Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
be (1(-14)/u + 1)-6. Which is smaller: w or -17? -17 Let a be 4/(-108)-6 - 1. Suppose -80 = -5n + 50. Let l = -27 + n. Is a bigger than l? True Suppose 0 = 4c + 3r + 210, -148c + 151c - 2r = -166. Do c and -120 have the same value? False Let q(d) = -14d - 28. Let a be q(-7). Suppose 3x - a = -2k, k + 0x - 24 = 4x. Is k bigger than 95/3? True Suppose 5h - 85 - 30 = 0. Let r be 89(7 + -11)/(-4). Suppose -2n - 3y = 2n - r, 0 = -2n + 4y + 50. Are h and n equal? True Suppose 0w = 6w - 30. Suppose 250 = 3c - wj, -2c - 3j = j - 130. Let v = c + -71. Which is bigger: v or 0.1? v Let s(m) = -6m - 1. Let i be s(-2). Suppose ix - 14x = -5w + 148, 44 = 2w - 5x. Which is smaller: w or 33? w Let v = -22.949 + 22.939. Is v at least as big as 332? False Let h(m) = m2 - 37m - 255. Let w be h(43). Is w at least as big as 1/92? True Let a = -11.21 - -0.21. Let l = 12.58 + -25.58. Let o = l - a. Which is bigger: 0.02 or o? 0.02 Let u be (-4 - -8) + 3 + (-6300)/732. Which is greater: -1 or u? -1 Suppose 0 = -215z + 77z - 608028. Is z not equal to -4406? False Let b be ((-177)/(-9))/((-2)/(-6)-1). Let n = 1 - b. Suppose 0u - 3u = n. Which is bigger: -21 or u? u Let i = 188 + -284. Let l = -94 - i. Let t be ((-6)/(-8))/(l/160). Is 61 at most t? False Let y = 3260 + -2808. Which is smaller: 449 or y? 449 Let k(b) = b2 + 5b - 2347. Let a be k(-51). Which is bigger: 5/3791 or a? 5/3791 Let o = -45 - -80. Suppose -9 = 2q - o. Suppose 2u = 4h + 336, 2h - q + 191 = -4u. Is h at most -85? True Let a(n) = -16n - 48. Let b be a(-20). Let m = 2452/9 - b. Which is smaller: m or 2/63? 2/63 Let c = -0.94 - 0.06. Let q = -301.1098 - 0.0902. Let x = q + 296. Are x and c nonequal? True Let a = 19 + -21. Let x = 48 + -71. Let l(u) = u*3 + 23u*2 - 2u - 44. Let w be l(x). Which is bigger: a or w? w Suppose 37 = 30t - 83. Let m be ((-42)/t + 4)8/4. Is -11 at most as big as m? False Let q be ((-560)/(-24))/(-10)(-9)/(-33). Is 0 greater than or equal to q? True Let m = 8 + -2. Let s be (-2)/m - (-30)/9. Suppose 2o = 0, -593p - o - o = -589p - 24. Does p = s? False Suppose i - 2j = 11, -3i = 4j + 11 - 4. Suppose 4h - 3g = -85, -4g + 4 = -ih - 58. Let y be (-18)/h + 2/11. Which is bigger: y or 16/15? 16/15 Let h = -123/34 - -771/340. Let u = h + 3/4. Let p = 3 - 3. Is u equal to p? False Let t = 271.4 - 251. Let j = 20.5 - t. Is 50 at least as big as j? True Suppose 4p - 11 = -7, -181 = 3j + 5p. Suppose -4a + 24 = -3t + 5t, -5t - 12 = -2a. Suppose -258 = ar + 114. Is j >= r? True Let r be (1/(-3))/(1/(-12)) + 6. Let k be (-139)/10 + 2 + (-16)/r. Is k < 2? True Let v be (0 + 4)/(16/(-176)-11). Which is greater: v or -71/2? v Let o(z) = 3z*2 + 17z - 46. Suppose 11 - 101 = 5f. Let n be o(f). Which is bigger: n or 619? n Let x(z) = -z + 25. Let w be x(15). Let v be (-1 - 5) + (16 - w) + 52. Is v smaller than 53? True Suppose -52u - 281u + 6u = -9483. Is -0.011 > u? False Let j = 652.1201 - 0.1201. Let k = -666 + j. Is -0.2 <= k? False Let w(q) = -183q + 120. Let j be w(1). Which is greater: j or -4? -4 Let n be (-272)/(-340) + (-1052)/(-485) + 0. Is -0.2 < n? True Let r = 526761 + -2623772/5. Which is smaller: 2007 or r? r Let b be ((-193952977372)/(-1995))/7 - 2/(-5). Let p = -13888477 + b. Let x = -9/95 + p. Which is bigger: 30 or x? 30 Let j(z) = z2 + 49z - 333. Let s be j(6). Let i(v) = 2v - 6. Let w be i(4). Suppose -2d - 6 = w. Is d > s? False Let d = 310 - -554. Let t = d + -69986/81. Is 1 less than or equal to t? False Let m = -3 + 60. Let t = 8 + m. Let l = t - 19. Which is bigger: l or -1? l Let z = 32.23441 - -0.06559. Is z > -0.1? True Suppose 7q - 4q - 1 = w, q + 9 = -2w. Let n be ((-5)/(-220))/(2/(-21646)). Let v = 246 + n. Are q and v non-equal? True Suppose -8v + 880 = -968. Suppose -2s + 79 = v. Which is bigger: -75 or s? -75 Let t(g) = -102g - 3876. Let y be t(-38). Is 15935 less than y? False Let o = 11.745 - -2794.255. Is o equal to 0? False Let h(q) = 492q3 - 4q*2 - 22q + 5. Let x be h(2). Which is greater: x or 3883? 3883 Suppose 0 = -2j, -3y + 5j + 43 = -14. Suppose 5k = l + 24, l + y = 6k - 2k. Let g = -6521/13 + 502. Which is bigger: g or l? l Let q = 9 + -5. Let d be (0/1)/(q/2). Let l = 818 - 7354/9. Is l not equal to d? True Let p be -44 + 250925/6175 - (-3 - 0). Do -1 and p have the same value? False Let r(d) be the first derivative of d*4/4 + 4d*3/3 + 5d*2 + 22d + 646. Let a be r(-4). Let p = -22 + 2. Which is smaller: a or p? p Let n(g) = 13g2 - 18g*2 + 4g*2 + 0g - 11g - 18. Let w be n(-9). Is w >= 2/33? False Let k = -195/133 + 28/19. Which is greater: -0.1 or k? k Let l = 1.5 + 7.5. Let q = l - 9.06. Let x be (-24)/(-80) - (-4)/(-5). Is x < q? True Let i be ((-1)/27)/(30/(-90))-12-72. Which is greater: 42 or i? i Let h = -7133 + 21398/3. Is h at most as big as 4279? True Let h = -533033470821/20171 - -607519252/23. Let b = 11853 + h. Which is greater: 0 or b? b Let m be (-8)/(-3)17/((-1938)/(-36)). Let r = m - 1. Are r and 1 unequal? True Let z be ((-42)/7 - -8)/(2/49). Let p = z - 27. Suppose 0 = 4i - 4l + 2l + p, 4i = l - 21. Is i not equal to -9/2? True Let z(m) = -5m + 17. Let g be z(4). Let u be (-2)/(-33)g(-195)/26. Which is bigger: u or 2? 2 Suppose 2m + 5x - 350 = 0, 6x - 5x - 8 = 0. Which is greater: 97 or m? m Let n be (3/6)/((165/(-1232))/(-15)). Which is bigger: n or 1392/25? n Let o(i) = -8i + 7. Let b = -50 + 51. Let q be o(b). Is -2/131 > q? True Suppose -87 + 150 = 15a - 78a. Is 1/35495 >= a? True Let h = 5.052 - 1.052. Are 67 and h equal? False Let k = 2509 + -2505. Is 98/33 not equal to k? True Let u = 3955 + -3954.8. Which is greater: u or -0.317? u Let y be 25 + (-14695)/730 + 14/(-4). Do 2 and y have the same value? False Suppose 16f - 21f + 60 = 0. Suppose -14 = -h + 2t, -h + 3t = -f + 2. Are 25 and h non-equal? True Let v = -233.2 - -232.7. Is v <= -2849? False Let q(a) = 8a3 - a2 + 4a - 3. Let b(n) = -3n3 - n + 1. Let o(c) = -11b(c) - 4q(c). Let s be o(-5). Suppose -s = d - 2. Is d < 3? True Let u(k) = 50k*2 - 72k + 285. Let w be u(4). Are 797 and w non-equal? False Let i = 13346 + -13561. Is i at most as big as -213? True Suppose 12x - 16 = 32. Let f be x/(-5)13/(-546). Does 1 = f? False Suppose c = 4a - 17, 2 + 5 = c + 2a. Let k(o) = 10 - 9o - 10o + 21o. Let f be k(-6). Which is smaller: f or c? f Let c = -19856 + 18582. Which is greater: c or -1276? c Let k = 194 - 300. Let h = -45 - 62. Which is bigger: h or k? k Suppose 5u = c + 328, c - 13u = -9u - 325. Let x be (-157)/(21/4)1. Which is greater: x or c? c Let x = -2/2749 - 1795079/24741. Let b = x + 2438/63. Which is greater: -33 or b? -33 Let t = 35159 + -35149.2. Which is bigger: 11.4 or t? 11.4 Let j = -241.6 - -200.56. Let k = j + 0.04. Let y = -40 - k. Is y > -2? True Let a = -152 - 294. Let d = 437 + a. Which is smaller: d or -1/15? d Let f = -121 + 192. Let r = -52.5 - 18.5. Let k = f + r. Which is smaller: k or -0.19? -0.19 Let m = -1411 + 1277. Which is greater: m or -133? -133 Let t be 46/126 + 399/(-2793). Let u = -2 - -1.928. Which is greater: t or u? t Let g(r) = -2r2 - 14r - 11. Let u be g(-6). Let q be u/54(-5 + 7). Which is bigger: 1 or q? 1 Let i(z) = z3 - 11z*2 - 12z + 5. Let n be i(12). Let w(q) = -q*3 + 21q*2 + 445q + 22. Let r be w(-13). Which is smaller: n or r? r Suppose j + 6 = 2j + 3w, -3j + 39 = 2w. Let r = -115045 + 115051. Which is greater: j or r? j Let h be (((-18196)/(-20320))/1)/((-18)/344). Let b = 3/1270 + h. Which is smaller: -18 or b? -18 Let v = 12667.999 - 12695. Let n = v - -0.001. Let z = n - -27. Which is greater: -17 or z? z Let q(f) = -f*3 - 4f*2 + 3f + 12. Let d be q(-4). Let x = 10 - -2. Suppose -5b = -o - 18, 2b - x = o - db. Which is smaller: o or 0? o Let v = -297 + 297. Suppose 5 = -3f - 4. Let r be (4/f)/(-264/8). Is r at least v? True Let a be 8/((-2720)/(-50))-1. Suppose -k = k + 8, -3k - 10 = -2i. Are a and i unequal? True Let w = -2.3 + 2.294. Let b = -0.9137 + -0.0863. Is w greater than or equal to b? True Let n be (-177)/1593 - (-1 + 88946/9). Let m be ((-81)/n)/(2/(-4)). Does 1/3 = m? False Suppose 11*z - 3939 = 5224. Suppos	{ "pile_set_name": "DM Mathematics" }
d Which is the fourth biggest value? (a) 0.2 (b) 8 (c) 1 (d) -30 d What is the second smallest value in 114, 2/11, 0.2, 0.5, 4? 0.2 Which is the fifth biggest value? (a) -3/5 (b) -2/259 (c) -1 (d) -1/5 (e) -3 e Which is the fourth smallest value? (a) -1/3 (b) 4/9 (c) -2 (d) -17 b What is the biggest value in -1, 0.6, -1/18, 1? 1 What is the biggest value in -18/7, 0.17, 0.5? 0.5 Which is the fifth biggest value? (a) -12 (b) -1/3 (c) 0 (d) 14 (e) -5/3 a Which is the third biggest value? (a) -2 (b) 2/3 (c) 1/4 (d) -0.27 d Which is the second smallest value? (a) -5 (b) -1/64 (c) 1.3 (d) -0.2 d What is the biggest value in 0.07, 1, -1/2, 1/3? 1 Which is the second smallest value? (a) -2/35 (b) -4 (c) -6.3 b What is the second smallest value in -2/7, 1/5, -0.008, 2/3? -0.008 What is the second biggest value in -0.1, -0.05, -1? -0.1 Which is the fifth biggest value? (a) 0.2 (b) 5 (c) 4/7 (d) -60/19 (e) -3 d What is the biggest value in 0.1, -0.2, -2/135, 5? 5 Which is the smallest value? (a) 0.8 (b) 3 (c) -4 (d) 1 c What is the biggest value in 3, -2/13, -3? 3 What is the third smallest value in 0.1, 0.2, -748? 0.2 What is the third smallest value in -0.5, 2/9, -0.2, -0.311? -0.2 Which is the biggest value? (a) 34/3 (b) -2/7 (c) 5 (d) -39 a What is the fourth biggest value in -0.11, 0.09, 3/5, -1? -1 What is the second biggest value in -3/2, -8/17, 3? -8/17 Which is the smallest value? (a) 2 (b) -7/5 (c) 0.3 (d) 0 (e) 50 b What is the second smallest value in -7, 4, 5, -2/5, -3/11? -2/5 What is the smallest value in 40, -0.1, 2/5, -1? -1 Which is the fourth smallest value? (a) -2/21 (b) -5 (c) -16/3 (d) -0.001 d Which is the third smallest value? (a) -2/11 (b) 4 (c) 1/528 b Which is the smallest value? (a) -28 (b) 4 (c) -0.4 a Which is the second smallest value? (a) 4 (b) -13 (c) 1 (d) -0.2 (e) -1/2 e Which is the third smallest value? (a) 1 (b) -6 (c) 2 (d) -5 (e) -3/4 e Which is the smallest value? (a) 0 (b) -4 (c) 4 (d) 4.4 (e) 3 b What is the third biggest value in -0.2, 5, -9, -11? -9 What is the fifth biggest value in 0.4, 3/5, -4.3, -1, -0.08? -4.3 Which is the third smallest value? (a) -1/4 (b) -3/5 (c) -0.0475 c Which is the third biggest value? (a) -18/5 (b) 3.8 (c) -0.2 a Which is the second biggest value? (a) -0.2 (b) 2/7 (c) 3 (d) -0.1 b Which is the second smallest value? (a) -4 (b) 59 (c) -3 (d) -2 c What is the third smallest value in 5, 0.1, 1/5, -5? 1/5 Which is the third smallest value? (a) 0.3 (b) 5 (c) 30 c What is the fourth biggest value in -4/9, 1/28, 0.5, 5? -4/9 Which is the second biggest value? (a) 4 (b) -0.05 (c) 3 c What is the third smallest value in -21.3, -3, 4? 4 Which is the third biggest value? (a) 4 (b) 1/57 (c) -4 c What is the second biggest value in -5, -0.2, 0.7, -4/25, 0.3? 0.3 What is the biggest value in -33.2, -0.3, 1? 1 Which is the second smallest value? (a) -1/6 (b) 1 (c) 4/5 (d) -245 a Which is the smallest value? (a) 1/11 (b) 1/3 (c) 0.1 (d) 0.15 a Which is the second smallest value? (a) -15/4 (b) 2 (c) -4 (d) -0.2 a Which is the third smallest value? (a) -2/17 (b) -0.42 (c) -3 (d) 0 a Which is the third smallest value? (a) 2/19 (b) 0.1 (c) 5 (d) -1.3 a What is the fourth biggest value in 8, -1/5, 4, -3/5? -3/5 What is the fourth biggest value in -2/9, -3, 1, -2? -3 What is the fourth biggest value in 0, 3, -1/4, -2/3? -2/3 Which is the biggest value? (a) -2/73 (b) -2 (c) 0.3 (d) 0 c What is the fourth biggest value in 100/3, 6, -1, -3? -3 Which is the biggest value? (a) 3 (b) -13 (c) -0.2 a What is the fourth smallest value in 4, -2/2089, -1/3, -4, -1? -2/2089 Which is the fourth biggest value? (a) 9/5 (b) -5 (c) 4/5 (d) -2/9 b Which is the biggest value? (a) 3/7 (b) -0.832 (c) 0.4 a What is the third smallest value in 1, 1/5, 96, 3/5? 1 Which is the smallest value? (a) 0.1 (b) 14 (c) -120 c Which is the smallest value? (a) -25/51 (b) -1 (c) -2/5 b Which is the fourth smallest value? (a) 2 (b) -8/17 (c) 2/7 (d) -3/4 a Which is the fourth smallest value? (a) -1 (b) 543 (c) 2/7 (d) 0 (e) 0.2 c What is the biggest value in 1, -3/5, -2/5, -3/65, 5? 5 Which is the second biggest value? (a) -3 (b) 2 (c) 0.66 (d) -45 c What is the fourth biggest value in -2, 34, -0.4, -0.3, -0.2? -0.4 What is the third smallest value in 5, -3/5, -1/3? 5 What is the smallest value in 10.54, 0.4, -3? -3 Which is the biggest value? (a) 0.38 (b) 0.29 (c) 1 (d) 1/3 c Which is the fourth smallest value? (a) 7 (b) 10 (c) 1 (d) -5 b What is the third biggest value in -0.4, -3, 1/807? -3 Which is the smallest value? (a) 4 (b) 35 (c) -12 c What is the second smallest value in -2/9, -6, 19/3, -0.4? -0.4 Which is the second smallest value? (a) 10 (b) 3.2 (c) -1 b What is the second smallest value in -2, 4, 5, 118? 4 What is the fourth biggest value in 1/2, -0.2, 0, -40? -40 What is the smallest value in -5, -0.5, -196, -1? -196 Which is the second biggest value? (a) -0.07 (b) -1 (c) -4/3 (d) 5 a What is the third smallest value in -383, -3, 1/2? 1/2 What is the fifth smallest value in -5, -5/3, 0.825, 0.4, 0? 0.825 What is the fourth smallest value in -3/40, 0.3, 4, -4, 1? 1 Which is the second smallest value? (a) 17 (b) -5 (c) -0.2 c Which is the biggest value? (a) -5 (b) 13 (c) -3 (d) 0.5 b Which is the fourth smallest value? (a) -2/3 (b) 0.5 (c) -18.1 (d) -6 b What is the third biggest value in 2, 0.3, -4, 29? 0.3 Which is the smallest value? (a) 3/22 (b) -3 (c) -4/5 b What is the fourth biggest value in 69, -2/15, -2, 0, -1? -1 Which is the second biggest value? (a) -2/15 (b) -1/4 (c) 3 (d) 0.2 d Which is the fourth smallest value? (a) -0.2 (b) 1 (c) 0 (d) 6 d Which is the second biggest value? (a) 2/5 (b) 2 (c) 0.45 (d) 3/17 (e) 5 b What is the third smallest value in -3/124, -0.3, 2/5, 4? 2/5 Which is the biggest value? (a) -1 (b) 1 (c) -1/14 b Which is the second smallest value? (a) -1 (b) 1/2 (c) -6/19 (d) 5 (e) 8 c What is the second smallest value in -1, -61, 0.8? -1 Which is the second biggest value? (a) 0 (b) -80 (c) 2 (d) -0.2 a Which is the third biggest value? (a) -2 (b) 79 (c) 0.1 (d) 5 c Which is the smallest value? (a) 2/5 (b) -4 (c) -4/15 (d) 3/4 b Which is the third biggest value? (a) 18 (b) 3 (c) 2/5 (d) 4 b What is the smallest value in -4, 117, 4? -4 What is the second biggest value in -1, -2, 21, 0.5? 0.5 What is the fourth smallest value in 12/73, -1, -2/3, -16? 12/73 What is the smallest value in 1, 2/7, -148? -148 What is the fourth biggest value in 0.4, -2/7, 3, -4? -4 What is the smallest value in 4, -34, -8, -2? -34 Which is the third smallest value? (a) -2 (b) 3 (c) 225 c Which is the second biggest value? (a) -11/6 (b) 0.08 (c) 3 (d) 4 c Which is the third smallest value? (a) 5 (b) 197 (c) 0.4 b What is the biggest value in 0.3, 5/4, -2, 12/19? 5/4 Which is the second smallest value? (a) 0.5 (b) 0 (c) -0.38 (d) -4 c What is the third smallest value in -2, 9, -0.001? 9 What is the second biggest value in 1/5, 26, 57? 26 Which is the biggest value? (a) -4/5 (b) -0.1 (c) -5/128 (d) -0.2 c What is the fourth smallest value in 2, -0.098, -0.05, -5? 2 Which is the second smallest value? (a) 3/2 (b) 5 (c) -1 (d) -2/3877 (e) -0.1 e Which is the fourth smallest value? (a) 5/4 (b) 0 (c) -93 (d) -1/11 a Which is the second smallest value? (a) 74 (b) 0.2 (c) 3 c What is the third biggest value in -3/7, 0, 41, 1.1? 0 Which is the third biggest value? (a) 3 (b) 4/13 (c) 1/10 c Which is the second smallest value? (a) -885 (b) -0.5 (c) 0.5 b What is the third smallest value in 5, -1, 4, 2, 0.8? 2 Which is the second biggest value? (a) -0.047 (b) -4/7 (c) -2/7 c What is the fourth biggest value in -2/11, 3/2, 0.11, -0.5, 2? -2/11 What is the fourth smallest value in 4, 1/16, -0.2, 0.5, -38/7? 0.5 What is the biggest value in 7, 0, -4? 7 What is the second smallest value in 2/3, -1/4, -11, 9? -1/4 What is the fourth biggest value in 0.2, -2/61, -3, 0.3, -5? -3 What is the second smallest value in -1, -4, 0.7? -1 Which is the second smallest value? (a) -9 (b) -2/1	{ "pile_set_name": "DM Mathematics" }
p*2 - 39p - 12. Let y be r(12). Round y to the nearest 1000000. 57000000 Let f = 40.9984 - 41. Let o = 0 + f. Round o to three dps. -0.002 Let u(w) = 6w + 3. Let v be u(-2). Let o = -6 - v. Suppose -1210000 = 4d - od. What is d rounded to the nearest 100000? -1200000 Suppose 523h + 323520 = 517h. What is h rounded to the nearest 10000? -50000 Let a = -211 + 210.831. What is a rounded to 2 decimal places? -0.17 Let c = 4.8 + -4.799724. Round c to 4 dps. 0.0003 Suppose -5f + 4f - 14 = 0. Let j = -9 - f. Suppose t + 5c + 50404 + 2849606 = 0, 0 = -jt - 3c - 14500006. Round t to the nearest one million. -3000000 Suppose 31835382 = -30u - 62754618. Round u to the nearest 100000. -3200000 Let n be 1580403/(-4) + 22 + 255/(-12). Round n to the nearest 100000. -400000 Let m = -22724565.993 + -12922.007. Let g = m - -22737486.9300081. Let j = g + 1.07. What is j rounded to 6 decimal places? 0.000008 Let v = -909 - -908.9999411. Round v to 5 dps. -0.00006 Let c = 812 - 417. Round c to the nearest 10. 400 Let o = 19579 - 9752. Let k = o - 18027. What is k rounded to the nearest one thousand? -8000 Let x(p) = -3p - 3. Let k(t) = -2t - 3. Let m(y) = 4k(y) - 3x(y). Let d be m(3). Suppose 5l - 33 - 32 = d. Round l to the nearest ten. 10 Let c = 89.322 + -0.122. Round c to the nearest 10. 90 Suppose 11c = 10c + 23. Let m be c2(-697)/34. What is m rounded to the nearest 100? -900 Let k = -6.66 - -6.029. Let s = 0.6609 + k. Let c = -0.03 + s. What is c rounded to five dps? -0.0001 Let n = -144903100.000122 + 144903229. Let y = -129 + n. Round y to five decimal places. -0.00012 Let q(z) = 362151z - 4. Let o be q(-6). Let i = o + 3716239. Let k = -276671 - i. What is k rounded to the nearest 100000? -1800000 Let h = 0.3276 + 28.0524. What is h rounded to 0 dps? 28 Let k = -91 - -191. Let j = 1132.1811 - 1032.174. Let z = k - j. Round z to 3 dps. -0.007 Let d = -0.084 + 0.0840329. Round d to 6 dps. 0.000033 Let m be (49600/6)/(506244/(-56250) + 9). Round m to the nearest one million. 78000000 Let j = -0.277500713 + 0.2775. What is j rounded to seven dps? -0.0000007 Let j be (2 + 0)174/12-197. Round j to the nearest one thousand. -6000 Let t = 1173.97996 - 1174. Round t to three decimal places. -0.02 Let a = -16 + 69. Let l = -7 + a. Let d = l + -46.00204. Round d to four decimal places. -0.002 Let b = -1.9 - -1.899999405. What is b rounded to 7 decimal places? -0.0000006 Let u = -2.5 + 3. Let y = u + -0.46. Let x = y + -0.74. Round x to the nearest integer. -1 Let n = -13 + 20. Suppose -2g - 220000 = -ng. What is g rounded to the nearest 10000? 40000 Let g = -12 - -14. Suppose 0 = gf + 3r, -3r = 2r - 20. Let p be ((-376)/f)/(2/30). What is p rounded to the nearest 100? 900 Suppose -5o + 17 = -3. Suppose -118 = -os - 3l, -5s - l - l + 144 = 0. Suppose -4y - s = -m + 12, 2y = 5m - 2. Round y to the nearest integer. -11 Let i = 3234263147 + -3234263265.49711365. Let g = 114.797113 + i. Let r = -3.7 - g. Round r to 7 dps. 0.0000007 Let w(x) = -4x + 3. Let i be w(0). Suppose 0 = ih + 3u + 181800000, 0 = -3h + 4h + 3u + 60600000. What is h rounded to the nearest 1000000? -61000000 Let w = -147.8 - -133. Let k = -475.51 + 460. Let o = w - k. Round o to one dp. 0.7 Suppose 2r = -3r. Suppose -3q + 2f - 32 = -5q, 5q + 2f - 77 = r. Let j be (-18)/(5/(q/3)). Round j to the nearest 10. -20 Let r = 19 + -18.886. Let v = 0.0982 - r. What is v rounded to three dps? -0.016 Let q = 533.9999285 + -534. Round q to five decimal places. -0.00007 Let l = 53.6815 - 43.678. Let n = -7 + -3. Let q = n + l. Round q to 3 dps. 0.004 Let d = 19.9301 + 1.1359. What is d rounded to one dp? 21.1 Let q = -3654 + 3668.048. Round q to 0 dps. 14 Let c = 1.9 - 4.4. Let i = c - -2.33. Let v = 0.1700044 + i. What is v rounded to six dps? 0.000004 Let y = 8179 + -8178.999984973. What is y rounded to six dps? 0.000015 Suppose -21j + 20j = -33414. Suppose -t - j = -7914. Let x = 37300 + t. What is x rounded to the nearest one thousand? 12000 Suppose 4d = 9d - 815. Suppose -3p + 440 + d = -3q, -q - 5p = 195. What is q rounded to the nearest 100? -200 Suppose -4j + 151199973 = -3q, -q + 96243487 - 20643488 = 2j. Let c be (-2)/(-18) - j/(-27). Round c to the nearest one hundred thousand. 1400000 Let z = 2002 - 2002.000003374. Round z to 7 dps. -0.0000034 Let a(z) = 99z*2 + 27z - 22. Let m be a(-22). What is m rounded to the nearest 10000? 50000 Suppose 0 = g - 3l - 6, l - 30 = -5g - l. Suppose 0 = t + 5h + 13, 0 = t + h + 1. Suppose 0 = -gz + tz + 296. What is z rounded to the nearest ten? 70 Suppose -9x - 2257 = 888563. Round x to the nearest one thousand. -99000 Let o = -1.42 + 1.3907. What is o rounded to 3 dps? -0.029 Let o = -191495477.1000707 + 191495343. Let b = -134.1 - o. Round b to 5 decimal places. 0.00007 Let v(l) = 1164l - 28. Let n be v(-3). What is n rounded to the nearest one hundred? -3500 Let q(s) be the third derivative of -29s*5/15 - 5s*4/8 - 13s*3/2 - 19s*2. Let v be q(19). Round v to the nearest ten thousand. -40000 Let g = 13 + -12. Suppose -5x + 5r + 45935 = 0, -3r = 2r - 20. Suppose p + x - 2693 = -2z, 0 = z - g. Round p to the nearest one thousand. -7000 Let w(h) = -3648001h + 1. Let g be w(1). What is g rounded to the nearest one hundred thousand? -3600000 Let c = -10 - -8. Let n = c + 6. Suppose 4v + 5l + 83995 = 0, nv = -6l + 3l - 83997. What is v rounded to the nearest 10000? -20000 Let k = -2448 - -2448.0171. Round k to 3 decimal places. 0.017 Let l = 85815.9 + -512263.9. Let z = -426446.199945 - l. Let g = -1.8 + z. Round g to 5 decimal places. 0.00006 Let r(x) = 9705880x + 40. Let f be r(17). Suppose 8t = 13t - f. What is t rounded to the nearest one million? 33000000 Let s = 2 - -5. Let o(x) = -106044x*2 + 5x + 10. Let k be o(s). Let g = -22196111 - k. What is g rounded to the nearest 1000000? -17000000 Let h = 46.54357 - -0.22843. Let t = -46 + h. What is t rounded to 1 dp? 0.8 Let y = 4.5182 - 4.5391682. Let b = y + 0.0209. What is b rounded to 5 decimal places? -0.00007 Let m = 605.55 - 579. What is m rounded to the nearest ten? 30 Let t(n) = -n*2. Let c be t(-1). Let h be c - 2/1 - -28. Suppose -4p + 6999 = 4m + 179, 5p = -h. What is m rounded to the nearest one hundred? 1700 Suppose -6d + 5d = -3. Suppose dh + 277 = 847. Round h to the nearest one hundred. 200 Let c = -187.3000001992 - -187.3. Round c to seven dps. -0.0000002 Let s = -11.8087 + -0.0013. Round s to the nearest integer. -12 Let a = -19.35 + -5.83. What is a rounded to the nearest integer? -25 Let i = -7.33 + 103.73. Let a = 62.5 - i. Let n = a - -36. Round n to zero decimal places. 2 Let i = 1.11 - 1.2. Let h = -0.08941 - i. Round h to four dps. 0.0006 Let w be 5/100/(-2). Suppose -320g + 36 = -316g. Suppose w = -gn + 6n + 2130000. Round n to the nearest one hundred thousand. 700000 Let f = -775 - -774.202. Round f to 1 dp. -0.8 Let b = 786824 - 231446. Let l = 955378 - b. What is l rounded to the nearest one hundred thousand? 400000 Let y = 0.4936 + -134.1286. Let o = y - -134. Round o to one dp. 0.4 Let c = 812 + -812.00166. Round c to 3 decimal places. -0.002 Let c = -306760 + 306760.599929. Let i = -0.63 + 0.03. Let x = i + c. What is x rounded to five decimal places? -0.00007 Let n be (202012734/48)/(-11) - 2/16. Round n to the nearest 100000. -400000 Let d = -3.048 - 1.322. Round d to zero decimal places. -4 Let m = 1634.1 - 1489.906. Let u = m + -144. Let i = u - 0.2. Round i to 3 dps. -0.006 Let d = -6529 - -11602. Suppose 0 = -u + 2 - 5, 3t + u = -d. Round t to the nearest 100. -1700 Suppose -4r = 32 - 1656. Round r to the nearest one hundred. 400 Let k = 22933 - 15218. Suppose 0 = -3m - 45079 - k. Let o be 0 + m + -1 + -1. Round o to the nearest 1000. -18000 Let v(b) = b3 - 9b*2 + 15b - 2. Let r be v(7). Suppose -2d + 2m = d + 289, -180 = 2d + rm. What is d rounded to the nearest ten? -100 Let k = 1615001 - 705001. Round k to the nearest one hundred thousand. 900000 Let n = 2.3 - 1.8. Let j = n + -0.49808. Round j to 4 decimal places. 0.0019 Suppose 2t - 45000000 = -7t. Round t to the nearest one million. 5000000 Let l = -84.86 - -1.86. Let z = 83.0000355 + l. What is z ro	{ "pile_set_name": "DM Mathematics" }
0). 14 Let x(l) = 38l + 71. Calculate x(-7). -195 Let j(d) = -89d - 9515. Determine j(-107). 8 Let f(k) = 693k + 654. What is f(-1)? -39 Let f(x) = 12x + 52. Give f(-10). -68 Let n(g) = -g*2 + 2878g + 66719. What is n(-23)? -4 Let g(v) = 97v - 840. Give g(9). 33 Let o(f) = -f3 - 74f*2 + 152f - 137. Determine o(-76). -137 Let g(z) = z*2 + 862z + 7656. Give g(-9). -21 Let q(t) = 537t + 1677. What is q(-3)? 66 Let a(z) = -3z*2 - 30z - 48. What is a(0)? -48 Let r(o) = -312o3 - o2 - 28o - 28. Determine r(-1). 311 Let n(y) = 13y2 + 1180y + 1181. Give n(-1). 14 Let z(t) = t*2 - 53t + 575. Give z(17). -37 Let p(q) = -739q - 4442. Calculate p(-6). -8 Let r(i) = 94i*2 - 14i + 23. Determine r(2). 371 Let a(l) = -8l2 + 37l - 144. Calculate a(4). -124 Let y(s) = 380s + 3421. What is y(-9)? 1 Let j(r) = 6r + 220. Calculate j(-33). 22 Let w(s) = -s*3 + 15s*2 + 3s + 906. What is w(18)? -12 Let z(w) = -3w3 - 6w*2 + 2w + 4. Give z(-2). 0 Let o(l) = -73l + 32. What is o(11)? -771 Let l(n) = n3 - 4n*2 + 14n - 25. Calculate l(3). 8 Let l(x) = 4x2 - 108x - 105. Calculate l(27). -105 Let r(n) = 32n + 998. Determine r(-21). 326 Let a(l) = 38l + 548. Calculate a(-13). 54 Let o(g) = -3g2 - 240g - 2277. Calculate o(-11). 0 Let x(y) = -2y2 + 63y + 164. Determine x(34). -6 Let u(r) = -2r2 + 21r - 36. Calculate u(8). 4 Let j(z) = -61z + 433. What is j(7)? 6 Let n(o) = o2 + 24o - 1. Calculate n(-21). -64 Let g(w) = 346w + 17305. Determine g(-50). 5 Let q(t) = 2t*2 + 55t - 150. Determine q(-29). -63 Let m(a) = -12a - 306. What is m(-21)? -54 Let u(g) = 3g*3 + 4g*2 + 58g + 103. Give u(-2). -21 Let k(u) = u*3 - 14u*2 + 12u + 16. What is k(9)? -281 Let d(t) = -39t - 35. Give d(-5). 160 Let w(b) = 2b*2 - 53b + 92. Calculate w(25). 17 Let h(t) = 93t - 93. What is h(-7)? -744 Let p(r) = -6r*2 - 113r - 78. Give p(-18). 12 Let p(d) = -161d + 2091. Give p(12). 159 Let t(o) = 208o - 7683. Determine t(37). 13 Let u(f) = -132f2 - 46f + 97. Calculate u(2). -523 Let l(w) = 5w3 - 260w*2 - 3w + 127. Give l(52). -29 Let n(w) = 3w3 + 26w*2 - 50w - 175. Give n(-10). -75 Let i(a) = 3a3 + 13a*2 - a + 29. Determine i(-7). -356 Let n(d) = 9d + 343. Calculate n(-39). -8 Let m(p) = p*3 + 42p*2 + 274p + 17. Determine m(-8). 1 Let a(y) = 2y3 + 24y*2 - 36y - 501. Calculate a(-12). -69 Let o(s) = -10s2 + 72s - 114. Determine o(2). -10 Let p(q) = -3q2 - 2q + 395. Determine p(-20). -765 Let u(f) = 8f + 131. What is u(-17)? -5 Let o(a) = -a2 - 40a - 52. Determine o(-37). 59 Let o(m) = -17m3 - 7m*2 - 3. Determine o(2). -167 Let i(c) = 18c + 2200. What is i(-119)? 58 Let h(l) = 9l2 + 116l - 300. Give h(-15). -15 Let p(z) = 5z3 - 8z*2 + 10z - 11. Determine p(4). 221 Let d(q) = -q*2 - 3q + 36. Determine d(5). -4 Let l(b) = -b*3 + 31b*2 - 27b + 29. Determine l(30). 119 Let r(d) = 7d - 257. Give r(34). -19 Let k(x) = -x2 - 7196x + 57623. Determine k(8). -9 Let g(l) = 2l3 - 81l*2 - 611l - 15. What is g(47)? -15 Let o(t) = -10t2 - 131t + 128. Give o(-14). 2 Let n(x) = -4191x + 25152. What is n(6)? 6 Let x(y) = -1560y + 12502. Calculate x(8). 22 Let k(v) = 54v - 62. Calculate k(5). 208 Let w(x) = 2x*2 + 68x - 6659. Calculate w(-77). -37 Let w(i) = -4i2 + 83i - 215. What is w(18)? -17 Let o(z) = 8z2 - 47z - 567. Give o(-6). 3 Let v(a) = a*3 + 45a*2 - 97a - 5. What is v(-47)? 136 Let j(y) = 2y2 + 32y + 205. What is j(-8)? 77 Let s(n) = -4600n - 18433. Give s(-4). -33 Let f(o) = 2o*2 + 17o - 2042. Calculate f(28). 2 Let o(z) = -14z + 127. Give o(4). 71 Let b(n) = 13n*2 - 3n - 10. Give b(4). 186 Let z(q) = -7q - 116. Give z(-12). -32 Let b(w) = 82w*2 + 5742w + 141. What is b(-70)? 1 Let v(s) = 830s + 108725. Calculate v(-131). -5 Let q(u) = u3 + 77u*2 + 225u + 221. Calculate q(-74). -1 Let m(g) = 54g2 - 260g - 47. Give m(5). 3 Let c(d) = d*3 - 18d*2 + 52d - 164. Calculate c(16). 156 Let v(z) = 3z3 + z2 - 8z - 2. Calculate v(-4). -146 Let r(i) = -i*2 + 802i - 15640. Give r(20). 0 Let c(d) = -10d3 - 5d - 18. What is c(-2)? 72 Let a(n) = 747n - 1488. Determine a(2). 6 Let u(d) = d2 - 26d + 275. Calculate u(16). 115 Let s(l) = 83l + 106. What is s(2)? 272 Let o(y) = 51y*2 - 665y - 697. Calculate o(14). -11 Let r(i) = i*2 - 4i - 277. Determine r(-24). 395 Let c(r) = -674r - 6740. Calculate c(-10). 0 Let n(x) = -3x*3 + 27x*2 + 27x - 237. Calculate n(9). 6 Let p(f) = -158f - 3875. What is p(-26)? 233 Let c(f) = -f3 - 12f*2 - 48f + 4. What is c(-11)? 411 Let f(m) = 10m2 + 140m + 468. Determine f(-9). 18 Let t(b) = -30b - 60. What is t(-4)? 60 Let p(a) = -5a*3 + 26a*2 - 79a + 372. Determine p(5). 2 Let v(u) = -u*3 - 37u*2 - 161u - 38. Calculate v(-32). -6 Let j(u) = -34u - 2129. Calculate j(-65). 81 Let p(l) = l2 - 9l + 29. Calculate p(4). 9 Let x(n) = -673n + 19508. Calculate x(29). -9 Let i(s) = 41s - 774. What is i(19)? 5 Let m(d) = 31d + 1714. Calculate m(-54). 40 Let s(k) = 3204k + 9626. Determine s(-3). 14 Let z(m) = 3m3 + 64m*2 - 41m - 1300. Determine z(-21). 2 Let t(d) = -436d - 26. Calculate t(0). -26 Let r(y) = -y3 + 11y*2 + 28y - 25. Give r(13). 1 Let n(o) = -o*2 + 23o + 64. Give n(24). 40 Let q(b) = 32b - 333. Determine q(7). -109 Let r(a) = -3a*2 + 33a + 74. Give r(-2). -4 Let s(p) = 1588p + 69875. Determine s(-44). 3 Let u(x) = x3 + 66x*2 - 4x + 4347. What is u(-67)? 126 Let g(v) = -343v - 2374. Calculate g(-7). 27 Let z(q) = q3 + 18q*2 + 10q - 14. Calculate z(-16). 338 Let o(l) = -l*2 + 8l + 418. What is o(-16)? 34 Let l(b) = b*3 + 13b*2 + 10b + 89. Determine l(-13). -41 Let i(l) = -l*3 - 129l*2 - 133l - 616. What is i(-128)? 24 Let g(l) = l*3 + 27l*2 - 2l - 21. Calculate g(-27). 33 Let c(w) = -2w2 - 163w - 1266. Determine c(-73). -25 Let c(z) = 6z3 - z2 - 3z + 3. What is c(-2)? -43 Let s(u) = 4u3 + 10u*2 + 16u + 60. Give s(-3). -6 Let k(g) = -8g + 448. Determine k(43). 104 Let w(r) = r2 + 8r - 74. What is w(5)? -9 Let p(g) = g*3 - 20g*2 + 147g - 1971. What is p(18)? 27 Let f(a) = -2a2 - 128a - 1500. Determine f(-16). 36 Let l(c) = 8c2 + 89c - 27. Calculate l(-11). -38 Let o(p) = -5p3 + 93p*2 + 25p + 256. Give o(19). 9 Let h(w) = 6w - 21. Calculate h(-8). -69 Let h(j) = 63j*3 + 3j*2 + 12j - 14. Calculate h(1). 64 Let n(h) = h*3 - 17h*2 - 31h + 765. Determine n(16). 13 Let x(g) = g*3 - 46g*2 + 45g - 33. Determine x(45). -33 Let m(b) = -b*3 - 14b*2 + 67b + 1016. Give m(-14). 78 Let a(j) = -j*3 - 2j*2 - 4j - 77. What is a(0)? -77 Let j(o) = -247o2 + 2224o - 1. What is j(9)? 8 Let f(m) = -43m - 111. Determine f(-7). 190 Let p(o) = o2 + 34o - 4216. What is p(-84)? -16 Let z(p) = -2763p - 13791. What is z(-5)? 24 Let m(v) = 53v*2 + 1327v + 43. What is m(-25)? -7 Let h(z) = -z*3 + 10z*2 - 80z + 279. Calculate h(5). 4 Let t(w) = -34w3 - 5w*2 - 6w - 3. Calculate t(-2). 261 Let h(a) = 15a3 - a2 + 2a + 3. Determine h(-1). -15 Let h(z) = -2z2 - 62z + 2194. Give h(21). 10 Let i(x) = 433x + 2534. Calculate i(-6). -64 Let g(s) = 2633s + 15791. Give g(-6). -7 Let s(a) = -8a3 - 5a*2 + 2a. Determine s(2). -80 Let j(p) = -11p2 + 365p - 53. Determine j(33). 13 Let k(g) = -g*2 - 22g - 80. Calculate k(-9). 37 Let p(a) = -a*2 - 186a - 5452. Give p(-34). -284 Let k(d) = -236d2 + 2363d - 12. Calculate k(10). 18 Let c(z) = -z*3 + 14z*2 + 31z + 62. Calculate c(16). 46 Let g(x) = x*3 + 14x*2 + 21x + 144. Give g(-13). 40 Let a(i) = -320i2 + 5i - 8. What is a(1)? -323 Let m(z) = -28z3 + 135z + 134. Calculate m(-1). 27 Let a(q) = -10725q - 32178. What is a(-3)? -3 Let h(w) = w3 + 16w*2 + 12w + 74. Determine h(-17). -419 Let y(a) = a2 - 1439. Determine y(38). 5 Let u(z) = z2 - 380z - 26408. Give u(-60). -8 Let n(m) = -m3 + 64m*2 - 14m + 868. Give n(64). -28 Let v(t) = -245t - 2077. Calculate v(-9). 128 Let k(q) = 4631q + 27796. Calculate k(-6). 10 Let r(c) = -89c + 119. What is r(-1)? 208 Let t(p) = 68p + 223. Calculate t(-5). -117 Let b(i) = -i*3 - 7i*2 - 7i + 47. C	{ "pile_set_name": "DM Mathematics" }
tive of p*4/12 + 5p3/6 + p2. Let s(k) = -5k + 4k - 9 + 13 - 8. What is -4c(b) - 5s(b)? -3b Let s(w) = -w2 - w - 1. Let q(b) = 2b*2 + 2b + 1. Let g be (-2 + 3)15. Suppose 0 = -gf - 0f - 10. Let d = f + 5. Calculate dq(n) + 5s(n). n*2 + n - 2 Let w(v) = -5v - 12. Let n(z) = -11z - 25. Determine -4n(k) + 9w(k). -k - 8 Let d(b) = b3 - 14b2 - 1. Let j be d(14). Let u(w) = w2 + w. Let t(i) = 4i2 + 6i. Determine jt(z) + 3u(z). -z*2 - 3z Let g = -43 - -40. Let p(d) = -d*2 + 2d + 2. Let q(c) = -c*2 + 3c + 3. What is gq(u) + 5p(u)? -2u2 + u + 1 Let u(t) = t3 + 5t2 - t - 3. Let y(x) = -x3 - 6x2 + x + 4. Determine 6u(i) + 5y(i). i3 - i + 2 Let z(l) be the first derivative of l3/3 + l2 + 1. Let u(t) be the third derivative of -t5/20 - 3t*4/8 - 6t*2. Give -2u(b) - 9z(b). -3b*2 Let r = 3 - 0. Let b(a) = -2a*3 + 5a - 1. Let p(k) be the third derivative of -k4/24 + k3/6 + 17k2 + 1. Give rp(w) + b(w). -2w3 + 2w + 2 Suppose 4y = -1 - 11. Let n be 2/y42/4. Let x(f) = -3f + 6. Let b(r) be the first derivative of r2/2 - 2r + 1. Calculate nb(m) - 2x(m). -m + 2 Let i = -73 - -68. Let x(g) = 12g. Let o(k) = -30k. What is io(z) - 12x(z)? 6z Let b(a) = 2a + 1. Let g(w) = w*2 + w - 1. Determine b(k) - 2g(k). -2k2 + 3 Let q(d) = 3d - 30. Let z(o) = o. Give -q(v) + 4z(v). v + 30 Let c(u) = -6u + 5. Let b(i) = -i*2 - 9i - 4. Let t be b(-8). Let y(g) = 14 - 17g + 1 - 1. Calculate ty(n) - 11c(n). -2n + 1 Suppose -3 = 9t - 12t. Let g(h) = -6h. Let k(m) = -m. Give tg(x) - 8k(x). 2x Let r(b) = -2b3 + 2b*2 - 6. Let k(x) = -4x*3 + 5x*2 - 13. Calculate -2k(j) + 5r(j). -2j*3 - 4 Let a(t) = -3t*3 + 2t*3 + 172t*2 - 173t*2 + 2t*3. Let f(i) = -3i*3 + 6i*2. Calculate 6a(p) + f(p). 3p3 Let w(m) = 5m*2 - 6m - 3. Let v(b) = -4b2 + 5b + 4. Determine 6v(n) + 5w(n). n*2 + 9 Let k(h) = -11h - 2. Let g(u) = 539u + 99. What is 2g(s) + 99k(s)? -11s Let l = 42 - 37. Let a(p) = 4p + 1. Let i(f) = -5f - 1. Determine li(g) + 6a(g). -g + 1 Let c(t) = t - 2t2 + 3t*2 - 2t*2. Let a(s) = 6s*2 - 2s + 1. Suppose -3o + 5o = -20. Let q be o/4(-8)/5. Give qc(f) + a(f). 2f2 + 2f + 1 Suppose -3v + 12 = 3j, v - 3j - 2 - 6 = 0. Let m(n) = -3n + 2. Let g(h) = -8h + 6. Determine vg(x) - 14m(x). 2x + 2 Let a(y) = y*3 - 5y*2 + 3y - 3. Let x(n) = -3n3 + 11n*2 - 5n + 7. Give 7a(l) + 3x(l). -2l3 - 2l*2 + 6l Let l = -5 + 0. Let o(g) = g - 1. Let x(s) = -s - 4. Let y(z) = z + 2. Let r(i) = -3x(i) - 5y(i). Calculate lo(p) - 2r(p). -p + 1 Let l(k) = 1. Suppose -c = -6c + 5. Let z(y) = 2y. Suppose -i = -5 + 6. Give cz(m) + il(m). 2m - 1 Let x(u) = 12u + 1. Let z(g) = g. Calculate -x(l) - z(l). -13l - 1 Let u be 1/((-2)/(6-3)). Let o(k) = -10k + 14. Let m(v) = -v - 1. Let p(g) = -m(g) - o(g). Let s(j) = -5j + 6. Calculate us(r) + 4p(r). -r + 2 Let k(f) = -4f2 - 4f + 5. Suppose 5b - 6c = -9c + 32, -4 = 4c. Let p(a) = 9a2 + 9a - 11. Calculate bk(y) + 3p(y). -y*2 - y + 2 Let p(m) = 13m*2 + m + 1. Let o(y) = 13y*2 + 1. What is 3o(w) - 2p(w)? 13w*2 - 2w + 1 Let p(u) = -2u2 + 3. Let m(j) = 3j*2 - 5. Suppose 3h + h = 5v + 13, 4v + 14 = 2h. Let q = -6 + 1. Calculate hm(n) + qp(n). n2 Let o(x) = -x + 2. Let d(w) = -5w + 11. Let l be (-6)/(-4)(-9)/(81/(-12)). Calculate ld(i) - 11o(i). i Let g(c) = 3c*2 - 3 - 26c*2 + 0 - 23c - 3. Suppose -5h + 10 = -0h. Let b(k) = -2 + 0k2 - 4k*h - 4k + 1. Determine 34b(p) - 6g(p). 2p2 + 2p + 2 Let f(u) = 2u2 - 9u - 3. Let w be f(4). Let c(s) = 11s2 + 7s + 11. Let r(l) = -5l2 - 3l - 5. Determine wr(n) - 3c(n). 2n2 + 2 Let p(k) be the third derivative of -k4/24 + 4k*2. Suppose 5m + 1 = 31. Let c(w) = 8w. Calculate mp(o) + c(o). 2o Let v(t) = 3t*3 + 5t*2 - 29t - 3. Let s(n) = n*3 + 2n*2 - 14n - 1. Determine -5s(d) + 2v(d). d*3 + 12d - 1 Let w(x) = -x*2 - 2x - 2. Let d(t) = 3t2 + 9t + 9. What is 2d(b) + 9w(b)? -3b2 Let x(m) = 4m + 1. Let k(j) = j. Let i be k(-3). Let y(q) = -5q - 2. Calculate ix(p) - 2y(p). -2p + 1 Let c(i) = -1. Let w(l) = l - 3. Determine 6c(q) + w(q). q - 9 Let i(r) = -r - 1. Let z(q) = 6q + 12. What is -12i(u) - z(u)? 6u Let g(x) = x - 3. Let v(m) = -1 - 3 + m + m. Let u = -4 - -8. Suppose -k - 4f = 16, -5k + uf = -3k - 4. Determine kg(n) + 3v(n). 2n Let m(u) be the third derivative of u5/15 - u4/8 + 4u*2. Let n(f) = 0f*2 - 4f - f*2 + 6f*2. What is 4m(c) - 3n(c)? c2 Let z(p) = p + 1. Let j(i) = 2i*2 + 6i + 5. Give j(l) - 6z(l). 2l2 - 1 Let b(p) = p3 - 7p2 - 6p + 6. Let k(d) = d*2 - 1. Let o(g) = -b(g) - 5k(g). Let i(w) = w. Calculate 6i(z) - o(z). z3 - 2z2 + 1 Let o(q) = q3 - 3q + 3. Let r be -2 + 1 - (2 - 7). Suppose 2i = 7g - 3g - 12, -2i - rg = -20. Let u(y) = y*3 - 2y + 2. Calculate io(n) - 3u(n). -n*3 Let n(i) = -5i. Let w(q) = -q. Let h(b) = -6b. Let k(g) = -2h(g) + 6w(g). Let s be 1/2-32. Give sn(l) - 2k(l). 3l Let x(b) be the first derivative of 7b3/3 + 7b*2/2 - 5b - 7. Let z(l) = 8l2 + 8l - 6. Suppose 0y - 18 = 2y. Let j = y - -3. What is jx(v) + 5z(v)? -2v2 - 2v Let d(w) = -11w3 - 4w*2 + 4. Let m(q) = 21q*3 + 7q*2 - 7. What is 7d(k) + 4m(k)? 7k*3 Let v(a) = -3a. Let m = -76 + 83. Let k(w) = 6w. Determine mv(f) + 4k(f). 3f Let x(q) = -4q - 59. Let g(f) = -f - 12. Let o(l) = 11g(l) - 2x(l). Let r(m) = m + 5. Let k(c) = -2c - 5. Let n be k(-4). What is no(s) + 8r(s)? -s - 2 Let q(b) = -6b + 4. Let h(z) = -13z + 9. Calculate 2h(c) - 5q(c). 4c - 2 Let b = -1 - -3. Let a be (-18)/(-14) - 2/7. Let u(r) = 2r + 2 - a + r*3 - 6r + 5r. Let i(k) = -4k*3 - 4k - 3. What is bi(l) + 6u(l)? -2l3 - 2l Let y(i) = 9i2 - 11i. Let z(j) = 3j2 - 4j. Let c = 16 + -12. What is cy(g) - 11z(g)? 3g2 Let y(f) = -9f*3 + 6f*2 + 6f. Let u(g) be the first derivative of 5/2g2 - 2g*4 + 5/3g*3 + 0g + 7. What is 6u(p) - 5y(p)? -3p3 Let v(b) = 7b + 12. Let j(n) = -13n - 23. Let x(u) = -6j(u) - 11v(u). Let m(z) = 1. Give 2m(t) - x(t). -t - 4 Let s(c) = -c*2 - c + 1. Let k(g) = 88g*2 + 55g - 55. What is k(z) + 55s(z)? 33z*2 Let n(w) = 39w*3 - 39. Let h(a) = -8a*3 + 8. Calculate 24h(f) + 5n(f). 3f*3 - 3 Let j(z) = -6z*3 - 4z*2 + 10z - 4. Let t(l) = 5l3 + 3l*2 - 10l + 3. Determine -3j(y) - 4t(y). -2y3 + 10y Let p(k) = k*2 + 3k + 14. Let j(u) = -u*2 - 5u - 28. Calculate -3j(n) - 5p(n). -2n2 + 14 Let p(w) = -w2 - w + 5. Let a(z) be the third derivative of z5/60 - z3/3 + 3z*2. Suppose -2l + 5 = -3l. What is la(q) - 2p(q)? -3q*2 + 2q Let c(w) = -7w3 + 3w*2 - w - 3. Let l(o) = 14o*3 - 5o*2 + o + 5. Give 5c(s) + 3l(s). 7s*3 - 2s Let d(b) = 0 - 5b + 4 - 4b. Let t be (-1)/(-2) + (-5)/2. Let k(v) = -4v + 2. Let h = 4 - -1. What is hk(z) + td(z)? -2z + 2 Let g(f) = f*3 + 6f + 4. Let r(m) = -2m3 - 7m - 5. Let s(w) = 4w3 + 2w - 2. Let q be s(1). Determine qr(d) + 5g(d). -3d3 + 2d Let b(j) = -2j3 + j2 - 6. Let x(a) = a3 - a2 + 5. Suppose -9 = 4n - 7n. What is nb(l) + 4x(l)? -2l3 - l2 + 2 Let b(a) = 11a - 5. Let s(c) = 9c - 5. Give 4b(y) - 3s(y). 17y - 5 Let a(g) = g - 1. Let q(x) = -6x + 6. Let d(z) = 2z + 2. Let k be d(-2). Let c be (1 + k)/(-4 + 3). Suppose 3 = s + c. Calculate sq(b) + 11a(b). -b + 1 Let u(x) = 16x*2 - 3x. Let n(f) = 944f2 - 176f. Determine -6n(i) + 352u(i). -32i2 Let s(m) = -7m*2 - 7m + 8. Let k(g) = 6g2 + 6g - 7. Suppose 5r - 31 = -0d - d, 4d = -4r + 44. Determine dk(j) + 5s(j). j2 + j - 2 Let n(o) = o3 - o*2 + 1. Let b = 2 - 3. Let h = b + 2. Let z(s) = -3s*2 - s - 5 + 3s*3 + 4 + 5. Give hz(c) - 4n(c). -c3 + c2 - c Let c(f) = f - 6. Let p(i) = i - 5. Let y = 15 + -19. Determine yp(n) + 3c(n). -n + 2 Let m(x) = -3x. Suppose 1 = 5a - 9. Let l(b) be the third derivative of b4/8 + b2. What is am(r) + 3l(r)? 3r Let n(o) = 8o - 8. Let c(g) = -g + 76 - 39 - 36. Let i = -8 - -2. Let w = i - 0. Determine wc(k) - n(k). -2*k + 2 Let z(p) =	{ "pile_set_name": "DM Mathematics" }
