Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
) = 0. -1, 0, 1 Suppose 2z - 4z + 4 = 0. Find w such that 0w - 4w - 2 + 6 + 4wz + 12w = 0. -1 Determine r so that 83r - 28r*2 - 4 - 79r + 16 - 20r3 = 0. -1, 3/5 Suppose 5 = 2l + 1. Factor ls5 + 1 - 4s*3 - 2 + 3 - 4s*2 + 2s + 2s4. 2(s - 1)*2(s + 1)*3 Let k(t) = -t + 11. Let z be k(6). Suppose -25 = -5q + zi, 3 = 2q - 2i + 7i. Find d, given that 0 + 2/3d3 - 2/3d*2 + 2/3d*q - 2/3d = 0. -1, 0, 1 Let p(d) = -d*2 + 2d + 10. Let o be p(4). Factor -45/2ro - 2 - 12r - 25/2r3. -(r + 1)(5r + 2)2/2 Suppose -215 = 8s - 3s. Let c = s + 48. Suppose 3/2u + 3/2u4 + 3/2u*c + 3/2 - 3u*2 - 3u*3 = 0. Calculate u. -1, 1 Let p(v) be the first derivative of 0v + 3 + 1/2v3 - 3/10v*5 - 1/8v*4 + 1/2v*2 - 1/12v*6. Solve p(l) = 0. -2, -1, 0, 1 Let o(w) be the third derivative of -8w*2 + 1/480w*6 + 1/240w*5 + 0 + 0w*3 - 1/48w*4 + 0w. Factor o(z). z(z - 1)(z + 2)/4 Let k(n) be the second derivative of n6/30 + n5/10 - n3/3 - n2/2 - 35n. Suppose k(l) = 0. What is l? -1, 1 What is p in 2/5p*3 + 0 + 2p - 12/5p2 = 0? 0, 1, 5 Let i(z) be the second derivative of z4/54 + 2z*3/3 + 9z*2 - 31z. Find y such that i(y) = 0. -9 Let w(d) = d3 + d2 - 2d + 1. Let r(g) be the third derivative of -g3/6 - 2g*2. Let i(p) = 2r(p) + 2w(p). Factor i(q). 2q(q - 1)(q + 2) Solve 0h2 + 6h*2 - 9h*2 - 9 - 12h = 0. -3, -1 Let q(h) be the second derivative of 3h5/20 + 15h. Determine l so that q(l) = 0. 0 Factor -3/5j4 + 0j - 3/5j3 + 0 + 0j*2. -3j*3(j + 1)/5 Let s = 346 + -346. Factor 6/7z3 - 4/7z - 2/7z2 + s. 2z(z - 1)(3z + 2)/7 Let b(u) be the third derivative of -19/20u*6 - 3/5u*5 + 33/35u7 + 0 + u3 + 9/8u4 + 0u + 6u2 - 27/112u*8. Suppose b(f) = 0. What is f? -1/3, -2/9, 1 Determine q, given that 1/4q*3 + 3/4q + 1/4 + 3/4q2 = 0. -1 Let x(n) be the first derivative of n6/27 - 2n5/15 + n4/6 - 2n3/27 + 2. Find a, given that x(a) = 0. 0, 1 Suppose -4w = -2w - 4g - 24, 18 = 4w - 2g. Suppose -2/7j + 1/7j*w + 1/7j*3 + 0 = 0. What is j? -2, 0, 1 Solve -13r*3 + 8r*2 + 6r + 2r3 + 13r*3 = 0. -3, -1, 0 Suppose 0 = y - 3y + 8, 2t + y = 10. Let w be -1 + t/(1 - 0). Factor 1/3i3 - iw + 0 + 2/3i. i(i - 2)(i - 1)/3 Let t(w) be the first derivative of w4/3 - w3/2 - w2/2 + 3w - 3. Let z(d) be the first derivative of t(d). Determine r, given that z(r) = 0. -1/4, 1 Suppose s + 3 = 5k - 11, -4s - 5 = -3k. Factor -2g*2 - kg*2 - 3g*2 + 3g + 5g2. -3g(g - 1) Suppose -2t = 3v, -v = t - 0t + 1. Let a(r) be the second derivative of 2r + 1/36r*4 - 1/6r*v + 0 - 1/18r*3 + 1/60r*5. Find p such that a(p) = 0. -1, 1 Factor 0b*4 + 0 + 0b*3 + 0b*2 - 1/8b*5 + 0b. -b5/8 Let a(j) = j3 - 5j2 + j - 4. Let q be a(5). Let t be 3/(51/6 - q). Factor -9/5y*2 + ty + 7/5y3 + 0. y(y - 1)(7y - 2)/5 Let z = -29 + 31. What is c in 0c + 0 - 1/2c*z = 0? 0 What is t in -2t*5 - 5/2t*2 + 3/2t*3 + 5/2t*4 + 1/2t + 0 = 0? -1, 0, 1/4, 1 Let a(g) be the second derivative of -7g5/20 - 5g4/8 + g3 + 3g2 - 5g. Let k(h) be the first derivative of a(h). Find s, given that k(s) = 0. -1, 2/7 Let z(a) be the second derivative of -1/3a3 + 2a*2 - a + 0 + 1/10a*5 - 1/3a*4. Factor z(g). 2(g - 2)(g - 1)(g + 1) Let b(y) be the first derivative of -3/20y4 + 2 + 0y - 1/10y2 - 1/25y*5 - 1/5y3. Solve b(f) = 0. -1, 0 Let n(h) be the second derivative of -h4/12 + 5h3/6 + 3h*2/2 + h. Let x be n(5). Factor 2r*3 - 2r*4 + 12r*2 - 3r*4 - 4r - 5rx. -r(r - 1)(r + 2)(5r - 2) Let h(c) be the third derivative of 0 - 2c*2 + 1/30c*6 + 0c*3 + 0c*4 + 1/15c*5 + 0c. Factor h(q). 4q2(q + 1) Let q(m) = 3m2 - 5m - 3. Let i(c) = 4c2 - 8c - 4. Let g(w) = w. Let j(a) = -g(a) - i(a). Let n(f) = 5j(f) + 7q(f). What is b in n(b) = 0? -1, 1 Let c = 6 - 6. Suppose 4g = -q - 5, -q + 1 + c = g. Factor 0 - 1/3j*4 + 1/3j - 1/3jq + 1/3j*2. -j(j - 1)(j + 1)2/3 Let q(z) be the first derivative of -6/5z*3 - 1 - 1/5z*2 + 13/10z*4 + 4/5z - 2/5z5. Solve q(s) = 0 for s. -2/5, 1 Let k(s) be the second derivative of -s10/16800 - s9/3150 - 3s8/5600 + s6/1200 - s*4/6 + s. Let q(t) be the third derivative of k(t). Factor q(p). -3p(p + 1)3(3p - 1)/5 Let j(x) be the second derivative of -x5/20 - 19x*4/12 - 40x*3/3 + 50x*2 - 68x. Factor j(k). -(k - 1)(k + 10)2 Let o be 53/7 + (-9)/(-21). Solve 4a*3 - 7 + 7 - 2a*2 + 14a*4 + oa*5 = 0 for a. -1, 0, 1/4 Let m(r) be the first derivative of -1/21r*3 + 0r*2 + 1/42r*4 - 2 - 3r. Let p(n) be the first derivative of m(n). Factor p(y). 2y(y - 1)/7 Let w(g) be the first derivative of -g6/30 - g5/10 - g4/12 - g + 2. Let t(a) be the first derivative of w(a). Factor t(o). -o2(o + 1)2 Let i(d) = d + 2d*4 - 11d + 8d5 + 10d*4 + 8d*3. Let v(n) = 7n*5 + 11n*4 + 7n3 - n2 - 9n. Let j(b) = -5i(b) + 6v(b). Factor j(p). 2p(p - 1)(p + 1)*2(p + 2) Let z(m) be the first derivative of 1/36m4 + 1/9m*3 + 2 - 1/60m*5 + m + 0m*2. Let h(t) be the first derivative of z(t). What is l in h(l) = 0? -1, 0, 2 Let d be (-2)/(-3) + (-56)/(-24). Solve 6k*2 - 5k*4 - 3k*4 + 8k + 2k4 + dk*5 - 11k = 0 for k. -1, 0, 1 Let q be (-65)/(-15) - 6/(-9). Let l(w) = -5w3 + 7w*2 - 9w + 1. Let h(m) = -11m3 + 13m*2 - 18m + 1. Let r(t) = ql(t) - 2h(t). Solve r(s) = 0. 1 Let v(c) = -2c3 - 11c*2 + 5c - 4. Let a(t) = t*2 - 6t + 3. Let o be a(3). Let z be v(o). Factor -2/3 + 7/3p3 - 16/3p*z + 11/3p. (p - 1)*2(7p - 2)/3 Let k be 0/(((-8)/12)/(2/(-6))). Let k - 4/3t*4 + 2t*3 + 1/3t*5 + 1/3t - 4/3t2 = 0. What is t? 0, 1 Let q(k) = k2 + 1. Suppose 0n = -3l + 3n + 18, 2l = 3n + 16. Let m be q(l). Suppose 1 + 1 - 2t2 - 5t*2 + mt = 0. Calculate t. -2/7, 1 Let q(b) be the first derivative of b6/40 - b5/20 - b*4/4 + 2b*2 + 3. Let g(r) be the second derivative of q(r). Factor g(c). 3c(c - 2)(c + 1) Find x, given that -18x + 5x2 - 7 + x2 + 31 - 3x2 = 0. 2, 4 Let p = -1 + 4. Factor 4 + 4 + 43q - 3qp - 9q*4 - 15q + 26q2. -(q - 2)(q + 1)(3q + 2)*2 Factor 9/7b - 54/7 + 12/7b2 - 3/7b*3. -3(b - 3)*2(b + 2)/7 Suppose 10t - 24 = 9t. Let m be 6/(-24)t/(-9). Factor -mp*2 - 2/3 + 4/3p. -2(p - 1)2/3 Let r(l) = 7l*2 - 12l - 19. Let a(q) = q*2 - 2q - 3. Let o(s) = 39a(s) - 6r(s). Let o(c) = 0. What is c? -1 Let y = 5 - 3. Let h = 134/3 + -44. Factor -hu - 2/3u*y + 4/3. -2(u - 1)(u + 2)/3 Let z(y) be the second derivative of 3/10y*6 + 0y*3 + 3/10y*5 + 1/14y*7 - 4y + 0y2 + 0 + 0y*4. Factor z(n). 3n*3(n + 1)(n + 2) Suppose 3f + 18 = 6. Let n be (-11)/(-3) + (-7 - f). Solve 8/3d - nd*2 - 8/3 = 0 for d. 2 Let w(a) = 8 - 2a - 4a2 + a3 + 9a + 11a2. Let n be w(-6). Solve 4v*3 - 4v4 + v4 + v*4 - 2vn = 0. 0, 1 Let i(c) = c2 + 22c + 73. Let r be i(-18). Find u such that -1/2u - r + 1/2u2 = 0. -1, 2 Factor 8i*2 + 9i*3 + 0i*4 - 12i + 3i5 + 4i*2 - 8i*4 - 4i*4. 3i(i - 2)2(i - 1)(i + 1) Let c = 11 - 9. Let r be c - (-2 + (0 - 0)). Factor 0 - 2/9g - 8/9gr - 8/9g*2 - 2/9g*5 - 4/3g*3. -2g(g + 1)4/9 Let d(w) = 19w*3 + 18w*2 + 3w - 18. Let n(m) = 7m3 + 6m*2 + m - 6. Let g(t) = 4d(t) - 11n(t). Factor g(h). -(h - 6)(h - 1)(h + 1) Let u(a) be the first derivative of a9/3528 + a8/1176 + a7/1470 + a3 - 2. Let h(y) be the third derivative of u(y). Factor h(n). 2n*3(n + 1)(3n + 2)/7 Let g(x) be the third derivative of 0x4 - 6x*2 - 4/15x*3 + 0 + 1/300x*6 + 0x + 1/50x5. Factor g(m). 2(m - 1)(m + 2)2/5 Let a(f) be the second derivative of 2f6/15 - f5/3 + f*4/9 + 2f*3/9 + 5f. Suppose a(i) = 0. Calculate i. -1/3, 0, 1 Suppose -2f + 6f = 8. Suppose r2 + r4 + fr4 - 7r*4 + 3r*4 = 0. What is r? -1, 0, 1 Let g(s) = 24s*3 - 16s*2 - 24s - 4. Let d(u) = -u*3 + u + 1. Let q(p) = -20d(p) - g(p). Determine f so that q(f) = 0. -1, 1, 4 Let v(l) = -l*4 + 4l*3 + 6l*2 - 4l - 2. Suppose 0t - 8 = -4t. Let a(b) = b*4 - 3b*3 - 5b*	{ "pile_set_name": "DM Mathematics" }
*2/o)/o)/oo/o7 assuming o is positive. o(-249/13) Simplify (b*(2/17)b)*(-2/7)/((bbbb17)/b(11/3)) assuming b is positive. b(-5945/357) Simplify ((f9/((f*(-2/3)f)/ff))(1/51))(1/8) assuming f is positive. f(13/612) Simplify (hh/(h*(6/5)/h)h)(3/5)/((h(1/9)h)/hh(3/7)) assuming h is positive. h(1796/1575) Simplify (g/g*(3/5)g)*(-3/17)g/g*(2/3)g9 assuming g is positive. g(2317/255) Simplify a*(8/15)a/((a/(aa14/a))/a)(a(3/5)/a)/(a(-24)a) assuming a is positive. a(572/15) Simplify (ssss*(1/13)s)/(s/s*(2/23))s(-1/13)/((s(-1)/ss)/s) assuming s is positive. s(117/23) Simplify ((hh(8/3))/(h/h(1/7))(h/(h/h2))(30/13))(-14) assuming h is positive. h(-4054/39) Simplify ((((x(xx8x)/x)/x)/x(x(xx/(xx*0x)x)/xxx)/x)/(x(1/6)x/x(-2/9)))50 assuming x is positive. x(3875/9) Simplify (l(-1/13)((((l/(ll/l*(-8)l))/l)/l)/l)/ll(5/6)/(l/((l/(l/l(-1/3)))/l)))38 assuming l is positive. l(-7695/13) Simplify (l(l(1/14)/l)/l)0/(l*(-2/5)l*(2/5)/l) assuming l is positive. l Simplify (((vvv(-2/7)vv)/(v(vv(-6))/v))8)(-34) assuming v is positive. v(-16592/7) Simplify ((q/(q(q/(q*(1/5)/q))/q)q)(3/10)/((((((q/(((q0q)/q)/q))/q)/qqq)/q)/q)/q)(-21/8))21 assuming q is positive. q(-10773/200) Simplify r(4/3)(r*(-1/5)/r)/r(r(-4))32 assuming r is positive. r*(-1933/15) Simplify (((u/(u/(uu/(u(-13)/u))))/u)/(u/u4))/((uu5/u)/uu(-16)) assuming u is positive. u30 Simplify uuu/((u/((u/u*(-1/10))/u))/uuu)u(u/(u/(uuu(6/5))))/u(u*(-4)u)/uu(1/3)/u assuming u is positive. u(-11/30) Simplify ((w6/((w/(w/w7))/ww))/(w*(-9)/www/(w(ww(-3))/w)w))(9/4) assuming w is positive. w9 Simplify ((ll(2/19))/l)/l6l*(-2/41)l(-1/11) assuming l is positive. l(-51709/8569) Simplify (i/((ii/(i/(ii/(iii*(11/4))i))ii)/i)i(ii14)/ii)/(i*(-4/33)i/i39) assuming i is positive. i(7243/132) Simplify l17/l11((l(ll(-7/3)l)/l)/l)(-1) assuming l is positive. l(22/3) Simplify (xxx*(-5)xx(-6)/xx)/(x17/((x(-1/47)x)/x)) assuming x is positive. x(-1176/47) Simplify ((aa12)/(a/a(-16)))/(a/a28)(1/7) assuming a is positive. a*(-1/7) Simplify f/(f/((ff/(ff(-16)/ff)f)/ff))ff*(-7)(ff8f)(-34) assuming f is positive. f(-328) Simplify p/((pp/(p/(p(2/9)p)))/p)p/p(-2/29)(p10)(-1) assuming p is positive. p(-2389/261) Simplify y31y/y32y(((yy(-12/5))/y)/y)/((y/y(-1/39))/y) assuming y is positive. y(-473/195) Simplify (k35k(-31))/(k8k/(kkkkk*(-1))k) assuming k is positive. k*(-3) Simplify (((bb6)/b)(6/5))36 assuming b is positive. b(1296/5) Simplify (n*(-29)n(-4))(7/4) assuming n is positive. n(-231/4) Simplify l(-1)lll/(ll/(lll*(4/11)))l*(-1/9)ll17/ll assuming l is positive. l(2005/99) Simplify (((z/z4z)(-42))(9/7))15 assuming z is positive. z1620 Simplify (n1/n(8/9))/(n(-2)/n(-1)) assuming n is positive. n(10/9) Simplify t(-4)tt(-1/17)t19/((t/t(-5/8))/t) assuming t is positive. t(2083/136) Simplify (g/g(-11)gg)*(-45)(ggg*(2/31)g)(3/23) assuming g is positive. g(-448905/713) Simplify i/((i*(8/7)iii)/i)i(2/93)(ii17)/i20 assuming i is positive. i(-2683/651) Simplify ((s/s9)/s(-4/9))/(s(-3)/s12) assuming s is positive. s(67/9) Simplify (fff33ff35fff)(5/2) assuming f is positive. f185 Simplify (v/v*0v*(3/8)v*(3/5)/(vv(vvv/((vv*(-5))/v)v)/v))(-1/4) assuming v is positive. v(321/160) Simplify (u*8u*3uu(1/7)uu(-2))(-1/12) assuming u is positive. u(-13/14) Simplify ((x/x7)/(xxx7/x)(xxx*(-5)/xx)/(xx(-1)x))(-4/11) assuming x is positive. x(72/11) Simplify ((((mm/(m(1/6)/mm))/m)/mm)(3/16))(-45) assuming m is positive. m(-225/32) Simplify (g/(g1g))*(2/79)g*26g/(g/g30) assuming g is positive. g(4422/79) Simplify ((c(-3/8))(1/15))(-6/31) assuming c is positive. c(3/620) Simplify b*(-6)b*(-2/13)b*(-32)bbb(-9) assuming b is positive. b(-587/13) Simplify (((t/(t*(-6)t)t)/t(-2/13))22)(2/91) assuming t is positive. t(4092/1183) Simplify (x(-1))43x*(3/2)x*(-20)xx assuming x is positive. x(-119/2) Simplify ((qqqq*(-2/7)q/(q(q1q)/q)qq)23)6 assuming q is positive. q(3588/7) Simplify (l/l(-1/6)l(3/5))15 assuming l is positive. l(53/2) Simplify t(-1/8)/ttt(-1/3)(t(2/7))(1/41) assuming t is positive. t*(-3109/6888) Simplify ((s/((ss(s1/s)/s)/s))(-47)/(s(-1)ss)(-38))(-3) assuming s is positive. s27 Simplify h(4/3)hhh*(3/5)(h/h*(-6/5)h)/(hh17/h) assuming h is positive. h(-148/15) Simplify ss*(-2/5)s*(-3/2)(ss(-10)s)/ss13s assuming s is positive. s(41/10) Simplify (q(2/17)/(q/q26))(5/4) assuming q is positive. q(2135/68) Simplify (r(-2/3)((r/r(3/2))/rrr)/rr(r(-1/6)r)/rr(1/2))(-2/55) assuming r is positive. r(-1/165) Simplify (k(-20)k(-22))/(k(2/7))12 assuming k is positive. k(-318/7) Simplify x*(-3/4)(x(x(-22/9)x)/x)/x(((x/(xx*(-12))x)/x)/x)(-27) assuming x is positive. x(-10807/36) Simplify (i/(ii(-12)/iii))/(i(-1/2)/ii)(ii(2/5)/i)1 assuming i is positive. i*(119/10) Simplify ((f/(f/(ff/(ff(-5)f))))/(f/((f((ff/((f*(-5/3)ff)/f)ff)/f)/ff)/f)ff))/(f*3f)(2/59) assuming f is positive. f(979/177) Simplify aa(-1/26)/aa((a(-6/7)/a)/a)/a(aa14a)/(a/(a/((a/a(-3/7))/a))) assuming a is positive. a(2307/182) Simplify ((((uu(-7)/u)/u)/u(3/11))(-38/3))(-39) assuming u is positive. u(-44954/11) Simplify (oo/(o/((o*16ooo)/o))oo(9/4))/(((o/(o/o(-16)))/o)/(o/o(4/9))) assuming o is positive. o(1433/36) Simplify (c*(-6/17)c/(c/(c/(cc7cc))))/(c/c4)14 assuming c is positive. c(555/17) Simplify (s/s(-36)s(-24))(-3/7) assuming s is positive. s(-39/7) Simplify ((z19)(-1/3))(-26) assuming z is positive. z(494/3) Simplify (d(-2/3)ddd3(dd/(d(-3/5)/d))/(dd/((d*6/d)/d)d))1 assuming d is positive. d(134/15) Simplify (t(-4/15)/t(2/7))/(t*2tttt(-2/87)t) assuming t is positive. t(-19882/3045) Simplify x(-21)/(xx(1/9))(x/(x*(2/7)x))(1/15) assuming x is positive. x(-6971/315) Simplify ((k(2/7))(-6/11)/(k2)(2/67))(-1/30) assuming k is positive. k(556/77385) Simplify (t/(t/(tt/t17ttt)))/t(t(3/17)/t)/ttt(-2/3)tt3 assuming t is positive. t(-535/51) Simplify ((u(-24)/u)/u(-3/10))(-2/67) assuming u is positive. u(247/335) Simplify (g/((g(-1)/g)/g))/(gg*(-14))(g/(g/(g(-4/3)/g)))(-10) assuming g is positive. g(121/3) Simplify k/(k/k11k)kk(-2/3)(k(3/4))(-2/11) assuming k is positive. k(673/66) Simplify (b(7/6)b(1/3))/(b(-17)b(4/7)/b) assuming b is positive. b(265/14) Simplify ((p/(pp(-2/17)/p))/(pp(-17)))/((p18p)/p4) assuming p is positive. p(36/17) Simplify ((j11j)/jj)/((j12j)/j)(j(5/3))(-49) assuming j is positive. j(-245/3) Simplify (o(1/4)oo)7/(o(2/49)/(oo*(3/11)o)) assuming o is positive. o*(38769/2156) Simplify (dd/(d*(1/11)dd)dd)(-35)/((d(-1/5)/d)/dd/(dd(2/7))) assuming d is positive. d(-24768/385) Simplify (sss1)(-3/2)/(s/(s/((s(-8)/s)/s))s)(-1/34) assuming s is positive. s(-81/17) Simplify w*(2/3)(w/w*(-2)w)/www/((ww(-3))/w)w(-3/5)/w assuming w is positive. w(106/15) Simplify ((g1)(-16/7)/(g*(-2)g(5/4)/g))(-3/5) assuming g is positive. g(9/28) Simplify (q/q(-7/3))/q*(-10)q/(q*(-11)q)q(q*(-1)qq)/q assuming q is positive. q(76/3) Simplify (m/(m(m/(((m/(m(m/m(2/9))/m))/m)/m))/mm))*(-25)m(1/11)/m(-4/11) assuming m is positive. m(6920/99) Simplify ((q/(q/(q/(q/q(-3/26))))q)(-7))(-1/11) assuming q is positive. q(161/286) Simplify (z(-5/3)z*(2/7)z*(2/23)z*4z)(1/4) assuming z is positive. z(895/966) Simplify (u*(-4/5)u(-18/7))/(u(-8))(5/7) assuming u is positive. u(82/35) Simplify (xx(4/9))(-30)/((x/(((x/((xx*18)/xx)*x)/	{ "pile_set_name": "DM Mathematics" }
ler: 0 or 2/1505? 0 Is 0 at least 13/550? False Which is greater: -1 or 3/11512? 3/11512 Which is bigger: 246 or 247? 247 Which is smaller: -44469 or -44470? -44470 Which is greater: 1 or -1/31? 1 Which is bigger: -0.1 or 0.17? 0.17 Is 2/197 smaller than 0? False Which is smaller: -88/3 or -29? -88/3 Which is smaller: -20591 or -20589? -20591 Which is smaller: 32026 or 32025? 32025 Which is smaller: 1/4 or -31517? -31517 Which is bigger: -473 or -1? -1 Is 75 != 72? True Are 23/31 and 0 non-equal? True Do 53 and 52 have the same value? False Which is smaller: -954 or -955? -955 Which is greater: 19/1784 or 0? 19/1784 Is -0.7 less than 342/7? True Which is greater: 3 or -51/10? 3 Which is smaller: 2/11 or -36? -36 Is -10 greater than -748/67? True Which is smaller: -948 or -946? -948 Which is smaller: 230 or 228? 228 Is 3/5 >= 3/31? True Does 14535 = 14535? True Are 2 and 36/17 equal? False Which is greater: -2/981 or -1? -2/981 Is 4189 greater than or equal to 4189? True Is -75/152 != -2/5? True Which is smaller: 5/74 or -1? -1 Which is greater: 0 or 11/2630? 11/2630 Which is greater: 0.1 or 34.71? 34.71 Which is greater: -429/17 or -24? -24 Is 1 > -5/3454? True Is 0.01 greater than -29.8? True Is -3102 at most -3103? False Which is greater: -4788 or -4789? -4788 Is -2/651 >= 0? False Which is greater: 293/11 or 27? 27 Is -44 <= -36? True Which is smaller: 89 or 91? 89 Which is bigger: 103/302 or -1/2? 103/302 Which is greater: 0 or -2/6335? 0 Which is bigger: 0 or -210? 0 Which is smaller: 1 or 62/115? 62/115 Is -267 at least as big as -268? True Is -2088 greater than or equal to -2085? False Which is smaller: -7 or 3? -7 Is -3038 less than -3038? False Is 0 <= -2/3269? False Is 14 equal to 9? False Which is smaller: -0.09 or 1/2? -0.09 Do -20/6711 and 1 have the same value? False Is -0.16 less than 5? True Which is bigger: 2 or 65/28? 65/28 Which is bigger: 190/23 or 7? 190/23 Do -256 and -254 have the same value? False Are -1 and -105/293 non-equal? True Which is greater: 4/6041 or -1? 4/6041 Are -38 and 2/11 non-equal? True Is 512 bigger than 515? False Are -5284 and -5284 non-equal? False Which is smaller: 14619/8 or 1828? 14619/8 Which is smaller: 2/3847 or 1? 2/3847 Which is smaller: 37/221 or 0? 0 Which is greater: 11/46 or 0? 11/46 Is -21050 >= -21050? True Which is smaller: 337 or 2? 2 Which is bigger: -15/151 or -1? -15/151 Which is greater: 136 or 117? 136 Is 24 >= 24? True Are 1581/4 and 394 equal? False Is 2/431 at most as big as -1? False Which is smaller: 0 or 3/205? 0 Is 51 <= 97? True Which is smaller: -2/437 or -1? -1 Which is greater: -8/225 or -1? -8/225 Which is smaller: 65/33 or 3? 65/33 Which is bigger: 605/6 or 101? 101 Is 277 <= 277? True Is 4/3 bigger than -1/9? True Do 2/157223 and 0 have the same value? False Are -673 and -673 equal? True Is 1061/5 > 211? True Is 196 > 158? True Which is bigger: -1/49 or -65/6? -1/49 Which is smaller: 476 or 1? 1 Is 1 > -5/1118? True Which is bigger: -1310 or -2621/2? -1310 Is 1/29 bigger than 2/29? False Which is smaller: 51/23 or 2? 2 Which is smaller: 85531/3 or 28511? 85531/3 Which is greater: -1/6 or -16? -1/6 Is 159/32 less than 6? True Is 3/37 != 1? True Which is smaller: -2.144 or -1? -2.144 Is 369 greater than 365? True Do -57 and 11 have the same value? False Is 0 less than -211? False Which is smaller: 4685/3 or 1562? 4685/3 Is 4188 > 4189? False Is 7/6 greater than or equal to -2/3? True Is 2200 < 3? False Which is bigger: -2 or -23/36? -23/36 Is 0.1 less than or equal to 5775? True Do -34 and -31 have different values? True Which is smaller: 0.1 or -185/29? -185/29 Which is greater: -56 or -57? -56 Is -285 != -284? True Which is greater: 213 or 178? 213 Are 328 and 0.1 nonequal? True Is 639 >= 640? False Which is greater: 7164 or 7166? 7166 Is 0 <= 4/107? True Are 96 and -2/5 unequal? True Is -0.01 greater than 276? False Which is bigger: 0 or -0.6? 0 Which is smaller: -150/911 or 1? -150/911 Which is smaller: 6929 or 6935? 6929 Which is smaller: 0 or 33/92? 0 Which is bigger: -61 or -5? -5 Is 996 less than 994? False Is 0 at most 34/427? True Is 0 equal to 6/73? False Which is smaller: -395 or -396? -396 Is 0.07 less than 38? True Which is smaller: -0.053 or 0? -0.053 Is 3 >= -4.27? True Is 1745 smaller than 1743? False Is 78/173 at most -1? False Is -123 <= -102? True Which is smaller: 0 or -3/2248? -3/2248 Which is greater: 23 or 195/8? 195/8 Do -432 and -425 have the same value? False Is -99 greater than or equal to -100? True Which is greater: -44/21 or -3? -44/21 Do -116/85 and 0 have the same value? False Which is smaller: -409 or -6? -409 Which is greater: -1135 or -1134? -1134 Is -43 bigger than -0.01? False Is -0.14178 not equal to 0.1? True Is 566 at least -2/5? True Is -170 less than or equal to -169? True Which is greater: 231 or 14? 231 Which is greater: 2/7 or 2/1071? 2/7 Which is greater: -1 or -3/1409? -3/1409 Is 6/23 greater than or equal to 1? False Which is smaller: 5/74 or -1? -1 Is -468 bigger than -468? False Which is smaller: 417 or 4? 4 Is 2774 < 2774? False Which is smaller: -1085/4 or -270? -1085/4 Is -97 >= -97? True Is -1/419 smaller than 0? True Are 0 and 65/36 non-equal? True Is 289 < 287? False Which is greater: -1412 or -1411? -1411 Which is bigger: 12339 or 12341? 12341 Are -1 and 10 nonequal? True Is -72 > -69? False Is -1 at least as big as 7/242? False Are -11/1362 and 0 nonequal? True Is 485 bigger than 486? False Which is smaller: 0.028 or -55? -55 Is -160/81 at least as big as -1? False Which is smaller: -48 or -53? -53 Is -1/868 equal to -13? False Which is smaller: 0 or 1/462? 0 Which is greater: 37 or 75/2? 75/2 Which is greater: 250 or 249? 250 Which is greater: -32 or -45? -32 Which is smaller: -24 or -254/11? -24 Which is smaller: -27/2 or -15? -15 Which is bigger: 4051 or 4049? 4051 Is -0.037 greater than or equal to -2? True Is 4/1141 at least as big as 0? True Which is smaller: -35/11 or -2? -35/11 Is -335 less than 0? True Is 7 bigger than 64/11? True Which is greater: -191 or -2/5? -2/5 Which is bigger: -1 or -11/17? -11/17 Are 2166 and 6500/3 equal? False Is -29799 != -29798? True Is -639 less than or equal to -638? True Which is smaller: -13920 or -13919? -13920 Is -138/337 less than -1? False Is -1 <= 101.4? True Which is smaller: -2471 or 3? -2471 Is 1/1079 equal to 0? False Do -354 and -0.07 have the same value? False Which is bigger: -9 or -12? -9 Which is bigger: 5 or 16? 16 Is 9738 >= 9738? True Is 262 less than or equal to 263? True Which is bigger: 6600 or 6599? 6600 Which is smaller: 1 or 1/1253? 1/1253 Is 9815 at least as big as 9815? True Is -73 at least as big as -75? True Which is smaller: -4161 or -4160? -4161 Is 19/6 less than or equal to 3? False Are 1.1 and -80 equal? False Which is smaller: 23/29 or 2? 23/29 Is 1278 at least as big as 1278? True Which is smaller: 1/3 or -16/7? -16/7 Is 1 <= 3/608? False Which is smaller: 53 or -1? -1 Which is smaller: -1 or 2/1167? -1 Which is bigger: -1437 or -1438? -1437 Which is smaller: -1 or 9/5360? -1 Are -704 and -706 equal? False Does -1061/5 = -212? False Which is smaller: -2 or -29/23? -2 Is -3/86 <= -1? False Is -5380 at least as big as -5380? True Which is greater: -1672 or -1661? -1661 Which is bigger: -212 or -223? -212 Is -320/13 smaller than -25? False Which is greater: -872 or -871? -871 Is 4/91 at least as big as -1? True Is -1609 greater than -1606? False Which is greater: -1269 or 2? 2 Which is smaller: -371 or -374? -374 Which is greater: 1 or 1/51? 1 Which is bigger: 959 or 960? 960 Which is smaller: -0.015 or 2? -0.015 Which is smaller: -6 or 0.9? -6 Which is smaller: 0 or 2.396? 0 Which is smaller: -0.197 or -0.54? -0.54 Is 505/11 equal to 45? False Is 1/41246 greater than 1? False Which is bigger: -0.3 or -286? -0.3 Which is greater: -321 or -320? -320 Are -0.0697 and -2/3 nonequal? True Is 40 smaller than 20? False Are 1/7 and 0 unequal? True Which is bigger: -185 or -1292/7? -1292/7 Which is smaller: 478 or 477? 477 Which is greater: -1 or -17/113? -17/113 Are -150 and -152 equal? False Is 0 <= 1/28406? True Is 3516 less than or equal to 3516? True Which is greater: 217/103 or 2? 217/103 Which is smaller: 1/6 or 73/4? 1/6 Which is bigg	{ "pile_set_name": "DM Mathematics" }
. Let k be 2/(m/10) - (-23)/69. Let 0 + 2x + 2/3x*k = 0. Calculate x. -3, 0 Let w(p) = 6p + 25. Let b be w(-5). Let j be (-4)/b(-25)/(-30). Suppose -j - 2/3f*2 + 4/3f = 0. What is f? 1 Let a be (-8)/(40/(-15)) + 16. Factor -21h - 166 - 4h*2 - ah + 66. -4(h + 5)2 Let x(m) = m3 + 2m*2 + m + 4. Let k be 3 + -2 + (-2 - 1). Let n be x(k). Factor 0s*n + 0s - 2/3s5 + 0s*3 + 0s*4 + 0. -2s*5/3 Let k(d) be the first derivative of 2d*3/7 + 15d*2/14 + 6d/7 + 92. Factor k(q). 3(q + 2)(2q + 1)/7 Let r(p) be the third derivative of 2p*7/105 + 2p6/15 - p5/15 - 2p4/3 - 17p*2 - 1. Factor r(u). 4u(u - 1)(u + 1)(u + 4) Let w(s) = s2 + 2s + 2. Let o be w(-2). Suppose 0 = -oh + 4. Factor -u2 + 0u*2 - 4u*3 - 2u*h + 11u*2. -4u*2(u - 2) Let g(r) be the second derivative of 5r - r2 + 0 + 0r*3 + 1/6r*4. Factor g(c). 2(c - 1)(c + 1) Let g(a) be the second derivative of 0a*3 - 23a + 2/147a7 + 2 - 2/105a*6 + 0a*5 + 0a*4 + 0a*2. Factor g(l). 4l*4(l - 1)/7 Let k = 13541/4 - 3385. Factor -1/4o5 + 1/4o*3 + 0 + 0o + ko4 - 1/4o2. -o2(o - 1)2(o + 1)/4 Let m be 948/(-553)2(-1)/8. What is o in -6/7o + 0 - 12/7o*5 - 15/7o*2 - mo*4 + 36/7o3 = 0? -2, -1/4, 0, 1 Let a(l) be the third derivative of l5/120 - 41l4/24 + 1681l*3/12 - 158l*2. Suppose a(r) = 0. Calculate r. 41 Factor -5/2l - 3l2 - 1/2l*3 + 0. -l(l + 1)(l + 5)/2 Let j(d) be the first derivative of -3/35d*5 - 3/14d*4 + 0d + d*3 - 13 - 6/7d*2. Find q such that j(q) = 0. -4, 0, 1 Let k(h) be the third derivative of 22h*2 + 0h*3 + 0h + 1/240h5 - 1/96h*4 + 0. Solve k(y) = 0. 0, 1 Let q = 86 + -82. Let t(y) be the second derivative of -1/84y*q + 3y + 0 + 0y2 - 1/42y*3. What is k in t(k) = 0? -1, 0 Let n be (-140)/(-165) + -9 + 175/21. Determine h, given that -nh*2 - 18/11 + 12/11h = 0. 3 Let s = -3 - 6. Let p(z) = -z*2 - 9z + 12. Let l be p(s). Factor lv2 + 56v*3 - 2 - 8v - 36v3 + 2. 4v(v + 1)(5v - 2) Let s = -15931 - -15931. Suppose 3/7o*3 - 3/7o + 0o2 + s = 0. Calculate o. -1, 0, 1 Let s(k) = 13k*3 - 69k*2 + 104k - 43. Let c = -2 - -7. Let f(n) = -19n3 + 103n*2 - 156n + 65. Let p(z) = cf(z) + 7s(z). Solve p(u) = 0 for u. 1, 6 Let h(o) be the second derivative of o7/56 - o6/8 + 3o5/80 + 13o4/16 - o3/4 - 3o2 + 82o. Let h(k) = 0. Calculate k. -1, 1, 2, 4 Let k(q) be the first derivative of -q7/490 + q6/140 - q*5/140 - 9q*2/2 + 13. Let x(d) be the second derivative of k(d). Factor x(g). -3g*2(g - 1)*2/7 Let z(n) = -9n*4 + 60n*3 - 42n*2 + 18. Let g(o) = 2o*2 - 7o*3 + 6o*3 + 3o*2 - 4o*2 - 1. Let j(q) = 18g(q) + z(q). Factor j(b). -3b2(b - 4)(3b - 2) Suppose -43x - 4 = -3v - 44x, 2v = -5x - 32. Solve 10/3a*v - 4/3 + 7a*2 + 4/3a - 31/3a3 = 0. -2/5, 1/2, 1, 2 Let d(g) be the second derivative of -g6/15 - 17g*5/10 + 37g*4/6 - 19g*3/3 - 3g - 100. Factor d(x). -2x(x - 1)*2(x + 19) Let z(o) be the first derivative of -o6/120 - o5/12 - o*4/3 - 2o*3/3 - 26o*2 + 18. Let f(h) be the second derivative of z(h). Factor f(s). -(s + 1)(s + 2)*2 Let s be ((-2)/36)/(25/(-20))12. Let u(g) be the third derivative of 0g + 0 - 2/3g*4 + sg*5 + 9g*2 + 1/3g*3. Factor u(x). 2(4x - 1)2 Let q be (-2)/(8/42(-840)/240). Find g such that 1/3 - 2/3gq - 1/3g*4 + 2/3g + 0g2 = 0. -1, 1 Let u(t) be the first derivative of -4t*3/3 - 20t*2 - 100t - 57. Factor u(i). -4(i + 5)2 Let p(v) = v4 - v3 + v2. Let l(d) = -4d*5 - 312d*4 - 10268d*3 - 137572d*2 - 629748d + 777924. Let g(y) = l(y) - 20p(y). Factor g(c). -4(c - 1)(c + 21)4 Let s(i) = 12i - 15. Let j(w) = -w*2 + 24w - 29. Suppose 35 = 5c - 15. Let a be (c/4)/(10/20). Let v(x) = as(x) - 3j(x). Find u such that v(u) = 0. 2 Let z(c) be the second derivative of c7/1155 - c6/220 - 2c*5/165 + 14c*2 + 9c. Let f(o) be the first derivative of z(o). Suppose f(k) = 0. Calculate k. -1, 0, 4 Let -3248/5t3 + 0t + 0 + 23t4 - 3364/5t*2 - 1/5t*5 = 0. Calculate t. -1, 0, 58 Let a(f) be the second derivative of -1/6f*5 - 15f + 0f4 + 5/126f*7 + 0f*2 + 5/18f*3 + 0 + 0f*6. Find d, given that a(d) = 0. -1, 0, 1 Let a(u) = 11u + 5. Let p be a(1). Suppose 2i - p = 4o, -2i + 3o = 2i - 12. Factor i + 3/4f*2 + 3/4f*4 + 3/2f*3 + 0f. 3f2(f + 1)*2/4 Let u(a) be the second derivative of 0a*2 + 1/2a*3 + 0 + 1/4a*4 - 12a. Suppose u(s) = 0. Calculate s. -1, 0 Let y(a) = 2a4 + 6a - 3 - 2a4 - 5a*4 + 2a3. Let m(n) = -n4 + n*3 + n - 1. Let j(i) = 12m(i) - 3y(i). Suppose j(o) = 0. What is o? -1, 1 Let v(d) be the third derivative of -d7/1575 - d6/900 + d5/450 + d4/180 + 23d*2. Factor v(x). -2x(x - 1)(x + 1)2/15 Let r(b) be the second derivative of -b5/50 - b4/15 + b3/15 + 2b2/5 - 57b. Factor r(j). -2(j - 1)(j + 1)(j + 2)/5 Let a(g) be the second derivative of g7/126 - g6/30 - g5/20 + 11g4/36 - g3/3 - 334g. Solve a(d) = 0 for d. -2, 0, 1, 3 Let w be 0/(-8) + 0 + 4. Determine s, given that -27s*3 + 7s*4 - 38s - ws4 - 6s - 4s + 72s*2 = 0. 0, 1, 4 Find k, given that 2304/7k + 3/7k3 + 144/7k*2 + 12288/7 = 0. -16 Let r be (((-1284)/(-8025))/(4/(-10)))/((-2)/15). Factor -3/2g*3 + 3/2g*4 + 1/2g*5 - 7/2g*2 + 0 + rg. g(g - 1)2(g + 2)(g + 3)/2 Let b(z) be the second derivative of -z7/147 - z6/105 + 13z5/70 + z4/42 - 16z3/7 + 36z*2/7 + 9z + 11. Solve b(h) = 0. -3, 1, 2 Let n(u) be the first derivative of u*4/14 + 8u*3/21 - 11u*2/7 + 12u/7 - 89. Factor n(p). 2(p - 1)2(p + 6)/7 Let v(a) be the first derivative of 124a3/7 + 4a*2/7 - 49. Factor v(i). 4i(93i + 2)/7 Suppose -b + u + 63 = 3b, u - 90 = -5b. Determine x, given that 3x + bx - 2 - 8 + 25x2 - 5x = 0. -1, 2/5 Let j(v) = v*2 + 14v - 11. Let q be j(-17). Let c be (4 + (2 - 4))/(q/15). Factor 0 - cs2 - 3/4s*3 - 1/4s - 1/4s4. -s(s + 1)3/4 Let x(w) be the second derivative of -w9/3780 + w*8/840 - 7w*4/6 - 13w. Let k(b) be the third derivative of x(b). Factor k(d). -4d3(d - 2) Suppose 0 = -3m - 3o - 2o - 13, 4m + 4o + 4 = 0. Let u be (m3/6)/2. Factor -4 + 6c - u - 2c*2 + 5 - 4. -2(c - 2)(c - 1) Let o = 167 - 167. Let l(u) be the second derivative of o + 0u*4 + 0u*3 + 1/15u*6 + 0u*2 + 1/10u*5 + 2u. Determine j, given that l(j) = 0. -1, 0 Let u(c) be the second derivative of -196c6/45 - 63c*5/5 + 61c*4/18 + 47c*3/6 + 3c*2 + 373c. Solve u(g) = 0 for g. -2, -3/14, 1/2 Factor 9/2q2 + 3/2q*4 - 6 - 6q*3 + 6q. 3(q - 2)2(q - 1)(q + 1)/2 Let j be ((-12)/56)/(6 - (-96)/(-14)). Let g(r) be the first derivative of -1/12r*3 + 0r*2 - 3 + 0r - jr4. Solve g(l) = 0 for l. -1/4, 0 Let b(s) be the second derivative of s7/84 - s6/24 + s5/80 + s4/24 + 17s. Solve b(l) = 0. -1/2, 0, 1, 2 Suppose 8m - 4m + g = 5, -3m + g + 9 = 0. Let s be 48/2 + (5 - m). Determine n, given that 3 + 3n*4 - 17n*2 - 16n*2 + sn2 = 0. -1, 1 Let y(i) be the second derivative of i6/3960 - 7i5/660 + 49i*4/264 + 2i*3 - 14i. Let n(a) be the second derivative of y(a). Factor n(m). (m - 7)2/11 Let c(d) be the third derivative of -d7/60 + d*6/15 - 11d5/120 + d4/24 - 8d2 - 3. Factor c(q). -q(q - 1)*2(7q - 2)/2 Suppose -1 = 8u - 49. Let g(y) be the first derivative of 0y2 + 3/8y*4 + 0y - 1/6y3 - 9 - 3/10y*5 + 1/12yu. Factor g(t). t2(t - 1)3/2 Let c = 73/95 + 12/19. Let d(s) be the first derivative of -4/5s*6 - 2/5s + 3 - 2/5s2 + 8/5s*3 - 22/25s*5 + cs*4. Determine a so that d(a) = 0. -1, -1/4, 1/3, 1 Suppose -159 + 7 = -38v. Factor -7/4q - 1/2 - 5/4q*3 - 9/4q*2 - 1/4qv. -(q + 1)3(q + 2)/4 Let a = -77/300 - -4/15. Let y(i) be the second derivative of 0i*3 + ai*5 - i + 0 + 0i*2 - 1/60i*4. Solve y(r) = 0. 0, 1 Let x be 3 + 1 + (20 - 22). Factor -2m*x + 4m + 0m + m + 2 - 5m*3. -(m - 1)(m + 1)(5m + 2) Let j be 4(-13)/(-156)(-2 + 2). Let m(q) be the first derivative of 0q2 + 1/27q*3 + jq + 3. Solve m(v) = 0 for v. 0 Factor 2/15a2 + 0 + 8/15a. 2a(a + 4)/	{ "pile_set_name": "DM Mathematics" }
ighest common factor of 214 and 23637263. 107 Calculate the greatest common divisor of 187808 and 10656. 32 Calculate the highest common factor of 57313221 and 66. 3 What is the highest common divisor of 7889 and 2552287? 23 What is the highest common divisor of 25 and 38998055? 5 Calculate the highest common factor of 1516 and 90656. 4 Calculate the highest common divisor of 101038 and 1058792. 98 What is the greatest common divisor of 578 and 8356? 2 What is the greatest common factor of 320 and 1500256? 32 Calculate the highest common divisor of 63437 and 6516710. 5767 What is the greatest common divisor of 716267 and 7784? 139 Calculate the greatest common divisor of 9051939 and 15096. 1887 Calculate the greatest common factor of 13556020 and 36058. 298 Calculate the greatest common factor of 2790 and 452330. 10 What is the greatest common factor of 1279 and 55115947? 1279 Calculate the greatest common factor of 10340 and 86292. 188 What is the highest common divisor of 5577 and 2023307? 143 What is the highest common divisor of 897736 and 1836? 68 Calculate the highest common factor of 2996 and 2507. 1 What is the greatest common factor of 16770 and 1498743285? 8385 Calculate the greatest common factor of 87280 and 430. 10 Calculate the greatest common divisor of 5240 and 6776761. 131 What is the highest common factor of 410 and 18901615? 205 What is the highest common factor of 173232 and 275184? 432 What is the highest common factor of 2194054 and 60412? 2746 Calculate the highest common divisor of 2107 and 192236359. 2107 Calculate the highest common factor of 2619092795 and 605. 605 Calculate the greatest common factor of 3605 and 61389545. 3605 What is the greatest common divisor of 507 and 1741389? 39 What is the highest common factor of 5 and 150833? 1 Calculate the greatest common divisor of 2287152 and 4932. 36 Calculate the highest common divisor of 1404 and 102544. 52 What is the greatest common divisor of 56 and 43744688? 8 What is the highest common factor of 21441905 and 9325? 1865 Calculate the highest common factor of 613809 and 6461. 7 What is the highest common divisor of 100483851 and 1521? 507 Calculate the highest common divisor of 14366924 and 156. 52 Calculate the greatest common divisor of 4583256 and 4968. 552 What is the greatest common divisor of 1410 and 39399066? 282 Calculate the highest common divisor of 9826 and 277474. 34 Calculate the greatest common divisor of 73094643 and 1215. 243 What is the highest common divisor of 3297165 and 8740? 2185 Calculate the highest common factor of 489 and 364746567. 489 What is the greatest common divisor of 10887 and 11889744? 57 Calculate the highest common factor of 25 and 135193600. 25 What is the highest common factor of 1255 and 31834330? 1255 Calculate the highest common factor of 68970 and 202350. 570 What is the greatest common factor of 33672 and 115782? 138 What is the greatest common factor of 1633137150 and 150? 150 What is the greatest common factor of 201542820 and 2006? 2006 What is the highest common divisor of 1795 and 709059105? 1795 What is the highest common divisor of 14 and 21583310? 14 Calculate the greatest common factor of 82345173 and 12. 3 Calculate the greatest common divisor of 1160082 and 185262. 462 What is the highest common divisor of 164 and 578879? 41 What is the highest common divisor of 77259 and 11531? 13 What is the greatest common factor of 11837 and 10583? 19 Calculate the highest common factor of 297 and 45961641. 297 Calculate the highest common divisor of 41693197 and 1904. 119 Calculate the highest common divisor of 50897166 and 130002. 2766 What is the highest common factor of 1334 and 93815551? 667 What is the greatest common factor of 1600 and 39115100? 100 Calculate the highest common factor of 8862074 and 78. 26 What is the highest common divisor of 1298 and 397542? 118 Calculate the greatest common divisor of 1417860 and 5040. 180 What is the highest common factor of 304239 and 155751? 807 What is the greatest common divisor of 2618 and 643706? 14 Calculate the greatest common factor of 18290807 and 7058. 3529 Calculate the greatest common divisor of 38683450 and 4650. 50 Calculate the greatest common divisor of 36 and 20065887. 9 What is the greatest common factor of 115182756 and 2808? 1404 Calculate the highest common factor of 2581 and 525654203. 2581 Calculate the highest common divisor of 3481456 and 7336. 1048 Calculate the highest common factor of 5639579 and 8514. 473 Calculate the highest common divisor of 894191710 and 5. 5 Calculate the highest common factor of 119 and 55779703. 119 What is the highest common factor of 22440 and 76886172? 2244 What is the highest common factor of 3728976 and 3144? 24 Calculate the highest common factor of 216 and 1524336. 24 Calculate the greatest common factor of 2007160 and 16680. 5560 Calculate the highest common divisor of 18216144 and 2264. 2264 Calculate the greatest common factor of 231 and 4086621. 231 Calculate the greatest common factor of 18368928 and 4896. 288 Calculate the highest common factor of 13247730 and 810. 90 What is the highest common factor of 20604 and 1718292? 204 Calculate the greatest common factor of 16605 and 1592728353. 3321 What is the highest common divisor of 2711988 and 1116? 36 What is the greatest common factor of 2052 and 3715? 1 Calculate the greatest common factor of 38005625 and 490. 245 Calculate the highest common divisor of 1435 and 789537. 287 What is the highest common divisor of 44656 and 66032? 16 What is the greatest common factor of 392656 and 351670? 506 Calculate the greatest common divisor of 6369114 and 24978. 138 What is the highest common factor of 1328200 and 9000? 200 Calculate the highest common factor of 450 and 632754. 18 What is the highest common factor of 2112 and 130936? 8 Calculate the greatest common divisor of 2214 and 9797442. 246 Calculate the greatest common factor of 7638 and 330942. 114 Calculate the highest common divisor of 532635696 and 25596. 8532 Calculate the highest common divisor of 216161 and 33907115. 5027 Calculate the highest common divisor of 42659085 and 15960. 1995 Calculate the greatest common factor of 22341114 and 72. 18 Calculate the greatest common divisor of 17635 and 293195. 5 What is the greatest common factor of 24752 and 43056? 208 What is the greatest common factor of 17819072 and 26468? 2036 Calculate the highest common factor of 315235 and 9104175. 4705 Calculate the highest common factor of 103003 and 1368823. 1241 Calculate the greatest common factor of 102744 and 5373. 9 Calculate the highest common divisor of 773843189 and 21. 7 Calculate the greatest common divisor of 1596883 and 703. 37 What is the greatest common factor of 32 and 184876472? 8 What is the highest common divisor of 280 and 1302520? 40 Calculate the highest common divisor of 52029 and 192741. 123 Calculate the greatest common factor of 37 and 38851. 1 Calculate the highest common divisor of 433213891 and 583. 583 Calculate the highest common divisor of 98237 and 43618. 193 What is the highest common divisor of 42487589 and 692? 173 What is the highest common divisor of 14 and 196521367? 7 Calculate the greatest common divisor of 179290920 and 219. 219 What is the greatest common divisor of 48612586 and 22? 22 Calculate the greatest common factor of 2533 and 1531. 1 Calculate the highest common factor of 4 and 14494240. 4 What is the highest common factor of 2965 and 595045? 5 Calculate the greatest common factor of 83695 and 46693. 881 What is the highest common factor of 923312 and 115? 23 What is the highest common divisor of 87583851 and 27? 9 Calculate the greatest common factor of 164936 and 7391. 389 What is the greatest common divisor of 479346 and 6295569? 2373 What is the greatest common factor of 128809 and 130067? 17 Calculate the highest common divisor of 8126 and 49035869. 239 What is the greatest common divisor of 629 and 1502828186? 629 What is the highest common factor of 65661 and 6428199? 129 What is the highest common divisor of 24951641 and 65? 13 What is the highest common factor of 156375 and 99? 9 Calculate the greatest common divisor of 1564 and 667759. 23 Calculate the highes	{ "pile_set_name": "DM Mathematics" }
u) wrt u? -144u Let o(b) = -2b - 6. Let c be o(-4). Let h = 0 + c. Find the third derivative of 0q4 + 6q*2 - 3q*h - 2q4 + q4 wrt q. -24q Let m(j) = 10j*4 - 6j*3 + 3j*2 - 6j. Let o(h) = 10h4 - 5h*3 + 3h*2 - 5h. Let t(a) = -5m(a) + 6o(a). Find the third derivative of t(u) wrt u. 240u Let o = 93 - 93. Let u(h) be the second derivative of 2h + 0h3 + h2 + 0h*4 + o - 1/20h*5. Differentiate u(d) with respect to d. -3d*2 Find the second derivative of 2q*4 - 13q - q*4 - 6q5 - q4 wrt q. -120q3 Let p(q) be the third derivative of 13q*5/60 + 2q3/3 - q2. Let t(z) = 6z2 + 2. Let i(u) = 3p(u) - 7t(u). What is the derivative of i(v) wrt v? -6v Let u(o) be the second derivative of -o*6/15 - 2o*3 - 4o. What is the second derivative of u(j) wrt j? -24j2 Let u(i) be the third derivative of i7/210 - i6/60 - 17i4/24 + i2 + 3. Find the second derivative of u(j) wrt j. 12j2 - 12j Suppose 3q + 5 = -7. Let s(c) = 2c*3 - 9c2 + 1. Let i(g) = g3 - 4g2. Let j(v) = qs(v) + 9i(v). What is the derivative of j(l) wrt l? 3l2 Let v(s) = s3 + 2s2 - 1. Suppose -12 = 2c + 6q - 2q, c + 5q = -12. Let n(m) = -m2. Let z(p) = cn(p) - v(p). What is the derivative of z(l) wrt l? -3l2 Let o(x) be the third derivative of 2x*7/105 - 7x*4/24 - 8x*2. Find the second derivative of o(p) wrt p. 48p*2 Suppose 4c = -0x + x - 3, -2x - 4c + 18 = 0. Let q = -5 + x. Find the second derivative of -qi + 3i - 2i4 - i4 - 2i wrt i. -36i*2 Find the second derivative of -23y*3 - 17y*5 + 6y*3 + 39y + 17y3 wrt y. -340y*3 Let a(z) be the first derivative of -59z*5/5 + 45z*2/2 - 2. What is the second derivative of a(u) wrt u? -708u*2 Let k(a) be the second derivative of -11a*5/20 + 7a*3/3 - 18a. Find the second derivative of k(f) wrt f. -66f Let g(x) = x. Let u(n) = 24n - 7. Let v(f) = -5g(f) + u(f). Find the first derivative of v(k) wrt k. 19 Let x(a) be the third derivative of 0 + 0a*3 + 1/12a*4 + 1/60a*5 + 3a*2 + 0a. Find the second derivative of x(z) wrt z. 2 Let n(q) = q - 1. Let o(w) = w - 5w - w4 + 7 + 0w. Let y(d) = -4n(d) - o(d). What is the derivative of y(l) wrt l? 4l*3 Let t(b) = 24b*2 + 2b + 5. Let f(v) = 25v2 + 2v + 3. Let w(j) = -3f(j) + 4t(j). What is the first derivative of w(c) wrt c? 42c + 2 Let a = 53 - 25. Find the third derivative of 28j + j*5 - aj - 5j2 wrt j. 60j*2 Let a = 170 - 2039/12. Let v(m) be the second derivative of 0 + 0m*2 + 1/2m*3 - m + am4. What is the second derivative of v(j) wrt j? 2 Let o(h) = h5 + h3 + h2 - h. Let v(r) = -6r5 - 3r*3 - 12r*2 + 3r. Let t(m) = -3o(m) - v(m). What is the third derivative of t(s) wrt s? 180s*2 Let p(w) be the second derivative of -17w6/30 - w3 + 9w. What is the second derivative of p(b) wrt b? -204b*2 Let u = 18 + -14. Find the second derivative of 0h - 2h4 - h + uh wrt h. -24h2 Let w(u) be the third derivative of -13u*9/504 - 7u*5/60 + 13u*2. What is the third derivative of w(n) wrt n? -1560n3 Let o(s) be the first derivative of -s2/2 - 1. Let y(m) = -6 + 4 - 1 - 5m. Let g(j) = 6o(j) - y(j). Find the first derivative of g(b) wrt b. -1 What is the second derivative of -124y2 - 16y + 124y2 - 22y*3 wrt y? -132y Suppose -i = -4i + 6. Find the second derivative of 0g*4 + 0g - 2g + ig*4 wrt g. 24g*2 Let b(g) be the third derivative of 13g*7/210 - 7g*5/30 + 2g*2. What is the third derivative of b(x) wrt x? 312x Let i(q) be the first derivative of 0q - 3/2q*4 + 10 + 3/2q*2 + 0q*3. What is the second derivative of i(v) wrt v? -36v Let o(y) be the second derivative of -7/12y4 + 7/2y*2 + 0y*3 + 3y + 0. What is the first derivative of o(w) wrt w? -14w Let p(g) be the first derivative of g5/20 + 7g*2/2 + 7g + 8. Let s(r) be the first derivative of p(r). Differentiate s(h) wrt h. 3h2 Let j(y) = 19y - 18. Let q(d) = -18d + 17. Let f(s) = 6j(s) + 7q(s). Differentiate f(v) with respect to v. -12 Suppose -10 - 25 = -5j. Let d(b) = 2b3 - 4b*2 + 7. Let y(o) = -3o*3 + 7o*2 - 13. Let h(n) = jd(n) + 4y(n). Differentiate h(r) with respect to r. 6r*2 Let t(r) = 5r*4 + 2r*2 + 2r - 3. Let d(l) = l4 - l2 - l - 1. Let i(s) = 2d(s) + t(s). What is the first derivative of i(f) wrt f? 28f*3 Let j(k) be the first derivative of 0k + 1 + 0k2 - 1/5k*5 + 1/3k*3 + 0k*4. What is the third derivative of j(s) wrt s? -24s Let x(p) be the first derivative of 7p3 - 12p - 8. Find the first derivative of x(i) wrt i. 42i Let h(i) be the third derivative of -2i7/105 - i4/8 + 3i2. What is the second derivative of h(z) wrt z? -48z*2 Let l = 11 - -2. Find the first derivative of g - 7g + l + 0g - 4 wrt g. -6 Let g = -55 - -91. Differentiate -4 - 3 + 32q - gq wrt q. -4 Suppose 3k + 2 = 4k. Find the third derivative of -ku*6 + 3u*2 + 3u*2 + 3u*6 + 2u*6 wrt u. 360u*3 Let v be 42/10 - 5/25. Suppose -3l = -l. What is the third derivative of -z*2 + lz - 2zv + 0z wrt z? -48z Let o(p) = -p5 + p4 + p3 + p. Let d(i) = -17i*5 + 4i*4 + 4i*3 - 2i. Let u(y) = -d(y) + 4o(y). Find the second derivative of u(q) wrt q. 260q*3 Let k(j) = 2j - 12. Let v be k(8). What is the third derivative of -vr2 - 10r*3 + 6r*2 + 8r*3 wrt r? -12 Let m(d) be the first derivative of 0d*2 + 3 - 9d - 1/3d3. Find the first derivative of m(f) wrt f. -2f Let k(h) = -h*3 - 2h - 5. Let g be (-1)/(-4)4 - 0. Let f(r) = 1 - 5 + 3. Let s(n) = gk(n) - 5f(n). Find the second derivative of s(c) wrt c. -6c Suppose 1 - 4 = -z. What is the derivative of -6d4 - d3 - 1 + dz + 2d*4 wrt d? -16d*3 Let b(t) be the second derivative of 0t*3 + 7/20t*5 + 6t - 5/12t4 + 0t*2 + 0. What is the third derivative of b(u) wrt u? 42 Let r(q) be the third derivative of 11q*5/20 - 19q*3/6 + 19q*2 - 2. Differentiate r(b) with respect to b. 66b Let d(p) = 6p4 - 9p*2 + 2. Let y(o) = -2 - 6o*2 - 3o*4 + 10o*2 + 1. Let r(z) = 4d(z) + 9y(z). Find the first derivative of r(h) wrt h. -12h*3 Let v(j) be the first derivative of 11j7/7 + j3 - 8. Find the third derivative of v(r) wrt r. 1320r3 Let j(i) = -i3 - 1. Let a(g) = 13g*3 + 10g*2 + 9. Let f(b) = 2a(b) + 18j(b). Find the third derivative of f(x) wrt x. 48 Differentiate -13y - 25y + 58 - 118 + 69 wrt y. -38 Let f be 8/(-4) - -8 - 2. What is the third derivative of -i2 + 4i*2 - 3i*4 - 6i*5 + 3i*f wrt i? -360i2 Let c(q) be the second derivative of q11/7920 + q7/630 + q4/6 - 6q. Let z(x) be the third derivative of c(x). Find the third derivative of z(l) wrt l. 840l*3 Let a(w) be the third derivative of -1/42w*7 + 0w*4 + 0 + 0w - 1/60w5 + 0w*3 + 0w*6 + 6w*2. What is the third derivative of a(r) wrt r? -120r What is the third derivative of -19h2 + 0h*2 - 8h*3 - 7h*2 + 0h*3 wrt h? -48 Let t = -23 - -27. Let x(m) = 2m*2 + m - 1. Let k be x(1). Find the third derivative of -3st + sk - 10 + 10 wrt s. -72s Let d(s) = s3 + 2s*2 - 2s - 1. Let b be d(-3). Let y = 8 + b. What is the second derivative of yh2 + h3 - 3h - 4h2 wrt h? 6h What is the second derivative of 20z + 2 + 20z - 4 + 39z4 - 39z wrt z? 468z2 Suppose 3n + 0n = 0. Differentiate 0x - 5 + 2 + nx + 2x with respect to x. 2 What is the third derivative of 12x5 - 20x*5 + 5x*2 - 16x*2 wrt x? -480x*2 Let t(r) be the first derivative of -2r*3 + 5 + 0r + 1/2r2. Find the second derivative of t(n) wrt n. -12 Suppose -25 = -7u + 2u. Find the third derivative of 13r*5 - 13r*5 - ur6 + r2 wrt r. -600r3 Let d(p) be the first derivative of 2p*5/5 + 7p*3/3 - 1. Find the third derivative of d(h) wrt h. 48h Let a(i) = i*3 + 3i*2 - 3i. Let l be a(-3). Suppose 0v - l = -3v. Differentiate 3 - 4c3 - 1 + 3c*v + 1 wrt c. -3c*2 Let c = 4 + 0. Suppose -q + 2q = c. What is the first derivative of 0h4 - 3 + 2 + hq wrt h? 4h*3 Suppose r + 4l - 3 = -13, -5l = 15. Suppose 4a - 2f = 10, -5a - 7f - 10 = -2f. What is the first derivative of r*h - a + 5 - 2 wrt h? 2 Let k = -52	{ "pile_set_name": "DM Mathematics" }
8. Solve 2d - kd = y for d. -3 Suppose -5h - 5c + 805 = 0, 44c - 47c + 167 = h. Solve 0 = -35w + h - 123 for w. 1 Let u be (-51)/(-3) + (0 + 1 - 4). Let q be (36/u)/(6(-3)/(-84)). Suppose -3h + 2h + 14 = 4l, 0 = 4l - q. Solve -g = h - 0 for g. -2 Let f be (2/((-8)/4))/((-5)/1005). Solve -8 = 205i - fi for i. -2 Let i be 291/331 - 2/(-11). Suppose 8l - 19l + 55 = 0. Solve -2s + ls = -i for s. -3 Suppose -1628 - 4662 + 140 = -82q. Solve 68z - 14 = qz for z. -2 Let c be ((-4)/2)/((-4)/16). Suppose 0 = -36m + cm + 56. Solve -3 = mv - 9 for v. 3 Let b(g) = -121g*3 - 44 + 23g + 122g3 - 13g*2 - 8g*2. Let l be b(20). Solve -l = -4h - 0h for h. 4 Let s(d) = -5d + 3. Let x(j) = -4j + 3. Suppose -4m = 3g + 23, m + 3 = 2g - 0. Let y(v) = ms(v) + 6x(v). Let h be y(7). Solve -c = c + h for c. -5 Suppose 3k = -12, -2k + 10 - 38 = -5n. Let v be 6/3455 + (-11670)/(-690). Suppose o = -ni + v, 2i - 8 = o - 1. Solve -l + 2 = o for l. 1 Suppose -16v + 3 = -11v - 3y, -5v + 23 = 2y. Suppose vu + 5g - 88 = 0, 5u - 6u = -3g - 6. Solve u - 23 = -2z for z. 1 Let z(v) = -v + 19. Let j be z(-9). Let c be 1246/j - (-1)/2. Let x = -40 + c. Solve -9 = -2u + xu for u. -3 Let j(k) = k3 + 9k*2 + 12k + 12. Let m be j(-7). Suppose -8h - m = -10. Let i be (64/(-48))/(h/3). Solve -w + 0 = i for w. -2 Let h = -1 + 3. Let k be (3/6)/(3/36) - h. Solve -4 - k = 4c for c. -2 Let h(o) = 105 + 251o - 135o - 132o. Let m be h(6). Solve 0 = -3y + m for y. 3 Suppose 4m + 636 = -98y + 102y, -2m + 330 = 2y. Solve -122w + 40 = -yw for w. -1 Suppose -g + 3 + 7 = 3x, -2g + 20 = -4x. Let m(b) = 5b2 - 255b + 2340. Let t be m(12). Solve t = 15i - gi + 15 for i. -3 Suppose -22g + 306 = -4g. Suppose 0 = 4b + 8, -2d + g = -5b + 7. Solve 0 = -s - d + 3 for s. 3 Let d(q) = 11q + 39. Let h(n) = -141n - 507. Let w(f) = -27d(f) - 2h(f). Let k be w(-3). Solve -7u + k = -u for u. 1 Suppose -39 = 8n - 11n + x, 0 = 4x + 12. Suppose 0 = no - 13o + 2. Solve o = 5k - 3 for k. 1 Let c be (4305/(-82))/(3/(-8)). Let d = c + -140. Solve -t + 6t + 5 = d for t. -1 Suppose -90m + 38 + 238 = -354. Solve mw - 386 = -379 for w. 1 Let j be 14/63 + (-16)/9-1. Suppose -jo + 2d + 5 - 3 = 0, d = 2. Solve -ox = 2x - 10 for x. 2 Let t be (-1729)/(-195) - 16/(-120). Solve ts + 3707 = 3698 for s. -1 Suppose 3w = -3, 0q - 2q + 23 = -5w. Let h be ((-65)/(-39))/(13/q). Solve -4 - 21 = hy for y. -5 Let b = 856 - 793. Suppose 17s - b = 5. Solve -3u = -7u + s for u. 1 Let l be 13(-213)/9. Let t = l + 96. Solve 22w - t = 17w for w. 5 Let v(z) = z*3 + 102z*2 + 105z + 692. Let l be v(-101). Solve l = -15q + 51q for q. 8 Let q = 72 - 34. Let k = q - 36. Solve kv = 4v + 8 for v. -4 Let a(d) = d*2. Let n be a(-2). Suppose nv + 0 - 8 = 0. Suppose 3z - 2i + 14 = 3i, -2z + 8 = i. Solve -4h = -vh - z for h. 1 Suppose -26n + 360 = -18n. Solve -19b + n = -10b for b. 5 Suppose -52 = -5j - 3h + 48, 100 = 5j - 5h. Solve jw = -37 - 23 for w. -3 Let w(u) = -u2 + 3u + 2. Let b be w(-3). Let l = -53 - -38. Let v = l - b. Solve v = -2f + f for f. -1 Let g = 30 - 18. Let l(k) = 4k*3 - 2k + 1. Let b(a) = a*3 - 8a*2 - 11a + 19. Let f be b(9). Let x be l(f). Solve g = -xy + 7y for y. 3 Let a(g) = -2g - 46. Let b(l) = -14l + 19. Let v(f) = 70f - 96. Let q(i) = 11b(i) + 2v(i). Let d be q(3). Let r be a(d). Solve -r = -h - h for h. 2 Let l = -35 - 11. Suppose -24h + 14h = -620. Let o = l + h. Solve 0g + o = -4g for g. -4 Let y(w) = -2w*2 + 11w. Let v(t) = t*2 - t - 1. Let m(a) = -3v(a) - y(a). Let x be m(-8). Solve -xf = 15 - 0 for f. -5 Let k(r) = -48r - 12. Let l be k(3). Let u be l/(-15) - (4 - (-144)/(-40)). Solve 0 = 6m - 22 + u for m. 2 Let z(u) = 32u*2 - 15u + 109. Let j be z(5). Let f = j + -830. Solve fr + r = 2r for r. 0 Let p(f) = 136f - 2849. Let s be p(21). Solve 0 = sx + 4x - 11 for x. 1 Suppose -7m = -3m. Let n be (3 + -2 - (m - 0)) + 55. Let a = n - 53. Solve 0 = -ao + 5o - 2 for o. 1 Let b(a) be the first derivative of a4/4 - a3 - 13a*2/2 - 30a + 141. Let f be b(6). Solve -4t - t - 10 = f for t. -2 Suppose 56058 - 9627 = 201q. Solve q = -4v + 243 for v. 3 Let i(b) = -b2 - b - 18. Suppose -16k = -21k. Let r be i(k). Let y = r + 24. Solve -p - 15 = -yp for p. 3 Let h(a) = -a*3 + 10a*2 + 21a - 74. Let j be h(11). Solve 42 = 6k + j for k. 1 Let f(p) = p2 + 5p - 29. Let v be f(-9). Suppose 2k - 17 = -v. Suppose -6 - 14 = -kw. Solve 0 = -wa - 18 + 2 for a. -4 Let g = -1 + 6. Let s(i) = i3 - 5i*2 + 8i - 3. Let o(n) = 2n + 2. Let t be o(0). Let z be s(t). Solve -gy - z + 26 = 0 for y. 5 Suppose -4w = -6w + 12. Suppose 0 = -wu + 17 - 5. Solve -v - v - u = 0 for v. -1 Suppose -7u - 11 - 2159 = 0. Let q = -304 - u. Solve -2p = -0 + q for p. -3 Let o(y) = 34y*2 + 53y + 337. Let a be o(-7). Solve 1600 - a = -8n for n. 4 Suppose -q = -4q. Let y be 4/(16/(-12)) - -8. Suppose 2r - 6 = -0r - 2o, -5r + yo = -25. Solve z + qz = -r for z. -4 Suppose -5s = 37 - 62. Suppose -2y + s = 3. Suppose 4l - 4u - 4 = 0, -4u + 41 = l + 4l. Solve -2r - l + y = 0 for r. -2 Let i(o) = o3 + 7o*2 + o + 19. Let k be i(-7). Let j be (k/7)/((-6)/(-21)). Suppose 0 = 5u - 5 - 10. Solve -ud + jd - 3 = 0 for d. 1 Let u be (19 - 14) + 781 - (-1 + 11). Solve 6o = 734 - u for o. -7 Let s(z) = z3 + 5z*2 - 15z + 6. Let w be s(-7). Let h = 28 - w. Solve 4 = 14y - hy for y. -4 Let f(c) = 3102 - 21c - 2c*2 + 70c - 3122. Let z = -30 + 54. Let r be f(z). Solve 0 = ra - 3a + 3 for a. -3 Let i be ((-4)/(-8))/((-7)/(-532)). Suppose 0 = 3q - 2q - 43. Let h = q - i. Solve 0 = hk - k for k. 0 Let b be -136 - 54/(-10). Let a = b - -135. Solve 5q = -26 + a for q. -5 Let f be ((-1904)/35)/((-1038)/(-210) + -5). Let o = 968 - f. Solve 3u - o = -19 for u. -1 Suppose x = -3l + 29, -l - 81 = -2x - 16. Suppose 0 = -15n + 31n - x. Suppose -2o = -2 - 18. Solve 4p - np + o = 0 for p. -5 Suppose 2128 = -0q + 8q. Let o = q - 242. Solve -oc + 20c + 8 = 0 for c. 2 Let m = 1491 - 1491. Solve 2n + 17 - 15 = m for n. -1 Suppose 3p + 1 = 13, -5n + 205 = -5p. Suppose 36 = 54i - ni. Solve v = -0v - i for v. -4 Let d(v) = v*3 + v - 8. Let m be (-2 - 1) + 7 + 6/(-3). Let s be d(m). Solve -5 = sy - 1 for y. -2 Let p(h) be the third derivative of h*5/30 - 3h*4/8 - 37h*3/6 - 10h*2. Let o be p(-6). Let v = o - 66. Solve -v + 7 = 4n for n. -4 Suppose 516 = 21l - 1122. Solve l - 295 = -31j for j. 7 Let u = 11 + -17. Let o be u/(-1) + 3/(-3). Let d(k) = 14k2 - 55k - 2. Let j be d(4). Solve 3f = of - j for f. 1 Let y = 143 - 84. Let a = y - 52. Solve 0 = -2h + a - 7 for h. 0 Suppose -43803s = -43778s - 7275. Solve 301r - sr = 20 for r. 2 Let t(z) = -2z*2 - 89z + 844. Let p be t(-52). Solve -46r - 18 = -pr for r. 1 Suppose 2a = -d + 51, -3a - 152d + 149d = -81. Solve 23w = 27w + a for w. -6 Let r(g) be the second derivative of g*3/3 + 9g*2/2 + 2g + 9. Let k be r(-3). Let z be 20/(1 - -1) + -1. Solve 2u + z = k for u. -3 Let h(u) = u + 228 - 211 + 0u. Let s be h(-12). Suppose -5o + o = -32. Solve -o = -si + 2 for i. 2 Suppose 1059 = 3k + 1047. Let m be 0/(3(-2)/(-3)). Solve m = -8a + ka + 16 for a. 4 Let s be 358/4 - (-6)/12. Suppose 5w - 4x + x = 455, -5w + 445 = -x. Let g = s - w. Solve -gn - 2 = 6 for n. -4 Let w(t) = t + 7. Let b be w(-5). Suppose 2z = -5l + 50, 4z + 85l - 88 = 81l. Let x be (-41)/410 - (-2)/z. Solve xk + bk = 4 for k. 2 Suppose 3x + 14x = -27x + 880. Solve 40f - xf + 60 = 0 for f. -3 Suppose -6r - 4 = -7r + 5a, -2a + 32 = 2r. Suppose 26n - 7n + rn = 0. Solve n - 25 = 5h for h. -5 Suppose 4n - 8n = 5m + 40, -2n = 5m + 20. Let j be (-5)/250n + (-24)/(-5). Solve -10 = 10s - js for s. -2 Let m(l) = 3l*3 + 126l*2 + 56. Let t be m(-42). Solve 0 = -50u + tu for u. 0 Let z = -46 + 58. Suppose -za - 4 = -28. Solve 4g + 4 = ag for g. -2 Let c be ((-22)/24 + 3/12)/((-13)/1287). Solve 83h - 51 = ch for h. 3 Suppose -27j + 17j = -26j. Let h = 5 + -3. Solve -3l + hl + 1 = j for l. 1 Let x(a) = -17a - 591. Let g be x(-45). Solve -gi + 172i +	{ "pile_set_name": "DM Mathematics" }
What is ((-2)/20)/((-23)/1150)? 5 Calculate 3 - ((-264)/36 - -11). -2/3 What is the value of (22/4)/(59 - 50 - (-95)/(-10))? -11 264/3967/(-2) + 4 5/3 Evaluate (-17)/(-3) + (-1350)/810. 4 (-1131847)/45616 + 3/32-2 -25 What is 2/307869/(-172) + 31? -1/20 What is 2/(-40)(10 + (-288)/24)? 1/10 Evaluate ((-76)/(-16))/((-38)/(-8) + (26 - 31)). -19 Calculate (-72417)/1912 - (-38)/1. 1/8 (-1983)/1053 + 2 + (-132)/858 -1/27 Calculate (-11(-8)/168)/((-224)/(-784)). 11/6 Calculate (-9 - 225/(-18))2. 7 What is the value of (12/7)/(11/(-77))? -12 148/18426 - (-126)/1449 21 What is (-24 + 9)/(15 + -17 + 1)? 15 What is ((-5)/(-15))/(-2 + (-429)/(-216))? -24 What is the value of (12/(-288)-18)/(7/(-140))? -15 What is the value of -32 + 42 - 245/25? 1/5 Evaluate 4 - (183/6 + (-11)/22). -26 Evaluate (-68)/((-748)/(-363)) + 25. -8 Calculate (16/28(-28)/3)/(60/90). -8 What is -4 + -1 + -10 + (-2268)/(-168)? -3/2 392084/(-5096) - -77 - (-2)/(-13)-1 3/14 (-4 - (-329)/21)/(75/90) 14 (-966)/(-630) + (-8)/6 1/5 (5 - (6 - 9)) + (-32)/(-8) 12 Evaluate (2 - (-60)/(-8)) + 3 + 3/2. -1 5985/5670 - 1/(-9) 7/6 Calculate 27 - 4(-130)/(-20). 1 2700/12375 - (-4)/(-10) -2/11 Calculate 786/(-84) - (-5 + -1 + 0). 3/7 Calculate (13 + 1 + -1)(238 + -237). 13 (1/21)/(-10 - 344/(-24) - 4) 1/7 What is -2(-44)/(-408) + 17/((-867)/6)? -1/3 What is (0 + -105)(-1482)/(-10374)? -15 What is the value of -6 - -42 - (-20988)/(-660)? 21/5 What is the value of ((-8)/(-70))/(612/7650)14? 20 (-2)/(-9) - (12 - 724/63) -2/7 What is the value of (-42)/(-2)(-14)/(-42) + (6 - -2)? 15 What is 134/(-272) + (-25)/(8075/(-38))? -3/8 Calculate (-23936)/(-2380) + (-6)/105. 10 What is the value of (-6 + 21/2)(112/(-1476))/(-7)? 2/41 Calculate -1 + 3 + ((-16)/(-16))/(-1 - -2). 3 What is (-25)/5 + -25 + (-105)/(-15)? -23 -6 - (453/(-72) - 9/27) 5/8 What is -2(-12)/(-8)(-1 + -16)/51? 1 Calculate (-7119)/(-5085) - (3 + (-68)/(-45)). -28/9 What is ((-846)/658 - (-116)/14) + -2? 5 What is the value of 13 + (-16 - (-11 + -17 + 30))? -5 Calculate (6/10)/(1 - 4). -1/5 Evaluate ((-5)/((-35)/(-21)))/(384/(-176)). 11/8 What is (-1276)/(-176) - 12/(-16)? 8 What is the value of -3((((-512)/12)/(-16) - -1) + -2)? -5 -2 + 8/10 - ((-308)/11 + 26) 4/5 What is the value of (6/(-28))/((7008/56)/(-12) + 7)? 1/16 Evaluate (-2)/(-23) + 21600/(-105570). -2/17 What is the value of (9 - 24 - 0) + (23 - 2)? -11 What is the value of 94/160 + (17/51)/((-5)/6)? 3/16 Calculate 4/24((-595)/(-833))/((-4)/(-14)). 5/12 What is -19 + (-270)/(-15) + (-41)/(-39)? 2/39 What is 78/(-66) - 32/(-176)? -1 Calculate 927/(-2266) + 31/126. 12/11 What is the value of 9867/2001 + (3 + 2 + -7 - 3)? -2/29 What is the value of (-957)/(-99) + 32/(-120)(-10)/(-4)? 9 Evaluate (25/(-200) + (-18)/(-16))9. 9 What is 1/10 - -172883/36890? 10/7 Calculate -7 - -7 - 9 - (-47 + 45). -7 Calculate 0 + 4 - (9/(-3) + -6). 13 (52/(-18))/((-182)/819) 13 Evaluate (-315)/362(-6)/(-98) + 1. -1/14 Calculate 4 + (208/728)/((-4)/63). -1/2 What is the value of (42/(-56))/((-90)/328/12)? 2/5 Evaluate (192/512)/(57/(-16)). -2/19 What is the value of (2318/133 - 14)/((-4)/(-14))? 12 Calculate 1016/(-20) - (2 + 6 + -2). -14 What is the value of (2/(-4))/(99/(-2178))? 11 Evaluate 7 - (-3 + (3 - -13)). -6 Evaluate 197769/6578 + (-15)/230. 30 Calculate (-44)/330 - -4(-164)/30 - -1. -21 What is the value of 14(-2)/21-3? 4 Evaluate ((-155)/70 - (-68)/(-238))140/25. -14 What is (8/3 + 0)/(688/3096)? 12 What is 856/30 + 3586/(-209)? -3/19 What is (12/(-161))/((30/(-35))/3)? 6/23 Calculate ((-100)/360)/((-61)/8 - -7). 4/9 Calculate 1344/(-224) - (21 - 2). -25 (288/8)/4 + ((-26)/2)/(-1) 22 What is the value of 705/210-2 + 7? 2/7 Evaluate (-70)/(-4)(-48)/672. -5/4 Calculate (-35)/(-28) + -14 + 98/7. 5/4 Calculate 16/32(1 - (-45)/(-33)). -2/11 (-1 + 110/80)/((-27)/12) -1/6 Evaluate (-341)/(-198)-2 - (40/18 + -2). -11/3 What is the value of 469/(-18)(-18)/(-48)? -23/4 What is (6/4(-39)/(-1638))/(20/14)? 1/40 Evaluate 39/(-65) + (12/(-21))/(130/(-91)). -1/5 What is the value of (10/(-120)3)/(6/4)? -1/6 What is the value of 620/160 - (-210)/(-60)? 3/8 Calculate (-122)/16 + -30 + 38. 3/8 Evaluate 167/(-63) + 80/(-140) + 4/18. -3 (-6)/9990/66 -10 What is 20/(-9) - ((-5902)/234 + 39)? -16 Calculate ((-62)/8 - -1)11860/8895 - -18. 9 Calculate (-2)/3(198/126 + 1). -12/7 Evaluate 20 + -5 + -9 + 4. 10 ((-13)/(-130)33)/(1 - 22/10) -11/4 What is 2/(-7) - (-6 + (-1080)/56)? 25 Calculate (141/(-188)(-1 + 45))/(-3). 11 What is 37/(851/644) - 2? 26 What is ((-441)/(-252))/((-2)/8)? -7 What is 11 + -4 + -2 + (-217)/49? 4/7 Calculate (-23 - 0) + -7 + 2 + 1020/85. -16 (-20592)/(-7128)6/(-13) -4/3 What is the value of 145/(-290) - (-14)/4? 3 What is the value of (-2 + 29/15)/(80/240)? -1/5 Evaluate (3 + 70/(-14))/(-2). 1 What is 14/(-4) + 3 + 144/(-96)? -2 What is (-16)/18 - (-864)/1944? -4/9 What is the value of (-24)/(-162)((-25)/(-90) - (-4)/18)? 2/27 Evaluate 578/(2 + 6)(-9)/27. -19 Calculate (-3)/2-7(855/70 + -12). 9/4 What is (-208 + 204)/((-8)/(-20))? -10 What is ((-14)/56)/(-4(-4)/(-192))? 3 What is (-62/(-16))/((-23)/((-5152)/42))? 4 Evaluate 0/2 + -25 + (-98)/(-3479)71. -23 Evaluate (3708/(-25029))/(2/3). -2/9 Calculate (39 - 19)(0 - (-8)/(-20)). -8 What is (14 - (-837)/(-62))(-24)/(-10)20? 24 247/(-2128)20 + 14/8 -4/7 ((((-1144)/99)/(-26))/(-14))/((-6)/(-9)) -1/21 What is the value of 28866/10188 - (8/2 - 1)? -1/6 What is the value of (3 - 2)/((-6)/(126/(-35)))? 3/5 What is 3/(-5) + (-598)/(-2760)2? -1/6 Calculate 1598/(-1034) + (-20)/5 + 5. -6/11 Evaluate (-7138)/(-581) - ((-702)/(-6))/9. -5/7 Calculate ((110/(-1925))/(6/(-885)) - 9)-7. 4 -2 + 7 - 31/((-3162)/(-486)) 4/17 Calculate (-681)/(-51) + 966/(-2737). 13 3040/(-25992) - 2/(-57)-3 -2/9 Evaluate -20 + (-1241)/561-9. -1/11 7/((-70)/8)(-12 - 3) 12 Evaluate -7 + (-242)/(-48) + 1 - (-8)/6. 3/8 Calculate ((33/55)/((-6)/20))/(11 + 5). -1/8 What is (425/1700)/(1/(-72))? -18 463/66 + (-13)/(-78) - (-24)/(-132) 7 Evaluate (-69)/2(21/27)/(28/(-24)). 23 What is (25/(-10) - -1)32/(-6)? 8 Evaluate ((-3)/32 - 0)/(828/368). -1/24 What is (-2)/((-10)/69) - 14? -1/5 What is the value of (8 - 1484/49) + (-2)/(-7)? -22 Evaluate 9 - (-13 + 25 - -9). -12 -11 + ((-29)/(1566/(-351)))/((-1)/(-2)) 2 Calculate 554/22 - 3/10440/726. 25 Evaluate (1 - -8) + 3 + -17. -5 Evaluate 9/(189/170) - 160/20. 2/21 Evaluate (21/35)/(156/(-160) + 1). 24 (-476)/(-187) + 23/(506/(-12)) 2 What is (11/110)/((-66)/(-88))? 2/15 (-1458)/(-972)(-10)/((-2)/(4/(-6))) -5 Evaluate 426639/80940 + (-21)/4. 2/95 What is the value of 10 + 0 + (676/(-52) - -1)? -2 Calculate (-55)/(-220) + 225/(-20). -11 Calculate ((-14)/21)/(-2) + (3360/(-9))/(-20). 19 What is 22038/(-570)4/((-32)/18)? 33 Calculate ((-19)/(-9) + -2)/(-15 + (-3568)/(-240)). -5/6 What is ((-24591)/945 - -26)/((-2)/3)? 1/30 (4/1 - (-26)/(-143)-1) + -4 2/11 Calculate -10 + 4 + (4 - -4) + -17 + 6. -9 What is 2/60 + (-10)/75? -1/10 Calculate (0 + 5)(-25 + 3)/22. -5 ((-2)/6 + (-40)/(-75))/((-84)/70) -1/6 What is (74/370 + (-18)/10)/(2/5)? -4 Calculate 1083/(-532) - (-12)/(-18)-3. -1/28 Calculate 7/(-6)138/322. -1/2 6 - 45(-80)/(-624) 3/13 What is the value of -5 + (730/40 + -22)8/(-6)? 0 ((-27)/(-6))/(9 + 2058/(-224)) -24 What is (1/(-9))/((-110)/11 + 868/84)? -1/3 What is the value of 7296/(-168) + 44 - (-471)/21? 23 20/(-7160/896) -16 Evaluate ((-191)/(310184/1740))/((-3)/73). 5/6 -30(63/(-60) + 1) 3/2 What is the value of 26/(-6) + (-19 - (-162)/9) - -5? -1/3 What is (4/(-9))/(-4) - (-24 - 3006/(-81))? -13 Evaluate ((-3104)/160 - -26)5. 33 Calculate 294/(-102) - 6/(-2) - 166/(-34). 5 Calculate -14 - (-35 - (-50 + 27)). -2 Evaluate 8/2 + 50/(-20). 3/2 -84(-12)/96 + 3/(18/(-3)) 10 (-2 + 1)/(441/(-1764)) 4 What is 18/(-12) - (-13)/((-234)/(-30))? 1/6 Evaluate 74/111 - (58 - -1)(-7)/(-21). -19 What is 29/58(-10)/55? -1/11 What is the value of (-5)/15 - (-7)/(-3)(-42)/(-147)? -1 Evaluate ((-27)/1305)/(-12(-57)/760). -2/87 Evaluate (-21)/4(-5)/(-9)3474/2895. -7/2 (-4)/(-8) - 51/6 - -21 13 Calculate ((6 + -36)/90)/(2/(-66)). 11 Calculate ((-57)/152 - (-65)/152)/((-6)/(-3)). 1/38 What is (-112)/(-21)2/168(-12)/(-8)? 2/21 What is the value of 720 - 728 -	{ "pile_set_name": "DM Mathematics" }
35 Calculate prob of picking 1 u, 1 h, and 2 a when four letters picked without replacement from auhawuwwwjwjwww. 2/1365 Three letters picked without replacement from jtophfpfo. What is prob of picking 1 p, 1 h, and 1 t? 1/42 Two letters picked without replacement from quuuuuuquq. Give prob of picking 2 q. 1/15 What is prob of picking 1 k and 1 t when two letters picked without replacement from xxxjxtaxtkxxjxxxxkxx? 2/95 Calculate prob of picking 2 u when two letters picked without replacement from {r: 1, u: 2}. 1/3 Three letters picked without replacement from jvlkvik. What is prob of picking 1 l, 1 j, and 1 i? 1/35 What is prob of picking 2 c when two letters picked without replacement from cclpcccjc? 5/12 Four letters picked without replacement from qabbqambxqbixam. What is prob of picking 2 a and 2 b? 6/455 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from {r: 5, m: 3, y: 4}. 10/33 Calculate prob of picking 2 n when two letters picked without replacement from zuzxznnzzxrz. 1/66 Calculate prob of picking 2 a when two letters picked without replacement from {a: 2, f: 7}. 1/36 Four letters picked without replacement from {h: 2, n: 2, o: 5}. Give prob of picking 2 h and 2 o. 5/63 Three letters picked without replacement from {c: 1, h: 1, s: 2, f: 4, b: 1}. What is prob of picking 1 h, 1 s, and 1 f? 2/21 Calculate prob of picking 1 k and 2 h when three letters picked without replacement from {p: 3, h: 3, k: 2}. 3/28 Three letters picked without replacement from qaqqqahaaqqqcacahqa. Give prob of picking 1 a and 2 q. 196/969 What is prob of picking 2 g and 2 z when four letters picked without replacement from gzzzgzzzzgzzzzzzgzz? 105/646 What is prob of picking 1 x and 2 p when three letters picked without replacement from {p: 16, x: 4}? 8/19 What is prob of picking 2 f when two letters picked without replacement from {s: 3, f: 6, n: 6}? 1/7 What is prob of picking 1 r, 2 z, and 1 f when four letters picked without replacement from {f: 4, q: 3, z: 8, r: 1, i: 3}? 28/969 Four letters picked without replacement from vvvpvvpvvv. What is prob of picking 4 v? 1/3 What is prob of picking 1 v and 1 f when two letters picked without replacement from vfhffquvf? 2/9 Calculate prob of picking 1 g, 1 h, and 1 i when three letters picked without replacement from hggni. 1/5 Three letters picked without replacement from vvvgg. Give prob of picking 2 v and 1 g. 3/5 Three letters picked without replacement from nhnonnnnhonn. Give prob of picking 2 h and 1 o. 1/110 Calculate prob of picking 2 f when two letters picked without replacement from cccicfrfccr. 1/55 Calculate prob of picking 1 f, 1 m, 1 r, and 1 l when four letters picked without replacement from rrnnxlmllnrmmrxlfll. 6/323 What is prob of picking 2 y and 1 l when three letters picked without replacement from {l: 5, y: 2, i: 2}? 5/84 Calculate prob of picking 1 a, 1 z, and 1 l when three letters picked without replacement from lazlqnnynyallln. 2/91 Four letters picked without replacement from {w: 3, h: 8}. Give prob of picking 1 h and 3 w. 4/165 What is prob of picking 2 t when two letters picked without replacement from qtwwqtwqwtwqtxwqtt? 5/51 Calculate prob of picking 1 c, 1 s, and 1 p when three letters picked without replacement from pplclpucsupuupupup. 7/408 Four letters picked without replacement from rrriirrrrr. What is prob of picking 4 r? 1/3 Two letters picked without replacement from {y: 2, s: 5, g: 4, j: 4}. What is prob of picking 1 s and 1 g? 4/21 Two letters picked without replacement from kkkk. Give prob of picking 2 k. 1 Calculate prob of picking 2 r and 1 s when three letters picked without replacement from rssssrss. 3/28 Three letters picked without replacement from {s: 6, u: 6, m: 3}. Give prob of picking 3 u. 4/91 Two letters picked without replacement from vssc. What is prob of picking 1 s and 1 v? 1/3 What is prob of picking 3 y when three letters picked without replacement from {y: 9, h: 2}? 28/55 Two letters picked without replacement from {w: 4, x: 1, q: 4, z: 2, h: 5}. What is prob of picking 1 h and 1 x? 1/24 What is prob of picking 2 j and 1 x when three letters picked without replacement from jxjjxxjxjxxhjxx? 24/91 Two letters picked without replacement from {t: 1, w: 2, o: 4, i: 1}. Give prob of picking 1 t and 1 i. 1/28 Three letters picked without replacement from {q: 2, v: 2, p: 4}. What is prob of picking 1 q and 2 v? 1/28 Two letters picked without replacement from {l: 6, o: 2, b: 4, p: 1, e: 1, z: 1}. What is prob of picking 2 o? 1/105 Two letters picked without replacement from iiiiiii. What is prob of picking 2 i? 1 Two letters picked without replacement from {b: 1, z: 3, h: 1, s: 3, c: 2, i: 1}. What is prob of picking 1 z and 1 c? 6/55 Three letters picked without replacement from {w: 7, r: 5}. What is prob of picking 3 r? 1/22 Two letters picked without replacement from qqoooqooqqoq. Give prob of picking 1 o and 1 q. 6/11 Two letters picked without replacement from uhuuohuhuhuuuu. What is prob of picking 2 u? 36/91 Four letters picked without replacement from {x: 2, p: 2, o: 1, l: 2, r: 1}. Give prob of picking 2 o and 2 r. 0 Four letters picked without replacement from {q: 8, f: 5}. What is prob of picking 1 f and 3 q? 56/143 Two letters picked without replacement from kkppcnngkcvcgppncv. Give prob of picking 1 g and 1 v. 4/153 Calculate prob of picking 1 w and 1 k when two letters picked without replacement from {k: 1, w: 7, z: 1}. 7/36 What is prob of picking 1 z, 1 d, 1 o, and 1 l when four letters picked without replacement from {l: 2, d: 6, x: 1, o: 1, z: 2}? 8/165 Four letters picked without replacement from hsicigc. What is prob of picking 1 s, 2 i, and 1 g? 1/35 Calculate prob of picking 1 c and 1 e when two letters picked without replacement from ccceddec. 2/7 Three letters picked without replacement from syysyyysyyysyssyyyc. Give prob of picking 3 s. 20/969 What is prob of picking 2 d and 2 u when four letters picked without replacement from gmdmuuumdmggmummdmd? 3/323 What is prob of picking 4 k when four letters picked without replacement from ukuuuuuuuukkkk? 5/1001 Three letters picked without replacement from fxcccccxcc. What is prob of picking 1 f and 2 x? 1/120 Calculate prob of picking 1 r and 3 g when four letters picked without replacement from {w: 4, r: 1, g: 2}. 0 What is prob of picking 1 o and 1 u when two letters picked without replacement from {w: 2, u: 4, o: 1}? 4/21 Two letters picked without replacement from {g: 7, z: 3, d: 1, p: 3}. Give prob of picking 1 p and 1 d. 3/91 Four letters picked without replacement from xxggxyxgx. What is prob of picking 1 x, 2 g, and 1 y? 5/42 Two letters picked without replacement from {h: 1, a: 1, r: 2}. Give prob of picking 2 r. 1/6 What is prob of picking 1 s and 1 v when two letters picked without replacement from ccvvs? 1/5 Four letters picked without replacement from {t: 1, a: 1, d: 2, o: 1, k: 1, l: 1}. What is prob of picking 1 a, 2 o, and 1 l? 0 Calculate prob of picking 2 p and 1 k when three letters picked without replacement from {e: 2, v: 3, t: 1, k: 1, p: 3, i: 1}. 1/55 Three letters picked without replacement from {v: 4, q: 10}. Give prob of picking 3 q. 30/91 Four letters picked without replacement from uoooaoaaaaa. What is prob of picking 3 o and 1 a? 4/55 Two letters picked without replacement from {j: 4, z: 4, a: 2, u: 4, o: 2, i: 4}. What is prob of picking 1 u and 1 a? 4/95 Two letters picked without replacement from {q: 2, k: 9}. Give prob of picking 1 q and 1 k. 18/55 What is prob of picking 2 r when two letters picked without replacement from {r: 5, n: 2, x: 9}? 1/12 Three letters picked without replacement from {h: 1, u: 4, n: 2, r: 1, d: 2}. Give prob of picking 1 u, 1 r, and 1 d. 1/15 What is prob of picking 2 x when two letters picked without replacement from mxxxmxxfxemdemxefe? 7/51 Calculate prob of picking 1 w and 2 f when three letters picked without replacement from wddfdfddwddfddfd. 3/140 Three letters picked without replacement from zdzzdzd. What is prob of picking 2 d and 1 z? 12/35 Two letters picked without replacement from ywemw. Give prob of picking 1 w and 1 m. 1/5 Calculate prob of picking 1 i and 1 o when two letters pi	{ "pile_set_name": "DM Mathematics" }
5 in descending order. 5, 3, -2, -4.9 Sort 2, -100, -4 in descending order. 2, -4, -100 Sort -0.029, -3, -2/11. -3, -2/11, -0.029 Sort 2/3, 9, 3. 2/3, 3, 9 Sort -34, -4, -0.2 in increasing order. -34, -4, -0.2 Sort -4, 4, -3, 3 in descending order. 4, 3, -3, -4 Put 0, -2, -4, -9 in descending order. 0, -2, -4, -9 Sort -2, 4, -258, -4 in decreasing order. 4, -2, -4, -258 Sort 2, 0.4, 0.11, 0, -3 in descending order. 2, 0.4, 0.11, 0, -3 Sort 4, -223, -4 in decreasing order. 4, -4, -223 Sort -0.33, -1/4, 4, 5. -0.33, -1/4, 4, 5 Sort 3, 1, -5, 232 in increasing order. -5, 1, 3, 232 Sort -6, -2/5, 1/30 in ascending order. -6, -2/5, 1/30 Sort -4, -8, -3, 0, -1. -8, -4, -3, -1, 0 Sort -212, 2, -5, 5. -212, -5, 2, 5 Put 3, -2, -1, 0 in increasing order. -2, -1, 0, 3 Put -1/1717, 4, -2 in decreasing order. 4, -1/1717, -2 Put 1/2, 10/11, 0, -5 in descending order. 10/11, 1/2, 0, -5 Put -8, 5, -3 in descending order. 5, -3, -8 Put 1/3, -1, -3/10 in ascending order. -1, -3/10, 1/3 Sort 1, -12, 2, 4. -12, 1, 2, 4 Put 2, 19, -1 in descending order. 19, 2, -1 Put -108, -6, -5, -2, 2 in descending order. 2, -2, -5, -6, -108 Sort -3, 15/8, 4/7 in decreasing order. 15/8, 4/7, -3 Sort 13, -5, 4, -1. -5, -1, 4, 13 Sort -0.55, 0, 2, -2 in decreasing order. 2, 0, -0.55, -2 Sort 3/17, 7/4, -1/3 in ascending order. -1/3, 3/17, 7/4 Put -3, 1, -5, 2 in ascending order. -5, -3, 1, 2 Sort -4, -2/11, -115/2. -115/2, -4, -2/11 Put 2, 0, 114 in decreasing order. 114, 2, 0 Sort 2, 6, 1 in decreasing order. 6, 2, 1 Sort 2, 2/5, 0.9, 0 in decreasing order. 2, 0.9, 2/5, 0 Put -1, -4, 5 in ascending order. -4, -1, 5 Sort -5/4, 0.3, -40 in decreasing order. 0.3, -5/4, -40 Sort 5, -2, -5, -428, 1 in descending order. 5, 1, -2, -5, -428 Put 1, -13, -2, 2 in ascending order. -13, -2, 1, 2 Sort -3/10, 9, 2/9 in descending order. 9, 2/9, -3/10 Sort -4, 3, -2435, -1 in descending order. 3, -1, -4, -2435 Put 5, -1, 1, -648 in decreasing order. 5, 1, -1, -648 Put -5, 147, 2, 6 in descending order. 147, 6, 2, -5 Sort 5, -1, -17, 0, -4. -17, -4, -1, 0, 5 Put 1/5, 0.4, 0.6, 0, 5 in descending order. 5, 0.6, 0.4, 1/5, 0 Sort 1, -9, 13, 2 in decreasing order. 13, 2, 1, -9 Sort -2, -5, -179. -179, -5, -2 Put 9/5, 4, 28, 0 in ascending order. 0, 9/5, 4, 28 Put 5, -6, 4 in decreasing order. 5, 4, -6 Sort -4/17, -1, -0.3, -3, 2/17. -3, -1, -0.3, -4/17, 2/17 Put 10.7, -3/4, 5 in ascending order. -3/4, 5, 10.7 Put -3, -248, 9 in ascending order. -248, -3, 9 Put 3, -19, -2, 2, -23 in ascending order. -23, -19, -2, 2, 3 Sort 8, 41, -9 in decreasing order. 41, 8, -9 Sort 5, -2319, 3. -2319, 3, 5 Put -0.4, 4, -1/4 in increasing order. -0.4, -1/4, 4 Sort -5, -4, 14, 1 in descending order. 14, 1, -4, -5 Put -2, -69, 4, 1 in ascending order. -69, -2, 1, 4 Sort 1, -3, -7, 22 in decreasing order. 22, 1, -3, -7 Put -1, -659, 0.4 in ascending order. -659, -1, 0.4 Sort 0.3, -216, 2 in decreasing order. 2, 0.3, -216 Sort 0, 4, 2, 1. 0, 1, 2, 4 Put -4, 5, -2, -40 in descending order. 5, -2, -4, -40 Sort 1, -182, 3/5, -3 in descending order. 1, 3/5, -3, -182 Sort -1, 1, -90 in descending order. 1, -1, -90 Sort -4, -10, -658 in ascending order. -658, -10, -4 Sort 2/3, 4.2, -3 in increasing order. -3, 2/3, 4.2 Put 3, 1, 71 in ascending order. 1, 3, 71 Sort 7, 52, -2 in descending order. 52, 7, -2 Put -87, 0.1, 0 in ascending order. -87, 0, 0.1 Sort -19, -6, -59 in increasing order. -59, -19, -6 Put -3, -2, 4, -5 in decreasing order. 4, -2, -3, -5 Sort 6, 1, 3, -1, -9 in ascending order. -9, -1, 1, 3, 6 Sort 9, 1, 6, 5 in ascending order. 1, 5, 6, 9 Sort 262, 0, -1, -3 in decreasing order. 262, 0, -1, -3 Put 0, -1, 0.5, -61, -0.04 in ascending order. -61, -1, -0.04, 0, 0.5 Sort -5, 24, 0 in increasing order. -5, 0, 24 Put -3/2, -0.5, -1.43, -1/8 in descending order. -1/8, -0.5, -1.43, -3/2 Sort 2, 12, -38, -3 in decreasing order. 12, 2, -3, -38 Put 0.06, 0.5, -3 in ascending order. -3, 0.06, 0.5 Sort 6, -0.1, 0.5, -3/4, -2/7 in ascending order. -3/4, -2/7, -0.1, 0.5, 6 Put -4, 5313, -3, -1 in increasing order. -4, -3, -1, 5313 Sort 9, 2, -22 in decreasing order. 9, 2, -22 Put 144, -2, 2 in increasing order. -2, 2, 144 Put -5, -0.8, 0.5, 3 in decreasing order. 3, 0.5, -0.8, -5 Sort -2, 13, 10. -2, 10, 13 Sort 2, 3, 0.12, 0, 9/10 in decreasing order. 3, 2, 9/10, 0.12, 0 Sort 6, 0, -2. -2, 0, 6 Sort 0.1, -0.1, -50/7, -6/5 in increasing order. -50/7, -6/5, -0.1, 0.1 Sort 0.3, 0.4, -94, -3 in decreasing order. 0.4, 0.3, -3, -94 Sort 3, -31, -3 in decreasing order. 3, -3, -31 Put -0.4, 0, 1/3, 112, 2/7 in decreasing order. 112, 1/3, 2/7, 0, -0.4 Put -1, -4, -16, 0 in ascending order. -16, -4, -1, 0 Put -24, 36, 5 in decreasing order. 36, 5, -24 Sort 5, 2/9, -0.2, -8. -8, -0.2, 2/9, 5 Sort -5, 25, 0.06 in decreasing order. 25, 0.06, -5 Sort -1, 4, 1/11, 3 in decreasing order. 4, 3, 1/11, -1 Sort -12, -3, 4 in increasing order. -12, -3, 4 Sort 3, -1, -5, 4, 10. -5, -1, 3, 4, 10 Sort 30/13, 3, -0.2 in increasing order. -0.2, 30/13, 3 Sort 3, 1, 103, 5. 1, 3, 5, 103 Put -5, 16, 281 in descending order. 281, 16, -5 Put -2, -69, -1 in decreasing order. -1, -2, -69 Sort 1/5, 2, -188, -4, 3 in descending order. 3, 2, 1/5, -4, -188 Put 2, 25, -5 in increasing order. -5, 2, 25 Sort 4, 440, 2. 2, 4, 440 Put -5, 23/3, -3/5, 0.2 in increasing order. -5, -3/5, 0.2, 23/3 Sort 3, -3/5, -5, 195 in descending order. 195, 3, -3/5, -5 Put -3, 3, 5, -1467 in decreasing order. 5, 3, -3, -1467 Sort 2/13, -1/6, 129, -0.1 in decreasing order. 129, 2/13, -0.1, -1/6 Put -0.6, -0.2, 1, 0.1 in descending order. 1, 0.1, -0.2, -0.6 Put -4, -2, 2, -39 in descending order. 2, -2, -4, -39 Put -38, -2, 2 in decreasing order. 2, -2, -38 Sort 1, -48, -2, 2, -1 in decreasing order. 2, 1, -1, -2, -48 Put -3, 7, 0.1, -8 in decreasing order. 7, 0.1, -3, -8 Sort 1/3, 3/7, 5, 0.02, 2. 0.02, 1/3, 3/7, 2, 5 Sort -16, -2, -2/3 in descending order. -2/3, -2, -16 Sort 0.02, 8, -4, -2 in ascending order. -4, -2, 0.02, 8 Put -276/5, -1, 3 in decreasing order. 3, -1, -276/5 Put 2, -53, -0.4 in descending order. 2, -0.4, -53 Sort -32, 1, -2, 104 in decreasing order. 104, 1, -2, -32 Put 257, 4, 6, 3 in descending order. 257, 6, 4, 3 Put 5, -6, -2.8, 4 in ascending order. -6, -2.8, 4, 5 Sort 0.4, 309, 2. 0.4, 2, 309 Sort -3, -8, 15, 0.4. -8, -3, 0.4, 15 Sort -2, -7, 4, -1. -7, -2, -1, 4 Sort -3, -85, -4, -10 in decreasing order. -3, -4, -10, -85 Sort 0.3, -194, 1 in descending order. 1, 0.3, -194 Sort 2, 3908, -5 in descending order. 3908, 2, -5 Sort -0.32, 12, 5, 2/9 in decreasing order. 12, 5, 2/9, -0.32 Sort -2/15, 2/11, 1, 0.038 in ascending order. -2/15, 0.038, 2/11, 1 Put -3, -5/3, -1/3, 0.2, 1 in increasing order. -3, -5/3, -1/3, 0.2, 1 Put -8, 0.4, 26 in decreasing order. 26, 0.4, -8 Put -20, 4, -3 in ascending order. -20, -3, 4 Sort -1/4, 0, 1, -4 in descending order. 1, 0, -1/4, -4 Sort 0, 2, 57, -10, -1 in descending order. 57, 2, 0, -1, -10 Sort -153, 32, 4 in increasing order. -153, 4, 32 Sort 15, -2/5, -7. -7, -2/5, 15 Sort -2/13, 2/73, 2/15. -2/13, 2/73, 2/15 Put 1, 2, 3, 5, 23 in ascending order. 1, 2, 3, 5, 23 Sort 4, -3/2, 2/99 in decreasing order. 4, 2/99, -3/2 Sort 16, 1/6, 11 in decreasing order. 16, 11, 1/6 Sort 50, 5/2, -1/4 in increasing order. -1/4, 5/2, 50 Sort -0.1, 3/4, 0.05, 3, 37 in increasing order. -0.1, 0.05, 3/4, 3, 37 Sort -1, -25, 2 in increasing order. -25, -1, 2 Sort -0.06, -2/19, -0.4 in decreasing order. -0.06, -2/19, -0.4 Put 5, -3, -133 in increasing order. -133, -3, 5 Put -2/11, -5/307, -2 in ascending order. -2, -2/11, -5/307 Put -1, -5, -0.17 in ascending order. -5, -1, -0.17 Sort 0, -19, -5, 10 in ascending order. -19, -5, 0, 10 Sort 2, 47, -3. -3, 2, 47 Sort -0.3, -5, 1/17 in increasing order. -5, -0.3, 1/17 Sort 8/7, 4, 1, -0.5 in decreasing order. 4, 8/7, 1, -0.5 Put 17, 0, -5 in increasing order. -5, 0, 17 Sort 0, -5, -1, -134 in increasing order. -134, -5, -1, 0 Put 4, 115, -4 in descending order. 115, 4, -4 Sort -1/5, -4, 41.7 in increasing order. -4, -1/5, 41.7 Put -2, 5, -1, 20 in decreasing order. 20, 5, -1, -2 Sort 6, 20, -2 in descending order. 20, 6, -2 Sort -4, 4, -119 in ascending order. -119, -4, 4 Sort 3, 0, 1, 4, 14 in ascending order. 0, 1, 3, 4, 14 Sort -25, 6, 2 in descending order. 6, 2, -25 Put 1, 2, 3	{ "pile_set_name": "DM Mathematics" }
Suppose 207 = 11l + 9. Calculate the highest common factor of 414 and l. 18 Let i be (3/2 - 1)/((-1)/(-8)). Suppose 0 = 2k + p - 34, 5k - 82 = -0k - ip. What is the greatest common divisor of k and 54? 18 Let f(j) = 4j*2 + 10j - 15. Let d be f(-4). Calculate the highest common divisor of 21 and d. 3 Let f = 68 - 28. Suppose 4z = 3p + 7, 0 = 20z - 17z + 4p - 24. Calculate the highest common factor of z and f. 4 Let j be (-4)/10 + (-96)/(-15). Suppose 0 = 19v - 236 - 49. Calculate the highest common divisor of j and v. 3 Let f = 96 - 64. Calculate the greatest common divisor of f and 1. 1 Let v(f) = 0f2 - 2 - 5f2 + f - f3 - 2f. Let a be v(-6). Let y = -129 + 137. Calculate the highest common factor of a and y. 8 Let u be 77 - ((-3)/9)/(11/99). Calculate the greatest common factor of 60 and u. 20 Let v = 87 - 94. Let k(n) = 4n*2 - 1. Let x be k(3). Let i be (-2)/v - (-305)/x. Calculate the greatest common factor of 63 and i. 9 Let c(x) = 63x - 803. Let v be c(13). What is the highest common divisor of 56 and v? 8 Suppose 2962a - 2963a = -8. What is the greatest common factor of 184 and a? 8 Let i = -6 + -16. Let f be (561/i)/(0 - 9/12). What is the greatest common factor of f and 374? 34 Let d = -27 - -76. Suppose 7s = 2s + 85. Suppose -11 = 2h - 5r - 0, -h + s = 2r. What is the highest common divisor of h and d? 7 Suppose 15 = -n + 4i - i, 0 = -4n + 5i - 67. Let k = n - -28. Let h be k/2(-30)/(-25). What is the highest common divisor of h and 6? 6 Let j(v) = v2 - 9v + 40. Let n be j(5). Suppose w - 3 - 12 = 0. What is the greatest common factor of w and n? 5 Let i(u) = -5u - 17. Let v be i(-7). Let s be -2 + 1 - -2 - -1. Let y be s/7 + (-244)/(-28). Calculate the highest common factor of v and y. 9 Suppose 4p - 9 = 7. Let j = 30 - 2. What is the greatest common divisor of j and p? 4 Suppose -2q + 0q - 110 = -5x, 3x - 66 = -q. Calculate the highest common factor of 55 and x. 11 Let p(n) = -n*2 - 19n - 26. Let k be p(-15). Let l = 76 - k. Calculate the greatest common factor of 168 and l. 42 Let q(x) = x + 5. Let s be q(4). Suppose 5o - 20 = -5. Suppose 75 = d + 3k, od - k - 164 = d. Calculate the greatest common divisor of d and s. 9 Let o be (-24)/4(-28)/24. Suppose 7l - o - 49 = 0. Suppose lb - 9b + 25 = 0. Calculate the highest common factor of 25 and b. 25 Let i = -15 - -26. Let r(y) = 2y*3 - 7y*2 - 5y + 5. Suppose -6u + 5u = -4. Let q be r(u). What is the greatest common divisor of i and q? 1 Let w = 699 + -687. Calculate the highest common factor of w and 27. 3 Suppose 4t + t = 75. Let f = 69 - 39. Calculate the highest common divisor of t and f. 15 Let c(s) = -s3 + s2 - 2s - 4. Let v be c(4). Let j = v + 78. What is the greatest common factor of 9 and j? 9 Suppose 3q + 5q = 3q. Suppose q = 6m - m - 55. Calculate the highest common divisor of m and 77. 11 Suppose a = -2y + 83, -3a + 8a - 5y = 355. What is the greatest common factor of 15 and a? 15 Let s be (-57)/6(-9)/(27/(-6)). Let r = s - -50. What is the highest common factor of 124 and r? 31 Let i = 817 - 647. What is the greatest common divisor of i and 30? 10 Let g(l) = -l2 - 14l + 8. Let n be g(-13). Suppose 2y - 3h - 153 = 0, -42 = 3y + 2h - 304. What is the highest common divisor of y and n? 21 Let q = 81 + -40. Let u = 64 - q. Calculate the greatest common factor of u and 69. 23 Let z(k) = -3k + 164. Let v be z(44). Suppose 3g + 2l = -3l + 169, -207 = -4g - 3l. Calculate the greatest common factor of v and g. 16 Let s(b) = -6b2 + 67b - 28. Let g be s(10). Calculate the greatest common factor of g and 861. 21 Suppose 3y - 16 = -y. Suppose -yl + 3l = -12. Let b(s) = s3 + 11s*2 + 11s - 8. Let w be b(-8). What is the greatest common divisor of l and w? 12 Suppose -k + 5k = -c + 1892, k = -5c + 492. What is the highest common divisor of k and 20? 4 Let m = 27 + 1. Suppose -17t + 19t = m. What is the highest common divisor of 28 and t? 14 Suppose 5h = 2d + 319, -7h = -h + 4d - 402. What is the greatest common factor of h and 91? 13 Suppose -4r + 2r + 24 = 0. Suppose 20u - 16u - r = 0. Let j be (2/(-6))/((-1)/6). Calculate the greatest common divisor of u and j. 1 Let n be (-6 - -2)(-12)/8. Calculate the greatest common factor of n and 66. 6 Let b(p) = -39p*3 + 2p + 1. Let i be b(-1). Let m = -8198 + 8200. Calculate the greatest common divisor of m and i. 2 Suppose 5i - 2l = -7l + 115, 0 = 5i + 2l - 106. Let g be (0 + -54)i/(-12). What is the greatest common factor of g and 18? 18 Let h be -1 + (-2 + -30)/(-2). Let v(k) = 10k2 + 2k + 1. Suppose 5u - 7 = 3. Let f be v(u). Calculate the highest common divisor of f and h. 15 Let m = 1034 + -704. Suppose -510 + 120 = -13t. What is the highest common factor of t and m? 30 Let j be (-2 + 1 - 0)-7. Let o = j - 3. Let x be 1/(-16)2816/(-176). Calculate the highest common divisor of o and x. 1 Let y be 214/(160/72 + -2). Calculate the greatest common divisor of 9 and y. 9 Suppose n + 0 = -3u - 1, 0 = 2n + 2. Suppose -m + 0r - 2r + 164 = u, m - 172 = -4r. Calculate the greatest common factor of 13 and m. 13 Let n = 59 + 74. Suppose -s = -j + 24, 0 = 5j + 16s - 20s - 115. Calculate the highest common divisor of j and n. 19 Let z(i) = i + 3. Let b be z(-5). Let v be (-4 - 5/b)-32. What is the highest common divisor of 32 and v? 16 Suppose 2v + 4 = 3p - p, 5p = -2v + 31. Suppose pk - 1 = 39. Calculate the highest common factor of 32 and k. 8 Let y(o) = -2o + 20. Let d be y(6). Suppose 0i = 3i - 72. What is the highest common divisor of d and i? 8 Suppose 0 = 3u - 0u - 6. Suppose -2 - 2 = -up. Suppose -8 = pt, 2y + 5t = -2y + 40. Calculate the highest common divisor of 6 and y. 3 Let n(x) = -75x + 2202. Let y be n(26). Let q = -5 + -1. Let s(m) = -4m + 4. Let h be s(q). Calculate the greatest common divisor of h and y. 28 Suppose -3a + 6 = -4x - 10, 2 = a + 2x. Let j(r) = 5r + 6. Let k be j(a). Let u = k + -18. Calculate the highest common factor of 20 and u. 4 Let y(r) = 46r2 - 13r - 51. Let b be y(5). What is the greatest common divisor of b and 22? 22 Let a be ((-11)/(-1))/(2/(82/1)). What is the highest common divisor of a and 41? 41 Suppose -4y + 29 = -79. Calculate the highest common divisor of y and 15. 3 Suppose -2k = d - 26, 3k - 150 = -5d - 20. Calculate the highest common factor of d and 26. 26 Suppose -9q = 4a - 10q - 356, -4a + 5q = -340. Let c be (7/(-4) + 1)-24. Calculate the highest common divisor of c and a. 18 Let v = -155 - -182. Suppose 202 = o - 14. Calculate the greatest common factor of o and v. 27 Suppose 452 + 5323 = 25x. Calculate the highest common divisor of x and 42. 21 Let o = -297 - -675. Let a = o - 270. Calculate the greatest common factor of 12 and a. 12 Suppose -703 = -3x - 2l, -214 = 3x - 5l - 882. Let r = 20 - -1. What is the highest common factor of x and r? 21 Let i = 13 + 251. Let f(n) = -n3 + 7n*2 + n - 18. Let t be f(6). Calculate the greatest common divisor of t and i. 24 Suppose -7d + 894 = y - 187, y = d + 1049. What is the greatest common factor of 27 and y? 27 Let i(u) = -2u3 + 4u*2 - 2u + 9. Let m be i(-4). Calculate the highest common divisor of 19 and m. 19 Let r be -4 - ((-24)/(-4) - 2). Let x be (-21)/(2/(r/4)). Suppose y - x = -0y. Calculate the greatest common factor of 7 and y. 7 Let n(h) = 5h*2 - h - 3. Let o be n(-3). Suppose -5x - 88 + 3 = -5t, 2x = t - 19. What is the highest common divisor of o and t? 15 Let q(t) = -t - 9. Let h be q(-11). Suppose -hk + 15 + 39 = 0. What is the greatest common factor of k and 18? 9 Let z(o) = 3o - 20. Let t(n) = -6n + 40. Let u(l) = 6t(l) + 11z(l). Let k be u(0). Calculate the greatest common factor of k and 20. 20 Let y(w) = 0 + 2w + w*3 - 4w*2 + 2w*3 + 2. Let q be (-3)/(3/(-6) + -1). Let l be y(q). What is the greatest common divisor of 112 and l? 14 Suppose -4t - 11 = -3m, -2m + 0m = -4t - 10. Let k be (-4)/10 - (-94)/10. What is the highest common divisor of m and k? 1 Suppose l - 4y = -3, -y + 0y = 5l - 69. Suppose -9i - 460 = -li. Calculate the highest common factor of i and 23. 23 Let h(r) = 15r - 519. Let b be h(37). Calculate th	{ "pile_set_name": "DM Mathematics" }
Convert 9.736153 millilitres to litres. 0.009736153 How many millilitres are there in fifty-one halves of a litre? 25500 How many years are there in one fifth of a decade? 2 What is sixty-one quarters of a microgram in nanograms? 15250 Convert 996140.4cm to millimeters. 9961404 How many nanograms are there in 25/2 of a microgram? 12500 What is 4.456246ml in litres? 0.004456246 What is seven eighths of a day in hours? 21 How many microseconds are there in seven quarters of a millisecond? 1750 How many micrometers are there in 3/5 of a centimeter? 6000 How many millilitres are there in twenty-one fifths of a litre? 4200 How many milliseconds are there in 1/24 of a minute? 2500 What is 3/10 of a litre in millilitres? 300 Convert 945.2863 seconds to nanoseconds. 945286300000 How many millilitres are there in 4.206153l? 4206.153 What is twenty-nine halves of a millisecond in microseconds? 14500 How many milligrams are there in 42/5 of a gram? 8400 How many seconds are there in 19/4 of a minute? 285 What is 41.61182 decades in centuries? 4.161182 What is 76845.8 decades in millennia? 768.458 How many micrometers are there in 1/4 of a millimeter? 250 What is 12264.38 years in millennia? 12.26438 How many grams are there in 13/4 of a kilogram? 3250 How many kilograms are there in 0.8792553ug? 0.0000000008792553 How many millennia are there in 62008.73 decades? 620.0873 What is 43/2 of a litre in millilitres? 21500 How many millilitres are there in 7/25 of a litre? 280 What is thirty-seven fifths of a microgram in nanograms? 7400 How many millilitres are there in 13/5 of a litre? 2600 How many days are there in ten sevenths of a week? 10 How many centuries are there in one fifth of a millennium? 2 What is 3/56 of a week in minutes? 540 How many millilitres are there in seven eighths of a litre? 875 How many millimeters are there in one quarter of a meter? 250 Convert 81533.6ml to litres. 81.5336 What is 998595.7 micrograms in nanograms? 998595700 What is 11/10 of a microgram in nanograms? 1100 How many months are there in eleven quarters of a decade? 330 What is 47228.18 micrometers in meters? 0.04722818 What is 6376.632l in millilitres? 6376632 What is 7/2 of a second in milliseconds? 3500 Convert 47889.19 micrometers to centimeters. 4.788919 How many millilitres are there in 138.1573 litres? 138157.3 What is one fifth of a meter in millimeters? 200 Convert 13.80596 days to nanoseconds. 1192834944000000 What is 3.790914 micrograms in kilograms? 0.000000003790914 What is 5/4 of a year in months? 15 What is 1/4 of a meter in centimeters? 25 Convert 55117.8 millilitres to litres. 55.1178 How many nanometers are there in 520271.4 millimeters? 520271400000 What is 3/5 of a millennium in months? 7200 Convert 351.073cm to micrometers. 3510730 Convert 46.07484 milliseconds to microseconds. 46074.84 How many millilitres are there in 18/5 of a litre? 3600 What is 3/40 of a meter in millimeters? 75 What is 78.39948kg in tonnes? 0.07839948 Convert 11.70235 millennia to years. 11702.35 What is twenty-one fifths of a centimeter in micrometers? 42000 How many months are there in six fifths of a millennium? 14400 What is 27/2 of a milligram in micrograms? 13500 How many grams are there in 17/2 of a kilogram? 8500 How many days are there in 204.87681 hours? 8.53653375 What is 17/2 of a milligram in micrograms? 8500 Convert 2.3154714 seconds to minutes. 0.03859119 How many minutes are there in 7.385206 hours? 443.11236 How many minutes are there in 5/8 of a day? 900 What is 1/5 of a millennium in years? 200 What is fourty-nine fifths of a kilometer in meters? 9800 How many centimeters are there in 48762.37 micrometers? 4.876237 How many litres are there in 894.2994 millilitres? 0.8942994 How many nanoseconds are there in 975.6032ms? 975603200 How many months are there in one quarter of a century? 300 Convert 9.46339 millilitres to litres. 0.00946339 What is 16876.79ml in litres? 16.87679 How many tonnes are there in 0.9944222mg? 0.0000000009944222 How many micrometers are there in five eighths of a centimeter? 6250 What is 45/4 of a microsecond in nanoseconds? 11250 What is eleven halves of a millennium in months? 66000 How many grams are there in one quarter of a kilogram? 250 What is one fifth of a millimeter in micrometers? 200 What is thirty-one fifths of a decade in years? 62 How many microseconds are there in 6/25 of a millisecond? 240 How many millilitres are there in 3/40 of a litre? 75 What is one quarter of a kilometer in centimeters? 25000 What is 1658.299041 nanoseconds in weeks? 0.0000000000027418965625 How many milliseconds are there in fifty-two fifths of a second? 10400 What is twenty-one halves of a meter in centimeters? 1050 What is 597.587 millilitres in litres? 0.597587 What is 8202.002 millilitres in litres? 8.202002 What is 117.9582km in millimeters? 117958200 How many years are there in 12/25 of a millennium? 480 How many millilitres are there in 7/4 of a litre? 1750 Convert 9267.519g to micrograms. 9267519000 How many millilitres are there in 634771.1l? 634771100 How many millilitres are there in 850.356l? 850356 How many millilitres are there in 13/5 of a litre? 2600 How many nanometers are there in 8.26424um? 8264.24 What is 0.0857585 decades in months? 10.29102 What is 6/25 of a microgram in nanograms? 240 How many millennia are there in 893060.9 years? 893.0609 How many centimeters are there in 3/5 of a kilometer? 60000 How many kilograms are there in one fifth of a tonne? 200 What is five quarters of a second in milliseconds? 1250 What is 5403.805 centimeters in nanometers? 54038050000 How many litres are there in 621128.6ml? 621.1286 How many litres are there in 4.337241 millilitres? 0.004337241 What is twenty-eight thirds of a hour in seconds? 33600 What is 3/5 of a millennium in decades? 60 What is 35.99097 weeks in days? 251.93679 What is 430.447ml in litres? 0.430447 Convert 793791.1 seconds to nanoseconds. 793791100000000 What is five quarters of a kilogram in grams? 1250 Convert 2497.878 millilitres to litres. 2.497878 What is 71/4 of a year in months? 213 How many meters are there in 13/5 of a kilometer? 2600 How many milligrams are there in three fifths of a gram? 600 How many millilitres are there in 21.33556 litres? 21335.56 How many centimeters are there in 0.4061815 micrometers? 0.00004061815 What is twenty-one eighths of a litre in millilitres? 2625 Convert 6.49614 millennia to centuries. 64.9614 What is 820.4482 days in milliseconds? 70886724480 Convert 2862.68661 seconds to weeks. 0.004733278125 What is 8.543106 millennia in centuries? 85.43106 What is fifty-one quarters of a millennium in decades? 1275 How many millilitres are there in 158.284l? 158284 What is 29408.2l in millilitres? 29408200 What is 6/5 of a tonne in kilograms? 1200 How many micrograms are there in 3/40 of a gram? 75000 What is 504309.2nm in millimeters? 0.5043092 Convert 1031.355t to nanograms. 1031355000000000000 Convert 99558.423 milliseconds to days. 0.0011522965625 How many nanograms are there in 658.9419 milligrams? 658941900 How many centimeters are there in 4.98668m? 498.668 What is 7/4 of a micrometer in nanometers? 1750 What is 0.9533463ml in litres? 0.0009533463 Convert 86.1298mm to kilometers. 0.0000861298 Convert 6814.732km to meters. 6814732 How many days are there in 526646.4 hours? 21943.6 What is twenty-five halves of a milligram in micrograms? 12500 How many milliseconds are there in one quarter of a second? 250 How many centuries are there in 0.4404017 years? 0.004404017 What is 4.625286 milligrams in kilograms? 0.000004625286 What is 22/9 of a hour in seconds? 8800 How many nanograms are there in 61/4 of a microgram? 15250 Convert 6193.386 meters to millimeters. 6193386 How many hours are there in 413674.5 weeks? 69497316 How many meters are there in fourty-two fifths of a kilometer? 8400 Convert 911.27 hours to milliseconds. 3280572000 What is five eighths of a hour in seconds? 2250 What is 1/15 of a millennium in months? 800 Convert 0.223847l to millilitres. 223.847 What is 5/8 of a milligram in micrograms? 625 What is 6305.886mm in kilometers? 0.006305886 What is 11/4 of a centimeter in micrometers? 27500 What is 1/4 of a gram	{ "pile_set_name": "DM Mathematics" }
