Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
suming t is positive. t*(1/8) Simplify ((h(hh(-6)/h)/h)(9/8))(2/23) assuming h is positive. h(-27/46) Simplify ((d(2/9))(-1/7))45 assuming d is positive. d(-10/7) Simplify (((wwww4)/w)/w)/w(-1/13)(w(2/5))48 assuming w is positive. w(1578/65) Simplify (s/((ss(1/4))/s))35s7ss(-2/23)s assuming s is positive. s*(3235/92) Simplify (oo*1)/((o(ooo*(2/7))/oo)/o) assuming o is positive. o*(-2/7) Simplify (h(h/(hh(-1)/h)h)/h)*(-9/5)/((hh(-3/10))/(h(-9)h)) assuming h is positive. h(-141/10) Simplify (o1)(-2/47)/(o/(o5o)oo/o(1/3)) assuming o is positive. o(464/141) Simplify z/(zz(-22)/z)zz/(z/(z/z(-4/11))) assuming z is positive. z(279/11) Simplify c/c2cc(2/15)c((c(2/3)/c)/c)(-18) assuming c is positive. c(377/15) Simplify (q(-18))(2/3) assuming q is positive. q(-12) Simplify (f0)22/(f(-5)/(f/(f(-2)ff))) assuming f is positive. f6 Simplify (n(-6)/(n/(n(-3)/n)))/((n/(nn*(-7)n))/(n/(n/(nn/n(2/11))))) assuming n is positive. n(-167/11) Simplify u/u4u*(-1/2)((u*(-2/17)u)/uuu)/uu/u7 assuming u is positive. u(-293/34) Simplify ((l(1/2))(-2/59))(29/5) assuming l is positive. l(-29/295) Simplify i(-2/3)(i*(3/8)ii)/i assuming i is positive. i(17/24) Simplify k/(kk*6)kk(-25)kk assuming k is positive. k(-28) Simplify (p1)(11/7)/(p(-5)pp(-10)p) assuming p is positive. p(102/7) Simplify (((z(-30/13)/z)/z)/z)(-5/9) assuming z is positive. z(115/39) Simplify (ff2)(-17)(fff0)/f7 assuming f is positive. f*(-56) Simplify (h/(h/(hh/(h/((h/(h(-2/5)/h))/h)))))(-4/3)(h(2/3))(-30) assuming h is positive. h(-116/5) Simplify (o(-1/2)/o)2/(o(-4)o/(oo(1/3)o)o) assuming o is positive. o(4/3) Simplify g/g10gg/(gg*(2/23))g assuming g is positive. g(-163/23) Simplify f20f/f(-14) assuming f is positive. f35 Simplify (qq*39q)/q(-3/5) assuming q is positive. q(208/5) Simplify f/(f/(f/f*16))f6/f assuming f is positive. f(-10) Simplify (f*(1/16)/(fff(-3/5)f))(-18) assuming f is positive. f(1683/40) Simplify (((k/(k/k*(-1))k)/k)(-23))(-8) assuming k is positive. k(-184) Simplify o/(o(13/4)/o)oo/((oo(-18))/o)o assuming o is positive. o(79/4) Simplify (((i(1/4)i)/i)/((i/i(1/3))/i))/(ii/(i/(ii(-1)i)))(2/45) assuming i is positive. i(89/180) Simplify ((t(tt/t*(2/3)t)/t)/t)(3/5) assuming t is positive. t(4/5) Simplify ((u*(-4/7)/u)/uuu(-2/5))/(u/(u/(u(3/2)uu))uu(-7)) assuming u is positive. u(37/70) Simplify (o(-4/7)/o)(-18/11) assuming o is positive. o(18/7) Simplify x(-20/7)/(xx(-2/23)) assuming x is positive. x(-607/161) Simplify w*32/ww*(-18/13)w assuming w is positive. w(398/13) Simplify (v5)29 assuming v is positive. v145 Simplify (r/r(3/4))/(r(1/5)/r)r6/(rr/(r*(1/5)r)) assuming r is positive. r*(25/4) Simplify v/(vv*(-2/17))v(-25) assuming v is positive. v(-423/17) Simplify (k*(1/6)k*(-2/5)k)(-15) assuming k is positive. k(-23/2) Simplify (((z*(-2/7)/zz)/zzz)(-1))(2/85) assuming z is positive. z(-2/119) Simplify y(-6/11)y(-39) assuming y is positive. y(-435/11) Simplify ((l(3/7))(9/7))(2/23) assuming l is positive. l(54/1127) Simplify ((rr(-1))/r)(-2/153)/(rr1/rr)(-4/35) assuming r is positive. r(1294/5355) Simplify (l/(l/(l/((l/l*(-1/16))/l))l)ll(5/6))46 assuming l is positive. l(1955/24) Simplify (b(1/7)b/(b/(b/(b/(b/(b3b))))))/((bb(2/5))/b)(2/77) assuming b is positive. b(-1104/385) Simplify (g/(gg0))(-36/5)(g(-3)g)/(g*0/ggg) assuming g is positive. g(-3) Simplify (a(-1)/aa/a*1a)/((a/(a*(-3/4)aaa))/(a(a/a(-4/3))/a)) assuming a is positive. a(31/12) Simplify mmmmm(1/7)mmm*7(mmm*(1/9)m)/((mm/m5mm)/mm) assuming m is positive. m(1087/63) Simplify (j/j(-1))/j*(-1/5)(jj(1/3))(-3/17) assuming j is positive. j(167/85) Simplify z4/(z(-5)z)(z(-2/5))(-2/11) assuming z is positive. z(444/55) Simplify (l(4/7)/l1)/(lll6l4) assuming l is positive. l(-87/7) Simplify i12/i5 assuming i is positive. i*7 Simplify l/(ll*(14/11))l(-1/26) assuming l is positive. l(-375/286) Simplify (a*(-5/6)aa(3/8))/(aa/((a/a*(1/5)a)/a)aa(-8)/a) assuming a is positive. a(881/120) Simplify (p/((pppp(-1/3)/ppp)/p))(-42)/(p(3/4))20 assuming p is positive. p55 Simplify p27/pppp(1/5) assuming p is positive. p(141/5) Simplify o*(-2/7)o/o*(-1/12)(ooo(2/9))/o(-1) assuming o is positive. o(1013/252) Simplify (((q(-1/3)q)/q)/q)/(q(-8/9)/q) assuming q is positive. q(5/9) Simplify (k(1/3))(-3/23)/(k/((k/(kk*(-1/4)k))/k)kkk(-2/9)) assuming k is positive. k(-3785/828) Simplify ((kk/(k/(kk(3/7))k)k)/(kk(1/7)))/(k2/kk(2/9)) assuming k is positive. k(4/63) Simplify y(-6/11)/yyyy/(yy/y(-1))y assuming y is positive. y(-6/11) Simplify (x(-5/4)x(5/7)/x)(15/4) assuming x is positive. x(-645/112) Simplify ((x7/x)/(x(-1/6)x))(28/5) assuming x is positive. x(434/15) Simplify (d(d/(d(d/d*(2/7)d)/dd)dd)/d)(-6/31)/((d(-1/4)d)/d6) assuming d is positive. d(4509/868) Simplify ((x*(-2/9)/xx)/x(-2/19))(2/9) assuming x is positive. x(-40/1539) Simplify c2c7c(c/c(-2/7))/(cc*4c) assuming c is positive. c(37/7) Simplify (f6)3 assuming f is positive. f18 Simplify (i*(-3/11)ii(1/11))(1/45) assuming i is positive. i(1/55) Simplify n/n16n(-15) assuming n is positive. n(-30) Simplify (n*(-5)n)/n(n(-4)n)/nn(2/9)/n(-9) assuming n is positive. n(2/9) Simplify (yyy((yy(-30))/y)/y)(-26) assuming y is positive. y728 Simplify (y(2/3)y)(4/7)/(((y(1/4)/y)/y)/(y/(y(-1/2)/y))) assuming y is positive. y(437/84) Simplify (d/(dd(-6))ddd*0dd)/(d(2/13)/d(3/7)) assuming d is positive. d(935/91) Simplify ((d(1/3)/d)/dd)(4/3)/(d(-2/5)/d)21 assuming d is positive. d(1283/45) Simplify ((b(-2/7))(-46))(-50) assuming b is positive. b(-4600/7) Simplify ((((ww(-1/3)w)/w)/ww)/w)(-6/19)/(w(1/2))(18/7) assuming w is positive. w(-157/133) Simplify (u(-3)/u)/u(-23) assuming u is positive. u19 Simplify z8zz(2/13) assuming z is positive. z(119/13) Simplify (i/i(-5/7))41 assuming i is positive. i(492/7) Simplify (p/((p(-20)p)/pp))/(pp/((p(-2/95)/p)/p)) assuming p is positive. p(1518/95) Simplify (((h*3h)/hh)/(h9h))/(h*(-9)/(hh/(h/((hh(1/15)h)/h)))) assuming h is positive. h(76/15) Simplify (z/((z/z(-5))/z)z/(z/z0))/(z/z(-1))(-45) assuming z is positive. z86 Simplify ((b(1/2))22)(-1/3) assuming b is positive. b(-11/3) Simplify (qq*(1/2)q/(q/((q*(-3)q)/q)))(-2/77) assuming q is positive. q(3/77) Simplify h*(7/4)((h/(h*(-14)/h)h)/h)/h assuming h is positive. h(67/4) Simplify j(-5/2)/j(-19) assuming j is positive. j(33/2) Simplify k/(k*(-7)k)kk*(-4/5)(k/((k0/k)/k))(-24) assuming k is positive. k(-324/5) Simplify ((w(-1))12)(-41) assuming w is positive. w*492 Simplify (ss(-8))20 assuming s is positive. s(-140) Simplify d(-7/6)d(-21) assuming d is positive. d(-133/6) Simplify c(-12/5)c/c(-17) assuming c is positive. c(78/5) Simplify (o/(o*(1/6)o))/(oo(-7)oo)(o(-2/5))(16/7) assuming o is positive. o*(613/210) Simplify ((o((oooo(2/25)oo)/o)/oo)/o)(-31) assuming o is positive. o(-3162/25) Simplify o*(5/3)(o/(o/(ooo/o*(1/4)o)))/o assuming o is positive. o*(53/12) Simplify (((ppp6pp)/p)(11/4))(-35) assuming p is positive. p(-3465/4) Simplify z4z*(-5/3)zz/((z(-1/2)/z)/z)zzz(-2/11) assuming z is positive. z(571/66) Simplify (z(-11)/z)(-2) assuming z is positive. z24 Simplify (d(-2/11))(-3/2) assuming d is positive. d(3/11) Simplify (g(-2/29)/g)(-2/119) assuming g is positive. g(62/3451) Simplify (y/y(-1))29 assuming y is positive. y58 Simplify (y(-3/5))41 assuming y is positive. y(-123/5) Simplify (g(-3/2)g*(3/11	{ "pile_set_name": "DM Mathematics" }
composite number? False Is 28463 a composite number? False Is 6599 prime? True Is 25341 a composite number? True Is 597967 a composite number? False Is 5114 a prime number? False Is 230981 a prime number? False Is 105297 composite? True Is 41443 a composite number? False Is 246073 composite? False Is 446 prime? False Is 8513 composite? False Is 2609 a composite number? False Is 17809 composite? True Is 4007 a prime number? True Is 787197 composite? True Is 24733 a prime number? True Is 3943 a composite number? False Is 262897 prime? True Is 54709 a composite number? False Is 32173 prime? True Is 17783 composite? False Is 557 a composite number? False Is 1749529 prime? True Is 256429 a composite number? True Is 55073 composite? False Is 72521 composite? True Is 71047 a composite number? True Is 1476857 a composite number? False Is 118115 prime? False Is 2399 a composite number? False Is 26259 a composite number? True Is 528041 prime? True Is 5627 prime? False Is 393502 composite? True Is 175943 composite? True Is 356441 prime? True Is 186619 prime? True Is 1067 a composite number? True Is 1135757 a composite number? True Is 10403 a composite number? True Is 23105 a prime number? False Is 14203 a prime number? False Is 18453 a composite number? True Is 758 a prime number? False Is 7639 a prime number? True Is 275447 a composite number? False Is 6593 composite? True Is 18429 prime? False Is 3799 composite? True Is 161209 a prime number? False Is 45281 a composite number? False Is 400559 a prime number? True Is 88571 a composite number? True Is 7433 prime? True Is 12031 a prime number? False Is 82019 composite? True Is 157283 a composite number? True Is 6247 composite? False Is 5219 a composite number? True Is 1632559 a prime number? False Is 46439 a composite number? False Is 5639 a prime number? True Is 378127 prime? True Is 3181 a prime number? True Is 455303 prime? False Is 1511 a composite number? False Is 36911 prime? False Is 32313 a composite number? True Is 251281 a composite number? True Is 33101 a prime number? False Is 78359 a composite number? True Is 35831 a composite number? False Is 4819 a prime number? False Is 32407 a prime number? False Is 8141 a composite number? True Is 71633 a composite number? False Is 513829 a composite number? False Is 31751 prime? True Is 61871 a prime number? True Is 1003 composite? True Is 18617 prime? True Is 84191 a prime number? True Is 141409 a prime number? False Is 48383 composite? False Is 780473 a composite number? True Is 48079 a composite number? False Is 1954 a prime number? False Is 913058 a composite number? True Is 108041 a prime number? True Is 10477 prime? True Is 138055 prime? False Is 9643 a prime number? True Is 31303 prime? False Is 26947 prime? True Is 536695 a prime number? False Is 10007 prime? True Is 210437 prime? True Is 14954 a composite number? True Is 22315 a composite number? True Is 7031 a prime number? False Is 211 composite? False Is 329779 composite? False Is 247823 composite? True Is 2377087 composite? True Is 8509 a composite number? True Is 2927 prime? True Is 19315 composite? True Is 41219 a prime number? False Is 54517 a composite number? False Is 2453 a prime number? False Is 18857 prime? False Is 240101 a composite number? False Is 452759 composite? False Is 3793 composite? False Is 14369 a composite number? False Is 155251 a composite number? False Is 57983 prime? False Is 2209 prime? False Is 137209 a composite number? False Is 697303 a composite number? False Is 18107 a composite number? True Is 8951 a prime number? True Is 939553 composite? True Is 10849 a prime number? False Is 5779 a composite number? False Is 284629 composite? True Is 1793 prime? False Is 818561 composite? False Is 80611 prime? True Is 3803 a composite number? False Is 13511 prime? False Is 25151 a composite number? True Is 46 composite? True Is 371 a composite number? True Is 1007 a prime number? False Is 56629 composite? False Is 15727 a composite number? False Is 220538 a composite number? True Is 3269 prime? False Is 189077 prime? False Is 241861 a composite number? False Is 56839 composite? True Is 11777 composite? False Is 32411 prime? True Is 47251 prime? True Is 93257 a prime number? True Is 4762 prime? False Is 89151 composite? True Is 246443 composite? True Is 47471 a composite number? True Is 2613503 a composite number? False Is 110089 composite? True Is 39499 prime? True Is 14461 prime? True Is 460697 composite? False Is 186209 prime? False Is 252082 a composite number? True Is 105919 a composite number? True Is 259537 a composite number? False Is 17341 composite? False Is 97 composite? False Is 10183 prime? False Is 24901 composite? True Is 33377 a prime number? True Is 104827 a composite number? False Is 404941 prime? True Is 2659 prime? True Is 308755 prime? False Is 123343 composite? True Is 1363343 prime? False Is 5549 a composite number? True Is 563533 a composite number? True Is 82867 a prime number? False Is 112319 prime? False Is 491077 a prime number? False Is 6761 a prime number? True Is 376773 composite? True Is 28869 a composite number? True Is 101782 a composite number? True Is 251809 a composite number? False Is 31359 composite? True Is 3687 a composite number? True Is 288007 composite? False Is 155729 a composite number? True Is 335903 prime? False Is 12071 prime? True Is 2083657 a prime number? False Is 14273 a composite number? True Is 9851 prime? True Is 184111 a prime number? True Is 45703 prime? False Is 6127 a composite number? True Is 26661 a prime number? False Is 3694 composite? True Is 18439 a prime number? True Is 37279 a prime number? False Is 43573 a prime number? True Is 163973 prime? True Is 12941 a composite number? False Is 35063 a composite number? True Is 711163 a composite number? False Is 78133 a prime number? False Is 1716163 a prime number? True Is 871229 a prime number? True Is 614 a composite number? True Is 180871 a prime number? True Is 41721 composite? True Is 12179 a prime number? False Is 170567 a prime number? False Is 11983 composite? True Is 25523 a prime number? True Is 139597 a composite number? False Is 104459 a composite number? False Is 5531 a composite number? False Is 7283 a composite number? False Is 13201 a composite number? True Is 1793 prime? False Is 5347 composite? False Is 1931 composite? False Is 200569 prime? True Is 1492133 a prime number? True Is 2594859 prime? False Is 246877 prime? False Is 146501 composite? True Is 166189 composite? False Is 400429 a prime number? True Is 2591363 a composite number? False Is 37319 prime? False Is 11391 prime? False Is 1495679 a composite number? True Is 587 prime? True Is 129097 a prime number? True Is 189263 a prime number? False Is 84377 composite? False Is 138353 composite? True Is 17201 a prime number? False Is 198539 composite? True Is 161183 composite? True Is 65371 a prime number? True Is 140297 a composite number? False Is 778 prime? False Is 3937 a composite number? True Is 6899 a composite number? False Is 4049 prime? True Is 1117 prime? True Is 562181 prime? True Is 261977 a composite number? False Is 2939 prime? True Is 25031 prime? True Is 5194183 prime? False Is 478603 composite? False Is 14461 prime? True Is 5639 a prime number? True Is 47189 a prime number? True Is 746851 a prime number? False Is 89743 composite? True Is 259117 prime? False Is 21653 composite? True Is 3313 a composite number? False Is 9565 composite? True Is 262645 prime? False Is 1597 a composite number? False Is 136771 composite? True Is 336757 composite? False Is 13911 a prime number? False Is 34399 prime? False Is 107611 prime? False Is 826651 a prime number? False Is 2103 a prime number? False Is 178681 prime? True Is 80167 composite? False Is 39049 composite? True Is 281419 composite? False Is 8794 a composite number? True Is 800849 a prime number? False Is 57089 a composite number? False Is 79171 a composite number? True Is 749 a prime number? False Is 221873 prime? True Is 58207 composite? False Is 41353 a composite number? True Is 7631 a prime number? False Is 1514 a composite number? True Is 57898 composite? True Is 434197 composite? True Is 26203 composite? False Is 81521 prime	{ "pile_set_name": "DM Mathematics" }
ative of r5/30 + r4/4 + 5r3/6 + 54r*2 - r. Give q(w). 13 Let t(n) be the third derivative of -7n*6/40 + 113n2. Calculate t(-1). 21 Let f(z) = z2 - 5z - 5. Let u be f(6). Let y be (-5)/((-4)/8 + u). Let m be (-56)/y + 24/(-40). Let p(b) = -b2 + 2b + 7. What is p(m)? -8 Suppose -4k + g + 17 = 0, -2g - 25 = 3g. Let f(w) be the second derivative of w5/20 - w4/4 + w3/6 + 3w*2/2 + w. Calculate f(k). 6 Let n(x) be the second derivative of 1/6x*3 + 0 - 4x + 7/2x2. What is n(-5)? 2 Suppose 193w + 51 = 176w. Let p(a) = -a2 + a + 1. Calculate p(w). -11 Let s(f) = -4f + 4f + 2f + 3 - 3f. Calculate s(-9). 12 Let k(b) = 59b - 110b + 53b - 6. Determine k(6). 6 Let p(d) = 4d + 4. Let a(i) = 5i - 28. Let z be a(5). Give p(z). -8 Let i(t) = t - 6. Let k = 26 + 34. Suppose 0 = -0h - 10h + k. Determine i(h). 0 Let x(b) = -b - 3. Let z be ((-38)/(-6))/((-1)/3). Let u = z + 35. Suppose -4g - u = 4. What is x(g)? 2 Let n(a) be the first derivative of -a3/3 - a2 - a + 18. Let o(z) = -3z + 7. Let v be o(4). Give n(v). -16 Suppose 35 = 2h + 3h. Let k(f) be the third derivative of f6/120 - f5/10 - 3f4/8 - 2f3/3 + f2. What is k(h)? -18 Let f(y) = -2y + 5. Let r = 125 + -112. Suppose -4k + 3 + r = 0. Determine f(k). -3 Let c(w) = 3 - 53w + 1 + w2 + 48w. Calculate c(6). 10 Let o(s) = s + 1. Let j = 49 - 54. Let r(h) = 9h + 8. Let t(a) = jr(a) + 40o(a). What is t(1)? -5 Let p(i) = -92 + 10i - 2i + 86 - i2. Let d be (-3)/1 + -4 + 13. Give p(d). 6 Let u(l) be the first derivative of -6l - 9 - 1/2l2. Determine u(0). -6 Let o(n) = -n3 - n + 90n*2 - 3n - 187n2 + 104n*2 + 6. What is o(6)? 18 Let k(y) = 7y + 1. Let w(f) be the second derivative of 9f + 2f*2 + 2/3f*3 + 1/12f*4 + 0. Let x be w(-3). What is k(x)? 8 Let u(a) = -2a + 2a - 3a. Let o(f) = -3f - 17. Let c be o(-8). Suppose c = -3g - 2s, 0s = 2g - s - 7. What is u(g)? -3 Suppose -3c - 11 = 7. Let n(x) = -1. Let z(u) = -3u + 3. Let t(r) = cn(r) - z(r). Let a(q) = -q*3 - 8q*2 + 20q - 4. Let h be a(-10). Calculate t(h). -9 Suppose -33 = 16q + 31. Let h(z) = 2z*2 - 7z + 5. Let f(b) = 3b2 - 8b + 6. Let w(a) = 3f(a) - 4h(a). Give w(q). -2 Let n = 4 - 4. Suppose -5l - 21 - 19 = n. Let x be (-18)/(-8) - (-2)/l. Let u(c) = -c2 + 2c + 1. What is u(x)? 1 Let s(d) = -36d + 50d - 12d + 3. Suppose q + 3 = g, -6q = -2q - 4. Calculate s(g). 11 Let n(p) = p - 17. Suppose 2m - 101 = -3m - 4y, -1 = -m + 4y. Determine n(m). 0 Let r(m) = -m - 23. Suppose 4p - 23 = -23. What is r(p)? -23 Let h(d) = 2d2 - 22d + 36. Let t(j) = -5j2 + 67j - 107. Let u(w) = 8h(w) + 3t(w). Calculate u(-26). -7 Let v(f) be the second derivative of -f5/20 + f4/6 + 7f3/6 + f2/2 - 2f - 11. Determine v(4). -3 Let t(c) be the first derivative of 5/12c4 - 1/2c*2 - 1/3c*3 + c + 2. Let l(u) be the first derivative of t(u). Give l(-1). 6 Let j(h) = 334h*2 + 21 + 5h - 15h - 335h*2. Determine j(-12). -3 Let a(l) = -4l*3 - 6l*2 - 8l + 4. Let p(m) = 3m3 + 5m*2 + 6m - 3. Let y(h) = -4a(h) - 5p(h). Give y(1). 1 Let t(v) = v2 + v + 2. Let z(o) = -o3 - 2o2 - 2o - 1. Let i(k) = 2t(k) + z(k). Calculate i(0). 3 Let p(a) = a + 47. Let t(b) = -24. Let o(r) = 3p(r) + 5t(r). What is o(-5)? 6 Let w(r) be the third derivative of r6/120 + 7r5/60 + r4/6 - 4r3/3 + 3r2. Let v(u) = u3 - 12u2 + 21u - 16. Let y be v(10). Determine w(y). 4 Suppose -3c - 55 = -4y, 5c + 3y = -46 - 7. Let a(h) = h*2 + 13h - 17. What is a(c)? -17 Let c(x) = x - 6. Let h(s) = 5s2 + 7s + 1. Let r be ((-14)/10)/1 + 6/(-10). Let a be h(r). Give c(a). 1 Let y(q) = -q*2 - 12 - 79q + 17q + 16q + 18q + 16q. Give y(-8). 20 Let p(c) be the second derivative of -c*3/6 + 4c*2 - 47c - 2. Give p(8). 0 Let y(i) = -7i3 + 10i*2 - 4i - 3. Let n(h) = -11h3 + 15h*2 - 6h - 5. Let j(x) = -x + 5. Let a be j(10). Let f(g) = an(g) + 8y(g). Give f(3). 13 Let y(b) = b*2 + b. Let x be y(-3). Let d(h) = 43h*2 - 18h2 + 3 + 0 - h3 - 19h2. Give d(x). 3 Let z(l) be the second derivative of 0 - 2l + l*3 + 1/12l*4 - 9/2l*2. Suppose -5a + 3x = -3a + 26, x = 2a + 18. Give z(a). -2 Let n(i) = -10 - i2 + 172i - 185i + 3 + 11. Give n(-13). 4 Suppose 17 - 1 = -a. Let r = -21 - a. Let g(q) = q + 3. Calculate g(r). -2 Let z(v) = v3 + 17v*2 - 20v - 43. Let t be z(-18). Let n(p) be the second derivative of -p*3/6 - 6p. What is n(t)? 7 Let v(k) = k*2 - 4k + 3. Let f be v(2). Let y be 2/(-10)(1 + -11). Let g(a) = 6a*2 - 3a + a*y + 3a. Calculate g(f). 7 Let o(w) = -6w3 - w2 + 5w + 2. Let q(c) = c3 + c2 - c. Let r(x) = -o(x) - 5q(x). Let t = -6 - -8. What is r(t)? -10 Let u(r) = -1 + 3r - 5r + 2. Suppose 1 - 6 = g. Let s = g + 6. Determine u(s). -1 Let d(t) = -t2 - 2t + 1. Let m(b) = -6b2 + 2b - 3. Let j be m(1). Let o be -3 - j - (-1 - -2). Suppose h + 7 = c + c, h = oc - 10. What is d(c)? -14 Let t(a) = 4a - 5. Let k(c) = -3c + 11. Let m(s) = -4k(s) - 9t(s). Give m(1). -23 Let j(h) = -h2 - 4. Suppose -3r - 5t = -29, 5r + 17t = 13t + 31. Calculate j(r). -13 Let r(p) be the second derivative of -p5/60 + p4/8 + 2p3/3 - 17p*2/2 - 15p. Let v(q) be the first derivative of r(q). What is v(5)? -6 Let z(c) = c*3 + 6c2 - 1. Let y(f) be the first derivative of f4/2 + 13f3/3 - f2/2 - 2f - 17. Let g(h) = 2y(h) - 5z(h). Determine g(-2). -3 Suppose -23 = -4y - b, 0y - 3b + 9 = 2y. Let j(x) = x*2 - 2x*2 + 3 + yx + 3. Let f be (-26)/41380/(-1495). Determine j(f). 6 Let n(z) be the second derivative of -z4/6 + 7z*3/6 + 9z2/2 - z + 1. Calculate n(5). -6 Let i(r) = -r3 + 3r2 + 4r. Suppose 0 = -3s + 8 + 7. Suppose sm = -4m + 27. What is i(m)? 12 Let z = -4 - -6. Let r(h) = 4h*2 + h. Let j(u) = 4u*2. Let p(a) = -4j(a) + 3r(a). Calculate p(z). -10 Suppose 20 = 62x - 64x. Let u(i) = i2 + 10i - 4. What is u(x)? -4 Let w(y) be the second derivative of y*4/12 - 11y3/6 + y2/2 - 21y. Let x(f) = 2f*2 - 23f + 2. Let p(b) = 13w(b) - 6x(b). What is p(6)? 7 Let q(y) = -y*2 + 12y - 16. Suppose -4d + 4 = 5s, -3d - 8 = -4s + 5s. Suppose s = -i, -2i = -5n + 3i + 75. Give q(n). -5 Let w(m) = 2m2 + m - 2. Let i(p) be the second derivative of -p5/20 + p4/4 + 4p*3/3 + 4p*2 + 42p. Let y be i(5). Give w(y). 4 Let y(o) be the first derivative of -2o3/3 - 5o*2/2 - 4o - 141. Determine y(-3). -7 Let s be (-9)/2 + 2/(-4). Let z = 8 - 2. Let d(k) = 17k2 + k3 - 6 - 6k*2 - zk2 - k. What is d(s)? -1 Let j(y) = y3 - 2y2 - y + 3. Let f = 142 - 139. Give j(f). 9 Let w(b) = b3 - 7b*2 + 6b + 4. Let t(h) = -h*3 + 16h*2 - 46h - 18. Let l be t(12). Calculate w(l). 4 Let x(y) = -4y - 5. Let o(d) = 5d + 8. Let k(z) = -3o(z) - 4x(z). Let p(v) = -v - 3. Let g be p(0). Calculate k(g). -7 Let n(h) = -3h - 5. Let s be -7 - 126/(1 - 10). What is n(s)? -26 Let z(d) be the second derivative of d5/20 + 5d*4/12 - 2d*3/3 + 5d*2/2 - 2d. Suppose 5o + 34 = -371. Let r = o + 75. Determine z(r). -7 Let n(k) = k2 - k - 4. Let x = -7 - -4. Let z(w) = w + 6. Let p be z(x). Determine n(p). 2 Let p(g) = -9 + 3g + 4 + 5g + 0g + 3. Calculate p(3). 22 Suppose 0 = 3s - 5x + 50, -5s - 4x + 2x - 73 = 0. Let w be ((-1)/3)/(5/s). Let v(l) = l2 - l3 + 2 - 2. What is v(w)? 0 Suppose 0 = j + 6 - 9. Let f(y) = 4y2 + 15 - 9 - 3 - y - y - y3. Give f(j). 6 Let r(v) = -v*2 + 6v + 6. Let x be (-6)/120/(-2). Suppose 18 = 6q - xq. Suppose y - 18 = -2f - 2y, -qy - 6 = -2f. Determine r(f). 6 Suppose -3z + 6z = -12. Let k(n) = n2 - 4n - 4. Let o(d) = -d*2 + 4d + 5. Let y(q) = zo(q) - 3k(q). Calculate y(6). 4 Let o = -168 - -173. Let x(f) = 2f3 - 11f*2 + 5f + 7. What is x(o)? 7 Let c(h) = 3 + 4h + 22h*2 - 31h*2 + 4h*2. Give c(-2). -25 Let m(l) = -2l*3 - 11l*2 - 16l - 8. Let y be m(-4). Let c(t) be the second derivative of -t*3/6 + 11t*2/2 + 3t. Calculate c(y). 3 Let a(z) = 2z2 + 7z + 5. Suppose 5j - 129 = 4o, -o = -j - 4 + 29. Suppose 0 = 5n + j - 9. Calculate a(n). 9 Let y(t) be the second derivative of t4/12 + 3t*3/2 + 7t*2/2 + 4t - 27	{ "pile_set_name": "DM Mathematics" }
(g) = 56g3 - 22g*2 - 4g + 5. Let l(t) = -6h(t) - 5z(t). What is the third derivative of l(n) wrt n? -306 Suppose -80 = k - 5k + 5w, k = -3w + 3. What is the second derivative of -19f*3 - 17f - kf3 + 12f wrt f? -204f Let t(c) = -c2 - 6c + 10. Let j be t(-7). Find the second derivative of 0a3 - 5a*3 - 5a - 3aj wrt a. -48a Let l(d) be the first derivative of -3d4/4 - 247d*2/2 - 57d + 355. What is the derivative of l(s) wrt s? -9s2 - 247 Let i(u) be the second derivative of 17u*6/720 + 7u*5/120 + 7u*4/3 - 3u. Let m(j) be the third derivative of i(j). What is the derivative of m(w) wrt w? 17 Let r(s) be the first derivative of 13s6/3 + s5/5 - 75s*2/2 + 56. What is the second derivative of r(i) wrt i? 520i*3 + 12i*2 Find the second derivative of 27773 + 22b*4 + 3b + 47b4 - 27772 wrt b. 828b*2 Let i be 98/10 - (-12)/(-15). Let z be (-2)/i(-6 + -3). What is the third derivative of -6v5 + 0v*2 + 4v*2 + 2v*z wrt v? -360v*2 Suppose h = -2c - 59, -3c + 4h = h + 75. Let b = -6 - c. Find the third derivative of -4o5 + 4o*5 + 25o2 + o6 - bo2 wrt o. 120o*3 Let i be 2/(-9) + 22/18. Let j(x) = -7x + 29. Let h be j(4). What is the derivative of -10 + h + 2t4 + i wrt t? 8t3 Let r(x) be the second derivative of -x7/42 + 5x3/6 - x2 - 12x. Let k(z) be the first derivative of r(z). Find the first derivative of k(s) wrt s. -20s3 Let k(j) = -2396j*2 + 1355j + 80. Let f(p) = 799p2 - 452p - 30. Let o(w) = -8f(w) - 3k(w). Find the second derivative of o(u) wrt u. 1592 Find the third derivative of 3t - 4t + 104t6 - 50t*6 - 2t*2 wrt t. 6480t*3 Let f(u) be the first derivative of 0u - 3 + 0u3 - 7/2u2 + u5 + 0u4. What is the second derivative of f(h) wrt h? 60h*2 Let n(j) = 838j*3 - 17j*2 + 54. Let u(z) = 1256z*3 - 25z*2 + 81. Let q(g) = 7n(g) - 5u(g). Find the third derivative of q(f) wrt f. -2484 Let x(q) = 3q*2 + q - 3. Let v be x(-2). What is the second derivative of 41w - 8w2 + 0w2 + w2 - vw2 wrt w? -28 Let i(t) be the first derivative of -t6/6 + 23t*5/60 - 35t*2/2 - 5. Let b(j) be the second derivative of i(j). Find the third derivative of b(a) wrt a. -120 Let c(w) be the first derivative of -121w*4/4 + 42w + 105. Differentiate c(f) with respect to f. -363f2 Let q(l) = 683l*2 - 931l + 12. Let v(d) = -2048d2 + 2794d - 40. Let p(m) = 10q(m) + 3v(m). Find the second derivative of p(u) wrt u. 1372 Let s(g) = -g*2 - 12g + 3. Let d(i) = -i - 12. Let f be d(0). Let h be s(f). What is the derivative of -3j - h + 6 - 11 wrt j? -3 Let n(m) be the first derivative of -23m*5/5 + 3m*4/4 + 58m*3/3 - 309. Find the third derivative of n(q) wrt q. -552q + 18 Find the second derivative of -41r2 - 25r*2 + 429r - 527r wrt r. -132 Suppose -3g - 90 = -5w + 2g, -4w = 2g - 54. Find the second derivative of -93p + 59p - 15p3 - wp*3 wrt p. -180p Let o(x) be the first derivative of 79x5/5 - 14x*3 - 3x*2/2 - 210. Find the third derivative of o(z) wrt z. 1896z Let q(l) = 6 - 6l3 + 9l*4 + 7l*3 - 3 + 6l3. Let c(j) = -j4 - j*3. Let g(v) = 14c(v) + 2q(v). What is the first derivative of g(w) wrt w? 16w*3 Differentiate -4s*2 + 115 - 61s + 0s2 + 48s wrt s. -8s - 13 Let u(h) = 40h*3 - 58h2 + 3. Let a(o) = -o2 + 1. Let d(j) = -6a(j) + 2u(j). Find the third derivative of d(r) wrt r. 480 Let d(a) = a + 5. Let k be d(-16). Let h(m) = m*3 + 10m*2 - 12m - 10. Let u be h(k). Find the first derivative of -3n3 - 2n*3 - 5 - 3n*3 + u wrt n. -24n*2 Suppose 0n - 2g + 4 = n, -3g = 5n - 27. What is the third derivative of -30t + 4t2 + 28t*n + 30t wrt t? 3360t3 Let k(x) be the third derivative of -13x*5/12 + 47x*4/24 - 5x*2 + 55x. Find the second derivative of k(i) wrt i. -130 Let a(u) = -453u2 + 405u - 9. Let k(o) = -1357o2 + 1214o - 24. Let l(b) = -8a(b) + 3k(b). What is the second derivative of l(i) wrt i? -894 Suppose -1 = -r - p, r - 3 = 2p - p. Suppose -3j = -rj - 2. Find the third derivative of -3v*2 + 5v*5 + 3v*6 - 3v*j - 5v*5 wrt v. 360v*3 Let r(t) = 493t*2 - 2t + 726. Let g(q) = -489q2 + 3q - 727. Let h(s) = 2g(s) + 3r(s). Differentiate h(w) wrt w. 1002w Let p be ((-4)/10)/((-1)/20). Let d be (-24)/5(-330)/99. Find the third derivative of -py2 + 16y - dy + 0y*5 - 5y*5 wrt y. -300y*2 Differentiate -38p*2 + p + 38p*2 - 103 - 32 - 21p*3 wrt p. -63p2 + 1 Let y(v) be the first derivative of v6/20 - v*5/6 + 5v*2 + 2. Let x(t) be the second derivative of y(t). What is the third derivative of x(s) wrt s? 36 Let u be (-2)/6 + (-2)/(-6). Suppose 2c = -x - 2x + 1, u = 2x - 4c - 22. What is the derivative of 0s*x - 2s*3 + 6 + 3s*3 wrt s? 3s*2 Let v(b) be the third derivative of -17b6/30 - b4/4 + b*3/6 - 19b*2 + 3b. What is the second derivative of v(a) wrt a? -408a Let o(c) be the third derivative of -11c6/60 + c4/8 + 11c3/3 + 24c*2. What is the derivative of o(d) wrt d? -66d*2 + 3 Let u be (12 + -11)/(1/5). What is the third derivative of ut*2 - 16t*3 - 3t2 + t2 wrt t? -96 Find the second derivative of -3 - 410n2 - 129n - 448n2 + 2n*4 + 890n*2 wrt n. 24n*2 + 64 Find the third derivative of -49u*2 + 233u*4 + 28u*2 - 2u*3 - 706u*4 wrt u. -11352u - 12 Let a(n) be the second derivative of -100n3/3 + 85n2 + n - 2. Differentiate a(s) wrt s. -200 Let v(u) = -u3 - 2u - 1. Let k(l) = -60l*3 - 4l + 61. Let r(z) = k(z) - 2v(z). Find the first derivative of r(y) wrt y. -174y*2 Let n be (5 - 52/12) + (-4)/6. Let l(r) be the second derivative of -3r + n - 3/2r2 - 5/6r3. Find the first derivative of l(g) wrt g. -5 Let u(s) = -s3 - s*2 - s + 42. Let k be u(0). What is the first derivative of -13 + 46t*2 - 3 - kt*2 wrt t? 8t Suppose -7 + 1 = -2d. Find the first derivative of 6 - d + 49p*2 - 40p*2 wrt p. 18p Let z(w) be the second derivative of w*6/15 - 2w*3/3 + 13w*2 + 100w. Differentiate z(y) with respect to y. 8y3 - 4 Let k(s) = 22s*2 - 52s - 12. Let o(z) = -22z2 + 52z + 15. Let h(m) = 5k(m) + 4o(m). What is the second derivative of h(v) wrt v? 44 Let k(s) be the second derivative of 269s5/20 - 143s4/3 - s3/3 - 719s. What is the third derivative of k(l) wrt l? 1614 Let q(j) be the second derivative of j6/45 + j5/15 + j3/3 - 6j. Let f(y) be the second derivative of q(y). What is the second derivative of f(u) wrt u? 16 Let x(s) be the second derivative of -211s4/3 - 439s*2/2 - 3s - 11. Differentiate x(p) with respect to p. -1688p Let t(x) = 73x*3 - 10x + 7. Let w = 96 - 91. Let n(b) = 49b3 - 7b + 5. Let i(j) = wt(j) - 7n(j). Find the second derivative of i(s) wrt s. 132s What is the second derivative of 2q + 282q3 + 25q*3 - 3620 + 3606 wrt q? 1842q Let j be 14 + -1 - (-5)/15-9. Find the second derivative of 4o*4 - jo - 4o + 39o wrt o. 48o2 Differentiate 42 - 4h + 125h2 + 5h + 10 + 14 with respect to h. 250h + 1 Let r be ((-2)/15)/(-10 + 2). Let o(q) be the third derivative of 7/24q*4 + 0q*3 - rq*5 + 0q + 0 - 5q2. Find the second derivative of o(g) wrt g. -2 Suppose -2m + 12 - 4 = 0. What is the second derivative of 82q2 - mq + 6q3 - 8q - 82q2 wrt q? 36q Let w(k) = -5k2 - k. Let z(r) = -331r*2 - 4r - 42. Let v(m) = -3w(m) - z(m). Find the second derivative of v(f) wrt f. 692 Suppose -5w = -g - 0g - 12, 4w - 6 = 2g. Suppose 0c + 9 = -3c, -c = -z + 6. Differentiate 3mz + 4 + 2 - mg - 4m3 with respect to m. -6m*2 Suppose 2s = 3q + 30, -3q = 4s - s - 30. Let p be ((-8)/s)/(2/(-6)). Find the second derivative of -v2 - vp - 8v + v*2 + 4v wrt v. -2 Let q(r) be the first derivative of r*6/6 - 12r*3 - 38r*2 - 22. Find the second derivative of q(o) wrt o. 20o*3 - 72 Let n be ((-30)/(-2) - 0)/((-51)/(-85)). Differentiate -n + 7y + 11y + 7y - 5y with respect to y. 20 Let h(u) = -26u - 32. Let v(r) = -1. Let o(f) = -h(f) - 4v(f). Let a(p) = 25p + 35. Let x(k) = -4a(k) + 3o(k). What is the first derivative of x(d) wrt d? -22 Let u(q) be the second de	{ "pile_set_name": "DM Mathematics" }
f) -1/3 (g) -0.0362 g What is the fourth smallest value in -1/3, 2/33, -249, 4, -699? 2/33 Which is the third smallest value? (a) -110 (b) -0.08 (c) 4 (d) 0 (e) 22 d What is the fourth smallest value in 0.5, -22/69, -21.51, -3, 0.2? 0.2 What is the second smallest value in -65.594, 0.12, -89? -65.594 Which is the seventh biggest value? (a) 1/7 (b) -1.6 (c) -3 (d) 0.1 (e) -2/17485 (f) 5 (g) -4 g What is the third biggest value in 2, -248/7, -18/71, 3, 5/4? 5/4 What is the second smallest value in 12710, 38/7, 70? 70 What is the third biggest value in -31.7, 2/121, -102? -102 What is the third biggest value in -2/3, 2, 0.68, 1, 303? 1 Which is the biggest value? (a) -17303 (b) 4251/8 (c) 0.3 b Which is the second biggest value? (a) 1025 (b) -5 (c) 292 (d) -2 c Which is the fourth biggest value? (a) 2/3 (b) 5 (c) 0.1 (d) 11 (e) -28 (f) -13/18 c Which is the smallest value? (a) 2/3 (b) -5 (c) -4 (d) -401 (e) 84 d What is the smallest value in 2/13, -0.2, -0.4, 0.1, -2/13, 5, -8356? -8356 Which is the biggest value? (a) -11 (b) 3 (c) 281241 c Which is the second biggest value? (a) -1.5 (b) -398 (c) 1/9 (d) 4 (e) -30 c What is the biggest value in -17, -1, 0.0204, -0.0836, 1/11? 1/11 Which is the fourth biggest value? (a) -2/7 (b) 54 (c) 0.2 (d) 42/283 a What is the second biggest value in 0.8, -161, -4/23? -4/23 Which is the biggest value? (a) 0.4 (b) -3/2 (c) 60/59 (d) -1 (e) 3/2 (f) -11/15 e What is the fourth biggest value in -1.6, 64, 2, -2/3, 840? -2/3 Which is the seventh biggest value? (a) -0.3 (b) 3 (c) -2/3 (d) 0.4 (e) 0.2 (f) 29/241 (g) 3/8 c What is the second biggest value in -6/391, -0.1, -2/3, -0.5, 0.059, -2? -6/391 Which is the fifth smallest value? (a) 29 (b) 6 (c) -0.3 (d) -3 (e) -1 (f) 5/11 (g) 1/46 f What is the fifth biggest value in -1715, -4, 3, 1151, -2? -1715 Which is the fifth biggest value? (a) 1/6 (b) 0.52 (c) -591 (d) -5 (e) -4/3 (f) 0 d What is the second biggest value in 0.12, 1, -13, 28682? 1 Which is the second biggest value? (a) -9.4407 (b) 0.0772 (c) 5 b What is the second smallest value in -43, 0, 5, -167, -0.4? -43 What is the smallest value in -24/7, 78/605, -0.1, 2/3, 1/4, -0.4, -2? -24/7 Which is the third smallest value? (a) 5 (b) -1/1609 (c) -60 (d) 4/7 (e) 1/3 e Which is the seventh smallest value? (a) -3.6 (b) 1 (c) 2/7 (d) 4 (e) 1/13 (f) 0.4 (g) -1/2 d What is the second biggest value in -0.17, 55.53, 4, 0.2? 4 Which is the seventh smallest value? (a) 29281 (b) -5 (c) -1/9 (d) 1/9 (e) 1 (f) -2/11 (g) -0.02 a What is the second biggest value in -75, -2/7, -0.0685565? -2/7 Which is the third biggest value? (a) 5475023 (b) -1/4 (c) -0.2 b Which is the second biggest value? (a) -3 (b) -1462 (c) -0.3 (d) 8.247 c Which is the fourth smallest value? (a) -1 (b) 0.02 (c) -2 (d) 18 (e) -5 (f) -1/17 (g) 0.2 f Which is the second smallest value? (a) 67 (b) -2 (c) -3 (d) -5 (e) 0.8757 (f) 0.5 c What is the biggest value in -5, 0, -11, 4, 612? 612 Which is the smallest value? (a) -12569 (b) -0.5 (c) 4/7 (d) -0.18 (e) 0.3 a Which is the third biggest value? (a) -0.3 (b) -2 (c) -139 (d) -2336/5 c Which is the third biggest value? (a) 23293 (b) -0.016 (c) -3 c What is the smallest value in -2696, 2/331, 10, -0.5? -2696 What is the sixth smallest value in -9, 823, 1, 6, 1/18, -1/3? 823 What is the second smallest value in -0.1, -8, 27, -3, 15, -58, 3/4? -8 Which is the sixth biggest value? (a) 0.2 (b) -7/2 (c) -2/7 (d) 0.4 (e) 0.51646 (f) -2 b Which is the smallest value? (a) -0.058 (b) -4/3 (c) 0.2 (d) 842 b What is the fifth smallest value in 6/5, 11, 1/2, -27.3, 12? 12 What is the fourth biggest value in 0.51, -0.4, -2, -6, -7? -6 Which is the fourth biggest value? (a) -2 (b) 0.20802 (c) 9 (d) 2 a Which is the smallest value? (a) -8 (b) 3301 (c) -2/17 (d) -128 d What is the smallest value in 0.8, -1/15710, -2/7, -2? -2 What is the biggest value in 5, 1.15205, 2/3, -0.13? 5 Which is the fifth biggest value? (a) 6/7 (b) 27 (c) 1/66 (d) -1 (e) -4 (f) -1/5 (g) -7 d Which is the fourth smallest value? (a) -0.5 (b) -33/4 (c) 11 (d) -2.57 (e) -0.2 e Which is the biggest value? (a) -1 (b) 4 (c) -0.03 (d) 271 (e) -43/17 d What is the third smallest value in 21.94, -4, 9, 15? 15 What is the biggest value in -1/18, 1.13, 4063? 4063 What is the third biggest value in 1.8, 5.233, -92, 1? 1 Which is the seventh smallest value? (a) -0.5 (b) 1/4 (c) 1/10 (d) -3471 (e) 4 (f) -3/2 (g) -3 e Which is the smallest value? (a) -103 (b) 0.136 (c) 1 a Which is the sixth smallest value? (a) -0.4 (b) -2 (c) 5 (d) -2/7 (e) 961 (f) 0.1 e Which is the smallest value? (a) -3/2 (b) -3 (c) 1 (d) -21 (e) 4 (f) 43.2 (g) 0.5 d What is the third biggest value in 3, 0.12, -21157? -21157 Which is the second smallest value? (a) -76/137 (b) 1/2 (c) 4342 b Which is the second smallest value? (a) -5 (b) 0.09 (c) 3.23 (d) 14 (e) 63 (f) -3 f What is the third smallest value in -19/5, -2, 2, 13.3287, 1/6? 1/6 Which is the second smallest value? (a) -2.3 (b) -3.353 (c) 424 a What is the fourth biggest value in -2/23, 377, 0.13, 4, -0.4, -2/75, 0? 0 Which is the fourth smallest value? (a) -1 (b) 791 (c) 51/5 (d) -7.49 b What is the second smallest value in 0.4, 1/7, 0.032, 0, 3? 0.032 What is the smallest value in -53, -670, 0.2, -4, 0.034? -670 Which is the second biggest value? (a) 32 (b) -5 (c) 41 (d) 4/59 a Which is the sixth smallest value? (a) 0.06 (b) 1306 (c) 3 (d) 0.84 (e) -5 (f) -0.03 b What is the sixth smallest value in -16, -0.5, -4, -186, -3, 0.4, -23/2? -0.5 Which is the smallest value? (a) 9 (b) 523 (c) -2/557 c What is the third biggest value in -33, -1.77, -6859? -6859 What is the seventh smallest value in 2, -4/5441, 0.1, -23, 0.5, 0.2, -1/4? 2 Which is the fourth biggest value? (a) 53.94 (b) -6 (c) 1/2 (d) -1 b What is the second smallest value in -93, 29332, -2? -2 What is the smallest value in -14, 2, 10.528? -14 What is the second biggest value in 3/5, 2/29, -2/5, -29, 2, 0.4, -51? 3/5 Which is the third biggest value? (a) 0.33 (b) 1/4 (c) -3 (d) 19 (e) 0.5 (f) 594 e Which is the fifth smallest value? (a) -4/3 (b) 1/3 (c) -77/37 (d) -5 (e) 0.2 (f) -207 (g) -4 a What is the smallest value in -1, -1/3, -0.11, 5, 34171? -1 What is the second biggest value in 3, -2, -2/5, 185754, 0.4, 11/5, 4? 4 What is the third smallest value in 1, 26/6937, -0.2, 0.43, 3/2, -3/4, -3? -0.2 What is the second smallest value in -0.2, -0.12056, -6346, 0.3? -0.2 Which is the third smallest value? (a) -45 (b) -0.11 (c) 10881/8 (d) -0.4 (e) -0.3 (f) -1/6 (g) 0.4 e What is the third biggest value in -5, -3597, -2, 103? -5 Which is the smallest value? (a) 456 (b) 0.0367 (c) -3 (d) -0.3 c Which is the smallest value? (a) 118.7 (b) 0.2 (c) -0.054 (d) 2/7 c Which is the second biggest value? (a) 2.4 (b) -175 (c) 3 (d) -1/3 (e) 2/5 (f) -3/5 (g) 2/9 a What is the biggest value in -23/178, -0.082, -2, -0.07? -0.07 Which is the smallest value? (a) -1/3 (b) -0.4 (c) 36 (d) 0.4 (e) 1 (f) 3 (g) -0.082 b Which is the fourth biggest value? (a) 1.145 (b) -5/3 (c) -1.1 (d) 1.6 (e) 0 c Which is the third smallest value? (a) -1/2 (b) 28/15 (c) 2/3 (d) -0.04 c What is the second biggest value in 7.9259, -0.1, 4/7, 0.8, 1/3? 0.8 Which is the second smallest value? (a) 198 (b) 2.49 (c) -0.2 b What is the second biggest value in -5, -1.1, -66, 103, -1/4, -1/797? -1/797 What is the third biggest value in -720, -1/2, 2/3, 8/5, 4? 2/3 What is the fifth biggest value in 86, -0.5, -3/5, 20198, -0.077? -3/5 What is the fourth biggest value in -1136.85, -0.1, 3, -4, 3/7, 4/5, -3? -0.1 What is the fourth smallest value in 3, 191, -77.8, -65? 191 What is the third smallest value in 23.8, 4, 1/3, 1, -85? 1 What is the fourth smallest value in 1/7, -253.466, 0, -59, -0.06? 0 What is the second biggest value in -4, -102420377, 3? -4 What is the second biggest value in -1604, -3/2, 1/200? -3/2 Which is the fourth biggest value? (a) -429 (b) -1 (c) -2804/7 (d) -2/33 a Which is the third smallest value? (a) -192728 (b) 7 (c) 233 c	{ "pile_set_name": "DM Mathematics" }
eplacement from uquuiquqquqquu? 3/91 What is prob of sequence rgw when three letters picked without replacement from gjpjjgwfrgr? 1/165 Three letters picked without replacement from qdvqbvdvbdunundb. Give prob of sequence uvu. 1/560 Calculate prob of sequence nsss when four letters picked without replacement from {n: 3, s: 3}. 1/20 What is prob of sequence bvv when three letters picked without replacement from bbvbbbbvbv? 7/120 Three letters picked without replacement from tdddfdffdtnt. Give prob of sequence ffd. 1/44 Four letters picked without replacement from eeeheeeheeeeeeh. Give prob of sequence hheh. 1/455 Calculate prob of sequence zoz when three letters picked without replacement from {z: 16, o: 4}. 8/57 Two letters picked without replacement from {w: 1, b: 5, t: 9, i: 3}. Give prob of sequence it. 3/34 What is prob of sequence vma when three letters picked without replacement from {a: 8, d: 1, m: 1, v: 6}? 1/70 What is prob of sequence cbc when three letters picked without replacement from {c: 2, n: 3, b: 2, u: 6, r: 2}? 2/1365 Three letters picked without replacement from yycc. What is prob of sequence ccy? 1/6 What is prob of sequence dos when three letters picked without replacement from {p: 1, s: 1, o: 4, d: 7}? 7/429 Calculate prob of sequence oooo when four letters picked without replacement from {o: 4, u: 7}. 1/330 Two letters picked without replacement from phwwbp. Give prob of sequence wb. 1/15 Four letters picked without replacement from {n: 1, z: 5, m: 2, w: 1, f: 1}. Give prob of sequence wzmn. 1/504 Two letters picked without replacement from zziiiiqeieqqzzqe. What is prob of sequence qz? 1/15 Three letters picked without replacement from reffebfbbvpf. Give prob of sequence rpf. 1/330 Calculate prob of sequence to when two letters picked without replacement from {j: 2, t: 4, o: 2, u: 2, w: 1, c: 1}. 2/33 What is prob of sequence tet when three letters picked without replacement from eeeezzeeeeeeentzetet? 13/1140 What is prob of sequence or when two letters picked without replacement from vtocgtvttrcv? 1/132 Two letters picked without replacement from hiilgokookhhki. What is prob of sequence hl? 3/182 Two letters picked without replacement from xccxcccddcxdxmzqx. What is prob of sequence xq? 5/272 Calculate prob of sequence jy when two letters picked without replacement from {f: 1, j: 1, y: 3}. 3/20 Calculate prob of sequence uu when two letters picked without replacement from {h: 1, u: 2}. 1/3 Two letters picked without replacement from neege. Give prob of sequence gn. 1/20 Four letters picked without replacement from {v: 2, k: 4, e: 1, d: 2, q: 2, n: 4}. Give prob of sequence envv. 1/4095 What is prob of sequence aall when four letters picked without replacement from azaaczlclccacqczccqa? 1/2907 Calculate prob of sequence hsm when three letters picked without replacement from hkkmkkkvktkskm. 1/1092 Three letters picked without replacement from {k: 2, p: 5, w: 4}. Give prob of sequence wpk. 4/99 Three letters picked without replacement from {v: 1, f: 7, w: 1, n: 3, g: 1}. What is prob of sequence fwg? 7/1716 Four letters picked without replacement from {i: 3, f: 1, p: 2, c: 3, q: 6}. Give prob of sequence cqpc. 1/455 Two letters picked without replacement from {p: 1, a: 2, c: 1, z: 2, s: 2}. What is prob of sequence zc? 1/28 Calculate prob of sequence mmmz when four letters picked without replacement from {m: 8, z: 5}. 14/143 Calculate prob of sequence ovo when three letters picked without replacement from {v: 2, f: 1, u: 5, w: 2, o: 2, d: 1}. 1/429 Calculate prob of sequence ffqf when four letters picked without replacement from fffq. 1/4 Two letters picked without replacement from {t: 2, w: 4}. What is prob of sequence tw? 4/15 Calculate prob of sequence bss when three letters picked without replacement from {w: 1, b: 1, s: 2}. 1/12 Three letters picked without replacement from {n: 1, d: 4, p: 5}. What is prob of sequence pnd? 1/36 Calculate prob of sequence ggw when three letters picked without replacement from {w: 3, r: 5, g: 2}. 1/120 Calculate prob of sequence lnnl when four letters picked without replacement from nllllllln. 1/36 What is prob of sequence pp when two letters picked without replacement from {p: 3, m: 3}? 1/5 Two letters picked without replacement from tjflpljljjjlaaptljaj. Give prob of sequence jj. 21/190 What is prob of sequence ik when two letters picked without replacement from kkarkkkaikri? 1/11 What is prob of sequence lll when three letters picked without replacement from {l: 3, k: 4}? 1/35 Calculate prob of sequence otoo when four letters picked without replacement from iioiioiiitiioigoooi. 5/3876 Two letters picked without replacement from xqqqzxzqqqqq. Give prob of sequence qx. 4/33 Four letters picked without replacement from {k: 12, x: 5, a: 2}. Give prob of sequence xakx. 5/969 Four letters picked without replacement from {a: 1, n: 2, t: 2, b: 1}. What is prob of sequence tbta? 1/180 What is prob of sequence rooe when four letters picked without replacement from {e: 2, o: 4, r: 5}? 1/66 What is prob of sequence nan when three letters picked without replacement from {a: 6, n: 10, m: 4}? 3/38 Calculate prob of sequence vy when two letters picked without replacement from {v: 3, m: 1, u: 1, w: 2, y: 4}. 6/55 Calculate prob of sequence seu when three letters picked without replacement from {e: 1, s: 1, u: 1}. 1/6 Two letters picked without replacement from hsfpfmp. What is prob of sequence hf? 1/21 Two letters picked without replacement from annnaneynynya. What is prob of sequence an? 3/26 What is prob of sequence bbes when four letters picked without replacement from {z: 1, s: 1, v: 3, c: 2, b: 5, e: 1}? 1/858 Calculate prob of sequence lql when three letters picked without replacement from {e: 7, a: 6, j: 3, q: 1, l: 2}. 1/2907 Two letters picked without replacement from {c: 6}. What is prob of sequence cc? 1 Calculate prob of sequence akzb when four letters picked without replacement from lllzlbflalllllkkkl. 1/24480 Three letters picked without replacement from {r: 1, c: 3, h: 1, b: 4, k: 1, w: 2}. Give prob of sequence wwr. 1/660 Three letters picked without replacement from {z: 1, d: 1, x: 1, j: 1, n: 3, a: 6}. What is prob of sequence ndj? 1/572 Calculate prob of sequence dy when two letters picked without replacement from yvidw. 1/20 Three letters picked without replacement from hhmmpheehhhppesm. Give prob of sequence hhs. 1/112 Three letters picked without replacement from vnvpvvpvvpnpvppvv. Give prob of sequence npp. 1/68 Calculate prob of sequence unn when three letters picked without replacement from unnu. 1/6 Three letters picked without replacement from {x: 2, w: 2, i: 1}. What is prob of sequence wxx? 1/15 Calculate prob of sequence ffff when four letters picked without replacement from {f: 4, i: 2}. 1/15 Three letters picked without replacement from {k: 3, d: 9, f: 1, l: 1}. Give prob of sequence dld. 3/91 Calculate prob of sequence ek when two letters picked without replacement from bkxekbkkk. 5/72 What is prob of sequence dcc when three letters picked without replacement from cqcdpcccc? 5/84 Two letters picked without replacement from ykyjzzti. Give prob of sequence zi. 1/28 What is prob of sequence uwtu when four letters picked without replacement from {w: 4, d: 3, u: 3, t: 4, g: 3}? 1/595 Three letters picked without replacement from zclzyjycozyllll. What is prob of sequence cyy? 2/455 Two letters picked without replacement from {t: 3, m: 4, l: 5, k: 1, x: 1}. Give prob of sequence lt. 15/182 What is prob of sequence vgh when three letters picked without replacement from zvvgqgvghztg? 1/110 Calculate prob of sequence avai when four letters picked without replacement from iavbaikv. 1/210 Two letters picked without replacement from kekekk. What is prob of sequence kk? 2/5 Three letters picked without replacement from {u: 3, y: 2}. Give prob of sequence yuu. 1/5 Two letters picked without replacement from whwohwhoohwwwhhhow. What is prob of sequence hh? 7/51 Two letters picked without replacement from cjce. What is prob of sequence cc? 1/6 Two letters picked without replacement from {f: 2, t: 6, o: 1, a: 5, b: 1, m: 1}. Give prob of sequence mm. 0 Calculate prob of sequence	{ "pile_set_name": "DM Mathematics" }
3u + 17 = j, 3j + u = -2j + m. Solve jy = -2v + 18, -y + 3y - 2v - 10 = 0 for y. 4 Let l(x) = -x + 37. Let y be l(18). Let r = y + -15. Suppose 0 = 4q + 3t - 4 - 2, rq = 5t + 22. Solve 4k - 3k - 3 = 2j, -15 = qk for j. -4 Suppose -89 = -12m - 65. Solve 41x + mo = 43x, -x = 5o + 30 for x. -5 Let n(d) = 5d + 6. Let i be n(0). Let m be 16/i - 1/(-3). Solve -13 = -3y + l, -25 - 1 = -4y - ml for y. 5 Suppose 0m + 5m = 5d + 85, 0 = -m. Let i(f) = -f3 - 16f*2 + 18f + 4. Let s be i(d). Let o = s - -13. Solve oh = -h - 4y + 7, 0 = 3h - y + 5 for h. -1 Suppose 30 + 50 = 20t. Suppose 0 = 5d - tr + 3r - 17, d = 3r + 9. Solve 2n + 6j + 3 = dj, j = n + 4 for n. -3 Suppose 0 = 20o - 17o - 834. Let j = o - 278. Solve m = 2v - 3m + 14, -3v + 5m - 18 = j for v. -1 Let s(a) be the third derivative of 0 + 7/24a*4 - 1/3a*3 + 0a - 15a2. Let c be s(2). Solve -o = -0g + 2g - 12, -4g + c = -4o for o. 2 Let s(x) = 14x - 5. Let h be s(1). Suppose hj - 13 - 23 = 0. Solve 3g - 2f = 7g + 14, 0 = -4g + jf + 4 for g. -2 Let m be (-4)/6(-30)/4010. Solve 4f + 4 = -4r, 6f - m = r + 11f for r. 0 Suppose -3b + 225 = 2b + 4a, 4b = -a + 169. Suppose 12i - 19 = b. Solve 2q = iw + 20, -q = -5q - 4w - 16 for q. 0 Let m(c) = c3 + 35c*2 - 108c - 1253. Let u be m(-37). Solve -10 = 4p + ux, -5p - 4 = -2x + 4x for p. 0 Let o be (81/18)/((-12)/(-10))4. Let a = o + -12. Let y = 9 + -6. Solve 3i - 15 = j, 4j - aj = -y for i. 4 Suppose 440 = -4s + 4o, 0 = 2s + o - 5o + 220. Let z be (-2)/(-12) - s/60. Let i be (-10)/(-20)(4/z - -4). Solve 4k = x + 18, 2x = -k - ix + 15 for k. 5 Suppose -4x + 10 + 102 = 0. Let u = -299 + 300. Suppose o = m - 5, -u = -2m + m - 3o. Solve -5b + mi = x, 3i - 10 = -2i for b. -4 Let g(p) = -1096p - 8765. Let h be g(-8). Let i be 4/690/12. Solve -iu = -2b + 1, u - 4 = -hu + 4b for u. -1 Suppose 0 = h + 277h + 90h - 1104. Solve h = l, -4i + l + 8 - 3 = 0 for i. 2 Let p be (-11960)/(-598) - (-1 - -12). Solve 0 = 2t - 5b - p, -13t + 9t = b + 15 for t. -3 Let l(g) be the third derivative of g5/60 + 5g*4/4 + 59g*3/6 + 12g*2 - 3. Let k be l(-28). Solve 0 = -5t + 4s + 28, -kt - s - 4 = -14 for t. 4 Suppose p = n - 0n - 9, -25 = 5p. Suppose -no + 8 = -2o. Solve 0d - b - 5 = od, 5b - 9 = -3d for d. -2 Let f(g) = 4g2 + 232g + 2. Let u be f(-58). Suppose -4i = -3z - 6, 0 = -3i - 3z - uz + 19. Solve -2j - 3j + 29 = -4o, 3o - 12 = -ij for o. -1 Suppose -4h - 3n = -53, 5h + 0n - 3n - 73 = 0. Suppose 13j - 27 = hj. Let x = 37 + j. Solve m + m = 3d + x, 5d = -3m + 15 for m. 5 Let h be (34/(-4) + 4)/((-96)/64). Solve -hd - 13 = -2x, -4x + 4d = -8 - 12 for x. 2 Let x = -1 + 1. Let y(n) be the second derivative of -n5/20 + n4/6 - n3/3 + n2 - 1061n. Let s be y(x). Solve 0 = -2a + a - d + 2, -a - 3d = -s for a. 2 Suppose -56 = a - 75. Let w = -15 + a. Solve 4t + 0 = -4f + 4, -wt = -4f - 36 for f. -4 Suppose -4a = 4v - 16, -3v = -73 + 67. Let w be (-2 - -4) + (-2 - -2). Solve -wn + a = -2k, -3n + n + 23 = 5k for n. 4 Let l = 9194 + -9192. Solve a = 38u - 40u - 12, 5a + 20 = -lu for u. -5 Let t = 12397 - 12392. Solve 4p = -2u + 4u + 28, 30 = 2p - tu for p. 5 Let b be 4 + ((-1)/(-5))/((-42)/(-210)). Suppose -b = m - r, -5m = -2r + 10 - 0. Solve -4k - 20 = 3w, -w + 3k = -mk - 2 for w. -4 Let t(w) = -17w - 51. Let r be 4 + 0 + (-35)/((-15)/(-3)). Let b be t(r). Solve -4d + 18 = 3c, -c = 5d - 17 - b for c. 2 Suppose -34y + 592 = 48. Let c = 11 - 6. Suppose j - y = -c. Solve -3h - 3 = 0, 3l - h - j = 2 for l. 4 Suppose -3h + 6h - 8 = -w, 1 = h + 2w. Suppose 4s - 3 = r, -2r - hr + 23 = -s. Solve -2j = -y + 1, -y = sj + 2y + 5 for j. -1 Let s be 0 + (15/(-5) - (2 + -8)). Let h be (-1)/(s/(-33) + 1 + -1). Suppose 0 = hg - 6g - 10. Solve -2w - 2d = 3w + 31, -w + d - g = 0 for w. -5 Let h(l) = 9l2 + 5l*2 + 27 - 16l*3 - 16l + 17l3 - 10. Let z be h(-15). Solve 0 = -c - 3 - 2, -4c - z = 4u for u. -3 Suppose 2f - 35 = -15. Let y(d) = 27 + 6d - 5d - 2d + f. Let h be y(9). Solve -h = -5q + l, -3l = q + l + 7 for q. 5 Let u(p) = -6p*2 + 198p + 656. Let k be u(36). Suppose -2y - 5 = -3y. Solve k = -2l, -4 = r - yl - 21 for r. -3 Let s = -5818 + 5818. Solve -2a = -5z + 9, sa = 2z + 4a + 6 for z. 1 Suppose g - 5g - 3k = -3, 3k = -3g. Suppose 0 = 5p - 5, p - 20 = -gj - p. Let s be j/217(-6)/(-4). Solve 3r - r + s = -5c, -2c + 10 = -2r for c. 1 Suppose -11y + 8y = 291. Suppose -43x - 2034 - 2395 = 0. Let u = y - x. Solve 5v = -5g + 4v - u, 0 = -5g + 3v - 22 for g. -2 Let c(m) = 10m - 55. Let r be c(6). Suppose -5f = ry - 30, y = 3y - 2f - 4. Solve -q - 7 = -2b - y, 4b - 11 = q for q. 5 Let g be (1 + -1)2/4. Suppose -9r + 21 = -8r - 3c, g = c. Solve 5y + 3j - 9 = r, y + 3j = 18 for y. 3 Suppose 39f - 35f + 308 = 0. Let v = 83 + f. Suppose -8m + vm + 8 = 0. Solve 6w - w = z + 16, z + m = w for w. 3 Suppose -h - 5p = 7, 53h - 52h - 5p = 23. Solve 35 = -2j + 4f + 37, -4f - h = 0 for j. -3 Let y(m) = m3 - 3m*2 + m + 3. Let w be y(2). Let g be (-7)/((-35)/(-20))(w - 2). Solve -2v + 1 = 3l - 4, -12 = -gl - 4v for l. -1 Suppose 33q - 42 = 19q. Suppose 12 + 7 = g - 3n, -3n = qg + 3. Solve -12 = gt + 3i - i, 0 = 3t - 3i + 27 for t. -5 Suppose 14b = -4q + 13b + 2393, -2989 = -5q - 2b. Let l = q - 595. Solve -4o - f = f - l, -11 = 3o + 5f for o. 3 Suppose -114t + 206 = -25t + 14t. Solve 4l = -d + 5 + 6, tl - 2d + 2 = 0 for l. 2 Let j(g) = 3g*3 + 21g*2 + 5g - 7. Let w be j(-6). Suppose 15b + 11 = w. Solve 3d + 5f - 32 = -10, -bd - f = -1 for d. -1 Let b(k) = k*2 + 13k + 52. Let u be b(-4). Suppose -u = -5t - 1. Solve -tm - 11 = 4h, 5m - 3m = -5h - 5 for m. -5 Let m(d) = -d*3 + 2d*2 + 21d - 48. Let c be m(4). Solve -4j + 41 = 4k + k, 31 = 3k + cj for k. 5 Let q be (-484)/77 + 6 - (-111)/21. Solve -qk - 3g + 1 = 0, 8g = 5g - 9 for k. 2 Let h be 6 - 1 - (-116)/(-4). Let c(b) = -5b - 118. Let d be c(h). Solve -3q - u + 2 = 0, -q - du - 2u = -19 for q. -1 Let o(r) = r*3 + 27r*2 + 104r - 127. Let d be o(-22). Solve -7a + 5a - 10 = 4s, -s + 25 = -da for a. -5 Let x be ((-140)/(-50))/(1/(-95)). Let b = -241 - x. Let q(a) = a*2 - 4. Let z be q(-3). Solve -k - 10 = -p, -4k + b = 4p - zk for p. 5 Suppose 11w - 55 = -0w. Suppose -5q - 10 = -wc, 4q + 8 = -8c + 4c. Solve -3p - 2o - 1 - 7 = c, 0 = 2p + 5o + 20 for p. 0 Let j(g) = -2g + 4. Suppose 5h + 12 = -8. Let v be j(h). Solve 0 = -5z - 20, 2b - v = -z + 6z for b. -4 Suppose 0 = -27x + 25x + 182. Let u = 93 - x. Solve 3i - 1 = n + u, 5n = 4i + 7 for n. 3 Let l(h) = -h - 47. Let x be l(0). Let z = 50 + x. Suppose 0 = -m + 3, -zw + 51 = -0m + m. Solve 2d = 5o + w, 3d + 5o + 1 = -0d for d. 3 Let x = 1131 + -1127. Solve -8 = -xi, -2a + 5a + 3i + 6 = 0 for a. -4 Let g = -78 + 86. Suppose -47i - g = -55i. Solve 0v = q + 3v - 13, 5q - v - i = 0 for q. 1 Suppose 0 = m - 4m + 45. Suppose 3z + m = 0, 0z + z = -3p - 104. Let s = -31 - p. Solve -l = b - 1 - 1, 2l + s = 0 for b. 3 Let u = -13 + 14. Let m(p) = -p + 1. Let d(g) = 11g - 24. Let y(q) = ud(q) + 2m(q). Let x be y(3). Solve 3s - 5w - 7 = -0s, -xs + 17 = -3w for s. 4 Let t = -67 + -58. Let v be ((-3)/(15/t))/1. Suppose g + 4g = v. Solve -ga + 3o = 5o + 8, -5o = -5a + 20 for a. 0 Let r(p) = 2p. Let m be r(0). Let c = 64 - 54. Let h = 16 - 14. Solve -hk = -3x - c, 3x = -mk - 3k for k. 2 Let k(w) = 2w2 - 17w + 33. Let p be k(6). Solve d - 2 = 3g - p, 0 = -5d + 4g + 6 for d. 2 Let v = 1998 - 1993. Solve 5r = vs, 6 = -4s + r - 3 for s. -3 Suppose -5f + 16 = -f + 2r, 24 = 4f + 4r. Suppose -3p - 2p + 7 = q, 4q = -3p + 11. Suppose 8v - q - 30 = 0. Solve -2i - fj = -3j + 2, 0 = vj for i. -1 Suppose -5t - 36 = n, -4n + 37 + 3 = -3t. Let a be (-2 + 5)(t - 93/(-9)). Solve 2l = y + 13, a = -4l + 27 for y. -3 Let w be (-2)/(-9) + (-32)/(-18). Let x(u) = -u2 - 12u - 2. Let p be x(-10). Solve k - 2v - 5 = -p, wv = -2k - 2 for k. -5 Let b be (1 + -22)20/(-4). Suppose 101*t + 68	{ "pile_set_name": "DM Mathematics" }
f = -30 + 54. Solve -4 = 2o - f for o. 4 Suppose -4r + 6r - 2 = -v, 0 = -2r. Solve 20 = 2m + vm for m. 5 Let z(w) = w*3 + 19w*2 + 36w + 5. Let h be z(-2). Solve -15c - h = -16 for c. 1 Let n be (-4 - -2)/(1/(-3)). Let r(m) = -m2 + 6m - 1. Let f be r(n). Let j be 3/(-1) - (f + -3). Solve j = -3l - 5 for l. -2 Let a = -255 + 255. Let w = -2 - -1. Let g = w - -3. Solve -2n = g - a for n. -1 Let w be 0/9(-1)/(-2). Solve 8 = 4o - wo for o. 2 Suppose 4o + 4g = 0, 4g - 3 + 13 = o. Suppose 10 = -j + 3u, -5j + u - o = -4j. Let f be (0/(-1))/(j + 0). Solve -5l - 2 + 17 = f for l. 3 Let k be (-676)/(-34) - (49/17 + -3). Suppose -2g = -g - 3. Solve -ga - a = -k for a. 5 Let s = 57 + -135. Let k = s - -90. Solve 0 = 5t - t - k for t. 3 Suppose 12o = -0 + 24. Suppose 1 + 4 = 5m. Let c be m(-2 - -3) + 0. Solve c = oz + 9 for z. -4 Let s be ((-56)/(-6))/(-8 + (-78)/(-9)). Solve -16u = -su - 6 for u. 3 Let b be -92/(-3)3. Let v be 42/b - (-1)/(-3). Suppose -20 = -4q - x, q - vq + 4x - 12 = 0. Solve 0n - qn - 20 = 0 for n. -5 Let f = 72 - 72. Let n be f(-1)/(-4) - (0 - 0). Solve n = 3s + s for s. 0 Let y(x) = -x*3 + 11x*2 + 6x - 11. Let s(v) = v*3 - 11v*2 - 5v + 10. Let l(i) = 6s(i) + 5y(i). Let d be l(11). Solve 0 = du + 23 - 3 for u. -4 Let t = -59 + 59. Suppose -3q - 12 = t, -5g = -q + 3q - 37. Solve 3i + 0 = g for i. 3 Let b(c) = -3c - 3. Let l be b(-5). Let a = 54 - 41. Solve l + a = 5u for u. 5 Let n(s) = -s2 + 33s - 59. Let a be n(31). Solve 2t - 7 = -a for t. 2 Suppose -2 = 3f - 2. Solve -3j = -6 - f for j. 2 Let x(g) = 0 + 6 - 4 + 17g*2 - 7g*2 - 4g. Let q be x(1). Solve 2z = -0 - q for z. -4 Let l(i) = -i3 + 10i*2 + 3i - 14. Let p be l(10). Solve 0 = pc - 13c + 12 for c. -4 Let h(f) = -f3 + f2 + f + 2. Suppose -1 = l, -4n + 0l = -4l - 12. Let w be h(n). Let u be 0 + 4 - (0 + w). Solve 3p - up = 3 for p. -3 Let o(a) = 11a3 - a2 + 4a - 2. Let v = -8 + 9. Let c be o(v). Solve s = -2s - c for s. -4 Suppose 16v - 165 = -37. Solve 22c = 26c - v for c. 2 Let o = 2100 - 2096. Solve -30n + 31n + o = 0 for n. -4 Let r(q) = q2 - 10q + 11. Let y(a) be the second derivative of a3/6 + a2/2 + 6a. Let z be y(8). Let f be r(z). Solve -fj - 15 = j for j. -5 Suppose 0u - 21 = 19u - 78. Suppose -f - 2o + 7o = 3, 0 = 4f + 2o - 32. Let p = -10 - -18. Solve ul - p = fl for l. -2 Let w be (-14)/(-6) + -2 - 3/9. Solve w = h - 2h + 1 for h. 1 Let f = -1 - -5. Let w be (16/(-6))/((-10)/(-360)). Let a = -93 - w. Solve u + f = au for u. 2 Let k(n) = -n*2 - 9n - 9. Let y be k(-7). Suppose yf = f. Solve a + 3a = f for a. 0 Suppose 2d = 3d + 5, -5d = -2z + 39. Solve 30 = zv - v for v. 5 Let n = -10 + 13. Suppose -12 = -2b + 3t, 23 = 4b + t - 1. Solve nr = b + 3 for r. 3 Let b = -3 + -8. Suppose -2s = 0, -3v = -7s + 3s + 27. Let k = v - b. Solve 0 = 7a - ka - 10 for a. 2 Let p be -3 - (-66)/9 - 7/21. Solve 0a = -pa for a. 0 Let f(g) = -g3 - 6g*2 + 15g - 6. Let a be f(-8). Solve -a + 0 = -2z for z. 1 Let g = -1856 - -1899. Solve 0 = 3r + 37 - g for r. 2 Let c = -918 + 958. Solve 0 = -3r + 46 - c for r. 2 Suppose 0 = -2j + j. Suppose 21 - 11 = -2p. Let q(a) = a + 7. Let v be q(p). Solve vz + 2 - 4 = j for z. 1 Let h(v) = -v*2 + 4v + 1. Let p(w) = w. Let c be p(2). Let i be h(c). Suppose -3u + 17 = iy - 7u, y + u - 7 = 0. Solve -yj - 21 = 4 for j. -5 Let a = -45 + 32. Let u(s) = 14 - 2s + 5s - 2s + 1. Let r be u(a). Solve -20 = -rz + 6z for z. -5 Suppose 5z = -4i - 10 - 1, -5i - 16 = 4z. Let n be z/3 - 40/(-15). Solve 0 = -2d - nd for d. 0 Let r(d) = d2 + 13d + 35. Let q be r(-3). Solve qb = 3b for b. 0 Let t = -605 + 615. Solve -20u + 15u = t for u. -2 Suppose -2a = 2a - 3a. Suppose 4u + 3l - 4 = a, 4l + 4 = 2u + 2. Solve 8 = -3z - u for z. -3 Suppose -3y = -15 + 93. Let r = y + 35. Let w(u) = -2u + 21. Let t be w(r). Solve ti = -i for i. 0 Let g(q) = -2q*3 + 10q*2 + 2q - 10. Let b be g(5). Suppose 0p + 3p = 3l + 3, -21 = -4l - p. Suppose -u - lu = 0. Solve -3r + 3 + b = u for r. 1 Suppose 53 = 34f - 185. Solve -b - 24 = -fb for b. 4 Suppose 4u = -u. Let y be 12/3 + -41. Suppose y = -w + 61 - 58. Solve ui = -wi - 9 for i. -3 Suppose 4 + 0 = k - 3l, k - l - 10 = 0. Let h = k + -13. Suppose h = 2r - 0r + m - 3, 4 = -4m. Solve 0 = i - ri - 3 for i. -3 Suppose -78 + 113 = 5p. Solve 10l - 6 = pl for l. 2 Let l be 544/102 + -1 + 2/3. Suppose -3f - 2y = 10, y + 4 + 1 = -lf. Solve d - 5d + 16 = f for d. 4 Let k be -26/161632/(-153). Solve 6r = 26 - k for r. 3 Let g(n) = n3 - 10n*2 + n - 5. Let m be g(10). Suppose 3t + 52 = mt. Suppose 29 = 5r + l, 4l - t = -5r - 0l. Solve -2 = -4q + r for q. 2 Let m = 20 + -24. Let n be (-2)/m + 27/18. Solve r - 1 + n = 0 for r. -1 Let f be 30(8/(-5))/(-4). Let c = -8 + f. Suppose r - v = 2r - 2, -8 = -r - cv. Solve 0 = -rl - l for l. 0 Let g be 53 + (5 - 1 - 6). Solve -50q + 1 = -gq for q. -1 Let s(g) be the second derivative of g*3/3 - 5g*2 - 16g. Let b be s(5). Let u = 0 - 0. Solve -2t + b - 2 = u for t. -1 Let u be 28/(-8) - 3/2. Let i be (-3 - 0 - u) + 17. Let j = 22 - i. Solve jw = 5 + 4 for w. 3 Suppose 3o - 15 + 8 = u, -4o = -12. Solve 6z - 8 = uz for z. 2 Let w(k) be the second derivative of -k*4/12 + 5k*3/6 + 5k*2 + 9k. Let x be w(6). Solve -xh + 3h - 2 = 0 for h. -2 Let o = -60 - -75. Let a be 1/1(-1)/(-3)o. Solve 4y - 3y = a for y. 5 Let i = -33 - -38. Suppose 27 = ir + 22. Solve 0 = -k - r + 5 for k. 4 Let w be 0/(((-10)/(-12) - 1)6). Solve 8p - 10p = w for p. 0 Let k = 201 + -165. Solve 0 = 5b + 13b + k for b. -2 Let o = 43 + -49. Let s = 7 + o. Solve -3c + s = -5 for c. 2 Let z = 41 + -39. Suppose -3d = -5d - 5c - 3, -c = d. Suppose 0 = 3m + 3b - 3, 4m - b + 0b + d = 0. Solve -zv = -m - 6 for v. 3 Let r = -7 + 7. Let q(h) = -h3 + h2 + h + 2. Let g be q(r). Suppose 0 = 3f - 9f + 36. Solve g = -4y - f for y. -2 Suppose -4b + 18 = v - 0b, -4v = b - 12. Suppose 2t + 5r = t + 1, -vt + 4r + 44 = 0. Let o = t + -16. Solve -k - 3k = o for k. 0 Let b(f) = -f*3 + 2f*2 - 4f - 3. Let p be b(-2). Let z = p - 5. Solve 7t - 3t = z for t. 4 Suppose -38 = 4u + 42. Let t(b) = b + 21. Let f be t(u). Solve -n + 0n = f for n. -1 Let p(j) = j*3 - 3j*2 - 10j + 25. Let v be p(4). Solve k - v = -5 for k. -4 Let i = 8 + -8. Suppose 5t = 3l - 170, -2l + 24 = 5t + 194. Let b = 37 + t. Solve -bx - 2x + 25 = i for x. 5 Let j = -4 - -6. Suppose f - 273 = 4f. Let t = f + 91. Solve tg + g = j for g. 2 Suppose -5l - g = -20, 4l + g + 2g = 16. Solve 0 = -2k - 2k - l for k. -1 Suppose -2 = v + 3. Let t = -3 - v. Solve 0 = to + o - 15 for o. 5 Let i be (-2 - -1)/(7/(-14)). Let k be i + 9 - (-3 + 4). Let d be 4/k + (-6)/(-10). Solve 0 = 3o + d - 10 for o. 3 Suppose 5f - 20 = -2s, -5f = 2s - 3f - 20. Solve sg = 6g - 8 for g. -2 Suppose 11r + 714 = 53r. Solve -1 = -rx + 18x for x. -1 Let a(o) = 18o + 165. Let d be a(-8). Solve 9r - d = -12 for r. 1 Let x be (-3 - (-3)/(-6))-2. Let l(z) = -3z2 + z3 - 2z2 - 8z - z*2 + 2z - 5. Let c be l(x). Solve ck + 2 = -0k for k. -1 Suppose 2j = -4w + 196, 3j + 73 = 2w - 17. Let z = w + -44. Solve n = 5n + z for n. -1 Let m = -1667 + 1680. Solve 3g - 16 = -m for g. 1 Suppose -16c + 13c + 120 = 0. Let z = 40 - c. Solve z = -5s + 6 + 4 for s. 2 Suppose q + 36 = a, 42 = 2a - 2q + 6q. Solve -7k - a + 10 = 0 for k. -3 Suppose 0 = 14q - 21q. Solve q = 3y - 6y + 12 for y. 4 Let d(i) = -i3 + 7i*2 - 5i - 8. Let r be d(6). Let v = r - -4. Let a = 2 + v. Solve ay = y - 15 for y. -5 Let o(b) = 2b*2 + 11b + 9. Let g be o(-5). Solve -11a - 18 - g = 0 for a. -2 Let z = -15 - -19. Suppose -zg - 10 + 3 = 3j, 3g + 3j + 9 = 0. Suppose 0 = 2x - 2r - r + 9, gx - 11 = -r. Solve -12 = -n - xn for n. 3 Suppose k = -3m + 18, -m - 3m = -3k - 11. Suppose 12z - 24 = 9z - 4n, 18 = -3z + 3n. Solve -m = -5x - z for x. 1 Let y be 4/24 + (123/18 - -2). Let f be 1/2(y + -7). Solve -2r - 5 = f for r. -3 Suppose 5o = 5g + o, 0 = 4*g + o. Solve -w + 2 + 3 = g for w. 5 Let s = 1003 + -980. Solve s = -	{ "pile_set_name": "DM Mathematics" }
se z = c - 4. Does 14 divide c? False Suppose -2b - 500 = -5f, -4f - 3b + 8b + 383 = 0. Suppose 487 = 5r - 2r + g, -5g - 463 = -3r. Let q = r - f. Is q a multiple of 20? False Let t(f) = 59f*2 - 3f - 4. Is 17 a factor of t(-2)? True Let q be (-2 - (-3 - 1)) + 55. Suppose -3m - 5h = m - q, -2m - 5h = -21. Is (-2)/(-4) - m/(-4) a multiple of 2? False Let u = 651 - 245. Does 7 divide u? True Let u = 12 + -11. Let c(y) = -5y - 2. Let z be c(9). Let h = u - z. Is h a multiple of 12? True Suppose 5 = 5l, -4 + 17 = 4q + l. Suppose qd - 14 - 1 = 0. Suppose 0w + 4 = -4g + 4w, 0 = dg - w - 11. Is g even? False Let t(w) be the first derivative of 7w3 - 2w + 15. Is t(2) a multiple of 41? True Suppose -p + 22 = 4y, 73 + 60 = 4p + y. Does 23 divide p? False Let b(g) = g + 27. Let h(v) be the first derivative of -v*3/3 + 7v*2/2 + 8v - 2. Let d be h(8). Is b(d) a multiple of 9? True Let j(c) = 8c2 + c - 4. Let y be j(2). Let x = y + -28. Suppose -6 = xh - 14. Is 4 a factor of h? True Let h(c) = c*3 - 3c + 10. Does 9 divide h(4)? False Let g(n) = n. Let c be g(3). Suppose 2j - 183 = -0j - ch, 5h + 15 = 0. Is j a multiple of 16? True Let a(r) = 19r + 2. Is a(8) a multiple of 11? True Let w(v) = v + 8. Let a be w(-7). Let c = 59 - a. Suppose -4r = -4o - 38 - c, -o = -2r + 50. Does 7 divide r? False Does 15 divide (10/8)/((-1)/(-156))? True Let y = 8 + -5. Let n(r) = 2r - 3. Let x be n(y). Does 14 divide 1/x(0 - -129)? False Suppose -36x + 13200 = -14x. Is x a multiple of 15? True Let k be (-5 + 2)/3-31. Suppose 70 = 4j + 3t - 1321, -5j = kt - 1741. Is j a multiple of 50? True Let f(r) = -r*2 + 13r - 16. Let x be f(11). Suppose xc + 4k = 3c + 56, 2c + 3k - 37 = 0. Is 20 a factor of c? True Suppose 2y - 7y + 6346 = m, 6362 = 5y - 3m. Does 82 divide y? False Suppose 6 = 2g, 122g = -4j + 125g + 711. Does 45 divide j? True Does 26 divide 5822/10 + 18/(-90) + -3? False Let v = -10 - -10. Suppose -2c - c - 30 = v. Let k = c - -13. Is 2 a factor of k? False Let b(t) = t*3 - 12t*2 + 5t - 20. Suppose -6 = -2j, -4z - 5j - 7 + 70 = 0. Is b(z) a multiple of 22? False Let m be (-110)/(-9) + (-14)/631. Let t be -2(1 - (-10)/(-4)). Suppose th = 2h + m. Does 3 divide h? True Let g(s) = -s2 - 14s + 5. Let y be g(-14). Suppose 0p - 4 = -p + m, 2m - 20 = -yp. Is p a multiple of 4? True Let f be (-1 - 0)0/(-3). Suppose -4n - 108 = -4j, 3j + 0j + 2n - 71 = f. Let u = j + -10. Is 5 a factor of u? True Let n be 1 - (0 - (-3 - -322)). Let d be n/(-15)(-18)/8. Is (d/(-10))/(4/(-20)) a multiple of 5? False Does 4 divide (-2 + 1)(3 + -1287)? True Is 116 a factor of (14/(-3) - -5) + (-2122)/(-6)? False Let k(y) = -y*3 - 14y*2 - 3y + 8. Does 14 divide k(-18)? True Does 21 divide (-5 + 106/3)/((-1)/(-18))? True Let v be 1-3 - (-30)/15. Let x be -4 + (-8)/2v. Suppose 2h - 7 - 43 = x. Does 4 divide h? False Suppose 3s - 356 = -s. Suppose -3c + o + 205 = 0, c = -5o + s + 6. Does 25 divide c? False Let c = 181 + -97. Let s(p) = 2p2 + 5p + 6. Let x be s(-6). Let a = c - x. Does 8 divide a? False Let d(j) be the second derivative of -j*5/20 - 11j*4/12 - 13j*3/6 - 7j*2 + 28j. Does 23 divide d(-12)? False Suppose 3n + 24 = 11n. Suppose 0 = 2s + 5c + 16, 7s + 6 = 4s - nc. Does 17 divide 54 - 5 - s-1? True Let o(r) = -2r3 - 2r2 + r + 3. Let n(t) = -t3 - t - 1. Let g(a) = n(a) - o(a). Is 42 a factor of g(4)? True Let p = -483 + 651. Does 8 divide p? True Let g(x) = 3x3 + 3x*2 + 6x + 4x - 10x*2 - 4 - 3x. Is g(4) a multiple of 13? True Suppose -1077 - 1240 = -7b. Suppose 3l - w + b = 5l, -4l + 2w + 666 = 0. Is 18 a factor of l? False Let s(d) = 10d*2 + 3d - 3. Is 10 a factor of s(6)? False Let c be ((-617)/(-2))/((-1)/(-2)). Suppose -5v + c = -733. Does 10 divide v? True Let y(h) = -h2 + 4h - 1. Let b be y(3). Suppose 0 = -bc + 1 + 3. Suppose j - 20 = c. Does 6 divide j? False Suppose -25 = 3c + 4t, 4c - 6t - 4 = -2t. Is 4/(-6) + (-32)/c + 1 a multiple of 2? False Let h(l) = -12l - 52. Is 6 a factor of h(-14)? False Let b = -144 + 130. Is ((-196)/1)/(b/21) a multiple of 14? True Let i = 45 + -39. Does 18 divide (i/(-14)-2)/((-1)/(-63))? True Does 16 divide (-18)/(-66) + 21847/77? False Suppose 3q - 2k - 19 = 0, q + q - 5k = 20. Suppose -59 = -w - 4s, 2w - 121 = -0w - qs. Is w a multiple of 22? False Suppose 4s + 44 = -5v, -2v + 0 = 4s + 8. Let q = v - 8. Let o = -5 - q. Does 4 divide o? False Let m be 0/21/(-1). Suppose m = 5c + 3t + 17, 5c = -t + 3t - 22. Is 7 a factor of 34/c-12? False Let d(j) = -j + 24. Let s(p) = p*2 + 3p - 4. Let i be s(-4). Does 5 divide d(i)? False Let u = -76 - -93. Suppose -2o + 380 = 2k, 5k + 973 = 5o - u. Does 21 divide o? False Suppose -3z + 8z = 3370. Is z a multiple of 19? False Let o = -64 + 149. Is o a multiple of 7? False Let s(x) = x*3 - 4x*2 - 11x. Does 8 divide s(8)? True Let z(q) = 5q2 - q. Let t be z(1). Is ((-60)/(-18))/(t/30) a multiple of 14? False Let p = -20 + -8. Let q = 30 + p. Is q even? True Let b be -5 + (0 - 0) + 6/(-2). Does 15 divide (-11607)/(-212) - (10/b + 1)? False Suppose -3c = 3c - 12. Suppose 9 = z + ct - 9, 4z - 52 = -3t. Is 3 a factor of z? False Is 2/3 - (-3568)/3 a multiple of 10? True Let u(c) = -c*3 + 14c*2 - 20c - 14. Is 31 a factor of u(10)? True Let q(x) be the first derivative of x6/360 - x5/30 + 5x4/12 - 2x*3/3 + 7. Let v(a) be the third derivative of q(a). Is v(7) a multiple of 13? False Let f = 5 + 1. Is (-10)/(-30) - (-838)/f a multiple of 18? False Suppose 0 = -i - 0i + 596. Let o = i - 350. Is o a multiple of 20? False Let c(n) be the first derivative of n*3/3 + 7n*2/2 - 4n - 9. Is 20 a factor of c(-11)? True Suppose -4z = -2x - 210, -3x = 5z + 2x - 240. Suppose 9f + z + 3 = 0. Let g(o) = -11o - 18. Is 14 a factor of g(f)? False Is 27 a factor of (-1)/(((-8)/(-864))/(-1))? True Let z(v) = 2v*3 + 17v*2 - 9v - 2. Let d be z(-9). Let r = d - -19. Is r a multiple of 17? True Let p(w) = 14w + 65. Does 16 divide p(3)? False Suppose -684 = -3d - z, -3z - 9 = -0z. Is 5 a factor of d? False Suppose -g + 2g = 2d - 128, 0 = 4g. Is 10 a factor of d? False Let u be (-6)/(-9)(-3 + 6). Suppose -z - 4 = -4b + 4, ub + 5z = 26. Is 14 a factor of b(224/12 - -2)? False Suppose 7f = 399 - 2723. Let d = 476 + f. Is d a multiple of 18? True Suppose -5j - 147 = 88. Let n = 68 - 141. Let p = j - n. Is p a multiple of 9? False Suppose -2m + 2 = -4. Suppose s - 13 + 1 = 2h, 0 = -ms - 5h - 19. Is 26 a factor of s/(28/(-29) - -1)? False Suppose 3f - 9 = 0, -6r + 741 = -3r - f. Suppose 9s + r = 13s. Is s a multiple of 15? False Is 14 a factor of 1361 - (-10 + (-98)/(-14))? True Suppose 4u + u = 5a + 25, 25 = a + 5u. Let i(y) = 11y*2 + 39 - 10y*2 - y - 26. Is 7 a factor of i(a)? False Let v = 1036 + -382. Is v a multiple of 18? False Suppose -3 = -3s + 12. Suppose -2x + 11 = 5. Suppose xd - m - s - 111 = 0, 3m = -5d + 170. Is 16 a factor of d? False Let h be (3/2 + -1)-18. Let c = -289 - -236. Let a = h - c. Is a a multiple of 20? False Suppose 4c - j - 863 = 0, 4c - 430 = 2c + 2j. Is 24 a factor of c? True Let c(j) = -22j*2 + 1. Let p be c(-1). Suppose 0 = -g - 5l + 2l + 48, 106 = 2g + l. Let b = p + g. Is 11 a factor of b? True Suppose 4838 = 6w - 652. Does 61 divide w? True Is 39 a factor of (-4)/6 + (-110295)/(-81)? False Suppose -175 = -2i + 5f, -i + 4i - 235 = 2f. Suppose -70h - 600 = -ih. Is h a multiple of 12? True Let z(c) = c3 - 64c*2 - 175c - 56. Is z(67) a multiple of 21? False Let g = -475 - -705. Is 14 a factor of g? False Let v = 16 + -27. Let q = v - -14. Suppose -222 + 36 = -ql. Is 19 a factor of l? False Let o = 2267 - 875. Does 29 divide o? True Suppose 4m + 3 = -3p - 16, -4m = p + 17. Let x(o) = 2o2 - 3o - 11. Does 33 divide x(m)? True Let n(v) = v*3 - 11v*2 + 10v + 22. Let o be n(7). Let r = 184 + o. Does 8 divide r? True Suppose 3d = 6d + 42. Let m be (-24)/10735/d. Let c = -74 + m. Is 13 a factor of c? True Suppose -141 - 149 = -10z. Let s = 45 - z. Does 16 divide s? True Suppose 4g + 0z - 2992 = 2*z, 0 = g - z - 746. Does 10 d	{ "pile_set_name": "DM Mathematics" }
) = -23x - 6. Let g(u) = 24u + 5. Let m(z) = -3g(z) - 2y(z). Is m(-7) composite? False Suppose 4d - d - 4x + 13 = 0, 0 = 5d + 5x - 25. Let z(r) = 2r2 + 6r + 4. Let s be z(-6). Is d + (s - 0) + -2 composite? True Let h = 533 - -678. Is h a prime number? False Suppose 3o = -4g + 17, -30 = -5g - 0o + 5o. Suppose -gh = -h - 24. Is 460/h + 2/6 a composite number? True Let q(o) = 7 - 5 - 1 + 3o. Is q(6) a composite number? False Let r be -34(-3)/625. Suppose -3v + 207 = -3l - 27, 5v + 2l = r. Is v a composite number? False Suppose 0 = 3x + x - p - 90, -5x + 116 = -3p. Is x a composite number? True Suppose -h + 124 = 2b, b + 3b - 248 = -5h. Suppose 0 = -4x - 5q + 441, -2x + b = -5q - 151. Is x prime? True Is ((-8226)/(-21) - 1) + 6/21 a prime number? False Suppose -2p = -354 - 140. Is p a prime number? False Let v(k) = 116k + 41. Is v(11) a prime number? False Suppose 0 = -4u + 3p - 17, 5u = -p - 6 - 1. Is 0 + -1 + u - -74 prime? True Let b be (-4)/(8/1193)-2. Suppose o - 1247 = -i - 59, o - 4i - b = 0. Suppose 3r - 385 = -2s, -5s + r + o - 235 = 0. Is s composite? False Let t(w) = 3w*3 - 4w*2 - w + 4. Is t(3) a composite number? True Let l(k) = 7k*2 - 6k - 2. Is l(-5) prime? False Let x(i) = 538i + 3. Is x(1) prime? True Suppose 3u - 207 = -3o, -226 = -3o - 5u - 23. Is o prime? True Is ((-146)/(-4))/((-3)/(-18)) a composite number? True Let o = -1 - -3. Suppose 138 = os - 116. Is s prime? True Let n(b) be the third derivative of 59b5/20 - 2b2. Is n(1) prime? False Let z(h) = h3 + 13h2 + 7h + 1. Is z(-6) composite? False Suppose 4y = 3y + 20. Let a be (26/(-4))/((-5)/950). Is 2/8 + a/y a composite number? True Suppose 0 = 3z - 9. Is (-119)/3(0 - z) a prime number? False Let i(m) = -m*3 + 2m*2 + 3m - 1. Let y be i(-3). Suppose -12 + y = r. Is r composite? False Let u(j) = j*3 - 3j*2 + j + 2. Let m be 34/61. Let p be u(m). Suppose 2x + 5i - 2i - 146 = p, -4x = -2i - 324. Is x composite? False Suppose 0 = y + 4w - 9, -y + 5 = -2w + 4w. Let l be (y/2)/(1/10). Suppose -ls - 5 = 20, 0 = 2o + 2s - 32. Is o prime? False Let l(x) = x + 12. Let w be l(0). Let f = -10 + w. Suppose 4o - 952 = -4u, 5u + 1150 = 5o + fu. Is o prime? True Let m(b) = b3 - 4b*2 - 6b + 5. Let g(r) = r*3 + r + 5. Let l be g(0). Let p be m(l). Suppose f + 5n = -2f + 185, p = 5n - 20. Is f composite? True Let o(p) = -p*2 + p - 1. Let q(r) = 3r*2 - 11r + 7. Let v(z) = -4o(z) - q(z). Let b be v(-8). Suppose -bi + 366 + 164 = 0. Is i a composite number? True Let v(w) = w*2 - 3w + 3. Let z be v(3). Let s = 343 - 24. Suppose -s = -zj + 116. Is j a composite number? True Let i = -4 + 7. Suppose -ia + a + 586 = -h, 0 = -h. Is a a composite number? False Let c be 1(-1081 + 1)/(-4). Suppose 2y - 5h - 54 - 57 = 0, c = 5y - 5h. Is y prime? True Let p(s) = s2 + 5s - 1. Let n be p(-6). Let t = 413 + -28. Suppose t = nj - 0j. Is j a composite number? True Suppose o + 2q = -2o + 351, -464 = -4o - 4q. Let r = o + -52. Is r a composite number? False Let m(o) = -o + 6o + 2o. Suppose 0 - 20 = -4a. Is m(a) a composite number? True Suppose -2u - 1 = 7, 3w = 3u - 57. Let j = 57 - w. Let d = j - 43. Is d prime? True Let m(q) = 3q - 5. Let f be m(3). Suppose 0 = fa + 2p - 354, -3a - p + 268 = -0a. Is a a prime number? False Suppose 2h - 6803 = -5u, -h = -9u + 8u + 1362. Is u a prime number? True Suppose 0 = 5n - 6n + 6. Suppose nu = u + 115. Is u a composite number? False Suppose -5r = 0, -c = -6r + r + 10. Is 13656/40 - (-4)/c a composite number? True Suppose 0 = 3z, 4i - 655 = -4z + 1237. Is i composite? True Suppose -b + 144 = 4l, 2l = 5b + 7l - 705. Suppose 4x = 1152 - b. Is x a prime number? False Suppose -83 = -4l + 21. Let p(d) = -d2 + 5d - 2. Let a be p(2). Suppose 47 = at - 3c, -2t + 5c = c - l. Is t composite? False Suppose -4a + 16 = -132. Is a a prime number? True Let c = -362 + 646. Suppose -w = -5m + 741, 4m - 2w - 304 = c. Is m composite? False Is (-324)/(-14) + (-3)/21 composite? False Suppose -2i = i + 3x - 378, -4i = -2x - 486. Let r = 182 - i. Is r prime? True Suppose -4m - 20 = -2w, -w - 4m - 20 = -0m. Suppose w = -6o + 3o + 6. Let i(c) = 4c2 - c - 1. Is i(o) prime? True Let a be 1/(-4) - (-3976)/32. Suppose a = 4o - 112. Is o prime? True Let l(k) = -4k2 + 4k + 2k2 + k2 + k + 3. Suppose 2m - 3g + 0g + 1 = 0, -7 = 2m - 5g. Is l(m) prime? True Let l(g) = -1 - 2g + 4g - 1 + g*3 - 2g*2. Is l(3) prime? True Let w = -1645 - -3162. Is w prime? False Let m(f) = 35f. Let r be m(1). Is 7/r + (-1148)/(-10) composite? True Suppose -a - 7 = -6. Is (a/(-2))/((-5)/(-3890)) composite? False Suppose -4l + 369 - 53 = 0. Is l composite? False Let k(g) = g3 + 6g*2 - 6g + 8. Let i be k(-7). Let x = 6 - i. Suppose 3n = xu + 14, -3n + 5 = -u - 5. Is n a prime number? True Suppose 28 = 4q - 0q + 2l, 2l = 8. Let t(i) = i3 - 3i*2 - 8i + 5. Is t(q) prime? False Suppose -6o = -3o + 18. Is 200/6 + 2/o a composite number? True Let s(i) = 33i + 2. Is s(13) prime? True Suppose 2l = 3t + 3, 4l = 2l - 3t - 15. Let x(w) = -w. Let k(o) = -21o - 2. Let c(a) = k(a) - 4x(a). Is c(l) a composite number? True Suppose 2a = -5p + 959, -7p + 4p = -a + 452. Is a a composite number? False Let p be (-1)/(3/(-30)) - 2. Suppose -4v = h - 18, 4h + 3v - p = 64. Let g = h + -5. Is g prime? True Suppose -3f + 7f + 64 = 0. Let b = -9 - f. Is b prime? True Suppose 2a = -0a + 1288. Let d = -195 + a. Is d a composite number? False Suppose -5g + 9g = -20, 2g + 1052 = 2k. Is k prime? True Let t(k) = -80k - 1. Let h be t(-1). Suppose -d + 9 = 3. Suppose -5n = -dn + h. Is n a composite number? False Let a(c) = c*3 - 6c*2 + 8c - 14. Is a(9) prime? False Let v = -3 + 3. Let k be -26 - (-1)/(-3)v. Let f = k + 49. Is f a composite number? False Let r(g) = -g3 - 10g*2 - 9g - 3. Let p be r(-9). Is (-1 + -216)(p + 2) a composite number? True Let t = 1674 + -317. Is t a prime number? False Suppose -858 = n - 4n. Suppose -2p + 3p = n. Suppose 4x - 6x - 4i = -p, 546 = 4x - 5i. Is x composite? False Let t = -884 - -2343. Is t a composite number? False Suppose 3b - 2b = -5w + 12, -2b + 2w = 0. Suppose -5s + 1 = bz + 49, -3s - 44 = 5z. Is 1338/4s/(-12) composite? False Let x(t) = 9t*2 - 7t - 7. Is x(-5) a prime number? False Suppose 3k = 2r - 0k - 1171, 0 = 4r - 3k - 2345. Is r a composite number? False Let r(f) = f + 91. Let x(c) = 5 + 4c - 3c - c2 - 3. Let u be x(2). Is r(u) composite? True Suppose 3r - 10 = -2r, 245 = x - 4r. Is x a prime number? False Let f(n) = -n*3 - 4n*2 - 2n - 5. Suppose -h - 3h = 16. Let q be f(h). Suppose -b + qb - 28 = 0. Is b a prime number? False Let z(x) = -x*3 - 6x*2 + 7x + 6. Let s be z(-7). Let g = s + -1. Is (-5)/g + (-1 - -60) prime? False Suppose 0r - 252 = 2r. Suppose a + 272 = -3f, 0f - 10 = 2f. Let l = r - a. Is l composite? False Let c(w) = w2 + 8w + 3. Let q be c(-8). Let b = q + 30. Is b a prime number? False Let j(n) = n*2 - 4n + 11. Is j(-12) a prime number? False Suppose -j + 69 = -226. Is j composite? True Let r(u) = u - 3. Let i be r(3). Let v(q) = 2q2 - 3q + 5. Let x be v(4). Suppose 86 = 2o - io + 4k, 5k = -x. Is o a prime number? True Let a = -6 - -11. Suppose 36 = -2i + ai. Is 4/i - 92/(-3) a prime number? True Let w be ((-56)/35)/(1/5). Let h(t) = 2t2 + 10t - 5. Is h(w) a composite number? False Let c(t) = -24t. Let y be c(-1). Let x = -9 + y. Is x prime? False Let o = 236 - 73. Is o a prime number? True Suppose -5u = -4s + 20, -4u - 6 - 4 = -2s. Suppose 27 = -2n - 3n + 3f, -4f + 1 = sn. Let y = 14 + n. Is y composite? False Let g = 1304 + -613. Is g a composite number? False Let d = 5 - 1. Is (-1742)/(-18) + d/18 a prime number? True Let t(q) = q*2 + 3q - 9. Is t(-7) composite? False Let w = -2018 + 3967. Is w composite? False Suppose -3j - 2513 = -2w, 0w + 3j = 4w - 5035. Is w a composite number? True Suppose -10 - 166 = 4k. Let y = 75 + k. Is y composite? False Let v(i) = 190i - 5. Is v(3) composite? True Let s = 21 + 266. Is s prime? False Let a(i) = 2i - 1. Su	{ "pile_set_name": "DM Mathematics" }
000 to the nearest 100000. -2300000 What is 0.0000055632 rounded to 7 decimal places? 0.0000056 What is 39730 rounded to the nearest one thousand? 40000 What is -0.00000244 rounded to seven decimal places? -0.0000024 What is -0.001106 rounded to 4 dps? -0.0011 What is 0.000006169 rounded to six decimal places? 0.000006 Round 0.009254 to 4 decimal places. 0.0093 Round -163 to the nearest 100. -200 What is 44.521 rounded to the nearest ten? 40 Round -0.000067901 to five decimal places. -0.00007 What is -1787.1 rounded to the nearest one hundred? -1800 What is -40 rounded to the nearest ten? -40 Round 0.00001173 to seven dps. 0.0000117 Round -0.8068 to 1 decimal place. -0.8 What is -0.000007069 rounded to 6 dps? -0.000007 What is 0.04378 rounded to 2 dps? 0.04 Round -74748 to the nearest 1000. -75000 What is 8784 rounded to the nearest 100? 8800 Round 0.0000682 to 6 decimal places. 0.000068 Round 0.6422 to 2 decimal places. 0.64 Round 19610000 to the nearest one million. 20000000 Round -5.99 to 1 decimal place. -6 What is -11842 rounded to the nearest one hundred? -11800 Round -90000 to the nearest 1000000. 0 What is 551200 rounded to the nearest ten thousand? 550000 What is 5320.7 rounded to the nearest 100? 5300 What is -0.0000059 rounded to 6 decimal places? -0.000006 Round 5038.2 to the nearest one hundred. 5000 Round -56540000 to the nearest one million. -57000000 Round 12139200 to the nearest one hundred thousand. 12100000 Round 0.00000017547 to 7 dps. 0.0000002 Round -1.53539 to 1 dp. -1.5 What is -39.322 rounded to one decimal place? -39.3 Round 15571000 to the nearest 1000000. 16000000 What is 0.655 rounded to one dp? 0.7 Round 0.71423 to 1 decimal place. 0.7 What is 14993 rounded to the nearest one hundred? 15000 Round -0.000210629 to 6 decimal places. -0.000211 Round -0.001528 to 4 dps. -0.0015 What is 1013 rounded to the nearest 10? 1010 Round -17669400 to the nearest 100000. -17700000 Round 0.0000069953 to 6 dps. 0.000007 What is 0.00001019 rounded to 7 dps? 0.0000102 Round 0.03734 to 1 decimal place. 0 What is -0.0110705 rounded to 5 decimal places? -0.01107 What is 0.2007 rounded to 2 dps? 0.2 Round 2918.7 to the nearest 10. 2920 Round -4314300 to the nearest 10000. -4310000 What is -1131.42 rounded to the nearest 100? -1100 Round -1718900 to the nearest one hundred thousand. -1700000 Round 10.682 to the nearest integer. 11 Round 0.00024517 to five dps. 0.00025 Round -262700 to the nearest 10000. -260000 What is -25.539 rounded to one decimal place? -25.5 What is 5612 rounded to the nearest one hundred? 5600 What is 0.03507 rounded to three dps? 0.035 Round -13.854 to the nearest integer. -14 Round 0.000002826 to six dps. 0.000003 What is -0.010129 rounded to 4 decimal places? -0.0101 What is -2181500 rounded to the nearest 100000? -2200000 What is -49145000 rounded to the nearest one hundred thousand? -49100000 Round -2248000 to the nearest one hundred thousand. -2200000 Round 0.00001502 to five decimal places. 0.00002 Round -0.0341 to three decimal places. -0.034 Round 149.57 to 0 decimal places. 150 What is -21740000 rounded to the nearest one million? -22000000 What is -470000 rounded to the nearest one million? 0 Round -0.60729 to 2 decimal places. -0.61 Round -0.000275 to four decimal places. -0.0003 Round 4080.8 to the nearest 100. 4100 What is -118.1 rounded to the nearest ten? -120 Round 0.000049597 to 6 dps. 0.00005 Round -1.459 to the nearest integer. -1 Round 0.013868 to 3 decimal places. 0.014 What is 261000 rounded to the nearest ten thousand? 260000 Round 0.00083141 to 5 dps. 0.00083 What is -0.009112 rounded to four decimal places? -0.0091 Round -4751000 to the nearest one hundred thousand. -4800000 Round 118528000 to the nearest 1000000. 119000000 Round -0.0004797 to 5 dps. -0.00048 What is 169170 rounded to the nearest 1000? 169000 What is -0.0000051702 rounded to six decimal places? -0.000005 What is -0.00060398 rounded to 4 dps? -0.0006 What is -443400 rounded to the nearest ten thousand? -440000 Round 6166 to the nearest one hundred. 6200 Round 0.0000045475 to 7 dps. 0.0000045 Round 43.148 to the nearest integer. 43 What is 65100 rounded to the nearest 10000? 70000 Round 40.01 to the nearest integer. 40 What is -0.00000111 rounded to six decimal places? -0.000001 What is 71.09 rounded to zero decimal places? 71 What is -206.74 rounded to the nearest 10? -210 Round -0.0002435 to 5 decimal places. -0.00024 What is 15.772 rounded to one dp? 15.8 What is 39540000 rounded to the nearest 1000000? 40000000 Round 0.0002067 to 5 dps. 0.00021 What is -0.15319 rounded to 3 decimal places? -0.153 What is -427 rounded to the nearest one hundred? -400 Round -58.753 to the nearest ten. -60 Round -865.96 to the nearest integer. -866 What is 0.00324 rounded to two decimal places? 0 Round -48435 to the nearest 1000. -48000 Round 0.00000072758 to 7 decimal places. 0.0000007 What is 58.18 rounded to the nearest integer? 58 What is -0.000019662 rounded to 6 dps? -0.00002 What is -0.00010398 rounded to five dps? -0.0001 What is -64.95 rounded to the nearest 100? -100 Round -0.0000013029 to 7 decimal places. -0.0000013 Round -883060 to the nearest one hundred thousand. -900000 Round 0.037177 to four decimal places. 0.0372 What is -0.0000106084 rounded to 7 decimal places? -0.0000106 Round 0.5605 to one decimal place. 0.6 Round -1.155 to 2 decimal places. -1.16 What is 0.01137 rounded to four dps? 0.0114 What is -6.346 rounded to 1 decimal place? -6.3 Round 0.0000113423 to 7 dps. 0.0000113 Round 26.4 to the nearest integer. 26 Round 37800 to the nearest 1000. 38000 Round -43980 to the nearest 1000. -44000 Round -0.004821 to 3 decimal places. -0.005 Round 0.26739 to 3 decimal places. 0.267 Round 9222 to the nearest 1000. 9000 What is -1080 rounded to the nearest 100? -1100 Round 1.1747 to 1 dp. 1.2 Round -418360 to the nearest one hundred thousand. -400000 What is 60959000 rounded to the nearest 1000000? 61000000 What is -0.0001144 rounded to six decimal places? -0.000114 What is 0.09017 rounded to 2 decimal places? 0.09 What is 906.5 rounded to the nearest 10? 910 Round -53184 to the nearest 100. -53200 What is -0.00000058 rounded to 7 dps? -0.0000006 What is 0.002529 rounded to 4 decimal places? 0.0025 Round 1597 to the nearest one thousand. 2000 What is -10.575 rounded to the nearest ten? -10 What is -0.00000015615 rounded to 7 decimal places? -0.0000002 What is 104345000 rounded to the nearest one million? 104000000 Round -430.29 to the nearest one hundred. -400 Round 686000 to the nearest 100000. 700000 Round 0.0103 to two dps. 0.01 Round -0.0000552 to three dps. 0 Round 29.27 to the nearest integer. 29 What is 0.00014591 rounded to six decimal places? 0.000146 What is -0.0097 rounded to three dps? -0.01 What is 0.040802 rounded to 2 decimal places? 0.04 What is 0.08323 rounded to three dps? 0.083 What is 2884130 rounded to the nearest 10000? 2880000 Round 0.009 to two decimal places. 0.01 What is 0.1944 rounded to 1 dp? 0.2 What is -5110 rounded to the nearest 100? -5100 Round -0.47187 to 1 dp. -0.5 What is 0.16678 rounded to three decimal places? 0.167 What is -16004000 rounded to the nearest 1000000? -16000000 Round -0.0019918 to four dps. -0.002 Round -0.00142 to three decimal places. -0.001 What is -38.4 rounded to the nearest one hundred? 0 What is -0.000031 rounded to 5 dps? -0.00003 Round 0.77966 to three dps. 0.78 Round -0.4004 to 2 decimal places. -0.4 What is 0.00026 rounded to four decimal places? 0.0003 What is 199341 rounded to the nearest 10000? 200000 What is 0.000003883 rounded to six dps? 0.000004 Round 0.01016 to four dps. 0.0102 Round 0.00002504 to six decimal places. 0.000025 What is -0.0904 rounded to 2 dps? -0.09 Round -0.0031294 to three dps. -0.003 Round 817430 to the nearest 100000. 800000 Round -0.0000378 to 6 dps. -0.000038 What is 430 rounded to the nearest ten? 430 Round 83.46 to the nearest ten. 80 What is 496000 rounded to the nearest one hundred thousand? 500000 What is 4969000 rounded to the nearest one million? 5000000 What is -6.21182 rounded to zero dps? -6 What is 182980 rounded to the nearest one thousand? 183000 Round 0.3378 to two dps. 0.34 What is 134.277 rounded to 0 dps? 134 Round 2	{ "pile_set_name": "DM Mathematics" }
+ -5 + (6(-1 + sqrt(175)) - sqrt(175)) + -5)2 + -3 + -3. -800sqrt(7) + 4625 Simplify ((-2sqrt(1088)-2-4)2 - ((sqrt(17) + 3 + sqrt(2057))2 + sqrt(119)/(sqrt(7) - (sqrt(7) - sqrt(77)/sqrt(11))))) + 0. -73sqrt(17) + 276071 Simplify -2 + ((4sqrt(1900) + sqrt(1900) + sqrt(1900))-4 - (4sqrt(19)2 - (2 + -1sqrt(19))))2. -996sqrt(19) + 1178021 Simplify -5 + sqrt(5) + 3sqrt(5) + sqrt(20)/(sqrt(256) + sqrt(4)) + (-5 + -1sqrt(720) - (1(sqrt(720) - sqrt(720)2) - sqrt(720)))*2. -1043sqrt(5)/9 + 740 Simplify (-5(4(sqrt(77) + sqrt(77)2 + sqrt(77)) - ((sqrt(77) + sqrt(77) + sqrt(77)-1)-2 + sqrt(77))))/(31sqrt(448)6). -85sqrt(11)/144 Simplify -4((1(sqrt(153)-2 + sqrt(153)))/(-1-1sqrt(9)) + ((sqrt(17) - (sqrt(68) + 0)) + sqrt(17) + sqrt(17) - (3 + sqrt(833)))*2). -2484 - 140sqrt(17) Simplify (sqrt(130)-2-3)/(sqrt(1210)-1) + -1 + 1(sqrt(325)-3)2. -6sqrt(13)/11 + 2924 Simplify 2-4((sqrt(416)/(-4(sqrt(8) + sqrt(16)/sqrt(2))))/(((sqrt(36) - sqrt(324))-4)/sqrt(9)) + -4). sqrt(13)/8 + 32 Simplify -1(sqrt(200) - 4sqrt(200)2)2 + sqrt(14)/(5sqrt(7)) + -2sqrt(32). -9800 - 39sqrt(2)/5 Simplify ((sqrt(156) - 4sqrt(156)-2)/(sqrt(12) - sqrt(972)-1) + 2(sqrt(39) - sqrt(39)-1-3)/(sqrt(9)/sqrt(3)-4))2. 4693/100 Simplify (4-5sqrt(65)-1)/((1sqrt(245) + sqrt(245))1). 10sqrt(13)/7 Simplify 4((sqrt(5) - sqrt(30)/sqrt(24)) + sqrt(540)/sqrt(3) + sqrt(15)/(sqrt(192) - (sqrt(192) + sqrt(192)-2 + sqrt(192) - sqrt(192)))-4). 25sqrt(5) Simplify 1(((12sqrt(125) + sqrt(125) - (-5 + sqrt(125) + 0)) + 5)-2-5 + 4)*2. 20800sqrt(5) + 60816 Simplify (-2sqrt(3087)1-1)/((((sqrt(576) + 2sqrt(576) + sqrt(576))5 + sqrt(576) - sqrt(576)) + sqrt(576))-4). -sqrt(7)/48 Simplify (5(-6sqrt(2592)-51 + 5))*2. 270000sqrt(2) + 58320625 Simplify -6(-5 + (sqrt(280)/(sqrt(45)/sqrt(9)))/(sqrt(252)-5)). 2sqrt(2)/5 + 30 Simplify -3(-5(sqrt(18) - (sqrt(144) - sqrt(144)-1)/sqrt(8)))/(sqrt(6) + (-2sqrt(24)/sqrt(4) - sqrt(6)) + sqrt(24)/(1sqrt(4))). 15sqrt(3) Simplify 5(-4 + (-4sqrt(208))2) + -3-1sqrt(468)-4. -72sqrt(13) + 16620 Simplify ((-5(3 + -1 + sqrt(2736) + -1) + -5 + 4)6)2. 25920sqrt(19) + 2463696 Simplify ((-2(sqrt(1377) - -6sqrt(1377)-1 - sqrt(1377)) + -4 - ((0 + sqrt(1377) + sqrt(1377) - sqrt(1377)) + -4 - (sqrt(1377) + 0 + sqrt(1377))-3))6)2. 1239300 Simplify 3 + 5(2 + (1 + sqrt(1008))2 + (sqrt(448) - (sqrt(448) - (3 + sqrt(448) - sqrt(448))))2 + -4)-3. -15237 - 360sqrt(7) Simplify (((-6-1sqrt(198))/(1sqrt(55)/sqrt(5)))/((sqrt(99) + (sqrt(99) + sqrt(99) + sqrt(99)1)6 + sqrt(99))/(sqrt(44)/sqrt(4)-4)))*2. 72/25 Simplify ((sqrt(21) - (sqrt(525) + sqrt(525)-3) - (sqrt(21) - sqrt(105)/sqrt(5)-5))/((sqrt(108) - (sqrt(108)-2 - sqrt(108)))/(2sqrt(81))))2. 1575/16 Simplify 1 + 0 + -1 + sqrt(17) + 1 + 5 + 4 + -5 + -3. 2 + sqrt(17) Simplify (-1 + (2(sqrt(88) - (sqrt(88)-2-6 - sqrt(88) - sqrt(88))))/(5(sqrt(512) + (sqrt(512) - sqrt(512)3) - sqrt(512))))*2. -9sqrt(11)/20 + 2491/1600 Simplify 0 + -4(sqrt(475) - (0 + sqrt(475) - sqrt(475))2) + ((1sqrt(190))/sqrt(10) - sqrt(228)/(sqrt(36)/sqrt(3)))*21. -20sqrt(19) Simplify (-2(sqrt(104) + -1sqrt(104)) - (sqrt(104) + 3sqrt(104))1)/(-5((-2sqrt(240) + sqrt(240))/sqrt(10))/sqrt(3)). -4sqrt(13)/5 Simplify (0 + (-4 + sqrt(20)/sqrt(4) + -4 - sqrt(30)/(sqrt(6) + (sqrt(6) - 1sqrt(150)))) + 0)2. -64sqrt(5)/3 + 656/9 Simplify (1(0 + sqrt(98))4 + (1 + 0 + sqrt(98) - (sqrt(98)2 + 2 + sqrt(98))))2 + -2. -28sqrt(2) + 391 Simplify (((3 + (sqrt(1216) - -4sqrt(1216)))3 - 42(sqrt(1216)-5 + sqrt(1216)))2 + 0)1. 6768sqrt(19) + 2686225 Simplify 3(-1(-1 + sqrt(396)) + (-5 + 0 + sqrt(396))2 - 6(sqrt(396) + sqrt(396) + -1 + -2)). -414sqrt(11) + 1320 Simplify (0 + -63(5 + (sqrt(612) + sqrt(612)2 + 4 - sqrt(612) - (sqrt(612)12 + sqrt(612)))))*2. -34992sqrt(17) + 224532 Simplify 2 + (sqrt(525)-2 + (sqrt(1344)2 - sqrt(1344)))/(sqrt(384)/(sqrt(32)/sqrt(4)) - sqrt(192)1). sqrt(7)/2 + 2 Simplify -53(sqrt(85)-14)/((sqrt(550)/sqrt(11))/sqrt(10)). 60sqrt(17) Simplify 1(3(-4(3 + -3 + sqrt(147) + sqrt(147) + sqrt(147) + sqrt(147) + -2 + -2))2 + -2). -10752sqrt(3) + 113662 Simplify (-1 + (-1 + sqrt(242))-13 - (-5 + 0 + sqrt(242) + -4 + 0))*2. -968sqrt(2) + 3993 Simplify 3 + 3(-4 + 2 + -1 + 0 + sqrt(612))2-6. -11175 + 648sqrt(17) Simplify (((sqrt(153) + -1 + -2 - ((sqrt(153) - (-5 + (sqrt(153)1 - sqrt(153)))) + sqrt(153)))-1 + 4)2)*2 + 3 + 4. 288sqrt(17) + 1195 Simplify (4(sqrt(204) - 42sqrt(204) - sqrt(204) - 3sqrt(204)1))/(1(sqrt(972) - (sqrt(972) + -2sqrt(972))) + 1sqrt(972)6). -11sqrt(17)/18 Simplify -4((sqrt(25) + sqrt(1600)2)/(4sqrt(45)) - (-4 + sqrt(40)/(sqrt(8) + sqrt(24)/sqrt(3)) + -2)). -24 - 11sqrt(5)/3 Simplify -3 + (6(sqrt(84)2 + sqrt(84)))/(-1sqrt(588)) + (0 + (sqrt(700)-26 - (sqrt(700) - (sqrt(700) + 1))-2))*2. 3342sqrt(7)/7 + 100801 Simplify (sqrt(10)/(sqrt(405) + sqrt(5)) - (-5 + sqrt(72)))*2 - ((sqrt(90) - sqrt(10))5)/((sqrt(5) - sqrt(20)/sqrt(4) - sqrt(5))6). -172sqrt(2)/3 + 4731/50 Simplify 3 + (5 + (-52sqrt(2299) - sqrt(2299)) + -1 + sqrt(2299)-1 + -5)2. 264sqrt(19) + 331060 Simplify -3(-6sqrt(220)/sqrt(4) + sqrt(605)/(sqrt(33)/sqrt(3)))/(1(sqrt(11) + sqrt(77)/(sqrt(7) + sqrt(21)/sqrt(3) + sqrt(7)))4)4. 45sqrt(5)/4 Simplify ((sqrt(130) + 5sqrt(130)2 + sqrt(130) + sqrt(130) + sqrt(130))/sqrt(10)-3)2 - (-4 + sqrt(13)-2 + sqrt(13) + -1 + -1)-2. -2sqrt(13) + 22920 Simplify 5(-2 + (sqrt(9)/sqrt(3)6 + 2)*2 - 3sqrt(6)/((sqrt(4) + sqrt(100))/sqrt(2))). 235sqrt(3)/2 + 550 Simplify 3 + (-2(2sqrt(3)6 - (sqrt(3)-2 + 0) - (-1(sqrt(3) + sqrt(12)) + sqrt(3) + (sqrt(147) - (sqrt(147) + -1)))) + 1)*2. -192sqrt(3) + 3084 Simplify 1 + (-3((sqrt(500) - ((sqrt(500) + 0 + sqrt(500))-1)*2) + 4(sqrt(500) + 1)) - ((-1(2 + sqrt(500) + sqrt(500))2 - sqrt(500)) + 1 + -3)). -60sqrt(5) + 7995 Simplify -1 + (sqrt(1539)-2-2 + 3(-1 + sqrt(1539)) - (sqrt(1539) + (sqrt(1539) - (0 + 0 + sqrt(1539))2))3). 9sqrt(19) + 4613 Simplify -1(4 + (4 + sqrt(2)-1 - (2 + (sqrt(32))2))) + (sqrt(24)/(sqrt(8)/sqrt(4)))/(2sqrt(24) - sqrt(6)). 4sqrt(2)/3 + 26 Simplify -5(sqrt(72)1 - sqrt(18) - sqrt(18))/(6sqrt(486) - sqrt(486))-5. 0 Simplify 61(2(sqrt(1088)36 + 2 + (sqrt(1088) - (sqrt(1088) + -2))))*2-6. -50764032 - 165888sqrt(17) Simplify (((sqrt(336)/(sqrt(6)-2) + (sqrt(616)-2)/sqrt(11))/(sqrt(96)/(sqrt(768)-2)) + 0)5)2. 280000 Simplify ((3sqrt(102)1 + 2sqrt(102)-5)/(sqrt(294)-1 + (sqrt(150) - 2sqrt(150) - sqrt(150)))2)*2 + -5 + 5. 196/17 Simplify -5((3(2 + 1(sqrt(1872) + 1)))*2 + (0 + sqrt(1872) + 0 + sqrt(1872) + (sqrt(1872) + -1)-2)*2 + -5). -84640 - 3240sqrt(13) Simplify ((3 + sqrt(612)2-4 + -2(1 + sqrt(612)) + -2)4)*2. 1920sqrt(17) + 979216 Simplify ((1-2sqrt(102) - sqrt(102) - sqrt(102))/sqrt(6)6 + sqrt(1377)-1 + (sqrt(1377)-1 - sqrt(1377)) + 3)2-3. -132678 + 918sqrt(17) Simplify 3 + sqrt(637) + -1sqrt(13) + 3 + (sqrt(1573) - (-1 + sqrt(1573) + 0))*22. 8 + 6sqrt(13) Simplify (-4 + (-1 + sqrt(243))2 - ((sqrt(243) - 13sqrt(243)) + 0))*2. -432sqrt(3) + 3924 Simplify 2 + ((sqrt(726)3 + sqrt(726) + sqrt(726))/sqrt(3))2 + -5 + sqrt(2) + (-4 + sqrt(8))2. -15sqrt(2) + 6071 Simplify ((4(sqrt(210) - sqrt(210)-1))/(sqrt(1210)-2))/((sqrt(3) + sqrt(240)/sqrt(5) - 3sqrt(48))2). 2sqrt(7)/77 Simplify 5 + (-3-1sqrt(144)-5)/(-3((sqrt(96)1 - sqrt(96)) + sqrt(96))/sqrt(12)) + -2. 3 + 15sqrt(2) Simplify ((-3(1sqrt(91) + sqrt(91) + sqrt(91)) - sqrt(91))6-2)/(1(sqrt(35)/sqrt(45) + sqrt(14)/(sqrt(2) + sqrt(8)))). 180sqrt(13) Simplify (5(-2 + -4-2sqrt(891)) - 3((sqrt(891) + 1)5 + 0))2. -11250sqrt(11) + 557500 Simplify (sqrt(450)/(sqrt(10) + (sqrt(100)-5 + sqrt(100))/sqrt(10) + sqrt(10)))2 + 1 + (sqrt(1620) + sqrt(1620) + -1)2. -72sqrt(5) + 25973/4 Simplify 4-6(-3 + -2 + sqrt(833)1 + -3 + 4 + 1 + sqrt(833))2. -80184 + 2016sqrt(17) Simplify -2 + (sqrt(567) + -2 + 5 - (sqrt(567) + -1(-2 + sqrt(567) + sqrt(567)) + sqrt(567)) - (4 + ((sqrt(567) + -1)-3 - -1sqrt(567)3)))*2. -108sqrt(7) + 601 Simplify -1 + (-3(sqrt(85) - -1sqrt(85)) + 1(1sqrt(85) - sqr	{ "pile_set_name": "DM Mathematics" }
r + 3. Let n(m) = -120 - 2m + 110m2 - 108 + 231. Is n(r) prime? False Let f(v) = -v3 + 3v2 + 30v + 1. Let n be f(7). Suppose -nl + 3057 = -1653. Is l a prime number? False Suppose 12c - 20c = 13248. Let o = -898 - c. Is o composite? True Let v = 1038910 + 1521561. Is v a prime number? True Suppose -22b = 59b - 4075191. Is b prime? True Suppose -742558 = -6k - 4u, 2k - 7k = -2u - 618825. Is k a composite number? True Is ((-1540483)/(-98) - 4/(-14))(0 + 2) a composite number? True Let z = 36 + -35. Let u be 20/30(z - -2). Suppose -5w - 3y = -3155, -w - uw + 2y = -1893. Is w prime? True Is (-8)/(-2) - (50 - 21597) prime? False Let o = -18633 - -28766. Is o a prime number? True Let g = 949367 + -649234. Is g a prime number? False Let u(d) = -5d + 166. Suppose j - 16 = -2w, -j - 11w + 7w = -8. Is u(j) a prime number? False Let r = 10 - 4. Suppose u = ru - 110. Let w = 17 + u. Is w a prime number? False Suppose 0 = -3x - 107 - 61. Let m = 110 + x. Suppose -3u - 4w = -105, -7 + m = 2u - 5w. Is u a prime number? True Suppose -2l + 3 = -0a + a, -l = 0. Let o be ((-66)/(-9)a)/(4/178). Suppose -3w = -4w + o. Is w composite? True Let l(b) = -2 + 3b + 2 + 3 - 878b3 - 7807b*3 + 22b*3. Is l(-1) prime? True Let l(c) = 21c*3 + 3c*2 - 13c + 15. Let v be l(5). Let n = v - 545. Suppose -2103 = -5j + 6b - 2b, 0 = 5j - 5b - n. Is j a prime number? True Let o be -6((-2)/(-24))/(15/(-150)). Suppose -3174 = -3d + 3l, -18d - ol = -13d - 5260. Is d a prime number? False Is 35/(-70) + 20697/6 composite? False Let t = -62 + 61. Let o(w) = -20w - 5. Let r be o(t). Suppose 20p = rp + 4915. Is p prime? True Let q(z) = 1253z2 - 101z - 733. Is q(-21) prime? True Suppose 0 = 16y + 161 - 193. Is (y - -2) + 7566 + 1 a composite number? False Suppose -29o + 30o = 4i + 18377, -4o + 73544 = 2i. Is o a composite number? True Let x = 382 - 339. Suppose 4c - 10 = -3p + x, -c - 3p + 20 = 0. Is c composite? False Let k(a) = -3605a3 - 3a*2 + 165a + 514. Is k(-3) a composite number? False Suppose -4v + 5i = -63785, 0v = v + 2i - 15930. Suppose 10t + 10t - v = 0. Is t a prime number? True Let d(r) = -6r3 - r. Let j be d(-1). Suppose 20 = 5v, -j = -2s + 3v - 3. Let g(i) = 282i - 13. Is g(s) a prime number? True Is 144/28810137219 a composite number? True Suppose -g - 129448 = 4z - 9z, -3z + 77682 = -5g. Is z prime? True Let q = -563 + 571. Is (-1)/(q/(-4))-10-11351 a composite number? True Let r(x) = 40313x*2 + 24x - 92. Is r(3) a prime number? False Suppose 2b - 8o - 432785 = 284577, 717390 = 2b - o. Is b composite? False Suppose 2f + 2n = 594632, 3n = 5f - 252510 - 1234078. Is f a composite number? False Suppose 2775 = 3s - 4z, 0z + 1855 = 2s - z. Let b = s - 366. Let c = b + -372. Is c a prime number? True Let w be 3 + (-5 - 4) + 42949. Suppose -11427 - w = -10f. Is f prime? True Is (11/22)/((-5)/(-8656850)) composite? True Let o = 58 - 55. Suppose oi = -4s - 0s + 25393, 25399 = 4s - 3i. Is s prime? False Let s be ((-16)/(-10))/(1/((-15)/(-6))). Suppose 0 = 4d - 3b - 1, 5 = b + sb. Is (-3 - -511 - 6/(-2))d composite? True Let o = -76204 + 1224023. Is o composite? False Let o(q) = 5q*2 + 8q + 4. Let h be o(-3). Suppose -13071 = -28k + hk. Is k prime? True Let f = -53855 + 76728. Is f composite? True Is 34318((520/16)/(-13) + 3) a prime number? True Let h = -18 - -36. Suppose 6 - h = -4f. Is 0 + (f/(-1) - -118) a composite number? True Let n(d) = -2d2 - 14d + 11. Let b be n(-7). Let g(i) = 11i2 + 2i + 8. Is g(b) a prime number? True Let k(l) = 3580l2 + 84l - 263. Is k(3) a composite number? True Let b(n) = -n. Let v(w) = -27w - 11. Let z(t) = -3b(t) + v(t). Suppose -124h = -112h + 132. Is z(h) prime? False Let i = 1349 - 483. Let c = i + -423. Is c a prime number? True Suppose 3p + 2m - 41 = 0, 30 = 2p + 6m - 4m. Suppose 10r + pr = 223461. Is r a prime number? False Let n(r) = 2r - 12. Let x be n(11). Let o(c) = 7 - x - 19c - 39. Is o(-16) prime? False Let d(k) = 2k + 8. Let v be d(-2). Suppose 4f + 7z = vz + 70324, 0 = z. Is f composite? False Suppose 11n - 10n = -t - 70, 0 = -t. Let j = 3247 - n. Is j a composite number? True Let h = 437701 + -104604. Is h a prime number? True Suppose 204p = -240139 - 1192 + 1419023. Is p prime? False Let i(h) = 46693h2 + 52h + 21. Is i(-2) prime? True Let u = -141 + 116. Let y = 27 + u. Suppose -3a = ya - 7270. Is a a prime number? False Suppose 20x + 38x - 92x + 6077534 = 0. Is x a prime number? False Suppose 3b - 2t = 752, 221 + 1074 = 5b + 5t. Let y = b + 303. Is y prime? True Let r = 255063 - 66296. Is r a prime number? True Suppose 4d - 5264 = -3l, -5d + 0l + 6603 = -2l. Let p = d + 14768. Is p a composite number? False Let h(f) = 42f3 + 16f*2 + 28f - 137. Is h(12) a prime number? True Let z(c) = 13c2 - 3c - 3. Let o(n) = 3n2 + 3n. Let r be o(-2). Suppose 31 = -rs + 1. Is z(s) composite? False Let x(l) = 2l*3 + 18l*2 + 21l - 178. Is x(19) prime? False Let k = 230292 + -149983. Is k composite? False Let x(m) = 3 - 10m2 + 4m*3 - 5m*3 + 7m + 2m3. Let d be x(10). Suppose -9f + 3844 = d. Is f composite? False Suppose 14 = -7z - 42. Let h = z - -8. Suppose h = -4g - n + 1392, -4g - 2n + 0n = -1396. Is g composite? False Let s(y) = -3y - 54. Let w be s(-19). Suppose 2j = -wj + 30. Suppose 4z - i - 2448 = 0, -5i - 631 = 5z - jz. Is z a prime number? False Let u(c) = c*2 + 6c - 18 - 4 + 33. Let g be u(-5). Suppose i - 233 = -2a, -4a + 243 = gi - 5i. Is i a prime number? True Let s(a) = a*3 + 21a*2 - 38a - 22. Let b be s(23). Let j = -9451 + b. Is j a prime number? False Let g = 2348660 - 1437549. Is g composite? False Suppose -3x + 6x = -5p - 18591, -2p - 30985 = 5x. Let h = -3240 - x. Is h composite? False Suppose -726 = -170b + 49b. Let x = 3104 + -1815. Is b + -12 + x + 2/1 prime? False Let p(d) = 3d - 68. Let a(q) = 7q + 68. Let l be a(-7). Let x be p(l). Let g(s) = -s3 - 5s*2 - 3s + 8. Is g(x) prime? False Suppose 0 = -4m + 51 - 75. Let s(f) = -692f + 25. Is s(m) composite? False Let w(b) = 21277b - 681. Is w(10) prime? False Let f(l) = -l2 + 14l + 16. Let n be f(14). Suppose 0 = -ny + 18y + 172. Let s = 153 + y. Is s composite? False Let u(m) = 97m + 20. Let y be u(11). Let h = y - -2607. Suppose 2i - 4f - h = 0, i - 1847 = -0i - 2f. Is i prime? True Let g(j) = -295j + 34. Let y be 35/(-49)-7 - (12 - 0). Is g(y) a composite number? False Suppose -f = 48a - 50a - 8535, -4f + 2a + 34164 = 0. Is f prime? True Is (-6)/(-5) + 5472068690/3550 a composite number? False Is 10033845/55 + (0 - 24/44) a prime number? False Let b(l) = -l - 1. Let w(d) = -d + 1. Let k(h) = -2b(h) + w(h). Let t be k(6). Suppose -2595 = 4f - tf. Is f a prime number? False Let i(x) = 67 + 226 + 16972x2 + 24x - 16948x2. Is i(-17) prime? False Let m = -2280 - -785. Is -18 + 20 - (m - 2) a composite number? False Let m(u) = -19u*2 + 32u + 6u2 + 37u*2 + 13 + 97u*2. Is m(-6) composite? False Let g(w) = 3w + 23. Let u be g(-17). Let f be u/(-35) + 22/10. Suppose fc - 5x = 85, 3x + 54 = 2c - x. Is c composite? True Let c = -143682 + 217375. Is c composite? False Let d(t) = -t*3 + 14t*2 - 25t + 7. Let u(r) = r*3 + 2r*2 - 2r + 6. Let l be u(-3). Suppose -3y + 4 = -o + 15, 29 = lo - 5y. Is d(o) composite? False Suppose -p + 796 = 3p. Let j = p + -30. Suppose -6n - j + 1747 = 0. Is n composite? False Suppose z - 1740 = 3z. Let x = z - -1273. Suppose 282 + x = c. Is c a prime number? False Let q(n) = 2851n2 + 57n - 11. Is q(15) prime? False Let v(z) = 5172z2 - 264z + 1061. Is v(4) a composite number? False Suppose 33z + 21z + 14z = 5245724. Is z a prime number? False Let v be (-2)/1 - (-10 - (0 - 4)). Suppose 0o = -vo + o. Suppose 3n - 21324 = -n - 4i, -5n - 4i + 26651 = o. Is n prime? False Let l(w) = -w3 - 3w*2 + 63w + 125. Is l(-24) composite? False Suppose -4n = 3m - 14, 2m - 3n + 18 = -1. Let j be 0(2/(-2) - m) + 0. Suppose r + jk = k + 779, 5k - 773 = -r. Is r prime? False Suppose 10652739 = 54g + 71*g - 32672636. Is g a composite number? True Su	{ "pile_set_name": "DM Mathematics" }