-1/3? j Let x(r) = r*2 - 6r - 1. Suppose -13 = 3p - 49. Suppose 0 = -0z + 2z - p. Let j be x(z). Is 1/3 != j? True Let q be 2/(-8) + (-21)/12. Let n = -4.9 + 0.9. Let i = -5 - n. Which is smaller: i or q? q Let x = -6 - -4. Let z = -3 - x. Are -2/7 and z equal? False Let q = -0.9 - -0.84. Let i = q + -0.04. Let c = -0.2 + 0.3. Which is greater: c or i? c Let c = -0.25 - 0.05. Let i = c + 1.3. Let p = 2 - 1. Do p and i have different values? False Let b(p) = p2 - 6p + 5. Let m be b(5). Let t(r) = -4r + 4. Let q be t(1). Do m and q have the same value? True Let w = -5 - -17. Let g = -181 - -180. Is g < w? True Suppose 0 = -21h + 16h + 50. Is h smaller than 10? False Let y = 0.5 - 0.9. Let h = -7218/19 - -380. Let c = -11/76 - h. Which is bigger: y or c? c Let m = 655/8 + -82. Which is greater: m or -1? m Suppose m - 105 = -41. Let d = m + -450/7. Is 1 greater than d? True Let z = 1 - 1. Let o = -6 + 9/2. Which is smaller: z or o? o Let w = 1043/5 + -209. Is 155 > w? True Let a(q) = -q + 1. Let h be a(-4). Let z = -0.91 + 0.71. Is h smaller than z? False Let t = -0.3 + 0.4. Let v be (-16)/(-12)2/(-12)3. Which is bigger: t or v? t Let a be (1 + 0 + -2)-3. Suppose 0o - 6 = ao. Which is smaller: o or -1? o Let v(l) = -l - 4. Let g be v(-4). Let s be -5 - g1/(-3). Which is greater: s or -3? -3 Suppose -m - 6 = -4c, -3m - 2c - 18 = -7m. Let v(b) = -3b - 5. Let i(d) = 4d + 5. Let f(r) = 4i(r) + 5v(r). Let s be f(m). Which is smaller: s or 3? s Suppose -2w + 4 = 5j, 2j + 2j = 0. Let h be (-10)/18 + w/9. Let n = -4 - -4. Is h less than n? True Let d be 21650/(-52). Which is smaller: d or -74/3? d Let k be 4 + (-428)/84 + 1. Is 0 >= k? True Let b be 16/20(-165)/(-2). Let a = b - 529/8. Is 0 greater than or equal to a? True Let y be (-1)/(34/121). Which is greater: 1/151 or y? 1/151 Suppose -n - 2 = -3w - 0w, -3w - 2n = 13. Let i = -2 - -4. Let a(l) = l - 4. Let o be a(i). Is o greater than w? False Let k(t) = t - 6. Let r be k(10). Suppose -5o + 3 = -27. Suppose a - o = -r. Are 2 and a non-equal? False Suppose 4z = -4y - 16, 33 = -z - 2z + 4y. Let c = 10 + z. Is c smaller than -2? False Let m = 13 - 7. Let h = -4 + m. Let x = -1 - h. Are 1/4 and x equal? False Let m = -18 - -63. Suppose 7 + m = -4d. Are -13 and d non-equal? False Suppose 3v - 3l + 9 = 0, -3v - 3 = 2v - 2l. Let z be 216/(-102) + v2. Is z equal to -1? False Suppose 0 = 4i + q - 22, -i + 3q - 4q = -7. Is 0 >= i? False Let z = -15 + 11. Let q = z - -3.8. Let s = 0 - q. Which is smaller: -0.1 or s? -0.1 Let m be 3 + (1 - 1) + -5. Let o be 2 - 6/m-3. Do -8 and o have the same value? False Let d be 0 - 1 - 14/(-5). Suppose 0 = -2x + 3o + 5, 2o - o + 3 = 2x. Which is smaller: x or d? x Let o be 0/(((-10)/(-5))/(-1)). Let q = -29/119 - -9/17. Is o at least as big as q? False Let f = 0.1 + 0. Let o = -113/273 - -5/39. Which is bigger: o or f? f Let x(s) = s*3 + 6s*2 + s + 2. Let g be x(-6). Let v be (-15)/36 + g/(-6). Let u be 78/21 + 4/14. Is v != u? True Suppose -4c - 34 = -2a - 0c, 5a - 57 = 3c. Suppose a - 3 = -3t. Let o be (-3 - -3)/(t/(-2)). Are 1/3 and o equal? False Let j be 0 - -2 - (-776)/6. Let u = 362/3 - j. Let l = u + 21/2. Which is smaller: 0 or l? l Let q = 11 - 31. Let l = q + 19.9. Are l and 0 unequal? True Let d be 92/147 + (4/12 - 1). Which is smaller: 2/9 or d? d Let n(z) = z3 + 5z*2 + 4z + 2. Let w be n(-4). Which is greater: 2/3 or w? w Let l = 12 + -13. Let u = 2 - l. Which is greater: u or 0? u Let t = 0.07 + -0.01. Let o = t - -1.94. Let q = o + -6. Which is smaller: q or 0? q Suppose 3p - 12p + 9 = 0. Suppose 25 = -5u + 75. Let w be ((-1)/u)/(1/2). Which is smaller: p or w? w Let j(s) = s + 1. Let v be j(-2). Let d be -2(-2 - -1)/v. Suppose 18 = -2r - 4q, 3q + 3 = 5r + q. Which is smaller: r or d? d Suppose 0 = -3k + 7k. Is 65/4 at most as big as k? False Let b = 17 + -1. Which is greater: b or -0.1? b Suppose 0 = 4i - 4t - 20, t = 4i - 5 - 0. Suppose k + 4r - 1 = 21, i = -r + 5. Suppose 2o = 5 - 1. Is k greater than o? False Let a = 28/55 + -10/11. Suppose -7u = -5u. Which is smaller: a or u? a Let v(i) = -i3 + 2i*2 - 1. Let k be v(1). Let j be 1/(1/(-2) + k). Let f be (2/6)/(j/(-4)). Which is smaller: f or 0? 0 Suppose 3l = -3l + 6. Let w = 23/90 + -1/30. Is w equal to l? False Suppose p - 8 = -0p. Let b be (p/(-16))/(8/(-6)). Is 0 less than b? True Let k(u) = u*2 + 5u + 5. Let s be k(-4). Let h be (8/72)/((-14)/(-12)). Which is greater: s or h? s Let v be -24(2 + 12/(-9)). Is v >= -17? True Let d be 13 + (-4)/4 + -4. Does 5 = d? False Let p = -3/14 + -2/7. Suppose 0 = 2l - 3 - 1. Which is greater: l or p? l Let f(m) = -m*3 - 6m*2 + 9m + 15. Let k be f(-7). Is 1 greater than k? False Let o be (-4)/10(-426)/4. Let x = 43 - o. Which is smaller: x or 2/11? 2/11 Let f be (3 + -3)43/12. Suppose 4w = 2w. Let h be f + (1 - w/3). Is 3/2 greater than or equal to h? True Let m be (-2)/34(2 + -4). Let l = m + 1/136. Which is smaller: l or 0? 0 Suppose -2s + 6s + 4 = -v, -s + 2 = v. Let n be (-38)/12 - v/(-24). Let p = 2 + n. Which is smaller: p or -3? -3 Let w(h) = 8h + 2 - 2 + h2 + 5 + 0h. Let i be w(-7). Let d be (i - 0)(-2)/4. Do d and 3 have the same value? False Let h = -0.6 + 1.7. Let f = -2.9 - h. Let n = 3.8 + f. Are 1/4 and n unequal? True Let i = -17 + 21. Suppose -3d = d + i. Let v be 26/(-36) - (-1)/2. Is d at most v? True Let m = 43/21 + -7/3. Is m at least 4? False Let z = 339 + -340. Let g = 13/4 - 25/8. Which is bigger: z or g? g Suppose 2s = -s. Let l = 9 - s. Are l and 8 unequal? True Let m(p) = -3p - 3. Let x be m(-2). Suppose 0 = -z - 6 + x. Let j be (-4 - z) + 4/2. Which is smaller: 2 or j? j Let c(r) = -r*2 + 2r + 6. Let z be c(-4). Let w = -17 - z. Is w at least as big as 1? True Let s(w) = w3 - w2 - 3w + 4. Let d be s(3). Suppose u + d = 18. Is 5 less than or equal to u? True Let l(f) = 2f*2 + 8f + 6. Let i be l(-3). Let a(r) = -r*2 + 3r - 1. Let k be a(2). Is k at least i? True Suppose 2u - 2 = -0. Let f = 31539/47 + -671. Which is smaller: u or f? f Let b = 9 - 10. Let j be 4/10 + 6/(-40). Which is greater: j or b? j Let x be (-6 - -4)/((12/(-11))/(-1)). Is -1 > x? True Let q be 9/12 - 15/(-20). Which is smaller: q or 0.2? 0.2 Let q = -0.7 + -0.3. Let c = 1.1 + q. Let v = 100 - 95. Which is smaller: c or v? c Let v = -6.2 - 0.8. Let o = 0.18 + -5.18. Let i = o - v. Which is greater: 2/7 or i? i Let x = -0.23 + 0.1. Let w = x - -0.03. Which is smaller: 4 or w? w Let p be (-2)/(-5) - 23/(-5). Is 5 > p? False Let c be (1/14)/(-5 + 78/15). Which is bigger: c or 1? 1 Let b(t) = 6t + 2. Let y be b(0). Is 3 bigger than y? True Let f = 1.9 - 1.6. Which is bigger: 4 or f? 4 Let i = -200 - 43. Let j be ((-3)/4)/(i/(-72)). Which is bigger: j or 1? 1 Suppose -10 = 2c - 3y, 0c + 4c = y. Is -1/46 >= c? False Let o = -71 + 56. Which is greater: o or 0? 0 Let q(i) = i*3 + 5i - 6. Let m be q(3). Which is greater: m or 35? m Let g(c) = -c*2 + 3c + 11. Let t be g(5). Which is bigger: t or -0.4? t Let l = -26 + 48. Is 23 less than or equal to l? False Let c(b) = b*3 + 6b*2 - b - 6. Let m be c(-6). Let z be (-2)/6 - (-129)/9. Let f be (-6)/(-9)(-6)/z. Which is smaller: f or m? f Let t be (-4)/12 + (-7)/6. Let b be 8/126 + (-14)/(-63). Is b greater than or equal to t? True Let j = 6 + -8. Let q be ((-5)/(-2) + j)3. Which is greater: 1 or q? q Suppose q - 3q = -6. Suppose 28 = -d + g, -qd - 48 = g + 32. Let r be (-6)/d3-3. Which is bigger: r or -1? -1 Let j(u) = -u3 + 18u*2 + u - 25. Let k be j(18). Let v be (-5)/(-6) - 6/36. Which is bigger: k or v? v Let l = 12 + -10. Suppose lu = -3u. Is u >= -5/6? True Let l(w) = -3w*2 + 7w + 20. Let k be l(-2). Which is bigger: -9 or k? k Suppose -19y - 151 - 305 = 0. Are y and -24 non-equal? False Let z be 4/18 + 7 + (-4592)/(-72). Which is smaller: z or 70? 70 Let h = 0.3 + 1.2. Let z = -1.5 + h. Let d = -3 + 10. Is d != z? True Let t = -18569/4458 - 1/743. Is -3 bigger than t? True Suppose 3p - 3w = 72, -p + 0w + 4w = -27. Which is bigger: p or -1/4? p Suppose -6 + 26 = 5y. Suppose -20 = -4k, -v + 9k = yk + 19. Do v and 6 have the same value? True Let l(u) = u*3 -	{ "pile_set_name": "DM Mathematics" }
k, 6 Let t = 1352 + -675.4. Let y = t - 677. Put y, 2, -0.2, 3/4 in decreasing order. 2, 3/4, -0.2, y Let g be 66/962 - (123/(-24) + 5). Sort -3, -1/9, 3.19, g in descending order. 3.19, g, -1/9, -3 Let v = 18604.2 + -18604. Sort v, 2/25, -196 in descending order. v, 2/25, -196 Let b(d) = 2d*3 + 2d - 1. Let j be b(1). Suppose 6z - 22 = -40. Let n be 12z/(-6) - 1. Put -2, j, n, 4 in ascending order. -2, j, 4, n Suppose 30c = 101 - 281. Let l(b) = -26b - 124. Let g be l(c). Sort g, 1, -3 in decreasing order. g, 1, -3 Let o(s) = 2s2 + 15s + 3. Let f be o(-7). Let x(u) = -u*2 - 18u + 28. Let i be x(-14). Let z be i/22 + (-26)/(-143). Sort z, f, 3, 1. f, 1, 3, z Let h = 154 - 164. Let l be (33/(-42))/1 - 5/h. Put l, -2/5, 0.4, -3/5 in decreasing order. 0.4, l, -2/5, -3/5 Let p be ((-2 + 3)/248)/((-114)/(-4808)). Let n = p + -2/589. Let t = 63 + -253/4. Put -3/4, n, t in descending order. n, t, -3/4 Let k = -749 + 750. Sort k, -5, -1, -0.02 in descending order. k, -0.02, -1, -5 Let o = 17118 - 17120. Put 2/9, 3, o, -694 in decreasing order. 3, 2/9, o, -694 Let b be (-1 - (0 + 0))/(9/(-36)). Suppose 4n = d + 4, 9 + 15 = bn + 4d. Sort 1, n, -5, -13 in ascending order. -13, -5, 1, n Let v = 648 - 624. Let f be ((-126)/v - (-1)/4) + 2. Sort -49, f, -4 in decreasing order. f, -4, -49 Suppose -1105u + 156 = -1180u + 456. Suppose -3i + 105 = -6i. Put i, u, -3, 0 in increasing order. i, -3, 0, u Let k be ((-68)/(-6430))/((-1)/(-151)). Let g = k + 2/643. Sort 4, -2/5, 2/7, g. -2/5, 2/7, g, 4 Let t be 3/2 - ((-105)/(-6))/35. Sort 4, -5, t, 2697 in descending order. 2697, 4, t, -5 Let f = -261 - -257. Suppose -5r - 3h = -17 - 55, -3h = 3. Suppose -20 = 19z - rz. Sort 0.3, z, 0, f. z, f, 0, 0.3 Suppose 4d - 2989t + 2987t = -320, -332 = 4d + 4t. Put -11, -3, d in decreasing order. -3, -11, d Let y = 52.356 + -48.356. Let t = -6 - -2. Put -3, t, y, 0.5 in ascending order. t, -3, 0.5, y Let o(p) = -8p + 5. Let k(q) = -q + 2. Let x(a) = -3k(a) + o(a). Let m be x(-1). Sort -1, -4, 19, m in decreasing order. 19, m, -1, -4 Let w = -97 - -102. Suppose -11c - 8 = -30. Put w, -21, c, -2 in decreasing order. w, c, -2, -21 Let z = 20 - 21.3. Let w = z + 0.9. Let f be (-24)/14(-6)/24. Sort f, 0.4, 0.1, w in increasing order. w, 0.1, 0.4, f Let y be (5(-6)/(-60))/(1221/(-246)). Let h = y + -3/37. Put -8, -0.1, h, -2 in decreasing order. -0.1, h, -2, -8 Suppose -24z = -185z + 15456. Sort 3, 4, 2, z, -3. -3, 2, 3, 4, z Let v(a) = -a + 27. Suppose -43b - 100 = -47b. Let j be v(b). Put -0.9, -5/6, j in decreasing order. j, -5/6, -0.9 Suppose -10l = -5429 + 5469. Sort l, -2, 4, 7, 13. l, -2, 4, 7, 13 Suppose 2p = -0p. Let n(b) = -17b + 255. Let a(k) = -8k + 128. Let r(v) = 5a(v) - 2n(v). Let s be r(21). Put s, 2, p, 5 in decreasing order. 5, s, 2, p Let f(j) = -97j + 92. Let z be f(1). Let a(d) = -d + 1. Let u be a(5). Put 2, u, z, -3 in ascending order. z, u, -3, 2 Suppose 4h + m - 4 = 0, h - 15m + 12m - 14 = 0. Put -27, h, 11, -4, -2 in ascending order. -27, -4, -2, h, 11 Let b = 0.16 + 0.84. Let r = 109 + -105. Let v(w) = -w + 7. Let o be v(8). Put o, b, 5, r in descending order. 5, r, b, o Let a be (1 - 0)1 - -2. Let o be (2 + 1)/a - 0. Suppose 380q = 384q + 16. Put o, -5, q in decreasing order. o, q, -5 Let z be (-9)/2 + (-657)/(-162). Let a = 103 - 111. Sort 0.2, z, -2/3, a in descending order. 0.2, z, -2/3, a Suppose 0 = 13t - 361 - 276. Suppose 0 = 4g - y - 7, tg = 50g + 3y - 5. Put 3, g, -10 in ascending order. -10, g, 3 Suppose -4x + 5 = 3h, 2h - 130 = -4x - 120. Sort -1, h, 7, -3. h, -3, -1, 7 Let r = -5.12 - -5. Let w = -2680.68 + 2681. Let b = w + r. Put -4, 1/3, -0.06, b in descending order. 1/3, b, -0.06, -4 Suppose -106z = -116z + 30. Sort -5, 0, z, -19, -2 in decreasing order. z, 0, -2, -5, -19 Let g = -4.98 - 0.02. Sort -490, -3, g. -490, g, -3 Suppose 130d = 128d - 3c - 27, -2d - 5c = 41. Put -4427, d, -2 in increasing order. -4427, d, -2 Let n(c) = -c*2 + 6c + 1571. Let h be n(-31). Put 3, -2, h in decreasing order. h, 3, -2 Let a = 7911 - 8001. Sort 2, 4, -2/31, a in increasing order. a, -2/31, 2, 4 Suppose 6s + 40 = 11s. Let h be s/(-3) - -2(-7)/(-21). Sort 1, h, 33 in decreasing order. 33, 1, h Let w = 104 + -73. Let i = w - 32. Let r be -2i510/(-25). Put r, 0, -3 in descending order. 0, -3, r Let p = 0.7 - -0.3. Let c be (-3 - 5) + -135 + -1. Let z = c + 718/5. Put p, z, 2/9 in decreasing order. p, 2/9, z Let h = 117.69 - 115.69. Let o be (-3)/(3/2) + 0. Let g be (3/(-2))/(4/8). Put -1, h, g, o in descending order. h, -1, o, g Let k(f) = 2f2 - f - f2 - 2 + 0 - 2f*2. Let u be k(-2). Let d be (2 - ((-6 - -1) + 13)) + 4. Sort 0, 6, u, d in decreasing order. 6, 0, d, u Let s be -10 + (5 + 9 - 6). Suppose 4g = -5u - 12, -9g - 4u - 15 = -4g. Put s, 5, -1, g in ascending order. g, s, -1, 5 Let y(m) = -m*2 - 2m - 1. Let h be y(-1). Suppose h = -21x + 25x + 8. Let w(v) = -v - 5. Let d be w(x). Sort d, -10, 0 in decreasing order. 0, d, -10 Let w = 100 + -97. Suppose g - 2o + 4o - 14 = 0, 0 = -5g + wo + 5. Suppose 0 = 6l - l + u - 4, gl + u = 3. Sort l, -1, 2 in decreasing order. 2, l, -1 Let z be 0 + 0 + -2 + 6. Suppose 14u + 4623 = 4623. Suppose -4b - 4 = 4. Sort 6, z, u, b in increasing order. b, u, z, 6 Let c be (-2)/(-8)(2 - 3). Suppose 0 = 4z - 8r + 5r - 757, 4z + 2r - 782 = 0. Suppose -z + 217 = -8v. Put 4, v, c, 0.3 in descending order. 4, 0.3, c, v Let h = -795421 - -795418. Let z be (-4)/14 + (-37)/(-7). Suppose -13 - 12 = -zq. Put 12, q, h in descending order. 12, q, h Let x be (-12)/10((-520)/(-24))/13. Sort -9, 0, 4, x in descending order. 4, 0, x, -9 Let g = -4 - -4.3. Let a be 1757/(-5020) + (-3)/(-5). Put a, 5, 4, g in descending order. 5, 4, g, a Suppose -1036 = 8p - p. Let t = -144 - p. Sort t, -62, -4. -62, -4, t Let o(l) = 2l + 2. Let n be o(1). Let d be ((-2)/n)/((-4)/8 - 0). Suppose -3t + 2h = -2h + 22, -5t - 26 = -4h. Sort 4, t, d in ascending order. t, d, 4 Let u be -1 + (1 - (-6)/2). Suppose 5n + 5z = 4 + 11, -u = -n + 5z. Suppose 3m - 27 = -4o, -69m - o + 11 = -64m. Put -1, -1/4, n, m in descending order. n, m, -1/4, -1 Let c = -616 - -617. Let p = 4 - 0. Put p, -3, c in decreasing order. p, c, -3 Suppose -159t - 5x + 12 = -163t, -5t - 15 = -5x. Put -7, -1, t, -4 in descending order. -1, t, -4, -7 Let n = -0.3 + -0.7. Let q = -193.117 - -193. Let j = q - -2.117. Sort n, -0.09, j in descending order. j, -0.09, n Let h be 80/(-70)(-175)/330. Let z = h + -3/11. Put 2/11, -0.3, z in increasing order. -0.3, 2/11, z Let t(i) = 2i*2 - 3i - 1. Suppose l - k = 8, 4l + 2k = -2k - 8. Let x be t(l). Put 1, x, -3, -5 in descending order. x, 1, -3, -5 Suppose -2k = 3c + 54, 4k + c = 3k - 28. Let z be (-174)/(-116)4/k. Sort -0.14, 1, 4, z. z, -0.14, 1, 4 Let a = 9621 - 9619. Sort 2/3, -1.49, a. -1.49, 2/3, a Let h(o) = o*3 - 3o*2 + 2o - 2. Let v be h(2). Let p be (-25)/v - (-6)/12. Let r = p + -9. Put r, 1, 0.7 in descending order. r, 1, 0.7 Let f = -1.3532 + 0.3532. Sort f, -3/20, -2/3, 0.02. f, -2/3, -3/20, 0.02 Let b(d) = 32d2 - 44d + 91. Let n be b(2). Sort -1, -2, 1, n in increasing order. -2, -1, 1, n Let y be (-1)/4 - (-858)/104. Suppose 14 = 3i + u, -2 = yi - 9i - 3u. Put i, 1, 4, -5 in decreasing order. i, 4, 1, -5 Let l = -0.6 - -0.7. Let g(r) = -r*2 + r - 1. Let t be g(2). Let k be -7 + (-2 + -4)/t. Put l, k, -1/4 in descending order. l, -1/4, k Let g = -98 - -98. Suppose gq + 18 = -9q. Put -1, -4, q, 3 in increasing order. -4, q, -1, 3 Let f = 300 + -3898/13. Let l = 0.496 - 0.996. Let r be (-1)/4 + 1 + (-70)/72. Sort -4, r, l, f in descending order. f, r, l, -4 Let g = -7235 - -7229. Sort -2/7, -1/9, g, 0, 2/7 in increasing order. g, -2/7, -1/9, 0, 2/7 Let k = -99 - -104. Let b be (-3)/3(-2)/(-18). Let y = -7/18 + b. Sort 3/7, k, y in decreasing order. k, 3/7, y Let q(f) = 5f2 + 6f + 30. Let j(a) = -11a2 - 14a - 68. Let k(n) = -4j(n) - 9q(n). Let o = 1 + -1. Let v be k(o). Sort v, -5, -4. -5, -4, v Let a = -318 + -5. Let k = a + 34219/106. Let y = k - -2/159. Put y, 0, 5 in decreasing order. 5, 0, y Let h = -52.13 + 51.9. Let q = 53 + -52.77. Let k = h + q. Sort -23, k, 0.2	{ "pile_set_name": "DM Mathematics" }
65 Calculate 145317 divided by 27. 48439/9 765277 divided by -5 -765277/5 What is 18391326 divided by -4? -9195663/2 -12199922 divided by 98 -124489 What is 18070835 divided by 515? 35089 221743838 divided by -4982 -44509 What is -2527222 divided by -61? 2527222/61 Calculate 4358063 divided by 23. 189481 Calculate -3468 divided by 5479. -3468/5479 -1486 divided by 8214 -743/4107 What is 9669 divided by -8785? -9669/8785 Divide 25 by 120445. 5/24089 -296135 divided by -1818 296135/1818 Divide -367245 by -24483. 15 Divide 35706 by 86. 17853/43 Calculate -2 divided by -19260347. 2/19260347 -35391624 divided by -114536 309 -92595229 divided by -6 92595229/6 What is -105949536 divided by -17658256? 6 What is -2876 divided by -2597? 2876/2597 What is 747 divided by 44902? 747/44902 What is 17866308 divided by 2? 8933154 Calculate 3 divided by -4918352. -3/4918352 Calculate -1085082 divided by -542541. 2 What is 13444332 divided by 3361083? 4 Calculate -47692 divided by -208. 11923/52 What is 25218808 divided by 3896? 6473 Divide 835706 by 40. 417853/20 Calculate 129009845 divided by -5. -25801969 Divide 10530 by 724. 5265/362 46692890 divided by 1 46692890 Divide 16338861 by -563409. -29 What is 3337772 divided by 5? 3337772/5 2241612 divided by 9 249068 What is -4 divided by -1132662? 2/566331 Calculate 66035672 divided by 270638. 244 -29840 divided by -1788 7460/447 What is 125238 divided by -399? -41746/133 2979 divided by -53608 -2979/53608 What is -1135904 divided by 224? -5071 40592 divided by 3718 20296/1859 Divide 764335266 by -254778422. -3 Calculate 3 divided by -6930414. -1/2310138 What is -3329838 divided by -38274? 87 Divide 82947795 by -7. -11849685 Divide -8114340 by -3030. 2678 108922002 divided by 740966 147 Calculate 6479313 divided by 3. 2159771 -15 divided by 1275309 -5/425103 Divide -957570 by -219. 319190/73 Divide -88746244 by 22186561. -4 Calculate 246116310 divided by 22. 11187105 What is 126 divided by -3427901? -126/3427901 15201390 divided by 1520139 10 212 divided by -216095 -212/216095 -4522028 divided by 161501 -28 What is 30155040 divided by -77920? -387 Calculate 6940578 divided by 1156763. 6 What is -123284733 divided by -6369? 19357 What is -26402715 divided by 5280543? -5 Calculate -1334 divided by -48667. 1334/48667 What is -53075000 divided by -19300? 2750 What is 38035768 divided by 5777? 6584 -29775068 divided by -30887 964 1 divided by -978773 -1/978773 Calculate -7459584 divided by 5298. -1408 Divide 0 by 1734322. 0 What is 5415022 divided by -35? -5415022/35 -70421048 divided by -8 8802631 Divide -351894270 by -2. 175947135 Calculate 16348062 divided by -3. -5449354 Divide 1020410 by 7615. 134 972682886 divided by -1282 -758723 Calculate 196861686 divided by 3394167. 58 What is -613825 divided by -14275? 43 1 divided by -2047326 -1/2047326 What is -762 divided by -10628? 381/5314 What is -723985 divided by -11? 723985/11 What is -65165314 divided by 1? -65165314 What is 67272027 divided by 1180211? 57 What is -51555840 divided by 768? -67130 Calculate -67978218 divided by -67978218. 1 What is -1716 divided by 121030? -66/4655 What is 3 divided by 36599856? 1/12199952 68230266 divided by 3506 19461 What is 135658600 divided by 84260? 1610 Calculate 259630140 divided by -6. -43271690 Divide 11524786 by 68194. 169 What is 3617020 divided by -11? -328820 Divide -138422727 by 12. -46140909/4 852000 divided by -375 -2272 -529983 divided by -81 6543 What is -3 divided by -132522463? 3/132522463 Calculate -7323310 divided by 43. -7323310/43 2 divided by -6878087 -2/6878087 -1 divided by -892590 1/892590 4 divided by 68141104 1/17035276 Calculate 56410684 divided by -14102671. -4 Calculate -138447375 divided by -25. 5537895 219805216 divided by 6868913 32 -13919570 divided by -7 1988510 -8983327 divided by 1343 -6689 What is 37360400 divided by -48520? -770 10894975 divided by -33523 -325 What is 22598944 divided by 1412434? 16 -135 divided by -2124937 135/2124937 What is 141200709 divided by -3? -47066903 Calculate -3 divided by -631233. 1/210411 Divide 214 by -3472740. -107/1736370 Divide 0 by 2339608. 0 Calculate -111968 divided by 119. -111968/119 27074968 divided by -2 -13537484 -163840 divided by 5 -32768 -5542968 divided by -692871 8 Calculate -5 divided by 8114219. -5/8114219 What is -527240 divided by 2519? -527240/2519 What is 22 divided by -580936? -11/290468 -307214584 divided by -153607292 2 What is -2151607 divided by 3? -2151607/3 Divide 1207666 by 63. 1207666/63 42067330 divided by 8413466 5 Calculate -209313 divided by 44. -209313/44 Calculate 34462920 divided by 1. 34462920 Calculate -383432985 divided by 29081. -13185 What is -106952014 divided by 59? -1812746 Divide -71840 by -33. 71840/33 Divide 6 by 197805485. 6/197805485 What is 5 divided by -189507? -5/189507 Divide 20807000 by -10. -2080700 Calculate -18681677 divided by 653. -28609 What is -836715 divided by 79? -836715/79 What is -213755177 divided by -1194163? 179 Divide -103 by -61627. 103/61627 Divide 1055355 by -1995. -529 -48605355 divided by -5 9721071 Calculate 41027 divided by -59. -41027/59 Calculate -221184 divided by 3456. -64 Divide -41755530 by -1821. 22930 -122998 divided by 6 -61499/3 -16831251 divided by -4 16831251/4 1045451 divided by -364 -1045451/364 Calculate 47477251 divided by -3. -47477251/3 What is -23 divided by 53032? -23/53032 Divide -900851325 by -445. 2024385 Calculate 1006060 divided by 7. 1006060/7 -170585859 divided by 3967113 -43 Divide 738482556 by 444. 1663249 -12863744 divided by -6431872 2 What is 133432 divided by 1745? 133432/1745 -586542480 divided by -80 7331781 Calculate -12 divided by -492856. 3/123214 Divide -13916520 by -1044. 13330 Divide -78132090 by -1. 78132090 -541506 divided by 24 -90251/4 Calculate -17079489 divided by -9. 1897721 What is -1445 divided by -1519? 1445/1519 -49883 divided by -83 601 Calculate 179317 divided by -174. -179317/174 Divide -39664 by -384. 2479/24 Divide -2453750 by -13. 188750 Calculate 138 divided by 225080. 69/112540 What is 13 divided by 2264353? 1/174181 -2 divided by -116320 1/58160 -3869 divided by 9659 -3869/9659 Divide -16002548 by -238844. 67 3718430 divided by -1859215 -2 Calculate 121376340 divided by 6. 20229390 What is -138377064 divided by 217574? -636 Calculate -29913750 divided by -15. 1994250 Calculate -229 divided by 8952. -229/8952 What is -150849888 divided by 5387496? -28 -340773174 divided by -16227294 21 What is -15858084 divided by 12? -1321507 Divide 12799380 by -10. -1279938 Calculate 8189 divided by -185. -8189/185 Divide 13880401 by -28. -13880401/28 Divide -7650896 by 478181. -16 Calculate 110821897 divided by 640589. 173 Divide 8584 by -19651. -8584/19651 Calculate -23684519 divided by 14. -23684519/14 -317311 divided by -103 317311/103 -69 divided by -759689 69/759689 Divide 111853 by -3698. -111853/3698 Divide 1 by -4678335. -1/4678335 Divide -176 by 5813. -176/5813 Calculate 4004489 divided by -1. -4004489 987486236 divided by -12386 -79726 What is -9367782 divided by -37? 9367782/37 17 divided by 371203 17/371203 What is -2 divided by 5236656? -1/2618328 Divide -2034282 by 2. -1017141 Divide -9728271 by 5. -9728271/5 What is -20276928 divided by -214? 94752 Calculate -14557620 divided by 18084. -805 Divide -18835 by 7495. -3767/1499 What is 2222953 divided by 5? 2222953/5 Divide -1114895 by -10. 222979/2 -47646215 divided by -4127 11545 5097392 divided by 20554 248 Calculate -318499 divided by 10. -318499/10 What is -25 divided by 124906? -25/124906 Calculate -533 divided by -103150. 533/103150 1116342 divided by 12 186057/2 What is -612217494 divided by -43729821? 14 What is 344688344 divided by 16856? 20449 50858006 divided by -3 -50858006/3 Calculate 28 divided by -3850640. -7/962660 -8 divided by 37283819 -8/37283819 47311320 divided by -11827830 -4 Divide 6548992 by -1637248. -4 Divide 8 by -2055679. -8/2055679 What is 24 divided by -1033023? -8/344341 -53555788 divided by -52 1029919 Calculate 68460313 divided by -1. -68460313 What is -15811202 divided by 3? -15811202/3 What is -175271772 divided by 1123537? -156 What is 199868985 divided by -5? -39973797 18268070 divided by 1 18268070 Calculate -39904944 divided by	{ "pile_set_name": "DM Mathematics" }
-0v - 15, -1 = -3v + 2c for v. -1 Suppose -2x - 3x + 140 = 0. Suppose xz - 29z = -8. Solve d + 15 = -5q, -2d - 3q - z - 1 = 0 for d. 0 Suppose 3b - 4v + 61 = 6b, 5b + 2v = 83. Let c(r) = r2 + r - 69. Let m be c(-9). Solve 0k - b = -mk, -3k = 4w - 27 for w. 3 Let h = -15 + 39. Let d(j) = j2 + 7j - 6. Let a be d(1). Suppose -2x + 3i - 2 = 5i, -3x = ai - 2. Solve -2p - 12 = xw, -3p + 5p = 5w + h for w. -4 Let f = -27 + 90. Suppose -f = 5j - 78. Solve jr = -q + 3q - 18, 5q = -2r + 7 for r. -4 Let j = 6 - 3. Let o be (-1 - j/3) + 11. Let x be (o/(-6) + 2)0. Solve 4q + 2a - 4 = x, 2q + 5a = -2q - 2 for q. 2 Let h(c) = 2c*2 - 51c - 154. Let x be h(-3). Solve 2r = 5r - u - x, -6 = -4r - 2u for r. 4 Suppose 0f - 116 = -4f. Let b(t) = -6t2 - 3t + 1. Let v be b(-3). Let u be (2 - v/(-12))-3. Solve -3l + 2a + 20 = 2l, 2l = ua + f for l. 2 Let q be 3/9(32 - 2). Solve 0 = -w + c + 2, -3c - q = -4w - c for w. 3 Suppose -2u = 2d - 4, 4u + 0d - 28 = d. Suppose -14 = -v - 0v + 4f, 0 = -2f - u. Solve -o + 3 = m + 4o, -vm = -5o + 9 for m. -2 Suppose 0 = -16q + 6q + 20. Let l be ((-2 - q)3)/(-1). Solve l = 4b, 5 = 5n + 4b - 12 for n. 1 Let f(q) = -q2 + 10q - 6. Let p be f(6). Let k be (-34)/(-9) - (-4)/p. Suppose 5d = 2d + 6, 5l - 5d = 0. Solve -g + ks = -l + 7, -4s = 5g + 25 for g. -5 Suppose w = 5c - 2c - 11, -5w = -5c + 25. Suppose 4v = -2b + 8, -v - 4b = -cb - 2. Solve -s + 4f = 5f + 4, -4f = vs + 18 for s. 1 Let z be (-1)/1 - (8 - 4). Let x(r) = r3 + 8r*2 + 9r - 10. Let t be x(z). Solve -5q = d - 6d - 30, 3d - 5q = -t for d. -5 Suppose 0 = 8x + 31x - 156. Solve -5k = -t + 24, 3k + xt = -k for k. -4 Suppose 0 = 20d - 68 + 8. Solve -dw - 1 - 31 = -5a, 2a = 5w + 28 for a. 4 Let r be (1/2)/((-2)/(-12)). Let h be r/(-1(-3)/4). Let b be h(28/16)/7. Solve q - 4z = -z + b, -3q + 3 = -z for q. 1 Suppose 3o = 0, -6r - 39 = -7r + 3o. Solve 20 = -2q - 3b, 5q + 5b + 1 = -r for q. -4 Let z = -38 - -40. Suppose 2t = 7t - r - 11, zt - 2r + 2 = 0. Let c = 8 + 8. Solve 5y = -0f - 2f + c, 7 = tf - y for f. 3 Suppose -13t + 183 = -311. Suppose 0 = j - 4m + 13, -4j + t = -0m + 2m. Let z be (-1 + 3)(1 + 1). Solve -5v = -3b - 29, 3b = 6b + zv - j for b. -3 Let i = 32 + -15. Let h = -150 - -155. Suppose 11 = 2t + h. Solve -5r + 25 = -5n, -4n = -5r + t + i for n. -5 Suppose x = 2x - 11. Suppose 0 = -xg + 17g. Solve g = -j + 4n - 1, j + j + 2n + 12 = 0 for j. -5 Suppose 0 = -2c - 5l + 3, -2l - 3l = 5. Solve h - ch = 3x - 3, 6 = -2h for x. 4 Suppose 0 = -3c + 3 + 21. Suppose c = -4n, n = -5f + 1 - 3. Let q(d) = d2 + 24d + 48. Let k be q(-22). Solve f = 5t + kr - 28, -4r - r = -10 for t. 4 Suppose 20 + 13 = -3k. Let x = 8 + k. Let s = 3 + x. Solve 3n + 24 = -sn - 3d, -4n + 5d = -4 for n. -4 Let s be 25/(-7) + 3/(-7). Let c be (-156)/(-3)2/s. Let m be 4/c - (-196)/91. Solve -4z + 41 = 5x, 0 = 3x - 5z + 3 + m for x. 5 Let s(n) = -n*2 + 7n. Suppose 3m - 10 + 4 = 0. Suppose mk - 21 = -7. Let d be s(k). Solve 3a = 5y - a - 11, 5y - 3a - 7 = d for y. -1 Let q(d) = -15d2 - d + 29 - 7d2 + d3 - d + d. Let x be q(22). Solve -4n + 5f = -29, 2f = -5n + 2 - x for n. 1 Let h be 2/12 + 85/30. Suppose 0 = -z - 4z + 50. Suppose 0 = 5w - z. Solve 4 = -hi + wf + 5, -4f + 9 = 5i for i. 1 Let s = 112 - 86. Suppose -22k - 8 = -sk. Solve 0y + ky + d = 7, 3y = 3d + 6 for y. 3 Suppose -4w + h + 3 = -8, 3 = 2w - 3h. Solve v + 2v - 5z + 34 = 0, -wz = -4v - 27 for v. -3 Let d(j) = 2j + 22. Let w be d(-10). Solve 0 = -f - 2z - 3, -z - wz = 3f + 3 for f. 1 Suppose 0 = 4i - 33 + 13. Suppose 9y = 2y - 301. Let b = 47 + y. Solve 2m + 0t + 2t = 4, bt = im - 10 for m. 2 Suppose -25d + 140 = -15d. Solve -8o + 4o = 4j + 8, d = -4o - j for o. -4 Let s(r) = -3r*3 - 8r*2 + 2r*3 + 14 - 12 - 4r. Let h be s(-7). Let p = -14 - h. Solve -2q - n + 8 = -0n, pn - 10 = -4q for q. 5 Let o(d) = 2d2 - 6d + 4. Let s be (4 - (2 + 5))/(-1). Let m be o(s). Solve t - 5f = -m, -2t - 3f + 1 = -4 for t. 1 Suppose 2 = a - 2. Let f = -1312 - -1321. Solve -o = -2q - 6, -1 = o - aq - f for o. 4 Let l(c) be the second derivative of -c3/3 + 3c*2/2 + c. Let d be l(0). Suppose -31 = 2u - 85. Solve u = -3v + 6f - 3f, 4v - df = -32 for v. -5 Let t(o) = 18o*3 + 2o*2 + 4o - 5. Let k be t(1). Solve 4w + 3 = k, -3w + 15 = -3u for u. -1 Let k(w) = -4w - 32. Let d be k(-9). Solve dr + 21 = -3v - 7, 4v + 32 = -4r for v. -4 Suppose 22 = -68s + 79s. Solve -w = u - s, 3w = 3u + w + 14 for u. -2 Suppose -3l + 4 = -2. Suppose -lm = -6m. Suppose -a + 3 = -ma. Solve 4g - 4 = 0, 4 = -0z - az + 4g for z. 0 Let i be 108/32 - 12/32. Solve b + ic + 9 = 0, -6c + c = 5b + 15 for b. 0 Let x(c) = -c3 - c2 + c + 5. Let d = 11 - 6. Suppose z - k + 2 = 0, 2z + 3 = dk - 7. Let y be x(z). Solve -12 = 2j - 4m, -yj + 5m - 24 = m for j. -4 Suppose 7g = -76 + 111. Solve 8 = 5u - 4a, -4u - ga = u + 10 for u. 0 Let i = 8 + -4. Suppose -9q - 51 = -69. Solve -4k = -qm, -ik + m = -4m + 6 for k. 1 Suppose 2q - 7 = -4j + 5q, j + 2q = 10. Solve -2n - 2l = 2, -l - 2l = jn + 7 for n. -4 Suppose -173 = -39n - 17. Solve 4i = 2m - n - 6, 2m + 11 = -3i for m. -1 Suppose -k = 24 - 10. Let y = -9 - k. Solve -1 = -w + yq, 0 = -q - 2q for w. 1 Let a(x) = -2x - 8. Let k be a(-5). Suppose -5t + 3 = q, kq - 2 = t + 4. Solve g + 4j + 4 = 2j, 0 = -qg - 2j - 8 for g. -2 Suppose i + 0 - 3 = 0. Suppose -4a + 2x = 370, -7a - 5x - 470 = -2a. Let c = a - -97. Solve 2l + 2l = -d + 3, cd - 12 = il for l. 0 Suppose -30w = -28w - 4. Let l be ((-11)/((-44)/(-24)))/((-3)/w). Solve -3i + lh = 10, -i - 3i + 2h = 0 for i. 2 Suppose 2m - 28 = m. Suppose n + 6n - m = 0. Solve -2 = -5k - 3t + n, 0 = k + 4t + 9 for k. 3 Let u(m) = 3m*2. Let z be u(1). Let l be (-5 + z)/63. Let a(n) = -6n - 2. Let k be a(l). Solve -f = w - k, 0f - 2f + 8 = w for w. 0 Suppose 0 = 5f + 28 - 133. Let w = -16 + f. Let r be (-1 - -3)(-2)/(-2). Solve wj = a + 28, -ra = -1 + 7 for j. 5 Suppose 2v - 28 = 4p - 6p, 4v = 2p + 56. Let y = v + -9. Suppose yr + 50 = 10r. Solve f + 0w = -w + 2, 4w - r = -3f for f. -2 Suppose 162 = 4j - r, 2j + 0r = 4r + 88. Let h = j + -26. Solve -2s - 9 = n, -s = 2s + n + h for s. -5 Suppose -2p - 5u = -29, 2p + 5 = -u + 14. Solve 5g = -po + 24 - 1, -30 = -5g + 5o for g. 5 Suppose -5k = 4p - 32, 3p + 30 = 3k - 0p. Solve 3v = 5c + 11 + 2, 2c = 4v - k for v. 1 Suppose 4v + 4 = p, 2v = -4p - 59 + 75. Solve -4r - 8 = 0, -17 - p = 5l + 3r for l. -3 Let c = 5152 - 5145. Let d be ((-64)/(-10))/(4/20). Solve 3n = -0p - p + c, 3n - d = 4p for p. -5 Let c be -4 + 7 + (9 - -2). Let o be 1 + -2 + 2 + 16. Let v = o - c. Solve -vs - 2z + 11 = 0, 0 = 2s + s + z - 13 for s. 5 Let w(s) = -s - 3. Let t be w(-5). Let y(j) = 7j + 3j*2 - 13j + 0j2 - tj*2 + 5. Let h be y(5). Solve h = 4o - 4n, -8 = 5n + 7 for o. -3 Let k be (-351)/117(0 - 1). Solve -16 = -i + kr, -2i + 7r - 4r + 20 = 0 for i. 4 Let v = -34 + 36. Let k be (1 - 2)/((-11)/v + 5). Solve -2x + 5x + 5z - 4 = 0, 0 = kx + 3z - 3 for x. 3 Let r = 13 - 17. Let k(q) = -q*3 - 4q*2 - 2q + 1. Let x be k(r). Suppose 0 = 4h + x - 49. Solve -u = -5o - 21, 1 - h = o - 5u for o. -4 Suppose -7d - 63 = -91. Solve -3h - ds = 27, 0 = 3h + h - 5s + 5 for h. -5 Suppose 15 = 5h - 5y, -4y = 5h - 6 - 27. Solve -25 = hi, 2w - 4i - 21 = -i for w. 3 Suppose -237 = -3h - 2j, -8h + 3h + j = -408. Let s = h + -60. Solve -7l + 2l + 2z - s = 0, 18 = -5l + z for l. -3 Suppose -2c - 23 + 8 = 5y, 15 = -3c - 5y. Solve cr - r + 5 = 0, -37 = 4i - 5r for i. -3 Let t(v) = -9v2 - 61v - 37. Let o be t(-6). Solve 5b + 26 = 6z - 4z, -z = -ob - 23 for b. -4 Let m be (15/(-10)-1)/(3/6). Let p(u) = -u3 + 7u*2 + 3. Let t be p(7). Let g(i) = 3i - 4. Let d be g(t). Solve -2l + 11 = 3y, my - y - l - d = 0 for y. 3 Let d(l) = -l + 47. Let y be d(12). Let s = 35 - y. Solve s = 2j - 4b - 2, b - 13 = -5j + 14 for j. 5 Suppose 0o = -3o + 9. L	{ "pile_set_name": "DM Mathematics" }
of 117930? 3 What is the hundreds digit of 3314? 3 What is the tens digit of 5159? 5 What is the thousands digit of 4833? 4 What is the units digit of 944? 4 What is the thousands digit of 7494? 7 What is the ten thousands digit of 51896? 5 What is the thousands digit of 122505? 2 What is the thousands digit of 1131? 1 What is the thousands digit of 13995? 3 What is the thousands digit of 24711? 4 What is the thousands digit of 67305? 7 What is the units digit of 1469? 9 What is the units digit of 5316? 6 What is the ten thousands digit of 12853? 1 What is the thousands digit of 13937? 3 What is the hundreds digit of 24967? 9 What is the tens digit of 1897? 9 What is the thousands digit of 50391? 0 What is the units digit of 3918? 8 What is the units digit of 698? 8 What is the units digit of 15208? 8 What is the tens digit of 16? 1 What is the units digit of 318? 8 What is the tens digit of 932? 3 What is the units digit of 23517? 7 What is the ten thousands digit of 33699? 3 What is the hundreds digit of 733? 7 What is the ten thousands digit of 27457? 2 What is the tens digit of 1451? 5 What is the units digit of 144? 4 What is the ten thousands digit of 22936? 2 What is the units digit of 1087? 7 What is the thousands digit of 12969? 2 What is the hundreds digit of 1843? 8 What is the hundreds digit of 481? 4 What is the hundreds digit of 2860? 8 What is the units digit of 1516? 6 What is the thousands digit of 3861? 3 What is the hundreds digit of 48819? 8 What is the ten thousands digit of 19623? 1 What is the tens digit of 9660? 6 What is the units digit of 20523? 3 What is the hundreds digit of 6471? 4 What is the thousands digit of 2121? 2 What is the units digit of 340? 0 What is the tens digit of 515? 1 What is the units digit of 3257? 7 What is the tens digit of 93918? 1 What is the tens digit of 5601? 0 What is the units digit of 8548? 8 What is the tens digit of 777? 7 What is the thousands digit of 6425? 6 What is the units digit of 7734? 4 What is the thousands digit of 4265? 4 What is the tens digit of 8665? 6 What is the hundreds digit of 1069? 0 What is the ten thousands digit of 35740? 3 What is the tens digit of 16906? 0 What is the units digit of 41032? 2 What is the units digit of 4626? 6 What is the tens digit of 1555? 5 What is the hundred thousands digit of 131723? 1 What is the tens digit of 2483? 8 What is the tens digit of 28245? 4 What is the thousands digit of 16535? 6 What is the hundreds digit of 4195? 1 What is the hundreds digit of 847? 8 What is the units digit of 4333? 3 What is the ten thousands digit of 12579? 1 What is the thousands digit of 1007? 1 What is the hundreds digit of 877? 8 What is the tens digit of 985? 8 What is the tens digit of 25713? 1 What is the units digit of 473? 3 What is the units digit of 11998? 8 What is the tens digit of 59034? 3 What is the ten thousands digit of 34641? 3 What is the tens digit of 4327? 2 What is the tens digit of 533? 3 What is the thousands digit of 120376? 0 What is the ten thousands digit of 50677? 5 What is the thousands digit of 18043? 8 What is the tens digit of 1275? 7 What is the tens digit of 1405? 0 What is the units digit of 5470? 0 What is the units digit of 101? 1 What is the hundreds digit of 390? 3 What is the hundreds digit of 1529? 5 What is the tens digit of 1203? 0 What is the tens digit of 3997? 9 What is the hundreds digit of 1159? 1 What is the thousands digit of 20637? 0 What is the units digit of 194? 4 What is the tens digit of 30? 3 What is the thousands digit of 1804? 1 What is the thousands digit of 150700? 0 What is the hundreds digit of 1202? 2 What is the tens digit of 1408? 0 What is the tens digit of 41150? 5 What is the hundreds digit of 69405? 4 What is the units digit of 6004? 4 What is the hundreds digit of 9248? 2 What is the tens digit of 4310? 1 What is the units digit of 3629? 9 What is the thousands digit of 10007? 0 What is the tens digit of 31844? 4 What is the thousands digit of 1529? 1 What is the thousands digit of 2999? 2 What is the tens digit of 5454? 5 What is the units digit of 1139? 9 What is the tens digit of 142? 4 What is the hundreds digit of 1151? 1 What is the thousands digit of 4093? 4 What is the thousands digit of 5507? 5 What is the hundreds digit of 1808? 8 What is the tens digit of 525? 2 What is the units digit of 54133? 3 What is the hundreds digit of 8163? 1 What is the tens digit of 8086? 8 What is the tens digit of 3359? 5 What is the thousands digit of 1497? 1 What is the thousands digit of 50267? 0 What is the units digit of 8056? 6 What is the tens digit of 28151? 5 What is the tens digit of 2176? 7 What is the hundreds digit of 7477? 4 What is the units digit of 8950? 0 What is the units digit of 17728? 8 What is the units digit of 72? 2 What is the hundreds digit of 4355? 3 What is the units digit of 2671? 1 What is the units digit of 8973? 3 What is the thousands digit of 19386? 9 What is the units digit of 1415? 5 What is the hundreds digit of 16855? 8 What is the tens digit of 10764? 6 What is the hundreds digit of 4389? 3 What is the units digit of 312? 2 What is the thousands digit of 38608? 8 What is the ten thousands digit of 10572? 1 What is the tens digit of 866? 6 What is the thousands digit of 1912? 1 What is the tens digit of 567? 6 What is the thousands digit of 1139? 1 What is the units digit of 728? 8 What is the hundreds digit of 8030? 0 What is the hundreds digit of 642? 6 What is the tens digit of 331? 3 What is the tens digit of 2324? 2 What is the hundreds digit of 3034? 0 What is the units digit of 1383? 3 What is the tens digit of 584? 8 What is the units digit of 54768? 8 What is the units digit of 11351? 1 What is the thousands digit of 75716? 5 What is the thousands digit of 18425? 8 What is the hundreds digit of 6890? 8 What is the hundreds digit of 937? 9 What is the hundreds digit of 113409? 4 What is the thousands digit of 2655? 2 What is the tens digit of 37579? 7 What is the hundreds digit of 1257? 2 What is the units digit of 1086? 6 What is the units digit of 3748? 8 What is the thousands digit of 2603? 2 What is the tens digit of 608? 0 What is the tens digit of 1150? 5 What is the thousands digit of 111452? 1 What is the ten thousands digit of 43108? 4 What is the units digit of 9299? 9 What is the hundreds digit of 20964? 9 What is the thousands digit of 4301? 4 What is the tens digit of 85165? 6 What is the units digit of 31091? 1 What is the units digit of 708? 8 What is the units digit of 24171? 1 What is the tens digit of 8268? 6 What is the thousands digit of 1204? 1 What is the thousands digit of 6978? 6 What is the thousands digit of 3411? 3 What is the hundreds digit of 976? 9 What is the hundreds digit of 1375? 3 What is the thousands digit of 76739? 6 What is the hundreds digit of 518? 5 What is the tens digit of 9075? 7 What is the units digit of 47942? 2 What is the hundreds digit of 3242? 2 What is the thousands digit of 5639? 5 What is the tens digit of 29401? 0 What is the units digit of 634? 4 What is the hundreds digit of 836? 8 What is the tens digit of 652? 5 What is the units digit of 146828? 8 What is the thousands digit of 44467? 4 What is the units digit of 495? 5 What is the tens digit of 2922? 2 What is the ten thousands digit of 14900? 1 What is the hundreds digit of 43513? 5 What is the units digit of 33? 3 What is the tens digit of 8117? 1 What is the units digit of 1711? 1 What is the units digit of 873? 3 What is the thousands digit of 2141? 2 What is the units digit of 270? 0 What is the tens digit of 545? 4 What is the tens digit of 610? 1 What is the units digit of 1703? 3 What is the hundreds digit of 10171? 1 What is the tens digit of 87481? 8 What is the thousands digit of 91073? 1 What is the hundreds digit of 7263? 2 What is the hundreds digit of 9132? 1 What is the hundreds digit of 4121? 1 What is the units digit of 122628? 8 What is the units digit of 408? 8 What is the thousands digit of 4255? 4 What is the units digit of 1605? 5 What is the hundreds digit of 2044? 0 What is the units digit of 41652? 2 What is the units digit of 692? 2 What is the tens digit of 1154? 5 What is the tens digit of 615? 1 Wha	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from btzzllttztttzbtt. What is prob of picking 2 t, 1 z, and 1 l? 8/65 Calculate prob of picking 1 k and 2 c when three letters picked without replacement from kvcvc. 1/10 Calculate prob of picking 2 s when two letters picked without replacement from ossso. 3/10 Calculate prob of picking 1 g and 1 e when two letters picked without replacement from {v: 1, g: 6, e: 4}. 24/55 Calculate prob of picking 1 c and 1 w when two letters picked without replacement from owuco. 1/10 Two letters picked without replacement from pqjko. What is prob of picking 2 k? 0 What is prob of picking 2 f and 2 h when four letters picked without replacement from hhhhfhhhhhhhhhhffhf? 105/646 Three letters picked without replacement from qqqkqkkrqrk. What is prob of picking 3 q? 2/33 What is prob of picking 1 d, 1 c, and 2 t when four letters picked without replacement from ddttjc? 2/15 Two letters picked without replacement from ccrhchcxrh. Give prob of picking 2 c. 2/15 Three letters picked without replacement from sosoqfwh. What is prob of picking 1 s, 1 h, and 1 q? 1/28 Two letters picked without replacement from {z: 1, n: 3, q: 2, e: 3, x: 5, f: 1}. What is prob of picking 1 n and 1 z? 1/35 What is prob of picking 3 c and 1 z when four letters picked without replacement from zzczzczzczzzzz? 1/91 Two letters picked without replacement from jrzmrjpm. What is prob of picking 1 p and 1 m? 1/14 Calculate prob of picking 2 b and 1 l when three letters picked without replacement from jjbjnbbpbnlnonojbjn. 10/969 What is prob of picking 3 u when three letters picked without replacement from tittutttiuitu? 1/286 Four letters picked without replacement from {v: 3, p: 5}. What is prob of picking 4 p? 1/14 Calculate prob of picking 1 g and 1 o when two letters picked without replacement from {h: 1, s: 2, g: 1, o: 1}. 1/10 Calculate prob of picking 1 r and 1 i when two letters picked without replacement from {e: 1, t: 1, v: 12, r: 1, b: 3, i: 1}. 1/171 What is prob of picking 1 w and 1 n when two letters picked without replacement from {d: 2, w: 5, t: 2, n: 4, c: 4}? 5/34 What is prob of picking 3 u when three letters picked without replacement from fbcufuuuffbcffufcc? 5/408 Four letters picked without replacement from lrlcfwffffffffwfcrw. What is prob of picking 4 f? 35/646 Three letters picked without replacement from zoktkkzoczzqz. What is prob of picking 1 k, 1 t, and 1 q? 3/286 What is prob of picking 2 p and 1 i when three letters picked without replacement from {p: 2, i: 5}? 1/7 Calculate prob of picking 2 l when two letters picked without replacement from {v: 5, h: 4, l: 6}. 1/7 What is prob of picking 1 d and 1 y when two letters picked without replacement from {u: 3, d: 2, y: 12}? 3/17 Three letters picked without replacement from {h: 4, i: 2}. What is prob of picking 3 h? 1/5 Four letters picked without replacement from {m: 1, l: 2, s: 2}. What is prob of picking 2 s and 2 l? 1/5 Four letters picked without replacement from {m: 5, z: 4, t: 7, b: 2}. Give prob of picking 2 z and 2 b. 1/510 Three letters picked without replacement from {r: 3, w: 2, j: 4, i: 2}. Give prob of picking 1 j and 2 i. 4/165 What is prob of picking 1 y and 1 s when two letters picked without replacement from jyjhjhpjaahsjhy? 2/105 Calculate prob of picking 2 x when two letters picked without replacement from xnnnnxxxnx. 2/9 What is prob of picking 1 g and 3 u when four letters picked without replacement from {u: 5, g: 7}? 14/99 Two letters picked without replacement from {t: 16, x: 2}. Give prob of picking 2 t. 40/51 What is prob of picking 3 x when three letters picked without replacement from {x: 5, j: 5}? 1/12 Calculate prob of picking 2 g, 1 v, and 1 j when four letters picked without replacement from {k: 5, v: 3, j: 1, e: 6, g: 3}. 1/340 Two letters picked without replacement from rrlrlirirlrll. What is prob of picking 2 l? 5/39 Four letters picked without replacement from aaaaaaa. Give prob of picking 4 a. 1 Calculate prob of picking 1 f and 3 h when four letters picked without replacement from {h: 9, f: 9}. 21/85 Two letters picked without replacement from dyydyjdyydccyeyydyyy. Give prob of picking 1 y and 1 d. 11/38 What is prob of picking 1 s, 1 y, and 2 j when four letters picked without replacement from mjssmsssmjmsy? 6/715 Three letters picked without replacement from {w: 2, m: 1, b: 3, v: 3, e: 1, j: 1}. Give prob of picking 1 v, 1 j, and 1 w. 2/55 What is prob of picking 2 t, 1 r, and 1 c when four letters picked without replacement from rsktstsussscuusks? 1/2380 Two letters picked without replacement from {a: 6, f: 2, g: 2, k: 2, m: 3}. Give prob of picking 2 f. 1/105 What is prob of picking 2 q and 1 n when three letters picked without replacement from qqnqqnqnnqnqnnnn? 27/80 What is prob of picking 2 s and 2 c when four letters picked without replacement from {q: 10, c: 2, s: 3}? 1/455 Calculate prob of picking 1 y and 2 q when three letters picked without replacement from yqaqarayarxraaarxar. 2/969 What is prob of picking 1 j and 1 a when two letters picked without replacement from {d: 1, a: 2, j: 2, g: 4}? 1/9 Calculate prob of picking 2 x when two letters picked without replacement from {x: 3, n: 3}. 1/5 Calculate prob of picking 3 f when three letters picked without replacement from {f: 3, p: 1}. 1/4 Calculate prob of picking 1 i and 3 f when four letters picked without replacement from {f: 9, i: 5}. 60/143 Four letters picked without replacement from {g: 1, f: 4, n: 5}. What is prob of picking 3 n and 1 f? 4/21 Two letters picked without replacement from sdmxmxxwdd. What is prob of picking 1 s and 1 w? 1/45 Two letters picked without replacement from zkidttih. What is prob of picking 1 d and 1 i? 1/14 Three letters picked without replacement from rrllbv. What is prob of picking 1 l and 2 r? 1/10 What is prob of picking 4 f when four letters picked without replacement from ffffkffkkfff? 14/55 What is prob of picking 1 y, 1 x, and 1 o when three letters picked without replacement from oyygygggqxqggoxqoyg? 8/323 What is prob of picking 2 j, 1 f, and 1 y when four letters picked without replacement from {e: 1, k: 1, y: 1, j: 2, f: 1, t: 1}? 1/35 Two letters picked without replacement from {v: 6, m: 1, q: 1, e: 1, i: 9, c: 2}. Give prob of picking 1 e and 1 v. 3/95 Calculate prob of picking 1 o and 1 w when two letters picked without replacement from woqttooqoout. 5/66 Two letters picked without replacement from {s: 2, e: 6, f: 4, w: 2, i: 1}. What is prob of picking 1 w and 1 f? 8/105 What is prob of picking 1 d and 1 a when two letters picked without replacement from dqdqizdzqdzzqaz? 4/105 What is prob of picking 1 t, 2 e, and 1 o when four letters picked without replacement from {o: 3, e: 9, t: 2, h: 4}? 6/85 Calculate prob of picking 1 h, 1 q, 1 p, and 1 r when four letters picked without replacement from shhhqqrphhshypqqhp. 7/255 Four letters picked without replacement from sspppspksps. What is prob of picking 3 s and 1 k? 1/33 Calculate prob of picking 1 p and 2 j when three letters picked without replacement from {p: 2, q: 5, j: 6}. 15/143 Two letters picked without replacement from {q: 11, g: 3}. Give prob of picking 2 g. 3/91 Four letters picked without replacement from alaalcaaimaacciaacgm. Give prob of picking 2 i and 2 l. 1/4845 Two letters picked without replacement from {j: 2, q: 1, x: 1, l: 2}. Give prob of picking 2 l. 1/15 What is prob of picking 1 g, 1 y, 1 s, and 1 p when four letters picked without replacement from {y: 3, g: 4, k: 1, s: 4, e: 3, p: 2}? 24/595 Two letters picked without replacement from {s: 4, a: 3, i: 2, k: 1, o: 1, c: 1}. Give prob of picking 1 c and 1 k. 1/66 Three letters picked without replacement from fszshfskyfshyshssyz. What is prob of picking 1 y, 1 f, and 1 h? 9/323 Three letters picked without replacement from {g: 6, k: 4, d: 3}. Give prob of picking 3 g. 10/143 What is prob of picking 2 y when two letters picked without replacement from yzzzyzyz? 3/28 What is prob of picking 1 n, 2 k, and 1 p when four letters picked without replacement from pnpnnnpkppkp? 8/165 Three letters picked without replacement from {q: 4, z: 9, l: 6}. Give prob of picking 1 z, 1 q, and 1 l. 72/323 Two letters picked without r	{ "pile_set_name": "DM Mathematics" }
