(-8). Solve 0 = 2u - d + 11 for u. -3 Let q(z) = z - 9. Let m be q(10). Solve l - m = -4 for l. -3 Let x(s) = s2 - s - 1. Let h be x(-2). Let y = 6 - 4. Let o = h - y. Solve b + o = -2 for b. -5 Let t = -2 + 6. Let l be -1 + t - (-9 + 6). Solve 0 = -lc + 2c - 4 for c. -1 Let w be 34 - 24 - (5 - 0). Solve 5g + w + 20 = 0 for g. -5 Suppose 3s = -s. Suppose 0 = -sa - 4a. Suppose 5r + 5u - 35 = a, 2r - 4u - 2 = -0r. Solve rv = -6 - 19 for v. -5 Suppose 0 = -5j - 9 + 34. Suppose -2i + 3 = -j. Solve 0 = 4f - 0 + i for f. -1 Suppose 4k = -20, -18 = 2w - 0k + 4k. Let l be w + (2 + -3 - 0). Let h be (-10)/(-65) - (100/(-26) - -1). Solve l - h = -3n for n. 1 Suppose 4v = -5j + 68, 2j - v = -0v + 22. Solve -5q + 2q = j for q. -4 Let p = 22 + -14. Let w = -3 + p. Let n = w - -8. Solve -3z = -n + 4 for z. 3 Suppose 0 = -2t + 3t - 2. Let j(b) = 2b - 1. Let h be j(t). Suppose 0 = -4f + 2d - h + 15, -2f + 2d = -8. Solve 0 = -fy + 4y for y. 0 Let z be 3 + 9(-1)/(-3). Let f = 6 - z. Solve fs - s - 5 = 0 for s. -5 Let n be 9 + (-2)/2 - 3. Suppose 0 = 4k - 2v + 2, 0k - 4k - nv + 5 = 0. Suppose k = -y - y + 6. Solve -2z - z + y = 0 for z. 1 Suppose 3n + h + 8 = 0, 0h + h + 5 = -2n. Let v = 0 - n. Suppose vd - 2d = 1. Solve 6x - 5x - d = 0 for x. 1 Let i = -6 - -8. Let j = 1 + i. Suppose n = jn - 6. Solve 0 = -ns - 15 for s. -5 Let o be (0 + 1)/((-2)/12). Let g = o - -10. Solve 2k - 3k - g = 0 for k. -4 Let r = -105 + 112. Solve -3x = -rx for x. 0 Let n(h) = -h*3 + 3h*2 + 4h + 5. Suppose o - 9 = -o - u, 4u - 4 = 0. Let i be n(o). Solve il - 29 = -9 for l. 4 Suppose -2k = k - 60. Suppose -3s = 12, 0 = -5d + 4s + s + 15. Let g = d - -1. Solve 0 = -gi + 4i + k for i. -5 Let c = 12 + -6. Solve -3 = 3k - ck for k. 1 Let n be (-5)/(-10) - (-2)/(-4). Solve -v + n = -2 for v. 2 Let a be (-27)/(-4) - 3/(-12). Suppose -u = -1 - a. Solve un = 3n - 20 for n. -4 Suppose 4h + x - 17 = 2x, -4h + 3x = -11. Suppose 0 = m - 3d + 2, -hm + 0m + 22 = d. Suppose -o = 2o. Solve o = ml + l for l. 0 Suppose 5g - 5y = 25, -2g + 3y + 4 + 1 = 0. Let d be 6/g(-10)/(-2). Solve 0 = 7h - dh for h. 0 Suppose -7x = -6x. Solve -q + 4q - 12 = x for q. 4 Let c = -4 + 7. Let v(r) = 0 + 0 + r3 + 0r - 3 + 5r - 4r*2. Let g be v(c). Solve -gx = -x for x. 0 Let x(r) = -r*3 - 10r*2 + 25r + 16. Let b be x(-12). Solve s + b = 6 for s. 2 Let x = 8 - 19. Let w be 204/33 + 2/x. Suppose 0 = -2f + wf. Solve -m - 2m + 9 = f for m. 3 Suppose 2h - 7 = u, 5u - h - 2 = 8. Solve 12 = -c - uc for c. -3 Suppose -10 = -6k + 38. Solve -2b - k = 2 for b. -5 Let p(r) = 2r2 + 10r - 13. Let q(c) = c*2 + 11c - 14. Let b(l) = -2p(l) + 3q(l). Let z be b(11). Solve -3k + z = -0k for k. 2 Let g(v) = 5v. Let p be g(1). Let r(y) = 2y*2 + y - 2. Let m be r(-2). Solve ms + 3 = -p for s. -2 Let t(o) = o*2 - 2o. Let p be t(4). Let z = p - 5. Suppose -3r = 5i - 35, -zi + r = -2r + 3. Solve iw + 5 = 1 for w. -1 Suppose -24 = -3o - 9o. Suppose -2x = 3x - 5. Solve -oq = x - 3 for q. 1 Let f be 8 + (-7 - 1)/2. Solve 0s - fs + 20 = 0 for s. 5 Suppose 3h + 13 = -5s - 0s, 2h - 2 = 2s. Let t(z) = z3 + z2 + 17. Let g be t(0). Let u = g + h. Solve 7r - u = 3r for r. 4 Let d(r) = r3 - 2r*2 + 1. Let c be d(1). Solve cv = -3v for v. 0 Let h(i) = -i2 + 7i + 6. Let y be h(5). Suppose 0 = d + 3, 2t + 4d - 7d - 29 = 0. Suppose 2n = -0 + t. Solve -nx + 1 = y for x. -3 Let o be 8 - (-1 - (4 - 9)). Let s(w) = 2w*2 + w. Let f be s(1). Suppose fx - 3 = -2g, 3g + x = -o + 12. Solve 0 = -gd - 0d - 15 for d. -5 Suppose -12t + 33 = 5o - 14t, -4o + 24 = -t. Solve -oi + 8 - 3 = 0 for i. 1 Suppose p = 4l + 2p - 14, -2l + 14 = 4p. Solve 2y = ly for y. 0 Let q be 0 - 2 - (2 - -6). Let g = q + 13. Solve -g + 8 = -h for h. -5 Let d(j) = 2j - 10. Let t be d(7). Suppose t = g - 0. Solve 2k + g = -6 for k. -5 Suppose -3o + 22 + 27 = -5n, -4 = 2n + 4o. Let g be 106/(-12) - 3/18. Let r be (-4)/n - g/2. Solve 0 = -t + rt - 4 for t. 1 Let v = 40 + -10. Let l be 1/3v/5. Suppose l = 5q - 3q, -4q = -s + 1. Solve so = 3o + 6 for o. 3 Let j be (7/(63/30))/(1/3). Solve 3q = 5q - j for q. 5 Suppose 0 = i - 3i + 28. Solve -5 = -3y - i for y. -3 Suppose 4x + 20 = -x. Let a be (1 + x + 3)/1. Solve 3v + a = 3 for v. 1 Suppose 0 = 2y - y. Suppose -h - x = -5, 3h - 4x = 1 - y. Solve -hv = -v - 2 for v. 1 Suppose -4a = -3t - 112 - 78, -2a + 3t = -98. Let k = -20 + 36. Suppose -2c = 5d + k, 5c + 16 = 5d + a. Solve 0 = h + 3 - c for h. -1 Let v(x) = x*3 + 9x*2 + 3. Let d be v(-9). Solve dc + c = 4 for c. 1 Suppose 0 = 4y + 19 - 75. Suppose -y = -4g + 2, -o - g = -6. Solve h + o = -1 for h. -3 Suppose 2s - 4i = 30, -5i - 38 = -2s - 5. Solve -z + s = -4z for z. -3 Let o = 4 - 2. Suppose -m - 18 = om. Let v = m + 7. Solve -h = -2h + v for h. 1 Suppose p = 13 - 11. Solve 0 = u - 0 - p for u. 2 Suppose -2r - 3r = 15. Let d be r/6 - 25/(-10). Solve -h = d + 1 for h. -3 Let h = -15 + 17. Solve 0 = hr - 4 + 2 for r. 1 Let m(p) = p3 - p2 + 3p - 3. Let o be m(2). Let h = o + -5. Solve ht = -1 + 7 for t. 3 Suppose -2 - 10 = -3q. Suppose -qx - 10 = -26. Solve -15 = xj - 9j for j. 3 Suppose p = -4x + 7, -5p + 2x + 16 = 3x. Solve 20 = 2o + po for o. 4 Let u = 11 + -9. Solve 0v - 10 = -uv for v. 5 Let w(a) = a3 - a2 + a - 1. Let t be w(0). Let o be 2 - -1 - 0/t. Solve 0 = -4q + o + 13 for q. 4 Let f(b) be the second derivative of -b5/20 + b4/3 - b3/6 - 3b*2/2 - 6b. Let n be f(3). Solve nt + t - 8 = 0 for t. 2 Suppose 2b = -2b - 40. Let p be 9/15 + 6/b. Solve 3w = -9 - p for w. -3 Let i(y) = y*2 + 7y - 3. Let h be i(-8). Solve -2f - h = 3f for f. -1 Let g(m) = 2 - 1 - 2 + 3m. Let x be g(1). Solve 1 + x = -i for i. -3 Suppose 5l - 3 = q, -l - q - 1 = -4. Solve 0 = -k + l for k. 1 Suppose -3n - 12 = -3y, 0 = 3y - 0y - 2n - 12. Suppose y = t + 5. Let x be -12((-3)/(-9) + t). Solve -m - m = -x for m. 4 Let s = -2 + 6. Suppose -2 = 2m - 28. Suppose 5i = l - 16, 2l - si - m = 1. Solve -7 = 4o + l for o. -2 Let u be -1(-3 + 1)/((-4)/(-2)). Solve u = -0w - w for w. -1 Let j be 0 + (-2 - (4 + -13 + 3)). Solve -s = -5s + j for s. 1 Suppose 4 = 4v - 6v. Let c be v/(-6) + 4/6. Let b = c + 0. Solve -b = 3g + 5 for g. -2 Let k be (-8)/(-44) + (-106)/(-22). Let v(p) = -p2 + 7p - 4. Let u be v(k). Solve -5b + 14 = -u for b. 4 Suppose -2x = -2g - 6, 3x - 9g - 9 = -4g. Suppose 0 = -xo - 11 - 4. Let h = o + 5. Solve -4 = -ht - 2t for t. 2 Let u be ((-2)/(-6))/((-2)/(-42)). Let b = u - 5. Solve -bt + 2 = -4 for t. 3 Let c be (-4)/(60/(-9))-5. Let a be (-30)/(-45) - 4/c. Solve -3b + a = -2b for b. 2 Suppose 0 = -0k + 4k. Solve k = 2b - 2 for b. 1 Suppose 10 = 2c, 3c - 5c = -3b - 4. Solve -bv - 4 = 2 for v. -3 Suppose -9w + 4w = 0. Solve 0 = 4h - 8 - w for h. 2 Suppose 23 = 5v - 4o, 6v - 2v = -3o + 6. Let z(m) = 7m + 8. Let r(q) = -q. Let n(b) = 6r(b) + z(b). Let j be n(0). Solve vt - 25 = jt for t. -5 Suppose 28 = 4m + 3t, -4t - t - 14 = -2m. Let q = m - 4. Let h(z) = z2 + 4z + 2. Let b be h(-4). Solve q = -bs - s for s. -1 Suppose -4l + 4 = -5m - 30, -3l = m - 16. Solve -4h - 10 = -lh for h. 5 Suppose 0 = 2u + u + 2g - 56, u + g - 18 = 0. Solve -8a + 3a + u = 0 for a. 4 Let n = -7 - -11. Let x = n + 2. Let r be 1/4x2. Solve -t - 12 = rt for t. -3 Let o be (5 + 65/(-10))/(1/(-6)). Solve -3z + 3 = o for z. -2 Suppose 0 = 3n - 3y - 2y - 5, 5y = -3n - 5. Solve 9 = -na + 3a for a. 3 Let g(o) = o2 - 2o + 3. Let f be g(0). Solve 0 = -6a + fa for a. 0 Let c = 46 + -44. Solve -c = -d + 3 for d. 5 Let t(z) = 2z - 1. Let j be t(-2). Let g(w) = -w2 + 2. Let s(a) = a2 + a - 3. Let n(l) = js(l) - 4g(l). Let h be n(-6). Solve f - h - 2 = 0 for f. 3 Suppose 2m + 2 - 12 = 0. Let s(w) = w - 2. Let r be s(m). Let l be (r/6)/(2/16). Solve -2f = 2f + l for f. -1 Let x = 46 - 43. Solve 6s + 6 = xs for s. -2 Suppose -h - 22 = -3p - 5h, -7 = -2p + 5h. Let a = 10 - p. Solve -al + 10 - 2 = 0 for l. 2 Let c = -4 + 12. Solve 2i + c = -0*	{ "pile_set_name": "DM Mathematics" }
ue of 6/(-3)(-1)/2? 1 Calculate 3(100/15)/(-4). -5 (-2)/(18/75(-80)/48) 5 What is (-4)/(-30)(-20)/(-4)-6? -4 What is ((-440)/176)/(2/(-4))? 5 What is ((-12)/45)/(10/25)? -2/3 What is ((-48)/9)/(-3(-28)/(-18))? 8/7 ((-1)/4)/(177/(-236)) 1/3 What is the value of 14((-50)/20)/5? -7 1005/(-804)(-3)/10 3/8 Evaluate (-432)/756(-1)/(-2). -2/7 What is 1/29(-6)/9? -3 What is the value of ((-2)/16)/(2/(14))? -1/4 Evaluate (-6)/530/12. -3 What is ((-16)/(-5))/45? 4 (-28)/(-30)550/220 7/3 Evaluate 9/38/6. 4 What is the value of (-11)/1116/40? -2/5 Evaluate (6/10)/((8/(-5))/(-8)). 3 What is the value of 3/((-9)/2)(-60)/160? 1/4 What is the value of (-5)/(-9)(-4)/(-40)-4? -2/9 27/(-3)4/(-18) 2 ((-20)/12)/(6/(-36)5) 2 Calculate (96/12)/249. 3 Evaluate 14-5(-5)/(-525)12. -8 Calculate ((-2)/(-10))/(3(-7)/35). -1/3 Calculate ((-20)/50)/(14/(-105)6). 1/2 What is the value of (-11)/(-88)3(-2)/3? -1/4 What is ((0/(-3))/1)/1? 0 Calculate (-1)/((3/(-2))/((-12)/32)). -1/4 Calculate -126/(-324)(-6)/(-1). 4/3 What is the value of (((-78)/(-54))/(-13))/((-1)/3)? 1/3 What is 4(1/10)/(2/2)? 2/5 Evaluate 3/(((-312)/(-13))/8). 1 Evaluate (314/(-14))/(1/1). -3 Calculate (6/(-15))/(1276/(-220)). 2/29 Evaluate (-80)/(-180)1/((-6)/9). -2/3 (((-27)/3)/(-36))/((-27)/(-48)) 4/9 (12/20)/((-27)/30) -2/3 Calculate (32/80)/((-8)/(-6)). 3/10 Evaluate (((-392)/(-21))/7)/(4/(-12)). -8 What is the value of ((-14)/(-280))/(-16/15)? -1/8 Evaluate (40/175)/((-11)/(220/8)). -4/7 What is the value of -554/(-60)(-2)/(-3)? 3 What is ((-48)/(-840))/(2/10)? 2/7 Calculate (-2)/35/2-3. 5 What is 3/5(-280)/504? -1/3 Calculate (1/(-3))/(((-891)/18)/(-11)). -2/27 What is the value of (-2)/1442/(-36)? 1/6 ((374/(-44))/(-17))/((-14)/24) -6/7 What is the value of (-8)/(-36)3-2? -4/3 What is (-5)/(2(-7)/(-14))? -5 Evaluate (752/(-940))/((-24)/50). 5/3 (((-56)/(-42))/(-1))/20 -1/15 Evaluate 1/(73/(-189)). -9 What is the value of (-11)/(-66)(-4)/(2/1)? -1/3 What is 2/55(-48)/84? -8/7 Evaluate (-1778)/38116/20. -7/5 Calculate 9/(-8)66/(-99). 3/4 -119/63 -1/7 What is 517/(-7)? -5 (78/(-416))/((-9)/8) 1/6 What is the value of -16/((-6)/(-1))? -1 Calculate 5/(25/(-2))765/(-51). 6 What is 12/18(-2)/(-6)-3? -2/3 Calculate ((-8)/14)/((-23)/((-161)/6)). -2/3 Evaluate (3(-12)/54)/((-10)/6). 2/5 What is ((-16)/(-500))/((-7)/70-4)? 2/25 What is (9/(-54)6/4)/1? -1/4 What is the value of (2/5)/(27/(-15))? -2/9 (-2)/((36/(-24))/((-3)/4)) -1 What is (-24)/14-1224/864? 4/7 Calculate 318/(-108). -2/9 What is ((-12)/(-30))/(((-36)/(-5))/3)? 1/6 Evaluate (4/(-10))/(352/50). -2/7 Calculate ((-8)/6)/((-43)/(-258)). -8 Calculate (-2)/(-12)59/(531/594). 11 What is (0/4)/((-30)/5)? 0 Calculate (0/35)/((6/1)/(-2)). 0 Evaluate ((-5)/3)/((-29)/(-87)). -5 Calculate 5/((-80)/(-24))8/6. 2 Calculate (-34)/(-119)(-1)/(8/7). -1/4 (-45)/27(-27)/30 3/2 Evaluate ((-12)/(-96)8)/(12/(-3)). -1/4 What is the value of ((-14)/14)/((-3)/12-34)? -2/17 Evaluate 195/(-234)-1(-2)/(-1). 5/3 Evaluate 8/264/128. 2 (-1)/4-8(-2)/8 -1/2 1/2((-48)/52)/(-3) 2/13 8/123/(-19) -2/19 What is the value of 2(-4)/802? -1/5 What is the value of (-43/(-168)-2)/(-1)? 1/7 ((-56)/(-16))/((-5)/10) -7 Calculate 43/88/(-30). -2/5 5/((220/8)/11)-1 -2 What is the value of ((-8)/((-13)/(-13)))/1? -8 What is the value of 72/(-702)9/6? -2/13 What is (6/12)/((-14)/(-12))? 3/7 Calculate 42/(-4)7/(-294)6. 3/2 Evaluate ((-3)/((-207)/(-4)))/(2/3). -2/23 What is (-425/(-70))/(10/(-35))? -5 What is (-24)/(-84)(-7)/9? -2/9 What is the value of (-16)/(-12)24(-12)/(-5568)? 2/29 (-2)/5-52/24 1/6 Calculate ((-1)/(-1))/((-2)/(-10)). 5 What is the value of (-90)/200(-50)/(-30)? -3/4 (((-34)/(-34))/((-1)/7))/1 -7 Calculate (266/266)/(1/(-8)-1). 8 Calculate -5(52/(-13))/(-15). -4 2/(4/2022/11) 5 (-14)/(-294)14(-1)/(-3) 2/9 Evaluate ((-44)/6)/(-11)9. 6 What is the value of 5/(15/(-9))72/378? -4/7 Evaluate (-36)/16-216/8. 9 What is the value of 0/((2/6)/(2/6))? 0 What is (6/18)/(((-9)/(-3))/(-3))? -1/3 Evaluate (81/9)/(-9)3. -3 Calculate 2/(-5)1(-2)/(-2). -2/5 What is 16/(-72)-40? 0 What is the value of -12(27/(-6))/(-9)? -6 Evaluate ((-5)/(20/2))/(9/(-36)). 2 What is 8/(-12)(-105)/14? 5 Calculate ((69/6)/23)/((-2)/12). -3 Evaluate (7/7035)/14. 1/4 Calculate (-1)/((-2)/(-12))(-10)/75. 4/5 Calculate 1(-12)/((-12)/3). 3 1/(1/(1/(-2))) -1/2 What is ((-13)/26)/((-11)/154)? 7 What is the value of ((-8)/(-24))/((-20)/6)? -1/10 What is the value of (7/119)/(-1(-3)/6)? 2/17 (2016/384)/(-13) -7/4 What is the value of ((-2)/(-5))/((-232)/145)? -1/4 What is 9/(-1)(-8)/24? 3 What is the value of (1/2)/((-6)/12)? -1 Calculate 16/3((-133)/19)/28. -4/3 What is the value of 63/92/(-16)? -1/4 What is 4/6((-60)/(-32))/5? 1/4 (-696)/(-116)14/(-12) -7 Calculate (9/(-15))/((-32)/320). 6 What is ((-440)/(-396))/((-10)/(-12))? 4/3 What is the value of (-2)/4(-328)/(-1394)? -2/17 What is the value of ((-6)/36-6)/(-3)? -1/3 6/(-27)3/(-4)-2 -1/3 What is ((78/(-12))/(-13))/(1/(-1))? -1/2 Evaluate ((-30)/24)/(4/(-16)). 5 What is (-72)/1981/(-2)? 2/11 Calculate ((-121)/22)/118. -4 What is ((-126)/1092)/((-2)/((-8)/3))? -2/13 Calculate 3(-8)/12(-3)/2. 3 Evaluate (-420)/24(-8)/28. 5 What is (3/142)/((-12)/42)? -3/2 What is 0/(((-1)/4)/((-6)/48))? 0 Calculate 5/(-20)-102. 5 What is the value of (-192)/((-176)/(-11))(-1)/(-3)? -4 What is the value of ((-474)/(-29625))/(2/(-10))? -2/25 What is the value of ((-24)/(-32))/(9/2)? 1/6 What is (4/14)/(44/14)? 1/11 Evaluate 15/10112/42. 4 (((-25)/(-55))/(-5))/((-3)/11) 1/3 (-1)/33/4 -1/4 Evaluate (-90)/(-5)5/(-15). -6 2/((-6)/(-2)(-8)/60) -5 What is the value of (-21)/(-7)((-2)/1)/6? -1 What is -3(12/1)/(-12)? 3 What is 69/(-216)(-32)/10? 4/5 Evaluate ((-46)/(-69))/((4/6)/(-2)). -2 Calculate (6/6)/(-5(-4)/140). 7 Calculate (-3)/((-3)/2)4/2. 4 What is the value of 0/(-20)(-1)/(-3)? 0 What is (32/2)/(((-76)/19)/2)? -8 What is the value of (12/14)/(24/(-12))? -3/7 Evaluate 0/(((-126)/2)/9). 0 Evaluate ((-135)/315)/((1/1)/(-7)). 3 Evaluate (3/5)/((-726)/220). -2/11 What is the value of ((-3)/6)/((-129)/(-172))? -2/3 What is 5(-2)/(-10)-3? -3 ((-3)/6)/(4/(6-4)) 3 What is the value of ((-2)/(1-10))/(85/255)? 3/5 What is ((-24)/(-288))/(15/24)? 2/15 What is the value of (4/(-6)21/14)/1? -1 (-2)/454/(-36) 3/4 Evaluate ((-12)/(-162)-6)/(-2). 2/9 What is (-152)/382/166? -3 What is the value of (-6)/(-15)10/2? 2 (-2)/(((-42)/(-12))/7) -4 What is the value of (1/(-5))/(16/(-10))? 1/8 Calculate ((11/(-3))/(-11))/(-1). -1/3 Calculate ((150/(-45))/(-2))/((-2)/6). -5 Calculate 154/7623(-54)/(-2). 6/11 Calculate 5/1(-1)/((-14)/(-4)). -10/7 Evaluate 13/13032/8. 2/5 Calculate ((-450)/27)/(-10)2/5. 2/3 What is (665/(-266))/(10/(-24))? 6 (-28)/2854/(-4) 5 Evaluate (3/12)/(9/(-4)1). -1/9 ((-7)/14)/(2/8) -2 Evaluate 126/(-48)-4-1. -6 What is the value of 2/((3/2)/(15/(-4)))? -5 Calculate ((-14)/(-42))/((-2)/(-6)). 1 Evaluate ((-4)/(-6))/(6/728). 1 Calculate 0/6(14/4)/(-7). 0 Calculate (-9)/(-3)(-2)/(30/5). -1 What is the value of (2/(-4)4/4)/(-2)? 1/4 6/2(-8)/((-48)/(-2)) -1 (-1)/((-5)/5)-5 -5 Evaluate (2/5)/((-64)/40). -1/4 What is 2/4(-54)/92? -6 What is the value of 4/18(-6)/4? -1/3 Evaluate (14/35)/((-12)/10). -1/3 Evaluate ((-58)/232)/(1/(-10)1). 5/2 Evaluate (99/55)/(9/(-30)). -6 What is 60/(-75)(-20)/64? 1/4 What is the value of (2/(-4))/(21/(-84))? 2 Evaluate (-1)/((-5)/2014). 2/7 What is (-4)/(-70)(-182)/(-26)-5? -2 Evaluate ((-16)/6)/(36/6). -4/9 What is (-124/(-16))/1? 3 What is the value of (-287)/369((-4)/(-14))/1? -2/9 What is 1/((-1)/((-54)/(-30)5))? -9 Calculate 4(-9)/(-144)-20. -5 What is the value of -314/211/(-8)? 1/4 What is ((-4)/(-8)-1-2)/1? 1 What is the value of ((-1)/((-2)/2))/((-114)/(-76))? 2/3 7(24/4)/(-18)-3 7 2(-5)/((-130)/13) 1 What is ((-4)/90)/((-8)/(880/(-11)))? -4/9 (-14)/(-70)-185/3 -6 What is the value of (1/(7/7))/(10/(-6))? -3/5 What is ((49/7)/(-7))/((-4)/1)? 1/4 Evaluate (-10)/(-4)-1012/(-1350). 2/9 Evaluate 6(-2)/(-2)2/4. 3 ((1/(-2))/1)/(7/(-4)) 2/7 Evaluate 12/(-18)(-6)/4. 1 What is ((-20)/(-6))/1*24/20? 4 Calculate (3/((-252)/(-8)))/(10/60). 4/7 Calculate (-10)/(	{ "pile_set_name": "DM Mathematics" }
Let z be 188/16 + 3/12. Suppose -11b - 307 = -zb. Is b prime? True Suppose 20317 = 11f - 451. Suppose 1221 = s - f. Is s a prime number? True Suppose -4q + 0q = -4l + 4412, -l + 2q + 1105 = 0. Let h = l - 599. Is h a composite number? True Let g(s) = -s3 - 9s*2 + 14s + 16. Let p be g(-10). Let l = 93 + p. Is l a prime number? False Let b be -11 - (-65)/(-5). Let z be (-6)/21 + (-2804)/b. Let q = z + 57. Is q a composite number? False Let c = 79 + -81. Is ((-1039)/c - 0)(-29 - -31) a prime number? True Let i(s) = s*3 + 3s*2 - s + 3. Let c be i(-3). Suppose 5l - 3j - 259 = 0, 0 = 5l - j + cj - 275. Is l a composite number? False Suppose 2y + 2h + h - 6 = 0, 0 = -y - 4h + 8. Suppose y = m - 808 - 553. Is m composite? False Suppose -y = -5i + 303591, 301339 + 2268 = 5i + 3y. Is i composite? False Let r(y) = -y3 - 7y*2 + 2y - 4. Let q be r(-7). Is -6 + (-111)/q - (-185)/6 composite? False Let t(f) = 8 - 7f - 3 - 5f + 0f. Is t(-6) prime? False Suppose 0 = 5w + 2a + 10, -4w = -w - 3a - 15. Suppose -3l - 502 = -0g - g, w = 5g - 2l - 2523. Is g a composite number? True Let t(a) = a2 - 7a - 3. Let h be t(8). Suppose 6n + 2712 = 4u + 2n, 4u = -hn + 2667. Is u a prime number? True Let z = -1497 - -5888. Is z prime? True Suppose 0y + 5y - 75 = 0. Suppose 7s - 3s + 2o - 254 = 0, 0 = -3s - o + 189. Let b = y + s. Is b prime? False Let a(p) = 4p*2 + 2p + 1. Let r be a(-1). Is (0 - -3) + 115 + r a prime number? False Suppose 13 = -g + 4j, g - 2j = -0j - 7. Is 122/(g + 2) + 1 a composite number? True Let w(u) = -u - 3. Let q be w(-6). Let i(z) be the third derivative of 13z5/30 - z4/6 - z*3/6 - 5z*2 - z. Is i(q) a composite number? True Let s be 3/((4 + -5)/(-9)). Let k be 6/27 - 2166/s. Let m = -1 - k. Is m composite? False Suppose -3z + 1541 = -817. Suppose -y - 2y = -z. Is y composite? True Let t be 948(2/(-8) - -2). Suppose -4s + s = -t. Is s prime? False Let t = -4407 + 11416. Is t a prime number? False Let s = 22140 + -3193. Is s a prime number? True Let h(z) = -3z*3 + 11z*2 + 8z + 81. Is h(-14) a prime number? True Let m = -82 + 563. Is m prime? False Let q = -3 + 3. Suppose q = -m - 1 + 5, 3s - 919 = -4m. Is s a prime number? False Let g(m) = 469m - 7. Let y be g(-2). Suppose -3a + 7354 = 4l, -a + 5a - 9852 = 4l. Let o = a + y. Is o prime? False Suppose -4d + 19 = -r, r = -r - 6. Suppose -dw + 3394 = 1046. Is w composite? False Is 4/(-3)(-13875)/10 + -3 a prime number? True Suppose -2d - 55v + 57v = -131198, -2v = 0. Is d a composite number? False Let v(p) = -p*2 + 11p + 36. Let n be v(14). Is 12/(-36) - 1076/n composite? False Suppose 0j + 3d + 10065 = 3j, -d - 16767 = -5j. Is j composite? True Let o(p) = 1171p - 12. Let f be o(3). Suppose -3r + f = 6r. Is r composite? False Let v(h) = 584h*2 - 27h + 48. Is v(5) a composite number? True Is -5 + 5 + 1599 + 4 a prime number? False Let s(c) = -c*2 + 4c + 118. Let g be s(-10). Suppose 19 = -r + 88. Let h = r - g. Is h composite? True Let a be 1 + -1 - (1 + 3). Let o be 2/4 + (-2)/a. Is 213(8/(-12) + o) composite? False Suppose -20h = 2h - 938498. Is h composite? True Let g(j) = -255j3 - j2 - 3j + 17. Is g(-4) a composite number? False Let f be (-64)/((-6)/(-3)) + 3. Let y = f + 50. Suppose -5w - 5v = -175, -1 = -5v - y. Is w prime? False Let p = 52612 + -29370. Is p composite? True Let q = -273 + 170. Let g = q + 484. Is g composite? True Suppose 0 = -2m + 4s + 3 + 29, 20 = 5m + 2s. Suppose 11g + mg = 1139. Is g prime? True Let l(r) = 12r - 3. Let p be l(1). Let x(a) = 2a*3 - 14a + 8. Let m be x(p). Suppose -4j + m + 176 = 0. Is j composite? False Suppose -3w + w + 17 = b, 4b - 26 = -w. Is 1577 + -4 + w + 0 prime? True Is ((-16)/4)/(36/(-182907)) a prime number? True Let r(c) = 3809c*2 + 13c + 23. Is r(-2) prime? True Let m(r) = 9r3 + 5r*2 - 6r + 17. Let z(i) = -17i3 - 10i*2 + 13i - 33. Let f(w) = 11m(w) + 6z(w). Is f(-7) a composite number? True Let b(f) be the third derivative of -f*4/8 - 11f*3/6 + 6f*2. Let p be b(-5). Suppose k - 1583 = -pj, -9 = -4k + 3. Is j a composite number? True Is (221/(-51))/((-5)/255) a composite number? True Is 3415/(4 + -5 + 2) + -8 prime? True Let f(p) be the first derivative of 5p*3 + 9p*2/2 - 23p + 21. Is f(-8) a composite number? True Let c be ((-1006)/6)/(2/36). Is (-1 - -2) + 7/((-21)/c) composite? True Suppose 4 + 2 = 3p. Suppose -4h + 822 - p = 0. Is h a prime number? False Suppose -3 - 9 = -4t, 2f = -4t + 22. Let d(n) = 55n + 2. Let m be d(f). Suppose -8 = -5h + m. Is h a prime number? False Let s(v) = -2v*2 - 10 - 17v + v*3 - 2v*2 - 9v*2. Let i be (-5)/((-5)/(-3)) - -18. Is s(i) a prime number? False Let i(v) = -109v - 84. Is i(-11) composite? True Suppose -5p + 416 = h, -p - 20 = 3p. Suppose 3b - h = -3d, -2b = -4d - 212 - 94. Is b a composite number? False Is ((-1)/((-24)/5442))/(1/4) prime? True Let f be (-2 + 0)570/(-12). Let y = f - -5. Let p = y + -17. Is p prime? True Is (-224)/(-32) - -25279 a composite number? True Let a = 3892 + -2185. Is a a composite number? True Suppose 0v - 14 = -2v. Suppose 2d - 2o - 4 - 12 = 0, -13 = -d + 2o. Suppose -x + 121 = -r, -vx + 484 = -dx + 2r. Is x a composite number? True Suppose 5h = h - 3180. Let y = h - -1352. Is y composite? False Let n(f) = -15f - 2. Let c be n(-2). Suppose u - d = -73, -d - c = 2u + 112. Is (-2)/2 - (5 + u) prime? False Let f = -76984 - -129859. Is 4/(-14) - f/(-63) a prime number? True Let y = 24 - 40. Let p be ((-6)/(-4))/(6/y). Let f(c) = -2c*3 - 3c*2 - c + 5. Is f(p) a composite number? False Suppose -261x + 273x - 790692 = 0. Is x a composite number? True Suppose d = 2d - 350. Suppose 0 = -2z + d + 20. Let j = 574 - z. Is j composite? False Let q = -2953 + 4166. Is q prime? True Let i = -70 - 9. Let j = i + 139. Let v = j + -37. Is v prime? True Suppose -x - 4 = 0, -x = 2y - 4y + 28. Let l(r) = 403r + 1. Is l(y) composite? True Let c(j) = 419j - 6. Let z be c(-8). Let i = z - -1852. Is (-4)/6 - i/18 prime? True Suppose 3o - 657 = 2o. Suppose 4w - o - 1787 = 0. Let k = w - 364. Is k composite? True Is 10445 + 32/(-8) + 0 prime? False Let t(r) = 0r + 9r + 5r2 + 1 + 7r*2. Suppose -n - 2n - 18 = 0. Is t(n) a prime number? True Suppose 0 = -2v + 4u - 6, 3v - u - 6 = -0u. Suppose -3x - 26 = -a, 4x + 13 = -0a - va. Is -121x/4 a prime number? False Let c(i) = -i*3 + 17i*2 + 13i + 35. Is c(16) prime? True Let c(u) = 354u2 - 9u + 41. Is c(4) a prime number? True Is (-6 - 104/(-16))11746 prime? False Let w be (5 - 2)(-1)/(5/(-5210)). Is w114/28 a composite number? True Suppose y - 3g = -209 + 1544, -3g + 2652 = 2y. Let r = y - -308. Is r a prime number? True Let d(l) = 1900l - 7. Is d(2) composite? False Let c = 126 - 125. Let m be ((-8)/6)/23. Is ((-47)/m)/(c/2) a composite number? False Let j = 72 + -52. Suppose 0 = 27s - js - 2233. Is s a prime number? False Is 2/(-3 - (-33)/9) + 1264 composite? True Let k(b) = 208b + 12. Let s be k(6). Suppose s = 5l + z, 0z = 5l - 5z - 1230. Is l composite? False Suppose a + 21j - 11107 = 16j, 11147 = a - 5j. Is a a composite number? True Suppose 6m = 7m - 4035. Suppose -71k + 74k - m = 0. Is k a prime number? False Let b(u) = 5u*2 + 24 - 13 + u + 12u*2 + 3u*2. Is b(-8) a prime number? True Let x be 174/418 + -20 + 17. Is x - (5 - 5 - 1) composite? True Let t = 587 - 235. Suppose -t = -3z + 407. Is z prime? False Suppose -6l + 6423 = -141135. Is l a prime number? True Let s(x) be the second derivative of -917x6/120 + x5/60 + x4/12 + x3/6 - 2x*2 - 4x. Let o(h) be the first derivative of s(h). Is o(-1) composite? True Suppose -5 = -5j + 5y, -4y + 0 = -j - 2. Let i(r) = 7r - 19. Let m be i(3). Suppose l - jz - 79 = 23, 8 = -mz. Is l composite? True Let p be 4 + ((-4)/1)/2. Suppose 2c + 639 = y, 2c + 1278 = py + c. Suppose -1085 = -4g + y. Is g composite? False Suppose -4i + k + 15287 = 0, -10k = -11k - 3. Is i a composite number? False Let p be 16(-46)/4. Let r = -127 - p. Is r(-2)/810 a composite number? True Suppose d + 2v - 437 = 0, 3v + 1347 = 6d - 3*d. Is d a pri	{ "pile_set_name": "DM Mathematics" }
.6 - 5. Let o = p - -0.1. What is the second biggest value in -1/11, l, o, -3/5? o Let x = 0.0335544 + 1.6664456. Let f be -2 + (-18)/(-5) + -2. Which is the second biggest value? (a) -3 (b) f (c) x b Suppose 20f = -228 - 92. Let p = 65/4 + f. Which is the smallest value? (a) p (b) 8/13 (c) -3 c Let g be -2 + (0 - (-40)/18). Let u(k) = 128k*2 + 7k - 51. Let v be u(4). Let d be 90/v(-12 - -2). What is the third biggest value in 0.03, d, 3/7, g? 0.03 Let i = -328.0441 - -0.0441. Let q = i - -332. What is the second biggest value in -0.2, q, -1? -0.2 Let x = 14/387 + 8/43. Let m = -1.2 - 0.8. Which is the second smallest value? (a) -0.25 (b) m (c) 1/6 (d) x a Let t be (77/121 - 1)/(-2). Which is the smallest value? (a) t (b) -6 (c) -5 (d) -0.1 (e) -1/5 b Let f = -3 + 2. Let r = 3384.58 - 3385.08. Let q = 0.39 + -0.01. Which is the smallest value? (a) q (b) r (c) f c Let z = 268.9604 - -0.0396. Let u = z + -269.6. Which is the second biggest value? (a) 0.1 (b) 5 (c) u (d) 0 a Let b = 89/3 - 30. Let m = -0.0887 - 0.0413. What is the third smallest value in b, 4, -3, m? m Let i be 2 + 2/(-15)12. Suppose 710 = -23y + 2826. Let g be (69/y)/((-2)/(-8)). Which is the third biggest value? (a) g (b) 1 (c) i c Let u = -1.9464 - -3.8464. Which is the third biggest value? (a) 135 (b) u (c) 1 (d) 4 b Let t(k) = -k3 + 38k*2 - 3k + 164. Let y be t(38). Let c be (0 - -3 - 1)y/(-200). What is the smallest value in c, -1, -4/3? -4/3 Let t = 0.067 - -14.933. Let i = t - 20. Let y = -2.157 + 0.157. Which is the biggest value? (a) 0.1 (b) -1/3 (c) i (d) y a Let q = 4.927 - 4.027. Which is the third smallest value? (a) q (b) 2 (c) -57 (d) 3 b Let o be (-4)/6 + (-12)/1656/(-36). Which is the second smallest value? (a) 5 (b) 2/5 (c) o (d) -2/5 (e) 2/27 e Let x be (-20)/(-132)11 - 1. What is the third biggest value in x, 2, 4, 4/7, 6/11? x Let u = 1.9 + 0. Suppose -10 = -21j + 16j. Which is the second smallest value? (a) 0.5 (b) j (c) u c Let x = -344 - -306. Let s = 40 + x. Which is the biggest value? (a) s (b) -5 (c) 3/7 (d) -4 a Let d(k) = k2 - 4k + 12. Let a be d(8). Suppose a = -s + 5s. Let l = 897 + -899. What is the smallest value in s, -1, l? l Let g = -5950 + 5498. What is the second biggest value in -0.3, g, -0.1? -0.3 Let z = 41415 - 41414.6. Let m = 4 + -9/2. Which is the smallest value? (a) m (b) z (c) 0.3 (d) -2 d Let s = 1105 + -1104.931. Which is the second biggest value? (a) s (b) 3/2 (c) -1/4 a Let j be 12/648-212 - -4. Which is the second smallest value? (a) 8/3 (b) j (c) 4 a Let q be 65/(-45) - (-50)/30. Which is the biggest value? (a) -5 (b) -146.5 (c) q c Let k = -2 + 2. Let n = -2.2964 - -3.2964. Which is the second smallest value? (a) n (b) k (c) -2 b Let t = 3070983/28 + -109691. Let u = t - -100/7. What is the biggest value in -3, u, -5? u Let s = -6650 + 53201/8. What is the smallest value in -0.3, -237, s? -237 Let v = -1891.88 + 1892. What is the biggest value in 7, v, -2? 7 Let w = -12.6 + 7.2. Let r = 103.4 + w. Let l = -97.6 + r. Which is the third smallest value? (a) 12/7 (b) -0.3 (c) l a Let u = -71 - -354/5. Suppose k - 3c = -6, -5k + 10 = 10c - 5c. What is the second smallest value in -3, k, 0.4, u? u Let n be (-32)/56((-9)/6)/(-3). Let w = 26.8 - 28.8. What is the biggest value in -4, w, 0.2, n? 0.2 Let h = -593/6 + 98. Let q = -1.208 - -0.208. Which is the third smallest value? (a) -0.3 (b) q (c) h a Let q = 15.32 + -14.82. What is the third smallest value in 11, q, 25/2? 25/2 Let u = -3.1 - 0.9. Let x be (-446)/4 + 15/(-60). Let z = x - -112. Which is the biggest value? (a) z (b) -3 (c) -0.2 (d) u a Let l = -0.0838 - -38.3838. Let p = -38 + l. What is the third biggest value in p, -4.4, -4, -0.5? -4 Let t = -175 + 324. Let v = -19 + t. Let q = -131 + v. Which is the second biggest value? (a) q (b) 8 (c) 0.4 c Let x = -136.9511 + -0.0489. Let j = x - -137.1. Which is the second biggest value? (a) -4 (b) j (c) 15 b Let t = 36.98 + -36.78. Which is the fourth biggest value? (a) -3 (b) t (c) 5 (d) 0.05 (e) -5 a Let y = 20774 - 20773.7. What is the second smallest value in -18, -1, 0.4, y, -1/4? -1 Let a = 40.1 - -1.9. Let u = a - 47. What is the third smallest value in 5, u, 2, 6? 5 Suppose -5w + 350 - 370 = 0. Which is the biggest value? (a) 1 (b) 24 (c) -2/17 (d) w b Let g = 56924/53 + -1074. Let t be (-60)/(-48) - (3 - 45/12). What is the third smallest value in 1/5, g, t, -1/4? 1/5 Let q = -4 + 7. Let r = 78526/58899 - -2/19633. What is the third smallest value in r, -6.2, q? q Suppose 4j - 12 = -4l, -5j + 2 = l - 1. Let c = 21.83 - 22.43. What is the third biggest value in l, c, 0, 0.1? 0 Suppose -91k + 66k + 196 = -554. Which is the third biggest value? (a) -1/4 (b) k (c) -0.1 a Let w = -1286.1 - -1286. Which is the third biggest value? (a) 1/4 (b) w (c) -5 (d) -30 (e) -3 e Let m = -289/3 + 95. Let r(l) = l2 - 2. Let v be r(-3). Suppose -14d = vd - 21. Which is the third smallest value? (a) d (b) -4 (c) m a Let b = -0.22 - -1.06. Let v = -1.04 + b. Let x(m) = -m2 + 5m - 9. Let d be x(4). What is the third biggest value in d, 4, v, -49? d Let g = -110 - -772/7. Suppose -113f + 111f + 1 = 3j, -4j = -5f + 14. Which is the fourth smallest value? (a) f (b) 11/4 (c) g (d) -5 b Let h = 0.3 - 1.3. Let a = -19212.9 - -19212. What is the second smallest value in -3/5, a, h? a Let g = -28.43 - -27.8. Let i = -112.37 - -113. Let y = i + g. Which is the second smallest value? (a) y (b) 0.3 (c) 8 b Let d be (-3)/8 - (-297)/88. Let i be 5 - (d + (-55)/(-35)). Which is the second smallest value? (a) 3 (b) -1/3 (c) i c Let r = -14.7 - -123.7. Let p = -3023.1 - -3132. Let n = p - r. What is the third smallest value in -12, -0.2, n, -0.5? -0.2 Let y = 3.09 - -1.91. Let j be 2/7 + 2272/(-8344). What is the third smallest value in -0.1, j, y? y Let f = 7618 + -7617.9. What is the biggest value in f, 0, 6/41, 11? 11 Let z be (-2028)/3042 + (19/27)/1. Suppose 4q + 7 = -1. Which is the second smallest value? (a) z (b) 0.5 (c) q a Let h = -4699200 + 718981042/153. Let t = 390/17 - h. What is the third smallest value in 3, t, 0.3? 3 Let n = 2.5463 - 1.5463. Which is the smallest value? (a) -1 (b) -13 (c) n (d) 87 b Let v be 203(-36)/(-6384) + (-5)/4. Which is the second smallest value? (a) -5 (b) 8 (c) v (d) 2/3 (e) 4 c Let g be (-2)/(-12)(-14 + 32)(-16)/(-168). Which is the biggest value? (a) 1 (b) -1/9 (c) -702 (d) g a Let m = -2105.2 + 2104.7. What is the smallest value in 6, m, 15/16? m Let o = 34.4 - -87.6. Let l = -127 + o. What is the second smallest value in 2, l, 0.4, -1/3? -1/3 Let b = 5 + -3. Let s = 1.033 - 1.5. Let q = s - -0.067. What is the third smallest value in q, b, 0.3? b Let v = -193 - -269. Suppose -vm = -79m + 12. What is the second smallest value in -3, -4, m, 0.3? -3 Let l = 3367 + -26933/8. Let u = 43 + -128/3. What is the smallest value in 3, l, -0.5, u? -0.5 Let j = 28.28 + -26. Let o = j - 0.28. Let w = 0.0977 - 3.0977. What is the second biggest value in -2/5, o, w? -2/5 Let o = 144.7 + -144.7. What is the fourth smallest value in -4, o, -2, 3/5, -2/181? o Let f = -0.02 + -1.98. Let r = -1611 - -1616. Let b = r + f. What is the third smallest value in -3, -0.4, b, -5? -0.4 Let u = 3.74 + -11.74. Which is the smallest value? (a) 0.2 (b) u (c) -0.1 (d) 4 b Let b = -0.32 - -0.372. Let h = 0.048 + b. Let t = -0.079 + h. What is the second biggest value in 2, 0, t? t Let q(x) = -12x - 25. Let z be q(-2). What is the second smallest value in 1/4, 0.8, 2/9, z? 2/9 Let v = 11420.2 - 11420. What is the smallest value in -0.07, -14, -1/6, -2, v? -14 Let j be (-18)/3 - -6*(-55)/(-33). What is the second biggest value in 0.02, -0.5, j, -7? 0.02 Let g = 4.44 - 1.44. Let t = -10.7 - -5.7. Which is the second smallest value? (a) g (b) t (c) 6 a Let i = -4.2 - 0.4. Let o = i - -4.2. Let u = -0.08 + -0.22. Which is the smallest value? (a) u (b) 2 (c) 6/11 (d) o d Let x = -6886 + 6844. What is the fifth smallest value in -0.1, -3/5, -3, x, 3? 3 Let n = -260 - -168. Let c = 110.5 + n. Let w = 19 - c. What is the second biggest value in -4, -2, w? -2 Let	{ "pile_set_name": "DM Mathematics" }