ger? 15 What is 313069 to the power of 1/3, to the nearest integer? 68 What is 41747 to the power of 1/5, to the nearest integer? 8 What is 19352873 to the power of 1/3, to the nearest integer? 268 What is the square root of 3180786 to the nearest integer? 1783 What is the cube root of 384962 to the nearest integer? 73 What is the ninth root of 730042 to the nearest integer? 4 What is the square root of 823591 to the nearest integer? 908 What is 12701101 to the power of 1/6, to the nearest integer? 15 What is the third root of 59501 to the nearest integer? 39 What is the square root of 3675343 to the nearest integer? 1917 What is the third root of 76390 to the nearest integer? 42 What is the fifth root of 17414222 to the nearest integer? 28 What is the fourth root of 49861 to the nearest integer? 15 What is 392483 to the power of 1/9, to the nearest integer? 4 What is 14808363 to the power of 1/9, to the nearest integer? 6 What is the third root of 2532427 to the nearest integer? 136 What is the cube root of 431298 to the nearest integer? 76 What is the third root of 18661485 to the nearest integer? 265 What is 726053 to the power of 1/2, to the nearest integer? 852 What is the square root of 28114078 to the nearest integer? 5302 What is 286466 to the power of 1/3, to the nearest integer? 66 What is the square root of 1524289 to the nearest integer? 1235 What is 1690013 to the power of 1/5, to the nearest integer? 18 What is the tenth root of 7779046 to the nearest integer? 5 What is the seventh root of 7421893 to the nearest integer? 10 What is 130204 to the power of 1/2, to the nearest integer? 361 What is the ninth root of 55623 to the nearest integer? 3 What is 565515 to the power of 1/2, to the nearest integer? 752 What is the cube root of 42649139 to the nearest integer? 349 What is 661878 to the power of 1/2, to the nearest integer? 814 What is the eighth root of 172388 to the nearest integer? 5 What is the square root of 911906 to the nearest integer? 955 What is 1387132 to the power of 1/3, to the nearest integer? 112 What is 308974 to the power of 1/2, to the nearest integer? 556 What is the cube root of 1594255 to the nearest integer? 117 What is 207603 to the power of 1/3, to the nearest integer? 59 What is 843467 to the power of 1/7, to the nearest integer? 7 What is 10209001 to the power of 1/3, to the nearest integer? 217 What is 28228 to the power of 1/2, to the nearest integer? 168 What is the third root of 542621 to the nearest integer? 82 What is 243584 to the power of 1/3, to the nearest integer? 62 What is 18210 to the power of 1/6, to the nearest integer? 5 What is the eighth root of 1601374 to the nearest integer? 6 What is 29293283 to the power of 1/3, to the nearest integer? 308 What is 2004292 to the power of 1/3, to the nearest integer? 126 What is 1117265 to the power of 1/8, to the nearest integer? 6 What is 55553 to the power of 1/7, to the nearest integer? 5 What is the third root of 1971827 to the nearest integer? 125 What is 1687833 to the power of 1/2, to the nearest integer? 1299 What is 413387 to the power of 1/3, to the nearest integer? 74 What is the seventh root of 2137441 to the nearest integer? 8 What is the third root of 10923811 to the nearest integer? 222 What is 3834230 to the power of 1/2, to the nearest integer? 1958 What is the square root of 377552 to the nearest integer? 614 What is the cube root of 436722 to the nearest integer? 76 What is 9354358 to the power of 1/8, to the nearest integer? 7 What is 366729 to the power of 1/2, to the nearest integer? 606 What is 15744818 to the power of 1/2, to the nearest integer? 3968 What is the fifth root of 327298 to the nearest integer? 13 What is the ninth root of 18725807 to the nearest integer? 6 What is 298136 to the power of 1/2, to the nearest integer? 546 What is 861262 to the power of 1/8, to the nearest integer? 6 What is the square root of 632113 to the nearest integer? 795 What is 348032 to the power of 1/2, to the nearest integer? 590 What is 18545455 to the power of 1/2, to the nearest integer? 4306 What is 1499563 to the power of 1/2, to the nearest integer? 1225 What is the sixth root of 186164 to the nearest integer? 8 What is the square root of 4351523 to the nearest integer? 2086 What is the square root of 1835290 to the nearest integer? 1355 What is the eighth root of 1498817 to the nearest integer? 6 What is the fifth root of 1705203 to the nearest integer? 18 What is the square root of 5024719 to the nearest integer? 2242 What is the tenth root of 11233098 to the nearest integer? 5 What is the square root of 369172 to the nearest integer? 608 What is 2915459 to the power of 1/3, to the nearest integer? 143 What is the tenth root of 6242645 to the nearest integer? 5 What is the seventh root of 7234 to the nearest integer? 4 What is 387761 to the power of 1/2, to the nearest integer? 623 What is 777918 to the power of 1/2, to the nearest integer? 882 What is 955091 to the power of 1/5, to the nearest integer? 16 What is 405292 to the power of 1/2, to the nearest integer? 637 What is 169663 to the power of 1/6, to the nearest integer? 7 What is the cube root of 222699 to the nearest integer? 61 What is 224247 to the power of 1/2, to the nearest integer? 474 What is 7070049 to the power of 1/3, to the nearest integer? 192 What is the square root of 194149 to the nearest integer? 441 What is the third root of 715683 to the nearest integer? 89 What is the fifth root of 910812 to the nearest integer? 16 What is the square root of 12502639 to the nearest integer? 3536 What is the square root of 179779 to the nearest integer? 424 What is 896951 to the power of 1/8, to the nearest integer? 6 What is the tenth root of 24026885 to the nearest integer? 5 What is 629368 to the power of 1/10, to the nearest integer? 4 What is the third root of 172573 to the nearest integer? 56 What is the fourth root of 6801983 to the nearest integer? 51 What is the square root of 14243284 to the nearest integer? 3774 What is 1234473 to the power of 1/3, to the nearest integer? 107 What is the cube root of 170711 to the nearest integer? 55 What is the third root of 681111 to the nearest integer? 88 What is the fourth root of 539194 to the nearest integer? 27 What is the seventh root of 7155808 to the nearest integer? 10 What is the square root of 437358 to the nearest integer? 661 What is 614543 to the power of 1/10, to the nearest integer? 4 What is the fifth root of 5118184 to the nearest integer? 22 What is the third root of 428 to the nearest integer? 8 What is the cube root of 3879445 to the nearest integer? 157 What is the third root of 315796 to the nearest integer? 68 What is the seventh root of 3207713 to the nearest integer? 9 What is 165150 to the power of 1/3, to the nearest integer? 55 What is the square root of 5691506 to the nearest integer? 2386 What is the third root of 239392 to the nearest integer? 62 What is 739503 to the power of 1/7, to the nearest integer? 7 What is the tenth root of 1152322 to the nearest integer? 4 What is 46494 to the power of 1/2, to the nearest integer? 216 What is the square root of 88555 to the nearest integer? 298 What is the tenth root of 6271852 to the nearest integer? 5 What is 900292 to the power of 1/4, to the nearest integer? 31 What is the third root of 17638118 to the nearest integer? 260 What is the eighth root of 14832 to the nearest integer? 3 What is the third root of 604134 to the nearest integer? 85 What is 5500358 to the power of 1/2, to the nearest integer? 2345 What is the cube root of 328741 to the nearest integer? 69 What is 15280828 to the power of 1/2, to the nearest integer? 3909 What is the third root of 23478666 to the nearest integer? 286 What is the cube root of 1584 to the nearest integer? 12 What is the square root of 633053 to the nearest integer? 796 What is the square root of 2638875 to the nearest integer? 1624 What is the seventh root of 637171 to the nearest integer? 7 What is the cube root of 8794022 to the nearest integer? 206 What is the cube root of 3830980 to the nearest integer? 156 What is 5319268 to the power of 1/3, to the nearest integer? 175 What is the third root of	{ "pile_set_name": "DM Mathematics" }
1440/7200)/(2/18) 9/5 What is (49/1200)/(16/200-30)? -1/80 ((5/(-2))/((-13)/26))/((-23)/(621/(-270))) 1/2 What is the value of (4570/1371)/((-6)/(-27))? 15 What is the value of 16/(-36)-1(-7560)/560? -6 4/((-8)/21)(-15058)/67761 7/3 What is (((-67392)/(-663))/48)/(4/34)11/(-3)? -66 What is 3633/9688(112)/((-6)/(-20))? 15 Calculate (108(-37)/(-12987))/((-20)/26). -2/5 2((-2)/(-54))/((-604)/3624) -4/9 (33/(-506))/(19062/2824) -2/207 What is 9/((-9)/(-23))(2/10)/(66/110)? 23/3 What is ((-1584)/40392)/((-3)/(-102))(-87)/16? 29/4 Evaluate (4/(-2))/(10/(-5))(-2255)/55. -41 Evaluate 72/(-270)(-969)/(-76). -17/5 Calculate -222(-33)/(-1782)3. -37/3 What is the value of (-5633)/393(-3)/(-1)? -43 Evaluate (-12)/(-32)(4431/1266)/(17). 3/16 Evaluate -1720/(-1020)((-17544)/16)/17. -43/2 Evaluate ((-103680)/(-11664))/(16/(-54)). -80 Evaluate ((-6)/80)/((-104589)/(-185936)). -2/15 What is the value of ((54/15)/(-2))/(-37(-882)/31080)? -12/7 Calculate (2/4)/((-10924)/2294040). -105 What is the value of (((-24)/(-21))/(-2))/((-640030)/(-15449))? -2/145 Evaluate (-136)/4(-1388)/(-1735)105/24. -119 Evaluate (2930/1172)/(((-10)/(-15))/((-16)/(-5))). 12 Evaluate (2/(-10)-3)/(-182(-60)/1300). 1/14 What is the value of -8(1506629/536)/199? -113 (6/6)/(58/(-58))62/10 -31/5 What is (-91)/395166/64288? -3/16 What is (77/(-21))/((3/(-4))/(138/1012))? 2/3 What is the value of (8372/37674)/(1/(-234))? -52 What is 40/1002280/(-1938)? -8/17 10/(-39)((-2583)/(-82))/(-21) 5/13 (-5547)/(-216333)(-4602)/(-2) 59 What is the value of (2135/3355)/(4/(-22))? -7/2 What is -14(-6)/(-36)((-540)/(-1330))/(-27)? 2/57 Calculate (-9310)/(-175)((-13090)/(-68))/(-77). -133 -40(-40)/320078 39 What is the value of 160/(-120)(-4)/((-3640)/21)? -2/65 What is the value of (99/653422)/((-3)/(-387))? 43 Calculate 23(-50)/20700-181. 1 What is (25/120)/(1095/(-146))? -1/36 What is ((-4)/(-3(-150)/(-1305)))/(98/72)? 58/5 153626/(-1110)(-4)/1544 56/11 Calculate (42(-10)/(-15))/((756/(-72))/21). -56 Calculate ((720/28)/15)/((-1)/8(-28)/(-147)). -72 Evaluate ((-168)/3024)/((-2)/(-36)). -1 What is the value of (144/90)/((-126)/1575)? -20 (-380)/(-10)19116/12312 59 Calculate 2/20(1/(-7))/((-50)/(-125)). -1/28 What is 220/110114/(-152)-9(-2)/(-11)? 27/11 What is the value of ((132352/(-1410))/(-352))/((-5)/202/5)? -8/3 What is the value of (22400/8000)/((-343)/(-5))? 2/49 Calculate ((112/35)/4)/((-1048)/1608). -2/131 Calculate (-4956)/47220/7. -30 What is the value of ((-21)/(-130))/((-224732)/(-13483920))? 12/13 Calculate ((10/(-50))/((-135)/(-270)))/(-522/2). 2/275 Calculate (-2820)/1074/(-444). 47 What is the value of (-6)/(-3)(-4785)/638? -15 (-233)/(51260/2244)(-5)/1 51 Calculate ((0/1)/18)/((-434)/62). 0 Calculate ((-4)/(-406))/(-8(-53)/(-8904)). -6/29 Calculate ((-9)/(-15))/(5745/124475). 13 (19/(-184))/((-4450)/(-13350)(-9)/(-2)) -3/92 ((-3205)/(-641))/(25/(-420)-2) 42 Calculate (76/(-42))/((-131461)/193732). 8/3 What is the value of (2/(-40))/(10062/774012/13)? -1/24 What is the value of (16/(-4233))/(10062/(-57018))? 2/249 Evaluate -35(-4171)/(-1204)32/(-40). 97 Calculate 18/(-14)(-44954)/(-1482)2/24. -13/4 Evaluate ((-14)/(-77))/((-3006)/(-334)4/(-33)). -1/6 What is the value of (32/192)/((37/204)/(-37))? -34 What is the value of ((-2)/62)/(((-5)/(-450)45)/3)? -4 Calculate ((-10)/15238848/(-60700))/((-41)/2). -2/95 (((-495)/(-20))/(-9))/((-3)/24) 22 What is the value of (-3392/16698)/(2/(-363))? 33 What is the value of ((-24)/(-14))/(-3)17597517/(-85218)? 118 Calculate (-710052)/(-1690600)1(-15)/14. -9/20 Evaluate 32/(-36)(-588)/(-13720)5. -4/21 What is ((-4)/(-54))/(26144/(-4902))? -1/72 What is (-4738)/21321(-1458)/3? 108 What is (1936/(-220704))/((-9)/6-124/108)? -1/38 Evaluate ((-7335)/125510)/(3/(-70)). 15/11 Evaluate (-41955)/22376624/(-30). 39 What is the value of (-1022/(-385)-5)/((-666)/(-259))? -10/9 What is (14562/(-5663))/((-6)/8)? 24/7 What is (-40)/(-6)-40(-2349)/(-4640)? -135 ((-2)/26(-2249)/(-519))/(-1) 1/3 Evaluate 26885/(-16131)2/902/(-2). 1/27 Calculate 1390/(-417)(-142)/10(-36)/(84/(-7)). 142 What is the value of (-3619)/775520/1(-39)/4? 91 What is ((-10)/(200/3))/(52/((-2288)/165))? 1/25 Calculate (19((-10)/(-6))/((-5)/3))/(-1). 19 What is the value of 15/(-375)5(-5)/(-27)(-11718)/868? 1/2 What is the value of ((-75)/(-75)(-1)/(-8)2)/((-2)/(-40))? 5 Evaluate 130357/25644((-24)/(-1))/2. 61 Calculate ((-80)/96224/(-70))/((6/63)/(-2)). -56 What is ((-1)/9)/(24/24(-18)/5346)? 33 Evaluate (88/80)/((-10736)/(-1220)). 1/8 ((-16)/181425/50)/((-200)/450) 57 What is ((-29)/6)/(((-1056)/(-99))/32)? -29/2 What is the value of ((135/(-375))/(-3)10)/((-6)/70)? -14 Evaluate (4228/(-2718))/((-10)/(-18)). -14/5 What is the value of (-14)/33(-2766)/(-3227)? -4/11 ((-426)/(-1491))/(-26/(-2016)) 48 Evaluate (-189)/(-1701)96/(-656). -2/123 Evaluate (((-528)/(-30))/(2/(-5)))/((-182)/(-91)). -22 Calculate (8/8)/(2/6)182/42. 13 What is 78/(1009008/(-88))-14? 2/21 What is (-155)/(-558)18/(-60)192/(-84)? 4/21 What is ((-375)/(-125))/((2(-7)/49)/2)? -21 Evaluate (36/(-2))/6((-2150)/15)/(-10). -43 ((-18220)/10021)/(18/22) -20/9 Calculate 139/(4095/30)28/(-4). -2 What is the value of ((2497/(-908))/(15345/(-36)))/(1/(-5))? -1/31 (83136/105652)/((-5)/(-305)) 48 What is (4(-9)/(-12))/(2/(-10))209536/26192? -120 Evaluate 3072/(-72)3/(-54)-27. -64 What is (689/(-2))/((-52)/(-8))? -53 What is ((-247665)/1045)/((-6)/(-2))? -79 ((-378)/(-1050))/(315/68250) 78 What is the value of (((-78)/(-30))/13)/(((-40)/(-960))/(25/40))? 3 Calculate (1496/99)/(((-1372)/(-126))/(-49)). -68 What is the value of (3519481/(-12263))/(7/(-3))? 123 What is the value of 20/68(-138)/345? -2/17 -14140/(-56)(-1)/(-135)-6 -14/9 1317/43918/(-36)6/(-458) 2/229 Evaluate (150/(-630))/((-125)/900). 12/7 (((-72)/(-9))/((-40)/(-310)))/((-2)/(-1)) 31 What is the value of 564/470(-90)/72? -3/2 Evaluate (-128)/((-2688)/2205)4/(-20). -21 Evaluate ((-1)/(-2))/((9/(-120)-4)/((-198)/9735)). -2/59 (4/((-60)/15))/(((-6)/288)/((-30)/(-40))) 36 Calculate (2/((-8)/6)(-590)/(-27612))/(885/(-354)). 1/78 281484/11175/30 42 Calculate -88(4002/319)/69. -16 What is (19/((-4389)/(-28))(-18)/(-48))/(-2)? -1/44 Calculate ((-98)/77)/(1575/14850). -12 What is 52/(-208)56/3012/70? -2/25 Calculate (570/1051/(-1))/((624/(-14))/(-26)). -19/6 What is the value of (-12)/((-108)/(-253))(-534)/3916? 23/6 What is (-898)/404145/65? -2/13 Calculate ((-8)/(-13))/(-95(-14)/34580). 16 What is (((-7854)/(-44))/174/6)/((-1)/(-4))? 28 Calculate 110/(-11)(-1872)/416. 45 What is ((-3)/7)/((-124)/(-217))384(-21)/(-882)? -48/7 What is -6(-170)/(-24)106/265? -17 Calculate ((-28)/2027/(1458/(-450)))/(5/(-15)). -35 Evaluate 624/(-195)51/(-2)(-63)/(-28). 18 What is ((-1712)/(-4280))/((168/(-15))/1)? -1/28 (360/(-150))/(1069/(-920)) 16/5 What is (792/41382)/(32/(-528))? -6/19 Calculate ((-1386)/(-945))/((-1)/5(-9)/9). 22/3 Calculate (((-41)/((-1722)/42))/((-1)/(5/1)))/(-1). 5 Calculate ((-7752)/510)/(60/(-75)). 19 Calculate ((-8484)/(-101))/142/(-116). -3/29 Evaluate ((1/6)/(294/196))/(1/(-87)). -29/3 Evaluate -7(-118)/150332338. 13/7 What is the value of ((-2141)/6423)/((-2)/(-6))25? -25 What is the value of ((-6)/21)/(((-252)/56)/(45/20))? 1/7 Calculate ((-10)/(-8)-4)/(((-179)/(-9308))/((-2)/8)). 65 What is the value of ((-4)/(-14))/(24/(-70))182/91? -5/3 What is the value of ((5/2)/((-1740)/522))/(3/(-404))? 101 Calculate ((-2370)/1422(-6)/10)/((-10)/(-350)). 35 ((-10)/6)/(81180/(-353133)) 29/4 Evaluate ((3/20)/((14/(-16))/(67/804)))/1. -1/70 What is (((-585)/(-156))/(6/(-8)))/((-16)/(4416/(-12)))? -115 What is the value of (22/(-4)1)/((-81)/3175228)? 77 What is the value of 65/6435772/(-14)? -1/9 What is the value of ((-1)/(-120)(-18)/(-4))/((2106/104)/9)? 1/60 What is 0(-2)/(-30)4(-13)/312? 0 Evaluate (-8)/5(-4850)/1940. 4 Evaluate (-3837/(-6327))/((-50)/27675). -123 What is ((-264)/(-1))/(-80(-151)/(-6040))? -132 Calculate 57/95-365(-23)/(-3864)-14. 73/4 What is the value of 2/(-85)15540/(-1036)? 6/17 ((-6)/(-4))/(15/(-25))(-2)/(450/(-9)) -1/10 (-138)/(-3243)-942/(-1)2/(-4) -4 Calculate 161/(-69)12/1	{ "pile_set_name": "DM Mathematics" }
+ 5p - 2 = 0, b + 2b - 22 = 2p. What is the units digit of s(b)? 8 Suppose 0 = -w + t + 63, 3w - 181 = -t + 2t. Let h = w + 10. What is the tens digit of h? 6 Let y(s) = -s + 1. Let r(k) = 62k - 17. Let n(a) = r(a) + 6y(a). What is the hundreds digit of n(2)? 1 Let q(v) = v2 - v - 2. Let z be q(-1). Suppose z = -2i + 6i + 3a + 13, -3i + 5a + 12 = 0. What is the units digit of (-2 - i)(-60)/5? 2 Let b = 6 - 15. Let y = -4 - b. Suppose -164 + 54 = -yt. What is the tens digit of t? 2 Let y(w) = -w + 3. Let v be y(0). Let r(i) = i*2 - 4i + 3. Let c be r(v). Suppose cz - 2z = -74. What is the units digit of z? 7 Let j(i) = -3i3 + 12i*2 - 13i - 1. Let b(a) = a*3 - 6a*2 + 6a. Let k(h) = -5b(h) - 2j(h). What is the tens digit of k(-5)? 4 Let r = -13 - -22. Let c be r/4512/(-24). Let b = c + 70. What is the tens digit of b? 2 Let h = 1226 + -445. What is the hundreds digit of h? 7 Let a = 799 + -239. Suppose -132 + a = 2x. What is the tens digit of x? 1 What is the hundreds digit of 1/((9 - 7)/914)? 4 Suppose -4h + h + 1245 = 4s, 3h - 4s - 1221 = 0. What is the hundreds digit of h? 4 Suppose -12b + 17b = 360. What is the tens digit of (-1)/(b/(-71) - -1)? 7 Let i(j) = 2j2 + j + 2. Let s be i(2). What is the tens digit of (0 - -30)/(9/s)? 4 Suppose -3q + 10m - 12m + 5401 = 0, -2m = 4q - 7204. What is the tens digit of q? 0 What is the units digit of -5 + (86 - -5) - -6? 2 Let r be ((-16)/(-40))/((-1)/15). Let h be (4/r)/((-3)/756). Suppose -4b - 48 = -h. What is the tens digit of b? 3 Let o be 8/(4/(-2 + 0)). Let h(p) = -p3 + 6p*2 + p - 8. What is the units digit of h(o)? 8 Suppose 5b - 2k = 3b + 2282, 0 = -b - 3k + 1121. What is the thousands digit of b? 1 Let y = 352 - 81. What is the tens digit of y? 7 Suppose 116988 = 24o - 19140. What is the hundreds digit of o? 6 Let h = -80 - -85. Suppose -12 = hz - 512. What is the hundreds digit of z? 1 Suppose 0 = -2g + q + 12, 0 = 4g + 2q - 8 - 8. Suppose gy - 2901 - 649 = 0. What is the tens digit of y/30 - (-4)/(-6)? 2 Let b = 132 + 558. What is the units digit of b? 0 Let h be ((-30)/(-21))/5 + (-192)/(-14). Suppose m - 4n - 29 = 0, -2m + 4m = -4n + 58. Let p = m - h. What is the units digit of p? 5 Let f = -13 + 15. Suppose -3p = 4j - 9, -j - 3p = 2p - 15. Suppose i + 3w - 13 = j, -i + 31 = fw - 5w. What is the units digit of i? 2 Suppose -5w - 606 = -p, p + 5w = -p + 1152. What is the hundreds digit of p? 5 Suppose 7o + s = 4o - 205, 3o = -5s - 185. What is the units digit of 2(o/4)/(-5)? 7 Suppose 73g = 69g + 3368. What is the units digit of g? 2 Suppose 4a = 6a. Suppose -4q + 112 = -aq. Suppose -2h = -4r + 22, -r - 4h = 3r - q. What is the units digit of r? 6 Let w(m) = -m3 + 5m*2 + 5m + 3. Let p be w(6). Let l(i) = i + 1. Let h be l(p). What is the tens digit of ((-56)/h)/((-2)/(-3))? 4 Let b be (3/(-9))/((-2)/24). Suppose -d = -20 - b. Let k = -5 + d. What is the tens digit of k? 1 Suppose 3360 = 43l - 35l. What is the tens digit of l? 2 Suppose 3g + 11 + 1 = 0. Let h be g/18 + (-26)/(-117). Suppose h = 2v - v - 23. What is the tens digit of v? 2 Let p(a) = 16a2 - 5a + 4. What is the hundreds digit of p(7)? 7 Let l be 4 - (1 + 1) - 2. Suppose -2g + la - 2a = -2, -10 = -g + 2a. Suppose -s - 6p = -p - 49, 5s + gp - 182 = 0. What is the units digit of s? 4 Suppose -4416 = 13y - 54570. What is the tens digit of y? 5 Let w be (28 - -1)/(4 - 3). Suppose -3r = 5z - 11 + w, -5z + 3r = 42. What is the units digit of 4 + z/(-2) + 22? 9 What is the units digit of 2223/6 + 26/(-24)? 0 Suppose -3g - 5g = -160. Suppose 2j + 5w - 19 = 179, 5w = -g. What is the tens digit of j? 0 Let f be (22 - -2)-2 - -3. Let s = -14 - f. What is the units digit of s? 1 Suppose 0 = -5c + 1208 + 192. Suppose 4l = -l + c. Suppose -4p + l = -32. What is the tens digit of p? 2 Let u be ((-2)/6)/(4/(-384)). Suppose 0 = 3i - 1 - u. Suppose 2v - i = -3. What is the units digit of v? 4 Let u be (-13)/(-39) + (-26)/6. Let z = u + 16. Suppose 6w + z = 162. What is the units digit of w? 5 Let k(o) = -2o*3 - 2o*2 + 5o + 4. Let c be k(-4). Let t be c/(-14) - 4/14. What is the units digit of ((-4)/(-6))/(t/(-99))? 1 Let d(c) = 2c + 837. What is the hundreds digit of d(0)? 8 Suppose 1244 = 5v + 5l - 2141, -2v + 1354 = 4l. What is the hundreds digit of v? 6 Let u(s) = -62s*2 + 5s - 4. Suppose 2q + 16 = 5h, -3h - 11 = -h + 5q. Let w be u(h). What is the tens digit of (w/11)/((-1)/2)? 4 Let l(s) = 2s2 - 5s - 40. Let d be l(8). Let w = d - -7. What is the units digit of w? 5 Let j = 26 + -21. Suppose 2i - 9 = 5q + ji, -4i - 12 = -4q. Suppose q = 3f - 5f + 26. What is the units digit of f? 3 What is the hundreds digit of (-7)/(-147)-7-1251? 4 Let z(y) = -y + 4. Let m be z(-3). Let w = m + 4. Let v(s) = s - 8. What is the units digit of v(w)? 3 Let o(l) = -l2 - 10l + 2. Let r be o(-8). Let f = 12 + r. Let h = f + -10. What is the tens digit of h? 2 Let o = 233 + -36. What is the tens digit of o? 9 Suppose 5608 = 2i - 2c - 2942, 2i = 4c + 8558. What is the tens digit of i? 7 Suppose c - 4 + 1 = 0. Let q(t) = -8t + 11t + c + 16. What is the units digit of q(12)? 5 What is the hundreds digit of (9 - 15)/((-9)/(-6))-494? 9 Suppose 22d - 2926 = 48092. What is the units digit of d? 9 Let p be (31 + -1)/6 + (-1)/1. Suppose -6m + pm + 162 = 0. What is the units digit of m? 1 Suppose 1828 = p - n, 1824 = p + 83n - 82n. What is the units digit of p? 6 What is the tens digit of 23 - 2242/95 - (-3698)/5? 3 Let v(q) = q*2 + 8. Let w be v(0). Let p be (-22)/w - (-3)/(-12). What is the units digit of -3 + 11 + 3 + p? 8 Let z = 2360 + -801. What is the thousands digit of z? 1 Suppose -7l + 11l = 64. Suppose 0z + 3z - c = 83, -2c + l = z. What is the tens digit of z? 2 Let n(z) = z*2 - 9z + 12. Let u = 40 - 32. Let f be n(u). Suppose 20 = -p + 6p, 4i = fp + 240. What is the tens digit of i? 6 Let w = 118 + -62. Suppose -3d + w = -220. What is the tens digit of d? 9 Let m = 45 - 59. Let f be (-98)/(-4) + 1/(-2). Let p = m + f. What is the units digit of p? 0 Let x(p) = -4p3 - 3p*2 + 4p - 5. What is the units digit of x(-6)? 7 Let s = 19893 - 13461. What is the units digit of s? 2 Let o = 1581 + -1023. What is the units digit of o? 8 What is the hundreds digit of (-1)/(1/(-855)) - (-22 - -27)? 8 Let d(n) = -361n + 1. What is the units digit of d(-3)? 4 Let m = -67 - -69. Let o = 79 - m. What is the units digit of o? 7 Let i(o) = -o2 + 11o - 24. Let u be i(10). What is the tens digit of 714/15 - u/35? 4 Let k be -361(-5)/(-10)-2. Let b = k + -212. What is the tens digit of b? 4 Let p(c) = 4c3 + 18c + 3. What is the tens digit of p(5)? 9 Suppose 2z - 1384 = -400. Suppose 2i = v + 244, -4i + z = -v - 0v. Suppose 0 = -u - 4, -i = -a - 3a + u. What is the units digit of a? 0 Suppose -6x + 5x = 4, 5y - 5x - 55 = 0. Suppose -131 = -2c + 5n, y + 8 = -3n. What is the units digit of c? 3 Let w(s) = -s - 10. Let l(k) = -1. Let b(f) = 2l(f) - w(f). Let j be b(-6). Suppose -ju = 0, 4u - 14 = -4q + 30. What is the tens digit of q? 1 Let q(n) = -n3 + n2 - n. Let w(j) = -j*3 - 2j - 2. Let h(d) = -2q(d) + w(d). What is the units digit of h(3)? 7 Let f(x) = 7x*2 - 16x + 19. What is the tens digit of f(4)? 6 Let p(q) be the second derivative of -9q3/2 + 19q*2/2 - 32q. What is the hundreds digit of p(-5)? 1 Let o = -60 + 1079. What is the hundreds digit of o? 0 Let d be (3 + 0)(-38)/(-6). Let q = d - -38. What is the tens digit of q? 5 Let z(w) be the second derivative of -1/20w*5 + 7/12w*4 - 5w + 0 + 1/2w2 + 1/2w*3. What is the tens digit of z(7)? 2 Let q(p) = -p - 6. Let w be q(-11). Let g = w + -5. Suppose 15 = 3i, gt = -t - 5i + 32. What is the units digit of t? 7 Let f = 249 + 671. What is the hundreds digit of f? 9 Suppose 4w - 972 = -i, 4w = -i + 8w + 932. What is the tens digit of i? 5 Let g(j) = 111j - 104j - 3j*3 + 0 - 7j*2 + 3 + 4j3. What is the units digit of g(7)? 2 Let z(b) = b3 - 5b2 + 2b - 1. Let q be z(4). Let k(n) = 3*n + 1. Let a be k(q). What is the units digit of 28/(-42) + a/(-3)? 8 What is the hundreds	{ "pile_set_name": "DM Mathematics" }
(112))). -495sqrt(5)/14 - 15 Simplify (-1 + -1 + -5(-5 + (sqrt(1872) + ((sqrt(1872)-2 - sqrt(1872)) + -1 - sqrt(1872)) + sqrt(1872) - sqrt(1872)))-6 + -4)*2. 401760sqrt(13) + 15197796 Simplify (5sqrt(187)-4 - 64sqrt(187))/(-6sqrt(33)/(sqrt(72)/sqrt(6))). 44sqrt(17)/3 Simplify 1 + (-4(-1(((sqrt(637) - (-5 + sqrt(637))) + -3 - sqrt(637)) + 5) + 4)-3)2. -6048sqrt(13) + 93025 Simplify 2(sqrt(2448) + -2 + 0 + sqrt(2448) + 0 + -3 - (sqrt(2448)-4 + -2)-3)2. 5280sqrt(17) + 489842 Simplify ((sqrt(171) + -1sqrt(171))-5 - sqrt(171) - 1-3sqrt(171))/(sqrt(324) - sqrt(324)1 - sqrt(180)/sqrt(5)). -sqrt(19) Simplify ((sqrt(21) + 1sqrt(189))-3)/(sqrt(567) - sqrt(567)-4-3). 4sqrt(3)/33 Simplify (-51sqrt(1408) - (sqrt(1408) - 2sqrt(1408)-1))/(sqrt(792)/sqrt(2) - (sqrt(77)/sqrt(7) + sqrt(11))-3). -16sqrt(2)/3 Simplify ((2 + sqrt(200) + (sqrt(288)3 - sqrt(288)) + sqrt(288) + sqrt(288) + sqrt(288) + sqrt(288))-6 - (sqrt(6) - sqrt(42)/sqrt(28))/(sqrt(36)/sqrt(3)))*2. 11814sqrt(2) + 3878113/8 Simplify -5 + (-1 + sqrt(125) - sqrt(125))*2 + -4 + 3 + ((3 + -3sqrt(125))3-4)*2. -12960sqrt(5) + 163291 Simplify -4(-4 + (sqrt(2) - (1 + sqrt(2)))2 + sqrt(2) + sqrt(288) + 1)*2 + (sqrt(2) + sqrt(50) + 1 - (sqrt(2)-3 + 5))5. -1472 + 565sqrt(2) Simplify 6(((sqrt(432) - (sqrt(432) + (-1(sqrt(432) + 3) - sqrt(432))))-1 + (-5(sqrt(432) + 0) - sqrt(432)16))*2 + 2). 5616sqrt(3) + 438114 Simplify ((1sqrt(720) - sqrt(720))/(sqrt(12)/sqrt(4)-5))/((sqrt(2187)-1 + sqrt(2187) - sqrt(2187))/(-1sqrt(9)-1)). 0 Simplify (3 + -2 + ((-2sqrt(180) + -2)-4 - (-5 + -4 + (sqrt(180) - (sqrt(180) - 2sqrt(180))))))*2. 1296sqrt(5) + 6804 Simplify (-3 + (sqrt(6336) - (-5 + 0 + sqrt(6336))) + -2 + 4 + (sqrt(6336) - -3(sqrt(6336) + -2 - sqrt(6336)))-2)*2. -1536sqrt(11) + 25600 Simplify (((sqrt(154) + 2sqrt(154))6)/((sqrt(7) + sqrt(28) - sqrt(7))6))/((((sqrt(1100) - 2sqrt(1100)) + sqrt(1100) - sqrt(1100))6 - sqrt(1100))-6). sqrt(2)/280 Simplify (sqrt(300) + -3 - (2 + sqrt(84)/sqrt(7) + sqrt(12)))2 - ((-4 + (sqrt(588) - (sqrt(588) + 1)))2 + 5-2sqrt(588)). 108 + 80sqrt(3) Simplify -25-5((1sqrt(245)2 - sqrt(245) - -1(sqrt(245) + -1))2 - (3 + (1sqrt(245))*2 - (sqrt(245) + 1 + 0))). -1050sqrt(5) + 36700 Simplify (sqrt(1584)-1 + 1 + -2sqrt(1584)1 - ((1 + sqrt(1584))-6 - -1sqrt(1584)-1))*2 + 0. 672sqrt(11) + 25393 Simplify ((-5 + (0 + 2 + sqrt(153))-6 + -6(1 + 1 + sqrt(153)))4)2. 33408sqrt(17) + 365968 Simplify (sqrt(228)2-1 + sqrt(228) + (-2sqrt(228)4 - sqrt(228)))/((sqrt(3888) + sqrt(3888) + sqrt(3888)-1 + sqrt(3888))/(sqrt(196)-1)). 35sqrt(19)/9 Simplify (-1(-4 + (sqrt(1100) - (sqrt(1100) + 1)) - (sqrt(1100) + 5(sqrt(1100) + -2 - sqrt(1100)) - sqrt(1100) - sqrt(1100)))-6 + -3)*2. 3240sqrt(11) + 40329 Simplify (-3sqrt(980) - sqrt(40)/sqrt(2)3)/(sqrt(810)3 + sqrt(810) + 2sqrt(810)). -4sqrt(2)/9 Simplify (6(sqrt(216)-1 + (sqrt(1536)2 - sqrt(1536)) + sqrt(1536) + sqrt(1536) + sqrt(24)))/(1sqrt(12)154). 33sqrt(2)/5 Simplify -2(sqrt(720) + (sqrt(720) - (sqrt(720) - (sqrt(720) - 1sqrt(720))))2 + -3) - (-54((sqrt(20)/sqrt(4)2 - sqrt(5)) + sqrt(5)))*2. -7994 - 24sqrt(5) Simplify (4-4((sqrt(475) + 2)4 - (sqrt(475) + 2sqrt(475) + 5))-4)2. 122880sqrt(19) + 1982464 Simplify (-4sqrt(76)-3 - 4sqrt(76)-4)/((((sqrt(72) - sqrt(72)-2) + sqrt(72))/sqrt(3))/((sqrt(24)/sqrt(4) + sqrt(6) - sqrt(6))-4)). -28sqrt(19) Simplify (((sqrt(170) + sqrt(170) + -4-4sqrt(170) + sqrt(170))2)/((5sqrt(50))/sqrt(5)-5))*2. 24548/625 Simplify (-1 + sqrt(405) + -3 - sqrt(405) - -5(2 + sqrt(405)))*2 - ((5-1sqrt(405) - sqrt(405))2 + -5)4. -48139 + 540sqrt(5) Simplify ((-1sqrt(156)26)/(((sqrt(12) + (sqrt(48) - sqrt(12)))-3 + sqrt(12))-5) + -3)*2. 72sqrt(13)/25 + 7497/625 Simplify 0 + sqrt(108) + ((sqrt(108) - sqrt(108)3) + 0)2 - (2 + (sqrt(108)-1)*25). -110 + 6sqrt(3) Simplify (sqrt(384)-3-4 - sqrt(384))/(3sqrt(12)4) + -3 + -1. -4 + 11sqrt(2)/3 Simplify ((0 + (sqrt(95)/(sqrt(5) - -4-2sqrt(5) - sqrt(5)) - (sqrt(931) - (2sqrt(931) + -5))))1-1-5)*2. -6875sqrt(19)/4 + 1476875/64 Simplify (5((0 + (sqrt(2057) - (0 + sqrt(2057) - sqrt(2057))) - (sqrt(2057) - 1(sqrt(2057) + 1))) + 0)-4-2 + 4)*2. 38720sqrt(17) + 3293136 Simplify (1(sqrt(136) - (sqrt(136) + -2sqrt(136) + sqrt(136))) + sqrt(136)-1-5)/(sqrt(8) + sqrt(40)/sqrt(5)-6 + (sqrt(200) - -1sqrt(200))). 6sqrt(17)/5 Simplify 0 + ((sqrt(60) - (sqrt(960) - (sqrt(960) + (sqrt(960)2 - sqrt(960))))) + sqrt(60) - -1sqrt(540))/((1sqrt(24))/sqrt(2)4) + -4. -4 + 9sqrt(5)/4 Simplify -1 + (-2(-4 + (sqrt(98) + 1 + sqrt(98) - sqrt(98))6) + -3 + 4)*2. 504sqrt(2) + 14120 Simplify ((sqrt(130)-31 - sqrt(130)) + -4sqrt(130)-2)/(sqrt(10) - (sqrt(10) - sqrt(250)-2) - (3sqrt(110))/sqrt(11)). -4sqrt(13)/13 Simplify 1 + (sqrt(1088))2 - sqrt(153)/(sqrt(9)-4) - -3(2 + (1sqrt(153))/sqrt(9)). 13sqrt(17)/4 + 1095 Simplify (-5 + (2sqrt(684) + sqrt(19) - (sqrt(209)2)/sqrt(11) - (-1 + -1 + sqrt(304))) + 1)2. -28sqrt(19) + 935 Simplify (61sqrt(190)/(sqrt(250)1)6)*2-1. -24624/25 Simplify (((-2sqrt(68)-3 - 2(sqrt(68) - (sqrt(68) + (sqrt(68) - 1sqrt(68)))))-1)/((2sqrt(8)-3 - sqrt(8) - sqrt(8))/(sqrt(8) - sqrt(72))))2. 153 Simplify (sqrt(170)-3-16)/(sqrt(180)/sqrt(2)3). 2sqrt(17) Simplify 4(((5 + sqrt(80))6)*2 - ((sqrt(5) - -3sqrt(405)) + 2)). 5648sqrt(5) + 15112 Simplify (-6(sqrt(156) - (sqrt(156) - 2(sqrt(156) - 4sqrt(156)))))/(sqrt(60)/sqrt(5)-1 - (sqrt(12) - (sqrt(12)1 + sqrt(12))-1))-6. 54sqrt(13) Simplify ((sqrt(12) - sqrt(108)3)/(sqrt(6) + (sqrt(6) - (sqrt(486) - sqrt(486)1 - sqrt(486)))) + sqrt(20)/(5sqrt(50)/sqrt(5) - sqrt(10) - sqrt(10))5)-1. -31sqrt(2)/33 Simplify ((sqrt(24) - (-2sqrt(288))/sqrt(12)) + sqrt(24) - sqrt(216)3)/(sqrt(64)/sqrt(8)-2 + sqrt(800)6). -5sqrt(3)/58 Simplify -16((sqrt(1573) - ((-6sqrt(1573))2 + -2)) + (sqrt(1573)-6 + 4)*2)5-4. -62040sqrt(13) + 2160 Simplify ((-2sqrt(560))/(sqrt(5)4-1) - (-1(sqrt(77) - (sqrt(77) - -2sqrt(77))))/(sqrt(99)-3))*2. 2800/81 Simplify (-3 + -2(sqrt(75) - 2sqrt(75)2)*2)6-3 + 2. 24356 Simplify 3(-6sqrt(605)1 - (2(sqrt(605) + 0))2 - (sqrt(605)3 + -4 + 1(2 + sqrt(605)))). -7254 - 330sqrt(5) Simplify -2(2 + ((2(0 + sqrt(275)) - (sqrt(275) + -2sqrt(275) + -1))2 - ((sqrt(275) - (sqrt(275) - (sqrt(275) + 1)-4))-3)2) + -5). 2820sqrt(11) + 74542 Simplify 1((sqrt(176) - (0 + sqrt(176) + 0))2 - (-1 + sqrt(176)-1)) - (-1 + sqrt(176) + -1 + (sqrt(176) - ((sqrt(176) + -3)2)2)). -100sqrt(11) + 743 Simplify (-1 + (sqrt(7) + -5 + 0 + sqrt(7))4 + (-5sqrt(567)-1 + sqrt(567))-2 + -5)*2. 5200sqrt(7) + 70676 Simplify (-3((-1sqrt(20)-2 + -2(sqrt(20) - -2sqrt(20)))-1)/(sqrt(4) + sqrt(4) + sqrt(16)/(sqrt(4)-2) - sqrt(12)/(sqrt(3)-2)) + 5)*2. -60sqrt(5) + 205 Simplify -41-1(2sqrt(612)1 - sqrt(612) - sqrt(612))21. 0 Simplify 3 + (-6-6(sqrt(875) - -1sqrt(875)))/(sqrt(700)1 + sqrt(700) - sqrt(700) - sqrt(252)4). -180sqrt(5)/7 + 3 Simplify sqrt(18)/(-3sqrt(150))-4 + (3(-4 + -2 + sqrt(300)))2. -16196sqrt(3)/15 + 3024 Simplify (-3 + (sqrt(684) - sqrt(684)-2) + sqrt(684))-5 + -2 + (1(-4 + sqrt(684)) + 4 + sqrt(684) + 2)2. -72sqrt(19) + 2753 Simplify (sqrt(84)/(sqrt(14)/sqrt(7)) + sqrt(42) - (sqrt(504) - ((4sqrt(504) - sqrt(504)) + sqrt(504) - sqrt(504)))/sqrt(12))/((sqrt(672)-1)/(sqrt(28)2))6. -24sqrt(7) Simplify (0 + -1 + (3 + (sqrt(99) + (sqrt(99) - (sqrt(99) - -1sqrt(99))))*2 + (sqrt(99) - ((sqrt(99) - (1 + sqrt(99))) + -1) - sqrt(99)))3)-5. -70 Simplify (sqrt(22)/(sqrt(11) - sqrt(77)/(sqrt(7)2))-5 + sqrt(32)/(-2sqrt(4)) + (sqrt(8) - (sqrt(8) + 0)*2)5)4. -160 - 4sqrt(2) Simplify ((sqrt(76) + -3(sqrt(76) + (sqrt(76)2 + sqrt(76) + sqrt(76) - sqrt(76)) - sqrt(76)))-5-2)/(-11-4sqrt(8)/sqrt(2)) + 4. -20sqrt(19) + 4 Simplify 2(1sqrt(252) + (sqrt(756) + 2sqrt(756) + sqrt(756) + sqrt(756))/sqrt(12))/(sqrt(18)/sqrt(2)-2 - -3sqrt(27)/sqrt(3)). 14sqrt(7) Simplify -1 + 1sqrt(200) + sqrt(200) + (sqrt(200) + 0 + -5)2 - (-2sqrt(200)2 + 33sqrt(200))2. -4776 - 80sqrt(2) Simplify (-23sqrt(119) - (sqrt(119) + sqrt(119	{ "pile_set_name": "DM Mathematics" }
7y2 Let q(h) be the third derivative of h6/24 - 5h*4/24 - 5h*2. Find the second derivative of q(o) wrt o. 30o Let p(n) be the second derivative of n7/840 + n6/120 - n*3/6 + 3n. Let y(c) be the second derivative of p(c). What is the third derivative of y(k) wrt k? 6 Let p = -26/17 - -277/170. Let u(y) be the second derivative of 0 - py5 + 2y + 0y3 + 1/12y*4 + 0y*2. Find the third derivative of u(r) wrt r. -12 Let m(u) be the second derivative of -5u*4/3 + 10u*2 - 13u. Differentiate m(k) wrt k. -40k Let i = -9 + 92. What is the third derivative of 2 + 79l*2 - il*2 - 9l*5 - 2 wrt l? -540l2 Let h(g) = -g2 + 8g + 4. Let s be h(8). Suppose 0 = su - 12, n + 4u - 12 = 4. Find the second derivative of -nd - 4d2 + 7d*2 + 3d wrt d. 6 What is the third derivative of -4c6 + 6c*6 + 7c*2 - 5c*6 wrt c? -360c3 Let v(y) be the second derivative of y7/21 - 5y3/3 + 5y. What is the second derivative of v(r) wrt r? 40r3 Let k(t) be the third derivative of 4t7/105 + t4/3 - 3t2. Find the second derivative of k(p) wrt p. 96p*2 Differentiate -113v4 - 40 - v3 + 56v4 + 56v*4 wrt v. -4v*3 - 3v*2 Let f(y) = 8y*6 + 4y*5 + 4y*3 - 17y*2 - 4y + 4. Let g(u) = -u5 - u3 + u - 1. Let r(w) = f(w) + 4g(w). What is the third derivative of r(n) wrt n? 960n*3 Let m(x) = 9x*3 + 7x - 3. Let n(t) = 18t3 + 13t - 5. Let o(c) = 5m(c) - 3n(c). Find the second derivative of o(r) wrt r. -54r Let k be 2/6(-1)/2-9. Let m(a) be the first derivative of -a - 1 + ka*2. Differentiate m(s) with respect to s. 3 Let q(w) be the second derivative of 0w*5 + 0 + 0w*6 - 1/6w*3 + 0w*2 + 2/21w*7 - 4w + 0w4. What is the second derivative of q(z) wrt z? 80z*3 Let n(r) be the first derivative of 4r*2 - 2r + 2. Differentiate n(l) wrt l. 8 Let c(n) = 5n2 - 1. Let z be c(1). Suppose -y = -zy. Find the second derivative of ya - a5 + 4a - 3a wrt a. -20a3 Let g(o) = o3 - o*2 + o + 1. Let v(p) = 5p*4 + 5p*3 - 5p*2 + 5p + 7. Let u(l) = 5g(l) - v(l). Differentiate u(d) wrt d. -20d*3 What is the second derivative of 7 + 13u - 33 - 7u3 + 13 + 17 + u5 wrt u? 20u*3 - 42u Let h(y) = -2y - 7. Let n be h(-5). Let i be 7 + 12/(-2) + (2 - -1). Differentiate 7m - 6m + nm - 2m - i with respect to m. 2 Let s(y) be the second derivative of 0y*2 + 0y*6 + 0y*4 - 5/42y*7 + 5/6y*3 - 9y + 0y5 + 0. What is the second derivative of s(c) wrt c? -100c3 Let u(d) = d3 - 6d2 + 2. Let l be u(6). Suppose k + 3 = lk. Find the first derivative of -p*4 + 3p*3 + 3 - kp*3 + 2p*4 wrt p. 4p*3 Let h(v) = -5v*3 - 5v. Let z(f) = f5 - f3 + f. Let j(x) = 2h(x) - 10z(x). What is the second derivative of j(i) wrt i? -200i3 Let a(s) be the second derivative of -s3/2 + 21s*2/2 - 22s. What is the derivative of a(o) wrt o? -3 Let w(s) be the third derivative of -13s6/120 - s4 - 10s*2. What is the second derivative of w(p) wrt p? -78p Let t be 2 - (-4)/(4/3). Let w(c) = 6c3 - 5c*2 + 2c. Let m(k) = k3 - k2 + k. Let i(a) = tm(a) - w(a). What is the second derivative of i(q) wrt q? -6q Let w(b) = 13b3 + 5b - 19. Let n(i) = 7i3 + 3i - 10. Let s(r) = 5n(r) - 3w(r). Differentiate s(v) wrt v. -12v2 Let o(i) = -2i - 9. Let l be o(-6). Let h(r) = 5 + 0r + r2 + lr - r. Let z(f) = -1. Let j(a) = -h(a) - 5z(a). What is the second derivative of j(b) wrt b? -2 Suppose -l + 3l = 0. Suppose -4x - 8 = l, 2 + 2 = -3a - 5x. What is the third derivative of 0i*5 - 2i5 + i5 - ai2 wrt i? -60i*2 Let o(i) be the second derivative of 13i*4/6 + 13i*3/6 - 4i + 1. What is the second derivative of o(k) wrt k? 52 Let v(h) be the third derivative of -h*5/10 + 2h*3/3 - 9h*2. What is the first derivative of v(r) wrt r? -12r Let o(r) = -7r - 10. Let c(v) be the first derivative of 29v*2/2 + 41v + 2. Let y(w) = -2c(w) - 9o(w). Differentiate y(l) with respect to l. 5 Let p(w) be the first derivative of w4/2 + w2 - 33w + 46. What is the derivative of p(j) wrt j? 6j*2 + 2 Let g(b) be the third derivative of 0b*3 + 1/30b*5 - 3b*2 + 0b - 1/168b8 + 0b*7 + 0b*6 + 0b*4 + 0. What is the third derivative of g(n) wrt n? -120n*2 Suppose -3 - 3 = -2x. Suppose 5l - xl = 0. Find the third derivative of -d*3 - 3d*5 + ld5 + d3 + 2d2 wrt d. -180d2 Let k(n) = n2 + 5n + 2. Let l = 7 + -12. Let m be k(l). Differentiate -d2 - 1 - 5d*m + 3d*2 - 1 with respect to d. -6d Let a(s) = -13s2 - 39s - 2. Let c(g) = 51g2 + 156g + 9. Let z(v) = 9a(v) + 2c(v). What is the second derivative of z(b) wrt b? -30 Let y(x) be the second derivative of 8x7/21 + x5/20 + 13x*3/2 + 45x. Find the second derivative of y(s) wrt s. 320s3 + 6s Let w(v) = v3 - v - 1. Let k be w(2). What is the second derivative of -r4 + 2r + 3r - r - kr wrt r? -12r*2 What is the third derivative of 3o*3 - 6o*2 - 3o*3 + 15o*2 - 11o*4 wrt o? -264o Let d be 2/(-9) - (-4)/18. What is the second derivative of 3a - 4a - 4a3 + da wrt a? -24a Let l(w) be the first derivative of -w7/14 - w4/4 - w - 1. Let h(c) be the first derivative of l(c). Find the third derivative of h(f) wrt f. -180f*2 Let t(i) be the second derivative of 5i*7/42 + 2i*3/3 - 4i. What is the second derivative of t(f) wrt f? 100f3 Let t(h) = -10h*2 + 2h + 12. Let n(q) = -q*2 + 1. Let k(w) = 12n(w) - t(w). What is the second derivative of k(i) wrt i? -4 Let q(z) = -3z3 + 4z*2 - 4z + 1. Let p(c) = 3c3 - 3c*2 + 3c. Let v(m) = -4p(m) - 3q(m). What is the first derivative of v(n) wrt n? -9n2 Let s(w) be the third derivative of 0w*7 + 0w*6 - 1/60w*5 + 0w*4 - 1/112w*8 + 0 + 0w3 - w2 + 0w. Find the third derivative of s(y) wrt y. -180y2 Let i(d) be the third derivative of d9/60480 - d6/720 - d5/60 + d*2. Let p(s) be the third derivative of i(s). What is the derivative of p(q) wrt q? 3q2 Let p(x) be the first derivative of x4/6 + x*3/3 + x - 1. Let d(m) be the first derivative of p(m). Find the second derivative of d(o) wrt o. 4 Let x be -41 + 5/5. Let s = 1 - x. What is the derivative of -g*s - 8g*4 + 7g*4 - 3 wrt g? -8g3 Let b(l) be the second derivative of -l4/4 - 3l2 + 3l. What is the derivative of b(u) wrt u? -6u Let v(w) be the first derivative of w8/168 + w5/15 - 3w*2/2 + 2. Let h(q) be the second derivative of v(q). What is the third derivative of h(g) wrt g? 120g*2 Let x(b) be the third derivative of -4b*2 + 4/3b*3 + 0b - 2/15b5 + 0b*4 + 0. Differentiate x(g) wrt g. -16g What is the third derivative of 12s2 + 9s*2 + 30s*4 + 14s*2 - 8s*2 wrt s? 720s Let a = 11 + -4. Let v = a - 3. Find the second derivative of w + w*4 - 3w*4 - 2w - w*v wrt w. -36w*2 Suppose 4d + 9 - 33 = 0. Suppose 0x = 3x - d. What is the third derivative of -3n2 - 2n*2 + 3n*2 + xn*4 wrt n? 48n Let u(o) be the first derivative of -20o3/3 - 55o + 10. Find the first derivative of u(l) wrt l. -40l Let z(b) be the second derivative of -7b*6/10 + 13b4/12 + b2/2 - 3b + 3. What is the third derivative of z(d) wrt d? -504d Let r(k) = -k*2 - 4k + 1. Suppose l + 15 = -4l. Let t be r(l). Differentiate 1 + 2q*t + 0q*4 - 3q*4 wrt q. -4q*3 Let z(j) be the first derivative of -8j*7/7 + 6j*3 - 14. Find the third derivative of z(k) wrt k. -960k*3 Let j(m) be the first derivative of -14m*3 - 25m*2/2 + 51. What is the second derivative of j(s) wrt s? -84 What is the second derivative of -3k*4 + 8k + 5k + 8k*4 + 8k*4 wrt k? 156k*2 Suppose 0 = 4i - 4z, 0 = -4i + 3z + 4. What is the third derivative of 4c*5 + 0c*2 - ic5 - c2 + c*6 wrt c? 120c3 Let r(k) = k5 - 6k3 + 3k*2 + 6k - 6. Let d(t) = -7t3 + 2t*2 + 7t - 7. Let w(z) = 6d(z) - 7r(z). What is the third derivative of w(v) wrt v? -420v2 Let i(n) = -n - 7. Let v be i(-9). Suppose c = -v + 6. Find the first derivative of -2 + 5t - ct - 3t wrt t. -2 Let w be (-99)/540 - (-2)/6. Let u(l) be the second derivative of 0l4 - wl*5 + 0l*3 + 0 - 3/2l*2 - 2l. Differentiate u(f) wrt f. -9f*2 S	{ "pile_set_name": "DM Mathematics" }
580c3 - 15668558c? -82953480c What is the third derivative of -85377528p*5 + 4796p*2 - 309p + 2 wrt p? -5122651680p2 Find the third derivative of 515448086z*4 - 16051645z*2 + 5z. 12370754064z Find the second derivative of -254k*2x*2 + 3k*2x - k*2 + 2kx2 - 77kx + k + 56x*2 + 35x + 2 wrt x. -508k2 + 4k + 112 Find the first derivative of 1208290v + 9482973. 1208290 Find the second derivative of -409743188r*2 + 1479548r - 16. -819486376 What is the first derivative of 1235999b2ko + 4b*2k - b*2o - 4b2 + 3bk + 26bo - 5b - o + 4 wrt k? 1235999b2o + 4b2 + 3b What is the second derivative of 396067470j2 + 4229034j wrt j? 792134940 What is the third derivative of 165386c3qr + 6c*3qu - c3r*2u - 71c2qu - 4823c*2r*2u + 2c2r - 4cqru + 2r2u wrt c? 992316qr + 36qu - 6r2u What is the second derivative of 611620070c2 + 1611792c - 110 wrt c? 1223240140 What is the third derivative of -9089407z6 + 937924269z*2 wrt z? -1090728840z*3 What is the third derivative of 56972637n*4w2 + n4w - 38n*2w - 58718w2 + 6 wrt n? 1367343288nw2 + 24nw Differentiate -7kr2 + 682218kr + k - 8850r*2 - 1648 wrt k. -7r*2 + 682218r + 1 What is the second derivative of 24220955n2 - 299035n - 6 wrt n? 48441910 Find the third derivative of -2j2m*3 - 9j*2m*2 + 2719jm3 + 2734026jm2 - 581m*3 wrt m. -12j*2 + 16314j - 3486 Find the third derivative of k*5 + 509358412k*3 - 2k*2 + 14k - 10586291. 60k2 + 3056150472 What is the third derivative of 50576864t*5 - 246t*2 + 318133t wrt t? 3034611840t2 Find the third derivative of -7605r*6 - 6860r*3 - 76r*2 + 788r + 1397. -912600r3 - 41160 Find the first derivative of 251053022l*4 + 385904711. 1004212088l*3 What is the third derivative of 101ls3 - 26674ls2 - l + 1683742s*3 + 195s wrt s? 606l + 10102452 What is the second derivative of -322216506b*2h*2 + 23523bh2 + 3bh - 495h*2 wrt b? -644433012h2 Find the third derivative of -f5 + 2129027f4 + 25776476f*2 wrt f. -60f*2 + 51096648f What is the second derivative of -142215218x2 + 302167283x? -284430436 What is the first derivative of -61665453fk*3 + 9668016k*3 wrt f? -61665453k*3 What is the derivative of 607673a*2bj + 42a*2 - 2ab + 17aj - 150249a wrt j? 607673a2b + 17a Find the second derivative of -84016w*5 - 15w*3 - 345w - 167858. -1680320w3 - 90w What is the first derivative of 764120161l - 1547644921? 764120161 Find the third derivative of 32352199k*2w*3 + 2k*2w*2 - 3268k*2 - 2kw - 53w*2 + 62 wrt w. 194113194k*2 What is the first derivative of 31666219d*3 - 20597174? 94998657d*2 Find the third derivative of -2nx3y - 2nx*3 + 248nxy + 10697x3y + 16x3 - 406x*2 wrt x. -12ny - 12n + 64182y + 96 Find the third derivative of 2066635f*3l*2 - 300f*3l - 451839f2l - 77fl*2 wrt f. 12399810l*2 - 1800l Find the second derivative of -101k3l + k*3 - 58540k*2l + 30kl - 3k + l + 2302 wrt k. -606kl + 6k - 117080l What is the third derivative of -18366053k*3 - 39323446k*2 wrt k? -110196318 What is the third derivative of 581986r*3 - 13456018r*2? 3491916 Find the third derivative of 42t*3v*3 - 3t*3vx + 15t*2v*2xz + 97t*2x + 1303v3xz - v3 + 3vz wrt v. 252t*3 + 7818xz - 6 What is the third derivative of -10w*4 - 169475w*3 + 3733772w*2 wrt w? -240w - 1016850 Differentiate -2649858l2u*3 + 1067l*2 - 2lu4 - 640l + 20 with respect to u. -7949574l2u*2 - 8lu3 Find the second derivative of 71351933d*2 + 152638138d wrt d. 142703866 What is the second derivative of 32859879r4 - r2 + 35388956r? 394318548r2 - 2 Find the second derivative of -22v*5 + 2247v*4 + 164v*2 + 77996040v wrt v. -440v3 + 26964v2 + 328 Differentiate -a3i - 29a*3 + 6014229a*2i*4 + 5a*2 - 6494a wrt i. -a*3 + 24056916a*2i*3 What is the third derivative of 65g*4u - 2g3u + 37820g3 - 3g*2u - 42g2 - 2383gu - 6 wrt g? 1560gu - 12u + 226920 Find the third derivative of 56a4 - 133472a*3 + 64039785a*2 + 1. 1344a - 800832 What is the second derivative of 11232423u4 - 17805637u wrt u? 134789076u2 Differentiate -25j*3 - 901846j*2 - 217892735. -75j*2 - 1803692j What is the second derivative of 4744c2sw + 18938518c*2w*2 + 56c*2 + 4csw - cs + c - 4sw2 + 3sw - s wrt w? 37877036c*2 - 8s Find the second derivative of -85r4 + 11196r*2 - 10r + 3255. -1020r2 + 22392 What is the derivative of -70ju3 + 145ju + 5j + u*3 + 8007u*2 + 496u wrt j? -70u3 + 145u + 5 Find the second derivative of -44103n4 - n2 - 3077629n + 2 wrt n. -529236n2 - 2 What is the first derivative of -998077664d - 667195754 wrt d? -998077664 What is the derivative of 37i4 + 29376i*3 - 2388034? 148i*3 + 88128i*2 Find the first derivative of 109l*2w + 21214l2 - 12w + 20757 wrt l. 218lw + 42428l What is the second derivative of 140725435u*2 + u - 77225480? 281450870 What is the third derivative of 10fp4 - 5127fp3 + 17276fp2 + 283f + 6p4 + p3 wrt p? 240fp - 30762f + 144p + 6 Find the second derivative of -7o*4s + 255o3s - 1234o2s - 1277097os - 15s wrt o. -84o*2s + 1530os - 2468s What is the second derivative of 18407365a*2s*3 - as*3 - 106as - a + 86s*2 + 18s wrt a? 36814730s3 What is the derivative of 627g*4t*3 + 6117g*2t*3 - 65413117t*3 wrt g? 2508g*3t*3 + 12234gt3 What is the third derivative of 18930738q*3 - 112038497q*2? 113584428 What is the first derivative of -11c*3 - 107c*2 - 1477c - 56404605? -33c2 - 214c - 1477 What is the second derivative of 36097919c4 - 97969c + 3? 433175028c2 Find the second derivative of 3a*5 - 6907a*4 + 226a*3 + 53a - 26983 wrt a. 60a3 - 82884a*2 + 1356a Find the third derivative of -343400k3 + 27900628k*2. -2060400 What is the third derivative of 25o*2r*4 - 6292o*2r*2 - 30290o*2r + 1505765or*3 - 5r*4 wrt r? 600o*2r + 9034590o - 120r Find the third derivative of 105587i2k*3 - 2817596i*2k*2 - 33ik3 - 2i - 2k3 - 4k*2 wrt k. 633522i*2 - 198i - 12 Find the third derivative of a*3h*3 - 7148486a*3h*2 - 226031a*2h*3 - 2a*2 wrt a. 6h*3 - 42890916h2 Find the second derivative of z4 + 124411z3 - z2 - 8353194z wrt z. 12z2 + 746466z - 2 What is the derivative of 13287232l3x + 90535594l3 wrt x? 13287232l*3 Differentiate 39717561i*2sz + 84i*2 + 40953z wrt s. 39717561i2z Differentiate 121754o3 + 2o*2 - 189o + 15788143 with respect to o. 365262o2 + 4o - 189 Find the second derivative of 5t4 + 2565t*3 + 23t*2 - 4623859t - 6 wrt t. 60t2 + 15390t + 46 Differentiate -1866479n2 + nz - 11482406z wrt n. -3732958n + z What is the second derivative of -3b3r*2z*3 + 84804b*3rz3 + b3z*2 - 47926br2z*3 - 2brz - 10bz*3 wrt r? -6b*3z*3 - 95852bz3 Differentiate -3w*4 - 38w*3 + 935509w + 34549263 wrt w. -12w3 - 114w*2 + 935509 What is the third derivative of -408788739g*6 - 42g*2 - 8g - 23144 wrt g? -49054648680g3 Find the second derivative of -8018q*3 + 2q*2 + 1492737q - 1 wrt q. -48108q + 4 What is the second derivative of f4 - 119206704f*3x*2 + 2fx2 - 2fx - 31f - 96x + 1 wrt f? 12f*2 - 715240224fx2 Find the third derivative of -17869500t*3 - 13281384t*2. -107217000 Find the second derivative of 36823389q*2 + 3466657q wrt q. 73646778 Find the first derivative of 14n4 + 600452n - 78719025. 56n3 + 600452 What is the second derivative of 83497f*2w*2y*2 + 15f*2w*2 + 6f*2y - 3fw - 2fy*2 - 2fy - 201wy - 2y wrt w? 166994f2y*2 + 30f*2 What is the third derivative of -29c*6 + 1105c*5 - 1596c*3 + 134910c*2 + 148 wrt c? -3480c*3 + 66300c*2 - 9576 What is the second derivative of -16120194w*5 + 8213836w? -322403880w3 What is the first derivative of 5273420u - 936260 wrt u? 527	{ "pile_set_name": "DM Mathematics" }
rest ten thousand. 0 Let v = -1811810.5955 - -1813638. Let d = v + -1827. Let i = 0.4 - d. What is i rounded to three dps? -0.005 Let d = 74 + -106. Let v = -0.531 - 30.429. Let b = v - d. What is b rounded to 1 decimal place? 1 Let q = -18835080 + 18835092.000091. Let y = 12 - q. What is y rounded to 5 decimal places? -0.00009 Let u = -809 + 2197. Let s = u - 1381.87. Round s to 0 dps. 6 Let j = 42 + -36.1. Let g = -4.74 + j. Let v = g + 0. What is v rounded to 1 dp? 1.2 Let x = -1.2 + 1.192. Let b = x + -40.992. Let t = -41.47 - b. What is t rounded to one decimal place? -0.5 Let p = -0.01667 - 262.08333. Let h = p - -277. What is h rounded to zero dps? 15 Let f = -8.5000034 - -8.5. Round f to 5 dps. 0 Let i be (2 - 2) + 1 + -1. Suppose 0 = -4c + 6 + 6, 4n + 4c - 12 = i. Suppose 4 = 4l, -449 = 5h + l - nl. What is h rounded to the nearest 100? -100 Let u = 26911 - 54911. What is u rounded to the nearest 10000? -30000 Let l = 92 + 70. Let t = l + -161.999923. What is t rounded to five dps? 0.00008 Let d be (-1)/3 + (-5)/3. Let b = -2151 - -6560. Let g be d/(-6) + b/3. What is g rounded to the nearest 100? 1500 Let d = 17 - 17.0432. Let t = 0.0431538 + d. Round t to six decimal places. -0.000046 Let r = 760.536 - 758. Round r to one dp. 2.5 Let z = 13.9 - 117.1. Round z to 0 decimal places. -103 Suppose s + 4s = s. Suppose 0l = 3i + 3l - 291, -3l = s. Round i to the nearest 10. 100 Let z = 413 - 413.0000624. What is z rounded to 5 dps? -0.00006 Let h = 71 + -69. Suppose 2l - 5202 = -13j + 9j, hj - 2605 = -5l. What is j rounded to the nearest 10000? 0 Suppose -n + 0a - 575 = 4a, 3n - 2a = -1683. What is n rounded to the nearest 10? -560 Let n = 46 - 42.56. Let d = 4.4 - n. What is d rounded to 1 decimal place? 1 Let x = 355.00585 - 355. What is x rounded to 4 decimal places? 0.0059 Let f = 0.96 - -18.36. Round f to the nearest integer. 19 Let a = -998868319.0000078 + 998868408. Let o = 89 - a. What is o rounded to six dps? 0.000008 Let z = 159314141 - 159314161.8000089. Let o = 98 + -118.8. Let t = z - o. What is t rounded to 6 decimal places? -0.000009 Let a = 3.768 + -3.9. Let k = -0.007 - a. What is k rounded to 2 decimal places? 0.13 Suppose -4b + 4a + 1422 = -2b, 1422 = 2b + 5a. What is b rounded to the nearest 100? 700 Let k = -121 + 264. Let y = -142.9999814 + k. Round y to six decimal places. 0.000019 Let i = 3.6 - 2. Let w = -7.93 + 9.5. Let j = i - w. Round j to 2 dps. 0.03 Let u = -2.6 - -1.14. Round u to the nearest integer. -1 Let r = -49 + 47.86. Let m = 47.59 + -47. Let p = m - r. Round p to 1 decimal place. 1.7 Let n = -4.04 - 17.22. Let z = n + 21. Let s = -0.2557 - z. Round s to three decimal places. 0.004 Let n = -41 - -46. Let w = 23.5522 + -28.55219. Let r = w + n. What is r rounded to 4 decimal places? 0 Let l = -0.2 + 0.17. Let y = 0.263186 - 0.2331854. Let n = l + y. What is n rounded to 7 decimal places? 0.0000006 Let c(d) = 10 - 4849997d + 0 - 4. Let h be (-8)/6(-12)/(-8). Let f be c(h). Round f to the nearest 1000000. 10000000 Suppose 2g - 17 = -11. Suppose 2z = 4, -z - gz - 1412 = -2y. Round y to the nearest 100. 700 Suppose 0 = 149w - 150w - 25710. Let m = -5910 - w. Round m to the nearest one thousand. 20000 Let j = 0.15 + 0.115. Let g = -0.035 + j. Let n = 1.21 - g. Round n to 1 decimal place. 1 Let y = 91781 + -91734.00006. Let o = y + -47. What is o rounded to 5 decimal places? -0.00006 Let w = 1.97 + 0.03. Let c = 2.06 - w. Let u = 0.033 - c. What is u rounded to two decimal places? -0.03 Let k = -585 - -1325. Suppose 0 = c - 4c - 2400. Let o be k/1c/(-8). What is o rounded to the nearest ten thousand? 70000 Suppose 0 = -16g + 12107224 + 2964776. What is g rounded to the nearest 1000000? 1000000 Suppose -16y + 14y = 0, 4y = 5t + 62950. What is t rounded to the nearest 100? -12600 Let i = 0.02 - 0.01. Let z = i + -0.04. Round z to 2 dps. -0.03 Let m = -3.9424 + -0.0676. Let o = m - 2.77. Let t = o - -0.88. Round t to 0 dps. -6 Let f = -23 + 23. Suppose f = -5p + 8 + 7, -5p + 185 = -2m. Round m to the nearest 10. -90 Let x(a) = -a2 - a + 8. Suppose 0w + 4p = -5w - 36, 0 = -2w + 5p + 12. Let t be x(w). Let q be (27102 - (t + 6))/1. Round q to the nearest one thousand. 27000 Suppose -5s + u + 3 = 0, 12 = 3s + s + 4u. Let q(x) = -969999x3 - x2. Let m be q(s). What is m rounded to the nearest one hundred thousand? -1000000 Let q = 19888116 - -20357327. Suppose -3545443 + q = x. What is x rounded to the nearest one million? 37000000 Let k(p) = -13700p - 1096. Let a(z) = -2. Let x be 3/(3/2) + 1094. Let v(r) = xa(r) - 2k(r). Let g be v(5). Round g to the nearest ten thousand. 140000 Let p = 4996830 + 3103170. What is p rounded to the nearest one million? 8000000 Let s be 1/(0 - 1) + 2. Suppose -m - s = -0m. Let w be (-206)/(-4)-134 - m. What is w rounded to the nearest one thousand? -7000 Suppose 0 = 12k - 4k + 120000. Let v be k15/((-12)/(-4)). What is v rounded to the nearest 10000? -80000 Suppose 3f - 6171 = -2m, -3m - 11f = -9f - 9264. Round m to the nearest 1000. 3000 Let s = 2524 - 4422. Let c = 2012.3 + s. What is c rounded to the nearest 10? 110 Let y = -15 - -1. Let d = -30 - y. Let i = d - -18.8. What is i rounded to the nearest integer? 3 Let m = -73.4855 - -0.7055. Let o = 0.78 + m. Let s = 72.0062 + o. What is s rounded to three decimal places? 0.006 Let x = -6.51 - -6.510000531. What is x rounded to 7 decimal places? 0.0000005 Let p = -122792.7226674 - 1.7193326. Let t = p + 122805.44200144. Let m = t + -11. Round m to seven dps. 0.0000014 Let c = 2883 + -69283. Round c to the nearest one hundred thousand. -100000 Let k = -16.63 - 1.97. Let q = k + 37.5. What is q rounded to 0 decimal places? 19 Let k = -0.021 - -0.037. Let a = k + -0.0211. What is a rounded to three dps? -0.005 Let a = -17.568 + -0.332. Let u = 0.9 + a. Let s = 17.07 + u. Round s to 1 dp. 0.1 Let v = -604 - -855. Suppose -vo + 254o = -3510000. Round o to the nearest one hundred thousand. -1200000 Let p = -1.59 + 1.5899515. What is p rounded to 5 decimal places? -0.00005 Let l = -24.8329 - -0.1579. Let z = 25 + l. Let f = z + -0.35. What is f rounded to 2 dps? -0.03 Let t be 785675/(-22)26. Let i = 858550 + t. What is i rounded to the nearest one hundred thousand? 400000 Let j = -9 + 9.54. Let q = -0.5400171 + j. What is q rounded to six dps? -0.000017 Let d = 11311 - -5509. Round d to the nearest ten thousand. 20000 Let y = -8288 - -4221. Let i = 5767 + y. What is i rounded to the nearest 100? 1700 Let j = -0.413 + -0.951. Let p = -1.14 - j. Round p to 1 dp. 0.2 Let r = -1.806 + 4.552. What is r rounded to one decimal place? 2.7 Let o = -90 - 69. Let t = 20853.94993 + -20694.951. Let g = o + t. What is g rounded to four dps? -0.0011 Let t = 49 - 48.859. Let m = 0.1252 - t. What is m rounded to three dps? -0.016 Let c = 16186.999 - 16208. Let l = -21 - c. Round l to 2 decimal places. 0 Let n = -280.00000001 + 280. Round n to 7 decimal places. 0 Suppose 0 = -3i + 4b + 1012804, 2b + 675202 = 2i - 0b. Round i to the nearest 10000. 340000 Let b = -5.55 - 9.2. Let v = 13 + b. Round v to one decimal place. -1.8 Let n = 3 - 2.938. Let f = -866.9407 - -867. Let b = n - f. What is b rounded to three dps? 0.003 Let k = -0.53 + 0.5. Let f = k - 0.07. What is f rounded to 0 decimal places? 0 Let g(v) = 2066v - 2. Let a = -2 + 8. Suppose -2x + 0 = a. Let s be g(x). Round s to the nearest 1000. -6000 Let j = 754 - 753.998729. What is j rounded to four decimal places? 0.0013 Let v = -15.86083061 - -0.06036561. Let i = v + 15.8. What is i rounded to four decimal places? -0.0005 Let u = 111340 + -302840. Round u to the nearest 10000. -190000 Let l = 2.636 + -2.63602206. What is l rounded to 6 decimal places? -0.000022 Let s(k) = 715k2 - 16k + 21. Let y be s(21). Round y to the nearest 10000. 320000 Let u = 58.6114 + -58.5. What is u rounded to 2 decimal places? 0.11 Let b = 14 + -5. Let c = 9.162 - b. Let r = -0.1620101 + c. What is r rounded to 6 decimal places? -0.00001 Let i = -2557.015414 + 2557. Round i to four decimal places. -0.0154 Let f = 1196 + -1195.9993586. Round f to 4 dps. 0.0006 Let i = -1483.9999627 + 1484. Round i to five decimal places. 0.00004 Let	{ "pile_set_name": "DM Mathematics" }
third derivative of 2k3m*3 + 2k*3m2 - k3 - 4k2m*3 - km*3 - 36710km2 - 479m*3 wrt m. 12k*3 - 24k*2 - 6k - 2874 What is the second derivative of 844854o3 - o - 358026 wrt o? 5069124o What is the third derivative of -95856m3 - 85190m*2? -575136 What is the second derivative of 11240x*5 + 7x*4 - 296300x? 224800x3 + 84x*2 What is the third derivative of -45f*2i*3 - 13361f*2i*2 + 5fi3 - 2fi2 + 3i*3 wrt i? -270f*2 + 30f + 18 Differentiate 614028k2 + 438930 with respect to k. 1228056k What is the derivative of -948bsy - 4bs + 7by3 - by + 2sy - 58544s + y3 - 2 wrt b? -948sy - 4s + 7y3 - y What is the second derivative of -20669y*4 - 65065y? -248028y2 Find the third derivative of -105v*6 - 11v5 - v4 + 42684v2 wrt v. -12600v*3 - 660v*2 - 24v What is the second derivative of -932r3 - 27505r wrt r? -5592r Differentiate 7439s*2 + 20s + 926948 wrt s. 14878s + 20 What is the second derivative of -45hkx*2 + hkx + hk + 3hx*2 + 704kx2 + 32kx + 2k + 284 wrt x? -90hk + 6h + 1408k Find the second derivative of -f*4 + 86010f*3 + 59696f + 4 wrt f. -12f2 + 516060f What is the first derivative of -177863nz*2 + 3z*2 - 114751 wrt n? -177863z*2 What is the third derivative of 45970f*3m*2 + 2f*2m*2 + 10592fm2 wrt f? 275820m*2 What is the third derivative of -75r*6 + 10r*4u + r*3u + 2r2u + 9r2 - 4591u wrt r? -9000r3 + 240ru + 6u Differentiate 178846b4 + 3502341. 715384b3 Find the third derivative of -f2v4 - 83842f*2v*3 - 3f*2v*2 + 76540fv2 wrt v. -24f*2v - 503052f2 Differentiate -50668a + 4741 wrt a. -50668 What is the second derivative of 1414g4p*2 + 12g*4 + gp*2 - 205p*2 - 94p - 2 wrt g? 16968g2p*2 + 144g*2 Find the first derivative of 1559f*4 - 2f*2t*2 - 75f*2x - 2t2x - 13203t2 + 28x wrt f. 6236f3 - 4ft2 - 150fx Find the third derivative of -1807235i*3 + 853322i*2. -10843410 Find the third derivative of -25613f*3y3 + f2y2 + 3fy2 + 4fy - 1681y*3 wrt f. -153678y*3 What is the second derivative of -2tw3 - 9tw2 + 5tw - 171t - 232w4 - w - 4 wrt w? -12tw - 18t - 2784w2 What is the third derivative of 4224dt3 - 2dt2 - 10dt - 39d - 32t5 + 4t*2 - 2 wrt t? 25344d - 1920t2 Find the second derivative of -5875x*5 + 63792x. -117500x3 What is the first derivative of -aqx2 + 4043aq - 2ax2 + 1226ax + qx*2 + 2qx - 2x*2 + 7x wrt q? -ax2 + 4043a + x*2 + 2x What is the third derivative of 66p2v3 + p2v2 - 400p*2 - 3pv2 - 308v*3 wrt v? 396p*2 - 1848 What is the second derivative of -151285j*4 - 8j3 + j2 - 2418207j? -1815420j*2 - 48j + 2 What is the second derivative of -28k5 + 39480k*3 - 1265934k? -560k3 + 236880k What is the second derivative of -14bg*2q*2 - 5bq2 - 4132b + 3g3q*2 - 8g*3q wrt q? -28bg*2 - 10b + 6g3 Find the third derivative of -2p*5 - 6p*4 - 1341p*3 - 391624p*2. -120p*2 - 144p - 8046 What is the derivative of -60305r4 + 26753? -241220r*3 What is the first derivative of -10180o*4 + 3o - 121077? -40720o3 + 3 What is the second derivative of -2h5 - h4 - 682h2 + 2222h - 6 wrt h? -40h3 - 12h*2 - 1364 Find the third derivative of 13j*3l*2n*2 - 661j*3l*2n - 8070j3ln3 - j3n*2 - 2jn + 10l*2n3 + l2n2 wrt n. -48420j*3l + 60l2 What is the third derivative of -1745737n*4 + 949161n*2? -41897688n What is the second derivative of 2n3v*2 + 26n*2v*2 + 2315n*2 - 3nv + 2n + 2v2 - 330v + 2 wrt n? 12nv*2 + 52v*2 + 4630 Find the third derivative of 615tv6 - 11tv5 + 24tv2 - 16tv - 6v wrt v. 73800tv*3 - 660tv2 What is the first derivative of -32064t - 452024 wrt t? -32064 Find the first derivative of 34b3y - 155621b3 - 27b*2y - 7by + 2b wrt y. 34b*3 - 27b*2 - 7b What is the second derivative of 4611gk*2o*3 - 237gk2o - 28029gk + 2k2o*3 + 52o*3 wrt k? 9222go3 - 474go + 4o*3 What is the second derivative of 77117g*4 - 5715g + 2? 925404g2 What is the second derivative of 8h*4 + 2h*3 - 101693h*2 + 348774h wrt h? 96h2 + 12h - 203386 Find the first derivative of a*2o*3 + 9467ao3 + 11ao + 20o3 - o2 - 552o + 1 wrt a. 2ao3 + 9467o*3 + 11o Differentiate -28574v - 17461 with respect to v. -28574 What is the derivative of -230691k*2 + 1193286? -461382k What is the third derivative of 779117q5 + 3q*2 + 70914 wrt q? 46747020q*2 Find the third derivative of 53643t*3 + 31t*2 - 27t + 4. 321858 Find the second derivative of -4305977d2n*3 - 696dn3 + 426d + n*2 wrt d. -8611954n*3 What is the third derivative of -1136199q*3 - 31q*2 - 3q + 2142? -6817194 What is the first derivative of -11s3 - s2 + 2357s + 822462? -33s2 - 2s + 2357 What is the third derivative of 516f6o*2 + 6f*6o + 5102f2o + 2o2 wrt f? 61920f*3o*2 + 720f*3o Differentiate 2598h3 - 260h - 583988. 7794h2 - 260 Find the third derivative of 322598j*4 + 4014j*2 wrt j. 7742352j Find the first derivative of -213607b2c - 2b2 + 9151b - 3 wrt c. -213607b2 Find the third derivative of 100071r*3 + 192396r*2. 600426 Find the third derivative of 510t*6 - 14t*5z*3 + 3t*2z*3 - 6034t + 14z3 wrt t. 61200t*3 - 840t*2z*3 Find the third derivative of 1716b*3 - 3085b*2 - 7b. 10296 What is the derivative of -136403x2 - 27177 wrt x? -272806x Find the second derivative of -814849b2 - 52656b - 7. -1629698 Find the third derivative of 173409y3 + 12y*2 - 293y - 1. 1040454 Find the second derivative of 1192901s3 + 160525s - 2. 7157406s What is the second derivative of f4 - 6f*3 + 63f*2 + 46f + 60 wrt f? 12f2 - 36f + 126 Find the third derivative of -2431k3z*2 + 12k*3z - 447k2 - k - 11z*2 wrt k. -14586z*2 + 72z Find the third derivative of -1557l5 + 2l*4 - 4l*3 + 15l*2 - 1978 wrt l. -93420l*2 + 48l - 24 Find the second derivative of -u*5 - 111527u*4 - 59u + 943 wrt u. -20u3 - 1338324u*2 What is the third derivative of 16383o6 - o2 - 2563o? 1965960o*3 Differentiate -259899s*2 + 184375 with respect to s. -519798s Find the third derivative of -28299sv*5 - 5sv4 - 8434sv + 2s - 2v2 - 4 wrt v. -1697940sv2 - 120sv Find the second derivative of -12a*4 + 72a*3 + 8a*2 - 129844a. -144a2 + 432a + 16 Find the third derivative of 167d3ko2 - 90d*3o*2 + 471d*2k + 24d2o*2 + 6o*2 wrt d. 1002ko2 - 540o*2 Find the first derivative of -17469p*2 + 6p + 230539 wrt p. -34938p + 6 What is the second derivative of -387697b*4 - 392666b? -4652364b2 Differentiate 104j*3o*3 - 3276j*3o*2q - j*3o - 82o3q - o - 37 wrt q. -3276j3o*2 - 82o*3 Find the third derivative of -211817i*3 + 339i*2 - 13i + 3 wrt i. -1270902 Find the third derivative of it3 + 65599it2 + t6 + 583t*4 wrt t. 6i + 120t3 + 13992t Find the first derivative of 1551ry*4 - 2ry - 43799r - 2y wrt y. 6204ry3 - 2r - 2 What is the third derivative of -687f6 - 339f*4 + 723721f*2 - 2? -82440f*3 - 8136f What is the second derivative of -20d3i*2o + 9d3i + 5d3o*2 + 8dio*3 - 1650i*2o*3 - 2io3 - 5i wrt i? -40d3o - 3300o3 Find the second derivative of -1094194q*5 + 11621q - 4 wrt q. -21883880q3 Differentiate 108fi3 + 142fi - 30736f with respect to i. 324fi*2 + 142f Find the first derivative of 476664g + 938558 wrt g. 476664 What is the first derivative of -779d*2 - 17d + 67530? -1558d - 17 Differentiate -2978m*3v*2z + 6m3 - 1556m*2z - 15mv*2z - 4z wrt v. -5956m*3vz - 30mvz What is the second derivative of 2210635f3 - 33f + 3220? 13263810f Find the second derivative of -d3m*2z + 1799d3m*2 + 7d*3z + 4d3 + 3dmz - 11m2 - 151mz wrt m. -2d*3z + 3598d3 - 22 Find the first derivative of 2783j*2k - 162j	{ "pile_set_name": "DM Mathematics" }
at is one fifth of a kilometer in centimeters? 20000 What is twenty-seven fifths of a day in minutes? 7776 What is 0.9765317 tonnes in kilograms? 976.5317 Convert 728134.6l to millilitres. 728134600 What is fifty-two fifths of a litre in millilitres? 10400 How many millilitres are there in twenty-nine fifths of a litre? 5800 How many weeks are there in 2238.4383 hours? 13.3240375 What is 27.64951 millilitres in litres? 0.02764951 How many litres are there in 32042.64ml? 32.04264 What is one fifth of a milligram in micrograms? 200 What is 6/5 of a century in decades? 12 What is 3.030425mm in micrometers? 3030.425 How many centimeters are there in 1/4 of a meter? 25 How many months are there in nineteen quarters of a millennium? 57000 Convert 36.29097cm to nanometers. 362909700 What is 4/75 of a day in seconds? 4608 How many months are there in fourty-five halves of a decade? 2700 How many days are there in 14.9692752 milliseconds? 0.0000001732555 What is 1/5 of a kilogram in grams? 200 Convert 376.4565 years to millennia. 0.3764565 How many millimeters are there in 6/25 of a meter? 240 What is eleven quarters of a hour in minutes? 165 How many decades are there in 29/2 of a millennium? 1450 What is 1/4 of a minute in seconds? 15 Convert 34.46126 decades to months. 4135.3512 How many centuries are there in 11/2 of a millennium? 55 What is 4.303099cm in kilometers? 0.00004303099 Convert 94.6502mm to centimeters. 9.46502 How many micrograms are there in 327.9504 grams? 327950400 How many millennia are there in 23.1815 centuries? 2.31815 How many centuries are there in six fifths of a millennium? 12 What is twenty-one quarters of a litre in millilitres? 5250 What is 38.1104g in kilograms? 0.0381104 How many millilitres are there in 13.53247l? 13532.47 Convert 297996.5 nanoseconds to milliseconds. 0.2979965 What is 107695.26 months in years? 8974.605 What is 0.9746531 millilitres in litres? 0.0009746531 What is fourty-three halves of a millisecond in microseconds? 21500 Convert 80697.06l to millilitres. 80697060 What is 61/4 of a litre in millilitres? 15250 Convert 6.016335 kilograms to milligrams. 6016335 How many months are there in five quarters of a year? 15 How many kilograms are there in 70759.3ug? 0.0000707593 What is eighteen fifths of a millisecond in microseconds? 3600 How many milligrams are there in 1/16 of a kilogram? 62500 How many grams are there in 42.41903 milligrams? 0.04241903 What is 27/4 of a year in months? 81 What is 93089133.9s in weeks? 153.91721875 How many litres are there in 0.0376764 millilitres? 0.0000376764 What is 21/5 of a milligram in micrograms? 4200 What is 22/9 of a hour in seconds? 8800 Convert 453.751 litres to millilitres. 453751 How many milligrams are there in fifteen quarters of a gram? 3750 Convert 87286.356 minutes to days. 60.615525 Convert 26.390247 months to millennia. 0.00219918725 How many millilitres are there in 7.179989 litres? 7179.989 What is 464.4704 nanograms in micrograms? 0.4644704 How many years are there in three fifths of a century? 60 Convert 649719.3kg to grams. 649719300 How many centimeters are there in nine tenths of a meter? 90 How many milligrams are there in 169.5651 micrograms? 0.1695651 How many minutes are there in thirteen fifths of a day? 3744 What is 15/4 of a litre in millilitres? 3750 What is seven halves of a year in months? 42 What is 34/5 of a kilogram in grams? 6800 Convert 591165.3l to millilitres. 591165300 How many nanograms are there in three fifths of a microgram? 600 What is 3/10 of a centimeter in micrometers? 3000 How many months are there in seven halves of a decade? 420 What is three fifths of a microgram in nanograms? 600 How many millilitres are there in 3/8 of a litre? 375 What is 3/8 of a milligram in micrograms? 375 How many microseconds are there in one twentieth of a millisecond? 50 How many nanometers are there in 45/8 of a micrometer? 5625 How many years are there in 19/4 of a century? 475 What is one quarter of a kilometer in centimeters? 25000 What is 3/10 of a kilometer in centimeters? 30000 How many minutes are there in 422.1804us? 0.00000703634 What is 24.91644 minutes in hours? 0.415274 Convert 755.7589 litres to millilitres. 755758.9 What is 32945.86 decades in millennia? 329.4586 Convert 0.800461 millennia to decades. 80.0461 How many kilograms are there in twenty-seven quarters of a tonne? 6750 Convert 404.289 centuries to decades. 4042.89 Convert 0.4347449nm to millimeters. 0.0000004347449 Convert 238654.17 months to millennia. 19.8878475 Convert 7.096228ml to litres. 0.007096228 How many months are there in 30.63737 millennia? 367648.44 What is four sevenths of a week in days? 4 How many litres are there in 7.39277ml? 0.00739277 What is 97.26297 litres in millilitres? 97262.97 How many centimeters are there in sixty-one quarters of a meter? 1525 What is 1/20 of a kilometer in meters? 50 How many hours are there in 23330.016ns? 0.00000000648056 How many micrometers are there in 3/5 of a centimeter? 6000 How many centimeters are there in 0.8499299 micrometers? 0.00008499299 How many litres are there in 6.287622 millilitres? 0.006287622 Convert 8467.763 millimeters to kilometers. 0.008467763 What is 27/2 of a millennium in years? 13500 What is 13/5 of a litre in millilitres? 2600 How many millimeters are there in 1/5 of a meter? 200 What is twenty-seven halves of a litre in millilitres? 13500 How many millilitres are there in 7/4 of a litre? 1750 How many minutes are there in 19054.377 seconds? 317.57295 How many months are there in 3/10 of a millennium? 3600 What is 1063261.2 months in years? 88605.1 What is 9/10 of a kilometer in centimeters? 90000 What is five quarters of a meter in millimeters? 1250 Convert 88.91131 days to hours. 2133.87144 Convert 1778.0634 months to centuries. 1.4817195 What is 63.107325ms in hours? 0.0000175298125 Convert 10604.31 hours to days. 441.84625 What is fifty-eight thirds of a day in minutes? 27840 What is one fifth of a kilometer in centimeters? 20000 What is seven quarters of a micrometer in nanometers? 1750 What is 6/25 of a milligram in micrograms? 240 How many micrometers are there in 44/5 of a millimeter? 8800 What is 0.7122913 litres in millilitres? 712.2913 What is fourty-six fifths of a week in minutes? 92736 How many millimeters are there in 1/5 of a centimeter? 2 How many nanograms are there in twenty-seven halves of a microgram? 13500 What is three fifths of a decade in years? 6 What is 18/5 of a litre in millilitres? 3600 Convert 8330.826ml to litres. 8.330826 How many centimeters are there in 720023.3 micrometers? 72.00233 Convert 16.901394ns to minutes. 0.0000000002816899 How many millimeters are there in 117346.1um? 117.3461 How many millilitres are there in twenty-one halves of a litre? 10500 How many micrometers are there in 10633.56 centimeters? 106335600 What is 0.54993 tonnes in grams? 549930 Convert 286391.5 meters to kilometers. 286.3915 How many micrometers are there in five eighths of a millimeter? 625 Convert 0.166587l to millilitres. 166.587 What is 47.7795um in nanometers? 47779.5 What is 9994.075 millennia in centuries? 99940.75 How many hours are there in 249088.6 days? 5978126.4 What is 0.3981182 nanoseconds in seconds? 0.0000000003981182 Convert 748480.2 grams to nanograms. 748480200000000 What is 2.259573 hours in days? 0.094148875 Convert 977264.2ml to litres. 977.2642 What is one quarter of a litre in millilitres? 250 Convert 5.5604475ms to hours. 0.00000154456875 What is 1/4 of a millisecond in microseconds? 250 How many litres are there in 21865.7 millilitres? 21.8657 Convert 0.22346 tonnes to milligrams. 223460000 Convert 950.9631 tonnes to micrograms. 950963100000000 What is twenty-three eighths of a litre in millilitres? 2875 What is 18708965.1 minutes in weeks? 1856.048125 How many months are there in three eighths of a decade? 45 What is one twentieth of a milligram in nanograms? 50000 What is 492.9529 days in microseconds? 42591130560000 What is thirteen quarters of a tonne in kilograms? 3250 What is 25/4 of a year in months? 75 What is 7/2 of a litre in millilitres? 3500 How many milligrams are there in 5/8 of a gram? 625 How many millimeters are there in 972.	{ "pile_set_name": "DM Mathematics" }
the terms in 916s2 - 578s*2 + 552s*2 + 4s*3 + 798s*2. 4s*3 + 1688s*2 Collect the terms in 104c + 153c + 23c - 84c. 196c Collect the terms in 2 - 1649w + 1649w - 2 + 3w3. 3w*3 Collect the terms in 69o3 + o2 - 111o3 - 305o*3 - 3o*3. -350o3 + o2 Collect the terms in -11t + 5t + 21t - 1 + 23t. 38t - 1 Collect the terms in 108 - 108 - 34m*2 + 59m*2 + 2m*3 + 40m*2. 2m*3 + 65m*2 Collect the terms in -303p*2 - 106 - 110 - 106 - 106 + 431. -303p*2 + 3 Collect the terms in -189j + 23j + 167j. j Collect the terms in 57351f2 - 114698f*2 + 57339f*2. -8f*2 Collect the terms in 196u + 205u + 228u - 1023u + 196u + 201u. 3u Collect the terms in -264p - 242p + 553p. 47p Collect the terms in -17g + 10g + 10g - 29g - 9g. -35g Collect the terms in 17169j2 - 46758j*2 - 39121j*2. -68710j*2 Collect the terms in -202382l + 3l3 - 202394l + 404776l. 3l*3 Collect the terms in -9c*2 - 13c*2 - 23c*2 + 62c*2 - 2c - 9c2. 8c*2 - 2c Collect the terms in -118y2 - 3083719y + 3083719y. -118y*2 Collect the terms in -58d + 73d - 153d. -138d Collect the terms in -u + 16u + 2u - 8u. 9u Collect the terms in 3a*2 + 3a*2 - 529a - 400a + 166a. 6a2 - 763a Collect the terms in -823f3 - 5f2 - f2 + 6f2. -823f*3 Collect the terms in -26596544459f + 26596544459f - 2f*2. -2f*2 Collect the terms in 9517o + 6366o + 5923o. 21806o Collect the terms in 33i + 55i - 78i. 10i Collect the terms in 3x - 291x2 - 3x + 119x2 + 142x*2. -30x*2 Collect the terms in -d + 3724 - 3d - 1825 - 1899. -4d Collect the terms in 4n + 0n + 66n - 6n + 10n. 74n Collect the terms in -378183t + 2t3 - t3 + 378183t. t*3 Collect the terms in 70 - 12 + 2z - 20 - 21 - 17. 2z Collect the terms in -2o + 54 + 9o3 + 130 - 2o*3. 7o*3 - 2o + 184 Collect the terms in -40w3 + 1 - 3w - 1 - 4w + 15w*3. -25w*3 - 7w Collect the terms in -73089p2 + 4 - 4 + 73079p*2. -10p*2 Collect the terms in 16k + 19k - 55k - 235. -20k - 235 Collect the terms in 18b - 7b - 13 + 13 - 14b. -3b Collect the terms in 484q*3 + 706q*3 - 74q*3 - 40q*3. 1076q*3 Collect the terms in -11d*3 - 1669d*2 - 1671d*2 + 3340d*2. -11d*3 Collect the terms in 2605i*2 + 2963i*2 - 5589i*2. -21i*2 Collect the terms in 123545p*3 - 123543p*3 + 3p*2 - 3p*2 + 0p*2. 2p*3 Collect the terms in -13w*2 + 17w*2 + 31w*2 - 2w*2 + 33w*2. 66w2 Collect the terms in -2 - 7 + 24 - 13 - m. -m + 2 Collect the terms in -l2 - 3l2 + 4l*2 + 770264l*3 - 770393l*3. -129l*3 Collect the terms in 300b*3 - 29b*3 - 54b*3. 217b*3 Collect the terms in 283015h*2 - 283015h*2 - 3h*3. -3h*3 Collect the terms in 26u*2 + 20 - u + 6 - 9. 26u*2 - u + 17 Collect the terms in -23k + 9678828 - 9678828. -23k Collect the terms in -42o*3 + 25o*3 - 87o*2 + 45o*2 + 42o*2. -17o*3 Collect the terms in -1777r*2 + 1455r*2 - 1135r*2 + 1454r*2. -3r*2 Collect the terms in 37d - 65d + 11d + 30 + 15d. -2d + 30 Collect the terms in -29 + 144 - 23 - 64 - 28 - 2r2. -2r*2 Collect the terms in -1893 - 4o - o*2 + 2o2 - 1139. o2 - 4o - 3032 Collect the terms in -40 + 77 + 3m*2 - 33. 3m*2 + 4 Collect the terms in 52s + 55s - 119s + 55s. 43s Collect the terms in -2 + 2003r3 - 1992r*3 + 0. 11r*3 - 2 Collect the terms in 32 - 299x + 604x - 32 - 280x. 25x Collect the terms in -11516b*3 - 15196b*3 + 7184b*3. -19528b*3 Collect the terms in -265o*2 + 526o*2 - 1065o*3 - 263o*2. -1065o*3 - 2o*2 Collect the terms in 24 - 24 - 152b - 493b. -645b Collect the terms in -13767 + 13x3 + 27545 - 13778. 13x3 Collect the terms in -g2 - 347g + 3g2 + g2 - 6 - g*2. 2g*2 - 347g - 6 Collect the terms in 134 + 174 - 308 + 9x2. 9x*2 Collect the terms in 12 - 100 - z - 128 + 3z. 2z - 216 Collect the terms in -85i*2 - 1177i - 83i2 + 271i + 169i2. i2 - 906i Collect the terms in -99f2 - 25f + 64f - 40f. -99f2 - f Collect the terms in 63h*2 + 10h*2 - 73h*2 - 4969h*3. -4969h*3 Collect the terms in -245f - 3f2 - 3f*2 + 7f2 + f2 - 2. 2f2 - 245f - 2 Collect the terms in 51v2 + 84v*2 - v + 16v*2 - 111v*2. 40v*2 - v Collect the terms in 57029 - 114057 - 45b + 57031. -45b + 3 Collect the terms in -588p*3 + 38 - 38 - 991p*3 + 526p*3. -1053p*3 Collect the terms in -9p + 48p + 2p - 62p. -21p Collect the terms in -101045f2 - 101053f*2 + 202097f2. -f2 Collect the terms in -3g3 - 20g*3 + 5g3 - g3 + 11g3. -8g*3 Collect the terms in -83q - 6q - 600 + 600. -89q Collect the terms in -3688u3 - 3694u*3 - 3688u*3 - 3697u*3 - 3693u*3 + 18462u*3. 2u*3 Collect the terms in -82725m*2 + 41385m*2 + 41340m2 - m3. -m*3 Collect the terms in -57 + 4u*3 + 66 + 6u*3. 10u*3 + 9 Collect the terms in -2988s*2 + 44s - 28s - 16s. -2988s2 Collect the terms in -30s*2 - 152309s*3 - 280s*2 + 152311s*3. 2s*3 - 310s*2 Collect the terms in -4z*2 - 13z*2 - 5z*2 - 19z + 18z2. -4z*2 - 19z Collect the terms in 28169 + 14z3 - 22z*3 - 28169. -8z*3 Collect the terms in 8319508 - 8319508 - 9a*3. -9a*3 Collect the terms in 16t*3 - 1111t*2 + 10t*3 + 1111t*2 - 43t*3. -17t*3 Collect the terms in -348 + 678 - 14j - 330. -14j Collect the terms in 689 + 3r - 1409 + 720 - 3r + 4r*3. 4r*3 Collect the terms in -245s + 39s - 377s - 197s. -780s Collect the terms in -14q2 + 44q*2 + 2127580 - 2127580. 30q*2 Collect the terms in -2397n + 56n2 + 2397n - 13n2. 43n*2 Collect the terms in -133q - 154q - 119q - 130q + 532q. -4q Collect the terms in -3869u*3 + 992u*3 - 2237u*3. -5114u*3 Collect the terms in -249 + 249 - 24x + 91x. 67x Collect the terms in -23 - q*2 + 2q*2 + 58 - 3q*2 - 283. -2q*2 - 248 Collect the terms in 36k*2 - 2k*2 + 34 + 27 - 61. 34k*2 Collect the terms in 14661q*2 - 323q + 323q. 14661q*2 Collect the terms in -244i - i*2 + 128i + 116i. -i2 Collect the terms in -4g - 5g + g + g + 2g. -5g Collect the terms in -155z*3 - 6z - 177z3 - 4z. -332z3 - 10z Collect the terms in -11t3 + 8466261973 - 8466261973. -11t*3 Collect the terms in 2458c*2 + 637c*2 - 2038c*2 + 4633c*2. 5690c*2 Collect the terms in 396490380u + 52u2 - 396490380u. 52u2 Collect the terms in -160a + 114a - 230a - 604a. -880a Collect the terms in 13i2 - 4i*2 - 8i*2 - 5i*2 - 9i*2. -13i*2 Collect the terms in -496z*3 - 68z + 68z. -496z*3 Collect the terms in -3l*3 + 28l + 10276l2 - 10276l*2. -3l*3 + 28l Collect the terms in -71c3 - 121c*3 + 636207c*2 - 636207c*2. -192c*3 Collect the terms in -6x + 11x + 202x*2 - 51x*2 - 6x. 151x2 - x Collect the terms in -25o - 196 + 379 - 185 + 92o. 67o - 2 Collect the terms in 2p2 + 2 - 3p*2 + 4p*2 + 6 - 8. 3p*2 Collect the terms in -1131k + 1131k - 2k*3 + 770k*2. -2k*3 + 770k*2 Collect the terms in 2 + 7 - 7 + 182k. 182k + 2 Collect the terms in 26 + x2 - 12x - 6x - 9x - 8x. x2 - 35x + 26 Collect the terms in h + 11h - 5h - 2h - 3h*2 - 5h. -3h2 Collect the terms in -168 + 11w - 30w + 17w. -2w - 168 Collect the terms in 0 + 3 + 4 + 5 + 4 - 12y*2. -12y*2 + 16 Collect the terms in 72p + 112p - 2p. 182p Collect the terms in 14t*2 - 2t - t*3 + 15t*2 + 3t2. -t3 + 32t2 - 2t Collect the terms in 691m3 - 135m*3 - 247m*3 + 909m*3. 1218m*3 Collect the terms in 14699 - 44110 + 14707 + 14704 + 0j3 + j3. j*3 Collect the terms in 2w*3 + 0w*3 - 101w + 0w. 2w*3 - 101w Collect the terms in -16w + 5w - 5w - 34w - w. -51w Collect the terms in 7 - 4 - 161914x - 3 + 161912x. -2x Collect the terms in -4 - 57f + 42f + 3 + 152f. 137f - 1 Collect the terms in -6094y2 + 6094y*2 - 263y*3. -263y*3 Collect the terms in -2998963y + 5997983y - 2998953y. 67y Collect the terms in 35k*3 + 328k - 536k + 208k - 4 + 4. 35k3 Collect the terms in 39f*2 + 122f**2	{ "pile_set_name": "DM Mathematics" }
bigger: -12 or o? o Let h = -15/28 + 73/84. Is h at least 0.2? True Suppose o - 36 = -2o. Suppose 2h = -4u + 18, -2h + 5u - 6u = -o. Let c(i) = -i*2 + 6i - 4. Let p be c(h). Which is smaller: p or 3? p Let x(z) = 3z + 3. Let u be x(6). Let g = -13997/4 - -3519. Is g equal to u? False Let j = 160 + -126. Let b = j - -71. Which is smaller: b or 1? 1 Suppose -f = -2d + 4 - 3, 0 = -4d + 5f - 7. Which is greater: d or 12/23? d Let y = -678/5 - -136. Suppose j - 4b = -16, 2j - 3j = 3b - 12. Which is bigger: j or y? y Let h(d) = d. Let k be h(2). Let v be (-62)/(-155) + 3114/40. Let a = v + -77. Is k greater than or equal to a? True Let s = 540 - 526. Is s smaller than 0? False Let c = 23.74 - 4.25. Let t = 20 - c. Which is bigger: t or -1/2? t Let n be (-14)/(-140) + 1718/(-380). Which is smaller: -5 or n? -5 Let f(m) = -122m + 1099. Let v be f(9). Which is smaller: 14/235 or v? 14/235 Let d be (-20)/(-3222)66/55. Are d and 0 equal? False Let p be (4/14 + (-50)/(-70))1. Which is bigger: p or 2/51? p Suppose 10a = 9a. Is a bigger than -12/79? True Let t(n) = n2 - 11n - 9. Let g be t(12). Let c be (1/(-2))/(g/(-6)). Let m be (2/8)/(c/(-4)). Do m and -1 have the same value? True Let k = 68.83 - 70. Let h = -0.38 + k. Let u = 1.6 + h. Is u greater than or equal to 0? True Suppose -8v = -v - 119. Let j(k) = 9k - 270. Let s be j(30). Which is greater: s or v? v Suppose 2u = 6u + 8. Suppose 77s = 51s + 26. Which is bigger: u or s? s Let r = 1307/2 + -8955/14. Which is smaller: 14 or r? r Let i be ((-4)/6)/((-2)/39). Let j = i - 10. Suppose 6r = 5r + 3. Does r = j? True Let v(i) = 5i3 + 12i*2 + 9i + 6. Let o(x) = -4x3 - 11x*2 - 9x - 6. Let u(q) = -4o(q) - 3v(q). Let l be u(-7). Which is smaller: l or -9? -9 Suppose -51 = -3b - 5g + 3g, 2g = b - 9. Suppose 2u = -b + 13. Which is bigger: u or -3/20? -3/20 Let m = -240.1 + 240. Which is smaller: -0.11 or m? -0.11 Suppose -5i + 4y = -9 - 3, 0 = -4i - 3y - 9. Suppose ip = -3p + 3. Is p < 3/19? False Let s = 724 + -5066/7. Is s <= -147? False Let c be (-1)/(-2) + 5/10. Let h be ((-1 - -2) + -1)/c. Is 6/11 smaller than h? False Let q = 6289/4485 - 2/897. Which is bigger: q or 0? q Let g = -20.348 + -0.652. Let s = -1.1 + 1. Which is bigger: g or s? s Let w be (336/9)/(2/6). Suppose 5z + 3q - 2q - w = 0, -2q = 5z - 109. Is z > 24? False Let y be 30(8/(-5) + 1). Which is bigger: y or -52/3? -52/3 Let o = -151 - -66. Which is smaller: o or -83? o Let v be 2/5(-5)/(-3). Let u = 20.2 - 2.2. Let d = u + -16. Which is greater: v or d? d Let s be ((-2)/4)/((9/6)/(-3)). Is s smaller than 13/19? False Let c = -1.9 + 0.9. Let d = -6545 + 137414/21. Let z = 1/7 + d. Is z at least c? False Let w = -2 - -1.54. Let d = w + 5.46. Is d >= 0.2? True Let k = 241/3 - 2660/33. Which is bigger: k or -0.12? -0.12 Let j(s) = s*2 + 10s + 8. Let f be j(-9). Let v(y) = 4y + 1. Let q be v(1). Suppose 20 = -5l, -40 = qt - 0l + 5l. Is f less than or equal to t? False Let p be 807/(-207) + 5 - (-8)/(-12). Which is bigger: 0.1 or p? p Let h = 232 - 98. Which is bigger: h or 133? h Let y be (-21)/(-7)4/(-6). Let m be y/8 - 143/(-8). Is m bigger than 7? False Let q be (-11 - -4)/21 - 2/3. Which is greater: q or -15/121? -15/121 Let o = 61781351/15 - 4113943. Let j = 4812 - o. Which is smaller: -1 or j? j Let o be -10((-1)/2 + -1). Let f = o + -19. Is f bigger than -9? True Let q = -265851 - -4516783/17. Suppose 796 = -5b - 3r, -b - 2r = -6b - 786. Let y = q - b. Is y less than 1? True Let o be (4938/1097)/(18/(-24)) - -6. Which is bigger: o or 1? 1 Let g be 7/((-42)/(-8)) - 2/6. Let l be (-5)/g + 6/(-2) + 2. Which is greater: -9 or l? l Suppose 0 = -5x + 27 - 12. Suppose xw + 3v = w + 14, -v - 12 = -w. Which is bigger: w or 9? w Let q = 204059/1332 - -645/148. Let w = 158 - q. Suppose 2x - 13 = 4x + 5d, 3x - 6 = d. Which is smaller: x or w? w Let w = 624 - 654. Do w and -123/4 have different values? True Let j(v) = 3v*2 + 4v + 2. Let u be j(-2). Suppose -l - 75 = -ul. Is l at least 13? True Let m = -661 + 333. Which is smaller: m or -4? m Suppose -2u + 3u = -2. Let n = u - -5. Let f(a) = 2a*2 - 4a + 3. Let r be f(2). Is r greater than or equal to n? True Let n = 1/2113 - -2108/10565. Is 33 at least as big as n? True Let y = 257 - 261. Let g = -18 + 27. Let h = g + y. Do 4 and h have the same value? False Let j = -283 - -625. Let o be (4 - 0)9/j. Let z = -119 - -118. Which is bigger: o or z? o Let q = 26378/7 + -3775. Which is smaller: q or -7? -7 Let j be 7945/(-21) - 2/(-6). Let h be 4/(-14) + 393/j4. Which is smaller: h or -5? -5 Suppose -4b + 3 = -4p - 5, 13 = -4p - b. Let f be p/5 + 16/(-40). Is -1 at most as big as f? True Suppose -8 - 10 = -o. Suppose -2j - o = j. Let a be 0 - (j/8)/1. Is a < -2? False Let o(z) = -2z - 2. Let v = 36 - 34. Suppose -l + v = 3. Let c be o(l). Which is smaller: 2/25 or c? c Let n be -5(-5 + -2 + 6). Let r(b) = -b*3 + 4b*2 + 8b - 15. Let y be r(n). Which is bigger: y or -1/94? y Let g = -1679 - -13435/8. Suppose 0 = -4b - 4. Is g < b? False Let x = -44295/59 + 751. Is x < -1? False Let h be 285/(-756) - 7/(-28). Which is greater: -1 or h? h Let s = -508.97 - -515. Let w = 0.07 + s. Do -0.1 and w have the same value? False Let k(x) = -5x - 10. Let q(d) = -9d - 19. Let h(i) = 11k(i) - 6q(i). Let n be h(10). Is -6 smaller than n? False Suppose -2o - 2o = a + 72, a + 3o + 75 = 0. Let y be (-1)/(a/(-352)) - -4. Which is smaller: y or 1? y Let v(p) = -2p3 - 14p*2 - p + 5. Let s be v(-7). Let b be -16(s/(-8) + 2). Let l = 6 - 13. Are b and l equal? False Let t = 18.4 - 18.3. Does 9/29 = t? False Let s be 5558/56 - (-1)/(-4). Is 99 != s? False Let l be 2(-2 - 5) - 1. Let h(q) = -q3 - 16q*2 - 15q - 17. Let y be h(l). Is -16 equal to y? False Let b(a) = -3a - 73. Let n be b(18). Is n not equal to -128? True Let l = -49 + 58. Suppose 0 = -8b - 1 + l. Let r be (-26)/(-30) - 4/6. Do b and r have the same value? False Suppose -2d + 26 = 5t - t, -56 = -4d - 4t. Let z = -9 + d. Let n be (-970)/(-291) + -14. Which is bigger: z or n? z Let b = 1 + 8. Let d = 8 - 7. Suppose -b = a - d. Is -7 less than or equal to a? False Let x = -90 + 100. Suppose xv = 7v - 3. Is v less than 15? True Suppose 2g - 5q - 195 = 0, -6q = 2g - q - 205. Is g at most as big as 102? True Let g(h) = -8h - 5. Let k be g(-2). Suppose y + 3 = 2l, -l + 4y + y = -15. Which is greater: l or k? k Let o(f) = -f*2 - 17f - 24. Let u be o(-16). Let n = -37/4 - u. Is 0 >= n? True Let d = -285.22 - -281. Let l = d + 0.22. Is -6 not equal to l? True Let l = 1285 + -1286. Is l at most as big as -21? False Let q = -1058 + 7408/7. Let j = 2 + -2. Is j not equal to q? True Let m be ((-4)/3)/(((-20)/(-15))/(-1)). Let z be (0 - -1)m + -31. Which is smaller: z or -3/4? z Suppose -3o = -3x + 1956, 16o - 20o = 5x - 3287. Which is greater: x or 654? x Let h = 761 + -762. Is -24/257 less than or equal to h? False Let l(h) = -h3 + 5h*2 - 4h + 2. Let a be l(4). Suppose -39j = -15j - 50160. Let b be (-490)/j + a/11. Is -1 <= b? True Let m(n) = 2n2 - 12n + 14. Let g be m(6). Let y be (g/28)/((-4)/58). Is y not equal to -6? True Suppose -m + 3g = m - 18, -5m - 5g = 5. Suppose -4k + 3k + 6 = 0. Suppose 0 = mw - kw - 12. Is -4 at least w? True Let s = 1087/3906 + -1/1953. Suppose -2n + 2 = 2k, -1168k + 1165k = -5n + 13. Is k > s? False Let p(r) = -28r + 1. Let q be p(1). Let i be ((-3)/q)/((-2)/(-6)). Which is bigger: -1 or i? i Let p = 0.08 - -0.72. Let b = 0.0051 - 0.1051. Is p < b? False Let q = -3 + 4. Let b be (-4)/11118/12. Are q and b equal? False Let k(i) = -i*3 - 6i*2 - 7i - 4. Let n be k(-5). Let v be 4/n(-3)/(-26). Let b be 1 + -2 - (-5 - (-1 + -2)). Which is greater: b or v? b Let d = -9/112 + 2117/19376. Is d at least 1? False Suppose -16z - 443 = 1253. Are z and -533/5 unequal? True Suppose 4v + 0v - 3f - 83 = 0, -2v + 4f = -44. Let z = v - 31. Is z smaller than -1? True Let f = -1 - -3. Let n = 9 - f. Let k = n - 3. Which is smaller: 3 or k? 3 Let b = 0.58 + -0.38. Let w(q) = q3 + 9q*2 + 5q + 1. Let o be w(-4). Let v = o - 429/7. Which is smaller: b or v? v Suppose 764 = p - 5*p.	{ "pile_set_name": "DM Mathematics" }
6 Round -11464.0192 to the nearest 1000. -11000 Round -0.1628451 to 0 dps. 0 What is 32.55314848 rounded to three decimal places? 32.553 What is -0.00000917027745 rounded to six dps? -0.000009 Round -0.00000093528851 to 7 decimal places. -0.0000009 Round 0.00718267031 to three decimal places. 0.007 Round -13093.2251 to the nearest 100. -13100 Round -3972.796093 to the nearest 1000. -4000 What is 2829.585397 rounded to the nearest 100? 2800 Round -0.0000281566923 to 6 decimal places. -0.000028 What is 29998037.8 rounded to the nearest 1000000? 30000000 What is 0.6656059577 rounded to five decimal places? 0.66561 Round 5135.049011 to 0 dps. 5135 Round 117436970800 to the nearest 1000000. 117437000000 Round -926187.209 to the nearest 1000. -926000 What is -0.011207218983 rounded to six dps? -0.011207 What is -16.17093498 rounded to 0 dps? -16 Round 3484907.6 to the nearest 100. 3484900 What is 10648029.22 rounded to the nearest 100000? 10600000 Round 0.056287195 to 3 decimal places. 0.056 Round 32.813485 to 1 dp. 32.8 Round -868115.2821 to the nearest 1000. -868000 Round -108015869.3 to the nearest 1000000. -108000000 Round 0.002347230199 to 4 dps. 0.0023 What is -0.00458867621 rounded to 5 decimal places? -0.00459 Round 0.00566333852 to 4 dps. 0.0057 What is -0.05265722127 rounded to four decimal places? -0.0527 What is -1234326.21 rounded to the nearest 100? -1234300 What is -876.1215096 rounded to one decimal place? -876.1 What is -0.00405959475 rounded to five decimal places? -0.00406 What is 0.000134135587 rounded to 7 decimal places? 0.0001341 Round 0.75536772 to 3 decimal places. 0.755 Round 333.018589 to one dp. 333 Round 15832913.949 to the nearest one million. 16000000 Round -0.00000212937143 to 6 decimal places. -0.000002 What is 2.2291448267 rounded to four dps? 2.2291 What is 164311178.7 rounded to the nearest 100000? 164300000 What is 98923.1 rounded to the nearest 100000? 100000 What is -130585157500 rounded to the nearest 1000000? -130585000000 What is 1086673.45 rounded to the nearest one thousand? 1087000 Round 0.015854612 to three decimal places. 0.016 What is -107855.4531 rounded to the nearest one thousand? -108000 Round 105.663454 to the nearest integer. 106 What is -0.0226023612 rounded to 4 dps? -0.0226 Round -121921288.2 to the nearest 100000. -121900000 What is -0.00188422521 rounded to five decimal places? -0.00188 Round 1.08542909 to 3 decimal places. 1.085 What is -0.041906691 rounded to two decimal places? -0.04 What is 2047.30889 rounded to the nearest 100? 2000 What is 131788.335 rounded to the nearest 100? 131800 What is -0.3532545515 rounded to five dps? -0.35325 Round -16357.22531 to the nearest 1000. -16000 What is -5580216 rounded to the nearest one hundred thousand? -5600000 What is -0.0026849056286 rounded to four dps? -0.0027 What is 259408.0801 rounded to the nearest 1000? 259000 Round -12.4892152 to 3 dps. -12.489 What is -840161063 rounded to the nearest one hundred thousand? -840200000 What is 0.00130284597 rounded to six dps? 0.001303 Round 403658927.3 to the nearest 10000. 403660000 What is -561.4715179 rounded to two dps? -561.47 Round 0.00054256965 to six decimal places. 0.000543 What is 0.0009325904 rounded to 3 dps? 0.001 Round -0.007184665674 to five decimal places. -0.00718 Round -1061508.712 to the nearest ten thousand. -1060000 What is 18992726.83 rounded to the nearest 10000? 18990000 Round -23.4708644 to three decimal places. -23.471 What is 0.00037815834 rounded to four decimal places? 0.0004 What is -6176.43996 rounded to the nearest 100? -6200 Round 0.0237880401 to 4 dps. 0.0238 What is -0.00229660164 rounded to 4 dps? -0.0023 What is 34556916 rounded to the nearest one hundred thousand? 34600000 Round -98850.997 to the nearest one hundred. -98900 Round -0.00060301432 to 6 dps. -0.000603 Round -15.7546486 to the nearest 10. -20 Round 541315388 to the nearest one hundred thousand. 541300000 What is 0.00000108459661 rounded to 7 dps? 0.0000011 Round 83.461729 to one decimal place. 83.5 Round -0.0000004012395555 to seven dps. -0.0000004 What is -114868787 rounded to the nearest 1000000? -115000000 Round 28425403.77 to the nearest 10000. 28430000 What is -288168948 rounded to the nearest ten thousand? -288170000 What is 0.009815009352 rounded to six dps? 0.009815 What is -0.03884717256 rounded to six dps? -0.038847 What is 1334420.97 rounded to the nearest 10000? 1330000 What is 4.40617674 rounded to 4 dps? 4.4062 Round -355.73626 to 2 decimal places. -355.74 Round -0.0031535417 to five dps. -0.00315 Round -3500400.5 to the nearest 100000. -3500000 What is 17659309.57 rounded to the nearest one hundred thousand? 17700000 Round 0.000020065229 to six dps. 0.00002 Round -14.67268497 to 3 dps. -14.673 What is 165.67303 rounded to 1 dp? 165.7 Round -220.866127 to 1 dp. -220.9 Round 36165.643 to the nearest 1000. 36000 What is 30.533808 rounded to one dp? 30.5 What is -0.08126122334 rounded to 3 dps? -0.081 Round 1010368.023 to the nearest 100. 1010400 What is -0.0003675217 rounded to seven decimal places? -0.0003675 What is -0.000589801503 rounded to 4 dps? -0.0006 Round 0.827059618 to one decimal place. 0.8 Round -23.7298496 to one dp. -23.7 Round -68128942 to the nearest one hundred thousand. -68100000 Round -1063580041 to the nearest 100000. -1063600000 What is -10388569.4 rounded to the nearest 100000? -10400000 Round -78324532.4 to the nearest one hundred thousand. -78300000 Round -11.480146 to zero decimal places. -11 What is -206384.4407 rounded to the nearest one hundred? -206400 Round -165.870706 to 1 decimal place. -165.9 What is 117.95971 rounded to the nearest 100? 100 What is 3291102.75 rounded to the nearest one hundred thousand? 3300000 What is -10864581.7 rounded to the nearest one million? -11000000 What is -0.000004265016 rounded to six decimal places? -0.000004 Round -5158608.65 to the nearest 100. -5158600 What is -18.0770784 rounded to three decimal places? -18.077 Round -0.40498291 to 2 decimal places. -0.4 Round 0.0510985259 to 4 decimal places. 0.0511 What is 0.00615852717 rounded to three decimal places? 0.006 Round 16749.154053 to 1 dp. 16749.2 What is -401253.614 rounded to the nearest 10000? -400000 Round 2266.6403 to the nearest ten. 2270 Round -703788.3795 to the nearest 10000. -700000 What is 1.0831949 rounded to three dps? 1.083 What is -440.186869 rounded to the nearest integer? -440 What is -1090.287146 rounded to 0 dps? -1090 Round -15032.2877 to the nearest one thousand. -15000 What is -131.0414366 rounded to 1 decimal place? -131 What is 1166.09992 rounded to 1 dp? 1166.1 What is 2211.39205 rounded to the nearest 1000? 2000 Round 0.024122962 to three decimal places. 0.024 Round -0.000063108813 to five decimal places. -0.00006 Round -17112.6062 to 0 decimal places. -17113 Round 0.0286860449 to 6 dps. 0.028686 Round -0.0016987413 to 4 decimal places. -0.0017 Round 1279.6466167 to the nearest 100. 1300 What is 48018524 rounded to the nearest one million? 48000000 What is 328.43279867 rounded to the nearest 10? 330 Round -2988.2921 to the nearest 1000. -3000 Round 78732483.77 to the nearest 1000. 78732000 Round 0.000261595214 to 4 dps. 0.0003 What is -178469230 rounded to the nearest one million? -178000000 What is -2248233.2 rounded to the nearest one thousand? -2248000 Round -2.086604 to two dps. -2.09 Round 387824.79 to the nearest 100000. 400000 What is 1.801287748 rounded to five dps? 1.80129 What is -0.25546415 rounded to 3 decimal places? -0.255 What is -17723.17211 rounded to the nearest one hundred? -17700 What is -15997039022 rounded to the nearest 1000000? -15997000000 What is 0.0292580017 rounded to 6 decimal places? 0.029258 What is -2095282.019 rounded to the nearest one hundred thousand? -2100000 What is -239.484979 rounded to 0 decimal places? -239 Round 6.2574275 to the nearest integer. 6 Round -81.52626 to two decimal places. -81.53 Round 7867.726602 to 0 decimal places. 7868 What is -987644.87 rounded to the nearest ten thousand? -990000 Round 0.0000053386402 to 7 decimal places. 0.0000053 Round -0.0950685468 to 2 dps. -0.1 What is 0.00503367531 rounded to five decimal places? 0.00503 What is -0.000003779159302 rounded to seven dps? -0.00000	{ "pile_set_name": "DM Mathematics" }