2f2 + 5f*2 to the form l + jf*3 + vf*2 + uf and give v. -1 Rearrange (2 + 2 - 2)(54 - 70 + 62)(3w - 6w + w) to the form cw + u and give c. -184 Express (-4 + 1 + 1)(-6q2 - 6q*2 + 5q*2 + (2q - q + 0q)(-7 + 7 - 22q)) in the form dq*2 + l + pq and give d. 58 Express -32k + 45k - 27k - 21k - 8 - 4 in the form zk + y and give y. -12 Express (-133 - 1592r + 684r - 932r + 133)(-2r*2 + 3r*2 + 2r*2) in the form d + hr*3 + sr*2 + vr and give h. -5520 Rearrange 378d - 22d + 346d2 - 343d*2 + 8d to md + hd*2 + f and give m. 364 Rearrange (3p*2 + 4p - 5p2 - 3p)(-p + 2p + 0p)(1 + 1 + 3) to r + bp3 + dp*2 + fp and give b. -10 Rearrange -955t2 - 5 + 812t*2 + 4 + 5 to ft*2 + it + r and give r. 4 Rearrange (-4 + 1 + 8)(2o + 1 - 1) + (3 - 3 - 5)(3 + 1 - 2)(-o + 2o - 3o) to the form yo + m and give y. 30 Rearrange (-2k + 0k + 4k + 20)(1 - 2 + 3)(4 + 0 - 3)(-3 + 0 - 2) to the form x + lk and give l. -20 Express 689g + 694g - 1383g + 4g*2 as lg + v + ug2 and give u. 4 Rearrange -2y*2 - 41y*4 + 43y*4 + 23y - 497y - 2y*3 to t + zy + dy4 + qy*3 + ny*2 and give d. 2 Express (-2601 + 2626 + 5y - 3y)(-1 + 1 - y)(-7 - 4 + 6) in the form gy + zy2 + t and give g. 125 Rearrange 3696b - 3696b + 62b*2 to p + ab*2 + jb and give a. 62 Express (0u2 + 0u*2 - 2u*2)(-u + 0u - u)(3u - 3u + 4u) + (-4 + u + 4)(13u3 + 215u - 215u) as zu*4 + ku*3 + f + iu*2 + tu and give z. 29 Rearrange 54l2 - 2l*3 + 0l*3 - 2l*3 + 6l*3 - 53l*2 + 36 to the form ul + sl2 + h + kl*3 and give k. 2 Rearrange (-2 + 4 - 3)(69 - 118i2 + 117i*2 - 46) to ni*2 + si + d and give n. 1 Express (-14 - 4 - 7)(-2 + 0 + 0)(8y - 9 + 9)(3y - 3y - y) as vy2 + j + py and give v. -400 Rearrange -1 + 159o - o4 + 119o - 41o - 33o to so + do*3 + xo*2 + u + ko*4 and give k. -1 Rearrange -5x*3 + 4x*3 - 2x*3 + (3x + 4x - 4x)(21x*2 - 15x*2 + 19x*2) to zx*3 + lx*2 + vx + f and give z. 72 Rearrange (2v2 + 3v*2 - 3v*2)(40v + 12v - 8v) + 29v + 10v3 - 29v to i + hv2 + nv*3 + tv and give n. 98 Express -65n - 3 - 15n - 71n + 28n - 44n as l + wn and give l. -3 Rearrange -31l2 + 11 + 28l*2 + 43l - 43l to the form yl + dl2 + r and give r. 11 Express (-1 + 1 - 5)(-2 - 3 + 3)(38 - 38 - 84h*4) in the form gh*2 + yh + th4 + bh*3 + j and give t. -840 Rearrange -11395l - 3 + 1 + 13333l + 2 to gl + v and give g. 1938 Rearrange (-6u2 + 80u - 5u2 + 10u*2)(2u - 2u + u*2) to the form su*4 + yu*3 + c + zu + bu2 and give s. -1 Rearrange -5m*4 + 5m*2 + 2 - 52m*3 + 0m*2 + 50m*3 - 7m*2 - 21 to the form gm + zm3 + tm*4 + lm*2 + j and give t. -5 Rearrange -3f - 46f2 + 29f*3 - 2 - 35f*3 + 7f*3 to the form sf*3 + if + bf2 + a and give b. -46 Rearrange (12 + 4 - 2 + 3)(-11j - 3 - 17j + 25j) to g + oj and give g. -51 Express 2d3 + 2d*3 - 2d*3 + (-3d*2 + 4d*2 - 3d*2)(0d - 2d + 0d) + 8d*3 + 8d*3 - 2d - 9d3 as td*2 + r + sd*3 + kd and give s. 13 Express 2r4 + 73r + 57r - 128r - 1 - 3r2 + r2 as p + dr + ir4 + yr*3 + ar*2 and give i. 2 Rearrange (17i*2 - 8792 - 4i + 8792)(-2 - 1 - 3) to pi + j + xi2 and give p. 24 Rearrange (-1 + 3d + 2 + 1)(-224205d - 22d3 + 224205d) to the form zd + ld*3 + p + xd*4 + cd2 and give x. -66 Express -g3 - 2g3 + g3 + 10g*2 + (-1 + 2 - 2)(4g2 - 4g2 - g2)(62 + g - 62) as ag*2 + rg + hg3 + y and give a. 10 Express 491y - 16 + 29 - 13 as ky + f and give k. 491 Express 3u*2 - 3u*2 - 2u*3 + (-u + 0u + 2u)(3u - 5u + 3u)(-1 + 1 - 2u)(441 - 586 + 1190) in the form ju3 + c + tu + wu2 and give j. -2092 Express 9449h - 43h2 + 3h*4 - 5h*4 + 3h*3 - 9449h as ph2 + o + wh*4 + gh + ch3 and give c. 3 Rearrange -2g*4 - 28g*2 - 2889 + 2889 + (-3g*3 - 3g*2 + 3g*2)(g + 2g - g) to the form dg*4 + og*2 + fg + ig3 + p and give d. -8 Rearrange -d3 + 5 + 192d*2 - 2d - 203d2 - 5 to the form id*2 + ad*3 + v + rd and give i. -11 Express 3o2 + 81o - 5o2 + 80o - 155o in the form lo*2 + ao + u and give a. 6 Express 3495c - 6490c + 3570c as q + wc and give w. 575 Express 4u - u - 6u + 51 - 51 + 11u + (-2 + 2 + u)(-8 - 6 - 1) in the form xu + y and give x. -7 Express -b2 - 53b*4 + 5b - 7b + b - b as r + mb*4 + qb + ob3 + yb*2 and give q. -2 Rearrange 0 + 3301t*2 - 3258t*2 + 2 to the form vt*2 + m + pt and give m. 2 Rearrange -152d3 - 70d*3 - 3 - 39d*3 + 1 to gd*2 + vd*3 + sd + z and give z. -2 Express 341v - 3v*3 + 18 - 339v + 2v4 - 1 as fv*2 + jv*4 + av*3 + sv + o and give o. 17 Express 3m - 10m*4 + 6m*4 - 48m*3 + 0m + 6m4 as zm*2 + bm + nm4 + p + xm*3 and give b. 3 Rearrange -3o*2 + 39o*3 + 70o*3 + 4o*2 - 23o*4 + 25o*4 to ho + yo4 + jo*3 + do*2 + n and give d. 1 Rearrange 23s + 6s - 207s*2 - 29s + 581s2 to xs*2 + r + qs and give x. 374 Rearrange (16 + 3 - 1)(-36 - 20 + 8)(2 + 3 - 3)(4m3 + m3 - 4m3) to q + jm + im2 + hm*3 and give h. -1728 Rearrange -4 - 2w - 3 - 23w2 + 5 - 2 - 6w*2 to kw + g + lw2 and give g. -4 Rearrange (3 + 93 + 16)(r*2 + 0 + 0)(4 - 2 + 3) to the form s + hr + fr*2 and give h. 0 Express -518s*2 - 13 - s - 2s + 520s2 as hs*2 + cs + y and give y. -13 Rearrange 41a - 18 + 12 + 6 to the form c + ja and give j. 41 Express (-4u + u + 5u + (-1 + 2u + 1)(-41 - 88 + 18))(-u + 3u - 3u)(-4 + 6 + 2) as yu2 + ju + o and give y. 880 Rearrange (-r + 2r + r)(2 - 2 - 8r)(1 - 1 + 2r + (-4r + 4r + r)(-2 + 0 + 13)) to the form xr3 + qr*2 + cr + f and give x. -208 Rearrange -119n2 - 2729 + 2729 + (2 - 1 + 1)(n2 - n2 - n*2) to t + zn*2 + gn and give z. -121 Express 15u3 - 48 - 17u3 - 9 - 52 - u2 in the form bu + x + au*3 + qu*2 and give a. -2 Rearrange -115 + 41 + 6d - 131 to the form zd + j and give z. 6 Rearrange (-16 + 16 - 10l)(-15 - 2 + 2)(7l + 7 + 0 - 5) to the form r + fl + vl2 and give f. 300 Rearrange 405 - u + 210 + 2u - 3u to the form yu + h and give y. -2 Express 33 - g - 18 - 5 + 4g2 - 2g2 + g3 as v + sg2 + tg*3 + pg and give s. 2 Rearrange -19 + 19 + 13g + (-g - 4g + 3g)(-1 + 5 - 2) - 44g + 18 - 18 to the form rg + q and give r. -35 Rearrange -1 + 6 - 5 - 2 + 41o to yo + m and give m. -2 Rearrange -3j2 + 158j - 309j - 2 + 155j - j*2 + 0j*2 + 2j*2 + (2j - j - 3j)(-2j + 3j - 3j) - 4 + 2j*2 + 4 to q + yj + mj2 and give q. -2 Express (-2y + 2y + 6y*3)(0y + 0y - 2y) + 0 + 0 - 2y*4 - 45y*2 - 206y*4 + 45y*2 as iy*2 + uy*3 + py*4 + w + cy and give p. -220 Rearrange 9 - 31 + 1673r + 8 + 14 to the form d + pr and give p. 1673 Rearrange -155 + 67 + h + 74 + h - 4h to the form gh + j and give j. -14 Express -932n + 932n - 487n3 + (-3n + 3n + 2n*2)(0n + 2n - n) as fn + rn*2 + bn*3 + v and give b. -485 Express -147l*3 + 1 + 1 + 29l*3 + 42l*3 as h + il + kl2 + ql*3 and give h. 2 Rearrange -2p + 10p3 - 3p*2 - 11p*2 + 14p*2 + 23p*3 - 7 to rp + dp3 + hp*2 + a and give r. -2 Rearrange 5d*2 + 9d*2 - 61d*4 + 1 + 59d*4 to the form td*4 + wd*3 + hd + z + jd2 and give z. 1 Rearrange (-2t2 + t2 + 0t2)(-4 + 2 + 1)(-52 + 8 + 4 + (3 + 0 - 2)(5 + 0 - 3)) to the form ht2 + d + zt and give h. -38 Express (16 - 36 - 16)(2w - 2 + 2)(-1 + 1 - 1 - 2w) as s + aw + pw2 and give a. 72 Express (0 + 0 + n2)(282 - 105 - 39)(3n2 + 1 - 1) + 0n3 - n2 + n*4 + 0n*3 as un + an2 + f + zn*3 + vn*4 and give a. -1 Rearrange ((-3 - 3 + 8)(-4 + 2 + 4) - 3 - 1 + 0 - 5 - 17 + 4)(0p + 4p - 2p) + p + 1 + 2 - 2p to x + hp and give h. -37 Express 62 + 2z2 - 63 + 8z*4 - z - 2z*3 - 6z*4 - 5z*2 in the form f + pz + uz2 + bz*4 + tz*3 and give u. -3 Rearrange (4 - 4 + 2)(0 + 0 + 2)(-74 - 36d + 37 + 35)(7d*3 + 3d*2 - 3d*2) to the form sd*4 + fd*3 + md*2 + od +	{ "pile_set_name": "DM Mathematics" }
Put -2, b, -97 in decreasing order. b, -2, -97 Suppose -v - 5 = 0, 5q - 7v - 5 = -3v. Sort q, 4, -22 in decreasing order. 4, q, -22 Suppose -30 = -5c + a, 7c - 30 = 4c + 3a. Let d be -448/(-220). Let b = -1/55 - d. Put b, c, -4 in increasing order. -4, b, c Suppose 0 = -b + 5, 0 = y - 9b + 12b - 13. Sort -1/2, y, 0, -2/5 in decreasing order. 0, -2/5, -1/2, y Let i = -0.3 - -0.7. Let l = -769 + 772. Sort -2, 4, i, l in decreasing order. 4, l, i, -2 Let a be ((-7)/4 - -2)/(3/24). Suppose 0 = ah + 2 - 4. Sort -5, h, 4, -4 in increasing order. -5, -4, h, 4 Let i be (4/20)/((-2)/(-15)). Let x = 19 - 6. Suppose 2g - x = -3q, g - 4q + 7 = -3. Sort 1/3, i, g in ascending order. 1/3, i, g Suppose 0 = -5a + 2v + 12, 4a = 2v + 2v. Let f be (2/((-20)/25))/((-2)/a). Put -3, f, 7 in ascending order. -3, f, 7 Let b = -0.07 - 0.93. Let j = -166 + 163. Sort j, -3/5, b in ascending order. j, b, -3/5 Let o be 7 + (4 - 10) + -5. Sort 8, o, -5, 2. -5, o, 2, 8 Let f be ((0 + -1)/((-5)/395))/(-1). Sort 2, f, 1, 3 in descending order. 3, 2, 1, f Let u = -45 + 110. Let y = 76 - u. Sort -4, y, -5 in decreasing order. y, -4, -5 Let g be -5(-504)/901/2. Let k(z) = -3z - 4. Let b be k(-3). Sort b, g, 2 in decreasing order. g, b, 2 Let m = -309.4 - -284. Let v = 25 + m. Put 2, -1/4, v, 0.4 in decreasing order. 2, 0.4, -1/4, v Let j(p) = 3p - 10. Suppose -2s + 12 = s. Let n be j(s). Sort -5, n, 0, -1. -5, -1, 0, n Suppose 4g = -0g + 8. Suppose 4 + 40 = -gq. Let z be -3 + q/18-3. Sort 0.4, z, 5. 0.4, z, 5 Suppose 10 = -5w + 30. Let y = -41 - -37. Let b be -1 + 2 + -4 + (-1 - y). Sort 3, b, w in descending order. w, 3, b Suppose 0 = 3n - 40 + 52. Sort -2, n, 6, 0 in decreasing order. 6, 0, -2, n Let l = -2/1081 + 1085/2162. Put 2, l, 6 in descending order. 6, 2, l Let j = -4658/3 + 1552. Put j, 117, 1/4 in increasing order. j, 1/4, 117 Let j be 12/27 - (2 + (-88)/45). Sort -12, j, 0.06 in decreasing order. j, 0.06, -12 Let x = 0.3 + 4.7. Suppose 0 = -6d + 18. Let q be d/110/(-40). Sort x, q, -5 in descending order. x, q, -5 Let m be ((12/8 - 3) + 2)6. Put -1, 4, m, 3/7 in descending order. 4, m, 3/7, -1 Let g be (-7 + (-1 - -2))/(-2). Suppose 1 = 5n - 3b + 11, -3n - 5b = 6. Put n, -1, g in descending order. g, -1, n Let c be ((-68)/51)/(12/(-45)). Let q be (-62)/12 + 4/24. Put c, 2, q in descending order. c, 2, q Let c = 722 + -716. Put c, -2/7, 15 in descending order. 15, c, -2/7 Let o be 8/(-6)(0 + (-12)/(-8)). Let b be (-10)/(-8)((-8)/o - 0). Put -2, b, -3 in descending order. b, -2, -3 Let b = -793 + 790. Sort b, 0.06, 4, -0.1. b, -0.1, 0.06, 4 Let t be (6/15)/((-1)/(-10)). Suppose 4q = -4n - 0q - 4, 2n + tq + 10 = 0. Suppose 4g - 3o = g + n, o = -5g + 17. Sort 1, 4, g in decreasing order. 4, g, 1 Let p = 279 + -279.4. Let h = 0.24 - -0.06. Sort -8, h, p in ascending order. -8, p, h Let v(b) be the first derivative of b*4/24 - 5b3/6 - b2 + 4. Let l(t) be the second derivative of v(t). Let k be l(5). Put 4, -5, k in ascending order. -5, k, 4 Let i = 8 - 14. Suppose -4r + 6r + 5y - 12 = 0, -3r - 20 = -2y. Let x be r/(-12) + 42/9. Put i, 0, x in increasing order. i, 0, x Let g = 0.0406 - 0.0126. Sort 5, g, 0.2, 1 in decreasing order. 5, 1, 0.2, g Let z be 3 - -10 - 15 - -17. Sort z, 3, 25, -3 in descending order. 25, z, 3, -3 Let k = 1054 - 1047. Sort 11, k, 4 in descending order. 11, k, 4 Let a(m) be the first derivative of -m4/4 - 2m3 - m2/2 - 11m + 27. Suppose -3j = -7j - 24. Let g be a(j). Sort -2, -4, g in decreasing order. -2, -4, g Let z(r) = -r3 + 5r*2 - r + 1. Let l be z(5). Let w be (-7)/((-140)/(-12)) + 93/5. Let h be (6 + (-102)/w)/((-2)/6). Sort 0, h, l in increasing order. l, h, 0 Let m = 474 + -474.5. Sort 0, 2/5, m, 5/7 in descending order. 5/7, 2/5, 0, m Let l = 37 - 34. Let w be l/(-4 - -13) - (-10)/(-3). Let i = 2 - -1. Sort 1, i, w in ascending order. w, 1, i Let d = -12 - -7. Let i = -569 - -575. Put i, 5, d in decreasing order. i, 5, d Let i be (-1)/(-3) - (-8)/3 - 3. Let l be ((-4)/(-4 + 6))/(10 - i). Put 0.2, 1, l in increasing order. l, 0.2, 1 Let d = 471 + -470. Sort d, 11, 4. d, 4, 11 Let u = 2297 - 2292. Sort u, 3, 4, 1/7 in descending order. u, 4, 3, 1/7 Suppose -5c + 6 = -3z + 17, 8 = -5c + 4z. Suppose -2l + 3s = -14, 0l = l - s - 6. Put c, 11, l in descending order. 11, l, c Let o = -2.56 - -2.16. Put 1/9, 1/6, o in increasing order. o, 1/9, 1/6 Suppose 3 = -0n + n. Let h = 1312 + -1310. Sort h, 5, n in decreasing order. 5, n, h Let z(x) = x2 - 14x + 30. Let q be z(13). Sort 2, q, -7 in increasing order. -7, 2, q Let c = 61.3 + -65.3. Put -25, -2/21, c in ascending order. -25, c, -2/21 Let l = -0.03 - 0.06. Let p = -0.11 + l. Let x = p + 0.1. Sort -0.02, -2/11, x in ascending order. -2/11, x, -0.02 Let u = 142 - 184. Let g = 42.3 + u. Put 1/3, 4, g, 0.05 in descending order. 4, 1/3, g, 0.05 Suppose 5y = -15, h - 5y - 37 = -2y. Suppose 3p - j = 14, -p - 4p - 3j = -h. Sort 1, -1, p. -1, 1, p Let i be ((-6)/4)/((-6)/(-8)). Suppose 0 = -5n + 1 + 39. Suppose -7x + 1 = -nx. Put x, 4, i in descending order. 4, x, i Let k = 7.9 - 5.9. Let o = 6.4 - 6. Let b = -3 + 10. Put k, b, o in decreasing order. b, k, o Let x(c) = 23c + 436. Let y be x(-19). Let i be ((-10)/(-8))/((-6)/24). Sort i, -2, y. i, -2, y Let d(g) = -g*2 - 7g - 1. Let s be d(0). Sort 4, -3, s, 0.4 in descending order. 4, 0.4, s, -3 Let n(v) be the second derivative of -v*3/6 - 2v*2 + v. Let a be n(-8). Suppose 5 + 4 = 2o - 5d, ao + d = -15. Put 3/2, o, 2/3 in ascending order. o, 2/3, 3/2 Let p(t) = t + 5. Let y be p(-4). Suppose 3o = 5r + 5o + 28, 5o = 2r - 12. Put 3, r, y in decreasing order. 3, y, r Let r(w) = -w + 7. Let q be r(7). Let p = -3 + 8. Suppose 21 = -5b + s, 3s + qs - 13 = pb. Put b, 5, -1 in decreasing order. 5, -1, b Let n(t) be the third derivative of 5/6t*3 + 0 + 0t - 1/120t6 - 5/12t*4 + 1/6t*5 + 5t*2. Let y be n(9). Sort -5, y, 0. -5, y, 0 Let l = 1106.6 - 1107. Let u = -17 - -69/4. Sort 3/7, l, -2/17, u in decreasing order. 3/7, u, -2/17, l Suppose f + 8 - 3 = 0. Sort f, -0.2, 0, -4 in descending order. 0, -0.2, -4, f Let t = 3776/5 - 756. Sort t, -0.4, -4. -4, t, -0.4 Let i = 51 - 34. Suppose 4u = -5n - i, 4n + 30 = 4u + u. Let w = 0.03 - -4.97. Sort 0.4, w, n in increasing order. n, 0.4, w Let h = 0.1982 - 0.0982. Let g = 0.03 - 2.03. Let j = g + -3. Put j, h, -4 in descending order. h, -4, j Let r = 7 - 11. Let l = 459 - 459. Sort r, l, 3 in increasing order. r, l, 3 Let l be ((-228)/(-9))/(5/(-15)) - 3. Let n = -78 - l. Let p = 1 - 1. Put p, 4, n in ascending order. p, n, 4 Suppose 2u - 114 = 4l, -37 = -0u - u - 3l. Suppose 2q - 7 + 9 = v, 5v + 3q - u = 0. Let b = -9 + 5. Sort 5, v, b in ascending order. b, 5, v Suppose 0h = 3h - 54. Let b = h - 15. Let u(a) = 5a - 7. Let o be u(b). Put o, -1, -2 in descending order. o, -1, -2 Let n = -0.06 + 0.26. Sort 0.3, n, -0.2 in descending order. 0.3, n, -0.2 Let o(y) = -y. Let q be o(1). Suppose 3v - 9 = 6. Let n = 763 - 759. Put n, q, v in ascending order. q, n, v Let d = -165 + 194. Let f = 31 - d. Let s(b) = -b*3 - 5b*2. Let h be s(-5). Sort h, f, -5 in decreasing order. f, h, -5 Let d be 2 + ((-1)/1)/(-1). Suppose d = m - 2y, 5y = -m - 0y + 10. Sort m, -8, 4 in decreasing order. m, 4, -8 Let g = -5.2 + 5. Let s = 0.9 - 1.3. Let q = 4 - 1. Sort s, g, q in increasing order. s, g, q Suppose 0 = -0j - 5j + 4d - 24, -4j = -5d + 21. Sort -1, j, 0.2 in descending order. 0.2, -1, j Let d be 7/(-3)(-256)/2688. Sort d, -3, -3/7, 5. -3, -3/7, d, 5 Let f = -1/1929 + 429/643. Sort 3, f, 3/5, -1 in decreasing order. 3, f, 3/5, -1 Suppose 3f - 141 = 6f. Put 5, f, 1 in descending order. 5, 1, f Let s be 39/6 + -7 + (-1)/6. Put 1, 2/9, 0.1, s in descending order. 1, 2/9, 0.1, s Let j = 10 - 6. Suppose -w + 9 = -jw. Let v(k) = -k3 + 11k*2 - 24k - 2. Let y be v(8). Sort y, 4, w in descending order. 4, y, w Let a = -119 + 117. Sort -221, a, -4 in decreasing order. a, -4, -221 Let s(q) = -8 - q - q + 0q + 0q. Let u be s(-9). Suppose 2 = -3g - u. Put 0, 5, g in decreasing order. 5, 0, g Let a(m) = 3m*2 + 12m + 7. Suppose -6 = -7z + 9z. Let h be a(z). Sort h, -1, 7 in ascend	{ "pile_set_name": "DM Mathematics" }
s 265 divide 50221433? False Is 9528416 a multiple of 262? True Is 1559 a factor of 383311330? True Is 2346 a factor of 115019688? True Is 41181490 a multiple of 10? True Is 760125723 a multiple of 21? True Does 5 divide 7347457? False Is 21 a factor of 159922791? True Is 13934500 a multiple of 124? True Is 250812271 a multiple of 841? True Is 15 a factor of 5640504? False Is 22153600 a multiple of 1120? True Is 753274080 a multiple of 2210? True Is 59267724 a multiple of 12? True Does 325 divide 74452950? True Is 14592838 a multiple of 14? False Is 111 a factor of 74311165? False Is 3 a factor of 11414381? False Is 13122198 a multiple of 9? True Does 42 divide 105885990? True Does 26 divide 6310512? True Is 106 a factor of 807275330? True Is 4492 a factor of 1490508488? True Is 50 a factor of 62489619? False Is 131461397 a multiple of 1447? True Is 120552440 a multiple of 8? True Does 1382 divide 517837616? False Does 3 divide 26961570? True Is 2966 a factor of 202204084? True Does 20 divide 143433011? False Is 17798903 a multiple of 200? False Is 451 a factor of 5215160? False Is 5 a factor of 14901789? False Does 358 divide 44106099? False Is 1445299907 a multiple of 12? False Is 244060247 a multiple of 5? False Does 73 divide 3024081283? True Is 161790240 a multiple of 992? True Is 499154088 a multiple of 94? False Does 2130 divide 495968370? True Is 1836 a factor of 229257215? False Is 358528130 a multiple of 34? True Is 494584808 a multiple of 136? True Is 34 a factor of 627697709? False Is 48 a factor of 265519392? True Is 151013040 a multiple of 34? True Is 10768239 a multiple of 1164? False Does 150 divide 2692613550? True Is 77401128 a multiple of 31? False Is 160 a factor of 839996160? True Is 16245240 a multiple of 110? True Is 7017251 a multiple of 227? True Is 64180317 a multiple of 11? False Is 1227949608 a multiple of 243? False Is 570 a factor of 4442580? True Is 26712720 a multiple of 27? True Is 579 a factor of 1616045403? False Is 35 a factor of 171096590? True Is 15 a factor of 178125733? False Does 71 divide 127353549? False Is 2629701859 a multiple of 43? False Is 1599 a factor of 12963273? False Is 1082202551 a multiple of 220? False Is 2270887097 a multiple of 138? False Is 1879 a factor of 320046312? True Is 128809509 a multiple of 27? False Does 27 divide 52235118? True Is 1464 a factor of 1359877325? False Is 490014720 a multiple of 30? True Is 167 a factor of 92798226? True Does 8 divide 31256128? True Is 707938542 a multiple of 162? True Does 15 divide 592425? True Does 437 divide 693519? True Is 1658146 a multiple of 238? True Is 33 a factor of 6483477? True Is 724045415 a multiple of 185? True Does 50 divide 49065162? False Does 13 divide 41436044? True Is 11 a factor of 6731116? False Is 57 a factor of 581571552? False Does 207 divide 59229531? True Does 9 divide 652259826? True Is 111327541 a multiple of 31? True Is 227 a factor of 853577052? False Is 827 a factor of 188003564? True Does 15 divide 2973388? False Does 50 divide 604199296? False Does 161 divide 47033896? True Is 3 a factor of 601904715? True Is 416 a factor of 13678781? False Does 5 divide 14086328? False Does 13 divide 2812758? True Is 55 a factor of 1133785421? False Does 13 divide 29450616? True Is 474183882 a multiple of 3095? False Does 10921 divide 732515154? True Does 9 divide 24596919? True Is 4865 a factor of 1327855433? False Does 32 divide 2279753251? False Is 12 a factor of 29832823? False Does 22 divide 172202734? True Is 422 a factor of 448498224? True Does 13 divide 6431425? True Is 17 a factor of 199842820? True Is 559 a factor of 75293314? False Is 56 a factor of 3777539? False Is 43335504 a multiple of 16? True Is 43 a factor of 24927208? False Is 63338564 a multiple of 2944? False Is 28300656 a multiple of 1454? True Is 16076484 a multiple of 22? False Does 5 divide 36195394? False Is 2854379713 a multiple of 274? False Is 476 a factor of 38049437? False Does 709 divide 165727699? False Does 31 divide 1229652878? False Does 20 divide 51113891? False Is 671698818 a multiple of 1722? True Does 18 divide 1338996599? False Is 1087345532 a multiple of 1198? True Is 38959536 a multiple of 938? False Is 10 a factor of 22977880? True Does 25 divide 74964596? False Is 84 a factor of 27143424? True Does 15 divide 770164815? True Does 442 divide 2653645? False Does 33 divide 863082? True Is 8569802 a multiple of 538? True Is 397 a factor of 90072014? False Is 106 a factor of 240388492? False Does 405 divide 52506225? True Does 818 divide 332166164? False Is 4043 a factor of 1062908368? False Is 5648 a factor of 249443920? True Is 5576 a factor of 118322720? True Does 53 divide 251087067? False Is 1456 a factor of 326669616? True Is 169047646 a multiple of 262? False Is 3005 a factor of 41952805? True Does 229 divide 69990305? False Is 7031 a factor of 3539799136? True Does 1665 divide 202721628? False Is 3813070 a multiple of 829? False Does 13 divide 827819707? True Is 2443 a factor of 220792650? False Does 154 divide 32931910? False Does 676 divide 305426264? True Is 4 a factor of 261472? True Is 124 a factor of 634072600? False Is 695 a factor of 115134447? False Does 2895 divide 2536735065? True Is 3028 a factor of 614278248? True Is 23 a factor of 372497669? False Does 197 divide 30538949? False Is 126558257 a multiple of 10? False Is 165325459 a multiple of 13? True Does 18 divide 10313730? True Is 95756945 a multiple of 49? False Does 93 divide 3145498851? False Is 336487760 a multiple of 5? True Is 490097282 a multiple of 537? False Is 25596166 a multiple of 5? False Is 38811300 a multiple of 9? False Is 127 a factor of 3504002858? False Is 25 a factor of 1055855000? True Is 1682922408 a multiple of 12? True Is 899578780 a multiple of 2228? False Is 271962627 a multiple of 412? False Is 846 a factor of 114714216? True Is 38509354 a multiple of 226? False Is 23 a factor of 25442878? False Is 3052722735 a multiple of 81? True Does 30 divide 210498374? False Is 10 a factor of 32048897? False Is 1143238810 a multiple of 538? False Does 1179 divide 1696962419? False Does 30 divide 6820552? False Does 265 divide 5853081? False Does 23 divide 51470831? False Is 32785153 a multiple of 425? False Is 1642 a factor of 304303650? True Does 2465 divide 422836240? True Is 174429383 a multiple of 902? False Is 561491549 a multiple of 29? False Does 95 divide 252416707? False Does 63 divide 116310513? False Does 28 divide 9042012? True Is 6 a factor of 288111660? True Does 799 divide 918528003? True Is 7 a factor of 4165293? False Is 2428876996 a multiple of 91? True Is 124 a factor of 1283597656? True Is 655 a factor of 2142600093? False Is 20 a factor of 148541267? False Is 770 a factor of 728183835? False Is 1583380993 a multiple of 21? False Does 10 divide 11041150? True Is 6809 a factor of 1729343011? True Does 170 divide 31036445? False Is 2524576489 a multiple of 37? True Does 775 divide 30471744? False Does 48 divide 34342928? False Is 29080064 a multiple of 512? True Does 124 divide 73158546? False Does 38 divide 38343740? False Is 416202702 a multiple of 127? False Does 1841 divide 9657886? True Is 770 a factor of 40140175? False Does 54 divide 12505538? False Does 8 divide 25190960? True Is 164 a factor of 634244580? True Is 13280064 a multiple of 656? True Does 6 divide 34831249? False Is 42246672 a multiple of 104? True Does 67 divide 147251193? True Is 1056 a factor of 91537479? False Is 18 a factor of 1183597272? True Does 230 divide 74484523? False Is 53044890 a multiple of 7? False Is 128488608 a multiple of 926? False Is 543 a factor of 140347581? True Does 1313 divide 51464724? False Is 574 a factor of 17471412? True Does 48 divide 4336041? False Is 26 a factor of 7452146? True Is 37277741 a multiple of 40? False Is 21 a factor of 108461136? True Is 25 a factor of 10165479? False Does 83 divide 10846523? True Is 56798705 a multiple of 498? False Does 910 divide 30420748? False Is 508 a factor of 30940686? False Does 36 divide 400245192? True Is 189 a factor of 229409237? False Does 14 divide 1123798564? True Does 58 divide 44628568? False Does 10914 divide 3049338858? True Does 15 divide 221775661? False Does 59 divide 11	{ "pile_set_name": "DM Mathematics" }
y - 209. Let c be n(-21). Let q(b) = b. Let s(p) = p - 2. Let l(r) = r - 1. Let o(i) = -l(i) + 3s(i). Determine co(a) - 4q(a). -2a - 5 Let j(u) = 3u + 1. Suppose -516s + 500s = 48. Let c(l) = -3l - 1. Give sj(y) - 2c(y). -3y - 1 Let h(g) = 21g3 + 3g*2 - 2g - 3. Let m(i) = 2i3 - i2 + i + 2. Calculate -h(w) - 3m(w). -27w3 - w - 3 Let p(w) = -6w. Let z be -21 - 0/((-3)/(-1)). Let l(y) = -y. Let s be 2 - 44/20 - (-4)/(-5). Let b be s + 5 + (-4 - (3 - 6)). Calculate bp(f) + zl(f). 3f Let y(x) be the second derivative of -x4/3 - 53x - 3. Let q(h) = 2h2. Give 13q(f) + 6y(f). 2f2 Let d(m) = m2 - 3m - 2. Let l(x) = 2x + 1. Suppose -4k = 0, -2k + 3 = o + k. Give ol(w) + 2d(w). 2w2 - 1 Let l(j) = 39j. Let s(x) = 26x. Suppose v + 2 = 0, -w - 3v = -0v - 14. Let o be (-11 + (-294)/(-30))w/3. What is os(n) + 5l(n)? -13n Let f(p) = 2456p*2 - 5p + 20. Let r(j) = -12280j2 + 26j - 110. What is 11f(y) + 2r(y)? 2456y2 - 3y Let u(k) = k*3 + 2k*2 + 3k. Suppose 4y = -4y + 16. Let p(b) = b - yb + 18b*2 - 14b2 - b3 - 5b2. Let s = 0 + -1. Determine su(i) - 3p(i). 2i3 + i2 Let t(q) = -q*2 - 3. Let y(b) = -5b*2 - 4b - 4. Let c(u) = u*2 + u. Let p(k) = -4c(k) - y(k). Let o be -1(-13 - -12) + (-6)/(-2). Give op(n) + 5t(n). -n2 + 1 Let w(c) = 5c*2 - 56. Let z(t) = 2t*2 - 19. Suppose 3k + 8 = 5g - 10, -11k + 74 = 5g. Give kw(l) - 11z(l). -2l2 - 15 Let p = 6757 + -6762. Let r be 56/4 + -3 - 3. Let l(s) = -s3 + 5s2. Let j(n) = -2n*3 + 8n*2. Calculate pj(a) + rl(a). 2a*3 Let l(f) = -4f*3 - 63f*2 - 3f - 87. Let z(q) = 6q3 + 81q*2 + 4q + 116. What is -9l(d) - 7z(d)? -6d3 - d - 29 Let a(f) = 22f*2 - 6f + 20. Let q(y) = 38y2 - 10y + 39. What is -5a(u) + 3q(u)? 4u2 + 17 Let r(l) = 2l*2 - 8l + 6. Suppose 22 = -3o - 5. Let g(f) = 2f*2 - 17f + 5f2 + 3f*2 + 13 - 5f*2. What is or(d) + 4g(d)? 2d*2 + 4d - 2 Let v(h) be the first derivative of -h - 6. Let u(a) = -3a3 - a - 6. Let r be 6/4(168/36 - 2). Calculate rv(w) - u(w). 3w3 + w + 2 Let j(w) be the second derivative of w2/2 + 37w - 8. Let o(n) = -9n + 6. Give 5j(c) - o(c). 9c - 1 Let j(g) = -66g - 101. Let m(r) = -77r - 104. Determine 6j(i) - 5m(i). -11i - 86 Let v(o) = 4o + 5. Let n(d) = -15 + 4 - 387d + 378d. Let q be (-2 - 2) + 10 - 2 - 18. What is qv(f) - 6n(f)? -2f - 4 Let v(a) = -6a + 7577. Let p(h) = 17h - 22748. Give -4p(m) - 11v(m). -2m + 7645 Let k(s) = 16s2 + 178s + 8. Let q(j) = -5j2 - 61j - 3. Give -3k(p) - 8q(p). -8p2 - 46p Suppose 1244o - 495 = 1347o + 123. Let x(h) be the second derivative of -19h3/6 - 3h*2 + 3h. Let i(d) = 702d + 221. What is oi(a) - 221x(a)? -13a Let m(w) = 2w3 - 9w*2 - 3w + 7. Let k = 2043 - 2036. Let d(c) = -3c3 + 17c*2 + 5c - 13. Determine km(i) + 4d(i). 2i3 + 5i*2 - i - 3 Let j(d) = 2d*2 - 6d - 11. Let t(m) = -6m2 + 20m + 38. Let i(c) = -7j(c) - 2t(c). Let s(r) = 10r2 - 9r - 6. Determine -11i(y) - 2s(y). 2y2 - 4y + 1 Let m(o) = 23o2 + 12o - 96. Let r(f) = -11f2 - 6f + 42. Let i(x) = 3m(x) + 7r(x). Let p(t) = 7t2 + 5t - 5. Give 5i(g) + 6p(g). 2g2 Let q(b) = -29b - 386. Let k(z) = 38z + 387. What is -3k(p) - 4q(p)? 2p + 383 Let g(r) = 9221 - 187r2 - r - 9220 + 186r2. Let u(d) = -d2 - 3d + 12. Determine -3g(p) + u(p). 2p2 + 9 Let c(h) be the third derivative of -h5/60 + h3/6 + 6h*2. Let s(n) = 32n + 3n - 34n + 2n2. Determine -3c(a) - 2s(a). -a2 - 2a - 3 Let j = 150517 - 150512. Let w(a) = 3a - 6. Suppose -3f - 8 = -f. Let y(k) = 2k - 6 + 2 - 1. What is fw(v) + jy(v)? -2v - 1 Let v(m) be the third derivative of -5m3/2 - 7497m*2 + m. Let w(x) = x + 1. Give v(i) + w(i). i - 14 Let b(n) = -16n*3 - 16n. Let z(i) = 5i3 + 4i*2 - 7i. Let j(m) = 18m3 + 15m*2 - 27m. Let p(r) = 4j(r) - 15z(r). Calculate -2b(t) + 11p(t). -t*3 - t Suppose -4p = 5m - 26, 3m = -11p - 2m + 54. Let i(r) = 23r3 - 5r. Let n(w) = 23w3 - 4w. Determine pi(g) - 5n(g). -23g3 Let o(x) = 4x*3 - 17x*2 + 6x + 6. Let l(d) be the second derivative of d5/20 - d4/12 + d3/6 + d2/2 - 77d - 3. Determine -6l(z) + o(z). -2z3 - 11z*2 Let b(n) = -9 + 11 - 157n + 153n. Let r(k) = k - 14. Let p be r(17). Let w(q) = 7q - 5. Determine pw(g) + 5b(g). g - 5 Let g(k) = 37k + 2368. Let s(n) = 59n + 3552. Give -8g(q) + 5s(q). -q - 1184 Suppose 0 = 30v - 45v + 60. Let k(x) = 26x + 23. Let p(d) = 9d + 8. Give vk(q) - 11p(q). 5q + 4 Let v(p) = -p - 4. Let i(o) = 2o + 12. Let k(r) = -2r - 13. Let d(t) = -4i(t) - 3k(t). Suppose -508z - 516 = 533z - 1170z. Give zd(n) - 7v(n). -n - 8 Let s(a) = -71a - 28. Let z(t) = 14t + 5. Determine -2s(y) - 11z(y). -12y + 1 Let k(g) be the second derivative of -g3/6 - 47g. Let o(t) = -t - 5. Let m(y) = -5y - 3. Let z(f) = -m(f) + o(f). What is k(h) - z(h)? -5h + 2 Let x(r) = 48r + 60. Suppose 0 = -j - 4p + 1917, 2j - j - 1911 = 2p. Suppose -1914 + j = -y. Let c(i) = -i - 1. What is yx(l) + 60c(l)? -12l Let m(z) = -397590z*2 + 210z + 70. Let u(d) = 51302d2 - 27d - 9. Give 9m(w) + 70u(w). 12830w2 Let a(p) = p2 + 2p + 1. Let g(h) = -1019h2 - 12h - 6. What is -6a(w) - g(w)? 1013w*2 Let w(x) = 7x - 3. Suppose -5n + 66 = 2l, 2l + n + 26 = 3l. Let b(j) = 44 - 104j + l - 2 - 56j. Determine 3b(o) + 70w(o). 10o Let p(q) = -778q*3 - 3q*2 - 3. Let f(l) = 56l3 + l2 + 1. Give -12f(r) - 4p(r). 2440r3 Let q(l) = 3l*3 + 93l - 7. Let d(t) = -t*3 - 54t + 4. Determine 5d(a) + 2q(a). a*3 - 84a + 6 Let f(t) = t*3 - 3t*2 + t + 1. Let c(m) = 8m*3 - 27m*2 - 3m + 6. Calculate -2c(w) + 18f(w). 2w3 + 24w + 6 Let s(t) = 5t2 - 3t + 3. Let d(l) = -l*2 + l. Let n be (2/(-4) - 0)/(-17 - (-105)/6). Give ns(b) - 3d(b). -2b*2 - 3 Let v(q) = -30q + 10. Let l(u) = 2u + 215. Let a(p) = -3p - 307. Let j(c) = -7a(c) - 10l(c). What is 12j(w) + v(w)? -18w - 2 Let z(u) = -u*3 + 9u*2 - 9u. Let k be (4/(-10))/((-3)/(-15)). Suppose -221 + 219 = -s. Let v(c) = -15779 + c + 15779 - c*s. What is kz(f) - 18v(f)? 2f3 Let l be (24/10)/((-1124)/(-1405)). Let c(i) = -i2 - 2i + 6. Let q(z) = z2 + 2z - 7. What is lq(d) + 4c(d)? -d*2 - 2d + 3 Let j(o) = -o*3 + 2. Let s be ((-65)/35 + 1)/(4/(-14)). Let i(d) = 3d2 + ds - 3 - 6d2 + 3d*2. What is -2i(q) - 3j(q)? q3 Let k(g) = 8g*2 + 2099g + 1 + 6g3 - 4175g + 2073g. Let w(a) = 5a*3 + 7a*2 - 2a + 1. What is -4k(u) + 5w(u)? u*3 + 3u*2 + 2u + 1 Let s(o) = o + 1. Let a(j) = 2j + 17. Let f be a(-8). Let g(v) = 205v - 190v + f + 9. Let n(t) = -13t - 88. Let c be n(-6). Calculate cs(d) + g(d). 5d Let f(m) = 7m3 + m - 4. Let a(n) = -15n*3 - 3n + 9. Let d(o) = 6a(o) + 13f(o). Let s be 5/210/(-25). Let y(w) = w - 1. Give sd(r) - 5y(r). -r3 + 3 Let n(h) = 121h*2 + 12h + 17. Let k(j) = 118j2 + 13j + 15. Let u(i) = 9k(i) - 8n(i). Let g(s) = -19s2 - 4s. Give 11g(p) + 2u(p). -21p2 - 2p - 2 Let v(o) = -15o2 - 5o + 2. Let n(b) = 10b2 + 12b + 8. Let a(f) = f*2 + 3f + 3. Let k(d) = -3a(d) + n(d). What is 5k(w) + 2v(w)? 5w*2 + 5w - 1 Let s(d) = d + 1. Let h = 921 - 919. Let m(g) = -14g - 10. What is hm(a) + 18s(a)? -10a - 2 Let m be ((-2)/1)/(-2 + 0). Let a be ((-1)/40)/(-21). Suppose a = 3d - 920 + 932. Let n(i) = 3i + 5. Let y(p) = p + 1. What is dy(t) + mn(t)? -t + 1 Let m(z) = 382 - 863 + 472 + 65z. Let i(c) = -32c + 4. What is 13i(g) + 6m(g)? -26g - 2 Let h(f) = -f2 - 6f + 52. Let j be h(5). Let q(o) = o + 0 + 2 - 3o. Let v(b) = -9b + 5b - 2 + 7b. Calculate jv(x) - 4q(x). -x - 2 Let a(u) = -15u - 8. Let z(d) be the third derivative of 7d*4/12 + 7d*3/6 - 2643d*2. What is -6a(m) - 7z(m)? -8m - 1 Let z(x) = 4x3 - 28x*2 + x - 17. Let h(a) = -3a*3 + 18a*2 - a + 12. What is 7h(s) + 5z(s)? -s3 - 14s*2 - 2s - 1 Let k = 14169 + -14164. Let q(u) = -15u2 + 1. Let d(v) = 29v*2 - 2. Give kq(z) + 3d(z). 12z*2 - 1 Let f = -259 - -263. Suppose -2x = fr - 4x - 18, 4r - x = 13. Let c(o) = 2o	{ "pile_set_name": "DM Mathematics" }
38. Let o(i) = -3i - 4. Let y(r) = -r - 1. Let n(a) = o(a) - 4y(a). Determine v(n(c)). 8c Let t(h) = -h2 + 7h + 5. Let m be t(7). Let d(o) = 5 + o*2 - 5o2 - m. Let q(v) = v2. Determine q(d(a)). 16a4 Suppose l + 29 = 4d, -4d + 15 = d + 3l. Let c(b) = -4b - 2. Let o be c(-2). Let v(i) = -i2 + o - d. Let y(p) = 9p*2. What is v(y(k))? -81k4 Let f(i) be the third derivative of -i7/2520 + i5/60 - i2. Let u(w) be the third derivative of f(w). Let j(p) = -p - 3p + 2p. Calculate j(u(y)). 4y Let x(c) = -3c*2. Let n(i) = 530i. What is x(n(q))? -842700q2 Let b(p) = -3p - 17. Let q(n) = -6n2. Determine q(b(a)). -54a*2 - 612a - 1734 Let z(p) = -4p2 + 10p. Let u(g) = 60g2. What is z(u(f))? -14400f*4 + 600f*2 Let q(v) be the first derivative of -9v*2/2 - 7. Let s(w) = 5w. Calculate q(s(u)). -45u Let k(a) = -5a2. Let x(h) = -h2 + h + 1. Let l(j) = 4j2 - 2j - 2. Let p(f) = 2l(f) + 4x(f). Calculate k(p(v)). -80v4 Let t(j) be the third derivative of 17j*5/60 - 11j*2. Let x(p) = -2p. Determine x(t(s)). -34s2 Let x(r) = 266r. Let v(l) = 3l2. Calculate v(x(w)). 212268w*2 Let t(a) = -3a - 4a + 11a - 3a. Let m(s) = -57s. What is t(m(h))? -57h Let i(u) = -u + 5. Let c be i(3). Let j(n) = 4n + n - cn. Let m(b) = -2b*2. Determine j(m(r)). -6r*2 Let t(o) = 0o + o + 0o. Let s(x) = -2x. Let d(l) = -4l. Let y(m) = -6d(m) + 13s(m). Determine t(y(g)). -2g Let s(t) = 38t2. Let r(h) = 205h*2. What is r(s(j))? 296020j*4 Let j(i) be the second derivative of -i - 1/6i*3 + 0 + 0i*2. Let r(g) = -17 + 5g*2 + 17 + 0g*2. Calculate r(j(a)). 5a*2 Let g(d) = 7d. Let q(r) be the first derivative of -8r3/3 + 59. What is q(g(v))? -392v2 Let z(v) = v2. Let x(o) be the first derivative of 6 + 1/2o2 + 0o. Give x(z(w)). w*2 Suppose -4c + 27 = -5y, -2c + 0y = 2y. Let m(i) = -2i - 3 + c. Let s(z) = z. Give m(s(t)). -2t Let a(m) = 3m - 18m + 14m + 7m. Let j(g) = -5g. Determine a(j(h)). -30h Let t(d) = 3d - 14 + 14. Let s(z) = -9z. Calculate t(s(u)). -27u Let i(x) = -2x*2. Let f(a) = 31a - 3. Determine i(f(d)). -1922d2 + 372d - 18 Let w(x) = -30x2. Let j(c) = 4c. What is w(j(y))? -480y2 Let h(f) = -3f*2. Suppose -4d = -0d. Let p = 12 + -10. Let t(o) = 2o - po + do - o. Calculate t(h(w)). 3w2 Let o(u) = -u3 - u + 1. Let x be o(0). Suppose 4k - 17 + x = 0. Let a(w) = w + w - kw. Let h(r) = r2. Give h(a(s)). 4s2 Let z(c) = c2. Let p(w) = -342w. What is p(z(i))? -342i*2 Let d(z) = -55z*2. Let u(y) = 41y. What is d(u(r))? -92455r2 Let o(i) = 216i. Let b(m) = 3m2. Determine b(o(q)). 139968q*2 Let d(a) be the third derivative of -7a*4/24 + 7a*2. Let n(w) = -2w. What is d(n(t))? 14t Let d(y) = y. Let f(m) = -1236m*2. What is f(d(j))? -1236j*2 Let w(o) = o + 2. Let k be w(5). Let z(l) = 5l + kl + l. Let i(a) = 2a*2. Give z(i(g)). 26g*2 Let a(r) = 2r + 2. Let d be a(-2). Let q be -1(-1)/d-2. Let t(y) = 1 - q + y. Let i(u) = 3u2. What is t(i(m))? 3m*2 Let i(y) = 67y*2. Let f(h) = -2h + 1. Let t(z) = -z + 1. Let l(d) = 2f(d) - 2t(d). Calculate i(l(a)). 268a2 Let t(d) be the third derivative of -d6/720 + 3d*4/8 - 7d*2. Let w(q) be the second derivative of t(q). Let o(x) = 6x. Calculate o(w(u)). -6u Let s(y) = 8y*2. Let i(j) be the first derivative of 2j*3/3 - 5. What is i(s(n))? 128n*4 Let l(x) = 27x + 1. Let p(y) = -11y. Give p(l(w)). -297w - 11 Let i(f) = 2f. Let q(m) be the second derivative of 0 + 2m - 7/6m3 + 0m*2. Give q(i(c)). -14c Let i(j) = 12j2 + j2 - 16j*2 + 5j*2. Let f(z) = 25z*2. Calculate i(f(k)). 1250k*4 Let v(x) = 2x*2. Let c(m) = -13m*2. Give c(v(p)). -52p*4 Let d(s) = -s. Let l(a) = 1064a*2 - 2. What is d(l(h))? -1064h2 + 2 Let o(m) be the third derivative of m5/30 - 26m2. Let u(g) = -2g*2 + 17g. What is u(o(j))? -8j4 + 34j*2 Let l(a) = -26a*2 + 14a*2 + 15a*2. Let w(c) = -7c*2. What is l(w(d))? 147d*4 Let y(r) = 2r*2. Let j(w) = -2w. Give y(j(t)). 8t2 Let j(h) be the first derivative of 4h*3/3 - 6. Let f(i) = -4i*2. What is f(j(p))? -64p4 Let l(x) = -x2. Let j(y) be the third derivative of y*4/12 + 6y*2. Calculate l(j(n)). -4n2 Let j(w) = 19 + w2 - 19 - 2w2. Let k = 8 - 5. Let u(d) = -3 - d2 + k. Give j(u(h)). -h4 Let v(u) = u. Let f(p) = 2916p. Calculate f(v(d)). 2916d Let k(j) = 2j. Let d be (-1)/(-1)(9 + 20). Let n(c) = 8c + d - 29. What is n(k(i))? 16i Let v(r) = -r. Let z(j) = 24j - 2. Give z(v(h)). -24h - 2 Let d(f) be the second derivative of f4/2 - 22f. Let q(l) = -3l. Calculate q(d(w)). -18w*2 Let z(r) = -2r*2. Let c(v) = 3v*2 - 134. What is c(z(x))? 12x*4 - 134 Let l(z) = -z. Let y = 10 - 1. Let w(a) = ya*2 + 91 - 91. Calculate l(w(u)). -9u*2 Let w(g) = 174g - 3. Let n(o) = -o*2. What is w(n(s))? -174s2 - 3 Let s(p) = p2 + p*2 + 0p*2. Let x(f) = -3f + 3f - 5f. What is s(x(c))? 50c2 Let t(c) = c2 + 28c. Let h(n) = -76n + 1. Give t(h(q)). 5776q*2 - 2280q + 29 Let w(t) = -t. Let j(r) be the second derivative of -r*3/3 + 4r. What is j(w(n))? 2n Let t(n) = 26n - 3. Let g(u) = -4u2. Determine g(t(x)). -2704x*2 + 624x - 36 Let d(s) = -5s - s2 - 5s + 10s. Let a(w) = 4w. Give d(a(q)). -16q2 Let y(i) = i2 + 3. Let v(l) = 1. Let s(u) = 3v(u) - y(u). Let g(a) = 10a. Determine g(s(o)). -10o*2 Let v(i) = 6i*2 - 16i*2 + 20i*2. Let l(z) = -2z*2. Determine l(v(x)). -200x4 Let s(a) be the third derivative of a5/60 + a*2. Let r(g) be the first derivative of 2g*3/3 - 3. What is s(r(m))? 4m*4 Let t = 22 + -14. Let p(n) = -17n + 6 - t + 2. Let y(g) = -2g. Calculate y(p(j)). 34j Let c(l) be the third derivative of l*4/12 + 2l*2. Let r(z) be the second derivative of 0z*3 + 0z*2 - 5/12z*4 - 3z + 0. Determine c(r(t)). -10t2 Let f(s) = 8s. Let a(v) be the third derivative of v*5/20 - 4v*2. Give a(f(d)). 192d2 Let m(j) = -j2. Let b be 6/(-27) + (-38)/(-9). Let n(w) = b + w - 3w - 4. What is m(n(h))? -4h2 Let b(v) = -v3 - 6v2 - 4v + 5. Let t be b(-5). Let s(g) be the third derivative of 0g3 - g2 + t - 1/12g*4 + 0g. Let o(w) = 5w. What is o(s(z))? -10z Suppose 3m - y - 8 = 0, 0m - 5y = 3m + 4. Let x(a) = 2am - 4a*2 + 4a*2 + 0a*2. Let q(z) = 2z + z - 5z. Determine x(q(k)). 8k*2 Let a(q) be the second derivative of 4q + 0 + 0q2 - 1/6q3. Let x(c) = -c2 - c2 + c2. Determine a(x(j)). j*2 Let l(d) = 2d. Let v(u) = 21u2 - 14u - 14. Let a(w) = -4w2 + 3w + 3. Let i(z) = 14a(z) + 3v(z). What is i(l(s))? 28s2 Let d = -1 - 0. Let z be (2 - d)25/15. Let r(g) = zg - 6g + 3g. Let x(u) = 2u. Calculate r(x(m)). 4m Let b(q) = 4q. Let l(c) be the second derivative of c5/120 + c3/2 + 2c. Let u(r) be the second derivative of l(r). Give b(u(w)). 4w Let z(w) = -w*3 - 11w*2 - 11w - 3. Let r be z(-10). Let o(m) = -7 + 3m + 0 + r. Let i(c) = -c2. What is i(o(u))? -9u*2 Let k(x) = -117x*2 + 87x*2 + 86x2. Let y(f) = f2. Give k(y(q)). 56q4 Let l(t) = -122t*2 - 5t. Let v(c) = -4453c2 - 183c. Let j(h) = -183l(h) + 5v(h). Let b(y) = y*2. Determine j(b(i)). 61i*4 Let z(o) = -2o. Suppose 0 = 4u + 5f - 2f - 17, 0 = 2u - 2f - 12. Let t(s) = us*2 + 4s*2 - 3s*2 - 3s*2. Calculate z(t(g)). -6g*2 Let q(g) be the first derivative of -2g3/3 + 2. Let u(b) be the third derivative of -b5/12 + 7b2. Calculate u(q(t)). -20t*4 Let a(i) = 2i - 4. Let c(x) = 2x - 5. Let n(f) = -5a(f) + 4c(f). Let m = 3 + -1. Let j(o) = 2o - mo + 2o. Determine j(n(s)). -4s Let t(h) = -2h*2. Suppose -11z - 8 = -15z. Let a(d) = 3d - zd - 4d - 4d. Determine t(a(g)). -98g*2 Let d(z) = -28z*2. Let n(j) = 18j. Give n(d(f)). -504f2 Let a(p) = 20p2. Let y(z) = 1187 + z2 - 1187. Determine a(y(u)). 20u4 Let u(a) = 11a*2. Let w(o) = -o. Let r(i) = -6i. Let x(j) = r(j) - 5w(j). Determine x(u(l)). -11l*2 Let v(n) = -17n + 1. Let s(j) be the second derivative of -j*3/3 + 35j. Calculate s(v(l)). 34l - 2 Let b(k) = -2k*2 - 4k. Let t(v) = 8v. What is t(b(z))? -16z**2	{ "pile_set_name": "DM Mathematics" }