between 2:42 AM and 12:24 PM? 582 What is 223 minutes after 7:05 AM? 10:48 AM What is 2 minutes after 12:36 PM? 12:38 PM What is 92 minutes after 6:18 PM? 7:50 PM What is 662 minutes before 6:56 PM? 7:54 AM How many minutes are there between 6:27 PM and 12:41 AM? 374 How many minutes are there between 12:02 AM and 9:18 AM? 556 How many minutes are there between 3:56 AM and 8:54 AM? 298 What is 488 minutes after 1:29 PM? 9:37 PM How many minutes are there between 12:32 PM and 5:53 PM? 321 What is 52 minutes before 7:39 PM? 6:47 PM What is 596 minutes before 2:24 AM? 4:28 PM How many minutes are there between 5:26 PM and 7:45 PM? 139 How many minutes are there between 2:50 AM and 12:36 PM? 586 How many minutes are there between 5:52 AM and 12:19 PM? 387 How many minutes are there between 6:49 AM and 11:54 AM? 305 What is 387 minutes after 6:13 PM? 12:40 AM How many minutes are there between 5:28 PM and 8:01 PM? 153 What is 502 minutes before 8:57 PM? 12:35 PM What is 505 minutes before 3:57 AM? 7:32 PM What is 588 minutes after 5:03 PM? 2:51 AM What is 166 minutes after 1:12 AM? 3:58 AM What is 488 minutes before 3:12 PM? 7:04 AM How many minutes are there between 12:52 AM and 12:08 PM? 676 What is 715 minutes after 3:34 PM? 3:29 AM How many minutes are there between 11:38 PM and 9:27 AM? 589 What is 558 minutes after 2:17 AM? 11:35 AM What is 488 minutes before 11:12 AM? 3:04 AM What is 321 minutes before 4:22 AM? 11:01 PM What is 359 minutes before 3:32 AM? 9:33 PM How many minutes are there between 10:48 AM and 3:03 PM? 255 What is 265 minutes after 2:47 AM? 7:12 AM What is 293 minutes after 5:46 AM? 10:39 AM What is 115 minutes before 12:22 AM? 10:27 PM How many minutes are there between 6:55 AM and 1:56 PM? 421 How many minutes are there between 1:51 AM and 11:46 AM? 595 What is 244 minutes before 3:28 AM? 11:24 PM What is 528 minutes before 7:49 AM? 11:01 PM What is 251 minutes before 6:56 PM? 2:45 PM How many minutes are there between 1:38 AM and 10:06 AM? 508 What is 371 minutes after 3:34 AM? 9:45 AM What is 623 minutes after 11:14 AM? 9:37 PM How many minutes are there between 6:55 PM and 4:12 AM? 557 What is 253 minutes before 12:46 PM? 8:33 AM What is 277 minutes after 2:18 AM? 6:55 AM How many minutes are there between 12:12 AM and 5:17 AM? 305 How many minutes are there between 1:11 AM and 6:07 AM? 296 How many minutes are there between 12:00 PM and 11:22 PM? 682 What is 237 minutes after 1:10 PM? 5:07 PM What is 643 minutes before 5:02 AM? 6:19 PM How many minutes are there between 10:19 PM and 2:02 AM? 223 How many minutes are there between 7:06 PM and 5:33 AM? 627 How many minutes are there between 2:26 AM and 9:52 AM? 446 How many minutes are there between 6:12 PM and 7:34 PM? 82 How many minutes are there between 3:45 AM and 10:46 AM? 421 What is 155 minutes after 11:07 PM? 1:42 AM How many minutes are there between 1:05 PM and 12:52 AM? 707 What is 289 minutes before 3:47 PM? 10:58 AM How many minutes are there between 7:31 AM and 3:53 PM? 502 How many minutes are there between 7:16 AM and 11:12 AM? 236 How many minutes are there between 4:21 AM and 4:10 PM? 709 How many minutes are there between 10:53 AM and 10:55 AM? 2 What is 468 minutes after 12:15 AM? 8:03 AM How many minutes are there between 3:08 PM and 5:27 PM? 139 What is 12 minutes after 12:20 AM? 12:32 AM What is 702 minutes before 10:36 AM? 10:54 PM How many minutes are there between 1:45 PM and 12:05 AM? 620 How many minutes are there between 10:35 PM and 11:34 PM? 59 What is 249 minutes after 8:02 PM? 12:11 AM How many minutes are there between 11:42 AM and 5:14 PM? 332 What is 185 minutes before 4:26 AM? 1:21 AM What is 667 minutes before 4:15 PM? 5:08 AM What is 491 minutes before 3:39 PM? 7:28 AM How many minutes are there between 9:03 AM and 4:07 PM? 424 What is 203 minutes after 7:08 PM? 10:31 PM What is 63 minutes after 6:47 AM? 7:50 AM How many minutes are there between 3:38 PM and 12:55 AM? 557 What is 385 minutes after 1:43 AM? 8:08 AM What is 679 minutes before 3:26 AM? 4:07 PM How many minutes are there between 3:14 AM and 10:18 AM? 424 What is 371 minutes after 11:26 AM? 5:37 PM What is 586 minutes after 12:11 AM? 9:57 AM What is 573 minutes before 5:00 PM? 7:27 AM How many minutes are there between 4:37 AM and 7:11 AM? 154 What is 709 minutes before 5:59 AM? 6:10 PM How many minutes are there between 7:59 AM and 5:46 PM? 587 What is 291 minutes before 12:08 PM? 7:17 AM How many minutes are there between 1:04 PM and 11:20 PM? 616 How many minutes are there between 8:55 PM and 8:39 AM? 704 What is 596 minutes before 7:14 PM? 9:18 AM What is 309 minutes after 7:23 AM? 12:32 PM How many minutes are there between 3:25 PM and 11:26 PM? 481 How many minutes are there between 3:56 PM and 4:29 PM? 33 What is 687 minutes before 3:26 AM? 3:59 PM How many minutes are there between 7:15 AM and 3:28 PM? 493 How many minutes are there between 8:36 PM and 8:23 AM? 707 How many minutes are there between 10:59 AM and 4:08 PM? 309 What is 443 minutes before 3:38 AM? 8:15 PM How many minutes are there between 8:23 PM and 6:19 AM? 596 How many minutes are there between 1:15 AM and 12:54 PM? 699 How many minutes are there between 7:48 AM and 3:26 PM? 458 How many minutes are there between 11:08 AM and 11:59 AM? 51 What is 96 minutes before 4:51 AM? 3:15 AM What is 332 minutes after 5:28 AM? 11:00 AM How many minutes are there between 8:16 PM and 11:03 PM? 167 What is 557 minutes after 9:33 PM? 6:50 AM What is 458 minutes before 10:26 PM? 2:48 PM What is 514 minutes before 9:49 AM? 1:15 AM What is 706 minutes after 8:18 AM? 8:04 PM What is 429 minutes before 6:36 PM? 11:27 AM How many minutes are there between 11:21 PM and 4:31 AM? 310 How many minutes are there between 10:34 AM and 9:39 PM? 665 What is 439 minutes before 7:40 AM? 12:21 AM How many minutes are there between 2:37 PM and 5:29 PM? 172 What is 627 minutes after 1:54 AM? 12:21 PM How many minutes are there between 11:23 PM and 9:32 AM? 609 How many minutes are there between 2:51 AM and 11:04 AM? 493 What is 664 minutes after 12:37 PM? 11:41 PM How many minutes are there between 11:56 PM and 7:57 AM? 481 What is 14 minutes after 12:52 PM? 1:06 PM How many minutes are there between 4:22 PM and 1:39 AM? 557 How many minutes are there between 4:59 AM and 6:50 AM? 111 How many minutes are there between 1:48 AM and 1:04 PM? 676 How many minutes are there between 1:03 PM and 3:10 PM? 127 What is 399 minutes before 6:38 PM? 11:59 AM How many minutes are there between 10:39 AM and 4:52 PM? 373 What is 51 minutes before 3:50 AM? 2:59 AM What is 38 minutes before 5:20 AM? 4:42 AM What is 468 minutes before 12:29 PM? 4:41 AM What is 480 minutes before 1:18 PM? 5:18 AM How many minutes are there between 8:50 PM and 6:31 AM? 581 What is 706 minutes after 3:24 PM? 3:10 AM What is 158 minutes before 8:05 AM? 5:27 AM What is 243 minutes before 6:34 PM? 2:31 PM How many minutes are there between 3:21 PM and 12:49 AM? 568 What is 265 minutes before 9:32 PM? 5:07 PM What is 655 minutes after 11:54 PM? 10:49 AM How many minutes are there between 10:39 PM and 8:21 AM? 582 How many minutes are there between 8:06 AM and 9:06 AM? 60 What is 421 minutes after 5:24 PM? 12:25 AM What is 181 minutes after 5:57 AM? 8:58 AM How many minutes are there between 10:14 PM and 8:13 AM? 599 What is 191 minutes after 7:50 PM? 11:01 PM What is 647 minutes before 10:09 PM? 11:22 AM How many minutes are there between 3:42 PM and 1:06 AM? 564 What is 490 minutes after 10:24 AM? 6:34 PM How many minutes are there between 2:44 AM and 2:05 PM? 681 How many minutes are there between 2:17 AM and 5:22 AM? 185 What is 54 minutes before 12:36 PM? 11:42 AM How many minutes are there between 7:11 PM and 9:17 PM? 126 What is 92 minutes after 5:37 AM? 7:09 AM What is 702 minutes before 10:53 AM? 11:11 PM What is 591 minutes before 7:37 AM? 9:46 PM How many minutes are there between 6:26 PM and 8:09 PM? 103 What is 627 minutes after 1:30 AM? 11:57 AM How many minutes are there between 3:43 AM and 10:17 AM? 394 How many minutes are there between 7:34 AM and 12:26 PM? 292 What is 482 minutes before 3:38 PM? 7:36 AM What is 657 minutes before 9:04 PM? 10:07 AM W	{ "pile_set_name": "DM Mathematics" }
((-35 - (3 + -3)) + 319 + -317). 25 (0 + 10 - -1) + (39 - (41 - 60)) 69 What is the value of -90 - (11 + -15) - (-13 + 6 + -5)? -74 Evaluate 17 - (58 + -26) - -55. 40 -1 + 1 - 3 - (-7 - (12 + 2 + -18)) 0 Evaluate -29 + (-20 - ((-6 - 16) + 50)). -77 What is the value of -66 + 42 + 7 + (1 - 0) - 7? -23 What is the value of (-13 - -16) + (5 - -24 - 112)? -80 Evaluate -37847 + 37814 - ((9 - -1) + -1 + -1). -41 What is (-12 - 10 - -5) + 0 + 43? 26 What is the value of 18 + 14 + -19 + -13 + -5 + 24? 19 0 + (10 + 3 + -1 - (-534 + 636)) -90 -49 + -2 + 19 + (-11 - 32) -75 What is the value of 27 + (3 + 0 - ((-25 - -30) + 9))? 16 Calculate 23 + (-63 - 1) - -126. 85 Calculate 19 - (28 - (-12 - -15) - -33). -39 Evaluate 8 - (61 - (-15 - -41) - (-4 - 1)). -32 Calculate -10 + (-4 - (7 + 4)) - -4 - (-1 - -9). -29 Calculate (-1 - -4) + 0 + -40 + -2 + -4. -43 0 + 16 - (-6 - -2 - (-12 + -41)) -33 Calculate -1 - (124 + (10 + -1 - (-96 + 122))). -108 Evaluate (35 - 4) + 2 - (962 + -904). -25 Calculate (8 - 10) + 12 - (-3 + 17) - 11. -15 Evaluate (-26 - (9 - 45)) + (-4 - 19). -13 (8 - 1) + (481 - 578) -90 Evaluate (-26 - ((-12 - (-17 - 16)) + -17)) + -11. -41 What is the value of -49 + 27 + -2 + 69? 45 Calculate -48 + 3 + 2 + 5 + 0 + -11 + -1. -50 What is the value of -20 + 20 + -13 + 7 + 1? -5 (-1 - (0 + -10)) + (15 - -43 - 25) 42 2 + 216 + 996 + -1128 86 What is the value of -24 + (11 - (-1 + 13)) + (-95 - 26)? -146 What is -1 + -25 + 7 + -11 + (14 - -2)? -14 Evaluate -30 + 199 + -47 + -48. 74 What is -56 + 47 + (12 - 16) - (-1 - -12)? -24 (-15 - 5) + (-3 - (8 + -28)) - (-1 - 1) -1 Evaluate (-1 - 19) + (13 - 23) + 27 - -31. 28 Calculate 7 + (5 - 13) + 11 + 47 + 7. 64 Calculate 0 + -18 - (195 + -292 + -22). 101 What is 9 + (7 - (-7 + 0 + -40)) + 11 + -2? 72 Evaluate 2 + -4 + 6 + -19 + -16. -31 3 - (17 + -44) - (2 + 15) - 57 -44 What is 49 - ((-23 - (5 - 9)) + 18)? 50 83 + -66 - 8 - (-8 - (0 - 1)) 16 (-3 + 6 - 10) + -22 + (-20 - (-197 + -1)) 149 Evaluate 202 + -177 - (1 + (-13 - -7)). 30 -75 + (91 - 32) + 19 + -1 2 Evaluate -33 - -3 - (-2 - -23 - (-3 + 13)). -41 What is the value of (29 - 56 - -23) + -1 + -14 - (-1 - 5)? -13 28 + 63 + -240 + 234 85 Evaluate 39 - (2 + 2) - (9 - (8 - 4)). 30 What is the value of (3 - 7 - 63) + (10 + 13 + -35 - -24)? -55 What is (-88 - -104) + (25 - -4 - -4)? 49 What is the value of -96 - 0 - (-10246 + 10285)? -135 Evaluate -10 - (28 + -11 + 4) - -21 - -2. -8 16 + (39 + -15 + -15 - 14) 11 (-651 - -666) + (0 + -2 + 0 - (-129 - 7)) 149 What is -1 + 14 - (8 - (108 - 10 - -18))? 121 What is the value of -1 + 6 - (-3 - 8 - (152 - 193))? -25 What is 2 + -31 + 1 - (8299 + -8328)? 1 (7 - 10) + 1 + 8 - (1351 - 1340) -5 What is 6 + (-8 - -5) + -14 + (-7 - -15) + 27? 24 Evaluate -8 + (25 - (-27 + 29)). 15 What is the value of -13 + 28 + -1 - (-10 + -24)? 48 What is the value of 9 + -1 + (8 - -35) + (-15 - -6)? 42 What is -16 + 9 - (-3 - -58 - (-26 - (-5 - 10)))? -73 What is the value of 0 + -13 - (9227 + -9247)? 7 Calculate -10 + 27 - -14 - (38 - 48). 41 Calculate (-11 - 9 - (-38 - -21) - 93) + -17. -113 What is the value of 79 - (-60 + 40) - (-7 + 2 + (6 - 8))? 106 Calculate (-1 + 1 - -3) + -3 + -97 + -924 + 931. -90 What is the value of 41 - ((-3 - (-7 - -4) - -11) + 130 + -135)? 35 (3 - -23) + 120 + -123 - 80 -57 Evaluate -17 + 1 - (26 - (13 + -7) - 6). -30 What is the value of -27 + -3 + -16 + 4? -42 Evaluate 2 + -40 - (1584 + -1585). -37 Calculate 12 + 0 + (-40 - -7 - -66 - -24). 69 Evaluate -55 - (628 - 625 - (0 - (-2 - 6))). -50 What is 11 + (9 - (7 + 10)) + -6 + 13 - -8? 18 Calculate -43 + (48 - 0 - (-450 + 470)). -15 Calculate (-4 - (1 + 0 + (-11 - 11))) + 83 + -74. 26 Evaluate -6 - (-11 + (23 - 71)). 53 Evaluate (-5 - (1 - (-3 + 0 + -5 + -13))) + -6. -33 -1 + 0 - (19 - (25 + 21 + 18 + -23)) 21 Evaluate -11 - ((-13 - 1) + (-42 - -17) + 27). 1 What is -11 + (37 - 19) - (32 - (-11 - -5))? -31 What is the value of 7 + (-6 - -17) + -4 - 16? -2 Calculate 16 + 140 + -28 + -121. 7 What is the value of (113 - 147) + (12 - (6 + -16))? -12 Evaluate 37 - 71 - (-14 + -28). 8 Evaluate 0 - -4 - ((0 + -11 - -50) + -26). -9 Evaluate 78 - (-29 - -53 - 19). 73 Evaluate 6 + -30 + 15 - ((-1 - 8) + 11). -11 2271 + -2297 + 28 + (2 - 3) 1 Calculate -60 - -14 - (-403 - -253). 104 What is the value of 57 + -42 + -153 - -113? -25 What is (-3 - 20) + -10104 + 10061? -66 1 + (-8 - -2) - (-291 - -296) - 68 -78 13 + (-15 - (1 + 0)) + (1 - -3 - 54) -53 263 - 173 - (-15 + (-12 - 17)) 134 What is 1 + 78 - (27 + 0 - (-384 - -405))? 73 What is (36 - (10 - -72) - -20) + 82? 56 What is 137 + -154 + 5 + 9? -3 Evaluate 16 + 0 - (20 - 1 - (6 + 7 - 3)). 7 What is the value of (-23 + -1 - (-2 - 2 - 4)) + -12? -28 Evaluate 33 + -67 + -2 - -78. 42 Calculate -9 + (88 - ((-1 - -6 - 0) + -266 + 248)). 92 What is the value of -1 + 74 - (-2086 + 2167)? -8 Calculate (-112 - (-64 - 0)) + 63. 15 81 + -60 + (17 - 18) 20 What is 14 + 95 + -79 + -43 + 1? -12 Calculate 0 + 0 - (-17 - (-17 - (0 + 31) - -18)). -13 Calculate (-140 - 76) + 205 - (28 + -1). -38 What is -5 - (-91 + 77) - (-1 + -1 + 8)? 3 What is the value of -181 + (47 - -82) - 57? -109 Evaluate -12 - 4 - (-3 + (-8 - -12) - -8). -25 What is the value of (-5 - 1) + -695 + 738 - -17? 54 0 - ((-5 - -2) + -8) - -22 33 What is the value of -96 - (-136 - (-127 - -30))? -57 6 + 1 - 15 - (-2 + 1 + (9 - 6)) -10 (-1 - 0) + 1 - (-649 - -638) - 2 9 28 - (-19 + (41 - 1) + -25) 32 What is the value of -80 + 19 + -26 + 20? -67 21 + -40 + 8 + 22 11 Calculate -16 + (-65 - (-11 + (6 - (-14 - 3 - -11)))). -82 What is (-6 + 18 + -35 + 8 - -16) + 17? 18 Calculate 25 - (-51 - (-23 - 54)). -1 Evaluate (65 + -33 - 31) + -13. -12 What is (1 - 5 - 0 - (-34 - -37)) + (-57 - 4)? -68 What is (9 - 14) + -8 - ((-4 - -87 - 0) + -2)? -94 Evaluate 10 + (-31 + (-1 - -14) - -18) + -61. -51 Calculate 26 + (41 - 25 - 1) - (-2 + -3) - 4. 42 Evaluate (16 - -6) + -65 + 18 + -66. -91 153 + 2 - (-315 + 393) 77 What is -731 + 644 - (-188 + -1)? 102 What is (15 - 102) + (22 - -4)? -61 Calculate -28 + (66 - 24) - ((1 - 0) + -5). 18 What is -6 - (-11 - (26 + 7 + -23))? 15 Evaluate 36 - (-129 - -32) - 214. -81 (-21 + (19 - 7) - -20) + 2 13 What is the value of (-23 - -30 - 29) + -14 + 34? -2 (2 + 32 - 1 - (436 + -408)) + (-1 - 0) 4 Evaluate 90 + -62 + 13 + 14 + 7 + (-1 - -3). 64 What is the value of 5 + -7 - -8 - ((82 - -47) + -19)? -104 (3689 - 3757) + (37 - 1) - -36 4 What is the value of 114 - 77 - (25 + 18) - (-2 + -15)? 11 What is the value of -99 + 118 - (-5 - (39 - 2))? 61 What is 35 + 0 - (-132 + 195 + 8)? -36 What is the value of (8 - 18 - -12 - -1 - 7) + -52 + -15? -71 Evaluate (-12 - -19) + (-69 - 1) - (-1 + -18 - -15). -59 What is the value of 4 + -6 - (-13 - (-23 - (-16 - -28)))? -24 -18 + 0 + (6 - (-9 + (-6 - -19))) + -7 -23 What is the value of (-993 - -979) + (2 - -47)? 35 What is (-4 - -35) + -36 + -44 + 6? -43 Evaluate 111 - 7 - -5 - (-60 + 93 - 16). 92 What is the value of (-19 + 6 - (28 + -9 - 41)) + -45? -36 What is (0 - 0) + (-15 - -11) + 69 + 0 - -3? 68 What is -7 + (-11 - (7 - 5 - 19) - 8) - 23? -32 Evaluate (-1 - -2) + 15 - (-955 + 966). 5 What is -12 + -28 + 37 + -8 + 3 + 2 + 47? 41 1 - -1 - (-1 - -62 - -4) -63 What is the value of (20 - (5 - -5)) + (-74 - (-1 + 7 + -14))? -56 Evaluate 2 + -51 + (28 - (1 - -11)) + 20. -13 (-15 - -4 - -11) + -76 + 14 + 1 -61 What is (38 - 130 - -52 - (2 - 1 - 3)) + -15? -53 Calculate -41 + (-27 - (-73 - -103)). -98 104 - 84 - (49 + 43) -72 What is (0 + 0 - -60) + (8 - (32 + -29)) + -13? 52 What is (-7 - -187 - 175) + (20 - 0)? 25 Evaluate -1 + -37 + 1 - (-7 + (-14 - -21 - -4)). -41 Calculate -4 + -3 + 26 - (-66 - -86). -1 What is the value of 59 + -137 + 118 + 13? 53 What is the value of -53 + 12 + -1 + -9 + 74 + -94? -71 Evaluate (9 - -1) + 199 + -263 + -8 - (-7 - -4). -59 What is (-46 - 0) + -2447 + 2594? 101 Evaluate -14 + (-75 - (-26 + -5)) + (0 - -5). -53 What is the value of (-13 - -89) + (-26 + 26 - 25)? 51 What is the value of 13 - -6 - (31 + 25)? -37 What is -4411 - -4463 - ((0 - -2) + -21)? 71 Evaluate -30 - (33 + -73) - (2 - (-3 + -62 - -2)). -55 What is (305 - 260) + -1 + -19 + 2? 27 Calculate -2 + -1 - (-32 - (-48 + (-14 - -18))). -15 Calculate 3 - -5 - (2 - -19) - (-111 - 28). 126 Calculate -16 - -19	{ "pile_set_name": "DM Mathematics" }
.144 Multiply -2 and 17. -34 Work out -0.4 * 0.053. -0.0212 What is 2 times -90? -180 -0.2 times -72.21 14.442 Work out -33.35 * 4. -133.4 -925.8 -232.2 -0.5 0.109 -0.0545 Calculate 0.3-125. -37.5 What is the product of 0.5 and -183? -91.5 What is the product of -6748 and 0? 0 What is -0.05 times 20? -1 -438-28 12264 Product of -1335 and 0.14. -186.9 -4506 -2024 What is the product of -33 and -0.05? 1.65 -0.0169 times -8 0.1352 Product of -3 and 57. -171 What is 5 times -0.1039? -0.5195 3 -3.1 -9.3 9.5 times 0.3 2.85 -3423 times -0.1 342.3 -0.18 * 1.9 -0.342 -79 * 184 -14536 Multiply -0.4 and 0.98. -0.392 Product of 1.95 and 1. 1.95 -0.7455 times -2 1.491 0.6 * 0.66 0.396 -21 times -65 1365 What is 1801.8 times 2? 3603.6 Calculate -35.7. -17.1 -0.173 -5 0.865 -4 times -0.06 0.24 What is the product of 981 and 0.5? 490.5 -0.4 * 191 -76.4 Multiply -140 and -3. 420 Multiply -4 and -0.29. 1.16 Calculate -4344. -1376 Work out 0.5 -1180. -590 0.61 * -5 -3.05 Multiply -103 and 0.2. -20.6 What is -0.173 times -28? 4.844 Calculate -7410.2. -148.2 What is the product of 61 and -9? -549 -1.4 4 -5.6 0.11-0.037 -0.00407 What is -56 times 0.9? -50.4 2100.02 4.2 What is 1.09 times -15? -16.35 Work out -0.4 * 18.2. -7.28 -2 * -95 190 -11 * -20 220 Product of -0.16 and 0.352. -0.05632 -0.3-1 0.3 Multiply 148 and 0.4. 59.2 What is -0.4 times -97? 38.8 -0.20.0225 -0.0045 Work out -2 * 11.05. -22.1 Product of -2930 and 0.5. -1465 -27.6 * -1 27.6 -9410.4 -376.4 Product of -0.36 and -0.13. 0.0468 230.1-5 -1150.5 Calculate 0.0001-0.3. -0.00003 -5 times -0.51 2.55 What is 0.3 times -0.063? -0.0189 Multiply 1 and 92. 92 0.31 0.3 Multiply -0.6 and -281. 168.6 15.9 times -23 -365.7 Product of 239 and 2. 478 -0.2 times 0.0501 -0.01002 What is the product of -0.1 and 0.015? -0.0015 Calculate 32.10.3. 9.63 -3.8 0.7 -2.66 Work out -469 * 1.8. -844.2 What is -19 times -58.5? 1111.5 -0.49 times 1 -0.49 0.4 times -143 -57.2 Multiply 19 and 0.0077. 0.1463 What is the product of -32 and 97? -3104 Product of -577 and 1. -577 Product of -0.1 and -2.8. 0.28 Product of -2.6 and -2.2. 5.72 0.5 times 0.5727 0.28635 -0.16019 * 1 -0.16019 Work out 7 * -14. -98 What is 2 times 24? 48 Multiply 721 and 0.2. 144.2 Calculate 01374. 0 Calculate -0.3-347.8. 104.34 What is -344 times 0.015? -5.16 Multiply -0.002 and 0.115. -0.00023 Multiply -9 and -2.2. 19.8 -164.51 * 0.4 -65.804 What is the product of 522 and -4? -2088 Product of 0.2 and -7. -1.4 20.4 times -0.02 -0.408 Product of -12 and -8. 96 What is -40 times 0.28? -11.2 What is -0.041 times -1? 0.041 -0.06 * 11 -0.66 Multiply -3 and 2.61. -7.83 Multiply -0.4 and -50. 20 Product of 0.1 and 333. 33.3 What is 0 times -0.596? 0 -103 times 3 -309 Work out 0.3 * 65. 19.5 -0.0365 -0.18 99-59 -5841 -13 times 1 -13 Product of -24.6 and 0.4. -9.84 What is the product of 0.5 and -240? -120 -2 times -37 74 What is -3.455 times 0.4? -1.382 Multiply -2 and -63. 126 0.251 * -7 -1.757 0.4-2.97 -1.188 What is the product of 0.1862 and -3? -0.5586 -4.35 -11 47.85 -34.9 times -0.32 11.168 Work out 0.92 * 5. 4.6 Product of 0.6 and 0.73. 0.438 -0.048-4 0.192 Calculate -0.06314.2. -18.852 Product of -9.6 and -0.31. 2.976 Work out 0.2 * 0.51. 0.102 What is -3 times 0.3784? -1.1352 -2-3190 6380 Multiply 1095.3 and 0.2. 219.06 -1.1 times 0.0219 -0.02409 Product of -1.351 and -1. 1.351 What is 0.15 times 0.2? 0.03 What is the product of -0.3 and -497? 149.1 0.550 25 What is the product of -3.9 and -0.1? 0.39 Product of 0.97 and -0.2. -0.194 -3 * -245 735 Product of 1041 and -3. -3123 Multiply -5 and 212. -1060 Multiply -3 and 129. -387 Calculate -0.0540.4. -0.0216 Work out 4 1094. 4376 Product of 1 and 732. 732 Multiply 0.1 and 10.5. 1.05 Calculate -332-1. 332 Calculate -0.03-32.7. 0.981 2-0.023 -0.046 Product of 0.1 and 1894. 189.4 Multiply 1.2 and -0.14. -0.168 Work out -0.149 -1. 0.149 Work out -0.068 * 18. -1.224 2610.4 104.4 0.13 9 1.17 Product of -0.02 and 1439. -28.78 0.4 * -0.5 -0.2 Work out 10.13 * -2. -20.26 -0.2 * -61 12.2 Calculate -0.01530.2. -0.00306 Product of 0.081 and -1. -0.081 What is 0 times 4019? 0 What is -0.0957 times -2? 0.1914 0.04465 0.01 0.0004465 Work out -6 * 0.3. -1.8 334 * -0.5 -167 Calculate 0.053-4. -0.212 What is 0.3 times 0.609? 0.1827 What is 2.84 times -1? -2.84 What is the product of -0.029 and -36? 1.044 What is the product of -56 and -0.09? 5.04 3 times 0 0 Multiply -440.8 and -2. 881.6 -4.08 -0.3 1.224 What is the product of 2.8 and -0.3? -0.84 Work out -23 * 165. -3795 Work out 0.185 * 0.1. 0.0185 Multiply 0.156 and -0.3. -0.0468 What is 274 times 0.1? 27.4 Calculate -0.7-0.84. 0.588 Work out 4.22 0.1. 0.422 Product of 0 and 0.1. 0 0.2 * 3.773 0.7546 Calculate -3.51. -3.5 -81-0.5 40.5 Product of 0.28 and -4. -1.12 Work out 0.2 * 94. 18.8 Work out -857 * -0.3. 257.1 Product of -0.2 and -35.3. 7.06 Work out -1 * 208. -208 What is the product of 2.84 and 2? 5.68 Work out 30230 * -0.4. -12092 Multiply -0.4 and -1955. 782 11 times 1 11 Work out -0.041 * 8. -0.328 What is -4232 times 0.3? -1269.6 15 times 17 255 -27-0.44 11.88 Multiply 4 and -10. -40 Work out 0.01 -17. -0.17 What is 266 times 0? 0 -0.3 * -1.48 0.444 What is the product of -3 and 0.409? -1.227 What is the product of 593 and 0.2? 118.6 4 times 27 108 Work out -3 * -61.1. 183.3 Work out 122 * 0.1. 12.2 3-52.9 -158.7 What is the product of 0.074 and 0.02? 0.00148 Multiply -11.1 and -45. 499.5 Product of -283 and 3. -849 What is 15135 times 0.3? 4540.5 Product of 0.111 and 1. 0.111 -1590 times -3 4770 Work out 0.03 3. 0.09 Product of -18 and -62. 1116 Calculate 3.6-0.2. -0.72 0.438 times 0.38 0.16644 What is -233 times 0.3? -69.9 What is the product of -0.08 and 0.92? -0.0736 Calculate -2-353. 706 Work out 2 * 4773. 9546 Work out 1296 * 0.3. 388.8 What is the product of -68 and 19? -1292 Work out 3 * -2.6. -7.8 What is the product of 0.0738 and 0.03? 0.002214 -36.4 * 0.04 -1.456 Calculate -9890.5. -494.5 Product of -1.1 and -0.08. 0.088 What is -1.2 times -0.03? 0.036 Calculate -2120.22. -46.64 0.099 * 0.1 0.0099 0.02 * 0.9 0.018 Multiply -2 and 0.002. -0.004 What is the product of -0.05 and -3.8? 0.19 Multiply 0.75 and 8.8. 6.6 Calculate 8.9-5. -44.5 What is the product of -1 and 0.028? -0.028 -2394 -0.2 478.8 347 * -2 -694 What is 430 times 0.4? 172 2-0.089 -0.178 What is 0.2 times -1.25? -0.25 15.7-0.4 -6.28 0 * 0.881 0 Work out -0.005 * -2. 0.01 Multiply -2 and -94. 188 Product of -2 and -10.5. 21 What is -0.3 times -1.358? 0.4074 Multiply 160 and -0.5. -80 0.06 * -1.172 -0.07032 Product of 0.1 and 6.4. 0.64 What is the product of 0.5 and 38.1? 19.05 Multiply -4865 and 0.3. -1459.5 Work out 5 * -111. -555 29 * -14 -406 What is -6.6 times 5? -33 2 times -180 -360 101 * -16 -1616 137-0.1 -13.7 Multiply -691 and 0.1. -69.1 Multiply 0.3 and -152. -45.6 -81-0.13 10.53 Work out 0.5 * 29. 14.5 Work out -0.3 * 21.6. -6.48 0.761 times 4 3.044 Calculate -63158. -18948 2.5-8 -20 -2.653.4 -138.84 -9 1.46 -13.14 What is -0.052 times 0.079? -0.004108 What is -5 times 921? -4605 -0.1 * -14 1.4 Work out 11 * -45. -495 0-191.6 0 -1287-1 1287 Work out 18 * -0.03. -0.54 What is -10.7 times 0.1? -1.07 Calculate -4-191. 764 -1-13 13 Work out -7946 * 2. -15892 What is the product of 2 and -341? -682 What is the product of 8 and 5.6? 44.8 -1425 * 4 -5700 Work out 12 * -6.6. -79.2 Multiply 0.4 and -2.2. -0.88 What is 76 times -0.08? -6.08 Product of 1 and 0.1006. 0.1006 -57-3 171 -0.041 times -8 0.328 -9 -24 216 Work out 5 * -128. -640 460.102 4.692 Calculate 5-479. -2395 What is -38 times 11? -418 What is -209 times -0.2? 41.8 What is 306 times -0.009? -2.754 What is the product of -0.5 and -140? 70 -0.0615 times 4 -0.246 Work out 364 * 4. 1456 What is the product of 751 and 3? 2253 -66-0.2 13.2 Calculate -0.1-5.1. 0.51 -3.264 times 3 -9.792 Product of -4 and 0.82. -3.28 What is the product of 0.5 and 0.035? 0.0175 -9090.4 -363.6 What is the product of -0.4 and 336? -134.4 1770-0.4 -708 Product of -0.067 and 30. -2.01 46.4-1.1 -51.04 Calculate 880.01. 0.88 Multiply 0.7 and -0.076. -0.0532 Multiply -0.1 and 0.4. -0.04 Work out 9 * -0.149. -1.341 -0.0616 times -2.1 0.12936 Multiply 23 a	{ "pile_set_name": "DM Mathematics" }
-2t = -4u - 60, -u + 0t = t + 18. Let s = u + 15. Let a = s + 5. Calculate the smallest common multiple of a and 16. 16 Suppose 2p - 14 = 26. Suppose -4u = -2u - 18. Let n(m) = m*2 - 7m + 4. Calculate the least common multiple of p and n(u). 220 Suppose 2r - 11 = -5, 2v + 3r - 229 = 0. Calculate the smallest common multiple of v and 110. 110 Find the common denominator of 101/90 and (-65)/(-36) + 40/180. 180 Let s = 39602/3 - 4712749/357. Find the common denominator of 75/4 and s. 476 Let m = -20 + 38. Let c = 25 + -20. Suppose 0 = -5b + 4o - 10, b - co = -o - m. Calculate the lowest common multiple of 4 and b. 4 Let x = 3059 + -30617/10. Find the common denominator of -93/134 and x. 670 Find the common denominator of 3/(-30)(-2 + -6 - 109) and 39/81-35. 90 Suppose -5h + 280 = -655. Calculate the lowest common multiple of h and 17. 187 What is the lowest common multiple of (40/(-12))/(12/(-648)) and 100? 900 Let s = 306 - 7692/25. What is the common denominator of (9/6)/(-3)62 and s? 25 Suppose -15m + 20 = -40. Calculate the common denominator of 145/12 and 2(m/10 - (-479)/(-160)). 48 Let a = -44 - -50. Let p = -20731/12 + 1734. What is the common denominator of (2/15)/(a + (-684)/110) and p? 36 Let y = -15 - -42. Suppose 0 = f + 5, -5z = 4f + 7 - y. What is the lowest common multiple of z and (2/1)/(2/(24/2))? 24 Let u = 1358 + -1352. Calculate the lowest common multiple of (-12)/(0 + (-9)/12) and u. 48 Let m = -3695/18 + 409/2. Let v be 5/(3/(-21) - 0). Calculate the common denominator of m and 249/v - 6/21. 45 Let s be (2/1194)/((-6)/(-81)). Let c = 17765/2388 - s. Find the common denominator of 52/9 and c. 36 Let b = -329/9 - -2465/63. Find the common denominator of b and -109/108. 756 Let c = 407254745/1302 - 938365/3. Let g = 194/31 - c. Find the common denominator of g and ((-1)/6)/(14/(-78)). 14 Let d be (-12/2 - 4)3. Calculate the smallest common multiple of -1 - -16 - d/((-20)/4) and 6. 12 Suppose 2x + 2m = 38, 4m + 19 = x + 5. What is the lowest common multiple of x and 108? 108 Calculate the common denominator of (0 - 59/10)/((-6)/5) and -39/28. 84 Let n = -26 - -16. Let a = -2764 + 2786. What is the lowest common multiple of -20(n/4)/5 and a? 110 Let o = 70698 + -14139519/200. What is the common denominator of -173/180 and o? 1800 Let d = 1/8570 - -250669/29995. Let f = 6/3847 + -550157/23082. Find the common denominator of f and d. 42 Let u = 18014819/128 + -140740. Calculate the common denominator of -85/12 and u. 384 Let n = 1214626/75 + -16196. Calculate the common denominator of n and -58/9. 225 Suppose -8520 = t - 6t. Let p = t - 3315/2. What is the common denominator of 23/2 and p? 2 Let y = 390 + -1593/4. Let h be 3159/12 - 2/8. Find the common denominator of h/(-24) + 2/(-3) and y. 8 Let n be (-5)/(-1) + (-2 - -1). Suppose v - n = -k - 2v, v + 12 = k. Let c(m) = -m3 - 4m*2 - 2m + 1. Calculate the least common multiple of k and c(-4). 90 Let i(y) = -136y - 22. Calculate the lowest common multiple of 54 and i(-1). 1026 Let o be -2-2(-479)/4. Let k = o - -929/2. Find the common denominator of 151/14 + -25 + 22 and k. 14 Let t(i) = 3i*2. Let a = -1409 - -1418. What is the lowest common multiple of a and t(1)? 9 Let a = -2341 + 2353. Suppose -110 = -5k + m, 3k + m - 79 = -k. What is the lowest common multiple of k and a? 84 Let k(z) = -z3 + 21z*2 + 44z + 52. Calculate the smallest common multiple of k(23) and 126. 126 Let h = 62/13 + 279/26. Find the common denominator of 129/(-18)(-6 - (13 - 20)) and h. 6 Let j = -82 + 142. What is the least common multiple of 70 and j? 420 Let j = -20150533/342 + 58920. What is the common denominator of -61/304 and j? 2736 Calculate the least common multiple of 380 and (-13584)/(-72) - (-20)/15. 380 Suppose q + 0q - 5 = 0. Calculate the common denominator of 97/4 and (q - (-652)/(-132))(-102)/88. 484 Let s be 112/(-42)(-3)/(-2). Find the common denominator of 61/10 and (-145)/15 - s/8. 30 Let y(d) = -2d3 + 3d*2 + 2d - 1. What is the lowest common multiple of 32 and y(-1)? 32 Suppose 0 = 4v - 6v + 980. Let x = 6869/14 - v. Let n = -247381/528 + 5187/11. Calculate the common denominator of n and x. 336 Suppose 17h + 60 = 20h. Suppose -3n + 106 = -h. Calculate the smallest common multiple of 3 and n. 42 Let u = 4397 + -65897/15. Find the common denominator of u and -95/6. 30 Calculate the common denominator of 3/(297/249) + 9/(-3) and -25/87. 957 Let v = -235 - -305. What is the least common multiple of v and 130? 910 Let c = 84 + -45. Suppose -c = -4o - 3. Calculate the least common multiple of o and 6. 18 Let b = -130 - -189. Calculate the common denominator of 31/8 and -3 - ((-13)/(-26))/((-4)/b). 8 Suppose 2j + 3j - 23 = 2z, -12 = 3z. Let u(y) = -y*3 - 2y*2 + y + 1. What is the lowest common multiple of j and u(-3)? 21 Suppose 2i + 536 = 576. Calculate the least common multiple of i and 20. 20 Let v = -26465/185592 + 39/703. Calculate the common denominator of 11/26 and v. 3432 Let q(w) = w*2 + 4w - 1. Let t be q(5). Find the common denominator of -57/16 and (-8)/t + (-2553)/660. 80 Let h = 6557/12 - 546. What is the common denominator of -47/23 and h? 276 Let s = 55 - 55. What is the common denominator of 11/38 and (s - -27)(-1 - 10/(-8))? 76 Let o(r) = r3 + 3r*2 - 7r + 21. What is the smallest common multiple of 4 and o(-5)? 12 Let v(m) = m*2 - 8m + 19. Let i be v(5). Suppose -y + ir + 78 = y, -5r + 18 = y. What is the lowest common multiple of 27 and y? 297 Suppose o = 3o - 3n + 9, 0 = 2o - 4n + 14. Suppose -3j + 4p + 1 = 0, 3 + 0 = -op. What is the common denominator of 89/6 and 0 + j - (0 + 25)? 6 Find the common denominator of (-12912)/13440 + (-4)/(-14) and 25/56. 280 Let u = 343969/36 - 9553. Find the common denominator of u and (-153)/(-12)(-2 - 192/(-90)). 180 Suppose -36m + 986 = 14. Calculate the lowest common multiple of 9 and m. 27 Let t = 30475/6462 - -82/359. Calculate the common denominator of t and 61/112. 1008 Let f be (-7937)/(-30) - (-2)/(-2). Let t = f - 521/2. Let d = -17/5 + t. Find the common denominator of -145/6 and d. 6 Let a be (-3)/(-15) + (-122)/10. What is the lowest common multiple of 30 and (14 + a)3/2? 30 Find the common denominator of -3015/280 - -1 and 115/12. 84 Calculate the smallest common multiple of 3/(-2)(-14)/2112 and 12. 12 Suppose -3y = 4x - 67539, x + 84417 = 6x - 3y. What is the common denominator of -27/2 and (-4)/(-10) + (x/(-640))/9? 32 Let n = 82360/127 - 1297/2. Let d = n + 12693/1778. Calculate the common denominator of -40/9 and d. 63 Let x be (-3)/(-12)(-2 + 6). Calculate the common denominator of -21/10 and (-405)/(-50) + -2 + x. 10 Let d be 8/(-8) + ((-4724)/2338)/(-2). Let p = -7897/4676 + d. Calculate the common denominator of 67/18 and p. 252 Suppose -t + 111 = 2t. Suppose -3f - t + 4 = 0. What is the smallest common multiple of 20 and 10/30 - f/3? 20 Suppose -a = p - 4, 8 = -7a + 9a - 5p. Calculate the lowest common multiple of a and 116. 116 Find the common denominator of 0 - 4 - (-1758)/444 and (7/6)/(-7)5727/184. 592 Let w = -290923/16 - -18189. What is the common denominator of -35/4 and w? 16 Let z be 2042/(-6)(-6)/6. Let u = -11063/33 + z. What is the common denominator of u and 16/11? 11 Let c = 3/3488 + -32519/45919520. Let y = c - 15363563/52660. Let q = -296 - y. Find the common denominator of -77/34 and q. 68 Let m = 94 + -104. Calculate the common denominator of 51/40 and ((-484)/m - 4)(-4)/(-64). 40 Let k = -13 + 35. Find the common denominator of (-14118)/5460 + (-24)/(-5) and 0 - (2 - 109/k). 154 Let t(l) = l*2 + 4l - 4. Let i be t(-6). Suppose -3x + 7x = i. What is the lowest common multiple of x and 5? 10 Let r = 22 + -18. Suppose rc + 0c + 2g - 60 = 0, -44 = -3c - g. What is the least common multiple of c and 10? 70 Calculate the common denominator of -46/11 and 86/1320 + 2/(-11). 660 Let z(m) = 83m3 - 6m*2 + 5m + 3. Let q be z(-3). Let a = q + 13787/6. Calculate the common denominator of a and 15/4. 12 Let f = 43 + -27. What is the lowest common multiple of f and -2 + (6/2)/((-60)/(-80))? 16 Suppose -4h + 10 = -18. Let f(w) = 5w - 2. Let c be f(h). Calculate the common denominator o	{ "pile_set_name": "DM Mathematics" }