) = -59k + 66. Suppose 20w - 12w - 32 = 0. Let b(g) = wu(g) + 9x(g). Differentiate b(j) with respect to j. 25 Let g(n) = 453n*2 + 42n + 52. Let s(a) = -6a + 1. Let q(k) = -g(k) - 6s(k). What is the second derivative of q(w) wrt w? -906 What is the second derivative of -247b4 + b - 2b*3 - 6 + 1193b*4 + 8b*3 - 6b*3 wrt b? 11352b*2 Let m be -1(-1)/(2/10). Let w(z) be the first derivative of -2 + 7/5zm + 0z*2 + 4/3z*3 + 0z*4 + 0z. Find the third derivative of w(u) wrt u. 168u Let s be 10/(-25) + (-22)/(-5). Suppose 2u - 5u = 3, u + 17 = 4o. What is the first derivative of oa4 + as - 4a*4 + 7 wrt a? 4a*3 Let i(y) = -86y*3 - 3y*2 - 3y + 81. Let z(b) = 171b3 + 5b*2 + 5b - 164. Let q(l) = 5i(l) + 3z(l). Find the first derivative of q(f) wrt f. 249f2 Let c(z) be the first derivative of 409z*6/6 - 2z*3/3 - 3z*2 - 171. Find the third derivative of c(u) wrt u. 24540u*2 Let r be -7 + 5 + (-10)/(-2). Find the third derivative of 26j*4 + 2j*4 + rj*2 + 10j*4 wrt j. 912j What is the second derivative of 1037p - 50p*3 - 60p - 187p4 + 185p*4 wrt p? -24p*2 - 300p Let k(m) be the second derivative of m*5/20 + 13m4/6 - m3/3 - 31m2/2 - 9m. Find the second derivative of k(n) wrt n. 6n + 52 Let p be -1 + (23 - (-9)/(-3)). Find the third derivative of -9s*5 + ps*5 + 3s*5 - 3s*2 wrt s. 780s2 Let c(r) be the second derivative of r8/168 + 5r4/12 - 5r*2 - 4r. Let u(h) be the first derivative of c(h). What is the second derivative of u(w) wrt w? 40w3 Find the second derivative of 479u*3 - 955u*3 + 476u*3 - 241u*4 + 24 - 2u wrt u. -2892u2 Let l be (-1)/2 - (-18)/12. Let d be l/(-3) - (-192)/36. Find the first derivative of -4c*2 + 5 + dc - 5c + 1 wrt c. -8c What is the derivative of 232 - 7s - 2s + s - 1456s4 + 1462s*4 wrt s? 24s*3 - 8 Let f(r) be the third derivative of 0 - 19/6r*3 + 0r*5 + 1/24r*6 - 18r*2 + 0r + 0r4. What is the derivative of f(n) wrt n? 15n*2 Let l(v) be the first derivative of -52 + 0v*2 - 37/4v*4 - 24v + 0v3. What is the derivative of l(i) wrt i? -111i*2 Find the first derivative of -705j*3 - 684j*3 + 4j*2 + 115 + 1418j*3 wrt j. 87j*2 + 8j Let j(o) = -16o3 + 2o*2 + 3o + 1. Let t be j(-1). Differentiate -t + 7q2 + 11 - 15q*2 with respect to q. -16q Suppose -2t + 15 = 2t + 3q, -2t + 11 = 5q. Suppose -6 = -th + 3. What is the third derivative of -hp4 - p2 + 5p*2 - 8p*2 wrt p? -72p Let i(p) = 2349p3 + 18p*2 - 18p - 318. Let v(u) = 671u3 + 5u*2 - 5u - 91. Let f(q) = -5i(q) + 18v(q). What is the derivative of f(b) wrt b? 999b2 Let r(p) be the third derivative of 0 + 0p + 0p3 + 2p*2 + 0p*4 + 3/20p*5 + 3/70p*7 + 0p*6. What is the third derivative of r(k) wrt k? 216k Let k(b) = -268b3 - 256b*2 - 11b. Let x(f) = 133f3 + 128f*2 + 6f. Let v(w) = -6k(w) - 11x(w). What is the third derivative of v(z) wrt z? 870 Find the third derivative of -2b2 + 67 + 5b*2 - 2b*3 - 68b*4 - 5b*2 + 22b*4 wrt b. -1104b - 12 Let w(z) be the first derivative of -13 + 0z4 + 0z + 0z2 + 0z*5 - 1/3z*6 - 14/3z*3. What is the third derivative of w(s) wrt s? -120s*2 Let y(h) be the first derivative of -9h4/4 + h3 - h*2 - 31h - 29. Find the second derivative of y(j) wrt j. -54j + 6 Let f(y) = -y4 + 0y + 6y3 + 2 + 3y + 6y - 4y3. Let r(u) = u4 - u*3 + u - 1. Let j(s) = f(s) + 2r(s). What is the second derivative of j(i) wrt i? 12i2 Let d(k) be the third derivative of 7/8k*4 + 12k*2 + 0 + 0k + 23/6k3. Differentiate d(q) with respect to q. 21 Let p(d) = -d2 + 5d + 3. Let l be p(5). Suppose -6r = -lr - 9. Find the second derivative of 29 - ra2 - a - 29 wrt a. -6 Let u be 8/4 - (1 + 1). Find the second derivative of -q5 - 4q*5 + q + uq + q wrt q. -100q3 Suppose 4n - 10 = 26. Let j = n - 6. Differentiate 7m + 0m + j + 1 - 6 with respect to m. 7 Let f(u) be the third derivative of u*6/60 + 13u*5/15 + 14u*4/3 - 25u*2 + 3. Find the second derivative of f(i) wrt i. 12i + 104 Find the third derivative of 1430t4 + 162t*2 - 1430t*4 - 189t*6 wrt t. -22680t*3 Let o(l) = 3l*4 - 64l*3 - 5l*2 - 5l - 110. Let u(i) = i4 + i3 - i*2 - i. Let x(g) = o(g) - 5u(g). What is the derivative of x(v) wrt v? -8v3 - 207v*2 Let g(w) be the third derivative of -28w*2 + 0 - 4/15w*6 - 1/2w*3 + 0w*5 + 0w*4 + 0w. Differentiate g(t) wrt t. -96t2 Let i(o) = -o2 + o + 1. Let h(c) = 174c*2 - 91c + 3. Let r(f) = h(f) - 3i(f). Find the second derivative of r(v) wrt v. 354 Let w(p) be the third derivative of 41p*4/3 + 10p*3/3 + 287p*2. Differentiate w(i) with respect to i. 328 Let u(y) = -33y4 - y3 + 116. Let f(r) = 66r4 + 3r*3 - 232. Let g(a) = -3f(a) - 7u(a). What is the derivative of g(i) wrt i? 132i*3 - 6i*2 Let k be (-4)/(-2) - 4 - -4. Let n = 2 + k. Find the first derivative of -3i + 3i + n + 4 + 9i*2 wrt i. 18i What is the second derivative of 798t2 - 6 - 778t2 + 9 + t3 - 46t wrt t? 6t + 40 Let b(m) = 4m - 31. Let s be b(5). Let l(y) = 74y + 75. Let c(j) = 15j + 15. Let g(i) = sc(i) + 2l(i). Differentiate g(t) wrt t. -17 Let w(b) be the second derivative of -b8/84 + 3b*4/8 + 13b*2/2 - 10b. Let x(h) be the first derivative of w(h). Find the second derivative of x(k) wrt k. -80k3 Suppose -31 = b - 10. Let g be ((-7)/b)/((-3)/(-18)). What is the third derivative of -7m3 + m2 + 151 - 151 - 3mg wrt m? -42 Let o = 135 - 35. Suppose -9g + o = -4g. What is the second derivative of 11p - gp + 14p - 2p5 wrt p? -40p3 Let o(x) be the second derivative of -x5/5 + x4/12 + x3/6 + x*2/2 + 2x. Let n be o(-1). Find the first derivative of 4l4 + n - 8l*4 + 6l*4 wrt l. 8l*3 Suppose 0w = -5w + 10. Suppose -14 = -wi - 5v, 6i - v - 6 = 2i. Differentiate -3 - 4x*3 + 51x*i - 51x*2 with respect to x. -12x*2 Let n(i) be the third derivative of 53/60i*5 + 0i*4 - 4/15i*6 + 0 + 2i - 3i2 + 0i*3 - 1/210i*7. What is the third derivative of n(j) wrt j? -24j - 192 Let j = 68 + -66. Find the third derivative of 2c2 - 19c*2 - 21c*j + 29c*4 wrt c. 696c Differentiate 223 + 90 + 92 - 740 + 134q with respect to q. 134 Let f(d) be the third derivative of -7d*6/8 + 43d*5/10 - 91d*2. Find the third derivative of f(q) wrt q. -630 Let d(t) be the second derivative of 19t8/6720 - t5/12 - 13t4/12 - t. Let q(b) be the third derivative of d(b). What is the derivative of q(x) wrt x? 57x*2 Let u(p) be the second derivative of 11/3p*3 + 0p*2 + 0p*6 + 0p*4 - 24p + 11/42p7 + 0 + 0p*5. What is the second derivative of u(w) wrt w? 220w*3 Let u be (1 - -1)45/6. Find the second derivative of 8m2 - 12m + um - 17m wrt m. 16 Let j(w) = w*2. Let g(p) = -25p*2 + 3p + 106. Let v(x) = g(x) + 2j(x). Find the first derivative of v(a) wrt a. -46a + 3 Suppose 6y - 2y = 4, n - 5 = 4y. What is the third derivative of 5g*6 + 14g*6 - ng*2 + 25g*2 wrt g? 2280g*3 Let p(w) be the second derivative of 0w*3 + 8w*2 - 29w + 0 + 13/20w5 + 0w*4. What is the derivative of p(g) wrt g? 39g*2 Let j(q) = -11q*2 + 129q - 169. Let u(z) = 7z2 - 86z + 112. Let n(m) = -5j(m) - 8u(m). Differentiate n(t) wrt t. -2t + 43 Let q(b) = 5b*3 + 5b2 + 7. Let i(m) = -m4 - 6m3 - 6m*2 + 2m - 8. Let y(x) = -5i(x) - 6q(x). Find the second derivative of y(p) wrt p. 60p2 Let i(k) be the third derivative of 0 + 0k*4 + 23/6k*3 + 19/210k*7 + 0k + 0k6 + 0k*5 + 17k*2. What is the first derivative of i(d) wrt d? 76d*3 Let y(w) = -39w*3 + 32w*2 + 2. Let u(v) = -118v*3 + 97v*2 + 6. Let a(b) = -2u(b) + 7y(b). Find the third derivative of a(x) wrt x. -222 Let d = 46 + -42. What is the third derivative of 7o*4 - 11o*2 + 6o*d - 4o*4 wrt o? 216o Let x be 11/((-132)/(-18))4/6. What is the first derivative of 9i*2 + 3i*2 - 4 - x - 22i*2 wrt i? -20i Let z(g) = -11g3 + 148g*2 - 2g - 4. Let t(w) = 13w3 - 147w*2 + 3w + 6. Let s(m) = -2t(m) - 3z(m). Find the third derivative of s(i) wrt i	{ "pile_set_name": "DM Mathematics" }
+ sqrt(6)))-2. -72sqrt(7)/73 Simplify 6((-5 + -2sqrt(98) - sqrt(98)) + (-2 + sqrt(98))*26 + -4). -1134sqrt(2) + 3618 Simplify (11(sqrt(832) + sqrt(832) + -5)1)*2. -160sqrt(13) + 3353 Simplify (sqrt(90)/(sqrt(18)/sqrt(2)) + (sqrt(10) - sqrt(50)/sqrt(5))-5)/(sqrt(245) - -5(sqrt(245)1 + sqrt(245))). sqrt(2)/77 Simplify (4 + 5 + (sqrt(19) + (sqrt(19) - (sqrt(19) + 1 + 1)))4 + 0)*2. 8sqrt(19) + 305 Simplify (sqrt(1500)5 - sqrt(1500) - sqrt(60))/(sqrt(144)/(sqrt(108)/sqrt(9)))2. 38sqrt(5) Simplify 5((sqrt(1216) - -5(sqrt(1216) + 0)) + sqrt(1216) + 0 + sqrt(1216) + -2 + -5)2-1. -389365 + 4480sqrt(19) Simplify 3((-1sqrt(320) + -2)-3 - (sqrt(320)-1-6 - (sqrt(320)1 + -4))). -48sqrt(5) + 6 Simplify ((sqrt(192) - (sqrt(192) - sqrt(192)-2))-6)/((sqrt(256) + sqrt(256)-1)-2 - sqrt(256)). -6sqrt(3) Simplify ((sqrt(80) + 0 + sqrt(20)/sqrt(36) + 3 + sqrt(500)1)-2-4)*2. 5504sqrt(5) + 596864/9 Simplify (1sqrt(864))/(sqrt(12)/(sqrt(6)-4 + sqrt(6))). -36sqrt(3) Simplify (-4 + (sqrt(45)1 + -2 - (sqrt(4500) - (sqrt(4500) + -1))))*2 + 4. -42sqrt(5) + 98 Simplify ((2(sqrt(90) - -1sqrt(90)))/(-2sqrt(20)/sqrt(4)-3))2. 8 Simplify (sqrt(63)/(sqrt(441) - sqrt(9)))21 + (6sqrt(112) + sqrt(7))4. 7/36 + 100sqrt(7) Simplify 0 + (-1(sqrt(243) + (sqrt(243) + 1)-6 - sqrt(243)))*2 + (((1 + sqrt(243))6)*2 - (sqrt(243) + (sqrt(243) + 1 - sqrt(243)) + 0)). 1287sqrt(3) + 17567 Simplify (4(sqrt(242)2 + sqrt(242) + sqrt(242)) + sqrt(242) + sqrt(242) + 3 + (sqrt(242) - (sqrt(242) + 0 + sqrt(242))) + -3 + -3)*2. -1122sqrt(2) + 69947 Simplify (1(2sqrt(396) - sqrt(396))-3)2 + (sqrt(704) - (sqrt(704) - (-3 + 0 + sqrt(704) + sqrt(704))2)) + 4. -96sqrt(11) + 6393 Simplify (sqrt(363) - (sqrt(363) + (-22sqrt(363) - sqrt(363))) - (-4 + sqrt(363) + 1))*2 + -5. 264sqrt(3) + 5812 Simplify ((sqrt(900) - ((sqrt(900)2 - sqrt(900)) + sqrt(900)))4)/(5sqrt(192)-1). sqrt(3) Simplify 4(0 + sqrt(2057) - sqrt(2057))2 + sqrt(2057) + -1 + 5 - (0 + sqrt(1700) + sqrt(1700))25. -189sqrt(17) + 4 Simplify 6((1((sqrt(13) - sqrt(52)/sqrt(4)) + sqrt(13)) - (sqrt(13) - (1 + sqrt(13))-4)2) + 0). -2046 - 234sqrt(13) Simplify (-1(sqrt(125) - (1 + sqrt(125))2) - (sqrt(605) + 0 + sqrt(605) + sqrt(605) + 2))5. -140sqrt(5) + 620 Simplify 0 + (sqrt(832)-1-2)2 - (4 + -1 + (sqrt(13) + -1 + -4)2). 10sqrt(13) + 3287 Simplify ((0 + sqrt(363) - sqrt(363))6 + -2 + 4(sqrt(108) + -1 + sqrt(108))-6)2. -12672sqrt(3) + 249316 Simplify (-5sqrt(405)/((-2sqrt(9) + sqrt(9))3)1-6)2. 4500 Simplify (sqrt(44) - (-2(sqrt(44) + sqrt(44)1 + sqrt(44)) + sqrt(44) - sqrt(44)))/(sqrt(4) + (sqrt(48)-2)/sqrt(12)) + -3. -7sqrt(11) - 3 Simplify 2 + (-4sqrt(81)4)/sqrt(3). -48sqrt(3) + 2 Simplify 3 + sqrt(33)/(2(sqrt(3) + sqrt(12)/sqrt(4)) - sqrt(3)) + 6(2sqrt(99))/sqrt(9). 3 + 37sqrt(11)/3 Simplify (-1 + 2 + (sqrt(17) + ((sqrt(17) + -1)1)2)3)-3. -165 + 9sqrt(17) Simplify ((1(sqrt(600) + sqrt(600) + sqrt(600)2))/(sqrt(48)/(sqrt(8)/sqrt(2)))-5)2. 20000 Simplify -1(sqrt(171) + 3 + sqrt(171) + sqrt(133)/sqrt(567)). -55sqrt(19)/9 - 3 Simplify (-4(5 + 1 + sqrt(272) + 52sqrt(272) + 5))*2. 15488sqrt(17) + 528528 Simplify 5(sqrt(768)-3)/(sqrt(576)/sqrt(4)). -20sqrt(3) Simplify (4sqrt(24)/sqrt(4) + (sqrt(6) - -1sqrt(24)))/(sqrt(21)/sqrt(63) + (sqrt(75)-2 + sqrt(75) + sqrt(75) - sqrt(75)) + sqrt(75)). 21sqrt(2) Simplify (3 + 2 + sqrt(539) + (1sqrt(539) - sqrt(539)) + 1)*2-1-4. 336sqrt(11) + 2300 Simplify -46(0 + sqrt(192))54. -3840sqrt(3) Simplify (5((sqrt(1300)-1-5 - sqrt(1300)) + (sqrt(1300) - (sqrt(1300) - sqrt(1300)4)) + 3))2. 12000sqrt(13) + 2080225 Simplify -1((sqrt(891) + -3)2-1 - ((sqrt(44)/sqrt(2)-4)/sqrt(2))2). -54sqrt(11) + 1076 Simplify -3 + (-1 + sqrt(99))*2 + sqrt(11) + (sqrt(132)2)/sqrt(12) + (sqrt(66)/sqrt(6) + 4)-6. -9sqrt(11) + 73 Simplify (-3(sqrt(70) - (sqrt(70)-1 + sqrt(70) + sqrt(70)))-4)/((sqrt(110)-36)/sqrt(11)). 0 Simplify ((-2(sqrt(3564)2 + sqrt(3564)))/(1sqrt(36)3))2. 396 Simplify ((sqrt(35) + -2sqrt(5040))/(-1sqrt(405)))2. 3703/81 Simplify ((3 + -2sqrt(567) - ((sqrt(567) - (-2 + sqrt(567))) + 0))4)2. -576sqrt(7) + 36304 Simplify 5 + ((sqrt(432)-3 - sqrt(432))-5)2 + (sqrt(432) - (sqrt(432) + -1 + sqrt(432) + 5))2. 96sqrt(3) + 173253 Simplify (4(sqrt(1088) + 0)*2 - (sqrt(1088)1 + 1)*2)-2. -6526 + 32sqrt(17) Simplify ((3 + (sqrt(252) - sqrt(252)14) + (sqrt(252) - ((-1 + sqrt(252) - sqrt(252)) + sqrt(252))) + 4)-3)*2. -2592sqrt(7) + 20988 Simplify (-5 + 4 + (1 + sqrt(1584))1 + 5 + -1 + sqrt(1584))2. 192sqrt(11) + 6352 Simplify ((sqrt(171) + 5(sqrt(171)-2 - sqrt(171)))-4)/(sqrt(1296) - -2(sqrt(1296) + (2sqrt(1296) - sqrt(1296)) + sqrt(1296))). 2sqrt(19)/3 Simplify 6(sqrt(7) + ((sqrt(7) + 2)-2)*2) + 1(sqrt(7) + 1) + -5. 260 + 103sqrt(7) Simplify -2(0 + sqrt(612) - (sqrt(612) + sqrt(612) + -1) - (((sqrt(2448) + -2sqrt(2448))2 - sqrt(2448)) + sqrt(17) - (sqrt(153) + 0))). -16sqrt(17) + 4894 Simplify (3(3 + sqrt(128) + 0 + -5 - (sqrt(128) + 0 + sqrt(128) + 3 + 5)))2. 1440sqrt(2) + 2052 Simplify (1 + (6sqrt(343)2 + sqrt(343) - (1sqrt(343) + 4)2))3. -1074 + 105sqrt(7) Simplify ((-4-6(sqrt(204) - ((sqrt(204) - -3sqrt(204)) + sqrt(204))))/(sqrt(300) - (sqrt(300) + 3-1sqrt(300))))*2. 17408/25 Simplify (-1(-1sqrt(1080))/(sqrt(192)/sqrt(2)))2. 45/4 Simplify (sqrt(110)-2-1)/(53sqrt(10) - sqrt(10))5. 5sqrt(11)/7 Simplify (-2sqrt(95)4)/(sqrt(720) - ((sqrt(720) - (-1sqrt(720) + sqrt(720)) - sqrt(720) - sqrt(720)) + sqrt(720)) - sqrt(720) - sqrt(720)). 2sqrt(19)/3 Simplify (sqrt(77) + sqrt(77)-11 - sqrt(77))/((sqrt(121) - (sqrt(121) + 1sqrt(121)))/sqrt(11)). sqrt(7) Simplify (sqrt(756)-24 - sqrt(756))/(-6(sqrt(192) - -1sqrt(192) - sqrt(192))). 9sqrt(7)/8 Simplify (3((sqrt(170) - (1sqrt(170) + sqrt(170)))/sqrt(10) - sqrt(17)) + 3(sqrt(17) + sqrt(153) + -2))-4. -24sqrt(17) + 24 Simplify (sqrt(136)/(sqrt(88)/(2sqrt(11))) - (sqrt(17) + (-1 + sqrt(17))3)*23)-6. -444sqrt(17) + 5058 Simplify (sqrt(91) - (sqrt(91) + (sqrt(91) - ((sqrt(91) - sqrt(91)-2)6 + sqrt(91)))) - sqrt(91))/(sqrt(77)/sqrt(891)). 153sqrt(13) Simplify (5 + (-2 + 0 + sqrt(76) - sqrt(76)))2 + (sqrt(114)-2-1)/(2sqrt(6)6). sqrt(19)/6 + 9 Simplify 6((sqrt(180) + -1)1 + sqrt(180) + (sqrt(180) - (6(sqrt(180)2 + sqrt(180)))2))6. -2099556 + 648sqrt(5) Simplify 2(sqrt(34)-23)/(2sqrt(2)2). -3sqrt(17) Simplify 1-1sqrt(20) + (12sqrt(25))/sqrt(5). 0 Simplify ((-3(-2sqrt(104) + sqrt(104) - sqrt(104)))/(2sqrt(8)6))2 - (-4 + sqrt(208)-2 + sqrt(208))-3. -12sqrt(13) - 35/4 Simplify ((-3sqrt(350)-1)/(sqrt(7) + 3sqrt(700)))2. 450/961 Simplify (4(sqrt(152)-2 + sqrt(152) - sqrt(152)) - sqrt(152))/((sqrt(72)/sqrt(3))/sqrt(3)). -9sqrt(19) Simplify -5(-4 + -3 + 1sqrt(448) + sqrt(448) + 5 + sqrt(448) + 1)*2. -20165 + 240sqrt(7) Simplify ((0 + sqrt(567) - sqrt(567))1)2 - (sqrt(567) + -5(-4sqrt(567) - sqrt(567)))2. -383292 Simplify (6(0 + sqrt(6)/sqrt(3)2 + (-5 + sqrt(2))5))*2. -12600sqrt(2) + 26028 Simplify (sqrt(162)-2-3)*26 - (-3(3sqrt(162) + 1 - sqrt(162)))*2. -324sqrt(2) + 29151 Simplify ((sqrt(2700) + -1 + -5 - (sqrt(2700)1 + sqrt(2700) + sqrt(2700))-1)1)2. -1440sqrt(3) + 43236 Simplify 4((sqrt(364)-3)/sqrt(7))/(sqrt(4) - sqrt(196)2). 12sqrt(13)/13 Simplify -4(-1 + (1sqrt(38))/sqrt(2) + -1). -4sqrt(19) + 8 Simplify (-5 + sqrt(832) + 1 + sqrt(832) + sqrt(832) + 2 + -4 + 1sqrt(13))*2. -300sqrt(13) + 8161 Simplify -6(-1(sqrt(931) + -2) + sqrt(931) + sqrt(931) - (sqrt(931) - (sqrt(931) - (sqrt(931) - (2 + sqrt(931))4))))2. -89976 - 3360sqrt(19) Simplify ((sqrt(76)1 + sqrt(76) + sqrt(76))-4 + 1 + 5(-3 + 2sqrt(76)))*2. 112sqrt(19) + 500 Simplify (((sqrt(2048) + 1)-1 - sqrt(2048))-6)*2 + 2. 4608sqrt(2) + 294950 Simplify ((1 + sqrt(275) + -2 + 5)-6 + 3)2 + -1. 1260sqrt(11) + 10340 Simplify (sqrt(1700)-1-4 + 3 - (-5 + (-2sqrt(1700) - sqrt(1700)) + -3))2. 1540sqrt(17) + 83421 Simplify (4(sqrt(153) + sqrt(153)3 + sqrt(153)) + 1 - ((sqrt(153) - (2sqrt(153) + -1)) + sqrt(153) + -1 + sqrt(153)-1))*2. 126sqrt(17) + 67474 Simplify	{ "pile_set_name": "DM Mathematics" }
= -348383k2. Let j(d) = d2. What is j(z(o))? 121370714689o*4 Let j(s) = -25s + 3. Let b(o) = o*2 + 34o. Give b(j(r)). 625r2 - 1000r + 111 Let m(r) = 196r2. Let a(f) = 524f*2. Give m(a(j)). 53816896j*4 Let l(w) = 12w2. Let n(m) = m2 - 1. Let h(p) = 35 + 7p2 - 23 - 18. Let s(g) = h(g) - 6n(g). What is l(s(x))? 12x4 Let x(p) = 3p. Let y(s) = 12s + 14. Let g(k) = 7k + 10. Let u(l) = 7g(l) - 5y(l). What is u(x(d))? -33d Let o(d) = 15d*2. Let u(n) be the first derivative of 19n*3/3 - 243. What is u(o(m))? 4275m*4 Let l(j) = -44j - 4. Let c(b) = 28b2 + 33b*2 - 130b*2 + 29b*2 + 38b*2. What is l(c(s))? 88s*2 - 4 Let k(p) = 535p - 9. Let d(y) = 2y2. Calculate d(k(i)). 572450i*2 - 19260i + 162 Let a(c) = -3c2. Let l(h) = 30250h*2. What is l(a(x))? 272250x*4 Let u(d) = d. Let q(w) = 111w - 505w + 176w + 102w. What is q(u(b))? -116b Let i(u) = -12u2. Let l(p) = -478643p. Give l(i(x)). 5743716x2 Let y(l) = 11l*2 + 6l. Let u(f) = -22f2 - 13f. Let w(v) = -6u(v) - 13y(v). Let m(z) = -5z. What is m(w(q))? 55q*2 Let n(l) = -7l*2 - 6. Let r(c) = -20c*2 - 17. Let z(d) = -17n(d) + 6r(d). Let y be 15/(11/2 - 4). Let g(h) = -8 + 18 - y + 8h. What is g(z(p))? -8p2 Let q(d) = -18d. Let z(b) = 91b. Let j(y) = -26q(y) - 5z(y). Let p(r) = 5r. Calculate p(j(o)). 65o Suppose s + 4s - 10 = 0. Let p(r) = 2r - 2r - sr. Let f(i) be the third derivative of -i5/30 + 9i*2 - 2. Determine p(f(b)). 4b*2 Let t(n) = -15n*2. Let m(p) = 72834p*2. Calculate t(m(o)). -79571873340o*4 Let h(f) = f. Let j be (-6 - -2)-4(-4 + 6). Let r(z) = 8z + 8. Let a(p) = 52p + 52. Let l(g) = jr(g) - 5a(g). Calculate l(h(k)). -4k - 4 Let n(p) = -3p. Let x(u) = -3900u*2. Calculate x(n(j)). -35100j*2 Let g(m) be the first derivative of 1 - 2m + 1/6m3 + 0m*2. Let p(f) be the first derivative of g(f). Let v(q) = 4q*2. Calculate v(p(k)). 4k2 Let o(t) = t2. Let g(k) = -k*2 - k + 1. Let i(q) = 55q*2 + 66q - 66. Let m(v) = 66g(v) + i(v). Calculate o(m(c)). 121c*4 Let q = 922 + -156. Let x(n) = -q - 3n*2 + 766. Let l(u) = 6u*2 - 5u - 5. Let g(s) = s*2 - s - 1. Let y(f) = -10g(f) + 2l(f). What is y(x(z))? 18z*4 Let f(b) = -2 + 2 + 11b. Let u(v) = 71v + 7. Let m(x) = -91x - 9. Let k(l) = -7m(l) - 9u(l). What is f(k(z))? -22z Let i(p) = -2p. Let g(j) = 15j. Let d(w) = -g(w) - 15i(w). Let h(l) = -10l2. Determine d(h(t)). -150t2 Let s(u) = u2 + 7u. Let c(y) = -374y. Give s(c(j)). 139876j2 - 2618j Let n(j) = 5j. Let w = 8 + -6. Let b(y) = -2y*2 + 13y - 14. Let s be b(4). Let h(t) = -s - 3t + 6 + wt. Calculate h(n(l)). -5l Let y(c) = -6c. Let i(k) be the second derivative of 22k3/3 + 40k - 2. What is i(y(v))? -264v Let b(g) be the third derivative of g7/1680 - 7g*5/30 - 15g2. Let o(v) be the third derivative of b(v). Let m(a) = a2. Calculate m(o(h)). 9h2 Let c = 135 - 71. Let u(x) = 64x - cx - 2x*2. Let y(f) = -2f. What is u(y(j))? -8j2 Let x(y) = 3y. Let w(m) be the first derivative of m*5/20 + 9m*3 - 23. Let l(z) be the third derivative of w(z). Calculate x(l(t)). 18t Let r(u) = -u. Let p(b) = -1493b2 + b. Give p(r(l)). -1493l2 - l Let z(j) be the second derivative of -j3/3 - 4j2 - 23j - 7. Let k(t) = -2t. What is k(z(n))? 4n + 16 Let d(p) = -7p - 5. Let g(j) = -7 + j + 3j - 8j - 6j. Let i(n) = -7d(n) + 5g(n). Let f(q) = 9q2 + q. Calculate i(f(x)). -9x*2 - x Let f(t) = -14t - 5. Let h(r) = r*2 - 3r - 3. Let u(q) = q*2 - 4q - 4. Let x(d) = -4h(d) + 3u(d). Give f(x(o)). 14o2 - 5 Let i(s) = s. Let x(g) = -75g*2 - 2g - 49. Determine x(i(k)). -75k2 - 2k - 49 Let v(j) = 6j2. Let f(i) = 242739i - 242739i + 28i*2. Give v(f(r)). 4704r*4 Let c(t) = 3t. Let j(i) be the third derivative of -31i4/24 + i3/2 - 545i*2. Determine j(c(r)). -93r + 3 Let v(a) = 42a2. Let i(b) be the second derivative of b3/3 - 135b - 2. Give i(v(x)). 84x2 Let x(m) be the second derivative of -m3/6 + m. Let w(b) = 38b + 71b - 105b + 1 - 1. Calculate w(x(p)). -4p Let g(y) = y2 + y - 3975. Let s(i) = 5i. What is g(s(c))? 25c2 + 5c - 3975 Let d(r) = -6r. Let j(c) = -8c*2 + 2c*2 + 4c*2 + 12c*2. Determine d(j(a)). -60a*2 Let y(k) = -2 - 7354k*2 + 2 + 7365k*2. Let u(a) = 2a*2 - 89 + 89. Determine y(u(q)). 44q*4 Let q(g) = -4g. Let k(i) = 2i - 2. Let n be k(2). Let c(m) be the first derivative of -8m*n + 2 - 3 + 10m*2. Calculate c(q(f)). -16f Let y(o) = 20o2. Let h(p) = 4p*2 - 420p. What is h(y(k))? 1600k4 - 8400k2 Let v(t) = t2 + 1. Let m be v(1). Let q(b) = -b*2 + 4b + 1. Let z be q(m). Let p(o) = 3o2 + 0o2 + 5 - z. Let l(f) = f2. Determine l(p(u)). 9u4 Let z(x) = 224x - 44. Let d(y) = 12y. What is z(d(w))? 2688w - 44 Let i(h) = -2h + 7159. Let t(n) = n2. Give i(t(y)). -2y*2 + 7159 Let q(d) = -2117d + 4490d - 2058d. Let m(g) = 4g. What is m(q(j))? 1260j Let m(g) = -8g2 + 594g. Let l(r) = 8r2. What is m(l(w))? -512w*4 + 4752w2 Let v(q) = q2. Let i(u) = 25u - 3 - u + 75u + 16u + 5. Calculate i(v(b)). 115b2 + 2 Let v(c) = c2 - c - 72. Let z(j) = 11j. Determine v(z(i)). 121i*2 - 11i - 72 Let y(q) = 3q - 2. Let j(p) = -10p + 7. Let v(t) = -4j(t) - 14y(t). Let d(l) = -4 - 6l2 - 8l*2 + 25l*2 - 8l*2. Determine v(d(m)). -6m2 + 8 Let m(k) = -3 + 2 + 1 - k2. Let q be 0/(4/2) + 3. Let i(x) = qx2 - 7x*2 + 2x*2. Calculate i(m(a)). -2a*4 Let f(n) = -3n + n + 0n + 3n. Let k(p) be the third derivative of -13p4/24 + 152p*2. What is f(k(h))? -13h Let j(x) = 2x2. Let m(y) = 1140y - 675. Let f(q) = 17q - 10. Let i(h) = -135f(h) + 2m(h). What is i(j(w))? -30w2 Let y(q) = -q2 + q - 1. Let p(a) be the second derivative of 5a4/3 - a3/3 + a2 + 3a. Let u(s) = -p(s) - 2y(s). Let v(o) = o. Determine u(v(d)). -18d*2 Let x(n) = 2n*2. Let i(s) = 28880s*2. Determine x(i(p)). 1668108800p*4 Let v(i) = -6i*2 + 4i. Let k(a) = 13a2. Let u(s) = 4s*2. Let f(x) = -3k(x) + 10u(x). Give f(v(g)). 36g*4 - 48g*3 + 16g2 Let x(h) = h2 + 5h. Let o(k) = -k. Let m(z) = -5o(z) - x(z). Let n(s) be the third derivative of -11s5/60 + 8s*2. Determine n(m(j)). -11j*4 Let y = 28 - 26. Let m(q) = q - 182q*y + 184q*2 - q. Let r(c) = 3c. Let t(g) = -6g. Let w(l) = 9r(l) + 4t(l). Calculate m(w(n)). 18n*2 Let g(y) = 173y*2 - 1. Let f(o) = 428o. What is f(g(w))? 74044w2 - 428 Let m(p) be the first derivative of -2p*3/3 + 2. Let b be (-2)/(-3) + (-24)/(-18). Let q(g) = -bg + 0g + 5g. Calculate q(m(a)). -6a2 Let c(v) = -297 + 589 + 59v - 294. Let q(o) = o*2. Determine c(q(d)). 59d2 - 2 Let f(v) be the first derivative of v3 + 191. Let g(r) = -r*2. Give g(f(w)). -9w*4 Let t(u) be the first derivative of -4u*2 + 8. Suppose -5v + 32 = 4z, -2z + v = 4v - 16. Let i(a) = -8a + za - a. Calculate i(t(o)). 8o Let u(k) = -k*2. Let z(o) = 4o + 3. Let v(g) be the third derivative of -g*4/8 - 2g*3/3 + 22g*2. Let h(f) = -3v(f) - 4z(f). Calculate h(u(d)). 7d*2 Let d(j) = 1413j. Let s(x) = -2x. Calculate d(s(r)). -2826r Let u(d) = 15168d. Let r(f) = -12f. Give u(r(y)). -182016y Let d(n) be the second derivative of n5/60 + 23n*2/2 - 7n. Let v(y) be the first derivative of d(y). Let i(g) = -25g + 2. Give v(i(z)). 625z*2 - 100z + 4 Let b(g) = 32g. Let y(c) = -3c. Let z(h) = -h. Let u(q) = 6y(q) - 17z(q). Determine b(u(p)). -32p Let m(q) be the first derivative of 14 + 0q - 3/2q2. Let r(o) = -8o. What is m(r(y))? 24y Let a = 2920 - 2911. Let s(k) be the third derivative of -13/24k*4 + 0k*3 + 0 + 0k + ak2. Let f(g) = -g2. Give s(f(l)). 13l*2 Let o(s) = 57s*2 - 8s*2 - 29s*2. Let k(i) = 14i*2. Determine k(o(v)). 5600v*4 Let y(p) = 1992p. Let k(q) = 2q2. Determine y(k(o)). 3984o*2 Let k(z) = 0z - 2 + 22 + z. Let q(i) = -i - 3. Let u(l) = -2l - 5. Let w(j) = -5q(j) + 3u(j). Give w(k(p)). -p - 20 Let o(n) be the first derivative of -n2 + 13. Let h(b) = -b2 - 68. Give h(o(r)). -4r*2 - 68 Let p(r) = 5142r. Let d(u) = u + 5. What is p(d(s))? 5	{ "pile_set_name": "DM Mathematics" }
-1 Let v(l) = 7l + 24. Let x be v(-9). Let b be x/9 - (9 - 13). What is the closest to -9 in b, 0, 1/3? b Let d = -41/12 - -27/4. Suppose 29u - 76 - 31 = 9. Which is the closest to -1/3? (a) -3/2 (b) d (c) u a Let d = 20187 + -20186.7. Let o = 78 - 236/3. Which is the nearest to 1? (a) -2 (b) o (c) d c Let n = 334/7 - 48. Suppose 0 = -642k - 434k + 5380. What is the nearest to -1 in k, 1/6, n, -12? n Suppose 15 = 33u + 15. Let m = 6961/3 - 2368. Let z = m - -49. Which is the closest to u? (a) -1 (b) z (c) 0 c Let r = 14629 - 14630. What is the closest to 2 in -0.3, 210, r? -0.3 Let j = 32 - 34. Let m = 1.95 - -0.05. Let g = j - m. Which is the nearest to g? (a) -1 (b) 0.4 (c) -4 c Let d be 162/(-432)(-8)/(-18). Which is the nearest to -16? (a) d (b) -1 (c) -4 c Let x = -335.7 + 336.2. Which is the nearest to 1/3? (a) -0.048 (b) 0.4 (c) -3 (d) x b Let x be ((-28)/(-6) - (-120)/(-20))/1. What is the closest to 1 in -0.6, x, -3? -0.6 Let i = 1.565 - 1.705. What is the closest to i in -0.23, -0.3, -4, -1/7? -1/7 Suppose 5h - 10 = 0, -4n + h + 11 = 17. Let q = 23 + -6. Let x = -12 + q. Which is the nearest to 0? (a) n (b) x (c) 0 c Let h = 0.13 + 0.144. Let j = -0.374 + h. What is the nearest to j in 0.4, 4/5, -3? 0.4 Let k = -114339/4 + 28585. Let b = -0.4 - -0.3. What is the nearest to k in -1/2, b, -1? b Let o = 346/1755 + 1/351. Which is the closest to -6? (a) 4 (b) -3 (c) o (d) -4 d Let p = 0.59 + 3.81. Let f = 37.4 - p. What is the nearest to 2/5 in 5/2, f, 0.5? 0.5 Let t = 8340 + -8187. What is the closest to -0.1 in -5, 1, t, 5? 1 Let q be ((-371)/35 - -11)1/2. Let o = -3/5 + q. What is the closest to -3 in -2/9, o, -3, -2/17? -3 Let x = 3941.5 + -3942. Which is the nearest to 1? (a) -5 (b) -2.1 (c) -12 (d) x d Let r = 24785 - 49573/2. What is the nearest to -8 in -3, 1, -5, r? -5 Let h = -235283/91 + 33636/13. Let y(t) = -t3 + 3t*2 + 3t + 4. Let z be y(4). What is the closest to z in -3/5, 1/9, h? 1/9 Let k(o) = -o*2 - 6o - 4. Let v be k(-3). Let j = 6 - v. Let d = 15847 + -15825. Which is the closest to j? (a) 2/3 (b) -2 (c) d a Let c = 15783/184 - 1970/23. Let b = -2 - -2. What is the closest to -0.02 in c, -3, b? b Let h = 3046.7 + -3047. Which is the nearest to 1? (a) h (b) 193 (c) 3 a Let m = 39317 + -39312. What is the closest to 2/5 in -0.5, m, 2, -1.9? -0.5 Let v = 3838.057 + -3834. Let x = v - 0.057. What is the closest to 0.1 in x, 0.3, -0.01? -0.01 Suppose -2k - n - 6823 = -6828, 10 = k - 2n. Let r = -254 + 4316/17. Which is the closest to -1.9? (a) r (b) 0.5 (c) k a Let r = -10826 + 10823. Which is the nearest to r? (a) 1/3 (b) 13 (c) -5/6 c Let h = 565.9 - 565.8. Which is the closest to h? (a) 2 (b) 0 (c) 1/2 (d) -3/14 b Let z = 0.4934 + -5.4934. What is the nearest to z in 1/8, -0.3, -1/6, -1/2? -1/2 Let b = 192 - 204. Let d be (-3)/b - 6/6. What is the nearest to -1 in d, 0.4, -3/5? d Let t = -3 + 4. Let v = -2839703 - -2839703.1. Let u = -0.1 - -2.4. Which is the nearest to -0.1? (a) t (b) u (c) v c Let x = 0.18556 - 1.18556. Which is the nearest to x? (a) -0.09 (b) 2/3 (c) 1 (d) 2.6 a Let x = 119 + -117. Let y be x/(-6)-1 - (-72)/(-135). What is the nearest to -1/3 in 0.4, -5, y? y Let g be (28249/(-52) - -6) + 3/1. Let y = g + 534. What is the closest to 0.1 in y, 131, 2/7? 2/7 Let n = 14725 + -14723. Which is the nearest to n? (a) -0.2 (b) 0 (c) 2.1 c Let f = 288 + -274.6. Let m = f + -13.4. What is the closest to m in -0.1, 4.2, -0.4? -0.1 Let l be (4434/(-8))/(((-132)/(-16))/(-11)). What is the closest to -2 in l, 0, -0.5, -2/9? -0.5 Let w = 0.2449 + 0.2551. Which is the closest to -2/59? (a) w (b) -0.5 (c) 3 (d) -3 b Let m = -440 - -652. Let s = m - 212.12. Which is the nearest to 2? (a) 5 (b) s (c) 2 c Let f be -20 + (276/48 - -14). Which is the nearest to 21? (a) -2/9 (b) -1/2 (c) 1/2 (d) f c Let j be (-62)/(-28) - (-2)/(-1). Let u = -1/14 - j. What is the closest to 2/11 in -4, u, -4/7? u Suppose 2t - 6t - 2a + 16 = 0, t - a = -2. Let i(c) = -c*2 + 13c + 96. Suppose 77 + 13 = 5y. Let h be i(y). What is the nearest to 0.1 in t, -4, h? t Let i(t) = -2t*2 - 12t - 4. Let f be i(-5). Let q be (-4)/14 - f/42. Let d = -157/44 - -42/11. Which is the closest to d? (a) 0 (b) -5 (c) q a Let v be 51/102 - (-28)/8. Which is the closest to v? (a) 1 (b) 1/4 (c) -4 a Let h = 7389 - 7339. Which is the nearest to -46? (a) -0.2 (b) h (c) 4 a Let z = -174.328 - -0.328. Let j = z - -174.2. What is the nearest to 2 in -0.3, j, -2/19, -0.4? j Let g = 4/1045 - 50582/1045. What is the nearest to -1 in -3/2, 3, g? -3/2 Let x = -5565 - -5565.2651. Let t = x + 0.0349. Let w = 2 - 3. What is the nearest to w in 5, -2, t? -2 Let u = 3/328 - -635/2296. Let m = -1.171 - 0.829. Which is the closest to u? (a) 2 (b) m (c) -1 (d) 3/2 d Suppose 0 = -3v - y + 33, 3y = 2v - 11 - 0. Let u be (-5)/v + (-26)/(-20). What is the nearest to 1/2 in -3, u, 0.5? 0.5 Let k be (-3648)/(-3276) - 4/7. Let a = k - 10/39. Let h = 7 + -4. What is the closest to 0 in a, -0.4, h? a Let o be -1 + -1 + 15/(90/4). Which is the closest to -73? (a) o (b) -1 (c) -1/2 a Suppose -210r + 212r - 5 = 5g, -3r - 3 = 3g. Which is the closest to r? (a) -103 (b) -0.3 (c) 5 b Suppose 8u = 9u - 42. Let w = u + -17. Let v = w - 24. What is the nearest to v in -3, -0.1, -5? -0.1 Let y be 60/(-3)(-8)/32 + 108. Let m = -1019/9 + y. Let d = -19 - -75/4. Which is the closest to -0.2? (a) -0.2 (b) m (c) d a Let b = -15 - -17. Let c = -66 + 61. Let r = -0.043 + 0.343. What is the closest to b in -4, r, c? r Let z(j) = 2j*2 + 34j - 21. Let u be z(-21). Let l = -154 + u. Let o = 66/13 - 436/91. Which is the nearest to 0.1? (a) o (b) l (c) 0.2 c Let c = -4879 + 43913/9. What is the nearest to -0.1 in -6, 4, c, -5? c Let z be (-2)/9 - (-124)/72. Let i = -25673 - -25672. Let m be (-1)/((2/(-1))/2). Which is the nearest to i? (a) -1/3 (b) z (c) m a Let m = -32143 + 32143.5. Suppose -3u + 4f + 2 = -0, -4f = -5u + 6. Which is the nearest to u? (a) 2 (b) -0.1 (c) m a Suppose -62l = -24l. What is the nearest to -3/2 in -4, 2, l, -1? -1 Let r be ((-1538)/5383)/((-32)/14-1). Which is the closest to 0? (a) r (b) -9/8 (c) 0 (d) -3/16 c Let y = 0.02926 + -71.02926. What is the closest to y in -1, -2/3, 1/3? -1 Let p = 13458 + -13458. What is the closest to -83 in p, 0.1, -6/5? -6/5 Let b = 5190 + -5198. What is the nearest to 1/52 in b, 5, 1? 1 Let d = -50.165 - -55.165. Let r = 1.7 + -14.7. Let l = 25 + -51/2. What is the closest to l in d, r, 2? 2 Let h = -12150.1 - -12150. What is the closest to 7/5 in h, 2/9, 3? 2/9 Let s be 1 + 6 - 280/42. What is the closest to s in 0.4, -2/41, -0.03? 0.4 Let a = 98.612 + -99. Let c = 0.488 + a. Let z = -4.4 + 4. What is the closest to c in 0.1, z, 2/9? 0.1 Let g = -16254 + 16252. Which is the closest to 0? (a) -49 (b) -7 (c) -0.1 (d) g c Let i = -0.1 + -0.3. Let n = -3069/2 - -1577. Let o = n + -43. Which is the nearest to o? (a) i (b) -2/11 (c) 0.5 a Let x = -110 + 109.8. Let p = -3.223 - 0.277. Which is the closest to 0.2? (a) p (b) -0.4 (c) x c Let w = 3327.4 - 3327. What is the nearest to 3 in -3/5, -8, -5, w? w Suppose -o - 8 = -3o - 3s, -3s = -o - 14. Let z(x) = -7x2 - 4x - 5. Let p be z(o). Let d = 186/5 - 37. Which is the closest to p? (a) d (b) -1 (c) 0.3 b Let n be (-1 - 3/(-6)) + 0. Suppose -3l = -2l. Let z be ((-1)/(-6))/(90/(-60)). Which is the nearest to n? (a) z (b) -3/5 (c) l b Let q = -1369.6 + 1370.6. Which is the nearest to -1? (a) 0.2 (b) -1/2 (c) -1/26 (d) q b Let l = -2085 - -2038. Which is the nearest to -0.1? (a) -7 (b) -1/3 (c) -0.5 (d) l b Let v = -26.9 + 27.039. Let f = 1.139 - v. What is the nearest to f in -3/5, -2/5, 0.2? 0.2 Let l = 287.9 - 287.7. What is the closest to 1/37 in 4, -3/2, l, 2/7? l Let n = -9424/21 - -1348/3. Which is the nearest to 14? (a) -0.19 (b) 0 (c) n c Let g = -5888/3 - -5887/3. Which is the closest to g? (a) 0.7 (b) 60 (c) 2 a Suppose 118s + 652 = -35s - 10*s. What is the nearest to 1 in -0.4, -62, 0.1, s? 0.1 Let v = -1 - -1.1. Let y = -0.02319 - -0.02319. What is the closest to y in -15, 1/8, v? v Let a = -276.64 - -2.64.	{ "pile_set_name": "DM Mathematics" }
h? h Let d = 53 + -51. What is the fourth biggest value in 0.4, d, 0.2, -1? -1 Let r = -58 - -53. Which is the fourth biggest value? (a) -0.4 (b) r (c) -2 (d) -1 b Let s = -1 + 1. Suppose b + b - 6 = s. Suppose -2a + ba + 9 = -2w, -5a = w + 9. What is the third smallest value in 3/7, w, 3/8? 3/7 Let z be (-18)/264 + (-1)/(11/2). Which is the third smallest value? (a) -0.3 (b) 0.4 (c) z (d) -4 c Let q = -27.4 - -27. Which is the second biggest value? (a) 11 (b) q (c) -0.2 c Let p = 0.2 - 0.2. Let d be ((-5)/(-3))/((-4)/(-12)). Suppose 0 - d = t. Which is the second biggest value? (a) t (b) 5 (c) p c Let v = -8 - -6.5. Let l = 3.5 + v. What is the smallest value in -3/7, l, -5? -5 Let f be 5/2(0 + -1). Let z = -0.0224 + 0.5224. What is the biggest value in 2/11, z, f? z Let w = -0.5 - -0.1. Let z be -6(-2 + (-10)/(-6)). Let j = 9/5 - z. Which is the biggest value? (a) w (b) j (c) 5 c Suppose 2y + 3y - 5 = 0. Let a = -0.8 + 0.6. What is the third biggest value in a, 0, y? a Let m be (-30)/4(-5)/(-50). Suppose 3b - 4 = 5. What is the smallest value in m, b, -0.4? m Let c(x) = -6x2 - 2x. Let m(l) = -l*2. Let a(b) = 2c(b) - 14m(b). Let f be a(3). Let t be 0 - ((-4)/2)/(-4). What is the third smallest value in t, 1, f? f Let u = 1 - -3. Let i = -28.2 + 29.2. What is the second smallest value in i, 0.4, u? i Let t = 20 + -20.5. Which is the smallest value? (a) -1 (b) t (c) 0 a Let o be ((-12)/165)/((-4)/(-10)). What is the biggest value in o, -1/3, 0.5, 1? 1 Let z be (-4)/(-10) + 356/10. Let y be (-2)/8 + 21/z. Which is the second biggest value? (a) -4 (b) 4 (c) y c Let v be (-4)/(-44)5/(5/2). Let h = -0.08 + 0.38. Which is the second smallest value? (a) -0.04 (b) v (c) h b Let o = 4 + 1. Let j = o + -6. Let n = -2 - -2. Which is the smallest value? (a) 2/17 (b) n (c) j c Let h = -59.8 - -60. Which is the second smallest value? (a) 3 (b) h (c) -0.4 (d) 2 b Let v = 10/5227 - 5284567/36589. Let f = 144 + v. Which is the biggest value? (a) -0.3 (b) 4 (c) f b Let d = -18 - -18.1. What is the biggest value in -0.2, d, -2/25? d Let r(h) = -3h + 4. Let n be r(3). Let y = -0.41 - -0.01. Which is the biggest value? (a) y (b) 3/5 (c) n b Let r = 16.4 + -16. Which is the third smallest value? (a) r (b) 1/10 (c) -2/5 (d) 1 a Let o be 3-1 - (1 + -2). Let g = 0.8399 + 0.0601. What is the smallest value in 4, g, o? o Let d = 0.159 + -0.059. What is the third biggest value in d, -0.3, 13? -0.3 Let d = -7 - -7.12. Let b = d - -3.88. What is the second biggest value in -5, -2, b? -2 Let v = 20907/38779 - 2/2983. Let u = 8/39 - v. What is the second biggest value in -6/11, u, -0.2? u Let y = 279 + -3067/11. Which is the second biggest value? (a) y (b) 5 (c) 0.3 c Let i = 0.3 + -0.2. Let r be 0/(7 + 0 + -3). Which is the biggest value? (a) i (b) 1 (c) r b Let r = -0.05 - 0.15. Let f = 2.2 - 2. What is the second smallest value in -1/3, r, f? r Let h = -0.3 + -0.2. Let o(j) = -j*3 + 3j*2 + 3j + 4. Let f be o(4). Let u = 0 - f. Which is the third biggest value? (a) h (b) u (c) 0.5 a Let y be -2 + (-7)/(-3) + -1. Suppose -u + 1 + 3 = 0. Suppose 5p = -x + 18 - u, -5x = -20. Which is the biggest value? (a) p (b) 1/3 (c) y a Let g = 0 - 2. Let x be (g/(-6))/((-1)/15). What is the biggest value in -3, x, -0.3? -0.3 Let r = 0.07 + 7.93. Let w = 4 - r. Which is the smallest value? (a) -5 (b) -2/3 (c) w a Let i be 0 + 0 + (-9 - -12). Suppose 2m - m + 34 = 4j, -28 = -4j + 4m. Suppose -5z = h, j - 38 = 4z - 5h. What is the smallest value in z, 0.4, i? z Let x be (-3 + -2)/(-1)1. Let r = 4/9 - 1/9. What is the third biggest value in -4, r, x? -4 Let n = 4.77 - -0.23. Let q = 0 + -0.4. Let f(d) = d*3 - 4d*2 + 3d - 2. Let p be f(2). Which is the second biggest value? (a) n (b) p (c) q c Let i = -2480/13 + 191. Let x be 111/135 + (-4)/18. Which is the third biggest value? (a) -4 (b) x (c) i a Let k = -1 - -1. Let z be (-25)/9 + 5 + -2. Which is the biggest value? (a) z (b) 3 (c) k b Let k = 1.8 + -1. Let g = 0.8 - k. Which is the third smallest value? (a) g (b) -4 (c) 2/11 c Let o be ((-2)/4)/(2/(-4)). Let n = 20 + -16. Which is the smallest value? (a) -0.4 (b) n (c) o a Let b = -0.3 - 0.7. Let i be (0 + -1)-316/(-36). What is the second biggest value in 0, i, b? b Let d = -292 + 487. Let i be 1/5 - 104/d. Which is the smallest value? (a) 1 (b) -7 (c) i b Let w = -358/9 + 4010/99. Let c = -39/22 - w. What is the biggest value in 0.9, c, 5? 5 Let r = 6 + -7. Let u = 0.8 + r. Let j = -11/28 - -1/7. Which is the second smallest value? (a) u (b) 4 (c) j a Let k = 9 + -9. Let o = -5 - k. Which is the third biggest value? (a) o (b) -2/5 (c) -2 a Let i = 4 - 3. Let k be (-315)/12(-54)/(-20). Let z = 71 + k. What is the third biggest value in z, i, 3? z Let p = 2.97 + 0.03. Which is the third smallest value? (a) -0.4 (b) p (c) -3 (d) -2 a Let x = 4.4 + -4. Let i = 6.8 - -29.2. Let h = -35 + i. What is the third biggest value in -5, x, h? -5 Let j = 4.9 - -0.1. Let g = 5 + -6. What is the biggest value in g, 0.4, j? j Let z(k) = 2k + 2. Let w be z(-6). Let i be ((-2)/10)/(4/w). Which is the smallest value? (a) i (b) -3 (c) 3 b Let d(y) = -y*3 + 5y*2 - y - 1. Let a be d(4). Let j = a + -8. Suppose -m = -2l + j, -4l - 5m = 4 - 3. What is the third biggest value in -0.3, 2, l? -0.3 Let i = 0 - -16.5. Let y = i - 16. Let x = -5 + 10. Which is the third biggest value? (a) -1 (b) y (c) x a Let p(s) = s*3 + 6s*2 + s + 6. Let d be p(-6). Let x = 17 + -11. Suppose xq = 2q + 12. What is the second biggest value in d, q, 1? 1 Let n = 1.8 + -1.4. Which is the second biggest value? (a) 0.1 (b) n (c) 1/2 b Let v(j) = -11j - 1. Let z be v(-4). Let q = z + -345/8. Let n = -1.01 + 0.71. What is the biggest value in 1/2, q, n? 1/2 Let m = -0.9 + 0.9. Let f = 0.4 - m. What is the biggest value in f, 3, 0.5? 3 Let n = 2 + -2. Let w be 0/1 - (-1)/(-4). What is the second biggest value in n, -0.3, w? w Let g = -5.7 + 6. Let o = -5.3 + g. What is the biggest value in 4, -0.4, o? 4 Let x = -235 - -234.5. Let p = 0.1 - -2.9. Which is the smallest value? (a) 1/2 (b) p (c) x c Let q = -0.05 - -7.05. What is the biggest value in q, -1/4, 2/5? q Let o = 15 + -11. Let x be 62/(-36) - o/(-18). Let v = -13.7 - -18.7. Which is the biggest value? (a) 5/4 (b) x (c) v c Let i = -22 - -17. Which is the second smallest value? (a) -2/3 (b) -4 (c) i b Let w be (-266)/357 - (-4)/6. Let p = w + 83/408. What is the second biggest value in 0.4, 5, p? 0.4 Let d = 9 - 7. Let s = 0.1 - -0.1. Which is the second smallest value? (a) d (b) 5 (c) s a Let h(d) = 2d - 1. Let o be h(2). Which is the third biggest value? (a) -0.02 (b) o (c) 2/11 a Let o = 9/77 + -5/231. What is the third smallest value in o, 4, 3? 4 Let m = 0 + 4. Which is the second biggest value? (a) m (b) 3/5 (c) 2 c Let f = 0.37 + -0.07. Let t = 0 - f. Let x = t + 0.8. Which is the second smallest value? (a) 0.3 (b) x (c) -0.2 a Let d be (-12)/(-8) - 134/84. Let t = 1.03 + -1.1. Let a = 0.23 - t. What is the second smallest value in 0.2, a, d? 0.2 Let p = 1.95 + 0.05. Let x(q) = 2q - 2. Let k be x(-5). Let m be 15/k + 3 + -1. Which is the third biggest value? (a) 0.5 (b) m (c) p a Let y(h) = 6h2 + h. Let v be y(-1). Let i be (2/(-4) - -1) + -1. Which is the smallest value? (a) 1/4 (b) v (c) i c Let d be ((-2)/3)/(13/3). What is the smallest value in d, -0.1, -1/4? -1/4 Let w be 1/(-5) + (-6)/(-15). Let y = 46/473 - 12/43. Let r be -2 + (-125)/(-35) + -1. Which is the second smallest value? (a) r (b) w (c) y b Let o = 0.4 - 0.3. Let v = o - 0.4. Let q = v - -0.4. Which is the biggest value? (a) -1/4 (b) q (c) -5 b Let i = -0.76 + -0.24. Let z = -0.7 - i. What is the third smallest value in 1, z, -0.3? 1 Let g = -2.8 - -3. Let l = -0.17 - -0.09. Let c = l + -4.92. What is the third smallest value in c, g, -4? g Suppose x = -5m - 7, 4x - 4m - 26 = -6. Which is the second biggest value? (a) 0.1 (b) -1/7 (c) x (d) -0.1 a Let s = -18 - -19. Which is the smallest value? (a) -1 (b) -5 (c) s b Let n be (-2)/8 + (-14)/8. Let l = -6 - -5. Let i = 117 - 587/5. What is the second smallest valu	{ "pile_set_name": "DM Mathematics" }
factors of t? 11 Let f be (-1)/(-5) + (-72)/(-15). Let c be 196/6 + (-2)/3. Suppose k + c = fk. List the prime factors of k. 2 Let q(k) = k3 + 9k2 + 4. Let u be q(-9). Let m(x) = x3 - 4x2 + 5x + 4. List the prime factors of m(u). 2, 3 Suppose -3 = 3u + 3. Suppose 2n - r - 15 = 0, 2n - 3r - 35 = -2n. Let w = n + u. What are the prime factors of w? 3 Suppose 2w - w - y = -6, -2 = 3w + 5y. Let q(l) = l*2 + 3l - 2. Let u be q(w). Suppose -a = 5k - 2a - 18, 4a + 6 = -uk. List the prime factors of k. 3 Suppose -4z + 200 = x, -2z - 133 = -5z - 5x. What are the prime factors of z? 3, 17 Let d = -3 + 5. Let s = d - -5. What are the prime factors of s? 7 Let g(i) = i*3 + 3i*2 + i + 1. Let p = 7 + -9. Let x be g(p). Suppose 0 = -5f - 0b - 4b + 60, -xb + 1 = f. List the prime factors of f. 2 Suppose h - 3h + 2c = -2, 3h - c + 5 = 0. Let j be (-1 - (h + 0)) + -2. Suppose 5o + 0o = -5q + 30, -3q + o + 30 = j. List the prime factors of q. 3 List the prime factors of (1348/(-48)-3)/(2/8). 337 Let h(m) = -2m - 12. List the prime factors of h(-8). 2 Let n(m) = 23m2 + 3m + 6. List the prime factors of n(-3). 2, 3, 17 Let b(g) = -g + 1. Let q(u) = -u*3 - 4u*2 - 2u - 1. Let w be 1/3 - (-7)/(-3). Let h be q(w). What are the prime factors of b(h)? 2, 3 Let w = 5 + 37. List the prime factors of w. 2, 3, 7 Suppose 0 = -5w + 5j + 20, -j + 3j + 8 = -w. Suppose wc + 4c - 8 = 0. Suppose 5r + 45 = 3d, 2r + 12 = -cr. What are the prime factors of d? 2, 5 Suppose 4r - 9 - 27 = 0. Suppose 4c - rc + 95 = 0. List the prime factors of c. 19 Suppose 0 = 4n - w - 12, 16 + 0 = 4w. Suppose -33 = -5u - 8. Suppose 4q - ug = 14 + 8, 0 = -q + ng. What are the prime factors of q? 2 Suppose 0 = -3p - 2p + 425. What are the prime factors of p? 5, 17 Suppose -3o = -12 + 6. What are the prime factors of o? 2 Let p(c) be the third derivative of c5/60 - 7c4/24 - c3/3 + c*2. Let u be p(8). Let i = 3 + u. What are the prime factors of i? 3 Suppose -q - q = -10. Suppose b - 20 - 120 = -3l, 4l + qb = 194. Suppose -4w - 14 = -l. List the prime factors of w. 2 Let x(a) = a3 + 15a*2 - 3a - 7. List the prime factors of x(-15). 2, 19 Suppose -6b = -3b - 5c + 6, -3 = 2b - 3c. Suppose -3 - b = -3t. What are the prime factors of t/((1 - -2)/18)? 2, 3 Let d(h) = h*2 - h - 13. List the prime factors of d(-7). 43 Let r(v) = -v - 5. Let w be r(-7). Suppose 2d - 30 = w. List the prime factors of d. 2 Let y be ((-4)/8)/((-1)/(-184)). Let z be (y/6)/(4/(-6)). Suppose 4a = 3u - z, 0 = -0u + u + 3a + 1. What are the prime factors of u? 5 Let j = -4 + 6. Let n(a) = -2a2 + 2 - 7a + 3a2 - ja2. List the prime factors of n(-6). 2 Let z be ((-22)/6)/(1/3). Let s(p) = p3 + 10p2 - 12p + 8. What are the prime factors of s(z)? 19 Let k(h) = -h3 + h2 - h - 2. Let u be k(0). Let t(b) = b + 2. Let w be t(-2). What are the prime factors of u/(-1) - (w + -2)? 2 Let l be 6/(-27) + 40/18. Suppose -lx + 51 = x. List the prime factors of x. 17 Suppose r = -3t - 19 + 114, 5t - 189 = -2r. List the prime factors of r. 2, 23 Let n be (0 + -2)/(-1 + 0). Let f(a) = -n + a - 3a - 6. List the prime factors of f(-9). 2, 5 Let n = 17 + 65. What are the prime factors of n? 2, 41 Let w = -4 - -4. Let g = w - -2. Suppose -gb - 10 = -o, 2o - 6o + 5b + 43 = 0. List the prime factors of o. 2, 3 List the prime factors of (-8)/2(795/(-20) + 5). 139 Let u be 5 + (-2)/(-2) + -1. Let q = u - 1. Let s(c) = c*3 - 3c*2 - 2c - 1. List the prime factors of s(q). 7 Let v = 21 + 89. What are the prime factors of v? 2, 5, 11 Suppose 2f - 3 - 5 = -3o, 5f - 4o - 43 = 0. Let y = f - 3. Suppose 0 = 3q - 3n - 45 - 15, yq + 3n - 73 = 0. List the prime factors of q. 19 Let i be ((-2)/2)/(10/(-30)). Suppose -122 = -ia - 5k, -2a + 37 = -5k - 11. List the prime factors of a. 2, 17 Let c be -12(-1 + (-3)/(-6)). Suppose 65 = -p + cp. Suppose -a - p = -2a. List the prime factors of a. 13 Suppose 3k = k + 10. Let t be (7 - -2)(k + -4). Let f = t + -1. List the prime factors of f. 2 Suppose -2u = 5 + 1, -3z - 30 = 2u. Let p(v) = -v*3 - 8v*2 - 3v - 7. List the prime factors of p(z). 17 Let g(c) = 2c + 2 - 5 + 1. Let q = 7 + -3. List the prime factors of g(q). 2, 3 Suppose 4q - 7q = 4g - 1040, -g = q - 260. List the prime factors of g. 2, 5, 13 Suppose -4j + 5j = -4. Let y = 6 + j. Suppose yq + a = 23, 4q - 5a = -0q + 67. List the prime factors of q. 13 Let z(j) = 2j2 + 13j + 5. Let p be z(-11). Suppose 4l - p = -8. What are the prime factors of l? 2, 3 Let p(x) = 3x*3 + 2x*2 + 3x - 3. Let t(w) = 48w3 + 33w*2 + 48w - 48. Let v(y) = 33p(y) - 2t(y). List the prime factors of v(2). 3 Suppose 56g - 53g - 378 = 0. What are the prime factors of g? 2, 3, 7 Let s(f) = 14f2 + 4f - 6. Let k(o) = -5o2 - o + 2. Let v(q) = 17k(q) + 6s(q). Let t be v(7). List the prime factors of 1/2 + (-7)/t. 2 Let k(r) = -12r - 3. What are the prime factors of k(-3)? 3, 11 Let n be (-4)/(-10)-1-10. Suppose -w - 3w = 4y, -y - n = 0. What are the prime factors of w? 2 Suppose 4s = -v - 10, -3s = -2v - 0s + 24. Suppose -3x - v = -33. List the prime factors of x. 3 Let o(f) = 36f*2. Let v(z) = 2z + 15. Let s be v(-7). List the prime factors of o(s). 2, 3 Let c(h) = h*3 - 5h*2 + 4h + 2. Let x be c(4). Suppose xl - 6 = 4. What are the prime factors of l? 5 Suppose -3u - 2u - 50 = 0. List the prime factors of ((-13)/2)/(5/u). 13 Let f = -1 + 4. Suppose 0 = 4g + 8, fr + 2g + 0g - 17 = 0. List the prime factors of r. 7 Suppose -u + 37 + 54 = 0. Suppose 85 = 5c - 5r, 0 = 5c + r - u + 18. List the prime factors of c. 3, 5 Let l be (-7)/2-118. Let m = 109 - l. Suppose p - 4p - 43 = -4i, m = 5i + 4p. What are the prime factors of i? 2, 5 Suppose 3m - 40 = -10. Suppose 0 = 2w - 7w - m. Let c(t) = 3t*2 - 2t + 1. List the prime factors of c(w). 17 Suppose 0 = -q - 5, 0q + 415 = 5l + 4q. Let z = l - 37. What are the prime factors of z? 2, 5 Let x(t) = t3 - 4t*2 - 12t - 16. List the prime factors of x(7). 47 Suppose -2i - 21 = -65. Suppose -i = -b - b. List the prime factors of b. 11 Let o(n) = -6n + 4. Let p be o(-4). Suppose -1 = -3k + 5. Suppose kz - p = -2z. What are the prime factors of z? 7 Suppose 2l + 3 - 13 = 2d, 5l - 3d - 25 = 0. Suppose -4o - 2z = -200, 0 = lo + 3z - 166 - 84. Suppose 2k = 7k - o. List the prime factors of k. 2, 5 Let a(l) = l3 - 14l*2 + l - 5. Let n be a(14). Let i = -4 - -7. Suppose 4m + iq = n, -4m + q = 2 - 15. List the prime factors of m. 3 Suppose 5t + 5 = 4t. Let q(l) = l*2 + 6l + 7. List the prime factors of q(t). 2 Let m(g) = -9g2 - 1. Let r be m(-1). Let f(p) = -p3 - 10p2 - p - 5. List the prime factors of f(r). 5 Let r(o) be the second derivative of o5/20 - o4/4 - o2 - 5o. What are the prime factors of r(4)? 2, 7 Suppose 17 - 51 = -2y. List the prime factors of y. 17 Suppose 0d - 4 = -4d. Let y be (-4)/22 + (-468)/(-33). What are the prime factors of d/((8/y)/4)? 7 Let p(u) be the first derivative of u*4/4 + 4u*3/3 + 3u*2/2 + 5u + 1. Let a be p(-4). List the prime factors of (-2)/a + 276/14. 2, 5 Suppose 0 = 8y - 371 + 3. What are the prime factors of y? 2, 23 Let j(r) = 24r2 - r + 5. List the prime factors of j(2). 3, 11 Let j(b) = b3 + 15b2 - 15b - 13. What are the prime factors of j(-15)? 2, 53 Suppose -3b = 5q - 211, -5b + 0b - 3q + 341 = 0. What are the prime factors of b? 67 Let k(u) = -u2 - 12u - 14. Let d be k(-10). Let s = 12 + d. List the prime factors of s. 2, 3 Let y(q) = 28q + 35. List the prime factors of y(5). 5, 7 Let q = 9 - 7. Suppose -3n - qs = -6n + 45, -3n + 48 = -3s. What are the prime factors of n? 13 Let u(s) = -24s3 + s2 + s. Let w be (-1 - -4)8/(-24). What are the prime factors of u(w)? 2, 3 Let i(j) = -j*3 + 3j*2 + 4j + 1. Let o be i(4). Suppose -4 = -5w + o. Suppose -2z + 11 + w = 0. List the prime factors of z. 2, 3 What are the prime factors of 2 + (0 - (-294 - (1 + -2)))? 5, 59 Suppose 2d = -4w + 3d - 27, d - 3 = 0. List the prime factors of (-59)/(-2) + w/12. 29 Let c(s) = -s2 + 11s - 13. Let t be c(9). Suppose 61	{ "pile_set_name": "DM Mathematics" }
ming c is positive. c*(65/2) Simplify (z/((zz*(3/2))/z)z/(z*(-6)z))*(-18)(z/(z*1z))*(-11)/((z/(z/(((z/(zz/(z*(-4)z)z))/z)/z)))/(zzz/z(2/17))) assuming z is positive. z(-1328/17) Simplify ((i(-2/7)/i)/ii*(1/2)i(-3)/(i(-3/5)/i))/(i2/i(-2/11))11 assuming i is positive. i(-1903/70) Simplify ((uu1u)/u)*41uu/u(3/7)u*(1/4)(u(-2/7))(1/19)(uu/(u(u(-3/5)/u)/u)u)/uuu(-2/3) assuming u is positive. u(700163/7980) Simplify (o(-6/11))(-19/2)o1o(-12) assuming o is positive. o(-64/11) Simplify ((b13/b)34((b(1/4)/b)/b)(-1/30))6 assuming b is positive. b(48967/20) Simplify ((gg/(gg16gg))49/(g5/(gg22)))(-2/15) assuming g is positive. g(326/3) Simplify ((b(-2/7)/b)*(18/13)bb(1/3)bb(-6))(2/41) assuming b is positive. b(-2974/11193) Simplify (l(2/3)l*(1/3)l)*(6/17)/((lll(1/3))5/(l(-1)/l(ll3/lll)/l)) assuming l is positive. l(-457/51) Simplify ((w(-4))2w(-14)/(w6/w))(-47) assuming w is positive. w1269 Simplify (l*2l/(l*(-5)/l)l(lll(2/3)l)/(l/(l*1l)))/((l0/l)11)41 assuming l is positive. l(1397/3) Simplify ((gg/g(-2/5))/(gg/(g/(g*(-2)g)))(gg/(g*(-6)/g))/gg/(gg(1/2)))/((g2g)/(g*(-1/2)g)(ggg(2/7))/g(-3)) assuming g is positive. g(74/35) Simplify ((d(-2/15)d)/(dd(-6)/dd))*46(d*4dd)/(dd*(-6))(d/d*(3/7)dd)/d(-2/11) assuming d is positive. d(327581/1155) Simplify (((a(1/18)aaa/a(-5/2))/(a3/(aa/(a/((aa/(a*(-6)aa))/a)))))(-49))32 assuming a is positive. a(-120736/9) Simplify yy*(3/7)y*(-14/3)y*33y(1/7) assuming y is positive. y(628/21) Simplify (x*(1/3)(x/((x/(xx(-5)/x))/x))/xx(x/(x/(x(-2)/xx)))(19/5))/(x/x(-6/7)x(-2))(-2/69) assuming x is positive. x(-9073/805) Simplify ((n1/n7)/(((n/n(2/9))/n)/(n/n(-1/9)n)))/((n5)5)(1/9) assuming n is positive. n(-58/9) Simplify ((jj/j(4/3)j)(-47))(-9/2)/((j/(jj(-1)j))(-8/9)/(((j(-1)/j)/j)/j(-4))) assuming j is positive. j(707/2) Simplify ((a/(a*6/a)a*3)/(a(a*(2/7)/a)/aa)(-31))/((a(-2/13)/a)/(aa(-5))(a*(-1)a)(-1/13)) assuming a is positive. a(456/91) Simplify ((a/a0)(-2/37))(-33)/(a(-4/7)/((a/((a/a*0)/a))/a)aa(-2)a/a(-1/2)) assuming a is positive. a(961/518) Simplify (t/((t/(t/(tt/t(-2/3))))/t))(-19/2)(t0)(39/7)(t(-1/4)t/(tt/t(2/17)))(-1/33) assuming t is positive. t(433/68) Simplify ((z(12/11))(41/5)z*18(zz/(zz(10/13)))/z)(35/2) assuming z is positive. z(65506/143) Simplify ((((y(4/7)/y)/(y/(y/(yy(-20)))))(2/81))39)(1/9) assuming y is positive. y(3380/1701) Simplify (((oo*(-2/3)o)/o)*(-44)/((ooo(2/3))/o)(1/49))/(((o1o)/o)*(3/32)o/(o*(2/11)o)oo(1/4)) assuming o is positive. o(-820795/51744) Simplify b(2/41)/(b23bb)(b(-2/17))50 assuming b is positive. b(-21491/697) Simplify ((b/b(-12))/(b/(b(b/b*(2/7))/bb)))(1/3)/((b(-1/4)/b)(-50)/(b(-2/25)/b(-1))) assuming b is positive. b(-19953/350) Simplify (o/o3)/o(1/5)o/(oo/o*(-1/5))(oooo6)/o(o(-1))(-38)o/(o/(o(-4/7)/o))oo(-5) assuming o is positive. o(1296/35) Simplify ((w(-2/11)w)/ww)41(((w*(-4/19)/w)/ww)/w)(-15) assuming w is positive. w(13941/209) Simplify (b*(-8)bb/b(-2/3)b)(4/3)/(b(1/18)/b(-9))(-31) assuming b is positive. b(4949/18) Simplify (q9q/q(-9)(q/(q/(q/(q/(q/q*(8/7)))q)))/(qq/q(-9/4)qqq))(-37) assuming q is positive. q(-13061/28) Simplify (w/(w/w*(-1/11)))/(w/((w/(ww*(21/2)))/w))((ww/(w(-6/11)w))/w)(3/14) assuming w is positive. w(-1921/154) Simplify (((((((m/m15)/m)/m)/m)/m)(1/38))(-7/2))19 assuming m is positive. m*(63/2) Simplify ((n((nn(2/9)n)/n)/n)/((nn1/nn)/n)(nnn/(n(-1/4)/n)n)(1/4))/(n3nn(n(2/9)n)/n)(-1/16) assuming n is positive. n(67/36) Simplify ((m(-5))(1/57)/(m*(-1/7)mm(3/13)))2 assuming m is positive. m(-12196/5187) Simplify ((ll(-4)/l)/(l(-7)ll))/((ll/(ll/l(-2/11)))/((l(1/4)/l)/l))((l/l(2/11))3)49 assuming l is positive. l(5267/44) Simplify (a(1/3)/a)(-2/21)a*(1/7)(a/(aaa*(2/9))aa)/a(a8/(a/a(4/7)))23 assuming a is positive. a(10970/63) Simplify (h((h(-1/4)/h)/h)/hh/(h(h/(h/h(-26)h))/hhh))/(h(h/((h(-16)/h)/hh))/h)(2/101) assuming h is positive. h(9451/404) Simplify (((((m/(mm3m))/m)/m)/m)/(m/m*(1/6))(m/((m/(mm/(m/(m1m)m))m)/m))(-13))/((m/m(2/7))/m8)(-6/23) assuming m is positive. m*(-34519/966) Simplify (cc/(cc18)cc)(-24)/(c(3/20))12 assuming c is positive. c(1791/5) Simplify (v(-1)vv(vvvv(-7)vv)/vv(v(1/3))(-8/3))/((v(-2)/v5)/((v(6/11)v)/(vv(-8)vv))) assuming v is positive. v(1154/99) Simplify ((a25)31a*(-42)/(a/(aaa(-40))a))(21/5) assuming a is positive. a(14553/5) Simplify ((n/(n*(-6)n))/n*2(nn(-1/4))/n7)/(n/(nn*4)n/(n7/n))50 assuming n is positive. n(1791/4) Simplify (((b29bb(-2/59))(-31/3))(2/49))41 assuming b is positive. b(-4494256/8673) Simplify ((u/u6)/((uu/(u/u(-6)))/u))(-22)/(u(3/5)/u(-3/5)u*(-2)/u(uuu*3u)/uu) assuming u is positive. u(-131/5) Simplify (n(-1))(-1/8)(n/(nn(1/3))nn)(-32)(n*(1/9)n*(1/6))/(nn0)(-20) assuming n is positive. n*(-2371/72) Simplify q/(q/(qq*(1/12)qq))(q*(-2)/q)/qq(q/(q1q)q)/q(-3)(q*4qqq/(q/q*(-1/9)q)q)(2/3) assuming q is positive. q(757/108) Simplify s(-4)s/(s/(ss/s5s))(s/(s/s(-3/4)))/s(-2)(s*(-2/19)s*4ss)(-7/5) assuming s is positive. s(-4941/380) Simplify ((k/k(-2/17)kkkk)/k(-5/9)k*(-9/5)kkk*(-16)k)(-44) assuming k is positive. k(307208/765) Simplify (((((r/r*(1/5))/r)/(rr(2/3)))/(r5r(2/19)/r))11)(-15/7) assuming r is positive. r(18722/133) Simplify (i3ii/(i/(ii*2/ii)i))(-17)/((((i/i(-7))/i)/i(1/5))/(i2/(i(3/2)/i))) assuming i is positive. i(-1073/10) Simplify ((r(-1))(-19)/(r/(r(rr(-3/7))/rr)rr(-1)))/((r(2/5)/r)/(r/(r/r(-6/11))))(2/69) assuming r is positive. r*(173319/8855) Simplify ((mm(4/7))(-34)(m/((m/(mm*(-2/5)/mm))/m))32)49 assuming m is positive. m*(-546/5) Simplify (u(u/(((uu(-1/63)u)/u)/u))/uu)(-34)/(u/(uu*23)u)(-2) assuming u is positive. u(-7090/63) Simplify (u*6uu/u(-3/10))(-45)/(((uu(-3/8)/u)/u(-1))/((u/(u*7uu))/(u/((uuu(3/2))/u)))) assuming u is positive. u(-3045/8) Simplify (b/(b/(b(-16)bb)b)(b/(b/b13))/b)/(b/(bbb/(b/b(-32))b))(33/7) assuming b is positive. b(-1011/7) Simplify ((((x/x*(-5)x)/x3)/(((x(2/19)/x)/x)/(x/x7)))(-2/3))(-2) assuming x is positive. x(-8/57) Simplify (k*28kk(1/3))/(k(1/26)kk(-6/13)kkkk) assuming k is positive. k(1931/78) Simplify ((uu*2uu(1/6))/(u(-2/41))(-9/8))5 assuming u is positive. u(10115/492) Simplify ((k(-1))(6/19)/(kk(-1))(-28))/(((k/(kk/(k/(kk*(-1/2)))))/kk*(-6))/(((kk*2/kk)/k)/k2)) assuming k is positive. k(273/38) Simplify (t(t(5/8)t)/t)/(tt(3/38)tttt)t(-17/4)/(t(-37)/t) assuming t is positive. t(4605/152) Simplify s(2/113)/(ss(-3/13)ss)(s(1/41))40 assuming s is positive. s(-106962/60229) Simplify ((a/a3)/((a((((a/a(3/8))/a)/aa)/a)/aaa)/aa)(a1/a)(-40))/(((a*(-2)a)/aa)(-4/11)/(a(-3)/(a/(aa(1/13))))) assuming a is positive. a(-6763/1144) Simplify (d*(-2/43)d/(d/(d/((d/d*(-16))/d)))d(-1)/d(2/9))(4/11) assuming d is positive. d(-25184/4257) Simplify (ii(1/2)/ii(-3))(-2/35)(i(-4)i5)12 assuming i is positive. i*(85/7) Simplify v((v*3v)/vv)/vv*(-4/5)vv(3/5)v*5(v/v*(-6)v/(v*0v))/(vv(1/2)v/(v*(-2/7)v)) assuming v is positive. v(1051/70) Simplify (s(2/23)/(sss/(ss32)))/(s3)(-3) assuming s is positive. s(899/23) Simplify ((j(-3)j*(-11))/(jj*(1/7)j)30)(-12/19) assuming j is positive. j*(6576/133) Simplify ((o/(oo(1/4)))/(o(-2/5)o))/(o(2/7))15(o0)(-14/13)/(o*(3/4)o**(-1)/o) assuming o is positive. o	{ "pile_set_name": "DM Mathematics" }
e letters picked without replacement from {s: 9, g: 4, m: 3}. Give prob of sequence smg. 9/280 Three letters picked without replacement from {g: 1, y: 5, v: 4, l: 2, w: 2}. What is prob of sequence lwl? 1/546 What is prob of sequence yw when two letters picked without replacement from {y: 1, w: 2}? 1/3 What is prob of sequence se when two letters picked without replacement from {s: 2, e: 1}? 1/3 Three letters picked without replacement from {l: 5}. Give prob of sequence lll. 1 Four letters picked without replacement from {i: 9, a: 1, x: 3, g: 6}. Give prob of sequence xagi. 9/5168 Calculate prob of sequence xxh when three letters picked without replacement from {h: 4, x: 2}. 1/15 Calculate prob of sequence nz when two letters picked without replacement from ntlzmtoomtnmnmt. 1/70 Calculate prob of sequence yz when two letters picked without replacement from {z: 13, y: 5}. 65/306 Four letters picked without replacement from hyyyyyyyyyyyyyyhjhjy. Give prob of sequence yjyj. 7/1938 What is prob of sequence ye when two letters picked without replacement from {y: 5, e: 2, u: 1, s: 1}? 5/36 What is prob of sequence vv when two letters picked without replacement from vnyyyvnyvwswnynwnn? 1/51 Four letters picked without replacement from qttltqqtqttqqqtqjtt. Give prob of sequence jtql. 1/1292 What is prob of sequence hc when two letters picked without replacement from hhchhyhchh? 7/45 What is prob of sequence brg when three letters picked without replacement from rgbiq? 1/60 What is prob of sequence rr when two letters picked without replacement from {q: 2, b: 1, r: 2, v: 1}? 1/15 Calculate prob of sequence bbg when three letters picked without replacement from {b: 4, g: 2, q: 3}. 1/21 What is prob of sequence bb when two letters picked without replacement from {d: 5, b: 8}? 14/39 What is prob of sequence iew when three letters picked without replacement from eiiew? 1/15 Two letters picked without replacement from {i: 3, e: 1, d: 2, j: 2, w: 3, x: 1}. What is prob of sequence dw? 1/22 Four letters picked without replacement from otoocovqqtototccvo. What is prob of sequence ctvq? 1/1530 Four letters picked without replacement from tuqyuqayutuutt. Give prob of sequence qyqa. 1/6006 Calculate prob of sequence iuk when three letters picked without replacement from udddukuiudffdfdidf. 1/612 Two letters picked without replacement from {o: 2, z: 2, r: 1, k: 1, i: 4, h: 2}. Give prob of sequence ho. 1/33 Two letters picked without replacement from ojjie. Give prob of sequence oe. 1/20 What is prob of sequence rsrr when four letters picked without replacement from {r: 5, s: 1, l: 12}? 1/1224 Two letters picked without replacement from {f: 16, k: 2}. Give prob of sequence ff. 40/51 Three letters picked without replacement from {e: 2, r: 1, t: 2}. What is prob of sequence ert? 1/15 Two letters picked without replacement from {e: 2, s: 1, m: 1, l: 3, w: 3, o: 3}. What is prob of sequence se? 1/78 What is prob of sequence hx when two letters picked without replacement from hhhxxhxhxh? 4/15 Four letters picked without replacement from ohxonnohhxnxo. What is prob of sequence hxoo? 9/1430 What is prob of sequence omoz when four letters picked without replacement from ooymmoaazoozyymmy? 1/357 Two letters picked without replacement from {p: 2, a: 1, t: 1, r: 2, o: 1}. What is prob of sequence at? 1/42 Four letters picked without replacement from yyiiyyyiyniyiiy. Give prob of sequence yiiy. 2/39 Two letters picked without replacement from iioaq. What is prob of sequence qo? 1/20 Calculate prob of sequence rb when two letters picked without replacement from rrrb. 1/4 Calculate prob of sequence ftty when four letters picked without replacement from qtoqqqtfqfffqofyfoy. 1/3876 Two letters picked without replacement from {u: 5, o: 5}. Give prob of sequence uu. 2/9 Four letters picked without replacement from jnnnnjnnjjjjnj. What is prob of sequence nnjn? 35/572 Three letters picked without replacement from fffffffff. Give prob of sequence fff. 1 Two letters picked without replacement from qqqlqqqlqqlqqqlqqq. Give prob of sequence qq. 91/153 Two letters picked without replacement from pbpb. What is prob of sequence bp? 1/3 Four letters picked without replacement from qaqaqq. What is prob of sequence qaqa? 1/15 Three letters picked without replacement from {s: 7, z: 2, b: 6}. What is prob of sequence sbs? 6/65 What is prob of sequence xz when two letters picked without replacement from {p: 2, x: 1, z: 1, g: 2, k: 1}? 1/42 What is prob of sequence djjj when four letters picked without replacement from {d: 3, j: 3}? 1/20 Four letters picked without replacement from vzzzzzzzzzvzzzvzvz. What is prob of sequence zzzv? 91/765 What is prob of sequence bb when two letters picked without replacement from {m: 9, z: 5, b: 2}? 1/120 Three letters picked without replacement from nbmnubnffnnbbnnu. Give prob of sequence buf. 1/210 Three letters picked without replacement from {j: 2, a: 1, z: 2, x: 1}. Give prob of sequence zxa. 1/60 What is prob of sequence bpkb when four letters picked without replacement from bkxkpxbbp? 1/126 Four letters picked without replacement from kkkbbbqkkkkkkkkk. What is prob of sequence kkqb? 33/3640 What is prob of sequence ua when two letters picked without replacement from {k: 4, u: 8, g: 3, a: 4}? 16/171 Four letters picked without replacement from {s: 1, d: 2, h: 1, j: 3}. Give prob of sequence jhjs. 1/140 Four letters picked without replacement from cycyyracrayyccaryra. Give prob of sequence cyar. 5/969 Calculate prob of sequence dd when two letters picked without replacement from {d: 2, e: 1, k: 5, z: 1, o: 1}. 1/45 Calculate prob of sequence cj when two letters picked without replacement from wfgjcpcp. 1/28 Calculate prob of sequence ni when two letters picked without replacement from {n: 3, g: 8, d: 2, p: 2, r: 2, i: 2}. 1/57 Calculate prob of sequence jyj when three letters picked without replacement from yzzjzyzdhjddgzzyzz. 1/816 Three letters picked without replacement from {g: 6, h: 2}. What is prob of sequence ggh? 5/28 Calculate prob of sequence my when two letters picked without replacement from {v: 3, m: 4, y: 1}. 1/14 Calculate prob of sequence nnxx when four letters picked without replacement from xxxnxnxn. 1/14 Calculate prob of sequence pp when two letters picked without replacement from {w: 1, p: 2, f: 1}. 1/6 Two letters picked without replacement from {o: 1, p: 1, y: 2, s: 1, m: 1, q: 1}. What is prob of sequence sq? 1/42 Two letters picked without replacement from hdzhiizhdihdihchi. Give prob of sequence hd. 9/136 What is prob of sequence kkk when three letters picked without replacement from {x: 2, k: 7, u: 4, p: 1}? 5/52 Two letters picked without replacement from gasauej. Give prob of sequence ge. 1/42 Two letters picked without replacement from {w: 5, g: 4, z: 5, n: 5, a: 1}. Give prob of sequence za. 1/76 Three letters picked without replacement from gxqqgqbxwqqggb. Give prob of sequence gbx. 2/273 Calculate prob of sequence vb when two letters picked without replacement from qqxbbdvbqqv. 3/55 Four letters picked without replacement from nnnnnffjffnj. Give prob of sequence nfjj. 2/495 Two letters picked without replacement from pppppjjp. Give prob of sequence pj. 3/14 Four letters picked without replacement from wbppwwmwwwvwpwwwwb. What is prob of sequence pbvb? 1/12240 Calculate prob of sequence ixw when three letters picked without replacement from {x: 2, v: 1, s: 1, w: 1, z: 1, i: 1}. 1/105 Four letters picked without replacement from {f: 10, u: 10}. What is prob of sequence ffff? 14/323 What is prob of sequence zn when two letters picked without replacement from {h: 1, l: 1, z: 1, t: 4, n: 1}? 1/56 Two letters picked without replacement from niinnrninrnrrrnnnirn. What is prob of sequence ri? 6/95 Four letters picked without replacement from annaaa. What is prob of sequence anaa? 2/15 Three letters picked without replacement from qtugl. What is prob of sequence glu? 1/60 What is prob of sequence rk when two letters picked without replacement from dgkkkdddkgdddgdgrdrd? 2/95 What is prob of sequence ghol when four letters picked without replacement from onnoogohololglonn? 1/1360 Three letters picked without replacement from xxxgi	{ "pile_set_name": "DM Mathematics" }
he tens digit of 1 + 12 - 2/g? 1 What is the units digit of (-2)/(-8)-17(15 + -67)? 1 Let j = 13 + -25. Let f = j + 23. What is the tens digit of f? 1 Let f be 6/15 + (-44)/10. Let k = f + 6. What is the units digit of k? 2 Let a(t) = t*3 + 4t*2 - 2t + 2. Let l(v) = -2v2 - 2v + 1. Let w be l(1). Let j = -1 + w. What is the units digit of a(j)? 0 Suppose 0 = -5v + 3v - 5y + 56, 0 = -4v + 2y + 136. What is the tens digit of v? 3 Let y = -5 + 8. Suppose yj = 6 + 6. What is the units digit of j? 4 Let g = 104 + -67. What is the units digit of g? 7 Let d = 5 - 3. What is the units digit of d? 2 Let p(d) = -3d + 47. What is the units digit of p(0)? 7 Let p(h) = 2h*2 - 24h + 4. What is the units digit of p(12)? 4 Let l = -4 - -5. Let f be 2 + 2 + 0 + l. Suppose -2d + d = 5g + 1, d - 9 = fg. What is the units digit of d? 4 Suppose 0 = 6s - 2s. Let u = s + 2. Suppose uk + 27 = 5k - 2n, k = -5n + 9. What is the units digit of k? 9 Suppose 5g + 8y - 3y = 65, 83 = 5g - y. Suppose m - 2v - g = 0, 68 = 3m + 7v - 3v. What is the units digit of m? 0 What is the tens digit of 1 - (-3)/(6/218)? 1 Suppose -r + 3 = -2. Let h = r - 3. Suppose -5x + hx + 4 = 4l, -x + 5l = -33. What is the units digit of x? 8 Let s(o) = 22o*2 + 4o - 3. Let f be s(2). Suppose -4n + 71 = -f. What is the units digit of n? 1 Let q = 10 + -8. Let t = 4 + -2. Suppose -tn - 8 = -4b, -qb = 3n - b - 16. What is the units digit of n? 4 Suppose 5r = 63 + 242. What is the tens digit of r? 6 Suppose c = 5n + 4c - 20, 16 = 4n + 4c. Suppose -4h + 58 = -g - ng, 64 = 5h - 2g. What is the tens digit of h? 1 Let k = 32 - -3. What is the tens digit of k? 3 Let i(r) = -9r3 - r - 2. What is the units digit of i(-1)? 8 What is the units digit of 3348/45 - 6/15? 4 Suppose -2k + 4y + 164 + 292 = 0, 0 = -3y - 15. What is the tens digit of k? 1 Let q be 52/10 - (-3)/(-15). Let o = q + -11. What is the units digit of -10(o/15 - 0)? 4 Let n(l) = 3l*2 + 2l*2 - 5l2 - l3 + 4l2. What is the units digit of n(3)? 9 Let m = -6 + -7. Suppose -5n - 48 = 72. Let r = m - n. What is the units digit of r? 1 Suppose 2g - 3o = g + 17, -g + 9 = -5o. Suppose 3l - 5j + 10 = 28, 5j = 4l - g. What is the units digit of l? 1 Let s(f) = f2 + 2f + 67. What is the units digit of s(0)? 7 Let i = 20 + -2. Suppose 2q + i = 3q. Suppose 5v - 17 = q. What is the units digit of v? 7 Suppose 83 = r + 7. Suppose -2j + 4 = 0, 8 = -4t - 4j + r. What is the units digit of t? 5 Let f = 32 + -49. Let t = 0 - f. Suppose 3v - t - 8 = -2u, 5 = v + 4u. What is the units digit of v? 9 Suppose -10 = 5w, 2c + 7w - 18 = 2w. Let t = -4 + c. What is the units digit of t? 0 Let v(r) = r2 + 4r + 13. What is the units digit of v(-8)? 5 Suppose -4z - 4t + 4 + 0 = 0, z = 4t + 6. Suppose v - 5y + z = 1, 3v - 36 = 2y. What is the tens digit of v? 1 Let a(i) = i - 1. Let r(j) = -9j + 20. Let l(s) = -4a(s) - r(s). What is the tens digit of l(11)? 3 Suppose a - s + 1 - 16 = 0, s + 3 = 0. Let d = 20 - a. Suppose -2v + d = 2. What is the units digit of v? 3 Let x = 0 + 14. Suppose 5j + 2g + 2g - 23 = 0, 2j - x = -4g. Suppose -ju + 4t + 64 = u, 0 = -5t - 25. What is the tens digit of u? 1 What is the units digit of (44/(-16) - -3)461? 1 Let r(u) = -u3 - u2 + u - 5. Let n be r(0). Let d = -1 - n. Suppose -ds = -28 - 8. What is the units digit of s? 9 Let b be 5/((-5)/2)-1. Suppose l + 3 - 6 = 0. Suppose j - 75 = -bk - lk, 5k - 2j = 60. What is the units digit of k? 4 Let x = 0 + -1. Let s(a) = 22a*3 + 14. Let t(l) = 7l*3 + 5. Let m(g) = -6s(g) + 17t(g). What is the units digit of m(x)? 4 Let u be (1 + -27)1/2. Let z = -1 - u. What is the tens digit of z? 1 Let n(v) = -v3 + v2 + 2. Let k be n(0). Suppose 3q - q = k. What is the units digit of q? 1 Suppose 11 = 4x - 7x - m, 2m - 13 = x. Let d(h) = -h*3 - 4h*2 + 4h - 4. What is the units digit of d(x)? 1 Suppose 0 = -4n - 0n - 5f + 32, 0 = -4n + 4f + 32. Let a = -10 + 14. Suppose -3o - 2 = -b, -4o + 32 = ab - n. What is the units digit of b? 8 Let q(h) = -13h - 1. Let w(n) = 52n + 5. Let c(a) = -9q(a) - 2w(a). What is the units digit of c(1)? 2 Let c = 52 - 37. What is the units digit of c? 5 Suppose -n + 100 = -o, -3n + 189 = 2o - 91. What is the units digit of n? 6 Suppose -3 = -i, 0i + 2i = 4m + 26. Let l(x) = x + 8. What is the units digit of l(m)? 3 Let p be (-3)/18 - (-22)/(-12). Let q = 1 + p. What is the units digit of (-18)/(-4) - q/2? 5 Suppose 3y - 23 = 37. What is the units digit of y? 0 Let m = 2 + -1. What is the tens digit of 13 + (m + -2 - -4)? 1 Let w = -82 - -42. Let p be (-452)/10 - 8/w. Let c = -32 - p. What is the units digit of c? 3 Let i = -7 - -13. Let l = 10 - i. What is the units digit of l? 4 Let p(r) = -4r3 - 2r*2 - 2r + 1. What is the tens digit of p(-2)? 2 Let l(p) = p - 3p - 3p + 4p. What is the units digit of l(-2)? 2 Suppose 3r - u = 4u + 407, 2r + 2u = 266. What is the hundreds digit of r? 1 Let v be 0(-1)/(0 + 1). What is the units digit of v + 9 - 0/2? 9 Suppose 2s + y = -s, s + 4y + 11 = 0. What is the units digit of s? 1 Let v(s) = s*2 - 3s - 6. Let m be v(6). Let i be -2((-2)/4 + 2). Let r = m + i. What is the units digit of r? 9 Let x = 2 - 3. What is the tens digit of (-1 + (x - -13))/1? 1 Let n = 25 - -18. What is the tens digit of n? 4 Let j = 118 - 30. What is the tens digit of j? 8 Suppose -5 = d - 42. What is the tens digit of d? 3 Suppose -2g = -2p - 40 + 4, 53 = 3g - 4p. Let h = g + -9. What is the tens digit of h? 1 Let z(l) = 6l + 3. Suppose 2k + 12 = 4r - 0k, 0 = -2k - 4. What is the tens digit of z(r)? 1 Let a(i) = 7i2 + 4i + 3. Let m be a(-3). What is the tens digit of (-3)/(-15) - m/(-5)? 1 Let l(v) = 5v2 - 6v + 5. Let n(h) = -6h2 + 7h - 6. Let i(y) = 4l(y) + 3n(y). What is the units digit of i(2)? 4 Suppose y - 716 = -3y + 4a, -5a - 533 = -3y. What is the units digit of y? 1 Suppose 22 = -0t + t. What is the tens digit of t? 2 Let s(f) = 13f + 1. Let z be s(2). Suppose z = -w + 4w. Suppose -5d + w = -6. What is the units digit of d? 3 Suppose 4j - 53 = 3p, p = 3j - 2p - 42. What is the units digit of (j + 1)/((-6)/(-4))? 8 Suppose 2p = -261 + 651. Suppose 30 + 163 = 5v - 3j, -5v = -5j - p. What is the tens digit of v? 3 Suppose -4n = 4y - 3y - 405, 0 = -4n - 4y + 408. What is the hundreds digit of n? 1 Suppose -3i = 7r - 3r - 16, -2r - 3i = -8. Let d be r/14 - 36/28. What is the tens digit of (1 + 0/d)12? 1 Let j(u) = -3u - 5. Suppose -6 = -v - 2. Let p = v - 8. What is the units digit of j(p)? 7 Suppose 4v = w - 22, 5v + 5w + 10 = v. Let a(f) = f*3 + 5f*2 - 4f - 5. What is the units digit of a(v)? 5 Suppose 0a - a - 2t + 72 = 0, 5t = 4a - 353. What is the units digit of a? 2 Let q be (6/9)/((-1)/(-3)). What is the tens digit of (0 + 4)(q + 8)? 4 Let w = -28 - -129. What is the tens digit of w? 0 Suppose 4g - 3z = -17, -2g = -3g + z - 5. Let d(p) = 2p*2 + p - 2. What is the units digit of d(g)? 4 Suppose -5u - 14 = 1. Let r(f) = f*2 - f + 3. What is the tens digit of r(u)? 1 Let a = 3 + 1. Let g(u) = -1 + au - 2 - 3u. What is the units digit of g(5)? 2 Suppose 2f = 2c - 12, -3c + 0 = -2f - 14. Suppose -ca + 27 = a. What is the units digit of a? 9 Let q = -3 + 3. Suppose 0 = -2u - 5h - 11 + 36, q = u + 2h - 13. What is the tens digit of u? 1 Let w = -40 - -82. Suppose -2f + 0f = -4g - 48, -3f - 4g + w = 0. Let v = 30 - f. What is the tens digit of v? 1 Let w be 3/3-1-16. Suppose -x - w = -2x. What is the tens digit of x? 1 What is the hundreds digit of 616/5 - 4/(-5)? 1 Let i = -7 + 11. Let k(h) = -i + 3h*2 + 1 - 3h - 2h2. What is the units digit of k(5)? 7 What is the units digit of 120/(-2)(1 - (-12)/(-9))? 0 Let t be 3/681. Suppose -tx + 3h = -49, 2x + 4h - 28 = 2h. What is the units digit of (-6)/18 - x/(-3)? 4 Let c(m) = -m3 + 8m*2 - 7m + 8. What is the tens digit of c(6)? 3 Suppose 2n = -3t + 41, 6t - t = 3n + 81. What is the tens digit of t? 1 Let l(i) = 110i2 + 2i + 3. What is the tens digit of l(-1)? 1 Suppose -9 = -v - 2v. Suppose 0 = vt + 4 - 19. Suppose	{ "pile_set_name": "DM Mathematics" }
mon divisor of 15 and p? 3 Let c be 1989/26 - 2/(-4). What is the greatest common divisor of c and 11? 11 Let o(f) = -21f + 5. Let r be o(-1). Calculate the highest common divisor of r and 130. 26 Suppose k + 120 = 4g - 0g, 0 = g + 2k - 21. What is the highest common divisor of 232 and g? 29 Suppose -2o + 2 = -3o. Let u be (o - -3)33. What is the greatest common divisor of u and 18? 9 Suppose 2i - 2 = -6. Let s be 6i/9-30. Let r(w) = -17w - 1. Let a be r(-1). What is the highest common factor of s and a? 8 Let j be (-3 - -24) + 2 - 2. Suppose 0 = 3b - j - 24. Calculate the greatest common divisor of b and 165. 15 Let t(p) = 352p*2 + 4p + 3. Let s be t(-1). What is the greatest common divisor of 27 and s? 27 Suppose -130 = -j + 46. What is the greatest common factor of 22 and j? 22 Suppose -5s + 68 - 8 = 0. Let k = -6 + 6. Suppose ky - 24 = -2y. What is the greatest common divisor of y and s? 12 Let p(i) = -i2 + 155. Let z be p(0). Let o = -78 + z. What is the highest common factor of 7 and o? 7 Let o be (-1)/(-1)1 + 7. Suppose -o = -2f + 26. Let a = -12 + f. Calculate the greatest common factor of 40 and a. 5 Let m(s) = -5s + 9. Let v be m(-5). Calculate the highest common divisor of 85 and v. 17 Let n = -60 - -90. What is the highest common divisor of n and 120? 30 Let d be -2 + 1 + 68/2. Let c be (-3 + 5)(-11)/(-2). Calculate the highest common divisor of c and d. 11 Let q = -182 + 280. What is the greatest common factor of 28 and q? 14 Suppose m - 5m + 55 = -3f, 4f = -4. What is the greatest common factor of 91 and m? 13 Let r = -2 + 18. Calculate the highest common divisor of 2 and r. 2 Suppose 79 - 7 = 3x. Suppose 3v + v = x. Let r = 33 + -9. Calculate the greatest common factor of r and v. 6 Let s = -24 + 35. What is the highest common divisor of s and 121? 11 Let d be -2 + -340/(-12). Calculate the highest common divisor of d and 32. 8 Let u be (-14)/21(-63)/2. Calculate the greatest common factor of 21 and u. 21 Let x be (128/(-20))/(6/(-15)). Let v(c) be the first derivative of c*3/3 + 32c + 1. Let s be v(0). What is the greatest common divisor of s and x? 16 Suppose -4u = 4s - 138 - 242, 5u - 3s - 451 = 0. Suppose 0 = 3y + 2m - u, y + 0y - 40 = 4m. Calculate the greatest common factor of 16 and y. 16 Let i = 59 - 213. Let f = i + 274. Calculate the greatest common factor of 24 and f. 24 Let f = -35 + 50. What is the highest common divisor of 120 and f? 15 Suppose -9y + 8y + 15 = 0. What is the greatest common divisor of y and 5? 5 Let n be (75 + -3)4/8. Calculate the highest common factor of n and 54. 18 Let c = 27 + -2. Suppose 5q + 3k = c, 5q - k + 3k = 25. Suppose 95 = -0u + 5u + qi, -5i = 5. What is the greatest common divisor of 4 and u? 4 Let p = 2 + 3. Let c(j) = -j3 + 7j*2 - 5j - 3. Let g be c(p). Let v be ((-10)/6)/((-1)/33). Calculate the greatest common divisor of v and g. 11 Suppose -9i + 14i - 15 = 0. Suppose j - 3q = ij - 84, -5q = -4j + 124. What is the greatest common factor of j and 9? 9 Let u(m) = m*2 + 8m + 7. Let y be u(-11). What is the highest common divisor of y and 5? 5 Suppose 2v = -0c + 4c + 6, 6 = 3c. Let a(y) = 3y3 - 3y + 3. Let o be a(2). What is the highest common factor of v and o? 7 Suppose -4 = -t - 3t. Suppose 12 = -4o, -2i = o - 0 + 1. Calculate the greatest common factor of i and t. 1 Let s be 1-22(2 + -5). Let v = s - 26. Calculate the greatest common divisor of v and 5. 5 Suppose 4g = 0, l = -2g - 2 + 5. Suppose 4y - 12 = 0, -5o + 7y + 23 = ly. What is the highest common divisor of o and 28? 7 Let l(p) = p3 + p2 + p - 2. Let d be l(0). Let o = -2 + -2. Let f be 2/o + (-13)/d. Calculate the highest common factor of f and 6. 6 Suppose 4d = -81 + 561. Suppose -5b - 2w + 322 = 0, 2b + w - d = -2w. Suppose -4g = -27 + 3. Calculate the greatest common factor of b and g. 6 Let l be 1/(-1) - (12 - 24). Calculate the highest common divisor of l and 77. 11 Let t = 4 + -6. Let f be (1/t)/((-3)/6). Suppose -4s + f + 19 = 0. What is the greatest common factor of 5 and s? 5 Let u = -294 - -453. What is the highest common factor of 106 and u? 53 Let z(y) = y2 + 2 + y3 - 2y2 - 7y*3 + y - 1. Let h be z(-1). Calculate the greatest common divisor of 45 and h. 5 Let u be 400/65 - 2/13. Calculate the greatest common divisor of u and 3. 3 Suppose 4u = -0u + 4, 2u - 102 = -4y. What is the highest common divisor of 225 and y? 25 Let l(d) = d3 + 16d*2 - 22d - 21. Let b be l(-17). Calculate the highest common divisor of b and 48. 16 Suppose 7 - 27 = -5b. Suppose -3s = -7s + b. Let k be (-23)/(-7) - 2/7. Calculate the highest common divisor of s and k. 1 Suppose -5z = 4c - 1042 - 345, -4z + 1109 = 3c. Calculate the highest common divisor of z and 25. 25 Let x be 4 + -1 + -1 - -589. Suppose 4k + 210 = v, -3v = 2k - k - x. Calculate the greatest common divisor of v and 22. 22 Let q be (5/(-10))/(2/(-20)). Suppose 5g = 5h + 50, qg = 2h + 34 + 16. Suppose 5s = 2s + 120. Calculate the greatest common factor of s and g. 10 Suppose -2m = 2p, 0 = -3p - 9m + 4m - 6. What is the greatest common factor of 3 and p? 3 Let g = -22 + 25. What is the highest common divisor of g and 6? 3 Suppose -2u + 94 = 4p, 2u = 3u + 3p - 51. Suppose -2c = c. Suppose -y + c = -26. Calculate the highest common factor of y and u. 13 Let c(i) be the second derivative of i4/6 - i3/3 + i2/2 + i. Let a be c(1). Let z = 6 - a. Calculate the greatest common divisor of 10 and z. 5 Let u = -1 + 4. Let c be (8/14)/(22/77). Suppose -4h + c = -uh, -5z + 4h + 482 = 0. What is the greatest common divisor of z and 14? 14 Suppose 0 = -4t - t + 25. What is the greatest common factor of t and 35? 5 Let x(y) = -y + 5. Let k = 9 - 1. Let g be x(k). Let b = 7 + g. What is the highest common divisor of b and 12? 4 Suppose 5n - 3n - 20 = 0. Let k be ((-8)/5)/(-2)n. Suppose -4g - 3l = -60, 0 = -0l - 2l + k. Calculate the highest common divisor of g and 60. 12 Suppose -55 = -4v + 137. Suppose 5j - v = j. Suppose 0 = -0t + 2t - 24. What is the greatest common divisor of t and j? 12 Let d be 12 - 01/2. Let m be 1 - -1 - 8/(-2). What is the greatest common factor of d and m? 6 Suppose -4k - 4 = 0, -4a - a = 2k + 2. Let p = 6 - 4. Suppose ay - 320 = -py. What is the highest common divisor of 20 and y? 20 Suppose q + 8 = -q, 2q = 2p - 110. Calculate the greatest common divisor of p and 153. 51 Suppose -5s + 43 = 4q, -2q + 3s + 1 + 4 = 0. Calculate the greatest common factor of q and 56. 7 Let g = 5 + -14. Let j be (-6)/g + 32/6. Suppose -4d + q = -31, -7d - 5q = -3d - 61. Calculate the greatest common factor of j and d. 3 Suppose 0 = -4g + 3h + 1, g - 2 - 4 = -5h. Let t be (2 - -5) + (-1)/g. Let o be 3/((-9)/t + 2). What is the greatest common factor of 48 and o? 6 Let a = 103 - 26. What is the highest common divisor of 11 and a? 11 Let d be (-30)/(-45) + 38/6. What is the greatest common divisor of 35 and d? 7 Let u be -2 - (-41)/(1 + -2). Suppose -6x - 152 = -8x. Let b = u + x. What is the greatest common factor of b and 3? 3 Let l be 172/(-6) + 4/(-12). Let c = l - -85. Suppose -4w = -25 - 7. Calculate the greatest common divisor of w and c. 8 Suppose -4z = 5g - 671, 3z + 678 = 2g + 3g. Let f be (-29 - -30)15/1. Calculate the greatest common factor of f and g. 15 Suppose 4v + v - 103 = -4f, 5f = 2v + 104. Let b be f/2(0 + 2). Let l be 312/b + (-6)/33. Calculate the highest common factor of 21 and l. 7 Let f = -22 + 42. Calculate the greatest common factor of 140 and f. 20 Let j(l) = -2l + 5. Suppose -g - g = m - 15, 0 = -2g + 2m. Let h be j(g). Let n be 20(h/2)/(-5). What is the highest common factor of 4 and n? 2 Let t = -40 - -57. Calculate the highest common factor of t and 17. 17 Let p(s) = -3s - 21. Let x be p(-9). Suppose -3 = -5j + 12. Suppose -jz = -3 - x. What is the greatest common factor of 1 and z? 1 Let h(v) = v - 1. Let y(s) = -4s + 4. Let k(u) = 3h(u) + y(u). Let p be k(-4). What is the highest common factor of p and 15? 5 Let z be (-2)/(-1) - (-1 + 1). Suppose zh + d - 5 - 4 = 0, -5*d + 12 = -h. Let j be (h/(-2))/(1/(-16)). What is the highest common divisor	{ "pile_set_name": "DM Mathematics" }
est value in 3, -3, p? 3 Let o = -647 - -416. What is the biggest value in -1/4, 3, o? 3 Let f = -93.086 + 93. Let h = -6.914 + f. Let w = -0.4 - -0.3. What is the smallest value in h, w, 4? h Let h = -1.349 - -3.349. Let s = -18/13 - -80/39. Which is the second smallest value? (a) -1 (b) s (c) h b Let g = 3 - 32. Let w = 25 + g. Let z be (-8)/5 - 1 - -2. Which is the third biggest value? (a) z (b) w (c) 2/11 b Let f(k) = 2k + 1. Let o be f(-3). Let s be o + ((-1)/1 - -2). Let p = -7640/22929 - 1/7643. What is the third smallest value in 1, s, p? 1 Let z = 39 - -25. Let w = z + -64. What is the biggest value in -1, w, 3/5? 3/5 Let q = 10 - 6. Let f be (-2 + 6/q)/(3/12). Which is the third smallest value? (a) 4 (b) f (c) -2/7 (d) 0.4 d Let f(s) = -s3 + 7s*2 - 6s + 2. Let k be f(6). Let w = -6.945 - 1.055. Which is the third smallest value? (a) k (b) 1/11 (c) w a Let k = -77/20 + 18/5. Which is the second biggest value? (a) -0.4 (b) k (c) 1/8 b Let b = 92 + -646/7. Let d = 10/17 - 13/51. What is the second biggest value in -0.2, b, d? -0.2 Let m = 1 + -6. Let q = -16/241 - -2808/13255. Let l = 18/55 - q. What is the third smallest value in l, -4, m? l Let i be 7 + -5 - 8/5. Let s = 57.8 + -58. What is the fourth smallest value in i, -4, 0.6, s? 0.6 Let x = 2145/120547 - 1/1013. Let d = 54 + -49. What is the third smallest value in x, d, 1/4? d Suppose 0 = 5f - 4f + 64. Let p = 446/7 + f. Which is the third biggest value? (a) p (b) 1 (c) 2/7 a Let l = 1.34 - 3.44. Let i = 42.1 + -44. Let b = i + l. What is the third biggest value in 0, 6, b? b Let k = -2.8 - -1.9. Let v = k + 1. Let f be (-5)/2 - 6/(-12). What is the second smallest value in f, v, -3/5? -3/5 Let g(u) = 2u - 4. Let k be g(7). Let d be -1 - -3 - 472/k. Let p = d - -45. Which is the third smallest value? (a) 0.2 (b) p (c) 0 a Let t = 0.02 + -4.02. Let q = -4.4 - t. Let o = 1.6 - q. Which is the second smallest value? (a) 0 (b) o (c) 2/15 c Let v = -4.07 - -0.07. What is the second biggest value in -12/13, 0.3, -2, v? -12/13 Let f = 0.09 - 0.12. Let d = -0.17 + f. Let k = 66 + -465/7. Which is the third biggest value? (a) 1/2 (b) k (c) d b Let z = -0.324 + 0.524. What is the biggest value in z, -3/4, 1, 65? 65 Let t be (2/(-52))/(1/(-4)). Let o = 0.817 - 0.917. Which is the smallest value? (a) t (b) o (c) 0 b Let a(q) = -q + 9. Let l be a(5). Suppose -40 = -5m + 4i, -lm - 3i - 4 = i. Suppose 18 = -mp + 2. What is the second biggest value in p, -1/4, -3? -3 Let r = 462 + -462. What is the biggest value in 3/70, r, 1/4? 1/4 Let v = 22 - 11. Let b = 39 - v. Let o = -27.7 + b. What is the third biggest value in 1, o, -5? -5 Let h be ((48/(-8))/42)/((-3)/7). Which is the biggest value? (a) h (b) -0.1 (c) 4 c Let p = -4846.5 - -4848. Let o be (-10)/6 + 1 + 0. What is the second smallest value in p, o, 1/2? 1/2 Let v = 0.536 + -0.636. Let g = 0.2 + -0.24. What is the second smallest value in 4, g, v? g Let z = 22.575 + 0.525. Which is the smallest value? (a) z (b) 4 (c) 0.3 c Let j = -493/4 + 124. Let y = 4.1 - 7.3. Let o = 2.7 + y. What is the smallest value in j, o, 3? o Let d = -47385847 + 4264892659/90. Let y = 1849 - d. Let u = y - -2/45. What is the smallest value in u, 3, 0.3? u Let u = 420.1 - 420. What is the second smallest value in 3, 0.2, u, -0.7? u Let n = 67.8 + -67.3. Which is the fourth smallest value? (a) n (b) -1 (c) 5 (d) 0.4 c Suppose 0 = 5a + 9 - 39. Let g = -0.01 + 0.51. What is the third smallest value in 3, g, a? a Suppose -30x + 5h + 5 = -28x, 3x = 3h + 3. Which is the second biggest value? (a) 0.08 (b) x (c) -5.9 b Let r = 238 + -275. What is the second biggest value in 0.3, 3/8, r? 0.3 Let j = -4210 - -4205. Let z = 292/3 + -95. What is the third smallest value in j, 3, z, 3/5? z Let q = 5.9 + -5.29. Let p = -0.01 + q. Let g = -0.1 + p. What is the biggest value in -2/3, g, -3? g Let x be 0 + ((-2)/8)/1. Let w = -3549 - -3544. Which is the second biggest value? (a) -4 (b) w (c) x (d) 5 c Let m(v) = -v*3 - 12v*2 + 28v + 2. Let t be m(-14). Let n be (12/430)/(t(-2)/(-20)). Which is the smallest value? (a) 0 (b) -0.3 (c) n b Let l = -2/5 - -11/15. Let w be 27/(-15) - 6/(-15). What is the second biggest value in -3/4, l, w? -3/4 Let k = 9/25 + -24/25. What is the third smallest value in 5, -0.1, k, 1/3? 1/3 Let i be 1/(-15) - ((-64)/(-12) - 6). Which is the third biggest value? (a) 2 (b) i (c) -2 (d) -0.3 d Let p be 0 + -4 - 60/(-16). Which is the second biggest value? (a) 0.8 (b) p (c) 0.1 (d) 1 a Let w = 4.6 + -5. Suppose 78 = -3j + 90. Suppose -3u + u - 5s = 18, -j = s. What is the second smallest value in w, u, -4? w Let n be (-8)/12 - (-17)/3. Suppose 9 = ni - d, 5i - 33 = 4d - 12. Which is the second biggest value? (a) i (b) 2/5 (c) 1/5 b Let z = 3.26 + -3.2. Let u = 5.94 + z. Which is the second biggest value? (a) -3 (b) -2 (c) u b Let v be 3/(693/22)6. Which is the second smallest value? (a) 7 (b) -0.1 (c) v (d) 1/2 d Let v = -0.1 - -0.3. Let o = -0.088 - -2.888. Let s = v + o. Which is the third smallest value? (a) 2/9 (b) -8 (c) s c Let p = -182 + 186. Which is the smallest value? (a) 0.3 (b) -51 (c) p b Let w = -246 + 243. What is the smallest value in w, 0.3, -5? -5 Let p = 173 - 98. Let k = -78 + p. Which is the biggest value? (a) k (b) -0.4 (c) 12 c Let g = 0.071 - 0.471. Which is the smallest value? (a) 1 (b) g (c) 0.1 b Let q = -112.9 + 107.89. Let u = q + 0.01. Let v = 0.98 + 0.02. What is the third biggest value in 0, u, v? u Let x = 507 - 3043/6. Let p be (4/(-4))/((-12)/2). What is the third biggest value in p, -2/9, 0.4, x? x Let j = -3 + 6. Let d = -6.46 + 13.46. Which is the smallest value? (a) 0 (b) j (c) d a Let w(u) = -2u - 7. Let y be w(-6). What is the third biggest value in y, -1, 0.6? -1 Let t(k) = -21k + 206. Let q be t(10). Suppose o = -4o. Which is the fourth smallest value? (a) q (b) 3 (c) o (d) -2.7 b Let p = 833 - 829.1. Which is the third biggest value? (a) -3 (b) p (c) -2/5 a Let m = -0.02 - 3. Let n = m - -0.02. Let k = 4.3 - 0.3. Which is the third smallest value? (a) k (b) -0.1 (c) n a Let t(y) = -y3 - 3y*2 + 4y + 2. Let o be t(-4). Let r = 205/3 - 67. Let j = 58.3 - 57.8. Which is the third smallest value? (a) j (b) r (c) o c Let t = 14.9 - 15. Let b = -44 - -175/4. Let n = 3.882 + 0.118. What is the third biggest value in n, t, b? b Let b = -169 - -169.2. Let v be (-3)/((-11)/(-2) + -4). What is the third biggest value in b, 3/7, 3, v? b Let u = 1618.7 - 1619. What is the third biggest value in 1/7, u, 0.12? u Let w = 778/15 + -52. Suppose -2u = -u - 1. Let k = u - -3. Which is the smallest value? (a) 5 (b) w (c) k b Let d = 3.7 - 0.3. Let o = d - -0.6. What is the third smallest value in -3/4, -2, o? o Let y = -8 - -7.76. Let s = y + 0.04. Let m = 13.2 + s. What is the second smallest value in m, -3, 2/3? 2/3 Let j = 11677/91 + -909/7. Which is the second smallest value? (a) -2/7 (b) -0.4 (c) j b Let u = 107617/180 - 2485/4. Let d be 1/(-4) + 954/40. Let x = d + u. What is the second biggest value in x, -1, -4? -1 Let q = 56.3 - 56.6. Which is the smallest value? (a) -59/2 (b) q (c) -1 a Let r be -1 + (-12)/(-3) + -3. Let y be -3 + (r - -2)4. Let m = -10 + y. Which is the second biggest value? (a) m (b) 1 (c) -9 a Let h = -3.8 - 1.2. Let k = h - -5. Let m be (56/(-12))/(-7) - 2. Which is the third smallest value? (a) -3 (b) k (c) m b Let m = -0.25 - -44.25. Let u = m - 42. What is the second biggest value in -0.2, 3, u, -2? u Let r be (-15)/392/5. Let t = -1687246/9 + 187223. Let j = t + 249. What is the second smallest value in -0.3, j, r? r Let u = -1.4 + 1. Let y = u - 0.6. Let h = -2 - y. What is the smallest value in h, 0.5, 4/5? h Let x be (-1 + 2)2 + -1. Suppose -15 - x = 4w. Let k be ((-12)/(-45))/(w/6). Which is the biggest value? (a) k (b) 0.5 (c) -3/2 b Let s = -113.8 + 112. Which is the second biggest value? (a) s (b) 0.07 (c) -3/4 c Let h be (-1 + 3)/(5 - 3). Suppose -2l - 5u - 397 = -2u, 4u + 398 = -2l. Let d = -1771/9 - l. Which is the biggest value? (a) d (b) h (c) 2/5 b Suppose -6*i - 87 + 111 = 0. What is the second smallest value in	{ "pile_set_name": "DM Mathematics" }
3 Four letters picked without replacement from {x: 2, n: 1, d: 1, j: 1}. What is prob of picking 2 x, 1 n, and 1 d? 1/5 Four letters picked without replacement from zawzwmwwmhzwtwww. What is prob of picking 1 m and 3 z? 1/910 Calculate prob of picking 1 m and 2 z when three letters picked without replacement from mghgezgezzg. 1/55 What is prob of picking 1 s and 1 l when two letters picked without replacement from {d: 1, s: 1, l: 2, u: 3}? 2/21 Two letters picked without replacement from bmbmbbbbbmmmlbbl. What is prob of picking 1 m and 1 b? 3/8 Four letters picked without replacement from {e: 13, d: 5}. What is prob of picking 1 d and 3 e? 143/306 Four letters picked without replacement from {t: 4, e: 5, d: 10, l: 1}. Give prob of picking 3 d and 1 l. 8/323 Calculate prob of picking 1 q and 2 s when three letters picked without replacement from {q: 3, s: 8}. 28/55 What is prob of picking 3 a and 1 e when four letters picked without replacement from {a: 3, e: 1, h: 1, o: 4, b: 10}? 1/3876 Calculate prob of picking 1 z and 1 r when two letters picked without replacement from crzzytir. 1/7 Two letters picked without replacement from {j: 1, i: 1, t: 4, f: 1, o: 1}. What is prob of picking 2 t? 3/14 What is prob of picking 1 b and 1 p when two letters picked without replacement from {c: 2, k: 1, b: 1, p: 6, n: 5, s: 1}? 1/20 Two letters picked without replacement from {d: 5, n: 5, r: 1, z: 4}. Give prob of picking 2 n. 2/21 Calculate prob of picking 1 n, 1 h, and 1 v when three letters picked without replacement from hhhhhhhhhvhnhhhhhhh. 1/57 What is prob of picking 2 r when two letters picked without replacement from ccrrcccccc? 1/45 Two letters picked without replacement from kkkkknnnuflulknuukl. Give prob of picking 1 f and 1 l. 1/57 What is prob of picking 2 h when two letters picked without replacement from {f: 7, h: 5}? 5/33 Two letters picked without replacement from {p: 4}. Give prob of picking 2 p. 1 Two letters picked without replacement from ppfpxfffpxpppxfp. What is prob of picking 2 f? 1/12 Two letters picked without replacement from uiiliil. What is prob of picking 1 u and 1 i? 4/21 Two letters picked without replacement from {m: 2, o: 1, i: 1, v: 2, q: 1}. Give prob of picking 2 m. 1/21 Three letters picked without replacement from ppzpzppp. Give prob of picking 1 z and 2 p. 15/28 Two letters picked without replacement from {i: 2, v: 6}. What is prob of picking 2 v? 15/28 Two letters picked without replacement from krmkmtrrnmmrmnlrkrn. What is prob of picking 2 n? 1/57 Three letters picked without replacement from {t: 1, j: 2, h: 1, s: 4, y: 2, g: 2}. What is prob of picking 1 t, 1 g, and 1 h? 1/110 What is prob of picking 1 f, 1 n, and 1 g when three letters picked without replacement from {g: 2, f: 3, n: 3, r: 12}? 3/190 Two letters picked without replacement from {f: 1, l: 1, y: 1, w: 1, n: 1}. What is prob of picking 1 w and 1 y? 1/10 Four letters picked without replacement from {w: 4, p: 1, q: 1, o: 6, c: 4}. Give prob of picking 2 w, 1 o, and 1 q. 9/455 Three letters picked without replacement from {l: 3, c: 3}. Give prob of picking 2 l and 1 c. 9/20 Calculate prob of picking 2 n and 1 d when three letters picked without replacement from {d: 4, z: 2, k: 6, r: 2, n: 3, y: 1}. 1/68 What is prob of picking 1 n, 1 e, and 2 l when four letters picked without replacement from llelleenlllel? 112/715 Calculate prob of picking 3 r when three letters picked without replacement from {q: 2, c: 1, r: 4}. 4/35 Two letters picked without replacement from {f: 3, k: 2, j: 10, a: 5}. Give prob of picking 1 f and 1 j. 3/19 Two letters picked without replacement from {a: 1, z: 1, o: 2, x: 1, s: 1, v: 1}. What is prob of picking 1 x and 1 o? 2/21 What is prob of picking 2 o when two letters picked without replacement from {o: 4, z: 2, v: 1}? 2/7 Calculate prob of picking 1 x, 1 h, and 1 a when three letters picked without replacement from {x: 1, h: 4, a: 5, j: 1, n: 1}. 1/11 Two letters picked without replacement from {k: 7, l: 9}. Give prob of picking 1 k and 1 l. 21/40 Two letters picked without replacement from ypypy. What is prob of picking 2 p? 1/10 Two letters picked without replacement from {u: 3, i: 7}. Give prob of picking 2 u. 1/15 Calculate prob of picking 2 r when two letters picked without replacement from rffrrrffrfpfsrw. 1/7 Three letters picked without replacement from buppu. Give prob of picking 3 p. 0 Two letters picked without replacement from eey. Give prob of picking 2 e. 1/3 Two letters picked without replacement from {o: 3, l: 5, u: 8}. What is prob of picking 1 u and 1 o? 1/5 Four letters picked without replacement from {i: 1, r: 1, h: 3, y: 10}. What is prob of picking 1 r, 2 y, and 1 i? 3/91 Three letters picked without replacement from yooyehhyeyye. What is prob of picking 1 e and 2 h? 3/220 What is prob of picking 1 z and 2 x when three letters picked without replacement from {z: 1, x: 2, h: 8, o: 2}? 1/286 Three letters picked without replacement from bbjs. What is prob of picking 1 j and 2 b? 1/4 Four letters picked without replacement from kjjjjkjjjj. Give prob of picking 1 k and 3 j. 8/15 Calculate prob of picking 3 n when three letters picked without replacement from nnnntnnnntntnntnnnnn. 28/57 What is prob of picking 1 q and 1 w when two letters picked without replacement from qqqcqmwim? 1/9 Calculate prob of picking 1 g and 1 n when two letters picked without replacement from ngnnnngnnnnnng. 33/91 What is prob of picking 1 e and 1 s when two letters picked without replacement from {e: 4, r: 5, s: 2, o: 2, w: 1}? 8/91 What is prob of picking 2 n and 2 o when four letters picked without replacement from {n: 5, j: 8, o: 3}? 3/182 What is prob of picking 3 u and 1 c when four letters picked without replacement from uucheucu? 4/35 What is prob of picking 1 d and 2 c when three letters picked without replacement from ccddccddddcc? 9/22 Calculate prob of picking 1 m and 2 q when three letters picked without replacement from qimqiii. 1/35 Calculate prob of picking 1 n and 1 k when two letters picked without replacement from {q: 13, k: 1, n: 3}. 3/136 What is prob of picking 1 c, 1 z, and 1 k when three letters picked without replacement from {k: 1, d: 1, z: 1, c: 1, e: 1}? 1/10 Four letters picked without replacement from lxxxxxxllllxx. What is prob of picking 2 l and 2 x? 56/143 Two letters picked without replacement from sssdqqdnvkdnds. What is prob of picking 1 v and 1 n? 2/91 Three letters picked without replacement from {q: 1, s: 1, i: 1, t: 1, y: 1, z: 2}. What is prob of picking 1 i, 1 s, and 1 q? 1/35 Calculate prob of picking 1 u and 2 a when three letters picked without replacement from {u: 1, m: 1, a: 3}. 3/10 What is prob of picking 2 n and 1 a when three letters picked without replacement from {c: 7, n: 3, a: 1, e: 3, p: 2, s: 1}? 3/680 What is prob of picking 2 w when two letters picked without replacement from wttwi? 1/10 What is prob of picking 1 u and 1 j when two letters picked without replacement from uujuuuujujouujuouuol? 24/95 Four letters picked without replacement from eeeeeeepepeeeeepeep. Give prob of picking 2 p and 2 e. 105/646 Two letters picked without replacement from {f: 8, y: 10, b: 1}. What is prob of picking 1 y and 1 b? 10/171 Four letters picked without replacement from aejlnjljemjjl. What is prob of picking 2 l and 2 e? 3/715 Four letters picked without replacement from {r: 3, a: 1, b: 5, v: 4}. Give prob of picking 1 b and 3 v. 4/143 Three letters picked without replacement from nttnnnkkkn. Give prob of picking 2 n and 1 t. 1/6 Three letters picked without replacement from {j: 1, h: 2, l: 2, r: 2, v: 5, t: 2}. What is prob of picking 1 r and 2 l? 1/182 What is prob of picking 1 p and 1 q when two letters picked without replacement from {q: 2, p: 1, d: 2, k: 1}? 2/15 What is prob of picking 1 j and 1 c when two letters picked without replacement from {c: 2, j: 2, z: 2}? 4/15 What is prob of picking 2 j when two letters picked without replacement from jojojj? 2/5 Calculate prob of picking 3 y when three letters picked without replacement from {v: 1, y: 1, t: 7, s: 5}. 0 Three letters picked without replacement from {t: 1, q: 1, e: 1, m: 2, f: 8, n: 2}. Give prob of picking 1 n, 1 f	{ "pile_set_name": "DM Mathematics" }
, 23473 List the prime factors of 48475776. 2, 3, 41, 3079 What are the prime factors of 1072283127? 3, 41, 8717749 List the prime factors of 1466777. 13, 17, 6637 List the prime factors of 312131829. 3, 19, 5475997 List the prime factors of 38086591. 47, 810353 What are the prime factors of 48720439? 683, 71333 List the prime factors of 306994942. 2, 17, 311, 29033 What are the prime factors of 905958307? 571, 1586617 List the prime factors of 1386630013. 19, 107, 191, 3571 List the prime factors of 1233079434. 2, 3, 3917, 17489 List the prime factors of 3993338243. 19, 2711, 77527 What are the prime factors of 634287254? 2, 317143627 List the prime factors of 1551529339. 41, 2777, 13627 List the prime factors of 103709673. 3, 17, 13291 List the prime factors of 46811092. 2, 11702773 List the prime factors of 42859955. 5, 83, 139, 743 List the prime factors of 501144810. 2, 3, 5, 389, 42943 List the prime factors of 808258441. 337, 1009, 2377 What are the prime factors of 1539921390? 2, 3, 5, 7, 7332959 What are the prime factors of 40762947? 3, 13587649 List the prime factors of 436652017. 137, 3187241 List the prime factors of 132082088. 2, 16510261 What are the prime factors of 30068039? 30068039 List the prime factors of 654419678. 2, 11, 1979, 15031 What are the prime factors of 11227283? 11227283 What are the prime factors of 31379562? 2, 3, 64567 List the prime factors of 2965590267. 3, 71, 691, 20149 List the prime factors of 169009577. 11, 67, 229321 What are the prime factors of 26109434? 2, 13, 1004209 List the prime factors of 177199067. 177199067 List the prime factors of 101263744. 2, 157, 5039 What are the prime factors of 104882945? 5, 17, 19, 101, 643 What are the prime factors of 1502443168? 2, 23, 2041363 List the prime factors of 348894223. 348894223 What are the prime factors of 1184434007? 1184434007 What are the prime factors of 76198200? 2, 3, 5, 13, 9769 What are the prime factors of 634552108? 2, 158638027 What are the prime factors of 1687912237? 11, 153446567 List the prime factors of 538808589. 3, 11, 5442511 List the prime factors of 1299491235. 3, 5, 7, 61, 22543 List the prime factors of 59762795. 5, 11952559 What are the prime factors of 7475358950? 2, 5, 4903, 30493 What are the prime factors of 875841255? 3, 5, 720857 List the prime factors of 2490205006. 2, 37, 1601, 21019 What are the prime factors of 1633022331? 3, 544340777 List the prime factors of 18353907. 3, 11, 13, 1097 What are the prime factors of 4415958796? 2, 19, 58104721 What are the prime factors of 138491671? 23, 261799 List the prime factors of 139384780. 2, 5, 2621, 2659 What are the prime factors of 2107311873? 3, 702437291 What are the prime factors of 952068901? 7, 17, 8000579 What are the prime factors of 567395763? 3, 11, 23, 747557 What are the prime factors of 3101528648? 2, 387691081 List the prime factors of 29296917. 3, 13, 19, 23, 191 List the prime factors of 1298089263. 3, 4219, 102559 What are the prime factors of 1489051350? 2, 3, 5, 337, 1091 List the prime factors of 551352778. 2, 275676389 What are the prime factors of 1616121? 3, 13, 19, 727 List the prime factors of 134517822. 2, 3, 22419637 List the prime factors of 74356919. 7, 13, 89, 9181 What are the prime factors of 3845904933? 3, 13, 98612947 What are the prime factors of 301769906? 2, 83, 1817891 List the prime factors of 37570191. 3, 2753, 4549 List the prime factors of 1707176442. 2, 3, 284529407 List the prime factors of 59018630. 2, 5, 11, 536533 List the prime factors of 1530749436. 2, 3, 127562453 What are the prime factors of 120840062? 2, 7, 43, 200731 List the prime factors of 4314475610. 2, 5, 97, 4447913 List the prime factors of 358162735. 5, 7, 10233221 What are the prime factors of 991271711? 523, 1895357 List the prime factors of 322127909. 322127909 List the prime factors of 87930081. 3, 19, 23, 79, 283 List the prime factors of 4997128. 2, 67, 9323 List the prime factors of 2067080977. 13, 2281, 69709 List the prime factors of 283776187. 821, 345647 What are the prime factors of 280598244? 2, 3, 23383187 What are the prime factors of 38273919? 3, 17, 467, 1607 What are the prime factors of 127475348? 2, 7, 11, 13, 31, 79 What are the prime factors of 185981953? 185981953 List the prime factors of 2028541732. 2, 7, 313, 231463 List the prime factors of 56439187. 7, 307, 26263 What are the prime factors of 873223588? 2, 11213, 19469 What are the prime factors of 391667707? 29, 13505783 List the prime factors of 587302310. 2, 5, 7, 197, 42589 List the prime factors of 7655121. 3, 227, 1249 What are the prime factors of 199477797? 3, 66492599 What are the prime factors of 214053585? 3, 5, 2339, 6101 What are the prime factors of 2202676158? 2, 3, 73, 401, 12541 List the prime factors of 48647496. 2, 3, 71, 28549 List the prime factors of 312677762. 2, 156338881 List the prime factors of 168846922. 2, 2927, 28843 What are the prime factors of 2160149047? 7, 17, 18152513 List the prime factors of 353525009. 353525009 List the prime factors of 1244102174. 2, 7, 88864441 List the prime factors of 19676976. 2, 3, 11, 83, 449 What are the prime factors of 302935205? 5, 59, 1026899 List the prime factors of 1725061733. 3167, 544699 List the prime factors of 527932698. 2, 3, 87988783 List the prime factors of 4799879845. 5, 19, 599, 84349 What are the prime factors of 684005797? 3989, 171473 What are the prime factors of 464164029? 3, 7, 1847, 3989 List the prime factors of 2265600569. 449, 5045881 List the prime factors of 8125638761. 383, 21215767 What are the prime factors of 474047395? 5, 8111, 11689 What are the prime factors of 40793521? 163, 250267 List the prime factors of 463385478. 2, 3, 151, 511463 What are the prime factors of 2606472389? 449, 5805061 List the prime factors of 909239. 909239 What are the prime factors of 64489545? 3, 5, 1433101 What are the prime factors of 1437023180? 2, 5, 71851159 List the prime factors of 33374120. 2, 5, 13, 4937 What are the prime factors of 98472409? 7, 1249, 1609 What are the prime factors of 500304952? 2, 7, 8934017 List the prime factors of 286242820. 2, 5, 23, 349, 1783 List the prime factors of 61322704. 2, 29, 283, 467 List the prime factors of 422060161. 89, 233, 20353 List the prime factors of 4811049986. 2, 37, 619, 105031 List the prime factors of 111506990. 2, 5, 7, 23, 69259 What are the prime factors of 486647370? 2, 3, 5, 11, 379, 1297 What are the prime factors of 343431302? 2, 2269, 75679 What are the prime factors of 281350138? 2, 19, 71, 104281 List the prime factors of 93965885. 5, 13, 17, 85037 List the prime factors of 40028546. 2, 41, 488153 List the prime factors of 1984225848. 2, 3, 11, 73, 149, 691 What are the prime factors of 790383436? 2, 83, 2380673 List the prime factors of 302909590. 2, 5, 19, 1594261 What are the prime factors of 64257789? 3, 37, 47, 109, 113 What are the prime factors of 201886234? 2, 11, 9176647 What are the prime factors of 84861729? 3, 3143027 What are the prime factors of 929027553? 3, 19, 16298729 What are the prime factors of 351843535? 5, 23, 3059509 What are the prime factors of 172209204? 2, 3, 4783589 What are the prime factors of 5903116498? 2, 19, 59, 101, 131, 199 List the prime factors of 62622527. 11, 5692957 List the prime factors of 327391874. 2, 12197, 13421 What are the prime factors of 42435888? 2, 3, 11, 179, 449 List the prime factors of 20235331. 23, 879797 List the prime factors of 1583292919. 13, 10303, 11821 What are the prime factors of 97714615? 5, 19542923 List the prime factors of 80263111. 127, 631993 What are the prime factors of 370311221? 7, 17, 41, 71, 1069 List the prime factors of 28826715. 3, 5, 1921781 What are the prime factors of 930888610? 2, 5, 93088861 What are the prime factors of 119933051? 7, 3347, 5119 List the prime factors of 147644900. 2, 5, 13, 137, 829 What are the prime factors of 536317306? 2, 7, 2411, 15889 What are the prime factors of 76748712? 2, 3, 3197863 List the prime factors of 1582666. 2, 17, 46549 What are the prime factors of 11560329? 3, 11, 23, 5077 What are the prime factors of 4631039041? 4631039041 What are the prime factors of 32154427? 32154427 What are the prime factors of 29298	{ "pile_set_name": "DM Mathematics" }