-27 = -4u + 5z + 8, -2u + z + 13 = 0. Find the second derivative of -180c*5 - 3c + 6 + 214cu + 78c*5 wrt c. 2240c*3 What is the third derivative of 17l*2 - 3 - 7l*3 - 19l*3 + 8317l*4 - 129l + 35l3 - 9l*3 wrt l? 199608l Suppose -16o + 157 = -83. Let t be (14/3)/(6/9). What is the second derivative of ty + y*2 + 9y - oy2 wrt y? -28 Let c(w) = 1251w*3 - 10w*2 - 15w + 800. Let u(f) = -1248f3 + 8f*2 + 12f - 801. Let p(v) = -4c(v) - 5u(v). Differentiate p(y) with respect to y. 3708y2 Let n(u) be the first derivative of u5/5 - u4/2 + 1408u*3/3 - 192u*2 - 2u + 7582. What is the second derivative of n(f) wrt f? 12f2 - 12f + 2816 Let v(g) = 1123g3 - 1732g*2 + 12g. Let j(s) = -1129s3 + 1731s*2 - 9s. Let r(a) = -4j(a) - 3v(a). What is the third derivative of r(n) wrt n? 6882 What is the first derivative of -1268 + 4z2 - 294 + 200 + 3z*3 + 44z*4 - 13z*4 + 24z*4 wrt z? 220z*3 + 9z*2 + 8z Suppose x = 2s + 59 - 13, -28 = -x - 4s. Let w = -31 + x. Differentiate 15 - 5q4 - wq*4 + 3 wrt q. -56q*3 Let y(z) be the first derivative of -25z7/7 + z6/6 + 5z5 - 4495z*3/3 - 5569. What is the third derivative of y(i) wrt i? -3000i*3 + 60i*2 + 600i What is the third derivative of -132097t3 + 1232t*6 + 132097t*3 - 1325t*2 wrt t? 147840t*3 Let o(k) be the first derivative of -2k*3/3 - 1773k*2/2 + 3198k + 3403. What is the first derivative of o(i) wrt i? -4i - 1773 Let v(b) be the first derivative of 49b*5/5 + 15b*4/4 + 14b3/3 + b2/2 - 8b - 50. Find the third derivative of v(f) wrt f. 1176f + 90 Let p = 19458 - 58351/3. Let a(v) be the first derivative of 0v2 + 7/4v*4 - 31 + pv*3 + 0v. What is the third derivative of a(z) wrt z? 42 Let h(z) be the third derivative of 367z9/28 - z5/60 - 34z*3 + 2z*2 + 1106z. Find the third derivative of h(p) wrt p. 792720p3 Let c = -61 - -63. Suppose 2j - 2t + 4 = 0, -1 = -t + c. Differentiate 12b - j + 6 + 2 + 1 with respect to b. 12 Find the second derivative of 276g2 + 155g*2 + 628g*2 + 18 - 29g*2 + 205266g - 205264g wrt g. 2060 Let f(s) be the first derivative of -3877s*3/3 - 392s*2 + 792. Find the second derivative of f(t) wrt t. -7754 Let c(u) = -697u*3 - 2u*2 + 2u + 1480. Let z(d) = -13d3 - d2 + d. Let m(s) = -c(s) + 2z(s). Find the first derivative of m(o) wrt o. 2013o2 Let o be 64 + (3 + 0)2. What is the third derivative of 38i4 - oi*5 - 31i4 - i2 - 7i4 + 35i wrt i? -4200i2 Suppose -2w - 7r = -10r + 4, r = -3w + 16. What is the second derivative of 23o*w + 35o + 53o - 19o wrt o? 276o2 Let v = -41361 + 248185/6. Let i(p) be the third derivative of 0 + 4p*2 + 0p - 13/8p4 - vp*3. Differentiate i(t) with respect to t. -39 Let p(s) be the first derivative of -2s - 45s3 - 5s*7 - 7 - 26s*3 + 17s*7 + 38s*3. Find the third derivative of p(n) wrt n. 10080n*3 Find the second derivative of 41 + 731p*3 - 5919p*3 + 4368p + 78 - 119 wrt p. -31128p Let l(m) = m3 - 10m*2 - 5m - 1. Let f(i) = 9206i3 + 50i*2 + 25i + 4363. Let c(v) = f(v) + 5l(v). Differentiate c(h) wrt h. 27633h*2 Let i be ((-1)/2)/((-43)/1634). What is the second derivative of 2c*4 - ic + 49 + 36c2 + 28c*2 - 49 wrt c? 24c2 + 128 Let q(f) = f2 - 26f - 85. Let c be q(29). Find the second derivative of 34k + 31k4 - 9k*5 - 34k*4 - 2 + c wrt k. -180k*3 - 36k*2 Find the second derivative of 4 + 20926v + 20910v - 41706v - 6500v2 + 7 wrt v. -13000 Let q(z) be the second derivative of -z7/6 - 4z*4/3 - 7z*3/6 - 11z*2/2 - 15z - 38. Find the second derivative of q(n) wrt n. -140n3 - 32 What is the third derivative of 11115n*2 - 2613061n*6 - 164n*4 + 2613058n*6 - 550n*4 wrt n? -360n*3 - 17136n Let k(o) be the second derivative of -1142o5/5 - o4/6 + 937o3/6 - o2 - 6832o. What is the third derivative of k(t) wrt t? -27408 Find the second derivative of 2k + 7k + 8196k*2 + 2k + 49 - 7732k2 wrt k. 928 Let z be (7 + (-8)/1)/((-1)/2). What is the derivative of -24 - 6b*z + 7b*2 - 22 - 48 - 7b wrt b? 2b - 7 Let j(t) be the second derivative of 79t6/3 + t5/20 + t*4/12 + 3532t*2 - 2t + 385. Find the first derivative of j(k) wrt k. 3160k3 + 3k*2 + 2k Let o = 171 + -123. What is the first derivative of 21 + 132s - o - 132s - 50s2 wrt s? -100s Let o be (-1386)/(-357) + (-6)/(-51). Suppose 2i - 3 = 3. What is the third derivative of -9d*i + 19d*2 - 11d*o - 42d*2 + 9d*3 wrt d? -264d Let t be (-2)/(88/66 - 250/183). Find the first derivative of -79 + tb - 10 - 36 wrt b. 61 Find the third derivative of -4082i*2 - 61852i + 61852i + 8579i*3 wrt i. 51474 Let a(m) be the third derivative of 92m*5/3 - 4339m*4/24 + 665m2 + m. Find the second derivative of a(r) wrt r. 3680 Let r(s) = s3 - 14s2 - 15s + 2. Let q be r(15). Find the third derivative of -17y4 + 17y*4 - 3y*2 + 25y*q - 32y*6 - 2y wrt y. -3840y3 Let x = 58 + -65. Let n(b) = b3 + 8b*2 + 8b + 10. Let h be n(x). What is the third derivative of 11y2 - 5y*h + 26y*2 - 31y*3 wrt y? -216 Let r(s) be the third derivative of -431s*4/24 + 2128s*3/3 + 312s*2. Differentiate r(n) with respect to n. -431 Let h(x) = 3x - 39. Let r be h(17). Suppose 9s = rs - 246. Differentiate 85 - 183 + s + 17y wrt y. 17 Let i(c) be the second derivative of 77c*7/6 + 49c*4/4 + 5c*2/2 + 8c - 48. Find the third derivative of i(b) wrt b. 32340b2 Let w(n) be the third derivative of -667n*5/60 - 647n*4/24 + 3n*2 + 90n. Find the second derivative of w(g) wrt g. -1334 Let f(t) = 20t2 + 7t + 2. Let b be f(-2). Let d be 50/3 - (b/12 - 6). Find the third derivative of 13v2 + 16v*2 + dv*6 - 6v*6 wrt v. 1320v*3 Let y(z) be the first derivative of -500z*3 - 1635z*2/2 - 234. Find the second derivative of y(u) wrt u. -3000 Let y(m) = -9m - 60. Let n be y(-7). What is the second derivative of -l*3 - 8l - l - 13l - 2l*n wrt l? -18l Let z(x) = -2x2 + 14x - 2. Let o(n) = 1882n2 - 746n - 11. Let j(s) = -o(s) + 5z(s). Find the second derivative of j(p) wrt p. -3784 Suppose 95 = -3l + 3t - 526, 3l = 4t - 621. Let v = l + 521. What is the first derivative of -314x*2 - 21 - 28x*3 + vx*2 wrt x? -84x*2 Suppose 3f = 5b - 1407, 2b - 7b + f = -1399. What is the third derivative of -bd*3 - 27d*3 + 42d*3 + 377d*2 - 465d*2 wrt d? -1584 Let k = -938 - -940. Suppose -2y + 3 + 1 = 0. What is the second derivative of 2zk - 4z*y - 3z + 10z + 5z wrt z? -4 Let n = 672/19 - 4013/114. Let p(r) be the third derivative of 0r - 3r*2 + nr*4 + 13/6r*3 + 0. What is the derivative of p(b) wrt b? 4 Find the second derivative of -18v + 783v4 + 455 + 34v - 17v wrt v. 9396v2 Find the second derivative of -c2 + 971c5 + 695c*5 - 24c*4 + 8c*4 + 2790c + 16c4 wrt c. 33320c*3 - 2 Let v(h) = 7264h*3 - 4h*2 - 1868h - 56. Let g(i) = i3 + i2 + 2i + 14. Let c(f) = -4g(f) - v(f). Find the second derivative of c(q) wrt q. -43608q Let n(g) be the second derivative of 512g*3 + 409g*2/2 - 498g. Differentiate n(i) wrt i. 3072 Let y = -482 + 485. What is the second derivative of 6o + 37o*3 - 19o*3 + yo - 4o - 11o*3 wrt o? 42o Let k(g) = g*2 - g - 8. Let r be k(5). Suppose 0 = -5h + 2z + r, -3 = h + 3z - 2. Find the second derivative of 12l + 18l*h + 14l*3 - 18l*2 wrt l. 84l What is the second derivative of -5f2 - 5909440 + 3f + 5909762 - 1096f3 + 5f*2 wrt f? -6576f Let y(r) be the first derivative of -2766r5/5 + 4272r - 392. Differentiate y(l) wrt l. -11064l3 Differentiate -1771 - 748 + 16h + 9h - 25h + 4h + 389h*2 with respect to h. 778h + 4 Let q(m) = 3 + 5m2 - m3 - 12m + 8m - m2. Let g be q(2). What is the third derivative of y2 + 8y*2 + 10y3 - yg wrt y? 54 Let d = -57375 + 108828. What is the first derivative of -19q2 + d + 73q*2 - 51527 wrt q? 108q Let g = -2628 - -2633. Suppose h - 12 = -2. What is the third derivative of hk5 + 14k*2 - 17k*5 + 12k*6 + 7k*g wrt k? 1440k**3 Let v(l) be the third deriva	{ "pile_set_name": "DM Mathematics" }
-px = -2m, 0 = 19m - 18m - 3x + 8 for m. 4 Suppose -43s = -46s - 45. Let m be ((-2)/(-3)s)/(-2). Solve 0o = 3o + mf, 3f - 34 = 5o for o. -5 Let p(h) = -6h*3 - 4h*2 - 4h + 2. Let j be p(-2). Let r = 44 - j. Let a be r((-4)/(-8) + 0 + 1). Solve -3n - 17 = 5u + a, 0 = -3u + 3n - 12 for u. -4 Let x(m) = -3m + 23. Let o(n) = n - 1. Let q(f) = 6o(f) + 3x(f). Let h be q(19). Solve 3j + j - 2p = -6, -h = j + 4p for j. -2 Suppose -3827 = 157t - 246t. Solve -2i + g = -10, -2i - 21 = 5g - t for i. 6 Suppose 11m - 18 = 8m. Let u be (-3 - -6) + -3(-46)/m. Let a = 30 - u. Solve av = -p, 0v - v = -4p + 17 for p. 4 Suppose 6 = 3s + q, -5s - 2q + 10 = 2. Solve 13a + p - 3 = 15a, -4a - 12 = -sp for a. 0 Suppose -l = -5i + 185, -2i - 657 = 3l - 170. Let o = l - -179. Solve o = r + 3n, 3r + n = -2n + 18 for r. 2 Suppose 5m + 426 = 526. Suppose 3s + 5l + 6 = -16, 4l + m = 0. Suppose 0 = 4x - 24 + 4. Solve -xt = n + s, -t = 3t - 4n + 20 for t. -1 Let i(j) = 555j - 1660. Let g be i(3). Solve 4 = -4s + gs, s + 11 = -5r for r. -3 Let o(u) = -2u*3 + 24u*2 - 52u - 2. Let t be o(3). Solve tk + 4 = 2g, -43k + 28 = -47k - 4g for k. -3 Suppose 0 = 3w + 4w - 84. Let l(b) = -b3 - 3b*2 - 2b - 4. Let r = -8 - -5. Let z be l(r). Solve 3f + w = 4f + 4n, n - z = 0 for f. 4 Suppose -1159 = -3w - 2q, 2w + 208 = -2q + 976. Solve -wa + 389a - 2 = 3k, 0 = a + k for a. 2 Suppose x = 40m - 35m - 23, 27 = 3m - 5x. Solve 2r + 1 = 3z - 8, 0 = -2r + mz - 14 for r. 3 Suppose 27 = 3k - 3b, 4b = -39 + 11. Solve 26 = 3p - kq + 16, 5q = -p + 9 for p. 4 Suppose -14u + 12u = -1008. Let y be 1056/u + (-4)/42. Solve 5a = yh + 6, -a - 2h + 10 = 2h for a. 2 Suppose 0 = -5w + 3a + 16, 44 = 18w + 7a - 11a. Solve 4c - 2c + 5x - 23 = 0, -3x + 17 = -wc for c. -1 Let h be 3/15-154/(-1). Solve -35j + 40j - h = -2m, -j = 5m - 7 for j. 2 Suppose 9o - 9 - 36 = 0. Suppose -q - 147 + 151 = 0. Let m = o - q. Solve 5k - 11 = -w, -3w - k - m = -3k for w. 1 Let r = 6560 + -6553. Let b = 5 + -3. Solve 4w = 2s - 2, -4s - 2w - b = -rw for s. -3 Let c(i) = i2 - 5i + 15. Let o be c(5). Suppose 6x = 15 + o. Solve 0 = 4z - xq + 30, -6z + q = -z + 27 for z. -5 Suppose 5b - 3b = -294. Let h = 149 + b. Let s(c) = c*2 + 7c. Let t be s(-7). Solve -2x - 5i + 24 = t, -x - hi = -3x - 4 for x. 2 Let n = 38 - 35. Suppose 5y + ng = 31, -3y = 4g - 24 + 1. Let t = 13 - y. Solve 3 = 5u - 2i + t, 0 = u + 2i + 1 for u. -1 Suppose 52v + 740 = 200v. Solve -8 = 3x + 3k - v, 5x - k - 13 = 0 for x. 2 Suppose 5z + 70 = 5t, 3t + t - 24 = -4z. Let p(k) = -k*2 + 20k - 95. Let m be p(t). Solve 5r + 0r = -5g + 10, -mg = 0 for r. 2 Suppose -35z + 33 + 212 = 14z. Solve -3d + 23 = 4f, f + 0 = zd - 23 for d. 5 Let a be (-224)/(-24) - ((-48)/9)/(-4). Solve -4g - 28 = -4s, a = -5g - s - 3 for g. -3 Suppose 1052 + 1038 = 11i. Let m = i + -189. Solve f - 3t = m, -2f + t = -3 + 1 for f. 1 Let z = -291 + 295. Suppose 2b = -2 + 26. Let a = b - 10. Solve -3d - z = au - 1, -d + 16 = -5u for d. 1 Suppose -9 = -z - 5a - 24, 5z + a + 195 = 0. Let t be (-33)/(-15) + (-3)/604. Let w be ((-1)/4)/(t/z). Solve 8d = 3d - f - 15, 0 = -5d - 3f - w for d. -4 Suppose 0 = -2t + 10t - 7t - 12. Solve 3v - 4o = 11, -9o + 6o = -3v + t for v. 5 Let z = -516 - -524. Let s be -1(-13 - (-32)/z). Solve -s = -j + 2v, -2v - 10 = 5j + 5 for j. -1 Let h = 242 + -241. Suppose n = 4n. Solve -5r + l + 18 = n, r = 4l - 3 - h for r. 4 Let a(h) = -h2 - 3h + 423. Let r be a(-22). Solve -m + 6m + ry + 5 = 0, 7 = -3m - 4y for m. 3 Suppose 8277 = -6a + 8289. Solve 2c = -2x + 18, 6c - ac = 16 for x. 5 Suppose 0 = -5f + 5d - 2d + 10, 2d + 13 = -3f. Let w be 3/(f((-15)/(-12) - 2)). Solve p = 5s - 30, -2p + 10 = -wp for s. 5 Suppose 166 = 4a - 456c + 459c, -3c = 3a - 126. Solve 5s + 102h = 107h - a, 2s + 5h = 12 for s. -4 Let g be 240/192 - (-3 + 0 - (-51)/12). Solve g = n + 2p + p + 1, 0 = 5n - p - 27 for n. 5 Let d(t) = -t - 5. Let x be d(-7). Suppose 4w = 2w + 116. Suppose p - w + 53 = 0. Solve -19 = -pn + xb, 3n + 2 - 13 = b for n. 3 Let p = -16215 - -16224. Solve 0 = 5s - 4i + 7i + p, -s - 7 = -2i for s. -3 Suppose -2g - z = -86, 2g + 3z + 50 = 136. Suppose -38s + gs = 10. Solve 6 = 3k - sn, -3n = -5n for k. 2 Let p(n) = 16n - 1214. Let g be p(76). Solve 4f = 2z, 4z - 3f = gf for z. 0 Suppose 3r - 4 = 14. Suppose 3m - 2k = 0, 2m - 5k = rm. Solve 0 = -3j - b + 6, 4j + 2b + m = 8 for j. 2 Suppose -3u = 15, 3r + u = -3u + 118. Suppose 8p - 2 = r. Suppose -d + z - p = -5d, -5d + 5z - 5 = 0. Solve -3v + d = 5t + 16, -5v + 6 = -2t for t. -3 Let n be 0/(6/(-4) - 30/(-20) - 1). Solve 8m - 2w - 5 = 9m, 2m - 3w - 25 = n for m. 5 Let x = 38 - 38. Suppose -4o + 203 = -5a, x = 3o + a + 2a - 132. Let k = o + -47. Solve -z - 7 = -4b, 2z = 4b - kz - 10 for b. 1 Suppose -34j = -44j + 30. Let d be -10 + (8 - 3) + 8. Solve 4t - 3 = dg, -3g - 8 = jt - 5 for t. 0 Let o(c) = -34c*2 + 273c - 6. Let q be o(8). Solve 34s = 36s + qb + 4, -2b = -4 for s. -4 Suppose 19n + 126n - 2465 = 0. Solve l + n = 4d, l + 79 = 78 for d. 4 Suppose -5j - 47c + 46c = -25, 2j + 5c - 33 = 0. Solve -6p = 4w - jp - 10, 3w - 2p = -10 for w. 0 Let r(z) = -z3 + 13z*2 + z - 10. Suppose -21 = -2o + n, 15o + 59 = 18o + 4n. Let x be r(o). Solve 3j + 5g = -2, -3g = xj + 8 - 2 for j. -4 Let c be 646/26 - 2/(-13). Suppose 14w = cw - 55. Solve -5 = wm - 4i, 5m - 4i = 4m + 15 for m. -5 Let o(w) = -3w + 42. Let z be o(13). Suppose 0 = -zb + 3d - 3, 0d - 3d + 3 = -b. Solve -q + 1 = -bq - a, 4q - 2a - 12 = 0 for q. 5 Let f(q) = q*2 + 7q + 3. Let i be 23 + (-12)/4 + 1. Suppose 42 = -2t - it. Let p be f(t). Solve 4x + 1 = px, 0 = -5j + 4x + 14 for j. 2 Let f be 16/(144/(-27)) + 7. Solve c = 2p - 3, p - fc + 14 - 26 = 0 for p. 0 Suppose -6 = -17g + 14g. Suppose 5q - y + 10 = 0, 0y + gy = -q - 13. Let m be 130/(q + -2)-1. Solve 0 = -2u - 0r - 4r + m, 0 = -u + 5r - 15 for u. 5 Let q = 52 - 27. Suppose 5k = z + 32 - 10, 0 = -5k + q. Suppose zd + 2m + 3m + 25 = 0, d + m + 5 = 0. Solve -5p - t + 29 = 0, d = -3p - t - 3 + 22 for p. 5 Suppose 7b - 2b = -450. Let k be (b/12)/((-3)/6). Suppose kv = v + 126. Solve 2g + l + 3 = 0, 4g + v = 8g + 5l for g. -4 Let d = -283 - -55. Let l = -224 - d. Solve 25 = 5g, w + g - 24 = -lg for w. -1 Suppose j + 3j - 1189 = 5u, 238 = -u + j. Let a = 241 + u. Solve -3i + 2y = -4, ai + 4y + 10 = -y for i. 0 Let k(o) = 71o - 923. Let m be k(13). Suppose 5z - 6z = 0. Suppose z = 5r + 4 - 14. Solve -rv = d + v + 14, 5v + 15 = m for d. -5 Let m be 7 + 1(-21)/7. Let i be 1 - (4/2 - 2). Solve -2b = 2k + i - 5, -mb - 6 = -3k for b. 0 Let z(p) = -p*2 - 207p - 1780. Let r be z(-9). Solve 0 = -4h, 0 = -rm - 2h + 12 - 2 for m. 5 Let f be 52(22/6)/((-3)/(-9)). Let c = 574 - f. Solve 2w - 3s - 14 = -2w, w + 2s = -c for w. 2 Let s = 20189 - 20174. Solve -h - 6 = 2w, -4h + 9h = -w + s for h. 4 Let p = 5 - 3. Suppose i = 4 - 2. Let c be i-2(-5)/10. Solve ps + 8 = w, -4w + 7 - 5 = cs for s. -3 Suppose 0 = -6u + 60 - 18. Let s be (-156)/(-42) + 2/u. Solve y - 11 = 2l, -y + 10 = -3l - s for l. -3 Suppose m + 57 = 19b, -15 = m - 4b - 3. Solve 4l = 12, ml = -k - 5l + 18 for k. 3 Let b be (-4)/(16/20 + 39/(-30)). Let i be b(42/(-16))/(-7). Solve n = 5t - 29 + 8, it - 8 = -4n for t. 4 Suppose -21n = -22n + 3. Suppose 5q - 4q - n = 0. Solve -3g + 3 = 0, -j - 1 = j - qg for j. 1 Let m be 12/8(-52)/(-26). Solve 7s - 5x = 10s - 4, 0 = -ms - 2x + 7 for s. 3 Let n be 0 - (3 - 0)2. Let c = 8 + n. Let w = -2175018 + 2175021. Solve 3k + 4v = -7, -cv + wv + 1 = 0 for k. -1 Suppose -7p - u + 1114 = -3p, 0 = -p + 2u + 283. Let o = -276 + p. Solve 2k + 21 = 5x - 2, 13 = 2x + ok for x. 5 Let k(a) = -6a + 65. Let h be k(11). Let n be 2688/441 + h + (-19)/(-21). Solve 2x - 14 = -2x - 2u, 0 = 2u - n for x. 2 Suppose -6 = 2c + f, 18 = -31c + 36c - 3f. Solve -x + 4d = -9, c = -x + 39d - 36d + 8 for x. 5 Let b(j	{ "pile_set_name": "DM Mathematics" }
5? 21 Calculate the remainder when 89130 is divided by 156. 54 Calculate the remainder when 514648 is divided by 87. 43 Calculate the remainder when 4517 is divided by 1519. 1479 What is the remainder when 388797 is divided by 3015? 2877 Calculate the remainder when 171875176 is divided by 156. 148 What is the remainder when 744614 is divided by 115? 104 What is the remainder when 12917391 is divided by 17? 9 Calculate the remainder when 368203 is divided by 40906. 49 What is the remainder when 13204626 is divided by 1126? 24 What is the remainder when 27603 is divided by 2098? 329 What is the remainder when 15888951 is divided by 17403? 12 Calculate the remainder when 806983 is divided by 271. 216 What is the remainder when 78062 is divided by 164? 162 Calculate the remainder when 33675 is divided by 727. 233 What is the remainder when 120856 is divided by 60253? 350 What is the remainder when 37988 is divided by 36055? 1933 Calculate the remainder when 209921 is divided by 1072. 881 Calculate the remainder when 52661005 is divided by 55. 45 Calculate the remainder when 7492259 is divided by 6836. 3 Calculate the remainder when 432503 is divided by 6066. 1817 What is the remainder when 874145 is divided by 67241? 12 Calculate the remainder when 54854380 is divided by 121. 119 Calculate the remainder when 4189607 is divided by 1701. 44 Calculate the remainder when 392882 is divided by 398. 56 Calculate the remainder when 223533 is divided by 2454. 219 What is the remainder when 3508083 is divided by 1011? 924 Calculate the remainder when 2278587 is divided by 1139267. 53 What is the remainder when 20510434 is divided by 5763? 5680 What is the remainder when 6686196 is divided by 1? 0 Calculate the remainder when 31508143 is divided by 2331. 16 What is the remainder when 10519332 is divided by 380? 172 What is the remainder when 36919379 is divided by 858590? 9 Calculate the remainder when 1985625 is divided by 28774. 219 What is the remainder when 305360 is divided by 2229? 2216 What is the remainder when 2249123 is divided by 27426? 191 What is the remainder when 1382152 is divided by 249? 202 Calculate the remainder when 3737470 is divided by 28101. 37 Calculate the remainder when 1387136 is divided by 11368. 240 Calculate the remainder when 8238550 is divided by 1563. 1540 Calculate the remainder when 11606 is divided by 2857. 178 What is the remainder when 583030 is divided by 204? 202 What is the remainder when 12919958 is divided by 4306645? 23 What is the remainder when 475766 is divided by 31658? 896 Calculate the remainder when 1180519 is divided by 4340. 39 Calculate the remainder when 9524279 is divided by 234. 11 What is the remainder when 86653 is divided by 10826? 45 Calculate the remainder when 6051742 is divided by 6687. 7 What is the remainder when 8722851 is divided by 15576? 291 Calculate the remainder when 5017893 is divided by 58. 23 What is the remainder when 27012778 is divided by 29? 3 Calculate the remainder when 36354996 is divided by 2644. 2640 What is the remainder when 11375012 is divided by 5? 2 Calculate the remainder when 1994486 is divided by 94917. 1229 Calculate the remainder when 1560279 is divided by 3514. 63 Calculate the remainder when 337733 is divided by 623. 67 Calculate the remainder when 62969846 is divided by 36. 14 Calculate the remainder when 455590 is divided by 151850. 40 Calculate the remainder when 20397898 is divided by 1854354. 4 Calculate the remainder when 307371 is divided by 34148. 39 What is the remainder when 84375545 is divided by 193? 191 What is the remainder when 387395 is divided by 193694? 7 Calculate the remainder when 63355057 is divided by 31677527. 3 Calculate the remainder when 68028 is divided by 32582. 2864 What is the remainder when 3092539 is divided by 795? 784 What is the remainder when 4257818 is divided by 177407? 50 Calculate the remainder when 918304 is divided by 918283. 21 Calculate the remainder when 139830 is divided by 23299. 36 Calculate the remainder when 115465 is divided by 3822. 805 What is the remainder when 7958263 is divided by 159159? 313 What is the remainder when 11346218 is divided by 1009? 13 What is the remainder when 161901 is divided by 3929? 812 Calculate the remainder when 157854 is divided by 2846. 1324 Calculate the remainder when 1610831 is divided by 3356. 3307 What is the remainder when 12329678 is divided by 761? 717 What is the remainder when 2431237 is divided by 99? 94 What is the remainder when 1330321 is divided by 199? 6 Calculate the remainder when 9805908 is divided by 23743. 49 Calculate the remainder when 78231 is divided by 19516. 167 What is the remainder when 63432531 is divided by 21? 15 What is the remainder when 16935270 is divided by 27672? 6 What is the remainder when 8032468 is divided by 2008109? 32 What is the remainder when 49369 is divided by 1907? 1694 Calculate the remainder when 85630 is divided by 16472. 3270 Calculate the remainder when 74681132 is divided by 102. 98 Calculate the remainder when 2886982 is divided by 360839. 270 What is the remainder when 1608403 is divided by 402100? 3 Calculate the remainder when 234795771 is divided by 34. 33 Calculate the remainder when 458303008 is divided by 10. 8 Calculate the remainder when 157106 is divided by 144. 2 Calculate the remainder when 14659 is divided by 4639. 742 What is the remainder when 7534089 is divided by 912? 57 What is the remainder when 6582287 is divided by 101? 16 Calculate the remainder when 155663 is divided by 482. 459 Calculate the remainder when 641159 is divided by 71224. 143 What is the remainder when 383140 is divided by 108? 64 Calculate the remainder when 153199182 is divided by 12. 6 Calculate the remainder when 2878975 is divided by 65. 60 What is the remainder when 288184 is divided by 1072? 888 Calculate the remainder when 46977883 is divided by 23488939. 5 What is the remainder when 156152 is divided by 1514? 210 Calculate the remainder when 29076578 is divided by 724. 14 What is the remainder when 2210052 is divided by 535? 502 What is the remainder when 17236 is divided by 8001? 1234 Calculate the remainder when 16612046 is divided by 105. 101 Calculate the remainder when 164733036 is divided by 2971. 2970 Calculate the remainder when 105951 is divided by 52469. 1013 Calculate the remainder when 50145517 is divided by 29. 22 Calculate the remainder when 233400 is divided by 58275. 300 Calculate the remainder when 169506 is divided by 483. 456 Calculate the remainder when 13718239 is divided by 163. 159 Calculate the remainder when 445635 is divided by 334. 79 What is the remainder when 10054713 is divided by 493? 471 What is the remainder when 650893 is divided by 85? 48 What is the remainder when 993685 is divided by 173? 146 Calculate the remainder when 57399 is divided by 18805. 984 Calculate the remainder when 667391 is divided by 74072. 743 Calculate the remainder when 10073878 is divided by 359781. 10 Calculate the remainder when 839055 is divided by 279336. 1047 Calculate the remainder when 1770699 is divided by 85. 64 What is the remainder when 9652084 is divided by 1072453? 7 Calculate the remainder when 322483 is divided by 1671. 1651 What is the remainder when 45533385 is divided by 5059259? 54 Calculate the remainder when 780893 is divided by 165. 113 Calculate the remainder when 11812395 is divided by 2173. 2140 Calculate the remainder when 36973026 is divided by 974. 960 Calculate the remainder when 254109720 is divided by 25. 20 What is the remainder when 14293 is divided by 4126? 1915 Calculate the remainder when 1191685 is divided by 2301. 2068 What is the remainder when 43090746 is divided by 64? 58 What is the remainder when 196338 is divided by 5946? 120 Calculate the remainder when 194317 is divided by 5555. 5447 Calculate the remainder when 146827 is divided by 7727. 14 Calculate the remainder when 88541 is divided by 14671. 515 Calculate the remainder when 287799800 is divided by 38. 36 Calculate the remainder when 139536 is divided by 5165. 81 Calculate the remainder when 534012 is divided by 2949. 243 Calculate the remainder when 340407 is divided by 1319. 105 What is the remainder when 617756 is d	{ "pile_set_name": "DM Mathematics" }
0 and 20. 160 Find the common denominator of -27/2561 and 51/65. 12805 Calculate the smallest common multiple of 900 and 10. 900 Find the common denominator of -25/4 and 55/328. 328 Find the common denominator of -91/6 and 43/504. 504 Calculate the smallest common multiple of 66 and 36. 396 What is the lowest common multiple of 16 and 72? 144 What is the lowest common multiple of 80 and 144? 720 Calculate the smallest common multiple of 7753 and 4. 31012 Find the common denominator of 8/15 and -68/8223. 41115 Find the common denominator of 65/14 and 19/4270. 4270 What is the least common multiple of 102 and 272? 816 Calculate the common denominator of 59/130 and 58/65. 130 Find the common denominator of 50/869 and -89/948. 10428 Calculate the common denominator of 37/322 and -83/230. 1610 Calculate the least common multiple of 48 and 6. 48 What is the common denominator of -137/6 and -2/453? 906 Calculate the smallest common multiple of 784 and 6566. 52528 What is the common denominator of 61/270 and 91/360? 1080 Find the common denominator of -10/521 and 89/4. 2084 Calculate the lowest common multiple of 30 and 54. 270 What is the common denominator of -133/822 and 65/2? 822 Find the common denominator of 30/553 and 32. 553 Calculate the least common multiple of 24 and 336. 336 What is the common denominator of 97/242 and -34/7? 1694 What is the smallest common multiple of 144 and 1624? 29232 Calculate the smallest common multiple of 175 and 770. 3850 What is the lowest common multiple of 153 and 2108? 18972 Calculate the least common multiple of 855 and 180. 3420 Calculate the common denominator of 8/39 and 29/10. 390 What is the least common multiple of 4249 and 9? 38241 Calculate the common denominator of 99/8 and 121/18. 72 Calculate the common denominator of 55/2 and -32/57. 114 What is the smallest common multiple of 38 and 48? 912 Calculate the common denominator of 23/45 and -8/5. 45 Calculate the smallest common multiple of 152 and 54. 4104 Calculate the lowest common multiple of 180 and 50. 900 Calculate the least common multiple of 20 and 10726. 107260 What is the lowest common multiple of 912 and 912? 912 Calculate the common denominator of 47/475 and 107/250. 4750 Calculate the common denominator of -25/92 and 77/184. 184 Find the common denominator of 53/6 and -76/195. 390 What is the lowest common multiple of 109 and 2071? 2071 Find the common denominator of 11/1305 and -74/261. 1305 Calculate the common denominator of -11/670 and 87/20. 1340 Calculate the common denominator of -33/199 and -75/1592. 1592 Calculate the common denominator of 163/60 and 23/24. 120 Find the common denominator of -13/4 and -79/172. 172 Find the common denominator of -93/10 and -63/130. 130 What is the common denominator of 53/540 and -26/25? 2700 Calculate the least common multiple of 852 and 568. 1704 What is the least common multiple of 68 and 527? 2108 Calculate the least common multiple of 36 and 5. 180 Calculate the common denominator of -113/520 and 70/39. 1560 Find the common denominator of 23/33 and -55/108. 1188 Find the common denominator of 167/210 and -143/960. 6720 Calculate the common denominator of -117/10 and 71/1088. 5440 Calculate the common denominator of 83/2 and 29/234. 234 Calculate the common denominator of 5/4 and 6/1115. 4460 What is the lowest common multiple of 132 and 990? 1980 What is the smallest common multiple of 3700 and 12? 11100 What is the common denominator of 13/280 and -49/44? 3080 Calculate the common denominator of 41/20 and -41/40. 40 Calculate the common denominator of 55/1533 and 99/10. 15330 What is the least common multiple of 264 and 5148? 10296 Find the common denominator of -21/662 and 115/12. 3972 Calculate the common denominator of -46/105 and -19/165. 1155 Calculate the lowest common multiple of 60 and 24. 120 Calculate the lowest common multiple of 12 and 264. 264 Find the common denominator of 59/9 and -89/36. 36 Find the common denominator of 27/145 and 101/348. 1740 Find the common denominator of -163/1134 and 23/162. 1134 What is the common denominator of -101/2544 and 57/40? 12720 What is the lowest common multiple of 7776 and 864? 7776 What is the smallest common multiple of 28254 and 22? 310794 What is the common denominator of 107/48 and -35/22? 528 What is the lowest common multiple of 30 and 35? 210 What is the common denominator of -1/718 and -38/5? 3590 Calculate the least common multiple of 15 and 171. 855 What is the least common multiple of 33 and 7? 231 Calculate the smallest common multiple of 54154 and 12. 324924 Calculate the common denominator of -43/20 and -29/160. 160 Calculate the least common multiple of 4979 and 182. 69706 Calculate the least common multiple of 88 and 32. 352 Find the common denominator of 115/78 and -56/135. 3510 Calculate the common denominator of -31/200 and -16/125. 1000 Find the common denominator of -53/8 and -41/28. 56 Find the common denominator of -149/108 and 79/36. 108 Find the common denominator of -38/67 and 7/10. 670 Calculate the least common multiple of 256 and 22. 2816 Calculate the lowest common multiple of 68 and 424. 7208 Find the common denominator of 109/6 and 151/72. 72 Calculate the least common multiple of 10290 and 36. 61740 What is the lowest common multiple of 550 and 500? 5500 Calculate the least common multiple of 56 and 14. 56 Find the common denominator of 83/372 and 119/930. 1860 What is the smallest common multiple of 1701 and 378? 3402 What is the lowest common multiple of 5 and 425? 425 Find the common denominator of -3/56 and 53/224. 224 Find the common denominator of 20/63 and 127/364. 3276 Calculate the common denominator of 113/384 and -17/16. 384 What is the lowest common multiple of 9 and 3649? 32841 Find the common denominator of 13/290 and -49/4. 580 What is the common denominator of 83/452 and 15/44? 4972 What is the smallest common multiple of 8 and 552? 552 Find the common denominator of 37/130 and 67/35. 910 Calculate the smallest common multiple of 76 and 2. 76 What is the common denominator of -9/3334 and 45/8? 13336 What is the common denominator of -20/657 and -82/99? 7227 What is the common denominator of -7/348 and 59/54? 3132 What is the smallest common multiple of 128 and 224? 896 Find the common denominator of 149/132 and 67/132. 132 What is the smallest common multiple of 154 and 28? 308 What is the common denominator of 13/18 and 127/3072? 9216 Calculate the common denominator of 13/8 and -43/132. 264 Find the common denominator of 8/45 and 139/18. 90 What is the common denominator of 33 and -36/18895? 18895 Calculate the least common multiple of 30 and 1095. 2190 Calculate the common denominator of -5/98 and -83/616. 4312 Calculate the common denominator of 11/8 and -85/192. 192 What is the common denominator of 50/2463 and -13/10? 24630 What is the common denominator of -17/18 and -137/198? 198 What is the smallest common multiple of 63 and 243? 1701 Calculate the smallest common multiple of 154 and 350. 3850 What is the smallest common multiple of 42 and 20? 420 Calculate the least common multiple of 2 and 779. 1558 What is the least common multiple of 31 and 310? 310 What is the common denominator of -39/8 and -29/18? 72 Calculate the common denominator of 37/48 and 61/16. 48 What is the smallest common multiple of 12 and 104? 312 Calculate the smallest common multiple of 600 and 480. 2400 What is the least common multiple of 1 and 3? 3 Calculate the common denominator of -21/464 and 103/1856. 1856 What is the lowest common multiple of 40 and 309? 12360 Find the common denominator of 103/3520 and -69/352. 3520 Calculate the lowest common multiple of 965 and 30. 5790 Calculate the common denominator of -11/18 and 5/124. 1116 Calculate the lowest common multiple of 16 and 2128. 2128 Calculate the smallest common multiple of 343 and 294. 2058 Calculate the common denominator of -37/675 and -67/10. 1350 What is the common denominator of -1/7 and -89/686? 686 What is the smallest common multiple of 1240 and 160? 4960 What is the least common multiple of 393 and 879? 115149 Calculate the least common multiple of 568 and 1420. 2840 Calculate the lowest common multiple of 8 and 288. 288 What is th	{ "pile_set_name": "DM Mathematics" }
pu*2 wrt p. 65i*2u*2 - 2u*2 Find the third derivative of 208j*6n - 106j2n wrt j. 24960j3n What is the derivative of 2oz*2 + 3o + 872z2 - 673 wrt z? 4oz + 1744z What is the derivative of 9j3 - 82j*2 + 1906? 27j*2 - 164j Find the third derivative of -11j3o*3 + 14j*3o*2 + 2j*3 + 2jo2 - 10o*3 wrt o. -66j*3 - 60 Find the second derivative of -3g*2io2 - 2g*2io - 1846g*2i + 18gi*2o*2 + 2go2 + 2i*2 wrt o. -6g*2i + 36gi*2 + 4g Find the second derivative of f*2n*3q + 6f2nq + 4f*2q - 15fn*3q - 3n3q wrt n. 6f2nq - 90fnq - 18nq What is the second derivative of 1977b5 + 1608b wrt b? 39540b3 What is the second derivative of -32b*2g - b*2 + 153bg - 21g wrt b? -64g - 2 Differentiate 1693n*2 - 8151. 3386n Differentiate -15927s4 + 15011. -63708s*3 Find the second derivative of -18a*2o*2 - 74a*2o + 8ao*2 wrt o. -36a*2 + 16a Differentiate 10b3 + 6b*2w - 1714w with respect to b. 30b*2 + 12bw Differentiate -x4 - 2x*3 + 4x*2 - 8312. -4x*3 - 6x*2 + 8x What is the first derivative of 36d4o*2 + 7do2 + 822o*2 wrt d? 144d*3o*2 + 7o*2 What is the second derivative of -3d*3 - 174d*2 - 1770d wrt d? -18d - 348 Find the third derivative of 15o*6 + 43o*5 - 2o4 - o2 + o - 117. 1800o3 + 2580o*2 - 48o What is the second derivative of -40w4 - 26w + 5 wrt w? -480w2 Differentiate -5h*3x + h*3 - 8h*2x + 1977x with respect to h. -15h*2x + 3h2 - 16hx What is the second derivative of -97k4 + k2 + k + 11? -1164k2 + 2 Find the second derivative of 199o*2y*3 + 5o + 10y3 wrt o. 398y3 Find the second derivative of -g5 - 1042g4 - 717g wrt g. -20g3 - 12504g*2 What is the third derivative of -13342k*5 - 635k*2 - 2 wrt k? -800520k*2 What is the second derivative of -65i*3 + i + 19? -390i What is the second derivative of z*4 - 56z*3 - 4z*2 - 2z - 7407? 12z2 - 336z - 8 What is the second derivative of -225p3 - p - 24 wrt p? -1350p Find the first derivative of -6334i2 - 1217 wrt i. -12668i What is the third derivative of 23m4 + 172m*3 + 874m*2 - 3m + 1 wrt m? 552m + 1032 Differentiate 2311j - 798. 2311 Differentiate -ag2 - 11ag - 128a - g*2 wrt g. -2ag - 11a - 2g Find the second derivative of -3720b*4 - 6669b. -44640b2 Find the second derivative of 8t*3u*2 - 559t*3 - 38tu2 - 2tu - 14t - 4u2 wrt t. 48tu2 - 3354t What is the first derivative of 1991am*3 + 3855m*3 wrt a? 1991m*3 What is the third derivative of -8f*4l*2 + 4f*4 - 4f*2l + 45fl*2 wrt f? -192fl2 + 96f What is the first derivative of 260u4 + u3 + 1022? 1040u*3 + 3u*2 What is the third derivative of 2c*3o*2 + 28c3 - c2o2 - 236c*2o + 2 wrt c? 12o2 + 168 What is the third derivative of 2o*3y*3 + 6o*3y*2 - 3o*2y2 + y3 - 4y2 wrt o? 12y*3 + 36y*2 Find the second derivative of -3x*4 - 110x3 + x2 - 61x - 33. -36x*2 - 660x + 2 What is the second derivative of -21x4 + 7x*3 - 227x wrt x? -252x2 + 42x What is the second derivative of -20p2z*2 + 2p*2z + 10p2 + 84pz2 - p + 2z*2 + 1 wrt p? -40z*2 + 4z + 20 Find the third derivative of 31l3m3 + l3m - 42l*2m3 - l2m wrt l. 186m*3 + 6m Find the third derivative of 2868r5 + 850r*2 wrt r. 172080r*2 What is the derivative of -31cf3p*3 + 3cf3p*2 + 2f*3p*3 - 27f*3p - 3 wrt c? -31f3p*3 + 3f*3p2 Find the second derivative of k2s4 - 20k*2su + 40s*4u - 2 wrt s. 12k2s*2 + 480s*2u Find the first derivative of -165ir*2 - 1346i + r*2 wrt r. -330ir + 2r What is the third derivative of -4222t3 - 13t*2 - 13 wrt t? -25332 Find the second derivative of -21a*5f + 2a2f*3 - 2af3 - 4a - 6f3 wrt a. -420a*3f + 4f3 What is the derivative of -3316j*3 + 643 wrt j? -9948j*2 What is the derivative of -2h*3x - 15h3 - 2h*2x*3 + 124x*3 - 1 wrt h? -6h*2x - 45h2 - 4hx3 What is the third derivative of -42c*4z2 - c3z2 + c2z*2 - 24z*2 + 2z wrt c? -1008cz*2 - 6z*2 Differentiate -2r4 + r3 - 170r - 898 wrt r. -8r*3 + 3r*2 - 170 Differentiate -4l*2z3 + l2z - 8lz2 + 4z*3 + 19z wrt l. -8lz*3 + 2lz - 8z*2 Find the second derivative of -2317a*2 + a + 1956. -4634 Find the second derivative of 3a*2w*2 + 2a*2w - 2aow + 2ow2 - 39o - 2w2 wrt w. 6a*2 + 4o - 4 Find the third derivative of -16p3 - 93p*2 + 1. -96 Find the third derivative of -505m*3 + 3m*2 - 8m wrt m. -3030 What is the third derivative of -299v6 + 2v*2 + 22v? -35880v3 What is the second derivative of -2s*3 - 84s*2 + 13s - 6? -12s - 168 What is the second derivative of 3s*4u - s*3u + 146s3 + 119su + 9u - 3 wrt s? 36s2u - 6su + 876s What is the derivative of 3201g*3s + 335g3 - g2 wrt s? 3201g*3 Find the first derivative of 143j - 1033 wrt j. 143 Differentiate -111i2 - i - 193. -222i - 1 What is the third derivative of 1506i6 - 3i*3p*3 - 13i*2p*2 - 107i + p*3 + 2 wrt i? 180720i*3 - 18p*3 Find the third derivative of -9a*6x - 9a3x3 + a2x - 11ax2 + x3 wrt a. -1080a*3x - 54x3 Differentiate 2965x - 3532 wrt x. 2965 What is the third derivative of -k*6 + 10k*4z + k*3z - 11k2z - 3kz wrt k? -120k3 + 240kz + 6z What is the third derivative of -2o4 - 263o*3 - 904o*2? -48o - 1578 What is the third derivative of -19g4 - 12g*3 + 660g*2? -456g - 72 Find the second derivative of -96a2 - a + 300 wrt a. -192 Find the third derivative of -4245l*4 - 4959l*2. -101880l What is the third derivative of -9bk*3 + 4bk2 - 4k*3 + 475k wrt k? -54b - 24 What is the second derivative of 1876y*5 + 2y - 1674? 37520y3 Find the first derivative of 6k*2 + 3k + 33. 12k + 3 What is the first derivative of -398o*4 - 420? -1592o3 What is the derivative of -h2r4 - 172h*2r + 627h2 wrt r? -4h*2r*3 - 172h*2 What is the second derivative of 15c*3k + 2c3 - 2c*2 + 41ck - 26 wrt c? 90ck + 12c - 4 Find the second derivative of 7l3n + 4l3 - 2l*2n + 14ln - l + n wrt l. 42ln + 24l - 4n Find the second derivative of -372ac*2p*2 + 29acp*2w + 2ap*2 + 4c*2p*2w - c - 22p2w wrt c. -744ap*2 + 8p*2w Find the third derivative of -18394v3 - 4v*2 + 1709. -110364 Find the second derivative of -49o*2p5 + o2p4 + o2p - o*2 - 101 wrt p. -980o*2p*3 + 12o*2p*2 What is the first derivative of -4k*4 - 14kq + 277q - 2 wrt k? -16k3 - 14q Find the second derivative of 161l2o - 3l2 - 170lo - 6o wrt l. 322o - 6 What is the derivative of -529c - 476 wrt c? -529 Find the third derivative of -7t4 - 105t*3 + 5t*2 + 657. -168t - 630 Find the second derivative of -3b3 + b2 + 9b - 5. -18b + 2 Find the first derivative of 2b*4 + 96b*3 - 106 wrt b. 8b*3 + 288b*2 Find the third derivative of 464o*4q*2 - 18o*4q + 3o2q + 7682oq*2 wrt o. 11136oq2 - 432oq What is the first derivative of 7f*2s*2 - 3f*2v + 44fsv + s2v - 277s2 + v wrt f? 14fs2 - 6fv + 44sv What is the first derivative of 248n*3 + 48? 744n*2 What is the derivative of -294s*3 + 113? -882s2 Differentiate s3 - 88s2 + 86 with respect to s. 3s*2 - 176s Differentiate 19b3ci2 - 237b*3i*3 - 9b*3i + 37b2ci3 with respect to c. 19b*3i*2 + 37b*2i*3 Find the third derivative of 20g*3q*2 + 7g*3q - g*3 + 3g*2q + 9g2 - 5q*2 - q wrt g. 120q*2 + 42q - 6 Find the third derivative of -2f5 + 276f*4 + 154f*2 wrt f. -120f*2 + 6624f Find the third derivative of 1512o6 + 122o*2 - 4. 181440o*3 Find the third derivative of -8598k*3 - 2k*2 - 229k. -51588 What is the third derivative of -120x4 + 78x*2 - 1? -2880x Differentiate 2lq*4 - 21lq3 + lq*2 - 165l wrt q. 8lq*3 - 63lq2 + 2lq Find the second derivative of 72q*4 - 3q**3 - 41	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from {b: 5, h: 8}. 10/39 What is prob of sequence etaa when four letters picked without replacement from {e: 3, t: 5, a: 4}? 1/66 Two letters picked without replacement from ljccjjcclcclljlll. Give prob of sequence jj. 3/68 Two letters picked without replacement from rerru. Give prob of sequence eu. 1/20 Calculate prob of sequence vss when three letters picked without replacement from vssvxvvs. 1/14 Four letters picked without replacement from qytvvuquz. What is prob of sequence tvuv? 1/756 Calculate prob of sequence xc when two letters picked without replacement from xcxxxxxcxpxcpxx. 1/7 What is prob of sequence cp when two letters picked without replacement from {p: 2, c: 6}? 3/14 Four letters picked without replacement from uckkfkkukkcckuukkkru. Give prob of sequence ufuu. 1/1938 What is prob of sequence xsq when three letters picked without replacement from xqsququql? 1/126 Two letters picked without replacement from zzndznzzfnfzf. What is prob of sequence df? 1/52 Calculate prob of sequence fs when two letters picked without replacement from {r: 1, x: 1, p: 1, t: 1, f: 2, s: 1}. 1/21 What is prob of sequence qqa when three letters picked without replacement from qaaqq? 1/5 Calculate prob of sequence oo when two letters picked without replacement from {o: 3, i: 5, u: 4}. 1/22 Three letters picked without replacement from uoszuzuuuuuduuuuu. What is prob of sequence odu? 1/340 Calculate prob of sequence hhaa when four letters picked without replacement from ahahaahhhaaa. 7/99 Four letters picked without replacement from fbrffbbfrbbffbr. What is prob of sequence bfrr? 3/455 Calculate prob of sequence bf when two letters picked without replacement from ffbfffffffffffffff. 1/18 Four letters picked without replacement from unwwwunwnnnnnnun. What is prob of sequence unuu? 9/7280 What is prob of sequence ssym when four letters picked without replacement from pspppppspkyypmpps? 1/4760 What is prob of sequence aa when two letters picked without replacement from afaf? 1/6 Two letters picked without replacement from lxvxxxxxvlxix. Give prob of sequence xx. 14/39 Calculate prob of sequence jrt when three letters picked without replacement from ccrarrcjact. 1/330 What is prob of sequence cc when two letters picked without replacement from {g: 5, c: 11}? 11/24 Three letters picked without replacement from {t: 3, n: 5}. What is prob of sequence ttn? 5/56 Two letters picked without replacement from {p: 3, o: 7, x: 2}. Give prob of sequence pp. 1/22 Calculate prob of sequence ywf when three letters picked without replacement from ygdwfgd. 1/210 Calculate prob of sequence eegn when four letters picked without replacement from {e: 4, g: 10, n: 2, i: 1}. 1/238 Three letters picked without replacement from weunenesnnuv. What is prob of sequence suv? 1/660 Calculate prob of sequence obb when three letters picked without replacement from {i: 9, b: 3, x: 1, o: 5}. 5/816 Two letters picked without replacement from vfooftffooflfvtffff. What is prob of sequence tv? 2/171 Two letters picked without replacement from {b: 1, u: 1, g: 1, n: 1, t: 2, o: 1}. Give prob of sequence ob. 1/42 Calculate prob of sequence fcl when three letters picked without replacement from ffcfffczccfflcff. 3/224 Four letters picked without replacement from {q: 4, n: 4, f: 5, x: 2}. What is prob of sequence qqnn? 2/455 Calculate prob of sequence sz when two letters picked without replacement from zzszsez. 4/21 Four letters picked without replacement from {q: 2, a: 8}. What is prob of sequence aaqq? 1/45 Calculate prob of sequence rj when two letters picked without replacement from {f: 1, r: 6, q: 4, j: 2}. 1/13 Four letters picked without replacement from {c: 1, x: 1, l: 3, r: 6, o: 1, f: 5}. What is prob of sequence xoll? 1/9520 What is prob of sequence bt when two letters picked without replacement from tqqatqppqqbqamqqp? 1/136 Three letters picked without replacement from pappapa. Give prob of sequence aap. 4/35 Calculate prob of sequence pj when two letters picked without replacement from {p: 3, j: 1, y: 6, q: 2}. 1/44 Calculate prob of sequence fdf when three letters picked without replacement from dffdffdfddfddffffdd. 45/323 Calculate prob of sequence yg when two letters picked without replacement from {g: 1, d: 1, y: 9}. 9/110 Three letters picked without replacement from {i: 2, f: 2, p: 1, w: 1, s: 1, v: 1}. Give prob of sequence iiw. 1/168 Calculate prob of sequence qy when two letters picked without replacement from {q: 2, y: 2, d: 3, p: 3, e: 3}. 1/39 What is prob of sequence hqcc when four letters picked without replacement from hycqcttcccqqt? 1/286 What is prob of sequence ejjp when four letters picked without replacement from ipjpe? 0 Calculate prob of sequence svv when three letters picked without replacement from {s: 3, v: 12}. 66/455 What is prob of sequence yy when two letters picked without replacement from ssbbybbsbsbyssysbb? 1/51 What is prob of sequence ma when two letters picked without replacement from mmmmmmmmmmammmmmmmm? 1/19 Three letters picked without replacement from {p: 7, i: 6}. What is prob of sequence ppi? 21/143 Three letters picked without replacement from {p: 1, e: 7, l: 1}. Give prob of sequence eep. 1/12 Three letters picked without replacement from {q: 6}. Give prob of sequence qqq. 1 Two letters picked without replacement from {e: 2, g: 3, j: 7, k: 2, m: 3, z: 1}. What is prob of sequence gj? 7/102 Three letters picked without replacement from fhizoid. Give prob of sequence ihf. 1/105 Three letters picked without replacement from gql. Give prob of sequence glg. 0 Two letters picked without replacement from rvuvvuppprpvpwpp. What is prob of sequence rp? 7/120 What is prob of sequence ogo when three letters picked without replacement from {g: 9, o: 2}? 1/55 Three letters picked without replacement from {j: 13, u: 1, c: 1, g: 2}. What is prob of sequence gjg? 13/2040 Two letters picked without replacement from {i: 8, w: 2, r: 2}. Give prob of sequence ii. 14/33 Calculate prob of sequence xwwx when four letters picked without replacement from wlxwywxylw. 1/210 What is prob of sequence zzd when three letters picked without replacement from zddzzzzdzd? 1/6 Two letters picked without replacement from ggmggmggmm. What is prob of sequence mg? 4/15 Calculate prob of sequence vl when two letters picked without replacement from {v: 2, y: 4, l: 3, k: 1}. 1/15 Calculate prob of sequence prqp when four letters picked without replacement from immpprimqi. 1/2520 Two letters picked without replacement from {n: 3, t: 3, k: 5, c: 7, f: 2}. Give prob of sequence cc. 21/190 Two letters picked without replacement from ssssbsbsbsbbbssbsbb. What is prob of sequence ss? 5/19 Four letters picked without replacement from {y: 3, g: 1, e: 5, f: 11}. Give prob of sequence yeeg. 1/1938 Calculate prob of sequence zf when two letters picked without replacement from {f: 3, y: 2, t: 1, w: 3, r: 1, z: 7}. 21/272 Calculate prob of sequence hvh when three letters picked without replacement from {v: 1, t: 2, h: 4, z: 1, l: 1}. 1/42 Calculate prob of sequence ob when two letters picked without replacement from {d: 1, h: 2, o: 1, s: 1, y: 2, b: 1}. 1/56 Four letters picked without replacement from gnnn. Give prob of sequence nggn. 0 Calculate prob of sequence raar when four letters picked without replacement from aajaajjrjarajaa. 2/585 Two letters picked without replacement from {h: 1, o: 3, x: 4}. Give prob of sequence xx. 3/14 Four letters picked without replacement from {p: 14, w: 5}. Give prob of sequence pwwp. 455/11628 Calculate prob of sequence fnzz when four letters picked without replacement from {f: 1, n: 6, i: 2, z: 3}. 1/330 What is prob of sequence af when two letters picked without replacement from {d: 2, z: 1, f: 7, a: 3, e: 1}? 3/26 Calculate prob of sequence neg when three letters picked without replacement from egrhemrhn. 1/252 Calculate prob of sequence hmim when four letters picked without replacement from {z: 1, h: 8, m: 2, i: 7, s: 1}. 7/5814 Two letters picked without replacement from eejyyeyyjeejyjyyju. Give prob of sequence yy. 7/51 Four letters picked without replacement from {n: 5, z: 15}. Give prob of sequence nnzz. 35/969 What is pro	{ "pile_set_name": "DM Mathematics" }