-1294700, -2589485, -3884270, -5179055, -6473840, -7768625? -1294785h + 85 What is the a'th term of 613, 1008, 1435, 1900, 2409, 2968, 3583? a3 + 10a*2 + 358a + 244 What is the f'th term of 55070, 55080, 55064, 55010, 54906, 54740, 54500? -2f3 - f2 + 27f + 55046 What is the l'th term of 15589346, 15589313, 15589280? -33l + 15589379 What is the g'th term of -14116226, -14116223, -14116218, -14116211, -14116202? g2 - 14116227 What is the t'th term of 2759, 23912, 81689, 194402, 380363, 657884, 1045277, 1560854? 3052t*3 - 211t - 82 What is the r'th term of -10698, -42852, -96430, -171426, -267834, -385648, -524862? r*3 - 10718r*2 - 7r + 26 What is the f'th term of 19677, 39465, 59249, 79029, 98805, 118577? -2f2 + 19794f - 115 What is the a'th term of -7802, -7390, 1234, 18070, 43118? 4106a2 - 11906a - 2 What is the d'th term of -146222109, -146222103, -146222095, -146222085, -146222073? d*2 + 3d - 146222113 What is the r'th term of 171492, 171141, 170790, 170439, 170088? -351r + 171843 What is the t'th term of 681575, 681616, 681655, 681692, 681727? -t2 + 44t + 681532 What is the u'th term of 2691294, 2691293, 2691292? -u + 2691295 What is the l'th term of -23284, -93300, -209984, -373336, -583356? -23334l2 - 14l + 64 What is the j'th term of 1, 1351, 2727, 4141, 5605, 7131, 8731, 10417? 2j3 + j2 + 1333j - 1335 What is the q'th term of -518774, -1037518, -1556266, -2075018, -2593774? -2q2 - 518738q - 34 What is the w'th term of 1926, 1949, 1990, 2049, 2126, 2221? 9w2 - 4w + 1921 What is the l'th term of -2900324, -2900329, -2900334? -5l - 2900319 What is the z'th term of -860396545, -1720793089, -2581189633, -3441586177, -4301982721, -5162379265? -860396544z - 1 What is the f'th term of -36090319, -36090332, -36090345? -13f - 36090306 What is the g'th term of -17724590, -17724589, -17724588, -17724587, -17724586, -17724585? g - 17724591 What is the h'th term of 84078, 82841, 80786, 77919, 74246, 69773, 64506? h3 - 415h*2 + h + 84491 What is the m'th term of 2795482, 2795477, 2795468, 2795455, 2795438? -2m*2 + m + 2795483 What is the k'th term of 89513822, 89513820, 89513818? -2k + 89513824 What is the g'th term of 6651, 9744, 12837? 3093g + 3558 What is the w'th term of -251117, -502428, -753739, -1005050, -1256361? -251311w + 194 What is the s'th term of -27078424, -27078420, -27078416, -27078412, -27078408, -27078404? 4s - 27078428 What is the g'th term of -14760, -29567, -44374, -59181? -14807g + 47 What is the i'th term of -15597, -11689, -7781? 3908i - 19505 What is the b'th term of 19754, 13688, 7622, 1556? -6066b + 25820 What is the l'th term of 65956, 131817, 197678, 263539, 329400, 395261? 65861l + 95 What is the k'th term of -4170, -5394, -738, 12738, 37974, 77910, 135486, 213642? 490k*3 - 4654k - 6 What is the q'th term of 338778, 338622, 338466, 338310, 338154, 337998? -156q + 338934 What is the x'th term of -8535, -8975, -9707, -10731, -12047? -146x*2 - 2x - 8387 What is the s'th term of -8147, -16295, -24449, -32609, -40775? -3s2 - 8139s - 5 What is the m'th term of 13642, 54573, 122796, 218311, 341118? 13646m2 - 7m + 3 What is the r'th term of -214, -215, -196, -163, -122, -79, -40? -r*3 + 16r*2 - 42r - 187 What is the t'th term of 2001202, 4002473, 6003744, 8005015, 10006286, 12007557? 2001271t - 69 What is the q'th term of 110757, 442948, 996561, 1771596? 110711q*2 + 58q - 12 What is the f'th term of 123191, 123146, 123101, 123056, 123011, 122966? -45f + 123236 What is the t'th term of -2379, -16399, -53711, -125961, -244795, -421859? -1941t*3 - 433t - 5 What is the v'th term of -1417693, -2835575, -4253457, -5671339, -7089221? -1417882v + 189 What is the l'th term of 67, 112, 129, 130, 127, 132, 157? 2l*3 - 26l*2 + 109l - 18 What is the k'th term of -352335, -704663, -1056985, -1409301, -1761611? 3k2 - 352337k - 1 What is the d'th term of -1829, -4440, -8757, -14780, -22509, -31944? -853d2 - 52d - 924 What is the d'th term of -1710770, -1710777, -1710784, -1710791? -7d - 1710763 What is the s'th term of -15196, -60660, -136440, -242536, -378948, -545676? -15158s*2 + 10s - 48 What is the m'th term of 47430, 379488, 1280780, 3035922, 5929530? 47436m3 + m2 + 3m - 10 What is the o'th term of 3282, 3266, 3242, 3204, 3146, 3062, 2946, 2792? -o*3 + 2o*2 - 15o + 3296 What is the d'th term of -34336, -34462, -34592, -34726, -34864, -35006, -35152? -2d2 - 120d - 34214 What is the b'th term of -3304605, -6609212, -9913819, -13218426? -3304607b + 2 What is the n'th term of 42871, 85645, 128431, 171235, 214063, 256921? n3 + 42767n + 103 What is the v'th term of -1175, -2663, -4245, -5969, -7883, -10035? -8v3 + v2 - 1435v + 267 What is the m'th term of 172794, 171656, 170518, 169380? -1138m + 173932 What is the x'th term of 204, 1770, 6056, 14418, 28212? 226x*3 + 4x*2 - 28x + 2 What is the u'th term of 47063065, 47063059, 47063053, 47063047, 47063041, 47063035? -6u + 47063071 What is the d'th term of -930348, -930375, -930402, -930429, -930456, -930483? -27d - 930321 What is the k'th term of -9656, -19314, -28978, -38648? -3k2 - 9649k - 4 What is the i'th term of -13756, -27498, -41216, -54904, -68556, -82166, -95728? i*3 + 6i*2 - 13767i + 4 What is the z'th term of 1973, 8111, 18275, 32459, 50657, 72863, 99071? -z*3 + 2019z*2 + 88z - 133 What is the w'th term of -7202, -12835, -18468, -24101, -29734? -5633w - 1569 What is the u'th term of 41182, 82312, 123442? 41130u + 52 What is the s'th term of -35728375, -71456750, -107185125, -142913500, -178641875, -214370250? -35728375s What is the o'th term of -643, 415, 1485, 2567, 3661, 4767? 6o*2 + 1040o - 1689 What is the m'th term of 134, -500, -1820, -3832, -6542, -9956? -m*3 - 337m*2 + 384m + 88 What is the r'th term of -2104, -2307, -2510? -203r - 1901 What is the u'th term of -101367, -811008, -2737183, -6488160, -12672207? -101378u3 + u2 + 2u + 8 What is the g'th term of -3941, -32868, -111545, -264848, -517653? -4146g3 + g2 + 92g + 112 What is the q'th term of -9271, -18573, -27921, -37315, -46755, -56241, -65773? -23q*2 - 9233q - 15 What is the k'th term of 1067, 2223, 3363, 4481, 5571, 6627? -k*3 - 2k*2 + 1169k - 99 What is the j'th term of 11859991, 23719982, 35579973, 47439964, 59299955? 11859991j What is the n'th term of 759, 621, 483? -138n + 897 What is the d'th term of 39201, 78391, 117581, 156771, 195961, 235151? 39190d + 11 What is the r'th term of 16930, 34125, 51326, 68539, 85770, 103025, 120310? r3 - 3r*2 + 17197r - 265 What is the v'th term of -121790511, -243581018, -365371525? -121790507v - 4 What is the l'th term of -73, -359, -1117, -2581, -4985? -39l*3 - 2l*2 - 7l - 25 What is the v'th term of -9148, -9132, -9178, -9316, -9576, -9988, -10582, -11388? -5v3 - v2 + 54v - 9196 What is the b'th term of 1323, 2451, 4305, 6885, 10191? 363b2 + 39b + 921 What is the v'th term of -352845, -353842, -354839, -355836, -356833, -357830? -997v - 351848 What is the w'th term of -14580471, -14580470, -14580469, -14580468, -14580467, -14580466? w - 14580472 What is the p'th term of 13385, 13023, 12667, 12317, 11973? 3p*2 - 371p + 13753 What is the s'th term of -4234, -17121, -38586, -68629, -107250, -154449, -210226? -4289s2 - 20s + 75 What is the s'th term of -37273, -75046, -112819, -150592, -188365, -226138? -37773s + 500 What is the z'th term of -300, -1274, -2922, -5244? -337z*2 + 37z What is the h'th term of 8334, 28067, 81630, 185937, 357902, 614439, 972462, 1448885? 2819h3 + h2 - 3h + 5517 What is the x'th term of -558483, -2233980, -5026497, -8936040, -13962615, -20106228, -27366885, -35744592? -x*3 - 558504x*2 + 22x What is the v'th term of -1730226, -3460449, -5190668, -6920883, -8651094? 2v2 - 1730229v + 1 What is the d'th term of 342, 8625, 22434, 41775, 66654, 97077, 133050, 174579? d*3 + 2757d*2 + 5d - 2421 What is the c'th term of 356406, 356125, 355844, 355563, 355282, 355001? -281c + 356687 What is the i'th term of -110650266, -221300533, -331950800, -442601067, -553251334, -663901601? -110650267i + 1 What is the k'th term o	{ "pile_set_name": "DM Mathematics" }
1. Let d = -43 + 46. Solve -bk - d = -14k for k. 1 Let q = -4 - -5. Suppose 3i + i = -3x + 39, 3x = 2i + 21. Let w be -8(x + -10 - 1/(-2)). Solve wr = -3 - q for r. -1 Suppose 3c = -4c + 112. Suppose -2p - 2p + 2m + 12 = 0, 5m = 4p - 12. Suppose -5h + o - po + 30 = 0, 23 = 2h + 3o. Solve hw + 0w = -c for w. -4 Suppose -2x - 16 + 0 = -4v, -24 = -4v - 2x. Let q(r) = -5r - 2. Let y be q(14). Let k = 82 + y. Solve 5h + v + k = 0 for h. -3 Let z be 21/((-2)/(-9)). Suppose -12 - z = -3b. Let n(s) = -s2 + 8s - 5. Let g be n(b). Solve j - 1 = g for j. 3 Let j(v) = v*3 + 19v*2 - 63v + 173. Let n be j(-22). Solve n - 105 = -2p for p. -1 Let f(l) = l3 + 11l*2 + 32l + 14. Let o be f(-6). Solve 4s - o = 3s for s. 2 Suppose 4m - 94 = 4h - 90, -5m + 4h + 6 = 0. Suppose i + 45 = 6i. Solve -s - i = ms for s. -3 Let n = 10 - 6. Suppose -3c + 13c - 120 = 0. Suppose -ca - 3a = -8a. Solve -nj + aj + 20 = 0 for j. 5 Let f(x) = 0x - x + x3 + 5 + x2 - 2x3 + 0. Let i be f(0). Solve ij + 6 = 2j for j. -2 Let d(a) = -a3 + 15a*2 + 21a + 236. Let j be d(17). Solve -164b + 161b = -j for b. 5 Let h(i) = -13i + 30. Let f be h(9). Let r = f - -90. Solve 2g + r = 3g for g. 3 Let p be (-11)/(33/(-18)) + -1. Suppose 0 = -py + 15. Solve 5b - 2 = yb for b. 1 Let p = 18 - 16. Let l = -6 - p. Let d be 4/16 - 6/l. Solve -2u + 3 = d for u. 1 Let d be 25/((-125)/(-30)) - -1. Solve 41 = dn + 13 for n. 4 Let z(x) be the first derivative of -x*4/2 - 4x3/3 - x2 + 2x + 26. Let k be z(-2). Solve 5d - k = 4 for d. 2 Suppose 0 = 4o - g - 22, 3o - 6o = g - 13. Suppose 3l + 2t - 20 = 0, 4t + 25 - o = 0. Solve l = -3s - 2 for s. -4 Let p(h) = -2h*3 + 13h*2 + 5h + 20. Let l be p(7). Solve -4m - l = -7m for m. 2 Suppose -5s + 3z = -36, 4s + 0z - z - 26 = 0. Solve 27t - 21 = st for t. 1 Let j = -36 - -15. Let i = 22 + j. Suppose 14 + i = 5k. Solve -t - 6 = -k for t. -3 Let h = -50 - -56. Let r be (-14)/(-21) - 4/h. Solve rk + k - 1 = 0 for k. 1 Suppose 6z = 2z + 8. Let r be 11 + -10 + 0 + 2. Solve -b - z = -r for b. 1 Suppose -4j + 4x + 20 = 0, 5x + 41 = 3j + 16. Suppose 0 = -5z - jz + 30. Suppose -3i + z = -2n + 3n, 5n = -5i. Solve -ip + 5 = 14 for p. -3 Let c = 16 - 54. Let b = -32 - c. Solve b + 10 = -4r for r. -4 Let d be 5/(35/69) + 3/21. Solve 13b = 18b - d for b. 2 Let i = 4 + -1. Solve 11 = -ix + 20 for x. 3 Suppose 7l + 239 - 659 = 0. Let p = -54 + l. Solve c - p = -c for c. 3 Let h(n) = 3n - 40. Let q be h(15). Suppose 2r + 2r = -4. Let c = r - -1. Solve -qw + cw = -10 for w. 2 Suppose -4w + 61 = u - 5, -2w - u = -34. Let g = 8 - 7. Let q be ((-18)/(-2))/(g + 0). Solve 5t = w + q for t. 5 Let x = -37 - -25. Let d = x - -13. Solve d = a - 0 for a. 1 Let g be (12/30)/(2/60). Suppose 8 = 4x - g. Solve xh + 13 - 38 = 0 for h. 5 Let b(c) = -7c - 82. Let z be b(-13). Solve zi + 6i + 75 = 0 for i. -5 Suppose 5h + 5 = -0. Let l be 876/96 - h/(-8). Let n be 4 + l/68. Solve 0 = b + 3b + n for b. -4 Let i be -6(6/(-4))/3. Let p(h) = 2h2 + 42h + 47. Let b(m) = m*2 + 21m + 24. Let r(s) = 9b(s) - 4p(s). Let d be r(-20). Solve df = if for f. 0 Suppose 6 = l - g, -4l - 7g = -3g - 8. Suppose lp + 10 = 6p. Suppose 0j + pj = 0. Solve j = -v + 4 - 1 for v. 3 Suppose 5f + 60 = 5i, -2i - 2i = -5f - 43. Suppose 5 = -4h + i. Suppose hj = 3q - 20 + 65, -4q = 4j - 44. Solve -5l + j + 12 = 0 for l. 5 Suppose 0 = 18y + 8y - 130. Solve yz - 4 - 21 = 0 for z. 5 Let y(f) = 70f + 13. Let i be y(0). Solve -4z - 25 = -i for z. -3 Suppose 0 = 4p + 16, -p - 1 = -b + 5. Suppose 0 = bh - 4n - 32, 4n - 7 - 21 = -4h. Solve 0 = -4x - 2 - h for x. -3 Let a = -2 - -4. Suppose 0 = -5w - 0w. Suppose 2t + 2t + 3j - 19 = 0, w = -2t + j + 7. Solve 2f = -af - t for f. -1 Suppose -12k = -0k. Solve -m = -km + 3m for m. 0 Let y(w) = w2 - 14w + 11. Let x be y(11). Let a = x - -17. Let p(u) = u + 9. Let o be p(a). Solve 0 = -od - 2 - 2 for d. -1 Suppose -7a = 5a - 72. Solve 5 = 11f - a for f. 1 Let x(b) = 3b + 39. Let p be x(-6). Suppose 0 = 6m - p + 3. Solve -3k + m = -6 for k. 3 Suppose 0 = 55q - 14q - 123. Solve -qm = 1 + 11 for m. -4 Suppose 94 - 100 = -2m. Suppose -5s = 25, -ms - 20 = -f - 0s. Solve -a + f = 7 for a. -2 Let x(s) = -4s2 - 17s + 9. Let i be x(-9). Let a be i/(-12)21. Let h be 6/(a/6 + -3). Solve 2o + h = -0 for o. -2 Suppose 4c - 108 - 44 = 2o, -2c + 60 = 3o. Solve 12p = 24 + c for p. 5 Suppose 16k = 15k - 47. Let n = 53 + k. Solve 2y + 16 = ny for y. 4 Let l(v) = 2v3 - 3v*2 - 2v - 3. Let g be l(3). Let i be (g + 1 - -2)2. Let y be (-2)/(-7) - (-72)/i. Solve -z - 2 = -yz for z. 2 Let n be 8 + (-210)/24 + (-19)/(-4). Solve nz + 9 - 1 = 0 for z. -2 Let n = -62 - -70. Suppose 5z + y - 8 = 0, -2z + 0y + 2y = -n. Solve -zh - 2 = -h for h. -2 Let k(l) = -l*2 - 7l - 1. Let z(i) = i*3 - 11i*2 + 10i - 6. Let g be z(10). Let m be k(g). Solve 5 = -mo - 20 for o. -5 Let h = -26 - -28. Suppose 5j = 5c - 15, -c + 4j + h = -4. Suppose cq - 4q + 3f = -4, f - 27 = -5q. Solve -qo - 3 = 22 for o. -5 Suppose 18 = 2i + 4b, 3b = -i + 3 + 7. Solve iw = -17 - 18 for w. -5 Suppose -3y + 1097 - 1034 = 0. Solve 6t = 9 + y for t. 5 Let h be 6/(-3)1 - -6. Suppose -2b + 3g + 70 = 25, -2b + 24 = 4g. Let w = b - 12. Solve h = -4t + wt for t. 2 Let a(j) = j*3 + 7j*2 + 9j - 2. Let i be (-5)/((-1 + 2)(11 + -10)). Let o be a(i). Solve -5g - o = 2 for g. -1 Let p(q) = q + 1. Suppose f - 1 = 2z, 2z - 6z + 4f - 12 = 0. Let d be p(z). Suppose 0 = -3n + 6, 2j + d - 15 = -3n. Solve -j = -2t + 1 for t. 2 Let m(b) = b*2 - 10b + 10. Let j be 32/18 + (-4)/(-18). Let k(u) = 2u3 - 3u*2 + 4u - 3. Let g be k(j). Let r be m(g). Solve -14 - r = 3x for x. -5 Suppose 4l = x + 7, -4l - 2 = 4x - 2x. Let u be l/(-2) + 3/6. Suppose u = 2s - s - 7. Solve -27 = -4g - s for g. 5 Suppose -4g = -2r + 6r - 32, -3r + 15 = 0. Let j be (-2)/(-6) - (-5)/g. Solve ja = -2 - 0 for a. -1 Let u = 21 + -19. Suppose -3l = -2q - 10, q = -l + 4q - 6. Let i be (-1)/((-3)/l) - u. Solve i = d + 4d - 5 for d. 1 Let p = -269 - -284. Solve 7z + 20 = -p for z. -5 Suppose 3d + t = 1, 3d + 1 = 4t - 3. Solve d = o - 4o for o. 0 Suppose 2i - 10 = -4f, -2i = i - 15. Suppose 2k - 2 = -fk. Solve a + k = 5 for a. 4 Let m be 476/77 + (-12)/66. Solve -44w + 46w - m = 0 for w. 3 Let v = 533 + -531. Solve -vf + 9 - 1 = 0 for f. 4 Suppose -2a - 2n - n = 6, 4a + 2n = 4. Solve -k - a = -0 for k. -3 Let t = -5 + 13. Suppose 4c - 4 - t = 0. Solve cr - 3 = 3 for r. 2 Let l = 1519 + -1490. Solve -l = 11c - 73 for c. 4 Let h be (-24)/3633/(-2). Let k = -8 - -8. Solve 4y - h + 3 = k for y. 2 Suppose 3o + 6 - 3 = 0. Let n = 5 + o. Suppose 29 = -q + 4q - 5x, -nq - 2x = -4. Solve -q = -f - 1 for f. 2 Let d(m) = 4m*2 - m. Let b be d(2). Let o = b + -6. Suppose -4 = c - o. Solve cj - 5 = 3 for j. 2 Let b(t) = 5t - 10. Let u be b(6). Suppose -u = h - 6h. Suppose -2v + 5 = -1. Solve vl = 2 + h for l. 2 Let n be ((-4)/18)/(29/(-261)). Solve np - 39 = -31 for p. 4 Suppose 4s = -5q + 16, -5s + 3q = 5q - 3. Let i be (1 - (s - 1)) + 30. Solve -i = -4l - 13 for l. 5 Suppose 3f + 2p = 2, -6f + 2p = -4f - 8. Let h(d) = -d*2 - 9d + 12. Let k be h(-10). Solve fu = 3u + k for u. -2 Suppose 0 = 5h - 4k - 38 + 9, 3h + 2k - 13 = 0. Let l(b) = -b*3 + 14b*2 - 11b - 22. Let w be l(13). Suppose -hg + w = -6. Solve -gn + 2 = -8 for n. 5 Let a be 12/1 - (-12 + (10 - -6)). Solve 7l = -20 - a for l. -4 Let r(n) = -12n + 292. Let l be r(24). Solve -19 + 27 = lq for q. 2 Let g be 1/(-1)(-22)/11. Let w be 261/18 - (-1)/g. Suppose -6l - 3 = -w. Solve -3 = -ld - d for d. 1 Let a(v) = -7v2 + v3 + 7v*2 + 4v*2. Let y be a(-4). Suppose h - 2h + 2 = y. Solve hi - 6 = 4i for i. -3 Let g(m) = -2m + 7. Let b(x) = -9x + 36. Let z(k) = 2b(k) - 11g(k). Let n be z(3). Solve -5y - n = -17 for y. 2 Let a = 0 + 2. Suppose av + 5f = 2f + 15, 3f = v + 6. Suppose -5o + m + 30 = -3m, vo = 4m + 18. Solve 4n + o = 22 for n. 4 Let n = 2 - -10. Suppose -3*o + 0 - n = 0. Let h be (	{ "pile_set_name": "DM Mathematics" }
5x3 Expand (3b + b*3 - 3b)(-4b - 2b + 2b - 1). -4b4 - b3 Expand (3 - 3 - y2)(7 - 3 - 2)(-3 + 1 - 5). 14y*2 Expand (-3y + 3y - 2y)(-4 + 5 - 21)(2 + 1 + 1). 160y Expand (-3t*4 - 10t*3 + 10t*3)(-3 + 2 + 0)(4t - 5t + 3t). 6t5 Expand 5p*3 - 2p3 - p3 + (11p2 - 2p + 2p)(-p - 3p + 5p). 13p3 Expand (3 - 1 + 0)(-5 - 2 + 3)(c4 + c4 + 0c*4). -16c*4 Expand (-2t + 1 - 1)(-27t - 12 + 54t - 24t). -6t2 + 24t Expand (2k2 + k2 - k2)(-k*2 - 2 + 2) + 0k4 + k4 - 3k4 + (-44k - 21 + 21)(-5k*3 + 3k*3 + 0k*3) + 2k*2 - 2k*4 - 2k*2. 82k*4 Expand (3 - 1 - 3)(-3l2 + 3l*2 + 2l*3) - 4l*3 + 2l*3 + 3l3 + (l3 + 1 - 1)(-4 + 1 + 1). -3l*3 Expand (3t*2 + 1 - 3t*2 - 6t*2)(-4t + 2t - t). 18t3 - 3t Expand -4p4 - 2p*4 - 2p*4 + (-2 + 2p + 2)(p3 - 3p + 3p) + 3p4 - p4 - 3p4. -7p*4 Expand (0g - 2g2 + 0g)(0 + 0 + 2g*2 + (-4 + 3 + 3)(2 + 2g2 - 2)). -12g*4 Expand (2l - l + 0l)((l + 0l + 0l)(3 + 1 - 3) - 6 + l + 4 + 0l). 2l2 - 2l Expand (-2 + 4 - 3)((-1 + 1 + 1)(3w - 2w - 3w) + (1 - 1 - 1)(6w + 10w - 8w)). 10w Expand (2f2 + 0 + 0 - f2 - 4f*2 + 3f*2 + (4 - 2 - 3)(f*2 - 4 + 4))(2f - 3f*2 - 2f). 3f4 Expand -3i + 2i + 3i + (0i + 2i - 3i)(5 - 6 + 0) + 2i + 17i - 12i. 10i Expand (-2g2 + 2g2 + g2)(-6g + 5g - g - 15g*2). -15g*4 - 2g*3 Expand (3 - 1 - 3)(17 + 7r - 17)(3 + 1 - 3 + (-3 - 2 + 3)(2 - 5 + 1)). -35r Expand (-4y + 4y - 2y)(6 + 0 - 2)(0y*2 + 2y2 + y2). -24y3 Expand (1 - 4 - 1)(-g*4 + 7g*2 - 7g*2). 4g*4 Expand (4y*2 - 4y2 - y2)(-60 - 19 - 5). 84y*2 Expand (32m - 3m3 - 1 - 32m)(-1 - 1 + 0)(2 - 4 + 4). 12m3 + 4 Expand -2a*5 - 3a*5 + 0a*5 + (2a*5 - 8a5 - a5)(1 + 3 - 3). -12a*5 Expand (0y + 4y - 5y)(4 - 4 - y) + 4y - y*2 - 6y + 3y2 - 1. 3y*2 - 2y - 1 Expand (-4p + 6p + 0p)(-p*3 + 2p*3 - 2p*3) + 3p*2 - 3p2 - p4 - 6p4 - 22p*4 - 5p*4. -36p*4 Expand (-1 - 1 + 0)((0 - 3 + 4)(5i + i - 4i) - 4i + i + 4i + 2i + 5i + 2i). -24i Expand (3p*2 - 7p + 7p)(3p - 3 + 1 - 1). 9p*3 - 9p*2 Expand 0w*5 - 2w5 + w5 + (-w*2 + 2w3 + w2)(-3w*2 + 3w2 + w2 + w*2 + 4w*2 - 3w*2 + (0w + w - 3w)(w + 1 - 1) + 2 - 2 + w*2). 3w*5 Expand (-2v + 0v + 0v)(-2v + 0v + v)(-1 + 0 + 3). 4v2 Expand -c2 - 3c*2 + 5c2 + (-c2 + 2 - 2)(-1 + 2 - 2) + 2c*2 - 249c + 239c + 5c*2. 9c*2 - 10c Expand (1 - 2 + 3)(0 + 0 + 6)(-p*2 - 6p*2 - 2p*2). -108p*2 Expand (3 - 7 + 2)(-2 - 2 + 2)(-22u*3 + 11u*3 + 28u*3). 68u*3 Expand (0u*3 - 2u*3 + 3u*3)(-4 + 1 + 1) - 12u + 12u - 7u3. -9u*3 Expand (0d - 5d + 4d)(-5d + 12d - 4 - 3d). -4d2 + 4d Expand (-6b4 - b4 + 8b*4)(-6 + 2 + 2). -2b4 Expand (3g*2 - 3g2 - g3)(3 + 0 - 6) + (0g*2 + 2g*2 - 3g*2)(-g + g + 2g). g3 Expand (0 + 0 - 4 + 3 - 2 + 0 + (-4 + 4 + 1)(0 + 0 - 2) + 1 + 1 - 3 + 3 - 2 + 1 - 1 + 6 - 3)(-2n + 2n - n5). 2n*5 Expand 3p - p - 3p + (p - 4p + 5p)(2 + 1 - 4) - 4 + 2p + 4 - 5 - 5p + 5. -6p Expand (a - 3a + a + (0a + 2a - 3a)(3 - 2 + 1))(-5 - 8 + 8 + (3 - 5 + 1)(2 - 2 + 1)). 18a Expand (-1 + 1 - v5)(0 + 5 - 3) - 7v5 + 13v*5 + 14v*5. 18v*5 Expand (11s*2 - 4s + 4s)(-13s2 - 4s*3 + 13s2) + s4 - 2s5 - s4. -46s*5 Expand (-2u*2 - 3u*2 + 3u*2)(0u - 2u + 0u) + u2 + 3u*3 - 6u*2 + 3u*2. 7u*3 - 2u*2 Expand (29t*2 - 4t*3 - 29t*2)(-2t + t + 3t)(-1 - 2 + 4). -8t*4 Expand (87b*3 - 84b*3 - 2 + 3b + 4b)(0b + 0b - b*2). -3b*5 - 7b*3 + 2b*2 Expand 9t3 + t3 - 2t3 + (-t2 - 4t*2 + 4t*2)(2t + 2 - 2) - 2t*3 + 0t*3 + 4t*3. 8t*3 Expand ((5t + 0t - 3t)(0t*2 + 4t*2 - 2t*2) + 4t*2 - 7t*3 - 4t*2)(0t + 0t + 2t). -6t*4 Expand (4 - 2 + 0)(-3 + 3 + 3g)(3g4 - 2g*4 + 2g*4). 18g*5 Expand 1 - 2u - 1 + (1 - 1 - 2)(2u - u + 0u) - 3u - 4u + 5u + 0u - 5u + 4u + 6u - u - 4u. -6u Expand 4x4 + 1 - 1 + (2x*2 + 4x*2 + 0x*2)(-3x2 + x2 + 0x*2). -8x*4 Expand (5 - 4 - 2)(-2u + 4u - 3u) - 2u - u + 4u + (-u + u - 2u)(1 + 0 + 3). -6u Expand (0 + 0 + m)(-22m + 20m + 30m). 28m2 Expand ((-5c*2 + 5c*2 + 2c*2)(0 - 3 + 2) + c*2 + 0c*2 + 0c*2 + 2c*2 - 3c*2 + 8c*2)(-3c + 2 - 2). -18c*3 Expand (-184 - 225 + 348)(s - s - 2s). 122s Expand (-6u + 49u + 7u)(2u - 2u - u). -50u2 Expand (1 + 3 - 2)(3y5 - 3y*5 + 2y*5) + (-2y + 4 - 4)(-5y*2 + 0y*2 + 6y*2)(-4y2 - y2 + 3y*2). 8y*5 Expand ((-2n - 4n + 5n)(0n + 0n + n) - 2n*2 + 7 - 7)(4 - 4 - 3n). 9n*3 Expand (6j*3 - 2j*3 - 2j*3)(-j*2 + 0 + 0) + (0j*2 + 0j2 + j2)(-j + j + j3) + 2 - 2 - 2j*5. -3j*5 Expand (0l4 - l4 + 2l4)(-4 + 6 - 5)(6 - 3l - 6). 9l5 Expand (-b - 2b*3 + b)(-3b2 + 4b*2 + 5b*2) + (-1 + b + 1)(-2b4 - 2 + 2). -14b*5 Expand 0s*3 + 0s3 + s3 + (-2s2 + 0s*2 + 0s*2)(-2s - s + 5s) + 3s3 + 6s*3 + 5s*3 + (-3 - 2s*3 + 3)(1 - 2 + 3). 7s3 Expand (1 - 1 - g)(-3 + 0 + 1)(7 + 12 - 12). 14g Expand g*2 + 7g*2 - 2g*2 + (4 + 0 - 2)(3g2 + 4g - 4g). 12g*2 Expand (-2 - 3 - 1 - 1 + 3 - 3 + (3 - 3 + 1)(0 + 1 + 1))(-2o + 0o + 0o). 10o Expand (-4f + 2f + 3f)(3f*2 + 2f*4 - 3f2) + f5 - 5f2 - 3 + 1822f*4 - 1820f*4 + 5. 3f*5 + 2f*4 - 5f*2 + 2 Expand 15h*2 - 5h*2 + 0h*2 + (4h + 2h2 - 4h)(-6 + 3 + 1). 6h2 Expand (t3 + 3t3 - 2t*3)(-t*2 + 4t*2 + 0t*2). 6t*5 Expand -v + 2v - 4v + (2 - 3 + 3)(-2v - 3v + 4v) - 2v - 2 + 2. -7v Expand (4 - 3t - 4)(1 - t - 1)(-6t2 - 2t*2 - 7t*2). -45t4 Expand (d2 - 248d + 126d + 125d - 9)(2d + 3d - 6d). -d3 - 3d*2 + 9d Expand (m2 + m2 - m*2)(3 - m - 3) + (-2 + 2 + m*2)(m + 2m - 2m) - m*3 + 2m3 + m3. 2m3 Expand (3o + 2 + 5 - 4)(-1 + 4 + 3). 18o + 18 Expand (0 - 3 + x - 7)(-5x + 2x + 4x). x*2 - 10x Expand (3i + 3i - 5i)(8 + 2 - 1) + (0 + 2i + 0)(5 - 2 - 4) + 2i - 6i + 2i + 4i + 2i - 5i + 4i - 4i + i. 7i Expand (21v + 2v - 3v)((4 - 6 + 4)(-v*2 - 4v*2 + 3v*2) - 4v - 2v2 + 4v). -120v3 Expand (-1188 + 1188 + 17w)(-2w + 0w + 0w). -34w2 Expand (i - i + 2i)(-4 + 2 + 0) - 2i + i - 4i + (-2 - 2 + 9)(2 - 2i - 2). -19i Expand (-84c + 84c - 9c3)(0c - 3c + 6c). -27c*4 Expand (6 + 16 - 7)(-3n + 6n + 0n). 45n Expand n*3 + 2 + 5 - 5 + 5n*3 + 8n*3 - 4n*3 + (0n + 0n + 2n)(3 + n2 - 3). 12n*3 + 2 Expand (-7u - 11u + 29u)(-4u + u + u) - 4u2 + 0u*2 + 3u*2. -23u*2 Expand (f - 2f - 2f)(0 - 1 + 4)(7 + 8 - 20). 45f Expand ((w2 + w2 + 0w2)(w - 2w2 - w) - 2w*4 - 2w*4 + 6w*4 + 4w*4 - 2w4 - w4)(-4w + 2w - 2w). 4w5 Expand (-4d + 0d - 5d)(-4d*2 - 2d*2 + 4d*2). 18d*3 Expand -13t*2 + 9t*2 + 13t*2 + (-5 + 5 - 3t)(-7t + 3t + 3t). 12t2 Expand (-4h + 4h + 3h)(-h + 0h + 4h)(-3 + 0 + 1). -18h2 Expand (-3 - 3j*4 + 3)(12 + 6 - 5 + (0 + 3 - 2)(2 + 0 - 1) + 2 + 0 + 0). -48j*4 Expand (2h + 3 - 3)(-1 + 2 - 4)(0 + 2 + 1)((-2h + 3h - 3h)(2 - 2 + 2) + h + 1 - 1 + 0 + 0 - 2h + 0h - 3h + h - 2h - 4h + 0h). 234h*2 Expand (7 - 3q*2 - 7)(-27 - q*2 + 27). 3q*4 Expand (2 - 2 - 4)(-3q + 5q - q)(5 + 1 - 3). -12q Expand (3h2 + 2h*3 - 3h*2)(15h2 - 3h*2 + 0h*2 + (-2 - 1 + 2)(0h2 - 2h*2 + 0h*2) - 3h*2 + 3h2 - h2). 26h5 Expand ((4 - 3 - 5)(2 - 2u - 2) + 2 - 2 + u)(2u + 1 - 1). 18u*2 Expand (0i*2 + 2i2 + i2)(0i + i - 5i)(0 - 1 + 2). -12i3 Expand (35 + 184 - 99)((-2s + 3s + 0s)(0 + 3 - 2) + 1 + s - 1). 240s Expand (-1 - 1 + 1)(q5 + q5 + 0q5) - 4q*5 + 0q*5 + 3q5 + q5 + 3 - 3. -2q5 Expand (-3n - n*2 - 2n*2 + n)(-6 - 9n + 6). 27n*3 + 18n2 Expand -s3 - s*3 - 5s*3 - 2s*2 + 2s*2 - 3s*3 + (-2s - 2s + 3s)(-3s*2 + 3s2 + s2) - 2s3 - 4s*2 + 4s*2. -13s*3 Expand (-1 + 5 - 3)(-5s4 - s*2 + s	{ "pile_set_name": "DM Mathematics" }
2)*2). -96 - 6sqrt(2) Simplify -5 + (-4((sqrt(147) + 2 + sqrt(147))5 + 4(sqrt(147) + 1 + sqrt(147)) + 0 + -2))2. 48384sqrt(3) + 764347 Simplify ((2sqrt(385)/sqrt(112))/(sqrt(132)/((sqrt(84) + (sqrt(84) - (sqrt(84) - ((-1sqrt(84) - sqrt(84)) + sqrt(84)))) - sqrt(84))/sqrt(7))) + -1)*2. sqrt(5) + 9/4 Simplify (sqrt(624)-1-5 - -6sqrt(624)1)/(-2-2sqrt(1200))-3. -33sqrt(13)/20 Simplify ((sqrt(55) + sqrt(1375)4 + -2sqrt(55)-5 + sqrt(55))/((sqrt(15)/sqrt(3) - sqrt(5))4 - sqrt(10)/sqrt(2)1))*2. 11264 Simplify 5 + 5(sqrt(55)1-5)/sqrt(11)-2-1 + 0. -50sqrt(5) + 5 Simplify (-4(2 + 1sqrt(147) - (4 + sqrt(147)2 + sqrt(147)) - (-4 + -3 + sqrt(147) + 1 + sqrt(147)))-14)*2. -57344sqrt(3) + 606208 Simplify (4(((sqrt(153) - (1 + sqrt(153)))4 - sqrt(153))6 + 3 + (sqrt(153) + 1)-2 + 0 + sqrt(153)-1 + -4))2. 23328sqrt(17) + 209952 Simplify ((5-1sqrt(78))/(sqrt(192)1))/((sqrt(12)/sqrt(150) + sqrt(2) - -22sqrt(2))4). -25sqrt(13)/832 Simplify (6(-2(-4(1 + sqrt(468)) - sqrt(468)) + 4 + 0)-1)21. 51840sqrt(13) + 1689984 Simplify (5sqrt(190)1 - (sqrt(190) + sqrt(190)-3)-5)/((6sqrt(50)2)/(sqrt(5) + sqrt(720)2)). -125sqrt(19)/12 Simplify -6(-2 + (0 + 0 + sqrt(539) + sqrt(539) - (sqrt(539) - 3sqrt(539)-6))-63)*2. -302818848 + 51408sqrt(11) Simplify (3-1(sqrt(104)1 + sqrt(104))-2)/((51sqrt(96))/((sqrt(972)1 + sqrt(972) - sqrt(12)) + sqrt(12))). 216sqrt(13)/5 Simplify 5 + (2(-1sqrt(209) - sqrt(209)))/(2sqrt(1100)) + -1. -sqrt(19)/5 + 4 Simplify 1(-1 + (-1 + sqrt(1053)2 - (-3 + 0 + sqrt(1053)))-1)*2. 54sqrt(13) + 1062 Simplify (-3((2(sqrt(847) + -3) - (sqrt(847)3 + sqrt(847) + -3)) + -2)36)2. 641520sqrt(7) + 9952308 Simplify ((-5-1sqrt(114))/sqrt(6) + sqrt(57)/(sqrt(243) + (sqrt(243) - (-1sqrt(243) - sqrt(243)) - sqrt(243))))2 - -22((2 + sqrt(2736))-3)*2. 1728sqrt(19) + 72259984/729 Simplify (-2 + -2(sqrt(294)/(sqrt(6)-14))/(sqrt(28)/(sqrt(4)2)-1))2. 4sqrt(7) + 11 Simplify ((sqrt(475)-1 + -5 + sqrt(475)2-5)-6)*2-31. -6210000 - 59400sqrt(19) Simplify (2 + (4(0 + sqrt(162)) - sqrt(162)) + (sqrt(162) + 0 + sqrt(162))3 + 2 + -31-2sqrt(162))24. 4320sqrt(2) + 145864 Simplify (3 + ((2sqrt(35))/sqrt(5) - -1sqrt(7)6) + -3 - 5(1sqrt(189)/sqrt(3))/(sqrt(9) - (-2sqrt(108))/sqrt(12)))2. 2527/9 Simplify (6(sqrt(66) - (-1sqrt(66) - sqrt(66))6 - (sqrt(66) - (sqrt(66) + -1sqrt(66) - sqrt(66))6)))/(sqrt(216)6 - (sqrt(216)/sqrt(4))/sqrt(9)). 36sqrt(11)/35 Simplify ((-5 + -5(sqrt(1088) + (sqrt(1088) + 2 - sqrt(1088))-5) + 0)6-2 + 4)*2. -514560sqrt(17) + 4204096 Simplify (0 + 2sqrt(1372) + 4 + sqrt(1372) + 4 + 2 + ((sqrt(1372) - (sqrt(1372) - 2sqrt(1372))) + -5)2)2. 67228 Simplify (6(sqrt(176) + sqrt(176) + sqrt(176) + 0) + 1sqrt(704) + -2 - (sqrt(5500)3 - sqrt(5500))/((sqrt(10) + sqrt(490) - sqrt(10))/sqrt(2)))*2. -2160sqrt(11)/7 + 3207796/49 Simplify (-4 + (-4 + sqrt(68) + sqrt(68)-3 + sqrt(68) - sqrt(68)))2 + ((sqrt(17) - sqrt(85)/(2sqrt(5)))6)26 + -2. 64sqrt(17) + 1252 Simplify 4((sqrt(192) - (2sqrt(192) - sqrt(192))) + 0 + (1sqrt(192) + 1)*2 - (-1sqrt(192)-34)*2). -109820 + 64sqrt(3) Simplify (sqrt(12) + (-2(sqrt(12) - sqrt(72)/sqrt(6)) - sqrt(12)) + (sqrt(192) - (sqrt(192) + 1sqrt(192))))/((-5sqrt(64))/(62sqrt(4))). 24sqrt(3)/5 Simplify (((sqrt(153) + 2sqrt(153))5 + (sqrt(153) - 2sqrt(153))1)1)/((4(sqrt(99) - (2sqrt(99) + sqrt(99))))/((sqrt(132)/sqrt(3))/sqrt(4)))2. -7sqrt(17)/2 Simplify -1 + ((-4 + 2((sqrt(931) - (sqrt(931) + 1)) + sqrt(931)))64)*2-3. -6497281 + 290304sqrt(19) Simplify (5(sqrt(77) + (-1sqrt(77)4 - sqrt(77) - sqrt(77)) + 3sqrt(77)-1))/(((-1sqrt(264))/sqrt(8))/(sqrt(9)/(sqrt(12)/sqrt(4)))) + 2. 2 + 40sqrt(7) Simplify (2 + -4 + -6(sqrt(560)-5)/(sqrt(15)/sqrt(3)-6 - sqrt(5))3)*2. 1440sqrt(7)/7 + 129628/7 Simplify ((2sqrt(1377) + -4 + -1 + -4 - 1(sqrt(2448) - sqrt(2448)3 - (4 + sqrt(34)/sqrt(2))))-1)*2. -430sqrt(17) + 31458 Simplify 1((-4 + 2(sqrt(68) + sqrt(68) + 0) + 0 + -1 + sqrt(68))-6)2. -3600sqrt(17) + 62100 Simplify -22(-4((sqrt(147) - (2 + 0 + sqrt(147))) + 3))2-61. 384 Simplify 4(4sqrt(5600)1)/((sqrt(8) + 3sqrt(8)2)3) + -2. -2 + 160sqrt(7)/21 Simplify (((sqrt(90)-1 - sqrt(90))4)/(sqrt(9) + sqrt(90)/(sqrt(20)/sqrt(2))))/((sqrt(450)/sqrt(9))/sqrt(10) - sqrt(100)/sqrt(5)). 4sqrt(2) Simplify -4 + 2 + (4(5(sqrt(1331) + -1) + -5(sqrt(1331) + -3) + sqrt(1331)) + 0)*2. 3520sqrt(11) + 22894 Simplify 5 + -5 + sqrt(19) + (sqrt(19) + sqrt(19) + 1)-6 + (2 + 1 + sqrt(1539))2 + 3. 43sqrt(19) + 1545 Simplify (3 + (12sqrt(85))/sqrt(5))1 - (6-2sqrt(102))/(sqrt(6) - (sqrt(54) - sqrt(6))5)3. -2sqrt(17) + 3 Simplify -3-4(3 + -4sqrt(32)4 + 1 + 0 + sqrt(32) + 1)*2. -7200sqrt(2) + 86700 Simplify -5(1 + sqrt(15)/(2sqrt(5)) + (sqrt(147) + -1)*2 + 1 + 3). -765 + 135sqrt(3)/2 Simplify ((sqrt(190)/sqrt(40))*2 + sqrt(133)/sqrt(28) - sqrt(152)/(sqrt(392) + -2sqrt(392)))-2 + 4 + -5. -21/2 - 9sqrt(19)/7 Simplify 5(sqrt(896)/sqrt(8) + sqrt(252)/sqrt(4))2 - ((-4 + sqrt(448)-2)-6)2. -63373 - 4608sqrt(7) Simplify (sqrt(1584)26 + sqrt(1584) + 2 + sqrt(1584)-2 + 5 + 2(-2sqrt(1584)-2 + (sqrt(1584) - (sqrt(1584) + 0)4)))2. 2184sqrt(11) + 267745 Simplify 2(-4 + -2 + sqrt(153) + (sqrt(85) - (sqrt(85) - ((sqrt(85) + sqrt(85)1 - sqrt(85)) + sqrt(85)))-2)/sqrt(5))2 + 3. -48sqrt(17) + 211 Simplify (4 + -5sqrt(720) + sqrt(720)3 + 2 + sqrt(720) + 3)*23-3. -7209 + 1944sqrt(5) Simplify -4 + 2((((sqrt(468) + -2)6)*2 - -1(sqrt(468) + -2sqrt(468))) + sqrt(468) + -2 + sqrt(468) + -2 + sqrt(468) + -6-3sqrt(468)). -1488sqrt(13) + 33972 Simplify 0 + ((sqrt(65) - (sqrt(65) - (sqrt(65)-2-4 + sqrt(65)) - sqrt(65)) - sqrt(65)) + ((-1sqrt(65) - sqrt(65))-3 - sqrt(65)))/(-2-2sqrt(605)). 7sqrt(13)/22 Simplify (-3 + -5(-4 + 1sqrt(125) - 6(sqrt(125) - 2sqrt(125))))2 + 3. -5950sqrt(5) + 153417 Simplify (-352(sqrt(833) + 2 + 0 - (((sqrt(833) - ((sqrt(833)2 - sqrt(833)) + sqrt(833))) + sqrt(833))-3 + sqrt(833)))1)*2. 3600 Simplify (5 + (-4 + ((sqrt(363) - (sqrt(363) - (-2 + sqrt(363)))) + 2)-3 + 3 + sqrt(363) + sqrt(363)-1 + 5 + sqrt(363) + 0)-5)*2. -3300sqrt(3) + 36525 Simplify 4(-4-5(sqrt(88)-3 + sqrt(88)))/(sqrt(32)/(sqrt(16)/sqrt(4)3)) + 1. -480sqrt(11) + 1 Simplify 3 + (-6(sqrt(833) + 0) + -2)2 + ((sqrt(833) + -1)2-6 - ((sqrt(833)2 + sqrt(833))2 + -5)) + -5. 252sqrt(17) + 17494 Simplify (5 + 3 + sqrt(8) + 2)2 - ((sqrt(8)/(sqrt(112)/sqrt(7)))2 + 0). 40sqrt(2) + 215/2 Simplify (((5 + sqrt(208) - (sqrt(208) + 5))-3)*2 - (3 + 3 + sqrt(1573) + 0)) + 0. -11sqrt(13) - 6 Simplify -5 + 3(sqrt(160)/(1sqrt(8)) - sqrt(140)/(sqrt(14)/sqrt(2)))/((2sqrt(80))/sqrt(8)3). -5 Simplify -5 + (3 + sqrt(11)23 + -3 + 1 + sqrt(1331))*2 + 1 + 0. 34sqrt(11) + 3176 Simplify (sqrt(130) + sqrt(130)21 - (-2sqrt(130)2 + sqrt(130) - sqrt(130)))/(-252sqrt(360)) + 2. -7sqrt(13)/120 + 2 Simplify (3 + 3 + 5 + 0 + sqrt(1539))*2 + (-3(0 + (3sqrt(76)5)/sqrt(4)))*2. 198sqrt(19) + 40135 Simplify 6(((sqrt(1331) + -1)25 - (sqrt(1331) + 1 + sqrt(1331) + -4)) + (sqrt(1331) + (-2 + (sqrt(1331) + -3 - sqrt(1331)) - sqrt(1331) - sqrt(1331)))3). -990sqrt(11) + 39888 Simplify (sqrt(4536) + sqrt(4536)-2 - sqrt(4536))/(1sqrt(64)/sqrt(8)) - (-3sqrt(252) + sqrt(252))/(sqrt(9) - -4sqrt(9)2). -158sqrt(7)/9 Simplify 1 + (5-2sqrt(2200)4)/(6sqrt(275) + sqrt(11) + (sqrt(88) - -3sqrt(88))/sqrt(8)) + 0. -80sqrt(2)/7 + 1 Simplify ((sqrt(336) - (sqrt(336) - (sqrt(336) - (sqrt(336)2 - sqrt(336)))-1))-5)/((sqrt(6)-4)/sqrt(2) + sqrt(12)/(2sqrt(4))). 0 Simplify (-4(sqrt(147) + ((sqrt(147) + 1)1 - sqrt(147))) + -6(-2 + 2-1sqrt(3)))*2. -256sqrt(3) + 832 Simplify 31(3(sqrt(90) - (-1sqrt(90) + sqrt(90) + sqrt(90) + sqrt(90))))/((sqrt(6)/sqrt(12) - sqrt(2)) + sqrt(2) + sqrt(450)). -54sqrt(5)/31 Simplify ((-5 + sqrt(19)-3 + (sqrt(19) - sqrt(475)-1) - -5(1 + sqrt(76))*25) + -3)4. 412sqrt(19) + 7668 Simplify -5 + (sqrt(1331) - ((1sqrt(1331) - sqrt(1331)) + 0) - -4sqrt(1331)1)2-4 + 0 + 3. -133102 Simplify 1(4 + -5 + (-6(3sqrt(4032) + sqrt(4032)) + sqrt(4032))*2 + -3). 213292	{ "pile_set_name": "DM Mathematics" }