a. 5 Let n be (12 - 7) + 8 + -10. Solve 6 = 2t + 4h - 2h, nh = 2t - 6 for t. 3 Let a = 480 + -480. Suppose 0 = -3s - 23 - 13. Let u be (8/s)/(4/(-30)). Solve -10 = 4t + t - uf, a = 5t + 2f - 4 for t. 0 Suppose -10o + 7o = 258. Let v = o - -89. Suppose -5t + 8 + 6 = f, vt = -2f + 7. Solve x + 0x + 5j + 9 = 0, tj - 13 = 4x for x. -4 Let j(b) = 153 - 28 - 3b - b. Let v be j(30). Solve -4z = z + v, z = -4c - 17 for c. -4 Let r(i) = 14i + 13i - i*2 + 0i*2 - 29i + 18i - 23. Let x be r(2). Solve -xa + 2 = -3, 2o + 4a - 2 = 0 for o. -1 Let q be 1(5 + -6)-11. Let u be ((-49)/21)/((-2)/(-6)). Let j = -2 - u. Solve -g = -x - j, -4x - 1 - q = 0 for g. 2 Let g(i) = 2i*2 + 12i - 49. Let a be g(3). Solve -5x - 6 = -2r, -ar - x + 15 = -2x for r. 3 Let l = -31403 + 31405. Solve -19 = -2d + 2v - 5v, 0 = -5d + lv for d. 2 Let x(h) = 5h + 10. Let w be x(-1). Suppose r - 16 = -4f + wr, 2r = 5f - 17. Let b be (4 - 2)/69. Solve -bl = -4p - 7, -p - 7 - f = 2l for p. -4 Let t(x) = -x + 7. Suppose -6v + 77 + 31 = 0. Let i be t(v). Let l(b) = -2b*2 - 23b - 7. Let a be l(i). Solve 5c = aw - 5, 0c = -w - 4c + 17 for w. 5 Suppose -2t = -3x - 19, 410t = 405t - x + 22. Solve -3r - 3c - c + 11 = 0, 4r + 6 = tc for r. 1 Let r(z) = 11 + z3 - z2 + 3 - 15z - 4z*2 - 3. Let d be r(7). Solve -2u = db + u + 25, 9 = -3u for b. -4 Suppose -199 = -27f + 11f - 39. Solve 5d + 4 = -2i + f, i = 3d - 8 for d. 2 Suppose -14m + 16 = 5z, 7z - 12z + 29 = m. Solve 2l - k - 5 = 0, k - z = 3l + 4k for l. 1 Let j be ((-14)/(-77) - 2091/66)-18. Suppose 4a - j = -555. Solve u + 3z + 17 = 0, au - 3z = -2z - 1 for u. -2 Let d be -15((-288)/(-27) - 11). Solve 0 = 4b + 2o - 9 - d, 5o = -b + 17 for b. 2 Let r be (-12 + 26 - 14)/4. Solve 3s - z + 1 = 4s, r = 4s - 5z - 31 for s. 4 Let x(m) = 27m - 256. Let r be x(10). Let w be 18/515/3. Solve 2q - 4d = w, -2q - 4d = -0d + r for q. 1 Suppose 0 = -x + 18 - 20. Let z be 7 - 102 - (x - -2)1. Let r be (-1)/((4 + 1)/z). Solve 3y + 0f = -2f - r, 4y + 14 = 3f for y. -5 Suppose -10l = -7l. Let c(b) = 6b + 21. Let m be (14/35 - (-51)/(-15)) + 0. Let s be c(m). Solve 5o - 4 = w + 19, -so + 3w + 9 = l for o. 5 Suppose 8r - 2b = 7r + 1761, 4r = -4b + 7056. Let o = r - 1762. Let w be 1(11 - -2) - 1. Solve -o + 10 = -5v + 3d, -4d + w = 3v for v. 0 Let t be 1 + 20/12 + (1 - 1/(-3)). Solve 5l + o + 11 = l, -to = 3l - 8 for l. -4 Let i(c) = c*3 + 5c*2 + 4c + 16. Let v be i(-6). Let g be 1/4 - v/161. Solve 3l - 2 = -2o, 2l - 6 = -gl - 2o for l. 2 Suppose 4u + 10 = -3h + 5u, 2h = 5u + 2. Let a(m) = 2m*2 - 2m - 38. Let j be a(h). Solve -g + 1 = -2l - 1, -2l = -5g + j for g. 0 Let o(n) = 19 + 5n - 34 + 0n. Let v be o(4). Solve -w = 0, vu + 5w + 10 = w for u. -2 Let l(j) = -57j - 176. Let i be l(-4). Suppose -6s = 7s - i. Solve sq = -0f + 2f - 14, -f - 3q = 8 for f. 1 Let j(b) = -7b - 12. Let x(f) = 5f + 11. Let n(p) = 6j(p) + 7x(p). Let v be n(0). Solve -2m + vd - 1 = -10, 11 = 3m - 5d for m. 2 Let w(i) = -53i2 + 5i + 16. Let k be w(4). Let z = 812 + k. Solve 2y = 2r + 3r + 30, z = -r - 3y + 11 for r. -4 Let o(i) = 486i + 29161. Let l be o(-60). Let v(d) = d3 + 4d*2 - 7d - 6. Let h be v(-5). Solve -k - k + l = -3r, -hr + 5k = -1 for r. -1 Suppose -t - 8 = -5t. Let z(c) = -c*3 - 32c*2 - 240c + 9. Let g be z(-12). Solve -w = 4v - g, w + tv = -3w - 6 for w. -3 Suppose -6713 = 17n + 36. Let u = n + 397. Solve 2o + 4 = -0o + 2l, u = -4o - 2l - 26 for o. -5 Let q = 191 - 762. Let m = -559 - q. Solve 0 = 3o + 5h - 20, 6o = o + 3h - m for o. 0 Suppose i + 2r - 15 = 0, -113i + 5r = -112i - 1. Solve -m - i = 3f, 2m + 1 = -4f + 5f for m. -2 Let b(z) = 11z + 6. Let x be b(-9). Let a be -1(-3)/(-1) - 7533/81. Let h = x - a. Solve hp - 3g + 8g + 35 = 0, -3p - 7 = -2g for p. -5 Suppose -1818d + 15 = -1815d, -5g + 5d = 5. Solve gm + 2q + 4 = 0, -m - 9q = -7q - 5 for m. -3 Let h = -4163 - -4167. Solve -20 = 5g - 9p + 10p, p - 16 = hg for g. -4 Suppose 5 = 4s - 3s. Let z be ((-39)/4 + 9)(1 - s). Solve -2 = 4x - p - p, -x = zp + 11 for x. -2 Let q(x) = 7x - 23. Let s be q(8). Suppose 9 = -6m + s. Solve -mf + 0a - 3a - 26 = 0, 0 = -f - a - 7 for f. -5 Let r be (-4)/(-7)(-5 + (-279)/(-18)). Let f be (-10)/(-16)(r + 2). Solve 4s = -2k + 3 + 3, -4k - 1 = -fs for s. 1 Let n(o) = -99o2 + 23o*2 + 19 + 27o*2 + 27o*2 + 18o + 24o2. Let m be n(-1). Solve 2p + 2k = -0p + 10, 3k = m for p. 4 Let a = -139 + 165. Suppose 36 = c + a. Solve -p - s = 2 - 0, -5s = 4p + c for p. 0 Let v = -865 + 816. Let b be (-1)/7 - 203/v. Solve 0l = 5f + 4l - 18, -l + b = f for f. 2 Suppose -3w + 3d + d + 31 = 0, -w = -5d - 25. Let v be 4(-4 + (156)/4). Let j be v/(-12)(-3)/2. Solve 5y = 2q + 19 + 6, -jq + wy - 25 = 0 for q. 0 Suppose 139c = 136c - 5x + 32, -c + 4x = 12. Solve -4m - 8 = -0m - cb, -5m - 4 = -2b for m. 0 Let h = 1255 - 1796. Let n = h + 346. Let x be (-1)/2 - n/6. Solve -z - 3z - x = 4o, -z + 5o + 22 = 0 for z. -3 Let g(t) = -t*3 - 16t*2 + 36t - 20. Let d be g(-18). Let i be d/(-5) - 2 - -2. Solve 0 = -2v + iv - 4r + 6, 4v - 5r = -9 for v. -1 Let s(c) = 2c*2 - 33c - 10. Let k be s(18). Suppose 5g - 155 = -35. Let p = k - g. Solve 4i - p + 6 = -2b, 2b - 5i = -31 for b. -3 Let c be ((-6)/2)/((-54)/72). Suppose 3g + 11 = 20. Suppose 2s - 5 = -gs + l, -3s + l + 5 = 0. Solve -2y - cb - 8 = 0, sb - 4b - 8 = 0 for y. 0 Let p(h) = 2h*2 + 9h - 7. Let q be p(1). Solve r - 13 = qy - 26, 2y = 4r + 24 for y. 2 Suppose 474 = 318j - 162. Solve -jy + 7y - 19 = 3h, 0 = -2h - 6 for y. 2 Suppose -3 = -q - 1. Solve -10 = 5o + qp, 3o + p + 16 - 9 = 0 for o. -4 Let v be (-16890)/(-990) - 4/66. Solve 0 = -2n - 4p + 4, 8n - 3n + v = -p for n. -4 Let j be ((-2)/4)/(2/(-20)). Let m = j - 2. Let y be (-72)/(-14)(-1197)/(-513). Solve 20 = 2q + 5t - 10t, mt = -4q - y for q. 0 Suppose 0 = -9k - 20 + 47. Suppose kf = 7f + 5c - 40, -2f + 2c + 2 = 0. Solve 0w - l - 20 = fw, 20 = -5w - 4l for w. -4 Suppose -737 = -74b + 965. Solve 20r + 8 = 5s + 24r, r = 5s - b for s. 4 Suppose 0 - 22 = d - 3w, 2d + 40 = 5w. Let t be (-28)/141d/4. Solve tz = -2b + 9 + 4, -5b - 4z = -7 for b. -1 Let q = 3111 - 3109. Solve 3j = 4p + 25, 7j - p + q = 9j for j. 3 Let b(m) = 7m + 43. Let g be b(-6). Suppose -3h - 5a - 5 - 2 = 0, 5h + g = -3a. Solve 3q - 5s + h - 10 = 0, 6 = 2q - 5s for q. 3 Let s = 594 + -591. Suppose 18 - s = -3j, 24 = k - j. Solve 3m - k = -2y - 2y, -y + 3m = 14 for y. 1 Let w be 56/(-42)6/(-4). Suppose -q + 2h = 33, 2q + 2h = -wh - 58. Let i = -7 - q. Solve -5l + 12 = -t, 4t - 3l - i = -7l for t. 3 Let w(s) = -17s - 12. Let z be w(8). Let u = z - -151. Solve -3k + 3 = -3m - k, 0 = 2m - uk - 3 for m. -3 Let c(p) = p3 + 67p*2 - 288p - 279. Let z be c(-71). Solve -3m - 14 = 2g, zm - 4 = -4g - 30 for g. -4 Let k(j) = 6j3 - 114j*2 + 10. Let c be k(19). Solve -4 = 2u + z - 6, 4z = u - c for u. 2 Let u(i) = 3i*2 + 24i + 50. Let o be u(-2). Let w be o/(-10) - (-867)/255. Solve -6 - 1 = -wg + f, 28 = 5g + f for g. 5 Let s be 14/21(-3)/4(5 - 11). Solve x + 2 = 0, -8 = 3y - 4y + sx for y. 2 Let d be (-26)/(-10) - 18/30. Suppose -dc = -3m - 9, -2m = -5c + 19 - 2. Suppose -2i - 3i = -125. Solve -ca + i = -5g, 2g + g - 14 = -4a for a. 5 Suppose 645g - 573g = 144. Solve -o + 3a = g, 2o - 29a = -28a + 6 for o. 4 Let s(v) = v3 - 38v*2 + 2v - 73. Let x be s(38). Solve -2f - 2 = 0, -19 = -0u - 4u + xf for u. 4 Suppose 0 = -3t - 3t - 432. Let o be 464/t + 6 + (-76)/(-9). Solve 5k - 2k = 3b - 21, 0 = 2b - o for k. -3 Suppose -i - 6l = -4l, -28 = i - 5l. Let t = i + 28. Suppose -19x + tx = 2. Solve -z - x = 2v, -6z - 20 = -4v - 2z for v. 1 Suppose d + 12l - 14l - 69 = 0, -3d - 2l = -199. Let k = 72 - d. Solve -kr + 15 = -4y, 4r = 4y + 7r + 23 for y. -5 Let k(d) = 39 - 2d - 57 + 14. Let j be k(-7). Solve -3v - z - 13 = -2, 0 = -3v - 2z - j for v. -4 Let w(x) = -x*2 - 17x + 14. Let f be w(-1	{ "pile_set_name": "DM Mathematics" }
-0.09, p, z. p, z, -0.09 Let h be 18/(-4) - 3/2. Let n(t) = t*3 + 5t*2 - 9t - 8. Let c be n(h). Suppose 5a + c = -0a. Sort 3, a, 1 in decreasing order. 3, 1, a Let n be -3 + (-7 - 2) - 7. Put n, 0.2, 4/3, -1/2 in decreasing order. 4/3, 0.2, -1/2, n Let m = 31 + -41. Let l = m + 9.5. Put -0.3, l, 1/2 in ascending order. l, -0.3, 1/2 Suppose -2s + 2 + 8 = 0. Let y = 0 - -1. Let f = -538 - -538.4. Put s, y, f in ascending order. f, y, s Let j = 101 + -705/7. Let b = -28/9 - -187/63. Sort -1/6, b, j in decreasing order. j, b, -1/6 Let r = -0.13 + -14.87. Let d = -46 - -46. Let k be (d - -2)9/90. Sort k, r, 4 in increasing order. r, k, 4 Let g = -2212 + 2211.7. Sort 1/4, -22, g, 0.4 in descending order. 0.4, 1/4, g, -22 Let d be 28/(-5) - 30/(-50). Let m(w) be the second derivative of -w*4/12 - 8w*3/3 + 11w*2/2 - 4w. Let i be m(-17). Sort d, i, 1 in increasing order. i, d, 1 Suppose 0 = -5m + 6m - 2. Suppose 0 = -s + a - 2a + m, 3s = 2a + 16. Suppose 1 + 1 = 2l. Put s, l, 0.2 in decreasing order. s, l, 0.2 Suppose 0 = -g + 1 + 12. Let j = -10 + g. Put j, -6, 4 in decreasing order. 4, j, -6 Let h be (-6 + 12)/((-2)/(-4)). Put h, -2, 1, 5 in decreasing order. h, 5, 1, -2 Suppose 9l + 1325 = 1424. Put l, -4, -1, 0.2 in increasing order. -4, -1, 0.2, l Let a be (-2)/(-10) + (-145)/(-25). Let q be 0/(-7(-24)/(-84)). Put a, q, -3 in increasing order. -3, q, a Let b = -0.286 + -0.214. Sort b, -1, 3 in decreasing order. 3, b, -1 Let m(b) = b + 4. Let c be m(-5). Suppose -39k = -74 - 213 + 53. Put 5, k, c in descending order. k, 5, c Let n = -37 - -55. Let m = n - 13. Let w = -10 - -11. Put -2, m, w in increasing order. -2, w, m Suppose 4z + 17 = v - 7, 37 = -5z + 3v. Let c(d) = d*3 + 66d*2 - 70d - 199. Let f be c(-67). Sort -1, f, 4, z. z, -1, f, 4 Suppose 3x = -4m + 128, -4m - m - 5x = -160. Let b be m/56 - 9/(-21). Let c be (-2 + 1)/((-1)/(-3)). Sort 5, c, b in ascending order. c, b, 5 Let h be -2 + (-3)/(6/4). Suppose -z + 25 = -3l, 0l = z + 2l. Suppose -3v - z = 2v. Put -5, h, v in ascending order. -5, h, v Let x be (-3)/30 + 0/14. Let u = 1 - 1.7. Sort u, 1/3, x in ascending order. u, x, 1/3 Let l be ((-16)/12)/(-6 + 8 + 1). Sort 2, l, -2/69 in increasing order. l, -2/69, 2 Let d be 1(-4)/24 + 61/6. Let i be ((-1)/(-2)4)/(d/15). Sort 8, 2, i, -1 in ascending order. -1, 2, i, 8 Let r = -22.2 + 22.22. Let v = 8.5 + -1.5. Let m = v - 4. Sort r, 0.1, m in descending order. m, 0.1, r Let p be (2/(-1))/((-30)/9). Sort -0.5, p, -0.02, 1. -0.5, -0.02, p, 1 Let f be 26460/216 - 2/4. Put -3, f, 0 in descending order. f, 0, -3 Let w = -2.5 + 1. Let z = w + -0.5. Sort 0.5, z, 2 in increasing order. z, 0.5, 2 Suppose 2l = l - 3, 4p + 5l = -3. Suppose -12 = -0z + pz. Let d be 1/z - (-30)/24. Sort d, -3, 5 in increasing order. -3, d, 5 Suppose 2y = 4, -y = -2s - 2y + 262. Suppose sg - 128g - 4 = 0. Put -4, g, -6, 0 in decreasing order. g, 0, -4, -6 Let v = -53 + 56. Let z be 2 - (16/9 - 0). Sort -9, z, v in decreasing order. v, z, -9 Let j(h) = 8h - 1. Let n be j(-2). Let v = -15 - n. Let u be (-27)/(-9)v/6. Put -5, 3, u in decreasing order. 3, u, -5 Let r(u) = -71u*3 - 2u*2 + 4u - 3. Let v be r(1). Put -1, v, 2 in decreasing order. 2, -1, v Let i be 1(-4 - -5)-5. Sort 16, 0.3, i in ascending order. i, 0.3, 16 Suppose -3x - 5b + 32 = 0, -3x - 2b - 5 = -34. Let g be x/6(-12)/(-18). Put -2, -3, g in descending order. g, -2, -3 Let i = -37 + 44. Let x = i + -4. Sort x, 0, 1 in decreasing order. x, 1, 0 Let z = -748 - -883. Put -4, z, 2 in descending order. z, 2, -4 Let w be 21/28 - 107/4. Let s = 30 + w. Put -3, -10, s in descending order. s, -3, -10 Let f = 52.7 + -53. Let m = 0.04 - 0.1. Sort f, m, 0.1. f, m, 0.1 Let t = -2.36 + -0.64. Sort -4, -14, t, -1/15 in decreasing order. -1/15, t, -4, -14 Let z = 31 + -40. Let b be (-10)/2z/15. Put -3, b, -2 in ascending order. -3, -2, b Let d(g) = 8g - 101. Let k be d(11). Put 2, k, 1 in decreasing order. 2, 1, k Suppose 158w = -5a + 156w - 225, -3a - 124 = -w. Sort 2, -1, -4, a in decreasing order. 2, -1, -4, a Let u = -2/2341 + -7015/9364. Let b = 0.3 + -0.25. Sort -3, b, -1/2, u. -3, u, -1/2, b Let v be -3(-4)/(-6) - 2. Suppose -k + 22 = 4d + d, -3k + d + 2 = 0. Sort -2, v, k. v, -2, k Let l be ((-49)/126 - (-2)/(-18)) + 3. Let g = -0.2 - 4.8. Let b = -4.7 - g. Put -1/2, l, b in descending order. l, b, -1/2 Let z be (10/(-4) - -3)0. Let l = 2 - z. Let p be (-7 + 6)/(9/(-90)). Put l, p, 5 in descending order. p, 5, l Let u = -4 + 54. Let g = u + -49.9. Sort -0.07, 3, -1, g. -1, -0.07, g, 3 Suppose 10d - 5d + 4g = -9, 0 = -d + g. Let f be (-12)/(10 - 34/4). Put f, -2, d in decreasing order. d, -2, f Let h(p) = -2p3 + 2p*2 + p + 1. Let g be h(2). Put g, 6, 0 in descending order. 6, 0, g Suppose j = -2f - 8, -182j + 26 = -177j - f. Suppose -6 - 60 = 3m. Put -5, m, j, -3 in descending order. j, -3, -5, m Let w = -0.3 + 0.32. Let v = -0.047 + 0.467. Let u = w - v. Sort u, -1/3, -1/2 in decreasing order. -1/3, u, -1/2 Suppose 17k + 4k = -21. Suppose -4a = -3 - 1. Sort k, a, -3, 4. -3, k, a, 4 Let b(m) be the second derivative of 0m2 - 1/6m*3 + 10m + 0. Let z be b(-1). Sort z, -3, 2/13. -3, 2/13, z Suppose w = -4f - 0w - 138, 4w = 3f + 113. Let y be 4/10 + 84/f. Let s = 4 + -2. Put s, y, -4 in decreasing order. s, y, -4 Let l(o) = 30o - 2. Let r be l(0). Put 4, 3, 64, r in descending order. 64, 4, 3, r Suppose 15d + 25 + 50 = 0. Sort d, -11, 1 in descending order. 1, d, -11 Let a(j) = -22j + 3. Let l be a(-2). Let z = -45 + l. Sort -5, -8, z. -8, -5, z Let k = 88 + -89. Let z be k/(90/(-8))(-35)/(-14). Sort -0.3, 3, z, -3 in descending order. 3, z, -0.3, -3 Suppose -21t + 146 = -274. Sort t, -3, -4 in ascending order. -4, -3, t Let p be 12/(-2)2/(-3). Let q be (-186)/(-42) - 6/14. Suppose -qn + 27 = -13. Sort p, -2, n in increasing order. -2, p, n Let r = -0.136 - -0.436. Let j = -1 - -0.7. Let f = j - 0.2. Put f, -1, r in descending order. r, f, -1 Let c be 3/(66/(-122)) + 420/770. Put -2, 55, c in decreasing order. 55, -2, c Let s = -6/35 - -4/7. Let a(o) = o2 - 3o - 7. Let c be a(5). Sort s, -0.5, c, 5 in descending order. 5, c, s, -0.5 Suppose -a - a = -70. Let o = a + -35. Sort o, 14, -4, -1 in decreasing order. 14, o, -1, -4 Let t(j) = j*3 - 10j*2 + 9j. Let h = 24 + -15. Let b be t(h). Suppose -3y + 2y - 2 = b. Put y, 3, -4 in descending order. 3, y, -4 Let n(j) = -j*2 + j + 3. Let x be n(0). Let o be (-12)/(-66) + 6/(-33). Put 4, x, o, -2/11 in descending order. 4, x, o, -2/11 Suppose -51r - 10 = -49r. Let o be (15/(-9))/((-1)/3). Sort 2, r, o. r, 2, o Let x = -930 - -969.7. Let v = -40 + x. Sort -2/3, 3/5, v in descending order. 3/5, v, -2/3 Suppose 53l - 23l + 19l = 0. Sort -66, l, -5 in increasing order. -66, -5, l Suppose 34s - 27s = 560. Let m be 40/s((-2)/4)/1. Sort 6, m, 1, 1/9 in descending order. 6, 1, 1/9, m Let h = -3 - -2. Let n be 2/4 - ((-15)/10 + 5). Let l be n/(-4)-4(-3)/3. Put -2, h, l in decreasing order. l, h, -2 Let q = -0.08 + -2.92. Let o = -6.4975 + 0.4975. Sort q, o, 1. o, q, 1 Let u be (-348)/(-57) + 22/(-209). Put u, -1, -4 in ascending order. -4, -1, u Let b(u) = -u2 + 2u + 2. Let f be b(3). Let o = 0.27781 + 8.72219. Sort 4, 0.2, f, o in decreasing order. o, 4, 0.2, f Suppose f - 22 = -4n, n + 1 + 0 = 3f. Suppose 10 = 21g - 19g. Suppose -gp = -3p - 2. Put -5, n, p in descending order. n, p, -5 Let n = 887.1 - 887. Sort n, -3, -3/7, -227 in ascending order. -227, -3, -3/7, n Let m = 3.3 + 0.7. Let c(j) = j*2 - 7j + 3. Let t be c(6). Suppose -45 = -0w + 3w - 3a, 2a = -w + 15. Put t, m, w in decreasing order. m, t, w Let u(m) = -m*2 + 11m - 22. Let v be u(2). Put v, 10, -5 in increasing order. -5, v, 10 Let y = 151 - 185. Sort y, -3, 3, -4 in descending order. 3, -3, -4, y Let d be (1/(-8))/(316/(-568)). Let m = -2/79 - d. Let i = -0.06 - 1.94. Put i, m, 3 in increasing order. i, m, 3 Let k = -0.53 - -5.53. Let m = -0.21 + 19.21. Sort m, -1/2, k in ascending order. -1/2, k, m Let q = -43067/4 - -10821. Let k = q - 55. Sort -0.5, 1/2, k in decreasing order. 1/2, -0.5, k Let n = -277/3 - -185/2. Sort n, -1, -8. -8, -1, n Let t(r) = 3*r - 35. Let j be t(	{ "pile_set_name": "DM Mathematics" }
Let q = -166/371 - m. Which is the nearest to x? (a) 4 (b) q (c) 0.2 b Let s = 0.4 - 0.45. Let f = -3.05 - s. Let j = -3.1 - f. Which is the nearest to j? (a) 5 (b) -0.1 (c) 1 b Let n = -10 - -6. Let y = n - -3.8. What is the nearest to 0 in -5, y, -0.02? -0.02 Let l = -1.01 + 0.01. Let k = 26 + -105/4. Let w be (3 + 53/(-18))4. What is the nearest to k in w, l, -4? w Let q = 4 + 1. Let j = q + -4.9. Let x = 0.1 - 0.2. Which is the nearest to x? (a) 3/4 (b) j (c) -1 b Let q = -20 + 20. What is the closest to -1 in -0.2, 5, q? -0.2 Let v = 8 - 4. Let m = -8 + v. What is the closest to 1/2 in -5, m, 4? 4 Let l = 5.2 + -5. Which is the closest to 3? (a) 3 (b) l (c) -0.5 a Let f = -87 + 78.8. Let v = 8 + f. What is the nearest to 0 in v, -4, 2? v Let p = 10.8 + -11. Which is the nearest to 0.08? (a) 0.1 (b) 2 (c) p a Suppose -3p = 2j - 2p - 3, 4j = 2p + 18. Let z be (j + -2 + 0)-1. Let s = -0.03 - 0.17. What is the nearest to s in 1, z, 0.2? 0.2 Suppose -5t - v + 3 = 0, -5v = 3t - 4v - 1. Let k be ((0/(-1))/(-2))/1. Let r = -0.2 + 0.1. What is the closest to r in t, -1/10, k? -1/10 Suppose -6 + 0 = -2l. Which is the closest to -7? (a) 1/4 (b) l (c) -2 c Let k = -1.52 - -0.02. Let m = k - -1.4. Which is the nearest to m? (a) 2/15 (b) 0.3 (c) -2/9 c Let u = 0.4 + 0.6. Let w = u + -1.1. Let q be (-2)/(-10)(-20)/24. What is the nearest to w in -2/11, -5, q? q Let g = 26 + -28. What is the closest to -1 in g, 13, -0.4? -0.4 Let x = 0.16 - -0.34. What is the nearest to 2 in 5, x, -0.2? x Let d = 0 - 3. Let i be (d/2)/((-42)/8). What is the closest to i in -3/7, 0.1, -1/4? 0.1 Let j = 5 - 5. Let n = -0.1 - j. What is the closest to -1 in n, 0.1, 0.3? n Let c = -0.118 + 0.118. Let h = -0.37 + -0.03. What is the nearest to 2 in h, c, -3/5? c Let r = 0.03 - 2.03. Let z(p) = 5p*2 - p + 1. Let m be z(1). What is the closest to -1 in r, 1, m? r Let r = 0.3 - -0.2. Let n be 2/(-8) + (-13)/(-20). Let v = -1 + 2. What is the closest to v in -0.4, r, n? r Let x = 1/48 - 7/48. Let i be 0 + -1 + 0 + 3. Suppose q - 1 = -0. What is the nearest to q in 1/2, i, x? 1/2 Let p = -1935/13 - -149. Let g = 0.063 - 4.763. Let n = 0.7 + g. What is the nearest to 2/7 in p, n, 5? p Let l = 1.04 - 1.1. Let n = l + 2.06. Let f = -0.8 - 0.2. Which is the closest to 2? (a) f (b) n (c) -2/11 b Suppose -s - 2z + 11 = 0, 3s + 0z + 4z - 23 = 0. Let d = -43 - -303/7. What is the nearest to d in -2, s, -3? s Let p(o) = -o + 4. Let j be p(4). Suppose 7s - 4s = j. Suppose s = 2v - n - 10, -v + 4n + 31 = 4v. Which is the closest to 1/5? (a) 4 (b) -0.2 (c) v b Let q = 2580/29 - 89. Let w = 32/87 + q. Which is the closest to w? (a) -1 (b) -3 (c) -4 a Let f be (-2)/(-7) - 0/(-1). Let w = -5 - -3. Let y = -1583/2655 + -2/531. Which is the closest to f? (a) y (b) w (c) 3/4 c Let l = 0.6 - 0.1. Let u = 194 - 194.2. What is the closest to u in -2/5, 0.3, l? -2/5 Let v = 234 - 235.07. Let d = -0.07 - v. What is the closest to d in 4, -2/9, 0? 0 Suppose -2i = -6i + 12. Suppose 0 = -20o + 15 - 95. Which is the closest to -7? (a) i (b) 1/4 (c) o c Let x = 1103/72 + -158027/10440. Let w = 1/58 + x. Let c = 1.3 - 0.3. What is the nearest to -1 in -1/6, c, w? -1/6 Suppose u + 1 = 2b + 10, 5b = -4u - 29. Let a be u/((-3)/(-6)) - -1. What is the nearest to -1 in a, -0.3, 0? a Let s = 46 + -51. Which is the nearest to 1? (a) s (b) 0.2 (c) -17/3 b Let y = 2.98 + 0.02. Let l = -25 - -7. Let p be -2 - (l/15 - 1). Which is the nearest to 0? (a) y (b) 4/7 (c) p c Let g = 0 - -1. Let r = 26.5 - 21.5. What is the nearest to g in 0.1, 1/2, r? 1/2 Let k = 19 + -6. Let g = 12 + -1. Let s = g - k. What is the nearest to 0.3 in -1/4, s, -4/3? -1/4 Let d = -4 + 9. Let m = -14 + 13.93. Let w = 2.07 + m. What is the closest to 0.1 in d, w, 3? w Let z = 8393149/121770 - 13821/205. Let h = 2/297 - z. Let i = -8 - -10. Which is the closest to i? (a) -0.1 (b) h (c) -0.4 a Suppose 3p = -59 + 62. Which is the closest to p? (a) 3 (b) 4/9 (c) -4 b Let m = -0.038 + 0.038. What is the closest to 0 in m, -1.9, 5? m Let p = -0.236 - 0.064. What is the nearest to 1/2 in -3/7, p, 0.3? 0.3 Let v = -2.2 - 0.8. Let k be 3/(-1)10/(-6). Which is the nearest to -3? (a) k (b) 0.5 (c) v c Let o = 254/3 + -86. Which is the closest to o? (a) 1 (b) -4 (c) 3 a Let v(j) = -2j2 - 3j + 2. Let r be v(-3). Let h = r - -8. Let q = 40/7 - 233/42. Which is the closest to -0.1? (a) h (b) -3/5 (c) q c Let g = -0.7 - 0.3. Let d = -15 - -15. Let q = g + d. Which is the closest to q? (a) -0.2 (b) 0.3 (c) -3 a Let i be (1/(-3))/((-3)/27). Let h = -0.17 - 9.83. Let j = h - -7. Which is the nearest to 2/5? (a) i (b) j (c) 0 c Suppose 0 = -2f + 2, 0 = -4d + 4f - f + 1. Let i be (-6)/16(-4)/9. Let q = 0.04 + 0.36. What is the nearest to d in 4, q, i? q Let o = -163/91 - -27/13. What is the nearest to o in -2, -14, -0.2? -0.2 Let z = -5 - -8. Let f be (3/12)/(z/(-8)). What is the closest to f in -5, 3, 2? 2 Let u(s) = 14577s3 + 1. Let i be u(1). Let h = i + -101547/7. Let k = 71 - h. What is the closest to k in -0.5, 0.2, 5? -0.5 Let t = 4.9 - 1.9. Let f be (-2)/(-4) + (-1)/(-2). What is the nearest to 0 in t, 5, f? f Let s = -11.4 - -11. Which is the closest to 0? (a) s (b) 0.6 (c) 0.1 c Let k = -62 + 311/5. Let l = -105 + 105.1. Which is the closest to l? (a) k (b) -4 (c) 3/2 a Suppose -49 = -2k - 15. Suppose 2c = -5n + 2, 3n + 3 = 2c + k. What is the closest to -1 in -5, c, 0.4? 0.4 Let j be (-26)/24 + (-9)/(-27). What is the nearest to j in -0.4, 0, -1/5? -0.4 Let p = -0.13 - -0.13. Let q = -2.7 + 0.7. Which is the closest to p? (a) -4 (b) q (c) 0 c Let p = -0.99 - -0.9. Which is the nearest to 2/3? (a) -5 (b) -1 (c) p c Let v = 2.6 + -2.3. Let a be (-4)/55/9. What is the nearest to -1 in v, -2, a? a Let t(o) = 10o + 2 - 9o - 4o. Let a be t(2). What is the nearest to -2/7 in -0.1, 0.5, a? -0.1 Let u = -25.6 - -26. Which is the nearest to -0.1? (a) 2 (b) -3 (c) u c Let m = 0.2 + -0.3. Let g = -0.7 + 0.4. Which is the closest to m? (a) -3 (b) 0.4 (c) g c Let i = -4.1 - -8.1. Let a = -3/20 + 2/5. What is the closest to a in i, -1/3, -4? -1/3 Let o = 0 + -2. What is the nearest to -1 in 0.2, o, -3/2? -3/2 Let z = 1 + -2. Let q be (-2)/z15/6. What is the closest to 1 in -4, q, -1? -1 Let i = -3.7 + 7.7. Let r = 1 + 1. Which is the closest to -2/5? (a) i (b) 5 (c) r c Suppose -2d + 0d - 3l = 25, 5d + 30 = -l. Let v = -7 + 4. What is the nearest to v in -3/2, d, 3/7? -3/2 Let a be (2/5)/(2/(-4)). Let i = 10 + -7. Let w = 121 + -116. What is the closest to 2/5 in w, i, a? a Let r = -1 + 0. Let j = -3 - r. Let l = -0.6 + 3.6. Which is the closest to 0? (a) l (b) 4 (c) j c Suppose 13r - 17r + 16 = 0. What is the nearest to 1 in -0.5, r, -4/3? -0.5 Let c = 0.5 - 0.2. Let y = 2.1 + -2. What is the closest to y in c, 2, -4? c Let n = 0.32 + 16.58. Let b = 17 - n. What is the nearest to 0.01 in -1, -2/13, b? b Let t = -0.009 + -1.991. What is the nearest to 2 in 5, t, -5? 5 Let i = -31 + 30.8. Which is the nearest to 1? (a) -2/5 (b) 2/7 (c) i b Let r = -0.43 + 0.33. Which is the nearest to -0.3? (a) 1/2 (b) r (c) 4/5 b Let j(k) = -k - 66. Let z be j(0). Let u be (2/5)/(z/12). Let i = u - 82/385. Which is the closest to 1/2? (a) -1/3 (b) i (c) 4 b Suppose -7n = -3n - 16. Let g be -3 - (n/(-1) - -1). Let z be 1/(-2)18/15. Which is the nearest to 1/3? (a) z (b) g (c) -3 b Let d = -0.2 - 0. Let y = -0.42 - -0.52. Which is the closest to y? (a) -3 (b) -4 (c) d c Let y = 6 - 3. Let i be 2 + -8 + y + 2. Let h = 0.3 + 0.7. What is the nearest to -2 in 4, i, h? i Let r = -0.5 + 2.5. Which is the closest to 1? (a) -1/8 (b) r (c) -0.4 b Suppose 3t = -5t. Which is the nearest to t? (a) -0.1 (b) -2/3 (c) 6 a Let y = 0 - -1. Let p = 0.2 - 0.7. Let x = 0.05 - -2.95. Which is the nearest to 0? (a) y (b) p (c) x b Let d be -3 + (-100)/(-36) + 0. What is the nearest to 0.2 in 2/7, -0.1, d? 2/7 Let y = 2/37 + -108/629. Let u = 3 - 8. Let j = 5 + -2. Which is the nearest to -1/3? (a) u (b) y (c) j b Suppose 0 = -6p + 2p - 3i + 15, p - 2i - 12 = 0. Let j = -11 + p. Let z = 0 + 0.1. Which is the nearest to -1? (a)	{ "pile_set_name": "DM Mathematics" }
+ 4. Find the second derivative of -6m2 - 4m - dm4 + 2m*2 + 4m*2 wrt m. -48m2 Let q(a) = -a2 + a - 1. Let p(t) = -8t2 - 10t + 2. Let m(n) = p(n) + 2q(n). Find the second derivative of m(d) wrt d. -20 Suppose -9 + 34 = 5f. Suppose -4r = -h - 7 - 0, fr = -2h + 12. What is the third derivative of dr - d2 - d2 - d3 wrt d? -6 Let u(p) be the third derivative of -2p*7/105 + 5p*3/6 - 6p*2. Differentiate u(g) with respect to g. -16g3 Let w(h) be the first derivative of h9/56 - h*5/20 + 5h*2/2 + 1. Let u(y) be the second derivative of w(y). Find the third derivative of u(m) wrt m. 1080m3 Let o(k) be the second derivative of -k7/630 + k6/240 - k4/3 + 2k. Let g(j) be the third derivative of o(j). What is the second derivative of g(p) wrt p? -8 What is the second derivative of -489z + 22z4 + z3 + 498z - 8z4 wrt z? 168z*2 + 6z Let c(i) be the first derivative of 53i6/6 - 11i*2/2 + 2i - 33. What is the second derivative of c(x) wrt x? 1060x3 Let o(m) = 5m*2 + 5m - 2. Let p(u) = 10u2 + u + 1 - 6 + 9u. Let a(r) = 5o(r) - 2p(r). What is the second derivative of a(h) wrt h? 10 Let c(q) = 17q3 - 5q*2 + 6q - 5. Let g(u) = -9u3 + 3u*2 - 3u + 3. Let v(w) = -3c(w) - 5g(w). What is the second derivative of v(f) wrt f? -36f Let y(u) = 3u*2 + 3u - 1. Let v(q) = -q + 1. Let l = 17 - 16. Let w(s) = ly(s) + 3v(s). Find the first derivative of w(z) wrt z. 6z Let w(m) = -2m5 + m4 + m*5 + 5m*2 - 3m4. Let p(x) = -x5 - x4 + x2. Let b(l) = 2p(l) - w(l). What is the third derivative of b(g) wrt g? -60g*2 Let f = 0 + 2. Find the first derivative of 0a - 4a + 2a + f wrt a. -2 Let a(i) = i3 + i2 - i. Let s be a(0). Let q = s + 3. What is the second derivative of c - 2c3 + c3 + 0c*q wrt c? -6c Suppose -3q - j + 28 = 2, 5j - 25 = 0. What is the first derivative of -2 - 6u2 + qu*2 - 2u*2 wrt u? -2u Let o(h) be the second derivative of -2h7/21 - 2h*3/3 + 4h. What is the second derivative of o(a) wrt a? -80a3 Let t = -1 - -6. Differentiate -5j*2 + 3j*2 - 1 + 3 + tj*2 wrt j. 6j Let c be (-2)/(16/(-4))4. What is the third derivative of -15u*2 + 7u*2 - 5u*4 + 14u*c wrt u? -120u Let l(f) = -4f4 + 5f*3 - 12f*2 - 41. Let n(m) = 3m*4 - 4m*3 + 10m*2 + 40. Let j(a) = -5l(a) - 6n(a). Differentiate j(o) wrt o. 8o*3 - 3o*2 Let d(x) be the first derivative of -5x3/3 + x2/2 + 7. What is the second derivative of d(w) wrt w? -10 Let z(i) = 21i + 1. Let u be z(2). Find the second derivative of 4b - b*2 - 43 + u wrt b. -2 Let j be 96/56 - (-2)/7. Suppose jg = 4g - 8. What is the third derivative of 3w*2 + 6w*4 - 2w*g - 2w*2 wrt w? 96w Suppose h - 2 = -2q, 4h - q - q - 18 = 0. Find the second derivative of 3l - 13 - 8l*h + l + 13 wrt l. -96l2 Let v(a) = a2 + 5a + 4. Let s be v(-5). Find the second derivative of 4n + 23n4 - 16n*s - 10n*4 wrt n. -36n2 Let v(f) be the second derivative of -f5/20 + f*3/6 + 2f*2 - 3f. Let u(r) be the first derivative of v(r). Find the first derivative of u(d) wrt d. -6d What is the first derivative of 314 + 315 + 25t2 - 607 - t3 wrt t? -3t2 + 50t What is the derivative of 2m - 2m - 1 - 12m2 + 7m*2 wrt m? -10m Differentiate -2f2 + 14f*3 + 6 + 10f*2 - 8f*2 with respect to f. 42f*2 Find the second derivative of 0b*2 - 28b*2 + 481b - 449b wrt b. -56 Suppose -3v = -2b - 7, b = 2v - 0b - 5. What is the first derivative of -39a*2 + 2 + 35a*2 - va + 3a wrt a? -8a Let y = 4 + 8. Suppose 0 = 4z + 5l + 2, -6z + 2z + 2l = -y. Find the second derivative of b2 + 2b*3 - 2b - b*z wrt b. 12b Let c(h) be the third derivative of h6/30 - h5/15 + 2h2. Find the third derivative of c(r) wrt r. 24 Let w(k) = k2 - 1. Let p be w(-2). Find the second derivative of z - 3z - z*p + 4z*3 wrt z. 18z Let q be 5 + -4 + 3 - -39. What is the second derivative of -6n4 + 46n - 2n4 - qn wrt n? -96n2 Let n(c) = -c. Let s(f) = 31f*2 - 12f. Let a(y) = 4n(y) - s(y). Find the second derivative of a(v) wrt v. -62 Let t(d) = 56d + 19. Let s(o) = -28o - 9. Let m(j) = -13s(j) - 6t(j). Find the first derivative of m(k) wrt k. 28 What is the third derivative of 4g*6 + 6g*3 - 8g*2 - 6g*3 wrt g? 480g*3 Let b be (-4)/6 - (-40)/15. Suppose -10 - b = -3f. Differentiate -t*f + 3 - 5t*2 + 5t*2 with respect to t. -4t*3 Let r be ((-6)/(-4))/((-9)/(-12)). What is the third derivative of -5u2 - ur - u*4 + 3u*2 wrt u? -24u Let v be 4 + -6 - (-2 + 1). Let g be 3 + ((-6)/(-3) - v). What is the third derivative of -3q2 - q2 + 3q*3 + gq2 + q3 wrt q? 24 Let s = -1 + 3. Suppose 5i - 8i = -12. What is the third derivative of 14di - 3d*2 - 15d*4 + 6d*s wrt d? -24d Let u(v) = -v3 - v2 + v + 1. Let o(w) = 14w3 + 6w*2 - 3w - 3. Let s(n) = -o(n) - 3u(n). What is the third derivative of s(y) wrt y? -66 Let l(s) = 6s*5. Let n(a) = -a. Let r(c) = l(c) + n(c). What is the second derivative of r(j) wrt j? 120j*3 Let n(c) be the second derivative of -4c + 0c3 + 0c*4 - 5/2c*2 + 0 + 1/5c*5. Differentiate n(j) with respect to j. 12j*2 Suppose 3v + v + 24 = 0. Let b = 8 + v. What is the third derivative of 2q4 + 2 + 3q*b - 2 wrt q? 48q Let z(a) be the second derivative of a*4/12 + 13a*3/6 - 4a. Find the second derivative of z(h) wrt h. 2 Let o(f) be the first derivative of -24f5/5 - 5f*2 - 15. What is the second derivative of o(b) wrt b? -288b*2 Let p(k) = 1. Let y(j) = -j - 12. Let q(l) = -3p(l) - y(l). Let d be q(-7). Find the second derivative of 0h2 - 5hd + h2 + h + 3h2 wrt h. -2 Let p(u) = -u2 - u. Let f(c) = -5c*3 - 12c*2 - 4c. Let z(o) = f(o) - 4p(o). Find the third derivative of z(k) wrt k. -30 Let k(a) be the first derivative of 4a*6/3 + 5a*2 + 11. What is the second derivative of k(p) wrt p? 160p*3 Let s = -5 + 5. Suppose -2 = -sq - q. What is the second derivative of 3z2 - 4z*2 + qz*2 + 2z wrt z? 2 Let v = -8 - -11. Differentiate v + 4u + 5 - 5 with respect to u. 4 Let c(u) be the third derivative of -1/30u*5 + 0u - 1/3u3 + 0 - 2u*2 + 0u*4. What is the first derivative of c(w) wrt w? -4w Let q(l) = -l*3 - 4l*2 - 2l + 3. Let w = 6 + -9. Let i be q(w). What is the first derivative of -z*2 + 2 + i + 2z*2 wrt z? 2z Let b be (-1 - -2) + 2 - -1. Find the second derivative of 3g4 + 0g + 0g - bg wrt g. 36g2 Let u(y) = 6y - 2. Let n(f) = 19f - 5. Suppose -g = -0 + 7. Let h be (-48)/40(-10)/6. Let j(o) = gu(o) + hn(o). What is the derivative of j(m) wrt m? -4 Let z(b) be the second derivative of b7/6 - b6/5 + 35b4/12 + 19b + 1. What is the third derivative of z(w) wrt w? 420w2 - 144w Let r(c) = 140c3 + 2c*2 + 29. Let j(m) = 47m3 + m2 + 9. Let l(s) = -11j(s) + 4r(s). Find the third derivative of l(h) wrt h. 258 Find the first derivative of k*3 - 2k*2 + 2k*2 - 5k*3 - 4 wrt k. -12k*2 Let s(p) be the first derivative of 9p*2/2 + 3p + 9. Differentiate s(c) wrt c. 9 Find the second derivative of -5g5 + 21g*5 - 2g*5 + 18g wrt g. 280g3 Find the third derivative of 5j*2 + 3j*6 - 6j*2 + 11j2 - j6 wrt j. 240j3 Let j(k) be the first derivative of 2k*2 + 0k*4 + 0k + 0k5 + 0k*3 + 5/6k*6 + 2. What is the second derivative of j(b) wrt b? 100b*3 Let i be (-4 + 7)/(-2 + 3). What is the third derivative of 8l*4 + i + 6l*2 - 3 wrt l? 192l Suppose -h + 0h = 0. Suppose 0 = -5w + 3n - 15, 4w + hn - 5 = -n. Differentiate 4 - 5 + w + x wrt x. 1 Suppose 5j = -3q + 2, -4j + 8 = 4q - 0j. Find the second derivative of 4m - 2m - 6mq + 2m wrt m. -72m2 Let a(s) be the first derivative of 2s*4 + 2s*2 - 7. Find the second derivative of a(o) wrt o. 48o Let x(r) = r2 + r + 6. Let k(n) = -n2 - 7. Let l(b) = -6k(b) - 7x(b). What is the second derivative of l(h) wrt h? -2 Let u(b) = 8b3 + 11b. Let t(i) = -i*3 - i. Let g(j) = 4t(j) + u(j). What is the second derivative of g(c) wrt c? 24c Suppose -5k - 24 = -2j, -5j + 2k + 14 = k. Find the third derivative of 3w3 + w3 - w**2 -	{ "pile_set_name": "DM Mathematics" }
z + 6 = -4p + 2z for p. -2 Let z = -405 - -422. Suppose -h = -4j - 5 - 3, z = 5h + 3j. Solve 4u + 0 = -hb + 4, 4 = 4b - u for b. 1 Let z(s) = -s*3 + 19s*2 + 19s + 26. Let u be z(20). Let l be (u/(-4) + -2)/((-1)/10). Let v = l + 2. Solve 0 = 4g + 4, 8 = 5y + 4g + v for y. -5 Suppose a = -0a - 81. Let b = a + 81. Solve b = -4f - 2q + 10, -5 = -q - 0q for f. 0 Let z(h) = 32h - 4. Let b be z(1). Suppose -3g + 2r = -22, 2g - 3r = r + b. Let v be (3 - (g - 1))/(-3). Solve -2u + 0 = 10, v = 5y - 5u - 40 for y. 3 Let n be (-14 + 15)/((-2)/(-6)). Solve -6 = 4r - nr + 3p, -5r - p + 12 = 0 for r. 3 Let k be (-7980)/(-1540) + 2/(-11). Solve 0s + 25 = -2u - 5s, 2u - ks = 25 for u. 0 Let c(w) = 2w + 8w - 12w2 + 1 + 12 + w3. Let z be c(11). Suppose 0 = -3d + v + 4, -zv + 25 = 5d. Solve -2n - d = -1, 2x = 4n for x. -2 Let h(m) = m3 - 30m*2 + 83m - 54. Let i be h(27). Suppose i = -4l + 108 - 100. Solve -2w + l = -2q - 0, w - 3q - 1 = 0 for w. 1 Let s = 568 + -581. Let m be 14/(-2)(1157/91 + s). Solve -4a + 8 = 0, y - my + 2a - 5 = 0 for y. -1 Suppose 0 = 41u - 39u - a + 2, 3u - a = 0. Solve m = -z + um + 4, -4 = 2m for z. 2 Suppose -5k - 13 = m, 5k + 6 + 9 = 0. Solve p - 4 = 4n - m, -3p = -4n - 6 for p. 2 Let d(l) = -l*3 + 8l*2 + 8l + 9. Let i be d(9). Suppose -r + 5 + 4 = i. Let y be (-15)/5(-12)/r. Solve 2s = 3m - 3s - y, -11 = -4m + s for m. 3 Suppose -4h + 4m - 51 + 83 = 0, 0 = 6h + 3m - 39. Solve -4s = 5l - 22, 10l + 4s = hl + 18 for l. 2 Suppose -30 = -5z - 10. Let b be z + -3 + 2/2. Suppose -bv + 15 = -25. Solve -8 = -2j - 0j, -5d - 5j + v = 0 for d. 0 Let g be ((-10)/(-4))/(760/912). Solve -2p - s = 4s + 13, 0 = p + gs + 7 for p. -4 Let q be 40/(4 + 0) + (-21)/(126/48). Solve -2m + 7c - 28 = 2c, 5m = -qc - 12 for m. -4 Suppose -6t + 2w = -9t + 11, 2w + 49 = 9t. Solve -3 = 2c - 5h, -4c + 21 = -8c - th for c. -4 Let f be ((-12)/(-18)12)/(-2)-1. Solve -3i + 7r + 13 = 9r, 0 = 5i - fr - 29 for i. 5 Suppose 3v = 9v - 24. Suppose 2z - vb = -4, 3z + 4b = -0b + 24. Solve -2g + 5l + 2 = 4l, -8 = -zg + 4l for g. 0 Suppose -12 = -4x, -5x + 29 = g - 6. Let r be (-152/(-40))/(1/g). Suppose -8b + 13 = -11. Solve -2j + 6 = 0, j = -0h - bh + r for h. 4 Let v(t) = -t*2 - 8t - 9. Let p be v(-6). Let k(f) = f*3 - 3f*2 - 2f - 6. Let w be k(4). Solve 0 = 3x - a - 5, -px + 3a = -w - 7 for x. 1 Let y = 1246 + -1244. Solve -16 = -4v, 5j + v + 14 = -y for j. -4 Suppose 2x + 63 = 5v, 19v - 18v + 3x = -1. Let z be 10/(-55) + 7/v5. Solve zn = -15, k = 4n + 12 + 9 for k. 1 Let a(f) = f2 + 569f + 3938. Let u be a(-7). Solve -up - 38 = 2h - 0h, 0 = -2p - 4h - 34 for p. -7 Suppose -3t = 8t + 6t. Suppose 12j = -tj + 48. Solve k - 4 = 5a + 12, 0 = -k + ja + 13 for k. 1 Suppose -170o + 175o - 16 = -2i, i = 5o - 7. Let p = -1 + 6. Suppose 18 = 3v + 4s + o, -v - 20 = -ps. Solve j - 4 = -3b - 0b, v = -5j - b + 6 for j. 1 Let j(t) = -t*3 - 18t*2 + 18t + 14. Let n(o) = o*2 - 1. Let k(r) = -j(r) - 2n(r). Let x be k(-17). Solve xs = -4a + 17 + 6, -2a - s + 7 = 0 for a. 2 Suppose y - 4 = 3s + 12, -7 = s - 2y. Let o be -4 - s - (-5 - -1). Solve -2i - 3v + 1 = -6v, oi + 5v = 15 for i. 2 Let w be 207/(-276)16/(-3). Solve -2g - 5n - 25 = -1, 0 = wn + 16 for g. -2 Suppose -64f - 6 = -63f. Let d be f/(20/(-4)(-10)/(-25)). Solve 3m = -2j + 5, -4j + dm - 1 = -2 for j. 1 Let z(h) = -3h*2 - 18h + 124. Let y be z(-10). Solve yo + 31i - 27i = 16, -5i = o - 12 for o. 2 Let t be (01/(-9))/(-1) + 5. Solve 3b + tw - 34 = -15, 27 = -b + 5w for b. -2 Let z(j) = -3j + 20. Let t be ((-40)/16)/(2/(-4)). Let d be z(t). Suppose 52 = dn - 18. Solve 4g = 2g - 3r + n, 3g - 4r - 4 = 0 for g. 4 Suppose 263541i + 36 = 263559i. Solve -3c + 8 = -5b, 34 - 36 = ic + 4b for c. 1 Let d = 88 - 74. Suppose 0 = -dh + 15h - 4. Suppose -3 = 3s - 5s + 3n, hs - 5 = 5n. Solve -5m - 3q + 14 = s, 10 = 3m + 5q - 8 for m. 1 Suppose 0 = -597349g + 597325g + 72. Suppose 0 = -0o + 3o. Let z = 21 - o. Solve -gh + 3x = z, -h + 1 + 4 = 3x for h. -4 Let d be (333/63 + (-3 - 0))399/114. Solve -2p + 13 = -3v, 2v = 5v - p + d for v. -1 Suppose 0n = 5n - 20. Let g = 35 - 18. Suppose 4p - 3w - g = 0, -2p + 5w + 19 = -0p. Solve 0 = m + 2v + 2, nv + 6 = 4m + p for m. 0 Let y(u) = -3u2 - 29u + 12. Let f be y(-10). Solve fw + a = 5a + 14, 3w - 17 = 2a for w. 5 Suppose 81w = 2w. Solve w = -3y - 3g - 15, -4y - 20 = -2g - 3g for y. -5 Let o be 20/50(-6 - (-51)/6). Solve 3z + o + 2 = -2p, p - 5z = 18 for p. 3 Suppose 0 = 9a - 13a - 32, 58 = 3g - 5a. Solve 0 = -3z + gz + 5l + 9, -3z - 4l - 9 = 0 for z. -3 Let r(h) = h*2 + 17h + 28. Let y(u) = -u. Let b(t) = -r(t) - 6y(t). Let d be b(-6). Solve 4 = -k - 4i, dk - 4k + 12 = -2i for k. 4 Let l(y) = -y2 - 11y + 46. Suppose 15c + 18 = 17c + 3r, -4r = -16. Let a be l(c). Solve t + 2w + a = -5, -3w = 6 for t. -5 Let w(x) = -x*3 - 5x*2 + 10x - 29. Let c be w(-7). Let r be ((-5)/10 + c)(-16)/6. Solve -2d = rq + 6, -6d - 6 = -3d + 3q for d. -1 Let w(a) = -a + 2. Let q be w(-2). Suppose 8k - 9960 = -32k. Let j be 4/34 - (1 - k/51). Solve 3 = jn - 4f + 35, qn + 4f = -8 for n. -5 Suppose -4h + 1509 - 265 = 0. Suppose 15d + 4 = -h. Let r = d - -24. Solve q - 5g + rg = -2, 2q = -g + 6 for q. 2 Let b be (210/25)/((-6)/(-20)). Let l(d) = -11d + 109. Let t be l(12). Let w = t + b. Solve 4f + 23 = -wp, -p = f + 2p + 11 for f. -2 Suppose -36j + 37j + 5 = 0, -45 = -5n + 5j. Solve v = 5v - r - 24, nv + 5r = 0 for v. 5 Suppose -3f - 4d - 14 + 49 = 0, f - 10 = -d. Suppose j - 3z = -3, 0 = -0j + 3j - 2z - f. Solve 4i - m + 6m + 1 = 0, 5i + jm = -11 for i. -4 Suppose -67x + 90x + 368 = 0. Let r be (60/18 - -2) + x/12. Solve rj + 5q = -6, -11 = -2j + 5q + 1 for j. 1 Let i(s) = s*3 + 2s + 215. Let q be i(0). Let m = 220 - q. Solve -2x - 33 - 2 = ma, 3a = 3x for a. -5 Let z = 0 - -3. Suppose 4d = -0h - 5h + 309, 149 = 2d - zh. Suppose 4j - d = -8. Solve -y - o + 5 = 0, -4y + 3 + j = 3o for y. 5 Suppose 82f - 83f - 9 = -2h, 3f = h - 27. Let c = -3 + 17. Solve hp - 30 = -5r - 5p, -r + c = 3p for r. 2 Let b = 4298 + -4278. Solve -13 - 1 = 4v - 3l, 5v - 5l + b = 0 for v. -2 Let r = 229 - 225. Suppose -17 = -5g + 4f + 12, rf - 11 = -3g. Solve -5w - gv + 25 = 0, 0 = -4w - 5v + 4 + 20 for w. 1 Let z(p) = -p*2 - 14p + 28. Let m be z(-16). Let n be m/6 + 102/18 + -4. Solve 5q = -2d - 11, -q = 4d + n - 6 for d. 2 Suppose -30u = -108u + 21u + 57. Solve b - 4 = 4h, -h - 2b - u = -0b for h. -1 Let l = 13 + -2. Suppose g - 5 = -3z, l = 4g + 4z - z. Let v = -448 + 454. Solve gd = -i - 2, i + 23 = -d + vi for d. -3 Suppose 157w - 152w - 35 = 0, -w - 32 = -3i. Solve 5j + 5n = 35, 11j - ij = -3n + 1 for j. 4 Let k be ((-75)/40)/(-5) - 159/(-24). Solve -4z - q + k = 0, 3q - q = 6 for z. 1 Suppose 155w - 148w = 189. Suppose -wz + 14z = -143. Solve -4k + 2a - z = 3, k = -3a + 14 for k. -1 Suppose -x - 7 = -3a, 5a = -7x - x + 31. Solve -xu - 1 - 8 = -z, -5z = -2u - 29 for u. -2 Let i = 547 + -327. Suppose -6f = -f - 2k + i, -4f + 4k - 188 = 0. Let g be (-63)/f(1 + 14/6). Solve -gt - 4v + 9 = 0, -t - 3v = -3 - 1 for t. 1 Let a be -3(62/(-6) - -9). Solve 3h = ac + 11, 2c + 9 = -2h - 7 for h. -3 Let b be (0/(((-66)/(-231))/((-1)/(-21))))/(-2). Solve b = -x, 5x - 9 = -5m + 6 for m. 3 Let c = -2209 - -2209. Solve -d + 5m = -13 + 16, -4d - 3m - 12 = c for d. -3 Let k(f) be the third derivative of -1/4f*4 + 0f + 16f2 + 13/2f*3 + 0. Let x be k(6). Solve xb - 5a + a - 28 = 0, -8 = 2b + 4a for b. 4 Suppose -42 = -3h + 85b - 80b, 27 = 2h - 3b. Suppose 3f = -3s + 2s + 3, -3f = 3s - h. Solve 5j + g + 23 = f, 0 = -g - 2g - 9 for j. -4 Suppose -131 = -12u - 47. Solve 0 = 2y + t - u, 3y - 2t - 3t = 17 for y. 4 Let q(w) = -2w2 - 23w - 6. Let m = -29 - -32. Suppose mv + 14 + 19 = 0. Let d be q(v). Solve -r + 6 = -3p - 2p, -dr + 5p + 10 = 0 for r. 1 Suppose -60o = -61o + 3. Solve -b - 3h = 0,	{ "pile_set_name": "DM Mathematics" }
1 - (-3)/(-2))2. Let v = r + j. What is g(v)? 6 Let g(z) = -z3 + 5z*2 + 9z - 7. Let l(p) = -2p + 30. Let o be l(12). Give g(o). 11 Let i = -97 - -97. Let w(q) = -q2 - 4q - 1. Let m(x) = -x - 1. Let s(u) = -3m(u) + w(u). What is s(i)? 2 Let b(i) = -i3 + 10i*2 - 2. Suppose 2o - 16 - 16 = -3k, -o - k + 14 = 0. Determine b(o). -2 Let a(f) = 7f - 4f2 + 0f*3 - 4f2 - f3 - 12. Give a(-9). 6 Let c(h) be the third derivative of -h5/30 - h4/24 - h*3/6 - 3h*2. Let j = 0 + 0. Suppose -4u - 4 = -ju. Give c(u). -2 Let o(v) = 1. Let l(a) = -a - 2. Let j(p) = l(p) - 4o(p). Calculate j(-10). 4 Let c(n) = -2n3 - 6n*3 - 5n*2 + 37 + 7n*3 - 31 + 8n. Let l(j) = -2j + 4. Let r be l(5). Give c(r). -6 Let c(s) = -2s + 2. Let r = 16 + -20. Determine c(r). 10 Let c(h) = 6h + 5h*2 + 3h*3 - 5h*3 + 3 + 0h3 + h3. Calculate c(6). 3 Let i(q) = -4. Let y(o) be the first derivative of -o*2/2 + 4o - 3. Let c(x) = -2i(x) - 3y(x). What is c(3)? 5 Let t(r) = r + 12. Let c be (4/5)/(2/(-25)). Determine t(c). 2 Let d be 0 - 1 - (-3 + 1). Let m(i) = -1. Let x(l) = -3. Let b(r) = -11m(r) + 4x(r). Let v(u) = -6u2 + 4. Let z(k) = 5b(k) + v(k). Determine z(d). -7 Let l(u) = -2u - 5. Let z be 6/9 + 14/(-3). Let b be (2/z)/((-2)/12). Let j(h) = 3h + 9. Let o(s) = bj(s) + 5l(s). Give o(-4). 6 Let x(l) = -l - 1. Let f(a) = -4a - 4. Let j(h) = -3f(h) + 14x(h). Let k(n) = -n3 + 6n*2 - 6n + 7. Let b be k(5). What is j(b)? -6 Let r(s) = s*2 + s + 7. Let o = 11 - 11. Let g be r(o). Suppose -3x = -gx - 8. Let y(j) = j3 + 3j*2 + 3j. Calculate y(x). -2 Let o = -78 + 74. Let m(h) = 3h2 + 5h - 2. Give m(o). 26 Let n(i) = 4i. Let x be n(1). Let b(u) = xu + 4u2 - 2 - 4u + 3. What is b(-1)? 5 Let x(i) = -i - 1. Let n(f) = f*2 - 17f + 18. Let z be n(16). What is x(z)? -3 Let y(t) be the second derivative of t5/20 - t4/2 - 7t3/6 + 3t*2/2 + t. Give y(7). 3 Let l(d) = 6d + 1. Let h(i) = -12i - 2. Suppose 3t - 4v + v = -15, -2v = 2t + 14. Let g(z) = th(z) - 13l(z). Determine g(-1). 5 Let p(s) be the first derivative of 7s3/3 + s2/2 - s - 1. Let k(h) = -2h - 11. Let w be k(-6). What is p(w)? 7 Suppose 0 = -4v + 6v + 4j - 26, 25 = v + 5j. Let z(g) = g3 - 4g*2 - 4g - 1. Calculate z(v). 4 Let f(b) = -2b3 - b2 - 3b - 1. Let i be f(-1). Let l(d) = d - 1. What is l(i)? 2 Let l(t) = t*3 - 15t*2 - 15t - 20. Let n be l(16). Let f be 2 + 4/(n/(-5)). Let p(m) = m - 1. Give p(f). 6 Let q(n) = 5n2 - 4n - 4n2 + 5 - 2n + 3n. What is q(4)? 9 Suppose m - 5 = 1. Let c(r) = r2 - 5r + 4. What is c(m)? 10 Let j(w) = -14w2 - 6w - 6. Suppose 24 = -2c - 2c. Let h(r) = -15r2 - 7r - 7. Let m(z) = cj(z) + 5h(z). Give m(-1). 9 Let u(x) = x*2 + 6x - 4. Suppose -3z - 6 - 12 = 0. Calculate u(z). -4 Suppose 74s - 5 = 73s. Let u = 0 + 1. Let t(a) = u + 0a*2 - 6a - a + a*2. Determine t(s). -9 Let b(p) = -2p + 14. Suppose -3s + 22 = q + s, 0 = -q - 5s + 25. What is b(q)? -6 Let k(q) = q*2 + 2q*3 + 0q*2 + 2 - 3q + 3q2 + 4q. Calculate k(-3). -19 Let y(f) = 5f3 - f2 + 1. Let c be y(-1). Let z(b) = -b3 - 4b*2 + 2b - 2. Calculate z(c). 13 Let r be (-1)/(-2) - 3/9. Let z(d) be the third derivative of rd4 + 0d + 2d2 + 0 - 1/60d*5 - 1/3d3. Give z(3). 1 Let t(c) = -c3 + 5c2 - 2c + 6. Suppose 5i + 7 + 3 = 0. Let g = i + 3. Suppose -3x + g = -2, -3 = -f + 2x. Give t(f). -4 Let j(n) be the third derivative of -1/120n*6 - 1/60n*5 + 0 - 1/24n*4 - 5/6n*3 + 0n + 2n2. Let c(f) = f - 2. Let w be c(2). Calculate j(w). -5 Let u(j) = -4j*2 + 9j*2 + 5j*2 - 3j*2 + 2j + j*3 + 8. Determine u(-7). -6 Let g = -12 + 14. Let f(a) = 0 + g + 26a - 27a. What is f(0)? 2 Let g(h) = 6h3 + h2 - 20h + 16. Let r(m) = m3 - 4m + 3. Let v(l) = 2g(l) - 11r(l). Calculate v(-3). -22 Let g(r) = 6r + 1. Let h(u) = u2 - 2u - 2. Let s be h(0). What is g(s)? -11 Let k(m) = -2m - 11. Let v(w) = -w - 10. Let h(a) = 5k(a) - 6v(a). Suppose -3f = 5s - 0f - 1, 3s - 15 = 3f. Suppose 3d - 4 = sd. Determine h(d). -11 Let y(v) = -2v2 - 2v + 1. Let l(k) = 5k2 + 6k - 3. Let t be 2/(-11) + (-80)/44. Let h(z) = tl(z) - 7y(z). Let m = 0 - 2. Give h(m). 11 Let l = 11 - 9. Let k(j) = -2j + 2j + j - 5. Let a(f) = -1. Let m(w) = lk(w) - 14a(w). Calculate m(4). 12 Let n(d) = d + 1. Let f be n(1). Let u be ((-7)/f + 3)2. Let m(b) = b2 + 4b*2 + 1 - 3b2. Determine m(u). 3 Let c(u) be the second derivative of -u4/12 - 7u3/6 - u2/2 + 34u. Let y be (-2)/(-3) - 28/6. Calculate c(y). 11 Let a(w) = w*3 - 3w*2 - 3w + 3. Suppose 0 = 4m + u - 22, 2m + 6u = 2u + 18. Suppose mj - 8 = j. Suppose -jz - 19 = -q - 6, -z = 5q - 10. Give a(q). -6 Let z be 71/9 + (9/3)/27. Let p(v) = v3 - 8v*2 - 2v + 8. What is p(z)? -8 Let n(a) = a*2 - a - 1. Let x be n(-2). Suppose 0 = 2j + 4i - 4, 2j = j - xi - 1. Let y(w) = -w2 + 5w - 5. Determine y(j). -1 Let d(c) = 4c - 6. Suppose -4v + 0 - 8 = 0. Let p be (-16)/105/v. Give d(p). 10 Let p(h) = 3h + 1. Let z = 2 - 3. Calculate p(z). -2 Let r be (-2 - (-3 + 1)) + 2. Suppose -rb + 5b + 11 = 2o, -2o + 4b = -12. Let q(w) = w3 - 5w*2 + 5w. Calculate q(o). 4 Let o(k) be the second derivative of -k*5/20 + 7k*4/12 - 4k*3/3 + 7k*2/2 - 5k. Determine o(6). -5 Let n(b) be the first derivative of 4b3/3 + b2/2 - b + 5. Suppose h = -j + 4 - 0, -5j - 1 = -2h. Calculate n(j). 4 Let u be (2/2)/(1/4). Suppose -uv = -2v + 10. Let f(o) be the third derivative of -o6/120 - o5/15 + o4/4 + 6o2. Calculate f(v). -5 Let c(n) = n3 - n*2 - 7. Let s be 2/(-5) - ((-154)/(-35))/(-11). Determine c(s). -7 Let t(s) be the first derivative of 0s + 1/2s2 + 0s*3 + 1/4s*4 + 3. Let r(i) = 3i*3 + 2i*2 + i + 1. Let x(o) = -r(o) + 2t(o). Determine x(-3). 5 Let u = 17 + -23. Let y(m) be the third derivative of m*2 + 0m + 1/3m3 + 1/24m4 + 0. Determine y(u). -4 Let f = -6 + 1. Let v(h) = -h3 + 0h - h - 4 + 3. Let p(u) = -5u*3 - 6u*2 - 9u. Let a(k) = -p(k) + 4v(k). What is a(f)? -4 Let m be (3/(-5))/((-5)/25). Let i(g) = 4g + 4. Let y be i(4). Suppose -r = mr + y. Let z(o) = o + 2. Determine z(r). -3 Let b(c) = 0c*2 - c + 0c - 7c2. Let t be b(-1). Let g(x) = 8x*2 + 4x - 14. Let y(s) = -7s2 - 4s + 13. Let u(z) = 6g(z) + 7y(z). Calculate u(t). -5 Let d(a) be the third derivative of a4/24 + a3/2 - 4a2. What is d(-5)? -2 Suppose -3t = 4m - 18, -4t + 4m = -5t + 6. Let l(d) = 5d - d + 0 - t - 3d. Let p be 1/210. Give l(p). -6 Let f(y) = -4y + 15y - 11y + 1 - 6y*2. Give f(-1). -5 Let z be (-1)/(-1)(4 + -3). Let c be (-2 - -6)/(3 - z). Let r(w) = -w*3 + 3w*2 + 3w - 3. What is r(c)? 7 Let l be (11/22)/((-2)/24). Let d(z) = 6z - 4z + 5z + z2. What is d(l)? -6 Let n(u) = u2 - 3u + 2. Let k be n(1). Let s(b) = -b + b*2 - 2b*2 - 1 + 6. Give s(k). 5 Let w be (-1 + 0)/(8/(-48)). Let q = w - 11. Let i(m) = m - 2. Calculate i(q). -7 Let r(a) be the second derivative of 0 + 1/2a*2 - 4a - 1/6a3 + 1/3a4. Determine r(1). 4 Let s(y) = y3 + 2y2 + y + 2. Let x(g) = -2 - 2g*2 + 3g*2 + 0g - 3g. Let q = -3 - -6. Let a be x(q). Determine s(a). 0 Let m(r) = -r2 - 2r + 1. Let d = -15 - -14. Let c be 1/3-3 + d. Determine m(c). 1 Let t(m) be the third derivative of m5/60 - m3/6 - 2m*2. Calculate t(1). 0 Let k(b) be the first derivative of 4b*3/3 + b - 2. Let n be (-12)/(-18) - (-10)/(-6). What is k(n)? 5 Suppose 0 = 3y + 4y + 49. Let k(h) = h + 7. Give k(y). 0 Let l(g) = 2g + 9. Suppose 30 = -28k + 23k. What is l(k)? -3 Let z(b) = b*2 - 5b - 12. Let q be z(7). Let t(h) = -h - 3h2 + 6h*q + 12h*2. Determine t(-1). 16 Let f(z) = 3z + 1. Let v(p) = 16p - 7p + 4p + 6 + 3p. Let g(a) = -11f(a) + 2v(a). Calculate g(-5). 6 Let t(n) be the first derivative of 3n2 - 1/4n*4 + 2n*3 + 2n + 1. Give t(7). -5 Suppose -h = 2 + 2. Let c(z) be the third derivative of -z6/120 - z5/15 + z*4/24 - 2z*3/3 + 15z2. Give c(h). -8 Let v be 14/35 - (-24)/(-10). Let l = -6 - v. Let a(r) be the first derivative of -r2/2 + r + 1. What is a(l)? 5 Let h(l) = -l*2 + 11l + 3. Let f be h(	{ "pile_set_name": "DM Mathematics" }
3 What is the r'th term of 313497, 313495, 313491, 313485, 313477, 313467? -r*2 + r + 313497 What is the i'th term of 7456, 7458, 7460, 7462, 7464, 7466? 2i + 7454 What is the o'th term of 8798, 17320, 25842, 34364, 42886? 8522o + 276 What is the p'th term of 227, 1034, 3243, 7556, 14675, 25302, 40139, 59888? 117p3 - p2 - 9p + 120 What is the y'th term of 2999, 6003, 9021, 12059, 15123, 18219, 21353? y3 + y2 + 2994y + 3 What is the a'th term of -3231, -3729, -4227? -498a - 2733 What is the p'th term of 4361, 17439, 39241, 69767? 4362p*2 - 8p + 7 What is the b'th term of -864869, -864871, -864875, -864881? -b2 + b - 864869 What is the h'th term of -106651, -106644, -106627, -106594, -106539, -106456, -106339? h3 - h*2 + 3h - 106654 What is the p'th term of 1175725, 2351449, 3527173? 1175724p + 1 What is the a'th term of -59, -279, -645, -1157, -1815, -2619, -3569? -73a*2 - a + 15 What is the n'th term of -1155, -1553, -1951? -398n - 757 What is the v'th term of -31804, -127232, -286274, -508924, -795176, -1145024? v*3 - 31813v*2 + 4v + 4 What is the g'th term of 897, 914, 925, 930? -3g2 + 26g + 874 What is the k'th term of 3472, 8559, 13646, 18733, 23820? 5087k - 1615 What is the t'th term of 91728, 183427, 275112, 366777, 458416? -t3 - t2 + 91709t + 21 What is the i'th term of 798, 3193, 7182, 12765? 797i2 + 4i - 3 What is the v'th term of 394, 847, 1362, 1939, 2578, 3279? 31v2 + 360v + 3 What is the h'th term of -386, -372, -356, -338, -318? h*2 + 11h - 398 What is the o'th term of 197053, 394105, 591157, 788209? 197052o + 1 What is the o'th term of 28343, 56687, 85029, 113369, 141707? -o2 + 28347o - 3 What is the u'th term of 801, 807, 817, 831, 849, 871, 897? 2u2 + 799 What is the r'th term of 20248, 20211, 20172, 20131, 20088, 20043, 19996? -r2 - 34r + 20283 What is the d'th term of -232, -951, -2154, -3847, -6036, -8727, -11926? -d*3 - 236d*2 - 4d + 9 What is the k'th term of 1132813, 1132808, 1132803? -5k + 1132818 What is the q'th term of -390, -806, -1222, -1638? -416q + 26 What is the b'th term of 9778, 9775, 9772, 9769? -3b + 9781 What is the a'th term of 253987, 507974, 761961, 1015948? 253987a What is the j'th term of 59, 33, -33, -157, -357? -3j3 - 2j*2 + j + 63 What is the h'th term of 474, -485, -3078, -8121, -16430, -28821? -136h3 - h2 - 4h + 615 What is the j'th term of -106, 61, 256, 485, 754, 1069, 1436? j3 + 8j*2 + 136j - 251 What is the y'th term of -42034, -42035, -42036? -y - 42033 What is the b'th term of 5740, 5763, 5814, 5905, 6048, 6255, 6538, 6909? 2b3 + 2b*2 + 3b + 5733 What is the c'th term of 1080, 1045, 980, 885, 760, 605, 420? -15c2 + 10c + 1085 What is the u'th term of 8780, 17602, 26424, 35246? 8822u - 42 What is the d'th term of 360148, 720288, 1080430, 1440574, 1800720, 2160868? d2 + 360137d + 10 What is the d'th term of 981, 810, 675, 594, 585? 3d3 - 192d + 1170 What is the k'th term of -252, -447, -578, -633, -600, -467, -222? 2k3 + 20k*2 - 269k - 5 What is the g'th term of 104, 191, 272, 341, 392, 419? -g*3 + 3g*2 + 85g + 17 What is the o'th term of -3681, -3660, -3639, -3618, -3597, -3576? 21o - 3702 What is the u'th term of 2583, 5095, 7591, 10065, 12511, 14923, 17295, 19621? -u3 - 2u*2 + 2525u + 61 What is the f'th term of -527, -582, -673, -800, -963? -18f2 - f - 508 What is the z'th term of -837, -783, -729? 54z - 891 What is the u'th term of 538, 287, -140, -749, -1546, -2537, -3728, -5125? -u*3 - 82u*2 + 2u + 619 What is the a'th term of -48342, -96685, -145022, -193353? 3a2 - 48352a + 7 What is the z'th term of -231, -312, -393, -474, -555, -636? -81z - 150 What is the d'th term of 1677, 1686, 1707, 1746, 1809, 1902, 2031? d3 + 2d + 1674 What is the d'th term of -13, -49, -83, -115, -145, -173? d*2 - 39d + 25 What is the c'th term of -340, -1462, -3346, -5998, -9424, -13630, -18622, -24406? -c*3 - 375c*2 + 10c + 26 What is the h'th term of -1983, -7901, -17759, -31557, -49295, -70973? -1970h2 - 8h - 5 What is the l'th term of -388, -1478, -3296, -5842? -364l2 + 2l - 26 What is the d'th term of 25, 18, -39, -152, -327? -d*3 - 19d*2 + 57d - 12 What is the u'th term of -2521, -2413, -2103, -1489, -469? 17u3 - u2 - 8u - 2529 What is the p'th term of -284, -585, -874, -1145, -1392, -1609? p*3 - 308p + 23 What is the j'th term of -214, -422, -630, -838, -1046, -1254? -208j - 6 What is the m'th term of -56807, -113613, -170419, -227225? -56806m - 1 What is the y'th term of 102942, 205855, 308732, 411555, 514306, 616967? -3y3 + 102934y + 11 What is the z'th term of -97056, -97053, -97050? 3z - 97059 What is the n'th term of 47, 73, 77, 53, -5, -103, -247? -n3 - 5n*2 + 48n + 5 What is the n'th term of 9935, 19831, 29727? 9896n + 39 What is the j'th term of -4897, -5119, -5341, -5563? -222j - 4675 What is the v'th term of -186, -374, -564, -756, -950? -v*2 - 185v What is the o'th term of -2793, -2746, -2625, -2394, -2017? 6o3 + o2 + 2o - 2802 What is the p'th term of -25634, -51247, -76860, -102473, -128086, -153699? -25613p - 21 What is the o'th term of -1161172, -2322348, -3483528, -4644712, -5805900, -6967092? -2o*2 - 1161170o What is the h'th term of 13304, 106420, 359162, 851342, 1662772, 2873264, 4562630, 6810682? 13302h3 + h2 - h + 2 What is the b'th term of -421, -524, -651, -814, -1025, -1296, -1639? -2b*3 - 89b - 330 What is the h'th term of -31860, -127552, -287070, -510408, -797560, -1148520, -1563282? h*3 - 31919h*2 + 58h What is the n'th term of -1417, -1429, -1441? -12n - 1405 What is the x'th term of 10631, 21020, 31409, 41798, 52187? 10389x + 242 What is the r'th term of 131496, 131494, 131492, 131490, 131488, 131486? -2r + 131498 What is the g'th term of 1, -88, -201, -350, -547, -804, -1133, -1546? -2g*3 - 75g + 78 What is the l'th term of -535, -1066, -1591, -2110, -2623, -3130, -3631? 3l2 - 540l + 2 What is the c'th term of -63, -99, -165, -267, -411, -603, -849? -c*3 - 9c*2 - 2c - 51 What is the q'th term of 626, 731, 1014, 1565, 2474, 3831, 5726? 15q3 - q2 + 3q + 609 What is the r'th term of -4335, -8656, -12977? -4321r - 14 What is the k'th term of -1704, -3373, -5040, -6705, -8368, -10029, -11688? k2 - 1672k - 33 What is the p'th term of 443, 1614, 3541, 6224? 378p2 + 37p + 28 What is the r'th term of -12418, -24832, -37244, -49654, -62062? r*2 - 12417r - 2 What is the k'th term of -94, -97, 78, 521, 1322, 2571? 15k3 - k2 - 105k - 3 What is the n'th term of -53, -120, -191, -272, -369, -488, -635, -816? -n*3 + 4n*2 - 72n + 16 What is the l'th term of -128179, -128183, -128189, -128197, -128207, -128219? -l*2 - l - 128177 What is the r'th term of -14876, -29751, -44626, -59501? -14875r - 1 What is the l'th term of -1, -12, -9, 32, 135? 4l3 - 17l*2 + 12l What is the v'th term of -375, -597, -865, -1203, -1635? -4v3 + v2 - 197v - 175 What is the p'th term of -2238, -2269, -2296, -2319? 2p2 - 37p - 2203 What is the o'th term of 242, 484, 700, 878, 1006, 1072, 1064? -2o3 - o2 + 259o - 14 What is the f'th term of 33304, 66588, 99838, 133048, 166212, 199324, 232378, 265368? -f*3 - 11f*2 + 33324f - 8 What is the l'th term of -78, -289, -624, -1095, -1714, -2493, -3444? -2l3 - 50l*2 - 47l + 21 What is the q'th term of -11602, -11591, -11556, -11485, -11366, -11187? 2q3 - 3q - 11601 What is the a'th term of 14180, 14142, 14106, 14072, 14040, 14010, 13982? a*2 - 41a + 14220 What is the g'th term of -1664, -1635, -1532, -1319, -960? 6g3 + g2 - 16g - 1655 What is the m'th term of 24387, 24381, 24371, 24357, 24339, 24317? -2m2 + 24389 What is the a'th term of 417, 777, 1143, 1515, 1893, 2277? 3a*2 + 351a + 63 What is the k'th term of 135, 206, 325, 492, 707? 24k2 - k + 112 What is the p'th term of -32417, -32423, -32429, -32435? -6p - 32411 What is the i'th term of -3049, -5825, -8601, -11377? -2776i - 273 What is the q'th term of -46, -59, -58, -43, -14, 29, 86? 7q*2 - 34q - 19 What is the t'th term of -53, -73, -105, -149, -205, -273, -353? -6t2 - 2t - 45 What is the c'th term of -5142, -10	{ "pile_set_name": "DM Mathematics" }
be (-24)/(-14) - (-3)/(s/(-6)). Determine t(h). -9 Let f(m) = -3m3 - 8m*2 + 7m - 2. Let a(p) = p*3 - p. Let y(k) = -4a(k) - f(k). Determine y(8). -22 Let o(x) be the first derivative of -1/2x2 + 2x + 2x3 - 1/4x*4 - 3. Suppose -a + 14 = 3n - 0a, 3n = -2a + 10. Determine o(n). -4 Let v(j) = -9j*2 - 8j*2 + 4j - 6 - 3j2 + 30j*2 - 9j*2. Give v(-5). -1 Let x(s) = -16s + 26. Let b(h) = -24h + 42. Let y(o) = 5b(o) - 8x(o). Give y(-1). -6 Let q(f) = 2f - 26. Suppose o - 123 = -117. Let w(a) = -a + 12. Let b(z) = oq(z) + 13w(z). Suppose 5s + 4 = s. What is b(s)? 1 Let w(a) = -8a + 8. Let p = 0 - 14. Let s(x) be the second derivative of x*3/2 - 3x*2/2 + x. Let l(i) = ps(i) - 5w(i). What is l(-3)? 8 Let s(z) = -z2 - z - 10. Suppose 0 = o + 18 - 18. What is s(o)? -10 Suppose 5l - 3 = 4l. Let y(t) = 6t*3 - 2t*2 - 7t - 4. Let g(q) = -q*3 + q + 1. Let b(k) = 5g(k) + y(k). Give b(l). 4 Let y(r) = 6r - 1. Suppose -3 = 13n - 16. Determine y(n). 5 Suppose 16c - 34c = 72. Let h(z) = -z*2 - 2z + 5. Determine h(c). -3 Let q(m) = -m2. Let u(r) = -r2 + 3r - 2. Let v be u(3). Let o(z) = 2z + 3. Let f(a) = vq(a) + o(a). What is f(-2)? 7 Let c(l) be the first derivative of l4/4 - 2l*3 - 3l*2 - 10l - 1. Suppose -4k + 0k = -40. Suppose 5f + 5x + k = 65, 4x - 30 = -2f. Calculate c(f). -3 Let z(v) = 7v3 + 11v*2 + 2v + 11. Let k(f) = 16f3 + 23f*2 + 4f + 23. Let p(a) = 3k(a) - 7z(a). Give p(-8). 8 Suppose -15f - 27 = 48. Let p(j) = j3 + 6j*2 + 3j - 3. Give p(f). 7 Let b(n) be the first derivative of 1/4n4 - 1/2n*2 + 13 - 2n*3 + 8n. What is b(6)? 2 Let u = 14 - -23. Let y(l) = -52l2 + 1 + 101l*2 - ul2 - l. Let p(i) = -i - 4. Let z be p(-5). What is y(z)? 12 Let y(q) = -q3 + 8q2 - 13q. Let w be (-7)/(-7)5 + (-3)/(-3). Calculate y(w). -6 Let j(h) be the first derivative of -h2/2 - 14h + 156. Calculate j(-12). -2 Let i be 18/3(-10)/(-15). Let l(b) = 5b*3 - 5b2 - 8. Let n(m) = m3 - m - 1. Let s(z) = l(z) - 4n(z). What is s(i)? -4 Let z(s) = s3 + 4s*2 + 3s + 2. Let v = 1 - -2. Let n be 3-1 - (-3 + v). Let j be z(n). Let x(a) = 2a*2 + 2a - 2. Calculate x(j). 10 Suppose 0 = 134d - 120d - 112. Let h(m) = -5m + 19. What is h(d)? -21 Suppose 0 = 2r + 2g - 3 - 1, 3r - 14 = g. Let o(z) be the third derivative of -1/3z3 + 0z + 1/24z4 - 2z2 + 0. What is o(r)? 2 Let j(a) be the first derivative of -a4/4 + a3/3 + a2/2 - a + 291. Suppose 3m = 2m. Determine j(m). -1 Let j(w) = 8w2 + 46 - 329w - 2w2 + 312w - 5w2. Calculate j(14). 4 Let g(o) = o3 - 3o*2 + 3o - 4. Let x(z) = -2z3 - z2 + z - 1. Let u(h) = g(h) + x(h). Give u(-5). 0 Let l = 76 + -48. Let o = l - 23. Let s(z) = z2 - 5z + 2. Let p(x) = -x*2 + 6x - 3. Let a(c) = 3p(c) + 2s(c). Determine a(o). 10 Let q = -26 - -46. Let t = q - 18. Let u(y) = 5 + 5yt - 6 - y - 1 - 2y2. Determine u(-2). 12 Let i(h) = h3 + 5h2 + 2h + 10. Let t be i(-5). Let o(q) = q3 + q2. Give o(t). 0 Let a(z) = 4z + 29. Let k be a(-8). Let i(l) = -l3 + 4l - 4. Let n(d) = d*2 + d - 1. Let u(y) = i(y) - 4n(y). Determine u(k). -9 Suppose -78y + 66 = -56y. Let n(z) be the third derivative of 0 + 0z + 1/120z*6 + 1/24z*4 + 7z*2 - 1/6z*y - 1/15z5. Determine n(4). 3 Let o(x) be the first derivative of -x2 - 2x - 48. Suppose h = -4s - 0 + 3, -8 = 2h + s. Let l = 2 + h. Determine o(l). 4 Let y(q) be the third derivative of 1/8q*4 + 0 + 1/60q*5 + 0q - 5/6q3 + 4q2. Let d = 13 + -18. Give y(d). 5 Let s(o) be the third derivative of -o8/20160 + o7/5040 - o6/360 - 13o5/60 - 13o*2. Let b(r) be the third derivative of s(r). What is b(2)? -4 Let x(k) = -k - 2. Let n be (33)/(18/(-12)). Let r be 0/1 + n/(-2). Let q(s) = -s*3 + 2s*2 + 2s - 3. Let l be q(r). What is x(l)? 4 Let i(x) = x*3 - 12x*2 + 21x - 17. Let q be i(10). Let m(r) = -r + 4. Give m(q). 11 Let b(m) = m*3 - 3m*2 - 4. Suppose -7t + 2t + n + 13 = 0, 4 = -2t + 5n. What is b(t)? -4 Suppose 4l = -4f - 16, 0 = -5f - 0f - l - 4. Let u(g) = -g3 - g2 + g + 11. What is u(f)? 11 Let z(i) = -i + 7. Let g be z(-12). Suppose c - t = 2c + 2, -3c + 2t = -g. Suppose -cb - 8 = 1. Let u(d) = d3 + 3d*2 - 2d - 2. What is u(b)? 4 Let q = -5 - -4. Let h be (2 - q) + -6 + 26. Let c(y) = 2y2 + y2 + 21 - h + 2y. Determine c(-2). 6 Let v(d) = -2d + 8. Let l(p) = 3p - 16. Let g(q) = -3l(q) - 5v(q). Let a(u) = -u*3 - 9u*2 + 10u. Let r be a(-10). Suppose rb = 2b. Give g(b). 8 Let q(u) = -4u2 + 3u - 30u3 - 2u - 2u + 31u*3 - 4 - 5u. Let j = 8 + -3. Determine q(j). -9 Let y(g) = g*3 - 9g + 13g2 - 1 + 23g*2 - 49g*2 + 11g*2. Determine y(4). -5 Let q(i) = -2i - 2. Suppose 2c + 3c + 2u + 114 = 0, 3c = -5u - 76. Let w(x) = x2 + 25x + 63. Let m be w(c). Determine q(m). 4 Let x(n) be the first derivative of n3/3 + n2 - 14n + 13. Let j(t) = -2t*2 - 3t + 29. Let h(r) = 4j(r) + 9x(r). Determine h(-8). 6 Let c(j) = 2j + 0j + 10 - 3. Let f(a) = -a - 4. Let d(p) = 4c(p) + 7f(p). Suppose 14m = -134 + 50. What is d(m)? -6 Let f be ((-3)/2)/(-1 + (-5)/(-8)). Let j be 26/f + 0/(-2). Let n(i) = i*2 + i + 2. What is n(j)? 14 Let h = -48 + 54. Let d(v) = 4 - 5 - hv + v + 0. Give d(1). -6 Let t(v) be the third derivative of -v*4/24 + 2v*3 + 8v*2 + 10v. What is t(15)? -3 Let h(m) = m*3 + 6m*2 - 2m - 9. Let c be h(-6). Let g(n) = -7n2 - 2n3 + n3 + 2nc + 1. Suppose 35b = 34b + 7. Determine g(b). 1 Let v(b) be the third derivative of -b5/60 - b4/24 + b3/6 - 76b*2. Determine v(-3). -5 Suppose -5x + 33 = 3k - 0x, -5k - 4x = -42. Let s(r) = 3r - 22 + 21 + kr. Calculate s(1). 8 Let t be (-9)/18 + (-6)/(-4). Let w(h) = 0h + 0h + t - 9 + 4h. Calculate w(6). 16 Let m(b) be the second derivative of 1/6b*3 - 3b*2 + 23b + 0. What is m(-7)? -13 Suppose 18n = 21n - 3. Let l(g) be the second derivative of -2g5/15 - g3/6 + g2 + 3g. Let f(w) be the first derivative of l(w). What is f(n)? -9 Let c be 1 + 12/(-3) - -1. Let x = 0 + c. Let n(v) = 3v + v2 - v + 2 + 0v*2. Determine n(x). 2 Let w be (2/(-6))/((-1)/9). Let j = w + -7. Let n(u) = 7u*2 + 9u + 12. Let g(b) = -11b2 - 13b - 18. Let v(r) = 5g(r) + 8n(r). Determine v(j). -6 Let y(i) be the first derivative of 22i3/3 - i2/2 + 42. Calculate y(1). 21 Let m(d) be the first derivative of d7/840 + d6/72 - 5d*4/24 + 2d*3/3 + 29. Let v(g) be the third derivative of m(g). What is v(-5)? -5 Let r(j) = 3j + 11. Let u = -286 + 278. What is r(u)? -13 Let z be 36/27 + (-4)/6. Let o(g) = g - 12. Determine o(z). -12 Let n(k) = 4k*2 + 3k. Let f = 4 - 2. Let x(y) = 8yf - 1 + 7y + y*2 + 4 - 2. Let v(d) = -7n(d) + 3x(d). Determine v(3). -6 Let h(y) = -5y + 2. Let t(u) = -14u + 6. Let z(c) = -11h(c) + 4t(c). Suppose -r + 3m - 11 = 0, 20r = 16r + 3m + 1. Determine z(r). -2 Let p(b) = -2b + 1. Suppose s - 8 = 2q, -2q + 4 = 5s + 24. Let k be 6(20/(-6))/q. Suppose -k = -5t + 1. Calculate p(t). -1 Let t be 1(-2 + 5) - -1. Suppose -4h - 32 = -7h + 4v, 4h = -tv - 4. Let i(x) be the third derivative of x4/24 - x3/6 - 2x2 + 12. Give i(h). 3 Let j(o) = o3 + 4o2 + 2o + 6. Suppose 8w + 342 = 302. What is j(w)? -29 Let t(l) be the first derivative of l4 + 2l3/3 - l2/2 - 304. Let w(b) = -b*3 - 2b*2 + 5b + 4. Let u be w(-3). Determine t(u). -22 Let v(p) = -2p2 + 3p + 1. Let r(l) = l*2 - 5l + 8. Let f be r(4). Calculate v(f). -19 Let r(f) be the third derivative of f6/120 + f5/10 - 5f4/8 + 2f*3/3 - 33f*2. What is r(-8)? -4 Let q(b) = 6b*2 - 10b + 7. Let c(a) = -7a2 + 10a - 7. Let k(h) = 5c(h) + 6q(h). Let m(d) = -d*2 + 6d + 1. Let j be m(5). Calculate k(j). -17 Let r = -507 - -510. Let o(h) = h*3 - 3h*2 - 4h + 3. Calculate o(r). -9 Let o(y) = -y*3 - 10y*2 - 22y - 2. Let h be o(-7). Let a(z) = z*3 - 5z*2 - 3z + 11. Give a(h). -4 Let v(k) be the first derivative of k*5/120 + 5k*4/24 + 7k3 - 39. Let u(j) be the third derivative of v(j). Give u(-8). -3 Let w(s) be the second derivative of -s7/840 + 7s6/360 - s5/20 - s4/6 - 11s**3/3 +	{ "pile_set_name": "DM Mathematics" }
lacement from {p: 2, s: 2, y: 1, k: 1, a: 8}. 4/91 Calculate prob of picking 2 t, 1 n, and 1 s when four letters picked without replacement from nstuntussussuttvust. 10/323 Two letters picked without replacement from {b: 10, s: 6, i: 2}. Give prob of picking 1 b and 1 s. 20/51 What is prob of picking 3 a and 1 c when four letters picked without replacement from ucaaccaaazacaaucz? 2/17 What is prob of picking 1 t and 1 i when two letters picked without replacement from {i: 5, t: 13}? 65/153 Two letters picked without replacement from hhawjwxp. What is prob of picking 1 w and 1 a? 1/14 Two letters picked without replacement from {s: 1, y: 4, p: 2, k: 1, j: 3}. Give prob of picking 2 y. 6/55 What is prob of picking 4 i when four letters picked without replacement from iiiiiiiziiizzii? 33/91 Two letters picked without replacement from hwwhgghwgwh. Give prob of picking 2 g. 3/55 Calculate prob of picking 1 a, 1 g, 1 w, and 1 h when four letters picked without replacement from {w: 1, x: 1, h: 1, g: 1, a: 1}. 1/5 Two letters picked without replacement from {a: 7, m: 3}. What is prob of picking 2 m? 1/15 Four letters picked without replacement from bthtbbbhhwbt. Give prob of picking 1 w and 3 t. 1/495 Two letters picked without replacement from ceeeellccclceceeec. What is prob of picking 2 e? 28/153 Two letters picked without replacement from zzmmammmammadmmdmmc. What is prob of picking 1 z and 1 d? 4/171 Two letters picked without replacement from zpzrzhzhphzr. What is prob of picking 1 r and 1 p? 2/33 What is prob of picking 3 g when three letters picked without replacement from {g: 3}? 1 Four letters picked without replacement from arrebnaabnza. Give prob of picking 2 r, 1 n, and 1 z. 2/495 What is prob of picking 2 o when two letters picked without replacement from hhxofhfocdf? 1/55 Two letters picked without replacement from {n: 1, h: 1, b: 2, t: 2, f: 1, c: 1}. What is prob of picking 1 n and 1 f? 1/28 Calculate prob of picking 2 p and 1 g when three letters picked without replacement from {z: 7, g: 1, s: 2, p: 2}. 1/220 Three letters picked without replacement from {p: 4}. Give prob of picking 3 p. 1 What is prob of picking 2 b and 2 j when four letters picked without replacement from zjpwbbij? 1/70 Two letters picked without replacement from twtwtttttt. Give prob of picking 1 w and 1 t. 16/45 Calculate prob of picking 4 r when four letters picked without replacement from {u: 4, a: 1, r: 6, q: 3, z: 1, p: 4}. 5/1292 What is prob of picking 2 l when two letters picked without replacement from {p: 3, l: 4, t: 2}? 1/6 Two letters picked without replacement from {z: 1, q: 4, s: 2, u: 5, h: 2}. What is prob of picking 1 u and 1 s? 10/91 Calculate prob of picking 4 f when four letters picked without replacement from ffmcmccmcmfmmffffmc. 35/3876 Four letters picked without replacement from {f: 1, z: 7}. What is prob of picking 4 z? 1/2 What is prob of picking 1 d and 2 t when three letters picked without replacement from {t: 4, s: 1, d: 3}? 9/28 Three letters picked without replacement from ttctccttctttcctc. What is prob of picking 2 t and 1 c? 9/20 Three letters picked without replacement from {z: 2, f: 9}. Give prob of picking 2 f and 1 z. 24/55 What is prob of picking 2 p and 1 g when three letters picked without replacement from {p: 4, g: 6, s: 6, h: 2}? 3/68 Two letters picked without replacement from nzlulzw. Give prob of picking 1 u and 1 n. 1/21 Two letters picked without replacement from {j: 5, c: 2, s: 9}. What is prob of picking 2 c? 1/120 Calculate prob of picking 3 m when three letters picked without replacement from {m: 8, a: 5}. 28/143 Calculate prob of picking 1 t and 1 o when two letters picked without replacement from egooegoyygyggyygyt. 1/51 Calculate prob of picking 2 k when two letters picked without replacement from ffffkfk. 1/21 Calculate prob of picking 1 w and 3 g when four letters picked without replacement from dndgdndggqqdnnddw. 1/2380 What is prob of picking 2 g when two letters picked without replacement from ggaaaaagag? 2/15 Calculate prob of picking 1 i and 2 c when three letters picked without replacement from {e: 8, i: 2, c: 2}. 1/110 Calculate prob of picking 1 u and 1 l when two letters picked without replacement from lloudlldmdll. 1/11 Two letters picked without replacement from {k: 1, q: 8, d: 4}. Give prob of picking 1 q and 1 d. 16/39 Two letters picked without replacement from {g: 4, f: 6, s: 4, q: 1}. What is prob of picking 1 s and 1 f? 8/35 Calculate prob of picking 1 k and 1 z when two letters picked without replacement from {k: 1, n: 1, a: 1, z: 1, l: 1}. 1/10 Three letters picked without replacement from mmigjigimgmimimiii. Give prob of picking 1 i and 2 m. 5/34 Calculate prob of picking 2 e and 1 r when three letters picked without replacement from {r: 1, e: 2, t: 1, k: 1, x: 1, b: 1}. 1/35 Four letters picked without replacement from {k: 2, d: 9, f: 2}. What is prob of picking 2 k and 2 d? 36/715 Three letters picked without replacement from {w: 1, p: 4, n: 4, v: 2, i: 3}. Give prob of picking 2 p and 1 w. 3/182 Three letters picked without replacement from {k: 1, n: 1, x: 2, f: 2}. Give prob of picking 1 k, 1 f, and 1 x. 1/5 Two letters picked without replacement from {k: 2, u: 9, b: 1, h: 1}. What is prob of picking 1 k and 1 h? 1/39 What is prob of picking 1 h, 1 l, and 1 w when three letters picked without replacement from {g: 1, h: 1, u: 1, k: 1, w: 2, l: 1}? 2/35 What is prob of picking 1 z and 1 t when two letters picked without replacement from mmtz? 1/6 Calculate prob of picking 2 a when two letters picked without replacement from {l: 15, a: 3}. 1/51 Two letters picked without replacement from bbbxbnbbxxbnbbbbxbx. What is prob of picking 2 b? 22/57 What is prob of picking 2 n and 1 p when three letters picked without replacement from {k: 1, m: 5, p: 4, n: 3}? 6/143 Four letters picked without replacement from {j: 7, y: 6}. What is prob of picking 2 y and 2 j? 63/143 Two letters picked without replacement from {h: 6, e: 5, g: 1, m: 3, l: 1, p: 1}. What is prob of picking 1 g and 1 e? 5/136 What is prob of picking 4 f when four letters picked without replacement from ffffffffffffrfffrff? 35/57 Calculate prob of picking 1 c and 1 k when two letters picked without replacement from ykyyyyyyykcyyky. 1/35 What is prob of picking 1 r, 1 h, and 1 e when three letters picked without replacement from npheuerennnpeee? 6/455 What is prob of picking 2 j when two letters picked without replacement from jjjdjjjdjjjddj? 45/91 Calculate prob of picking 2 j and 1 z when three letters picked without replacement from {j: 1, r: 1, z: 1}. 0 What is prob of picking 1 z and 2 b when three letters picked without replacement from zzbzzzb? 1/7 What is prob of picking 1 a, 2 s, and 1 c when four letters picked without replacement from {a: 1, n: 1, c: 4, t: 2, s: 3}? 2/55 What is prob of picking 1 r, 1 j, and 1 b when three letters picked without replacement from bbitbiijttrbljribb? 1/34 Three letters picked without replacement from bhhhhb. Give prob of picking 1 h and 2 b. 1/5 Two letters picked without replacement from qzzqzrzzq. What is prob of picking 2 z? 5/18 What is prob of picking 2 q and 2 x when four letters picked without replacement from xqxqq? 3/5 Calculate prob of picking 1 a and 1 z when two letters picked without replacement from {a: 4, z: 5, b: 1, p: 4, y: 5}. 20/171 What is prob of picking 1 x, 1 w, and 1 m when three letters picked without replacement from mxxxxxwxe? 1/14 Calculate prob of picking 1 c, 2 l, and 1 y when four letters picked without replacement from {l: 4, g: 1, c: 1, y: 5}. 1/11 Calculate prob of picking 2 z when two letters picked without replacement from {v: 1, d: 1, u: 1, z: 6}. 5/12 Calculate prob of picking 1 e and 1 q when two letters picked without replacement from qdqqqzdzedwddzzz. 1/30 Two letters picked without replacement from ddiinndinii. Give prob of picking 2 i. 2/11 Two letters picked without replacement from {v: 6, c: 2, z: 1, q: 2, d: 7}. What is prob of picking 2 c? 1/153 Two letters picked without replacement from {o: 2, t: 1, k: 12, l: 1, q: 1}. What is prob of picking 2 k? 33/68 Four letters picked without replacement from fffmfffffmfffffffm. Give prob of picking	{ "pile_set_name": "DM Mathematics" }
a factor of h? True Suppose -4r + 2j = -47334, 3734 = r + 2j - 8112. Is 22 a factor of r? True Let y(g) = -g2 + 14g + 4. Let z be ((-20)/3 - -2)/(8/(-24)). Let x be y(z). Suppose 3l = xl - 85. Is 17 a factor of l? True Let i be (5 + -6)/((-3)/687 + 0). Suppose -r = 3t - 1777, -2t + 5r + i = -950. Suppose -6u - 160 + t = 0. Is 7 a factor of u? False Let x(o) = -o*3 - 4o*2 + 8o - 67. Is 52 a factor of x(-15)? True Let b(o) = -18o + 64. Let h be b(7). Let y = h - -158. Does 8 divide y? True Suppose 3z - 5a = 92 + 17509, z - 4a = 5867. Is z a multiple of 14? False Is 81 a factor of (-65)/15 - (-4841800)/129? False Let p(g) = 4g2 + 2g + 1. Let x be p(-1). Suppose 4z = xy - 6y + 191, -4y + 243 = 3z. Is y a multiple of 3? True Does 11 divide (85/10)/(((-14)/(-792))/7)? True Suppose -5v - 3590 = 3i - 14819, -5v - i = -11223. Is v a multiple of 22? True Let r be ((-4)/6)/((-3)/((-27)/6)). Let o(u) = 3u3 + u2 - 2u - 3. Let n be o(r). Is 2 + n - ((-15)/(-3) - 23) a multiple of 5? False Is (352 - (3 - -1))/((-66)/(-165)) a multiple of 30? True Suppose -74b + 75446 = -43694. Is b a multiple of 11? False Suppose 3x + 12069 = 4n, -16x + 20x - 15094 = -5n. Does 8 divide n? False Let q = 84 - 82. Suppose qu = -2a + 28, -2a = -u - u - 12. Suppose 15d = ad + 110. Is d a multiple of 22? True Let u be 10/((-3)/(-17 - 7)). Let h = -3 + u. Does 7 divide h? True Suppose 7354 = 2k - 3h + 2303, -10067 = -4k - h. Does 7 divide k? False Suppose -12o = -40283 - 61405. Is 44 a factor of o? False Let y = 65 - 63. Suppose 5i - 79 = -yn, 4n + 2i = 4i + 98. Is n a multiple of 27? True Suppose 0k - 4k = 5h - 85, h = -3k + 6. Does 55 divide 11/(21/(-180)(-3)/h)? True Suppose 3n + 9w - 14w = 77517, 129195 = 5n + 2w. Does 9 divide n? True Suppose -8t + 81 = t. Suppose 200d = 197d + t. Suppose 0 = k - d, 3k + 4 = q - 12. Is 2 a factor of q? False Let a(v) = -464v + 869. Does 37 divide a(-26)? False Let d = 22 - 82. Suppose -5p + 4q = 2q + 187, -3q = 5p + 207. Let i = p - d. Is 8 a factor of i? False Let n(p) = -p*3 + 3p*2 + 10p + 4. Let j be n(5). Suppose -jq = m + 3m, 20 = 5m - 5q. Suppose -4t + 0t - 20 = -4d, md - t = 10. Is 5 a factor of d? True Let t = 3 - -58. Suppose 101 + t = 3n. Suppose v + n = 2q, 4q - q - 68 = -5v. Is 8 a factor of q? False Let h(w) = w*3 - 13w*2 - 5w - 8. Let i(r) = -6r2 - 2r - 4. Let v(y) = 2h(y) - 5i(y). Let q be (-3)/15(-30)/42. Is 47 a factor of v(q)? True Let t = 559 + -665. Let i = 151 + t. Is i a multiple of 15? True Let o = 13302 + -6134. Is o a multiple of 28? True Let n be (-50)/(-20)34. Does 32 divide (-2)/15 - 232/n-7? False Let j(b) = -4b - 43. Let x be j(-10). Does 2 divide -15((-4)/12 + x)? True Is 11 a factor of (-196)/147(((-645078)/(-8))/(-7) - 0)? False Let d(j) = -4j - 6. Let r be d(-2). Suppose -ry - 5x = -1060, -5y + 3222 - 603 = -3x. Does 21 divide y? True Let y be (2/10)/(16/80) - 3. Is 10 a factor of 2/(y + (-792)/(-393))? False Let v = 4946 - -3006. Is v a multiple of 71? True Is 41 a factor of 2/((-4)/(-6234)) - 12/(16 - 4)? True Suppose -85933 = -15r + j, -2j - 17189 = -3r - 3j. Is 18 a factor of r? False Let r(u) = u - 41. Let p be r(41). Suppose 0 = -c - 1 - p, 3c - 3237 = -2m. Is m a multiple of 15? True Let p(c) = c2 - 5c - 13. Let j be p(7). Let w be 0(54/60 - (-2)/(-5)). Is 15 a factor of 51/(j(w - (3 - 4)))? False Let x(u) = 6u2 + 12u - 690. Is x(30) a multiple of 10? True Let b be 5((-452)/5 - -2). Let h = -710 - -703. Is 8 a factor of b/h + (-2)/14? False Let i(q) be the second derivative of -q3/6 - 10q*2 - 20q. Let u be i(-12). Is (1/(-4)2)/(u/1872) a multiple of 13? True Let b(h) = -1214h - 1297. Does 12 divide b(-12)? False Let s(t) = -t*2 - 8t + 120. Let l be s(16). Let i = l - -359. Does 5 divide i? True Is 7 a factor of 1/(-6) + (-100798)/(-60) + 11/55? True Let h be (3/(-6))/(3 - 2)12. Is (596/h)/((-26)/117) a multiple of 46? False Suppose 23 - 72 = 4r + o, -5r = -o + 59. Let w(p) = -18 + 2p + p*2 - 5 + 0p. Does 10 divide w(r)? False Let f be -2223 - (-1)/(-3)-3. Does 27 divide -3 - -3 - 0 - f? False Let b(m) = -391m - 26. Let h(v) = -2351v - 156. Let p(q) = 13b(q) - 2h(q). Does 71 divide p(-1)? True Suppose 13484 = 68b - 108848. Is b a multiple of 30? False Suppose -1502738 = -365u + 1524937. Is u a multiple of 217? False Let l(w) = -w*2 - 5w - 2. Let t be l(-9). Let a = -5 + t. Let v = 115 + a. Does 12 divide v? True Is 33 a factor of (-162)/(-2511) + (-64447)/(-31)? True Let a(g) = 3 - 7g3 - 20g - 4g2 + 11g + 6g. Is a(-3) a multiple of 11? True Suppose 170y = 215y - 381375. Does 113 divide y? True Let s(t) = -t3 + 6t*2 - 5t + 2. Let d = 23 - 18. Let v be s(d). Suppose -3b = -3c + 198, -5b + vb + 257 = 4c. Is c a multiple of 13? True Let s(u) = -181u + 9. Suppose -4a = -2o + 2, -4a + 7 + 1 = -4o. Does 17 divide s(a)? False Let i(p) = p*2. Let w be i(0). Suppose 131 = 11l - 7l - 3x, w = 4l - 4x - 132. Is 4 a factor of l? True Let q = -162 + 188. Let l = 30 + q. Is l a multiple of 15? False Let o(b) = 44b3 + 3b*2 + 32b - 240. Does 19 divide o(12)? True Let q = -550 - -198. Let k = q + 411. Does 11 divide k? False Suppose -1 = -n, -2i + 5i + 4n - 28 = 0. Let w be 49 + -52 + 47 + -1. Suppose w = ib - 181. Is 7 a factor of b? True Suppose -5y + 45 = 4y. Suppose 3o - 46 = -2h - 2, o = -yh + 123. Does 3 divide h? False Suppose -43693 = -110s + 105s - 2513. Is s a multiple of 28? False Let h(x) = -x3 + 9x*2 + 20x - 25. Let d be h(10). Does 8 divide d/100 + ((-2658)/8)/(-1)? False Let d(x) = 22x2 + 95x - 1010. Is d(13) a multiple of 12? False Let z(s) = 4s2 + 19s - 136. Is z(9) a multiple of 15? False Let w be 17 + -9 - (22)/(-2). Let p(u) = 20u - 38. Let t be p(w). Let r = 12 + t. Is r a multiple of 29? True Let p be (10 + -16)/((-3)/2). Suppose pm - 2160 - 756 = a, m - 4a - 729 = 0. Does 43 divide m? False Let l(i) = i*3 + 27i*2 + 45i - 288. Does 17 divide l(-22)? False Suppose -d + 5s - 47760 = -6d, -7d - 4s + 66882 = 0. Does 6 divide d? True Does 12 divide ((4640/10)/8)/(2/309)? False Suppose 2n = 2u + 4n - 48, 3u - 2n - 77 = 0. Suppose -4p = -um + 22m - 453, 346 = 3p + 4m. Is p a multiple of 16? False Let y(m) = -m3 + m2 - 2m + 2. Let s be y(-3). Suppose 1118 = -i + s. Does 8 divide 3 - (4/(-14) + i/14)? True Let r be 23/((1 - -2) + 232/(-80)). Suppose -b + 3s = -349, 0 = b + s - r - 99. Is 24 a factor of b? False Let r = -12662 + 25272. Is 10 a factor of r? True Let x(f) = -33f + 70. Let q(y) = -67y + 140. Let r(c) = -2q(c) + 5x(c). Is r(-14) a multiple of 14? True Suppose 5y = t - 10776, -2t - 2y + 19152 + 2436 = 0. Is 11 a factor of t? True Is -5 + (19 + -12 - -21422) a multiple of 137? False Does 37 divide ((-8996)/8 + 10)(-208)/12? False Let u = -2502 - -7538. Is 19 a factor of u? False Let u(d) = 3d*2 + 11d + 27. Let a be (-3)/(21/(-440)) + (-2)/(-14). Let y = 54 - a. Is 19 a factor of u(y)? True Let y(f) = -49f + 6. Let h be y(-2). Is (-162)/12(-2 - h/6) a multiple of 3? True Let p = -9920 - -14396. Is 11 a factor of p? False Let m(u) be the first derivative of -7u2/2 - 20u + 2. Let t(k) = -14k - 39. Let n(v) = 5m(v) - 3t(v). Is n(8) a multiple of 22? False Let t = 1503 + 3863. Does 29 divide t? False Suppose -4t = -t + 195. Let r = -25 - t. Let m = 130 - r. Is m a multiple of 18? True Suppose -7v + 12 = -16. Is v/14 + (-8 - 2456/(-28)) a multiple of 10? True Let p(d) = -106d + 99. Let z be p(-16). Does 28 divide 5 + ((-3)/(-18) - z/(-30))? False Let f = 376 + 577. Let t = f - 595. Does 13 divide t? False Is 4/(32/10) - (5 + 24551/(-4)) a multiple of 22? False Let c(s) be the second derivative of -3s5/20 + s4 + 23s*3/6 - 5s*2/2 + 60s. Is 41 a factor of c(-5)? False Let c = 92 - 88. Suppose -ck + 828 = -2s, 5s = k + s - 200. Does 12 divide k? False Suppose -5z + 5i = 2i - 27, 3i - 21 = -3z. Let g = 6 - z. Suppose 4j - 398 + 146 = g. Is 7 a factor of j? True Let a(s) = -2s - 14. Suppose 0 = 6c + 47 - 5. Let z be a(c). Suppose z = -j + 4r + 24, -6r = -r. Is j even? True Suppose -34j = -55j - 40j + 218014. Does 3	{ "pile_set_name": "DM Mathematics" }
et w be -33(4/(-3))/(-2). Let k(y) = -y3 - 11y*2 - 11y. Determine wu(g) - 2k(g). 2g3 Let w be -3 - (9 + -1 - 1). Let f be (-4)/(-18) + (-25)/(-9). Let a(r) = -6r*2 - 10r + 6. Let p(b) = -2b2 - 3b + 2. Determine fa(k) + wp(k). 2k2 - 2 Let f(s) = 3s*2 - 1. Let c(l) = 7l*2 - l - 2. Calculate 2c(u) - 5f(u). -u2 - 2u + 1 Let z(u) = -1. Let k(y) = y - 1. Suppose -5i + 5s + 40 = 0, -4s - 3 = 5. Suppose 0 = 2x - in + 2n + 14, x + 3n - 18 = 0. Calculate xk(t) - 3z(t). 3t Let x(z) = -z - 1. Let g(d) = -1. Let b(n) = -n - 4. Let s(m) = -b(m) + 2g(m). Calculate 5s(o) + 7x(o). -2o + 3 Let o(c) = 9c2 + 4c + 2. Let j(u) = -10u2 - 5u - 1. Give -4j(y) - 5o(y). -5y2 - 6 Let w(z) = -z + 0z - z - 1. Let u(v) = 2v + 1. Suppose -86 = -17f - 1. Determine fu(l) + 4w(l). 2l + 1 Let d(a) = -14a*2 + 11a + 5. Let z = 5 - 0. Suppose -zy + 39 = -1. Let v(l) = -9l*2 + 7l + 3. What is yv(q) - 5d(q)? -2q2 + q - 1 Let t(h) = -5h - h + 2 + 0h + 7h. Let m(p) = -2p - 6. Give -3m(b) - 8t(b). -2b + 2 Let f(h) = -1. Let o(m) = -m + 2. Let b be -5(-1)/((-5)/(-2)). Let i be 16/12 + 12/(-6). Calculate bf(n) + io(n). -n Let c be 0 - (1 - (-3)/(-1)). Let k(y) = y*2 + 11y. Let h(t) = 2t. Determine ck(o) - 11h(o). 2o*2 Let h(k) = 12k*3 + 15k*2 - 15. Let m(a) = 3a*3 + 4a*2 - 4. Let l = -65 + 69. Calculate lh(i) - 15m(i). 3i*3 Let x(p) = -4p*3 - 3p*2 - 4p + 5. Let b = -16 - -12. Let w(i) = 0 - 1 - 3i3 + 5 - 2i*2 - 3i. What is bx(c) + 5w(c)? c*3 + 2c*2 + c Let g(a) = -5a3 + a2 + 5a. Let o(s) = -11s*3 + 2s*2 + 11s. Determine -7g(j) + 3o(j). 2j3 - j2 - 2j Let n(p) = p*3 + p - 4. Let k(m) = 2m*3 + 2m - 7. Calculate -4k(b) + 7n(b). -b*3 - b Let o(t) = t + 1. Let c = 2 + 0. Suppose 3w - 1 - c = 0. Let r(k) = k*3 + 4k + 6. What is wr(n) - 4o(n)? n*3 + 2 Let g(f) = -f - 1. Let d(l) = 2l + 34. Give -d(s) - 3g(s). s - 31 Let s(r) = -r2 + 2r + 1. Let z(h) = h*2 - 3h - 1. Let x = 6 + -6. Suppose x = 3g - 4g + 5. Determine gz(y) + 7s(y). -2y2 - y + 2 Let d(x) = 6x*3 - 7x*2 - 5x. Let p(h) = 11h3 - 13h*2 - 9h. Give 5d(f) - 3p(f). -3f3 + 4f*2 + 2f Let y(x) = -4x2 + x. Let t(r) = r3 + r2. Calculate 5t(n) + y(n). 5n3 + n2 + n Let p(a) be the third derivative of a6/120 - a5/60 + a4/6 - a3/2 - a2. Let k(u) = -3u*3 + 3u*2 - 11u + 8. Let b = 50 - 39. Give bp(m) + 4k(m). -m3 + m2 - 1 Let q(p) = -1. Let m(s) = -6s + 18. Let l(o) = m(o) + 12q(o). Let c(j) = -13j + 13. Give -4c(y) + 9l(y). -2y + 2 Let r = -6 + 2. Let i(l) = -6l3 + 3l. Let n(b) = -7b3 + 4b. What is ri(q) + 3n(q)? 3q3 Let z(r) = 3r - 3. Let i(q) = 3q - 4. Let f(y) = -5i(y) + 6z(y). Let t(u) = -8u + 9u - 6 + 15 + 12u. What is 9f(o) - 2t(o)? o Let c(r) = 2r2 - 2r + 1. Let v(j) = -2j2 + 2j - 1. Let b be 0 + 0 + -3 + (2 - 5). Determine bc(k) - 7v(k). 2k2 - 2k + 1 Let w(x) = -x + 3. Let p(a) = 1. Give -3p(g) + w(g). -g Let s(j) = 6j*2 + j + 2. Let z(f) = 19f*2 + 4f + 6. Calculate -7s(v) + 2z(v). -4v2 + v - 2 Let m(j) = -4j*3 + 16j*2 - 10j. Let s(l) = -l3 + l2 + 5l2 - 3l + 0l - l2. Determine 5m(p) - 16s(p). -4p*3 - 2p Let x = 64 + -65. Let i(b) = b*2 - 2b. Let f(n) = n3 + n2 - n - 1. Calculate xi(p) + f(p). p3 + p - 1 Suppose 4z = 2z - 12. Let l(d) = 4d*2 + d - 1. Let y(u) be the first derivative of 23u*3/3 + 3u*2 - 6u - 4. What is zy(g) + 34l(g)? -2g2 - 2g + 2 Let g(y) = -y*2 + 1. Let m(b) = 3b*3 + 5b*2 + 2. Give -3g(n) + m(n). 3n3 + 8n2 - 1 Let o(f) = -f2 - f - 1. Let h(n) = 3n2 + 5n + 34. Determine -h(b) - 5o(b). 2b*2 - 29 Let o be 3 + -6 + 1 - -3. Let w(c) = -1. Let b(t) = 2t + 3. What is ob(s) + 5w(s)? 2s - 2 Let z(f) be the second derivative of f5/20 - f4/6 + 3f*2/2 + 10f. Let j(m) = -3m2 + 4. What is 2j(h) - 3z(h)? -3h3 - 1 Let v(a) = a3 - 2a2 - 5a. Let m(s) = 6s3 - 10s*2 - 26s - 1. Give -2m(h) + 11v(h). -h*3 - 2h*2 - 3h + 2 Let c(s) = 5s3 + 9s*2 + 5s - 7. Let m be -3 + -2 + (1 - -1). Let y(n) = -2n3 - 4n*2 - 2n + 3. Calculate mc(k) - 7y(k). -k3 + k2 - k Let d(p) = 2p3 - p2 - 2p + 3. Let m(c) = c - 3c3 + 0c*3 - 2 + 2c3 + c2. Let r = -12 + 19. Let x = 11 - r. Give xd(b) + 6m(b). 2b3 + 2b*2 - 2b Let o(i) = -13i + 43. Let u(y) = 6y - 22. Calculate 4o(m) + 9u(m). 2m - 26 Let p(r) = 3r + 0r3 - 4r + 4r - 2r3. Let u(d) = -d3 + d. Calculate p(j) - 3u(j). j3 Let j(w) = 8w*2 - 5. Let c(i) = 9i*2 - 6. Let b = 9 - 4. Calculate bc(m) - 6j(m). -3m*2 Let o = -19 + 14. Let w(m) = 3m + 4. Let r(u) = -4u - 5. Calculate or(y) - 6w(y). 2y + 1 Let a(i) = -9i - 10. Let x(c) = 5c + 5. Calculate 3a(r) + 5x(r). -2r - 5 Let h(r) = -r + 1. Let w(z) = 2z*2 - 3z + 3. Determine 3h(j) - w(j). -2j*2 Let h(x) = -20x + 11. Let p(a) = 5a - 4. Let k(r) = -r. Let d(v) = 2k(v) - p(v). Let m be (-2)/(-4) - 21/(-6). Give mh(z) - 11d(z). -3z Let x(r) = -r. Let z = 41 + -42. Let g(b) = -2b + 1. Calculate zg(a) + x(a). a - 1 Let g(p) = -3p*2 - 2p. Let h(i) = -33i2 - 20i - 9. Let u(z) = -8z2 - 5z - 2. Let b(s) = -2h(s) + 9u(s). Determine -2b(w) + 5g(w). -3w2 Let z(b) = -b2 + 11b. Let u(x) be the second derivative of -x*3/6 - x. Let m be ((-245)/(-14))/512/21. Calculate mz(v) + 22u(v). -2v2 Let d(n) = 2n*2 + 2n + 7. Let z(v) = 2. Let a(k) = 1. Let b(g) = -11a(g) + 6z(g). Calculate 6b(q) - d(q). -2q*2 - 2q - 1 Let u(r) be the third derivative of -r5/60 + r4/12 - r*3 + 11r2. Let t(p) be the first derivative of p3/3 - p*2 + 5p - 2. Determine 6t(m) + 5u(m). m*2 - 2m Let y(l) = 26l3 + 6l*2 - 3l + 17. Let f be (-2)/3 + 16/(-3). Let a(v) = -9v3 - 2v*2 + v - 6. Calculate fy(s) - 17a(s). -3s*3 - 2s*2 + s Let z(p) = 2p*2 + 7p + 3. Let v(b) = -b*2 - 3b - 1. Let q(u) = -5v(u) - 2z(u). Let d(s) = -4s2 - 3s + 3. Determine -d(a) - 5q(a). -a2 - 2a + 2 Let f(s) = 3s - 1 + 0s - 4s. Let o be f(-7). Let p = -8 + o. Let r(x) = x2 + x. Let a(t) = -4t*2 - 2t. What is pr(g) - a(g)? 2g*2 Let l(q) = -1. Let b(p) = -p. Determine -4b(v) + l(v). 4v - 1 Let t(j) = -5j + 2. Let w(n) = -9n + 5. Let h = 33 + -28. Determine ht(r) - 3w(r). 2r - 5 Let c(i) = -11i3 - 3i - 7. Let o(v) = -5v3 - 2v - 3. Calculate -3c(b) + 7o(b). -2b3 - 5b Let a(p) = 20p2 - 3. Let g(v) be the first derivative of -7/3v*3 - 3 + v + 0v*2. Give -6a(s) - 17g(s). -s2 + 1 Let f(o) = 6o3 + o2 - 3o - 3. Let s(t) = -11t*3 - 2t*2 + 5t + 7. Give -5f(p) - 3s(p). 3p3 + p2 - 6 Let h(a) be the first derivative of a2 + a - 4. Let z(k) = -5k - 3. What is 8h(n) + 3z(n)? n - 1 Let c(u) be the third derivative of u6/30 - u5/30 + 5u4/24 - u3/2 + 2u2. Let j(q) = -q3 + q*2 - q + 1. What is c(s) + 3j(s)? s3 + s2 + 2s Let s(y) = -6y + 3. Let j = -19 - -25. Let q(l) = -7l + 3. What is js(z) - 5q(z)? -z + 3 Let o(a) = 7a*3 + 2a2 + 1. Let j(n) = -n3 - n*2 + 1. Calculate -2j(q) - o(q). -5q3 - 3 Let b(w) = 5w*2 + 2. Let l(z) = -66z*2 - 27. Let p(g) = -27b(g) - 2l(g). Let y(c) = -7c*2 - 1. Calculate 5p(m) - 2y(m). -m2 + 2 Let g(x) = x - 1. Let q = 12 + -15. Let b(z) = -4z + 2. What is qg(s) - b(s)? s + 1 Let k(t) = -8t*2 + 14t - 3. Let m(s) = -s*2 - 10s. Let d be m(-11). Let u(i) be the first derivative of -i*3 + 5i*2/2 - i + 2. Give du(q) + 4k(q). q2 + q - 1 Let k(v) = v + 2. Let c(n) = -n2 + 5n + 8. Suppose 0a - 9 = -a. Give ak(x) - 2c(x). 2x*2 - x + 2 Suppose o + 0 = -2. Let x = o + 0. Let d(k) = -2k - 3. Let j(a) = 8a + 13. Suppose -5q - 9 = -4q. Calculate qd(w) + xj(w). 2w + 1 Suppose 0 = 3s - 2s + 3k + 2, -4k - 4 = 0. Let g(i) = -8i. Let o(d) = -d. Calculate sg(c) - 5o(c). -3c Let b(g) = -g*2 - g - 1. Let a be (3 - 21/9)3. Let n(l) = -6l + al*2 + 20l + 3 - 11l. Suppose -3x + 24 = x. What is xb(y) + 2n(y)? -2y2 Let g(k) = -2k*3 + 5k*2 + 5k - 4. Suppose -8f + 0f = 8. Let z(x) = -x*2 - x + 1. What is fg(b) - 5z(b)? 2b*3 - 1 Let t(u) = -2 - 222u**2 - 2 + 21	{ "pile_set_name": "DM Mathematics" }
the first derivative of r(z). Give t(1). 5 Let r(c) = c*2 + 7c - 6. Let q(a) = -a*3 - 21a*2 + 22a + 10. Let v be q(-22). Suppose 5k + v = -30. Calculate r(k). 2 Let j(i) = -2i*3 + 2i*2 - 2i - 3. Let w(q) = 7q3 - 6q*2 + 6q + 8. Let v(k) = -11j(k) - 4w(k). Calculate v(1). -5 Let t(g) = g*3 + 3g*2 + 3g + 4. Let w(x) = -x*2 + 3x - 5. Let n = -31 - -33. Let i be w(n). What is t(i)? -5 Let a be 0(-2)/(-4 - -6). Let r(l) = 5l - 3 + 0 - 3l + a. Let u(g) = -g2 + 4g - 2. Let y be u(2). Determine r(y). 1 Let i(d) = -3d + 4. Let r = -1313 - -1304. Determine i(r). 31 Suppose 0z - 14 = -z. Let q be (19/38)/(1/z). Let n(v) = -qv + 8v - 2 + 1. Determine n(2). 1 Let y be 5 - -7 - (0 + 0). Let o = 14 - y. Let r(z) = 2z - 9z - 17z2 + 16z*o + 6. Give r(-8). -2 Let f(c) be the first derivative of -1/4c*4 + 4c - 4/3c3 + 4 + 0c*2. What is f(-3)? -5 Let h = 35 + -25. Suppose 0d - h = -5d. Suppose 0 = -do - 2o. Let x(g) = g2 - g + 11. Calculate x(o). 11 Let f = 0 + -3. Let b(c) = 2c*3 - 16c*2 + 4c - 16. Let o(s) = s*3 - 6s*2 + 2s - 7. Let l(p) = -3b(p) + 7o(p). Determine l(f). 20 Let r = 2 - 3. Let j(c) = 8c2 - 3c + 4. Let t(m) = -17m2 + 7m - 9. Suppose -5o + 12 = -o. Let v(k) = ot(k) + 7j(k). What is v(r)? 6 Let o(u) = -7u - 3. Let a(h) = 13 + 6h + 5h + 18h. Let l(f) = 2a(f) + 9o(f). Suppose 3n - m + 10 = -n, 5m = -10. Calculate l(n). 14 Let v = -4 + 5. Let p = 0 + v. Let s(m) = m2 - m + 2m*3 - 5m3 - m3 - m*3. Calculate s(p). -5 Let h(k) = k. Let f = -1375 + 1378. What is h(f)? 3 Let l(i) be the second derivative of -5i*3/6 + 9i*2/2 + 104i. Calculate l(0). 9 Let b(v) be the first derivative of v4/4 + v3 + v*2/2 - 3v - 14. Suppose 4 = -z + 1. Give b(z). -6 Let v be 1 - (-1 - 1 - -2). Let g be ((0/(-3))/v)/1. Let l(q) = -q - 4. What is l(g)? -4 Suppose 0 = 10d - 12 - 8. Let c(b) = -b2 + b + 1. Let l(w) = -6w*2 + 3w + 2. Let v(s) = dc(s) - l(s). What is v(1)? 3 Let d(i) = -i2 - 5i - 5. Let p be (-4)/14 - (-66)/(-14). What is d(p)? -5 Let n be (6/(-30)-5)/(3/(-42)). Let g(p) = -p2 - 14p + 9. What is g(n)? 9 Let w be -7 - (1/(-2))/((-11)/(-242)). Let f(u) = 5 + 5u2 - 6u - u*2 - 2u*2. Determine f(w). 13 Suppose 2l = 2z + 10, -3l - l + z + 14 = 0. Let h(b) = b - 3. What is h(l)? 0 Suppose 0 = 3c - 74 + 23. Suppose 0 = 5t + 2n - c - 6, 5n + 20 = 3t. Let a(j) = j2 - 7j + 5. What is a(t)? -5 Let y = -19 - -24. Suppose 4b - 45 = -3h, b - y - 9 = 2h. Let c(v) = 5 + bv + 12v - v2 - 19v. What is c(6)? -1 Let r(o) be the second derivative of o*3 - 16o*2 - 256o. Calculate r(5). -2 Let c(t) = 8t2 - 10t - 10. Let z(b) = -7b2 + 9b + 9. Let r(l) = -6c(l) - 7z(l). Let u(m) = 3 - 16 - 10 - 2m - 1. Let w be u(-14). What is r(w)? 1 Let v(t) = 3t3 - t2 + 1. Suppose 3k + 1 = 2k. Let q be v(k). Let d(x) be the first derivative of x3/3 + x2 - x + 61. Determine d(q). 2 Let z(i) be the second derivative of -i6/120 + i4/24 + i*2/2 + 3i. Let o(v) be the first derivative of z(v). Let l = 11 - 10. What is o(l)? 0 Let u(p) = -p*2 - 3p - 1. Suppose 3s - 8 - 7 = 0. Suppose h + 5 = -2d, 0h + s = -3d + h. What is u(d)? 1 Let y(s) = s*3 - 2s*2 + s. Suppose -15u = -19u + 4. Let v(w) = w + 2w + 4 - 3 - 4w + w2. Let o be v(u). What is y(o)? 0 Let z(m) = m - 2. Let l(w) = w - 1. Let x(s) = 5l(s) - 4z(s). Let k be x(-9). Let r(y) = y3 + 7y*2 + 7y + 4. What is r(k)? -2 Let l = 1379 + -1382. Let m(u) = u*2 - 3u - 8. Let v(b) = -b*2 + 3b + 7. Let q(t) = 5m(t) + 6v(t). What is q(l)? -16 Let t(j) = 16j + 9. Let m(l) = -l - 1. Let i(k) = m(k) - t(k). Let d(g) = 11g + 7. Let r(z) = 7d(z) + 5i(z). Determine r(1). -9 Let d(s) be the first derivative of 52 + s + 1/2s2 - 3/4s*4 + 0s3. Determine d(2). -21 Let k(i) be the second derivative of -i3/6 - i*2/2 - 395i. Suppose 0h - 4h + 65 = 5x, 5x = 5h - 25. Let u be h/(-45) - 104/18. Calculate k(u). 5 Let c(o) = 8o*2 + o - 1. Let t be (3/(-9))/(2/(-12)). Suppose -j + 28 = 3j + tb, -j = b - 9. Suppose -5z = -5q - 15, -5z = jq - 11 - 14. What is c(q)? 8 Let y = -28 - -30. Let i(n) = 4n - 1. Calculate i(y). 7 Let r(v) = 2v - 13. Let t(x) = x - 7. Let m(w) = -6r(w) + 11t(w). Let j be m(0). Let i(f) = -2f2 + 2815 + 2817 - 5633 + f3 + f. Give i(j). -1 Suppose v = -2 - 1. Let y(c) = 7c2 + 19c + 11. Let b(u) = 4u2 + 10u + 5. Suppose -75 = -20m + 5m. Let a(t) = mb(t) + vy(t). Give a(-6). -2 Let o(m) = -m*3 - 7m*2 - 7m. Suppose -3q = 3n - 8q + 33, -n - 12 = -2q. Determine o(n). 6 Let c = -2 - -8. Let v(q) = -q*2 + 3 - cq - 2q2 + 2q*2. Suppose 0 = u + 2 + 4. What is v(u)? 3 Let r be 1 - (1 + -2) - 0. Suppose 0 = -ra + 5 - 1. Let s(u) = 2u - 6 + a + 2u. Determine s(3). 8 Let r(u) = 7u3 + 5u. Let c(y) = -20y3 + y2 - 15y + 1. Let m(a) = -6c(a) - 17r(a). Give m(5). -6 Let b(v) = -v + 8. Let h = 55 + -35. Suppose -r + 7 = -4t - 9, 2r = -5t - h. What is b(r)? 8 Suppose 11 = 4m - 1. Suppose -6h - 15 = -mh. Let a(l) be the second derivative of l*4/12 + 2l*3/3 - 123l. Determine a(h). 5 Suppose 19x + 139 + 51 = 0. Let h(b) = 2b - 23. Let m(k) = k - 1. Let l(c) = h(c) - 4m(c). Let i be l(x). Let a(f) = 5f. Determine a(i). 5 Suppose -4q = 3i + i + 436, 2i - q + 230 = 0. Let r = i + 113. Let n(f) = f2 - f + 11. Calculate n(r). 11 Let l(k) be the second derivative of -k6/360 - k5/20 - 10k*3/3 + k + 16. Let s(f) be the second derivative of l(f). Suppose 0h = -2h - 14. What is s(h)? -7 Let i(f) = 10f*2 + 2f + 1. Suppose -2z = z + 5x + 103, -x = -z - 37. Let k = -37 - z. Calculate i(k). 9 Let k(y) = 14y + 10. Let t(w) = 13w + 9. Let z(v) = -2k(v) + 3t(v). Let b(n) = 5n + 4. Suppose -25 = 36u - 493. Let q(r) = ub(r) - 6z(r). Give q(6). 4 Let d(a) = -1065a - 2 + 2125a - 1065a. Determine d(3). -17 Let d(v) = -501 - 497 - 3v + 998 + 8v. Let q(p) = -p + 8. Let w be q(6). Let f be (-2)/1w/4. Calculate d(f). -5 Let q(i) = i*3 + 5i*2 + 4i + 2. Let p be (-12 - -7)(-2)/5. Let u be (-4 - -4)/(3 - p). Suppose u = -n - 5 + 3. What is q(n)? 6 Suppose 0 - 34 = 13p + 18. Let t(c) = 7c - 8. Let v(a) = a - 1. Let y(h) = -t(h) + 5v(h). Determine y(p). 11 Let q(d) = -9d + 46. Let k(t) = 8t - 34. Let i(w) = -4k(w) - 3q(w). Let p(n) = -3n. Let j be p(1). Determine i(j). 13 Suppose -28b + 26b - 4 = 0. Let p(c) = -2c*3 - 4c*2 - c + 2. Determine p(b). 4 Suppose 3m + 6 = 5s, -45 = -4s - 5m - 55. Let p(u) = u3 + u2 + 3u + 10. Determine p(s). 10 Let i(z) = 3z3 + 8z*2 - 7z - 7. Let x(l) = -8l3 - 24l*2 + 21l + 20. Let m(d) = 11i(d) + 4x(d). Let q = -50 - -57. What is m(q)? 3 Let y = -16 + 10. Let j(s) be the second derivative of s3/3 + s2 + 512s. What is j(y)? -10 Let x = -652 + 652. Let l(j) = -j - 32. What is l(x)? -32 Let q(w) = 21w*2 - 4w + 1. Let o(x) = 22x2 - 6x + 1. Let l(r) = -3o(r) + 4q(r). Suppose 2 = -t + 5. Suppose 8v - tv = -5. Give l(v). 17 Suppose -2n + 5l = 6l - 71, 3n - 5l - 74 = 0. Let a(u) = -22 - 12 + n - 13u. What is a(1)? -14 Let l be (2 + 0)(-5 - -9). Suppose -10 = -ld + 3d. Let t(s) = -2s*2 + 8s*2 + 3s - 7sd - 2. What is t(4)? -6 Let x(d) = -d2 - 13d - 10. Let v(s) = -4s - 71. Let k be v(-15). Calculate x(k). 12 Let i(u) be the first derivative of u3/3 + u2/2 - 17u - 16. Let q(l) be the first derivative of i(l). What is q(-4)? -7 Let d = 346 + -343. Let y(v) be the first derivative of -v*4/4 + 2v*3/3 + 3v*2/2 - 3v + 3. Determine y(d). -3 Let a(n) be the third derivative of n6/120 + n5/10 + n*3/6 - 3n*2. Suppose 11 = -6k - 25. What is a(k)? 1 Let z(k) = -2k2 + 2k + 3. Let d be -31(-2)/(-2). Let l(j) = -3j2 + j + 3. Let c be 22/143 + 50/262. Let h(r) = cz(r) + dl(r). Give h(-4). -1 Let j(b) = -2b2 + b + 1. Let x(o) = -o3 - 11o*2 + 10o + 10. Let p(k) = -2j(k) + x(k). Determine p(-8). 8 Let n(m) = -2m - 8. Let u be n(-15). Let a be (-1)/(-3) + u/(-3). Let g(r) = r - 1. What is g(a)? -8 Suppose -5g - 12 = -11g. Let w(d) = -9d + 26d - 13d - dg + 2. Give w(6). -10 Suppose i = -4h - 4, -2h - 6 = -4i - 7h. Let y = 16 + -21. Let o(v) = -2v + 4. Let t(c) = -	{ "pile_set_name": "DM Mathematics" }