). What is c rounded to the nearest 100000? 10000000 Let d = 2177 - 1403. Let q = 773.999998526 - d. What is q rounded to 7 dps? -0.0000015 Let c = 133 + -128. Suppose cx - 22173 = -y - 121358, -5y - 5x - 495985 = 0. What is y rounded to the nearest 10000? -100000 Let d = 105 + -107.8. Let b = 2.13 + d. Let q = -0.6769 - b. Round q to 3 decimal places. -0.007 Let u = -112296575522.000000526 + 112296575797. Let n = -275 + u. Round n to 7 dps. -0.0000005 Let w = 2.304 + -2.61. Let x = 1.954 - w. What is x rounded to the nearest integer? 2 Let n(h) = -h3 - 12h*2 - 28h - 10. Let f = 129 + -140. Let g be n(f). Let a be ((-4060)/(-12) + -5)g. Round a to the nearest 10000. 60000 Let c = 21581 + -21580.999993769. Round c to 7 decimal places. 0.0000062 Let q = 74 - 89. Let y = 38099780.9999995 + -38099796. Let n = q - y. Round n to seven decimal places. 0.0000005 Suppose 0 = -5d - 15, -3h + 2d - 42 = -h. Let t be (-5)/60 + (-2608802)/h. What is t rounded to the nearest one thousand? 109000 Suppose 4d - 77850051 - 532269949 = 0. Round d to the nearest one million. 153000000 Let g be ((-6222)/(-255))/(3/(-3015) - 0/2). Round g to the nearest 10000. -20000 Let t(c) = 291c*2 - 4c - 97. Let a(p) = -583p2 + 5p + 195. Let n(u) = -3a(u) - 5t(u). Let o be n(-10). What is o rounded to the nearest one thousand? 29000 Let j = 178.853404 + -178.87. What is j rounded to 4 dps? -0.0166 Let v = 8168 - 8168.00000055204. What is v rounded to seven dps? -0.0000006 Suppose -3i = -s - 0s + 259366, 345824 = -4i + 4s. Let v = i + 139708. Let l = v + -16253. Round l to the nearest 10000. 40000 Let z = 4 + 329. Suppose -z + 43 = -5t. Let l = 4 + t. What is l rounded to the nearest 10? 60 Let t = 0.78558 + 0.05944. What is t rounded to one decimal place? 0.8 Let z = 22854729 + -22855712.7797. Let c = 984 + z. What is c rounded to 2 decimal places? 0.22 Let q = -1849238.00595 + 1849338. Let y = -100 + q. What is y rounded to three decimal places? -0.006 Let l = 120.66764 - 121.05. Let k = l + 0.66415. Let x = k + -0.28. What is x rounded to 4 dps? 0.0018 Let j = 0.05191 + 446.64809. What is j rounded to the nearest ten? 450 Let z = 221 - 582. Let u = z - -137. Let m = u + 223.99999484. Round m to 6 dps. -0.000005 Let s be (3 + (2000 - 3))(15 + -6806). What is s rounded to the nearest one hundred thousand? -13600000 Let h = -25937.4 - -26018.4126. Let g = 78.88 + 2.12. Let t = h - g. Round t to three dps. 0.013 Suppose -b + 3 = -0. Let y be 0/(1/(-1(3 - 4))). Suppose c - 102999997 = -2m, -bc = -ym - 2m + 103000009. Round m to the nearest one million. 52000000 Let i = -14035.9925832 + 14036. Round i to four decimal places. 0.0074 Let y = -514 + 1198. Suppose o = -4w - y, 706 = -2o + 2w - 682. What is o rounded to the nearest one hundred? -700 Let p = -8381.0001724 - -8381. Round p to five dps. -0.00017 Let n(f) = 110340f2 - 20f + 124. Let u be n(11). Let q = 6915044 - u. Round q to the nearest one hundred thousand. -6400000 Let b = 31 + 128. Let u = -159.0000032 + b. What is u rounded to six decimal places? -0.000003 Let p = 40871 - 40836.706. What is p rounded to the nearest integer? 34 Let c = -27 - -31. Suppose 2x = 2k - 3k, 0 = 4x + ck. Let l be (3 + x)820000/12. What is l rounded to the nearest 10000? 210000 Let n = -19.01 - -20.4711. Round n to 1 dp. 1.5 Let z = -265 - -290. Let g = z + 46.1. Round g to the nearest integer. 71 Let r = 1282785 - -182215. Round r to the nearest one million. 1000000 Let m = -2.038 - -2.2731. Let c = -0.235097361 + m. What is c rounded to 7 dps? 0.0000026 Let j be 15720942544/(-9420) - 2/15. What is j rounded to the nearest ten thousand? -1670000 Let h = -29 + 47. Let i be (2 - 2/(-2)) + 21. Suppose 20m - i = hm. What is m rounded to the nearest 10? 10 Let b = 638 - 268. Let z = -312.6 + b. What is z rounded to the nearest ten? 60 Suppose 5w + 4907 = 2a, a = -12w + 17w + 2451. Round a to the nearest one thousand. 2000 Let h = 138991.1 + -152423. Round h to the nearest 1000. -13000 Let o = 273 + -272.9422. Let t = o - 0.0580695. What is t rounded to four dps? -0.0003 Let f = -4898592.474999715 - -4898552.475. Let b = f - -40. What is b rounded to seven dps? 0.0000003 Let x = 227.859 + -228. Let o = x - -2.641. What is o rounded to 1 decimal place? 2.5 Let f = 0.116 - -70.884. Let l = f + -70.99996. What is l rounded to four decimal places? 0 Let n = -379 + 226. Let r = n + 238. Let t = 84.53 - r. What is t rounded to 1 dp? -0.5 Let i = -0.14443 - -0.144442988. Round i to six decimal places. 0.000013 Let m = -0.51 - 0.02. Let x = 29271472 - 29271472.529999844. Let s = m - x. Round s to 7 decimal places. -0.0000002 Let m = -19.345 - -19.329151. Let k = m - -0.0153. What is k rounded to five decimal places? -0.00055 Suppose -11d + 19d = 425280. What is d rounded to the nearest 10000? 50000 Let o(k) be the first derivative of -287/3k3 + 4k + 27/2k2 - 18. Let v be o(12). Round v to the nearest ten thousand. -40000 Suppose 182l + 29145 = -3q + 178l, l = q + 9701. What is q rounded to the nearest 10000? -10000 Let g = 2010.089 - 1990. What is g rounded to one decimal place? 20.1 Let d = 2506.9991354 + -2507. Round d to five dps. -0.00086 Let s = 1.326238 + -88.325774. Let j = 87 + s. Round j to four decimal places. 0.0005 Let y = -40381754 - -40019664.66. Let h = y + 362120.339977. Let q = 31 - h. What is q rounded to five decimal places? 0.00002 Let n = 0.01 + 184.99. Let r = n - 185.00229. Round r to 4 decimal places. -0.0023 Let r = 4365.50045814 + -4365.5. What is r rounded to four decimal places? 0.0005 Suppose 3y + 5q = -9, -3y + 5q + 18 = q. Suppose i = -yl - 56278, -3l + i - 44476 = 39946. Round l to the nearest one thousand. -28000 Let q = -11967.00046934 - -11967. What is q rounded to five dps? -0.00047 Let p(s) = 321999995s + 9. Let k be p(1). Suppose 0w - 4o + 321999984 = 5w, 0 = 5w - o - k. Round w to the nearest 1000000. 64000000 Let v = -1.997 - 223.823. Round v to the nearest ten. -230 Let s = -107 + 116. Let f be ((-21363)/s)/((-9)/216). Let p = 35968 - f. Round p to the nearest 10000. -20000 Let j = 0.44 - 122.24. Let v = j + 109. Let z = v - -12.8000024. What is z rounded to 6 decimal places? 0.000002 Let l = -55.179795148 - -55.18. Round l to 5 decimal places. 0.0002 Let d = -49573 - -161203. Let p = 1072370 + d. What is p rounded to the nearest 100000? 1200000 Let l be ((-23)/(-23))/((-1)/4) - -14067022. Suppose -q = -f - 3110001, -4f - l = -2q - 1627016. Round f to the nearest one million. -3000000 Let u = 157 + -352. Let r be 1499550312/u - 8/(-5). What is r rounded to the nearest one million? -8000000 Let g = -151572 - -91676. Let f = -40396 - g. What is f rounded to the nearest 1000? 20000 Let f = -0.000411 - -0.859101. Let i = 2.185 - 3.045. Let r = f + i. What is r rounded to four dps? -0.0013 Let m = 10.3 - 11.5095. Let j = 1.885 + m. What is j rounded to 1 dp? 0.7 Let b = -6409 + 5893.3. What is b rounded to the nearest 10? -520 Let z = -156 - -243. Let o = z + -155. Let r = o - -68.00003. Round r to 3 dps. 0 Let u = 39357 - 107375. What is u rounded to the nearest 1000? -68000 Let d = 0.7762 - 0.346308. Let n = d + -0.43. Round n to five dps. -0.00011 Let o = -182.0184026 + 182.02. Round o to four dps. 0.0016 Let m = 114 + -115. Let w be ((-10075584)/(-15) - (-9)/(-15))m. Let h = -12771705 - w. Round h to the nearest 1000000. -12000000 Let o(p) = -p*3 - 4. Let b be o(5). Let l = b - -573. Let g be 62520/15l. Round g to the nearest 100000. 400000 Let o = 34.7 + -34.779. Let r = -7058 + 7043.579. Let g = o + r. What is g rounded to zero dps? -15 Let x = -2875.5 + 3196.4. Round x to the nearest one hundred. 300 Let n(a) = a3 - a2 - a + 3241. Let g be n(0). Let p = 356 + -4897. Let v = p + g. Round v to the nearest 100. -1300 Let k = -268 + 269.96. Let w = -119 - -119.57. Let m = w - k. What is m rounded to one decimal place? -1.4 Let a = 28925.3821 + -28929. What is a rounded to one dp? -3.6 Let x = -7223 + 7224.5605. What is x rounded to 2 decimal places? 1.56 Let k = -0.079 - -0.158. Let c = 7.079 - k. Let v = -7.00018 + c. Round v to 4 decimal places. -0.0002 Let s be ((-6)/(-8) - -1)-36. Let p = 406 + -306. Let x = p + s. What is x r	{ "pile_set_name": "DM Mathematics" }
pose -14p = -17p + c. Suppose -r - p = -32. What is the units digit of r? 3 Let i be -1(-31 - -1)-4. What is the units digit of i/(-150)4670/4? 4 Suppose 8a + 48 = 16a. What is the hundreds digit of 4070/(-15)2a/(-8)? 4 Suppose -4g - g - 80 = 0. Let z(x) = 4x2 + 41x + 19. What is the tens digit of z(g)? 8 Suppose -50000 = -44m + 43m + 2w, 4m - 200060 = -2w. What is the units digit of m? 2 Suppose -261m + 258m - y + 91693 = 0, 0 = -2m - 2y + 61126. What is the tens digit of m? 6 Let j(x) = 12x*3 + 13x*2 - 71x + 359. What is the units digit of j(11)? 3 Suppose 0 = -3a - 10a + 78. Let m(c) = a + 76c - 6 - 1 - 3. What is the units digit of m(2)? 8 Let n(f) = -2f + 36. Let r be n(12). Suppose -6 = 3d - r. Suppose -dy = 2k + 2k - 60, 0 = -k + 5. What is the tens digit of y? 2 Let k = 123 - 90. Suppose 3i - 36 = -k. What is the units digit of i + 0 - 4 - 59/(-1)? 6 Suppose -2r - r - 16 = -j, 2j + 2r = 32. Let p = j - 23. What is the units digit of p14/(-14)? 2 Let s = -47 - -43. Let p be (900/16 - 0) + (-3)/s. Suppose 1245 = 11u + p. What is the units digit of u? 8 Let d = 13305 - 2801. What is the ten thousands digit of d? 1 What is the thousands digit of ((-6404)/(-18))/((-116)/(-3741)) + (-2)/(-12)? 1 Let s(f) = 53f - 249. Let d(k) = 54k - 248. Let t(r) = 6d(r) - 5s(r). What is the tens digit of t(16)? 0 Let v = 60 + -55. Suppose -2l = 5i - 24, 4l - vi + 12 = -0l. Suppose lm - 3y = 225, 5m + 3y - 554 = 2y. What is the units digit of m? 1 Let g(y) = -236y + 186. Let m be g(-21). Let b = -3516 + m. What is the units digit of b? 6 Let w(s) = 16s2 - 176s - 528. What is the units digit of w(-36)? 4 Suppose 2z = 0, 3z + 0z = -y + 512. Let a = y - 252. What is the hundreds digit of a? 2 Suppose -5b - 5z + 2498 = -6z, 2b - 1001 = z. What is the units digit of b? 9 Let f = -1899 + 8702. Suppose -13o + 2583 = -f. What is the tens digit of o? 2 Suppose 0 = -76f + 1334116 + 876192. What is the tens digit of f? 8 Suppose 3u = 6u, -5u = -5s + 1165. Suppose -7n - 9 = -s. What is the hundreds digit of ((-8)/n3)/((-2)/600)? 2 What is the tens digit of 6208/(-4 + 0)(-1 + 4/(-2))? 5 Suppose 0 = -2m - 2j + 6, -m - 2j - 1 = -3. Let n be 2 + (m - 3) + 10. Let x(v) = v2 - 7v + 8. What is the tens digit of x(n)? 8 Let z = 18750 + 1439. What is the thousands digit of z? 0 Let k(y) = 184y2 - 161y + 124. What is the ten thousands digit of k(-10)? 2 Suppose 9q = 8q + 6769. What is the units digit of q? 9 What is the thousands digit of (-3 + 1 - -4718) + (-29 - -14 - -15)? 4 Suppose -16a = -24a - 24. What is the units digit of ((-1)/a145)/((-81)/(-972))? 0 Let s(j) = -1010j + 3318. What is the units digit of s(-12)? 8 What is the ten thousands digit of -10(96/(-672) - (-44218)/(-7))? 6 What is the units digit of 874 - (-91)/(27 + -14)? 1 Let l be 3 - (8/(-32) + 1006/(-8)). Suppose 32 = -q + c, -2q - 2q + 5c = l. Let s = q + 33. What is the units digit of s? 2 Let p(l) = -615l + 2907. What is the ten thousands digit of p(-44)? 2 Let q(n) = 2n*2 + 5n - 41. Let d be (-21 - 2/1)/((-4)/24). Let s be ((-1)/3-7)/(46/d). What is the tens digit of q(s)? 9 Suppose -q + 4m + 121791 + 199833 = 0, 0 = 5m - 20. What is the units digit of q/602 + ((-4)/14 - 0)? 4 Let o(l) = -5l*2 + 578l + 553. What is the hundreds digit of o(104)? 5 Suppose -12d + 8892071 = 191d - 4317748. What is the hundreds digit of d? 0 Let t = 31 - 11. Let o be (-9)/((-45)/t) + -43. Let r = -20 - o. What is the tens digit of r? 1 Let n(s) = 4s - 36. Let i(o) = -o + 10. Let k be i(-2). Let v be n(k). Suppose -va + 436 = -8a. What is the units digit of a? 9 Let g(m) be the first derivative of -m4/4 + 2m3/3 - m2/2 - 19m + 2. Let p be g(0). Let u = p - -99. What is the units digit of u? 0 Suppose -41p + 9p + 701408 = 0. What is the units digit of p? 9 Suppose 353 = 4f + 3h, -3h + 713 = 5f + 271. Let g = f - 77. What is the units digit of g/1632/6 - -12? 6 Suppose -903 = -3w - 3v + v, -5w + 1505 = v. Suppose wr + 887 = 302r. What is the hundreds digit of r? 8 Suppose i + 6v - 1052 = 0, 0i + v = 5i - 5291. What is the thousands digit of i? 1 Let x(t) = -t - 75. Let h be x(-37). What is the units digit of 95/h14/(-5)? 7 Suppose 1532180 = 76o + 278948 - 447496. What is the hundreds digit of o? 3 Let p(a) = -a*3 - 7a*2 - a - 4. Let f be p(-7). Suppose -2g = fg - 50. Suppose -5b + 105 - g = 0. What is the tens digit of b? 1 Suppose -297p = -301p + 8. Suppose 0 = -pc - 138 + 248. What is the tens digit of c? 5 Suppose 2f - 10 = 2. Let k be (-4)/f + 64/24. Suppose b - kb + 83 = 0. What is the units digit of b? 3 Let r(d) = 2085d - 114. What is the thousands digit of r(8)? 6 Suppose -782098 - 925710 = -30g - 407998. What is the thousands digit of g? 3 Let q = 39822 - 26764. What is the hundreds digit of q? 0 Let i(w) be the second derivative of -347w5/20 + w3/6 - 20w. What is the units digit of i(-1)? 6 Suppose -3 = u - 1. What is the units digit of -2965(u + 54/30)? 3 Let x(n) = -2n2 - 5n + 19. Suppose 0 = -9k - k - 70. Let h be x(k). Let b = h + 80. What is the units digit of b? 6 Let i(k) = 11k*2 - 1 + 3 - 2k - 9 + k*3 + 1. What is the tens digit of i(-8)? 0 Let o be (-12)/(-5 - -1)(1133 + -2). Suppose -o + 486 = -3a. What is the hundreds digit of a? 9 Suppose -3g - 3p = 579, -797 + 7 = 4g - 5p. Let h be (-2 + 186/(-9))g/10. Let u = h - 316. What is the hundreds digit of u? 1 Suppose -590q + 618 = -593q. What is the tens digit of (1 + (-2882)/(-12))/(q/(-1236))? 4 Let h(i) = -1 + 43i2 - 21i - 31i + 53i. What is the tens digit of h(2)? 7 Suppose 0 = -43q + 95 - 9. Let p(x) = 23x*2 - 10x + 11. What is the units digit of p(q)? 3 What is the thousands digit of ((-21)/((-525)/5890))/(1/45)? 0 Let g(t) = 193t3 + 2t*2 - 2t + 1. Let a be g(1). Suppose k = -4f + a, k - 124 = f + 85. What is the tens digit of k? 0 Let v(x) = 35 - x + 65x*3 - 66x*3 - x - 16x*2 - 6x. What is the hundreds digit of v(-16)? 1 What is the units digit of (6 - 9)10/(-6)(-8862)/(-15)? 4 Let w(v) = 26v - 16v - 7v3 - 4 - 4v*2 - 18v - 62v3 - 3. What is the tens digit of w(-2)? 4 Let p be 0 - 0(-6)/(48/4). Suppose m - 667 - 352 = p. What is the thousands digit of m? 1 Let l = -171 + 176. Suppose -lv - 4r = -1742, -4v = 4r - 2r - 1396. What is the tens digit of v? 5 Let r be (2 + 1)/(-9)-253. Let a be 2/(2(-1)/(-4)). What is the units digit of (r + -29)/((-1)/a1)? 6 Suppose 72d - 1448960 = 1443496. What is the ten thousands digit of d? 4 Suppose 0w + 1 = w. Let h(t) = -t + 139t + 32 - 28. What is the hundreds digit of h(w)? 1 Suppose -313 = 7i - 4898. Suppose 4y = -4l - 141 + 641, 5y - i = 5l. Suppose -4r - f = -y - 243, 182 = 2r + 4f. What is the tens digit of r? 9 Suppose 0 = -4w - 5u + 2336, -5w + 3u - 3 = -2886. Let d = 797 - w. What is the units digit of d? 8 Let y(p) = -4036p - 31. Let d be y(-1). Let v = -2830 + d. What is the thousands digit of v? 1 Let f(y) = y3 + 8y*2 + 8y + 8. Let c = -44 + 38. Let z be f(c). Let m = -30 + z. What is the units digit of m? 2 What is the tens digit of ((-5)/20 - 68487/(-12)) + 2? 0 Let l(i) = -20i - 17. Let y be (-6(-6)/(-9))/(0 - 2). Suppose -3m = -4d - 36, -4m + 36 - 8 = -yd. What is the tens digit of l(d)? 0 Let g = -18 - -21. Suppose gi + 9 = 5x + 5i, -x - 2i = 3. Suppose 0 = -xh + 11h - 632. What is the tens digit of h? 7 Let i(z) = 45z + 387. What is the tens digit of i(11)? 8 Let r(w) = 49w*2 - 7w + 35. Let a be r(5). Suppose a = 2i - p, -7i + 2449 = -3i - 3p. What is the units digit of i? 3 Suppose 4r = 4j + 98598 - 39630, 4r + 2j - 58992 = 0. What is the tens digit of r? 4 Let u be 6/(1 + 4/8). Suppose y - 17 = 4i - uy, y - 7 = -i. Suppose ig - 390 = -76. What is the units digit of g? 7 What is the units digit of (11217/(-5))/(13 - 1596/120)? 8 Suppose -3g + 3v - 6 = 4v, 4 = -g - v. What is the hundreds digit of (-732 + (-2)/1)g? 7 Let v = 264 + -261. Suppose -3a = vu - 1152, u - 1512 = -4a + 5u. What is the hundreds digit of a? 3 Let y = 22241 + 42133. What is the units digit of y? 4 Let o(r) = -r2 + 16r - 26. Let c be o(3). Suppose -2	{ "pile_set_name": "DM Mathematics" }
o(i) wrt i? 58 Let d(g) be the second derivative of 0g2 - 3g + 0 + 0g3 + 0g*5 - 1/4g*4 + 1/10g*6. What is the third derivative of d(v) wrt v? 72v Let x(k) be the second derivative of 2k + 0k*3 + 0k*5 - 1/10k*6 - 1/6k*4 + 0k*2 + 0. What is the third derivative of x(f) wrt f? -72f Let z(u) be the second derivative of 7/6u3 + 0 + 8u - u2. What is the first derivative of z(t) wrt t? 7 Suppose -1 = -q + 2. Suppose r - 10 = -5. Find the third derivative of n2 + rn3 + 0n*3 - qn3 wrt n. 12 Let b(m) be the first derivative of m8/560 - 5m4/24 - m3/3 + 1. Let w(d) be the third derivative of b(d). What is the first derivative of w(x) wrt x? 12x3 Let a(o) be the first derivative of -o8/1680 + o*5/60 + 5o*3/3 + 6. Let f(r) be the third derivative of a(r). Find the second derivative of f(x) wrt x. -12x*2 Suppose -2j = -6 - 2. What is the third derivative of 101p3 - 101p*3 - 7p*2 + 9p*j wrt p? 216p Let v(f) = -21f5 + 7f*4 + 9f*2 - 6f + 6. Let x(w) = -w*4 + w - 1. Let m(u) = -v(u) - 6x(u). What is the third derivative of m(p) wrt p? 1260p2 - 24p Let x(i) = i*3 - 8i*2 + i - 8. Let o be x(8). What is the derivative of 1 - 12p*3 + 11p*3 + o wrt p? -3p*2 Let m(h) = -h + 8. Let z be m(5). Let t be -2z/(-2) - -2. Find the second derivative of 0i5 + 0i*t - 4i - i*5 wrt i. -20i3 Let z = 2 + 1. Find the first derivative of -1 - n2 - z + 2 wrt n. -2n Let s(h) be the second derivative of 0 - 1/6h*4 + 2h + 0h2 + 2/3h*3. What is the second derivative of s(b) wrt b? -4 Find the second derivative of -16b - 33b2 - 14b*2 - 4b*2 wrt b. -102 What is the second derivative of -2a + 4 - 44a5 - 2812a*3 + 2812a*3 wrt a? -880a*3 What is the third derivative of 5h*2 - 9h4 + h4 - h*2 + 5h*2 wrt h? -192h Let j = -54 - -164/3. Let w(f) be the first derivative of 1/2f4 + 0f + 0f2 - 3 + jf*3. Find the third derivative of w(n) wrt n. 12 Suppose 0 = -3f + 3. Let b be f + 3 - (3 + -2). Find the first derivative of -1 - x + x + 2xb wrt x. 6x2 Let j(q) = q3 - 5q2 + q - 3. Let v be j(5). What is the third derivative of -2y*2 + 0y + 0y + 5y*v + 2y*4 wrt y? 48y Find the second derivative of 16w2 - 3w*2 - 12w + 5w + 15w wrt w. 26 Suppose -b = -x - 7, -2b + 3x = 6x + 6. Suppose 5l - 3 = -5k + 17, -4k = 3l - 13. What is the third derivative of lu2 - u4 - 4u2 + bu*4 wrt u? 48u Let n(p) be the third derivative of -11p8/336 - p5/30 + 3p*2. Find the third derivative of n(y) wrt y. -660y*2 Suppose -f + 2 = 3, 4x = -3f + 9. Suppose -q - 1 = -t - 3, -xq = -12. What is the second derivative of to4 - o4 - 3o*4 + o wrt o? -24o*2 Suppose -5b = -3y + 32, 0 = 5y + 5b - 0b. Suppose -y + 0 = -2v. Differentiate fv + 1 + 0 - f3 - f2 wrt f. -3f2 Let d(g) be the second derivative of -g10/15120 - g6/144 + g4/3 - 3g. Let f(l) be the third derivative of d(l). Find the second derivative of f(i) wrt i. -40i*3 Let u(j) = -3j + 1. Let f be (4/(-6))/((-2)/(-3)). Let o be u(f). Find the first derivative of 2n + 0n + 2 - on wrt n. -2 Let g(s) = s3 - 2s + 1 - 2s2 + s - s. Let a be g(3). Find the first derivative of 5r + 2 - ar - 2r wrt r. -1 What is the second derivative of 29 + 9d2 + 9d - 29 wrt d? 18 Let r(j) = 6j - 2. Let w(i) = -i + 1. Let z(d) = -2d + 2. Let q(h) = 7w(h) - 4z(h). Let k(x) = 5q(x) - r(x). Differentiate k(b) wrt b. -1 Let p(g) be the first derivative of 2g*5/5 + 2g*3/3 + 2. Find the third derivative of p(y) wrt y. 48y Let p = 5261/20 - 263. Let h(z) be the second derivative of 1/4z4 + 0z*3 + 0 + pz*5 + z + 0z2. What is the third derivative of h(a) wrt a? 6 Let v(x) be the first derivative of x5/120 - 5x4/24 + 8x*3/3 - 3. Let o(u) be the third derivative of v(u). Find the first derivative of o(r) wrt r. 1 Let q(l) = -2l*4 + 5l - 3. Let c(r) be the first derivative of -1 - 1/2r2 + r. Let u(i) = -5c(i) - q(i). Find the first derivative of u(a) wrt a. 8a3 Let v(x) be the third derivative of x5/5 - x4/8 + 28x*3/3 + 15x*2 + 3x. What is the derivative of v(t) wrt t? 24t - 3 Let j(q) be the second derivative of -q9/7560 + q7/840 + q4/6 + 2q. Let t(o) be the third derivative of j(o). Find the third derivative of t(i) wrt i. -48i Suppose j - 5j - d - 1 = 0, 0 = d + 5. Let v = j + 1. Find the second derivative of 0l3 - vl*3 + 2l + 4l3 wrt l. 12l Let j(s) be the first derivative of s*6/3 + 2s*2 - 8. What is the second derivative of j(u) wrt u? 40u*3 Let o(b) be the third derivative of 4b*2 + 0b - 1/3b3 - 1/8b*4 + 0. Differentiate o(a) with respect to a. -3 Let s(x) = -4x + 15. Let g(c) = -12c + 45. Let j(p) = 6g(p) - 17s(p). What is the derivative of j(r) wrt r? -4 Let o(q) be the second derivative of 0q*4 + 0q*5 + 0q*3 + 0 - 1/10q*6 - 1/2q*2 - 2q. What is the first derivative of o(c) wrt c? -12c3 Suppose -9 = -b - 8. Differentiate 0a*2 - 1 - b - 6a*2 - 3 with respect to a. -12a Let f(g) be the first derivative of g*4/4 + 2g - 10. Differentiate f(d) with respect to d. 3d2 What is the third derivative of y2 - 10y*2 - 4y*2 + 9y*3 wrt y? 54 Let v(y) = -11y*4 + 5y*2 - 5y - 30. Let b(p) = p4 - p2 + p + 1. Let g(h) = -5b(h) - v(h). Differentiate g(d) wrt d. 24d3 Let v(j) = -j2 - 7j - 8. Let g(a) = -a - 1. Let z(u) = 14g(u) - 2v(u). Differentiate z(d) with respect to d. 4d Let z be ((-1)/2)/((-2)/12). What is the third derivative of -6sz + 2s*2 - 6s*3 + 9s*3 wrt s? -18 Find the third derivative of -7t*2 + 7t6 + t2 + 9t2 + 9t*2 wrt t. 840t*3 What is the third derivative of 2n*5 + 5n*2 + 8n*5 - 11n*2 - 6n*2 wrt n? 600n2 Let m(u) be the first derivative of -u5/20 + u*4/24 + 3u2/2 - 2. Let r(s) be the second derivative of m(s). What is the second derivative of r(p) wrt p? -6 Let o(t) = t4 + t3 - t2 - 1. Let k(c) = -2c5 + c4 + c3 - c2 - 24c - 1. Let p(v) = 2k(v) - 2o(v). Find the second derivative of p(i) wrt i. -80i3 Let x(k) = -k2 + 5k + 3. Let j be x(5). Find the third derivative of 5z2 - zj - 12z + 12z wrt z. -6 Suppose 0g - 4o = g - 22, 4g - o = 3. Let j = 7 + -5. Find the second derivative of -ju - gu*3 - u + 5u wrt u. -12u Let c be (-1)/(-14/12). Differentiate -6oc + 6o*3 - 5 - 4o*3 with respect to o. -12o*2 Let v(f) be the third derivative of 0f*4 + 0 + 0f + 0f5 + 5/6f*3 - 1/24f*6 + 4f*2. Differentiate v(d) wrt d. -15d2 Let g(q) be the third derivative of q8/168 + 2q7/35 - 2q5/15 - q4/12 + 29q2. Find the third derivative of g(c) wrt c. 120c*2 + 288c Let s(d) = -4d4 - 2d3 + d2 - 2d + 2. Let v(c) = 5c*4 + 3c3 - c2 + 3c - 3. Let m(o) = 3s(o) + 2v(o). Find the third derivative of m(a) wrt a. -48a What is the third derivative of 5o2 - 2o5 + o5 - 9o5 wrt o? -600o2 Let p(z) = z5 + z4 - z2 - z. Let j(f) = 11f5 + 3f*4 - 3f*2 - 10f. Let c(n) = -j(n) + 3p(n). What is the second derivative of c(l) wrt l? -160l*3 Let l(p) be the third derivative of 2p*7/35 + 5p*4/24 + 26p*2. Find the second derivative of l(k) wrt k. 144k*2 Let t be 8/5 + (-2)/(-5). Suppose 3k - t = 4. What is the second derivative of 3 - 3 + g*2 + kg wrt g? 2 Suppose -3d + 25 = 2d - 4u, -3u + 5 = d. Suppose -dt + 9t - 4 = 0. Differentiate -5 + 5 - t - v with respect to v. -1 Differentiate 15 - 12 + 8r + 60 wrt r. 8 Let k(a) = 2 - 7 + 3 + 3. Let p = 7 - 3. Let l(u) = 2u - 2. Let g(r) = pk(r) + l(r). Find the first derivative of g(x) wrt x. 2 Let j(s) = s2 - 8s + 10. Let u = -9 + 16. Let m be j(u). Differentiate -3x3 - 1 + 3xm + 2 - x4 wrt x. -4x3 Let s(f) be the third derivative of f5/15 - 5f*4/24 + 3f*2. What is the second derivative of s(o) wrt o? 8 Suppose 1 + 3 = s. What is the third derivative of -5r + 2r2 - r + 6r - r*s wrt r? -24r Suppose 6 = 2c, 3r + 0r - 21 = -5c. Suppose -3 - 7 = -rs. Find the second derivative of -7y*5 - 2y + 3ys + 3y*5 wrt y. -20y*3 Let f = 8 - 5. Let h(i) be the first derivative of -2 + i - 1/3i*f + 0i**2. Find the fi	{ "pile_set_name": "DM Mathematics" }
/(-985) 8/3 -144/842/4 -1/3 What is (-2)/((-12)/(-2))(-1962)/6213? 2/19 (-117)/(-78)(-10)/(-525)(-10)/(-3) 2/21 Calculate 19/(-6)(-376)/(-141). -4 What is ((-504)/60)/(-21)(5/6)/5? 1/15 (-1)/(1-2)(-41168)/2573 -8 What is the value of ((-1)/(-1))/(60/56-7)? -2/15 What is (-112)/(-14)(-2)/6(-30)/8? 10 What is ((-216)/180)/((-6)/(-10)4/(-6))? 3 Evaluate (45/(-12))/(81/6)(-15)/50. 1/12 Calculate (48/1)/(25/50030). 32 What is ((-10)/(-15))/(12/(-9))216/12? -9 What is the value of 2/33(-6075)/225? -18/11 Calculate (-2)/((126/(-1029))/((-18)/42)). -7 What is ((-3)/(-4)(-1)/(9/108))/1? -9 Evaluate ((-12)/(-10))/(17/(3995/(-658))). -3/7 (20/35)/(((-984)/112)/41) -8/3 Calculate (12/(-4))/((87/54)/29). -9 Calculate 20/((2175/(-300))/(2/(-24))). 10/7 What is 24/10(180/(-27))/((-8)/4)? 8 Evaluate (20/(-4))/(-20)-2(-40)/(-2). -10 Calculate ((-47)/(-47))/(((-12)/9)/(-4)). 3 What is 65/(-5)1/14? -3/7 What is the value of (0/1)/(-1)(-443)/443? 0 5/(-450)-18-50 -10 What is (-10)/(-3)((-1)/2)/(9500/(-600))? 2/19 -4((-105)/(-140))/((-6)/(-32)) -16 Calculate (-4)/9((-178)/(-623))/((-20)/7). 2/45 What is (-224)/(-16)(-57)/38? -21 Evaluate 1/((-2)/(-20))(5796/115)/28. 18 What is (-9646)/1033503/14? -1/50 Calculate 3087/17646/28. 3/8 (184/(-1012))/((-1)/(-88)) -16 Calculate 1711(1612/341)/26. 34 Evaluate (24/(-36))/((-80)/9(-12)/(-10)). 1/16 What is ((-40)/8)/(-5)-8? -8 Evaluate 8/5010/(-36)(-4590)/(-918). -2/9 Evaluate (3/5)/1450/(-30). -9 Calculate (-5(-3)/20)/((357/8)/(-17)). -2/7 What is the value of ((-6)/(-40))/((-45)/(-360))? 6/5 Calculate ((-5)/(-8))/(-5)(-860)/(-2150). -1/20 What is (6/(-5))/(6021/(-1115))? 2/9 ((-14)/(-4))/((2/4)/(1/(-2))) -7/2 What is the value of (728/910)/(1/(-5))? -4 What is 1560/7801/(-8)? -1/4 What is the value of 69/(1863/(-72))6/5? -16/5 3/6-1(-2280)/(-60) -19 What is ((-15)/(-15))/((-2)/351/68)? -2 Evaluate (14/133)/((-60)/(-190)). 1/3 What is (-5)/3(-171)/(-95)? -3 Evaluate (-1648)/2060130/4. -26 What is the value of ((-97)/(230181/452))/((20/14)/(-1))? 2/15 (((-3)/7)/(-1))/(5/((-3850)/(-15))) 22 Evaluate (-2)/(-4)(-7)/3551. -1/2 102/(-12)210/255 -7 ((-1)/30)/(33540/(-19350)) 1/52 What is the value of (624/20)/(-13)(-10)/3? 8 Evaluate 30/(-8250)-55(-30)/4. -3/2 Evaluate ((-18)/(-28))/((-12)/14)(-60)/(-5). -9 What is ((-3)/5)/(-3)(-3492)/19206? -2/55 Calculate (-1)/6((-861)/738)/(28/(-12)). -1/12 Calculate ((-4)/(-24))/(70/120). 2/7 12(3/(-27))/(((-65)/13)/75) 20 What is 136/(-68)2/18? -2/9 Evaluate ((-24)/(-15))/((-588)/(-70)(-5)/(-15)). 4/7 What is the value of ((-30)/(-25)-2)/((-4)/1440-27)? -32 Calculate (-646)/(-34)56/16(-8)/14. -38 What is ((-234)/(-975)8/36)/((-6)/9)? -2/25 Calculate ((-89)/356)/(5/36). -9/5 What is the value of ((-60)/(-9))/4(-12)/(-12)-6? -10 Calculate (5/(-20)(-16)/(-12))/(5/(-330)). 22 What is ((-22)/11)/(70/140)? -4 What is 11/(-9)(-1064)/(-5852)? -2/9 What is (-456)/(-855)(-280)/(-96)? 14/9 Evaluate (6456/17754)/(10/11). 2/5 Evaluate ((18/72)/((-2)/4))/((-2)/(-60)). -15 Evaluate (2/28)/(208/728). 1/4 1/(((-52)/(-12))/1327/(-1)) -1/9 What is the value of 7176/1248(8/(-10))/((-2)/(-10))? -23 What is 414/46(-8)/4? -18 Calculate ((-55)/(-95))/((-40)/(-380)). 11/2 Evaluate ((-18)/(-495))/(((-24)/20)/3). -1/11 What is the value of ((-96)/(-2880))/(4/1806)? 1/4 Calculate (-64)/544136/(-1). 16 ((-215)/30)/(-43)-1 -1/6 116/(-216)3 -2/9 144/3362/(-3)1/(-3) 2/21 Evaluate 0/((-26(-78)/1352)/((-3)/10)). 0 (15/(-245))/(1392/2436) -3/28 What is the value of 384/(-36)(-147)/98? 16 Calculate (18/216)/(15/(-1980)). -11 Calculate (-204)/48448/(-44). 34 What is ((-5)/(75/(-10)))/(((-380)/270)/(-38))? 18 Calculate ((-16)/120)/(116/(-1914)). 11/5 (-75)/(27225/154)6/(-14)1 2/11 Evaluate (3(-68)/153)/((56/(-3))/(-4)). -2/7 Calculate 2/((-4110/120)/(1/2)). -3/11 Calculate -17(-22)/561(-9)/(-42). 1/7 What is the value of (4(-187)/(-34))/(-2)? -11 Calculate 3852/6420(6/8)/(9/5). 1/4 What is (-58)/1218(-12)/(-6)? -2/21 Calculate ((-16)/450)/((-8)/6). 2/75 (1/(-5))/((-2)/(-52)13) -2/5 What is the value of ((-26)/(-4160)40)/(1/52)? 13 264/(-528)-13 3/2 Calculate (900/(-250)(-2)/(-3))/(2/(-5)). 6 Calculate (1008/35532)/((-2)/(-3)). 2/47 What is the value of (-7)/(-263/54)(-14)/6? -7 Calculate (-196)/112(-124)/(-2)76/(-266). 31 What is (-59/90)/1? -1/2 ((10/2480)/(42/56))/(5/(-20)) -2/93 What is the value of ((-1)/(-10)2)/((-59)/(-8732)-37)? -4/5 What is (2/2)/(19/(-38)(-232)/12)? 3/29 What is the value of (((-9)/6)/1)/((-76)/(-152))? -3 What is the value of 26/(-12)(-11780)/30628? 5/6 Evaluate 117/(-36)(-36)/(-9). -13 ((-9)/((-12)/4))/((-7)/(-84)-4) -9 What is the value of ((-21)/1230/105)/1? -1/2 What is -11(-24)/1848-70? -10 What is the value of ((-10)/(-56))/((-77)/((-9548)/(-31)))? -5/7 What is ((-82)/41)/(5/10)? -4 Evaluate (((-2)/(-6))/(36/(-108)))/(592/(-32)). 2/37 ((-510)/187)/(215/(-1419)) 18 Evaluate ((-23)/(-6))/((-121)/726). -23 What is (3/14)/(150/(-175))? -1/4 What is 48/(288/126)-1? -14 Evaluate (-4)/(754/((-195)/(-15))). -2/29 Calculate 105/(120/8)-21/(-2). 7 635/(-381)(-2)/10-27 -9 Evaluate ((-288)/(-176))/(-9)11. -2 What is (108/40)/(12/(-10))-4? 9 What is 3/(4/(-24)36/(-32))? 16 2/((-2)/3)(-204)/(-153) -4 Calculate (-15)/27(-9)/(-30)825/(-220). 5/8 What is -116(-9)/(-108)(-60)/(-5)? -16 Evaluate ((-729)/(-6804))/(6/(-16)). -2/7 What is the value of (-1)/(((-3)/32)/((-130)/5))? -13 What is the value of (240/2640)/(2/(-22))? -1 Calculate (104/16)/(26/52). 13 What is (-163)/(2156/28(-4)/22)? 24/7 What is (-11)/198(-1)/616? 4/27 What is (-132)/(-396)(-6)/(-20)-2? -1/5 What is the value of (-30)/18(-21)/(-25)? -7/5 What is the value of -8(-2)/(-496)2? -2/31 Calculate (84/(-10))/(17100/(-4250)). 21 Evaluate 14380/73338(-27)/5(-4)/12. 6/17 Evaluate 252/12122/7259. 6/17 -9340/(-90) 12 Calculate (5(-7)/(-98))/(15/(-12)-1). 2/7 What is (1/21)/((-8)/72)? -3/7 What is the value of (-4(-5)/80)/((48/4)/24)? 1/2 What is the value of ((-30)/14025-34)/((-12)/(-10)1)? 2/33 Calculate 42/(-14)(-8)/16. 3/2 2/(3(-35)/(-15)) 2/7 What is (((-32)/12)/1)/((-128)/14401)? 30 What is the value of 5/((-7)/(-21)8/(-8))1? -15 Calculate 2/39((-5)/15)/((-50)/75). 1/39 Evaluate 8811/4005-1(-4)/22. 2/5 (55/10)/116/(-8) -3/8 Evaluate 20/(-360)-6153/(-3). -17 What is (13/(-273)7)/(5/(45/6))? -1/2 (30/5)/(2(-5)/(-20)) 12 What is the value of 14/3((-5)/70)/(52/48)? -4/13 What is the value of -63/8(-18)/(2808/(-26))? -3/8 What is (806/(-465))/((8/(-15))/4)? 13 ((-1311)/(-4370))/((-48)/20) -1/8 What is the value of 16/(3/((-525)/200))? -14 What is the value of (-90)/(-200)2/6-8? -6/5 What is the value of 4/(-22)21463/(-28)? 19 32/(-6)252/224 -6 What is the value of (-8(-9)/217)/((-86)/43)? -12 Evaluate ((-6)/8)/(9/(-4)). 1/3 Evaluate 3717/2708118/14. 3/17 (-3)/30(-166)/83 1/5 (-100)/75210/(-20) 14 ((-80)/9102/(-4))/((-290)/145) -2/91 ((-2)/(-5))/(3726/(-90))-9 2/23 Calculate 1/(((-25)/(-75))/((-2)/1210)). -5 What is the value of (510/(-17))/152/(-1)? 4 Calculate (-15(-3)/6)/(-27(-95)/2052). 6 What is the value of (-24)/(-8)2/(48/(-40))? -5 What is ((-5)/(-35))/((140/15)/(-14))? -3/14 Calculate (-6)/(-21)251/(-502). -1/7 What is (256/(-576))/((-2)/63)? 14 What is 1458/(-81)((-18)/6)/(-3)? -18 Calculate (45/3)/(-5)30/570. -3/19 Calculate (-6)/1((-80)/156)/(-20). -2/13 (6/7)/(45/(-21)) -2/5 Calculate ((8/(-60))/(-110))/(8/(-48)). -2/25 What is -910/22515/4? -3/2 What is the value of (-16)/(-280)215/(-172)? -1/14 Calculate ((-3)/9)/(34/(-102)). 1 (19/2)/(301/(-602)) -19 Calculate 9/(-7)(-6)/1821. 9 Calculate (((-8575)/21)/35)/(5/(-3)). 7 Evaluate 1/36-1260. -20 Calculate ((-837)/(-93))/((-3)/2). -6 Calculate (1/21)/(12/56). 2/9 What is the value of (0/(588/(-42)))/(-1)? 0 Calculate ((-35)/((-2205)/396))/((-3)/((-63)/(-6))). -22 What is the value of (-1)/(((-41)/(-246))/(1/39))? -2/13 Calculate 0(-20)/(-560)14. 0 Evaluate ((-12)/(-10))/(4/10(-645)/344). -8/5 Evaluate 4/(-10)(-2020)/(-202). -4 What is the value of ((4/(-40))/(9/828))/(26/65)? -23 2/3*810/7560 1/14 What is (10/25)/((-156)/65)? -1/6 What is the value of (7/(-3))/((-15022)/348)? 2/37 1/((-3)/(9	{ "pile_set_name": "DM Mathematics" }
) to base 6 5100 10201110 (base 3) to base 9 3643 1120020222 (base 3) to base 11 21166 1720 (base 11) to base 14 b32 Convert 31bb (base 12) to base 5. 133341 325311 (base 6) to base 9 41167 Convert -425 (base 7) to base 4. -3113 -308 (base 13) to base 11 -429 Convert 1002101 (base 4) to base 13. 1c13 10011 (base 3) to base 6 221 What is -408 (base 14) in base 4? -30120 -39905 (base 12) to base 13 -29ca8 What is -1341001 (base 5) in base 11? -19835 Convert -3366 (base 9) to base 11. -1964 -122120011 (base 3) to base 11 -9689 What is 32287 (base 10) in base 7? 163063 What is 110000011011110 (base 2) in base 3? 1021000110 Convert -6530 (base 8) to base 14. -1360 Convert 2d75 (base 14) to base 5. 230024 What is 1111110101010 (base 2) in base 3? 102010020 Convert 10001010000 (base 2) to base 6. 5040 What is 2415 (base 14) in base 12? 3783 Convert -41c (base 15) to base 2. -1110011111 -536 (base 8) to base 11 -299 Convert 205c (base 13) to base 11. 33a5 Convert 4617 (base 10) to base 16. 1209 Convert 100010111110110 (base 2) to base 5. 1033120 Convert -5453 (base 9) to base 10. -4017 What is 121040 (base 5) in base 15? 1515 -28493 (base 12) to base 5 -3242413 -16733 (base 13) to base 9 -64842 Convert 1392 (base 10) to base 14. 716 What is 532 (base 9) in base 7? 1160 What is -e2 (base 15) in base 13? -134 -244 (base 5) to base 11 -68 170 (base 10) to base 11 145 Convert 11101220 (base 3) to base 4. 302022 Convert -4514 (base 11) to base 5. -142234 -b7cd (base 14) to base 13 -115a4 What is -1a20 (base 13) in base 9? -5327 Convert -1041123 (base 6) to base 3. -2122110220 What is 10110011001110 (base 2) in base 4? 2303032 Convert -13504 (base 13) to base 9. -54341 What is 250 (base 7) in base 12? b1 -1220 (base 15) to base 12 -2293 What is -5245 (base 6) in base 5? -14211 -220a (base 12) to base 5 -110004 What is -33b (base 14) in base 16? -281 Convert 120442 (base 7) to base 13. 9c28 What is 785 (base 16) in base 12? 1145 Convert -2121 (base 4) to base 6. -413 -1e0 (base 15) to base 10 -435 Convert 122100201 (base 3) to base 10. 12655 What is -4a5 (base 14) in base 8? -1641 What is -5e8c (base 16) in base 4? -11322030 Convert 134 (base 9) to base 5. 422 What is -1606 (base 9) in base 4? -103011 -2cc6 (base 15) to base 4 -2112210 Convert 5643 (base 16) to base 2. 101011001000011 Convert -4400 (base 11) to base 16. -16b0 -10111000100010 (base 2) to base 6 -130402 522 (base 10) to base 14 294 -6bda (base 15) to base 2 -101100110010010 What is 59b3 (base 14) in base 5? 1000031 What is 1242 (base 6) in base 14? 186 What is -10011212 (base 3) in base 5? -33233 Convert -20323213 (base 4) to base 5. -2132313 1001201110 (base 3) to base 13 96b7 What is 1024444 (base 6) in base 2? 1100010001101100 -1010210 (base 3) to base 9 -1123 What is 670 (base 11) in base 6? 3415 2562 (base 10) to base 11 1a1a 2645 (base 9) to base 3 2201112 Convert 53412 (base 8) to base 3. 1010120021 What is 6100 (base 7) in base 5? 31412 What is -101010002 (base 3) in base 10? -7373 1303123 (base 4) to base 10 7387 Convert 878 (base 10) to base 8. 1556 What is 16a0 (base 11) in base 16? 877 What is 116a (base 12) in base 3? 2200101 Convert 114 (base 6) to base 15. 31 Convert 2a21 (base 13) to base 7. 23550 -633 (base 11) to base 14 -3c6 Convert 531 (base 10) to base 9. 650 What is 1393 (base 10) in base 3? 1220121 What is -6104 (base 8) in base 10? -3140 What is 11120 (base 9) in base 3? 101010200 Convert -45 (base 12) to base 16. -35 b86 (base 15) to base 10 2601 Convert 1202 (base 8) to base 5. 10032 Convert -33341 (base 5) to base 15. -a66 What is 603 (base 7) in base 3? 102000 4712 (base 14) to base 6 133124 Convert -101000100011010 (base 2) to base 12. -10022 What is -cc80 (base 14) in base 6? -431504 -203203 (base 4) to base 3 -10010021 What is -100342 (base 5) in base 11? -246a Convert -324113 (base 5) to base 12. -655a Convert a0c3 (base 14) to base 3. 1101212122 Convert -33a (base 13) to base 10. -556 39c (base 13) to base 3 212120 Convert 460 (base 9) to base 16. 17a Convert 757 (base 15) to base 9. 2241 Convert 305 (base 8) to base 16. c5 What is 112112 (base 4) in base 13? 860 -436 (base 16) to base 3 -1110221 What is -253ba (base 12) in base 6? -1030354 112034 (base 8) to base 14 db64 Convert a8 (base 12) to base 8. 200 Convert -a17a (base 11) to base 12. -79a6 Convert -136023 (base 7) to base 2. -110010111100101 What is 35888 (base 9) in base 13? ac46 Convert 11020010 (base 4) to base 13. 9731 Convert 1264c (base 14) to base 16. b05c Convert -853 (base 13) to base 16. -58c What is -107df (base 16) in base 4? -100133133 What is 110a (base 11) in base 10? 1462 Convert a00 (base 11) to base 16. 4ba 22044 (base 6) to base 2 101111101100 Convert -3651 (base 7) to base 10. -1359 Convert -110111010 (base 2) to base 14. -238 344 (base 6) to base 13 a6 -65 (base 12) to base 5 -302 What is 1bad (base 16) in base 12? 4125 What is -5365 (base 7) in base 12? -1131 What is 3541 (base 6) in base 3? 1011121 -3010 (base 5) to base 13 -233 Convert -2350 (base 7) to base 4. -31210 What is -4688 (base 14) in base 3? -121211112 What is 71 (base 14) in base 3? 10200 -648 (base 11) to base 15 -36d 8a (base 14) to base 2 1111010 What is 250 (base 6) in base 7? 204 What is 100111111 (base 2) in base 13? 1b7 -11e2 (base 16) to base 10 -4578 -18c (base 15) to base 10 -357 Convert -ca3 (base 13) to base 14. -b05 Convert 17675 (base 9) to base 4. 2332322 Convert -11012 (base 5) to base 11. -629 Convert -30104 (base 6) to base 3. -12101111 Convert -144200 (base 5) to base 6. -44331 What is 2562 (base 7) in base 13? 5a0 Convert -311 (base 14) to base 11. -4a9 -202323 (base 4) to base 16 -8bb Convert 100001100101 (base 2) to base 16. 865 -595 (base 12) to base 6 -3505 11001010101011 (base 2) to base 13 5b9a Convert 1110100101 (base 2) to base 7. 2502 What is 435 (base 16) in base 5? 13302 What is 3233 (base 6) in base 14? 3ad Convert -101201010 (base 3) to base 16. -1e7e What is 3015 (base 15) in base 11? 7693 Convert 1110310 (base 4) to base 9. 7401 Convert -25387 (base 9) to base 8. -41301 Convert -20a (base 15) to base 10. -460 -dd (base 16) to base 5 -1341 -42c (base 14) to base 10 -824 What is -2ab2 (base 14) in base 16? -1db4 Convert -1cd (base 16) to base 7. -1226 What is -411326 (base 7) in base 5? -4221024 12001 (base 3) to base 15 91 Convert 11010001100 (base 2) to base 14. 87a What is 26036 (base 13) in base 6? 1301405 25846 (base 9) to base 10 17457 Convert -27912 (base 10) to base 9. -42253 Convert -21321 (base 5) to base 12. -a19 534 (base 9) to base 11 367 Convert 293 (base 12) to base 15. 1b9 Convert 363 (base 13) to base 11. 495 -6c2 (base 13) to base 3 -1121102 -1370 (base 10) to base 12 -962 What is -2312 (base 5) in base 11? -282 Convert -101011100111 (base 2) to base 7. -11065 -13104 (base 8) to base 14 -2112 -2285 (base 9) to base 14 -893 -1aaa (base 11) to base 3 -10122120 2425 (base 6) to base 12 415 What is 439 (base 13) in base 14? 39a Convert -1000001010110 (base 2) to base 12. -2506 What is 3621 (base 7) in base 12? 936 -2620 (base 7) to base 9 -1324 Convert -489 (base 15) to base 4. -100011 -1d6 (base 16) to base 3 -122102 What is 1043222 (base 5) in base 13? 85ab Convert -32002 (base 8) to base 9. -20233 -15652 (base 12) to base 9 -45508 -1431 (base 8) to base 11 -661 -1134 (base 7) to base 11 -34a -8d05 (base 15) to base 8 -72352 c6bd (base 16) to base 11 35252 What is -34101 (base 10) in base 16? -8535 Convert 2c (base 14) to base 3. 1111 Convert 6031 (base 8) to base 14. 11b3 635 (base 15) to base 10 1400 Convert -104 (base 12) to base 15. -9d Convert 49 (base 14) to base 8. 101 746 (base 14) to base 3 1222010 What is -2827 (base 9) in base 11? -1668 What is -101000010100 (base 2) in base 10? -2580 136 (base 8) to base 9 114 What is 2695 (base 12) in base 4? 1011101 2591 (base 10) to base 8 5037 Convert -1210002212 (base 3) to base 6. -430205 Convert 10101111100001 (base 2) to base 4. 2233201 What is -324 (base 7) in base 9? -203 What is 113002 (base 4) in base 12? a2a -a044 (base 15) to base 13 -12511 What is -1324331 (base 5) in base 8? -64331 What is -30122 (base 5) in base 8? -3570 51 (base 11) to base 4 320 918 (base 12) to base 8 2444 Convert -110010 (base 4) t	{ "pile_set_name": "DM Mathematics" }