= -nr - 6 for r. -1 Let x(c) be the first derivative of -c4/4 - 7c*3 - 21c*2 - 71c - 272. Let q be x(-19). Solve -q - 5 = -2h for h. 5 Suppose -1820 - 2620 = -235t + 87t. Solve 28c + 2 = t for c. 1 Let g be 61/21 + (-2)/(-21). Suppose 4f - t = gt + 12, 0 = 4f - 5t - 11. Solve 0 = -2q + fq for q. 0 Let n(m) be the third derivative of 5m4/24 + 17m*3/3 - 4m2 + 1. Let h be n(-6). Solve -h + 5 = -x for x. -1 Let r(d) be the first derivative of d3/3 + 9d2/2 + 8d + 71. Let l be r(-9). Solve -ln = -4n + 4 for n. -1 Let v be (-5 - -2) + (-80)/(-28) - 176/(-56). Solve -vq + 40 - 31 = 0 for q. 3 Suppose -31l + 5q = -32l + 7, -2l - 4q + 20 = 0. Solve lf - 16f - 4 = 0 for f. -1 Suppose 17z = 12z - 10, -n + 10 = 5z. Let d be 71/(-5) + (-5)/(-25). Let v = 14 + d. Solve vc + n = 4c for c. 5 Let w(p) = 4p*2 + 235p + 235. Let f be w(-1). Solve -x = -fx + 10x for x. 0 Let s(p) = p3 - p2 - 2p + 5. Let v be s(2). Suppose 0 = 3d + 1 + 2, 4g + 3d - v = 0. Solve -o - g = -5 for o. 3 Suppose 165l - 8521 = 28274. Solve -5w - l = -268 for w. 9 Let q = 2571 + -2535. Solve -129l + 117l = q for l. -3 Let s(z) = z*3 + 27z*2 + 46z - 100. Let o be s(-25). Let r = 0 - 0. Suppose v - 3c + r = -1, 4v - 18 = c. Solve o = -t + vt - 20 for t. 5 Let v = -231 + 233. Suppose -5w + v = h, -4w - 4h + 7h - 6 = 0. Solve w = -4n + 17 - 1 for n. 4 Let y be 5 + (3 - 6) + 2. Let w(n) = n*3 - 5n*2 + 5n + 2. Let c be w(3). Let q be 0/(c + -1 + 15/5). Solve -2a = -y - q for a. 2 Let i(o) = o + 1. Let z be i(-1). Suppose -5w = -14w + 45. Suppose 3h - 6 = b, -wb + 15 = 2h - 23. Solve -2s + z = b for s. -3 Let h(y) = -150y - 26. Let c be h(-2). Let x = c - 270. Solve -xg + 9g = 5 for g. 1 Suppose 82 - 6 = 38q. Solve 31j + q = 33j for j. 1 Let c(n) = -n3 + 15n*2 + 18n - 21. Let d be c(16). Suppose 8y + 12 = dy. Solve -p + 2 = y for p. -2 Let w = -127 + 415. Suppose -16 = -2m - 6, 0 = 3f + 3m - w. Let n = 91 - f. Solve -5d = -nd for d. 0 Let m(d) = -8d - 122. Let t be m(-14). Let n(a) = a*2 + 10a + 3. Let s be n(t). Solve -s = -5c + 17 for c. 4 Let g(q) = 94q*2 - 57q - 1. Let c be g(1). Solve 2461d = 2465d - c for d. 9 Let a(l) be the third derivative of -l*4/3 - 5l*3 + 47l*2. Let q be a(3). Let d = -50 - q. Solve -d + 16 = 3f for f. 4 Let s be -4 + (-5 - -10) + 0 + -1. Solve s = 17m - 0m + 34 for m. -2 Let g(z) = -562z - 1089. Let l be g(-2). Solve -145a + 138a - l = 0 for a. -5 Let p(q) = 4q - 11. Suppose -10c = -7c. Suppose c = -7i + 58 - 23. Let d be p(i). Solve -d = 4y + 11 for y. -5 Suppose -5z + 3s = -850, 663 = z + 3z + s. Let x = z + -162. Solve 20 = xo - o for o. 5 Let v be ((-12)/(-15))/(6/(-15)). Let k be 42/(-126)(-1 + v). Solve 9f = 8f + k for f. 1 Suppose -87j + 2660 = 46j. Solve 14r - 78 - j = 0 for r. 7 Let j be (4 + 17)(8 - 7). Suppose -5q - j = -31. Solve -qg = -1 + 3 for g. -1 Let c = 2889 - 2856. Solve 6f + c = 33 for f. 0 Let g(r) = r*2 - 2r - 12. Let m be g(0). Let q be (20/m + 1)/((-2)/(-12)). Let k(w) = 2w + 10. Let p be k(q). Solve 0u - 4 = pu for u. -2 Let r = -5018 - -5023. Solve -232 + 212 = -rp for p. 4 Let w be (-2)/(-5 - 145/(-30)). Solve -wo = o + 26 for o. -2 Suppose 24w - 879 = 321. Solve -17 + w = -11l for l. -3 Suppose 0 = -12f - 8455 + 11395. Solve l - 241 + f = 0 for l. -4 Let i(h) = -h*3 - 45h*2 - 82h + 280. Let z be i(-43). Solve 2c - z = -120 for c. -6 Suppose 8 - 33 = -5z - r, 3z - r = 15. Suppose -48 = -4w + 4s - zs, -s - 56 = -4w. Solve -n = -w + 10 for n. 3 Let f = -103 - -339. Let p = 237 - f. Solve p = -5g - 9 for g. -2 Suppose 1 = 19v - 0 + 1. Solve v = 120p - 95p - 100 for p. 4 Let a be (-5474)/(-105) + (-4)/30. Suppose -a = -21c + 25c. Let h be 0 + (-8)/52 + (-2)/c. Solve hg = 4g + 16 for g. -4 Suppose 2n + 165 + 1083 = 50n. Solve -24w - n = 46 for w. -3 Let d(s) be the first derivative of s*3/3 + 7s*2 + 13s - 54. Let j be d(-13). Solve jz - 4 = -z for z. 4 Suppose -3k - 1098 = -3b, 2b - k + 106 - 842 = 0. Solve -12v = 418 - b for v. -4 Suppose -320 = -2w - 3c, -15w + 4c = -13w - 320. Solve 144 - w = -4b for b. 4 Let g = 6 - 3. Suppose 5b - 2h = 4, -b + 120 = -3h + 127. Solve bc = 2c - gc for c. 0 Let p(a) = a2 + 25a - 2950. Let d be p(-69). Solve v + d = 87 for v. 1 Let u(v) = -v*2 + 9. Let f be u(0). Suppose -4l - l = -25, 5w + 4l = 125. Suppose -q - 1 = -4s, 250 = -5s - 535q + 553q. Solve -sz - w = -f for z. -3 Suppose 2c = -3b + 5c, -4b = 3c - 21. Suppose 4n = 2h - 18, 5n + 10 + 14 = bh. Solve ha = -0a - 12 for a. -4 Let a = -2740 - -2754. Solve 754r - 761r = a for r. -2 Suppose 4o - 143 = 3z + 71, -5z = o - 65. Solve -9p + o = 10 for p. 5 Let t be 137 + (-583)/(-106) + 29/(-2). Solve 2l - t + 116 = 0 for l. 6 Let j(v) = 21v - 983. Let m be j(47). Solve -4 = mg + 4 for g. -2 Let x be -44 - (-1 + (-20)/(-4)). Let m(g) = -13g - 17. Let i be m(-5). Let a = x + i. Solve 4 = -ah - h for h. -4 Let k(q) = q3 - 27q*2 + 27q - 26. Let t = -19 - -45. Let l be k(t). Solve l = 5v - v for v. 0 Suppose x = -3n + 84, 0n + 2n - 45 = 3x. Suppose 0 = 17y - 7 - n. Solve yt + 18 = 10 for t. -4 Suppose -49 = 8z - 57. Suppose 3q - z = 11, -j + q - 4 = 0. Suppose 2k - 12 = -3d - 2k, 2d - 8 = 4k. Solve p + j = d for p. 4 Suppose 5a - 5 - 25 = 0. Let r(i) = -7i - 196. Let t be r(-28). Solve -az - 15 + 45 = t for z. 5 Suppose -136r = -47 - 905. Let b = 30 - 18. Solve bw = rw - 5 for w. -1 Suppose 0 = -3i - 2s + 1070, -9i + 351 = -8i - 5s. Let m = -353 + i. Solve o + 3 = m for o. 0 Let o be 4 + -6 - (1 - 1). Let f be (4 + o - -60)1. Suppose -p + f = -2v + 5v, -10 = -5p. Solve 0 = 7s - 2s - v for s. 4 Let n(i) = 2i*2 - 13i + 6. Let y be n(6). Suppose v - 13 = -5u - yv, -4v - 8 = 0. Suppose ua - k = 4, 3k = 3a - 4 - 2. Solve -2j = -a - 1 for j. 1 Let g(r) = -r2 + 34r + 29. Let o be g(15). Let n = 206 - o. Let d = -101 - n. Solve 5q = -d - 3 for q. -2 Let x(c) = c2 - 503c - 1010. Let j be x(-2). Solve 2t - 167 + 157 = j for t. 5 Suppose -95 = -4f - 3d, 65f + d = 61f + 85. Solve 15m + f = 50 for m. 2 Let h(d) be the second derivative of d*4/3 - 25d*3/6 - 19d*2/2 + 101d. Let i be h(7). Solve 0 = ig - 4 + 14 for g. -5 Suppose 3i - 5q - 2 = 0, 3q + 9 - 1 = -5i. Let g = 17 + i. Suppose -20 = gm - 21m. Solve -y = m - 0 for y. -4 Suppose 77 = -0b + 11b. Suppose 116 = bx + 25. Suppose 5l - 13 - 2 = 0. Solve x = 4j - l for j. 4 Suppose b = -a + 3161, 0 = 47b - 42b + 6a - 15813. Solve 0 = -10g + 3123 - b for g. -3 Let u(y) = 3y + 38. Let v be u(-11). Suppose vm = 15m - 50. Suppose 5w - 4w = -mg + 37, 3g - 15 = -3w. Solve r = -r + g for r. 4 Let m(f) = -3f + 4. Let s be m(-5). Suppose -a + 16 = 4b, -4a + s = -5b - 24. Suppose -4p = -a, 0 = -l - 0p - p + 10. Solve -l = 4d + 1 for d. -2 Let m be ((-20)/150)/(1/(-6))215. Solve -169k = -mk for k. 0 Let i be 6 - (-6)/(108/(-102)) - 2959/(-33). Solve r - i = -17r for r. 5 Let a = -189 + 189. Let h be 3 - (-1 + a)(3 - 0). Solve 0 = -10s + hs + 4 for s. 1 Let p be ((-98)/4)/7-2. Let n(i) = -p - 9 - 8i - 5i - 6 + i2. Let a be n(15). Solve 3g - 20 = ag for g. -4 Let z = -1349 - -1406. Solve 35r + z = -13 for r. -2 Let m(f) = -f*2 + 47f + 23635. Let b be m(-132). Let n be 2/6 - 4/12. Solve q + bq = n for q. 0 Let y be (-3 - -1)3/(-2). Let s(p) = p*3 - 26p*2 - 55p - 28. Let a(d) = -d*2 + 20d - 56. Let h be a(14). Let l be s(h). Solve r + yr + 20 = l for r. -5 Suppose -2k = 5h - 3k + 25, 2h + 13 = k. Let q(w) = -w3 + 15w + 8. Let v be q(h). Solve 5x + 7 - v = 0 for x. 1 Let o be (-10920)/168(-2)/101. Solve os - 15 = 11 for s. 2 Let q(k) = -k*3 - 45k*2 - 129k - 92. Let v be q(-42). Solve 0 = -8u + v - 74 for u. -5 Let u = -40121 - -40431. Solve -289 = -7z - u for z. -3 Let n = -584 + 597. Suppose -ns = -132 + 106. Solve 0 = -8y + sy - 30 for y. -5 Let u(t) = 7t - 131. Let q be u(14). Let h(j) = j*2 + 29j - 126. Let a be h(q). Solve -g = 2g + a for g. -2 Let c(q) = -q3 - 72q - 291 + 381 + 11q2 + 26q*2. Let r be c(35). Solve -30z - r = -25z for z. -4 Suppose 59n = 61	{ "pile_set_name": "DM Mathematics" }
, 13, -5, -12, 0 in increasing order. -12, -8, -5, 0, 3, 13, 324 Put 834, -5, 2.776 in increasing order. -5, 2.776, 834 Put -1, -111, -2, 18, 7 in descending order. 18, 7, -1, -2, -111 Put 163, 2, -1, 4, 3, -11 in increasing order. -11, -1, 2, 3, 4, 163 Sort -10237, -173, 2. -10237, -173, 2 Sort -872840, -6, -4. -872840, -6, -4 Sort 25, -3, -2048181. -2048181, -3, 25 Sort 0.1, 0.14, -108, 33/71, -1 in increasing order. -108, -1, 0.1, 0.14, 33/71 Put -1, -8009, 2, -2/23, -0.4 in ascending order. -8009, -1, -0.4, -2/23, 2 Put 805, 2, -0.1312, 1, 6 in descending order. 805, 6, 2, 1, -0.1312 Sort -0.1, -1/2, 803/2, -33, 5. -33, -1/2, -0.1, 5, 803/2 Put 7/2, 1/8, -9, -582, 1, 8 in decreasing order. 8, 7/2, 1, 1/8, -9, -582 Sort -111650, 5, -5, -10 in ascending order. -111650, -10, -5, 5 Sort 4539, -5, 5, -3, -17 in decreasing order. 4539, 5, -3, -5, -17 Put -4, -1, 190/229 in decreasing order. 190/229, -1, -4 Sort 7, 4, 1, 661, -2, 3, 48/17 in descending order. 661, 7, 4, 3, 48/17, 1, -2 Put -1/4, 44503, -1.808 in descending order. 44503, -1/4, -1.808 Put 1/5, -1/3, -61601, 0, 2/11 in decreasing order. 1/5, 2/11, 0, -1/3, -61601 Sort -13, 5, 377445 in decreasing order. 377445, 5, -13 Sort -165, 91, -5, -61 in decreasing order. 91, -5, -61, -165 Sort -3, -9354, -14, 3 in decreasing order. 3, -3, -14, -9354 Sort -4, -94, -421615 in decreasing order. -4, -94, -421615 Sort 195.5, -0.81, 24 in decreasing order. 195.5, 24, -0.81 Sort 0, 2.22581, -21 in ascending order. -21, 0, 2.22581 Put 17, 5, 1, 20404 in descending order. 20404, 17, 5, 1 Sort -1, 10156, 1880, 1 in decreasing order. 10156, 1880, 1, -1 Put -28, 1/10, -373/4, -0.039, -4 in descending order. 1/10, -0.039, -4, -28, -373/4 Put 2/11, 1, 89, 0.0167, 0.2 in decreasing order. 89, 1, 0.2, 2/11, 0.0167 Sort 13, -216, 0, 52, 4 in descending order. 52, 13, 4, 0, -216 Sort -14/157, 3/4, -4, 4.04, -0.5 in descending order. 4.04, 3/4, -14/157, -0.5, -4 Sort 0, 4, -4, -45, 2 in ascending order. -45, -4, 0, 2, 4 Sort -3/5, -8762/139, -38 in descending order. -3/5, -38, -8762/139 Sort 9, 3, -254, -1, -5, 1, 11. -254, -5, -1, 1, 3, 9, 11 Sort 5, 639, 189. 5, 189, 639 Sort -49, 0.3, 3, 10, 1/6, 2/7, 9/8 in descending order. 10, 3, 9/8, 0.3, 2/7, 1/6, -49 Sort -2, 289, -352, 8, 11 in descending order. 289, 11, 8, -2, -352 Sort 2, 758, 502, 2/23 in decreasing order. 758, 502, 2, 2/23 Sort 17, -64, 9, -2, 0 in decreasing order. 17, 9, 0, -2, -64 Sort -3, 2/19, 912, 1, -2/7, 1.5. -3, -2/7, 2/19, 1, 1.5, 912 Sort 8, 221694, -3, 0 in descending order. 221694, 8, 0, -3 Put -3, 3, -4, -81519, 5, -2 in ascending order. -81519, -4, -3, -2, 3, 5 Put -2, 19, 1, 105, 11 in increasing order. -2, 1, 11, 19, 105 Sort -10, 3, -63691. -63691, -10, 3 Put 4955, 6, 80, -3, 2 in decreasing order. 4955, 80, 6, 2, -3 Put 3, -16, -1/83934 in decreasing order. 3, -1/83934, -16 Put 1, -14/9, -2718452 in descending order. 1, -14/9, -2718452 Put -4, 1, 0, 4, -246364, -26 in decreasing order. 4, 1, 0, -4, -26, -246364 Sort 45, 2, 426, 1, -5, -8 in increasing order. -8, -5, 1, 2, 45, 426 Put -132, -2, -5, 6 in descending order. 6, -2, -5, -132 Put 0, -619, 14 in decreasing order. 14, 0, -619 Put 21.7, -767, -0.04, -1 in ascending order. -767, -1, -0.04, 21.7 Sort -0.3, 5, 6, 0.5, -2/41315, -6. -6, -0.3, -2/41315, 0.5, 5, 6 Put 4, 1103, 11, 0 in increasing order. 0, 4, 11, 1103 Sort 0, -1/838427, -1/5 in decreasing order. 0, -1/838427, -1/5 Put -94, -37, 7, 96 in descending order. 96, 7, -37, -94 Sort -262, 26, -1, 1, -66, 2 in increasing order. -262, -66, -1, 1, 2, 26 Sort 1484, -26, -20, -6, 5, 0 in ascending order. -26, -20, -6, 0, 5, 1484 Put 727, 658, 4, -4 in increasing order. -4, 4, 658, 727 Sort -129, -9, 344. -129, -9, 344 Put -2/9, -2, 2, -5, 0.6717, 3, 5 in descending order. 5, 3, 2, 0.6717, -2/9, -2, -5 Put 1, 33, 4, 5, 706, -11 in descending order. 706, 33, 5, 4, 1, -11 Put -34, 41, -2, -4, 2, -6 in descending order. 41, 2, -2, -4, -6, -34 Put 2808684, -4, 107 in descending order. 2808684, 107, -4 Sort 1, 2, 6, 8718.5, 0.09, -4/7 in increasing order. -4/7, 0.09, 1, 2, 6, 8718.5 Sort 0.7, 0.3, -98477.68 in increasing order. -98477.68, 0.3, 0.7 Sort -4, 1760969, -7 in decreasing order. 1760969, -4, -7 Sort 2/11, 5, 22, 33, 19, -3, 4. -3, 2/11, 4, 5, 19, 22, 33 Put -131331, -23, -4, 0, 2, 3 in descending order. 3, 2, 0, -4, -23, -131331 Sort -3, -1, -82200, -9, -4 in descending order. -1, -3, -4, -9, -82200 Sort 2, 44, -10271 in decreasing order. 44, 2, -10271 Sort -46, 162, -234, -2 in decreasing order. 162, -2, -46, -234 Put -92, -4, 1607 in descending order. 1607, -4, -92 Sort -7, 5, -1, 1817, 0 in ascending order. -7, -1, 0, 5, 1817 Put 1/2, -0.5, 19.55614, 0.01, 0.3 in increasing order. -0.5, 0.01, 0.3, 1/2, 19.55614 Sort 5, 117, 5850, -2, 0 in ascending order. -2, 0, 5, 117, 5850 Sort -659, -3, -3033, 3, 0. -3033, -659, -3, 0, 3 Put 4998, 389, 13 in increasing order. 13, 389, 4998 Sort -5, 2/15, -2/535, -4, -105. -105, -5, -4, -2/535, 2/15 Sort -266, 4, -4, 11, 85, -5 in decreasing order. 85, 11, 4, -4, -5, -266 Sort 34, 6, 1516, 818 in decreasing order. 1516, 818, 34, 6 Sort 1166, 4, -173, -3, 12 in descending order. 1166, 12, 4, -3, -173 Sort -3, -7, -17, -160, 21, 5 in increasing order. -160, -17, -7, -3, 5, 21 Put -220, 21, -2, 3, -3, -12 in descending order. 21, 3, -2, -3, -12, -220 Put 3, 4, -4, 9, -2, 0, -55 in decreasing order. 9, 4, 3, 0, -2, -4, -55 Sort 76/185, 3316, -4 in descending order. 3316, 76/185, -4 Sort 0, 5925177, -3. -3, 0, 5925177 Put 206, 0, 17146 in descending order. 17146, 206, 0 Put -0.5, -0.052, -0.4, -9/2 in decreasing order. -0.052, -0.4, -0.5, -9/2 Sort 1056, 41, 185, 1, 5. 1, 5, 41, 185, 1056 Sort 230, -20, -1774. -1774, -20, 230 Put -754, 55564, -4 in increasing order. -754, -4, 55564 Put -4, -7427, 14641 in increasing order. -7427, -4, 14641 Sort 100, -268, -30, -4. -268, -30, -4, 100 Put -83, 3, -3, -94, 4, 12 in increasing order. -94, -83, -3, 3, 4, 12 Sort 4, -2, -1, -10, 2, -3315. -3315, -10, -2, -1, 2, 4 Sort 2/3, -5, -23940, -1/3. -23940, -5, -1/3, 2/3 Put 0, -1, -3, 8, 157, -2 in ascending order. -3, -2, -1, 0, 8, 157 Put -8538, -7, -5 in descending order. -5, -7, -8538 Sort -64, -15, 11, -4 in descending order. 11, -4, -15, -64 Sort -1, 832, -3, 258 in decreasing order. 832, 258, -1, -3 Sort -18, 925, -22 in ascending order. -22, -18, 925 Sort -0.98, 1.3, 2/7, 3/4 in descending order. 1.3, 3/4, 2/7, -0.98 Put -11, -5, 26461, -1, -62 in decreasing order. 26461, -1, -5, -11, -62 Put 0.06, -3, 67, -28, -4.7, -5 in increasing order. -28, -5, -4.7, -3, 0.06, 67 Put -69920, 3, -5 in decreasing order. 3, -5, -69920 Sort -5, 8437, -3, -2, 3, 5 in increasing order. -5, -3, -2, 3, 5, 8437 Sort 4/3, -2/7, 1028, -6/11, 5, -2 in decreasing order. 1028, 5, 4/3, -2/7, -6/11, -2 Put -0.29, -2.2, -326, -3/4 in increasing order. -326, -2.2, -3/4, -0.29 Put 1966, 5, -3, 1376 in descending order. 1966, 1376, 5, -3 Put 4.1, 3, -0.2, 0.4, 2, -184 in ascending order. -184, -0.2, 0.4, 2, 3, 4.1 Sort 4, -2, -19, 23, -1/11, 0.3 in descending order. 23, 4, 0.3, -1/11, -2, -19 Put -9, -4, -174.8, -0.06 in descending order. -0.06, -4, -9, -174.8 Put 1837127/278, -1/3, -0.4 in increasing order. -0.4, -1/3, 1837127/278 Sort 81, 984, -6, 7 in decreasing order. 984, 81, 7, -6 Sort 0.01, 13, -92, -2/5, 5, 54 in ascending order. -92, -2/5, 0.01, 5, 13, 54 Sort 12, 4, -4, 0, 7, 5, -3 in increasing order. -4, -3, 0, 4, 5, 7, 12 Put -11, 5, -5, -1, -755, 0, -19 in ascending order. -755, -19, -11, -5, -1, 0, 5 Sort 6, -11, -171, 0, 1, -2. -171, -11, -2, 0, 1, 6 Put -4, -2, -17, -1810, 4, 129 in ascending order. -1810, -17, -4, -2, 4, 129 Sort -4.8, -3, -113/5, -78 in increasing order. -78, -113/5, -4.8, -3 Sort 1, -827, -5, -32, 3. -827, -32, -5, 1, 3 Put 237, 2, 4, -2, 0, -3 in descending order. 237, 4, 2, 0, -2, -3 Put 1, -4, 4, 761812, -7 in descending order. 761812, 4, 1, -4, -7 Sort 0, -61, -25749, 4 in descending order. 4, 0, -61, -25749 Put 4, 9, -25, -85, 2, 5 in decreasing order. 9, 5, 4, 2, -25, -85 Sort -77, -1139, -46. -1139, -77, -46 Put 217, -25, 2, 49 in decreasing order. 217, 49, 2, -25 Put 0, -1, 7, -1219, -5, -590, 1 in decreasing order. 7, 1, 0, -1, -5, -590, -1219 Sort -1, 1984, 11, 37 in desce	{ "pile_set_name": "DM Mathematics" }
4t. What is the smallest common multiple of 1 and w(-4)? 8 Suppose -24 = 4d - 124. What is the least common multiple of d and 6? 150 Suppose -5w = 2j + 3 + 3, -4j - 12 = 3w. Calculate the common denominator of -2(-214)/(-8) - j and (3/4)/((-6)/(-116)). 2 What is the common denominator of -13/4 and 82/36 + -6 + 4? 36 Calculate the common denominator of (453/(-6))/((-9)/(-3)) and 3/13. 78 Let s(h) = -4h - 5 - 6 + 0 - 1. Calculate the least common multiple of s(-5) and 6. 24 Let y(h) = h*3 + 8h*2 + 2h - 1. Let l be y(-8). Let f be -6 + (-1)/(1/1). Let b = f - l. Calculate the smallest common multiple of 6 and b. 30 Let d = -36 - -54. Let k = -2 - -19. Let c = k + 3. Calculate the smallest common multiple of d and c. 180 Suppose 0u - 3u - 153 = 5h, 0 = -5h - 5u - 155. Find the common denominator of 1/(-3) + 59/h and 31/6. 30 What is the lowest common multiple of 5/((-10)/(-8)) + (-60)/(-5) and 2? 16 Let n = -18774 - -563167/30. What is the common denominator of n and -115/66? 330 Suppose 172 = 5r - 98. Suppose -3l = -0l - r. Suppose -7 - 18 = -2z + 3s, -5s - 39 = -3z. Calculate the smallest common multiple of z and l. 72 Find the common denominator of (-2404)/(-504) - (-2)/7 and -59/18. 18 Suppose 3d - 10 = 2. Suppose -10r + 11r - d = 0. Calculate the least common multiple of 4 and r. 4 Let u(n) = -n3 + 9n*2 - 6n + 5. Let i be u(8). Suppose 0m = -o + 2m, 4m - 60 = -4o. Let r = i - o. What is the least common multiple of 10 and r? 110 Let a be (7 + -13)(-7)/(-3). Let l = a - -22. Calculate the lowest common multiple of 20 and l. 40 Let s be (0 - -2 - 5)-1. Suppose k + 2 = -s. Calculate the common denominator of 2/k + 54/20 and 99/10. 10 Let z = 36 + -20. What is the lowest common multiple of 12 and z? 48 Let c = 0 - -1. What is the lowest common multiple of c and 1? 1 What is the lowest common multiple of ((-36)/(-45))/(2/50) and 18? 180 Suppose -5n + 333 = -4n. What is the common denominator of 37/48 and n/286 + (-4)/(-26)? 528 Let m = 86 + 4. Suppose 5a + 2t - m = -0t, a + 3t = 5. Calculate the smallest common multiple of 4 and a. 20 Suppose 0 = 5h - 34 - 1. Let k be (-3)/2 + 112/32. Suppose -k - h = -r. What is the lowest common multiple of 5 and r? 45 Suppose -s + 4r - 10 = 0, 2s - r + 4r - 24 = 0. What is the lowest common multiple of s and 4? 12 Calculate the common denominator of 51/11 and (-7)/((-4)/(-2) + 0). 22 Let x(y) = -227y - 1. Let b be x(-1). Let g be 228063/156610/b. Let c = g - -3/6554. Calculate the common denominator of -53/6 and c. 18 Let n(l) = l - 2. Let g be n(2). Let r be 3 + (2 - (g - -1)). Suppose rk = 2k + 20. What is the smallest common multiple of 2 and k? 10 Let g be (25256/32)/(335/(-2)). Let u = g + -26/67. Find the common denominator of 62/70 + 4/10 and u. 70 Let n = 49787/90 + -4904/9. Calculate the common denominator of n and 109/12. 60 Let v(c) = -31c2 - c. Suppose -l + 0l - 3 = 0. Let x be v(l). Find the common denominator of 4/10 - x/(-165) and -41/3. 33 Suppose 2k - 1 - 1 = 0. Calculate the least common multiple of k and 8. 8 Let i be (-10)/(-4)32/20. Suppose 0 = -3n + i + 11. Suppose g + 72 = ng. Find the common denominator of -38/9 and g. 9 Suppose -2b - 3u - 1335 = 3b, -b - 5u = 289. Let x = b - -4747/18. Find the common denominator of 1/16 and x. 144 Let b = -126/37 - 1250/111. What is the common denominator of b and -77/2? 6 Let d = 3321/14 + -237. What is the common denominator of d and 63/8? 56 Let d be (-3)/(-3) - (-4)/(-2). Let w be (1/3)/(d/(-42)). Calculate the common denominator of (-4)/w - (-249)/(-84) and -149/18. 36 Let k be (15/(-4426))/(2/4). Let v = -263167/26556 + k. Let g = -11017/18 - -606. What is the common denominator of g and v? 36 Let d(o) be the first derivative of -3o4/4 + o3 - o2/2 - o + 3. Let y be d(2). What is the least common multiple of 24(3 - y/(-6)) and 22? 132 Let j be (-7)/21 - (-23)/(-3). Let i be (6/j)/(1/(-4)). Suppose i = u + 2. What is the lowest common multiple of u and 11? 11 Let l = 9 + -8. Let m = l - -3. What is the lowest common multiple of m and 2? 4 Let m = 78109/10 + -7822. Find the common denominator of 15/28 and m. 140 Suppose 0 = -0k - 2k. Suppose -3b + kj - 4j = -64, 0 = -2b + j + 28. What is the common denominator of 43/b - 5/5 and -85/2? 16 Let l be 4(165/(-6))/(-5). What is the common denominator of (5/80)/((-2)/l) and 9/8? 16 Let l be (-1)/2 - 2850/(-4). Let r = l + -400. Calculate the common denominator of 2/(-5) + r/105 and -14/11. 77 Let b(l) = l3 + 18l*2 - 20l + 2. What is the lowest common multiple of 33 and b(-19)? 231 Let g be (24/4)/((-6)/(-8)). Suppose -2y + g = y - z, -3y + 13 = -2z. Calculate the lowest common multiple of 1/(-3) + (-68)/(-6) and y. 11 Let t = -13367/8 + 1665. Calculate the common denominator of t and -107/12. 24 Suppose 0 = -3j + 4 - 1. Let y be (-9)/(-3) - 1/j. Suppose yp = -5s + 55, 7s - 3s - 44 = 4p. Calculate the lowest common multiple of s and 6. 66 Find the common denominator of (-3 - -1)/(48/113)2 and 9/2. 12 Let m(r) = r + 60. Calculate the lowest common multiple of m(-32) and 40. 280 Let t = -178988/5049 + 390/11. Let n = -9790/459 - t. Calculate the common denominator of 45 and n. 3 Calculate the smallest common multiple of 17 - (-2 - (-4 + 3)) and 18. 18 Let t = 241027353/25505 - 47251/5. Let y = t - 2780069/306060. Find the common denominator of 123/10 and y. 60 Suppose -5w = j - 23 - 44, 5j + 43 = 2w. What is the smallest common multiple of w and 6? 42 Let n = 10 - -26. Find the common denominator of 387/n - -1 and 73/3. 12 Let w = 1 + 0. What is the lowest common multiple of (3 + -1)/((-2)/(-1)) and w? 1 Find the common denominator of 18(-2)/80 - 0 and (-31)/22 + (1 - 1). 220 Let h be (-6)/(-21) + 57/21. Calculate the common denominator of ((-23)/h)/(4 + -1) and (0 + 2/(-12))25. 18 Let d(r) = -r*3 - 2r*2 + 2r + 5. Calculate the least common multiple of d(-3) and 14. 56 Suppose 5 = 3w + 2. Suppose 5o = 10o - 5. Calculate the lowest common multiple of w and o. 1 Let g be (-4)/(-10) + 11469/(-3885). Let s = g + -6/37. Calculate the common denominator of ((-18)/20)/((-21)/(-224)) and s. 35 Let a(k) = -k3 - 4k*2 + 3k + 4. What is the least common multiple of a(-5) and 20? 140 Let v = -19/8 + 163/72. Let z be 42/(-4)(-4)/(-171). Let x = z + -8/19. Find the common denominator of x and v. 9 Suppose 3s - 2s = -2, -4o + 80 = 4s. Let j = 27 - o. What is the lowest common multiple of j and 4? 20 Let c = -1 - 0. Let j be 2005/2 - c/2. Let b = j - 6079/6. Calculate the common denominator of -73/14 and b. 42 Suppose -k + 6k = -17380. Let q = k + 38198/11. Let x = 379 - 3397/9. Find the common denominator of q and x. 99 Suppose -2 = -2w + 6. Let f(j) = -j2 - 7j - 1. Calculate the least common multiple of f(-6) and w. 20 Let g be (3 + 7/(-3))12. What is the common denominator of 51/10 and 3/g68/12? 40 Let q = -860825/41 + 20988. Let j = -13/410 - q. Find the common denominator of 43/20 and j. 20 Let j(b) = b*2 - 8b + 22. Suppose -2v = -5h + 1, 3v + v - 33 = 3h. What is the lowest common multiple of v and j(6)? 60 Let k be 102/(-14) + (-4)/(-14). Suppose 2r = -2 + 4. What is the common denominator of 85/18 and r/(-3) + k/24? 72 Let k = -5 - -17. What is the lowest common multiple of k and 10/1 + (0 - 2)? 24 Suppose 0 = 11h - 3h - 48. Calculate the smallest common multiple of 22 and h. 66 Calculate the common denominator of (41/2 + -1)/(-4) and 1/((-4)/3) - -23. 8 Let c = 4465973/6 + -742606. Let z = c - 1747. What is the common denominator of (-289)/(-15) + (-4)/(-10) and z? 6 What is the smallest common multiple of 10 and (-5 - -2)(1 - -1)/(-6)? 10 Let d = 1/14037 - 3270631/140370. Let n be (348/(-9))/(5/3). Let o = d - n. Find the common denominator of o and -3/8. 40 Let i = -1596297/10 - -159470. Let f = 159 + i. What is the common denominator of (61/10)/((-2)/5) and f? 20 Suppose -11f + 224 = 5f. Let o(d) = -3d3 - 2d*2 - 3d. What is the lowest common multiple of f and o(-2)? 154 Let j = 2782/9 - 21851/72. Find the common denominator of j and 59/32. 32 Let c(q) = -2q - 16. Calculate the smallest common multiple of 16 and c(-28). 80 Suppose -5 - 4 = -3b. Find the common denomina	{ "pile_set_name": "DM Mathematics" }
ny minutes are there in 19/10 of a day? 2736 How many seconds are there in 7/6 of a minute? 70 How many milliseconds are there in thirty-four fifths of a second? 6800 Convert 4.7126436 days to weeks. 0.6732348 What is 1/5 of a tonne in kilograms? 200 What is 589.0301km in millimeters? 589030100 How many millilitres are there in 605.0876 litres? 605087.6 How many seconds are there in 3.976329 milliseconds? 0.003976329 Convert 624.2787l to millilitres. 624278.7 What is 7/4 of a litre in millilitres? 1750 What is 201.3249 minutes in microseconds? 12079494000 What is 3/8 of a decade in months? 45 What is 7/8 of a centimeter in micrometers? 8750 Convert 106614.78 hours to days. 4442.2825 What is 427040.1ng in kilograms? 0.0000004270401 How many centimeters are there in 3/8 of a kilometer? 37500 What is 1/4 of a litre in millilitres? 250 How many years are there in 3/8 of a millennium? 375 Convert 677.660634 seconds to weeks. 0.001120470625 How many micrometers are there in thirty-three tenths of a centimeter? 33000 What is 130890.9 hours in milliseconds? 471207240000 How many centuries are there in 0.6983159 decades? 0.06983159 How many millilitres are there in ninety-five halves of a litre? 47500 Convert 808502.7 kilometers to nanometers. 808502700000000000 How many millilitres are there in 11/4 of a litre? 2750 What is 7.361761 nanometers in meters? 0.000000007361761 How many centuries are there in 61.04195 millennia? 610.4195 How many months are there in 1/20 of a decade? 6 How many kilograms are there in one quarter of a tonne? 250 How many minutes are there in three fifths of a hour? 36 How many millennia are there in 1.879763 centuries? 0.1879763 What is 80.07748 milligrams in tonnes? 0.00000008007748 How many micrograms are there in 6330.237t? 6330237000000000 Convert 757618.4nm to micrometers. 757.6184 Convert 1.9097496 months to millennia. 0.0001591458 What is fourty-four fifths of a week in minutes? 88704 How many centimeters are there in 1/4 of a meter? 25 What is one fifth of a litre in millilitres? 200 What is 41/2 of a microgram in nanograms? 20500 What is twenty-five eighths of a tonne in kilograms? 3125 How many milliseconds are there in 7/8 of a minute? 52500 What is 11/8 of a tonne in kilograms? 1375 How many seconds are there in 642063.1 days? 55474251840 What is 297104.1l in millilitres? 297104100 What is 1281.828429 microseconds in weeks? 0.0000000021194253125 What is twenty-five halves of a tonne in kilograms? 12500 How many years are there in 0.504563 centuries? 50.4563 What is 19/4 of a hour in seconds? 17100 How many meters are there in 29/2 of a kilometer? 14500 What is 2336.729nm in millimeters? 0.002336729 What is 8/15 of a day in minutes? 768 Convert 0.9213259 years to months. 11.0559108 What is 96295.45ml in litres? 96.29545 What is 15/4 of a second in milliseconds? 3750 What is 35445.78 microseconds in milliseconds? 35.44578 What is 25/4 of a kilometer in meters? 6250 How many micrograms are there in eleven quarters of a milligram? 2750 How many months are there in 645632.6 decades? 77475912 What is three fifths of a litre in millilitres? 600 What is 295.5365ug in nanograms? 295536.5 What is 81328.27ml in litres? 81.32827 What is 90487.5 months in decades? 754.0625 What is 36496.9 years in centuries? 364.969 How many months are there in 8382.629 decades? 1005915.48 What is 2744.202 centuries in millennia? 274.4202 What is three fifths of a micrometer in nanometers? 600 How many grams are there in 12/25 of a kilogram? 480 Convert 6.928048 decades to centuries. 0.6928048 How many centuries are there in 0.9345453 millennia? 9.345453 How many millilitres are there in 4.160121 litres? 4160.121 How many decades are there in three tenths of a millennium? 30 How many weeks are there in 6697372.5 minutes? 664.421875 How many litres are there in 20.76564ml? 0.02076564 Convert 48.54904 days to minutes. 69910.6176 How many milligrams are there in 3/25 of a gram? 120 How many seconds are there in 3/5 of a minute? 36 What is 23.22652um in nanometers? 23226.52 How many nanometers are there in 6/25 of a micrometer? 240 Convert 219.0645ms to minutes. 0.003651075 Convert 127919.2257s to weeks. 0.21150665625 What is seven eighths of a micrometer in nanometers? 875 What is 23.4228 millennia in centuries? 234.228 How many micrometers are there in one quarter of a centimeter? 2500 How many months are there in thirteen eighths of a millennium? 19500 How many centimeters are there in five quarters of a meter? 125 How many kilograms are there in 1.12993g? 0.00112993 How many months are there in 2/15 of a century? 160 What is 32329.4 millilitres in litres? 32.3294 What is 31.98392 grams in milligrams? 31983.92 Convert 0.265691s to microseconds. 265691 Convert 75176.72g to tonnes. 0.07517672 What is 0.9877456 millennia in decades? 98.77456 How many years are there in 3/8 of a millennium? 375 What is 3/25 of a litre in millilitres? 120 Convert 1.606535t to micrograms. 1606535000000 How many tonnes are there in 10.97334mg? 0.00000001097334 What is 17/2 of a day in hours? 204 What is 6/5 of a litre in millilitres? 1200 What is 1.005466 centimeters in millimeters? 10.05466 How many meters are there in 51/8 of a kilometer? 6375 What is 59/3 of a decade in months? 2360 Convert 825.5155 millilitres to litres. 0.8255155 What is 837937.7 nanograms in grams? 0.0008379377 Convert 2.095479 nanograms to milligrams. 0.000002095479 How many micrometers are there in 79.25159cm? 792515.9 How many months are there in one twentieth of a millennium? 600 How many millilitres are there in 30.8386 litres? 30838.6 What is 10/3 of a year in months? 40 What is 8315019.9 milliseconds in hours? 2.30972775 What is 1/10 of a kilometer in millimeters? 100000 How many months are there in six fifths of a millennium? 14400 What is 5.8490865us in hours? 0.00000000162474625 How many litres are there in 9523.194 millilitres? 9.523194 How many micrometers are there in 0.5067667 nanometers? 0.0005067667 Convert 339563.4mg to grams. 339.5634 What is 9702.628ml in litres? 9.702628 How many nanograms are there in 293.6412 tonnes? 293641200000000000 What is 26/5 of a microgram in nanograms? 5200 What is 4/7 of a week in minutes? 5760 How many grams are there in 7302.043 nanograms? 0.000007302043 What is 7582.029 millilitres in litres? 7.582029 What is 594138.7 weeks in days? 4158970.9 How many meters are there in 21/5 of a kilometer? 4200 What is 5/8 of a litre in millilitres? 625 Convert 16907.265 hours to days. 704.469375 Convert 5155.175 tonnes to grams. 5155175000 How many micrometers are there in 12/25 of a millimeter? 480 How many litres are there in 4.92301 millilitres? 0.00492301 How many nanograms are there in 17/10 of a microgram? 1700 How many years are there in 13/5 of a decade? 26 How many kilometers are there in 0.7478378cm? 0.000007478378 How many weeks are there in 12024.39546ms? 0.00001988160625 How many meters are there in 5/4 of a kilometer? 1250 What is 132.5507ml in litres? 0.1325507 What is 56227.93l in millilitres? 56227930 How many millilitres are there in 17/2 of a litre? 8500 How many litres are there in 581.5951 millilitres? 0.5815951 What is 581.2628 centimeters in meters? 5.812628 Convert 4.435734ng to milligrams. 0.000004435734 What is 47.44261l in millilitres? 47442.61 How many milligrams are there in 45456.55 kilograms? 45456550000 What is 68177.016ms in hours? 0.01893806 What is three fifths of a litre in millilitres? 600 How many milliseconds are there in 0.6435357s? 643.5357 How many nanograms are there in six fifths of a microgram? 1200 What is fifty-nine fifths of a microgram in nanograms? 11800 How many seconds are there in 5/6 of a day? 72000 What is 9069.625 kilometers in micrometers? 9069625000000 How many minutes are there in 23/3 of a week? 77280 Convert 84177.29 decades to millennia. 841.7729 How many kilograms are there in nineteen quarters of a tonne? 4750 Convert 0.5750726ug to grams. 0.0000005750726 What is 178811.5us in seconds? 0.1788115 What is 1/16 of a week in minutes? 630 Convert 2587.074 millilitres to litres. 2.587074 Convert 493689.168 minutes to weeks. 48.9771 Convert 530483.1 kilograms to grams. 530483100 How many months ar	{ "pile_set_name": "DM Mathematics" }
What is 6469547 to the power of 1/10, to the nearest integer? 5 What is 4818604 to the power of 1/6, to the nearest integer? 13 What is the square root of 260570 to the nearest integer? 510 What is 72220 to the power of 1/2, to the nearest integer? 269 What is the square root of 1270848 to the nearest integer? 1127 What is the fifth root of 325171 to the nearest integer? 13 What is 12984381 to the power of 1/9, to the nearest integer? 6 What is the fifth root of 11880861 to the nearest integer? 26 What is the square root of 1473902 to the nearest integer? 1214 What is 141319 to the power of 1/4, to the nearest integer? 19 What is 1036469 to the power of 1/10, to the nearest integer? 4 What is the square root of 6369507 to the nearest integer? 2524 What is the third root of 20955988 to the nearest integer? 276 What is the third root of 10124116 to the nearest integer? 216 What is 731739 to the power of 1/10, to the nearest integer? 4 What is 1713122 to the power of 1/3, to the nearest integer? 120 What is 9293261 to the power of 1/10, to the nearest integer? 5 What is 13325 to the power of 1/3, to the nearest integer? 24 What is 8462910 to the power of 1/3, to the nearest integer? 204 What is the square root of 140485 to the nearest integer? 375 What is 326609 to the power of 1/2, to the nearest integer? 571 What is 266216 to the power of 1/7, to the nearest integer? 6 What is 3479209 to the power of 1/3, to the nearest integer? 152 What is the square root of 1275108 to the nearest integer? 1129 What is 673344 to the power of 1/3, to the nearest integer? 88 What is 1482485 to the power of 1/2, to the nearest integer? 1218 What is 344751 to the power of 1/2, to the nearest integer? 587 What is 1275915 to the power of 1/3, to the nearest integer? 108 What is the cube root of 163568 to the nearest integer? 55 What is 40082 to the power of 1/3, to the nearest integer? 34 What is 182319 to the power of 1/3, to the nearest integer? 57 What is the square root of 986538 to the nearest integer? 993 What is the fourth root of 1143343 to the nearest integer? 33 What is 630537 to the power of 1/6, to the nearest integer? 9 What is the fourth root of 2641707 to the nearest integer? 40 What is 1709805 to the power of 1/3, to the nearest integer? 120 What is the square root of 12241602 to the nearest integer? 3499 What is the fifth root of 12804773 to the nearest integer? 26 What is 216624 to the power of 1/3, to the nearest integer? 60 What is the cube root of 797432 to the nearest integer? 93 What is 135599 to the power of 1/6, to the nearest integer? 7 What is 423355 to the power of 1/2, to the nearest integer? 651 What is 70135 to the power of 1/2, to the nearest integer? 265 What is 1729187 to the power of 1/2, to the nearest integer? 1315 What is 2587516 to the power of 1/6, to the nearest integer? 12 What is the fifth root of 14607 to the nearest integer? 7 What is 70464 to the power of 1/8, to the nearest integer? 4 What is 917320 to the power of 1/4, to the nearest integer? 31 What is 10064114 to the power of 1/2, to the nearest integer? 3172 What is 5758345 to the power of 1/7, to the nearest integer? 9 What is 5707770 to the power of 1/6, to the nearest integer? 13 What is 2702851 to the power of 1/2, to the nearest integer? 1644 What is 3053922 to the power of 1/7, to the nearest integer? 8 What is the cube root of 43920 to the nearest integer? 35 What is 317406 to the power of 1/7, to the nearest integer? 6 What is the ninth root of 206507 to the nearest integer? 4 What is the square root of 226111 to the nearest integer? 476 What is 498689 to the power of 1/2, to the nearest integer? 706 What is the cube root of 10034318 to the nearest integer? 216 What is the seventh root of 4416199 to the nearest integer? 9 What is 732900 to the power of 1/2, to the nearest integer? 856 What is 681295 to the power of 1/2, to the nearest integer? 825 What is 2079559 to the power of 1/2, to the nearest integer? 1442 What is the third root of 1365023 to the nearest integer? 111 What is the third root of 26797269 to the nearest integer? 299 What is 625511 to the power of 1/4, to the nearest integer? 28 What is 207518 to the power of 1/5, to the nearest integer? 12 What is the third root of 193380 to the nearest integer? 58 What is 8782884 to the power of 1/2, to the nearest integer? 2964 What is 255578 to the power of 1/6, to the nearest integer? 8 What is the square root of 6771158 to the nearest integer? 2602 What is the square root of 608984 to the nearest integer? 780 What is the cube root of 8938032 to the nearest integer? 208 What is the third root of 25299929 to the nearest integer? 294 What is the cube root of 8740231 to the nearest integer? 206 What is the cube root of 1989863 to the nearest integer? 126 What is 529261 to the power of 1/2, to the nearest integer? 728 What is the square root of 6001992 to the nearest integer? 2450 What is 54934 to the power of 1/3, to the nearest integer? 38 What is 6401435 to the power of 1/3, to the nearest integer? 186 What is the square root of 887231 to the nearest integer? 942 What is the cube root of 3328802 to the nearest integer? 149 What is 3412122 to the power of 1/2, to the nearest integer? 1847 What is the third root of 3719870 to the nearest integer? 155 What is 3847098 to the power of 1/10, to the nearest integer? 5 What is the cube root of 28075791 to the nearest integer? 304 What is 127086 to the power of 1/8, to the nearest integer? 4 What is 222875 to the power of 1/2, to the nearest integer? 472 What is 420027 to the power of 1/10, to the nearest integer? 4 What is the eighth root of 15197659 to the nearest integer? 8 What is 209473 to the power of 1/8, to the nearest integer? 5 What is 5924287 to the power of 1/3, to the nearest integer? 181 What is the third root of 76213 to the nearest integer? 42 What is the third root of 603034 to the nearest integer? 84 What is the fifth root of 41491781 to the nearest integer? 33 What is 260014 to the power of 1/3, to the nearest integer? 64 What is the square root of 733061 to the nearest integer? 856 What is the cube root of 1349513 to the nearest integer? 111 What is 1319435 to the power of 1/2, to the nearest integer? 1149 What is the cube root of 122221 to the nearest integer? 50 What is the tenth root of 2558382 to the nearest integer? 4 What is 4187168 to the power of 1/2, to the nearest integer? 2046 What is 203586 to the power of 1/9, to the nearest integer? 4 What is 3834119 to the power of 1/5, to the nearest integer? 21 What is 90987 to the power of 1/3, to the nearest integer? 45 What is the third root of 813644 to the nearest integer? 93 What is the fifth root of 9506020 to the nearest integer? 25 What is the seventh root of 4907289 to the nearest integer? 9 What is 26092 to the power of 1/8, to the nearest integer? 4 What is the square root of 7020472 to the nearest integer? 2650 What is 14623898 to the power of 1/9, to the nearest integer? 6 What is 3699432 to the power of 1/3, to the nearest integer? 155 What is the seventh root of 232491 to the nearest integer? 6 What is the cube root of 240916 to the nearest integer? 62 What is 360328 to the power of 1/2, to the nearest integer? 600 What is the cube root of 2383136 to the nearest integer? 134 What is 7654970 to the power of 1/8, to the nearest integer? 7 What is the seventh root of 481349 to the nearest integer? 6 What is 488661 to the power of 1/2, to the nearest integer? 699 What is 1595722 to the power of 1/3, to the nearest integer? 117 What is 517986 to the power of 1/2, to the nearest integer? 720 What is 29407 to the power of 1/2, to the nearest integer? 171 What is 8399962 to the power of 1/9, to the nearest integer? 6 What is 120682 to the power of 1/5, to the nearest integer? 10 What is the square root of 84904 to the nearest integer? 291 What is 8899873 to the power of 1/2, to the nearest integer? 2983 What is the seventh root of 26405951 to the nearest integer? 11 What is the seventh root of 3464532 to the nearest integer? 9 What is 17103843 to the power of 1/3, to the nearest integer? 258 What is 739809 to the power of 1/5, to the nearest integer? 15 What is 3240059 to the po	{ "pile_set_name": "DM Mathematics" }
nt values? True Let v be (-30)/25(-30)/9. Is 3 greater than v? False Let w be ((-3 - -4) + -1)1. Which is bigger: -3 or w? w Let s be ((-8)/12)/((-6)/(-9)). Is s <= -1/16? True Let u(n) = n + 7. Let h be u(-7). Let a = 89/372 + 1/93. Which is bigger: a or h? a Let j = -6 - -4. Let p = 23 - 45/2. Is p at least j? True Let o = 3931/12 - 326. Let d = 4/3 - o. Which is bigger: d or 0? 0 Suppose -2v + 3h + 2 = -2h, 4h = 3v - 3. Let y = 25720182/17 - 1513368. Let l = y - -416. Is l at least v? False Suppose -1 = 4t - 9. Suppose -2v + a + 0a = t, 5a = 4v + 16. Is 1 greater than or equal to v? True Let o = 30 - 89/3. Is o greater than -0.08? True Let i be (-1)/4 + 19/(-4). Suppose 3h + 2 - 12 = 2s, h = 4. Let b(o) = -4o3 + o2 - o. Let r be b(s). Is r at most as big as i? False Suppose 2u + 0u - 10 = 0. Suppose -un + 6 = -3n. Is 3 smaller than n? False Let k be (0 + 1)(-20)/(-5). Which is smaller: k or 0.2? 0.2 Let n = 8 + -4. Suppose 3 = -2j - 5t, -2j + 5t = nt - 3. Is j equal to 2/7? False Let w = -511 - -3611/7. Is w smaller than 4? False Suppose -z + 304 = -j + 1096, -4j + 3z + 3166 = 0. Let a = j + -3937/5. Which is bigger: a or 4? 4 Let z = -511/180 + 26/9. Let n = -18 + 91/5. Let w = n + z. Which is smaller: w or 1? w Let a be 0/(-2) + 1 + -1. Suppose -k - 4 + 1 = a. Let i(z) = -z2 - 2z + 5. Let l be i(-4). Is k at least l? True Let d = 1348 + -36400/27. Is -1 not equal to d? True Let b be (-3)/(-6) - (-2 - (-18)/8). Is 0 not equal to b? True Suppose 2d + 3 + 3 = 5k, -2k + d = -3. Let f(b) = -b3 - b2 + 2b + 1. Let p be f(0). Which is smaller: k or p? k Let t = 20 + -41/2. Are t and 7 equal? False Let j(d) = d*3 + 7d*2 - 9d - 9. Let s be j(-8). Let z be 7/(-4) - s/(-4). Suppose -y = -3q, -y = y + 2q. Is z not equal to y? True Let g be 2/(-4)(0 + -6). Suppose 13 + g = -4n, -3f - 22 = 4n. Which is bigger: f or -1? -1 Let r = -0.22 - -2.72. Let u = r - 0.5. Which is smaller: u or -5? -5 Let z(l) = -l*3 + 6l*2 - 5l - 1. Let w be z(5). Which is smaller: w or 2/261? w Suppose -5 = 4y - 1. Let j = -1 - 0. Let f be (0 + (-2)/(-2))j. Is f at least as big as y? True Let w(c) = -3c2 + 8c - 1. Let q be w(-2). Is -29 at most as big as q? True Let y = -37 + 37. Does y = 1/21? False Let g = -2.8 + 2.1. Do -2 and g have different values? True Let s(v) = 2v - 1. Let z(t) = 2t3 + t2 + t. Let b be z(-1). Let m be s(b). Let d be (-36)/(-10) + (-2)/m. Which is smaller: d or 3? 3 Let y = 0.1 - 1.1. Let i = 0.2 - 0.15. Let d = -2.95 - i. Which is bigger: d or y? y Let g be -1 + -1(-1 - -2). Let m = 2 - g. Suppose 4b - 36 + 8 = my, -23 = 5y - b. Is -4 at least as big as y? True Suppose -3u + 11 = p + p, 3u = -3p + 15. Let j = -7569 + 22913/3. Let b = -68 + j. Is b greater than u? False Let i(u) = -u2 + 5u - 2. Let x = -1 + 4. Let o be i(x). Is 7/2 > o? False Let m = 3 - 2. Let x = 0 + m. Let l = -3 + x. Is l smaller than 1? True Let y be 16/6(-18)/(-12). Is 5 at most y? False Let f(t) = -4t - 3. Let d be f(-2). Let x(q) = q*2 - 4q - 4. Let j be x(d). Which is greater: j or 2/9? j Let c = -856/7 - -122. Suppose -5 = -3v + 7. Is v <= c? False Let j be (-2 - 1-4)6. Let s be (-3)/j + 81/420. Which is smaller: 0 or s? s Suppose 2u + 0u + 10 = 0. Let w = 11 + -25. Let n = w - -8. Which is smaller: n or u? n Let d = 5 - 5. Is d less than or equal to -32? False Let j = -1 + 2. Let k be (-1 - -2)(-2 + j). Let v = 1 - k. Is 3 at most v? False Let j be (-20)/15(-2 - (-15)/6). Which is bigger: j or -1/2? -1/2 Let b = 1.11 - 0.9. Let w = 0.11 - b. Let u = 0.02 - 0.42. Which is smaller: u or w? u Let y be (-25)/(-10)(-48)/(-75). Is y greater than 3? False Let n be 1 + (-3 - 112/(-49)). Suppose -3c + c - 20 = 0. Is c less than n? True Let b = 17 - 12. Let v = 4 - -3. Let j = v - b. Which is smaller: -0.1 or j? -0.1 Let l = 3 - 8. Suppose -2r - 3r + 25 = 0. Suppose g + 18 = -rf + 4g, -2f - 32 = 5g. Which is greater: f or l? l Let i = 0.3 - 0.4. Let h = -20.9 + 4.9. Is h != i? True Let p(n) = 2n2 + n3 - 2n2. Let s = 20 + -20. Let u be p(s). Do 0 and u have the same value? True Let b(k) = k3 + 3k*2 + 3k + 8. Let t be b(-3). Let r be ((-10)/(-52))/5-2. Which is smaller: t or r? t Let s be (-8)/(-6)3 + -1. Let t(o) be the second derivative of -o*3/6 + 3o2/2 + o. Let f be t(s). Which is smaller: 1 or f? f Let k = 32/37 + -937/185. Which is greater: k or -5? k Let b = -2.4 - -1.6. Is 1 smaller than b? False Let h(u) = u3 + 5u2 + u + 2. Let m be h(-5). Suppose 3i - 29 = 25. Let q be (3/(-48))/(m/i). Are q and 0 unequal? True Let v = -152 - -151. Which is greater: -0.198 or v? -0.198 Let r(s) = -s*2 - 7s + 5. Let o be r(-8). Let p be 0 - o/((-39)/(-2)). Suppose b = 5b - 4. Is b at most p? False Suppose 0 = -7y + 55 + 22. Which is smaller: y or 10? 10 Suppose 0l - 8 = -2l. Suppose 2q + 4 = 3q. Suppose -4t = -lh + 4, -2t - 6 - 2 = qh. Is t less than 2? True Let x = -103 + 108.1. Let d = x + -0.1. Let b = 5 - d. Are b and 0.1 nonequal? True Suppose 0 = -8g + 16g + 408. Is -51 < g? False Suppose -6 = -3b + 6. Is 6 greater than or equal to b? True Let w = -20 - 0. Let y be (-2)/90 + 4/w. Is 1 at most as big as y? False Let j be 1 + (-1 + 7)/3. Suppose -jv - 1 + 4 = 0. Let o = -1 + 2. Do v and o have the same value? True Let k = 32 - 30. Which is smaller: 0.4 or k? 0.4 Let z = -405 + 489.1. Let w = z + -80. Let u = -4 + w. Which is smaller: u or -2/5? -2/5 Suppose l + 2t = -8, 2l = -3l - 3t - 5. Suppose -7 = -n + lh, n + 2h - 48 = -3n. Which is smaller: -1 or n? -1 Let c be -4 - 1/(-31)122. Is c at least as big as 0? False Let h = 54.4 - -6.6. Which is smaller: h or 1/3? 1/3 Let g = -2.5 - -3.5. Suppose -3w + 15 = -3m, 0 = -w - m - 3 + 2. Let b = w - 2. Is b < g? True Let k be 26/(-3) - 1/3. Let b be (-3)/(k/6) - -2. Suppose -2q = bn + 16 - 2, 3q = 5n + 23. Which is bigger: q or 1/4? q Let q(d) = d + d2 + d2 + 5 - 3d2 - 12d. Let i be q(-10). Let r be -2(-3 - i/(-6)). Is r at most as big as 2? True Let q be 6/(-3) + (-54)/(-26). Which is smaller: 0 or q? 0 Suppose 0 = -2f - 0 - 2. Which is smaller: f or 6/25? f Let a = 79 + -63. Is 16 != a? False Let k(z) = -z*2 - 9z - 10. Let q be k(-7). Suppose 80 = 10s + 6s. Is q at least s? False Let f = -44 + 47. Are 5 and f equal? False Suppose 9 = -2m - m - 2j, -m + 3j = -8. Is m > 3/16? False Let v(b) = -b3 + 11b*2 - b + 5. Suppose 3x + 49 = 5h, 4h - x - 48 = -3x. Let m be v(h). Suppose w = -5q + 2w - 26, -q - 2 = 3w. Is q bigger than m? True Let p(t) = -t*2 - 8t - 1. Let m be p(-9). Let r = m + 14. Let v be (2/r)/(18/(-16)). Is 0 >= v? True Suppose -2i = 2o + 8, -10 = -2o - 3o. Let r be (-3 + i/3)1. Is -4 equal to r? False Suppose a + 5 = 6a. Let c = 6 - 3. Suppose cs + 0 = -4m - 9, 0 = -3m - 9. Are s and a non-equal? False Suppose -2t - 7t = -9. Is t bigger than 4? False Suppose 4t + 0t = -168. Let l = t - -30. Let p be 1/(-3) - (-56)/l. Is -4 equal to p? False Let n = -0.6 - 0.4. Let t = n + 0.5. Let w = t - -0.7. Which is greater: w or -0.1? w Suppose -3t = -8t. Is 2 greater than or equal to t? True Suppose 5 = 4p - 7. Let l = -11 + p. Let r(n) = n*3 - 9n*2 - 11n + 2. Let c be r(10). Is l bigger than c? False Suppose 3q = 12, 11 = -3w - 0q - q. Which is smaller: -3/4 or w? w Let y be 16/4227/(-18). Which is greater: -2 or y? y Suppose 0 = z - 0z - 6. Let y be z/(-18)14. Is y smaller than -2? False Let x be -4 - 51/(-12)1. Is x less than 2? True Suppose -2j = -0j + b - 1, 4b = -3j + 4. Let i(a) = 2a2 + 4a - 10. Let v be i(-7). Let f be v/(-33) - 10/(-5). Is f != j? True Let s = -638/171 - -54/19. Does s = -2? False Suppose a + 9 = 2i, a - 5i = -i - 19. Which is smaller: a or -1/3? -1/3 Let o = 12 - 31. Which is greater: o or -18? -18 Let h = -3607334/1925 + -12836/385. Let b = h - -1907. Let x = 17/25 + b. Are x and 1 equal? False Let q = -4 + 4.1. Let y = -0.3 - q. Is y at least as big as 1? False Let j(f) be the first derivative of f*2/2 + 7f - 3. Let d be j(-12). Is d not equal to -6? True Let q = -170570/46189 - -2/3553. Is q bigger than -4? True Let h = -12 - -11. Is h at most as big as -2/3? True Let g be ((-2)/(-3))/(2/(-33)).	{ "pile_set_name": "DM Mathematics" }
alse Is 37913923 a composite number? False Is 135072929 a prime number? True Is 37269031 prime? False Is 1392617 prime? False Is 6034091 prime? False Is 2732893 composite? False Is 18484171 composite? False Is 1011472487 a composite number? False Is 83503861 composite? True Is 257437 composite? False Is 779837 prime? True Is 61781 composite? False Is 2866789 composite? True Is 66872461 composite? True Is 6576571 composite? False Is 280456991 prime? True Is 75215479 composite? False Is 86323 a composite number? False Is 572023 composite? False Is 38539 a prime number? False Is 25605862 composite? True Is 102109369 a composite number? False Is 623657 composite? True Is 53987 a composite number? False Is 5180723 a prime number? False Is 2152613 prime? False Is 889171 a prime number? True Is 1490053 a composite number? True Is 95540953 composite? False Is 40025443 composite? False Is 10111219 composite? True Is 15372209 prime? True Is 184077407 prime? True Is 650519 a composite number? False Is 291043499 a composite number? False Is 369222661 composite? True Is 20854843 a composite number? False Is 1757369 prime? False Is 27737971 prime? False Is 7686291 composite? True Is 158479973 a composite number? True Is 3254011 a composite number? True Is 1307557 a prime number? True Is 32875597 prime? False Is 1417109 a prime number? False Is 21881 composite? False Is 24035971 prime? False Is 704061803 prime? False Is 1070195435 a composite number? True Is 16980401 a composite number? True Is 2259307 prime? False Is 4778213 a prime number? False Is 11196167 composite? False Is 17589911 a composite number? True Is 41665447 prime? True Is 55436383 composite? True Is 8352619 composite? True Is 1247759 a prime number? True Is 10802657 prime? False Is 100209 prime? False Is 171293 prime? True Is 9795161 composite? False Is 18251 a composite number? False Is 15755303 prime? False Is 4902757 a prime number? True Is 7275809 a composite number? False Is 5873771 a prime number? False Is 12121562 a prime number? False Is 3565381 composite? False Is 10814299 prime? False Is 19616809 composite? False Is 8484943 prime? False Is 445741 a composite number? False Is 15511 a composite number? False Is 116294617 a composite number? False Is 6062911 prime? True Is 8556299 prime? False Is 238292113 composite? False Is 3682753 a prime number? False Is 2827081 prime? False Is 1425766 a prime number? False Is 497755135 a composite number? True Is 4973527 a prime number? False Is 16318451 composite? True Is 14674909 composite? False Is 30532063 composite? True Is 13962639 a composite number? True Is 35059499 prime? False Is 46394191 a prime number? True Is 211034947 a composite number? False Is 14439731 composite? True Is 172997 composite? True Is 6547579 a prime number? True Is 25189583 a composite number? True Is 118939397 a composite number? False Is 1869893 a composite number? True Is 5154053 composite? True Is 1970582 a composite number? True Is 351257 a prime number? True Is 3933191 prime? False Is 112372177 a composite number? False Is 375767 composite? True Is 855373 composite? False Is 178967831 a prime number? False Is 72704323 prime? True Is 133402117 composite? True Is 15271901 prime? True Is 232690505 prime? False Is 47859953 a prime number? False Is 192838757 prime? False Is 22003201 composite? True Is 36663779 composite? True Is 27950521 prime? True Is 515621 composite? False Is 187442161 composite? True Is 18048995 prime? False Is 16060573 prime? False Is 3956371 composite? True Is 9596561 composite? True Is 1076717 a prime number? True Is 166079071 a prime number? False Is 2827889 a composite number? True Is 1492499 a prime number? True Is 5740331 a composite number? True Is 13759979 a composite number? False Is 364183 prime? True Is 18817289 composite? True Is 1394807 composite? True Is 170328259 a composite number? False Is 47656009 prime? False Is 1318661 composite? False Is 55095379 prime? True Is 127532549 composite? False Is 510717107 composite? True Is 3896923 a prime number? True Is 23061079 composite? True Is 277068817 a prime number? True Is 42776521 a prime number? False Is 429770849 composite? False Is 7790047 a composite number? False Is 133794943 composite? True Is 179606551 a composite number? True Is 570733 composite? False Is 372528847 composite? False Is 41579 composite? False Is 199306637 composite? True Is 13587587 a composite number? True Is 16039289 prime? False Is 524790113 a composite number? False Is 72101633 prime? False Is 472669143 a composite number? True Is 1004465498 composite? True Is 5230627 composite? False Is 1278551 a prime number? True Is 32378321 composite? False Is 880697 prime? False Is 6575029 prime? True Is 1048793 a composite number? False Is 507043 a composite number? True Is 119531 prime? False Is 124518477 a composite number? True Is 11588537 a composite number? True Is 18151358 prime? False Is 14795621 prime? False Is 51330491 composite? False Is 214250159 prime? True Is 70298521 composite? False Is 83620351 composite? False Is 128167957 a prime number? True Is 65019109 composite? True Is 518269951 composite? False Is 1878547 a prime number? False Is 2331829 composite? False Is 967661 a prime number? False Is 490381 composite? True Is 22896287 composite? False Is 22419647 composite? True Is 142553309 prime? False Is 22016569 prime? True Is 6124109 composite? False Is 1646121 a prime number? False Is 1760615 composite? True Is 64913327 a composite number? True Is 1432189897 a prime number? True Is 20849267 a prime number? False Is 2130241 a prime number? True Is 18904529 prime? False Is 26948541 a prime number? False Is 5426779 composite? False Is 30384943 a prime number? True Is 12614353 prime? True Is 44132633 prime? True Is 17779823 composite? False Is 17065579 prime? False Is 14149111 a prime number? True Is 1650463 a composite number? False Is 7838417 composite? True Is 95662861 a composite number? True Is 118366327 a prime number? True Is 470709881 composite? True Is 25925179 a composite number? True Is 8050577 prime? True Is 16030147 composite? True Is 236222851 a prime number? True Is 2007907 a prime number? False Is 216884257 prime? True Is 367834843 a prime number? True Is 279498361 a prime number? True Is 4655411 a prime number? True Is 57023311 prime? True Is 41921987 a composite number? False Is 538355 a prime number? False Is 114339961 a prime number? True Is 32545333 a prime number? True Is 1297031 a prime number? False Is 647759719 a composite number? False Is 165659107 composite? True Is 50859695 composite? True Is 102365693 prime? False Is 37705841 prime? True Is 43706913 composite? True Is 186469 a prime number? True Is 9752387 a prime number? True Is 41495911 composite? False Is 4202413 prime? True Is 9305567 a composite number? True Is 119423 prime? False Is 781150197 composite? True Is 42032818 a prime number? False Is 2811583 composite? False Is 356144381 composite? False Is 8932993 composite? True Is 11157469 composite? True Is 2639821 a prime number? False Is 2737403 composite? True Is 5422537 a composite number? True Is 1193581 a composite number? True Is 3169721 composite? False Is 7668011 prime? False Is 26112007 a prime number? True Is 2600161 prime? True Is 125591 composite? False Is 487843 prime? True Is 1370311 prime? True Is 2126363 composite? False Is 384359 prime? True Is 7898447 prime? True Is 3249557 a prime number? True Is 69961559 composite? True Is 1339847 composite? True Is 223682545 composite? True Is 1984039 a composite number? False Is 103396691 composite? False Is 8384071 a composite number? False Is 1863839 prime? True Is 4713937 composite? True Is 566983 prime? False Is 758614 composite? True Is 6963311 a composite number? True Is 590988949 composite? False Is 6417113 a prime number? True Is 56039023 prime? True Is 1084297 composite? False Is 1070885 composite? True Is 30594709 a prime number? False Is 22780207 a composite number? False Is 2689081 a prime number? False Is 2385521 a composite number? True Is 11699 a composite number? False Is 21457243 composite? True Is 2280401 composite? False Is 550677269 a composite number? False Is 130297529 composite? False Is 500	{ "pile_set_name": "DM Mathematics" }
*4 + 20/9 + 22/9j*3 = 0. Calculate j. -1, 1, 10 Suppose 93g + 91g = 42g. Let k(u) be the second derivative of g - 2/7u2 + 5/42u*4 - 3/7u*3 + 21u. Solve k(i) = 0 for i. -1/5, 2 Let y be 8/(-6)42/(-4). Let b(w) = -2w*4 + 26w*3 - 17w*2 + 16w. Let q(p) = p*4 - 12p*3 + 9p*2 - 8p. Let i(m) = yq(m) + 6b(m). Factor i(t). 2t(t - 2)*3 Let i(x) be the first derivative of -9 + 1/6x*2 + 1/6x*4 + 1/30x*5 + 5/18x*3 + 0x. Factor i(y). y(y + 1)2(y + 2)/6 Let p(f) be the second derivative of 1/4f4 + 0f*3 + 0f*2 + 3/100f*5 - 1 - 111f. Factor p(o). 3o2(o + 5)/5 Let x be 2/(-50) - (-7904)/2600. Let v(i) be the second derivative of -1/18i4 - 21i + 1/3i2 - 1/30i*5 + 1/9i*x + 0. Find z, given that v(z) = 0. -1, 1 Let b = 965 + -965. Let m(g) be the third derivative of 16g*2 - 1/6g*5 + 0 + bg*4 - 1/24g*6 + 0g*3 + 0g. Find j, given that m(j) = 0. -2, 0 Let 243t3 - 2444t*2 - 154t*3 - 59536 - 99t*3 - 149816t = 0. Calculate t. -122, -2/5 Let a(u) be the first derivative of u*4/2 + 80u*3/3 - 129u*2 + 1721. Solve a(w) = 0 for w. -43, 0, 3 Let m = -694 - -696. Find k such that -k + 0k + 6k - 2k - 4km + 2k - k*3 = 0. -5, 0, 1 Find k such that -3/5k*4 + 1224/5 + 1227/5k*3 - 1221/5k*2 - 1227/5k = 0. -1, 1, 408 Let y(x) be the third derivative of x7/6720 + x6/384 + x*5/80 + 25x*4/24 + 2x*2 + 1. Let j(d) be the second derivative of y(d). Factor j(z). 3(z + 1)(z + 4)/8 Let j be (-4)/(-6) + ((-9660)/(-63))/46. Let l(h) be the first derivative of -2/15h*3 + 1/10h*j + 0h - 2/5h2 - 17. Suppose l(p) = 0. What is p? -1, 0, 2 Let s = 1162 + -1160. Let j be 52/650 + (s - (-112)/(-150)). What is v in jv*2 - 64/3v + 256/3 = 0? 8 Let t = 125 - 122. Factor 2p3 + 20p - 22pt + 18p*3 + 8p*2 - 2p*2. -2p(p - 5)(p + 2) Determine p, given that -112p + 128 - 60p*3 + 1305p*2 - 40p - 1283p2 + 62p3 = 0. -16, 1, 4 Let y(p) be the third derivative of p7/735 + 8p6/105 + 29p5/70 - p4/21 - 116p3/21 + 9p*2 - 14p. Determine j, given that y(j) = 0. -29, -2, 1 Find r, given that 3/4r3 + 375/4r - 123/2 - 33r2 = 0. 1, 2, 41 Let z(g) be the third derivative of 4g*7/945 - 19g*6/90 - 2g*5/9 + 29g*4/54 + 343g*2. Let z(o) = 0. What is o? -1, 0, 1/2, 29 Let p be (1 - (-2)/4)/(11025/19600) + -2. Find c such that 12/5c + 16/15 - pc2 = 0. -2/5, 4 Solve 14/3r*4 - 22r*2 + 0 - 19/3r*3 - 1/3r*5 + 24r = 0 for r. -2, 0, 1, 3, 12 Suppose -6q - 5 = 31. Let k be ((-1)/(-3))/1(q + 54). Solve 32j - 44j*2 - 3j*3 + 0j*3 + 9j*3 + k + 6j3 = 0. -1/3, 2 Let c(l) be the second derivative of -l4/54 - 398l3/27 + 133l*2/3 - 1389l + 2. Suppose c(o) = 0. Calculate o. -399, 1 Find w such that 12/5w2 - 36/5w - 1/5w3 + 0 = 0. 0, 6 Let b be ((-4)/(-1772))/(19/(-5) - -4). Let j = b - -13255/3101. What is w in 36/7w*2 - jw + 54/7w3 - 12/7 = 0? -1, -1/3, 2/3 Let n(s) be the first derivative of 44/45s*3 + 3/5s*4 + 2/5s + 1/45s6 + 107 + 14/75s*5 + 13/15s*2. Let n(d) = 0. Calculate d. -3, -1 Let d(q) = 5q*2 - 3224q + 518416. Let b(v) = -10v2 + 6447v - 1036833. Let n(j) = -4b(j) - 7d(j). Find f such that n(f) = 0. 322 Let h(w) be the second derivative of -676/3w3 + 0 + 24w - 182/3w4 - 49/10w*5 + 0w*2. Factor h(b). -2b(7b + 26)*2 Let h = 119 - 58. Suppose 33 = -7o + h. Factor 3t2 + 5/3t*3 + 1/3t*o + 2/3 + 7/3t. (t + 1)*3(t + 2)/3 Let n(p) = p3 - p2 - p. Let c(y) = -8y3 - y2 + 11y + 32. Let o(s) = c(s) + 7n(s). Factor o(k). -(k - 2)(k + 2)(k + 8) Let w = -813 + 816. Find o, given that 4o*4 - 24o*2 - 36o - 74o3 + 38o*w + 3o*5 - 6o*5 + 2o*4 + 57o*3 = 0. -2, -1, 0, 2, 3 What is b in -1/3b*2 + 118b - 10443 = 0? 177 Let a(s) be the first derivative of -s*6/2 - 822s*5/5 - 19035s*4 - 826200s*3 - 4374000s*2 - 793. Let a(h) = 0. Calculate h. -90, -4, 0 Let x be 0/(44/28639). Factor 8/9p4 - 2/9p*5 + xp*2 + 0p + 0 - 8/9p3. -2p*3(p - 2)*2/9 Let w be 8/92 - ((-8448)/690)/11. Let n(g) be the second derivative of -11g - 3/25g5 - 2g*3 + wg*2 + 0 + 17/20g*4. Factor n(u). -3(u - 2)*2(4u - 1)/5 Let n(f) be the third derivative of f5/90 + 17f*4/6 - 4f*2 + 2f - 238. Factor n(a). 2a(a + 102)/3 Let f(u) be the third derivative of u*5/20 - 43u*4/64 + 15u*3/16 - 5805u*2. Factor f(l). 3(l - 5)(8l - 3)/8 Let w(v) be the second derivative of 4v6/9 - 23v*5/5 - 5v*4/6 + 197v*3/18 + 23v*2/2 + 58v. Determine u, given that w(u) = 0. -1/2, 1, 69/10 Let g(a) = -7a4 + 57a*3 - 307a*2 + 621a - 445. Let t(j) = -50j4 + 398j*3 - 2150j*2 + 4346j - 3114. Let f(o) = 22g(o) - 3t(o). Factor f(h). -4(h - 7)(h - 4)(h - 2)2 Factor -3/8m*4 + 0 - 18m*2 - 45/8m*3 + 24m. -3m(m - 1)(m + 8)2/8 Let d(c) be the third derivative of c6/12 - 13c*5/12 - 35c*4/24 + 924c2. Solve d(i) = 0. -1/2, 0, 7 Let c(x) be the second derivative of -x5/20 + 631x4/4 + 5x + 1152. Factor c(v). -v*2(v - 1893) Factor -5/7r3 + 0r*2 + 2/7r*4 + 0r + 0. r*3(2r - 5)/7 Factor 0 + 3/4s*3 + 15/2s + 21/4s2. 3s(s + 2)(s + 5)/4 Let v(b) be the third derivative of 11b2 - 1/140b*7 + 0b*3 + 1/80b*6 - 1/120b*5 + 0b*4 + 1/672b*8 - 3b + 0. Factor v(h). h*2(h - 1)*3/2 Let i be (-1 - (3 - (5 - 1)))/(-2). Let k(d) be the second derivative of 1/3d*3 + 3/4d*2 - 17d + i + 1/24d4. Let k(g) = 0. What is g? -3, -1 Let r = 482 - 469. Let s be r/(-3) + 712/89. Suppose -12 + 1/3g*5 - sg*4 + 47/3g*3 + 32g - 97/3g2 = 0. Calculate g. 1, 2, 3 Let f(x) be the first derivative of -x3/3 - x + 26. Let r(n) = -8n*2 - 72n - 328. Let c(w) = -4f(w) + r(w). Let c(y) = 0. What is y? -9 Suppose 3 = t + 1. Suppose 255c + 226 - 49c - 2342 - 2c*t - 22c - 2c2 = 0. Calculate c. 23 Suppose -8/3o*2 + 322/3 - 1286/3o = 0. Calculate o. -161, 1/4 Solve -13q + 113q - 40 + 70071q2 - 70073q*2 + 142 = 0 for q. -1, 51 Let f(m) be the first derivative of 5166529m*3/6 + 2273m*2/2 + m/2 - 416. Factor f(l). (2273l + 1)*2/2 Let u(c) = 21c*2 + 178c - 460. Let z(n) = 19n2 + 179n - 452. Let a(s) = 9u(s) - 10z(s). Factor a(y). -(y - 2)(y + 190) Let z(h) = -5h*2 - 51h - 150. Let w(d) = -2d + 5. Let s(j) = -2w(j) - z(j). Suppose s(o) = 0. What is o? -7, -4 Determine y so that -664y - 3y*3 + 334y - y*3 + 28y*2 + 306y = 0. 0, 1, 6 Let s(k) be the first derivative of -5k3/3 + 2290k*2 - 1048820k + 3073. Factor s(p). -5(p - 458)2 Let t(c) be the second derivative of -c5/5 + 170c*4/3 + 2c*3/3 - 340c*2 - 1038c. Suppose t(m) = 0. Calculate m. -1, 1, 170 Let k(w) be the first derivative of -3w6/11 + 84w*5/55 - 35w*4/11 + 104w*3/33 - 17w*2/11 + 4w/11 + 1015. Find f such that k(f) = 0. 1/3, 1, 2 Let i(f) be the first derivative of 3f4/4 + 169f*3 + 10836f*2 + 21168f - 1452. Factor i(b). 3(b + 1)(b + 84)*2 Let j = -79 + 82. Solve 243t*3 - 20t*2 + 247t*3 - 495t*j = 0. -4, 0 Find z, given that 32z*2 + 55 - 86 - 17 + 4z*3 - 66z + 22z - 24 = 0. -9, -1, 2 Let t(r) = -r2 - 12r + 82. Let l(p) = p*2 + 21p - 82. Let j(u) = 3l(u) + 2t(u). Factor j(y). (y - 2)(y + 41) Let u(j) be the third derivative of -3/40j*6 - 1/5j*5 + 0j*3 + 5/6j*4 + 0j - 22j2 + 1/210j*7 - 3. Solve u(o) = 0 for o. -2, 0, 1, 10 Let c(r) be the first derivative of 11r*4/18 + 262r*3/27 + 128r*2/3 - 8r + 607. Factor c(i). 2(i + 6)2(11i - 1)/9 Suppose 614h - 375 = 853. Determine u so that -1/2uh - 3/2 + 1/2u*3 - 5/2u = 0. -1, 3 Let i(d) be the first derivative of -d*4/6 - 26d*3/9 + 56d2 + 5907. Suppose i(b) = 0. Calculate b. -21, 0, 8 Let g(y) be the second derivative of y6/70 + 3y5/14 - 183y*4/28 + 166y*3/7 - 240y*2/7 - 13y - 20. Find u such that g(u) = 0. -20, 1, 8 Let w(k) be the third derivative of -k*6/900 - 32k*5/225 + 143k*4/36 - 370k*3/9 + 1419k*2. Factor w(o). -2(o - 5)*2(o + 74)/15 Let t(j) = 2j4 + 10j*3 - 6j - 6. Let f be (1/(-2))/((-6)/(-60)). Let k(a) = -a*4 - 11a*3 + 5a + 5. Let o(q) = ft(q) - 6k(q). Factor o(d). -4d3(d - 4) Let f = -251 + 317. Factor 64t*3	{ "pile_set_name": "DM Mathematics" }
b + 95 for z. 16 Solve a + 4t + 126 = 0, 12a = 6019637t - 6019633t + 100 for a. -2 Solve 0 = -5i + 158l + 346, 6i + 1 - 6 + 3 = 9i + 2l - 16 for i. 6 Solve 3u - c = 7, -6c + c + 572 - 1133 = -571 for u. 3 Solve 6026k - 6028k + v + 36 = 0, 0 = -k - 2k + 2v + 3v + 187 for k. -1 Solve 5j = 939120y - 939116y - 23, 2j + 29 = -5y for y. -3 Solve 315172a + 365 = 315174a + 5p, 0 = 5a - 6p + 475 for a. -5 Solve 55h + 23s = -55h + 114h - 256, 173 = -h - 14s for h. -5 Solve -k + 4g - 8568 = -8556, 5g - 26 = 4k for k. -4 Solve 5b = -170j + 172j + 79, 3j - 6b + b + 76 = 0 for j. 3 Solve 4h + 5u - 65 = -h, 156h - 157h + 17u + 31 = 0 for h. 14 Solve 4p = m - 26, 5p + 43 = -16m - 16 + 61 for m. 2 Solve 5 = -5m - 6a, m = 4a + 18 - 14 - 5 for m. -1 Solve r + 0r = -15v - 2r + 3, 12v + 13r = r + 14r + 20 for v. 1 Solve 3n = -4v - 33, -5v - 25479 + 25439 = 4n for n. 5 Solve -1711m = -5s - 1713m - 10, 0 = -5s + 5m + 25 for s. 0 Solve 2t - 65 = -1212f + 1214f + 7t, 309 = -12f - 3t for f. -25 Solve 4y = -m - 77, 3y + 255 - 119 = -3m + 76 for y. -19 Solve 0 = 2o + 4z - 66, -4z - 13952 = 7o - 13993 for o. -5 Solve 3j + q = 12, 165j - 167j - 123 = -43q for j. 3 Solve 2m + m - 6a + 4822 - 4834 = m, -2a - 1 = -m + 5 for m. 6 Solve 0 = 2l - 2l + m - 2 - 8, 2696 = -6l + m + 2680 for l. -1 Solve -78 - 69 = 3l + 4y - 78, -2l + 19y - 46 = 0 for l. -23 Solve 0 = 5i + 4w - 19 - 7 - 38, -10i + 118 = -2w for i. 12 Solve 2p + 7 = -o, -62o = 13p - 67o + 57 for p. -4 Solve 0 = 2y + 3l - 167, -4l - 319 = 4y - 535 for y. -5 Solve -19b + 16b = -5u + 78, -4u + 32b - 29b = -60 for u. 18 Solve -5r + 3z = 100, 5r + 24 + 68 = 6z - 83 for r. -5 Solve -131x - 5o + 44 = -128x, 4x + 0o - 11o + 118 = 0 for x. -2 Solve 5n = 1231u - 1233u - 34, 0 = 2n - 0n + 12 for u. -2 Solve -2j - 36 = 5b, 12j = -183b + 179b - 216 for b. 0 Solve -4c + 7 = 5a + 2, -5 = -5c - 0c - 6a for c. -5 Solve -3y - 37 + 7 + 15 - 35 = 5l, 2l - 55y - 823 = 0 for l. -1 Solve 2z - 31689 + 31675 = 0, -4t + 26z - 162 = 0 for t. 5 Solve -73355a = -3k - 73352a - 30, -2a = -40k - 400 for k. -10 Solve -s = -4s + 5x + 75, x - x + 3 = -x for s. 20 Solve 0 = 3a - 2x + 5, 77 = -53a + 4x - 101 - 76 + 9 for a. -5 Solve -3r + 6456 - 6463 = -4n, -6n = r + 17 for r. -5 Solve -w + 13i - 133 = 0, 155 = 2w + 3i + 131 for w. -3 Solve -3f = -2l - l - 14 - 11 - 2, 0 = 139f - 4l + 504 for f. -4 Solve -6v - 2y = 3y - 2y + 171, 41v - 38v = -7y - 102 for v. -27 Solve -v - 5h - 155 = -0v, -h = 975v - 1000v + 157 for v. 5 Solve 0 = 917f - 914f - 2d + 11, -8d + 51 = -13f for f. -7 Solve 400u = 790u - 399u + 3p + 90, 2p - 39 = -3u for u. 11 Solve -82151k - 6 = -82155k - 3t, 4k - t = 14 for k. 3 Solve 109j + 11j - 1188 = 36j - 3v, 0 = 3j - v - 38 for j. 14 Solve 27y - 69 = -5p, 5p + y + 17 = 10 + 24 for p. 3 Solve -2m + 3m + 4o = 30, 7m - 317o + 4487 - 1640 = 8m for m. -6 Solve -v + 3624 = -5n + 3572, -47n - 517 = 0 for v. -3 Solve -4m + 0n = -4n + 8, -m + 6n = -2m - 16 for m. -4 Solve v + 230 = -246b + 243b, v - 4b = -9b - 382 for v. -2 Solve -5876y + 5875y = g + 13, -4g + 143 = -9y for y. -15 Solve 2k - 14s + 42 = 0, 2s + 15 = 6k - 9s + 16s for k. 0 Solve 100r - 5w = 97r - 20, -4w = 3r - 61 + 18 for r. 5 Solve 38a - 39a - 5t + 3t - 2 = 0, 3t + 24 = -5a for a. -6 Solve 0 = -2l + 6n - 14, 2l + 47n + 63 = -l + 42n for l. -16 Solve -6 = -h - 12x + 33x - 20x, -2h + 28x = -64 for h. 4 Solve 3339r + 3x = 3334r - 115, -55 = 2r + 3x for r. -20 Solve 10t - 32t + 148 = -4j + 18t, -3j = t - 13 for j. 3 Solve -3n = -5o + 77, -5n + 74 = 6o + 145 for o. 4 Solve -4f = 4j + 176, -12103828j + 12103827j - 29 = -2f for j. -39 Solve -8w + 5w - 12m + 32 = -4m, -55w + 5m = -890 for w. 16 Solve 10u - 15z = -18z + 4z - 7, 0 = -3z - 13 + 4 for u. -1 Solve 2f = 5j + 17, 0 = -2j + 2f + 199 - 213 for j. -1 Solve -38c + 35c = -9, 11 + 37 = 9w - 2c - 9 for w. 7 Solve 5m - 4f = -20, -1295m + 3f = -1290m + f for m. 4 Solve 3b + 2m = 52, -176b + 32 = -181b + 2m - 36 for b. -2 Solve d - 241 = 7g, 2258g = -2d + 2254g - 130 for d. 3 Solve -32q = -36q + 9p + 18, -3p - 6 = q for q. 0 Solve 27l + 0r + 1089 = -22l + 6l + 5r + 763, -4l = 4r + 8 for l. -7 Solve -5v = -5r - 320, -8v = -551r + 555r - 524 for r. 1 Solve 41o + 52o - 90o + 2w = -13, -14w + 4 = 2o for o. -5 Solve -44421u = -44424u - 5 - 4, 63 = 5l - u for l. 12 Solve 250g = j + 252g + 57 - 32, 5j - 2g = -8g - 105 for j. -15 Solve -s - 15 = 5h, -24s - 24s = -7h - 52s - 34 for h. -2 Solve 0 = 2a + 4, -3a - 470351 = 3z - 470375 for z. 10 Solve 12h - 5h + 10a + 185 = 9a, -2a = 3h + 84 for h. -26 Solve 4y + 62k = 4y + 57k + 10 - 5, 23 - 1 = -y + 2k for y. -20 Solve 31f - 18 = -142, 10a - 60 = 4a + 4a + 4f for a. 22 Solve 2f + 0p - 10 = -4p, -2f - 9p + 3 = -22 for f. -1 Solve -3r = -7v - 34, 10r = 2v + 15r - 9 + 7 for v. -4 Solve 6b - 3371l = -3369l - 20, -4l - 2 = 2b for b. -3 Solve -9i - 4l + 55 = -4i, -110i + 17 = -105i + 5l - 43 for i. 7 Solve 24899p + 2t - 5 - 9 = 24900p, 2p = -11t + 77 for p. 0 Solve -21h - 153 = -3a, 3809h - 3811h = 3a - 107 for h. -2 Solve -10 = 2a - k, -4k + 187 + 441 - 6041 = 771a for a. -7 Solve 0 = -5l + 5d + 60, 9l + 5l - 9l = 8l - 4d - 42 for l. 6 Solve a + 0r + 16 = -2a + r, 286 = -19a - 88a - 5r for a. -3 Solve -3r = 5w + 29, -250138w + 250135w - 24 = 4r for w. -4 Solve -4j - 5b = -160, 1653 + 1573 = -3j + 4b + 3315 for j. 35 Solve 0 = 325l - 322l + 5x + 4 + 39, 0 = l - 14x - 158 for l. 4 Solve -5u + 17v = -277, 3u - 67 = -141v + 145v for u. 1 Solve -209b - 24 = -q - 211b, -46 = -3q - 4b for q. -2 Solve -21485d + 83 = -21480d - 4y + 32, -4y = 9d + 9 for d. 3 Solve -2w - 5 = 3o, o - 22445w + 170 = -22412w for o. -5 Solve -9f + 73 = -2j, 1305j - 1302j - 3f = -15 for j. 4 Solve -f + 32 = -5t, -9t + 8813 = 5f + 8823 for f. 7 Solve -22 = 4t - 3b, -6 = t + 62b + 24b - 87b for t. -4 Solve 96w - 690 + 1058 = 2k, 5k - 203 = w for w. -3 Solve 441 = 47f - 3y - 48 + 2498, 188 = -4f - 4y for f. -43 Solve a + 589j = 588j + 29, 5j - 153 = 3a for a. -1 Solve 36v + 24 = b, 4 = 3v - 3v - 3b - 4 - 28 for v. -1 Solve -4s + 4 = -g, 5s - 8220 = -44g - 8034 for g. 4 Solve j + 156 = -5s, j = 6963s - 6970s - 218 for s. -31 Solve 50845c + 0f + 302 = 50840c + 2f + f, 4c - 18f = -304 for c. -58 Solve 5i - 5c + 185 = 0, 84i - 1281c + 1278c + 516 = 0 for i. -5 Solve 5h = 3x + 45, 9030x - 9024x = 5h - 60 for h. 6 Solve -5c + 186 = -7v, 227429v - 227432v - 88 = 2c for v. -28 Solve 4c + 50 = 130240m - 130242m, 2m + 50 = -2c for m. -25 Solve 11y + 6k = -8, 5y - 3k - 1262 = -1237 for y. 2 Solve -y - 40 = 560f - 561f, -y + 4 = 10f for f. 4 Solve 2136w - 2117w - 25 = -5x, 4x + w = 20 for x. 5 Solve -o + 134 = -x + 124, 0 = 2o + 170x + 2216 for o. -3 Solve -3j - 22571 = -a - 22576, 0 = -3a - 3j + 1 + 8 for a. 1 Solve 2b + 3t = -12, -103b + 49 = -113b - 5t - 31 for b. -9 Solve -4w + 4w + 60 = -12s, 3w - 13s - 8s + 31s = 7s - 24 for w. -3 Solve -2b + 39645 = -d + 39628, -5d = -6b + 89 for b. -1 Solve 13i + 5t - 27 = 0, -11 = -2i - 5t - 28 for i. 4 Solve -3j = 4u + 77 - 22, -4j - 460u + 461u = 10 for j. -5 Solve -3n = -587k + 584k - 4n, 24k = 20k - n for k. 0 Solve 5u = 5t + 60 + 95 - 135, 4 = -5u + t for u. -2 Solve -4l - 3h - 73 - 162 = -312, 10l - 212 = 12h for l. 20 Solve 3p - 2f = -49, -137102 = -p + f - 137120 for p. -13 Solve -108f + 103f = -5n - 95, 10f = n + 10 for f. -1 Solve 0 = 22x - 4k + 126, 3x + 3k + 18644 - 18641 = 0 for x. -5 Solve -5b + 610d - 611d + 34 = 0, 3d = 8b - 13 for b. 5 Solve 4u = -4942c + 4941c + 16, -2c - u + 53 = 0 for c. 28 Solve x - 14d = 54, 15x + 4x + 3d = 17x - 47 for x. -16 Solve -26295s = -5i - 26294s + 5, -i + s - 7 = 0 for i. 3 Solve 2n + 379513i + 16 = 379509i, -3n - 2 = -5i for n. -4 Solve -3k - 2k - 5s - 9 = -4, k - 2378781*s - 11 = -237	{ "pile_set_name": "DM Mathematics" }
))(-29/4) assuming o is positive. o(23693/80) Simplify ((nn(n*(-4/7)/nn)/nnn)33)(-44)/((nnn*2n)*30(nn/n(-2/15))/nn*3n) assuming n is positive. n(-386549/105) Simplify ((s(-1))29)(7/6)/((s*6s/s(-2))/(s/(s(-1/4)/s)s(ss1/ss)/s)) assuming s is positive. s(-463/12) Simplify ((n(2/9)/n*(-3/2)n*(1/3)/(nn/n(3/7)))(-6/5))(-17) assuming n is positive. n(1037/105) Simplify ((((y*0y)/(y(-3/2)/y))(-17/4))(4/7))(1/8) assuming y is positive. y(-17/16) Simplify (((m/m(-15))/(m*21/m))/(m/(mm(mm*(-24)m)/m))(-20))47 assuming m is positive. m20492 Simplify ((y/y15)/((yyy/(y((y(-1/9)y)/y)/y))/y)y(-10)/y(-3/2))(15/7) assuming y is positive. y(-2215/42) Simplify ((j(1/4))(9/4))14/((j(1/3)/j)(1/14)j*(-1/5)(j/j(-1/4))/j) assuming j is positive. j(6613/840) Simplify ((((k/k*(-4/7))/((k(k/k*(2/11))/k)/kk))/((kkkk(-5)/k)/(kk*(-2/9)k)))(-43))(-2/25) assuming k is positive. k(329638/17325) Simplify (((d12/((dd11)/d))/(d/((d/(dd*(-4/3)))/d)(d7/d)/d))(-17))(15/11) assuming d is positive. d(1190/11) Simplify (k*20/(k/(k/(k/(k/(k/(k/(kk*(-1/17)k)))))))k18kk/k(-20))6 assuming k is positive. k(5922/17) Simplify w/w(4/5)www*(1/5)w1/w(-1/8)ww*(2/9)w*0/www6ww(-1/2)/w assuming w is positive. w(3689/360) Simplify (z/(z/(z/(zz2))))(-1/29)(z/(zz*(-1))z)/(z/(z/(z*(1/9)z)))(z(-2))15((zz(-5))/zzz)/((zz/(z*3/z)z)/z) assuming z is positive. z*(-8363/261) Simplify (ff(-2/5)/f)49/(f*6/ff*(4/5))(f/f4)/(f(2/9)f)(f*(-1)f)(-2) assuming f is positive. f(-1333/45) Simplify (p0)(11/6)(p(-1/4))(-2/33)(p/(p/p*(3/5)p))/p*4((p*(1/4)/pp)/p)/pp(-2/11) assuming p is positive. p(-379/60) Simplify ((mm*(-1/7))/(mm*(1/4)mm)(((mm6)/m)/m)/(((m/m3)/m)/m))/((mm*(-5/6))/m(m/m(-1/3))/m)(1/27) assuming m is positive. m(5009/756) Simplify (((h(3/16)(((h2h)/hhh)/h)/h)(-4/9))(-2/11))(2/35) assuming h is positive. h(1/99) Simplify ((s*1/s)/(ss*1s))/(s/s*(-5)ss(-2/9))(s(2/7))(-44)(ss/(ss7))/((s/(ss(-1/3)/s))/s) assuming s is positive. s(-1807/63) Simplify ((rr/r(-5/4))(-2/45)(r/(rr/r8))/(r(-4/7)/rr))(-26/3) assuming r is positive. r(-60827/945) Simplify ((k/(kk/(k0k)k))(-41))(-10/9)(k1)(-24)k6k(-6) assuming k is positive. k(-626/9) Simplify ((y*(-3/2)/(y/(yy*(1/3)))y*(1/9)y(-7))(-6/11))(1/33) assuming y is positive. y(145/1089) Simplify (d*(1/4)dd(2/7))(-15/11)/(d(-1/6)d/d*(2/11)d*6d/d0) assuming d is positive. d(-9005/924) Simplify (d(-8)/d(-1/5))/((d/(dd(-37)/d))/d)24 assuming d is positive. d(-4479/5) Simplify ((w/((w(4/11)/ww)/w)ww)/w(-2/55))33((w/(w/w(1/7)))/((www(-3)w)/w))/(ww0w*(-2)w) assuming w is positive. w(4282/35) Simplify ((k(-1/9)k)/(k/k4))(-17)(((k/(k/(k(k/(k(-1)/k)k)/kk)))/k)(-12/11))(-26) assuming k is positive. k(4687/99) Simplify (((b/b(-1/2))/(bbb/b(-8)))/(b8bb/b4bb))/((b/(b/b14))/(b(-2/23)/b))13 assuming b is positive. b(-9827/46) Simplify ((((k(-1/3)k)/k)/k)(-1/24))(-48)k(1/3)k/(k*(-6)k)k(k1)(-5) assuming k is positive. k*(-1/3) Simplify ((pp1)/p)50(p(-2/7))(2/31)(p*1p)*42p*(-1/2)pp(pppp3/p)/pp assuming p is positive. p*(60969/434) Simplify (((bb/(bb/((b/((bb*3)/bb))/b)b)b/(b/(b*(-2)b))b)/((b/b(1/14))/bb/(bb(-13))))(25/4))(13/2) assuming b is positive. b(-81575/112) Simplify hh/h*(-1/7)hh/(h(-1/10)h)(h(-1)h)*(-16/5)(h(-1/2))(2/33)/((h/((h/(h/(hh(2/5)))hhh)/h))/(hh(-4/3))) assuming h is positive. h(813/154) Simplify ((i16i)/i*(1/11)(i/(i/i(8/5)))(-10))(-34) assuming i is positive. i(-340/11) Simplify a(-5)/(a(-6)/aa)(a(-3/8)/a)/(a4/a)((a/(a(aa(-1)/a)/aaaa))47)(2/45) assuming a is positive. a(-1967/360) Simplify (s(-29)ss*(-9/7)((s*(6/5)/ss)/s)(-1/8))(2/11) assuming s is positive. s(-8207/1540) Simplify ((u(-3)u(1/7)/u)/(u2/(uuu(2/9)uu)))/(u(-1)u/(uuu(-1)))(-12) assuming u is positive. u(-859/63) Simplify (((a(1/28)/(a/a*(-43)aa))(-1))(-1/5))(-1/40) assuming a is positive. a(1287/5600) Simplify (a2/a(1/16)a(-2/7)/a(-6))/((a(-2/9))(-5)/(a*(-2/19)(aa8)/a)) assuming a is positive. a(276467/19152) Simplify (s(-13/2)s10)29(s(-6)s*(-2/15)s)/(s*(-2/7)ss)(-1) assuming s is positive. s(20597/210) Simplify (((yy/y*1y)/y(y/(y(-3/4)y)y)/y)/((y1y)/((yy/((y/y(-7))/y))/y)))/((y(3/7)yy)(5/6))(1/24) assuming y is positive. y(-6385/1008) Simplify ((g(2/21))(-34)/(gg(7/5))(-1/11))(-3/14) assuming g is positive. g(1744/2695) Simplify ((v(-12))(-1/49)v/v(-8)v/(v*(5/4)v)v)(-37) assuming v is positive. v(-65231/196) Simplify ((n/((n(-6)nn)/n))(-5/14)/(((n(20/9)/n)/nn)/n(-21)))(-5) assuming n is positive. n(7675/63) Simplify ((b(1/3)b)(-49)/(bbbb*(-5/2)b6))/((b(2/13)/b)/bb/b(-2)b3/b(-4/7)) assuming b is positive. b(-41801/546) Simplify (w/w(-2/7)ww(w/w6)/ww(w/w2)(9/4))/(w(-1)ww/(w/(w1w))(w(ww(-1/4))/w)/((ww*(-2/9)w)/ww)) assuming w is positive. w(-311/63) Simplify (r(9/4)r/(rr/r(-1/10)))2r*(-1)/rrrrrr*(2/3)rr(r/(r(3/4)/r))/r(-2/27) assuming r is positive. r(4477/540) Simplify ((n/(n(-7)/nn)nn(-20)n)/((n/n*0n)/n(-1/3)))(2/27) assuming n is positive. n(-74/81) Simplify ((m(1/6))(-2/53)/(m3/mmm(-2/47)))(-23) assuming m is positive. m*(509404/7473) Simplify ((r/((rr(r/(r/r(-11))r)/r)/rr))/r13r/r*(-12)(((r/((r/((r*3r)/r))/r))/r)/r)/r)(-2) assuming r is positive. r(-22) Simplify ((xx/(xx(2/3)))(1/45)x/x(3/4)xx(2/7)xx)/((xx/x1)(-25)((x/x(-2/9))/x)/(xx/x5)) assuming x is positive. x(95713/3780) Simplify ((ww(-2/21)/ww)(-7/2)/(w(14/9)((ww*(1/6)w)/w)/w))(9/5) assuming w is positive. w(-44/5) Simplify (((c(-1/5)/c(-4))(-22))(2/51))(5/4) assuming c is positive. c(-209/51) Simplify ((((xx(-14))/x)/x(1/6))/(x3/x)(-27))(4/25) assuming x is positive. x(478/75) Simplify (((t(-3/4)/(tt*(-1/4)t))/((ttt*(-2/13)/ttt)/tt/(tt(10/9))))(-9))(-5/8) assuming t is positive. t(-3785/208) Simplify (k/k0k(2/9)/k)(2/17)/(((k*0k)/kk)(-1/56))(-24) assuming k is positive. k(-431/1071) Simplify (b(-9)/b(-20)b*(-3/13)b(12/7))(-35) assuming b is positive. b*(-5680/13) Simplify ((c/(c/(cccc(-1/3))))18/(c*(-2/5)c/(c/(c*6/c)c)))/(cc3cccc0cc)(13/7) assuming c is positive. c(969/35) Simplify ((aa*(-11/7)/aa)/a)*(-10/19)/(aaaaa(7/3))(11/8) assuming a is positive. a(-25157/3192) Simplify ((j(-1/2))(-1/34))(-38)/(((jj*(2/29)j)/jj3)/((j3/jj)/(j/(j/j*(-7)j)j))) assuming j is positive. j(5297/986) Simplify ((oo*(1/2)o)15/(o7o/(o(-4/7)o)))/((o*(-3)/(oo/(o*(-6)/ooo)))/((o/(o(3/4)o))/o((ooo(-1/3)oo)/o)/o)) assuming o is positive. o(3347/84) Simplify ((z(-2/9))13z/(z*(-1)z)zz(4/3))37 assuming z is positive. z(148/9) Simplify (((d1)*10(dd1dd)10)(1/42))(3/35) assuming d is positive. d(5/49) Simplify (((nn/(n*(-1)n))/n)*(-1/12)n*(2/5)n/(n/n*(-1/2))nn)/(n(-5)n(4/3))50 assuming n is positive. n*(3703/20) Simplify ((uu(8/5))(-5)(u(-8)u)(3/13))1 assuming u is positive. u(-190/13) Simplify ((r(-6)/r)/r2)(5/11)/((rr/(r/((r/(r/((r/(rr/r*6))/rrrr)))/r))rr)/r(1/4))(-3/8) assuming r is positive. r(-285/352) Simplify (y(2/7))*(1/34)((y/(y/y(-1/4)))/y)43y2y*(-1/5)y(yy*(1/2)/y)/yyy(-1/7) assuming y is positive. y(-120391/2380) Simplify ((o(-1))(28/9)/(((o5o)/ooooo)/(oo(-4)o)))/((o*(2/7)o)*48o/o*(-1)oo0) assuming o is positive. o(-4966/63) Simplify (a(-2/19)a*6)/(aa/(a/a(1/2)))7((aaaaa(-1))(15/4))(48/5) assuming a is positive. a(3929/38) Simplify (((ccccc(c	{ "pile_set_name": "DM Mathematics" }
47 Calculate the highest common factor of 37661 and 224640. 13 What is the greatest common factor of 4620400 and 2100? 100 Calculate the greatest common divisor of 3110 and 9219595. 1555 What is the highest common divisor of 1572708 and 24? 12 What is the highest common divisor of 86 and 197198? 86 Calculate the greatest common factor of 2 and 262521. 1 What is the greatest common factor of 17199 and 42490791? 1323 Calculate the greatest common factor of 7252317 and 62352. 3897 Calculate the greatest common factor of 32 and 7723220. 4 Calculate the greatest common divisor of 10703 and 200299. 1529 What is the greatest common factor of 32 and 428111264? 32 Calculate the greatest common factor of 18070609 and 17. 17 What is the highest common divisor of 22988 and 37786? 14 Calculate the highest common divisor of 8729189 and 665. 133 Calculate the highest common factor of 2317 and 2877383. 331 What is the greatest common factor of 241002 and 31887? 27 What is the greatest common factor of 7938 and 30366819? 3969 What is the highest common divisor of 46 and 527503712? 46 Calculate the greatest common divisor of 194170080 and 74592. 3552 What is the highest common divisor of 37090368 and 1488? 48 What is the greatest common factor of 231741 and 6? 3 Calculate the highest common divisor of 51 and 2358367041. 51 What is the greatest common factor of 776632 and 6539? 503 What is the greatest common divisor of 1672 and 5866234? 22 What is the greatest common divisor of 13713282 and 882? 18 What is the highest common divisor of 709091 and 3725? 149 Calculate the highest common factor of 31154 and 2432959. 421 What is the greatest common divisor of 65 and 23799560? 5 Calculate the highest common factor of 247904 and 26352. 976 What is the greatest common factor of 264 and 74854912? 88 Calculate the greatest common divisor of 132102 and 3053382. 1074 What is the highest common divisor of 21142925 and 25? 25 Calculate the greatest common factor of 5567191 and 95018. 4319 What is the highest common divisor of 5369 and 1285492? 767 Calculate the greatest common divisor of 599620 and 65380. 140 What is the highest common divisor of 4721982 and 16430? 3286 Calculate the highest common factor of 34840071 and 682425. 9099 What is the highest common divisor of 7464768 and 51? 51 Calculate the greatest common divisor of 173375104 and 716. 716 Calculate the highest common divisor of 2450 and 109871181. 49 What is the greatest common factor of 3732000 and 390? 30 What is the greatest common divisor of 9149 and 4166716? 1307 Calculate the greatest common divisor of 896 and 660604. 28 What is the greatest common divisor of 2110 and 412663250? 2110 Calculate the greatest common divisor of 135 and 5003925. 15 Calculate the greatest common factor of 644 and 30096640. 28 Calculate the highest common factor of 9982512 and 9050. 362 Calculate the greatest common divisor of 662454 and 1624994. 5662 What is the highest common divisor of 15574 and 1384500? 26 What is the highest common factor of 37697 and 24035? 253 Calculate the highest common divisor of 299293 and 2997. 37 What is the highest common factor of 212079330 and 10? 10 Calculate the highest common divisor of 46420 and 112640. 220 Calculate the highest common factor of 369142733 and 916. 229 Calculate the highest common factor of 19803 and 24537639. 861 What is the greatest common factor of 183 and 367042856? 61 What is the highest common divisor of 1988657 and 4233053? 3817 What is the highest common divisor of 1812288 and 78? 6 Calculate the greatest common factor of 1808513 and 6251. 329 Calculate the greatest common factor of 3390 and 69760. 10 Calculate the highest common divisor of 2144 and 116013984. 2144 What is the highest common divisor of 17328 and 12014802? 2166 Calculate the highest common factor of 2559612 and 121. 11 What is the highest common divisor of 637 and 234712933? 91 Calculate the greatest common factor of 1490000 and 875. 125 Calculate the highest common factor of 382 and 629695294. 382 What is the highest common divisor of 5876 and 79922414? 2938 What is the highest common divisor of 648369 and 376739? 1181 What is the greatest common factor of 303195 and 15045? 255 Calculate the greatest common divisor of 650 and 9241180. 130 Calculate the highest common divisor of 1816690 and 1600. 10 What is the highest common factor of 3636026395 and 755? 755 What is the highest common divisor of 7497252 and 24? 12 What is the greatest common divisor of 774789 and 9148800? 2859 What is the greatest common divisor of 9559 and 1264? 79 What is the highest common factor of 333794279 and 23569? 3367 What is the greatest common divisor of 195052 and 1584? 44 What is the greatest common divisor of 1074 and 507859874? 358 What is the greatest common factor of 916 and 10105770? 458 Calculate the greatest common factor of 333 and 1717680267. 333 Calculate the highest common factor of 105 and 14686630. 35 What is the greatest common factor of 5401565 and 520? 65 What is the highest common divisor of 1198691 and 5083? 299 What is the highest common divisor of 46384 and 1523759? 223 Calculate the greatest common factor of 1631 and 833494823. 1631 Calculate the highest common factor of 2703 and 52156. 17 What is the highest common factor of 2014 and 108202150? 2014 Calculate the greatest common divisor of 12848324 and 74. 74 What is the highest common divisor of 32802720 and 1440? 480 Calculate the highest common factor of 6786 and 8171562. 174 What is the greatest common divisor of 384 and 223481472? 384 What is the greatest common factor of 218063 and 29279? 437 What is the highest common divisor of 6885 and 1829655? 135 What is the highest common divisor of 1197 and 103755447? 171 What is the highest common factor of 83 and 27341943? 83 Calculate the highest common factor of 98 and 50475782. 98 What is the greatest common divisor of 36148 and 30628975? 1291 What is the greatest common factor of 38657610 and 270? 90 Calculate the highest common divisor of 15 and 33554805. 15 What is the greatest common factor of 61125624 and 5292? 756 What is the greatest common divisor of 6887056 and 8393? 1199 What is the highest common divisor of 1387 and 1644868? 19 Calculate the greatest common factor of 910534100 and 334. 334 What is the greatest common divisor of 936 and 11543922? 234 Calculate the greatest common divisor of 5 and 8042173. 1 Calculate the highest common divisor of 253 and 141140581. 23 Calculate the greatest common factor of 130 and 8990774. 26 Calculate the highest common divisor of 725348029 and 2842. 1421 Calculate the greatest common divisor of 55279149 and 4023. 447 Calculate the greatest common divisor of 10 and 59133925. 5 Calculate the highest common factor of 2215 and 779520520. 2215 Calculate the highest common divisor of 19856194 and 4978. 262 Calculate the greatest common factor of 512608 and 4288. 32 Calculate the highest common factor of 506 and 4339226. 46 What is the greatest common divisor of 112606 and 49166? 1586 Calculate the greatest common divisor of 896148 and 678156. 372 What is the greatest common divisor of 50 and 10071170? 10 Calculate the highest common divisor of 180912 and 192. 48 Calculate the greatest common divisor of 39947 and 3508833. 929 Calculate the highest common factor of 84 and 96320112. 84 What is the greatest common divisor of 1353 and 1989999? 33 What is the greatest common divisor of 170730 and 192150? 630 What is the greatest common divisor of 2911 and 5440249? 41 Calculate the greatest common divisor of 1561 and 2990981. 7 What is the greatest common factor of 588 and 19538988? 84 What is the greatest common divisor of 1740362 and 36062? 494 Calculate the highest common factor of 35392516 and 68134. 6194 Calculate the highest common divisor of 513 and 204801. 57 What is the highest common divisor of 34334021 and 401? 401 What is the highest common divisor of 159602850 and 21450? 1650 What is the highest common divisor of 2676992 and 256? 256 What is the greatest common divisor of 75638123 and 99? 11 Calculate the highest common divisor of 13397632 and 45064. 1048 What is the greatest common divisor of 105927 and 204819? 201 Calculate the highest common f	{ "pile_set_name": "DM Mathematics" }
/13 What is the value of (((-330)/(-135))/(-11))/(6/(-18))9/(-411)? -2/137 Evaluate (84/24)/((-4520)/(-20340)). 6 What is 212/6(-21)/(-21)-9(-2)/6? 106 ((-278)/(-2641))/(30/9405) 33 Calculate -129(8476/78)/163. -86 Calculate (30/28)/((-35)/6615-81). 5/2 What is the value of ((14840/196)/5)/((-4)/14)? -53 Evaluate (69/3726(-3)/(-2))/((-43)/(-28251)). 73/4 312/1248(-24)/(-22)11 3/11 What is the value of (4/48)/((-385)/16)(-55)/(-22)? -2/231 Calculate ((-342)/(-108))/((-109)/327). -19/2 What is 147906/(-19422)7/(-231)? 3/13 ((19737/57018)/(3/2))/(14/(-2)) -3/91 What is (0/((-5)/(-10)-2))/((-28)/(-28))? 0 What is the value of (24/(-32))/((-4)/(-208))? -39 Calculate 8/(-560)25(-168)/(-16). -15/4 265/1696-5610/(-75) 7/6 ((-20)/(-14)-1)/((-50010)/(-46676)(-2)/72) 48 ((-2)/(-14))/(11(-34)/(-12614)) 53 What is the value of ((64/504)/(18/28))/(111/(28971/174))? 8/27 (528/(-1100))/(((-6)/15-1)/1) -6/5 Evaluate 4/(-34)675/(-5130)152/(-8). -5/17 What is (6/119/(-3))/((-25940)/12970)? 19 What is (-5088/19800)/(1/(-12))? 8/3 What is (22/(-1))/((5/(-15))/(8(-63)/336))? -99 Evaluate 45/(135/(-42))(-1014)/(-273). -52 What is ((-4)/(-5))/(12992/20300)(-14)/(-15)? 7/6 Evaluate (6/(-16))/(11637/(-182744))9. 53 Calculate (((-4268)/(-88))/(-97))/(1/34). -17 What is the value of (6/(-6))/(-799/1134)? 18/11 3156750/(-4575)((-34)/119)/((-12)/(-7)) 115 Evaluate 9(-2)/1(-50784)/38088. 24 9/(-189)7-1-132 -44 Calculate ((76/(-4))/19)/(-13(-10)/(-2)). 1/65 Calculate ((-2014)/(-380))/53(-4)/(-18)5/1. 1/9 Calculate (63-2140/7560)/(-175). 1/25 Evaluate 21/9(-92)/(-1127)-63. -12 ((-22)/(-5))/((-8)/(-3)(390/(-30))/260) -33 What is the value of (4/((-220)/11))/(13/18850-10)? 29 ((28616/245)/(-146))/(4/(-9)) 9/5 What is (14/(-108))/(532/(-228))? 1/18 What is 770/(-110)-41/44-1? -7/11 What is the value of 16/((976/(-50))/(-61))? 50 What is (-6)/41016/(-12)? 20 (430/(-1118))/(15/3) -1/13 Evaluate 6/27-3-35463/(-288). -59/4 Calculate ((3815/(-4))/(-7))/(((-51360)/107)/(-96)). 109/4 Calculate 2/(16/4)10(828/(-4))/(-69). 15 Evaluate (((-256)/(-192))/((-11)/55))/((-8)/(-108)). -90 Evaluate 32/98416412/184. 8/23 Evaluate 144/(-162)2/((-7)/((-168)/(-64)))-3. -2 What is the value of (-3400)/(-85)830/(-300)? -32 Evaluate 56274/(-253233)199/(-2). 11 What is ((-5010)/(-8350))/(119/35)? 3/17 What is 3/((-6)/13((-2506)/(-84))/(-179))? 39 What is the value of (-9)/(630/(-100))713/(-91)? -10/7 What is -84(-9)/(-6)(-4)/12? 42 What is the value of (-135)/(-18)12/7550/(-10)? -6 What is (-14124)/(-5885)(-6)/(-48)-6? -9/5 What is 68/214(-1159880)/(-10840)? 34 Evaluate 2520/14287/738. 70 Calculate ((-609)/145)/(420/4800). -48 What is (-40915)/44422(-57)/42(-152)/2? -95 Evaluate (402525/(-5367)1/(-4))/((-3)/4). -25 What is the value of (15/2)/(21/(-56))(-64)/(-280)? -32/7 Calculate (-20)/((159900/3567)/(-130)). 58 Calculate ((-2)/68)/(((-486)/(-12960))/((-30)/(-25))). -16/17 Evaluate (((-32)/6)/((-78)/(-117)))/(19(-30)/(-2565)). -36 What is 64/(-96)621/7659? -2/37 Evaluate 59500/(-28560)38. -50 What is 2601/1428(-12)/(-102)? 3/14 15/(-15)(-8)/10(-55)/(-154) 2/7 What is the value of (-6)/(-2)159/(67257/(-14664))? -104 What is 12(-273)/5148(-176)/77? 16/11 (-8)/12(-60)/(33/(264/16)) 20 What is ((((-2550)/(-374))/(-25))/(126/(-77)))/(-2)? -1/12 Calculate (-41280)/(-302720)(-8)/78. -2/143 What is the value of (1/6)/((127/(34671/(-26)))/14)? -49/2 What is (385/(-539))/(900/3465)? -11/4 What is 17(-30)/64604/(-27)? 2/171 Calculate (-17150)/(-147)(-28)/(840/(-9)). 35 What is (((-30)/(-60))/(5/(-2)))/(((-170)/40)/(-17))? -4/5 Calculate (-52)/(-24)((-10)/(-234))/(1225/1470). 1/9 Calculate 6-131(-26)/32584/(-33592). -52 What is ((1740/3190)/(21/(-22)))/(10/42)? -12/5 (384912/270)/99(-25)/20 -18 Calculate 7/(-14)4/(-7)(-231)/2607. -2/79 Calculate ((-6)/((-48)/8))/((-15)/240). -16 (139/28773)/(3/(-135)-5) 1/23 Evaluate ((-883)/(-8830))/((-1)/(-620)). 62 (-819)/(-54)((1827/70)/29)/((-57)/95) -91/4 893256/(-4908)1/(-14) 13 What is the value of 15(((-3906)/20925)/((-2)/(-20)))/(-4)? 7 Evaluate ((-91)/(12012/660))/7. -5/7 Calculate 9-125745/22980. -27 What is (-28140)/(-438984)24/(-15)? -4/39 6(15000/(-1800))/(5/4) -40 Evaluate ((-12)/(-808))/((-39)/52). -2/101 What is 5/(7/(633/5130))? 1/38 What is ((-204)/(-765)(-120)/(-54))/((-3)/(-9))? 16/9 What is the value of (-2)/(-22)(-3)/(-9)(-41)/(10332/216)? -2/77 What is the value of -3(282/9)/(740/370)? -47 Evaluate (((-62)/(-248))/((-2)/(-156)-3))/(1/12). -78 Evaluate ((-135)/1215)/((5/(-12))/(-5)). -4/3 Evaluate (1117/(-4468))/((-3)/180). 15 ((-2)/(-4))/((-8801)/(-228826)) 13 ((-1)/1)/(((-4056)/1365)/104) 35 Calculate (12699/(-28220))/((-7)/(-840)). -54 What is the value of (16351/(-5395830))/((-6)/44)? 1/45 (-18)/44(-8)/(-30)(-179)/(716/40) 12/11 What is the value of (2/22)/(2040/(-748))? -1/30 Evaluate 2/(-4)-132088/(-5280). -11 Calculate 55/(-13)43147/(-3319). 55 Evaluate 16/192851. 34 Calculate (-25)/(750/40)35/(-40). 7/6 Evaluate -29(-37376)/1625856. 12/29 What is the value of ((-98)/14)/((-5334)/60198)? 79 (-4)/(-36)641/(1763/(-1806)) -28 Evaluate (((-6)/126)/((-1)/18))/(-14326/169). -3/77 What is the value of (4/(-140))/(-5512/(-264))? -1/25 (-24)/(-396)-944/(-12) 2 Evaluate (-15)/(-42)-3(-461608)/98916. 5 (910/(-70)2)/((-9)/42) 12 Calculate ((-1827)/(-252))/(300/(-800)). -58/3 What is (52/(-208))/(4/(12/3))44/143? -1/13 (7/3)/(2121/(-14544)) -16 (23/((-2990)/20))/((-10)/1560) 24 What is the value of (((-21)/(-630))/((-25)/(-4750)))/((-1)/3)? -19 Evaluate (18/(-6435))/((-241)/3133). 2/55 What is the value of (3/228/63)/((-73)/(7227/264))? -1/4 Evaluate (5658/205)/23(-20)/28. -6/7 27/5049(-418)/((-152)/8) 2/17 Evaluate ((-25)/5)/(-5)1/(63/(-1476)). -82 Evaluate (-90)/(-84)(48/(-21))/(1260/(-882)). 12/7 What is (-12325)/(-3570)(7176/115)/26? 58/7 Calculate 2/5(-30720)/(-761856). 1/62 1171500/(-7500)(-5)/(-11) -71 What is 5/(-20)(24080/43)/(-5)? 28 Calculate ((-196695)/(-150))/31(-405)/(-729). 47/2 Evaluate 32/(-3)((-846)/(-1833))/((-3)/52). 16 (-25)/(-10)2/9-31308/(-33790) 2/31 Calculate (-56043)/(-262971)61/1. 13 (78468/(-170014))/(4/598) -69 What is (((-9)/(-3))/15)/(119715/(-3450))? -2/347 Calculate (279/6)/(42/(-420)15). -31 What is (15780/(-130185))/(6/33)? -2/3 1/(28/12)(-336)/64(-240)/(-20) -27 (-10(-217)/(-465))/(31(-6)/(-27)) -7 Evaluate -30(12696/3680)/(-3(2/1)/8). 138 Evaluate 98/8937676-186. -31/2 Calculate 9/((-1170)/160)((-37)/4)/(-37). -4/13 What is 384/(-288)(-69)/253? 4/11 Evaluate (((-3)/(-2))/(630/168))/(32/(-20))60. -15 Calculate (-2)/((7/22)/((-4368)/8008)(-1)/7). -24 Calculate (13/((-650)/(-60)))/(14(-54)/(-2016)). 16/5 What is ((-235)/((-39950)/1020))/((-3)/22)? -44 ((-300)/(-90)1/(-2))/((-220)/(-6204)) -47 What is the value of ((-18)/(-292)15/450-10)/((-48)/(-64))? -2/73 Calculate 1215/3240(-2968)/21. -53 What is the value of 463/(-2315)1150/5? -46 What is the value of 16/63564/70224-19? -18/7 Evaluate ((60/50)/((-91)/(-130)))/((-6)/105). -30 ((-77)/(-154))/((-10)/(-80))(-102)/8 -51 What is (1592/(-3582))/(11/(55836/(-24)))? 94 Calculate 30/4520097/(-154). -87 What is the value of (-36)/16(-36332)/879? 93 Calculate (2964/(-4199))/(99/(-204)). 16/11 Evaluate (1926/856)/((-27)/24). -2 ((-3464)/6495)/((-38)/2565) 36 What is the value of (17/4)/(48/(-1776)-37(-2)/2)? -17/4 What is (-80)/(-6)(-66)/(-10)38/(-1045)? -16/5 What is the value of (12/(-9))/(-3(-48)/2376)? -22 What is the value of -15(-403)/3348-18(-72)/(-20)? -117 Evaluate 11055/2948440/(-25). -66 Calculate (-504896)/32928(-1)/(10/(-6)). -46/5 What is ((-120)/(-3910))/((-336)/3864)? -6/17 Calculate (-39024)/1355140/42. -96 What is the value of (-56)/(-34)(-76262)/(-4486)? 28 What is the value of (-230(-54)/135)/(-12)? -23/3 51(-208)/(-360)78/(-169) -4/3 Calculate (13720/(-84))/(-98)(-18)/(-2)-1. -15 Evaluate (-471056/6204)/(-2(-1)/(-8)). 32 Evaluate ((32/2464)/((-2)/(-7)))/(4/11). 1/8 What is the value of 22/4952(432/(-12))/(-4)? 4/5 What is the value of (57/(-513))/(2/(-96))*828/(-48)? -92 Calculate (((-948012)/1092)/103)/((-1)/(-7)). -59 Calculate (415/(296310/612))/((-2)/(-28)).	{ "pile_set_name": "DM Mathematics" }
t is j rounded to six dps? -0.000006 Let d = 0.44 + -4.04. Let c = -14 + d. Let k = 16 + c. Round k to the nearest integer. -2 Let w(c) = -1088c - 8. Let q(f) = -f3 - 2f*2 + f + 3. Let j be q(-3). Let m be w(j). Round m to the nearest 1000. -10000 Let s = -20.2 + 28.3. Let c = -0.54 - s. Let r = c - -8. What is r rounded to one decimal place? -0.6 Let k = 20.2 + -15. Round k to the nearest integer. 5 Let l = -4.99999956 + 5. What is l rounded to 7 dps? 0.0000004 Let v = 3 - 0. Let n(f) = 65624f*2 + 3f + 1. Let b be n(4). Suppose 4g = 2g - r - 700001, 3g + b = vr. Round g to the nearest one hundred thousand. -400000 Suppose 2n - 56 = 4l + 316, -3l = -n + 279. What is l rounded to the nearest 10? -90 Let u = 0.5 + -0.57. Let a = 3.07 + u. Let h = a + -2.99964. Round h to four dps. 0.0004 Let w = -30 - -30.46. Let t = w - 0.4599981. Round t to six dps. 0.000002 Let c = 38 + -19. Let y = 9 + c. Let g = 27.999974 - y. What is g rounded to five decimal places? -0.00003 Let m be (-14)/3(-423)/2. Suppose 18 - m = -j. Suppose 3g + 194 = 4c + 3086, g - 3c = j. Round g to the nearest 100. 1000 Let t = 210003 + -210011.99996. Let o = -9 - t. Round o to 5 decimal places. -0.00004 Let n = 49.116 - 49. Round n to 2 decimal places. 0.12 Let q = 16816138.000018 + -16816119. Let r = q + -19. Round r to 5 decimal places. 0.00002 Suppose -2j = 3j - 1017510. Let m be j/11 - 4/22. Suppose -m = -3c - 2c. Round c to the nearest 1000. 4000 Let p = 80 + 16. Let t = p + -119.8. What is t rounded to 0 dps? -24 Let c = -74 - -143. Let h = -0.75286803 - 68.24710297. Let b = h + c. What is b rounded to 5 decimal places? 0.00003 Let o = 82 + -81.9959. Round o to 3 dps. 0.004 Let k = 20.9999938 - 21. What is k rounded to six decimal places? -0.000006 Let v = -35899.087 + 35881.087087. Let z = v - -18. Round z to five dps. 0.00009 Let i = -549.866 - -550.536081. Let n = -0.67 + i. What is n rounded to five dps? 0.00008 Let y = -8411.9996 - -8409. Let a = -2 + -1. Let k = y - a. Round k to four decimal places. 0.0004 Let m(f) = -f3 - 11f*2 - 10f - 6. Let p be m(-10). Let i be 40/6(p + 3). What is i rounded to the nearest one hundred? 0 Let z = 51 + -50.99993. Round z to 5 decimal places. 0.00007 Suppose 34 = -y + 90. Suppose 0 = -2o + y + 80. What is o rounded to the nearest ten? 70 Let g = 592.8412786 + 2469.0240284. Let u = g + -2896.8654. Let b = u - 165. Round b to 5 decimal places. -0.00009 Let i = -1.64 - -1.63853. What is i rounded to 4 decimal places? -0.0015 Let o = -0.637 + 0.7. What is o rounded to 2 dps? 0.06 Suppose -47994 = -2u + 2p, p = -4u + 4p + 95991. Suppose 9f = 7f - u. Round f to the nearest ten thousand. -10000 Let m = 74925.726 + -74920.72600016. Let n = 5 - m. What is n rounded to seven decimal places? 0.0000002 Let s(i) be the first derivative of 433i5/40 + 5i4/24 - i3 - 5. Let w(d) be the third derivative of s(d). Let u be w(5). Round u to the nearest 1000. 7000 Let r = 39609385 + -39611522.743056. Let q = r - -2153.743. Let v = q - 16. What is v rounded to five decimal places? -0.00006 Let g = 0.5857 + -0.58. Round g to three decimal places. 0.006 Let x = 1.934 + -2. Round x to 2 decimal places. -0.07 Let i = -4.4285 - -4.99803. Let m = i - 0.57. Round m to four decimal places. -0.0005 Let n = 0.2 + 0.4. Let s = n + -0.5999975. Round s to 6 dps. 0.000003 Suppose -y = -0a - a + 278, 826 = -3y + a. What is y rounded to the nearest one hundred? -300 Suppose -1686139 = 3p - 147139. Round p to the nearest 100000. -500000 Let k = 1.8 - 2.48. What is k rounded to one decimal place? -0.7 Let y be (332/3)/((-13)/(-68133)). Let a be 10440028/6 + (-4)/6. Suppose -a = 3g - l, 2l - 3l = -g - y. Round g to the nearest one hundred thousand. -600000 Let n = -2363.65 - -2347.6521. Let s = n + 16. Round s to three decimal places. 0.002 Let s = 3.647 - 3.43. What is s rounded to one decimal place? 0.2 Let v = -5.11 + 5. Let l = -0.1142 - v. What is l rounded to three decimal places? -0.004 Let t = 6684 - -9216. Round t to the nearest one thousand. 16000 Let g = -2 + -1. Let u = g - -4. Let x = 1.00000008 - u. Round x to seven decimal places. 0.0000001 Let u = 520.231 - 520. Let p = 0.2310109 - u. What is p rounded to six dps? 0.000011 Let c = 8.2 + -2.6. Let g = 6 + -1. Let k = c - g. What is k rounded to 0 dps? 1 Let r = 0.039 + -0.154. Round r to two dps. -0.12 Let j(r) = 8903r2 - 2r + 4. Let z be j(-4). Suppose -b - z - 279540 = 2w, -w = 3b + 211000. Round w to the nearest 10000. -210000 Let d = 3354 - 6254. Round d to the nearest one thousand. -3000 Let z = 9.06 + -9.06000513. What is z rounded to six decimal places? -0.000005 Let g = -1.7599849 - -1.76. What is g rounded to 6 dps? 0.000015 Let c = -3.61 + -0.29. Let x = -4 - c. Let u = x - 0.07. Round u to one dp. -0.2 Let j = 132.32 + -2.32. Let y = j + -129.9867. What is y rounded to 3 dps? 0.013 Let u = -40479794 + 40479792.3000007. Let x = u - -1.7. Round x to six decimal places. 0.000001 Let m = 1844 - 1960.87. Let k = m - -115. Round k to 1 dp. -1.9 Let v = 4979.51 - 4900. Let j = -63.8 - 15.2. Let q = v + j. What is q rounded to 1 dp? 0.5 Let o = 0.311 + -0.041. Let z = 25.6073 + -25.88. Let v = z + o. Round v to three decimal places. -0.003 Let t = 0.963 + -0.023. Let y = 0.06 + t. Let k = 0.9999992 - y. Round k to 7 dps. -0.0000008 Let l = 21 + -25. Let t = 1092846 + -1092849.9999904. Let z = t - l. What is z rounded to six decimal places? 0.00001 Let r = -0.8 + 3.8. Let k = 3.0003 - r. Round k to 3 dps. 0 Let u = 4.4 + -4.429. What is u rounded to three decimal places? -0.029 Let s(m) = -11249m3 + 7m*2 + 8m + 12. Let c be s(-6). Round c to the nearest one hundred thousand. 2400000 Let t(a) = -14258a3 + a2 + 4a. Let b(f) = -3f - 4. Let r be b(-4). Let l be t(r). What is l rounded to the nearest one million? -7000000 Let m = 23 + -23.185. Round m to two decimal places. -0.19 Let d = 10 + -17. Let o = 6.99985 + d. Round o to four dps. -0.0002 Let v = -5 + 5.83. Let y = 24474 + -24473.17063. Let b = v - y. What is b rounded to 4 decimal places? 0.0006 Let y = 1.114115 - 0.584057. Let l = 0.53 - y. Round l to 5 dps. -0.00006 Let k = 56.8 + -59.23. Let u = k + -0.07. Let s = -2.500046 - u. Round s to five decimal places. -0.00005 Let d = 11.3 - 5.4. Round d to the nearest integer. 6 Let a = 246611 + -132611. What is a rounded to the nearest ten thousand? 110000 Let w = -141 - 97. Let p = -52735.07 - -52972. Let o = w + p. Round o to 1 dp. -1.1 Suppose 5i = 4i - 2850. Round i to the nearest 100. -2900 Let q = 50468733.78999842 + -50468733. Let x = q + -0.79. What is x rounded to 7 dps? -0.0000016 Suppose -3t + 1533 = -357. What is t rounded to the nearest 100? 600 Let q be (-3)/((6/(-4))/(-1)). Let t be (-3794 - 6) + 2 + q. What is t rounded to the nearest one thousand? -4000 Let o(n) = -2n - 3. Let g be o(-9). Suppose 2m - g = -m. Suppose my + i - 3i - 247 = 0, 0 = 2y - 4i - 102. Round y to the nearest ten. 50 Let l = 0.064 - -142.936. Let r = l - 213. Let n = r - -69.9934. Round n to 3 decimal places. -0.007 Suppose 3h + h = 12. Suppose 5i = hi - 4q + 2, -8 = 4i + 2q. Let a be -37 + 2 + i - 2. Round a to the nearest ten. -40 Let h = -38.355 - 1.625. Let j = 0.02 - h. Let v = -39.9999963 + j. Round v to 6 decimal places. 0.000004 Let z be (-5)/15 - -38278/(-18). Round z to the nearest one hundred. -1400 Suppose i + 3i = -920000. What is i rounded to the nearest ten thousand? -230000 Let l(c) = c*3 - 6c*2 + 5c + 2. Let u be l(5). Let k be (14/10)/(u/10). Round k to the nearest integer. 7 Let q = 18.82 - 2535.82. Let i = q + 2509.972. Let w = i - -7. What is w rounded to two decimal places? -0.03 Let p = 5.895 - 6. Round p to two decimal places. -0.11 Let n = 0.85 + -0.84484. Round n to 4 decimal places. 0.0052 Let d(o) = 20250o - 1. Let z be d(1). Suppose 0 = 5i - h - z, 4h + 16776 = 5i - 3470. Suppose -3c - 2c = i. What is c rounded to the nearest 100? -800 Let h = -0.6 + 1.8. Let z = 0.7 - h. What is z rounded to one decimal place? -0.5 Let y = 927.269986 + -927.3. Let x = y + 0.03. What is x rounded to five decimal places? -0.00001 Let u = 0.02 - 0.021. Let q = u + 3.901. Round q to the nearest integer. 4 Let	{ "pile_set_name": "DM Mathematics" }