r? 3, 5 Suppose 0 = -5f + 44 + 56. List the prime factors of f. 2, 5 Suppose -13x + 391 = -38. List the prime factors of x. 3, 11 What are the prime factors of (162/(-90))/(3/(-190))? 2, 3, 19 Suppose 0i + 5i = -50. Let g = 18 + i. What are the prime factors of (g - (-3 - -1)) + 1? 11 Let i(s) = -9 + 3s2 - 3s + s*2 - 2s*2. What are the prime factors of i(4)? 11 Let x = 16 + -9. Let j = 12 - x. Suppose -2a + 11 = jc, -4c + 5a = -7c - 1. What are the prime factors of c? 3 Let q = 2 + -2. Suppose 2s - 17 = -2g + 7, 4g + s - 45 = q. What are the prime factors of g? 11 What are the prime factors of (1/(-1))/((-2)/(-54)-3)? 3 Suppose d + 3a - 42 = -3d, a = 3d - 25. Let z be -4(2/(-4) - 0). Suppose -zy + d = -11. What are the prime factors of y? 2, 5 Let y(j) = -j2 + 8j + 2. Let k(u) = 3u2 - 23u - 6. Let w(l) = 6k(l) + 17y(l). List the prime factors of w(-3). 13 Let r(w) = w*3 - 11w*2 + 13. Let m be r(11). What are the prime factors of m - -2(-1)/(-1)? 3, 5 Suppose -3o - m + 3m = -7, -5o = m + 10. Let w be 18(-6)/4o. Suppose 0 = -2c - c + w. List the prime factors of c. 3 Let c be 2 + (0 - 1) - 7. Let w = -12 - c. Let g(u) = -u*2 - 9u - 8. List the prime factors of g(w). 2, 5 Let j be -6 + 3(-3)/(-9). Let u(m) = -2m - 5. List the prime factors of u(j). 5 List the prime factors of (-3168)/(-51) + 4/(-34). 2, 31 Suppose 4i - 196 + 56 = 0. List the prime factors of i. 5, 7 Let o(m) = m3 - 10m*2 - 11m - 9. Let s be o(11). List the prime factors of (6/s)/(10/(-135)). 3 Suppose 0 = 3w + y - 8, -1 = 2w - 4y - 11. Let k(v) = v2 - v - 2. List the prime factors of k(w). 2 Let j(m) = 4m - 17. List the prime factors of j(14). 3, 13 Let o(p) = -2 - 1 - 2 - 2 - 3p. Let t be (-3)/(-3)(-14)/2. List the prime factors of o(t). 2, 7 Suppose -1156 = o - 18o. What are the prime factors of o? 2, 17 Suppose 13d = 12d + 5. What are the prime factors of d? 5 Let x(y) = -8y + 1. Let g be x(-1). Suppose 2c = g + 9. What are the prime factors of c? 3 Suppose 0r = r - 58. List the prime factors of r. 2, 29 Suppose 4b = b + 6. Suppose -5l - by = -5y - 74, -5l + y = -68. List the prime factors of l. 13 Let k = 40 - 6. List the prime factors of k. 2, 17 Suppose -473 = -w + 4p - 117, p - 1696 = -5w. List the prime factors of w. 2, 5, 17 Let u be 2/8 - 39/(-4). Suppose 0 = -0o + 5o - 5. What are the prime factors of u + o + 2/(-2)? 2, 5 What are the prime factors of -8 - -52 - 4-1? 2, 3 Suppose 0 = -4p - 333 + 873. Suppose -2o + 79 = 3b, -5b = o + 4o - p. List the prime factors of b. 5 Suppose 2q - 227 = -0q + 3b, 0 = -4q - 4b + 404. List the prime factors of q. 2, 53 Let i = -340 - -536. Let n = i - 124. What are the prime factors of 2/10 + n/15? 5 Suppose -2f + 4m = 3 + 123, -f = -m + 64. Let a be 10/f - (-108)/26. Suppose l + 5k = -8, l + 2k - a = -0. What are the prime factors of l? 2, 3 Let w = 288 - 187. List the prime factors of w. 101 Suppose -2f + 5j = -38, j - 6j = -10. Suppose o = -3o + f. What are the prime factors of o? 2, 3 Let i be (1 + 1)49/(-14). Let y = -8 - i. Let m = 6 - y. What are the prime factors of m? 7 Suppose 4v - 20 = -2o, -6o + 4v = -2o - 28. Let z = o - 6. Let b = 2 + z. What are the prime factors of b? 2 Suppose -3y + 69 + 21 = 0. List the prime factors of y. 2, 3, 5 Let c be (-4)/(-10) + (-406)/(-35). Suppose 3v = -i + 10, 3i = 3v + 2v - c. What are the prime factors of v? 3 Let s = 54 + 12. What are the prime factors of s? 2, 3, 11 Let o = -103 + 333. What are the prime factors of o? 2, 5, 23 Suppose 7h - 4h + 29 = 2u, 0 = 4h + 4. Suppose u = -c + 2c. List the prime factors of c. 13 Let f be (-31)/(-3) - (-3)/(-9). Suppose 2 = 5s - 3. Suppose -p + f = -s. List the prime factors of p. 11 Suppose -5a + 16 = -2a - 4p, 0 = 3a + 3p - 9. Let l(m) = -m*3 + 4m*2 - 1. Let i be l(a). What are the prime factors of (-2)/(-1 + i)15? 3, 5 List the prime factors of (-2 - 7)/3 + -1 + 115. 3, 37 Suppose -3s - 1 = -4. Suppose 5p + h = 2p - s, -4p + 16 = -3h. Let d = p - -1. List the prime factors of d. 2 Let p(z) be the first derivative of z4/4 - 5z*3/3 - 3z*2/2 - 8z - 2. Let h(j) = -2j - 16. Let o be h(-11). List the prime factors of p(o). 2, 5 Let w(r) = -r2 + 6r + 3. Let c = 2 + -3. Let p be (c - -2)(3 + 0). What are the prime factors of w(p)? 2, 3 Let k(z) = 7z - 3z3 - 2z*3 + 6z*2 - 4 + 4z*3. Let o be k(6). Suppose 34 = 3w + 4m, -o = -5w + w + 2m. List the prime factors of w. 2, 5 Let k(r) = r3 + 7r*2 + 4r + 1. Let x be k(-6). Suppose 39 + x = 4c. Suppose 11 = 4f - c. What are the prime factors of f? 2, 3 Let y be ((-9)/(-6))/((-2)/4). List the prime factors of (y/5)/((-1)/55). 3, 11 Suppose -7k + 2k + 65 = 0. Suppose a + 4g - 10 = 0, 0 = -2a + 4a + g - k. What are the prime factors of a? 2, 3 What are the prime factors of (-3)/(-26/64)? 2 Let w = 5 + -8. Let l be (1/w)/(6/(-18)). Suppose 5 = 3p - l. What are the prime factors of p? 2 Let j(p) = -p2 - 8p - 1. What are the prime factors of j(-5)? 2, 7 Suppose 0 = -2l + 2c + 360, -5c - 93 - 441 = -3l. What are the prime factors of l? 3, 61 Suppose -4o + o - 5c = -7, 0 = o + 4c. Let k be (-3)/(-6)0/(-2). Suppose on + n - 55 = k. What are the prime factors of n? 11 Suppose -2k - 5u - 21 = 0, -4k - 4 - 3 = 3u. Let i be 11/((-9)/5 + k). Suppose 8n - 3n = i. What are the prime factors of n? 11 Suppose 6n - 17 = 2n + 5t, -5t - 2 = n. Suppose i - 13 - 23 = -s, ns - 143 = -4i. Suppose 5l + 5 = i. List the prime factors of l. 2, 3 What are the prime factors of (-25)/(-2)(-28)/(-14)? 5 Let f(b) = -b3 + 16b*2 + 17b + 10. What are the prime factors of f(17)? 2, 5 What are the prime factors of -83(-2)/42? 83 Suppose 0 = b - 4b + 3. Let t = -7 - -6. List the prime factors of (t - -1)b + 9. 3 Let f = -17 + 31. Suppose 0 = i - 25 - f. Suppose 9 = -3d + i. What are the prime factors of d? 2, 5 Suppose -10 = 3g + 11. Let k = -5 - g. Suppose 0 = -ko + 29 + 9. What are the prime factors of o? 19 Suppose 0 = 3z - 5s - 74, -2z = -7z + 3s + 118. List the prime factors of z. 23 Let v be (-7 - 3)/(-1 + -1). Suppose -va + 0a - 31 = -2h, 5h + 5 = -4a. Suppose hj + j - 32 = 0. What are the prime factors of j? 2 Let p(x) = x*2 - 9x + 9. Suppose 4q = 9 + 31. What are the prime factors of p(q)? 19 Suppose 0w + 4k - 30 = -w, -2k + 36 = w. Suppose 0 = 2f + p - 6p + 8, 5f = -3p + w. What are the prime factors of f? 2, 3 Let w = -2 - -4. Suppose -v = -15 - w. List the prime factors of v. 17 Suppose 6n = -3m + 3n + 27, 0 = 3m - 3n - 27. Let z be (-6)/m - 160/(-6). Suppose z = -5h + 71. What are the prime factors of h? 3 Suppose -6w = -3w - 234. List the prime factors of w. 2, 3, 13 Suppose -425 - 435 = -4f. List the prime factors of f. 5, 43 Suppose 258 = p + 5d, 2p - d - 3d = 502. What are the prime factors of p? 11, 23 List the prime factors of (-33 + -1 + 2)/((-3)/6). 2 Let p(y) = 3y2 - 1. Let o be p(1). Suppose -oz + 0 + 12 = 0. What are the prime factors of z? 2, 3 Suppose -3y - s + 112 = 2y, 5y - 2s - 106 = 0. List the prime factors of y. 2, 11 Let d = -9 + 5. What are the prime factors of (-69)/(-6) + (-2)/d? 2, 3 Suppose 3p = 6p - 9. Let m(v) = 2 + 6v - 6 + 3 - pv. List the prime factors of m(1). 2 Let i(r) = -r*2 + 8r - 6. Let d be i(7). Let n(g) = -32g. Let o be n(d). List the prime factors of o/1230/(-8). 2, 5 Let b(i) be the second derivative of i*3/6 + 4i. Suppose -d + 5d = 20. List the prime factors of b(d). 5 Let u(p) = -2 + 2p + 4 - 3 - 2. Let g be u(4). Suppose 3x + 0z - 42 = gz, 4z + 21 = x. What are the prime factors of x? 3 Let v(o) = o*2 + 9o + 5. Let s be v(-10). Suppose 5 + s = 4j. List the prime factors of j. 5 Suppose -3b + 3 = -k, -3 + 4 = -k + b. Suppose 28 = 2i + 2z, k = 3i - z - 23 - 3. List the prime factors of i. 2, 5 Suppose -4k + 27 = 2s - 41, 5k + 5s = 90. Let q = k - -11. List the prime factors of q. 3 What are the prime factors of 138/(-2)14/(-6)? 7, 23 Let n(g) = -g*2 + 2g - 1. Let p be n(2). Let y = p + 2. Let m = 3 - y. List the prime factors of m. 2 Let m(h) = 14h3 - h2 + h. What are the prime factors of m(1)? 2, 7 Suppose -4g - 4	{ "pile_set_name": "DM Mathematics" }
by 130. 1 What is the remainder when 827 is divided by 16? 11 What is the remainder when 253 is divided by 69? 46 What is the remainder when 1535 is divided by 19? 15 What is the remainder when 727 is divided by 9? 7 What is the remainder when 166 is divided by 49? 19 What is the remainder when 63 is divided by 6? 3 What is the remainder when 268 is divided by 30? 28 Calculate the remainder when 4283 is divided by 143. 136 Calculate the remainder when 886 is divided by 11. 6 What is the remainder when 1280 is divided by 61? 60 What is the remainder when 217 is divided by 11? 8 What is the remainder when 542 is divided by 32? 30 Calculate the remainder when 113 is divided by 64. 49 Calculate the remainder when 132 is divided by 21. 6 Calculate the remainder when 285 is divided by 4. 1 What is the remainder when 1611 is divided by 100? 11 Calculate the remainder when 24 is divided by 13. 11 What is the remainder when 137 is divided by 50? 37 Calculate the remainder when 71 is divided by 24. 23 Calculate the remainder when 765 is divided by 59. 57 Calculate the remainder when 2472 is divided by 73. 63 Calculate the remainder when 141 is divided by 13. 11 What is the remainder when 24035 is divided by 12? 11 What is the remainder when 333 is divided by 98? 39 Calculate the remainder when 63 is divided by 8. 7 What is the remainder when 322 is divided by 19? 18 What is the remainder when 398 is divided by 121? 35 What is the remainder when 295 is divided by 30? 25 What is the remainder when 39674 is divided by 52? 50 What is the remainder when 1448 is divided by 371? 335 What is the remainder when 528 is divided by 28? 24 Calculate the remainder when 467 is divided by 52. 51 Calculate the remainder when 3656 is divided by 59. 57 What is the remainder when 65 is divided by 58? 7 Calculate the remainder when 14584 is divided by 29. 26 What is the remainder when 92 is divided by 33? 26 Calculate the remainder when 4368 is divided by 46. 44 Calculate the remainder when 405 is divided by 46. 37 Calculate the remainder when 77 is divided by 5. 2 Calculate the remainder when 114 is divided by 113. 1 What is the remainder when 745 is divided by 6? 1 Calculate the remainder when 126 is divided by 35. 21 Calculate the remainder when 199 is divided by 25. 24 What is the remainder when 2204 is divided by 734? 2 What is the remainder when 1121 is divided by 127? 105 Calculate the remainder when 412 is divided by 9. 7 Calculate the remainder when 1673 is divided by 14. 7 Calculate the remainder when 37 is divided by 1. 0 Calculate the remainder when 32 is divided by 28. 4 Calculate the remainder when 2491 is divided by 12. 7 What is the remainder when 484 is divided by 318? 166 Calculate the remainder when 49 is divided by 2. 1 Calculate the remainder when 255 is divided by 174. 81 What is the remainder when 1915 is divided by 481? 472 Calculate the remainder when 339 is divided by 57. 54 What is the remainder when 290 is divided by 73? 71 Calculate the remainder when 168 is divided by 13. 12 Calculate the remainder when 1617 is divided by 28. 21 What is the remainder when 2964 is divided by 4? 0 Calculate the remainder when 29 is divided by 17. 12 Calculate the remainder when 391 is divided by 29. 14 What is the remainder when 1478 is divided by 45? 38 What is the remainder when 12742 is divided by 177? 175 Calculate the remainder when 257 is divided by 45. 32 What is the remainder when 2504 is divided by 11? 7 Calculate the remainder when 250 is divided by 137. 113 What is the remainder when 188 is divided by 188? 0 Calculate the remainder when 583 is divided by 31. 25 What is the remainder when 87 is divided by 20? 7 Calculate the remainder when 1582 is divided by 132. 130 What is the remainder when 223 is divided by 14? 13 Calculate the remainder when 595 is divided by 50. 45 What is the remainder when 338 is divided by 44? 30 What is the remainder when 191 is divided by 86? 19 What is the remainder when 23 is divided by 15? 8 Calculate the remainder when 214 is divided by 33. 16 What is the remainder when 5076 is divided by 35? 1 Calculate the remainder when 377 is divided by 10. 7 Calculate the remainder when 301 is divided by 141. 19 What is the remainder when 941 is divided by 73? 65 Calculate the remainder when 605 is divided by 101. 100 Calculate the remainder when 193 is divided by 3. 1 Calculate the remainder when 1295 is divided by 13. 8 Calculate the remainder when 1519 is divided by 259. 224 What is the remainder when 2001 is divided by 12? 9 Calculate the remainder when 816 is divided by 106. 74 What is the remainder when 2277 is divided by 43? 41 What is the remainder when 1424 is divided by 88? 16 Calculate the remainder when 237 is divided by 2. 1 What is the remainder when 266 is divided by 18? 14 Calculate the remainder when 537 is divided by 45. 42 What is the remainder when 3887 is divided by 108? 107 What is the remainder when 1772 is divided by 14? 8 What is the remainder when 1277 is divided by 67? 4 Calculate the remainder when 147 is divided by 42. 21 What is the remainder when 161 is divided by 85? 76 What is the remainder when 4589 is divided by 16? 13 What is the remainder when 435 is divided by 40? 35 What is the remainder when 417 is divided by 19? 18 Calculate the remainder when 468 is divided by 67. 66 Calculate the remainder when 671 is divided by 13. 8 Calculate the remainder when 2069 is divided by 18. 17 Calculate the remainder when 1894 is divided by 627. 13 What is the remainder when 367 is divided by 54? 43 What is the remainder when 122 is divided by 18? 14 Calculate the remainder when 92 is divided by 34. 24 Calculate the remainder when 1093 is divided by 108. 13 What is the remainder when 39 is divided by 36? 3 What is the remainder when 4724 is divided by 105? 104 What is the remainder when 123 is divided by 6? 3 What is the remainder when 126 is divided by 5? 1 Calculate the remainder when 29780 is divided by 146. 142 What is the remainder when 4661 is divided by 43? 17 Calculate the remainder when 310 is divided by 39. 37 What is the remainder when 205 is divided by 28? 9 What is the remainder when 282 is divided by 141? 0 Calculate the remainder when 1086 is divided by 68. 66 Calculate the remainder when 339 is divided by 38. 35 What is the remainder when 23 is divided by 9? 5 What is the remainder when 570 is divided by 185? 15 Calculate the remainder when 198 is divided by 151. 47 What is the remainder when 60 is divided by 59? 1 What is the remainder when 1531 is divided by 20? 11 Calculate the remainder when 49102 is divided by 72. 70 Calculate the remainder when 2372 is divided by 25. 22 What is the remainder when 74 is divided by 26? 22 Calculate the remainder when 125 is divided by 34. 23 What is the remainder when 222 is divided by 9? 6 What is the remainder when 283 is divided by 68? 11 Calculate the remainder when 152 is divided by 22. 20 What is the remainder when 2119 is divided by 21? 19 What is the remainder when 143 is divided by 50? 43 What is the remainder when 142 is divided by 36? 34 What is the remainder when 404 is divided by 26? 14 Calculate the remainder when 591 is divided by 99. 96 What is the remainder when 4946 is divided by 50? 46 What is the remainder when 230 is divided by 64? 38 Calculate the remainder when 223 is divided by 25. 23 Calculate the remainder when 2869 is divided by 29. 27 Calculate the remainder when 380 is divided by 34. 6 What is the remainder when 622 is divided by 8? 6 Calculate the remainder when 63 is divided by 14. 7 What is the remainder when 29238 is divided by 170? 168 Calculate the remainder when 461 is divided by 36. 29 Calculate the remainder when 135 is divided by 23. 20 What is the remainder when 391 is divided by 28? 27 What is the remainder when 2631 is divided by 22? 13 What is the remainder when 25415 is divided by 111? 107 What is the remainder when 597 is divided by 141? 33 What is the remainder when 198 is divided by 96? 6 Calculate the remainder when 228 is divided by 23. 21 Calculate the remainder when 458 is divided by 14. 10 What is the remainder when 1645 is divided by 131? 73 What is the remainder when 1167 is divided by 39? 36 What is	{ "pile_set_name": "DM Mathematics" }
u, 5u = 3g + 10 for g. 5 Solve -5s + 4l = 20, 25s + 4l + 36 = 23s for s. -8 Solve 4z = 4p + 6z + 6, -4z = -12 for p. -3 Solve 0 = z + 3m + 11, 20z - 17z + m + 17 = 0 for z. -5 Solve 3g + z + 11 = 0, g + 5z = -g - 16 for g. -3 Solve 2k + 3 = -t, 4t - 1 = -4k - 9 for t. -1 Solve n = -5i - 30, -4n - n - 10 = -3i for i. -5 Solve -5b = h - 13 + 2, 16 = -4h for b. 3 Solve -3n - 9 = -4m + 7m, -5n - 2m - 21 = 0 for n. -5 Solve q - 4 + 1 = 0, 0 = -t + q - 2 for t. 1 Solve -2c - 2c - 30 = 5j, 5j + c = -15 for j. -2 Solve 0 = 3b - 4n + 5, -2b = -n - 5 for b. 5 Solve -3f + v + 12 = 0, 2v + 6 = -4f + 12 for f. 3 Solve 36c - 39c + 9 = 0, -x + 5c = 14 for x. 1 Solve -s - 14b = -15b - 10, 2b - 15 = -5s for s. 5 Solve -3v = 2y - 3, 10y - 15y + 5v = 30 for y. -3 Solve 2x - 5 = 1, 4x + 8 = -5m for m. -4 Solve -n = -2r - 1 + 10, 5r = -5n for r. 3 Solve -23s + 21s + 12 = 2n, -4s - n + 9 = 0 for s. 1 Solve -2s + 21 = -7s - a, -3s + a - 19 = 0 for s. -5 Solve 24 = -4b - 4p, b + 5p = 3b + 5 for b. -5 Solve 33h - 5j = 37h - 17, 2h - 10 = -4j for h. 3 Solve -z + 3 = 2z + 3t, z - 5t = 25 for z. 5 Solve -3h = 4o - 5h + 18, o = 2h - 9 for o. -3 Solve 7s - 11s + 16 = -l, 0 = -5l + s - 4 for l. 0 Solve -3r + 21 = 3h, 2r + 4 - 6 = 2h for r. 4 Solve 44m - 4h = 49m + 32, m + 3h + 13 = 0 for m. -4 Solve 5x + 4s - 4 = 4x, 3s - 4 = -x for x. 4 Solve h = u + 2, -6u + 5h = -8u - 4 for u. -2 Solve 5b - 3n = 12, -2n - 3 = -2b + 5 for b. 0 Solve 5d + 14 = n, -50n + 53n = -3 for d. -3 Solve -201s + 203s - 18 = 4f, 14 = 4s + 3f for s. 5 Solve -4x + 10 = j, -5j = 45x - 47x + 16 for j. -2 Solve 3k + 27 = -3s + 9, 3s + 24 = -5k for s. -3 Solve -4w = -3r, 5w + 2r = 5r - 3 for w. -3 Solve -2n - 3n = -3o - 11, 2n = -2o + 14 for o. 3 Solve v + 3b - 4 = 0, 2v + b + 35 - 43 = 0 for v. 4 Solve 5u - 4q = 35, 3u + q = -3q - 11 for u. 3 Solve 4b - 12 = -4y, -6b + 5y = -3b - 1 for b. 2 Solve -7x = -2x + 2p - 8, p = -x + 1 for x. 2 Solve 0 = -3b + 3x - 15, 3b + 3x - 5 = x for b. -1 Solve 3m + 4l = m - 10, -l = -4m - 11 for m. -3 Solve -95m + 91m - 2 = -2d, 10 = -5d + 5m for d. -5 Solve -z - 15p + 12 = -12p, 2z = 5p - 31 for z. -3 Solve -6h + 4h - 2 = 4v, v + 4h = -18 for v. 2 Solve 2t + p + 0p + 12 = 0, 4p + 40 = -4t for t. -2 Solve -2h - h - 16 = -5m, 0 = -4h - 4m for h. -2 Solve 5b - 2k = 26, -6 = b + 5k + 5 for b. 4 Solve 7 = -5i + 2y, -5 = 3i - y - 1 for i. -1 Solve 2v + 14y - 9y + 10 = 0, -2y = 5v - 17 for v. 5 Solve -5g - 2z = 13, 4z + 1 = -2g - z for g. -3 Solve u + 3u = q - 22, 3u - 2q + 19 = 0 for u. -5 Solve 4t + 2 + 1 = u, -5u = t + 27 for u. -5 Solve 3x = -f - 0 - 1, -3x - 5 = -f for f. 2 Solve 0 = 2c + 5p - 18, -c - 2p + 9 = 1 for c. 4 Solve 2t + 10 = 2l, 0 = 3t - l - 4l + 21 for t. -2 Solve 54c - 55c - 4l = 24, 2c - 12 = 4l for c. -4 Solve -5 = t + 4q, 2q + 8 = -3t - 3q for t. -1 Solve -3q = 4l - 7q - 36, 5q + 29 = l for l. 4 Solve l - y - 6 = 0, -26 = -3l + 5y - 0y for l. 2 Solve -2w - 3z = -6 + 15, -25 = -5w + 2z for w. 3 Solve 2q + 10 = 0, -8 = -p - 5q - 36 for p. -3 Solve -j + 2y - 13 = 0, 4y = 2j + y + 21 for j. -3 Solve 5v - 161 + 159 = q, v + 10 = -5q for q. -2 Solve -y + 22s - 25s - 5 = 0, y = 5s + 3 for y. -2 Solve 2z + 2w - 2 = 0, -3z + 4w = w + 27 for z. -4 Solve -57z + 52 = 8y - 53z, 5y - 34 = -3z for y. 5 Solve 15 = -3h + 5i - 16, 0 = -h + i - 7 for h. -2 Solve 4 = -4s - 4i, -s + 5i - 11 = -2s for s. -4 Solve g + 6 = -3z, -52g + 50g - 6 = 3z for g. 0 Solve 10o = -3f + 9o - 14, 2f + 3o = -14 for f. -4 Solve 2a - 2f + 10 = 0, -28 = -a - 3f - 13 for a. 0 Solve 2r - 5j + 15 = 0, 19j - 16j - 9 = r for r. 0 Solve -5i = -3c - 2, -3i + 331c - 327c - 1 = 0 for i. 1 Solve 28 = 3n + 4v, -2n - 18 = 30v - 31v for n. -4 Solve -4p = 5a + 13, -10p = -9p - 5a - 28 for p. 3 Solve -4a = -3g + 15, -49a = g - 48a + 2 for g. 1 Solve 9 = -3a, 0 = q + a - 12 + 19 for q. -4 Solve 0 = 5k - 4k + 3, -3o - 24 = 5k for o. -3 Solve -5o + 6 = 3w, 2o + 2w - 77 + 73 = 0 for o. 0 Solve 4k = 5p - 2 - 31, 0 = -2p + 2 for k. -7 Solve 0 = g - y - 1, 2 = -4g + 3y + 7 for g. 2 Solve 0 = -2n - 5w - 23, 2n + 11 = 3w - 4w for n. -4 Solve 3c + 1 = -5j, 53j + c = 52j + 1 for j. -2 Solve -4t = 6q - 3q + 15, 5q - 1 = 2t for q. -1 Solve -5l - 5p - 40 = 0, 17l = 16l + 5p + 10 for l. -5 Solve -8m + 4m + 2g = 0, -2g - 3 = -m for m. -1 Solve -3x - 6 = -4y, 5x + 2 + 8 = -4y for x. -2 Solve b + 3h + 11 = 0, 4h + 6 = h for b. -5 Solve c - 12 = 2k - 23, -c + 7 = 4k for k. 3 Solve 62b + 6 = -2v + 64b, 11 = -2v - 3b for v. -4 Solve -3n + 8n = 2c + 1, 4n + 19 = -5c for c. -3 Solve 5v - 11 - 19 = 5k, 4v = 0 for k. -6 Solve -2h = 3v + 22, 2v + 4h = -3 - 25 for v. -4 Solve -3p + 109 = -5j + 93, 0 = -2j + 2p - 8 for j. -2 Solve 0 = -2y - 3u - 19, -3y + u - 31 = 6u for y. -2 Solve -4w - 3 = -5d, d = -4w + 5d - 4 for w. -2 Solve -5g + 2 = -5b - 8, -5b - g = 10 for b. -2 Solve 2s + s + 18 = -5m, -5m - 19 = 4s for m. -3 Solve 0 = -2x - l, x = -5l - 22 + 4 for x. 2 Solve 4o + 5k = -10, -9k - 18 = 4o - 8k for o. -5 Solve -18 = 5m + 4z, 4m + 4 = m + z for m. -2 Solve -4d - 22 = -2n, 4 = d + d + 2n for d. -3 Solve 1 = 4b - b - 4t, -2b + 3t = -2 for b. -5 Solve 5p = r + 71 - 65, 0 = -p for r. -6 Solve 5 = i - 3d, -i + 23d - 26d - 1 = 0 for i. 2 Solve 3s + 5n - 32 = -6, 3s - 2n + 2 = 0 for s. 2 Solve 0 = -c + 9u - 7u - 5, 5c - 3 = 3u for c. 3 Solve -5b + 10 = 0, -i - 2b - 5 = -10 for i. 1 Solve p = 4p - 4o - 5, -p + 3o = 0 for p. 3 Solve 0 = 5i - i + 4h + 28, -3i - 25 = 5h for i. -5 Solve -3c - 12 = 0, 2a - c = 3c + 20 for a. 2 Solve 6l = -h + 8l - 5, -5h - 2l = 13 for h. -3 Solve -4s = 27z - 26z + 13, -2z = -2s - 14 for s. -4 Solve -2m = 5f, -m + 5f = 4m for m. 0 Solve 3 + 4 = v - 5q, 2q + 4 = 0 for v. -3 Solve 4j - 5a = 38, -3a - 8 = -0j + 5j for j. 2 Solve 10h = 5h - 2v + 16, 5h = 4v + 28 for h. 4 Solve -3c + 10 = -z, 9z - 11 = -5c + 5z for c. 3 Solve 4i - 20 = 0, 0 = -y - 7i + 26 + 4 for y. -5 Solve -4c + 3l = -11, 2c - 2l = -1 + 7 for c. 2 Solve -8 = -4o - x, -4o + 6x + 32 = x for o. 3 Solve -2t = 0, -t = -4j - 6t + 12 for j. 3 Solve 50 = 5z - 5j, -2j + 5 = 5z + 2j for z. 5 Solve o = 2x - 15, -x - 60o + 15 = -62o for x. 5 Solve t + 7j - 5j + 11 = 0, -5j - 26 = t for t. -1 Solve 1 = 5t + 2m - 9, -m + 5 = 2t for t. 0 Solve 14 = 15y - 12y - 4d, 3y + 4d + 2 = 0 for y. 2 Solve 2u + 7 = -2j - 1, 4u + 10 = 2j for j. -1 Solve -4a = -5o + 8, 9a - 11a - 4 = 5o for o. 0 Solve -37 = 4b + 5v - 11, -2 = v for b. -4 Solve -20 = -4u, 2h - 77 = -u - 62 for h. 5 Solve m = -5s - 22, m + 53 = 4s + 67 for s. -4 Solve 45b + 4h = 44b + 19, 3b = -h + 2 for b. -1 Solve -6r + 8n - 6n + 38 = 0, n - 11 = -3r for r. 5 Solve 0 = 5d + 3f + 20, 52d - 50d - 5f - 23 = 0 for d. -1 Solve 55w = 59w - 16, 4p + 2w = -8 for p. -4 Solve l = -4i + 11, -3i + 3l - 4l = -8 for i. 3 Solve -4x - 40 = -5s, 27x - 5s = 30x - 5 for x. -5 Solve -5j + 13 = -4l, -26l + 22l = 3j + 5 for j. 1 Solve 2j + u = -0u, j = 5u - 11 for j. -1 Solve 0 = y - 5t - 9, 3y + t = -2y + 19 for y. 4 Solve 4b + 6h = 3h, 2b + 2h = 0 for b. 0 Solve 2i - 3i + 3j = 19, -3j = 5i + 5 for i. -4 Solve -5q = 5w + 10, 0 + 3 = -3w - 2q for w. 1 Solve -166x + 168x - 3w + 12 = 0, 4x - 5w = -22 for x. -3 Solve 3t = -15 + 6, 0 = -5l + 2t - 9 for l. -3 Solve 4j = -3o + 6, -3o - 3 = 5j - 12 for j. 3 Solve 0 = 5m - 2d - 13, -19d + 16d + 6 = m for m. 3 Solve -2i = -3d - 18, -25 = 3i - 6i + 4d for i. 3 Solve 5a + 2l - 5 = 0, 3 = l - 2 for a. -1 Solve 3h = -3v + 6, -5v = 6h - 5h - 18 for h. -2 Solve -5a - 40 = -5y, -21y + 2 = -17y + 2a for y. 3 Solve -y - 1 = 4g - 2g, 0 = -4y + 4g + 8 for y. 1 Solve 2n - 30 = 4f, 11f = -3n + 6f - 10 for n. 5 Solve 3 + 9 = 4a + 4w, -2w = -10 for a. -2 Solve 2a = -4, -2j + 0j - 3a = 12 for j. -3 Solve -4s - 16 = -3f, -2s + 7 = -2*f	{ "pile_set_name": "DM Mathematics" }
3n - 1340 = 3i. Round n to the nearest one hundred. 1300 Let l = 61 - 87. Let g = -26.000011 - l. Round g to five decimal places. -0.00001 Let l = -1.6 - -9.6. Let d = l + -8.00000056. What is d rounded to seven dps? -0.0000006 Let d = 1.2 + -2.59. Round d to 1 decimal place. -1.4 Let u = -46768 + 46766.79993. Let j = -3.7 + 2.5. Let p = j - u. Round p to 5 dps. 0.00007 Suppose 0 = -3x + 4z + z, -z = -2x. Suppose 0 = -xa - 3a + 18. Let g be ((-80000)/a)/(5/1800). What is g rounded to the nearest one million? -5000000 Let l = -151 + 241. Let d = l - -10. Suppose 4v - 5r = d, v = r - 4r + 42. What is v rounded to the nearest 100? 0 Let l = -195819969.9999999 - -195819958. Let i = -12 - l. What is i rounded to six dps? 0 Let x = 1.1 - 23.42. Let q = 23 + x. What is q rounded to one decimal place? 0.7 Let r = 59.8 - 48. Round r to the nearest integer. 12 Let p(x) = 28x + 6. Let o be (-8)/(-24) + 46/6. Let u be p(o). What is u rounded to the nearest 100? 200 Let g = -79530619 + 49430619. What is g rounded to the nearest one million? -30000000 Let s = 760 - 420. Round s to the nearest one hundred. 300 Let d = 13 - 51. Let r = -2393.1 + 2431.079. Let v = r + d. Round v to two decimal places. -0.02 Let j(b) = b3 + 11b*2 + b + 1. Let s be j(-8). Round s to the nearest 10. 190 Let t be (219237 + -6)(-292)/(-3). Suppose t + 13061516 = 4a. Round a to the nearest one million. 9000000 Let l = 1.79363 - 1.6336412. Let j = -0.16 + l. What is j rounded to 6 dps? -0.000011 Let x = -0.166 + 0.25. Let n = -436.454 + 436. Let j = x + n. What is j rounded to 1 dp? -0.4 Let n be 27/(-6) - (-2)/4. Let f(z) = 2881z*2 - 5z + 2. Let s be f(n). Let v = s + -16118. Round v to the nearest 10000. 30000 Let k = -9 + 8. Let v be (k + 4)4/6. Suppose 0p = 2m - vp - 9000010, -4p = 20. Round m to the nearest one million. 5000000 Let v = -0.107 - -0.10699898. What is v rounded to 6 dps? -0.000001 Suppose -8k + 225 = 2465. What is k rounded to the nearest one hundred? -300 Let q = 0.05 + -0.0500084. Round q to 6 decimal places. -0.000008 Let f be 4/6 + 1405912/12. Suppose -530840 = -2h + f. Suppose 5k - h = k. Round k to the nearest 10000. 80000 Let k = 7.3 - 7.292. Round k to 2 decimal places. 0.01 Let r = 876.0387 + -876. Round r to three dps. 0.039 Let d be (-3)/(-6)32. Suppose -3m - c + 5 = 0, dc - 15 = 3m - 2m. Suppose -3b + mb = -5a - 63000, -a = 0. Round b to the nearest 10000. 20000 Let q(d) be the first derivative of 19527d*3 + 7d*2 - 7d + 5. Let c be q(-13). Round c to the nearest one million. 10000000 Let q be (1 + -9751)(-224)/(-24). Round q to the nearest ten thousand. -90000 Suppose -669885 = 5x - 2x. Let a = x + 113295. Round a to the nearest ten thousand. -110000 Let f = -279.37 + 1.37. Let n = 176 + f. Let x = n - -101.99999949. What is x rounded to seven dps? -0.0000005 Suppose -4a - 87084 = -2a. Suppose i - 3x + 372704 = 6i, 0 = i + x - 74540. Let b = i + a. What is b rounded to the nearest 10000? 30000 Let w = 1040405 - 1016576.89. Let i = w + -23628. Let r = -201 + i. Round r to 1 decimal place. -0.9 Let l = -0.76 - -0.809. What is l rounded to two dps? 0.05 Let z(w) = -w + 1. Suppose -i + 3p + 6 = -p, 4p - 4 = -4i. Let x be z(i). Let r be 252/(x/((-15)/6)). What is r rounded to the nearest one hundred? 600 Let j = -410486.9055 - -420008.625498. Let n = j - 9524.72. Let r = n + 3. What is r rounded to six dps? -0.000002 Let r be 2 + 584992 - 0. Suppose 4g + r = g. What is g rounded to the nearest ten thousand? -40000 Let q = 394683.799997 - 394684. Let n = q + 0.2. What is n rounded to six dps? -0.000003 Let p = -45.4 + -6.6. Let k = 54.04 + p. Round k to 1 dp. 2 Let h(x) = -9x3 - 15x*2 - 18x - 10. Let m be h(-10). Round m to the nearest one thousand. 8000 Let r = -0.3 + -40.7. Let x = r - -76. Let g = x - 34.999983. What is g rounded to five dps? 0.00002 Let u = -3.9 - 12.1. Let g = u + 16.26. What is g rounded to 1 dp? 0.3 Let b(p) = -p*3 - 5p*2 - 3p - 2. Let s be b(-3). Let k(q) = q*3 + 5q + 3. Let z be k(-3). Let g be -3 - sz/(-3). Round g to the nearest one hundred. 100 Let d = 0.772 + -0.69. Let y = 5.5679 + 0.2141. Let f = y - d. Round f to zero decimal places. 6 Let h be (-2870)/(-7 + 3 + (-2 - -5)). Round h to the nearest 100. 2900 Suppose 4p - 5p - 2y + 3620 = 0, 3p - y = 10895. Round p to the nearest one thousand. 4000 Let d be (2 - (-3)/(-1))0. Suppose -y - k + 3 = d, -y + k = -2k + 1. Let m be (3/(-6))/(y/(-600000)). What is m rounded to the nearest 100000? 200000 Suppose 8 = 5q + 23, -z - 5q = 335. Let s = -640 - z. Round s to the nearest one hundred. -300 Let j(x) = 10x*2 - 7x - 8. Let w be j(-7). Round w to the nearest one hundred. 500 Let d be (-26000 - 0)/((-7)/(-56)). Round d to the nearest 10000. -210000 Let c(s) = 61570s3 + 2s*2 - s. Let o be c(1). Suppose -d - 528429 = o. Let f be -3 - ((-2 - 1) + d). What is f rounded to the nearest 100000? 600000 Let m = -10 + 9.8. Let b = m - -0.20024. What is b rounded to 4 dps? 0.0002 Let p = 7 - 4. Suppose 0 = -4h + 2 + 2. Let j be 239 + (p - h)/2. Round j to the nearest one hundred. 200 Let m = -28.7 - 4.3. Let q = m - -33.47. Round q to 1 dp. 0.5 Let m = -95567 - -95567.400006. Let t = m - 0.4. Round t to five decimal places. 0.00001 Let l = -4.608 - -4.5. Let s = l + 0.057. Round s to 2 dps. -0.05 Let v = -138 - -140.37. Let w = v + -132.37. Let p = w + 130.91. What is p rounded to one dp? 0.9 Let c = 14 - 9. Let n = c + -12. Let z = n + 6.972. Round z to two dps. -0.03 Suppose -5c = -5 - 5. Suppose cs = 5s - 345. What is s rounded to the nearest 10? 120 Let n = -0.5 - -0.5. Let o = n - -0.1. Let s = 0.095 - o. What is s rounded to 3 dps? -0.005 Let k = 54.85 + 0.15. Let a = 15.957 - -38.981. Let b = a - k. What is b rounded to two dps? -0.06 Let c = 0.24000002 + -0.24. What is c rounded to 7 decimal places? 0 Let b = 0.01417 + -0.015. Round b to three dps. -0.001 Let i = -0.25 - 2.15. Let x = i + 1.3. Round x to the nearest integer. -1 Suppose 2k = -4p - 2k + 64000008, 2k = -4p + 64000004. Suppose 4n = 6n - p. What is n rounded to the nearest 1000000? 8000000 Let z = 50.9999921 - 51. What is z rounded to six dps? -0.000008 Let v be 28565 - 2 - (-3)/(-1). Let a = -7560 + v. What is a rounded to the nearest ten thousand? 20000 Let a = -4.4 + 4.576. Let b = a - 0.1760123. Round b to 6 decimal places. -0.000012 Let q = -1.158 + 0.038. Let d = 1.119774 + q. What is d rounded to five decimal places? -0.00023 Suppose -4 = -5h + 5b + 11, -3h - 5b = -49. Suppose -450000 = 3g - hg. What is g rounded to the nearest 100000? 100000 Let r = -298.488 - 0.512. Let j = 155 + r. Let u = 144.000059 + j. What is u rounded to five decimal places? 0.00006 Suppose 3k + 8 = 4a, a = 4a + 3k - 6. Suppose 5g + 22 = r, -r + 5 = 2g - 6r. Let p be (g/a)/(2/(-60)). What is p rounded to the nearest ten? 80 Let x(s) = 6s + 1000. Let t(r) = r - 2r + 1 - 1. Let g(j) = 5t(j) + x(j). Let k be g(0). Round k to the nearest 10000. 0 Let y = -0.11 + 0.32. Let t = y + -0.209951. What is t rounded to 5 decimal places? 0.00005 Let y = -33 + 32.66. Let k = y + -0.01. Let i = 0.35000029 + k. What is i rounded to 7 dps? 0.0000003 Let h(o) = 633331o + 7. Let i be h(3). What is i rounded to the nearest one hundred thousand? 1900000 Suppose 5g - 4w = 40, -2g - 2w + 2 = g. Let z be (-1)/g + 6718/(-8). What is z rounded to the nearest one hundred? -800 Let m = -155 + 283. Let k = 123.51 - m. Let y = -5 - k. Round y to one dp. -0.5 Let b = 505641.8599972 + -505642. Let i = 11.14 + -11. Let r = b + i. Round r to 6 dps. -0.000003 Let j = 10 - 6. Suppose 0r - r = -j. Suppose 0 = 2a + rt + 398 + 62, 2a - 2t + 490 = 0. What is a rounded to the nearest one hundred? -200 Let d = -501 - -347. Let l = d + 53. What is l rounded to the nearest ten? -100 Suppose -206675 = -18*h - 56555. Round h to the nearest one thousand. 8000 Let r = 0.52 + -0.93. Let o = r + 42.41. Let y = o - 33.8. What is y rounded to 0 dps? 8 Let z = -6.4 + 6.39999981. Round z to seven decimal places. -0.0000002 Let q = -1267.9 + 1364. Let n = 102 - q. Let l = n + -4.79. Round l to 1 dp. 1.1 Let s = -0.01329 + 0.0032. Round s to three dps. -0.01 Let l = 89.05 - 87	{ "pile_set_name": "DM Mathematics" }
0/3 = 0 for i. -161, -290/7, -1, 1 Factor 5a4 + 37220a*3 + 779415a*2. 5a*2(a + 21)(a + 7423) Suppose -2v*5 + 20v*4 + 6344v*3 + 122380v*2 + 116058v = 0. Calculate v. -29, -1, 0, 69 Factor -f*4 - 1259f*3 - 400640f*2 - 2743132f. -f(f + 7)(f + 626)*2 Solve 4b*4 + 11152b*3 + 1523092b*2 + 53353944b = 0 for b. -2646, -71, 0 Find f such that -f*2/9 + 3757f/3 - 22538/9 = 0. 2, 11269 Let -86085x2 + 68838x + 24 = 0. Calculate x. -2/5739, 4/5 Factor -o*4/5 - 393o*3 - 5889o*2/5 - 5887o/5 - 1962/5. -(o + 1)*3(o + 1962)/5 Determine o, given that -2o2/13 + 48522o/13 - 436536/13 = 0. 9, 24252 Suppose -261w3 - 7045w*2/3 + 23496w - 60 = 0. Calculate w. -15, 2/783, 6 Let -v*2/5 - 21032v/5 - 110586256/5 = 0. Calculate v. -10516 Determine j, given that 2j2/9 + 152j/9 + 134 = 0. -67, -9 Let -3y5 - 1425y*4 - 180627y*3 - 2649759y*2 + 2831814y = 0. What is y? -229, -18, 0, 1 Find b such that 5b5 + 79820b*4 + 318082305b*3 - 3826172210b*2 + 9250743040b - 5742732960 = 0. -7988, 1, 2, 9 Suppose o*5/5 + 6o*4/5 - 6o*3 - 4o*2 + 69o/5 + 54/5 = 0. What is o? -9, -1, 2, 3 Determine v, given that v*2 - 857662v + 183896026561 = 0. 428831 Factor -5k3 + 1725k*2 + 25205k - 26925. -5(k - 359)(k - 1)(k + 15) Factor -2c*3 + 2046c*2 - 2040c - 4088. -2(c - 1022)(c - 2)(c + 1) Factor r5 - 29r*4 + 212r*3 + 140r*2 - 2352r. r(r - 14)2(r - 4)(r + 3) Let -6x*2 + 9128x - 3042 = 0. Calculate x. 1/3, 1521 Factor -45y3/7 + 274y*2/7 - 24y/7. -y(y - 6)(45y - 4)/7 Determine b so that -2b*5 - 46b*4 + 156b*3 - 8b*2 - 208b = 0. -26, -1, 0, 2 Factor i*2 - 6939i + 20808. (i - 6936)(i - 3) What is c in 272c*2 - 1460c + 1488 = 0? 93/68, 4 Factor -3k2/2 - 3561249k - 4227498146667/2. -3(k + 1187083)2/2 Factor -j3/5 + 387j*2/5 - 1380j - 33856/5. -(j - 368)(j - 23)(j + 4)/5 What is u in -u*2/3 + 13594u/3 - 46199209/3 = 0? 6797 Determine w, given that -2w5 + 110154w*4 - 110152w*3 = 0. 0, 1, 55076 Solve -6v*4/11 - 152v*3/11 - 878v*2/11 - 1572v/11 - 432/11 = 0 for v. -18, -4, -3, -1/3 Determine u so that 3u2 - 36213u - 36216 = 0. -1, 12072 Suppose 3j4 + 162j*3 - 864j*2 + 1230j - 531 = 0. What is j? -59, 1, 3 Factor -w*5 - 2w*4 + 6w*3 + 4w*2 - 13w + 6. -(w - 1)*3(w + 2)(w + 3) Let 50w*2 - 69004w/5 + 1104/5 = 0. What is w? 2/125, 276 Determine k so that -5k2 - 60315k - 60310 = 0. -12062, -1 Find h, given that -79h2/7 + 1181h/7 + 60/7 = 0. -4/79, 15 Factor 4l3/3 - 5332l*2/3 + 436364l/3 - 9222812/3. 4(l - 1247)(l - 43)*2/3 Factor -3h*4 - 2328h*3 + 7005h*2 - 4674h. -3h(h - 2)(h - 1)(h + 779) What is n in n*2/2 - 245n - 492 = 0? -2, 492 Find v such that -55v5/8 + 2417v*4/4 + 12969v*3/4 + 4653v*2/2 - 44307v/8 - 2511/4 = 0. -3, -6/55, 1, 93 Factor 3s2 - 215073s - 1075440. 3(s - 71696)(s + 5) Factor 2k2/13 - 660k/13 + 634. 2(k - 317)(k - 13)/13 Find z such that 2z5/5 + 12z*4/5 - 11648z*3/5 - 4672z*2 + 17052672z/5 - 33918976/5 = 0. -56, 2, 52 What is k in 9k4 - 7049k*3/3 + 154614k*2 - 163540k + 33800/3 = 0? 2/27, 1, 130 Factor s*3/5 - 2269s*2/5 - 36496s/5 - 29248. (s - 2285)(s + 8)2/5 Find s, given that -2s*3 + 20060s*2 + 40126s + 20064 = 0. -1, 10032 Factor 3m3/5 - 71212m*2/5 + 23737m/5. m(m - 23737)(3m - 1)/5 Let s5 - 2844s*4 + 2033425s*3 - 16122666s*2 + 26156428s - 12064344 = 0. What is s? 1, 6, 1418 Factor 2t2/7 - 320t/7 + 5358/7. 2(t - 141)(t - 19)/7 Solve 635g4/12 - 767g*3/4 + 399g*2/4 - 9g/4 = 0. 0, 3/127, 3/5, 3 Factor -a*3 + 30306a*2 - 30305a. -a(a - 30305)(a - 1) Factor 5d3 - 32000d*2 + 191865d - 287730. 5(d - 6394)(d - 3)*2 Factor 16l*3/5 - 4136l*2/5 - 89831l/5 - 468999/5. (l - 279)(4l + 41)*2/5 Factor 4j*3 - 684j*2 - 1416j + 5536. 4(j - 173)(j - 2)(j + 4) Solve 5h*2 - 10465h + 176460 = 0. 17, 2076 Factor 62746d5/5 + 37648d*4 + 188244d*3/5 + 62752d*2/5 + 2d/5. 2d(d + 1)*3(31373d + 1)/5 Determine y so that -2y*4 + 40483y*3 - 204687008y*2 - 1742603625y - 820125000 = 0. -8, -1/2, 10125 Determine r so that -15544860r4/7 - 44439772r*3/7 + 6567896r*2/7 - 49552r/7 + 96/7 = 0. -3, 2/509, 2/15 Determine d so that -4d4 + 21952d*3 - 30118140d*2 - 21952d + 30118144 = 0. -1, 1, 2744 Factor 4h2/5 + 4052h + 383496/5. 4(h + 19)(h + 5046)/5 Factor 3m4 - 2841m*3 + 676854m*2 - 2010720m + 1336704. 3(m - 472)2(m - 2)(m - 1) Factor 3m*2/5 + 1453824m/5 + 176133685248/5. 3(m + 242304)2/5 What is m in 3m*2/2 - 2247m - 18072 = 0? -8, 1506 Let 34u2 + 161334u + 18980 = 0. What is u? -4745, -2/17 Find w, given that -7w5/5 + 503w*4 - 182669w*3/5 - 8041099w*2/5 - 2625168w + 882180 = 0. -29, -2, 2/7, 195 Find n such that 27n4/10 - 8856n*3/5 + 7056n*2 - 46976n/5 + 20864/5 = 0. 4/3, 652 Factor t*3/5 - 79t*2/5 + 772t/5 - 1632/5. (t - 68)(t - 8)(t - 3)/5 Find a, given that 2a3/13 + 66452a*2/13 - 199370a/13 + 132916/13 = 0. -33229, 1, 2 Determine r, given that -4r3/5 - 2276r*2/5 - 315648r/5 + 2322432/5 = 0. -288, 7 Factor 2p2/3 - 15346p + 92068/3. 2(p - 23017)(p - 2)/3 Determine q so that -48q2 - 873q - 3510 = 0. -195/16, -6 Solve 3a3 + 807a*2 + 23385a - 137475 = 0 for a. -235, -39, 5 Suppose -d*5/3 + 50d*4/3 - 58d*3 - 14228d*2/3 + 43183d/3 - 9610 = 0. What is d? -15, 1, 2, 31 Factor 64b4 + 5807712b*3 + 2903844b*2 + 362980b. 4b(b + 90745)(4b + 1)*2 Let -3s*3 + 756s*2 - 11871s - 26790 = 0. What is s? -2, 19, 235 Suppose -2o2/15 + 830o/3 + 104536/5 = 0. Calculate o. -73, 2148 Suppose 5h4 - 6373535h*3 - 19120635h*2 - 19120645h - 6373550 = 0. Calculate h. -1, 1274710 Find y such that -4y3/3 - 13936y*2/3 - 622012y - 21240408 = 0. -3346, -69 Suppose 4h3 - 4466648h*2 + 1246934022244h = 0. Calculate h. 0, 558331 Determine o so that 5o4 + 4105o*3 + 68695o*2 + 285695o + 221100 = 0. -804, -11, -5, -1 Determine o, given that o*4/4 - 7o*3 - 843o*2/4 - 2727o/2 - 1944 = 0. -9, -2, 48 What is g in 5g3 + 7220g*2 + 6935g - 404040 = 0? -1443, -8, 7 Let 395c3 - 6073c*2 + 7588c + 196 = 0. Calculate c. -2/79, 7/5, 14 Factor -a*2 - 8349a + 50130. -(a - 6)(a + 8355) Factor 22i*2/13 - 262772i/13 + 47776/13. 2(i - 11944)(11i - 2)/13 Factor 5t*2 - 21200t - 42420. 5(t - 4242)(t + 2) Determine o so that 3o3/4 - 4059o*2/4 - 3o/4 + 4059/4 = 0. -1, 1, 1353 Solve -5c4 + 19838c*3 + 47631c*2 + 35728c + 7940 = 0 for c. -1, -2/5, 3970 Suppose 2s5/7 + 306s*4/7 + 2098s*3 + 216878s*2/7 + 390912s/7 + 188416/7 = 0. What is s? -64, -23, -1 Factor 2v2/7 - 1306v/7 - 940. 2(v - 658)(v + 5)/7 Factor 3b4 - 1560b*3 + 192000b*2. 3b*2(b - 320)(b - 200) Solve 2b*4 - 34b*3 + 120b*2 + 232b - 320 = 0 for b. -2, 1, 8, 10 Solve 4m5/7 - 804m*4/7 - 12788m*3/7 - 5316m*2 + 12784m/7 + 38016/7 = 0. -11, -4, -1, 1, 216 Factor l*4 + 477690l*3 + 57047889397l*2 + 228185825340l + 228183914596. (l + 2)*2(l + 238843)*2 Suppose -2o*2/7 - 174o/7 + 29240/7 = 0. What is o? -172, 85 Factor -h*2 - 2137062h - 1141758497961. -(h + 1068531)*2 Solve 5b*2 - 149361b - 119492 = 0. -4/5, 29873 Determine x so that -279x3 - 177x*2 + 471x - 15 = 0. -5/3, 1/31, 1 Factor -8g3 + 5870g*2 - 4396g - 1466. -2(g - 733)(g - 1)(4g + 1) Solve 12m5 - 592m*4 + 3839m*3 - 6003m*2 - 216m + 3780 = 0 for m. -2/3, 3/2, 5, 42 Find p such that p3 + p2 - 20p = 0. -5, 0, 4 Suppose -184z*3 + 678z*2 - 746z + 252 = 0. Calculate z. 63/92, 1, 2 Determine v so that 12v3 + 137388v*2 - 137397v + 34350 = 0. -11450, 1/2 Determine y, given that 196y5 - 604y*4 + 244y*3 + 572y*2 - 440y + 32 = 0. -1, 4/49, 1, 2 Solve -3s5 - 4s*4 + 45s*3 + 30s*2 - 112s - 96 = 0 for s. -4, -4/3, -1, 2, 3 Factor -p*3/3 + 1192p*2/3 - 372421p/3 + 3375610. -(p - 581)*2(p - 30)/3 What is b in -2b5 - 1662b*4 + 5002b*3 - 1674b*2 - 5000b + 3336 = 0? -834, -1, 1, 2 Factor -4f3 - 160424f*2 - 1608812036f - 6432681616. -4(f + 4)(f + 20051)*2 Factor 113675g*2 - 113685g + 10. 5	{ "pile_set_name": "DM Mathematics" }
True Is 86923 a prime number? True Is 311723 a prime number? False Is 69899 a composite number? False Is 446 composite? True Is 15689 prime? False Is 1504093 a composite number? False Is 4937 prime? True Is 7403 a composite number? True Is 47447 prime? False Is 91423 prime? True Is 5639 prime? True Is 187483 prime? False Is 626929 a composite number? False Is 143513 a composite number? False Is 3989 prime? True Is 898701 a prime number? False Is 20431 a composite number? False Is 282221 a composite number? False Is 32117 composite? False Is 66901 prime? False Is 736867 prime? True Is 25969 composite? False Is 990922 composite? True Is 130783 a composite number? False Is 17753 prime? False Is 1151 prime? True Is 150827 a prime number? True Is 20341 a composite number? False Is 845827 composite? True Is 16163 composite? True Is 989 a composite number? True Is 1733 a composite number? False Is 237751 composite? True Is 1543 a composite number? False Is 6353 composite? False Is 675689 composite? True Is 410047 a composite number? True Is 233 a prime number? True Is 10949 a prime number? True Is 44871 a composite number? True Is 28123 a prime number? True Is 232409 a prime number? True Is 943 a prime number? False Is 99443 a composite number? True Is 145891 composite? True Is 6491 composite? False Is 268861 a composite number? False Is 138742 composite? True Is 7583 a composite number? False Is 17153 prime? False Is 6839 composite? True Is 331 a composite number? False Is 325877 a prime number? True Is 109 composite? False Is 41153 prime? False Is 11993 a composite number? True Is 168985 prime? False Is 245783 composite? False Is 261127 a prime number? True Is 102423 a composite number? True Is 427 a prime number? False Is 133847 composite? True Is 67426 a prime number? False Is 981337 prime? False Is 27509 a composite number? False Is 328481 prime? True Is 128449 a prime number? True Is 2531 a prime number? True Is 16411 prime? True Is 20261 a composite number? False Is 52981 composite? False Is 187873 a prime number? False Is 230881 prime? False Is 338659 a composite number? False Is 157559 prime? True Is 44293 a prime number? True Is 12301 composite? False Is 6819 prime? False Is 248371 a prime number? True Is 504173 a prime number? False Is 7586 composite? True Is 3545 prime? False Is 55849 prime? True Is 6113 prime? True Is 2863 composite? True Is 7647 composite? True Is 6667 composite? True Is 4679 composite? False Is 155579 a prime number? True Is 4393 a prime number? False Is 103361 a composite number? True Is 11393 a composite number? False Is 3763 a composite number? True Is 12422 a prime number? False Is 5251 a composite number? True Is 12869 prime? False Is 82027 prime? False Is 166207 composite? False Is 473 composite? True Is 58822 a composite number? True Is 474803 a prime number? False Is 31767 composite? True Is 301123 composite? False Is 9803 composite? False Is 7919 prime? True Is 965087 a prime number? True Is 1574 composite? True Is 3433 a composite number? False Is 30193 a composite number? True Is 33119 composite? False Is 67283 prime? False Is 392383 a composite number? False Is 16871 a composite number? False Is 251 a composite number? False Is 889059 a prime number? False Is 35611 prime? False Is 4327 a composite number? False Is 2459 prime? True Is 18923 a composite number? True Is 85385 prime? False Is 3593 a composite number? False Is 11157 a prime number? False Is 6756863 a composite number? False Is 15701 composite? True Is 2234029 a prime number? False Is 25703 prime? True Is 4195 a prime number? False Is 22853 a prime number? True Is 53017 a composite number? False Is 9941 a prime number? True Is 250643 composite? False Is 222283 a composite number? True Is 53467 a prime number? False Is 133411 composite? True Is 107999 a composite number? False Is 1049 composite? False Is 6157 a composite number? True Is 38827 a composite number? True Is 71387 a prime number? True Is 102761 composite? False Is 1108243 a prime number? False Is 3943 a composite number? False Is 150341 prime? False Is 301021 composite? True Is 222731 prime? True Is 248359 composite? True Is 24733 prime? True Is 852341 a composite number? True Is 2321 a prime number? False Is 774833 prime? True Is 144949 a prime number? False Is 106087 a prime number? True Is 553 a composite number? True Is 2174 composite? True Is 182053 composite? True Is 1622407 composite? False Is 127567 a composite number? True Is 53871 prime? False Is 2921 composite? True Is 4541 composite? True Is 7151 composite? False Is 1361 a prime number? True Is 237901 a composite number? False Is 55477 a composite number? True Is 1931 a composite number? False Is 565007 prime? False Is 14503 a prime number? True Is 1222255 prime? False Is 392911 composite? False Is 22171 composite? False Is 24829 prime? False Is 1177 a prime number? False Is 3739 prime? True Is 6437 a prime number? False Is 5403745 a composite number? True Is 23081 a prime number? True Is 12451 a prime number? True Is 397219 a prime number? False Is 84361 prime? False Is 100173 a prime number? False Is 3163 composite? False Is 12047 a prime number? False Is 1356247 composite? False Is 3491 prime? True Is 1263047 a composite number? False Is 121859 a prime number? False Is 62171 a prime number? True Is 234457 a prime number? True Is 6167 a composite number? True Is 34691 a prime number? False Is 70337 composite? True Is 79138 a prime number? False Is 3351 a prime number? False Is 15787 a prime number? True Is 692513 composite? False Is 26359 a prime number? False Is 407567 prime? True Is 128143 a composite number? True Is 654697 a composite number? False Is 830579 prime? True Is 1034707 composite? False Is 11677 composite? False Is 1191 a composite number? True Is 428303 a composite number? False Is 847453 composite? False Is 5141 a prime number? False Is 20626 prime? False Is 11969 a composite number? False Is 17539 prime? True Is 2845 prime? False Is 19015 composite? True Is 129113 prime? True Is 7103 a composite number? False Is 15551 prime? True Is 643681 composite? False Is 151835 composite? True Is 159719 prime? False Is 73907 a composite number? False Is 113255 composite? True Is 1589935 a prime number? False Is 780407 composite? True Is 2321 composite? True Is 28081 a composite number? False Is 91909 prime? True Is 146651 a prime number? False Is 9221 prime? True Is 14971 a composite number? True Is 77681 prime? True Is 55313 composite? False Is 152939 prime? True Is 349073 a composite number? True Is 14941 prime? False Is 1511 composite? False Is 9649 a prime number? True Is 27533 a composite number? True Is 11197 prime? True Is 105785 prime? False Is 13607 prime? False Is 74759 composite? False Is 527099 composite? False Is 428483 composite? True Is 9487 prime? False Is 50719 a prime number? False Is 27893 a prime number? True Is 2923 composite? True Is 186389 prime? False Is 46043 prime? False Is 291077 prime? True Is 6043 composite? False Is 180589 composite? True Is 281665 a prime number? False Is 6389 composite? False Is 49183 a prime number? False Is 11863 a composite number? False Is 205473 a prime number? False Is 33227 prime? False Is 1235909 a composite number? False Is 16249 a composite number? False Is 1362131 a prime number? True Is 3691 composite? False Is 50497 a prime number? True Is 3371 prime? True Is 14281 composite? False Is 45281 composite? False Is 736717 a composite number? False Is 3761 composite? False Is 3329 a prime number? True Is 176849 a composite number? False Is 25435 prime? False Is 5077 a composite number? False Is 42491 composite? False Is 175543 a composite number? False Is 107083 a prime number? False Is 37803 a composite number? True Is 134801 prime? False Is 2203 a prime number? True Is 9793 composite? True Is 6549583 a composite number? False Is 2579 a composite number? False Is 46919 composite? False Is 216877 prime? True Is 132477 a composite number? True Is 4783 a prime number? True Is 22769 a prime number? True Is 5353 composite? True Is 38707 a composite number? False Is 493843 a composite number? True Is 21971 a prime number? False Is 541 composite? False Is 317045	{ "pile_set_name": "DM Mathematics" }
2 + d + 15. Is m(p) composite? True Let d be 3 + -2 + 58 + -1. Suppose d = 4r - 138. Is r composite? True Let f be (-4)/(-20) - 18/(-10). Is ((-147)/(-6))/(1/f) composite? True Suppose c + 1 = 6. Suppose -cg + 21 = -224. Is g a prime number? False Suppose s = -2u + 13 - 90, -2u - 5s - 81 = 0. Let v be 4/(-6) - 53/(-3). Let r = v - u. Is r composite? True Let c be 4/14 + 48/(-21). Is c/(-4) - 630/(-12) composite? False Suppose 5j - 1100 = -3h, 2h - 564 - 95 = -3j. Is j composite? False Let s(m) = 37m + 7. Is s(3) composite? True Suppose 0 = r - 3l - 743, -3r + 2l + 2l + 2229 = 0. Is r composite? False Let q = 4 - 1. Suppose 0 = qs + 5 - 116. Is s a prime number? True Let s(l) = 25l2 + 3l - 7. Is s(-4) prime? False Suppose f = -3g + 2g, -5g + f - 12 = 0. Let s(r) be the third derivative of -13r4/24 - r3/2 - 5r2. Is s(g) a prime number? True Let n = 3 - -3. Suppose -nm = -2m - 1772. Is m a composite number? False Is 2/5 - 1 - 135592/(-20) prime? True Suppose -3n = -n + 2y - 194, 5y = -20. Let r = n + -69. Suppose -4i - 26 = -2p, p + r = 3p + 2i. Is p composite? True Let t be 2/5 + (-17)/5. Suppose 0 = -2j - 2a - 28, 0j + 5a + 57 = -4j. Let s = t - j. Is s a composite number? True Suppose 4z + 8 - 24 = 0. Suppose -4y + 1174 = c, -1176 = -0y - zy - 2c. Is y composite? False Let s = 306 + 2131. Is s a prime number? True Suppose 0 = 2k - 3k - 4l + 161, 179 = k - 5l. Is k a prime number? False Let f = 2 - -1. Suppose fk = 3b - k - 173, 118 = 2b - 4k. Is b a prime number? False Let z be 929/5 - 9/(-45). Suppose -143 = -p + z. Is p a prime number? False Is (11/1)/((-5)/(-85)) prime? False Let m be -183/12-2. Let r(x) = -32x - 1. Let w be r(3). Is (-4)/(-18) - w/m composite? False Let d(l) = 8l*2 - 41. Is d(-18) prime? True Let w(a) = 9a*3 + 7a*2 - 17a + 3. Let o(l) = 4l3 + 3l*2 - 8l + 1. Let v(n) = -7o(n) + 3w(n). Is v(-4) composite? True Let r = 4 - 0. Let a(p) = p*2 - 12p - 10. Let x be a(13). Suppose -46 = xj - rj. Is j a prime number? False Suppose 2l - l = f - 3, l - 3f = -13. Suppose 0 = -7w + lw. Suppose 5d - 94 - 391 = w. Is d a composite number? False Let w(y) be the second derivative of 5y4/3 - y2/2 + y. Is w(1) a prime number? True Let g(s) = s + 3. Let k = -5 + 9. Is g(k) a prime number? True Let p(n) = -4n + 5n + 5 + n*3 - 2n + n*2. Let v be p(0). Suppose 5s = -vm + 270, -4s + 0 = -4. Is m a composite number? False Let y be (-2)/(-3) + (-40)/(-30). Is (y - -109)2/6 a composite number? False Suppose -2u = -5d - 1443, 710 = u - 5d - 14. Is u prime? True Suppose 0z - z - 1 = 0. Is (-1011)/(-6)(z + 3) a prime number? True Let v(r) = 2r2 + 9r. Let h(i) = i*2 - 5i + 7. Let m be h(5). Let x be (-2)/m - 75/7. Is v(x) composite? True Suppose 2 - 89 = -q. Suppose -t + q = 4x - 0t, -4x + 84 = 4t. Is x a composite number? True Suppose 2f + 6 = 0, -f = -5z + 78 + 40. Is z prime? True Let n = -37 - -72. Is n composite? True Suppose 0 = -5z - 34 - 16. Suppose -10 + 205 = 5v + 3i, 0 = 2v - i - 78. Let f = v - z. Is f composite? True Let k = 1 - -2. Suppose 0h = kh - 273. Is h a prime number? False Let s be -10 - (-1 - (0 + 0)). Let j(p) = -2p3 + 5p*3 + 7p - 2p3 + 8 + 35p*2 - 25p*2. Is j(s) composite? True Let v(h) = -7h*3 - 10h*2 + 5h + 17. Let r(o) = -4o3 - 5o*2 + 2o + 8. Let g(d) = 5r(d) - 2v(d). Is g(-3) a composite number? True Is (-16314)/(-14) - 12/42 composite? True Let p = 526 + -131. Is p prime? False Let q(d) = -d*2 - 5d - 1. Let c be q(-2). Let w be c2(-159)/(-15). Let n = -71 + w. Is n a composite number? True Suppose -7c + 4c = -240. Suppose -4o - 3p = -691 - 240, -5o - 3p = -1160. Suppose -5j = 3u - o - 31, -j = -5u - c. Is j a composite number? True Is (-69)/(-6)(0 - -6) prime? False Suppose -197 = -3j + j + b, -j + 91 = b. Let t be 45/(-4)12/3. Let u = j + t. Is u composite? True Let r = -242 + 757. Is r composite? True Suppose -2m - j + 93 = 0, m - 3m + 3j = -113. Is m composite? True Suppose -3t = -4 + 1. Is ((-6)/18)/(t/(-231)) prime? False Suppose -p = -1 - 0. Let m be 263/(-12). Is 105/(-10)(m + p) composite? True Let t(p) = 3p*2 - p - 1. Let c be t(-2). Let y = c - 8. Suppose -5w + 5 = -y. Is w a prime number? True Let y = 7 + -2. Let x be (-6)/y140/2. Is ((-17)/4)/(3/x) a prime number? False Let a(v) = -v - 3. Let h be a(-8). Suppose 10 = hz - 10. Is -2 - 6(-86)/z a composite number? False Suppose -13 = -3m - 4. Suppose -3t + 4b = t, mb = -4t + 14. Is t/10 - (-222)/15 composite? True Let k be 1/(-4) + 41/4. Let o(u) = -u*3 + 11u*2 - 10u. Let l be o(k). Suppose lv + 33 = v. Is v a composite number? True Let g(i) = 26i2 + i + 1. Let c be g(-1). Let v = c - -267. Is v composite? False Is 1/(-5) + (-1492)/(-10) prime? True Let g(a) = a3 + 6a2 + 3a + 2. Let c be g(-5). Suppose -v = -19 - c. Is v composite? False Let c(k) = k - 13. Let b be c(10). Let d(s) = -3s3 - s2 + 2s - 1. Is d(b) a composite number? True Suppose 4z + l - 31 = 4l, 2 = 3z + 2l. Suppose -j = -zj + 45. Is j a prime number? False Let a be (10/(-30))/((-1)/15). Suppose 3z - 995 = 2o, z + 4o + 1320 = az. Is z composite? True Suppose -5k + 704 = -2001. Is k a composite number? False Let h = 62 + -132. Let u = 261 + h. Is u a composite number? False Let j(s) = -s*2 - 9s - 4. Let b be j(-8). Suppose 4g = r + 4r + 801, 2r = bg - 798. Is g a composite number? False Let u be (4 - 7/2)0. Suppose u = -4v - 2v + 966. Is v composite? True Suppose -2v - j + 1 = -6, -3v - 4j = -3. Suppose vk = -0k + 1255. Is k prime? True Let b = 459 - 66. Suppose 0 = -5s + b - 118. Is s composite? True Suppose -2z = -4z + 254. Is z a composite number? False Let w(g) = -g + 18. Let m be w(15). Suppose mo = 2o + 149. Is o prime? True Let p = 6 + -11. Let f(w) = 9w*2 + 2w - 4. Is f(p) a prime number? True Let a be -1 + 4 + 0 + -1. Let y be (1/(-2))/(a/20). Let j(m) = m*3 + 9m*2 - 6m - 3. Is j(y) prime? True Suppose 5i + 3z = 2200, 178 = -4i - 2z + 1940. Is i prime? True Is (-7 - 1139)1/(-2) composite? True Let i(f) = f3 - 2f*2 + f - 2. Let l be i(3). Suppose -3b - d = -6, 5b + 2d - l = -0d. Suppose -bp - p + 93 = 0. Is p a composite number? False Let j(v) = -v*3 + 7v*2 + 3v + 10. Let f(u) = 3u - 2. Let m be f(3). Is j(m) a composite number? False Let l(o) = -o2 + o + 2317. Is l(0) composite? True Suppose 0 = -5a + 5i + 175, 0 = -a + 3a - 3i - 72. Suppose 0 = -3t + 30 + a. Is t prime? False Suppose -12 = 3h - 3l, -5l + 14 = -4h - 0. Let i = -12 - h. Is -268(-1 - i/8) a composite number? False Let p be 3 + -383 + 0 + 3. Let z = p + 714. Is z prime? True Let g(a) = a3 + 9a*2 + a + 6. Let q be g(-9). Is ((-22)/6)/(q/171) a prime number? False Suppose -j = -x, -x + 12 = j - 6x. Let i = j + 7. Suppose -222 = -h - iv + 5v, 4h = -v + 893. Is h a prime number? True Let c = 0 + -5. Suppose y + 1 = 5q + 5, -2y = -2q. Is (c/2)/(q/4) a prime number? False Let k = 69 - -28. Is k prime? True Let d(m) = -m*2 - 6m + 5. Let t be d(-7). Let r be (-228)/(-14) + t/7. Suppose 4s - 12 = 0, -2s = -k + 3s + r. Is k composite? False Suppose t - 3w + 7 = 0, 2t + t - w + 5 = 0. Let i(a) = -5a + 1. Let o be i(1). Is t/2 + (-342)/o a prime number? False Suppose 4n + 0n + 28 = 0. Let s = n + 21. Is s composite? True Let c(b) = 10b + 2 + 0 + 0 - 259b. Is c(-1) a composite number? False Let w be (6/1)/(3/56). Let g = -11 - -16. Suppose 0 = -2l - gd + w, 0l + 2d - 106 = -2l. Is l prime? False Let d(h) = h2 - 3h + 2. Let f be d(3). Suppose 0r + 222 = fr. Is r composite? True Suppose h - 2h + 4j - 8 = 0, -8 = 4h - 4j. Let x = 19 - h. Is x a prime number? True Suppose 0 = -3k + 2x + 3x + 31, 0 = x + 5. Suppose -l + 92 = -2a - 3a, l - ka = 83. Suppose -3f + 411 = 4o, 2f + l = 4o + 331. Is f prime? False Suppose -84 = 4o - 0o - 2u, -2o - 30 = -4u. Let l = o + 78. Is l prime? False Let m(i) = i - 12. Let p be m(9). Is 19 - (p - (-3 + 0)) a composite number? False Is 0/6 + (323 - 2) prime? False Let k = 583 + -296. Is k a composite number? True Let g be -14-1(-1)/(-2). Let q(z) = -4 + 4 + 2 + z2 - 2z*2 + 10z. Is q(g)	{ "pile_set_name": "DM Mathematics" }
alse Let i = -41 + 44. Suppose 7l = il - 4t + 744, 188 = l - t. Is l a composite number? True Let n(v) = 3519v*2 - 7v + 19. Is n(2) a prime number? True Let d(y) = -425y3 - 9. Is d(-4) composite? False Let x(c) = c3 - 7c*2 - 10c + 10. Let d be x(7). Is (-24)/d + 2 + (-6703)/(-5) composite? True Suppose -2t + 81856 = -g, 40935 = -63t + 64t - 4g. Is t a composite number? False Let i(p) = -2p + 25. Let x be i(11). Suppose -xm = -s + 616 + 1139, 5s + 3m = 8811. Suppose -y - y + 6 = 0, 4y - s = -3j. Is j a prime number? False Suppose 0 = -5c - 15, -2c = 5d - c - 7. Suppose u + 3q - 394 = 0, 5q - 46 = du - 823. Is u prime? False Suppose -4r + 4i = -2r - 21038, -2r + 2i + 21036 = 0. Is r composite? True Let o be (6/(-8))/(12/144). Is (-2)/3 + (-6333)/o a prime number? False Suppose h - s = 49, -1 = -4s + 7. Let r = h + 110. Is r prime? False Let z(b) = 44b3 + 3b*2 - b + 1. Is z(3) a prime number? True Let k(n) be the second derivative of 0 - 3/2n*2 - 1/12n*4 + n + 13/6n3. Is k(11) composite? False Let b(a) = -a3 + 10a2 + 9a + 1. Let m = 9 - 5. Suppose k - 25 = -f + mk, 0 = -4f + k + 45. Is b(f) composite? True Let f be (-50)/4(-4 - 6). Let q = 1224 - f. Is q a prime number? False Suppose 4s - 12161 = 18707. Is s prime? True Suppose 21z = -99 + 6756. Is z prime? True Let x(z) = -2z*2 - 4z + 1. Let k be x(-2). Let h(u) = -2u + 2. Let w be h(k). Suppose w = -4d + 3d, 5l = 4d + 235. Is l a prime number? True Let n(l) = 18l*2 - 4l + 5. Let m be n(5). Suppose 0v + 3v - 3p - 1317 = 0, -2p - m = -v. Is v a composite number? False Suppose -4k = -5f - 21536 - 23965, -4k + 45491 = -3f. Is k a prime number? True Suppose r + 106 = -w - 550, -1975 = 3r - 4w. Let k = r + 1244. Is k composite? False Let i(g) = 3g - 3. Let m be i(-3). Let d(b) = -b3 - 8b*2 - 3b + 5. Let t(r) = -2r3 - 17r*2 - 6r + 10. Let h(l) = -5d(l) + 3t(l). Is h(m) prime? False Let k(h) = -3h3 - 35h*2 - 21h + 95. Is k(-24) a composite number? False Let q be (-11457)/27 - (1 - (-4)/(-3)). Let x = q + 1617. Is x composite? False Let p(b) = -b*2 + 3b + 11. Let x be p(5). Is (-5 - (-126)/24)3188/x prime? True Let v = -175 - -208. Is v a composite number? True Let a = 20 - 12. Let n(m) = m2 - 9m + 8. Let o be n(a). Suppose ov + 62 = 2v. Is v a composite number? False Suppose 0 = -2o - 10, 6x = 4x - 2o + 20. Suppose 2k - 2m = -28, -3k - x = -5m + 23. Let r = 65 + k. Is r a composite number? True Suppose 7d - 4d + 2l = 1251, l + 1260 = 3d. Is d prime? True Let u(f) = -f3 + f2 - f + 698. Is u(0) a prime number? False Let s(u) = -3u + u - 5u*2 + 4u*2 - 1 - 9u*3. Let o be s(-1). Is (-997)/(-9) - (-2)/o a composite number? True Let t = 3 + 8. Suppose -4o = t - 3, 0 = -5f - 2o + 1766. Suppose 5y - f = 201. Is y a prime number? False Suppose f - 92 = 92. Suppose -4u + f = k + 44, -16 = -4k. Is u composite? True Let g = 9 + -15. Let m = g + 9. Suppose 83 = -n + mn - 3p, 3n - 3p = 120. Is n a composite number? False Let m(p) = 3 + p3 - 4p*2 + 2p - 4p + 6p*2 + p. Let s be m(4). Let t = 306 - s. Is t composite? False Suppose -60t + 54t - 24 = 0. Let q(n) = -71n + 9. Is q(t) prime? True Let y = -16 + 26. Suppose 2 - y = -4a. Suppose -3r + 149 = -ar. Is r a prime number? True Suppose -3u + 3b + 70368 = 0, -3u - 2b - 4296 + 74679 = 0. Is u a prime number? True Suppose -5k + 14 = -1, -2k = -2d + 5086. Let t = d + -1753. Let v = 1148 - t. Is v composite? True Suppose 4x + 40 = 5r, -5r + r - 5x - 9 = 0. Suppose -z - 6605 = -4i, 0i + 2i - 3298 = -rz. Is i a prime number? False Is (11971 - 12)/(2 + (2 - 3)) a composite number? False Suppose -3n - 5q + 38 + 13 = 0, -5n = 2q - 66. Suppose -5r - 10318 = -nr. Let c = -901 + r. Is c a prime number? False Suppose 0 = 3u - 14161 - 227. Let w = u + -3261. Suppose 6z = 11z - w. Is z a prime number? True Let c(u) = u + 95. Suppose 0g + 3g = 0. Suppose g = -0s + s. Is c(s) a composite number? True Let q(u) = u + 13. Let l be q(-10). Suppose -j = 0, -2r - lr + 20 = j. Suppose -2c - g = -4g - 1049, 5c + rg = 2565. Is c composite? True Suppose 3k - m - 16 = m, 2k - 9 = m. Suppose -z - kz = -12, -g = -3z + 9. Suppose 0 = 4i - j - 3473, gi + 4j = 8i - 4333. Is i prime? False Suppose -48p - 32557 = -207709. Is p composite? True Let n = -5 - -4. Let b = n + 5. Suppose 316 = ba - 2r, -5a + 6a + 2r - 79 = 0. Is a prime? True Let g(j) = -2j2 - 4j - 14. Let c be g(-5). Is (-1)/4 + (-1639)/c a composite number? False Suppose -2o - 14888 = -3f - 40095, -3f = 5o - 63028. Is o prime? False Let u = -2528 + 14159. Is u prime? False Let i = -1079 - -1699. Suppose 4u - 2u - i = -2n, -2u - n = -615. Is u composite? True Let u be ((-9)/(-6))/(2/(-4)). Let r be (-12)/42/6. Is r/(u + 542/181) composite? False Let m = -1469 + 2138. Is m/(-3)(-7 + 6) a prime number? True Suppose d = 4l + 13, -3d = 3l - 2l + 13. Is 4/3 + (-953)/d a composite number? True Let b be (-16)/(-7) + (-8)/28. Suppose -5m = c - 1492, m - bc - 132 = 162. Suppose m = 2t - 34. Is t prime? False Let g(t) = -t3 + 10t*2 + 2t - 4. Suppose 3 = 3w - 0w. Suppose 5q - 2l - 33 = 0, 0 = l + 3 + w. Is g(q) composite? False Suppose -h + 14 = -3o, o - 2h - 2h = 10. Let l(w) = -3w*3 - 4w + 5. Is l(o) composite? False Let z(l) = 395l + 5. Let j = 15 - 13. Let y be z(j). Suppose 0 = 4x - x - y. Is x a composite number? True Let d(a) = -a*2 - 5a - 4. Let f be d(-4). Is (-2)/(-8) + f + (-5298)/(-24) prime? False Suppose -3i + 15 = 0, 2i = -5z - 0i + 35. Suppose -m + 43 = m - 5c, zm - 97 = 2c. Let n(v) = -v3 + 20v*2 + 7v - 25. Is n(m) a prime number? False Let g = -217 - -415. Let t = g + -140. Is t prime? False Let u be ((-276)/36)/((-1)/(-12)). Let h = 231 + u. Is h prime? True Suppose -1666 = -2d + 4d. Let g = 2884 + d. Is g prime? False Suppose -14k + 3k + 88 = 0. Is (1/k10)/((-2)/(-6488)) prime? False Is 3512/828 - 5 composite? True Let x(o) = -979o + 6. Let k be x(-3). Let i = k + -1856. Is i prime? True Is ((-15121)/2)/(3/(-6)) composite? False Let p = -511 - -304. Let x = p - -627. Let j = x + 499. Is j composite? False Is 2/28 + (-21719295)/(-546) a composite number? False Let q(o) = 6o*3 - 5o*2 - 3o + 4. Let r be q(-4). Let a = r - -1229. Is a a composite number? True Let h(d) be the first derivative of d*3 + 2d*2 - d + 3. Suppose 0 = -2z - 3 - 1. Is h(z) prime? True Is 17/((-85)/88702)(-20)/8 a prime number? True Let c = -8056 - -14471. Is c prime? False Let q be (8 - (-7)/(-1)) + -6 + 0. Let d(h) = -10h*3 - 6h + 5. Is d(q) a composite number? True Suppose 56827 = 3q + a, 45q - 40q = 4a + 94723. Is q prime? False Suppose -d + 206 = -3n, 0d - 4d = -n - 54. Let j = n + 371. Suppose -3f + j = -17. Is f prime? False Let t be 6(3 + 3/(-2)). Suppose -6b + t = -3b. Suppose -1735 = -2x + 4u - 3u, 0 = -x + bu + 880. Is x prime? False Suppose -11v = -0v - 40315. Is v a prime number? False Suppose 0 = -7s + 312408 - 34795. Is s a composite number? False Let v = 3 + 0. Suppose vp + 6 = 21. Suppose -5l - 490 = -2s - 3s, ps - 445 = -4l. Is s a composite number? True Let l be -13/64. Let b be l/5 - (-1744)/10. Suppose -2h - 40 = -b. Is h composite? False Suppose -3v = -5a - 296, 0 = -v - 3a + 59 + 21. Let u = -62 + v. Let j = 91 + u. Is j prime? False Is 1053035/45 - (-1)/((-63)/(-14)) prime? False Let z(v) = v*2 + 5v + 3. Let k be z(-5). Suppose 10 = kl - 8. Is (-21)/7(-586)/l a composite number? False Let y(b) = b*3 + 5b*2 + 24b - 7. Suppose 4p - 46 = -14w + 11w, -3w + 4p + 14 = 0. Is y(w) prime? True Let h(g) = g + 1. Let p be h(10). Let y(d) = d - 11. Let j be y(p). Is (-2 + j)-2 + -2 a composite number? False Let y = -31 - -46. Let s be ((-44)/(-6))/(10/y). Is 4 - s-78 - -4 a composite number? True Let x(g) = -32 - 7 + 2 + 61g. Is x(8) composite? True Suppose -l = 3a + 2a - 19789, 5a - 19773 = 3l. Is a composite? True Let o be 125/(4/81). Let f = o + -119. Is f a prime number? True Suppose 0 = n + 4u - 1706 - 1945, 3n = u + 10979. Is n a prime number? True Let t(p) = 21432p*2 - p + 2. Is t(1) prime? True Suppose 4v - 176 = -4	{ "pile_set_name": "DM Mathematics" }
git of y(0)? 4 What is the tens digit of 2/(-4) + 855/10? 8 Suppose 2g + 2s = -6, 4g - 5s + 45 = -g. What is the units digit of 146/g-3? 3 Suppose -4t = -5u - 895, 337 + 91 = 2t + 4u. What is the tens digit of t? 2 Suppose -3k + 211 = 4r, -26 = r - 2k - 76. What is the units digit of r? 2 Let m(b) be the first derivative of -b3/3 + 7b*2/2 + 5b + 2. Let d be m(6). Let s = d - 8. What is the units digit of s? 3 Let n be (-120)/21 + 2/(-7). Let z = n + 21. Let x = -9 + z. What is the units digit of x? 6 Let m(v) = v. Let g(q) = 11q + 5. Let z(u) = -g(u) + 2m(u). Let k(i) = 19i + 9. Let h(c) = 6k(c) + 13z(c). What is the tens digit of h(-9)? 1 Suppose 5l + n = 19, 0l - 4l + 3n = 0. What is the units digit of l? 3 Suppose -2i = y + i + 7, 6 = -2y - 4i. Let w(f) = f*3 - 4f*2 - 5f. Let h be w(y). Suppose h = -2t + 9 + 5. What is the units digit of t? 7 Suppose 0 = y - 35 - 113. What is the hundreds digit of y? 1 Let b(n) = 11n*2 - 3n + 10. Let j(c) = 5c2 - 2c + 5. Let r(q) = -4b(q) + 9j(q). Suppose 3p - 5p = -12. What is the units digit of r(p)? 5 Suppose -b + 6 = 1. Suppose 3j = j - 10, bj = 4i - 141. What is the units digit of i? 9 Let q(a) = -5a + 4a + 0a2 + 6 + a2. Let y(d) = -d3 - d2 + d. Let t be y(0). What is the units digit of q(t)? 6 Let s(l) = l - 6. Let y be s(3). Suppose -5w - 7 = 3. What is the units digit of (-64)/(-12)y/w? 8 Let x(m) = 4m2 + 12m - 10. What is the hundreds digit of x(-9)? 2 Let g(i) = 8i - 18. What is the units digit of g(8)? 6 Let y(d) = d3 + 7d*2 + 8. Suppose 0 = 4z - 2r + 22, 3z + 4 = 2r - 11. What is the units digit of y(z)? 8 Suppose 4j - 13 = 19. Let b(s) = 2s3 + 2s + 1. Let w be b(-1). Let f = j + w. What is the units digit of f? 5 Suppose -x - 4 = -2y - 13, -2y = 5x - 33. Suppose 5q = -3m - 7, x = 4m - 5q - 7. What is the units digit of (16 - m)6/10? 9 Suppose -93 - 43 = -8s. What is the tens digit of s? 1 Let m(c) = -4c3 + c2 + 2c + 1. Suppose -2p - 3p - 5 = 0. Let t be m(p). Suppose tq - 18 = q. What is the units digit of q? 6 Suppose -1939 + 707 = -7t. What is the tens digit of t? 7 Let o = -5 + -1. Let n(h) = h2 + 3h - 4. Let g be n(o). What is the tens digit of -30(3 - g/4)? 1 Let d be (-1)/(-7) - 4654/91. Let h = d + 89. What is the units digit of h? 8 Suppose 8k = 14k - 588. What is the units digit of k? 8 What is the hundreds digit of (-15)/(0 + 1)(-31 + 17)? 2 Suppose 4w - 5z - 60 = 0, 0w - 2w + 4z = -36. What is the units digit of w? 0 Let m(h) = -4h*3 + 12h*2 - 22h - 2. Let t(w) = w*3 - 4w*2 + 7w + 1. Let k(g) = 2m(g) + 7t(g). What is the units digit of k(-5)? 3 Let r = 10 - 15. Let o(v) = -v*3 - 5v*2 - 2v + 3. What is the tens digit of o(r)? 1 Let k(o) = 2o - 3. Let v = 0 + 4. Suppose 12 = -0f + vf. What is the units digit of k(f)? 3 Let f be 7/28 - (-29)/(-4). Let m = -2 - f. What is the units digit of m? 5 Suppose q + 2n - 3n = 54, -4q - 2n = -216. What is the tens digit of q? 5 Suppose -6 = 3q - 5q - 2o, 18 = q - 2o. Let t(u) = u2 - 6u + 7. What is the units digit of t(q)? 3 Let q = 16 + -9. What is the units digit of 2/(-4)2 + q? 6 Let g = -94 - -270. What is the hundreds digit of g? 1 Let i be (0/(2 + 0))/2. Let g(q) = 2q + 2 + 0 + i - q. What is the units digit of g(3)? 5 Suppose -j - 3q + 34 = 0, 0q - 4q = j - 37. Suppose x + 0x - j = 0. What is the units digit of x? 5 Let j = 12 + 6. What is the units digit of j? 8 Suppose 3j = x - 2 - 3, 2j + 25 = 5x. Suppose jz + 32 = z. What is the tens digit of z? 3 Let d(m) = m*2 + 3m + 6. Let q be d(-5). Suppose 5y - q = 9. What is the units digit of y? 5 Let a(s) = -8s*3 - s + 3s*3 - 2s3 + 3 - s2 + 5s. Let k be a(-2). Let t = 66 - k. What is the tens digit of t? 1 Suppose -3n = 0, 0 = g - 3g + n + 4. Suppose 5o - 3 - 7 = k, -4k + 14 = -go. What is the units digit of o? 3 Suppose 2n = 3 + 5. What is the units digit of (-1 + -9)/(2 - n)? 5 Suppose -9j - 10 = -4j. Suppose 0z = 5z - 10. What is the units digit of j - -10 - (1 + z)? 5 Suppose 0 = 2x + 4j + 14, x - 19 + 5 = 5j. Let w be (1 + 2)/(x - -2). Suppose 4i = 3i + 4p - 15, -wi - 4p + 19 = 0. What is the units digit of i? 1 Let i(s) = s3 + 6s*2 + 4s - 3. Let b be i(-5). What is the units digit of 3/6b - -45? 6 Let r(t) = -8t + 1. Suppose -64 = -4c - 0c. Suppose -x - c = 5q, x = 3x - 2q - 4. What is the units digit of r(x)? 9 Suppose 0 = -2v + 3o + 361, 0 = 5v - v + o - 729. What is the tens digit of v? 8 Let d(b) = b*2 + 5b + 4. Let v be d(-6). Let y(f) = -12f + 1. Let j be y(-2). What is the units digit of (-10)/j + 44/v? 4 Let a = -14 - -38. What is the units digit of a? 4 Suppose j - 4 = -j + 4a, 4j - a - 1 = 0. Suppose -5c + jc - 2y + 29 = 0, 2y = 4. What is the units digit of c? 5 Suppose -2y - y - 54 = 0. Let q = 5 + -3. What is the units digit of y/(-3)2/q? 6 Let x(s) = s2 + 2. Let k be x(-4). Suppose k = -3h + h. Let i = h - -15. What is the units digit of i? 6 Let k be (-66)/(-14) - 4/(-14). Suppose -5h + 4h + 4 = 0. Suppose -kb + 2b + 6 = -z, hz - 41 = -b. What is the units digit of z? 9 What is the tens digit of -1(-63 + (-1 - -3))? 6 Suppose 0 = 3k + 2y - 159, 11k - 260 = 6k - 5y. What is the tens digit of k? 5 Let u(l) = 4l - 1. Let q be (4/(-6))/(2/(-3)). What is the units digit of u(q)? 3 Let u = -3 - -6. Let w(o) = 0 - 3o - o + uo - 2. What is the units digit of w(-7)? 5 Let v(z) = -z + 7. Let m = 21 - 14. Let r be v(m). Suppose rb - 2b = -18. What is the units digit of b? 9 Let p(z) be the first derivative of z*3 + 3z*2/2 - 3z + 3. What is the tens digit of p(2)? 1 Let b be (0 + 3)(-7 + 6). Let z be 80(-2)/6b. Suppose -5j + 4c = -z, 0 = j - 2j + c + 16. What is the tens digit of j? 1 Let k(n) = 6n2 + n + 2. Let y be k(3). Suppose -4i + y = 3. What is the tens digit of i? 1 Suppose 5t - 41 - 4 = 0. Let n(s) be the third derivative of -s4/24 + 2s3 - s2. What is the units digit of n(t)? 3 Let a = 1 + 3. Suppose 4g - 4 = at, 0t - 5t - 2g = -16. Suppose -tl + 30 = l. What is the units digit of l? 0 Suppose -3n + 0z + 399 = -z, -2z = 2n - 258. What is the units digit of n? 2 Let x(y) = y + 10. Let n be x(-7). Suppose 0 = 4a + v - 10 - 3, -v = -4a + n. What is the units digit of a? 2 Let j(c) = c2 - c + 16. Let o(f) = f2 - f + 15. Let w(z) = -6j(z) + 7o(z). Let x be w(0). Suppose -40 = -xb + 4b. What is the units digit of b? 8 Let m(u) = -15u - 30. What is the units digit of m(-10)? 0 Let d(p) = 5p - 1. Let o be d(3). What is the tens digit of 1(o - (1 - 0))? 1 What is the units digit of -1 - (4 + 116/(-1))? 1 What is the hundreds digit of 2/(8/292 + 0)2? 1 Let w(r) = -r*3 + 9r*2 + 13r - 6. What is the tens digit of w(10)? 2 Suppose -120 = -0f - 3f + 2h, f - 40 = 3h. What is the units digit of f? 0 Let r = 36 - 5. What is the tens digit of r? 3 Let a(v) = v*2 - v + 5. Let t be a(0). Suppose -ti - 3r + 12 = 0, 2i - 6r + 3r = 9. Suppose -2z - 7 = 3, -iw - 16 = 5z. What is the units digit of w? 3 Let y = 33 + -22. Suppose -c + y = -0. What is the units digit of c? 1 Let f be (-6)/15 + 156/(-10). What is the tens digit of 110/3 - f/(-24)? 3 Let z(v) be the first derivative of v5/60 - v4/24 - v3/2 - v2 - 3. Let o(r) be the second derivative of z(r). What is the units digit of o(4)? 9 Suppose 79 + 38 = 9o. What is the tens digit of o? 1 Let b = -8 - -10. Let k(c) = -3c2 - 2c + 3. Let v(g) = -9g2 - 6g + 8. Let n(a) = 8k(a) - 3v(a). What is the units digit of n(b)? 6 Let l(p) = p*3 - 3p*2 - 10p - 6. Let r(i) = -i*2 - i - 1. Let z(v) = -l(v) + 5r(v). What is the units digit of z(-4)? 3 Suppose -41 = -4a + 5d, 3d + 2d + 13 = -3a. Let v be 2(a - 1)2. What is the units digit of 1423/v? 7 Let p = -8 - -12. Suppose 14 = pt - 158. What is the tens digit of t? 4 Suppose 2a - 12 = 3j, 7 = a - 3j + 2j. What is the units digit of a? 9 Let r(w) = -3w - 1. Let n be r(-1). Suppose 3m - n = 4. What is the units digit of m? 2 Let v be (-2 - -1)/(4/16). Let f(d) be the second derivative of d5/20 + d4/3 + 5d2/2 + 2d. What is the units digit of f(v)? 5 Let t = 316 + -155. What is t	{ "pile_set_name": "DM Mathematics" }
est common factor of a and w? 11 Let w be (-11/(-3))/((-5)/(-240)). Let s be 0 - 0 - 4/(-2). What is the highest common factor of w and s? 2 Let m(z) = -2z - 10. Let j be m(-7). Suppose -jo + 72 = 4f - 0o, -5f + 90 = 3o. What is the highest common divisor of 6 and f? 6 Let x be (-322)/(-8) - 3/12. Let q be (-31)/(-3) - 5/15. Let j = -5 + q. What is the highest common divisor of x and j? 5 Let y be 2/(-2) + (14 - 1). Suppose 3r + 9 + 3 = 4n, -44 = -4n - 5r. Calculate the highest common divisor of y and n. 6 Suppose -t = 170 - 206. Calculate the highest common factor of 90 and t. 18 Let z(b) = -b. Let m(i) = 8i - 6. Let n(r) = m(r) + 2z(r). Let y be n(6). Calculate the highest common divisor of y and 3. 3 Let f = 80 - 38. Calculate the greatest common factor of 6 and f. 6 Let n be (-3)/(-2)34/3. Suppose -2t = 3 + 7, -3b = -2t - 10. Let q = b - -17. Calculate the highest common factor of n and q. 17 Let j = -3 - 1. Let w = 6 + j. Let d(y) = 5y*2 + 2. Let t be d(2). Calculate the highest common factor of w and t. 2 Suppose -3w = -2o - 78, -2w + 36 = -o + 5o. Let d be 1/(-2 - -1) - 56/(-8). Calculate the highest common divisor of d and w. 6 Let q = -8 + 19. Let d be (4 - 0)/((-4)/(-22)). What is the greatest common divisor of q and d? 11 Let b(i) be the first derivative of i3/3 + 5i*2/2 + 1. Let h be b(-7). Calculate the greatest common divisor of h and 35. 7 Let b = 31 + -5. What is the highest common factor of b and 130? 26 Let y(n) = 2n*3 - 8n*2 + 5n - 7. Let m be y(5). Let w = -12 - -29. Calculate the greatest common factor of m and w. 17 Let m = -12 - -18. What is the greatest common divisor of m and 42? 6 Let y be -3((3 - 1) + -4). Calculate the greatest common divisor of 4 and y. 2 Suppose 0 = -4r - 4g + 148, 4r - 110 = -5g + 39. What is the greatest common factor of r and 9? 9 Let m be (-9)/(-36) - (-99)/4. Calculate the highest common divisor of 10 and m. 5 Suppose 6 = -c + 3c. Suppose 20 = cj + j. What is the highest common factor of 5 and j? 5 Suppose 2v + 28 = 4v. What is the highest common factor of v and 28? 14 Suppose 6 = 3x + 5d - 11, -x - 1 = -5d. Let l = -4 + x. Suppose l = 5c - c - 144. What is the highest common factor of c and 9? 9 Let m = -2 + -6. Let l(p) = -2p - 10. Let q be l(m). Let j be 51/q - 1/2. Calculate the highest common factor of 4 and j. 4 Suppose -f - 2p = -1, -3p + 2p = 4f - 18. Calculate the greatest common factor of f and 35. 5 Suppose -3m = -5m, -3d + 204 = 2m. Calculate the greatest common divisor of 17 and d. 17 Suppose 242 = -2w + 7w + 3d, -w + 66 = 5d. Calculate the greatest common factor of w and 23. 23 Suppose -9 = 3i, 0w + 4w + 3i = 23. Let a be ((-4)/w)/((-1)/56). What is the highest common factor of 14 and a? 14 Let h = -10 + 16. Let l be (3-3)/((-69)/506). Calculate the highest common divisor of h and l. 6 Let l(x) = -x3 + 4x*2 - 2x + 1. Let u be l(3). Let n be (-1)/u + (-34)/(-8). Let k = 812 + -804. Calculate the highest common divisor of n and k. 4 Suppose 1757 = 8t + 413. What is the highest common factor of t and 21? 21 Suppose -3i + 15 = 0, 53 = 4d - 3d + 5i. Calculate the greatest common factor of d and 98. 14 Let x = -45 - -65. Let o = -3 - -8. Suppose om - 4m = 50. Calculate the greatest common divisor of x and m. 10 Suppose -5i = -3i - 8. Suppose 5o - 2o = b + 113, -5o - 5b + 155 = 0. Calculate the greatest common factor of o and i. 4 Let v = 41 - 5. What is the greatest common factor of v and 252? 36 Suppose 3n - 176 = -n. Let q = -2 + 19. Suppose -4d + q - 1 = 0. What is the greatest common divisor of n and d? 4 Let d be (-26)/(-18)3-3. Let v be (d/(-2))/((-5)/(-10)). What is the greatest common divisor of v and 13? 13 Let a(m) = -m3 + 5m*2 - 3m + 17. Let n be a(4). What is the greatest common divisor of 189 and n? 21 Suppose 4o - 5r = 54, 4 = -3o + 4r + 45. Let w(v) = -v*2 + 11v + 10. Let p be w(o). What is the highest common factor of p and 70? 10 Let f = 7 - 7. Let u be (f + 1 - -2) + -1. Let q be ((-384)/(-2))/3u. What is the highest common divisor of q and 16? 16 Suppose -3i + 27 = 2w + 2, w - 10 = -i. What is the highest common divisor of 1 and w? 1 Let u = -31 - -40. Let v = 6 - 2. Let h be v/18 - (-214)/u. What is the greatest common factor of h and 3? 3 Let k(m) = 4m - 9. Let l be k(6). Let g = 25 - l. What is the greatest common divisor of 2 and g? 2 Suppose -i - 3j = 444, -3i - 3j = i + 1776. Let u be i/(-10) - (-6)/(-15). Calculate the greatest common divisor of 110 and u. 22 Let i(c) = c2 - 8c - 23. Let b be i(11). Suppose g = -41 + 131. Calculate the greatest common divisor of b and g. 10 Let l(d) = 21d - 5. Let p(z) = 41z - 11. Let x(i) = 9l(i) - 4p(i). Let h be x(1). Let c = 40 + -24. Calculate the greatest common factor of h and c. 8 Let p be (5 - 2) + 62. Suppose 3c = 137 + 133. Calculate the highest common divisor of p and c. 15 Suppose 2911 = 4f - 5x + 501, f - 594 = -3x. Suppose -y = 4y - f. What is the greatest common factor of 48 and y? 24 Let s be 12/54 + (-176)/(-18). Let d = 1 + 1. What is the highest common factor of d and s? 2 Let y(z) = z*2 - 3z + 2. Let b be y(4). Suppose -4 = -5c + b, 0 = x - 4c - 3. Let g be 7/(1 + (-10)/11). Calculate the highest common factor of x and g. 11 Let h be (172/6)/(2/3). Suppose 4o - k = -33, 2o + h = -3o + 3k. Let b = o - -17. Calculate the highest common factor of b and 3. 3 Suppose 25q + 199 = 624. Let n be 2(67/2)/1. Suppose -3w + n + 188 = 0. What is the highest common factor of q and w? 17 Suppose 3g - 129 = 51. Let u = 39 + -15. What is the greatest common factor of u and g? 12 Suppose 18 = r + 2r. Let a be r/5 + 2/(-10). Let s(f) = 13f*2 + 2f - 1. Let h be s(a). Calculate the highest common divisor of 35 and h. 7 Let p(q) = q*3 - 2q*2 - q - 2. Let l be p(2). Let k = 16 + l. Calculate the highest common divisor of 60 and k. 12 Suppose 0 = -g + 6g. Suppose gf + 3f - 189 = 0. Calculate the greatest common divisor of 7 and f. 7 Suppose -m + 3l + 21 = -0l, m + 3l - 51 = 0. What is the highest common factor of m and 4? 4 Suppose 0 = -f - 2f + 84. Let b be 272/f - 4/(-14). Let c(k) = -k*3 + 6k*2 + 3k - 4. Let w be c(4). Calculate the greatest common divisor of w and b. 10 Let v = 50 - -18. Calculate the highest common divisor of v and 17. 17 Suppose p = -2o + 40, -2o + 3o + 92 = 3p. Calculate the greatest common divisor of 16 and p. 16 Let u = -166 + 342. Calculate the greatest common factor of u and 16. 16 Suppose -4p + 139 + 29 = 0. Calculate the highest common factor of 12 and p. 6 Let x = -14 - -23. Suppose 4o = 5h - x, -h + 3 - 7 = 5o. What is the highest common factor of 2 and h? 1 Let k = -8 - -11. Suppose -n = -2a - 2a + 25, 4a - kn - 27 = 0. What is the greatest common factor of a and 3? 3 Suppose -17 = 9k - 143. What is the greatest common factor of k and 154? 14 Let d = -8 + 10. What is the greatest common factor of 3 and d? 1 Let b(i) = -i - 4. Let d be b(-4). Suppose d = 3r - r - 26. Calculate the highest common divisor of 13 and r. 13 Let a = -36 - -78. Calculate the highest common divisor of 28 and a. 14 Let i be (-17)/(-2) - (1/(-2))/1. What is the highest common divisor of 6 and i? 3 Let i(t) = 5t2 + 3. Let x be i(4). Suppose y = 2k + 305 - x, 0 = 4k - 8. Suppose 3z - 47 = y. What is the greatest common divisor of z and 13? 13 Let i(z) = -4z - 2. Let h be i(-3). Let w = 14 - h. Suppose -a = -47 - w. Calculate the highest common factor of a and 17. 17 Let o(r) = -r2 + 5r + 4. Let q be o(5). Suppose -60 = -qv + 32. Suppose 2h = h + 2g + v, 3h = 3g + 60. What is the greatest common divisor of 17 and h? 17 Let u be 6/(-15) - (-22)/5. Suppose w + uw - 10 = 0. Let f be (4/10)/(w/10). What is the highest common divisor of f and 20? 2 Suppose 0 = 2w + 4 - 8. Suppose -wx - 17 = 9. Let y = x + 45. What is the highest common divisor of y and 4? 4 Let a = -23 - -17. Let g(i) = 3i2 + 8i - 6. Let k be g(a). Calculate the highest common divisor of 9 and k. 9 Let y be 1/((2 - 1)/(-12)). Let o = y - 4. Let w be o/(-1) + -2 + 2. Calculate the highest common factor of 144 and w. 16 Let r(b) = -5*b - 3. Let f be r(-5). Suppose -d = 20 - 75. What	{ "pile_set_name": "DM Mathematics" }
e the remainder when 200009 is divided by 125. 9 What is the remainder when 156307 is divided by 31258? 17 Calculate the remainder when 869 is divided by 423. 23 What is the remainder when 288821 is divided by 288814? 7 What is the remainder when 21617 is divided by 327? 35 Calculate the remainder when 976 is divided by 27. 4 What is the remainder when 18919 is divided by 18917? 2 What is the remainder when 2851 is divided by 794? 469 Calculate the remainder when 2361 is divided by 835. 691 What is the remainder when 100762 is divided by 14? 4 Calculate the remainder when 44521 is divided by 17. 15 Calculate the remainder when 12605 is divided by 1001. 593 Calculate the remainder when 2006 is divided by 89. 48 Calculate the remainder when 2343 is divided by 917. 509 Calculate the remainder when 71408 is divided by 107. 39 Calculate the remainder when 8371 is divided by 26. 25 What is the remainder when 736 is divided by 352? 32 What is the remainder when 12829 is divided by 5? 4 Calculate the remainder when 33005 is divided by 209. 192 What is the remainder when 1129761 is divided by 514? 503 What is the remainder when 53334 is divided by 53329? 5 What is the remainder when 2288 is divided by 1119? 50 What is the remainder when 388104 is divided by 1931? 1904 What is the remainder when 26354 is divided by 1124? 502 What is the remainder when 671990 is divided by 11? 0 What is the remainder when 18970 is divided by 619? 400 Calculate the remainder when 17321 is divided by 275. 271 What is the remainder when 169756 is divided by 36? 16 Calculate the remainder when 51271 is divided by 25. 21 What is the remainder when 4122 is divided by 4095? 27 Calculate the remainder when 66670 is divided by 43. 20 What is the remainder when 2138 is divided by 434? 402 What is the remainder when 2056 is divided by 201? 46 What is the remainder when 4139977 is divided by 52? 49 What is the remainder when 334507 is divided by 69? 64 Calculate the remainder when 421265 is divided by 241. 238 What is the remainder when 3298 is divided by 908? 574 Calculate the remainder when 4317984 is divided by 1153. 1152 Calculate the remainder when 3441 is divided by 719. 565 What is the remainder when 170383 is divided by 663? 655 What is the remainder when 233150 is divided by 18? 14 What is the remainder when 3410 is divided by 53? 18 Calculate the remainder when 24844 is divided by 4137. 22 Calculate the remainder when 334408 is divided by 71. 69 What is the remainder when 317588 is divided by 90? 68 Calculate the remainder when 7837 is divided by 1949. 41 Calculate the remainder when 3835 is divided by 1409. 1017 What is the remainder when 101980 is divided by 2913? 25 Calculate the remainder when 5899 is divided by 278. 61 What is the remainder when 15109 is divided by 3231? 2185 Calculate the remainder when 277552 is divided by 48. 16 What is the remainder when 8407 is divided by 600? 7 Calculate the remainder when 36765 is divided by 5251. 8 What is the remainder when 98886 is divided by 51? 48 Calculate the remainder when 42975 is divided by 5312. 479 Calculate the remainder when 5194 is divided by 40. 34 Calculate the remainder when 7240 is divided by 1444. 20 Calculate the remainder when 161572 is divided by 14. 12 Calculate the remainder when 1710 is divided by 436. 402 Calculate the remainder when 16797 is divided by 3354. 27 Calculate the remainder when 20450 is divided by 817. 25 What is the remainder when 1608 is divided by 33? 24 What is the remainder when 35081 is divided by 17490? 101 Calculate the remainder when 23051 is divided by 7682. 5 What is the remainder when 2029 is divided by 20? 9 Calculate the remainder when 527 is divided by 53. 50 Calculate the remainder when 12474 is divided by 260. 254 What is the remainder when 1889 is divided by 49? 27 What is the remainder when 15515 is divided by 36? 35 Calculate the remainder when 84710 is divided by 11. 10 Calculate the remainder when 126488 is divided by 11. 10 Calculate the remainder when 28958 is divided by 579. 8 What is the remainder when 27394 is divided by 33? 4 What is the remainder when 44695 is divided by 1722? 1645 Calculate the remainder when 10283 is divided by 251. 243 What is the remainder when 1213 is divided by 861? 352 Calculate the remainder when 1751134 is divided by 111. 109 Calculate the remainder when 20107 is divided by 119. 115 What is the remainder when 19172 is divided by 20? 12 Calculate the remainder when 4156 is divided by 97. 82 Calculate the remainder when 110440 is divided by 12. 4 Calculate the remainder when 51121 is divided by 25552. 17 What is the remainder when 247696 is divided by 107? 98 What is the remainder when 604 is divided by 247? 110 What is the remainder when 809 is divided by 665? 144 Calculate the remainder when 9687 is divided by 346. 345 Calculate the remainder when 1536 is divided by 423. 267 What is the remainder when 60579 is divided by 324? 315 Calculate the remainder when 182718 is divided by 465. 438 Calculate the remainder when 3248 is divided by 1470. 308 Calculate the remainder when 72 is divided by 62. 10 What is the remainder when 107005 is divided by 42? 31 What is the remainder when 931 is divided by 48? 19 Calculate the remainder when 16906 is divided by 740. 626 What is the remainder when 1632 is divided by 5? 2 What is the remainder when 5022 is divided by 648? 486 What is the remainder when 28269 is divided by 9408? 45 What is the remainder when 4681 is divided by 107? 80 Calculate the remainder when 983 is divided by 957. 26 What is the remainder when 2533 is divided by 177? 55 What is the remainder when 4013 is divided by 22? 9 Calculate the remainder when 82972 is divided by 99. 10 What is the remainder when 24930 is divided by 1659? 45 What is the remainder when 2954 is divided by 434? 350 What is the remainder when 11039 is divided by 962? 457 What is the remainder when 364499 is divided by 243? 242 Calculate the remainder when 1710 is divided by 1014. 696 Calculate the remainder when 262 is divided by 43. 4 What is the remainder when 49659 is divided by 93? 90 Calculate the remainder when 3194 is divided by 187. 15 Calculate the remainder when 2286 is divided by 192. 174 Calculate the remainder when 163581 is divided by 163576. 5 What is the remainder when 4798 is divided by 96? 94 Calculate the remainder when 161255 is divided by 47. 45 What is the remainder when 300607 is divided by 61? 60 What is the remainder when 2874 is divided by 595? 494 What is the remainder when 180866 is divided by 298? 278 Calculate the remainder when 4730 is divided by 238. 208 Calculate the remainder when 921302 is divided by 35. 32 What is the remainder when 10126 is divided by 111? 25 Calculate the remainder when 239973 is divided by 88. 85 What is the remainder when 8388 is divided by 4176? 36 Calculate the remainder when 379881 is divided by 938. 929 Calculate the remainder when 3955 is divided by 36. 31 Calculate the remainder when 4468 is divided by 34. 14 Calculate the remainder when 200996 is divided by 20. 16 What is the remainder when 115110 is divided by 57519? 72 What is the remainder when 18003 is divided by 22? 7 Calculate the remainder when 234339 is divided by 277. 274 What is the remainder when 1921 is divided by 16? 1 What is the remainder when 3085 is divided by 980? 145 What is the remainder when 2296238 is divided by 80? 78 Calculate the remainder when 1569982 is divided by 272. 270 Calculate the remainder when 65730 is divided by 20. 10 What is the remainder when 71046 is divided by 8878? 22 What is the remainder when 18709 is divided by 18709? 0 What is the remainder when 4509 is divided by 163? 108 What is the remainder when 49907 is divided by 141? 134 Calculate the remainder when 686 is divided by 230. 226 What is the remainder when 11994 is divided by 998? 18 What is the remainder when 5570 is divided by 1? 0 Calculate the remainder when 444431 is divided by 48. 47 Calculate the remainder when 125380 is divided by 195. 190 Calculate the remainder when 448287 is divided by 1388. 1351 What is the remainder when 14413 is divided by 121? 14 Calculate the remainder when 4736 is divided by 140. 116 Calculate the remainder wh	{ "pile_set_name": "DM Mathematics" }
ourth root of 202784560 to the nearest integer? 119 What is 176732937 to the power of 1/9, to the nearest integer? 8 What is the fourth root of 79473518 to the nearest integer? 94 What is the fifth root of 43729154 to the nearest integer? 34 What is 464224613 to the power of 1/9, to the nearest integer? 9 What is the tenth root of 22128993 to the nearest integer? 5 What is 398139062 to the power of 1/5, to the nearest integer? 52 What is the seventh root of 850814849 to the nearest integer? 19 What is the sixth root of 1088494114 to the nearest integer? 32 What is the third root of 51316406 to the nearest integer? 372 What is 203939565 to the power of 1/3, to the nearest integer? 589 What is the tenth root of 34654910 to the nearest integer? 6 What is the cube root of 357142401 to the nearest integer? 709 What is the tenth root of 113099980 to the nearest integer? 6 What is the square root of 1992242697 to the nearest integer? 44635 What is 79134217 to the power of 1/3, to the nearest integer? 429 What is 106768737 to the power of 1/10, to the nearest integer? 6 What is 99918605 to the power of 1/8, to the nearest integer? 10 What is 75082432 to the power of 1/10, to the nearest integer? 6 What is 13245561 to the power of 1/3, to the nearest integer? 237 What is the square root of 44868291 to the nearest integer? 6698 What is the third root of 472441862 to the nearest integer? 779 What is the square root of 1385814988 to the nearest integer? 37227 What is 65751582 to the power of 1/3, to the nearest integer? 404 What is the cube root of 540385018 to the nearest integer? 815 What is the square root of 1099115322 to the nearest integer? 33153 What is 304349434 to the power of 1/3, to the nearest integer? 673 What is the fifth root of 184696848 to the nearest integer? 45 What is the square root of 1671891448 to the nearest integer? 40889 What is the square root of 1165444434 to the nearest integer? 34139 What is the cube root of 3263322962 to the nearest integer? 1483 What is the third root of 1019764396 to the nearest integer? 1007 What is 140422081 to the power of 1/2, to the nearest integer? 11850 What is the fourth root of 138658614 to the nearest integer? 109 What is 49821421 to the power of 1/2, to the nearest integer? 7058 What is the cube root of 1356224497 to the nearest integer? 1107 What is 26529461 to the power of 1/8, to the nearest integer? 8 What is the seventh root of 9956392 to the nearest integer? 10 What is 18019414 to the power of 1/3, to the nearest integer? 262 What is 53632586 to the power of 1/2, to the nearest integer? 7323 What is 1555138995 to the power of 1/10, to the nearest integer? 8 What is the fifth root of 14642631 to the nearest integer? 27 What is 2174886 to the power of 1/8, to the nearest integer? 6 What is 1007825628 to the power of 1/10, to the nearest integer? 8 What is 1719232046 to the power of 1/8, to the nearest integer? 14 What is 2380347693 to the power of 1/4, to the nearest integer? 221 What is 693328440 to the power of 1/2, to the nearest integer? 26331 What is the third root of 75716409 to the nearest integer? 423 What is the third root of 2935304291 to the nearest integer? 1432 What is the third root of 28048326 to the nearest integer? 304 What is the eighth root of 49615424 to the nearest integer? 9 What is 2621201651 to the power of 1/3, to the nearest integer? 1379 What is 469893948 to the power of 1/8, to the nearest integer? 12 What is 47469196 to the power of 1/10, to the nearest integer? 6 What is the sixth root of 431049648 to the nearest integer? 27 What is 152771864 to the power of 1/2, to the nearest integer? 12360 What is the square root of 691963779 to the nearest integer? 26305 What is 25777266 to the power of 1/9, to the nearest integer? 7 What is 117404787 to the power of 1/2, to the nearest integer? 10835 What is the square root of 971341787 to the nearest integer? 31166 What is the square root of 271393126 to the nearest integer? 16474 What is 80883165 to the power of 1/2, to the nearest integer? 8994 What is the third root of 818296004 to the nearest integer? 935 What is the cube root of 127509557 to the nearest integer? 503 What is the fifth root of 345730857 to the nearest integer? 51 What is 55077852 to the power of 1/10, to the nearest integer? 6 What is the sixth root of 46317473 to the nearest integer? 19 What is the third root of 162190258 to the nearest integer? 545 What is 597342097 to the power of 1/2, to the nearest integer? 24441 What is the fourth root of 407045359 to the nearest integer? 142 What is the square root of 324025034 to the nearest integer? 18001 What is 1375807980 to the power of 1/2, to the nearest integer? 37092 What is the tenth root of 6054305343 to the nearest integer? 10 What is 214411107 to the power of 1/2, to the nearest integer? 14643 What is the third root of 1108869406 to the nearest integer? 1035 What is 1100872661 to the power of 1/9, to the nearest integer? 10 What is 10638543 to the power of 1/2, to the nearest integer? 3262 What is the third root of 3753458471 to the nearest integer? 1554 What is 545737539 to the power of 1/4, to the nearest integer? 153 What is the square root of 253493178 to the nearest integer? 15921 What is the eighth root of 12714568 to the nearest integer? 8 What is 136858955 to the power of 1/3, to the nearest integer? 515 What is 112852252 to the power of 1/6, to the nearest integer? 22 What is the square root of 572911311 to the nearest integer? 23936 What is the fourth root of 330968694 to the nearest integer? 135 What is the square root of 39359365 to the nearest integer? 6274 What is the tenth root of 137870011 to the nearest integer? 7 What is the third root of 989075357 to the nearest integer? 996 What is the square root of 178169809 to the nearest integer? 13348 What is the third root of 102433760 to the nearest integer? 468 What is the square root of 64741829 to the nearest integer? 8046 What is 629517528 to the power of 1/8, to the nearest integer? 13 What is the third root of 848638485 to the nearest integer? 947 What is 14283045 to the power of 1/3, to the nearest integer? 243 What is the square root of 58533626 to the nearest integer? 7651 What is 17908137 to the power of 1/2, to the nearest integer? 4232 What is the third root of 67530338 to the nearest integer? 407 What is 409764257 to the power of 1/2, to the nearest integer? 20243 What is the cube root of 373448389 to the nearest integer? 720 What is the square root of 999516088 to the nearest integer? 31615 What is the square root of 2197197570 to the nearest integer? 46874 What is 39508342 to the power of 1/3, to the nearest integer? 341 What is 47365594 to the power of 1/8, to the nearest integer? 9 What is the square root of 3688271764 to the nearest integer? 60731 What is the third root of 2035534500 to the nearest integer? 1267 What is 370073293 to the power of 1/5, to the nearest integer? 52 What is 607642962 to the power of 1/3, to the nearest integer? 847 What is 1017235351 to the power of 1/10, to the nearest integer? 8 What is the third root of 112273251 to the nearest integer? 482 What is the third root of 93692607 to the nearest integer? 454 What is 71953 to the power of 1/3, to the nearest integer? 42 What is the fourth root of 35863009 to the nearest integer? 77 What is the cube root of 15348212 to the nearest integer? 249 What is 761669675 to the power of 1/8, to the nearest integer? 13 What is 178217765 to the power of 1/3, to the nearest integer? 563 What is 2518313568 to the power of 1/9, to the nearest integer? 11 What is 87231503 to the power of 1/8, to the nearest integer? 10 What is the cube root of 1890096732 to the nearest integer? 1236 What is the cube root of 810355089 to the nearest integer? 932 What is the square root of 2028938477 to the nearest integer? 45044 What is the square root of 21402624 to the nearest integer? 4626 What is the square root of 1846860 to the nearest integer? 1359 What is the square root of 21733328 to the nearest integer? 4662 What is the third root of 5695428220 to the nearest integer? 1786 What is 11884685 to the power of 1/8, to the nearest integer? 8 What is the square root of 12732	{ "pile_set_name": "DM Mathematics" }