0y + y - 58 = -4q. Let f be 18/y - 38/6. Determine b(f). 3 Let g(n) = -5n + 21. Let a be g(5). Let d(b) be the third derivative of b5/60 + b4/8 - 5b3/6 + b2. Give d(a). -1 Suppose -v - v = 8. Let i = v - -8. Let o(p) = 4p3 - 3p*2 - 5p + 3. Let r(j) = 7j3 - 6j*2 - 10j + 7. Let w(x) = 5o(x) - 3r(x). Calculate w(i). -2 Let u(g) = 28g2 - 3g + 6. Let h(t) = 84t2 - 8t + 16. Let a(f) = -3h(f) + 8u(f). Determine a(1). -28 Let g(u) = u*3 + 5u*2 + 3u - 3. Let f be g(-3). Let o(q) = 2q - 6. Give o(f). 6 Let t(n) = 3n*2 + 17n + 5. Let z be t(-5). Let y(v) be the third derivative of -v6/120 - v5/12 + v3 - v2. What is y(z)? 6 Let x(n) = 7n3 - 2n*2 - 2n - 1. Let q be 3 + (2 - (-2 + 3)). Suppose -7 = -3g - qb - b, -3b = -4g - 10. Calculate x(g). -8 Let s(r) be the third derivative of r7/840 + r6/72 + r*5/120 - 7r*4/24 - 5r*3/6 - 5r2. Let p(l) be the first derivative of s(l). Calculate p(-5). -12 Let c(p) = p2 + 2p - 1. Let k(v) = 2v - 5. Let l be k(4). Suppose 2t = lz + 19, 3t + 3 + 1 = -2z. Give c(z). 14 Let c(u) be the first derivative of -u*3/3 - 2u*2 + 4u + 2. Give c(-7). -17 Let q(k) = -k3 - k2 + k - 1. Let a(t) = -5t3 - 15t*2 + 15t - 7. Let x(s) = a(s) - 6q(s). Calculate x(8). 7 Let w(a) be the third derivative of a5/60 - a4/6 + 7a*3/6 - 14a2. Give w(6). 19 Let g(u) be the third derivative of -u5/60 - u4/12 + u3/6 + 4u2. Let h(a) = a3 - 5a*2 + a - 3. Let j be h(5). Give g(j). -7 Let w(r) be the first derivative of -3r*2/2 + r + 3. Determine w(1). -2 Let k be (-1)/((-5)/(-15)(-3)/(-2)). Let u(g) = -8g - 2. What is u(k)? 14 Suppose -5k - 4 = -24, 3o - 18 = -3k. Let z(w) = w + 1. Calculate z(o). 3 Let s(c) be the second derivative of -c3/6 - c2/2 + 15c. What is s(5)? -6 Let k(s) = s3 - 7s*2 + 4s + 2. Suppose 4g - 28 = 4m, g + 2m + 4 - 5 = 0. What is k(g)? -28 Let n(i) = -3i*2 - 2i. Let m be n(2). Let b = m + 12. Let y(q) = -q*2 - 4q. Give y(b). 0 Let j(x) = 5x2 - 4x - 17. Let y be 14/4 - 2/4. Let n(z) be the first derivative of -2z3/3 + z2/2 + 6z - 15. Let t(u) = yj(u) + 8n(u). Give t(-2). 1 Let o = 2 + 0. Let n(p) = -3p2 - 4 - 5p + 3 + 2po + 3. Determine n(-4). 6 Let l be (20/25)/((-1)/(-5)). Let k(y) = ly - 3y - y3 + 10y*2 - 3 - 6y*2. Calculate k(4). 1 Let p(t) = 3t*2 - 11t - 9. Let a(u) = -4u2 + 16u + 13. Let w(c) = 5a(c) + 7p(c). Suppose f + 2 = -0f. What is w(f)? 0 Let x(j) = -j3 - j2 - 1. Suppose -3p = 5k - 37, k + 0p - 1 = p. Let b = -7 + k. Give x(b). 3 Let r(t) = t*2 - 7t + 4. Suppose i + y = -6, 2i + 15 = -5y + 3. Let x = i - -11. Calculate r(x). -6 Let f(w) = w*3 + 9w*2 - 2w - 9. Let n be f(-9). Suppose -q + 4q - n = 0. Let z(d) = -2d + 4d - qd + 1. Determine z(1). 0 Suppose -2c + 0c + 4 = 0. Let l(k) be the first derivative of k*2/2 + k - 2. Give l(c). 3 Let z(x) = 3x - 10. Let w(r) = -4r + 11. Let u(o) = 2w(o) + 3z(o). What is u(0)? -8 Let i = -18 + 15. Let m(p) = -4p + 7. Let j(w) = 5w - 8. Let q(s) = ij(s) - 4m(s). Give q(3). -1 Let z(p) = 3 - 10p - 8 + p*2 + 11p + 4p. Let q(b) = -b2 - 3b. Let k be q(-3). Suppose k = 3g - 1 + 16. Determine z(g). -5 Let a(o) = 4o + 2o + 0o. Let v be -5 + 7 + 3/(-1). Determine a(v). -6 Suppose -3k - 28 = 4j, -2k + 0j - 4j = 20. Let f be k/63/(-2). Let a(t) = -14t + 9. Let d(z) = -5z + 3. Let m(o) = 3a(o) - 8d(o). What is m(f)? -1 Let g(a) = -a*3 - 7a*2 - 6a - 9. Let y be -101/1 - -4. Give g(y). -9 Let i(t) = 6t - 18. Let r(c) = -4c + 12. Let b(j) = 5i(j) + 7r(j). Let o(u) = u + 6. Let n be o(0). What is b(n)? 6 Suppose 4k + 6 = j + 1, 0 = -5j + k + 6. Let n(f) = f2 + 2f - 1. What is n(j)? 2 Let r(f) be the first derivative of f*4/2 - 2f3/3 + f2 - 3f - 2. What is r(2)? 9 Suppose -3 = 3x - 9. Suppose -5f - 2b + 3 = -34, -xb + 28 = 4f. Let n be f/6(-2)/3. Let q(r) = -6r - 1. Give q(n). 5 Let t(g) = -g + 9. Let b be t(0). Let x = -5 + b. Let p(a) = -a*2 + 6a - 3. Calculate p(x). 5 Let d(f) be the second derivative of -6f + 0 + 1/6f*4 - 1/20f*5 + 2/3f*3 - 2f2. What is d(3)? -1 Let t(p) = p3 + 2p2 + 2p - 1. Let f be t(-2). Let m(x) = x*2 + 6x - 1. Calculate m(f). -6 Let h(n) be the second derivative of n5/60 + n4/4 + 2n3/3 + 4n*2 + 2n. Let d(g) be the first derivative of h(g). Determine d(-3). -5 Let c(v) = v*2 - v. Let w(r) = -2r*2 - 4r + 1. Let x(g) = 3c(g) - w(g). Calculate x(1). 5 Let y(d) = 2d - 3. Suppose -2u - 2u = 36. Let a = -6 - u. What is y(a)? 3 Suppose -5g = -0 + 5. Let c(j) = j + 1. Let s(a) = -2. Let t(p) = c(p) + s(p). Let f(d) = -8d + 1. Let k(l) = -f(l) - 2t(l). Determine k(g). -5 Suppose 5p - 70 = 5a, 2a + 2a + 2p + 50 = 0. Let d = 8 + a. Let s(t) = t*3 + 4t*2 - 5t - 5. Calculate s(d). -5 Let h(y) be the first derivative of -y7/840 + y6/180 + y5/40 - y4/24 - 2y3 - 1. Let d(q) be the third derivative of h(q). What is d(3)? -1 Let r(t) = 5t + 41. Let f be r(-8). Let g(l) = -4l2 - 2l + 1. Calculate g(f). -5 Let c(f) = -f*3 - 6f*2 + f. Let d(q) = 3q*3 + 13q*2 - 2q + 1. Let j(v) = -5c(v) - 2d(v). Let z be 4/16610. Suppose 0 = -5t + z - 0. Calculate j(t). 4 Let p(m) = 0m*3 + 5m*3 - 3m*3 + 2m2 - 1. Let z be p(1). Let s(v) = v - v2 - 4v + 4v + 3. Calculate s(z). -3 Let h = 86 - 89. Let l(p) = -7p - 3. Give l(h). 18 Let x(r) = -r + 8. Let a be x(6). Let y = a + -1. Let n(l) = 4l*3 + 2l - 1. What is n(y)? 5 Suppose 2n + 37 = 5f, 4n - 3n + 4f = 14. Let i(a) be the first derivative of -a4/4 - 2a3 - a2 - 7a + 3. What is i(n)? 5 Let g(o) be the second derivative of o6/120 + 7o5/60 - o4/3 - 5o3/6 + 3o*2/2 - 7o. Let a(k) be the first derivative of g(k). Give a(-8). -5 Let r be -3(1 - 0/2). Let g be (-42)/(-4) + r. Let n(h) = 4h + 1. Give n(g). -3 Let t = -15 + 10. Let d = t - -5. Let s(w) be the third derivative of -w6/120 - w5/60 - w4/24 - w3 + w2. What is s(d)? -6 Let q = -107 - -99. Let p(s) = -s - 14. Determine p(q). -6 Let l = 3 - 4. Let m(y) be the first derivative of -y4 - y2/2 - y + 1. What is m(l)? 4 Let k(a) be the third derivative of 0 - 1/360a*6 + 1/2a*3 + 0a + 1/20a5 + 3a*2 - 1/8a4. Let o(g) be the first derivative of k(g). What is o(6)? -3 Let g(f) = f3 + 5f2 + 4f + 4. Let y be g(-4). Suppose 2z = yz. Let a(l) = 0 - 2l3 - 1 + z. Calculate a(1). -3 Let o(j) = j2 - j + 3. Let q(c) = 2c*2 + 6. Let d(n) = -5o(n) + 2q(n). Suppose 8 = -2y, -4u + y + 9 = -19. Calculate d(u). -9 Let a = -4 - -5. Let f(x) = -1 - a - x + 3x - x. What is f(6)? 4 Let c(z) be the third derivative of z6/120 + z5/60 - z*3 + 3z*2. Suppose -t = 2j - 5, j - 2t + 5 = -5. Calculate c(j). -6 Let b(i) be the first derivative of 2i*2 + i - 1/3i*3 + 3. Suppose -2q = -17 + 7. Give b(q). -4 Let v be -2 + (-30)/(-26) + 4/(-26). Let b(r) = -17r3 - r2 - 2r - 1. Determine b(v). 17 Suppose 10 = 3o + 5p, -5o = -3p + p + 35. Let m(y) = -y*3 - 5y*2 + 2y + 5. Determine m(o). -5 Let d be 4(3 + 15/(-6)). Suppose dq + 15 = 5q. Let x(u) be the first derivative of u2 - 3u + 1. What is x(q)? 7 Let g = 31 - 28. Let o(t) = 0tg - 7 - 30t*2 + 24t2 - t3 + 5t. Determine o(-7). 7 Suppose -2g - 3p - 8 = 0, 3p = g + 4 - 0. Suppose u = 3o + 5, u + 2o - 5 = 7o. Let y(d) = -2d - ud + d - 2 - d2. What is y(g)? 6 Let n(t) = 16t*2 - 6t2 - t3 - 2t - 5t*2 + 3 - 2t. Determine n(3). 9 Let q(m) = -m*3 + 0m*3 - 5 + 0m*2 + 3m*2 + 6m. Let w(t) = t*2. Let u(a) = -5a*2 - 3a. Let p(z) = u(z) + 6w(z). Let i be p(4). What is q(i)? 3 Let g(v) = v3 + 6v*2 + 6v. Let z be g(-5). Let f(t) = -2t2 + 10t + 3t2 - 4t - 5. Determine f(z). -10 Let t(f) = -4f3 - 8f*2 + 5f - 8. Let c(y) = -2y3 - 3y*2 + 2y - 3. Let o(b) = -11c(b) + 4t(b). Determine o(1). 6 Suppose 3 = -6d - 27. Let t(n) = -n3 - 6n*2 - 3n - 7. Give t(d). -17 Let i(m) be the second derivative of -1/12m4 - 2/3m*3 + 0 + 2m + 0m2. Give i(-5). -5 Let x(k) = k3 - 3k*2 - 5k. Suppose 6 - 2 = p. Give x(p). -4 Let y(o) = -o*2 - 1. Let i(n) = -9n*2 - n - 5. Let r(u) = -i(u) + 4y(u). What	{ "pile_set_name": "DM Mathematics" }
? True Is 1 + 4665 + -415/20 a prime number? True Suppose t + d - 1281 = 0, -1297 = -t - 0d - 5d. Is t a prime number? True Suppose -7k + 121064 = k. Suppose -k = 2s - 6s - 3t, -11371 = -3s + 2t. Is s prime? False Let n be 45/(40/(-1498)). Let v be -3 - 3/((-6)/(-2186)). Let b = n - v. Is b prime? True Suppose 4 = l + 3l. Let i(g) = 708g*2 - g. Is i(l) prime? False Suppose -4d = -8 - 8. Suppose -4z - d = 4w, 0z + 5w + 17 = z. Suppose zs - 4i = -s + 233, 96 = s - 5i. Is s composite? False Suppose 8 = 3a - a. Suppose -2q = -6q + 5d + 5016, 2d + 5004 = aq. Is q a prime number? True Suppose 5r + 2m = -3631, -4m + 7m = -2r - 1459. Let v = 1420 + r. Let j = -478 + v. Is j prime? False Is 40092 - (-6 + (23 - 12)) a prime number? True Let y(k) = 3k + 2k + 5 + 0k + 12k*2 - 3k. Is y(6) a composite number? False Let h(a) = a*2 - 14a + 13. Let v be h(13). Suppose 3z + vz - 1347 = -3o, -4z + 2o = -1820. Is z prime? False Let u be (-12)/78 - ((-72)/(-39) + -2). Suppose 4m + uo + o - 598 = 0, -2o + 4 = 0. Is m composite? False Let c = -80 - -121. Let n = c + 2. Is n composite? False Let w = -348 - 7. Let r = w + 533. Suppose 4a = r + 154. Is a prime? True Let q(h) = h2 + 2h. Suppose -r = -3r. Let y be q(r). Suppose 10d - 15d + 265 = y. Is d a composite number? False Suppose -5s + 21 = -2s. Suppose 4 = 9r - sr. Is (-24)/4(-109)/r prime? False Let k = 8 - 22. Let i be 23/(-2) + 7/k. Let d = 1 - i. Is d a composite number? False Is (1/5)/((-3)/(-282045)) a composite number? False Suppose -4j + 3v = -49459, -3j + 7v + 37088 = 6v. Is j a composite number? True Suppose 18m = -3m + 145551. Is m a composite number? True Let u(i) be the third derivative of 7393i*4/24 - 11i*3/6 + 9i*2. Let x be u(-6). Is 8/(-14) - x/91 prime? True Let f = 6657 - 1103. Is f a composite number? True Suppose n = -2i + 4n + 15, 2n + 10 = -3i. Suppose il + 4025 = 5l. Suppose -4s + l = s. Is s a prime number? False Suppose -112q + 1939678 = -2791090. Is q composite? False Let i be (12/5)/((-6)/(-20)). Let m(d) = 2d*3 + 7d*2 + 5d + 9. Let l be m(-3). Is -2((-628)/i - l) a composite number? False Let n(h) = h3 - 3h*2 + 42h + 45. Is n(16) a composite number? True Let r = -38 - -19. Let x = 19 + r. Suppose xl - 201 = -3l. Is l a composite number? False Suppose -20 = -4f, 3f - 17 = s - 2s. Suppose 0 = -n + sn - 8. Is (n/10)/(1/5) composite? True Suppose 3l - 2w = 5921, 4l + 0w - w = 7893. Is l prime? True Suppose -19286 = 46b - 398832. Is b composite? True Suppose 5i - 133272 = 3m - 21132, -2i + m = -44857. Is i composite? True Let k(m) = 203m3 + 9m*2 - 7m + 12. Is k(5) a composite number? False Let q = -7999 + 18452. Is q prime? True Let h = -1 - 4. Let q = h - -7. Suppose qu - 204 = 218. Is u prime? True Suppose 0 = m - 1364 + 1105. Is m composite? True Suppose -81912 = -4y + n, 94y + n - 40950 = 92y. Is y composite? False Let t be (-8 - -5)(-8)/6. Suppose 6235 = td + 3g, -2g - 3131 = -2d + g. Is d prime? False Suppose p + 5r - 955 = -371, -4p - 4r + 2256 = 0. Is p prime? False Suppose 4h + 7 = 27. Suppose -139 = hg - 1589. Let p = g - 197. Is p a composite number? True Let f be -16/(-8)4. Suppose 5a - 550 = -fs + 3888, -1483 = -s + 2a. Is s a composite number? False Suppose 3u - 54 = 3g - 0g, -2u - 3g = -61. Suppose 3a = c - u, -a = c + 2 - 13. Is c composite? True Suppose 0r - 9145 = -5r. Is r a composite number? True Let f = -6 + 6. Suppose f = -4z - 12 + 28. Suppose zj - 485 = 3v, -5j + 3v + 0v = -604. Is j prime? False Let q(p) = -11p3 - p2 + 1. Suppose -5 = -f, 2g - 5g - 38 = -f. Let u = -13 - g. Is q(u) prime? False Is (-654390)/(-231) - (-3)/21 a prime number? True Let h be (-234)/18 - (1 - 0). Let w(r) = 17r2 + 12r + 19. Is w(h) a prime number? False Let u(t) be the second derivative of t5/20 - t4/2 - 5t3/3 - 4t*2 + 4t. Is u(11) prime? True Let d = 845 - 477. Suppose -4g + 526 = -3m + 150, -3m + 2g = d. Let s = m - -283. Is s prime? True Let r(n) = 19n2 + 12n - 45. Is r(14) composite? False Suppose 3h + 3i = 141144, -6h - 2i = -8h + 94108. Is h composite? False Suppose -58617 = -16c - 11c. Is c prime? False Let s(c) = -c3 - 36c*2 - 42c - 86. Is s(-35) composite? True Suppose 4n - 20459 = 3n - 2y, -81871 = -4n - y. Is n composite? True Let d = 1 - -1. Suppose dl + u = -412 + 13535, -3l + 4u + 19657 = 0. Is l a composite number? True Let i = 16 - -18. Suppose 0 = iq - 36q + 330. Suppose q + 46 = h. Is h prime? True Let l = 1105 - -197. Let t = l - 293. Is t composite? False Suppose 3p - 45901 = -4t, 0 = -p - 5t + t + 15287. Is p a prime number? True Let w = 6 + 22. Let l = -15 + w. Is (3 - l)/((-4)/94) prime? False Let i be (-4)/6 - (-11)/3. Suppose -it + 4t - 793 = -u, -4t = u - 3175. Is t a composite number? True Let s = 943 + 284. Is s a prime number? False Suppose 356v = 336v + 101180. Is v a composite number? False Let s be ((-2 - 1) + 6)/(-1). Let u be 0(-3 + s + 5). Suppose 3x - 362 = 5n, -2x + x + 3n + 122 = u. Is x a composite number? True Let x(g) = 3g3 - 5g - 13. Is x(9) a prime number? True Suppose 0 = k + 2, -4t + k = 6k - 6. Let g(f) = 98f - 15. Is g(t) prime? False Let q(h) = 3h*2 + 5h - 1. Let w be q(-4). Let s = 66 - w. Suppose 3 - s = -4z. Is z prime? False Suppose -s + 5h = -2s - 11, 3h + 6 = 0. Let a(z) = z. Let m be a(s). Is m/2 + 1495/10 a composite number? False Suppose -3s = 7s - 20. Suppose -r + 3n + 812 + 731 = 0, -3086 = -2r - sn. Is r composite? False Let q(r) = 73r*2 + 3r + 1. Suppose 9c - 32 = c. Is q(c) a composite number? False Let s be 2/(-11) - (-798)/33. Let w be 35/(-10)s/(-21). Suppose -wa + 2l + 89 = -a, -l = 5a - 170. Is a prime? False Let c(q) = -1606q - 659. Is c(-15) composite? False Let a(i) = -3i2 - 4i + 12. Let q(o) = 6o2 + 7o - 23. Let t(f) = -f*2 - 4f + 3. Let c be t(-4). Let x(p) = cq(p) + 5a(p). Is x(-7) composite? False Suppose 2o = a - 559 + 58, -o = -5a + 2460. Suppose -5z = -5g - 15, -3g + 1 + 0 = -z. Suppose -95 - a = -gx. Is x a prime number? True Let f(t) = -t*2 + 5t + 5. Let d be f(5). Let x(z) = 9z3 + 9z*2 - 14z + 11. Is x(d) prime? True Let c(f) = 65f - 2. Let u be c(1). Suppose 0 = -2v - 4d - d + u, 4v + 4d = 96. Is (-6)/2 - (3 - v) a prime number? True Suppose -10 = 3v - 37. Let a(h) = 12h + 3. Let y be a(v). Suppose 3d = -0d + y. Is d prime? True Suppose -1409 = -c + 4r - 7r, 2806 = 2c + 3r. Is c composite? True Let g be 120/(-16)(-4)/5. Let w be (20/g)/(12/18). Suppose wx = -k + 63, -3k + 2k + x + 87 = 0. Is k a composite number? False Let p(w) = -46w - 56. Let z(f) = 23f + 28. Let r(g) = 2p(g) + 5z(g). Is r(13) a composite number? True Suppose -4p - 9460 = -8p + 4u, 0 = -p + 2u + 2367. Is p a composite number? True Let p be ((-4)/5)/((-2)/790). Let x = 564 - 36. Suppose -4q = -x - p. Is q a composite number? False Suppose 2i = 4, 2i + 381997 = 5x + 8736. Is x a composite number? False Suppose 5943 = 5w - 62752. Is w composite? True Let k = -5 - -12. Is k/((-2)/(-116)2) prime? False Suppose 49522 = -8a + 19a. Is a a composite number? True Let v = 134 - 117. Is 2195/v + (-28)/238 prime? False Let d(w) = -489w + 2w2 + 3w*2 + 473w - 29. Is d(-16) composite? True Suppose n - 25 = -4n, -n = -2l - 3. Is (-2392)/(-13) + 3/l composite? True Is (481/74)/(1/734) prime? False Is ((-15798)/(-4))/((-132)/(-88)) prime? True Is (-8 - (-3 - -2058))1-1 a composite number? False Suppose 4v = -8 + 48. Let o = 14 - v. Suppose ob - 9 + 0 = -3j, 0 = -2j - 4b + 2. Is j prime? True Let x = -225 - -369. Suppose -5r + x = -331. Suppose 3t = 8t - r. Is t composite? False Let f = -1327 - -2310. Is f composite? False Suppose 13v - 4i = 16v - 139713, -2v + 93142 = 2i. Is v a prime number? False Suppose -w = 18 + 2. Let z(g) = g2 + 20g + 3. Is z(w) composite? False Let m(p) be the third derivative of -17p4/4 + 4p*3/3 + 4p*2. Let t be m(-5). Is (t/(-8))/(2/(-8)) prime? False Let n(h) = 4h + 16. Suppose -8 = 4y - 4p, 0 = -4p - 6 - 14. Let j be n(y). Is (11 + j)/(1/(-13)) composite? False Suppose 0 = -2b + 83 + 21. Suppose -b	{ "pile_set_name": "DM Mathematics" }
the next term in -1203, -1202, -1201? -1200 What is the next term in -5, 10, 41, 94, 175? 290 What comes next: 67456, 67457, 67458, 67459? 67460 What comes next: -310, -332, -354, -376? -398 What comes next: 35, 96, 157, 218, 279, 340? 401 What comes next: 27, 61, 97, 135, 175, 217, 261? 307 What comes next: -911, -1821, -2733, -3647? -4563 What is the next term in -212, -423, -634, -845, -1056, -1267? -1478 What comes next: -3, -4, -3, 0? 5 What comes next: -145, -292, -439? -586 What comes next: -961, -959, -955, -949? -941 What comes next: 53, 103, 155, 209, 265, 323, 383? 445 What is next in 20058, 20059, 20060, 20061, 20062? 20063 What is the next term in -1251, -1259, -1281, -1323, -1391, -1491, -1629? -1811 What is next in 99, 193, 291, 393, 499, 609? 723 What is next in 20, 47, 74, 101, 128? 155 What is the next term in 27, 42, 61, 78, 87? 82 What comes next: 75, 145, 201, 237, 247, 225, 165, 61? -93 What is next in -77, -75, -73, -71? -69 What is the next term in -28, -142, -338, -622, -1000? -1478 What comes next: -71, -88, -117, -158? -211 What is next in -7742, -7741, -7740, -7739, -7738? -7737 What is next in -3714, -3717, -3730, -3759, -3810, -3889, -4002, -4155? -4354 What is next in 7, 26, 53, 94, 155, 242, 361? 518 What is next in -88, -177, -266, -355? -444 What comes next: 14, 33, 52, 71, 90, 109? 128 What is next in -21, -58, -157, -348, -661, -1126, -1773, -2632? -3733 What is next in -5242, -5243, -5254, -5281, -5330, -5407, -5518, -5669? -5866 What comes next: 276, 305, 334, 363, 392, 421? 450 What is next in 96, 65, -26, -207, -508, -959, -1590? -2431 What is next in 118, 79, 40, 1, -38, -77? -116 What is the next term in -786, -1580, -2378, -3180, -3986, -4796? -5610 What comes next: -27, -36, -61, -108, -183, -292, -441, -636? -883 What is the next term in 39, 152, 341, 606? 947 What is the next term in -210, -199, -166, -99, 14, 185, 426? 749 What is the next term in -122, -168, -214, -260? -306 What comes next: 939, 1882, 2825, 3768? 4711 What is next in 100, 85, 54, 1, -80? -195 What is the next term in -23, -27, -33, -41, -51, -63, -77? -93 What is next in -2936, -11795, -26568, -47261, -73880, -106431? -144920 What comes next: -70, -141, -210, -277, -342, -405, -466? -525 What is next in 405, 490, 577, 666, 757? 850 What is next in -43, -38, -33, -28? -23 What is the next term in -2, -14, -42, -92, -170, -282, -434? -632 What is the next term in -1258, -5023, -11298, -20083? -31378 What is the next term in 0, -3, -6? -9 What is the next term in -143, -315, -487, -659, -831? -1003 What is the next term in -22, -27, -44, -79, -138? -227 What is the next term in 2, 24, 104, 272, 558? 992 What is next in 30, 103, 162, 201, 214, 195, 138? 37 What comes next: 86, 152, 218, 284, 350, 416? 482 What comes next: -249, -371, -507, -663, -845, -1059, -1311, -1607? -1953 What comes next: 2156, 4314, 6476, 8642, 10812? 12986 What is the next term in 964, 1928, 2890, 3850? 4808 What comes next: -172, -347, -522? -697 What is the next term in 265, 528, 791, 1054? 1317 What is the next term in -77, -78, -79, -80, -81, -82? -83 What is the next term in -57419, -57425, -57443, -57479, -57539? -57629 What is next in -102, -105, -110, -117, -126, -137? -150 What comes next: -33, -70, -109, -150, -193, -238? -285 What comes next: 59, 62, 61, 56? 47 What comes next: 19, 35, 51? 67 What comes next: -537, -542, -551, -564, -581? -602 What is the next term in 38, 54, 80, 116? 162 What is next in -269, -893, -1925, -3359, -5189, -7409? -10013 What is next in 30, 76, 196, 426, 802, 1360, 2136, 3166? 4486 What is next in 15, 23, 29, 27, 11, -25, -87? -181 What comes next: 271, 537, 799, 1057, 1311, 1561, 1807? 2049 What comes next: -85, -86, -89, -94? -101 What comes next: 157, 587, 1295, 2275, 3521, 5027, 6787? 8795 What is next in -4, 3, 20, 53, 108, 191, 308? 465 What is next in 37, 63, 87, 109, 129, 147, 163? 177 What is the next term in 8021, 8023, 8025? 8027 What is next in 64, 257, 572, 1003, 1544, 2189? 2932 What is next in -13, -48, -121, -250, -453, -748? -1153 What is the next term in -6386, -6385, -6384? -6383 What is next in 6202, 12410, 18606, 24784, 30938? 37062 What comes next: -19, -59, -121, -205, -311, -439, -589? -761 What comes next: -87, -194, -301? -408 What is next in 524, 520, 514, 506, 496, 484? 470 What is the next term in -31, -78, -141, -226, -339? -486 What is next in 1059, 2117, 3175, 4233? 5291 What comes next: 341, 690, 1043, 1400, 1761? 2126 What is next in 15, 39, 75, 129, 207, 315? 459 What is the next term in 8, 42, 102, 188, 300, 438, 602? 792 What comes next: -2, -1, 12, 43, 98, 183, 304, 467? 678 What is next in -97, -94, -89, -82? -73 What is next in -193, -218, -267, -346, -461, -618, -823? -1082 What is the next term in 372, 1484, 3338, 5934, 9272, 13352, 18174? 23738 What is the next term in 103, 415, 935, 1663, 2599, 3743, 5095? 6655 What is next in -87, -98, -119, -150, -191, -242, -303? -374 What is the next term in 24, 32, 44, 60? 80 What comes next: -94, -205, -316? -427 What comes next: -65, -61, -57, -53, -49? -45 What is next in -100, -203, -310, -421, -536? -655 What is next in -8, 11, 18, 7, -28, -93? -194 What is next in -268, -309, -350, -391, -432? -473 What is next in -117, -151, -185, -219? -253 What is the next term in -13, -20, -29, -40, -53? -68 What is next in 780, 771, 758, 741? 720 What comes next: -9, -14, -21, -30, -41, -54? -69 What comes next: 29, 89, 151, 215, 281? 349 What is next in -397, -795, -1193, -1591, -1989? -2387 What comes next: -95, -183, -271, -359, -447, -535? -623 What comes next: 193, 384, 575? 766 What comes next: 8363, 16725, 25087? 33449 What comes next: -2524, -5084, -7658, -10252, -12872, -15524, -18214? -20948 What is the next term in -27, -42, -79, -150, -267, -442, -687, -1014? -1435 What is next in -43, -59, -89, -139, -215, -323, -469, -659? -899 What is next in 7, 43, 87, 145, 223, 327, 463, 637? 855 What is next in 5524, 11057, 16600, 22159, 27740, 33349, 38992, 44675? 50404 What is next in 17, 29, 43, 53, 53, 37? -1 What is next in -8, 15, 38, 61? 84 What is next in 27, 25, 9, -27, -89, -183, -315, -491? -717 What is the next term in 156, 341, 552, 801, 1100? 1461 What is next in 13, 8, 1, -8, -19? -32 What is next in 19, 16, 7, -8? -29 What is next in 55, 116, 177, 238? 299 What comes next: 21, 22, 33, 60, 109, 186, 297? 448 What is next in -61, -79, -97? -115 What comes next: -10, -9, -6, -1, 6, 15? 26 What is next in 7490, 7491, 7492, 7493, 7494? 7495 What is the next term in -14, -4, 14, 40? 74 What is the next term in -34, -31, -28? -25 What is the next term in 23, 31, 39? 47 What is the next term in 39, 140, 307, 540? 839 What is next in 412, 395, 352, 271, 140, -53? -320 What is next in -37, -144, -323, -574? -897 What is the next term in -50, -92, -134, -176, -218, -260? -302 What is next in 23, 40, 69, 110? 163 What comes next: 125, 507, 1143, 2033, 3177, 4575? 6227 What comes next: -118, -222, -324, -424, -522, -618, -712? -804 What is the next term in -208, -416, -624, -832? -1040 What is next in 2, -53, -204, -499, -986, -1713, -2728? -4079 What comes next: -200, -194, -186, -176, -164, -150? -134 What is next in -72, -170, -292, -432, -584, -742, -900, -1052? -1192 What is next in 176, 233, 290, 347, 404, 461? 518 What is the next term in 14, 88, 212, 380, 586, 824, 1088? 1372 What comes next: 111, 226, 341, 456, 571? 686 What is next in -12, -18, -22, -24? -24 What is next in -2965, -5924, -8883, -11842? -14801 What is the next term in -1493, -2987, -4481, -5975, -7469? -8963 What is the next term in 33, 45, 67, 99, 141, 193? 255 What is the next term in 10, 47, 100, 169, 254? 355 What is the next term in 96, 186, 272, 354, 432? 506 What comes next: -20, -46, -100, -188, -316, -490? -716 What is next in 144, 184, 224? 264 What is the next term in 36, 139, 312, 555, 868? 1251 What is next in -138, -235, -330, -423, -514, -603? -690 What comes next: 15406, 15404, 15402, 15400? 15398 What is next in 2857, 2856, 2855, 2854? 2853 What is next in 26, 25, 28, 35? 46 What is next in -43, -154, -319, -532, -787, -1078, -1399? -1744 What is next in 6, 12, 18, 24, 30, 36? 42 What is the next term in 4, 9, 0, -29, -84? -171 What is the n	{ "pile_set_name": "DM Mathematics" }
3/2 a Which is the biggest value? (a) 0 (b) -533 (c) 2 (d) 1 (e) -3/2 (f) 7233 f Which is the sixth smallest value? (a) 0.4 (b) -0.3 (c) 6/7 (d) 24977 (e) 7/6 (f) -17 (g) 3/2 g Which is the third smallest value? (a) -95 (b) -10.31 (c) -43 (d) 7 b Which is the second biggest value? (a) 0.12 (b) -0.7 (c) -835 (d) 10 (e) -10 a Which is the third biggest value? (a) 1 (b) -17384 (c) -25 (d) 5 c What is the sixth smallest value in -2, -6, 0.1, 22, 0, 2/3, 19? 19 Which is the fifth smallest value? (a) 1/23157 (b) -7 (c) 1/6 (d) -4 (e) 6 e What is the second biggest value in 2/11, 1/5, 4, -1, 2, 441, 10/11? 4 What is the third smallest value in 4, -5, -1/2, -4, 2/9785, 1224? -1/2 Which is the biggest value? (a) 344 (b) -1.5 (c) -7 (d) 31/6 (e) -0.5 a Which is the biggest value? (a) 11 (b) -3/4 (c) -15.04527 a Which is the second smallest value? (a) -0.01523 (b) 186 (c) -0.5 (d) 4/3 a What is the biggest value in -176, -0.2, 5081, 4/9? 5081 Which is the fifth smallest value? (a) 0 (b) 1 (c) 8 (d) 200.3 (e) 2132 e Which is the second smallest value? (a) -33 (b) -1 (c) -3 (d) 16 (e) -107 a Which is the biggest value? (a) 0.11917 (b) 334 (c) 0.06 b What is the third smallest value in -236054, -3, -2/21? -2/21 What is the fourth biggest value in 81, 3, 5, 11922? 3 What is the fifth smallest value in 2, 1.3, 7/19, -0.39, 0.5? 2 Which is the fourth biggest value? (a) 0.01 (b) 0.5 (c) 269178 (d) 3 (e) 5 (f) -5/4 b Which is the biggest value? (a) -5449 (b) 3/32 (c) 4 c What is the third biggest value in 180, -0.333, -18, -1/15? -0.333 Which is the second biggest value? (a) 25 (b) 0.4 (c) 0.6 (d) -2/13 (e) -7/310 (f) -0.4 (g) -3/7 c Which is the second smallest value? (a) -0.3 (b) -1822.6 (c) -791.1 c Which is the second smallest value? (a) 0.09 (b) -0.1 (c) 5 (d) 46 (e) -31 (f) -3 (g) 0.2 f Which is the smallest value? (a) -7345 (b) 2/15 (c) 4900 a What is the fourth smallest value in 5, -1/4, 2/5, -184, 2, -249? 2/5 Which is the biggest value? (a) -0.4835 (b) -4 (c) -190 (d) -0.4 d What is the biggest value in 265324/7, -1, 6? 265324/7 What is the sixth biggest value in 0.5, -67, 0.6, 1, 4, 0.14, 1.5? 0.14 Which is the fourth smallest value? (a) 0 (b) 0.4 (c) -0.5 (d) -2/25 (e) -4 (f) 4.1 (g) 8 a Which is the biggest value? (a) -2938.1 (b) -1/4 (c) -10 (d) 9 d Which is the second smallest value? (a) 7/8 (b) -4 (c) 142 (d) 9/8 (e) 6 (f) 1/6 (g) 1/2 f What is the third smallest value in 1/5, 0.1, -12905577? 1/5 Which is the fourth biggest value? (a) 5 (b) -0.04 (c) 187 (d) -44/21 (e) 0 b Which is the fourth smallest value? (a) -1 (b) 0.0266 (c) -0.052 (d) 0.1 d Which is the fifth biggest value? (a) -5 (b) 94 (c) 0.2 (d) -1/3 (e) -1 (f) 375 (g) -5/3 e What is the fourth biggest value in 1.7, -0.13, 5, -0.2, -0.3, 54, 1/40? 1/40 What is the second biggest value in 29, 3, -0.4, 0.1, 0.4, 277, -3/2? 29 What is the fourth smallest value in -3, -299.9, -8, 1, 27? 1 What is the third biggest value in 4, -16647471, 0.5? -16647471 Which is the fifth smallest value? (a) 4 (b) 1 (c) 80 (d) -1/7 (e) -0.2 (f) 20/191 a Which is the second biggest value? (a) -2 (b) 2/1427 (c) 2 b What is the third smallest value in 2, 0, -0.7, -599, -0.05? -0.05 Which is the second smallest value? (a) 0.5 (b) -1/1111 (c) -169 (d) 45 b What is the second biggest value in -6/11, 2/9, 0.214, 0.55, -20.6? 2/9 Which is the smallest value? (a) 88 (b) 1659/4 (c) 4/19 c Which is the second biggest value? (a) 0 (b) -2/104401 (c) 6/19 a Which is the sixth smallest value? (a) -5/7 (b) 1 (c) 0 (d) 0.06 (e) 692 (f) 0.1 e Which is the sixth smallest value? (a) -1/10 (b) -8 (c) 0.1655 (d) 3 (e) 7 (f) 0.07 e What is the fourth biggest value in 11/12, -60, 0.6, 0.15? -60 Which is the fourth biggest value? (a) 69 (b) -1020 (c) 0.4 (d) 1 (e) 5 (f) 0.2 c What is the third biggest value in -0.07, -1/62, 24027, 3? -1/62 Which is the fifth smallest value? (a) 14 (b) -4 (c) -26/47 (d) -35 (e) -5 a What is the third biggest value in -6, 0.07, 15.77, 76, 2? 2 What is the fourth biggest value in 1/39, -5, 0.1, 4/49? -5 What is the second smallest value in 1017, 9, -1.4? 9 What is the third biggest value in -2/259, -1611/7, 0.4, -4? -4 Which is the third biggest value? (a) -7867 (b) 2/15 (c) 1/5 (d) 4 (e) 1 (f) -0.1 c What is the fourth smallest value in 2, 0.5, -1.56, -89/48? 2 Which is the seventh biggest value? (a) 211 (b) -1/6 (c) -0.24 (d) -131 (e) 1/4 (f) 0.3 (g) -5 d What is the smallest value in 1/6, 2/7, -18, -243.038? -243.038 Which is the fourth smallest value? (a) 3/2 (b) 477025 (c) -1 (d) 0.4 (e) 1/6 a Which is the third smallest value? (a) 1.41 (b) 30.8 (c) 1.6 b Which is the third biggest value? (a) -153 (b) 5706 (c) -2/95 (d) -5 d Which is the biggest value? (a) -0.3 (b) 1/4 (c) 1.3 (d) 6 (e) 101 e What is the fifth biggest value in 0.69, 2/9, -1.48, -3, -16? -16 What is the seventh biggest value in -17, -5, 2/9, -6, -2, -1.17, 1/5? -17 What is the third smallest value in 1, -150770, -42/23? 1 What is the third smallest value in 18, -3/2, 1/9, -139/37, -1/2? -1/2 What is the third smallest value in -20, -1, -15062207? -1 What is the fourth smallest value in -6/13, 61, 152, -29? 152 What is the biggest value in 1/104, 111877, 0? 111877 Which is the fourth biggest value? (a) -2/305 (b) 0.1 (c) 146 (d) -3 (e) -2 e What is the fourth smallest value in -0.5, -3/5, 5, 3.1, 210, -1? 3.1 What is the fifth biggest value in 0.41, 7, -1/3, -194, -3, 1/6, -4/3? -4/3 Which is the third smallest value? (a) 1602 (b) -0.054 (c) 10 (d) -0.5 c Which is the fourth smallest value? (a) 0.43 (b) -2 (c) -20 (d) 0.1 (e) 75 (f) -1/3 d Which is the second biggest value? (a) 7 (b) 2/105 (c) 1.646 c Which is the second biggest value? (a) 0.3 (b) -353 (c) 7 (d) -15 (e) -13 a Which is the fifth smallest value? (a) -4 (b) 4/5 (c) 1/19 (d) -3 (e) 4 (f) 4811 e What is the third biggest value in -14/9, -5, 38, 0.5, -58, -0.3? -0.3 What is the fifth smallest value in 9.4, 1, -38/9, 15, -0.4? 15 What is the fifth smallest value in 38, -2, -1, 0.021, 1/3, -3? 1/3 What is the third smallest value in -23, 0.1596, 11, 0, 0.2, 5, 3/2? 0.1596 What is the biggest value in -5, -2/7, -3/4, 1, -3/29971, 0.2? 1 Which is the third smallest value? (a) -78 (b) 3 (c) -0.04 (d) -266 (e) 0 c Which is the fifth biggest value? (a) -2/5 (b) -966 (c) 11 (d) -3 (e) 1 (f) 5 d Which is the fourth smallest value? (a) -1 (b) -5.98 (c) 1025 (d) -0.5 c What is the second biggest value in 1, 75882, -0.3, 3/5, -2? 1 Which is the third biggest value? (a) 1 (b) 2159619 (c) -1/6 c What is the sixth smallest value in -0.01, 1, -5, -0.3, 12019, -0.4, -1? 1 What is the biggest value in -67462, 27, 1? 27 Which is the third smallest value? (a) -0.4 (b) 38 (c) -0.14 (d) -1/12 (e) -2/19 e Which is the biggest value? (a) -10519.58 (b) 591 (c) 0.3 b What is the third biggest value in 2/9, 4, 2/11, -0.06, 0.5, 5, -2704.7? 0.5 Which is the second smallest value? (a) -0.0659794 (b) 5 (c) 34 b Which is the smallest value? (a) -0.24 (b) 5 (c) -0.2 (d) 6.1 (e) 0.2 (f) 0.14 a What is the fifth smallest value in -1/5, 9/11, -3, -0.5, 95528? 95528 What is the fourth biggest value in -1, -1/4, -4/13, 5/57, 96/7? -4/13 Which is the second smallest value? (a) -6/11 (b) 2/15 (c) 0.3 (d) -185 (e) 9.22 a Which is the fourth biggest value? (a) 0.12 (b) -5 (c) 0 (d) -27 (e) 188/13 (f) 4 c What is the smallest value in 0.2, 12, 134, 0.0386, 2, 1/6, 5/2? 0.0386 Which is the second smallest value? (a) 103 (b) -4 (c) 6243 (d) 1 d What is the third smallest value in 0.79, 1/9, -0.2, -0.5, 438? 1/9 Which is the third smallest value? (a) 0.4 (b) 0.55 (c) -0.2 (d) 15 (e) -142 (f) 4 a Which is the fifth smallest value? (a) 0.4 (b) 13 (c) 3/7 (d) -19 (e) -4807/2 b What is the second smallest value in 2/13, 4, -1, 8, -1.575? -1 What is the third smallest value in -1/8, 0.05, 3/7, -4, 188.15? 0.05 Which is the smallest value? (a) 34 (b) -1/4 (c) -1/32 (d) -3 (e) 0.2 (f) -0.2 d Which is the biggest value? (a) 12 (b) 4	{ "pile_set_name": "DM Mathematics" }
c. Let n = l + 0.3. What is the smallest value in -0.1, -3, n? -3 Let p = -185/1352 - -2/169. What is the biggest value in 0.5, p, -3/11? 0.5 Let t(a) = -3a + 1. Let d(h) = 7h - 2. Let c(v) = 2d(v) + 5t(v). Let i be c(2). Let q = -25/112 + -1/16. What is the third biggest value in i, q, 1? i Let m = -0.39 + -0.01. Suppose 0 = -17o + 19o - 4. Which is the smallest value? (a) 5 (b) m (c) o b Let j = -7.2 + 7. Which is the third smallest value? (a) j (b) -5 (c) 0.03 c Let u = 70 - 69.8. Which is the third biggest value? (a) 0 (b) 2/3 (c) u a Let j = 42 + -85/2. What is the second smallest value in 3, j, 12? 3 Let j = -8.9 + 9.4. What is the fourth biggest value in -0.4, 0.04, -2, j? -2 Let b = -1.3 - -2.4. Let p = -3.9 - b. Let w = -124/3 + 41. What is the second biggest value in 2/7, p, w? w Let s = -12 + 16. Which is the biggest value? (a) 0.3 (b) -5 (c) s c Let p = -143/4 - -36. What is the third biggest value in 8, 2, 0.3, p? 0.3 Let m = -457 + 454. Let v = 0.16 - 0.2. What is the biggest value in m, -1/2, v? v Let v = 2.2 - 2.3. Let x = -0.2 - 0.3. What is the biggest value in 2/7, x, v? 2/7 Let g = 0.06 - 0. Let z = -0.14 - g. What is the smallest value in -4/7, z, -1? -1 Let a be 0/(3/62). Let b(l) = -l2 + l - 5. Let t be b(a). What is the third smallest value in -0.2, -0.4, t? -0.2 Let s = 92 + -90. Let n be 0 - -1 - 6/5. Which is the second biggest value? (a) -3/7 (b) n (c) s b Let a = 2/39 - -35/78. What is the third biggest value in -2/25, a, -0.5? -0.5 Let h be 24/(-40) - (36/40 - 2). What is the smallest value in 0.2, h, -0.06, -1? -1 Let m = -403/4 - -100. Which is the smallest value? (a) -4 (b) m (c) -0.9 a Let u = 0.52 + 0.08. Let p = -5.4 - u. Let x = -4 - p. Which is the third smallest value? (a) x (b) -1/5 (c) -5 a Let y be ((-1)/2)/(7/4). Let i = 2/17 + -21/34. What is the second biggest value in 1, y, i? y Let y be 2/618/(-24)-2. Let j = 7.18 - 0.18. Which is the smallest value? (a) j (b) y (c) 4 b Let z = 1.27 - 0.77. Let l = 0.05 - 2.05. Which is the third biggest value? (a) 2 (b) l (c) z b Let j = -0.6 + -0.2. Let r = j - 0.2. Which is the second smallest value? (a) -4 (b) r (c) 1 b Let i = 0.1 + 5.9. Let g = -27 + 38. Let d = g - i. What is the second smallest value in 0.3, d, 2/3? 2/3 Let a = -15 + 15.1. What is the smallest value in -2, 2, 4, a? -2 Let v = -2 - -4. Let z = -1.74 + 1.84. Which is the second smallest value? (a) 1 (b) v (c) z a Let v = 85 + -88. Which is the smallest value? (a) -0.05 (b) v (c) 3 b Let a = -0.1 - 0. Let c = -157/2 + 79. Let n be 2((-1)/(-2) + 0). What is the third biggest value in c, a, n? a Let m = 3.4 - -0.6. Which is the third smallest value? (a) -1/11 (b) 2/5 (c) m (d) -0.2 b Let b = 4 - 6. Let m = 10 + b. Let s be (-6)/(-8)m/(-9). What is the second smallest value in s, -2/13, -3/5? -3/5 Let p = -0.339 - -0.039. Which is the fourth biggest value? (a) 1 (b) -1/2 (c) 1/2 (d) p b Let k = 1.83 - 0.83. What is the third biggest value in -3, k, -4, 2? -3 Suppose -4y - 2f = 0, 0y + f = -y. What is the second biggest value in y, 5, 0.2? 0.2 Let z = -18.7 + 0.7. Let y = 13 + z. Let l = 1 - 0.6. Which is the third smallest value? (a) l (b) 2 (c) y b Let i = 0.8 - 2. Let q = i + 1. Let f = q + 0. Which is the smallest value? (a) 1 (b) f (c) 2 b Let d = 2 + -30. Let o = d + 27.78. Let y = 0.08 - o. Which is the second smallest value? (a) 4 (b) 2 (c) y b Let u = 57 + -76. Which is the biggest value? (a) -3 (b) 4/3 (c) 4/7 (d) u b Let y = -196/1245 + 2/83. Let x = 9.3 - 9.5. What is the third smallest value in -5/4, x, y? y Let k = 0.27 - -0.03. What is the third smallest value in k, 3, 2? 3 Let i be (-3)/(3/(-8)) - 3. Let h be 1 - i - 0/(-3). Suppose 6 = -3j - 0. What is the third biggest value in 2/3, h, j? h Suppose 5p = 5r - 15, 0 = 3r + 5p + 6 + 9. Let v = -36 - -38. What is the biggest value in -4/7, r, v? v Suppose 5k + 480 = -3z, -2k - k = -z - 146. Let d be z/(-210) - (-4)/(-7). What is the third biggest value in 3, 4, d? d Let s = -8 + 7.5. What is the third biggest value in -0.4, -5, s? -5 Let i = 38.42 - 39. Let n = i - -0.08. Let m = 0.1 - -0.1. Which is the second biggest value? (a) n (b) -2/9 (c) m b Let j = 74 - 75.1. Which is the third smallest value? (a) 0 (b) j (c) 5 (d) 2/5 d Let r = -4.5 - -4. Let z = r - -0.3. Let c = -0.3 - z. What is the second biggest value in -0.4, c, 5? c Let k = -148/45 + 26/9. Which is the smallest value? (a) k (b) 4 (c) 2/5 a Let t = -1.6 - -1.4. Which is the smallest value? (a) -2/5 (b) t (c) 2 a Let z = -3.4 + 0.4. Let m = 3 + z. Which is the biggest value? (a) -2 (b) m (c) -1/5 b Let v(g) = g - 2. Let w be v(4). Let i be (-2 - 2)w/(-4). Let k be (1/(-2))/(9/12). What is the second biggest value in i, k, -0.3? -0.3 Let h = 0.16 + -0.19. Let m = -0.03 - h. Which is the third smallest value? (a) 1/3 (b) m (c) -4 a Let s be (-12)/(-10) - 6/3. Let c = -12 + 11. Let x = 6 - 5.7. What is the second smallest value in c, x, s? s Let p(r) = -r3 + 3r*2. Suppose -3d - 13 = -2v, 4 - 11 = -5v - d. Let q be p(v). Suppose -qj - j + 15 = 0. What is the third biggest value in j, 2, 0.2? 0.2 Let h = 5119/17 - 301. What is the smallest value in -0.1, -5/4, -5, h? -5 Let p be 3/4(0/6 + -4). What is the biggest value in p, -0.03, 1/4, -2? 1/4 Let l(n) = -13n2 - 2n. Let b(t) = -25t2 - 3t. Let d(j) = -3b(j) + 5l(j). Let q be d(1). Let c be 1-2 + q/6. What is the biggest value in -0.1, -1, c? -0.1 Let m = 101.5 + -73. Let i = m - 22. Let d = -6 + i. What is the second smallest value in -0.3, 1/3, d? 1/3 Let a = 13.1 - 12. Let z = 1 - a. What is the third smallest value in 0, 1/8, z? 1/8 Let h = -9 + 27. Let u = h - 14. What is the third smallest value in -0.2, 5, u? 5 Let i be 1 - (1 - (-1 + -4)). Let a = -101.5 + 102. What is the second biggest value in 2, a, i? a Let j = -11113/4 + 2794. Let z be ((-1)/(-21))/(4/1299). Let y = z - j. Which is the third smallest value? (a) y (b) 1/2 (c) 1 c Let t be (-2)/5 - 156/(-15). Let d = t + -41/4. What is the biggest value in -0.3, d, 4? 4 Let q = -0.68 - 0.32. What is the third smallest value in q, -0.2, 2? 2 Let s = 8 + -13. Suppose 0 = -5c - 2a + 143, 113 = 5c + 3a - 34. Let r be 15/c - (-1)/(-3). What is the second biggest value in r, s, -3? -3 Let w = 41 - 43. Which is the third smallest value? (a) 3/4 (b) 0.4 (c) w a Let s = -7.3 + 7. Let n = 1.4 - 4.9. Let t = 0.5 + n. Which is the biggest value? (a) -0.2 (b) t (c) s a Let j = 40 + -48. Which is the second biggest value? (a) 5 (b) -0.4 (c) j b Let o = 3.1 + -1.1. What is the smallest value in 0.1, o, -6? -6 Let o = 0.11 - 0.51. Which is the biggest value? (a) o (b) 2 (c) 1/2 b Let z = -0.7 + 0.3. Let i(q) = -2q - 4. Let b be i(-4). Let u be (-7)/18 + b/18. What is the biggest value in z, u, -2/17? -2/17 Let s = 0.042 - -0.158. Which is the second smallest value? (a) s (b) 2/11 (c) -1 (d) 5 b Let f = -0.034 - 4.966. Which is the third smallest value? (a) -0.2 (b) f (c) -0.4 a Let p = -3 - -2.96. Let r = -4.04 - p. Let q be ((-12)/(-88))/((-3)/(-4)). Which is the biggest value? (a) q (b) r (c) -2/9 a Suppose 0 = -4n + 2w + 38, -14 = -n - 2w + 8. Let u = -977/2 - -477. Let h = u + n. Which is the second biggest value? (a) -4 (b) h (c) -5 a Let d be (-4 - -1)1/(-18). Let b = 4/3 + d. What is the third smallest value in -2, -0.2, b? b Suppose -f - u - 4 = 0, 5f + 3u + 35 = 5. Let q = -0.9 + 1. Which is the third biggest value? (a) q (b) f (c) -1/2 b Let t = 32/75 - -6/25. What is the second smallest value in 2/7, t, 2/5, -2/5? 2/7 Let t be 12/(-78) - 74/26. Let m be -2 + 4/(-7) - t. Which is the second smallest value? (a) 5 (b) 1 (c) m b Let i be (-2 + 2 + -1)1. Let g = 820.5 - 820. Which is the second biggest value? (a) i (b) -1/6 (c) g b Let f be (((-30)/(-4))/(-5))/(9/(-24)). What is the third biggest value in 2, f, 2/7, -8? 2/7 Let n = -8/3 - -7/3. Suppose -4u + 0 + 21 = -w, 0 = -4u + 20. Let h be ((-33)/15 + 2)/w. Which is the smallest value? (a) n (b) 3/2 (c) h a Let q(g) = -g2 + 6g + 8. Let u be q(8). Let d = u - -2. Which is the third smallest value? (a) d (b) -2/11 (c) -2/3 b Let y = -4 -	{ "pile_set_name": "DM Mathematics" }