Let o = -3 + 4. Let k(s) = op(s) - 4y(s). Determine gk(u) - 7i(u). -u*2 Let w(b) = 2b*2 - 4b + 3. Let z be w(2). Let k(n) = -n*2 - 4n + 1. Let f(g) = -2g2 - 7g + 2. What is zf(i) - 5k(i)? -i2 - i + 1 Let m(r) = r2 - 7r + 6. Suppose 3l - 8l + 25 = 0. Let v(k) = k - 1. Calculate lv(i) + m(i). i*2 - 2i + 1 Let t(r) = -3r3 + 4r3 + r3 - 6r2 - 3r + 0r. Let g(n) = -n2. Determine -6g(b) + t(b). 2b3 - 3b Let d(u) = 3u3 - 21u*2 - 21u + 21. Let g(n) = -n*3 + 5n*2 + 5n - 5. Suppose 120 = 5l + 95. Determine ld(o) + 21g(o). -6o*3 Let f(i) = 2i*3 + 3i*2 + 3. Let c(u) = -5u*3 - 7u*2 - 7. Calculate -3c(p) - 7f(p). p3 Let m(h) = 988h*3. Let a(f) = 19f*3. Calculate 209a(l) - 4m(l). 19l3 Let c(m) be the third derivative of -m4/4 + 5m3/6 + 11m*2. Let q = 30 + -8. Let o(k) = k - 1. Suppose 5x - 16 = x. Calculate qo(v) + xc(v). -2v - 2 Let r(a) = -a + 1. Let d(x) = 5x + 4. What is d(f) + 3r(f)? 2f + 7 Suppose w = o - 3, -3o - 1 = w - 6. Let p(s) = 2s + o + s - 2s. Suppose -z + 6z + 20 = 0. Let j(v) = 4v + 7. Give zj(x) + 14p(x). -2x Let c = 51 + -50. Let v(r) = r*2 - r. Let t(w) = -6w*2 + 2w. Determine ct(i) + 4v(i). -2i2 - 2i Let w(i) = -i*2 - i - 1. Let c(z) = -3z + 2z + z2 + 2 + 3z. Let f = -7 - -8. Determine fc(v) + 2w(v). -v2 Let m(p) = p + 3. Let a(b) = b3 + b + 3. Let z(v) = v*3 + v + 3. Let f(x) = 3a(x) - 4z(x). Calculate 2f(n) + 3m(n). -2n*3 + n + 3 Let y(c) = 86c*2 + 1. Let r(n) = 258n*2 + 3. Give 3r(a) - 8y(a). 86a*2 + 1 Let d(u) = 7u + 5. Let h(p) be the first derivative of -3/2p2 - 2p + 1. Determine -2d(o) - 5h(o). o Let a(k) = -4k3 + 2k*2 - 1. Let l(t) be the first derivative of 9t*4/4 - 5t3/3 + t2/2 + 2t - 5. What is 5a(z) + 2l(z)? -2z*3 + 2z - 1 Let s(q) = 4q + 1. Let c(v) = -v + 106 + 7v - 105. Determine -5c(z) + 7s(z). -2z + 2 Let b(z) = 7z + 4. Let i = 1 + 2. Suppose ih - 6h = -39. Let c(u) be the second derivative of -5u3/2 - 9u*2/2 - 3u. What is hb(w) + 6c(w)? w - 2 Let s(o) = 3o2 - 3o + 3. Let g(w) = -10w2 + 8w - 8. Give 3g(c) + 8s(c). -6c2 Let y(i) = 1. Let n(r) = -r3 + 6. Let p be ((-2)/(-4))/((-2)/(-20)). Let q = 59 + -55. Suppose -2k - 2 = 2t - 3k, 5t + p = qk. Give tn(g) + 4y(g). g*3 - 2 Let u(x) = -29x*3 - 4x - 4. Let o(v) = -28v3 - 5v - 5. Calculate 4o(n) - 5u(n). 33n3 Let u(c) = -2c*2 - 5c + 4. Let k(z) = -5z2 - 11z + 9. Suppose 4a = 5a + 3. What is ak(p) + 7u(p)? p*2 - 2p + 1 Let s(i) be the third derivative of -5i4/12 - 8i*3/3 - 3i*2. Let l(r) = -r - 1. Let w(n) = 7n + 9. Let d(a) = 4l(a) + w(a). Give 16d(u) + 5s(u). -2u Let c(z) = z*3 - z + 1. Let q(f) = 2f*3 - 3f + 3. What is 3c(h) - q(h)? h3 Let k(i) = -15i + 13. Let o(u) = 2u + 1. Let t be o(3). Let m(y) = 11y - t + y - 4y. Calculate 6k(p) + 11m(p). -2p + 1 Let v(g) = -17g3 + 7g*2 + 7g. Let j(t) = -8t3 + 3t*2 + 3t. What is 7j(z) - 3v(z)? -5z3 Let y(f) = -6f*2 + 3f + 3. Let u(q) = -36q2 + 16q + 16. Let h(x) = -18x2 + 8x + 8. Let m(g) = 5h(g) - 3u(g). Give 3m(c) + 8y(c). 6c2 Let a(i) = -2i - 3. Let c(p) = -p + 1. Let w(t) = 2t + 7. Let m(d) = -2c(d) + w(d). Determine -5a(l) - 3m(l). -2l Let m(f) = 7f*2 - 4f - 5. Let u(p) = 4p2 + 0 + 3p + 0p - 10p*2 + 4. Calculate 4m(g) + 5u(g). -2g*2 - g Let r(h) = -287h*3 - 41h*2 + 41h + 41. Let o(b) = 36b3 + 5b*2 - 5b - 5. Calculate -41o(w) - 5r(w). -41w3 Suppose f - 3 = -2f. Let c(p) = -1. Let y(o) = -o*3 + 5o*2 - 4o + 2. Let i be y(4). Let z(d) = -2d + i - 4 + 2. What is fc(b) + z(b)? -2b - 1 Let n(c) = c + 2. Let v be (0 - -4)/8 + (-14)/(-4). Let a(i) = -2i - 2. What is vn(k) + 3a(k)? -2k + 2 Let z(a) = 2a*3 - 13a*2 + 15a + 2. Let k(c) = c*3 - 6c*2 + 7c + 1. What is -13k(u) + 6z(u)? -u*3 - u - 1 Let j(u) = 2u + 1. Let a(y) = -2y - 1. Suppose -20 - 5 = 5s. Give sj(z) - 6a(z). 2z + 1 Let z(l) = -l - 11. Let a(w) = 1. Let c(k) = k3 + 7k*2 + 4. Let r be c(-7). Calculate rz(v) + 44a(v). -4v Let r(g) = -4g + 4. Let z = 15 - 19. Let b(n) = 3n - 3. Determine zr(x) - 5b(x). x - 1 Let b(o) = 4o. Let p(m) = 2m - 9. Suppose -3s + 1 = -2s, 0 = -5k - 3s + 33. Let l be p(k). Let n(u) = -5u + 4u - 4u. What is lb(r) + 2n(r)? 2r Let o(j) = 36j2 - 27j + 27. Let g(q) = -5q2 + 4q - 4. Calculate 27g(f) + 4o(f). 9f2 Let j(s) be the first derivative of -5s*2 - 2s + 1. Let l be -11 - 3(1 - 0)-1. Let w(i) = -i. Calculate lw(n) + j(n). -2n - 2 Let r(c) = -c*2. Suppose -6z + z = -5i - 35, -2i = -z + 9. Let l = 3 + -2. Let s(g) = 2g + 1 + 4g*2 - 2g*2 - 6g*2. Calculate ir(u) + ls(u). -2u*2 + 2u + 1 Let w(c) = -14c + 4c + 13 - 3c - 4c*2. Let p(r) = -3r*2 - 9r + 9. Let z(f) = -6f3 + f2 + f - 1. Let q be z(1). Give qw(s) + 7p(s). -s2 + 2s - 2 Let q(z) = 3z2 - 4z - 6. Let u(l) = 3l2 - 3l - 5. Let w be (6/4)/(15/(-30)). Give wq(n) + 4u(n). 3n2 - 2 Let p(k) = -1 + 11k + 3 + 15. Let h(f) = 2f + 3. Give 34h(i) - 6p(i). 2i Let g(q) = q + 3. Let x be g(-7). Let v(h) = 5h2 + 4h + 2. Suppose 5 = 3y - 4y. Let o(w) = -6w2 - 5w - 2. Determine xo(l) + yv(l). -l*2 - 2 Let l(s) = 2s*2 + 5s + 5. Let f(c) = -7c - 12c*2 + 11c + 14c2 + 4. Determine -5f(m) + 4l(m). -2m*2 Suppose 0y - 4 = 4y, -8 = -5f - 2y. Let d(h) = 6h*3 + 10. Let l(n) = 2n*3 + 3. Determine fd(q) - 7l(q). -2q*3 - 1 Let n(y) = 1. Suppose -2o = 4f + 6, -2f = 3o + 2o + 23. Let g(s) = -4s + 7. Let m(t) = 5t - 11. Let p(v) = -3g(v) - 2m(v). What is fp(i) - 2n(i)? 2i - 1 Let o(z) = 11z - 6z + 6z*2 - 25z - 23. Let d(n) = 2n2 - 7n - 8. Suppose -i + 0 + 17 = 0. Give id(p) - 6o(p). -2p2 + p + 2 Let f(m) = 2m*2 + 4m - 3. Let z(c) = -2c2 - 5c + 4. What is -5f(t) - 4z(t)? -2t2 - 1 Let s be (6/(-10))/((-2)/10). Let c(x) = -2x. Let m(i) = 5i + 2i - 9i + i. Give sc(o) - 4m(o). -2o Let j(i) = i + 1. Let s(w) = 3w. Let h(q) = -2j(q) - s(q). Let b(m) = -9m - 4. Calculate -6b(k) + 11h(k). -k + 2 Let j(f) = -8f*2 - 2f - 6. Let i(u) = 23u2 + 5u + 17. Determine -4i(g) - 11j(g). -4g2 + 2g - 2 Let o(f) = 3f + 6. Let n(s) = 3s + 5. Let z = -41 - -36. Calculate zn(r) + 4o(r). -3r - 1 Let g(i) = -2i*2 + 4i. Let t(l) = l*2 - 3l. Suppose -5a = 2k + 20, 3k + 3a = -0a - 12. Suppose km + 2 = -m. Determine mg(c) - 3t(c). c*2 + c Let q be 1/(-1) - (13 - 16). Let i(d) = d + 4d + 2 - d. Let u(o) = -o - 1. Give qu(y) + i(y). 2y Let r(g) = -4g. Let m(s) = 5s + 1. Let h(j) = -3m(j) - 4r(j). Let z(f) be the second derivative of -2f3/3 + 13f*2/2 + 2f. Calculate 26h(t) + 6z(t). 2t Let b(r) = 7r*2 - 4r + 2. Let g(z) = 8z2 - 5z + 1. Calculate 4b(c) - 3g(c). 4c2 - c + 5 Let o(f) = f2 - 17f - 13. Let n(r) = -4r + 1. Let z(t) = 1. Let b(q) = -n(q) + 4z(q). Determine -9b(k) - 2o(k). -2k2 - 2k - 1 Let j(m) = 3m + 2. Let h be (-10 + (-2 - -2))/2. Let i(z) = -3z - 2. What is hj(c) - 6i(c)? 3c + 2 Let s(f) = -6f - 12. Let k(r) = -6r - 11. Let l(w) = 4k(w) - 5s(w). Let b(a) = -a - 3. Suppose -u + 5 - 4 = 0. Suppose 0 = m + 1 + u. Give ml(h) - 11b(h). -h + 1 Suppose 3u = -3u. Let g be (-3)/(-6) + (-1)/(-2). Let a(x) = 4x + g + 3 + 0 + u - 2x2. Let z(r) = -5r*2 + 11r + 11. Calculate -11a(h) + 4z(h). 2h2 Let y(i) = i2 - 6i - 4. Let o be y(6). Suppose 1 + 0 = -q. Let h be 2(o - -2 - q). Let v(l) = 5l + 13. Let r(g) = g + 3. Give hv(k) + 9r(k). -k + 1 Let s(j) = -j3. Let o(b) = -b3 + 2b2 + 2b + 1. Give -o(k) - 2s(k). 3k*3 - 2k*2 - 2k - 1 Let w(s) = -5s + 19s + 6s + 6 + s. Let q(l) = -4l - 1. Determine 11q(z) + 2w(z). -2z + 1 Let x(y) = 11y + 4. Let r(p) = -5p - 2. Let m(t) = 14r(t) + 6x(t). Let v(s) = 6s + 6. What is -7m(j) - 5v(j)? -2j - 2 Let d be 2/1 + 0/(-8). Suppose c + 3 + d = 0. Let m(y) = -7y + 6. Let r = 5 + 1. Let w(f) = -6f + 5. What is cm(u) + rw(u)? -u Let l(z) = -16z*2 - 16z - 17 + 10 + 4z3 - 9. Let r(c) = -c3 + 5c*2 + 5c + 5. Calculate -5l(g) - 16r(g). -4g*3 Let y(x) = 34 + x + 39 - 74.	{ "pile_set_name": "DM Mathematics" }
equence ub. 1/24 Four letters picked without replacement from {d: 1, u: 5, n: 3, z: 7, g: 3}. What is prob of sequence zgnz? 21/5168 Calculate prob of sequence hnn when three letters picked without replacement from nnnnnnhnhnnnnnh. 66/455 Two letters picked without replacement from asnqdeqs. Give prob of sequence ed. 1/56 Three letters picked without replacement from ryiyrrrryiyryriiyrr. What is prob of sequence rry? 24/323 Two letters picked without replacement from {a: 4, s: 2}. What is prob of sequence sa? 4/15 What is prob of sequence knnk when four letters picked without replacement from nnknk? 1/10 What is prob of sequence unn when three letters picked without replacement from {u: 2, n: 2}? 1/6 Two letters picked without replacement from {r: 4, x: 4, a: 2, y: 4}. What is prob of sequence yx? 8/91 What is prob of sequence jxnv when four letters picked without replacement from vnjccxh? 1/840 What is prob of sequence juev when four letters picked without replacement from {e: 2, u: 2, v: 1, j: 1, n: 1}? 1/210 Three letters picked without replacement from ddev. What is prob of sequence ded? 1/12 What is prob of sequence flf when three letters picked without replacement from {l: 2, f: 8, j: 2}? 14/165 What is prob of sequence gtv when three letters picked without replacement from {t: 1, v: 1, g: 1, l: 1, q: 1}? 1/60 Calculate prob of sequence rwr when three letters picked without replacement from ttrwttrwttt. 2/495 Calculate prob of sequence mv when two letters picked without replacement from myvmmhmmumtmmyyhhvmu. 9/190 What is prob of sequence pp when two letters picked without replacement from aiippiraara? 1/55 Four letters picked without replacement from uuugaeiu. What is prob of sequence iuei? 0 Three letters picked without replacement from {g: 1, e: 2, n: 2}. Give prob of sequence ege. 1/30 Calculate prob of sequence qvdm when four letters picked without replacement from dmdvmkmmlmmqmmk. 2/4095 Three letters picked without replacement from uixbuxzibibbibuzib. Give prob of sequence xzz. 1/1224 Three letters picked without replacement from {i: 1, o: 7, v: 2, n: 4}. Give prob of sequence ooo. 5/52 Three letters picked without replacement from vvkkkvk. What is prob of sequence kvk? 6/35 Three letters picked without replacement from {z: 1, v: 2, q: 1, y: 1, r: 2}. What is prob of sequence zrr? 1/105 What is prob of sequence vvvv when four letters picked without replacement from {v: 10}? 1 What is prob of sequence llll when four letters picked without replacement from lllll? 1 Calculate prob of sequence rr when two letters picked without replacement from {t: 3, r: 3, l: 1}. 1/7 Calculate prob of sequence kgey when four letters picked without replacement from yegyyykeeugyygykeu. 7/3060 Two letters picked without replacement from weozttom. Give prob of sequence mz. 1/56 Four letters picked without replacement from {q: 5, e: 3}. What is prob of sequence qqqe? 3/28 Two letters picked without replacement from {c: 1, d: 3, y: 4, z: 1, g: 1, t: 5}. Give prob of sequence dz. 1/70 What is prob of sequence ae when two letters picked without replacement from {h: 2, s: 1, a: 1, e: 1}? 1/20 Four letters picked without replacement from aaaa. What is prob of sequence aaaa? 1 Two letters picked without replacement from sbytytsyyattbttyyd. Give prob of sequence yt. 2/17 Calculate prob of sequence iut when three letters picked without replacement from iaytttyibyiaatu. 2/455 Calculate prob of sequence fzzf when four letters picked without replacement from ffffzfffzffffzffff. 7/408 Three letters picked without replacement from {j: 10, n: 2}. What is prob of sequence jnn? 1/66 What is prob of sequence pepi when four letters picked without replacement from eieeeeeeppipeepeppe? 55/7752 Two letters picked without replacement from {u: 4, f: 2, l: 1, g: 1, q: 9}. What is prob of sequence ff? 1/136 Two letters picked without replacement from {e: 1, m: 4, k: 2, o: 9}. What is prob of sequence mm? 1/20 Calculate prob of sequence yss when three letters picked without replacement from lsllyslqqsyls. 2/143 Four letters picked without replacement from fnfefqhnhfnffeh. Give prob of sequence fhqh. 1/910 What is prob of sequence vjy when three letters picked without replacement from {y: 2, o: 2, v: 5, i: 8, j: 1}? 5/2448 What is prob of sequence rr when two letters picked without replacement from rrrrrfrffrrrrrfrrfr? 91/171 Four letters picked without replacement from {g: 1, b: 18}. Give prob of sequence bbbg. 1/19 Three letters picked without replacement from qjjdjqjjjdddqqddj. Give prob of sequence jjq. 7/170 What is prob of sequence qvy when three letters picked without replacement from {q: 1, y: 1, t: 1, v: 1, l: 2, c: 1}? 1/210 What is prob of sequence hh when two letters picked without replacement from khhhkhhhhkhhhhhhkhhk? 21/38 What is prob of sequence vr when two letters picked without replacement from rvzvrzrrrv? 1/6 Four letters picked without replacement from bpesbrebsvrbrp. What is prob of sequence bbvr? 3/2002 Three letters picked without replacement from cacrkkkarkeaerre. Give prob of sequence ckc. 1/420 What is prob of sequence evw when three letters picked without replacement from vvvvvvoevvvuuquvvow? 11/5814 Calculate prob of sequence aa when two letters picked without replacement from {a: 4}. 1 Four letters picked without replacement from rnqqxdrxkdnknqn. What is prob of sequence qdnr? 2/1365 Two letters picked without replacement from {a: 4, s: 3}. What is prob of sequence sa? 2/7 What is prob of sequence ph when two letters picked without replacement from {h: 4, e: 7, p: 5}? 1/12 Four letters picked without replacement from {y: 1, n: 2, x: 3, h: 4, p: 2, r: 2}. Give prob of sequence hrry. 1/3003 Four letters picked without replacement from {g: 2, q: 1, e: 3, i: 6}. What is prob of sequence qgei? 1/330 Two letters picked without replacement from {u: 1, f: 1, a: 11, w: 1, v: 1, d: 3}. What is prob of sequence vw? 1/306 Calculate prob of sequence zzmm when four letters picked without replacement from zmmz. 1/6 What is prob of sequence dyyd when four letters picked without replacement from ndmmmxdnnmmy? 0 Calculate prob of sequence iiip when four letters picked without replacement from {p: 5, i: 8}. 14/143 Two letters picked without replacement from {q: 1, i: 1, e: 1}. What is prob of sequence qi? 1/6 Three letters picked without replacement from {d: 2, h: 4}. What is prob of sequence hhh? 1/5 Three letters picked without replacement from nhhbnnihnkxk. What is prob of sequence ihn? 1/110 Two letters picked without replacement from vcccvhjccvgcsccvc. Give prob of sequence cc. 9/34 Three letters picked without replacement from dvhcddt. Give prob of sequence dtc. 1/70 What is prob of sequence yyqq when four letters picked without replacement from yqqyqqyyyyqyyyyyyyq? 65/1292 Calculate prob of sequence ms when two letters picked without replacement from {n: 3, s: 1, m: 3}. 1/14 What is prob of sequence hj when two letters picked without replacement from {j: 4, h: 2}? 4/15 Two letters picked without replacement from jfqjlljjjqljfqj. Give prob of sequence jj. 1/5 What is prob of sequence ye when two letters picked without replacement from yyeeeeyeyei? 12/55 What is prob of sequence pue when three letters picked without replacement from upe? 1/6 What is prob of sequence oooo when four letters picked without replacement from ooyooyoyooooooo? 33/91 What is prob of sequence irqg when four letters picked without replacement from irqrgg? 1/90 What is prob of sequence ym when two letters picked without replacement from {m: 14, y: 4}? 28/153 Calculate prob of sequence dbq when three letters picked without replacement from qqdbbbqddqdqdddd. 1/28 Three letters picked without replacement from {e: 6, l: 6, q: 2, r: 4}. Give prob of sequence rre. 1/68 Two letters picked without replacement from {b: 1, j: 4, a: 3, k: 1, l: 2}. What is prob of sequence aj? 6/55 Four letters picked without replacement from {o: 2, v: 2, u: 5, z: 3, k: 3}. Give prob of sequence ukvk. 1/546 What is prob of sequence qq when two letters picked without replacement from {u: 6, q: 4}? 2/15 What is prob of sequence cuc when three letters picked without replacement from uucc? 1/6 Three letters picked witho	{ "pile_set_name": "DM Mathematics" }
there between 9:18 AM and 11:57 AM? 159 How many minutes are there between 4:13 AM and 10:27 AM? 374 What is 217 minutes after 2:33 AM? 6:10 AM How many minutes are there between 11:52 PM and 11:21 AM? 689 How many minutes are there between 1:20 PM and 6:18 PM? 298 What is 252 minutes before 8:59 AM? 4:47 AM What is 462 minutes before 12:22 AM? 4:40 PM How many minutes are there between 6:56 PM and 2:29 AM? 453 How many minutes are there between 10:54 AM and 1:41 PM? 167 What is 501 minutes after 10:56 AM? 7:17 PM How many minutes are there between 11:23 AM and 12:02 PM? 39 How many minutes are there between 11:24 PM and 8:57 AM? 573 How many minutes are there between 11:27 PM and 12:58 AM? 91 How many minutes are there between 9:38 AM and 4:47 PM? 429 What is 149 minutes after 5:34 PM? 8:03 PM How many minutes are there between 8:48 AM and 2:03 PM? 315 How many minutes are there between 5:06 PM and 9:19 PM? 253 How many minutes are there between 8:34 PM and 8:59 PM? 25 How many minutes are there between 1:50 PM and 4:06 PM? 136 What is 705 minutes after 12:18 PM? 12:03 AM What is 538 minutes after 12:20 AM? 9:18 AM How many minutes are there between 4:04 AM and 5:51 AM? 107 What is 644 minutes after 8:16 AM? 7:00 PM What is 387 minutes before 4:57 AM? 10:30 PM How many minutes are there between 2:06 AM and 1:46 PM? 700 How many minutes are there between 9:26 PM and 1:29 AM? 243 What is 318 minutes after 6:07 PM? 11:25 PM What is 154 minutes before 10:17 AM? 7:43 AM How many minutes are there between 7:47 AM and 3:55 PM? 488 How many minutes are there between 12:53 AM and 10:17 AM? 564 What is 54 minutes before 12:02 PM? 11:08 AM What is 63 minutes after 10:06 PM? 11:09 PM What is 463 minutes after 12:42 AM? 8:25 AM How many minutes are there between 10:51 PM and 1:52 AM? 181 How many minutes are there between 7:56 AM and 12:42 PM? 286 How many minutes are there between 2:22 PM and 12:19 AM? 597 What is 430 minutes after 3:28 AM? 10:38 AM How many minutes are there between 10:01 AM and 11:10 AM? 69 What is 176 minutes after 10:56 PM? 1:52 AM How many minutes are there between 3:26 PM and 1:37 AM? 611 What is 92 minutes before 8:21 AM? 6:49 AM How many minutes are there between 11:42 AM and 5:03 PM? 321 How many minutes are there between 2:36 AM and 1:56 PM? 680 What is 532 minutes after 12:46 AM? 9:38 AM What is 446 minutes after 12:25 PM? 7:51 PM How many minutes are there between 11:17 PM and 6:55 AM? 458 How many minutes are there between 10:48 PM and 12:29 AM? 101 How many minutes are there between 9:14 AM and 6:42 PM? 568 What is 266 minutes before 4:00 PM? 11:34 AM What is 327 minutes after 9:17 PM? 2:44 AM What is 680 minutes after 10:28 AM? 9:48 PM What is 191 minutes before 1:06 PM? 9:55 AM How many minutes are there between 1:15 AM and 8:13 AM? 418 How many minutes are there between 4:01 PM and 8:57 PM? 296 How many minutes are there between 9:56 AM and 5:39 PM? 463 What is 538 minutes after 4:28 PM? 1:26 AM What is 646 minutes before 6:34 PM? 7:48 AM What is 56 minutes after 2:19 AM? 3:15 AM What is 652 minutes after 12:40 AM? 11:32 AM What is 473 minutes after 10:27 PM? 6:20 AM How many minutes are there between 8:12 PM and 1:49 AM? 337 What is 342 minutes after 1:28 AM? 7:10 AM What is 468 minutes after 4:28 PM? 12:16 AM What is 462 minutes after 11:28 AM? 7:10 PM How many minutes are there between 6:38 AM and 1:17 PM? 399 What is 423 minutes after 11:08 AM? 6:11 PM How many minutes are there between 8:31 PM and 2:16 AM? 345 What is 27 minutes after 10:18 PM? 10:45 PM What is 181 minutes after 8:30 AM? 11:31 AM What is 670 minutes before 11:40 PM? 12:30 PM What is 25 minutes after 10:29 PM? 10:54 PM What is 421 minutes after 8:59 AM? 4:00 PM What is 372 minutes before 9:27 PM? 3:15 PM What is 154 minutes before 11:39 PM? 9:05 PM How many minutes are there between 3:49 PM and 2:17 AM? 628 What is 560 minutes after 1:12 PM? 10:32 PM What is 325 minutes before 11:49 AM? 6:24 AM How many minutes are there between 5:55 PM and 3:46 AM? 591 What is 570 minutes after 11:53 AM? 9:23 PM What is 504 minutes before 3:42 AM? 7:18 PM How many minutes are there between 2:41 PM and 8:09 PM? 328 How many minutes are there between 9:19 PM and 10:26 PM? 67 What is 11 minutes after 1:42 AM? 1:53 AM How many minutes are there between 7:06 PM and 4:57 AM? 591 What is 623 minutes before 4:21 AM? 5:58 PM What is 408 minutes after 12:42 AM? 7:30 AM What is 445 minutes after 5:46 AM? 1:11 PM What is 402 minutes before 8:12 AM? 1:30 AM How many minutes are there between 2:30 PM and 1:13 AM? 643 What is 360 minutes before 10:00 AM? 4:00 AM How many minutes are there between 3:00 PM and 4:17 PM? 77 What is 480 minutes before 2:31 PM? 6:31 AM What is 552 minutes before 10:03 AM? 12:51 AM How many minutes are there between 2:22 PM and 2:04 AM? 702 How many minutes are there between 5:21 AM and 4:38 PM? 677 What is 592 minutes before 1:10 AM? 3:18 PM What is 678 minutes before 5:52 AM? 6:34 PM How many minutes are there between 7:45 AM and 7:10 PM? 685 What is 700 minutes before 7:09 PM? 7:29 AM What is 360 minutes after 10:05 PM? 4:05 AM What is 35 minutes after 2:43 AM? 3:18 AM How many minutes are there between 8:44 PM and 12:56 AM? 252 What is 456 minutes after 6:36 AM? 2:12 PM How many minutes are there between 5:52 AM and 4:22 PM? 630 How many minutes are there between 5:29 PM and 3:39 AM? 610 What is 315 minutes after 6:30 AM? 11:45 AM What is 391 minutes before 11:42 PM? 5:11 PM What is 309 minutes before 5:03 PM? 11:54 AM What is 236 minutes before 4:26 AM? 12:30 AM What is 165 minutes after 1:32 PM? 4:17 PM What is 697 minutes after 11:16 PM? 10:53 AM How many minutes are there between 7:13 PM and 11:27 PM? 254 What is 238 minutes after 9:13 PM? 1:11 AM How many minutes are there between 3:24 AM and 10:18 AM? 414 What is 186 minutes before 5:08 PM? 2:02 PM How many minutes are there between 11:33 AM and 10:30 PM? 657 What is 353 minutes before 12:22 PM? 6:29 AM How many minutes are there between 4:18 PM and 4:05 AM? 707 How many minutes are there between 5:50 PM and 8:35 PM? 165 How many minutes are there between 11:33 PM and 11:53 PM? 20 How many minutes are there between 4:34 AM and 3:26 PM? 652 How many minutes are there between 11:33 AM and 2:09 PM? 156 What is 88 minutes before 4:45 AM? 3:17 AM How many minutes are there between 4:44 AM and 2:41 PM? 597 What is 578 minutes after 2:30 PM? 12:08 AM How many minutes are there between 9:12 PM and 1:38 AM? 266 What is 354 minutes after 9:35 PM? 3:29 AM What is 691 minutes after 6:27 PM? 5:58 AM How many minutes are there between 9:44 PM and 8:04 AM? 620 How many minutes are there between 1:55 AM and 7:37 AM? 342 What is 44 minutes after 8:45 AM? 9:29 AM How many minutes are there between 3:32 AM and 5:57 AM? 145 What is 599 minutes before 4:37 AM? 6:38 PM What is 587 minutes before 7:16 AM? 9:29 PM What is 235 minutes after 3:30 PM? 7:25 PM What is 704 minutes after 4:59 AM? 4:43 PM What is 12 minutes before 1:02 PM? 12:50 PM How many minutes are there between 6:20 PM and 8:42 PM? 142 How many minutes are there between 2:41 AM and 6:37 AM? 236 What is 467 minutes before 2:05 AM? 6:18 PM How many minutes are there between 9:42 PM and 5:28 AM? 466 What is 344 minutes after 3:52 PM? 9:36 PM How many minutes are there between 11:40 AM and 4:19 PM? 279 How many minutes are there between 12:39 PM and 10:27 PM? 588 How many minutes are there between 8:32 PM and 1:50 AM? 318 What is 661 minutes after 11:37 AM? 10:38 PM How many minutes are there between 2:55 AM and 3:01 AM? 6 How many minutes are there between 12:39 PM and 9:59 PM? 560 How many minutes are there between 7:49 PM and 5:40 AM? 591 What is 663 minutes before 9:44 AM? 10:41 PM How many minutes are there between 6:13 AM and 6:03 PM? 710 What is 49 minutes before 9:50 PM? 9:01 PM How many minutes are there between 9:46 PM and 5:33 AM? 467 How many minutes are there between 11:28 AM and 5:23 PM? 355 How many minutes are there between 7:02 AM and 5:43 PM? 641 How many minutes are there between 7:11 PM and 6:18 AM? 667 How many minutes are there between 12:34 PM and 8:39 PM? 485 How many minutes are there between 8:10 AM and 7:57 PM? 707 What is 5	{ "pile_set_name": "DM Mathematics" }
4l - 6l + 6. Suppose -lx = -0x - 12. Solve xu = -12, u + 7 = 3a - 11 for a. 5 Let x(k) be the third derivative of k5/60 + k4/24 - k3/6 - k2. Suppose 3r - 16 = 7r. Let d be x(r). Solve s - 5g = -28, 3s + 2g - d = -2g for s. -3 Let k = -90 + 92. Solve 5b = 5u - 25, 10 = -3u + ku - 4b for u. 2 Suppose 3h + 1 = 2h. Let q = h - -5. Solve f = 2k, -3f - 2 = -qf + k for f. 4 Let m be 7/6 + (-11)/66. Suppose 3q + m = 7. Solve -3y - 3b = 7 - 1, -5b - 10 = -qy for y. 0 Let c(g) = 19g*2 + g. Let a be c(1). Let y = -3 - -7. Solve -y = -b, 4b - a = 3j - 2j for j. -4 Let k = 15 - 10. Solve -9 = -3c, 5c - 11 - k = d for d. -1 Let n(z) = -2z - 2. Let h be n(-2). Let c be -2 - -3 - 1 - -5. Let w be c/(-2)6-1. Solve -hk + 6 = 2q, -w = -2q - q for k. -2 Suppose 4k - 4q - 18 = -2q, -3k - 2q = 4. Suppose 3l - 3 = -o - 10, 29 = 5o - l. Solve 15 = -5d + 2j, kd = 7d + oj + 50 for d. -5 Let v(x) = x - 8. Let p be v(7). Let s = 1 - p. Suppose sh = -2 + 8. Solve -4f + 3 = hc, -2f + c - 7 = 4 for f. -3 Let y = 48 - 40. Solve r + 3l = -9, 4r - 2r + l = -y for r. -3 Let k be (-671)/(-44) + (-3)/(-4). Suppose -o = -2o + k. Solve n + 16 + 9 = 5x, 0 = -4x + o for n. -5 Let g be (-18)/(-10) - 3/(-15). Suppose -2x = -3u + 19, gu - 1 = -x + 7. Solve 2k - 13 = -3r, -r - 3k + 21 = u for r. 1 Suppose 2w + 5r - 29 = 0, 0w + 12 = w + 2r. Solve 10 = -5u, -9 = -wt - u - 1 for t. 5 Let y be -3 - (2 - 10)1. Let i = 0 + y. Let q = 0 - -3. Solve -4k - qc + ic + 18 = 0, 20 = 3k + 5c for k. 5 Let h(m) = 3m + 2. Let k be h(2). Let o be (41)/(4/k). Suppose 0r - 2r + o = 0. Solve -5j - 30 = -5d, 0 = -2d + rj + j + 24 for d. 2 Suppose 0 = 5o - 61 + 11. Solve o = -5f + 5a, 0 = -a + 9 - 4 for f. 3 Let t(c) = 6c - 2. Let v(l) = 7l - 2. Let u(j) = -6t(j) + 5v(j). Let d be u(4). Let w be 7/3 - d/3. Solve -1 = -s + z - w, -s = 2z + 5 for s. -3 Let r(y) = -y3 - y2 - y. Let c = 2 - 3. Let l be r(c). Let f be 2(2 - l) + 1. Solve fk + 3 = -2n - 2n, 2n = k + 1 for k. -1 Let o be (0 - -2) + (-9)/(-1). Solve 4n - o = -3h - 0n, 0 = 5h + 3n for h. -3 Let r(m) = 4m - 19. Let z be r(16). Let y = z + -24. Solve h - 5o + y = 0, -5h + 0o + 4o - 21 = 0 for h. -1 Let w be 596/28 + (-4)/14. Suppose -h + 2h = w. Suppose 6z = 3z + h. Solve g = -2g + 5q + z, 3q = -6 for g. -1 Let o = -4 - -4. Suppose 2m + 3m - 135 = o. Let s be ((-16)/6)/((-6)/m). Solve -5r = -2r + s, 4a + 4r + 24 = 0 for a. -2 Let t = -12 + 16. Solve -5h - j - 24 = 0, t + 16 = -2h - 3j for h. -4 Let o be (-60)/(-18)9/5. Let r = -1 + o. Solve -j - 6 = -3h + 5, -rj = -2h + 16 for h. 3 Let y = -2 + 10. Let c = y - 5. Solve 4i = -cw + 17, -2w = 4i + 2w - 20 for i. 2 Suppose 4d - 4 = 4. Let t(k) = k*d + 2k2 + 1 - k2 - 3k. Let s be t(2). Solve 2y - 3f - 20 = 0, -3f = sy - 2f - 8 for y. 4 Let c = 12 + -10. Solve -4m = -5x + 19, x = cm - 5m for x. 3 Let i(x) = x - 13 - 3x + 17. Let y be i(-5). Let q be (-148)/(-28) - 4/y. Solve q = -4m - 5c, -5c = -2m - 0c + 35 for m. 5 Let i(u) = -2u + 23. Let g be i(10). Solve 0 = -4k - 3l - 15, k - g = 3k - 3l for k. -3 Let q = 10 + -7. Suppose -qo + o + 4 = 0. Let f be (-15)/(-21) - (-2)/7. Solve -od - 2x + 1 = -f, d - 7 = x for d. 4 Let q = -48 + 57. Solve 0 = -3l + q, a = -a - 4l + 12 for a. 0 Let b(c) = 2c3 - 4c*2 + 2c + 2. Let y be b(2). Let j be (-1)/2-1y. Solve -5i + 0i - 20 = ju, 2u = 0 for i. -4 Let w = 9 + -6. Solve 0v + 10 = h + wv, -h = -4v + 11 for h. 1 Let y(t) = -t3 - 2t + 11. Let r be y(0). Solve j = -5l - 12, -10 = -3j + 4l + r for j. 3 Let u be 7 - (5 + -2 + 1). Suppose 2x - 3 = u. Solve 2l + xk = -2k + 16, l = k - 6 for l. -2 Suppose -5s = -10s - 4c + 3, 4c = -4s. Solve su + l = 8, -5u + 36 = -0u - 4l for u. 4 Let v be 6/(-4)(-14)/3. Let i(n) be the second derivative of n3/6 + 7n*2/2 - n. Let z be i(v). Solve -4l - c + 15 = 0, 0l - z = -3l + 2c for l. 4 Let f(u) = u3 - 5u*2 + 5u. Let g be f(4). Suppose s + 0s - gj + 2 = 0, 0 = 5s + 3j - 13. Solve 0 = -3y - 2w + 6, y + 10 = 6y - sw for y. 2 Let r(s) = -s*2 + 4s + 3. Let l be r(4). Suppose -4a + h - 8 = -0h, 16 = -4h. Let x = a + l. Solve -2o + 9 = 5k - 11, x = 5o for k. 4 Suppose 2h = -10, 2x - 7x - h + 15 = 0. Suppose -56 = -xa - l, l = -2a + 29 - 1. Solve 4p + 4n = -a - 2, -20 = 5p + n for p. -4 Let g be 2 + -1 + -2 - -49. Suppose -u + 5u = g. Let j = 25 - u. Solve 3o - 2y = j, 23 = o + 2o - 4y for o. 1 Let r(v) = 3v*2 + 3v - 3. Let z be r(1). Solve -4c = -x - 8, -zx - 4c + c + 21 = 0 for x. 4 Let d(p) = -p2 - 10. Let t be d(0). Let c be 70/22 + t/55. Solve o + 1 = -cr - 13, o - 6 = r for o. 1 Let a = 5 - 39. Let k = -14 - a. Solve x + 2 = -2, 4h + 4x + k = 0 for h. -1 Suppose z + 0z = 45. Suppose f = 3k - 2f + z, 3f = 5k + 65. Let b be ((-6)/k)/(3/15). Solve -x + 2y - 3 = 0, by - 3 = 2x - 0y for x. 3 Let i = 8 + 20. Let b = i + -21. Solve 4x = -4p - 16, bx - 2x - p + 20 = 0 for x. -4 Let d = -32 - -32. Solve -u + 2z = -9, dz + z = -5 for u. -1 Let i be ((-4)/(-5))/(-4 - (-164)/40). Solve 0h - 2h = -2q + i, -q = h for h. -2 Let b be -3 + (-3 - 2)/(-1). Let t = b - -1. Solve -j = 4i + 7, -2j + 0j + ti = -8 for j. 1 Let o be (-128)/(-7) + (-2)/7. Let l = 20 - 8. Let r = l - 8. Solve 3y - v + o = 0, 0 = -2y + v + rv - 25 for y. -5 Suppose -2w + 6w - 24 = 0. Suppose 3m = -3h + 1 + 5, 2h + 5 = m. Let q be -5((-6)/5)/m. Solve -2l = -3l + i + w, -5i + 5 = ql for l. 5 Suppose -6p + 14 + 4 = 0. Solve 12 = 4u - pd, -u + 0d - 2d - 8 = 0 for u. 0 Suppose -l = 0, 15 = 5m + 2l + 3l. Suppose -4h + h - 22 = -5k, 0 = 4h + 16. Solve -11 = j + ki - 2, -mj + 5i = -17 for j. -1 Suppose -2w - w - 9 = 4l, 0 = 5w - 3l - 14. Let r be (w/3)/(2/6). Solve -2g + r = j - 4, 4 = 2j + 2g for j. -1 Let q(f) = f + 14. Let a be q(-6). Suppose 0 = 2l - 2c - 12, 3c = -9. Solve -a = -lx - x, -5o = -x - 23 for o. 5 Suppose -2p + 4v = -28, 2p + 2p + 3v - 1 = 0. Let f be p-9(-1)/(-4). Let j = f - -17. Solve -3h + 12 = 2w, -jw + 3w = h - 4 for w. 0 Let o(m) = m + 8. Let b be o(0). Suppose 0 = bv - 3v + 45. Let u be (3 - 1)/((-2)/v). Solve -4n - 14 = -2n + 4z, -n = 3z + u for n. -3 Suppose 4o + 3 = 5o. Let u be (-7)/7 - (2 - o). Solve 28 = -uj + 2j + 4i, -j = -3i + 11 for j. 4 Let o = 28 - 22. Solve 12 = 3a, 5a - o = m + 4a for m. -2 Let g(m) be the first derivative of -m3/3 + 3m*2 + 5m + 3. Let i be g(6). Solve -v - 5x - 5 = 2v, 3x - 31 = iv for v. -5 Let t be (-6 + 3)/((-6)/4). Suppose -2g + 5g = -to + 12, 3g = 2o. Solve 3r - 4 = -4n, 5n - 3r - o - 2 = 0 for n. 1 Let c be 4/99/2. Solve 20 = -4u, -p = -cp + 2u + 5 for p. -5 Suppose 0 = 5o - 2i - 26, -3i = 4o - 5 - 2. Suppose -2r = -2w - 14, 4w + 4 = -o. Solve -4p - 5s = r, 3s - 13 = 2p + 2s for p. -5 Let d(u) = -3u - 17. Let h be d(-7). Solve -l = 3w, -4l - hw + 8 = -0l for l. 3 Let v(j) = -j*3 - 6j*2 + 3. Let w(h) be the first derivative of -3h*2/2 + 3h - 2. Let s be w(3). Let x be v(s). Solve 2o + 12 = 2a, -xa + 16 = a for o. -2 Let n = -2 + 4. Solve -nj + 12 + 14 = 4t, -5t + 34 = 3j for t. 5 Let o(z) = 2z*2 + 19z + 12. Let f be o(-9). Let a be 2/((-28)/12 + f). Solve -4 = ac + w + 13, -4c = 3w + 26 for c. -5 Suppose 4j - 36 = -4c, 4c + j + 0j - 39 = 0. Solve 2v + 3 = -5y, 5v - 3y - 2y = c for v. 1 Let a(w) = 2w2 + 2w - 2. Let u be a(-2). Let i = -15 - -9. Let v be (8/i)/((-2)/6). Solve 3y - 15 = -up, 2p = -2y + vy for p. 3 Let n(c) = 2. Let a(s) = -s - 1. Let m(i) = -a(i) + n(i). Let d be m(0). Solve 2k - k + 5u + 30 = 0, -2u = dk + 25 for k. -5 Let t be (-3)/(1 - (-5)/(-2)). Let a = 4 + 1. Solve 3q = -3r - 10 + 25, 0 = -ar + 4q - t for r. 2 Let b be 3 - (8 - 3) - -3. Let j be -2 + b - (9 + -15). Solve -16 = -5v - 6, 0 = 5y + jv for y. -2 Let h be (-5 + (1 - -1))/(-1). Suppose -hz - 3 - 9 = n, 3n - 16 = 4z. Suppose 26 + 10 = 3c. Solve n = -3x, -2x - x - c = 3b for b. -4 Suppose 3z = 3l + l + 4, 5z = -5l - 40. Suppose 0j = 3j - 18. Let n be j/3(-10)/l. Solve -o = -3p - 6o + 22, 22 = n*p + o	{ "pile_set_name": "DM Mathematics" }