- 2. Factor r(i). -2i3(i - 1)*2/3 Let w be 3 - 0/((-3)/(-3)). Determine n, given that -8/7n*2 - 8/7n*4 + 12/7n*w + 0 + 2/7n + 2/7n5 = 0. 0, 1 Let h(c) = -c2 - 7c - 4. Let m be h(-6). Let n(g) be the second derivative of 0 - 1/35g5 + 2/21g*3 + 1/42g*4 - g - 1/7g*m. Factor n(z). -2(z - 1)(z + 1)(2z - 1)/7 Factor 3/2h + 9/4h2 + 0 + 3/4h*3. 3h(h + 1)(h + 2)/4 Factor -4h - 6 - 2/3h*2. -2(h + 3)*2/3 Let j = 13/70 - 3/35. Let s(w) be the second derivative of -4/45w*6 - jw*5 + 1/3w*3 - 1/3w*2 + 0 + 2w + 5/18w4. Let s(r) = 0. Calculate r. -1, 1/4, 1 Let v = -19 + 22. Suppose 2p - 4 = 2f - 2, vf = -4p + 11. Factor 0g + 4/5g4 - 2/5g*5 + 0g*p + 0 - 2/5g*3. -2g*3(g - 1)*2/5 Factor 12 - d - 23 - 2d2 - d3 + 11. -d(d + 1)2 Determine r so that -4r*2 + 3r*2 - 20 + 0r*2 - 4r*2 + 20r = 0. 2 Suppose 0 = -3b - 31 - 8. Let x = -11 - b. Let -6/7n*3 + 4/7n*x + 0 + 2/7n = 0. What is n? -1/3, 0, 1 Let b(j) be the third derivative of -1/336j8 + 0j + 1/210j7 - 1/60j*5 + 3j*2 + 0 + 0j*3 + 1/120j*6 + 0j*4. Suppose b(h) = 0. What is h? -1, 0, 1 Let g = 120 + -117. Let d(t) be the third derivative of 0t + 0 + 1/105t7 - 1/30t*6 - 1/840t8 - t2 + 1/15t5 + 1/15t*g - 1/12t*4. Factor d(f). -2(f - 1)*5/5 Factor 8/7r*3 - 6/7r - 2/7 + 0r2. 2(r - 1)(2r + 1)*2/7 Suppose 0 = -5b + b + 12. Let t = -41 + 41. Factor -4/9g2 + 0g - 2/9gb + t. -2g*2(g + 2)/9 Suppose -5a + 3h = -16, a + 3 = -3h - 1. Suppose -l + 2 = -0. Factor g2 - 1 + 2g - lg2 + 0ga. -(g - 1)2 Find r, given that -2/7r - 5/7r*2 - 3/7r*3 + 0 = 0. -1, -2/3, 0 Let b = 6/103 - -279/515. Determine a so that ba + 3/5a2 - 6/5 = 0. -2, 1 Let p(w) be the second derivative of w7/168 - w6/60 - w5/80 + w4/24 + w. Factor p(m). m2(m - 2)(m - 1)(m + 1)/4 Let f(n) be the second derivative of -n*6/10 - 27n*5/20 - 15n*4/4 + 25n*3/2 + n + 24. Factor f(r). -3r(r - 1)(r + 5)2 Let n(h) be the third derivative of -h5/30 + h4/6 - h3/3 + 7h2. Factor n(i). -2(i - 1)*2 Suppose -20v*2 - 5v*4 - 19v*3 + 4v + v*4 + 36v*3 = 0. What is v? 0, 1/4, 2 Let b(t) = -3t*3 + 3t*2 + 3t - 3. Let u(p) = -9p3 + 9p*2 + 9p - 9. Let i(f) = 7b(f) - 2u(f). Determine l so that i(l) = 0. -1, 1 Let y(a) be the third derivative of -a6/40 - a5/5 - a*4/2 - 14a*2. Factor y(u). -3u(u + 2)2 Let i(q) be the second derivative of q9/15120 - q8/2240 + q7/1260 + q4/6 + 2q. Let d(y) be the third derivative of i(y). Factor d(h). h*2(h - 2)(h - 1) Let l(u) be the second derivative of u3/6 - u2/2 - u. Let r(g) = -86g - 2g2 - 1 + 89g + 0. Let v(o) = l(o) + r(o). Determine b so that v(b) = 0. 1 Let h(f) be the third derivative of -f*7/70 + 3f6/40 - f4/2 + 28f2. Find d, given that h(d) = 0. -1, 0, 2 Let y be 1 + -1 - (-2 + 3 + -1). Let -1/6h*2 + 1/6 + yh = 0. What is h? -1, 1 Let f be ((-117)/(-156))/(9/24). Solve 2mf - 1 + 1/2m - m3 - m4 + 1/2m5 = 0. -1, 1, 2 Factor 24/5l + 1/5l3 - 16/5 - 9/5l2. (l - 4)2(l - 1)/5 Let n(b) be the first derivative of -11/8b*2 + 8 + 11/16b*4 - 7/12b*3 + 9/20b*5 - 1/2b. Factor n(r). (r - 1)(r + 1)2(9r + 2)/4 Let v = -445 + 1336/3. Factor -o2 + vo*3 + 4/3 + 0o. (o - 2)*2(o + 1)/3 Let c(m) be the first derivative of -4m3/3 + 6m2 - 36. Find s such that c(s) = 0. 0, 3 Let k = 6 + -7. Let w(x) = x3 + x*2 - x. Let s(p) = -5p*3 - 9p*2 - 3p - 2. Let n(u) = ks(u) - 3w(u). Let n(q) = 0. Calculate q. -1 Suppose -9z + 72 = -7z. Let v be 3/(-12) + 21/z. Factor 0 - 2/3y + vy*2. y(y - 2)/3 Let l(b) be the second derivative of 49b6/150 - 21b*5/100 - 2b*4/5 - 2b*3/15 - 12b. Factor l(o). o(o - 1)(7o + 2)2/5 Suppose 6k - 107 + 3k2 + 107 = 0. Calculate k. -2, 0 Let b be ((-6)/41/(-3))/10. Let w(c) be the second derivative of bc5 + 2c*2 + 5/12c*4 - 3c + 4/3c3 + 0. Factor w(l). (l + 1)(l + 2)*2 Determine k so that 6k + 0 - 63/4k4 - 75/2k*3 - 9k2 = 0. -2, -2/3, 0, 2/7 Let x(z) be the second derivative of z6/1620 + z5/180 + z4/54 + z*3/3 + 4z. Let i(s) be the second derivative of x(s). Determine o, given that i(o) = 0. -2, -1 Let g(v) = -3v3 + 3v. Suppose -c + 5o + 14 = 0, 3c - 4c - 3o - 2 = 0. Let n(u) = -7u3 + 7u. Let z(w) = cn(w) - 10g(w). Factor z(d). 2d(d - 1)(d + 1) Let u(x) be the third derivative of -x6/24 - 3x5/20 - x4/6 - 29x2. Factor u(c). -c(c + 1)(5c + 4) Let q(x) be the second derivative of 0x4 + 3x*2 - 4x + 3/2x3 + 0 - 3/20x*5. Determine m, given that q(m) = 0. -1, 2 Let o(p) = -2p*3 + 15p*2 - 24p + 19. Let y(i) = -2i3 + 14i*2 - 24i + 18. Let h(m) = 2o(m) - 3y(m). Factor h(z). 2(z - 2)3 Let y = -26 + 28. Let o(t) be the first derivative of 0t*2 + y - 3/2t*4 - 6/5t*5 - 2/3t*3 + 0t - 1/3t6. Factor o(z). -2z*2(z + 1)3 Solve -5 + g2 + 6 + 3 - 2g2 + 3g = 0 for g. -1, 4 Let j(f) be the first derivative of f6/180 + f5/30 + f*3 + 3. Let c(a) be the third derivative of j(a). Factor c(n). 2n(n + 2) Let m(d) be the first derivative of 6d + 2/9d3 - 2d*2 - 2. Suppose m(g) = 0. Calculate g. 3 Let b be 51 - (7 + -5). Suppose bo + 37 = 5d, -29 = -5d - 2o + 3o. Let m(p) = 1. Let t(n) = -4n*2 - 5n - 6. Let q(v) = dm(v) + t(v). Factor q(w). -(w + 1)(4w + 1) Let q(p) be the third derivative of p7/420 - p5/60 + p3/12 - 5p2. Factor q(z). (z - 1)2(z + 1)2/2 Let f(d) be the third derivative of d6/24 + d5/4 + 3d*2. Solve f(w) = 0 for w. -3, 0 Suppose -6/7j*2 + 4/7 + 10/7j = 0. Calculate j. -1/3, 2 Suppose x + 5g = 3g - 8, 3g = -15. Suppose 9 = 3h - r, -4r + xr = 3h - 18. Suppose 6w*h - 6w4 + w5 - w3 = 0. What is w? -1, 0, 1 Let b(h) be the third derivative of -h6/60 - 7h5/60 - h4/12 + h3/2 - 31h*2. Factor b(s). -(s + 1)(s + 3)(2s - 1) Let o(p) be the second derivative of -1/14p7 + 4p + 0p5 + 0 + p4 - 3/10p*6 + 0p*2 + 0p*3. Determine q so that o(q) = 0. -2, 0, 1 Let r = 230/3 + -76. Factor -2/3 + rb*2 + 0b. 2(b - 1)(b + 1)/3 Factor 20v4 + 40v*2 + 4 - 30v*3 - 2v*5 + 18v*3 - 2v*5 - 20v - 28v3. -4(v - 1)*5 Suppose -q + 0i + 13 = -2i, 0 = 4q - 5i - 37. Let k(v) be the second derivative of -2v + 1/12v4 + 0 + 1/20v*5 + 0v*q + 0v2. Factor k(s). s2(s + 1) Let j(w) be the third derivative of 2w*2 + 0w*5 + 1/60w*6 - 1/4w*4 + 2/3w*3 + 0w + 0. Factor j(b). 2(b - 1)2(b + 2) Solve 2/11x2 + 0x + 0 = 0. 0 Let w(i) = -2i + 2. Let l be w(0). Let -8/5h - 8/5 - 2/5hl = 0. Calculate h. -2 Factor 0 + 16/5l*2 + 2l*5 - 36/5l*4 + 24/5l*3 + 0l. 2l2(l - 2)*2(5l + 2)/5 Find c, given that -21c*5 - 159/7c*2 + 12/7 + 21c*4 + 159/7c*3 - 12/7c = 0. -1, -2/7, 2/7, 1 Suppose -4h + 0 = 8. Let s be 3/(-18) + h/(-4). Let 4/3k*2 - 5/3k - sk3 + 2/3 = 0. Calculate k. 1, 2 Let q = -21/4 + 113/20. Factor qu*2 + 0 + 0u + 8/5u3. 2u*2(4u + 1)/5 Factor 0k + 2/5k2 + 0 + 3/5k*3 + 1/5k4. k2(k + 1)(k + 2)/5 Suppose -3g + 42 = 5r, -g - 26 = -3r - 3g. Let b be -2 - (-2 - r/9). Factor -2/3t4 - 8/3t*3 - 4t*2 - 8/3t - b. -2(t + 1)4/3 Let y = -64 + 257/4. Suppose -r + 6 - 4 = 0. Factor -q - y - q3 - 1/4q*4 - 3/2qr. -(q + 1)4/4 Let y be (-1 - 1)(4 + (-91)/21). Let d(w) be the first derivative of w2 + 2/3w*3 + 1 + yw + 1/6w4. Factor d(b). 2(b + 1)*3/3 Let c be (3/(-12))/((-190)/1216). Let -2/5j*5 - 4/3j*4 + 0 + 8/15j - 2/5j3 + cj2 = 0. Calculate j. -2, -1/3, 0, 1 Let r(h) = -h3 - 4h2 + 2h - 11. Let n be r(-5). Factor 2/3l3 + 2/3l*n + 0 + 0l + 0l2 - 4/3l*5. -2l*3(l - 1)(2l + 1)/3 Let n(t) = -4t3 - 2t*2 - 3. Let c(z) be the first derivative of 1/3z*3 + 2z + 0z2 + 3/4z*4 + 1. Let y(d) = 6c(d) + 4n(d). Factor y(l). 2l*2(l - 1) Let g be 2/(-6)(-6)/4. Let y(m) be the first derivative of 2m + gm4 - 2/3m3 - m2 - 1. Factor y(i). 2(i - 1)2(i + 1) Let b be (-10)/(-70) + 166/14. Let l = 16 - b. Factor 1/4tl + 0t*2 - 1/4 + 1/2t*3 - 1/2t. (t - 1)(t + 1)*3/4 Let m(w) = -w - 17. Let n	{ "pile_set_name": "DM Mathematics" }
of (-16272 + 6)/((-186)/15 + 12)? 0 Suppose 746u = 678u + 180540. What is the units digit of u? 5 Suppose -3n + 184141 = o, -4n + 33268 = 5o - 212224. What is the ten thousands digit of n? 6 Let t = 239 + -226. Suppose -4z + 235 = q, -2q + 16z + 503 = tz. What is the hundreds digit of q? 2 Suppose 15 = 10g - 5. Suppose gq - l = l - 4, 0 = -l + 2. Suppose qv = v - 2u - 67, -3u = v - 72. What is the units digit of v? 9 Let h(b) be the first derivative of -b*2 + 375b + 22. What is the units digit of h(0)? 5 Suppose 43w - 1081024 = 11w. What is the tens digit of w? 8 Suppose 4y + 6 = -z, 11y - 8 = -5z + 10y. Let g(i) = 45i2 + 10i - 21. What is the tens digit of g(z)? 7 Suppose -v = v + 58. Let g(s) = s*2 - 27s - 148. Let r be g(30). Let t = v - r. What is the units digit of t? 9 Suppose -4796 = -5m + g, 2m + 0m - 1916 = g. Suppose 321b - 326b + m = 0. What is the tens digit of b? 9 Let h = 562 + -559. Suppose -3188 = -hu - 5m, 3u + 1712 = -2m + 4888. What is the thousands digit of u? 1 What is the thousands digit of 5/((-70)/88)(-8771)/14? 3 Let j = -5752 - -14375. What is the hundreds digit of j? 6 Let q = -2132 - -5252. Suppose 0 = -136m + 121m + q. What is the tens digit of m? 0 Suppose -w + 4l + 274 + 400 = 0, -2w - 5l = -1322. Let j = -122 + w. Suppose -j - 976 = -8k. What is the tens digit of k? 9 Suppose 2s - 123 = 10661. Suppose 3h = -2t + s - 543, -3h = t - 4853. What is the hundreds digit of h? 6 Let l(p) = 39p3 + p2 - 13p - 20. Let h(r) = 77r3 + 2r*2 - 25r - 39. Let w(g) = -6h(g) + 11l(g). What is the tens digit of w(-2)? 6 Let s(u) = 27u + 11. Let h be s(-2). Let o = 47 + h. Suppose -or + 0r - 2j + 412 = 0, -r + 4j + 112 = 0. What is the units digit of r? 4 Suppose 37n = 11n + 92872. What is the units digit of n? 2 Suppose 5o - 44 = o. Let i = o + -1. What is the tens digit of 1014/10 + (-4)/i? 0 Suppose -2r - q + 6 = 3, -3r + 4q = -21. Suppose ra - 4y = -0y - 700, 0 = -4a + 5y - 935. Let v = -136 - a. What is the hundreds digit of v? 1 Suppose -4d = 2c - 4800, 3c + 4d = 2c + 2396. What is the hundreds digit of c? 4 Let s(g) = -3g*2 + 27g + 78. Let u(q) = 5q2 - 28q - 79. Let o(a) = 4s(a) + 3u(a). What is the hundreds digit of o(-17)? 5 Let q be -3(-10)/6 - -9. Suppose 4 - 18 = -ql. What is the tens digit of (232/(-16))/(((-2)/l)/12)? 8 Let y be (3 - 1/3)/(2/660). Let p = y + -543. What is the tens digit of p? 3 Suppose 3u - 5667 = -3t, -5t + 5u + 8946 = -509. What is the hundreds digit of t? 8 Let z = 301 + -298. Suppose 0 = -l + 5q + 249, -1050 = -zl - l + 2q. What is the hundreds digit of l? 2 Suppose -47a = -51a + 25416. What is the thousands digit of a? 6 Let w be (-36)/(-8) + (-50)/20. Suppose -q = -5q - 5j + 7660, 5j = wq - 3800. What is the thousands digit of q? 1 Let s = 44052 + -22739. What is the tens digit of s? 1 Let q be (-14)/(-8) - (0 - (-6)/8). Let l be (-4 - 0)(-13 - -4) + q. Let u = 90 - l. What is the units digit of u? 3 Let x = 35 + -150. Let r = 272 + x. What is the units digit of r? 7 What is the thousands digit of (-44)/((-528)/770838) - 6/(-4)? 4 Suppose -78a + 3658781 = 975503. What is the units digit of a? 1 Let k(o) = o + 1. Let u(d) = -32d - 11. Let t(q) = 3k(q) + u(q). Let l be t(-4). Let w = l - 40. What is the units digit of w? 8 Suppose -23 = 8q + 113. Let t = 207 + q. What is the hundreds digit of t? 1 Let y(q) be the third derivative of 11q5/60 + 193q*3 + 71q*2 + 1. What is the units digit of y(0)? 8 Let v = -96 + 108. Let f(k) = -16k + 39k - vk + 5 + 6k2. What is the units digit of f(5)? 0 Suppose -16150 = -8s - 2326. Suppose -8w + 5w + s = 3p, -5p - 2880 = -5w. What is the hundreds digit of w? 5 Let g(f) = -87f + 30. Let b(p) = 174p - 59. Let m(n) = -6b(n) - 11g(n). What is the tens digit of m(-3)? 8 What is the units digit of ((-16037)/609)/((-1)/483)? 9 Let k(q) = -8q*2 - 27q + 223. Let x be k(10). Let g = 1550 + x. What is the units digit of g? 3 Let h = 110 - 56. Let s be 1 + -3 + h/9. Suppose -sw + r = -122, -r = -0w + w - 33. What is the units digit of w? 1 Suppose -47 = -17m + 21. What is the hundreds digit of (-930)/m((-56)/21)/2? 3 Suppose 2 = -2l + 2t, 17t + 23 = 2l + 20t. Suppose -ld - 348 = -2q - 932, -584 = -4d + q. What is the units digit of d? 6 Suppose 2g + 2s - 2228 = 0, -9 = 4s + 3. Suppose 4w + g + 660 = 3a, w + 2973 = 5a. What is the units digit of a? 5 Suppose -5 + 11 = 3a. Suppose -al + 338 = 82. Suppose -g = -u - 3u + 242, 2u + 3g = l. What is the tens digit of u? 6 Suppose 3y + 8125 - 23586 = -4n, -2y = 4n - 15458. What is the thousands digit of n? 3 Suppose 0 = -76h + 71h + 45. Let n(u) = 3u*3 - 13u*2 + 4u + 63. What is the units digit of n(h)? 3 Let h(p) = 2p2 - 31p + 89. Let d be h(12). Suppose -899 - 449 = -4b - c, -20 = dc. What is the units digit of b? 8 Let d be 2/(-9) - (105190/18)/5. Let y = -394 - d. What is the tens digit of y? 7 Let r = -149 + 154. Suppose -rq + 10q = 2y - 3783, 5y = -2q + 9472. What is the units digit of y? 4 Suppose 24z - 4400496 = -120z. What is the units digit of z? 9 Let m = -70 + 54. Let q = m - -21. Suppose d - 796 = -qu, 4u = u + 4d + 496. What is the tens digit of u? 6 Let r = -7080 + 16532. What is the thousands digit of r? 9 Let u(b) = 280b - 1065. What is the units digit of u(31)? 5 Let k(c) = -99c*3 - 9c*2 - 24c - 263. What is the thousands digit of k(-6)? 0 Suppose -2f - 3640 = -0f - 25428. What is the thousands digit of f? 0 Suppose 26b - 12775 = 131948 + 86625. What is the tens digit of b? 9 Let h = -1267 - -1825. Let m be h - 8/(-10)(-10)/(-4). Suppose z + 4z = m. What is the units digit of z? 2 Suppose 49a + 9a + 8a - 1974324 = 0. What is the thousands digit of a? 9 Suppose -6h - 2582 = -11h - 3q, -2h + 4q + 1012 = 0. Let b = -271 + h. What is the hundreds digit of b? 2 Let o = -144 + 23. Let f = 32 - o. Suppose z + 64 - f = 0. What is the units digit of z? 9 Let m be (-21)/(-49) - (398/14 + -1). Let y = m + 40. What is the tens digit of y? 1 Let a be (66/165)/(4/(-7690)). Let s = a - -1415. What is the units digit of s? 6 What is the ten thousands digit of 388984/(-44)(-12 + (-26)/(-4))? 4 Let v be (-2)/510/8-4. Suppose -9l + 16 = -v. Suppose 2s + 3t = 3s - 159, ls = -4t + 308. What is the tens digit of s? 5 Let r(b) = b*3 + 13b*2 + 12b + 39. Suppose 2y + 36 = -4f + 6y, 0 = 5f - 4y + 48. What is the units digit of r(f)? 9 Let z = 19371 - 2031. What is the ten thousands digit of z? 1 Suppose 5n + 25 = -3r, -4n - 4r - 38 + 10 = 0. Let y be (2 - 1) + (-6 - 0). What is the tens digit of (y/n - 2)28? 1 Let y = -42 + -5. Let m be (8/4)/(-2)y. Suppose f - m = 9. What is the units digit of f? 6 Let s = 7546 + -4991. Suppose 220d = 215d + s. What is the units digit of d? 1 Suppose 5t - 7t = -6. Let i(k) = -4k*t + 6k + 2k2 - 1 - 6k - k3. What is the units digit of i(-2)? 7 Let m = 106264 - 72096. What is the thousands digit of m? 4 Let r(o) = o3 - 14o2 - 17o + 36. Let j be r(15). Let x = j - -232. What is the units digit of x? 8 Suppose 2p + 2841 - 15259 = -2r, 4p = 3r + 24843. What is the tens digit of p? 1 What is the hundreds digit of 27843/4 + (-11)/(-44)? 9 Suppose 107802 = 5l - 3n, 126l - 127l + n + 21558 = 0. What is the hundreds digit of l? 5 What is the units digit of 132(-12)/5417-15? 0 Suppose 1060y = 4v + 1058y - 289406, 217050 = 3v - y. What is the ten thousands digit of v? 7 Let z(r) = 6r*2 + 2. Let c be z(-1). What is the tens digit of 3246/c + (-72)/96? 0 Let v = -172489 - -254751. What is the tens digit of v? 6 Let s be ((-76)/(-12) + -6)/(3/11403). Let u = -1 - 9. What is the hundreds digit of 0 + (s/5 - (-4)/u)? 2 Let t(n) = -7n + 1. Let l = -71 + 67. What is the units digit of t(l)? 9 Let v(p) = 95p3 - 13p*2 + 48p - 170. What is the thousands digit of v(7)? 2 Suppose 188q - 201q = -2509. Suppose -189r + qr = 6232. What is the hundreds digit of r? 5 Let t(i) = 6i2. Let u be t(-1). Let d(n) = -3n + u + 4n + 14. What is the units digit of d(-18)? 2 Let z(x) = -x3 + 37x*2 - 39x + 108. Let m be z(36). Suppose m = 3*l - 2167 - 362. What	{ "pile_set_name": "DM Mathematics" }
Let y(n) = -5 + 2 + 2. Suppose -4c + 0 = -4. Let r(i) = i. Give cr(h) + y(h). h - 1 Let l(f) = -10f2 + 2f + 2. Let u(q) = 170q2 - 35q - 35. Calculate -35l(a) - 2u(a). 10a2 Let m(j) = -2j3 + j2 + 2j + 6. Let c(h) = -2h3 + h2 + 3h + 7. Give -2c(s) + 3m(s). -2s3 + s2 + 4 Let q(n) = 4n2 - 7 + 2n*3 + 17 - 14. Let u(x) = -4x*3 - 9x*2 + 9. Give -9q(i) - 4u(i). -2i3 Let s(y) = -y2 + y. Let b(j) = -15j2 - 6j. What is -b(a) - 6s(a)? 21a2 Let g be -2 - (0 - 2) - (-1 - 0). Let y(w) = -w2 - 4w + 1. Let o(q) = -q + 1. What is gy(d) - o(d)? -d*2 - 3d Let n(b) = -13b3 + 4b*2 + 3b - 4. Let w(o) = -o3 + o2 + o - 1. What is n(j) - 4w(j)? -9j*3 - j Let q(j) = j - 9. Let h be (1 + 0)1-5. Let w be 3 - 6/(h - -3). Let k(z) = -z + 8. Calculate wq(y) + 7k(y). -y + 2 Let v = 9 - 4. Suppose vg - 12 = 33. Let c(f) = 5f + 9. Let n(a) = -10a - 8. Let p(l) = -l - 1. Let o(z) = -n(z) + 12p(z). Calculate go(r) + 4c(r). 2r Let t(r) = -r*3 - 5r - 5. Suppose -i - 2s + 3 = 0, -s = 5i + 16 + 5. Let c(j) = j + 1. Determine ic(p) - t(p). p3 Let j(a) be the first derivative of 5a*3/3 + 11a*2/2 - 11a - 1. Let c = -33 + 11. Let s(x) = x*2 + 2x - 2. What is cs(z) + 4j(z)? -2z2 Let w(p) = p + 1. Let d be (36/(-27))/(1/3). Let s(t) = -3t - 5. Determine dw(k) - s(k). -k + 1 Let w(v) be the second derivative of 11v*4/12 - 7v*3/3 - 11v*2/2 + 10v. Let f(u) = 7u2 - 9u - 7. What is -8f(y) + 5w(y)? -y*2 + 2y + 1 Let r(q) = -21q3 + 15q. Let t(v) = -11v3 + 8v. Give -4r(n) + 7t(n). 7n3 - 4n Let b(l) = l - 1. Let o(t) = -5. Determine 3b(f) - o(f). 3f + 2 Let w(h) = h*3 - 6h + 1. Let p(d) = -2d3 + 12d - 2. Calculate -4p(z) - 7w(z). z*3 - 6z + 1 Let j(t) = 15t + 19. Let z(i) = -8i - 10. Give -6j(x) - 11z(x). -2x - 4 Let w(h) = -35h*3 - 5h*2 + 2. Let n(t) = -53t*3 - 8t*2 + 3. Determine 5n(x) - 8w(x). 15x*3 - 1 Let z = -12 + 15. Let n(k) = k - 4k3 + k3 + k*2 + 4k*3. Let h(a) = -2a*3 - 3a*2 - 3a. Calculate zn(j) + h(j). j3 Let k(c) = 23c - 3. Suppose 9 = 2b - 2u + u, 4u - 30 = -3b. Let o(j) = 8j - 4 + 6 - 3. What is bk(f) - 17o(f)? 2f - 1 Let i(p) = -2p3 + 5p*2 + 7p. Let k(m) = -4m3 + 11m*2 + 15m. Let a = 12 - 6. What is ak(x) - 13i(x)? 2x3 + x2 - x Let s(i) = -5i - 4. Let u(q) = -11q - 9. Give -14s(z) + 6u(z). 4z + 2 Let h(b) = 2b + 9. Let d(j) = 3j + 18. Calculate 3d(r) - 5h(r). -r + 9 Let z(c) = 9c3 - 3c*2 - 3. Let f(j) = -9j*3 + 2j*2 + 2. Determine 3f(d) + 2z(d). -9d*3 Let n(j) = -5j*3 - 4j*2 - 2j - 2. Let t(o) = -11o3 - 9o*2 - 3o - 4. Determine -9n(q) + 4t(q). q*3 + 6q + 2 Let h(c) = -c*2 - 3c + 1. Suppose x + 2f = 10, 0x + 2f + 38 = 5x. Suppose x = -2o - 14. Let m(l) = 6l*2 + 16l - 5. Calculate oh(w) - 2m(w). -w*2 + w - 1 Let t(u) = -2u + 1. Let w(l) = -l*2 + 9l - 15. Let z be w(6). Let a(v) = 1. Give za(c) - t(c). 2c + 2 Let i(k) = k - 2. Let o(l) = -2l + 0l - 4 + 5l - 1. Calculate 8i(m) - 3o(m). -m - 1 Let r(m) = -m3 - 5m. Let t(i) = i*3 + 6i. Give 6r(x) + 5t(x). -x3 Let d(c) be the first derivative of -c3/3 - 3c - 9. Let p(k) = k2. Calculate d(i) + 2p(i). i2 - 3 Let w(y) be the second derivative of -y3/3 + 7y2/2 - y. Let o(p) = -34. Let k(b) = -7. Let l(t) = 5k(t) - o(t). Calculate -6l(g) - w(g). 2g - 1 Let v(f) = 3f2 + 4f + 9. Let d(i) = i*2 + i + 1. Determine 5d(y) - v(y). 2y2 + y - 4 Let n(p) = p - 1. Let j(a) = 16a - 20. Calculate -2j(r) + 40n(r). 8r Let d(c) = -6c - 3. Let q(k) = -11k - 7. Determine -5d(i) + 3q(i). -3i - 6 Let t(u) = -8u3 + 6u - 6. Let d(f) = 9f3 - f2 - 7f + 7. Calculate -6d(y) - 7t(y). 2y3 + 6y*2 Suppose -4w - 1 - 7 = 0. Let c(i) = i + 21i2 + 12 - i - 31i2. Let r(v) = v2 - 1. Calculate wc(n) - 22r(n). -2n2 - 2 Let t(z) = -z2 + z2 + 0z*2 - 5z*2 + 3z*3 - 5 - 5z. Let v(h) = h3 - h2 - h - 1. Give -t(q) + 5v(q). 2q*3 Let m(x) = -x. Let s be (-42)/(-56) + 5/4. Let o(d) = 3d. What is sm(g) + o(g)? g Let s(w) = -w3 - w2 + 1. Let q = -2 - -4. Let o(m) = 3m*2 - m - q - 5m + 4m. Determine -o(n) - 2s(n). 2n3 - n2 + 2n Let i(u) = 10u3 - 7u*2. Let t be 34/12 + 1 + 0. Let s(j) = 3j3 - 2j*2. What is ti(a) - 7s(a)? -a3 Let f(z) = -25z*2 - 4z + 2. Let m(t) = -26t2 - 5t + 3. Give -3f(d) + 2m(d). 23d2 + 2d Let u(x) = -20x2 + 11x + 4. Let g(s) = 5s2 - 3s - 1. Let q(h) = 9g(h) + 2u(h). Let w(m) = 6m2 - 6m - 2. Give -4q(d) + 3w(d). -2d2 + 2d - 2 Let k(y) = -18y - 5. Let a(c) = -90c - 24. Give 3a(l) - 14k(l). -18l - 2 Let j(h) = -9h + 17. Let l(o) = 4o - 8. Let p = -63 + 76. Determine pl(b) + 6j(b). -2b - 2 Let q(l) = -5l3. Let j(u) = 45u*3. Calculate -4j(b) - 35q(b). -5b*3 Let q(d) = -13d*2 + 9d - 4. Let s(g) = 3g2 - 2g + 1. Determine -2q(j) - 9s(j). -j*2 - 1 Let l(t) = 4t + 2. Let b(i) = 4i + 1. Let g(h) = 4b(h) - 5l(h). Let p(a) be the first derivative of -a2/2 - a + 1. Give -g(n) + 5p(n). -n + 1 Let f(d) = -10d3 - 2d*2 - 5d - 6. Let l(v) = 19v3 + 4v*2 + 9v + 11. Give -11f(m) - 6l(m). -4m3 - 2m*2 + m Let p be (2 - (0 - 0)) + 1. Suppose -3h + 5 = -pv - 4, -5v + h - 27 = 0. Let w(o) = -7o2. Let a(i) = 6i*2. What is va(y) - 5w(y)? -y2 Let s(a) = 4a - 1. Suppose 11l - 23l - 24 = 0. Let g(f) = -21f + 8. Let n(q) = 42q - 15. Let x(r) = -5g(r) - 3n(r). Calculate lx(d) - 11s(d). -2d + 1 Let g be (4 - 6) + (1 - -14). Let m(w) = -15w + 11. Let c(d) be the first derivative of -7d2/2 + 5d + 3. Determine gc(r) - 6m(r). -r - 1 Let g(p) = -3 + 0p - 3p + 0p. Let k(j) = -13j - 13. Let b(v) = v*2 - v - 2. Let f be b(-2). Determine fk(a) - 18g(a). 2a + 2 Let v(h) = -4h + 84 + 9h - 89 - 5h2 + 6h*3 - 7h3. Let a(x) = x3 + 2x2 - 2x + 2. Let m be 5 + 0/2 - 0. Calculate ma(d) + 2v(d). 3d3 Suppose -6u - 36 = -8u. Suppose 0 = -2b + 5b - u. Let f(a) = 8a + 1. Let q(d) = 23d + 3. Give bq(z) - 17f(z). 2z + 1 Let l(s) = s3 - s2 + s. Let j be l(2). Suppose -j = -0a - 2a. Let m(z) = -z*3 + 2z - 2. Let v(h) = -h*3 + 3h - 3. Determine am(i) - 2v(i). -i*3 Let j(w) = -15w*3 - 6w*2 - 6w. Let b(t) = -210t3 - 85t*2 - 85t. Calculate -6b(q) + 85j(q). -15q3 Let f(t) = -3t*3 - 2t*2 - 2t - 5. Let h(c) = -10c3 - 7c*2 - 7c - 15. What is 14f(i) - 4h(i)? -2i3 - 10 Let p be (-1 - (0 - 2))0. Suppose -b + 2 = -p. Let o(v) = -bv - 1 + 3 + v. Let f(c) = -c + 2. What is -4f(i) + 3o(i)? i - 2 Let k(h) = h. Let f(n) = n3 - 4n*2 + 2n - 2. Let g be f(4). Let q(d) = gd - d - 4d + 0d. Give -4k(s) + 3q(s). -s Let z(c) = -c3 + 2c + 2. Suppose 5q + 34 = 84. Suppose 5w - 4y + 6 = -y, 2w + q = 5y. Let k(a) = w + 1 + a2 - a + 2a. What is 2k(n) - z(n)? n3 + 2n*2 Let j(i) = 7 - 1 - 2i + 3i. Let s(n) = n + 7. Suppose 7p = -21 - 14. What is pj(d) + 4s(d)? -d - 2 Let d(r) = -r - 1. Let y(s) = s + 4. Suppose 3b - 6 = -3b. Calculate by(v) + 3d(v). -2v + 1 Let i be ((-1 + -1)1)/2. Let h(r) = -r*2 - r - 1. Let a(p) = -6p*2 - 4p - 4. Let f(m) = m + 7. Let g be f(-3). What is gh(j) + ia(j)? 2j2 Let p(v) = v2 + v + 2. Let g(s) = -5s*2 + s. Let j(c) = 6c*2 - 2c - 1. Let k(u) = -5g(u) - 4j(u). What is -2k(a) + 5p(a)? 3a2 - a + 2 Let d(b) be the first derivative of 3b*2/2 + 2b - 6. Let l(f) = -7f - 5. Suppose 3z - 2h + 6 + 15 = 0, 5h = 15. Determine zd(g) - 2l(g). -g Let j(i) = -i3 - i2 - 5i + 2. Let c(f) = f3 + 2f*2 + 7f - 3. Let v(g) = -5c(g) - 7j(g). Let r(q) = -q3 + q2. Determine -3r(n) - v(n). n3 - 1 Suppose 5j = -k + 29, 0j = -5k - 4j + 61. Suppose -k = r - 1. Let m(x) = 2x*3 + 8x2 - 14. Let o(u) = u3 + 3u2 - 5. Calculate ro(p) + 3m(p). -2p*3 - 2 Let z(f) = -f + 1. Let n be ((-12)/(-15))/(2/50). Let t(j) = -6j + 5. Calculate nz(k) - 4t(k). 4k Let c(b) = 9b - 21. Let n(o) = -5o + 11. Give -4c(l) - 7n(l). -l + 7 Let c(g) = -3g + 2. Suppose -3u - 21 = -3. Let o(a) = 4a - 2. Determine uc(l) - 4o(l). 2l - 4 Let d(k) = 4k. Let f(n) = 5*n. Let p = -5 + 10. Determi	{ "pile_set_name": "DM Mathematics" }
m + 177m - 948 = -27m. Solve -4/5v*5 + 188/5v*2 + 64v - 256/5 + 68/5v4 - 316/5v*m = 0. -1, 1, 8 Let h = -1009 - -991. Let q be (h/30)/(27/(-90)). Factor 64/3 - 16k + 4kq - 1/3k3. -(k - 4)3/3 Let d(n) = 3n3 - 2n + 1. Let h be d(1). Factor 194 + 2uh + 2u - 10u - u2 - 203. (u - 9)(u + 1) Factor -1096/7g - 75076/7 - 4/7g*2. -4(g + 137)*2/7 Let u be 5/(20/16) - 1. Factor 7w*u + 6w*3 - 4w - 16w3 + 4w*3. w(w - 2)(w + 2) Let r(d) be the first derivative of d6/6 - 4d*5/5 - 3d*4/4 + 34d*3/3 - 26d*2 + 24d + 3591. Factor r(s). (s - 2)*3(s - 1)(s + 3) Let r be (2/3)/((-16)/(-504)). What is n in -10n*3 + 6n*4 + 21n - rn3 - 12 - 41n*5 + 44n*5 + 7n*3 + 6n*2 = 0? -4, -1, 1 Factor -12b + 10/3b4 + 0 - 13/3b*3 - 20b*2 - 1/3b*5. -b(b - 6)*2(b + 1)*2/3 Suppose -16 = -4o, 75o - 70o - 23 = -z. Let p(r) = 5 - 3 - 3 - r*2 + 5r*3 + 3r + 2. Let a(j) = -4j3 - 2j. Let u(d) = zp(d) + 4a(d). Factor u(v). -(v - 1)(v + 1)(v + 3) Let a(s) = -3s + 58. Let o be a(21). Let j(w) = -w3 + w2 + w + 1. Let m(z) = -2z*3 + 2z*2 - z + 5. Let u(g) = oj(g) + m(g). Factor u(r). 3r(r - 2)(r + 1) Factor 1/6z*2 - 13/2z + 37/3. (z - 37)(z - 2)/6 Suppose 4g - 11 - 15 = -5x, 14 = 3x + 2g. Factor 9 + 8a + a*x - 4 + 1 - 3a. (a + 2)(a + 3) Let z(c) be the first derivative of -1/6c*3 + 9/2c + 0c2 - 18. Determine x, given that z(x) = 0. -3, 3 Let t(y) be the first derivative of -7y*6/27 + 136y*5/45 - 47y*4/6 + 104y*3/27 + 28y*2/9 + 1306. Let t(p) = 0. What is p? -2/7, 0, 1, 2, 7 Let k(d) be the second derivative of 0d*2 - 2 + 2d - 1/48d3 + 1/30d*6 - 1/80d*5 - 5/96d*4. What is i in k(i) = 0? -1/2, -1/4, 0, 1 Let p be ((-1130)/(-40))/(45/1520). Let m = p + -954. Factor 44/9i - mi2 - 242/9. -2(i - 11)*2/9 Find j such that -1/4j*2 + 267/2 + 175/4j = 0. -3, 178 Let f be 159740/2856 - 53 - (-12)/51. Find h such that 13h2 + fh*3 - 70/3h + 1/6h4 - 100/3 = 0. -10, -1, 2 Let g(j) = -5j*4 + 560j*3 + 9j*2 - 544j. Let y(l) = 70l4 - 7840l*3 - 125l*2 + 7620l. Let n(v) = 55g(v) + 4y(v). Let n(u) = 0. Calculate u. -1, 0, 1, 112 Suppose -266 = -5i + 94. Let 9 - 60l*3 + 19l*2 - 26l + 13l2 - 29 + 2l*2 + il = 0. Calculate l. -5/6, 2/5, 1 Let j = 278208/2642615 - 2/139085. Factor -32/19p + 128/19 + jp*2. 2(p - 8)2/19 Let x(y) be the third derivative of y5/90 - 17y4/4 - 310y*3/9 + 712y*2. Solve x(g) = 0 for g. -2, 155 Let a be ((-1464)/(-9))/8 - 2/(-3). Let n be 6/(-7) + 60/a. Factor -3/2y*n - 3y - 3/2. -3(y + 1)2/2 Let b(r) be the first derivative of -10r - 3 + 11/3r4 + 0r*2 + 4/3r*3 + 9/5r5. Let h(a) be the first derivative of b(a). Solve h(p) = 0. -1, -2/9, 0 Let s = -10 - -5. Let p(b) = b3 + 3b5 + 5 - 43b*3 + 40b3 - b4. Let o(i) = i4 - i3 + 1. Let n(z) = so(z) + p(z). Factor n(f). 3f*3(f - 1)*2 Let q(a) = 12a*2 + 57a - 84. Let z(d) = 3d2 + 14d - 20. Let l(b) = 5q(b) - 21z(b). Factor l(c). -3c(c + 3) Factor 0w3 + 53205w - 53575w - 440 - 104w*2 + 19w*2 - 5w*3. -5(w + 2)(w + 4)(w + 11) Let i = 136222 + -136222. Let x be (-154)/(-70) + (-1)/5. Determine k, given that ik + 2/11 - 2/11k*x = 0. -1, 1 Let d(g) be the first derivative of 1/80g*5 + 0g*2 + 1/720g*6 + 17/3g*3 + 0g - 1/12g4 + 15. Let l(n) be the third derivative of d(n). Factor l(h). (h - 1)(h + 4)/2 Let q be (-2)/(-4) + 183(-3)/(-18). Suppose 4c - 20 = -12. Factor -8 + o*3 + 2o - qo2 - o4 - 6o + 37oc. -(o - 2)2(o + 1)(o + 2) Let t(a) be the third derivative of a7/1890 - 25a*6/72 - 377a*5/180 - 1133a*4/216 - 7a*3 + 7a*2 - 3a - 4. Solve t(w) = 0 for w. -1, 378 Determine t, given that -2t4 + 3t*2 - 11t*4 + 7t*3 - 1 + 12t*4 - 13 - 19t = 0. -1, 2, 7 Let v be 80/(-32) - (-162)/4. Let s be -6(-4)/(-24) + v/14. Factor -12/7g - s - 3/7g2. -3(g + 2)*2/7 Factor -201u + 200 - 286u - 26u*3 + 640u*2 + 5u*5 + 176u - 304u - 204u*3. 5(u - 5)(u - 1)3(u + 8) Let y be 42/(-6) + (-2098)/(-238). Let j = -9/17 + y. Solve -3/7n2 - 6/7 - jn = 0 for n. -2, -1 Let d be ((7 + -2)/55)/(6/999). Let y(h) be the second derivative of 3/2h*2 - dh*3 + 1/20h*5 + 0 - 1/4h*4 - 5h. Factor y(p). (p - 3)(p - 1)(p + 1) Factor 9h3 + 116h - 1/2h4 - 72 - 105/2h*2. -(h - 9)(h - 4)*2(h - 1)/2 Suppose 2k + 5 = 4k + 3z, 0 = -3k + 5z + 17. Let 15i*2 - 14i*k - 14i - 17i4 + 10i*3 + 20 - 26i + 26i4 = 0. What is i? -2, 1, 2 Let w(v) be the third derivative of 1/48v*5 + 0v + 1/1344v8 + 0v*3 - 1/840v*7 - 1/48v*4 - 1/160v*6 + 0 + 36v*2. Find x such that w(x) = 0. -2, 0, 1 Let g(a) = -10a*4 - a - 5. Let h(u) = -69u*4 + 56u*3 + 528u*2 - 7u - 35. Let b(t) = 35g(t) - 5h(t). Factor b(l). -5l2(l + 12)(l + 44) Factor -16/9h*3 - 40/9h - 44/9h2 - 4/3. -4(h + 1)*2(4h + 3)/9 Let y(n) = -2n*2 + 41n - 22. Let l be y(17). Factor 54h - 5h*3 - lh - 60h2 + 43h. -5h2(h + 12) Factor 16/17l4 + 96/17l*2 - 88/17l*3 + 0l + 2/17l5 + 0. 2l*2(l - 2)*2(l + 12)/17 Let h(p) be the third derivative of p*8/2352 - 3p*7/490 - 3p*6/35 + 41p*5/15 - 28p*4 + 1056p*3/7 - 3209p*2. What is l in h(l) = 0? -11, 4, 6 Suppose 5h + 51 = 3l, 14h - 12h = -4l + 94. Let z(b) be the first derivative of -7/2b2 + l - 1/3b*3 - 6b. Solve z(y) = 0 for y. -6, -1 Let a(z) = -8z4 - 5z*3 - 14z*2 - 24z. Let t(l) = 5l4 + 3l*3 + 14l*2 + 24l. Let j(u) = 2a(u) + 3t(u). Determine s, given that j(s) = 0. -3, -2, 0, 4 Let s(f) be the first derivative of -3f3 - 165f*2/8 + 75f/4 + 353. Solve s(d) = 0 for d. -5, 5/12 Let q(y) be the second derivative of 3y5/10 + y4/6 - 4y*3 - 4y*2 - 742y - 2. Find l such that q(l) = 0. -2, -1/3, 2 Let l(r) be the third derivative of 0r + 3 + 31/4r*4 - 1/40r*5 - 961r*3 - 12r*2. Determine t so that l(t) = 0. 62 Let s be ((-3)/570)/((-201)/92460). Determine u so that -6/19u*2 - 28/19 + su = 0. 2/3, 7 Let c = 797 + -777. Factor -31n2 + 116n*3 - c + 111n*3 + 4 - 230n*3 - 58n. -(n + 2)(n + 8)(3n + 1) Solve -32i + 92/3i2 + 4/3 = 0. 1/23, 1 Let x(y) be the first derivative of -15/2y*4 + 20 + 8y*5 - 40/3y*3 + 35/2y*2 + 0y - 5/6y6. What is i in x(i) = 0? -1, 0, 1, 7 Let t(v) = -6v*5 + 12v*4 + 21v*3 - 9v. Let u be (-3)/(-6)(7 - 5). Let m(k) = -k5 + k3 - k. Let n(p) = ut(p) - 9m(p). Factor n(o). 3o*3(o + 2)2 Let q(i) be the third derivative of i6/60 - 79i5/30 - 20i*4/3 - 11429i*2. Let q(w) = 0. What is w? -1, 0, 80 Let s be (594/264)/((-30)/(-8)). Let n = s + -1/35. Determine c, given that 4/7c*5 - 4/7c*3 + 0 - nc*4 + 0c + 4/7c2 = 0. -1, 0, 1 Let z(x) be the first derivative of -2x*5/25 + 72x*4/5 - 8446x*3/15 - 71292x*2/5 - 133848x/5 - 6059. Let z(n) = 0. Calculate n. -11, -1, 78 Let l(r) be the third derivative of -r*6/60 - 11r*5/30 + 25r*4/12 - 13r*3/3 - 57r2 + 12. Let l(y) = 0. What is y? -13, 1 Let o(v) = v3 - 3v2 - 46v + 138. Let g be o(3). What is j in 10/7j3 - 4j*2 + 0j + g + 2/7j4 = 0? -7, 0, 2 Let m(a) = a3 - a2 - 3a + 4. Let z be m(4). Let v be 34/(-289) - z/(-51). Solve 2/3 + 0n2 - 4/3n*3 + 4/3n - vn4 = 0. -1, 1 Let m(g) be the third derivative of -1/160g*5 - 41/64g*4 - 2g*2 - 5/2g*3 + 0g - 49. Find n, given that m(n) = 0. -40, -1 Let s(k) be the second derivative of -8k2 - 13 + 1/3k*3 + 4/3k*4 - 1/10k*5 + k. Let s(g) = 0. Calculate g. -1, 1, 8 Let h(x) = -8x*2 + 23x + 28. Let w(y) = -y*2 - 3y - 5. Let o(k) = k*2 + k + 2. Let r(j) = 2o(j) + w(j). Let p(s) = -h(s) - 3r(s). Factor p(m). 5(m - 5)(m + 1) Let d be (-10 + 8)(-3 + (-1)/(-2)). Let j(v) be the second derivative of 1/10v6 - 1/4v*4 + 0v*2 + 14v + 3/2v3 + 0 - 9/20v*d. Solve j(z) = 0. -1, 0, 1, 3 Suppose 0 = 4m + 4x - x - 20, 0 = -4m + x + 4. Suppose y - 2 + 12 = 3j, m = j - y. Solve -10b*2 + 5b*4 + 20 + 60b - 30 - jb3 - 11b*3 - 30 = 0. -2, 1, 2 Let i = 43 - 38. Suppose 4a = -3n + 106, 3n + 0n - ia = 151. Solve 54s2 + ns*2 + 5s*4 - 20 - 81s*2 + 20s - 20s*3 = 0 for s	{ "pile_set_name": "DM Mathematics" }
y for y. 58 Solve -65u - 18944u + 1994496 = -535u + 2302u for u. 96 Solve 0 = -19159i + 19064i - 2755 for i. -29 Solve -103x + 531 = -81x - 63 for x. 27 Solve 520n - 121345 - 59543 = 2317n - 2985 for n. -99 Solve 0 = -2825b + 280b + 239230 for b. 94 Solve -192w - 1591 = 12256 - 1559 for w. -64 Solve 827t = 783t + 2684 for t. 61 Solve 663o + 218 - 9164 = 10281 for o. 29 Solve -32139281g = -32138976g - 22265 for g. 73 Solve -88292a = -87982a - 32240 for a. 104 Solve 0 = 30514c - 29113c - 47634 for c. 34 Solve -170066b + 170025b + 3731 = 0 for b. 91 Solve 0 = 239a - 27 - 9772 for a. 41 Solve -30y + 33y = -128y - 34y - 9900 for y. -60 Solve -1721h - 60582 = 1950h - 1037h for h. -23 Solve 13588055q - 13588121q - 7656 = 0 for q. -116 Solve -1253 - 1189 + 3798 = 2j + 1256 for j. 50 Solve 2808 = -672h + 18264 for h. 23 Solve -999m - 593m - 24857 = 22903 for m. -30 Solve -11512d = -11979d + 8615 - 37569 for d. -62 Solve -788w - 4392 = -172w + 7928 for w. -20 Solve 219r + 6115 + 2422 = -240r - 4315 for r. -28 Solve 2420 = -37y - 1613 for y. -109 Solve 7213 = -148m - 441 - 338 for m. -54 Solve -418i - 195072 = -210120 for i. 36 Solve -3483s + 6952s = 3488s + 1501 for s. -79 Solve 58h - 586 + 3081 = -4291 for h. -117 Solve -1229 = -3i + 27i - 629 for i. -25 Solve -6925k = 4833k + 3179k - 1717755 for k. 115 Solve 1552m - 2644 + 354 = 1529m - 174 for m. 92 Solve 1025 = 12815f - 12856f for f. -25 Solve 127p = -61p - 63p + 93p + 4898 for p. 31 Solve 0 = -1086v + 1813 + 23172 + 16283 for v. 38 Solve 6310 = 769o - 175o + 8039 + 20249 for o. -37 Solve -46446 = 620l + 81l - 3685 for l. -61 Solve -141w - 3243514 = -3256345 for w. 91 Solve 17904 = 4146m + 256045 - 14257 for m. -54 Solve -702n = -23642 + 476 for n. 33 Solve 11g = 81g + 104g + 4872 for g. -28 Solve 1598g - 52922 - 39078 = -702g for g. 40 Solve -2112z - 5936 = 171472 for z. -84 Solve -861s - 468 = 25362 for s. -30 Solve -28f - 63f - 2016 = 61f - 7336 for f. 35 Solve 10236t = 10127t + 3597 for t. 33 Solve 251g + 811 + 1448 = 0 for g. -9 Solve 5g = -22g - 21g - 0g + 144 for g. 3 Solve -333i + 1345 = -126 + 12793 for i. -34 Solve 1374o - 8464 = 20390 for o. 21 Solve -18754b - 1680 = -18859b for b. 16 Solve 41397 = -549w + 50730 for w. 17 Solve 679 = 223d - 3628 - 5951 for d. 46 Solve 0 = 45v + 2686 - 616 for v. -46 Solve 404k + 31k - 23121 = 68k for k. 63 Solve 6 - 170 = 6b - 27b + 214 for b. 18 Solve -14851k + 48618 + 9461 + 97537 = -7745 for k. 11 Solve -63o - 12o + 9312 = 47o - 2522 for o. 97 Solve 1004z - 9944 - 1382 - 39714 = 124z for z. 58 Solve 8528 + 204 = -148k for k. -59 Solve 1692 = 160x - 3428 for x. 32 Solve 236 = 176i - 448 - 737 + 13 for i. 8 Solve 1883m + 55972 = -2041m - 18584 for m. -19 Solve -2520l + 11000 = -2270l for l. 44 Solve 2922 = 673l + 11275 + 6291 + 1508 for l. -24 Solve -13728 = -55f - 13838 for f. -2 Solve 7979 = 9o - 17o + 7779 for o. -25 Solve 130p = 3083 + 4327 for p. 57 Solve -1234x + 706 = -4347 - 3585 for x. 7 Solve 4420m + 935 = 5355m for m. 1 Solve -132q + 427q = 647 - 1412 + 9615 for q. 30 Solve 30h + 21324 - 18656 = -16h for h. -58 Solve 2377 + 1238 = -37n + 174 for n. -93 Solve -3747 + 22499 + 24304 = 936m for m. 46 Solve -1356 = 21i + 19i + 859 + 265 for i. -62 Solve 7151n = -21103 - 708299 for n. -102 Solve 2631 = 3172p + 4226p - 2755 - 2012 for p. 1 Solve 14543t - 137186 = -5055t for t. 7 Solve 189h - 92h - 2312 = 386h for h. -8 Solve 14546 = 278p + 2036 for p. 45 Solve 428w + 15104 - 1367 = -7663 for w. -50 Solve 249372a = 249434a + 992 for a. -16 Solve 73z - 2776 = -1827 for z. 13 Solve -54b - 21888 = 161b + 72b - 6103 for b. -55 Solve 5432i + 889i = -2908i - 36916 for i. -4 Solve -15n - 271n - 8160 = 54n for n. -24 Solve -125u = 119u + 317 - 7393 for u. 29 Solve 2438 = 1468w - 1230 - 2204 for w. 4 Solve 971n = 110n - 5289 + 28904 + 8242 for n. 37 Solve 1240v - 327v = -60272 - 29202 for v. -98 Solve 256v + 235v = 421v + 7140 for v. 102 Solve -202r + 192r + 540r + 20776 + 2014 = 0 for r. -43 Solve -499 - 1886 = 178t - 112t - 119t for t. 45 Solve 0 = 8946i - 9704i - 6064 for i. -8 Solve 27z - 865 = 57z + 925 + 100 for z. -63 Solve -416t + 1225 = -855 for t. 5 Solve -564 = 53q + 3331 - 6598 for q. 51 Solve -7591 + 68963 + 167045 = -3129h for h. -73 Solve -2138l = -2633l - 9900 for l. -20 Solve 0 = 138r + 5967 - 339 + 1410 for r. -51 Solve 1127 + 1082 = -29y + 1060 - 243 for y. -48 Solve 71p = -83p + 481p - 184p - 9152 for p. 64 Solve 1156w + 99731 = 122851 for w. 20 Solve 3250h + 2616h - 1695h + 2923h = -482392 for h. -68 Solve 4035s - 944 = 4507s for s. -2 Solve -150 + 4940 + 568 = -281t - 1386 for t. -24 Solve 185b = 3037b + 142600 for b. -50 Solve -258 = 155x - 897 + 4514 for x. -25 Solve 1432223u - 84 = 1432219u for u. 21 Solve 34b - 377 = 745 for b. 33 Solve 52056 = -213d + 335d + 842d for d. 54 Solve 48m + 2820 = 589 + 263 for m. -41 Solve -2767b - 104723 + 6101 = -14721 + 79352 for b. -59 Solve 10j = 340j + 190j - 53j - 7939 for j. 17 Solve 1133y + 764y + 130944 = 49373 for y. -43 Solve 221c = -1193c + 12726 for c. 9 Solve -6224t - 16 - 30 = -6223t for t. -46 Solve 91g - 87g + 2500 = -72g - 616 for g. -41 Solve 316091 = -17k + 315649 for k. -26 Solve 460q - 18q + 246 - 16158 = 0 for q. 36 Solve 79a + 157a - 8652 = 46a - 16a for a. 42 Solve -44q + 229223 = 228695 for q. 12 Solve -98x - 370x + 54x + 11716 = 124 for x. 28 Solve 0 = 382g + 519 + 1454 + 2120 - 1037 for g. -8 Solve 173h = 212 - 14398 for h. -82 Solve 78386 - 22902 = -1067d for d. -52 Solve 2076u - 780u + 19806 + 76890 = -1390u for u. -36 Solve -135b = 374 - 873 - 1393 - 1078 for b. 22 Solve -106c - 131c = 75c + 2808 for c. -9 Solve 2691 + 25667 = 763n + 13896 - 23688 for n. 50 Solve -61616 = 43759u - 41718u + 48598 for u. -54 Solve 2631p + 1326p = 63312 for p. 16 Solve 1078 = -242r + 2288 for r. 5 Solve 23936c - 24102c = 1328 for c. -8 Solve 115g - 187 + 6778 = -54g for g. -39 Solve 77748 = -120v + 80628 for v. 24 Solve 252h - 1458h = -16884 for h. 14 Solve -111z - 2470 = 638 for z. -28 Solve 0 = 95663a - 95750a + 2262 for a. 26 Solve -243680 = 117p - 246722 for p. 26 Solve -72x + 173x = 68x - 66 for x. -2 Solve 142x - 226 + 665 + 271 = 0 for x. -5 Solve 446145 = 6085o + 3020o for o. 49 Solve 555r + 239 = -5941 - 2700 for r. -16 Solve -2014x - 1090 + 3693 = -3439 for x. 3 Solve 116a - 99a - 3402 = -109a for a. 27 Solve 432g = -385g + 19909 + 4975 + 3711 for g. 35 Solve -132070 + 130214 = -93a + 35a for a. 32 Solve 487n + 46491 - 8929 + 7729 = 0 for n. -93 Solve -373067 - 58366 = 10503o + 232384 - 75649 for o. -56 Solve -17210000 = -93m - 17210093 for m. -1 Solve 532c = -204c - 449c + 414c - 94833 for c. -123 Solve 2055c + 7541 = 1999c + 2725 for c. -86 Solve 106d + 4095 + 51649 = -1636d for d. -32 Solve -5643n - 7171n - 13715n - 212232 = 0 for n. -8 Solve 0 = 423o + 70672 - 113818 for o. 102 Solve -8393 - 29931 = 871y for y. -44 Solve 15539o + 779005 = -790434 for o. -101 Solve -3129 - 4876 = -303b + 23204 for b. 103 Solve -20496 = -231k - 2331k for k. 8 Solve 5405m - 397602 = 261m - 229m for m. 74 Solve 24r - 13195485 + 13197045 = 0 for r. -65 Solve 788o + 61159 + 134951 = -1500o + 40526 for o. -68 Solve 413163 = 1040m + 1918m + 1791m for m. 87 Solve 342c = 743c + 19248 for c. -48 Solve -353k - 28k - 27440 = 158k + 441k for k. -28 Solve 6657u - 4864u = -71720 for u. -40 Solve 40793 + 104297 - 7980 + 86498 = 3388d for d. 66 Solve -8327o - 597040 - 360565 = 0 for o. -115 Solve 550s - 463s + 93906 = 639s + 2926s for s. 27 Solve -303a = -728a + 183a + 12342 for a. 51 Solve -723r + 202r = 360r + 11082 - 3153 for r. -9 Solve -61l + 68l = -231l + 4046 for l. 17 Solve 64 = -262j + 11068 for j. 42 Solve -3480c = -3586c + 5724 for c. 54 Solve 3744452 = 1174i + 3737408 for i. 6 Solve 4940h + 62489 = 4387h for h. -113 Solve -1430l + 91908 = -188l for l. 74 Solve 0 = 2038y - 57141 - 97747 for y. 76 Solve 0 = 1164l - 5359 - 1625 for l. 6 Solve 105h = 97h - 354*h + 9774 for h.	{ "pile_set_name": "DM Mathematics" }
ne q(5). 1220 Let u(x) = -117x - 8432. What is u(-52)? -2348 Let g(z) = -12z + 790. Calculate g(20). 550 Let p(i) = 2i3 + 1138i - 2291. What is p(2)? 1 Let y(p) = 45p2 - 2862p + 2862. Calculate y(1). 45 Let m(b) = 69b + 2524. What is m(-23)? 937 Let h(l) = -12l*2 - 204l + 2126. Calculate h(8). -274 Let a(w) = 17w2 + 445w - 2554. Determine a(6). 728 Let y(h) = 49h3 + 47h*2 + 10h - 36. Give y(-1). -48 Let o(q) = 19q2 - 546q + 1011. Calculate o(23). -1496 Let f(a) = 7a2 - 175a + 1557. Give f(12). 465 Let p(g) = 12g2 + 1163g - 46. Determine p(-97). 51 Let f(d) = -d*3 + 148d*2 - 2692d + 519. Give f(21). -6 Let q(a) = -4a3 + 628a*2 + 63. Calculate q(157). 63 Let y(r) = -47777r + 286667. Determine y(6). 5 Let v(t) = -529429t + 4764867. Calculate v(9). 6 Let x(i) = -3i*2 + 199i - 2658. Determine x(32). 638 Let t(z) = -1166z + 183. Determine t(2). -2149 Let k(f) = -92f*2 - 491f + 17. Calculate k(-6). -349 Let p(h) = -32402h + 56638690. Determine p(1748). -6 Let c(h) = -6h*2 - 1958h - 114519. Give c(-250). -19 Let q(l) = -6345l + 602793. Determine q(95). 18 Let g(x) = 110602x + 110588. What is g(-1)? -14 Let l(o) = o*2 - 263051o - 2367559. What is l(-9)? -19 Let u(v) = -74v + 177. Calculate u(-24). 1953 Let k(t) = 2t*2 + 15269t - 244816. Determine k(16). 0 Let x(r) = 15r3 - 7855r*2 - 2618r - 1013. What is x(524)? 35 Let t(l) = -l*3 - 124l*2 + 510l - 323. Calculate t(-128). -67 Let f(u) = -3u3 - 20u*2 + 556u + 2336. Calculate f(-4). -16 Let o(n) = 23n2 + 15657n + 11573. Determine o(-680). 13 Let c(v) = 1379v + 18141. Calculate c(-13). 214 Let s(h) = -3h*2 - 397609h + 6760213. Determine s(17). -7 Let l(t) = t*3 + 23t*2 - 1009t - 819. Determine l(-45). 36 Let q(m) = 3572m + 310784. Calculate q(-87). 20 Let a(f) = -315175f - 945634. Calculate a(-3). -109 Let a(s) = -935s + 59838. What is a(64)? -2 Let b(a) = -842a - 2541. Calculate b(-3). -15 Let p(q) = 19q2 - 2733. Give p(-12). 3 Let x(m) = -25m*2 + 72m - 281. What is x(4)? -393 Let x(v) = -13v2 - 600v - 1302. Determine x(-43). 461 Let r(x) = -x*3 + 41x*2 - 971x + 45463. Determine r(43). 12 Let r(d) = -3d3 + 3d*2 + 82d + 35. Give r(6). -13 Let f(t) = -2t3 - 2t*2 + 4196t + 18. Calculate f(0). 18 Let f(b) = -6b3 + 58b*2 - 156b + 22. Determine f(9). -1058 Let k(j) = -j*3 + 24j*2 + 554j - 467. Determine k(-15). -2 Let f(p) = p*3 - 22p*2 + 40p - 486. Determine f(13). -1487 Let k(n) = -n*3 + 38n*2 - 29n - 2604. Give k(35). 56 Let u(f) = -24f2 - 1434f + 9909. Determine u(-66). 9 Let p(y) = 126072y + 2. What is p(0)? 2 Let j(a) = a3 - 172a*2 + 7a - 1840. Give j(172). -636 Let i(b) = -5b2 - 142b + 7793. Determine i(38). -4823 Let d(m) = -29m2 - 274m + 2. Give d(-12). -886 Let r(y) = -479y - 2008. Calculate r(-4). -92 Let t(n) = 19n*3 + 71n*2 + 37n - 207. Calculate t(-2). -149 Let m(r) = 29250r - 87721. What is m(3)? 29 Let j(v) = 161v - 10080. What is j(51)? -1869 Let k(p) = 5p3 + 64p*2 - 52p - 16. Calculate k(-14). -464 Let k(j) = -739568j + 4437404. Calculate k(6). -4 Let k(d) = -386d - 1315. Calculate k(-4). 229 Let x(s) = -s*2 - 257s + 357433. Give x(483). 13 Let j(k) = -16k2 + 4971k - 51295. Calculate j(300). 5 Let a(i) = -441i + 3774. Determine a(6). 1128 Let b(j) = 9314j - 4675670. Give b(502). -42 Let c(n) = -1256n + 375547. Give c(299). 3 Let f(l) = -289l*2 + 1741l - 9. What is f(6)? 33 Let n(q) = -2q2 + 3491q - 13941. Determine n(4). -9 Let d(j) = 136j2 - 6187j + 32232. Determine d(6). 6 Let t(n) = -14n3 + 740n*2 - 630n + 336. Calculate t(52). 24 Let u(v) = -2v3 - 208v*2 - 5273v + 380. Calculate u(-44). 72 Let s(q) = q*2 + 161q - 9291. Calculate s(54). 2319 Let r(u) = 6630u - 79583. Calculate r(12). -23 Let g(x) = x3 + 571x*2 + 4x - 73. Determine g(0). -73 Let c(s) = -2s2 + 166s - 2064. Calculate c(58). 836 Let b(f) = -163939f - 655745. Calculate b(-4). 11 Let r(g) = -3g*2 - 1602g - 14164. Determine r(-9). 11 Let w(m) = -m*3 - 84m*2 + 4632m + 408. Give w(-122). 896 Let l(i) = 2i3 - 6i*2 - 74i + 118. What is l(9)? 424 Let p(z) = 2625z2 - 167999z - 67. Calculate p(64). -3 Let s(t) = 1876t + 89. Calculate s(0). 89 Let g(u) = u2 - 26501u + 79500. Give g(3). 6 Let l(m) = 9m2 + 10932m + 295575. Calculate l(-1187). 12 Let f(k) = -4k3 + 33k*2 - 22k - 14. Give f(7). 77 Let x(q) = -792461q - 44377812. Give x(-56). 4 Let s(f) = -20710f - 28704049. What is s(-1386)? 11 Let l(n) = n*3 - 109n*2 - 802n + 65. Calculate l(-7). -5 Let c(d) = 448d - 12552. Give c(28). -8 Let i(o) = o2 + 827o + 67630. What is i(-92)? 10 Let o(k) = -6k3 + 438k*2 - 4389k - 144. Calculate o(61). 39 Let i(h) = -h*2 - 5542h + 279646. Give i(50). 46 Let z(k) = -k*2 + 94k + 2144. What is z(118)? -688 Let t(w) = 4w2 + 19w + 639. What is t(-25)? 2664 Let m(y) = 467y - 17347. What is m(37)? -68 Let k(o) = 8o*2 - 125o - 938. Determine k(28). 1834 Let k(l) = -7l3 - 1536l*2 - 659l - 244. Give k(-219). 194 Let n(i) = 47593i - 55017511. What is n(1156)? -3 Let q(m) = m3 + 18m*2 + 89m + 1285. Calculate q(-13). 973 Let c(k) = k*2 + 35619k - 641359. Calculate c(18). 107 Let z(s) = 12704s + 63467. What is z(-5)? -53 Let m(x) = 1362763x + 1362761. Give m(-1). -2 Let c(t) = -2t3 - 159t*2 - 906t - 65331. Determine c(-79). 2 Let i(g) = 357g + 20445. Calculate i(-57). 96 Let t(u) = 10u*3 - 1370u*2 + 4u - 347. What is t(137)? 201 Let s(y) = 1213y - 3705. Calculate s(3). -66 Let b(u) = -3910u - 148417. What is b(-38)? 163 Let h(i) = 58i - 3763. Calculate h(40). -1443 Let i(f) = 110f - 2906. Determine i(24). -266 Let o(x) = 343x - 59061. Calculate o(157). -5210 Let q(d) = d2 - 45d + 443. Calculate q(29). -21 Let m(z) = z*3 + 26z*2 - 312z - 8351. What is m(-25)? 74 Let y(v) = 15400v - 61971. What is y(4)? -371 Let o(b) = 148b*2 + 654b + 52. Determine o(-4). -196 Let j(a) = 10a3 + 134a*2 + 256a - 12. Calculate j(-11). 76 Let n(q) = -q*2 + 2375q + 1498557. Determine n(-518). -17 Let j(g) = -2202g + 880795. Give j(400). -5 Let t(m) = -m2 + 142m - 1211. Give t(10). 109 Let v(i) = -4603i + 9910. Calculate v(2). 704 Let v(j) = 18j*3 - 302j*2 - 75j + 101. Calculate v(17). -18 Let g(y) = -y*3 - 198y*2 - 3720y + 557. Give g(-177). 1088 Let l(w) = -214w + 4333. Determine l(7). 2835 Let b(w) = -w3 + 406w*2 + 404w + 1276. Determine b(407). 55 Let w(f) = -431f2 + 13368f - 272. Calculate w(31). -55 Let w(s) = -s*2 + 154s + 8014. What is w(-41)? 19 Let f(i) = i*3 - 24i*2 + 82i + 31. Determine f(5). -34 Let q(m) = m*2 - 560m + 71359. Determine q(194). 355 Let k(z) = 4z3 + 49z*2 - 22z - 352. Calculate k(-12). 56 Let b(f) = -2319f - 11419. Give b(-5). 176 Let n(s) = 5s*2 + 4370s + 314032. Calculate n(-795). 7 Let l(g) = -32183g - 64816564. Determine l(-2014). -2 Let z(a) = -a3 - 87a*2 + 64a - 2152. What is z(-88)? -40 Let k(g) = -g*2 - 782g - 103871. What is k(-169)? -274 Let i(x) = -2260x - 65698. Determine i(-29). -158 Let f(v) = -344v + 767. Determine f(-4). 2143 Let t(l) = -6181l + 86669. Determine t(14). 135 Let p(j) = 499189j + 2995136. Calculate p(-6). 2 Let v(z) = 65z3 + 123z*2 + 120z - 3. What is v(-1)? -65 Let o(r) = r*3 - 93r*2 - 928r + 61404. Calculate o(96). -36 Let x(c) = 13c2 - 56c + 147. Determine x(6). 279 Let w(i) = -3i3 + 78i*2 + 700i + 54. Calculate w(-7). 5 Let n(d) = -d*3 - 9d*2 + 34d + 367. What is n(-10)? 127 Let f(l) = l*3 - 786l*2 - 2346l + 28. Give f(-3). -35 Let w(i) = 1603i - 8519. Calculate w(9). 5908 Let p(c) = c2 + 22709c + 136194. Determine p(-6). -24 Let t(d) = -d*3 - 114d*2 + 114d - 118. What is t(-115)? -3 Let j(w) = -23w2 + 65w + 578. Give j(-6). -640 Let i(j) = 237825j - 951293. Calculate i(4). 7 Let a(l) = -4l*3 + 181l*2 - 980l + 303. Give a(39). 108 Let s(p) = p*3 - 71p*2 - 302p + 760. Determine s(75). 610 Let x(b) = -b*3 - 83b*2 + 242b + 19815. Give x(-83). -271 Let r(c) = 119c - 8691. What is r(73)? -4 Let d(s) = -s2 - 39991s - 3790106. Determine d(-95). 14 Let z(v) = v*3 - 26v*2 - 196v + 63. Calculat	{ "pile_set_name": "DM Mathematics" }
ine -3l(q) + 24s(q). 3q Let z(y) = -58y*2 + 9y. Let w(k) = 5626k2 - 870k. What is 3w(p) + 290z(p)? 58p2 Let v(b) = b - 1. Let x = -144 + 143. Let h(o) = 3o - 2. Calculate xv(w) + h(w). 2w - 1 Let w(n) = 5n3 + 4n2 + 1. Let h(m) = -m3 - m*2 - 1. Let p be (11 - 14)(-2)/(-1). Give ph(k) - w(k). k3 + 2k2 + 5 Let y(i) = -i2 + 2i - 2. Let s = -67 + 69. Let j(c) = c - 3 + 0c - 198cs + 196c*2. Give -2j(f) + 3y(f). f2 + 4f Let l(g) = -2g2 + 27g - 152. Let m(o) = -o*2 + 7o - 1. Calculate -l(i) + 4m(i). -2i*2 + i + 148 Let q(z) = -6z*2 + 2z. Let p(v) = 5v2 - v. What is 2p(a) + 3q(a)? -8a*2 + 4a Let l(t) = 9t - 4. Let b(y) = -6y + 3. What is -8b(m) - 5l(m)? 3m - 4 Let s(o) = -2o*2 - 9o + 2. Let f(c) be the third derivative of c*5/60 + 5c4/24 - c3/6 - 13c2 + 2. Calculate 11f(j) + 6s(j). -j2 + j + 1 Let y(c) = 4c*2 - 6c + 94. Let t(p) = 3p2 - 4p + 62. Determine 7t(l) - 5y(l). l*2 + 2l - 36 Let g(a) = 3a2 + 3 + 15a + 16a - 34a. Let c(w) = -6w2 + 5w - 5. What is 6c(q) + 10g(q)? -6q2 Let p(z) = -5z*3 + 3z*2 - 2z. Let h be p(1). Let k(b) = 5b + 0b + 9b3 - 3b3. Let r(d) = d3 + d. Calculate hr(i) + k(i). 2i*3 + i Let m(k) = -31 + 6 + 24 + 3. Let r(o) = o - 2. Calculate 2m(x) + 3r(x). 3x - 2 Let m(k) = -8k3 + 15k*2 + 2k - 3. Let l(g) = -11g3 + 15g*2 + g - 2. What is -3l(j) + 2m(j)? 17j*3 - 15j2 + j Let y(f) be the first derivative of -f4/2 + 2f3/3 - 2f*2 - 1540. Let m(v) = -3v*2 - v + 6v + 2v3 + 0v. Give 2m(z) + 3y(z). -2z3 - 2z Let a(w) = -9w. Let i(r) = r3 + 23r*2 - 27r - 70. Let g be i(-24). Let u(c) = 37c + 1. Calculate gu(l) + 9a(l). -7l + 2 Let s(t) = 8t2 - 2t. Let w(a) = -16a + a - 3 + 9a*2 + 12a + 3. Determine -6s(i) + 4w(i). -12i2 Let r(w) = 2. Let n(m) = 82m - 1. Calculate -n(u) - r(u). -82u - 1 Suppose -4x + n - 9 = 15, 0 = 3x - 3n + 27. Let b(r) = 7r3 - 2r*2 + 2. Let j(f) = 15f*3 - 5f*2 + 5. Calculate xb(t) + 2j(t). -5t3 Let w(z) = -z2 + 3z - 5. Let t(n) = -3n*2 + 10n - 12. Let h be t(1). Let p(v) = v*2 - v + 3. Calculate hp(k) - 3w(k). -2k*2 - 4k Let f(p) = 8p - 12. Let d(v) = -2v + 3. Let g be (-1 + -7)/(7 - 11). Determine gf(i) + 9d(i). -2i + 3 Let j(h) = h3. Let b(g) = g + 2. Let m be b(-1). Let f(z) = -6z*3 - 3z*2 - 2. Suppose -9p = -33 - 3. Calculate mf(o) + pj(o). -2o3 - 3o*2 - 2 Let r(f) = -7f*3 - 2f2 + 6. Let b(h) = h3 - h*2 + 2. Let l(o) = 12o*3 - 2o*2 + 1. Let i(s) = 4b(s) - l(s). Determine -6i(x) + 7r(x). -x*3 - 2x*2 Let v(u) be the second derivative of 0 - 1/12u*4 + 0u*2 + 5/6u*3 - u. Let p(d) = -d - 1. Calculate -4p(c) - v(c). c*2 - c + 4 Let t(j) = 5j - 17. Let d(a) = 5a - 19. What is 7d(l) - 6t(l)? 5l - 31 Let j(p) = 7p2 - 7p + 135. Let l(i) = -8i2 + 8i - 136. What is -6j(t) - 5l(t)? -2t2 + 2t - 130 Let j(f) = -9f3 - 3f*2 + 2f + 4. Let i(a) = a3 + a2 - 5a + 2. Let l be i(-3). Let s(x) = -x3 - x2 + 1. What is lj(y) + 3s(y)? 6y*3 - 2y - 1 Let r(o) = 501o3 - 3o*2 + 3o - 6. Let q(n) = -1502n3 + 8n*2 - 8n + 16. What is -3q(h) - 8r(h)? 498h3 Let p(n) = n3 - 6n*2. Let a be p(6). Suppose -12 = -2o - a. Let b(r) = -7 + r*2 + o + 2r + r. Let x(y) = -y*2 - 2y + 1. Give -3b(k) - 4x(k). k*2 - k - 1 Let i(s) = -19s + 2. Let p(c) = -8c + 2. Calculate 2i(t) - 5p(t). 2t - 6 Let j(v) = -8v3 + 8v*2 - 7v. Let u(y) = -17y3 + 17y*2 - 15y. Let d = 225 + -212. Determine dj(a) - 6u(a). -2a3 + 2a2 - a Let i(x) be the third derivative of -x4/24 - x*3 + 17x*2 + 11x. Let d(l) = -2l - 12. Determine -6d(s) + 13i(s). -s - 6 Let p(k) = 3k*2 - 2k - 3. Let d(n) = 2n2 - 2. Calculate -4d(i) + 3p(i). i2 - 6i - 1 Let c(u) = -521u2 - 3u. Let m(y) = 3y2 + y. What is c(n) + 3m(n)? -512n2 Suppose 0 = -4g + 5h + 11, -10g + 12g = h + 1. Let s(f) = f + 4. Let b(y) = y - 1. Let v(n) = -7n + 7. Let w(d) = -6b(d) - v(d). Give gs(r) - 2w(r). -3r - 2 Let x(h) = 17h + 6. Let r(i) = -2i - 9. Let f(p) = -4p - 7. Let t(b) = -3f(b) + 2r(b). What is -13t(d) + 6x(d)? -2d - 3 Let w(r) = 21r3 - 6r*2 - 17r + 74. Let j(q) = -7q3 + 2q*2 + 6q - 26. What is -17j(d) - 6w(d)? -7d3 + 2d*2 - 2 Let s(b) = -789b - 783b + 2 + 1558b. Let d(z) = -41z + 6. What is 4d(w) - 11s(w)? -10w + 2 Let g(l) = 5 - 2 + 11l + 3 - 5l + 11l2. Let m(p) = -4p*2 - 2p - 7. Let h(a) = 1. Let r = -21 - -22. Let d(b) = rm(b) + 5h(b). Give -8d(n) - 3g(n). -n*2 - 2n - 2 Let b(h) = 1. Suppose -29j - 33j + 62 = 0. Let f(i) = i + 10. Calculate jf(m) - 6b(m). m + 4 Let j(n) = 10n3 + 97n + 4. Let f(r) = 8r3 + 97r + 3. What is 4f(b) - 3j(b)? 2b3 + 97b Let m be (-24)/324 + (400/108)/(-4). Let f(j) = j2 + j + 1. Let i(h) = h3 + h*2 - 10h + 1. What is mi(u) + f(u)? -u3 + 11u Let k(t) = 1. Let u(r) = -2. Let p(m) = -4m - 6. Let i(f) = -p(f) + 6u(f). What is 2i(x) + 12k(x)? 8x Suppose -4l = -3f - 871, 0 = -4l - 3f + 118 + 771. Let w(v) = 3v2 - 219 - v2 + l - 6v2. Let r(i) = -i2. Let a = -2 + 1. What is aw(u) + 2r(u)? 2u*2 - 1 Let d(m) = 14m - 6. Let h(c) = 127 - 125 + 6c - 9c - 2c. Give 4d(l) + 11h(l). l - 2 Let t(b) = 4b*2 + 3b + 9. Let y(k) = 6k2 + 4k + 13. Let a = 22 + -27. Determine ay(z) + 7t(z). -2z2 + z - 2 Let i(v) = -7v*3 - 11v*2 - 17v - 8. Let b(t) = t*3 + 3t*2 + 2. Determine -5b(p) - i(p). 2p3 - 4p*2 + 17p - 2 Let k(t) = 4t3 + 33t*2 - 5t - 1. Let w(q) = -3q3 - 33q*2 + 4q. Determine -5k(l) - 6w(l). -2l3 + 33l*2 + l + 5 Let n(d) = -22825d*2 - 605. Let c(q) = 226q*2 + 6. Give -605c(h) - 6n(h). 220h*2 Let f(y) = -3y - 3. Let n(b) = 22 + 3b - 2b - 13. Let o be n(-7). Let i(r) = -3r - 4. Determine oi(x) - 3f(x). 3x + 1 Let a(u) = u3 - u2 + 7. Let d(w) = 21w3 - 2w*2 + 5w + 9. Let m(c) = -2a(c) + d(c). Let o(y) = 10y*3 + 3y - 3. Give -3m(x) + 5o(x). -7x3 Let x(y) = 4y*2 - 11y + 34. Let n(f) = 6f2 - 13f + 34. Determine -5n(h) + 6x(h). -6h2 - h + 34 Let w(g) = 3g*2 - 2g + 2. Let l(k) = -5k2 + 5k - 5. Let z be ((-4)/2)/24 - 5474/552. What is zw(s) - 4l(s)? -10s2 Let q = -23 + 26. Let j(r) = qr - 4r + 8r + 7r. Let z(i) = 5i. What is -6j(t) + 17z(t)? t Let t(q) = 0 + 6 + 3q - 5. Suppose 5v + 1 = -m - m, 0 = 4v - 3m - 13. Let k(x) = x. What is vt(b) - k(b)? 2b + 1 Let q(d) = -16d3 + 8d*2 - 23d. Let s(n) = -19n3 + 9n*2 - 23n. Determine -6q(f) + 5s(f). f*3 - 3f*2 + 23f Let f(b) = 2b - 1. Let o(y) = 0 + 0 - 1 + y + 0y. Suppose j - 4a - 9 = -7a, j - 3a = -3. Determine jf(t) - 2o(t). 4t - 1 Let a(k) = -k*3 - 2 + 7k - 20k + 422k*2 - 435k2. Let q(c) = -c3 - 6c2 - 6c - 1. Calculate -6a(f) + 13q(f). -7f3 - 1 Suppose 5i - 13 - 7 = 0. Let m = 9 - 19. Let n(x) be the third derivative of x4/24 + x3/3 + 5x2 - 37x. Let l(u) = 3u + 5. Determine il(y) + mn(y). 2y Let o(c) = 4c2 - 13c. Let p be o(3). Let m(v) = -2v2 - 5v + 9. Let s(t) = t*2 + 3t - 5. Calculate pm(j) - 5s(j). j*2 - 2 Let x(j) = 1484j - 1 + 1487j + j2 - 2972j. Let i(l) = l*2 + 4l + 4. What is i(w) + 4x(w)? 5w*2 Let y(h) = -2h + 1. Let q be 24 - 25/5 - 5. Let t(s) = -4s + 23s - qs - 4s. Suppose 4m - 7 = -15. Calculate my(u) - 6t(u). -2u - 2 Let c(f) = -f*2 - 5f + 15. Let y(p) = 8 + 17 + 36p - 22 - 37p. Determine 2c(m) - 11y(m). -2m2 + m - 3 Let p(x) = 2x*2 + 14x + 8. Let w = -171 + 179. Let k(v) = v*2 + 5v + 3. What is wk(s) - 3p(s)? 2s2 - 2s Let y(k) = -10 - 7k - 1 + k + 5 + 3k. Let f(i) = 7i + 12. Give -4f(m) - 9y(m). -m + 6 Suppose m + 4n + 9 = 0, 0 = m + m + 4n + 6. Let g(l) = 22l*3 - 8l*2 - 8l - 8. Let c(k) = 7k3 - 3k*2 - 3k - 3. Calculate mg(f) - 8c(f). 10f3 Let k(j) = j2 + j. Let q(h) = 6h*2 - 6h + 5. Let t(o) = 4o2 - 6o + 4. Let z(c) = 5q(c) - 6t(c). Give -4k(f) + z(f). 2f*2 + 2f + 1 Let k(o) = 9o + 458. Let i(g) = 6g + 305. Determine -7i(h) + 5k(h). 3h + 155 Let n(d) = d3 - 1. Let a(y) = y2 - y - 5. What is a(h) - 6n(	{ "pile_set_name": "DM Mathematics" }
/18. 36 Suppose -4p + 5c + 165 = 0, 4p - 159 = -17c + 16c. What is the lowest common multiple of p and 25? 200 Let h(k) = -3k - 14. Let n be h(-6). Let c(v) = 2v - 3. Suppose b + 3r = 2b, 3b - 3r - 6 = 0. Calculate the lowest common multiple of c(n) and b. 15 Suppose -28n + 22 = -90. What is the lowest common multiple of 25 and n? 100 Calculate the common denominator of -49/80 and (5(-34)/4)/(0 + -4). 80 Let t = -96301/18 - -5356. Suppose -2q - q = -15. Calculate the common denominator of 372/50q/(-8) and t. 180 Suppose 5s = -492 + 1582. Let n = s + -622. Find the common denominator of 85/22 and (9/6)/((-84)/n). 154 Let o = 4337/192 - -5/64. Let x = 21487 - 601261/28. Let q = 20/7 + x. What is the common denominator of o and q? 12 Let n = -42158/23 - -519059/115. Let v = n - 10735/4. Calculate the common denominator of v and -101/6. 60 Let q = -4880186 - -1190768923/244. Let h = -1/244 + q. What is the common denominator of -41/12 and h? 12 Let b = 12443/90 - 686/5. Calculate the common denominator of (1/(-4))/((-9)/(-564)) and b. 18 Let v = 444 - 381. What is the lowest common multiple of v and 8? 504 Let s be -8 - (-132 + 1) - (0 + -3). Let r = s + -115. Find the common denominator of -13/3 and r. 3 Let t = -102 + 302. Let x = t + -479/2. Calculate the common denominator of x and 121/20. 20 Suppose z - 8z + 385 = 0. Calculate the least common multiple of z and 33. 165 Let z = 63 - 57. What is the lowest common multiple of (z/8)/(3/2163) and 88? 792 Suppose 3v + 12 = l - v, -5v - 90 = -5l. Suppose -3b = 2 - l. What is the common denominator of 645/10(-4)/b and 41/3? 3 Let n = 16 + -28. What is the common denominator of n/(3 + 57/(-12)) and -53/4? 28 Suppose i - 7 = -3. What is the lowest common multiple of 14 and i? 28 Suppose 13h - 12h - 6 = 0. Suppose -4l - h = -2a, 3l + 29 = a + 4a. Calculate the lowest common multiple of 8 and a. 56 Let u = -7 - -10. Suppose -2c + 80 = uc. What is the smallest common multiple of 20/25(-50)/(-4) and c? 80 Let m = -33 - -97. Calculate the common denominator of (-9)/((-180)/m) - -2 and -97/14. 70 Let u(s) = -s3 - s2 - s + 14. Let y(x) = x*2. Let h be y(0). Suppose -29p + 25p = -40. Calculate the lowest common multiple of p and u(h). 70 Suppose -b + 32 = -30. What is the common denominator of (b/(-93))/((-10)/94) and 121/78? 390 Let y be -3 - (-1 + 1 - 2). Find the common denominator of ((-61)/9)/y - 0 and 9/33 + 36271/1518. 18 Suppose -6 = t + 4s, 9t + 3s = 4t + 4. Suppose ta = 5a - 12. What is the smallest common multiple of 4 and a? 4 Let j(n) = -7 + 4n + 2n + n. Let x(l) = -3l + 4. Let z(s) = -2j(s) - 5x(s). Calculate the smallest common multiple of 6 and z(8). 6 What is the smallest common multiple of 140 and (13/(13/28))/(4/14)? 980 Suppose 0 = -7s + 4s + 102. Suppose 2p = -z + 21 + 10, -4z + s = 3p. What is the least common multiple of 14 and p? 126 Let d(k) = -5 + 8k + 3 - 4k + 0. Suppose -3y + 4j = -1, -3j = 3y + y - 18. What is the least common multiple of 6 and d(y)? 30 Suppose -6g + g + 5 = 0. What is the common denominator of 3/2 and 5/(-36) - g - (-16)/72? 12 Calculate the common denominator of ((-5)/(-25))/((-64)/(-1500)) and 41/28. 112 Let l be ((-30)/4)/((-2)/4). Let c = l + -5. Calculate the smallest common multiple of 10 and c. 10 Suppose 4 = 4l + 4c, 2 + 1 = -3l + 3c. Suppose lp = -2p + 24. Suppose -y + n = -5, -6 = 5y - 3n - 29. Calculate the lowest common multiple of p and y. 12 Let v(q) = 2q - 86. Calculate the smallest common multiple of 276 and v(53). 1380 Calculate the common denominator of 15/(-4) - 28/7 and -21/13. 52 Let i(r) = 2r*2 + 33r + 29. What is the lowest common multiple of i(-17) and 36? 828 Let k = 31 + -40. Let v = k - -13. What is the least common multiple of v and 4? 4 Suppose -5p - v + 0v + 52 = 0, -5v = -10. Suppose 4 = -3n + p. What is the lowest common multiple of n and 4? 4 Find the common denominator of -11/60 and (-899)/(-310)(-20)/144. 360 Suppose 19y + 408 = 70y. Calculate the least common multiple of 88 and y. 88 Suppose 11h + 2o = 13h - 28, -5h - 2o = -42. Calculate the lowest common multiple of 22 and h. 110 Let c = 352 - 292. Calculate the smallest common multiple of 25 and c. 300 Let c = -1644 - -6485/4. Let l be 1318/436 + (-1 - (-2 - -4)). Let q = -914/545 - l. Calculate the common denominator of q and c. 20 Let h(b) = -2b2 - 12b - 7. Suppose -4a - z = 14, 3z - 2z = 2. Calculate the smallest common multiple of h(a) and 3. 9 Let n = -16 + 22. Let f(y) = y2 - 5y - 3. Let x be f(n). Suppose 0d - x = -2k + d, -2k - 5d = 3. Calculate the common denominator of 58/7 and k. 7 Suppose -l + 8 = -5h, -64 = 4l - 7l + 5h. Calculate the least common multiple of 21 and l. 84 Let h = -18 + 21. Suppose 2k - 5d = 23, -2d - 4 = -2. Suppose 3q - k = h. Calculate the least common multiple of q and 1. 4 Let f = 31369/55824 + 2/3489. What is the common denominator of f and (1 - 1) + (-46)/(-44)? 176 Suppose 225 + 215 = -4n. Let q = n - -124. What is the lowest common multiple of q and 6? 42 Let u = 4951/1305 - 164/45. What is the common denominator of u and -133/18? 522 Let c(p) = 7p + 111. Calculate the lowest common multiple of c(-9) and 8. 48 Let k(o) = 27o - 154. Suppose -3m = -12, -4s = -3s - 4m + 10. Suppose -2u - 128 = -su. Calculate the smallest common multiple of u and k(6). 32 Let r(x) = x + 11. Let b be r(-10). What is the lowest common multiple of 3 and b/2138? 57 Let c = -4236/5 + 17051/20. Find the common denominator of c and -155/42. 420 Let d be (-3)/(-4)1(-9 + 129). Find the common denominator of (-23)/(-14) + 1 + 0 and -1 - 0 - (-207)/d. 70 Let t = -13887 + 13911. Suppose -221 + 21 = -5n. What is the least common multiple of n and t? 120 Let t be (-615)/(-10)(-1)/26. Let d = t - -388/39. Calculate the common denominator of -95/8 and d. 24 Let z be (-1)/(4(-1)/(-976)). Find the common denominator of ((-5)/60)/(2/z) and -19/14. 42 Let h be (-28)/(-182) - (-34258942)/1924. Let v = h - 17806. Find the common denominator of v and 30. 74 Let f = 2456383/42 + -58489. Find the common denominator of -82/21 and f. 42 Let y = -8/1727 + 260873/20724. Let u = -360703577171787/73546 + 4904462202. Let w = u - 1/3343. What is the common denominator of y and w? 132 Calculate the lowest common multiple of 400 and 1526/49 + -4 - (-6)/7. 2800 Let v be (-4)/6 - 247/39. Calculate the common denominator of (-3)/v - (-374)/616 and -25/12. 84 Suppose 4f - 16 = 3y, 14 = -3y + 2f + 6. Suppose y = 5a + 5z, -3z - 28 = -2a + 2z. Calculate the smallest common multiple of a and 4. 4 Let b(j) = j2 - j + 4. Let l be b(2). Suppose 2x - lx = -164. Let q = -10/421 + -39955/1684. Find the common denominator of x and q. 4 Let h = -157 + 187. What is the least common multiple of h and 21? 210 Calculate the common denominator of (-738)/396 + (-4)/(-6) and 57/4. 132 What is the smallest common multiple of 24 and ((-2)/5)/(50/(-8250))? 264 Let f be (4/(-3))/((-24)/(-72)). Let i be -6 - (f - (-6 - 0)). What is the common denominator of -7/16 and i/60 - 447/360? 16 Let t(x) = x2 - 5x. Let g be t(5). Suppose g = m - 6. Calculate the lowest common multiple of m and 6. 6 Let b be 215386/125910 - (1 + -1). Let x be 9/(-4197)(1 + (-28)/36). Let i = b - x. Calculate the common denominator of i and 50/9. 45 Calculate the common denominator of 184/126 + (0 - 2) and (-9)/54(-35)/10. 252 Suppose -5r = 3v + 2v + 440, -12 = 4v. Calculate the common denominator of r/16 + 1/(-2) and 75/22. 176 Suppose 4d = 4, -4d + 3 = -b + 41. What is the smallest common multiple of 30 and b? 210 What is the smallest common multiple of 88 and -2(-5)/(50/55)? 88 Suppose -9 = -2d - 19. Let a = -11 - d. Calculate the lowest common multiple of 16 and 748/51a/(-4). 176 Calculate the common denominator of 29/3 and 11771/711 - 2/(-18). 3 Suppose p + p = -3n + 20, 2p = 2n + 10. Let c = p + -4. What is the smallest common multiple of (4 - -2) + 4 + -5 and c? 15 Suppose 2t = -2t + 3q + 79, -t - 4q = -34. Suppose 24z - 36z = -456. What is the least common multiple of z and t? 418 Calculate the smallest common multiple of ((-3)/(-4))/((-21)/14)*-12 and 38. 114 Let a = -867/8 - -33	{ "pile_set_name": "DM Mathematics" }
-2, 1, -5, -9 in ascending order. -9, -5, -2, -1, 1 Sort -1, -11, 4, -3. -11, -3, -1, 4 Put 1, 51, -1, -16 in increasing order. -16, -1, 1, 51 Sort 11, -0.3, -1/4, -1/2 in descending order. 11, -1/4, -0.3, -1/2 Sort 1, 1/8, -1 in increasing order. -1, 1/8, 1 Put -0.1, -4, 356, -0.7 in increasing order. -4, -0.7, -0.1, 356 Sort -4, 0, 3, -12. -12, -4, 0, 3 Put 3, -3, 2, 465 in ascending order. -3, 2, 3, 465 Sort -4, -5, -4757 in ascending order. -4757, -5, -4 Sort 32, -2, 5, -1 in decreasing order. 32, 5, -1, -2 Put -2, 3/8, 5, -1 in descending order. 5, 3/8, -1, -2 Put -10, -1/10, 20 in descending order. 20, -1/10, -10 Put 0, 3, -109, 1 in descending order. 3, 1, 0, -109 Sort -2, -6, 1, 316, -1 in descending order. 316, 1, -1, -2, -6 Sort -5, 4, 0, 3, -35 in ascending order. -35, -5, 0, 3, 4 Put -5, 2.2082, -0.2 in descending order. 2.2082, -0.2, -5 Sort 1/5, -1/5, 3/4, 2, 0. -1/5, 0, 1/5, 3/4, 2 Sort 0.87, 2, 5/4, 2/13 in descending order. 2, 5/4, 0.87, 2/13 Sort -87/10, 0.2, 3 in descending order. 3, 0.2, -87/10 Sort 2/5, -3, 0.3, 0.01 in decreasing order. 2/5, 0.3, 0.01, -3 Put 1/4, 1/3, 2, -15, 1/2 in decreasing order. 2, 1/2, 1/3, 1/4, -15 Sort 4, -0.4, 5, 0.12 in decreasing order. 5, 4, 0.12, -0.4 Put 2, -3/4, 3, 539 in decreasing order. 539, 3, 2, -3/4 Sort 51, 4, -11 in ascending order. -11, 4, 51 Sort -0.2, 68, -67/4, -0.4, 0.3. -67/4, -0.4, -0.2, 0.3, 68 Sort 24, 2, -21 in descending order. 24, 2, -21 Put 1, -4, -21, -2 in ascending order. -21, -4, -2, 1 Sort 28, 10/13, 2/15 in descending order. 28, 10/13, 2/15 Sort 0.4, 1/54, -1, 2, 5 in decreasing order. 5, 2, 0.4, 1/54, -1 Put -32, -0.1, -14, -1 in descending order. -0.1, -1, -14, -32 Sort -3, 2, 41, 1 in ascending order. -3, 1, 2, 41 Sort 9, 13, -7, 3 in decreasing order. 13, 9, 3, -7 Put 3, -2, 0, -1 in ascending order. -2, -1, 0, 3 Put -5, -1, -996 in descending order. -1, -5, -996 Sort -0.3, 4, -70, -4 in increasing order. -70, -4, -0.3, 4 Sort -1, -3, 4, 0. -3, -1, 0, 4 Sort 1, -6/43, 0.1 in descending order. 1, 0.1, -6/43 Sort -2/9, -1/4, -10, 2/13, 0.3 in decreasing order. 0.3, 2/13, -2/9, -1/4, -10 Put -19, -5, 3, 4 in increasing order. -19, -5, 3, 4 Put 81, 0.1, 1/3, 2 in increasing order. 0.1, 1/3, 2, 81 Put -73, 3, -5, 0, -1 in decreasing order. 3, 0, -1, -5, -73 Sort -223, -3, -1 in descending order. -1, -3, -223 Put -191, 3, -1 in ascending order. -191, -1, 3 Put 3.5, 1/15, -3/8 in increasing order. -3/8, 1/15, 3.5 Sort -3, 2, 4, -6, -2 in descending order. 4, 2, -2, -3, -6 Sort -0.2, 4, -0.1, 100, 7/3. -0.2, -0.1, 7/3, 4, 100 Sort -4, 5, 63, -8. -8, -4, 5, 63 Put 0, -0.2, -2, -10 in ascending order. -10, -2, -0.2, 0 Sort 1, -16, -19, 2. -19, -16, 1, 2 Sort 4, 3, 9, 0 in descending order. 9, 4, 3, 0 Put 5, 3, -2.3, -2/5 in decreasing order. 5, 3, -2/5, -2.3 Sort 5, -0.1, 3, 7 in descending order. 7, 5, 3, -0.1 Put 2, 0, -9, -21, -5 in descending order. 2, 0, -5, -9, -21 Sort 3, 0.3, -97, -0.2, -2. -97, -2, -0.2, 0.3, 3 Sort 42, -5, -0.5, -2/7 in decreasing order. 42, -2/7, -0.5, -5 Put -2, 2, -72 in descending order. 2, -2, -72 Sort 2/15, 2/179, -1 in ascending order. -1, 2/179, 2/15 Sort 180, -1, 3 in decreasing order. 180, 3, -1 Sort 42, -3, 4, -4 in descending order. 42, 4, -3, -4 Sort 3294, -2, -3 in descending order. 3294, -2, -3 Sort -5, -1, 1, -960. -960, -5, -1, 1 Put 3, 0, 22/9 in increasing order. 0, 22/9, 3 Sort -0.5, 9, 0.2, -5. -5, -0.5, 0.2, 9 Put -2, -1, -0.3, 13 in descending order. 13, -0.3, -1, -2 Put 2/9, -1, -324 in increasing order. -324, -1, 2/9 Sort 2, 5, 8 in descending order. 8, 5, 2 Sort -3, 212, 0. -3, 0, 212 Sort 5, -5, -8 in increasing order. -8, -5, 5 Put 5, 115, 0, -2, -7 in ascending order. -7, -2, 0, 5, 115 Put -1, -6.39, 3/11 in decreasing order. 3/11, -1, -6.39 Sort 3, 0, -4, 101 in decreasing order. 101, 3, 0, -4 Put 150, 3, -0.2, 0.2 in decreasing order. 150, 3, 0.2, -0.2 Sort 36, -6, -5, 5, 3 in increasing order. -6, -5, 3, 5, 36 Sort -3, -1, -2/5 in ascending order. -3, -1, -2/5 Sort -4, 2, 671, 1, -2 in increasing order. -4, -2, 1, 2, 671 Sort -2, -60, -3/10 in ascending order. -60, -2, -3/10 Sort -3, 0, -10, 7, 4 in ascending order. -10, -3, 0, 4, 7 Put 3, -10, -1.5, 1, -5 in descending order. 3, 1, -1.5, -5, -10 Sort -2, 4, -212, 0.2. -212, -2, 0.2, 4 Sort 5, 0, 144, -4, -5 in increasing order. -5, -4, 0, 5, 144 Sort -5, -15, -189 in increasing order. -189, -15, -5 Put 0.1, 0.3, -3/176, 5, 1/2 in decreasing order. 5, 1/2, 0.3, 0.1, -3/176 Put -6, 73, -17 in descending order. 73, -6, -17 Put -4, -10, -7 in decreasing order. -4, -7, -10 Put 3, -2, 643 in descending order. 643, 3, -2 Put 0.1, 10/9, -2/21, -4, 1 in decreasing order. 10/9, 1, 0.1, -2/21, -4 Sort -4, -72, 17 in decreasing order. 17, -4, -72 Sort 5/6, -0.014, 1/4 in descending order. 5/6, 1/4, -0.014 Sort 15.6, 4, -2/19. -2/19, 4, 15.6 Sort -1, 1.3, 0, -3/7. -1, -3/7, 0, 1.3 Put -4/7, 2.4, 2/3 in ascending order. -4/7, 2/3, 2.4 Put 6, 17, 1 in increasing order. 1, 6, 17 Put 5, -68, 1 in decreasing order. 5, 1, -68 Put 6, 1, 22, 2 in decreasing order. 22, 6, 2, 1 Sort -0.2, -0.1, -4, 4/3 in descending order. 4/3, -0.1, -0.2, -4 Sort -8/3, -1/6, -2.39, 2, -0.2. -8/3, -2.39, -0.2, -1/6, 2 Put -5, -1/8, -16, -2, -3 in increasing order. -16, -5, -3, -2, -1/8 Sort -2, -1897, -4, 0 in increasing order. -1897, -4, -2, 0 Sort -5, 5, 30, 8, 2 in ascending order. -5, 2, 5, 8, 30 Sort 3, 2, 17. 2, 3, 17 Sort 1, 0, -67, -2 in decreasing order. 1, 0, -2, -67 Sort -2, 2, 34, -5 in descending order. 34, 2, -2, -5 Put -4, 12, 2, 3 in increasing order. -4, 2, 3, 12 Put 2/5, -678, -5, -1/2 in increasing order. -678, -5, -1/2, 2/5 Sort -3, 1/5, 1243 in decreasing order. 1243, 1/5, -3 Sort 5, 14, -4, 3, 33 in descending order. 33, 14, 5, 3, -4 Sort -1, -22, 6, -5. -22, -5, -1, 6 Sort -4/7, -26, 3/7, -5/3, 0.3 in increasing order. -26, -5/3, -4/7, 0.3, 3/7 Sort 4, -8, -7, 7 in increasing order. -8, -7, 4, 7 Sort -42, 1, -3, -1, 9. -42, -3, -1, 1, 9 Sort 6, -11, 3, 0 in descending order. 6, 3, 0, -11 Put -0.249, 0.4, 0 in descending order. 0.4, 0, -0.249 Put -48, 0, -4, -5 in decreasing order. 0, -4, -5, -48 Put -271, 3, 0 in decreasing order. 3, 0, -271 Sort -3, -486, -0.5 in ascending order. -486, -3, -0.5 Put -5, -23, 5 in decreasing order. 5, -5, -23 Sort -6, -5, 6, 5 in decreasing order. 6, 5, -5, -6 Put 0.3, -35, -0.39 in decreasing order. 0.3, -0.39, -35 Put 26, -1, 0 in ascending order. -1, 0, 26 Put -4, -3, -15 in decreasing order. -3, -4, -15 Put 1, -1, 18, -4 in decreasing order. 18, 1, -1, -4 Put 48/11, -3, 3/4, -3/8 in decreasing order. 48/11, 3/4, -3/8, -3 Sort 13, -4, -3 in descending order. 13, -3, -4 Sort 0, -126, 3. -126, 0, 3 Sort -42, 1, -2, 3 in decreasing order. 3, 1, -2, -42 Sort 5, -9, 2, 3. -9, 2, 3, 5 Put -121, 2, -3 in descending order. 2, -3, -121 Put 1/5, 0.4, 43 in decreasing order. 43, 0.4, 1/5 Sort 1/2, -0.01, 0.2, -1 in descending order. 1/2, 0.2, -0.01, -1 Sort 25, -2, 2 in ascending order. -2, 2, 25 Put 0, 2, -39, -1 in descending order. 2, 0, -1, -39 Sort -17, 4, 2, -10 in decreasing order. 4, 2, -10, -17 Put 40, 1, -5, 3, 5 in descending order. 40, 5, 3, 1, -5 Sort 72, 1, 3/4. 3/4, 1, 72 Sort 1, -0.5, 85, 1/7 in descending order. 85, 1, 1/7, -0.5 Put -2, 7, 3, 1, -4 in descending order. 7, 3, 1, -2, -4 Put 4/5, -1, -30, 2/9 in ascending order. -30, -1, 2/9, 4/5 Sort -27, -3, 3, -4. -27, -4, -3, 3 Put 0.12, -0.2, -0.5, -26, -2/11 in increasing order. -26, -0.5, -0.2, -2/11, 0.12 Sort 3, -345, -1 in descending order. 3, -1, -345 Sort -62, 3, 20, 5, -3 in descending order. 20, 5, 3, -3, -62 Sort -2/5, -1/2, -0.3 in descending order. -0.3, -2/5, -1/2 Sort -27, -25, -3 in increasing order. -27, -25, -3 Sort 2, 3/8, -29, 5 in ascending order. -29, 3/8, 2, 5 Sort -5, 20, 0.3 in ascending order. -5, 0.3, 20 Sort 26, -5, 5, -3 in decreasing order. 26, 5, -3, -5 Put 4, -5, -1, 0 in ascending order. -5, -1, 0, 4 Sort 3, 1.4, 15 in descending order. 15, 3, 1.4 Put -4, -1/2, -0.9, -7, -64 in decreasing order. -1/2, -0.9, -4, -7, -64 Sort 8, -5, -1. -5, -1, 8 Put 708, -4, -2, 10 in increasing order. -4, -2, 10, 708 Sort 5, -35, -4 in decreasing order. 5, -4, -35 Sort 5, 2, -4, -279 in descending order. 5, 2, -4, -279 Sort -5, 840, 0, 3 in decreasing order. 840,	{ "pile_set_name": "DM Mathematics" }
*2. What is the third derivative of h(o) wrt o? 84 Let v = -10 - -13. Find the second derivative of -4m*v - 19m*3 + 9m*3 + 16m wrt m. -84m Let y(i) be the second derivative of -3i*4 + 37i*2 + 15i. Differentiate y(o) with respect to o. -72o Let u = 62 + -40. What is the first derivative of -22k + 6k2 - 15k*2 - 7 + uk wrt k? -18k Let b be 21/9 + 1/(-3). What is the third derivative of -6u*2 + 7u*2 - 2u*3 - 23u*b + 0u3 wrt u? -12 Let h(g) = -g2 + 4g + 4. Let i be h(4). Let b be 2/(-8) + 17/i. Find the second derivative of -bu - 2u - 2u + 5u - 7u2 wrt u. -14 Let k(t) = -t3 + t - 1. Let j(n) = -9n3 - 2n + 9 + 7n + 9. Let p(o) = j(o) - 5k(o). What is the derivative of p(x) wrt x? -12x2 Let g(y) = y3 - y2 + 2. Let v(m) = -12m*3 + 5m*2 + m + 10. Let c(k) = -5g(k) + v(k). Find the third derivative of c(w) wrt w. -102 Let g be 2(0 - 5/2). Let c = g + 12. Find the third derivative of cb3 - b2 - 5b3 + 0b*2 + 5b*3 wrt b. 42 Let z(p) be the first derivative of 2p5/5 + p4/4 + 11p3/3 - 15p*2/2 + 3. Find the third derivative of z(t) wrt t. 48t + 6 Suppose 2d + d = 6. Let h be d/430/3. Find the second derivative of -a + 2a5 + 7a - 2a + 0a*h wrt a. 40a*3 Let b(n) be the first derivative of 1 + 0n*5 - 2n*3 + 0n*2 + 0n + 10/7n7 + 0n*4 + 0n*6. What is the third derivative of b(o) wrt o? 1200o*3 Suppose r + 3r - 5l - 202 = 0, 184 = 4r + 4l. Find the second derivative of 116z*2 + rz - 116z2 + 20z*4 wrt z. 240z*2 Let a(d) be the first derivative of -18d*5/5 + 31d*2/2 - 24. What is the second derivative of a(p) wrt p? -216p*2 Find the second derivative of -91 + 3 + 688g - 689g - 3g4 - 89 - g5 - 3g4 wrt g. -20g*3 - 72g*2 Let l(f) = -f + 26. Let k be l(23). Let t(n) = 4n + 4. Let h(z) = 2 - 8 - 3z + 2. Let m(v) = kh(v) + 4t(v). What is the first derivative of m(g) wrt g? 7 Let b(h) be the third derivative of -4/15h*6 + 0 + 0h*5 - 4/3h*4 + 40h*2 + 0h + 0h3. What is the second derivative of b(s) wrt s? -192s Let u = 14 - 11. Suppose -uk + k + 10 = 0. What is the derivative of w - 4w - k + 7w + 5w wrt w? 9 Suppose -5l = -3q - 0q - 50, -4q = -3l + 85. Let z = q - -27. What is the second derivative of -3w*3 - zw - 4w + 0w wrt w? -18w What is the first derivative of 22x*2 - 112x*2 - 18x*2 - 43 - 25 wrt x? -216x Let h be (-1 + (-14)/(-10))15. Suppose -4 = 2s - hs. Find the first derivative of 4 - u + s - 2 + 8u wrt u. 7 Find the first derivative of -39 - 31a4 + 8a*4 - 6a*4 + 4 wrt a. -116a*3 Suppose 3s - 18 = 24. Suppose 6 = -4d + s. What is the third derivative of -3x*4 - dx*2 - 3x*4 - 5x*6 + 6x*4 wrt x? -600x*3 Let z = 16 + -11. Find the second derivative of -12g*5 + 20g*5 - 20g + 14gz wrt g. 440g*3 Let u(n) = 333n*3 - 9n*2 + 10n - 5. Let m(t) = 166t3 - 4t*2 + 5t - 2. Let s(o) = 9m(o) - 4u(o). Find the second derivative of s(j) wrt j. 972j Let v(w) be the first derivative of -14w*4 + 11w*3 - 67. Find the third derivative of v(p) wrt p. -336 What is the second derivative of -2n*2 + 186n - 326n + 3n*3 + 3n*3 + 190n wrt n? 36n - 4 Find the third derivative of -51v*2 - 3140 + 1570 + 9v*6 + 1570 wrt v. 1080v*3 Let k(p) = 2p*4 + 11p*4 + 0p*3 - 3 + 0p*3. Let v(a) = 25a4 + a2 - 7. Let l(c) = 7k(c) - 3v(c). What is the third derivative of l(b) wrt b? 384b Suppose -3t + 17 = -o, -4 = -2t + o + 8. What is the second derivative of -4 + 5 - 45v*3 + tv - 5 - 3v wrt v? -270v Let n(d) = d*2 - d - 3. Let a(r) = 289r*3 - 5r*2 + 11r - 14. Let u(l) = -a(l) - 4n(l). Find the second derivative of u(w) wrt w. -1734w + 2 Find the first derivative of -3l2 + 116 - 36319l*4 + 323 + 15l*2 + 36317l*4 wrt l. -8l*3 + 24l Let x(f) be the first derivative of -33f4/4 + 3f*3 + f - 5. Find the third derivative of x(o) wrt o. -198 Let m(d) = -d + 15. Let b be m(13). Find the third derivative of 3x*3 + 5x*2 + 0x*b - 15x*2 - 20x2 wrt x. 18 Let g(z) be the third derivative of z7/210 + z*6/60 + 17z*5/12 + 26z*2. What is the third derivative of g(r) wrt r? 24r + 12 Let m(z) = 6z4 + 14z*2 + 3z - 185. Let v(h) = 11h4 + 29h*2 + 5h - 369. Let y(g) = -5m(g) + 3v(g). Differentiate y(o) wrt o. 12o3 + 34o Let w(u) be the first derivative of u5/4 + u2/2 - 23u - 18. Let d(q) be the first derivative of w(q). Find the first derivative of d(o) wrt o. 15o*2 Let x(f) be the second derivative of -323f7/42 + f4 + 3f3/2 - 317f. Find the third derivative of x(c) wrt c. -19380c2 Suppose 2u = 2v + 6, 0u - 4v = -5u + 13. Let f = u - -2. What is the third derivative of -h*6 - fh*6 + 5h*2 - 7h*2 wrt h? -480h*3 Suppose -5n = -4 - 11. Let l(c) = -c*3 - 9c*2 + 13c + 34. Let d be l(-10). What is the first derivative of -4 - dk + 9k + n wrt k? 5 Let x(l) = 7l - 7l + 0l2 + l2. Let k be x(3). What is the second derivative of kq - 4q - 3q + 11q - 8q*4 wrt q? -96q*2 Let u(z) = 14z*3 + 11z*2 + 6z - 48. Let y(g) = -g3 - g2 - g + 1. Let f(h) = u(h) + 6y(h). Differentiate f(j) wrt j. 24j*2 + 10j Find the second derivative of -157g5 + g3 + 2g*3 + 1 + 64g*5 - 60g + 80g5 wrt g. -260g*3 + 18g Suppose 2l + t = 47, 3l = -4t + 15 + 48. Find the second derivative of -lu*5 + 55u*5 + 4u*5 + 17u wrt u. 680u3 Let n(j) = 51j*2 + 24j + 658. Let k(t) = 17t2 + 8t + 219. Let z(l) = -11k(l) + 4n(l). Differentiate z(i) with respect to i. 34i + 8 Suppose -7s + 31 = -95. What is the first derivative of 19n2 + 4 + 2 - sn*2 - 40n*2 wrt n? -78n Find the first derivative of -64 + 13 + 84 + 106 - 105l3 wrt l. -315l*2 What is the derivative of -13o*2 - 13o*3 - 8o*3 + 19o*3 - 603 - 6o*3 wrt o? -24o*2 - 26o Let n(k) be the third derivative of 179k5/20 - k4/24 + 17k*3/6 + 66k*2. What is the second derivative of n(s) wrt s? 1074 Let x(l) be the first derivative of 26 - 23l + 0l2 - 23/4l*4 + 0l*3. What is the first derivative of x(g) wrt g? -69g*2 Let f(d) = 617d*4 + 9d*3 - 1350. Let r(o) = 309o*4 + 4o*3 - 675. Let x(y) = 4f(y) - 9r(y). Differentiate x(w) with respect to w. -1252w*3 Let j(x) = -4x*3 + 3x + 4. Let m(f) = -3f3 + 87f - 45f - 40f + 4. Let o(c) = -4j(c) + 6m(c). What is the derivative of o(t) wrt t? -6t2 Let b(g) = -121g*3 - 3g2 + 10. Let z(l) = l3 + 1. Let v(p) = b(p) + 5z(p). What is the third derivative of v(n) wrt n? -696 Let m be (0 - 9) + 5 - (-37)/1. What is the third derivative of 29g*2 - 6g*6 + 2g*6 - mg*6 - 7g*2 wrt g? -4440g*3 Let p(c) be the first derivative of 7c6/30 + c4/2 + c*2 + 23. Let k(x) be the second derivative of p(x). Find the second derivative of k(f) wrt f. 168f Suppose 4k - 4 = -0. Let z(d) = 16d2 - d - 5. Let x(l) = l2 - l - 1. Let c(t) = kz(t) - 5x(t). Find the second derivative of c(j) wrt j. 22 Suppose 4n = 23 - 7. Suppose -5q + 2 = -4u, 3q = q + n. Find the second derivative of m - 4m4 - um + 0m + 2m wrt m. -48m2 Suppose 16 = 3h + 4o, -3h + o + 4 = 2o. Let l(m) = -m2 + 12m + 256. Let p be l(-11). What is the second derivative of hg + 4g + g*3 + 6g*p wrt g? 42g Let d(h) be the second derivative of 0h4 + 3/4h*5 + 0 + 0h*2 + 22h + 5/6h3. Find the second derivative of d(y) wrt y. 90y Let r(o) be the first derivative of -273o4/4 - 146o*3/3 + 241. What is the third derivative of r(l) wrt l? -1638 Suppose -5o = -4n + n + 44, -2n + 28 = -3o. Let l be (n/(-36))/((-3)/27). What is the derivative of al + 3a*2 - 6 - 7a*2 - 3a*2 wrt a? -12a What is the first derivative of 112 - 162o4 + 5 + 2 wrt o? -648o3 Let u(c) be the third derivative of -c8/5040 - 3c6/80 + 3c*5/20 + 24c*2. Let h(b) be the third derivative of u(b). Differentiate h(z) wrt z. -8z Find the second derivative of 3f + 9282 - 9282 - 48f*3 wrt f. -288f Let c(m) be the third derivative of 427m6/120 + 61m5/30 - m3/3 + 941m2. Find the third derivative of c(x) wrt x. 2562 Let s(b) = b + 3. Let k be s(7). Suppose 0 = 5u - k. What is the first derivative of -u	{ "pile_set_name": "DM Mathematics" }
g + 17 - d = 0 for g. 5 Let n(v) = 2v + 14. Let h be n(-7). Suppose 25 = -hp + 5p. Solve q - 6q = p for q. -1 Suppose 3 - 6 = -i. Let h be -5 - (3 + 1 - i). Let x be (-15)/h(1 + 1). Solve -7 = -4r + x for r. 3 Let n = -24 + 24. Let j be -6(-2)/(-12)15/(-5). Solve -jo - 2o - 10 = n for o. -2 Suppose i = -5f + 75, 66 = 4f + i + 5. Let g = -10 + f. Let l(d) = d*3 - 3d*2 - 3d. Let x be l(g). Solve 20 = -t - xt for t. -4 Let k be 10(2/20 + 8/20). Solve 0 = 8u - ku for u. 0 Let d(t) = -2t - 2. Let r be d(-3). Let m(c) = c + 41. Let w be m(0). Let h = -40 + w. Solve -5i + h + r = 0 for i. 1 Suppose v - 3z = -v + 10, 4z - 38 = -2v. Suppose 0 = -5q + 44 + v. Let t = q + -1. Solve -g + t = -6g for g. -2 Suppose 27x - 9x - 144 = 0. Solve xs - 6s - 10 = 0 for s. 5 Suppose 0 = -536r + 535r. Solve -2q + 23 - 17 = r for q. 3 Let f(b) = b*2 - 25b + 176. Let h be f(9). Solve -14g - h = -6g for g. -4 Let a(d) = -d*3 + 16d*2 + 16d - 1. Let n be a(17). Let k = n - -22. Solve 0 = kt - 5t for t. 0 Let d = -215 - -221. Solve p = dp + 25 for p. -5 Suppose 0 = 3t, 4 = 2p - 0p + 2t. Let w be (-6 - (-75)/10)p1. Solve 5v - w - 7 = 0 for v. 2 Let o(s) be the first derivative of s*3/3 - 9s*2/2 + 8s - 6. Let y be o(7). Let q = 8 + y. Solve qp + 2p = 12 for p. 3 Suppose 0 = -4i + w + 2321, -11w = -2i - 14w + 1171. Solve -586q = -iq + 10 for q. -2 Let l(c) = 3c + 22. Let w be l(-6). Solve -1 = 3r - wr for r. 1 Let v(j) = 4j - 3. Let x be (-1)/(((-12)/10)/6). Let r be v(x). Solve -3y - r + 5 = 0 for y. -4 Suppose 80p = 16p. Solve p = -2j - j for j. 0 Let z(f) = f*2 - 56f + 565. Let x be z(13). Solve 36 = xd + 3d for d. 4 Suppose 2b - 9 = -3. Suppose -5y = -10, 0 = -5z - by + 12 + 9. Solve 8 - 2 = -zw for w. -2 Suppose -2 - 4 = -3j. Let s = -1 - j. Let f = s - -11. Solve 4u + f = 4 for u. -1 Suppose 27k = 38k - 22. Solve 0o - ko - o = 0 for o. 0 Let r = -4 - -9. Suppose -5z + 32 = -18. Let h be (-8)/(-44) - 2/11. Solve hm - rm = -z for m. 2 Let p = 3738 - 3736. Suppose k = -k. Suppose 5d = -k + 25. Solve pu - 13 + d = 0 for u. 4 Let q(r) = r*3 + 16r*2 - 4r + 2. Let v be q(-16). Let m be 6/(-8) - v/(-24). Solve o + mo = 3 for o. 1 Suppose 42 = w + 40. Suppose -11 + 17 = wz. Solve b = -zb - 8 for b. -2 Let a = -215 + 217. Solve x = -ax + 15 for x. 5 Let d be -6(-9 + 49/21). Solve -5a = d - 20 for a. -4 Let z be -41 + (37 - 10). Solve 0 = 5j - z + 3 for j. 4 Let z(y) = y + 19. Suppose 15k - 13k = -32. Let a be z(k). Solve -b + 0b = a for b. -3 Let a be (36/16)/((-2)/24). Let g be (a/6)/((-3)/18). Let i = -24 + g. Solve 4l = -13 - i for l. -4 Let f(k) = 24k2 - 3k - 2. Let y be f(-1). Solve -8i = -3i - y for i. 5 Let r(a) = -3a2 - 18a - 17. Let v(i) = -i*2 - 6i - 6. Let l(y) = 3r(y) - 8v(y). Let w be l(-5). Solve wf - 1 = f for f. 1 Let w = 1272 + -1255. Solve 7f - w = -10 for f. 1 Let v = -60 + 61. Suppose j + t = 9, 2j = 2t + 3 - v. Let r(i) = -i + 13. Let m be r(9). Solve -ma + 3 + j = 0 for a. 2 Suppose 0 = -1616n + 1619n + 2q - 20, 3q = -2n + 25. Let w be (4/(-10))/(2/(-20)). Suppose 9k = wk. Solve 0 = 2g - k + n for g. -1 Suppose 0i + 96 = 12i. Solve 9j - 5j + i = 0 for j. -2 Let g(u) = -u3 - 21u*2 + 75u + 102. Let i be g(-24). Solve 17a - i = 23a for a. -5 Let j be 1 + -4 - (-4)/2. Let g be (-51 + j)12/(-18). Solve 12 + 4 = gy for y. 4 Suppose 87 + 193 = 10v. Suppose 4f - 3i - v = -7i, 0 = f + 5i - 27. Solve -f = -7x + 9x for x. -1 Let u(d) = 3d3 + d - 1. Let i be u(1). Let a = 3 - i. Suppose -10 = -at - t. Solve k + t = -k for k. -5 Suppose 3f + 5x - 13 = 0, 2x - 8 + 1 = -3f. Suppose -f = 3m - 7. Solve h + 3 = mh for h. 3 Let t be (-590)/50 + 2/(-10). Let m be t/8(-22)/3. Solve 4 + m = 5w for w. 3 Suppose -273 = -4k + 3i, 5k - i = -38 + 382. Solve -15h - 8h = -k for h. 3 Suppose -10f = 21f. Solve f = -3g + 3 - 0 for g. 1 Let r(s) = s*2 + 7s + 3. Let z be r(-7). Suppose -3i - 13 = -4k + 3, -2k = 2i - 8. Solve -12 = -iu - zu for u. 4 Let s(g) = -g*2 + 35g - 4. Let y be s(21). Let q be (-2 - y/(-25)) + 2/5. Solve 30 = -5o + q for o. -4 Suppose 0 = g - 31 + 19. Solve 20 = gf - 8f for f. 5 Let m = -82 - -85. Let r be (4/3)/(2/15). Solve r = mq + 22 for q. -4 Let y(b) be the third derivative of b*6/12 - 2b*2. Let n be y(1). Solve -n = -g - 7 for g. 3 Suppose 2c + 14 = -0c. Let n = c - -11. Solve nm + 3 = -1 for m. -1 Let t be 1/(-2) - ((-209)/(-22) + -13). Let s = -12 + 6. Let f be 66/9 + 2/s. Solve -q = f - t for q. -4 Let y(x) = x*3 - 4x*2 - 59x + 22. Let m be y(10). Solve 35z - mz = -12 for z. -4 Let a = -263 + 268. Solve 2k - 1 = a for k. 3 Let n(i) = i3 - 3i*2 + 5i - 1. Let z be n(2). Suppose 3v + zd = 49, -6v - d = -3v - 41. Solve -2f + v = 3 for f. 5 Let i = 2 + 7. Suppose -8 - 38 = 4w + 2h, -7 = 3w - 4h. Let g = i + w. Solve gd - d = -5 for d. 5 Let f be 4/16 - (-66)/24. Solve -f = -4w - 7 for w. -1 Let l(k) = -6k. Let b be l(1). Let i be 13/(-39) - (1 + 20/b). Solve 5 = iu - u for u. 5 Let s(f) = -f3 - 5f*2 - 4f + 3. Let p be s(-4). Let l(h) = 4h - 3. Let m be l(p). Let t = m + 0. Solve 0 = 3w + t for w. -3 Let y(d) = -50d + 252. Let v be y(5). Solve 0 = -vu + 6u + 20 for u. -5 Let j = -943 + 964. Solve 8y + 53 - j = 0 for y. -4 Suppose 0 = 2m - 93 + 253. Let p be 21/14m/(-6). Suppose -8 = -2a - 18, 4a = 3l - p. Solve l = 2n + 2n for n. 0 Let g = 2 + 6. Let k be 2/(-6)-32. Suppose -kc = 3c - 90. Solve c = 5u + g for u. 2 Let r be (4/6)/((-18)/135). Let m(g) = -g*2 - 6g + 1. Let x be m(r). Solve -2o = -xo + 12 for o. 3 Suppose -15 = -5w, 3w - 2 = -4u + 5w. Let k(y) = -2y + 4. Let f be k(4). Let i be (8/f)/(u/(-5)). Solve 3t - it = 0 for t. 0 Let r(h) = -h2 + 6h - 3. Let y be r(3). Let u(d) = 2d3 - 3d*2. Let b be u(2). Let i be ((-18)/b - -4)0. Solve -3w + i - y = 0 for w. -2 Suppose 5w - t - 40 = 0, -2w + 4t = -7w + 65. Solve 15 = wo - 6o for o. 5 Suppose -3w = -5b - 18, 0 = -5b + 3w - 6w - 42. Let k(z) = z*3 + 7z*2 + 7z - 8. Let t be k(b). Let y = 29 + t. Solve 3 - y = 4u for u. -3 Suppose 500 = -26i + 46i. Solve 21 = -4m + i for m. 1 Let w = -4 - -20. Let b(q) = -q*3 + 9q*2 - 9q + 10. Let n be b(8). Solve -w = nh + 2h for h. -4 Suppose -35h + 30h = 3i + 1, i - 5h = 13. Solve iy + 13 - 10 = 0 for y. -1 Let g(t) = -t3 - t2 - t - 5. Let p be g(3). Let o = p + 56. Solve 0 = 3b - o for b. 4 Let a be 0 + 2 - (-2 - -4). Suppose 11b - 3b - 24 = a. Solve bg - 4 = -16 for g. -4 Suppose -43k + 38k + 35 = 0. Solve 0 = -km + 9m for m. 0 Suppose -37x = -4x - 99. Solve -171 = -xy - 156 for y. 5 Let a = -33 - -18. Suppose -4w = -8w - 52. Let c = w - a. Solve j - cj = -4 for j. 4 Suppose 0 = -2s - 25 + 41. Solve sz = 16 + 16 for z. 4 Let s(x) = 3x*2. Let i be s(2). Let w = -10 + i. Suppose 0 = -wo + 3o. Solve 0 = -ok - 4k for k. 0 Suppose 19m + 1426 = 50m. Solve 16 = 42n - mn for n. -4 Let k = -84 + 30. Let m = k - -58. Solve -q - mq = 15 for q. -3 Let d be ((-2)/2)/((-6)/(-366)). Let y = d - -76. Solve 4l + y = -5 for l. -5 Let f = 28 + -28. Suppose f = 3c - 9 + 3, 4d - 22 = -3c. Solve -dg = -g for g. 0 Let b be (1 - (1 - -2))/((-19)/38). Suppose j - bj = -9. Solve 0v = -v - j for v. -3 Let p(o) = -o2 - 7o - 7. Let y be p(-5). Let z = -88 + 87. Let d(q) = -5q - 3. Let t be d(z). Solve -tu = -yu - 2 for u. -2 Let p = 8 + 4. Let r(y) = -10y*2 + 3y + 4. Let s be r(-3). Let h be (-1)/(-5 - s/20). Solve 0 = -ho + o + p for o. 4 Suppose 0t + 2t = 8. Let v be 8/(((-2)/4)/(3/(-6))). Let f be (v-2)/(6/(-3)). Solve 0p - tp + f = 0 for p. 2 Let p = -88 - -88. Let y(s) = 4s2 - s - 1. Let k be y(-1). Suppose p = v - 3a + 6, -2a + 4 = -k. Solve -3r + r - v = 0 for r. -3 Let d(b) = -b*3 + 29b*2 - 79b + 31. Let m be d(26). Solve h - mh = 20 for h. -5 Let k = -264 - -300. Solve 35s - ks = -5 for s. 5 Suppose 5d - 3g - 111 = -19, 3g + 28 = d. Solve c = -3c - d for c. -4 Let x(b) = -2b - 9. Suppose -4p - 3 = -3p. Let q be x(p). Let w(m) = -m*2 - 5m - 6. Let i be w(q). Solve a - 4 = -i for a. 4 Let h = 682 + -633. Solve -h = -9*n - 31 for	{ "pile_set_name": "DM Mathematics" }
ist the prime factors of 892445299. 83, 97, 110849 What are the prime factors of 4266064? 2, 11, 24239 What are the prime factors of 270960960? 2, 3, 5, 17, 16603 What are the prime factors of 1266233982? 2, 3, 13, 1321, 12289 What are the prime factors of 14212155? 3, 5, 859, 1103 What are the prime factors of 139392176? 2, 7, 11, 113143 List the prime factors of 38488287. 3, 1741, 7369 List the prime factors of 47573883. 3, 7, 59, 12799 What are the prime factors of 439557593? 17, 1201, 21529 What are the prime factors of 28418360? 2, 5, 710459 List the prime factors of 6661457608. 2, 13, 19, 3371183 What are the prime factors of 3365610785? 5, 17, 39595421 What are the prime factors of 819921478? 2, 19, 67, 307, 1049 What are the prime factors of 206858898? 2, 3, 11492161 What are the prime factors of 2844619001? 7, 23, 1019, 2477 What are the prime factors of 310575029? 310575029 List the prime factors of 71476817. 41, 1163, 1499 List the prime factors of 205178927. 205178927 What are the prime factors of 7453107? 3, 276041 List the prime factors of 244081188. 2, 3, 13, 167, 347 List the prime factors of 98267504. 2, 251, 24469 List the prime factors of 40779793. 40779793 What are the prime factors of 1828142293? 71, 25748483 What are the prime factors of 73689856? 2, 287851 List the prime factors of 320208551. 13, 2351, 10477 List the prime factors of 161652284. 2, 40413071 List the prime factors of 1012110604. 2, 253027651 What are the prime factors of 1016701550? 2, 5, 67, 303493 What are the prime factors of 112148822? 2, 3851, 14561 List the prime factors of 335320245. 3, 5, 13, 573197 What are the prime factors of 33396415? 5, 13, 17, 30223 List the prime factors of 507682266. 2, 3, 7, 13, 23, 40427 What are the prime factors of 37628331? 3, 13, 964829 What are the prime factors of 40980525? 3, 5, 41, 13327 What are the prime factors of 6460683977? 11, 3347, 175481 List the prime factors of 295932428. 2, 11, 6725737 What are the prime factors of 53049694? 2, 26524847 List the prime factors of 2834486117. 4201, 674717 List the prime factors of 8489942074. 2, 599, 7086763 List the prime factors of 2480948975. 5, 17, 37, 157771 List the prime factors of 51309228. 2, 3, 23, 185903 List the prime factors of 56698720. 2, 5, 13, 27259 List the prime factors of 648653077. 61, 10633657 What are the prime factors of 87995890? 2, 5, 547, 16087 What are the prime factors of 957365659? 17, 53, 61, 17419 List the prime factors of 5479470105. 3, 5, 29, 12596483 List the prime factors of 93207280. 2, 5, 761, 1531 What are the prime factors of 430426823? 430426823 List the prime factors of 461990996. 2, 29, 67, 59443 List the prime factors of 144124318. 2, 13, 5543243 List the prime factors of 4619163307. 11, 419923937 What are the prime factors of 976901262? 2, 3, 43, 293, 12923 What are the prime factors of 629788876? 2, 911, 172829 What are the prime factors of 46267293? 3, 173, 239, 373 What are the prime factors of 1357851408? 2, 3, 28288571 List the prime factors of 15001659. 3, 19, 29243 List the prime factors of 749864207. 277, 2707091 List the prime factors of 186738313. 41, 67, 67979 List the prime factors of 123100588. 2, 13, 463, 5113 What are the prime factors of 937440508? 2, 234360127 What are the prime factors of 50206136? 2, 293, 21419 List the prime factors of 1274524046. 2, 637262023 What are the prime factors of 163034242? 2, 7, 43, 270821 What are the prime factors of 966145399? 966145399 What are the prime factors of 40519980? 2, 3, 5, 75037 List the prime factors of 219594387. 3, 47, 1557407 List the prime factors of 411234167. 163, 2522909 What are the prime factors of 254412311? 79, 3220409 What are the prime factors of 275725263? 3, 11, 131, 63781 What are the prime factors of 127326062? 2, 7699, 8269 What are the prime factors of 51449753? 51449753 List the prime factors of 332828350. 2, 5, 613, 10859 What are the prime factors of 2386138061? 19751, 120811 What are the prime factors of 4909161916? 2, 373, 3290323 List the prime factors of 5382974738. 2, 2691487369 List the prime factors of 1531280929. 31, 53, 932003 What are the prime factors of 405902146? 2, 13, 107, 145903 What are the prime factors of 489886041? 3, 1117, 146191 What are the prime factors of 1940324849? 71, 157, 174067 List the prime factors of 174695383. 17, 41, 263, 953 List the prime factors of 1342532734. 2, 67, 1097, 9133 List the prime factors of 5621187436. 2, 1405296859 List the prime factors of 134761553. 134761553 What are the prime factors of 1110797303? 7, 11, 1311449 List the prime factors of 15208473. 3, 7, 307, 337 List the prime factors of 73073459. 563, 129793 List the prime factors of 763163187. 3, 254387729 List the prime factors of 24225032. 2, 13, 109, 2137 List the prime factors of 768343630. 2, 5, 251, 443, 691 What are the prime factors of 3475683848? 2, 7, 13, 1217, 3923 List the prime factors of 1867253184. 2, 3, 3241759 List the prime factors of 11153622. 2, 3, 1858937 What are the prime factors of 126018836? 2, 149, 211441 List the prime factors of 7878481622. 2, 11, 223, 1605887 What are the prime factors of 14644454? 2, 11, 193, 3449 List the prime factors of 70704873. 3, 47, 55717 What are the prime factors of 239369499? 3, 773, 3823 What are the prime factors of 558326274? 2, 3, 11, 17, 41, 53, 229 What are the prime factors of 52923310? 2, 5, 11, 149, 3229 What are the prime factors of 259996113? 3, 13, 17, 67, 1951 List the prime factors of 93380000. 2, 5, 7, 23, 29 What are the prime factors of 960498292? 2, 13, 691, 26731 What are the prime factors of 1257587127? 3, 53, 197, 1487 What are the prime factors of 185254134? 2, 3, 13, 17, 139709 What are the prime factors of 821378628? 2, 3, 7, 3259439 List the prime factors of 26376265. 5, 17, 227, 1367 What are the prime factors of 437979355? 5, 11, 19, 107, 3917 List the prime factors of 709127913. 3, 13, 73, 249079 What are the prime factors of 1754196257? 11, 159472387 What are the prime factors of 149941211? 7, 1373, 15601 List the prime factors of 273409655. 5, 54681931 What are the prime factors of 158064247? 11, 71, 202387 List the prime factors of 40962655. 5, 23, 356197 List the prime factors of 116068050. 2, 3, 5, 7, 36847 What are the prime factors of 3658030274? 2, 239, 7652783 List the prime factors of 6082128449. 5419, 1122371 List the prime factors of 78543909. 3, 47, 185683 What are the prime factors of 180895656? 2, 3, 19, 20879 List the prime factors of 42905638. 2, 277, 77447 What are the prime factors of 52258437? 3, 7, 11, 73, 1033 What are the prime factors of 1109879560? 2, 5, 503, 55163 List the prime factors of 542166181. 542166181 List the prime factors of 95999874. 2, 3, 1511, 10589 List the prime factors of 642620222. 2, 29, 11079659 List the prime factors of 20978594. 2, 7, 13, 73, 1579 What are the prime factors of 61923950? 2, 5, 11, 112589 List the prime factors of 128088372. 2, 3, 10674031 List the prime factors of 1020712754. 2, 439, 1162543 What are the prime factors of 546988581? 3, 60776509 List the prime factors of 5062419401. 13, 1217, 319981 What are the prime factors of 845216872? 2, 97, 1089197 What are the prime factors of 3794882635? 5, 19, 757, 52769 What are the prime factors of 58157716? 2, 59, 263, 937 What are the prime factors of 3637880797? 43, 2833, 29863 List the prime factors of 489911559. 3, 17, 2953, 3253 List the prime factors of 533031478. 2, 7, 83, 458719 List the prime factors of 3322476658. 2, 487, 1063, 3209 What are the prime factors of 4059839281? 43, 94414867 List the prime factors of 1550210629. 11, 61, 643, 3593 List the prime factors of 92299021. 103, 896107 List the prime factors of 241579056. 2, 3, 5032897 List the prime factors of 57982149. 3, 23, 31123 List the prime factors of 1172177088. 2, 3, 6105089 List the prime factors of 49342547. 2999, 16453 List the prime factors of 241305426. 2, 3, 31, 47, 3067 List the prime factors of 94035265. 5, 83, 347, 653 What are the prime factors of 14573734? 2, 7, 1040981 List the prime factors of 197117482. 2, 17, 79, 73387 List the prime factors of 3559175750. 2, 5, 13, 401, 2731 List the prime factors of 699308198. 2, 349654099 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