des? 225 What is 17/4 of a tonne in kilograms? 4250 What is 5555.942um in meters? 0.005555942 Convert 6302.357 litres to millilitres. 6302357 How many millilitres are there in 3/25 of a litre? 120 What is three eighths of a microgram in nanograms? 375 What is 6/5 of a litre in millilitres? 1200 What is 43/4 of a century in months? 12900 What is 3/25 of a century in years? 12 What is 80.11622m in centimeters? 8011.622 What is 5/6 of a week in minutes? 8400 How many micrograms are there in twenty-one quarters of a milligram? 5250 What is five quarters of a kilogram in grams? 1250 How many micrometers are there in thirty-four fifths of a centimeter? 68000 Convert 1.849615 nanograms to tonnes. 0.000000000000001849615 What is 89271.73t in grams? 89271730000 Convert 2000.649us to nanoseconds. 2000649 How many litres are there in 74032.3ml? 74.0323 What is 156709.9737s in weeks? 0.25911040625 How many minutes are there in fourteeen ninths of a day? 2240 How many centimeters are there in 3/10 of a meter? 30 How many grams are there in 31286.14mg? 31.28614 What is three fifths of a kilogram in grams? 600 How many nanoseconds are there in 65.3001 minutes? 3918006000000 How many years are there in one quarter of a century? 25 How many months are there in 11/4 of a decade? 330 What is twenty-six fifths of a micrometer in nanometers? 5200 Convert 92.90213 decades to centuries. 9.290213 What is eleven quarters of a century in years? 275 What is twenty-one quarters of a kilogram in grams? 5250 What is 3/50 of a meter in micrometers? 60000 What is 3/10 of a millennium in decades? 30 Convert 3187.471ml to litres. 3.187471 What is twenty-seven halves of a hour in minutes? 810 How many months are there in thirteen quarters of a millennium? 39000 What is thirty-four fifths of a litre in millilitres? 6800 How many millilitres are there in 29/2 of a litre? 14500 What is twenty-seven halves of a century in months? 16200 How many micrometers are there in 25/2 of a millimeter? 12500 How many nanograms are there in one fifth of a microgram? 200 How many micrometers are there in 303.8496 kilometers? 303849600000 What is twenty-five halves of a day in minutes? 18000 What is 663.137 days in minutes? 954917.28 How many seconds are there in fourteeen ninths of a hour? 5600 Convert 21669.71m to kilometers. 21.66971 How many micrograms are there in one quarter of a milligram? 250 Convert 0.1053865mm to nanometers. 105386.5 Convert 27.79768kg to tonnes. 0.02779768 What is 27/2 of a millennium in years? 13500 What is fifty-seven fifths of a century in months? 13680 What is 3/50 of a milligram in micrograms? 60 How many nanograms are there in 3/50 of a microgram? 60 What is 72/5 of a meter in centimeters? 1440 What is 111.506kg in milligrams? 111506000 How many hours are there in 56.83938 minutes? 0.947323 How many kilometers are there in 0.7960133um? 0.0000000007960133 Convert 634.7305ml to litres. 0.6347305 Convert 283.6362s to minutes. 4.72727 How many centuries are there in 347.6941 decades? 34.76941 What is 18303.477 months in millennia? 1.52528975 How many kilograms are there in 421118.9g? 421.1189 How many hours are there in five quarters of a week? 210 What is twenty-five quarters of a centimeter in micrometers? 62500 What is nine tenths of a kilogram in grams? 900 How many millilitres are there in 616834.8 litres? 616834800 Convert 62499.447ns to hours. 0.0000000173609575 What is 20.32816us in seconds? 0.00002032816 What is 5/4 of a litre in millilitres? 1250 What is 23/8 of a milligram in micrograms? 2875 What is 429110.37 microseconds in hours? 0.000119197325 How many seconds are there in 10/3 of a minute? 200 What is 31/5 of a century in months? 7440 What is twenty-five halves of a year in months? 150 What is 56.27859 micrometers in millimeters? 0.05627859 How many kilograms are there in 1.880733g? 0.001880733 What is 42.15677 litres in millilitres? 42156.77 What is 192776.8 kilometers in nanometers? 192776800000000000 Convert 7378.939 minutes to milliseconds. 442736340 How many minutes are there in 13/8 of a day? 2340 How many meters are there in 96861.9um? 0.0968619 Convert 28.71981mm to nanometers. 28719810 What is 3.366273 days in microseconds? 290845987200 How many months are there in 3/5 of a decade? 72 What is 0.1685779 meters in kilometers? 0.0001685779 How many millimeters are there in 8.90387 meters? 8903.87 What is 29/5 of a litre in millilitres? 5800 What is 24772092.3 seconds in days? 286.71403125 What is 21589.7t in nanograms? 21589700000000000000 What is 5/24 of a week in hours? 35 What is one sixth of a century in months? 200 What is seven quarters of a milligram in micrograms? 1750 How many millilitres are there in 11/2 of a litre? 5500 How many centuries are there in 55.44023 years? 0.5544023 What is 3/5 of a decade in months? 72 Convert 1694.72871 milliseconds to days. 0.000019614915625 How many months are there in 0.3621339 millennia? 4345.6068 What is 23/3 of a year in months? 92 What is 5900.187 grams in nanograms? 5900187000000 How many centuries are there in 4115.125 decades? 411.5125 How many kilometers are there in 7.697746m? 0.007697746 How many millimeters are there in 339900.2 kilometers? 339900200000 Convert 15501.11g to tonnes. 0.01550111 What is 2/21 of a week in minutes? 960 What is 3/50 of a week in seconds? 36288 How many microseconds are there in one sixteenth of a second? 62500 What is 46/5 of a day in minutes? 13248 Convert 0.924276 weeks to hours. 155.278368 What is 44/5 of a millisecond in microseconds? 8800 What is 0.2886978 decades in months? 34.643736 What is fifty-one halves of a meter in millimeters? 25500 What is 32/5 of a millennium in centuries? 64 How many millennia are there in 567.3967 centuries? 56.73967 Convert 63457.94 centuries to months. 76149528 What is 0.9617684 kilometers in nanometers? 961768400000 How many micrograms are there in twenty-one halves of a milligram? 10500 What is eighteen sevenths of a week in minutes? 25920 What is 31/5 of a litre in millilitres? 6200 How many millennia are there in 7472.58 months? 0.622715 What is 15/4 of a centimeter in micrometers? 37500 How many litres are there in 1.860836ml? 0.001860836 How many millilitres are there in 5.144992l? 5144.992 How many nanometers are there in 1.871309mm? 1871309 What is one fifth of a decade in months? 24 What is 7.484335cm in micrometers? 74843.35 How many millilitres are there in 89.8767 litres? 89876.7 Convert 9.328082ml to litres. 0.009328082 What is 43/4 of a hour in seconds? 38700 What is 1123.0605 months in millennia? 0.093588375 How many years are there in 113822.52 months? 9485.21 What is 250593.4 centimeters in millimeters? 2505934 How many hours are there in eleven quarters of a week? 462 What is eleven halves of a century in months? 6600 How many millilitres are there in nineteen quarters of a litre? 4750 How many milligrams are there in 5/8 of a gram? 625 How many millilitres are there in 94951.45l? 94951450 What is twenty-nine fifths of a gram in milligrams? 5800 Convert 698954.3 nanoseconds to milliseconds. 0.6989543 What is 51.49009 decades in months? 6178.8108 Convert 35.39313mm to nanometers. 35393130 How many hours are there in 7/4 of a week? 294 How many millilitres are there in twenty-one fifths of a litre? 4200 Convert 780.331104ns to weeks. 0.00000000000129023 Convert 3.447769 centuries to decades. 34.47769 What is 0.7508005ng in grams? 0.0000000007508005 How many millilitres are there in fourty-one halves of a litre? 20500 What is 2416.899ns in minutes? 0.00000004028165 What is seven eighths of a kilometer in meters? 875 What is 1/5 of a milligram in micrograms? 200 How many centimeters are there in 657.5929m? 65759.29 How many milliseconds are there in 0.0295757 minutes? 1774.542 What is 31/5 of a kilogram in grams? 6200 What is 912792.3 millilitres in litres? 912.7923 How many microseconds are there in 5281.095 weeks? 3194006256000000 What is 43/2 of a litre in millilitres? 21500 What is one quarter of a microgram in nanograms? 250 Convert 26.04112 centuries to years. 2604.112 How many nanometers are there in 7377.81 micrometers? 7377810 How many milligrams are there in thirteen eighths of a gram? 1625 What is	{ "pile_set_name": "DM Mathematics" }
? 80 Suppose 3z + 17 = 2j, j - 3j - z = -21. What is the smallest common multiple of j and 18? 90 Let n = -19757 - -8248. Let o = n - -207059/18. Let y = 146/43 + -3465/172. Find the common denominator of o and y. 36 Let q = 655997/60 - 10933. Calculate the common denominator of q and -31/18. 180 Suppose q - 184 = 3o, 7o - 750 = -4q + 12o. What is the least common multiple of 10 and q? 190 Suppose 0 = -5c + 12 + 38. Suppose -26b + 44 = -24b. What is the smallest common multiple of b and c? 110 Suppose 2u - 7u = -10. Let j be (-1)/(u/(-4)-7758). Let l = j - -228866/19395. What is the common denominator of 17/10 and l? 10 Suppose 0 = -u - k + 3, k + 9 = 2u - 0u. Let j(m) = -4 + 2 - 2m + 3m + 1. What is the lowest common multiple of u and j(19)? 36 Let g = 2034 - 10221/5. Let v = 494 + -3140. Let b = v + 7870/3. Calculate the common denominator of b and g. 15 Let h = -608/23 - -18487/782. Find the common denominator of 137/24 and h. 408 Let q = -3233/6 + 557. Let i be (1/(-2))/((-3)/6). Calculate the common denominator of q and 69/(-108) - i/4. 18 Let x be (-2)/4(-20)/2. Suppose -3d + xd - 92 = 0. What is the least common multiple of 3 and d/8 + (-3)/(-12)? 6 Let n be 1/(-2)(-262)/22. Let q = n - 815/99. Let l = 14501/154 + -669/7. Find the common denominator of l and q. 198 Let t(p) = -14p + 2. Let l be t(4). Let z = 1/2980 - -101309/32780. Calculate the common denominator of z and l/30(-90)/8. 44 Suppose -27h + 301 = -459 + 4. What is the lowest common multiple of ((-3)/(-4))/((-2)/(-24)) and h? 252 Let n(h) = 2h - 17. Let b be n(13). Let x(v) = 5v + 2. Let t be x(b). Suppose -2l - 3 + t = 0. Calculate the smallest common multiple of 12 and l. 132 Let a = -21867/14 + 1563. What is the common denominator of 292/(-8) + (18 - 14) and a? 14 Calculate the common denominator of -161/330 and 5/(-50) - (-68)/1275. 1650 Let j = 7 - 5. Suppose -7y + 40 = -jy. Let v(z) = z2 + 2z + 7. Calculate the least common multiple of y and v(0). 56 Suppose 0 = 2q, 2s - 76 = -2s + q. Let v = -2002 + 2899. Find the common denominator of (v/13)/(s - -1) and 101/2. 20 Calculate the common denominator of (54/168)/(36/399) and -139/84. 336 Let f = 49655/8 - 6215. Let q = -5318 - -117057/22. What is the common denominator of q and f? 88 Let k = -6895 - -55077/8. Find the common denominator of k and 17/16. 16 Let j = 1334 - 29267/22. Let x = 7 - 9. Find the common denominator of 1/(16/(-158)) + x and j. 88 Suppose -3c + 14 = -0c - 4g, -2g = 4. Suppose 4a - 48 = -4x, 39 = 3x + ca + 6. Calculate the smallest common multiple of (-3)/(-2)(-20)/(-3) and x. 90 Let t = 30 - 42. Let c = t - -3. Let a = c - -17. What is the smallest common multiple of 1 and a? 8 Let t = -9626 - -423571/44. Calculate the common denominator of -75/68 and t. 748 Let s(y) = -23y - 5. Let z be s(7). Let n = z + 256. Find the common denominator of 19/5 and 12/n - 518/(-165). 55 What is the least common multiple of 15 and 4/30 + (-1878)/(-90)? 105 Let m = 14 + -34. Let g = -18 - m. Suppose h + 10 = gh. What is the lowest common multiple of 10 and h? 10 Let w(t) = -8 - 3 - 8 - 2t + 9. Calculate the least common multiple of 6 and w(-7). 12 Calculate the common denominator of 30/(-4)(-22)/(-160) and (-14)/41155/588 - 2. 32 Let h be -1459(1 + 0 + 0). Let b be -5 - -2 - h/5. Let s = b + -287. Calculate the common denominator of s and 14/13. 65 Suppose 0 = -5q - 7 - 18. Let f be q/(-2)(-57 + 17). Find the common denominator of 5/(f/194) - 1 and -53/16. 80 Let z(d) = -d*2 - 5d - 2. Let n be z(-4). Let f be n/(4/14 - 0). Suppose -3h = f - 25. Calculate the lowest common multiple of h and 10. 30 Let j = 95 - 86. Suppose -30 = jf - 14f. Calculate the lowest common multiple of f and 8. 24 Suppose -d + 48 = 4s, -2d + s + 8 + 52 = 0. Calculate the smallest common multiple of d and 9. 288 Suppose 29z = 37z + 11z - 114. Let r = 23 - 7. What is the smallest common multiple of r and z? 48 Calculate the common denominator of 73/20 and 2 - ((-1 - -2) + 62/(-32)). 80 Let n be 566/6 + (-2)/6. Suppose 2f = 26 + n. Suppose -h = 3h + f. Calculate the common denominator of h and 91/4. 4 Let v = 15001/6 + -2487. Let b = -31 - -16. Let f = -61/2 + b. What is the common denominator of v and f? 6 Suppose -o + 33 = -y, o + 0o - 5y = 21. Find the common denominator of -55/2 and (-2)/o(-177 - 6). 6 Let r = -1863894 - -22342517/12. Let w = r + 2019. Find the common denominator of w and 137/(-6) + -21. 12 Suppose 0 = 25r - 1033 - 17. Suppose -a - 11 = w + 4a, 0 = -2w - 2a + 2. What is the least common multiple of w and r? 84 Find the common denominator of -43/18 and (-410)/80(-8)/3. 18 Find the common denominator of (-6)/28(-126)/12 and 71/28. 28 Suppose -2i + 192 = 4x - 2x, -2x = -i - 183. What is the least common multiple of x and 15? 465 Let v be ((-5)/(-10))/((-12)/662). Let j = 869/20 + v. Let r = j - 6/5. What is the common denominator of -33/2 and r? 6 Let h = 1317 - 1297. Calculate the smallest common multiple of h and 22. 220 Let a(p) = -2p3 + 2p*2 + 3p - 2. Suppose -4h + 12 = 2v, 0 = -5v - 6h + h + 35. What is the smallest common multiple of v and a(-2)? 16 Let k(q) = 9q3 + 10q + 28 - 2q2 - 24 - 8 + 4q*3. What is the smallest common multiple of 1 and k(2)? 112 Let n(y) = 7y + y - 14y. Let a be n(-5). Suppose -4s + a = k, -6k = -k - 4s - 78. What is the smallest common multiple of k and 12? 36 Suppose -8j - 55 = -71. What is the smallest common multiple of 146 and j? 146 Let f = -4/9 - 125/63. Find the common denominator of f and ((909/(-15))/3)/((-16)/(-40)). 14 Let b = -1671901466435/28 + 59622887599. Let l = b - -87894420. Let x = l - 15358. What is the common denominator of x and -107/20? 140 Suppose -2n - 5u = -1508, -n - n = -5u - 1548. Let r = 6941/9 - n. Find the common denominator of -5 and r. 9 Let n be ((-704)/80)/((-2)/(-40)). Let q be 2/6(-5838)/n. Let b = q + -2/11. Calculate the common denominator of -41/20 and b. 40 Let x(a) = a2 + 11a - 403. What is the least common multiple of x(-29) and 42? 714 Let g be ((-1)/(-8))/(1/(-5386)). Let i = g + 654. Let s = 9277 - 74119/8. Find the common denominator of i and s. 8 Let m(a) = -a + 11. Suppose 0 = -8j + 3j - 25. What is the lowest common multiple of 10 and m(j)? 80 Let x be -21924/(-3). What is the common denominator of -53/12 and (-780)/x(-6)/8? 48 Let n(a) = -a*3 + 7a*2 - a - 5. Let i = 12 + -6. Let q be n(i). Suppose -5v + 65 = q. What is the lowest common multiple of 18 and v? 72 Suppose -10v = -531 + 201. Calculate the smallest common multiple of v and 27. 297 Suppose 0 = 2z - 2n - 8, 0 = 5z - 0z - 4n - 22. Calculate the lowest common multiple of 8 and z. 24 Let j(t) = t*3 + 7t*2 + 6t - 3. Let s(l) = -l + 1. Let z be s(7). Let w be j(z). Find the common denominator of ((-9)/(-4))/(w/18) and -87/22. 22 Calculate the common denominator of -16/39 and 2252/(-816) - (-15)/121. 663 Suppose -3i - 2x + 420 = 0, 4x = -5i + 296 + 404. Calculate the least common multiple of 84 and i. 420 Let u = 101 + -63. Calculate the common denominator of 11/(-44) + u/72 and 69/14. 126 Let r(y) = -5y*2 + 84y - 13. Calculate the least common multiple of r(16) and 153. 153 Calculate the common denominator of -43/360 and 731/(-17)4/(-2520). 2520 Let i(k) = -k3 - 6k*2 + k + 8. Suppose -3t + 30 = 9. Let b = t + -13. Calculate the lowest common multiple of 6 and i(b). 6 Let j be -5 + 4 + (-6)/2. What is the common denominator of 19/9-3 + -3 and 214/(-8) + j/(-16)? 6 Calculate the common denominator of 36/49 and (-3400)/3606/(-28). 294 Suppose -2d - 3 - 3 = 0. Find the common denominator of 107/18 and d + 68/(-9) + 3. 18 Let z(r) = r3 + 16r*2 - 36r + 26. Let h be (-1)/(20/15)24. What is the lowest common multiple of z(h) and 22? 286 Let v = -451/10 - -334/15. Calculate the common denominator of (5/(-125))/(10/2975) and v. 30 Find the common denominator of 2/444473/315 and 272/(-224) + (-2 - 1). 770 Let t(q) = q*3 + 12q*2 - 15q + 10. Let d be t(-13). Suppose -w - d = -4w. What is the least common multiple of w and 4? 12 Let b be (166/(-6))/((-2)/6) - -1. Suppose -b = -3d - d. Calculate the smallest common multiple of 33 and d. 231 Supp	{ "pile_set_name": "DM Mathematics" }
)*32((cc(cc(3/7))/c)/(cc(cc*(-1)cc)/c))/(c(-2)/(c/(cc(8/3)))) assuming c is positive. c(-6746/21) Simplify ((u/(u/(u*(2/9)u)))/u)*(2/33)/(uu*5uuu*3)((u*(3/16)/u)/(u/(uu/(u(u/(uu*5u)u)/u))u))(-21) assuming u is positive. u(-470087/4752) Simplify (t*(-1/4)/tt)*(-26)(ttt/(tt(1/9)t)t)/t(3/4)(tt1t)(1/14)/(t2t(2/9)) assuming t is positive. t(473/84) Simplify ((zzz(1/3))(-3/10)(z(-6/7))28)(-46) assuming z is positive. z(5681/5) Simplify ((s/((sss*(-2)s)/s)ss(1/4))/(s(1/5)/s(-1/2)))/((s(2/3))(12/19))(7/2) assuming s is positive. s(29/380) Simplify ((o(-2/3)(oo/o*(4/5)o)/o)/(o*(1/23)o(-7/4)))36 assuming o is positive. o*(9273/115) Simplify (((qq*(2/3)qqq)/q*(6/13))/((qq*(-3))/((qqq(-10))/q)))(-6/17) assuming q is positive. q(218/221) Simplify (r(-2/3)/rr*(-3)(rr/(rr(-1/4)))(2/17))/(((((r1/r)/r)/r)/r)(1/5))(-2/33) assuming r is positive. r(-25559/5610) Simplify ((j(j7/jj)/j)/(j/j(-2/3)))1/(((j(j/(jj*0j))/jj)/(j/(j/j(1/4)j)))/((j*(1/2)j)/j7)) assuming j is positive. j(-11/12) Simplify ((((g/((g*(-3)g)/g))/gg5)/(g(1/4)ggg2))(24/11))12 assuming g is positive. g(1080/11) Simplify ((((o/(o/o5))/(o8o))/(o/o2)(-16))50)(-14) assuming o is positive. o14000 Simplify ((x(-5/7)xx(-6/5))/((xx*(2/31)/xx)/x3))20 assuming x is positive. x*(4432/217) Simplify (((n/(nn*(2/7))nn)(-3/23)n/(n/n*(2/15))n*4n)(-16))(3/5) assuming n is positive. n(-189712/4025) Simplify ((((d/d36)/dd)/d(-13))/((d/(d/d34))/(dd/((d/(d*(-15)/d)d)/d)d)))(-3/4) assuming d is positive. d(105/2) Simplify ((((qqq/((qq(2/9))/q))/q3)/((q(q/q(-1/10)q)/q)/(qq/((q((q((qqq5q)/q)/q)/q)/q)/q)q)))(-2/63))(-47) assuming q is positive. q(-18283/2835) Simplify (((y/((y(-6)yyy)/y))/(y/((y*8y)/y)))/(yyyy(-1))(-2/13))/(y(-1/3)/(y/(y/y5))(y/y1)(-14/9)) assuming y is positive. y(688/39) Simplify (a1/a)*(-40)(a(2/3))(-43)(aa*(-2)a/(a*(-7)/a)a)18 assuming a is positive. a(400/3) Simplify ((s/((s*(2/9)/s)/ss))*(-1/94)s2/(((s/(s/(s/(s/s2)))s)/s)/s))/((s(1/6)/(s4/s))/((s/s(-1/6))/(s(-1/4)/s))) assuming s is positive. s(10543/1692) Simplify (r/(rrr/r(-36)))16r*(2/17)/rrr40 assuming r is positive. r(-9654/17) Simplify (((hh*(-1)/hh)/h)(-1/17))(2/13)/(hh/h(1/5)hh(1/5))(-19) assuming h is positive. h(12599/221) Simplify ((uu/(u/((uu/((u(-13)u)/u))/u)))/u13)(13/5)u(1/2)/u(-9)(u*(3/5)/u)/(uuu(-3)) assuming u is positive. u(153/10) Simplify ((((tt(t/(((t(-1/5)tt)/t)/tt))/ttt)/t)/t)*(-10)t*(-31)t7)28 assuming t is positive. t(-1008) Simplify (c18/(cc/c(-7/6))(cc16)/c19)(-1/4) assuming c is positive. c(-77/24) Simplify (w(-2/19)w)/(ww(6/11)w)(w/(ww(2/7)))(-1/4)(w(-1)/w)(-3/46)w3/w(-2/15) assuming w is positive. w*(1700431/1009470) Simplify ((ll*5)/ll*(2/13)(l/((l/(l(-2/5)/l))/l))(-2/51))46 assuming l is positive. l(788302/3315) Simplify ((k*(5/2)k)/(k*(6/7)kkk))*(11/2)(kk(1/5)/k)/k(-5)(k1)(1/23) assuming k is positive. k*(10559/3220) Simplify ((pp*(-5))/pp/((p*8p)/p))*(-3/2)/(pp*4ppp/(p*(-4/7)pp)(p(-2/5))(7/2)) assuming p is positive. p(449/35) Simplify ((k(-2/13)/(kk(1/19)k))/(kkk11)(2/105))(-21) assuming k is positive. k(63647/1235) Simplify ((xx/(x(-3/5)/x))/xxx(1/14)/xx)/((xxx*(-1/3)x)/((xx(-5/3))/x))x(-2/3)/(x5x)x*(1/7)xx(1/10) assuming x is positive. x(-213/35) Simplify ((y1y*(3/8)y(y1/y)(-2/79))(-7))(2/59) assuming y is positive. y(-133/236) Simplify (((w(w/(ww(-2/5)/www))/w)/w)/w)(2/5)((w*(-1/4)w)/w)/w(w/(w7/w))/w(w4/w(2/13))(-3/14) assuming w is positive. w(-82939/9100) Simplify (((b*26b)/b(7/5))/(b(2/31)/bb/((b/(bb18))/b)))36 assuming b is positive. b*(36468/155) Simplify (j((j*(-7)/j)/j)/j(j*(1/4)j)/j(j/(jj*7j))/jjjj8j)/(j*(-6)j*(2/7)j(-1/6)/j1) assuming j is positive. j(11/84) Simplify ((y1/y)*(-5/4)/((y/(yyy(-1/3)/yyy)y)/yy/(yy/y(-5/6))))/((y/y(-4))(4/5))(2/39) assuming y is positive. y(257/78) Simplify ((s3s)/(sss(ss(-3))/s)(s(-1/2)/s)/s(-1/4))/(s/((sss*(4/5)s)/ss)s*(3/2)(s/(s(-2/9)/s))/(s(-2/3)s)) assuming s is positive. s(389/180) Simplify r(-5)r*0rr(rr(-2/5)r)/r*(-6)(((r*(1/4)rr)/r)/(r(-5)/r))31 assuming r is positive. r(4587/20) Simplify ((i/((ii(3/4)/i)/i))(6/11))*29(i(-2/5)/i)(1/15)(i/(i/i(2/11)))/ii/((i*(-1)/ii)/i) assuming i is positive. i*(36071/1650) Simplify ((hh(-6))/(h/h(-5)))*36/((hhh(h/h10)/h)/(h(2/13)h))(1/13) assuming h is positive. h(-66818/169) Simplify j(2/5)/(jjj/j0j)j(-1)jj(2/7)(j*(-6)jj(-3))(-1/2) assuming j is positive. j(24/35) Simplify u(-2/3)uuu*(-6)(u/u3)/(u/u(2/11))(u/(((u/u(-2/9)u)/u)/u))/uuu*(-1/3)/u(uu/(u/u(-1)))(-17) assuming u is positive. u(-796/99) Simplify ((ssss(3/2))/s(-10)s(-6/17)s/(s6/s))(2/45) assuming s is positive. s(23/51) Simplify (((((d/(d/(d/d(-2)d)))/d)(8/11))8)(-32))42 assuming d is positive. d(-258048/11) Simplify ((((u(2/7))(42/11))(-4/15))(-2/39))36 assuming u is positive. u(384/715) Simplify ((z(-1/35)/z(3/17))/(z(3/5)z(6/7)))25 assuming z is positive. z(-4945/119) Simplify ((j5)47/(j(-5)j)(-49))(-17/4) assuming j is positive. j(-663/4) Simplify (g(-41)g*(-2/29)(gg(4/19)/g)/(g29/gg))(15/4) assuming g is positive. g(-144345/551) Simplify ((l(-5))(-28)/(l(-13)/l(-1/4)))(-26/3) assuming l is positive. l(-7943/6) Simplify (d/d*(-30)d*(2/13)d*(17/7)ddd*(-43)/dd)(-2/145) assuming d is positive. d(270/2639) Simplify (((hhh*(-4)h)/hh)/hh*(2/29)hhhh(-5)h*(-4/9))/((hh*(-4)h(-2)/h)/((h/(h(-1/5)/h))/(hhh/h(3/2)))) assuming h is positive. h(6067/2610) Simplify (((ll(1/4))/l)4(l/(l/(l*(-2/7)l)))/ll/(ll*(-5))l)/(ll5ll(l/l(3/5))/l)(-15) assuming l is positive. l(824/7) Simplify q40/((qq(1/14))/q)((q/(q*(-4/9)/q))/q)/qq/(q*(7/8)q)q assuming q is positive. q(20411/504) Simplify ((k/(k(-2/13)k))/((k(k/k(2/15))/k)/k)(k2)(-2/119))/((kk/(k/((k(-1/4)/k)/k))kk)3/(k/k(1/3)kk0)) assuming k is positive. k(-10203/30940) Simplify (v1/v(-4/5)vv(-7)v*(-7)vv)/(v(2/9)/(vv(-4/5)))(2/43) assuming v is positive. v*(-17804/1935) Simplify ((ggg/(gg*(-1)/gg)g)41(g(-2/5))(1/53))/((g*(2/3)g)(-34/7))(-19) assuming g is positive. g(56668/5565) Simplify ((m(1/7))*(-40)(mm(-1))/(m42m))(11/2) assuming m is positive. m(-3751/14) Simplify ((l*(-3/16)l(7/5)/l)/(l/l(-4/9))(-21))(14/11) assuming l is positive. l(51317/1320) Simplify ((m/(m(-2/7)/m))(-6))(-1/33)m/(((m/(m(2/3)m))/m)/m)mm/m*(1/6)((m/(m*(-2/3)m))/m)(-1/11) assuming m is positive. m(2747/462) Simplify (((l*(1/2)l)/llllll)/l(2/11))(3/5)/(l7/ll/(ll(l/l*(-7/5))/l)(l/l(-1/8))/l(-1/4)) assuming l is positive. l(-157/88) Simplify (g/g(-1/10)gggggg*(-4/3)gg)26/((g/((g8/g)/gg))/(g/g*(-5)g)g(-1/7)/(g/g2gg)) assuming g is positive. g(19958/105) Simplify (n(-6/5)n*(1/6)(nn(-1/4))(2/29))(-30) assuming n is positive. n(854/29) Simplify ((u(-1/3))(-34)u*(-28)u(uu(u12/u)/uu)/u)(-33) assuming u is positive. u121 Simplify (((p/((pp(-2/7))/p))(-25)/((p/(p/((p/p(-6))/p)pp))/((pp(1/2))/p)))(1/12))20 assuming p is positive. p(-2495/42) Simplify w*(-2/3)/(ww*7/www)(w/(w/w8))/w(-7)((w(-2/11)ww)/(w(3/2)/www))/(w(2/13)/(ww*(-9)w)) assuming w is positive. w*(-2147/858) Simplify ((qqq(1/12)qqq)/q*(2/19)((q/(q/(qq(1/2))))/q)(4/21))(-3/14) assuming q is positive. q(-8097/7448) Simplify (a(6/17)/((a(a/(((aa(-5/8))/aa)/a))/a)/a)((a/a(-1))/a)/(a/(((a/a(22/3))/a)/a)))*0 assum	{ "pile_set_name": "DM Mathematics" }
) -1/8 (15/12)/(3/242) 5 What is the value of 0 - (-1)/(-7) - -1? 6/7 Evaluate 1/(16/5 - 6/2). 5 2 + (-15)/7 - 5696/(-623) 9 What is the value of 2/11/(-21)? -2/21 (-1 - (-45)/6) + (-11)/22 6 Evaluate (2/(-13))/((-1)/1). 2/13 Evaluate 2/(-4)(-224)/(-560). -1/5 What is (-369)/276 - (84/(-69))/14? -5/4 (-6)/(-22) + (-752)/176 -4 Evaluate 10/(-65) + (-168)/429. -6/11 What is the value of 4 - (14/18 - -3)? 2/9 What is the value of (9 + -8)/(-2 - 2)? -1/4 What is the value of (-30)/204/6 + -2? -3 What is the value of 2 + ((-2160)/(-84))/(-10)? -4/7 What is the value of (-12)/15 - 0 - (-744)/(-120)? -7 What is the value of (-6 - -6) + 3/(-1)? -3 Evaluate 3 + 594/(-76) + 0. -2/19 (-6)/4 + (-27)/6 -6 Evaluate (3/(-6))/(-1)0/2. 0 Evaluate 1/(-3)(-3)/90. 0 What is the value of 3/10(6 + -3 + -1)? 3/5 Calculate -7 + 48/22 + 5. 2/11 What is 2/8(10 - 16)? -3/2 (2 - 17)/54/(-6) 2 What is the value of (517/(-850))/(1/2)? -1/5 What is the value of 1/(-4) + 55/(-20)? -3 Calculate 0(6 + -7 + 1/2). 0 What is 4 + (-30)/128/10? 2 Calculate ((-1)/2)/((-216)/96). 2/9 What is (34/51)/(1/(-3))? -2 What is (-99)/135 - 2/(-5)? -1/3 What is 2/(-8) - (-156)/(-208)? -1 Evaluate 4/(-15) + 12/(-30). -2/3 Calculate (14/(-8))/(11/44) - -3. -4 Calculate (22/110)/((-3)/(-2)). 2/15 What is the value of (-2)/(-70) + 18/45? 3/7 What is 18/(-48)-208/10? 6 (-1)/3 + (-4)/(-9 - 3) 0 Calculate (-4)/34 - (-88)/170. 2/5 What is the value of (-1 + 40/32)/((-4)/4)? -1/4 What is (-6(-6)/(-63))/(2/(-21))? 6 What is 2/4 + ((-135)/(-70))/(-3)? -1/7 Evaluate (-264)/(-220) - -12/(-10). 1 What is (10/7)/((-120)/(-105))? 5/4 What is (-360)/132022/4? -3/2 What is the value of 20/6(7/(-5))/(-7)? 2/3 What is 1/(-5)50/1702? -2/17 Evaluate (-6 - -5 - -7) + -8. -2 What is the value of 7/24 - (4/6)/1? -3/8 What is (-1 - -3 - 5)3/(-3)? 3 What is (-21)/15 - (-3 - -7)/(-4)? -2/5 Evaluate 1 - ((-36)/8 - -7). -3/2 4/(-35) - 16/(-40) 2/7 (22 + -22 + 10/(-4))2 -5 Calculate (-2)/((-90)/21)92/(-322). -2/15 (-261)/(-116)(-4)/(-6) 3/2 What is the value of ((-2)/7)/(-35/15)? 2/7 (-5)/20 + (174/(-168) - -1) -2/7 What is -2 + -1 - (-10 + -3)? 10 What is the value of 1/((-6)/12)(-6)/(-4)? -3 What is the value of ((-16)/60)/(180/(-150))? 2/9 Calculate (11 - 312/32)(-2)/5. -1/2 Calculate 2/9 + 95/180. 3/4 Calculate (9 - 11)(0 + 2). -4 What is 0/33 - 42/7? -6 What is the value of 6/8 - (2 + 205/(-20))? 9 Evaluate (-534)/801 - -4(-1)/6. -4/3 Calculate (-16 + 6)(6/(-4) - -1). 5 Evaluate ((-111)/12 - -9)/((-57)/(-24)). -2/19 What is the value of 231/168 + (-2)/(-16)? 3/2 Calculate (0 + 5/10)/(2/4). 1 Evaluate 30/(-9)(198/(-70) + 3). -4/7 What is the value of (88/12)/(-2) + 4? 1/3 (4/(-4))/((-19)/3 - -8) -3/5 What is the value of 798/(-252) + ((-4)/(-2) - -2)? 5/6 (-315)/300 + (-8)/(-10) -1/4 4/(-7)(2244/216 + -10) -2/9 Evaluate (-3 + 1)265/(-106). 5 ((-20)/(-36))/((-55)/66) -2/3 What is 171/135 + 5/(-3) + 1? 3/5 What is (27/42)/94? 2/7 2210/650 + 2/(-5) 3 What is the value of (6/28)/((-24)/64)? -4/7 What is (-7)/10 + (49/14)/7? -1/5 Evaluate (-29 + 26)(1/3 + 0). -1 Evaluate (-135)/24 + (3 - (1 - 4)). 3/8 Evaluate 0 + (-3 - (-12 + 14)). -5 What is (9 - (-140)/(-16)) + 1/(-12)? 1/6 What is 25/75 - (-1)/(-12)? 1/4 What is (-19 - (-2 + -7)) + 11? 1 Evaluate ((-134)/(-201))/((-1)/(-15)-2). -5 Evaluate 81/243(0/2 + -3). -1 What is -7 - 0 - 65/(-10)? -1/2 Evaluate 4/2 + (195/(-104) - 0). 1/8 What is the value of (4/(-1))/(6 - 3)? -4/3 (-28)/(-4) - (-81)/(-9) -2 ((-2)/(-57))/((-8)/24) -2/19 (1/(-3))/((-17)/(-102)) -2 -3 - 39/(-13) - 0/1 0 Evaluate (-19)/((-2090)/(-20))22. -4 (-232)/(-56) - (5 + 0) -6/7 0/(-2) - (-7 - -6) 1 4/48 + (-3)/4 -2/3 Evaluate ((-18)/4)/(-9)(2 + -8). -3 2 + (-2)/((-60)/(-55)) 1/6 Evaluate 8 - 11/((-33)/(-18)). 2 Calculate (-6765)/(-715) + (-6)/13. 9 0/26(-3)/(-6) 0 What is ((-1)/((-65)/52))/(14/(-5))? -2/7 Calculate 6/(5/((-5)/2)). -3 What is (2/(-6))/((-26)/104)? 4/3 -2(1 + -2) + (-55)/11 -3 Calculate (-38 - -38)/(-1 - (2 + -1)). 0 What is 2/13 - (3 + (-1244)/364)? 4/7 Evaluate 5 + (-14)/(-21)-9. -1 What is the value of 37/((-2035)/176)(-10)/(-4)? -8 What is -9 - ((-140)/4)/5? -2 What is the value of ((-32)/14 + 2)(-245)/84? 5/6 What is (1/5)/((-33)/15 - -1)? -1/6 (-1085)/(-279) + (-1)/(-9) 4 Calculate 2/12 - (-9)/18. 2/3 Calculate 3/(-2)(-63)/(-378). -1/4 (-10)/15(-15)/2 5 Evaluate ((-44)/33)/((-2)/3). 2 What is the value of ((-4)/(-26))/(6/(0 + -6))? -2/13 Calculate (-27)/(-3) + (-216)/24. 0 Evaluate 14/(784/(-520)) + 9. -2/7 1-3(-24)/36 2 What is (-4)/(-22) + 840/(-385)? -2 What is the value of 5 + (-1)/(4 - (-13)/(-3))? 8 Evaluate -9 + 2 - -1(-4 - -12). 1 Calculate (-6)/(-48) - (41/8 + -1). -4 Evaluate (-25)/(-24)-3 - (-1 - 2). -1/8 Calculate 18/52 - 18/36. -2/13 Evaluate ((-163)/(-815))/((-2)/12). -6/5 (-252)/(-420)-2(-5)/(-16) -3/8 Evaluate (-9)/(-6) - (200/30)/5. 1/6 What is (17 - 10)6/7? 6 (-2)/3-3 - 9/3 -1 (105/14 - 10)/(10/8) -2 Calculate 2/(1/(-7) - 78/(-182)). 7 What is the value of 3/(-7)154/(-33)? 2 Evaluate 2/(-9) - 07/(-35). -2/9 Evaluate (-16)/(-120)31/2. 1/5 Evaluate (((-378)/45)/7)/(9/30). -4 What is the value of (40/70)/(144/(-56))? -2/9 Evaluate -5 - 1/((-7)/(-231)-9). -4/3 Calculate (-21)/7 + 1 + 5/3. -1/3 (-136)/320 + 12/15 + 0 3/8 What is (-820)/(-240) + (-14)/8? 5/3 What is the value of 20/352 + (-1)/(-8)? 2/11 Evaluate (292/(-3650))/((-2)/(-10)). -2/5 Evaluate 308/(-440)(1 + 3/2). -7/4 (-4)/4(29 - 31) 2 Evaluate (-3 + 2 + 0)(-1 + 1). 0 What is the value of 8/(-28)6/3? -4/7 Calculate (-36)/(-42) + -1 + 0. -1/7 What is (-1120)/(-3420) + ((-116)/36 - -3)? 2/19 What is the value of -6(-5)/(-360)-24? 2/3 Evaluate 1/(-2)((-5)/(-1) - -5). -5 (-264)/(-40) - (-4)/(-20)-2 7 What is the value of -10 - (-3)/((-36)/(-96))? -2 What is ((-10)/1554/12)/1? -3 Calculate 8/(-14)371/318. -2/3 Calculate (-60)/16 - (8 - 12). 1/4 What is 0 + (-6)/33 - (-196)/352? 3/8 What is the value of (2/12)/(13/(-52))? -2/3 Calculate 2 + (-6 + -2)(-3)/6. 6 (-5)/((-35)/(-24)) - -4 4/7 Evaluate (-9)/((-486)/(-495)) + 9. -1/6 (-230)/(-55) + (-3 - 1) 2/11 3/66-62 + (-30)/(-10) 2/11 0 - 2 - -4 - (6 + -5) 1 6/(-2)6/724 -1 Evaluate (72/(-114))/6 + (-22)/152. -1/4 What is 72/108 - 1/(-3)? 1 Evaluate 9/3 - (-5)/(-45)0. 3 What is 1-1 + 39/39? 0 Evaluate (0/(-4) + 1)-2. -2 Calculate -2 - ((-1)/(-3) - (-15)/(-5)). 2/3 What is the value of (-1 - 8/(-4))/(-1)? -1 Evaluate (-18)/2 + (-18)/(-30)5. -6 ((-9)/60 + 0)/((-43)/172) 3/5 (-1456)/1330 - 12/(-10) 2/19 Calculate ((1 + -2 + 0)/1)/7. -1/7 What is (-16)/(-264)(0 + -3) - 0? -2/11 Calculate (2 - -2) + 0 + 17/(-3). -5/3 What is 1 + (-11)/9 + 77/(-99)? -1 (-6 + (-68)/(-12))3/(-8) 1/8 (-4)/(-20) - 126/(-45) - 12 -9 Evaluate (0 + 3)(8 - 68/8). -3/2 Evaluate (56/(-12) + 5)(3 + -6). -1 1/(-8) + 5/40 0 What is -2(2/5)/(4/25)? -5 What is the value of ((-9)/(-21))/((-6)/(-70))? 5 (-2)/(-6) + (-483)/2691 2/13 Calculate (-18)/210/(-30). 3 (-2)/(-2) - (-37 + 35) 3 18/(-81) + (-145)/(-45) 3 What is the value of 1/3318(-2)/3? -4/11 Evaluate -10(2 - (-13 + 16)). 10 Evaluate ((-2)/3)/(-1) - 2/(-6). 1 What is the value of (1519/364)/7 + 3/(-4)? -2/13 What is (-5)/8 + (-210)/(-280)? 1/8 Evaluate 8/(-2) - 3(-80)/72. -2/3 What is the value of (54/6)/(2/(-3))? -5 What is (-4 - 12/(-2))/(-5)? -2/5 (-4)/14 + 198/(-42) -5 Calculate 044/32. 0 What is the value of ((-29)/(-435))/(2/12)? 2/5 ((-16)/(-6) - 2)/(20/30) 1 What is the value of ((-360)/275)/(-6) - (-4)/(-10)? -2/11 What is (5 - 66/30)40/16? 7 Calculate (64/6)/(-2)(-30)/40. 4 What is ((-60)/45)/((-6)/(-1))? -2/9 What is the value of (-1 - (-1 - -3)) + -1? -4 Evaluate (40 - 40)/(3 - 1). 0 ((-6)/(-8))/(156/32) 2/13 What is (-14)/(-70)30 + (-1 - 0)? 5 What is (18/(-8))/(6-1)? 3/8 Evaluate ((-1)/3)/(-3 - 372/(-108)). -3/4 ((-10)/14)/(7/(-49)) 5 Calculate 58/(-138) - 12/(-138). -1/3 What is ((-2)/(-15))/((-6)/30)? -2/3 What is the value of (-4)/2(-6)/(-4)? -3 Evaluate -8 + 5 - -6 - -1. 4 What is 12/4 + (24/14 - 5)? -2/7 Calculate ((-135)/120)/(6/4). -3/4 What is the value of (-4 - -4) + 6/2? 3 What is (14/9)/7*(-6)/(-4)? 1/3 Evaluate 0 - (0/((-15)/5))/2. 0 (8 + (-288)/40)/(14/(-5)) -2/7 Calculate (-78)/(-351) + 50/18. 3 What is the value of 5/2 + 6/(-2 +	{ "pile_set_name": "DM Mathematics" }
ment from yrrrsyyryr. 2/45 What is prob of sequence pgo when three letters picked without replacement from gpuog? 1/30 Two letters picked without replacement from ccqvntcmcnnnqctvvcv. Give prob of sequence qq. 1/171 Calculate prob of sequence kyw when three letters picked without replacement from wyfywywwwkywk. 4/143 Calculate prob of sequence hh when two letters picked without replacement from {y: 6, l: 4, h: 5}. 2/21 Two letters picked without replacement from {j: 1, q: 11}. Give prob of sequence jq. 1/12 Two letters picked without replacement from jjajajdjanaajjajjaj. Give prob of sequence dn. 1/342 What is prob of sequence nfnf when four letters picked without replacement from knnfk? 0 Four letters picked without replacement from {r: 7, t: 1, q: 1}. What is prob of sequence rtrq? 1/72 What is prob of sequence qq when two letters picked without replacement from {l: 4, k: 2, v: 1, q: 4}? 6/55 Three letters picked without replacement from axfxyayxazyzmza. What is prob of sequence ayx? 6/455 Calculate prob of sequence usf when three letters picked without replacement from uusffs. 1/15 Three letters picked without replacement from {a: 1, c: 1, o: 1, i: 1, l: 1}. Give prob of sequence ilo. 1/60 Three letters picked without replacement from {d: 6, o: 1, x: 2, w: 2}. What is prob of sequence wwx? 2/495 What is prob of sequence yvv when three letters picked without replacement from {v: 5, y: 3, j: 5}? 5/143 Calculate prob of sequence zbbb when four letters picked without replacement from {b: 3, z: 3}. 1/20 What is prob of sequence fuff when four letters picked without replacement from ffffuuffuufu? 35/396 What is prob of sequence nv when two letters picked without replacement from vkvvuxn? 1/14 Three letters picked without replacement from vzwwvjwjvdw. Give prob of sequence vdd. 0 Three letters picked without replacement from {d: 2, n: 1, m: 1, l: 1}. Give prob of sequence dld. 1/30 Two letters picked without replacement from ukkukkukukuuukukku. Give prob of sequence uk. 9/34 Calculate prob of sequence pbx when three letters picked without replacement from {h: 8, x: 1, i: 1, p: 2, b: 4, a: 4}. 1/855 What is prob of sequence dv when two letters picked without replacement from ddvjjdd? 2/21 Four letters picked without replacement from {y: 9}. Give prob of sequence yyyy. 1 Three letters picked without replacement from {r: 2, b: 3, a: 4}. Give prob of sequence bra. 1/21 Three letters picked without replacement from {y: 5, z: 6, s: 2, h: 2, a: 1}. Give prob of sequence shs. 1/840 Two letters picked without replacement from xxxpxxxzxsxx. What is prob of sequence ps? 1/132 Two letters picked without replacement from hmmhmhhhhhhh. Give prob of sequence hh. 6/11 Four letters picked without replacement from {x: 5, q: 5, d: 5, h: 1, n: 3}. What is prob of sequence nxxh? 5/7752 What is prob of sequence fafa when four letters picked without replacement from {f: 3, a: 8}? 7/165 Calculate prob of sequence yyhz when four letters picked without replacement from {h: 1, y: 9, z: 1, a: 1}. 1/165 Two letters picked without replacement from wqwwqwwqqwwwwqww. Give prob of sequence qq. 1/12 Four letters picked without replacement from {n: 6, d: 7, r: 3, v: 1}. What is prob of sequence rrdv? 1/1360 Two letters picked without replacement from {u: 6}. What is prob of sequence uu? 1 Two letters picked without replacement from {f: 4, x: 11, q: 1, h: 3}. Give prob of sequence xh. 11/114 Two letters picked without replacement from {n: 1, p: 2, u: 1, j: 1}. What is prob of sequence np? 1/10 What is prob of sequence zt when two letters picked without replacement from tvvvvtdztdd? 3/110 Calculate prob of sequence ssbs when four letters picked without replacement from {a: 4, s: 7, c: 1, b: 1}. 7/572 Calculate prob of sequence eo when two letters picked without replacement from nnnqmmnoemen. 1/66 What is prob of sequence jnnn when four letters picked without replacement from {j: 5, n: 5, b: 1, i: 1}? 5/198 Three letters picked without replacement from uuxyffyfvyk. What is prob of sequence fyx? 1/110 Four letters picked without replacement from lipljvivvijjvijjilv. Give prob of sequence jlij. 25/7752 Four letters picked without replacement from yiingn. What is prob of sequence ynng? 1/180 Three letters picked without replacement from {f: 9, g: 6, k: 2, e: 2}. What is prob of sequence gkf? 6/323 Four letters picked without replacement from mmkkkokkomo. What is prob of sequence momm? 1/440 Three letters picked without replacement from {u: 5, g: 3, o: 2}. Give prob of sequence uug. 1/12 Calculate prob of sequence cck when three letters picked without replacement from kkcwwccckkk. 2/33 Three letters picked without replacement from nnnnnwnnww. What is prob of sequence nwn? 7/40 Calculate prob of sequence mld when three letters picked without replacement from {l: 1, m: 2, x: 1, b: 2, d: 1, s: 2}. 1/252 Two letters picked without replacement from {k: 1, u: 7}. Give prob of sequence uu. 3/4 What is prob of sequence rp when two letters picked without replacement from wrrpwgrr? 1/14 Four letters picked without replacement from bbbfbbbbbfbbbbbbffbb. Give prob of sequence bfff. 16/4845 Calculate prob of sequence pwga when four letters picked without replacement from gawpgbz. 1/420 What is prob of sequence cc when two letters picked without replacement from {x: 12, c: 3}? 1/35 Two letters picked without replacement from ssssssvssvsvsv. What is prob of sequence ss? 45/91 What is prob of sequence pew when three letters picked without replacement from {m: 1, f: 2, e: 2, p: 5, w: 1, u: 6}? 1/408 Calculate prob of sequence vc when two letters picked without replacement from {p: 2, c: 1, v: 1, o: 10}. 1/182 Three letters picked without replacement from {i: 5, k: 5}. What is prob of sequence iki? 5/36 What is prob of sequence tmt when three letters picked without replacement from {b: 1, r: 3, t: 2, m: 1}? 1/105 What is prob of sequence gbmg when four letters picked without replacement from {m: 11, g: 5, b: 1, h: 2}? 55/23256 Three letters picked without replacement from teeaemplttm. Give prob of sequence pae. 1/330 Three letters picked without replacement from ddunnunodnzddoddo. What is prob of sequence ndn? 7/340 Two letters picked without replacement from {i: 2, r: 2}. Give prob of sequence ii. 1/6 Three letters picked without replacement from mjjjjjjjjmmj. Give prob of sequence mmj. 9/220 What is prob of sequence yy when two letters picked without replacement from {y: 2, x: 1}? 1/3 Calculate prob of sequence dctr when four letters picked without replacement from drrrrrrrrttrrtcttrr. 5/7752 Four letters picked without replacement from pzlzhhhhphh. Give prob of sequence zzpl. 1/1980 What is prob of sequence no when two letters picked without replacement from {o: 1, d: 4, n: 4, r: 1}? 2/45 Calculate prob of sequence wx when two letters picked without replacement from dxdxwddi. 1/28 Calculate prob of sequence io when two letters picked without replacement from itgggotott. 1/45 Two letters picked without replacement from {p: 3, f: 3}. What is prob of sequence pf? 3/10 Calculate prob of sequence bn when two letters picked without replacement from {b: 5, q: 1, s: 4, n: 3}. 5/52 Calculate prob of sequence mrm when three letters picked without replacement from {r: 3, d: 2, j: 2, a: 3, m: 3}. 3/286 Four letters picked without replacement from dplvldvlvvvlvzpd. What is prob of sequence dpdz? 1/3640 Two letters picked without replacement from ehssemdsssdde. Give prob of sequence sh. 5/156 Calculate prob of sequence vvvv when four letters picked without replacement from vvvvv. 1 What is prob of sequence uenp when four letters picked without replacement from enesuzp? 1/420 Two letters picked without replacement from {h: 3, a: 3, k: 1, c: 1, u: 3}. What is prob of sequence ak? 3/110 Four letters picked without replacement from aahhaaalalalh. What is prob of sequence hhah? 7/2860 Calculate prob of sequence fc when two letters picked without replacement from ijcppgfg. 1/56 Calculate prob of sequence blyx when four letters picked without replacement from ybqlxfl. 1/420 Calculate prob of sequence lh when two letters picked without replacement from {h: 5, l: 3}. 15/56 Calculate prob of sequence zaz when three letter	{ "pile_set_name": "DM Mathematics" }
d(r) be the third derivative of -11r2 + 0 + 0r - 1/8r4 + 0r*3. Determine d(j(y)). -24y*2 Let g(i) = 2i. Suppose -5530 = -u + 1207. Let b(n) = -un - 11n*2 + 6737n. Give b(g(d)). -44d2 Let v(s) = -25s*2. Let a(g) be the third derivative of 0g + 0g3 + 1/60g*5 - 224g*2 + 0 + 0g*4. Calculate a(v(k)). 625k*4 Let a(s) = 17s. Let c(x) be the first derivative of -x*5/30 - 7x*3/3 + 2x + 10. Let k(g) be the third derivative of c(g). Calculate a(k(t)). -68t Let f(v) be the second derivative of -v4/6 + 45v*2/2 + v - 59. Let y(r) be the first derivative of f(r). Let p(g) = 40g. What is p(y(n))? -160n Let n(m) = -468745m. Let k(j) = 365j2. Determine k(n(l)). 80198484384125l*2 Let p(d) be the first derivative of -19d4/12 - d3/6 - 8d - 168. Let t(j) be the first derivative of p(j). Let k(f) = -3f*2. Determine k(t(x)). -1083x*4 - 114x*3 - 3x*2 Let u(y) = 28y. Suppose 34o - 35o = 5. Let r be (-3)/(1/2 - o/(-4)). Let a(d) = -7d + 10d - rd - d. Determine u(a(p)). -56p Let n(r) be the third derivative of 9r5/20 - r2 - 12r. Let d(g) be the second derivative of -g*4 + 4g - 1. Determine n(d(l)). 3888l4 Suppose -1883 + 1760 = -51w + 10w. Let u(q) be the second derivative of 43/3q*w + 17q + 0q2 + 0. Let h(m) = 2m. Give u(h(j)). 172j Let i(h) = -12h + 11. Let t be i(-1). Let r(b) = -24b - tb + 70b. Let d(m) = 3m. Calculate d(r(q)). 69q Let g(l) be the first derivative of -l2/2 - 179. Let q(z) = -11z*2 + 5z*2 + 3 + 7z*2 + 3z*2. Calculate g(q(w)). -4w*2 - 3 Let g(c) = -65c*2 - c + 1029. Let y(n) = n. Determine y(g(l)). -65l2 - l + 1029 Let y(a) = -a2 - a. Let v(c) = -5c2 - 6c. Let f(x) = -v(x) + 6y(x). Let q(w) = -22w + 9776 + 75w - 9776. Give q(f(i)). -53i*2 Let y(b) = 916831 + 37b - 916831 + 43b. Let f(o) = -2o*2 - 4. What is y(f(x))? -160x2 - 320 Let s(g) be the second derivative of -g4/12 - 58g3/3 - 2g - 276. Let x(n) = 26n + 2. What is s(x(h))? -676h*2 - 3120h - 236 Let u(a) = -3a2. Let t(l) be the first derivative of -l6/180 - l3/3 - l2 + 13. Let g(n) be the third derivative of t(n). Determine u(g(b)). -12b*4 Let h(w) = 0 - 626621w + 626624w + 0. Let y(o) = 2o*2 - 1802o. Calculate y(h(k)). 18k2 - 5406k Let r(d) = -4d2 + d + 14. Let u(a) be the third derivative of a5/60 + 1318a*2 + 3. Determine r(u(f)). -4f4 + f2 + 14 Let r(s) = -3748s2. Let i(w) = 1329w*2 - 2. Calculate i(r(l)). 18669132816l*4 - 2 Let o(h) = -7 + 7 - 2h2. Let q(n) = n2 + 24n - 16. Let i(r) = -3r*2 - 66r + 44. Let z(b) = -4i(b) - 11q(b). Determine o(z(u)). -2u4 Let o(d) = 2d*2. Let f(r) = 91 + 197r + 121r - 76r - 93. What is o(f(x))? 117128x2 - 1936x + 8 Let c(w) = -33w - 8w + 34w - 11w*2. Let m(s) = -s. Calculate m(c(q)). 11q*2 + 7q Let o(q) = 1943q2. Let k(z) = -2z + 24. Let r(j) = 2j - 28. Let l(g) = 7k(g) + 6r(g). Determine l(o(a)). -3886a*2 Let t(b) = -3b*2. Let a(u) be the first derivative of -1677u*2/2 - 747. Give t(a(j)). -8436987j*2 Let x(r) = -37r. Let b(l) be the third derivative of 0l3 - 106 + 2l*2 + 0l*4 - 7/60l*5 + 0l. Determine b(x(v)). -9583v2 Let p(q) = -29347q*2. Let z(n) = -280n + 14. What is z(p(j))? 8217160j2 + 14 Let a = 385 - 285. Let m(t) = -105t + 199t - at. Let l(i) = 16i. Calculate m(l(q)). -96q Let o(p) = 64p - 3. Let j(b) = 107b - 5. Let s(z) = -6j(z) + 10o(z). Let u(n) = -5n + 2. Calculate u(s(h)). 10h + 2 Let b(h) = -17686364h. Let u(r) = -7r. Give b(u(t)). 123804548t Let d(z) = -8z. Let y(s) be the first derivative of -180 + 0s2 - 1/3s*3 + 0s. What is d(y(j))? 8j2 Let p be ((-2)/6)/(-3 + 204/72). Let m(r) = 3r*2 - 4r2 + r2 + 5rp. Let z(t) = -15t. Give m(z(x)). 1125x2 Let k = 355 + -7. Let h(d) = k - 174 - 174 + 24d. Let j(z) = -6z2. Give j(h(b)). -3456b*2 Let m(f) = 56f. Let x(l) = -106205l2 - 5l + 4. Calculate m(x(o)). -5947480o2 - 280o + 224 Let x(p) = p*2 - 12p. Let b(c) = 14 - 16c - 14 - 91c*2 + 93c*2. Let t(k) = 3b(k) - 4x(k). Let h(z) = 504z*2. Calculate h(t(j)). 2016j*4 Let x(r) = r - 12. Let f(w) be the first derivative of 133w*3/3 - 1522. Calculate x(f(i)). 133i*2 - 12 Let b(a) = -2a*2. Let d(g) = -26 + 323g - 386g + 26. Calculate b(d(p)). -7938p2 Let o(y) be the second derivative of -y3/6 + 120y + 16. Let f(g) be the third derivative of 3g*5/10 + 5g3/6 + g2. Calculate o(f(z)). -18z2 - 5 Let j(x) = 207x. Let n(h) = h. Let i(c) = -j(c) + 414n(c). Let z(p) = -28493p*2 + 56955p*2 - 28464p*2. Give i(z(k)). -414k*2 Suppose 0 = 4j - 5o - 8, -2o = -4o. Let l(q) = -q2 - 13q*j + 12q*2. Let x(c) = 5c. Give l(x(a)). -50a2 Suppose -3u = -127f + 125f + 12, -3f + 1 = 4u. Let x(l) be the second derivative of 24l - 1/2l*f + 0 + 0l*2. Let v(p) = 3p. Determine x(v(a)). -9a Let x = -19 - -24. Suppose -2g = 4m - 58, -4m + xg + 0g = -37. Let u(h) = mh - 32h + 18h. Let t(b) = -13b. Give t(u(o)). 13o Let q = 27 + -8. Let b(a) = 5 - 5 - qa2. Let k(g) be the third derivative of g5/30 - 22g2. Determine b(k(d)). -76d*4 Let w(r) = 2r*2. Let f(z) be the first derivative of 226/3z*3 + 60 + 0z*2 + 0z. Determine f(w(l)). 904l4 Let j(u) = -3u. Let s(w) be the second derivative of 19w3/6 + w2/2 + 7w + 60. Give j(s(z)). -57z - 3 Let x(i) = -2i*2. Let h(n) = -6n*2 - n + 1. Let r be h(1). Let z = r + 9. Let v(p) = 15p*2 + z - 2 - 1. Calculate v(x(t)). 60t*4 Let k(i) = 502i - 1. Let b(s) = -91524s. Give k(b(f)). -45945048f - 1 Suppose 41z = 38z + 21. Let f(q) = zq + 13q - 35q + 4q. Let d(r) = 23r. Let g(t) = 4t. Let m(c) = -6d(c) + 34g(c). Calculate m(f(y)). 22y Suppose 21s - 3 = 39. Let i(d) = -39d2 - 2d*s - 42 + 42. Let h(y) = -4y*2. What is i(h(f))? -656f*4 Let f(k) = -4k. Let w(x) be the first derivative of -8x2 - 21 + 7x*2 - 45 + 2x*2. Calculate w(f(z)). -8z Let l(i) = -2i2 - 35. Let h(v) = -10v. Let a(b) be the first derivative of -5b2/2 - 100. Let c(m) = 5a(m) - 3h(m). Give l(c(z)). -50z2 - 35 Let w(a) = a2 - 4a - 58. Let r be w(10). Let g(d) = 2d2 - 1 - 1 + r - d2. Let l(b) = -113b2. What is g(l(q))? 12769q*4 Let b(d) = d. Let z(u) = 113u + 302. Let g(h) = 142h + 303. Let q(f) = 4g(f) - 5z(f). Determine q(b(o)). 3o - 298 Let r(f) = 3 + 17f2 - 8 + 5. Let g(s) = -632s*2 - 635s*2 + 0s + 0s + 1264s*2. Calculate g(r(m)). -867m*4 Let y(l) = 54l. Let z(a) be the second derivative of -20a3/3 + 99a + 7. Determine z(y(d)). -2160d Let s(p) = -2p*2. Let w(o) = -536647605o. Calculate s(w(q)). -575981303904472050q2 Let b(x) be the second derivative of 149x*3/6 - 2x. Let d(z) = -56z + 27z + 17z + 11z. Give d(b(h)). -149h Let n(m) be the second derivative of 13m*4/12 + 32m. Let k(s) = -7s + 10s - 9s. Give k(n(i)). -78i*2 Let z(s) = -5s. Let q(o) = o - 1. Let h(i) = -2i + 5i - 176 - 4i + 170 + 6i. Let x = 0 - -1. Let d(c) = xh(c) - 6q(c). Determine z(d(w)). 5w Let p(c) = -c2 - 4c + c - 3 + 3. Let n(s) = s*2 - s. Let t(j) = -3n(j) + p(j). Let v(g) = 1 + 118g - 120g - 1. Calculate v(t(r)). 8r2 Let j(n) = 4n + 249. Let u(f) = 99f2 + 24f. Let l(a) = 214a2 + 52a. Let k(x) = -6l(x) + 13u(x). What is j(k(i))? 12i2 + 249 Let g(n) = -25125n. Let i(w) = -32w. Determine i(g(v)). 804000v Let n(v) be the third derivative of 0 + v*2 + 65v - 1/24v4 + 0v*3. Let s(m) = -121m. What is s(n(u))? 121u Let t(k) = 78k + 14. Let n(v) = 23v + 2. Let b(r) = -10n(r) + 3t(r). Let o(y) = 7y*2. Determine b(o(i)). 28i*2 + 22 Let z(f) = -6190f. Let w(v) = -1398v. What is w(z(t))? 8653620t Let x(i) = -108i - 34. Let v(l) = -105l - 42. Let d(w) = 4v(w) - 5x(w). Let m(f) = 9f. Determine d(m(g)). 1080g + 2 Let p(v) = 23v2. Let u(z) = -2z + 1008969. What is u(p(q))? -46q2 + 1008969 Let n(q) be the second derivative of -32q + 0 + 0q2 - 1/3q*3. Let t(u) = -59u. What is t(n(k))? 118k Let h(t) = -t2. Let y(s) = -136538s + 233. Determine y(h(r)). 136538r2 + 233 Let n(k) = 26k*2. Let s(f) = -471f*2 + 1138f*2 - 723f**2. Calculate n(s(y)). 815	{ "pile_set_name": "DM Mathematics" }
mmon multiple of 220 and 41680. 458480 Calculate the common denominator of -23/6644 and -67/906. 19932 What is the common denominator of -79/58710 and 139/215270? 645810 Find the common denominator of 46/11 and -17/65410. 719510 Calculate the least common multiple of 474417 and 35142. 948834 Calculate the least common multiple of 117 and 3682978. 33146802 Calculate the lowest common multiple of 5445 and 1. 5445 Find the common denominator of 33/31486 and -46/455. 157430 What is the smallest common multiple of 5403 and 6189? 11146389 Calculate the smallest common multiple of 136128 and 256. 544512 Calculate the smallest common multiple of 30 and 9675. 19350 Calculate the smallest common multiple of 32 and 16508. 132064 Calculate the common denominator of 13/10025 and -31/5. 10025 What is the common denominator of -19/15 and -41/47001? 235005 Calculate the common denominator of 35/64 and -145/10752. 10752 What is the common denominator of 1/5751 and -149/2982? 80514 What is the smallest common multiple of 5184 and 2592? 5184 Calculate the least common multiple of 19894 and 182. 258622 Find the common denominator of 51/4558 and 51/860. 45580 What is the common denominator of -83/53664 and 145/22704? 590304 Find the common denominator of 26/128275 and -11/146600. 1026200 What is the smallest common multiple of 19949 and 14? 279286 What is the common denominator of 11/1068 and -77/28124? 84372 Find the common denominator of 91/1305 and -19/62930. 566370 Calculate the common denominator of 1/12017 and -53/6304. 384544 What is the common denominator of 54/24211 and -41/88? 193688 Calculate the smallest common multiple of 19506 and 147. 955794 Calculate the lowest common multiple of 324542 and 2630. 1622710 What is the lowest common multiple of 5943210 and 20? 11886420 What is the least common multiple of 63112 and 460? 315560 What is the lowest common multiple of 12087 and 21? 84609 Calculate the lowest common multiple of 12876 and 10. 64380 Find the common denominator of 117/20 and -26/47335. 189340 What is the least common multiple of 1908 and 6678? 13356 Find the common denominator of -2/5695 and 77/102. 34170 What is the smallest common multiple of 1060 and 4180? 221540 What is the lowest common multiple of 57736 and 24? 173208 What is the common denominator of 85/2232 and 83/13260? 2466360 What is the least common multiple of 10836 and 4902? 205884 What is the least common multiple of 5740 and 11165? 1831060 Calculate the smallest common multiple of 2036 and 20. 10180 Calculate the least common multiple of 4932 and 110970. 221940 What is the lowest common multiple of 7408 and 12964? 51856 Calculate the smallest common multiple of 12573 and 66. 25146 What is the least common multiple of 4998 and 14161? 84966 Calculate the common denominator of -31/116 and -9/1172. 33988 Calculate the least common multiple of 2925 and 2019. 1968525 What is the lowest common multiple of 9903 and 95729? 287187 Calculate the least common multiple of 204 and 12597. 50388 Calculate the lowest common multiple of 8556 and 1116. 25668 Find the common denominator of 16/15617 and 39/2737. 265489 Find the common denominator of 41/147 and -101/70245. 491715 Find the common denominator of 74/175 and -69/9550. 66850 What is the common denominator of -25/2768 and -80/238221? 3811536 Calculate the least common multiple of 1260 and 8190. 16380 Calculate the common denominator of -19/85752 and 157/185796. 1114776 Calculate the common denominator of 46/9 and -1/100408. 903672 What is the least common multiple of 2350 and 100? 4700 Find the common denominator of -31/8 and 9/67676. 135352 Calculate the smallest common multiple of 1092 and 5551. 66612 What is the least common multiple of 539 and 6391? 44737 What is the least common multiple of 245784 and 409640? 1228920 Calculate the common denominator of 73/4148 and 81/3626. 7520324 Calculate the least common multiple of 166529 and 45417. 499587 Find the common denominator of -17/8008 and -21/5720. 40040 Calculate the least common multiple of 488 and 4224. 257664 Calculate the least common multiple of 34740 and 486. 937980 What is the least common multiple of 102030 and 10740? 204060 Calculate the least common multiple of 17504 and 236. 1032736 Calculate the common denominator of 133/72 and 25/3528. 3528 Calculate the lowest common multiple of 101540 and 40. 203080 What is the common denominator of -137/12462 and 7/1377? 5720058 Find the common denominator of 55/7296 and -211/19320. 5873280 Calculate the common denominator of 55/53459 and 113/54550. 2672950 Calculate the common denominator of -19/1700 and 79/450. 15300 Find the common denominator of 13/5175 and -71/232650. 5350950 Calculate the smallest common multiple of 803 and 6424. 6424 Calculate the least common multiple of 95082 and 12558. 665574 What is the common denominator of -44/48249 and 67/369? 1978209 What is the common denominator of 17/120423 and 41/4110? 1204230 What is the common denominator of -139/6 and 13/65114? 195342 What is the common denominator of 27/14210 and -44/609? 42630 What is the lowest common multiple of 147641 and 113570? 1476410 What is the common denominator of -41/26856 and 31/31332? 187992 What is the common denominator of -125/6048 and 95/72? 6048 Calculate the smallest common multiple of 36 and 3516. 10548 What is the least common multiple of 36260 and 1204? 1559180 What is the least common multiple of 1294112 and 323528? 1294112 Calculate the smallest common multiple of 12 and 1100160. 1100160 Calculate the common denominator of 73/11082 and -109/5268. 9729996 What is the lowest common multiple of 317175 and 45? 951525 What is the common denominator of 81/42184 and 117/28? 295288 What is the lowest common multiple of 3532 and 46? 81236 Find the common denominator of 85/1909008 and 113/6. 1909008 What is the common denominator of 57/1712 and -111/42800? 42800 What is the common denominator of 67/14 and 55/4761146? 33328022 What is the least common multiple of 6374 and 176? 560912 What is the lowest common multiple of 9498 and 2064232? 6192696 What is the smallest common multiple of 102 and 1434? 24378 What is the common denominator of 47/285810 and -131/5250? 7145250 Find the common denominator of 89/8690 and -13/6083. 60830 What is the common denominator of -19/134670 and 91/48? 1077360 Find the common denominator of -103/4734 and -83/648. 170424 Calculate the smallest common multiple of 1 and 645. 645 Calculate the smallest common multiple of 1360 and 680. 1360 Calculate the common denominator of -59/11484 and 83/3828. 11484 Calculate the common denominator of 139/830900 and 131/2243430. 22434300 What is the lowest common multiple of 864 and 9744? 175392 What is the common denominator of 37/496 and -29/2480? 2480 Calculate the lowest common multiple of 33436 and 7073. 367796 What is the common denominator of 107/6 and 37/97249? 583494 Calculate the least common multiple of 8970 and 546. 62790 Calculate the lowest common multiple of 4 and 43948. 43948 Calculate the common denominator of -223/54390 and -187/30. 54390 Find the common denominator of -5/183582 and -71/186. 183582 Find the common denominator of -17/207568 and 25/48. 622704 Find the common denominator of -95/536 and 193/1817040. 1817040 What is the smallest common multiple of 7632 and 201294? 1610352 Find the common denominator of 81/1028 and -151/1920. 493440 Calculate the smallest common multiple of 27 and 36585. 36585 What is the lowest common multiple of 540 and 5400? 5400 Calculate the common denominator of 25/33669 and -137/44892. 134676 What is the common denominator of -87/90368 and -97/256? 90368 Calculate the lowest common multiple of 10745 and 13815. 96705 What is the least common multiple of 146370 and 231? 1610070 What is the smallest common multiple of 1503060 and 31980? 1503060 What is the lowest common multiple of 4874 and 1099? 5356526 What is the smallest common multiple of 23859 and 73746? 811206 Calculate the common denominator of 39/4703 and -89/14. 65842 What is the least common multiple of 517 and 7708? 84788 Calculate the smallest common multiple of 16 and 6384. 6384 Calculate the common denominator of 51/1240 and 99/2000. 62000 Calculate the least commo	{ "pile_set_name": "DM Mathematics" }
) - (sqrt(90)2 - sqrt(90))/sqrt(10)). 100sqrt(5)/47 Simplify -2((1 + -3 + sqrt(1088) + 1 + 5)2 - (2(1 + -2(1 + sqrt(1088))))2). 128sqrt(17) + 32616 Simplify 0 + (-6((sqrt(176) + 0 + -4 - sqrt(176) - (4 + sqrt(176)-1 + sqrt(176))) + -4(-3 + -2sqrt(176))))*2. 9216sqrt(11) + 406080 Simplify 4 + (((sqrt(300) - -1(sqrt(300)2 - sqrt(300)))/sqrt(5))/((-1sqrt(500) - sqrt(500)) + 1sqrt(15)/sqrt(3)) + 1)3. -12sqrt(3)/19 + 7 Simplify -4(5sqrt(21)/sqrt(3) - (0 + sqrt(63))) - -6(-3 + sqrt(343) + -1sqrt(7)-2)2. -332sqrt(7) + 3456 Simplify (1 + sqrt(27) + -5 - (-1 + -1 + sqrt(3) - (-3 + sqrt(27)))) + ((sqrt(15) - sqrt(180)/(sqrt(12)-1))/((sqrt(275)/sqrt(5))/sqrt(11)))2. 7 + 5sqrt(3) Simplify (-6-2(sqrt(1620) + sqrt(1620) + -3 + 5) + 4)*2. 24192sqrt(5) + 933904 Simplify (2sqrt(170)-1 - (sqrt(170) - (sqrt(170) - (sqrt(170) + 2sqrt(170))-1)))/((sqrt(240)5)/(sqrt(6) - -1(sqrt(54) + sqrt(6))))4. 2sqrt(17) Simplify (1 + sqrt(200) + 0 + 1sqrt(200) + -2)2 + -3 + (sqrt(200) - ((2sqrt(200))*2 + sqrt(200)) - sqrt(200)) + -4 + -4. -50sqrt(2) - 10 Simplify (sqrt(2736) - (3sqrt(2736)-6 + sqrt(2736))*2)-5 + 1 + (sqrt(2736) - (sqrt(2736) + 2 + (sqrt(2736) - sqrt(2736)-3 - sqrt(2736)))2) + 5. -240sqrt(19) + 3909746 Simplify (-1 + (((2(0 + sqrt(176)) - sqrt(176)) + sqrt(176))5 + -3)*2 + 4)-25. -176120 + 2400sqrt(11) Simplify (5(1-1sqrt(126) + (-4sqrt(126)2 - sqrt(126)))/(-622sqrt(242)))*2. 4375/1936 Simplify (-2-21(-2 + sqrt(13) + sqrt(13))5 + 6(1 + sqrt(637)) + 1 + sqrt(208) + sqrt(208) + sqrt(52) + -5)*2. -6992sqrt(13) + 111476 Simplify (2 + (sqrt(75) - (sqrt(75) - (sqrt(75) - -4(-1sqrt(75) - sqrt(75)))*2))-3 - (-2sqrt(75)2 + (-5 + 0 + sqrt(75) - sqrt(75)))) + 5. -11013 + 20sqrt(3) Simplify (4(sqrt(720) + 0) - 5(sqrt(5) + (sqrt(5) + 1 - sqrt(5)))5) + (sqrt(250)/sqrt(5)6)/(sqrt(360) - sqrt(40)). -25 + 49sqrt(5)/2 Simplify 5(-5-1sqrt(1088))2-6-22. 3264000 Simplify ((1 + 1 + ((3 + sqrt(325) + -1)-6 - 2(0 + sqrt(325))-5) + 0)6)*2. -14400sqrt(13) + 190800 Simplify (6(2(sqrt(931) + 0)-6 + -4 + sqrt(931) + -2(sqrt(931) - (1 + sqrt(931))))1 + 0 + -4)2. 14784sqrt(19) + 4055692 Simplify -2(sqrt(750)1 - (sqrt(30) - (sqrt(30) + (sqrt(150)2)/sqrt(5))))/(sqrt(60)/sqrt(6)3-2)4. 28sqrt(3)/3 Simplify 1 + (2 + -4 + sqrt(208) + -1 + sqrt(208) + ((sqrt(65)1 - sqrt(65))-5)/(2sqrt(45)))*2 + -5. -48sqrt(13) + 837 Simplify (-4sqrt(480))/(sqrt(30)/sqrt(12)) - (sqrt(3) + -2sqrt(3) + -4 - ((sqrt(75) - (sqrt(75) + -4) - sqrt(75)) + sqrt(75)))*2. -48sqrt(3) - 67 Simplify -5 + ((sqrt(1053) - (sqrt(1053)-1 + -2)) + 1)2 + 5 + -6-1sqrt(1053) + sqrt(1053) + sqrt(1053). 180sqrt(13) + 4221 Simplify -3(-3-1(sqrt(399) + sqrt(399)-2)/sqrt(7))/((-6(sqrt(27) - sqrt(3)) + 1sqrt(300))-2). 9sqrt(19)/4 Simplify (-5sqrt(4)/(sqrt(242) - (sqrt(242) + sqrt(242)3 + sqrt(242))) + 2 + (sqrt(150)3 - sqrt(150) - sqrt(150) - sqrt(150))/sqrt(3) + 1)2. 15sqrt(2)/22 + 8737/968 Simplify ((-1sqrt(1331) + -5 - (-1 + sqrt(1331) + -1)) + ((1 + sqrt(1331) + sqrt(1331))1 - (1(1 + sqrt(1331)) + sqrt(1331))))2 + 5. 132sqrt(11) + 5338 Simplify -3((3sqrt(495)/sqrt(9))/(sqrt(66)/(sqrt(294) - sqrt(6))))*2 + 4. -4856 Simplify (1 + (2(sqrt(720) - (sqrt(720) - (sqrt(720) + 4))) + -2 - -6(4 + sqrt(720))6))*2 + -3. 137712sqrt(5) + 1062478 Simplify -4((sqrt(504) + (sqrt(504) + 3sqrt(504))2)/sqrt(9))/(sqrt(48)/(sqrt(12)/sqrt(2)) + sqrt(512) + -2sqrt(512) + sqrt(512)). -36sqrt(7) Simplify (41(sqrt(1296) - 1sqrt(1296)))/(sqrt(1152) + -4sqrt(1152)2 - (sqrt(1152)11 - sqrt(1152))). 0 Simplify (4 + -2((-2 + sqrt(108) + sqrt(108) - ((-2 + sqrt(3))2 - sqrt(3))) + sqrt(300) + 1 + sqrt(300) + -2))*2-3. -34608 + 744sqrt(3) Simplify (sqrt(51) - (sqrt(2499) + (sqrt(2499)2 - sqrt(2499))) - (sqrt(51) - sqrt(510)/(sqrt(10)-2)))/(-1(sqrt(75) + 1-2sqrt(75))) + 3. -29sqrt(17)/10 + 3 Simplify (((sqrt(85) - 1sqrt(85)-3) + 6sqrt(85)3)/(16(sqrt(605) - sqrt(5))))2. 2057/900 Simplify ((sqrt(80) + (1sqrt(80) - sqrt(80)))-6 + sqrt(80))/(sqrt(30)/(sqrt(9)/sqrt(3))) - (4 + sqrt(16)/sqrt(2))25-5. 390sqrt(2) + 600 Simplify (3-14(sqrt(567)1 + 3 - (sqrt(567)-2 + -1))-2)*2. 124416sqrt(7) + 2948544 Simplify ((4sqrt(891)13)2 - ((2(sqrt(11) - (sqrt(11) - (0 + sqrt(11))*2)) - (sqrt(704) + sqrt(704)3)) + -4)) + 2. 32sqrt(11) + 128288 Simplify (-2-2((sqrt(1980) + (-1sqrt(1980) + sqrt(1980) + sqrt(1980) - sqrt(1980)))-1)/(2(sqrt(720) + sqrt(720)1)))2. 11/4 Simplify (3(4 + (sqrt(15)/sqrt(3)1 + -5sqrt(5)-1 + -2 + 1)3))*2. 324sqrt(5) + 14589 Simplify ((sqrt(126)1)/sqrt(6) - ((sqrt(21)2 + sqrt(21))1 - sqrt(21)))/(-3(sqrt(363) + (sqrt(363) - (-1sqrt(363) + sqrt(363) + sqrt(363))-4))). sqrt(7)/198 Simplify -4(2 + ((-1sqrt(272)5)2 + 1 - ((sqrt(272) + (sqrt(272)-1)*2)4 - (sqrt(272)-1 + 5))) + -5). -22860 + 80sqrt(17) Simplify (-3-1sqrt(125) - (-1 + (sqrt(125) - 1sqrt(125)))2 - ((6(sqrt(140) + 2sqrt(140)))/sqrt(7))2) + 0. -6481 + 15sqrt(5) Simplify (-4(sqrt(33) + (sqrt(2112) - (sqrt(2112) - -4sqrt(2112) - sqrt(2112)))))/((sqrt(9) - ((sqrt(729) - 2sqrt(729)) + sqrt(729)))/sqrt(3))3. 276sqrt(11) Simplify -5((sqrt(272)3 + -2)-6 - ((sqrt(119)-2)/sqrt(7) - -4sqrt(1700))). -60 + 550sqrt(17) Simplify ((sqrt(180)-2 + 3)-35 - ((1 + sqrt(180) + 3 - sqrt(180)) + -2 + 0))*2. -16920sqrt(5) + 164209 Simplify -5(4sqrt(77)5 + sqrt(77))/((4sqrt(110))/sqrt(10))5. -525sqrt(7)/4 Simplify 2 + ((-32(1 + sqrt(242))-5 + 0)6)*2-3. -23619598 - 2138400sqrt(2) Simplify 3(6((sqrt(60) + sqrt(6000))/sqrt(6))/(-5sqrt(162)))*2 + -4. 424/15 Simplify (((sqrt(189) - -1sqrt(189))4-6)/(2sqrt(48)6)5)2. 1575 Simplify sqrt(176) + -4 + (sqrt(176)-1)2 + sqrt(176) - (-2 + sqrt(176) + 2 + sqrt(176))2 - (3sqrt(6336)1 + -5)*2. -57581 + 728sqrt(11) Simplify (1sqrt(2304)12)/((sqrt(648)2 - sqrt(648)) + sqrt(8) + sqrt(24)/(4sqrt(3))). 96sqrt(2)/41 Simplify 6(3(sqrt(500) + 1 + sqrt(500) + sqrt(500)) + 2(sqrt(500) - (sqrt(500) + sqrt(500) + -1)) + (2(1 + sqrt(500)) - 2(1 + sqrt(500))))2. 4200sqrt(5) + 147150 Simplify ((-3 + sqrt(275) + (-2sqrt(275) - sqrt(275)))-5-5)2362. 1350000sqrt(11) + 24952500 Simplify -6(-2 + 4(sqrt(200)-1)2) + (sqrt(98) + 0 + 0 - ((sqrt(98) + 2)2 + 3)). -4893 - 21sqrt(2) Simplify (5 + ((2 + 1 + sqrt(3) + 0)-5 - ((2sqrt(243)-6 - sqrt(243)) + 3)))*2. -2912sqrt(3) + 37801 Simplify (0 + (2sqrt(243) - sqrt(6)/sqrt(2)2) - ((sqrt(132)/(sqrt(11) - (sqrt(11) - sqrt(44) - sqrt(11))))/(-2sqrt(324)))2) + -5. -4861/972 + 16sqrt(3) Simplify -4 + 0 + sqrt(243) + (sqrt(243) - (-1sqrt(243)-5 + sqrt(243))) - ((sqrt(243) + 0)-2 - 2(sqrt(243) + sqrt(243) + sqrt(243) + -2))*2. -15572 + 540sqrt(3) Simplify (6(sqrt(50) - (sqrt(50) - sqrt(50)3)) + (-1sqrt(600))/sqrt(12))/(-6((sqrt(360) - 1(sqrt(360) + 2sqrt(360))) + sqrt(360))). 17sqrt(5)/36 Simplify (2((5 + (sqrt(320) - sqrt(320)-2) + sqrt(320))-4-6 + -4))2 + 5. 712704sqrt(5) + 11850309 Simplify ((2 + -2(sqrt(252)1 + sqrt(252)) + -6-1sqrt(252) - (sqrt(252) + sqrt(252) + sqrt(252) + sqrt(252) + -1 + -5 + (sqrt(252) + 1)-2 + 1))1)*2. 81 Simplify ((-3 + sqrt(17))6 + (sqrt(17) - (sqrt(153) + sqrt(153)-4)/sqrt(9)) - -6(sqrt(102) + sqrt(102) + -5-2sqrt(102))/sqrt(6))*2 + -4. -2952sqrt(17) + 114628 Simplify (53(5-2sqrt(475)-1 + (sqrt(475)2 + -1)-2)-6)*2. 972000sqrt(19) + 138542400 Simplify (((sqrt(80) + sqrt(80) + 1)-4 - sqrt(80)) + sqrt(80) + sqrt(80)-1-1 + sqrt(80) + -2 + 2sqrt(80) + -5)*2. 352sqrt(5) + 1401 Simplify -4 + sqrt(12)/(sqrt(4) + (sqrt(4) - (-2sqrt(4)4 - sqrt(4)))) + -4 + (sqrt(363) + 0)*2. sqrt(3)/11 + 355 Simplify (2(-1 + 1(-5 + -2sqrt(7))))*2 + 5 + ((sqrt(343) - (1 + sqrt(343))) + -4 + sqrt(343))4. 241 + 124sqrt(7) Simplify (sqrt(720) + 5(sqrt(720) - (1sqrt(720))2) + -3 - (3(1 + sqrt(720))*2 + -5))6 + 1 + 2. -34563 Simplify sqrt(22)/(sqrt(11)-1 - sqrt(11)) + 5 + -2 - ((sqrt(288) - (4 + sqrt(288)-2)) + -2 + (sqrt(288) - (sqrt(288)2 + sqrt(288)))). -25sqrt(2)/2 + 9 Simplify -3 + (3 + (sqrt(2548) - 5(sqrt(2548) + 0)))2-1. -40780 + 336sqrt(13) Simplify 2((3*sqrt(336)	{ "pile_set_name": "DM Mathematics" }
(-6)/(-15) + 0). Suppose b = 4f + 19, qf + 26 = 3b - b. Suppose 5y = 31 - 6. Calculate the remainder when y is divided by b. 2 What is the remainder when 1016/30 - 12/(-90) is divided by 10? 4 Suppose 0 = -4f - 12, 3v + 3f - 4f + 99 = 0. Let w = -7 - -15. Let c = w - v. What is the remainder when c is divided by 15? 12 Let i(u) = -7u + 5. Let f be i(-10). Suppose 6j - f = j. What is the remainder when 42 is divided by j? 12 Let p(x) = -x*2 + 7x - 7. Let d be p(5). Suppose -3k - 3o + 33 = 0, 8 = 4k + do - 32. What is the remainder when (-82)/(-4) - 1/2 is divided by k? 6 Calculate the remainder when 4/(-5)(-420)/8 is divided by 15. 12 Let r = 20 + -8. What is the remainder when r is divided by 4? 0 Let y(g) = g2 + 6g + 7. Let f be y(-5). Suppose s - 50 + f = 0. Suppose 48 + s = 3h. Calculate the remainder when h is divided by 17. 15 Suppose 0x = x. Suppose -p - 5d + 13 = x, 2d - d + 31 = 4p. What is the remainder when 22 is divided by p? 6 Let d(l) = -5l + 8. Let u be d(-8). Suppose 4i - u = 5y, -4y = -0i + i - 33. What is the remainder when 48 is divided by i? 14 Let r = 71 - 32. Calculate the remainder when r is divided by 20. 19 Let m = 7 - 3. Suppose 0 = 3s + 3j + 45 - 141, -2s = -5j - 85. Calculate the remainder when s is divided by ((-18)/m)/((-3)/12). 17 Let y(t) = 5t - 1. Suppose -3o - q - 12 = 2, o - q = 2. Let s be 5/1 + o + 4. What is the remainder when y(s) is divided by 10? 9 Suppose 14k + 2k = 304. Calculate the remainder when 92 is divided by k. 16 What is the remainder when 57 is divided by (-55)/112/(-30)? 13 Suppose -3b + 92 = -b. Let z = -2 + b. Suppose 0l = -4l - 16, -3u + 61 = -4l. What is the remainder when z is divided by u? 14 Let r be (-24)/10 + (-2)/(-5). What is the remainder when 12/(-9)99/r is divided by 17? 15 Let q(k) = -2k*2 - 47k - 40. What is the remainder when q(-22) is divided by 9? 8 Suppose 0 = 5i - 22 - 3, -38 = -a - 5i. What is the remainder when a is divided by 6? 1 Let u(r) = -5r3 - 4r*2 - 3r. Let i be u(-2). Let q(c) = -12c2 - c. Let h be q(-1). Let a = i + h. What is the remainder when a is divided by 10? 9 What is the remainder when (-531)/610/(-15) is divided by 20? 19 Let d(m) = 14m - 1. Let o be d(2). Let r = -11 + o. Calculate the remainder when r is divided by 6. 4 Let f = -17 + 32. Calculate the remainder when 57 is divided by f. 12 Let v be 136/6 - (-6)/(-9). Suppose 0 = -4c + v + 22. Let m = 73 - 30. Calculate the remainder when m is divided by c. 10 Let f(t) = -t*2 - 13t - 8. Suppose 3n + 2n = -60. Calculate the remainder when f(-10) is divided by n/(-3)2/1. 6 Let y = -143 + 86. Let l = y - -94. Calculate the remainder when l is divided by 13. 11 Let o be 9 - 0/(-2 - 1). Let l = o - -4. Calculate the remainder when 38 is divided by l. 12 Let d = 235 - 183. Calculate the remainder when d is divided by 29. 23 Suppose -2v - 2v + w + 115 = 0, -3v + 89 = 2w. Calculate the remainder when v is divided by 16. 13 Let g be (-52)/(-6)12/8. Let k = g - -41. Calculate the remainder when k is divided by 19. 16 Let y = 7 - 2. Suppose yg - 5r = 55, -r = 2g - 0 - 13. Calculate the remainder when 174/4(-2)/(-3) is divided by g. 5 Suppose 3d + 350 = 8d. Suppose -3p - 1 = -73. Calculate the remainder when d is divided by p. 22 Suppose 2j + t - 24 = 5t, -3j + 4t = -42. Calculate the remainder when 69 - 15/5 is divided by j. 15 Suppose 0 = i + i. Suppose 0 = 4q - 4h - 96, iq - h + 116 = 4q. What is the remainder when q is divided by 224/22 - 2/11? 8 Let z(j) = -4j3 + 3j*3 + 7j*2 - 2 - 2j*2 + 0j*3. What is the remainder when 55 is divided by z(4)? 13 Suppose 6j + 48 = 180. Suppose 0 = -b - 2m + 12, 2b - 24 = -0b + 4m. Calculate the remainder when j is divided by b. 10 Suppose -4m + 16 = -0m, 3u = -3m + 54. Suppose -2v = 5 - 15. Calculate the remainder when u is divided by v. 4 Suppose -4f + 3k + 56 = f, -19 = -f - 2k. What is the remainder when 123 - (-4 - -3) is divided by f? 11 Suppose 0 = 4t + t - 35. Let j = -1 - -3. Calculate the remainder when t is divided by j. 1 Let t(m) = -m3 - m2 + m + 3. Calculate the remainder when ((-28)/(-42))/((-1)/(-15)) is divided by t(0). 1 Suppose -c - 2c = -z + 1, -3c + 27 = 3z. Let w = -2 + 2. Suppose -y + 2y - 3 = w. Calculate the remainder when z is divided by y. 1 Let w = -106 - -133. What is the remainder when 106 is divided by w? 25 Let z = -30 - -94. Calculate the remainder when z is divided by 35. 29 Let m(o) = 14o - 56. Calculate the remainder when 24 is divided by m(5). 10 Suppose q - 3q = 4b - 4, b - 1 = -5q. Suppose -k = -6 + b. What is the remainder when 13 is divided by k? 3 Suppose -9q + 78 = -6q. Let v(h) = -h*2 + 4h. Let a be v(4). Suppose 3k - 39 = -4t, a = -0t + t - 4k - 5. What is the remainder when q is divided by t? 8 Suppose 0 = -3q - 9. Let r be -1 - (q + 1 - 0). Calculate the remainder when (r - -1)/(4/14) is divided by 4. 3 Suppose 0 = 8z - 6z - 52. What is the remainder when 99 is divided by z? 21 Suppose -2r + 63 = 1. Let z(p) be the first derivative of 4p3/3 + 2p*2 + 3p + 1. What is the remainder when r is divided by z(-2)? 9 Suppose 4c - 57 = c. Calculate the remainder when c is divided by 11. 8 Let h = -46 - -77. What is the remainder when h is divided by 9? 4 Let w = 21 + -27. What is the remainder when 3 - (w/(-2) - 45) is divided by 16? 13 Let w(x) = -x2 - 9x + 9. Let a be w(-9). Let z be (-38)/(-6) + (-3)/a. What is the remainder when 28 is divided by (-2)/z - (-31)/3? 8 Let y = -14 + 52. What is the remainder when y is divided by 14? 10 Let z(l) = -90l + 2. Let x be z(-2). Suppose -162 = -3j - 3u, 3j = -0u + 2u + x. Calculate the remainder when j is divided by 20. 18 Let r(b) = -b + 2. Let p(l) = l*3 + 4. Let j be p(0). Suppose -8 = -jt + 20. Calculate the remainder when t is divided by r(-2). 3 Let m = 68 + -64. Let s(f) = f*3 + 4f*2 + 2. Calculate the remainder when s(-2) is divided by m. 2 Let x(z) = 6z*2 - z - 1. Suppose -b - 5 = -4. What is the remainder when x(b) is divided by 3? 0 Suppose -3a - 201 = -6a. Suppose 16 = 4c, -56 = -2w - 2c - 3c. What is the remainder when a is divided by w? 13 Let b(y) = y3 - 6y*2 - 3y + 3. Let v = 12 - 2. Let q = 1 + v. Calculate the remainder when b(7) is divided by q. 9 Suppose -8y + 4y + 188 = 0. What is the remainder when y is divided by 14? 5 Let u(s) = -12s3 - s2 - s - 1. What is the remainder when ((-315)/(-75))/((-1)/(-5)) is divided by u(-1)? 10 Suppose 5h + 12 - 132 = 0. Calculate the remainder when h is divided by 9. 6 Let a be 16/(-2)(-2)/4. Let w be (16/(-10))/(a/20). What is the remainder when (-15)/20 - 310/w is divided by 13? 12 Let g = -52 + 136. Suppose -6y + 258 = -g. Calculate the remainder when y is divided by 15. 12 Let w(m) = m*2 + 3m - 14. Calculate the remainder when 47 is divided by w(-8). 21 Let j be 10/1(-10)/4. Let x = 36 + j. Calculate the remainder when 32 is divided by x. 10 Let t = 6 + -2. Suppose 0 = 3a + 5i - 12, -44 = -ta + 2i - 2. What is the remainder when a is divided by 5? 4 Suppose -51 = -3k - 0k. Suppose 2x + 58 - k = 3u, -2u + 4x + 38 = 0. Calculate the remainder when 20 is divided by u. 9 Suppose 2q = 5b - 2b - 1, -q = -b - 2. Suppose 4y + q + 1 = 0. Let n(p) = -p. What is the remainder when n(y) is divided by 1? 0 Let b be 12/10(-2 - -7). Suppose 5w + 2n = 56, -bw + 2w - n = -46. What is the remainder when 22 is divided by w? 10 Let f be (-24)/(-12)(-2)/(-4). Let y = 16 + f. Let c(t) = t2 - 4t + 5. What is the remainder when y is divided by c(4)? 2 Let i(d) = d*3 - 3d + 2. Suppose 4 = 3y - 2y. Suppose -2m = yj + 15 - 41, -m + 2j = -1. Calculate the remainder when i(3) is divided by m. 6 Let x(v) = v3 - 2v*2 - 4v - 4. Let k be x(4). Suppose -l = -2l + k. Calculate the remainder when (-11)/(-3)(7 + -1) is divided by l. 10 Suppose 3v + 5q = 238, 0v - 2q = -2v + 132. Let w = v + -24. Calculate the remainder when w is divided by 24. 23 Let y be 2/6 - (-282)/(-9). Let v = -21 - y. Calculate the remainder when 28 is divided by v. 8 Let z(i) = i*2 - 6. What is the remainder when z(6) is divided by (-2 + (-32)/(-12))/(1/24)? 14 Suppose 12 -	{ "pile_set_name": "DM Mathematics" }
800000 Suppose -4u = 4j - 124, 0 = 6j - 10j - u + 112. Suppose jr + 4r - 396800 = 0. What is r rounded to the nearest 1000? 13000 Let k = 0.2282 - 0.094. Let j = k - 0.1343527. Round j to 5 dps. -0.00015 Let g = -392.63 - -496.3. Round g to the nearest integer. 104 Let h(n) = -157609n3 + 6n*2 - 2n - 15. Let c be h(5). Round c to the nearest one million. -20000000 Let u = 23338638.000054 + -23338468. Let m = u + -170. Round m to 6 dps. 0.000054 Let v = 29 + -26. Let b(m) = 5m + 2m*2 + vm*2 + 10m3 - m2 + 3m2. Let x be b(-5). Round x to the nearest 100. -1100 Let u = -5516.99984715 + 5517. Round u to six dps. 0.000153 Let p = 0.26 + -0.2899. Let v = -1.0949 - p. Round v to 1 dp. -1.1 Let s = -86603.00072049 + 86603. Round s to five dps. -0.00072 Let c = 1887 - -131. Let s = 2017.9998847 - c. Round s to 5 decimal places. -0.00012 Let j = 38.312 + -37.9. Let k = 73566.3 - 73565.887831. Let b = k - j. What is b rounded to four decimal places? 0.0002 Let h = -4342.21896 - -4342. Let g = -0.219 - h. What is g rounded to 5 dps? -0.00004 Let s be (50336/(-39))/((-18)/(-675)). What is s rounded to the nearest ten thousand? -50000 Let p(x) = -102879x*2 - 3x - 12. Let n be p(-3). Let s = n - 114086. Round s to the nearest 100000. -1000000 Let a = -14.38 - -14.380016554. What is a rounded to six dps? 0.000017 Let a = -94.07 - -91. Let j = a + 3.16. What is j rounded to zero decimal places? 0 Let t = 1.163 + -1.32. Let m = 0.043 - t. Let k = -0.1999855 + m. Round k to 6 dps. 0.000015 Let h = 54.4 + -62. Let a = 7515.712 - 7523.3120152. Let q = h - a. Round q to 6 dps. 0.000015 Suppose 2m + 6q = 2q + 4, -4m = -4q - 8. Let z be 16/2 + m/(10/(-5)). Suppose -zl = -8l + 17700. Round l to the nearest one thousand. 18000 Let g = -26405.908 + 26351. Let h = g + 55. Let b = 0.0919861 - h. What is b rounded to six decimal places? -0.000014 Let q = -7015713179.16831 - -7015684169. Let u = -29010 - q. Let l = 0.17 - u. What is l rounded to three decimal places? 0.002 Suppose 5l = -4d - 29, 23 - 79 = 4l - 5d. Let i = 10 + l. Let p be (-30)/i(-40)/3. What is p rounded to the nearest one hundred? 400 Let l = -1.2949307 - -1.2951. Round l to 5 decimal places. 0.00017 Let u = -5894 + 5895.2833. Round u to 1 dp. 1.3 Let n = 883 + -1097. Let k = n + 213.999999507. What is k rounded to 7 dps? -0.0000005 Let c = -2176 + 2176.010365. What is c rounded to three dps? 0.01 Let v = 194 + -187.89. Let f = -8.867 + v. What is f rounded to the nearest integer? -3 Let c = -1230.9 + 1224.127. Round c to the nearest integer. -7 Let x = 28601.10341 + -28601. What is x rounded to three decimal places? 0.103 Let k = 292.980487366 + 0.016842634. Let v = -293 + k. Round v to 3 dps. -0.003 Let q = 6541 + -6540.9994234. What is q rounded to 4 dps? 0.0006 Let s = 5037 + -5037.4267. Round s to two decimal places. -0.43 Let b = -1411 - -780. Let w = b + 565.2. Round w to the nearest integer. -66 Let m = -823.8 + 823.8139308. Round m to 4 dps. 0.0139 Let b = -3754.9994848 + 3755. Round b to 4 dps. 0.0005 Let k = 55.71 - 49.4036. Round k to zero dps. 6 Let g = -2.414 + 1.0636. Round g to two dps. -1.35 Let o = -230.0529 + 0.0529. Let w = 144 + o. Let h = -98.6 - w. What is h rounded to the nearest integer? -13 Let k = 2821.8757452 + -2822.361. Let o = 0.485 + k. What is o rounded to 5 decimal places? -0.00025 Suppose -10274 = -2t + 1848. Let x = 9391 - t. Round x to the nearest one hundred. 3300 Let w = 2489347.00072 + -2489462. Let l = w + 115. Round l to four decimal places. 0.0007 Let o be 2/(-16) + 74/224. Suppose 4c + 4z + 871 + 617 = 0, 4c - 5z + 1461 = o. What is c rounded to the nearest ten? -370 Let l = 968 - 485. Let k = l + -283. Round k to the nearest one thousand. 0 Let t = -9058487.2247 - -9058098. Let a = t + -0.0753. Round a to the nearest ten. -390 Let m = 58 + -57.997. What is m rounded to 1 dp? 0 Let n(y) = -y*3 + 26y*2 - 27y + 15. Let d be n(20). Let l be 256d170/3. Round l to the nearest 1000000. 27000000 Let g = 54 - -194. Let m = 248.000442 - g. What is m rounded to five dps? 0.00044 Let h = 0.0802 + -392.0802. Let g = h + 348.7. Round g to 0 dps. -43 Let q(o) = -1426o3 + 88o*2 - 1089o + 52. Let m be q(28). What is m rounded to the nearest 1000000? -31000000 Let v = -3922 + 3922.00004119. Round v to 6 decimal places. 0.000041 Let d = -3266591 - -3266742.9777. Let o = d + -152. Round o to three decimal places. -0.022 Let x = -1.95068 - -1.8237. Round x to two dps. -0.13 Let n = 334139 + -160863. Let s = -67724 - n. Round s to the nearest ten thousand. -240000 Let k = -10473.6812 + 10470. Round k to the nearest integer. -4 Let m = 219.0509892311 - 219.051. Round m to 6 dps. -0.000011 Let j be (-63)/(-13) - (-72)/468. Suppose 3g - 5b - 7511103 = -23231083, 0 = 2g - jb + 10479980. What is g rounded to the nearest 100000? -5200000 Let f = 42394 + -42286.204. Let h = -0.204 - f. Let b = h + 98.5. What is b rounded to the nearest 10? -10 Let v(u) be the second derivative of -13u4/12 - u3/3 - 2u*2 - 3u + 12. Let q be v(4). What is q rounded to the nearest 100? -200 Let j = 5493.400037459 + -5493.4. What is j rounded to 6 decimal places? 0.000037 Suppose 87w - 349941 = 84w + 3l, 4w = -l + 466553. What is w rounded to the nearest ten thousand? 120000 Let o be 130/455 + 10455957/21 + -3. What is o rounded to the nearest 10000? 500000 Let d = 3.820048 - 3.892. Round d to three dps. -0.072 Let k = 4.4218 - -0.357. Round k to the nearest integer. 5 Let u(g) = 190003g + 3. Let p be (-4 + 1 + 3)/1. Let b be (1 + p)(-5 - -3)/2. Let i be u(b). What is i rounded to the nearest one hundred thousand? -200000 Let z = -0.41 + 0.59. Let s = z + -0.1799366. What is s rounded to six dps? 0.000063 Let r(m) = 864306m - 18. Let p be r(3). What is p rounded to the nearest one hundred thousand? 2600000 Suppose 2o + 3a = -12, 4o - 12 = 3o + 3a. Suppose 7h - 54224 - 295496 = o. Suppose h = -3y + 142060. What is y rounded to the nearest one thousand? 31000 Let x = -5.4240918158 - -5.4241. What is x rounded to 6 decimal places? 0.000008 Let d = 233.4137 + 1.1163. Let b = -226 + d. Round b to the nearest integer. 9 Let j be (-1340164)/(-35) - -9(-2)/45. Round j to the nearest one thousand. 38000 Let o = 3762.0433 - 3762. Round o to one decimal place. 0 Let m = -29 + 61. Suppose m = b + 7b. Suppose bc = 17371493 + 5428507. What is c rounded to the nearest 1000000? 6000000 Let q(w) be the first derivative of 63w4 + w3/3 - 5w2/2 - 8w - 58. Let f be q(-4). What is f rounded to the nearest 1000? -16000 Let r = -1 - -1.03. Let m = 2258 + -2257.9784. Let s = m - r. Round s to 3 decimal places. -0.008 Let g = 0.691 + -0.30892. What is g rounded to 3 dps? 0.382 Let c = 3.4 - -0.6. Let g = -3.999951 + c. Round g to five dps. 0.00005 Let z = 4 - -601. Let p = 605.0000485 - z. What is p rounded to 5 dps? 0.00005 Let x = -6406.999997003 + 6407. Round x to six decimal places. 0.000003 Suppose 0 = p - 4p - 3d + 27, -32 = -4p - 3d. Suppose pa - 20 = -0. Suppose 3t + 442 = -t + 2j, at + 437 = -3j. What is t rounded to the nearest 10? -110 Let i = 346 - -1233. Let b = -1579.0000967 + i. What is b rounded to five dps? -0.0001 Let t = -5485 + 5485.00005657. What is t rounded to 6 decimal places? 0.000057 Let z = -28 + 98. Let m = -0.04554 - -70.08954. Let h = z - m. What is h rounded to two decimal places? -0.04 Let i = 756.9028 + 0.0972. Let d = -142522 - -141760.27. Let a = d + i. Round a to 1 dp. -4.7 Suppose -v - 5 = -2. Let j(z) = 2737z + 21. Let n be j(v). What is n rounded to the nearest 1000? -8000 Let g = 963 - 2687. Let z = g - -1724.00799. Round z to 3 dps. 0.008 Let j = -0.12667868 + 0.12646. Round j to six dps. -0.000219 Let b = -0.69 - -1.27. Let d = 0.627 - b. Let c = d + -0.03. What is c rounded to two dps? 0.02 Let d(f) = f*3 - 5f*2 - 2f + 4. Let x be d(5). Let b(a) be the second derivative of 95a3/2 + 96a. Let w be b(x). What is w rounded to the nearest 100? -1700 Let a = -0.437 + 0.602. Let w = a - 0.19076. What is w rounded to three decimal places? -0.026 Let s = 660 + -1148. Let p = s - -487.999739. What is p rounded to 5 dps? -0.00026 Let x be 28/(-16)*16528/4. Let w = -6010 + x. Let v = 53241 +	{ "pile_set_name": "DM Mathematics" }
64 - 84471036 = 0 for v. 52 Solve -313 = 136m - 17 + 642 + 422 for m. -10 Solve 128g - 464g + 1846 = -113g - 81g for g. 13 Solve 63085f + 3333 = 62984f for f. -33 Solve -7760s - 7757s = 2655s - 199892 for s. 11 Solve -147c = 1082c - 6145 for c. 5 Solve 0 = 7593r - 5769r - 36480 for r. 20 Solve 7296v + 60958 = -99554 for v. -22 Solve -64112 - 126793 = -2145k for k. 89 Solve 5548 = -48p + 5788 for p. 5 Solve -5060 = 250w - 30w for w. -23 Solve 2098104 - 2096090 = -53f for f. -38 Solve -838u + 266u - 6846 = -1126 for u. -10 Solve -480a - 41370 = 666a + 1612a for a. -15 Solve -656d - 648d - 30412 = 9710 + 18558 for d. -45 Solve -36p = 48p + 55p - 78p - 1037 for p. 17 Solve 86d - 103 - 92 = 63 for d. 3 Solve -970 - 3634 - 27 = -331s + 1989 for s. 20 Solve 350l + 58115 + 7489 = -1141l for l. -44 Solve -667d + 4428 = -831d for d. -27 Solve -706y - 9004 + 4583 - 9699 = 0 for y. -20 Solve 0 = -241k - 11 + 1457 for k. 6 Solve 0 = -712m - 29986 - 8462 for m. -54 Solve 804k - 87k + 1981k + 45788 = -21662 for k. -25 Solve 0 = -403z + 800z - 441z - 2024 for z. -46 Solve -1489p + 8379 = -652p - 704p for p. 63 Solve -13d + 811d - 3468 - 1411 - 1505 = 0 for d. 8 Solve 170x + 4023 + 2287 = 250 - 2780 for x. -52 Solve -2401 = 86l + 8l + 1021l + 944 for l. -3 Solve 8925v - 2989v - 2547v - 15750 = 2514v for v. 18 Solve -1061m - 352m = 215m - 136640 + 38960 for m. 60 Solve 0 = 72a - 756 + 313 - 1213 for a. 23 Solve 23715 = 577r + 188r for r. 31 Solve 2y - 40 = 12 - 26 for y. 13 Solve -496742 = -263c - 499372 for c. -10 Solve -13226 + 1767 = 1637f for f. -7 Solve -150m + 1897 = -561m - 1921 - 292 for m. -10 Solve -1667d = 14778 + 225 for d. -9 Solve 0 = -938t - 929t + 1738t - 1161 for t. -9 Solve 489o + 1922 - 1922 = 0 for o. 0 Solve -110y + 49y - 62 = -40 + 39 for y. -1 Solve -2b - 53b + 1114 - 2269 = 0 for b. -21 Solve -70f - 24136 + 15596 = 0 for f. -122 Solve 407g = -8311 - 1864 for g. -25 Solve -770o + 253o - 4661 = -235o - 223o for o. -79 Solve -1263o - 48447 = 2176 - 103 for o. -40 Solve -80w - 18w = -206w - 324w + 10800 for w. 25 Solve 636l + 12288 = 892l for l. 48 Solve -21320 = 5579p - 5046p for p. -40 Solve -68r = 83r - 37r - 6r + 2700 for r. -25 Solve 493x - 891x - 25472 = 0 for x. -64 Solve -2228z + 6105 - 52893 = 0 for z. -21 Solve 169359 + 17699 = -1032o + 4478o - 5918 for o. 56 Solve 421g - 32775 = -1764g for g. 15 Solve 58i - 72662 = -328i - 1160i for i. 47 Solve -293 - 38 = -349f - 216f + 234 for f. 1 Solve 75569 = -72m + 67145 for m. -117 Solve 7690 + 13360 + 1102 = -997x - 29692 for x. -52 Solve -14524 = -1209u - 82425 - 8266 for u. -63 Solve 4621860 = -73o + 4618429 for o. -47 Solve -2012k - 7980 = -2278k for k. 30 Solve -1808f = 3312f + 117760 for f. -23 Solve 0 = -164f + 2322 + 2926 for f. 32 Solve 8018 = 609i - 5218 - 6583 - 13676 for i. 55 Solve 0 = 617s + 1508s - 278375 for s. 131 Solve 75u + 1265 - 2840 = 0 for u. 21 Solve -1209r - 195r = 78624 for r. -56 Solve 295f - 35889 = -227f - 1187f for f. 21 Solve 353y - 974y = -12420 for y. 20 Solve 1987723 = 145f + 1995118 for f. -51 Solve 396h + 4117 = 224h - 11191 for h. -89 Solve -1620 = -9228k + 9243k for k. -108 Solve -12o + 526 = -33o - 595 - 748 for o. -89 Solve -2108486c + 2108390c = -650 - 7990 for c. 90 Solve -496l + 968l + 564l + 10154 + 2278 = 0 for l. -12 Solve 1881n + 110478 + 140299 = 38224 for n. -113 Solve -17675r - 330424 + 496477 + 999089 + 125133 = 0 for r. 73 Solve 479c + 599c = -53121 + 38029 for c. -14 Solve -50r + 9360 = 190r for r. 39 Solve 6274 - 16147 = 994o + 19947 for o. -30 Solve -1360a - 1281a = 26410 for a. -10 Solve -2769y - 70526 + 41349 - 142501 = 0 for y. -62 Solve 4003j + 802j = -43245 for j. -9 Solve -3562c - 333904 = 510c for c. -82 Solve 725w + 226w - 125w = -142w + 36784 for w. 38 Solve -2743d = 4253d - 426756 for d. 61 Solve 3239 = -733y - 21y - 23151 for y. -35 Solve 67427 = 902s + 8797 for s. 65 Solve -238080 = -8826n + 11386n for n. -93 Solve 618l - 9522 = 211l + 147l + 122l for l. 69 Solve 18h + 60h - 1112 - 448 = 18h for h. 26 Solve -415f + 56892 = 651f + 1520f for f. 22 Solve 90o + 2324o - 27579 - 112433 = 0 for o. 58 Solve -62g - 5g - 9493 = 135g + 1213 for g. -53 Solve 57l = 6711593 - 6710282 for l. 23 Solve 8188 - 2707 = 99b + 104b for b. 27 Solve -220y - 9807 = -15y + 1744 + 11614 for y. -113 Solve -8396n = 2372n + 444n - 543n + 309401 for n. -29 Solve 947m = 511m + 485m for m. 0 Solve -305y + 111y + 48y - 403y + 34587 = 0 for y. 63 Solve -12a - 51742 = -27a - 50842 for a. 60 Solve -1401a + 1093a - 538 = -7930 for a. 24 Solve 0 = -168h + 137h - 249h - 5880 for h. -21 Solve 5434 = -502h + 8h for h. -11 Solve -314b - 1784b + 1369b - 936912 = 6423b for b. -131 Solve -370 - 261 - 5 = 25q + 389 for q. -41 Solve -228y = -16748 - 2404 for y. 84 Solve 734a + 228 = -253a - 111 - 1635 for a. -2 Solve -197h - 3409 + 2471 = 2693 + 7598 for h. -57 Solve 4359p - 2566p - 4601 + 113974 = 0 for p. -61 Solve 319w = 430w - 3552 for w. 32 Solve -3679 - 700 = 107i - 958 + 1180 for i. -43 Solve -10899 - 2992 = -742q + 13563 for q. 37 Solve 1811n - 360n + 1437n = 712n + 10880 for n. 5 Solve 24t - 3983 = -34t - 53t + 4231 for t. 74 Solve -2798l - 2190l = -316l + 1067l + 797721 for l. -139 Solve -15127 = -16118r + 794269 - 133550 + 291234 for r. 60 Solve 10530l + 68104 - 34788 = -345764 for l. -36 Solve 1490c - 15886 = 44390 + 10136 + 30908 for c. 68 Solve -92k + 340k + 6062 = -567k - 51k for k. -7 Solve 0 = -296l - 68 + 19 + 49 for l. 0 Solve 985j + 3804j - 2759j + 1016736 = -9394j for j. -89 Solve -35132 = -1236g + 15544 for g. 41 Solve -55821406c = -55821244c + 10368 for c. -64 Solve -12r - 520 = -2r - 378 - 482 for r. 34 Solve -203s = -1744459 + 1752579 for s. -40 Solve -503i + 649i + 943i + 80586 = 0 for i. -74 Solve 356509a - 356564a = -2310 for a. 42 Solve -1144a + 4536 = -853a - 9141 for a. 47 Solve 150n + 139128 = -1019n - 195n for n. -102 Solve 865t + 20613 = 218t - 19926 + 425 for t. -62 Solve 20p - 150p = 139p - 47p + 21312 for p. -96 Solve 11830r + 46789 - 92249 - 214800 = 0 for r. 22 Solve -7o - 17o - 34o + 11o = -235 for o. 5 Solve -10n + 3 - 111 = -38 for n. -7 Solve 526g - 488g + 690 + 754 = 0 for g. -38 Solve 222a - 8a - 842 = -505a - 123 for a. 1 Solve 566m + 22288 = 309m - 539m for m. -28 Solve 844u - 13305 - 17486 = 2125 for u. 39 Solve 68 = 2n - 90n + 540 + 56 for n. 6 Solve 71t + 22750 = -66t + 33436 for t. 78 Solve 346j + 13826 = -10740 for j. -71 Solve -160080 = -1007l - 23329 + 13292 for l. 149 Solve -35p - 34p + 427 = -8p for p. 7 Solve 99460165p = 99460223p + 3654 for p. -63 Solve 531 = -b + 281 + 281 for b. 31 Solve -9416 = -497u + 35u - 638 for u. 19 Solve 767068v = 767472v + 13736 for v. -34 Solve 4555x - 692149 = -99999 for x. 130 Solve -2988 = -25075p + 24992p for p. 36 Solve 47850 = 264n + 74250 for n. -100 Solve 1126o - 10774 - 626 = -1266 for o. 9 Solve 3825i + 16714i - 1185i + 974682 = -438160 for i. -73 Solve 75001n = 74647n - 8850 for n. -25 Solve -1408n + 4172 = -1557n for n. -28 Solve 0 = -301n - 602n - 206n + 31052 for n. 28 Solve -490v + 4050 = 92v + 29076 for v. -43 Solve 0 = -58v + 1539v - 24791 - 41854 for v. 45 Solve 1011 = -117q + 65q + 526 - 2479 for q. -57 Solve -2087h - 46789 - 51559 = 51h for h. -46 Solve -37407 - 61111 + 19282 = -3442b + 51560 for b. 38 Solve 214k + 25776 = 31768 for k. 28 Solve 4598744q - 4598915q = -1539 for q. 9 Solve 6904 = -678z - 23315 + 3099 for z. -40 Solve 739g + 707g - 82856 + 12829 = 3719 for g. 51 Solve 1361z + 3568z - 216876 = 0 for z. 44 Solve -3949 = -105r + 3842 + 2499 for r. 98 Solve 80p + 1205 + 47 - 172 = -1240 for p. -29 Solve -1429q - 1430q = -2830q - 580 for q. 20 Solve 513z - 508z = -711z + 7160 for z. 10 Solve -2041h = -1521h + 12043h + 847722 + 810594 for h. -132 Solve 2912 = 50z - 83z - 128z - 6426 for z. -58 Solve -391951 = -17401w + 478099 for w. 50 Solve 3489 = -579v + 1558 - 7912 for v. -17 Solve -3837i - 5330*i = 550020 for i.	{ "pile_set_name": "DM Mathematics" }
ctors of 1355406? 2, 3, 13, 17377 List the prime factors of 397059. 3, 13, 10181 List the prime factors of 282078. 2, 3, 15671 What are the prime factors of 3631681? 31, 193, 607 List the prime factors of 1092729. 3, 11, 33113 List the prime factors of 3564817. 3564817 What are the prime factors of 143565? 3, 5, 17, 563 What are the prime factors of 4385413? 227, 19319 List the prime factors of 1563135. 3, 5, 7, 14887 List the prime factors of 96496. 2, 37, 163 List the prime factors of 839872. 2, 11, 1193 What are the prime factors of 681989? 7, 11, 17, 521 List the prime factors of 14295044. 2, 3573761 What are the prime factors of 16035774? 2, 3, 2672629 What are the prime factors of 357833? 7, 17, 31, 97 List the prime factors of 1651034. 2, 7, 11, 71, 151 What are the prime factors of 19705549? 23, 47, 18229 List the prime factors of 908944. 2, 56809 List the prime factors of 786232. 2, 23, 4273 List the prime factors of 8751573. 3, 37, 41, 641 List the prime factors of 48877. 37, 1321 What are the prime factors of 347129? 347129 What are the prime factors of 1972486? 2, 541, 1823 List the prime factors of 11363586. 2, 3, 13, 145687 What are the prime factors of 32605363? 7, 4657909 List the prime factors of 333007. 29, 11483 What are the prime factors of 1861681? 613, 3037 List the prime factors of 2663718. 2, 3, 443953 List the prime factors of 866571. 3, 19, 23, 661 What are the prime factors of 6878734? 2, 41, 149, 563 What are the prime factors of 16530054? 2, 3, 23, 119783 List the prime factors of 278993. 11, 13, 1951 What are the prime factors of 71474? 2, 13, 2749 What are the prime factors of 1829504? 2, 14293 What are the prime factors of 25566510? 2, 3, 5, 43, 19819 List the prime factors of 672608. 2, 21019 What are the prime factors of 15046109? 13, 1157393 List the prime factors of 1828089. 3, 7523 What are the prime factors of 1427689? 1049, 1361 List the prime factors of 164863. 19, 8677 What are the prime factors of 16351835? 5, 1283, 2549 List the prime factors of 394055. 5, 53, 1487 What are the prime factors of 1832487? 3, 610829 What are the prime factors of 3386424? 2, 3, 141101 What are the prime factors of 178675? 5, 7, 1021 What are the prime factors of 15765? 3, 5, 1051 What are the prime factors of 3929147? 107, 36721 List the prime factors of 2076962. 2, 233, 4457 List the prime factors of 2444594. 2, 97, 12601 What are the prime factors of 4476704? 2, 19, 37, 199 What are the prime factors of 12827316? 2, 3, 17, 227, 277 List the prime factors of 3063275. 5, 19, 6449 What are the prime factors of 8551339? 991, 8629 What are the prime factors of 555799? 31, 17929 What are the prime factors of 1194249? 3, 7, 29, 37, 53 What are the prime factors of 2979709? 17, 175277 What are the prime factors of 6172870? 2, 5, 11, 17, 3301 What are the prime factors of 80734? 2, 37, 1091 What are the prime factors of 179463? 3, 163, 367 What are the prime factors of 174250? 2, 5, 17, 41 List the prime factors of 9195998. 2, 7, 23, 28559 List the prime factors of 2813375. 5, 71, 317 What are the prime factors of 3385471? 89, 38039 What are the prime factors of 21942655? 5, 7, 47, 13339 What are the prime factors of 350626? 2, 19, 9227 List the prime factors of 796955. 5, 19, 8389 List the prime factors of 41171251. 11, 3742841 What are the prime factors of 252518? 2, 7, 17, 1061 List the prime factors of 12087433. 12087433 What are the prime factors of 1293059? 113, 11443 What are the prime factors of 64904? 2, 7, 19, 61 What are the prime factors of 461922? 2, 3, 167, 461 What are the prime factors of 443736? 2, 3, 6163 What are the prime factors of 31122337? 31122337 List the prime factors of 29461. 17, 1733 List the prime factors of 5704975. 5, 228199 List the prime factors of 707555. 5, 141511 List the prime factors of 9931483. 1523, 6521 List the prime factors of 269954. 2, 43, 73 List the prime factors of 1616037. 3, 17, 31687 What are the prime factors of 8197204? 2, 2049301 What are the prime factors of 276031? 7, 47, 839 What are the prime factors of 34151816? 2, 19, 224683 What are the prime factors of 3079707? 3, 61, 16829 What are the prime factors of 12735681? 3, 7, 19, 59, 541 List the prime factors of 1125799. 37, 30427 What are the prime factors of 133117? 133117 What are the prime factors of 3814951? 7, 659, 827 List the prime factors of 2076373. 13, 159721 List the prime factors of 182427. 3, 7, 17, 73 What are the prime factors of 6110501? 6110501 What are the prime factors of 15052583? 7, 13, 53, 3121 List the prime factors of 24201716. 2, 7, 11, 78577 List the prime factors of 2768920. 2, 5, 7, 11, 29, 31 What are the prime factors of 6721147? 6721147 List the prime factors of 654131. 31, 21101 What are the prime factors of 1549639? 7, 13, 17029 What are the prime factors of 1699012? 2, 7, 60679 List the prime factors of 5701168. 2, 11, 29, 1117 List the prime factors of 258647. 19, 13613 List the prime factors of 817643. 89, 9187 List the prime factors of 2155551. 3, 281, 2557 What are the prime factors of 397532? 2, 23, 29, 149 What are the prime factors of 247698? 2, 3, 11, 139 What are the prime factors of 882190? 2, 5, 47, 1877 List the prime factors of 1217628. 2, 3, 149, 227 What are the prime factors of 2515616? 2, 127, 619 What are the prime factors of 6960813? 3, 811, 2861 List the prime factors of 1072875. 3, 5, 2861 What are the prime factors of 4521958? 2, 7, 322997 What are the prime factors of 6882254? 2, 103, 33409 What are the prime factors of 5301702? 2, 3, 7, 6011 List the prime factors of 6013125. 3, 5, 1069 List the prime factors of 11846632. 2, 7, 47, 643 What are the prime factors of 162697? 19, 8563 List the prime factors of 322957. 41, 7877 List the prime factors of 2116400. 2, 5, 11, 13, 37 What are the prime factors of 985263? 3, 328421 What are the prime factors of 7428773? 11, 47, 14369 What are the prime factors of 1787725? 5, 43, 1663 List the prime factors of 128947. 7, 13, 109 What are the prime factors of 1015595? 5, 7, 29017 What are the prime factors of 305031? 3, 17, 5981 List the prime factors of 128449. 128449 What are the prime factors of 134877? 3, 44959 What are the prime factors of 10376395? 5, 2075279 What are the prime factors of 1558793? 43, 36251 List the prime factors of 1105987. 31, 35677 What are the prime factors of 127392? 2, 3, 1327 List the prime factors of 187129. 187129 What are the prime factors of 562896? 2, 3, 1303 List the prime factors of 847083. 3, 373, 757 List the prime factors of 158817. 3, 167, 317 List the prime factors of 4734168. 2, 3, 197257 List the prime factors of 1132206. 2, 3, 188701 What are the prime factors of 1916234? 2, 31, 997 What are the prime factors of 27704420? 2, 5, 23, 229, 263 List the prime factors of 15250. 2, 5, 61 List the prime factors of 3951105. 3, 5, 29, 31, 293 What are the prime factors of 702176? 2, 21943 What are the prime factors of 650844? 2, 3, 101, 179 List the prime factors of 334862. 2, 11, 31, 491 What are the prime factors of 248333? 103, 2411 List the prime factors of 1236316. 2, 309079 What are the prime factors of 1697932? 2, 31, 13693 List the prime factors of 35610076. 2, 1783, 4993 What are the prime factors of 3540989? 61, 58049 What are the prime factors of 5515092? 2, 3, 11, 19, 733 List the prime factors of 474114. 2, 3, 31, 2549 What are the prime factors of 374703? 3, 7, 2549 List the prime factors of 572185. 5, 19, 317 What are the prime factors of 454729? 11, 67, 617 List the prime factors of 3817303. 7, 545329 What are the prime factors of 7346548? 2, 11, 166967 List the prime factors of 33747. 3, 7, 1607 List the prime factors of 276818. 2, 61, 2269 What are the prime factors of 245802? 2, 3, 71, 577 What are the prime factors of 2895120? 2, 3, 5, 4021 What are the prime factors of 938361? 3, 479, 653 What are the prime factors of 244498? 2, 43, 2843 What are the prime factors of 12907207? 191, 67577 What are the prime factors of 147375? 3, 5, 131 List the prime factors of 549223. 307, 1789 List the prime factors of 926376. 2, 3, 11, 29 What are the prime factors of 3433980? 2, 3, 5, 11, 43 What are the prime factors of 502818? 2, 3, 181, 463 List the prime factors of 13722604.	{ "pile_set_name": "DM Mathematics" }
= 0. -6, 1 Factor -f*2 + 317f - 630. -(f - 315)(f - 2) Find f, given that -2f*2/3 + 152f - 8664 = 0. 114 Determine k, given that 4k3 + 8k2 = 0. -2, 0 Factor -z4/9 - 2z3 - 12z*2 - 30z - 27. -(z + 3)*3(z + 9)/9 Suppose -2w2/19 + 29312w/19 - 107399168/19 = 0. Calculate w. 7328 Factor -16k2/7 - 52k + 92/7. -4(k + 23)(4k - 1)/7 Determine w so that 4w*5 - 48w*4 + 192w*3 - 248w*2 - 132w + 360 = 0. -1, 2, 3, 5 Determine a, given that -a*5 - 15a*4/2 - 9a*3/2 + 53a*2/2 - 9a/2 - 9 = 0. -6, -3, -1/2, 1 Suppose -4j2 + 13336j - 11115556 = 0. What is j? 1667 Let -8q3/15 - 326q*2/15 - 238q/15 + 16/3 = 0. Calculate q. -40, -1, 1/4 Find g, given that -2g4 + 4g*3 + 14g*2 + 8g = 0. -1, 0, 4 Factor -2i2 - 2276i + 2278. -2(i - 1)(i + 1139) Find n such that n*4 - 8n*3 - 31n*2 - 22n = 0. -2, -1, 0, 11 What is r in -4r2 + 676r = 0? 0, 169 Determine j, given that -21j5/4 + 113j*4/4 - 115j*3/12 - 9j*2/4 + 5j/6 = 0. -2/7, 0, 1/3, 5 Factor -y*3/6 - 4y*2/3 + 11y/6 + 3. -(y - 2)(y + 1)(y + 9)/6 Solve -2r5/15 - 2r*4/15 + 2r*3/5 + 2r*2/15 - 4r/15 = 0. -2, -1, 0, 1 Solve -5r4 + 540r*3 - 9620r*2 - 267840r - 1230080 = 0 for r. -8, 62 What is d in -2d4/3 + 295d*3/6 - 3571d*2/3 + 28138d/3 + 2420 = 0? -1/4, 22, 30 Suppose 3y5 - 273y*4 + 5778y*3 + 20154y*2 - 5781y - 19881 = 0. Calculate y. -3, -1, 1, 47 Factor 4z2 - 128z + 1024. 4(z - 16)2 Determine u so that -3u*3/4 + 567u*2/4 - 6768u + 6627 = 0. 1, 94 Factor -i*3 + 2622i*2 - 1718721i. -i(i - 1311)2 Find o, given that 5o*3 + 240o*2 + 1300o + 1680 = 0. -42, -4, -2 Find c, given that c*2/5 + 26c/5 + 88/5 = 0. -22, -4 Find g such that -3g5 + 3930g*4 - 2059320g*3 + 539541840g*2 - 70679981040g + 3703631006496 = 0. 262 Suppose k*4 + 274k*3 + 272k*2 - 274k - 273 = 0. What is k? -273, -1, 1 Suppose -3f2/4 + 51f/4 - 45/2 = 0. Calculate f. 2, 15 Factor 4r4 + 816r*3 - 4148r*2 + 6672r - 3344. 4(r - 2)2(r - 1)(r + 209) Factor 45t*2 - 2240t - 500. 5(t - 50)(9t + 2) Find z, given that z4 - 2z*3/3 - 4z*2 + 8z/3 = 0. -2, 0, 2/3, 2 Factor 2o2/3 - 8o/3. 2o(o - 4)/3 Let 4r3/7 - 416r*2/7 + 11220r/7 - 20808/7 = 0. What is r? 2, 51 Suppose s*4/2 + 77s*3 + 2964s*2 - 77s - 5929/2 = 0. What is s? -77, -1, 1 Factor 10i3 + 185i*2 - 100i - 95. 5(i - 1)(i + 19)(2i + 1) Let -2f5/19 + 36f*4/19 - 96f*3/19 + 92f*2/19 - 30f/19 = 0. What is f? 0, 1, 15 Factor -2p2 + 334p + 676. -2(p - 169)(p + 2) Suppose -2s2 - 196s = 0. What is s? -98, 0 Determine p so that 2p2 = 0. 0 Determine t so that 6t*4 - 27t*3 + 12t*2 + 63t - 54 = 0. -3/2, 1, 2, 3 Factor -2n3/13 - 46n*2/13 - 84n/13. -2n(n + 2)(n + 21)/13 Suppose v4/6 + 15v*3/2 + 189v*2/2 + 441v/2 = 0. What is v? -21, -3, 0 Suppose -3r5 - 21r*4 - 27r*3 + 21r*2 + 30r = 0. What is r? -5, -2, -1, 0, 1 Factor -4c3 + 56c*2 + 59c + 15. -(c - 15)(2c + 1)*2 Factor -3h*3/2 + 21h/2 + 9. -3(h - 3)(h + 1)(h + 2)/2 Solve 44c*4 + 184c*3 - 452c*2 + 176c + 48 = 0. -6, -2/11, 1 Factor -4x5 - 112x*4 + 236x*3 - 120x*2. -4x*2(x - 1)*2(x + 30) Factor -2q5 + 4q*4 + 16q*3 + 4q*2 - 14q - 8. -2(q - 4)(q - 1)(q + 1)3 Determine t, given that -5t*2 + 1945t + 3910 = 0. -2, 391 Solve 2t2/9 - 160t/9 + 142 = 0 for t. 9, 71 Factor -3n3 + 60n*2 - 51n - 114. -3(n - 19)(n - 2)(n + 1) Factor 2l*3/13 - 12756l*2/13 + 27119256l/13 - 19218512752/13. 2(l - 2126)3/13 Factor 2k*4/15 + 74k*3/15 - 166k*2/5 + 258k/5. 2k(k - 3)*2(k + 43)/15 Find n such that 2n2/7 - 26n/7 + 72/7 = 0. 4, 9 Find i such that 2i5/9 + 4i*4/3 - 22i*3/9 - 40i*2/3 + 200i/9 = 0. -5, 0, 2 Factor -4s3/5 - 9084s*2/5 - 1032396s - 1030580. -4(s + 1)(s + 1135)*2/5 Factor -4k*5 + 40k*4 - 280k*2 - 380k - 144. -4(k - 9)(k - 4)(k + 1)3 Factor -4q*3 - 64q*2 - 192q. -4q(q + 4)(q + 12) Determine m so that 5m*3 + 120m*2 + 900m + 2000 = 0. -10, -4 Factor q*3 + 140q*2 + 4900q. q(q + 70)2 Factor -2g*3 + 176g*2 - 970g - 1148. -2(g - 82)(g - 7)(g + 1) Solve 3z*2/8 - 969z/2 + 312987/2 = 0 for z. 646 Suppose 2r3 + 28r*2 - 62r + 32 = 0. What is r? -16, 1 Factor -n*4/5 + 4n3/5 + n2/5 - 4n/5. -n(n - 4)(n - 1)(n + 1)/5 Find c, given that 31c4 - 170c*3/3 - 37c*2/3 + 10c/3 = 0. -1/3, 0, 5/31, 2 Factor -9i4 + 384i*3 + 129i*2. -3i*2(i - 43)(3i + 1) Factor -j*3 + 27j*2 - 96j + 92. -(j - 23)(j - 2)2 Factor s5/2 + 5s*4/2 - 11s*3 + 8s2. s2(s - 2)(s - 1)(s + 8)/2 Factor -2z*3 + 296z*2 - 290z - 588. -2(z - 147)(z - 2)(z + 1) Suppose 8m*4/13 + 4792m*3/13 - 9606m*2/13 + 6008m/13 - 1202/13 = 0. Calculate m. -601, 1/2, 1 Suppose 3p3/4 + 663p*2/2 + 1323p/4 = 0. Calculate p. -441, -1, 0 Factor -3t4 - 102t*3 - 447t*2 - 348t. -3t(t + 1)(t + 4)(t + 29) Let 9i2 - 43i - 10 = 0. What is i? -2/9, 5 Factor o*5 - 5o*4 - 3o*3 + 17o*2 - 10o. o(o - 5)(o - 1)*2(o + 2) Factor -p*2 + 4p + 117. -(p - 13)(p + 9) Factor 80j*4 + 600j*3 + 765j*2 + 270j. 5j(j + 6)(4j + 3)*2 Factor -5y*3 - 135y*2 + 4280y - 4140. -5(y - 18)(y - 1)(y + 46) Solve -5a*4/4 + 5a*3 - 15a*2/2 + 5a - 5/4 = 0 for a. 1 Factor r*3/3 + 509r*2/3 + 508r/3. r(r + 1)(r + 508)/3 Determine p so that -p*2/5 + 22p/5 - 57/5 = 0. 3, 19 Find s, given that 4s2/5 + 656s/5 = 0. -164, 0 Find a, given that -52a2/9 + 380a/9 - 200/3 = 0. 30/13, 5 Factor -2z4 + 770z*3 - 99072z*2 + 4292608z - 4194304. -2(z - 128)3(z - 1) Factor -5l2 - 110l - 105. -5(l + 1)(l + 21) Factor -p*2/9 + 388p/9 + 391/3. -(p - 391)(p + 3)/9 Solve -3h*5/4 + 12h*4 + 36h*3 - 345h*2/2 + 771h/4 - 135/2 = 0 for h. -5, 1, 18 Solve k*3/3 - 65k*2 - 131k - 197/3 = 0 for k. -1, 197 Determine j so that 2j2 + 34j - 868 = 0. -31, 14 Solve 5z4 + 280z*3 + 4995z*2 + 26180z - 31460 = 0. -22, -13, 1 Find v, given that 3v2 - 78v - 1521 = 0. -13, 39 Solve 8h5/5 + 51h*4/5 + 58h*3/5 - 81h*2/5 - 36h/5 = 0. -4, -3, -3/8, 0, 1 Factor n*2/2 - 7n/2 - 4. (n - 8)(n + 1)/2 Factor -v4 + 24v*3 - 178v*2 + 336v + 539. -(v - 11)(v - 7)2(v + 1) Solve -2l3/11 - 4l*2 + 146l/11 - 100/11 = 0 for l. -25, 1, 2 Factor 3y2/5 + 9y/5 - 6. 3(y - 2)(y + 5)/5 Factor 4k5 - 552k*4 + 27608k*3 - 585152k*2 + 4417668k - 3859576. 4(k - 41)3(k - 14)(k - 1) Suppose 3i*4/2 + 63i*3/2 + 405i*2/2 + 1053i/2 + 486 = 0. Calculate i. -12, -3 Find x such that 2x5/3 + 22x*4/3 + 30x*3 + 54x*2 + 36x = 0. -3, -2, 0 Suppose 34x2/13 + 28x/13 = 0. Calculate x. -14/17, 0 Factor -h*3/2 - 63h*2/2 - 120h - 118. -(h + 2)*2(h + 59)/2 Let -2n5 + 6n*4 + 26n*3 - 30n*2 = 0. Calculate n. -3, 0, 1, 5 Solve 5q*2 + 13q + 6 = 0 for q. -2, -3/5 Let 3k2 - 2157k = 0. Calculate k. 0, 719 Let 5z2 + 300z + 295 = 0. Calculate z. -59, -1 Factor -3z4 - 6z*3 + 57z*2 + 60z. -3z(z - 4)(z + 1)(z + 5) Factor 2f4 + 6f*3 - 8f*2 - 24f. 2f(f - 2)(f + 2)(f + 3) Determine j, given that -3j4 - 81j*3 - 342j*2 - 264j = 0. -22, -4, -1, 0 Factor -d*3/4 - 57d*2/4 - 14d. -d(d + 1)(d + 56)/4 Factor 2x4/15 + 5792x*3/5 + 18870336x*2/5 + 27324246528x/5 + 14837065864704/5. 2(x + 2172)4/15 Factor 3x*4 - 78x*3 - 864x*2 + 38400x - 270336. 3(x - 16)3(x + 22) Let -2g2 - 156g + 656 = 0. Calculate g. -82, 4 Let 2h4 - 30h*3 - 32h*2 + 480h = 0. What is h? -4, 0, 4, 15 Factor -3a2 + 516a - 22188. -3(a - 86)2 Factor 25x*4 - 885x*3 + 351x*2 - 35x. x(x - 35)(5x - 1)2 Find q, given that -13q*2 + 31q + 24 = 0. -8/13, 3 Factor -3h5 - 468h*4 - 19602h*3 - 105300h*2 - 151875h. -3h(h + 3)*2(h + 75)2 Factor -t2/7 + 4239t/7 - 4238/7. -(t - 4238)(t - 1)/7 Solve 2h3/15 - 8h*2/5 + 2h/3 + 44/5 = 0 for h. -2, 3, 11 Factor -q*5 + 4q*4 + 10q*3 - 28q*2 + 15q. -q(q - 5)(q - 1)*2(q + 3) Factor 2w4/5 + 8w*3/5 + 2w*2 + 4w/5. 2w(w + 1)*2(w + 2)/5 Factor 2x2/11 - 412x/11 + 816/11. 2(x - 204)(x - 2)/11 Factor	{ "pile_set_name": "DM Mathematics" }