+ (-19)/(-22). 220 Suppose 0 = 3i + 2g - 20, -2i - 2g + 0g = -14. Let b be 978/9 + i/(-9). Calculate the lowest common multiple of 16 and b/8 - 1/(-2). 112 Let f = 1752 - 12238/7. Let v be 1(-2)/115810. Let b = v - -16322/6369. What is the common denominator of b and f? 77 Suppose -4t + 12 = k + 3k, -5k + 19 = t. Suppose 0d - 5u = -2d + 16, -6 = -4d - 3u. What is the smallest common multiple of -4(3/(-2))/d and k? 4 Let b = 1986 - 21869/11. Calculate the common denominator of b and 23/43. 473 Let x be 2 - (-2 - (16 + -2)). Suppose m - x = -m. Let b = 19 - 10. What is the lowest common multiple of b and m? 9 Let o be (-2 + 4)/(-2) - -190. Let n be (6/(-5))/(3/(-40)). What is the common denominator of (o/16)/((-12)/n) and -65/9? 36 Let j(d) = d*3 - 3d*2 + 2d - 4. Suppose -24z + 17z + 14 = 0. What is the least common multiple of j(3) and z? 2 Suppose 5k - 2 = 68. What is the smallest common multiple of 20 and k? 140 What is the smallest common multiple of 2 + (0 - -4)/2 and 16? 16 Let t be (6/9 + 2)-3. Calculate the lowest common multiple of 5 and (30/(-8))/(3/t). 10 Let o be 3 - (-3)/3 - 2. Suppose -b - 4 = -ob. Suppose 31 = 3z + 5c, -bz + 2c + 17 + 33 = 0. What is the lowest common multiple of 4 and z? 12 Suppose -2t = 3t - 90. Let z = 12 - 21. Calculate the smallest common multiple of ((-6)/(-5))/(z/(-90)) and t. 36 Calculate the lowest common multiple of 18 and 3/(-5) - (9 + 153/(-5)). 126 Suppose 0 = k - 2 - 3, -25 = 2y - 3k. Calculate the common denominator of -41/11 and 3/y + (-1345)/(-200). 88 What is the common denominator of (-9(-1)/10)/((-8)/20) and 97/16? 16 Calculate the common denominator of 5/25-3 - (-572)/70 and 59/7. 7 What is the smallest common multiple of 2/(-12) + (-327)/(-18) and 14? 126 Let z(c) = c2 - 5c + 4. Let o be z(5). Suppose -oi = i. Suppose i = -3a - 10 + 37. What is the smallest common multiple of 9 and a? 9 Let j(g) = g + 3. Let v be j(4). Let r(k) = 2k2 - 7k - 3. Let b be r(6). Suppose b = 2m + v. What is the lowest common multiple of 14 and m? 70 Calculate the smallest common multiple of 24 and (18/8)/((-3)/(-28)). 168 Suppose 2i - 24 = -2q, 5q = -2i + 27 + 18. Calculate the common denominator of 54/4q/84 and 20/7 - (0 + -1). 56 Suppose -4c + 21 = -47. Suppose 1 = -2f + c. What is the lowest common multiple of 8 and f? 8 Suppose -4w = -5w + 4. What is the smallest common multiple of ((-10)/3)/((-7)/6 - -1) and w? 20 Let a(i) = -i*3 - 8i*2 - 2i - 11. Let v be a(-8). Suppose 6t = t + v. Calculate the lowest common multiple of 18 and t15 - (-2 - -3). 126 Let z = 5 - -3. What is the smallest common multiple of 11 and z? 88 Suppose 2r - 4 = r. What is the least common multiple of 5 and r? 20 Let x(y) be the third derivative of -y6/120 + 7y5/60 + y4/12 - 5y3/6 + 4y*2. Calculate the least common multiple of 1/(-5) - 44/(-20) and x(7). 18 What is the common denominator of -682/18(-8)/56 and -64/9? 63 Let p(d) = d - 2d*2 - 6d3 - d3 - 8d3. Let c be p(1). What is the smallest common multiple of (-5 - -2)/(6/c) and 11? 88 Let z(w) = w3 - 6w*2 + w - 6. Suppose -2 - 22 = -4y. Let u be z(y). Calculate the common denominator of 238/(-40) - (u - 1) and 119/12. 60 Let t = -56 - -72. Calculate the smallest common multiple of 10 and t. 80 Suppose 0x = -2x - 3g - 4, 2g = -2x. What is the lowest common multiple of x and 1? 4 Let f(j) = j - 4. Let p be f(5). Let q = p + 3. What is the lowest common multiple of q and 3? 12 Calculate the common denominator of -3/4 and ((-6)/(-3)1)/(27/(-33)). 36 Suppose l = 3, -3l = -4o + 2l + 17. Suppose 0 = d - 2d - o. What is the common denominator of 303/(-70) + d/(-20) and -9/14? 14 Let q = -25 + 72. What is the least common multiple of 6 and q? 282 Let y be (-34)/(-4) - 2/(-4). Let l be (-6)/(-27) + (-47)/y. Let c = l - -11. Calculate the least common multiple of c and 2. 6 Let d = -13051/8 - -1625. What is the common denominator of d and -2 - (-4)/(-10) - -2? 40 Suppose 0 = 5a - 3a - 100. Find the common denominator of 37/3 and a. 3 Suppose -4b = -2b - 22. Let s(x) = x*3 + 4x*2 + x - 4. Let r be s(-3). What is the least common multiple of b and (8 - 1) + r/(-2)? 66 Let k = 95 + -65. Calculate the least common multiple of k and 10. 30 Let r = 148/11 - 13. Calculate the common denominator of r and 3/10. 110 Let i = -15 - -21. What is the smallest common multiple of 2 and i? 6 Suppose -6 = l - 0l. Calculate the common denominator of l/56(-10 - -16) and 25/4. 28 Let s = -2 + 0. Let j = 13 - 8. What is the smallest common multiple of j and s/(42/(-44))? 55 Let x = -3672/5 + 33082/45. Let r be -1 - (2 - 589/(-720)). Let q = x + r. Find the common denominator of q and -59/22. 176 Let g = -1275 + 12769/10. What is the common denominator of 21/10 and g? 10 Suppose 6j = j + 210. Calculate the common denominator of 42/11 and ((-469)/j)/(6/4). 99 Suppose s - 4y = -2s - 251, -2s - 164 = -2y. Calculate the common denominator of (-1010)/(-8)2/(-10) and (26/3)/(s/(-21)). 44 Suppose 5r - 19 - 31 = 0. Suppose z + t = -3z + 20, -2z + r = -3t. Suppose 0 = -zv + 2 + 13. What is the least common multiple of v and 3? 3 Let z be -1 + 4889/(-5634) - -1. Let m = z - 24/313. Find the common denominator of m and ((-1314)/45)/((-64)/10). 144 Let b(t) = t + 2. Let x be b(13). Find the common denominator of -5 and x/3(-46)/(-15). 3 Suppose -2c + 0c + 6 = 0. Suppose cm = -2m - 30. Calculate the common denominator of ((-1)/(-6))/(m/111) and 1/16. 48 Let m = 31957/12 - 2665. Calculate the common denominator of 85/8 and m. 24 Let v = -4422 + 61869/14. Calculate the common denominator of -91/6 and v. 42 Let z(l) = -l + 249. Let v be z(0). What is the common denominator of 12/11 and 1/(30/v) - 0? 110 Let a(s) = -s*2 - 7s + 28. Calculate the least common multiple of a(-9) and 3 + -2 + (0 - -9). 10 Suppose 0x - 3 = -x. Suppose 2g + 16 = 5l - 8, 3l - 2g = 16. Suppose -r = -lr + 9. What is the lowest common multiple of r and x? 3 Suppose 5q + 48 = -5x + x, -5x + 14 = -3q. Calculate the common denominator of -28/11 and (-153)/q(-12)/18. 44 Calculate the common denominator of 67/6 and 79/(-12) - -4 - -1. 12 Suppose 9y - 14y = -120. What is the lowest common multiple of 14 and y? 168 Suppose 5n - 4 = -k + 6, 40 = 4k + 3n. Suppose kl = 9l + 8. What is the lowest common multiple of 6 and l? 24 Let f(r) be the second derivative of r*3/6 + 7r*2 + r. Calculate the least common multiple of 2 and f(-6). 8 Suppose 30 = -0f + 3f. Let y = 12 + f. Let q(d) = d3 + d2 - d + 2. What is the smallest common multiple of y and q(0)? 22 Let x(j) = j2 + 7j + 6. Calculate the least common multiple of x(-7) and 11. 66 Let o(k) = 644k2 - k - 1. Let v be o(-1). Let p = -12877/20 + v. Let q = -7869 + 157417/20. Find the common denominator of p and q. 20 Let l = -625954 - -461958353/738. Let v = -95/123 + l. Calculate the common denominator of v and -49/2. 18 Calculate the least common multiple of 10 and (-201)/(-9) + (2/3 - 1). 110 Let b(w) = -4w*3 - 8w*2 + 7w - 10. Let z(g) = -g*3 - 3g*2 + 2g - 3. Let y(u) = 2b(u) - 7z(u). What is the smallest common multiple of y(5) and 11? 11 Suppose -4b + 3b = -9. Let u = -9 - -15. Calculate the least common multiple of u and b. 18 Let v = -1 + -1. Calculate the lowest common multiple of (28/10)/(2/5) and (0 - v)18/4. 63 Suppose -4a - 16 = -2q, -3q - 15 = 3a - 66. Suppose 5 = n + 5u, -u - 23 = -3n + 2n. Calculate the least common multiple of q and n. 140 Suppose 5i = 5q + 5, 5q - 8 = -i + 11. Let g(y) = 0y + 2 - 6 + 4y. Calculate the least common multiple of g(q) and 3. 24 Suppose 3m - 1 = 8. Suppose -i + 2k = -10, 3i + mk = -0 + 3. Find the common denominator of 43 and (-9)/2i/(-3). 1 Suppose -w - 35 = -4g + 2w, 0 = 2g - 3w - 19. Let x(u) = -u*2 - 5u + 8. Calculate the lowest common multiple of x(-6) and g. 8 Calculate the smallest common multiple of 6 and (4 + (-32)/6)-9. 12 Let b = 26 - 26. Suppose 9h - 6h - 18 = b. What is the least common multiple of 8 and h? 24 Suppose -4o + 4 = -3o. Suppose -8 = 6r - 2r, 3r = 2c + 6. Let l(n) = n3 + 6n**2 - n + 6. Calculate the lowest common multiple of l(c) and o. 12 Let a	{ "pile_set_name": "DM Mathematics" }
derivative of -50c3/3 + 3c + 244. Let o(r) = 4r2. Give o(q(l)). 40000l*2 Let j(g) = -440076841g. Let p(h) = -2h2. Determine p(j(f)). -387335251969078562f2 Let p(u) = u2 - 2u - 134. Let t(a) = -441a. Determine t(p(l)). -441l2 + 882l + 59094 Let i(o) = -10o - 323. Let q(m) = m + 33. Let v(k) = -i(k) - 6q(k). Let d(s) = -2s. What is d(v(c))? -8c - 250 Let u(g) = -37640g2. Let c(j) = -11j. Calculate c(u(b)). 414040b2 Let z(s) = 50s. Let a(x) = 43765x2 + 24. What is z(a(m))? 2188250m*2 + 1200 Let o(j) = -6j*2 + 2. Let h(g) be the second derivative of 5g4/6 + g3/6 - 2295g. Give h(o(b)). 360b*4 - 246b*2 + 42 Let l(t) = -143t*2. Let z(w) = -w - 4. Let n(b) = 133b + 494. Let m(v) = 2n(v) + 247z(v). What is m(l(h))? -2717h2 Let l(a) = 4a. Let z(w) = -9w. Let o(r) = -13l(r) - 6z(r). Let m(v) be the second derivative of 0v*3 + 1/6v*4 + 0 - 66v - 3/2v2. Give m(o(p)). 8p*2 - 3 Let t(v) = 25v*2 + 24v + 6. Let i(q) = -903q2 - 868q - 217. Let l(y) = -6i(y) - 217t(y). Let g(r) = r*2 + 1. Determine l(g(x)). -7x*4 - 14x*2 - 7 Let m(s) = -3190s*2 + 2013. Let y(p) = -2p. Give m(y(j)). -12760j2 + 2013 Let u(x) = 63x + 2. Let l(w) = -334w + 21. Let a(y) = -63y + 4. Let c(p) = 21a(p) - 4l(p). Give c(u(m)). 819m + 26 Let n(q) = -1890q*2. Let y(l) = 1422l. Determine y(n(h)). -2687580h2 Let g(r) = -14975188r2. Let i(f) = -f2. What is i(g(k))? -224256255635344k4 Let x(s) = -21s + 2338. Let g(c) = c - 1169. Let q(j) = -6g(j) - 3x(j). Let b(m) = -m2 + m2 - 3m2. Give b(q(t)). -9747t*2 Let j(b) = 17b. Let n(z) = -z*3 + 5z*2 - 6z. Let x be n(6). Let c be (-2518)/(-9) + (-16)/x. Let t(u) = 2u2 - 280 + c. Calculate t(j(p)). 578p*2 Let t(f) = -86f*2. Let q(p) = -7p*2 + 10p + 5. Let r(z) = -4z2 + 6z + 3. Suppose -90k = -86k - 24. Let a(y) = kq(y) - 10r(y). Determine t(a(h)). -344h4 Let w(a) = 2a*2. Suppose -13i + 16 = -9i. Suppose 86 = ir + 3o, -4r - 2o + 88 = 2o. Let p(z) = -rz + 16z + 19z. What is p(w(v))? 30v*2 Let n(i) be the second derivative of 31i*4/12 + 13i*2/2 + 68i. Let t(f) = 15f2 + 6. Let q(w) = 6n(w) - 13t(w). Let d(g) = -g2. What is d(q(r))? -81r*4 Let i(m) = 11m. Let s(h) = 14439h2 - h - 141. Give s(i(o)). 1747119o*2 - 11o - 141 Let g(b) = 92b. Let k(r) be the first derivative of -r4/24 - 19r*2/2 - 25. Let v(w) be the second derivative of k(w). What is v(g(d))? -92d Suppose 0 = -4j + 2 + 6. Let l(g) = g2 + 0g*j - 2g*2. Let o(a) be the second derivative of 11a*4/12 + 3237a. Give o(l(b)). 11b4 Let t(k) = -6k*2 + 18k*2 - 10k*2 - 5k*2. Let x(d) = -19d*2 + 2d - 2. Let j(h) = 97h2 - 11h + 11. Let z(q) = 2j(q) + 11x(q). Give z(t(c)). -135c4 Let g(w) = 0w + w - 3w. Let r(p) = -33p. Let q(l) = -280l + 15757 - 15757. Let h(b) = -5q(b) + 42r(b). Give h(g(j)). -28j Let o(s) = 2s. Let w = 199 - 69. Let y(q) = 29q + 62q + wq + 65q. Calculate y(o(i)). 572i Let f(i) = 3489i2. Let p(h) = -1048h*2. Calculate p(f(g)). -12757430808g*4 Let j(r) = -418r3 + r2. Let w be j(-1). Let a(t) = wt - 419t + 9t2. Let l(z) = -3z. What is a(l(n))? 81n2 Let i(c) be the third derivative of c2 + 0c*3 + 0c + 0 + 67/24c4. Let b(u) be the third derivative of u5/30 - 259u*2 + 29. Give i(b(g)). 134g*2 Let j(c) be the first derivative of -2c*3/3 - 2387. Let o(u) = 134u - 8. Determine o(j(y)). -268y2 - 8 Let l(b) = b - b + 23b2. Let s(u) be the third derivative of -u4/24 - 443618u2. Calculate s(l(i)). -23i*2 Let s(q) = 42q. Let w(v) = 150112v2. Calculate w(s(d)). 264797568d*2 Let p(h) = -2h + 450. Let s(a) = -a + 150. Let k(g) = -p(g) + 3s(g). Let z(y) = 7818y. Determine k(z(t)). -7818t Let r(t) = 16t. Let z(s) = -252189s. What is z(r(f))? -4035024f Let u(z) = -220z. Let q(k) = 33k*2 + 25k + 2. What is q(u(h))? 1597200h2 - 5500h + 2 Let j(l) be the first derivative of 20/3l3 + 0l*2 + 13 + 0l. Let n(g) = 5g2. Give n(j(s)). 2000s*4 Let s be (4 + -1)/(2/(-6)3). Let j(x) = -19x. Let b(h) = 52h. Let q(y) = sb(y) - 8j(y). Let g(a) = -6a2 - 3. Give g(q(n)). -96n2 - 3 Let g(z) be the first derivative of -z2/2 + 1662. Let b(o) = o - 1999. What is g(b(k))? -k + 1999 Let l(h) = -2h2. Let a(w) = 7w*2 - 64w*2 + 140786776 - 140786776. Give a(l(c)). -228c4 Let h(j) = j2. Let o(q) = -q*2 - 23q + 57. Let x be o(-23). Let p(f) = -51f2 - 57 + x. What is p(h(t))? -51t*4 Let z(m) be the first derivative of -5m*3/3 + 74m + 2300. Let y(j) = 3j. Give y(z(p)). -15p*2 + 222 Let y(q) = 3q. Let t = 234 + -227. Let i(c) = 7c + 5c*2 - tc + 9c2. Determine i(y(u)). 126u2 Let n(o) be the first derivative of o3 - 8776. Let v(d) = -851d2 + 2d. What is v(n(g))? -7659g4 + 6g*2 Let s(z) = -560963z. Let u(r) = 36r2. What is u(s(h))? 11328461545284h*2 Let p(c) = -203c*2 - 158c + 5. Let l(i) = 101i2 + 63i - 2. Let y(b) = 5l(b) + 2p(b). Let v(n) = -18n. What is v(y(j))? -1782j*2 + 18j Let r(q) = -12q2. Let c(m) be the third derivative of -m6/36 + 10m*3 + 37m*2. Let k(w) be the first derivative of c(w). Give r(k(a)). -1200a*4 Let o(v) = -10v*2 + 8v - 24. Let t(f) = -f*2 - f + 3. Let x(n) = -o(n) - 8t(n). Let a(d) be the first derivative of 3d2/2 - 5. Give a(x(p)). 54p*2 Let z = -3057 - -3061. Let x(a) be the third derivative of 1/24a*z - 6a*2 + 0a + 0a3 + 0. Let f(j) = j2. Give f(x(l)). l2 Let t = -228 - -240. Suppose 0 = 5u - 1 + 16. Let a(f) = -5f2 - 4f. Let c(x) = -x*2 - x. Let r(y) = tc(y) + ua(y). Let n(o) = 3o*2. What is r(n(b))? 27b*4 Suppose -5q + 111 = 3a, -4a + 5q - 74 = -6a. Let k = -35 + a. Let f(j) = kj + 14j - 4j + 12j. Let n(d) = 3d2. Give f(n(l)). 72l*2 Suppose 0 = -0m + m - 4y + 3, -5y - 6 = 2m. Let d be (-1 - m)(4 + -2). Let t(k) = -6 - d + 38k2 + 10. Let p(r) = 2r*2. What is p(t(l))? 2888l*4 Let o(y) = -309453436y. Let c(k) = -2k2. Give o(c(v)). 618906872v*2 Suppose -2b - 2b + 12 = 2q, -2 = q. Let h(x) = -b - x + 4. Let v(c) = -16c2 + 6c*2 + 20c*2 + 23c - 17c2 - 23c. Determine v(h(k)). -7k2 Let q(b) = 13b. Let p(y) = 6639950y. Calculate p(q(r)). 86319350r Let i(z) = -8z + 2041287. Let n(l) = l2. What is i(n(y))? -8y*2 + 2041287 Let d be 6/(-15) + 68/20. Let v(k) = -d - 68k + 61k + 3. Let b(q) = -11 - 4q - 10 + 21. Determine v(b(j)). 28j Let x be 2/(-3) - 44/(-3). Let d(s) = -13 + 5s + x - 1. Let k(v) = v*2. Determine k(d(r)). 25r2 Let y(k) = -k2 - 384k. Let g(j) = -37j. Let z(x) = -31x. Let t(o) = -5g(o) + 6z(o). Give y(t(c)). -c2 + 384c Let c(d) = 6529d. Let b(k) = -k2 + 5k + 1. Let y(z) = -z*2 + 15z + 3. Let p(l) = -3b(l) + y(l). Calculate p(c(u)). 85255682u*2 Let b(l) be the second derivative of 5l*4/12 + 712l. Suppose s + 9 + 3 = 5f, -5f = s - 8. Let k(r) = 0r2 - 7r2 + rf. What is b(k(h))? 180h4 Let a(s) = -2s. Let m(r) = -30r3 + r2 + 3r + 2. Let d be m(-1). Let x(w) = -3w - 2w + 55w + dw. Calculate x(a(h)). -160h Let c(o) = 7o*2. Suppose -5b + 91 + 214 = 0. Let a(j) = -bj2 + 22j*2 + 25j*2 + 29j*2. Calculate c(a(p)). 1575p*4 Let u(v) = 153v2. Let h(l) be the first derivative of l4/24 - 7l2 - l + 94. Let m(r) be the second derivative of h(r). Give u(m(a)). 153a*2 Let b(n) = 7n*2. Let g(f) = 13370815f. Calculate g(b(a)). 93595705a2 Let k(v) be the third derivative of -v5/15 - 262v*2. Let w(h) = -2 - 3 + 5 + 14h*2. What is k(w(j))? -784j*4 Let m(j) = -34222j*2. Let i(c) = 156c. What is m(i(z))? -832826592z2 Let m(i) = 773260i*2 - i. Let r(g) = 3g. Give r(m(s)). 2319780s2 - 3s Let s(y) = -9y. Let k(w) = 12w. Let v(i) = 3i + 48. Let x(a) = -a - 20. Let r(n) = -5v(n) - 12x(n). Let o(u) = -4k(u) - 11r(u). Give s(o(p)). 135p Let m(l) = 3l2. Let d(c) be the third derivative of c5/6 - 2c*3/3 - 332c*2. Calculate m(d(p)). 300p*4 - 240p*2 + 48 Let s(h) = -53372h + 23. Let a(w) = -w. What is s(a(k))? 53372k + 23 Let q(y) = -200y*2 + 19155y. Let p(h) = 6h. Calculate q(p(i)). -7200i*2 + 114930i Let c(n) be the	{ "pile_set_name": "DM Mathematics" }
3 Let y(d) = -d - 3. Let v be y(-6). Calculate the highest common factor of v and 6. 3 Let l(v) = -v*3 - 7v2 - v + 2. Let u(j) = -j2 - j + 5. Let c be u(-4). Let x be l(c). Calculate the highest common factor of x and 3. 3 Let g(a) = 11a2 + 5a + 7. Suppose -3n + m + m - 13 = 0, 2n + 10 = 2m. Let j be g(n). Calculate the greatest common divisor of j and 13. 13 Let f = 41 - 22. What is the highest common factor of f and 209? 19 Let g = 23 + -19. Suppose 0 = -3w - gl + 55, l - 103 = -5w - 0l. What is the greatest common factor of 168 and w? 21 Let i be 3/2 + 441/6. Suppose 4v + 14 = 50. Suppose vt - i = 6t. Calculate the greatest common factor of 10 and t. 5 Let p be (12/(-42) + (-40)/7)-2. Suppose -24 = -4j + 2l, -4j = -2j - 3l - 20. What is the highest common divisor of j and p? 4 Suppose h = 29 + 39. Let m be 8/20 + h/5. Calculate the greatest common divisor of m and 21. 7 Suppose 0 = b + 3b + 16. Let h be (-7)/2 - 2/b. Let s be -1 - (1 + h + -7). What is the highest common divisor of 4 and s? 4 Let q(y) = -17y - 9. Let f be q(-7). Let m = 10 + 12. Calculate the highest common factor of m and f. 22 Suppose 5n = -5c + 15, -n = 5c - 2n - 33. Calculate the greatest common divisor of c and 48. 6 Suppose 3r - 4g + 670 = 0, -5g + 587 = -2r + 138. Let z = -150 - r. Calculate the highest common divisor of z and 8. 8 Let g(i) = -i + 6. Let b(a) = -a + 1. Let o be b(4). Let s be g(o). What is the greatest common divisor of 18 and s? 9 Let x be 3/(-9) + (-100)/(-12). Suppose -3k + 2k = -16. What is the greatest common divisor of k and x? 8 Let i be (-54)/(-36) + 986/4. What is the highest common factor of i and 62? 62 Let q be 2/(-3)(-9)/(-6). Let m be (3 + -6 + q)-1. Calculate the highest common factor of 28 and m. 4 Let d be (384/(-120))/(4/(-30)). Calculate the highest common factor of d and 120. 24 Suppose -50 = -4v + 3w + 13, 5w = 5v - 85. Suppose -2l + 48 = 36. Calculate the highest common divisor of v and l. 6 Suppose -5z - 35 = -0. Let l(k) = -k*2 - 9k - 8. Let h be l(z). Calculate the highest common factor of h and 54. 6 Let b(v) = v*3 + 11v*2 + 10v + 4. Let s be b(-10). Suppose 0 = -4w + a + 21, sw - a - 15 = 2a. What is the highest common factor of w and 4? 2 Suppose 5m = -4a + 130, 2m + 2m - 73 = 3a. Calculate the greatest common divisor of 198 and m. 22 Let t be (0 + 1)/((-2)/(-464)). Calculate the greatest common divisor of t and 29. 29 Suppose 2q - 60 = -3f - q, 2f = -3q + 39. Let h be 94/7 + 32/56. Calculate the highest common factor of h and f. 7 Let d be 28 - (2 - 4) - 0. Let w be (10/(-5))/((-4)/d). Let k(j) = 8j - 1. Let i be k(2). What is the highest common factor of w and i? 15 Let r = 4 + -6. Let a be 315/6 + r/(-4). Suppose 0 = 5y + 8 - a. What is the highest common factor of y and 1? 1 Let i(t) = 2t2 - 2t - 2. Let o be i(2). Suppose -oa - 54 = -180. Let w(v) = -v2 + v + 9. Let z be w(0). What is the greatest common divisor of z and a? 9 Let j = -48 + 93. What is the highest common factor of j and 18? 9 Let x = -9 - -29. Calculate the highest common factor of 4 and x. 4 Let p(r) = 3r - 12. Let v be p(10). Calculate the highest common factor of 18 and v. 18 Let b be ((-18)/(-4) + -2)2. Suppose -bn - 1 + 66 = 0. What is the greatest common divisor of n and 117? 13 Let w(r) = r*3 - 3r*2 - 2r + 7. Let q be w(4). Suppose -3n - 3p = -0p - 120, -4n = p - 175. What is the greatest common divisor of n and q? 15 Let y = -2 - -15. Let z = y + -10. Suppose -3u - 6k = -zk - 93, -u + 35 = -3k. What is the highest common divisor of 8 and u? 8 Suppose -5i - 2w = 21, -4i + 2i - 3 = -w. Let t be 0(-1)/i - -18. What is the greatest common divisor of 180 and t? 18 Let k(r) = 8r + 2. Let m be k(-4). Let u be (-3 + -1)m/8. What is the highest common factor of u and 45? 15 Let t(c) = 4c - 2. Let u be 2/3 - (-56)/24. Let f be t(u). Suppose -3m - 5w = -0 - 30, -5m - 4w = -50. What is the greatest common factor of m and f? 10 Suppose 2n + n = -9. Let k be 11/4 - n/12. Let a be 86 + -2k/3. What is the greatest common divisor of 14 and a? 14 Suppose 0 = 2v - 13 + 7. Suppose -vh - 9 = -5k - 4, -2k + 18 = 2h. What is the greatest common divisor of h and 55? 5 Suppose -5w + 19 + 11 = 0. Let z be 92/5 - w/15. Calculate the greatest common divisor of z and 6. 6 Suppose -3b - 30 = 2b. Let h be ((-21)/b)/(-7)-126. What is the highest common divisor of 7 and h? 7 Let x = 5 + 19. Let v(f) = -f2 - 8f. Let z be v(-4). Calculate the greatest common factor of z and x. 8 Let r be -21/4-38. Let d be ((-4)/(-2))/(3/57). What is the highest common divisor of d and r? 19 Let u be 5/((-2)/(-10) - 0). Let b(y) = -y*3 - 2y*2 + 2y + 2. Let a be b(2). Let v = a - -15. Calculate the highest common divisor of v and u. 5 Let m be -2 + (2 - -3) + 34. Let b = m + -20. Calculate the highest common divisor of b and 34. 17 Suppose 4i = -2q + 496, -2q = -q - 3i - 233. Let t = -241 - -263. Calculate the greatest common divisor of t and q. 22 Let u be 570/8 + -2 - 51/(-68). Let d(f) = -f*3 - 3f*2 - 4f - 2. Let o be d(-3). What is the greatest common divisor of u and o? 10 Suppose -3t + 63 - 18 = 0. Calculate the greatest common factor of 135 and t. 15 Let r be 12/15 - 168/(-15). Calculate the greatest common divisor of 96 and r. 12 Suppose 0u - 24 = -6u. What is the highest common factor of u and 6? 2 Suppose 5j = 1063 - 343. Suppose 314 = 2i + 3s, i - s - 4s = j. What is the greatest common divisor of 14 and i? 14 Suppose -2c - 4 = -10. Let w be (-105)/(-6) - c/6. Calculate the highest common factor of 153 and w. 17 Let x be (-2 - (-4 - 29)) + -3. Calculate the greatest common factor of x and 140. 28 Let x be (-12)/(-7) + 22/77. Suppose p + 2s = -s - 7, -s = -2p + 14. Calculate the highest common factor of p and x. 1 Suppose -3v = -0t - 5t + 125, 0 = t + 3v - 7. Calculate the highest common divisor of t and 66. 22 Let v be 252/66 + 4/22. Suppose 0 = -vg - l + 27, g - 4l - 18 = -7. What is the greatest common divisor of 77 and g? 7 Let k(g) = g*2 - 8g. Let j be k(4). Let b = j - -29. What is the greatest common factor of 13 and b? 13 Suppose 5g = -o + 32, -2o + 7g - 4g - 1 = 0. What is the highest common divisor of o and 7? 7 Suppose -4 = -u - 1. Let z = -4 + 25. Calculate the highest common divisor of z and u. 3 Let d(k) = k*2 + k - 15. Let p be d(0). Let h = 18 + p. Suppose 0 = -3j + 12 - 3. What is the highest common factor of h and j? 3 Suppose 0 = 3p - 59 + 11. Let w = p + -9. What is the highest common factor of w and 77? 7 Let t(p) = -p3 + 10p*2 - 8p - 5. Suppose -5i = -2i - 27. Let z be t(i). What is the highest common divisor of z and 2? 2 Let q be 9 + (-2)/1 + -1. Let r(w) = 2w + 4. Let l be r(q). What is the highest common factor of 2 and l? 2 Suppose -17h - 10 = -18h. What is the highest common factor of h and 35? 5 Suppose 165 = 5i - 3k, -2k + 25 = 4i - 85. Let l(o) = -o3 - 3o*2 + 2o - 2. Let y be l(-4). What is the greatest common factor of i and y? 6 Let o(x) = x - 9. Let a be o(21). Calculate the greatest common factor of 12 and a. 12 Let g = -26 - -44. Suppose -4l + 6l - 80 = 0. Suppose l = n - 2j, 4n = 4j - 52 + 204. What is the highest common divisor of g and n? 18 Let i(v) = -v3 + 5v*2 + 7v - 5. Let g be i(6). Let o be g/(3(-1)/(-6)). Suppose -l = o - 5. What is the greatest common divisor of 24 and l? 3 Let a = 15 + -1. Suppose 0 = 3h + j + 2784, -3j = h - 2j + 928. Let x be (-8)/12 - h/6. What is the highest common factor of a and x? 14 Let j be ((-1)/(-1) - 0) + 15. Let g(o) = -o - 4. Let b be g(3). Let z = b + j. What is the highest common factor of z and 9? 9 Suppose 0l - 2l - k + 44 = 0, 4k + 8 = 0. Let h = l + -11. What is the highest common divisor of 60 and h? 12 Let j be 286(84/8)/7. Let a = 44 - 11. Let x be ((-11)/a)/((-1)/j). What is the greatest common divisor of 13 and x? 13 Suppose 27 = -t + 2. Let n = t + 96. Let i = 121 - n. What is the highest common divisor of 20 and i? 10 Suppose -x - 3o + 19 = -20, 0 = -5x - o + 167. What is the highest common factor of x and 22? 11 Let r(n) = 4*n - 1. Suppose 6 = -z + 4. Let j be 2/z + (-2 - -5). Let q be r(j). Calculate t	{ "pile_set_name": "DM Mathematics" }
, -4g - z = -2z - 15. Let v(k) = -4k3 - 2 + 3k*g + 3k - 2k + 1 + 2k*2. Let s(l) = 3l*2 + l. Let p be s(-1). What is v(p)? 1 Suppose -d - 22 - 17 = -5l, -27 = -l + 5d. Let j be l/(-14)0/1. Let t(a) = -a2 + 2. Determine t(j). 2 Let d(s) = -s2 - 6s. Let r be 3 - (6 - (3 + -6)). Determine d(r). 0 Let i(g) be the second derivative of -g3/2 + 3g*2/2 + g. Suppose -3r = -2f - 9, -f = 5r + 3f - 37. Let a = r + -2. What is i(a)? -6 Let z(q) = q3 + 10q - 3q - 8q*3 - 7 + 4q*2 + 6q3. Calculate z(5). 3 Let z = -11 + 8. Let v(y) = -y3 - 2y2 + y - 3. Give v(z). 3 Let j(u) be the second derivative of u5/20 - 5u*4/12 - 5u*3/6 + 3u*2/2 - u + 18. Determine j(6). 9 Let t be -34/6 - -6. Let s(q) = 5q - 2q2 + 2 - q2 + tq2. Let g be (5/15)/(2/(-12)). Determine s(g). -4 Let u(f) = -2f*2 + 2f + 2. Let g(b) = b*3 - 12b*2 + 29b - 20. Let a be g(9). Determine u(a). -10 Let h(d) = 48d - 17d - 1 - 25d - 17d. Determine h(-1). 10 Let i(u) be the second derivative of u*5/20 + 5u*4/12 + 2u*3/3 - 2u*2 - 6u. Calculate i(-4). -4 Let t be 3(8/3 - 2). Let u(k) be the third derivative of 0 + 1/3k*3 - 1/24k*4 + 2k*t + 0k. Give u(3). -1 Let u(i) = -7i - i - i3 + 7i - 4 + 2 - i*2. Let t be 4/14 + 414/21. Suppose -5v = r - t, 0 = -r - 3v + 17 - 5. What is u(r)? -2 Let n(h) be the third derivative of 1/2h*3 + 1/12h*4 - 9h*2 + 0h + 0. Give n(-3). -3 Let v(t) be the third derivative of -t6/30 - t4/24 + t2. Let k = 13 + -10. Let q(o) = o - 2. Let c be q(k). Determine v(c). -5 Let a(j) = j2 + 7j - 7. Let c be 2/((-8)/(-6))224/(-48). Give a(c). -7 Let a(c) = -6c2 - 11c - 1. Let y(d) = 5d2 + 10d. Let q(p) = 6a(p) + 7y(p). Give q(4). -6 Let m(u) = 3u3 - 3u*2 + 1. Let f be m(1). Let v(t) be the first derivative of 0t - 2t2 + f - 4/3t*3 - 1/4t*4. Determine v(-3). 3 Let x = -10 + 15. Let v(n) = -7n + 15. Let i(k) = 7 - 2k + 2k - 3k. Let q(y) = 5i(y) - 2v(y). Calculate q(x). 0 Let d(x) be the third derivative of 0x - 1/6x3 - 1/30x*5 - 1/24x*4 + 0 + 2x2. Let n = 3 + -5. Determine d(n). -7 Let s(p) be the second derivative of -p4/12 + p*3 - 2p*2 - 2p. What is s(4)? 4 Suppose -2f = 2f. Suppose -4g = a - 16, 1 = -g - fa + a. Let s(u) = -u*3 + 3u2 + 3. What is s(g)? 3 Let x(g) be the first derivative of -g2 + 5/3g3 + 4 - g. Let w(t) = t3 - t2 - 2t - 1. Let f be w(2). Give x(f). 6 Let w(s) be the third derivative of s4/4 - s3/6 + s*2. Let b = -1 + 4. Suppose 3l + b = 6. What is w(l)? 5 Let m(a) = -2a2 + 3a - 3. Let h(p) = -2p2 + 3p - 3. Let v(f) = 5h(f) - 4m(f). Calculate v(4). -23 Let s(a) be the first derivative of -1/4a4 - 2a*2 + 5/3a*3 - 9 + 0a. Let i be ((-4)/2)/((-2)/3). Calculate s(i). 6 Let w(c) = -c*2 + c - 1 - 4c + 4c. What is w(3)? -7 Let l(y) = 2y - 4. Suppose 4b = 3g + 28, g - 3g + 5b = 28. Determine l(g). -12 Let c = 9 + -7. Let r(n) be the second derivative of 0 - n - 1/12n4 + 3n*c - 1/6n3. What is r(0)? 6 Let p(b) be the first derivative of b3/3 + 2b2 - 3b + 14. Calculate p(-6). 9 Let o = -29 - -54. Suppose -2r + o = -3. Suppose 4 = -2l, l - 4l = -4s + r. Let a(g) = g*2 - g - 1. What is a(s)? 1 Let b = 1/3 + 1/6. Let q(m) be the second derivative of 1/20m*5 + 0 - 2m + bm2 - 1/3m*3 + 1/6m4. What is q(-3)? -2 Let h(s) = -s2 + 9. Let p(t) = 2t + 4. Let v be p(-2). What is h(v)? 9 Let z(n) = -4n*3 - 8n*2 - 9n + 2. Let i(c) = -3c3 - 7c*2 - 8c + 1. Let g(d) = -5i(d) + 4z(d). Determine g(4). 3 Let q(h) be the second derivative of -h*3/6 + 3h*2/2 - 5h. Let y(i) = -1. Let f(d) = q(d) + 6y(d). Give f(0). -3 Let f(z) = -2z - 4 + 4 + 0z + 4. Determine f(4). -4 Let m(p) = -7p + 2. Let n(o) = -6o + 1. Let h(q) = 5m(q) - 6n(q). Suppose -2v = -4, 0 = f - v + 7 + 1. What is h(f)? -2 Let m(x) be the second derivative of x5/20 + x4/2 + x*3/6 + 7x*2/2 - 15x. Determine m(-6). 1 Let r(w) = -w3 - w2 + w. Let a(x) = 3x3 + 7x*2 - 3x + 4. Let d be 181/2. Let h(u) = dr(u) + a(u). Determine h(4). -8 Let n(o) = 0o + 4o3 - 2o*2 + o - 3o + o*2 - 1. What is n(2)? 23 Let d = 7 - 2. Let j(s) = -15s*3 - 3s + 11s3 - s2 + 1 + ds3. Let q(w) = w - 3. Let o be q(6). Give j(o). 10 Let n(p) = -p3 - p*2 + 2p + 2. Let w(i) = -i - 5. Let r be w(-8). Let k = -5 + r. What is n(k)? 2 Let r(h) be the second derivative of -h*4/12 - 7h3/6 - h2 + 19h. Calculate r(-3). 10 Let a(g) be the second derivative of g3/6 - g2/2 - 170g. Suppose 47 = 3i - 4y, -4y = y + 10. Suppose 5c + i = -12. Give a(c). -6 Let t(k) = -2k3 - k2 - 2. Let q(j) be the second derivative of -j5/2 - j4/2 - 11j*2/2 + 2j. Let x(r) = -2q(r) + 11t(r). Determine x(1). -1 Suppose 4 = -y - 0. Let m(a) = -a*2 - 2a + 1. What is m(y)? -7 Let c(j) = -2j3 + 24 - 6j2 - 23 + j3 + 2j. Determine c(-6). -11 Suppose 0 = t + 2r + 4, 17 = 5t - 2r - 11. Suppose -2m + 4m - 30 = 0. Suppose m = s - ts. Let i(q) = -q3 - 5q2 + 3. Determine i(s). 3 Let g(m) = m - 1. Let v(n) = n2 - 16n + 20. Let k be v(15). What is g(k)? 4 Let k = -659 - -662. Let h(c) = -4c + 6. Let w(f) = 7f - 11. Let u(m) = -5h(m) - 3w(m). Determine u(k). 0 Let f be 44/6 + 2/(-6). Let o(g) = -g2 + 7g - 5. Determine o(f). -5 Let m(z) = z*3 - 3z*2 + 3z - 3. Let d be -1 + 0 + 0 + 3. Give m(d). -1 Let w(g) = -g*2 - 27g - 12. Let z be w(-27). Let k(j) = -j*2 - 12j + 10. Calculate k(z). 10 Let h(y) = y*3 + 6y*2 + 3y - 5. Let v(x) = x*3 - x - 5. Let c be v(0). Determine h(c). 5 Suppose 2o + o - 6 = 0. Let g(k) = -3. Let s(j) = j + 11. Let y(r) = os(r) + 9g(r). Give y(6). 7 Let f(g) = g2 + g + 4. Let c be f(0). Let p be (14/56)/((-1)/c). Let y(w) = -w2 - w + 1. Determine y(p). 1 Let a(d) = -d*2 - 4d - 4. Let k be (2 + -8)3/(-9). Suppose -k = 3u + 1. Let r = -2 + u. Give a(r). -1 Let c(g) = -9g + 4. Let z(v) = 10v - 3. Let x(w) = -4c(w) - 3z(w). Let r(d) = -d2 + 1. Let n(h) = -r(h) - x(h). What is n(6)? 6 Let h(v) = v2 + 7v + 5. Let b be h(-7). Let j(z) = bz - 3z + 4z + z*3 + 3z*2 + 4 - 2z. Determine j(-3). -8 Let g(o) = -5o3 - 5o*2 + 2o - 2. Let l(b) = -14b3 - 14b*2 + 5b - 6. Let z(m) = 8g(m) - 3l(m). Determine z(-2). -8 Let c(v) = -v*2 + 4v + 5. Let z(x) = -x*2 + 12x - 21. Let k be z(9). Calculate c(k). -7 Let t(x) be the second derivative of -7x4/6 - x3/6 + x - 42. Calculate t(1). -15 Let a(t) = t + 2. Let p(l) = -5l*2. Suppose 2o - d = 4, 5d - 8 = o - 1. Suppose -3n + o = 6. Let y be p(n). Determine a(y). -3 Let u(v) = v3 - 5. Let t(p) = -p3 - 2p2 - p - 2. Let l be t(-2). What is u(l)? -5 Let d(n) = 3n - 1. Let q(y) = -13y + 4. Let v(k) = 9d(k) + 2q(k). Let r(i) = 3i + 4 + 3 - 11i. Let p(b) = 2r(b) + 14v(b). Calculate p(-3). 6 Let a = -4 - -12. Let m = -11 + a. Let b = m - -5. Let t(c) = 2c*2 - 2c - 2. Give t(b). 2 Let c be ((-1)/(-2))/((-2)/4). Let t be (32 - c) + -2. Suppose -2o - 11 = -q, -o + 8 - 36 = -tq. Let f(k) = -k2 + 4k + 5. Determine f(q). 0 Let x = 9 + -5. Let d(u) = -xu + u + 6 + 4u + u - 6u2 - u3. What is d(-6)? -6 Let t(l) = -2l*2 - 3l + 3. Suppose 33 = 14z - 3z. Determine t(z). -24 Let b(d) be the third derivative of d5/120 + d4/12 + d*3/3 + 3d2. Let j(s) be the first derivative of b(s). Give j(-3). -1 Let g(z) = -z2 + 5z + 2. Let y(d) = d3 - 5d*2 - 6d + 5. Let n be y(6). What is g(n)? 2 Let f(d) = 2d2. Let c be f(-2). Let o be c - 2 - 2/1. Let a(b) = -b + 2. Let m(j) = 1. Let n(q) = -a(q) + 3m(q). Give n(o). 5 Let a(j) be the second derivative of -j5/20 - j4/6 - j3/3 + j2/2 - 15j. What is a(-2)? 5 Let i(h) = -2h - 2h - 3 + h2 - 5h - 4. What is i(9)? -7 Let u(i) = 7i3 + 2i*2 + 4i + 4. Let a(r) = 6r3 + 2r*2 + 3r + 4. Let o(m) = 6a(m) - 5u(m). Calculate o(-3). 1 Let n = -20 - -30. Suppose b = -b + n. Let m(u) = 0 - 5 + u*2 + u - bu. Give m(4). -5 Let r(x) = x - 3. Let i(t) = 5t - 13. Let q(a) = 2i(a) - 9r(a). Let w be q(3). Let n(o) = -o3 + 3o*2 + 6o - 2. Calculate n(w). 6 Let p = -70 + 68. Let g(a) = -a*3 + 2a*2 + 2a + 2. Determine g(p). 14 Let n(u) = -13u3 - 7u*2 - 13u. Let t(b)	{ "pile_set_name": "DM Mathematics" }
) = f*2 + f. Let i be n(l). Solve -3v + iy + 19 = 0, -3y - 18 = -v - tv for v. 3 Let p be (-515)/(-25) - (-24)/(-40). Solve -5c + p = -g, -4c + 16 = -2g - 0 for c. 4 Let x(w) = w*3 - 5w*2 + w - 4. Let n be x(5). Let m(g) = 5g - 9 + 42 - 3. Let a be m(-5). Solve 13 = 5o + 3f, -ao + 3o + 5f = n for o. 2 Suppose 195 = -16p + 31p. Let i = 7 - 4. Suppose 0 = -0u + u + 4f + 10, -2u + p = -if. Solve 4n - 2n = 3j - 16, 3n + uj + 11 = 0 for n. -5 Let h = 48 - 81. Let w = -29 - h. Solve -1 = wk + 5v - 2, 3v + 2 = -5k for k. -1 Let j(f) = -27f2 - f + 1. Let x be j(1). Let z = x + 27. Solve -2m - y - 3 = z, -15 = 2m - 3y - 0 for m. -3 Let q = -366 - -370. Solve a = -4z + 4a - 8, -2a = qz - 12 for z. 1 Suppose 7 = 3o + 5a + 21, -2o + 5a = -24. Suppose 0 = -f - or + 12, 0 = 4r + 5 - 17. Let s be f-2(-3)/9. Solve z + 5 = 5d - 14, -d + sz = -19 for d. 3 Suppose 0v = -8v + 88. Solve d + 2d = -q + v, -4d + 16 = 0 for q. -1 Suppose 4s + 3z + 19 = 48, 0 = -z + 3. Solve 3o + 19 = -sx - 0x, -3x + o = 17 for x. -5 Let h(z) be the second derivative of -z*5/20 + 17z*4/12 + 3z*3 + 5z*2/2 + 9z. Let r be h(18). Solve rb + c = -9, b = -2b + c - 7 for b. -2 Suppose -12f + 109 = 1. Suppose 0 = 13l - 10l - f. Solve -p = -u - 4, 2p - lp + 19 = -4u for u. -5 Let l be (-20)/(-45) + 246/54. Solve -2g - 3k + 2 = k, 5g - k - l = 0 for g. 1 Suppose -33 = 5k - 18. Let j be ((-3)/4)/(k/(-216)-3). Solve -r + p + j = -2p, 14 = 3r - p for r. 3 Suppose 7r - 4r - 21 = 0. Suppose 13 + 22 = rf. Solve 0q = -fq + 5p + 35, -33 = -4q + 5p for q. 2 Let m(t) = -t + 15. Let w be (-290)/(-22) - 6/33. Let x be m(w). Solve -6p - 4 = -xp + 2h, -3p + 5h - 29 = 0 for p. -3 Suppose -t - 4n = -22, 24 = 2t - n + 5n. Let m be 1(-3)/9(-51)/17. Solve -3r = tx - 4r + 13, -r = x - m for x. -4 Let y be (4 - 3)/((-2)/(-34)). Let k = -12 + y. Solve -10 = 4n + 5d - k, -4d = 4n + 4 for n. 0 Suppose -37 = -3c - 16. Let b be ((-8)/7)/((-2)/c). Let x be (-1)/((4/(-5))/b). Solve 0 = g + h + 7, xg = -0g + 2h for g. -2 Suppose -3x + 15 = z - 8x, 0 = 2z + 4x + 12. Suppose -2b - 2q + 6 = 0, zb - 4b + 5q = -12. Solve 3w = -5r - 0r - 27, 3r = 3w + b for w. -4 Suppose 15x - 22x = 0. Suppose x = 2d - d + 5o, -4d = o. Solve -4r + 4l = d, 5r - l - 2l - 8 = 0 for r. 4 Suppose 3j - 25 - 3 = -2i, -5i + 25 = 0. Suppose jv = 5 + 19. Solve -5s = l - 6l + 20, l = -vs - 16 for l. 0 Suppose 198 = k + 192. Solve 0r - 3r + k = 0, -8 = 3g - r for g. -2 Let o(v) = -3v - 2. Let d be o(-8). Suppose d = 4s + 74. Let c = 15 + s. Solve -g + 4t + 2 = -8, 14 = 5g - ct for g. 2 Let v = 29 - 24. Suppose -3k - k = j - 17, j = -k + v. Solve 0 = -3i - 3m - j + 4, 4m = -2i - 6 for i. 5 Let b = -228 + 235. Solve 4 = 4s + n, s + n + b = 8 for s. 1 Suppose 5v - 52 - 8 = 0. Let b = 18 - v. Let s(q) = 9q*2 - 3q - 2. Let a be s(-1). Solve -p - bg = -3g + 13, -p - 2g = a for p. -4 Suppose -17 = -2i - 9. Solve iv = p - 3, 5v + p - 4 = -19 for v. -2 Let c = -35 + 39. Solve -5x - 12 = -2b, -3b + 5 = cx + 33 for b. -4 Let u(k) = -k*2 + 6k + 4. Let d(i) = i*2 + 20i + 14. Let p be d(-19). Let t = 1 - p. Let z be u(t). Solve 6r + zh + 31 = 3r, -4h = -2r + 6 for r. -5 Let c be (-30)/2 - (-235 + 207). Let g be (3/(-5))/(1/(-5)). Solve 12 = 3r - 3f, 2f + 0f = -gr - c for r. -1 Let m(u) = -u*3 - 10u*2 - u - 6. Let i be m(-10). Suppose 5l - 7 = 2n - n, il - 8 = 0. Solve -4h + 22 = -nx, x = 3h - 2x - 18 for h. 4 Let i be (-12)/24/12-8. Solve -5c = -2c + 3d + 24, -d = -5c - i for c. -4 Let f = 755 + -750. Solve 7 = 5r + 2g + 11, -5r = 5g - f for r. -2 Let h be ((184/(-3))/4)/((-15)/45). Let v = -42 + h. Solve -5s = -vp - 1, -3 = 5p + s - 9 for p. 1 Let g be (-24 - 0)(-6)/(-12). Let l be 2/(-1 - 5)g. Let x be 3/l41. Solve -25 = -6t + t + 5a, 0 = -5t - 2a - x for t. 1 Let p be -4 - -10 - (1 - -1). Suppose -36 - 4 = -pv. Let y = 12 - v. Solve b = 3u + 6 - y, -4u = -5b - 2 for u. -2 Let s(y) = 3y*2 + 8y - 7. Let f be s(1). Solve 0b = 2u + 3b + 6, 0 = -u + fb - 3 for u. -3 Let p(c) = -c3 + c2. Let i be p(-1). Suppose -4s + 38 = ig, 4g + g - 47 = -4s. Solve -5b = -n + s, -5b - n = -2b + 8 for b. -2 Let j = -55 - -91. Suppose -4i - 8 - 50 = -5t, 4t = -2i + j. Solve -z - 3c = 6, 5c + t = -2z + 1 for z. 3 Let k(t) = -15 + 11 - t - 34t2 + 4t. Let d be k(2). Let j be (-1)/(-5) + d/(-5). Solve 6a - 3l - j = a, -5l = -4a + 32 for a. 3 Suppose 0 = -9x + 59 - 14. Solve -2c = -xy + 1, -2c - 17 = 3c + 2y for c. -3 Let r be ((-8)/14)/(2/(-7)). Suppose -s - a = rs - 4, -3s + 4a = 16. Solve 4p - 3p = 2z - 3, 2p - 3z + 7 = s for p. -5 Let m be 12/4 - 2 - -18. Let k = 21 - m. Suppose -n = -v - k, 3v + 0 = -3n + 24. Solve -3f - 4j = -7, -2f + 4j - 2 = nj for f. -3 Let t be -2(-15)/5(-1)/(-3). Let i(c) = c + 4. Let y be i(t). Solve 3b + 3u = 4b - y, -15 = 3b + 2u for b. -3 Suppose 0 = 3t + 26 - 38. Solve 0s = 2s + tj - 18, 4j = -4s + 24 for s. 3 Suppose 3v - 6 = 3, -4u - 2v + 14 = 0. Suppose -3y + ul = -4 - 5, -3l = -3y + 9. Let k = 5 - 1. Solve m + 3 + k = yx, m + 3 = -x for m. -4 Suppose -5g = 2r - 37, -4g + 8 = -4r + 12. Suppose 3a - 2m + r = 13, -2a - 6 = -4m. Solve 0 = -5h + af + 40, 3h - f = 6 + 10 for h. 4 Let c(m) = m3 - 12m*2 + 9m + 27. Let b be c(11). Solve 2x + 10 = -4u, 4u + bx = -10 + 3 for u. -3 Let v be 104/(1/(-1)) + 0. Let b = v + 112. Solve 2l = 5g + 14, 3g - bg = 2l + 6 for l. 2 Let t be 26/12 - (-7)/(-42). Suppose -tg - 5d - 21 = 0, -2g + 28 = 2g - 4d. Solve -4v - 8 = -u, -2u = gv - 7 + 1 for u. 4 Let n(b) = -b3 - 2b*2 + 4b - 1. Let g be n(-4). Let y be g/93 + -1. Solve 5t + 10 = -ys, 4s + 2t = -2 - 2 for s. 0 Let m = -11 - -11. Suppose m = f + 4f - 25. Let z = 9 - f. Solve 4w + 40 = zr, 2w + r + 5 = -0w for w. -5 Suppose -2 = -4s - 26. Let r = s + 9. Suppose -ru = -3k + 3, 6 = 2k + 5u - 17. Solve 0 = -3l - g, -3g = -0l + 5l + k for l. 1 Let a = -136 - -139. Solve 4y = 5w - 11 - 6, ay + 10 = w for w. 1 Let u be 8 + (-12)/(-9)-3. Solve uv + 28 = -4g, 0 = 5v + 4g - 0g + 30 for v. -2 Let b be (-39)/(-18) - 1/6. Let m(h) = -2h3 - h + 3h*b + 0h + 3 - 4 + 3h3. Let q be m(-3). Solve -3y + 4u - 5 = -qy, -4y - u = -14 for y. 3 Let v be -20(-32)/40 + -4. Solve 4q - 3m - v = 0, 5m = 2q - 0m - 6 for q. 3 Let z(m) = -m + 11. Let b be z(9). Let v be (1 - b)-51. Suppose -4l + 2l = -vh - 34, -5h = 0. Solve p - 5p = i - l, 2i = p - 11 for i. -3 Let y = 20 - 18. Suppose -3z + 20 = yz. Solve -35 = -5a - 5r, -zr + 20 = 2a + r for a. 5 Let o(u) = u - 1. Suppose -7 = -3b - l - 3l, 5l = b + 4. Let a be o(b). Solve -4z - 2f = 26, a = -4z - 0f + f - 11 for z. -4 Let s = 24 - 16. Let r be 3/9 - (1 + (-18)/27). Suppose r = w - 2g - 2 - 14, 4g = -w - s. Solve v + 2b = -b + w, -4v + 10 = b for v. 2 Let t = 597 + -585. Solve -t = -5h - 2v, -v = 5h - 5v - 6 for h. 2 Suppose -43r - 28 = -50r. Solve 8u + r = 4u + 4z, -5z - 40 = 4u for u. -5 Suppose 2a - 7a + 10 = 0. Suppose -4t - 2j + 18 = 0, 5t + 2j = 11 + 10. Solve -ti - 4g = 13 - 33, 2g - 10 = -ai for i. 0 Suppose -18 = 10u + 132. Let l be (-3 + u/(-4))4. Solve c + 8 = 2c - lj, 4c + 2 = -5j for c. 2 Suppose -13t = -6t - 28. Solve 5i - 1 = -2q - 12, -tq + i = -11 for q. 2 Suppose -18 + 225 = 23v. Solve -7j + 3j = 2t - 12, v = -3t + 3j for t. 0 Suppose -2w + 39 - 33 = 0. Solve 6 = 2g - 4a, 5g + wa - 7a = -9 for g. -5 Suppose 270 = -z + 7z. Suppose 31t = 28t + z. Let b(x) = x2 - x - 5. Let s be b(5). Solve 3n - t = 3f - 2f, 3f - s = -3n for n. 5 Suppose -20 = -7x + 11x. Let p be 96/40 + 2/x. Solve 4y - 16 - 4 = -pn, 12 = 4y for n. 4 Let z(l) = -2l - 28. Let w(j) = -3j - 30. Let q(r) = -3w(r) + 4z(r). Let t be q(22). Solve 0 = -5a - 5g + 35, t = -4g + 7 + 1 for a. 5 Let c = 286 - 282. Solve -t + 2t + cu + 9 = 0, -3u = 3t for t. 3 Suppose 0 = -3l - 15l + 54. Suppose 24 = 2f + 6. Solve ln - n - c = 13, -3c = f for n. 5 Let q(m) = 11m + 448. Let d be q(-40). Solve 3k - 4 = dk - 4*p, 4 =	{ "pile_set_name": "DM Mathematics" }
pu + 70 = -4n - 18, 5n - 25 = 0. What is the remainder when u is divided by 14? 12 Let r(p) = 2p + 3. Let g(n) = -n*2 - 5n - 6. Let k(z) = -2g(z) - 5r(z). What is the remainder when k(-4) is divided by 38/4 - 1/(-2)? 9 Let k(a) = a*2 - 3a - 5. Calculate the remainder when 14 is divided by k(5). 4 Let r(t) = -t*2 - 7t + 4. Let y be r(-7). Suppose 2c + yn + 48 = 6c, -3c = -n - 34. Let z(v) = v. What is the remainder when z(c) is divided by 4? 3 Calculate the remainder when 55 is divided by (-12 - 7/(-1))(-2 - 1). 10 Let g(r) = r3 + 7r*2 - 3r - 16. What is the remainder when 19 is divided by g(-7)? 4 Let n = 30 + -13. Calculate the remainder when 84 is divided by n. 16 Let q = 10 + 3. Suppose -4j = 2a - 62, -3j = a - 20 - 14. Calculate the remainder when a is divided by q. 12 Suppose 5z - 31 = 14. What is the remainder when 17 is divided by z? 8 Calculate the remainder when (-1 + (238 - -1))/2 is divided by 30. 29 Suppose 2 = 2o - 12. Let h(m) = -3m*3 + 7m*2 - 3m + 6. Let q(n) = -n*3 - n. Let v(k) = -h(k) + 2q(k). What is the remainder when 2 is divided by v(o)? 0 Suppose -3t - 2t + 5 = 5m, -5m = 3t - 11. Let g = m - 2. Calculate the remainder when 71 is divided by 24/g6/4. 17 Suppose h = 5g + 52, 3g + 0g = -2h + 39. Suppose -o - 4o = -70. What is the remainder when h is divided by o? 13 Suppose -40 = 4a - 5u, -4a + 3u + 4 - 44 = 0. Let j = a + 13. What is the remainder when j is divided by (2 - (-3)/(-2))4? 1 Let a(r) = -7r + 3. Let q(g) = 2g + 3. Let b be q(-4). Suppose 29 = 2y + 3. Calculate the remainder when a(b) is divided by y. 12 Let v(f) = -4f + 108. What is the remainder when v(20) is divided by 8? 4 Let a(c) = 4c2 - 2. Let d be a(-2). Let s = d - 6. What is the remainder when s is divided by 3? 2 Let t = 212 + -146. What is the remainder when t is divided by 17? 15 Suppose -857 = -3c + 346. Suppose -224 - c = -5j. Suppose -2a - 27 + j = 0. Calculate the remainder when a is divided by 17. 15 Let h = -2 - -6. Let x be h/18 - 526/18. Let s = -12 - x. Calculate the remainder when s is divided by 6. 5 Suppose 2i - 3i = -11. Let l(n) = 7n - 4. What is the remainder when l(5) is divided by i? 9 Suppose -w = -4w - y + 67, 2w = 2y + 58. What is the remainder when w is divided by 4? 0 Suppose -4l + 48 = -2l. Let h be (-4)/(-14) + 36/21. Suppose -j = hj - 39. What is the remainder when l is divided by j? 11 Let i(k) = 6k - 30. What is the remainder when 88 is divided by i(8)? 16 Suppose -4a + 2a = -108. Let z = -13 + a. What is the remainder when z is divided by 22? 19 What is the remainder when 6 is divided by (-1)/(4 + -6 + 1 + 0)? 0 Let i be (2 + 2)/(-2) - -2. Let k(s) = -s + 472. Let w be k(i). Calculate the remainder when 76 is divided by (-6)/27 - w/(-18). 24 Let x = 142 - 115. Suppose 0 = i + 3 + 11. Let r = 28 + i. Calculate the remainder when x is divided by r. 13 Let l(o) = 4o + 2. Let g be l(-5). Let k be (0 + g/2)/1. Let b = k - -16. Calculate the remainder when 19 is divided by b. 5 Let w(h) = h3 - 7h*2 - 8h + 4. Suppose -f = 2u - 47, -5f + 2f = 5u - 115. Let s = u - 16. Calculate the remainder when s is divided by w(8). 2 Suppose -2y + 4 = -y. Suppose -16 - 140 = -yr. Calculate the remainder when r is divided by 20. 19 Let h be (-2)/(36/(-9)). Suppose r - h = 1. Suppose 7l - rl - 5 = 0. What is the remainder when l is divided by 1? 0 Calculate the remainder when 16 is divided by (42/15)/((-2)/(-5)). 2 What is the remainder when ((-5 - 120) + -5)(-2)/5 is divided by 9? 7 Let m = -7 - -14. What is the remainder when m is divided by 3? 1 Suppose -5p - 4f - 4 = 0, -2p = -4p - 2f - 2. What is the remainder when 1 + (42 - -2) + 0 is divided by -1(-12)/(1 - p)? 9 Let y = -57 - -72. What is the remainder when 271(-2 - -3) is divided by y? 12 Suppose 104 = 2v + 46. What is the remainder when 84 is divided by v? 26 Let h(n) = 4n + 5. Let y be h(-10). What is the remainder when 5 is divided by (-10)/y + (-26)/(-7)? 1 Let v(o) = 2o3 + o2 - 1. Let x be v(3). Suppose -5a + x = -53. What is the remainder when 43 is divided by a? 20 Let z(j) = -2j3 - j2 + j - 1. Let k(d) = 3d - 4. Let a be 5 - (-2)/42. What is the remainder when z(-3) is divided by k(a)? 13 What is the remainder when 2982/66 - 2/11 is divided by 12? 9 Let s(u) = -u2 - 17u + 15. Let f = 25 - 13. Calculate the remainder when s(-15) is divided by f. 9 Let t be (-1)/((-14)/(-12) - 1). Let j = -8 + 12. What is the remainder when (-14)/3t/4 is divided by j? 3 Let y(b) = -b3 - 8b*2 - 7b + 7. Let l be y(-7). Let q(m) = -m*2 + 10m - 7. Calculate the remainder when q(l) is divided by 5. 4 Let u(w) = -w - 21. Let j be u(-7). Let b = j + 34. What is the remainder when 38 is divided by b? 18 Suppose -d + 10 = 2s - 2, -d + 5s = -40. What is the remainder when 39 is divided by d? 19 Calculate the remainder when 43 is divided by 17/4(4 + 4 + -4). 9 Let c = 1 - -1. Suppose -cj = 4k - 0k - 86, -4k + 185 = 5j. Calculate the remainder when j is divided by 17. 16 Let i = -23 + 162. Calculate the remainder when i is divided by 35. 34 Suppose i - 10 = -i. Suppose -2m = f - 38, -85 = -4f + im + 2. Calculate the remainder when f is divided by 10. 8 Suppose -4q - 4b + 44 = 0, -2b = q - 2 - 6. What is the remainder when (0 + (-3)/5)-45 is divided by q? 13 Suppose 4k - 22 = 2k. Suppose 2q - 7q + 22 = -2i, -4i + 12 = 4q. What is the remainder when k is divided by q? 3 Suppose 4k = -2v - 0k + 14, 4v = -4k + 32. What is the remainder when 42 is divided by v? 6 Let g = 27 - 16. Suppose -3a + 69 + 57 = 0. What is the remainder when a is divided by g? 9 Suppose -i + 92 = -41. What is the remainder when i is divided by 45? 43 Let w(b) = -1 + 1 + 33b2 - 1. Let l be w(-1). Let c = -17 + l. What is the remainder when 29 is divided by c? 14 Suppose 0 = 5q + 5f - 35, 8q - f = 4q + 3. What is the remainder when 5 is divided by q? 1 Suppose 0 = 4m - 7m - 2b + 196, -b = -3m + 190. Let w(h) = -2h + 1. Let z be w(-1). Let y = z + 19. What is the remainder when m is divided by y? 20 Suppose 0 = -c + 8 + 6. Calculate the remainder when 39 is divided by c. 11 Let a(p) = p - 3. Let t be a(3). Let r = 2 - t. Suppose 0 = g + 3x + 5, 2g - rx = 11 + 11. Calculate the remainder when 12 is divided by g. 5 What is the remainder when (5 - (-21)/(-15))/((-6)/(-40)) is divided by 5? 4 Let i(a) = 103a - 16. Let d be i(7). Calculate the remainder when 111 is divided by 1/(-5) - d/(-25). 27 Let q(j) = -j*3 - 4j*2 - 3j - 1. Let d be q(-3). What is the remainder when 9 + 1/(-1) + 3 is divided by ((-8)/2)/(d/1)? 3 Let o(y) = 2y2 + y + 1. Let t = 27 - 24. What is the remainder when t is divided by o(-1)? 1 Let j = -280 + 167. Let a = 4 - j. What is the remainder when a is divided by 30? 27 Let p(x) = x + 22. Calculate the remainder when 60 is divided by p(9). 29 Suppose 0 = -4p + 3p + 11. Suppose 10y - 96 = 7y. What is the remainder when y is divided by p? 10 Suppose 45 = -2k - 3k. Let w(j) = j + 16. Calculate the remainder when w(k) is divided by 4. 3 Let q = 15 - 0. Let b(r) = r - 1. Let v(h) = -35h + 21. Let f(s) = -21b(s) - v(s). Calculate the remainder when f(2) is divided by q. 13 Let a(y) = 19y - 3. Calculate the remainder when 138 is divided by a(2). 33 Suppose k - 14 + 0 = 0. Calculate the remainder when (-13)/(2/(-12)31) is divided by k. 12 Let a = 31 - 15. Let w(r) = 7r + 18. Calculate the remainder when w(4) is divided by a. 14 Suppose -294 = -5x + 91. What is the remainder when x is divided by 20? 17 Let f(k) = k*3 + 5k*2 - 7k - 4. Let h be f(-6). Suppose 0 = z - 1 - h. Let d(r) = r*2 - 2r + 4. Calculate the remainder when d(z) is divided by 3. 1 Let y(b) be the first derivative of b*2 - 2b - 1. Let x = -55 - -59. What is the remainder when y(6) is divided by x? 2 Suppose n - 5n = -8. Suppose -51 = -5s + 5d + 14, -nd = -3s + 43. Suppose 16 = 2f + 2p, 2p - 3p = 2. What is the remainder when s is divided by f? 7 Let a(y) = 2y*3 - 3y*2 - 3y + 2. What is the remainder when a(3) is divided by 4 - ((-525)/165 - 2/(-11))? 6 Suppose -5y + 13 = -3w, -2y + 5w + 0w = -9. Let v(f) = 6f. Calculate the remainder when 22 is divided b	{ "pile_set_name": "DM Mathematics" }