a2 + 240a - 200 = 0. Calculate a. -10, -5, 1, 2 Find s such that 188s2 - 7524s + 160 = 0. 1/47, 40 Suppose y*2/2 + 90y + 179/2 = 0. What is y? -179, -1 Determine h so that 5h4 - 90h*3 - 1515h*2 + 3280h - 1680 = 0. -12, 1, 28 Solve 2x2 + 2x - 24 = 0 for x. -4, 3 Factor d*4/3 + 55d*3/3 + 52d*2 - 4d/3 - 208/3. (d - 1)(d + 2)2(d + 52)/3 Factor -d*4/9 + 349d*3/9 - 695d*2/9 + 347d/9. -d(d - 347)(d - 1)*2/9 Suppose 2p*5 + 52p*4/3 + 170p*3/3 + 260p*2/3 + 184p/3 + 16 = 0. What is p? -3, -2, -1, -2/3 Factor -2s2/3 - 80s/3 + 56. -2(s - 2)(s + 42)/3 Factor -2f2/23 - 244f/23 - 7442/23. -2(f + 61)2/23 Factor -18c*2/7 - 12c/7 - 2/7. -2(3c + 1)*2/7 Find u such that -7u*4/4 - 43u*3 - 401u*2/4 - 26u + 33 = 0. -22, -2, -1, 3/7 Factor 2g3/3 - 110g*2/3 + 1456g/3 + 1568/3. 2(g - 28)2(g + 1)/3 Determine w, given that 2w4 - 4w*3 - 30w*2 - 8w + 40 = 0. -2, 1, 5 Solve 45w5 + 645w*4 - 490w*3 - 570w*2 + 445w - 75 = 0. -15, -1, 1/3, 1 Find a, given that -2a3/11 + 28a*2/11 + 62a/11 + 32/11 = 0. -1, 16 Let -9a5/5 - 138a*4/5 + 252a*3/5 - 54a*2/5 - 51a/5 = 0. What is a? -17, -1/3, 0, 1 Suppose -14r5 - 172r*4 - 468r*3 - 512r*2 - 238r - 36 = 0. Calculate r. -9, -1, -2/7 Solve -v*3 + 3v*2 - 2v = 0. 0, 1, 2 Find y, given that -27y5 + 108y*4 + 156y*3 - 78y*2 - 129y - 30 = 0. -1, -2/3, -1/3, 1, 5 Solve 8w4 + 21w*3 + 7w*2 - 6w = 0. -2, -1, 0, 3/8 Determine g so that 5g5 + 515g*4 - 1575g*3 + 1585g*2 - 530g = 0. -106, 0, 1 Let 4j2 + 1264j + 1260 = 0. Calculate j. -315, -1 Solve 5l4 - 2380l*3 + 290270l*2 - 1677900l + 2485125 = 0. 3, 235 Factor i*2 + 35i + 66. (i + 2)(i + 33) Solve -o3 + 22o*2 - 96o - 288 = 0 for o. -2, 12 Determine d so that -d*3/2 - 2811d*2 - 3953670d - 7896100 = 0. -2810, -2 Solve -9u3 + 33u*2 - 30u = 0 for u. 0, 5/3, 2 What is p in 5p2/2 + 22p - 9/2 = 0? -9, 1/5 Factor -4a2 - 2440a - 12100. -4(a + 5)(a + 605) Factor 2v3/11 - 96v*2/11 + 654v/11 - 560/11. 2(v - 40)(v - 7)(v - 1)/11 Factor 26c*4 + 62c*3 + 30c*2 - 22c - 16. 2(c + 1)3(13c - 8) Factor 3l*3/4 + 153l*2/4. 3l*2(l + 51)/4 Factor -32j4/15 + 112j*3/15 - 146j*2/15 + 28j/5 - 6/5. -2(j - 1)2(4j - 3)2/15 Find h, given that -2h*4 - 458h*3/3 - 146h*2/3 + 458h/3 + 152/3 = 0. -76, -1, -1/3, 1 Factor 25t5 - 40t*4 - 20t*3. 5t*3(t - 2)(5t + 2) Factor 3q3/2 - 15q*2/2 - 12q + 72. 3(q - 4)2(q + 3)/2 Suppose 672r5/17 + 3184r*4/17 + 1978r*3/17 - 78r*2/17 - 224r/17 - 32/17 = 0. Calculate r. -4, -4/7, -1/4, 1/3 Factor 4r4 - 80r*3 + 468r*2 - 648r. 4r(r - 9)*2(r - 2) Find r, given that 5r4 + 225r*3 + 1875r*2 + 4375r = 0. -35, -5, 0 Factor -h*5 - 58h*4 - 312h3. -h3(h + 6)(h + 52) Find z such that 4z5/5 - 8z*4/5 - 3z3/5 + z2 + 2z/5 = 0. -1/2, 0, 1, 2 Suppose -s3/2 + s2 + 89s/2 - 45 = 0. What is s? -9, 1, 10 Factor 25c3 + 515c*2 - 210c. 5c(c + 21)(5c - 2) Factor -4w4 - 16w*3 + 4w*2 + 16w. -4w(w - 1)(w + 1)(w + 4) Factor -q*3/7 - 2q*2/7 + 5q/7 + 6/7. -(q - 2)(q + 1)(q + 3)/7 Determine t so that -2t4/3 - 18t*3 - 500t*2/3 - 576t - 1280/3 = 0. -10, -8, -1 Solve n*2/4 + 1331n/2 + 1771561/4 = 0 for n. -1331 Suppose -2u2/9 + 4u - 10 = 0. What is u? 3, 15 Find w such that 2w4/3 + 48w*3 - 988w*2 + 5488w/3 - 890 = 0. -89, 1, 15 Determine i, given that -3i3/4 + 299i*2/4 + 51i/2 - 50 = 0. -1, 2/3, 100 Suppose -j*4/7 - 90j*3/7 - 2197j*2/7 - 7740j/7 - 7396/7 = 0. What is j? -43, -2 Factor 4p5/3 - 68p*4/3 + 64p*3/3. 4p*3(p - 16)(p - 1)/3 Suppose -1476x*4/7 + 27570x*3/7 - 18212x*2/7 + 3170x/7 - 36/7 = 0. What is x? 1/82, 1/3, 18 What is t in 5t3 + 20755t*2 + 21548875t + 21528125 = 0? -2075, -1 Factor 2r4 + 6r*3 - 60r*2 - 256r - 192. 2(r - 6)(r + 1)(r + 4)2 Factor d3/2 + 9d*2 + 54d + 108. (d + 6)3/2 Find l such that -l4/3 + 83l3/3 - 158l*2 + 932l/3 - 616/3 = 0. 2, 77 What is o in -5o4 + 20o*3 + 75o*2 - 90o = 0? -3, 0, 1, 6 Factor -28x3 - 64x*2 + 68x + 24. -4(x - 1)(x + 3)(7x + 2) Let -d*4/3 - 8d*3 - 128d2/3 = 0. Calculate d. -16, -8, 0 Factor -c4 + 5c3 + 4c*2 - 20c. -c(c - 5)(c - 2)(c + 2) Let -y5/2 + 2y4 - y3/2 - 3y2 = 0. What is y? -1, 0, 2, 3 Factor 2g*3/21 - 4g*2/3 - 64g/21. 2g(g - 16)(g + 2)/21 Factor 4y*3 - 88y*2 + 560y - 800. 4(y - 10)2(y - 2) Factor 2y5 + 2y*4 - 2y*3 - 2y*2. 2y*2(y - 1)(y + 1)2 Solve 4a*5/11 + 2a*4/11 - 4a*3/11 - 2a*2/11 = 0 for a. -1, -1/2, 0, 1 Factor -14c*2/13 - 310c/13 - 44/13. -2(c + 22)(7c + 1)/13 Factor -3f*3/4 - 3f*2/2 + 129f/4 - 30. -3(f - 5)(f - 1)(f + 8)/4 Determine k, given that 52k*2 + 540k - 352 = 0. -11, 8/13 Find b, given that -b*2 + 28b - 52 = 0. 2, 26 Factor 4r4 + 2288r*3 + 324888r*2 - 656656r + 329476. 4(r - 1)2(r + 287)2 Factor -c3 - 84c2 + 87c + 170. -(c - 2)(c + 1)(c + 85) Let -1683h4 - 951h*3 - 18h*2 = 0. What is h? -6/11, -1/51, 0 Factor 3f*5 - 1917f*4 + 305280f*3 + 307200f*2. 3f*2(f - 320)*2(f + 1) Factor -2a5/3 - 2a*4 + 6a*3 + 18a*2. -2a*2(a - 3)(a + 3)2/3 Determine u so that -3u*2 - 27u + 270 = 0. -15, 6 Suppose 48a3 - 70a*2 + 24a - 2 = 0. Calculate a. 1/8, 1/3, 1 Factor 2m5 + 34m*4 + 156m*3 + 280m*2 + 176m. 2m(m + 2)*3(m + 11) Factor 4r3/5 + 208r*2/5 + 1972r/5 - 20184/5. 4(r - 6)(r + 29)2/5 Factor k2/7 + 2831k/7 - 2832/7. (k - 1)(k + 2832)/7 Solve -4c4 - 52c*3 - 104c*2 + 160c = 0. -10, -4, 0, 1 Factor -32c2 + 228c - 328. -4(c - 2)(8c - 41) Factor 2u*4/17 + 562u*3/17 + 53544u*2/17 + 1811296u/17 + 7786880/17. 2(u + 5)(u + 92)*3/17 Solve 5b*5 - 55b*4 - 195b*3 + 895b*2 - 650b = 0 for b. -5, 0, 1, 2, 13 Factor -l*3 - 593l*2 - 1183l - 591. -(l + 1)*2(l + 591) Suppose z*5/3 + 5z*4/3 + 10z*3/3 + 10z*2/3 + 5z/3 + 1/3 = 0. Calculate z. -1 Determine t, given that 4t5 + 36t*4 + 20t*3 - 532t*2 - 1320t - 800 = 0. -5, -2, -1, 4 Suppose 4z2/7 - 24z/7 + 36/7 = 0. What is z? 3 Let 50a4 - 200a*3 - 2038a*2 - 1860a - 432 = 0. What is a? -4, -3/5, -2/5, 9 Factor 2p2/9 - 4280p/9 + 2289800/9. 2(p - 1070)2/9 Factor -f4/2 + f3 + 3f*2/2 - 2f - 2. -(f - 2)*2(f + 1)*2/2 Find c such that -2c*3 - 12c*2 - 16c = 0. -4, -2, 0 Let 2i5/7 + 64i*4/7 + 512i*3/7 = 0. What is i? -16, 0 Suppose 33z*4 - 42z*3 + 9z2 = 0. Calculate z. 0, 3/11, 1 Factor c5/3 + 13c4/3 + 40c*3/3 + 12c2. c2(c + 2)2(c + 9)/3 Suppose -4x5 + 332x*4 - 3624x*3 + 15768x*2 - 30996x + 23004 = 0. What is x? 3, 71 Factor 2p3/3 + 8p*2 + 14p + 20/3. 2(p + 1)2(p + 10)/3 Factor -2l3/11 + 6l*2/11 + 8l/11. -2l(l - 4)(l + 1)/11 Factor -r3/4 - 93r*2/4 + 47r/2. -r(r - 1)(r + 94)/4 Factor -d*4 + 10d*3 - 11d*2 - 70d. -d(d - 7)(d - 5)(d + 2) What is s in 14s*5 + 856s*4/3 + 342s*3 - 1484s*2/3 - 248s + 304/3 = 0? -19, -2, -2/3, 2/7, 1 Factor -5k3 - 5k*2 + 25k - 15. -5(k - 1)2(k + 3) Factor -5i3/3 - 20i*2/3 - 5i. -5i(i + 1)(i + 3)/3 Determine j, given that -j4/6 + 5j*3/3 - 4j*2 - 5j/3 + 25/6 = 0. -1, 1, 5 Let -58m2 + 2m/7 = 0. What is m? 0, 1/203 Let 2d2 + 36d + 162 = 0. What is d? -9 Factor 2i2/3 + 172i/3 + 3698/3. 2(i + 43)2/3 Factor -2s*3/7 - 12s*2/7 + 26s/7 + 12. -2(s - 3)(s + 2)(s + 7)/7 Let -2g*2/5 - 112g/5 = 0. What is g? -56, 0 Factor s*3/3 + 79s*2/3 + 533s + 507. (s + 1)(s + 39)2/3 Suppose -p4 + 11p*3 - 22p*2 - 60p + 72 = 0. What is p? -2, 1, 6 Determine k so that k*3/4 - 17k*2/4 + 25k/2 + 44 = 0. -2, 8, 11 Factor -2r3/5 + 26r*2/5. -2r*2(r - 13)/5 What is h in 14h5/5 + 78h*4/5 + 132h*3/5 + 68h*2/5 - 18h/5 - 18/5 = 0? -3, -1, 3/7 Find o, given that o*5/8 + 931o*4/8 + 219007o*3/8 + 1079257o*2/8 + 214832o + 214369/2 = 0. -463, -2, -1 Let -3h2 + 360h + 363 = 0. What is h? -1, 121 Let 2b4 + 174b*3 - 2b*2 - 174b = 0. What is b? -87, -1, 0, 1 Suppose m*4/8 - 29m**3/8 + 8	{ "pile_set_name": "DM Mathematics" }
et a(q) be the first derivative of q6/60 + q5/10 - 4q3/3 - q2/2 - 7. Let t(l) be the second derivative of a(l). Factor t(n). 2(n - 1)(n + 2)2 Let g = 18085/3 + -6028. Factor 0 + 0y*4 + 2/3y*2 + 0y + gy5 - y3. y2(y - 1)*2(y + 2)/3 Let z(j) be the first derivative of -j*4/30 - 692j*3/45 - 29929j*2/15 + 161. Factor z(c). -2c(c + 173)2/15 Suppose 161 = 3c + 5n, 3n = -3c + n + 158. Suppose -1 - 9f - 67f3 - 27f*2 + 4 + cf*3 = 0. What is f? -1, 1/5 Factor 16h*3 + 1749h*2 - 16h*3 - 1749h*2 + 3h*5 - 87h*4. 3h*4(h - 29) Let p(g) be the third derivative of 2/3g3 + 0 - 1/8g*4 + 0g + 21g2 - 1/60g*5. Find s, given that p(s) = 0. -4, 1 Let k = -7509/10 - -751. Find h, given that -1/10h + kh2 + 0 = 0. 0, 1 Let x be 2/4 - (-9)/2. Let d = -15132/35 - -2166/5. Factor dg*3 - 3/7g*4 - 3/7g*x + 0g + 0 + 0g2. -3g*3(g - 1)(g + 2)/7 Let t(m) = -2 - 13 + 14m*2 - 9m - 15m2. Let c be t(-6). Find s, given that -cs - 5s2 - s3 + 4s3 + s4 - s*5 + 5s = 0. -2, 0, 1 Factor -164s - s4 + 86s - 3s4 - 29s*2 + 21s*3 + 84s. -s(s - 3)(s - 2)(4s - 1) Suppose 5d + 0d = 10. Let f(k) = -k + 2. Let t be f(-1). Determine s so that -3s + s3 + 5s*d + 14s*2 - 10s*3 - t - 4s*2 = 0. -1/3, 1 Factor 42x + 6/5x2 + 396/5. 6(x + 2)(x + 33)/5 Let n(m) = m4 + m3 + m2 - m - 1. Let k(i) = i3 - 5i*3 + 6 + 6i - 931i2 + 925i*2 - 8i*4. Let r(j) = k(j) + 6n(j). Solve r(s) = 0. 0, 1 Let w(i) = i3 + i2 - i. Let p(u) be the third derivative of -u6/40 - u5/10 - u4/8 - u3 + 8u2. Let d(c) = p(c) + 6w(c). Solve d(y) = 0. -1, 2 Let v be (3/(-2))/(3/(-6)). Suppose -5f4 + 5f*v - 19f + 19f = 0. What is f? 0, 1 Let r be 10/82/5. Suppose 12p - 2 = 10p, -5u - 2p = -22. Solve rg2 + ug + 8 = 0 for g. -4 Let -65p2 + 9p - 50p3 + 0p - p + 212p3 - 7p2 = 0. Calculate p. 0, 2/9 Let o(v) be the second derivative of -v5/10 + v*4/3 + 41v*3/3 - 42v*2 - 108v. Suppose o(d) = 0. Calculate d. -6, 1, 7 Suppose 2q = -13n + 11n + 6, 0 = -2n + 4q + 12. Determine r so that 8/3r*3 + 4/3r + 0 + 10/3r2 + 2/3r*n = 0. -2, -1, 0 Let o be 935/561(-11 + 15)(-6)/(-20). Factor 0 + 20/9b + 4/9bo. 4b(b + 5)/9 Let c(b) be the second derivative of b5/70 + 2b*4/21 - 5b*3/21 + 2b + 22. Factor c(z). 2z(z - 1)(z + 5)/7 Let w(p) be the first derivative of 2/5p*2 - 1/5p*3 - 7/20p*4 + 0p + 20. Solve w(r) = 0 for r. -1, 0, 4/7 Let i be (-120)/32(11/(-10) + 1). Find y such that -i + 3/8y*2 - 3/8y*3 + 3/8y = 0. -1, 1 Suppose 0 = 2v - 5v - 9v. Let i(u) be the first derivative of -u3 + 9/2u*2 + vu - 4. Factor i(x). -3x(x - 3) Suppose -3d + 52 = -k, d + 0k - 12 = -k. Let f be (1(-4 - d/(-6)))/(-3). Factor 0l*3 + fl*2 - 2/9l + 0 - 4/9l4 + 2/9l*5. 2l(l - 1)3(l + 1)/9 Let c(t) be the third derivative of t5/420 + t4/12 + 4t3/7 - 150t*2. Factor c(h). (h + 2)(h + 12)/7 Suppose 3z - 25 + 1 = 0. Solve 12m*4 + 40 - 46m*2 + 52m*2 + zm*4 - 5m*5 - 56m*2 - 5m*3 + 20m = 0 for m. -1, 2 Let l(y) be the first derivative of -120y2 + 144y - 13 + 4/5y5 + 10y*4 + 52/3y*3. What is f in l(f) = 0? -6, 1 Let a = -8 + 12. Suppose ax + 8 = 2d + 2d, -4d - 3x + 8 = 0. Factor -4 - 2r3 + 42r*2 + d - 40r*2 + 2r. -2(r - 1)2(r + 1) Let m(b) be the third derivative of -b*5/270 - 5b*4/108 + 2b*3/9 - 82b*2. Factor m(z). -2(z - 1)(z + 6)/9 Let l = 1181/150 + -47/6. Let b(k) be the second derivative of 1/75k*6 + 0 - lk*5 + 0k*2 + 6k + 0k3 + 1/30k*4. Factor b(n). 2n*2(n - 1)*2/5 Let p(g) be the first derivative of -3g*5/5 + 15g*4/4 - 6g*3 - 6g*2 + 24g - 137. Factor p(m). -3(m - 2)3(m + 1) Let r(b) be the first derivative of 8 + 1/51b6 + 8/85b*5 + 5/34b*4 + 4/51b*3 + 0b + 0b2. Factor r(v). 2v*2(v + 1)*2(v + 2)/17 Factor -2646/5 - 888/5s2 + 9513/5s + 21/5s3. 3(s - 21)*2(7s - 2)/5 Let z(l) be the second derivative of -l6/60 - l5/40 + l4/12 + 44l. Suppose z(p) = 0. What is p? -2, 0, 1 Let q = 15 + -13. Let 40 - 193u5 - 1205u*3 + 8u*2 - 130u + 470u + 68u*5 + 700u*4 + 422u*q = 0. What is u? -1/5, 2 Factor -22 - 22c*2 + 32 + 38 - 20c. -2(c + 2)(11c - 12) Factor -16/5 - 14/5f + 2/5f2. 2(f - 8)(f + 1)/5 Suppose 2m + 6 = 0, 4m = 3g - 2g + 8. Let n be (5/g)/((-1)/(-2))0. Factor 3/2 + nu - 3/2u*2. -3(u - 1)(u + 1)/2 Let i(g) be the first derivative of 2g*6/3 - 68g*5/5 + 80g*4 - 256g*3/3 - 352. Factor i(w). 4w*2(w - 8)*2(w - 1) Let s be (-2(-24)/(-36))/(-4). Let p(r) be the first derivative of 1/9r*3 + sr*2 + 1 + 0r. Factor p(a). a(a + 2)/3 Let j(t) be the third derivative of -7t*6/10 + 4t5/3 + t4/2 - 4t3/3 - 21t*2 + 3. Factor j(i). -4(i - 1)(3i + 1)(7i - 2) Let -4/5z2 - 36/5 - 1/5z*3 + 41/5z = 0. What is z? -9, 1, 4 Let k(o) be the second derivative of o*6/120 + 3o*5/40 + 2o*3/3 - 9o. Let r(m) be the second derivative of k(m). Factor r(s). 3s(s + 3) Suppose 0g = -2h + 3g + 26, 39 = 5h - g. Suppose 3t5 - 10t*2 + ht*4 + 3 + 4t*2 + 3t - 4t4 + 0t*5 - 6t*3 = 0. What is t? -1, 1 Let f(j) = 8j*2 - 53j + 24. Let t(q) = 5q2 - 35q + 15. Let y(n) = -5f(n) + 7t(n). Factor y(z). -5(z - 3)(z - 1) Let c(r) be the first derivative of -2r3/45 + 154r*2/15 - 11858r/15 + 106. Suppose c(x) = 0. What is x? 77 Let g(y) be the second derivative of -y4/48 - y3/24 - y - 135. Factor g(h). -h(h + 1)/4 Suppose 0 = w + w - x + 1, -w + 4x - 4 = 0. Suppose 5f - 30 = -w. Factor -fj - 6j3 - 3j*4 + 3j*2 + 0j + 12j. -3j(j - 1)(j + 1)(j + 2) Let i(p) = -2 + 5p + 68p2 - 9p*3 - 73p*2 + 10p*3. Let l be i(4). Factor 2/15o*3 - 2/15o + 2/15ol - 2/15. 2(o - 1)(o + 1)2/15 Let j(i) = -3i*2 + 21i + 26. Let v be j(8). Let k = -1 + 1. Determine y so that kyv + 2/5y*4 + 4/5y - 2/5 - 4/5y3 = 0. -1, 1 Let v(k) = -21k*3 - 23k*2 + 101k - 82. Let a(g) = -33g3 - 35g*2 + 152g - 124. Let y(t) = 5a(t) - 8v(t). Determine q so that y(q) = 0. -6, 1, 2 Let p(n) be the first derivative of -n*6/4 - 3n*5/5 + 3n4/8 + n3 + 41. Suppose p(w) = 0. What is w? -2, -1, 0, 1 Let l = 105 - 88. Factor t + 26t2 - lt*2 + 0t*3 + 5t + 3t3. 3t(t + 1)(t + 2) Let y(b) = -10b2 + 36b - 8. Let k(h) = h*2 + 5h - 11. Let w be k(-6). Let l(x) = -11x2 + 36x - 8. Let f(a) = wy(a) + 6l(a). Let f(u) = 0. What is u? 1/4, 2 Let b(d) be the first derivative of -d*4/7 + 32d*3/7 + 50d*2/7 + 226. Factor b(x). -4x(x - 25)(x + 1)/7 Let k(j) be the third derivative of -j*7/945 - 11j*6/180 - 197j*5/270 - 133j*4/36 - 26j*3/3 + 2j*2 - 389. Determine w, given that k(w) = 0. -26, -3, -1 Let q(f) = -13f*3 + 76f*2 + 150f - 150. Let r(y) = 25y3 - 152y*2 - 302y + 302. Let w(u) = 7q(u) + 3r(u). Factor w(z). -4(z - 6)(z + 2)(4z - 3) What is r in 118r - 13r*2 + 2r - 13r2 - 20 - 29r2 = 0? 2/11, 2 Let n(g) be the first derivative of g5/50 + g4/15 + g3/15 - 12g + 13. Let x(q) be the first derivative of n(q). Determine i, given that x(i) = 0. -1, 0 Factor 7347o + 61590 - 2271 + 3o4 + 11623o*2 - 9049o*2 + 144o*3 + 12933o. 3(o + 9)(o + 13)3 Let f(l) be the first derivative of -l6/9 + 16l5/15 - 23l*4/6 + 56l*3/9 - 4l*2 + 99. Determine w so that f(w) = 0. 0, 1, 2, 3 Let f(c) be the first derivative of -3c*4/4 - 6c*3 - 27c*2/2 - 12c + 20. Factor f(q). -3(q + 1)2(q + 4) Factor 68n3 + 4n*4 - 16n + 22n4 + 15n*4 + 19n*4 - 112n*2. 4n(n - 1)(n + 2)(15n + 2) Let c(b) be the second derivative of 17b + 1/60b*6 + 1/8b*2 - 5/48b*3 - 1/8b*4 - 1/160b5 + 0. Determine w so that c(w) = 0. -1, 1/4, 2 Let d(n) be the second derivative of -n5/20 - n*4/12 + 7n*3/2 + 45n*2/2 - 187n. Determine t, given that d(t) = 0. -3, 5 Let b(w) = -24w2 + 42w - 7. Let p(q) = -12q2 + 21q - 3. Let l(s) = -s + 4. Let k be l(-7). Let a(o) = kp(o) - 6b(o). Factor a(h). 3(h - 1)(4h - 3) Let o(y) = 4y*5 - 19y*4 + 15y3 + y2 - y. Let z(r) = r5 - r4 + r**2 - r. Let u(n) = o(n) - z(n). Factor u(i)	{ "pile_set_name": "DM Mathematics" }
-6a5568 -743493 (base 13) to base 2 -1010011000001110101010 1100000010001101111100 (base 2) to base 9 5837526 5017c (base 14) to base 7 1430615 What is 1025533 (base 8) in base 7? 2215425 Convert -9b65b9 (base 15) to base 5. -3344202144 What is -22501454 (base 6) in base 15? -da28d Convert 1788a6 (base 11) to base 6. 5522222 Convert 238156 (base 12) to base 15. b50a6 Convert 30413252 (base 6) to base 8. 3251000 141844 (base 10) to base 11 9762a What is 32241221 (base 5) in base 7? 2222320 -33790 (base 11) to base 10 -48862 -1e47d (base 16) to base 11 -85204 -91839 (base 11) to base 7 -1065664 What is -102122012210 (base 4) in base 3? -100002011100112 What is 18a229 (base 11) in base 15? 5b6ac -1100100111100001 (base 2) to base 15 -104a6 11001110000001111 (base 2) to base 10 105487 What is 110201120 (base 3) in base 16? 243c Convert 73119 (base 12) to base 15. 2e8d6 What is -173346 (base 11) in base 3? -111121112212 What is -3121 (base 6) in base 9? -854 Convert 10011110101000011 (base 2) to base 5. 10044334 What is 1f201c (base 16) in base 12? 824564 Convert 10524217 (base 8) to base 7. 25210041 146cd6 (base 14) to base 13 1bb513 -43534545 (base 6) to base 7 -14036306 What is 1121002021100 (base 3) in base 14? 181093 -9cbc2 (base 15) to base 11 -310819 -1395316 (base 11) to base 13 -65a5aa What is 21101112 (base 3) in base 12? 314b Convert -12524105 (base 6) to base 2. -1100101011110001001 What is -896a54 (base 13) in base 7? -36362604 Convert -11111100101111 (base 2) to base 4. -3330233 -4e071 (base 15) to base 5 -30443411 What is 10607832 (base 9) in base 16? 4e7a03 Convert -1830837 (base 10) to base 13. -4c1448 What is -111010110101101 (base 2) in base 4? -13112231 Convert 36143131 (base 7) to base 8. 14161702 -1267511 (base 11) to base 5 -1030111233 What is -1faeb (base 16) in base 3? -20121000100 16166 (base 9) to base 3 120012020 -4a1c (base 14) to base 9 -18702 Convert 96b6d (base 14) to base 15. 72ec6 -64747 (base 10) to base 4 -33303223 -44744 (base 13) to base 11 -85404 What is -1236697 (base 10) in base 14? -242997 Convert -149262 (base 10) to base 16. -2470e 173286 (base 11) to base 12 10b023 What is 6851418 (base 9) in base 15? 4cebc8 Convert -350204 (base 9) to base 16. -334c6 What is 12000120210 (base 4) in base 5? 400340221 -18a46a (base 13) to base 8 -2277663 Convert 9a266 (base 14) to base 4. 1123032202 What is 19aaa9 (base 11) in base 14? 80095 121121013221 (base 4) to base 14 c53b97 What is -1591759 (base 10) in base 7? -16346461 What is -4260330 (base 7) in base 2? -1111110101010000000 Convert -22300 (base 12) to base 9. -68200 596062 (base 14) to base 9 5660670 -259 (base 16) to base 8 -1131 What is 2286387 (base 9) in base 7? 13344544 -17932d3 (base 15) to base 9 -35273400 What is 20221122100212 (base 3) in base 6? 211054552 What is -2aa643 (base 15) in base 4? -13312332003 Convert 22701520 (base 8) to base 11. 2880134 What is -1a29098 (base 14) in base 8? -61501036 838c6 (base 16) to base 5 114220242 What is -1b6c43 (base 16) in base 5? -430002222 2001210022 (base 3) to base 13 15686 Convert 143d64 (base 15) to base 3. 1211112110211 -32207825 (base 9) to base 15 -156d25b What is -351204 (base 6) in base 15? -8dba What is 559580 (base 12) in base 6? 45123440 1526891 (base 12) to base 9 8047451 What is 4237644 (base 8) in base 12? 466204 Convert 73b2 (base 12) to base 10. 12662 What is 89845 (base 13) in base 10? 249670 What is -2011221223 (base 4) in base 5? -120004220 What is 201011112012 (base 3) in base 6? 12030352 -30631466 (base 9) to base 10 -14723997 What is -1051552551 (base 6) in base 5? -10430220120 Convert 2100130310 (base 4) to base 16. 90734 What is 4222313411 (base 5) in base 16? 8626b3 Convert -23142177 (base 8) to base 13. -1071c60 What is 1001001001101110101000 (base 2) in base 15? 325cce 16532162 (base 7) to base 12 662412 Convert 16520453 (base 7) to base 3. 10001020011202 Convert -11001010010001110100 (base 2) to base 9. -1502471 Convert 111110111010101110100010 (base 2) to base 5. 13210242344 What is 12050132 (base 6) in base 16? 5cb88 1b5983a (base 12) to base 2 10110010010101001101110 -2b0a (base 12) to base 15 -176a 2153645 (base 11) to base 9 7104114 Convert -678401 (base 9) to base 5. -101001003 Convert -4143323 (base 6) to base 3. -101011211120 What is -27338 (base 13) in base 2? -10001110101011111 What is -9144835 (base 10) in base 14? -1300947 Convert -1011033400 (base 5) to base 10. -2049225 37423b (base 14) to base 10 1893805 1202122010002 (base 3) to base 11 590463 225278 (base 10) to base 15 46b38 Convert -156306 (base 8) to base 16. -dcc6 344210224 (base 5) to base 10 1553814 Convert 24033143 (base 5) to base 10. 221048 What is 2103313002 (base 4) in base 8? 2236702 What is -81bd92 (base 14) in base 16? -42bd6c -12100221102001 (base 3) to base 9 -5327361 -2002132302 (base 4) to base 15 -a8550 d131e (base 16) to base 11 535856 Convert 121121111221 (base 3) to base 4. 1033310320 Convert 58777 (base 15) to base 9. 468514 Convert -432001 (base 12) to base 8. -4030201 What is -6c21c (base 13) in base 14? -52297 Convert -61603652 (base 7) to base 11. -2a05688 Convert 11000000111110010110100 (base 2) to base 9. 12807037 Convert 100011200 (base 4) to base 12. 32168 Convert -2a546 (base 11) to base 14. -11a91 What is -79149 (base 11) in base 3? -12211020221 What is 2400132123 (base 5) in base 3? 101022002222011 44145 (base 12) to base 15 1ba38 Convert -1154321 (base 9) to base 16. -98f29 -1935523 (base 11) to base 13 -8a753b Convert 22243043 (base 6) to base 10. 674595 What is -1b9ed (base 15) in base 6? -1532354 2442123240 (base 5) to base 15 79d9b5 What is 84417b (base 12) in base 3? 10220201020212 What is 203241535 (base 6) in base 8? 15333543 What is -371070 (base 9) in base 6? -4444230 Convert 10232021204 (base 5) to base 15. e391d9 What is -26dc3 (base 14) in base 13? -3491a -631a3 (base 14) to base 5 -30122232 Convert 2029923 (base 11) to base 4. 31223113121 What is 3ce45 (base 15) in base 4? 233300012 Convert 1716055 (base 9) to base 14. 1ac453 What is 216584 (base 9) in base 12? 62b4a What is 168f0 (base 16) in base 2? 10110100011110000 Convert 8c7513 (base 13) to base 12. 1146830 What is 196817 (base 12) in base 2? 1101101001000010011 128744 (base 9) to base 6 1403534 Convert -24143024 (base 6) to base 7. -6314044 1101010001101010011110 (base 2) to base 9 6483863 Convert 22103222 (base 5) to base 6. 4032314 -2473532 (base 10) to base 7 -30011315 -436633 (base 14) to base 11 -13201a2 What is 670531 (base 9) in base 14? a6022 What is 11123313312 (base 4) in base 7? 15053121 Convert -1302615 (base 7) to base 16. -29466 What is 3663c6 (base 13) in base 10? 1299096 Convert -32045 (base 10) to base 3. -1121221212 What is 356215 (base 7) in base 13? 2352a -6805 (base 10) to base 6 -51301 What is -4439a (base 12) in base 9? -147011 Convert -3f5f4b (base 16) to base 10. -4153163 What is -be1c24 (base 15) in base 10? -9067984 -19949 (base 15) to base 7 -464154 Convert 52827 (base 10) to base 13. 1b078 -2154432 (base 8) to base 10 -579866 Convert -1fe99d (base 16) to base 14. -3c6273 Convert -540191 (base 11) to base 14. -186c52 What is 4467683 (base 9) in base 14? 46927c What is 23818 (base 14) in base 11? 5a117 -2886208 (base 9) to base 7 -16351202 -100100000100001010110 (base 2) to base 8 -4404126 Convert -37d90 (base 14) to base 5. -13342010 199179b (base 12) to base 13 1177919 What is 92154 (base 10) in base 3? 11200102010 Convert 331503533 (base 6) to base 11. 3404695 What is -2200020 (base 3) in base 10? -1950 Convert -25661871 (base 9) to base 16. -c08a04 -100100010101001011100 (base 2) to base 13 -328b44 Convert 12327257 (base 8) to base 6. 134314423 -221473 (base 9) to base 16 -204f3 What is -3883434 (base 11) in base 10? -6724733 Convert a2ab (base 14) to base 10. 27983 What is -316584 (base 9) in base 15? -3ad0d What is 15745437 (base 8) in base 15? 4c3604 What is 384b6b (base 14) in base 2? 111011000001011001011 Convert -2011ad (base 16) to base 3. -10221202221220 What is -227133 (base 9) in base 11? -93561 Convert 1a02014 (base 12) to base 13. 119a3b5 -33111323233 (base 4) to base 6 -222112211 -212121001222 (base 3) to base 4 -1301120222 What is -17000 (base 14) in base 6? -1122	{ "pile_set_name": "DM Mathematics" }
mc3 + u and give m. -13 Rearrange 2x*4 - 1839x*2 + 1 + 1841x*2 - 2 - 3x to tx2 + mx*4 + i + kx + jx3 and give t. 2 Express u2 + 0u*2 - 2u + 2u3 - 7 + 8 as tu*2 + iu*3 + o + zu and give i. 2 Rearrange -3 + d + 4 - 4d2 + 4d*2 - 3d*2 + 2d*4 to c + ad*2 + hd*3 + xd*4 + yd and give y. 1 Rearrange 4z - 5z*2 - z - 9z + 7z2 to the form qz*2 + hz + y and give q. 2 Rearrange d - 3769d2 - d + 3819d*2 to l + td + wd2 and give w. 50 Rearrange -5p + 0p + 6p*2 + 4p - 3p2 to np*2 + lp + y and give n. 3 Rearrange -8 + 8 - q - 24q to bq + k and give b. -25 Express (0a + 3a - 2a)(a*2 - 3a*2 + 0a*2) + 4a*2 - 2a*3 - 4a*2 - 10a*3 - 7 + 4 + 25a*3 in the form c + qa*2 + ja*3 + pa and give p. 0 Express -3d - 2d + 14d2 + 3d as ad + td*2 + u and give a. -2 Rearrange -12 - 1 - 2h + 7 to the form i + ph and give p. -2 Express -15d + 25d + 5d*2 - 13d*2 - 13d as sd2 + id + x and give x. 0 Rearrange (16r + r + 15r)(-3 + 1 + 1) + 4r - 5r + 0r + 2r - r - 2r + (r + 3 - 3)(1 - 1 - 1) to l + qr and give q. -35 Express 4u + 0u + u*3 - 2u - 2u2 as z + ou*3 + nu*2 + su and give s. 2 Rearrange 2 + n*3 + 2 + 2n2 - 8 + 1 + n4 to the form z + wn4 + in*2 + ln + sn3 and give i. 2 Rearrange 27d*2 - 14d*2 + 14d*2 to nd*2 + cd + o and give n. 27 Express 4z2 - 13z + 0z2 - 2z3 - z2 - 5z2 as k + pz*3 + oz*2 + xz and give x. -13 Express -3 + 3c4 + 16c*3 + 2c + 0 - 16c3 as j + lc*3 + pc*2 + mc*4 + oc and give p. 0 Express (2 - 2 - q)(30q - 36q + 52q) in the form l + sq2 + gq and give s. -46 Express (-1 + 1 + 2v)(-2v + 2 - 2 + (-2v - 3v + 3v)(-5 + 1 + 0) + 0v - 5v + 3v + (-4 - 3 + 5)(-v - v + 3v)) as nv2 + b + tv and give n. 4 Express (0i - 2i - i)(7 - 5 - 29) as pi + v and give v. 0 Express 11j - 18j + 10j in the form b + oj and give o. 3 Express (3 + 2 - 3)(0 + 0 - 2)(-13i3 + 32i - 32i)(2 - 2 - 1 + (-2 + 2 - 2)(3 - 2 + 0) - 4 + 3 + 3) in the form n + si + oi3 + ri*2 and give o. -52 Express 2059 - 2059 + 23x as r + tx and give t. 23 Express -18o*3 + 8o*3 - 3o*3 + (-4o*2 + 5o*2 - 2o*2)(4o - 4o + o) - o*3 + 2o*3 - 2o*3 as b + io + do3 + xo*2 and give i. 0 Express (2y - 2y + y)(-34 - 53 + 54) as d + qy and give q. -33 Rearrange 9q*2 + q - 11q2 + q4 - 2 + q*4 to sq*4 + fq*3 + xq + l + vq2 and give l. -2 Express (4r + 26r - r)(-1 + r*3 + 1) in the form nr*2 + o + hr*4 + br*3 + lr and give h. 29 Express (-1 + 5 - 1)(-2 + 2 - 2n)(-12n + 0n - 2n - 2) as v + sn + an*2 and give a. 84 Express -170z - 3z2 - 7 + 167z - z*2 in the form nz + wz2 + k and give n. -3 Express -9p - p - 5 - 4p + 11p in the form wp + o and give o. -5 Express (3 - 4 + 0)(142b2 - 23b*2 + 3b*2) as ob + pb2 + k and give p. -122 Rearrange 0 - 2s - 3 + 15 + 6 to rs + u and give u. 18 Rearrange (y3 + 23y - 24y + 2y*3)(38 + 11 + 1) to the form q + py2 + hy + jy3 and give j. 150 Express d4 - d2 - 2d + 2d - 5 in the form u + hd + jd4 + td*2 + rd*3 and give t. -1 Express (0 + 0 - 5)(3z + z2 - 3z)(-4z + 5z + 7z) in the form pz2 + wz + f + lz3 and give l. -40 Express 7j*2 - 3j*2 + 2j*2 as dj + kj2 + s and give k. 6 Rearrange (-4l + l + 2l)(-l3 + l2 - l*2) - 10l*3 + 3l*4 + 10l*3 to the form xl*3 + yl + cl4 + j + bl*2 and give b. 0 Rearrange -33x - 15x + 92x + 70x to vx + n and give v. 114 Rearrange (1 - 1 - t)(-3 + 4 + 2) to the form yt + f and give f. 0 Rearrange 4u2 - 2u*2 + 983u*3 - 962u*3 - 3u*2 to hu*2 + lu + o + xu3 and give x. 21 Rearrange (-2c3 - c3 + 2c3)(17c - 2c - 3 - 11c) to zc*4 + uc + w + ac2 + vc*3 and give z. -4 Express 3v*3 - 34 + 14v*2 + 23v*2 - 37v*2 in the form a + lv*2 + kv + xv3 and give a. -34 Express 8 + 10g - 8 as ag + w and give a. 10 Rearrange -51p - 6675 + 6675 to the form z + ip and give i. -51 Express -p - 2p*3 + p + (0p*2 - 3p*2 + 2p*2)(2p - 3 + 3) - 22p*3 + 87p*2 - 87p*2 as bp*2 + r + fp + wp3 and give w. -26 Express -w4 + w3 + 2 + 0w*2 - 2w*2 - 3w*3 + 1 as rw + g + aw3 + dw*2 + hw*4 and give g. 3 Express -10v*2 + 1 + 0 + 5v*2 - 3 as tv*2 + h + bv and give t. -5 Rearrange (-2z2 - 4z*2 + 5z*2)(3 - 1 - 1)(-3 - 2 + 3)(1 + 0 + 1) to the form m + lz2 + hz and give l. 4 Rearrange -3n3 + 14 + n3 - 3 to the form vn*3 + j + sn + bn2 and give v. -2 Rearrange (35i*2 + 1162 - 1162)(-1 - 1 + 0) to the form ui + n + ji*2 and give j. -70 Rearrange 3c*2 - 6 - 7c - 1 + 6 to the form x + fc + lc*2 and give f. -7 Rearrange 716x + 13 + x*2 - 718x - x*3 + 3x*3 to the form nx + t + gx2 + bx*3 and give n. -2 Rearrange -21s + 4s + 3s + 10 + s to the form q + zs and give q. 10 Rearrange -2i + 3 - 6 + 15 - 17i2 - 10 to the form p + wi*2 + oi and give w. -17 Rearrange -5l - 14l*4 - 2l*3 + 27l4 + l - l2 - 1 + 2l to the form gl*4 + zl*3 + ml + dl2 + i and give z. -2 Express 0o + 2 + 2o - 2o3 + o3 - o as mo2 + ho*3 + po + y and give y. 2 Rearrange 2t4 + 5t + 2t2 - 2t*2 + 5t*2 + 6t*3 - 7t*2 to ot + qt2 + dt*4 + f + xt*3 and give q. -2 Rearrange -8g*4 + 7g*4 + 11g*4 + (0g*2 + 2g*2 - 3g*2)(4g2 - g + g) to mg*4 + bg*2 + yg*3 + wg + i and give m. 6 Rearrange 4 - 2c - 5 + 1 to the form ac + w and give a. -2 Rearrange (0 - 2 - 4m + 6m)(6m + 54 - 54) to qm + dm*2 + s and give d. 12 Rearrange -2x2 + 62 + x3 - 6x3 - 67 - x + 2x to lx3 + h + nx*2 + ox and give n. -2 Rearrange (-3 + 1 + 4)(15 - d - 2 + 1) to the form rd + v and give v. 28 Express -8a3 - 2 + 7a*3 + 26a*2 - 29a*2 + a in the form ba*2 + g + qa + ua3 and give q. 1 Rearrange (-3k - 4k + 5k)(-3 + 3 - 8k + (0 + 2 - 1)(-2k + 3k - 3k)) - k + k - 4k2 to zk + s + nk2 and give n. 16 Express 2q2 - q4 + 3q3 + 6q - 9q3 - 5q as pq3 + k + zq*4 + dq*2 + mq and give p. -6 Express -8j3 + 34j*3 - 21 - 18j*3 - 10j*3 in the form pj*3 + kj*2 + lj + d and give d. -21 Express 40n - 17n - 4n in the form cn + w and give c. 19 Express -k*4 + 0k*2 + 3k + 2k3 + k2 - 7k + 6k as wk*2 + pk + b + sk4 + ck*3 and give p. 2 Express 1 - 4 + 5 + 92i - 3 in the form j + ki and give j. -1 Rearrange -4o*3 - 3o*3 + 2o3 + (o2 - 3o2 + 3o*2)(0 + 4o - 3o + 2) to the form fo2 + t + do + bo3 and give f. 2 Express -7 + 7t*3 + 2t*3 + 0t*3 - 8t*3 in the form gt*3 + nt*2 + at + x and give g. 1 Rearrange 0 + 3g - 40 - g to the form lg + t and give l. 2 Rearrange -6 + 4q + 5 + 2q to mq + r and give m. 6 Express 2 + 3f + 0 - 3 - f*3 in the form pf*2 + jf*3 + r + mf and give r. -1 Express -b*3 + 2 + 4b*3 - 2b*3 as sb*3 + d + rb*2 + kb and give d. 2 Rearrange -q2 - 11 + 27 - 16 + q3 to vq2 + i + tq + yq3 and give v. -1 Express 5f*2 + 729 + f - 729 in the form xf*2 + sf + b and give x. 5 Rearrange m2 + m2 - 4m2 + 4m*2 - 4m*2 + 2m*2 + (14 - 14 - 9m)(-2m + 0m + 3m) - m2 - m2 + 0m2 to the form h + km + gm2 and give g. -11 Rearrange -5y + 0y - y4 + y + 7y + y*3 to the form sy*2 + x + ky*4 + ry*3 + uy and give k. -1 Express 0a - 1 - 21a*2 + 19a*2 - 3a in the form wa + qa*2 + l and give q. -2 Rearrange -4 - 2v + 4 + 3v2 + (-v + 3v*2 + v)(0 + 4 + 0) to the form ov + t + hv*2 and give t. 0 Rearrange 16 + 4h - 9h + 6h to kh + w and give w. 16 Express 0 - 4d3 + d3 - 2 + (-5d2 + 2d*2 + 5d*2)(0d + 2d - 4d) + 28d - 56d - 10d*3 + 26d as id2 + hd*3 + g + xd and give g. -2 Express -50q4 - 5q*4 - 127q*4 + 9q4 + (4 - 4 - q2)(q2 + 2q*2 - 5q*2) in the form cq*3 + t + dq + rq4 + iq2 and give r. -171 Express p3 + 0 + 0 + 2 + 2p2 + p4 - 4 - 2p as xp2 + vp*4 + kp*3 + w + yp and give v. 1 Express -12m - 5m + 22m in the form x + km and give k. 5 Express -s + 0s + 3s + s as w*s + f	{ "pile_set_name": "DM Mathematics" }
olve -4k + 32 = 3l, 209l = -53k + 205l - 5 for k. -1 Solve 21f - 19f + 32 = 4h, -4h - 1 + 49 = -4f for h. 4 Solve m = 5y - 4, -2y = 4m + 7 - 10 - 3 for m. 1 Solve -12i = -9o + 5o + 11o - 103, 1 = 2i + 3o - 18 for i. 8 Solve 6p + p = -w + 2p + 160, -32p + 2112 = 34p for w. 0 Solve -5o + 4o + 31 = j - 28 + 65, 7o = j - 26 for j. -2 Solve -m - 8086 = 3y - 8072, m + 13 = -4y for m. -17 Solve -28a = -q + 167, -5a + 2q - 63 + 35 = 0 for a. -6 Solve -23 = -314g + 315g + s, 2g + 14s = -358 for g. 3 Solve 28z - 34z = 3a - 2a + 3a - 18, -a - 2 = -5z for a. 3 Solve -92 = -6g + 4w, -514g = -518g + 12w + 304 for g. -2 Solve -a - 6 = 12a - 5a - 11a - v, 6a - 5v + 9 = 0 for a. 1 Solve -2v + 325 + 238 = 119l, -v + 4 = 4l for l. 5 Solve 82 = 4r + 2q, 3r + 132 = 63708q - 63705q for r. -1 Solve 0o - 4o = -5u + 2o - 49, 2o + 70896 = 5u + 70949 for u. -11 Solve 4v = 22b - 25b + 8 - 43, 2v = 152b + 750 for b. -5 Solve b + 13 = -5a, 60697 = 5a + 3b + 60696 for a. -4 Solve 17 = -4p + 5n, -3p = -41483n + 41516n - 171 for p. 2 Solve 4l - 456 = 45n - 342, 9l + n - 52 = 0 for l. 6 Solve 0 = -12h - 13h + 2m - 147, 5h - 4h + 0h + 3m = 28 for h. -5 Solve 0 = -41w - 4v - 1143 + 1639, 4w - 50 = -2v for w. 12 Solve -d + 15 = 11r + 11, 0 = 3r + 5d + 136 for r. 3 Solve 2b + 0b - 2q = q + 33, 0 = -45q + 51q - 6 for b. 18 Solve 1351234w - 1351239w = -6i + 83, -i = 3w + 59 for w. -19 Solve -13w + 3d = 39 - 14 - 24, 2w + 2d = 4d - 14 for w. 2 Solve 3s - 90 = -l, 2l = 2s + 12823 - 12891 for l. -3 Solve -1322l = 3w - 1311l - 148, -4w - 7l + 90 = 0 for w. -2 Solve -77u - 202 = -26g - 74u, -16 = -g - 4u for g. 8 Solve 194k = 103d - 108d + 197k + 120, d + 5k + 4 = 0 for d. 21 Solve -64 = -1752c + 1751c + 6m, -4m - 42 = -c for c. -2 Solve -40 = 5c + 3i, -58c + 59c - 40i = 195 for c. -5 Solve x + 2b = -12, -1394730x = -1394726x + b + 20 for x. -4 Solve -5p = 5, -14f + 65 - 16 + 110 = -5p for f. 11 Solve -9i = -3u - 96, -5i + 48 = 14u + 53 - 27 for i. 10 Solve -x + l = 4, -1026x + 1027x + 14 = 3l for x. 1 Solve 362h + 5c + 167 = 354h, 4h = -2c - 66 for h. 1 Solve -f + 889350d = 889353d - 59, -5d + 59 = f for f. 59 Solve 2m = -4y + 280, 697 = -m + 4y + 423 for m. 2 Solve 4f - 3y = -9, -2f - 331113 + 331110 = -3y for f. -3 Solve 2o - 16177 + 16196 = q, 0 = -5o + 5q - 75 for o. -4 Solve 2f - 2c = 2c + 14, -2c + 12 = -4f + 4 for f. -5 Solve 21t + 4o = 17t - 16, -4t = -0t + 17o + 42 for t. -2 Solve -49122s + 49118s - 4d - 196 = 0, s - 8d + 28 = -3 for s. -47 Solve 9 = -2b - 1, 0 = -0j - 30j - 10b + 119 - 53 + 184 for j. 10 Solve -222f + 3l - 20 - 49 = -225f, 4f - 71 = 3l for f. 20 Solve -5h + 35 = -12h, 5h - 789 = 4i - 838 for i. 6 Solve -4374b + 4376b + 3s = -8, -s = -43b + 221 for b. 5 Solve -63 = 5r + t - 2t, -r - 60 = -2r + 695t - 741t + 66 for r. -12 Solve -3d = -2j + 3d - 3d + d - 60, -8j - 5d - 177 = 0 for j. -24 Solve -8m + 5w = 449, 2m - 7m - 2w - 218 = 78 for m. -58 Solve -4x - 3i + 5 = 0, 63x - 531i + 533i - 221 - 78 = 6 for x. 5 Solve 0 = 5k + 5d + 75, -2k + 3k + 219d = 222d - 11 for k. -14 Solve -167641 = -29m - 5o - 167705, -3m - 2o + 1 - 18 = 0 for m. -1 Solve 82z + 2l = 162z - 82z + 12, 0 = -l - l - 8 for z. 10 Solve 25 = -4y - 3h, 2y + h - 338 + 345 = 0 for y. 2 Solve -2f = 4q + 2, 0 = -5734q + 5736q - 2f - 8 for q. 1 Solve -4o + 5z - 33 = -6o + 8z, -o - 654 = -0o + 3o + 74z for o. 3 Solve 5j - 522 = 19c, 5j = c - 4 + 29 - 7 for c. -28 Solve 681u + 3z = 689u + 125, -3u - 136 = -4z for u. -4 Solve 92b + 27 = -m + 93b + 43, 0 = -3m - 4b + 62 for m. 18 Solve -u - 4387h = -4384h + 5, 4u + h = 2 for u. 1 Solve -35 = 5i - h, 4h = -3i - 780945 + 780901 for i. -8 Solve w = 3n - 46, 0 = -10w + n + 15688 - 16061 for w. -37 Solve -3j + 851h = 424h + 415h - 75, j = -4h + 1 for j. 13 Solve -4d + 10 + 2 = -k, 0 = -k + 500d - 540 - 2811 + 859 for k. 8 Solve 2404s = 2407s - 6, -29t + 9s = -34t + 38 for t. 4 Solve 1691569n + 15 = -5i + 1691573n, -3i + 2n = 7 for i. 1 Solve -3y + y + 35 = -5q - 146, -25q + 118 = y for y. 93 Solve 6 = -3s, 4p - 4s - 156 = -124 for p. 6 Solve -302 = m - 3f - 299, 2f - 55 = -17m for m. 3 Solve 17f - 224 = -3b - b, -174 = -4f - 3b - 111 for f. 12 Solve -4s + c - 15 = 0, 69s + 4c - 4 = 27s + 44s for s. -4 Solve -1169w = -1167w + 3c - 121, -19w + 2w = 3c - 1141 for w. 68 Solve -2b + 6156v - 6161v + 53 = 0, 36 = 4b - 4v for b. 14 Solve -36o + 5u - 15 = -38o, -4o - u + 39 = 0 for o. 10 Solve 3p - 28 = 5v, 48594v - 48597v - 14 = p for p. 1 Solve 0 = 5c - 0n + 3n - 4, -36 = 1083c - 1084c - 5n for c. -4 Solve -2t - 2r = 14 + 40, -90 = 199t - 195t + 13r for t. -29 Solve -24127u - 6m = -24123u + 52, 0 = -4u + 4m - 52 for u. -13 Solve 0 = -15c + 13c - 4o - 36 + 10, 3c + 5o = -30 for c. 5 Solve -311p + 2824 + 16763 = -3v, 55 = 3p - 2p - 4v for p. 63 Solve -46 = 84681u - 84685u - 3c, -4u + 5c + 62 = 0 for u. 13 Solve 542 = 17p - 2w, 0 = -4p + 6w + w + 21 + 100 for p. 32 Solve -6r - 13 = -5c - 5r + 5r - 6 + 11, -6r - 18 = 0 for c. 0 Solve 44 = 3540q - 3543q + 2k, 0 = 4k + 8 for q. -16 Solve 72j = 3h - 2j + 71j + 18, 4h = -3j - 24 for h. -6 Solve -5o + 3p = -87, 5373p - 69 = -3o + 5379p for o. 15 Solve 33v - 20v + 20c + 937 = 16c, -3c = -2v - 155 for v. -73 Solve 4x - 35 = 4b + 209, -5b - x - 12782 = -12843 for b. 0 Solve 796 = -3l + 138a - 267 - 232 + 341, 14 = 2a for l. 4 Solve -4x + 2134p = 2136p + 34, 5x - 100 = 5p for x. 1 Solve -5y - 306 = 3x - 86, -3y - 141 = 0 for x. 5 Solve f + 10k - 38 = 3f + 6k, -11f = -9f - 2k + 24 for f. -5 Solve -27q + 5p - 321 = 0, -5q + 2p - 61 = 1 + 49 for q. -3 Solve r + 25 = 4d - 2r + 5, 5r = -14d + 70 for d. 5 Solve 31r = -24l - 35r + 62r - 108, -l - r - 7 = 0 for l. -4 Solve -14u + 12u + 4j = 78, u + 4j + 57 - 150 = 0 for u. 5 Solve t - 9 = j, j - 19t + 26433 = 26280 for j. -1 Solve 0v = -32x - 2v + 320, 15v = -3x + 30 for x. 10 Solve 2o = -4r - 4 - 34, -21r + 31o = -12r - 6r - 329 for r. -4 Solve 877 + 876 - 1848 = -5t - 5z, 2t + 6z = 130 for t. -4 Solve -3553m = -3497m + 2c - 66, -4 = m - c for m. 1 Solve -3d + 30 = 2t, 17t + 72 = -15t + 140 + 220 for d. 4 Solve 33n + 10 = 18n + 3l + 34, 4l - 8 = 0 for n. 2 Solve 19080m - 5w + 125 = 19094m, 0 = m + w - 34 for m. -5 Solve 74775o = 74772o - 6, -2t - 3o - 70 = 0 for t. -32 Solve -4b - 4b - 3b + 10b - 4r - 9 = 0, -2 = 2b - 305r + 309r for b. 7 Solve 4x + 12 = -2d + 10x, -d - 554x + 564x = 20 for d. 0 Solve -5r - 6 = a + a - r - 2r - r - 6, -705a = -6r for a. 0 Solve -19i + 9i + 6 = -0i - 2o, 17 = o for i. 4 Solve 27y = 14y + 17y + 4q - 36, 0 = -y + 3q + 21 for y. 12 Solve 0 = -2f + 594699q - 594700q + 7, 3f - 12 = -3q for f. 3 Solve 11j - v = 21123 - 21122, -3j - 3v = -69 for j. 2 Solve 2z - 525 = -17u, 3z = -3u + 346484 - 346394 for z. -1 Solve -217 = 4b + 29u, -93864u - 62 = 4b - 93866u for b. -18 Solve 5u = l + 22, 3808 - 3844 = -2u + 2l for u. 1 Solve 23y + 7t + 11 = 0, -2y + 7 = 4y - 2y + t + 10 for y. -2 Solve -b - 4b - 2 = -3n, 3506n - 3505n - 7 = -5b - 33 for b. -4 Solve -145f + 3r + 56 = -148f + 74, f - 2r = -21 for f. -3 Solve 58y - 60y - 2f = f + 48, 4y - 66 = 4f - f - 0f for y. 3 Solve 1337957 = -4y + 1337961, 11w = 3y - 14 for w. -1 Solve 3o - 48925c + 48922c + 78 = 0, c - 119 = 4o for o. -31 Solve 14772g - 14769g + 65 = -2n, -4n - 107 = 5g for g. -23 Solve 2c - 15u + 8u = 14u + 222 + 292, 4u + 76 = -4c for c. 5 Solve -o - 5 = -u - 8, 28o - 36o - 2u - 36 = 0 for o. -3 Solve 0 = -3d - h + 34, 24831h - 24838h - 14 = 0 for d. 12 Solve -9m - x + 215 = -12m + 259, 2m = 19x + 11 for m. 15 Solve 3x = -11l - 32, l - x - 48 = -56 for l. -4 Solve -1732 = -2v + 28y - 1728, -3v - y + 2 = -2v for v. 2 Solve -257l = -3a + 663 - 1954, -l - 2a + 1 = 0 for l. 5 Solve 0 = -l - 3399r + 3386r - 24, 0 = 2l + 2r for l. 2 Solve -v + 10 = 2m, 2m + 17	{ "pile_set_name": "DM Mathematics" }
What is the highest common factor of 100 and f? 5 Let u = -10025 + 10510. Calculate the greatest common factor of 5 and u. 5 Let g(h) = 232h2 - 60h + 192. Let b be g(3). Calculate the greatest common factor of b and 2380. 140 Let m be 6/(-10) - (-5 + 119/35). Suppose 4w + 17 = m. Let y be w/(-14) - 5/(-35)5. What is the greatest common factor of y and 1? 1 Let r be (-10)/(-4)21/28(-64)/(-24). What is the highest common factor of 1715 and r? 5 Let k(c) = 83c2 - 1. Let d be k(-2). What is the greatest common factor of 1 and d? 1 Let u(s) = -s3 - 23s*2 - 50s - 159. Let w be u(-21). What is the highest common divisor of 48 and w? 3 Let v = -2744 + 2759. Calculate the greatest common factor of 102 and v. 3 Suppose -381p + 386p + 3i = 92257, 2p = 4i + 36856. What is the greatest common factor of 46 and p? 46 Suppose -2c - 5z + 39 = 0, -c - 33 = -3c + z. Suppose 0 = -2y - i + c, 3i = 10y - 8y + 3. What is the highest common factor of y and 12? 6 Suppose -1569 - 603 = -6o. Let w = 440 - o. Calculate the greatest common factor of 6 and w. 6 Let m = -3097 - -4163. Calculate the highest common divisor of m and 246. 82 Suppose -44f + 5455 = 4047. Let b = 47 - -17. What is the highest common divisor of b and f? 32 Let u(x) = 14x2 - 12x - 2. Let o be u(-2). Suppose 0 = -4s - 3j + 261, o = -s + 2s + 5j. What is the greatest common divisor of 9 and s? 9 Suppose 50 = 2p + p - 5a, 2p = a + 31. Suppose -g - 3b = -p + 4, g - 15 = b. Let r = -7732 - -7753. What is the highest common factor of g and r? 7 Let j(z) = -z*2 + 14z + 4. Let g be j(6). Let d be (1/(3 - 2))/(-1). Let b be (-13)/(4/(d + -3)). What is the highest common factor of b and g? 13 Let g be (-3157)/(-123) - 4/6. Let v be (-1 - -2) + 274/1. What is the highest common factor of v and g? 25 Let x(y) = 237y - 2455. Let q be x(15). What is the greatest common divisor of q and 100? 100 Suppose l - 133 = 4p, -687p + 355 = 3l - 688p. Let m = -5 + 18. What is the greatest common divisor of l and m? 13 Let j(b) = -b3 + 11b*2 - 7b - 36. Let h be j(8). Let a = 200 - h. Calculate the greatest common divisor of 10 and a. 10 Suppose 6917z - 6965z + 7056 = 0. What is the greatest common factor of 24794 and z? 49 Let q = -7 + 139. Suppose 48 = -126l + ql. Calculate the greatest common factor of 72 and l. 8 Suppose 5q + 188 + 12 = 0. Let a = 14 - q. Let c be ((-3)/(-2))/(4/48). Calculate the greatest common divisor of c and a. 18 Let n be ((-2223)/468)/(1/30)4/(-6). What is the highest common divisor of 30115 and n? 95 Let w = 19 - 12. Let h be (-708)/(-21) + 2/w. Let x(y) = -1167y2 + 2362y - 5. Let m be x(2). Calculate the greatest common factor of m and h. 17 Let c(b) = b*3 - 3b*2. Let z be c(-3). Let j = z - -84. What is the greatest common factor of j and 45? 15 Let f = 335 - 321. Let z = 252 - f. What is the highest common divisor of z and 136? 34 Let f be (-36 + 1)(-13320)/2775. Let b be (-14)/4(0 + -16). Calculate the greatest common divisor of b and f. 56 Let i = -4105 - -4633. What is the highest common factor of 80 and i? 16 Let t(b) = -40b + 240. Let l be t(-23). Calculate the greatest common divisor of 40 and l. 40 Let t = -38173 - -38629. Calculate the greatest common factor of t and 190. 38 Suppose -3w + 3l + 20076 = 0, 5w + l - 16230 - 17236 = 0. Calculate the highest common factor of 138 and w. 69 Let u = 10955 + -10679. Calculate the highest common divisor of u and 966. 138 Let b be 172 - 186 - (3 - 44). Suppose -4f + 0f + 100 = 4l, -2f + 62 = -4l. What is the greatest common divisor of f and b? 27 Suppose 0 = 223q + 2181 - 32638 - 48039. Calculate the highest common factor of q and 1628. 44 Suppose 0 = -2s + 2h - 4, -4s - 11 = -h - 0h. Let m be (171/27)/((-1)/s). Calculate the highest common divisor of 171 and m. 19 Suppose -94z + 55 = -126 - 383. What is the highest common factor of z and 11478? 6 Let l(f) = 7f2 - 20f - 1215. Let o be l(-24). What is the greatest common divisor of 63 and o? 21 Let x be (0 - (-19 - -8 - 142)) + -11. Calculate the highest common divisor of x and 7171. 71 Let w(k) = -192k + 110. Let p be w(0). Calculate the greatest common divisor of p and 130. 10 Let q = -1976 + 1998. Suppose 0 = -8c + 4c - o + 16, -3c + 12 = -o. Suppose -cp + 147 = -73. What is the greatest common factor of p and q? 11 Let y be 2913/7 - (-19 + (-2144)/(-112)). What is the greatest common factor of y and 143? 13 Let f = 40 + -13. Let y be 234/(-15)30/f-3. Suppose -w - 5x = -38, -4w + 52 = -4x - y. Calculate the greatest common divisor of 4 and w. 4 Let g(c) = -c*2 + 2. Let k be g(0). Suppose 21a - 2281 = 869. Suppose -kw - a = -5w. Calculate the greatest common divisor of w and 10. 10 Let z be 91 + 4(-1)/(-2). Let p = -70 - -83. Let l(j) = -2j*3 + 26j*2 + 2j + 5. Let w be l(p). Calculate the greatest common factor of z and w. 31 Let i = -195 + 288. What is the highest common factor of i and 248? 31 Let a = -3936 + 3961. What is the greatest common factor of a and 345? 5 Let z be ((-192)/(-864))/(4/34029) + 2/4. What is the greatest common divisor of 248 and z? 31 Let o = -117 - -132. Let i be o(2/10)/(22/110). Calculate the highest common divisor of 5 and i. 5 Suppose -5u - 25 = -80. Suppose 36 = 4z, -3h + z + 32 + 190 = 0. What is the greatest common factor of u and h? 11 Let x = 12140 - 7096. Calculate the greatest common divisor of x and 52. 52 Suppose 95t = -4o + 92t + 1552, 0 = 4t + 16. What is the highest common factor of o and 46? 23 Let g be -1 - (10/(-20))/(1/604). Let o = g + -215. Suppose 5w = -4u + o, -4w + 5u + 7 + 29 = 0. Calculate the greatest common divisor of w and 2. 2 Suppose 4w - 2140 = -5l, 0 = -2l + 2w + 504 + 370. Calculate the highest common factor of 32 and l. 16 Let c = -9 + -24. Let d be c/1(-8)/24. Suppose 39b = 40b - 44. Calculate the greatest common divisor of d and b. 11 Suppose 24 = 4w - 4y, -w + 2y - 7y - 24 = 0. Let c(r) = 36r*2 - 4r + 6. Let s be c(w). Calculate the highest common divisor of 1102 and s. 38 Let v be (28/10)/(417/(-30) - -8 - -6). What is the greatest common divisor of 6776 and v? 28 Let l be (346/9)/((-12)/(-306)). Let d(f) = f + lf*3 - 319f*3 - 4f*2 - 1 + 4f*2. Let j be d(1). Calculate the highest common divisor of j and 8. 8 Let m = 719 - 466. Suppose 3h + 3f - 66 = 0, -21 = -3h + 2h - 2f. Calculate the greatest common divisor of h and m. 23 Let v = 20818 + -20676. What is the highest common factor of v and 25418? 142 Let f(h) = 24h - 46. Let v be f(2). Suppose -58 = -vw + 2b - 0, 3w - 5b = 87. Calculate the highest common factor of 725 and w. 29 Suppose 3z - 27 = -15f + 12f, f = -3z + 17. Let b be 872/56 + 9/105f. Suppose 132 = 2w - 60. Calculate the greatest common divisor of b and w. 16 Let b be 10(-7)/(35/2). Let r be (b/12)/(11/(-198)). Let o = -31 + 46. What is the highest common factor of o and r? 3 Suppose 0 = 3j - 10t + 7t - 2247, 2j - 1502 = 3t. Suppose -j = -4x + 5m, 0 = -4x - 5m + 199 + 536. Calculate the greatest common divisor of 37 and x. 37 Let z(a) = 289a*2 + 13a + 90. Let f be z(3). Calculate the highest common factor of f and 735. 105 Let q(c) = c*3 - 10c*2 + 34c + 3. Let i be q(5). What is the highest common divisor of 2272 and i? 16 Suppose -k - 36 = -l - 0, -l - 3k + 28 = 0. Suppose 3o - l = 11. Suppose od + 210 = 18d. What is the greatest common divisor of d and 20? 10 Let h be (-2)/(-11) - (-6332)/22. Suppose -2q + 67 - 18 = 5o, -q - o + 29 = 0. Calculate the greatest common factor of q and h. 32 Suppose -4n = 5i + 15, 9 = -6n + 2n - 3i. Suppose 0 = 3c - n - 12, -4v + 4c = -548. Calculate the greatest common divisor of 235 and v. 47 Let l(u) = 519u + 591. Let n be l(5). Calculate the greatest common divisor of n and 236. 118 Suppose -q + 7 = 3g, -21 = -5q - 0q - g. Suppose -qs = s + 3s. Suppose s = -3v + 101 + 1. Calculate the greatest common factor of v and 119. 17 Suppose 0 = -268r + 460932 - 104492. Calculate the highest common divisor of 1520 and r. 190 Suppose 5o = 5g - 53 + 43, 0 = -4g + 5o + 9. What is the greatest common factor of g and 19? 1 Let q = 27037 + -27035. Calculate the highest common factor of q and 73	{ "pile_set_name": "DM Mathematics" }
i(u) - 14m(u). -4u2 Let q(v) = 32 - v - 34 + 3v - v. Let d(a) = 6a - 11. Suppose 90 = 6n + 288. What is nq(m) + 6d(m)? 3m Let m(o) = -13o*2 + 11o + 5. Suppose -3u - 5t = 53, 5u - 7 = 6u - t. Let g(i) = -7i2 + 6i + 3. Determine ug(a) + 6m(a). -a*2 - 3 Let c(x) = -9x. Let z(d) = 10d. Let o(y) = -39y. Let w(i) = -3o(i) - 13z(i). Determine 7c(g) - 5w(g). 2g Let c(u) = -5u3 - u2 - 5u. Let n(p) = -5p*3 - 2p*2 - 6p. What is 3c(o) - 2n(o)? -5o3 + o2 - 3o Let v(i) = 5i3 - 449i - i*3 + 455i - 6. Let w(n) = -3 + 5n - 4 + 3n*3 + 2. What is -5v(a) + 6w(a)? -2a3 Let l(q) be the third derivative of q6/40 + q5/30 + q4/12 - 3q2. Let f = 11 - 13. Let p(k) = 30k*3 + 21k*2 + 21k. What is fp(y) + 21l(y)? 3y3 Let x be (-12)/10(0 + 5). Let v(o) = o. Let j(i) = 5i2 - 5i - 9. Let c(n) = -j(n) - 6v(n). Let k(l) = 4l*2 + l - 8. Determine xc(u) - 7k(u). 2u*2 - u + 2 Let v(n) = -8n*2 - 2n + 3. Let u(l) = -7l2 - 2l + 2. Give 5u(a) - 4v(a). -3a2 - 2a - 2 Let z(d) = 5d2 - 8d - 6. Let m(i) = -i*2 + i + 1. Determine 6m(n) + z(n). -n*2 - 2n Let i(l) = 1 + 0 + 2l + 0 - 2l*3 - 2l*2. Let s(p) = -p + 2. Let v be s(3). Let q(j) = j. Suppose -5w = -g - 11, -g - 1 = -0g. Calculate vi(x) + wq(x). 2x*3 + 2x2 - 1 Let p(g) = -g3 + 1. Let v(c) = -4c3 + 7. Give -3p(u) + v(u). -u*3 + 4 Let p(k) = 3k + 7. Suppose 5s = -3o + 32, 2s + 3s + 4o = 31. Let g(r) = -r - 2. Calculate sg(l) + 2p(l). -l Let k(t) = -2t*3 + 13t2 + 19. Let y(d) = d3 - 6d2 - 9. Give 6k(a) + 13y(a). a3 - 3 Let b(v) = -v2 + v + 1. Let i(a) = 2a*3 - 6a*2 + 9a + 6. What is -6b(r) + i(r)? 2r*3 + 3r Let m(q) = -4q - 2. Let s(j) = -3j - 1. Let r(l) = 4l - 49. Let b be r(13). Give bs(f) - 2m(f). -f + 1 Let h(t) = 4t - 4. Let s(d) = -7d + 9. Calculate -7h(u) - 3s(u). -7u + 1 Let d(r) = -3r2 + 3r + 2. Let t(p) = 2p2 - 2p - 1. Give 3d(k) + 5t(k). k*2 - k + 1 Let x(m) = 3m*3 - 9m*2 + 7m - 2. Let r(t) = -5t3 + 14t*2 - 11t + 3. What is -5r(n) - 8x(n)? n*3 + 2n*2 - n + 1 Let x(k) = -5k - 30. Let o(d) = 9d + 59. Give 3o(w) + 5x(w). 2w + 27 Let y(o) = -6o2 - 4o. Suppose 2 = -i, -28 = 2n + 4i - 2. Let l(h) = -h - 5. Let k be l(-9). Let c(t) = 5t2 - 18t*2 - 8t - t. Give kc(p) + ny(p). 2p2 Let p be ((-9)/(-6) + -2)2. Suppose 3l + 3a - 8 = -l, 2a - 2 = -2l. Let o(f) = -f*2 - 7f. Let i(k) = -k. Determine li(y) + po(y). y*2 + 2y Let h(z) = -3z2 + 10z + 3. Let b(l) = l*2 - l. What is -b(d) - h(d)? 2d*2 - 9d - 3 Let f(t) = -t*2 - 6t - 6. Let z = 4 + 2. Suppose s - 7 = -6. Let k(w) = w + 1. What is sf(g) + zk(g)? -g*2 Suppose 3z - 5z = -8. Let p(d) = -16d - 4d + zd*2 + 13d. Let t(o) = -3o2 + 6o. What is 5p(m) + 6t(m)? 2m2 + m Let c(j) = -5j*2 - 2j + 2. Let s = 5 - 3. Let a(t) = -11t2 - 5t + 5. What is sa(d) - 5c(d)? 3d2 Let q(g) = -5g + 6. Let b(k) be the first derivative of -2k2 + 5k - 4. Determine -6b(h) + 5q(h). -h Let k(z) = 3z3 + 5z*2 + 5z - 7. Let i(o) = o*3 + 2o*2 + 2o - 3. What is 5i(a) - 2k(a)? -a3 - 1 Let l(b) = b3 + b*2. Let o(p) = 2p*3 - p. Give -3l(y) + 2o(y). y3 - 3y*2 - 2y Let a(i) = -i2 + i - 2. Let b(j) = -j2 - j + 1. Let u be b(-2). Let s(w) = -3w - 4. Let d(p) = p + 1. Let r(l) = 4d(l) + s(l). What is ua(o) + 2r(o)? o2 + o + 2 Let c(h) = h3 + h + 1. Let m(b) be the third derivative of b6/120 + b4/8 + b*3/6 + 22b*2. Give -3c(q) + m(q). -2q3 - 2 Let t(v) be the third derivative of -v6/30 + 5v*4/24 + 5v*3/6 + 69v*2 - 2v. Let p(w) = 5w3 - 6w - 6. Give 5p(y) + 6t(y). y*3 Let m(w) = -10w*3 + 6w + 18 + 0 - 1 - 4w3 + 20w*2. Let f(b) = -5b*3 + 7b*2 + 2b + 6. Determine 17f(j) - 6m(j). -j3 - j2 - 2j Let q(h) = 7h + 7. Let s(a) = 13a + 13. Let p(g) = g2 - 9g + 20. Let l be p(7). What is ls(t) - 11q(t)? t + 1 Let v(d) = 1. Let q(k) = k + 11. What is -2q(o) + 22v(o)? -2o Let y(s) = 12s*3 + 4s*2 - 4s. Let h(m) = -12m3 - 3m*2 + 3m. What is 4h(p) + 3y(p)? -12p3 Let t(g) = g + 1. Let z(r) = 8r + 5. Suppose -9 = -3c - 3n, -c = 4c + n - 27. What is ct(l) - z(l)? -2l + 1 Let y(r) = -4r*2 + 3. Let j(n) = 5n + 30. Let x be j(-7). Let o(g) = 5g2 - 3. Give xo(b) - 6y(b). -b2 - 3 Let y(b) = -3b*2 + 10b. Let p(a) = a + 7. Let r be p(-9). Let x(d) = -d*2 + 3d. Let g(z) = z*3 - 5z*2 + 7. Let s be g(5). Calculate ry(w) + sx(w). -w2 + w Let t(u) = -13u*2 - 7. Let k = 10 + -8. Let w(c) = 2c*2 + k + 4c*2 - 2c*2. What is -2t(n) - 7w(n)? -2n*2 Let u(l) = -29l*3 - 5l*2 + 5. Let n(b) = 246b*3 + 42b*2 - 42. What is 5n(g) + 42u(g)? 12g*3 Let l(v) = 6278v. Let x(q) = -91q. Determine 5l(f) + 344x(f). 86f Let m(x) be the third derivative of x*4/6 - 17x2. Let i(b) = -b2 + b. Calculate -4i(o) + m(o). 4o*2 Let a(d) = -2d - 2. Let c(b) = b*3 + 11b*2 - 2b - 15. Let v be c(-11). Let w(r) = 4r + 4. Calculate va(k) + 3w(k). -2k - 2 Let d(s) = -3s2 + 2s + 5. Let n(l) = -l*2 + l + 2. Calculate 2d(t) - 7n(t). t2 - 3t - 4 Let o(m) = -4m2 - 11m + 6. Let j(g) = 7g2 + 21g - 11. Let q(w) = -6j(w) - 11o(w). Let y(c) = -c*2 + 2c. What is 2q(x) + 5y(x)? -x*2 Let k(y) = -5y + 3 - 2y + 10y + 4y. Let i(c) = 15c + 6. Calculate 6i(j) - 13k(j). -j - 3 Let y(r) be the second derivative of -r5/4 + r4/6 - r*3/3 + 3r*2/2 - 9r. Let p(k) = k3 - k2 + k - 1. Calculate 3p(b) + y(b). -2b3 - b2 + b Suppose -3p + 12 = 6. Let o(t) = 2t. Let f(i) = -3i - 1. Give po(u) + 2f(u). -2u - 2 Let q(z) = -21z - 6. Let u(p) = 22p + 5. What is 3q(m) + 4u(m)? 25m + 2 Let c(y) be the second derivative of y4/6 + y3/2 + 3y. Let l(r) = 5r2 + 7r. Give -7c(d) + 3l(d). d*2 Let n(d) = 4d + 8. Let t(z) = -2z - 4. What is -4n(o) - 7t(o)? -2o - 4 Let b(a) = -1 + 2a + a3 - 3a - a*2 + 0a. Let q(d) = 2d3 - 8d2 + d2 + 4d3 - 7d - 6. Let h = 27 + -41. What is hb(w) + 2q(w)? -2w3 + 2 Let d = 37 - 38. Let x(b) = -3b - 7. Let k(o) = -1. Calculate dx(h) + 6k(h). 3h + 1 Let z(a) = 24a - 4. Let g(k) = 25k - 5. Determine 5g(b) - 6z(b). -19b - 1 Let i(g) be the first derivative of -g + 1. Let b(f) = -3f + 29. Let u be b(10). Let v(m) = 2m. Let k be (-1)/(-2)1-2. What is kv(l) + ui(l)? -2l + 1 Suppose 0 = 2a - 2x - 2, -2x = -3a + 8 - 2. Let h(f) = 0f + a + 0f + 2f. Let p(j) = 1. What is h(o) - 3p(o)? 2o + 1 Let v(c) = 4c2 + 0c*2 - 7c*2. Let n(y) = -70y*2 + 55y - 55. Let f(s) = 5s2 - 4s + 4. Let x(g) = 55f(g) + 4n(g). What is 11v(q) - 6x(q)? -3q2 Let t(v) be the third derivative of -5v*4/12 + 3v*2. Let w(n) = 2n - 3n + 2n. Give 2t(a) + 22w(a). 2a Let f(c) = -c - 1. Let r(n) = 0n - 2n + 0n + 3n + 1. What is -3f(h) - 2r(h)? h + 1 Let u(o) = -o2 + 12o*2 - 8o*3 - 4 - 2 - 5 + 6o. Let m(q) = -10 + 5 + 3q3 + 5 + 4 - 4q*2 - 2q. What is -11m(i) - 4u(i)? -i*3 - 2i Let q(h) = h*3 + 14h*2 + 14h + 11. Let j be q(-13). Let y(r) = -3r - 7. Let c(a) = -a - 3. Calculate jy(d) + 5c(d). d - 1 Let i(m) = -3m*2 + m + 4. Let f(v) = 12v*2 - 5v - 17. Determine -2f(p) - 9i(p). 3p2 + p - 2 Let j be (-5)/(-2) + (-3)/(-6). Let p be ((-4)/j)/(2/(-6)). Let i = -3 + p. Let l(w) = w2 - w - 1. Let m(s) = 6s*2 - 6s - 2. Give im(r) - 4l(r). 2r2 - 2r + 2 Let u(q) = -q*2 - 5q - 2. Let m be u(-4). Let i(y) = -y3 + y2 + 1. Let j(h) = h3 - h2 - h - 2. Determine mi(s) + j(s). -s3 + s2 - s Let l(f) = 2f + 7. Let w(o) = -o - 9. Let j(c) = 2c + 16. Let p(i) = 3j(i) + 5w(i). Give -6l(t) + 14p(t). 2t Let n(q) = 3q2 - q - 2. Let m(c) = 13c*2 - 5c - 9. Give 2m(u) - 9n(u). -u*2 - u Let a(v) be the first derivative of -3v*2/2 + 2v + 8. Let y(p) = p. Calculate a(l) + 4y(l). l + 2 Let y(c) = -5c2 + c2 - 2c2. Let u(k) = 3k*2. Calculate 7u(h) + 3y(h). 3h*2 Let j(k) = -2k*3 + 5k*2 - 4k - 4. Let i(z) = -2z3 + 5z*2 - 3z - 3. Give 4i(d) - 3j(d). -2d3 + 5d*2 Let x be (-17)/(-6) - 5/(-30). Suppose xv + 22 - 1 = 0. Let h(l) = 5l - 4. Let y(w) = -3w + 2. Calculate	{ "pile_set_name": "DM Mathematics" }
-3 Let g = -139 + 138. Let k(i) = 7i3 + 2i*2 - 1. What is k(g)? -6 Let k(d) be the third derivative of 1/12d*4 + 0d + 4d2 + 0 + 1/6d*3. Give k(-3). -5 Let p(a) = -a + 3. Suppose 2t + 4 = 2n, 0n = -4n - 5t + 35. What is p(n)? -2 Suppose 13 = 2y + 1. Let a(d) = d3 - 6d*2 - 2d + 1. Calculate a(y). -11 Let t(h) = h*2 + 10h + 2. Let o = -13 + 8. Give t(o). -23 Let b(q) = -6q + 1. Let p be 22/46 + 0. Suppose -8 = 5d - p. Suppose 2 + 3 = -dj. What is b(j)? 7 Let l(c) = -c*2 + c + 1. Suppose 8 = 9n - 5n. Give l(n). -1 Let q(o) be the third derivative of -o2 + 0 + 0o - 1/6o5 + 1/6o*3 + 0o4. Let z(x) = x2 - 1. Let b be z(0). Give q(b). -9 Suppose -3 = -3w - g - 9, 9 = 3g. Let n(z) = 3z + 3. Give n(w). -6 Let r(k) = k - 9. Let d(m) = -m3 + 5m*2 + 5. Let j = 4 - -1. Let v be 10/(j/((-10)/(-4))). Let x be d(v). Give r(x). -4 Let q(u) = 3u + 3u - 5u. Let j be 1 + (0 - (-4 - 0)). Calculate q(j). 5 Suppose 0 = 2q + q. Let u = -2 - -5. Let f = q + u. Let j(o) = o - 3. Determine j(f). 0 Suppose 2p = 4p - 5s + 7, -5 = p - 3s. Suppose -8 = 3b + p. Let n(h) = h + 2. Give n(b). -2 Let t(c) be the second derivative of c*2 + 0 + 1/3c*3 - 5c. Suppose 2m + 2m = -16. What is t(m)? -6 Let n(r) = 2r + 8. Let s be (2 + (-18)/(-3))/(-1). Let q = -14 - s. Give n(q). -4 Let h(f) = 5f*3 + 8f*2 - 12f - 3. Let t(v) = v*3 - v. Let q(z) = -h(z) + 6t(z). What is q(7)? -4 Let m(d) be the third derivative of -3d2 + 0d - 1/24d4 + 0 + 2/3d3. Let c = 1 + -1. Give m(c). 4 Let c(q) = q3 + 5q2 + 3q + 1. Let t(y) = -y + 1. Let u be t(3). What is c(u)? 7 Suppose -2l - 4k = 3 - 1, 0 = 2k. Let w be (-2 + 4)/(-2)l. Let o(b) = b*3 + 26b*2 - 3 - 25b*2 - 10 + 12. Calculate o(w). 1 Suppose -b = 2j - j - 5, -2b - j = -7. Let p be (b - 2)1/(-2). Suppose 0 = 4x - 4h - 28, x - 3h + h - 9 = p. Let l(o) = -o. Calculate l(x). -5 Let d(p) = p3 - 5p*2 - 3p + 7. Suppose 0 = -4b + m + 22, 2b + m - 26 = -2b. What is d(b)? 25 Let x(i) = -i + 7. Let f be x(5). Suppose -p = fq - 3q - 8, -4q = 0. Suppose 0d - p = -2d. Let r(z) = -3z + 6. What is r(d)? -6 Let s(i) = i2 - 5i - 4. Let p be s(5). Let g be 38/14 - p/14. Suppose -gc + 6c + 9 = 0. Let f(v) = v*3 + 3v*2 + v + 1. Determine f(c). -2 Let o(n) be the third derivative of -13n6/120 - n5/60 + n*3/6 + 2n*2 - 5n. Give o(1). -13 Suppose 0 = 2t - 5r - 34, 2t = -5r - 3 - 3. Let d(k) be the second derivative of -k4/12 + k3 + 4k2 - 4k. What is d(t)? 1 Suppose -17 = 3l - 5l - 3a, 3a - 1 = 2l. Let n(q) = 1 - 6q + 7q2 - 6q*2 + lq. Calculate n(2). 1 Let a(v) = -v*3 + 3v*2 + 5v - 1. Let i(p) = -p*3 + 22p*2 + 22p + 27. Let n be i(23). Determine a(n). 3 Let l(i) be the first derivative of 2i2 + 19. Give l(-1). -4 Suppose 8 + 7 = -5w. Let m be (-1 - 1) + (-6 - -14). Let d(l) = -ml3 + 3l + 5l3 - 3l + 2 - 3l2. What is d(w)? 2 Let w(d) = d - 3. Let z(l) = -1. Let o(v) = -w(v) + 4z(v). Give o(-1). 0 Suppose 3 = 3d - 0. Let b(n) = n + 1. Let u(v) = -4v - 1 + 7v + 4 - 1. Let k(o) = -10b(o) + 5u(o). Give k(d). 5 Let q(r) = 2r*3 - 8r*2 + 5r - 3. Let u be q(3). Let y(z) = 6z + z2 + 4 + 0z2 + 3. Calculate y(u). 7 Let f(z) be the second derivative of -z5/30 + z4/6 - z3/3 - 3z2/2 + 2z. Let i(d) be the first derivative of f(d). Let c = 19 - 16. Determine i(c). -8 Let f(i) = -2i. Let k = -56 - -34. Let s be 4/(-18) + k/(-18). Calculate f(s). -2 Suppose 3l + 3m - 24 = 0, -4 = -4l + 4m + 12. Let g = l + -2. Let w(y) = 3y - gy - y. Determine w(2). -4 Suppose 0 = -3x + 4 + 8. Suppose x = -2i + 3i. Let d(j) = 2j - i - 3j + 2. What is d(-5)? 3 Let f(b) = b*3 + 2b*2 - 3b - 4. Let m be f(-2). Let o(y) = y + 2. Calculate o(m). 4 Suppose 4s + s + 30 = 4g, 2s + 4g + 12 = 0. Let q(c) = 2c + 1. Let z be q(4). Let u(y) = -3y - 4 - zy2 + 2y2 - y3 - 3y. What is u(s)? -4 Let u(t) = 4t2 + t2 - 4t2 + 3 - 5t. Calculate u(4). -1 Let u(a) = 0a2 - 3a*2 + 18a*2 + 3a*2. Determine u(1). 18 Let s = -2 - -6. Let l(n) be the first derivative of -1 - 1/2n*2 + 2n. What is l(s)? -2 Let x(m) = m2 + 4 - 8 - m3 - 6m2 - 1 - 4m. What is x(-4)? -5 Let j(p) be the second derivative of -p5/20 - p4/2 - p3/6 + p2 + 5p. Determine j(-6). 8 Let n(u) = u3 - 6u*2 + 3u - 1. Suppose -4d = -12 - 8. Determine n(d). -11 Let m(s) = s2 + s - 6. Let o = 2 - -4. Let k(r) = -r + 1. Let z(f) = ok(f) + m(f). Give z(4). -4 Let y be (-3)/(-2)2-1. Let i(n) = 1 - 6n + 1 + 3n + 48n2 - 49n*2. Give i(y). 2 Let y(i) = -8i - 1. Let k(h) = h*3 + 7h*2 + 4h + 5. Let d be k(-6). Let c = -18 + d. Determine y(c). 7 Let i(h) = -2h2 + 4h - 2. Let b = 28 - 25. Give i(b). -8 Let z(o) = 5o. Suppose -5f = -u + 3u - 21, -6 = 2u - 4f. Suppose -un = -g - 4, -4g + 29 = 3n - 0g. Suppose 4l + 1 = nl. Give z(l). -5 Let c be (-2)/(-4)0/4. Let p(w) be the first derivative of 1/4w4 + w + cw2 - w3 + 1. Give p(2). -3 Let w(t) = -5t3 - 4t*2 - 8t + 10. Let k(x) = 4x3 + 3x*2 + 7x - 9. Let h(l) = -6k(l) - 5w(l). What is h(-3)? 1 Suppose -4f + 52 = -4. Let s = f - 10. Suppose j + s = 3. Let u(r) = -2r. Give u(j). 2 Suppose 0 = 2o + 1 - 13. Let y(h) = -h3 + 7h*2 - 7h + 5. Give y(o). -1 Let l(p) be the first derivative of p*2/2 + p - 6. Let k(w) = w. Let g(n) = -k(n) + 2l(n). What is g(-4)? -2 Let j(o) = -6o - 4. Let l(m) = -2 + 2m - m - 1 - 6m. Let b(d) = 4j(d) - 5l(d). Give b(5). 4 Let t(f) = f3 - f - 1. Let j(c) = 5c*3 + 5c*2 - 1. Let q(o) = j(o) - 3t(o). Give q(-3). -16 Let c(s) = -s*3 + s + 2. Suppose 10w = 17w. Give c(w). 2 Let o(n) be the second derivative of -1/6n*3 + 6n + 0 - n2. Determine o(4). -6 Let p(o) = -o3 + 15o2 + 15o + 17. Let m be p(16). Let v(l) = 8l3 + 8l*3 - 7l*3. What is v(m)? 9 Suppose -1 = -2b + 7. Let c(r) = r*3 - 4r*2 - 3r. What is c(b)? -12 Let g(o) be the first derivative of o*5/60 + 2o*3/3 + 1. Let s(u) be the third derivative of g(u). Suppose -a + 3n = 9, 26 = -a + 3a + 5n. Determine s(a). 6 Let h(b) = 1411b2 - 2 + 3 + 6b*3 - 1413b*2. What is h(-1)? -7 Let t(q) = 2q*3 + 2q*2 + 7q - 12. Let x(i) = i3 + i2 + 3i - 6. Let f(z) = -3t(z) + 7x(z). Let w = 11 + -11. What is f(w)? -6 Let b be (-6)/(-10) - ((-288)/(-30) + -4). Let h(l) = 2l + 7. What is h(b)? -3 Let l(v) = -5v - 2. Let w(p) be the second derivative of -p3 - 3p*2/2 + 2p. Let q(r) = -3l(r) + 2w(r). Let h be ((-4)/3)/(4/(-6)). Give q(h). 6 Let d(b) = -b - 5 + 5b - 5b. Determine d(5). -10 Let s(o) be the first derivative of 3o + o2 - 1/4o4 + o3 - 6. What is s(3)? 9 Let c(y) = -2y - 20 + 32 - 14. Give c(5). -12 Let x(l) = -l + 3l + l - 4l. Determine x(0). 0 Let o(u) = -u - 1. Let q be o(-4). Let f(h) = h3 - 2h*2 - h - 4. Determine f(q). 2 Let r be (-132)/(-21) - 6/21. Let l(k) = -k. Let c be l(r). Let b(j) = j + 3. Give b(c). -3 Suppose -3s + 2s = 3. Let a(g) be the second derivative of g4/12 + 2g3/3 + g2/2 - 11g. Give a(s). -2 Let w(l) = 3l + 2. Suppose -m + 1 = -3. Suppose -3k = -5 - 1. Suppose -4c = -3r - 6, -kr - c - 5 = -mc. What is w(r)? 8 Let m(q) be the first derivative of -1 + 4/3q*3 - 4q + 0q2 + 1/4q4. What is m(-4)? -4 Let l(c) = -c3 - 7c2 + 3c + 7. Let o be 2 + 6/(-3) + -7. What is l(o)? -14 Let a(v) = -1. Let b(q) = -q + 1. Let s(n) = -a(n) + b(n). What is s(3)? -1 Let t be 12/(-8)4/(-6). Let x be t/(1 + 0)-2. Let y(r) be the first derivative of -r4/4 - r3/3 + 2r - 2. Calculate y(x). 6 Let g(c) = 4c*2 - 4c + 3. Let i(o) be the third derivative of -o6/120 + o5/15 + o4/24 - o3/3 + 5o2. Let d be i(4). Give g(d). 11 Suppose -7 = -v - 2, 2b - 29 = -v. Let j be (-2)/(-8) - (-21)/b. Let o(m) = m + 2 + jm - m. Give o(-3). -4 Suppose 6n + 15 = 9n. Let x(r) be the first derivative of -r4/12 + 2r*3/3 + 5r*2/2 - 2r + 2. Let i(k) be the first derivative of x(k). Determine i(n). 0 Let f(l) be the first derivative of 3 - 1/2l3 + 0l - l*2 + 1/8l*4. Let t(p) be the second derivative of f(p). What is t(2)? 3 Suppose 0 = 6g - 2g. Let p be (g - (5 - 2)) + -2. Let m(u) = 3u + 3. Let a(b) = -2*b - 2. Let	{ "pile_set_name": "DM Mathematics" }
Give -273k(y) - 2s(y). 39y3 Let h(x) be the third derivative of 3x6/40 - x5/20 + x4/8 + x3/2 + 6x2 + 3x. Let o(s) = 8s3 - 2s*2 + 2s + 2. Calculate 2h(n) - 3o(n). -6n3 Let r(o) = o3 - 28o*2 - 3o + 5. Let x(b) = -4b3 + 57b*2 + 7b - 11. Determine 7r(n) + 3x(n). -5n3 - 25n*2 + 2 Let p(y) = 15y*3 + 4y*2 - 4y + 4. Let u(x) = 14x3 + 5x*2 - 5x + 5. Let o be (10/30)/((-5)/75). Calculate op(l) + 4u(l). -19l3 Let b(s) = -s. Let i = -426 + 425. Let q(g) be the second derivative of -4g*3/3 - 5g. What is iq(r) + 4b(r)? 4r Let l(k) = -k3 - 4k*2 + 3k - 3. Let f be l(-5). Suppose -7 - 7 = -fi. Let w(c) = -4c - 1. Let r(s) = 21s + 4. What is ir(x) + 11w(x)? -2x - 3 Let k(h) = h*3 + 2h*2 - 3h - 2. Let w = -1643 + 1640. Let c(x) = x*3 + 3x*2 - 3x - 2. Determine wk(b) + 2c(b). -b*3 + 3b + 2 Let w(z) = 2z2 - z + 1. Let s(n) = -9n*2 + 20n - 6. Let u(q) = s(q) + 6w(q). Let v(i) = 2i*2 + 13i. What is -3u(a) + 4v(a)? -a*2 + 10a Let v(z) = 205 - 4z - 2z*2 - 2z*2 - 201. Let l(f) = -4f*2 - 3f + 3. What is 4l(b) - 3v(b)? -4b2 Suppose 5n - 3n = -8. Let l(v) = -4v + 8. Let s(r) = -5r + 11. Let a(u) = -3l(u) + 2s(u). Let f(b) = b + 0b + 3b - 2 - b. Calculate nf(g) + 5a(g). -2g - 2 Let g(p) = -p. Let h(y) = -191y + 765. Let u be h(4). Let s(k) = -k2 + 6k - 1. Calculate us(b) + 4g(b). -b*2 + 2b - 1 Let y(p) = 5p3 - 3p - 2. Let n be 4/(-34) - (0 - 106/34). Let c(f) = 14f3 - 8f - 6. Calculate nc(z) - 8y(z). 2z3 - 2 Let l(i) = -167i + 2. Let n(y) = -502y + 7. Give -7l(j) + 2n(j). 165j Let c(f) = -23f3 - 5f*2 + 24f - 31. Let u(b) = 12b3 + 3b*2 - 14b + 16. Give 3c(w) + 5u(w). -9w3 + 2w - 13 Let u(a) = 6a3 - 33a - 6a2 + 33a - a*2. Let n(i) = -5i*3 + 6i2. Let f(r) = -r3 + 4r2 + 6r + 1. Let d be f(5). What is du(c) + 7n(c)? c3 Let b be 7/(-3) - (4/(-66) - (-144)/(-528)). Let y(v) be the second derivative of -v3/6 + v*2/2 + v. Let f(k) = -4k + 2. What is by(w) + f(w)? -2w Let d(p) = 26p2 - 11p + 10. Suppose h + 7 = i, -5h - 8 = -i - 17. Let b(w) = -5w*2 + 2w - 2. Determine ib(q) + 2d(q). -3q2 - 2 Let s(b) = -19b*2 - 3b. Let m(o) = 13o + 43o*2 + 13o - 18o + 13o*2. Give -3m(k) - 8s(k). -16k2 Let n(a) be the first derivative of a4/4 - 4a3/3 + 2a*2 + 3a + 279. Let s(m) = -m*2 + m + 1. Give n(r) - 3s(r). r3 - r2 + r Let r(o) = -3o3 + 110o*2 - 13o + 7. Let b(l) = -2l3 + 73l*2 - 9l + 5. Calculate 7b(a) - 5r(a). a*3 - 39a*2 + 2a Let z(u) = -70u3 - 8u - 5. Let k(g) = -35g3 - 3g - 2. What is -5k(s) + 2z(s)? 35s3 - s Let q(v) = -v + 11. Let i be q(9). Let g(c) = -1 + 2c*2 - i - 4c + c. Let w(y) = 0 - 4 - 2y + 2 + y2 + 0y*2. Calculate -6g(n) + 10w(n). -2n*2 - 2n - 2 Let w(q) = 14q2 + 14q + 2. Let z(x) = x*2 + 2x. Give w(f) - 5z(f). 9f*2 + 4f + 2 Let a(j) = -5j3 + 3j*2 + 4j + 4. Let t(l) = -11l3 + 6l*2 + 9l + 9. Let p(n) = -n*2 + 73. Let u be p(-8). Calculate ua(c) - 4t(c). -c3 + 3c*2 Let j(n) = 3n*3 - 3n*2 + 57n. Let k(h) = -h3 + h2 - 28h. Calculate -3j(p) - 7k(p). -2p*3 + 2p*2 + 25p Let t(b) = 10b2 - 3b + 7. Let i(o) be the first derivative of -o*3/3 - o - 913. What is 6i(f) + t(f)? 4f2 - 3f + 1 Let c(r) be the third derivative of 0r3 + 0 - r2 - 1/24r*4 + 0r. Let i(d) be the first derivative of -5d2/2 + d + 19. Determine -11c(w) + 2i(w). w + 2 Let b(p) = -p + 2. Let w(x) = -2x + 3. Let v be (6(3 + -2))/(3/(-2)). What is vb(z) + 3w(z)? -2z + 1 Let j(z) = 16z3 + 11z*2 + 11z - 11. Let o be (44/33)/((-2)/(-3)). Let l(w) = 7w2 - 2 - 21w*3 - 5w*o + 24w*3 + w + w. Give 6j(d) - 33l(d). -3d3 Let p(u) be the first derivative of u4/4 + u*3/3 + 4021. Suppose -5j + 2 = 7. Let w(g) = 4g3 + 5g*2 - 2g. Determine jw(x) + 5p(x). x*3 + 2x Let d = 14 + -11. Let q(u) = 3u2 - 2u - 2. Suppose 0g - g = 2. Let l(t) = 3t*3 - 3 - 4t*3 + 8t*2 - 4t*2 - 3t. Give dq(j) + gl(j). 2j3 + j2 Let f(k) be the third derivative of 7k4/24 - k3/6 + 4k2. Let q(u) = 8u - 2. Let a be (24/(-114))/((-18)/171). Calculate aq(v) - 3f(v). -5v - 1 Let q(a) = -a3 + 16a*2 - 16a + 14. Let c be q(15). Let j(v) be the first derivative of v*2/2 + 1. Let s(b) = -b + 1. Calculate cs(h) + j(h). 2h - 1 Let n(z) = 6z*2 - 2z - 5z + 3z. Let v(f) = 13f2 - 7f. Let o(t) = -2t2 + t. Let l(s) = -6o(s) - v(s). Calculate 4l(u) + n(u). 2u*2 Let k(i) = 5i*3 + 4i*2 - 2. Let m(f) = -5f*3 - 5f*2 + 1. Give 4k(g) + 3m(g). 5g3 + g2 - 5 Let m(l) = 11l2 - l + 4. Let y(j) = -j - 2. Calculate m(i) + 2y(i). 11i2 - 3i Let z(s) = -22s2 - 24s + 4. Let h(j) = 7j2 + 8j - 1. Determine -7h(q) - 2z(q). -5q2 - 8q - 1 Let k(t) = 69t3 + 11t*2 + 17t - 10. Let p(c) = -23c3 - 4c*2 - 6c + 3. What is 4k(d) + 11p(d)? 23d3 + 2d - 7 Let g(s) = 13s - 4. Let f = -23 - -23. Suppose f = m + 5i - 34, 7i - 3i = 20. Let o(v) = -3 + 1 + 3 - 3v. Determine mo(j) + 2g(j). -j + 1 Let l(i) = 1 - 6 + 2 + i + 2. Suppose -4 + 9 = -5p. Let g(d) = -88d + 3 + 2d*2 - 95d - d*2 + 177d. Calculate pg(u) - 3l(u). -u*2 + 3u Let m(f) = 1. Let l = -11 + 11. Suppose l = 5c - 2c - 24. Let i = -9 + c. Let z(q) = -2q - 12. Calculate iz(a) - 10m(a). 2a + 2 Let a(u) = -4u3 + u2 + u - 7. Let w(l) = 3l3 - l2 - l + 6. Calculate -5a(b) - 6w(b). 2b3 + b2 + b - 1 Let u(t) = 8t*2 + 6t + 4. Let i(d) = d + 1. Suppose -4o + 8o - 11 = -q, 3o - 2q = 22. Determine oi(g) - u(g). -8g*2 - 2g Let y be 7 - (40 + 0/6). Let h(m) = 81m3 + 33m*2 - 33. Let q(f) = 5f*3 + 2f*2 - 2. What is yq(z) + 2h(z)? -3z*3 Let p(i) = -5i - 3. Let l = -3 - 32. Let d be 2/7 + (-340)/l. Let w(j) = -16j - 10. Determine dp(a) - 3w(a). -2a Let m(r) = r*2 + 1. Let p(z) = -4z*2 - 1. Suppose w - 4n + 3 - 14 = 0, 4w - 4 = -4n. What is wm(k) + 3p(k)? -9k2 Let t(b) = 600b*2 + 1. Let x(j) = 600j*2 + 2. What is 4t(m) - 3x(m)? 600m*2 - 2 Let v(n) = -2n3 - n2 - n. Let w(t) = -4t3 + 2t*2 - 4t - 1. Calculate 4v(f) - w(f). -4f*3 - 6f*2 + 1 Let j(p) = -6p - 44. Let y = -2778 + 2767. Let z(d) = -2d - 15. Give yz(c) + 4j(c). -2c - 11 Let l(m) = m + 1. Let f(z) be the second derivative of 0 + 1/2z2 - 3z. Suppose 0 = -2v - 2 - 2. Calculate vl(g) + 3f(g). -2g + 1 Let q(x) = -2x2 + x + 1. Let i(j) = 29j*2 - 2j - 6. Calculate -i(a) - 2q(a). -25a*2 + 4 Let v(u) = 2u*2 + u. Let y(x) = -30x*2 + 15x. Give -18v(d) - y(d). -6d*2 - 33d Suppose 0 = 35l - 39l - 16, 0 = -5g - l + 21. Let q(j) = -6j*3 + 2j*2 + j - 5. Let u(x) = -7x*3 + 2x*2 + x - 6. Give gu(a) - 6q(a). a3 - 2a*2 - a Let o(y) = 2y*2 + 7y - 2. Let x(m) = 3m2 + 6m - 2. Let p be (-4 + 1)(0 - 12/(-6)). What is px(f) + 5o(f)? -8f*2 - f + 2 Let z(f) = 6f + 2f - 6f + 234 - 233. Let p(x) be the first derivative of -4x2 - 5x - 4. Let i(h) = 2h + 1. Let c be i(4). Determine cz(w) + 2p(w). 2w - 1 Let c(f) = -2f + 170. Let i(b) = 3b - 175. Determine -5c(t) - 4i(t). -2t - 150 Let s(h) = -h + 1. Let o(d) = -d. Let l(t) = -2o(t) + 4s(t). Let x be 2 - 0/((-3)/(-1)). Let a(q) = 6q - 3 - 2 - xq - 2. Give -4a(k) - 7l(k). -2k Let a(y) = y + 4. Let f(d) = 1. Let r(u) = 2. Let i = 33 - 27. Let l(q) = ir(q) - 13f(q). Suppose 0 = 2j - 0j + 3v + 4, 3v = -3j. Give jl(x) + a(x). x Let o(s) = s3. Let z(n) be the third derivative of -n6/8 + 167n2. Determine -4o(g) - z(g). 11g3 Let d(p) = -468023p*3 + 3352p*2 - 6704. Let w(s) = 419s*3 - 3s*2 + 6. Determine -3d(z) - 3352w(z). -419z*3 Let z = -84 - -88. Let r be (9 - 9) + z/(-1). Let g(n) = 4n*2 + 4n + 4. Let t(w) = w3 + w2 + w + 1. Calculate rt(i) + g(i). -4i3 Let d(l) = l2 + l. Let k = -9 + 12. Let w = 8 - k. Suppose -wu = -7 + 2. Let h(a) = -2a*2 - a. Determine ud(v) + h(v). -v*2 Let o(u) = 2u2 + 15. Let b(l) = l2 + 7. Let i = -660 + 656. What is io(r) + 7b(r)? -r2 - 11 Let q(u) be the second derivative of u5/20 + 7u4/12 + 7u*3/6 - 9u*2/2 - u. Let i(y) = 1 - 3y**	{ "pile_set_name": "DM Mathematics" }
housands digit of 1566319? 6 What is the ten millions digit of 11420508? 1 What is the tens digit of 226458? 5 What is the tens digit of 591479? 7 What is the tens digit of 99175? 7 What is the thousands digit of 1850710? 0 What is the hundreds digit of 674952? 9 What is the units digit of 466240? 0 What is the tens digit of 2335738? 3 What is the ten thousands digit of 279295? 7 What is the ten thousands digit of 487315? 8 What is the hundred thousands digit of 16984575? 9 What is the ten thousands digit of 60451? 6 What is the tens digit of 239605? 0 What is the hundreds digit of 2882900? 9 What is the units digit of 191334? 4 What is the millions digit of 23407439? 3 What is the tens digit of 349523? 2 What is the ten thousands digit of 476224? 7 What is the hundreds digit of 11782957? 9 What is the hundreds digit of 3541405? 4 What is the units digit of 402189? 9 What is the hundred thousands digit of 23836470? 8 What is the thousands digit of 41789228? 9 What is the units digit of 86631? 1 What is the units digit of 18751? 1 What is the thousands digit of 198067? 8 What is the hundreds digit of 6631415? 4 What is the units digit of 386193? 3 What is the units digit of 171115? 5 What is the hundred thousands digit of 175846? 1 What is the thousands digit of 6974443? 4 What is the units digit of 6563732? 2 What is the thousands digit of 83768? 3 What is the hundred thousands digit of 146528? 1 What is the hundred thousands digit of 581263? 5 What is the ten thousands digit of 194869? 9 What is the hundreds digit of 455505? 5 What is the hundred thousands digit of 284566? 2 What is the units digit of 363604? 4 What is the units digit of 1190590? 0 What is the units digit of 478167? 7 What is the tens digit of 66662? 6 What is the thousands digit of 43268? 3 What is the units digit of 2876541? 1 What is the ten thousands digit of 6772678? 7 What is the hundreds digit of 212931? 9 What is the hundred thousands digit of 3665796? 6 What is the units digit of 5397904? 4 What is the ten thousands digit of 14352755? 5 What is the ten thousands digit of 3068569? 6 What is the ten thousands digit of 40749? 4 What is the ten thousands digit of 74620? 7 What is the thousands digit of 629980? 9 What is the hundreds digit of 259873? 8 What is the thousands digit of 17382? 7 What is the thousands digit of 422988? 2 What is the units digit of 30779? 9 What is the tens digit of 1796060? 6 What is the tens digit of 2846851? 5 What is the tens digit of 1807414? 1 What is the tens digit of 7770028? 2 What is the units digit of 347328? 8 What is the thousands digit of 165459? 5 What is the units digit of 238222? 2 What is the tens digit of 158338? 3 What is the hundreds digit of 4617396? 3 What is the ten thousands digit of 4439946? 3 What is the ten millions digit of 34706645? 3 What is the hundreds digit of 441561? 5 What is the ten thousands digit of 318895? 1 What is the units digit of 650979? 9 What is the ten thousands digit of 1073691? 7 What is the millions digit of 7319236? 7 What is the hundreds digit of 25082048? 0 What is the ten thousands digit of 240632? 4 What is the hundred thousands digit of 435944? 4 What is the units digit of 5720224? 4 What is the hundreds digit of 3755235? 2 What is the tens digit of 1525252? 5 What is the millions digit of 2068889? 2 What is the hundreds digit of 412352? 3 What is the tens digit of 921662? 6 What is the hundred thousands digit of 126337? 1 What is the millions digit of 2451372? 2 What is the hundred thousands digit of 332190? 3 What is the thousands digit of 101812? 1 What is the units digit of 2109491? 1 What is the thousands digit of 1448412? 8 What is the hundred thousands digit of 1001011? 0 What is the thousands digit of 4485429? 5 What is the tens digit of 949529? 2 What is the ten thousands digit of 353171? 5 What is the thousands digit of 307900? 7 What is the units digit of 522126? 6 What is the units digit of 28285415? 5 What is the tens digit of 174259? 5 What is the thousands digit of 189189? 9 What is the thousands digit of 117615? 7 What is the units digit of 860536? 6 What is the tens digit of 1795146? 4 What is the ten thousands digit of 441837? 4 What is the ten millions digit of 14811951? 1 What is the ten thousands digit of 31545897? 4 What is the ten thousands digit of 47096? 4 What is the units digit of 7121678? 8 What is the thousands digit of 181486? 1 What is the units digit of 1539782? 2 What is the tens digit of 43002? 0 What is the hundred thousands digit of 722335? 7 What is the hundred thousands digit of 508630? 5 What is the thousands digit of 10300255? 0 What is the ten thousands digit of 729281? 2 What is the hundreds digit of 6312600? 6 What is the hundred thousands digit of 3851612? 8 What is the hundreds digit of 5132215? 2 What is the units digit of 403974? 4 What is the millions digit of 1674137? 1 What is the thousands digit of 12361614? 1 What is the units digit of 11140616? 6 What is the units digit of 278776? 6 What is the hundred thousands digit of 2144977? 1 What is the hundred thousands digit of 1065561? 0 What is the hundreds digit of 1892319? 3 What is the units digit of 8720632? 2 What is the ten thousands digit of 8230802? 3 What is the hundred thousands digit of 147048? 1 What is the hundreds digit of 1925089? 0 What is the thousands digit of 23156073? 6 What is the hundreds digit of 901254? 2 What is the tens digit of 1451430? 3 What is the hundreds digit of 837295? 2 What is the hundreds digit of 18741650? 6 What is the tens digit of 3549952? 5 What is the ten millions digit of 12931203? 1 What is the thousands digit of 1015531? 5 What is the ten thousands digit of 1133193? 3 What is the units digit of 1067322? 2 What is the thousands digit of 454683? 4 What is the thousands digit of 605530? 5 What is the millions digit of 5096896? 5 What is the ten thousands digit of 1786337? 8 What is the hundred thousands digit of 728060? 7 What is the thousands digit of 884852? 4 What is the units digit of 88377? 7 What is the thousands digit of 86591? 6 What is the tens digit of 175761? 6 What is the units digit of 2128387? 7 What is the tens digit of 4245101? 0 What is the ten thousands digit of 18172018? 7 What is the thousands digit of 283584? 3 What is the tens digit of 2415924? 2 What is the hundreds digit of 6387683? 6 What is the units digit of 404438? 8 What is the ten thousands digit of 10932460? 3 What is the hundreds digit of 13929773? 7 What is the units digit of 162344? 4 What is the ten thousands digit of 76680? 7 What is the thousands digit of 32543888? 3 What is the millions digit of 1655501? 1 What is the hundreds digit of 5231028? 0 What is the tens digit of 2511050? 5 What is the millions digit of 1019743? 1 What is the tens digit of 526060? 6 What is the hundreds digit of 3616052? 0 What is the thousands digit of 171471? 1 What is the tens digit of 1476291? 9 What is the thousands digit of 5542662? 2 What is the ten thousands digit of 1426660? 2 What is the thousands digit of 3272150? 2 What is the millions digit of 1525261? 1 What is the hundred thousands digit of 628230? 6 What is the ten thousands digit of 497272? 9 What is the thousands digit of 135065? 5 What is the hundred thousands digit of 4487908? 4 What is the ten thousands digit of 7597057? 9 What is the units digit of 10734989? 9 What is the hundreds digit of 400383? 3 What is the ten thousands digit of 11983449? 8 What is the hundreds digit of 15989? 9 What is the ten thousands digit of 6640581? 4 What is the hundred thousands digit of 128877? 1 What is the ten thousands digit of 5581847? 8 What is the thousands digit of 2011950? 1 What is the hundreds digit of 32491697? 6 What is the hundreds digit of 27899? 8 What is the tens digit of 1461684? 8 What is the units digit of 78822? 2 What is the hundred thousands digit of 8154423? 1 What is the ten thousands digit of 74163? 7 What is the ten thousands digit of 111924? 1 What is the ten thousands digit of 50777? 5 What is the tens digit of 101254? 5 What is the thousands digit of 342521? 2 What is the hundreds digit of 319662? 6 What is the hundreds digit of 9760442? 4 What is the hundreds digit of 14685748? 7 What is the tens digit	{ "pile_set_name": "DM Mathematics" }
17653682 Let c(i) = -5i. Let j(u) = 171378u*2 + 3. Give c(j(t)). -856890t*2 - 15 Let x(s) = 12s2. Let k(u) be the first derivative of -u5/15 + 83u2/2 + 187. Let q(l) be the second derivative of k(l). What is x(q(i))? 192i*4 Let n(h) = -35h + 15h - 26h - 28h. Let y(q) be the second derivative of q3/6 - 32q. Determine y(n(m)). -74m Let o(r) = -18r. Let c(w) = -5167w2 - 2w + 19. Determine o(c(j)). 93006j2 + 36j - 342 Let d(i) = -20i2 - 13i*2 - 10i*2 + 36i*2. Let b be 36/15-1-10. Let y(q) = -bq*2 + 34q*2 + 0q + 0q. Determine y(d(n)). 490n*4 Let w(u) = 666177u*2 - 2. Let s(a) = -4a*2. Calculate w(s(m)). 10658832m4 - 2 Let z(q) = -q2. Let b(a) be the third derivative of 0 + 0a + 67/12a*4 - 34a*2 + 0a*3. Calculate b(z(d)). -134d*2 Let s(i) be the second derivative of -1/12i*4 + 0i*2 + 0 + 9i + 0i3. Let d(b) = 135b. Give s(d(a)). -18225a2 Let h(k) = 75k*2 + 66k*2 + 2 - 25k*2 + 1 + 30k*2. Let c(g) = 7g. Let d(x) = 4x. Let l(y) = -3c(y) + 5d(y). Calculate l(h(v)). -146v*2 - 3 Let g be (22 - -1) + (22 - 24). Let v(h) = -gh + 7h - h2 + 3h + 11h. Let p(q) = -9q*2 - 4q. What is v(p(t))? -81t4 - 72t*3 - 16t*2 Suppose -5q + 522 = -u + 59, -5u - 383 = -4q. Let p(m) = 179 - 87 - 14m - q. Let d(t) = -t2 + 4t*2 - 2t*2. Give d(p(h)). 196h*2 Let f(h) = -2h. Let b(n) = 622952314n. Give b(f(p)). -1245904628p Let b(p) be the first derivative of -p6/120 - p4/4 + 119p3/3 + 89. Let f(v) be the third derivative of b(v). Let m(x) = -3x*2. Give m(f(t)). -27t*4 - 108t*2 - 108 Let u = 159 - 99. Let l(x) = 107x + 62x - ux. Let a(y) = y*2. Determine a(l(c)). 11881c*2 Let q(y) = 2y*2 + 481. Let a(l) = 191l + 41. Calculate a(q(v)). 382v2 + 91912 Let m(t) be the second derivative of 1 - 8/3t*3 + 0t*2 + 11t. Let s(k) = 3k. Determine m(s(i)). -48i Let x(u) = -61 - 3u - 10u + 61. Let y be 4/6 - 14/21. Let c(q) = q + yq2 - q - 2q*2. Calculate x(c(i)). 26i*2 Let y(m) = -102m2 - 3. Let i(n) = -n2 - 24n - 6. Suppose -8 = -104r + 96r. Let u(w) = 4w + 1. Let l(p) = ri(p) + 6u(p). What is l(y(s))? -10404s4 - 612s*2 - 9 Let v(t) = -10t. Suppose 8 = 4c + 2h - 2, -2h = 2. Let m(r) = -11r*2 - 11r*2 + 19r*2 - cr*2. Calculate m(v(j)). -600j*2 Let k(v) = -2686523v. Let m(f) = 5f. Determine k(m(q)). -13432615q Suppose -9 + 8 = k. Let a(w) = -7w2. Let i(n) = -n2. Let p(g) = ka(g) + 5i(g). Let y(m) = -19m + m - 18m - m. Calculate p(y(c)). 2738c*2 Let m(x) = x. Let n(j) = 7578j + 166. Determine n(m(w)). 7578w + 166 Let h(g) = 6g. Let v(q) be the first derivative of -19q3/3 + 920. What is h(v(p))? -114p*2 Let l(x) = -2x*2. Suppose v - 264 = -32v. Let t(j) = -j + 3. Let d be t(-5). Let i(o) = -do - o - vo. What is i(l(b))? 34b2 Let n(x) = 6x*2. Let k(l) be the first derivative of 31l*2/2 - 77. Give k(n(o)). 186o*2 Let o(l) = 2l. Let n(z) = 53 + 32 - 125 + 38 + 84z2 + 60z*2. Calculate o(n(s)). 288s*2 - 4 Let u(f) = -167348f. Let v(k) = 120k. Determine v(u(o)). -20081760o Let p(y) = -502y2 + 126y*2 + 120y*2 + 133y*2 + 13y + 124y2 - 1. Let j(d) = -d2. Determine p(j(h)). h4 - 13h*2 - 1 Let l(o) = 3o. Let y(d) be the second derivative of 1/2d3 + 0 + 117d - d*2. Determine y(l(i)). 9i - 2 Let n(s) = 22s2 - 3s. Let l(q) = 51q2 - 6q. Let j(c) = 86c2 - 10c. Let g(z) = 3j(z) - 5l(z). Determine n(g(o)). 198o4 - 9o*2 Let w(s) = 2s*2 - 405s + 5. Let a(o) = o*2 - 270o + 5. Let z(n) = 3a(n) - 2w(n). Let g(d) = -104d2. Determine z(g(v)). -10816v*4 + 5 Let c(f) = 1581f*2. Let g(l) = -9l*2 - 136. Give g(c(q)). -22496049q*4 - 136 Let u(b) = 3b*2. Let a(o) = -21147573o*2. Calculate a(u(t)). -190328157t*4 Let p(k) = 57k*2. Let m(v) = 1109v - 2269v + 1092v. What is p(m(o))? 263568o2 Let f(c) = 15c*2. Let a(x) be the first derivative of 3x*2/2 + 47x - 2576. What is f(a(i))? 135i2 + 4230i + 33135 Let v(b) = 36b. Let i(z) = -2801156z + 1. What is v(i(c))? -100841616c + 36 Let d(j) be the third derivative of j5/10 - 25j*3/3 + 1893j*2. Let w(t) = -t. Determine d(w(z)). 6z*2 - 50 Let c(p) = 2767 - 2767 + 5p. Let y(o) = -368o. Give y(c(f)). -1840f Let x(u) be the third derivative of -4u4/3 + 1003u*2 + 1. Let f(t) = 2t*2 - 2. What is f(x(s))? 2048s*2 - 2 Let a(b) = b - 16. Let y(k) = 4k - 128. Let l(i) = -8a(i) + y(i). Let p(c) = 2c*2 + 722c. Determine l(p(s)). -8s2 - 2888s Let a(u) be the third derivative of -77u5/60 - 13u*2 - 5. Let b(s) = -12s*2. Give a(b(g)). -11088g*4 Let a(s) = 32s + 6. Let m be 1(-3 + -4 + 2 + 2). Let w(v) = 2v + 2. Let f(d) = mw(d) + a(d). Let n(p) = 7p*2. Calculate f(n(i)). 182i*2 Let d(x) = -31x*2. Let c = 4698 + -4696. Let t(h) be the third derivative of 0h*3 + 0 + 0h + 2hc + 1/12h*4. Determine d(t(a)). -124a*2 Let q(r) = -7r. Let t(b) = 81b2 + 7b - 50. Let v(d) = 39d2 + 4d - 30. Let k(w) = 3t(w) - 5v(w). Calculate q(k(p)). -336p2 - 7p Let c(n) = 8229688n. Let y(v) = -v. Calculate y(c(i)). -8229688i Let p(v) = -39v2 + v2 + 34v*2 + 5v*2. Let b(z) = -4z*2 - 13z + 13z. Determine b(p(f)). -4f*4 Let g(w) be the second derivative of 7/12w*4 + w + 0w*2 + 0 + 0w3. Let y(o) be the second derivative of o3/6 + 22o + 59. Calculate g(y(t)). 7t2 Let n(z) = z2. Let q(k) = -7k2 + 2471k - 4962k + 2484k + 3. Determine q(n(c)). -7c4 - 7c*2 + 3 Let t(l) = -3l*2 + 2l. Let b = 420 + -416. Let u(i) = -11i - 8. Let a(k) = -23k - 18. Let q(d) = ba(d) - 9u(d). Calculate q(t(f)). -21f2 + 14f Let y(m) = 6120m2 - 3m - 197. Let t(a) = 2a. Determine y(t(p)). 24480p*2 - 6p - 197 Let t(f) = 1297f. Let s(u) = -2046u. Calculate t(s(r)). -2653662r Let s(c) = 24c*2 - 12c*2 - 1923 + 1923 - 11c*2. Let a(r) = -31r. Determine a(s(i)). -31i2 Let z(s) = -3 + 13 - 10 + 2s*2. Let r(t) be the first derivative of -9t*2 + 1594. Give z(r(h)). 648h2 Let q(g) be the first derivative of g2 - 1047. Let n(c) = -219c2 - c. Determine q(n(m)). -438m*2 - 2m Let b(p) = 3p2. Let n(a) be the third derivative of -41a*6/90 - 26a*3 + 41a*2 - 2. Let o(u) be the first derivative of n(u). Give o(b(l)). -1476l*4 Let v(r) = -4r + 119. Let h(n) = 11n - 229. Let o(d) = -2h(d) - 5v(d). Let s(x) = 2x. Give s(o(f)). -4f - 274 Let t(s) = -7s*2 - 8. Let j(p) = 6021p. Determine j(t(c)). -42147c2 - 48168 Let s(z) = 28z - 24z - 5z. Let x(k) be the first derivative of k4/12 - k2/2 + 1. Let l(v) be the second derivative of x(v). What is s(l(w))? -2w Let z(u) = 3u. Let o(i) = 5675813i2. Calculate o(z(m)). 51082317m2 Let m(c) = c2 + 13149. Let p(v) = 135v. Calculate m(p(z)). 18225z*2 + 13149 Let i(a) = 43a. Let s(j) = -12j - 10. Let f be (-8 + 13 + -7)/((-1)/2). Let k(m) = -10m - 8. Let b(u) = fs(u) - 5k(u). Give b(i(w)). 86w Let p(g) = -2g. Let h(s) = -59102508s - 2. Calculate h(p(w)). 118205016w - 2 Let w(o) be the first derivative of 2152o3/3 + o2/2 + 398. Let l(v) = 2v. Give w(l(d)). 8608d2 + 2d Let d(a) be the first derivative of -a*4/3 - 31a*2/2 + 70. Let g(q) be the second derivative of d(q). Let c(s) = -6s. What is g(c(k))? 48k Let a(i) = -174i*2 + 56i - 4. Let d(w) = -172w2 + 42w - 3. Let c(n) = 3a(n) - 4d(n). Let u(b) = b + 5b - b - 6b. What is u(c(p))? -166p2 Let g be (-4)/(-18) + 185284/198. Let p(q) = 936 - 11q - g. Let w(i) be the second derivative of i*3/6 + i. What is w(p(f))? -11f Let c(n) = 2309 - 287n - 2309 - 65n. Let b(d) = -6d. Calculate b(c(q)). 2112q Let z(r) = 23r2 + 10r + 15. Let h(o) = -851o2 - 368o - 552. Let n(v) = 5h(v) + 184z(v). Let q(k) = -25k2 - 1. Determine q(n(p)). -13225p4 - 1 Let q(m) be the second derivative of m4/12 - 25m2/2 - 79m + 3. Let f(o) = 7o2. Give q(f(h)). 49h*4 - 25 Let i(l) = 128l2. Let b(w) be the third derivative of -w4/12 - 14w3/3 - 4258w*2. What is i(b(m))? 512m*2 + 14336m + 100352 Let n be (-38)/8 - 4/16. Let b be (3 + n)2/(-2). Let i(y) = -y - 7. Let h(u) = -1. Let v(z) = bi(z) - 14h(z). Let s(x) = 5x**2. Deter	{ "pile_set_name": "DM Mathematics" }
he first derivative of -d*2/2 - 12d + 2. Suppose -3h = -4l - 282, l + 4l + 355 = 5h. Let r = -77 - l. Calculate j(r). -4 Let p = 30 + -25. Let h(k) = 5 + 1 + 0 + k - p. Let b = 3 + -2. Calculate h(b). 2 Let j be ((3 + -2)/2)/((-2)/272). Let h = j + 60. Let a(n) = n*2 + 6n - 6. Calculate a(h). 10 Let z(t) = 22 - 24 + 3t3 + t + 19t*2 + 11t - 2t3 - 6t*2. Calculate z(-12). -2 Let o(h) be the second derivative of 1/3h*3 + 0 - 3h*2 - 13h. Calculate o(5). 4 Let m(s) = s*2 + s + 19. Let t(j) = 3j + 21. Let n be t(-7). Calculate m(n). 19 Let i be 966/(-84) + 6/(-4). Let n(h) = -h*3 - 14h*2 - 13h - 4. Give n(i). -4 Suppose 590l = 589l - 4. Let u(i) = i*2 + 4i + 4. Determine u(l). 4 Let u(c) = -c*2 - 3c + 4. Suppose -2v = 3j - 6j, -v = -2j + 1. What is u(v)? -14 Let j(r) = -19r3 + r2 - 4r + 1. Let h(n) = -32n3 + 3n*2 - 9n + 3. Let s(b) = -3h(b) + 5j(b). Calculate s(3). 8 Let d(z) = -68z2 - 63z2 - z3 - 2 + 0 + 133z2 + 3z - 2z. What is d(1)? 0 Let h be (4 - 0) + (-4)/(16/(-12)). Let j(a) = 1. Let c(z) = -z2 + 6z + 13. Let k(b) = c(b) - 3j(b). Give k(h). 3 Let w(i) = 2i + 32. Let b be w(-13). Let q(x) = 0x - 2x + x - b. What is q(-5)? -1 Let i(b) = -6b2 - 70b - 14b3 - 4 + 77b + 15b3. Give i(5). 6 Let u(h) = h3 + 9h*2 + 9h + 2. Let x(v) = -2v2 - 3v + 82. Let a be x(6). Determine u(a). -6 Let x(k) be the third derivative of k6/60 - k4/24 - k*3/6 - 2k2 + 1. Give x(-1). -2 Let v(o) = -o2 - 1. Let m(n) = -2n2 - 13n + 1. Let a be m(0). Calculate v(a). -2 Let i(s) = s*3 - 7s*2 + 3s + 3. Let f(j) = 33j - 27. Let c be f(1). Determine i(c). -15 Let t(n) = 56n*2 - 61n2 - 1 + 5 + n3. Determine t(5). 4 Let m(j) be the first derivative of j*4/4 - 5j*3 + 15j*2/2 - 16j - 413. Determine m(14). -2 Let v(b) = -5b + 3. Let z(x) = -9x + 7. Let j(u) = -5v(u) + 2z(u). Suppose 3n - 7 = 2d, -6 = -n - d - 2d. Calculate j(n). 20 Suppose -196 = -56i + 196. Let c(m) = m*2 - 8m - 7. What is c(i)? -14 Let v(s) = s*3 + s - 22. Suppose 24n - 19n = 0. Give v(n). -22 Suppose -3q = -4q - 3t + 18, 0 = 3q - 2t - 10. Let m(o) = -3o + 18 - o3 - 6o*2 - 6 - q. Give m(-5). -4 Let p(x) = 9163x*3 - 4x - 9164x3 - 9x*2 + 5 + x. What is p(-8)? -35 Let z(r) = 3r - 19. Suppose 0 = 3s - 113 + 89. Give z(s). 5 Let n(h) be the second derivative of -h3/6 + h2/2 - h. Let m = 24 - 5. Suppose -5o + 6 = 5a - m, 2o - 16 = -4a. Calculate n(o). -1 Let d(k) = k2 + 1 - 12 + 8 + 2k. Let p(r) = r*2 + 16r - 22. Let a be p(-17). Determine d(a). 12 Suppose 0 = 4k - 6k + 4. Suppose 12 = -kf - 2. Let h(t) = -t + 8. Determine h(f). 15 Let x be (-5(-8)/20)/(3/531). Let n(j) = j*2 + 356j + j*2 - xj + 1. Give n(-3). 13 Let v(n) = n*3 + 3n2 + 2. Let o be v(-3). Let z(y) = 3 + 3 - yo - 3. Suppose 4r = 12r + 6r. Calculate z(r). 3 Suppose -5i - 23 = 2z, 7 = -i + z + 1. Let n(k) = 2k + 5. Determine n(i). -5 Let x(q) = 5q - 6. Let d be (2-2)/(-4 + 2). Let g be d - (-10)/(-1 + 6). Calculate x(g). 14 Let z = 1803 - 1802. Let g(x) = 2 - 5 + 3 - 8x - 1. Give g(z). -9 Let w(n) be the first derivative of 4n*3/3 - 3n*2/2 - 3n - 4. Let j = 35 + -36. Let z(u) = -1. Let i(m) = jw(m) + 3z(m). Give i(2). -10 Let t(o) = 2o - 15. Suppose -3w = -21a + 18a + 42, -5a + 52 = w. Determine t(a). 7 Let a(p) = -p3 - 4p*2 + 6p - 5. Let v be (-24)/(-64) - 86/16. What is a(v)? -10 Let o(w) be the second derivative of -w*4/12 - 7w*3/6 - 3w*2 - 21w + 2. Calculate o(-5). 4 Let u(f) = -2f3 + 12f*2 + 7f - 11. Let c(l) = 8l3 - 48l*2 - 30l + 45. Let q(p) = 2c(p) + 9u(p). Calculate q(6). 9 Let q(g) = -g - 5. Let w be ((-88)/(-220))/(2/15). Give q(w). -8 Let c(h) be the third derivative of 2h2 - 1/60h*5 + 0 + 1/4h*4 + 0h - h*3. Let y = 43 - 38. What is c(y)? -1 Let b(t) = -27t - 2. Suppose -150g = -152g - 2. Calculate b(g). 25 Let x(h) = -2 - 12h - 14h + 27h. Suppose 4 = -v + 3q, 2v - 3v - 5q = -12. Suppose -3g + 25 = 2u, g - 6g = vu - 39. Determine x(g). 5 Let w(u) = 9u*3 + 8u*2 - 4u + 3. Let x(v) = 4v3 + 4v*2 - 2v + 1. Let b(j) = 3w(j) - 7x(j). Give b(-4). -6 Let z(m) = 14m2 + m - 1. Let s be 1/((-60)/(-15)(-2)/(-40)). Suppose 0w = 4w, -5c + w + s = 0. Determine z(c). 14 Let b be (-10)/1(-2)/5. Suppose -8c = -bc + 12. Let y(u) be the third derivative of -u*4/24 - 3u*2. Give y(c). 3 Let q(d) = -10d + 47. Let p be q(5). Let s(u) = 9u + 36. Calculate s(p). 9 Let f(n) = -35 - 35 + 10n - 37 + 107. What is f(-1)? -10 Let d(q) = 4 + 7 + 8q - q2 - 2q - 4. Let s = 13 + 9. Suppose 4u - 2 = s. What is d(u)? 7 Let p(h) = -h3 + h2 + 3h - 1. Let o be p(2). Let k(w) = w - 5w + 3w + o. Let b(m) = 19m + 50. Let c be b(-3). Calculate k(c). 8 Suppose -3i = s, -4s + i = 21 - 8. Let d = 4 - -1. Let l(n) = 0n + 4n - 3 - dn. What is l(s)? 0 Let t = 14 + -24. Let i(c) = -c*3 - 9c*2 + 9c + 9. What is i(t)? 19 Suppose -5q + 23 = -a, -4a - 22 = -3q - 15. Let u(m) = 2m*3 - 11m*2 + 7m - 1. Calculate u(q). 9 Let j = -1871 + 1873. Let c(w) be the second derivative of 0 - 11w + 1/4w*4 + 3/2w*j + 0w*3 + 1/20w5. Calculate c(-4). -13 Let t(b) = 1 + b + 3 + b2 - 6b - 1 - 5. Calculate t(3). -8 Let l(s) = 15s + 99. Let r be l(-7). Let p(b) = 5b + 8. Give p(r). -22 Let y(f) = -3f*3 - 13f*2 - f - 11. Let h(j) = 2j3 + j2 + j + 1. Let a(r) = -2h(r) - y(r). Give a(11). -2 Let x(f) = -4f + 20. Suppose 3j + a - 40 = 0, 19j - 21j - 2a = -24. Calculate x(j). -36 Let b(h) = -h*3 + 8h*2 - 9h + 3. Suppose -112 + 21 = -13d. Determine b(d). -11 Let h(d) be the second derivative of d3/6 - 3d*2/2 - 78d. Calculate h(8). 5 Let m(b) = -4 + 32b + 2 - 33b. Let a = -38 - -38. Let q be (-5 - -4)a/2. What is m(q)? -2 Let f(d) = 3d + 3. Let s be 1-23(-11 + 10). Suppose 0x + 5k - 25 = -5x, -5k + s = 3x. Suppose 8 + x = -3l. Give f(l). -6 Let z(f) = -5f + 81. Let l be z(17). Let x(b) = b + 0 - 3b + 3b + 3. Give x(l). -1 Let l(i) = 68i + 192. Let q(f) = -13f - 39. Let a(g) = -2l(g) - 11q(g). Determine a(-7). -4 Let r = -64 - -65. Let o be -5 - (-10 - r) - (2 - 0). Let p(q) = -4q*2 + 3q*2 - q + 3q. Determine p(o). -8 Let a(o) = 32o + 4. Let g(i) = -1. Let t(m) = -a(m) - 5g(m). Calculate t(1). -31 Let h(j) be the second derivative of j3/3 - j2 - j. Let u(t) = -t*3 - 11t*2 + 18t + 79. Let l be u(-12). Calculate h(l). 12 Let o(k) = -k*2 + 12k + 19. Let a = 60 + -47. Give o(a). 6 Let t = -37 - -39. Suppose 5s + 4d + d + 20 = 0, -3s - td = 12. Let b(y) = y*3 + 5y*2 + 6y + 3. Calculate b(s). -5 Let m(s) = -s - 1. Let c = 30 - 94. Let u = -64 - c. What is m(u)? -1 Let o = -52 - -57. Let z(k) = -2 + o - 6k - k2 + 5 + 0k. Suppose 18 = -4c - 6. Calculate z(c). 8 Let l be (-7)/(-3) + -34/(-18). Suppose lf + 0 = -12. Let o(j) = -2j*2 - 6j. Calculate o(f). -8 Let r(b) be the second derivative of -b7/840 + b6/360 - b*4/24 + 7b*3/6 - b. Let g(s) be the second derivative of r(s). Let n = -61 + 61. Calculate g(n). -1 Let k = 342 - 347. Let o(r) = -2 - 9r + r*3 + 3r*2 + 0r*2 - 1 + r. Determine o(k). -13 Let g(k) = -3k3 + k2 - 5. Let o be -3520/(-78)2/8. Suppose -4h - h - 10 = 0. Let u(r) = -7r*3 + 3r*2 - 9. Let v(j) = hu(j) + og(j). What is v(0)? -7 Let r(z) be the second derivative of z4/12 + 5z*3/6 + 20z. Let f be 4/18 + (-304)/72. Calculate r(f). -4 Let c(x) = -x + 2. Let r(i) = -i*3 + 5i*2 - 2i - 5. Suppose 12 = -k + 4. Let n be k((-14)/4 - -3). Let z be r(n). Determine c(z). -1 Let h(t) = t3 + 8t*2 - 10t - 7. Let k be h(-9). Suppose 0 = -i + 2i - k. Let w(g) = -15g + 3 + 2g + 6g + gi. What is w(6)? -3 Let d(h) be the third derivative of -h4/12 + 2h3/3 + h2. Suppose -4n + 12 = -w, 5 = 4n - 3. Give d(w). 12 Let n(d) = 26 + 3d + 7d + 13 - 5 - 16d. Give n(7). -8 Suppose 5c - 28 = -4o, -c + 3o = -5 + 7. Let s(g) be the third derivative of -g6/120 + g5/15 - g4/12 + g3/6 + 5g*2. What is s(c)? -7 Let g(v) = -8v2 - 8. Let r(f) = f2 + 1. Let d(z) = -g(z) - 10r(z). Suppose 5y = 25, y + 3 = -2i + 12. Suppose 2u - u = -i. What is d(u)? -10 Let h(p) = -p*3 + 4p*2 - 2p +	{ "pile_set_name": "DM Mathematics" }
qmqcqq. What is prob of sequence mm? 3/136 Three letters picked without replacement from xcccxcccxccccccxxc. What is prob of sequence xxx? 5/408 What is prob of sequence lll when three letters picked without replacement from lll? 1 Four letters picked without replacement from qlcclq. What is prob of sequence lqcq? 1/45 What is prob of sequence gm when two letters picked without replacement from {m: 3, g: 8}? 12/55 Calculate prob of sequence thth when four letters picked without replacement from ttttttttthhttthhtttt. 8/323 What is prob of sequence uo when two letters picked without replacement from bvruo? 1/20 What is prob of sequence hwd when three letters picked without replacement from dhmhwm? 1/60 Calculate prob of sequence pb when two letters picked without replacement from {u: 9, p: 2, h: 2, b: 1}. 1/91 What is prob of sequence rlrl when four letters picked without replacement from {l: 6, r: 2}? 1/28 Calculate prob of sequence wwww when four letters picked without replacement from {w: 2, p: 2}. 0 Calculate prob of sequence sy when two letters picked without replacement from {y: 2, m: 11, s: 5, e: 1}. 5/171 What is prob of sequence dj when two letters picked without replacement from jsdssjjdsssjd? 1/13 Calculate prob of sequence rjj when three letters picked without replacement from jjrrrjrjrrr. 14/165 Calculate prob of sequence jq when two letters picked without replacement from {m: 3, j: 1, q: 1, c: 2}. 1/42 Three letters picked without replacement from gqnngxqiqg. What is prob of sequence qig? 1/80 What is prob of sequence cmm when three letters picked without replacement from cccccccmmcm? 8/165 Calculate prob of sequence xll when three letters picked without replacement from lxlxxllllxxxlxxllxlx. 5/38 Three letters picked without replacement from {o: 1, e: 6, r: 2, u: 2}. Give prob of sequence rou. 2/495 What is prob of sequence vvvv when four letters picked without replacement from {v: 9}? 1 Two letters picked without replacement from {n: 9, o: 7}. Give prob of sequence oo. 7/40 What is prob of sequence qvff when four letters picked without replacement from {q: 5, v: 2, f: 9}? 3/182 What is prob of sequence effe when four letters picked without replacement from ffefeffefefffeffeff? 65/1292 Calculate prob of sequence ozzo when four letters picked without replacement from {o: 3, z: 3}. 1/10 Four letters picked without replacement from umuldyuxdmxduud. Give prob of sequence uuyd. 2/819 Four letters picked without replacement from ccwvvcdvaacawvccccw. Give prob of sequence vwav. 3/2584 Three letters picked without replacement from vopkk. Give prob of sequence kvo. 1/30 Two letters picked without replacement from yyffyypyifyyypf. Give prob of sequence if. 2/105 Calculate prob of sequence ycyt when four letters picked without replacement from ctyyttctttytccct. 1/182 Calculate prob of sequence vvv when three letters picked without replacement from {x: 2, i: 3, o: 3, v: 5}. 5/143 Calculate prob of sequence znk when three letters picked without replacement from knkkkknzzktknknnkn. 3/136 What is prob of sequence bbbb when four letters picked without replacement from bbbbbbb? 1 Calculate prob of sequence xn when two letters picked without replacement from nppxpjnpxnff. 1/22 Calculate prob of sequence ss when two letters picked without replacement from gsqsggsggqggssgsg. 15/136 Three letters picked without replacement from igigiigggggii. What is prob of sequence igg? 21/143 What is prob of sequence dah when three letters picked without replacement from {b: 2, d: 1, h: 1, a: 4}? 1/84 Three letters picked without replacement from swusfxu. What is prob of sequence uwx? 1/105 What is prob of sequence oh when two letters picked without replacement from {b: 2, g: 2, x: 1, h: 1, o: 1}? 1/42 What is prob of sequence hdh when three letters picked without replacement from {d: 4, z: 6, h: 3}? 2/143 Three letters picked without replacement from {u: 12, c: 1, a: 3}. Give prob of sequence uau. 33/280 Four letters picked without replacement from {p: 3, b: 3, h: 2, k: 7, w: 3, i: 1}. What is prob of sequence hpww? 1/2584 What is prob of sequence ud when two letters picked without replacement from riidmuduihmi? 1/33 Three letters picked without replacement from {l: 2, s: 11}. Give prob of sequence lss. 5/39 Three letters picked without replacement from {g: 3, x: 3, f: 1}. Give prob of sequence xgx. 3/35 Two letters picked without replacement from xlllxxxlllxgxgx. What is prob of sequence xl? 1/5 Calculate prob of sequence zcc when three letters picked without replacement from wwwzwwccqwqtqcwc. 1/280 What is prob of sequence bbc when three letters picked without replacement from bbbc? 1/4 Three letters picked without replacement from nnkkkknknk. What is prob of sequence kkk? 1/6 Three letters picked without replacement from iiibaiiiibiia. Give prob of sequence baa. 1/429 Two letters picked without replacement from {p: 1, y: 1, e: 5, z: 1, n: 1}. Give prob of sequence pz. 1/72 What is prob of sequence yel when three letters picked without replacement from yllylylyyey? 4/165 Four letters picked without replacement from rreuueruevrrueuu. Give prob of sequence uuuv. 1/364 Four letters picked without replacement from deddyeydee. Give prob of sequence ydey. 2/315 Three letters picked without replacement from {s: 4}. Give prob of sequence sss. 1 What is prob of sequence ysk when three letters picked without replacement from ksyhh? 1/60 Calculate prob of sequence ts when two letters picked without replacement from tttsss. 3/10 Four letters picked without replacement from {r: 3, d: 17}. Give prob of sequence dddd. 28/57 Two letters picked without replacement from {g: 1, p: 2, d: 4, l: 3}. What is prob of sequence dd? 2/15 Three letters picked without replacement from {y: 1, l: 2, v: 1, e: 2}. Give prob of sequence lee. 1/30 Two letters picked without replacement from bidbdbddbib. Give prob of sequence bi. 1/11 What is prob of sequence qpqf when four letters picked without replacement from fqfqfqqqfsp? 1/99 What is prob of sequence wwwi when four letters picked without replacement from wiww? 1/4 What is prob of sequence pnp when three letters picked without replacement from xxxnnpxpp? 1/42 Calculate prob of sequence eip when three letters picked without replacement from {r: 2, p: 1, i: 1, e: 1, n: 2, m: 1}. 1/336 Four letters picked without replacement from {a: 7, q: 9}. What is prob of sequence qqaa? 9/130 Four letters picked without replacement from eeeeeeeeeedee. What is prob of sequence eede? 1/13 Two letters picked without replacement from {u: 1, d: 5, a: 1, v: 1, s: 1, e: 5}. What is prob of sequence va? 1/182 Three letters picked without replacement from {k: 13, o: 3, j: 3}. Give prob of sequence joj. 1/323 Two letters picked without replacement from {x: 6, n: 4}. What is prob of sequence nx? 4/15 Calculate prob of sequence vyv when three letters picked without replacement from yvvv. 1/4 Four letters picked without replacement from mptppjpmvvcvjc. Give prob of sequence cjpm. 4/3003 Three letters picked without replacement from tjjyjjytttwjjat. What is prob of sequence wta? 1/546 Calculate prob of sequence bov when three letters picked without replacement from {b: 2, v: 1, o: 4}. 4/105 What is prob of sequence ysas when four letters picked without replacement from {v: 4, a: 4, y: 3, n: 4, s: 1}? 0 Four letters picked without replacement from {v: 4, c: 7}. Give prob of sequence vcvv. 7/330 Calculate prob of sequence anan when four letters picked without replacement from {n: 5, p: 2, a: 8}. 4/117 What is prob of sequence fhff when four letters picked without replacement from {f: 3, t: 1, h: 12}? 3/1820 Calculate prob of sequence nnnn when four letters picked without replacement from nnnnnn. 1 Calculate prob of sequence umww when four letters picked without replacement from mywusmcyccsswuww. 1/910 Three letters picked without replacement from {o: 4}. What is prob of sequence ooo? 1 What is prob of sequence yw when two letters picked without replacement from {s: 4, y: 1, w: 3}? 3/56 What is prob of sequence wd when two letters picked without replacement from {o: 4, h: 7, y: 2, d: 1, w: 2}? 1/120 What is prob of sequence vh when two letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