at u + 2/7 - 1/7u5 - 2/7u*4 + au*3 + 8/7u*2 = 0. -1, 2 Let v(f) be the second derivative of 0f*2 - 8/3f3 + 0 - f4 + 2/5f6 + 14f + f*5 - 2/21f*7. Find y such that v(y) = 0. -1, 0, 1, 4 Let h = 1345 - 1341. Let p(m) be the first derivative of -8m - m*4 - 4/5m*5 + hm*3 - 14 + 2m*2. Factor p(o). -4(o - 1)*2(o + 1)(o + 2) Let c = 16 - 8. Suppose 0 = -3q + 5q - c. Suppose -g2 + 2 + 5g*2 - q - 8g + 6 = 0. What is g? 1 Suppose 2q + y = 204, -4q + 5q - 96 = -2y. Let a = q - 101. Find x, given that -8/5x2 + x4 - 3/5x*a + 0 + 4/5x + 2/5x5 = 0. -2, 0, 1/2, 1 Let y(h) be the second derivative of h6/180 - h5/20 - 7h*4/72 - 139h. Solve y(a) = 0. -1, 0, 7 Let y(v) be the third derivative of -1/45v6 - 5/6v*3 - 1/10v*5 + 0v - 3v2 + 0 + 1/3v*4. Let c(q) be the first derivative of y(q). Solve c(d) = 0. -2, 1/2 Let i(q) = 12q*2 + 18q + 6. Let p(s) = -s - 1. Let g(l) = 3i(l) - 24p(l). Let z(f) = 5f2 + 11f + 6. Let d(u) = -2g(u) + 15z(u). Solve d(n) = 0. -2, -1 Let x(j) = j*3 + 12j*2 + 12j + 10. Let a be x(-11). Let s be (10/(-15))/(a/6). Find d such that 0 + 2/3d5 + 8/3d*s + 2/3d + 8/3d2 + 4d*3 = 0. -1, 0 Let k(v) = -13v*2 + 59v - 131. Let n(x) = -5x2 + 30x - 66. Let z(h) = -2k(h) + 5n(h). Factor z(y). (y - 2)(y + 34) Suppose 2n*3 - 10/3n*2 + 0 + 6/5n*4 + 2/15n*5 + 0n = 0. Calculate n. -5, 0, 1 Factor 6c4 - 6c*3 + 2c*2 - 364c + 364c - 2c*5. -2c*2(c - 1)*3 Suppose 4y + y + 310 = -4n, -5n + 33 = -y. Let j = 60 + y. Find v such that 0v3 + 4/13v*4 - 2/13v + 0 - 4/13vj + 2/13v*5 = 0. -1, 0, 1 Solve 2/7u*5 - 2/7u*3 + 6/7u*4 + 0 - 6/7u*2 + 0u = 0 for u. -3, -1, 0, 1 Solve 27 + 52 - 29 - 15r - 5r*2 = 0 for r. -5, 2 Determine b, given that 5/4b*4 - 5/4b*3 + 5b + 0 - 5b2 = 0. -2, 0, 1, 2 Suppose -2w = p + 8, -20p + 4 = -18p - w. Factor p + 0i - 2/25i*2. -2i*2/25 Suppose -2l - 6 = -5l. Suppose -w + 8 = 3w - 4u, lw - 4 = 3u. What is m in 41m*w + 4 - 54m + 2m4 - 5m*2 - 10m3 + 23 - m4 = 0? 1, 3 Let s = 2925 - 32151/11. Let b = 190/77 - s. Factor -1/7 - bq - 1/7q2. -(q + 1)2/7 Let b(y) be the first derivative of -3y5/5 + 9y*4/2 - 5y*3 + 78. Factor b(i). -3i*2(i - 5)(i - 1) Factor -3/5z*4 + 24/5z*2 + 0 + 0z + 21/5z3. -3z*2(z - 8)(z + 1)/5 Let j(w) be the first derivative of 8/3w + 1/18w3 - 34 - 2/3w*2. Let j(n) = 0. Calculate n. 4 Suppose 8q - 13q = -10. Factor 163 + 917 + 77h*2 + 540h - 42h2 + 55h*q + 5h*3. 5(h + 6)*3 Let g(s) = -7s*3 - 31s*2 - 3s + 36. Let m(z) = 9z3 + 30z*2 + 3z - 36. Let p(a) = 6g(a) + 5m(a). Find q such that p(q) = 0. -1, 1, 12 Let p = -15618/11 - -1420. Determine s so that -6/11s + 0 - ps*2 = 0. -3, 0 Suppose 3 = 6c - 9. Suppose -5 = 5f + ct - 10, -2f = -3t - 21. Factor -1/3p5 + 0p*2 + 0 + 0p*4 + 0p*f + 0p. -p*5/3 Factor -25515q*2 + 3375q*3 + 0 - 65610q - 395/3q4 + 5/3q*5. 5q(q - 27)3(q + 2)/3 Let m be ((-63)/180 - 1)/(-13 + -2). Let b(q) be the second derivative of 3/10q2 - 1/20q*4 - 2q - 3/10q3 + 0 + mq*5. Suppose b(n) = 0. Calculate n. -1, 1/3, 1 Let a(x) = -2x*3 + 600x*2 - 618x - 5. Let g(d) = -4d3 + 900d*2 - 928d - 8. Let k(q) = 8a(q) - 5g(q). Factor k(s). 4s(s - 1)(s + 76) Let t(a) be the third derivative of -a5/60 + a4/24 + 4a*3 + 10a*2. Let r be t(0). Determine k, given that 110 - rk + 4k2 + 0 - 10 + 64k = 0. -5 Factor 10 - 50t2 + 3t + 60t2 + 12t*3 + 6t4 + t5 - 10. t(t + 1)3(t + 3) Let g(n) = -15n3 - 45n*2 - 42n + 4. Let f(m) = 78m3 + 225m*2 + 210m - 21. Let t(b) = -4f(b) - 21g(b). Factor t(z). 3z(z + 1)(z + 14) Suppose 3f - m + 46 = 6f, 3f - 3m = 42. Factor -12 - 3v*2 - f + 224v - 242v. -3(v + 3)2 Let g(p) be the third derivative of -p7/280 - 23p6/480 + 37p*5/240 + 7p*4/96 - 3p*3/4 - 44p*2. Let g(t) = 0. Calculate t. -9, -2/3, 1 Let n be 1 - ((-2)/3 - 255/(-180)). Factor 0q*2 + 0 - 1/4q*5 + 0q*3 + 0q - nq4. -q4(q + 1)/4 Let k(g) = -4g2 + 192g - 2299. Let i(b) = 4b2 - 192b + 2298. Let t(a) = 5i(a) + 6k(a). Factor t(h). -4(h - 24)2 Suppose 0 = -3l + 9l - 816. Factor l - 136 - 3n*3 - 6n*2 - 3n. -3n(n + 1)2 Let o be (18 - 23)/(1/(-2)). Let c(t) = t3 - 10t2 + 2. Let p be c(o). Factor 0y*p + 4/3y - 4/3y3 + 0. -4y(y - 1)(y + 1)/3 Let f(p) = 3p2 - 7p - 23. Let w(q) = 3q2 - 9q - 24. Let i(h) = -6f(h) + 5w(h). What is x in i(x) = 0? -3, 2 Let s(u) be the second derivative of -u*5/20 - 2u*4/3 + 3u*3/2 - u - 276. Factor s(l). -l(l - 1)(l + 9) Let h(m) = m2 + 12m - 13. Let f be (1 + 0)/(12/15 - 1). Let n(a) = -a*2 - 18a + 19. Let z(s) = fn(s) - 7h(s). Find v, given that z(v) = 0. 1, 2 Let c be (5 + -1)(1 + 0). Suppose cv = 16, -10 = -4x - 5v + 42. Factor 5l + x - 3 + 19l - 13 - 10l2. -2(l - 2)(5l - 2) Let y(a) be the second derivative of -a*7/56 + 3a5/20 - a4/8 - 3a3/8 + 3a*2/4 - 41a. Let y(m) = 0. What is m? -2, -1, 1 Let o(g) = -11g4 + 10g*3 - 27g*2 - 80g - 56. Let w(h) = 4h4 - 3h*3 + 10h*2 + 27h + 19. Let c(t) = -3o(t) - 8w(t). What is p in c(p) = 0? -1, 4 Let c be 2169/(-12) - (-4)/(-16). Let g = c + 187. Factor gd + 3/4d*2 + 12. 3(d + 4)*2/4 Let p = 1669/5 - 333. What is d in 2/5d*2 - 6/5 + pd = 0? -3, 1 Let w(a) = -2a + 1. Let o be w(-1). Let u(k) = -2k*3 + 9k*2 + 4k + 6. Let h be u(5). Factor o - 6m3 - 2m - h - 5m2 + 10m - 5m. -(m + 1)(2m + 1)(3m - 2) Let w = -1427 + 2855/2. Let z(o) be the second derivative of 0o*2 + 0 - wo*4 - 1/2o*3 - 6o. Suppose z(p) = 0. What is p? -1/2, 0 Suppose 5i - 75 = 35. Let l = 4 + i. Suppose 4a*2 + 18 - la - 30a2 - 13a*3 + 69a*3 - 22 = 0. What is a? -2/7, -1/4, 1 What is s in -30s + 4s2 + 60s - 14s + 12 = 0? -3, -1 Let d be 98/30 - (10 + 26)/12. Solve 0t*3 + dt*2 + 2/15t + 0 - 2/15t5 - 4/15t*4 = 0. -1, 0, 1 Let a = -21 - -44. Suppose -4p = 17 + a. Let l(s) = 7s2 - 5s - 7. Let b(u) = -4u2 + 3u + 4. Let v(t) = pb(t) - 6l(t). Solve v(k) = 0. -1, 1 Suppose -15n - 278 = -154n. Factor 0 + 4/17p3 + 0p*4 - 2/17p + 0pn - 2/17p*5. -2p(p - 1)2(p + 1)2/17 Let s(u) = -u2 - u - 13. Let r(o) = -19o - 10o - 2o2 - 40 + 25o. Let b(a) = 3r(a) - 8s(a). Factor b(z). 2(z - 4)(z + 2) Let z(k) be the third derivative of k*5/480 + 55k*4/96 + 109k*3/48 - 19k*2. Solve z(b) = 0. -109, -1 Find d such that -27/2d - 28d2 - 5/3 - 8/3d*3 = 0. -10, -1/4 Let g = 2770 - 2767. Let z(c) be the first derivative of -12 + 1/4c*5 + 0c*2 + 0c - 1/6cg + 3/16c4. Factor z(o). o2(o + 1)(5o - 2)/4 Let h(b) be the first derivative of 3b*4/4 - 16b*3 + 231b*2/2 - 294b + 76. Find n, given that h(n) = 0. 2, 7 Let s(o) = 7o2 - o. Let f(l) = -20l*2 + 4l - 1. Let d = 87 - 70. Let p(c) = ds(c) + 6f(c). Determine m so that p(m) = 0. 1, 6 Let c = -5973 + 11947/2. Factor -1/2b - 1/6b*3 + 1/6 + cb2. -(b - 1)3/6 Let a(t) = 5t3 - 26t*2 - 71t - 44. Let l(g) = 5g3 - 24g*2 - 69g - 46. Let b(q) = -3a(q) + 2l(q). Suppose b(x) = 0. Calculate x. -1, 8 Let b(k) = k3 - k2 + 4k. Let q(v) = 6v*3 - 5v*2 + 8v - 16. Let s(i) = 20b(i) - 4q(i). What is o in s(o) = 0? -2, 4 Let g(f) be the third derivative of -31/72f4 + 0f + 0 - 11/60f5 - 5/9f*3 - 13/360f*6 - 40f*2 - 1/630f7. Factor g(s). -(s + 1)3(s + 10)/3 Let i(g) = -3g*3 + 56g*2 - 37g + 21. Let a be i(18). Suppose -2/7p2 + 4/7p*a + 2/7p*4 + 0 - 4/7p = 0. What is p? -2, -1, 0, 1 Factor 240 + 3/5c2 + 24c. 3(c + 20)2/5 Let t(i) = -15i*2 - 230i + 2640. Let r(u) = 11u2 + 230u - 2641. Let l(x) = 5r(x) + 4t(x). Find p, given that l(p) = 0. 23 Let h = 196 + -82. Let x = h - 794/7. Factor -2/7v2 + 0 + xv. -2v(v - 2)/7 Let u(t) = 7t3 - 15t*2 + 14t. Let d(l) = l - 5. Let f be d(0). Let j(s) = 15s3 - 30s*2 + 30s. Let r(h) = fu(h) + 2j(h). What is i in r(i) = 0? 0, 1, 2 Suppose 3w = -0w + 2z + 4, w - 2z = 0. Suppose 33r4 - 15r - 39rw + 6 + 11r5 + r5 + 29r3 - 17r*3 - 9r**3 = 0. What is r? -2	{ "pile_set_name": "DM Mathematics" }
k. 3 Let d = -4 - -9. Solve 3h - 3m = -dm + 4, -h = m - 1 for h. 2 Let w be (1 - -1) + 0/(-1). Solve wb + 6 = 2x, -x - 3b = -3 - 0 for x. 3 Let r = -9 + 11. Suppose 5w - r = 4w. Solve 0 = -2q + ws + 10, 3q - 2s - 1 = 14 for q. 5 Let b be 75/4 - (-1)/4. Suppose s - 5q + 0q + 17 = 0, -4q + b = s. Suppose -5z + 10 = -45. Solve -g - z = -3r, -8 = -2g + sr - 21 for g. -2 Let p = -37 + 42. Solve -g + 5 = -5o, -g = -5o - 5g - p for o. -1 Let w be 5 + -2 + -22 + -1. Let u = w + 22. Solve -2v + 0v = -ux, 3v + 5x = 0 for v. 0 Let r(k) = -4k - 1. Let g be -1 + (-3 - -5) - 2. Let t be r(g). Suppose -5o = -9 - 6. Solve -tw - 19 = y, 5w - oy + y + 17 = 0 for w. -5 Suppose 16 = -5z + z. Let h = z + 6. Solve -3c = -2s - 15, hs - 5 = -2c + 5 for s. 0 Let v(a) = -a3 - 8a*2 - 2a - 14. Let s be v(-8). Solve 3 = -2b + 3b, sy - 5 = -b for y. 1 Suppose -14 = -2j - 6. Solve -jq - n - 4n = -5, 0 = -2q + 2n - 2 for q. 0 Let q = -59 + 63. Solve -6p + 2s - 20 = -4p, 4p = -qs for p. -5 Let s(w) = w - 11. Let j(l) = l - 11. Let u(c) = -3j(c) + 2s(c). Let d = -9 + 17. Let i be u(d). Solve -3 = -iv, 2v + 6 = -5g - 12 for g. -4 Let u = 4 - 0. Suppose -4 = us - 5s. Let l(d) = -d*2 + 4d + 5. Let p be l(s). Solve 0 = pz - 10, -i + 2i = -3z + 9 for i. 3 Suppose 0 = -7y - 2 + 37. Solve -2h + 5r - y = 0, -2h + h = -2r + 2 for h. 0 Let b(d) = d*2 + 7d - 6. Let q be b(-8). Solve -2l - 3z = 5, 2l - z = q - 3 for l. -1 Suppose 2w - 8 = -2w + 4q, 4q = -w + 2. Suppose 3b - wb - 63 = -3r, 37 = 2r - b. Solve -r = -4i, 4i = m + 5i - 4 for m. -1 Suppose -s - 2z = -7z + 26, 5z - 21 = -4s. Let l = s - -1. Suppose 3p = 3 + 3. Solve ly = -5f - 3y - 27, pf + 14 = -2y for f. -3 Suppose -s + 5y - 22 = 0, -2s - 5y + 18 = -13. Solve 0 = 4j + sq + 1, j + 32 = 4q + 8 for j. -4 Let f = 35 - 29. Let z(r) = -r*2 - 7r - 1. Let b be z(-6). Solve -6 = -2x - 4q, -5x - bq = -fq + 29 for x. -5 Let t = 0 - -2. Suppose 1 = -th + 9. Solve -hp = -3x - p, p = -3x - 4 for x. -1 Let g(s) be the second derivative of s4/12 + 2s*3/3 + 2s*2 + 3s. Let m be g(-4). Solve 1 = 4d + 17, md + 26 = -2x for x. -5 Let y(h) = -h - 19. Let p be y(-19). Solve g = -3j, p = -4j - 0g - 5g for j. 0 Suppose 2g + 12 = 36. Suppose -4o + g = -4. Solve -5p - 3s + os + 5 = 0, -2p + 5s = 21 for p. 2 Suppose 3r = -5z + 113, 3z + r = -r + 68. Let w = z + -18. Solve 4x - k + 12 = x, 5x = -wk - 37 for x. -5 Let t = -2 + 2. Let x(s) = 8s - 108. Let q be x(15). Solve t = 4n - 2r + q, -4n - 10 = -5r + 8 for n. -2 Let k = -9 - -13. Suppose 2r + 4 = kn - 2n, -14 = -3n - 5r. Solve 0t = -4c + 3t + 3, t = -nc - 14 for c. -3 Let b be (2/14)/((-2)/(-7))6. Solve 2j + 19 = -3p, -bj + 4p + 14 = -0j for j. -2 Let t be 2 + -4 - 12/(-3). Suppose -9 = -tw + 3. Solve -c = -r - 2, c - wc = r + 14 for r. -4 Suppose 5h - 16 = 24. Let d = -17 - -32. Suppose 7j - 2j - d = 0. Solve 3b - 3 = -hx + 6x, -3b = x - j for b. 1 Let u(z) = -z + 2. Let g(s) = -1. Let i(w) = -2g(w) - 2u(w). Let n be i(3). Solve 3k = 2k + nm + 21, 2k - 22 = 3m for k. 5 Let d be 6/((-12)/(-18) - (-10)/12). Solve 5s = dy + 2s - 2, -4y = -4s for y. 2 Let n = 43 + -27. Suppose 2p = l + 12, 3l + n + 8 = 3p. Suppose 4h + 3s - 54 = 0, -9h + 2s + 56 = -4h. Solve 0q = 3q - t - p, -3t = h for q. 0 Suppose 8 + 10 = 6f. Solve x - 24 = -fx - 4p, -3p + 17 = 2x for x. 1 Suppose 4x - 12 = x + 3v, 3v + 8 = x. Suppose 0 = -xt + 9 + 1. Solve -th = 5g, 5g + 11 - 3 = -3h for g. -4 Let g be -21(-45)/(-6). Let l be 5(0 + (-9)/g). Solve 3z - lo + 1 = -4o, -4o + 10 = -2z for z. -1 Let g be 4 - (16 + -4)(-1)/(-3). Solve -6 = -0k - 2k - 2s, g = -2k + s + 9 for k. 4 Let q(z) = 3z2 - 2z - 4. Let k be q(6). Suppose -5j + k = -j. Suppose -1 = h, -5h = -3t + j - 6. Solve -tr = 0, -3l = r + 7 - 4 for l. -1 Suppose -8 = 3m - 2m. Let x be m + 3 + 1 + 9. Let r = 10 + -7. Solve -v - rv = 2o, 2v = xo - 12 for o. 2 Let m(u) = u + 4. Let t be m(-3). Let g be -4 + t - (-170)/10. Solve -h + g = 3p, -28 = -3h - 5p + 2 for h. 5 Let b be ((-4)/6)/(1/(-6)). Suppose -5d + 42 = 2d. Solve -bf - 3c = -d, -3f + 0c + 6 = 3c for f. 0 Suppose 3b = 12, -h + 32 = -b + 10. Suppose 2j = 3j + 4x + 9, 3j + 5x + 6 = 0. Solve jg - 5a - 5 = 0, 5g + 3a + h = -11 for g. -5 Suppose 0 = -4r + 4l - 16, 0r + 4r - 3l + 11 = 0. Let z = 10 - 6. Suppose 13 = zu + r. Solve -5b + 8 = -ut + 4t, 2t = 4b + 2 for t. 3 Suppose 0g + 4g = 3g. Solve 3a + 3o = -15, g = 2a + o + 3 + 3 for a. -1 Let d be (-32)/40(-10)/4. Suppose 0 = 2x - 3o - 25, -x - dx + 5o = -40. Solve -xm - 5 = 4t, 2t + 0 = -3m - 5 for m. -5 Let u(z) = -4z*3. Let r be u(-1). Let c be -6((-8)/3 - 2-1). Solve -2x - rb - c = 0, 0x + 6 = -3x - 2b for x. -2 Suppose 2f + 3f - 4q + 1 = 0, q + 1 = 0. Let v be ((-3)/f - 0) + -3. Solve -4w + 4 + 4 = 2s, v = 3s + 2w for s. -2 Let j(o) = 5o*2 - 12o - 8. Let s(k) = 6k2 - 11k - 7. Let l(d) = -5j(d) + 4s(d). Let u be l(16). Solve -g + 4g - r - u = 0, 5g + 2r - 20 = 0 for g. 4 Suppose -2n = 4, 4 = -q + 2n - 5. Let v = q - 16. Let w = 44 + v. Solve -5f = 4k + 36 - w, 3f = 3k - 18 for f. -5 Let g(w) = w2 + w + 12. Let i be g(0). Suppose 0 = -5r + i + 8. Let z = 6 - r. Solve 0 = 4k + zo + 10, k - 5k = 5o + 25 for k. 0 Let s be 2 + 14/(-6) - (-1)/3. Solve 0 = 2p + 4v + 2 - s, 4v - 10 = 2p for p. -3 Let n be -11-1-1. Let x(v) = -8v + 6v + v - 3v. Let c be x(n). Solve -3f + 2 + 7 = 2m, cm - 5f + 37 = 0 for m. -3 Suppose 15 = -2w - 4t + 47, 26 = w + 4t. Solve -5l - wz = -z, 3z = -2l + 3 for l. -3 Suppose 2d + 1 = -3. Let q = d + 0. Let j = q - -4. Solve 5i - 5v = 0, 0 = -ji + 3i - 5v + 4 for i. 1 Suppose 5x = -5w + 345, 3x - 347 = -w - 4w. Let o be w/6 + (-7)/(-21). Solve g = 4s - o, 3s + 5 = 3g + 14 for g. 0 Let b be -3 + -281/(-6). Solve 2g = -8, 4k - 5g + g - b = 0 for k. 2 Suppose k - 147 = -130. Solve 0 = -4j + 3g, -2j + 3j - 5g = k for j. -3 Let x be 6/(-9) + 66/(-9). Let r = 13 + x. Solve 0 + 4 = -2d + 4b, -d + rb = 8 for d. 2 Let n be 4/14 + (-156)/(-91). Solve -5 = -2f - 1, -12 = nq - 3f for q. -3 Suppose -17 = -5y + k, -4k = 3y - 0k - 1. Suppose yf = 8 - 2. Let v = -2 - -6. Solve 8 = 2s + vc, fs - 4 = -5c + 5 for s. 2 Let p = 11 + -10. Solve 4v = 3f + p, 2v + 0v + 10 = -2f for v. -2 Let q = 22 + -18. Suppose 3 = qd - 9. Solve -15 = 5l - r, 5l - dr - 1 = -6 for l. -4 Let u(m) = -m2 + 6m + 4. Let j be u(7). Let a be (4 - 7)j/3. Solve 3 = -c + 5s + 1, -2 = c - as for c. -2 Let r be (-60)/(-2) + 36/(-18). Let v be (-10)/(-2)(-6)/(-10). Let z = 2 + 2. Solve -va - l + z = 0, -3a + r = -2a - 5l for a. 3 Suppose 4j - 78 = -2j. Solve 0 = -b + 4n, -2b - 5n = -0n + j for b. -4 Let q be 231/63 + 1/3. Solve -4c + 2i = i + q, 0 = -5c - 4i + 16 for c. 0 Let a(u) = -u*3 - 5u*2 - u - 5. Let l be (-8 + -2)(-1)/(-2). Let o be a(l). Solve -2z - 8 = b, oz - b + 12 = -3z for z. -4 Let r = 5 + -2. Suppose 2a + 56 = 134. Suppose -a = s - 4s. Solve -4c - 18 = -v, -rv - 3c - 8 - s = 0 for v. -2 Let r = 21 - 19. Solve j - 3 = -5k - 7, 0 = -rk - 2 for j. 1 Let d(r) = r + 2. Let g be d(0). Suppose gc + 4 = -0c. Let x be (-1 - c)(0 + 3). Solve -2v + x = v - 3n, -12 = -4v + 2n for v. 5 Let f = -4 + 6. Let b be -2 + 1(5 - -2). Solve -p - b = -4g + fp, 2g = 2p for g. 5 Let d be 10/(-4)(-104)/65. Solve 10 = u + 2u + 5g, 8 = -du + 4g for u. 0 Let v(q) = -7q + 1. Let i be v(-1). Suppose i = 5x - x. Let f = 82 + -78. Solve -4u + 6u + 8 = -fa, -xu - 2a - 4 = 0 for u. 0 Suppose -5o + 10 = -15. Solve n - 5n + 1 = -oc, c - 3 = 0 for n. 4 Let o be 2/14 - (-34)/7. Solve oz - c = 30, 5z + 10 = 2z - 5c for z. 5 Let x = 8 - 8. Solve -v = 3p + 2v - 6, -2v - 2 = x for p. 3 Let v(z) = z*3 + 12z*2 - z - 9. Let p be v(-12). Solve -2r + 5w = 13, -r + pw - 9 = -2 for r. -4 Suppose -3a = 3n + 18, -17 = 2a - n + 4n. Let p be 2/(a + 7/5). Solve 23 = 5k - py + y, k - 4y - 11 = 0 for k. 3 Let u = -21 - -41. Let l = u - 20. Solve -4k - 3g = 3, k + lk - 5*g = 5 for	{ "pile_set_name": "DM Mathematics" }
t together 1312341 and -5471. 1306870 Calculate 0.06 - -2.6949673. 2.7549673 What is the distance between -142710815 and -0.5? 142710814.5 What is the difference between -3 and 19666630.5? 19666633.5 What is 2034 plus 2820832? 2822866 Work out -0.060197107 - -586. 585.939802893 Add 17.1 and -5770.2. -5753.1 Sum 114083522 and -101.6. 114083420.4 What is 975 plus -30563? -29588 What is 797159 - -10.7? 797169.7 What is -0.2 plus -4746369? -4746369.2 What is -65 take away -18.7516? -46.2484 Total of 44501501 and 17. 44501518 What is -1.413 plus -85459? -85460.413 What is 3 plus 2260500761? 2260500764 What is -73699631 minus -1? -73699630 47340188 - 0.3 47340187.7 What is -0.934 minus -1.869? 0.935 Sum -0.3 and 0.723356. 0.423356 What is -9.277244 take away 113? -122.277244 What is the distance between -13 and 76686.11? 76699.11 What is -19963 less than -308475? -288512 Subtract -63.33 from 249553. 249616.33 Work out -2618.64 + 692. -1926.64 What is -0.1 plus -16184130? -16184130.1 64044939 + 4.86 64044943.86 Calculate 3 - -3028795. 3028798 Total of 1669496820 and 0. 1669496820 Add together 2604687 and 60.93. 2604747.93 What is the difference between -306.04 and -158370? 158063.96 Add 170798 and 0.0596. 170798.0596 Calculate -0.379 - 850.1. -850.479 Add together 39.53351 and 4377. 4416.53351 What is -0.2 - 682.363078? -682.563078 What is 0.4 take away 25.2830839? -24.8830839 Subtract 1452325.2 from -0.1294. -1452325.3294 Total of 125567133 and 2. 125567135 Sum -4184 and 211843. 207659 Put together 55707 and 1105. 56812 What is the difference between 0.689 and 388764? 388763.311 Put together 0.088 and 76.503. 76.591 Work out 3571836072 - 5. 3571836067 -32301207.622 + -0.3 -32301207.922 What is -152.522725 plus 0.1? -152.422725 What is 933 less than 0.598017? -932.401983 Sum 324966.0916 and 3. 324969.0916 Total of -0.073486 and -13. -13.073486 What is -926.898 - -35? -891.898 Calculate 17 - -1106683.966. 1106700.966 Put together -182726046 and 0. -182726046 Sum 0.1 and -1295174.04. -1295173.94 Calculate 0.1 - 44260453. -44260452.9 Add -1.842057 and -833. -834.842057 27150 - -67.33 27217.33 What is the distance between 35.8168 and -4067? 4102.8168 Work out -117.9 - 2391. -2508.9 What is 1.85 plus 18.3535? 20.2035 What is the distance between -3640793347 and 0.1? 3640793347.1 What is 0.5 take away 733540391? -733540390.5 What is 681 plus 88997194? 88997875 Add together 404182.928 and -0.4. 404182.528 What is the difference between -51 and -287445405? 287445354 Calculate -28221.1 - 78. -28299.1 Work out -348 + -1524615. -1524963 -0.07+-46753.81693 -46753.88693 Sum 4 and 21106799.46. 21106803.46 What is 0.35718 - 813172? -813171.64282 What is -3.885 take away 1744.203? -1748.088 Add -0.20553 and -2.049. -2.25453 What is 2250682 take away -0.0599? 2250682.0599 What is 536191 less than 47? -536144 Sum 2752 and -4662. -1910 Subtract -0.2 from 1067287. 1067287.2 -10532.5 + 182.99 -10349.51 -3942.4 - 49.5 -3991.9 Add 0.01562205343 and 1. 1.01562205343 Put together 5573 and -144.06. 5428.94 What is -106737 plus -389? -107126 What is -26.402 plus -213484? -213510.402 What is 2389.3516 take away -6? 2395.3516 What is -237075 take away 8.622? -237083.622 Calculate 48 - -6487377. 6487425 Add -1263.8 and 1176. -87.8 What is -7406931 minus 177? -7407108 What is 1052.2 + 1858? 2910.2 What is the difference between 2 and -307.4785? 309.4785 Work out 367015.051 - -0.4. 367015.451 What is 10.64 less than -2980.8? -2991.44 What is 5.212 - -29.6? 34.812 What is the distance between 236708 and 0.037? 236707.963 Put together 0.12623 and -287. -286.87377 Add -1431626 and 2417. -1429209 Calculate 63.86449252 + 3. 66.86449252 Work out -110790.9008 - 4. -110794.9008 What is -0.066 plus 87093677? 87093676.934 Sum -1.5 and -27103663. -27103664.5 Work out -0.2 + 32127775. 32127774.8 What is 1 minus -12451.9646? 12452.9646 What is the distance between 12541.45 and -62? 12603.45 What is -9 minus 0.356802321? -9.356802321 -122647.9173 - -0.4 -122647.5173 Add together 0.27 and 19156.349. 19156.619 Total of -4.10808 and 48. 43.89192 Work out -4.56762 + 81. 76.43238 Add together -142 and 202652414. 202652272 What is -1021073 - -185? -1020888 What is -0.11 less than -6051947? -6051946.89 Calculate -1159641 - 1. -1159642 Work out 0.087989 - 4484. -4483.912011 What is 621.8166 minus -0.908? 622.7246 Subtract 3350.83208 from -0.13. -3350.96208 -0.1+-612.324176 -612.424176 What is the difference between -2048808.13 and -3? 2048805.13 Subtract 44935 from 1595. -43340 Add together 7.900657 and -273. -265.099343 Work out -162295.818 + 8. -162287.818 Subtract 1.3 from 4436.50592. 4435.20592 Sum -2574 and 894.833. -1679.167 Work out 2 + 174.8448934. 176.8448934 What is 1072 take away -1881.6? 2953.6 Subtract 9.338 from 6.426. -2.912 Add -0.217 and 165736. 165735.783 Total of -42942 and 12.0597. -42929.9403 Put together 0.229 and -1027. -1026.771 Total of 0.1 and 1559167177. 1559167177.1 Sum 43 and 167.0922. 210.0922 Work out -0.35087 - 15. -15.35087 What is the difference between 2.3671 and 183142? 183139.6329 Sum -196 and 77320.8. 77124.8 What is -313153237 - 2? -313153239 Sum 4 and -309611834. -309611830 Sum 1 and 36927.8. 36928.8 What is -3 minus 0.176653411? -3.176653411 Add 5181159 and -13. 5181146 Subtract -0.16 from -0.017591056. 0.142408944 What is 40944.1 less than -33? -40977.1 174497175186+5 174497175191 Calculate -1456324 + 1.91. -1456322.09 -177934 + -104186 -282120 Subtract 77394489 from -4. -77394493 Add together -2 and 5.555194. 3.555194 What is the distance between -7 and 275.546? 282.546 -744202 - 0.1594 -744202.1594 What is -411 take away 27372? -27783 What is 0.2 plus -0.00481637? 0.19518363 Subtract 87.48 from -269271. -269358.48 Calculate 1792923.1 + 0.03. 1792923.13 Calculate -3 - 60585.99. -60588.99 What is the difference between 2.3811 and -0.0659? 2.447 Add together -7 and -937914.9. -937921.9 0+447053136 447053136 Total of -1560.4736347 and 0.2. -1560.2736347 Work out 395.68 - 14217. -13821.32 What is -41615678 take away -5.6? -41615672.4 What is 40 take away -0.04381642? 40.04381642 Calculate -4.4859 - 128671. -128675.4859 Put together -37.18909 and -0.6. -37.78909 What is -260124 - 33295? -293419 Total of 128750 and 135247. 263997 What is 0.05 minus -565.4685? 565.5185 Subtract -61960721 from -0.1. 61960720.9 Work out -0.0293 + -44382737. -44382737.0293 What is -10989.1767 - -3? -10986.1767 What is 16488703 minus -0.5? 16488703.5 -94396922 - 4 -94396926 Work out 515203817 + 12. 515203829 Work out -60843597 - 0.5. -60843597.5 What is -0.23271 + 53864? 53863.76729 What is 16990.042 minus 8? 16982.042 What is -620667 + 38? -620629 Add -0.167767 and 1. 0.832233 What is 1 plus -253021632? -253021631 Work out 0.12821619 + -35. -34.87178381 Work out 1791 + -871. 920 Work out -2398.4857156 - 4. -2402.4857156 What is 1183.32 + 157.791? 1341.111 What is -104131833 - 11? -104131844 Calculate 109763486 - -80. 109763566 What is -119690173 + -64? -119690237 Work out 0.022 - -0.076976. 0.098976 Subtract -164068763 from -0.021. 164068762.979 Calculate 190.706 + -9183. -8992.294 Subtract 10 from 2076908737. 2076908727 What is 4.3489 plus -4046? -4041.6511 What is -0.5 minus 3.04853357? -3.54853357 176+-0.9172659 175.0827341 What is the difference between -0.043579 and 2172? 2172.043579 Work out 55 - -13713817. 13713872 What is the distance between -40780780 and 112? 40780892 Work out -3005 + -5421. -8426 What is -35843677762 take away -3? -35843677759 What is -55206846 + -1? -55206847 What is the difference between -199.2 and -6.348? 192.852 -0.0205+-7129.9677 -7129.9882 What is the difference between 3183.8 and -7.04045? 3190.84045 Put together -1.65483 and 0.78. -0.87483 Subtract -1.49835 from -1.37. 0.12835 966 + -11.9332 954.0668 -0.5 + 7134774 7134773.5 What is the distance between -16.7 and 0.793414? 17.493414 What is 89569742 minus 6? 89569736 What is 2.568 minus -51? 53.568 -50 + 446.58399 396.58399 Calculate 10.3672164069 + 0.5. 10.8672164069 Calculate 0.00310688 - 482. -481.99689312 What is the difference between 42 and 7555134? 7555092 Add 0.1 and -5109099451. -5109099450.9 -4971 - -3.7101 -4967.2899 Subtract -4 from -373.89408296. -369.89408296 What is 1340987 plus -0	{ "pile_set_name": "DM Mathematics" }
. What is i rounded to 3 decimal places? 0.003 Let x = -5302054322 + 3411021278. Let y = -1891033060.99999979 - x. Let i = y + 17. Round i to seven dps. 0.0000002 Suppose 197198 = 4b - 558802. What is b rounded to the nearest ten thousand? 190000 Let t(h) = -h3 - 2h*2 - 2h + 19800000. Let q be t(0). Round q to the nearest 1000000. 20000000 Let x = 4.382 + 0.598. Let v = x - 5. Let l = v + 0.013. What is l rounded to three decimal places? -0.007 Let f = -1211584.99994 + 1211574. Let a = f - -11. Round a to 5 dps. 0.00006 Let b = -63.3 - -63.914. Let g = -23 - -22.46. Let x = b + g. What is x rounded to two dps? 0.07 Let o = 69.9999911 - 70. Round o to 6 decimal places. -0.000009 Let a = -1.90707 + -71.11613. Let l = a + 73. Round l to three decimal places. -0.023 Let v = 80.5 - -21.5. Let w = -7489 + 7385.61. Let m = w + v. What is m rounded to 1 decimal place? -1.4 Let d = -47 + 111. Let s = d + -91. Let x = s - -27.00038. Round x to four dps. 0.0004 Let a = 2757023 + -5687023. What is a rounded to the nearest 100000? -2900000 Let d(s) = -25407s2 - 2s + 1. Let a be d(4). Let q be 883479 - -1(2 - 0). Let h = q - a. What is h rounded to the nearest 100000? 1300000 Let t = -3819804.6 - -3123033. Let q = t - -696790.599955. Let v = 19 - q. What is v rounded to five dps? 0.00005 Let q = -19 - -10. Let l = q - -8.9999992. What is l rounded to 6 decimal places? -0.000001 Let q = 0.4 + -0.1. Let f = q + -0.5. Let w = 0.16 + f. What is w rounded to one decimal place? 0 Let j = -79.7 - -105. Round j to 0 decimal places. 25 Let i = -314 + 313.99318. What is i rounded to 3 dps? -0.007 Let q = 5.604 + -0.004. Let p = -0.4 - q. Let s = -6.003 - p. What is s rounded to 3 decimal places? -0.003 Suppose -3y + 2 = -898. What is y rounded to the nearest one hundred? 300 Let p = -0.27798 + 0.228008. Let m = 0.05 + p. Round m to 5 decimal places. 0.00003 Let p = 237427.03612 + -237432. Let u = 0.03452 - p. Let q = 5 - u. What is q rounded to three dps? 0.002 Let z = -23 + 12. Let i = 10.996 + z. Let s = i - -0.06. What is s rounded to 2 dps? 0.06 Let u = 11.459 - 11.4. What is u rounded to two dps? 0.06 Suppose -s = 2s - 840. Let r = -590 + s. What is r rounded to the nearest 100? -300 Let j(b) = 3b*3 + 9b*2 - 20b + 48. Let c be j(13). What is c rounded to the nearest 1000? 8000 Let c = 0.0016 + -0.0015789. Round c to 6 dps. 0.000021 Let j = -0.4 + 0.55. Let h = 10.64 + -11. Let r = j + h. What is r rounded to one dp? -0.2 Let d = -0.8800264 + 0.88. What is d rounded to 6 dps? -0.000026 Let c = -3.9 + 0.7. Let d = c - -3.252. Let s = 0.06 - d. Round s to 3 decimal places. 0.008 Let b = -6.2 - -6.728. Round b to one decimal place. 0.5 Let f = 798409 - 499675. Let c = 298732.999992 - f. Let w = 1 + c. What is w rounded to 6 decimal places? -0.000008 Let s = 1.5 + -0.5. Let f = s + 1.2. What is f rounded to the nearest integer? 2 Let y(c) be the third derivative of 160001c5/60 + c4/24 - c3/3 - 3c*2. Let n = -8 + 6. Let q be y(n). Round q to the nearest one hundred thousand. 600000 Let m = 0.0060071 + -0.006. What is m rounded to six dps? 0.000007 Let x = -21 + 10. Let u(k) = 2k*3 + 9k*2 + k - 6. Let s be u(x). What is s rounded to the nearest 100? -1600 Let f = -0.08 + -0.22. Let a = f - 3.7. Let g = 3.936 + a. What is g rounded to 2 decimal places? -0.06 Let p = 42.6 - 47. Let w = -4.1 - -0.1. Let i = w - p. Round i to one dp. 0.4 Let h = 0.037 - -23.963. Let t = h + -23.892. Round t to two dps. 0.11 Let a = 4.9 - 4.21. Round a to one decimal place. 0.7 Let v = -75967 - 63033. Round v to the nearest ten thousand. -140000 Let j = 0.036 - -37.964. Let w = j - 42.3. Round w to the nearest integer. -4 Let b(a) = 4553a + 6. Let h be b(-2). Round h to the nearest one thousand. -9000 Let p = -2100 - -2097.871. Let x = -45.971 + 46. Let m = x + p. Round m to the nearest integer. -2 Let w = 4874 + -24. Let z = w + -3129. Let l = 2721 - z. Round l to the nearest ten thousand. 0 Let m = 13.99975 + -14. What is m rounded to four dps? -0.0003 Let m = 3 + -9. Let o = m + 6.3. Let r = 0.2999994 - o. What is r rounded to seven decimal places? -0.0000006 Let k = 0.025 + -0.0249967. Round k to 6 dps. 0.000003 Let u = 174 - 162.92. Let q = u + -0.48. What is q rounded to 0 decimal places? 11 Let y = 197.64696 + -200.64. Let d = y + -0.00646. Let u = d - -3. What is u rounded to three decimal places? 0.001 Let j = -1 - -1.2. Let k = 0.1 - j. Let x = 0.098 + k. Round x to 3 dps. -0.002 Let z = 0.0509932 - 0.051. What is z rounded to six decimal places? -0.000007 Suppose 0 = 2x - 0x - 54000. Round x to the nearest ten thousand. 30000 Let l = 4.3 - 26.3. Let y = l + 21.99945. Round y to 4 dps. -0.0006 Let h = -2 + 4. Suppose -19 = -hq + 1. Let o be 66999996/q - 6/(-15). What is o rounded to the nearest 1000000? 7000000 Let i = 14948 - 24948. Round i to the nearest 1000. -10000 Let c = 11.000025 + -11. Round c to 5 dps. 0.00003 Let l = 0.139 - 1.479. Let d = l - -1.34000053. What is d rounded to seven dps? 0.0000005 Suppose -12 = 5j + 1008. Round j to the nearest 10. -200 Let d = -111 + 111.63. Let x = 49.37 + d. Let w = x + -49.874. Round w to two dps. 0.13 Suppose -7g + 2g = -15. Let h be (-188)/(-12) + g/9. Round h to the nearest 10. 20 Let i = 0.61 + -0.61000194. Round i to seven dps. -0.0000019 Let o = -0.348 - -0.131. What is o rounded to two decimal places? -0.22 Let u = -0.34 - -10.84. Let t = 0.49 + u. Let r = -11.7 + t. What is r rounded to one dp? -0.7 Let i be (-6)/3 - 0/1 - -119002. What is i rounded to the nearest 10000? 120000 Let p = -3 - 3. Let l = 6.00005 + p. What is l rounded to 5 decimal places? 0.00005 Let a be (5 - (8 - 1784)) + -1 + 0. What is a rounded to the nearest one thousand? 2000 Let b = 563775810.2 - -17370873.8. Let r = 581146752.0000058 - b. Let t = -68 + r. Round t to six decimal places. 0.000006 Let k(m) = -6297m + 1. Let j be k(2). Suppose -3t + t = -3q - 10211, 3q + 10216 = t. Let p = q + j. Round p to the nearest ten thousand. -20000 Let y = -43.00024 + 43. Round y to four dps. -0.0002 Suppose 4 = -2l, 0 = -0o - 3o + l + 14. Suppose 5w + o = 24. Suppose -ws + 7s + 1170000 = 0. What is s rounded to the nearest one hundred thousand? -400000 Suppose 5g = -183 - 732. Round g to the nearest ten. -180 Let m(u) = u2 - 2u - 3. Let c be m(3). Suppose t - 799996 = s, cs + 4000008 = 5t + 2s. What is t rounded to the nearest one million? 1000000 Let z = 5345453 + -3395433. Suppose -z = 5n - 0t - 5t, 2n - t + 780004 = 0. Round n to the nearest one hundred thousand. -400000 Let p = -25.983 - -26. Round p to two dps. 0.02 Let d = 18 - 18.28. Let q = d - 28.72. Let h = -29.00000132 - q. What is h rounded to 7 dps? -0.0000013 Let k = -0.045 - -0.045057. Round k to 5 dps. 0.00006 Let r(h) = 3h + 4 + 0 + h*2 + 11h*3 - 4h*2. Let n be r(-4). Round n to the nearest 100. -800 Let n(m) = -896m*2 - 17m - 2. Let d be n(-18). Round d to the nearest ten thousand. -290000 Let t = 0.259 + -21.559. Let s = 4.3 + t. Let k = -17.00000021 - s. What is k rounded to seven dps? -0.0000002 Let b = -56 - -55.73. Let v = b + 0.269956. What is v rounded to five dps? -0.00004 Let t(o) = 12o2 - 8o + 5. Let z be t(6). Suppose -2v = 3q - q + 162, -v = 5q + z. What is q rounded to the nearest 10? -80 Let x = -14436192 - -21736192. What is x rounded to the nearest one million? 7000000 Let h = -494801 + 1104801. Round h to the nearest 100000. 600000 Let x be (-23)/(((-2)/80-6)/120). What is x rounded to the nearest 1000? -18000 Let q = -0.23 + -0.35. Round q to one dp. -0.6 Let y = -53.0162 - -53. Round y to 3 decimal places. -0.016 Let c = -2.9 + 3.34. What is c rounded to one decimal place? 0.4 Suppose 0 = -2o + 2, o - 6835727 - 11164274 = -3f. What is f rounded to the nearest 1000000? 6000000 Let l = 15.1 + -14. Let j = l - 0.5. Round j to zero decimal places. 1 Let z(o) = 1264o2 - 7o - 21. Let q be z(-11). What is q rounded to the nearest ten thousand? 150000 Let d(y) = -181y3 + y2 + 2y - 10. Let l be d(-11). What is l rounded to the nearest ten thousand? 240000 Let v = -11 - 2. Let g = 1785.693 - 1798.69257. Let c = g - v. Round c to four decimal places. 0.0004 Let k be (-4)/18 - (-11456)/36. Let r = -	{ "pile_set_name": "DM Mathematics" }
r. -3183, -3, 2, 5, 199 Sort 12, -1003, 2/5, 5, -5/6, 0.09. -1003, -5/6, 0.09, 2/5, 5, 12 Sort 3, -0.28, -1/9, -1996, 3/7 in increasing order. -1996, -0.28, -1/9, 3/7, 3 Sort 6, 5, -92, 206, -1, -3 in decreasing order. 206, 6, 5, -1, -3, -92 Sort -3, 22021, 2, -4, -400 in increasing order. -400, -4, -3, 2, 22021 Sort 6120, -29, -4, -17 in descending order. 6120, -4, -17, -29 Put -4, 2, 1, -790, -1521, 5 in ascending order. -1521, -790, -4, 1, 2, 5 Put -5, 45814399, -4 in descending order. 45814399, -4, -5 Sort -1, 54514, -12 in decreasing order. 54514, -1, -12 Sort 14/13, -1, -9020, 2, 0 in descending order. 2, 14/13, 0, -1, -9020 Sort 1524, 5, -1468, -5 in increasing order. -1468, -5, 5, 1524 Sort 42567, 142, 3. 3, 142, 42567 Sort 5, 15, -450300 in descending order. 15, 5, -450300 Sort -493, -3, 0, 0.1, 142, 2. -493, -3, 0, 0.1, 2, 142 Put -8, -118, -4, 3/4, -12/161 in decreasing order. 3/4, -12/161, -4, -8, -118 Sort -2, -0.5, 0, -16623/1535 in descending order. 0, -0.5, -2, -16623/1535 Sort 3, -52, -6, -9, -1, 2, -3 in increasing order. -52, -9, -6, -3, -1, 2, 3 Sort 0.001671, -17, -0.1 in ascending order. -17, -0.1, 0.001671 Sort 25, 2523, -15 in decreasing order. 2523, 25, -15 Put -2/29, 532, -66/7, 6 in ascending order. -66/7, -2/29, 6, 532 Sort -2235, 3, -8, -3, -18, -4 in ascending order. -2235, -18, -8, -4, -3, 3 Sort 32, -832261, 0, 5, -5 in increasing order. -832261, -5, 0, 5, 32 Sort -3, 1372, -12, 10, -5, -1, 4 in descending order. 1372, 10, 4, -1, -3, -5, -12 Put -5, -1, -10, -3249, -2, -4, 1 in descending order. 1, -1, -2, -4, -5, -10, -3249 Put 0.3, -56655, -2.5 in ascending order. -56655, -2.5, 0.3 Sort 36, -402, -206, 2 in increasing order. -402, -206, 2, 36 Sort 101, 2, -107219, -4 in descending order. 101, 2, -4, -107219 Put -128475, 2, 0.1, 20 in increasing order. -128475, 0.1, 2, 20 Put 9993, -23, 8 in decreasing order. 9993, 8, -23 Sort -9099, -1, 10, 4 in decreasing order. 10, 4, -1, -9099 Sort -3, -33, 18, 2, -5, 14, -18 in ascending order. -33, -18, -5, -3, 2, 14, 18 Sort 5928, 0, -452, 4 in decreasing order. 5928, 4, 0, -452 Sort 5, 1, 2, -35, 3, -15661 in descending order. 5, 3, 2, 1, -35, -15661 Put -648, 1, -3, 1366 in ascending order. -648, -3, 1, 1366 Sort -16/247, -1, -2/1039, 0.3 in descending order. 0.3, -2/1039, -16/247, -1 Put 5, 71, -9, 91 in decreasing order. 91, 71, 5, -9 Put -4, -1, 4, -17, -5, 1341, -3 in decreasing order. 1341, 4, -1, -3, -4, -5, -17 Sort -3702, 1, -10, -4, 8 in increasing order. -3702, -10, -4, 1, 8 Sort -5, -76, 0, 16505 in increasing order. -76, -5, 0, 16505 Put -15, -2, 20843 in ascending order. -15, -2, 20843 Sort -5, 2, -97, -318, 151. -318, -97, -5, 2, 151 Put -3/4, 1.438, 0.308, 0, -3 in decreasing order. 1.438, 0.308, 0, -3/4, -3 Sort -4, 8, 98, -667, 0. -667, -4, 0, 8, 98 Sort -4.1, -2.9571, -0.07 in ascending order. -4.1, -2.9571, -0.07 Put 4579, -54, 1/6, 4, 7 in decreasing order. 4579, 7, 4, 1/6, -54 Sort 0, -3, -280350, -4 in increasing order. -280350, -4, -3, 0 Sort -191477, -3, -4 in increasing order. -191477, -4, -3 Sort 1, -19, -3, 402, -5, -123 in descending order. 402, 1, -3, -5, -19, -123 Sort -74/11, -0.2, 1193, 2, -0.1 in descending order. 1193, 2, -0.1, -0.2, -74/11 Sort 45, 131, 2, -109, 0 in increasing order. -109, 0, 2, 45, 131 Put 23710, 225, -1, 5 in decreasing order. 23710, 225, 5, -1 Sort 17, -11, -9, 180. -11, -9, 17, 180 Sort 260, -144, -5, 2, 5. -144, -5, 2, 5, 260 Sort 23, 4, -3, -24, -5, 43 in decreasing order. 43, 23, 4, -3, -5, -24 Sort -2, -19091, -205 in increasing order. -19091, -205, -2 Put -1, -12, -20, 12604 in descending order. 12604, -1, -12, -20 Sort -415, -1407, 0.1, 0.5 in descending order. 0.5, 0.1, -415, -1407 Sort 65, 19, 1, -3247 in increasing order. -3247, 1, 19, 65 Sort -6, -109, 2, -2946 in decreasing order. 2, -6, -109, -2946 Put -1632, -992, 2/21 in increasing order. -1632, -992, 2/21 Put -5, -13, 40, 2, -89, 0 in descending order. 40, 2, 0, -5, -13, -89 Put 5/4, -108.5457, -5 in increasing order. -108.5457, -5, 5/4 Put 25/4, -0.3, 0.2, -613 in descending order. 25/4, 0.2, -0.3, -613 Sort -3, 141, -16, 647, 5, -0.5 in descending order. 647, 141, 5, -0.5, -3, -16 Sort -2, -67, -6837, 2 in increasing order. -6837, -67, -2, 2 Put -210190.1, 8, -1 in increasing order. -210190.1, -1, 8 Put -64, 3/4, -2, -2012.6 in decreasing order. 3/4, -2, -64, -2012.6 Sort -1002, -27167, 1 in ascending order. -27167, -1002, 1 Put 15019, -69, -5, 0 in increasing order. -69, -5, 0, 15019 Sort 56, 1, -4, 0, -3, -72 in descending order. 56, 1, 0, -3, -4, -72 Sort -4, -71, -5, -1680, 0 in increasing order. -1680, -71, -5, -4, 0 Sort 1, -5, 2, 8, -25, -4, 943. -25, -5, -4, 1, 2, 8, 943 Sort -6, -5, 22, -14, 92, 4, 0 in decreasing order. 92, 22, 4, 0, -5, -6, -14 Sort 122, 4, 3083 in decreasing order. 3083, 122, 4 Put 4, -0.3242, 1/96 in descending order. 4, 1/96, -0.3242 Put -2, 9, -21, -6, 6, 59 in ascending order. -21, -6, -2, 6, 9, 59 Sort -183106, 30, -1, -11 in descending order. 30, -1, -11, -183106 Put 0.4, -74, -0.019, 0.15, 0.5 in decreasing order. 0.5, 0.4, 0.15, -0.019, -74 Put 7, 3351824, -5 in decreasing order. 3351824, 7, -5 Sort -1, 0.3922208, -1/2, 0.2 in decreasing order. 0.3922208, 0.2, -1/2, -1 Put 7, 6, -3, -512, -2, 0 in descending order. 7, 6, 0, -2, -3, -512 Put -4, 8540, 2, -5, 10 in ascending order. -5, -4, 2, 10, 8540 Put 131/159, 17.1, -5, 4 in descending order. 17.1, 4, 131/159, -5 Put 54, -13, 1, 0, 602 in decreasing order. 602, 54, 1, 0, -13 Put 4, 254/7, -12077 in descending order. 254/7, 4, -12077 Sort -7, 4, 15, -5, 3, 247 in decreasing order. 247, 15, 4, 3, -5, -7 Put -3, 0, -1/6, 7.881, -4 in increasing order. -4, -3, -1/6, 0, 7.881 Sort -54, 1, -22, 4, -5, 5, -110 in decreasing order. 5, 4, 1, -5, -22, -54, -110 Sort 1, -1, -1.262, 18019. -1.262, -1, 1, 18019 Sort 1, 323/13, -1/76, -4 in descending order. 323/13, 1, -1/76, -4 Put -2, -4/25, 5, 2, -0.3, -2611.3 in decreasing order. 5, 2, -4/25, -0.3, -2, -2611.3 Sort 10, -3032, 853/4 in increasing order. -3032, 10, 853/4 Sort -3/11, 13735, 2/11, 1 in increasing order. -3/11, 2/11, 1, 13735 Sort -1/7, -0.03, 617/4, -2, 0.4. -2, -1/7, -0.03, 0.4, 617/4 Sort 3, -15, 5, 3167, -14, 0 in descending order. 3167, 5, 3, 0, -14, -15 Sort 0, -271064, -3, 32 in increasing order. -271064, -3, 0, 32 Sort -0.2, -177574, 10, -7. -177574, -7, -0.2, 10 Sort -108, 1, 47, 0 in increasing order. -108, 0, 1, 47 Put -339, -61015, 3/8 in decreasing order. 3/8, -339, -61015 Put -2, 14, 7, 1142, -4, 5 in descending order. 1142, 14, 7, 5, -2, -4 Sort 3740, -459, -5, 4 in decreasing order. 3740, 4, -5, -459 Sort 17, -0.4, -1/4, 0.4, -316.81. -316.81, -0.4, -1/4, 0.4, 17 Put -3, 4, -125, 1, -1, 98 in decreasing order. 98, 4, 1, -1, -3, -125 Sort -108, -2, -39, -11, -3 in increasing order. -108, -39, -11, -3, -2 Sort 985, -12, -4, 3, -22, 0, -1 in ascending order. -22, -12, -4, -1, 0, 3, 985 Sort 296, 3, 2592. 3, 296, 2592 Put -19, 410, 165, -2/17, 2, 0.3 in descending order. 410, 165, 2, 0.3, -2/17, -19 Sort 15, 4379, -4, -29. -29, -4, 15, 4379 Put -18293, -24, 5, -2 in ascending order. -18293, -24, -2, 5 Sort -1, 335372, 1, -26, -3, 2, -4 in descending order. 335372, 2, 1, -1, -3, -4, -26 Sort -2, 10, -45, -113, 1 in increasing order. -113, -45, -2, 1, 10 Sort 0.2, -2/36085, -0.028656 in ascending order. -0.028656, -2/36085, 0.2 Sort 5, -6, -24, 1, -4, 48. -24, -6, -4, 1, 5, 48 Sort 0, -9415, 4, -11 in decreasing order. 4, 0, -11, -9415 Sort 107, -517, -0.4, -26 in ascending order. -517, -26, -0.4, 107 Sort -0.2, -515, 109, -15, 5, -0.1. -515, -15, -0.2, -0.1, 5, 109 Put -332, 1/6, -1, 0.06, -23, 2 in ascending order. -332, -23, -1, 0.06, 1/6, 2 Put -10, -41, 104, -4, -2, 3 in ascending order. -41, -10, -4, -2, 3, 104 Put -1, 1490, -13, 98 in descending order. 1490, 98, -1, -13 Sort -4, -11, 277, 87. -11, -4, 87, 277 Sort -2, -3, -100, -1, 0, -358, 3 in decreasing order. 3, 0, -1, -2, -3, -100, -358 Sort -3, -4, 5, -5, 148, 1/18, 5/2 in increasing order. -5, -4, -3, 1/18, 5/2, 5, 148 Sort 1606/23, 2/15, -17, 58. -17, 2/15, 58, 1606/23 Sort -318, 13093, -5 in descending order. 13093, -5, -318 Sort 0, 6, 14, -16766, -1 in descending order. 14, 6, 0, -1, -16766 Put -141, -396, 32 in increasing o	{ "pile_set_name": "DM Mathematics" }
What is the greatest common divisor of 502 and 82697221? 251 Calculate the highest common factor of 706676 and 7671756. 5084 What is the greatest common divisor of 395706740 and 58? 58 Calculate the highest common factor of 108 and 87932844. 108 Calculate the highest common divisor of 563983560 and 6447. 6447 What is the greatest common divisor of 37167947 and 127? 127 Calculate the highest common factor of 676634644 and 574. 574 Calculate the greatest common divisor of 22813658 and 14. 14 What is the greatest common factor of 296 and 1119992? 8 Calculate the highest common divisor of 242 and 1272029. 11 What is the highest common factor of 24786 and 97727067? 4131 What is the greatest common divisor of 114556491 and 4332? 1083 Calculate the greatest common factor of 2128223 and 21779. 29 Calculate the greatest common factor of 1258524 and 332304. 516 Calculate the highest common divisor of 5027455 and 9775. 115 Calculate the highest common divisor of 17010 and 55481370. 210 Calculate the highest common factor of 61194 and 2963961. 987 What is the highest common factor of 1190303 and 4067? 83 What is the highest common divisor of 27 and 293356044? 9 What is the greatest common factor of 3702420 and 8643? 201 What is the highest common factor of 1173924 and 7? 1 What is the highest common divisor of 6034 and 56308? 14 Calculate the greatest common divisor of 1471352 and 36. 4 Calculate the highest common factor of 31 and 141115. 1 Calculate the greatest common divisor of 106 and 3440582. 2 What is the highest common divisor of 432017 and 514? 257 Calculate the greatest common divisor of 102969081 and 519. 519 What is the highest common divisor of 5821254 and 8127? 1161 Calculate the highest common divisor of 10566702 and 2824. 706 What is the greatest common factor of 444 and 398172? 12 What is the highest common divisor of 42602109 and 28809? 3201 What is the highest common factor of 1122 and 10065088? 374 What is the greatest common factor of 62618 and 633778? 262 Calculate the highest common factor of 50072418 and 1782. 1782 Calculate the highest common divisor of 3002 and 178714. 38 What is the greatest common divisor of 26078382 and 2442? 66 What is the greatest common divisor of 555230 and 3042? 26 Calculate the greatest common factor of 2522 and 26706719. 1261 What is the highest common divisor of 52151 and 913792? 121 What is the greatest common factor of 212 and 3071191? 53 Calculate the greatest common divisor of 4635 and 669015. 45 Calculate the highest common factor of 7339078 and 102232. 1966 Calculate the greatest common factor of 41070966 and 24. 6 Calculate the greatest common factor of 883462 and 700150. 2546 Calculate the greatest common divisor of 2751 and 53850432. 393 What is the highest common divisor of 26848 and 4248160? 32 What is the greatest common divisor of 117657 and 102? 51 Calculate the greatest common divisor of 192821440 and 1180. 1180 What is the highest common divisor of 82189489 and 9852? 821 Calculate the greatest common divisor of 42 and 141145242. 42 What is the greatest common divisor of 1528 and 970064552? 1528 Calculate the highest common factor of 7803055 and 65. 65 Calculate the greatest common divisor of 404 and 36730670. 202 Calculate the greatest common divisor of 369630 and 346653. 999 What is the greatest common factor of 371065563 and 3663? 3663 Calculate the highest common divisor of 93619 and 1649. 17 What is the highest common divisor of 742 and 37058686? 14 Calculate the highest common divisor of 130836887 and 61. 61 What is the highest common factor of 54520 and 11992? 8 What is the highest common factor of 2890204 and 51? 17 What is the highest common factor of 136 and 73946974? 34 What is the greatest common factor of 6185914 and 2478? 826 What is the highest common factor of 5619369 and 735? 147 What is the highest common factor of 225127505 and 1055? 1055 What is the greatest common factor of 1768 and 4606303? 221 What is the greatest common divisor of 2358944 and 412? 4 Calculate the highest common divisor of 809627 and 118531. 2009 What is the highest common divisor of 607104848 and 112? 112 What is the highest common factor of 43762422 and 227? 227 Calculate the highest common divisor of 90190119 and 41. 41 Calculate the highest common factor of 9718918 and 5225. 209 Calculate the highest common factor of 1 and 26749870. 1 Calculate the greatest common factor of 48749 and 13980877. 1681 What is the greatest common divisor of 272 and 85531964? 68 What is the greatest common factor of 9956 and 40892180? 76 What is the greatest common divisor of 2583 and 6512030? 287 What is the highest common divisor of 1163351 and 2401? 7 What is the greatest common divisor of 63 and 3404982? 21 Calculate the greatest common factor of 1139 and 709798. 67 Calculate the greatest common factor of 2485 and 144865. 35 What is the greatest common divisor of 1158012 and 824562? 342 What is the greatest common factor of 21942272 and 640? 128 What is the highest common factor of 32912 and 6671344? 272 What is the highest common factor of 424440 and 202919? 131 Calculate the highest common divisor of 2847 and 92279811. 2847 What is the highest common factor of 264 and 1413896? 88 Calculate the greatest common divisor of 6591088 and 3430. 686 What is the greatest common divisor of 83166 and 2396874? 498 What is the highest common divisor of 74806196 and 580? 116 Calculate the highest common factor of 3416184 and 19584. 1224 What is the greatest common factor of 592528 and 63104? 464 Calculate the highest common factor of 12471 and 476346473. 4157 Calculate the greatest common divisor of 918 and 18231615. 27 Calculate the greatest common divisor of 32143692 and 84. 84 What is the highest common divisor of 400680939 and 408? 51 What is the highest common factor of 12 and 377318136? 12 Calculate the highest common divisor of 312 and 29216967. 39 What is the greatest common factor of 6776 and 1098196? 484 Calculate the highest common factor of 102191535 and 360. 45 Calculate the greatest common divisor of 937552 and 19712. 1232 What is the highest common divisor of 1659359400 and 5878? 5878 What is the highest common factor of 35904 and 1044384? 1056 What is the greatest common factor of 2157572 and 5389? 17 Calculate the highest common divisor of 75458 and 320392. 58 What is the highest common divisor of 36 and 151116? 12 What is the greatest common factor of 36181 and 41710? 97 What is the greatest common factor of 3120 and 19575920? 1040 What is the highest common factor of 60 and 166531200? 60 What is the greatest common divisor of 12936 and 22220814? 3234 What is the greatest common divisor of 108968 and 13364? 1028 Calculate the greatest common divisor of 7335468 and 2325. 93 Calculate the highest common divisor of 224025 and 102525. 75 Calculate the highest common factor of 20951967 and 3054. 1527 Calculate the greatest common divisor of 1132 and 15214. 2 Calculate the highest common divisor of 2229 and 19527. 3 Calculate the greatest common factor of 608 and 7797448. 152 What is the highest common divisor of 266 and 68626138? 266 What is the greatest common factor of 1597791375 and 45? 45 Calculate the greatest common divisor of 397000 and 125452. 1588 Calculate the greatest common divisor of 29771292 and 108. 12 Calculate the highest common factor of 1250 and 58666250. 1250 What is the greatest common factor of 17748 and 79060931? 493 Calculate the greatest common divisor of 44137 and 2071. 19 Calculate the greatest common divisor of 183415794 and 53659. 2333 Calculate the greatest common factor of 13922 and 259025771. 6961 What is the highest common factor of 738 and 108013926? 246 What is the greatest common divisor of 5531 and 53761320? 5531 Calculate the highest common factor of 23536 and 292624. 16 What is the highest common divisor of 109664 and 401304? 184 Calculate the highest common factor of 424 and 178046186. 106 What is the greatest common factor of 15424 and 46784? 64 Calculate the greatest common factor of 5277323 and 394064. 2239 What is the highest common divisor of 44344694 and 186? 62 What is the highest common divisor of 2205972 and 116928? 1044 What is the greatest common divisor o	{ "pile_set_name": "DM Mathematics" }
g - 12, 3v + g + 4g - 12 = 0. Let x(o) = 2676o - 5 + 1 - 2678o + 23. Give x(v). 1 Let j(m) be the third derivative of m6/120 - m5/40 + 17m*4/24 + 24m*2 + 1. Let g(n) be the second derivative of j(n). Determine g(2). 9 Suppose 6 = -2i + 8. Let y be -2(1 + 3/(-2)). Let k(b) = -1 - b - y + 3 + i. Calculate k(5). -3 Let z = 2658 - 2666. Let i(d) = -4d - 28. Calculate i(z). 4 Suppose 0 = 3n - 40 - 5. Let k(s) = -s + 13. Let v be k(n). Let h(l) be the third derivative of -l5/60 - l4/24 - 3l*2 + 8. What is h(v)? -2 Let j(s) = 12s - 6s + 4s - 6s + 11 + 7. Calculate j(4). 34 Let l(o) = o3 - 6o*2 - 5o - 8. Let v(i) be the third derivative of 7i6/120 - i4/24 + 5i*3/6 + 19i*2. Let f be v(2). Let z = f + -52. What is l(z)? 6 Let l(j) = -3j*3 + 7j*2 - 3j + 2. Let h(a) = 10a3 - 21a*2 + 8a - 5. Let k(t) = 2h(t) + 7l(t). Let q = -287 - -293. What is k(q)? 10 Let z(l) = l*2 + l + 4. Let u be 2/(16/(-12))(-8)/3. Suppose -3o + 16 = o - uf, 5o + 5f = 0. Suppose 4 = oi + 10. Give z(i). 10 Let k(g) be the first derivative of -4/3g*3 - 85 - 5g - 3g2 + 1/4g*4. Give k(5). -10 Suppose 101u = -100u + 56u + 290. Let c(d) = d*3 - 9d*2 + 8d + 3. Determine c(u). -9 Let h be 522/5 + 162/270. Let k(c) = -hc - 6 + 52c + 54c. Let q = -14 - -20. Calculate k(q). 0 Let j(i) = 4i*3 - 2i*3 - 4i + 2 - 38391i2 + 38381i*2. Calculate j(5). -18 Suppose -9323 - 1107 = -35b. Let n(r) = -298 + r + 583 - b. Determine n(7). -6 Let c(f) = -6f2 + 4f2 - f3 + 3f2 + 2. Let v = -2318 + 1382. Let m = 936 + v. Calculate c(m). 2 Suppose 5m + z - 2z - 472 = 0, 0 = -4m + 3z + 371. Let a = -101 + m. Let p(b) = -5b - 6 + b - b*2 - 4b. What is p(a)? 6 Suppose -201y = -398y + 209y - 84. Let j(a) = -a3 + 7a*2 - 3a + 3. Give j(y). -18 Let l(r) = -64r2 - 124r - 126. Let u(f) = -54f2 - 126f - 126. Let k(j) = -5l(j) + 6u(j). Determine k(-33). 6 Let g(u) = u*3 + 16u*2 + 30u + 22. Let o(p) = 3p3 + 48p*2 + 90p + 67. Let a(r) = 10g(r) - 3o(r). Give a(-14). -9 Let w(d) = -122d2 + 10d - 15. Let j(x) = 14x2 - x + 1. Let z(o) = 18j(o) + 2w(o). Give z(-4). 108 Let i(w) be the second derivative of -5w*3/3 + 133w*2 + 3978w - 1. Determine i(27). -4 Let g(l) be the first derivative of -1/3l3 + 0l*2 + 2l + 62. Calculate g(2). -2 Let m be 49((-4)/(-8))/(6/12). Let g = 55 - m. Let n(z) = -2z + 3. Give n(g). -9 Let n = -61 + 55. Let b(t) = -2t2 - 11t + 8. Let s be b(n). Let d(p) = -p3 - p2 + 5p + 2. Let h be d(s). Let k(o) = -o - 1. Calculate k(h). -1 Let r(v) = -10v - 374 - 382 + 1160 - 375 + v*2. Determine r(17). 148 Suppose a + 1450 = -3c + 4c, 3c - 4345 = 4a. Let m = -1453 + c. Let i(t) = -1 + 2t - 3t - 5t. Determine i(m). -13 Let h(q) = 11q - 17. Let f(t) = 2t - 6. Let u(x) = -3f(x) + h(x). Let g be ((-3)/6)/(3/(-30)). Calculate u(g). 26 Let k(f) = -f3 - 2f*2 + 3f + 2. Suppose 0 = -3s + 2s + 3. Suppose -r = 4r - p - 9, -sr - 2p = 5. Suppose 14 = -5j - r. Determine k(j). 2 Suppose 0 = 3o - 5h + 40, 3o = 3h - 6h. Let u(g) = -3g + 35. Let n(x) = 25x - 355. Let j(m) = -n(m) - 10u(m). Determine j(o). -20 Let t(y) = 22y2 - 16y - 8. Let v(p) = -19p2 + 13p + 7. Let c(r) = 6t(r) + 7v(r). Give c(0). 1 Let c(o) = -5o2 + 96o - 25. Let x(b) = -b*2 - 426b - 2501. Let r be x(-6). Calculate c(r). -6 Let l(g) = 11g2 - g. Let d be 5/5(-1 - (53 - 0)). Let x be d/(-189)(-7)/(-2). Determine l(x). 10 Let d(u) be the second derivative of -u3/6 + 4u*2 - 8u. Let h be d(-3). Let t(s) = -9s - 2s*2 - 1 - 2s2 + s2 + hs. Give t(1). -2 Suppose -89 + 1688 - 74 = 305l. Let f(t) = -t*3 + 4t*2 - 11t + 83. Give f(l). 3 Suppose 3d = -9d + 240. Let u = 18 - d. Let w(a) = -a - 4. Determine w(u). -2 Let u(f) = 7f3 + 2f*2 + 9f - 3. Let b(a) = -3a3 - a2 - 5a + 2. Let y(z) = 5b(z) + 3u(z). Suppose 176o - 175o + 2q = 7, 3q = 12. What is y(o)? -6 Suppose -47d = -48d - 17. Let r(p) = -8p - 8. Let x(a) = 3a + 3. Let c(t) = dx(t) - 6r(t). Calculate c(-7). 18 Suppose 0 = 1250b - 1246b - 24. Let h(p) = -18p + 6p - b + p*2 + p + 3p. Suppose 0 = 2d - 7 - 11. Determine h(d). 3 Let z(l) = 42l*3 + 3l + 10 - 6l2 - 44l3 - l2 + 2l - l. Calculate z(-5). 65 Let g be (-990)/275(-20)/18. Let y(v) be the third derivative of 0 + 2/3v3 + 1/8v*g + 18v*2 - 1/60v*5 + 0v. Determine y(3). 4 Let y(j) = -1. Let w(t) = t*3 - 4t*2 - t + 4. Let a(p) = w(p) + y(p). Let h be (15 + -20)/((-2)/154). Let q = h - 381. Calculate a(q). -1 Let l(v) = -v + 1 - 5v + 0v. Suppose 5c - 15c - 2310 = 0. Let p = c + 229. What is l(p)? 13 Let s(w) = 0w + w - 5w - w2 + 6. Let i(p) = -3p*2 + 32p + 15. Let n be i(11). Suppose 9v - 2a + 8 = 7v, -nv + 5a = 14. What is s(v)? -6 Let x(j) = j3 - 4j*2 - 16j + 31. Let c be (-260)/(-45) + (6/(-33))/(36/(-44)). Calculate x(c). 7 Let u(n) be the third derivative of 2n - 34n*2 + 0 - 1/24n*4 - 5/6n3. What is u(4)? -9 Let c(a) be the first derivative of a3/3 - 4a2 + 13a - 3. Let p(x) = x*2 - 28x + 141. Let w be p(6). Give c(w). 22 Let u(t) = 4 - 2t2 + 5 - 3 + 16t + t2 + 0. Calculate u(16). 6 Let a(d) be the second derivative of d3/6 - 5d2/2 - 178d - 18. Determine a(-2). -7 Let i(b) be the first derivative of -5b2/2 + 3b + 2. Let p(w) = -24w + 12. Let g(r) = 14i(r) - 3p(r). Give g(-4). -2 Let b(u) = 9u + 3. Let z(m) = -5m - 2. Let x(i) = -3b(i) - 5z(i). Suppose 2a = -1668s + 1673s + 30, -2s - 33 = -5a. What is x(a)? -9 Let j(l) = -8l2 + 3l - 12. Let r(f) = -33f2 + 13f - 52. Let p(s) = 9j(s) - 2r(s). Calculate p(-3). -61 Let a = 188 + -172. Let x(p) = -3 + 14p + ap - 29p + 4. Let g = 1 - 0. Give x(g). 2 Let w(h) = -137h + 278. Let m(k) = -45k + 84. Let r(c) = -13m(c) + 4w(c). Determine r(0). 20 Let j(z) = -12z - 172. Let m(d) = -8d - 102. Let p(v) = -5j(v) + 8m(v). Give p(9). 8 Let a(k) = 6k*2 - 48k - 81. Let v(l) = 7l2 - 53l - 91. Let q(w) = 8a(w) - 7v(w). Calculate q(-5). 29 Let a be 14/(-6)(240/35)/(-8). Suppose 3p = -t + 19, -5t + 14 - 45 = -3p. Let w(d) = 1 - d*2 + pd - a - 4. Give w(4). 7 Let c(u) = -5u + 1. Suppose 165n = 189n + 192. Determine c(n). 41 Let w(i) be the second derivative of i5/20 - i4/3 - i3 + 3i*2 - i. Let o be (-10)/315288/(-245). Let v = o - 203. What is w(v)? 1 Let c be (-9)/(4 + 68/(-20)). Let y(r) = 2r + 22. What is y(c)? -8 Suppose -359 = -8t - 311. Let b(f) = -217f + 109f + 3 + 3 + 109f. What is b(t)? 12 Suppose -s + 28 = 2p, 128s - 132s = -16. Let u(x) = -x*3 + 11x*2 + 13x - 11. Determine u(p). 1 Let l(y) = -24y - 268 + 370 - 67. What is l(2)? -13 Let g(p) = -p3 - 35p*2 - 68p - 67. Let s = -7128 + 7095. Give g(s). -1 Suppose -2v - 2w = 2, -14 = -3v + 5v - 2w. Let c(k) be the third derivative of -k6/120 - k5/12 + 5k*4/24 + 2k*3/3 - 15k*2. Give c(v). -32 Let g(h) = 66h*2 + 4h - 20 + 13h + 56h*2 - 185h*2 + 65h*2. Give g(-10). 10 Let h(a) be the first derivative of 25a - 109. Let f(v) = -v - 30. Let r(c) = -2f(c) - 3h(c). Give r(7). -1 Let a(u) = 3u3 + 2u - 1. Let o be (20/(-2))/(-11 + 2 - -7). Suppose -5z - 3c = -25, 0 = -0c - oc - 25. Suppose 6h + z - 14 = 0. Give a(h). 4 Suppose -3n - 19 - 9 = q, 2q = -8. Let m(b) be the first derivative of -b3/3 - 5b*2 - 2b + 83086. What is m(n)? 14 Let m(u) be the second derivative of u5/60 + u4/8 - 7u3/6 - 9u*2 + 69u. Let j(a) be the first derivative of m(a). Give j(-6). 11 Let x(v) = -v - 1. Let z = 69 + -49. Suppose 5n = -c - z, -4n + 5n = 5c - 4. Suppose 5b - 5o = 0, -2b - 3o - o + 24 = c. Calculate x(b). -5 Let q(i) = i*3 - 10i*2 + 10i + 8. Let y(p) be the second derivative of -p*5/10 + 5p*4/6 + 17p*3/6 - 21p*2/2 + 31p. Let m be y(6). What is q(m)? 17 Let b = -12 + 16. Suppose 0 = 2i - bi. Let a(v) = -24v + 0v*2 + 62v - 6 - 22v - 15v - v*2. Determine a(i). -6 Let f(j) = j - 6. Suppose 0 = 16n - 15n - 9. Let a be f(n). Let v(r) = -r2 - r + 2. Calculate v(a). -10 Let i(c) be the third derivative of c4/24 + c3/2 - c*2 - 110. Let g = -10 + 10. Calculate i(g). 3 Let x be (10 - -3) + -79 + 63. Let f(i)	{ "pile_set_name": "DM Mathematics" }
-18n4 Let j(n) = -n2. Let r(l) = 2l + 3 + 1 + 3 + 0. Give r(j(u)). -2u2 + 7 Let g(r) = 15r. Let v(w) = 14w2 + 6w + 6. Let a(t) = 12t2 + 5t + 5. Let y(k) = -6a(k) + 5v(k). Calculate y(g(h)). -450h2 Let u(x) = -86x - 352. Let c(q) = 4q2. Calculate c(u(f)). 29584f*2 + 242176f + 495616 Let v(k) = 8k2 + 3k + 3. Let d(n) = 8n2 + 4n + 4. Let s be -2 + (7 - (1 + 1)). Let q(u) = sd(u) - 4v(u). Let o(h) = -h*2. Calculate q(o(g)). -8g*4 Let v(u) = 4u - 712. Let w(d) = 394d. Give w(v(x)). 1576x - 280528 Let p(i) be the second derivative of 2i - 18i - 6i + i4. Let x(k) = k. What is x(p(g))? 12g*2 Let n(s) = 240312s*2. Let i(d) = 2d. Determine n(i(f)). 961248f2 Let g(c) = -40c + 114c - 40c - 39c. Let n be 4(2/(-4) - -1). Let j(d) = -nd + 2d - d. What is j(g(t))? 5t Let o(i) be the third derivative of i7/1260 - i4/12 - 2i*2. Let x(c) be the second derivative of o(c). Let m(f) = 8f*2. Determine x(m(v)). 128v*4 Let j(z) = 75z. Let t(q) = -603q. Give t(j(w)). -45225w Let x(j) = -j. Let v(q) = 3565q + 217. Let u(m) = -99m - 6. Let w(s) = -217u(s) - 6v(s). Give x(w(y)). -93y Let b(q) = 2q. Let l(o) = 3o. Let w(h) = 6b(h) - 5l(h). Suppose -3d = -2t + 6t - 35, -44 = -3d + 5t. Let k(a) = d + a*2 - 13. Calculate w(k(m)). -3m*2 Suppose -3w = -p - 3 - 10, 0 = 4w + 4p + 4. Let q(h) = 3h - 3h - wh. Let m(a) = 1. Let k(i) = 5i*2 - 3. Let u(c) = k(c) + 3m(c). Determine u(q(d)). 45d2 Let l(y) = 16y*2 + 14744y. Let f(j) = j. What is l(f(a))? 16a2 + 14744a Let i(k) = k*2. Let m(c) = 21c - 23. Let v be m(2). Let o(d) = -vd2 - 5 + 5 - 37d*2. What is o(i(f))? -56f4 Let o(a) be the second derivative of a3/6 + 7a - 13. Let t(n) be the third derivative of 0n*3 + 0n + 0 + n*2 - 11/24n*4. Give o(t(w)). -11w Let i(z) = 8z - 5. Let k(j) = -8j + 4. Let v(o) = 4i(o) + 5k(o). Let q(b) = 6b2. Give q(v(g)). 384g2 Let z(h) be the third derivative of h4/6 + 17h2 - 2. Let q(u) = -2u + 2u2 + 4u - 2u. Determine z(q(k)). 8k*2 Suppose 3i - 2j = 4i - 48, 0 = -4i + 4j + 144. Suppose 0 = 12m - 7m - i. Let q(s) = -s*2 - m + 8. Let g(p) = -3p*2. Calculate q(g(n)). -9n4 Let x(s) = -s2. Suppose 5y + 4a = 339, 2a = -1 + 3. Let v = y - 40. Let l(h) = -v + 60 + 4h*2 - 33. Determine x(l(z)). -16z*4 Suppose -2q + 273 = 11q. Let w(k) = -8 + 3k*2 + q - 13. Let j(d) = 3 - 3 - 2d*2. Give j(w(v)). -18v*4 Let p(v) = -14v*2. Let r(d) be the third derivative of 3d*4/8 + 132d*2. Determine r(p(c)). -126c*2 Let w(c) be the second derivative of -19c*4/12 - 5c + 3. Let v(s) be the second derivative of -s*3/3 - 5s. Determine w(v(x)). -76x2 Let f(i) = -1430i*2. Let o(m) = 11m. What is o(f(k))? -15730k2 Let v(f) = 3f*2. Let u be 2/((-2 + 0)/(-18)6). Let q(s) = 0s2 + us*2 + 7s*2 - 8s*2. Determine v(q(p)). 12p*4 Let w(h) = -1 - 3h*2 + 1. Suppose 2 = -3m + 4m, 10 = -z + 4m. Let v(a) = 22a - 7. Let j(x) = 7x - 2. Let b(k) = zv(k) + 7j(k). Calculate w(b(n)). -75n2 Let v(g) = -297954g. Let f(u) = -u*2. What is v(f(j))? 297954j*2 Let r(t) = -1479t + 68. Let h(u) = 8u. Calculate r(h(f)). -11832f + 68 Let y(b) = 7 - 7 - 2b. Let k(l) = 1. Let r(g) = 2g*2 + 5. Let c(s) = -10k(s) + 2r(s). Determine c(y(o)). 16o*2 Let g(p) = -2p*2 - 14. Let f(r) = -r - 393. Give f(g(v)). 2v*2 - 379 Let l(b) = 3b*2 - 2. Let t(s) = -2s*2 - 88. What is l(t(c))? 12c*4 + 1056c*2 + 23230 Let g(t) = -24t*2 - 39 + 39 + 12t*2. Let s(o) = 3o. Calculate s(g(c)). -36c2 Let k(u) = -7u*2. Let c(m) = 10651m*2. Determine k(c(q)). -794106607q4 Let o(n) be the third derivative of -n5/60 - 14n3/3 + 2n*2 - 2. Let f(v) = 2v. Calculate f(o(u)). -2u2 - 56 Let t(m) = -2m. Let l(q) = 16q2 - 37q*2 + 22q*2 + 4q - 15q. Determine l(t(j)). 4j*2 + 22j Let f(o) = 3o. Let s(m) = 18m - 5. Let c(h) = -9h + 2. Let b(p) = 5c(p) + 2s(p). Let u(w) = -13w. Let q(v) = 7b(v) - 5u(v). Determine f(q(n)). 6n Let z(f) = -53f*2 + 93f*2 - 27f*2. Let o(c) = -5c. Give z(o(a)). 325a2 Let k(u) = 4u3 - u2 + 4u - 4. Let n be k(1). Let p(c) = 12c*2 - nc*2 - 4c*2. Let g(q) = 7q. Determine g(p(h)). 35h2 Let r(j) = -515j. Let d(k) = -3k2 + 3. What is r(d(w))? 1545w*2 - 1545 Let c(r) = 6r. Let q(y) = 16y + 11. Let s(p) = 4p + 3. Let j(l) = -6q(l) + 22s(l). Determine c(j(a)). -48a Let w(v) = -185v. Let h(s) = -s - 1. Let g(m) = 5m + 6. Let q(o) = -g(o) - 6h(o). What is w(q(x))? -185x Let d(s) be the second derivative of 0 + 0s*2 - 10/3s*3 + 5s. Let o(x) = -x. Determine d(o(a)). 20a Let j(v) = -14v. Let z(q) = -24q2 + 110q - 110q. Let d(g) = -5g*2. Let b(r) = 11d(r) - 2z(r). What is b(j(f))? -1372f*2 Let w(q) = 3q*2 - 1537q - 35. Let p(a) = 2a. Give w(p(s)). 12s*2 - 3074s - 35 Let w(y) = -y - 2. Let f be w(-6). Let u(q) = q + 5. Let s(h) = -5 - 1 + 4 + 0. Let j(c) = fu(c) + 10s(c). Let r(p) = 2p2. What is j(r(n))? 8n*2 Let k(l) = -278l2. Let g(d) be the third derivative of d5/60 + 681d2. Give g(k(m)). 77284m*4 Let p(n) = -3n2. Let u be 0/(-2 + 2 - -3). Let v(h) = h3 + 8h2 + 6h - 2. Let i be v(-7). Let o(g) = ug - ig + 6g. What is p(o(r))? -3r2 Let n(h) be the third derivative of h5/30 - 7h2 + 8. Let t(r) = r2. Calculate n(t(f)). 2f*4 Let l(i) = i. Let a(d) = -58d*2 - 7. Let q(o) = -19o*2 - 2. Let s(c) = -4a(c) + 14q(c). Calculate l(s(h)). -34h*2 Let n(b) = 2b*2. Let a(i) = -17663i. Calculate a(n(q)). -35326q2 Let g(t) = 14t*2. Let w(x) = 2x*2 + 26x + 52. Let f(i) = 3i + 6. Let c(q) = 52f(q) - 6w(q). Calculate c(g(r)). -2352r*4 Let l = 93 - 91. Let h(i) = -6i*2 - 5i*l - 6i*2 + 5i*2. Let b(t) = -4t*2. What is h(b(y))? -192y*4 Let m(a) = 5a. Let f(t) = -6t - 5t + t2 - 8 - 2. Let s be f(12). Let g(u) = us + 9u2 - 2u*2 - 4u*2. What is m(g(h))? 20h*2 Let d(p) = 34p. Let t(w) = 18w2 - 24w - 3. Let j(o) = 53o2 - 64o - 8. Let c(g) = -3j(g) + 8t(g). Give d(c(y)). -510y2 Let g(a) = a - 1. Let y(c) = -6c + 5. Let w(h) = 12h - 10. Let n(r) = -2w(r) - 5y(r). Let t(p) = 10g(p) - 2n(p). Let o(i) = -80i. Determine o(t(z)). 160z Let i(b) be the first derivative of 3b*2/2 + 1046. Let m(c) = -2 - 10c + 2. What is i(m(w))? -30w Let z(k) = 4k. Let a(g) = 9g + 22. Let q(l) = 8l + 22. Let u(p) = 5a(p) - 6q(p). Give z(u(v)). -12v - 88 Let x(k) = -15k*2. Let g(t) = t - 1. Let d(c) = -4c + 3. Let v(l) = l*3 + 5l*2 + 2l + 7. Let i be v(-5). Let a(n) = ig(n) - d(n). Calculate a(x(z)). -15z*2 Let b = 37 + -25. Suppose -2u = -4l + 4, -2u - 4l + 0l + b = 0. Let x(p) = 4p2 - p - 3pu + p. Let w(j) = -j2. Give w(x(m)). -m*4 Let m(o) = -6o2. Let k(f) = f2 + 13f + 26. Let u be k(-11). Suppose -2t + 16 = uv, 0 = 3v - 8v - 5t + 30. Let s(w) = 3 - 5 + vw + 2. Give m(s(h)). -24h*2 Let g(m) = m - 1599. Let q(v) = -34v*2 - 5. Calculate g(q(h)). -34h*2 - 1604 Let u(p) = 209p - 76. Let g(n) = 16n - 6. Let a(v) = -38g(v) + 3u(v). Let q(m) = m2. Calculate a(q(k)). 19k*2 Let w(p) be the second derivative of 53p*4/12 - 5p - 28. Let g(r) = 2r2. Calculate g(w(s)). 5618s*4 Let r(v) = -2v*2. Let x(o) be the first derivative of -8o*3 + o - 363. Calculate x(r(u)). -96u*4 + 1 Let x(b) = -b. Let t(a) = -14a*2. Let c be (-6)/(-9)4/((-16)/18). Let s(k) = 407k2. Let w(y) = cs(y) - 88t(y). What is w(x(f))? 11f*2 Let k(b) = -21b. Let h(x) be the third derivative of 13x4/24 - 236x*2. Give h(k(y)). -273y Suppose -5q + 6q = 0. Let g(y) = y2 + y2 + qy2. Let r(i) = -i. Determine g(r(w)). 2w*2 Let s(d) = 5d. Let i(q) be the second derivative of 2q3/3 + 7q*2/2 + 8q. Let l(k) = -3k - 5. Let w(a) = -5i(a) - 7l(a). What is w(s(h))? 5h Let k(s) = -1124789s. Let g(f) = -2f*2. Give g(k(u)). -2530300589042u*2 Let t(p) = 2p*2 + 7 - 7. Let m(u) = 2u - 15 - 8u + 2u - 5 + 22. Determine m(t(l)). -8l2 + 2 Let l(x) = 49x*2 + 288. Let q(r) = -2r. Calculate l(q(z)). 196z2 + 288 Let t(d) = 4d*2 + 1400d + 14. Let m(o) = 2o2 + 699o + 6. Let x(k) = 7m(k) - 3t(k). Let y(p) =	{ "pile_set_name": "DM Mathematics" }
, 5t + 3 = -5q - i for t. 0 Suppose 0 = 32z - 37z + 25. Solve -l = -g - 4, 0g - 20 = -zl + g for l. 4 Let p = 0 - -4. Suppose -pi + 9 = 1. Solve 3c + 9 = 4o, 2c - 6o = -io - 6 for c. -3 Suppose 2p - 4 = -0p, -y = -3p + 6. Solve -4d - m - 22 = -3m, y = d - 2m + 7 for d. -5 Suppose 3x + 3 = -3t - 9, -4t - x - 4 = 0. Solve -4r + 5l + 11 = t, 4l = -3r - 7 - 8 for r. -1 Let g(f) = 4f + 2 + 1 + 0 + f*2. Let x be g(-4). Solve 6v = -2c + v - 25, -xc + 3v + 15 = 0 for c. 0 Let o(n) = -n2 + 7n + 10. Let m = -4 + 12. Let y be o(m). Solve -5b + 17 + y = q, 2b - 4q + 10 = 0 for b. 3 Let j = 1 - 1. Suppose 3b + jb - 9 = 0. Solve n + by = -0y - 6, 2n - 6 = 3y for n. 0 Suppose 12 + 3 = 5f. Suppose fk = -5r - 37, 4 = -3r + 2k - 3. Let j = -3 - r. Solve ji - 2s + 10 = 0, 3 - 1 = -4i - 2s for i. -2 Let z(h) = -h*2 + 10h - 10. Let i be z(8). Let q be i/(-2 - (-23)/10). Let b = -2 + 2. Solve b = 5o - 5y + q, -15 = -o - 4o - 2y for o. 1 Suppose 9i = 4i + 20. Suppose -2b + 4g - 4 = 0, 0 = ib - g - 0g - 20. Solve -2l = 4, 5q - b = -l - 28 for q. -4 Let b(c) = -4c. Let s be b(-1). Let h = 1 - 3. Let g be h/(-6) + (-3)/9. Solve 4r + v = -4v, g = sr - v for r. 0 Let s be 6 + ((-6)/3 - (4 - 2)). Solve 0 = 3g - si + 4, 2g - 1 = -3i + 5 for g. 0 Let q = 39 - 24. Suppose 2d + 3d = q. Let c(x) = x*2 - 3x - 2. Let o be c(4). Solve u + d = 2w, -3w + ow - 21 = 4u for w. -1 Let j(s) = 2s2 - s. Let i be j(1). Let f be i + (-2 - -1) - -2. Solve 4q = z - fz + 4, 5z = -2q + 20 for q. 0 Let a = -7 + 11. Let r = a - -6. Solve r = c - 2u, 0c + 2c = -3u - 15 for c. 0 Let y be 2/4(10 + 0 + 0). Solve -3f - 4l = -32 + 10, 4f - yl + 12 = 0 for f. 2 Let f(t) = t*3 + 7t*2 - t - 5. Let r be f(-7). Solve 0 = -y - 2i, 0 = -5y + 6i - ri - 14 for y. -2 Suppose 0 = 2g + 4g. Suppose 2s = -2r + 16, 2s - 3s = 3r - 14. Solve -rb - 4v - 10 - 5 = g, 25 = -5b - 4v for b. -5 Let w = 17 + -9. Solve y - 3g + 4 = -2g, 2y + 5g = -w for y. -4 Suppose 36 = 4u + 3v, -3u + 4 = -v - 10. Let p be 1095/35 + u/(-21). Solve -q - 8 = -b, p = 5b - 3q - 3 for b. 5 Let v = 24 + 2. Suppose 2c = -2, c = -3h + 36 + v. Solve -2m - m = -3d + 27, -4d + m = -h for d. 4 Let x = -15 - -27. Let h = 22 - x. Solve 6 = 3r, 2g + 3r - h = g for g. 4 Let k be 266/18 - 1 - (-2)/9. Solve h = 3w + k, 4w + 14 = 5h + 3w for h. 2 Suppose -2k + 2 = -k. Let x be k/(-3) - 64/(-6). Solve -2w - 2s = -x, -s - 4s = w - 9 for w. 4 Suppose 7 = -4g - 5u, g + 9 = -2g - 5u. Solve 3r + 3s = 12, -gr - 13 = -4s + 9 for r. -1 Suppose 0 = 2v + 2k + 2, 0v = 2v - 3k + 12. Suppose -3o + o = -10. Let p = v + o. Solve 2i = -pr + 11 - 3, -3 = 3r for i. 5 Suppose 4d - 2g = 28, d - 3d - g = -6. Suppose -k + 5 + 2 = -dv, 0 = -5k - v + 61. Let y be -8(-4)/(-8)-1. Solve -j - 6 = -4j, -s = -yj + k for s. -4 Suppose 0 = 5i - 30 + 5. Let q = 54 + -31. Solve -4s = -0s - v - 19, -is + q = -v for s. 4 Suppose -17 - 11 = -4j. Let x(z) = -z*3 + 8z*2 - 8z + 7. Let h be x(j). Suppose h = 3l - 111 + 30. Solve -4w = -3f - 11, -5f - w - l = w for f. -5 Suppose 2v + 9 = 5v. Suppose -3d - 2y = 4, 5d = -0d + vy + 25. Solve -3z + 2q = -14, -2z + q = -dq - 11 for z. 4 Suppose 32 = 3d - 5w, 41 = -2d + 6d - 5w. Let a = -5 + d. Solve 3r + 12 = -y + ay, 5r = -3y + 12 for r. 0 Let a(q) = 5 + q2 + q2 - q*2 - 2q - 3q. Let l be a(5). Solve -2i + 41 = 2i + 5p, 10 = li - 2p for i. 4 Let c(b) = b*2 - b - 7. Let u be c(4). Solve 5i + ug = 0, 4i - 2i - 15 = -5g for i. -5 Let n be 213/9 + -1. Solve 4k = 2b + nk + 2, 3k = 3b + 9 for b. -2 Let t = 24 + -24. Solve 2z - 3f + 20 = t, 2z + f + 3f = 8 for z. -4 Let k be (2 + 0)(-10)/(-4). Solve -4d - 9 = kp, p - 5d = -3p - 40 for p. -5 Suppose 5o - 20 = 0, -4l + 5o = 5 + 7. Solve 5w = 0, -m + 0 = lw - 1 for m. 1 Let p = -13 - -21. Solve 5x + p = x, 3x + 6 = -t for t. 0 Suppose 5n = n + 20. Suppose ni = 7i - 22. Solve -1 - 6 = p + 5y, -3p + i = -y for p. 3 Let t = -3 + 5. Let u be 1 - (t-1 + 1). Solve 4a - 16 = -0a, -4a = uw - 26 for w. 5 Let j(v) = -v*3 + 15v*2 - 13v - 4. Let m be j(14). Solve d + m = 2w, -12 = -3w + d + 1 for w. 3 Suppose -2n + 28 = -6n. Let r be -3 + 5 - 5 - n. Solve -3q - 4 + 16 = 0, -rb + 4 = -q for b. 2 Let m(k) = -k3 - k2 + 5k + 2. Let n be m(-3). Solve 0 = -5d + 25, -13 - 12 = nt - 3d for t. -2 Let a be (0 - -1)/1 + 1. Let n = -654 + 659. Solve 3l + 3 = g + g, -al = -ng - 9 for l. -3 Suppose 0 = 2h - 3h - 3r + 12, -5h + 4 = r. Solve -c + 16 = -3f, 2c - 5f - 27 = -h for c. 1 Let u(f) = 10f + 4. Let q be u(2). Solve 6h = 2h - 3k + q, 4h + 5k - 32 = 0 for h. 3 Suppose -5j + 3w - 4w - 40 = 0, 3j + 22 = -w. Let a be (-1)/(-4) - (-17)/(-4). Let g be (a/(-3))/((-3)/j). Solve 5i - 7 = -2z + g, 16 = i + 5z for i. 1 Let v = 4 + -5. Let w be (v(-3 - -1))/2. Solve -5m + w - 4 = -2u, -4m - 7 = 3u for u. -1 Suppose 0 = -5x - 0x - 20, 4x + 20 = n. Suppose 2d - 10 = -n. Solve da = -2v + 1, 0 = 4v - v - 5a + 27 for v. -4 Let l = -13 + 15. Let c(k) = k*3 + 8k*2 + 4k - 9. Let o be c(-7). Solve -s + 16 = ls + 2p, -5s + 4p = -o for s. 4 Let v = -10 - -15. Suppose 0 = -j + v. Suppose g = 3g - 8. Solve gl - 2 = b, 0 + j = -l + 3b for l. 1 Suppose 3d = 4d - 4. Let k be 0/(3d/(-6)). Solve -2p = -5j - 23, k = j - p - 4p for j. -5 Let l(j) be the second derivative of 0 - 3/2j*3 - 6j*2 + 2j + 1/12j4. Let o be l(11). Solve -4q - o = -3q + 5m, -4m - 8 = 0 for q. 0 Let z = -18 + 17. Let r be z - -2 - (-1 + -3). Solve 2y = -rd - 6, 2y - 4d + 3d = -6 for y. -3 Suppose -q + g + 6 = 0, -q - 2g = -g + 2. Suppose qu - 3 = u. Let j(i) = -i3 + i2. Let t be j(0). Solve -4c + ul = -29, c - l - 8 = -tl for c. 5 Suppose q + 3o - 10 = -3, 4q - 5o - 11 = 0. Suppose -25 + 33 = 2j. Solve -a = -ja - 9, -qk = 4a + 24 for k. -3 Suppose 2k = -k + 21. Let n = k + -4. Solve -4t + 6 = -2a - 0, -9 = na - 5t for a. -3 Let s = 17 - 15. Suppose 3y - 3i + 5 = s, -i + 4 = 0. Solve 5o = 3a - 23, y = -5a + o - 3o for a. 1 Let h(r) = -11r - 28. Let y be h(-3). Let o be (0/1)/(0 - -1). Suppose 0 = -g + 3v - 3, 5g + 2v + 2v - 23 = o. Solve -4p = -gi + 4, 10 = yp + 30 for i. -4 Let b = 54 + -49. Solve -4v - 3t + 8 = 0, -bv + 23 = -t - 6 for v. 5 Suppose 9g - 8g - 4 = 0. Let o(c) = c - 2. Let r(m) = m - 1. Let l(k) = 2o(k) - 3r(k). Let h be l(-6). Solve 3d = 5s - 30, -gs + 28 = -hd - 3s for d. -5 Let k(r) = 4r + 1. Let y be k(3). Suppose 9 = -3q - 3, 3q + y = f. Solve -3 + f = 2i - s, -3s + 6 = -2i for i. 0 Let x(w) = 18w. Let a be x(-4). Let l be (a/(-32))/((-2)/(-32)). Solve -4n + l = -0r + 4r, 0 = 5n + 2r - 30 for n. 4 Suppose 9 = 3z - f, -f = 5z - 34 + 11. Solve 0 = -4i + 5x + z + 17, 21 = 5i - x for i. 4 Let u(g) = -g*3 + 12g*2 - 11g + 10. Let f be u(11). Solve 3 = 4s - 1, 4d = 2s + f for d. 3 Let b = 4 + -6. Let d = 6 + b. Solve f - 7 = -2h + 2f, dh + 3f = -11 for h. 1 Suppose 0 = -3h - 25 + 43. Solve 2m = -2u - 0 - h, 31 = 3u - 5m for u. 2 Let b be (0 + 1)(0 + 5). Suppose 3q = -q + bo + 37, 5o + 13 = -4q. Solve 20 = -qc - i + 6i, 4i = 5c + 29 for c. -5 Let b(h) = -h2 + h + 4. Suppose 3k = 3q - 9, 3q - 4k + 2k = 6. Let p be b(q). Solve 0 = pf - z + 8, -3z = -2f + 2 - 6 for f. -2 Suppose -5b + 30 = 5f - 0f, -3f = -6. Suppose 1 + 11 = bg. Solve 4z + gs + 5 = 0, z + 2z + 5s + 12 = 0 for z. 1 Let p = 6 - 3. Let f = -26 - -18. Let g be (p/(-2))/(3/f). Solve -w = 2x + x - 19, -x = gw - 21 for x. 5 Let j = 28 - 28. Solve j = 4t - 2q + 14, -2t - 1 = q - 0 for t. -2 Let a = -22 + 24. Solve 4i - 2q = -a, -2i = -0i + 3q - 11 for i. 1 Let q be 11/(-4 - -3) - 2. Let k = -7 - q. Solve 2n - 2w = -w - 9, 0 = -2w + k for n. -3 Let p be 2/(-6) - 344/(-24). Let w be (-140)/(-18) - p/(-63). Solve 2k = 2l - 8, -5k - 5 = 2l + w for k. -3 Suppose -4s + 45 = -9s. Let h = -7 - s. Suppose -hz = -0z. Solve zo - 3y + 19 = 2o, -y - 12 = -3o for o. 5 Let y(o) = -o. Let f(d) = 20d. Let x(b) = f(b) + 15y(b). Let q be x(2). Let g = -4 + 6. Solve -4k + q = 5*c	{ "pile_set_name": "DM Mathematics" }
wrt b. -48by*3 + 734y*3 What is the first derivative of 75370g*2x*3 + 2g*2x*2 + 1125g*2 - g wrt x? 226110g*2x*2 + 4g*2x What is the second derivative of -148044h2m - hm - 27h - m - 182 wrt h? -296088m What is the third derivative of -754b*2gm3 - b2gm - 29b*2m*2 - 7bgm + 27m3 + 22m*2 wrt m? -4524b*2g + 162 What is the first derivative of m*3q + 75696m3 + 124mq2 - 5q2 wrt q? m3 + 248mq - 10q Find the second derivative of -30791au2v*4 - au*2v + 2au*2 - 3auv*3 - 2auv - 1903au + 2av wrt v. -369492au*2v*2 - 18auv Find the second derivative of 2o3r*2 + 2o*3r + o*3 - 117991o*2r*2 - 5952o*2r - 2or*2 - 4or wrt r. 4o*3 - 235982o*2 - 4o Differentiate 966269f4 + 2114579. 3865076f*3 Find the third derivative of -2r*3t*3y + r*3 - 14r*2t*2 - 19709t*3y + 6t2y - 62y wrt t. -12r*3y - 118254y Find the first derivative of -996837my - 3643306y wrt m. -996837y Find the second derivative of 153301df2 - 204df + 4f*2i*3 + 37fi3 + 46f wrt f. 306602d + 8i*3 What is the third derivative of -5513c*3ny - 3c*3n + 2c3y - 3c3 + 80c*2ny - 50c*2n - 2y wrt c? -33078ny - 18n + 12y - 18 Differentiate 6dp2 + 43dx3 + 5d + p*2x*3 - 2338p*2x*2 - 2p*2x - 2px*2 wrt d. 6p*2 + 43x*3 + 5 What is the second derivative of -3m*2p*2tz - 4m*2p*2t + 3m2p*2 + 2m*2t*2 + 34m*2z + 4mp*2t*2z - 689pt*2z + ptz wrt t? 4m2 + 8mp2z - 1378pz Differentiate -24tvx2 + 7tvx - 6644tv + 22t + 2vx2 + 39x wrt x. -48tvx + 7tv + 4vx + 39 Find the second derivative of -2720l*3v - 6l2v*3 - 9lv3 + 4lv2 - 163lv wrt l. -16320lv - 12v*3 Find the third derivative of 3m*2s*3 + 5489m*2s - m*2 - 151ms5 - 21s3 + s2 wrt s. 18m2 - 9060ms2 - 126 What is the second derivative of -4435s*3z*3 - 3s*3z + 3sz*4 - 4442 wrt z? -26610s*3z + 36sz*2 What is the third derivative of -264g*2s*6 - 121g*2s*3 - 8g*2 - 5481s*2 wrt s? -31680g*2s*3 - 726g*2 Differentiate -246559r - 1848721. -246559 What is the second derivative of 49j5 + 506j*3 - 817594j wrt j? 980j3 + 3036j What is the first derivative of 12841j3 - 5j*2 - 764439? 38523j*2 - 10j Find the second derivative of 13895r5 - 6r*4 + 55112r - 6. 277900r3 - 72r*2 Find the first derivative of 232017jt3 - t3 + 5596 wrt j. 232017t*3 What is the third derivative of 280cf3 - 20cf2 + c - 179f*3 - 939 wrt f? 1680c - 1074 Find the second derivative of -117562io*2 + 44i + o*2 - 369o + 3 wrt o. -235124i + 2 Find the second derivative of 144650c*2v*2 - 108c*2 + 5cv - 71v wrt v. 289300c2 Find the second derivative of 259494z*2 - 2z - 298181. 518988 Differentiate 83c2 + 68ci - 252907i wrt c. 166c + 68i Differentiate -34155k4 - 547675 with respect to k. -136620k*3 Find the second derivative of -140677h*5 + h + 26248 wrt h. -2813540h*3 Find the third derivative of -2b*5 + 1421b*3 - 18b*2 - 1595b wrt b. -120b2 + 8526 What is the third derivative of 10822k*3 + 2k*2 + 2355k - 1 wrt k? 64932 Differentiate -2k4 + 1336k*3l - 410k2 - 92l - 875 wrt k. -8k3 + 4008k*2l - 820k Differentiate -95163g*4 - 68672 with respect to g. -380652g*3 What is the derivative of 5262c*3iv2 - 5c*3i - iv2 - iv + 13233i - 2v wrt c? 15786c2iv2 - 15c*2i What is the third derivative of -83797c4 + c2 - 37454c - 8? -2011128c What is the second derivative of 162hx2 + hxz + 1392hz + 10x*5z + x*2z - 2xz + 2x + 18 wrt x? 324h + 200x3z + 2z What is the third derivative of 2444j*4z - 26j3n*3z + 2j2n*3z + 3j2n*2z - 18j2 - 11jn3 - jz + 2n3z wrt j? 58656jz - 156n3z Find the third derivative of 101880f2z*3 - 11f*2z*2 - 2644f*2z wrt z. 611280f2 Find the third derivative of b3v*2 + 2926b*3v + 8b2v*2 - 11bv2 - 2v*2 wrt b. 6v*2 + 17556v What is the first derivative of 22181g3z + 3g3 - 221g*2 + 2g - 25 wrt z? 22181g3 What is the first derivative of 28147d*2i*2 + 29i*2 - 343 wrt d? 56294di2 What is the second derivative of -5691s*2v*2 - 15s*2 + 3v*2 - 2v - 479 wrt v? -11382s2 + 6 Differentiate -3007r*4 + 40572 with respect to r. -12028r*3 What is the third derivative of 3b*5 - 2b*4 + 19b*3 + 178863b*2? 180b*2 - 48b + 114 Find the second derivative of -4o2v*2 + 3o*2 - 28ov2 - 321o - 215v2 + 49v + 1 wrt v. -8o2 - 56o - 430 Find the second derivative of -105696y3 - 2y + 39985 wrt y. -634176y Find the third derivative of 371494g*6 - 54g*2 + 30g + 2. 44579280g3 Find the first derivative of 2al3 + 2al2w + 32l3w + 4932l3 - 12l + 2715w wrt w. 2al2 + 32l*3 + 2715 Differentiate 2a3 - a2 - 9131a + 1733609 wrt a. 6a*2 - 2a - 9131 What is the third derivative of -29234q5 + 36653q*2 wrt q? -1754040q*2 Find the second derivative of 277836h*3 + 474640h wrt h. 1667016h Find the first derivative of -69830m*3 - 66879 wrt m. -209490m*2 Differentiate -15189j + 38862. -15189 Differentiate -32288gh*3y2 - h3y2 + 10h*3 - 483hy2 + 2y*2 with respect to g. -32288h*3y2 What is the third derivative of -g6 + 2g5 + 560110g*3 - 701300g*2 wrt g? -120g*3 + 120g*2 + 3360660 What is the second derivative of 3633r*3 - 270r*2 - 15616r + 22 wrt r? 21798r - 540 What is the third derivative of -5664d*3g*2 - 10d*3m*3 - 87d*2g*2m*3 + 288d*2gm3 + 2dg2m*3 wrt d? -33984g*2 - 60m3 Find the second derivative of -x4 + 420341x2 - 2130322x wrt x. -12x2 + 840682 Differentiate -32303f*3 + 26622. -96909f*2 Find the third derivative of 139434b*3 + 195b*2 - 56b - 1 wrt b. 836604 Find the third derivative of -68385u3 + 7u*2 - 25u - 3 wrt u. -410310 Find the first derivative of 36ou*3 + 1469o - 3u4 + 506u*2 + 3 wrt u. 108ou2 - 12u*3 + 1012u Differentiate 6818s4u2 + u2 + 23u + 689 with respect to s. 27272s*3u*2 What is the derivative of 100f*4 - 530f*3 - 164995 wrt f? 400f*3 - 1590f*2 Find the third derivative of -37161z*5 + 10z3 + z2 + 798104 wrt z. -2229660z2 + 60 What is the first derivative of 39x*2 + 9976x - 2555521 wrt x? 78x + 9976 Find the third derivative of 2o*5 - 249980o*3 - 99o*2 - 3o - 539. 120o2 - 1499880 What is the third derivative of -136j*5 + 5j4 - j3 + j*2 - 13j + 3177 wrt j? -8160j2 + 120j - 6 Find the first derivative of -6o2s + 18o2 + os - 63414o - 1951s wrt s. -6o2 + o - 1951 What is the third derivative of -2n*3st - 31n*3t*2 - 320n*3t + 2n2t*2 - 12176nst*2 - 3t*2 wrt n? -12st - 186t*2 - 1920t What is the third derivative of -47469h5 + 51755h*2 wrt h? -2848140h*2 What is the third derivative of 2q*3v*3 - 55q*3v*2 - 11532q*2v*2 - 432173v*3 wrt v? 12q*3 - 2593038 Find the third derivative of -39292rw6 + 3rw3 - 65467rw2 wrt w. -4715040rw3 + 18r What is the third derivative of 2537727u4 - 1704561u*2 wrt u? 60905448u What is the third derivative of 207045b3 + b2 + 83370? 1242270 What is the second derivative of 40s*2v*3 - 334s*2v*2 - sv*3 + 2sv - 77s - v - 26 wrt s? 80v3 - 668v*2 Differentiate -1316655o + 802473 with respect to o. -1316655 Find the second derivative of 55306i2n*3 + 1063in3 + 23in2 wrt i. 110612n*3 Find the third derivative of 530f*3o*3 - 1246f*3o - 2f3 + f2 - 4fo3 - 426080fo2 wrt f. 3180o*3 - 7476o - 12 Find the second derivative of 329077b2 - 68b + 589 wrt b. 658154 Find the third derivative of -8p5 - 525p*3 - 32754p*2. -480p*2 - 3150 What is the second derivative of 152l*3p*2 + 126l*3p + 3l2p*2 - 139l + 134p2 - 4 wrt l? 912lp2 + 756lp + 6p*2 What is the first derivative of 262m*2o*3p + m*2o*2 + 17429mo3 + 59o*3p - o*2p + o*2 wrt p? 262m*2o*3 + 59o*3 - o	{ "pile_set_name": "DM Mathematics" }
k. 2, 3 Let p(o) = 2o2 - 5o - 8. Let f be p(7). Suppose -19 = 4r - f. List the prime factors of r. 3 Let x(d) = -d2 + 9d - 12. Let r be x(8). What are the prime factors of (-9)/r32/6? 2, 3 Suppose -f + n = -149, 4f + n - 593 = 4n. Suppose -d = -5p - 0d + 149, f = 5p - 4d. Let u = p + -21. What are the prime factors of u? 3 Let l = 10 + 25. Suppose -4a + l = a. What are the prime factors of a? 7 Let d(g) = -g*3 - 12g*2 - 3g + 8. What are the prime factors of d(-12)? 2, 11 Let f = 43 + -28. Suppose -6l + 3l = -3u + f, 2u + 5l = -11. Suppose up = -p + 36. What are the prime factors of p? 2, 3 Let r(k) = k*3 - 6k*2 + 3. Let u be r(6). Suppose -uq + 2q + 2 = 0. List the prime factors of q. 2 Let l(t) = t2 + 6t - 4. Let i be (-72)/(-33) - (-6)/(-33). Suppose -2p - 5u = -u - i, 33 = -3p + 3u. List the prime factors of l(p). 3 Let o(t) = 2t - 11. Suppose -12 = -b - 3. What are the prime factors of o(b)? 7 Suppose 161 = 2p + w + 32, 0 = p + 2w - 57. What are the prime factors of p? 67 Let q = -88 + 105. List the prime factors of q. 17 Let u(x) = 2x*2 + 4x + 2. Let h be u(-2). Suppose 5d - 4p = -0d + 47, hd = 5p + 12. What are the prime factors of d? 11 Let v(g) = g3 + 6g*2 - 2g + 3. What are the prime factors of v(-6)? 3, 5 Let w be (-125)/(1(0 + -1)). Let d be w/(-20) - (-1)/4. List the prime factors of ((-4)/d)/(4/36). 2, 3 Let c = 565 + -397. List the prime factors of c. 2, 3, 7 Suppose 4o + p - 3p = 552, -o = -p - 140. List the prime factors of o. 2, 17 Let a be 9/(-6)(-88)/6. Let z(v) = 5v2 - v. Let s be z(-1). Let u = a - s. What are the prime factors of u? 2 Let c = -168 + 297. List the prime factors of c. 3, 43 Suppose 10m - 6m = 4. List the prime factors of m/(-3 - 76/(-24)). 2, 3 Suppose 2z - 2b - 70 = 0, 4z + 3b = 2 + 173. What are the prime factors of (4 + -10)z/(-6)? 2, 5 Let m(f) = -4f + 9. What are the prime factors of m(-13)? 61 Let h(g) = 2g*3 - 2g*2 - g + 3. What are the prime factors of h(2)? 3 Suppose -2p = -3x - 4, -3x - p + 3 = 1. What are the prime factors of (3/6 - x)60? 2, 3, 5 Let j(q) = -q3 + 9q*2 - 3q - 13. Let v be j(9). Let a = -25 - v. Let r = a - 4. List the prime factors of r. 11 Suppose 3h = h + 54. Suppose 3m + 0m - h = 0. What are the prime factors of 3/((m/(-12))/(-3))? 2, 3 Let p = -12 - -23. Suppose -p = 5k - 106. What are the prime factors of k? 19 Let q be 2/7 - 4/14. Let h be (-1 + 3 - q)/2. What are the prime factors of 21/6 + h/(-2)? 3 Let u(t) = 2t3 - 2t*2 - 5t. Let f(v) = -v*3 + 2v*2 + 6v. Let m(s) = 6f(s) + 7u(s). Let h be 2/(-8) - (-20)/16. What are the prime factors of m(h)? 7 Suppose -4a + 217 = -d - 262, 0 = -3a - 3d + 378. What are the prime factors of a? 11 Let x = 16 - -2. What are the prime factors of x? 2, 3 Suppose -u + 16 + 26 = 0. Suppose -6 = 3p - u. List the prime factors of p. 2, 3 What are the prime factors of -3(-2 - 350/15)? 2, 19 Let o(z) = -3z*2 - 6z + 7. Let w(s) = -6s2 - 11s + 13. Let i(b) = 11o(b) - 6w(b). What are the prime factors of i(-3)? 2, 13 What are the prime factors of (-4)/(-7) - (-4304)/112? 3, 13 Suppose 2f = 0, -5f + 110 = 5s - 40. List the prime factors of s. 2, 3, 5 Suppose -10 - 26 = -2o. List the prime factors of o. 2, 3 Let t(b) = -b - 7. Let x be t(-9). Let l(v) = -18v. Let y be l(x). List the prime factors of (-4)/18 + (-152)/y. 2 Suppose -3n + 4d + 45 = 0, d + 72 = 3n + 6d. Let p = n + -12. What are the prime factors of p? 7 Let l(k) = -2k + 2. Let j be l(7). What are the prime factors of (-2 - j)(-1)/(-2)? 5 Let w = -8 + 6. Let v = w - 18. What are the prime factors of (v/6)/((-3)/9)? 2, 5 Suppose -33 + 117 = 4w. What are the prime factors of w? 3, 7 Let i be (-57 - (-3)/3)-1. Suppose -2j = 2j - i. List the prime factors of j. 2, 7 Let x(n) be the first derivative of 3n - 1 + 1/3n3 - 3/2n*2. What are the prime factors of x(3)? 3 Suppose -r = -20 + 8. Let o(f) = 1 + rf + 1 - 1. List the prime factors of o(1). 13 Suppose -23 = -3n - 8. Suppose -nx + 57 = -2x. What are the prime factors of x? 19 List the prime factors of 51/6 + -3 + 28/8. 3 Let n(t) = -t2 + 4t + 6. Let c be n(5). What are the prime factors of (-1 - -1) + (c - -2)? 3 Let w = 9 - 10. List the prime factors of w + 1 + -2 + 27. 5 What are the prime factors of (48/7)/((-3)/(-21))? 2, 3 Suppose 3r = 7r. Suppose -3z - 3g = -12, z - 5z - 3g = -16. Suppose -2b + zv + 26 = r, -v = -2b + 7b - 10. List the prime factors of b. 3 Let h = 36 + -17. Suppose -4 = 5c - h. What are the prime factors of c? 3 Let r be -43/6 - -29. Let c be 72/r21/2. Suppose 0 = -2y - 0y + c. List the prime factors of y. 2, 7 Let t = 15 - 1. Let g be (-4)/t + 72/(-42). Let m(h) = -5h - 1. List the prime factors of m(g). 3 Let i = 16 - 10. What are the prime factors of -2(-12 + (i - 3))? 2, 3 Let c be -3 + 285 - -2. Suppose -4t - c = -r - 394, 2t + 4r - 132 = 0. Suppose -4n = -2d - 2d - t, 0 = 2n + d - 29. List the prime factors of n. 3, 5 Let w(b) = -b - 3. Let k be w(5). Let n = k + 12. Suppose -nl + 44 = -0l. What are the prime factors of l? 11 Let q(b) = -b3 - 11b*2 - 11b + 7. Suppose 26 = -2f - 3u, 2f + u + 14 = 4u. What are the prime factors of q(f)? 17 Suppose 0 = -4q - 0q + 240. Suppose -12c = -8c - q. List the prime factors of c. 3, 5 Let h be (8/20)/((-4)/(-20)). Suppose 0 = -3a + hd + 16, a + 0a - 4d = 2. What are the prime factors of a? 2, 3 Let i be 6/5 - 2/10. Let q be 2 + -2 + i + 1. Suppose -4a = -4, -2a - q = -n - 1. List the prime factors of n. 3 Let y = -26 + 47. List the prime factors of y. 3, 7 Let x be (-5 - -8)(-3 - 0). What are the prime factors of ((-10)/45)/(1/x)? 2 What are the prime factors of -79(20 + -21)31? 3, 79 Let w(r) = 0r3 - r3 - 3r - 1 + r. Let o be w(-2). Suppose o = -2f + 51. What are the prime factors of f? 2, 5 Let p = 27 + -42. What are the prime factors of 13(-25)/p? 5 Let y = -14 - -20. Let t(v) be the first derivative of v2/2 + 5v - 2. What are the prime factors of t(y)? 11 Let a = 12 + 39. What are the prime factors of a? 3, 17 Let b(t) = -16t + 2. Let z(k) = -11k + 1. Let w(d) = -5b(d) + 8z(d). Let o be ((-3)/(-4))/(22/(-88)). What are the prime factors of w(o)? 2, 11 Suppose 4t = 174 + 266. Suppose -6o = -o - t. Suppose 0 = -3i + 3a - 7a + 17, 0 = -4i - 5a + o. List the prime factors of i. 3 Let m be 3 + 6/(-4)2. Suppose 2x - 5o - 11 = -mo, 0 = 3o + 3. What are the prime factors of x? 3 Let q = -24 - -8. Let p = 28 + q. What are the prime factors of p? 2, 3 Let c = -34 + 84. What are the prime factors of c? 2, 5 Let a = 69 + -13. What are the prime factors of a? 2, 7 Let w = 0 - 0. Let t = -13 + 15. Suppose -2b - 3b + 35 = n, -tb + n + 7 = w. List the prime factors of b. 2, 3 Let s(c) = 3 + 4c - 9 - 5c - c. Let y be s(9). Let t = -11 - y. List the prime factors of t. 13 Let u = 47 + -26. Suppose 1 - u = -q. Suppose 2v - 4 - q = 0. List the prime factors of v. 2, 3 Suppose -2l - 2t + 15 = 3t, 0 = -3l + 2t + 13. Let f(g) = -3g*2 - 1 - 2g - lg + 2g*2. List the prime factors of f(-6). 5 Let l = -10 - -23. Suppose 2r = 3c + l, 2c - 6c = r - 23. What are the prime factors of r? 11 Let f(n) = 40n + 1. Let c be f(2). Suppose -v + 4v - c = 0. What are the prime factors of v? 3 Let l(t) = -t3 - 8t*2 + 8t - 4. Suppose 5i = 4i. Suppose i = 3m - 18 + 45. List the prime factors of l(m). 5 What are the prime factors of 22/115/2? 5 Let v(b) = b*2 + 3b + 3. Let z be v(-3). Let k = z - -5. Let q(w) = w*2 - 8w + 4. What are the prime factors of q(k)? 2 Let v(t) = 2t + 5. Let m be v(-4). List the prime factors of 6 - (m + -1 + 3). 7 List the prime factors of -1((2 - -3) + -28). 23 Suppose 9k = 4k + 20. What are the prime factors of k? 2 Let o be 1-2 + (3 - 1). Let m = o + 10. List the prime factors of m. 2, 5 Suppose 2d + b = 6d - 322, -84 = -d + 2b. List the prime factors of d. 2, 5 Let w be 264/10 - (-6)/(-15). Let t = w + -16. Suppose 3u = n - 14, -3u - 12 = -2n + t. List the prime factors of n. 2 Let n = -40 - -9. Let u = 65 + -19. Let z = u + n. List the prime factors of z. 3, 5 Let d be (-3)/(32/8). Let g be 1(-7 - 0)1. Let w = d - g.	{ "pile_set_name": "DM Mathematics" }
) = n*2 - 1. Let z be d(2). Suppose -3k*z - 3 - 2k - 3k - 4k - 9k2 = 0. What is k? -1 Suppose -10 = -5s, 3n = -n - 2s + 4. Factor -3z2 + 1 + nz*2 + 0 + 2z + 4z2. (z + 1)2 Let o(d) be the second derivative of d7/294 + d6/105 - d4/42 - d3/42 + 18d. Factor o(w). w(w - 1)(w + 1)*3/7 Let p = 179 - 524. Let x be p/(-105) - 13. Determine n so that xn2 - 2/7n*3 + 0n + 0 = 0. 0, 1 Let q(h) = -3h5 + h4 + 8h*3 - 6h*2 - h + 1. Let o(u) = -3u*5 + 9u*3 - 6u*2. Let y(a) = 2o(a) - 3q(a). Factor y(f). 3(f - 1)*3(f + 1)*2 Suppose -2j = 3t - 228, 6j - t = 11j - 596. Determine u so that -75/2u*5 + ju*4 - 96u*2 + 0 - 24u - 36u3 = 0. -2/5, 0, 2 Let c(y) be the first derivative of -y4/4 + 6y*3 - 54y*2 + 216y - 49. Factor c(h). -(h - 6)*3 Let y be ((-240)/(-70))/((-2)/(-7)). Let o be (-2)/y-26 - 3. Solve -ou + 1/3 + u2 = 0. 1/3, 1 Let p be 0 + 4 - (-14)/(-4). Factor -1/2k*3 + 0 - pk*2 + 0k. -k*2(k + 1)/2 Let c be ((1 + -1)/(-1))/1. Suppose c = -3t - t + 12. Factor -2d*4 - 2d*3 - 3d*2 + td*2. -2d*3(d + 1) Let t be 8/(-6)(-1)/3. Factor 4/9 + 2/9m - 2/9m3 - tm*2. -2(m - 1)(m + 1)(m + 2)/9 Let y(k) be the second derivative of 4k + k2 + 1/6k*4 + 0 - 2/3k*3. Factor y(b). 2(b - 1)*2 Let r be (6 + -5)(-2)/(-8). Suppose 5h = 7 + 3. Factor -ry + 1/4yh - 1/2. (y - 2)(y + 1)/4 Let k(y) be the third derivative of -y8/336 - y7/30 - 3y6/20 - y5/3 - y4/3 - 23y*2. Let k(s) = 0. What is s? -2, -1, 0 Let c(f) = 9f*5 + 4f*4 - 5f*3 - 7f. Let d(u) = -u5 + u3 + u. Let b = 12 + -14. Let q(v) = bc(v) - 14d(v). Factor q(z). -4z3(z + 1)*2 Let z(l) be the second derivative of 0l*3 + 0 - 2/105l*6 + 1/70l*5 + l + 1/42l*4 + 0l*2. Suppose z(j) = 0. What is j? -1/2, 0, 1 Suppose -b + 19 = 5m + 2b, 1 = -m - 3b. Let h = -5 + m. Factor -1/2l2 - 1/2l + h. -l(l + 1)/2 Suppose -3p + 13 = -2. Suppose pg = -o - 7, o + 0o = g + 5. Factor 2/7vo + 2/7 + 6/7v*2 + 6/7v. 2(v + 1)3/7 Let q(x) = 4x + 4. Let v be q(-8). Let d = v + 202/7. Factor -6/7h2 - 2/7h*4 + 0 + 2/7h + dh3. -2h(h - 1)3/7 Let g(i) = -i - 6. Let q be g(-8). Factor 0f + f*2 - q + 4 + 3f. (f + 1)(f + 2) Let y(f) be the first derivative of -4f5/5 + f4 + 8. Factor y(w). -4w3(w - 1) Let h(g) be the first derivative of g*4/2 - 3g*2 + 4g + 8. Find r such that h(r) = 0. -2, 1 Let m(i) be the second derivative of -i5/10 + i4/6 + i3/3 - i2 + 44i. Factor m(o). -2(o - 1)*2(o + 1) Let k(r) = -r*3 - r - 1. Let b(p) = 4p*4 + 7p*3 + 4p*2 - 17p - 13. Let o(i) = -b(i) + 5k(i). Factor o(t). -4(t - 1)(t + 1)2(t + 2) Let j be (-500)/(-5)10/16. Let a = j - 61. Suppose -6r + ar2 + 6 = 0. Calculate r. 2 Let v(t) = 3t*2 + 16t - 11. Let g(p) = -12p2 - 63p + 45. Let w(q) = 4g(q) + 15v(q). Determine r, given that w(r) = 0. -5, 1 Suppose -4r - 47 = 13. Let l be r/(-6)(-4)/(-5). Factor -lz - z + 0z + 1 + 2z2. (z - 1)(2z - 1) Let w(z) be the second derivative of -3z*6/2 - 3z*5/2 + 55z*4/12 + 10z*3/3 - 10z*2 + 14z - 2. Factor w(d). -5(d + 1)2(3d - 2)2 Let a(n) = -7n*4 + 9n*3 - 2n*2 + 5. Let f(h) = 4h*4 - 5h3 + h2 - 3. Let z(m) = -3a(m) - 5f(m). Factor z(i). i*2(i - 1)*2 Let l(k) be the second derivative of -1/2k*2 + 1/60k*5 - 1/12k*4 - 2k + 0 + 1/6k3. Let h(f) be the first derivative of l(f). Factor h(u). (u - 1)2 Let y(w) be the first derivative of w5/90 + w4/36 - 2w*3/9 + 3w*2 + 9. Let o(m) be the second derivative of y(m). Suppose o(f) = 0. Calculate f. -2, 1 Solve 12n - 10 - 9n - n3 + 8 = 0. -2, 1 Let l(z) = z2 - 4z + 8. Let r(p) = -p - 1. Let a(o) = -l(o) - 2r(o). Let h be a(4). Factor k - hk*5 + 2k*3 - k. -2k*3(k - 1)(k + 1) Let i(u) be the third derivative of u2 + 0u - 1/36u4 - 1/336u*8 + 1/72u*6 + 0u*3 - 1/630u*7 + 1/180u5 + 0. Let i(y) = 0. Calculate y. -1, 0, 2/3, 1 Let d(c) be the second derivative of -c7/126 + 2c6/45 - c5/15 - c4/18 + 5c3/18 - c2/3 + 10c. Let d(o) = 0. What is o? -1, 1, 2 Let i(r) be the second derivative of 0r*3 - 1/60r*4 + 7r + 0 + 1/100r5 + 0r2. Factor i(y). y2(y - 1)/5 Let a = 17 - 17. Determine h so that 2/3h*2 + 2/3h + a = 0. -1, 0 Let p = 169 - 839/5. Solve 2/5i4 - 2i + 2/5i3 - pi*2 - 4/5 = 0. -1, 2 Let k be (-2)/25(-900)/120. Factor 0 - 3/5q + kq*3 + 0q*2. 3q(q - 1)(q + 1)/5 Let w be (-2)/(-3) - (-16)/3. Let -9r2 - w - 2r3 - r2 - 2 - 16r = 0. What is r? -2, -1 Determine j so that -1 - 32j*2 - 5 + 24j - 27j3 + 3j + 26j2 + 12j*4 = 0. -1, 1/4, 1, 2 Let x(o) be the third derivative of 0o + 0o3 + 1/10o*5 - 2o*2 + 1/40o*6 + 0o*4 + 0. Solve x(j) = 0. -2, 0 Factor -2v*2 + 4/3v*3 - 1/3 + 4/3v - 1/3v4. -(v - 1)4/3 Let x(r) be the first derivative of -r4/60 + r3/15 - 2r - 2. Let j(f) be the first derivative of x(f). What is v in j(v) = 0? 0, 2 Let l(b) be the first derivative of 3/2b2 + b3 - 6b + 1. Factor l(u). 3(u - 1)(u + 2) Find t, given that 5/2t2 + 10 + 30t*3 + 10t*4 - 30t = 0. -2, 1/2 Let k(r) be the first derivative of -r*4/20 - 4r3/15 - r2/2 - 2r/5 - 19. Factor k(s). -(s + 1)2(s + 2)/5 Let t(a) be the third derivative of a6/420 + a5/42 + a*4/28 - 3a*3/7 - 34a*2. Factor t(g). 2(g - 1)(g + 3)2/7 Suppose 0 = -a + 4 + 5. Let l(v) = -v3 - 2v*2 - v. Let b(r) = 2r*3 + 4r*2 + 2r. Let z(f) = al(f) + 4b(f). What is s in z(s) = 0? -1, 0 Suppose -11r = -6r. Suppose 4t = -rt. Factor 0g2 + 0g + t + 0g4 + 2/5g*5 - 2/5g*3. 2g*3(g - 1)(g + 1)/5 Let y(l) = -3l + 34. Let p be y(10). Let r(t) be the first derivative of -8t2 - 3 - 10/3t*3 - 8t - 1/2tp. Factor r(j). -2(j + 1)(j + 2)2 Let p(r) be the first derivative of -r8/4200 - r7/2100 + r6/900 + r5/300 - 4r*3/3 + 2. Let u(x) be the third derivative of p(x). Factor u(f). -2f(f - 1)(f + 1)2/5 Let i(j) be the second derivative of -j4/96 + j*3/24 + 10j. Suppose i(y) = 0. What is y? 0, 2 Suppose 0 = -0f + 5f - 3m - 22, 0 = -4m - 16. Let p be 22 + (-120)/35. Factor -6/7z*3 + 6/7z + 4/7zf - p. -2(z - 1)(z + 1)(3z - 2)/7 Factor 21/2a*4 + 75/2a*2 + 24a + 3/2a5 + 6 + 57/2a*3. 3(a + 1)*3(a + 2)*2/2 Let a be (-8)/(-5) + (-6)/(-15). Factor 0r*a + 2r2 - r2. r*2 Let b(s) be the first derivative of 2s + 2. Let h(j) = -j*2 - j + 6. Let f(c) = -6b(c) + 2h(c). Factor f(u). -2u(u + 1) Let v(j) = -j2 - j + 1. Let s(a) = 3a*2 + 3a - 28. Let z(m) = s(m) - 2v(m). Factor z(r). 5(r - 2)(r + 3) Let f(a) be the third derivative of a8/30240 - a7/7560 + a5/20 - a2. Let p(g) be the third derivative of f(g). Factor p(b). 2b(b - 1)/3 Let g(x) = -5x*2 + 103x - 199. Let d(o) = 3o2 - 69o + 133. Let y(m) = -7d(m) - 5g(m). Factor y(s). 4(s - 4)2 Let r(x) be the second derivative of -3x6/10 + x4/3 - 9x. Solve r(p) = 0. -2/3, 0, 2/3 Factor 42z*3 + 24z*2 - 115z*4 + 234z*4 + 2z - 99z4. 2z(z + 1)2(10z + 1) Let b(d) = -5d*2 + 7d + 5. Let i(k) = -k*2. Let f(o) = b(o) - 4i(o). Let j be f(7). Factor 2 + 2y3 - 6y - 4y3 - 6y*4 + 2y*j + 6y*3 + 4y*2. 2(y - 1)*4(y + 1) Let g(b) = 5b2 + 2b - 2. Let t(q) = 11q2 + 5q - 5. Let m(o) = -5g(o) + 2t(o). What is r in m(r) = 0? 0 Let z(h) be the third derivative of -h6/1080 - h3/3 + 3h2. Let d(m) be the first derivative of z(m). Find g, given that d(g) = 0. 0 What is x in -15x - 10x2 + 3 + 11x*2 + 19x = 0? -3, -1 Let r be (5 + -10)/(-15) - 2/6. Factor 0 + 2/5l2 + rl. 2l2/5 Let w(x) be the first derivative of -x8/4200 + x6/450 - x4/60 + 2x*3/3 - 5. Let d(t) be the third derivative of w(t). Suppose d(j) = 0. Calculate j. -1, 1 Let m be (7/84)/(3/8). Factor 0z - mz2 + 2/9. -2(z - 1)(z + 1)/9 Suppose 3n - 10 = n. Suppose 1 + 4 = ni. Suppose x + i + 1/4x2 = 0. Calculate x. -2 Let d be 1/(-3) - (-62)/6. Let z(p) = p3 - 11p2 + 9p + 12. Let i be z(d). Find x such that 0 - 2/5x + x3 - 3/5x*i = 0. -2/5, 0, 1 Let k be 165/50 - 6/(-15). Find j, given that 4/5 - 6/5j + 2/5j**k = 0. 1, 2 Let w be (	{ "pile_set_name": "DM Mathematics" }