-15653 Convert 12223 (base 5) to base 9. 1252 -ac3 (base 14) to base 5 -32011 What is -27717 (base 9) in base 16? -4978 -572 (base 15) to base 11 -a20 Convert -17770 (base 9) to base 13. -5799 What is 1000010100 (base 2) in base 16? 214 What is -30802 (base 10) in base 16? -7852 Convert -10001110010 (base 2) to base 7. -3214 Convert 11430 (base 6) to base 4. 122022 Convert -4451 (base 6) to base 2. -10000001111 What is 71e (base 15) in base 5? 22404 1cc (base 16) to base 8 714 -100111011 (base 2) to base 4 -10323 What is -4916 (base 14) in base 2? -11000111011000 What is -17647 (base 8) in base 2? -1111110100111 Convert -11323 (base 5) to base 15. -3ad Convert -422212 (base 5) to base 9. -21248 4500 (base 13) to base 5 302013 -3222 (base 5) to base 3 -121012 Convert 1125 (base 16) to base 10. 4389 What is 22a (base 11) in base 8? 422 -214644 (base 7) to base 6 -450333 Convert 3432 (base 7) to base 5. 14443 -4304 (base 5) to base 14 -2d5 Convert -10111010111011 (base 2) to base 5. -340323 -22a3 (base 13) to base 5 -123430 124122 (base 5) to base 10 4912 ab9 (base 12) to base 15 706 Convert 11111001 (base 2) to base 4. 3321 Convert 637 (base 11) to base 3. 1001101 Convert 3f91 (base 16) to base 12. 9501 17331 (base 8) to base 3 101211111 -1096 (base 11) to base 8 -2634 Convert -136 (base 13) to base 3. -21221 1011000011 (base 2) to base 7 2030 What is -34445 (base 9) in base 5? -1213324 224434 (base 6) to base 4 10223212 What is 2332 (base 10) in base 12? 1424 Convert 54615 (base 8) to base 5. 1213200 What is 22103203 (base 4) in base 15? c791 461 (base 14) to base 8 1545 -492a (base 16) to base 2 -100100100101010 Convert -1222 (base 3) to base 8. -65 What is -426 (base 14) in base 3? -1010022 What is -a35 (base 11) in base 14? -652 What is -26251 (base 8) in base 12? -6749 Convert 1b1b (base 13) to base 9. 5533 Convert 516 (base 7) to base 10. 258 Convert -22226 (base 9) to base 7. -61023 What is -220011101 (base 3) in base 4? -10103032 -13a9 (base 15) to base 10 -4209 Convert -120221 (base 3) to base 5. -3210 100025 (base 9) to base 3 10000000212 What is -346 (base 12) in base 4? -13212 What is 431031 (base 6) in base 10? 35227 What is 22246 (base 11) in base 8? 76754 What is 1220112 (base 3) in base 5? 21031 Convert -103224 (base 5) to base 10. -3564 Convert 4 (base 9) to base 5. 4 -5675 (base 10) to base 5 -140200 Convert 42482 (base 10) to base 2. 1010010111110010 -2e9a (base 16) to base 11 -8a66 What is -111111010100 (base 2) in base 10? -4052 -94a (base 13) to base 7 -4421 334 (base 8) to base 5 1340 647 (base 12) to base 2 1110010111 Convert -8178 (base 9) to base 13. -2954 What is -2556 (base 14) in base 16? -1990 Convert -20532 (base 8) to base 6. -103310 69b (base 15) to base 4 113120 -7a7 (base 16) to base 13 -b79 What is -166 (base 7) in base 6? -241 -2650 (base 7) to base 14 -527 -23013311 (base 4) to base 2 -1011000111110101 Convert -201110 (base 3) to base 8. -1015 3203 (base 4) to base 16 e3 Convert -2502 (base 10) to base 3. -10102200 What is -13626 (base 9) in base 3? -110200220 -2322 (base 11) to base 3 -11011221 15484 (base 13) to base 16 9d8a 340 (base 16) to base 15 3a7 What is 44054 (base 8) in base 2? 100100000101100 Convert -1100101111 (base 2) to base 12. -57b 6eb7 (base 16) to base 2 110111010110111 Convert 102330 (base 4) to base 6. 5340 -10523 (base 6) to base 15 -696 Convert 4040 (base 15) to base 7. 54351 -11200121000 (base 3) to base 4 -112201332 33 (base 13) to base 15 2c What is -5164 (base 10) in base 3? -21002021 -202210120 (base 3) to base 12 -8936 Convert 11110110101001 (base 2) to base 16. 3da9 Convert -151ca (base 14) to base 10. -52510 What is -2d9 (base 14) in base 12? -407 What is -11505 (base 6) in base 7? -4643 -1c6 (base 15) to base 3 -120020 What is -14041 (base 5) in base 16? -47a 6a1 (base 11) to base 15 3ac What is -17630 (base 9) in base 15? -391c What is -2137 (base 15) in base 9? -10567 Convert 4683 (base 9) to base 10. 3477 Convert 3383 (base 9) to base 15. b20 5132 (base 7) to base 9 2405 50452 (base 7) to base 11 9216 -421 (base 9) to base 13 -205 Convert -1222202 (base 3) to base 9. -1882 Convert 11521 (base 6) to base 14. 89b Convert 15381 (base 9) to base 3. 112102201 What is 10630 (base 8) in base 9? 6154 Convert -532e (base 15) to base 6. -213242 Convert -24561 (base 8) to base 2. -10100101110001 Convert 1030322 (base 4) to base 8. 11472 101212221 (base 3) to base 16 1f00 What is -871 (base 11) in base 16? -416 Convert -1303431 (base 5) to base 8. -61623 What is -3415 (base 7) in base 5? -14422 What is 3db5 (base 14) in base 15? 3394 What is 14064 (base 8) in base 5? 144241 What is 874 (base 13) in base 6? 10411 What is -57a (base 14) in base 13? -659 Convert 621 (base 12) to base 6. 4041 665 (base 10) to base 5 10130 What is -7578 (base 12) in base 15? -3c58 Convert 1458 (base 12) to base 15. a82 What is -4b7 (base 14) in base 7? -2520 -1292 (base 13) to base 7 -10511 -153a (base 15) to base 11 -3471 Convert -1000010101111 (base 2) to base 4. -1002233 4443 (base 9) to base 10 3279 -1886 (base 9) to base 4 -112233 What is -2143 (base 13) in base 11? -3519 4bdc (base 15) to base 4 3330312 57721 (base 9) to base 11 26a15 -10c (base 15) to base 12 -179 What is 1387 (base 10) in base 11? 1051 What is 3205 (base 6) in base 8? 1325 Convert -3662 (base 8) to base 9. -2628 What is 64f (base 16) in base 5? 22430 What is 543 (base 6) in base 4? 3033 574c (base 15) to base 16 485a Convert 11221 (base 4) to base 2. 101101001 Convert -2163 (base 10) to base 13. -ca5 2248 (base 13) to base 6 34104 -43305 (base 7) to base 15 -32e0 d20 (base 16) to base 13 16b6 What is -7586 (base 14) in base 7? -113126 -c1 (base 14) to base 10 -169 What is -102221100 (base 3) in base 15? -28a3 231102 (base 4) to base 3 10222100 What is -fd6 (base 16) in base 7? -14551 -537 (base 9) to base 4 -12313 -3c6a (base 15) to base 11 -9790 1d5 (base 15) to base 12 2b5 Convert -1e9 (base 15) to base 11. -374 3aa3 (base 13) to base 6 102542 Convert 3dc7 (base 16) to base 5. 1001230 What is -2112022 (base 3) in base 7? -5243 -424102 (base 5) to base 7 -56424 Convert 3262 (base 11) to base 10. 4303 -749 (base 10) to base 15 -34e -35e (base 15) to base 4 -23330 Convert -1101001011100 (base 2) to base 4. -1221130 Convert 1764 (base 14) to base 11. 3182 What is -110011100010010 (base 2) in base 9? -40167 What is -1221121 (base 3) in base 5? -21140 What is 68c (base 14) in base 7? 3535 Convert 211112 (base 3) to base 9. 745 What is 2213210 (base 4) in base 7? 43160 What is 542 (base 9) in base 6? 2015 What is 86c0 (base 13) in base 15? 584b What is 38a (base 12) in base 4? 20122 Convert 2010011 (base 3) to base 15. 6cd What is -20 (base 5) in base 3? -101 -29a (base 14) to base 11 -440 Convert 11523 (base 8) to base 10. 4947 Convert 1465 (base 7) to base 16. 24a Convert -10211300 (base 4) to base 5. -1100200 6123 (base 9) to base 2 1000101111100 -111001000010 (base 2) to base 10 -3650 -1603 (base 12) to base 16 -a23 Convert fc38 (base 16) to base 6. 1214532 Convert -489 (base 12) to base 3. -221020 1400 (base 15) to base 14 17b5 2012220002 (base 3) to base 12 21325 Convert -2023 (base 5) to base 11. -21a -392 (base 13) to base 6 -2522 Convert 80a (base 11) to base 13. 5a3 -3101 (base 5) to base 8 -621 What is -4476 (base 13) in base 11? -7202 Convert 1540 (base 12) to base 4. 213000 What is 66165 (base 7) in base 6? 204400 -402 (base 5) to base 11 -93 Convert -20431 (base 6) to base 5. -42010 -32124 (base 6) to base 2 -1000100010100 82 (base 12) to base 10 98 What is -25024 (base 6) in base 4? -321220 What is -838 (base 9) in base 2? -1010101011 Convert de9 (base 16) to base 5. 103221 4aa (base 12) to base 14 386 51525 (base 6) to base 12 3ba5 Convert -a363 (base 15) to base 8. -103326 2a5 (base 14) to base 11 449 Convert -58b (base 12) to base 15. -3a2 15d (base 14) to base 9 340 Convert 1288 (base 12) to base 8. 4110 Convert -211020 (base 3) to base 6. -2440 Convert 2136 (base 7) to base 13. 468 Convert 2a7 (base 14) to base 8. 1033 Convert 498 (base 10) to base 16. 1f2 -764 (base 12) to base 11 -8a6 Convert 101112033 (base 4) to base 6. 1304543 -1430 (base 6) to base 11 -314 Convert -130131 (base 5) to base 14. -1ba1 -255354	{ "pile_set_name": "DM Mathematics" }
Let x(w) = w. Let s(m) = -21m + 34. Let g(z) = -10z + 15. Let h(b) = 7g(b) - 3s(b). What is h(f) + 5x(f)? -2f + 3 Let r(t) = 46t2 + 4t - 22. Let v(l) = 8l2 + l. Calculate -r(w) + 7v(w). 10w2 + 3w + 22 Let q(w) = -w*2 + w + 1. Let z(l) = -58l + 465. Let v be z(8). Let n(j) = 20j3 - 5j*2 + 4j + 4. Calculate vn(m) - 4q(m). 20m3 - m2 Let a(k) = -8872k*2 - 2k - 2. Let p(v) = -1268704v2 - 287v - 287. What is 287a(b) - 2p(b)? -8856b2 Let i(g) = 7g + 9. Let w(c) = -c. Let b be -12 - 2/4-14. What is bw(a) - i(a)? -2a - 9 Let s(f) be the third derivative of f4/4 - 5f*3/6 - 20f*2 + 10f. Let o(h) = -6h + 4. Let c = 4 - 0. Give co(x) + 3s(x). -6x + 1 Let w = 185 - 192. Let c(r) = 9r + 4. Let f be (3 - 3)(-5)/10. Let l(z) = 8z + 7 + f - 4. Calculate wl(b) + 6c(b). -2b + 3 Suppose 17z = 5i + 14z + 10, 5z - 26 = -i. Let u(y) = -y + 1. Let a(p) = 2p. Calculate ia(q) + 4u(q). -2q + 4 Let h(t) = -t. Let v(m) = 12m. Let w(b) = -24b. Let c(l) = -7v(l) - 4w(l). Let s(x) = 75x - 3666. Let i be s(48). What is ih(p) - 6c(p)? -6p Let f(o) = -10o - 6. Suppose 133 = 114b + 341 + 362. Let y(p) = 10p + 7. What is by(q) - 6f(q)? 10q + 1 Let l(g) = -g + 2. Let u(v) = 5v2 - 37v + 14. Let o be u(7). Suppose s - 15s - 714 = o. Let j(w) = -8w + 17. Calculate sl(r) + 6j(r). 3r Let h(w) = -5w*2 - 17w*3 + 20w*3 - 3w - 2w. Let v(l) = 3l*3 - 6l*2 - 6l. Let u = -519 + 513. Calculate uh(q) + 5v(q). -3q3 Let y(p) = 1. Let v(b) = -15b + 4. Suppose -2a = -5t - 34, 77t + 3a - 33 = 80t. What is ty(z) + v(z)? -15z Let b(t) = 16t*2 + 84t + 17. Let f(z) = 10z2 + 53z + 11. Let r(k) = 7b(k) - 11f(k). Let d(c) = c*2 + 3c - 1. Determine 5d(x) - 3r(x). -x*2 + 1 Let l = -1771 + 1765. Let u(x) = -7x*2 - 3x + 3. Let o(c) = -120c2 - 52c + 52. Determine lo(m) + 104u(m). -8m2 Let r(i) = -2i*2. Let u(w) be the first derivative of 4w*3/3 + 409. Calculate 5r(m) + 3u(m). 2m*2 Let c(u) = -17115u + 2. Let z(x) = 8572x - 1. Calculate -6c(l) - 13z(l). -8746l + 1 Let f(l) = -1944l + 12. Let m(y) = 1943y - 10. Give -5f(n) - 6m(n). -1938n Let o(a) = 6a + 2. Let g(i) = 19i + 7. Let d = -30 + 21. Let l(r) = -38r - 14. Let b(f) = dg(f) - 4l(f). Let n = 168 - 161. Give no(j) + 2b(j). 4j Let i(k) = -3k + 1. Let u(h) = -13h + 4. Let x be 8/(-10) - (-56)/20. Let o = -488 + 479. Determine oi(l) + xu(l). l - 1 Let n(r) = 59r + 11. Let k(s) = 12s + 2. Let p(w) = -5k(w) + n(w). Let b(y) = -5y3 + 4y*2 - 2y + 2. Determine -b(d) + 2p(d). 5d*3 - 4d*2 Let d(q) = 9q*2 - 4q - 7. Let z(w) = -1 - 126w + 8w*2 - 5 + 123w. Suppose -32 = s + 5c, -3s + 5c + 6 = 2. Give sz(y) + 6d(y). -2y*2 - 3y Let i(v) = 2v2 - 3v - 3. Let u(s) = -2s + 1. Let k(j) = -5j - 36 - 40 + 116 - 38. Let o(a) = -3k(a) + 7u(a). What is i(h) + 3o(h)? 2h*2 Let s(p) = -9p*3 - 7p*2 + 22. Let l = 3549 + -3544. Let b(v) = 14v*3 + 11v*2 - 33. Calculate lb(y) + 8s(y). -2y3 - y2 + 11 Let b(f) = 32f2 + 3f - 1. Let w(o) = -35o2 - 3o. Determine -5b(k) - 4w(k). -20k2 - 3k + 5 Let f(s) = -21s + 5. Let l(u) = 6u. Let i(a) = f(a) + 3l(a). Let g(q) = 3q - 6. Determine -5g(t) - 6i(t). 3t Let t(r) = r2 - r - 1. Let m(f) = 4f + 564f2 - 2 - 572f*2 + 3 + f. Give m(b) + 6t(b). -2b2 - b - 5 Let m(g) = -34g*2 + 15g + 43. Let f(n) = 33n2 - 18n - 53. Give 3f(o) + 4m(o). -37o2 + 6o + 13 Let x(m) = 7m2 - 2m + 11. Let f(u) = 3u2 - u + 5. Let i be (-2 - -3)/(1/(-2)). Let t be 9/(i(-3)/6). What is tf(g) - 4x(g)? -g*2 - g + 1 Let w(n) = -8458n - 2. Let f(d) = 8512d + 2. Determine 3f(s) + 4w(s). -8296s - 2 Let h(g) = -11g2 - 4g + 28. Let w(c) be the third derivative of c5/10 + c4/12 - 7c3/3 - 243c*2 - 6. What is -4h(y) - 7w(y)? 2y*2 + 2y - 14 Suppose -4o + 256 - 290 = 5w, 0 = -6o + w. Let p(u) = -u3 - 6u*2 + 5u + 1. Let q(v) = v + 1. Calculate op(b) + 3q(b). b*3 + 6b*2 - 2b + 2 Let l(d) = d*2 + 8d. Let q(y) = -32y2 - 92y - 26. Let z(x) = -5x2 - 15x - 4. Let g(r) = 6q(r) - 39z(r). Determine 2g(i) - 9l(i). -3i2 - 6i Let k = 22022 + -22016. Let o(p) = -3p2 - 7p + 12. Let t(w) = -2w2 - 6w + 11. Determine ko(g) - 7t(g). -4g2 - 5 Let g(m) = 2m*3 - 21m2 - 1439. Let h(z) = -z3 + 9z2 + 720. Determine -3g(i) - 7h(i). i3 - 723 Suppose -c + 8 = -1. Suppose -n + c = 7. Let s = -173 - -176. Let m(g) = 2g. Let v(q) = -q*2 - 2q. Give nv(z) + sm(z). -2z2 + 2z Let g(a) = 10a - a2 + 862 - 2a - 860. Let b(v) = v*2 - 7v - 2. Give 6b(r) + 5g(r). r*2 - 2r - 2 Let b(x) = -6x2 - 10x + 135. Let g(r) = -5r2 - 11r + 133. Calculate -3b(w) + 4g(w). -2w2 - 14w + 127 Let x(n) = -4n3 + 15n*2 + 4n + 8. Let a(g) = -8g3 + 29g*2 + 7g + 14. Calculate -4a(o) + 7x(o). 4o3 - 11o*2 Let c(k) = 9k*2 + 144k - 20. Let f(x) = 2x2 - x - 3. Determine -c(p) + 5f(p). p*2 - 149p + 5 Let v(f) = -f*2. Let j(g) = 215g*2 - 25g + 12. Let l(z) = 18z2 - 2z + 1. Let d(s) = 2j(s) - 25l(s). Calculate -2d(r) + 6v(r). 34r2 + 2 Let q(o) = -38o*2 - 37o. Let p(g) = 76g2 + 87g. Give -4p(x) - 7q(x). -38x2 - 89x Let y(a) = -a - 4. Let k(g) = 22g - 27. Give k(d) + 4y(d). 18d - 43 Let w = 47 + -44. Suppose 0 = n + 20. Let k(u) = 3 - 15u*2 + 18u*2 - 3 + 7u*3 + 0. Let f(o) = 48o*3 + 20o*2. What is nk(x) + wf(x)? 4x*3 Let f(c) = 1. Let o = -1 - 2. Suppose -5122r = -5111r + 11. Let m(k) = -7k*2 - 3. Determine of(d) + rm(d). 7d*2 Let p(n) = 3n*2 - 5n. Suppose 25r + 75 + 75 = 0. Let x(l) = l3 + 5l*2 - 4l - 3. Let m be x(r). Let b(f) = -2f2 + 2f. Determine mb(g) - 6p(g). 12g2 Let d(l) = 20l + 1199. Let h be d(-60). Let m(v) = v + 1. Let q(b) be the first derivative of -3b2 - 4b - 1. Determine hq(u) - 5m(u). u - 1 Let s(d) = 2d3 + 62d*2 - 6d - 8. Let w(n) = 2n3 + 64n*2 - 5n - 7. Determine -8s(q) + 9w(q). 2q3 + 80q*2 + 3q + 1 Let s(p) = -3p + 7. Let c(r) = -r - 1. Let t(f) = -14f - 827. Let n be t(-59). Calculate ns(x) - 6c(x). 9x - 1 Let r(h) = -4h*3 - 2h*2 - 5h - 2. Let g be (-146)/(-12) - 2044/1752. Let j(c) = -20c3 - 11c*2 - 26c - 11. What is gr(f) - 2j(f)? -4f3 - 3f Let h(m) = -22m3 - 46m*2 + 11m. Let i(w) = 3w3 + 8w*2 - w - 1. Calculate h(b) + 6i(b). -4b3 + 2b*2 + 5b - 6 Let a(c) = 19c3 - 6c2 + 5. Let q(r) = -35 - r3 - 21 + 30 + 25 + r*2. Determine a(p) + 5q(p). 14p3 - p2 Suppose -3f = -4d - 11 + 33, 3f + 5d - 41 = 0. Let b(z) = -z2 - z - 1. Let p(v) = -3v*2 + 3 + 3v + 3v2 + 5v*2. Calculate fp(n) + 6b(n). 4n*2 Let c(s) = 9s - 15. Let f(m) = -11m + 14. Let u(y) = -58y + 73. Let v(a) = -11f(a) + 2u(a). What is -4c(k) + 7v(k)? -k + 4 Let d(w) = 15w3 - 2w*2 + 16w - 31. Let o(r) = -6r3 + r2 - 6r + 11. What is -3d(h) - 8o(h)? 3h3 - 2h*2 + 5 Let c(f) = 2f. Let m be (-19)/(-57)(-2 + 11). Let t(z) = 3z + 1. Let o(h) = mt(h) - 4c(h). Let g(d) = -2 - d + 0d + 1. Determine -3g(r) - o(r). 2r Let z(u) = -5u*3 - 7u*2 - 7u - 13. Let i(b) = 3b3 + 5b*2 + 5b + 9. Suppose 16l + 428 + 32 = -76l. Give lz(x) - 7i(x). 4x3 + 2 Let s(x) = -4x*2 - 4x3 + x2 - 6x - 60x*3 + 65x*3 + 13x - 2. Let q(u) = 3u2 - 7u + 3. Determine -2q(v) - 3s(v). -3v3 + 3v*2 - 7v Let r(l) = -166239l2 - 4136. Let f(c) = -1933c*2 - 48. Determine -517f(d) + 6r(d). 1927d*2 Let m(x) = 3865x - 5. Let v(j) = -199047j + 258. Determine -258m(c) - 5v(c). -1935c Let l(z) = -10. Let s(j) = 7. Let p(t) = -5l(t) - 7s(t). Let b(r) = r + 37. Let f(d) = 19. Let i(n) = b(n) - 2f(n). Let o be 4/2(-2)/4. Give op(x) + i(x). x - 2 Let g(y) be the third derivative of y4/12 + 7y*3/6 + 7109y*2. Let c(s) = -s + 1. What is -5c(z) + g(z)? 7z + 2 Let b(r) = -4r - 1. Let y(u) = -u - 60. Let q(z) = 48. Let g(p) = 5q(p) + 4y(p). Determine 3b(i) - 4g(i). 4i - 3 Let l(z) = -z2. Suppose 4s = o + 1, o - 3o = 4s + 14. Let w be ((-10)/20)/(2/24). Let p(r) = -5 + 16r2 + 4 - 12r*2. Determine sp(a) + wl(a). 2a**2 + 1 Let c = 6694 - 6700. Let n(t	{ "pile_set_name": "DM Mathematics" }
z(c)). -6c2 Let g(s) = s. Let t(v) = v + 12. Let q be t(-9). Let n(h) = 0h*2 - qh2 - h2 + 2h2. Determine g(n(d)). -2d*2 Let s be ((-1 - -2) + -1)/(-1). Let l(o) = so - 3o + o. Let y(n) = -5n*2 + 0n + 0n + 4n*2. Give y(l(j)). -4j*2 Let b(t) be the second derivative of 2t*4/3 - 4t. Let q(u) = -u - 2 + 2. Give q(b(j)). -8j2 Let v(b) = 4b. Let l(i) = -i + 5. Let n(w) = -2. Let c(r) = -2l(r) - 5n(r). What is c(v(h))? 8h Let s(c) = -c - 1. Let d(x) = -2x*2 - 33. What is s(d(b))? 2b2 + 32 Let y(l) be the second derivative of l5/60 + l*2 - 4l. Let z(r) be the first derivative of y(r). Let g(h) = h. Determine z(g(b)). b*2 Let o(h) = -2h*2 + 163. Let s(m) = 2m*2. Give s(o(g)). 8g*4 - 1304g*2 + 53138 Let z = 8 + -5. Let k(o) be the first derivative of zo - 3 - 3o - 3o*2. Let i(s) = 2s. Calculate i(k(c)). -12c Let u(c) = -c. Let m(i) be the second derivative of -i3/6 + 3i. Calculate m(u(d)). d Let c(d) be the second derivative of d5/40 - d3/2 - 2d. Let j(x) be the second derivative of c(x). Let i(k) = 2k*2. What is j(i(l))? 6l*2 Let j(k) = 36k. Let i(l) = 6l2. Calculate i(j(u)). 7776u2 Let d(q) be the third derivative of q4/12 - q*2. Let k(n) = 14n*2. Give k(d(v)). 56v*2 Let x(o) = 2o + 7. Let q(l) = l + 3. Suppose -19 = 2z + 3f - 2, -2 = z - 5f. Let j(b) = zq(b) + 3x(b). Let m(v) = 3v*2. Give m(j(p)). 3p*2 Let m(s) = -s + 2s + s. Let r(l) be the first derivative of l*2/2 - 4. Calculate r(m(h)). 2h Let m(k) = 2k2. Suppose 16 = 3z + r, 23 - 3 = 5r. Let i(h) be the third derivative of -h2 + 0h + 0h3 + 0 + 1/24h*z. Calculate m(i(d)). 2d*2 Let z(f) = -3f - 9. Let l(i) = 4i2. Determine l(z(r)). 36r*2 + 216r + 324 Let v(p) = -12p. Let n(c) = 3c*2. Give n(v(x)). 432x*2 Let m(n) be the first derivative of 2n*3/3 + 54. Let a(f) = 0 + 7f - 2f - 4. Let p(d) = 14d - 11. Let h(b) = 11a(b) - 4p(b). Calculate h(m(i)). -2i2 Suppose -2b + 2 = -4. Let i(l) = bl - 2l - 6l + 2l. Let v(d) = 2d2. Give i(v(o)). -6o*2 Let b(h) = -3h. Let r(a) = 664a. What is r(b(g))? -1992g Let w(c) = 7c2 - 5c. Let q(v) = 11v2 - 8v. Let l(u) = -5q(u) + 8w(u). Let k(n) = -2n. Give k(l(g)). -2g*2 Suppose 3y - 25 = -2y. Let j(a) = 3a + ya + 0a - 4a. Let c(t) = 3t*2. Determine c(j(d)). 48d*2 Let x(m) be the first derivative of 3m*2/2 + 1. Let h(u) = -15u - 4u2 + 2u*2 + 15u. What is h(x(f))? -18f2 Let g(b) = 4b. Let u(h) = 7h2 + 3h + 3. Let x(q) = 64q2 + 28q + 28. Let a(w) = -28u(w) + 3x(w). Give g(a(n)). -16n2 Let o(u) be the third derivative of u4/12 + u2. Let s(w) = 14w - 17. Let z(y) = 5y - 6. Let i(c) = -6s(c) + 17z(c). Give o(i(r)). 2r Let j(o) = 80o2 + 80o*2 - 167o2. Let c(y) be the first derivative of y2/2 + 4. Give c(j(m)). -7m2 Let n(m) = -3m*2. Let r(u) = u - 137. Determine n(r(y)). -3y*2 + 822y - 56307 Let b(g) be the second derivative of g*3/3 + 6g. Let r(x) be the second derivative of -x*3/3 - x. Calculate b(r(p)). -4p Let j(w) = 2w2. Let k(n) be the first derivative of n2 + 6. Give k(j(r)). 4r*2 Let a(w) = w. Let u(m) = -5 - 29m*2 + 27m*2 + 5. Calculate a(u(c)). -2c*2 Let v(g) = 2g. Let c(z) be the third derivative of 0 + 2z2 + 1/8z*4 + 0z + 0z3. What is v(c(l))? 6l Let m(y) = 4y2. Let d(w) = 3w*2 + 17w*2 - 30w*2. Calculate m(d(a)). 400a*4 Let c(y) = -3y2. Let u(v) be the third derivative of v4/8 - v*2. Give c(u(p)). -27p2 Let d(h) = h. Let k(a) be the third derivative of -a4/12 - 25a3/6 + 50a*2. Give k(d(c)). -2c - 25 Let h(m) = 5m2 + 11. Let p(u) = -u2 - 2. Let k(d) = 2h(d) + 11p(d). Let i(a) = 19a*2. Determine k(i(f)). -361f*4 Let b(r) = 116r*2 - 4r + 7. Let j(v) = -2v. Determine b(j(k)). 464k*2 + 8k + 7 Let n(a) = -a. Let x(o) = 2762o. Calculate x(n(g)). -2762g Let m(w) = -12w - 678. Let b(c) = -c. Give m(b(l)). 12l - 678 Let s(m) = 2m. Let f(d) = 2d - 3504. Determine f(s(x)). 4x - 3504 Let y(h) = 2h. Let z(w) = -39w - 2. Calculate z(y(l)). -78l - 2 Let h(f) = -3 - 2f + 3. Let s(a) = -2. Let v(n) = n - 6. Let g(z) = 6s(z) - 2v(z). Calculate h(g(c)). 4c Let h(c) = -5c. Let z(r) be the first derivative of r3/6 + 3r + 2. Let q(o) be the first derivative of z(o). What is h(q(m))? -5m Let p(m) = 2m. Let l(i) = -2i2 - 2i - 66. Calculate l(p(b)). -8b2 - 4b - 66 Let t(w) = -145 - 2w + 145. Suppose -3j + 4 = -8. Let b(k) = 4k + 2k*2 - jk. Calculate t(b(v)). -4v2 Let u(o) be the second derivative of 0 + 0o*2 + 5o + 1/3o3. Let p(x) = 2x*2. Give u(p(c)). 4c*2 Let l(k) = -2k*2. Let h(j) = 23j + 6. Calculate h(l(g)). -46g2 + 6 Let j(h) = -h2. Let m(a) be the third derivative of 0a*4 + 2a*2 + 0 + 0a + 0a3 + 1/30a*5. Give j(m(t)). -4t*4 Let x(l) be the second derivative of 0 + 3l + 2/3l3 + 0l*2. Let a(c) = -6c + 5c + 0c. Give a(x(q)). -4q Let a(n) = 10n*2 + 0n*2 - 2n*2. Let s(r) = 2r*2. Calculate a(s(v)). 32v*4 Let v(i) = -8i + 3. Let q(a) = -5a. What is q(v(s))? 40s - 15 Let k(c) = 2c - 7. Let n be k(5). Let r(o) = -3o + o + 3 - n. Let j(y) = 8 - 8 - 2y2. What is j(r(i))? -8i2 Let h(n) = -n2 + 8n + 6. Let x be h(5). Suppose -5 = 4c - x. Let a(d) = -2d + cd - d. Let j(f) = f2. What is a(j(m))? m2 Let v(i) be the second derivative of -i*3/2 - 9i. Let a(l) = -4l2. What is a(v(q))? -36q*2 Let k(w) = 3w*2 - 2 + 2. Let j(s) = -14s - 1. Let f(q) = -7q. Let x(v) = 13f(v) - 6j(v). Let y(r) = r - 1. Let d(z) = x(z) + 6y(z). Determine k(d(n)). 3n2 Let v(x) be the first derivative of x3/3 - 1. Let g(u) = -u - 1. Let m(q) = 7q + 5. Let o = 6 - 7. Let s(j) = om(j) - 5g(j). Calculate v(s(p)). 4p2 Let r(a) = 2a. Let q(b) = -21119b2 - 1. Give q(r(j)). -84476j2 - 1 Let t(z) be the third derivative of z4/12 - 60z2. Let w(n) = -3n + 12. Calculate t(w(c)). -6c + 24 Let v(c) be the first derivative of -2/3c*3 + 0c*2 - 1 + 0c. Let n(f) = 16606 - f - 16606. Give n(v(g)). 2g2 Let z(t) = -2t. Let s(u) be the second derivative of -u*6/60 - 5u*3/6 - 2u. Let q(g) be the second derivative of s(g). What is q(z(d))? -24d2 Let b(x) = 70x. Let t(k) = k. What is t(b(g))? 70g Let j(n) = -8n. Let r(m) = 7m. What is j(r(s))? -56s Let x(o) be the first derivative of -o3/3 - 1. Let j(u) be the second derivative of u4/12 - 8u. Determine j(x(f)). f4 Suppose -4w + 6 = -w. Let o = w + 1. Let h(u) = -2u + 4u - ou. Let j(i) = 2i*2. What is h(j(q))? -2q*2 Let p(b) = -9b*2 - 6b*2 + 4b*2. Let n(y) = -3y*2. What is p(n(k))? -99k*4 Let l(o) = -5o*2 + 2. Let c(g) = 9g*2 - 5. Let x(b) = -2c(b) - 5l(b). Let q(r) = -r. Determine q(x(h)). -7h*2 Let t(p) = -2p. Let w(a) = -290a. What is t(w(l))? 580l Let h(y) = y*2. Let i = 0 - -2. Let j(d) = 6d*i + 20d - 20d. Determine j(h(n)). 6n4 Let t(a) = a. Let r(y) be the third derivative of y6/360 + 5y3/6 + 2y2. Let u(f) be the first derivative of r(f). Calculate t(u(p)). p2 Let k(o) = -o. Let z(t) = -5000t. What is k(z(n))? 5000n Let y(v) = 2v + 2v + 0v - 6v. Let o(l) = -3l - 2. Let i(z) = -3z - 3. Let d(m) = 2i(m) - 3o(m). Give d(y(a)). -6a Let v(d) = 7d*2. Let l(z) = -17z - 27. Determine v(l(o)). 2023o2 + 6426o + 5103 Let m(q) = q2 + 4. Let n(w) = w2 + 5. Let c(s) = 5m(s) - 4n(s). Let i(k) = -2k. Determine c(i(j)). 4j*2 Let q(g) = 11g2. Let h(s) = -s2. Determine q(h(v)). 11v4 Let s(t) = 20t. Let c(n) = -142n. Calculate s(c(g)). -2840g Let i be 0/(-1) - 5-1. Let d(x) = -i - x + 0 + 5. Let m(u) = 2u. Give d(m(r)). -2r Let d(q) = -4181 + 2q + 4181. Let f(o) = -18o. Determine f(d(t)). -36t Let f(c) = c. Let r(p) = 55p. Let s(x) = 8x. Let b(h) = 3r(h) - 20s(h). Give b(f(m)). 5m Let l(o) be the third derivative of o4/24 - o2. Let p(u) = 6u. Let w(z) = 3z. Let t = 0 + 4. Let q(s) = tp(s) - 7w(s). Give q(l(x)). 3x Let b(k) be the first derivative of 3k3 - k2 + 16. Let i(l) = -l2. What is i(b(j))? -81j*4 + 36j*3 - 4j*2 Let l(p) be the first derivative of -2p*3/3 - 272. Let t(w) = 3 - 2w + w - 3w. Let v(c) = -c + 1. Let a(g) = 2	{ "pile_set_name": "DM Mathematics" }
y ((j/j5)/j5)(17/3) assuming j is positive. j(-51) Simplify (t*(-8)t(-1/9))(43/2) assuming t is positive. t(-3139/18) Simplify (a(8/3)/a5)/((a(-3/2)a)/(a(2/3)a)) assuming a is positive. a*(-1/6) Simplify o/(o(o/(o/o*5))/o)o/o*(-11)o assuming o is positive. o9 Simplify (t0/t)/(tt4)t*(-4)/tt*(2/5)t assuming t is positive. t*(-48/5) Simplify ((xx(-1))/x)(1/4)(xx/(xx/x1))(-16) assuming x is positive. x(-65/4) Simplify p6/p(4/3)(pp/(((((pp*5)/p)/p)/pp)/p))/(p(p/((pp/((pp(-1))/p))/p))/p) assuming p is positive. p(14/3) Simplify t(-11)/t(-1/16) assuming t is positive. t(-175/16) Simplify (x(-7)/(x5x))/((x/x(-8))/x8) assuming x is positive. x(-14) Simplify (u2/uuuuu(-2))(-16) assuming u is positive. u*(-32) Simplify o(o/o*16)/ooo(-2/3) assuming o is positive. o(-44/3) Simplify gg*(-1/7)g(5/3) assuming g is positive. g(53/21) Simplify (q*(-1/3)qqq*(-1/4)q)/((q/(q/(q/q(2/7))))/q(-7/5)) assuming q is positive. q(127/420) Simplify ((i/((i/i(-2/3))/ii))/iii(-5)i)/(i*5(i*5iii)/i) assuming i is positive. i*(-50/3) Simplify (r/(r/(rr(3/16))))/(r(-3/5)r) assuming r is positive. r(63/80) Simplify mmm(mmmm/(mmm/m(-2)mm)m)/mmm*(-1)mmm/m*(-5/6)m/(mmmm(-3/11)) assuming m is positive. m(139/66) Simplify (c(-5)/(c/c(4/5)))/(c/(c/c(-2))c)(-1/15) assuming c is positive. c(-79/15) Simplify ((l(2/3))50)(-29) assuming l is positive. l(-2900/3) Simplify (r*(-3/4)/rrr/(r/(r/(rr(-3/2)))))25 assuming r is positive. r(75/4) Simplify (q(-6/13)/q)/(q/(q(-10)/q)) assuming q is positive. q(-175/13) Simplify (k/(kk(-3/4)/kkk))(-49)/((((k/(kk*(3/7)k))/kk)/k)/k1) assuming k is positive. k(439/28) Simplify t(-14)/(t/(tt*15t)) assuming t is positive. t2 Simplify ((l(-5))(-30))(1/64) assuming l is positive. l(75/32) Simplify (m(-3)mm(-2/29))/(m(-1))(7/10) assuming m is positive. m(-397/290) Simplify s*(-3/10)ss/s(-18) assuming s is positive. s(197/10) Simplify ((n/((n2/n)/n))(-15))(2/125) assuming n is positive. n(-6/25) Simplify (x1)9/(x3/(xx/(x/(x*(-1/14)x))x)) assuming x is positive. x(125/14) Simplify (jj(jj*(-2/13)/jjj)/jj3)26 assuming j is positive. j152 Simplify (m(1/34))(2/7) assuming m is positive. m(1/119) Simplify (r*(-6)/(rr/((r/(r/r*5))/r)r))/(r*(-1/6)rrr*(-2/9)r) assuming r is positive. r(-137/18) Simplify a(-17/5)a/(a(9/7)/aa) assuming a is positive. a(-129/35) Simplify ((k(-2/7))(27/2))(10/13) assuming k is positive. k*(-270/91) Simplify ((hh(1/8))/h(-3/2))(-1/44) assuming h is positive. h(-21/352) Simplify (((i/(i/(i(i(-24/5)i)/i)))/i)/i)(14/9) assuming i is positive. i(-406/45) Simplify ((t*5t)/t)(16/3) assuming t is positive. t(80/3) Simplify ((j/(j/j(-5)))/(j(-4/7)j))/(j(-7)(jj/j(-2/7))/j) assuming j is positive. j(2/7) Simplify (o(6/7)/((o(-1/6)/oo)/oo))/(o3/(((oo/((o(o/o(-2/11))/oo)/o))/o)/oo)) assuming o is positive. o(-997/462) Simplify (z/((z(1/3)zz)/zz))/((z*(-8)z)/z)(z1)(18/11) assuming z is positive. z(274/33) Simplify q10q(-11) assuming q is positive. 1/q Simplify o(4/3)(o/((((o(-3)o)/o)/o)/o)o)/o(oo/((oo*(-1/4)o)/o))/(o/(o/(oo(-1/3)))) assuming o is positive. o(95/12) Simplify (q/q(3/7))/(q2/q)(q(-2/7))0 assuming q is positive. q(-3/7) Simplify b/(b13/b)bb(-3)/b assuming b is positive. b(-14) Simplify nn/(n(2/5)/n)nnnn(-10)n assuming n is positive. n(-17/5) Simplify (o/o4o(-6/5))(18/11) assuming o is positive. o(-378/55) Simplify (x/x(-2/5))(-40)x(-2)/((x8/x)/x) assuming x is positive. x(-64) Simplify ((m(-2/7))(-2/29))(-1/5) assuming m is positive. m*(-4/1015) Simplify (mm*2mm(-5))/((m/((mm*0)/m))/mm)(2/9) assuming m is positive. m(-11/9) Simplify (d*(-6/11)dd)/((dd/(d/d(-3/8)))/d) assuming d is positive. d(161/88) Simplify r*(-1/13)r/r20 assuming r is positive. r(-248/13) Simplify (c*1c11)/((c(-6)c)/(c/c(-7/3)c)) assuming c is positive. c(64/3) Simplify (h(-1/17)h)(-32) assuming h is positive. h(-512/17) Simplify (ll*(4/11)/lll)(25/3) assuming l is positive. l(650/33) Simplify ((dd(-3/7))/(d(-2)/d))/(ddd(-1/4))(-44) assuming d is positive. d(564/7) Simplify ((n/n(1/5))/((n/(nn(-2/5)/n))/n))/((n(3/4)/nn)/(n(-2/9)/n)) assuming n is positive. n(-283/180) Simplify xx(-22/7)xx(1/17) assuming x is positive. x(-129/119) Simplify m(-19/4)(m/((mm/m45)/m))/mm assuming m is positive. m*(161/4) Simplify q(qq(-24))/qq/(q/(qq(6/7))) assuming q is positive. q(-148/7) Simplify i4/((i(2/13)i)/i)(((ii*(-1))/ii)/i)(-37) assuming i is positive. i(531/13) Simplify (v(-2/19)/(v/v(-2/13)))(-20) assuming v is positive. v(6220/247) Simplify (oo(-2))(-39)/(o/(o(-8)o)ooo/o2) assuming o is positive. o30 Simplify (rr/r*(1/18)r/((rr(2/11))/r))(-1/6) assuming r is positive. r(-547/1188) Simplify m(-1/42)/m28 assuming m is positive. m(-1177/42) Simplify (u/(u(u/u*1)/uuuu))16 assuming u is positive. u(-32) Simplify ((q/((qqq*1q)/qq))/q3)(-3/20) assuming q is positive. q(9/10) Simplify z/z(-6)zzzz(-6) assuming z is positive. z4 Simplify z26z/(z*(4/3)z)zz assuming z is positive. z*(80/3) Simplify (ww*(4/7)ww(ww(-2/3)/w)/ww)/(ww(-1/2))44 assuming w is positive. w(-401/21) Simplify (ww(-1/2))/(w2/ww) assuming w is positive. w(-3/2) Simplify ((z(-1/7)/z)/(zz(5/4)))(-10) assuming z is positive. z(475/14) Simplify l(-5)l3(l1)(2/111) assuming l is positive. l(-220/111) Simplify i(-33/2)iii(-3/4) assuming i is positive. i(-61/4) Simplify (mm*1mm(m*6m)/m)(7/4) assuming m is positive. m(35/2) Simplify (u/u(-2/5))(-2/3)/(u(1/3)/u)(23/5) assuming u is positive. u(32/15) Simplify (u/(u/(u/(u(2/3)/u)u)u))*(-9/4)((uu0)/u)(6/25) assuming u is positive. u(-3) Simplify (j/(j/(jjj/(((j/j(-4))/j)/j))))/jj/j(-36) assuming j is positive. j36 Simplify q*19q(2/3) assuming q is positive. q(59/3) Simplify ((t(1/4))(22/5))(4/11) assuming t is positive. t(2/5) Simplify (z/z*1zz(-3/8))/((zz/z*(-4)z)/z8) assuming z is positive. z(13/8) Simplify (v/v(-3))(2/25) assuming v is positive. v(8/25) Simplify (c1c)/(c18/c) assuming c is positive. c(-15) Simplify x/(x(-2)/x)xxxx4(x*(1/2)xxx)/(x/((x(-3)/x)/x)) assuming x is positive. x(17/2) Simplify ((ddd*(3/11)dd)/d)/(d/(dd*(-2))dd) assuming d is positive. d(-8/11) Simplify xx*4x/x4 assuming x is positive. x2 Simplify (v/(vv15vvv)v)/v(2/7) assuming v is positive. v(-121/7) Simplify d(-18)/(d(-14)dd) assuming d is positive. d(-6) Simplify (gg(-24))(2/67) assuming g is positive. g(-46/67) Simplify (i/i(-14))/iii(-1) assuming i is positive. i14 Simplify w*7w*(-2/39)ww assuming w is positive. w(349/39) Simplify (v/(vv/v(-18)))/(v(2/19)vvv) assuming v is positive. v(-420/19) Simplify k(-16)/(kkk(-3/16)) assuming k is positive. k(-285/16) Simplify (m/m(1/2))(-2/13)(m/m(-1/4))40 assuming m is positive. m(649/13) Simplify u(-6)/(uu9)((((uu(-6)u)/u)/u)/u)/(uuu/u*0u) assuming u is positive. u(-27) Simplify (k(2/3)/k)*(-1)k*(-6)k5 assuming k is positive. k(-2/3) Simplify d*(-1/3)/dd(-15) assuming d is positive. d(-49/3) Simplify (j(-1))(6/11)/((j/(j/j*(-2/13)))/((jj/(j/((jjj*(-5/2))/j)))/jj)) assuming j is positive. j(-255/286) Simplify y/y(-3)yy/(yy(2/5)/y)y(y0/y)(-31) assuming y is positive. y(188/5) Simplify i19i(-9) assuming i is positive. i10 Simplify ((d/(dd(-1/8)))/(dd*5dd))(-10) assuming d is positive. d(315/4) Simplify (i(i(-7)/i)/i)/(i5/i) assuming i is positive. i(-12) Simplify (w(4/9)w/w1)/(w(1/3)w(((w/(w(w*(2/7)w)/ww))/w)/w)/w) assuming w is positive. w(214/63) Simplify (((l*	{ "pile_set_name": "DM Mathematics" }