5 - 6h*4 - 15h*3 Expand (-2m + 2m + m)(-2 + 0 + 0)(26 - 98 - 24). 192m Expand (-3 - 3 + 4)(156q - 37 + 22 + 16). -312q - 2 Expand (-21 + 24 + 24w + 37w)(w - w + w*4). 61w*5 + 3w*4 Expand -3g3 - g3 + 0g3 - 2g*3 + 4g*3 + 0g*3 + (4g - g - 2g)(0 - g*2 + 0) + (16 + 15 - 36)(-g*2 - 3g3 + g2) - 2g3 + 2g*3 - 2g*3. 10g*3 Expand (-w - 12w + w)(-2w - w - w)(-2w + w*2 + 2w). 48w4 Expand (-2 - 3 + 4)(9p4 - 19p4 + p4) + (-6p3 + 4p*3 + 0p*3)(-2p - 4 + 4) - 3p*4 + 3p*4 - 2p*4. 11p*4 Expand (-2 + 5 - 1)(19r + 13r - 8 - 42r)(-3r4 + 3r4 + r4). -20r5 - 16r*4 Expand -202572 + 203635 - z + 4z*2 - 3z*2 + (-2 + 2 + 1)(-2z2 + 2z*2 - 2z2). -z2 - z + 1063 Expand (4 + 0v - 5 - v)(5v4 - 2v*4 - 2v*4) + (0v*2 - 6v*2 + 3v*2)(-4v3 + 9 - 9) + v5 + 3v5 + v5. 16v5 - v4 Expand (-o + 4 - 4)(19o - 5 + 8 - 4o)(4o - o - o + (2 - 2o - 2)(-2 + 4 + 1)). 60o3 + 12o*2 Expand 3t*3 - 3t*3 + 5t*4 + (2t + 3 - 3)(-t3 + 5t*3 - 2t3) - t4 + 0t4 + 0t*4 + 91t*4 + 88t*4 - 125t*4. 62t*4 Expand 2 - 2 - 2z + (1 + 1 - 1)(-3z + z + 3z) + 0z - z + 3z + z - 2z + 2z + (1 - 1 - 2)(450z - 899z + 465z). -30z Expand (3v2 - 55v - 104946 + 104946)(0v*3 - 2v3 + v3). -3v5 + 55v*4 Expand (-z - 2 + 2)(0 + 0 - 2z) + 334z*2 + 2z - 691z2 + 352z*2 - 11. -3z*2 + 2z - 11 Expand 1 + 1 + x - 2x + (-36 + 12 + 11)(3x - 5x - 2x). 51x + 2 Expand (u - u - u)(-2 + 2 + u)(0 + 0 + u)(3 - 18 - 13) + 12u*3 + 12u*2 - 12u*2. 40u*3 Expand (-x + 4x + 7x)(-7 + 4 - 11)(-2 + 4 + 0). -280x Expand (2 + 2 - 2)(4 - 3 + 0)(-3c3 + 0 + 0)(0c2 - 2c*2 + 3c*2) + 4c*5 + 4c*3 - 4c*3. -2c*5 Expand (-23u + 15u - 59u)(72u - 72u - 3u*2). 201u*3 Expand (-4y*3 + 47 - 47)(4y + y2 - 2y*2 + 4y*2). -12y*5 - 16y*4 Expand ((n - n - 2n*3)(-1 + 2 + 1) + (0n - n + 0n)(2n*2 - 4 + 4))(26n - 15n + 20n). -186n*4 Expand (-2b - 4 + 4)(12b*4 + 13b*3 - 13b*3 + 1). -24b*5 - 2b Expand 0w5 + 3w5 - w5 + 3w5 - 88w*5 - 179w*5 + (4w + 0w - 2w)(4w4 - w4 - 4w4) - 2w*5 + 0w*4 + 0w*4. -266w*5 Expand -3b - 26 + 26 + (5 - 3 + 0)(8 - 8 - 4b). -11b Expand (-3g + 7g - 3g)(-11 - 1425g*2 + 1524g*2 + 8). 99g*3 - 3g Expand -3 - 2o3 + 140o*5 + 1 - 406o*5 + (2 - 3 + 2)(-3o5 + 4o*5 + 0o*5). -265o*5 - 2o*3 - 2 Expand (1048k*4 - 464k*4 - 2k + 2k)(0 - 1 + 5). 2336k4 Expand (-3o + 0o + 2o + (1 - 3 + 3)(-2o - 4 + 4) + 0 - o + 0 - o - 56 + 56 + 2o + 0 + 0 + (-4 + 1 + 1)(-2o + 2o - o))(7 - 2 - 4). -o Expand (-1 + 0 - 2)(-4n - n + 3n)(-5n*3 - 6n3 + n3) + n4 + n4 - n*4. -59n*4 Expand 10t + 54t2 + 2t*4 - 30t*2 - 28t*2 + (9t + 3t - 6t)(-4t*3 + 3t3 - t3). -10t4 - 4t*2 + 10t Expand (-3t - 4t + 9t)(-4t + 4t + t2) - t2 + t2 + t3 + (-11t3 - 134t + 134t)(2 + 1 - 4). 14t3 Expand (-36p + 57p - 89p)(p + 4p - 4p)(3p - p - 3p). 68p3 Expand (k - 4k + k)((k4 + 0k4 + k4)(-8 - 73 - 27) - 2k4 + k4 - k*4) - 3k*5 + 5k*5 + 3k*5. 441k*5 Expand -4g + 5 + 5 - 13 + (6 - 1 - 4)(g - 2g - 5g). -10g - 3 Expand (2a2 - 5a*2 + 2a*2)(-5 - 3a2 + 5 + (-4a + 4a + 2a)(-1 - 2a + 1) + (3a2 + 4 - 4)(42 - 85 + 39)). 19a4 Expand (-371r + 3r3 - 5r*4 + 371r)(3 + 0 + 2). -25r*4 + 15r*3 Expand (-2 + 1 - 1 + (-5 + 5 + 6)(-4 + 0 + 3))(10 + n - 10 + (2 + 2 - 2)(-2n - n + n)). 24n Expand (151c - 151c + 49c2)(6 - 6 + 4). 196c2 Expand (5 - 5 - l + 2l - l + 0l + (-1 + 0 + 2)(3l + l - 6l))(3l - l + l*2 - 5l). -2l3 + 6l*2 Expand (3t*3 + 2t*3 - 4t*3 + (-4t - 2t + 4t)(3t*2 + 2 - 2) - 2t3 - t3 + t*3)(-2t + 3t + t). -14t4 Expand (-7o - 4o - 3o + (-5o + o + 6o)(-3 + 1 + 1))(-o*2 + 3o2 + o2) + (4o - 3o - 4o)(-o*2 - 3o*2 + 5o*2). -51o*3 Expand ((-15 - 32 - 6)(1 + 0 - 2) - 2 + 2 - 1)(-v + 4v - 5v). -104v Expand (-173n + 173n + 73n2)(3 - 3 - n*3 + (-n - 2n + 5n)(-3n2 + 4n*2 - 2n*2) + (-n - n - 11n)(-n2 - 3n + 3n)). 730n5 Expand (-2 + 2 + z2)(-9470z + 9470z - 3z*2 + 28). -3z*4 + 28z*2 Expand (2 - 2 - 2)(-4 - 7 + 3)(-19m - m + 54m). 544m Expand (-31x3 + 8x*3 - 45x*3)(-1 - 2 + 1). 136x3 Expand (4i - 6i - 7i - 9i)(i*3 + 0i*3 - 3i*3). 36i*4 Expand (-19q - 23q + 24q)(-1 + 3 - 3)(7q - 28 + 28). 126q*2 Expand -5p*3 + 5p3 + p5 + (p - p - 3p4)(0p + 11p - 5p). -17p*5 Expand (1689k*2 + 1689k*2 - 3379k*2 - 365)(-2k + 5k - 4k). k3 + 365k Expand (2w - 4w - w)(-1 - 1 + 1) + 50 - 50 + 3w. 6w Expand ((6 - 1 - 3)(-2 + 3 - 3) + 4 - 1 - 1 + 2 - 1 - 7)((-t2 - 4t*2 + 4t*2)(-4 + 2 + 0) + t*2 - 4t*2 + 4t*2). -24t*2 Expand -2n + 7n4 + 10n*4 - 2n*3 - 5n4 - n4 + 2n4 + 0n*4 + 2n4 - n2 + n*2 + (1 - 1 - 1)(3n - 3n - 2n4) + 0 + 0 - 2n*4. 15n*4 - 2n*3 - 2n Expand ((-2d - d + 6d)(-d + d - 2d) - 5d + d2 + 5d - 5 + 0 + d2 + d2)(5d + 0d - 2d). -9d3 - 15d Expand 7o4 + o4 - o4 + (-10o + 10o + 8o*3)(2o + o + 5o). 71o4 Expand (1 - 5 + 3 + (-2 - 3 + 3)(2 - 4 + 3) + 5 + 0 - 3)(10t - 4t + 2t). -8t Expand (0b + 0b + 2b)(89 - 13b - 88 + b). -24b2 + 2b Expand (-125 + 125 - 21n2)(9 - 3 - 1)(2 + 0 + 1)(-n + 0n + 3n). -630n3 Expand (0 - 6 - 8)(2p + 4p - 4p)(2p - 7p + p). 112p2 Expand (3 + r - 2 + 0)(5r + r + 4r)(-5r - 5 + 5). -50r3 - 50r*2 Expand (0 + 0 - 4)(2a - 3a - 63a5 - 120a*5). 732a*5 + 4a Expand (13 - 42 - 23)(k2 + k2 + 0k*2). -104k*2 Expand (-2 + 1 + 2)(28i3 + 15i*3 - 12i*3)(-i - i + 0i)(-1 + 0 + 3). -124i4 Expand (-5u + 4u + 3u)(1 - u3 - 1) - 16u*4 + 247u*2 - 247u2 - u + 7 + u4 - 7. -17u4 - u Expand (3u*2 + 0u*2 - 5u*2)(-u + u*2 + u + 2u*2 + u - u + (-2 + 3u*2 + 2)(0 + 3 - 2) + 2u2 - 5u2 + u2). -8u4 Expand (5g - 2g - g)(-13 + 46 + 0g + g) + (0 + 2 - 3)(-2g + g2 + 2g). g*2 + 66g Expand (-7x2 + 3x*2 + 2x*2)(24 - 91 - 64). 262x2 Expand (-67l + 168l + 181l)(3l - 2l - 2l). -282l2 Expand ((6 - 3 - 2)(-4 - 2 + 1) + 1 - 5 + 2 + (-4 + 4 + 2)(3 + 3 - 4) + 1 + 0 - 4)(-7j + 5j - 7j). 54j Expand (2 - 4 - 5)(-4g - g + 3g)(5g2 - 5g*2 - 6g*3). -84g4 Expand (a3 + 2a3 - a3)(1 - 144 + 6). -274a3 Expand (19l*4 + 13l*4 + 30l*4)(-l + 0 + 0 + 1 + 2l - 1 + 3 - 2l - 3 + 4 - 4 + l + (-3l + 2l + 2l)(-4 + 1 + 1) + l - 2l + 0l + 0l + l + 0l). -124l5 Expand (o4 + 3o*4 - 2o*4)(-2o - 2o + 6o - 3o - o + 2o + (0 - 1 + 3)(-o + 2o + o) + 5o - 2o - 2o - o - 2o + 4o + 2 - o - 2). 10o5 Expand (3 + w - 3)(-7w + 33 - 33)(w*2 + 7w*2 + 13w*2). -147w*4 Expand ((1 - 2 - 17)(-1 + 1 - 4d2) - d2 - 3 + 3)(-4 + 2 + 5) + 3d2 + 2d*2 - 4d*2 + (0 + 5 - 3)(-3d2 + 4d2 + d2). 218d2 Expand (-100 - 17 + 0)(4a - 12a + 4a) + 5a + 0a - 3a. 470a Expand (19b - b - 30b)(-89 + 89 - 19b2). 228b*3 Expand -182 - 53s4 + 182 + s4 + 2 - 2 + (-s2 + s2 - 6s3)(-3s - 2s + 3s). -40s*4 Expand (62 - 41 + 381)(f - 2 + 2)(-2f + 2f + f). 402f*2 Expand (5z + 2z + 20z)((-1 - 4 + 3)(5z4 + 0z*4 - 4z*4) + 7z*4 + 0z*4 - 3z*4). 54z*5 Expand 310y + 162y - 609y + (2y + 4y - 5y)(-3 + 2 + 0). -138y Expand (-443f + 127f - 875f)(3f - 4f - f) - 4f*2 - 4f*2 + 6f*2. 2380f*2 Expand (5 - 2 - 39)(-8m + 10m - 7m). 180m Expand (67 + 24v - 67)(-2 + 2 - 4). -96v Expand (-1440r + 1052r + 949r)(0 - 3 + 0). -1683r Expand (-20 - 11 + 0)(88d*4 - 88d*4 - 24d*5). 744d*5 Expand ((1 - 4 + 2)(-m - 2 + 2) - 205 + 205 - 25m)(4 - 3 + 0). -24m Expand (2w - w + w)(-3 + 9 - 11)(-2w + 2 - 2). 20w*2 Expand (2f - 6f + 5f + (-4 + 4 - 2)(-f + f - f) - 3f - f + 5f + f + 0 + 0 - 2f + 2f - 2f - 20f + 0f - 16f)(2 - 5 + 1)(-3f + f + 4f). 132f*2 Expand (-2 + 2 - 8)(2o - 4o - 12o). 112o Expand (-17u - 6u*2 + 17u	{ "pile_set_name": "DM Mathematics" }
Is f(6) a multiple of 29? True Let w be (0 - 2)66/(-12). Let k = w + -7. Suppose 4m - 8 = -0m, m + 50 = kh. Does 13 divide h? True Let j be (-4 - -14)93/6. Suppose 5c + 3n = j, -2c + 0n + 51 = -n. Does 14 divide c? True Suppose 3c = -4v + 286, -8c = -5c + 3v - 282. Is 15 a factor of c? True Let s = -1052 + 2042. Does 64 divide s? False Let z(s) = s*2 - 10s + 93. Is z(-16) a multiple of 15? False Suppose 0 = -y - 2y + 153. Let l = 20 + y. Suppose 0 = 3r - 7 - l. Does 17 divide r? False Let a be 21/14 - 130/(-4). Let i = a - -6. Does 7 divide i? False Suppose -35 - 21 = -7y. Suppose yr + 190 = 3b + 3r, 0 = 2r + 4. Does 20 divide b? True Let h be 439/(-4) + 2/(-8). Let v = -154 - h. Let z = v - -65. Is z a multiple of 3? True Let v(l) = 5l*2 - 5l + 4. Let g be v(4). Let o = -26 + g. Is 9 a factor of o? False Let m(d) be the third derivative of d6/120 + d5/5 - 5d4/24 - 3d*3/2 + 3d*2 - 1. Let c be 1/(-2) + (-46)/4. Does 14 divide m(c)? False Suppose 7d + 16 - 2662 = 0. Is 39 a factor of d? False Let z = -16 - -17. Let m be 755/15 - z/3. Does 26 divide (9/(-6))/((-1)/m)? False Suppose 0 = -9w + 1558 + 1601. Is 27 a factor of w? True Does 6 divide 206(1 + (-4)/(-8))? True Let u(y) = 14y*2 - y - 10. Let w be u(-7). Suppose v - 8 = 3v, 3k = 2v + w. Is 45 a factor of k? True Let u(r) = r - 4. Let l = -7 - -10. Let b be u(l). Let j(n) = -86n + 1. Is 26 a factor of j(b)? False Let w(q) = 19q + 3. Let t(l) = -2l - 1. Let z(o) = t(o) - w(o). Is z(-4) a multiple of 6? False Let q(u) = u3 + 43u*2 - 70u - 109. Does 23 divide q(-43)? False Let i = -20 + 167. Does 25 divide i? False Let k = -246 - -120. Is (k + 2)/(2/(-2)) a multiple of 31? True Let y(c) be the third derivative of 5c4/24 - c3/6 + 2c*2. Let g be (-50)/(-15)6/5. Does 6 divide y(g)? False Let z(q) = 3q2 - 36q + 2. Let t be z(12). Suppose 0r - tj = -r + 23, 0 = 4r + j - 56. Is 7 a factor of r? False Suppose -4 = -5o + 3x + 10, 0 = -2o + 2x + 8. Let s(d) = -9d + 37. Let r be s(4). Is 18 a factor of r + o - (-50 - 4)? False Suppose 0 = 2r + 2r + 96. Let g be -1 + 5 - r/12. Suppose -16 = -gp + 2p, 2m + 5p = 32. Is m a multiple of 3? True Let b be (-4)/(-14) + (-1590)/(-70). Let y = b + -44. Let r = y - -44. Does 9 divide r? False Is 11 a factor of (28/21)/(8/1182)? False Let x = 371 + 841. Is 9 a factor of x? False Let s = 2881 + -1000. Is s a multiple of 11? True Suppose -4m - 1 = 5z, -5z + 4m - 2 + 33 = 0. Suppose 3f = -i - 41, 2f - 93 = zi + 30. Let a = i - -61. Is 10 a factor of a? True Let r(v) = v3 - 11v*2 + 8v + 15. Let i be r(10). Let l be i/15(-3)/1. Suppose 0 = 2b + l - 121. Is b a multiple of 12? True Let g = 278 + -196. Suppose 0 = 7y - 1160 + g. Is y a multiple of 27? False Suppose -10a + 7a + 3072 = 0. Let s be (-2)/(-6) - a/(-24). Suppose 21 = r + w, -r + 2w = 2r - s. Is r a multiple of 15? False Suppose 2v + 185 = -161. Let y = v + 434. Is 9 a factor of y? True Let h = 1 + 9. Suppose -2o - 6 + 4 = 5m, -5o + h = 5m. Suppose b + ob = 35. Does 4 divide b? False Let z be 4/18 - 175/(-63). Suppose -6t + zt = 5c - 483, -3t = -c - 501. Is t a multiple of 35? False Suppose 23p + 16p = 26754. Is p a multiple of 14? True Suppose -z = b + 2b - 92, 0 = -b + 2. Is z a multiple of 12? False Suppose 6t = 2h + 1728, 5h = 5t - 127 - 1303. Does 19 divide t? False Suppose -2i + 7i = 2x + 1850, 2i = -2x + 726. Is i a multiple of 23? True Suppose 5b = -0 + 30. Suppose -2 = f - b. Suppose -fr - 3c + 24 = -3r, 3c + 96 = 4r. Does 12 divide r? True Let d = -16 + 8. Let k(g) = g + 11. Let r be k(d). Suppose 2n = rn - 27. Is 13 a factor of n? False Suppose -5p - 2j + 1729 = 0, 6j - 4j - 1039 = -3p. Is 26 a factor of p? False Suppose 5a - 10a = -1420. Is a a multiple of 15? False Suppose -54b = -62754 - 24024. Is b a multiple of 19? False Let j(b) = b3 + 5b*2 + 6. Let c be j(-5). Is (5 - c - 0)-133 a multiple of 19? True Let i(s) = -s*2 + 9s - 13. Let z be i(6). Let u = -2 + z. Suppose 15 = ug, -3g - 46 = -2d - g. Is 9 a factor of d? False Let v(l) = -l2 + 17l - 1. Let r = 91 - 34. Suppose 0 = 4m + 1 - r. Is 9 a factor of v(m)? False Is 15 a factor of 926 + ((-62)/217)/((-2)/28)? True Let f(r) = r3 - 10r*2 + 17r - 12. Let w be f(8). Is 116/w-2 a multiple of 11? True Suppose -7k - 4g = -3k - 3504, -3k + 2628 = -3g. Is 12 a factor of k? True Let f(n) = n2 + 3n - 8. Let c be f(-4). Does 4 divide ((-24)/15)/(c/80)? True Suppose 0 = 4i - 3i - 5. Suppose -2c + iq + 21 = 0, 3q - 5 = -c - 0c. Is 8 a factor of c? True Let o(b) = -b*2 + 3b*3 - 2b*3 - 9b*2 + 2b + 19. Is o(11) a multiple of 17? False Suppose 395k - 3213 = 388k. Is k a multiple of 9? True Let b(m) = -m*3 - 5m*2 + 27m + 15. Let l(c) = c*3 + 4c*2 - 27c - 15. Let p(j) = -6b(j) - 5l(j). Is p(-12) a multiple of 21? True Suppose 7d - 72 = 3d. Let n(o) = o + 6. Let t be n(-9). Is 6 a factor of d + (-8 - -2)/t? False Suppose -402v + 840 = -399v. Does 35 divide v? True Suppose -s - 20 = -27. Suppose sj = 2075 - 612. Is 18 a factor of j? False Suppose 5a + 7 = 32. Suppose z = -ap + 5 + 21, -5p + 4z + 21 = 0. Suppose pc - 92 = c. Is 15 a factor of c? False Suppose -147m = -144m - 279. Does 7 divide m? False Let q(s) = -s*2 - s. Let d(u) = -7u*2 + 4u - 9. Let m(a) = -d(a) + 5q(a). Does 21 divide m(10)? False Suppose -4v = -2s, 5s + 2 = 4v + 14. Suppose 2r + 48 = 3l, -5l + vr = -3r - 85. Let g = l + -8. Does 3 divide g? True Let b(o) = o*3 + 12o*2 - 31o - 26. Is b(-14) a multiple of 4? True Suppose -y - 2v = -58, 220 = -3y + 7y - 4v. Let r = y - -7. Suppose 5i + 4 + 11 = 2z, -5z + r = -4i. Is z a multiple of 4? False Let n(i) = -6i - 4. Let c be n(-5). Let x = 45 - c. Does 8 divide x? False Let o be -6((-3)/(-9) - 0). Let p be (12/(-6))/((-4)/(-490)). Is p/(-5) - (-1 + o) a multiple of 13? True Let o(t) = 59t - 116. Does 10 divide o(14)? True Let l = 1390 + -965. Is 25 a factor of l? True Suppose -10u + 98 = 4u. Suppose -us + 14s = 1316. Does 22 divide s? False Let y(i) = 142i - 6. Let b be y(-4). Let k = -309 - b. Is 57 a factor of k? False Let k(p) = -13p + 2. Let x be k(-1). Let l = -13 + x. Does 14 divide (3 - -12)/(l - 1)? False Suppose -9b + 608 = -b. Is b a multiple of 3? False Let a(w) = w*3 + 5w*2 - 19w - 9. Let f be a(-15). Is -5 - (f/6 - -4) a multiple of 46? False Suppose h + 1390 = 3s, 431 - 1357 = -2s + h. Does 8 divide s? True Suppose -4j - 276 = -60. Let x = j + 79. Does 4 divide x? False Let w(q) = -q3 - 4q*2 + 6q + 12. Let b be w(-5). Let s be (-246)/14 + (-3)/b. Let o = s - -60. Is o a multiple of 14? True Suppose 2m = -0m + 114. Suppose m = b - 15. Suppose -88 = -2r + b. Is r a multiple of 18? False Let x(l) = 2l*2 + 12l + 15. Let t be x(-7). Let k = 46 - t. Does 12 divide k? False Let w = 27 + -35. Let v(m) be the third derivative of -5m4/24 + m3 + 4m*2. Is v(w) a multiple of 23? True Suppose 0 = -2a - 3a - 30. Let h be 8/a(-3)/(-2). Let b(d) = 10d2 - d - 2. Does 10 divide b(h)? True Suppose 0 = 37p - 234 - 25. Does 2 divide p? False Suppose -3y - 2m + 697 = -m, -4m + 709 = 3y. Let k be 24/10 - (-2)/(-5). Suppose y = 3l - 5q, -2q + 170 = kl - 0q. Is 32 a factor of l? False Let y = 70 + -67. Let t(c) = 2c3 - c2 - 8c + 7. Does 4 divide t(y)? True Let l(j) = 14j*2 + 11j - 91. Is 21 a factor of l(7)? True Let i(c) = -c*2 + 6. Let j be i(0). Suppose -2s + j = -0s. Is s a multiple of 3? True Let m = -13 + 9. Is 13 a factor of (-338)/6(-10 - m)/2? True Let p(u) = -u*3 + 14u*2 + 8u + 15. Let y be p(15). Let f = 152 + y. Suppose 9c - 324 = 4c - 4j, 2j + f = c. Does 16 divide c? True Let u be -2 - (4 + 5/(-2)-12). Is (u/(-24))/((-1)/(-246)) a multiple of 54? False Is -2 - (-1 - -2 - 372) a multiple of 34? False Suppose -3n + 2037 - 383 = -5k, 2730 = 5n - 3k. Is 16 a factor of n? False Suppose -5u = 11 + 14. Does 18 divide ((-9980)/16)/u + 2/8? False Let m(k) = 6k2 + 4k. Let a(t) = -t*2. Let d(q) = -5a(q) - m(q). Let o be d(-4). Suppose o = 5c - b - 195, 89 = 3c + b + 4*b. Does 19 divide c? True Let x = -370 - -820. Is 45 a factor of x? True Let w(	{ "pile_set_name": "DM Mathematics" }
4eb - 1f? 4cc In base 3, what is -10201121 - 110? -10202001 In base 13, what is -36 + 4936b? 49335 In base 2, what is 10 + 1000001000111110? 1000001001000000 In base 5, what is -12 + 1223011? 1222444 In base 3, what is -1121100121 + 0? -1121100121 In base 7, what is 454153 + 3? 454156 In base 13, what is 5500 - -1? 5501 In base 7, what is -23 - -12623? 12600 In base 12, what is -a + -194? -1a2 In base 14, what is 127c - 10? 126c In base 15, what is -e88 + -33c? -12c5 In base 6, what is -340542 + 3? -340535 In base 7, what is -164 + 1330? 1133 In base 10, what is 2 + -48997? -48995 In base 5, what is 1042413 + -2? 1042411 In base 15, what is 78 - 112a? -10a2 In base 2, what is -10010 + -110010111011? -110011001101 In base 14, what is 1 + 61c4? 61c5 In base 16, what is -2 + dbe? dbc In base 8, what is -51 + -1733? -2004 In base 7, what is -400 + -3421? -4121 In base 12, what is -45 + -890? -915 In base 10, what is -62 - 41014? -41076 In base 4, what is -32 - -2213101? 2213003 In base 2, what is 1100101011 + 11011? 1101000110 In base 13, what is 190 - -31? 1c1 In base 7, what is 166515 - 11? 166504 In base 7, what is 11312 + -3? 11306 In base 9, what is 2 + 570? 572 In base 12, what is 2 - 26596? -26594 In base 5, what is -1314133 + 10? -1314123 In base 3, what is -11 + 100220100221? 100220100210 In base 5, what is 20444 - -313? 21312 In base 8, what is 111304 + -6? 111276 In base 4, what is 1110210 - 213? 1103331 In base 12, what is 2 - -1509a? 150a0 In base 2, what is -1101100101101001110 - -10? -1101100101101001100 In base 9, what is -3622 - 33? -3655 In base 7, what is -23442 - 42? -23514 In base 14, what is 1acc + -14? 1ab8 In base 13, what is -6 - 376a? -3773 In base 11, what is -32 - 7044? -7076 In base 4, what is -30023 - 20102? -110131 In base 16, what is -5 + -d512? -d517 In base 13, what is -4 + 3a0b3? 3a0ac In base 15, what is 1 + 4941? 4942 In base 3, what is -2110122000 + 1221? -2110120002 In base 6, what is -52011321 - 1? -52011322 In base 8, what is 113720 - -2? 113722 In base 7, what is -23552 + -1505? -25360 In base 9, what is -63426 - 3? -63430 In base 13, what is -2 - 399? -39b In base 11, what is 22301 + 10? 22311 In base 12, what is 28a33 + 4? 28a37 In base 16, what is 1 - 16a77? -16a76 In base 14, what is -281d - 238? -2a57 In base 13, what is 548c8 + -1? 548c7 In base 15, what is -357 - -19? -33d In base 2, what is 10 - 1011110000100111? -1011110000100101 In base 7, what is 46416 + -2? 46414 In base 3, what is -1120212121 + 11? -1120212110 In base 10, what is -4 + -8138? -8142 In base 10, what is -4 + 2284? 2280 In base 4, what is -1012313 + 23? -1012230 In base 16, what is -5 - -1e6e? 1e69 In base 6, what is 10 + 44353? 44403 In base 9, what is -7501 + -1? -7502 In base 13, what is 13 - -352? 365 In base 15, what is 33ddd + -10? 33dcd In base 12, what is 51 - 1b3? -162 In base 13, what is -5bb72 + -2? -5bb74 In base 13, what is 0 + -5b94? -5b94 In base 16, what is 322 + 12b? 44d In base 13, what is -5 - 10c9? -1101 In base 9, what is -14 + -63205? -63220 In base 8, what is -1 + -12137? -12140 In base 12, what is -151 - 2002? -2153 In base 7, what is 14130 - 11? 14116 In base 3, what is 112021 - -12? 112110 In base 3, what is -100 - -22102200120? 22102200020 In base 4, what is -220230323 + -10? -220230333 In base 11, what is 5a - -2? 61 In base 5, what is -3 + 4433043? 4433040 In base 2, what is 10 - 111011011011011110? -111011011011011100 In base 12, what is -6502a + 5? -65025 In base 16, what is -2e5 - 316? -5fb In base 4, what is -2110131012 + -11? -2110131023 In base 16, what is -5 + ded1? decc In base 2, what is 1100010110 + 1001011? 1101100001 In base 9, what is -44 - 28450? -28504 In base 7, what is -4330 + 2333? -1664 In base 12, what is -2bb00 + 17? -2baa5 In base 8, what is 756505 + 11? 756516 In base 7, what is 2360 + 12? 2402 In base 16, what is 13a6 - -a? 13b0 In base 4, what is -1232012 - -32313? -1133033 In base 2, what is 11010011 - -1011110111? 1111001010 In base 9, what is -134 + 6? -127 In base 12, what is 454817 + -3? 454814 In base 3, what is -10 + -1110121220? -1110122000 In base 3, what is -1020 - 1022? -2112 In base 11, what is 1 - -2935? 2936 In base 13, what is -1 + -6bb31? -6bb32 In base 14, what is -32bb18 + -2? -32bb1a In base 7, what is 2 - 23565? -23563 In base 5, what is 2000 + 4113? 11113 In base 14, what is -5379c - 1c? -537ba In base 2, what is -10 + -1001100000001001? -1001100000001011 In base 8, what is 13 - -110377? 110412 In base 13, what is 79 + 2636? 26b2 In base 14, what is -88 - 4b? -d5 In base 7, what is 1502 - 44? 1425 In base 15, what is 46 + 4d8? 52e In base 2, what is 11 - 110010110100111? -110010110100100 In base 9, what is -2 - 3667? -3670 In base 7, what is 3 - 4024651? -4024645 In base 11, what is -1311 - 161? -1472 In base 4, what is -200332320 - 1? -200332321 In base 14, what is 83 - -944? 9c7 In base 2, what is -10001000 + 1100000000011? 1011101111011 In base 2, what is 1011 - -1111100001110011? 1111100001111110 In base 10, what is 6673 - -81? 6754 In base 6, what is -31 - 1123323? -1123354 In base 9, what is -58 + -66? -135 In base 6, what is -104 + -1023402? -1023510 In base 3, what is -212020 - -222222? 10202 In base 14, what is 855c0 - -3? 855c3 In base 2, what is -111011 + -100110110? -101110001 In base 10, what is -133 - -1900? 1767 In base 11, what is 737 + 1a7? 933 In base 7, what is -551 + -525? -1406 In base 8, what is 2775 - -154? 3151 In base 13, what is 1 - 946b? -946a In base 10, what is 157449 + -5? 157444 In base 9, what is 25 - -736? 762 In base 13, what is 5c7 + -136? 491 In base 13, what is -6 - 2464? -246a In base 9, what is 5 + -656136? -656131 In base 13, what is -3807 - 7? -3811 In base 3, what is -10 + -1100000111? -1100000121 In base 15, what is 143ed + -c? 143e1 In base 3, what is -11 + -1100121? -1100202 In base 16, what is -3 - -5ecc? 5ec9 In base 5, what is -1241334 - 2? -1241341 In base 16, what is -6fe83 - -5? -6fe7e In base 12, what is -5 + -16a537? -16a540 In base 16, what is 1 + 113df? 113e0 In base 6, what is 1 - 155524? -155523 In base 7, what is 503 - 3? 500 In base 2, what is 10001101100 - 10000110001? 111011 In base 16, what is -d9 - 39? -112 In base 4, what is -11 + -3213311? -3213322 In base 6, what is 13 + -2344? -2331 In base 5, what is 1023423 + -10? 1023413 In base 15, what is 1ac - 0? 1ac In base 10, what is 95 - 889? -794 In base 14, what is 78d4 - -2a? 7920 In base 7, what is -105 + 1034? 626 In base 10, what is -22001 - -12? -21989 In base 15, what is 18 - -281d? 2836 In base 8, what is -5665 - -21? -5644 In base 4, what is 31231 - 10130? 21101 In base 8, what is -6 + 32427? 32421 In base 16, what is -17860 - -5? -1785b In base 14, what is 1bca - -2? 1bcc In base 13, what is -a4 + 349? 275 In base 3, what is -2002002 + -1100201? -10102210 In base 12, what is 48 - -1518? 1564 In base 14, what is 2 + -4726? -4724 In base 10, what is 2454 - -400? 2854 In base 8, what is -6 - -431506? 431500 In base 11, what is 3 + 8299? 82a1 In base 6, what is -1 + 3102303? 3102302 In base 14, what is 14 + -17c6? -17b2 In base 9, what is -4077 - -12? -4065 In base 6, what is -3 - 3540043? -3540050 In base 6, what is 14405 + -141? 14224 In base 5, what is -30 - 234111? -234141 In base 11, what is -224 - -894? 670 In base 6, what is -13350 + -110? -13500 In base 8, what is -331 - -127? -202 In base 9, what is -17752 + 14? -17737 In base 14, what is 16a26 - -4? 16a2a In base 9, what is -203 + -3403? -3606 In base 3, what is -12 - 11010211210? -11010211222 In base 2, what is 111010110011101 - 1101? 111010110010000 In base 15, what is 261d - -5d? 267b In base 14, what is 15 + -4d14? -4cdd In base 15, what is -3c1 + 17? -3a9 In base 6, what is 23254024 + -4? 23254020 In base 6, what is -225 - -155444? 155215 In base 13, what is b5b681 + -3? b5b67b In base 16, what is -1d7c - 92? -1e0e In base 13, what is -1 + 216a? 2169 In base 9, what is 21282 - -5? 21287 In base 10, what is 21185 - -40? 21225 In base 2, what is 1011 - -10000010001101001? 10000010001110100 In base 4, what is -3111 + 1023331? 1020220 In base 16, what is -4 + a8d7? a8d3 In base 5, what is 320310 - -300? 321110 In base 4, what is -11213131123 + 3? -11213131120 In base 11, wha	{ "pile_set_name": "DM Mathematics" }
1 - 36m to the form w + gm and give g. -20 Express -i*2 + 4i2 - i3 - 2i4 - 5i*2 + 1 + 4i*2 as bi*3 + ji*4 + wi*2 + pi + n and give w. 2 Express -5q2 + 4q2 - 1 + q4 + 0q4 - 2q*4 as zq*3 + t + lq + pq4 + wq*2 and give l. 0 Rearrange -2h + 12h2 - 5h*2 + h to rh + ph2 + g and give r. -1 Rearrange 17v*2 - 354v + 354v to the form lv + mv2 + o and give m. 17 Express -2a*4 - 3a*2 + 6a*2 + 2a + 3a3 - 2a*2 - 3 in the form xa*4 + ba*3 + oa + ha2 + l and give b. 3 Express (3 + 3 - 3)(5s2 - 9 + 9 + (-s2 - 2s*2 + 2s*2)(-1 + 0 + 0)) in the form ws2 + rs + b and give w. 18 Express (2a + 0a + a)(3a - 2a + 0a) in the form w + ta2 + za and give t. 3 Express 8a + 3a + 13a as ca + x and give x. 0 Rearrange -4y + 3 + 7y + 1 to o + ry and give r. 3 Express (5y*2 - 5y*2 - 2y*2)(-9 + 7y + 9 + y - y + 2y + (1 + 0 - 3)(2y - 5y + y)) as py*2 + zy*3 + l + qy and give z. -26 Rearrange (y2 - y2 + 3y2)(5 + 2y - 5)(8 - 3 + 2)(-5y + 3y + 3y) to cy3 + hy + my2 + u + jy*4 and give u. 0 Rearrange (-2 + 3w + w - 5w)(-1 + 4 - 7) + 6w + w + 0w to the form n + kw and give k. 11 Express 5z - 4z + 2z + (2 - 4 + 3)(7z + 19 - 19) in the form a + dz and give d. 10 Rearrange (4g - 1 + 1)(6 - 3 - 4)((-3g + 4g - 3g)(-2 - 1 + 5) - 2g + 2 - 2) to mg*2 + hg + z and give m. 24 Express (-2z + 2z + 3z2)(-3 + 3 - 3z)(-4 + 4z + 4)(-2 + 2 - 1) - z*4 + 4z - 4z in the form tz*4 + v + hz*2 + kz*3 + gz and give t. 35 Rearrange 5 - 9 + 2m4 + 5m + 5 + m*2 - 3m*4 to the form im*4 + cm*2 + wm*3 + pm + g and give c. 1 Rearrange -10a + 2a + 40a to the form k + ua and give u. 32 Express -2 + 3 - 10j3 + 7j*3 - 5j + 4j3 in the form mj + c + oj3 + pj*2 and give o. 1 Express (-h - h + h + 1)(2 - 2 - 1) + 3h - h - h as d + yh and give y. 2 Express -65m - 97m + 15m in the form p + km and give k. -147 Express (-4 + 0 + 2 + (2 + 0 + 0)(-3 - 1 + 3) + 2 + 1 - 4 - 7 + 2 - 3)(-v*2 + 4v2 - v2) in the form rv2 + k + hv and give r. -26 Express 0i + 21i*2 + 15i2 - i + i2 as k + ci2 + vi and give c. 37 Rearrange -3v2 - 2 - 7v*4 + 0v*2 + 3v*4 - 2v*4 to jv*3 + lv + nv4 + k + gv*2 and give k. -2 Express 0l + 2l - 6l*2 + l - 2l - 6 as yl2 + il + m and give i. 1 Rearrange -3c2 - 8c*2 - 11c*2 to the form gc*2 + v + fc and give g. -22 Express (-3k + 0k + k)(-16k + 5k + 0k)(-2 + 1 - 1)(0 + 1 - 4) in the form ik + tk*2 + g and give i. 0 Rearrange 0t + 4t - 5t + 1 - 7t - 2t + 5t - 2 + 2 - 2t + (0 - 1 + 0)(5t + t - 4t) to kt + q and give k. -9 Rearrange (1 - 1 + 1)(0y2 + y2 - 3y2) + (5y - y - 5y)(-y - 3y + y)(5 - 1 - 1) to the form x + zy + sy*2 and give s. 7 Express 0p*3 - 6p*3 - 249p4 + p3 + 245p4 + p in the form rp*2 + n + zp*3 + xp*4 + qp and give x. -4 Rearrange 0 + 28k + 0k + 0 to the form b + ok and give o. 28 Express -35w + 5 + 7 - 12 as m + uw and give m. 0 Rearrange (0b - 3b + 4b)(21 + 83 - 25)(-2b + b + 0b) to the form rb + k + xb*2 and give x. -79 Rearrange (3u*3 - 3u*3 - 3u*3)((-2u - 1 + 1)(3 - 1 + 0) + (2u + 2 - 2)(7 + 0 + 0)) to nu + fu*2 + du*3 + xu*4 + h and give x. -30 Rearrange -58m + 2 + 6 - 8 to the form o + nm and give n. -58 Express (101 + 73 - 124)(-5r2 + r2 + 2r*2)(3r2 + 0r*2 - 5r*2) in the form sr*2 + a + cr + gr4 + tr*3 and give g. 200 Rearrange -m + 4m - 6m - 2m - 5m + 5m + (m + m + 0m)(2 - 2 - 2) + 1 - 1 + 2m + m - m - m + (2 - m - 2)(1 - 3 + 0) to the form z + cm and give c. -6 Rearrange 4g*2 + 1 + 2 - 5g*2 to the form c + zg + jg2 and give c. 3 Rearrange u3 + 20u*2 + 0u*3 + 6u - 22u2 to o + pu*3 + mu*2 + yu and give p. 1 Rearrange (-10 + 6 + 1)(0 + 2q + 0q + q2 + 2) to m + rq*2 + hq and give h. -6 Express 3 - 2w2 - 2 + 6w*3 - 15w*3 in the form m + cw + iw3 + zw*2 and give i. -9 Express 0f*2 + 0f*3 + 4f*2 - 4f*3 in the form wf*3 + nf*2 + pf + u and give n. 4 Express -2 - 3g3 + 4 + g + 0g in the form ng + zg*2 + p + ug*3 and give n. 1 Rearrange (-5k + 2k + k)(2k + 1 - 1) + 18k*2 + 9k*2 + 36k - 38k to the form u + wk + jk2 and give w. -2 Express -9 + 9 - 3n - n - n + n + (2n - 1 + 1)(0 + 2 + 0) + 0 - n + 0 + 2n - 2n - n + 3n + 7n + 14n in the form r + tn and give t. 22 Express (k*4 + 0k*3 + 0k*3 + (-4 + 5 + 1)(-2k4 + k4 - k4))(5 - 2 - 4) as gk2 + ak*3 + hk*4 + x + rk and give h. 3 Rearrange 5f - 4f*3 - 3f*4 - 4f + f*4 to the form pf*4 + nf + i + of2 + kf*3 and give k. -4 Rearrange -149 + 149 - 136n to b + cn and give b. 0 Rearrange 7 + 2c*2 + 13 - 3 + 5 to the form kc*2 + p + mc and give p. 22 Rearrange 0n2 - 3n2 + n2 - 4n2 + 2n + n*3 to the form yn*2 + d + tn*3 + mn and give y. -6 Rearrange (8 + 0 - 1)((1 - 3 + 3)(0 - 2k + 0) - 4 - k + 4 + 3k + k - 2k) to the form u + fk and give f. -7 Express (2u - 2u + 2u)(2u - 15u + u)(2 + 5 - 5)(3 + 3 - 5) as w + xu2 + su and give x. -48 Rearrange (4 + 1 - 2)(3f + 3 - 3 + (-3 + 1 + 1)(-6f + 11 - 11) + 4 - 4 - f) to xf + p and give x. 24 Express q + 2q + 3q as c + gq and give g. 6 Express (-h + 3 - 3)(-4h - h + 2h) - 2h2 - h2 + 5h2 - 124h - 3 + 124h + 3h*2 as yh*2 + qh + s and give s. -3 Rearrange 37 + 2y - 37 + y - 1 + 1 + (0y - y + 3y)(-1 - 5 + 4) + 2y - 1 + 1 + 0y - 3y + 5y to xy + s and give x. 3 Express 0 + 21o*2 - 5 + o + 5 as fo*2 + to + c and give t. 1 Rearrange (a*3 + 3a*3 + 3a*3)(a - 4a - a) to the form ha*3 + wa*2 + da*4 + v + ya and give d. -28 Rearrange 3a + 0a*2 - 3a - 55a2 to ma + h + ya2 and give y. -55 Express i + i + 2i + (5 + 1 - 3 + (2 + 3 - 3)(0 - 3 + 2))(i - 2 + 2) as si + r and give s. 5 Rearrange -3w*3 + 2w*2 - 39w + 5w3 + 36w - w*3 to pw + qw2 + h + aw*3 and give p. -3 Rearrange -19k2 + k3 + 6k - 5k*2 - 6k to the form y + wk + ik*2 + hk*3 and give h. 1 Express 2j*2 - 5j + 5j + (2j*2 - 1 + 1)(-7 - 7 + 15) - 2 + 2 - j*2 + (2j + 0j + 0j)(0 + 0 + 2j) + 0j + 0j - j*2 as m + gj*2 + lj and give g. 6 Rearrange -6y - 10 + 8 - 4 to the form py + s and give s. -6 Rearrange (2 - 2 - 1)(3n + 0n - 2n) + (7n - 17 + 17)(0 + 2 - 3) to the form j + mn and give m. -8 Express (0 + 0 - 2j)(6j - 2j - 9j)(2 + 3 - 3) as nj*2 + uj + k and give n. 20 Rearrange -13c3 + 25c*3 - 11c + c - 15c3 to the form uc + fc2 + n + bc*3 and give u. -10 Rearrange -2h + 1 + h - h + (-2h + 4h - h)(5 - 39 - 28) to u + qh and give u. 1 Rearrange -10a4 + a2 - 4a*3 - 2a*4 + 11a*4 + 4a to the form da + ka*2 + ta*4 + n + ba*3 and give d. 4 Rearrange (4a*2 - 6a*2 + 6a*2)(-2 + 0 + 0) + (3a + 2a - 4a)(-3 + 3 - 4a) to the form pa + ga2 + t and give p. 0 Rearrange 4o*3 - 3o*3 - 2o*3 + (-4o + 2o + o)(2o2 - 2o*2 + 2o*2) + 7o*3 - 3o*3 + 4o*3 to the form bo*2 + po*3 + io + q and give p. 5 Express -3g4 - 3g + 0g3 - 3g3 + g - g2 + 2g4 as cg*3 + rg*2 + pg + w + xg4 and give r. -1 Express 10x*2 + 3x*2 - 8x*2 in the form lx*2 + jx + u and give l. 5 Rearrange 32s - 14s - 12s to the form qs + v and give q. 6 Rearrange -35 + 2y3 + 6y*2 - 4y2 + 52 - y3 + 2y3 + 0y*3 + (-1 + 1 + 2y)(0y*2 + 2y2 - y2) to hy2 + iy + my3 + w and give h. 2 Express (-5 + 0 - 1)(-4v2 - 10v + 8v + v2) in the form s + xv + zv2 and give x. 12 Rearrange 0u*2 - 2u*2 - 2u + 4u2 - 4u*2 to the form ru*2 + z + lu and give r. -2 Express 140b - 157b - 2b2 - 2b*2 + 6b*2 as rb + z + pb2 and give r. -17 Express -67n + 67n + 2n*2 in the form a + kn + jn2 and give k. 0 Rearrange -3 + 3x*2 + 1 - 3x - 5x + 7x to mx2 + ix + j and give m. 3 Rearrange ((4 - 3 - 3)(3k - k - 3k) + 4 + k - 4)(9k2 + 20 - 20) to hk*2 + y + dk*3 + ok and give d. 27 Rearrange b*3 + 51b*4 - 48b*4 - 2b*2 + 3 - 2b*3 to jb*2 + nb*3 + h + yb**4	{ "pile_set_name": "DM Mathematics" }
out replacement from {q: 1, i: 1, d: 1}. 1/6 Calculate prob of sequence xqjr when four letters picked without replacement from jrqxxqxxxxqrq. 2/715 What is prob of sequence xx when two letters picked without replacement from ttxtxtrxtxttx? 5/39 Calculate prob of sequence hff when three letters picked without replacement from {h: 3, c: 1, v: 4, f: 5}. 5/143 Two letters picked without replacement from nehtnhnnhnhtqhnnnqt. What is prob of sequence hn? 20/171 Four letters picked without replacement from mwwyormyk. What is prob of sequence omwk? 1/756 Four letters picked without replacement from nnnnnnnnnnannnn. Give prob of sequence annn. 1/15 What is prob of sequence kfk when three letters picked without replacement from {k: 2, f: 1}? 1/3 Calculate prob of sequence xn when two letters picked without replacement from {n: 1, z: 4, x: 6, v: 5}. 1/40 What is prob of sequence vha when three letters picked without replacement from {a: 1, g: 3, h: 2, l: 3, v: 1}? 1/360 Two letters picked without replacement from {m: 1, w: 4, c: 2}. What is prob of sequence ww? 2/7 What is prob of sequence denn when four letters picked without replacement from dddddednddnddd? 1/1092 Calculate prob of sequence cn when two letters picked without replacement from ncngac. 2/15 Two letters picked without replacement from loclcoll. Give prob of sequence lo. 1/7 Calculate prob of sequence rnzp when four letters picked without replacement from {n: 1, z: 6, r: 1, s: 3, p: 1, l: 1}. 1/2860 What is prob of sequence xm when two letters picked without replacement from uuxmlmlllllllx? 2/91 Three letters picked without replacement from {c: 3, y: 8, t: 1, x: 3, m: 3}. What is prob of sequence cmy? 1/68 Three letters picked without replacement from {i: 1, s: 3, h: 3, n: 5, p: 1, g: 1}. What is prob of sequence nsh? 15/728 What is prob of sequence cb when two letters picked without replacement from {b: 2, c: 1, z: 2, h: 1, d: 4}? 1/45 What is prob of sequence cs when two letters picked without replacement from {d: 1, h: 5, j: 1, s: 1, c: 2, p: 3}? 1/78 Calculate prob of sequence yyz when three letters picked without replacement from {z: 7, p: 8, y: 3}. 7/816 Calculate prob of sequence vq when two letters picked without replacement from qvvqffvvnvfvqvhf. 7/80 Three letters picked without replacement from {b: 1, a: 1, j: 3, v: 1, d: 5, n: 3}. Give prob of sequence njd. 15/728 Three letters picked without replacement from {b: 1, g: 1, e: 1, c: 2}. What is prob of sequence cge? 1/30 Four letters picked without replacement from {a: 2, g: 2, e: 1, v: 6, k: 6, w: 1}. What is prob of sequence evgk? 1/1020 Three letters picked without replacement from {b: 11, j: 1, l: 4, e: 3}. Give prob of sequence lbl. 22/969 Two letters picked without replacement from uzufufuzuffzzuuzsz. Give prob of sequence sf. 2/153 Calculate prob of sequence rr when two letters picked without replacement from {r: 9}. 1 Three letters picked without replacement from {e: 1, y: 1, a: 1, t: 3, w: 1}. What is prob of sequence wae? 1/210 Calculate prob of sequence aif when three letters picked without replacement from idsffaa. 2/105 Three letters picked without replacement from ssrssqbsyuqssb. Give prob of sequence qqb. 1/546 Two letters picked without replacement from xkko. What is prob of sequence xo? 1/12 What is prob of sequence en when two letters picked without replacement from {e: 10, n: 10}? 5/19 Two letters picked without replacement from {v: 4, k: 7, f: 4}. What is prob of sequence vk? 2/15 Four letters picked without replacement from {b: 5}. Give prob of sequence bbbb. 1 Three letters picked without replacement from {v: 1, n: 1, h: 1, w: 10}. What is prob of sequence vwn? 5/858 What is prob of sequence al when two letters picked without replacement from {a: 4, l: 5, x: 1, t: 4, j: 2}? 1/12 Four letters picked without replacement from {r: 2, b: 2}. What is prob of sequence rbrb? 1/6 Four letters picked without replacement from zzsszzzzzzz. What is prob of sequence zssz? 1/55 What is prob of sequence pkpe when four letters picked without replacement from kekeekepekkepppkk? 3/340 Two letters picked without replacement from nqwvq. Give prob of sequence nq. 1/10 Four letters picked without replacement from {f: 4}. Give prob of sequence ffff. 1 Calculate prob of sequence mmy when three letters picked without replacement from {x: 7, j: 1, m: 3, u: 2, y: 1}. 1/364 Calculate prob of sequence qh when two letters picked without replacement from {h: 4, q: 2}. 4/15 What is prob of sequence de when two letters picked without replacement from {e: 6, d: 2}? 3/14 Three letters picked without replacement from ohontotcptoop. What is prob of sequence nhp? 1/858 Two letters picked without replacement from {v: 3, j: 1, c: 2, x: 10}. Give prob of sequence jc. 1/120 What is prob of sequence pph when three letters picked without replacement from llppallpbpph? 1/66 Two letters picked without replacement from {e: 5, i: 2, d: 5, w: 5}. Give prob of sequence wd. 25/272 Calculate prob of sequence hs when two letters picked without replacement from {s: 1, h: 3, n: 1, a: 7}. 1/44 Two letters picked without replacement from sgsgusbsgusgs. Give prob of sequence su. 1/13 What is prob of sequence xx when two letters picked without replacement from lxllfzzxxzzzxlzxzz? 10/153 Calculate prob of sequence fv when two letters picked without replacement from frbfbbbvv. 1/18 Calculate prob of sequence tyo when three letters picked without replacement from ccccccyyyoycttc. 4/1365 Calculate prob of sequence ls when two letters picked without replacement from {l: 1, o: 1, s: 1}. 1/6 Calculate prob of sequence lny when three letters picked without replacement from {n: 3, y: 1, v: 2, w: 2, g: 6, l: 5}. 5/1938 Two letters picked without replacement from {r: 1, a: 1, x: 1, s: 1, k: 4}. Give prob of sequence sa. 1/56 What is prob of sequence jl when two letters picked without replacement from {o: 4, j: 1, l: 3, u: 2, x: 2}? 1/44 Calculate prob of sequence dx when two letters picked without replacement from {h: 2, n: 4, k: 1, d: 3, x: 4, g: 1}. 2/35 Calculate prob of sequence byf when three letters picked without replacement from {f: 7, s: 1, y: 1, b: 4}. 7/429 What is prob of sequence tit when three letters picked without replacement from {r: 1, t: 3, i: 4}? 1/14 Two letters picked without replacement from bbabbaabbbaai. Give prob of sequence ia. 5/156 What is prob of sequence qqpr when four letters picked without replacement from yrryaryqqeypqaap? 3/3640 What is prob of sequence mf when two letters picked without replacement from {m: 2, l: 6, f: 2, k: 2}? 1/33 What is prob of sequence qqoo when four letters picked without replacement from {x: 7, o: 3, q: 3}? 3/1430 Four letters picked without replacement from xfwwwwfxf. Give prob of sequence wwwx. 1/63 Calculate prob of sequence qx when two letters picked without replacement from xqxyxyx. 2/21 Calculate prob of sequence qvqq when four letters picked without replacement from pqvvhhvqqqqqp. 3/143 What is prob of sequence kmkm when four letters picked without replacement from {k: 4, m: 3}? 3/35 Calculate prob of sequence wwww when four letters picked without replacement from {g: 3, d: 3, w: 7}. 7/143 What is prob of sequence kyur when four letters picked without replacement from urahrkyhy? 1/756 Calculate prob of sequence im when two letters picked without replacement from stmsrsttsri. 1/110 Two letters picked without replacement from {l: 1, t: 2, y: 2, g: 2, z: 1}. Give prob of sequence zy. 1/28 Calculate prob of sequence rqi when three letters picked without replacement from {r: 3, w: 1, e: 1, q: 1, i: 1}. 1/70 Two letters picked without replacement from {t: 1, o: 8, a: 6, n: 1}. Give prob of sequence ot. 1/30 Calculate prob of sequence dh when two letters picked without replacement from heeececed. 1/72 What is prob of sequence qxx when three letters picked without replacement from qqqxxxqhxxxhqqqqq? 9/136 Two letters picked without replacement from tntnntnnntnlltlln. Give prob of sequence tn. 5/34 Calculate prob of sequence ppnp when four letters picked without replacement from uuxppnpppupnn. 3/143 Calculate prob of sequence aamm when four letters picked without replacement from {a: 3, s: 2, c: 3, m: 5}. 1/143 Four	{ "pile_set_name": "DM Mathematics" }
r. Solve s - r = 2s for s. -5 Let j = -282 + 286. Solve 0 = jn + 3n for n. 0 Let t(c) = c2 - 6c + 5. Let x be t(5). Suppose 3b - 12 = -x. Solve -5g = -b - 1 for g. 1 Let c(k) be the second derivative of k4/6 + k3/2 + k*2 - 6k. Let q be c(-2). Let f be (10/15)/(q/30). Solve -4 = fo + 11 for o. -3 Suppose -3p + 43 = -83. Let s = -33 + p. Solve -1 = -4k - s for k. -2 Let i = -60 - -81. Suppose 17 - 3 = 2r - t, 3r = t + i. Solve 4 = 3s - rs for s. -1 Let a be 2 - (42/(-2) + -2). Let p be a/(-10)(-2)/5. Let j be (p/(2/4))/1. Solve -n = -j - 2 for n. 4 Let w = 601 + -580. Solve -6f = -3 - w for f. 4 Let t = -260 + 288. Solve 0 = -12z + t - 4 for z. 2 Suppose 13d - 20 = 9d. Suppose y + 5y - dy = 0. Solve y = -4j + 2 + 6 for j. 2 Suppose 10f - 5 = 5f. Suppose 2i + 9 = -2r + f, i = 3r + 12. Solve ig + 4 = g for g. 4 Suppose 3b - 1 = 4b. Let a be -6(b - 6/(-4)). Let s be -3 + (-6)/a + 2. Solve -2g + s = -3 for g. 2 Suppose 0 = -5w - 9 + 69. Let x = -12 + w. Let r(t) = t3 + t2 + 2. Let o be r(x). Solve -f + 9 = of for f. 3 Suppose 0 = -b - b + 18. Let k be ((-12)/(-4))/((-6)/(-10)). Suppose -3n + b = kd, -5d - 3n - 2n = -15. Solve p - 5 = -dp for p. 5 Let y be -11 - (-2 + 2 + 2). Let j(s) = s2 - 6s - 9. Let l be j(9). Let o = l + y. Solve 0 = -2n - 3n + o for n. 1 Let g(r) = -r*2 + 20r - 30. Let y be g(18). Let l(n) = -n*3 + 4n*2 + 16n - 19. Let d be l(y). Solve 1 = -2i + d for i. 2 Suppose 4r = r - 36. Let a be -2(r/(-3))/(-4). Solve -k - 15 = ak for k. -5 Let i be 11/33 + 3/(-9). Solve 29b - 17b + 48 = i for b. -4 Let a be 423/(-564)(-40)/2. Let w(u) = 3u - 2. Let o be w(-4). Let b = o + a. Solve b = -2j + 9 for j. 4 Let a(t) = -t + 3. Let m be a(1). Suppose -my - 5 + 11 = 0. Suppose -3q + 3 = -q + yi, -2q + 2i = -8. Solve -3l - 9 + q = 0 for l. -2 Let l(v) = v3 - 6v*2 - v - 35. Let h be l(7). Solve -10u = -hu - 6 for u. 2 Let n(w) = -w3 + 22w*2 - 23w + 44. Let s be n(21). Solve -sl = -6l - 16 for l. -4 Let h be (-744)/(-16) + 35/10. Solve -hv = -51v for v. 0 Suppose 0 = 8o - 15 - 25. Solve -ot = -4t - 4 for t. 4 Let g(h) be the third derivative of -3h4/8 - h3 - 7h2. Let j be g(-1). Solve 0 = js + 2s for s. 0 Let i be (5/(-15))/(1/(-6)). Let x be -2 + i - (7 - 1). Let s(d) = d2 + 5d - 3. Let w be s(x). Solve -w - 3 = -3u for u. 2 Let y(d) = -2d*2 + 2 - 251d + 5d2 + 248d. Let k be y(1). Solve kg + g = -15 for g. -5 Let h be 1 - (-12)/(-3) - (3 - 18). Let q = 15 - h. Solve -q = c - 2 for c. -1 Suppose -9z - 1103 = -1940. Solve 95f = zf - 6 for f. -3 Let u(i) = -3i - 2. Let f(c) = -6. Let d(k) = -f(k) - u(k). Let b = 13 - 9. Let m be d(b). Solve -h - m = 4h for h. -4 Let t(m) = m*2 + 15m - 38. Let u be t(-17). Let l be -1 + (2 - (u - -5)). Solve l = 3r + 15 for r. -5 Let x be 6/440/15. Let w(n) = -3n + 5. Let g be w(-6). Let j = g + -20. Solve jz + 8 = -x for z. -4 Suppose 0 = 4r - 4o - 56, -42r - o + 58 = -37r. Solve -5 = rq + 19 for q. -2 Let s be 20/9 - (-4)/(-18). Let i = 89 - 86. Suppose -3c + 4 + 5 = ij, -4j + 12 = -sc. Solve -3x - 2 + 5 = c for x. 1 Suppose 13v = 146 + 153. Solve -3 = -5u - v for u. -4 Let j = 7 - 5. Suppose 3w - 6w = -6. Solve -jb + 4b = -w for b. -1 Let x be (-6 - -72)/6 - 0. Solve 7 - x = f for f. -4 Let w be 3/9(-549)/(-3). Suppose 5m + 11 = w. Solve 0x - 2x - m = 0 for x. -5 Suppose -7o = -6 - 22. Solve 0 = oi + i - 25 for i. 5 Suppose 0 = 3d - 5d - 8. Let c = 6 + d. Suppose -3t = ct - 30. Solve -tp + 16 = -2p for p. 4 Let k be 1(1 - 0)4. Let b = 6 - k. Let i = -339 - -344. Solve bf = 1 + i for f. 3 Let c(d) = d2 + 3d - 6. Let a be c(-5). Suppose -ak + 11 = -2l - 3, -32 = -4l - 4k. Suppose 5o = 4o + 1. Solve -o = u - l for u. 2 Suppose 8 = 6q - 10. Let w be q/((-6)/(-10)) - (10 - 6). Let r(j) = j2 - j + 1. Let u be r(0). Solve a + u = -w for a. -2 Suppose -15 = -2z - 5, 5z - 10 = 3w. Solve -wt + 28 - 3 = 0 for t. 5 Let d be -9(4/18 + 56/(-36)). Solve -2r + dr - 50 = 0 for r. 5 Let v(z) = -z*2 - 37z - 130. Let f be v(-33). Let l be (2/6)/(2/24). Let c = l + -3. Solve u + f - c = 0 for u. -1 Let t(l) = -l*3 + 12l*2 + 2. Let v be t(12). Suppose -x - vm = -3m - 5, -17 = -3x + 5m. Solve -xg - 13 = 3 for g. -4 Let h(c) = -c*2 - 6c + 5. Let l be h(-7). Let t be l/(0 - -2) - -6. Suppose 4k + 0p + 8 = 3p, 25 = 5k + tp. Solve 3w = -4 + k for w. -1 Suppose 11w = 8w + 12. Suppose -4j = wn, -n - 2n = -j + 8. Solve -ji = 3i - 10 for i. 2 Let o = -14 - -17. Let f = -762 + 767. Solve fu - ou = 0 for u. 0 Suppose 2p - 1019 + 997 = 0. Solve 0 = 7h - ph for h. 0 Let t = -596 + 611. Solve 10a - t = 15a for a. -3 Suppose -5f + 5 = -0f, c - 3f = 0. Suppose cp = -p + 8. Suppose 5i - 15 = pi. Solve in + 7 = -8 for n. -3 Let i(j) be the second derivative of j4/12 + 7j*3/6 + 7j*2 - 5j + 3. Let w be i(-6). Solve 4k + w = 24 for k. 4 Suppose 0 = -4m - 4m + 32. Let p(y) = y - 7. Let v be p(7). Suppose v = -0t - t. Solve t = 9q - mq for q. 0 Let z be 108/9 - (-3 - -1). Solve 15i + 5 = zi for i. -5 Let q be 150/550 - (-38)/22. Let n be ((-9)/3)/((-6)/4). Suppose nt - 6 = -5i, -qi + 18 = 3t + i. Solve 0 = l + l + t for l. -4 Suppose -5a + 0a + 37 = -3s, -s = -1. Solve n - 21 = an for n. -3 Let n = 4 + 0. Suppose -2i = s - 38, 29i - 27i - 36 = -2s. Solve -no - o = -i for o. 4 Let d(m) = 2m*2 + 4m - 5. Let c be d(1). Solve 0 = -3j + 13 - c for j. 4 Suppose 5b - 91 - 19 = 0. Let k be 33/b - (-2)/(-4). Solve 4 = 5p - k for p. 1 Let w be (-2 - ((-4)/(-2) - 9))3. Solve 0 = -wy + 6y - 18 for y. -2 Suppose c - 1 - 6 = -m, 4m - 25 = -c. Suppose 5x - 21 = 3d, 4 = 5d - 11. Solve mp + x = 3p for p. -2 Let f be (-76)/(-8) + 3/(-2). Solve 51 = fj + 11 for j. 5 Let y(a) = a3 - 5a*2 + 3a + 4. Let r be y(2). Let w be (r - -1)(-11 + 0). Solve -4t - 27 = -w for t. -4 Suppose 459 = 62o - 53o. Solve -g + o = 47 for g. 4 Suppose 47n - 296 - 80 = 0. Solve 10o = 6o + n for o. 2 Suppose -2k = 3z + 2k - 19, -z + 5k - 19 = 0. Solve -22 + z = 7m for m. -3 Suppose -5n + 1 = -29. Solve 2w + 16 = nw for w. 4 Let x = -1224 - -1260. Solve -2m + x = 7m for m. 4 Let y(t) = -t + 1. Let f(r) = -r2 + 2r - 1. Let u be f(3). Let q be y(u). Let x(s) = 3s2 + 1. Let c be x(1). Solve -c = 3i + q for i. -3 Let t(i) = 23i - 21. Let b be t(2). Solve -14p + b = -9p for p. 5 Suppose -2q + 71 = 3i, 2i - 3q - 11 = 58. Solve 0 = -23v + i + 42 for v. 3 Suppose 57n + 5133 = 21321. Solve 4v + n = 280 for v. -1 Let c(b) = b + 16. Let j be (1 - 10/4)50/75. Let x be c(j). Solve 0 = 4h - 5 - x for h. 5 Suppose -7 = 2p - 5n, 2p - 2n + 7n = 23. Suppose 3s - l + 3l = -10, 0 = -3s + 5l + 25. Solve 0 = -u - su + p for u. 4 Suppose -1 = -3o + 2s + 10, 3s = -o + 11. Let g be (-208)/(-56) + 2/7. Suppose -7 = -x - gd, 6d + 19 = x + 4d. Solve 0q - oq = -x for q. 3 Let x(r) = r*2 + 13r + 15. Let k be x(-12). Suppose 0 = -0s - ks. Solve -4v + 0v + 12 = s for v. 3 Let d = 5 + -2. Suppose 0z + 4z = -5u - 5, -2u - dz - 9 = 0. Let o be (3 - 0)/u2. Solve ol = 3l for l. 0 Suppose 0 = 3z + 4a - 24, -3a + 19 = z + 6. Solve -4i - 32 = zi for i. -4 Let k be 9/(-6)4/(-3). Suppose 4d - 5 + 1 = 0. Let z(h) = -8h - 29. Let r be z(-4). Solve k + d = -rt for t. -1 Suppose 0 = -2p - 50 + 70. Suppose 5g + t = 3, g - 5t + 9 = -pt. Solve c = -g - 2 for c. -3 Let p be (0 - -1)/(22/110). Let w be p/((-2)/(-4) + 2). Solve 0 = -wn + 5n for n. 0 Let s(o) = 6o - 5. Let g be s(5). Suppose 21y + 8 = gy. Solve 4r = y - 14 for r. -3 Suppose 2y + 19 = -3m, 0y - m + 7 = -2y. Let o be 4/(-10)1y. Solve 2 = -t - o for t. -4 Let z be (-7)/(-5) - 2/5. Let t = 0 + z. Let b be 14((-16)/(-4) + (-182)/49). Solve -3q = -t + b for q. -1 Let u be (-348)/(-42) + 2/(-7). Let l be (u - 3 - 1)/2. Let w = 1 + l. Solve -s + 2s = w for s. 3 Let w(m) = m*3 + 3m*2 - 7m - 10. Let r be w(-4). Suppose 2h = 3x - 8, -2x + 0h = -rh - 4. Solve -xo = -6o + 8 for o. 4 Suppose 4u = -4r + 4, 10 = -4r + 2r - 5u. Suppose rw + 19 = 4c - 1, 3w = 2c - 12. Solve -5q + cq = -5 for q. 1 Let z be 9/(-15) - (0 + 198/(-	{ "pile_set_name": "DM Mathematics" }
s the closest to 4/8065? (a) 10 (b) -4/7 (c) -2 b What is the closest to -0.3 in -5/63, -1, 0? -5/63 What is the closest to 2 in 4, 0.3, 0.1, 2.7, 0.5? 2.7 What is the closest to 4 in -61/233, 4, 3, 0? 4 Which is the nearest to 195/157? (a) 2/7 (b) -34 (c) -3/5 a What is the closest to -1 in 78999, -2/3, -0.3? -2/3 Which is the nearest to -1/4? (a) -2/57 (b) -12 (c) -0.3 (d) 4 c Which is the nearest to -1? (a) 0.3 (b) -0.4 (c) 4263 b Which is the nearest to -1? (a) 5.6 (b) -0.1 (c) 3/5 (d) -3 (e) 5 b Which is the nearest to -17? (a) -0.2 (b) 1/5 (c) 7.2 (d) -4 d What is the closest to 0.1 in 0.3, -0.5, -0.288, 2/33? 2/33 What is the closest to 2 in 5, 527/11, -0.6? -0.6 What is the nearest to -0.2 in -2/9, 0.069, 0.1, 196, -0.2? -0.2 What is the closest to -168 in -1, -2/3, -1/4, -235, -3? -235 Which is the nearest to 1/7? (a) -2 (b) 10 (c) 0.2 (d) -0.1 c Which is the nearest to 0.2? (a) 3/10 (b) 20/19 (c) 430 a What is the nearest to 0.1 in -4, -1/3, -13.91, 5? -1/3 Which is the closest to 36? (a) 0.481 (b) -10 (c) -0.2 (d) 5 d What is the closest to -0.1 in -5, 484, -0.1, 0.3? -0.1 Which is the closest to -1/80? (a) 6/7 (b) 0 (c) -0.06 (d) -2/13 b What is the closest to -1 in -26, 32, 2, 7, 1? 1 What is the closest to -16 in 2/3, 3, 9150? 2/3 Which is the closest to 4.97? (a) -0.1 (b) -0.3 (c) 3/2 (d) 46 (e) 5 e Which is the nearest to -5? (a) -1 (b) -4 (c) 0.21 (d) -15 (e) -5 e What is the closest to 0 in 8/3, -0.5, -0.2, 1.31? -0.2 What is the closest to 4 in -8, 0.1, 2/11, 0? 2/11 What is the closest to 0 in -1, 5/29, -5, 1/2? 5/29 What is the nearest to 5/2 in 4, -3, -0.04, 78, 3/7? 4 What is the closest to -1/3 in 1.44, 1/4, -0.02? -0.02 What is the closest to -6/19 in 0.3, -5.5, -2/7? -2/7 What is the nearest to 156 in 0.11, 2/23, 0, -3? 0.11 What is the closest to -1/3 in -4/31, -4, -0.4, 2? -0.4 What is the closest to -11 in 387, -1/3, -4, -3/2, 4? -4 Which is the closest to -1/12? (a) -3/7 (b) -2/9 (c) -7 b Which is the closest to -1? (a) -1 (b) 1/6 (c) -2796 (d) 1 a What is the closest to -9/19 in -2, 2.393, -0.2? -0.2 What is the closest to 1581731 in 0, -3/5, -0.4? 0 What is the nearest to 410874 in 3, -4, 0? 3 Which is the closest to -2? (a) 5 (b) 1/8 (c) 7 (d) -49 b What is the closest to 0.1 in 69, -27/2, 3/2? 3/2 Which is the closest to -18.7? (a) -2/25 (b) -1 (c) -3 c What is the closest to 0.1 in 0, 0.3, -79, 4, -0.111? 0 What is the closest to -1.01 in 1, 2, -4, -0.46? -0.46 What is the nearest to 7/6 in -25, -1/10, -0.051, -1? -0.051 Which is the nearest to 6? (a) -53 (b) 19 (c) 2 c Which is the closest to -3/4? (a) 5.4 (b) -15 (c) 2/17 c What is the nearest to 1 in 4, -1150, 1, -1/4? 1 Which is the closest to -3? (a) 1/4 (b) -4 (c) -0.2 b Which is the nearest to 4/15? (a) -5/4 (b) 0.4 (c) 1/3 (d) -1/11 (e) -1/15 c What is the nearest to -2 in 2/3, -8329, -2/15? -2/15 Which is the closest to 0? (a) -4 (b) -4.86 (c) 1/66 (d) -1 c What is the closest to -0.3 in -0.032, 70, -0.5? -0.5 Which is the closest to 0? (a) -89 (b) -43 (c) 2/5 (d) 0.2 d Which is the nearest to 3/8? (a) 4 (b) 0.3 (c) 3883 b Which is the closest to 0? (a) 11/5 (b) -35 (c) -1/4 c What is the closest to -8/3 in -5, -2/15, -375? -5 What is the closest to -3 in -1/5, 1/2, 1.2, 1? -1/5 What is the nearest to 1 in 271, -4, 4/7, 1/7, 1.4? 1.4 What is the nearest to 0 in -1.901, 7, -0.4, 1/7, -0.3? 1/7 What is the nearest to -1/2 in -1.4, -7, -2/9, -4/5, -1/12? -2/9 Which is the nearest to 0.4? (a) 3 (b) 5 (c) -0.25 (d) 0.1 (e) -3 d Which is the closest to 5? (a) 7 (b) -7 (c) 1/11 (d) 1/4 a Which is the closest to 231/2? (a) 5 (b) -1 (c) 2 (d) 4 a Which is the nearest to 1/3? (a) -4 (b) 8 (c) 2417 a What is the nearest to 0.1 in -1.8, 4, 3? -1.8 Which is the nearest to 1/2? (a) -3 (b) 0.4 (c) -624 b What is the nearest to 0 in -4/9, -0.5, -107, -48? -4/9 Which is the closest to 1? (a) 0.2 (b) -0.77 (c) 4 (d) -0.1 (e) -117 a Which is the closest to -2/3? (a) 4 (b) -4 (c) 5/1216 c What is the nearest to 3/8 in -0.3, 53, -2/77, -0.2? -2/77 What is the nearest to -0.8 in -0.3, 1, 0.5, -1/90, -3? -0.3 What is the nearest to 4 in 1/2, 0, 0.02, -1/5, -3? 1/2 Which is the closest to 4? (a) -1/4 (b) 3 (c) 883 b What is the closest to -5 in -6, -2, -116/3? -6 Which is the nearest to 0? (a) 12 (b) 3/4 (c) -2106 b Which is the nearest to 1/388381? (a) -3/7 (b) 1 (c) -3/4 a What is the nearest to 0.1 in -0.3, 5, -28, -0.0169, -3? -0.0169 What is the nearest to -1/5 in 3, -22/7, 2/13, 2, -0.5? -0.5 What is the nearest to 25/3 in -0.01, 61, 0, 1/12, 1/4? 1/4 Which is the closest to 3/8? (a) 19 (b) -0.6 (c) 3 (d) 0.5 (e) 2/11 d Which is the closest to -2/7? (a) 0.1316 (b) -3 (c) 3 a Which is the nearest to -0.219? (a) -1/2 (b) -8 (c) -21 a Which is the closest to -2/7? (a) 2 (b) -0.3 (c) -15 (d) 4 (e) 0 b Which is the closest to -2? (a) -6/5 (b) -567/10 (c) -5 (d) 2/17 (e) -3 a What is the closest to 1 in 0.021, 3, 0.2, 9, -3? 0.2 What is the closest to -1 in -3, 2/9, 32600? 2/9 What is the closest to 1 in 7, 10/3, -3/5, 1, 6? 1 What is the closest to 1/2 in -3, -1/5, 0.1, -0.01, 141? 0.1 Which is the closest to -6? (a) -5 (b) -1 (c) 0.0129 (d) 4 a What is the closest to -175 in 1, 0.1, -2/21, -258? -258 What is the nearest to -1/6 in -0.2, 277, -5, 0.5, -0.3? -0.2 Which is the closest to 1? (a) 40 (b) 3 (c) -1/6 (d) 144 c Which is the nearest to -2/17? (a) -5 (b) 0.5 (c) 3/11 (d) 8 c What is the nearest to 1/2 in -5, 7, -5.3? -5 Which is the nearest to -0.2? (a) -7 (b) -37 (c) 56 a Which is the nearest to 3? (a) 3/5 (b) 4 (c) -2 (d) -103 b What is the closest to -591 in 7, 6/7, -4? -4 What is the nearest to -0.023 in 2, 2/13, 1, -2, 5? 2/13 What is the closest to 1/28 in 0.2, 2, 22, 3? 0.2 What is the nearest to 1 in -930, 4, -1? -1 Which is the nearest to 0? (a) 9/7 (b) -5 (c) -111 (d) 1/4 (e) -0.5 d What is the closest to 56 in -5, -3, -2, 0.5? 0.5 What is the closest to 0.49 in -3, 6, -1/5, 1/3? 1/3 Which is the closest to -0.2? (a) 193/9 (b) 2/3 (c) -4 b Which is the closest to -0.1? (a) -1.7 (b) 3 (c) -38 a Which is the nearest to 12? (a) -2/17 (b) -3 (c) 163 (d) 2/9 (e) 0.5 e Which is the closest to -4.2? (a) 32 (b) 5 (c) 0.2 c Which is the closest to -5? (a) 0.056 (b) 0 (c) -2 c What is the closest to -2/5 in 9, 2/127, -0.29, -0.3? -0.3 What is the closest to -1.1 in 0.05, 59, -5, 2? 0.05 What is the nearest to 2/3 in 3, -4, -37, -0.04? -0.04 What is the closest to 1 in 0.0375, 2, -0.4, -3/5, 0.41? 0.41 What is the closest to 5 in 0.1, 17, -3, 214? 0.1 What is the closest to 35 in -2, -38, 1, -2/7? 1 What is the nearest to 0 in -27, 7, -0.1? -0.1 Which is the nearest to 2222? (a) 1/5 (b) 8 (c) -3 b Which is the closest to -3? (a) 3/11 (b) 0.5 (c) -4 (d) -11 c Which is the nearest to 0? (a) -1/4 (b) 6 (c) 1 (d) 2/7 (e) -740 a What is the closest to 300 in -0.5, -0.4, -670? -0.4 What is the closest to 2 in 1/33, -22, -1, -19? 1/33 Which is the closest to 26? (a) 2/5 (b) 0.2 (c) 5 (d) 2 c Which is the nearest to 1/2? (a) 5 (b) -39 (c) -2 (d) -7 (e) -1 e What is the nearest to 3 in -2/5, -0.03, -0.17, 4? 4 What is the nearest to -0.7 in 0, 3, -33? 0 What is the closest to 0 in -66/5, -3/8, -1016? -3/8 What is the closest to -2/7 in 0.4, -2/11, -226? -2/11 Which is the closest to -4? (a) -1/3 (b) -5 (c) -2/3 (d) -2 (e) 2/27 b What is the closest to 0.7 in -1952, 5, 4? 4 What is the closest to -8/7 in -5, 5, 6/11, -2/7? -2/7 Which is the closest to -2? (a) 2/5 (b) 3/5 (c) 0.9 (d) -37 a What is the closest to 0.1 in -2187, -2/9, 2? -2/9 What is the nearest to 19 in -14, 0.4, -4/9, 1? 1 What is the closest to 2 in -6, 1/67, 16? 1/67 Which is the closest to 1? (a) -0.3 (b) -4 (c) -1825 (d) -7 a Which is the closest to 10/27? (a) 1.5 (b) -0.5 (c) -0.1 c Which is the closest to -1? (a) 2/7 (b) -5 (c) 720/29 a Which is the nearest to -3/4? (a) 0 (b) 2 (c) -311.6 a What is the nearest to -33 in 0.4, 73, -5, 1/5? -5 What is the nearest to -2/19 in 2/7, 3, 75, -2/11, 0.9? -2/11 What is the nearest to 1 in 10, 1/3, 28/19? 28/19 Which is the nearest to 1	{ "pile_set_name": "DM Mathematics" }
Let a = k - 5.7. What is a rounded to 1 decimal place? 0.3 Let m = 1968 + -2327.2. What is m rounded to the nearest 10? -360 Suppose 14d + 470 = 16d. Suppose 0 = 2j - 3u + 187, -3j - d = -u + 56. What is j rounded to the nearest ten? -100 Let p = 79.0000172 + -79. Round p to 6 decimal places. 0.000017 Let p = 1306 - 1306.001024. Round p to 4 dps. -0.001 Suppose 0 = -3f - w + 4, -27 = -4f + 3w - 0w. Suppose -fp - t + 3t = -15899992, 4t = -2p + 10600016. What is p rounded to the nearest 1000000? 5000000 Let u = -277592 + 725592. Round u to the nearest 100000. 400000 Let z = 1.12 - 1.22. Let c = z + 0.1000188. Round c to five dps. 0.00002 Let p = 64816.999 + -1056.7142. Let i = p - 64083.284671. Let l = 323 + i. Round l to five dps. 0.00013 Let y(d) = 1249d + 12. Let i(g) = -1. Let x(u) = -4i(u) - y(u). Suppose -5t - t + 48 = 0. Let v be x(t). What is v rounded to the nearest 100000? 0 Let z = -0.058 - -0.101. Let x = z - 0.281. Round x to one decimal place. -0.2 Let f = 98 + -97.836. Round f to one dp. 0.2 Let j = 139.9 + -133. Let v = j - 6.8999982. What is v rounded to six decimal places? 0.000002 Let k = 229 - 229.948. Round k to 1 dp. -0.9 Suppose -4r = -5r - 191991. Let c = 9 + -6. Let i be r/c + 2 + -5. What is i rounded to the nearest 10000? -60000 Let k = 4373 + -6308. Let d = k - -1934.72896. Let b = -0.27 - d. What is b rounded to four dps? 0.001 Let t = -1066.304891 - -1066.3. Round t to 4 decimal places. -0.0049 Let h be 8689/(3/195 + 0). Let r = -807764 + h. Let u = r - -525979. What is u rounded to the nearest ten thousand? 280000 Let j = -277.999805 - -278. What is j rounded to four dps? 0.0002 Let p = -3573664.999882 - -3573802. Let i = -137.174 - -0.174. Let g = p + i. Round g to 5 dps. 0.00012 Let f = 125.139 + -2.539. Round f to the nearest 10. 120 Let c = 0.225 - 0.22248. What is c rounded to 4 decimal places? 0.0025 Let r = -574361 + 623112.8. Let j = 48746.799988 - r. Let z = 5 + j. Round z to 5 decimal places. -0.00001 Let o be ((-225)/(-27) - 6)/((-1)/4695). Round o to the nearest 100. -11000 Let q = -35.6 - 3.4. Let r = -196.2 - -156.99. Let b = r - q. Round b to 1 dp. -0.2 Let c be (-4)/123 - 0. Let r(q) = -4q*3 + 2q + 1. Let z be r(c). Suppose -2u - 4940 = 4w, zw = -4u - u - 12350. Round u to the nearest 100. -2500 Let n(y) = -809719y2 - y - 3. Let d be n(-3). Let a = d + 3437471. Round a to the nearest 100000. -3900000 Let g = -65.00748 - -65. What is g rounded to 4 dps? -0.0075 Let r(k) = 3k*2 + k + 716k*3 - 5k*2 - 2k - 2 + 2086k3. Let x be r(2). Suppose -2h = 99596 + x. What is h rounded to the nearest 10000? -60000 Let o = -13.1 - 0.9. Let j = 13.9999904 + o. What is j rounded to six decimal places? -0.00001 Let m = -61.5 - 3.5. Let u = -44 - m. Let i = -20.99999986 + u. What is i rounded to seven dps? 0.0000001 Let a = 16595.057798 - 16595. Let k = -0.058 + a. Round k to five decimal places. -0.0002 Let z = -233 - -357. Let o = z + -125.18. Let k = 20.78 + o. Round k to zero decimal places. 20 Let h = 506766 - 1045713. Let y = 628053 - h. What is y rounded to the nearest 100000? 1200000 Let l = -0.304 + 263.304. Let u = 264.79 - l. Round u to 1 decimal place. 1.8 Suppose -5s = -s - 72. Suppose 207 = -sj - 477. What is j rounded to the nearest 10? -40 Let n = -15 - -56. Suppose 0 = nk - 39k + 68000. Round k to the nearest one hundred thousand. 0 Suppose 2p = 0, -181800 = s - 4s + 4p. Round s to the nearest ten thousand. 60000 Let w = -2.42 + 3.6. Let z = -1.17851 + w. Round z to four dps. 0.0015 Let i = -2697496 - -2697521.99962. Let h = 47 - 21. Let a = i - h. Round a to four decimal places. -0.0004 Let r = -5087.03 + 5057.03043. Let w = r + 30. What is w rounded to four dps? 0.0004 Let d = 0.25376 - 0.29. Round d to two decimal places. -0.04 Let p = 137 - 138.62. Let d = 6.6 - 5. Let z = d + p. Round z to 2 dps. -0.02 Let p = 1.2 + -1.7. Let z = -5615.6 - -5615.10066. Let v = z - p. Round v to 4 dps. 0.0007 Let s = 0.3 + 2.7. Let q = 4 - s. Let r = q - 1.0000075. What is r rounded to 6 dps? -0.000008 Let z = -639.0000377 + 639. Round z to five dps. -0.00004 Let u = -70 - -66.8. Let v = -3.16 - u. What is v rounded to 2 decimal places? 0.04 Let r = -0.18517795 + 192.18579295. Let h = r - 192. Round h to 4 decimal places. 0.0006 Let a = -56 + 17. Let q = 318 + -339.1. Let z = a - q. What is z rounded to the nearest integer? -18 Let a = -44.72 - -42.031. What is a rounded to 1 dp? -2.7 Let l = 44 + -52. Let u = 8.0008 + l. What is u rounded to 3 decimal places? 0.001 Let g = -12.44 + 13. Let w = g + -1.44. Let v = w - -0.04. What is v rounded to one decimal place? -0.8 Let h = -6.25 + -11.3. What is h rounded to the nearest integer? -18 Suppose 3z + 16638793 = 4b, -3b + 16638796 = b - 4z. Let k be 10 + -12 + b + -1. Let a = 13059693 - k. Round a to the nearest one million. 9000000 Let i = 200 - 192. Suppose -17616248 = -u + 3383752. Suppose 13p + u = ip. What is p rounded to the nearest one million? -4000000 Let f = -65 + 65.06. Let t = -2.04 - f. Round t to one dp. -2.1 Suppose 10 + 8 = 6o. Suppose op + 5r - 172212 = 2r, -3p = 4r - 172216. Round p to the nearest ten thousand. 60000 Suppose 4u + 3g - 37 + 10 = 0, 5u = 4g - 5. Suppose 4q - 27200004 = w - 2w, 0 = uq - 3w - 20399988. Round q to the nearest 1000000. 7000000 Let k be -1 - -4 - (-939 + -4). Let z = -186 + k. What is z rounded to the nearest 100? 800 Let p = 4.87 + -0.27. Let v = 4.5938 - p. Round v to 3 decimal places. -0.006 Let t = 43 - 39. Suppose b = 5h - b + 34000000, th - 4b + 27200000 = 0. What is h rounded to the nearest one million? -7000000 Let i = -14.411 + -10.982. Let f = 25.5 + i. What is f rounded to 2 decimal places? 0.11 Let v be 14/(98/(-37317)) - 9. What is v rounded to the nearest one thousand? -5000 Let p = -2207808588.00000102 - -2207808622. Let b = 34 - p. Round b to seven decimal places. 0.000001 Let g = 14649 + -14647.6246. Round g to two decimal places. 1.38 Let w = -311201 - -311201.223881. Let f = -0.5 + 0.276. Let t = w + f. Round t to 5 dps. -0.00012 Let z = 2455.0002506 - 2455. Round z to four decimal places. 0.0003 Suppose 0 = -9o - 2 - 7. Let i = 0 + -1. Let h be (-749998 - i) + o3. Round h to the nearest one hundred thousand. -800000 Let l = -1137.99758 - -1138. Round l to five dps. 0.00242 Let c = -0.06013662 - -28.06014462. Let f = -28 + c. What is f rounded to 6 decimal places? 0.000008 Let v = -354 - -354.000726. What is v rounded to four decimal places? 0.0007 Let q = 4093.2199 - 4093. Round q to 2 dps. 0.22 Let f be 2/(24/20)(2 + 1). Suppose 0 = -3r - 2g + 894, fg - 705 - 480 = -4r. What is r rounded to the nearest one hundred? 300 Let m = -1016.89 + 1008. Let c = m - -9. Let f = c + -0.109952. Round f to 5 dps. 0.00005 Let h = 2.95 - 2.949999604. Round h to 7 decimal places. 0.0000004 Let g = 0.04 + -0.15. Let c = -0.11052 - g. Round c to four dps. -0.0005 Let a be 50/156/(-4). Let g(s) = -88s + 2. Let c be g(a). Let p = c - 892. What is p rounded to the nearest 100? -500 Let a = 9 + -14.8. Let h = a - -5.800715. What is h rounded to 4 decimal places? 0.0007 Let r = -6324475 + 11214278. Let n = -4889834.000195 + r. Let l = n - -31. Round l to 5 decimal places. -0.0002 Let q = 0.008702 - -95656.991298. Let d = q + -95661.3999914. Let x = d + 4.4. What is x rounded to 6 decimal places? 0.000009 Let v = -104.2 - -104.161. Let p = -7744.639 + 7749. Let u = v - p. What is u rounded to the nearest integer? -4 Let o = -0.384 - 23.516. Let g = 0.03977 - 23.81877. Let j = o - g. Round j to 2 dps. -0.12 Let f = 12391406 + -12391142.00127. Let j = 566 + -302. Let o = f - j. What is o rounded to four dps? -0.0013 Let x = 20.036 + -20. Let q = -84.964 - x. Let u = -80.3 - q. What is u rounded to the nearest integer? 5 Let o = -832 - -779.3. Let h = 55.27 + o. What is h rounded to one decimal place? 2.6 Let o = -152.99999582 + 153. Round o to 6 dps. 0.000004 Suppose 3y = -3k - 13890000, 6y = 10*y. Round k to the nearest 1000000. -5000000 Let c = 0 - 33. Let a = c + 32.9999785. Round a to 5 dps. -0.00002 Let l = 8.3 - 8.333. Let u = 0.0069 + 0.0238. Let z = l + u. Round z to 3 dps. -0.002 Let v = 134 + -133.999084. What is v rounded to 4 dps?	{ "pile_set_name": "DM Mathematics" }
r(6). Suppose 5v - 2 = -4z, 3v + 2z + 3z + 4 = f. Do 5/4 and v have the same value? False Let m be (-2)/(-5) - 14/10. Let q = 1 + m. Suppose 2z + q = 2. Is z bigger than 1? False Let k be 1/3 + 1/(-3). Let w be (1 - 3) + k + 3. Let f be -1 + 3 - (w + 2). Is -1 smaller than f? False Let l = -23 + 21. Which is bigger: -10/13 or l? -10/13 Let f = -15.1 - -15. Are f and -104 unequal? True Let j(v) = v*2 - 13v - 3 - 12 + v. Let m be j(13). Which is smaller: -1/2 or m? m Let l(g) = g*3 - 7g*2 + 6g + 4. Let w be l(6). Let x be 6/4(-32)/(-12). Is x less than or equal to w? True Let w = -5/111 - 133/333. Let h(y) = y2 - 12y + 12. Let l be h(11). Is w less than l? True Let r = 0.7 - -0.3. Let f = -1.01 - 0.09. Let t = f - -1. Which is greater: t or r? r Let d(m) = -m*3 + 2m2 + 4. Let s be d(3). Let q(i) = i3 + 5i2 - 2. Let k be q(s). Is k equal to -1/6? False Suppose 2x + 28 = -2j, -2x = 4j - 0j + 36. Which is smaller: -11 or x? -11 Let h be 2(5/(-2) + 3). Let x be ((-77)/(-3))/7 - 2. Which is smaller: x or h? h Suppose 5j - 4a - 1 = 0, -j - 2 = -5a + 2. Which is smaller: -0.7 or j? -0.7 Let g be ((-60)/(-234))/(3/9). Which is bigger: g or 0? g Suppose -2 = z + 3. Let u = 3 + -5. Let b be 5 + z/((-5)/u). Do 3 and b have the same value? True Suppose -b + k = 2b - 3, 3k = -4b + 4. Is b < 1/17? False Let a = -30 + 1. Let i be (7/(-35))/((-12)/1750). Let y = i + a. Which is greater: -1 or y? y Let t be 2 - 12/(0 - 3) - 3. Which is smaller: 5 or t? t Suppose -3b - 13 + 37 = 0. Let x = -118 - -127. Are x and b unequal? True Let l(s) = -3s - 75. Let t be l(-25). Is 2/355 less than t? False Suppose 2p + 2p + 8 = 0. Suppose -2z = -2i - 12, 2z = -0i + i + 7. Let o be 3z/(1/(-1)). Is p greater than o? True Let z(q) = 2q. Let y be z(-2). Which is bigger: 1 or y? 1 Let x = 3 - 0. Suppose -3r = -6r + x. Let c(z) = -z + 8. Let k be c(8). Which is smaller: k or r? k Let h be 10/2 + 1 + -1. Suppose 0 = -4y + hy. Let v be (-1 - 1) + 2 + 0. Is v != y? False Let v = 0 + 0. Let t(x) = -x2 + 6x + 12. Let z(j) = j*2 - 6j - 13. Let q(o) = 7t(o) + 6z(o). Let d be q(7). Are d and v equal? False Let j be (0 + -1)/(-1 - -2). Let k(l) = -4l + 1. Let u be k(-5). Let o be (-24)/u + (1 - 0). Is j smaller than o? True Let h(p) = -2p - 4. Let w be h(-2). Which is smaller: w or 1/3? w Let t be (-1 + -1)9/6 + 10. Is t at most -3? False Let h be (0 - -1)-1 - -1. Suppose -4r + 9r - 3z = h, 0 = -r - 3z + 18. Suppose 2 = -ru + u. Is -1 >= u? True Let k = 3 - 3. Suppose -3d + 3 = 0, 0q = 4q - d - 19. Let m = -3 + q. Which is bigger: k or m? m Let z = 0.01 - -0.19. Let o = 1.6 + -0.8. Let h = o + z. Is h bigger than -4? True Let v = -50 - -80. Let m be 6 + 2(-6)/4. Let c be 2(m/v - 0). Which is greater: -1 or c? c Let c(d) = d*2 + 11d + 15. Let r be c(-9). Which is smaller: r or -2? r Let p = 154 + -3543/23. Which is smaller: -2 or p? -2 Suppose -5t + 2 = -2j - 6, 2 = -t + 4j. Let c = t + 8. Is c less than or equal to 10? True Let q be (-40)/(-6) + (-2)/3. Suppose -m + qm = 10. Let p(o) = o*2 + 5o + 2. Let y be p(-5). Is y at most m? True Let g be 13/3 + (-1)/3. Suppose -4b + 4 = -2o - 2, -9 = gb + o. Is 4/13 < b? False Let l(n) = -n3 - 5n*2 - 5n - 1. Let i be l(-4). Suppose -m - 3 - i = 0. Let j be ((-9)/(-6))/(m/(-8)). Which is greater: j or -2/5? j Let i be (-6974)/(-72) - (-3)/12. Let p = 97 - i. Is 0 > p? True Suppose -4s - 16 = -8s. Which is greater: s or 2? s Let s = 8 - 31/4. Let c be (1 - 15/27)/((-10)/15). Is s greater than c? True Let i = -34/15 - -8/5. Which is greater: 1 or i? 1 Suppose 0 = s - 2w, 0 = -4s - 2w - 2w. Suppose s = 3u - v + 5v, u + 2v = 0. Which is bigger: 4/3 or u? 4/3 Let s = -8 + 8.003. Let j = 2.897 + s. Let p = 3 - j. Which is smaller: 4 or p? p Let p = 2.8 - 1.6. Let u = p + -0.4. Let c = u - 0.7. Which is smaller: c or -0.04? -0.04 Suppose 3d = -3f + 6, -3f - 3d + d + 10 = 0. Let u = f + -4. Suppose -5w + 7 = u. Is w bigger than 1/13? True Let t be ((-808)/(-19152))/(2/(-6)). Let s = 5/57 - t. Is s > 1? False Let x = -5 + 9. Let s be 7 + -1 + -2 - -2. Let c be (s/x)/(1/2). Does c = 3? True Let d = 56 + -53. Which is smaller: d or 7/2? d Let m = 57 + -38. Is 18 not equal to m? True Let g = 52 - 678/13. Does 0 = g? False Let n be (60/(-16) - -3) + (-5)/(-12). Which is smaller: 41 or n? n Let v be ((-4)/3)/(2 + 4). Let c = 2.81 + 0.19. Is v > c? False Let h = -1.3 + 0.8. Let g = h - -0.1. Which is greater: 2 or g? 2 Let i = -0.065 + -0.975. Let y = i - -0.04. Is y less than -1? False Suppose -60 = -4z + 12. Let s = z + -17. Do s and 3 have the same value? False Let c be -39(-10)/105 - 0. Which is smaller: c or 4? c Let j = -499/6 - -83. Let t(r) = r*2 - 2r + 1. Let z be t(2). Which is smaller: z or j? j Suppose 0 = -0a + 3a + 24. Let u be ((-4)/a)/(2/60). Suppose u = g - 6g - 5x, -2 = 3g - 4x. Which is smaller: g or -3? -3 Suppose -5z - h = 10 + 24, 0 = -h + 1. Let y = z + 6. Are y and 2/15 equal? False Let k(d) = d3 + 6d*2 + 5d - 2. Let y be k(-4). Let h = y + -10. Let j be 2/(-2) - (-7)/8. Which is smaller: j or h? j Let n(t) = t*3 + 17t*2 - 29. Let m be n(-17). Is -28 at most m? False Suppose -3h = -8h. Let f be (-7)/(-4) - (-6)/24. Which is smaller: h or f? h Let t = -1.41 - 0.19. Let r = t + 2.6. Which is bigger: r or -2? r Let g = -22 - -25. Let b = 1 - g. Which is smaller: 2 or b? b Suppose 3 = -3x - 2a, -x - 5a = -0 + 14. Let v be -2x3/(-6). Let c = 1/203 - 213/2030. Which is smaller: v or c? c Let d = -3 + 1.96. Let c = d - -0.04. Let w = 1 - c. Does w = -1? False Let h(v) = v*3 + 2v*2 - v + 2. Let g be h(-3). Let w be (g/(-15))/((-6)/(-15)). Let d = 2 + 0. Which is bigger: w or d? d Let a = 847 - 1729/2. Suppose -5t + 13 = -3l + l, -2l + 3t = 23. Let m = a - l. Which is smaller: m or 2? m Let p be 45 - ((3 - 0) + -2). Is p != 43? True Let p be (-20)/30 + 10/(-3). Let q = 1 + -1. Which is smaller: p or q? p Let z be (-222)/(-8) - 4/(-16). Suppose 3t = -5j - z, 0t + j + 2 = 3t. Let y be (1 - t) + (-2 - -1). Which is smaller: y or 2/5? 2/5 Let i = -0.04 + 2.04. Let a = 26 - 37. Let w = a + 11. Is w greater than or equal to i? False Let x(t) = -3 - t - 4 + 2. Let c be x(-5). Let w = 0 - -0.2. Is w greater than c? True Let s be ((0/1)/(-1))/2. Which is bigger: -1/47 or s? s Let v(b) = -b3 - 16b*2 - 12b + 30. Let f be v(-15). Is f at least -16? True Let i be (83/10)/(1/2). Let h = -6347849/40 - -158680. Let p = h + i. Which is bigger: 0 or p? p Suppose u - 1 - 3 = 0. Let c be 4/(-14) - 51/(-7). Let f(v) = v*3 - 7v*2 + v - 4. Let w be f(c). Is u bigger than w? True Let c = 7 - 5. Let a be c/(-5) + (-112)/20. Let h be (0 + 1 - 7) + 0. Is a at most h? True Let p = 4 - 2. Let x = -3.96 + 4. Let b = x - -0.96. Is p at most b? False Suppose 4l - 8 = 0, -3i - l = 2l + 21. Is i > -7? False Let l(k) = -2 + 5k + k2 - 4 - 2. Let b be l(-7). Is 5 at most b? True Let q = 14 - 8. Let o = 4 - q. Let a = 3 + o. Which is bigger: -2 or a? a Let v be 8 + -11 - (-1)/(-1). Is v bigger than -23/7? False Suppose 585 = 5r + 4n, -45 - 545 = -5r - 5n. Is r smaller than 113? False Let l(p) = -p. Let w be l(-5). Is 4 < w? True Let x be 36/(-18)1. Is -6/19 at least as big as x? True Suppose 5x = -2g + 3x - 6, -5g + 2x - 8 = 0. Suppose 4k + k = 15. Suppose -4f - k = -f. Are f and g nonequal? True Let u = -10862/97 + 112. Which is greater: u or 0? u Suppose -2l = -u + 7, u + 4u + 5l = 5. Suppose -2q + 28 = 4a + 2q, a = uq - 9. Suppose -5y - 20 = aw, 2y + 16 = 5w - 2y. Which is smaller: w or -1? -1 Let w be 2163/82 + -4. Which is smaller: w or 1? w Let s be ((-2)/(-5))/(-43/(-60)). Which is bigger: s or -4? s Let v(s) = -5s2 + 3s + 8. Let w(x) = -9x2 + 6x + 15. Let t(j) = 11v(j) - 6w(j). Let k be t(-2). Which is greater: -2/5 or k? k Let y = 0.2 - -1. Let p = -0.2 + y. Which is bigger: 0.5 or p? p Suppose 5a + 4d = -488, -2d - 303 = 3a - 3d. Let j be (-2)/8 - a/16. Do 6 and j have different values? False Let i = -11 + 23. Let x = 7 - i. Let c = -5 - x. Is 0 less than c? False Let i be (1/5)/((-2)/65). Which is smaller: -6 or i? i Let k = -8 - -13. Suppose -9 = -4l + 7. Are k and l nonequal? Tru	{ "pile_set_name": "DM Mathematics" }
here in twenty-five quarters of a gram? 6250 What is 6/25 of a microgram in nanograms? 240 What is 7/2 of a litre in millilitres? 3500 What is 41/2 of a litre in millilitres? 20500 What is 0.8008269 millennia in decades? 80.08269 Convert 29.1925l to millilitres. 29192.5 How many hours are there in 17/4 of a week? 714 Convert 4.754196m to kilometers. 0.004754196 How many decades are there in one fifth of a century? 2 How many microseconds are there in 82.71096s? 82710960 What is twenty-one fifths of a hour in seconds? 15120 What is thirty-one halves of a microsecond in nanoseconds? 15500 How many millilitres are there in 53.6938 litres? 53693.8 What is 4/75 of a week in seconds? 32256 How many nanograms are there in 0.4781357ug? 478.1357 What is 1/10 of a litre in millilitres? 100 Convert 8112.424cm to nanometers. 81124240000 What is 2.050352 tonnes in milligrams? 2050352000 What is 9704.919l in millilitres? 9704919 How many milligrams are there in 1/5 of a gram? 200 What is one fifth of a kilometer in meters? 200 What is 2.781834 millennia in centuries? 27.81834 How many millilitres are there in twenty-six fifths of a litre? 5200 How many nanograms are there in 1/4 of a microgram? 250 How many milligrams are there in 3/40 of a kilogram? 75000 What is one twentieth of a litre in millilitres? 50 How many milligrams are there in 5/4 of a gram? 1250 Convert 606830.4 years to centuries. 6068.304 How many milligrams are there in 3/32 of a kilogram? 93750 What is 28.66276 days in weeks? 4.09468 What is 94.22024 years in months? 1130.64288 What is eighteen fifths of a litre in millilitres? 3600 How many kilograms are there in seven eighths of a tonne? 875 How many millennia are there in 0.504562 centuries? 0.0504562 What is nine tenths of a millennium in years? 900 Convert 9.476136l to millilitres. 9476.136 What is fifteen quarters of a litre in millilitres? 3750 Convert 2387.454 years to millennia. 2.387454 What is 8/25 of a millimeter in micrometers? 320 How many nanograms are there in 461.6708mg? 461670800 How many millilitres are there in 410.7006 litres? 410700.6 How many micrometers are there in 31/2 of a millimeter? 15500 How many micrometers are there in nineteen quarters of a millimeter? 4750 What is 6/25 of a millennium in years? 240 How many litres are there in 792135.1 millilitres? 792.1351 Convert 16.72614s to hours. 0.00464615 What is 48/5 of a litre in millilitres? 9600 How many nanometers are there in 43/4 of a micrometer? 10750 How many millilitres are there in three fifths of a litre? 600 How many hours are there in 7/2 of a day? 84 How many millilitres are there in five quarters of a litre? 1250 What is 603.8972l in millilitres? 603897.2 Convert 6.06571 centimeters to nanometers. 60657100 What is 228083.4um in nanometers? 228083400 How many meters are there in 37/5 of a kilometer? 7400 How many millilitres are there in 0.6345829 litres? 634.5829 How many milligrams are there in eleven halves of a gram? 5500 How many meters are there in 5/8 of a kilometer? 625 Convert 57500.01 seconds to minutes. 958.3335 Convert 229355.5 meters to nanometers. 229355500000000 How many milliseconds are there in 29.11862 days? 2515848768 What is 555693.6 days in microseconds? 48011927040000000 What is 9.845659 days in seconds? 850664.9376 What is 731.5814 micrograms in milligrams? 0.7315814 What is 25.588479 days in weeks? 3.655497 How many minutes are there in 21/5 of a hour? 252 What is 3/25 of a micrometer in nanometers? 120 Convert 3.972004 days to microseconds. 343181145600 What is 55/2 of a micrometer in nanometers? 27500 How many milligrams are there in 21/2 of a gram? 10500 How many millilitres are there in 11/10 of a litre? 1100 Convert 0.9496628ml to litres. 0.0009496628 How many millilitres are there in 2.14483 litres? 2144.83 How many meters are there in 34/5 of a kilometer? 6800 What is 82278.51 decades in centuries? 8227.851 How many micrometers are there in 1/16 of a meter? 62500 How many decades are there in three fifths of a millennium? 60 What is 3455.593 meters in kilometers? 3.455593 Convert 9163.972 nanoseconds to seconds. 0.000009163972 What is five quarters of a millisecond in microseconds? 1250 What is 1/4 of a millennium in years? 250 How many months are there in fourty-six fifths of a century? 11040 What is 0.2713412ug in tonnes? 0.0000000000002713412 What is 446913.5 nanograms in kilograms? 0.0000004469135 Convert 23.25082 kilometers to nanometers. 23250820000000 What is fifteen quarters of a litre in millilitres? 3750 How many millilitres are there in 8/25 of a litre? 320 What is 3/16 of a week in minutes? 1890 How many minutes are there in 209.06655us? 0.0000034844425 How many days are there in 157772.43 minutes? 109.5641875 Convert 215.2868 millilitres to litres. 0.2152868 What is one tenth of a microgram in nanograms? 100 How many milliseconds are there in three tenths of a minute? 18000 What is 7/4 of a millimeter in micrometers? 1750 Convert 913199.6 years to months. 10958395.2 How many nanograms are there in 799.6078kg? 799607800000000 How many meters are there in twenty-nine halves of a kilometer? 14500 Convert 9.605026 micrometers to centimeters. 0.0009605026 How many centuries are there in 6/5 of a millennium? 12 What is 73/3 of a decade in months? 2920 What is 58305.6g in micrograms? 58305600000 Convert 576.9441 millennia to decades. 57694.41 What is 29/5 of a meter in millimeters? 5800 Convert 6432.011mm to nanometers. 6432011000 How many minutes are there in 1/5 of a day? 288 How many centuries are there in 7.342039 millennia? 73.42039 How many months are there in 5/24 of a century? 250 How many millilitres are there in 3497.479 litres? 3497479 How many millimeters are there in 21/2 of a meter? 10500 How many milligrams are there in seventy-one fifths of a gram? 14200 Convert 326.2288ml to litres. 0.3262288 What is 42/5 of a micrometer in nanometers? 8400 What is three tenths of a tonne in kilograms? 300 How many millilitres are there in 21/2 of a litre? 10500 What is 2.603531 tonnes in milligrams? 2603531000 Convert 0.1437928 kilograms to micrograms. 143792800 How many years are there in 3/50 of a century? 6 What is one twentieth of a milligram in nanograms? 50000 What is 118288.7ml in litres? 118.2887 What is five sixths of a decade in months? 100 What is seventeen quarters of a gram in milligrams? 4250 What is 5/4 of a meter in millimeters? 1250 How many milliseconds are there in 169.4719 days? 14642372160 How many millilitres are there in 3/8 of a litre? 375 Convert 1.096647 months to centuries. 0.0009138725 What is 478101.4 litres in millilitres? 478101400 What is ten thirds of a year in months? 40 What is 49184.88cm in kilometers? 0.4918488 Convert 845.503 centimeters to kilometers. 0.00845503 Convert 8376.371 decades to months. 1005164.52 What is thirteen eighths of a litre in millilitres? 1625 What is 1/10 of a kilogram in milligrams? 100000 How many milligrams are there in three tenths of a gram? 300 What is 11/2 of a week in hours? 924 Convert 1779.207 meters to centimeters. 177920.7 How many milliseconds are there in 7.401062 nanoseconds? 0.000007401062 Convert 2.211002 hours to nanoseconds. 7959607200000 Convert 782633.3 litres to millilitres. 782633300 What is 980.965 centuries in months? 1177158 How many kilometers are there in 44600.51 millimeters? 0.04460051 Convert 0.544255 millennia to years. 544.255 How many kilograms are there in 51/5 of a tonne? 10200 What is 91.62089l in millilitres? 91620.89 What is three fifths of a kilometer in centimeters? 60000 What is 402430.7l in millilitres? 402430700 How many centuries are there in 0.317518 millennia? 3.17518 What is 0.7434037 litres in millilitres? 743.4037 Convert 890450.6m to millimeters. 890450600 How many hours are there in 5/4 of a day? 30 What is 43.2884 millennia in years? 43288.4 How many months are there in 21.66132 decades? 2599.3584 How many millimeters are there in five eighths of a meter? 625 What is 0.0446091s in microseconds? 44609.1 How many seconds are there in 4.833839 hours? 17401.8204 How many millimeters are there in 29/5 of a centimeter? 58 What is three eighths of a litre in millilitres? 375 How many seconds are there in	{ "pile_set_name": "DM Mathematics" }
ing s is positive. s*(-5861/208) Simplify ((ll*(-7)/ll)/l(1/42))/((l(4/13)l)/l)(2/99) assuming l is positive. l(-108649/18018) Simplify (((((tt/(t/(((t(-2/27)/t)/t)/t)))/t)/t)/t)/(t(-2/21)/t))/((t*(2/9)/tt)/t)10 assuming t is positive. t(718/189) Simplify (y(2/15)/y(3/11))/(y*14y(5/13)) assuming y is positive. y(-31154/2145) Simplify (f(2/41)/f)4/(ff(3/2)/ffff*(-3/20)ff) assuming f is positive. f(-7507/820) Simplify (ii*(25/4)(ii(-13/6))/i)/(i(-3/2)ii)7 assuming i is positive. i(19/12) Simplify (c(7/4)/(cc*(7/6)))/(((c/((c/(cc*(-1)c))/c))/c)/cc)(-33) assuming c is positive. c(391/12) Simplify s9/ss*(-8)/s(ss(2/7))48 assuming s is positive. s(425/7) Simplify (((d/((((dd/(dd(-22))d)/d)/dd)/d))/d)/dd*8dd)16 assuming d is positive. d(-208) Simplify (zz/(z(z/(zz(z(2/7)/z)/z))/z))(-1)/(z/(z/(z(-11)/z))zz/(zz*(-4))z) assuming z is positive. z(33/7) Simplify ((s(1/3)/ss)/s)(1/8)(sss((s/(s(-3)s))/s)/s)29 assuming s is positive. s(1391/12) Simplify (i*(1/8)iii/i*17i)/((ii(-7)ii)/(((i(-3/2)/i)/i)/i)) assuming i is positive. i(-107/8) Simplify (i/(i/i(1/3)i))*(-2/39)i10/(i/(i(-9)i)) assuming i is positive. i(121/117) Simplify (q(2/5))20(qq/(qq/q(-2/17)))/q(-2) assuming q is positive. q(168/17) Simplify (y(-9/2)/(y*(-3)y))/(y/y*3yy)(1/45) assuming y is positive. y(-5/2) Simplify (k(11/3))(3/4)(k(-26))(-31) assuming k is positive. k*(3235/4) Simplify ((aa*9a(-4/9)/a)(-1/8))15 assuming a is positive. a(-385/24) Simplify (b/(bb(-8)))(9/11)((b(-5/6)/b)/b)(6/25) assuming b is positive. b*(1613/275) Simplify (l/(ll0/l))(-4/5)/((ll1)/l)(2/41) assuming l is positive. l(-174/205) Simplify (((nn3/n)/n)/n(-2/63))/(n/n(-4))(-39) assuming n is positive. n(12413/63) Simplify (((y(1/5)y)(2/9))48)20 assuming y is positive. y256 Simplify ((nn*(-2/9)n)/n*(-11))/((nn(-3/7))/n(-12)) assuming n is positive. n(13/63) Simplify (r(2/7))*(-5/6)/(rr(2/3))(-26) assuming r is positive. r(905/21) Simplify (s/(s(3/5)/ss))(-3)/(s(-1/4)/(sss(3/11)s)) assuming s is positive. s(511/220) Simplify (i16ii)(8/3)/(i25/((i(15/7)/i)/i)) assuming i is positive. i(162/7) Simplify (((dd(2/37)/d)/dd*(1/3)/dd)(-27))(-39) assuming d is positive. d(-23868/37) Simplify ((d(6/7))(-9))(1/34) assuming d is positive. d(-27/119) Simplify (f0/(f*(-2)f)(f/(f(4/5)f))/(ff/f(-1)ff))(-13) assuming f is positive. f(312/5) Simplify m(-3/8)m*(-23)(m(-10/11))(-9) assuming m is positive. m*(-1337/88) Simplify ((n/(n/(nn*2nn)))/(n/(nnnn/(n/(n*7n))n)n))/((nn(4/13)n)/nn)(1/31) assuming n is positive. n(6015/403) Simplify (((u/u(-2/13)u)/u*1)/((uuu(-2/15))/u(-1)))(-35) assuming u is positive. u(2338/39) Simplify (t(-3/4))(-21)/(tt*7/tt)(-18) assuming t is positive. t(639/4) Simplify (l*(-6)l(-10))/((l2l)/l)(2/9) assuming l is positive. l(-148/9) Simplify ((v/v(6/5))/v(3/2))/(v/(vv*9)vv6) assuming v is positive. v(3/10) Simplify (o9o)*(-39)o/(o*0o)(o(-3)/o)/o assuming o is positive. o(-395) Simplify (h(3/4)h(3/4))/(((h/(h/((h/(h/(h(-5/2)h)h))/h)))/h)/h(-18)) assuming h is positive. h(-12) Simplify qq/q(5/2)q*(1/13)/qq/(qqq*(1/12)/qq)qq(1/8) assuming q is positive. q(-431/312) Simplify k*(1/30)/(((kk/k*(-14/5))/k)/k)(kkk(1/8)/k)(3/32) assuming k is positive. k(-10219/3840) Simplify ((x9x)/x)/(x/x11)x*(-1/31)xxxxx(4/9) assuming x is positive. x(6532/279) Simplify (a*22a(-34))(1/12) assuming a is positive. 1/a Simplify (o3)(-23)o(-1/13)o25 assuming o is positive. o(-573/13) Simplify ((mm(-3)m*(-1/7)m)(-34))39 assuming m is positive. m(10608/7) Simplify (y/(y/y10))*(-20/7)yy/y(-18)yy/y(9/8) assuming y is positive. y(-431/56) Simplify ((aa(1/4))(-13)/((a((a(-1)aa)/aa)/a)/a(-1/2)))(-49) assuming a is positive. a(3479/4) Simplify ((g/g11)/((g/(gg/g(-8/5)))/g))(-6/7) assuming g is positive. g(192/35) Simplify (x/(xxx(-2/33)/x)x)/(x*(-2/17)x)(x17/x)/(x/(x/x24)) assuming x is positive. x(-4388/561) Simplify (w(3/2)www)*(-1/10)(((w3/w)/w)/w)(-31) assuming w is positive. w*(-9/20) Simplify ((cc*(-1/25)c)/c13)(-4/7) assuming c is positive. c*(1104/175) Simplify (r/(r/(rr*(1/11)))(rr/((r5r)/r))/r)/((r/r*12)/(r/(rr*17r))) assuming r is positive. r*(-109/11) Simplify ((jjj(-5))/jjjj/j*(1/6)(j/(j/j*(-2/9)j))/((j/(j/(jj(-4)))j)/j))18 assuming j is positive. j11 Simplify (s(-6/7))(-37/3)/((s/(ss(-3/2)))/s(-3/23)) assuming s is positive. s(2879/322) Simplify i(2/9)/(((i(i*22i)/i)/i)/i)((i((i(i/i(-10/11))/i)/i)/i)/i)/(i/(i/(ii(-20)))) assuming i is positive. i(-185/99) Simplify (vv(-14)v)(-2/7)/(v15)(1/29) assuming v is positive. v(591/203) Simplify ((jj(2/7))/j(-5/4))/(j(-14)(j(8/5)/j)/j) assuming j is positive. j(2371/140) Simplify (g(9/7)/g27)(25/3) assuming g is positive. g(-1500/7) Simplify (n(3/19)/(n(-7)nn))/(n*(15/4)n*(-13)n) assuming n is positive. n*(1019/76) Simplify zz*2z*(-7)(z(-2/3)/z)(7/5) assuming z is positive. z*(-19/3) Simplify ((t/(t(t(t1t)/t)/t))/(tt/(tt*5/tt)))/(t/t*7t(-1/6)/t) assuming t is positive. t(61/6) Simplify (vv/v(12/13))(-2)((vv/v(1/2))/vv)(-32) assuming v is positive. v(-652/13) Simplify j/((jj(-2/11))/j)jj23j*(-3)j(jjjjj(15/7))/jj assuming j is positive. j*(2258/77) Simplify ((ggg7g)/(gg(1/5)/gg))/(((g*17/g)/g)/gg*(-4/11)g) assuming g is positive. g(-321/55) Simplify (f/f1)/(ff(2/33)/ff)f14ffff/(ffff*(-5)/f)ff assuming f is positive. f(724/33) Simplify (h/(hh/(h/(h*(-3/2)/h))hh))(-1/42)/(h/(h(3/2)/h)h(-7/5)/h) assuming h is positive. h(793/420) Simplify (f*(-15)f*6)/(ff/(ff(fff*(-2/47))/f)ffff(-24)) assuming f is positive. f(609/47) Simplify ((i/(i/(iii/i(-2/3)))ii)(-29)/(i(-3/11)/i3))44 assuming i is positive. i(-21260/3) Simplify (ddd(-3)/d)35/(d(1/3))34 assuming d is positive. d(-244/3) Simplify ((q/(qq*(1/12))q*(-7)/q)/(((q/((q/(qqqqq(-1/3)))/q))/q)/(qq(-7))))(-4) assuming q is positive. q*71 Simplify ((d/(dd/d*(1/9)))/dd6)/(d(-6))(-15/8) assuming d is positive. d(-257/36) Simplify ((g*12g)/(g*(-3)g))/(g*(-2/15)gg(-7)) assuming g is positive. g(317/15) Simplify f(-4/13)f/(ff/(f/f(1/23))f)f13f28 assuming f is positive. f(11855/299) Simplify ((h(4/9)/h(-3/13))(-1))7 assuming h is positive. h*(-553/117) Simplify (qqq(-1/4)q)*(-2/9)q*(-3/2)q(-1/5) assuming q is positive. q(-104/45) Simplify ((r1)(-44)/(r0)(-1/56))0 assuming r is positive. 1 Simplify t/(t(-23)/t)t/t(-21)t(t/((ttt3t)/t))/(((t*(4/7)/t)/t)/tt) assuming t is positive. t*(318/7) Simplify ((vvv1/vv)*5((vv1)/v)(-4/25))17 assuming v is positive. v(6307/25) Simplify ((((oo/o*(-3))/o)/oo)/o*1)/(((o/(oo*(-13/5)o))/o)/(o*6o)) assuming o is positive. o(47/5) Simplify (l(-2/7)/ll(1/5))/(l(-2)l(-7)) assuming l is positive. l(277/35) Simplify i*10i*(-2/33)(i/(i/(ii(-8))))/i(-6) assuming i is positive. i(295/33) Simplify (s/(s(-12)s))(-13)/(s(2/107)/s(-24)) assuming s is positive. s(-19262/107) Simplify (((m/(m/(((m*(3/7)m)/m)/m)))/m(-11))/((m/(m/m(-2)m))/mm(mm*(-4/9))/mm))44 assuming m is positive. m(35684/63) Simplify (k*(1/9)k(-2/43))/(k(-3/7))(-25) assuming k is positive. k(-28850/2709) Simplify (i*(1/44)i/(i/i17))/(i(-3/2)(i15/i)/i) assuming i is positive. i(243/44) Simplify (d/(d/(d(1/4)d))(d(-1)/d)/dd*(-1/5)/dddd(-3/8)/d)(5/7) assuming d is positive. d*(-93/56) Simplify ((p/(pp/p*(-1)p))*(-4/13)p*(-5)p*(-5)p)18 assuming p is positive. p(-1890/13) Simplify (((ccccc*(3/16)c)/c)(-45))(-36) assuming c	{ "pile_set_name": "DM Mathematics" }
) + sqrt(1331)))*23. 399300 Simplify (sqrt(475) - (sqrt(475) - (-4 + 4 + sqrt(475))))*2 + sqrt(475). 5sqrt(19) + 475 Simplify 2 + (-2sqrt(68))2 + -5. 269 Simplify (sqrt(68) + -3-4sqrt(68))/sqrt(4). 13sqrt(17) Simplify ((sqrt(396) + sqrt(396) + (sqrt(396) - (2 + sqrt(396) - sqrt(396)) - sqrt(396)) + 5 + 1)2)2. 384sqrt(11) + 6400 Simplify -4 + 6(-4sqrt(78)/sqrt(6))2. 1244 Simplify (sqrt(432) + -5 + 2)2. -72sqrt(3) + 441 Simplify -5sqrt(13)-2 + ((sqrt(13) + sqrt(13) + sqrt(13)1 + 2)*2 - sqrt(13)). 21sqrt(13) + 121 Simplify (-2 + sqrt(612) + -1 + sqrt(612))*2. -72sqrt(17) + 2457 Simplify -5 + sqrt(3) + 3 + -1. -3 + sqrt(3) Simplify (-6-3sqrt(84))/sqrt(12). 18sqrt(7) Simplify (-55sqrt(1573)5)*2. 24578125 Simplify 6((sqrt(3) + 3sqrt(48) - sqrt(3))2 + -2sqrt(243)). -108sqrt(3) + 2592 Simplify sqrt(18) + 3 + -2 + sqrt(18). 1 + 6sqrt(2) Simplify (3 + sqrt(684) + 1 - sqrt(684))*2-6. -96 Simplify (sqrt(180)/sqrt(160))/sqrt(9). sqrt(2)/4 Simplify (-1 + sqrt(405) + 0 + sqrt(405) + sqrt(405) + sqrt(405))*2 - sqrt(405). -81sqrt(5) + 6481 Simplify (sqrt(128) + 0)2 + (sqrt(6)/sqrt(3))22. 132 Simplify sqrt(91)/(sqrt(7) + (sqrt(14)-1)/sqrt(2) + sqrt(7)). sqrt(13) Simplify (1 + sqrt(108) + sqrt(108) + -5 + 3)*2. -24sqrt(3) + 433 Simplify (3 + sqrt(117) + 0 - (sqrt(117) + 0 + -3))*26. 216 Simplify (-5sqrt(156)1 - sqrt(156))/(sqrt(1452)1). -6sqrt(13)/11 Simplify (sqrt(160)1)/(sqrt(40)/sqrt(32)). 8sqrt(2) Simplify ((sqrt(13) - sqrt(78)/sqrt(6))-2 - sqrt(13))2 - (sqrt(208) - sqrt(52))/sqrt(4). -sqrt(13) + 13 Simplify (sqrt(49) + (sqrt(441) + 3sqrt(441))/sqrt(9))/((3sqrt(28))/sqrt(4)). 5sqrt(7)/3 Simplify (sqrt(416)/(sqrt(32)/sqrt(4)))/((5sqrt(36) - sqrt(4)) + sqrt(4)). sqrt(13)/15 Simplify -2sqrt(20)-1. 4sqrt(5) Simplify sqrt(18) + 0 + 0. 3sqrt(2) Simplify (-3 + sqrt(13)-3 - sqrt(13)) + sqrt(26)/sqrt(2) + sqrt(13) + 1. -2sqrt(13) - 2 Simplify (sqrt(133)/(sqrt(7) - (-3sqrt(847) - sqrt(847))))*24. 76/2025 Simplify (sqrt(187) - sqrt(187)21 - sqrt(187))/(-2sqrt(11)-3 + sqrt(11)). -2sqrt(17)/7 Simplify ((sqrt(2016)1)/(-1sqrt(2)-2) + -3)*2. -36sqrt(7) + 261 Simplify 0 + 6(sqrt(13) + sqrt(13)-3). -12sqrt(13) Simplify (sqrt(57) - sqrt(114)/(sqrt(2)-1))/(1sqrt(48)). sqrt(19)/2 Simplify 1-5(0 + sqrt(700)). -50sqrt(7) Simplify ((sqrt(3) - (-1 + sqrt(3)))-5 + (sqrt(3) - (sqrt(243) + 1)))2. 96sqrt(3) + 228 Simplify 1(sqrt(2) - (3 + sqrt(200))). -9sqrt(2) - 3 Simplify 5 + (sqrt(396) - ((sqrt(396) - (-3 + sqrt(396)))*2 + sqrt(396))). -4 Simplify 5(1(sqrt(153)/sqrt(36) + -3 + sqrt(68)))2. -75sqrt(17) + 2305/4 Simplify (sqrt(300) + -2)*2-5. -1520 + 200sqrt(3) Simplify sqrt(4)/(sqrt(162) - (sqrt(162)-2 - sqrt(162)) - sqrt(162)). sqrt(2)/27 Simplify (sqrt(28) + sqrt(56)/(sqrt(10)/sqrt(5)))*2. 112 Simplify -2((1 + sqrt(76)/sqrt(4)3)2 + -1). -342 - 12sqrt(19) Simplify -4 + 0 + -2 + sqrt(11). -6 + sqrt(11) Simplify ((sqrt(396)-1 + sqrt(11))2 - (sqrt(22)/sqrt(2) + -2))2. -2sqrt(11) + 554 Simplify sqrt(30)/(-2sqrt(160)). -sqrt(3)/8 Simplify 5 + -4 + (1sqrt(272) - sqrt(17)). 1 + 3sqrt(17) Simplify ((4 + 2sqrt(171))-3)*2. 432sqrt(19) + 6300 Simplify (sqrt(1800)-2)/(sqrt(384)-1). 5sqrt(3)/2 Simplify (sqrt(15) + (sqrt(15) - (sqrt(15) - sqrt(75)/sqrt(5))))/sqrt(5) + ((sqrt(3) - (sqrt(3) - (3 + sqrt(108))))2 - sqrt(3)). 37sqrt(3) + 117 Simplify (sqrt(156) - (sqrt(156) - (((sqrt(156) - sqrt(156)2) + sqrt(156) + sqrt(156))5 + sqrt(156))))/(2(sqrt(12) + sqrt(108))). 3sqrt(13)/4 Simplify (sqrt(4356)-1)/((sqrt(108) + sqrt(108)2 - sqrt(108))/sqrt(9)) + 3. -11sqrt(3)/2 + 3 Simplify sqrt(91)/((-1sqrt(21) - sqrt(21))/sqrt(3))-3. 3sqrt(13)/2 Simplify (2sqrt(847) - (-5 + -2 + sqrt(7)))2. 294sqrt(7) + 3136 Simplify ((3(1 + sqrt(432)) - sqrt(432)) + sqrt(432) + 5 + sqrt(432) + 0)2. 768sqrt(3) + 6976 Simplify -4(-3 + -2sqrt(475))*2. -7636 - 240sqrt(19) Simplify -6(sqrt(475) - ((sqrt(475) + 1sqrt(475) - sqrt(475))*2 + sqrt(475))). 2850 Simplify sqrt(2057) + (0 + sqrt(2057)1 - sqrt(2057))*2. 11sqrt(17) Simplify -1 + (sqrt(891) + -1)*2. -18sqrt(11) + 891 Simplify -3 + (sqrt(19) + (sqrt(19) + -2)*2 + -3 - (sqrt(19) - (sqrt(171)-1)/sqrt(9))). -5sqrt(19) + 17 Simplify 0 + sqrt(3) + sqrt(3) + -2sqrt(3) + 5. 5 Simplify (sqrt(133)-1)/sqrt(7)-1. sqrt(19) Simplify sqrt(39)/(sqrt(3)1) - sqrt(1573)-3. 34sqrt(13) Simplify (sqrt(132) - ((sqrt(132) - (sqrt(132) + sqrt(132)-1)) + sqrt(132))-4)/(2sqrt(192)). 9sqrt(11)/8 Simplify 0 + (-4 + -5 + -1 + sqrt(5))2. -20sqrt(5) + 105 Simplify -3 + -4sqrt(140)/sqrt(5). -8sqrt(7) - 3 Simplify sqrt(55)/(sqrt(5)1) + (sqrt(11) - -2sqrt(11)-1). 0 Simplify (0 + sqrt(1377))2 + -4. 1373 Simplify -2sqrt(50)/(sqrt(250) - (sqrt(250) + (sqrt(250) - (sqrt(250) + -1sqrt(250) - sqrt(250))))). sqrt(5)/5 Simplify 4 + 1sqrt(1573) - sqrt(1573). 4 Simplify ((sqrt(95) - 1(sqrt(95) + -1sqrt(95) + sqrt(95))) + sqrt(95))/(sqrt(50)/sqrt(40)). 2sqrt(19) Simplify ((sqrt(16) - sqrt(48)/sqrt(3))/sqrt(8) - (sqrt(48)/sqrt(2))/sqrt(12)) + 2sqrt(18)6. 35sqrt(2) Simplify -3sqrt(325) - (-2 + sqrt(208)). -19sqrt(13) + 2 Simplify ((sqrt(63)-1)/sqrt(9)-5)*2. 175 Simplify -2(-4 + sqrt(208))4. -32sqrt(13) + 32 Simplify (sqrt(6050)-1)/(sqrt(160)-1). 11sqrt(5)/4 Simplify (sqrt(130) + (sqrt(130) + sqrt(130)-1)-4)/(1sqrt(250)). sqrt(13)/5 Simplify (sqrt(33)/((sqrt(99)-4)/sqrt(9)))2. 3/16 Simplify (sqrt(9072) - (sqrt(9072) - (sqrt(9072) + (sqrt(9072) + 0)-6)))*2. 226800 Simplify 3(sqrt(6)/sqrt(2) + sqrt(3))1. 6sqrt(3) Simplify -2(sqrt(1872) + 2) - sqrt(1872). -36sqrt(13) - 4 Simplify (sqrt(304) + 0)-4. -16sqrt(19) Simplify ((-1 + sqrt(11))*2 + 3)-45. -300 + 40sqrt(11) Simplify (sqrt(175)4-1)*2 + 1. 2801 Simplify (sqrt(80)/(sqrt(10) + (sqrt(10) - sqrt(160))))/(sqrt(4) + 1sqrt(400)). -sqrt(2)/22 Simplify (sqrt(3) - 2(sqrt(12) - sqrt(3))) + 1(sqrt(3)2)2. -sqrt(3) + 12 Simplify ((sqrt(288) + 1 + 2 - ((sqrt(288)-1 - sqrt(288)) + 1)) + -2)*2. 2592 Simplify -6sqrt(19)-1-1-2. 12sqrt(19) Simplify (sqrt(2) + (sqrt(8) - sqrt(2)))*25 - -6(-2 + sqrt(2))2. -24sqrt(2) + 76 Simplify ((6sqrt(704))/sqrt(4))2. 6336 Simplify (sqrt(243) + 2(0 + sqrt(243)))*2. 2187 Simplify ((sqrt(128) + -4)1)*2. -64sqrt(2) + 144 Simplify sqrt(170)/(sqrt(90)/(sqrt(36)/sqrt(4))). sqrt(17) Simplify 2 + (-2 + sqrt(68)/sqrt(4) - sqrt(17))-11. 4 Simplify (-1sqrt(567))24. 2268 Simplify (-3 + -1sqrt(3))-6. 6sqrt(3) + 18 Simplify (-2 + sqrt(3) + -5)2 + (0 + sqrt(3) + 3)2. -8sqrt(3) + 64 Simplify -3 + (sqrt(117) - (sqrt(117)-2)2). -471 + 3sqrt(13) Simplify 1-44sqrt(19). -16sqrt(19) Simplify -2(3 + sqrt(110)/(1sqrt(10)))*2 + -2. -42 - 12sqrt(11) Simplify -1 + sqrt(425) - (1 + sqrt(34)/sqrt(2))*2. -19 + 3sqrt(17) Simplify 1(sqrt(931) - (sqrt(931)2 + sqrt(931)))*2 - -4(sqrt(931) + 2sqrt(931) + sqrt(931)). 112sqrt(19) + 3724 Simplify ((sqrt(168)/sqrt(4))/sqrt(2))/(sqrt(567)1). sqrt(3)/9 Simplify sqrt(175) + 0 + sqrt(175) + 3. 3 + 10sqrt(7) Simplify sqrt(24)/(-3sqrt(8)) + sqrt(27)/(-2sqrt(9) + sqrt(9)). -4sqrt(3)/3 Simplify (sqrt(8)/(sqrt(4) - sqrt(36)3))*2. 1/32 Simplify sqrt(275) + 2 + 0. 2 + 5sqrt(11) Simplify (2sqrt(24)/sqrt(4))/(sqrt(36)/(sqrt(12) - (sqrt(12) - -2sqrt(12)))). -4sqrt(2) Simplify (sqrt(12) - 4sqrt(48)/sqrt(4))/(sqrt(216)2 + sqrt(216) - sqrt(216)). -sqrt(2)/4 Simplify sqrt(13) + -2 + 3 - (4 + 2 + sqrt(13)). -5 Simplify -1 + (1 + sqrt(1216))-6 + sqrt(1216). -40sqrt(19) - 7 Simplify -1 + (sqrt(128) + 3 + -2)2. 16sqrt(2) + 128 Simplify 2sqrt(2299)3. 66sqrt(19) Simplify sqrt(45)3 + (sqrt(320) + 1)*2 + sqrt(320). 33sqrt(5) + 321 Simplify sqrt(70)/((sqrt(80)-2)/sqrt(8)) + (((sqrt(112) - (sqrt(112) + sqrt(112)-2 + sqrt(112) + sqrt(112)))/sqrt(4))/sqrt(4))*2. -sqrt(7)/2 Simplify (sqrt(6655)-1 + sqrt(55))/sqrt(5). -10sqrt(11) Simplify (5(sqrt(17) + 2) + ((1sqrt(17) - sqrt(17))3 - sqrt(17)))*2. 80sqrt(17) + 372 Simplify (sqrt(45)/(2sqrt(45)/sqrt(5)))2. 5/4 Simplify 1(sqrt(90)/sqrt(2) + sqrt(30)/(sqrt(6) + sqrt(96))). 16sqrt(5)/5 Simplify -6(sqrt(7)2)2 + (sqrt(1008)-3)*2. 8904 Simplify (-2sqrt(2) + 2 - (sqrt(242) + 1)) + -3. -13*sqrt(2) -	{ "pile_set_name": "DM Mathematics" }
t p be u(5). Determine y(p). 2 Suppose -170x + 66 = -159x. Let i be 5 - (-3 - -9 - x). Let f(l) = 3l - 10. Determine f(i). 5 Let t = -2 + 1. Let n = -135 + 138. Let h(o) = -427 - 2o2 + 428 + on + 3o - o + 2o2. Determine h(t). -2 Let t(c) = -c2 + 3c - 4. Let n = 58 - 54. Suppose -4v - n = -v - 2l, -2v - 2l = -4. Suppose -y = w + 1, v = 4y - 3w + 5w - 6. Give t(y). -8 Suppose 0 = -15r - 46492 + 46462. Let s(d) = 2d*2 + 4d*3 + 4 - d - 3d*3 - 3. Give s(r). 3 Let z(k) = -6k*3 + 9k*2 - 7k + 21. Let w(f) = f*3 + 3f*2 - 2f + 7. Let l(a) = 3w(a) - z(a). Let o be -11 - 0/(-1). What is l(o)? -10 Suppose 0 = -d + 3v + 30, 4d - 2v - 11 = 59. Let z(b) = -b2 + 12b + 25. Calculate z(d). -20 Let l(y) = 3y - 4y - 31 - 26 + 53 - 29. Calculate l(-17). -16 Let o(u) = 5u2 + 6u - 4. Let m(k) = -k*2 - k + 1. Let y(d) = -3m(d) - o(d). Suppose 14v = -1424 + 1466. Give y(v). -26 Suppose -15i = -11i - 64. Let z(a) = 19a*3 + 17a*2 - 16a - 1. Let h(b) = -34b3 - 34b*2 + 32b + 2. Let l(d) = -5h(d) - 9z(d). Calculate l(i). -1 Let u(v) = v*2 - 11v + 15. Let a be -9 + (76/57)/(16/252). Give u(a). 27 Let y(j) = -5j3 + 6j*2 - 6j - 70. Let l(r) = -14r3 + 19r*2 - 19r - 198. Let m(c) = -4l(c) + 11y(c). Determine m(9). 31 Let v be (9/3)/((-12)/361). Let z(r) = -5r - 24. Give z(v). 21 Let l be (-42)/(-28)10/(-3). Let f(r) = -r + 8. Let x(t) = 2t - 15. Let y(b) = lf(b) - 3x(b). Calculate y(8). -3 Let g = 24562 - 24568. Let u(j) be the second derivative of j5/20 + j4/2 + j*3/6 + 3j*2/2 - j. Calculate u(g). -3 Let z(h) = 5h*3 - 4h*2 + 12h + 7. Let t(v) = -4v3 + 5v*2 - 9v - 7. Let m(l) = 4t(l) + 3z(l). Give m(8). -7 Let d(h) = h*2 + 7h + 12. Let p be (1 - 0 - 3) + -78 + 74. Calculate d(p). 6 Let l = 136 - 110. Suppose -41r + 43r = l. Suppose -3k - r = -10. Let p(h) = -6h*2 - h - 1. What is p(k)? -6 Let f(q) = 3q + 3. Let u = -8994 + 8993. Determine f(u). 0 Let d be (2/(-9))/1 - (-4070)/90. Let p = -46 + d. Let f(z) = -10z + 1. Calculate f(p). 11 Let b(l) = 9l + 123. Let p be b(-14). Let r(n) = -5n + 4. Determine r(p). 19 Suppose -14c + 23c = -3195. Let j = -349 - c. Let i(n) = -n3 + 7n*2 - 7n + 6. Give i(j). 0 Let u(v) be the third derivative of v6/60 + v5/120 - 38v3/3 - 30v*2 + 2. Let j(m) be the first derivative of u(m). What is j(-1)? 5 Let s(b) = 7b + 1. Let i(y) = -41y2 - 2y - 9. Let n be i(4). Let z = n - -679. Give s(z). 43 Let t(g) = 234g - 1164g + 233g - 3g*2 + 229g - 1 + 231g + 236g. Suppose 5l - 2k = 7, 0 = 2l - l - 5k + 17. Determine t(l). -31 Let y(m) = -m*3 + 5m*2 + 8m - 6. Let t be y(6). Let k(d) = -8d + 8d*2 + 19 - 48 + 18 - 7d*2 + 15. Calculate k(t). -8 Suppose -4h + 5j = -20, 5 = -9h + 10h - 2j. Let z(q) = -2q2 - 3. Give z(h). -53 Let b(d) = -d - 2. Suppose -26 = 4t - 42. Suppose s = 2 - 0, ts = -2n + 2. Let u be (-2)/(-8) + (3/4)/n. Determine b(u). -2 Let j(v) = -v*3 - 7v*2 - 8v - 7. Suppose -3z - 22 = -0z - i, 0 = 4z - 3i + 31. Let t be (z - (-183)/27) + (-86)/18. Determine j(t). -17 Let j(m) = 2m3 - 103m*2 + 98m - 164. Let s(h) = -6h3 + 310h*2 - 293h + 499. Let n(o) = -10j(o) - 3s(o). Determine n(49). -4 Let w(o) = -3o2 - o2 + 5o*2. Let v(u) = 6u*2 - u + 2. Let n(l) = -v(l) + 5w(l). What is n(0)? -2 Let x(t) = -2t3 - 5t*2 - 5t - 3. Let u(h) = h*3 + 8h*2 + 16h + 26. Let c be u(-6). Suppose cv + 6v = -24. Give x(v). 21 Suppose 79o - 47o = 56o + 96. Let r(w) = 27w - 3. Give r(o). -111 Let q(n) = 4n + 19. Let t(g) = -g2 + 14g - 16. Let o be t(6). Suppose -4z - o = 2b, 2b + 5z - 4z + 17 = 0. Give q(b). -5 Let h(z) = -3798 + 7687 + 14z - 3842. Determine h(-15). -163 Let a(m) = -2m3 - 33m*2 - 43m + 22. Suppose 0 = -2i - 735b + 732b - 9, i = 2b - 29. Determine a(i). -8 Let g(x) = -x. Let q(o) = -2o + 9. Let b(t) = -3g(t) + q(t). Let f be 2 + (-23)/(207/54). Calculate b(f). 5 Let r(x) = -18. Let n(w) = -w - 14. Let i(y) = -6n(y) + 2r(y). Calculate i(-10). -12 Let p(c) = c*2 + 16c - 11. Suppose 20 = 4h + r - 104, 2h - r = 68. Suppose 2y + h = -2a + 2, -5a - 79 = 3y. Determine p(a). 6 Let c(w) = -4w - 6. Let z = -1451 - -1453. Calculate c(z). -14 Let a(c) = -c2 + 4c*3 + 8c*2 + 2c + 3c - 20c*2 - 3 + 10c*2. Determine a(1). 3 Let d(s) = -3s - 14. Suppose -224n + 160n = 256. Calculate d(n). -2 Let y(v) = -3v3 - 23v - 26. Let o(k) = 2k3 + k2 + 16k + 18. Let w(h) = -7o(h) - 5y(h). Suppose 4a - 29 = 3b - 8, -a + b + 5 = 0. What is w(a)? -14 Suppose -y + 7 = -2x, 0 = -5y - 3x - 0 - 17. Let c(v) = -7v - 4. Let i(b) = 9 + 4 - 2b - 21 + 7. Let r(f) = c(f) - 4i(f). Give r(y). -1 Let x(j) be the second derivative of -3j2 + 226j + 1/3j3 + 0. Calculate x(4). 2 Let n be 96/(-9)6/(-4). Let o = 9 - n. Let k(m) = 3m - 1. Let p(i) = -4i + 1. Let g(v) = 5k(v) + 4p(v). Give g(o). 6 Let j(x) be the third derivative of -x*6/120 - 13x*5/60 - 4x*4/3 - 10x*3/3 + 1002x2. What is j(-10)? 0 Let i(q) = -q2 - q + 7. Let d(t) = t*2 - 6t - 34. Let f be d(10). Suppose 13p = fp - 35. Give i(p). -13 Suppose a = -3q + 20 + 17, -134 = -5a + 2q. Let g = a + -25. Let x(p) = -p3 + 2p*2 - 3p + 4. Give x(g). -14 Let a(l) be the first derivative of -l6/120 - l5/30 - l*4/6 - 5l*3/3 + 10l*2 + 291. Let u(h) be the third derivative of a(h). What is u(-3)? -19 Let q(o) = o - 5. Suppose -4v = -12 - 0. Suppose -4w + n - 6 = 0, vn - 2 = -2w + 6n. Let y be (36/36)/(w/(-20) - 0). Give q(y). 5 Let m(v) be the first derivative of 11v2/2 - 49v - 5003. Determine m(5). 6 Let a be -20(1/6 - (-10)/48052). Let y(j) = -j - 40. What is y(a)? -15 Suppose -6 = 4k + 4l - 5l, 2k - 3l = 2. Let c be 4(-6)/(-3)1/k. Let i(q) = -2q - 4. What is i(c)? 4 Let t(r) be the second derivative of r*3/2 - 3r*2/2 - 7r. Let o be t(3). Let q(k) = -2k + 6. Let j(d) = -d + 3. Let s(z) = 11j(z) - 6q(z). What is s(o)? 3 Let h be 7 - ((-16)/(-21) - (482 - 483)). Let o(b) = -15b - 53. Determine o(h). -23 Let u(t) be the second derivative of t4/4 + 17t. Let a be ((-836)/32)/11 - (-39)/104. What is u(a)? 12 Let o(l) = -4l3. Let y(s) = 2s + 23. Let n be y(-9). Suppose -2c + nm = -4c - 15, -3m = 5c + 9. Let w(d) = -2d - 1. Let i be w(c). Calculate o(i). 4 Let b(y) be the third derivative of 7/60y5 - 1/6y*3 + 0 + 0y - 125y2 + 1/12y*4. Calculate b(1). 8 Let b be 0 - 4(-3 - (-116)/(-16)). Suppose 5p = -5j + 121 - b, -5p - 48 = -3j. Let o(m) = 10m + 0 - 3m + j - 6m. Give o(0). 16 Let j(w) = w2 + 5w + 6. Let f be j(-5). Let a(y) = -13y. Let o(h) = 2h - 12. Let s be o(9). Let b(k) = -2k. Let z(p) = sb(p) - a(p). Calculate z(f). 6 Let u(q) be the first derivative of -1/3q3 + 1/2q*2 + 65 + 3q. Suppose y - 3y = 0. What is u(y)? 3 Let b be (-3 - (-30)/12)0. Let t(m) = 5m3 - 2m*2 - 2m + 22. Let u(h) = 2h3 - h2 - h + 11. Let f(y) = -3t(y) + 7u(y). Calculate f(b). 11 Let y(l) = -3l2 + l3 - 3l + 2l*3 - 6 + 10 - 12 - 4l*3. Give y(-3). 1 Let o(u) = 15u*2 + 5u - 3. Let q(h) = 7h2 + 2h - 2. Let m(i) = -4o(i) + 9q(i). Calculate m(-3). 27 Let y(h) = h - 8. Let n = -175 - -177. Suppose 11k - 64 = n. Give y(k). -2 Suppose 17 = 3b - 4k - 31, 2b = -3k - 2. Let v(r) = -9 - 3r*2 - 6r + 4r2 - 3r*2 + 3r2. What is v(b)? 7 Let m(x) be the second derivative of -x5/4 + x*4/12 - 3x. Let v be m(-1). Let p(n) = -4n + 5 - 6n + 4n + 3n*2 - 2n*2. Give p(v). 5 Let v(k) = 4k3 - k. Let w(u) = u3 + 13u2 + 9u - 37. Let x be w(-12). Determine v(x). -3 Let q(l) be the first derivative of -2l2 - l - 34. Let u(t) = 7t + 4. Let y be u(1). Suppose -3p = y - 2. Determine q(p). 11 Let i(t) be the third derivative of 1/24t*4 + 0t - 1/30t5 - 4t*2 - 11/6t*3 + 1/360t*6 + 0. Let c(k) be the first derivative of i(k). Calculate c(3). -2 Let t(l) = 11l - 4. Let h be t(-4). Let y = h + 55. Suppose -3f - 2a = -4, 6f = 3f + a + y. Let s(g) = -g*3 + 4g*2 - 3g + 3. Determine s(f). 5 Let q(p) = -24p2 - 31p*2 - 24p*2 - 15 + 8p + 103p2 - 23p2. Let n(x) = -x2 + 20*x - 91. Let j be n(14). Determine q(j). -22 Let c be (-15 +	{ "pile_set_name": "DM Mathematics" }