2z + 2. Let h(j) = j2 + j - 1. Let n(s) = 2h(s) + t(s). Determine n(b(a)). 2a4 Let v(p) = 127p. Let s(b) = -b*2 - b. Let z(l) = 15l*2 - 10l. Let q(n) = -10s(n) + z(n). Calculate v(q(c)). 3175c*2 Let y(w) = -314w. Let f(s) = 15625 - s*2 + 3s*2 - 15625. What is y(f(l))? -628l*2 Let y(l) = -114l*2. Let a(g) = 61764g*2. Give a(y(z)). 802684944z*4 Let c be (5(-2 - -3) - 10) + 9. Let l(u) = -64u + 57u + c - 2 - 2. Let t(y) be the third derivative of y5/15 + y2. What is t(l(i))? 196i2 Let i(q) = -4001q*2 - 564. Let x(b) = b. What is i(x(w))? -4001w2 - 564 Let r(a) be the third derivative of -a5/60 + 36a2. Let j(w) be the third derivative of -7w*5/12 + 32w*2. What is r(j(s))? -1225s4 Let m(f) be the third derivative of f4/24 - 13f2. Let x be (3 - 4)(-248 + -2 + 3). Let r(k) = -xk + 6k*2 + 247k. What is m(r(w))? 6w2 Let t(g) be the third derivative of g5/20 - 132g2 - 1. Let h(c) = c3 + 7c2 + 4c - 5. Let m be h(-5). Let l(s) = 25 - m - s. What is t(l(x))? 3x2 Let w(s) be the second derivative of s4/6 + 7s - 66. Let c(l) = 1. Let x(p) = 18p + 4. Let n(f) = 6c(f) - x(f). Give n(w(r)). -36r2 + 2 Let u(b) = 3b. Let f(x) = -9825x2 + 2432x. Calculate f(u(y)). -88425y2 + 7296y Let b(l) = 741l - 241. Let f(w) = -15w*2. Determine b(f(t)). -11115t*2 - 241 Let r(k) = 11k*2 + 5. Let w(t) = -11t + 36t - 3t - 15t - 8t. Calculate w(r(c)). -11c2 - 5 Let m(x) = 6x*2 + 40. Let u(f) = 558f - 6. What is m(u(o))? 1868184o2 - 40176o + 256 Let v be 193/(-9). Let f(g) = -3g2 - 10g - 1. Let d be f(v). Let t(o) = -3od + 3o*2 + 4o2 + o2. Let p(i) = -2i. Give p(t(x)). -10x*2 Let g(p) = 4p*2. Let x(q) = 785397q + 1942q2 - 785397q. Calculate g(x(m)). 15085456m4 Suppose 4l = 2u - 5 + 19, -2u = 3l. Suppose 0 = 5v - lo + 3o - 105, 5o = -v - 3. Let a(f) = vf + 18f - 42f. Let h(r) = -4r2. Calculate h(a(n)). -16n*2 Let w be 50/(-275) - 48/(-22). Let d(f) = 127f + 134f - 2f*w - 386f + 125f. Let z(m) be the third derivative of -3m4/8 + m2. Determine d(z(q)). -162q2 Let x be ((-88)/6)/(19/(57/(-2))). Let z(q) = 154q*2 - 93q*2 - 81q*2 - 22q + xq. Let g(o) = 5o*2. Determine z(g(p)). -500p*4 Suppose -w + 3w = 0. Suppose -2h + v + 8 = 0, 6 = h + v + 5. Let r(i) = 3i + wi - i - hi. Let d(o) = -o. Give r(d(q)). q Let m(p) = -210p - 219p - 208p - 218p + 848p. Let f(n) be the second derivative of -13n*4/12 + 2n. What is f(m(r))? -637r2 Let m(y) = -1896010543y. Let o(v) = -v*2. What is o(m(g))? -3594855979167154849g*2 Let f(p) be the second derivative of 17p - 2p3 + 3p*3 - 29p - 24p. Let x(a) = 7a. Calculate x(f(o)). 42o Let t(o) = 324o. Let u(a) = -10a - 8. Let r be 1/218 + -6. Let h(q) = -4q - 3. Let f(s) = ru(s) - 8h(s). Determine t(f(v)). 648v Let p(f) = -6f + 5. Let u(d) = 21d - 10. Let k(z) = 2. Let r(o) = -4k(o) + u(o). Let q(g) = -18p(g) - 5r(g). Let b(h) = 2h + 36. Determine q(b(a)). 6a + 108 Let i(l) = 2l*2. Let p(b) = 4b2 - 6. Let s(t) = t2 + 2. Let k = -307 + 308. Let m(w) = kp(w) + 4s(w). Calculate i(m(q)). 128q4 + 64q*2 + 8 Suppose 15 = g + 4g. Let f(z) = 8z2 - gz*2 + 5z2. Let n(u) be the first derivative of u2/2 + 31352. Give n(f(d)). 10d2 Let c(u) = 10u - 3. Let p(j) = 15j + 29. Let d(b) = -2c(b) + p(b). Let r(f) = f. What is d(r(t))? -5t + 35 Let z(g) = -2g*2. Let i(f) = -2f*3 + 43f*2 - 21f + 2. Let w be i(21). Let l(c) = 8 + wc + 7 - 17 + 4. Calculate z(l(o)). -8o*2 - 16o - 8 Let j(l) = 2995054l2. Let u(z) = z2. Calculate j(u(p)). 2995054p*4 Let l(y) be the first derivative of 4y*3/3 - 21180. Let f(j) = -5j2 - j2 + 0j2. What is l(f(w))? 144w4 Let b(i) be the third derivative of i7/210 - 29i5/60 - 2i*2 + 17. Let k(p) be the third derivative of b(p). Let x(m) = -m. Calculate k(x(r)). -24r Let r(g) be the second derivative of -7g4/12 - 35g - 32. Let t(l) = 555l2. Determine t(r(y)). 27195y*4 Let n(j) = -2j*2. Let d(k) = -7995k + 1 - 7868k + 16174k. Give d(n(g)). -622g2 + 1 Let q(b) = 2b*2 + 3b + 468. Let o(i) = -12i - 12. Determine q(o(a)). 288a*2 + 540a + 720 Let j(l) = 20l2. Let i = 11 - -15. Let w be 1 + (-7)/6 - i/(-12). Let q(z) = -47z*2 - 48z*w + 96z*2. What is q(j(m))? 400m4 Let h(p) be the third derivative of -p4/24 + 21p2 - 8. Let f(o) = 29o*2 + 60o*2 - 19o*2. What is f(h(u))? 70u*2 Let s(h) be the second derivative of 5h*3/2 + h. Let l(k) = 78k - 16k + 7k*2 - 45k + 0k2 - 17k. Give s(l(z)). 105z2 Let n(b) = -195b*2 + 2b. Let g(x) = 49641x. Give n(g(s)). -480524631795s*2 + 99282s Let h be ((-2)/3)/(5/(-15)). Let m(d) = -1733dh - 1744d*2 + 3487d*2. Let q(z) = 6z*2. Give q(m(y)). 600y*4 Let d(a) = 376a - 7969a2 + 1839a*2 - 9523a*2 - 376a. Let y(c) = c*2. Determine y(d(u)). 245016409u*4 Let t(d) = 2d*2. Let m(l) = -8l. Let c(i) = -7i - 3. Suppose -2s = 5o + 2, 2o = -2o + 3s - 20. Let j(u) = om(u) + 3c(u). Calculate t(j(z)). 50z2 + 180z + 162 Let f(g) = -1032g - 1054g + 1969g. Let j(t) = -2t. Give j(f(a)). 234a Let p(d) = -2291d2. Let x(u) be the second derivative of u4/12 - 17u - 1. Determine p(x(c)). -2291c*4 Let n(j) = -j. Let u(h) be the first derivative of -2h6/15 + h5/120 + 2h3/3 + h2 + 79. Let m(y) be the third derivative of u(y). Give n(m(o)). 48o*2 - o Let i(o) = -258903o*2. Let h(d) = -454d. Determine i(h(m)). -53364050748m2 Let x(f) = 391f*2. Let r(a) = -15a - 6. Determine r(x(q)). -5865q2 - 6 Let f(w) = 2w. Let i(o) = -188868709o2 + o + 2. Give i(f(b)). -755474836b*2 + 2b + 2 Let h(g) = 53g. Let u(i) = -i + 560754. Give h(u(x)). -53x + 29719962 Suppose -64 + 78 = 7c. Let s(l) = 7l + 34l2 - 35l*c - 7l. Let a(i) = 28i + 1. Give a(s(h)). -28h*2 + 1 Let g(b) = -14b*2. Let r(c) = -612c*2 - 57c + 3. Let s(m) = -1223m2 - 95m + 5. Let u(z) = 5r(z) - 3s(z). Give u(g(q)). 119364q4 Let x(u) = 2u*2 - 27u + 15. Let k be x(13). Let t be (914)/3 - k. Let j(m) = -9m*2 - 9m + 9m + tm*2. Let n(w) = -w. What is n(j(v))? -31v*2 Let o(k) = 4k + 5. Suppose -344 = 180i - 184i. Let y(a) = -40a + ia - 43a. Give y(o(u)). 12u + 15 Let z(t) = 59t + 30. Let s(b) = 5111b. Calculate s(z(v)). 301549v + 153330 Let m(l) = -2l. Suppose -f + 7 = 4q, 2f = -4q - 26 + 32. Let a(n) = 0n*2 + 2n*2 - 7n*q. Calculate a(m(r)). -20r*2 Let x(r) be the third derivative of 26333r*4/24 - 7689r2. Let b(h) = -h2. What is b(x(z))? -693426889z2 Let n(k) be the second derivative of 0 + 0k*2 - 59k + 2/3k4 + 0k*3. Let o(v) = -3v*2. Give n(o(h)). 72h*4 Let c(d) = 6d - 5d + d + 2d. Let z(y) = -169y2. What is z(c(r))? -2704r*2 Let v(w) = -88993w - 2. Let h(f) = -14f2 + 6f. What is v(h(q))? 1245902q2 - 533958q - 2 Let j(r) = -4r2 - 2023r. Let c(b) = -4220b2. What is j(c(k))? -71233600k*4 + 8537060k*2 Let i(n) = 2815n*2 - 44 + 68 - 2755n*2. Let t(g) = g. What is t(i(p))? 60p*2 + 24 Let u(l) = 32l*2 - 2l. Let s(d) = 312106d. Determine u(s(w)). 3117124967552w*2 - 624212w Let f(d) = 384d. Let z(i) be the third derivative of i4/6 - 7i*2 - 49i. What is f(z(a))? 1536a Let h(j) be the first derivative of 0j*2 + j - 227/3j*3 + 44. Let q(t) = 2t. Determine h(q(i)). -908i2 + 1 Let z(w) = -2w*2. Let s(b) = -6305899b. Calculate s(z(u)). 12611798u2 Let l(c) = -474c. Let f(p) = 22p2 - 103p*2 + 27p*2 + 34p*2 + 30p*2. Give f(l(r)). 2246760r*2 Let f(v) = -400v*2 - 1065v*2 + 504v - 1004v + 500v. Let b(x) = -5x. Give b(f(t)). 7325t*2 Let j(o) = -2103o*2. Let s(z) = -2207z + 2207z + 2z*2. Determine j(s(k)). -8412k*4 Let s(k) = -35k. Let l(h) = -18010h2 + 9h - 5. What is l(s(p))? -22062250p2 - 315p - 5 Let h(y) be the second derivative of -y*3/6 + 42y - 2. Let f(b) = -338b2 + 2b. Determine h(f(p)). 338p2 - 2p Let q be (-12)/(-7) + (-24)/(-84). Let c(f) = -63f - 48f + 110f - 24f*q. Let y(a) = -2a. Give y(c(n)). 48n2 + 2n Let d(n) = -3n. Let j(s) = 196732s*2 + s + 6. Calculate j(d(u)). 1770588u	{ "pile_set_name": "DM Mathematics" }
is the value of (-55 - -262) + -251 + (0 - -29)? -15 53 + (13 - -28) - 50 44 What is (-4 - -3) + (66 - (-16 + (36 - (10 - 6))))? 49 Evaluate 2 + -4 - ((40 - 3) + 4 + 24 + -34). -33 Evaluate 77 + (-26 - -16) + 39 - (0 - -7). 99 Evaluate -10 + 1 + 24 + -16 + 35 + -2. 32 Calculate -52 + -2 - (605 + -653). -6 What is the value of (9 - (19 + 6) - -7 - (-10 - 4)) + -21? -16 Evaluate 34 - (-58 + 101 + -50). 41 Evaluate -109 + (-4 - (33 - (-24 - -71))). -99 (3 - 1 - 3 - 1 - (-638 + 572)) + 0 64 Calculate -240 - (78 + -201) - -53. -64 -38 - (-78 - (92 + -50)) 82 Calculate -1 + 0 - (4 + (5 - 0) - (-56 + -38)). -104 What is -44 - (47 + -50 + 13 - (0 + 21))? -33 What is 110 + -53 + (0 - 24)? 33 What is -6 + -26 + (7 + 0 - (-36 - -50))? -39 Calculate (-76 - (-1 + (-1 - -8) + -10)) + 8. -64 Calculate -12 - (45 + 5 + -20). -42 What is the value of 22 + -20 + 15 + -21 + -34? -38 What is the value of -55 - (103 - 195 - -10)? 27 1 + -1 + (14 - (24 - -14)) -24 Evaluate 119 - (-71 - -177) - (3 + -2 - 0). 12 Calculate 68 - (-6 + -17) - (13 + 2) - 1. 75 What is 1374 + -1348 + 10 + -127? -91 What is -51 + (-28 - 0) - (-29 + 5)? -55 Calculate -3 + -4 + -24 + 151 + -137. -17 What is -4069 + 4060 + (53 - 0)? 44 What is 70 - ((-3 - 3) + (-49 - (-78 - -19)))? 66 Evaluate 2 + 3 + (2 - -54 - 21). 40 -8 + 3 + (-6 - (-3 + 20)) -28 Calculate -63 + ((-20 - -25) + (-18 - 1) - (84 + -84)). -77 Calculate 0 + -1 + 10 - ((64 - -81) + -175). 39 What is 87 + -90 + (-20 - -5) + 8 + 27? 17 Calculate -11 - ((0 - 7) + (351 - 323)). -32 What is (0 - -2) + -70 + (-121 - -102 - -27)? -60 Calculate 80 + (-14 - -16) - 119. -37 What is the value of (-4891 - -4894) + 2 + (0 - -25)? 30 -12 - (44 - 0 - ((-118 - -47) + 58)) -69 What is the value of (-1 - 3) + (-2 - (16 + -36 + 7))? 7 Calculate -12 + 36 + -50 + -5 + 44. 13 What is the value of (-93 - -3) + 15 + (-3 - -5) + 8 + -12? -77 What is the value of -58 + (4 - 13 - -6) + (1 - 7) + 5? -62 (-1 + 2 - 5) + -45 + (-12 + -34 - -43) -52 What is 97 + (-211 - -207) + (-3 - (7 - -3))? 80 Evaluate 30 + (-1 - -26) - 62. -7 (5 - (1 + (31 - (-3 - -17)))) + (1 - -26) 14 What is -66 + -67 + 113 + -3 + 3 + 1? -19 What is 5 + -4 + 2 + 3 + (-11 - (-20 + 15))? 0 What is the value of 24 + (48 - -6) + -76? 2 Calculate 100 + (9 - 40) - 57. 12 What is 1 + -12 - (3 + 0 - (-32 - (26 + -52)))? -20 Calculate -3 + -1 - -67 - (-101 + 128). 36 Calculate -21 + (8 - 3) - (21 + 0). -37 -37 + 44 + 16 + -72 -49 What is 1 + -32 + (4500 - 4425)? 44 Evaluate -288 + 249 - (4 - 32). -11 0 + -4 - (-52 - -12 - -82) -46 What is the value of -36 + -21 + 37 + 77? 57 What is (-34 - -8) + -5 + -24 + 129? 74 What is the value of 8 + 4 + 76 + -52? 36 3 + 8 + (-12 - (-13 - -14)) + -31 -33 Evaluate 16 + -16 - (8 + -18 + 11 - (-3 + 0)). -4 What is (-1 - 68) + (2183 - 2106)? 8 (7 - 1) + (-2 + 7 + 37 - 9) 39 What is the value of (-2 + 7 - 12) + 1 + -5 + 7 + -5? -9 2 + -56 - (69 + 2 + -35 - 23) -67 Calculate -4 + -2 - (14 + -3 + 17 + -16). -18 What is 29 + (62 - 78) - (0 + -1 - 0)? 14 What is the value of 69 - ((-143 - 17) + 130)? 99 What is the value of -3 + 61 + (25 - 34) + 12 + -3 + 0? 58 Evaluate 25 - 7 - (-18 - (-51 - -31)) - 119. -103 -50 + 20 + -25 + 84 + -42 -13 -113 + 118 + 29 + 74 108 Evaluate (965 - 964) + 1 + (10 - (1 - 2)). 13 (3 + -24 - -6 - (13 - 12)) + -1 -17 What is (4 - 1 - (-230 + 283)) + 13 + 2 + -15? -50 What is the value of 108 - -5 - (-900 + 1031)? -18 Evaluate -24 + 7 + -12 + 14 + -65 + 7. -73 What is -1 + 11 - (-3 - ((-10 - -21) + 0))? 24 (-104 - -120 - (-3 + 26)) + 92 - 14 71 What is 46 + (73 - 38) + -9? 72 Evaluate -23 + 32 + 1 + 1 - -33. 44 What is (-1 - (1 - -11)) + (-141 - (-177 - -29))? -6 What is the value of -7 + 9 + 15 + (49 - 58)? 8 What is the value of -10 + 8 + 5 - (4 - 74)? 73 Calculate (-560 - -597) + -60 + 3. -20 What is -8 + 1 + 17 + -3 - (-10 + 20)? -3 -12 + 27 + (25 - 44) -4 12 - (3 - (7 + 1 - 6)) - (-76 - 0) 87 What is (33 + 9 - 57) + -15 + 3 + 1? -26 (458 + -433 - (0 + 28)) + 3 + -2 -2 Calculate (-8 + 2 - -2) + (663 - 657) - 17. -15 What is the value of (160 - 1) + (-261 - (40 + -280))? 138 Evaluate -52 + (80 - (-24 + 58)). -6 What is the value of (-26 - -34) + ((8 - (13 + -7)) + -7 - -2)? 5 -49 + 2 + 1 + (-63 - -4) + 68 -37 Evaluate (-5 - (2 - -2)) + -3 + 15 - (8 + 107). -112 Evaluate 7 + (-304 - -222 - (-3 + -11 + -1)). -60 -8 - -11 - (-5 + 67 - (8 + -2 - 14)) -67 Calculate -18 - (6 + 8 + -12 + (-12 - -20)). -28 What is the value of 7 + (-81 - -76) + (2 - 12) + -3? -11 Evaluate (-33 - (-40 - -9)) + 31 + -10. 19 Evaluate 38 + (34 - 44) + 67. 95 Evaluate (-30 - (-16 + -2) - -26 - 11) + 2. 5 What is (5 - -21) + (79 + -83 - (1 + 4))? 17 Evaluate 16 + 0 + (11 - (32 - -61) - -39). -27 What is -9 - (12 - (-8 + 38)) - (-2 + 3 + -7)? 15 57 + (7 - (14 - 6)) + -10 46 Evaluate (-3 - -1 - -22 - (879 - 980)) + 5. 126 Calculate 3 + -16 + -3 - (54 - -87 - 145). -12 What is the value of (-72 - -80 - (-3 + 21)) + 1 + -15? -24 What is the value of 9 + -6 + -15 + 38 + -34? -8 What is -32 + 45 + -16 + (2 - (-82 - 7))? 88 Evaluate (-56 - -118 - 1) + 37. 98 What is -1 - (16 + 23 - 62)? 22 What is -78 + 76 + 25 + -100? -77 What is -1 - -2 - -1 - (-42670 - -42597)? 75 Evaluate -30 - (14 + 9 + -36 + 2). -19 96 - 115 - (-38 - -3) 16 Evaluate 18 + -35 + (-4 - -6) + -4 - 9. -28 9 - -34 - 22 - (27 - 8) 2 Calculate 4 - (6 - (1 + (-11 - -29)) - (2 - 8)). 11 Calculate -30 + (14 - 52) + 52. -16 Calculate (2 + -1 + -60 - 1) + (-6625 - -6630). -55 What is the value of 6 + (9 - 5) + -70 + -2 + 12 + -17? -67 What is -161 + -96 + (158 - -88)? -11 Evaluate -113975 - -113968 - (19 + 0 + 0 + -1 + 0). -25 Evaluate (-6 - (7 - (-4 + 5))) + (17 + 9 - -1). 15 Calculate 3 + 40 - (11 + -15 + -9). 56 What is 105 - (121 + -49 - -66)? -33 What is -46 + 20 - (-44 + 40)? -22 Evaluate (-103 - 1) + -3976 + 4018. -62 Calculate (36 - (35 + -8 + -17)) + 95. 121 Evaluate -114 + -1 - (6705 + -6774). -46 What is 11 + (-4 - 0) - (68 + -19)? -42 -1 + 0 + -59 + -15 + 57 + -41 -59 Evaluate -11 - (28 - (-36 - -62)). -13 What is the value of 93 - 0 - (2524 - 2482)? 51 Calculate (-257 - -389) + 54 + -209. -23 What is the value of (2 - -6) + -4 - -47 - (-7 - (-14 - -1))? 45 -23 + 71 + (30 + 7 - 21) 64 What is 57 + 2 + (-750 - -685)? -6 What is the value of -431 + 320 - (-166 - 25)? 80 Calculate (2 - -14) + (-17 - -8) - (-54 + 1). 60 Evaluate -7 + 61 + (-1 - 0 - (-87 + 96)). 44 What is the value of 17 + (-27 - 7) + 9 - (-3 + -2) - 74? -77 Calculate -10 + 26 + -53 + 21 - (2 - -60). -78 What is -3 + 40 - -6 - (338 + -331)? 36 Evaluate 11 + 17 - 5 - 32 - (8 - -1). -18 Evaluate -90 - (40 + -51) - 50. -129 What is -1 + ((-5 - -9) + 0 - 9) + 3 + 65? 62 What is the value of 44 + 6 + (-5 + 12 - -9) + 9? 75 Calculate 30 - (0 - (31 + -32 - 110)). -81 38 - (1 - -19 - (87 - 77) - 14) 42 ((-50 - -2) + 38 - -9) + (51 + 0 - 0) 50 What is the value of (-16 - -54 - (-7 - -39)) + -19? -13 (-91 - -136) + (-17 - 2) 26 Calculate -50 + 44 + 78 - 99. -27 Calculate 5 + (-14 - -12) + (21 - 23 - (55 + 0)). -54 What is -1 + 0 + 77 + 417 + -417 + -20 + 11? 67 Calculate 82 + -117 + 28 - (23 + 2). -32 -59 + -16 + 36 + -1 -40 What is (3 - -19) + -3 + 11 + -11? 19 (-1 - 19) + 5 + -24 - -26 -13 Evaluate -16 + (4 - 1) - (-160 - -165 - 136). 118 Evaluate (13 - 6 - 7) + (-164 - -85). -79 Evaluate (14 - (-50 + 41)) + -43. -20 What is the value of (19 - (16 - -3)) + 8 + 28 + -2 + 0? 34 What is 141 + (-29 - (-14 - 20 - -40))? 106 What is the value of 98 + -87 + (-3 - (11 + -2)) - (0 + -1)? 0 21 + -70 - (-35 - 42) 28 What is the value of 27 - (-229 + 253 - (-1 - -12 - -4))? 18 What is the value of 41 + 2 + -4 - (-139 + 63 + 85)? 30 Evaluate 1 + 21 + -21 + (-3 - -13) + -8 + 105. 108 What is the value of (-7 - (-14 - -11)) + 0 + -3 + -31 + -2? -40 (6 - (-4 + -1)) + 84 + -96 - 35 -36 What is the value of 37 + -18 + 37 + -38 + -86 + -1? -69 Evaluate -38 + 93 + -134 + 58. -21 Calculate 63 + 81 + (-138 - 32). -26 What is the value of (0 - (-2 + -3)) + (9 - 40) + -3? -29 -28 - (11 + 9) - (-13 - -20) -55 -10 + -35 - 71 - (-33 + 1) -84 What is the value of -60 + 11 + (6 + -14 - 2) + (-6 - -5)? -60 Calculate -116 + 108 + (9 - 0) - (-2 - -13). -10 Calculate -22 - -8 - (7 + -24 + 27 + 102). -126 Calculate (-13 - (-1 + 18)) + 10 + 0 + -99. -119 What is the value of	{ "pile_set_name": "DM Mathematics" }
at are the prime factors of q? 5 Suppose -6q - 6 = v - q, 0 = 2v - 4q - 2. Let a be (v/2)/(2/(-284)). Suppose a = 4s - 33. List the prime factors of s. 2, 13 What are the prime factors of (-11 - -5) + 405 - -7? 2, 7, 29 Let w(h) = -h*3 + 3h*2 + 2h - 1. Let s be w(2). Suppose k - 9 = -s. Suppose 0 = 3q + 3b - 36, -2b = -kq - 0b + 8. What are the prime factors of q? 2 Let s(l) = l3 + 4. Let j be s(-5). Let u = -84 - j. Suppose -4m + 83 = -u. List the prime factors of m. 2, 3, 5 Let z = -157 - -1426. List the prime factors of z. 3, 47 Suppose 15b = -590 + 14285. List the prime factors of b. 11, 83 Let j(w) = 13 + 2 + 8 + 28w + 3. List the prime factors of j(4). 2, 3, 23 Suppose 2f = f + 1045. List the prime factors of f. 5, 11, 19 Suppose -6 = -2f + 2h - 2, 3f = 4h + 6. What are the prime factors of (-1)/2(4 - f) - -73? 2, 3 Let k(h) = -243h - 175. What are the prime factors of k(-7)? 2, 7, 109 Suppose 5s = 20, -3x = 4s - 3396 - 2266. List the prime factors of x. 2, 941 Let s(p) = -p*3 - 5p*2 + 7p + 10. Suppose o = 7 - 14. List the prime factors of s(o). 59 Suppose 2z + 152 = 6z. List the prime factors of (-33)/(-2) + 57/z. 2, 3 Let c(f) = 1880f2 + 2f - 1. List the prime factors of c(-1). 1877 List the prime factors of 3 + (3/(-12) - (-29964)/48). 3, 11, 19 Let s be (52/10)/(5/150). Let k be ((-1)/(-3))/((-4)/s). Let t = 27 + k. What are the prime factors of t? 2, 7 Let a be (-1 - (1 - 3)) + 0. Let o = a + 4. Suppose om - 5f - 110 = -3f, -2m + 38 = -2f. List the prime factors of m. 2, 3 Let t = 570 - 328. What are the prime factors of t? 2, 11 Let b be (-1 + 17)(-7)/(-14). Suppose j - 10 + b = 0. Suppose -4a = -ja + 2, -u + 4a + 19 = 0. List the prime factors of u. 3, 5 Let s(j) = 7 + 4 - j2 + 9j - 2. Let i(v) = -v*3 + 7v*2 - 10v - 1. Let d be i(4). List the prime factors of s(d). 23 Suppose -4b - 977 - 1731 = -3g, g = -5b + 871. What are the prime factors of g? 2, 7 What are the prime factors of (0 - -4) + -1 - -1171? 2, 587 Suppose -47n = -33n - 14434. List the prime factors of n. 1031 Let k(g) = -3g + 68. List the prime factors of k(-22). 2, 67 Let f = 28 + -27. What are the prime factors of -2 - (f/(-1) - 79)? 2, 3, 13 Let n(r) be the first derivative of r*4/4 - 4r*3 - 11r*2/2 - 3r - 3. Let h be 80/6 - (-5)/(-15). List the prime factors of n(h). 23 Suppose -x + c + 0 = 2, 0 = 2c - 8. Suppose 3u - xz + 5z = 24, -5u - z = -28. Suppose ut - 60 = -0t. List the prime factors of t. 2, 3 Let s(y) = y3 + 2y*2 - y - 1. Let a be s(0). Let o(r) = -22r - 1. What are the prime factors of o(a)? 3, 7 Suppose -21x + 18x + 84 = 0. What are the prime factors of x/7 - (-140 - 2)? 2, 73 Let y(v) = -2v3 + 4v*2 + 6v - 9. Let l be y(2). Suppose 13 + 5 = 2x. What are the prime factors of (-2)/xl-3? 2 Suppose 10q - 2q = -16. List the prime factors of (0 - -16) + (9/(-3) - q). 3, 5 Let m(y) = -3500y*3 + 4y*2 - 11y - 12. List the prime factors of m(-1). 31, 113 What are the prime factors of 54/810 - (-12074)/15? 5, 7, 23 Let z = -13 + 34. Let s = z + -19. What are the prime factors of s(-11)/4-6? 3, 11 Suppose 4k + 128 = -7u + 3u, 3u = 5k - 96. List the prime factors of (0 - u)/((-1)/(-2)). 2 Suppose 19h - 2948 = -364. Let b = 237 - h. What are the prime factors of b? 101 Let t be 2/4(1 - -3). Suppose -2l - tl = -40. What are the prime factors of l? 2, 5 Suppose 2o - o + 73 = 2g, 2o - 142 = -4g. Suppose 5w - 3w - 8 = 0. Suppose g = wy - y. List the prime factors of y. 2, 3 Suppose 2l = 4k - 0l - 564, 0 = -k + 5l + 132. Let x = -86 + k. List the prime factors of x. 2, 7 Let t be -1 - -4 - -13(1 - -163). What are the prime factors of -1 + ((-2)/5)/((-7)/t)? 11 Let n(v) = 39v*2 - 9v - 8. Let a = -123 + 122. List the prime factors of n(a). 2, 5 Suppose -39l + 18048 = -23l. List the prime factors of l. 2, 3, 47 Suppose -2p - 3p = -15. Suppose -4j + p + 5 = 0. Suppose 27 = jd + d. What are the prime factors of d? 3 Let k(v) = -6v + 14 - 3 - v. Let l be k(-7). Let s = l - 27. List the prime factors of s. 3, 11 Suppose -37u - 10u + 151810 = 0. List the prime factors of u. 2, 5, 17, 19 Let m = 8 + -8. Let j = -6 - -11. Suppose m = -jp - 75 + 310. What are the prime factors of p? 47 Suppose -9 + 9 = -3j. Suppose -n + 96 - 5 = j. What are the prime factors of n? 7, 13 Let q(n) = -2n - 21. Let a be q(-15). What are the prime factors of a1 + 5 + -6? 2 Suppose -5j - u + 448 = -2285, 0 = 2j - 4u - 1080. What are the prime factors of j? 2, 3, 7, 13 Let l be (-2 - -4)1 + -1 + 0. List the prime factors of (-7)/5 + l - (-387)/5. 7, 11 Let t(s) be the third derivative of 3s5/10 - s4/24 + 7s3/3 + 5s*2 - 5s. What are the prime factors of t(3)? 173 Suppose -4t - 4u = -872, -34 = -5u - 9. What are the prime factors of t? 3, 71 Suppose 31l - 37341 = 4l. What are the prime factors of l? 3, 461 Let g be (1 + -145)(-4 - 60/(-18)). Let x = -89 + g. What are the prime factors of x? 7 Suppose -6k + 81 = -3k. Let s = k + -7. Suppose -q - 2i = -13, -2q - 2i + s = -4i. List the prime factors of q. 11 Suppose 5u - 2m = 50, 2u - 1 = -4m - 5. Let y be (u/(-10))/(4/(-20)). Suppose -15 - 5 = yh, -5s + 35 = 5h. What are the prime factors of s? 2, 3 Suppose 0 = 12w + 284 - 1316. What are the prime factors of w? 2, 43 Suppose 5u = s - 2s + 152, -4s = -2u - 520. Suppose 8y - s = -4y. List the prime factors of y. 11 Let r be (3/(-2))/((-24)/32). List the prime factors of r/8 + (-239)/(-4). 2, 3, 5 Suppose 2s + 5b = -9, -4s - 6b + 2b - 48 = 0. Let l = s + 33. What are the prime factors of l? 2 Let q = -310 + 489. List the prime factors of q. 179 Let l(w) = 2w*2 - 9w - 54. List the prime factors of l(-11). 7, 41 Let v(z) be the second derivative of 23z3/6 - z2/2 - 4z. What are the prime factors of v(3)? 2, 17 Let g(w) be the second derivative of -10w + 1/20w*5 - 5/12w*4 + 1/3w*3 + 2w*2 + 0. What are the prime factors of g(6)? 2, 13 Let w(g) = -2g + 9. Let q be w(6). Let j(v) be the third derivative of -v4/12 - v3/6 + 3v2. List the prime factors of j(q). 5 Let t = 31 + -26. Let i = 73 - t. List the prime factors of i. 2, 17 Suppose 3g = r - 5, 6g - 2g = r - 1. Suppose 0 = rh - 0h - 1938. What are the prime factors of h? 2, 3, 19 Let j(b) = -2b + 91. List the prime factors of j(-28). 3, 7 Let j = -5 - -6. Let c be (-2 - (-26)/j)/1. Let y = c + 20. What are the prime factors of y? 2, 11 Suppose 300 = i - 5g, g = -3i + 5i - 609. What are the prime factors of i? 5, 61 Suppose 3x + 2z = 4x + 12, 2x - 3z = -23. Let v(j) = -6j - 3. List the prime factors of v(x). 3, 19 Let y = -10 - -10. Suppose y = -0x - 3x - b - 104, -2x = -5b + 58. Let q = x + 50. List the prime factors of q. 2 Let j be (-2 + 5 - 2) + -7. Let r(b) = 12b2 - 3b + 1. Let t be r(2). Let d = t + j. What are the prime factors of d? 37 What are the prime factors of 282/329(-8071)/(-3)? 2, 1153 Suppose 3n = x - n + 12, n = 4x + 3. Suppose 5g + 5w = 490, x = -5g + w - 3w + 493. List the prime factors of g. 3, 11 Suppose -g + 13 = 4q, 5g - 7 + 17 = 5q. Let t(m) = -40m + 13. Let z(r) = -100r + 32. Let h(i) = 12t(i) - 5z(i). What are the prime factors of h(q)? 2, 7 List the prime factors of 25646/30 + 4 + 290/(-75). 3, 5, 19 Let m(h) = -h*3 + 5h*2 - 2h - 1. Let k be m(5). Let t = k + 14. Suppose 16 = -f + 2f - 5u, -tf + 3u + 60 = 0. List the prime factors of f. 3, 7 What are the prime factors of (4211 - 11) + 9 - 2? 7, 601 Suppose 9i = -3i + 3132. What are the prime factors of i? 3, 29 What are the prime factors of (-2)/6 - 11048/(-24)? 2, 5, 23 Let a = 5921 + -1389. List the prime factors of a. 2, 11, 103 Suppose 93j + 3297 = 100j. List the prime factors of j. 3, 157 Let y = -152 - -313. What are the prime factors of y? 7, 23 Let m(c) = -c*3 + 10c*2 + c + 10. Let z be m(10). Let p = -23 + z. Let o = 8 - p. List the prime factors of o. 11 Suppose -382 - 1103 = -11o. What are the prime factors of o? 3, 5 Let j(n) = n*3 - 37n*2 + 69n + 39. Let u be j(35). Let f be (3/2)/((-2)/(-4)). Suppose -fd = -ud + 11. What are the prime factors of d? 11 Let w be (-1)/3 - (-8)/(72/75). Suppose wt = 2t + 372. Wh	{ "pile_set_name": "DM Mathematics" }
9180342h - 9180393h - 663 for h. -13 Solve 519o - 726245 = -773474 for o. -91 Solve 149k + k + 738 + 263 = 101 for k. -6 Solve 0 = -106759a + 102763a + 203796 for a. 51 Solve 14f + 5860 + 3833 = -142f - 759 for f. -67 Solve 0 = 29y + 35y + 44452 - 45348 for y. 14 Solve 89825v + 2700 - 160 = 89698v for v. -20 Solve 18165 + 89946 + 192145 = -3412b for b. -88 Solve -17577 + 41107 = -905h for h. -26 Solve 2p = -10p + 19 + 299 + 246 for p. 47 Solve 7584 = -601s - 1431 for s. -15 Solve -1290o - 3825o = 832o + 2229o + 416976 for o. -51 Solve -11666 + 14220 = 564x - 22826 for x. 45 Solve -13x + 8x - 289 - 294 + 218 = 0 for x. -73 Solve 364v = 341v + 617v + 443v + 42517 for v. -41 Solve 13282 = 1682c - 48960 + 8853 - 3799 for c. 34 Solve 976 - 1691 = 927r - 2473 - 4731 for r. 7 Solve -12l + 2827 = 200l - 1413 for l. 20 Solve 2158u = 3504u + 55186 for u. -41 Solve -64112 = -1176i + 682 - 7170 for i. 49 Solve 0 = 12276d - 414591 + 156795 for d. 21 Solve 7n + 412n = -54n - 4530 - 5403 for n. -21 Solve -241 - 370 - 496 = -41f for f. 27 Solve -490u + 528u + 1714 = -908 for u. -69 Solve -17w - 218 = -119 - 405 for w. 18 Solve 36n - 364n - 12642 = 274n for n. -21 Solve 6914l + 25164 = 4817l for l. -12 Solve -130f - 38957 = -29987 for f. -69 Solve -519 - 61319 = -631h for h. 98 Solve -158k + 516 = -109k + 1147 + 1280 for k. -39 Solve 3106t - 191289 = -27286 - 71360 + 221063 for t. 101 Solve 0 = 1183833i - 1184002i - 15210 for i. -90 Solve -11v - 62v - 4862 = 63v - 1190 for v. -27 Solve 0 = -1957f - 5354 + 3667 - 60937 for f. -32 Solve -33f - 96f + 3589 = -32f for f. 37 Solve 436c - 845 = 27 for c. 2 Solve -1768 = 161i - 5504 - 8822 for i. 78 Solve -7120z = -6971z - 4917 for z. 33 Solve 527t - 461t - 2046 = 0 for t. 31 Solve 9843m - 9567m = 0 for m. 0 Solve 1312 - 993 + 165 + 6896 = -123r for r. -60 Solve 63v + 100v = 1827 + 112 - 309 for v. 10 Solve 2340 = 158p - 820 for p. 20 Solve -37l + 301 + 284 = -2058 + 90 for l. 69 Solve 11j + 6372 = 6603 for j. 21 Solve -10569m + 699 = -10336m for m. 3 Solve -13194 - 2591 = -521m - 3370 + 2694 for m. 29 Solve 7u - 11u - 300 = -20u + 52 for u. 22 Solve 52971 + 13176 - 297427 = 8260c for c. -28 Solve -64579 = 49t - 62815 for t. -36 Solve 13518 - 9036 = -166w for w. -27 Solve -1466c + 408c - 48090 = -600c for c. -105 Solve 0 = 202c + 421 - 3451 for c. 15 Solve 4469 + 4468 - 5582 + 1349 = -147w for w. -32 Solve 255x - 95965 = -4008x - 2179 for x. 22 Solve 316n = 12207 + 7069 for n. 61 Solve 7531u - 128368 = 5723u for u. 71 Solve 15n - 36n - 112n = 9n + 6390 for n. -45 Solve 266b - 1047b = 59356 for b. -76 Solve -920z + 63z - 4945 = -97z + 43695 for z. -64 Solve 879 = 55h + 108h + 4791 for h. -24 Solve 171r + 17337 = 17850 for r. 3 Solve 29s + 21748 - 23053 = 0 for s. 45 Solve 21w + 222w - 41w + 9090 = 0 for w. -45 Solve 15187 = 1984g - 2270g + 4283 - 13692 for g. -86 Solve 1327992 = -19381s - 222488 for s. -80 Solve -440l + 1608 = 7003 + 765 for l. -14 Solve -889440 = 1704y - 10424y for y. 102 Solve -2330a + 154918 - 36834 + 122384 = 28438 for a. 91 Solve 0b + 20b + 6660 = -165b for b. -36 Solve -2134y + 29724 = -2286 for y. 15 Solve -8l - 10l + 1040 = 8l for l. 40 Solve 0 = 155081k - 155245k + 6560 for k. 40 Solve 7122o + 367658 = -142391 + 11509 for o. -70 Solve 49o + 56240 = -935o - 682o + 186o for o. -38 Solve -29513q = -451106 - 2441168 for q. 98 Solve -196868d + 1406 = -196905d for d. -38 Solve 36x + 33x + 30x = -97x + 13524 for x. 69 Solve 718 = -470812n + 470094n for n. -1 Solve 2g + 69458 = 69432 for g. -13 Solve -163 = -42k + 1852 - 461 for k. 37 Solve 1248j + 415j = -19062 - 32491 for j. -31 Solve 1988p + 2201p + 28583 = -217148 + 65604 for p. -43 Solve -4945 = -366h + 1388h - 36627 for h. 31 Solve -83182 + 93282 = -1010j for j. -10 Solve 215w + 6278 = -1267w - 20398 for w. -18 Solve -5686t + 1730t + 336260 = 0 for t. 85 Solve -98y + 594y - 193y - 2977 = 74y for y. 13 Solve -243x - 29405 - 9755 = 469x for x. -55 Solve 1259q = 763q - 1581q + 43617 for q. 21 Solve -82l + 7162 - 7982 = 0 for l. -10 Solve 0g + 25 - 55 = -g - 40 for g. -10 Solve -79r = 110902 - 113509 for r. 33 Solve 7137 = 359q + 13277 + 26888 for q. -92 Solve 59u - 175u - 86037 + 94469 = 156u for u. 31 Solve -78g + 971 - 3202 - 889 = 0 for g. -40 Solve -208i = -44070 + 48438 for i. -21 Solve 30992 = -16503r + 17695r for r. 26 Solve 0 = 1998i - 1317i - 38136 for i. 56 Solve 0 = 1871y - 112056 - 144271 for y. 137 Solve -10899 + 29480 + 22319 = -2646r - 33188 for r. -28 Solve 111x + 478467 = 475026 for x. -31 Solve 24a + 12 + 31 = 20a - 21 for a. -16 Solve 12545418v + 936 = 12545431v for v. 72 Solve -51611 + 4677 = -1514n for n. 31 Solve 999q + 13074 = 48986 + 38014 for q. 74 Solve 0 = -4692p - 7037p - 691p + 571320 for p. 46 Solve 1766s - 2571 + 1435 = -51902 - 2214 for s. -30 Solve 11 + 201 = 14b - 250 for b. 33 Solve 209o = 787o + 8670 for o. -15 Solve -9155 - 13525 = 1620b for b. -14 Solve 0 = -2882i - 20241 + 314205 for i. 102 Solve 178w + 277w + 242w + 34400 = 297w for w. -86 Solve -259 = -96i + 1565 for i. 19 Solve 0 = -37w + 399788 - 398160 for w. 44 Solve -225t + 8648 = 13148 for t. -20 Solve -4423h + 1167h + 14684 + 35891 + 30825 = 0 for h. 25 Solve -30920 + 47 = 988n + 15563 for n. -47 Solve 0 = -17186z + 17118z - 3672 for z. -54 Solve -3174 = 128z + 2074 for z. -41 Solve -4792 - 2753 = -1245d - 176d + 20875 for d. 20 Solve -171c - 1650 + 231 = 975 for c. -14 Solve 6786 = -1326k + 487k + 11788 + 9261 for k. 17 Solve 16818j - 2184 = 16680j + 1956 for j. 30 Solve -168891d = -169097d + 8240 for d. 40 Solve -829s - 4477s + 55860 = -535s - 15705 for s. 15 Solve -226m + 10m + 3849 = -41m + 1224 for m. 15 Solve 542z + 235z + 108z - 6935 = 8110 for z. 17 Solve -22680m + 22590m = -1800 for m. 20 Solve 8t - 1918 = -2102 for t. -23 Solve 802c - 269c - 550 = -11210 for c. -20 Solve 105z + 2315 + 1910 = 950z for z. 5 Solve -73530p - 28272 = -74026p for p. 57 Solve 11002 + 3468 = 290c + 2000 for c. 43 Solve -885l - 17248 = -1501l for l. 28 Solve -12145z = -12846z + 11216 for z. 16 Solve -50m + 2126 + 2102 = 63m + 499 for m. 33 Solve 2433d = 36983 + 21409 for d. 24 Solve 5712 - 12784 = 450z + 17327 + 7101 for z. -70 Solve -1087q = 7582 + 71769 for q. -73 Solve 0 = 102015m - 102121m - 2438 for m. -23 Solve -1556v + 72952 = -31300 for v. 67 Solve -176296y = -175988y - 24640 for y. 80 Solve 34046 = 1718i - 2305i for i. -58 Solve 2907y - 2721y = 10416 for y. 56 Solve 240n - 598n = 495n - 22n for n. 0 Solve 6762m = 6488m - 27948 for m. -102 Solve -4315 - 54257 = -862c + 18815 + 1055 for c. 91 Solve 816l = -30l - 91l - 63716 for l. -68 Solve -5667 - 14021 = 188b + 56 + 3568 for b. -124 Solve 420k - 1383k - 17820 + 46350 = -118809 for k. 153 Solve 133a + 11722 = -163a + 2842 for a. -30 Solve -79q - 85q - 101q + 12190 = 0 for q. 46 Solve 9a + 456 - 609 = -423 for a. -30 Solve -8641 = 63y - 11413 for y. 44 Solve -66h + 347h + 12688 - 4645 = -6288 for h. -51 Solve 1161o - 782o = -1255o - 127452 for o. -78 Solve -18396 = 1341u - 96174 for u. 58 Solve -6693v - 782543 - 87547 = 0 for v. -130 Solve 507x - 5593 + 3314 = 7861 for x. 20 Solve -13105 = 1966f + 28794 + 21013 for f. -32 Solve -1232g - 2439 - 2865 = -1310g for g. 68 Solve -312p = -1201p - 39154 + 16929 for p. -25 Solve -44845 = 4898r + 2419r + 342956 for r. -53 Solve 249a + 16400 - 2840 = -164a + 74a for a. -40 Solve -414m + 1728 = -342 - 1120 - 122 for m. 8 Solve 144372 - 33749 = 2267g - 77538 for g. 83 Solve -227d - 473 = 6d + 124d - 116 for d. -1 Solve -8710 = -38668b + 38802b for b. -65 Solve 47h - 147h = 238h - 4732 for h. 14 Solve 2974r + 5814r - 1783r - 202795 = 574760 for r. 111 Solve -860d - 3405 = 26695 for d. -35 Solve -2376k - 14673k - 190930 = 525448 + 16729 for k. -43 Solve -1058b + 36077 + 953 = 0 for b. 35 Solve -508341 = 9639n - 1462602 for n. 99 Solve 237c - 97c = 129c - 176 for c. -16 Solve -121965 - 206229 - 153450 = 4722k for k. -102 Solve 483m + 0m = -371m + 34160 for m.	{ "pile_set_name": "DM Mathematics" }
(b) 2 (c) -1/7 (d) 0.4 d What is the biggest value in -16/13, 1.1, 4? 4 What is the third smallest value in 67/5, 5, -0.4? 67/5 Which is the third smallest value? (a) 3 (b) -17/2 (c) -0.034 (d) 1 d What is the second biggest value in 7, 51, -4? 7 What is the fifth smallest value in -0.2, 3/2, 0, 1, -3/2? 3/2 What is the second biggest value in -4, 0.07, 2/5? 0.07 What is the biggest value in 1/5, 0.6, 1, 2/13, 0.3? 1 Which is the biggest value? (a) -4 (b) 0.33 (c) 3 (d) 0 c Which is the biggest value? (a) 271 (b) -2 (c) 0.1 (d) 1/7 a Which is the biggest value? (a) 1 (b) 0.5 (c) -77 a Which is the third smallest value? (a) 0 (b) -3 (c) -0.09 (d) 11/3 (e) 1 a Which is the second smallest value? (a) -1/2 (b) -561 (c) -10 c What is the third smallest value in -0.1, -61/5, 2/15, -3, 0.3? -0.1 Which is the biggest value? (a) -0.3 (b) 77 (c) 2 b Which is the second biggest value? (a) -4 (b) -0.3 (c) -6 (d) -0.5 (e) 2/445 b Which is the fourth smallest value? (a) 4 (b) -6 (c) -0.09 (d) 0.02 a What is the fifth biggest value in -1/7, 10, 0, 46, -2/13? -2/13 Which is the fourth smallest value? (a) 3 (b) 0.5 (c) 15.1 (d) -55 c Which is the second smallest value? (a) 2/21 (b) -1/16 (c) -2/17 (d) 16/19 b Which is the third smallest value? (a) 0.2 (b) -1.2 (c) 8 (d) 5 (e) -1/3 a What is the fifth biggest value in 0.5, 2/33, 5, -2/7, -4? -4 What is the biggest value in -2/3, -46, 1, -5? 1 What is the second biggest value in 12, 4/15, 0.4, -1? 0.4 What is the third biggest value in 0.05, -2, -1, -56, -3? -2 Which is the second biggest value? (a) -9/14 (b) 0.2 (c) -83 (d) -0.3 d Which is the third smallest value? (a) -2/3 (b) -75/8 (c) 2/5 (d) 2/3 c Which is the fourth biggest value? (a) 4/9 (b) -0.07 (c) 5 (d) 0.1 b Which is the fourth smallest value? (a) -0.5 (b) 4 (c) 0.21 (d) 0.01 b Which is the biggest value? (a) -12/7 (b) -2 (c) 2 (d) -2/29 c What is the third smallest value in -4/9, -2, -1/6, 5? -1/6 Which is the second smallest value? (a) -4 (b) -11.2 (c) 7 (d) 1 a Which is the biggest value? (a) -4 (b) 4 (c) 0.01 (d) 14 (e) 5 d What is the smallest value in -3, 3/2, -2/15? -3 What is the fifth biggest value in 4/7, -2, -2/19, 14, 2? -2 Which is the third biggest value? (a) 0.2 (b) 59 (c) -3 c Which is the second biggest value? (a) 1 (b) -3 (c) -0.02 c Which is the fifth smallest value? (a) -5 (b) -4 (c) -2/15 (d) -3/2 (e) 12 e What is the fourth smallest value in 4, 0, 0.1, 8? 8 Which is the second smallest value? (a) 6 (b) 4/5 (c) -5 (d) 2 b What is the third smallest value in 2652, -4, 1/5? 2652 What is the second biggest value in 3.5, 6/13, -0.06? 6/13 What is the third smallest value in 0.9, -4, 9/20? 0.9 Which is the second biggest value? (a) 4/5 (b) 0.5 (c) -8 (d) 0.28 b Which is the second biggest value? (a) 2/5 (b) -1.3 (c) 5 (d) -0.02 a What is the third biggest value in 4, 0.4, 1.332? 0.4 What is the fourth smallest value in 7, -22, -1/7, 3, -4? 3 What is the third biggest value in -0.1, 71, 4? -0.1 What is the third smallest value in 4, -2/9, 1/9, 196, 2/3? 2/3 Which is the biggest value? (a) -0.2 (b) -1/3 (c) -1/4 (d) 2/9 (e) 135 e What is the third biggest value in -0.2, 1197, 2, 3? 2 Which is the second biggest value? (a) 5 (b) 232 (c) 3 a What is the second biggest value in 0.27, 0.4, 3/113? 0.27 Which is the second biggest value? (a) -34/7 (b) -0.1 (c) -7 a Which is the third smallest value? (a) -0.082 (b) 1.5 (c) 4 c What is the third smallest value in 2, -1, 16? 16 What is the second biggest value in 3, -59, 0.4? 0.4 What is the second smallest value in -0.1, -3, 6? -0.1 Which is the third biggest value? (a) 3 (b) 0 (c) 2 (d) -2/1023 (e) -1/3 b Which is the second biggest value? (a) 0 (b) 2/9 (c) 36 b Which is the second biggest value? (a) 0.5 (b) 3 (c) -33 (d) 4 (e) 2 b What is the third smallest value in -1/8, 1, 0.4? 1 Which is the second smallest value? (a) -4/3 (b) 4 (c) -3 (d) 2/9 a What is the third biggest value in 2/9, 3, -2/219? -2/219 Which is the smallest value? (a) -4/3 (b) -12 (c) 41 (d) -0.1 b What is the third smallest value in 46, 2.2, -2, 5/4, -4? 5/4 Which is the third smallest value? (a) 50 (b) -5 (c) 1/4 a Which is the third smallest value? (a) 3 (b) 0.1211 (c) 2/13 a What is the third smallest value in -0.25, 0.5, -2? 0.5 What is the second smallest value in 0.5, 5, -2, 1/19, -0.6? -0.6 Which is the second smallest value? (a) -2 (b) 18 (c) -0.5 (d) 0.3 (e) -0.4 c What is the smallest value in -0.031, 4, -2/7? -2/7 What is the biggest value in 47, -6, -19? 47 What is the smallest value in 2, 82, -21? -21 Which is the fourth smallest value? (a) 4/5 (b) -0.4 (c) -31 (d) 1/3 a Which is the smallest value? (a) -0.2 (b) 0.1733 (c) 0 (d) 1/5 (e) -0.1 a What is the smallest value in -3, 5, -0.38? -3 Which is the biggest value? (a) -3/34 (b) -13 (c) -1/4 a Which is the biggest value? (a) -2/7 (b) 0.052 (c) 4/5 c Which is the second smallest value? (a) -2/7 (b) 4 (c) 4/245 c Which is the fourth biggest value? (a) -4 (b) -1121 (c) -5/4 (d) -2/5 b Which is the biggest value? (a) -5/4 (b) 0.4 (c) 0.1 (d) -1686 (e) 2 e Which is the third smallest value? (a) 2 (b) -0.02 (c) 585 c Which is the biggest value? (a) 9/2 (b) -3 (c) 0.2 (d) 8 (e) 1/4 d What is the smallest value in -2/17, -0.3, -3? -3 Which is the third smallest value? (a) 3 (b) 4 (c) 5 c What is the fourth smallest value in -32, 0.2, -2, -5? 0.2 Which is the third smallest value? (a) -0.2 (b) 0.08 (c) -16 b What is the third biggest value in 0.3, -25321, 0.4? -25321 Which is the second smallest value? (a) -7/22 (b) 6 (c) 1/6 c What is the biggest value in 4, 1/7, -1, -15, -0.116? 4 What is the second smallest value in 0, 11, -11, -0.04, -1? -1 Which is the third smallest value? (a) 0.3 (b) 7.2 (c) 2/7 b What is the fourth biggest value in 5, 0.8, -0.4, -0.13? -0.4 Which is the third smallest value? (a) 4 (b) 144 (c) -0.07 (d) -0.5 a What is the second biggest value in -5, 2, -4, -3? -3 Which is the smallest value? (a) 5/6 (b) 2/3 (c) 1/6 c Which is the second biggest value? (a) 0.4 (b) -1/220 (c) 7/5 (d) -0.2 a What is the third smallest value in 1/18, -1.1, -4? 1/18 Which is the fourth smallest value? (a) 0.1 (b) 1/21 (c) 1/2 (d) 3/7 c What is the third biggest value in -2/17, 3/7, -4575? -4575 Which is the third biggest value? (a) -4 (b) 1/108 (c) 2 a What is the fourth biggest value in -24, -0.1, 3/29, 2/3? -24 Which is the third smallest value? (a) 0.06 (b) 0.1 (c) -120 (d) -0.1 (e) 1/4 a Which is the biggest value? (a) 0.51 (b) 4 (c) -1/9 b What is the fourth biggest value in 3, 0, 6, -5, 0.027? 0 Which is the third biggest value? (a) -1 (b) 0.4 (c) 1 (d) 257 b What is the smallest value in -70, 4, -4, -6? -70 Which is the second smallest value? (a) 3/5 (b) -4 (c) 21 a What is the third biggest value in -1, -4/5, -0.4? -1 What is the biggest value in -0.31, 3, -5? 3 Which is the second biggest value? (a) 2/33 (b) -0.91 (c) 2 a Which is the third smallest value? (a) -1/5 (b) -3/2 (c) 5 (d) -2/9 a Which is the fourth smallest value? (a) 0 (b) 37 (c) 0.4 (d) -3 b Which is the smallest value? (a) -3 (b) -0.3 (c) -5 (d) 1/5 c What is the smallest value in -0.13, 0.2, 2? -0.13 Which is the second biggest value? (a) -8/55 (b) 2 (c) -0.3 (d) 5 b What is the second smallest value in -1/9, -21, -2, -1, -0.8? -2 What is the second biggest value in -1/7, 3/116, -3, 4, 0.1? 0.1 Which is the third smallest value? (a) 1 (b) 1/367 (c) 2 c Which is the second smallest value? (a) 3 (b) -4 (c) 2/5 (d) 2.6 c What is the third smallest value in 10, -5, 0.05, 0.4? 0.4 Which is the fifth biggest value? (a) 4 (b) -5 (c) 36 (d) -1 (e) 1/4 b Which is the second smallest value? (a) -4/3 (b) 0 (c) -7 (d) 5 (e) 3/16 a What is the third biggest value in -182, 4, -0.2, -3, 0.1? -0.2 What is the second smallest value in -2/3, -3, 2/263, -0.1? -2/3 Which is the fourth smallest value? (a) 2/3 (b) 1/9 (c) -3/2 (d) 0.4 (e) 0.067 d What is the smallest value in -0.1, -3, 1, 5? -3 What is the fourth smallest value in -52, -2/3,	{ "pile_set_name": "DM Mathematics" }
1h. 164361h Collect the terms in -124335 - 20440p2 + 124335. -20440p*2 Collect the terms in 336q - 90q - 63q - 30 - 43q. 140q - 30 Collect the terms in 150125o2 - 75063o*2 - 75033o*2. 29o*2 Collect the terms in 90 + 1655q*3 - 446q*3 - 605q*3 - 90 - 605q3. -q3 Collect the terms in -59 + 0y + y + 20 - 82y + 20. -81y - 19 Collect the terms in 88a*2 - 44a*2 - 48a*2 + 57a - 2 - 875a. -4a*2 - 818a - 2 Collect the terms in 13d - 2079660d*3 + 2079419d*3 - 3d - 10d. -241d*3 Collect the terms in -220 - 15693q*2 + 5671q*2 + 220. -10022q*2 Collect the terms in -21u*2 - 74 - 106 - 104 + 503 + 18u*2 - 126. -3u*2 + 93 Collect the terms in -120b*3 + 269b*3 + 64b*3 + 330b*3 + 171b*3 + 93b*3. 807b*3 Collect the terms in 37r + 9r3 + 191r + 26r - 8r3. r3 + 254r Collect the terms in u - 31u - 39u - 45u - 155u - 3u + 2u2. 2u*2 - 272u Collect the terms in -20 - 89a + 134a + 53 + 122a - 33. 167a Collect the terms in 14287f - 40f*3 - 44f*3 + 83f*3 + 5130f. -f*3 + 19417f Collect the terms in 230w2 - 231w2 + 1494 - 1167. -w2 + 327 Collect the terms in 6790506c - 1490063c + 4363725c. 9664168c Collect the terms in -5804 - 5806 + 29i + 17410 - 5800. 29i Collect the terms in -13849688q - 189q*3 + 13849688q - 3q2 + 0q*2. -189q*3 - 3q*2 Collect the terms in 31 + 32 + 39 - 73 - 10v - 29. -10v Collect the terms in 148w*3 - 1230680w*2 + 1230686w*2 - 151w*3. -3w*3 + 6w*2 Collect the terms in -8f + 19f - 14f - 11f - 4f + 32f - 12f. 2f Collect the terms in 1685 - 332 - 15i*2 - 14i*2. -29i*2 + 1353 Collect the terms in 34454z - 12361z - 11046z - 11026z. 21z Collect the terms in -2993573b + 6b*3 + 1496838b + 1496735b. 6b*3 Collect the terms in -1441v*3 - 51 - 3292v*3 - 568v*3 + 51. -5301v*3 Collect the terms in -57837900304y + 57837900304y - 36y*3. -36y*3 Collect the terms in 945g - 13021g - 9133g. -21209g Collect the terms in -177n*2 + 342n*2 - 3 + 203n*2 + 526n*2 + 35n*2 + 5n*3. 5n*3 + 929n*2 - 3 Collect the terms in 480 - 976 + 496 - 7371w*2. -7371w*2 Collect the terms in 100k - 399k + 93k + 30 + 97k + 15k + 101k. 7k + 30 Collect the terms in -88904z + 266886z - 89047z - 89005z. -70z Collect the terms in 2292a - 12024a + 2432a + 2437a + 2436a + 2437a. 10a Collect the terms in -398i3 + 1466i*3 - 396i*3 - 236i*3 - 426i*3. 10i*3 Collect the terms in 3z - 12937135 + 12937135. 3z Collect the terms in -37w*3 - 54w*3 + 30w*3 - 8w*3. -69w*3 Collect the terms in 192 + 133 - 4110t + 4117t. 7t + 325 Collect the terms in 494s - 1470s - 466s2 + 486s + 490s. -466s*2 Collect the terms in -155723w*3 + 312440w*3 - 157012w*3. -295w*3 Collect the terms in 49 - 24w - 49w + 192w - 51w - 4 - 63w. 5w + 45 Collect the terms in -687 - 73f + 4f - 13 - 450 - 9f*2. -9f*2 - 69f - 1150 Collect the terms in -213 - 207 - 4648y + 628 - 208. -4648y Collect the terms in 2819496c3 - 2819505c*3 - 53c + 53c. -9c*3 Collect the terms in 2791k*3 + 2812k*3 + 2803k*3 - 8414k*3. -8k*3 Collect the terms in -5 + 21075u*3 + 19386u*3 + 5 - 40473u*3. -12u*3 Collect the terms in -61c*3 - 152c*3 - 78c*3 - 77c*3 + 487c*3 - 123c*3. -4c*3 Collect the terms in -956y*3 - 23y*2 + 36y*2 + 132y*3. -824y*3 + 13y*2 Collect the terms in -362q - 486q2 - 2 + 0 - 141q*2. -627q*2 - 362q - 2 Collect the terms in -5077 + 5077 - 187w3 + 698w*3. 511w*3 Collect the terms in 12898c*3 - 12891c*3 + 96c - 100c. 7c*3 - 4c Collect the terms in -179v + 0v2 - 7 - 15 - v2 + 0v2 - 86. -v2 - 179v - 108 Collect the terms in -24f - 3f*3 - 7f - 454f2 + f3 + 45f. -2f3 - 454f*2 + 14f Collect the terms in -917v - v2 - 16215v - 701v + 2052v - 4. -v*2 - 15781v - 4 Collect the terms in 2k2 + 1233k - 1233k - 1323 + 1299. 2k*2 - 24 Collect the terms in 394 - 132 + 298y - 133 - 129. 298y Collect the terms in 2a - 3a + 787707738a*3 - 787707879a*3 + a. -141a*3 Collect the terms in -2m*2 - 440 + 583 + 6m*3 + 783 + 7m*3. 13m*3 - 2m*2 + 926 Collect the terms in 7h + 56h2 - 98h*2 - 3316h*2 - 7h. -3358h2 Collect the terms in 204 + 199 + 226 + 5g - 794 + 165. 5g Collect the terms in 6589k*2 + 5k - 6589k2 - 143k*3. -143k*3 + 5k Collect the terms in -103q3 + 2789 - 5576 + 112q*3 + 2q + 2787 + 0q. 9q*3 + 2q Collect the terms in -7h + 35 + 45 + 16 - 127 + 31. -7h Collect the terms in -296y + 1502y + 641y + 582y + 835y - 335y. 2929y Collect the terms in 2u*2 - 246224952589 + 246224952589. 2u*2 Collect the terms in -30s*3 - 93s*2 - 24s*3 - 29s*3 + 101s*3. 18s*3 - 93s*2 Collect the terms in -15062n*3 + 32757n*3 - 499n*3 + 46681n*3 + 1 - 3n*2. 63877n*3 - 3n*2 + 1 Collect the terms in 240684i*3 + 6i + 0i - 6i. 240684i3 Collect the terms in 5 + 45964y - 7 - 23164y - 23697y - 8. -897y - 10 Collect the terms in -1112 - 3607d*2 + 1112. -3607d*2 Collect the terms in 764 + 2h + h*2 + 1155 - 2h - 2572. h*2 - 653 Collect the terms in -9k*2 - 3k + 3k - 3k*3 + 5487 - 5490. -3k*3 - 9k*2 - 3 Collect the terms in -716 - 715 - 698 + 18345f + 2129. 18345f Collect the terms in 13849s*2 - 55377s*2 + 13857s*2 + 13893s*2 + 13838s*2. 60s*2 Collect the terms in 5 - 600f - 803f - 1 - 4 + 2780f. 1377f Collect the terms in 2614c + 2669c - 5192c + 13. 91c + 13 Collect the terms in 61602h*2 - 30895h*2 + 3 - 30904h*2 + 1 - 4. -197h*2 Collect the terms in -198084l*2 + 396132l*2 - 198040l*2. 8l*2 Collect the terms in -79b*3 + 15b*3 + 24b3 + b3 - 48b + 16b*3 + 22b3. -b3 - 48b Collect the terms in 1622392 + 915j - 10j - 1622392. 905j Collect the terms in 487d + 3710d + 84538d + 23689d. 112424d Collect the terms in -415529i - 410757i + 815979i. -10307i Collect the terms in -14409l*2 - 14241l*2 + 29029l*2. 379l*2 Collect the terms in 10951 - 10951 - 1046r*3. -1046r*3 Collect the terms in 2 + 21586c*2 - 1702c*2 - 2 - 2929c*2. 16955c2 Collect the terms in -y3 + 18y3 + 454y + 2y2 - 906y + 432y. 17y*3 + 2y*2 - 20y Collect the terms in 0x3 - 1495x*2 - 1576x*2 - 4x*3 + 0x*3 - 1476x*2 + 4547x*2. -4x*3 Collect the terms in -130l*2 + 39l*2 + 134l*2 - 2l*2 + 6l*2 + 24l*2. 71l*2 Collect the terms in 6 - 12 - 15463767a*2 + 6. -15463767a*2 Collect the terms in -591 + 590 - 6h2 - h2 + 7h2 - 1086h*3. -1086h*3 - 1 Collect the terms in 1727r*2 - 5 - 3720r*2 - 3 + 1930r*2. -63r*2 - 8 Collect the terms in 29x*2 + 35x*2 - 1493x + 44x2 - 136x*2 + 30x*2. 2x*2 - 1493x Collect the terms in -3n + 3n*2 + 20798 - 6n*2 + 3n + 0n2 - 20801. -3n*2 - 3 Collect the terms in 2n*3 + 3 - 155n*2 + 977n*2 - 204n*2 - 465n*2 - 3 - 153n*2. 2n*3 Collect the terms in -477309g*2 + 25g - 55g + 238631g*2 + 30g + 238683g2. 5g*2 Collect the terms in -9 + 167v*2 - 100v*2 - 68v*2 - 3v + 40v. -v2 + 37v - 9 Collect the terms in -56r2 - 823r - 57r2 + 823r - 2r2. -115r*2 Collect the terms in -1251035j*3 - 1766109j*3 - 592768j*3. -3609912j*3 Collect the terms in 869r*3 - 465r*3 - 408r*3. -4r*3 Collect the terms in -237f + 50f + 54f + 31f + 53f + 56f. 7f Collect the terms in 20851399 - 84d - 20851399 - 21d. -105d Collect the terms in -52580c + 25483c + 28469c - 91942c - 61768c. -152338c Collect the terms in -88032a*2 + 44324a*2 + 44487a*2. 779a*2 Collect the terms in 79 + 16o*2 - 98 + 6525o - 13o2. 3o*2 + 6525o - 19 Collect the terms in -1660p2 - 4p*3 - 12094p*2 - 2130p2 + p3. -3p3 - 15884p*2 Collect the terms in 342578l*3 - 685190l*3 + 342570l*3. -42l*3 Collect the terms in 91 - 10q - 8q + 88 - 48q - 10q - 178. -76q + 1 Collect the terms in 3957c - 1437c + 3136c + 3919c - 1997c. 7578c Collect the terms in 53145w2 + 9w*3 + 53140w*2 - 159037w*2 + 52749w*2. 9w*3 - 3w*2 Collect the terms in -63 - 4949v + 2	{ "pile_set_name": "DM Mathematics" }
+ -1133? 101442 In base 2, what is -1 - -10000110001110111100? 10000110001110111011 In base 15, what is 19 + d90? da9 In base 5, what is 2 - 14214303? -14214301 In base 5, what is 4421044 + -10? 4421034 In base 4, what is 3232133 + -11? 3232122 In base 10, what is 2 - 197411? -197409 In base 8, what is 147703 - -22? 147725 In base 10, what is -90464 + 1? -90463 In base 14, what is -29 + 3d3? 3a8 In base 15, what is -3663 - -11? -3652 In base 10, what is -10332 + -55? -10387 In base 11, what is 5 - 31337? -31332 In base 4, what is -312113 - 12? -312131 In base 14, what is -8 - c257? -c261 In base 15, what is 2dc6a - 5? 2dc65 In base 16, what is 8 + -6352? -634a In base 2, what is 101011000101010010000 - 1? 101011000101010001111 In base 15, what is 159 - 19? 140 In base 14, what is 390 + 14? 3a4 In base 15, what is -139 + 38? -101 In base 16, what is -141 - 14? -155 In base 8, what is 4 - -551773? 551777 In base 15, what is -17e - -1? -17d In base 2, what is -111 + 100100101111? 100100101000 In base 10, what is -4 + 833104? 833100 In base 12, what is -13 + 44a42? 44a2b In base 12, what is -221 + 44? -199 In base 5, what is 133141121 - -2? 133141123 In base 16, what is -1148 - 120? -1268 In base 14, what is 96b + 12dc? 1c69 In base 5, what is 2 - 141410? -141403 In base 12, what is -5 + -26780? -26785 In base 4, what is -12200213 + 2? -12200211 In base 14, what is 144836 - 0? 144836 In base 7, what is -136 + -24266? -24435 In base 11, what is -310 + 29? -292 In base 14, what is 1bd + 83? 262 In base 5, what is -4244 - 221303? -231102 In base 5, what is 11 + -11140441? -11140430 In base 13, what is 2244 - 43? 2201 In base 5, what is 13 + 231333? 231401 In base 15, what is -41 - 19d? -1de In base 7, what is -225 - -1163? 635 In base 8, what is -53002 - -4? -52776 In base 16, what is -5 + 209da? 209d5 In base 4, what is 30211 + -100112? -3301 In base 2, what is -101 + 10101010010100101101? 10101010010100101000 In base 7, what is -2552 - -305? -2244 In base 16, what is -27051 - -2? -2704f In base 2, what is 1011 + 100111100010010011? 100111100010011110 In base 5, what is -1023 + -111110? -112133 In base 12, what is 30 - 13887? -13857 In base 5, what is -4023310 - 0? -4023310 In base 9, what is -300 - 115? -415 In base 11, what is 3a15 + 5? 3a1a In base 2, what is 100 + 100001010101110? 100001010110010 In base 8, what is 73150 + -4? 73144 In base 9, what is 3 - 234883? -234880 In base 16, what is 13 + -10667? -10654 In base 7, what is -110 + -162111? -162221 In base 3, what is -1020112021 + 11? -1020112010 In base 5, what is 3223402 + 4? 3223411 In base 16, what is a97 - 1d1? 8c6 In base 7, what is -450423 + 2? -450421 In base 8, what is -57051 + 14? -57035 In base 5, what is 0 + 314034002? 314034002 In base 8, what is -451023 - -3? -451020 In base 8, what is -106351 - 6? -106357 In base 4, what is 31 + 10223101? 10223132 In base 12, what is 4 + -2b814? -2b810 In base 3, what is 1000120200101 - -12? 1000120200120 In base 3, what is 11 + -11200111022? -11200111011 In base 9, what is -210 - -237? 27 In base 11, what is 2 - -14343? 14345 In base 10, what is 389 + 91? 480 In base 14, what is 6945 + 5? 694a In base 8, what is -160464 + -3? -160467 In base 16, what is -8f8 + 9? -8ef In base 2, what is -10001110 - -1010110? -111000 In base 2, what is -1000010000011111 - -1? -1000010000011110 In base 11, what is -2399 + -a? -23a8 In base 6, what is -2 - 555552? -555554 In base 12, what is 20 + a1a5? a205 In base 16, what is -26c2 + e? -26b4 In base 9, what is 43113 - -131? 43244 In base 2, what is 101 + 10111111011000110? 10111111011001011 In base 15, what is -34d2b8 + 0? -34d2b8 In base 15, what is 0 + d79e4? d79e4 In base 10, what is 24942 - -5? 24947 In base 9, what is -4508 - 173? -4682 In base 14, what is -c028 - 4? -c02c In base 8, what is -1236200 - 1? -1236201 In base 12, what is 4 - 94076? -94072 In base 11, what is 411 + 318? 729 In base 13, what is -5 + -23a86? -23a8b In base 6, what is -3014200 + 12? -3014144 In base 16, what is -27f61 - 15? -27f76 In base 16, what is -de69 - -d? -de5c In base 15, what is 9 - -323ee? 32408 In base 13, what is -6b68 - 144? -6cac In base 4, what is -3 - 131220201? -131220210 In base 3, what is -22 - 1220120? -1220212 In base 3, what is 10022122 - 11? 10022111 In base 14, what is 1026 + 1? 1027 In base 4, what is -1120023333 + 3? -1120023330 In base 3, what is -11 + -210002220102? -210002220120 In base 4, what is -2 - -2003020200? 2003020132 In base 16, what is 1a - 1607c? -16062 In base 12, what is 2767 - 34? 2733 In base 9, what is -611 - -15? -585 In base 12, what is 7 + -59646? -5963b In base 9, what is 206 + -344? -137 In base 15, what is -8 - -a16? a0d In base 4, what is -11 + -1012? -1023 In base 10, what is -5 - 80881? -80886 In base 9, what is -4 + 183702? 183687 In base 6, what is -2010131 + -101? -2010232 In base 14, what is 3d - -141d? 145c In base 15, what is -1547 - -49? -14ed In base 13, what is 17bc + 5b? 184a In base 4, what is 1022 - 1333? -311 In base 7, what is -3416 + -1254? -5003 In base 11, what is -5 + 1793a0? 179396 In base 14, what is -3 - 604a? -604d In base 9, what is -23075 - -11? -23064 In base 12, what is -5 + 1594? 158b In base 2, what is 110011111 + -11000010? 11011101 In base 14, what is 563 - 1097? -934 In base 15, what is 61 + -29b? -23a In base 4, what is -23103203 + -3? -23103212 In base 11, what is -1755a1 + -6? -1755a7 In base 7, what is -26 + 346300? 346241 In base 14, what is -4220 + 0? -4220 In base 3, what is 10220120222 - -2? 10220121001 In base 2, what is 1001101 - -11010100111? 11011110100 In base 9, what is 3 - -1843505? 1843508 In base 9, what is 2280 + 1304? 3584 In base 11, what is 1 + 140780? 140781 In base 5, what is -34412414 - 3? -34412422 In base 4, what is -331002123 + 13? -331002110 In base 7, what is 45 - 1442? -1364 In base 8, what is 51346 + 1? 51347 In base 12, what is -17 - -b? -8 In base 16, what is -5 + 1c4e? 1c49 In base 12, what is 64 - -94a? 9b2 In base 15, what is -2c - -134a3? 13476 In base 10, what is 1 + -1105669? -1105668 In base 5, what is 144 - 434431? -434232 In base 13, what is 2 - 8b21? -8b1c In base 3, what is -11212121 + 2021? -11210100 In base 7, what is 2215 - 114? 2101 In base 15, what is ae - -cb? 18a In base 7, what is -21 - 12530? -12551 In base 11, what is 1119a - a5? 110a5 In base 13, what is -16767 - 20? -16787 In base 13, what is 8a4a - 3? 8a47 In base 14, what is -a2d15 + 2? -a2d13 In base 6, what is -10253 - 520? -11213 In base 8, what is 37775 - 13? 37762 In base 14, what is -34 - -58c9? 5895 In base 12, what is 1923a9 - -2? 1923ab In base 4, what is -3201 - -200231? 131030 In base 9, what is 47 + 11445? 11503 In base 16, what is -1 - 9974? -9975 In base 15, what is -26da2 - -5? -26d9c In base 16, what is -1a - 1cc2? -1cdc In base 14, what is 9 - -41d7c? 41d87 In base 10, what is 198388 + 0? 198388 In base 16, what is 1951 + -4? 194d In base 13, what is 2017 + -188? 1b5c In base 6, what is 12 + -154451? -154435 In base 9, what is -124725 + 3? -124722 In base 4, what is -11 - 1221112? -1221123 In base 11, what is 5719a - -2? 571a1 In base 16, what is 1c - -623? 63f In base 7, what is -12 + -16316? -16331 In base 12, what is -5 - 416? -41b In base 11, what is -718 + 96? -632 In base 10, what is -133212 - 2? -133214 In base 16, what is 1 + 1b4a62? 1b4a63 In base 4, what is -333 - 322011? -323010 In base 10, what is -21 - -5285? 5264 In base 5, what is -122102410 + 10? -122102400 In base 2, what is 1000010010001 + -10111110? 111111010011 In base 16, what is -5 - fa2? -fa7 In base 13, what is -4 + 20562? 2055b In base 5, what is 10 + 134110? 134120 In base 12, what is -53 + -6836? -6889 In base 3, what is -211211121 - -2112? -211202002 In base 8, what is 1 + -6532? -6531 In base 14, what is 4b87 - 0? 4b87 In base 13, what is -2 - 120b1? -120b3 In base 9, what is 207 + 483? 701 In base 6, what is 1040501 + -3? 1040454 In base 10, what is 7 + -26092? -26085 In base 7, what is 1624 + 12? 1636 In base 16, what is -1e2b - 0? -1e2b In base 8, what is -5446 + 432? -5014 In base 2, what is 1101001000100 - 0? 1101001000100 In base 3, what is 10000010 + -121? 2222112 In base 2, what is 111101111100000 - 1101? 111101111010011 In base 1	{ "pile_set_name": "DM Mathematics" }
Suppose -o - 5n - 5 = f, -3o - n = 2n - 9. Suppose 3d = 8d - o. Solve 0 = -2l - q - d + 7, l = -q + 5 for l. 1 Let i = -3736 + 3738. Solve -y - 16 = 5n, 5y + in + 18 - 7 = 0 for y. -1 Suppose -2l - 22 = -34. Suppose 22b - 38 = l. Solve -4j = bh + 16, -5h - 1 = j + 3 for j. -4 Suppose 58b - 56 = 54b. Let a be 4/(-14) + ((-576)/b)/(-4). Suppose 5q = aq - 10. Solve 4o = -2g + 10, qg - 5o = -0g + 10 for g. 5 Suppose 57y = 50y + 56. Suppose -2b = 2p - 50, 4b = 2b + y. Solve -5a + 35 = 4n - n, -n + p = 4a for a. 4 Let l be 9/3 - -1 - -1. Let r = -4895 - -4903. Solve -3c - 6 = -lv, -3v + 4c + r = v for v. 0 Let a(o) = -183o - 1093. Let b be a(-6). Solve -10 = -u - 2d, -4u - bd + 56 = 25 for u. 4 Let z be (-14734)/(-4726) - 2/17. Solve r + 5 + 5 = -5p, 5p = zr - 30 for r. 5 Let k = 9 + -4. Let j = 3108 - 3105. Suppose -8 = 2g, -5g + j + 2 = kt. Solve tc - i = 3i - 35, -2c - 3i = -9 for c. -3 Suppose -384 = 15o - 3o. Let q = -32 - o. Solve -y + 10 = 2k, qy = y for k. 5 Suppose 4 = -6h + 5h - d, -h - 20 = 5d. Let u be 2/6 + (-8)/(-3). Let m be -1 + (10 - 2) + (-11 - -8). Solve h = my + uk - 6, -8k + 6 = -y - 5k for y. 0 Let p(i) = -45i - 32. Let v be p(-2). Suppose 8 + v = 3a. Suppose 7b + 5 = 4b + 5r, -5b + 4r = 4. Solve -2g - 6 = b, -2k + g - 5g = a for k. -5 Let a be 29/9 + (-2)/9. Suppose -5u + 8v = 6v - 51, 5 = u - 3v. Suppose uf - 2 = 9. Solve 5q - 20 = 5l, 0 = al - 2l + f for q. 3 Let c = -1909 - -1914. Solve 3y + 3m = -6, m - 10 = cy + 3m for y. -2 Suppose -9 = l - 11. Solve -2v + 17 = 3b - 6, -7 = -3b + lv for b. 5 Let a(q) = -q*3 + 5q*2 - 3q + 3. Let p be a(4). Suppose -f - 37v + 34v - 18 = 0, -2v = 4f + 2. Solve 3s + f = 0, -3s + ps = j - 5 for j. 1 Suppose -43 = -11w + 12. Suppose 4i - 5q = -7, -5q = -wi - 124 + 119. Solve 3v - 16 = -b, -3b + b = -i for v. 5 Let k be 0/((-3)/1 + -1 + 3). Let r be ((-2)/(-8) - k) + (-490)/(-56). Suppose 0 = -f + 4l + 25, -l - 3l = 4f. Solve 11 = -fd - 5m - 4, -3d - r = m for d. -3 Let y = 8006 + -8001. Solve 0 = -3m - q - 22, -2q = -7q - y for m. -7 Suppose 186 - 97 = -5c + 139. Solve 0 = 5u + 20, 13u + 32 = 5r + cu for r. 4 Suppose -17 = -4y + 3t, -4t = -3y + 5 - 1. Solve 11 - y = -5u - x, 15 = 4u - 5x for u. 0 Suppose 0 = 2k - 7 - 23. Let v = -15 + k. Solve -2m - 2m + 16 = v, -3i = -2m + 14 for i. -2 Let p(y) = 193y - 383. Let c be p(2). Solve 3 + 1 = 5z + 2a, a = -c for z. 2 Let l = 58 + -55. Suppose -la + 7a = 248. Let t = 67 - a. Solve 5n + o - 24 = -0o, -4o = -tn + 4 for n. 4 Let z be (-2)/5(-10)/1. Let i = 839281 + -839276. Solve 7a + 2 = ia, v - z = a for v. 3 Let l = -21654 - -21672. Solve -3p - 3k = -l, -1 = -4p + k + 13 for p. 4 Let x = 8943 - 8941. Solve -5f = -3k - 0 + 6, x = k + 2f for k. 2 Suppose -5h - o + 18 = -h, -4h - 3o + 30 = 0. Solve hu + 16 = z, -6u + 24 = z - 11u for z. 4 Let w = 1839 + -1836. Solve -c = 6n - 2n + 9, 4c + w = -5n for c. 3 Let p = 82 + 92. Suppose -pr = -169r - 5. Solve -3w + r = -4o, -45 = 5o - 0o + 5w for o. -4 Suppose 1452z - 162 = 1425z. Solve 0 = -o - 2, 4y - 3o = y - z for y. -4 Let x = 6948 - 6944. Solve -3y = 3p + p + 13, -3p + xy + 9 = 0 for p. -1 Let q be ((-47)/94)/((-3)/(-228)-2). Solve -4 = 4z, 4o - 18z + 1 = -qz for o. 0 Suppose 4c = -4w + 36, 5c - 5w = 25 + 10. Suppose -27 = -cq + 13. Solve 5k - 22 = -a, -2a + q + 3 = k for a. 2 Let y = -2088 - -2092. Solve -4 + 8 = -yn + b, -3n - 10 = b for n. -2 Let o = 10958 - 10945. Solve -2x - 28 = 4j, -x - 4j - o = 9 for x. -6 Suppose -8202 = 91g - 10841. Solve 5u - g = -2r, 4u - 9 = -2r + 3u for r. 2 Suppose -5r + 9r + 3x - 75 = 0, 5r + 3x = 90. Solve n + 49 = -2s + 54, 0 = 2s - n - r for s. 5 Let j(f) = 3f*2 - 11f + 10. Let n be j(8). Let l = n + -111. Solve 24 = 5z + d, z - 7 = -z - ld for z. 5 Let m(h) = 19h. Let y be m(1). Let f(u) = u + 3. Let c be f(2). Suppose -15 = cw - 8w. Solve 2i = 5x - 49 + y, x - 29 = wi for i. -5 Let j(w) = 2w3 + 2w*2 + 4w - 3. Let o be j(1). Solve 0 = 3x + 2s + o, x + s = -3x - 5 for x. -1 Let s(w) = -2w*2 - 7553 + 7540 + 3w + 3w2. Let b be s(3). Solve bm - 2m = 5f + 40, -2f - 3m = -5 for f. -5 Suppose -4b - 67 = -13b - 22. Solve -9o + 12 = 4c - 5o, 0 = 3c + 2o - b for c. -1 Suppose t - 12s = -10s, -2t = -2s. Solve 0 = n + 4a + 24 - 16, t = n + 2a + 6 for n. -4 Suppose 36h - 975 - 69 = 0. Solve 5i + 3 = hz - 27z, 2i - 6 = -z for z. 4 Let f = -48 - -52. Solve s + 15 = fs - 3o, 0 = 4o for s. 5 Suppose 24 = 16o - 18o - 5f, 4o - 2f - 24 = 0. Solve -k = -3x + k - 14, -ok - 1 = x for x. -4 Let g(c) = 2c2 - 105c + 562. Let b be g(6). Solve -4v - 5 = -q, 6q - 8q - b = -v for v. -2 Let q(r) = r3 + 60r*2 - 951r - 142. Let f be q(-73). Solve 2j + 5y + 16 = 6, fy = 0 for j. -5 Suppose -516y + 513y = 5z - 4, z + 3y = -4. Solve 5v + 3 = -4s + 1, -zs = 2v + 2 for s. -3 Let x = -188 - -188. Suppose -2u + xu = -16. Solve -f = 3, -2t + 3f + u = -t for t. -1 Let m(u) = -7 + 6u + 34 + 5. Let o be m(-4). Solve 2t = -3i + 7i - 4, t + 3i = o for t. 2 Let w = -483 - -477. Let h be 64/w63/(-56)2. Solve 15 = -5z, 2y + 3z = -y - h for y. -5 Let r = 352 + -350. Suppose -56 + 48 = -rp. Solve 4s - 1 - 3 = -3t, t + ps = 4 for t. 0 Suppose 325 = -4x - 175. Let s = -124 - x. Suppose 2q - 8 = 12. Solve 4n + 0n = -t + s, 5n = -5t - q for n. 1 Suppose -3b + 2x = -3x + 16, -20 = -4x. Suppose -4i - b = -19. Let m be (-1 + -1)/(1/(-2)) + 0. Solve 3u = 2f - u + 8, -mf + iu = 8 for f. 0 Let h(w) = -w*2 - 3w - 8. Let u be h(-6). Let x = u + 30. Suppose xj + 3a = 20, -4j + 0a - 4 = -3a. Solve 10 = jy + 2o, -4o = 4y - o - 18 for y. 3 Let d be (-49)/(-21) + 2/(-6). Solve l - 2l = -dq + 9, -4l = q for l. -1 Let j(k) = 2k2 - 10k - 9. Let l be j(7). Suppose 18v = lv + 5x - 27, 3 = -v + x. Solve -2t - t + 8 = 5f, -vt + 4 = 3f for t. -4 Let x = 192 + -193. Let a be x + -5 + (11 - 3). Solve 9 = -az - 5i - 18, 0 = 2z + 2i + 12 for z. -1 Suppose 24 = -31r + 30r. Let o be (1710/r)/(-15) + 3/(-4). Solve -ox + x - 12 = 0, 5x = -3y - 5 for y. 5 Suppose 0 = 5o - 5u - 108 - 2, -4o - u + 58 = 0. Solve 11z - 12z + 4 = -3f, 0 = 3f - 5z - o for f. -3 Let q(i) = -i*3 + 2i*2 + 2i + 2. Let b be q(2). Let w = -84 - -87. Solve -2n - wy + b = 0, 4y - 8 - 8 = 0 for n. -3 Let n(z) = 14z*2 - 5z. Let j be n(1). Suppose 12 = -4p, -4p = -y + 2y + 7. Suppose -8w - y = -jw. Solve -3i = q - 3q - 13, -4q - i = w for q. -2 Suppose -3s + 6 = 3c, c - 129 + 129 = 0. Solve -b + 2q = 7q - 4, 3b + sq + 14 = 0 for b. -6 Let b be 59436/198 + (-6)/993. Let o = 303 - b. Solve -5c = -2h + 2 + 4, 0 = -h + oc + 4 for h. -2 Suppose 0 = 481y - 5576 - 2120. Solve -63n + 60n - y = 5t, -4 = 2n + 2t for n. 3 Let i(u) = -9u + 36. Suppose 5r = 20 - 5. Let s be i(r). Solve 0p + 5p - s = n, p = -2n - 7 for n. -4 Let o(z) = -z2 - 9z - 16. Suppose -66 = 7r + 18. Let p be -9 + (-5)/(15/r). Let c be o(p). Solve -4g + c = -4l - 3g, 8 = -5l + 2g for l. 0 Let l(t) = 101t - 96. Let n be l(1). Solve 2j + np + 8 = 6p, -j + 5 = 4p for j. -3 Suppose 2n = -2t + 2, 0 = -4t - 0n - n + 7. Suppose 6i - 29 = ti - s, -2i + 5s = -9. Solve -w = 2m - 3w - 2, m - i = -w for m. 4 Suppose 0 = -d - 6 + 6. Suppose -4v - z + 57 = 4z, d = v + z - 15. Let r be (-2)/(-9) - (-86)/v. Solve -3n = -5c + 5, -10 = rc + 2n + 10 for c. -2 Let o = 27130 + -27125. Solve 12j = 3t + 13j + 13, j + 23 = -ot for t. -5 Suppose -21t = 11t + 26t. Solve -g + 41o - 38o = -10, 5g + o - 2 = t for g. 1 Let w = 5778 - 5766. Solve -w = 3r - 2p, -5r = -8r - p + 6 for r. 0 Let t(z) be the second derivative of z4/12 + z3/6 - 9z*2 - 2z - 8. Let c be t(-5). Solve 0v + cv + x = 7, 0 = -3x + 15 for v. 1 Let l(y) = -y2 - 23y - 100. Let s be l(-7). Suppose 4v = 2z + 12, 4v - 8 = -9z + sz. Solve -vx = 5c + 30, 6x = 3x - 4c - 21 for x. -3 Suppose -1314j = -1385j + 284. Solve 0 = -w - 5t + 15 + j, 0 = 2w - 4t + 18 for w. -1 Let z(x) = x2 + 18x + 35. Let v = -191 + 175. Let q be z	{ "pile_set_name": "DM Mathematics" }
= 3t - 4t - 4x + 165. Is t a composite number? True Is -2 + 8 + 18478 - 3 a composite number? False Let v = -428 - -2192. Let r be (-1)/(-1) + -810 - 2. Let j = r + v. Is j composite? False Let u = 4069 + -2006. Is u a prime number? True Suppose -6j + 2j + 1421 = l, -2837 = -2l - 3j. Is l prime? False Suppose -4q = -2q. Suppose 3p - 236 - 1 = q. Is p a prime number? True Suppose -13p + 147565 = -46174. Is p prime? False Let c be 50(-4 - (-26)/4). Let l(o) = 29o2 + 4o + 3. Let r be l(-3). Let s = r - c. Is s a composite number? False Suppose x + 1881 = 4x. Suppose 14s - 11s = x. Suppose s + 24 = t. Is t a prime number? True Let q(p) = p2 - 14p + 19. Let z be q(13). Suppose zd - 5245 = d. Is d composite? False Let l = -8 + 12. Let q(a) = 2a + l - 8a2 - 3 + 100a*2. Is q(-1) prime? False Let t be -12 - (0 + 10)/5. Let k(x) = -32x - 29. Is k(t) composite? False Let y = 1 + -3. Let s be (-1124)/(-3) - y/(-3). Suppose -2r + 189 = o, 4r - s = -0r + 2o. Is r composite? True Suppose -5 = -c, -4j + 1007 = c - 6c. Let s = j - 95. Is s composite? False Let r = -12 - -6. Let y = r + 9. Is 2-17(-3)/y a prime number? False Let c be 1703 + -3(-1)/(-3). Let l = c - 911. Is l a prime number? False Let u(o) = -o2 + 7o - 5. Let f(d) = d*2 - d. Let h(j) = 5f(j) + u(j). Is h(7) composite? True Let w be (1 - -5) + -12 + 12. Suppose 5z + 867 = 2n, 2225 = wn - n - z. Is n a composite number? True Let v(q) = 2q*3 - 14q*2 - 25q + 14. Is v(11) prime? False Let g be ((-10)/30)/((-1)/27). Let q be g/9 - (-1 + -2). Is (-331)/(-9) - q/(-18) composite? False Suppose 3n - 5a = 8, 4n - 4a - 17 = -1. Is n/(-3 + 9) - -1881 prime? False Let a be (-3)/((-12)/(-8)) - (5 + -9). Suppose 0t = 4t - 4592. Suppose 0 = -6i + ai + t. Is i a composite number? True Let t = -528 - -2261. Is t composite? False Let u = -619 - -1572. Is u a composite number? False Suppose 0 = m + m + 5j + 7, 3j = 3m + 21. Let r(w) = -158w + 5. Is r(m) a prime number? True Let f(c) = c*2 + 2c + 28. Let j be f(0). Let n = j + 23. Is n composite? True Suppose -6g + 58605 = -g + 5q, 3g - 35163 = q. Is g prime? False Let k be 4((-21)/12 + 2). Let l be (2 - 0)k/2. Is 95 + 1 - (l - 0) a prime number? False Suppose -3m + 134833 = 10w - 2m, 5m = 5w - 67400. Is w a composite number? True Let k = -13 + 18. Suppose 14 = ku - 11. Suppose -uf = -2065 + 275. Is f prime? False Let s be (-22)/(-33) + (-7)/(-3). Suppose sn - 9221 = -n + 3a, -a + 5 = 0. Is n prime? True Suppose 0 = -2s + 2r + 2716, -5447 = -4s - 2r + r. Is s a prime number? True Let k(g) = 3g2 + 23g + 21. Let t(o) = -2o2 - 12o - 10. Let y(d) = 3k(d) + 5t(d). Let v be y(10). Suppose -2a = va - 285. Is a prime? False Let k = -1 + 34. Suppose 18 = -31b + kb. Is b prime? False Let m be 6/(-5)(-20)/(-8). Let q(l) = -850l + 39. Is q(m) composite? True Suppose q = -2y - 0y + 784, -3q + 2337 = y. Is q composite? True Let a(j) = 38j3 - j2 - 17j - 7. Is a(8) composite? False Suppose 386898 = -2x + 8x. Is x composite? False Let v(n) = 7n*2 - 23n + 89. Is v(29) prime? True Suppose 0 = 3a - 617 + 77. Let w = a + 24. Suppose 3f = -3g + w, -3g - 148 = -2f - g. Is f prime? True Suppose 0 = 2l - l - 333. Suppose 97 = 2g - l. Is g a composite number? True Suppose -152698 = -5p - 3y, -3p - 3y = 43032 - 134652. Is p composite? False Let n(f) = f. Let k be n(9). Let u be -2 + -330/k. Is (-3)/u - 43/(-4) composite? False Suppose 2q - 4j + 181 = 2415, -4j = q - 1123. Let z = 1906 - q. Is z a prime number? True Suppose 2a - b - 7 = -2b, -4a = -2b - 34. Suppose 0 = d - a. Is 1214/d + 2/3 composite? True Let k be 2/13 + (-230)/(-26). Let v be 2/k + (-4424)/63. Is 2/(-7) + (-155490)/v a composite number? False Let v(y) = 101y*3 + 3y*2 + 7y + 11. Is v(6) composite? False Suppose 0 = -m + y - 4y + 24, -5y = -m. Suppose -3i - 2q = -7, m = -5i - 2q + 4q. Let z(g) = -184g3 - g2. Is z(i) a composite number? True Let u be 1/(5/453). Suppose -6k - 759 = -uk. Is 0 - (1 + -5) - k prime? True Let c be 42/(-21)21. Is (-12)/24 - 4878/c prime? False Suppose 6893 = b - 4f, 5b - 29f - 34501 = -27f. Is b a prime number? False Let r(l) = -149l - 38. Is r(-23) composite? False Let h(l) = -l*2 + 2l + 4. Suppose 2y + 2b = -3b + 37, -2y - 4b = -32. Let f be h(y). Let p = f - -99. Is p a prime number? True Let f(j) = 4j + 5. Let h be f(-2). Let m be h/4-4 - -163. Suppose -3a = z - 3z + m, -97 = -z - 2a. Is z prime? True Let a(o) = -o*2 + 5o + 4. Let x be a(6). Is x/(-2)(-1146)/(-6) prime? True Let w = -226095 + 316810. Is w composite? True Let u be 3((-10)/(-3))/5. Suppose 2c + u = 3c. Suppose -264 = -cg + 674. Is g a prime number? False Let y(g) be the second derivative of -g3 - 35g*2/2 + 17g. Is y(-19) a prime number? True Let y = 9 + -11. Let t(u) = -u*3 - 3u*2 - 4u - 2. Let o be t(y). Suppose 2 = -ob, z = -3z + 2b + 350. Is z a prime number? False Let b = 1533 - 1089. Let j = 1113 - b. Is j prime? False Is (-4)/(-14) + (1 - (-14502)/7) a composite number? True Let q = 421 + 621. Is q composite? True Suppose 28409 + 25129 = 6c. Is c a prime number? True Let k(n) = -3n + 2. Let f(p) = -p - 1. Let j(l) = -2f(l) + k(l). Let i be j(-2). Suppose -i = 2z + m - 18, 10 = 2z + 2m. Is z composite? False Is (1388/16)/(4/80) composite? True Suppose -82 = -3d - 19. Suppose -16r + dr - 1855 = 0. Is r a composite number? True Let a be 1302/(-35) - 2/(-10). Let s = 684 + a. Is s composite? False Suppose -3o + 2o + 3 = -3d, 2o = -3d - 30. Let r(f) = f*3 + 12f*2 + 11f - 17. Is r(o) prime? True Let w = 1 - -1. Suppose -wn + 6n - 5a + 12 = 0, n + 3 = -4a. Is 1 + 56 + n + 5 a composite number? False Let r(o) = o*3 - 7o*2 + 9o. Let p be r(4). Suppose b + 7 = -19. Let w = p - b. Is w a composite number? True Let k(s) be the third derivative of 5s6/2 - s5/30 + s4/8 - 5s*2. Is k(1) prime? False Let f(l) = 38814l*2 + 9l - 4. Is f(1) a composite number? True Suppose 5i + 2x = 10016, 4i = 7x - 5x + 8020. Suppose -3r + i = 9r. Is r composite? False Let j(b) = -b3 - 34b*2 - 29b + 223. Is j(-37) a composite number? True Is 67884/44 + (-2)/(-11) composite? False Let w be (0 - 21)(-1)/6-2. Let l(c) = -6c3 + c2 - 5c - 13. Is l(w) a prime number? True Let q(u) be the third derivative of -u6/120 - u5/30 - u*4/12 + 5u3/6 + u2. Suppose 0 = -h - 0p + 4p + 14, -3h + 5p = -7. Is q(h) a prime number? False Let h be ((-4)/(-10))/(7/35). Is 0 + 1 - (-86 - h) a prime number? True Suppose 5x = 6x + 948. Let y = x + 1327. Is y prime? True Suppose -3b + 10 + 2 = 0. Suppose -12 = 5y - bl, 3 = -5y + 3l - 2l. Suppose -4i = 2u - 994, u = 2i - yu - 507. Is i prime? True Let j = -4 - -12. Suppose 28 = jx - 684. Is x a composite number? False Let n = -1640 + 15637. Is n a composite number? False Suppose 0 = 2k + 2v - 10 - 10, -22 = -3k + v. Let r be ((-46)/k)/(4/(-16)). Suppose 0h + h - r = 0. Is h a prime number? True Let i(g) be the second derivative of -3g5/20 - g3 - 5g2 + g. Let m(b) = -34b - 174. Let t be m(-5). Is i(t) a composite number? True Let y(a) = 51a + 14. Let i(b) = -b2 - 3b + 3. Let z be i(-3). Suppose -zq + q - 21 = -v, -5q - 46 = -2v. Is y(v) prime? True Let v(m) = -2m + 34. Let z be v(16). Let k = 5991 - 4236. Suppose l - k = -4l - zc, 0 = l - c - 358. Is l a prime number? True Let k = -249 - -222. Suppose 3t - 1 + 397 = 3o, 0 = 2t - 3o + 260. Let l = k - t. Is l composite? False Let m = -10980 - -18021. Is m prime? False Suppose -290 = -v - 4v - 4n, 5v + 3n = 285. Let r = v + -94. Let k = 25 - r. Is k a prime number? False Let g = 1103 + -478. Let d = 889 - g. Suppose -3s - 2a + d = 0, 7a - 270 = -3s + 3a. Is s a prime number? False Suppose 13 = -c - 56. Let r = c + 172. Is r prime? True Suppose h - 963 = -h - l, -2h + 3l = -959. Suppose h = 3t - 1421. Is t a prime number? False Let p = -7 - -9. Let j(d) = 2d2 - 4d + 3. Let t be j(p). Let i = 208 + t. Is i a composite number? False Let d be 222/(-42) - (-4)/14. Let c(a) = 15a2 + 2a + 5. Let q be c(d). Suppose 5*s - q = 2995. Is s a composite number? False Let z(n) be the f	{ "pile_set_name": "DM Mathematics" }
derivative of -61717j3x*4 - 6j*3x*2 + 4118j*2x*4 + 2j*2x*2 + 4j*2x - 20x2 + 349x - 1 wrt x? -1481208j3x + 98832j2x Differentiate 977ou + 2o + 2720u + 1413389 wrt u. 977o + 2720 Find the second derivative of -7617554fnx*2 + 166fnx + 59428f + nx*2 + n wrt x. -15235108fn + 2n Differentiate -487082g2u - 4gu - 2g - 2318067u with respect to g. -974164gu - 4u - 2 Differentiate -3oy3 - 9258582oy2 + 7254736o - y*2 + 7 wrt y. -9oy2 - 18517164oy - 2y What is the derivative of 9h2 + 256043h + 13723239? 18h + 256043 Find the third derivative of 11d*2g*2l*3 - 289d*2g*2l*2 + 3d*2g*2l + 328470d2gl3 + 99d*2gl2 - dg*2 + 6g*2l wrt l. 66d2g*2 + 1970820d*2g Find the second derivative of 8766320qu*2 + 2437257qu wrt u. 17532640q What is the second derivative of -133625c3k*2 + 17c*3k - 6c2m + 277ckm + 13c + 41k2m wrt k? -267250c3 + 82m Find the first derivative of 2z4 - 3z*3 + 18558z*2 + 9z + 51187346 wrt z. 8z3 - 9z*2 + 37116z + 9 Find the first derivative of 42041559b + 171974293 wrt b. 42041559 What is the first derivative of 8095544oy3 - 7292129y*3 - 2 wrt o? 8095544y*3 What is the second derivative of 31850c*2vz3 + 401c*2z*3 - 180cz3 + 9cz + 2vz3 + 4vz - 6z*3 + 2z + 9 wrt c? 63700vz*3 + 802z*3 What is the second derivative of 8240765a*2 - 13171906a wrt a? 16481530 Find the third derivative of 1293g6 - 18831g*3 - 1950370g*2. 155160g*3 - 112986 What is the derivative of 319130587o*3 + 805264873 wrt o? 957391761o*2 Differentiate -12167j*4 - 8j*3 + 18956022. -48668j*3 - 24j*2 Find the second derivative of 6566614b*3 + 4506637b wrt b. 39399684b Find the third derivative of -40f*3h*2 + 5f*3h + 2924f3 - 5f*2 - 3912131fh2 wrt f. -240h*2 + 30h + 17544 Differentiate -51306802p2 + 40646221 wrt p. -102613604p What is the first derivative of -b*3 - 11b*2m + 4379bm + 14b - 4534273m wrt b? -3b2 - 22bm + 4379m + 14 What is the third derivative of -8k4r*3 + 6k*4r - 9960k3 - 787k*2r + kr3 + 5kr2 - 78k - 2r3 + r2 wrt k? -192kr3 + 144kr - 59760 What is the second derivative of 16603468k*5 + 8307355k wrt k? 332069360k3 What is the third derivative of 259g*6 + 6791g*5o*3 + 2g*2o*3 - 156g*2o + 2go*3 - 55o*2 - 3o wrt g? 31080g3 + 407460g*2o*3 Find the first derivative of -9676887f + 17231205. -9676887 Find the third derivative of 272029364v6 + v2 + 28783v - 40 wrt v. 32643523680v3 Find the second derivative of u2wy2 + 27u*2y - 6uwy2 + 1080uwy + 5uw + 112321wy*2 wrt y. 2u*2w - 12uw + 224642w Find the second derivative of 21h*4 + 170240h*2 - 37370874h. 252h2 + 340480 Find the third derivative of 1469856295x*3 + 106x*2 + 3070592. 8819137770 What is the third derivative of -21115q*5 + 497q*4 + 6q*2 + 516q - 41144 wrt q? -1266900q2 + 11928q What is the third derivative of 2j2t3 + j2t2 - 9j*2 + 4634834jt5 - 2076jt2 - 14j + 2 wrt t? 12j2 + 278090040jt2 Differentiate -53r*3z - 9572476r3 + 783r*2z + r*2 + 89z with respect to z. -53r3 + 783r*2 + 89 What is the third derivative of 2538309h*3 + 141h*2 + 9619h wrt h? 15229854 What is the first derivative of 10038831q2x - 610624q2 - 3q - 1 wrt x? 10038831q2 Find the third derivative of 26656238r*3 + 39520326r*2. 159937428 What is the first derivative of -1510anw*2 - 11aw3 - 23aw - 42nw3 + 10nw - n + 8w*3 - 56 wrt a? -1510nw2 - 11w*3 - 23w Find the first derivative of 219484u3 - 4u + 1550447. 658452u2 - 4 Differentiate -5594562oz - 1893575o - 3 wrt z. -5594562o What is the first derivative of -965v*4 - 76v*3 + 3v + 58943272 wrt v? -3860v3 - 228v*2 + 3 Find the second derivative of 43s*2u*2 + 622s*2 - 136su2 - 19938s wrt s. 86u2 + 1244 Find the third derivative of -321hy4 + 818hy3 - 261h + 2y4 - 3y*3 + 14780y*2 wrt y. -7704hy + 4908h + 48y - 18 Differentiate -376874k*2ry + 799k*2y*3 - 73783ky3 - 148ry3 with respect to r. -376874k*2y - 148y3 Find the third derivative of 126349524o*3 - 64933354o*2 wrt o. 758097144 What is the second derivative of 8088106x*2 - 933x + 7046? 16176212 What is the second derivative of -425538576c3 - 296460615c wrt c? -2553231456c What is the derivative of 15303987c - 99194520 wrt c? 15303987 Find the third derivative of 279394x5 + 8x*4 + 1747259x*2. 16763640x*2 + 192x Find the second derivative of -13947g2r*2 + 2g*2r - 17g2 - 40gr + 5g + 804r4 + 60 wrt r. -27894g*2 + 9648r*2 Find the second derivative of 149341348a*2 + 1611a - 67762. 298682696 What is the second derivative of -244730408u3 - 5u + 8623947? -1468382448u Find the second derivative of -4fv5 - 101fv2 - 13fv + 1144890f - 162v4 wrt v. -80fv3 - 202f - 1944v2 Find the third derivative of 94659i*6 - 1242i*5 + 530i*2 + 72254i wrt i. 11359080i3 - 74520i*2 What is the second derivative of 12893962s*2 - 6082171s? 25787924 Differentiate 4d3 + 6318193d + 167370735 wrt d. 12d2 + 6318193 Find the second derivative of 197138210u*3 + 241u + 1929235. 1182829260u What is the second derivative of 60496h*5 - 7875h*2j*2 - 13336912hj - 41j*2 wrt h? 1209920h*3 - 15750j*2 Differentiate -63791204m*2u - 19179673m2 wrt u. -63791204m*2 Differentiate -159g*2y - 123138g + 319921y - 108 with respect to g. -318gy - 123138 Differentiate -55420767k3 + 108505862. -166262301k*2 What is the second derivative of -29215142aw5 - 10aw3 - 73720a - 41w wrt w? -584302840aw3 - 60aw Find the second derivative of -30073349q*3 + 38704714q wrt q. -180440094q What is the derivative of -2kn2 + 648kn + 164726k + 1369n2 + n - 107596 wrt k? -2n*2 + 648n + 164726 Find the first derivative of -142088096y4 - 148608564. -568352384y*3 What is the third derivative of 3392026o*3 - 16564064o*2 wrt o? 20352156 Differentiate 183x*3 + 257x*2 + 2x - 11336480 wrt x. 549x2 + 514x + 2 Find the third derivative of -11072350z3 - 149839726z2. -66434100 Find the third derivative of q6 - 5495341q5v + 5q2v - 63q2 + 1443qv - 2v wrt q. 120q3 - 329720460q*2v Find the third derivative of 9930172r3 + 6222316r*2. 59581032 Find the third derivative of 48465744w*3 + 1619667w*2 + 1. 290794464 Find the first derivative of 938kr2 + 126342542k - 47164r2 wrt r. 1876kr - 94328r Find the third derivative of -33i4 - 10979921i*3s + 1243768i2s + is wrt i. -792i - 65879526s What is the third derivative of 3034942b*5 - 6b*2 + 673670b wrt b? 182096520b2 What is the third derivative of 390934902y*3 + 1629831y2 + 18 wrt y? 2345609412 Find the second derivative of g4 - 3101679g2 - 679g - 1307. 12g2 - 6203358 What is the third derivative of -57732x*4 + 59x*3 - 4388x*2 - 2577x? -1385568x + 354 What is the derivative of 423k*4 + 6k*2 + 4863k + 15761593? 1692k3 + 12k + 4863 Differentiate -4j3 - 287j*2z*3 - 9j*2z + 7253180z3 wrt j. -12j*2 - 574jz3 - 18jz What is the derivative of -2fg3 + f + 768818g + 4715873 wrt g? -6fg*2 + 768818 Find the third derivative of 8f*5 + 2001288f*4g - 10f2g + 691839g wrt f. 480f*2 + 48030912fg Find the second derivative of 40gj5 - 4108gj3 - 6239138gj - 48j*2 - 4j wrt j. 800gj*3 - 24648gj - 96 What is the second derivative of -11695024z*4 - 9z*3 - 2z*2 - 25z + 2244148? -140340288z2 - 54z - 4 What is the first derivative of -520y4 - 39360y - 70512540? -2080y3 - 39360 Differentiate 685842g*2t + 11512g2v - 2g2 - 763tv - 7t with respect to v. 11512g2 - 763t What is the second derivative of 8390304g5 + g4 + 3765033g wrt g? 167806080g3 + 12g*2 Find the second derivative of 7767u*5 + 7u*3 + 921u*2 + 20693u + 946 wrt u. 155340u3 + 42u + 1842 What is the second derivative of 16132428r*2	{ "pile_set_name": "DM Mathematics" }
.4 - y. Let h = -39/4 + 10. Which is the second biggest value? (a) h (b) -2/5 (c) o a Suppose -5z + 11 = 4s, -3s + 9 = 2z + 2z. Suppose g - 4g + z = 0. Let f be 1/(10/(-6) + g). Which is the second biggest value? (a) f (b) -0.1 (c) 0 b Let n = 81 - 85. Let t = -1.5 + 1.6. Which is the third biggest value? (a) -0.2 (b) n (c) t (d) 2/11 a Let s = 409.57 - 410. Which is the third smallest value? (a) s (b) 0.3 (c) -3 (d) 3 b Suppose 8 = 4g + 5z, g - 2z = -6z + 13. Let r = 12.7 - 13. What is the second smallest value in g, r, 0.2? r Let l = 0.26 + -1.4. Let u = -1.09 - l. Which is the smallest value? (a) u (b) 0 (c) -5 c Let w(h) = -8h - 52. Let r be w(-7). What is the smallest value in r, 0.121, -2/9? -2/9 Let h = -25.6 - -25.2. Which is the fourth smallest value? (a) 4 (b) 0.046 (c) -0.3 (d) h a Let h = 3 + -12. Let i = h - -5. Let u be 1 + 3 + 34/(-9). What is the third biggest value in u, -0.4, i? i Let s = 23.4 - 23. Let v = -3.6 - s. What is the smallest value in v, -2/3, 1? v Let m = 14 + -10. Let n = -9 + m. Let l = -430 + 429.8. What is the second biggest value in 5, n, l? l Let v = -1376 + 9634/7. Which is the second biggest value? (a) -8 (b) -3 (c) v b Let l = 358/1773 + 4/197. Let w = -35.2 + 36.2. Which is the fourth smallest value? (a) -2/3 (b) l (c) 0 (d) w d Let w = -17.7 + 18. Which is the second biggest value? (a) -2/13 (b) w (c) -0.13 (d) -3 c Suppose -5x + y = -y - 21, 5x - 5y = 30. Let z = 535/2 + -268. What is the third smallest value in x, 2/13, z, -0.2? 2/13 Suppose -4l = h - 12, 60 = 3h + 2h - 5l. Let o = h + -9. Let f = 0 + -5. What is the second smallest value in o, f, 0.1? 0.1 Suppose -5n - 154 = -n + 2j, 4j + 68 = -2n. Which is the third smallest value? (a) -5 (b) n (c) -3 c Let u = -0.15 - 10.85. Let c = -18 - u. Suppose -5t = 2h + 10 - 26, t - 8 = 2h. What is the third biggest value in h, 0.4, c? c Let f = -0.0798 + 0.1798. Which is the biggest value? (a) 4 (b) f (c) 3/338 a Let s = -186.5 + 187. What is the smallest value in -23, 0, s? -23 Let t = 136.07 - 136. Let h = -1227.93 + 1233. Let f = t - h. What is the biggest value in f, 2/11, 3/2? 3/2 Let r = -59.935 + 60. Let t = 0.065 - r. Let v = 104/5 + -708/35. Which is the smallest value? (a) t (b) 5 (c) v a Let l be 2(3 - 276/84). Which is the second biggest value? (a) -0.9 (b) 1 (c) l (d) -3 c Let f = -176.6 + 177. Which is the second biggest value? (a) 0 (b) -16 (c) -0.2 (d) f a Let g = 1802 - 1801.8. Which is the fourth smallest value? (a) -2/15 (b) -1/4 (c) -2 (d) g d Let t = -0.06 - -1.06. Let j = 3 - t. Let y = -5 + j. Which is the second smallest value? (a) 4 (b) -4 (c) y c Let b = -1.53 + 1.23. What is the biggest value in -2, -3, b, -0.5? b Let s = -160.3 + 164.3. What is the second biggest value in s, 3/4, -4, 1/10? 3/4 Let u = 0.6 + -1. Let t be ((-6)/(-33))/(3/(-99)-3). Which is the second biggest value? (a) t (b) -0.3 (c) u b Let n = -0.3 + 0.34. Let h = -5.04 + n. Let q = -247 + 2716/11. What is the third biggest value in q, h, -5/4? h Let z be ((-4)/6)/((-4)/54). Let n = z - 7. Let f = 36 + -35. What is the second biggest value in -0.5, f, n? f Let q = -7 - 115. Let n = -127 - q. What is the fourth biggest value in 2/5, -1, -4/5, n? n Let i = 0.03 + 0.57. Let m = i - 1. Let w = 622/1435 - 1/205. Which is the biggest value? (a) w (b) m (c) -4 a Let n(w) = 2w*2 - 10w + 10. Let a be n(4). What is the smallest value in a, 3, -3? -3 Suppose 0 = 2p - 6p - 3r + 13, 2p - 4r + 10 = 0. Suppose -3q + 132 = 408. Let v be q/(-90) - (-6)/(-27). What is the biggest value in v, -0.3, p? p Let x be (-7 + (5 - -1))1/2. What is the fourth biggest value in x, 0.1, 34, -2/7? x Let j = -9.4 + 9. Let f = 1 + -4. Let i = 0.2 - 0.4. Which is the third biggest value? (a) f (b) j (c) i a Let w = 758 + -2275/3. Which is the second biggest value? (a) w (b) -0.3 (c) 0.001 b Let y = 1151/7 - 164. Let z = 1414 - 1410. Let g be (-18)/4 + (-2)/(-4). What is the third biggest value in y, z, g? g Let v be (1 + -3 + (-30)/(-14))/4. Let g = 0.7 + -0.7. Which is the biggest value? (a) -3 (b) v (c) 0.2 (d) g c Let t be 4 + 6/30-22. Let w = -20.5 - -21. Which is the second smallest value? (a) t (b) 0.1 (c) 5 (d) w b Let b = -579/4 + 2891/20. What is the third biggest value in 2, b, -3.5? -3.5 Let g = -0.536 - -0.036. Which is the biggest value? (a) 43 (b) g (c) -0.1 a Suppose 3l + 252 - 518 = -260. Let i be (18/(-10) - 0) + 1. Let f(w) = w2 - 4w - 4. Let x be f(5). Which is the second smallest value? (a) i (b) x (c) l b Let x = -30.2 + 30. Let h = -839/3 - -279. Which is the fourth smallest value? (a) x (b) h (c) -2/7 (d) -1/7 d Suppose 0 = -2p - 5k - 20, p - 6 + 21 = -5k. Which is the second biggest value? (a) 0.3 (b) -0.45 (c) p (d) 4 a Let m = -24.9 + 26. Let r = -1375 - -1373.991. Let z = 0.009 + r. What is the second smallest value in z, -0.1, m? -0.1 Let l be 2/(-18)-31. Let a(d) = 4d - 3. Let s(g) = 2g - 2. Let w(r) = -2a(r) + 5s(r). Let t be w(5). What is the second biggest value in t, 0.2, l? l Let w = 1.396 - -2.604. Which is the biggest value? (a) w (b) -2/3 (c) 0 (d) 1/6 a Let s = 40.3 + -5.5. Let n = s - 35. Let k be 4/(-10) + (-23)/(-20). What is the second biggest value in 2, k, n? k Let l = -22699/3765 - 11/2510. Let t = l - -31/5. What is the smallest value in -1, t, -15? -15 Let q be 2 - 1 - 34/(-24). Which is the third smallest value? (a) q (b) 4 (c) 0.5 (d) 0.02 a Let j = 425/22 - 39/2. Let z(y) = y*3 + 7y*2 - 4y - 2. Let i be z(-9). Let m = i - -132. What is the third biggest value in 3, m, j? j Let d = -36.5 + 16. Let t = -21 - d. Let i be 30/108 + 2/(-4). Which is the biggest value? (a) 2/7 (b) t (c) i a Let d = 0.89 + -0.09. Let f = d + -0.6. What is the biggest value in 6/5, -1, f? 6/5 Let o = 19.64 + -10.64. Which is the fourth smallest value? (a) o (b) 5 (c) 1 (d) 3 a Let z be ((-422)/(-2321))/(-1 + (-28)/(-22)). Which is the third smallest value? (a) 0.2 (b) -4 (c) z (d) -22 a Let m = 11.1 - 7.1. Which is the third smallest value? (a) 0.4 (b) m (c) -0.06 (d) 0.2 a Let l(d) = -d*3 + 6d*2 + 5d + 9. Let g be l(7). Let k = 7 + g. Let o be k(-1)/(-4)-2. Which is the smallest value? (a) -1/5 (b) -5 (c) o b Let d = -0.8 + -10.2. Let v = 10.93 + d. Let l = -68 + 73. Which is the biggest value? (a) v (b) l (c) -1/2 b Let q = 9.78 - 10. Let x = 21.02 + q. Let m = x - 21. Which is the second biggest value? (a) -4 (b) m (c) -5 a Let t = 800/3 + -266. Let q = 3.7 + -4. Let o = 8 + -3. What is the second biggest value in o, t, q? t Let z = -2/1207 + -22925/4828. Let q = z + 65/12. Let g = -7/6 + q. What is the biggest value in g, 2/11, 1/3? 1/3 Let u = 6 + -3. Let y = 25 - 28. Which is the third biggest value? (a) y (b) 0.5 (c) u (d) -7 a Let r = -2736 + 2732. What is the third smallest value in 1, 0.75, r? 1 Suppose 21 = 5p - 4b + 1, -4p - 5b - 25 = 0. Let y = 8909/795 + -1/159. Let l = y - 178/15. What is the third smallest value in -2/19, l, p? p Let b = 802 - 801.6. Suppose -3y = 2t + y - 106, -y = -4t + 167. What is the third biggest value in b, t, 1/8? 1/8 Let p be (-3 + -1)/(-2)4. Let y be ((-21)/11)/((-12)/p). Let m = y + -23/44. Which is the third smallest value? (a) -0.4 (b) -1 (c) m c Let i = -9 + 5. Let c = 2.72 - 1.07. Let z = c + 1.35. What is the third biggest value in i, -6, z? -6 Let f = 8.2 + -8. Let i = -12 - -11.82. Let n = 7.18 + i. Which is the biggest value? (a) 1 (b) f (c) n c Let x = -8 + 17. Let l = x - 8. Let u = 9 + -13. What is the third biggest value in u, l, -3/16? u Let q = 21.3 - 21. Let l be 248/16*4/14 + -4. What is the third biggest value in -0.1, l, q, -1? -0.1 Let j = 22.2 + -22.5. Let t = -17 + 16.6. What is the third smallest value in t, j, 4, 0? 0 Let y = -705 + 700. Which is the biggest value? (a) 445 (b) -0.5 (c) y a Let n = -26 - -26.74. Let r = -1.14 + n. Which is the smallest value? (a) -0.02 (b) r (c) -0.3 b Let y = -0.034 - 4.666. Let w = 0.7 + y. Which is the third biggest value? (a) 1/4 (b) w (c) -2 b Let h = 46 + -25. Let j = -20.6 + h. Let m = 13.8 + -15. What is the biggest value in m, j, 2? 2 Let m = -0.055 + -2	{ "pile_set_name": "DM Mathematics" }
hat is the n'th term of -28, -77, -136, -211, -308? -n3 + n2 - 45n + 17 What is the r'th term of 6, 35, 86, 159, 254? 11r*2 - 4r - 1 What is the g'th term of 42, 70, 120, 198, 310? g*3 + 5g*2 + 6g + 30 What is the g'th term of -13, -5, 15, 53, 115? g*3 + g - 15 What is the v'th term of -16, -23, -34, -49, -68, -91, -118? -2v2 - v - 13 What is the u'th term of 179, 174, 167, 158, 147, 134? -u2 - 2u + 182 What is the x'th term of 115, 211, 291, 349, 379, 375, 331, 241? -x3 - 2x*2 + 109x + 9 What is the p'th term of 157, 323, 491, 661? p*2 + 163p - 7 What is the k'th term of 53, 103, 143, 167, 169? -k3 + k2 + 54k - 1 What is the o'th term of -350, -349, -348, -347, -346? o - 351 What is the v'th term of 209, 423, 637, 851? 214v - 5 What is the n'th term of -241, -222, -189, -142, -81, -6? 7n2 - 2n - 246 What is the z'th term of -3, -19, -43, -75, -115? -4z2 - 4z + 5 What is the h'th term of 1492, 2984, 4488, 6010, 7556, 9132, 10744? h*3 + 1485h + 6 What is the q'th term of -306, -296, -274, -234, -170, -76, 54? q*3 + 3q - 310 What is the l'th term of 145, 291, 437? 146l - 1 What is the a'th term of 485, 943, 1403, 1865, 2329, 2795, 3263? a2 + 455a + 29 What is the c'th term of -18, -34, -60, -102, -166, -258, -384? -c3 + c2 - 12c - 6 What is the g'th term of -1617, -3231, -4843, -6453, -8061, -9667, -11271? g2 - 1617g - 1 What is the x'th term of -74, -73, -70, -65, -58, -49, -38? x*2 - 2x - 73 What is the k'th term of -830, -837, -848, -863, -882? -2k2 - k - 827 What is the n'th term of -25, -19, -13? 6n - 31 What is the t'th term of -84, -86, -88? -2t - 82 What is the a'th term of 7, 14, 39, 94, 191, 342? 2a*3 - 3a*2 + 2a + 6 What is the b'th term of 0, -33, -96, -195, -336, -525, -768, -1071? -b*3 - 9b2 + b + 9 What is the i'th term of 2112, 4227, 6340, 8451? -i2 + 2118i - 5 What is the b'th term of -103, -96, -67, -4, 105, 272, 509? 2b3 - b2 - 4b - 100 What is the t'th term of 26, 32, 36, 38, 38? -t2 + 9t + 18 What is the g'th term of -503, -1009, -1517, -2027? -g*2 - 503g + 1 What is the z'th term of -29, -47, -75, -119, -185, -279, -407? -z3 + z2 - 14z - 15 What is the z'th term of 43, 97, 151, 205? 54z - 11 What is the s'th term of 98, 108, 134, 182, 258, 368? s*3 + 2s*2 - 3s + 98 What is the u'th term of 851, 1701, 2551? 850u + 1 What is the x'th term of 50, 207, 470, 839, 1314, 1895, 2582? 53x*2 - 2x - 1 What is the i'th term of 60, 66, 70, 66, 48, 10? -i*3 + 5i*2 - 2i + 58 What is the u'th term of -401, -802, -1203, -1604, -2005? -401u What is the d'th term of -407, -410, -413, -416, -419, -422? -3d - 404 What is the d'th term of -67, -63, -57, -49, -39, -27, -13? d*2 + d - 69 What is the s'th term of 31, 57, 83? 26s + 5 What is the i'th term of -8, -29, -72, -149, -272? -2i3 + i2 - 10i + 3 What is the v'th term of -24, -17, -4, 15, 40, 71, 108? 3v2 - 2v - 25 What is the q'th term of -2360, -2373, -2400, -2447, -2520, -2625, -2768, -2955? -q3 - q2 - 3q - 2355 What is the n'th term of -6, -23, -32, -27, -2, 49, 132? n3 - 2n*2 - 18n + 13 What is the c'th term of 2148, 4299, 6452, 8607, 10764, 12923, 15084? c*2 + 2148c - 1 What is the g'th term of 8669, 8670, 8671? g + 8668 What is the s'th term of 25, 17, 3, -17, -43, -75, -113? -3s2 + s + 27 What is the t'th term of -8, -26, -48, -74? -2t*2 - 12t + 6 What is the g'th term of -3, 24, 75, 150, 249, 372, 519? 12g2 - 9g - 6 What is the r'th term of -684, -1370, -2056, -2742, -3428? -686r + 2 What is the j'th term of 13, 53, 101, 157, 221, 293, 373? 4j*2 + 28j - 19 What is the f'th term of -11, -55, -99, -143, -187? -44f + 33 What is the m'th term of 26, 46, 66? 20m + 6 What is the y'th term of 163, 647, 1463, 2617, 4115, 5963, 8167, 10733? y*3 + 160y*2 - 3y + 5 What is the p'th term of 2159, 4317, 6475, 8633, 10791, 12949? 2158p + 1 What is the a'th term of 121, 248, 381, 520, 665? 3a*2 + 118a What is the r'th term of -186, -377, -572, -771, -974? -2r2 - 185r + 1 What is the c'th term of -171, -169, -167? 2c - 173 What is the y'th term of 52, 85, 118, 151, 184? 33y + 19 What is the z'th term of 90, 214, 374, 570, 802? 18z2 + 70z + 2 What is the d'th term of 966, 963, 960? -3d + 969 What is the m'th term of -6054, -12112, -18170, -24228? -6058m + 4 What is the x'th term of -42, -84, -126, -168? -42x What is the s'th term of -29, -41, -59, -77, -89? s3 - 9s*2 + 8s - 29 What is the d'th term of 256, 516, 772, 1024, 1272, 1516, 1756? -2d2 + 266d - 8 What is the f'th term of 1029, 2062, 3095, 4128? 1033f - 4 What is the c'th term of 1189, 1173, 1139, 1081, 993, 869, 703? -c3 - 3c2 + 1193 What is the h'th term of 6, 6, 14, 36, 78, 146? h3 - 2h2 - h + 8 What is the q'th term of 16, 22, 24, 16, -8? -q3 + 4q*2 + q + 12 What is the g'th term of -1117, -2233, -3349, -4465, -5581, -6697? -1116g - 1 What is the b'th term of -74, -105, -136, -167, -198? -31b - 43 What is the q'th term of 40, 21, 2, -17, -36, -55? -19q + 59 What is the p'th term of 7, 1, -7, -17? -p*2 - 3p + 11 What is the b'th term of -2182, -2181, -2180? b - 2183 What is the z'th term of 36, 37, 38, 39? z + 35 What is the m'th term of -80, -127, -166, -197, -220, -235? 4m2 - 59m - 25 What is the a'th term of -7, -24, -49, -82, -123, -172, -229? -4a2 - 5a + 2 What is the o'th term of 2135, 4271, 6407? 2136o - 1 What is the o'th term of -35, -34, -33, -32? o - 36 What is the u'th term of -257, -511, -765, -1019, -1273, -1527? -254u - 3 What is the w'th term of 3271, 3273, 3275, 3277, 3279, 3281? 2w + 3269 What is the r'th term of -57, -83, -109, -135? -26r - 31 What is the d'th term of -4935, -4931, -4917, -4887, -4835, -4755, -4641? d3 - d2 - 4935 What is the r'th term of -9, -18, -47, -108, -213, -374? -2r3 + 2r2 - r - 8 What is the u'th term of 6, 23, 50, 93, 158, 251, 378, 545? u3 - u*2 + 13u - 7 What is the s'th term of -279, -1110, -2489, -4410, -6867, -9854? s*3 - 280s*2 + 2s - 2 What is the g'th term of 44, 47, 50, 53, 56, 59? 3g + 41 What is the q'th term of 9, 6, 3, 0, -3, -6? -3q + 12 What is the y'th term of -124, -174, -258, -376, -528, -714? -17y2 + y - 108 What is the a'th term of -1802, -1807, -1824, -1859, -1918, -2007, -2132? -a3 + 2a - 1803 What is the o'th term of -3, -11, -23, -39, -59? -2o2 - 2o + 1 What is the c'th term of 28, 54, 80, 106, 132, 158? 26c + 2 What is the n'th term of -13, -42, -83, -136? -6n*2 - 11n + 4 What is the u'th term of 639, 629, 603, 555, 479? -u*3 - 2u*2 + 3u + 639 What is the n'th term of -12081, -12076, -12069, -12060, -12049, -12036, -12021? n*2 + 2n - 12084 What is the r'th term of 43, 32, -3, -74, -193, -372, -623, -958? -2r3 + 3r + 42 What is the q'th term of 857, 859, 861, 863? 2q + 855 What is the b'th term of 17, 7, -5, -19? -b2 - 7b + 25 What is the x'th term of -297, -1208, -2735, -4884, -7661, -11072, -15123? -x*3 - 302x*2 + 2x + 4 What is the j'th term of -487, -488, -489, -490, -491? -j - 486 What is the x'th term of -768, -766, -764, -762, -760? 2x - 770 What is the d'th term of 58, 84, 110, 136, 162, 188? 26d + 32 What is the o'th term of -3, 0, -1, -6, -15, -28? -2o2 + 9o - 10 What is the z'th term of -39, -48, -57, -66, -75? -9z - 30 What is the j'th term of 331, 352, 373, 394, 415? 21j + 310 What is the m'th term of 1, -15, -47, -95, -159, -239, -335? -8m2 + 8m + 1 What is the n'th term of -6649, -13293, -19937, -26581, -33225? -6644n - 5 What is the t'th term of 3128, 12491, 28096, 49943, 78032, 112363, 152936? 3121t2 + 7 What is the h'th term of -2862, -2864, -2868, -2874? -h2 + h - 2862 What is the c'th term of -2, 8, 18, 28, 38, 48? 10c - 12 What is the h'th term of -6, -8, -16, -36, -74, -136? -h3 + 3h*2 - 4h - 4 What is the h'th term of 9, 41, 111, 237, 437, 729, 1131? 3h3 + h2 + 8h - 3 What is the z'th term of 60077, 60078, 60079, 60080? z + 60076 What is the o'th term of -8, -29, -60, -101, -152, -213, -284? -5o2 - 6o + 3 What is the q'th term of -222, -210, -202, -198, -198, -202? -2q2 + 18q - 238 What is the h'th term of -73, -92, -137, -220, -353, -548, -817? -2h*	{ "pile_set_name": "DM Mathematics" }
- 139s - 23. Calculate the remainder when 380 is divided by n(-34). 64 Suppose v = 1070 + 1611 - 242. Calculate the remainder when v is divided by 13. 8 Suppose 33k = 39k - 12. Suppose 7p = 3n + kp - 38, 4n = 4p + 40. Calculate the remainder when 15 is divided by n. 3 What is the remainder when 399 is divided by 11/66 - (-298)/12? 24 Let l be (-5 + 6)/(1/1). What is the remainder when 306/l(-7)/(-14) is divided by 26? 23 Let c(x) be the third derivative of -x5/60 - 13x*4/8 - 143x*3/3 + 202x*2. What is the remainder when 216 is divided by c(-11)? 18 Let j(n) = 282n - 77. Suppose 3w = -2r - 3, -w = 4w + 4r + 7. Suppose -p - 4 + 30 = 0. Calculate the remainder when j(w) is divided by p. 23 Suppose 11g - 874 + 96 = 465. Calculate the remainder when 329 is divided by g. 103 Suppose -10h + 393 + 477 + 130 = 0. Calculate the remainder when 713 is divided by h. 13 What is the remainder when 1273 is divided by -21(6 - 405/63)? 4 Let j = 6 - -2. Let k be 36/90 + ((-974)/10 - 0). Calculate the remainder when (-6 - k)10/35 is divided by j. 2 Let m(o) be the first derivative of 0o - 1/2o*2 + 5 + 10/3o*3. Calculate the remainder when 42 is divided by m(1). 6 Let x be 1 - (-1)/((-1)/23). Suppose -3u - 27 = -2o, 4u + 44 = 103o - 100o. Let z = o + x. What is the remainder when 7 is divided by z? 1 Suppose -2 + 4 = t. Let u(q) = 14 + 25qt - 3 + 30q + q*3 - 41q*2. What is the remainder when u(14) is divided by 9? 3 Let j = -4319 + 4469. Calculate the remainder when 1343 is divided by j. 143 Calculate the remainder when 1784/((24/(-15))/(12/(-15))) is divided by 283. 43 Suppose 0 = 10z - 187 - 213. What is the remainder when 277 is divided by z? 37 Suppose -2b = -o - 723, -3b = 12o - 7o - 1091. Suppose 8c + b = 490. Calculate the remainder when 23 is divided by c. 7 Suppose 0 = -2o - 5h - 3 - 3, -10 = -5h. Let d be ((-1)/2)/(12/24). Calculate the remainder when 102 is divided by (-1127)/(-56) + 1 - d/o. 18 Suppose -3a - 1551 = -4v, 2v - 833 = 5a - 68. Let j = v - 294. What is the remainder when j is divided by 31? 3 What is the remainder when 2/((-20 + 11)/(-1332)) is divided by 93? 17 Let y(m) = m*3 - 35m*2 + 34m + 7. Let o be y(34). Suppose -232 = -oz + 6. Calculate the remainder when z is divided by 23. 11 Let o = 47 + -26. Let n = 12002 - 11940. What is the remainder when n is divided by o? 20 Let s(p) = 3p - 20. Let u be s(12). Let j(d) = d - 1. Let x be j(u). Suppose -33 = xg - 633. What is the remainder when g is divided by 7? 5 Let w = -1426 - -1471. Calculate the remainder when 1663 is divided by w. 43 What is the remainder when 1/5 - -12(-10308)/(-120) is divided by 415? 201 Calculate the remainder when 436440/210 - 6/21 is divided by 21. 20 Let d be (-2442)/(-48) + 4/32. Suppose -2u - 5j = -133, 3u + 4j - 189 = -0j. Let t = u - d. Calculate the remainder when 37 is divided by t. 5 Calculate the remainder when ((-8 - -13) + -6 + 2)521 is divided by 78. 53 Suppose 4v + 3r - 836 = 0, 3v + 114 - 748 = -4r. Calculate the remainder when v is divided by 60. 26 Let o = 1600 - 1447. Suppose 0 = -5j - 4j. Suppose 4x - 3t - 91 = 0, j = 5x + t + t - 108. What is the remainder when o is divided by x? 21 Suppose 2d - 133 = 3s, -2d + 95 = -4s - 41. Suppose -d = -5u + 28. Calculate the remainder when 19 is divided by u. 1 Suppose -5t + 2b + 235 = 71, 30 = t + b. Calculate the remainder when 105 is divided by t. 9 Let g = 84 - 54. Suppose 23c = gc - 14. Suppose -cs = -6, 2s + 181 = 5l - s. What is the remainder when l is divided by 8? 6 Let j = 2 - -12. Suppose -10 - j = -v. Suppose 31s + 660 = 35s. Calculate the remainder when s is divided by v. 21 Let g = -15 - -19. Suppose 2m = 5m. Suppose m = 2v + 4d - 68 - 20, -128 = -3v - gd. What is the remainder when v is divided by 22? 18 Calculate the remainder when 0 + 6 - 24486/(-53) is divided by 110. 28 What is the remainder when -23 - 32039/(-92) - (-6)/8 is divided by 31? 16 What is the remainder when 7137 is divided by ((-2358)/(-2751))/((-6)/(-980))? 137 Let g(f) = f3 + 8f*2 - 87f - 585. Calculate the remainder when 1/((1/211)/1) is divided by g(-7). 65 Let p = -261 - -279. Suppose -pv + 16v + 20 = 0. What is the remainder when 17 is divided by v? 7 Suppose 536 = -4p - 4s, 9p + 3s = 13p + 543. What is the remainder when 133 is divided by (17/(-51))/(((-3)/p)/(-1))? 13 Suppose 657 = f - z, f = 4z + 28 + 635. What is the remainder when f is divided by ((-1024)/192)/((-1)/3)? 15 Suppose 25o - 18837 = 4813. Calculate the remainder when o is divided by 463. 20 Suppose 16w - 12 = 132. Suppose wl - 22 = 455. Calculate the remainder when l is divided by 70/4 + 3/6. 17 Suppose -5j = -2f - 364, 80j - 281 = 76j + 5f. Suppose 4d - 2n = 8, 3n - 7 - 1 = d. What is the remainder when j is divided by d? 2 Let g be (14 + -11)(-1934)/(-6). Let w = -522 + g. Suppose -w = 14x - 19x. Calculate the remainder when x is divided by 23. 20 Suppose 0 = -9z + 4z + 5, -3j - 3z + 1608 = 0. What is the remainder when j is divided by 37? 17 Suppose -5d + 1993 = 19d - 1799. Suppose 56 = q + 3. Calculate the remainder when d is divided by q. 52 Let q(k) = 2k2 + 5k - 12. Let i be q(-4). Suppose -3r = y - 2 + 8, 3y - r - 22 = i. Calculate the remainder when 22 is divided by y. 4 Let c = 1228 + 827. Calculate the remainder when c is divided by 121. 119 Suppose -7h + 431 + 32 + 517 = 0. What is the remainder when 29259 is divided by h? 139 Let s = -16027 + 16121. Calculate the remainder when 591 is divided by s. 27 Let u(x) be the third derivative of x6/40 - 7x5/60 - x4/8 + 11x3/6 + x2 - 100. What is the remainder when u(5) is divided by 40? 36 Let u = 28383 + -28357. What is the remainder when 1161 is divided by u? 17 Suppose 33g = 42g + 2826. Let p = g + 325. Calculate the remainder when 41 is divided by p. 8 Let p = 50 + -47. Suppose -2k = -2i - 142, -pi = -6i - 9. Let t = k + -51. Calculate the remainder when 60 is divided by t. 9 Let t(p) = 2p*3 + 20p*2 + 7p - 11. Let r be t(-9). Suppose -3n + r = -n. What is the remainder when (-3)/12-3462 is divided by n? 41 What is the remainder when 305 is divided by ((-21)/9 - -2)/((-11)/(-5 + 599))? 17 Suppose -76p + 71560 = 16950 - 50726. Calculate the remainder when p is divided by 461. 3 Let r(u) = u3 - u2 + u + 39. Let w(g) = -5g + 64 + 7g - g + 29 - g2. Calculate the remainder when r(0) is divided by w(9). 18 Let t(a) = a3 - 46a2 - 41a - 210. What is the remainder when t(48) is divided by 175? 155 Let t be (1 - 224) + -5 - 6. Let r = 245 + t. Calculate the remainder when 42 - 0/(-1 + -3) is divided by r. 9 Let b be (-11)/4 + 3 + (-299)/(-4). Suppose 83n - 86n = -b. Suppose -39 = -2y - 13. Calculate the remainder when n is divided by y. 12 Let u(r) = 34r*2 + 3r + 22. Let q be u(-3). Suppose 66m = 55m + q. Calculate the remainder when 811 is divided by m. 28 Suppose -218z + 223z = 45. Calculate the remainder when (65/20)/(4/48) is divided by z. 3 Calculate the remainder when 4107 is divided by -1 - (-279)/(-18)-2. 27 Suppose 0 = -278r + 4485 + 4689. Calculate the remainder when 480 is divided by r. 18 Let z = 2145 - 2100. Suppose 557 = 4m + 85. Calculate the remainder when m is divided by z. 28 Let h = -143 - -208. Suppose -24 = -2t - 4d, -5t + 4d + h = 9d. Suppose -5y + 3y = -80. Calculate the remainder when y is divided by t. 12 Suppose 0 = l - 17 - 65. Suppose -2z + u = -26, 4u + 74 = 5z + 6u. Calculate the remainder when l is divided by z. 12 Suppose -2s + 6 = -0, -4h + 2s = 306. Let z = 5 - h. Let f(m) = -7m + 21. What is the remainder when z is divided by f(-3)? 38 Let o = -20097 + 20566. Calculate the remainder when 517 is divided by o. 48 Let y(s) = -2178s + 6701. Calculate the remainder when 585 is divided by y(3). 84 Suppose -36 = -18g + 15g. Suppose 4q - 696 = -4s, -7s - 4q + 874 = -2s. Calculate the remainder when s is divided by g. 10 Let l be 305/30 + -6 - 1/6. Suppose 3s + 0g = 3g + 285, -3g = -ls + 378. Let c = -10 - -29. What is the remainder when s is divided by c? 17 Let w(p) be the third derivative of -5p*4/8 - 25p*3/6 - 3p**2 + 6. Calculate the remainder when w	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.