01758-7 -712306 -0.8834 times 8 -7.0672 -7.580.36 -2.7288 -346.09-0.61 211.1149 Calculate 7674-0.6. -4604.4 -8.364-6 50.184 Product of 64062 and 0.1. 6406.2 What is the product of -71 and 26.57? -1886.47 Calculate -5-181457. 907285 -0.5-0.5576 0.2788 -5362 times 103 -552286 Product of 8 and 0.05783. 0.46264 Work out 414 -0.05. -20.7 Multiply 0.03 and -0.01076. -0.0003228 What is 7.82 times -39? -304.98 Calculate 420.97-0.07. -29.4679 Calculate -320-4.25. 1360 Product of -3.544322 and 2. -7.088644 Product of -5 and 181510. -907550 Multiply -0.1028 and -31.78. 3.266984 Work out -341003 * 0.15. -51150.45 Calculate -2203-3. 6609 What is 0.04 times -1509.5? -60.38 Work out 0.36 16650. 5994 -2 times 0.117297 -0.234594 Work out 2.03 * 1990.4. 4040.512 What is the product of 42055 and 0.09? 3784.95 71100-4 -284400 What is 39006 times 0.4? 15602.4 Product of 0.5 and 0.306732. 0.153366 -0.2 -1162.7 232.54 -13318-0.4 5327.2 -8.6 342 -2941.2 5309 1545 68 times 2.1 142.8 -49 21045 -1031205 What is the product of -53 and 0.08008? -4.24424 16.8 * 105 1764 Multiply -735 and 1.551. -1139.985 -3431 * 0.12 -411.72 68654 times 6 411924 Work out 3582 * -103. -368946 Multiply 0.104 and 8593. 893.672 -0.2 * -35118 7023.6 What is 2731 times -5? -13655 -2296 times 27 -61992 -2651 times -4 10604 Work out 477 * 0.04028. 19.21356 Work out -68745.3 * 0.1. -6874.53 What is -3 times -826728? 2480184 6420 * -278 -1784760 Product of -159 and 5.87. -933.33 -34-56336 1915424 What is the product of -202 and 588.6? -118897.2 -0.388 -24 9.312 12.27-4 -49.08 What is the product of -69840 and 3? -209520 Multiply -3 and -443593. 1330779 Multiply -183 and -42.2. 7722.6 Product of -7 and -7228. 50596 What is 0.5 times -19.997? -9.9985 What is the product of -6.3495 and -0.05? 0.317475 -0.5 times -8124 4062 0.005493 -15 -0.082395 -245939 * -5 1229695 What is the product of 0.04 and -3402? -136.08 Multiply -5750.44 and 7. -40253.08 What is the product of 1177 and -0.6? -706.2 Calculate -709699-0.01. 7096.99 -5 times 108.642 -543.21 What is the product of 36.6 and -0.047? -1.7202 Work out 15 -29987. -449805 2797.9 times 0.1 279.79 Calculate 757420.1. 7574.2 Calculate -13.39-34. 455.26 Work out 0.076 * 0.35. 0.0266 What is -2 times -29615? 59230 -1 times -153064 153064 Multiply -167.2 and 4.34. -725.648 Work out 17.978 * 3. 53.934 Calculate -0.553874. -2130.7 Calculate -6915.7-4. 27662.8 What is -0.5 times -222.4? 111.2 Work out -0.03 * -60675. 1820.25 2081.4 * -2.3 -4787.22 -862 * 0.014 -12.068 Calculate 0.4-663.94. -265.576 Work out 0.2 1336. 267.2 Product of -99 and 10078. -997722 213732-0.5 -106866 What is the product of -5 and 0.04554? -0.2277 Calculate 0.053465-8. -0.42772 What is -102092 times 0.2? -20418.4 921018 * -0.3 -276305.4 What is the product of 0.0437 and -2399? -104.8363 Calculate 0.3173.4. 52.02 What is the product of 62546 and 0.05? 3127.3 Work out 0.5 -63018. -31509 -1.49 * 2430 -3620.7 Multiply -0.02 and 61672. -1233.44 What is -11.898 times 67? -797.166 Work out 34668 * 7. 242676 Calculate -0.14732. -0.2946 -26906-0.02 538.12 What is -1.3 times -3148? 4092.4 Calculate -0.0388396. -15.3648 328.83 times 0.2 65.766 What is the product of 861 and -32? -27552 What is -21.3 times -0.322? 6.8586 0.19-33257.4 -6318.906 Product of -0.075 and -7002. 525.15 Calculate 0-2040. 0 Calculate -10.5-65.37. 686.385 What is -0.8 times 0.133016? -0.1064128 -13.48 times 33 -444.84 What is the product of 34696 and -4? -138784 -0.179 * -0.18 0.03222 -0.87257 -5805.6 What is the product of -0.114 and 83.9? -9.5646 -177 0.01948 -3.44796 67673-0.3 -20301.9 61.17 0.12 7.3404 28-3729 -104412 0.8735 times 6 5.241 -6.155 -0.4 2.462 Work out 145643 * -1. -145643 What is the product of -1 and -13656? 13656 0.6-5841 -3504.6 0 0.485422 0 What is the product of 0.3 and 2.2598? 0.67794 17 * -102639 -1744863 Calculate -43.3712. -520.44 Calculate -380434-5. 1902170 Multiply 136.1 and -0.0845. -11.50045 What is the product of -14.549 and 55? -800.195 What is 250.8 times 9? 2257.2 Multiply 4.719 and -206. -972.114 Product of -9 and 1600. -14400 411.9346 47.7384 -21 63300 -1329300 What is the product of -81 and 881? -71361 -325402 -65080 -6460-3 19380 Multiply 0.312 and -75. -23.4 Multiply 52.6916 and 2. 105.3832 Calculate -5.932.4. -191.16 Calculate -0.1904-12. 2.2848 Multiply 0.11 and 19.397. 2.13367 Work out 104 * -2.014. -209.456 2.10.507 1.0647 Multiply -36.46 and -49. 1786.54 0.5 times -19038 -9519 What is the product of -45.9 and 250? -11475 What is -126024 times 3? -378072 -75 -0.2421 18.1575 Work out -11 * -54863. 603493 Multiply 4 and -0.10066. -0.40264 Product of 10528 and -659. -6937952 Product of 0.022076 and 0.3. 0.0066228 What is the product of -24038 and 3? -72114 Multiply -0.629 and -38. 23.902 Product of -8293.2 and 0.03. -248.796 24.758 * -0.4 -9.9032 What is 0.457 times 9485? 4334.645 What is the product of 8785 and 8? 70280 Multiply -53 and -213. 11289 -0.1-205970 20597 Calculate 1370229. 397358 What is -30804 times 2? -61608 -0.167.8 -1.248 Calculate 1.7417.8. 30.972 What is the product of -394 and 0.8? -315.2 Work out -2516 * -230. 578680 Product of -5.33 and -164. 874.12 8 * -270.395 -2163.16 Multiply 5 and 2216.1. 11080.5 What is 99 times 1983? 196317 What is the product of -207.06 and -17? 3520.02 Product of 0.056 and -0.19697. -0.01103032 16792 * 0.3 5037.6 What is the product of 7 and 8107? 56749 5919 * -170 -1006230 Multiply 9576 and 116. 1110816 157694-4 -630776 1.323696 -0.4 -0.5294784 Multiply 1178638 and -0.4. -471455.2 -0.7 times -57142 39999.4 53339 * 23 1226797 Product of -0.044 and 2835. -124.74 Product of 8224.8 and -7. -57573.6 Work out 5 * 15.1806. 75.903 Multiply -0.82 and 74. -60.68 What is the product of 0.22215 and 0.2? 0.04443 Calculate -4.061146. -592.906 Work out 0.4 3801. 1520.4 Multiply -7 and -18353. 128471 247 times 0.167 41.249 Multiply 130 and 0.155. 20.15 Product of 3365 and 6. 20190 Product of -0.03 and -2871.5. 86.145 Multiply -3 and 5693.5. -17080.5 Work out 0.8416 * -5. -4.208 417 * 2078 866526 Multiply -5 and 1389.8. -6949 What is the product of 0.2 and 494.3? 98.86 Work out 6911 * 0.15. 1036.65 What is 2 times -0.11426? -0.22852 Work out -1 * -137.737. 137.737 Work out 0.3 * -9895. -2968.5 What is the product of -0.029776 and 0.06? -0.00178656 -0.79 times 0.038 -0.03002 Product of 0.62 and 6.853. 4.24886 Product of -8.69 and 232.7. -2022.163 Work out -0.2 * -33.187. 6.6374 What is the product of -1.39536 and -2? 2.79072 What is the product of 0.0624 and 82? 5.1168 Calculate 710-0.08. -56.8 16540.08 132.32 What is 13 times -83425? -1084525 Multiply 1.4 and 3755.4. 5257.56 Work out -2 * -5454. 10908 Work out 6 * -43.49. -260.94 Calculate 2.34.5. 10.35 Product of -5 and 3.131. -15.655 Calculate -1200330. -360090 Calculate 310.241. 7.471 What is 0.5 times 2513.2? 1256.6 7005.1 -2 -14010.2 576 times -0.09691 -55.82016 Product of -1619 and 3. -4857 What is -58629 times -1? 58629 Work out -723605 * -5. 3618025 -277 times -0.021 5.817 Calculate -2.16952. -14599.2 Product of 558.29 and -0.04. -22.3316 Product of -4 and -0.859. 3.436 463 times 0.05 23.15 Work out -1742 0.62. -1080.04 87-0.152 -13.224 Calculate -0.1-1416856. 141685.6 Multiply -2 and 329.21. -658.42 Work out 5 * 353.1. 1765.5 Work out 0.4 * 49945. 19978 What is -10 times 2335? -23350 Calculate -19670-4. 78680 What is 5.42 times 4.06? 22.0052 What is 88.2 times -1416? -124891.2 3087 5.12 15805.44 0 * 50.207 0 -27827-3.4 94611.8 -16234 times -1.2 19480.8 -0.3 0.320077 -0.0960231 Calculate -21496-0.63. 13542.48 What is the product of 765 and 0.005? 3.825 What is -38485 times 0.3? -11545.5 Product of 0.5 and 0.06796. 0.03398 Work out -10523 264. -2778072 -0.04 * -243.55 9.742 -43 times -1648 70864 Work out -3421856 * -0.4. 1368742.4 122122 times -0.3 -36636.6 Multiply 184649.2 and 0.3. 55394.76 8 * -8215 -65720 -2 times -26.2605 52.521 Multiply 0.05379 and 0.3. 0.016137 15 times -0.40017 -6.00255 Calculate -0.126495-0.3. 0.0379485 Multiply 0.096 and -24920. -2392.32 0.1 times 0.839221 0.0839221 Work out 3 -62566. -187698 Product of 0.09 and -0.222553. -0.02002977 Multiply 1.11 and -25856.	{ "pile_set_name": "DM Mathematics" }
2r2v + ahr*2v*2 - arv2 + 2h*3r*2v*2 wrt a? 138h*3r*2v - 78v2 What is the second derivative of -2ad3u + 164ad*3 - 23adu2 + d3u2 - 2d*2u*2 wrt u? -46ad + 2d*3 - 4d*2 What is the third derivative of -248h*3 - 394h*2 - 3h? -1488 Find the second derivative of 3n2o + 2n2rz - n2r + nrz + 2nz - 3n - o wrt n. 6o + 4rz - 2r Differentiate -2i*4 - 212il - 8437l wrt i. -8i3 - 212l Find the second derivative of 11aq*3 + 2aq2 - 149aq + q wrt q. 66aq + 4a Find the third derivative of -88z6 - 178z*2 wrt z. -10560z*3 What is the derivative of -31g*4z*2 + 45g*4 - 3z*2 + 1237 wrt g? -124g*3z*2 + 180g3 What is the derivative of -d2o + 2dgo - 5dg - d + 5g + 4o - 4 wrt d? -2do + 2go - 5g - 1 What is the third derivative of -19c*4 + 68c*3 - 219c*2 + 8c - 4 wrt c? -456c + 408 Find the second derivative of 310c*3x*2 - 2c*3x - 34x wrt x. 620c*3 What is the third derivative of 10q*2u*4 - 19q*2u*3 + 5q*2u*2 + 25q*2u + q wrt u? 240q2u - 114q2 Find the third derivative of 6z*6 - 13z*4 - 14z*2 + 1. 720z*3 - 312z Find the second derivative of 164r3 + 260r wrt r. 984r Find the first derivative of -16i*4 + 5i - 497 wrt i. -64i3 + 5 What is the third derivative of -is*3y - is3 + 6is2y - 13isy + 22iy - 231s*3y - 1 wrt s? -6iy - 6i - 1386y What is the second derivative of -6h4o*2 + 21h*2o*2 - ho*2 - 7ho - 6o*2 wrt h? -72h*2o*2 + 42o*2 What is the first derivative of 95l*2z - 310l2 + 9z wrt z? 95l2 + 9 Find the second derivative of 762u*4 - 3u*3 + 2u*2 + u + 6410. 9144u*2 - 18u + 4 Find the third derivative of -35p5 + 214p*2. -2100p*2 What is the derivative of -30t*4 - 17t*2u*2 + 2u*2 - 1786u wrt t? -120t3 - 34tu2 Differentiate -2c*2k*2 + 5c*2k - 4c2y - 2c + 4k*2y - 3y wrt c. -4ck2 + 10ck - 8cy - 2 Find the third derivative of 147s*2t*4 + 4s*2t*2 - 2st4 + 14st3 + 62s + t*2 + 1 wrt t. 3528s*2t - 48st + 84s What is the derivative of 189q*3v - 6q3 + 12q wrt v? 189q3 What is the second derivative of -7d*5r - 2d5 - 2d*3 - 79dr + d wrt d? -140d*3r - 40d3 - 12d Find the second derivative of 6r4 + 33r*3 - 452r wrt r. 72r2 + 198r Find the third derivative of -3lo*5 + 37lo4 - 2lo2 - 3o*4 + 2o*2 - 10o wrt o. -180lo*2 + 888lo - 72o Differentiate d*2fj + 2d*2 + 632df - 4fj3 - 15j*3 + 144j wrt f. d*2j + 632d - 4j*3 Find the second derivative of 657c*2w*2 + 2c*2w - c*2 + 57cw + 1 wrt w. 1314c*2 What is the derivative of 3812gr - 30052r wrt g? 3812r What is the third derivative of 183r*3w*3 + 9r*3w*2 + 6w*2 wrt w? 1098r3 Find the second derivative of g3i + g3 - g2i + 152gi wrt g. 6gi + 6g - 2i Find the third derivative of -5309s5 - 4221s*2. -318540s*2 Find the third derivative of -10073b*4t*3 + 3b*2t*3 + 274b*2 - bt*3 + 2bt wrt b. -241752bt3 What is the second derivative of -288k*3 - 616k wrt k? -1728k Find the second derivative of 56f3 - f2 - 55f wrt f. 336f - 2 What is the second derivative of -iux - iuz*2 + 7iuz + iu + 2ixz*2 - ixz - 48xz2 wrt z? -2iu + 4ix - 96x Find the second derivative of 2435j2p*2 - 11jp2 + 3jp wrt j. 4870p*2 What is the third derivative of -1816t*4 - 3490t*2 wrt t? -43584t Find the third derivative of -6b4 + 8b*3 - 2b*2 - 182b. -144b + 48 What is the derivative of -6g*3 + 68g*2 - 2037 wrt g? -18g*2 + 136g Find the third derivative of -13ab*3kw2 + ab*2kw2 + 7ak - aw + 382b3w*2 - 2b*2w*2 - 3bkw - 2b wrt b. -78akw*2 + 2292w*2 What is the derivative of -46z*4 + 2z*2 + 11? -184z*3 + 4z Find the second derivative of -90z2 - 452z wrt z. -180 What is the first derivative of 307ht - 3h + 5t + 416 wrt h? 307t - 3 What is the third derivative of -5k*2z*4 - 2k*2z*2 + 66kz3 + 307kz2 - z6 wrt z? -120k*2z + 396k - 120z*3 Find the second derivative of 19h*3j*2 + 7h*3j - 2h2j - 480hj*2 - 12 wrt h. 114hj2 + 42hj - 4j What is the second derivative of -18nq*3 + 15nq2 + nq + 823n + 2q wrt q? -108nq + 30n Find the third derivative of 48k*6 + 16k5 + k4 - 110k2 - 2 wrt k. 5760k*3 + 960k*2 + 24k Find the second derivative of -29m3 - 2m*2 - 125m. -174m - 4 What is the second derivative of 23fsv*3 - 3fsv - 6fs - fv2 - sv - 2v3 wrt v? 138fsv - 2f - 12v What is the second derivative of -g*2qx2 + 2898g*2qx - gqx2 - 2gx2 - 3g + 2qx*2 - 31 wrt g? -2qx2 + 5796qx Differentiate 284xy3 - 83y*3 with respect to x. 284y*3 What is the second derivative of 490o*2y - 2oy + 138 wrt o? 980y What is the third derivative of -6a*3r*4 - 2a*3r*2s + a*2r*2s - r*4s + 41s wrt r? -144a*3r - 24rs What is the third derivative of fk5 + 4fk2 + 18fk + 3f - 4560k4 + 2k*2 wrt k? 60fk2 - 109440k What is the second derivative of -49y3 - 2y - 66 wrt y? -294y Find the second derivative of -537bj3 + b + 9gj3 - 12gj - 10g wrt j. -3222bj + 54gj What is the first derivative of 6297l - 3504? 6297 Find the second derivative of -6j*2p*2 + 2254j*2p + jp + p3 - 4p*2 wrt p. -12j*2 + 6p - 8 What is the first derivative of -804j2y*2 - 458y*2 + 2 wrt j? -1608jy2 Find the second derivative of 2925z*4 + 1839z. 35100z2 What is the second derivative of 2h*3m*3 + 2h*3m*2 - 134h*3 + 2h*2m - 47m3 wrt m? 12h*3m + 4h3 - 282m Find the second derivative of -2i3m*3 - 2i*3m + 2i2m*2 - 8i*2 - 34im3 + 42m wrt m. -12i3m + 4i2 - 204im What is the third derivative of -2a*3b*2 - 9a*3bk - 3a*2k + 2a2 + b2k - 10b2 wrt a? -12b*2 - 54bk Find the second derivative of -1583i*2 - 1629i wrt i. -3166 What is the third derivative of -59dqv3 - 2dq - 2dv3 + qv*3 - 537qv + 2v*2 wrt v? -354dq - 12d + 6q Find the second derivative of -2g*2qz - 2801g*2q + gqz + 56gq + 20gz - 1 wrt g. -4qz - 5602q Differentiate -912u*4 - 127 wrt u. -3648u*3 Find the second derivative of 3n*4q - 93n3q*2 - 300nq2 wrt n. 36n*2q - 558nq*2 What is the third derivative of 3h*5 - 3h*4 - 1174h*3u + 11h2 - 65h + 3u wrt h? 180h*2 - 72h - 7044u Find the third derivative of -87p*3x*3 + 5p*2x*3 + 6p*2x wrt p. -522x3 What is the second derivative of -2145m*3 - 1945m + 1 wrt m? -12870m What is the third derivative of -1094j*3 - 20j*2 + 2j wrt j? -6564 What is the first derivative of -2890w3 + 2w - 4451? -8670w2 + 2 Find the third derivative of -124s*2w*3 - 48s*2w*2 - 6s*2w - sw3 + 2w*2 wrt w. -744s*2 - 6s Differentiate 32w3y - 23253w3 + 101wy4 wrt y. 32w*3 + 404wy3 What is the third derivative of -56q*5 + 174q*2 wrt q? -3360q*2 Find the first derivative of 5f*2q*2y + 2f2q - f*2 + 58fqy - 88fy wrt q. 10f2qy + 2f*2 + 58fy Find the third derivative of 4o*2u*3 - 2o*2u*2 + 2o*2x*2 + 3ou2x*2 + 3u*5x - 4u3x*3 - 22u*2x*3 wrt u. 24o*2 + 180u*2x - 24x3 What is the third derivative of -303m*5 + 6m*4 - 2270m*2? -18180m*2 + 144m Find the second derivative of 5d5 + 29d*4 - 1433d wrt d. 100d3 + 348d*2 What is the second derivative of 42l*4 + 2l*3 - 179l + 1? 504l2 + 12l Find the first derivative of 7ci*2rs + ci*2s*2 - 9ci2s + 3cis2 + 27cis - crs + 64rs*2 wrt r. 7ci2s - cs + 64s*2 Find the third derivative of -80q6 - q5 + 134q2. -9600q*3 - 60q*2 Find the third derivative of -3q*2s*4 - 3q*2s3 + q2s + 22s*2 wrt s. -72q*2s - 18q2 What is the second derivative of 3a*4x + 6a2x + 3ax - 2a + 3x wrt a? 36a2x + 12x What is the third derivative of -7670z*3 - 2z*2 + 6787z wrt z? -46020 Find the second derivative of -204	{ "pile_set_name": "DM Mathematics" }
i - 2i) to the form m + di and give d. 15398 Express -64p3 - 77p*3 - 23p - 2p2 - 61 + 20p + 144p3 as z + jp + np3 + xp*2 and give n. 3 Express 141r - 3125 + 6r2 - 3r*3 - 7r*2 + 3124 as n + zr*2 + sr*3 + kr and give z. -1 Rearrange (-3 + 4 - 2)(-3 + 5n + 3) - 6 + 464n + 4 + 1325n + (-n - 3 + 3)(-2 + 1 + 2) + 2n + n - n to p + qn and give p. -2 Rearrange 5k*2 + 2k*2 - 6k*2 + (2k + 7k - 3k)(-2k + 0k - 3k) - 51k2 + 11k*2 - 30k*2 to z + vk + qk2 and give q. -99 Rearrange (p3 - p2 + p2)(-71p + 12p - 32p) + p4 - 10p*4 - 4p*4 to lp*2 + hp*4 + tp*3 + yp + r and give h. -104 Rearrange -844p - 207p - 787p + 96p - 930p to the form qp + t and give q. -2672 Express (-64 - 74 - 2o + 130)(8 - 8 - o) + 46 + 2o - 46 + 9o*2 as n + mo + zo2 and give m. 10 Rearrange -13336j - 2260746 + 2260746 to n + vj and give v. -13336 Express -t + 13t*3 + 26t*2 + 119t*2 + 5t*3 - 19t*3 in the form at*3 + gt + ot2 + j and give a. -1 Rearrange -2293i*2 + 1114i*2 + 1285 + 1183i*2 to the form y + mi + li2 and give y. 1285 Express -18x*3 - 3 - 147060x*2 + 147079x*2 - 2x + x*4 + 3 in the form b + hx*4 + mx + lx3 + wx*2 and give w. 19 Express -1 + 44m + 62m + 8m + 48m - 3m*2 + 75m as sm2 + am + x and give a. 237 Express -70 - 69 + 2849o3 - 72 + 208 - 939o*3 in the form i + vo + lo2 + po*3 and give p. 1910 Express (-2 - 1 + 1)(-1712 - 2281 + 386)(-1 + 5r + r - 3r)(4r - r - r) in the form tr + f + cr2 and give c. 43284 Express 6482c - 5597c + 4800c as i + gc and give g. 5685 Rearrange -1306o + 644o + 322o - 408o - 1665o to the form h + do and give d. -2413 Express 0 - 5 + 2875v + 2868v - 6098v in the form f + lv and give l. -355 Rearrange v2 - 737v*4 + 38 - 483v*3 + 0 + v + 494v*3 + 736v*4 to the form s + hv + wv2 + zv*4 + jv*3 and give w. 1 Express -3z*2 + 353z*3 - 116z - 1 + 305z - 2 - 189z in the form hz + rz*2 + qz*3 + y and give y. -3 Express -12n + 11n + 397n*3 + 10 - 433n*3 in the form s + zn*2 + pn*3 + jn and give p. -36 Rearrange (-1056 + 1721 - 963)(-822 + 822 + 17s) to the form ns + m and give m. 0 Rearrange 130o*4 + 136o*4 - 377o4 - o2 + 56o + o3 + 124o*4 to the form uo*4 + no + f + xo3 + ro*2 and give u. 13 Express (3 + 2 - 6)(-12 - 28k + 12) + k - 5k - k + 8k - 2k + 0k as ik + x and give i. 29 Rearrange (-3o + 0o + 2o)((1 - 2 + 0)(-2o + o + 5o) + 49o + 87o - 78o)(2o + o - o)(-3 + 1 + 4) to the form u + po + so2 + bo3 and give b. -216 Rearrange (-o2 - o*2 + 3o*2)(4o - 3o - 3o) + 1 - 3o*3 - 1 + 1333o*3 - 31o*2 - 7o*2 - 1342o*3 to io*2 + bo + t + uo3 and give i. -38 Rearrange (-46w - 536 + 536)(6w + 11w - 6w) to sw + mw*2 + g and give m. -506 Express -1136 - 1133 + 2269 - 15136k in the form z + vk and give v. -15136 Rearrange (o + 2o - o)(-2o*3 + 0o*3 + 4o*3) + 1117486o*2 - 1117486o*2 - 1650o*4 to the form go*3 + co*2 + ao*4 + h + io and give a. -1646 Rearrange (-1 + 0 - 1)(2s - 2s - 2s) + (3s + 5s + 10s)(-1447 - 1426 + 917) to i + ds and give d. -35204 Express -15a*4 - 10a*3 + 8a*3 + 18a*2 + 2 - 3a*2 + 6a - 2a - 16a*2 in the form q + ha*2 + za*3 + fa*4 + na and give z. -2 Express 216p2 - 4p*3 + 27p*2 - 4 + 1 + 10p*2 + 5p*3 in the form cp + fp3 + n + rp*2 and give f. 1 Rearrange (2i*2 - 3i*2 + 4i*2)(5260i2 + 5260i*2 - 10519i*2 + 81 + 16i) to the form vi + c + ni*2 + bi*4 + si*3 and give n. 243 Express (-c + 4c - c)(-12215c + 24490c - 31520c + 61914c + 77850c) as xc + j + gc*2 and give g. 241038 Express (1 - 4 + 5)(32644 + 8u2 - 16374 - 16565) in the form ru*2 + n + au and give n. -590 Express -3h + 321 + 622 - 1219 - 3551 - 1871 in the form yh + p and give y. -3 Express (5 - 2 - 4)(24 + 177 + 825)(-r + 2r - 2r) in the form v + zr and give z. 1026 Rearrange 1652v - 2684v + 6221v + 5414v to l + av and give a. 10603 Rearrange (-t + 2 - 2)(-1 - 1 - 1) + 612t - 2292t + 311t - 1407t + 2t - 2t + 2t to st + c and give s. -2771 Rearrange 2y*2 + 11y*3 - 10y*3 - 3y*2 - 2 - 8y*3 - 5y*3 - 12y*3 + (-2 + 6 - 1)(4y3 + 5y*3 + 2y*3) to hy*3 + cy + ly2 + m and give h. 9 Rearrange 2 - 5 + 1 + 35929k*2 - 35713k*2 to the form t + uk + fk2 and give t. -2 Rearrange (2j + 2j - 3j)(-6884j*3 - 9448j*3 + 831j*2 - 831j*2) to cj*2 + f + dj + kj3 + pj*4 and give p. -16332 Express (-114c + 83c - 87c - 74c)(2 - 2 - 5) + (-2c - 3c + 6c)(1 + 1 - 4) + 0c + 4c - c as n + zc and give n. 0 Rearrange -13t*2 + 12 - 475t + 26t2 - 11t*2 - 10 to pt*2 + mt + y and give p. 2 Express -671c + 733c + 965c + 655c as zc + g and give z. 1682 Express -q - q + 3q + (1 + 1 + 0)(q + 0q - 2q) - 2q - 4q + 3q - 3q - 5 - 2 + 6 as sq + z and give s. -7 Rearrange -107y2 - 6 + 212y*2 - 109y*2 + 46 + 2y*3 to zy*3 + py + i + my2 and give m. -4 Rearrange 1392z*2 - 5593z + 1 - 171z2 + 11185z - 5594z to the form p + sz*2 + wz and give p. 1 Express (10g - 68g + 38g + 49g)(-4g - 3g + 2g) in the form qg + p + zg*2 and give z. -145 Rearrange 3y - 5y + 0y + (-y - 2 + 4y - 4y)(536 + 52 + 68) - 2 + 2 - y to vy + l and give l. -1312 Express (-9 - 24k + 9)(-k*2 + 0k*2 + 7k*2) + 170k*2 - 170k*2 - 12k*3 as xk*2 + dk + qk3 + l and give q. -156 Rearrange -55 - 2g - 23 - 95 + 19 - 137 to q + pg and give p. -2 Rearrange -79f + 14f - 3f*2 + 57f + 58f4 + 5f + 2f3 + 0f*3 to df*2 + mf*3 + bf*4 + x + nf and give b. 58 Rearrange 10l4 - 3130l - 2l4 + 0l*2 + 0l*2 + 4l*2 + 3246l to the form ol2 + bl*3 + ql*4 + tl + p and give t. 116 Rearrange 300w2 + 16w - 2w3 + w3 - 2 - 679w*2 - 688w*2 - 18w to the form kw2 + mw + pw3 + y and give k. -1067 Rearrange (-1 + 3 - 1)(2 - 4 + 5)(1 - k - 1) + (0 + 4 - 6)(-k - 52k + 31k) + k + 3k - 5k + (-1 - 2 + 4)(k - 3k + k) to the form j + ik and give i. 39 Express 417g + 1049g - 713g + 882g + 1096g in the form c + wg and give w. 2731 Express -534x*2 - 49x + 1059x2 - 88x - 525x2 - 39x*3 in the form yx + u + cx2 + qx3 and give y. -137 Rearrange t2 - 1570 + 3486 - 1588 to st + k + wt*2 and give w. 1 Rearrange -249 - 322r*2 - 27 + 10r*2 - 114 + 303r*2 to jr*2 + c + nr and give c. -390 Express -1 + 10402f3 + 3f*2 - 10405f*3 + 17f*4 + f - 4f*2 in the form lf*3 + gf*2 + q + if*4 + yf and give g. -1 Express (-151 + 10m + 13m - 25m)(12m2 - 19 + 2m*2 + 22) as hm*2 + q + cm*3 + um and give q. -453 Express -4x + 4x + x*2 + (2x - 2x + 3x)(2x + 2x - 3x) - x*2 - 5 + 5 - 2 + 73x*2 - 579x + 579x as px*2 + q + ix and give p. 76 Rearrange -12j4 - 52j + 27j - j2 + 39j + 2j4 - 1 to the form dj*2 + gj*3 + wj + h + sj4 and give w. 14 Express 23 - b2 + 49b + 9b + 15b*2 - 23 in the form vb + db2 + t and give t. 0 Rearrange -3k + 4k - 2k + (6 - 3 - 4)(-2k - 2k + 2k) + 57k - 65 + 65 + (-63 + 63 - 14k)(-3 - 3 + 7)(0 + 0 + 2) to the form o + tk and give t. 30 Express (z3 - z3 + z3)(-3133z - 520z + 1015z) as h + gz*2 + iz*3 + az + mz4 and give a. 0 Express -591 + 1726t*2 - 3453t*2 + 1726t*2 in the form ct + mt2 + o and give o. -591 Express 30 - 6217j - 79 - 4444j + 49 in the form g + zj and give z. -10661 Rearrange 71p2 - 267p*2 + 71p*2 + 10p*3 + 0p*3 + 2p + 101p2 to hp + zp3 + fp2 + q and give f. -24 Express j2 + 90j3 - j4 + 2 + 101j*3 + 21j - 192j3 as lj*4 + zj*2 + bj*3 + pj + v and give l. -1 Rearrange -32i + 4i + 6i + 5i + 24 + 13i to the form t + vi and give t. 24 Rearrange (-b*3 - 3b*3 + 5b*3)(-3b + 5b + 0b) - 2674120 - 210b*4 + 508b*4 + 2674129 to gb*2 + xb*4 + y + ib + tb3 and give x. 300 Rearrange -1 + 48f*3 - 14f - 5 + 22f - 179f*3 - 9f to the form gf + wf*2 + x + mf*3 and give x. -6 Express ((81 - 166 + 34)(-2 - 1 + 1) + (-3 + 5 + 0)*(0 - 6	{ "pile_set_name": "DM Mathematics" }
/(-2088)114/8. Let o(i) be the first derivative of 41 + 0i*2 - mi*3 + 0i. Calculate w(o(j)). -76j2 Let q(c) = 26c. Let a(u) be the second derivative of u*4/6 - 19u*3/3 - 37u - 3. What is q(a(t))? 52t2 - 988t Let q(i) be the first derivative of 3i5/40 - i3/3 - 20i*2 + 252. Let h(d) be the third derivative of q(d). Let k(g) = -2g*2. Calculate k(h(t)). -162t*2 Let o(g) = -36124267g. Let d(u) = -u. What is o(d(m))? 36124267m Let l(r) = 136r + 128r + 0 - 266r + 0. Let w(b) = 1030b2. Calculate w(l(c)). 4120c2 Let k(o) = o2 - 14. Let u(t) = -126444t2. Determine k(u(h)). 15988085136h*4 - 14 Let h(q) = q. Let w(r) = 236r - 5. Let a(t) = 4011t - 84. Let j(i) = -5a(i) + 84w(i). Give j(h(y)). -231y Let h(o) = -4o - 45. Let a(n) = -36n - 123. Let t(r) = 41r + 164. Let d(w) = -4a(w) - 3t(w). Give d(h(j)). -84j - 945 Let h(f) = -8f2. Let s be (95/38)/(140/21). Let g(r) be the third derivative of -1 + 0r*3 + sr*4 - 30r*2 + 0r. Determine h(g(m)). -648m2 Let b(t) = 18t*2. Let j(y) = -1234352y. Calculate j(b(n)). -22218336n2 Let g(a) = -12874a*2. Let d(x) = -9905x*2 + 2 + 19796x*2 - 2 - 9889x*2. Give g(d(b)). -51496b*4 Let s(d) = -39d*2. Let p(n) = 177n + 182n + 175n - 21 + 7 - 538n. What is p(s(k))? 156k*2 - 14 Suppose 0 = 5f - 2 - 23. Let l(m) = fm2 + 3 - 3. Let j(y) = -81y - 8. Let g(x) = 40x + 4. Let a(p) = -6g(p) - 3j(p). What is a(l(v))? 15v*2 Let h(q) = -665q. Let r(f) = 10950f + 10948f - 21893f. Give r(h(g)). -3325g Let f(r) = 2567073r. Let a(s) = 67s*2 - 1. Determine a(f(y)). 441520873751043y*2 - 1 Let z(b) = -2b*2. Let i(l) be the second derivative of 0 - 4l*2 + 12l + 2/3l3. Determine i(z(c)). -8c*2 - 8 Let l(d) = d. Let h(i) = 21i*2 - 63i. Let n(o) = -15o. Let t(x) = h(x) - 5n(x). Calculate l(t(b)). 21b2 + 12b Let p(r) = -9r. Suppose 5v - 49 = -39. Let o(w) = w - 10w + vw + 2w. What is p(o(h))? 45h Let a(i) be the second derivative of i*7/1260 + 5i*4/4 - 2i - 17. Let t(c) be the third derivative of a(c). Let m(j) = 68j2. Give m(t(d)). 272d*4 Let t(r) be the first derivative of -179r3/3 - r2/2 - 954. Let x(o) = 2o. Give t(x(j)). -716j*2 - 2j Let i(j) = 2j2 - 18j - 66. Let b(x) = -5x2 + 51x + 187. Let m(f) = 6b(f) + 17i(f). Let n(u) = 1204u2 - 2. Give m(n(c)). 5798464c*4 - 19264c*2 + 16 Let m(t) be the third derivative of 0t + 0 - 14t2 + 5/6t*3 + 1/6t*4. Let x(c) = -c - 1. Let w(s) = m(s) + 5x(s). Let j(f) = -8f2. Calculate w(j(o)). 8o*2 Let g(r) = 36 - 19 + 5r - 17. Let x(o) = -89o + 16o*2 + 89o + 10o2. What is x(g(n))? 650n2 Let z = -65 + 92. Let i(x) = -x3 + 2x2 + 5x - 4. Let a be i(3). Let p(j) = -zja - 47 + 47. Let b(o) = o2. Give b(p(d)). 729d4 Let d(k) be the first derivative of k2/2 + 4433. Let y(q) = 8q2 - 518q. Determine y(d(w)). 8w2 - 518w Let g(r) = -4r2. Let k(u) = -14692u - 22. Give k(g(s)). 58768s2 - 22 Let v(r) = -2r*2 + 7r. Let y(t) be the third derivative of -t*4/6 + 15t*3/2 + 6056t*2. What is y(v(s))? 8s*2 - 28s + 45 Let s(w) = -16w + 118. Let f(o) = 17o - 105. Let y(q) = -9f(q) - 8s(q). Let j(x) = -25x2. Give y(j(l)). 625l2 + 1 Let v(j) be the third derivative of j6/360 - 7j5/40 - 23j*4/12 + 82j*2. Let q(r) be the second derivative of v(r). Let g(d) = -d. Calculate g(q(x)). -2x + 21 Let v = 10 - 11. Let q(k) = -k3 + k2. Let n be q(v). Let c(i) = 2 - 6i2 + 2i*2 - n. Let r(b) = 2b. Calculate c(r(o)). -16o2 Let u(b) be the first derivative of -21 + 0b + 11/2b2. Let n(a) = -a - 1. Let i(t) = -t2 - t - 1. Let z(l) = 3i(l) - 3n(l). Determine u(z(x)). -33x*2 Let t(n) = -17n + 56. Let c(i) = 19. Let w(z) = -6c(z) + 2t(z). Let f(h) = -3h2. Give w(f(d)). 102d2 - 2 Let a(b) = b2 + 4b - 52. Let v be a(0). Let h = 59 + v. Let k(p) = -52 + 52 - hp2. Let i(n) = -n2. What is i(k(y))? -49y4 Let f(n) = 11586494n*2. Let m(l) = 7l*2. What is m(f(u))? 939727902484252u*4 Let a(f) = 658f - 5. Let v(m) be the first derivative of -2m3/3 - 2309. Give v(a(j)). -865928j*2 + 13160j - 50 Let p(d) = 13d2 + 3d*2 + 7d2. Let c(o) = o2 - 2o + 4. Let x be c(-10). Let f(a) = -57a + xa - 68a. What is p(f(q))? 23q2 Let m(y) = -352318315y. Let d(c) = -c. What is m(d(o))? 352318315o Let g(o) be the third derivative of -161o*4/24 + 1893o*2 + 2o. Let b(j) = -9j2. Calculate g(b(u)). 1449u2 Let w(a) = a2. Let h(x) be the second derivative of -1007x4/12 + 397x - 4. Give h(w(i)). -1007i4 Let w(q) = 95658629q + 2. Let z(d) = 3d. What is z(w(s))? 286975887s + 6 Let f(d) = -d*2. Let c(h) = 9101h*2 - h + 35. Calculate c(f(i)). 9101i4 + i2 + 35 Let l(b) be the first derivative of -305b3/3 + 54. Let h(s) = 3s*2. What is h(l(t))? 279075t*4 Let p(f) = f. Let x(i) = -181i + 26480 - 26480. What is x(p(d))? -181d Let f(t) = t2 - 9. Let d(g) = -794143g. Give f(d(i)). 630663104449i2 - 9 Let b(i) = 2i + 24. Let t be b(0). Let v(f) = -16f - 26f + tf. Let c(w) = -3w*2. Calculate c(v(q)). -972q2 Let m(w) = w2. Let n(q) = -331543893q. Calculate n(m(l)). -331543893l*2 Let t(y) = -17y. Let o(l) = 6l - 12l - 1135 + 1135. Let d(j) = 3o(j) - t(j). Let k(x) = 29x - 2. Give d(k(w)). -29w + 2 Let d(p) = -410 - 581p*2 + 197 + 213. Let w(n) = -3n*2. Calculate d(w(r)). -5229r*4 Let c(d) = 568d. Let r(b) = -9b - 416. Determine r(c(z)). -5112z - 416 Let g(u) = -256u2. Let b(j) = -j2 - 254526. Determine b(g(a)). -65536a*4 - 254526 Let z(b) = 2b*2. Let u(d) = -2d - 2d - 22d + 14d + 69d. What is u(z(v))? 114v2 Let f(g) = -g2. Let o(y) be the second derivative of -y3/2 - y2/2 + y - 76. Let a(i) = 22i*2 + 30i + 10. Let r(w) = a(w) + 10o(w). Calculate f(r(p)). -484p*4 Let h(n) = 37n*2 + n. Let u(x) = 6419x. What is u(h(d))? 237503d2 + 6419d Let d(p) = 88107963p. Let c(m) = 2m. Determine d(c(r)). 176215926r Let q(b) = 236b - 173b - 75b. Let c(p) = 226p2. Give q(c(j)). -2712j*2 Let g(u) = -7168u. Let r(f) = -2469f. Calculate g(r(h)). 17697792h Let a(s) = 513s. Let y(b) = 4980b*2. Determine a(y(r)). 2554740r*2 Let k(a) = -7725 + a + 7725. Let j(n) = 1472n*2 + n - 728n*2 - 686n*2. Calculate j(k(r)). 58r*2 + r Let c be -1 + (-9 - 0)-1. Let h(f) = -8 - 6f2 + c. Let b(n) be the third derivative of n5/60 - 15660n*2. Determine b(h(t)). 36t*4 Let n(f) = -38606f. Let a(t) = -103t. Give n(a(o)). 3976418o Let k(a) = -370a. Let o(c) = -41c. Let n(m) = 4k(m) - 37o(m). Let f(i) = -964i - 970i + 1937i. What is n(f(d))? 111d Let b(f) = -29f2. Let j(i) = -172828i. Calculate j(b(w)). 5012012w2 Let q(g) = -3g. Let i(b) be the first derivative of 8b3 + 8b + 637. Give i(q(t)). 216t2 + 8 Let v(d) = d - 3. Let w(z) = 22z*2 - 90z - 11. Determine w(v(l)). 22l2 - 222l + 457 Let b(d) be the first derivative of 2d3 + 2d*2 - 3891. Let p(v) = 3v - 3v + 2v. Give p(b(k)). 12k2 + 8k Let c(z) = 1226 - z*2 + 2z*2 - 1353. Let m(r) = 8r. Calculate m(c(j)). 8j2 - 1016 Let q(y) = 8y*2 - 57152 - 57173 + 114325. Let r(m) = -1 - 22m + 1. Give q(r(b)). 3872b2 Let t(i) = -68i*2. Let s(o) = 3o*2. Let g(v) = 85s(v) + 4t(v). Let a(m) = -7m*2. What is a(g(b))? -2023b*4 Let w(g) = 113g - 4. Let i(c) = -13c2 + 11392c. What is w(i(t))? -1469t2 + 1287296t - 4 Let i(m) = -172m + 109m + 74m. Let o(c) = 3c*2 + 10. Give i(o(d)). 33d*2 + 110 Let w(l) = 12l*2. Let r(g) = -73g - 24. Let d(t) = 401t + 120. Let n(z) = 2d(z) + 11r(z). What is n(w(o))? -12o*2 - 24 Let p(f) = -10f - 1. Let s(v) = -21v + 5. Let u(h) = 12h - 3. Suppose 11y - 3 = 10y. Let q(n) = ys(n) + 5u(n). Calculate p(q(l)). 30l - 1 Let s(t) = 7t. Let h(w) be the first derivative of -2w3/3 - 1043. Give h(s(o)). -98o*2 Let f(n) = -5. Let m(w) = -w + 3. Suppose 0 = 2p - 4i - 8, 0i - 2i = 10. Let g(b) = pf(b) - 10m(b). Let k(y) = 4y*2. Determine k(g(z)). 400z*2 Let q(n) = -9n*2. Let m = -459 + 461. Let b(j) = -4j*m + 100 - 100 - 4j*2. What is b(q(d))? -648d*4 Let o(j) = 7j + 10j - 19j + 2j + 101j**2. Let i(q)	{ "pile_set_name": "DM Mathematics" }
Suppose 5 = 5c - 5, z - 5c - 74 = q. Is 21 a factor of z? True Let r = 5189 + -1961. Is r a multiple of 20? False Suppose 1061m - 60750 = 1031m. Is 27 a factor of m? True Is (-88)/16-526 - (-18)/9 a multiple of 108? False Suppose -18r + 14r + 6 = -w, 4r = -3w - 2. Let t(p) = -1 - p + 32p*2 + 2p + 4p2. Does 9 divide t(r)? True Let z(k) = k2 + 6k - k - 15 + 9k + 56. Does 6 divide z(-15)? False Suppose -19015 = -12h + 21509. Is h a multiple of 110? False Suppose -17u + 4u = -260. Suppose -25y + uy = -480. Does 32 divide y? True Suppose 12h + 20 = 8h, 0 = -i + h + 11. Suppose 2y + 1300 = iy. Is 13 a factor of y? True Is 52250/61926/1070 a multiple of 15? True Suppose -4b = 4t + 52, -35 = 3b - 2t - 6. Let y(h) = h3 + 10h*2 - 10h + 15. Let j be y(b). Does 22 divide (-9)/(-18) - (-726)/j? False Let c(i) = 2483i - 308. Is 17 a factor of c(2)? True Let c(t) be the second derivative of -3t*3 - 8t*2 - 9t. Let y be c(-10). Suppose 0 = 4u + 5l - y, -4l = u - 3u + 56. Is 12 a factor of u? True Suppose 4q + 3d + 19 = 0, 2q - 15d - 8 = -13d. Is (330/25)/(((-3)/105)/q) a multiple of 5? False Suppose -27u + 24u = 4v - 1393, -2u + 937 = v. Is 6 a factor of u? False Suppose 5f - 139 + 1339 = 5m, -5f = -m + 232. Is m a multiple of 4? False Let b(k) = -79k + 7. Let z be b(-2). Suppose 5t - 2o - 396 = 0, 5o + z = 2t + 2o. Suppose 5y - t + 43 = 0. Is y a multiple of 5? False Suppose -70501 = 16i - 46i + 10379. Is 19 a factor of i? False Suppose 276 = 4u + 2d, -3u + 207 = -13d + 16d. Suppose p = s - u, -s - 7p + 2p = -87. Does 21 divide s? False Let z(g) = g + 11. Let l be z(-16). Does 37 divide 1(116 + l + 3)? False Suppose -52a + 77 + 79 = 0. Let o(i) = 4i2 + 5 - 4i + 2i3 - 3i + i. Does 9 divide o(a)? False Let r = 147 - 36. Let q = 143 - r. Is q a multiple of 8? True Let y(d) = 357d2 + 7d + 1. Does 40 divide y(-4)? False Let c be 6 - 45/(-18) - (-2)/4. Suppose -2k + 820 = 4j, 25 = -cj + 4j. Does 70 divide k? True Suppose 5r = 5, -5r = 2s - 2 - 13. Is -3 - (-70 - (-4 - -4 - s)) a multiple of 11? False Is (-1)/(2/6) - (47152/(-14) - 20) a multiple of 107? False Suppose v = -4, 6p - 3p + 4v + 4 = 0. Suppose -5c - t = -2099, -pc - 1259 = -7c - t. Is 45 a factor of c? False Let p = -5300 - -12860. Is p a multiple of 27? True Let q = 13927 - 11654. Does 5 divide q? False Let d(m) = -38m - 8. Let x(n) = -1. Let w(k) = d(k) - 3x(k). Is w(-1) a multiple of 14? False Let t(p) = 6853p - 2747. Is 102 a factor of t(5)? True Does 5 divide 2302272/784 + (-3)/(-7)? False Let k(s) = 4s3 + 40s*2 + 7s + 6. Let l be k(-10). Is 10 a factor of (l/(-5))/(1 - (-99)/(-100))? True Let u = 65 - 65. Suppose u = -0q - q. Let b(s) = 3s + 279. Is 12 a factor of b(q)? False Let q(o) = -62o + 62. Let a be q(1). Suppose a = -4t - 5c + 1143, -5t - 5c + 584 = -841. Is 3 a factor of t? True Suppose 5i - 5w - 7 = -37, 0 = -2i - 4w - 18. Let m(x) = 10x3 - x2 - 2x + 3. Let u be m(1). Is 30 a factor of i/((-21)/u)18? True Let v be 0 + -1 + 22 - (-2 - -6). Suppose 69 = -16z + vz. Is z a multiple of 9? False Suppose -62130 = 1060y - 1064y + 2l, -4l = -2y + 31086. Does 53 divide y? True Suppose 5n + 8 = 3a - 0n, 0 = -3n - 12. Let b(h) = 22h*2 - 15h - 43. Is 14 a factor of b(a)? False Suppose -l + 2083 - 622 = -3714. Does 75 divide l? True Let g(j) = 2j2 + 219j + 14208. Does 16 divide g(0)? True Suppose 0 = -13s + 3240 + 3468. Suppose 13p + s = 14p. Is p a multiple of 11? False Let q = 3600 + -1567. Is q a multiple of 19? True Suppose o - 334133 = 176o - 1345283. Is o a multiple of 9? True Is 40 a factor of ((711765/6)/5)/(48/32)? False Is 62 a factor of ((-5804)/(-10))/(48/480)? False Let d = -1862 + 1996. Does 3 divide d? False Does 67 divide (6/1214/(-21))/(1/(-24366))? False Suppose -3k - 10 = 5. Let y(g) = g*3 + 5g*2 + 8g + 12. Let a be y(k). Let i = a + 168. Is 10 a factor of i? True Suppose -101f + 100 = -81f. Suppose fk + 2330 = -5l + 7130, 4l = -3k + 3843. Is l a multiple of 25? False Let w be (0 - 1) + 40/(-48)-6. Suppose -2a + 266 = -4l, -665 = -4a - a + wl. Is a a multiple of 6? False Is 410((-10)/2 - -8 - (-45)/(-18)) a multiple of 11? False Let l be ((-3)/(1 + -7))/((-1)/(-10)). Suppose 0b = -lp - b + 35, -3p + b = -13. Is 224/(-40)(1 - 21/p) a multiple of 2? True Let l(w) = w*3 - 8w*2 + 8w + 16. Let q(d) = 2d2 - 10d - 4. Let m be q(6). Let u be l(m). Let a = u + -18. Does 5 divide a? False Let p = -4883 - -4974. Is 2 a factor of p? False Suppose 4b + 14 = 5q - 12, 2b - 3q + 14 = 0. Is 165/(1 + b)(-54)/15 a multiple of 22? True Let f be 5/5(-1 + 3 + 0). Suppose 5x + c - 3144 = 0, 6x - 2517 = fx + c. Does 17 divide x? True Let v = -199 - -200. Is 6 a factor of (4 - 2) + v + (5 - 2)? True Is 13 a factor of (-6)/(-27) + (-1457718)/(-1026)? False Let z(f) be the second derivative of f4/4 + 13f*3/3 - 29f*2/2 + 57f. Is z(-15) a multiple of 2? True Let l = -51 + 149. Suppose 3v = -15, z - 2v = v + l. Does 25 divide z? False Let j = 12223 - 7823. Does 11 divide j? True Let w = -86 + 39. Let p be 179(0 - -1) + -2 + -4. Let s = w + p. Does 21 divide s? True Let n = 120 + -117. Suppose -2058 = -4w - 3s, ns = -s - 8. Does 55 divide w? False Let h = -135 - -40. Let g be ((-342)/h)/(592/295 + -2). Suppose 3l - g = -129. Does 16 divide l? False Let v = -90 + 94. Suppose -5o + 1388 = -vu, -4u = 5o + u - 1370. Let y = -174 + o. Does 15 divide y? False Does 3 divide 2/(-6) - (-170004)/279? True Suppose 71550 = 526p - 451p. Is p a multiple of 6? True Suppose -5p + 4u + 969 + 2955 = 0, -2p = -5u - 1556. Is p a multiple of 27? False Does 21 divide 12576936/48(-10)/(-95)? False Let a be (-9)/45 + 26/5. Suppose -4n + an = 3. Suppose u = nu - 108. Does 18 divide u? True Let r = 85804 + -57346. Does 27 divide r? True Let v(n) = -3n - 15. Let a be v(-11). Suppose -a = -f - 15. Does 3 divide f? True Let q(i) be the first derivative of 2i3 + 10i*2 + 96i + 141. Does 30 divide q(-12)? True Let z = -419 + 703. Suppose 226 + 48 = -3n - j, 3n - j + z = 0. Let w = n - -168. Is w a multiple of 15? True Let s be (8/1)/((-2382)/(-396) - 6). Suppose s = -7l + 9l. Does 11 divide l? True Is ((-13 + 12)-4267)/(1 - 0) a multiple of 40? False Suppose 0 = 29k - 5k - 18768. Suppose -15i + 2473 = -k. Is 7 a factor of i? True Let s be 2/(-7) + (-4 - 60/(-14)). Suppose 0 = 4i - 4f - 1033 + 185, -5i + 4f + 1058 = s. Does 13 divide i? False Let a be (24/9 + -2)3. Let f(l) = 15 - 3424l + 25l2 - 8l*2 + 3417l. Is 36 a factor of f(a)? False Suppose 1973z - 1988z = -47580. Is 17 a factor of z? False Suppose t - 19865 = 2s - 1397, -t - 5s + 18510 = 0. Is t a multiple of 216? False Let t = 33706 + -5366. Is t a multiple of 20? True Let d(m) = -m*2. Let q(x) = -7x*2 + 3x - 29. Let j(r) = -3d(r) - q(r). Does 90 divide j(-7)? True Suppose d - 5w + w + 115 = 0, 0 = -d - 5w - 124. Let t = -69 - d. Let r = 98 + t. Is r a multiple of 22? False Let n(i) = 4i*3 + 8i*2 - 11i + 19. Suppose -4m = 4g - 40, 2 = 2m - 5g + 10. Is n(m) a multiple of 17? True Suppose 0 = 5d - 29 - 16. Suppose 883 + 2267 = df. Is 12 a factor of f? False Let b(l) = -37l - 1. Suppose 3z + 11 = -4, g - 6 = z. Let t be (g - -1)/(-9 + 7). Is b(t) a multiple of 4? True Let y(r) be the second derivative of 47r4/6 + 3r*3 - 15r*2 - 44r. Does 16 divide y(2)? False Let h = -158 + 160. Suppose -hs - 2w + 398 = -6w, 3s - 557 = -4w. Is 17 a factor of s? False Let t = -204 - -1121. Let i = t + -742. Does 25 divide i? True Does 86 divide (122024/(-280))/((-1)/15) + 1/(-1)? True Suppose 0m = 8m - 136. Let i = m - -43. Suppose -i = -8t + 2t. Is t a multiple of 3? False Let h(g) be the second derivative of 2/3g*3 + 0 - 8g + 11g2. Does 15 divide h(17)? True Let i(q) = -1 - 257q + 128q + 132q. Let t be i(1). Suppose 2s - 2y = 5s - 37, y - t = 0. Is 11 a factor of s? True Let w(x) = 8x*2 - 3x*3 + 42x*2 + x - 10 + 3x*3 - 2x*3. Let y(g) = 3g - 32. Let p be y(19). Does 2 divide w(p)? False Let z = 1754 - -1166. Is z a multiple of 10? True Let c = 0 + 0. Suppose 65*k - 413 = -218. Suppose r - 29 = w, r	{ "pile_set_name": "DM Mathematics" }