late 3/((14/4)/(-7)). -6 Evaluate ((-35)/10)/(-7)-6. -3 What is (-11)/331/(-1)? 1/3 Calculate ((-5)/(-5))/(-1)-5. 5 Evaluate (-22)/(8/(-10)). 5 Calculate (-315)/(-30)2/(-6). -7/2 What is (-6)/205(-4)/10? 3/5 Calculate 2/(-4)-1524/(-540). -1/3 Calculate 335/422. 5 (-2)/(-4)(-56)/7 -4 Calculate ((-30)/(-25))/(357/35). 2/17 What is (3/157)/(29/(-145))? -7 Evaluate 9-6(-4)/108. 2 What is the value of 36/8(-476)/(-306)? 7 1/39/6 1/2 What is (16/5)/((-84)/210)? -8 22/(-6)-3 2 ((-1)/(-39))/(1/6) 2/13 Calculate (-48)/(-18)(-9)/6. -4 (-12)/(-2)((-104)/195)/(-4) 4/5 Evaluate 26/(-13)(-6)/(-12). -1 What is (3/(-9))/((-10)/(-40))? -4/3 What is 6/(-4)(-12)/(-162)? -1/9 What is the value of ((-1)/(-5))/((8/12)/(-2))? -3/5 Calculate (-7)/(-35)(-10)/(-12). 1/6 Calculate 270/(-15)3(-1)/(-6). -9 -2(-80)/322/(-10) -1 Evaluate 3/60/(-7). 0 Evaluate (1/27)/((-135)/(-810)). 2/9 Calculate 1/((78/24)/(-13)). -4 What is (6/(-10))/((-1)/22)? 3/5 (1/5)/((-525)/750) -2/7 What is the value of (11/(297/(-18)))/((-3)/(-18))? -4 What is the value of 2/(-6)(-6)/8? 1/4 What is 18/33/(3/(-1))? -6 Evaluate 48/(-54)(-15)/40. 2/9 What is the value of (0/(8/(-2)))/(-1)? 0 Calculate (-3)/5(2/15)/1. -2/25 Evaluate 4(-5)/(-10)(-2)/(-38). 2/19 Evaluate (6/(-6))/(-56/30). 1 What is (3(-4)/54)/(-1)? 2/9 What is ((-1836)/(-12))/17(-2)/(-9)? 2 ((-4)/4)/((-4)/(-4)) -1 What is 5/(-10)(-23)/((-92)/24)? -3 What is -101/2(-8)/180? 2/9 Evaluate (-112)/(-84)(-1)/((-2)/9). 6 (-14)/1272/(-126) 2/3 What is (30/9)/(4/(-6))? -5 What is the value of 619/2855/3? 2/3 Calculate ((-3)/15)/(41/410). -2 What is the value of (30/2)/3-1? -5 ((-2)/(-8))/((-10)/5) -1/8 Calculate ((-49)/147)/((-2)/(-66)). -11 5/(-4)-1(-2)/1 -5/2 What is the value of 2(-5)/(-240)3? 1/8 What is ((-2)/10)/((-20)/200)? 2 What is 76/(-140)15? -3/2 What is the value of ((-1)/(-6))/((38/3)/(-19))? -1/4 What is the value of ((2/(-3))/(-2))/((-3)/45)? -5 What is the value of ((-1)/4)/(105/735)? -7/4 What is the value of (((-16)/40)/(4/(-5)))/(-2)? -1/4 What is the value of (6/(-4))/((-192)/1152)? 9 Calculate (-4)/336/(-144). 1/3 What is the value of -1526/117(-3)/(-2)? -5 What is the value of (-9)/(-30)(-4)/(-2)? 3/5 Evaluate (12/21)/((-430)/301). -2/5 Evaluate ((18/(-8))/(-3))/(396/(-88)). -1/6 What is (201/(-6)-3)/(-2)? -5 What is 24/6(-9)/(-114)? 2/19 What is (64/30)/(-8)5? -4/3 Calculate ((16/3)/4)/((-80)/(-90)). 3/2 Calculate (-2)/(-2)(8/2)/(-4). -1 What is the value of (2/4)/((-1206)/268)? -1/9 Evaluate ((-2)/35)/(1(-2)/(-10)). -2/7 Evaluate (16/20)/(4/(-2))10. -4 (24/72)/(1/15) 5 What is (-5)/60-21? 1/6 Calculate ((-135)/675)/(18/40). -4/9 12/8(-2)/15-5 1 What is (2/(-6)3)/(5/(-10))? 2 (((-3)/4)/(-1))/((-8)/(-32)) 3 Evaluate (6/4)/((-22)/(-11)). 3/4 Calculate ((15/(-9))/5)/(2/2). -1/3 Evaluate (2/(-8))/(11/44)7. -7 What is the value of 10(-7)/14-1? 5 What is the value of ((-4)/3)/((-184)/138)? 1 Calculate (9/(-5))/((-105)/(-175)). -3 What is 1/(-3(-16)/(-36)-1)? 3/4 What is 42/(-35)(-5)/(-3)? -2 What is (42/(-56))/((-5)/4)? 3/5 Calculate (15/3)/(45/54). 6 What is 1(-5)/(-175)5? 1/7 Calculate 12/(-84)-144. 8 (1/(-8))/(15/(-480)40) 1/10 ((-24)/16)/((-14)/4) 3/7 (-3)/(((-20)/5)/(-4)) -3 What is the value of -6(-20)/(-3)(-22)/176? 5 Calculate (-23/30)/(-1). 1/5 What is the value of (0/3)/((-5)/1)? 0 What is (10(-4)/8)/((-115)/161)? 7 What is the value of (-69)/115(-15)/(-18)? -1/2 Evaluate (14/(-14))/((-7)/(-21)). -3 (6/18)/((-2)/(-3)) 1/2 Evaluate -64/(-66)(-8)/16. -2/11 (12/(-42)(-14)/4)/(-3) -1/3 (-3)/((30/35)/(8/7)) -4 Evaluate ((2/(-1))/2)/(41/41). -1 ((-3)/(-18)1)/((-53)/(-530)) 5/3 What is the value of ((-182)/13)/(3/(9/(-6)))? 7 Evaluate -2(4/2)/((-252)/21). 1/3 (-6)/((-21)/(-7))2/(-12) 1/3 Calculate 36/(-20)(-100)/(-60). -3 What is -22(-4)/4? 4 Evaluate (10(-22)/165)/((-2)/6). 4 What is the value of (4/(-2))/(110/25)? -5 What is 2((-3)/36)/(-1)? 1/6 What is the value of (-31)/279(-6)/(-5)? -2/15 What is ((-6)/135)/(2/10)? -2/9 (-2)/(-2)(-3)/(-6) 1/2 Calculate (-152)/(-114)6/20. 2/5 What is the value of 6/(-30)(-3)/(-36)-10? 1/6 (-252)/448(-8)/(-6) -3/4 (-3)/(-21)(-45)/(-15) 3/7 Evaluate ((-4)/483)/((-14)/(-21)). -3/8 What is (-4)/(-2)-3(-21)/(-18)? -7 Calculate (330/(-12))/11(-36)/15. 6 What is (12/(-18)2)/10? -2/15 (0/(-4))/((-9)/3) 0 What is 3/(-2(-6)/(-8))? -2 What is the value of (2/160)/2? 0 What is the value of -5(-6)/101/7? 3/7 What is the value of 1(6/6)/(15/(-3))? -1/5 (3/(27/(-6)))/(4/6) -1 Calculate (20/(-12))/(4/6). -5/2 Evaluate 2/3642/(-14). -1/6 What is the value of (-756)/(-180)(-15)/(-9)? 7 20/162/(-5) -1/2 Calculate 4/(((-48)/(-20))/3). 5 258/(-80)2 -5 ((-3)/6)/((-3)/(-18)3) -1 Evaluate 10/(-15)126/(-14). 6 Calculate (12/5)/((162/(-90))/(-3)). 4 What is 10((-99)/(-88))/9? 5/4 What is (-18)/48(-120)/36? 5/4 ((-45)/(-125))/((-30)/(-25)) 3/10 What is the value of (1/(-2))/(15/(-6))? 1/5 Calculate (-10)/(-2)(25/5)/5. 5 What is 2/(((-4)/15)/((-74)/(-111)))? -5 What is the value of 118/59(-14)/4? -7 What is the value of ((-10)/4)/(((-15)/(-6))/5)? -5 (24/14)/(2/71) 6 What is the value of 2(-15)/((-270)/63)? 7 Calculate (-7)/(42/(-8))3. 4 What is the value of (6/9)/(((-1)/(-6))/1)? 4 (3/((-126)/16))/(44/(-66)) 4/7 (252/16)/21-4 -3 What is the value of (6/35)/((-65)/455)? -6/5 11/((-110)/80)(-2)/(-2) -8 Evaluate 20/878/65. 3 Evaluate (((-48)/(-9))/4)/(1/3). 4 Evaluate -2(-2)/((-2)/(-1)). 2 What is ((-1)/(-1))/(1/(-1))? -1 What is the value of 1/2(-6)/((-60)/5)? 1/4 Evaluate (((-945)/(-14))/(-15))/((-2)/4). 9 Evaluate (4/(-8)0/7)/2. 0 What is the value of (-4)/3216? -3/4 What is the value of (2/(-5))/((-10)/2256)? 3/2 Calculate 8/(-6)(-159)/106. 2 What is the value of ((-28)/(-120))/(-7)-6? 1/5 (-4)/(-1)4/16 1 Evaluate 15(-2)/(-70). 1/7 What is (15/40)/((-3)/(-6))? 3/4 What is (4/(-8))/((-12)/(-12))? -1/2 What is the value of 8/29/120-2? -3/5 Calculate 10/327/(-18). -5 6/(-44)(-8)/(-2) -6/11 (-19)/(38/15)4/6 -5 What is (-35)/10(-198)/1155? 3/5 Calculate 462/35423/((-9)/2). -2/23 (20/(-8))/(230/(-46)) 1/2 12177/(-118) -3 What is ((-4)/6)/(39/(-9))? 2/13 What is ((-252)/(-54))/((-2)/(-3))? 7 Calculate (12)/((-328)/287)4. -7 What is the value of (8/(-6))/((-12)/(-36))? -4 (-18)/(-45)(-11)/(-11) 2/5 What is ((-3)/24-2)/((-54)/(-1512))? 7 Calculate (-5)/(55/(-11))-2. -2 Evaluate ((-10)/((-20)/(-6)))/(1/1). -3 What is the value of ((-18)/45)/((2/20)/1)? -4 Evaluate 6/6(-3)/(-3). 1 What is the value of ((-2)/((-8)/2))/(-8)? -1/16 What is (-496)/(-434)7/(-6)? -4/3 Calculate (6/121)/(-2). -1/4 Evaluate 34/1840/16. 5/3 What is 4/5(-6)/12? -2/5 15/(-2)216/270 -6 Calculate 12/811/22. 3/4 ((-6)/4)/(-3)180/(-18) -5 Calculate (-36/63)/1. -2/7 What is ((-5)/((-45)/(-3)))/((-1)/(-1))? -1/3 (1/18)/((-155)/(-465)) 1/6 Calculate 141/188(-64)/(-6). 8 What is ((-7)/((-42)/(-9)))/((-6)/(-12))? -3 Calculate 9/1623/(-1). -1/6 What is ((-2)/6)/((-176)/96)? 2/11 Calculate 68/17010/(-4). -1 What is (-2)/16410/(-25)? 1/5 What is the value of (0/(-2))/((-3)/1)? 0 (-309)/(-206)8/66 2/11 -1(28/7)/12-18 6 What is the value of 12(-4)/(-64)-4? -3 Calculate (10/(-25))/(6/(-5)). 1/3 Calculate 15273/219. 10 What is the value of -10-72/(-28)? -5 What is ((-10)/(50/15))/(3/6)? -6 Evaluate (-3)/(-99)3-2. -2/11 Evaluate (18/121)/3. 1/2 What is the value of 12/9(-15)/(-10)? 2 What is the value of ((-2)/(24/(-2)))/((-50)/60)? -1/5 Calculate ((-280)/(-385))/((-12)/(-9)). 6/11 What is 44/(-33)(-27)/6? 6 What is 1(-8)/(-8)1? 1 What is the value of ((-6)/(-2))/(6/(-36)-6)? 3 Calculate (-28)/32264/99. -7/3 What is the value of (-6)/11(-7)/84-4? -2/11 Evaluate (-1)/(-2)6/9. 1/3 Evaluate (-2)/((3/(-4))/((-36)/(-32))). 3 Evaluate 25/(-10)16/(-4). 4 Calculate (-2)/(4/3)(-5)/(-30). -1/4 Evaluate 1/(-3)(-198)/(-165). -2/5 5-45/(-20) 5 ((-30)/(-25))/((-28)/20) -6/7 Calculate ((-65)/(-273))/((-10)/(-6)). 1/7 What is the value of (4/564)/((-3)/(-42))? 4 75/(-30)4/(-5) 2 Evaluate (-6)/21(-56)/(-8). -2 Evaluate 5/((-20)/4)6/(-14). 3/7 What is ((-21)/(-28)1)/(21/(-12))? -3/7 What is the value of ((-2)/8)/(21/8)? -2/21 Calculate 3(-100)/350(-14)/6. 2 What is ((-1)/((-6)	{ "pile_set_name": "DM Mathematics" }
e 5) to base 7 2615122 Convert -454146 (base 7) to base 8. -235460 Convert 13add (base 15) to base 14. 1906c What is -263125 (base 7) in base 2? -1011111111011101 2076346 (base 8) to base 6 15531142 What is 113321130330 (base 4) in base 8? 27713474 Convert -511501 (base 7) to base 4. -111033301 10e3f (base 16) to base 14 1b2d9 -1221100121 (base 3) to base 6 -452411 What is 5b98 (base 15) in base 16? 4c25 Convert 531312 (base 7) to base 12. 45109 2ac3c (base 15) to base 12 67879 What is -31122101 (base 5) in base 8? -761273 -1013220101 (base 4) to base 16 -47a11 Convert -43100 (base 10) to base 8. -124134 Convert -33137 (base 11) to base 9. -72848 Convert 760537 (base 9) to base 13. 12b347 What is -342683 (base 9) in base 7? -1513602 Convert -358a41 (base 15) to base 8. -11611061 -143253555 (base 6) to base 15 -3d7a68 -623657 (base 12) to base 11 -962507 3b6873 (base 12) to base 6 33045423 Convert -11000111100001111110111 (base 2) to base 11. -37662a7 -399a2 (base 11) to base 13 -1ccb7 Convert -971289 (base 10) to base 4. -3231020121 1bee6 (base 16) to base 13 400c6 What is -10101000000100010111 (base 2) in base 14? -13cc3d What is -4027000 (base 8) in base 16? -102e00 -250510343 (base 6) to base 14 -8ccdb9 -14ccb7 (base 16) to base 2 -101001100110010110111 -1199995 (base 12) to base 15 -47dbbb Convert -1002202 (base 4) to base 12. -256a What is -1c782a (base 15) in base 4? -11103323110 Convert -145637 (base 14) to base 3. -1022220001012 Convert -1054225 (base 7) to base 14. -35b15 -110000100011001100010 (base 2) to base 6 -54033110 -1447177 (base 10) to base 11 -8a9316 What is -7a48 (base 16) in base 9? -46842 Convert 115061156 (base 7) to base 9. 14470705 -f77e0 (base 16) to base 14 -1c5612 What is 1401647 (base 14) in base 13? 201127a Convert 282520 (base 9) to base 11. 108639 Convert -2560034 (base 7) to base 13. -b8bc2 What is 32ba2 (base 15) in base 16? 275e4 What is 5d71d2 (base 16) in base 2? 10111010111000111010010 Convert 96865 (base 13) to base 2. 1000010010100110010 What is 48695 (base 13) in base 11? 9098a -320e67 (base 15) to base 7 -26152264 1131103 (base 7) to base 15 2c154 Convert -15744686 (base 10) to base 14. -213bc06 Convert 103091 (base 13) to base 8. 1342222 Convert -1240311100 (base 5) to base 12. -1035141 -2101211120112 (base 3) to base 14 -25310d Convert -1712a (base 12) to base 14. -c05c -828229 (base 12) to base 15 -2a6483 Convert 335cc (base 13) to base 12. 45b9b What is 27544e (base 15) in base 9? 3501832 What is -2931c3 (base 14) in base 9? -2618518 What is -1052355 (base 6) in base 2? -1101000111001111 What is 5ac6b (base 16) in base 10? 371819 What is 9a112 (base 11) in base 15? 2d05d -154569 (base 10) to base 3 -21212000210 What is 18114584 (base 10) in base 3? 1021002022112112 87877 (base 9) to base 7 331666 -105b36 (base 13) to base 11 -242707 What is 1e71f (base 16) in base 2? 11110011100011111 What is 313020003 (base 4) in base 8? 671003 What is -898937 (base 10) in base 16? -db779 Convert -2dd6 (base 16) to base 6. -130154 3b5b67 (base 13) to base 12 595a97 What is 10211110212 (base 3) in base 10? 75434 What is -f9814 (base 16) in base 15? -152c17 Convert 211341233 (base 5) to base 15. 127c7d 204493 (base 12) to base 4 1323112233 Convert 2010351 (base 8) to base 3. 222212010102 -16114410 (base 7) to base 15 -2094d0 Convert 210243441 (base 5) to base 13. 2454a0 Convert 1101110111111011 (base 2) to base 4. 31313323 10312 (base 10) to base 11 7825 What is 2855378 (base 9) in base 4? 11333303012 -10212312133 (base 4) to base 2 -100100110110110011111 23110343 (base 8) to base 7 60436143 Convert -4383a6 (base 16) to base 13. -bbbc1c -1718911 (base 12) to base 8 -22130035 What is -17cba9 (base 13) in base 5? -123141312 What is c0848d (base 14) in base 5? 3124223444 -5634461 (base 7) to base 5 -134313101 Convert b599a3 (base 13) to base 12. 150a71b Convert -15f70e (base 16) to base 10. -1439502 10205122 (base 6) to base 2 1001000011010101010 212151 (base 7) to base 6 442150 Convert c8a30b (base 14) to base 9. 13687086 1001220102021220 (base 3) to base 10 15360972 What is -4505532 (base 6) in base 5? -24224114 Convert 100110101100111101100100 (base 2) to base 10. 10145636 1000032 (base 8) to base 12 107876 What is 5ddc1 (base 14) in base 2? 111000010001000101 Convert 414123403 (base 5) to base 2. 110100000111111001010 What is -c3b17 (base 16) in base 15? -10c774 Convert -71273b (base 14) to base 11. -2172645 229404a (base 12) to base 15 8b9451 -673320 (base 8) to base 7 -1633610 What is -2d7583 (base 15) in base 16? -219894 -32586 (base 12) to base 7 -364560 -14470 (base 10) to base 2 -11100010000110 Convert 2062545 (base 7) to base 12. 101090 31466 (base 11) to base 13 17b0b Convert 9b727 (base 12) to base 6. 4232451 What is -35c74 (base 15) in base 13? -6011b -34 (base 11) to base 12 -31 What is -312283 (base 9) in base 3? -100102022210 What is -4402102 (base 9) in base 15? -31a46b What is -20002120111 (base 3) in base 6? -2323234 What is 2186d (base 16) in base 9? 228333 Convert -2771604 (base 8) to base 3. -1110210101202 What is 360c14 (base 15) in base 10? 2584594 What is 3122332 (base 5) in base 12? 25a34 Convert -101110011010111001 (base 2) to base 14. -4d413 -a037b (base 14) to base 9 -645828 Convert -4471714 (base 10) to base 2. -10001000011101110100010 Convert 1287815 (base 10) to base 8. 4723207 Convert -556634 (base 7) to base 15. -1e262 What is -9b3818 (base 16) in base 9? -21123861 Convert 87bbc (base 14) to base 8. 1202232 100112022021 (base 3) to base 11 118a24 Convert aba5a (base 12) to base 3. 102120120221 -41130021 (base 6) to base 4 -10133213131 Convert 23333 (base 8) to base 5. 304242 Convert 741724 (base 10) to base 3. 1101200110021 -14452562 (base 7) to base 9 -2524222 32203032212 (base 4) to base 9 7153222 Convert 132302200 (base 4) to base 8. 366240 -12050 (base 12) to base 11 -17248 What is -139665 (base 13) in base 2? -1110100101010010110 What is -527701 (base 11) in base 14? -17db9c Convert -17245010 (base 8) to base 11. -22a3849 Convert -16230775 (base 9) to base 14. -111179d Convert -606375 (base 15) to base 10. -4577285 Convert -985c (base 15) to base 3. -1122020220 -101101200020 (base 3) to base 10 -204612 What is 1278303 (base 9) in base 15? dcce9 -62314 (base 9) to base 6 -514104 -20588 (base 12) to base 3 -2011000112 -a8da3 (base 14) to base 7 -3321563 a8d2a (base 16) to base 6 22453214 Convert 4e20 (base 16) to base 7. 112211 Convert -34da7 (base 15) to base 3. -22120002011 -1002123 (base 4) to base 5 -114001 32202130 (base 4) to base 2 1110100010011100 What is -100120101202 (base 3) in base 14? -4c912 What is 53882 (base 10) in base 8? 151172 What is -1145101000 (base 6) in base 3? -220200110222000 -149491 (base 10) to base 4 -210133303 Convert -3a9c9 (base 13) to base 11. -7516a Convert -73828 (base 12) to base 10. -151520 Convert -42c54a (base 14) to base 9. -4227016 Convert -10301322013 (base 4) to base 12. -505147 -1162135 (base 7) to base 9 -247217 -1001110101111010100 (base 2) to base 9 -541361 -123230200011 (base 4) to base 15 -986260 101020120001201 (base 3) to base 12 19a6201 -302350205 (base 6) to base 5 -2310141140 Convert 5768b0 (base 12) to base 2. 101010110000010000100 Convert 304242044 (base 5) to base 2. 100101111100100000111 Convert 27db0 (base 14) to base 7. 560610 Convert -2247404 (base 9) to base 5. -302301110 What is 463072 (base 8) in base 3? 21222200210 4013334 (base 9) to base 16 209302 -14812673 (base 9) to base 4 -130030020000 Convert -1e198 (base 15) to base 2. -10111111111000011 -3159a4 (base 11) to base 14 -d23c0 Convert -2445513 (base 6) to base 7. -1053354 What is -134530 (base 7) in base 13? -b89c -3512443 (base 11) to base 14 -b5ab24 -110002101000 (base 3) to base 16 -3a164 Convert -1703293 (base 11) to base 16. -2c4cd7 Convert -22222022312 (base 4) to base 11. -1639331 37f97 (base 16) to base 7 1643300 -ca5a2 (base 13) to base 10 -365679 2a89146 (base 11) to base 10 5282910 -4a1ad (base 15) to base 6 -5023314 What is -240998 (base 10) in base 6? -5055422 What is 35146551 (base 7) in base 14? 5a5328 -3718139 (base 11) to base 13 -1455a25 3449a95 (base 12) to base 6 555251105 -43401602 (base 8) to base 14 -1343aa6 Convert 65148 (base 10) to b	{ "pile_set_name": "DM Mathematics" }
579 List the prime factors of 107169614. 2, 19, 373, 7561 What are the prime factors of 4733258927? 43, 110075789 List the prime factors of 8632881947. 59, 2153, 67961 List the prime factors of 449856837. 3, 2459, 20327 List the prime factors of 76766861. 89, 467, 1847 What are the prime factors of 904962511? 61, 431, 34421 What are the prime factors of 976499476? 2, 2647, 92227 What are the prime factors of 25030713? 3, 8343571 List the prime factors of 81950494. 2, 631, 64937 List the prime factors of 44115842. 2, 22057921 List the prime factors of 73384527. 3, 3499, 6991 List the prime factors of 640031374. 2, 8237, 38851 List the prime factors of 40313421. 3, 19, 235751 List the prime factors of 26026814. 2, 11, 47, 25171 What are the prime factors of 55151764? 2, 13787941 What are the prime factors of 232878400? 2, 5, 145549 List the prime factors of 87924734. 2, 43962367 What are the prime factors of 203279077? 203279077 What are the prime factors of 32041492? 2, 7, 163477 List the prime factors of 260702133. 3, 79, 1100009 What are the prime factors of 11438347? 11438347 List the prime factors of 100400370. 2, 3, 5, 7, 19, 25163 What are the prime factors of 42916262? 2, 17, 73, 17291 What are the prime factors of 131066356? 2, 283, 115783 What are the prime factors of 98655199? 17, 5803247 List the prime factors of 59862270. 2, 3, 5, 13, 17, 9029 What are the prime factors of 6394435696? 2, 11, 79, 41809 List the prime factors of 35205506. 2, 7, 2514679 List the prime factors of 98832147. 3, 149, 221101 List the prime factors of 91073192. 2, 7, 23, 70709 List the prime factors of 14205263. 241, 58943 What are the prime factors of 126983158? 2, 743, 85453 List the prime factors of 76587323. 76587323 What are the prime factors of 1118753084? 2, 3701, 75571 List the prime factors of 7416425381. 1117, 6639593 What are the prime factors of 2096466213? 3, 19, 37, 79, 12583 What are the prime factors of 3066096420? 2, 3, 5, 23, 740603 What are the prime factors of 4173207998? 2, 23, 317, 541 What are the prime factors of 1019131088? 2, 5987, 10639 What are the prime factors of 75912014? 2, 587, 64661 List the prime factors of 1964672770. 2, 5, 19, 173, 59771 What are the prime factors of 234660811? 7, 11, 19, 160397 List the prime factors of 117430275. 3, 5, 1565737 List the prime factors of 937010856. 2, 3, 71, 191, 2879 What are the prime factors of 20377655? 5, 23, 79, 2243 What are the prime factors of 967186614? 2, 3, 161197769 What are the prime factors of 4316458? 2, 19, 113591 List the prime factors of 2803202088. 2, 3, 19, 6147373 What are the prime factors of 506226687? 3, 2053, 82193 List the prime factors of 118997873. 1069, 111317 List the prime factors of 103056267. 3, 61, 563149 List the prime factors of 711444937. 7, 101634991 List the prime factors of 972461414. 2, 486230707 List the prime factors of 141857859. 3, 11, 13, 23, 1307 List the prime factors of 412663799. 83, 563, 8831 List the prime factors of 2116296935. 5, 17, 101, 246511 What are the prime factors of 199617290? 2, 5, 19961729 List the prime factors of 406275228. 2, 3, 113, 99871 What are the prime factors of 1196631269? 2477, 483097 List the prime factors of 208772181. 3, 43, 179821 What are the prime factors of 119504164? 2, 13, 181, 12697 What are the prime factors of 2159436111? 3, 7, 521, 197371 List the prime factors of 3925078892. 2, 7, 23, 29, 73, 2879 What are the prime factors of 33284147? 13, 17, 150607 What are the prime factors of 711233821? 19, 5783, 6473 What are the prime factors of 2368545951? 3, 789515317 What are the prime factors of 236098071? 3, 11, 88327 List the prime factors of 564595062. 2, 3, 37, 2543221 What are the prime factors of 110774196? 2, 3, 13, 257, 307 List the prime factors of 154457790. 2, 3, 5, 1759, 2927 List the prime factors of 7678706324. 2, 31, 1193, 51907 What are the prime factors of 670330616? 2, 83791327 What are the prime factors of 880052220? 2, 3, 5, 23, 212573 List the prime factors of 117576800. 2, 5, 11, 31, 431 List the prime factors of 251938300. 2, 5, 17, 148199 What are the prime factors of 1056007150? 2, 5, 11, 1920013 List the prime factors of 240902062. 2, 120451031 What are the prime factors of 1164372250? 2, 5, 19, 245131 List the prime factors of 130560971. 47, 827, 3359 List the prime factors of 4656526185. 3, 5, 17, 18260887 What are the prime factors of 158644890? 2, 3, 5, 1762721 What are the prime factors of 4254993613? 13, 47, 89, 463 What are the prime factors of 840800415? 3, 5, 7, 13, 615971 List the prime factors of 3898324318. 2, 7, 4937, 56401 List the prime factors of 1019411843. 31, 32884253 What are the prime factors of 4129441? 19, 217339 What are the prime factors of 55876123? 55876123 What are the prime factors of 3278799728? 2, 857, 239119 What are the prime factors of 4060763525? 5, 7, 13, 254993 List the prime factors of 837893891. 837893891 List the prime factors of 238522573. 131, 1820783 List the prime factors of 60841779. 3, 20280593 What are the prime factors of 341706566? 2, 67, 1427, 1787 What are the prime factors of 37413043? 211, 233, 761 List the prime factors of 61688636. 2, 31, 443, 1123 What are the prime factors of 25648818? 2, 3, 13, 17, 23, 29 What are the prime factors of 7598360541? 3, 79, 32060593 List the prime factors of 1106999239. 14657, 75527 What are the prime factors of 27136356? 2, 3, 13, 197, 883 What are the prime factors of 2106035548? 2, 17, 30971111 What are the prime factors of 7477120? 2, 5, 7, 1669 What are the prime factors of 338306399? 338306399 List the prime factors of 4705364302. 2, 2352682151 What are the prime factors of 564322705? 5, 19, 37, 181, 887 What are the prime factors of 69468742? 2, 7, 4962053 List the prime factors of 150143501. 150143501 List the prime factors of 1055269141. 23, 1409, 32563 List the prime factors of 121700316. 2, 3, 1193, 8501 List the prime factors of 356472768. 2, 3, 23, 89, 907 What are the prime factors of 60116736? 2, 3, 78277 What are the prime factors of 107877248? 2, 842791 What are the prime factors of 429460041? 3, 143153347 What are the prime factors of 335499134? 2, 59, 2843213 What are the prime factors of 452502515? 5, 17, 29, 183571 What are the prime factors of 19304341? 7, 241, 11443 What are the prime factors of 270146877? 3, 7, 11, 13, 89959 List the prime factors of 131950685. 5, 17, 677, 2293 What are the prime factors of 3969927461? 4957, 800873 What are the prime factors of 176789601? 3, 983, 6661 What are the prime factors of 72813791? 23, 67, 47251 What are the prime factors of 61690046? 2, 11, 59, 47527 What are the prime factors of 681852775? 5, 431, 63281 What are the prime factors of 6602762649? 3, 7, 4007, 78467 List the prime factors of 49419692. 2, 7, 71, 24859 What are the prime factors of 1416128806? 2, 708064403 What are the prime factors of 316976704? 2, 11, 89, 5059 What are the prime factors of 23596950? 2, 3, 5, 13, 12101 List the prime factors of 52104432. 2, 3, 1085509 What are the prime factors of 14846110? 2, 5, 269, 5519 List the prime factors of 1148018482. 2, 13, 44154557 What are the prime factors of 211399004? 2, 52849751 List the prime factors of 793683055. 5, 11, 14430601 List the prime factors of 202454949. 3, 383, 176201 List the prime factors of 151167930. 2, 3, 5, 5038931 What are the prime factors of 773730619? 877, 882247 What are the prime factors of 349464814? 2, 283, 617429 List the prime factors of 9144782800. 2, 5, 17, 1344821 List the prime factors of 43828416. 2, 3, 76091 What are the prime factors of 24772250? 2, 5, 99089 List the prime factors of 20347782. 2, 3, 7, 13, 83, 449 What are the prime factors of 130794761? 130794761 What are the prime factors of 1882411082? 2, 941205541 What are the prime factors of 55773829? 149, 374321 What are the prime factors of 802154081? 83, 557, 17351 List the prime factors of 297303014. 2, 23, 6463109 List the prime factors of 824358825. 3, 5, 109, 33613 What are the prime factors of 62927630? 2, 5, 59, 106657 What are the prime factors of 6143328509? 179, 2437, 14083 List the prime factors of 156223004. 2, 7, 71, 78583 List the prime factors of 83144826. 2, 3, 1539719 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
at is the smallest value in -0.035712, -1, -2/15, -3/7, 1/6? -1 What is the fifth smallest value in -2/21, -2/13, 665, 4, -0.3, 3/2? 4 What is the biggest value in -1/11, -0.5, -4, -33? -1/11 What is the fourth smallest value in -2, -208/19, 1, -0.2, -1, 2/17? -0.2 What is the second biggest value in -17, -0.3, 0.1, -142? -0.3 Which is the third smallest value? (a) -16.3 (b) -2/27 (c) -11 (d) 2/3 b What is the smallest value in -2.1, 4, -2, -0.3, 4/97, 3/34? -2.1 Which is the third biggest value? (a) 5 (b) 1 (c) 2 (d) -5 (e) -1/12 b What is the third biggest value in -0.1, -2/5, -3/19, -1/15, -2.96? -3/19 What is the fourth biggest value in 2/23, -0.4, 9, -546? -546 Which is the third smallest value? (a) -4/3 (b) 3/28 (c) 0.4 (d) -1 (e) -8 d What is the second biggest value in 4, -0.4, 140, -1? 4 Which is the biggest value? (a) 7 (b) -0.3 (c) -0.1 (d) -23 a What is the second smallest value in 2/13, 227/4, 0.2? 0.2 Which is the third smallest value? (a) 2/13 (b) -322 (c) -1/3 (d) -0.6 (e) 2 c What is the third biggest value in -1.339, -15, 0? -15 Which is the second smallest value? (a) -86 (b) -94 (c) 0.4 (d) 73 a What is the fourth biggest value in 1/20, -3, 5, 38, -1.1? -1.1 Which is the fourth smallest value? (a) -5 (b) 54/25 (c) 5 (d) -11 (e) 1 b What is the third biggest value in 0, -0.2, 0.1, 5.593? 0 Which is the fourth biggest value? (a) 0.3 (b) -2/19 (c) 23 (d) 1/5 b What is the fifth smallest value in -34, -1, -2, -0.2, 0.9? 0.9 What is the second biggest value in 2/22655, -36, 1/2? 2/22655 What is the biggest value in -3/4, -2/21, 0.55, 2.8, 2/11? 2.8 Which is the third smallest value? (a) 259.9 (b) -5 (c) 7 (d) 0.4 (e) -0.5 (f) -1/5 f What is the third biggest value in 7, -21, -19, -4? -19 Which is the third smallest value? (a) 1 (b) -1 (c) -4/11 (d) 0.2 d Which is the fourth biggest value? (a) -12 (b) -4 (c) -3 (d) -2 (e) -1/12 b Which is the smallest value? (a) 5 (b) 2 (c) 0 (d) 0.04627 (e) -3 (f) 0.4 e Which is the third biggest value? (a) -1 (b) -78 (c) 5 (d) -7 d Which is the smallest value? (a) -26 (b) 309 (c) -4/9 (d) 1 (e) -1/8 (f) -2 a What is the second smallest value in 564, 0.45, 0.5? 0.5 What is the sixth biggest value in -7, 1, -933, -0.4, -2, 3? -933 What is the second smallest value in 0.2, 51.46, 5? 5 Which is the fifth biggest value? (a) -5 (b) 3 (c) -30 (d) 2/67 (e) 2 (f) 1 a What is the biggest value in 0.5, 18, 3, -13/5? 18 Which is the second biggest value? (a) 342 (b) 1/10 (c) -1/6 b Which is the third biggest value? (a) 0.3 (b) 6/5 (c) -1 (d) 2/9 (e) -4 d What is the biggest value in -0.4, -1, 6, 2/95, 4, 5? 6 What is the fifth biggest value in -4.23, -323, -0.2, -0.1, -3/4? -323 Which is the second smallest value? (a) 0.3 (b) 4 (c) 13027 b What is the second smallest value in 1, 4, -1/71586? 1 Which is the third smallest value? (a) 2/5 (b) 2/18525 (c) -0.9 a Which is the third biggest value? (a) -3 (b) 2 (c) -31010 c Which is the second smallest value? (a) 0.02 (b) 2668/7 (c) 3/4 (d) 0.07 d Which is the third biggest value? (a) -8147 (b) 0.27 (c) 4 a Which is the smallest value? (a) -2 (b) 124 (c) -85 c Which is the third biggest value? (a) 13 (b) -4 (c) 0.0654 (d) -2 d What is the third biggest value in -0.08, 0.7, -2.02? -2.02 Which is the sixth biggest value? (a) -1/22 (b) 2 (c) 1 (d) 0.5 (e) 38 (f) -0.04 a What is the biggest value in -95, 206/7, 1/4, 4? 206/7 What is the fifth biggest value in 5, -6/13, -0.5, 13, -5? -5 Which is the fifth smallest value? (a) -3/22 (b) -13 (c) 2/9 (d) 0.9 (e) 2/17 (f) -10 c What is the second biggest value in 308, 0.254, 0.5? 0.5 What is the third smallest value in 2, 0.4, 0.16, -818? 0.4 What is the third biggest value in 0.5, -81, -0.04, -1/6, 28, -3/5? -0.04 Which is the second biggest value? (a) -0.13 (b) 0.4 (c) 1/8 (d) -2/37 (e) 1/2 (f) -21 b What is the second biggest value in 3, -152, -5, 2/2577? 2/2577 What is the biggest value in 140, 5, -0.1? 140 What is the biggest value in 124/3, -0.2, -8, -10? 124/3 Which is the fourth biggest value? (a) 1.6 (b) -8081 (c) 2/9 (d) 1/3 b Which is the third smallest value? (a) -3 (b) -2 (c) 4275534 c What is the second biggest value in 98, -0.2, -149/7? -0.2 Which is the fourth biggest value? (a) 0.0881 (b) 0 (c) 6 (d) -1 d Which is the second biggest value? (a) -5 (b) -2/7 (c) -4 (d) 1/6 (e) -34 b What is the third smallest value in 90, 0.2, -0.2, -199? 0.2 What is the second biggest value in -0.645, 3, 119? 3 Which is the second smallest value? (a) -36 (b) -17.02 (c) 4 b What is the third smallest value in 1398, -5, -1/2, -0.2, -4, -0.4? -1/2 What is the third biggest value in -0.3, -0.1, 386? -0.3 Which is the fourth biggest value? (a) -5/2 (b) -4 (c) 0 (d) 19 (e) 3 (f) 0.02 c What is the third biggest value in -0.05, 0.4, -6, 26/7? -0.05 Which is the third smallest value? (a) -30.5 (b) -5 (c) 13605 c What is the fifth smallest value in 1, -0.09, -2/5, 1/9, 3, -0.39? 1 What is the second biggest value in 1/5321, 4, -0.24? 1/5321 What is the smallest value in -86, -3, 1? -86 What is the third smallest value in -0.4, -0.3, -53, 2? -0.3 Which is the biggest value? (a) 31 (b) 4/2503 (c) -5 a Which is the biggest value? (a) 43 (b) 22866 (c) -0.1 b What is the third biggest value in 0, 4, 2/7, 13732? 2/7 Which is the second biggest value? (a) -1 (b) -0.02 (c) -0.25 (d) -5/13 c Which is the third biggest value? (a) -1/3 (b) 0.1103 (c) 7 a Which is the fifth smallest value? (a) 1/4 (b) -5 (c) 14 (d) -1/189 (e) 4 c Which is the third biggest value? (a) 0 (b) -5 (c) 2 (d) 9/8 a Which is the second biggest value? (a) -3 (b) 4 (c) -2/173 (d) 7 (e) -2/7 b Which is the second biggest value? (a) 17530 (b) 0.5 (c) 2 c What is the fourth biggest value in 701.3, -3, 4/7, -9, -2/3? -3 What is the third smallest value in -4, -0.4, -5, -8, -7? -5 What is the third smallest value in -3, 0.4, 101/21, -2, 9, -0.1? -0.1 What is the second biggest value in -41, 11, 181? 11 Which is the second biggest value? (a) -5 (b) -16693 (c) 0.4 a Which is the fourth biggest value? (a) 13 (b) 9 (c) 10 (d) 0.81 d Which is the second biggest value? (a) 3/5 (b) 0.5 (c) -0.5 (d) -0.3 (e) -41 b What is the third biggest value in -1/5, -3, -2, -1, -2330? -2 What is the third smallest value in 335, -31, -3? 335 Which is the second biggest value? (a) -0.1 (b) -1 (c) -4 (d) -3 (e) -12/7 (f) -41.6 b Which is the third smallest value? (a) -36 (b) -3 (c) 857 c What is the third biggest value in -25, -0.3, 3, 2/9, -0.03? -0.03 What is the smallest value in 1, 5, -2566, -1/4, -0.4? -2566 Which is the fifth biggest value? (a) 11/3 (b) 14 (c) -2 (d) 1.4 (e) -1/5 c What is the fourth biggest value in 80, 2/13, 0.09, -6/13? -6/13 Which is the third smallest value? (a) 20/3 (b) 1.85 (c) -0.4 (d) -1/2 b What is the fourth smallest value in -5, 0.08, 4/5, 6/5, -17? 4/5 What is the biggest value in 0.1, -4, -2/13, -1/2? 0.1 What is the fifth smallest value in 2/43, 0, 0.02, 3.5, -0.4, -2/9? 2/43 What is the second smallest value in 3, -2/19, 5, 4, -54, -3/16? -3/16 Which is the third smallest value? (a) -0.02439 (b) -387 (c) -2/3 a Which is the second biggest value? (a) -1 (b) 4 (c) -66 (d) 4/3 (e) -1/6 d What is the biggest value in -1, 0.1, -9.23, 1.9, -3/5? 1.9 What is the fifth biggest value in -102.25, -3/4, -1, 2/9, -2? -102.25 Which is the fifth smallest value? (a) 0.4 (b) 0.5 (c) -2/3 (d) 3/14929 (e) -2 b Which is the third smallest value? (a) 78.19 (b) 0.09 (c) 1 a What is the second smallest value in 2.1, 5.95, -1? 2.1 What is the second smallest value in 2/7, 25/10623, -2? 25/10623 Which is the third smallest value? (a) 1/9 (b) 0.1 (c) -200 (d) 3.2 (e) 3/4 (f) -0.6 b What is the smallest value in 653718, 2/7, 3? 2/7 Which is the second smallest value? (a) -124 (b) -4/5 (c) 0.14 (d) 0.5 (e) -5 (f) -0.6 e Which is the second smallest value? (a) -1 (b) 0.26 (c) -7 (d) 4 a Which is the smallest value? (a) 0.2 (b) 11 (c) 269/87 a Which is the fifth biggest value? (a) -1/4 (b) 150 (c) -0.2 (d) 31 (e) 0.08 a What is the fifth bi	{ "pile_set_name": "DM Mathematics" }
y. What is 2l(n) - 3w(n)? -n Let x(s) = -5s3 - 2s + 2. Let v(l) = 14l3 + 7l - 7. Determine -4v(p) - 14x(p). 14p3 Let t(o) = 11o*3 + 4o + 4. Let x(i) = -210i3 - 77i - 77. Give 77t(q) + 4x(q). 7q3 Let q(b) = 9b. Let p(z) = -19z. Determine 6p(a) + 11q(a). -15a Let p(t) = -4t2 - 3t - 2. Let f(h) = 7h2 + 5h + 3. Let x be ((-30)/9)/((-8)/(-12)). Give xp(a) - 3f(a). -a*2 + 1 Let t(z) be the first derivative of -1/3z*3 + 5z - 1/2z4 + 5/2z*2 - 3. Let d(c) = 3c3 + c2 - 7c - 7. Calculate -5d(w) - 7t(w). -w3 + 2w*2 Suppose -2w - 3w = 4p - 11, -5w = -3p + 17. Let f(y) = y*3 + 4y*2 + 4y. Let l(g) = -3g3 - 11g*2 - 11g. Determine pl(d) + 11f(d). -d*3 Let o(j) = 2j*3 - 5j*2 + j + 3. Let r(f) = -2f*3 + 6f*2 - f - 4. Give 6o(x) + 5r(x). 2x*3 + x - 2 Let r(f) = 2f*2 - 3f - 5. Let o(k) = 2k2 - 2k - 6. Determine -5o(j) + 4r(j). -2j2 - 2j + 10 Let q(b) = 15b - 24. Let z(g) = -g + 1. Calculate 3q(s) + 72z(s). -27s Let s(h) = -39h. Let y(z) = 8z. Determine 5s(f) + 26y(f). 13f Let z(h) be the first derivative of -4h*2 + 28. Let n(k) = -3k. What is -11n(b) + 4z(b)? b Let c(h) = h*2 - h + 2. Let d(m) = 2m*2 - 3m + 5. What is 5c(r) - 2d(r)? r*2 + r Let m(x) = x. Suppose -2t + 4 = -0t. Let i(k) = 2k + k*t - 6k - 1 + 3k. What is -i(z) - 3m(z)? -z*2 - 2z + 1 Let q(s) = -38s + 1. Let m(t) = 37t - 1. Calculate -3m(n) - 2q(n). -35n + 1 Let d = -2 - -5. Let p be (d - (4 - 2))-1. Let w(c) = -5c + 6. Let v(u) = u - 1. Determine pw(h) - 4v(h). h - 2 Let k(v) be the second derivative of 2v*4 - 11v*3/2 + 17v. Let s(d) = 3d2 - 4d. What is 4k(j) - 33s(j)? -3j2 Let b(z) = 5z*2 + z - 2. Let m(y) be the first derivative of -3y + 2y3 + 2 + y2 + 2y - 2y. Give 4b(t) - 3m(t). 2t*2 - 2t + 1 Let m(u) be the third derivative of u5/12 + u4/24 + u*3/2 - 6u*2. Let i(s) = -9s*2 - 2s - 5. Let x be 1 + 1 + 0 - -1. Give xi(l) + 5m(l). -2l2 - l Let c(j) = -j2 + j - 1. Let t(o) = o2 + 3o - 1. Calculate -2c(h) + t(h). 3h*2 + h + 1 Let h(r) = 4r. Let f(w) be the first derivative of -w*4/12 - 7w3/2 - w2/2 - 2w - 5. Let t(i) be the first derivative of f(i). What is 11h(y) + 2t(y)? -2y*2 + 2y - 2 Let l(a) = -9a2 - 6a - 6. Let y = -4 + 10. Let d(t) = -18t2. Let c(v) = -2v*2 + v + 1. Let k(g) = 5c(g) - d(g). What is yk(h) + 5l(h)? 3h2 Let l(z) = -9z*2 - 6z + 6. Let u = 8 + -7. Let n(r) = r*2 + r - 1. Determine ul(m) + 6n(m). -3m*2 Let i(j) = -6j*3 + 2j*2 - 4. Let y(x) = 13x*3 - 5x*2 + 7. What is -5i(m) - 2y(m)? 4m*3 + 6 Let h(c) = 7c*3 - 4c + 1. Let m(z) = -z*2 - 3z + 3. Let a be m(-3). Let f(d) = -2 + 0 + 2 - d*a + d. Calculate 5f(l) + h(l). 2l3 + l + 1 Let o(y) = 14y*2 - 3. Let p(b) = -518b*2 + 112. Give 112o(i) + 3p(i). 14i*2 Let q(r) = 16r - 13. Let i(s) = 4s - 3. What is 18i(k) - 4q(k)? 8k - 2 Let f(t) = -t*3 + t - 1. Let d(y) = 8y*3 - 4y - 1. Calculate -d(r) - 6f(r). -2r*3 - 2r + 7 Let v(n) = 3n2 + 6n - 5. Let u(h) = -27 - 8h - 5h + 38 - 6h2. What is -6u(l) - 13v(l)? -3l*2 - 1 Let o(c) = 5c + 3c + 2c - 9c. Let m(l) = -8l - 2. Give m(w) + 5o(w). -3w - 2 Let x(n) = 20n2 - 11n + 11. Let u(j) = -7j2 + 4j - 4. Let m(b) = 17u(b) + 6x(b). Let t(s) = s*2 + 2s - 2. Calculate 3m(o) - 4t(o). -o*2 - 2o + 2 Let v(f) = -4f - 3 + 0 + 2. Let d(s) = -21s - 4. Let h(t) = 2d(t) - 11v(t). Suppose 18 = -518i + 515i. Let m(w) = -w - 2. Give im(y) - 4h(y). -2y Let d(b) = 10b*3 + 11b*2 + 11b + 4. Let q = 0 + 15. Suppose -y - q = -4. Let p(n) = -2n3 - 2n*2 - 2n - 1. Calculate yp(l) - 2d(l). 2l3 + 3 Let w(m) = 6m*2 - 2m. Let i(g) be the second derivative of -g*4/12 - 2g. Calculate -4i(c) - w(c). -2c*2 + 2c Let o(z) = -5z - 2. Let m(f) = -2f - 1. Let r = -11 - -19. Suppose 3i = 4i. Suppose -4u + 5c - 22 = i, -4u + 3c + 1 - 19 = 0. Give rm(b) + uo(b). -b - 2 Let j(u) = 60 - 5u + 2u - 63. Let m(z) = -2z - 3. What is 4j(a) - 5m(a)? -2a + 3 Let q(f) = 4f2. Let a = -27 - -9. Suppose 4 = -2o + o. Let h(j) be the third derivative of -j*5/60 - 68j*2 - 2. Calculate ah(c) + oq(c). 2c*2 Let x(d) = 2d*2 + 17d - 6. Let o(z) = -13z2 - 12z + 8. Let i(s) = -2s2 - s + 1. Let h(w) = 6i(w) - o(w). Determine -17h(t) + 6x(t). -5t2 - 2 Let w = 32 - 21. Let t(x) = -6x - 6. Let f(q) be the first derivative of -17q2/2 - 17q - 2. Calculate wt(b) - 4f(b). 2b + 2 Let a(p) = -13p*2 + 8p - 1. Let b(q) = 4q2 - 3q*2 + 2q*2 - 2q. Let s(h) = h*3 + 3h*2 - 5h - 6. Let m be s(-4). Calculate ma(j) - 9b(j). -j*2 + 2j + 2 Let m(g) = -9g2 - 6g - 6. Suppose 3s + 3b = -3 + 6, 4b = 8. Let a(t) = t2 + t + 1. Give sm(j) - 6a(j). 3j*2 Let g(z) = z + 1. Let l(h) = 7h + 3. Suppose -3d - 15 = 3j, -j + 4d + 10 = -3j. Calculate jg(s) + l(s). 2s - 2 Let o(b) = 6b3 + b2 + 7b - 7. Let c(m) = m*3 + m - 1. Suppose 2f + 3f - 20 = 0. Suppose fi + 42 = 7i. Give ic(l) - 2o(l). 2l*3 - 2l*2 Let x(m) = -45m*3 - 4m*2 + 4. Let g(b) = -45b*3 - 3b*2 + 3. Give -4g(z) + 3x(z). 45z3 Let d(u) = -u2 + 3u + 7. Let k be d(5). Let b(a) = -2a. Let c(p) = 14p + 11p - 20p. What is kc(i) - 7b(i)? -i Let g(v) = -v + 4. Let m be g(-7). Suppose -12 = -3w + w. Let s(h) = 9h2 - 15h - 9. Let p(z) = -5z2 + 8z + 5. Determine mp(j) + ws(j). -j*2 - 2j + 1 Let s(r) = r. Let q(k) = 11k2 - 8k. Calculate -5q(n) - 40s(n). -55n2 Let g(w) = -w3 - w2 + w + 1. Let m(x) = 2x*2 - 2x - 2. Give -4g(j) - 2m(j). 4j3 Let b(c) = -c + 3. Suppose 4y + p + 76 = 0, 4y - 3p + 0p + 92 = 0. Let s = y - -23. Let r(j) = 2j - 4. Determine sb(z) + 2r(z). z + 1 Let c(h) = 21h3 - 56. Let n(z) be the third derivative of -z6/60 + 5z*3/6 + 16z*2. Give 5c(l) + 56n(l). -7l*3 Let g(p) = 5p*2 - 4p - 1. Suppose 6 - 3 = o. Let x(v) = 0v2 - 4v + 7v + 1 - 4v*2 + 0v. Let l be ((-9)/(-6))/(3/4). Determine lg(s) + ox(s). -2s2 + s + 1 Let v(b) = 2b*2 + 6b*3 + 2b*3 + 5b + 4b3 - 8b*3. Let l(c) = 7c*3 + 4c*2 + 9c. What is 6l(h) - 11v(h)? -2h3 + 2h*2 - h Let c(q) = 25q*3 + 35q*2 + 35q. Let t(o) = 2o3 + 3o*2 + 3o. Determine 6c(v) - 70t(v). 10v3 Let s(v) = -11v - 5. Let j(c) = -2c - 1. What is 34j(r) - 6s(r)? -2r - 4 Let w(t) be the second derivative of t*3/3 + t. Let n = 13 - 8. Suppose -4b = -0b + 5h - 37, 3b - nh = -16. Let f(g) = -3g. What is bf(v) + 5w(v)? v Let o(w) = 3w*2 - 2w - 2. Let a(v) = -10v2 + 7v + 5. Calculate 2a(c) + 7o(c). c*2 - 4 Let g(x) = -3x*3 - 4x*2 + x. Let q(r) = -5r - 8r - 2r - 7r2 - 5r*3 + 16r. Give -7g(b) + 4q(b). b*3 - 3b Let o(t) = 3t2 + 3t + 3. Let f(w) = -21 + 2w - w3 - 4w*2 + 17 - 6w. Let u be 2 - (2/(-2) - 0). Calculate uf(j) + 4o(j). -3j3 Let c(w) = -3w*3 - 2w - 4. Let t = -3 + 0. Let n(u) = -3u3 - u - 3. Determine tn(z) + 2c(z). 3z*3 - z + 1 Let o(l) = 12l*2 + 5l + 3. Let k(r) = 25r2 + 11r + 7. Determine 3k(c) - 7o(c). -9c2 - 2c Let g(p) = 6p3 - 2p*2 + 3p - 1. Let h(s) = 9s3 - 3s*2 + 4s - 1. Calculate 7g(k) - 5h(k). -3k3 + k2 + k - 2 Let q(l) = 17l - 6 + 8 - 6 + 1. Let k(t) = -4t + 2 - 1 + 3t - 5t. Determine -11k(p) - 4q(p). -2p + 1 Let k(j) = -6j2 + 21j*2 + 4 + 17j*3 + 10j*3 + 11. Suppose 14 = v - 1. Let t(o) = -7o*3 - 4o*2 - 4. Calculate vt(r) + 4k(r). 3r*3 Let y(m) = -17m - 7. Let j(t) = 9t + 4. Let r be 60/(-9) - -42/12. What is ry(s) - 11j(s)? 3s - 2 Let d(s) = 2s*2 - 3s - 8. Let a(x) = -2x2 + 3x + 7. Determine 6a(b) + 5d(b). -2b2 + 3b + 2 Let c(r) = -11r3 - 2. Let n(u) = u3 - 1. Determine c(m) - 2n(m). -13m3 Let l(y) = 3y + 11. Let t(m) = -2m - 5. Determine -3l(z) - 5t(z). z - 8 Let u(s) = -6s*3 + 11s2 + 11. Let k(p) be the third derivative of p6/120 - p5/30 - p3/3 - 3p2. Calculate 11k(m) + 2u(m). -m3 Let d(a) = -6a + 5. Let w(n) = -3n + 2. Give 6d(h) - 13w(h). 3h + 4 Let c(h) = 3h3 - 8h*2 - 2h + 5. Let b(v) = -2v3 + 5v*2 + v - 3. Let x be (2 - (-36)/(-10))5. Calcul	{ "pile_set_name": "DM Mathematics" }
s + 26. Let d be g(-8). Let h = -16 - d. Solve 2q + 22 = -5u + 4, 0 = -q - 5u - h for q. -4 Let x(w) = 3w - 14. Let c be x(6). Suppose -4g - 2p + 16 = -6, -3p = g - 8. Suppose 0 = gy + 37 - 82. Solve h + y = 4l - 15, 3l + ch = -1 for l. 5 Suppose 15 = -5v + 35. Suppose 5t = 2c - 25, -176 + 151 = 4c + 5t. Solve -vn = 4 - c, -4 = 5y - n for y. -1 Let n be 1/4 + 1902/(-24). Let s = n - -83. Suppose 5m = sz - 77, 0 = -6z + 7z - m - 18. Solve 3y = 2w + z, -5y + 5w + 35 = 10 for y. 3 Let c(o) = o*2 + 6o + 15. Let r be c(-2). Suppose rn + 111 = 146. Solve 2y = 6, -ny = -a - 3y - 3 for a. 3 Suppose 140g + 105 = 143g. Let j be -1 - (1 - 3 - g). Solve -s + 5z = -0s + 29, -4s = -4z + j for s. -4 Let y be 19/3 - ((-1664)/(-78) - 21). Solve 5n - 30 = yz - 11z, 22 = 4z + 2n for z. 5 Let c(n) = n2 + 24n - 10. Let k be c(12). Suppose 2a - k + 410 = 0. Solve -v = 2t - 6, 2t = av - 3v + 14 for t. 4 Let p(z) = 26 + 4z - z*2 - 45 + 22. Let a be p(5). Let f be (6/a)/((-18)/24). Solve -2x - 5i - 15 = 0, 2x - x - fi - 25 = 0 for x. 5 Suppose -3r = -4h + 130 - 35, 5h + 4r = 80. Suppose 18v - 20 = 14v. Solve -2t - 3 - 1 = -g, -4t + vg - h = 0 for t. 0 Suppose -26w = 2r - 31w - 50, -r + 24 = -2w. Solve -j + 3j = 4a + 12, 4j - 4a - r = 0 for j. 4 Let h = -1600 - -1611. Solve 4 = 2q - 4d, -2q = -3d + 4d + h for q. -4 Suppose 0 = -3t - 213 - 456. Let d = t - -229. Solve -3x + 2g - 2 = 0, -14 = -5x + dx - 4g for x. 2 Let c be ((-62)/(-8))/(-1222/(-1056)). Solve 0 = f + 2, 5y + 28f = cf + 1 for y. -1 Let f be (-6 + ((-210)/(-12))/5)/((-15)/12). Solve -4z - 56h + 4 = -60h, -3z + fh = 2 for z. -4 Suppose -2 = -o - 3, b = -5o + 22. Suppose 10w - b = w. Solve 2t - 31 = 6t - wy, y + 3 = -2t for t. -4 Let q = -474 + 564. Suppose 20g + q = 30g. Solve -c - 7 = 4z, 5c + 3z - g - 7 = 0 for c. 5 Let u = -65 - -116. Suppose 0 = 3x + x - 220. Let i = x - u. Solve 2d - 2 + 7 = 5w, -id = -3w + 17 for d. -5 Let p(z) = 2z3 - 65z*2 - 57z + 2850. Let w be p(32). Solve -wy - 1 = -5, -y = -2a + 6 for a. 4 Let a be 5/1 - (-30)/255. Suppose -i + a = 3r, -6r + 11r - 3i + 5 = 0. Solve 2n + rh + 10 = 0, 0 = -5n + n - h - 14 for n. -3 Suppose -c + u + 207 = -4u, 0 = -4c - 2u + 916. Let d = -222 + c. Solve -5v + v = di - 18, i + v = 4 for i. 2 Let d be (-2 + -1)/(24/(-16)). Suppose h + 5l = 3 - 8, 3h - d = 2l. Solve -5n = 3i - 1, h - 7 = -4i - n for i. 2 Let p(k) = k3 - 8k*2 + k - 4. Let d = 1 + 7. Let n be p(d). Let s = -356 + 357. Solve -20 = -4o + 5w, nw + s + 9 = 2o for o. 5 Let i be (-162)/(-8) - 3 - 17/68. Solve 3h + 3l = l - i, -h - 5l - 10 = 0 for h. -5 Suppose 216m = 279 + 2313. Solve -m = 2z + 4r - 32, -5r = z - 22 for z. 2 Suppose 3f + 12 = -3k, 5f + 23 = 2k - 6k. Let c(h) = h + 12. Let v be c(f). Solve 4 = y + 2j, -4j = -3y - 3 + v for y. 2 Let p be (231/(-44))/(-3 + 21/8). Solve 3k + 1 = 3t + 10, -p = 4t - 2k for t. -4 Let t(o) = -o*3 + 40o*2 - 171o - 138. Let h be t(35). Solve -4i = -hc - 10, -c - c = 2i - 8 for i. 3 Suppose -305 = 75u - 380. Solve 5w = -3c + 13, 6 = 5w - 5c + u for w. 2 Suppose 3g = -2z - 10, -25 = 4g - 0z + 5z. Solve 3a - 6a - f = g, -2a = 3f - 7 for a. -1 Let a(r) = 33 - r - 2r - 2r. Let u be (-20 + 29 - 13) + (-9)/(-1). Let x be a(u). Solve -n = 0, h + h + x = n for h. -4 Let h(f) = f3 - 37f + 7. Let q be h(7). Suppose qr - 94r = 0. Solve -6 = -3w, 23 = 5d - rd - w for d. 5 Suppose 0 = -5d + 122 - 77. Let k = -5 + d. Solve 0 = 4m - kn + 5 - 13, -5n = 5m + 30 for m. -2 Suppose -2c + 5s = -17, c - 2c + 5 = s. Let t = 181163 + -181161. Solve k - 10 = x + x, k + c = -tx for x. -4 Suppose 0 = -2w - r - 1, -4w - 12r = -6r + 30. Solve -1 = -51t + 47t + wc, -c + 5 = 0 for t. 4 Suppose 5g + 20 = 0, -2p - 2g - 1478 = 3p. Let c be (2/6)/(-4 - p/72). Solve -3r - 13 = cj - 5j, -5r + 3j - 19 = 0 for r. -5 Let l = 169 - 335. Let f = l + 173. Suppose -k + 3k - 14 = 0. Solve -3g = t - k, 3t - 2g - 3 = f for t. 4 Let b be (16 - 0) + 6/(-6)(1 - -5). Solve 2p + 5r = b, -10p = 3r - 1 - 5 for p. 0 Suppose -17n - 20n - 22n + 236 = 0. Solve -2w + 10 = -0w, 0 = na + 2w - 18 for a. 2 Let b be (8/(-6))/((-1)/3). Suppose -3t = -9, -bt = -17x + 16x - 9. Solve v + 6 = -2w - x, 0 = 2v - 2w for v. -3 Suppose -87 - 158 = -5v. Let h be (1(2 + -4))/(-7)v. Solve 2t = -2n + h, 9n = -t + 4n + 23 for t. 3 Let q be (-4)/((-120)/93) + 568/(-80) + 7. Solve -2h - 9 = -qs, h = 4h + 4s - 12 for h. 0 Let p(w) = 32w + 1765. Let t be p(-55). Solve -y = -4s, 0 = 5y - ts - 6 + 21 for y. -4 Let x = -240 + 282. Suppose x = -19u + 118. Solve -4l = -5l - 3m + 3, -ul + m + 12 = 0 for l. 3 Suppose 34v = 105 + 75 - 44. Solve 3k + r = 6, -5k + 3r = vr - 12 for k. 3 Let y = 145 + -142. Suppose -2r = r + 9, -yr + 67 = 4h. Solve -n + 6n = -3u - h, -5n + 4u - 33 = 0 for n. -5 Let o(y) = -10y*2 + 2y. Let m(g) = -g. Let x be m(-2). Let s be o(x). Let f be (s/(-24))/((-1)/(-2)). Solve 0 = 4r + k - 2 + 7, 2r - 1 = fk for r. -1 Let n be (-9)/(-1 + -1 - 1). Let i be 0 + (1 - 0) + (3 - 1). Solve nd = -ir - 2d + 10, 4r + 25 = d for r. -5 Suppose 16s = 43 - 1307. Let h be s/(-4) + 14/56. Solve -5f + 4b + h = 0, 1 = f + 3b - 3 for f. 4 Let g(k) = 6k - 16 + k - 2k. Let w = 2451 - 2445. Let t be g(w). Solve 0o - 2o + 10 = -3l, 0 = 4l - 3o + t for l. -2 Let k(z) = z*2 + 3z + 1. Let l be k(-4). Let v(x) = -4 + 0 + l + 0 + 9x. Let p be v(2). Solve 0n - 4u = 5n + p, 0 = -n - 3u - 6 for n. -3 Let i be (-4 + 1)24/(-18) - -10. Let b be 7 + ((-16)/(-28))/((-4)/i). Solve u = a - u - 5, -25 = -ba + u for a. 5 Let g = -105 - -70. Let x be 6/24 + g/(-4). Let l(d) = -5d + 49. Let y be l(x). Solve -w = 5, -c = -2c - yw - 16 for c. 4 Suppose 52k = 72k - 1480. Suppose -6x = -x - 380. Let b = x - k. Solve 0o + 5l + 3 = -bo, -4o + l = -5 for o. 1 Let r = -950 - -1005. Suppose 68b = rb. Solve -5a + bn + 3n = -3, -n + 4 = 0 for a. 3 Suppose 3h = g + 7h - 2, -4g - 3h + 21 = 0. Suppose 0 = -18u + 44 - 8. Solve 5a = 15, -a = -ub - b + g for b. 3 Let v = -4811 - -4820. Solve -5h - q + 2q = -15, -q + v = 3h for h. 3 Suppose -512z + 5 = -511z. Suppose 2v - 6 = 0, -5x + 4v - zv + 73 = 0. Solve -4l = -8, -4r + 5l - x = 16 for r. -5 Suppose -56 = u - 60. Suppose 5c + 8n - 75 = 6n, -30 = -2c + un. Let q = -3 + 6. Solve -3d = -4i - c, -2i + 12 = qd - 3 for i. 0 Let t = -4060 + 4063. Solve 13 = 5k - 0k - tp, 5k - 2p = 17 for k. 5 Let l be 342/66 + -5 - 42/(-11). Suppose 24 = -lk + 40. Let q = 0 - -1. Solve -ka + 28 = 5g, -4a + 13 - q = g for a. 2 Let d = 166 - 151. Suppose -d = 8a - 13a. Solve -f - 17 = 5w, 4f + 13 = af - 4w for f. 3 Let a be (2/6)/((-70)/(-5880)). Solve 5l = -5y + 25, -24y - 8 = -ay - l for y. 1 Suppose -8s - 8 + 24 = 0. Let l be (1/2)/(s - (-286)/(-144)). Let x = l + -33. Solve -3r - 5w = -0r + 12, xw - 16 = 4r for r. -4 Suppose 525 = 80l + 125. Solve -p + 5c = -21, lp - 5c - 18 = 7p for p. 1 Let u = -8 - -12. Let j = -148 - -207. Suppose -jb = -37b - 110. Solve -uw = -2n - w - 3, -3w - 18 = bn for n. -3 Let i(j) = -j*2 + 122j - 469. Let k be i(4). Solve -3p = 2a - 3a - 12, 3a + kp = 24 for a. 3 Suppose 0 = 2g - 24 + 10. Suppose 2m + 4k - 452 = 0, -3k = gm - 5m - 455. Let i be m/60 + -2 + 128/60. Solve 3u + 3 = -ib - 2u, 4u = -2b for b. -2 Let h be 16/2(-40)/(-12). Suppose 3p = p + h. Suppose m - 9 = -3a, -m - 5a + 4a + p = 0. Solve -md = 3r + 2d - 16, 2r - 6 = -d for r. 2 Let s(j) = -6j - 1 - 9j + 19j - 5j. Let w be s(-4). Suppose wv - 32 = -5m, 2m + 0v - 4v = -8. Solve -3h - 13 = mu + u, 5u + 2h + 17 = 0 for u. -5 Suppose 126 + 50 = 4d. Let t = d - 32. Solve 0a + 2a + t = -3n, -3n = a + 9 for a. -3 Let p be 10/(-2) + (-27)/((-81)/42). Suppose 2f - 12 = -x, -pf + 4f - 4x + 36 = 0. Solve 4r = -fk + 23 + 17, r = 3k - 10 for k. 5 Let t(f) = -f3 + 7f*2 - 7f + 8. Suppose 0 = 3n, -2w + 3n = -5 - 1. Let h = w + 3. Let s be t(h). Solve 2g - sv = 6, -4v - 9 = 5g - v for g. 0 Let u be ((-4 - -5) + 3)(6 - (-165)/(-3	{ "pile_set_name": "DM Mathematics" }
is the nearest to -0.1 in 5, 4/9, 37? 4/9 What is the nearest to -0.1 in 1, 0.04, -0.1, 0.3? -0.1 Which is the closest to -0.1? (a) 1 (b) -0.5 (c) 0.7 (d) 3 b Which is the nearest to -2? (a) -0.4 (b) 1 (c) 15 (d) -4/5 d What is the closest to 1 in 18, -0.02, -1/8? -0.02 Which is the closest to 38? (a) 0.3 (b) -2/3 (c) -1 (d) 0.1 a What is the nearest to 0 in 6/5, -0.4, 0, 5? 0 What is the closest to -187 in 3, -0.1, -1? -1 Which is the closest to 1? (a) 3 (b) -20 (c) -3 (d) 4 a What is the closest to -2/7 in 4, 2/11, -2, 0.138? 0.138 What is the closest to -1/2 in 2, -0.3, 2/11? -0.3 Which is the nearest to -0.1? (a) 2/17 (b) 0.1 (c) 126 b Which is the nearest to -1? (a) 2/3 (b) 1606 (c) -3 a Which is the closest to 1? (a) -1.69 (b) 3 (c) -2 b Which is the nearest to -0.1? (a) 3 (b) -2/7 (c) -0.02 c What is the closest to -1 in 0.14, -1, 3, -3/16? -1 What is the closest to -5 in -5, 0.09, -0.1, -10? -5 What is the nearest to 1/2 in -5, -2, -34, 0.5? 0.5 What is the nearest to 1 in 6, 2/3, 1, 2/13? 1 Which is the nearest to 0.6? (a) -3/7 (b) 4 (c) -24/25 a What is the closest to 5/2 in 1/11, 0.2, -4/9? 0.2 Which is the closest to 0.3? (a) -1 (b) -4/5 (c) -0.2 (d) -0.3 c Which is the closest to -1/2? (a) 2/13 (b) -5 (c) 0.062 c Which is the closest to 122? (a) -4 (b) 2/5 (c) 9 (d) 4 c Which is the nearest to 69? (a) 0 (b) 7 (c) 1 b Which is the nearest to 1/496? (a) -0.3 (b) -0.2 (c) -1 (d) 0.4 b Which is the nearest to -9? (a) 4 (b) 5 (c) -1 (d) 1 c Which is the nearest to -0.1? (a) 0.2 (b) -188 (c) -3 a What is the nearest to -3 in -0.4, 0.2, 0.11? -0.4 What is the nearest to 19 in 3, -0.5, -3/2? 3 Which is the nearest to 0.1? (a) -1.4 (b) 8/7 (c) 4 b What is the closest to -1 in 2/5, 378, -0.4? -0.4 What is the nearest to -2 in 1, -8, -2/35? -2/35 What is the nearest to 0 in -4, -1/11, 25/3, -2? -1/11 What is the nearest to -1 in 0.2, -1, 2/5? -1 What is the closest to -267 in 7/5, 2, -1? -1 What is the closest to -6 in -1/4, 607, 0? -1/4 Which is the closest to 1/9? (a) -5 (b) 1.5 (c) 2/15 c What is the closest to 2/7 in 3, 0.94, 1? 0.94 Which is the closest to -2? (a) 2/11 (b) 5 (c) 29 (d) 2/13 d What is the nearest to 2/7 in -0.1, -9/11, -8, 1/2? 1/2 What is the closest to 2/7 in -18/11, -3, 0.078? 0.078 Which is the closest to 2/3? (a) -4 (b) 0.1 (c) 1519 b What is the nearest to 0.1 in -1, 2/15, -5, -79? 2/15 What is the closest to 0 in -1/5, 4/41, 5? 4/41 What is the nearest to -5 in 2/7, -1/2, 0, 0.24? -1/2 What is the closest to 5 in -5/4, -9, -2/11, 0? 0 Which is the closest to -372? (a) -0.1 (b) 5 (c) -3 c What is the nearest to -0.1 in 1/4, -0.057, -0.2? -0.057 What is the closest to 1 in -7, 2, -0.14, 4? 2 Which is the nearest to 1? (a) -3.5 (b) 0.3 (c) 0 b Which is the nearest to 0? (a) -2 (b) 0.2 (c) 2/13 (d) -9 c What is the nearest to -2/6581 in 3/5, 0.5, -1/10? -1/10 Which is the nearest to -2/11? (a) 4 (b) -1/2 (c) -2/9 (d) 0.3 c What is the closest to 14 in -12/7, -0.4, 9? 9 Which is the nearest to -0.8? (a) -1/7 (b) 1 (c) 0.05 (d) -5 a Which is the nearest to -16? (a) 1 (b) 3 (c) 1/4 c What is the nearest to -0.2 in 2/21, -1.02, -3/5? 2/21 Which is the nearest to 0.2? (a) 5 (b) 0.1 (c) -19 (d) 0.4 b What is the closest to 0.6 in 5, -1, -1/6, 1? 1 What is the closest to -1 in -0.025, -3, 0? -0.025 What is the nearest to 2/3 in 3, 2/5, -0.17, 1? 2/5 Which is the closest to 3? (a) 4 (b) 1 (c) -2/23 (d) -2/9 a What is the nearest to -1/2 in 4, -0.33, 0.05, -0.01? -0.33 Which is the closest to 1/2? (a) 1/4 (b) -369 (c) 4 a What is the nearest to -14 in 0, 0.5, -0.2, -1/8? -0.2 What is the closest to 2 in -6/5, -2/9, -1/5? -1/5 What is the closest to -3 in -68/3, 0.3, 1, 3? 0.3 What is the closest to -8 in 2/11, -0.4, 6/7? -0.4 What is the nearest to 2/13 in 0.1, 2.3, -0.24? 0.1 What is the closest to -1 in -14/5, -2/5, 0.5? -2/5 Which is the closest to -1? (a) 4 (b) -826/9 (c) 0.1 c What is the closest to 2/3 in -0.4, -3, -5, -1/3? -1/3 Which is the closest to -14? (a) -1/5 (b) -0.3 (c) -0.4 (d) -1 d What is the closest to -0.1 in -1/3, 0.4, -5, 2/7? -1/3 What is the closest to 5/6 in -0.08, -0.3, 4, 2/9? 2/9 Which is the nearest to 1? (a) -0.2 (b) 0.1 (c) -17 (d) 0.5 d Which is the nearest to -2? (a) -291 (b) 5 (c) 4 (d) 2 d What is the closest to 14 in -4, -5, 174? -4 Which is the nearest to -2? (a) 0.1 (b) 0.5 (c) 0.001 c Which is the nearest to 88? (a) 0.4 (b) -1 (c) -2 (d) -5 a What is the closest to 19 in -134, -3, 0, -3/4? 0 What is the closest to 1 in 14, 0, -3? 0 What is the nearest to -41 in 0.2, 0.5, 0.1, -2? -2 Which is the nearest to 1? (a) 0.3 (b) 0.4 (c) 2 (d) -1/9 b What is the closest to 0.1 in -0.1, -0.7, 4? -0.1 What is the nearest to 0.14 in -2, 0.4, -2/11? 0.4 Which is the nearest to 76? (a) 4 (b) 1 (c) -1/2 (d) 0 a What is the nearest to -6 in 5, -9/8, 3, -0.5? -9/8 Which is the closest to -4? (a) 2/29 (b) 0.07 (c) 1/3 (d) 0.4 a Which is the closest to -0.2? (a) -10 (b) -3 (c) -1/2 (d) -0.4 d What is the nearest to 29/5 in 0, -1, 4? 4 What is the nearest to 9 in 0.2, -31, -5? 0.2 Which is the nearest to 1/9? (a) 2/11 (b) 3 (c) -14 a What is the nearest to 0.04 in -29, 2, 0? 0 Which is the closest to 2/7? (a) -2/7 (b) -2/3 (c) -81 (d) -6 a Which is the closest to -0.4? (a) 2 (b) 0.3 (c) -0.4 c Which is the nearest to 3? (a) -13/4 (b) 2 (c) -8/51 b Which is the closest to -1? (a) -2 (b) -1/30 (c) 5 (d) 0.2 b What is the closest to -4/9 in -2/5, -20, -1? -2/5 Which is the closest to 0.1? (a) 1/6 (b) -2/3 (c) -33 (d) -34 a What is the nearest to 0 in -1/3, -0.7, 0.3, -2? 0.3 Which is the nearest to 0? (a) 0.07 (b) 0.1 (c) 4/5 (d) -120 a What is the nearest to 8 in -1/3, 6, 4/3, -2/7? 6 What is the nearest to -0.1 in 1, -7, -16, -2/9? -2/9 Which is the nearest to 2/5? (a) -0.1 (b) -0.08 (c) 0.1 c What is the nearest to -501 in -10, 0.1, -4, -1/4? -10 Which is the nearest to 8? (a) 1/5 (b) 1/6 (c) -1/16 a Which is the closest to -17? (a) 3/5 (b) -1/5 (c) -2 c What is the nearest to -0.1 in -2.4, 0.2, 4, 0.11? 0.11 Which is the nearest to -3/5? (a) 4 (b) 2/3 (c) -54 b What is the closest to -5 in 3, -2, 2, -5? -5 Which is the closest to 1.3? (a) 0.4 (b) -5 (c) -1 a Which is the closest to 0? (a) -0.09 (b) -15 (c) -1/6 (d) 5 a Which is the closest to -3? (a) -2/9 (b) -5 (c) 1/7 b Which is the closest to -0.05? (a) 12 (b) -5 (c) 2 c What is the closest to -16 in 0, 3/5, 1, 1.5? 0 Which is the closest to -13? (a) -1/2 (b) -7/3 (c) 5/2 (d) 3/4 b Which is the closest to 10.7? (a) -0.5 (b) -2/7 (c) -3/4 (d) 3 d What is the nearest to 2 in -1/6, 5, 5/2, -0.7? 5/2 Which is the closest to -1? (a) -1/5 (b) 2/7 (c) 3 (d) -2 a Which is the nearest to -1? (a) -3/5 (b) 0 (c) 1/18 (d) 5 a What is the closest to -2 in 2, -1, 0.01, -4? -1 Which is the closest to -0.2? (a) -2/3 (b) -2 (c) -0.4 (d) 0.5 c Which is the nearest to 0.1? (a) 0 (b) 36 (c) -2/3 (d) 0.3 a What is the closest to 2/3 in -1, 5, -2.6, -1/3? -1/3 What is the nearest to 0.4 in -3/2, -0.07, -3? -0.07 What is the nearest to -13 in 5/4, 1/2, -3? -3 What is the nearest to -1/4 in 1/5, -11/30, -4, -2/3? -11/30 What is the closest to -2 in 2, 0.3, -4, 370? -4 What is the nearest to 1 in 2122, 0.2, -0.3? 0.2 Which is the closest to 3/28? (a) -2/7 (b) 0.1 (c) 0.4 b Which is the nearest to 192? (a) -4 (b) -2/3 (c) 0.06 c What is the nearest to -2/17 in 0, -1/3, 4, -5? 0 What is the nearest to -3 in 0.12, 1, -5, -3/4? -5 What is the closest to 1 in 468, -3, -6? -3 Which is the closest to 0? (a) 1/18 (b) 214 (c) -4 a What is the closest to 1/3 in -2, -5, -0.4? -0.4 Which is the closest to -1/6? (a) 3 (b) -17 (c) -0.5 c Which is the closest to -3/10? (a) 0.05 (b) -2 (c) 0 (d) -0.4 d Which is the nearest to -8? (a) 5/2 (b) -28/5 (c) 0.4 b What is the nearest to 744 in -0.4, 5/4, 1/6? 5/4 What is the nearest to 1 in 5/2, 6, 3, -5? 5/2 Which is the closest to 6? (a) 12/13 (b) -2/5 (c) -1 a Which is the closest to -55? (a) -1 (b) 3 (c) -0.3 (d) 3/4 a What is the nearest to 8 in -4, 0.1, 5, 0.3? 5 Which is the nearest to 1? (a) 0 (b) -1	{ "pile_set_name": "DM Mathematics" }
s, 4, 0 in descending order. s, 4, 0 Let z be 27 - 24 - (27 + 0). Let s = 19 + z. Sort 5, 4, s in ascending order. s, 4, 5 Let j = -141 + 139. Sort j, 4, 1 in descending order. 4, 1, j Let j = 19 - 17. Let b be (4 - j - 1)0. Sort -5, b, 5 in decreasing order. 5, b, -5 Let f(p) = p3 - 10p*2 + 48p - 477. Let s be f(10). Sort s, -2, -45. -45, -2, s Let n = -10 + 10.12. Let c = n + -0.14. Let s = 36.1 + -36. Put s, c, -1/4 in decreasing order. s, c, -1/4 Suppose 17a - 25 = -8. Put 3, 6, a, 2 in ascending order. a, 2, 3, 6 Let w be 7(-12)/(-42)2. Let z = -13 - -10. Put w, 0, -5, z in increasing order. -5, z, 0, w Let c be 25/10(-8 - -6). Put 4, -37, c, 3 in decreasing order. 4, 3, c, -37 Let m = -19 + 25. Let c be m + 38/(-6). Sort -3, -1, c in descending order. c, -1, -3 Let o(f) = -f2 + 4f + 3. Let t(s) = -2s2 + 3s + 4. Let x(d) = 3o(d) - 2t(d). Let l be x(-5). Let q = -137.1 - -137. Sort 4/7, l, q in increasing order. l, q, 4/7 Let m(t) = -t*3 + 7t*2 - 7t + 8. Suppose 6 = -31k + 32k. Let w be m(k). Put w, 1, -2 in descending order. w, 1, -2 Suppose 2s + 2i - 129 + 17 = 0, s - 5i = 44. Suppose 0 = -4j + j + s. Sort -5, 2, j in ascending order. -5, 2, j Let o = -0.116 - 4.884. Put 2, o, 0.2 in ascending order. o, 0.2, 2 Let q(g) = -2g3 + 4g*2 + 5g - 2. Let u(f) = f*3 - f - 1. Let a(l) = -q(l) - 3u(l). Let h be a(-3). Put 12, 5, h in decreasing order. 12, 5, h Let h(i) = 2i + 11. Let a be h(-3). Suppose 8o - 1 + 9 = 0. Let j(v) = -v*2 + 2. Let m be j(0). Sort m, a, o in decreasing order. a, m, o Let k = 5.2 + -2.2. Let t = -30 + 30.1. Put t, k, -8 in decreasing order. k, t, -8 Let s be 3/64 + -26. Let g = s - -25. Sort 8/11, g, 2 in decreasing order. 2, g, 8/11 Let r be (-12)/8 - (-33)/6. Sort -1, r, 16 in decreasing order. 16, r, -1 Let n be 5/20 + (-21)/4. Suppose -2z + 9 = 1. Suppose 2k = -2s + 2, -3s - 9 - z = -5k. Put -4, k, n in increasing order. n, -4, k Let u be ((-18)/66)/(8/(-88)). Sort -3, -1/24, u in descending order. u, -1/24, -3 Suppose 4k - 55 - 85 = 0. Let f = k - 54. Sort -5, f, 2 in descending order. 2, -5, f Let r(l) = -l + 21. Let d be r(19). Let s be (5 - (-7)/(-3))/(d/3). Put 5, s, 3 in decreasing order. 5, s, 3 Let k(u) = u*2 + 4u + 4. Let c be k(-3). Let i = 3325 + -3326. Sort 3, c, -5, i in decreasing order. 3, c, i, -5 Let v be ((-2160)/(-132))/9 + 2/11. Sort 0, 5, v, -8 in descending order. 5, v, 0, -8 Let c = -0.131 + -0.069. Let a = 3/5 + -11/10. Sort a, c, 4. a, c, 4 Let a be ((-2)/4)/((-1)/2). Suppose -2 - 4 = -2d. Suppose -6 = -2b - dm, -b + 3m - 27 = 4b. Sort 4, b, a in decreasing order. 4, a, b Let a = 10 + -9.6. Let v(b) = -4b + 5. Let y be v(2). Let d be (2/y)/(30/18). Sort 0.2, a, d in decreasing order. a, 0.2, d Let i = 167 + -167.245. Let j = i - 0.255. Let f be (-4)/((1 + -3)/2). Sort 0.3, f, j in descending order. f, 0.3, j Let x = -5.7 + -0.3. Let o be (-190)/761/(-5). Sort -3, x, 0.2, o in descending order. o, 0.2, -3, x Suppose -4m = -t + 4, t - 2m + 2 = -m. Put t, -5, -1, 2 in increasing order. -5, t, -1, 2 Suppose 0s = -4s + 224. Let v = -56 + s. Let p be (-1)/(-3(-1)/6). Sort -1, p, v in descending order. v, -1, p Let m = -73.9 - -66. Let k = m - -8. Let i = k - -0.1. Sort i, 5/6, 2 in decreasing order. 2, 5/6, i Let l be (-2)/(-6) - 54/(-81). Let y = 3 + 0. Sort 11, l, -3, y in decreasing order. 11, y, l, -3 Suppose -3s = -8s - f - 4, 2s - 12 = 3f. Suppose -5j = 4y - 0 - 6, y + 3j - 5 = s. Put 2, y, 4, 1 in descending order. 4, 2, 1, y Let v = -9.035 - -9. Let p = v - 5.045. Let s = 0.08 + p. Put 0.4, -2, s in decreasing order. 0.4, -2, s Let a = -600 - -600.3. Put -0.3, -221/4, a in ascending order. -221/4, -0.3, a Let r be 0 + 7 - (-1)/(203/(-1435)). Sort r, -5, 2.5 in ascending order. -5, r, 2.5 Let n(h) = -6h3 + h2 + 4h - 3. Let y be n(1). Put 2, y, -46 in ascending order. -46, y, 2 Let f be (-26)/(-104) - 38/(-8). Let l(y) = -y2 - 7y - 2. Let g be l(-6). Sort -6, f, g. -6, g, f Let p be 108/30 - 8 - -5. Sort -3/2, 0.241, 0.2, p in decreasing order. p, 0.241, 0.2, -3/2 Let g(k) = -33k + 3. Let d be g(2). Let f = d - -68. Sort 0, 9, 3, f. 0, 3, f, 9 Let b(p) = 5p*2 - 18p - 18. Let l be b(-1). Let s = 1 - -3. Sort l, 0, -2, s. -2, 0, s, l Let a = 348 + -215. Let l = a + -128. Put -3/4, -2, l, 4 in descending order. l, 4, -3/4, -2 Let k be (8/10)/((-36)/90). Let r = 2.96 - -0.04. Put r, 0.3, k in decreasing order. r, 0.3, k Let m = -21 + 39. Let c = -0.43 - 17.87. Let i = c + m. Put 0.3, i, 0 in ascending order. i, 0, 0.3 Suppose -2v + 0 = 2, -3h + 5v + 47 = 0. Let k = -1119 + 1124.11. Let d = k + -0.11. Sort h, d, 0.2 in decreasing order. h, d, 0.2 Let o = 0.0287 + -0.0487. Sort o, -5, -2 in descending order. o, -2, -5 Suppose 12p = 29p - 26p. Put 3, -4, p, 15 in descending order. 15, 3, p, -4 Let z = 13.56 - 0.56. Let p = -11 + z. Put p, -0.2, -2 in descending order. p, -0.2, -2 Let r be (-21)/942/(-49). Sort -11, r, -5 in decreasing order. r, -5, -11 Let u = -9898/1815 + -2/1815. Let h = -5940/19 + 199858/627. Let z = u + h. Sort z, 0, 0.7 in descending order. 0.7, z, 0 Suppose -w = u - 6u + 20, 5w = -3u + 40. Put -3, 52, u, 3 in decreasing order. 52, u, 3, -3 Let z = 1888 + -1887.6. Put 22/5, z, 0.6 in descending order. 22/5, 0.6, z Let m = -1 - 1. Let d be 31/3 - 3/(6 - -3). Suppose 0 = -dp - 14 - 16. Sort -1, p, m in descending order. -1, m, p Let i = -89/30 + 14/5. Let l(q) = -41q + 1. Let a be l(-1). Let h = -167/4 + a. Put h, -6, i in increasing order. -6, i, h Let s = 496 + -495.81. Sort -2, -4, s in ascending order. -4, -2, s Let o be 1 + -1 - (-1)/(-9). Let y = 9.6 - 10. Let k = 4.6 - y. Sort o, k, -3. -3, o, k Let h = -5 + 5. Let b be (-4(-9)/(-36))/((-2)/6). Put b, 0.5, h in descending order. b, 0.5, h Let u(t) = -t3 + 3t*2 - 3t - 3. Let i be u(3). Let z be (-14 - i)3/(-4). Let s = 72 - 220/3. Sort z, s, -1 in increasing order. s, -1, z Let a be 6 - (-7 - -9)4. Sort a, -36, 2, 9. -36, a, 2, 9 Let o = 0.813 - -0.187. Sort 6, o, -66 in decreasing order. 6, o, -66 Let c = -27 - -30. Let f = 3.15 - c. Let g = 0.05 + f. Sort g, -0.1, 1 in increasing order. -0.1, g, 1 Suppose d + 5p - 16 = 0, -4d + 4p - 68 = -12. Let a be 3/18(d - -11). Put a, 9, 0.1 in increasing order. 0.1, a, 9 Let m(x) = -x3 + x2 + x - 6. Let d be m(0). Let b = -4 - d. Suppose -o + 9 = 5v, -5v + 12 = -bo - 0v. Sort o, 4, 1 in ascending order. o, 1, 4 Let t(d) = -d*2 - 1. Let b be t(-2). Let g be (-2)/(-10) + ((-72)/(-15) - 5). Put b, 4, g in decreasing order. 4, g, b Let i = 0.5807 + -0.1807. Let c = -2 - 1. Put c, i, 7, 1/7 in decreasing order. 7, i, 1/7, c Let t be (3 + (-63)/15)/((-101)/5). Let n = t + -268/1111. Put 1, -2/9, n in ascending order. -2/9, n, 1 Suppose 3z - 22 = 4n, -4z + 3n + 22 = z. Let h be (-2(3 + z))/2. Let c(i) = -i*2 - 5i - 3. Let r be c(-4). Put h, r, 0 in increasing order. h, 0, r Let k = 386 + -384. Let x be 1/(1/(-2) + 1). Suppose 0 = -f - xf + 3. Put 5, f, k in increasing order. f, k, 5 Suppose 550 = -7f + 2f. Let z = 552/5 + f. Let i = 16.74 + -16.6. Put z, i, -1/5 in ascending order. -1/5, i, z Let g = -18 + 20. Suppose 0t + 4s = -gt + 6, 0 = 4t - 2s - 22. Put -3, t, -5 in ascending order. -5, -3, t Let k be (-40)/5 + 0 + 1. Let c = 64 + -59. Suppose a + 4x - 5 = 0, ca - a = -2x + 6. Sort a, -5, k in decreasing order. a, -5, k Let f = -2 + 0. Let n = 84 + -109. Let x = n - -22. Put -2/9, x, f in decreasing order. -2/9, f, x Let n = -14 + 16. Suppose 2q - n + 8 = 0. Let p be 0 + 1 - (2 + -2). Put p, q, -5 in decreasing order. p, q, -5 Let x = -55 - -54. Sort x, -3, 4, 1/35 in increasing order. -3, x, 1/35, 4 Suppose 0 = l - 2m + 7, -8 = -l + 5m - 6m. Sort 4, -1, l, 0. -1, 0, l, 4 Let a = -4 - -2. Let t be ((-4)/(-8))/(a/(-12)). Suppose 5c + 6 = 3u, -u + 9 - 6 = -2c. Sort t, c, -6 in ascending order. -6, c, t Let o be 3 - (0 - 2)1. Sort -5, -7, o. -7, -5, o Let h be (8/20)/((-4)/(-20)). Let x(i) = 2i + 2. Let l be x(3). Suppose s - l = -s. Sort h, s, 1. 1, h, s Let h(r) = r*2 - 7r + 6. Let a be h(4). Suppose -4d = 4u - 20, -2d - 2 = u - 3u. Sort u, a, 0 in increasing order. a, 0, u Let k be (17 + -5 + 1)*(0 + 1). Let j = k - 16. Put 5, -2, j i	{ "pile_set_name": "DM Mathematics" }
er? False Let j(z) = z*2 - 5z - 1. Let n be j(6). Let q = 5 - n. Suppose q = 4f + 4t - 64, 0 = -5f - 2t + 22 + 43. Is f a prime number? True Let i = 11 - 6. Is (0 - -1)/(i/1115) prime? True Suppose 0 = 5p, -2z + p + 246 = -2p. Is z/18 + (-2)/(-12) composite? False Let u be (-27)/1222. Is (-3)/u + (-152)/(-3) a composite number? True Let d(f) = 66f*2 + 4f + 3. Is d(-2) a prime number? False Suppose -3m + 2y + 160 = -319, -3m + y = -484. Is m composite? False Let f(l) = -l2 + 8l + 7. Let z(h) = h*3 - 6h*2 - 3h + 9. Let n be z(6). Let p(m) = m*3 + 10m*2 + 9m + 6. Let i be p(n). Is f(i) prime? True Let w = -43 - -9. Let v = w + 48. Is 914/14 - 4/v composite? True Is 35 + (-2 - (-5 + 3) - 1) a prime number? False Let g = 4 + 1. Suppose 2t = gt - 9. Suppose -t = 2y - 11. Is y composite? True Suppose -3x = -50 - 583. Is x a composite number? False Let x(z) = -3 - 38z3 + 7z - 3z - 2z + 4. Is x(-1) a prime number? True Suppose -4n + 13 - 1 = 2h, 0 = -5h + 4n - 12. Let m(y) = y*3 + y. Let w be m(h). Suppose -z + 9 + 46 = w. Is z prime? False Suppose -k - 2k = -6. Suppose kz = -4n + 366, 0 = -2z + n - 2n + 378. Is z a composite number? False Let o = 1883 - 774. Is o a composite number? False Let x(o) = o*2 - 5o - 6. Let h be x(5). Let r be (-34)/(-6) - 2/h. Is (28/r)/(8/12) prime? True Let z(s) = -s*2 - 2s + 2. Let t be z(2). Let x = 7 + -27. Let c = t - x. Is c a composite number? True Let q be (-6)/(-36) - 34/(-12). Suppose -qs + 509 - 74 = 0. Is s prime? False Let j(k) = 2k3 + k2 - 6k3 + 3k*3 - 1 - 5k*3. Let q be j(1). Is (-2)/q(392 + 1) a composite number? False Let f(g) = -g*3 + 12g*2 + 9g - 1. Is f(-4) a composite number? True Suppose 2t = 4a + 18, -3t + 3a + 16 = -26. Let u = 50 - t. Is u prime? True Let f(y) = 12y3 + y2 + 3y - 7. Let t be f(5). Suppose 3w = -24 + t. Is w a prime number? True Let u be -1 - (0 + (1 - 2)). Suppose 4c - 3k - 307 = u, -26 = 4k - 6. Suppose 3y = -2d + c - 26, 3d - 4y - 45 = 0. Is d prime? True Let j = -43 - -28. Is (j/5)/(2/(-10)) a composite number? True Suppose -4 = -q - 0q. Let n(r) = 15r - 5. Is n(q) composite? True Let b(v) = 34v2 - v + 1. Is b(4) a prime number? True Suppose 0 = -8q - 4q + 12468. Is q composite? False Let i(k) = -k2 + 20k + 34. Is i(15) prime? True Suppose -347 - 1130 = -7w. Is w a composite number? False Suppose 2o - 4o = 2l - 1778, l - 881 = 3o. Is l a prime number? True Let t = 93 + -56. Is t composite? False Let o = 1306 + -755. Let f = o + -348. Is f prime? False Suppose -5f + 2761 = 3d - d, -3f - 2d = -1655. Is f a composite number? True Suppose 3g - 121 = -u, -3g - 208 = 4u - 719. Let t = 236 - u. Is t a composite number? True Let r = 114 + -79. Let h = 60 - r. Is h a composite number? True Suppose -3p + 712 = 5x, -2p - 2p - 4 = 0. Is x a composite number? True Let o = -1044 - -1513. Is o a prime number? False Suppose 16 = 6a - 2a + 2u, -5a + 5u = -20. Let k be a/10 - (-64)/40. Suppose 290 = -0p + kp. Is p prime? False Let u = 28 - -7. Is u a composite number? True Suppose 3c - i - 2 = 8, 3c - 5i = 14. Let a(d) = d*2 - 4d + 2. Let v be a(4). Is (183 - (v - 3)) + c prime? False Let m(a) be the third derivative of 0a - 1/8a*4 + 2a*2 + 1/20a*5 + 1/6a*3 + 0. Is m(-3) a composite number? False Suppose 0 = 5d - 4z - 959, -4d + 760 = 2z + 2z. Is d composite? False Let g(o) = o*2 - 2o + 2. Let b(d) = -d*2 + d - 1. Suppose 5j = 4m - 29, -2j + m - 2m - 9 = 0. Let r(y) = jb(y) - 4g(y). Is r(10) prime? True Let v(u) = 7u*2 + 20. Is v(-9) composite? False Suppose 5t = -0t + 4a + 52, -5a = 3t - 46. Suppose -2z = -6z + t. Suppose -v + 37 = -2w, 2w - 74 = -2v - zw. Is v a prime number? True Let x(w) = -2w3 + 4w*2 - 3w. Let j be x(2). Let l be 93/j(-1 + -1). Let y = -21 + l. Is y composite? True Suppose 4w = -f + 3w + 8, 0 = -5f - 4w + 35. Suppose 4 = fc - c. Suppose 2i + ci = 136. Is i a composite number? True Let n be (3/6)/((-1)/(-10)). Suppose -nd + 0d = -900. Suppose v - 217 = d. Is v composite? False Let y be 4/1 + 1-2. Let v be 7/y + 1/2. Suppose -2b = 3u - 35, 120 = -0b + 4b - vu. Is b a composite number? True Let x(t) = t*3 - 11t*2 - 12t. Let s be x(12). Suppose -5z - 20 + 565 = s. Is z composite? False Let r(b) = 6b*2 + 6b + 7. Let z(i) = -11i2 - 12i - 14. Let o(u) = 5r(u) + 2z(u). Is o(5) prime? False Suppose 590 + 475 = -5z + 5s, 0 = -2z - 3s - 421. Let y = -121 - z. Is y a prime number? False Let k be ((-2)/(-2))/1 - -1. Is 55 - (2 - (k + -2)) a prime number? True Let h be (29 - 7)/(-3 + 1). Let a = 52 + -22. Let i = h + a. Is i a composite number? False Let y(h) = -4h2 - 45h + 28. Let n(w) = -w*2 - 11w + 7. Let x(b) = 9n(b) - 2y(b). Is x(-7) a prime number? False Let y(c) = -98c + 5. Is y(-1) a composite number? False Let r = -118 + 208. Suppose 5f - r = 65. Is f prime? True Let c = 37 - -228. Is c prime? False Let p(o) = -o*3 - 8o*2 + 8o - 6. Let n be p(-9). Suppose -5t - 20 = 0, w - 147 = 2t + nt. Is w a prime number? True Suppose 2f - 8 = 5s - 4s, 0 = -4f - 3s + 16. Let j(x) = -x. Let q be j(-5). Suppose 0 = -0b - qb + 4a + 257, 0 = -fb - 4a + 220. Is b composite? False Let u(m) be the second derivative of -m3/6 - m2 - 4m. Let z be u(-5). Suppose -2g = -zc - 154, -2c - 2c = 2g - 182. Is g a prime number? True Let l(g) = g2 - 2g + 16. Is l(-7) prime? True Let x(q) = 30q3 - q2 + q - 1. Let p be x(2). Suppose -4y = 53 - p. Is y a composite number? True Let m = 7 + -5. Suppose -4c + 2348 = -g, -4c + 0g + mg + 2348 = 0. Is c prime? True Suppose 5a - 6 - 29 = 0. Suppose ab - 2b = 660. Suppose -5w - 331 = -5k - 2w, w = 2k - b. Is k composite? True Suppose -q - 3 = -49. Suppose i = -i + q. Is i a composite number? False Let u(w) = w2 + 4w. Let r be u(-4). Suppose m + o = 3, -3o + ro = 5m - 19. Suppose -mv - 121 = -3n, -v + 145 = 3n - 0v. Is n a composite number? False Is (84/(-60))/((-8)/10)6676 a composite number? True Suppose -8i = -1498 - 926. Is i a prime number? False Let b(j) be the second derivative of 1/10j*5 + 0j*2 - 3j - 1/4j4 - 1/3j*3 + 0. Is b(3) prime? False Suppose 4j + 5 = 4a + 37, 2j + 9 = -3a. Suppose jr = 0, -3p - 3 + 15 = r. Suppose -ps + 4t = -132, -2t = -s - 6t + 43. Is s a composite number? True Let b = -529 - -755. Suppose 0 = 3s - 6s + 4v + 129, -5s = -3v - b. Is s prime? True Let z(c) = 58c - 5. Let i be z(4). Suppose 0 = -4t + 1825 + i. Suppose -4d - 197 = -t. Is d prime? True Suppose l + 5 - 9 = 0, 4l = -5p + 30621. Is p composite? False Suppose -9 = 3t, 0 = -0a - 3a - 2t + 4683. Is a a composite number? True Suppose -2k - 2 = -0k, -4k = 4n - 1960. Is n a prime number? True Suppose 5i - 3118 = 3i. Is i prime? True Let r = 831 - 556. Let p = r - 114. Is p a composite number? True Let r be 0/(-1(-6)/3). Let k(a) = -a*3 + 5a*2 + 4a - 2. Let o be k(5). Suppose r = 2f - o. Is f a prime number? False Suppose 3 = 3b + 6. Is b/(-3) - (-22)/6 composite? True Let n = -2596 - -4517. Is n composite? True Suppose -s + 10 = s. Suppose -sl = -3l - 446. Is l a prime number? True Let v(i) = -24i - 1. Let s(c) = c3 + 6c*2 + 4c - 2. Let w be s(-5). Suppose -4j = -t, -wj - 6 = -j + t. Is v(j) composite? False Suppose -9222 = -5m - 707. Suppose 350 - m = -3n. Suppose -r - v = -162, -3r = -v - 3v - n. Is r a composite number? False Suppose -4g + 376 = 4o, 3o = g - o - 99. Suppose 3r - 3f - 95 = 7, -3r + g = 4f. Is r a prime number? False Suppose -5a = -4a - 111. Is a a composite number? True Let u = -3 + 5. Suppose 0 = -uy + 5 + 5. Is (67/(-3))/(y/(-15)) composite? False Is 1596/30 - 2/10 a prime number? True Let f(y) = -2y - 4. Let u be f(-3). Suppose 0 = -2h + 4v - 33 + 203, -3h + 255 = uv. Is h a composite number? True Let h be (4/12)/(2/36). Let i(z) = z2 + 1. Let s(g) = -5g*2 - 7g - 2. Let y(m) = -6i(m) - s(m). Is y(h) a prime number? True Let v(w) = w2 + 11w + 1. Suppose 2u - 9 = m, 0 = -2m - 3u + 5u - 20. Let n be v(m). Suppose -s + q + 66 = -14, 0 = q + n. Is s a composite number? False Is 1545/(-45)-33 a composite number? T	{ "pile_set_name": "DM Mathematics" }
+ 5m - 4. Let i be (-29)/6 + (-5)/30. Let z(f) = 8f*3 - 6f*2 + 6f - 5. Let p = 12 + -6. Determine iz(g) + ph(g). 2g3 + 1 Suppose -2x - 3d - 30 = 2x, -2x = -3d + 6. Let t = 7 + x. Let z(p) = 6p3 + 5p*2 - 3p. Let g(n) = -n3 - n2 + n. Give tz(r) + 5g(r). r*3 + 2r Let p(n) = n*3. Let r(b) = -3b3 - b2 + 5b - 5. Let t(j) = -j3 - j + 1. Let y(x) = r(x) + 5t(x). Calculate -18p(s) - 2y(s). -2s3 + 2s*2 Let r(n) = n - 3. Let m be 15(-1 - 8/(-12)). Suppose 4y + 8 = 24. Let p = m + y. Let w(g) = 1. Calculate pr(s) - 3w(s). -s Suppose -4l - 3y = 24, -5l + y = 4y + 30. Let v(a) = -2a. Let t(n) = -n. Give lt(u) + 2v(u). 2u Let u(h) = -h + 4h*2 + 1 + 6h*2 - 4 - 7h*2 + 5h*3. Let t(f) = -6f*3 - 4f*2 + f + 4. What is 3t(w) + 4u(w)? 2w*3 - w Let h = 1 + -5. Let o(q) be the first derivative of -7q*4/2 + 11q*3/3 + 9q*2/2 - 1. Let i(d) = -5d*3 + 4d*2 + 3d. What is ho(x) + 11i(x)? x*3 - 3x Let j(i) = -13i + 7. Let o(s) = -12s + 6. Calculate -5j(u) + 6o(u). -7u + 1 Let j(f) = 4f + 16. Let o(d) = -7d - 31. Give -11j(h) - 6o(h). -2h + 10 Let c(f) = 5f2 + 7f - 9. Let h(t) = -3t2 - 4t + 5. Determine 4c(u) + 7h(u). -u2 - 1 Let d(m) = -m3 - m*2 - 1. Let q(x) = 4x*3 + 5x*2 - 7x + 5. What is 5d(l) + q(l)? -l3 - 7l Suppose -2d - 4 = 8. Let c(r) = 8r + 5. Let g(o) = 17o + 11. Determine dg(a) + 13c(a). 2a - 1 Let w(t) = 5t2 + 3t + 3. Suppose 4 + 4 = -4x. Let l be x/2 - (-2)/(-1). Let g(k) = 26k*2 + 16k + 16. What is lg(n) + 16w(n)? 2n2 Let b(f) = -f - 1. Let k(m) be the second derivative of 5m3/6 + m2 - 12m. Suppose 6y - y = -10. Let c be (1 - y/1)1. Determine cb(u) + k(u). 2u - 1 Let y(m) = 11m - 13. Let b(n) be the first derivative of -6n + 1 + 5/2n*2. Calculate 9b(g) - 4y(g). g - 2 Suppose 8h + 16 = 4h. Let o(x) be the second derivative of -x3/2 + x2 + 38x. Let y(d) = -2d + 2. Give ho(s) + 5y(s). 2s + 2 Let r(n) = -3n2 - n + 2. Let i(h) = -7h*2 - 3h + 5. Let q be 8/5 + (-6)/(-15). What is qi(v) - 5r(v)? v*2 - v Let f(k) be the third derivative of 0 + 1/12k*4 + 0k + k*2 + 1/20k*5 + 1/3k*3. Let y(t) = 48t*2 + 33t + 33. Determine 33f(q) - 2y(q). 3q2 Let a(h) = -3h*2 + 2h + 2. Let u(y) = -16y2 + 10y + 10. Let i = -4 - -15. Calculate ia(b) - 2u(b). -b*2 + 2b + 2 Let s(y) be the second derivative of 1/12y4 + 0 - 1/2y*2 - 1/6y*3 + 2y. Let w(m) = -4m2 + 2m + 2. What is -2s(h) - w(h)? 2h*2 Let g(x) = -5x. Let q(o) = -2o - 5o + 3o. Let s(d) = -d. Let j be s(3). Give jg(m) + 4q(m). -m Let q(d) = -d - 1. Let s(h) = -18h*2 + 3h + 3. Calculate 6q(a) + 2s(a). -36a2 Let v(a) = -16a*2 - 5. Let u(l) = 17l*2 + 4. Calculate -4u(y) - 3v(y). -20y*2 - 1 Let n(w) = -15w - 7. Let i(l) = 7l + 3. Calculate -9i(a) - 4n(a). -3a + 1 Let l(a) = -6a3 + 4a*2 + 3a + 3. Let n(m) = 7m3 - 5m*2 - 3m - 4. Calculate 4l(f) + 3n(f). -3f3 + f2 + 3f Let c(h) = 8h2 + 4h - 6. Let f(x) = -7x2 - 4x + 5. Calculate 5c(n) + 6f(n). -2n2 - 4n Let o(f) = 3f3 - 2f*2 + 2. Let a(k) = 12k*3 - 9k*2 + 9. What is 4a(b) - 18o(b)? -6b3 Let i(d) = 1 - 4 + 2. Let a(n) = -n2 + 3n + 4. Let p be a(3). Let l(z) = -z + 0 + 4z - z + p. Calculate -5i(v) - l(v). -2v + 1 Suppose 2u = 3u - 2. Let q(k) = 2 + 3k + k - 13k*3 - 6 - 11k*u + 0k*2. Let i(b) = 7b*3 + 6b*2 - 2b + 2. Determine 11i(p) + 6q(p). -p*3 + 2p - 2 Let p(l) = -2l + 24. Let w be p(9). Let m(f) = 9f*2 + 5f + 1. Let x(o) = -o*2 - o. Give wx(s) + m(s). 3s2 - s + 1 Let r(d) = 4d + 2. Let c(s) be the first derivative of 9/2s2 + 5s - 2. Give -6c(o) + 14r(o). 2o - 2 Let y(r) = r3 - 8r*2 + 7r. Let l(q) = -q2 - q + 1. Let k(u) = u3 - 6u2 + 7u - 1. Let d(x) = -k(x) - l(x). Calculate -7d(f) - 6y(f). f3 - f2 Let q(s) = 3s + 18. Let l(m) = 1. Let x(p) = -18l(p) + q(p). Let c(a) = 5a. Determine -5c(w) + 8x(w). -w Let x(b) be the third derivative of -b5/60 + b4/6 - b3/2 - b2. Let q(u) = u2 - u + 1. Let t be (5/2 - (-9)/18) + -4. Give tx(w) - 2q(w). -w2 - 2w + 1 Let r(h) = 6h3 + 6h - 2. Let k(v) = -v*3 - v + 1. Determine -5k(y) - r(y). -y*3 - y - 3 Let o(w) = 7w*2 - 7. Let r(g) = -7g*2 + 6. What is -6o(c) - 7r(c)? 7c*2 Let w(m) = -3m*2 - 3m + 1. Let u(n) = -2n2 - 2n + 2. Give 4u(g) - 3w(g). g*2 + g + 5 Let r(h) = 9h3 + h2 + 40h - 5. Let w(l) = -5l3 - l2 - 20l + 3. What is 3r(g) + 5w(g)? 2g*3 - 2g*2 + 20g Let n(u) = -6u3 + 26u*2 - 20. Let c(w) = -2w*3 + 9w*2 - 7. What is 17c(k) - 6n(k)? 2k*3 - 3k*2 + 1 Let f(d) = -2d*2 - 3d - 2. Let y(k) = -5k2 - 7k - 5. Suppose -4u + 40 = 4b, -3u + 5b = -7 + 1. What is uf(x) - 3y(x)? x*2 + 1 Let m(j) = -2j*2 - 4j - 2. Let u(f) = f*3 + 15f*2 - 17f - 5. Let x be u(-16). Let a(c) = 5c2 + 11c + 5. Determine xm(n) + 4a(n). -2n2 - 2 Let w(d) = -3d. Let a(n) be the first derivative of 13n2/2 + 2. Suppose -5t = -2g - 38, -2t = 2g + 9 + 1. Give gw(v) - 2a(v). v Let g = -1 - 3. Let n(u) = 14u - 20. Let a(t) = 5t - 7. Let m be -41/4(1 + -12). Give gn(w) + ma(w). -w + 3 Let d(v) = 4v - 2. Suppose -2n - 3n = -15. Let i(z) = -7z + 3. What is ni(h) + 5d(h)? -h - 1 Let l(v) = -21v - 9. Let w(n) = 14n + 6. Determine -5l(d) - 8w(d). -7d - 3 Let w(x) = -9x + 9. Let q(j) be the third derivative of j4/6 - 2j*3/3 + 13j*2. Give -13q(o) - 6w(o). 2o - 2 Let u(r) = -r*3 - 2r - 2. Let d(i) = -23i - 21i - 1 + 43i. Calculate -2d(f) + u(f). -f3 Let s(l) = l2 + l - 1. Let m(u) = -4u2 - 3u + 3. What is 2m(r) + 6s(r)? -2r2 Let w = 12 - 16. Let o(c) = -3c3. Let p(f) = f3. Give wo(m) - 14p(m). -2m3 Let p(n) = -24n*3 + 5n - 9. Let y(g) = 12g3 - 2g + 4. What is 2p(w) + 5y(w)? 12w3 + 2 Let q(s) = 32s - 5. Let x(r) = -80r + 12. Calculate 12q(p) + 5x(p). -16p Let o(h) = -41h - 32. Let q(p) = -20p - 15. Determine 6o(a) - 13q(a). 14a + 3 Let d(g) = 3g*2 + 9g + 9. Let z(n) = -n - 1. Let y be z(-6). Let o(f) = f*2 + 4f + 4. Suppose -2a + 13 = 17. What is ad(v) + yo(v)? -v2 + 2v + 2 Let h(o) = 1. Let b(n) = 8n - 3. Calculate b(m) + 4h(m). 8m + 1 Let o(h) = -11h*2. Let l(i) = 4i*2. Let d = 8 + -3. Suppose dx + 0x = 0. Suppose -3q + 2q + 3 = x. What is qo(f) + 8l(f)? -f2 Let r(u) = -u2 - u + 1. Let n(z) = -3z*2 - 4z + 2. Let a be 117/(-24) - 7/56. Determine ar(s) + n(s). 2s*2 + s - 3 Let m(f) = -4f*3 - 1 + 0f*2 + 5f*2 - 61f + 2f2 + 54f. Let w(k) = -3k3 + 6k*2 - 6k - 1. Calculate -6m(y) + 7w(y). 3y3 - 1 Let g(s) = -s2 - s + 1. Let o(b) be the first derivative of 2b*3 + 2b*2 - 7b - 1. Determine 5g(v) + o(v). v2 - v - 2 Let f(j) = -j3 - 3j2. Let c(r) be the second derivative of r5/20 + r*4/6 + 4r. Give 3c(g) + 2f(g). g*3 Let d(v) = v + 5. Let t(o) = -o - 7. Let z(k) = -6k + 4. Let x be z(3). Let a be t(x). Let b(f) = -f - 6. Calculate ad(c) + 6b(c). c - 1 Let z(m) = 13m3 - 4m - 8. Let x(p) = -25p3 + 7p + 15. Give 4x(q) + 7z(q). -9q3 + 4 Let m(a) = -a - 1. Let v(n) = -21n - 2. Give -2m(r) + v(r). -19r Let s(x) be the third derivative of -x*4/24 - 4x*2. Let w(m) = 2m - 1. What is -3s(q) - 2w(q)? -q + 2 Let r be 6/(-9)(-6)/(-4). Let k(j) = j2 - j - 3. Let g(q) = 1 + 3q - 4q + 0q. Let m(v) = 3g(v) + k(v). Let d(c) = -c. Determine rm(s) + 2d(s). -s2 + 2s Let j(i) = 6i - 3. Let t(h) = h - 1. Let u = -30 + 31. Give uj(c) - 5t(c). c + 2 Let u(s) = 9s*2 + 6s - 6. Suppose -2q + 5m + 1 + 2 = 0, 0 = -5q + 3m - 2. Let y(z) = -z*2 - z + 1. Give qu(n) - 6y(n). -3n*2 Suppose 0 = -4j - 20 - 4. Let b be (9 + 0)(-1 + 0). Let s = j - b. Let l(c) = -3c - 6. Let m(o) = -2o - 5. What is sl(i) - 4m(i)? -i + 2 Let h(z) = -29z. Let c(d) = -30d. What is 5c(x) - 4h(x)? -34x Let a(l) = -3l - 2. Let m(i) = -i - 1. Let c(u) = -2u*2 - 2u + 2. Let x(n) = -c(n) - m(n). Let v(w) be the first derivative of x(w). Give 3a(h) + 2v(h). -h Let w(r) = -31r + 1. Let x(p) = 6p. Calculate 2w(j) + 11x(j). 4j + 2 Let f(b) = b. Let d = -10 + 11. Suppose -2p - 2*p + 1	{ "pile_set_name": "DM Mathematics" }
ograms. 89129580 Convert 39.24017 centimeters to kilometers. 0.0003924017 Convert 4740.03km to millimeters. 4740030000 What is thirteen quarters of a millimeter in micrometers? 3250 Convert 21685.39ml to litres. 21.68539 What is seven quarters of a millennium in decades? 175 What is 0.7913771 milligrams in tonnes? 0.0000000007913771 Convert 11248.335 nanoseconds to weeks. 0.0000000000185984375 How many meters are there in 8.35333 micrometers? 0.00000835333 How many months are there in twenty-one eighths of a decade? 315 How many meters are there in 3/40 of a kilometer? 75 What is five quarters of a kilogram in grams? 1250 How many minutes are there in twenty-three sixths of a day? 5520 How many hours are there in 40.55091 weeks? 6812.55288 How many micrometers are there in eleven quarters of a centimeter? 27500 How many decades are there in twenty-nine halves of a millennium? 1450 How many millilitres are there in 21/4 of a litre? 5250 How many millilitres are there in sixty-four fifths of a litre? 12800 Convert 231.9676nm to meters. 0.0000002319676 How many millimeters are there in fifty-four fifths of a centimeter? 108 How many years are there in 32/5 of a millennium? 6400 Convert 143.9691 millimeters to meters. 0.1439691 What is seventy-three quarters of a litre in millilitres? 18250 Convert 37817.98ms to nanoseconds. 37817980000 Convert 807628.4 nanograms to kilograms. 0.0000008076284 What is thirteen fifths of a kilogram in grams? 2600 How many nanometers are there in 88632.35mm? 88632350000 What is 141.3288kg in tonnes? 0.1413288 What is 13/4 of a second in milliseconds? 3250 What is fourty-three halves of a micrometer in nanometers? 21500 How many years are there in 3/40 of a millennium? 75 What is 11/4 of a litre in millilitres? 2750 How many millennia are there in 58.067 centuries? 5.8067 How many millilitres are there in 314.1083l? 314108.3 How many days are there in ten sevenths of a week? 10 What is 0.7455804ug in tonnes? 0.0000000000007455804 How many micrometers are there in 3.556824 meters? 3556824 How many centuries are there in 83168.06 decades? 8316.806 How many days are there in 21717725.4us? 0.0002513625625 How many micrograms are there in 639504.2g? 639504200000 What is 6161.418 millilitres in litres? 6.161418 What is five sixths of a millennium in months? 10000 Convert 0.3848581t to grams. 384858.1 How many minutes are there in seven sixths of a week? 11760 How many milligrams are there in 3/5 of a gram? 600 How many millimeters are there in 0.7240265 kilometers? 724026.5 How many grams are there in three tenths of a kilogram? 300 Convert 82124.3ug to nanograms. 82124300 Convert 279.628 years to decades. 27.9628 How many seconds are there in 0.7648352us? 0.0000007648352 How many minutes are there in thirty-three fifths of a day? 9504 What is 18/5 of a millennium in decades? 360 How many seconds are there in 28/3 of a minute? 560 What is 0.1572071 minutes in nanoseconds? 9432426000 What is thirteen fifths of a litre in millilitres? 2600 What is 608.1946g in micrograms? 608194600 How many micrometers are there in 1/20 of a millimeter? 50 What is 56724.51 millilitres in litres? 56.72451 Convert 7.932961 millilitres to litres. 0.007932961 Convert 8.32776ml to litres. 0.00832776 How many centimeters are there in 31153.28km? 3115328000 What is 236.0204 litres in millilitres? 236020.4 How many months are there in 7/3 of a decade? 280 How many decades are there in 4474.1 centuries? 44741 What is 2.724079 millennia in months? 32688.948 What is thirty-three fifths of a meter in millimeters? 6600 How many millimeters are there in 0.799328um? 0.000799328 What is 38098.03 hours in microseconds? 137152908000000 Convert 234570.9 millennia to decades. 23457090 How many days are there in 6.8259375 seconds? 0.00007900390625 How many millilitres are there in 11/4 of a litre? 2750 What is 92865.71 decades in millennia? 928.6571 What is 26.08757 millennia in years? 26087.57 What is 8/25 of a litre in millilitres? 320 How many centimeters are there in 97271.87 meters? 9727187 How many kilometers are there in 0.2460391nm? 0.0000000000002460391 How many seconds are there in 9/10 of a minute? 54 How many microseconds are there in 4.110514 hours? 14797850400 What is 4878.725 kilograms in nanograms? 4878725000000000 What is 31625.88 decades in centuries? 3162.588 What is 6/25 of a kilometer in meters? 240 How many hours are there in 7/4 of a week? 294 How many micrograms are there in seventeen quarters of a milligram? 4250 Convert 79.71758t to grams. 79717580 What is fifty-seven halves of a decade in months? 3420 What is 25/8 of a milligram in micrograms? 3125 What is 53/5 of a kilometer in meters? 10600 What is 3/5 of a litre in millilitres? 600 Convert 0.9778086 months to centuries. 0.0008148405 What is 1/4 of a micrometer in nanometers? 250 How many centimeters are there in 1/5 of a kilometer? 20000 How many kilograms are there in one fifth of a tonne? 200 Convert 116830.7 centimeters to nanometers. 1168307000000 What is twenty-one quarters of a litre in millilitres? 5250 What is three eighths of a tonne in kilograms? 375 How many seconds are there in 9/16 of a hour? 2025 What is 3/10 of a millennium in centuries? 3 Convert 83235.03 kilometers to nanometers. 83235030000000000 How many tonnes are there in 7.097833kg? 0.007097833 Convert 9923.966l to millilitres. 9923966 How many micrograms are there in fourty-six fifths of a milligram? 9200 What is 6278.566 millimeters in nanometers? 6278566000 What is one quarter of a hour in seconds? 900 Convert 0.0699423 centuries to millennia. 0.00699423 What is 1.108845mg in nanograms? 1108845 How many millilitres are there in one fifth of a litre? 200 What is 0.6350255 years in months? 7.620306 What is 1/10 of a second in milliseconds? 100 What is 731.4132ug in nanograms? 731413.2 How many millilitres are there in twenty-one halves of a litre? 10500 How many days are there in 12.4892847 microseconds? 0.00000000014455190625 Convert 6642.863 weeks to seconds. 4017603542.4 What is 5/4 of a week in hours? 210 Convert 31.95437l to millilitres. 31954.37 What is four sevenths of a week in hours? 96 Convert 69.96395 millennia to decades. 6996.395 What is 5/28 of a week in hours? 30 Convert 74708.86 millennia to years. 74708860 What is 1/16 of a hour in seconds? 225 How many months are there in seven fifteenths of a decade? 56 What is one quarter of a millennium in years? 250 What is 27/2 of a kilogram in grams? 13500 What is one tenth of a litre in millilitres? 100 How many seconds are there in three eighths of a day? 32400 What is 1886934.9 months in years? 157244.575 How many grams are there in five eighths of a kilogram? 625 What is 25.50387 millimeters in micrometers? 25503.87 How many millilitres are there in twenty-one eighths of a litre? 2625 How many centimeters are there in 3/16 of a kilometer? 18750 How many litres are there in 3.921362ml? 0.003921362 What is 1.424246 millilitres in litres? 0.001424246 How many years are there in 34/5 of a millennium? 6800 What is eleven quarters of a meter in centimeters? 275 How many milligrams are there in fifteen quarters of a gram? 3750 How many meters are there in 3/5 of a kilometer? 600 What is 718.6766 milligrams in micrograms? 718676.6 How many months are there in seven sixths of a year? 14 What is 1/10 of a millimeter in nanometers? 100000 What is twenty-seven fifths of a century in decades? 54 How many centimeters are there in one tenth of a kilometer? 10000 What is 70.31342l in millilitres? 70313.42 What is 27/5 of a millennium in months? 64800 How many weeks are there in 1272.141045 microseconds? 0.0000000021034078125 How many millilitres are there in 657.4918l? 657491.8 How many minutes are there in fourty-two fifths of a day? 12096 What is 0.4476496m in nanometers? 447649600 How many milliseconds are there in 968.1715 hours? 3485417400 What is 8.131761ml in litres? 0.008131761 How many litres are there in 654.6516ml? 0.6546516 What is seventeen quarters of a litre in millilitres? 4250 Convert 7665.129ml to litres. 7.665129 What is 1597.716mg in grams? 1.597716 How many months are there in 2278.977 centuries? 2734772.4 How many meters are there in 490.5	{ "pile_set_name": "DM Mathematics" }
t is the highest common factor of 38 and 1216? 38 Calculate the highest common divisor of 602 and 21. 7 What is the greatest common factor of 40 and 30? 10 What is the greatest common divisor of 351 and 459? 27 Calculate the greatest common divisor of 5 and 24405. 5 Calculate the highest common factor of 12 and 273. 3 What is the highest common divisor of 285 and 2055? 15 Calculate the highest common divisor of 7689 and 33. 33 What is the highest common divisor of 48 and 108? 12 Calculate the greatest common factor of 28 and 56. 28 Calculate the highest common divisor of 869 and 474. 79 Calculate the greatest common factor of 18 and 1827. 9 What is the highest common factor of 1365 and 63? 21 What is the greatest common divisor of 621 and 23? 23 What is the greatest common factor of 203 and 2291? 29 What is the highest common factor of 133 and 16359? 133 What is the highest common factor of 108 and 684? 36 What is the greatest common factor of 93 and 496? 31 Calculate the greatest common factor of 3328 and 338. 26 Calculate the highest common divisor of 684 and 4180. 76 Calculate the greatest common divisor of 1491 and 42. 21 What is the highest common divisor of 240 and 300? 60 Calculate the highest common divisor of 2376 and 88. 88 What is the highest common divisor of 5274 and 18? 18 Calculate the greatest common divisor of 25 and 16200. 25 Calculate the highest common factor of 22 and 13486. 22 What is the highest common divisor of 204 and 153? 51 Calculate the greatest common factor of 130 and 832. 26 What is the highest common factor of 78 and 13078? 26 What is the greatest common divisor of 28 and 798? 14 What is the highest common factor of 8 and 792? 8 Calculate the greatest common factor of 14565 and 10. 5 What is the greatest common factor of 25 and 7825? 25 Calculate the greatest common divisor of 66 and 968. 22 Calculate the highest common divisor of 12 and 1404. 12 What is the greatest common factor of 4 and 5108? 4 What is the highest common factor of 81 and 567? 81 Calculate the highest common factor of 48 and 48. 48 What is the highest common divisor of 100 and 100? 100 Calculate the greatest common divisor of 2597 and 98. 49 What is the highest common divisor of 56384 and 16? 16 Calculate the highest common factor of 4191 and 66. 33 Calculate the highest common factor of 25653 and 51. 51 Calculate the highest common factor of 11577 and 34. 17 What is the highest common factor of 1260 and 490? 70 Calculate the greatest common divisor of 180 and 27. 9 What is the highest common divisor of 6215 and 15? 5 What is the highest common divisor of 245 and 105? 35 What is the highest common factor of 6743 and 22? 11 What is the highest common divisor of 24 and 1980? 12 Calculate the highest common factor of 4455 and 198. 99 What is the highest common factor of 34 and 3536? 34 Calculate the greatest common factor of 4747 and 47. 47 What is the greatest common factor of 196 and 8? 4 Calculate the highest common divisor of 3 and 96. 3 Calculate the highest common divisor of 124 and 4. 4 Calculate the greatest common factor of 17 and 44489. 17 Calculate the highest common factor of 2597 and 53. 53 What is the greatest common divisor of 112 and 7? 7 What is the greatest common divisor of 4070 and 25? 5 Calculate the greatest common factor of 14 and 42. 14 Calculate the greatest common factor of 319 and 58. 29 What is the greatest common divisor of 143 and 286? 143 Calculate the highest common factor of 378 and 72. 18 Calculate the highest common factor of 30 and 96. 6 What is the greatest common factor of 28 and 46116? 28 What is the greatest common factor of 72 and 2748? 12 What is the greatest common divisor of 31137 and 97? 97 What is the greatest common divisor of 250 and 200? 50 What is the greatest common factor of 7218 and 9? 9 Calculate the highest common factor of 387 and 3225. 129 Calculate the greatest common divisor of 35 and 665. 35 Calculate the greatest common divisor of 45 and 240. 15 Calculate the greatest common divisor of 1 and 61. 1 Calculate the highest common factor of 97 and 49373. 97 What is the greatest common divisor of 56 and 40? 8 What is the highest common factor of 931 and 38? 19 Calculate the greatest common factor of 20 and 70. 10 What is the highest common factor of 801 and 89? 89 What is the highest common factor of 1886 and 2050? 82 What is the greatest common factor of 544 and 96? 32 What is the greatest common factor of 13 and 41015? 13 What is the greatest common factor of 2978 and 2? 2 Calculate the highest common divisor of 456 and 3000. 24 What is the greatest common factor of 552 and 192? 24 Calculate the highest common factor of 61 and 14701. 61 What is the highest common factor of 36 and 288? 36 What is the greatest common factor of 12 and 516? 12 Calculate the greatest common divisor of 210 and 945. 105 Calculate the greatest common divisor of 493 and 29. 29 What is the highest common factor of 288 and 126? 18 What is the greatest common factor of 8834 and 56? 14 Calculate the greatest common divisor of 3375 and 125. 125 Calculate the greatest common divisor of 46095 and 105. 105 What is the highest common divisor of 2929 and 58? 29 What is the highest common factor of 378 and 546? 42 Calculate the greatest common divisor of 7093 and 123. 41 What is the highest common factor of 56 and 1694? 14 Calculate the highest common divisor of 21 and 777. 21 What is the greatest common divisor of 21 and 336? 21 What is the greatest common divisor of 260 and 7540? 260 What is the highest common divisor of 462 and 756? 42 What is the highest common divisor of 135 and 54? 27 Calculate the highest common factor of 80 and 64. 16 Calculate the greatest common divisor of 51 and 102. 51 Calculate the highest common factor of 518 and 5106. 74 What is the highest common factor of 1215 and 15? 15 Calculate the highest common factor of 2145 and 880. 55 Calculate the highest common factor of 651 and 21. 21 What is the highest common divisor of 1030 and 10? 10 Calculate the highest common divisor of 53 and 53. 53 Calculate the greatest common divisor of 2507 and 109. 109 What is the greatest common factor of 4108 and 5056? 316 Calculate the greatest common factor of 79 and 1264. 79 Calculate the greatest common factor of 29 and 377. 29 Calculate the greatest common factor of 799 and 47. 47 Calculate the greatest common divisor of 228 and 1444. 76 Calculate the highest common divisor of 688 and 43. 43 What is the greatest common divisor of 1001 and 91? 91 What is the greatest common factor of 480 and 66? 6 What is the highest common divisor of 4601 and 86? 43 What is the highest common factor of 2856 and 5880? 168 Calculate the greatest common divisor of 16056 and 72. 72 What is the greatest common divisor of 14991 and 171? 57 What is the highest common divisor of 84 and 126? 42 Calculate the highest common divisor of 142 and 355. 71 Calculate the highest common factor of 8 and 18. 2 Calculate the greatest common factor of 8 and 464. 8 Calculate the greatest common divisor of 242 and 66. 22 Calculate the highest common divisor of 1012 and 1150. 46 Calculate the highest common factor of 8544 and 16. 16 Calculate the highest common divisor of 413 and 236. 59 Calculate the highest common divisor of 37224 and 88. 88 Calculate the greatest common factor of 942 and 24. 6 Calculate the highest common divisor of 228 and 2850. 114 Calculate the greatest common factor of 1719 and 27. 9 What is the highest common factor of 405 and 81? 81 Calculate the highest common factor of 64 and 3664. 16 Calculate the greatest common divisor of 722 and 76. 38 What is the greatest common divisor of 289 and 153? 17 Calculate the highest common divisor of 396 and 36. 36 What is the greatest common factor of 33539 and 22? 11 What is the highest common factor of 18 and 198? 18 What is the greatest common divisor of 679 and 1261? 97 Calculate the greatest common divisor of 3150 and 189. 63 What is the highest common divisor of 7144 and 760? 152 Calculate the greatest common factor of 164 and 2050. 82 Calculate the highest common divisor of 25 and 365. 5 Calculate the highest common divisor of 18 and 117. 9 Calculate the highest common divisor of	{ "pile_set_name": "DM Mathematics" }
+ 11/4j = 0 for j. -1, 6 Let x(v) be the first derivative of 0v + 9/20v4 + 9/25v*5 + 0v*2 - 1 + 1/10v*6 + 1/5v*3. Factor x(k). 3k*2(k + 1)*3/5 Let c = 1561/9 - 173. Factor -2/9j*3 - c + 2/9j + 4/9j2. -2(j - 2)(j - 1)(j + 1)/9 Let w(v) be the first derivative of -5v4/12 - v3/3 + v2/3 + 7. Find p such that w(p) = 0. -1, 0, 2/5 Let v = 30 + -27. Let u(p) be the first derivative of 0p - 2/33pv - 1/22p*4 - 1 + 0p*2. Factor u(i). -2i*2(i + 1)/11 Let h be (4/12)/(1/9). Factor 4t - t3 - 11t*h + 8 - 28t + 41t2 - 15t*2 + 2t*4. 2(t - 2)*2(t - 1)*2 Let h be (-3)/6 + 65/10. Factor -6 + hy - 3/2y2. -3(y - 2)*2/2 Let f(z) = -2z*2 + 4z - 8. Suppose 15 = -4h - 5. Let r be (2/h)/((-6)/(-60)). Let o(t) = 2t*2 - 5t + 8. Let a(k) = ro(k) - 3f(k). Factor a(d). -2(d - 2)2 Let c(i) be the second derivative of i7/2520 + i4/12 + 2i. Let m(o) be the third derivative of c(o). Solve m(q) = 0. 0 Determine f, given that 0 + 0f + 32/3f*3 - 8/3f*2 - 14/3f*4 = 0. 0, 2/7, 2 Find q, given that 2q - 8q + 38q*3 + 9q*2 + 38q*3 - 79q3 = 0. 0, 1, 2 Let t(c) be the first derivative of c6/8 + 3c5/20 - 9c4/16 - c3/4 + 3c2/4 - 18. Find j, given that t(j) = 0. -2, -1, 0, 1 Solve -10/3v + 4/3 + 2/3v3 + 2v*2 - 2/3v*4 = 0 for v. -2, 1 Suppose 3h - 32 = -8. Let t = h + -6. Factor -13/5pt - 4/5 - 6/5p*3 - 1/5p*4 - 12/5p. -(p + 1)*2(p + 2)*2/5 Let g = 2545 - 10099/4. Factor gr - 27/4r2 - 81/4 + 3/4r*3. 3(r - 3)*3/4 Solve 1/2t*3 - 1/2t*4 + 1/6t*5 + 0 - 1/6t*2 + 0t = 0. 0, 1 Let y(q) be the first derivative of -q*3/5 - 39q*2/5 - 507q/5 - 32. Factor y(m). -3(m + 13)2/5 Let i(n) be the second derivative of -3n5/50 - n4/30 + n3/5 + n2/5 - 43n. Factor i(x). -2(x - 1)(x + 1)(3x + 1)/5 Suppose -5p + 0p = -4p. Factor 0g + 0 - 2/5g*4 + pg*2 + 2/5g*3. -2g*3(g - 1)/5 Let a be 24 + 2/2. Let w be 0 - (a/(-2) + 3). Factor f3 + 1/2f*5 + 1/2 - 3/2f4 + f2 - wf. (f - 1)4(f + 1)/2 Determine y, given that -143y3 + 140y*3 + 15y*2 - 24y + 14 - 2 = 0. 1, 2 Factor 0m4 + 0 - 3/5m*3 + 3/5m*5 + 0m + 0m2. 3m*3(m - 1)(m + 1)/5 Let n be -1 + -2 + 2(-14)/(-4). Factor 1/2d + 3/2d*3 + 1/2d*n + 0 + 3/2d*2. d(d + 1)3/2 Let b(y) be the third derivative of y5/12 + 5y4/8 + 5y3/3 + y2. Factor b(a). 5(a + 1)(a + 2) Let w be -5((-28)/(-15) + -2). Suppose -2p = i - 4, 0p - p + 4 = i. Factor 2/3u*4 + 4/3u*3 + 0u + 0 + pu2 - wu*5. -2u*3(u - 2)(u + 1)/3 Suppose -8c = -29c - 30c. Factor c + 2/3k + 0k*2 - 2/3k*3. -2k(k - 1)(k + 1)/3 Let q(d) = d - 1. Let u be q(11). Let h be -7 - -5 - (-36)/u. Find f, given that hf - 8/5 - 2/5f*2 = 0. 2 Let z(v) = -5v - 6. Let f be z(-2). Factor -2/5g2 + 0 + 2/5g - 2/5g3 + 2/5g*f. 2g(g - 1)2(g + 1)/5 Find g such that -3g5 + 8g*4 - 2g*2 - 4 + 10g + 0g2 - 8g*3 - 2g2 + g5 = 0. -1, 1, 2 Let s(p) = 3p3 + 2p*2 - p. Let q be s(1). Factor -167u*2 + 167u*2 + 3u*q + 12u - 9u3. 3u(u - 2)2(u + 1) Let f(i) be the second derivative of 0 + 0i3 + 6i - 2/5i2 + 1/20i*4 - 1/100i*5. Let f(d) = 0. What is d? -1, 2 Let f be (4 - -1) + -8 - -6. Suppose 2k*2 + 2/3k*f + 4/3k + 0 = 0. Calculate k. -2, -1, 0 Suppose -3p = -2t + 52, 2 - 70 = 4p - 3t. Let g = p + 23. Factor -1/3 - o*2 - 1/3og - o. -(o + 1)3/3 Let m(p) be the third derivative of p8/5880 + p3/6 + p*2. Let a(h) be the first derivative of m(h). Factor a(t). 2t4/7 Let d(s) be the second derivative of s6/8 - 9s5/20 + 9s4/16 - s3/4 - 13s. Factor d(g). 3g(g - 1)2(5g - 2)/4 Suppose 8u = 5u + 24. Suppose 4l - 2k = 8, 0 = -l + 3l + k - u. Factor 1/4xl + 1/4x*2 + 0x + 0. x*2(x + 1)/4 Let y(p) be the third derivative of -p6/840 + p4/56 - p*3/21 + 2p*2. Find v such that y(v) = 0. -2, 1 Suppose c = -66 + 68. Let d(o) be the third derivative of 0o*3 + 0o + 0 + 1/735o7 + 0o*4 - 1/210o*5 + co*2 + 0o*6. Factor d(x). 2x*2(x - 1)(x + 1)/7 Let v(j) be the third derivative of 0j - 2j2 + 0j*3 - 1/120j*5 + 0 - 1/24j*4. Factor v(q). -q(q + 2)/2 Let n = -22 - -12. Let x = n - -10. Factor xb2 + 0 - 2/3b*3 + 2/3b. -2b(b - 1)(b + 1)/3 Suppose -4k + 0k = -8. Factor 2p - p - 3p + 4p*k - 3p*2. p(p - 2) Let d(y) be the first derivative of -5y6/12 + y5/2 + 5y*4/4 - 5y*3/3 - 5y*2/4 + 5y/2 + 8. Suppose d(f) = 0. What is f? -1, 1 Let r be -2 - ((-51)/24)/1. Let v(b) be the first derivative of 0b + 1 - rb*2 - 1/12b*3. Factor v(w). -w(w + 1)/4 Let v(a) be the second derivative of a6/6 - a5/4 - 5a4/6 - 23a. Solve v(b) = 0. -1, 0, 2 Let l(b) be the third derivative of -1/3b4 + 0b - 1/3b3 - 1/105b*7 + 0 - 1/5b*5 - 1/15b*6 - 9b*2. Factor l(m). -2(m + 1)4 Let k(i) be the second derivative of -i3/3 + i2 + i. Let l(v) = -v2 + v. Let j(y) = 4k(y) + 4l(y). Solve j(u) = 0 for u. -2, 1 Let h be (2 - 0/2) + 1. Suppose hi - 26 = -2i + 4c, 3i - 20 = -2c. Factor d + 6 - i + d2. d(d + 1) Let u(t) be the first derivative of t4/24 + t + 4. Let h(z) be the first derivative of u(z). Factor h(c). c2/2 Let r = -2 - -8. Factor 6 + 15z - rz - 3z3 + 0z*3. -3(z - 2)(z + 1)2 Let q(d) = -d3 - 2d*2 + d - 3. Let j be q(-3). Let i be -1(2 - (j - -2)). Suppose 0 + 1/4o + 1/4o*i + 1/2o*2 = 0. What is o? -1, 0 Let -6o*3 + 9/2o*2 + 3/2o*4 - 6 + 6o = 0. Calculate o. -1, 1, 2 Let b = -184 - -1290/7. Suppose 6 = 3v - 6. Factor -bi + 4/7i2 + 2/7i*5 + 0i*3 - 4/7i*v + 0. 2i(i - 1)3(i + 1)/7 Let g(a) = -2a - 5. Let q be g(-4). Factor 1/3m - 11/3m4 + 1/3 - 2m2 - m5 - 14/3mq. -(m + 1)4(3m - 1)/3 Let f(b) be the second derivative of 0 - 1/12b*4 + 4b + 0b2 - 1/6b3. Find j, given that f(j) = 0. -1, 0 Let -w3 + w + 3/4w4 + 1 - 7/4w*2 = 0. What is w? -1, -2/3, 1, 2 Suppose -4l = -5r - 26, l - 3r - 8 = 2. Factor 0 + 6wl - 12w + 24w2 + 2 - 20w*3 + 0. 2(w - 1)*3(3w - 1) Let m(u) = -u2 - 4u - 10. Let r be m(-8). Let s be 1/3 - 130/r. Factor 0 + sf4 + 4/7f*2 - 10/7f*5 + 0f - 18/7f3. -2f*2(f - 1)*2(5f - 2)/7 Suppose -7x + 10 = -9x + 4g, -4x - 5g + 32 = 0. Factor 0 - 4/5w2 + 2/5w + 2/5wx. 2w(w - 1)2/5 Suppose 16 = 4f + 4r, -r = -2 - 0. Find z, given that -6z*4 - 8z*4 + 11 - 26z - 54zf - 15 - 46z*3 = 0. -1, -2/7 Let n be (24/16)/((-6)/(-16)). Suppose ni - 5i = -2. Determine c, given that c - c3 + 0c*i - 1/2 + 1/2c*4 = 0. -1, 1 Let m(c) be the first derivative of -3c*4/16 - 3c*3/4 + 3c + 3. What is h in m(h) = 0? -2, 1 Let a(u) be the second derivative of -21/20u5 + 1/8u*2 + 49/120u*6 + 1/2u*3 + 0 + 11/24u*4 - 8u. Factor a(d). (d - 1)*2(7d + 1)2/4 Let v(g) = -5g*3 + 44g*2 - 33g. Let i(f) = 60f3 - 530f*2 + 395f. Let q(l) = -2i(l) - 25v(l). Factor q(w). 5w(w - 7)(w - 1) Let i = 5 - 3. Let h be (1/(-3))/((-1)/9). Find c, given that -c2 + 3c*2 + 1 - hci + c - c3 = 0. -1, 1 Solve 2/17d3 + 10/17d + 4/17 + 8/17d2 = 0 for d. -2, -1 What is y in -13y2 + y3 + 28y2 - 14y2 = 0? -1, 0 Let o(n) be the second derivative of -n4/3 - 8n3/3 + 10n*2 - 2n. Factor o(j). -4(j - 1)(j + 5) Let a(j) = j*2 + 5j - 4. Let p be a(-6). Suppose 0 = 6k - 166 + 148. Factor 0q + 1/4qp + 0 + 1/4q*5 - 1/4q*4 - 1/4qk. q2(q - 1)2(q + 1)/4 Let u(i) be the second derivative of -i6/1440 - i5/120 - i4/32 - i3/3 + i. Let j(s) be the second derivative of u(s). Factor j(n). -(n + 1)(n + 3)/4 Let j(k) be the first derivative of -5k3/6 - k2 + k/2 + 5. Find v, given that j(v) = 0. -1, 1/5 Factor 432/7s + 1728/7 + 1/7s*3 + 36/7s2. (s + 12)3/7 Let t(u) = u3 + u2 - u. Let k(q) = -10q2 - 4q - 8. Let g(j) = -j3 + j2 + j + 1. Let n(w) = -4g(w) - k(w). Let o(f) = n(f) - 6t(f). Factor o(x). -2(x - 2)(x + 1)*2 Suppose 3v - d = -0d + 17, v = -4d - 16. Factor 3gv - 5g3 + g3 + g*3. 3g*3(g - 1) Suppose -3r = -r - 10. Let k(i) = -i + 9. Let n be k(r). Let -2t*5 + 0t*4 - 2t*4 - 2t**n = 0. Calculate t. -2, 0 Let k(f) = -f	{ "pile_set_name": "DM Mathematics" }
h + 1. Let d(z) = -o(z) + 9v(z). What is the second derivative of d(g) wrt g? 12g2 + 6792g Let v(f) = f*2 + 3f - 10. Let t be v(-6). Let r be 56 - (-2 + 1 - (t - 8)). Differentiate 101x3 - 24x*3 + 22 - rx*3 with respect to x. 60x*2 Let r be ((-3)/4)/(2-1210/3920). Let i(o) be the second derivative of 0o*4 - o + 0 + 0o*3 - ro*2 + 3/10o*5. What is the derivative of i(f) wrt f? 18f*2 Suppose -2s - 290 = -12s. Differentiate 33 - 102 + 82d - sd + 8 - 75 with respect to d. 53 Let x be 1 + (0/(-3))/5 + 4. What is the first derivative of -xk + 58 - 194k2 + 101k*2 + 95k*2 wrt k? 4k - 5 Suppose -21b + 16 = -47. Let n(q) = 2q*2 - 2q + 60. Let f(w) = 2w2 - 3w + 60. Let v(j) = bn(j) - 2f(j). Find the first derivative of v(o) wrt o. 4o Let t(n) = n3 + 6n*2 + 2n + 5. Let i be -1 - (3 - (2 - 3)). Let h be t(i). What is the third derivative of 16r5 - hr*2 - 2r*5 + 9r*5 wrt r? 1380r*2 Let s(m) = 748m*2 + 96m + 4. Let u(f) = -742f2 - 98f - 4. Let n(w) = -3s(w) - 2u(w). What is the second derivative of n(c) wrt c? -1520 Find the second derivative of -29756w2 + 515w*3 + 6963w + 14879w2 - 110w*3 + 244w*3 + 14875w*2 wrt w. 3894w - 4 Let m(j) be the first derivative of -353j4/2 + 2j*3/3 - 909j - 1522. What is the third derivative of m(o) wrt o? -4236 Let i(p) be the first derivative of 60 - 75p + 0p*4 + 82/5p*5 + 0p*2 + 0p*3. Differentiate i(g) with respect to g. 328g*3 Let w = -2219 + 8899/4. Let x(t) be the first derivative of -wt*4 + 13/2t*2 + 0t*3 + 0t + 12. What is the second derivative of x(g) wrt g? -138g What is the second derivative of 2410r + 3619r - 21r*3 - 3031r*2 + 23r*3 wrt r? 12r - 6062 What is the second derivative of 1203k5 + 2161k - 5190k3 - 5182k*3 + 10372k*3 wrt k? 24060k3 Let q(r) = -r4 - r*3 - r + 1. Let g = -44 - -41. Let b(v) = -23v*4 - 3v*3 + 65v + 3. Let s(t) = gq(t) + b(t). Find the second derivative of s(z) wrt z. -240z*2 Let s(m) be the first derivative of 83m6/2 - m4/4 - 662m2 - 317. What is the second derivative of s(n) wrt n? 4980n*3 - 6n Let z(v) be the second derivative of -3v - 1/6v*3 + 8v*5 - 28 + 0v*2 + 151/12v*4. What is the third derivative of z(b) wrt b? 960 Differentiate 937604 - 469618 + 6994f - 472754 wrt f. 6994 Let r(p) = 2146p2 - p + 157. Let b(t) = -10694t*2 + 6t - 784. Let k(y) = -2b(y) - 11r(y). Find the second derivative of k(f) wrt f. -4436 Let z(x) = 3 + 6x3 - 13x*3 + 8x*3 - 5x - 1 - 7x2. Let v be z(8). What is the first derivative of -vl*2 + 50 - 2l + 7l2 + 12l*2 wrt l? -14l - 2 Let k(d) be the first derivative of -9d4/2 - 5d*3/3 - 5298d - 4918. What is the first derivative of k(c) wrt c? -54c2 - 10c Let c(b) = 24916b2 - 20b + 17254. Let o(r) = 37373r2 - 32r + 25880. Let s(j) = -8c(j) + 5o(j). Find the first derivative of s(w) wrt w. -24926w Let n = 78 - 77. Let t be n + 10 - (-1 + 5). What is the derivative of -28k*3 + 15 + 4k*3 + t + 14k*3 wrt k? -30k*2 Let q be 4(-2 - 9/(-4))-35. Let d be ((-185)/q + -5)7. What is the second derivative of 8z - 62z*d + 21z*2 + 5z + 0z wrt z? -82 Let p(c) be the third derivative of -1751c*5/60 - 445c*4/8 + 106c*2 - c. Find the second derivative of p(z) wrt z. -3502 Let i(c) be the third derivative of 0c*6 + 72c*2 + 7/24c*4 - 7/6c*3 + 0c + 0 + 1/60c5 - 5/14c*7. What is the second derivative of i(k) wrt k? -900k*2 + 2 Suppose -38 = -37n + 258. Let g(j) be the first derivative of 5/2j2 + n + 0j + 15/4j4 + 0j*3. Find the second derivative of g(x) wrt x. 90x Let y be (5/(-2))/((-75)/60). Find the second derivative of -74s3 - 51s*3 + 24s - 54s3 + 29s - s*y + 40s*3 wrt s. -834s - 2 Let t(d) be the second derivative of -1883d5/20 - 141d*4/2 - 2129d. What is the third derivative of t(s) wrt s? -11298 Let i(x) = 2x3 - 10x*2 - 7x - 6. Let f be i(6). Find the first derivative of 4 + 44 + fq + 39q - 3 wrt q. 63 Suppose -12t + 10 = -2t. Differentiate -28c - 68 - 52c - t wrt c. -80 Let f be 1/2 + (-6)/((-48)/260). Find the third derivative of 2027j2 - 1992j*2 + fj*3 + 7j*3 wrt j. 240 Suppose -4z + 100 + 16 = 0. What is the derivative of 24t - 27 - 22 + 9t*4 - zt wrt t? 36t3 - 5 What is the third derivative of 47w*3 + 19w*5 - 1906w*2 - 1 + 885w*2 - 2757w*2 - 63w*5 - 141w*2 wrt w? -2640w*2 + 282 Let u(f) be the third derivative of -11567f*4/24 + 4247f*3/2 - 12327f*2. What is the derivative of u(y) wrt y? -11567 Let n(r) be the second derivative of 3r7/14 - r6/30 + 13r5/20 - 1565r4/3 + r3/6 + 1150r + 1. What is the third derivative of n(h) wrt h? 540h*2 - 24h + 78 Let f(n) be the first derivative of -1/6n6 + n2 + 113/5n*5 + 0n + 321 + 0n4 - 23n*3. What is the third derivative of f(g) wrt g? -60g*2 + 2712g Let t be 5/3(-66)/(-22). What is the second derivative of 16a*t + 52 + 5a*3 + 156a - 80a - 78a wrt a? 320a3 + 30a Let y(l) be the third derivative of 578l7/105 + 8l*4/3 - 2l*3/3 - 11l*2. What is the second derivative of y(k) wrt k? 13872k*2 Let l(s) = 46s*2 - 91s + 8. Let h(p) = 10388p2 - 10341p*2 + 6 - 19p - 71p. Let y(g) = -4h(g) + 3l(g). Find the second derivative of y(f) wrt f. -100 Let d = 37480 + -37480. Let f(j) be the third derivative of 0 - 13/15j*5 + dj*4 + 6j*2 + j - 1/6j*3. What is the derivative of f(a) wrt a? -104a Let n = 12861 + -12859. Let h(z) be the third derivative of 3/20z6 + 0z*4 - 7/6z*3 + 0z*5 + 0 + 13z*n + 0z. Differentiate h(s) with respect to s. 54s2 Let q(b) = 5b + 3b2 + 0b + b + 6b - 6. Let v be q(19). Find the second derivative of -1265h*2 + 4 - 4 - 9h + vh2 wrt h. 80 Let d(z) be the first derivative of -95 - 27/2z*2 - 88/3z*3 + 0z. Find the second derivative of d(x) wrt x. -176 Let k(i) be the first derivative of 3787i5/5 + 1808i + 3059. What is the first derivative of k(j) wrt j? 15148j3 Let s = 94 + -155. Let o = 90 + s. Differentiate -ow - 7 + 14w + 12w with respect to w. -3 Let m(t) = 2411t2 - 88t + 2544. Let l(g) = 803g2 - 33g + 848. Let y(k) = -8l(k) + 3m(k). Differentiate y(o) with respect to o. 1618o What is the second derivative of 64 - 5v - 34 + 109v2 + 36 + 19v + 43 wrt v? 218 Let j(r) be the first derivative of -214r5 + r4/2 - 1157r*2 - 1857. What is the second derivative of j(u) wrt u? -12840u*2 + 12u Let f be ((-48)/(-30))/(3/(-45)-6). What is the second derivative of -6 + 1066l + 4l3 + l4 + 27 - 1071l + 0lf wrt l? 12l*2 + 24l Let x(b) = -12b - 93. Let i be x(-8). What is the second derivative of 123q*3 + 37q*3 - q + 2 - iq + 16q3 + 9q wrt q? 1056q Suppose 7i - 402 = i. Find the second derivative of -ia3 + 140a - 69a3 - 10a*3 wrt a. -876a What is the third derivative of -212i4 - 14107599i - 802i2 + 14107599i wrt i? -5088i Differentiate 829049n - 829049n + 8472 + 12040n*2 with respect to n. 24080n Let c(o) = 110o3 - 8o*2 + 31. Let h(m) = 111m*3 - 6m*2 + 30. Let t = -169 + 173. Let b(v) = th(v) - 3c(v). Find the first derivative of b(q) wrt q. 342q2 Let u(o) = o3 - o*2 - o + 33. Let n(k) = -61k*3 + 7k*2 - 4865. Let x(w) = -n(w) + u(w). Differentiate x(z) with respect to z. 186z*2 - 16z - 1 Let u = 359 - 357. Find the second derivative of -12p - up + 30p + 98p*2 + 1 - 8p wrt p. 196 Let l = 43 + -63. Let m be -3 + 2l/(-8). Find the second derivative of -4y + 32y + my*2 + 4y wrt y. 4 Let l(d) = -13802d3 + 358d*2 - 2d. Let b(z) = -138026z3 + 3581z*2 - 21z. Let u(v) = 2b(v) - 21l(v). What is the third derivative of u(w) wrt w? 82740 Let j(t) be the second derivative of 183t + 0 - 3/10t*5 + 0t*7 - 39/4t*4 - 1/14t*8 + 0t*6 + 0t*2 + 0t*3. Find the third derivative of j(p) wrt p. -480p*3 - 36 Find the second derivative of -97z*5 - 98z*3 + 45z*3 - 879z + 882z + 2278 + 34z*3 + 2z*2 wrt z. -1940z*3 - 114z + 4 Let j(w) = -w*3 - 7w*2 - 6w + 2. Let t be j(-6). Suppose s = 3s - 12. Find the first derivative of s + 5 - 20q*2 - t - 17 wrt q. -40q Let	{ "pile_set_name": "DM Mathematics" }
ainder when 4603924 is divided by 350. 24 What is the remainder when 15646 is divided by 15618? 28 Calculate the remainder when 5503350 is divided by 2039. 89 What is the remainder when 45770 is divided by 22778? 214 Calculate the remainder when 149288625 is divided by 194. 193 Calculate the remainder when 33004 is divided by 32667. 337 What is the remainder when 210790 is divided by 3292? 102 What is the remainder when 2054399 is divided by 85597? 71 Calculate the remainder when 6592492 is divided by 86743. 24 What is the remainder when 208787 is divided by 10209? 4607 What is the remainder when 988091 is divided by 674? 7 Calculate the remainder when 378603 is divided by 23. 0 What is the remainder when 25410 is divided by 77? 0 Calculate the remainder when 38856 is divided by 969. 96 What is the remainder when 21876 is divided by 7291? 3 Calculate the remainder when 34400550 is divided by 161. 2 What is the remainder when 134433352 is divided by 2635948? 4 Calculate the remainder when 1979328 is divided by 659770. 18 What is the remainder when 10450562 is divided by 471? 14 What is the remainder when 1834597 is divided by 250? 97 What is the remainder when 2898577 is divided by 676? 565 Calculate the remainder when 16323265 is divided by 252. 217 What is the remainder when 375959 is divided by 34? 21 Calculate the remainder when 53261 is divided by 8858. 113 Calculate the remainder when 95091022 is divided by 168. 166 What is the remainder when 73489 is divided by 2927? 314 What is the remainder when 15080078 is divided by 123? 32 What is the remainder when 7224022 is divided by 532? 526 What is the remainder when 13264604 is divided by 201? 11 Calculate the remainder when 181670 is divided by 3078. 68 What is the remainder when 484611 is divided by 401? 203 Calculate the remainder when 59568830 is divided by 15096. 14 Calculate the remainder when 5499148 is divided by 107. 97 Calculate the remainder when 25010035 is divided by 46. 19 What is the remainder when 3991040 is divided by 1? 0 Calculate the remainder when 23871 is divided by 1258. 1227 Calculate the remainder when 1911398 is divided by 1652. 34 Calculate the remainder when 20793 is divided by 4156. 13 Calculate the remainder when 147978 is divided by 3664. 1418 Calculate the remainder when 26812620 is divided by 764. 40 Calculate the remainder when 212127 is divided by 122. 91 What is the remainder when 5672523 is divided by 947? 940 What is the remainder when 1943189 is divided by 164? 117 Calculate the remainder when 4000740 is divided by 51. 45 What is the remainder when 81462 is divided by 6159? 1395 What is the remainder when 100597018 is divided by 285? 283 Calculate the remainder when 10921643 is divided by 3640544. 11 Calculate the remainder when 5612374 is divided by 6778. 190 What is the remainder when 26718 is divided by 295? 168 What is the remainder when 30808 is divided by 7702? 0 Calculate the remainder when 44162578 is divided by 121. 119 Calculate the remainder when 249240 is divided by 41391. 894 What is the remainder when 668952 is divided by 374? 240 What is the remainder when 166815932 is divided by 12274? 12272 Calculate the remainder when 828823 is divided by 1488. 7 Calculate the remainder when 808533 is divided by 33679. 237 Calculate the remainder when 187955081 is divided by 19. 13 Calculate the remainder when 4220915 is divided by 2007. 194 Calculate the remainder when 43923 is divided by 90. 3 What is the remainder when 1342014 is divided by 670734? 546 Calculate the remainder when 157254413 is divided by 604. 597 What is the remainder when 1529699471 is divided by 108? 107 Calculate the remainder when 1912541 is divided by 129. 116 What is the remainder when 4742033 is divided by 167? 68 Calculate the remainder when 2129325 is divided by 163. 56 Calculate the remainder when 416038 is divided by 4291. 4102 Calculate the remainder when 5761408 is divided by 82. 6 What is the remainder when 16716861 is divided by 94? 89 Calculate the remainder when 246837 is divided by 1387. 1338 What is the remainder when 2766099 is divided by 6202? 7 What is the remainder when 15000349 is divided by 3? 1 Calculate the remainder when 11621721 is divided by 1110. 21 Calculate the remainder when 866200 is divided by 32078. 94 Calculate the remainder when 7590125 is divided by 47. 1 What is the remainder when 388212 is divided by 22655? 3077 What is the remainder when 964388 is divided by 162? 2 What is the remainder when 115897631 is divided by 33613? 7 Calculate the remainder when 336292 is divided by 67248. 52 What is the remainder when 3043106 is divided by 2797? 2767 Calculate the remainder when 19350102 is divided by 6450033. 3 Calculate the remainder when 17560504 is divided by 763500. 4 What is the remainder when 1421075 is divided by 793? 19 Calculate the remainder when 2884550 is divided by 99467. 7 Calculate the remainder when 1261248 is divided by 57329. 10 What is the remainder when 817473 is divided by 67971? 1821 What is the remainder when 10490603 is divided by 27? 23 What is the remainder when 33989867 is divided by 33? 32 What is the remainder when 20694657 is divided by 1644? 1629 What is the remainder when 182681 is divided by 45374? 1185 Calculate the remainder when 3639257 is divided by 36759. 116 Calculate the remainder when 2286277977 is divided by 14. 11 Calculate the remainder when 167126 is divided by 1287. 1103 Calculate the remainder when 438000 is divided by 145987. 39 What is the remainder when 4848292 is divided by 275? 42 What is the remainder when 4764007 is divided by 772? 767 Calculate the remainder when 318319 is divided by 79578. 7 What is the remainder when 63834 is divided by 15790? 674 Calculate the remainder when 12550894 is divided by 3710. 3674 What is the remainder when 80467 is divided by 766? 37 What is the remainder when 624964309 is divided by 3238157? 8 Calculate the remainder when 1961148 is divided by 4070. 3478 Calculate the remainder when 6600811 is divided by 1155. 1141 What is the remainder when 34409969 is divided by 49? 13 What is the remainder when 2924294 is divided by 15? 14 What is the remainder when 11986939 is divided by 66226? 33 Calculate the remainder when 32848 is divided by 6021. 2743 Calculate the remainder when 750333 is divided by 2444. 25 Calculate the remainder when 47978 is divided by 158. 104 Calculate the remainder when 56199 is divided by 11212. 139 Calculate the remainder when 6222282 is divided by 45. 42 Calculate the remainder when 102494 is divided by 34104. 182 What is the remainder when 853155 is divided by 145? 120 Calculate the remainder when 44839 is divided by 22387. 65 Calculate the remainder when 11294119 is divided by 11. 1 Calculate the remainder when 3382849 is divided by 29416. 9 Calculate the remainder when 2507874 is divided by 339. 291 Calculate the remainder when 490844 is divided by 2406. 20 What is the remainder when 2741066 is divided by 456796? 290 What is the remainder when 6217953 is divided by 83? 8 Calculate the remainder when 378787 is divided by 3534. 649 What is the remainder when 892645 is divided by 5190? 5155 What is the remainder when 704473 is divided by 46956? 133 Calculate the remainder when 225248 is divided by 222843. 2405 What is the remainder when 53854267 is divided by 30103? 0 What is the remainder when 9988618 is divided by 3? 1 What is the remainder when 9072342 is divided by 1512043? 84 Calculate the remainder when 215 is divided by 107. 1 Calculate the remainder when 297584 is divided by 346. 24 Calculate the remainder when 18035 is divided by 4537. 4424 What is the remainder when 97060 is divided by 1332? 1156 Calculate the remainder when 12974784 is divided by 8. 0 What is the remainder when 15508055 is divided by 130? 95 Calculate the remainder when 11373602 is divided by 23. 10 What is the remainder when 19332 is divided by 111? 18 What is the remainder when 38445372 is divided by 749? 700 What is the remainder when 61980042 is divided by 206? 204 What is the remainder when 56303909 is divided by 15? 14 Calculate the remainder when 2666 is divided by 2455. 211 What is the remainder when 3028863 is divided by 113? 11 What is the remainder w	{ "pile_set_name": "DM Mathematics" }
60. Determine x(-40). -40 Let b(o) = -o*3 + 402o*2 - 12o + 4825. Calculate b(402). 1 Let d(w) = 57w - 19980. What is d(355)? 255 Let f(l) = 2l*3 - 23l*2 + 5577l - 61277. Calculate f(11). -51 Let g(t) = -t*3 - 54t*2 + 78t + 61. Calculate g(-55). -1204 Let x(a) = -3073a - 125993. Calculate x(-41). 0 Let t(z) = -86z*2 - 34353z - 15566. Calculate t(-399). -5 Let p(z) = 6640z + 238889. Give p(-36). -151 Let o(s) = s3 + 44s*2 + 10s - 1261. Give o(-44). -1701 Let f(c) = 2670472c - 8011412. What is f(3)? 4 Let c(r) = -5r*2 + 2863r - 117744. Determine c(528). 0 Let o(u) = 9291u + 371646. Give o(-40). 6 Let d(a) = a3 - 20a*2 - 695a + 42. What is d(-17)? 1164 Let b(n) = 15n2 + 908n + 13719. Determine b(-32). 23 Let o(z) = -7z2 + 163z + 4280. Calculate o(39). -10 Let k(t) = 39898t2 - 598483t + 199. Calculate k(15). 4 Let o(m) = -36m2 + 316m - 602. What is o(6)? -2 Let a(v) = 20v2 - 1751v - 800. Calculate a(88). -8 Let o(v) = -8953v + 13196750. Give o(1474). 28 Let r(h) = -2h*2 - 9496h + 56888. Calculate r(6). -160 Let n(x) = -810x2 - 8941x - 321. What is n(-11)? 20 Let z(t) = -176t - 9766. What is z(-46)? -1670 Let d(r) = -r3 - 49r*2 - 519r - 5005. Give d(-39). 26 Let k(g) = 8544g + 393003. Calculate k(-46). -21 Let o(v) = 2834978v - 8504934. Calculate o(3). 0 Let g(w) = w*3 + 2046w*2 + 36510w + 12175. Determine g(-2028). 7 Let m(t) = -t*2 - 6091t - 355874. Calculate m(-59). 14 Let a(t) = -2735t + 98728. Calculate a(36). 268 Let h(u) = -1086u + 310. Give h(1). -776 Let t(n) = -29n2 - 4n - 29. What is t(7)? -1478 Let n(t) = -5t2 - 213t + 367. Calculate n(-44). 59 Let s(c) = c*3 + 9c*2 + 85c - 571. Determine s(7). 808 Let s(j) = -2j3 - 772j*2 + 830j + 21675. Calculate s(-387). 3 Let v(f) = -53f2 - 604f - 1329. Calculate v(-3). 6 Let a(h) = 1050h + 12303. Calculate a(-15). -3447 Let f(o) = o2 - 46o - 1977. Give f(61). -1062 Let f(v) = 587v - 3619. Determine f(16). 5773 Let s(a) = -57a*2 - 16660a - 4666. Determine s(-292). 6 Let p(x) = x*2 + 12783x - 7402584. Calculate p(555). 6 Let c(u) = -32u - 2292. What is c(-49)? -724 Let o(w) = -6251w - 37125. Determine o(-6). 381 Let k(g) = g*3 - 182g*2 + 6843g + 925. Calculate k(129). 1699 Let l(q) = 205q2 + 9227q + 67. Determine l(-45). -23 Let n(u) = -38u - 6149. Give n(-163). 45 Let u(k) = k3 + 160k*2 + 2390k + 12369. Calculate u(-144). -15 Let r(i) = i*3 - 213i*2 - 32778i - 60231. Give r(317). -1 Let b(j) = 3j3 + 25j*2 - 11j - 1. Determine b(-9). -64 Let h(b) = -18b2 + 15988b - 3544. Determine h(888). 8 Let a(l) = -l*3 - 67l*2 + 10043l + 648586. Calculate a(-63). 1 Let z(t) = 55577t - 5613272. Give z(101). 5 Let b(u) = -982u + 344676. Determine b(351). -6 Let t(g) = 74g3 - 99g*2 + 105g - 8. Calculate t(1). 72 Let v(h) = 41h - 374. Determine v(12). 118 Let r(p) = -7p*3 + 4p*2 + 5p - 6. What is r(-6)? 1620 Let z(n) = 9n2 + 1974n + 33158. Calculate z(-201). -7 Let g(f) = 5f2 - 443f - 533. Calculate g(91). 559 Let y(m) = -4m3 - 616m*2 - 355m - 54679. Determine y(-154). -9 Let m(c) = 1198c + 11592. Give m(-13). -3982 Let w(h) = -h2 + 198h + 7822. What is w(-37)? -873 Let a(t) = 4t3 - 421t*2 + 108t + 535. Calculate a(105). 850 Let w(q) = 9q2 - 795q - 116040. What is w(166)? -6 Let m(g) = 6g2 - 697g - 2046. What is m(119)? -23 Let i(s) = -52829s - 633960. Give i(-12). -12 Let l(d) = -2d*3 - 1227d*2 - 13832d + 8431. Calculate l(-602). 3 Let w(y) = -9y2 - 2238y + 23378. Determine w(10). 98 Let q(f) = -99725f + 398987. What is q(4)? 87 Let l(h) = -2h*3 - 79h*2 - 17h - 151. Determine l(-39). -1009 Let o(z) = -332090z + 1660456. Calculate o(5). 6 Let t(s) = 105136s - 1787320. Calculate t(17). -8 Let c(l) = -3l3 + 911l*2 - 7944l + 16. What is c(9)? 124 Let r(m) = -1330m - 18898. Give r(-12). -2938 Let n(q) = q3 + 54q*2 + 81q + 1248. Give n(-52). 2444 Let q(j) = -28670j2 - 14j + 7. What is q(0)? 7 Let l(w) = 434w2 + 6083w + 74. What is l(-14)? -24 Let v(o) = -2o3 + 176o*2 - 2980o - 206. Calculate v(23). 24 Let s(i) = -12i2 - 153i - 527. Determine s(-11). -296 Let c(a) = 3a3 - 65a*2 - 198a + 5130. Calculate c(21). 90 Let w(c) = 2c3 - 769c*2 - 1930c - 1937. Determine w(387). -2 Let h(v) = -v*3 - 407v*2 + 14998v + 1772. What is h(-441)? 8 Let y(a) = 6480a - 2442956. What is y(377)? 4 Let h(u) = -2u*2 - 705u - 14402. What is h(-22)? 140 Let i(u) = 460u3 - 27u*2 - 36u - 5. Give i(-1). -456 Let o(q) = 3075q - 12415. Calculate o(4). -115 Let t(y) = 513y + 12787. What is t(-25)? -38 Let b(r) = -r*2 - 23r - 696. Calculate b(-31). -944 Let j(q) = 48898q + 97809. Calculate j(-2). 13 Let r(b) = -12b*2 + 1881b - 124. Determine r(156). 1280 Let b(f) = f*2 + 87f + 331. Calculate b(-82). -79 Let i(g) = g*2 + 5748g - 167562. Calculate i(29). -29 Let p(a) = 30a3 - 135a*2 - 48a - 94. Give p(5). 41 Let x(n) = -8n2 - 159452n + 159453. Determine x(1). -7 Let c(r) = -r*3 + 13r*2 + 1699r - 15613. Give c(9). 2 Let x(y) = 61593y + 184823. Calculate x(-3). 44 Let f(i) = -i3 - 12i*2 - 444i - 5809. Determine f(-13). 132 Let d(j) = -j*3 + 147j*2 - 575j + 450. Calculate d(143). 21 Let b(m) = -23m2 + 243m - 709. Determine b(3). -187 Let s(j) = -19086j + 3511843. Calculate s(184). 19 Let y(l) = 66l*2 - 2941l + 14696. What is y(5)? 1641 Let p(y) = 3031y - 106178. Give p(35). -93 Let a(u) = 39718u + 476622. Give a(-12). 6 Let c(m) = 2499m2 - 57480m + 62. Calculate c(23). -7 Let b(g) = -218g - 7593. Calculate b(-40). 1127 Let l(y) = 105141y*2 - 946271y + 19. Calculate l(9). 1 Let f(d) = 9062d - 353414. Give f(39). 4 Let r(y) = 17399y + 52153. Give r(-3). -44 Let h(w) = 5w3 - 315w*2 - 1334w + 24. Give h(-4). 0 Let g(u) = u*3 + 11u*2 + 2034u + 16075. What is g(-8)? -5 Let r(f) = 1909f + 103072. Calculate r(-54). -14 Let y(g) = -30g*2 + 7699g + 2813. What is y(257)? -14 Let r(n) = -1721n + 5176. What is r(3)? 13 Let a(l) = 7l*2 + 342l - 73. Determine a(-49). -24 Let a(i) = -90325i + 1716169. What is a(19)? -6 Let q(w) = -w3 + 56w*2 + 35504w - 1923056. Determine q(54). -8 Let p(r) = 14r2 - 85r - 16. What is p(0)? -16 Let y(a) = -29a2 + 832a - 139. What is y(28)? 421 Let c(m) = -5m2 + 7528m - 465445. Determine c(1441). -2 Let i(r) = r*2 + 1447r - 41306. Determine i(28). -6 Let c(n) = n*2 + 510n + 13493. What is c(-482)? -3 Let h(t) = 4t3 - 54t*2 - 708t - 159. Calculate h(-8). 1 Let h(c) = -2c3 - 4c*2 + 55c - 176. Calculate h(7). -673 Let y(z) = -22z - 864. Calculate y(-26). -292 Let o(v) = 4v*2 + 843v + 17753. Give o(-187). -12 Let h(p) = -p*3 - 61p*2 - 792p - 24. Calculate h(-42). -276 Let d(k) = k*3 - 45k*2 - 338k + 6966. Calculate d(49). 8 Let s(u) = 10u3 - 411u*2 - 1274u - 76. Calculate s(44). 12 Let y(r) = -14146r - 452678. Calculate y(-32). -6 Let d(s) = 7s*2 - 76s + 206. Give d(13). 401 Let o(r) = 2284r + 203282. Determine o(-89). 6 Let f(l) = 955l + 253069. What is f(-265)? -6 Let t(d) = -d*3 + 337d*2 + 24729d + 3632. What is t(399)? 41 Let g(w) = -302w2 - 5135w - 61. Determine g(-17). -44 Let v(i) = 602i - 67969. Determine v(113). 57 Let v(g) = 26229g + 131174. What is v(-5)? 29 Let o(u) = 17u2 + 635u + 293. Determine o(-34). -1645 Let d(i) = -i*2 + 18673i - 2097283. Give d(113). -3 Let a(x) = 399280x + 3593529. Calculate a(-9). 9 Let c(u) = -u3 - 26u*2 - 16359u + 32830. What is c(2)? 0 Let k(a) = -16619a - 83202. Calculate k(-5). -107 Let k(s) = 172049s - 344104. Calculate k(2). -6 Let r(l) = -1117l - 16698. What is r(-15)? 57 Let d(h) = 30h + 967. Determine d(-23). 277 Let w(b) = b*3 + 58b*2 + 28153b + 1570272. Determine w(-56). -24 Let o(c) = -20c2 - 2253c + 841. Determine o(-113). 50 Let a(g) = -32g2 - 176g + 11020. What is a(16)? 12 Let q(s) = -20406s + 81648. Determine q(4). 24 Let d(a) = 2a*3 + 106a*2 + 89a + 4599. Give d(-53). -118 Let d(t) = t*2 - 86154t - 1292629. What is d(-15)? -94 Let w(j) = j*2 + 1576j + 105454. Give w(-70). 34 Let j(o) = -2o3 + 14o*2 + 9309o - 46639. Give j(5). 6 Let f(u) = 1386*u	{ "pile_set_name": "DM Mathematics" }
-1) + -8 + 7. Suppose 4k + d = 8k. What is the greatest common divisor of k and 253? 11 Let j be ((-2470)/(-39))/((4/6)/1). Let c = 153 - j. Calculate the highest common divisor of 203 and c. 29 Suppose -18 = 3a - 48. Let h = a + 21. Let o = 17 + h. Calculate the highest common factor of o and 32. 16 Let b(x) = 10x + 1636. Let s be b(-133). What is the greatest common divisor of 7242 and s? 102 Let l(i) = i*3 + 3i + 5. Let s be l(-5). Let r be (s/10)/(-9)-4. Let v be 2/r + 130/39. Calculate the highest common factor of 24 and v. 3 Suppose 64f = 84f - 180. Let z(s) = s3 - 5s*2 - 13s - 9. Let t be z(f). Let b be 36(0 - (-2)/4). Calculate the highest common factor of t and b. 18 Let g(l) = 2l*3 - 5l*2 + 2l - 1. Let k be g(4). Let y(n) = n*2 - 14n - 2244. Let z be y(55). What is the highest common divisor of z and k? 11 Suppose 0h = -2h - 36. Let y be ((-1)/((-2)/h))/(-1). Let s be 18/48 - (-5025)/(-2)(-56)/1120. Calculate the highest common factor of s and y. 9 Suppose 3a - i - 18 = 0, 36i - 33i + 34 = 5a. Calculate the highest common divisor of a and 2155. 5 Suppose -3x + 2a = 2x - 451, 0 = -4x - a + 353. Let w be (-3 + x/5)5. Let g = w - -174. Calculate the greatest common divisor of 31 and g. 31 Suppose 5p = -4y - 72, 0 = p - 3y + 8y + 27. Let s be 8/102/p-15. Suppose -5l + 45 = -sl. What is the highest common factor of 3 and l? 3 Suppose 0 = -10f + 508 + 612. Suppose 2m + 165 = 7m. Suppose -2o + m = 1. Calculate the greatest common divisor of o and f. 16 Suppose 0 = 74a - 70a + j - 157, 2a = 4j + 92. Calculate the highest common factor of 152 and a. 8 Suppose 10a = -5a + 37a - 1540. Suppose l - 150 = -2l. Calculate the highest common factor of l and a. 10 Suppose -67 + 412 = y - 435. What is the greatest common divisor of y and 8385? 195 Let j be (10/(-6))/((-9)/54). Suppose 0 = f + 5 - j. Let r be f - 1/(2/(-4)). Calculate the greatest common divisor of r and 21. 7 Let v be (130/(-2))/(11/(-11)). Let p be (v/(-3))/((-4)/24). Let s = -88 + p. Calculate the greatest common divisor of 14 and s. 14 Let x be (-13 - 315/(-30))(-4 - -2 - 24). Let y be 130 - (1/1 - 1). What is the highest common factor of y and x? 65 Suppose 5u = -3t + 106, -76 = -4t - u + 88. Let q(x) = 8x - 33. Let c be q(12). What is the greatest common divisor of t and c? 21 Let g be (-4)/60 + (-158)/(-711)3786/20. What is the highest common divisor of 350 and g? 14 Let p(q) = 66q3 - 4q*2 + 3q + 9. Let o be p(4). What is the greatest common divisor of o and 111? 37 Suppose 17i + 223 - 1192 = 0. Let z(y) = -3y*3 + 6y*2 + y - 7. Let h be z(-5). What is the highest common divisor of h and i? 57 Suppose -1584 = -2t - 4f, -932f + 792 = t - 927f. Calculate the greatest common divisor of t and 2088. 72 Let n = -3072 - -3122. Calculate the highest common divisor of 110 and n. 10 Suppose 5x + 860 + 1505 = 0. Let l = -467 - x. Calculate the highest common divisor of 150 and l. 6 Let s = 973 + -390. Let w = s + -349. Suppose -r + 3r + 4f = w, -r = -3f - 117. What is the highest common factor of 13 and r? 13 Let p be (1/1)/(3 - (-6145)/(-2050)). Suppose 5z + 2y = 424, 4y = -5z + 9y + p. What is the highest common divisor of z and 24? 12 Let s be ((-4475)/(-18) - (-5)/(-30)) + (-136)/306. What is the greatest common factor of s and 32? 8 Let w = 2744 - 2735. Let z(q) = 2q + 1. Let f(u) = u2 + 7u + 4. Let x be f(-7). Let v be z(x). What is the greatest common divisor of w and v? 9 Let j be (-195)/(-4)(-5824)/312. Let y be (-4)/18 + (j/(-45) - 1). Let t(a) = -58a - 1. Let n be t(-1). Calculate the greatest common factor of y and n. 19 Let y = 1842 + -1415. What is the greatest common factor of y and 14? 7 Let v = -16 + 6. Let m(s) = -4s - 12. Let y be m(v). Let u be -4 - (-57)/15 - 2898/(-15) - -3. What is the greatest common divisor of y and u? 28 Suppose -116g = -113g + 2t - 13127, 4371 = g - 4t. Calculate the greatest common factor of 350 and g. 175 Let a(r) = -9r + 228. Let t be a(23). Suppose -51s = -54s + t. Calculate the greatest common factor of 49 and s. 7 Let r = 78 - 81. Let w(v) = v*2 + 10v + 23. Let d be w(r). Calculate the greatest common factor of d and 94. 2 Suppose -1583375 + 3652236 = 459y - 1365377. Calculate the highest common divisor of 172 and y. 86 Suppose 4j - 2035 = 5d, -3d + 2043 = 25j - 21j. What is the greatest common factor of 2 and j? 2 Let v be 14/(-49) + (-72)/(-7). Suppose 118 = 5t - c, -2t + 54 = 8c - 5c. Let z be 5 + -1 + -4 + (t - -6). What is the greatest common factor of v and z? 10 Suppose -95074q + 154 = -95052q. Suppose 5 + 4 = 3c. Let g(d) = 2d*2 - 2d + 2. Let w be g(c). What is the greatest common factor of q and w? 7 Suppose 481 = 15u - 127 + 158. What is the highest common divisor of u and 2270? 10 Suppose 0 = -2v - 4i + 2252, -25v + 22v = 4i - 3396. Calculate the highest common factor of 1768 and v. 104 Let w = 8 - -8. Let r(u) = u*3 - 5u*2 + 3u. Let h be r(5). Let y = w - h. What is the greatest common divisor of 11 and y? 1 Let t(p) = 12p2. Let g be t(1). Suppose gk = 10k. Let u be 1(0 + (4 - k)). Calculate the greatest common factor of u and 36. 4 Suppose 0 = h + 5 - 8, 3a - 1350 = 5h. Let w = 593 - a. What is the highest common divisor of 2 and w? 2 Let n(s) = 2s2 - 87s - 944. Let f be n(67). Calculate the highest common divisor of f and 40. 5 Let g = 77 + -25. Suppose 6z - 3z = 5i + 2, 3z + 5i - g = 0. Let v be 46628/72 - 2/z. Calculate the greatest common factor of v and 46. 46 Suppose 45g + k = 50g - 654, g = -4k + 114. Calculate the greatest common divisor of 7800 and g. 130 Suppose 12 = 2t + 2l, l + 4 + 2 = 3t. Suppose -tw = -5d + 22, 3 = 3d + 2w + 5. Calculate the highest common divisor of 18 and d. 2 Let g be 106 + 0 + 252/4812/(-9). Calculate the highest common divisor of g and 363. 33 Let x(a) = 7718a - 54010. Let d be x(7). Let i be -2 - (-3 + (0 - 2)). Calculate the greatest common divisor of d and i. 1 Let p be ((-2)/12)/((-103)/329394). What is the greatest common factor of 52 and p? 13 Let p(s) = 22s2 + 52s + 20. Let c(j) = 12j2 + 26j + 10. Let q(d) = -7c(d) + 4p(d). Let k be q(-7). Calculate the greatest common divisor of k and 312. 24 Suppose -11168 + 1853 = -9w. Calculate the greatest common divisor of w and 18. 9 Let n = -73163 + 73199. Let l be (2 - (2 + -2))12. Calculate the greatest common divisor of n and l. 12 Let q be 177/2 + (-1)/2. Let n be (270/(-81))/((-2)/687). Let o = 1156 - n. Calculate the greatest common divisor of o and q. 11 Suppose 37t + 3296 + 64948 = 103t. What is the greatest common divisor of 752 and t? 94 Suppose -o = -3t - 2, -o - 2o + 6 = -t. Suppose t = -u - 4 - 1, 4h - 5u + 215 = 0. Let p = h + 88. What is the greatest common divisor of p and 4? 4 Let m(p) = 13p2 - 3p + 2. Let j be m(1). Let r = -46 + 48. Let x = j + r. Calculate the greatest common factor of 35 and x. 7 Let g be (-1 + (-2485)/(-20))/(1/8). What is the highest common divisor of g and 85? 17 Let j(h) = -338h + 18. Let v be j(2). Let d = -382 - v. What is the highest common divisor of d and 6? 6 Suppose 7c - 9c + 104 = 11c. What is the highest common divisor of c and 6488? 8 Let m be (-60)/(-35)105/(-6)(-896)/80. What is the highest common factor of m and 492? 12 Let r(x) = -20x - 101. Let v be r(-5). Let y be (70 - 60) + -1 + -2 + v. Let f(s) = s + 17. Let q be f(13). Calculate the greatest common divisor of y and q. 6 Suppose 10u = 11u + 413. Let c = u - -653. What is the greatest common factor of 10 and c? 10 Let u = 257 - 257. Suppose -4b + ul = 5l - 49, -4b + 79 = -5l. What is the highest common factor of b and 208? 16 Suppose 3i + 2935 = 10i - 38106. What is the greatest common divisor of i and 82? 41 Suppose -5w + 11380 = -4f, 2w - 4529 = -165f + 162f. What is the highest common factor of w and 64? 32 Let t(g) = -g3 + 6g*2 - 5g + 9. Let i be t(5). Calculate the highest common factor of 1164 and i. 3 Suppose 2i = r + 227, i + 0r = -2r + 116. Let j be (0 - 760/12)(-528)/220. Calculate the highest common factor of i and j. 38 Suppose 10b = 4b - 1038. Let f = b + 242. What is the highest common divisor of 46 and f? 23 Su	{ "pile_set_name": "DM Mathematics" }
inder when n(6) is divided by 51. 26 Let m(f) = 160f + 2247. Calculate the remainder when m(14) is divided by 33. 32 Suppose 29 = 5h + 4d, -2d - 3d = 2h - 15. Suppose 0 = 3v - 2v - 2, 4x + hv = 218. What is the remainder when x is divided by 8? 4 Let l be 14(63/(-90) - (-1)/5). Let a be 2/40/(l - -15). Suppose -2j = -a - 102. What is the remainder when j is divided by 13? 12 Suppose -t - 21c = -20c - 32, -3t + 82 = -4c. Calculate the remainder when 1918 is divided by t. 28 Suppose -6k - 541 + 1687 = 0. Let j = 653 - 619. Calculate the remainder when k is divided by j. 21 Let j(o) be the second derivative of -4o3/3 - 47o*2/2 + 17o. Calculate the remainder when j(-22) is divided by 16/40(1 + 109). 41 Let u(l) = -l. Let p(c) = -c + 1. Let g(s) = -2p(s) + u(s). Calculate the remainder when 14 is divided by g(7). 4 What is the remainder when (-548495)/(-1467) + 32/(-36) is divided by 44? 21 Suppose 4 = -4m, 5i - 7 = 2i + m. Let h = 111 - 65. Calculate the remainder when h is divided by (-3 - (-4 + -2))(2 + i). 10 Suppose 454 = 5a - 196. Suppose 39 = 2d + y - 14, 5d = -2y + a. What is the remainder when 73 is divided by d? 1 Suppose -176a - 5292 = -554a. Let x = -78 - -131. What is the remainder when x is divided by a? 11 Let i(s) = 7s3 - 18s*2 + 8s - 11. What is the remainder when 1466 is divided by i(4)? 18 Let t = -2633 + 2720. What is the remainder when t is divided by 18? 15 What is the remainder when 1/(-3) + (-19)/((-114)/3104) is divided by 31? 21 Suppose 12352 + 986 = 71i + 3469. Calculate the remainder when 881 is divided by i. 47 Let y(c) = -188c + 1973. Calculate the remainder when y(8) is divided by 113. 17 Suppose 11f - 12f - 188 = -5v, 4f + 182 = 5v. What is the remainder when 177 is divided by v? 25 Let f be (31 + -28)/(6/4). Suppose 3k = -fg + 42 - 4, 3g - k = 79. What is the remainder when 74 + (2 - (-6)/(-3)) is divided by g? 24 Suppose 186m + 5h = 184m + 186, 3m - 222 = 2h. What is the remainder when 370 is divided by m? 58 Suppose 593f - 203f - 300849 = -35649. Calculate the remainder when f is divided by 674. 6 Let p = 121 + -119. Suppose 3t + p = 2t - 2d, 5t - 14 = -2d. Suppose -5z = v - 6v + 85, -12 = tz. Calculate the remainder when 97 is divided by v. 13 Let o = -863 + 728. Let d = 165 + o. Let x = -46 - -100. Calculate the remainder when x is divided by d. 24 Suppose -5v = -m + 110, 4m - 488 + 48 = 5v. Let u = m + -13. Let p = -580 - -590. What is the remainder when u is divided by p? 7 Calculate the remainder when 375 is divided by ((-45)/5 + 8)0 - -182. 11 What is the remainder when (-3570)/170 + (2833 - 1) is divided by 38? 37 Suppose 5g = -0g + 60. Suppose 0 = -3p - m - 7, -7p + 9p + 3 = -m. Calculate the remainder when (2 + (-68)/p)/(6/18) is divided by g. 9 Let q = -1114 - -1105. Let x(d) = -5 - 3d + 2d - d. Calculate the remainder when x(q) is divided by 10. 3 Let r be (-1)/(-7)7 - (-1 + 0). Suppose -i + 7 = z, -3i = -2z + ri + 14. Suppose 13y - zy = 48. Calculate the remainder when y is divided by 5. 3 Suppose 7p - 4p + 23p - 2054 = 0. What is the remainder when 473 is divided by p? 78 Let l(k) = k3 - 21k*2 - 223k + 36. What is the remainder when 418 is divided by l(29)? 121 Suppose 0 = -0m - 4m + 52. Let s(u) = -u*2 + 70u + 216. Let o be s(-3). What is the remainder when 24 is divided by (o/(-6))/((13/18)/m)? 6 What is the remainder when 67 is divided by (1/(-2 - -1) + 2/4)-50? 17 Suppose 7q = 1174 + 2767. Let d = 574 - q. Calculate the remainder when 61 is divided by d. 6 Suppose -183 = -5c - 18. Let f be 1/5-4 - (-2358)/10. Suppose -1313 = -11l - f. Calculate the remainder when l is divided by c. 32 Let i = 110 + -61. Suppose -t + 2g + 3g = -i, -2g + 4 = 0. Suppose 2p = 3s - 38, 0 = 5s - 6p + 5p - 61. What is the remainder when t is divided by s? 11 Suppose -4m + 16 = 0, -42m + 252 = 2g - 41m. Let q = -72 - -104. Suppose 2h + q = 4h. Calculate the remainder when g is divided by h. 12 Let o(c) = c3 - 13c*2 - 55c - 110. Let v = 2302 + -1640. Calculate the remainder when v is divided by o(17). 107 Let w(g) be the third derivative of -g*6/120 - 4g*5/15 + 17g*4/24 - 35g*3/6 - 148g*2 - 2. What is the remainder when w(-18) is divided by 11? 10 Suppose 10s - 15276 = 5s + 2n, -4s - 3n + 12207 = 0. Calculate the remainder when s is divided by 161. 156 Calculate the remainder when ((-484)/16)/(14/(-560)) is divided by 300. 10 Let i = -13 - -25. Suppose 0 = -4g - 4d + 472, -2d + 2 = -0d. Calculate the remainder when g is divided by (i - 2)/(11/44). 37 Suppose -3x + 950 = 16x. What is the remainder when 237 is divided by x? 37 Let q(l) = 4l2 + 192l + 1378. What is the remainder when 2072 is divided by q(-44)? 50 Let f = 6214 - 5944. What is the remainder when 765 is divided by f? 225 Let r = -39 - -77. Suppose -4v - 3d + 300 = 0, 2 = -d - 2. Let a = v + -57. What is the remainder when r is divided by a? 17 Suppose 4x - 1555 = -3l, 474 = 451l - 450l - 5x. What is the remainder when l is divided by 102? 101 Let h = -65 + 100. Let x(k) = k2 - 3. Let d be x(0). Calculate the remainder when (2 + 2 + d)68 is divided by h. 33 Let g be 8 + 0 + 288/(-48). Suppose gc - 5x = 29 + 34, 5c - 143 = -2x. What is the remainder when 63 is divided by c? 5 Suppose -6363 = -11d + 4d - 21. Calculate the remainder when d is divided by 297. 15 Let j(k) = -46k - 802. Let u(m) = m3 - 7m*2 - 7m + 2. What is the remainder when j(-18) is divided by u(8)? 6 Suppose -59c + 8888 = -3089. What is the remainder when 1220 is divided by c? 2 Let x = -47 + 50. Suppose 0 = 2z + 3n - 9, xz - 4 = 3n + 2. Suppose zh + 310 = 13h. Calculate the remainder when h is divided by 23. 8 Suppose -7r = -5r - 2, -i + 2r + 3 = 0. Calculate the remainder when 77 is divided by -3 + (16 + i - 2). 13 Let m(i) = 4i2 - 174i + 352. Let d(p) = 2p2 - 5p. Let o = 2 + 2. Calculate the remainder when m(2) is divided by d(o). 8 Let l = -31 - -33. Let o(w) = -18w - 291. What is the remainder when o(-21) is divided by (-23)/(1/l-2)? 18 Let l(f) = 3f - 37. Let j be -39 - (5 - (0 - -2)). Let g = j - -64. What is the remainder when l(g) is divided by 4? 1 Let m be 4/(1 - -3 - 477/119). Let s = 763 + m. Calculate the remainder when s is divided by 29. 26 Suppose -p + 3601 = -7a + 5a, -25074 = -7p - 5a. Calculate the remainder when p is divided by 21. 17 Let g(h) = 2h*2 - 115h - 124. What is the remainder when g(59) is divided by 13? 1 Let b(d) = 6d2 + 4d - 8. Calculate the remainder when 481 is divided by b(-6). 113 Suppose 707 = 93k - 1711. Calculate the remainder when 2053 is divided by k. 25 Let x = 105 - 73. Let s(z) = 217z + 3750. What is the remainder when s(-17) is divided by x? 29 Suppose 0 = 5w + 5, 2l - 7w - 93 = -2w. Let m = -663 - -762. What is the remainder when m is divided by l? 11 Let b(a) = 81a + 1579. What is the remainder when 3959 is divided by b(-19)? 39 Let l(q) = q2 + 8q - 260. Calculate the remainder when 751 is divided by l(-21). 10 Let o(d) = -6 - 20 - 17d + 5 - 72. What is the remainder when o(-15) is divided by 15? 12 Calculate the remainder when 745 is divided by (-580)/(-17) + ((-1288)/(-476))/(-23). 31 Let l = -2588 - -3032. What is the remainder when l is divided by 5? 4 Suppose -4w + 2c + 1928 = 0, -22w - 3c = -24w + 956. What is the remainder when w is divided by 235? 14 Let i(h) = 28h - 725. What is the remainder when i(34) is divided by 91? 45 Let z(m) = -m2 + 23m - 12. Let p(x) = -x*2 - 2x + 1. Let u be p(2). Let s = u - -24. Calculate the remainder when z(19) is divided by s. 13 Let z = 5388 - 2809. Calculate the remainder when z is divided by 17. 12 Let q be 28/6 + 24/(-9) + 2. Suppose 47 = qr - 5s, 2s - 3 = -9. What is the remainder when 53 is divided by (-434)/(-28) - (-2)/r-2? 8 Suppose 2h + 30 = 26. What is the remainder when ((3 - 1)/h)/((-10)/430) is divided by 25? 18 Suppose 312m - 108 = 308m. What is the remainder when 563 is divided by m? 23 Let j(i) = i3 - 5i*2 - 2. Let g be j(4). Let p = 20 + g. Suppose -y + 224 = -3r + 6r, -py - 77 = -r. Calculate the remainder when r is divided by 19. 18 What is the remainder	{ "pile_set_name": "DM Mathematics" }
-10) - -5. Suppose -2p = -a - 62, -4p + 4a + 102 + 18 = 0. Calculate the greatest common factor of y and p. 32 Let p(f) = -7f + 7. Let n be p(-10). Let y = -62 - -73. Calculate the greatest common divisor of n and y. 11 Let n be -2 + 1 - 2 - -14. Let g(r) = 8r - 1. Let b be g(7). What is the highest common factor of b and n? 11 Let f be 2/1 - (4 - (-182)/1). Let w be (-2)/(-3) + -2 + f/(-3). Let i = -33 - -57. Calculate the greatest common divisor of i and w. 12 Suppose -j = -4s + 10, -3j - s - s + 40 = 0. Let i = -5 + 32. Suppose -5p + 355 = -t, -5t + i = p - 18. What is the highest common factor of p and j? 10 Suppose -3w + 5h + 215 = 0, -329 = -w - 4w + h. Suppose -68y + wy + 3 = 0. Calculate the greatest common factor of y and 8. 1 Let n = 600 - 87. Let t = 258 - n. Let g be (-6)/(-1)t/(-34). Calculate the highest common factor of g and 18. 9 Let v be 0/(-21) - (0 + -27). Suppose -vk + 31k = -68. Let d = 23 + k. What is the greatest common divisor of d and 4? 2 Suppose 6s + 4t - 168 = 4s, 0 = 5s + 2t - 412. Suppose -340 = sl - 86l. Calculate the greatest common factor of l and 17. 17 Let g(v) = 2v2 - v. Let q be g(-2). Let l(k) = -k - 2. Let f be l(9). Let d = -6 - f. Calculate the highest common factor of q and d. 5 Let s(b) = -b2 - 30b - 161. Let q be s(-22). What is the highest common factor of 2895 and q? 15 Let f = 82 + 65. Suppose 27 = -4s + f. What is the highest common divisor of 10 and s? 10 Let y = -6 - -9. Let g(l) = -86l - 341. Let v be g(-4). Calculate the highest common divisor of v and y. 3 Let t = -107 + 202. What is the greatest common factor of t and 38? 19 Suppose -4k - 16 = 0, 158 = 3p - 3k + 1085. Let y be (1 + p/(-2))2. Let l(u) = 26u + 9. Let z be l(1). What is the highest common divisor of y and z? 35 Let h be (0/1 + -2)1 - -12. Let q be (-784)/(-7) - h/(-2). Suppose -13 = -4u + 39. Calculate the greatest common factor of q and u. 13 Suppose -a - 18 + 13 = d, 4 = -5d + 2a. Let t be 51 - (-1)/(-1). Let n be t - -53 - (-6)/d. Calculate the greatest common factor of n and 6. 6 Suppose 40k = 32k + 312. Calculate the highest common factor of 26 and k. 13 Let d = -296 - -373. What is the highest common factor of 7 and d? 7 Let g = -108 + -53. Let u = -85 - g. Calculate the highest common divisor of 38 and u. 38 Suppose -m = 4m. Suppose -r + 4 = -mr. Suppose o - 30 = -5x, -6o + o - 3x = -106. What is the greatest common factor of r and o? 4 Let c be 15 - 0/(-1 - 0). Suppose 0 = z - 2z + 2, -5j - 3z = -36. Let s(d) = 11d - 6. Let g be s(j). Calculate the highest common divisor of c and g. 15 Let p = -301 - -322. Calculate the greatest common divisor of p and 9. 3 Let j be -2 - (-5)/((-10)/(-94)). Let l = j - 22. What is the highest common factor of 46 and l? 23 Suppose -26 + 1 = -5s. Suppose 189 = -sq + 6q. What is the highest common factor of q and 27? 27 Let g(p) = -p*3 - 12p*2 + p + 13. Let a be g(-12). Let w be (a - 0)(-9 + 14). What is the greatest common divisor of 2 and w? 1 Suppose 598 = 66r - 53r. What is the greatest common factor of 23 and r? 23 Let i be 2/(-10) + (-165)/(-75). Let b = i - 0. Suppose 2o + g - 108 = 0, 0 = o + bg + 2g - 54. Calculate the highest common factor of 36 and o. 18 Suppose 82j - 66j - 320 = 0. Calculate the highest common factor of j and 90. 10 Suppose 0 = 5f - 10, x - 4x - 4f = -77. Let a = x + -28. Let y be (-47)/a + 10/(-25). Calculate the highest common divisor of y and 63. 9 Suppose 9w = 4w + 55. Suppose 0 = 8j - wj + 108. Let g = j + -20. Calculate the highest common divisor of g and 8. 8 Suppose 0 = 5b + 12 - 52. Let t(q) be the second derivative of -q3/6 + 25q*2/2 + 6q. Let l be t(b). What is the highest common divisor of l and 85? 17 Let b be 14/(-35) + 6(-398)/(-20). Suppose n = 4a - 443, n = 2a - 104 - b. Suppose 30 = 5v - 190. What is the highest common factor of a and v? 22 Suppose -5l - 13 + 43 = 0. Suppose 3s - 792 = -lg + 2g, 0 = -s - g + 264. What is the highest common factor of 24 and s? 24 Let m = 120 - 78. Suppose -41 = 8z - 7z. Let y = z + 69. What is the greatest common factor of m and y? 14 Suppose 0v = 4v - h + 2, 0 = 4v + 3h - 6. Suppose 5u - 344 + 119 = v. Calculate the greatest common factor of 9 and u. 9 Suppose 4d = -2f + 32, 2f - 3d - 8 = -d. Calculate the greatest common divisor of 24 and f. 8 Suppose -2p + 6 + 92 = 0. Let i = p + -27. What is the greatest common factor of 176 and i? 22 Let h(f) = -2f + 45. Let k be h(16). Let d = -1 + 14. What is the highest common divisor of k and d? 13 Let z be (16/(-6))/((-14)/(-24)76/(-798)). Let x(s) = 6s + 2. Let q be x(5). Calculate the greatest common divisor of q and z. 16 Suppose -m + 6 = m. Suppose 0 = -5g + 5r + 640, -242 = -mg + g - 5r. What is the highest common divisor of g and 14? 14 Suppose -2v + 4v - 54 = 0. Suppose 4k = -3m + 750, 384 = -6k + 8k - 3m. What is the highest common factor of k and v? 27 Suppose 2l - 815 = 5d + 2763, -2l - 4d + 3614 = 0. Calculate the highest common factor of 7 and l. 7 Suppose -d = 3d - 480. Let x = 550 - 538. What is the highest common factor of x and d? 12 Let p = 97 - 57. Let h(z) = -z3 + 23z*2 - 21z - 44. Let w be h(22). Let m = w + p. What is the greatest common factor of 9 and m? 9 Let u be ((-60)/(-45))/(16/1404). What is the greatest common factor of u and 65? 13 Suppose 2g = -0g - j + 6, 2j - 3 = 5g. Suppose -q = -33 + g. Calculate the highest common divisor of 160 and q. 32 Let b(k) = 5k - 19. Let q be b(9). What is the highest common divisor of q and 234? 26 Let k = 1007 - 707. What is the highest common divisor of k and 120? 60 Suppose -16t + 58t - 15834 = 0. What is the greatest common factor of 26 and t? 13 Suppose 0 = -v + 2, 3n - 77 = -0n - v. Suppose 0 = 3i + 5w + 82, 3i = -i - 3w - 113. Let s = -24 - i. What is the highest common factor of s and n? 5 Let b = -8 + 9. Let h(t) = -11t*3 - 2t*2 + 2t - 1. Let p be h(b). Let k be (-2)/6 - 148/p. What is the highest common divisor of k and 8? 4 Let v(b) = 3b2 - 3b + 3. Suppose -5 = -4j - 29. Let r be (9/j)/((-3)/6). Let x be v(r). Calculate the greatest common divisor of x and 14. 7 Let b be (-660)/(-35) + (-48)/56. Let k(c) = 2c*2 + 7c + 3. Let i be k(-5). What is the highest common divisor of b and i? 18 Suppose d - 170 - 232 = -4m, 0 = -d + 2. What is the highest common factor of 28 and m? 4 Let x(w) = w2 + 3w - 3. Let p be x(-6). Let r be (-2 + p/6)6. Let z = 48 - 33. Calculate the greatest common factor of z and r. 3 Suppose -2z = -5b + 226, 3b + 4z - 43 - 103 = 0. What is the greatest common factor of b and 1679? 23 Let p(j) = 39j - 203. Let x be p(6). What is the highest common factor of 1271 and x? 31 Suppose 186 = 4n - 1550. Let q = -277 + n. Suppose -461 = -4f - q. What is the highest common divisor of f and 19? 19 Suppose 0 = 4f - 2f - 228. Suppose -6s - 6 = -f. Suppose 3z = 4q - 57, 4 + 22 = 2q - 2z. Calculate the highest common factor of q and s. 18 Let z = 126 - 104. Suppose 0 = -4w + 4q + 596, 0w + 3w + 4q = 482. What is the greatest common factor of w and z? 22 Let i = 235 - 213. Let f = 9 + -4. Suppose -fa = 3q - 17 - 23, a = -2q + i. Calculate the greatest common divisor of q and 2. 2 Let b be 16/(-24) - (-70)/6. Let q(x) be the first derivative of x2 - 2x + 7. Let o be q(b). What is the highest common divisor of o and 50? 10 Suppose 5938 = -5y + 19393. Calculate the greatest common divisor of y and 117. 117 Let a = 923 + -572. What is the highest common divisor of a and 13? 13 Let b(l) = -7l + 2. Let j be b(3). Let u = j - -23. Suppose i + 2w = 5i - 4, 0 = 2w - u. What is the greatest common divisor of i and 8? 2 Suppose 8j = 4j - 424. Let x = -52 - j. Calculate the greatest common divisor of 36 and x. 18 Suppose -101 = -3s - 5f, s = -3f + f + 32. Let u = 22 + 83. What is the greatest common factor of s and u? 21 Suppose -g + i = 2g - 1280, 3g = -i + 1270. What is the highest common factor of g and 50? 25 Suppose -3934 = -7n + 18543. What is the greatest common divisor of n and 19? 19 Let v(y) = -y2 - 32y - 228. Let j be v(-12). Let n be (-6)/(1 + (-15)/12). Calculate the highest common factor of n	{ "pile_set_name": "DM Mathematics" }
2j2 - 2c*2 + 7257753cj wrt j. -23010262c*2 What is the third derivative of 260792881l*4 + 7295937l*2 - 7l wrt l? 6259029144l What is the second derivative of -30683913t*4 - 2t + 700132813? -368206956t2 Find the second derivative of -3252116u*4 - 7714394u. -39025392u2 Find the second derivative of -84071628f*2 + 11493f + 6848 wrt f. -168143256 Find the second derivative of -12x2z*3 + 93885x*2z*2 - 3x*2 + xz*3 + 721846x wrt x. -24z3 + 187770z*2 - 6 Find the second derivative of -10091349k*2 + 18983879k wrt k. -20182698 Find the third derivative of 3o3w*3 - 5o*3w + 1087194o2w*2 - 1747016ow4 wrt w. 18o*3 - 41928384ow What is the second derivative of 24551421a*3u*2 - 958a*3u - a*3 + 372u wrt u? 49102842a3 Find the third derivative of 1181751c*3 - 936151c2 - c. 7090506 Find the second derivative of -c2r2 + 1873c*2r - 9c2 + 11188cr3 - 424cr2 - cr + 186 wrt r. -2c2 + 67128cr - 848c Differentiate -7803635l + 7989204. -7803635 What is the second derivative of 4h*2o*3 - 24331516h*2o*2 - 30h*2o - 4h2 - 32ho + h + 15o + 50 wrt o? 24h2o - 48663032h2 Find the third derivative of -4n*5 - 1748034n4 + n3 + 53482708n2 wrt n. -240n*2 - 41952816n + 6 Find the third derivative of 621a4g - 3a4 + 556a*3g + 3a2g - 2a2 + 45ag + 5a + 215g wrt a. 14904ag - 72a + 3336g What is the derivative of -47ci - 290350c - 6i3 + 783i*2 - 3i + 51 wrt i? -47c - 18i*2 + 1566i - 3 What is the second derivative of -172840j4 - j3 + 3j*2 - 4221971j wrt j? -2074080j2 - 6j + 6 Find the second derivative of -135265687v2 - 696570v + 67. -270531374 Find the third derivative of 147882971i3tu - 9745065i*2tu - i2u - 2it wrt i. 887297826tu Find the second derivative of -18508675b3w*2 - 4276729bw - w2 + 3w wrt b. -111052050bw2 What is the third derivative of c3y3 + 12560861c*3y*2 + 4c*3y + 7cy*3 + 55342y*3 wrt y? 6c*3 + 42c + 332052 What is the second derivative of 11169512f3 - 2256188f + 1 wrt f? 67017072f What is the first derivative of -859695m*3s + 71062056m3 - 12ms2 wrt s? -859695m*3 - 24ms Differentiate 139a*4 - 10036a*2 + 11332663 wrt a. 556a*3 - 20072a What is the second derivative of 15fi*2 - 17fi + 186f - 159239i2 + 570i - 2 wrt i? 30f - 318478 Find the third derivative of -4206676j*5 + 10737740j*2 wrt j. -252400560j*2 What is the second derivative of -33507f*2q*2 - 7902f*2q + 30fq*3 + 3fq - 2f + 20 wrt q? -67014f2 + 180fq What is the third derivative of -64041lu4 - 16lu3 - lu*2 + 2lu + 33l - 3163u wrt u? -1536984lu - 96l What is the second derivative of 3b2i2 + b2i - 97b*2 - 113bi + 3612218i*2 + 34 wrt i? 6b*2 + 7224436 What is the derivative of 22o*3u + 1021686621o3 + 246o*2u + 3ou - 39u wrt u? 22o*3 + 246o*2 + 3o - 39 Find the second derivative of 210447932o3 - o2 - 117o - 1314356 wrt o. 1262687592o - 2 What is the first derivative of 3l*2x + 20l2 - 6lx + 3031x - 56470 wrt x? 3l2 - 6l + 3031 Find the third derivative of 3r5 + 23743679r*4 + 3r*3 - 489437261r*2 wrt r. 180r*2 + 569848296r + 18 Find the third derivative of -3d5 - 28862725d3 + d2 - 858668d - 77 wrt d. -180d*2 - 173176350 Differentiate 75742504j*3 + 48684204. 227227512j*2 Find the third derivative of -2av3 + av*2 - 11av - 187a + 30408154v3 - 436v + 1 wrt v. -12a + 182448924 What is the second derivative of 40280466v*2 - 109239327v wrt v? 80560932 What is the second derivative of -294255206p2 + 105376241p wrt p? -588510412 Find the third derivative of 4185406p5 + 3p*4 - 1495523p*2 - 6p wrt p. 251124360p2 + 72p What is the derivative of 749g3l*3 - 23798g*3 - 95129776l*3 + 1 wrt g? 2247g*2l*3 - 71394g*2 What is the second derivative of 125p*2r*3 + 6940p*2r - 26pr*3 - 3pr2 - 4p - 2r2 + 34 wrt p? 250r*3 + 13880r Differentiate 195ad*2 + 15923ad - 1723304a with respect to d. 390ad + 15923a Find the third derivative of 3222h*4l - 3h3l - 3401h3 - 2h*2l + 992hl - 28877h wrt h. 77328hl - 18l - 20406 What is the second derivative of 2g2i*2 + 664830g*2y*2 + 3gi2 - 329giy + i*2y - 2i2 + 2iy2 - 101y*2 wrt g? 4i*2 + 1329660y*2 Find the third derivative of 453835154l*6 + 303496791l*2. 54460218480l*3 Find the first derivative of 75v*3 - 149v*2 - 5242v + 674973654 wrt v. 225v2 - 298v - 5242 What is the derivative of -167h2o - 211112h2 + 6h + 32873o2 - 12 wrt o? -167h*2 + 65746o What is the second derivative of 55540188z5 + 59z - 258? 1110803760z3 What is the third derivative of 24b*3s*3 + 1161b*3s*2 - 338b*3s - 600b2s*3 + 36b*2s - 114s3 wrt b? 144s*3 + 6966s*2 - 2028s Differentiate -13722s3 - 378s*2 - 9s + 100666247 wrt s. -41166s2 - 756s - 9 What is the second derivative of -1033777834b2 - 221419771b + 2? -2067555668 Find the first derivative of -364005310ag - 7902a + 3565 wrt g. -364005310a What is the third derivative of -4012293j3o*5 - 4361800j*3o*2 + jo*2 wrt o? -240737580j*3o*2 What is the third derivative of -26t*2u*3 - 5t*2u2 - t2u - 304758tu3 + 9tu2 - 2t + 1620u2 wrt u? -156t*2 - 1828548t Find the third derivative of -174hx*3 + 4hx2 - 3hx + 6h - 5977x4 + 230x*2 wrt x. -1044h - 143448x What is the second derivative of -278172545t*2z - 28124tz + t + 5z + 6 wrt t? -556345090z What is the second derivative of -18960d3 + 262d*2 - 49d + 3059 wrt d? -113760d + 524 What is the second derivative of 276030518r*2 - 355354999r wrt r? 552061036 What is the second derivative of -16676920x3 + 7509879x wrt x? -100061520x Find the first derivative of 47d*2ux - 11100264d*2x*2 + dx*2 - 116632u*3x*2 wrt u. 47d*2x - 349896u2x*2 Find the third derivative of 1491095r*4 - 8686064r*2. 35786280r What is the third derivative of -10d5 + 7d*4 + 1677329d*3 + 3350d*2 - 392d - 7 wrt d? -600d2 + 168d + 10063974 Find the third derivative of -16227639o5 - 45313446o*2 wrt o. -973658340o*2 What is the second derivative of 253u*3 - 529u*2 - 306u + 293196? 1518u - 1058 What is the second derivative of -156514d*3g + 2d3 - 95d*2g - dg + 152d - 3g + 249 wrt d? -939084dg + 12d - 190g What is the second derivative of 45726229x*4 - 83140896x? 548714748x2 What is the second derivative of -157v*4 + 252v*3 - 40188v - 113? -1884v2 + 1512v What is the first derivative of -48h2 - 25611h - 159080321? -96h - 25611 Find the first derivative of 2u*3 - 193u*2 + 2287u - 29074237. 6u2 - 386u + 2287 Find the first derivative of -11856k2 - 1929k - 279421984. -23712k - 1929 What is the first derivative of 4543295p*4 - 107p*2 + 19555013 wrt p? 18173180p*3 - 214p What is the first derivative of 11445a2o*2 + ao*2 + 71ap - 13o*2p + 148o2 - 52op + 8p wrt a? 22890ao2 + o2 + 71p Find the first derivative of -13920a*2 - 15500a + 117658223 wrt a. -27840a - 15500 What is the first derivative of -32gir + 4670gi + 11gr + 374g - 6ir - 138r wrt i? -32gr + 4670g - 6r What is the third derivative of -458183604i3 - 2i*2 - 3i - 1221347 wrt i? -2749101624 What is the second derivative of -53810067a5 - 5a*2 - 459665090a wrt a? -1076201340a3 - 10 Differentiate -3958825w - 98700821 with respect to w. -3958825 What is the second derivative of 743668267y3 + 288655060y? 4462009602y What is the first derivative of 1058c*3 - 172092c - 1369127125 wrt c? 3174c2 - 172092 What is the first derivative of 35h*3 + 154h*2 - 79h + 61328388? 105h2 + 308h - 79 Find the first derivative of 85141239k3 - 86469141 wrt k. 255423717k*2 What is the first derivative of -62k*2 - 8501km - 5522319m wrt k? -124k - 8501m What is the third derivative of 119771u2y*3 + 2u*2y + 211u2 + 441uy3 + 3uy + 49y*2 - 155 wrt y? 718626u**2 +	{ "pile_set_name": "DM Mathematics" }
rp - 2u = 4, -22p - 2 = -21p - 2u for p. 2 Let g(q) = 2q - 8. Let d(i) = -10i3 - i2 - i + 2. Let l be d(1). Let p = -5 - l. Let a be g(p). Solve 0 = aw - 4r + 2, w + 4r + 4 = -3w for w. -1 Suppose -3b = -3r - 151 + 130, 3r + 17 = b. Solve 5v - 17 = 2o, -bv + 13 = 3 for o. 4 Let z(j) = -2j*2 - 12j. Let l(y) = 8y + 58. Let g be l(-8). Let q be z(g). Let u be ((-1)/2)/(-1)18. Solve q = 3p + 9, -4b - 2p - u - 1 = 0 for b. -1 Let a = -5107 - -5112. Solve 1 - a = 2b, 0 = 4d - 3b + 6 for d. -3 Suppose -9 = -2a + 5a. Let p be a3/9 - -4. Suppose -px - q + 1 = 0, -4x = -6q + 2q - 28. Solve 0 = 5r - xk - 6 + 21, -k = -4r - 12 for r. -3 Suppose 319f = 188f + 168f - 185. Solve -x - q = 0, 5x - fq = -101 + 71 for x. -3 Let v(y) = 36y - 40y - 4 + 20. Let t be v(4). Solve t = -2f + 5p - 21, -5 = -3f - p + 6 for f. 2 Let s be (-300)/(-210)14/4. Solve -o + 12 = sr, -5o - 13 + 33 = 5r for o. 2 Let m = -815 - -817. Suppose 6 = 3b - 5k - 9, mb - 2k - 10 = 0. Solve 1 = -2r + 3r + d, -4r + bd = 32 for r. -3 Let d(l) = 42l - 2852. Let x be d(68). Solve 8z - 4b - 24 = 9z, -xb = 20 for z. -4 Let r(d) = -10d - 44. Let s(w) = -29w - 132. Let u(g) = 11r(g) - 4s(g). Let k be u(-7). Solve kv - 5h + 1 = -3, 5v = 2h + 11 for v. 3 Suppose 3n = q + 76, 5q - 11 = -31. Suppose -nu - 28 + 76 = 0. Solve -5z = -2a - 2, 2a - uz + 16 = 5a for a. 4 Let a = -295 + 305. Solve 0 = -4z + 5p - 40, -ap + 3 = -3z - 13p for z. -5 Suppose 3g = 25 - 16. Suppose 0 = 5z - 12 - g. Solve -2y - 16 = zp, -6 = -2p + 6p - 5y for p. -4 Let y(j) = -2j*3 - 20j*2 + 27j + 59. Let g be y(-11). Solve 0 = n + gh - 17, -n = 8h - 9h + 3 for n. 1 Let q be (2697/(-6))/(-31) - 3/(-2). Solve -17 = 4l - 3j, q = -2l - l - j for l. -5 Let i(g) = 2g2 - 38g + 294. Let w be i(14). Solve 0 = -2l + b - 9, 0 = 159l - wl - 2b + 21 for l. -3 Let c be (-1 - 0)/(10/(-80)). Suppose 5t + 2i = 30, 2i - 6 = -3t + c. Solve -t = r + 4y, 0 = 4r - r - y + 11 for r. -4 Let n(z) = 12z2 + z3 - 10z - 11z - 13 + 7z. Let r be n(-13). Suppose 0 = -13u - r. Solve u = 5d - 2p - 29, 5d - 17 = -2p - 2p for d. 5 Let q(w) = 6 - 3 - 12w + w3 + 4w - 7w2. Suppose 9 - 297 = -36j. Let f be q(j). Solve -4x - c = c + 4, 1 = -x - fc for x. -1 Suppose -13m + 3m + 27 = -m. Solve 5s = -mf + 32, 5f = 5s - 2s + 8 for f. 4 Suppose 0 = -3h + z + 2z + 114, -z = -4. Let v(w) = w2 + 4w - 12. Let q be v(-5). Let m be (8/6)/(-4)h/q. Solve -4j + 12 = mo, 4j + o - 3 = 7 for j. 2 Suppose -4z - 18 = -102. Suppose -4k + 2f + 9 = -17, -4k + 5f + 35 = 0. Let j be 3((-4)/12 - (-4)/6). Solve -4a + 2 = 2w, -ka - j = -w - z for a. 3 Let y = 8 - 4. Let o = -77735 - -77738. Solve 0 = -yx - oc - 21 - 3, -2x + 14 = -5c for x. -3 Suppose 5k + 2 = -13, 4z = -4k + 1136. Let b = z + -285. Solve -x = 2t - 3, 2x = -bt + 3 + 5 for x. 5 Suppose 0 = -0f + 6f - 384. Let u = f + -48. Suppose -2n - 3 = -5k + 3, 0 = -2n + 4. Solve -m = -5y + m + 25, -2y + u = -km for y. 3 Let x(l) = l3 + 15l*2 + 19l + 70. Let j be x(-14). Suppose 4y - 2c - 4 = 70, -2y = c - 39. Solve -o = -3b - y, -3o = -b - jb - 17 for o. 4 Let m be (-9 + 11)/(4/61). Suppose 4f = -5v + 16, 0 = f + mv + 3. Let q(s) = 4s - 27. Let j be q(f). Solve -5u = -4h + 2 + j, 9 = -3u + 3h for u. 1 Let c = 2934 + -2930. Solve ci + 21 = 3p + 2, -p + 4i + 9 = 0 for p. 5 Suppose 40 = -19h + 27h. Suppose -3 = -c - 1, -6 = -hb + 2c. Solve 0 = bu + 3u + 15, -u + 22 = 5z for z. 5 Suppose 0 = -8k + 3 - 3. Let u = -183 - -185. Solve -2w + 3i - i = k, -w = -3i - u for w. -1 Let l = 203 + -239. Let o be (12/(-9))/(12/l). Solve of = 3h + 20, 4h + 3 = f - 2 for h. 0 Let z = -3687 + 3702. Solve 2d - 26 = -3f - z, -4d = 3f - 19 for f. 1 Suppose 38423j = 38418j + 5. Let r = 1 - -1. Solve -5f + r = 4q, -6 = -q + f - j for q. 3 Suppose 65 = 367j - 354j. Solve 0 = jf + 2k - 30, 2f - 7k + 3k = -12 for f. 4 Let a(h) = h2 - 4h - 6. Let y be a(6). Suppose -v = 4x - 4v - 28, x + 3v = -8. Let f be (63/(-27))/72-3. Solve -c - 3c = -fi - y, -9 = -xc + i for c. 3 Suppose -67m - 14 = -68m. Let l be (-56)/(-32) - (-2)/8. Suppose l = -2y + 8. Solve -3k + 2 = -d, yd + 0k - m = -k for d. 4 Suppose 19y - 83 = -7. Solve -6 = 2m + 2u - yu, 5m + 4u = -15 for m. -3 Let n = -784 + 229. Let z = -550 - n. Solve 0 = -za + 4c + 19, 12 = 5a + c + 2c for a. 3 Let t be (-227)/(-4) - (-2)/8. Suppose -12i - 160 = 488. Let s = i + t. Solve 4x = 5u + 17, -su + 5u = -3x - 16 for u. -5 Let z(o) = o*3 - 33o*2 - o + 35. Let p be z(33). Solve -5l - 3 = -4y, py = -28l + 23l - 21 for l. -3 Let p(j) = 4j3 + 20j*2 + 9j + 53. Let b be p(-5). Solve -10 = 2z - y, 5z + y + b = -24 for z. -6 Let k be ((-1)/(-2))/(1/(-80)). Let s = 40 + k. Let f be (-4 - -1)16/(-12). Solve -4l + 4r = s, 0 = 3l + fr - 20 - 1 for l. 3 Let m = 2800 - 2796. Solve -3w = -0 - 9, -mo + 5w = -5 for o. 5 Let o(f) = -9f - 13. Let v be o(-7). Let h = -42 + v. Solve -l = -5m - h, -3l = m + 5 - 13 for l. 3 Let t(s) = 3s - 86. Suppose -71 - 49 = -4w. Let b be t(w). Solve -b = 2p + 2d, -p + 2d + 14 = -d for p. 2 Suppose -o = 3a - 19, -4a - 4 + 24 = -4o. Let l be 4((-21)/a - -4). Let j(h) = h + 14. Let p be j(7). Solve -ln + 4 = -2z, -5n - 4z + p + 7 = 0 for n. 4 Let n(k) = -3k - 4. Let i be n(-3). Let b(a) = 2a*2 + 18a + 84. Let d be b(-10). Let g be d/50 - (-40)/(-500). Solve ih = gx - 2 + 8, 3x - 6 = 0 for h. 2 Suppose 0 = -19w + 2w + 408. Solve 3g - k + 12 - w = 0, 0 = 4k for g. 4 Let t = -4 + 6. Suppose 0 + 43 + 9 = 13w. Let s be (-2)/(-3) - (-4)/3. Solve -3y = so + 8, -y + to - 4 = wo for y. -2 Suppose 55f - 36 = 53f - 3d, -5d = -4f + 72. Solve 4m - 7m - f = -z, -5m - 37 = -4z for m. -5 Let g = 28004 - 28000. Solve y - 13b + g = -9b, 3y + 4b - 4 = 0 for y. 0 Suppose 21k - 93 = -10k. Suppose -kt + 19 = 2p, -3p - 3t + 12 + 9 = 0. Solve 5i = 2q + 10 - p, 16 = 4i - 4q for i. 0 Suppose 578 - 10 = 102a - 31a. Solve 7x - 5b = -13, x - 5b + a = 19 for x. -4 Let u(p) = 61p - 2619. Let k be u(43). Solve kb = -2z + 6, 16 = -28b + 32b for z. -5 Suppose 0 = -10m - 74 + 194. Let p be (-60)/(-18) - m/9. Solve 3f = pv - 1, -4f + 2v = -2f + 4 for f. 3 Let q be 13/((-156)/(-120)) - 7. Solve -y + 17 = 5b, 3b - 43 + 28 = -qy for y. 2 Suppose 104 + 36 = 8n + 20n. Solve 2s = ng - 15, 37s + 2g = 34s + 25 for s. 5 Let r(v) = -v2 - 54v - 531. Let s be r(-13). Solve 6m - 5p + 17 = 3m, s = 2p for m. -4 Let b = -37460 - -37481. Solve 4k - 5p = b, 3k + 13p - 12 = 16p for k. -1 Suppose 5t = 5y - 25, 2t + 8 + 2 = 5y. Suppose 3p - 8 = 2q - q, 5q - 40 = -5p. Suppose 6m = -pm + 40. Solve 41 = mg + 5h, 5g + yh = 3h + 5 for g. 4 Suppose -98g + 55 = -353 - 82. Solve 2k + 3f = 4, 0 = -gk + 6f - 2f + 10 for k. 2 Suppose 3m - 2a = -0m + 986, 2m + 3a = 666. Let f = -330 + m. Solve f = 2v - 4q - 24, 4 = 2v + v + 2q for v. 4 Let j(z) = z2 - 2z. Let u be j(3). Let l be 12/((1836/(-48))/(-51)). Solve 0y = -m + uy - l, -m + 2y = 11 for m. -1 Suppose 5j = -25, -t = t + j - 1. Suppose -tg + 4g + 2l - 8 = 0, -5l + 15 = 0. Solve 3o + gx + 11 - 29 = 0, -14 = -2o - 2x for o. 4 Let s be (9/6)/((-9)/(-48)). Suppose -st = 19 - 35. Solve 7f = tf + 5d - 20, -5 = -5d for f. -3 Suppose -10038z + 5 = -10037z. Solve b - 10 + 11 = i, -zb - 2i + 30 = 0 for b. 4 Let i be 56 + 06/(-36). Suppose -45n = -50n + i. Solve 4h + 3m + 12 = 0, nh + 15 = h - 4m for h. -3 Let l be 2208/168 - 5/(-175)-5. Solve -9v + 3w - 19 = -lv, 4v + 2w = 18 for v. 4 Let w = 11921 - 11920. Solve 2g + 10 = s - w, -s = 5g + 24 for g. -5 Let f = -27588 + 27601. Solve -5u + fj - 1 = 12j, 5j = 4u + 5 for u. 0 Let u(x) = -5x + x - 44x*2 + 8 + 45x*2 - 29. Let f be u(7). Suppose f = -0l - l + 6. Solve -1 = -2d + 3q, -d + 2q = 2d + l for d. -4 Let i = -2671 + 2712. Solve -4k - 4p + 16 = 0, -39p = -3k - ip + 7 for k. -1 Let n be (-100)/(-6)132/55. Suppose 18c = 14c + n. Solve -5x + c = 3p, -5p + 26 = -4x + 3x for p. 5 Let q be 14 + (-5 - -9 - -1)	{ "pile_set_name": "DM Mathematics" }
reater: w or -1/4? w Let p(c) = c*3 + 10c2 + c + 11. Let d be p(-10). Let q(z) = z2 + z. Suppose 2a + 3a = -5. Let t be q(a). Is t smaller than d? True Let l(t) = t*2 - 10t + 4. Suppose -2w = 2w - 44. Let q be l(w). Which is greater: q or 16? 16 Let p = 0.19 + 0.51. Let x = -0.6 + 0. Let s = x + p. Is 3 less than or equal to s? False Let o(s) = s + 33. Let i = 34 + -49. Let d be o(i). Let j = 46 - 28. Is d greater than j? False Let l(s) = -s*2 + 3. Let b = 1 - -8. Let h = -9 + b. Let f be l(h). Which is bigger: 5 or f? 5 Let f = 6.225 + -1.932. Let x = -0.577 - f. Let c = x + -0.13. Are c and -2/7 unequal? True Let y = -0.27 - 0.73. Let x = 0.04 - -8.96. Let o = 11 - x. Which is smaller: y or o? y Let m(i) = -45i - 589. Let r be m(-20). Which is greater: 309 or r? r Suppose -2 = 4q - 3q, 5p = -q - 22. Suppose 0 = 2d - 5v - 19, -20d = -15d - 3v. Is d equal to p? False Let r be (-3)/(-2)(11386/(-1626) + 7). Which is smaller: r or 1? r Let j(i) = -24i - 168. Let v be j(-6). Which is smaller: v or -259/11? v Let s(c) = -99c2 + 9c - 7. Let q(o) = -148o2 + 14o - 11. Let r(i) = 5q(i) - 8s(i). Let g be r(1). Is 51 <= g? True Let t = -99 + 120. Which is greater: 148/7 or t? 148/7 Let i = -19 - -19. Suppose -8c + i = 8. Is 2/5 > c? True Let d be 536/(-30) - -8. Let o = 7 - 4. Suppose -ol + 1 = dy - 3, -4 = l + 2y. Is 4 greater than l? False Let h = 2.98 - 3. Let j = 0.12 + h. Let m = 2/227 - 251/2724. Is m at least j? False Let a(p) = -p2 + 9p - 11. Let t(m) = -m + 2. Let v = -14 + 9. Let h be t(v). Let y be a(h). Is 7 != y? True Let u be ((-2)/(-15))/((-3)/(-9)). Let z = 2573 + -2573.06. Is z equal to u? False Let v = -13 + 12.98. Suppose 0 = -s + 4s - 3. Suppose 2q + s = 3. Which is bigger: v or q? q Let o = 438312 - 5706549/13. Let v = 653 + o. Let f(j) = -j*2 - 3j - 3. Let x be f(-2). Is x at least v? False Let a be (-117)/(-12) + 1 + (-15)/20. Let w be (-7 + 8)/(-12/a). Which is greater: w or -7? w Suppose -2u - 18 = -5u. Let p = -1.53 + 1.5. Let b = p - 0.07. Is b at most u? True Let t be (-980)/248 + (-4)/(-1). Which is greater: t or -1? t Let g = 697 - 646. Do g and 46 have different values? True Suppose 1881 = 34o - 397. Is o equal to 67? True Let b = -1/9940 + -2483/19880. Let h be (-4)/(-14) - (-60)/(-14). Let w = h - -3. Which is smaller: b or w? w Let t = 415 - 432. Is -16 less than t? False Let w be (-5)/(-7) + 9398/259. Which is bigger: w or 113/3? 113/3 Let g be 15 + 0 + 331 + -345. Let u be ((-2)/(-2))/(2/(-6)). Which is smaller: u or g? u Let y = 1.8 - 1.6. Let i = -0.2 + y. Let t = 0.1 + i. Which is smaller: -0.08 or t? -0.08 Let y(k) = -k*2 + 9k - 26. Let o be y(4). Is o less than or equal to 4/11? True Suppose 72 = -5b + 3t, -b - t - 3 = 13. Is 2/3 less than b? False Let i = -12.94 + 5.94. Is i less than 73? True Let a(k) = -74k - 630. Let g be a(-7). Which is smaller: -124 or g? -124 Suppose 24 = 24i - 21i. Let d(z) = -2z*2 + 15z + 11. Let m be d(i). Is m at most as big as 5? True Let s(d) = d*3 + 5d*2 - 2d + 5. Let m be s(-5). Let x be (18/m)/(6/15). Let a be (-3)/x + (-8)/(-11). Is a smaller than -1? False Let s(i) = i*2 + 7 + 9 - 30i + 45i. Let g be s(-14). Let d be (-2)/g - (-1)/(-4). Which is smaller: -1 or d? d Let p be (-2)/(-2) - 0/(-1). Let b be ((-6)/36)/(13/117). Which is greater: b or p? p Let v(a) = -a2 - 3. Let q be v(0). Let j = q - -2. Suppose 7c - 17c = 0. Is j <= c? True Let p = 282 + -577/2. Let f(b) = -b3 + 6b*2 + 17b - 14. Let g be f(8). Which is greater: p or g? g Suppose 12m + 405 - 9 = 0. Which is bigger: m or -67/2? m Suppose 3r + 4 = -140. Let z = 49 + r. Which is greater: z or -2/101? z Let l = 0.7 + -72.7. Let j = 79 + l. Is j < 1? False Let q = 94 + -84. Suppose 19w = 29 - q. Is w at least 8/7? False Let c(a) = -a - 11. Suppose -3p = -p + 24. Let h be c(p). Is 1/9 > h? False Suppose -2b = -3b + 42. Let d be ((-3)/(-108))/(b/944). Let z = d - -14/27. Which is smaller: 0 or z? 0 Let h(c) = -25c + 214. Let q be h(12). Which is bigger: -87 or q? q Let j = 236 + -8261/35. Which is smaller: j or -1? -1 Let o(w) = -w2 + 16w - 11. Let x = 55 + -40. Let d be o(x). Is -0.03 at least as big as d? False Let z be (-3)/2547 - 0/1. Let v = -589/19527 - z. Is v bigger than 1? False Suppose 12h = -3s + 7h + 32, -2h = -8. Are s and 13/4 non-equal? True Let q = 97 + -89. Suppose 5g = -18 + 53. Suppose t + 0t - g = 0. Is t less than q? True Let s = -121 + 96. Let r = -28 - s. Is r at most as big as 6? True Let u be 13(-3)/31. Is u >= -13? True Let w be (-20)/(-190) + (-4862)/(-19) - 6. Which is smaller: 249 or w? 249 Suppose 27 = -3c - 5w, 18w + 5 = -2c + 19w. Let z = -4 - 0. Is z not equal to c? False Let f = -36 + -12. Let v = f - -39. Is 0.5 smaller than v? False Suppose -3o + 3 = t, -o + 1 = -2t - 0. Which is smaller: -1/1697 or t? -1/1697 Let u = 12 - 11. Let i = 22 + -24. Let v be (-2 - (-90)/23) + i. Which is smaller: v or u? v Let a = -2194 + 6581/3. Let q be (-2)/(-6) + 1/3. Which is bigger: q or a? q Suppose -103 - 5 = 54g. Is -8/5 < g? False Suppose 2k + k = 0. Let b = -364 - -660. Let m = 5626/19 - b. Which is greater: m or k? m Let x(c) = c3 - 12c*2 + 1. Let u be x(12). Suppose 0 = 3v + 11 - 5. Let k be ((-1)/(-6))/((-1)/v). Is u >= k? True Let z = 75.956 - 76.1. Which is smaller: 1 or z? z Let c = -182 + 173. Is -3 equal to c? False Let h be (-22)/(-18) - (-1 + 2). Let c(v) = -3v - 10. Let x be c(-5). Let q be (-38)/133 + x/(-7). Is h greater than q? True Let f(m) = -m3 - m2 + 6m + 5. Let z be f(-3). Suppose -zw - 4k = -7, 0k = w + 2k - 5. Is w less than -8/5? False Let p be ((-3)/6)/(1/(-2)). Let c = 4 - p. Let d = 101 + -99. Is c at most d? False Let p = 977 - 976. Which is smaller: p or 5? p Let r(k) = 2k2 + 21k - 12. Let x be r(-9). Which is smaller: x or -36? x Suppose -3i + 107 - 688 = 4y, -2y - 3i = 295. Let k be 4/42-3 - y/182. Which is smaller: 0.03 or k? 0.03 Let n = 17 + -17. Let r be 6/(-42) - 3/28. Is n <= r? False Let f be 2 - (3 - 4)-2. Suppose f = 5a - 2a + q - 13, q + 17 = 2a. Is 4/5 < a? True Let l = 118.8 + -119. Suppose -6d + 4f - 9 = -d, -5f = -d + 15. Which is greater: l or d? l Suppose 0 = 6p - 415 - 95. Let y = 53 - p. Is -33 at least y? False Let h be 228/5(30 - 27). Is 138 at least h? True Let r be 20/70 - ((-1266)/(-1995))/2. Which is greater: r or 0.1? 0.1 Let r be 6/(-95) - (-33)/(-165). Do 0 and r have the same value? False Let h = -14 + 15. Are 1/301 and h equal? False Suppose 2 = -j, -3s + j + 6 = -7s. Let f = -7/10 + 73/110. Which is bigger: s or f? f Let d = 2.633 - 0.233. Are -5 and d equal? False Let f = 91/340 - 3/170. Let n = -3.25 - 1.7. Let a = n + 5. Which is greater: a or f? f Suppose 14 = 3n - 1. Suppose -6 = 2o - no. Suppose 18 = -3a + ot - 3, -t + 33 = -4a. Which is smaller: -11 or a? -11 Let k = -79/9 - -9. Let r(j) = 5j2 + 5j + 7. Let d(s) = -s*2 - s - 1. Let i(l) = 6d(l) + r(l). Let c be i(0). Which is greater: c or k? c Let j = -5 + 7. Suppose -8 + j = -a. Let p be (5/(-10))/(-37/(-42)). Which is bigger: p or a? a Let g be (-5)/2(-3 - -1). Let f be (567/(-45) + 11)/((-4)/10). Is g >= f? True Suppose -25 = 7l - 25. Which is bigger: 2/1191 or l? 2/1191 Let m(l) = -l2 - 8l - 6. Suppose 44 = -4y - 3i, 5y = i - 39 + 3. Let t be m(y). Let x = -467/2 - -229. Does t = x? False Let s be ((-8)/6)/(16/(-12))2. Is -9.9 at most s? True Let v be -2 + 5/4 - (-1669)/(-4). Let h = -2932/7 - v. Suppose q = -0q. Is h equal to q? False Let x(i) = 19i - 138. Let y be x(6). Let r = 30 + -55. Which is smaller: y or r? r Let x = -13 - -24. Let s = x + -9. Let a = s + -2. Which is smaller: 1/3 or a? a Let n = -54/19 - -524/171. Is -12.8 less than n? True Let y(n) = -n*3 - 6n*2 + n + 14. Let r be y(-6). Suppose 6 = -7z + rz. Which is smaller: 3 or z? 3 Suppose 1027 = 16o + 1187. Is o smaller than -83/9? True Let p be -1 + 6 + (1 - -39) + 0. Is p greater than 2? True Let g be 6/(-4) + (-3)/(-6). Is g less than -9/28? True Let r = 3556 + -1145033/322. Which is greater: 0 or r? 0 Suppose -11*z - 359 + 1085 = 0. Suppose -z = i - 66. Which is smaller: -6/19 or i? -6/19 Let g(q) = -q + 4. Let r be g(2). Let l = -47 + 89. L	{ "pile_set_name": "DM Mathematics" }
What is u? -1209, 0, 2/5, 4 Solve -14p2 + 5192p/3 + 1984/3 = 0 for p. -8/21, 124 Factor 2v2/5 - 65444v/5 + 535364642/5. 2(v - 16361)2/5 What is a in -19430a*4/3 - 77716a*3/3 - 58274a*2/3 + 4a = 0? -3, -1, 0, 2/9715 Let b*2 - 393b + 38012 = 0. Calculate b. 172, 221 Solve 2l4/3 - 318874l*3/3 + 318872l*2/3 = 0. 0, 1, 159436 What is v in 4v*4/7 + 104v*3/7 - 1884v*2/7 + 5616v/7 = 0? -39, 0, 4, 9 Solve 3z3 + 12z*2 - 111z - 120 = 0. -8, -1, 5 Suppose -5z4 - 85z*3 + 3170z*2 + 24640z = 0. What is z? -32, -7, 0, 22 Solve 582l5/5 - 1168l*4/5 + 8l*3/5 = 0. 0, 2/291, 2 Determine l, given that -2l*4 - 11680l*3 - 23336l*2 + 93408l = 0. -5838, -4, 0, 2 Suppose -3896w3 - 11708w*2 - 60w = 0. What is w? -3, -5/974, 0 Factor -3w2 - 314424w - 1257648. -3(w + 4)(w + 104804) Determine r so that 4r2 + 239088r + 3572691984 = 0. -29886 Factor -4s2/7 - 15604s/7 + 15608/7. -4(s - 1)(s + 3902)/7 Find x such that 2x4/9 + 70x*3/9 - 346x*2/3 - 14302x/9 + 32164/9 = 0. -43, -11, 2, 17 Solve 100r5/7 - 2050520r*4/7 + 6560336r*3/7 + 6232544r*2/7 + 1312128r/7 = 0. -2/5, 0, 4, 20502 Find t such that -t*3 - 1300t*2 + 61871t - 60570 = 0. -1346, 1, 45 Suppose -2j3/7 + 136j*2/7 + 1406j/7 - 220 = 0. Calculate j. -10, 1, 77 Solve 1125q3 - 109650q*2 + 2558780q + 5565160 = 0 for q. -2, 746/15 Suppose i*5/4 - 15i*4/2 - 67i*3/4 + 24i*2 = 0. Calculate i. -3, 0, 1, 32 Solve -4u*2/9 - 14948u/9 + 75040/3 = 0. -3752, 15 Factor 2r4/3 - 1460r*3/3 + 23906r*2/3 + 29509520r + 2451149664. 2(r - 489)2(r + 124)*2/3 Find x such that 2x*2/3 + 1916x/3 - 211120 = 0. -1218, 260 Find o such that -2o5/19 + 100o*4/19 - 1478o*3/19 + 7732o*2/19 - 3776o/19 - 51968/19 = 0. -2, 7, 8, 29 Factor 2g2/5 - 1834798g/5 + 1834796/5. 2(g - 917398)(g - 1)/5 Find u, given that -3u2 - 372u - 1440 = 0. -120, -4 Find n, given that -2n3/17 - 42n*2/17 - 16n/17 + 480/17 = 0. -20, -4, 3 What is w in 8w4 + 8362w*3 + 68298w*2 - 149368w - 41480 = 0? -1037, -10, -1/4, 2 Factor -4x4 + 36128x*3 - 81468568x*2 - 489787296x - 735168996. -4(x - 4519)2(x + 3)*2 Let -3z*3/4 - 2103z*2/4 - 387717z/4 - 6628017/4 = 0. Calculate z. -341, -19 Factor 2p3/9 + 100p*2/9 + 128p. 2p(p + 18)(p + 32)/9 Find b, given that -b5/4 + 228b*4 - 682b*3 + 453b*2/2 + 2729b/4 - 909/2 = 0. -1, 1, 2, 909 Find o such that -5o2 + 7025o - 83580 = 0. 12, 1393 Find n, given that 556n5 + 3344n*4 - 8292n*3 + 4328n*2 + 64n = 0. -8, -2/139, 0, 1 Suppose 4c4/9 - 16780c*3/3 + 158457692c*2/9 - 52746540c - 70358544 = 0. Calculate c. -1, 4, 6291 Suppose -2y2 - 1346y + 521400 = 0. Calculate y. -948, 275 Suppose -2g4/21 + 2156g*3/3 - 15088g*2/21 - 2156g/3 + 5030/7 = 0. Calculate g. -1, 1, 7545 Factor 2c2 - 46852c + 274388738. 2(c - 11713)2 Solve -k4/10 + 79k*3/10 + 606k*2/5 - 722k/5 - 1288/5 = 0 for k. -14, -1, 2, 92 Factor 4x2/7 + 328x/7 - 3168. 4(x - 44)(x + 126)/7 What is j in -15j4 + 303j*3 + 5313j*2 - 26055j - 31050 = 0? -69/5, -1, 5, 30 Solve 3i3 + 1878i*2 + 29172i - 65880 = 0. -610, -18, 2 Factor 4o3 + 1152904o*2 + 83074227076o. 4o(o + 144113)2 Factor -z2 - 631710z - 99764381025. -(z + 315855)2 Factor 2i*3 + 438i*2 - 2682i + 4050. 2(i - 3)2(i + 225) Determine t so that t*2 + 9850t - 19704 = 0. -9852, 2 Factor -p*2 + 4787p - 52536. -(p - 4776)(p - 11) Factor -3d*3 + 2465d*2 + 13244d - 9924. -(d - 827)(d + 6)(3d - 2) Factor -3l*3/7 + 159l*2/7 - 309l/7 + 153/7. -3(l - 51)(l - 1)2/7 Suppose -f2/4 + 1072f = 0. Calculate f. 0, 4288 Find a such that a3/7 - 5443a*2/7 + 7392936a/7 + 37100880/7 = 0. -5, 2724 Find u, given that 5u2 + 1641180u + 134673589620 = 0. -164118 Suppose 5w4 - 140w3 = 0. Calculate w. 0, 28 Determine b so that b2/8 - 997b/4 - 18027/8 = 0. -9, 2003 Factor 5l*2 + 825485l - 1650990. 5(l - 2)(l + 165099) Suppose -c*5 - 728c*4 + 1459c*3 - 730c2 = 0. What is c? -730, 0, 1 Factor -s4 - 1156s3 - 17099s*2 + 18256s. -s(s - 1)(s + 16)(s + 1141) Determine f, given that -f3 + 2555f*2 - 1742048f + 138121984 = 0. 91, 1232 Factor 2x5/9 - 104x*4/9 + 100x*3/3 - 296x*2/9 + 98x/9. 2x(x - 49)(x - 1)3/9 Factor -4w*2/5 - 4263w/5 - 7448/5. -(w + 1064)(4w + 7)/5 Find k such that k*2 + 392k - 5265 = 0. -405, 13 Factor -2f2 - 690f + 156312. -2(f - 156)(f + 501) Let -4s5/3 - 332s*4/3 + 20s*3/3 + 1660s*2/3 - 16s/3 - 1328/3 = 0. What is s? -83, -2, -1, 1, 2 Factor -3r5 - 2799r*4 - 11160r*3 - 11148r*2. -3r*2(r + 2)*2(r + 929) Factor n*2/3 + 1015n/3 + 2026/3. (n + 2)(n + 1013)/3 Factor 13l*3 + 112l*2 - 656l. l(l - 4)(13l + 164) Determine n, given that -5n*4 - 85n*3 - 280n*2 - 260n = 0. -13, -2, 0 Let -o*3 + 1693o*2 - 882720o + 131155200 = 0. Calculate o. 253, 720 Factor 3l3 + 1029l*2 - 7332l + 6300. 3(l - 6)(l - 1)(l + 350) Factor 2m*3/9 + 34m*2/9 - 440m/9 + 728/9. 2(m - 7)(m - 2)(m + 26)/9 Solve 5v*2 - 463645v - 463650 = 0 for v. -1, 92730 Find z, given that -3z3/7 + 1746z*2/7 + 7047z/7 - 8790/7 = 0. -5, 1, 586 Let -5a5 - 25a*4 + 2240a*3 + 22540a*2 = 0. What is a? -14, 0, 23 Determine y so that -61y*2 + 13181y - 1080 = 0. 5/61, 216 Factor m*4/4 - 1235m*3/4 + 2147m*2 + 2456m. m(m - 1228)(m - 8)(m + 1)/4 Solve -3k*3 - 5185k*2 - 1726k + 3456 = 0 for k. -1728, -1, 2/3 Suppose -2k4/5 + 402k*3/5 + 404k*2/5 = 0. Calculate k. -1, 0, 202 Factor 5t*2 + 170010t + 1445170005. 5(t + 17001)2 Determine z, given that 2116z*2/5 - 156032z/5 + 2876416/5 = 0. 848/23 Find h such that 3h5/7 - 2787h*4/7 - 6h*3/7 + 5574h*2/7 + 3h/7 - 2787/7 = 0. -1, 1, 929 Factor -190x2/9 + 15794x/9 - 664/3. -2(x - 83)(95x - 12)/9 Factor n3/4 + 367n*2/4 - 25069n/2. n(n - 106)(n + 473)/4 Solve -3c4/7 - 6381c*3/7 + 6402c*2/7 + 5472c = 0. -2128, -2, 0, 3 Factor -10b2 + 118744b - 47496. -2(b - 11874)(5b - 2) Suppose 2f*4 - 3260f*3 - 16344f*2 - 9828f + 29430 = 0. Calculate f. -3, 1, 1635 Factor 16q3 + 2370784q*2 + 2370772q + 592692. 4(q + 148173)(2q + 1)2 Factor 3i*3/2 + 15i*2/2 - 759i/2 + 741/2. 3(i - 13)(i - 1)(i + 19)/2 Factor 3z*3 - 291z*2 + 5457z + 5751. 3(z - 71)(z - 27)(z + 1) Find o, given that -453o*3 + 91509o*2 + 184218o - 1224 = 0. -2, 1/151, 204 Find c, given that -5c5/4 - 2965c*4/4 + 4475c*3/2 + 1475c*2 - 8930c + 5960 = 0. -596, -2, 1, 2 Suppose 4k4 + 240k*3 - 2212k*2 - 2448k = 0. Calculate k. -68, -1, 0, 9 Factor v*3 - 146109v*2 - 292221v - 146111. (v - 146111)(v + 1)2 Factor -46875s*3/2 + 70125s*2 + 4497s/8 + 9/8. -3(s - 3)(250s + 1)2/8 Let -2c*2/9 + 2810c/9 - 12064/3 = 0. Calculate c. 13, 1392 Factor 12o3 + 106700o*2 - 355832o - 284640. 4(o - 4)(o + 8895)(3o + 2) Let 4o2/5 - 19424o/5 - 58308/5 = 0. What is o? -3, 4859 Factor a*2/4 - 1114892a + 1242984171664. (a - 2229784)*2/4 Suppose 3j*3 - 10038j*2 = 0. What is j? 0, 3346 Factor 3t*2/5 + 5247t/5 + 31374/5. 3(t + 6)(t + 1743)/5 Suppose 3d2 - 16794d + 33576 = 0. Calculate d. 2, 5596 What is i in -i*2/3 - 820i/3 - 2700 = 0? -810, -10 Find u such that 290u5/3 - 568u*4 + 1202u*3/3 + 124u*2 - 160u/3 = 0. -2/5, 0, 8/29, 1, 5 Factor -3h3 - 414h*2 + 2568h - 3456. -3(h - 4)(h - 2)(h + 144) Let -3p*4 - 6033p*3 - 12045p*2 + 18081p = 0. Calculate p. -2009, -3, 0, 1 Let 36t5 - 1460t*4 + 672t*3 + 5232t*2 - 4480t = 0. Calculate t. -2, 0, 1, 14/9, 40 Solve a*4/12 - 1759a*3/3 + 3517a*2/6 + 1759a/3 - 2345/4 = 0. -1, 1, 7035 Factor -5u3 + 2405u*2 - 45995u - 48405. -5(u - 461)(u - 21)(u + 1) Factor -2l*2/5 - 3268l - 682752/5. -2(l + 42)(l + 8128)/5 Solve -5v5 - 593445v*4 - 17608551670v*3 + 17609738570v*2 + 17608551675v - 17609145125 = 0 for v. -59345, -1, 1 Solve -20z5/7 + 138z*4/7 + 174628z*3/7 + 17358z*2/7 - 17456z + 34920/7 = 0. -90, -1, 2/5, 1/2, 97 Determine d so that -4d3 + 10104d*2 - 6088356d - 373336544 = 0. -56, 1291 Let -5a5 - 70a*4 - 280a**3	{ "pile_set_name": "DM Mathematics" }
in the form j + gz and give j. 6 Express 1546m4 + m3 + 5m - 46m*2 + 56m*2 - 7 - 1545m4 + m3 in the form s + vm + um*2 + lm*3 + fm*4 and give v. 5 Express (-n - 1 + 1)(419n2 + 1321n*2 + 218n*2) - 10n*3 + 28n - 28n as dn + kn3 + un*2 + v and give k. -1968 Rearrange (2 + 2 - 3)(-3j2 + 3j*2 - 3j*2)(-95 - 142 + 86) - 5 - 2j2 + 6 - 4j*2 to the form g + pj*2 + oj and give g. 1 Rearrange 17337 + 147u2 - 43u*2 - 17337 + 1394u*2 to the form r + ju*2 + fu and give j. 1498 Rearrange -s*3 + 0 - 4 + 19914975s - 40s2 - 19914973s to the form ns2 + ws + qs3 + b and give q. -1 Rearrange 12v - 20 - 30v - 2v*2 + 22 + 988v*3 + 18v to yv3 + zv*2 + tv + a and give a. 2 Express 4 - 10s + 0s + 73s3 + 5917s*2 - 5915s*2 in the form fs*3 + gs + d + ks2 and give k. 2 Rearrange -163r*4 + 91r*2 + 6 - 27r*2 - 48r - 31r2 + 50r - 35r2 to the form pr + vr2 + hr*4 + wr*3 + q and give v. -2 Rearrange 22 + 1172l + 2817l - 45 + 23 to the form j + pl and give p. 3989 Express 520x4 + 1889x*4 - 6x4 + x4 - 4x + 4x + (x - x - x*3)(-5x + 0x + 3x) in the form gx*3 + zx*4 + yx + mx2 + b and give z. 2406 Express 5304z*2 - 2651z*2 + 2435 - 2651z*2 in the form oz*2 + tz + g and give g. 2435 Express -67n3 - 6n - 11768n2 + 66n*3 + 11795n*2 - 2 in the form an*3 + p + sn*2 + ln and give l. -6 Express -74 - i - 23800i2 + 23753i*2 + 81 in the form xi*2 + m + pi and give x. -47 Rearrange (5 - 3 - 1 + (1 - 4 + 2)(-2 - 3 + 6) - 2 - 3 - 3)(36q3 + 22q*3 - 93q*3) to the form h + uq*2 + iq + cq3 and give c. 280 Rearrange -28475s*3 - 2984s*3 + 441 - 873 + 432 + (0s*3 + 0s3 + s3)(0 - 4 + 2) to cs*2 + z + os + xs3 and give x. -31461 Rearrange 98 + 28a*2 - 3a*3 - 206 + 6a + 104 + 2a3 to h + la + wa3 + ua*2 and give w. -1 Express (-k - 3k + 2k)(-4k - k3 + 141987k*2 + 8k - 142330k2) as lk + rk3 + c + xk*4 + ok*2 and give o. -8 Rearrange 243 - 106958r*4 + 106953r*4 + 3r3 - r3 + (12r2 + 10r*4 - 12r*2)(-2 - 2 + 5) to or3 + dr*4 + l + mr + br2 and give d. 5 Express 889q - 1775q - 2103 + 16 + 880q as iq + o and give i. -6 Rearrange (-35 + 3 - 39)(5r + 91 - 91 - 5r + 668r3) to b + pr*2 + yr*3 + hr and give y. -47428 Express 3l - 29l*4 - 1162l*2 - 7 - 2l + 1164l2 - 3 as tl + dl4 + h + kl*2 + il3 and give i. 0 Express (-i3 - i*3 + 0i*3)(-14768i + 45260i - 12334i) as gi + b + si4 + ai*2 + ri3 and give s. -36316 Rearrange -a2 + 8296a - 40 - 4 - 2a*3 - 8294a + 7 - 2a4 + a3 to the form wa*2 + pa + u + qa4 + ha*3 and give q. -2 Rearrange (4 - 4 - t)(-3t - 2t + 3t) + 322 + 153 + t + 213t*2 - 203t*2 to the form wt + dt2 + s and give d. 12 Rearrange (-f2 + f2 - f4)(-1 + 3 + 0)(123711 - 64059 - 65090) to the form x + tf*4 + lf + kf2 + df*3 and give t. 10876 Express (6t - 2t - 2t)(-6012 + 197 - 5268 + 1185) as w + st and give s. -19796 Express -70f3 + 62f*3 - 70f - 2f + 2 as tf + af2 + mf*3 + n and give n. 2 Rearrange (11 + 23 + 19)(-2p + p + 0p)(p2 + 0p + 0p + (-825 + 825 + 109p)(-2p + p - p)) to the form np3 + j + yp*2 + hp and give n. 11501 Rearrange -26g3 - 91g*2 + 60g*2 - 27g*2 - 42g*2 - 2g*3 to cg*2 + sg*3 + ng + y and give s. -28 Express (5 - 1 - 9)(-18826j*2 - 14 + 3j*3 + 18826j*2) as oj + i + xj3 + rj*2 and give x. -15 Rearrange ((-4 + 0 + 5)(-2 - 1 + 4)(6 - 1 - 1)(2 + 2 + 0)(1 - 2 + 4) + 0 + 23 + 2)(-1 - 2g + 1) to kg + i and give k. -146 Rearrange (-6k2 + 2k*2 + 2k*2)(7 - 2 - 2) + 11k - 4304 - 9k*2 + 4305 + 12k*2 to ok + j + mk2 and give j. 1 Express 434l + 355 - 888l + 456l as vl + s and give v. 2 Rearrange -3p*3 - 179p*4 - 18p + 52p - 35p to the form mp4 + xp*2 + tp*3 + q + gp and give m. -179 Express (-6 + 3 - 16)(3i + 2i - 3i) + 2i + 0 + 0 + 3i - 3i + i + (3 + 5 - 2)(2i - 2 + 2) in the form wi + n and give w. -23 Express 2697o2 + 1100o*2 + 198o*2 as bo*2 + q + lo and give b. 3995 Rearrange -4d + 2d + 3d3 - 8 + d2 + d3 + 37 - 22 to qd + u + ld2 + yd*3 and give l. 1 Express -3q*2 + 7q*2 - 6q*2 + (88 + 7q - 88)((-311 - 70q + 311)(3 - 4 + 3) - 2 - q + q + q) in the form t + dq + zq2 and give z. -975 Rearrange (-52b*2 - 78b*2 - 55b*2)(-2 + 3 - 2)(-6b + 16b - 8b) to the form kb + wb*3 + o + mb2 and give w. 370 Express -v3 + 88v - 41v*2 - 243v - 3 + 2v4 + 148v as gv4 + yv*3 + iv + h + kv2 and give i. -7 Rearrange 2m*3 + 0m*3 + 0m*3 + (0m + m - 3m)(10m2 + 0m2 - m2) + 2m3 - 2m*3 - 5m*3 to um + x + qm3 + nm*2 and give q. -21 Express (50v*3 - 86v*3 + 28v*3 + 1464v)(-1 + 3 + 0) as iv + j + zv3 + uv*2 and give z. -16 Rearrange 29q - 136q - 636 + 106q to f + pq and give p. -1 Rearrange 150i*2 - 288 - 43 + 341 to hi + p + xi2 and give p. 10 Rearrange 3d*2 + 5d - 5d + (-13d - 43d + 88d)(-3d + 0d + 4d) + d*2 + 107 - 34 - 56 to td*2 + z + fd and give z. 17 Express 14 - 52652c4 + 2c + c*2 + 0c + 52650c4 in the form mc + fc3 + dc*2 + p + qc*4 and give m. 2 Rearrange 500i*3 + 2 - 957i*3 - 2i*2 + 63i*2 + 403i*3 to the form v + hi + pi3 + zi*2 and give v. 2 Rearrange 16i - 5 + 4025568i3 - i4 + 7i*2 + 15i - 4025569i3 to si*2 + ai*3 + ti*4 + hi + y and give a. -1 Rearrange (-2m + 2 - 2)(-5 + 3 + 1) + (-2 + 2 - 2)(0m - m - m) - 568 + 1155 - 169m - 592 to b + fm and give b. -5 Express (-2 - 3 - 2)(331n - 95n + 300n + (-4n + n + 2n)(2 - 2 + 2)) in the form rn + q and give q. 0 Rearrange 3f2 + 10f*4 + 78314f + 6 - 2f2 - 78319f to the form af + xf*3 + y + bf*4 + cf*2 and give b. 10 Express (0k - 3k + 0k)(-k + 0k + 0k + (-371 - 32 - 501)(-5k - 3k + 5k)(-4 + 4 + 1)) in the form a + dk + xk*2 and give x. -8133 Rearrange -2666o*2 - 3533 + 3533 - 10o*3 + 8o*3 - 2o*4 to t + zo + yo4 + fo*3 + xo*2 and give f. -2 Express (-5i + 2i + 2i)(3i*2 - 2i*2 - 7i*2) + 4i*3 - 4i*3 + 2i*3 - 623 + 624 - 3i3 + i3 as c + ti3 + gi + li2 and give c. 1 Rearrange 467n + 45 - 89 + 44 to the form o + sn and give o. 0 Rearrange (-4v + 2v + 0v)(3v - 6v + 2v) + 762 + 0v + v - 4962v*2 + 4961v*2 to the form tv + ov2 + h and give t. 1 Express -20393 - 20388 - 9580m + 40781 as n + om and give o. -9580 Express (2d*3 - 3d*3 + 0d*3)(0 - 2 + 0)(7533d + 399 + 396 - 795) as jd4 + i + bd + nd3 + zd*2 and give j. 15066 Express 0q*2 + 2q2 + q2 - 2 - q*2 + 2 + (-14 - 10q + 14)(-q + q - 2q) - 3q2 - 4q*2 + 2q*2 in the form oq*2 + aq + z and give o. 17 Express 28l3 - 90l - 11 + 2l2 - 98l + 187l in the form ol*2 + yl*3 + v + hl and give h. -1 Rearrange 95j2 - 106j*2 + 128j - 70j to the form rj*2 + ij + n and give i. 58 Express 228 + 34 - 5g - 779 as h + og and give o. -5 Rearrange -695 - 47i2 - 346 + 70i*2 - 24i*2 to the form k + fi*2 + ui and give f. -1 Rearrange -13 - 104b + 34b + 4944b2 - 4942b*2 to gb*2 + q + tb and give q. -13 Rearrange 184k4 - 9k - 92k3 - 177k*4 + 2 + 89k*3 to y + jk*3 + rk*2 + xk*4 + fk and give x. 7 Rearrange -3090w + 3090w - 19w3 - 137 to xw*2 + k + qw*3 + zw and give q. -19 Express 14w + 38128 - 19062 - 19066 + 29w*2 as sw + v + ow2 and give s. 14 Express -3h - 88h3 + 5h - 2 + 94h3 + 191h*3 + 8 as nh*2 + u + th + sh3 and give s. 197 Express 64u - 64u - 33u2 + u2 + 2u2 - 5u + 5u + (-1 + 2u + 1)(4u - 4u + u) + 8323u*2 - 1 + 2 - 8197u*2 as i + ju*2 + du and give i. 1 Rearrange ((-5 - 1 + 4)(4k - 2k - k) + 2 + k - 2)(-5 - 8 - 6)(67 + k - 67) to uk + rk2 + v and give u. 0 Rearrange -5t - 31 + 4t + 9t*4 + 29 - 166t*4 + 2t2 + t3 - 3t2 to bt*2 + ot + xt3 + kt*4 + a and give a. -2 Rearrange (-76a + 10 - 10)(-a - 3a + 3a + (3 - 2 + 1)(-7a + 2a + 3a) + a + 0a + 0a - 2a + 5a + 9a)	{ "pile_set_name": "DM Mathematics" }
0)). -43 ((3/(-9))/(57/171))/((-2)/(-196)) -98 Calculate (351/(-18))/3946968/119. -134 Evaluate 228/(-19)3/(-14)(-1)/((-30)/525). 45 Evaluate (3444/322260)/(105/(-150)). -2/131 ((-52)/1404)/(120/(-10080)) 28/9 What is ((-14)/(-12))/((-1)/(-3))(-52928)/(-4538576)? 2/49 Calculate 65/(-13)(2/(-3))/(577/1731). 10 ((-69654)/(-40185))/(4/(-6)) -13/5 What is the value of (((-5)/(-15))/((-112)/(-96)))/(8/224)? 8 Calculate -52/482021143/(-38481). 5/4 What is the value of 150/(-405)5/(35/14)60/80? -5/9 Evaluate 135/(-84)(-2807)/3609. 5/4 What is 862232/74648(-28)/(-3)? 24 Evaluate (-1)/((-45)/(-30)(-8)/((-720)/(-3))). 20 What is ((-918)/31824)/((45/288)/(-5))? 12/13 What is the value of (0/(-1))/((3/(-8))/(189/4435244))? 0 Calculate (-1)/((-5)/(-290)(39/(-26))/((-18)/24)). -29 -5603/4542/(-42) 67 145/3(-12)/1686 -10 Evaluate (255/15)/((-1530)/6030). -67 ((-1)/1)/(((-2728)/594)/(-124)) -27 What is 45/(115/(20470/267))? 30 Calculate (-54)/(-9)((-196)/(-147)9/(-8))/3. -3 Calculate ((-104)/(-364))/(20/(-760)-12/7). 38 What is (415/249)/((-250)/30)1-145? 29 Evaluate (-7)/12-15(-2112)/(-1320). 14 What is (12/324)/((69/18)/(-23))? -2/9 What is the value of (-33)/(-24)19612/2534851? 1/94 Calculate (8/(-22960)-35)/((-3)/6). -1/41 What is (-99550)/90542/77? -60 What is 1/46(-28)/(-238)-34? -2/23 Evaluate 901/24125/(35/(-7)). -45 Calculate (-8)/((171/570)/((-6)/2)10/(-4)). -32 What is the value of (95/5)/((-1)/(-12)(-3168)/792)? -57 What is (-18)/24(-63600)/(-954)? -50 (39/699)/(-1)32882/213733 -2/233 What is the value of (((-5)/12)/1)/(78/((-58032)/(-21855)))? -2/141 (-5)/(-6)-2(-3)/502/(-11) -1/55 What is the value of (396/(-55))/(55/(29700/(-162)))? 24 ((-4)/6)/(384/360250/120) -3/10 What is the value of 7/((-98)/(-14))-25? -25 What is (-81)/4-32191/4584? 27 What is the value of 47/(-23970)1022/(23)? -1/15 Calculate 5880/(-1225)(1/(-3))/((-15)/(-150)). 16 Calculate (1716/726-22)/1. -52 What is the value of ((-24)/464)/(((-1998)/72)/(-37))? -2/29 Evaluate (11336/1744)/(1/6). 39 (2/202)/(2/44210/263125) 25 What is the value of ((-4)/3)/((-9468)/(-3945))? -5/9 12/(-108)-50(-216)/228600 -2/381 What is the value of (-120)/(-140)(2660/(-30))/38? -2 Evaluate 3324/8310175/2. 35 ((-2)/120)/(266/(-26600)) 5/3 Calculate 60/21062/(3/((-216)/6)-40). 2/117 What is the value of ((-49)/735)/((-28)/22755/2)? 13/6 What is ((80/(-355))/16)/(2/(-10)125/(-50))? -2/71 Calculate 314/(-105)70/20-9. 63/5 Evaluate (((-36)/51)/(-4))/((-35)/(2870/369)). -2/51 (-7112/982)/1 -16 What is the value of (((-8)/(-12))/((-4)/(-18)-3))/(1420/(-20))? 1/71 Calculate ((-6174)/(-833))/14-17. -9 ((-11)/4408)/(-14(-16)/21280) -19 What is the value of (11250/(-1080))/(25/(-10))? 25/6 Calculate (3/(-2))/(51/952). -28 Evaluate (-1656)/(-1932)(-21)/39. -6/13 Calculate ((-48)/61)/(27104/(-56)). 2/121 (6/42)/(3/7)(-40500)/450 -30 ((-756)/14)/5457 -57 Evaluate 12(10/(-18))/(((-15)/(-12))/((-66)/88)). 4 Calculate ((-11)/(-4))/(106381/(-3054)). -3/38 Calculate -53(-12)/(-9)68/128. -53/2 68/10419/((-1438846)/(-6060)) 12 What is the value of (270/20)/(12/(-16))(-2)/(-182)-7? 18/13 (-2)/832103368/4307 -3/52 What is ((3696/256)/11)/(308/14784)? 63 What is the value of ((-100683)/(-2034))/(63/(-112))? -88 (7/4)/((-10)/45625/(2250/(-54))) 133 ((-5)/(-10))/(-5(-24)/(-8880)) -37 Calculate ((-5)/(-3))/(6739/13478). 10/3 What is (140/(-16))/7(-30)/(-800)16-72? 54 Evaluate 32/2814455/(-590). -28 Calculate ((-4)/22)/(63696/(-29194)). 1/12 Calculate (((-195)/(-234))/((-72)/216))/((-245)/4). 2/49 (15/120-4)/(-86/(-3936)) -41 (-22)/(-3)93/1612-117(-72)/(-27) -132 (37(-147)/117845)/(((-2)/20)/1) 6/13 61/(-3)((-3)/5)/((90/25)/18) 61 What is -703(21(-33)/13167)/((-2)/(-4))? 74 Calculate (35/9)/(-7)210/(-75). 14/9 Evaluate 125/502/3. 4/5 Calculate ((-14676)/69711)/((-4)/(-646)). -34 Evaluate (((-8)/84)/(24/14))/(747/(-11952)). 8/9 What is ((-240)/200)/((-41)/615)? 18 2/(200/87515(-3)/(-36)) 7 What is the value of ((-3)/198)/(((-266)/(-126))/19(-27)/12)? 2/33 What is the value of 91/(-78)(-33)/((-10395)/(-60))? 2/9 What is ((-19)/(646/255))/(-35)-21-2? 9 Calculate (-3546)/197050/(-420). 3/14 What is the value of ((-55)/(-15))/((-42416)/(-5784))? 1/2 What is the value of (100/(-30))/(-2)165/(-110)46? -115 Calculate -44/36(-8)/326. 2/3 What is (-420)/(-65)6390/360? 42 Evaluate (-53)/((-2385)/(-135))34/(-24). 17/4 Calculate ((-47)/(4089/(-1160)))/(40/144). 48 Calculate (32146/(-4672))/(13/3). -3/13 What is -2(-1136/(-20592))/(4/(8/(-2)))? 1/26 Calculate (3915/3480)/(2/(204/(-9))). -51/4 (435/(-348))/(2655/16) -2/131 Calculate 49/((-931)/(-741))5/6(-56)/(-210). 26/3 (-15)/(-1)(-240)/1802 -40 (-11)/(10/242658/(-6645)) 66 What is ((-3)/4)/(11772/(-5886))? 3/8 What is (1700/1122)/(30/22)? 10/9 (108/(-48))/(2484/126960) -115 Evaluate ((-1380)/(-210))/(((-74)/(-518))/((-2)/(-4))). 23 What is (-2)/(-40)-420570/121? -34 (5590/(-645))/((-7)/(-42)) -52 What is the value of 26/(2080/(-200))3/(-255)? 1/34 What is ((2537/(-1239))/((-1)/(-3)))/((-5)/35)? 43 Evaluate ((-705)/6)/(1951/78). -47 What is 6(-4)/2((-14352)/(-1326))/(-92)? 24/17 Calculate 397/((-5016095)/(-1444))7/(-5). -4/25 What is the value of (38/209)/((-46)/15433)? -61 Calculate 1096/328839/14/(-90)5. -26/9 Calculate ((-14)/6)/((-154)/(-46398)-19). 37 What is 102/832(-6)/144? -17 What is 3(-67)/(148137/335)? -5/11 (16/(-52)(-91)/14)/(16/(-328)) -41 Evaluate ((-53)/1696(-928)/29)/((-39)/(-21)). 7/13 Evaluate 1/1(-2)/((-1884)/(-74104)(-2)/3). 118 (((-444570)/(-56))/(-145))/(10/((-40)/(-3))) -73 What is (3/(-6))/(((-18)/(-9))/((-28288)/(-68)))? -104 Calculate (-488)/(-18300)-12575/(-2). 125 ((-1262)/(-11989))/((-14)/38) -2/7 Evaluate (51/(-85))/(80424/(-240)). 1/134 What is (210/175)/(90/(-1500))? -20 What is the value of 1/(-58)459334/(-1023)? 4 Calculate (73/109)/((-13784)/(-1502456)). 73 Calculate (80/(-194))/(2586/(-125421)). 20 Calculate -81-10(-50)/750. -54 What is (-131619)/(-1202)30/73? 45 What is (-2)/(((-4)/(-90)5)/(203/87))? -21 What is the value of (-10)/(-2)(-28)/(-1680)-45? -15/4 What is ((252/98)/(-9))/((-15)/(-14))20? -16/3 Calculate ((2/6)/(25/(-100))3)/(4/(-43)). 43 What is 220/(-3)2840/6248? -100/3 Calculate ((-1)/(-1))/((-30)/43860-34). 43 What is 10(5/10(-1)/8)/((-1682)/(-3364))? -5/4 Calculate (((-6864)/(-26))/(-12))/(7/((-56)/4)). 44 Evaluate 1/(-4)(1611/(-4833))/(1/72). 6 Evaluate (-16393)/(-39)(-1113)/(-4823). 97 Calculate ((12/(-3))/28)/((-158)/(-11613))(-10)/(-14). -15/2 What is ((-34)/(-8))/(122/5856)(-3)/(-36)4? 68 Calculate 14/2126(-12)/(-14)21/12. 26 What is the value of (-1)/35(-821)/821(2/2)/1? 1/35 What is the value of (((-3)/(-8)1)/((-530)/(-636)))/((-420)/(-50))? 3/56 What is the value of 9/3(-64)/576(-899)/58? 31/6 Evaluate (5580(-151)/8154)/((-5)/6). 124 Evaluate ((-17)/(-6))/((32825/(-606))/325). -17 (124236/(-8526))/(72/84) -17 Evaluate (-1536)/(-4480)4/(-6). -8/35 Evaluate (-2)/((-132)/3)((-869)/(-79))/(-22). -1/44 Calculate (2/(-1))/(12/(-228)27/(324/(-12))). -38 Calculate (-9)/(58/(736600/900)). -127 What is the value of 1/(-42(-29)/(-31668))? -26 What is ((-24)/84(-28)/20)/(1/(-95))? -38 Calculate 16(-2)/(-40)(-130)/156(-5)/9. 10/27 Calculate (10/(-1751))/((-1384)/11764)(-4)/(-10). 2/103 Evaluate ((-141984)/918)/((-124)/(-93)). -116 What is the value of (332/60)/(588/(-38220))? -104 Evaluate ((-360)/(-6))/((-8)/272-85). 24 Calculate -22/6(-271245)/6955. 26 What is the value of ((-50420)/1021005)/((-1)/1442)? 32/9 What is ((60/(-189))/((-1565)/14085))/((-2)/(-28)2)? 20 What is (6/(-9))/(249/(-1660)8)? 5/9 Calculate (-5)/65(-113373)/(-513). -17 Calculate (-14)/14((-108)/(-9))/(-12)23. 23 Calculate (-1728)/480(-35)/(-336). -3/8 Calculate (1188/209)/(-18)342/(-936). 3/26 What is 10/(-4)(-138)/(-14)((-17792)/960)/(-139)? -23/7 -483((-910)/(-490))/13 -69 ((2152/(-2548))/((-9)/49))/(1/(-15)) -35 What is (-7192)/2173(3472/(-96))/31? 116 What is 12620/(-16406)6/(-4)? 15/13 (24/(-126))/((-4332)/21546) 18/19 Evaluate (-255)/3740(-33)/(-12). -3/16 ((-108)/9)/((-13)/(-26)) -24 Evaluate ((-4660)/932)/(((-10)/(-60))/((-6)/(-4))). -45 121/(19965/1716)-5	{ "pile_set_name": "DM Mathematics" }