f*2 to the form y + zf*2 + qf and give q. -6 Express (81f - f2 + 1 - 81f)(4 - 1 - 4) - 149f*2 + 4f*2 - 202f*2 in the form bf*2 + m + tf and give m. -1 Express (m - 2m + 3m)((-7 + 3 - 2)(0 - 1 + 2) - 4 + 4 + 3 + (-2 + 1 - 4)(-4 + 5 - 2)) as d + zm and give z. 4 Rearrange 5044g - 8969g + 4502g to l + kg and give k. 577 Express 168j2 + 151j*2 + 2j*3 - 3 + 90j - 313j2 as uj + sj3 + y + kj*2 and give s. 2 Rearrange -2823h*2 - 2801h*2 + 5667h*2 - 10h to the form s + vh2 + zh and give v. 43 Express (-c*3 + 4c*3 - 2c*3)(-511128 - 7471c + 511128) in the form rc*3 + dc*2 + fc*4 + mc + n and give f. -7471 Express 2u + 0u + 0u + ((-3 - 3 + 5)(-3 - 3 + 5) - 1 - 3 + 2)(-u + 15u - 77u) + (-2u + 2 - 2)(-1 - 2 + 2) as m + du and give d. 67 Rearrange 215r2 + 30r - 217r2 - 23 + 5 to wr + yr2 + k and give w. 30 Rearrange (-3 - 2 + 3)(3 + 3 - 5)(1 + 3 + 1)((0g - g + 2g)(1 + 2 - 5) + 97g - 49g - 44g) to m + ag and give a. -20 Express -2970g + 1841g + 2640g + 7357g as yg + f and give y. 8868 Rearrange -26g4 + 13g*4 + 5g*4 + (0g2 - 1 + g2 + 9)(7g*2 + 3g - 3g) to zg*4 + ig*3 + u + hg + lg2 and give l. 56 Rearrange (45 + 30 + 7)(84m - 32m + 78m)(5m3 - 5m3 + m3) to y + vm2 + am*3 + bm + um4 and give u. 10660 Rearrange -666a + 331a + 0 + 9a*3 + 335a - 8 + 14a2 to the form w + ma + ta3 + xa*2 and give w. -8 Express -2 + 4c + 2c4 + 3436c*3 - 7239c*3 + 2c*2 + 3377c*3 in the form w + xc*3 + fc*4 + jc*2 + mc and give j. 2 Express (3s - 75s - s)(-27s*2 + 103s*2 - 34s*2) as xs*3 + ns*2 + gs + r and give x. -3066 Rearrange 276p2 - 910p + 399p + 511p to wp + sp*2 + k and give s. 276 Rearrange 9t - 10 + 10 + (-3 + 3 + 2)(2t + 2t - 5t) - 3t + 0t + t - 4t + 3t + 0t + 380t + 320t - 492t to the form q + zt and give z. 212 Express (0 + 0 + p)(-21 + 5 - 18 + (11 + 8 + 3)(3 - 6 + 0)) as n + sp and give s. -100 Express 6c + 4156c*2 - 349c*2 + 479c*2 + 11c - 18c as hc + wc2 + a and give h. -1 Express 13034 - 905v + 13040 - 26074 as gv + j and give g. -905 Rearrange 61v + 3 - 76v - 42 - 7 to x + mv and give x. -46 Express (-2s2 + 3s*2 - 2s*2)(3 - 5 - 15) - 92s + 92s - 8s2 in the form us*2 + gs + i and give u. 9 Express (g - 15g + 11g)(-117g + 18889 - 18889) as t + lg + ng*2 and give n. 351 Rearrange -132m*2 - 17m + 3m - 5 + 8m + 4m + 222m*2 to l + jm + xm2 and give j. -2 Rearrange 7929y*2 - 2644y*2 - 2639y*2 - 2649y*2 + 1831y to the form o + vy + dy*2 and give d. -3 Express 34t - 442 + 38t - 47 - 71t in the form m + ht and give m. -489 Rearrange -4 + 3 + 55y*3 + 2y - 109y3 - 360y*2 + 53y*3 to qy*2 + l + zy*3 + uy and give u. 2 Rearrange -72203w2 + 3w*4 + 2w*4 + 72205w*2 + 12w to the form mw2 + zw*4 + bw + k + fw3 and give z. 5 Express (3567 + 65n - 3567)((-3n*2 + 2n2 - n2)(-4n - 3n - 2n) + 2n2 - 2n2 + n3) as dn + h + kn*2 + gn*4 + wn*3 and give g. 1235 Express (-h + 6h - 9h + (-1 - 1 + 0)(9 + 11h - 9))(-1 - 3 + 7)(0 + 3 - 1)(1 - 1 + 2)(-4 + 0 + 2) in the form wh + t and give w. 624 Rearrange (7 - 3 - 1)(-2x + 2x - 2x) + (-2 + 5x + 2)(3 + 5 - 3) + x + 6x + 0x to the form q + ox and give o. 26 Rearrange 142r*3 + 2r*4 + 1 - 19r*4 + 6r*4 - 61r*3 + 13r*4 to b + yr*2 + ar + fr4 + xr*3 and give f. 2 Rearrange 4f - 14183f2 + 8177f*2 + 2195f*2 - 4f to the form l + if2 + af and give i. -3811 Express -1139n - 10058n - 18745n + 194n in the form fn + i and give f. -29748 Rearrange (-3 + 7 + 1)(1 - 4 + 0)(1 - 1 - 2)(967 - 967 - 188v) to the form i + gv and give g. -5640 Express (0 + b + 0)(-21 + 45 - 32) + b - 7b + 0b - 5b + 4b - 7b in the form l + nb and give l. 0 Express 25 + 2r*3 + 50r2 + r2 - 58r2 as ir*3 + xr*2 + v + qr and give x. -7 Rearrange (6 + 8o - 6)(1 + 0 + 1)(7o + o - 4o)(-5o + 4o + 2o)(-3 + 1 - 6) to the form to + ho*3 + qo*2 + n and give h. -512 Express (0 - 3 + 7)(5w3 + 4w*3 + 2w*3) + (10w + 39 - 39)(2w + 3w + 0w)(w - 5w + 2w) in the form aw*2 + rw*3 + fw + x and give r. -56 Express 0u4 - 2u*4 - 3u*2 - 34u*3 - 7u - 29u3 + 69u*3 in the form mu*4 + v + ru + ju2 + au*3 and give m. -2 Express -13852x + 47257x - 21988x - 19338x in the form g + mx and give m. -7921 Express (-272l + 364 - 364)(l - 5 + 5 + (-l + 2 - 2)(-5 + 0 + 4) + l - l + 2l) in the form f + tl2 + kl and give t. -1088 Express -29261 + 14627 + 1329t + 14634 as vt + g and give v. 1329 Rearrange -4681o2 - 137 - 42 + o + 179 + (o2 + 2o*2 + 0o*2)(2 + 2 + 0) to io + so*2 + n and give i. 1 Express ((-4 + 2 + 3)(-6i + 2i + 3i) + 4i + i - 3i + 4i - i + 6i)(-115 + 30 - 46) as ui + z and give u. -1310 Express (0q - 5q + 0q)(1912 - 1135 - q2 - 1340) as yq*2 + bq*3 + xq + z and give x. 2815 Rearrange -2x3 - 4983x*2 + 1596x*2 + 1289x*2 + 876x*2 + 5x*3 to the form sx + zx2 + cx*3 + f and give z. -1222 Express -7z*2 - 308z + 2z2 - 305z + 9z2 - 9z*2 in the form p + xz + qz2 and give x. -613 Express 46c*3 - 54c*3 + c - 127c3 - c2 - c - 6 as bc + k + qc*2 + oc*3 and give k. -6 Rearrange 2784g - 7 + 11 - 4 to the form i + lg and give l. 2784 Rearrange 3246899b - 25 + 71b2 - 246b*2 + 9 - 3246898b to rb + cb*2 + d and give c. -175 Express -24r*3 + 1 + r - 33r*3 + 54r*3 + 3r*2 as fr*3 + br + vr2 + o and give b. 1 Rearrange -370 - 5g3 - g2 + g*2 + 371 + 3g*2 - 14g + 0g3 to q + sg*3 + tg + jg2 and give s. -5 Express (m + m - m)(-4m2 - 6m*2 + 9m*2) + 2m*2 + 2m*3 + 20 - 22 + 3m*2 in the form am + vm2 + fm*3 + y and give a. 0 Rearrange 1404r*2 + 2 - 2689r*2 + 0r + 1441r2 + 0 - 2r to the form y + wr2 + hr and give h. -2 Express -10450a2 - 4356a*2 - 13 + 7 + 6 in the form l + da*2 + oa and give d. -14806 Rearrange -134t2 + 1930t - 142t2 + 277t*2 + 3038t to the form ot + mt*2 + z and give o. 4968 Express -540f + 1817f + 422f in the form if + m and give i. 1699 Express 2372y + 1663y - 6657y as dy + h and give d. -2622 Express -2w*2 - 829w*3 + 125w*3 + 2w*4 - w - w + 259w*3 - 1 in the form cw*4 + uw*3 + dw*2 + m + pw and give c. 2 Rearrange 317 - 631 + 538f3 + 316 to the form nf + yf2 + b + pf*3 and give b. 2 Rearrange (1 - 2 - 3)(-8434h + 16868h - 763 - 8439h) to w + lh and give l. 20 Express (1176i3 - 364335i + 364335i)(0 + 5i - 2 + 3) as mi*4 + ni + ti3 + si2 + f and give m. 5880 Rearrange (-z2 - 19z2 + 2 + 69z*2)(4 - 2 + 6)(-9 + 2 + 1) + 23z - 23z + 9z*2 to the form dz + n + sz2 and give d. 0 Rearrange -156 - 33y + 156 - 4y + 2y - y + (y + 3y - 3y)(-3 - 2 + 3) + 8y - 4y + 12y to ly + w and give l. -22 Rearrange -4p + 126 - 4p - 7p + 4p - 3p to the form d + qp and give d. 126 Rearrange (-87 - 24 - 224 - 98 - 49)((0 + 6 + 4)(i + 2i - 4i) + 2i + 2i - 7i) to n + ki and give k. 6266 Rearrange (-1 + 1 + 1)(3 + 1 - 3)(-69x*3 - 308x + 308x) + 7x*3 + 3x*3 + 2x*3 to the form ix*3 + kx + a + dx2 and give i. -57 Express -2o + 1 - 2o4 + 1 - 10831389o*2 - 9o*3 + 10831412o*2 in the form y + io*2 + po*4 + mo + no3 and give i. 23 Rearrange 52l*3 + 2l*4 + 55l*3 - 152l*3 + 2 + 58l*3 - 3l + l*2 to w + hl*2 + kl*4 + cl + ul3 and give w. 2 Rearrange (-1 + 0 - 1)(25874g4 + 3429 - 3429) to the form tg + jg2 + bg*4 + yg*3 + a and give b. -51748 Express (18u*2 - 16u + 16u)(-1 + 3 - u + 3u) + (-4u + 0 + 0)(-38u*2 + 27u*2 - 15u*2) in the form ku + wu3 + hu*2 + p and give h. 36 Express (0 - b + 0)(332081b + 940b*2 - 332081b) in the form nb2 + gb*3 + c + xb and give g. -940 Express -5o2 - 105o*3 + 302o*3 - 2o + 534442 - 534441 + 4o as v + ko*3 + go*2 + wo and give g. -5 Rearrange 28s2 - 30s*2 - 88s + 27s + 28s + 34s + 699 to the form ls + y + ns*2 and give l. 1 Express 257 - 536 +	{ "pile_set_name": "DM Mathematics" }
1). Let x = p - -4. Let q be 6(x/4)/1. Sort q, -5, 0 in increasing order. -5, 0, q Suppose -4o - 17 = -1. Suppose 5x + 12 = 3l, 5l + 4x - 9x - 20 = 0. Sort o, -1/2, l in descending order. l, -1/2, o Let l = 0.9 - -0.1. Let k = -164 + 159. Sort k, l, -2 in increasing order. k, -2, l Let j = 40 - 35. Sort 4, 0.3, j in decreasing order. j, 4, 0.3 Suppose -5b = -3b - 6. Suppose 0 = -l - bl + 16. Suppose 2q + 3q + n - 26 = 0, -3n + 13 = 2q. Sort -2, q, l. -2, l, q Let m(g) = -2g - 26. Let o be m(-14). Sort o, 1, -1 in ascending order. -1, 1, o Let r be (-2)/(-5) + (-7)/(-70). Put r, -0.4, -2 in decreasing order. r, -0.4, -2 Let o = -37 + 36. Suppose 5p + 17 = 4x - 10, -3p - 15 = -2x. Sort p, o, 5 in ascending order. p, o, 5 Suppose -16 = -3f + 5. Suppose -fk + 2k = -10. Put -5, k, 0 in decreasing order. k, 0, -5 Let j = -1.01 + 0.01. Put j, -5, 1/2 in decreasing order. 1/2, j, -5 Let g = -8/31 + 118/217. Sort 2/9, 2, g in decreasing order. 2, g, 2/9 Let p = -1.7 - -1.68. Let z = 0.08 - p. Sort z, 0, -2/15 in decreasing order. z, 0, -2/15 Let k(s) = s*3 - 4s*2 - 4s - 4. Let t be k(5). Let a be 0/(-13 - -1). Put 3, t, a in increasing order. a, t, 3 Let b = -0.84 + 0.7. Let f = b - -0.04. Let u = -104 - -727/7. Sort 2/3, u, f in ascending order. u, f, 2/3 Let z = 23 + -30. Sort z, -2/3, 0, -1 in decreasing order. 0, -2/3, -1, z Suppose -2b + 4 = 0, 4b - 56 = -2m - m. Let g = m - 97/6. Sort g, 1/2, 0.4 in descending order. 1/2, 0.4, g Let y = 0 + 0.5. Let s = -493/4 + 124. Sort -5, y, s. -5, y, s Let p = -14 - -14.5. Put 9, p, -2 in increasing order. -2, p, 9 Suppose w = -2 - 0. Let x be 1/3 + (-14)/(-3). Sort x, w, -8. -8, w, x Let d(o) = -o*2 + 9o - 12. Let u be d(8). Put 1/8, 0.02, u in ascending order. u, 0.02, 1/8 Let b(s) = -3s2 + s - 1. Let n be b(7). Let j = n + 1267/9. Put 4, 1, j in decreasing order. 4, 1, j Let p be 3/(-18)15. Let r = -3 + 2. Let a = -0.5 - r. Sort -1, p, a in ascending order. -1, p, a Let r = 3 - 3.2. Let p = -4 + 4. Let y = p + 1. Sort y, r, 0. r, 0, y Let t = 8.06 - 8. Let v = t + -5.06. Sort -3/4, 1, v in decreasing order. 1, -3/4, v Let d = 25 + -25. Let w = -4 - -2. Sort 4, d, w in ascending order. w, d, 4 Let j = -10 - -6. Suppose 3 = 5z - 12, 0 = h - z + 4. Put j, h, -3 in descending order. h, -3, j Let q = 50 + -49.08. Let p = 0.12 - q. Sort p, -1, -4. -4, -1, p Let b be (0/2)/(11/(-1)). Let x = -2 - 2. Sort b, 2, x in descending order. 2, b, x Suppose -5v - f + 6 = 0, 3v - 22 = -2v + 3f. Sort v, 0.2, 2/9 in decreasing order. v, 2/9, 0.2 Let c be 5(2 - 1) - 1. Let l be (-2)/(1c/2). Put 0.1, l, 1 in increasing order. l, 0.1, 1 Let p = 2 + -3. Let y = 1 + p. Suppose 8a - 41 + 9 = 0. Put y, 5, a in descending order. 5, a, y Let n = 29/19 - 1/38. Sort 2/11, 1/2, n. 2/11, 1/2, n Suppose -4b = -3i - 34, 68 = -5i - 0b + b. Let p be (2 - (-72)/i) + 3. Sort p, 4, 0 in ascending order. p, 0, 4 Let y be 2 - 3 - (7 + -10). Sort 4, 5, y in increasing order. y, 4, 5 Let k be (-1)/(-2)-2 - -1. Suppose 2o + 2p = -7 - 3, -2o - 4 = -p. Sort 1, k, o in ascending order. o, k, 1 Let r = 0 - -0.5. Let p = 5/46 - 177/782. Let i = 179/6 - 30. Sort p, r, i in ascending order. i, p, r Let a(r) = r*2 - 5r + 1. Let i be a(3). Put i, 0.5, -4 in descending order. 0.5, -4, i Let b = 17 + -14. Suppose 0 = s - 4s - b. Sort 1/4, s, -2 in ascending order. -2, s, 1/4 Let k(u) = -u3 - 7u*2 - 8u - 9. Let f be k(-6). Let b be 12/(-16)1/(-3). Sort -3, f, b in ascending order. -3, b, f Let y = -90 - -88.7. Put y, -1/2, -0.2 in descending order. -0.2, -1/2, y Suppose 0 = -8g + 35 - 27. Put 25, g, 3, 5 in decreasing order. 25, 5, 3, g Let j = -2132/15 + 142. Let p be ((-16)/10)/(2/(-5)). Suppose 2s - 5f = 14, f = -s + 2s - p. Put j, s, 1/3 in ascending order. j, 1/3, s Suppose 1 = i - 0. Suppose 0 = 2s + i - 7. Let g = 11 - 7. Sort 2/9, g, s. 2/9, s, g Let j be (-1)/(-2) + 5/(-2). Let o be 24/14 + (-4)/(-14). Sort 4, o, j in decreasing order. 4, o, j Suppose 2 = p, -5g - 4p = p + 175. Put g, 0, -4 in ascending order. g, -4, 0 Let h = 1 - -1. Let c be 284/(-700) - (-4)/14. Let a = c + 37/100. Sort a, -0.03, h in decreasing order. h, a, -0.03 Let w = -78 - -80. Put 2/3, 3, w, -4 in decreasing order. 3, w, 2/3, -4 Let c = 0.5 + 0. Let a = 0.6 - c. Let p = -0.5 + 0. Put a, p, -5 in increasing order. -5, p, a Suppose 3k - 2i = 14, -k = 4k - i - 21. Suppose -2f - 6 = -4t, kf + 4t - 7 = 5f. Sort -3, 2, f. -3, f, 2 Let k = 23 + -28. Let b(g) = 2g - 5. Let i(v) = v - 6. Let d(f) = 3b(f) - 4i(f). Let c be d(-6). Sort k, -4, c in increasing order. k, -4, c Let h = 24.97 - 25. Suppose 5i + 20 = i. Put i, h, -1 in decreasing order. h, -1, i Suppose 0 = 4b - 5u, -b + 0u = 4u - 21. Suppose -bl + 3l = -2. Put 4, l, -4 in decreasing order. 4, l, -4 Let d(y) = y*2 + 8y - 3. Let p be d(-9). Let s = p + -5. Put s, 4, 3 in descending order. 4, 3, s Let m(i) = -i*2 + 7i - 2. Let x be m(6). Sort 1, 0, x in ascending order. 0, 1, x Let d = 0.22 - 0.22. Put -5, 1, 3, d in decreasing order. 3, 1, d, -5 Let w = 3 - 19/6. Sort -1/3, -24, w, 0.1 in increasing order. -24, -1/3, w, 0.1 Suppose -6t + 10 = -t. Suppose 3f = -t - 4. Sort -5, f, 5. -5, f, 5 Let h = -13 - -22. Let p = 9.4 - h. Put -0.4, -4/7, p in ascending order. -4/7, -0.4, p Suppose 0 = -r - 2b + 7, -b - 4b + 25 = 4r. Let k = 672 + -675. Sort k, -4, r in descending order. r, k, -4 Let u(j) = j2 + 6j + 7. Let i be u(-5). Suppose 0 = ix + x. Let y be (-12)/(-44)3 - (-6)/33. Sort 2, y, x in ascending order. x, y, 2 Let j be -4 + (-4 - -4) - (-1 - 4). Put 3, -4, j, -1 in decreasing order. 3, j, -1, -4 Let g be 18/(-45)1-5. Let f be ((-6)/12)/((-1)/g). Suppose 2p + f = 3p. Put -2, p, -5 in decreasing order. p, -2, -5 Let w be 43/9 + 8/36. Suppose 2p = 3x - 3p + 17, -5p + 15 = -5x. Let i be (2 - (-3 + 1))/x. Put i, w, 2 in increasing order. 2, i, w Let a be (1521/798)/(2/(-16)). Let l = 106/7 + a. Let k = -1/4 - 5/12. Put k, 0.3, l in descending order. 0.3, l, k Let s be 11/(-4) - 51/(-17). Sort 0.01, s, 0.2 in decreasing order. s, 0.2, 0.01 Let k be (4/(-12))/(7/6). Let s = -6.01 - -0.01. Let g = 5 + s. Put k, 5, g in decreasing order. 5, k, g Let a be (-32)/(-30) + 10/(-25). Suppose 4c - 2c - 8 = 0. Suppose -cl = -2l. Sort a, -1/2, l in increasing order. -1/2, l, a Suppose o - 10 = b, 9o - 4o + 4b = 59. Put 4, o, 3 in increasing order. 3, 4, o Let y = 1 + 1. Let p = 193 - 189. Let z = -8 - -5. Put y, p, z in decreasing order. p, y, z Suppose -2w + w = -4c + 13, -4c - 3w + 9 = 0. Let k be ((-2)/(-3))/((-14)/6). Let r = -0.2 - 0.3. Put k, r, c in ascending order. r, k, c Let u be (-2)/(-10) + (-3)/15. Put u, 5, 8 in descending order. 8, 5, u Suppose 0 = -h - 8 + 12. Let u be (h - 3)/((-10)/4). Put 0.2, -2/3, u in ascending order. -2/3, u, 0.2 Let t = -405/4 + 101. Sort -2/9, -8, t in decreasing order. -2/9, t, -8 Let r(u) = u*3 - 4u*2 + 4u - 1. Suppose 4p - 2 = 2p. Let q be p + (-3)/(-1) - 1. Let j be r(q). Put -2, j, 0 in decreasing order. j, 0, -2 Suppose -2 = -2q - 3g, g + 14 = 2q - 2g. Sort -3, q, 2/7. -3, 2/7, q Let c = 0.4 + -0.3. Sort c, 5/2, -2/7 in descending order. 5/2, c, -2/7 Let n(h) = h*2 + h - 1. Let v be n(1). Suppose 0 = a + 7 - 3. Let y(b) = 2b + 5. Let p be y(a). Sort 0, v, p. p, 0, v Let a(r) = -5r. Let m be a(1). Let v(u) = u3 - 8u*2 + 8u - 5. Let c be v(7). Put c, m, -1 in ascending order. m, -1, c Let q(m) = m*3 + 7m*2 - 10m + 1. Let i be q(-8). Let c = -16 + i. Sort c, 6, 3 in descending order. 6, 3, c Let z = 0.18 + -0.05. Let m = 0.37 + z. Sort m, -2, -9. -9, -2, m Suppose u + 11 = 2k, 0 = 3u - 0k + 2k + 1. Let j = 8 - 10. Put -6, j, u in ascending order. -6, u, j Let b = -6 + 2. Suppose 5o + 3h = -28, -6o + 3o - 10 = -5h. Let y = o + 2. Sort y, 2, b in ascending order. b, y, 2 Let v(n) = -5n3 - n2 - n - 1. Let x be v(-1). Suppose 5r + 15 = -0r. Sort 0, x, r in increasing order. r, 0, x Let w = 21.7 + -22. Sort -0.07, 0.2, w in ascending order. w, -0.07, 0.2 Let m = 1.3 + -1. Let a = -25 - -29. Sort a, -2, m in descending order. a, m, -2 Suppose 3q = -f + 5 + 9, 0 = 5q + 4*f - 28. Let l = 2 + 0. Sort -2, q, l in ascending order. -2, l, q Sup	{ "pile_set_name": "DM Mathematics" }
ich is the smallest value? (a) 7/8 (b) -5 (c) 1 (d) -3 (e) 2 b What is the third smallest value in 0.1, -0.2, 1, 19? 1 What is the third biggest value in 0.5, 0.17, 0? 0 Which is the third biggest value? (a) -1/10 (b) -3/37 (c) 4 a What is the third biggest value in 9.5, 0, -3, -2/7? -2/7 Which is the third smallest value? (a) 0.07 (b) 17 (c) 5 b What is the third biggest value in -9, -1, 1.5? -9 Which is the smallest value? (a) 1 (b) 5 (c) -4 c What is the third smallest value in -6, -3, 2/9? 2/9 Which is the third smallest value? (a) 27138 (b) 0.3 (c) -3/7 a What is the fifth smallest value in 10, 14, -1/6, 0, -1/7? 14 Which is the third biggest value? (a) -0.4 (b) 1/2 (c) 2/3 a What is the second biggest value in -34, -17, -1? -17 Which is the third biggest value? (a) 5 (b) -12 (c) -1/2 (d) 0.2 c What is the fourth biggest value in -77, 1, -5, 1/4, 4? -5 What is the fifth biggest value in -2/3, 1/5, -0.2, 4, -25? -25 Which is the third smallest value? (a) 47 (b) 1/4 (c) -0.3 a Which is the third biggest value? (a) 0 (b) 2/245 (c) 4/7 a Which is the smallest value? (a) 138 (b) -4 (c) 1 (d) -3 b Which is the third biggest value? (a) -2 (b) 1/2 (c) 37 (d) -2/3 d Which is the smallest value? (a) -59 (b) 2/19 (c) -3/2 (d) -0.11 a Which is the second smallest value? (a) 0.1 (b) 3 (c) -3/10 a Which is the second smallest value? (a) -1/8 (b) -4.2 (c) 0.03 (d) -0.4 d Which is the second biggest value? (a) 0 (b) -3/14 (c) 4/7 a Which is the second biggest value? (a) 3/2 (b) 0.05 (c) -0.7 (d) 3/8 (e) 0.5 e Which is the third smallest value? (a) -0.3 (b) -2 (c) 3/65 c Which is the smallest value? (a) -2/109 (b) -48 (c) -5 b What is the second smallest value in -2/5, 5, -25, -1/7, 0.3? -2/5 What is the second smallest value in -4, 4, 2.56, -1? -1 Which is the smallest value? (a) -1 (b) -3 (c) -5 c Which is the third biggest value? (a) -1/3 (b) -49 (c) -4 b Which is the fourth smallest value? (a) 0.1 (b) -7/3 (c) 3/2 (d) 5 d What is the third smallest value in 13/5, 5, 34? 34 What is the second smallest value in -3, 2, -114, 4? -3 Which is the smallest value? (a) -0.1 (b) -4 (c) -1/2 (d) 75 b What is the second biggest value in 1, 0.1, 133, 1/8, 0? 1 What is the third biggest value in 71, 1/6, -3? -3 Which is the smallest value? (a) 4 (b) 929 (c) 2 (d) 3 c Which is the third smallest value? (a) -5 (b) -3 (c) -2.8 (d) -1/4 c What is the third biggest value in 0.5, -1/7, 4, 6? 0.5 What is the fourth biggest value in 1/6, 1/7, -5, -0.9? -5 What is the second smallest value in -2, 2/3, -11/7, 5? -11/7 What is the smallest value in 0.09, 5, 4, 13, -1/5? -1/5 What is the third biggest value in 1/9, 3, 0.08, 0.3? 1/9 Which is the third biggest value? (a) 2/11 (b) -4 (c) 2 (d) 74 a Which is the smallest value? (a) -35/3 (b) -0.2 (c) 0 (d) -4/5 a What is the fifth biggest value in -22, -4/3, -2/13, -2/11, 0.061? -22 What is the second biggest value in 0.2, 1, -0.4, -7.66, -0.1? 0.2 Which is the second smallest value? (a) -2/23 (b) -19 (c) 0.1 a Which is the third smallest value? (a) 2/3 (b) 0.1 (c) 3/8 (d) 10 a Which is the biggest value? (a) 3 (b) -3 (c) -0.4 (d) 2/9 a Which is the fifth smallest value? (a) 4 (b) 5/7 (c) 3 (d) 18 (e) -4/9 d Which is the third biggest value? (a) -4 (b) -3.615 (c) -0.2 a Which is the fourth biggest value? (a) -0.3 (b) 3/2 (c) -1/9 (d) -0.4 d What is the biggest value in 0.3, 0, 2/9, -1? 0.3 Which is the second biggest value? (a) -50 (b) 0 (c) -1 (d) 0.1 (e) 1/3 d Which is the second smallest value? (a) -0.4 (b) -0.2 (c) 0.5 (d) 0.02 (e) 5 b What is the biggest value in 1, 5, 10/13? 5 What is the biggest value in 0.3, 1/3, 0.2, 350? 350 Which is the second biggest value? (a) 15 (b) -0.4 (c) -2/9 (d) -3/16 d What is the fourth biggest value in 1, 5/18, 0, 0.4? 0 What is the second smallest value in 2, -2/211, -0.11, 3? -2/211 What is the biggest value in 7, -8, 3? 7 Which is the smallest value? (a) 0.05 (b) 7 (c) 0 (d) -0.5 d What is the third biggest value in 8, 2, 0.9, -3, 3/5? 0.9 Which is the second biggest value? (a) -0.1 (b) -2.18 (c) -3 (d) 0.2 a What is the fourth smallest value in -21, -11, 3/7, -2/5? 3/7 What is the third smallest value in -0.8, -1, 0.2, 0? 0 Which is the third smallest value? (a) -89 (b) -2/29 (c) 2 (d) -3/7 b What is the fourth biggest value in -2/19, -27, 2/7, 1, -0.06? -2/19 What is the third smallest value in 160, -0.08, 0, -0.5? 0 What is the third smallest value in -3/7, 2/19, 65, 3, 1? 1 What is the second biggest value in -0.2, 69, 0.14? 0.14 Which is the second smallest value? (a) 0.5 (b) 0.1 (c) -638/7 b Which is the biggest value? (a) -23 (b) 0.4 (c) 0.5 (d) -2/17 c What is the third smallest value in 2/9, 0, 60? 60 Which is the fourth smallest value? (a) -2 (b) 0 (c) 5 (d) 3/8 c What is the third biggest value in 30, 4/5, 4, 1/2? 4/5 What is the second biggest value in -4, 4, -873? -4 Which is the biggest value? (a) 1/2 (b) -614/7 (c) 3 (d) 0.4 (e) 2/9 c What is the fourth biggest value in -7/3, -6, -0.5, 7? -6 What is the third biggest value in 0.1, 283, -1/3? -1/3 Which is the third biggest value? (a) -3/4 (b) 4/7 (c) 6/5 (d) 1/5 d What is the smallest value in -0.3, 7, -6, 7/5? -6 What is the smallest value in 1/6, 120, 0.02? 0.02 What is the smallest value in 4/7, -16, -10/23? -16 What is the third smallest value in -0.1, 4/3, 6.76? 6.76 What is the smallest value in -6, 58, -1/2? -6 Which is the smallest value? (a) -1/7 (b) 3/4 (c) 2 a What is the second biggest value in 0.03, 5, -5? 0.03 What is the smallest value in 0.01, 0.4, -1/5, 4, -9? -9 What is the biggest value in 0.08, -5, -3.8? 0.08 What is the third biggest value in -38, 1/4, 3/4, -7? -7 What is the fifth biggest value in -0.01, -1/2, -3, 0, -4? -4 What is the smallest value in 2, -2, 0, 1, -134? -134 What is the third smallest value in -0.4, 0, -4155? 0 Which is the second smallest value? (a) 2/5 (b) 5 (c) -67 a What is the second smallest value in -5, -3, 0.2, -101/4? -5 Which is the third smallest value? (a) 0.15 (b) 3 (c) -1 b What is the fourth biggest value in 3, 0.2, 4, 2? 0.2 What is the third biggest value in 5, -0.23, 95, -1? -0.23 Which is the third smallest value? (a) -0.1 (b) -0.4 (c) 405.4 c What is the third biggest value in 12, -3, 5, -56? -3 What is the second biggest value in -2, 2/19, -5, 0.2, 3? 0.2 What is the second smallest value in -5, -2/9, 0.3, 2? -2/9 What is the biggest value in -0.5, 2, 5/6, 3/7? 2 What is the third biggest value in 0.1, -5, 13/215? -5 What is the fourth smallest value in 5, -5, 53, 0.5? 53 What is the biggest value in 8, -2/9, -0.3, -3? 8 What is the smallest value in -4, 2, 175? -4 Which is the third smallest value? (a) 136 (b) -2/9 (c) -0.1 a Which is the second biggest value? (a) -2 (b) -1 (c) 0.01 b Which is the fifth smallest value? (a) 0.4 (b) -0.1 (c) -2/9 (d) -4 (e) -15 a What is the fourth smallest value in 7, -3, -37, -2/3? 7 What is the third smallest value in 4/7, 1, -2/3, -1/3? 4/7 Which is the third smallest value? (a) -46/7 (b) -0.8 (c) 5 (d) -4 b What is the third smallest value in 4, -20, -2/5? 4 Which is the second biggest value? (a) -0.7 (b) 0.14 (c) -1/2 c Which is the smallest value? (a) -1/5 (b) 0 (c) 2.4 a What is the smallest value in -4, 5, -2, 2.92? -4 What is the third biggest value in -3/5, 644, -2/7, 2/11? -2/7 Which is the smallest value? (a) -1/2 (b) -82 (c) 4 (d) 3 b Which is the third smallest value? (a) 14 (b) -2 (c) -34 a What is the smallest value in 0.1, -5/3, -0.4, 1/7? -5/3 What is the second biggest value in -1/2, 8, 3/8, -2/19? 3/8 What is the fifth smallest value in -1/4, 3, 0.01, 0, -1? 3 Which is the second smallest value? (a) -0.06 (b) -0.4 (c) 4 (d) -0.1 d What is the biggest value in -2, 3/7, 5? 5 Which is the second biggest value? (a) 19 (b) 5 (c) 0 b Which is the second smallest value? (a) -5 (b) -2/5 (c) 0 (d) 2 b What is the fifth biggest value in -0.4, -0.2, 0.4, 0.3, -7/6? -7/6 Which is the fifth biggest value? (a) 5 (b) 2/73 (c) 2/17 (d) -3 (e) 0.5 d What is the third biggest value in -4, 0.2, -3, -0.4, -0.00	{ "pile_set_name": "DM Mathematics" }
without replacement from {a: 16, s: 2}. What is prob of picking 1 a and 2 s? 1/51 Three letters picked without replacement from mfffvfvffvmwm. What is prob of picking 3 m? 1/286 Two letters picked without replacement from wnnwnnnwnnnwwwnnwnww. Give prob of picking 1 n and 1 w. 99/190 Calculate prob of picking 2 p when two letters picked without replacement from {f: 8, v: 4, p: 2}. 1/91 Two letters picked without replacement from {a: 3, j: 2, c: 5, r: 2}. Give prob of picking 1 r and 1 j. 2/33 Two letters picked without replacement from tqktkkqkq. What is prob of picking 1 q and 1 k? 1/3 Three letters picked without replacement from {c: 3, j: 7, u: 8, s: 2}. What is prob of picking 2 j and 1 s? 7/190 Three letters picked without replacement from {r: 4, x: 2, d: 3, h: 1, a: 7}. What is prob of picking 1 d and 2 r? 9/340 Two letters picked without replacement from {o: 1, q: 2, y: 1}. What is prob of picking 1 q and 1 y? 1/3 Three letters picked without replacement from {q: 9, g: 2}. Give prob of picking 1 q and 2 g. 3/55 Calculate prob of picking 3 d and 1 c when four letters picked without replacement from dddddcdcdd. 8/15 Two letters picked without replacement from {m: 1, z: 3, r: 1, c: 1, y: 1}. Give prob of picking 1 z and 1 m. 1/7 What is prob of picking 1 r, 2 k, and 1 w when four letters picked without replacement from {r: 4, w: 4, k: 5, i: 1, f: 1}? 32/273 Two letters picked without replacement from qqkqkq. Give prob of picking 2 k. 1/15 Four letters picked without replacement from {g: 4, p: 3, t: 1, j: 2}. Give prob of picking 1 t, 1 p, and 2 g. 3/35 Calculate prob of picking 3 b when three letters picked without replacement from xbnxnnbbbbxxxxnbbbb. 28/323 Two letters picked without replacement from iiiiikiiiiiriirr. What is prob of picking 1 r and 1 i? 3/10 Two letters picked without replacement from jjxnjjal. Give prob of picking 1 j and 1 x. 1/7 Calculate prob of picking 4 a when four letters picked without replacement from avlalaalaavlvvaav. 1/34 What is prob of picking 1 m, 1 a, and 1 d when three letters picked without replacement from oaddm? 1/5 What is prob of picking 2 f, 1 r, and 1 e when four letters picked without replacement from egcfgfrrs? 1/63 Two letters picked without replacement from czzytccccczczcc. What is prob of picking 1 c and 1 t? 3/35 What is prob of picking 4 c when four letters picked without replacement from cccccccccc? 1 Calculate prob of picking 1 m, 1 l, and 1 u when three letters picked without replacement from eeumltteruueet. 3/364 What is prob of picking 1 y and 1 x when two letters picked without replacement from pykopyxw? 1/14 Two letters picked without replacement from {p: 5, n: 4, q: 1}. What is prob of picking 2 p? 2/9 Two letters picked without replacement from {i: 1, g: 1, x: 1, a: 7, j: 5}. Give prob of picking 2 a. 1/5 What is prob of picking 3 h when three letters picked without replacement from {h: 5, l: 1, s: 5, n: 6, u: 2}? 10/969 Three letters picked without replacement from xjqaxvq. Give prob of picking 1 v and 2 q. 1/35 Three letters picked without replacement from {b: 2, w: 7}. Give prob of picking 3 w. 5/12 Three letters picked without replacement from {d: 1, m: 1, u: 2, w: 1, f: 1, n: 1}. What is prob of picking 1 f, 1 n, and 1 d? 1/35 Four letters picked without replacement from swssws. What is prob of picking 2 w and 2 s? 2/5 Two letters picked without replacement from pdopg. Give prob of picking 1 d and 1 g. 1/10 Calculate prob of picking 2 z, 1 t, and 1 i when four letters picked without replacement from ztzkiztzikbb. 8/165 Calculate prob of picking 2 r when two letters picked without replacement from rrvvvrvv. 3/28 What is prob of picking 3 p when three letters picked without replacement from upuppuuu? 1/56 What is prob of picking 4 t when four letters picked without replacement from {c: 3, t: 5}? 1/14 Three letters picked without replacement from wffmwfzzf. Give prob of picking 1 f, 1 m, and 1 z. 2/21 Calculate prob of picking 2 z and 1 s when three letters picked without replacement from {z: 3, s: 2}. 3/5 What is prob of picking 1 d and 1 b when two letters picked without replacement from {n: 1, x: 2, b: 1, d: 1}? 1/10 Calculate prob of picking 1 f and 1 b when two letters picked without replacement from bkgfa. 1/10 Calculate prob of picking 1 j and 1 d when two letters picked without replacement from {d: 1, j: 1, w: 1}. 1/3 Four letters picked without replacement from zzqrqqqrs. What is prob of picking 1 r, 1 s, 1 z, and 1 q? 8/63 What is prob of picking 1 p and 1 x when two letters picked without replacement from jtxtxgpdgggtg? 1/39 Three letters picked without replacement from rrcrrtcgvgucvc. What is prob of picking 1 c, 1 r, and 1 t? 4/91 Four letters picked without replacement from nnnndnxyzxjxnjj. Give prob of picking 1 d, 1 y, and 2 j. 1/455 What is prob of picking 1 g and 1 i when two letters picked without replacement from {g: 2, e: 5, d: 4, i: 7}? 14/153 Calculate prob of picking 1 l, 1 g, and 1 u when three letters picked without replacement from ugyeulyemlyyeyugey. 1/68 What is prob of picking 1 p and 1 w when two letters picked without replacement from {p: 4, n: 1, s: 1, f: 2, w: 3}? 12/55 Three letters picked without replacement from {j: 2, z: 4, b: 3, o: 1, d: 1}. What is prob of picking 2 j and 1 o? 1/165 Two letters picked without replacement from zsz. What is prob of picking 2 z? 1/3 Three letters picked without replacement from uuuu. Give prob of picking 3 u. 1 Four letters picked without replacement from sssssbbss. Give prob of picking 4 b. 0 Three letters picked without replacement from {d: 4, y: 10, r: 6}. Give prob of picking 2 y and 1 r. 9/38 Three letters picked without replacement from {p: 9, o: 4, d: 1}. What is prob of picking 1 o and 2 p? 36/91 Three letters picked without replacement from xatyxttyyxtyy. Give prob of picking 1 y, 1 a, and 1 t. 10/143 Two letters picked without replacement from rrjmjjcjrjje. Give prob of picking 2 r. 1/22 Calculate prob of picking 2 f and 1 e when three letters picked without replacement from {e: 8, f: 5}. 40/143 What is prob of picking 2 f when two letters picked without replacement from lllff? 1/10 What is prob of picking 1 r and 1 x when two letters picked without replacement from rrrtrtjcrrjjx? 1/13 Three letters picked without replacement from yprkktkprrtrvv. Give prob of picking 1 t and 2 k. 3/182 Two letters picked without replacement from {c: 6, x: 3, e: 1, h: 4}. Give prob of picking 1 x and 1 e. 3/91 Two letters picked without replacement from dooooddodd. What is prob of picking 2 d? 2/9 Three letters picked without replacement from hqcww. What is prob of picking 2 w and 1 h? 1/10 What is prob of picking 1 j and 1 e when two letters picked without replacement from ocmejox? 1/21 What is prob of picking 2 h and 1 f when three letters picked without replacement from fhaoihsi? 1/56 Calculate prob of picking 3 m and 1 g when four letters picked without replacement from {a: 2, g: 4, m: 3}. 2/63 Four letters picked without replacement from {v: 3, b: 13, e: 3}. What is prob of picking 3 b and 1 v? 143/646 Three letters picked without replacement from {i: 7, c: 2, n: 6}. Give prob of picking 1 c and 2 i. 6/65 What is prob of picking 1 g, 1 w, and 2 r when four letters picked without replacement from uuryryegygyweurrg? 9/1190 Two letters picked without replacement from {k: 2, z: 1, u: 2, e: 1, d: 1, v: 2}. Give prob of picking 1 k and 1 z. 1/18 Two letters picked without replacement from {s: 3, p: 1, y: 5, u: 4}. What is prob of picking 1 s and 1 p? 1/26 Four letters picked without replacement from llvlvvvlvlo. What is prob of picking 2 v and 2 l? 10/33 Calculate prob of picking 1 j and 3 c when four letters picked without replacement from qjqqccqqcqjcqqqq. 2/455 Three letters picked without replacement from pppwmtwop. Give prob of picking 3 p. 1/21 What is prob of picking 2 z and 1 o when three letters picked without replacement from zzooozzzzzzzzz? 165/364 What is prob of picking 2 y when two letters picked without replacement from botodggygootgoyg? 1/120 Calculate prob of picking 2 k and 2 f when four letters picked without replacement from {x: 1, k: 5, f: 7, d: 3}. 3/26 Calculate prob of picking 3 j when th	{ "pile_set_name": "DM Mathematics" }