v - q for v. 1 Let m be (2 + -8 - 0)/(549/(-366)). Solve mf = 84 - 68 for f. 4 Let v(w) be the third derivative of -w*4/24 - 2w*3/3 - 15w*2. Let n be v(-6). Solve 0 = m - 1 - n for m. 3 Let p = 2 - 2. Let y be p/(-2 + 0/2). Let w = y - -2. Solve -4b + w = 10 for b. -2 Suppose 4s - 2 = 4i + 2, -i = -2s + 2. Let l be (s + 0)(26 + -2). Suppose 2h - 32 = -4y, -h = 2h - 2y - l. Solve 0 = 2g + h - 0 for g. -5 Let j be ((-16)/10)/(104/(-260)). Solve jp = -29 + 9 for p. -5 Let n be (-15)/3 - (1 - 1). Let j be 52/n-1. Solve -1 = -jg - 5 for g. -2 Let c(u) = -u2 + u + 12. Let b be c(4). Let q(y) = -2y*2 - y + 1. Let i be q(b). Solve 14 = 3g - i for g. 5 Suppose f = -3c + 10, 30 = 5f + c - 6. Suppose 3n - 5 = f. Suppose -7 = -nd + 13. Solve 0 = ds + 18 - 3 for s. -3 Let f be (-58)/10 + 8 + 2/(-10). Solve f - 6 = -x for x. 4 Suppose -p = -3l + 1, -2p + 2l = 3l - 5. Let h be (-1)/(p - 18/8). Suppose -h = -m - 1. Solve 0 = -0o + o - m for o. 3 Let f be ((-2)/(-3))/(172/(-60) + 3). Solve 14q = 15q - f for q. 5 Let f = -134 + 138. Solve 25h = 24h - f for h. -4 Let i(m) = m*2 - m + 3. Let w be i(0). Suppose -4b - 48 = -0. Let a = 14 + b. Solve n + a = w for n. 1 Suppose 0 = 6o - 541 + 499. Solve -oy + 3 = 38 for y. -5 Suppose 42k - 41k - 13 = 0. Solve 7x = -k + 13 for x. 0 Let p = -1607 + 1667. Solve 11y = -y + p for y. 5 Suppose 0 = l + 4y - 19, -8 = -y - y. Suppose lz = 4 + 5. Solve a + z - 8 = 0 for a. 5 Let m(q) = 2q + 10. Let l be m(-3). Solve -l + 8 = 4b for b. 1 Suppose -18 = 3y - i - 28, 5y + 2 = -3i. Solve 6h = yh + 4 for h. 1 Suppose -4m + 5w - 20 = 3, w + 7 = -5m. Let o be (-8)/(((-4)/(-1))/m). Suppose 19i - 7 = -7. Solve -or - 1 - 11 = i for r. -3 Let j(h) = h + 8. Let t be j(-6). Suppose 28 = 6p - tp. Let f = 10 - p. Solve 2y = fy for y. 0 Suppose -36 = -3p + 12. Suppose -3y + p = 13. Let i = y + 4. Solve -2w = -3w - i for w. -5 Suppose 0 = g - 2g - 4. Let l be 12/(-6)1 + (1 - g). Solve -l + 8 = z for z. 5 Suppose 0d + 4d - 5y = -1, 0 = -3y + 3. Let h be ((-1)/1 - -1)/d. Suppose -5f + 0f = h. Solve 3i + 0i - 12 = f for i. 4 Let j(n) = -n*2 - 22n - 86. Let c be j(-6). Solve 0 = -8f + cf - 6 for f. 3 Let o(f) = f + 14. Let w be o(-10). Suppose 5k - 32 = -4a, 2k - 15 - 5 = -wa. Suppose -9 = 3t - 6t, 2h - 1 = at. Solve h = c + 4c for c. 1 Let a(j) = -j2 + 3. Let w be a(0). Suppose wl + 3k - 42 = 0, -l + 5k - k - 11 = 0. Suppose 0 = -5h + 2h. Solve d - 4d + l = h for d. 3 Suppose 3k + 500 = -2k. Let g = k - -101. Solve -d = -2d - g for d. -1 Let h = 21 - 19. Suppose -t = -0t + ht. Solve 5b - 15 = -tb for b. 3 Let z(w) be the second derivative of w5/20 + w4/6 - 4w3/3 + w2/2 - 12w. Let q be z(-4). Solve 5y = -q + 6 for y. 1 Let g be ((-21)/(-28))/((-6)/(-40)). Solve 15i = 10i - g for i. -1 Let c = 51 - 50. Let x(a) = a3 - 2a*2 + a. Let j be x(c). Solve -2 = s - js for s. -2 Suppose -g - 18 = -34. Let h(o) = 2o - 32. Let f be h(g). Solve f = -r + 9 - 4 for r. 5 Let i = 34 - 30. Suppose -44 = -ig + 56. Suppose -3a - 5u = -75, a - g = -0u + 2u. Solve 0l = 5l - a for l. 5 Let q be (76/(-95))/(34/(-10) - -3). Suppose 3c = b - 12 + 1, 4b + 5c = 10. Suppose -2r - bu = -7 - 11, 4 = qu. Solve z = rz - 3 for z. 1 Let n = -109 - -41. Let a = n - -88. Solve 0 = 3v + 2v - a for v. 4 Suppose -5u + 4y + 55 = 6y, -61 = -4u - 5y. Solve -2o + uo = -28 for o. -4 Let r be 1 - -1 - 8 - 2. Let f(i) = -3i - 20. Let j be f(r). Suppose -3d - 1 = jo, -5d - 4o + 4 = -d. Solve -dx + 15 + 0 = 0 for x. 3 Suppose 0 = -2p + 7p - 55. Suppose 3q + 4j - 6 - p = 0, -2q = -5j - 19. Solve -3k + 5 = -q for k. 4 Suppose 6m + 19 = 7m. Suppose 0 = mb - 18b. Solve 0p + p + 4 = b for p. -4 Suppose 38k - 62 = 7k. Solve 0 = kf - 3 + 1 for f. 1 Suppose 3w = 230 - 230. Solve w = -0g + 3g - 6 for g. 2 Let d be -2063/9-3. Let u = 350 - d. Let f be u/(-63)(-14)/4. Solve -w - 3w = f for w. -2 Let h = 141 + -8. Solve -140b + hb = -35 for b. 5 Let k(j) = -j*3 - 3j*2 - 2j - 4. Let b be k(-3). Let h be 98/28 - b/(-4). Solve -7r + h = -3r for r. 1 Let r = 64 - 58. Let k be ((-9)/r)/(6/(-24)). Solve 2q + 2 = k for q. 2 Suppose 0 = 3n - 3g - 33, 30 = n + 4g - 1. Suppose -8 = 10z - 12z. Suppose 28 = zl + 4. Solve j = lj - n for j. 3 Suppose -u = 3p + 11, 0 = -u - 3p + 4p + 5. Solve 6a + u = 7 for a. 1 Let f be (1 + -22 + 1 + 2)/(-1). Let j be (-6)/10 + (-53)/(-5). Let n = f - j. Solve n = -k + 3k for k. 4 Let b(w) = w - 18. Let v be b(25). Suppose -vo + 22 = -20. Solve l - ol = -10 for l. 2 Let s be (-11)/((-1188)/84) + 2/9. Solve -b + 0 = s for b. -1 Suppose 15 = 5y - 3p + 6p, 0 = -3y + 5p + 9. Solve yk - 15 = 6k for k. -5 Let n(d) = d*3 - 3d*2 + 3. Let q be n(3). Let p = 46 - 49. Let m be -5 - -4 - p/(2 + -1). Solve -qh = -mh for h. 0 Let y(u) = u2 - 4u - 1. Let n be y(4). Let z be (n - 0)10/(-5). Solve 6 = 2h + z for h. 2 Suppose -m + 5f = 0, 46 = 4m - 8f + 11f. Solve mz = 13z + 15 for z. -5 Let t(i) = -4i - 20 + 6 - 2i. Let n be t(-4). Solve -f + n = -3f for f. -5 Let g be (1595/44)/(-29) + 129/4. Solve 0 = -13n + 5 - g for n. -2 Let d = 1109 + -1103. Solve -4y + 6 = -d for y. 3 Suppose 0 = -0o - o - 5, -3o = -2d + 15. Solve d = -5b - 5 - 5 for b. -2 Suppose 0 = 15v - 133 + 73. Solve 0 = va - 68 + 88 for a. -5 Suppose -3v + 20 = -v. Let w be 10/25 + 56/v. Solve -s - 3 = -w for s. 3 Suppose -11m + 64 = -2. Solve -mj + 35 = -13j for j. -5 Let n = 26 - 41. Let c = -16 - -7. Let h = c - n. Solve 3z - h = 3 for z. 3 Suppose -3b + 1 = 28. Let k be 6/(-4)12/b. Solve -kj = j + 6 for j. -2 Let p be (-1 - 2/(-6))/(2/(-48)). Suppose -k = 3k - p. Solve -kt = -t for t. 0 Let a(z) = -z3 - 21z*2 - 37z + 24. Let c be a(-19). Suppose -3m + 0m = 0. Suppose mb = -b. Solve co - o = b for o. 0 Let g(h) be the third derivative of 7h4/24 - 10h*3/3 - 6h*2. Let b be g(3). Solve b = -u - 1 for u. -2 Let x(y) = 4y + 27. Let s be x(-13). Let h = 32 + s. Solve 3d - 2 = h for d. 3 Suppose -2u = -u. Suppose -4g = 4k - 16, -g - 20 = -uk - 5k. Solve -kh - 4 = -2h for h. -2 Let q(n) = 93n2 - 14n + 17. Let i be q(1). Solve 23b = -b - i for b. -4 Suppose -162 = -7i - 141. Solve 0 = -4a - 17 - i for a. -5 Let l(d) = -d + 8. Let z be l(3). Suppose 0 = x - 2x + z. Solve 2k = xk + 9 for k. -3 Let f = -26 - -20. Let r be (3 + -2)/((-2)/f). Solve 0 = rx - x - 6 for x. 3 Let o be 1 + 5 - (10 + -6). Solve -5q - oq = -21 for q. 3 Let w = -26 + 26. Suppose -x + 1 = 3. Let b(o) = -o3 - o2 + o - 1. Let q be b(x). Solve wg - q = g for g. -1 Suppose 6v = 3v + 36. Let q be 122/(-4). Let z be (-1 + v)/(q/(-2)). Solve 0 = 5o + z + 3 for o. -5 Let w be (-188)/(-20) + 2 - 9/(-15). Solve -w = 8v - 4v for v. -3 Suppose 19k - 357 = -300. Solve -47 - k = -10g for g. 5 Suppose 3n + 210 = -4n. Let y = n - -50. Solve y = 3x + 2x for x. 4 Let r(h) = -131h - 252. Let b be r(-2). Solve -36 + 46 = -bl for l. -1 Let s = -2223 + 2253. Solve 4g - 10 + s = 0 for g. -5 Suppose 0 = -5b + t + 46, 4 = b + 6t - t. Suppose c = 4c - b. Let v(n) = 4n - 4. Let o be v(c). Solve 3x = -x - o for x. -2 Let g(w) = -w + 38. Let r be g(26). Solve 11b = 14b + r for b. -4 Suppose -137 = -6r + 31. Suppose -6c = -2c - r. Suppose -i - 3d + c = 3, -4d = -5i + 20. Solve 6 = iz - 2 for z. 2 Let v = 1321 - 1274. Solve -2 = -vj + 49j for j. -1 Let j be (6/(-9))/(1/(-18)). Let o = 15 - j. Let w be (-14)/21(-2 + -1). Solve wf + 15 = -of for f. -3 Suppose -18r = -14r + 144. Let n = 39 + r. Solve 1 = -2b + n for b. 1 Let r(n) = n*3 - 6n*2 - 2n - 32. Let p be r(7). Solve -pb + 24 = 3b for b. 4 Suppose 10 = b + 4. Suppose 5u - 26 = 3n, 5u - 4n = b + 17. Solve 0 = 2w + 3 + u for w. -5 Let c(u) = -2u*3 - 6u*2 - 2u - 3. Suppose 15 = -7l - 6. Let m be c(l). Solve 10 = -mi + i for i. -5 Suppose 5a - 10 = -0. Let i(h) = h2 - 8h + 19. Let k be i(5). Suppose -3l = 3, 0 = 2x - 3x - kl - 1. Solve xp = ap + 2 for p. 2 Let x(y) = 2y3 + 13y*2 - 4y + 25. Let v be x(-7). Solve -6 = vb - 18 for b. 3 Let m = 25 - 14. Let u be m/22 + (-5)/(-2). Solve 0 = -uf + 7*f -	{ "pile_set_name": "DM Mathematics" }
*2 - 9t + 10. Determine a(-11). -12 Let r(d) = -8d + 81. Determine r(10). 1 Let y(i) = -i3 - 25i*2 + 25i - 26. Give y(-26). 0 Let f(r) = -r - 24. Determine f(-20). -4 Let i(o) = -15o + 261. Calculate i(18). -9 Let r(v) = -v + 20. Give r(-15). 35 Let z(d) = -d3 + 5d*2 + 7d - 8. Determine z(6). -2 Let f(w) = 6w - 6. Give f(1). 0 Let l(g) = -31g + 36. What is l(1)? 5 Let h(w) = -w*3 + 15w*2 - 30w + 31. What is h(13)? -21 Let s(m) = 3m2 + 71m + 49. Calculate s(-23). 3 Let h(q) = 11q - 27. Calculate h(3). 6 Let m(h) = 17h + 208. Give m(-13). -13 Let p(x) = -8x3 + 2x*2 + 1. Determine p(2). -55 Let w(a) = 6a + 7. Calculate w(-6). -29 Let t(q) = -q*2 - 11q - 21. Give t(-7). 7 Let w(u) = -2u2 - 3u. What is w(-4)? -20 Let o(w) = 16w - 58. What is o(3)? -10 Let j(f) = 19f*2 + 10f + 17. What is j(-2)? 73 Let y(l) = -3l2 + 6l - 7. Determine y(4). -31 Let s(l) = 3l - 23. Determine s(-4). -35 Let h(z) = z3 + 5z*2 + 5z + 2. What is h(-4)? -2 Let v(f) = f*3 + 9f*2 + 18f + 29. Calculate v(-7). 1 Let q(h) = 2h - 65. Determine q(21). -23 Let i(c) = c2 - 14c - 86. Calculate i(20). 34 Let y(n) = n*3 - 9n*2 + 6n + 10. Determine y(6). -62 Let a(i) = 3i3 + i + 2. What is a(-1)? -2 Let r(w) = 52w - 2. Calculate r(-1). -54 Let x(f) = -2f2 - 4f + 14. Determine x(7). -112 Let i(w) = 55w + 232. Calculate i(-4). 12 Let a(t) = -3t + 41. Give a(11). 8 Let c(u) = 20u2 - u - 2. Determine c(2). 76 Let k(q) = -q2 - 10q - 22. Determine k(-10). -22 Let w(z) = z*3 + 8z2 + 1. Give w(-8). 1 Let o(s) = s2 + 2s - 6. Give o(-5). 9 Let c(u) = -4u + 3. What is c(6)? -21 Let c(h) = 2h2 + 11h + 13. Calculate c(-2). -1 Let b(w) = -w*3 - 12w*2 - 15w - 45. What is b(-11)? -1 Let b(w) = -w*2 - 19w + 24. What is b(-20)? 4 Let s(z) = 2z3 - 27z*2 + 12z - 1. Determine s(13). -14 Let r(x) = x3 + x2 - x - 2. Determine r(2). 8 Let n(m) = 48m2 - 432m + 4. Determine n(9). 4 Let b(w) = w*3 + 15w2 - w - 17. What is b(-15)? -2 Let z(f) = f2 - 2f - 9. Give z(6). 15 Let j(b) = 6b - 366. What is j(59)? -12 Let i(w) = 7w - 8. Give i(-4). -36 Let w(q) = q + 6. What is w(-12)? -6 Let x(f) = 3f*2 + 63f + 43. Calculate x(-20). -17 Let z(h) = 3h - 2. Give z(8). 22 Let u(o) = 29o + 27. Calculate u(-2). -31 Let b(i) = -i3 + i2 + 4i - 5. Determine b(2). -1 Let g(s) = -77s*2 + 3s + 3. Calculate g(-1). -77 Let m(w) = w*2 - 11w + 1. Determine m(11). 1 Let o(h) = -3h2 - 9h + 6. Give o(-5). -24 Let x(c) = -8c + 31. Calculate x(7). -25 Let v(y) = y + 17. What is v(-8)? 9 Let y(v) = 39v. Calculate y(-3). -117 Let t(a) = -9a + 3. Determine t(-1). 12 Let u(b) = b3 + 7b*2 + b - 20. Give u(-4). 24 Let y(i) = 2i*3 - 33i*2 + 15i + 16. Calculate y(16). 0 Let f(v) = -v*2 + 2v - 4. Determine f(4). -12 Let f(z) = 4z - 5. Determine f(3). 7 Let s(i) = i2 + 15i - 4. Give s(-15). -4 Let w(j) = -2j2 + 11j + 14. Calculate w(-4). -62 Let m(d) = 2d2 - 4d + 10. Determine m(4). 26 Let i(u) = -49u - 14. Determine i(-3). 133 Let k(t) = t2 - 24t - 62. Determine k(26). -10 Let z(k) = -47k2 + 144k - 4. Calculate z(3). 5 Let c(x) = x*3 + 4x*2 - 5x + 7. What is c(-5)? 7 Let f(d) = 18d + 209. Calculate f(-12). -7 Let d(k) = 2k*2 - 4k + 4. Give d(3). 10 Let m(f) = f - 5. Calculate m(6). 1 Let p(g) = -21g2 + g + 3. Give p(2). -79 Let t(z) = -2z*2 - 6z + 20. Calculate t(-5). 0 Let t(g) = -g*3 - 17g*2 - 22g - 101. Give t(-16). -5 Let a(o) = -o*3 - 8o*2 - 2o - 7. Determine a(-8). 9 Let h(p) = p*3 + 23p*2 + 22p - 8. Determine h(-22). -8 Let a(d) = -2d3 - 19d*2 - 37d - 21. Give a(-7). -7 Let z(o) = -8o + 30. Give z(7). -26 Let m(h) = -h3 + h2 - 2h - 55. Give m(0). -55 Let m(v) = 10v2 + 8v. Calculate m(-1). 2 Let g(j) = j*3 + 11j*2 - 4j - 28. Determine g(-11). 16 Let l(y) = -4y2 - 85y + 13. Determine l(-21). 34 Let i(b) = b*2 + 12b - 22. Determine i(-16). 42 Let t(v) = v*2 - 24v + 15. What is t(23)? -8 Let u(d) = -d*3 + 9d*2 + 24d - 5. Determine u(11). 17 Let g(q) = 2q2 - 15q - 107. What is g(12)? 1 Let i(b) = -3b3 - 62b*2 - 36b + 88. Give i(-20). 8 Let i(b) = 2b3 + 10b*2 + 5b - 10. Give i(-4). 2 Let j(y) = 30y2 + y - 1. Calculate j(2). 121 Let r(n) = 2n - 29. Calculate r(12). -5 Let r(n) = -n3 + n2 - 2n + 2. What is r(1)? 0 Let q(h) = h2 + 10h - 28. Calculate q(-13). 11 Let a(y) = -8y - 61. Calculate a(6). -109 Let y(w) = -w2 + 3w - 3. Determine y(1). -1 Let u(o) = 23o + 7. Give u(2). 53 Let s(o) = 6o - 119. Determine s(0). -119 Let l(a) = a*3 + 8a*2 + 6. Calculate l(-8). 6 Let m(o) = -8o + 1. Determine m(4). -31 Let a(r) = -r*2 - 7r + 18. What is a(2)? 0 Let i(x) = 2x + 9. Determine i(3). 15 Let k(d) = -d2 + 10d - 20. Determine k(8). -4 Let o(x) = x*2 + 7x + 16. Give o(-9). 34 Let g(j) = -12j2 - 14j + 23. Give g(2). -53 Let n(z) = 2z2 + z - 20. Give n(0). -20 Let f(b) = -2b*2 - b + 14. Determine f(3). -7 Let q(z) = -5z + 67. What is q(13)? 2 Let f(l) = -2l2 + 30l + 26. What is f(15)? 26 Let m(k) = 6k - 8. What is m(3)? 10 Let z(a) = 2a - 10. What is z(8)? 6 Let f(m) = m*3 + 3m2 - 6. Give f(-2). -2 Let k(g) = g3 + 3g2 - 1. Calculate k(-2). 3 Let c(l) = l3 + 4l*2 - 4l - 2. What is c(-4)? 14 Let q(r) = -r*3 - 8r*2 - 2r - 9. Calculate q(-8). 7 Let c(w) = -2w2 + 9w - 2. Determine c(6). -20 Let z(a) = -a*3 - 15a*2 + 14a - 35. Calculate z(-16). -3 Let w(q) = 8q3 + q - 2. What is w(1)? 7 Let n(x) = 3x + 10. What is n(0)? 10 Let n(q) = -q - 5. Give n(3). -8 Let n(o) = -33o + 227. Give n(7). -4 Let d(u) = -u - 1. What is d(2)? -3 Let t(g) = 3g - 7. Give t(4). 5 Let r(v) = 5v - 27. Give r(0). -27 Let n(h) = 18h + 5. Calculate n(-2). -31 Let b(s) = s*2 - 14s + 40. Calculate b(5). -5 Let q(b) = 3b + 4. Determine q(-3). -5 Let h(i) = i3 - 5i*2 - 6i - 3. Determine h(6). -3 Let h(b) = b*3 - 7b*2 + 4b - 31. Determine h(7). -3 Let s(p) = -8p3 + 119p*2 + 16p - 17. Determine s(15). -2 Let a(m) = -m*2 - 7m + 4. Determine a(-5). 14 Let x(k) = -6k + 34. Give x(7). -8 Let r(c) = -c - 10. Determine r(-11). 1 Let x(k) = -10k - 3. Give x(1). -13 Let d(l) = -l*2 - 8l + 9. Determine d(1). 0 Let h(i) = -i2 - i + 22. Give h(0). 22 Let j(v) = v3 - 5v2 - 4v - 69. What is j(7)? 1 Let l(w) = w*3 - 5w*2 + 8w - 5. Calculate l(5). 35 Let n(s) = -5s - 21. What is n(-5)? 4 Let k(j) = -2j*2 + 7j + 2. Calculate k(6). -28 Let h(l) = -l*3 + 5l*2 + 10l - 38. Give h(6). -14 Let t(p) = p3 - p2 - 2p - 3. Determine t(3). 9 Let m(y) = 11y*2 + y - 6. Calculate m(-2). 36 Let q(m) = 2m*3 - 2m*2 - 20m + 6. Calculate q(5). 106 Let s(q) = 5q + 6. Determine s(-2). -4 Let t(d) = -4d + 50. Calculate t(11). 6 Let j(k) = -2k3 - k2 + 4k + 5. Give j(-4). 101 Let y(j) = 2j2 + 10j - 4. Give y(-5). -4 Let z(g) = -g*2 + 3g. Give z(3). 0 Let w(v) = 8v. What is w(3)? 24 Let c(z) = -19z - 226. Give c(-12). 2 Let d(l) = -l*3 - 8l*2 + 32l - 5. Calculate d(-11). 6 Let n(b) = 2b - 4. What is n(16)? 28 Let d(c) = -c2 + 2c + 8. What is d(-3)? -7 Let y(c) = 43c + 677. Determine y(-16). -11 Let z(j) = 2j*3 - 5j*2 + j. Give z(2). -2 Let u(d) = -10d*2 - 3d. Determine u(2). -46 Let v(x) = x*2 - 16x + 59. Determine v(8). -5 Let b(p) = -4p - 51. Give b(-12). -3 Let u(z) = -6z + 31. Calculate u(10). -29 Let t(p) = p*3 + 4p*2 - p - 1. What is t(-3)? 11 Let x(j) = -13j2 - 1. Give x(2). -53 Let t(l) = l2 - 38l - 100. What is t(40)? -20 Let l(j) = j2 + 9j - 47. What is l(5)? 23 Let c(p) = -103p - 9. What is c(0)? -9 Let n(t) = 2t*2 - 12t - 5. Determine n(6). -5 Let j(b) = 2b3 + 18b*2 - 3b - 11. Give j(-9). 16 Let l(j) = j*3 + 16j*2 + 39j + 3. Give l(-13). 3 Let b(o) = -o*3 - 8o*2 + 9o + 7. Determine b(-9). 7 Let p(u) = -28u3 + u2 - 2u + 1. Give p(1). -28 Let d(q) = q*3 + 3q*2 + 2q - 15. Determine d(0). -15 Let f(v) = v*3 + 7v*2 - 7v + 3. Give f(-8). -5 Let q(x) = -x*2 - 61x - 894. Calculate q(-25). 6 Let p(z) = 42z - 246. Calculate p(6). 6 Let b(p) = 2p*2 - 6p - 3. Give b(3). -3 Let m(b) = b*3 + 8b*2 - 9b - 8. Determine m(-9). -8 Let w(g) = -2g2 + 9g - 4. Determine w(9).	{ "pile_set_name": "DM Mathematics" }
= 0. 0, 1 Let g = 945 - 1887/2. Solve -3/2t2 + 3/2t*3 - gt + 3/2 = 0. -1, 1 Let i(z) = 3z2 + 2z + 7. Let t = -16 + 21. Let q(j) = -4j2 - 2j - 8. Let u(a) = ti(a) + 4q(a). Determine l so that u(l) = 0. -1, 3 Factor 7/4a2 + 0 + 5/4a*3 + 1/2a. a(a + 1)(5a + 2)/4 Let a(c) = -c2 + c + 5. Let z be a(0). Let n = 7 - z. Determine h, given that -18h*3 + 64/9h - 10hn - 8/9 = 0. -1, 2/9 Let y(p) = -2p*3 - 4p + 4. Let m(s) be the first derivative of -3s4/4 - 5s*2/2 + 5s + 4. Let b(u) = 4m(u) - 5y(u). Factor b(h). -2h3 Let z(t) be the third derivative of 1/180t*6 + 1/45t*5 - 2/9t*3 + 2t*2 + 0 - 1/36t*4 + 0t. Suppose z(a) = 0. What is a? -2, -1, 1 Let p = 109 - 273/2. Let a = -27 - p. Factor -ar2 - 1/4r + 0 - 1/4r3. -r(r + 1)2/4 Let c be (0/(2/2))/(-2). Let z(t) = t2 - 8t - 6. Let q be z(9). What is r in qr - 5r + cr2 + r2 = 0? 0, 2 Let a = -2 + 4. Let x be 2/3(-6)/(-1). Factor b2 - 6b*x + ab*5 + 7b*2 + 0b*5. 2b*2(b - 2)*2(b + 1) Suppose 0 = 6s - s + 4w + 8, 2s - 4w = 8. Let k(q) be the third derivative of 0 - 4/9q3 + sq - 4q2 - 121/90q*5 - 11/9q*4. Factor k(b). -2(11b + 2)2/3 Let k = 18 - 13. Factor -k + w3 + 4 + 1. w3 Let j(z) be the first derivative of 0z4 - z2 + 0z - 1/360z*6 + 1/180z*5 + 1 + 0z3. Let r(q) be the second derivative of j(q). Factor r(i). -i2(i - 1)/3 Let t(u) be the first derivative of -u6/36 + u5/15 + u4/12 - 4u*3/9 + 7u2/12 - u/3 + 18. Factor t(d). -(d - 1)4(d + 2)/6 Let a(x) = -x2 + 5x. Let l be a(5). Solve lu2 - u3 + 3 - 2 + u + u2 - 2u*2 = 0. -1, 1 Let u(l) = 8l*3 + 18l*2 - 2l - 18. Let n(x) = -9x3 - 19x*2 + x + 19. Let y(s) = -3n(s) - 4u(s). Factor y(v). -5(v - 1)(v + 1)(v + 3) Let f(b) = b*2 + 6b - 1. Let j be f(-5). Let k be ((-1)/(-2))/((-1)/j). Factor ky5 + y5 - 2y*5. 2y5 Let p(j) be the third derivative of -j5/360 - j4/144 + j3/18 + 5j2. Determine i so that p(i) = 0. -2, 1 Let l(v) be the third derivative of v7/3360 - v6/360 + v5/160 + v3/6 - 3v*2. Let f(t) be the first derivative of l(t). Suppose f(i) = 0. Calculate i. 0, 1, 3 Let f = -10/29 + 88/87. Let q be 3/1 + -2 + 1. Let 4/3p + 2/3 + fpq = 0. Calculate p. -1 Factor 5 + 3 - 12k + 5k2 - 25k*2. -4(k + 1)(5k - 2) Let n(f) be the third derivative of 0f - 5/44f*4 + 0 - 7/330f*5 - 3/11f*3 + 2f*2 - 1/660f*6. Factor n(c). -2(c + 1)(c + 3)2/11 Suppose 18 = i + 60. Let u be (3/i)/((-4)/32). Let -2/7t*2 - ut - 2/7 = 0. What is t? -1 Suppose -3d + 5d = -2. Let g = 4 + d. Determine s, given that -5s2 + 2s + 3s3 + 2 + 3s*2 - 5s*g = 0. -1, 1 Find z such that 9z*2 + 6z*3 + 3/2z*4 + 3/2 + 6z = 0. -1 Factor 0 - 1/5x + 1/5x*2. x(x - 1)/5 Let 3/5d2 + 33/5d + 6 = 0. What is d? -10, -1 Let p(q) = q*2 + 5q - 1. Let o(b) = 5b2 + 21b - 5. Let i(v) = -2o(v) + 9p(v). Let l(f) = -4f2 + 12f + 3. Let s(r) = -22i(r) + 6l(r). Factor s(d). -2(d - 2)(d - 1) Suppose -2r + 2 = -r. Let b(c) be the second derivative of -1/16c*4 + c + 1/4c*3 + 0c*r + 0. Factor b(f). -3f(f - 2)/4 Let u be (-55)/(-132)4(-6)/(-8). Factor 0 + 1/2t + 9/4t3 + 7/4t*2 + 1/4t*5 + ut*4. t(t + 1)*3(t + 2)/4 Let p(t) be the third derivative of -t*6/40 - 3t*2. Factor p(u). -3u*3 Let b be 1/((-1)/(4/1)). Let o = b + 12. Suppose 2c - 16c4 + oc*3 - 20c*3 - 8c*5 + 2c*5 = 0. What is c? -1, 0, 1/3 Let q be (42/9)/((-4)/(-18)). Suppose -4c + q = -3c. Let -2 - 2 - 28i*3 + 24i + 0 - ci2 - 21i*3 = 0. What is i? -1, 2/7 Let m(g) = -g + 13. Let s be m(6). Suppose -s - 12 = -5p - 3w, 3p = -5w + 21. Factor 2 - 3t + 0tp + 2t2 - t2. (t - 2)(t - 1) Let x(n) = -n2 + 9n + 2. Let z(d) = -6d2 + 63d + 15. Let o(w) = -27x(w) + 4z(w). Let o(y) = 0. What is y? -2, -1 Factor 14p - 37p + 16p4 - 48p*3 + 36p*2 + 15p. 4p(p - 2)(2p - 1)*2 Factor 3k*2 + 2/3 + 1/3k*4 - 7/3k - 5/3k3. (k - 2)(k - 1)3/3 Let v(b) be the third derivative of -b5/12 - 5b4/4 + 35b3/6 - b2 + 9b. Factor v(m). -5(m - 1)(m + 7) Let b be -3(3 - (-33)/(-9)). Determine t, given that -12t2 + 15t*b - 1 + 0 - 2 = 0. -1, 1 Suppose 4l - u - 4 - 1 = 0, 0 = 5l - 2u - 4. Factor 6 + 2w2 - 4w*l + 0w + 4w. -2(w - 3)(w + 1) Let a(l) be the second derivative of 7l*6/10 + 9l*5/5 + 3l4/4 - l3 + 3l. Factor a(p). 3p(p + 1)2(7p - 2) Let i(j) be the second derivative of 49j*6/6 + 56j*5 + 1315j*4/12 + 250j*3/3 + 30j*2 - 4j + 1. Factor i(b). 5(b + 1)(b + 3)(7b + 2)2 Let p(x) be the third derivative of x9/120960 + x*8/40320 - 2x*5/15 - 5x2. Let n(z) be the third derivative of p(z). Factor n(t). t2(t + 1)/2 Let o(a) be the second derivative of a7/98 - 3a5/70 + a3/14 - 2a + 5. Factor o(k). 3k(k - 1)2(k + 1)*2/7 Let o(g) be the second derivative of 3g4/16 - g3/4 + g*2/8 + 8g. Factor o(l). (3l - 1)2/4 Let 3u*4 - 8u*2 + 15u*2 + 2u*3 + 4u*3 - 4u*2 = 0. What is u? -1, 0 Let o(z) = 13z*3 + 7z*2 - 6z - 7. Let k(w) = -6w3 - 3w*2 + 3w + 3. Let d(u) = -7k(u) - 3o(u). Suppose d(l) = 0. What is l? -1, 0, 1 Suppose -x - 9x = 8x. Let m(o) be the first derivative of -3 - 2/7o2 - 22/21o*3 + xo. Factor m(g). -2g(11g + 2)/7 Let r = -25 + 30. Let f(s) be the second derivative of -s3 + 0 - 2s - 1/10sr - s2 - 1/2s*4. Factor f(i). -2(i + 1)*3 Let z = 6 + -4. Factor 6g - g*2 - 2g + 0g - g2 - zg*3. -2g(g - 1)(g + 2) Let q(g) = 4g3 + 27g*2 - 238g + 724. Let j(m) = -3m3 - 27m*2 + 239m - 725. Let k(u) = -5j(u) - 4q(u). Factor k(p). -(p - 9)*3 Factor 11/3 + 10/3p - 1/3p2. -(p - 11)(p + 1)/3 Let n(q) be the first derivative of 5/3q2 + 3 + 20/9q*3 + 5/3q*4 + 1/9q*6 + 2/3q*5 + 2/3q. Suppose n(g) = 0. What is g? -1 Let i(h) be the third derivative of -2h2 + 0 + 0h + 1/60h5 - 1/12h*4 + 1/6h*3. Solve i(c) = 0. 1 Let x(v) = -v + 8. Suppose 9 = 3c - 5z, 5c + 2z - 60 = -14. Let r be x(c). Let 0 - 1/2n*2 + rn = 0. What is n? 0 Let q = 137/635 + -2/127. Let b(s) be the first derivative of 1 + 1/5s2 - qs*3 + 0s. Suppose b(z) = 0. What is z? 0, 2/3 Suppose 28/15a + 98/15a*2 + 2/15 = 0. What is a? -1/7 Let h be -10 + 1487/98. Factor 0 - hs - 2/7s*2 + 2/7s*3. 2s(s - 2)(s + 1)/7 Let l be 6((-4)/(-34) + (-224)/9996). Factor -12/7w - 8/7 - lw2. -4(w + 1)(w + 2)/7 Factor 8/5 - 4/5p - 4/5p2. -4(p - 1)(p + 2)/5 Suppose -g + 3s = -0s + 3, 0 = 2g + s - 15. Let l be (-29)/(-3) + (-2)/g. Factor 2p4 + 0p*2 + lp*5 + 0p - 4/3p3 + 0. 2p*3(2p + 1)(7p - 2)/3 Let r(m) be the third derivative of -m8/672 + m7/280 + m6/240 + 7m*2. What is p in r(p) = 0? -1/2, 0, 2 Let r be 24/(-18) + (-32)/(-24). Solve 3/5m*2 - 3/5m*3 - 1/5m + r + 1/5m4 = 0 for m. 0, 1 Let b(t) = -7t*2 - 18t + 19. Let i(z) = 3z2 + 9z - 9. Let s(x) = 4b(x) + 9i(x). Let j be s(8). Factor 3n3 - 2 + 2n*2 - 3n*j - 2n*3 + 2n. -2(n - 1)2(n + 1) Suppose -5b - 5z = 0, -3z - 27 + 3 = -5b. Factor 0 - s*2 + s + 1/4s*b. s(s - 2)2/4 Let o(h) be the first derivative of -h7/245 + h6/420 - h2 + 1. Let a(d) be the second derivative of o(d). Find x, given that a(x) = 0. 0, 1/3 Let k(n) be the third derivative of -n5/100 - n4/40 + n*3/5 - 11n*2. Factor k(y). -3(y - 1)(y + 2)/5 Let f(v) be the second derivative of 0v*2 + 0 + 1/30v*5 - 1/54v*4 + 8v - 2/27v3. What is k in f(k) = 0? -2/3, 0, 1 Factor 24/11z*2 + 6/11 - 20/11z - 12/11z3 + 2/11z*4. 2(z - 3)(z - 1)3/11 Let a = -657 + 4605/7. Let -av - 4/7 - 2/7v2 = 0. What is v? -2, -1 Let w be 1/(45/10 + -4). Let x(i) be the second derivative of 1/27i*3 + 2i + 0 + 1/54i4 + 0i*w. Factor x(y). 2y(y + 1)/9 Let n(r) = 9r*2 + 17r + 8. Let x(m) = -2m + 1. Let c be x(3). Let d(y) = -5y*2 - 9y - 4. Let a(s) = cd(s) - 3n(s). Suppose a(w) = 0. What is w? -2, -1 Let a = 1263 - 1260. Determine z, given that -1 + 17/6z + 1/2z*a - 7/3z*2 = 0. 2/3, 1, 3 Let y(s) be the second derivative of 3s6/200 + s5/50 - 3s4/40 - s3/5 + s2/2 - 4s. Let f(t) be the first	{ "pile_set_name": "DM Mathematics" }
AM? 1:41 AM What is 623 minutes before 2:14 AM? 3:51 PM How many minutes are there between 7:23 AM and 10:01 AM? 158 What is 682 minutes after 7:52 AM? 7:14 PM How many minutes are there between 2:10 PM and 12:44 AM? 634 What is 172 minutes after 3:34 AM? 6:26 AM What is 572 minutes after 9:37 AM? 7:09 PM How many minutes are there between 3:25 AM and 10:26 AM? 421 What is 274 minutes before 10:32 AM? 5:58 AM What is 203 minutes after 12:48 PM? 4:11 PM How many minutes are there between 1:02 AM and 6:33 AM? 331 What is 552 minutes after 7:17 PM? 4:29 AM How many minutes are there between 11:44 PM and 2:39 AM? 175 How many minutes are there between 8:29 PM and 11:14 PM? 165 What is 217 minutes after 1:41 PM? 5:18 PM How many minutes are there between 4:50 AM and 5:50 AM? 60 How many minutes are there between 6:23 AM and 1:57 PM? 454 How many minutes are there between 12:36 AM and 7:48 AM? 432 How many minutes are there between 8:40 AM and 2:33 PM? 353 How many minutes are there between 3:04 AM and 8:32 AM? 328 What is 549 minutes before 3:17 PM? 6:08 AM What is 462 minutes before 9:55 PM? 2:13 PM How many minutes are there between 10:53 AM and 9:17 PM? 624 How many minutes are there between 9:11 AM and 6:28 PM? 557 What is 473 minutes after 8:04 AM? 3:57 PM How many minutes are there between 10:47 AM and 8:00 PM? 553 What is 103 minutes before 9:42 AM? 7:59 AM How many minutes are there between 11:21 PM and 11:15 AM? 714 How many minutes are there between 11:56 AM and 2:57 PM? 181 What is 371 minutes before 11:47 PM? 5:36 PM What is 235 minutes before 6:45 PM? 2:50 PM What is 332 minutes before 10:18 PM? 4:46 PM How many minutes are there between 6:37 PM and 5:46 AM? 669 What is 585 minutes after 3:35 PM? 1:20 AM How many minutes are there between 5:52 PM and 5:02 AM? 670 How many minutes are there between 9:58 PM and 11:15 PM? 77 What is 40 minutes before 4:57 AM? 4:17 AM What is 185 minutes before 2:36 AM? 11:31 PM What is 670 minutes after 11:00 AM? 10:10 PM What is 42 minutes before 1:31 AM? 12:49 AM What is 260 minutes after 4:10 PM? 8:30 PM How many minutes are there between 12:09 PM and 5:00 PM? 291 How many minutes are there between 2:37 PM and 6:50 PM? 253 What is 331 minutes before 2:35 PM? 9:04 AM What is 463 minutes after 12:32 AM? 8:15 AM How many minutes are there between 7:39 AM and 7:49 AM? 10 What is 359 minutes before 6:24 PM? 12:25 PM What is 195 minutes before 7:04 PM? 3:49 PM How many minutes are there between 8:09 PM and 3:55 AM? 466 What is 235 minutes before 3:59 PM? 12:04 PM What is 107 minutes after 6:51 PM? 8:38 PM How many minutes are there between 7:11 AM and 10:12 AM? 181 What is 444 minutes after 2:29 PM? 9:53 PM How many minutes are there between 1:51 AM and 5:48 AM? 237 How many minutes are there between 6:28 AM and 5:29 PM? 661 What is 573 minutes after 10:03 PM? 7:36 AM What is 429 minutes after 2:27 PM? 9:36 PM What is 688 minutes after 2:16 AM? 1:44 PM What is 144 minutes before 10:39 AM? 8:15 AM What is 155 minutes before 11:13 PM? 8:38 PM What is 421 minutes after 4:54 PM? 11:55 PM How many minutes are there between 3:33 AM and 1:17 PM? 584 What is 665 minutes after 8:54 PM? 7:59 AM How many minutes are there between 8:41 AM and 1:15 PM? 274 How many minutes are there between 10:29 AM and 7:35 PM? 546 How many minutes are there between 6:28 AM and 8:09 AM? 101 How many minutes are there between 10:33 AM and 12:28 PM? 115 How many minutes are there between 12:01 PM and 1:10 PM? 69 How many minutes are there between 7:41 PM and 6:12 AM? 631 How many minutes are there between 2:47 PM and 5:52 PM? 185 What is 42 minutes before 3:33 PM? 2:51 PM How many minutes are there between 5:55 PM and 3:50 AM? 595 How many minutes are there between 4:37 AM and 2:47 PM? 610 What is 327 minutes before 7:18 PM? 1:51 PM How many minutes are there between 4:48 AM and 10:43 AM? 355 What is 317 minutes before 4:40 PM? 11:23 AM How many minutes are there between 11:52 PM and 4:03 AM? 251 How many minutes are there between 2:38 AM and 11:30 AM? 532 What is 679 minutes before 1:31 PM? 2:12 AM What is 111 minutes after 4:15 AM? 6:06 AM What is 468 minutes before 1:47 AM? 5:59 PM What is 286 minutes before 2:53 AM? 10:07 PM How many minutes are there between 7:39 AM and 12:37 PM? 298 How many minutes are there between 8:08 PM and 11:23 PM? 195 What is 644 minutes before 10:02 PM? 11:18 AM What is 661 minutes before 1:16 PM? 2:15 AM How many minutes are there between 12:21 PM and 3:11 PM? 170 What is 446 minutes after 1:39 AM? 9:05 AM What is 549 minutes before 12:52 PM? 3:43 AM How many minutes are there between 1:44 AM and 3:12 AM? 88 How many minutes are there between 1:41 PM and 4:19 PM? 158 How many minutes are there between 2:59 PM and 2:14 AM? 675 How many minutes are there between 4:48 AM and 1:38 PM? 530 How many minutes are there between 11:07 PM and 10:40 AM? 693 What is 110 minutes after 3:49 PM? 5:39 PM What is 139 minutes after 10:11 AM? 12:30 PM How many minutes are there between 3:49 AM and 4:01 AM? 12 What is 582 minutes before 1:27 AM? 3:45 PM What is 553 minutes before 4:07 PM? 6:54 AM What is 439 minutes after 6:28 AM? 1:47 PM How many minutes are there between 12:07 PM and 1:49 PM? 102 How many minutes are there between 2:11 AM and 9:47 AM? 456 What is 428 minutes before 1:37 PM? 6:29 AM How many minutes are there between 7:57 AM and 7:24 PM? 687 What is 584 minutes after 1:23 PM? 11:07 PM How many minutes are there between 11:53 PM and 12:18 AM? 25 How many minutes are there between 9:19 PM and 2:32 AM? 313 How many minutes are there between 7:44 PM and 5:41 AM? 597 What is 445 minutes after 10:28 AM? 5:53 PM How many minutes are there between 12:05 PM and 9:25 PM? 560 How many minutes are there between 4:42 AM and 3:21 PM? 639 How many minutes are there between 5:50 PM and 1:28 AM? 458 How many minutes are there between 5:44 PM and 12:42 AM? 418 How many minutes are there between 4:31 PM and 4:03 AM? 692 How many minutes are there between 10:38 AM and 8:20 PM? 582 How many minutes are there between 9:33 PM and 2:19 AM? 286 How many minutes are there between 11:56 PM and 10:51 AM? 655 What is 251 minutes after 1:05 PM? 5:16 PM What is 12 minutes after 12:02 AM? 12:14 AM How many minutes are there between 9:58 AM and 12:34 PM? 156 What is 552 minutes before 5:47 PM? 8:35 AM How many minutes are there between 11:47 AM and 9:05 PM? 558 What is 502 minutes before 5:42 PM? 9:20 AM What is 244 minutes before 10:23 AM? 6:19 AM What is 328 minutes before 3:52 PM? 10:24 AM How many minutes are there between 5:33 PM and 8:56 PM? 203 What is 249 minutes before 11:55 AM? 7:46 AM How many minutes are there between 7:37 PM and 2:02 AM? 385 How many minutes are there between 4:50 PM and 4:38 AM? 708 What is 41 minutes before 6:46 AM? 6:05 AM What is 661 minutes after 5:41 AM? 4:42 PM How many minutes are there between 10:26 AM and 2:09 PM? 223 What is 583 minutes after 6:43 AM? 4:26 PM How many minutes are there between 9:11 PM and 10:47 PM? 96 How many minutes are there between 8:29 AM and 3:55 PM? 446 What is 400 minutes after 2:13 PM? 8:53 PM What is 539 minutes before 3:12 PM? 6:13 AM How many minutes are there between 5:09 PM and 7:15 PM? 126 How many minutes are there between 4:18 AM and 11:18 AM? 420 How many minutes are there between 2:48 PM and 3:30 PM? 42 What is 697 minutes after 5:00 PM? 4:37 AM How many minutes are there between 11:05 AM and 1:22 PM? 137 How many minutes are there between 5:11 PM and 4:08 AM? 657 What is 98 minutes before 3:20 PM? 1:42 PM How many minutes are there between 1:47 PM and 10:37 PM? 530 How many minutes are there between 4:43 AM and 12:22 PM? 459 What is 313 minutes after 3:44 PM? 8:57 PM How many minutes are there between 7:46 AM and 6:56 PM? 670 How many minutes are there between 8:22 PM and 9:51 PM? 89 What is 60 minutes before 12:58 AM? 11:58 PM How many minutes are there between 12:23 PM and 3:52 PM? 209 How many minutes are there between 10:58 PM and 10:27 AM? 689 What is 660 minutes before 2:55 AM? 3:55 PM How many minutes are there between 4:13 PM and 10:07 PM? 354 What is 596 minutes before 5:00 AM? 7:04 PM How many minutes are there between 11:30 AM and 10:33 PM? 663 Wha	{ "pile_set_name": "DM Mathematics" }
est to -2/7 in 62/7, -4, -2, -0.1? -0.1 Which is the nearest to -0.21? (a) 5 (b) -0.1 (c) -4 (d) -0.2 d Which is the nearest to -1/2? (a) -0.3 (b) 0.1 (c) -3/22 (d) -0.4 d What is the nearest to -16 in -2, -5, 0? -5 Which is the nearest to -8? (a) 0.3 (b) -58 (c) -0.2 c What is the nearest to 0 in -4, -3/7, -0.3, 0.115? 0.115 Which is the nearest to -1/5? (a) -0.1 (b) 0.1 (c) -4/21 c Which is the closest to 0? (a) -0.4 (b) -0.8 (c) 1 a Which is the nearest to 0.2? (a) 0.01 (b) -0.3 (c) -2 (d) 0 a What is the nearest to 0.08 in -4/11, 3, 4? -4/11 Which is the nearest to -1/4? (a) 0 (b) 0.8 (c) 11 a Which is the closest to -13? (a) -0.2 (b) -1 (c) -0.29 (d) 6/11 b Which is the closest to 0.1? (a) -5 (b) -2 (c) 0 (d) -1/378 c Which is the nearest to 0? (a) 6 (b) -2/7 (c) -1.1 (d) -0.5 b Which is the nearest to 1? (a) -55 (b) 1/4 (c) -3 b What is the closest to 0.1 in 4, 3/5, -25/19? 3/5 What is the closest to 4 in 6, 5, -0.1? 5 What is the nearest to 18 in -0.3, 47, -0.4? -0.3 What is the closest to -1 in -0.018, -2, 23/2, 3/5? -0.018 Which is the closest to 2? (a) -1/2 (b) -2/13 (c) -1/19 c What is the closest to -0.1 in 3, -0.5, 2/7? 2/7 Which is the nearest to 0.1? (a) -0.53 (b) -2/5 (c) -2 (d) -1 b Which is the closest to 2? (a) -12.1 (b) -5 (c) -2/7 c Which is the closest to 19.6? (a) 0.5 (b) -3 (c) -0.2 (d) -4 a What is the closest to -1 in -0.03, 2/5, -4, 8? -0.03 Which is the nearest to -6? (a) -1 (b) -0.3 (c) 0.1 (d) 2 a What is the closest to 1/7 in 0.57, -5, -2, 3? 0.57 What is the closest to 4/7 in 0, -5, 25? 0 What is the closest to -2 in 4, -1, 0.4, -39? -1 Which is the nearest to 2? (a) 4 (b) -17 (c) -2 a Which is the closest to 0.1? (a) -6/11 (b) 1/8 (c) 0 (d) 3/5 b What is the nearest to 1 in -1, -2/3, 3/4, 4/9? 3/4 What is the nearest to 0.03 in -5, 1, 5, -0.2? -0.2 Which is the closest to 3? (a) -2 (b) 4 (c) 5/3 (d) 6 b What is the nearest to -2/5 in -528, 1/5, 2/15? 2/15 What is the closest to -1/3 in 1/6, 5, -2/7, 18? -2/7 What is the closest to 0 in -0.3, 723, 1? -0.3 Which is the nearest to 1/4? (a) 16 (b) 8 (c) 0.5 (d) 4 c Which is the closest to 0.09? (a) 5 (b) -0.1 (c) -4 b What is the nearest to 113 in -0.4, 0.4, 5/6? 5/6 What is the closest to -1/24 in 1/6, -18, 2/3? 1/6 What is the closest to 2/3 in -3, -0.2, 2.1? -0.2 Which is the nearest to 0? (a) -1.3 (b) -0.2 (c) 4 (d) -0.04 d Which is the nearest to 167? (a) -2 (b) -1/2 (c) 0.4 (d) 1/4 c Which is the closest to -6? (a) 2/7 (b) 1/3 (c) -12 c What is the nearest to -0.1 in 0.5, -16/9, 1/6? 1/6 Which is the closest to 0? (a) 17 (b) 0.5 (c) -71 b What is the closest to -1/2 in 6, 2/23, -1/8, -1/2? -1/2 Which is the closest to -0.3? (a) 14 (b) 2 (c) 0 (d) 0.07 c What is the closest to 0.1 in 26.4, 0.3, 2? 0.3 Which is the closest to 1/8? (a) -0.2 (b) 1 (c) -0.5 (d) 13/3 a Which is the nearest to -1? (a) 8 (b) 5 (c) -4 (d) 3 c What is the nearest to 1 in 3/5, 0.033, -3? 3/5 Which is the closest to -2/3? (a) 1/2 (b) 12/7 (c) -5 (d) -0.2 d Which is the nearest to 0? (a) 0.0475 (b) 0.4 (c) -5 (d) 1/2 a Which is the closest to -1/4? (a) 0.3 (b) -717 (c) 0.4 (d) 2/3 a Which is the nearest to -0.2? (a) 2/27 (b) -2/7 (c) 0.1 (d) 0.5 b What is the nearest to 0.1 in 4, -3, 0, -51? 0 What is the nearest to 0 in -164/3, 0, -2? 0 Which is the closest to 11? (a) -5/3 (b) -3 (c) 5 (d) 3 c Which is the closest to 1? (a) 4 (b) -0.1 (c) 3/7 c Which is the nearest to 0.3? (a) 9 (b) -2/5 (c) -2/11 (d) 1/4 d Which is the closest to -1/2? (a) 2/3 (b) 64 (c) 6 (d) -2 a Which is the nearest to -2? (a) -202 (b) -5 (c) 5 b Which is the closest to -6? (a) 0 (b) 2 (c) 1 (d) -1/4 d What is the closest to -0.2 in -0.02, -2/7, -4/7, 0.13? -2/7 What is the closest to -1/3 in -13, -6, 0.4, 1/4? 1/4 Which is the closest to -0.1? (a) 7 (b) 4.6 (c) -0.5 (d) 0 d What is the closest to -1.8 in -6/5, 1, 2? -6/5 Which is the nearest to -4/25? (a) -0.2 (b) -3 (c) 2/7 a Which is the closest to -0.1? (a) -5/2 (b) 0 (c) 4 (d) 8 b What is the nearest to -2/7 in 4, 0.2, 1.1, 5? 0.2 Which is the nearest to -2? (a) -1/2 (b) -5 (c) 0.02 (d) -61 a Which is the closest to 1? (a) -2/19 (b) -2/13 (c) 2 (d) -3 c What is the nearest to 0 in 0.27, -2/9, 0.4? -2/9 What is the nearest to -1/2 in -0.2, -9.51, -0.1, 2/7? -0.2 Which is the nearest to -0.2? (a) -6/11 (b) -2/5 (c) -0.3 (d) 0.4 c Which is the closest to -1? (a) -25.8 (b) 14 (c) -0.1 (d) -1 d What is the closest to -217 in 1/3, 3, 0? 0 What is the closest to -3 in 2/19, -0.2, 5, -5? -5 Which is the nearest to 31? (a) -12/11 (b) -0.1 (c) 1 c What is the closest to -0.1 in -5009, 0.2, -5? 0.2 What is the nearest to -1/11 in 2/9, -2, -1, -3? 2/9 Which is the closest to 1? (a) -1 (b) -5 (c) 2/9 (d) -0.07 c Which is the nearest to -3? (a) 0.02 (b) -9 (c) -0.1 (d) 0.3 c What is the closest to 2/7 in 2, 2/21, 0.5, -1/4? 2/21 Which is the nearest to 5/14? (a) 5 (b) 0.45 (c) -1 b What is the nearest to 2/9 in 42, -4, -0.3? -0.3 Which is the nearest to -1? (a) -1.9 (b) -0.2 (c) -4 b Which is the closest to 0.2? (a) 0.1 (b) -4 (c) -2.8 (d) 5 a Which is the closest to -1? (a) 1/5 (b) -4 (c) -0.2 (d) -0.4 d What is the nearest to 2 in -14, 1, 5? 1 Which is the nearest to 0.2? (a) 4 (b) 0 (c) -0.12 (d) -1/3 b Which is the nearest to 0.2? (a) -6/7 (b) 2/11 (c) -3/2 b Which is the closest to 7? (a) 3 (b) -1/2 (c) -0.2 (d) 1 a Which is the nearest to 0? (a) 0 (b) -1/9 (c) 4 (d) 3 a Which is the closest to 3? (a) -5 (b) -56 (c) -0.07 (d) 2 d Which is the closest to -1? (a) 18 (b) 4 (c) -7 b Which is the closest to 2? (a) 2/13 (b) -19 (c) -0.3 a What is the nearest to 6 in 4, -5, 1? 4 What is the nearest to -1/3 in -2, 0, 1/11? 0 Which is the closest to -2? (a) -1/2 (b) 4/7 (c) -0.2 (d) -1/13 a Which is the closest to 3? (a) 0.5 (b) -0.8 (c) 2 c Which is the closest to 0.4? (a) 1/7 (b) -0.6 (c) -3/8 a What is the closest to 0.1 in -101, -1, 48/5? -1 What is the nearest to -1 in 0.02, 24, 1/4? 0.02 Which is the nearest to 3/5? (a) 5/8 (b) 9 (c) 1/2 a Which is the closest to 5? (a) 3 (b) -5 (c) 9 (d) -4 a What is the nearest to 2 in -2/5, 0.4, 0.01, -76? 0.4 What is the nearest to -2 in 1/4, 1/75, 2/5, 1? 1/75 Which is the nearest to -1/4? (a) 1 (b) 3/37 (c) -8/3 (d) -5 b Which is the closest to 0? (a) 0.4 (b) 972 (c) 4 (d) 2 a What is the closest to -2/9 in -0.1, -5, 21/8, 2? -0.1 What is the closest to -31 in -2, -0.1, 0.08? -2 What is the closest to -2/45 in 4, -1/9, -3? -1/9 Which is the nearest to 1? (a) -0.2 (b) -379 (c) -3 a What is the nearest to 19 in -3, 2, 0.1? 2 Which is the nearest to 3? (a) -1 (b) 4 (c) 0.1 b What is the nearest to 1.4 in -0.3, -1/4, 2/9, 7? 2/9 What is the nearest to 4 in -3, 2, -0.08, -1/3? 2 Which is the closest to 616? (a) 1 (b) -2 (c) -3 a What is the closest to 1 in -0.1, -2/15, -3/4, 23? -0.1 What is the closest to -0.1 in -0.4, 0.3, -1004? -0.4 Which is the closest to -2? (a) 0 (b) -1/2 (c) -1/24 b Which is the closest to -5? (a) 0.2 (b) -8.9 (c) 1 (d) 1/3 b Which is the closest to -4? (a) -2/3 (b) -5 (c) 0.01 b What is the closest to 2.5 in 0.02, -0.1, 0.3, 1/9? 0.3 What is the nearest to -1 in -11, -2/7, -1/5, -4? -2/7 What is the nearest to 6 in -2, 54, 0.3? 0.3 Which is the closest to 13? (a) -1 (b) 0 (c) 0.5 (d) -10 c What is the closest to 0.4 in -12, 0, 4, -2/3? 0 What is the closest to -1 in 0, 2, 29, 3/2? 0 What is the closest to 3 in -2, -0.1, -11? -0.1 Which is the closest to 0.2? (a) 2/7 (b) 5 (c) -0.05 a What is the nearest to 1/3 in 0.08, 0.11, -4? 0.11 What is the closest to -6 in -5, 1, 4, 0? -5 Which is the closest to -0.01? (a) -3 (b) 0.5 (c) 9/2 (d) -5 b Which is the nearest to 3? (a) -2/9 (b) 0.1 (c) 12 b Which is the closest to 15? (a) -1 (b) 3/4 (c) -2 b What is the nearest to -37 in -0.1, -1/3, -0.3, -3? -3 Which is the nearest to -1/2? (a) 9/32 (b) -3 (c) -5 a Which is the nearest to -2? (a) 0.018 (b) 3 (c) 0.1 (d) 5 a Which is the nearest to -0.5? (a) -0.2 (b) -4 (c) 2 (d) 0.06 a Which is the closest to 164? (a) -8 (b) 2 (c) -3 b Wh	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from xxxxxhxhxhxhxxxxxx. Give prob of sequence hx. 28/153 Two letters picked without replacement from {p: 2, g: 8}. Give prob of sequence pp. 1/45 Two letters picked without replacement from allllllallllalllllll. What is prob of sequence ll? 68/95 Calculate prob of sequence xxd when three letters picked without replacement from xxddd. 1/10 Two letters picked without replacement from anjttaoatotvjtt. Give prob of sequence aj. 1/35 What is prob of sequence nr when two letters picked without replacement from nnruv? 1/10 Three letters picked without replacement from qjjqqqqqq. What is prob of sequence qjj? 1/36 Two letters picked without replacement from {j: 6, y: 2, x: 2, a: 1}. What is prob of sequence ax? 1/55 What is prob of sequence ql when two letters picked without replacement from qooslqssqq? 2/45 Four letters picked without replacement from {b: 2, c: 1, m: 4, t: 4}. What is prob of sequence bbtc? 1/990 What is prob of sequence zpab when four letters picked without replacement from {b: 1, p: 1, a: 2, z: 2}? 1/90 What is prob of sequence ss when two letters picked without replacement from {c: 10, h: 1, o: 1, s: 2}? 1/91 What is prob of sequence oe when two letters picked without replacement from {a: 1, w: 1, e: 1, o: 2, k: 2, q: 2}? 1/36 Two letters picked without replacement from {h: 4, z: 2, d: 1, m: 1}. Give prob of sequence dm. 1/56 Calculate prob of sequence yay when three letters picked without replacement from {y: 13, a: 6}. 52/323 Four letters picked without replacement from klkllkllkkrrkkllklk. What is prob of sequence lrrl? 7/5814 Calculate prob of sequence cw when two letters picked without replacement from {w: 6, d: 1, c: 1, b: 2, x: 3}. 1/26 What is prob of sequence dpm when three letters picked without replacement from dmjpj? 1/60 Four letters picked without replacement from yylyhlhyyybyhyxyhyy. Give prob of sequence yhhy. 55/3876 What is prob of sequence ovo when three letters picked without replacement from vvoovvovvvvoovooooo? 45/323 Four letters picked without replacement from hhmm. What is prob of sequence hmmh? 1/6 Three letters picked without replacement from {o: 3, y: 8, x: 3, r: 2}. What is prob of sequence roo? 1/280 Four letters picked without replacement from {a: 1, z: 2, e: 2, f: 4, h: 3}. What is prob of sequence aaef? 0 What is prob of sequence bbbx when four letters picked without replacement from xbbxybybb? 5/126 Two letters picked without replacement from zdszz. Give prob of sequence zz. 3/10 Two letters picked without replacement from krdjeex. What is prob of sequence xd? 1/42 Two letters picked without replacement from {e: 2, j: 5, o: 3, k: 3, q: 1, r: 1}. Give prob of sequence kr. 1/70 Two letters picked without replacement from wwawwwwwaaww. Give prob of sequence aa. 1/22 What is prob of sequence nj when two letters picked without replacement from pppppppnjpjnp? 1/39 Three letters picked without replacement from {u: 2, x: 1, v: 2, c: 1, a: 1}. Give prob of sequence vua. 2/105 Two letters picked without replacement from {r: 5, v: 5, i: 2}. Give prob of sequence vi. 5/66 Two letters picked without replacement from {l: 1, z: 2, d: 1, c: 3}. Give prob of sequence dz. 1/21 What is prob of sequence lmil when four letters picked without replacement from {q: 1, l: 2, i: 1, m: 1}? 1/60 Calculate prob of sequence euaf when four letters picked without replacement from {a: 1, u: 1, j: 1, e: 4, f: 1, i: 5}. 1/4290 Two letters picked without replacement from ofmpffggf. Give prob of sequence fm. 1/18 Three letters picked without replacement from {i: 5, u: 9}. Give prob of sequence uii. 15/182 Calculate prob of sequence ggw when three letters picked without replacement from {w: 1, g: 2}. 1/3 What is prob of sequence fi when two letters picked without replacement from {s: 7, i: 2, f: 2}? 2/55 Three letters picked without replacement from {q: 1, h: 4, z: 3}. Give prob of sequence zhz. 1/14 Two letters picked without replacement from {l: 3, t: 9}. What is prob of sequence tl? 9/44 Three letters picked without replacement from ninnnnnninin. Give prob of sequence nnn. 21/55 What is prob of sequence txxt when four letters picked without replacement from {t: 5, x: 7}? 7/99 Four letters picked without replacement from mmymebe. What is prob of sequence mmem? 1/70 What is prob of sequence xx when two letters picked without replacement from ppxxzhjt? 1/28 What is prob of sequence rwer when four letters picked without replacement from werrree? 3/140 What is prob of sequence bbl when three letters picked without replacement from {l: 1, o: 8, b: 4, q: 1, k: 1}? 2/455 Calculate prob of sequence pc when two letters picked without replacement from {c: 7, p: 3, v: 9}. 7/114 Two letters picked without replacement from {v: 5, r: 2, h: 4}. What is prob of sequence rh? 4/55 What is prob of sequence hceo when four letters picked without replacement from hocaezc? 1/420 What is prob of sequence tt when two letters picked without replacement from tttttttttt? 1 What is prob of sequence wbf when three letters picked without replacement from pbbpbbbubhfpubbw? 1/420 Calculate prob of sequence jn when two letters picked without replacement from nejjn. 1/5 Calculate prob of sequence lzc when three letters picked without replacement from zlzllccbl. 2/63 Three letters picked without replacement from sroroooororruoa. What is prob of sequence rsu? 1/546 What is prob of sequence saa when three letters picked without replacement from {e: 1, f: 3, b: 5, a: 3, s: 1}? 1/286 What is prob of sequence pjj when three letters picked without replacement from ptajja? 1/60 Four letters picked without replacement from ffffufuufuuf. What is prob of sequence ufff? 35/396 Four letters picked without replacement from {i: 3, w: 9}. Give prob of sequence iwww. 7/55 Calculate prob of sequence hkfh when four letters picked without replacement from {f: 1, k: 4, h: 3}. 1/70 What is prob of sequence rkmi when four letters picked without replacement from timtktikktrtttk? 1/4095 Two letters picked without replacement from {e: 1, d: 3, v: 8, u: 1, w: 2, s: 5}. Give prob of sequence wv. 4/95 Two letters picked without replacement from eebebbe. What is prob of sequence be? 2/7 Two letters picked without replacement from qsntqatntatn. Give prob of sequence sq. 1/66 What is prob of sequence bujs when four letters picked without replacement from {u: 2, b: 2, s: 4, j: 1, x: 1}? 1/315 Four letters picked without replacement from sednwzzeznzzndzzzz. What is prob of sequence ewnd? 1/6120 Four letters picked without replacement from {n: 7, r: 6}. Give prob of sequence rnrn. 21/286 Two letters picked without replacement from rrrzxrrszzxsrsrcrrz. What is prob of sequence cx? 1/171 Two letters picked without replacement from {p: 5, q: 1, k: 1, z: 2}. Give prob of sequence qk. 1/72 Four letters picked without replacement from ldlddddd. Give prob of sequence lddd. 1/7 What is prob of sequence pgb when three letters picked without replacement from bgppgpgpp? 5/168 What is prob of sequence trtt when four letters picked without replacement from {r: 3, t: 8}? 7/55 What is prob of sequence xx when two letters picked without replacement from ppttpxp? 0 Four letters picked without replacement from vqwyqqyqqqyf. Give prob of sequence fqvw. 1/1980 Four letters picked without replacement from {n: 1, p: 1, r: 5, d: 5, o: 3}. What is prob of sequence rrpo? 1/546 Two letters picked without replacement from {i: 1, q: 4, z: 5}. What is prob of sequence iz? 1/18 Calculate prob of sequence wa when two letters picked without replacement from {w: 9, a: 4, m: 4}. 9/68 Calculate prob of sequence ww when two letters picked without replacement from {j: 5, u: 3, e: 6, w: 3}. 3/136 Two letters picked without replacement from {v: 1, f: 3}. Give prob of sequence ff. 1/2 Two letters picked without replacement from {l: 6}. Give prob of sequence ll. 1 Two letters picked without replacement from {d: 9, f: 11}. What is prob of sequence fd? 99/380 Four letters picked without replacement from uxtlyyulxelttyx. Give prob of sequence ttue. 1/2730 Four letters picked without replacement from eeeeeeeeee. Give prob of sequence eeee. 1 Three letters picked without replacement from {r: 2, l: 10}. Wha	{ "pile_set_name": "DM Mathematics" }
term of -309, -450, -267, 402, 1719, 3846? 27t3 - 330t - 6 What is the l'th term of 4041, 3977, 3879, 3753, 3605? l*3 - 23l*2 - 2l + 4065 What is the w'th term of 96, 277, 420, 501, 496? -4w3 + 5w*2 + 194w - 99 What is the h'th term of 19, 270, 723, 1378, 2235, 3294, 4555? 101h2 - 52h - 30 What is the w'th term of 55614, 55604, 55602, 55614, 55646, 55704, 55794? w*3 - 2w*2 - 11w + 55626 What is the c'th term of 12, 7, -66, -255, -608, -1173, -1998, -3131? -8c3 + 14c*2 + 9c - 3 What is the z'th term of -1930, -5130, -10464, -17932? -1067z2 + z - 864 What is the a'th term of -153847, -153825, -153785, -153721, -153627? a3 + 3a*2 + 6a - 153857 What is the w'th term of -50027, -50023, -50019, -50015? 4w - 50031 What is the n'th term of -2608, -2547, -2486, -2425, -2364, -2303? 61n - 2669 What is the c'th term of -39156, -78232, -117308, -156384, -195460? -39076c - 80 What is the w'th term of 559, 2208, 4947, 8770, 13671, 19644, 26683, 34782? -w3 + 551w*2 + 3w + 6 What is the f'th term of 1284, 5038, 13736, 29850, 55852, 94214? 412f3 + 870f + 2 What is the m'th term of -2581, -5139, -7683, -10207, -12705, -15171? m3 + m2 - 2568m - 15 What is the k'th term of 113, 916, 3111, 7394, 14461, 25008? 116k*3 - 9k + 6 What is the w'th term of -1237, -4957, -11157, -19837, -30997? -1240w2 + 3 What is the w'th term of -2909, -11725, -26405, -46943, -73333, -105569, -143645, -187555? w3 - 2938w*2 - 9w + 37 What is the t'th term of -1, 215, 577, 1091, 1763, 2599, 3605, 4787? t*3 + 67t*2 + 8t - 77 What is the c'th term of -1141, -1238, -1335? -97c - 1044 What is the g'th term of 1621, 3271, 4919, 6565, 8209, 9851, 11491? -g2 + 1653g - 31 What is the y'th term of 662, 1421, 2180, 2939? 759y - 97 What is the i'th term of 5357, 5357, 5353, 5345? -2i*2 + 6i + 5353 What is the s'th term of 674969, 674963, 674955, 674945, 674933, 674919? -s*2 - 3s + 674973 What is the b'th term of -3785, -3780, -3771, -3758? 2b2 - b - 3786 What is the k'th term of -848, -3388, -7630, -13580, -21244? -k3 - 845k*2 + 2k - 4 What is the b'th term of -43, -107, -191, -295, -419, -563? -10b2 - 34b + 1 What is the b'th term of -107, -146, -155, -134? 15b2 - 84b - 38 What is the v'th term of -171, 207, 835, 1713, 2841? 125v2 + 3v - 299 What is the r'th term of -472, -993, -1514, -2035? -521r + 49 What is the i'th term of -332, -711, -1116, -1547, -2004? -13i*2 - 340i + 21 What is the y'th term of 153, 1167, 3905, 9225, 17985? 143y3 + 4y*2 + y + 5 What is the d'th term of 3167, 3166, 3165, 3164? -d + 3168 What is the x'th term of -203316, -203314, -203312? 2x - 203318 What is the q'th term of -87, -534, -1705, -3948, -7611, -13042, -20589, -30600? -58q3 - 14q*2 + q - 16 What is the k'th term of -20774, -20792, -20810, -20828, -20846? -18k - 20756 What is the c'th term of 63, 573, 1957, 4653, 9099, 15733, 24993, 37317? 73c3 - c2 + 2c - 11 What is the i'th term of 229, 907, 2027, 3589? 221i2 + 15i - 7 What is the k'th term of 2033, 8141, 18329, 32597, 50945? 2040k2 - 12k + 5 What is the n'th term of 664, 767, 938, 1177? 34n2 + n + 629 What is the t'th term of 214, 701, 1506, 2629, 4070, 5829? 159t*2 + 10t + 45 What is the s'th term of -210, -183, -148, -105, -54? 4s2 + 15s - 229 What is the x'th term of -13020, -13010, -12994, -12972, -12944? 3x2 + x - 13024 What is the y'th term of -1174, -2712, -4616, -6886? -183y*2 - 989y - 2 What is the m'th term of -721, -5719, -19289, -45721, -89305, -154331? -715m3 + 4m*2 - 5m - 5 What is the z'th term of 17390, 17387, 17382, 17375? -z2 + 17391 What is the u'th term of -198232, -198230, -198238, -198262, -198308? -u3 + u*2 + 6u - 198238 What is the y'th term of 66982, 133975, 200978, 267997, 335038, 402107, 469210, 536353? y3 - y2 + 66989y - 7 What is the f'th term of -28729, -57433, -86113, -114769? 12f*2 - 28740f - 1 What is the p'th term of -127, -12, 335, 1040, 2229, 4028, 6563, 9960? 21p3 - 10p*2 - 2p - 136 What is the f'th term of 35364, 70745, 106126, 141507? 35381f - 17 What is the n'th term of 2887, 2863, 2817, 2743, 2635, 2487, 2293? -n3 - 5n*2 - 2n + 2895 What is the p'th term of 15490, 30986, 46482? 15496p - 6 What is the t'th term of -1144, -1362, -1582, -1804, -2028, -2254, -2482? -t2 - 215t - 928 What is the o'th term of 212, 142, 30, -124, -320, -558, -838? -21o2 - 7o + 240 What is the o'th term of -1409, -1565, -1829, -2201, -2681, -3269? -54o2 + 6o - 1361 What is the z'th term of -899, -1779, -2643, -3491? 8z2 - 904z - 3 What is the o'th term of 578, 491, 250, -223, -1006, -2177? -13o3 + o2 + o + 589 What is the n'th term of -7495, -7493, -7493, -7495, -7499, -7505, -7513? -n2 + 5n - 7499 What is the x'th term of -4619, -9181, -13745, -18311? -x*2 - 4559x - 59 What is the i'th term of 117400, 234796, 352192, 469588? 117396i + 4 What is the a'th term of -127849, -127886, -127923? -37a - 127812 What is the r'th term of 302318, 604634, 906950, 1209266? 302316r + 2 What is the u'th term of 1264, 1269, 1262, 1237, 1188? -u3 + 12u + 1253 What is the c'th term of 32, 1, -98, -301, -644, -1163, -1894? -6c3 + 2c*2 + 5c + 31 What is the v'th term of 3712, 3192, 2670, 2146, 1620? -v*2 - 517v + 4230 What is the v'th term of 7293, 7285, 7263, 7221, 7153, 7053, 6915, 6733? -v3 - v2 + 2v + 7293 What is the h'th term of 16327, 16464, 16621, 16804, 17019? h3 + 4h*2 + 118h + 16204 What is the m'th term of 243, 1091, 2503, 4479, 7019, 10123, 13791? 282m2 + 2m - 41 What is the k'th term of 700, 1024, 1348, 1672, 1996? 324k + 376 What is the j'th term of -414, -824, -1232, -1638, -2042? j2 - 413j - 2 What is the m'th term of 16, 59, 138, 259, 428? m*3 + 12m*2 + 3 What is the z'th term of -74, -318, -648, -1064, -1566? -43z*2 - 115z + 84 What is the s'th term of -9686, -9638, -9506, -9248, -8822? 7s3 - s - 9692 What is the k'th term of 243487, 486973, 730459, 973945? 243486k + 1 What is the w'th term of 1, -33, -91, -185, -327? -2w3 - 20w + 23 What is the m'th term of 293, 1149, 2565, 4535, 7053? -m*3 + 286m*2 + 5m + 3 What is the v'th term of -116, -176, -178, -122? 29v2 - 147v + 2 What is the x'th term of -8482630, -8482631, -8482632? -x - 8482629 What is the l'th term of 1047, 4197, 9449, 16803? 1051l2 - 3l - 1 What is the f'th term of 589906, 1179810, 1769716, 2359624, 2949534? f*2 + 589901f + 4 What is the a'th term of 12166, 12126, 12086, 12046, 12006, 11966? -40a + 12206 What is the c'th term of -9442, -9445, -9462, -9493, -9538, -9597, -9670? -7c*2 + 18c - 9453 What is the n'th term of 7945, 8121, 8421, 8851, 9417, 10125, 10981, 11991? n*3 + 56n*2 + n + 7887 What is the v'th term of 140, 257, 396, 557? 11v*2 + 84v + 45 What is the h'th term of -14825, -14785, -14713, -14609, -14473, -14305? 16h2 - 8h - 14833 What is the l'th term of 18933, 37872, 56811, 75750? 18939l - 6 What is the q'th term of -1075, -1194, -1391, -1666, -2019? -39q*2 - 2q - 1034 What is the v'th term of -53949, -53960, -53983, -54024, -54089, -54184, -54315? -v*3 - 4v - 53944 What is the a'th term of 10457, 10425, 10395, 10367? a*2 - 35a + 10491 What is the p'th term of -1482, -2085, -2690, -3297? -p*2 - 600p - 881 What is the t'th term of -4162467, -4162464, -4162459, -4162452, -4162443, -4162432, -4162419? t*2 - 4162468 What is the x'th term of 25, -520, -1423, -2684? -179x*2 - 8x + 212 What is the g'th term of 11350379, 11350378, 11350377? -g + 11350380 What is the w'th term of 1568401, 1568404, 1568407, 1568410? 3w + 1568398 What is the a'th term of 147, 336, 531, 732, 939, 1152? 3a*2 + 180a - 36 What is the g'th term of 69, -15, -235, -657, -1347, -2371, -3795? -11g3 - 2g*2 - g + 83 What is the l'th term of 971, 1957, 2961, 3983, 5023? 9l*2 + 959l + 3 What is the s'th term of -4581, -4592, -4603? -11s - 4570 What is the j'th term of 366364, 732704, 1099034, 1465348, 1831640, 2197904? -j3 + j2 + 366344j + 20 What is the v'th term of -1765, -3522, -5279, -7036? -1757v - 8 What is the h'th term of -757, -789, -867, -1009, -1233, -1557? -3h*3 - 5h*2 + 4h - 753 What i	{ "pile_set_name": "DM Mathematics" }
a) 1 (b) o (c) 2/5 (d) 2/7 b Let s = -492/7 - -70. Let y = -40 + 46. What is the fourth smallest value in -0.4, y, s, 2? y Let i(s) = -184s3 + s2 + 2s + 2. Let f be i(-1). Let o = f - 2037/11. Which is the second smallest value? (a) o (b) -2/3 (c) -1 (d) 3/2 b Let c = 5 - 4. Let z = 2/147 - -268/1911. What is the second biggest value in z, 3, c? c Suppose -1480 - 566 = -33d. What is the second smallest value in d, -2, -0.2? -0.2 Let x = 5.085 - 0.085. What is the second smallest value in -249, 1/10, x? 1/10 Let o = 0.37 - -15.63. Let k = o + -16.14. Let r = -1.86 + k. Which is the second biggest value? (a) 1 (b) r (c) 0.2 c Let d = 0.3802 - -0.0198. What is the biggest value in 0.3, 1/7, d? d Let y be 148/24(5 - -4). Let d = 57 - y. Which is the biggest value? (a) d (b) -0.4 (c) 1/5 a Let x = -39 + 10. Let n = x - -29.2. Which is the smallest value? (a) -3/7 (b) -1 (c) n b Let u = 0.397 - 1.397. What is the second biggest value in u, 0.4, -1/14, 3/17? 3/17 Let w = 50 + -54. Let v = -0.03 - 4.97. Which is the third smallest value? (a) w (b) 0.1 (c) v (d) 4 b Let t = 2.4 - -2.6. Which is the fourth smallest value? (a) t (b) -5 (c) -3 (d) -1/26 a Let u = -3 + 7. Suppose -2g - 18 = y, -4g + uy + 4 = 28. Let o be ((-4)/g)/(20/(-8)). Which is the third smallest value? (a) 2 (b) o (c) 0.4 a Suppose -3 = x - 4a, -5x + 15 = -3a - 2a. What is the smallest value in -4/7, 1, -1/7, x? -4/7 Let f = -0.12 + 0.09. Let z = -11 + 10.67. Let x = z - f. What is the biggest value in -2, -5, x? x Let i = -0.8 + -2.4. Let m = -10 + 8.8. Let h = i - m. What is the third smallest value in h, 0.1, -7? 0.1 Suppose 4 = -4w - 4. Let m = -3.4 - -8.4. Which is the third biggest value? (a) m (b) w (c) -2/13 b Let n = -870 + 869. What is the fourth smallest value in -0.2, 4, 2, n? 4 Let i = 9 + -5. Let w be (-2838)/(-2604) - (-3)/(-6). Let x = w + -5/31. What is the second biggest value in -1/3, x, i? x Let g = -82 - -87. Let h = 0.12 - -0.18. Suppose -3m = -3j + 8 + 4, 0 = j - 2. Which is the third smallest value? (a) h (b) m (c) g c Let f = 0.03 + -4.9. Let t = f - 0.13. Which is the second biggest value? (a) -1/11 (b) -1 (c) t b Let r = 3 - 8. Suppose 25y - 34y = 0. What is the third biggest value in r, 1/4, y, -1? -1 Let m be 10/(-8) + 51/12. Suppose -w + 1 = 0, 5r + mw + 0w - 28 = 0. Which is the smallest value? (a) r (b) -1/4 (c) -2/5 c Let w = 2.2 - 16.2. Let m = 1.77 + -2.27. Which is the second biggest value? (a) -0.3 (b) w (c) m c Let x = -1.04 - 51.96. Let o = x - -55. Suppose 4p + 6 = 2p. What is the second biggest value in p, -2, o? -2 Suppose 4g = -g. Suppose gz = 6z. Which is the third smallest value? (a) -2 (b) -4 (c) z c Suppose -q = 2q - 12. Let r be 24/(-9) - q/(-6). Suppose 48o - 15o = 23o. What is the second smallest value in r, o, -4? r Let z = 20/7 + -86/35. Let f = -0.3447 - -0.1447. Which is the second smallest value? (a) -0.1 (b) -0.05 (c) z (d) f a Suppose -36z - 101 = 43. Which is the fourth biggest value? (a) z (b) -137 (c) 0.1 (d) -2 b Let s = -5/18 - 7/18. Let n(p) = -p3 + 2p*2 + 4p + 4. Let x be n(4). Let f = x - -14. Which is the biggest value? (a) f (b) s (c) -0.5 a Let k = -1.5 + 9.5. Let y = -7.7 + k. Let q = -2990/11 + 272. What is the third smallest value in 0.2, q, y? y Let i = -69 - -691/10. Let s = 1537/3 - 512. What is the biggest value in i, -1/2, s? s Let l = 0.36 - 0.06. Let n be 12 + -2 - (-27)/(-3). Let y = 7/6 - 17/12. What is the smallest value in y, n, l? y Suppose 4t + 14 = 6. Let p be (t/4)/(78/52). Let y = -6.4 + 6. Which is the second biggest value? (a) y (b) p (c) -2 a Let w(l) = -l3 + 6l*2 - 12l + 12. Let k be w(4). What is the third smallest value in -1/14, k, -3, -0.06? -1/14 Suppose 861 + 165 = -27f. What is the second smallest value in -5, f, 0.3? -5 Let a = 3392 + -3392. Let k = 5 + -7. What is the second biggest value in a, k, -1, 2? a Let i be ((-8)/(-50))/((-4)/(-70)-7). Let n = 10 - 7. What is the second biggest value in 1, n, i? 1 Let c(s) = -s*2 + 9s + 11. Let b be c(6). Let f = 25 - b. What is the second biggest value in -3, 2, f? -3 Let g be 10((-2)/5)/(-1). Let a = 2.6 - 2.9. Let k = 15 - 15.5. What is the second smallest value in a, k, g? a Let f = 50 + -113. Let k = f - -59. What is the second smallest value in 4, 0.3, k? 0.3 Let n = 0.1 - 0.5. Let k = n + -0.1. Let r = -11.6 - -13.6. Which is the second biggest value? (a) r (b) 0.2 (c) k b Suppose 7a - 18 = a. Let x be -1 + (a - 2)-25. Let l be (-2)/16x - 2. What is the smallest value in -2, l, 5? -2 Suppose 12 = 5n + 5z - 13, n - 5z = 5. Let t be 10/(-14)2/n. Let y = 435 - 432. Which is the smallest value? (a) t (b) y (c) -0.5 c Let l = -1.3 + 5.3. What is the second smallest value in 5, -4, l, -0.4? -0.4 Let d(p) = 3p3 - 3p*2 + 2p. Let i be d(3). Let h be (-10)/i - (-2)/(-12). Let j = 22 + -21. What is the third biggest value in -4, j, h? -4 Let f = -715 + 750.3. Let v = f + -35. What is the smallest value in v, -2/7, 2/11? -2/7 Suppose -2g + 2 + 2 = 0. Let o be 14/12(-4)/(-56)g. Which is the third smallest value? (a) -3 (b) o (c) -14 b Let f = 0.199 + -0.199. Let v = -2/97 + -81/776. What is the fourth biggest value in v, 2, f, 0.15? v Suppose 0 = 5q + 5p + 10, -3q = 2p + 3 + 2. Let v be q/(4/(-22) + (-162)/(-44)). Which is the smallest value? (a) 0.2 (b) v (c) 2.7 b Let x = 163 - 161. What is the fourth biggest value in 1/6, -6, x, -0.2? -6 Let g be 2/(-4)12/(-18). Let m = 34.5 + -33.7. Which is the smallest value? (a) g (b) m (c) 2/7 c Let d(w) = 11w. Let s be d(-2). Let h = s + 18. Let y = 4/41 + -131/82. Which is the smallest value? (a) h (b) 5 (c) y a Let w be 32/525/45. What is the third biggest value in w, -0.4, -3? -3 Let l = -331 + 330.5. Which is the third smallest value? (a) l (b) -2/5 (c) 10/11 c Suppose -v - 218 = -214. Suppose 5u = -0u + 15. What is the second smallest value in u, v, -0.5? -0.5 Suppose 5t = -h + 32 + 27, t + 2h - 19 = 0. Let a be (-1)/(-3) - t/99. Let f be 2 + 1 + 68/(-16). What is the third smallest value in 4, a, f? 4 Suppose 5v - 18 = -4z, 4v + 2z - 13 = 5. Let m be 3 + (-3)/4v. Which is the second biggest value? (a) -5 (b) -3/7 (c) m c Let v = -1321/9 - -149. Let i = v - 94/45. What is the second biggest value in 0, -3/4, 4, i? i Let p(z) = z*3 - 4z*2 + 2z - 2. Let k be p(3). Let h = 1.1756 + -1.0756. Let c = -0.1 + 0. What is the smallest value in c, h, k? k Let j be 34/6 - (6/9 + -1). Suppose -3r + j = 24. Which is the fourth biggest value? (a) r (b) -0.5 (c) -0.3 (d) 1 a Let y = -19.5 + 21. Let g = y - 1. Which is the third smallest value? (a) g (b) -3 (c) -2/15 (d) 2/11 d Let u be 116/(-87)(-3)/561. Which is the third biggest value? (a) u (b) 2 (c) -4/3 c Let k = -359.5 + 356.5. Let y be 3/65 + (-1)/5. Which is the third biggest value? (a) -5 (b) k (c) 9 (d) y b Let y = 164 - 93. Let j = y + -70.42. Let l = 0.08 - j. Which is the second smallest value? (a) -2/5 (b) l (c) 0.4 a Suppose -12a + 1925 - 113 = 0. Suppose 2v - 3t - 54 = 0, 5v + 3t - a = -16. What is the smallest value in v, 1, 0.2, 5/6? 0.2 Let t = -0.1081 + 5.1081. Which is the third smallest value? (a) 1/9 (b) t (c) 281 c Let v = 1448 - 1190. Which is the biggest value? (a) -2 (b) v (c) 2/3 b Let i = 9.9 - 11. Let t = -0.1 - i. Let q = -1115/3 + 373. What is the third biggest value in t, q, 0.2? 0.2 Let j = -19/8 + 61/24. Let f be -44(-11)/(-770) - 3/(-7). What is the second smallest value in j, -2/5, f, -3/4? -2/5 Let o(n) = -60n - 13. Let f be o(-5). Let y = -6313/22 + f. Which is the second smallest value? (a) -0.3 (b) y (c) -5 a Let h = 0.5 + -0.2. Let n = -1997 + 2000. What is the second smallest value in 5.5, n, h? n Suppose -2w = -2s, 0 = -7w + 10w - 5s. Suppose 11b + wb = -55. What is the smallest value in b, 1, 5/3, -0.2? b Let r be 1-2 + (-3)/6. Let s = -238 - -246. Which is the fourth smallest value? (a) r (b) 3 (c) 0.3 (d) s d Let v = -51 - -54. Let o be 2/v*12/40. Which is the fourth smallest value? (a) -11 (b) 3 (c) o (d) 3/2 b Let v = -10 + 23. Let u = -13.5 + v. What is the biggest value in u, -1/9, -5? -1/9 Let	{ "pile_set_name": "DM Mathematics" }
02 and -4 + (2/1 - (-28 - -4)). 1122 What is the common denominator of -111/28 and 3/(-270)-213/14? 140 Let g(o) = o - 7. Let c be g(6). Suppose -24 = 5t - 84. Calculate the common denominator of c + -2 - (-98)/(-12) and t. 6 Let b be 20 - -2(-1)/1. Suppose bx - 140 = 346. What is the least common multiple of x and 33? 297 Calculate the smallest common multiple of ((-1735)/20 - -3)/(2/(-16)) and 16. 5360 Let s = 3 - 2. Let x(w) = 7w*2 + 2w - 1. Suppose 32 = 3d + d. Calculate the least common multiple of x(s) and d. 8 Let q = 119 - 108. Suppose 2d + 2d - 24 = 0. Calculate the least common multiple of q and d. 66 Suppose 48 = -7d + 11d. Calculate the least common multiple of d and (-301)/((-63)/42). 60 Calculate the common denominator of (-2)/7 + (-51)/(-56) and (13 + -9)((-315)/(-48) + -3). 8 Suppose 10u - 1092 = -272. Calculate the least common multiple of 5 and u. 410 Calculate the lowest common multiple of 51/(-357) - (1 + (-36)/7) and 1358. 2716 Suppose -4d - 2a - 72 = -0a, 5d + 84 = -a. Let q be (-1)/5 + (-264)/30. Let k = q - d. What is the smallest common multiple of 11 and k? 77 Let i be ((-6087)/6)/((-135)/(-8815)). Let y = i + 66245. Find the common denominator of y and -37/6. 54 Calculate the common denominator of ((-4)/10)/(176/340) and 5/22. 22 Suppose -7c - 4c + 902 = 0. What is the least common multiple of 14 and c? 574 Let g = -163 - -229. Calculate the lowest common multiple of 18 and g. 198 Let p = -150 + 160. What is the lowest common multiple of p and 2? 10 What is the common denominator of 131/110 and 425/20466/15? 330 Let u = -612 - -1799/3. Let c = 2849/5 + -51107/90. What is the common denominator of u and c? 18 Let u = -709787/30 - -23662. What is the common denominator of 127/48 and u? 240 Let c(y) = 5691y - 1. Let q be c(-2). Let g be (-1)/3 - q/(-4). Let v = 2842 + g. What is the common denominator of -33/8 and v? 24 Let q(o) = -o*2 - 11o + 16. Let c be q(-12). Suppose d + d - c = 0. Find the common denominator of ((-9)/6 + d)/(-10) and -87/2. 20 Suppose -3a + 30 = -3u, u + 17 = -5a + 79. Calculate the common denominator of (-1)/3 - 161/a and -69/2. 4 Let a be (251/2)/(479688/22693). Let j = 2/5451 + a. What is the common denominator of j and -49/16? 16 Suppose 4p = t - 5789, 2p + 0t + 2887 = 3t. Let y = 8711/6 + p. What is the common denominator of y and 37/12? 12 Suppose 0p - 30 = -p + 3j, 4p - 205 = -5j. Calculate the smallest common multiple of p and 9. 45 Let m = 3396 - 5259. Let y = m + 7395/4. Find the common denominator of ((-3)/24)/(165/(-82) - -2) and y. 4 Let w = 487 + -312. Let b = w + -367/2. What is the common denominator of 29/14 and b? 14 Let b(s) = 3s - 3. Let q be b(5). Suppose -r + 2 = -q. What is the lowest common multiple of 2 and r? 14 Let n = 40049/140 + -1979/7. Calculate the common denominator of 73/12 and n. 60 Suppose 3v = 3o - 21, -2o - v = -7o + 19. Let a be (-83878)/13752 - o/(-2). Let h = -9/764 + a. Find the common denominator of h and -25/14. 126 Let a = -6182299/60 - -103036. Calculate the common denominator of a and 99/40. 120 Let f = -40697/56 + 5841/8. What is the common denominator of -16/7 and f? 28 Let t be (-30)/(3 + -4 - 1). Calculate the common denominator of 126/(-76) + 0/t and (-20)/50(-230)/(-72). 342 Let o = -742 + 1092. What is the lowest common multiple of 24 and o? 4200 Calculate the common denominator of 67/9 and -3 - (3 - 460/12)/2. 9 Let i(n) = n + 8. Let b be i(-8). Suppose 3f - 3 - 6 = b, 0 = w - f + 45. Let t = -39 - w. What is the least common multiple of 1 and t? 3 Let s = -64697/128297566 + 2/16327. Let o = s + 597271/165018. Calculate the common denominator of o and (-5(-336)/35)/(-1 - 10). 231 Suppose 4v - 8v = -48. What is the common denominator of (128/(-144))/((-2)/v) and -53/7? 21 Let o = -3196 - -159833/50. What is the common denominator of -43/6 and o? 150 Let a = 60351/10 + -18091/3. Calculate the common denominator of -49/144 and a. 720 Let o = -4477836425/3278 - -1366027. What is the common denominator of o and -151/12? 19668 Suppose 2r = 84o - 83o + 139, -3o - 9 = 0. What is the lowest common multiple of r and 68? 68 Calculate the common denominator of (3 - (-449)/(-70)) + 19/95 and -2 - (49/(-30) + -2). 210 Find the common denominator of 131/24 and 11517/2574 - 23. 312 Let o(r) = -r*3 + 8r*2 + 11r - 6. What is the least common multiple of o(9) and 12? 12 Suppose 2x = 5z - 66, -3 = -4z - 11. Let b be 62/15 - x/(-285). Let m(s) = -s + 11. Calculate the least common multiple of 5 and m(b). 35 Let t = 1194 - 1192. What is the smallest common multiple of t and 183? 366 Let j(u) = -u2 - u + 7. Let f be j(0). Suppose -3g + fg = -120. What is the common denominator of 71/14 and 147/g(-3)/7? 70 Let j = -1508216 + 15110541/10. Let f = 2841 - j. Find the common denominator of f and -99/38. 190 Suppose 183 + 585 = 24p. What is the least common multiple of p and 28? 224 Let t = -6259/10 - -636. Let u(v) = v2 - 5v + 4. Let m be u(3). Find the common denominator of t and (6 - (1 + m))/(-10). 10 Let t = 1634527/120 + -13620. What is the common denominator of t and 21/8? 120 Let r = 31745/3148 - 2/2361. What is the common denominator of 27/(-7)(-7)/2 and r? 12 Let d = -2/37987 + -52801896/645779. Let u = -19009/204 - d. Let h = -8461/4 - -2095. What is the common denominator of u and h? 12 Suppose 0 = b + r, 4b - 5 = -0r + r. Calculate the lowest common multiple of ((-609)/(-168) + (-3)/(-8))/4 and b. 1 Let b(z) = 85z + 2732. What is the least common multiple of 15(24/10 + 2) and b(-32)? 132 Let o(w) = 3w*2 - w. Let c be (2/(-2))/(-5 - -1 - -3). What is the smallest common multiple of (-2)/6 + (-44)/(-6) and o(c)? 14 Suppose -890 = -3b + g, -4g + 7g - 1502 = -5b. Suppose b = -u - 10. Calculate the common denominator of 70/3 and (98/u)/(2/4). 33 Let g = 2440 - 53683/22. Suppose -5a + 5 = -r, -r - 5a = 3r - 55. What is the common denominator of g and r? 22 Suppose -s - 26 - 67 = 0. Let m = s - -133. Calculate the lowest common multiple of 8 and m. 40 Let x = 1205/8 + -151. Suppose i + 25 = 4q, -5i + 10 = 5q - 2i. Find the common denominator of x and q/(-2)129/15. 8 Let g(z) = z + 4. Let s be g(-2). Suppose -b + s = 0, -4b + 0b - 22 = -3p. What is the least common multiple of 78 and p? 390 Let h(o) = 88o - 690. What is the lowest common multiple of h(8) and 26? 182 Let k = -177 - -187. Calculate the least common multiple of 11 and k. 110 What is the least common multiple of 392 and (-1)/2(-9)/((-27)/(-6))? 392 Let z = -60733/62154 - 5/1151. Calculate the common denominator of -67/108 and z. 108 Let u = -14903/4836 + -2/1209. Let c be (-10660)/(-6903) + 4/(-18). Let y = c + -3633/472. What is the common denominator of u and y? 24 Let y = -2386/5 + 171727/360. Calculate the common denominator of y and -103/72. 72 What is the common denominator of -101/32 and 0 + 2/(((-480)/(-188))/3)? 160 Let d = -22717270090/157 + 144696520. Let s = d + -35446397/64684. Let o = -8/103 - s. Calculate the common denominator of o and 15/2. 4 Let q = 79983/20 + -3998. What is the common denominator of 6/(-180)410/4 and q? 60 Suppose -6s + 1789 = -707. Calculate the least common multiple of s and 224. 2912 Suppose -q = 3p - 6q - 27, -2p + 20 = -4q. Suppose 0 = pk - 4w - 4, -k + 2w - 4w + 1 = 0. Calculate the least common multiple of 24 and (20/8)/(k/8). 120 Let u = 5 - 3. What is the least common multiple of (-276)/(-18) + 1/(-3) and u? 30 Let n be (-70)/(-1) - (8 + -8). Suppose n = -3p + 8p. What is the common denominator of -53/5 and ((-36)/135)/(1/p)? 15 Let z(a) = -a - 11. Let b be z(-5). Let x(o) = o*2 + 2o - 2. Calculate the lowest common multiple of x(b) and 6. 66 Let r = 92 - 42. Calculate the smallest common multiple of (116/29)/(-1 - -3) and r. 50 Suppose g + 3 = -4q + 36, -4g + q = -166. Suppose -n + g = 4c - 4, 2n = 3c - 42. Calculate the smallest common multiple of c and (-2)/(-6) - 390/(-18). 132 Let p(f) = f3 + f + 1. Suppose -36d + 42d = 36. Calculate the lowest common multiple of p(0) and d. 6 Let u = -3 - -5. Let x = -84 + 137. Suppose -x = -4a + 5c, 4a = 3*c + 11 + 40. What is the least common multiple of u and a? 12 Find the common denominator of (	{ "pile_set_name": "DM Mathematics" }
rt(684)-2 + -2)2. -2740 - 197sqrt(19)/4 Simplify sqrt(55)/((-1sqrt(132))/sqrt(12)). -sqrt(5) Simplify (-42sqrt(60))/((sqrt(84) - -1sqrt(84) - sqrt(84))/sqrt(7)). -8sqrt(5) Simplify (sqrt(204)-15)/(sqrt(12) - sqrt(48)/sqrt(16)). -10sqrt(17) Simplify ((-3sqrt(189))/sqrt(7))/(sqrt(45)/(sqrt(20)/sqrt(4))). -3sqrt(3) Simplify (sqrt(70) - (sqrt(70) + (sqrt(70) - (sqrt(70) - (sqrt(70) - (sqrt(70)1 + sqrt(70)))1))))/(sqrt(90) + 2sqrt(90) + sqrt(90)). sqrt(7)/12 Simplify (-3sqrt(171)-4)/sqrt(9). 12sqrt(19) Simplify sqrt(136)/(sqrt(512) + 3sqrt(512)). sqrt(17)/32 Simplify (2 + sqrt(363)-3 + sqrt(363) + sqrt(363))*2. -44sqrt(3) + 367 Simplify (1sqrt(143)-1)/(1sqrt(176)). -sqrt(13)/4 Simplify sqrt(14)/(sqrt(98) + sqrt(98)2 + sqrt(2)) + 1. sqrt(7)/22 + 1 Simplify ((-1sqrt(5) + 1 - (sqrt(245)-2 - sqrt(245))) + ((2sqrt(245))/sqrt(7))/sqrt(7))2. 44sqrt(5) + 2421 Simplify (sqrt(675) - 2sqrt(675))/sqrt(9)-4. 20sqrt(3) Simplify (sqrt(16)/sqrt(8) + -1)4. -4 + 4sqrt(2) Simplify (1 + sqrt(72))2. 12sqrt(2) + 73 Simplify (-1(sqrt(2736) + -2)5)*2. -1200sqrt(19) + 68500 Simplify 2sqrt(208)-3 + -4. -24sqrt(13) - 4 Simplify ((sqrt(32) + -3 - sqrt(2)) + sqrt(16)/(sqrt(8) - sqrt(128)))2. -16sqrt(2) + 209/9 Simplify (sqrt(17) - -2sqrt(17)-5) + (sqrt(17) - (sqrt(153)2)/sqrt(9)). -10sqrt(17) Simplify (3sqrt(85)2 - sqrt(85))/(-3sqrt(80)). -5sqrt(17)/12 Simplify 1((sqrt(2) - (-3 + sqrt(2))) + sqrt(2))2 - (2 + (sqrt(8))2). 1 + 6sqrt(2) Simplify (-2(sqrt(1216) + 1) + sqrt(1216))2 + (-3 + ((sqrt(1216) + 1)2 - sqrt(1216)) - sqrt(1216)). 32sqrt(19) + 2434 Simplify 4 + sqrt(684)2. 4 + 12sqrt(19) Simplify (sqrt(176)/sqrt(2))/((sqrt(88) + sqrt(88) + 1sqrt(88))/sqrt(8)). 2sqrt(2)/3 Simplify (sqrt(440)/sqrt(8))/sqrt(5) - -5sqrt(1100). 51sqrt(11) Simplify sqrt(170)/((-1sqrt(80) + sqrt(80) + sqrt(80) + sqrt(80))/sqrt(8)). sqrt(17)/2 Simplify (sqrt(847) + 0)2 - (2 + (-1sqrt(847) + sqrt(847))2). -2 + 22sqrt(7) Simplify -2(-3 + sqrt(30)/(sqrt(36)/sqrt(6))). -2sqrt(5) + 6 Simplify ((sqrt(220) - ((sqrt(220) - (sqrt(220) + sqrt(220)4)3) + sqrt(220)))/sqrt(5))2. 8624 Simplify (sqrt(136)/(sqrt(32)/sqrt(4)))2 - ((-2 + sqrt(1377))*2 - sqrt(1377)). -1364 + 45sqrt(17) Simplify 5(-2 + (sqrt(17) - (-2sqrt(17) - sqrt(17))3))2. -200sqrt(17) + 8520 Simplify (3 + -2sqrt(7))2 + -1. -12sqrt(7) + 36 Simplify (2 + 2 + sqrt(13) + sqrt(1872)-2)4. -92sqrt(13) + 16 Simplify (sqrt(1573) - ((-1 + sqrt(1573))-6)*2)-5. -4015sqrt(13) + 283320 Simplify ((sqrt(36) + (sqrt(144) - sqrt(144)3)/sqrt(4))/sqrt(12))*2. 3 Simplify ((1sqrt(3600) - sqrt(36))/(sqrt(60)/sqrt(5)-5))2. 243/25 Simplify ((sqrt(108) - (sqrt(108) - (sqrt(108) + (sqrt(108) - -1sqrt(108))) - sqrt(108)))/sqrt(4))/(4sqrt(36)). sqrt(3)/2 Simplify ((5((1sqrt(2057) - sqrt(2057)) + sqrt(2057)) - -1sqrt(2057)-1)-2)*2. 131648 Simplify ((2 + sqrt(500))3 + sqrt(500) + sqrt(500)-2 + 2)2. 320sqrt(5) + 2064 Simplify sqrt(15)/sqrt(5)-6 + (1 + sqrt(3) + 4)2. 4sqrt(3) + 28 Simplify ((sqrt(117)2)/sqrt(9))2 + (sqrt(13)1 + sqrt(13))1 + sqrt(143)/(sqrt(22)/sqrt(2)5). 11sqrt(13)/5 + 52 Simplify ((0 + sqrt(5))-4 + sqrt(5) - sqrt(5))*2 + ((sqrt(5) + -2)-1)*2. -4sqrt(5) + 89 Simplify 4 + (1 + sqrt(1872))*2. 24sqrt(13) + 1877 Simplify -4sqrt(24)/(sqrt(36)/sqrt(3)). -4sqrt(2) Simplify -1((sqrt(2) - -1sqrt(2) - sqrt(2))*2 + -4). 2 Simplify sqrt(38)/(2sqrt(32) - sqrt(32)). sqrt(19)/4 Simplify -2(4(sqrt(72) + -1)*2 + 0). -584 + 96sqrt(2) Simplify (0 + sqrt(243))*2-4. -972 Simplify -4 + 3(sqrt(32))2. 92 Simplify ((sqrt(5324)3)/sqrt(4))*2. 11979 Simplify (sqrt(36)/sqrt(2)-6 + sqrt(18) - sqrt(18))/(-2sqrt(726)). 3sqrt(3)/11 Simplify -4((sqrt(25)/sqrt(5) + 1)2 + 0). -24 - 8sqrt(5) Simplify (sqrt(152)/sqrt(8) + -3 + (sqrt(19) - ((sqrt(304) - (-4 + sqrt(304) + sqrt(304))) + sqrt(304))))*2. -28sqrt(19) + 125 Simplify 1 + sqrt(33)/(sqrt(9)/sqrt(3)). 1 + sqrt(11) Simplify -3(sqrt(63)/sqrt(9))25 + -1. -106 Simplify 3 + sqrt(1088) - ((sqrt(136)/sqrt(32))*2 + sqrt(17)). -5/4 + 7sqrt(17) Simplify (0 + ((-2sqrt(704) - sqrt(704))6 - -41sqrt(704)))*2. 137984 Simplify 1-1sqrt(13) + -4. -4 - sqrt(13) Simplify (sqrt(208) + ((1 + 2sqrt(208))*2 - sqrt(208) - sqrt(208)))-5. -4165 - 60sqrt(13) Simplify 2 + 3sqrt(28)6. 2 + 36sqrt(7) Simplify -3(3sqrt(19))*2 + (sqrt(19) - (-1 + sqrt(171))). -512 - 2sqrt(19) Simplify 1 + sqrt(15)/sqrt(5) + sqrt(3) + -5. -4 + 2sqrt(3) Simplify 2(-2(sqrt(17) + -1) - (4 + -1sqrt(17) + sqrt(17)))*2. 16sqrt(17) + 144 Simplify 5((sqrt(110) + sqrt(110)-1 - sqrt(110)) + sqrt(110) + sqrt(110))/sqrt(10) - ((sqrt(44)/(sqrt(4)-1))2 - (-1 + sqrt(275))2). -5sqrt(11) + 265 Simplify 4(-3 + sqrt(208)) - ((sqrt(65) - (sqrt(65) - sqrt(65)2))/sqrt(5) - (sqrt(1053) + 1)*2). 32sqrt(13) + 1042 Simplify -3((1 + sqrt(1100))2 + 1)4. -13224 - 240sqrt(11) Simplify 3(0 + sqrt(17)) - -1sqrt(1377). 12sqrt(17) Simplify (-3 + sqrt(1216)-3)2. 144sqrt(19) + 10953 Simplify (-3(sqrt(110) + 3sqrt(110)))/sqrt(10). -12sqrt(11) Simplify (sqrt(684)-2 + sqrt(684))*2 + 1 + -5. 680 Simplify -3 + (sqrt(684)-1 - sqrt(684)) + sqrt(684). -6sqrt(19) - 3 Simplify sqrt(171)/(-3sqrt(729)). -sqrt(19)/27 Simplify 5(sqrt(5) - (sqrt(30)4)/sqrt(6))*2. 225 Simplify (sqrt(550)/(1sqrt(10)))/(2sqrt(605) + sqrt(605)). sqrt(11)/33 Simplify (4(sqrt(343) + -1sqrt(343)))2 + -4. -4 Simplify (4sqrt(6)/(-5(sqrt(3) - (sqrt(3) - sqrt(27)))))2. 32/225 Simplify (sqrt(68) + 1)2. 2 + 4sqrt(17) Simplify sqrt(5) + ((sqrt(500) - (sqrt(500) + 2)) + sqrt(500))2 - (sqrt(20) + -3). -41sqrt(5) + 507 Simplify ((sqrt(3500)3)/sqrt(7))2. 4500 Simplify ((sqrt(11) - (-1sqrt(11) + 0)) + sqrt(11) + (sqrt(99)3)/sqrt(9))2. 396 Simplify ((sqrt(108)/sqrt(4) - sqrt(27))5 + sqrt(27))/(sqrt(576)-1). -sqrt(3)/8 Simplify ((sqrt(432) + 0)2 - sqrt(3) - -2sqrt(300)) + -5. 19sqrt(3) + 427 Simplify (-4sqrt(17)-6-3)2. 88128 Simplify ((sqrt(153)/(sqrt(9) + (sqrt(9) - sqrt(45)/sqrt(5) - sqrt(9) - sqrt(9)) - sqrt(9)) - sqrt(17))2 + sqrt(85)/sqrt(5)1)-2. -153/2 - 2sqrt(17) Simplify 2(1 + sqrt(13)) - 3sqrt(468). -16sqrt(13) + 2 Simplify -6(-1sqrt(900))/sqrt(12). 30sqrt(3) Simplify (2 + sqrt(5))1 + -4. -2 + sqrt(5) Simplify -2(sqrt(153) + 2sqrt(153))*2 + sqrt(153) - sqrt(153) - -1(-3sqrt(153))2. -1377 Simplify 1sqrt(832)2. 16sqrt(13) Simplify (-1 + sqrt(11) + 1 + 4)*2. 8sqrt(11) + 27 Simplify ((sqrt(128)-4 - sqrt(128))-1)*24. 12800 Simplify (5 + sqrt(45) + 0 + -3)*2. 12sqrt(5) + 49 Simplify (sqrt(12)/sqrt(4)13)*2. 27 Simplify ((0 + sqrt(637) + -1)1)*2. -14sqrt(13) + 638 Simplify (-5 + sqrt(833)-2)2. 140sqrt(17) + 3357 Simplify (sqrt(171) - -4sqrt(171)-2)/(sqrt(324)-1 + sqrt(324) + sqrt(324)). -7sqrt(19)/6 Simplify (1sqrt(192))2-3-4. 2304 Simplify -5 + sqrt(21)/sqrt(3) + -2 + (sqrt(21)/sqrt(3))2. sqrt(7) Simplify -1 + sqrt(5) + ((-2 + sqrt(5) + sqrt(5))2 - sqrt(5)) + 5. -8sqrt(5) + 28 Simplify (((sqrt(605)-1 - sqrt(605)) + sqrt(605) + sqrt(605))2 - sqrt(605))*2 + ((sqrt(720) - 1sqrt(720))/sqrt(9))2. 605 Simplify (2 + sqrt(2736) + (sqrt(2736) - (sqrt(2736) + -1 - sqrt(2736))) - (-1 + sqrt(2736) + 0))2. 96sqrt(19) + 2752 Simplify (sqrt(4320) + (-2sqrt(4320) - sqrt(4320)))/sqrt(6) + 2. -24sqrt(5) + 2 Simplify 0 + (sqrt(42) - 3sqrt(42))/sqrt(6). -2sqrt(7) Simplify (4 + sqrt(2) + sqrt(32) + -3)-6. -30sqrt(2) - 6 Simplify -2 + (1sqrt(152))/sqrt(8). -2 + sqrt(19) Simplify (-5 + (sqrt(45) - (sqrt(3645))*2))-1. -3sqrt(5) + 3650 Simplify ((sqrt(190)-2 - sqrt(190))-5)/sqrt(10). 15sqrt(19) Simplify (-2 + (3 + sqrt(468) + 1 - sqrt(468)))*2. 4 Simplify (sqrt(117)2-2)/(sqrt(9)-2-4). -sqrt(13)/2 Simplify (sqrt(34)/(sqrt(98) - (sqrt(98)5 + sqrt(98) - sqrt(98))))*2. 17/784 Simplify (2((sqrt(405)2 - sqrt(405)) + -3))2. -216sqrt(5) + 1656 Simplify (sqrt(931)1)2 - sqrt(19) - sqrt(19) - (sqrt(19) - (2sqrt(38)/sqrt(2))*2). -3sqrt(19) + 1007 Simplify (-4(-3 + sqrt(4)/(sqrt(2)-22 - sqrt(2))))2. 96sqrt(2)/5 + 3632/25 Simplify ((sqrt(65) + 2sqrt(65))-5 - sqrt(65))/(sqrt(25)/(sqrt(125) - sqrt(5))). -64sqrt(13) Simplify sqrt(2299)-2*-3 + -4. -4	{ "pile_set_name": "DM Mathematics" }
*2 + 482lm2 - 684 What is the second derivative of 5021718u*2x*3 + 225ux + 1077x*3 - 4x wrt u? 10043436x3 What is the second derivative of 9137f*4 - 6f*3 + 60949f + 2? 109644f2 - 36f What is the third derivative of 72277wz*3 + 1019059wz2 + 2z*3 wrt z? 433662w + 12 Find the first derivative of 294b2w + b*2 + 3bw - 179b - 25w - 24747 wrt b. 588bw + 2b + 3w - 179 What is the first derivative of -26687p*2 + 9547? -53374p Differentiate 449229m2 + 239647 wrt m. 898458m Find the third derivative of -3065p2y*4 - 6p*2y*2 + 2p*2 - 3y*5 + 3y*2 + 251 wrt y. -73560p*2y - 180y2 Find the second derivative of 9f*5 - 83f*4 + 57f*3 - 3567332f wrt f. 180f3 - 996f*2 + 342f Find the second derivative of -3au*2 + 3au - 25643a - 9131u2 - 2u - 2 wrt u. -6a - 18262 Find the second derivative of 1141229j*5 - 394899j. 22824580j3 Find the second derivative of 1270r*4 + 3r*3 - r + 49449. 15240r*2 + 18r Differentiate 57969q4 - 165750 with respect to q. 231876q*3 Find the second derivative of 2356198a*5 + 2694982a. 47123960a3 What is the derivative of 1172379u + 897106 wrt u? 1172379 What is the second derivative of 63299z4 + 382z + 6? 759588z2 Find the second derivative of or*2t*2 + 2or2 - 6ort + 6ot*2 + 8ot + 2r*2t*2 - 3r*2 + 2r - t*2 wrt t. 2or2 + 12o + 4r2 - 2 Find the third derivative of 6b*6 - 664b*4 + 36b*3 - 2b*2 + 327052b. 720b3 - 15936b + 216 What is the second derivative of 62185j2 + 17659j wrt j? 124370 What is the third derivative of -2260424f3 + 2780888f*2? -13562544 What is the second derivative of 135o*5 + 57o*4 + 42799o wrt o? 2700o3 + 684o*2 What is the second derivative of 21462d4 - d3 + 242697d? 257544d*2 - 6d What is the third derivative of 57x4 + 50592x*3 - 7145573x*2 wrt x? 1368x + 303552 Find the third derivative of 504849f5 - 620877f*2. 30290940f*2 What is the second derivative of -66844v*2 - 660v - 46? -133688 Differentiate -836s3x*2 + 1300s*3 + 21s*2x*2 + 7 with respect to x. -1672s*3x + 42s2x What is the derivative of 59179c3n + 1862c3o + c*3 - 2co + no wrt o? 1862c3 - 2c + n Find the first derivative of 47rt*2u - 125ru3 + t2u2 - tu + 972u3 + 2u*2 wrt r. 47t*2u - 125u3 Find the second derivative of -286830i*2x + 87ix - 33i + 4x - 1 wrt i. -573660x Find the second derivative of 2hm3 + 5hm2 + 14076hm + m3 - 4866m*2 - m wrt m. 12hm + 10h + 6m - 9732 What is the third derivative of -2301605m*3r - 4m2r + 8mr + 2m - 6253r wrt m? -13809630r Differentiate -63270p*3 - 1195 wrt p. -189810p*2 Find the second derivative of dp*3 + 2dpq + dq2 - 11p*3 - 8p*2q*2 wrt p. 6dp - 66p - 16q2 Differentiate -4vw - 2v - 1079w3 - 7575 wrt w. -4v - 3237w2 What is the second derivative of 5k*2m*2u + 14531k2mu - 5km2u - 19ku + 3 wrt k? 10m2u + 29062mu Find the second derivative of 57045r5 + 2r*3 - 4r*2 + 6r + 42946. 1140900r3 + 12r - 8 Differentiate 5d2g + 555dg*3 - dgn2 + 8g*3n*2 - 311n*2 wrt d. 10dg + 555g*3 - gn*2 Find the third derivative of -2s*5 - 13510s*3 - 2s*2 - s + 27127. -120s2 - 81060 Differentiate -i2r3z - 2881i2z - i - 57r3 + 4r*2z - 15z wrt i. -2ir3z - 5762iz - 1 Find the third derivative of 134l2u3 + l2 + 9870lu*2 + 6u*3 wrt u. 804l2 + 36 Find the third derivative of k6x + 429k*4x*2 - 8k*2x*2 + 8k*2 + 67x*2 wrt k. 120k*3x + 10296kx*2 Differentiate -192921l*2 + 20162 with respect to l. -385842l What is the third derivative of 520864v3w + v*2w + v*2 + 116vw + 6w wrt v? 3125184w Find the first derivative of 254k*3 - 9k*2 + 379072 wrt k. 762k*2 - 18k Differentiate 335580mv + 437m - 659 with respect to v. 335580m Differentiate -14i2 + 16i - 30870. -28i + 16 What is the third derivative of -49148d*3 - 3d*2 + 74 wrt d? -294888 Find the first derivative of 248134d*3 + 139143. 744402d2 Find the second derivative of b4 + 283b3 + 25b*2 - 5712b - 6 wrt b. 12b2 + 1698b + 50 Find the second derivative of -11792r2 - 18025r + 1. -23584 Find the second derivative of -95150n2 - 50616n. -190300 What is the second derivative of 443269hq*5 - 2hq2 + 44h - q*2 + 74q - 4 wrt q? 8865380hq*3 - 4h - 2 What is the third derivative of 60405dt*6 - 1186d - 19t2 - 4t wrt t? 7248600dt*3 Find the first derivative of -4f*3o - f*2o - 30fo + 9f + 207o + 31 wrt f. -12f2o - 2fo - 30o + 9 Find the third derivative of 150517x*3 + 52264x*2 wrt x. 903102 What is the derivative of 7i*4 + 7557i*3 - i - 207432 wrt i? 28i*3 + 22671i*2 - 1 Differentiate -10173n + 22364 wrt n. -10173 Find the third derivative of 1058074q3 + 337993q*2. 6348444 Differentiate 5605o*3 - 22o*2 - o + 3407071 with respect to o. 16815o*2 - 44o - 1 Find the third derivative of -32d5l + 4994d5 + 3d*2l - 5287dl - 7l wrt d. -1920d*2l + 299640d2 Find the third derivative of a6 + 1220a*5 + 16a*3 + 873a*2 - 44a - 2. 120a3 + 73200a*2 + 96 Find the first derivative of -21psz*2 - 20ps - 78pz2 + pz - 4sz + 205s - 2 wrt z. -42psz - 156pz + p - 4s What is the derivative of -2q*4 - 292427qz + 3z - 11000 wrt q? -8q3 - 292427z Find the first derivative of 2513382k + 370904 wrt k. 2513382 What is the first derivative of 56027gu2 - 1750724g + 29u4 - 2 wrt u? 112054gu + 116u*3 Find the third derivative of 75373d*2p*3 - 7230d*2p*2 + 2d*2p + dp3 wrt p. 452238d*2 + 6d Find the second derivative of -8738t5 - 953t + 1. -174760t3 Find the second derivative of 2269b*3f*2 + 359b*3f - 7b3 + b2f + 20bf*2 + 2 wrt f. 4538b*3 + 40b What is the first derivative of 312o3 + 1719o*2 - 3409907? 936o*2 + 3438o Find the second derivative of -6w4 + 13238w*3 + 9w*2 + 6187646w. -72w2 + 79428w + 18 What is the second derivative of 2n4 - 10n*3 + 29581n*2 + 17847n + 3? 24n2 - 60n + 59162 What is the first derivative of 152581d4l2 + d4 + 854146l2 wrt d? 610324d*3l*2 + 4d*3 Differentiate -55607z + 5553. -55607 Find the third derivative of 6p5 + 83p*4 - 7p*3 + 16p*2 - 110p wrt p. 360p2 + 1992p - 42 What is the second derivative of -1786487f5 - 12935f - 3 wrt f? -35729740f3 What is the first derivative of 12ab - 13a + 464b2 + 18b + 48422 wrt b? 12a + 928b + 18 What is the first derivative of -4qz*3 + 70qz + 238387q + 160z wrt z? -12qz2 + 70q + 160 Find the second derivative of -221z3 + 33z*2 - 103379z wrt z. -1326z + 66 What is the second derivative of 8726wy3 - 1656wy - y3 - 2y*2 wrt y? 52356wy - 6y - 4 What is the first derivative of b*3qz + 8b*3 + 8997b*2z - 304132bqz wrt q? b3z - 304132bz What is the third derivative of -7sx*3 - 33sx2 + 2sx + 121s + 9468x3 + x2 - x wrt x? -42s + 56808 Differentiate 70o3w*2 + 179o*3 - 2633o*2w*3 - 4 with respect to w. 140o*3w - 7899o2w*2 What is the derivative of 169487j*2 + 7390 wrt j? 338974j Find the third derivative of -227073r4 - 581r*2 + 16r wrt r. -5449752r Differentiate 200i*2 + 91i + 63926 wrt i. 400i + 91 What is the first derivative of -358236b + 208369 wrt b? -358236 Find the third derivative of -3675799c4 + 3676405c*2 wrt c. -88219176c Find the third derivative of 170n2u*4 + 12319n*2u*2 - 2n*2u + 5nu - 1174u6 wrt u. 4080n*2u - 140880u3 Find the third derivative of -10777h6 - h3 + 2h2 - 4h + 1639 wrt h. -1293240h3 - 6 Find the first derivative of -175cj4 + cj*2 + 2cj - 103c + 19j + 133 wrt j. -700cj3 + 2cj + 2c + 19 What is the first derivative of -iq + 235915i + 2q3 - 478367q + 2 wrt q? -i + 6q2 - 478367 What is the second derivative of -1779b*4 + 784b*3 + 2527143b wrt b? -21348b2 + 4704b What is the third derivative of -1248aq*4 + 591aq2 + 394aq - 3q**4	{ "pile_set_name": "DM Mathematics" }
-2, 62, 8. -5, -4, -2, 0, 3, 8, 62 Put 16098, 4, 6, -5, -12 in increasing order. -12, -5, 4, 6, 16098 Sort 0, -1989, 37 in descending order. 37, 0, -1989 Sort -28, -2, 109490, 11 in ascending order. -28, -2, 11, 109490 Put -0.4, 793/4, -41, -3, -0.1 in ascending order. -41, -3, -0.4, -0.1, 793/4 Sort 5, -8, 1230766 in ascending order. -8, 5, 1230766 Put -3, 1256, 40, -22, 2, 0 in ascending order. -22, -3, 0, 2, 40, 1256 Sort 3, -10026, 330 in increasing order. -10026, 3, 330 Sort 0, -2/537, -117/5, 673 in decreasing order. 673, 0, -2/537, -117/5 Sort -0.3, 95/4, 1, -5, 0.0725215 in descending order. 95/4, 1, 0.0725215, -0.3, -5 Put 5, -4, 2, 858, 7 in descending order. 858, 7, 5, 2, -4 Put -3, 0.5, 9, -0.3, 2, 0.02, -41 in decreasing order. 9, 2, 0.5, 0.02, -0.3, -3, -41 Sort 0, 135, -1, 392, -3, 4 in descending order. 392, 135, 4, 0, -1, -3 Put 41, 20, -3, -657, -2 in increasing order. -657, -3, -2, 20, 41 Put -0.4, -2, -116, 546.6, -2/7 in decreasing order. 546.6, -2/7, -0.4, -2, -116 Sort -751, -73, 2, 9, -2, 4 in decreasing order. 9, 4, 2, -2, -73, -751 Sort 5, -17638, -10/9, -2, 11, -2/5. -17638, -2, -10/9, -2/5, 5, 11 Put 4, -2, -1, -40558, 5, -3 in descending order. 5, 4, -1, -2, -3, -40558 Put 378, -2, 0.8, 30/23, -5 in ascending order. -5, -2, 0.8, 30/23, 378 Sort -18, -2, 3581, 2 in increasing order. -18, -2, 2, 3581 Sort -190, 1099, 0, -239 in descending order. 1099, 0, -190, -239 Sort 23, 35, 1029 in ascending order. 23, 35, 1029 Sort 7, -36, -10, -15, 2, 4 in descending order. 7, 4, 2, -10, -15, -36 Put 3, 29, 0, 44, -92, 5 in ascending order. -92, 0, 3, 5, 29, 44 Sort 35, 2546982, -5. -5, 35, 2546982 Sort 3, 7, -5, -0.05, 26, 1/4 in ascending order. -5, -0.05, 1/4, 3, 7, 26 Put -34, 16, 92098/5 in descending order. 92098/5, 16, -34 Put 5, 275117, -79 in decreasing order. 275117, 5, -79 Sort 1, 74/47, -0.5, -2.5, 0.5 in increasing order. -2.5, -0.5, 0.5, 1, 74/47 Put -5, -3, 14811593 in ascending order. -5, -3, 14811593 Sort -291, 1, -3, -20, 697 in descending order. 697, 1, -3, -20, -291 Sort 1, 112, 5, -2, -3, 7200 in descending order. 7200, 112, 5, 1, -2, -3 Sort -63800, 0, 2, -5, -4 in ascending order. -63800, -5, -4, 0, 2 Sort -5, -1, 751, -2041, 0, 4 in increasing order. -2041, -5, -1, 0, 4, 751 Put 21, 166, -4, 0, 25, -5 in ascending order. -5, -4, 0, 21, 25, 166 Sort -785, 158, -5, 3, 1 in decreasing order. 158, 3, 1, -5, -785 Sort -4, -1069, -93329 in ascending order. -93329, -1069, -4 Sort 1099, -0.5, -123, 3, -0.6, -3. -123, -3, -0.6, -0.5, 3, 1099 Sort 0.11, 3/4, -50/6793 in decreasing order. 3/4, 0.11, -50/6793 Put 5, 159257, -7 in descending order. 159257, 5, -7 Sort -0.2, -4.71, 0.1, 3, 1/9, 0.9 in descending order. 3, 0.9, 1/9, 0.1, -0.2, -4.71 Sort -5, -5845, -166 in increasing order. -5845, -166, -5 Sort 1346, 0.12, -0.21, -2/7 in increasing order. -2/7, -0.21, 0.12, 1346 Sort 2, -1, -5, 5884, 470, 4. -5, -1, 2, 4, 470, 5884 Sort 4/2615, -2/11, -19, 7 in descending order. 7, 4/2615, -2/11, -19 Sort 20, 296, 21. 20, 21, 296 Put 0.4, 0, -0.2, 22, 1/4, 57 in descending order. 57, 22, 0.4, 1/4, 0, -0.2 Put 12187, 20, -9 in increasing order. -9, 20, 12187 Put 57, -3/4, -11, 3, -5, -2, 42 in descending order. 57, 42, 3, -3/4, -2, -5, -11 Put 0, -390, -5, -159, -19 in descending order. 0, -5, -19, -159, -390 Put -3, -18, 154, 1, 44, 3 in descending order. 154, 44, 3, 1, -3, -18 Sort 16, -2581281, 4 in increasing order. -2581281, 4, 16 Put -43, -16, 804, -2 in increasing order. -43, -16, -2, 804 Put 2050, -47241, -6 in ascending order. -47241, -6, 2050 Put -3, 173790, -7, -5 in decreasing order. 173790, -3, -5, -7 Sort -95, 0.7, -1.082, -0.01, -3. -95, -3, -1.082, -0.01, 0.7 Put 2, -33, 0, 88693 in descending order. 88693, 2, 0, -33 Put 3, 1308, -0.14, 0.5, 6/13 in ascending order. -0.14, 6/13, 0.5, 3, 1308 Sort -5088, 7, -6, -46 in increasing order. -5088, -46, -6, 7 Sort -29, 37281, 1 in decreasing order. 37281, 1, -29 Put 44, 5, 7, 3, 62, -12, 4 in ascending order. -12, 3, 4, 5, 7, 44, 62 Sort -4, 6653, 2, -123, -5 in decreasing order. 6653, 2, -4, -5, -123 Put 5, 3, 1028, -8, 11 in decreasing order. 1028, 11, 5, 3, -8 Sort -1, 264577, 0.021 in increasing order. -1, 0.021, 264577 Put -0.05, -7, 41, 22, -4, 0.1 in descending order. 41, 22, 0.1, -0.05, -4, -7 Sort -5, -0.2, -0.1, -3, 1, -347/5 in descending order. 1, -0.1, -0.2, -3, -5, -347/5 Sort 0.054, -1/13149, -6, -2/11. -6, -2/11, -1/13149, 0.054 Put 1, -5, -1, -4, 294, 4, -771 in descending order. 294, 4, 1, -1, -4, -5, -771 Sort -1, -23, -7, -4, 3, -10, 1 in descending order. 3, 1, -1, -4, -7, -10, -23 Sort -28, 2023, -3, -1 in descending order. 2023, -1, -3, -28 Sort -93884, -4, -33 in ascending order. -93884, -33, -4 Sort -4, 7, -3, 13, -19, 3, 213 in ascending order. -19, -4, -3, 3, 7, 13, 213 Put 3133520, 2, 11 in descending order. 3133520, 11, 2 Put 5, 2, 3, 0, -3, -27, 12 in descending order. 12, 5, 3, 2, 0, -3, -27 Sort -7, -3, 11, 10, 4, -2, -9 in decreasing order. 11, 10, 4, -2, -3, -7, -9 Sort 4, 33, 2, 5, 0, 2551, -1 in increasing order. -1, 0, 2, 4, 5, 33, 2551 Put 6553, -18, 2, 11.7 in ascending order. -18, 2, 11.7, 6553 Put -3, -2, 2/7, -0.3, 33, 4.5, 1 in increasing order. -3, -2, -0.3, 2/7, 1, 4.5, 33 Sort 0.5, -13, -7/66452. -13, -7/66452, 0.5 Sort -1403230, -4, -2 in decreasing order. -2, -4, -1403230 Put -19, 16488, -1, 0 in decreasing order. 16488, 0, -1, -19 Put 0.01, -3, -489, 3356 in increasing order. -489, -3, 0.01, 3356 Sort -1, 14.5, 280 in ascending order. -1, 14.5, 280 Sort 47/35, -43, 3, -19 in decreasing order. 3, 47/35, -19, -43 Sort -83926, -5, -10, -4 in descending order. -4, -5, -10, -83926 Put 6, -5, -153, -2359 in descending order. 6, -5, -153, -2359 Sort -291005, -3, 1, -21, -5 in increasing order. -291005, -21, -5, -3, 1 Sort 266, -18, -5, -302, -9 in ascending order. -302, -18, -9, -5, 266 Sort -488, 0.3, -0.4, -0.1, 92, -7. -488, -7, -0.4, -0.1, 0.3, 92 Sort 273, 1, 82/27 in descending order. 273, 82/27, 1 Sort -0.7, -2, -10, 754, 0.2 in ascending order. -10, -2, -0.7, 0.2, 754 Put 0, 2, -3222, 1, 262 in decreasing order. 262, 2, 1, 0, -3222 Sort -4, -3, 831, 4, 34, 1 in increasing order. -4, -3, 1, 4, 34, 831 Put 1/6, 0.2175885, -5 in increasing order. -5, 1/6, 0.2175885 Put -1522, -9199, -2 in ascending order. -9199, -1522, -2 Put 224966, 3, -38 in decreasing order. 224966, 3, -38 Put 2/9, -27, 66117, 0.5 in descending order. 66117, 0.5, 2/9, -27 Sort -5, -2, 4, -0.01125, 1, -0.4 in increasing order. -5, -2, -0.4, -0.01125, 1, 4 Sort 2, -16, 3, 9, -34, 7, -5 in increasing order. -34, -16, -5, 2, 3, 7, 9 Sort -4, -3, -0.348, 0.0264. -4, -3, -0.348, 0.0264 Sort 75, -3, 595 in decreasing order. 595, 75, -3 Put -9, -425, -4401, 1 in ascending order. -4401, -425, -9, 1 Sort -5, 92, 592249 in increasing order. -5, 92, 592249 Sort -2/55, 12, 529, 53. -2/55, 12, 53, 529 Sort 15, -5, -35451242 in descending order. 15, -5, -35451242 Put 4, -3, -43, 5, -934, 1, 0 in descending order. 5, 4, 1, 0, -3, -43, -934 Sort -5, 52, -87, 14, 17 in decreasing order. 52, 17, 14, -5, -87 Sort 2, 4, 3, -916202, 2/3 in descending order. 4, 3, 2, 2/3, -916202 Put -355, -3/4, 0.006891 in ascending order. -355, -3/4, 0.006891 Sort 13.8, -0.2, -93, -271 in increasing order. -271, -93, -0.2, 13.8 Put -1, -103901373, -5 in decreasing order. -1, -5, -103901373 Put -2, 145, -23, 3, 2 in increasing order. -23, -2, 2, 3, 145 Sort 0.5771, 0.75, 0.5, -4/3, 0.09 in decreasing order. 0.75, 0.5771, 0.5, 0.09, -4/3 Put 10, 244, 4074, -4 in descending order. 4074, 244, 10, -4 Sort 135, -6, 95 in ascending order. -6, 95, 135 Put 21, -3, -4, -1, 7, -5, -201 in descending order. 21, 7, -1, -3, -4, -5, -201 Put 5, -1, -3, -12, -4, 1270, 3 in decreasing order. 1270, 5, 3, -1, -3, -4, -12 Sort -5, -165, 4, -12, -20, 35 in increasing order. -165, -20, -12, -5, 4, 35 Sort -2/9, -0.5, 1/8, -1.33, 1299. -1.33, -0.5, -2/9, 1/8, 1299 Sort -1/1380, -2/11, 0.0392, 0.3 in increasing order. -2/11, -1/1380, 0.0392, 0.3 Sort 0.2, 14046, 2/27, 2/23. 2/27, 2/23, 0.2, 14046 Put -3, -12, 5, -1, 224, -6 in increasing order. -12, -6, -3, -1, 5, 224 Sort -29, 2/3, 74/35, 1, -2, -3/35 in increasing order. -29, -2, -3/35, 2/3, 1, 74/35 Sort -3, -4, -3537, 29, 0, 1 in descending order.	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.