1001657a4 - 52a - 5252 wrt a. 12019884a2 Differentiate -1048c*2w + 17cw + 43822w wrt c. -2096cw + 17w Find the second derivative of 192844i3 - 2i*2 - 1306112i wrt i. 1157064i - 4 What is the derivative of 2198s*2w + 775s2 + 10sw + 17s wrt w? 2198s2 + 10s What is the third derivative of -841699l4 + l3 - 56487l*2 wrt l? -20200776l + 6 What is the second derivative of 1803271o2 - 1450026o wrt o? 3606542 Find the first derivative of -133169jn - j + n + 603211 wrt j. -133169n - 1 What is the derivative of -10132r*4 + 17236 wrt r? -40528r*3 Find the second derivative of -32a*2n - 119a2 - 2an + 324a + n + 1 wrt a. -64n - 238 What is the third derivative of ai*5 + 80025ai4 + 10908ai2 - 2a - 2 wrt i? 60ai*2 + 1920600ai Find the second derivative of 2g*5 - 236123g*4 - 26943g - 4. 40g3 - 2833476g*2 What is the derivative of -488o*4 - 7o*3 + 5282? -1952o*3 - 21o*2 What is the first derivative of -65hu3 + 604hu2 - 17u*3 - 1117u*2 wrt h? -65u*3 + 604u*2 What is the derivative of 84f*4 - 239f*3 - 6f*2 - 2f + 2101806? 336f3 - 717f*2 - 12f - 2 What is the derivative of 5q2s*2 + 798q*2 + 162879s*2 wrt q? 10qs2 + 1596q What is the third derivative of -998ar*3 - 3ar + 6853a + 4r5 + 3r3 + r2 wrt r? -5988a + 240r*2 + 18 What is the third derivative of 1559a*4t + 58a3t + a*2t - 311at + 27a - 1 wrt a? 37416at + 348t Differentiate -15bg*2o*2 + 32304bg2 + 2bo - 2o*2 + 69o - 595 with respect to g. -30bgo2 + 64608bg What is the third derivative of 20hq2r*3 + 41hq2r*2 - hqr - 3hr2 - 2q*2r*3 - 63q*2r - 439qr*3 wrt r? 120hq2 - 12q*2 - 2634q What is the derivative of 1867l2u*2 + 7l*2 - 25lu2 - 1782l + 2 wrt u? 3734l2u - 50lu Find the second derivative of 2aj*4 - 10aj - 7746a - 39642j4 + 2j*2 wrt j. 24aj2 - 475704j*2 + 4 Find the third derivative of 28005w*3xy2 - 2w*3xy + w2x + 432w2 - 2xy2 - 2y*2 wrt w. 168030xy2 - 12xy Find the first derivative of -3381n*2 + 22n + 834987. -6762n + 22 What is the second derivative of -7075g*3x*2 - 6g*3x + gx2 + 5gx + 285g - 3 wrt g? -42450gx*2 - 36gx What is the third derivative of -45029u*3 + 727u*2 - 11? -270174 Differentiate 532561cp3y + 4cp*3 - 2cp2 - 20885cp - 3py with respect to y. 532561cp3 - 3p Find the second derivative of 3q2v*2 - 531302q*2v - 9qv2 - q + v2 - 209v + 24 wrt q. 6v*2 - 1062604v Differentiate -2685234pt - 3271833p wrt t. -2685234p What is the second derivative of 1649cu*3 + 3cu2 - 32950cu - 2u*3 + 13u*2 - 2u - 7 wrt u? 9894cu + 6c - 12u + 26 Differentiate 7do*4 - 63do3 + 4d + 18o2 + 2211 with respect to o. 28do3 - 189do2 + 36o Find the first derivative of -4gx*2 + 5gxy + gy - 34x*3y + 52032x3 + xy wrt y. 5gx + g - 34x3 + x What is the second derivative of 196ks2 - 462954ks + 204s*5 wrt s? 392k + 4080s3 Find the first derivative of -3ns2 - 5ns + 2001n + 3s2 + 12s + 3 wrt s. -6ns - 5n + 6s + 12 Find the first derivative of 1409313y - 566027 wrt y. 1409313 What is the third derivative of -1025043t*5 - 1046025t*2? -61502580t*2 What is the second derivative of -jq*3 + 2jq + j - 29q*3 - 191q*2 + 18 wrt q? -6jq - 174q - 382 Find the first derivative of 406x3 + 9x*2 - 2x + 8211 wrt x. 1218x2 + 18x - 2 What is the second derivative of -278c3 + 3c*2 - 389938c? -1668c + 6 Find the second derivative of -1080o*3v*2 + 47o*3 + 2o*2v*2 - 4o*2 + 3ov3 - ov + 2o wrt v. -2160o*3 + 4o*2 + 18ov What is the second derivative of -514132p*4 + 168p - 280 wrt p? -6169584p2 What is the second derivative of -107578b*3 + 1187b + 85 wrt b? -645468b What is the first derivative of 46i*4z*3 + 150i*3z*3 + 15919z*3 wrt i? 184i*3z*3 + 450i*2z*3 Find the second derivative of 2790884x*4 + 4x + 16279. 33490608x2 Differentiate -1445c*2l*3 + 3888c*2 - cl*2 - 4c - 3l + 1 wrt l. -4335c*2l*2 - 2cl - 3 Find the third derivative of -17b*5 - 121456b*4 - 4b*2 + 1097b + 3. -1020b2 - 2914944b Differentiate -96p3t - 16p3 - 2p*2 - 20pt + 18p - 39t - 6 wrt t. -96p*3 - 20p - 39 What is the second derivative of 711m2u*3 + 15m*2u - 7m2 - 140mu3 - 15m - 2u - 2 wrt u? 4266m*2u - 840mu Find the second derivative of -2c5 + 2c*4 - 1098c*3 - 23732c + 1 wrt c. -40c3 + 24c*2 - 6588c Find the second derivative of -14896m2v*2 - 3m*2 - mv + 3v + 41 wrt v. -29792m*2 What is the third derivative of 1759612u*3 - 5407u*2 - u - 69 wrt u? 10557672 Differentiate -199306u*2 + u + 182246 wrt u. -398612u + 1 What is the third derivative of 36417n3x + n*3 - 2n*2x - 17n2 + n + 190 wrt n? 218502x + 6 What is the second derivative of -134176y2 + 1988y + 125? -268352 Find the second derivative of -b*4r*3 + 8163b*2r*3 - br*2 - 63r3 + r2 - 19 wrt b. -12b2r*3 + 16326r*3 Differentiate 351633o*3t*3 + 8o*3 - 72o*2 + 51o + 2 wrt t. 1054899o3t*2 What is the third derivative of -577986l3 + l2 - 12l + 3733 wrt l? -3467916 What is the third derivative of 3g*5 + 46g*4u - 82g3 + 22g*2u - 1025g2 - 2g wrt g? 180g2 + 1104gu - 492 Find the second derivative of 106cj3 + 2798c + 2j5 - 59j*4 - j wrt j. 636cj + 40j*3 - 708j2 What is the derivative of -l2w + 93l*2 + 38lw - 2398w + 234 wrt w? -l*2 + 38l - 2398 Differentiate -7p2s*2 + 127p*2s + 108p - 548992s*2 + 2s wrt p. -14ps*2 + 254ps + 108 Differentiate -5bd2 - 55678b + 42d2 with respect to d. -10bd + 84d What is the derivative of h*4 - 766h*2 - 5h + 364933? 4h3 - 1532h - 5 Find the second derivative of -2l2s*2 - 170l*2s + 18l2 + 13ls2 + 9s*2 + 2s - 49 wrt l. -4s2 - 340s + 36 Differentiate 169iv*2 - 152iv - 8368i + 3v2 - 2v - 2 wrt v. 338iv - 152i + 6v - 2 What is the derivative of -814d3p*2 - 60d*3p - 1321p2 + 2p - 14 wrt d? -2442d2p*2 - 180d*2p What is the first derivative of -24222kn*3 + 3n*3 + 9159 wrt k? -24222n*3 What is the derivative of -559563a + 889977 wrt a? -559563 Find the third derivative of 1253g2z*5 + 4654g*2z*2 + 35gz6 + 4gz2 + 4gz wrt z. 75180g*2z*2 + 4200gz3 Differentiate -13oz2 - 3oz + 5977o + 306z - 2 wrt z. -26oz - 3o + 306 Differentiate 8q3 - q2 + 283q + 15699 wrt q. 24q2 - 2q + 283 Find the first derivative of 600621w + 553788 wrt w. 600621 What is the derivative of -41068b*3y - 4b3 + 6b*2y*2 - 53485b*2 wrt y? -41068b*3 + 12b*2y Find the second derivative of 3459b4g + 40b4 - 2bg - 63627g wrt b. 41508b2g + 480b2 What is the second derivative of -74r*4 - 7r*3 - 2r*2 - 2245r - 1 wrt r? -888r2 - 42r - 4 What is the second derivative of 3r3 + 1910r*2v*2 - 2r + 5535v2 - 1 wrt r? 18r + 3820v2 Find the third derivative of -310668j*5 - 158j*2 - 8j + 15. -18640080j2 Find the second derivative of 2fz3 + 18fz2 + 988fz - 2z*2 - 3z wrt z. 12fz + 36f - 4 Find the first derivative of n4x - 30756n3x*3 - 3x3 + x2 - 695x - 17 wrt n. 4n*3x - 92268n2x*3 Find the third derivative of -245066k*6 - 377972k*2. -29407920k*3 What is the second derivative of 23686y*2 + 92755y wrt y? 47372 What is the second derivative of 86686h3 - 242491h wrt h? 520116h What is the derivative of -37473oz - 5927o + 2z - 7 wrt z? -37473o + 2 What is the second derivative of -1114o3s*2 - 316o*3s + 2o2s*2 - 141o*2s + 2o2 + 47s*2 wrt s? -2228o*3 + 4o*2 + 94 Differentiate -1337514a*2k2 - a2 + 752722 wrt k. -2675028a2k Find the second derivative of -2t4 - 5t*3 - 4414t*2 + 9t - 4020. -24t2 - 30t - 8828 Find the second derivative of 3o4 + 274o*3 - 195o*2 + 3501266o. 36o2 + 1644o - 390 What is the second derivative of -1002728d*2 - 165333	{ "pile_set_name": "DM Mathematics" }
Let o = -3 + 4. Let k(s) = op(s) - 4y(s). Determine gk(u) - 7i(u). -u*2 Let w(b) = 2b*2 - 4b + 3. Let z be w(2). Let k(n) = -n*2 - 4n + 1. Let f(g) = -2g2 - 7g + 2. What is zf(i) - 5k(i)? -i2 - i + 1 Let m(r) = r2 - 7r + 6. Suppose 3l - 8l + 25 = 0. Let v(k) = k - 1. Calculate lv(i) + m(i). i*2 - 2i + 1 Let t(r) = -3r3 + 4r3 + r3 - 6r2 - 3r + 0r. Let g(n) = -n2. Determine -6g(b) + t(b). 2b3 - 3b Let d(u) = 3u3 - 21u*2 - 21u + 21. Let g(n) = -n*3 + 5n*2 + 5n - 5. Suppose 120 = 5l + 95. Determine ld(o) + 21g(o). -6o*3 Let f(i) = 2i*3 + 3i*2 + 3. Let c(u) = -5u*3 - 7u*2 - 7. Calculate -3c(p) - 7f(p). p3 Let m(h) = 988h*3. Let a(f) = 19f*3. Calculate 209a(l) - 4m(l). 19l3 Let c(m) be the third derivative of -m4/4 + 5m3/6 + 11m*2. Let q = 30 + -8. Let o(k) = k - 1. Suppose 5x - 16 = x. Calculate qo(v) + xc(v). -2v - 2 Let r(a) = -a + 1. Let d(x) = 5x + 4. What is d(f) + 3r(f)? 2f + 7 Suppose w = o - 3, -3o - 1 = w - 6. Let p(s) = 2s + o + s - 2s. Suppose -z + 6z + 20 = 0. Let j(v) = 4v + 7. Give zj(x) + 14p(x). -2x Let c = 51 + -50. Let v(r) = r*2 - r. Let t(w) = -6w*2 + 2w. Determine ct(i) + 4v(i). -2i2 - 2i Let w(i) = -i*2 - i - 1. Let c(z) = -3z + 2z + z2 + 2 + 3z. Let f = -7 - -8. Determine fc(v) + 2w(v). -v2 Let m(p) = p + 3. Let a(b) = b3 + b + 3. Let z(v) = v*3 + v + 3. Let f(x) = 3a(x) - 4z(x). Calculate 2f(n) + 3m(n). -2n*3 + n + 3 Let y(c) = 86c*2 + 1. Let r(n) = 258n*2 + 3. Give 3r(a) - 8y(a). 86a*2 + 1 Let d(u) = 7u + 5. Let h(p) be the first derivative of -3/2p2 - 2p + 1. Determine -2d(o) - 5h(o). o Let a(k) = -4k3 + 2k*2 - 1. Let l(t) be the first derivative of 9t*4/4 - 5t3/3 + t2/2 + 2t - 5. What is 5a(z) + 2l(z)? -2z*3 + 2z - 1 Let s(q) = 4q + 1. Let c(v) = -v + 106 + 7v - 105. Determine -5c(z) + 7s(z). -2z + 2 Let b(z) = 7z + 4. Let i = 1 + 2. Suppose ih - 6h = -39. Let c(u) be the second derivative of -5u3/2 - 9u*2/2 - 3u. What is hb(w) + 6c(w)? w - 2 Let s(o) = 3o2 - 3o + 3. Let g(w) = -10w2 + 8w - 8. Give 3g(c) + 8s(c). -6c2 Let y(i) = 1. Let n(r) = -r3 + 6. Let p be ((-2)/(-4))/((-2)/(-20)). Let q = 59 + -55. Suppose -2k - 2 = 2t - 3k, 5t + p = qk. Give tn(g) + 4y(g). g*3 - 2 Let u(x) = -29x*3 - 4x - 4. Let o(v) = -28v3 - 5v - 5. Calculate 4o(n) - 5u(n). 33n3 Let u(c) = -2c*2 - 5c + 4. Let k(z) = -5z2 - 11z + 9. Suppose 4a = 5a + 3. What is ak(p) + 7u(p)? p*2 - 2p + 1 Let s(i) be the third derivative of -5i4/12 - 8i*3/3 - 3i*2. Let l(r) = -r - 1. Let w(n) = 7n + 9. Let d(a) = 4l(a) + w(a). Give 16d(u) + 5s(u). -2u Let c(z) = z*3 - z + 1. Let q(f) = 2f*3 - 3f + 3. What is 3c(h) - q(h)? h3 Let k(i) = -15i + 13. Let o(u) = 2u + 1. Let t be o(3). Let m(y) = 11y - t + y - 4y. Calculate 6k(p) + 11m(p). -2p + 1 Let v(g) = -17g3 + 7g*2 + 7g. Let j(t) = -8t3 + 3t*2 + 3t. What is 7j(z) - 3v(z)? -5z3 Let y(f) = -6f*2 + 3f + 3. Let u(q) = -36q2 + 16q + 16. Let h(x) = -18x2 + 8x + 8. Let m(g) = 5h(g) - 3u(g). Give 3m(c) + 8y(c). 6c2 Let a(i) = -2i - 3. Let c(p) = -p + 1. Let w(t) = 2t + 7. Let m(d) = -2c(d) + w(d). Determine -5a(l) - 3m(l). -2l Let m(f) = 7f*2 - 4f - 5. Let u(p) = 4p2 + 0 + 3p + 0p - 10p*2 + 4. Calculate 4m(g) + 5u(g). -2g*2 - g Let r(h) = -287h*3 - 41h*2 + 41h + 41. Let o(b) = 36b3 + 5b*2 - 5b - 5. Calculate -41o(w) - 5r(w). -41w3 Suppose f - 3 = -2f. Let c(p) = -1. Let y(o) = -o*3 + 5o*2 - 4o + 2. Let i be y(4). Let z(d) = -2d + i - 4 + 2. What is fc(b) + z(b)? -2b - 1 Let n(c) = c + 2. Let v be (0 - -4)/8 + (-14)/(-4). Let a(i) = -2i - 2. What is vn(k) + 3a(k)? -2k + 2 Let z(a) = 2a*3 - 13a*2 + 15a + 2. Let k(c) = c*3 - 6c*2 + 7c + 1. What is -13k(u) + 6z(u)? -u*3 - u - 1 Let j(u) = 2u + 1. Let a(y) = -2y - 1. Suppose -20 - 5 = 5s. Give sj(z) - 6a(z). 2z + 1 Let z(l) = -l - 11. Let a(w) = 1. Let c(k) = k3 + 7k*2 + 4. Let r be c(-7). Calculate rz(v) + 44a(v). -4v Let r(g) = -4g + 4. Let z = 15 - 19. Let b(n) = 3n - 3. Determine zr(x) - 5b(x). x - 1 Let b(o) = 4o. Let p(m) = 2m - 9. Suppose -3s + 1 = -2s, 0 = -5k - 3s + 33. Let l be p(k). Let n(u) = -5u + 4u - 4u. What is lb(r) + 2n(r)? 2r Let o(j) = 36j2 - 27j + 27. Let g(q) = -5q2 + 4q - 4. Calculate 27g(f) + 4o(f). 9f2 Let j(s) be the first derivative of -5s*2 - 2s + 1. Let l be -11 - 3(1 - 0)-1. Let w(i) = -i. Calculate lw(n) + j(n). -2n - 2 Let r(c) = -c*2. Suppose -6z + z = -5i - 35, -2i = -z + 9. Let l = 3 + -2. Let s(g) = 2g + 1 + 4g*2 - 2g*2 - 6g*2. Calculate ir(u) + ls(u). -2u*2 + 2u + 1 Let w(c) = -14c + 4c + 13 - 3c - 4c*2. Let p(r) = -3r*2 - 9r + 9. Let z(f) = -6f3 + f2 + f - 1. Let q be z(1). Give qw(s) + 7p(s). -s2 + 2s - 2 Let q(z) = 3z2 - 4z - 6. Let u(l) = 3l2 - 3l - 5. Let w be (6/4)/(15/(-30)). Give wq(n) + 4u(n). 3n2 - 2 Let p(k) = -1 + 11k + 3 + 15. Let h(f) = 2f + 3. Give 34h(i) - 6p(i). 2i Let g(q) = q + 3. Let x be g(-7). Let v(h) = 5h2 + 4h + 2. Suppose 5 = 3y - 4y. Let o(w) = -6w2 - 5w - 2. Determine xo(l) + yv(l). -l*2 - 2 Let l(s) = 2s*2 + 5s + 5. Let f(c) = -7c - 12c*2 + 11c + 14c2 + 4. Determine -5f(m) + 4l(m). -2m*2 Suppose 0y - 4 = 4y, -8 = -5f - 2y. Let d(h) = 6h*3 + 10. Let l(n) = 2n*3 + 3. Determine fd(q) - 7l(q). -2q*3 - 1 Let n(y) = 1. Suppose -2o = 4f + 6, -2f = 3o + 2o + 23. Let g(s) = -4s + 7. Let m(t) = 5t - 11. Let p(v) = -3g(v) - 2m(v). What is fp(i) - 2n(i)? 2i - 1 Let o(z) = 11z - 6z + 6z*2 - 25z - 23. Let d(n) = 2n2 - 7n - 8. Suppose -i + 0 + 17 = 0. Give id(p) - 6o(p). -2p2 + p + 2 Let f(m) = 2m*2 + 4m - 3. Let z(c) = -2c2 - 5c + 4. What is -5f(t) - 4z(t)? -2t2 - 1 Let s be (6/(-10))/((-2)/10). Let c(x) = -2x. Let m(i) = 5i + 2i - 9i + i. Give sc(o) - 4m(o). -2o Let j(i) = i + 1. Let s(w) = 3w. Let h(q) = -2j(q) - s(q). Let b(m) = -9m - 4. Calculate -6b(k) + 11h(k). -k + 2 Let j(f) = -8f*2 - 2f - 6. Let i(u) = 23u2 + 5u + 17. Determine -4i(g) - 11j(g). -4g2 + 2g - 2 Let o(f) = 3f + 6. Let n(s) = 3s + 5. Let z = -41 - -36. Calculate zn(r) + 4o(r). -3r - 1 Let g(i) = -2i*2 + 4i. Let t(l) = l*2 - 3l. Suppose -5a = 2k + 20, 3k + 3a = -0a - 12. Suppose km + 2 = -m. Determine mg(c) - 3t(c). c*2 + c Let q be 1/(-1) - (13 - 16). Let i(d) = d + 4d + 2 - d. Let u(o) = -o - 1. Give qu(y) + i(y). 2y Let r(g) = -4g. Let m(s) = 5s + 1. Let h(j) = -3m(j) - 4r(j). Let z(f) be the second derivative of -2f3/3 + 13f*2/2 + 2f. Calculate 26h(t) + 6z(t). 2t Let b(r) = 7r*2 - 4r + 2. Let g(z) = 8z2 - 5z + 1. Calculate 4b(c) - 3g(c). 4c2 - c + 5 Let o(f) = f2 - 17f - 13. Let n(r) = -4r + 1. Let z(t) = 1. Let b(q) = -n(q) + 4z(q). Determine -9b(k) - 2o(k). -2k2 - 2k - 1 Let j(m) = 3m + 2. Let h be (-10 + (-2 - -2))/2. Let i(z) = -3z - 2. What is hj(c) - 6i(c)? 3c + 2 Let s(f) = -6f - 12. Let k(r) = -6r - 11. Let l(w) = 4k(w) - 5s(w). Let b(a) = -a - 3. Suppose -u + 5 - 4 = 0. Suppose 0 = m + 1 + u. Give ml(h) - 11b(h). -h + 1 Suppose 3u = -3u. Let g be (-3)/(-6) + (-1)/(-2). Let a(x) = 4x + g + 3 + 0 + u - 2x2. Let z(r) = -5r*2 + 11r + 11. Calculate -11a(h) + 4z(h). 2h2 Let y(i) = i2 - 6i - 4. Let o be y(6). Suppose 1 + 0 = -q. Let h be 2(o - -2 - q). Let v(l) = 5l + 13. Let r(g) = g + 3. Give hv(k) + 9r(k). -k + 1 Let s(j) = -j3. Let o(b) = -b3 + 2b2 + 2b + 1. Give -o(k) - 2s(k). 3k*3 - 2k*2 - 2k - 1 Let w(s) = -5s + 19s + 6s + 6 + s. Let q(l) = -4l - 1. Determine 11q(z) + 2w(z). -2z + 1 Let x(y) = 11y + 4. Let r(p) = -5p - 2. Let m(t) = 14r(t) + 6x(t). Let v(s) = 6s + 6. What is -7m(j) - 5v(j)? -2j - 2 Let d be 2/1 + 0/(-8). Suppose c + 3 + d = 0. Let m(y) = -7y + 6. Let r = 5 + 1. Let w(f) = -6f + 5. What is cm(u) + rw(u)? -u Let l(z) = -16z*2 - 16z - 17 + 10 + 4z3 - 9. Let r(c) = -c3 + 5c*2 + 5c + 5. Calculate -5l(g) - 16r(g). -4g*3 Let y(x) = 34 + x + 39 - 74.	{ "pile_set_name": "DM Mathematics" }
ound -83.364 to the nearest ten. -80 What is -0.018171 rounded to 3 dps? -0.018 Round -0.059615 to 3 decimal places. -0.06 Round 0.000003093 to six dps. 0.000003 What is 0.0002718 rounded to 6 decimal places? 0.000272 Round -14.29 to zero dps. -14 What is 21026000 rounded to the nearest one hundred thousand? 21000000 Round 3.5964 to zero dps. 4 What is 0.00000115217 rounded to 7 dps? 0.0000012 Round -0.4801 to 1 decimal place. -0.5 What is 4.68 rounded to one decimal place? 4.7 What is -675.8 rounded to the nearest ten? -680 Round 10.464 to the nearest integer. 10 Round -5091 to the nearest one hundred. -5100 What is -32600 rounded to the nearest one hundred thousand? 0 Round -0.18224 to 2 decimal places. -0.18 What is -22438 rounded to the nearest 100? -22400 Round -2397 to the nearest one thousand. -2000 What is -0.000018451 rounded to 7 dps? -0.0000185 Round 797540 to the nearest 1000. 798000 What is -68.273 rounded to the nearest ten? -70 What is -7561 rounded to the nearest one hundred? -7600 What is 1474000 rounded to the nearest ten thousand? 1470000 Round 1.23856 to two dps. 1.24 What is -1913350 rounded to the nearest one hundred thousand? -1900000 Round -7.174 to the nearest integer. -7 What is 324.8 rounded to the nearest 100? 300 Round 194100 to the nearest one hundred thousand. 200000 What is -75400 rounded to the nearest ten thousand? -80000 What is 4.046 rounded to 1 decimal place? 4 Round 639 to the nearest ten. 640 Round -870.926 to the nearest one hundred. -900 Round 234200 to the nearest 100000. 200000 What is -0.003956 rounded to four decimal places? -0.004 What is 3135.01 rounded to the nearest 100? 3100 Round -14872 to the nearest 1000. -15000 Round 138.3 to the nearest ten. 140 Round 2.5292 to 1 dp. 2.5 What is -97485 rounded to the nearest 1000? -97000 What is -3.0635 rounded to two dps? -3.06 What is 4685900 rounded to the nearest one hundred thousand? 4700000 Round 112.63 to the nearest one hundred. 100 What is -343.35 rounded to the nearest ten? -340 What is -66.3 rounded to the nearest integer? -66 What is 0.004101 rounded to three decimal places? 0.004 Round -3001000 to the nearest one hundred thousand. -3000000 What is 143.99 rounded to the nearest 100? 100 What is 326179000 rounded to the nearest one million? 326000000 What is 39450 rounded to the nearest 10000? 40000 What is 0.05875 rounded to 3 decimal places? 0.059 Round 760.87 to the nearest 100. 800 What is -0.000126302 rounded to six decimal places? -0.000126 What is -15391000 rounded to the nearest 1000000? -15000000 Round -287700 to the nearest 10000. -290000 What is -0.000001903 rounded to 6 decimal places? -0.000002 What is -103500 rounded to the nearest one hundred thousand? -100000 What is 0.00000073 rounded to six decimal places? 0.000001 What is 0.00000061571 rounded to seven decimal places? 0.0000006 What is 3409510 rounded to the nearest one hundred thousand? 3400000 Round -24142400 to the nearest 100000. -24100000 Round 41.4 to the nearest one hundred. 0 Round 0.0000144258 to seven decimal places. 0.0000144 Round 42795 to the nearest one thousand. 43000 Round 413000 to the nearest one hundred thousand. 400000 What is 6.71 rounded to the nearest integer? 7 What is 9.155 rounded to the nearest integer? 9 Round 3982 to the nearest 100. 4000 Round -1166.6 to the nearest ten. -1170 What is -0.0006692 rounded to 5 dps? -0.00067 Round -0.0000117 to 6 decimal places. -0.000012 Round -163.01 to 0 decimal places. -163 Round 27.075 to the nearest ten. 30 What is 257.5 rounded to the nearest one hundred? 300 What is -0.002061 rounded to 3 decimal places? -0.002 Round -4.421 to the nearest integer. -4 What is 137000 rounded to the nearest one hundred thousand? 100000 What is 0.0008357 rounded to 5 dps? 0.00084 What is -52.5 rounded to the nearest ten? -50 Round -6056000 to the nearest one hundred thousand. -6100000 What is 0.4577 rounded to 2 dps? 0.46 Round 380.38 to the nearest ten. 380 What is 0.04089 rounded to three dps? 0.041 What is 27680 rounded to the nearest one thousand? 28000 What is 3389200 rounded to the nearest 100000? 3400000 Round 0.02588 to three dps. 0.026 Round -82.4 to the nearest ten. -80 Round -2.511 to one decimal place. -2.5 Round -21.5 to the nearest integer. -22 What is -124240 rounded to the nearest 10000? -120000 Round -1.27 to one decimal place. -1.3 What is -0.9257 rounded to one dp? -0.9 What is -0.0000018394 rounded to six dps? -0.000002 What is 1190800 rounded to the nearest one million? 1000000 Round 0.00000043349 to seven dps. 0.0000004 What is 116.04 rounded to the nearest integer? 116 Round -422.8 to the nearest one hundred. -400 What is 0.2857 rounded to 2 dps? 0.29 What is -4867.5 rounded to the nearest one hundred? -4900 Round -26.469 to one decimal place. -26.5 Round 0.0001251 to six decimal places. 0.000125 Round -206.76 to the nearest integer. -207 What is -447700 rounded to the nearest one hundred thousand? -400000 What is 0.0005614 rounded to 4 decimal places? 0.0006 What is 0.00020365 rounded to five dps? 0.0002 What is -552400 rounded to the nearest 10000? -550000 Round 0.000007522 to six dps. 0.000008 What is 8704000 rounded to the nearest 100000? 8700000 What is 6830 rounded to the nearest 100? 6800 Round 216.76 to the nearest integer. 217 What is -4310 rounded to the nearest 100? -4300 What is 0.000008508 rounded to seven dps? 0.0000085 Round -0.016 to one dp. 0 What is 171.8 rounded to the nearest integer? 172 Round -265000 to the nearest 1000000. 0 Round -369100 to the nearest ten thousand. -370000 What is 0.00029575 rounded to 5 dps? 0.0003 Round 0.7658 to one dp. 0.8 What is 2.3181 rounded to one decimal place? 2.3 What is -0.17909 rounded to three decimal places? -0.179 What is 87.49 rounded to zero decimal places? 87 What is -432140 rounded to the nearest ten thousand? -430000 What is 18152 rounded to the nearest one hundred? 18200 Round -0.033925 to two dps. -0.03 Round -5050 to the nearest 100. -5100 Round 0.0000009207 to seven decimal places. 0.0000009 What is 18.649 rounded to the nearest integer? 19 What is 428.49 rounded to the nearest integer? 428 Round -0.00008857 to 6 decimal places. -0.000089 Round -2.744 to one dp. -2.7 What is 0.819 rounded to zero decimal places? 1 What is 0.00007581 rounded to 6 decimal places? 0.000076 What is 0.0000044956 rounded to six dps? 0.000004 What is 17552000 rounded to the nearest one million? 18000000 What is -351000 rounded to the nearest one million? 0 Round 416.49 to the nearest integer. 416 Round -0.002862 to 3 decimal places. -0.003 What is 0.00000446 rounded to 6 dps? 0.000004 What is -0.031 rounded to three decimal places? -0.031 Round 0.00012507 to five decimal places. 0.00013 What is 0.4159 rounded to 1 decimal place? 0.4 What is -321370 rounded to the nearest 1000? -321000 What is -0.00008261 rounded to 6 decimal places? -0.000083 What is -1.3063 rounded to 1 decimal place? -1.3 Round -0.0005634 to four decimal places. -0.0006 Round 71.283 to the nearest ten. 70 Round -9031 to the nearest 1000. -9000 Round 0.000082709 to five decimal places. 0.00008 What is -4.5356 rounded to one dp? -4.5 Round 0.00015315 to 6 decimal places. 0.000153 What is -48842900 rounded to the nearest 100000? -48800000 What is -20267000 rounded to the nearest one million? -20000000 What is 48802000 rounded to the nearest one million? 49000000 What is -272350 rounded to the nearest one thousand? -272000 Round 0.0000579 to 6 dps. 0.000058 Round 124290 to the nearest 10000. 120000 What is -0.000003257 rounded to 7 dps? -0.0000033 What is 0.0011278 rounded to five dps? 0.00113 What is -67.46 rounded to the nearest 100? -100 Round 0.03769 to 3 decimal places. 0.038 Round 12.88 to 1 dp. 12.9 Round -230400 to the nearest ten thousand. -230000 What is 0.0453 rounded to 3 dps? 0.045 What is -0.00001471 rounded to 6 decimal places? -0.000015 What is 0.0000052485 rounded to 7 dps? 0.0000052 What is 88700 rounded to the nearest ten thousand? 90000 Round 32.117 to zero dps. 32 What is 1568730 rounded to the nearest 100000? 1600000 What is -6036.9 rounded to the nearest one thousand? -6000 Round -0.031547 to four dps. -0.0315 Round 0.147 to two dps. 0.15 Round 0.00011524 to six decimal	{ "pile_set_name": "DM Mathematics" }
0 (base 10) to base 13 0 Convert 13 (base 13) to base 9. 17 What is -412 (base 6) in base 14? -ac Convert -7 (base 8) to base 6. -11 -c (base 15) to base 8 -14 12 (base 7) to base 16 9 -1 (base 3) to base 12 -1 10 (base 8) to base 5 13 14 (base 14) to base 15 13 Convert -305 (base 6) to base 2. -1110001 What is 9 (base 10) in base 5? 14 -1 (base 13) to base 2 -1 -1 (base 15) to base 16 -1 1202 (base 3) to base 10 47 Convert 45 (base 13) to base 7. 111 Convert 7 (base 14) to base 12. 7 11 (base 3) to base 5 4 Convert -6 (base 7) to base 3. -20 Convert 25 (base 16) to base 7. 52 -19 (base 10) to base 9 -21 What is -3 (base 11) in base 8? -3 Convert -12 (base 3) to base 14. -5 1 (base 4) to base 12 1 What is 0 (base 13) in base 4? 0 Convert -a (base 14) to base 15. -a What is 16 (base 12) in base 5? 33 -141 (base 6) to base 2 -111101 What is -2121 (base 3) in base 2? -1000110 Convert -11 (base 4) to base 12. -5 -20 (base 12) to base 4 -120 0 (base 3) to base 9 0 -34 (base 5) to base 3 -201 Convert -11222 (base 3) to base 5. -1014 Convert 110010 (base 2) to base 4. 302 What is -18 (base 15) in base 9? -25 Convert -32 (base 8) to base 9. -28 -224 (base 7) to base 12 -98 Convert 3 (base 11) to base 9. 3 Convert 6 (base 12) to base 13. 6 Convert 5 (base 11) to base 3. 12 What is 65 (base 12) in base 9? 85 102 (base 3) to base 14 b -3 (base 16) to base 11 -3 -a5 (base 11) to base 14 -83 Convert 11 (base 5) to base 14. 6 7 (base 12) to base 11 7 What is 103 (base 6) in base 8? 47 What is a (base 13) in base 10? 10 What is 29 (base 14) in base 13? 2b Convert 4 (base 15) to base 11. 4 3 (base 5) to base 10 3 What is -1010 (base 2) in base 13? -a 188 (base 14) to base 5 2231 -4 (base 5) to base 2 -100 Convert 3 (base 8) to base 14. 3 -a (base 12) to base 2 -1010 What is -5 (base 9) in base 14? -5 -33 (base 4) to base 13 -12 What is 1 (base 14) in base 6? 1 Convert -3 (base 5) to base 12. -3 5 (base 8) to base 11 5 What is -4 (base 11) in base 3? -11 Convert 10 (base 2) to base 7. 2 2 (base 9) to base 5 2 111 (base 6) to base 3 1121 Convert 110 (base 2) to base 10. 6 Convert -4 (base 9) to base 15. -4 Convert -246 (base 7) to base 6. -340 What is -10110111 (base 2) in base 15? -c3 Convert 14d (base 14) to base 8. 411 Convert 2 (base 15) to base 4. 2 Convert 6 (base 16) to base 11. 6 Convert c (base 13) to base 12. 10 -3 (base 16) to base 10 -3 What is -6 (base 12) in base 6? -10 What is 5 (base 8) in base 6? 5 What is 8 (base 11) in base 13? 8 Convert 9 (base 11) to base 14. 9 What is -22 (base 5) in base 3? -110 Convert 1 (base 6) to base 3. 1 -65 (base 7) to base 4 -233 -302 (base 4) to base 10 -50 Convert 2 (base 6) to base 4. 2 Convert 2 (base 16) to base 14. 2 12 (base 3) to base 12 5 0 (base 16) to base 3 0 2 (base 9) to base 3 2 0 (base 15) to base 6 0 What is -2 (base 10) in base 4? -2 Convert -2 (base 7) to base 14. -2 -24 (base 10) to base 6 -40 What is -313 (base 5) in base 6? -215 What is 0 (base 13) in base 5? 0 Convert -13 (base 4) to base 14. -7 0 (base 14) to base 2 0 Convert -b (base 13) to base 10. -11 6 (base 16) to base 4 12 -15 (base 12) to base 6 -25 What is -32 (base 8) in base 16? -1a Convert 11 (base 2) to base 7. 3 What is -11110 (base 2) in base 14? -22 7 (base 16) to base 9 7 Convert 126 (base 8) to base 9. 105 6 (base 13) to base 7 6 Convert -212 (base 6) to base 16. -50 Convert 1 (base 7) to base 13. 1 Convert -8a (base 11) to base 7. -200 Convert -2 (base 9) to base 6. -2 Convert -8 (base 16) to base 14. -8 What is -2 (base 12) in base 9? -2 Convert 1020 (base 3) to base 9. 36 Convert -7 (base 10) to base 5. -12 Convert 123 (base 11) to base 13. b3 Convert 8 (base 14) to base 11. 8 2 (base 12) to base 16 2 What is 179 (base 10) in base 14? cb What is -2131 (base 4) in base 9? -184 -15f (base 16) to base 4 -11133 What is -14 (base 10) in base 15? -e Convert -25 (base 15) to base 9. -38 Convert 100 (base 3) to base 8. 11 What is 17 (base 8) in base 13? 12 What is 0 (base 9) in base 15? 0 Convert -25 (base 12) to base 2. -11101 What is -c9 (base 16) in base 13? -126 What is 0 (base 13) in base 11? 0 0 (base 10) to base 14 0 92 (base 12) to base 6 302 What is 2 (base 7) in base 8? 2 What is 3 (base 8) in base 3? 10 What is 14 (base 8) in base 5? 22 Convert -5 (base 14) to base 11. -5 What is -3 (base 8) in base 7? -3 -2 (base 13) to base 10 -2 33 (base 16) to base 7 102 What is -211 (base 5) in base 14? -40 Convert 1323 (base 5) to base 8. 325 What is -1 (base 4) in base 3? -1 0 (base 15) to base 7 0 Convert 4 (base 16) to base 2. 100 What is -4 (base 12) in base 4? -10 What is -234 (base 6) in base 2? -1011110 -6 (base 7) to base 2 -110 -101 (base 2) to base 11 -5 What is 4 (base 10) in base 3? 11 -152 (base 12) to base 8 -316 -2 (base 7) to base 5 -2 Convert -10 (base 2) to base 12. -2 Convert -9c (base 13) to base 8. -201 1103 (base 5) to base 2 10011001 3 (base 15) to base 4 3 Convert 142 (base 6) to base 12. 52 What is -436 (base 7) in base 3? -22021 Convert -1 (base 10) to base 9. -1 What is -41 (base 14) in base 9? -63 What is 1013 (base 5) in base 12? b1 Convert -244 (base 5) to base 15. -4e Convert -232 (base 5) to base 4. -1003 Convert -6c (base 15) to base 16. -66 What is -5 (base 15) in base 7? -5 Convert -7 (base 14) to base 10. -7 What is -2 (base 10) in base 3? -2 What is -10 (base 3) in base 10? -3 122 (base 7) to base 6 145 What is -2 (base 9) in base 2? -10 10 (base 14) to base 4 32 What is 312 (base 8) in base 16? ca 108 (base 9) to base 14 65 13 (base 12) to base 15 10 Convert -11 (base 4) to base 7. -5 Convert 2 (base 6) to base 14. 2 Convert -6 (base 16) to base 12. -6 -5 (base 13) to base 9 -5 -42 (base 15) to base 10 -62 Convert -2 (base 12) to base 13. -2 What is -2 (base 14) in base 7? -2 What is 7 (base 12) in base 5? 12 -4 (base 16) to base 2 -100 -15 (base 11) to base 15 -11 4 (base 13) to base 11 4 What is 2 (base 15) in base 7? 2 Convert -2 (base 4) to base 15. -2 What is -17 (base 9) in base 14? -12 What is 2 (base 10) in base 6? 2 Convert -77 (base 12) to base 8. -133 What is 107 (base 11) in base 10? 128 1001 (base 2) to base 7 12 Convert 256 (base 8) to base 14. c6 What is 61 (base 15) in base 16? 5b Convert -14 (base 6) to base 14. -a Convert 1 (base 11) to base 12. 1 Convert 1001 (base 2) to base 16. 9 -15 (base 10) to base 3 -120 -10 (base 8) to base 14 -8 What is -13 (base 16) in base 4? -103 12113 (base 4) to base 8 627 23 (base 7) to base 14 13 What is -2 (base 9) in base 13? -2 Convert -50 (base 9) to base 6. -113 10011 (base 2) to base 10 19 Convert 7 (base 12) to base 6. 11 Convert -4 (base 11) to base 2. -100 Convert -26 (base 7) to base 11. -19 -162 (base 8) to base 12 -96 What is -4 (base 16) in base 13? -4 3e (base 16) to base 9 68 What is -175 (base 10) in base 4? -2233 What is -224 (base 8) in base 16? -94 What is -102 (base 3) in base 5? -21 -12 (base 4) to base 15 -6 What is -51 (base 12) in base 9? -67 -12 (base 6) to base 15 -8 Convert 5 (base 7) to base 4. 11 Convert 142 (base 5) to base 9. 52 -4 (base 9) to base 2 -100 What is 2 (base 4) in base 16? 2 What is 58 (base 16) in base 12? 74 What is -11 (base 10) in base 14? -b 87 (base 14) to base 9 142 Convert -21 (base 9) to base 6. -31 -50 (base 9) to base 12 -39 Convert -30 (base 4) to base 11. -11 Convert 12 (base 6) to base 11. 8 Convert -48 (base 15) to base 13. -53 Convert -10 (base 5) to base 8. -5 Convert -7 (base 8) to base 5. -12 88 (base 9) to base 5 310 What is -16 (base 12) in base 15? -13 What is -2 (base 14) in base 12? -2 Convert -1 (base 13) to base 2. -1 Convert 1110 (base 3) to base 16. 27 What is -453 (base 6) in base 9? -216 2 (base 16) to base 11 2 4 (base 15) to base 4 10 What is -a (base 12) in base 8? -12 What is 48 (base 10) in base 14? 36 What is 29 (base 12) in base 10? 33 What is 1300 (base 5) in base 6? 532 Convert -70 (base 11) to base 2. -1001101 Convert 10101 (base 2) to base 13. 18 What is -215 (base 9) in base 2? -10110000 What is 3 (base 16) in base 12? 3 Convert -22 (base 10) to base 3. -211 Convert -3 (base 14) to base 10. -3 What is -62 (base 15) in base 4? -1130 Convert 23 (base 7) to base 11. 16 Convert -6 (base 15) to base 2. -110 Convert -10 (base 5) to base 2. -101 What is -270	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.