rest integer? 577 What is 243431 to the power of 1/2, to the nearest integer? 493 What is the square root of 13090491 to the nearest integer? 3618 What is the fifth root of 30143206 to the nearest integer? 31 What is 28030977 to the power of 1/5, to the nearest integer? 31 What is 3117631 to the power of 1/3, to the nearest integer? 146 What is 25208943 to the power of 1/3, to the nearest integer? 293 What is the cube root of 26290353 to the nearest integer? 297 What is 29531120 to the power of 1/2, to the nearest integer? 5434 What is 1251142 to the power of 1/9, to the nearest integer? 5 What is the third root of 2201696 to the nearest integer? 130 What is the cube root of 11831555 to the nearest integer? 228 What is 10187224 to the power of 1/6, to the nearest integer? 15 What is the square root of 5721242 to the nearest integer? 2392 What is 11522862 to the power of 1/2, to the nearest integer? 3395 What is the square root of 451840 to the nearest integer? 672 What is 848743 to the power of 1/2, to the nearest integer? 921 What is the cube root of 1082164 to the nearest integer? 103 What is the square root of 3324556 to the nearest integer? 1823 What is 1202 to the power of 1/2, to the nearest integer? 35 What is 35449 to the power of 1/2, to the nearest integer? 188 What is the cube root of 2800919 to the nearest integer? 141 What is 358566 to the power of 1/3, to the nearest integer? 71 What is 761730 to the power of 1/3, to the nearest integer? 91 What is the square root of 525419 to the nearest integer? 725 What is the sixth root of 1324043 to the nearest integer? 10 What is 3520304 to the power of 1/2, to the nearest integer? 1876 What is the square root of 21708290 to the nearest integer? 4659 What is 5365232 to the power of 1/2, to the nearest integer? 2316 What is 1068443 to the power of 1/2, to the nearest integer? 1034 What is the square root of 7431352 to the nearest integer? 2726 What is 117894 to the power of 1/3, to the nearest integer? 49 What is 870486 to the power of 1/5, to the nearest integer? 15 What is the tenth root of 42371137 to the nearest integer? 6 What is 2853824 to the power of 1/10, to the nearest integer? 4 What is the third root of 1000069 to the nearest integer? 100 What is the square root of 674828 to the nearest integer? 821 What is 1265499 to the power of 1/4, to the nearest integer? 34 What is the square root of 1831736 to the nearest integer? 1353 What is 11172532 to the power of 1/9, to the nearest integer? 6 What is the seventh root of 3754478 to the nearest integer? 9 What is the tenth root of 1017054 to the nearest integer? 4 What is the square root of 144374 to the nearest integer? 380 What is 164802 to the power of 1/2, to the nearest integer? 406 What is the eighth root of 462959 to the nearest integer? 5 What is the third root of 1411965 to the nearest integer? 112 What is 163973 to the power of 1/2, to the nearest integer? 405 What is 4189624 to the power of 1/2, to the nearest integer? 2047 What is 4896268 to the power of 1/2, to the nearest integer? 2213 What is 8899557 to the power of 1/2, to the nearest integer? 2983 What is 2535559 to the power of 1/7, to the nearest integer? 8 What is 17151582 to the power of 1/2, to the nearest integer? 4141 What is 3145447 to the power of 1/2, to the nearest integer? 1774 What is 342841 to the power of 1/2, to the nearest integer? 586 What is the third root of 133794 to the nearest integer? 51 What is 19412287 to the power of 1/2, to the nearest integer? 4406 What is the cube root of 6635570 to the nearest integer? 188 What is the square root of 2541966 to the nearest integer? 1594 What is the tenth root of 2864373 to the nearest integer? 4 What is 1812192 to the power of 1/2, to the nearest integer? 1346 What is 766058 to the power of 1/2, to the nearest integer? 875 What is the cube root of 1859531 to the nearest integer? 123 What is the square root of 9055721 to the nearest integer? 3009 What is 5144777 to the power of 1/3, to the nearest integer? 173 What is the eighth root of 1291 to the nearest integer? 2 What is the fourth root of 1730981 to the nearest integer? 36 What is 7771490 to the power of 1/2, to the nearest integer? 2788 What is the square root of 453503 to the nearest integer? 673 What is the eighth root of 3288273 to the nearest integer? 7 What is the cube root of 6541352 to the nearest integer? 187 What is the cube root of 5638083 to the nearest integer? 178 What is the third root of 4652308 to the nearest integer? 167 What is the eighth root of 2339186 to the nearest integer? 6 What is the fourth root of 27102178 to the nearest integer? 72 What is 6277305 to the power of 1/2, to the nearest integer? 2505 What is the ninth root of 503816 to the nearest integer? 4 What is the square root of 491574 to the nearest integer? 701 What is the tenth root of 11770620 to the nearest integer? 5 What is the third root of 3386524 to the nearest integer? 150 What is 1427598 to the power of 1/9, to the nearest integer? 5 What is 8371481 to the power of 1/2, to the nearest integer? 2893 What is the fourth root of 13898084 to the nearest integer? 61 What is the cube root of 545189 to the nearest integer? 82 What is 2635014 to the power of 1/3, to the nearest integer? 138 What is the fourth root of 268307 to the nearest integer? 23 What is the third root of 12353903 to the nearest integer? 231 What is the ninth root of 20446682 to the nearest integer? 6 What is the square root of 1124631 to the nearest integer? 1060 What is 257519 to the power of 1/5, to the nearest integer? 12 What is 39087856 to the power of 1/5, to the nearest integer? 33 What is 17496822 to the power of 1/10, to the nearest integer? 5 What is the square root of 698383 to the nearest integer? 836 What is 2508322 to the power of 1/2, to the nearest integer? 1584 What is the square root of 1573279 to the nearest integer? 1254 What is 1542914 to the power of 1/4, to the nearest integer? 35 What is the cube root of 50996 to the nearest integer? 37 What is 750195 to the power of 1/2, to the nearest integer? 866 What is the sixth root of 1334768 to the nearest integer? 10 What is the fifth root of 14978795 to the nearest integer? 27 What is the third root of 386186 to the nearest integer? 73 What is 633992 to the power of 1/2, to the nearest integer? 796 What is the tenth root of 10344308 to the nearest integer? 5 What is the cube root of 96699 to the nearest integer? 46 What is the square root of 275521 to the nearest integer? 525 What is the fifth root of 3192935 to the nearest integer? 20 What is the cube root of 2830459 to the nearest integer? 141 What is the fourth root of 260107 to the nearest integer? 23 What is the cube root of 25864004 to the nearest integer? 296 What is 3078318 to the power of 1/7, to the nearest integer? 8 What is 219040 to the power of 1/2, to the nearest integer? 468 What is 210503 to the power of 1/9, to the nearest integer? 4 What is the cube root of 2999485 to the nearest integer? 144 What is 4353140 to the power of 1/7, to the nearest integer? 9 What is the square root of 1322049 to the nearest integer? 1150 What is 7608109 to the power of 1/9, to the nearest integer? 6 What is 3947166 to the power of 1/2, to the nearest integer? 1987 What is the seventh root of 836641 to the nearest integer? 7 What is 230441 to the power of 1/8, to the nearest integer? 5 What is the third root of 239281 to the nearest integer? 62 What is the third root of 9016163 to the nearest integer? 208 What is the third root of 2197201 to the nearest integer? 130 What is the fifth root of 2635771 to the nearest integer? 19 What is the third root of 61370 to the nearest integer? 39 What is the square root of 5911693 to the nearest integer? 2431 What is the cube root of 8187566 to the nearest integer? 202 What is 129112 to the power of 1/2, to the nearest integer? 359 What is 171827 to the power of 1/2, to the nearest integer? 415 What is the fourth root of 6916152 to the nearest integer? 51 What is the third root of 53987 to the nearest integer? 38 What is the square root of 47426 to the nearest integer? 218 What is the sixth root of 1765867 to the nearest integer? 11 What is 2	{ "pile_set_name": "DM Mathematics" }
3y + 894 = 2u + 102, -4y - 1056 = 5u. Round y to the nearest 100. -300 Let m = 155 + -111. What is m rounded to the nearest 10? 40 Let k(j) be the second derivative of 98j4/3 + j3/6 - j2/2 + 3j. Let l be k(2). Let f = l - 2459. Round f to the nearest one hundred. -900 Let u = -2070870 - -5570870. Round u to the nearest one million. 4000000 Let d = -18417.96719 - -17251.230829. Let s = d - -1216.7363. Let b = 50 - s. What is b rounded to five dps? 0.00006 Let t = 19.93 + 0.07. Let n = 13 - t. Let k = n - -10.1. What is k rounded to the nearest integer? 3 Let r = -457 - -495.1. Let c = 105 - 65. Let g = r - c. Round g to 0 decimal places. -2 Suppose j + j = -6, -j + 3 = -3c. Let o be (c - -2) + 0 - -1. Let f be (o - -74)/((-9)/60000). What is f rounded to the nearest 1000000? -1000000 Suppose -3r + 12 = 0, -3z + 4r - 26 = -8z. Suppose 4y = zy + 6400. What is y rounded to the nearest 1000? 3000 Let b = 4 - 15. Let q = -11.000087 - b. Round q to 5 decimal places. -0.00009 Let i be (1/((-1)/1762))/(-2). Let s = i - 491. What is s rounded to the nearest 100? 400 Let k = -0.0175 - -0.01750347. What is k rounded to six decimal places? 0.000003 Let w = -412 + 411.9819. What is w rounded to three dps? -0.018 Let u = -143 + 141.616. Let v = -0.151 + u. Let o = v + 1.5. What is o rounded to two decimal places? -0.04 Let c = 8.4 - 8.4000027. Round c to 6 dps. -0.000003 Let n = 0.0697 - 5.9297. Let p = n + -0.14. Let o = p - -6.16. Round o to one dp. 0.2 Let k = 161 + -160.999548. What is k rounded to five decimal places? 0.00045 Let y = -14341825 - -29947397. Let i = 15605571.59000058 - y. Let u = 0.41 + i. What is u rounded to 7 decimal places? 0.0000006 Suppose 0 = 5g + 1361 + 4089. Round g to the nearest one hundred. -1100 Suppose -f + 9 = 5d + 1, 2f = 2d + 4. Let z be (-3)/f1 - 0. Let q be 0/(z - -4) - 15000. Round q to the nearest 10000. -20000 Let z = -1442759 + 819460. Let j = z - -623433.0077. Let t = j + -134. What is t rounded to 3 decimal places? 0.008 Let r = -0.099935 - -0.1. What is r rounded to 5 dps? 0.00007 Let y = -69710.953 + 69787. Let a = 76 - y. Round a to 2 decimal places. -0.05 Let o = -0.183 - -0.296. Round o to two dps. 0.11 Let i = 5 + -5. Let s = i - -0.0015. Round s to three decimal places. 0.002 Suppose 0 = 10t - 7t + 14400. Round t to the nearest 1000. -5000 Let r = -60.27 - -2.77. What is r rounded to the nearest 10? -60 Let z(o) = -340o2 + 3o + 11. Let q be z(-8). Let f = -9573 - q. Round f to the nearest 1000. 12000 Let f = -1628 - -1370.2. Let d = f - -249.795. Let x = d - -8. What is x rounded to 3 dps? -0.005 Suppose -1340 = -2b - 2b. Suppose 0 = 2p - b - 785. What is p rounded to the nearest 100? 600 Let g = 41.9 + -15.6. What is g rounded to the nearest integer? 26 Let d = 18350.017 - 18364. Let y = 14 + d. Round y to 2 decimal places. 0.02 Let b be 10919994/21 - (1 - (-9)/(-7)). Round b to the nearest 100000. 500000 Suppose -3n + n = -2632860. Let z = n - 596430. Round z to the nearest 100000. 700000 Let a = 25 - 46. Let u = a - -21.034. Round u to two decimal places. 0.03 Let c = -5.227 + 5.48. Round c to 1 dp. 0.3 Let w = 9.3 + 10. Let z = 23 - w. Let v = z + -2.85. What is v rounded to 1 decimal place? 0.9 Let z be (11 - 2)(2 - 1). Suppose -5g + g - 15 = -5c, -g - 3c + z = 0. Round g to seven decimal places. 0 Let g = -9343 + 4293. What is g rounded to the nearest one thousand? -5000 Let b be ((-3)/2)/((-3)/(-4)). Let r = 0 + b. Let d be (-915)/(r - 1209/(-600)). Round d to the nearest ten thousand. -60000 Let c = -103.99916 + 104. Round c to four dps. 0.0008 Let f = 208.01 - 207. Let s = 1 - f. Round s to two decimal places. -0.01 Let z = -1759116 + 2759116. Round z to the nearest 1000000. 1000000 Let c = 182.9805092 - -0.0283908. Let j = c - 183. What is j rounded to three decimal places? 0.009 Let n(a) = a*3 + 2a*2 - 4a. Let u be n(-3). Suppose -2b = -ub + 2. Let k = 37 - b. What is k rounded to the nearest ten? 40 Let x = 29.884 - 30. Round x to two decimal places. -0.12 Let j(h) = 162h3 + 3h + 2. Suppose -4k + 2z = k - 16, -2k - 4z + 16 = 0. Let r be (-2)/(k/2) - 1. Let d be j(r). Round d to the nearest 1000. -1000 Let c = -99.892 - -73.74. Let y = c - -26. Round y to 2 dps. -0.15 Let v = -0.04 - 0.006. Let n = v + 0.045959. What is n rounded to five decimal places? -0.00004 Suppose 3y = 2b - 7319996, -9082010 + 1762006 = 3y + 2b. What is y rounded to the nearest 1000000? -2000000 Let u = -156409.00996 + 156376.8. Let x = -32.2 - u. Let n = 0.01 - x. Round n to 5 decimal places. 0.00004 Suppose -y = 3y + 3q + 2293, -2y = -q + 1159. Let p = y + 986. Let v = -129 + p. What is v rounded to the nearest one hundred? 300 Let v = -181.9 + 331. Let p = v - 158. What is p rounded to the nearest integer? -9 Let l = -1231058 - -2626997. Let z = 2595939 - l. What is z rounded to the nearest 1000000? 1000000 Let j = -90.000063 - -90. What is j rounded to 5 dps? -0.00006 Let g = 173.995 - 176. Let v = -7 - -5. Let q = v - g. Round q to 3 decimal places. 0.005 Let l be 1784/(((-5)/1875-9)/3). Round l to the nearest 100000. 200000 Let k = 191628 - 191627.799987. Let i = k + -0.2. Round i to 6 dps. 0.000013 Suppose 3k = -2k - 9505685. Let l = -1137 - k. Round l to the nearest one million. 2000000 Let z = 0.4264 - 0.383. What is z rounded to three dps? 0.043 Suppose 2c + c + 5o = 404993, c - 2o - 134983 = 0. Let a = -21 + 27. Suppose -5k - 3y = -c, -y - a = y. Round k to the nearest 10000. 30000 Suppose f = -f - 8. Let k = f + 6. Suppose 4a - 1060000 = ka. What is a rounded to the nearest 100000? 500000 Let h = -0.04 - 0.02. Let l = h - -0.03. What is l rounded to 1 decimal place? 0 Let p(u) = 18161u*3 + 6u*2 + 6u + 5. Let x be p(-5). Round x to the nearest 100000. -2300000 Let d = 350 + -112. Let w = d + -237.887. What is w rounded to 2 decimal places? 0.11 Let t = 21.7 - 21.7000257. What is t rounded to six dps? -0.000026 Let d = -1.4 + 1.51. Let z = d + -0.2. Let l = z + 0.08999999. What is l rounded to 7 decimal places? 0 Suppose 4z + 5n + 9680 = 3z, 3n - 48512 = 5z. What is z rounded to the nearest 1000? -10000 Let p(n) = n - 2. Let d be p(4). Let s be d/(2 + (-63)/30). Round s to the nearest one hundred. 0 Let g(n) = -3n*2 - 3n - 2. Let x be g(-2). Let z(l) = -200l2 - 8l. Let r be z(x). Let y = r - -73736. What is y rounded to the nearest ten thousand? 60000 Suppose -3d + a = -15, 2a + 0a = -4d + 20. Let f(v) = -283999v2 - 4v - 5. Let c be f(d). What is c rounded to the nearest 1000000? -7000000 Suppose -2u - 4j - 90550 = 153850, 5u + 2j + 610976 = 0. Let l = u - -357790. Let p = l + -495596. Round p to the nearest one hundred thousand. -300000 Let o be (-3 - -6)1-1. Let a be 3720002/3 - (-2)/o. What is a rounded to the nearest one hundred thousand? 1200000 Let q(l) be the second derivative of 5333l3/6 + 2l*2 + l. Suppose -29 = 5u - 89. Let y be q(u). Round y to the nearest ten thousand. 60000 Let b(l) = -l - 10. Let g be b(0). Let k be (144/g)/((-1)/1875). What is k rounded to the nearest 10000? 30000 Let w = 1818927.49953 + -1818937. Let b = 9.5 + w. What is b rounded to four decimal places? -0.0005 Suppose 0 = -4w + 2 + 14. Suppose -181 = -wp + 471. Let m = -343 + p. Round m to the nearest 100. -200 Let z = -56.44 - -54. What is z rounded to 1 decimal place? -2.4 Let h be (-2556)/(-52) - 4/26. Suppose 5f = -h - 176. Round f to the nearest 10. -50 Suppose 5y = 5s + 15, 13 = 5y - 5s + 2s. Let j be (-1)/y + 9/2. Suppose 3k + m = 2m - 115, 4m = jk + 156. Round k to the nearest 10. -40 Suppose -2p + 5g = -10 + 36, 1 = p + g. Let z be (-3)/(6/230) - p. Round z to the nearest ten. -110 Let u(o) = -3o3 - o2. Let x be u(-1). Let f be ((-26)/4 - -1)x. Round f to zero decimal places. -11 Let q(m) = 3288m3 - 7m*2 + 7m + 5. Let g be q(6). Let p = g - -33011. Suppose p = 4n + 2i - 56984, -200004 = -n + 4*i. Round n to the nearest 1000000. 0 Let r = -10344 - -10344.20004. Let q = 0.1 - 0.3. Let i = q + r. Round i to 4 decimal places. 0 Let j = 0.52177 + -107.36377. Let f = -0.158 + j. Let u = 121.1 + f. Round u to 0 decimal places. 14 Let r = -80 + 44. Let z = r + 32.4. What is z rounded to zero	{ "pile_set_name": "DM Mathematics" }
(a) 28 (b) 2 (c) 0.4 b Which is the nearest to 0.828? (a) 66 (b) 0.5 (c) -1 (d) 2 (e) -0.3 b What is the closest to 157 in 1/6, 271, -0.2, 50? 50 Which is the closest to -2/7? (a) -9 (b) 1/283 (c) 2 (d) 5 (e) -5 (f) 2/5 b What is the closest to 2 in 852, -29, 1/5, -2/5, 13? 1/5 Which is the closest to -19? (a) -1.7 (b) 10 (c) 3/7 (d) -4 (e) 4 d Which is the nearest to -0.029? (a) -1.22 (b) -4 (c) 39 a Which is the closest to 0? (a) -1/4 (b) -1.8 (c) 795041 a Which is the closest to -0.08? (a) -3 (b) -4 (c) -2885 (d) -0.12 (e) 3 d What is the nearest to -22 in 23660, -3, -1/2? -3 What is the closest to 383/4 in -362, 1, -0.1? 1 What is the closest to 12 in 0.01, 5, -43422, -3, 1/3? 5 Which is the closest to 6? (a) -1/5 (b) 47.2 (c) 0.0218 c Which is the closest to -4? (a) -14.4 (b) 33 (c) -19 (d) -1/2 d Which is the closest to 3? (a) 50 (b) -0.06 (c) 3 (d) -229 c Which is the closest to 1? (a) -4/7 (b) -35/3 (c) 4/283 (d) 2/33 (e) -16/3 d What is the nearest to -1 in 0.5, 7/4, 3/320, -0.11, -2, 2? -0.11 Which is the closest to 17/3? (a) -274 (b) -1/4 (c) 8 c Which is the nearest to 0? (a) -10 (b) -1/8 (c) -6 (d) 496 b Which is the closest to -8? (a) 34326 (b) -2 (c) 0.5 b What is the closest to -0.19 in -13, 0.1, 1/20, -2/3, 1? 1/20 Which is the closest to 0? (a) -2149 (b) 33 (c) 581 b Which is the closest to -10? (a) 0.12 (b) 2/17709 (c) -3/5 c What is the nearest to 17 in 4, -55, 0, -5, 270? 4 What is the nearest to 26/5 in -0.05, 7/155, -5, -2/51, -0.5? 7/155 Which is the closest to 18/65? (a) 5 (b) 1 (c) 3/2 b What is the nearest to -2/15 in 5/6, -13, 10, -1/5, -6/7? -1/5 What is the closest to 31 in -0.462, 3, -1/4, -2/19? 3 Which is the closest to -2.9? (a) -26 (b) -4 (c) -2/71 (d) 23 b Which is the closest to 0.05? (a) 2 (b) 55/3 (c) -1/7 (d) -0.69 (e) -0.5 (f) -0.6 c What is the nearest to 36.9 in 2, 1031.4, 1? 2 Which is the nearest to 1.6? (a) 33.2 (b) 13/5 (c) -3 (d) 4/11 (e) 4 b What is the nearest to -9 in 0.17, 4/5, -1/6, -1/2, 23? -1/2 Which is the nearest to -2.7? (a) 2 (b) -0.2 (c) -3903 (d) -1/7 (e) -47 b What is the nearest to -4508/9 in 1, -2/15, 4, 2? -2/15 What is the closest to 8 in -4, -0.2, -4/7, -787, 1/25? 1/25 Which is the closest to 363? (a) 1/12 (b) 1 (c) -1/73 (d) -1/3 (e) 0.2 (f) -34 b What is the nearest to 1/122 in 0.5, -0.203, -450, 0.1? 0.1 What is the closest to 42.7 in 0.2, 3/5, 5, -1, -54, 0.4? 5 Which is the closest to -18? (a) 2.3 (b) -1411 (c) 16 a What is the nearest to -14.2 in -8190, 0.08, 4/7? 0.08 Which is the closest to -45/29? (a) 5 (b) -0.3 (c) 2.946 b Which is the nearest to 0? (a) 140 (b) -11 (c) -1 (d) -0.4 d What is the nearest to 0 in -21/57028, -0.2, 1/3? -21/57028 What is the closest to -1/8 in 2/7, 27057, 0.5? 2/7 Which is the nearest to -0.2? (a) 0.2 (b) -3 (c) -12 (d) -42872 a What is the closest to 21113 in -9/7, -4, -0.2, -3/5, -5, -6? -0.2 Which is the closest to -50? (a) -8 (b) -2 (c) 5 (d) 0.4 (e) 24/23 a What is the nearest to 0.2 in -3, -1/2, 1, -9, -1.3? -1/2 Which is the nearest to 0.2? (a) -2984739 (b) -0.01 (c) -3/4 b Which is the nearest to 20? (a) -2/9 (b) 0 (c) -5 (d) 0.5 (e) 0.097 (f) 199/3 d Which is the closest to 7/6? (a) 3/8 (b) -7 (c) -11 a Which is the closest to -3? (a) 0.1 (b) 0.2 (c) 4 (d) -3/32 (e) 29 d What is the nearest to 7 in -38/5, 5, 6/25, -0.5, 866? 5 What is the closest to 5 in 3/2, 26/9, -26/333? 26/9 Which is the nearest to 0.2? (a) 168.73 (b) 6 (c) -2/27 (d) 3 (e) 4 c What is the closest to 5 in 5/2, 2, -0.5, -16786? 5/2 What is the closest to 0.3 in 0.3, -24, -10/11, 7, 0.03? 0.3 What is the closest to -1 in -4/7, -0.5, -3.0582, -55, 1/2, 0? -4/7 Which is the nearest to 1473? (a) -3 (b) 1/3 (c) 1093 (d) 1 c Which is the nearest to -37? (a) -10 (b) 1 (c) -530 a What is the closest to 0.0183 in -11.4, -1/5, -14, 0.02, 4? 0.02 Which is the nearest to -14? (a) 2 (b) 274494 (c) -3 c Which is the closest to -2/7? (a) 211/135 (b) 2 (c) 2/9 (d) -5 (e) -99 c What is the closest to 0 in -0.16, 18/5, -0.18, 2/3? -0.16 What is the closest to -1 in 9, 0.12, -30, -1, 30? -1 Which is the closest to -1? (a) -0.00758 (b) -0.48 (c) -29 b What is the closest to 0 in -1.9, -14, 3, -1/4, -7/3, -5? -1/4 What is the closest to -14 in -5, 242, -34/29, -4? -5 Which is the nearest to -0.59? (a) 4.04 (b) 0.5 (c) 0.0538 c What is the nearest to 2/5 in -4/9, 201.97, -1/2, -0.2? -0.2 Which is the closest to 2/7? (a) 3.02 (b) -3 (c) 6 (d) 23 (e) 58 a What is the nearest to -0.1 in 0.066538, 1/2, 1/5, 0.6? 0.066538 What is the closest to 184/9 in -5/8, -2, 4, 2? 4 What is the nearest to 675 in -2, -1, 3/2, 0.1, 297? 297 What is the closest to 56/337 in -0.094, -1, 2, 1, -5? -0.094 Which is the closest to 6? (a) 4/3 (b) 7/5 (c) 21 (d) -0.3 (e) 1 (f) 0.114 b Which is the nearest to -48/605? (a) 6 (b) -4 (c) -2/199 (d) -0.4 c What is the closest to -0.3 in -3, -1, -53.6, -2/9, -77? -2/9 What is the closest to -1 in -51, -233, -22, 0.1, 5? 0.1 Which is the closest to 1? (a) 1/4 (b) -0.5 (c) 0.02 (d) -300 (e) 1.1 e Which is the nearest to -1? (a) 5 (b) 274/123 (c) 2 (d) -2/3 d What is the nearest to 1228064 in 2/9, 6, 2/7? 6 What is the closest to -155 in -3, 2/11, 3, -69, 2/9, -0.01? -69 Which is the nearest to 1? (a) -11/14 (b) -0.3 (c) -6 (d) -8 (e) -3 b Which is the closest to -1/3? (a) 2/26293 (b) 5 (c) -2/91 (d) -0.02 c What is the closest to -0.026 in -3, -1/7, -10, -24.6, -0.3? -1/7 Which is the nearest to 1? (a) 2 (b) -1/6 (c) 2/9 (d) -0.3 (e) -2.7645 c Which is the closest to -1099? (a) 0 (b) -2/5 (c) 0.4 (d) -4 (e) -6/19 d What is the nearest to -3/4 in -1/3, -3/7, 0.044, 4, -1/2? -1/2 Which is the nearest to -1/2? (a) -0.18 (b) -4 (c) 13 (d) -16 (e) 22.9 (f) -6/13 f Which is the closest to -3033570? (a) -2/11 (b) -5 (c) -3/4 b What is the nearest to 1 in -46, 3/8, 3.1, -127, 2/17? 3/8 Which is the nearest to -323? (a) 3/16 (b) 0.7 (c) 3 a Which is the nearest to 4? (a) -225193 (b) -1 (c) -0.1 c Which is the nearest to 1/2? (a) -121/164 (b) 36 (c) 2/15 (d) 1 c What is the closest to 54 in -2, 4, 215, -0.2, -1/20? 4 Which is the nearest to 2604? (a) -136 (b) 1 (c) 2 c What is the nearest to -1/2 in -17/3, -1/5, 1, -1.3, -126? -1/5 What is the nearest to -1.3 in -5/6, -83, -0.2, 2.2, -4? -5/6 What is the closest to -46/33 in -2/7, -69, 3/2? -2/7 Which is the nearest to -0.1? (a) 1 (b) -2 (c) -117.8375 (d) -0.12 d Which is the closest to 0? (a) -2/7 (b) -2 (c) 27 (d) -0.2 (e) -0.0441 e What is the nearest to 0.31 in -1339/14, -3/8, 1/4? 1/4 Which is the closest to 1/3? (a) -477 (b) -2 (c) -79 (d) 0 (e) -10 d What is the closest to 3/5 in 2/169, -9, -171? 2/169 What is the nearest to 41.11 in 1, 1.09, 4/9? 1.09 What is the nearest to 13 in 99, 0.2, 1243? 0.2 Which is the nearest to -6.16915? (a) 3 (b) -3/4 (c) -5 c What is the nearest to 0 in 7, -21.1, 0.06, -1/8, 0.1? 0.06 What is the closest to 24 in 0.2, 18, -3649? 18 Which is the closest to 0.22058? (a) 3/2 (b) -1 (c) -21.4 (d) -2 (e) -4 b What is the nearest to 76 in 0, -1/10, -2706, -0.3, -0.4? 0 Which is the closest to -3? (a) 2 (b) 6.11734 (c) 19 a Which is the closest to 1086.65? (a) 5 (b) 0 (c) -2/15 (d) 404 d What is the nearest to 0 in 40, 32, -0.1, 2/43, -0.4? 2/43 What is the nearest to 0.1 in 2/17, 0.4, -0.4, 199/9, 0.7, -11? 2/17 Which is the nearest to -1? (a) 0.09 (b) -5 (c) 0.22 (d) 5 (e) 15.62 a What is the nearest to 32018 in -0.4, -0.5, -51? -0.4 What is the closest to -0.4 in -0.4, -6, -7, 2.5, 1/5? -0.4 Which is the closest to 274? (a) 0 (b) 14 (c) -5 (d) 0.2 (e) 59/6 b What is the closest to 1 in -22, 5/3, 7, -298, 0.1? 5/3 What is the nearest to -2 in 4, -6.77, 12/5, 2/5, 1/9, -2? -2 What is the nearest to -369459 in 4, 1, -2? -2 Which is the nearest to -1? (a) -0.4 (b) 0.07 (c) -8046/11 a Which is the closest to -0.04? (a) -41 (b) 1 (c) 4.417 (d) 1/8 d Which is the closest to -9? (a) -1 (b) 0.00956 (c) 0.5 (d) 2/3 a Which is the closest to 1? (a) -7 (b) -2 (c) -0.2 (d) -1/329 (e) -3/7 d Which is the nearest to 14? (a) 9 (b) 0.	{ "pile_set_name": "DM Mathematics" }
c Let v = -140.87 + 120.87. What is the closest to 0.04 in 0.3, 0.4, v? 0.3 Let z = 8 - 8.1. Let j = -181/4 + 45. Suppose -95w + 183w - 94w = 18. What is the closest to 1/3 in j, z, w? z Let l = 39.58 + -39.48. Let a be ((-2)/(-4) - 2) + 0. What is the nearest to 0.9 in a, l, -3? l Let m = 1273 - 31817/25. What is the nearest to -2/7 in -2, 5, m? m Let p = -3 - -1. Let q = 5 + p. Let n be (-2)/(-4) - (-27)/(-45). What is the closest to -1/4 in -1/2, q, n? n Let t = 42.4 + -41.4. Let k = -47 + 48. What is the nearest to t in 5, 0.4, k? k Let z = 15.94713 - -0.05787. Let a = z - 0.005. What is the nearest to 0.1 in a, -4, 4? 4 Let k(f) = -f3 - 8f*2 + 2f - 33. Let j be k(-9). Let y be -1(7 - j/4). Which is the nearest to -2/5? (a) -4/7 (b) 0.3 (c) y a Let b = -17355 + 17343. What is the nearest to b in 1/3, -5, 0? -5 Let f = 3459/22568 + 1/1736. What is the closest to 0.1 in 40, f, 2/11? f Let q be 4/(-14) - (-74)/112. Let o be -5-518/7575. Let f = 65/606 + o. What is the closest to -1 in -2, q, f? -2 Let c be (2/(-3))/(8/6). Let x = -1.22 + 1.52. What is the nearest to c in -0.27, -0.1, x? -0.27 Let p = 0.06 - -0.94. Let g = 24 + -42. Let l be (-20)/12 - 102/g. Which is the nearest to 1? (a) l (b) 1/5 (c) p c Suppose 46c = 43c + 2d - 8, 0 = -3c + 3d - 12. What is the closest to -1/2 in -0.1, 2/51, c? -0.1 Let p = -1.957 - 0.043. Let f = -16/3 - -35/6. Which is the nearest to p? (a) f (b) 1/8 (c) 0.3 b Let y be 13/((-195)/6)10/(-12). Which is the nearest to 0? (a) -4 (b) 0.1 (c) -0.11 (d) y b Suppose 118y + 142y - 48y = -23y. What is the closest to y in 1, 5, 2.3? 1 Let p = 119 + -116.23. Let f = p - 2.27. Which is the nearest to 2? (a) 1/3 (b) 0.3 (c) f (d) 0.05 c Let k(p) = -p2 + 6p - 3. Let v be k(5). Suppose 3m + vx + 2 = -0x, m + 9 = x. Let w = -1302 + 1302. Which is the closest to w? (a) m (b) 2/3 (c) -0.14 c Suppose -3r - 3h = -441, -3h + 582 = 372r - 368r. What is the nearest to 0.1 in r, 3, -1/4? -1/4 Let j = -0.22 - -0.19. Let l = j - -4.03. Let s be (-71)/(-11) - (-12 - -19). Which is the nearest to -14? (a) s (b) l (c) -1/2 a Let r = -11078 - -11069. Which is the closest to r? (a) 2/5 (b) 1/3 (c) -3/7 (d) 1 c Suppose -17 = -5r - t, -3t = -8r + 6r. Let v be 225/20 + -9 - r/(-4). Which is the closest to v? (a) 2/11 (b) 18 (c) 4 (d) 5 c Let k be (9600/(-2660) - 12/114) + 4. Which is the closest to -9/7? (a) -1/5 (b) k (c) 6 a Let d = 0.20477 - -0.09523. What is the nearest to 1 in d, 7, 5, 32? d Let q = 162 - 158. Suppose q = -0m + m, 2m = 2o. Let s = -1 - 1. Which is the closest to 0? (a) 3 (b) o (c) s c Let s = 0.079 + 0.221. Let m = -0.14 + 0.14. Which is the closest to m? (a) s (b) 0.2 (c) 0.5 b Suppose -148y - 54 - 242 = 0. Let l = -1.3 + 6.3. Which is the nearest to y? (a) l (b) -3/7 (c) 6/5 b Let s = 1.95 - -0.05. Let o = 174 - 294. Let t = o - -124. What is the closest to s in -1/12, -3/5, t? t Let f = 560.6 - 561. What is the nearest to 4 in f, 0, -3, -5? 0 Suppose -84 = 3a - 39. Let v be 1/4 - (a/28)/(-1). What is the closest to 1 in v, 4, -3/8? v Let y = 1209/4675 + 6/425. What is the nearest to -1 in -2/5, 0, y, 54? -2/5 Let r = -1628 + 1625. Which is the nearest to 36? (a) r (b) -1/6 (c) 2/11 (d) -2 c Let m = -33.9 - -37.9. What is the closest to 7 in 2, -0.1, -0.16, m? m Let z = 48.07 + 0.93. Let m = z + -48. Suppose 2w + 67 = 63. What is the closest to m in -5, w, 1/2? 1/2 Let i be (-297)/(-11) + (14 - 40). Let x = 4 - 3.7. Which is the nearest to i? (a) x (b) -10 (c) 0.5 c Let i be 1/(-2) - (-3)/12. Let p be ((-8)/18)/4-3824/(-456). Which is the closest to 0.1? (a) p (b) 5 (c) i (d) -2.4 a Let i = -489.9 - -490. Let q = 3.3 + -2.9. What is the nearest to 0.5 in -2/5, q, i, -0.1? q Let o = 10 - 13. Let n(z) = -4z3 + 5z*2 + 8z + 6. Let q be n(o). Let d be (-2)/(-9) + (552/q)/(-4). Which is the nearest to 1? (a) -0.3 (b) 0.1 (c) d b Let o = -152.07 - -152. Let n = 3.48 - 29.18. Let l = 26 + n. What is the nearest to 0 in o, l, -0.5? o Let p = -0.03 - 2.77. Suppose -5q = 4z - 17, 19 = -82z + 87z + 4q. Which is the closest to -1/4? (a) -3 (b) p (c) z b Let g = 38.05 - -4.35. Let k = g - 43. Let c be ((-16)/(-48))/(2/(-3)). What is the nearest to -0.1 in -0.1, k, c? -0.1 Let o = -1945 - -1940. What is the nearest to -3 in 3, -0.31, o? o Let q = 451/6210 + 1/690. Which is the closest to -1? (a) -3 (b) q (c) -0.1 c Let h = 0.36353 - 1.36353. Which is the closest to -1/4? (a) -1.4 (b) -16 (c) h (d) 6 c Let g be -7 + 40/(-32) - (-11)/44. What is the nearest to g in 2, -0.2, -1/18, 5? -0.2 Let o = -0.547 - 1.753. Which is the nearest to o? (a) -11 (b) 3/2 (c) 0.5 (d) 5 c Let g = 14702 - 14700. What is the closest to -1 in -2/47, -2, -0.5, g? -0.5 Let s = 53449 - 53447. Let g = 0.5 + -0.62. What is the closest to g in s, 5, -4, -5? s Let b = 105.23 + 2.77. Let i = 103 - b. What is the closest to i in -4, 1, 4? -4 Let q = -233 - -506. Let l = -272.8 + q. Which is the closest to 2? (a) -0.2 (b) l (c) -16 b Let a = -93.81 + 93.81. Let c(k) = 2k + 14. Let o be c(-6). Let j be 51/(-9) - (-4)/6. What is the nearest to a in o, -1/12, j? -1/12 Let c be 1470/(-2970) + 6/22. Let v = 115/378 - 1/54. What is the closest to 1/4 in 2, v, c, 0.5? v Let p = 338.1459 + -0.0459. Let f = -338 + p. What is the nearest to f in -3, -1, 19? -1 Let u = 1/5 + -2/5. Let y = 47693.1 - 47693. Let b be 2 - (2 + (-1)/5). What is the nearest to 4 in y, b, u? b Let u = 172 - 1546/9. Which is the nearest to 1? (a) -3/2 (b) 3 (c) u (d) -23 c Let u be (18(-1)/(-56))/((-75)/100). Which is the nearest to -1? (a) 1 (b) -50 (c) u c Let z(g) = -g2 - 5g - 1. Let v be z(-4). Let m = -1.917 - -1.517. Let q = -14/23 - -51/46. What is the nearest to q in v, 0, m? 0 Let p = 0.09 - 0.03. Let o = p + -2.06. Let b = 121817.06 - 121817. What is the nearest to 1 in b, 1/4, o? 1/4 Let o = -3.7 + 3.72. Let j = 2683/5 - 537. Which is the closest to j? (a) 2/3 (b) 0.2 (c) o c Let b be 4/10(-1 - -2). Suppose 8 = -5v + a + 1, a + 4a + 40 = 0. What is the closest to b in 4, v, -5, 0? 0 Let z = 22 - 234. Let y = -212 - z. Let o be 1 + 0 - 9/7. Which is the nearest to 1? (a) y (b) o (c) -3 a Let i be ((-155)/(-124))/(-1 - (-68)/48). Which is the closest to -6.6? (a) -5 (b) -2 (c) 2/7 (d) i a Let d = 9133 - 9135. What is the nearest to -0.2 in -1/10, d, -10/9? -1/10 Let j = 499 - 496.67. Let k = j + -2.23. Let g = -1 + 1.5. What is the closest to k in g, -7, 1? g Let q be 3/18 + (-3)/(360/68). Which is the nearest to 2/7? (a) 4 (b) 3 (c) 0.2 (d) q c Let q be ((-10)/8)/(675/3240). Let i be (-2)/(((-10)/(-4))/51). Which is the closest to 0? (a) -0.5 (b) i (c) 4/5 (d) q a Let v = -27011 + 27094. Which is the closest to v? (a) -1 (b) -2 (c) -3/11 c Let z be ((-38)/10 - -8)/(-9 + (-172)/(-20)). What is the nearest to z in 3, -5, 10? -5 Let s = -0.4 + 0.3. Let l = 818.61 - 818.81. What is the nearest to -2/5 in -4, -4/9, l, s? -4/9 Let l = 12938 + -12992. What is the closest to -1 in l, 1, 3? 1 Suppose -4u + 152 = -2g, 34u + 104 = 37u + g. Which is the nearest to u? (a) -2/13 (b) 2 (c) -3/2 b Let o = -13 + 19. Let j = 5.6 - o. Let s be (-8008)/312 + 22 + 4. Which is the closest to -1? (a) s (b) j (c) 0.1 b Let u be -10 + -11(-165)/121. Let d = 1 - 1. Let p = d - 0.1. What is the nearest to p in u, -2, 0.5? 0.5 Let q = 1612 + -1612. Which is the nearest to 0.1? (a) q (b) -0.2 (c) -2/5 (d) -0.57 a Suppose 0 = 2o - 2i - 20, -5o + 13i - 18i = -80. Let z be 144/48 - o/5. Which is the nearest to 0.1? (a) z (b) -0.4 (c) -5 (d) -2 a Let t = -2.4 + 0.4. Let v = -18893 + 18882. Which is the nearest to -1/4? (a) v (b) t (c) -2/15 c Let z = -238 - -202. Let k be 46/z18/4. Which is the nearest to 2/9? (a) -0.4 (b) 3/2 (c) k a Let i = -241/3 + 80. Let j = -0.083 - 0.217. Let k = 7 - 5. Which is the closest to i? (a) j (b) -0.2 (c) k a Let z = -2.3891 + 1.8891. Which is the closest to 1/6? (a) 5 (b) -2/25 (c) z (d) -3 b Let r = -188.8 + 193. Let q = 29 - 25.8. Let y = r - q. Which is the nearest to 0.1? (a) 3 (b) y (c) -5 b Let x = 31 - 32.1. Let u = x - -2.1. Let w be ((-4)/(-20))/(14/20). Which is the c	{ "pile_set_name": "DM Mathematics" }
a prime number? True Suppose 0 = -5n + o + 1652, -2n + 1640 = 3n - 5o. Is n composite? False Let i(q) = 367q2 + q - 1. Let k be i(-2). Suppose 5l = -0l + k. Is l prime? True Let v(m) = 18m*3 - m + 2. Is v(3) a prime number? False Let c = -279 + 578. Is c a prime number? False Let y be (-6)/4 - 27/(-6). Suppose 135 - 993 = -yz. Suppose -5n = -z + 21. Is n a prime number? True Suppose b + 36 = 4i - 3b, -i + 13 = -2b. Let q(n) = 11n - 4. Is q(i) composite? True Let f = 15 + -10. Suppose -7y + fy = -74. Is y a composite number? False Let x(r) = 4r*2 - 8r + 5. Is x(4) composite? False Let a(f) = -f - 7. Let w(m) = 6m + 2. Suppose -6 - 2 = 4t. Let k be w(t). Is a(k) a prime number? True Let t = -7 + 7. Suppose 0 = -3a - 5x + 137, t = 5a + x + 5 - 248. Is a composite? True Suppose 0 = -4j + 3y + y - 28, 3y = -j + 1. Let b(s) = -2s3 - 3s*2 - 5s + 3. Is b(j) a prime number? False Let y be (5/4)/((-5)/(-20)). Suppose yo - 130 = -2t + 57, 2o + t = 75. Is o a prime number? True Suppose -4q - 3x + 193 = 0, 0 = -3q - x + 185 - 44. Is q prime? False Suppose 1785 = 4p + 269. Is p a prime number? True Suppose -30 = -4p - 2i, -2p + 5p + 2i - 25 = 0. Suppose -4n = 3f - 8, 0 = -f + pn + 9. Suppose 0 = fx - 4v - 171 - 129, 2x - v - 152 = 0. Is x prime? False Let l(g) = -g*3 - 6g*2 + 5g + 8. Let a = -5 + -2. Is l(a) prime? False Let g(m) be the second derivative of m*4/3 - 11m3/6 + m2/2 - 3m. Let z(v) be the first derivative of g(v). Is z(8) composite? False Suppose -2m + 5b - 4 = 0, 2m + b = 2b + 4. Suppose 0 = -2q - ml - 118, -q = 2q - 2l + 177. Let c = -38 - q. Is c composite? True Let x(u) = 33u - 11. Is x(18) composite? True Let p(x) = -110x + 21. Is p(-5) a composite number? False Suppose -1 = k - 2, -k - 1100 = -3a. Is a prime? True Let n(r) = 82r2 - r + 2. Let g(l) = l2 + l. Let j(h) = 2g(h) + n(h). Is j(-1) composite? True Suppose 0n - 4n = 436. Let u = n - -304. Suppose -3c = 2c - u. Is c prime? False Suppose 4j - 2217 = -x - 0x, x + 2760 = 5j. Is j prime? False Suppose 4z = -6d + 2d + 36, -5d + 30 = 2z. Suppose 4u = zn + 237, 0 = 2u - 7u - 3n + 250. Is u composite? False Let h(z) = 43z3 + z2. Let u be h(-1). Let v = u + 133. Is v prime? False Let l = 383 - -100. Let n = -253 + l. Suppose -n = -j - j. Is j composite? True Let m(n) = -15n3 - 4n*2 + 6n - 3. Let q = 10 + -6. Let a be m(q). Is (-4)/22 + a/(-11) composite? True Let s(v) = 5v2 + 2v + 3. Let c be -2(-3)/(-15)5. Is s(c) prime? True Let w(r) = -19r - 6. Let t(q) = 2q - 1. Let j be t(-2). Is w(j) composite? False Suppose -d + v - 2 = -0v, -5d - v = -14. Let g be (4/10)/(d/270). Is 4/6g/4 a prime number? False Let n(z) = z2 + z - 6. Suppose 2h + 20 = -2. Let u = 6 + h. Is n(u) a composite number? True Let i(p) = -p*2 - 2p. Let b be i(-2). Suppose 0 = -q - j + 65, -260 = -4q + 2j - bj. Is q a composite number? True Let o(q) = -7q*3 - 2q*2 - 4q - 3. Is o(-2) a prime number? True Let v = 2138 + -1164. Is v a prime number? False Suppose 0 = k + 15 - 53. Let o = 85 - k. Is o a prime number? True Is 11/77 + 4542/7 a prime number? False Suppose -5i + i = 3q - 41, q - 3 = 0. Let v(a) = a*3 - 9a*2 + 7a + 10. Let b be v(i). Is (3/(-9))/(b/(-474)) a prime number? True Suppose -2o - 177 = -5o. Is o a composite number? False Let m(b) = b*3 - 8b*2 + 8b - 29. Is m(14) a composite number? False Suppose 2p - 872 = -9a + 7a, -3a + 430 = p. Is p a prime number? True Suppose -2p = 2m - m - 155, -305 = -4p + 3m. Is p a prime number? False Is (1557 - -4) + (-6)/3 composite? False Suppose 205 + 1178 = 3l. Let c = l + -276. Is c prime? False Let g(r) = -53r*3 - 2r*2 - 2r - 1. Let l be g(-1). Let j = -3 + l. Suppose 2s = j + 25. Is s composite? False Let c(o) = -2o + 5. Let x be c(3). Let n = x + 142. Is n composite? True Let d be 334/6(3 + 0). Suppose f = 86 + d. Is f prime? False Let b(r) = 14r - 7. Let u be b(5). Let n = u + -40. Is n a prime number? True Suppose -13 - 1 = -2i. Is i composite? False Let k(w) = -w3 + 2w*2 + 2w + 4. Let a be k(3). Is 219a + 9/(-9) a composite number? True Let b be 1 + ((-1)/1 - 3). Let o(q) = -52q + 3. Is o(b) a composite number? True Let a(d) = -d*2 + 5d - 4. Let i be a(4). Suppose 4j = -ij + 452. Is j a composite number? False Suppose -l + 14 = -7. Suppose 5o = 4u - l, o + 0 - 7 = -2u. Suppose -3a + 14 = -u. Is a a prime number? False Let h = -158 + 301. Is h composite? True Let p = -10 + 12. Is p a prime number? True Let m = 52 + 411. Is m composite? False Let x(o) = -2o - 160. Let b be x(0). Is -1(2 + b)/2 a prime number? True Let x(s) be the second derivative of s*4/12 + 2s*3/3 - 4s*2 - 2s. Is x(-9) prime? True Let r(v) = -v - 3. Let j be r(-5). Suppose 4l = -jb + 206, -l + b = l - 93. Is l a composite number? True Suppose -4j + 5d + 204 = 0, j - 264 = -4j + 4d. Suppose 0 = -5i + 6p - 2p - 79, -i - 4p - 35 = 0. Let b = i + j. Is b prime? True Suppose 5p = -4c - 12 + 47, 6 = -3p + 3c. Suppose 4z + 0t = -pt + 696, -5z - 2t + 870 = 0. Suppose 0 = -4u + u + z. Is u composite? True Suppose 2v = -3v + 830. Suppose v = 4z - 166. Is z a prime number? True Let c be 2 + 1 - (-1 - 0). Suppose -cj - 3m + 22 = -2j, 3m - 7 = j. Suppose 4d = -jb + 296, -2d + 180 = 2b + 30. Is d a prime number? True Let j be ((-2)/(-6) + 3)84. Let x be j - (-5 - (-4)/2). Suppose -34 = 3a - x. Is a a prime number? True Let v = 62 + -16. Is v a prime number? False Suppose 9 = -4p + 7p. Let o = p - -2. Suppose -i - 60 = -oi. Is i composite? True Let h(y) be the first derivative of 15y2/2 - y - 8. Is h(4) a prime number? True Suppose 0a - 3a = -6. Suppose af - 37 = -5t, 5f + 6t - 3t - 64 = 0. Is f a composite number? False Let t(k) = 21k2 - 2k + 4. Let p be t(-4). Suppose -2j - 605 = -5j + 4d, -j + 2d + 203 = 0. Let i = p - j. Is i prime? True Let u be (1 + 1)1-5. Let f = u + 11. Is 14f34/4 a prime number? False Let p be 2 + (11 - 6/(-2)). Suppose 4i + 4s + p = 2i, 3i + 5s = -19. Is i composite? False Suppose 37 + 254 = 3j. Is j a composite number? False Suppose 0 = -2b + 2 + 4, -5b = -3j + 8802. Is j prime? True Suppose 2t - 318 = -4q, -65 + 220 = 2q - 3t. Is q a composite number? False Let n = 3 - 1. Suppose c - 64 = 3i, 2c = 5c + ni - 137. Suppose -u + 2u = c. Is u a composite number? True Let d = -641 - -1214. Is d a prime number? False Let q(a) = a + 7. Let l be q(-5). Suppose -4g + 5g - 644 = -4c, 5g = lc - 322. Is c a prime number? False Let o = -143 - -99. Is 6 + -6 + 3 - o composite? False Let n be (10/(-4))/(-5)-2. Let o = n + 6. Suppose -oy + 4f = -175, -4y + 4f = -139 + 3. Is y composite? True Suppose -24q + 19q + 1420 = 0. Let w = -157 + q. Is w prime? True Let d = 931 + 290. Suppose -4l = -l - d. Is l composite? True Suppose 0 = 2v + 3 + 1. Let h = v + 2. Suppose h = 2k - k - 37. Is k a composite number? False Suppose -2v + 5v = 9. Suppose 3f - 5c = 678, 0 = -3f - vc + 532 + 122. Is f a prime number? False Let f = 12 - 7. Suppose -2r - 4m = 20, -53 = 8r - 4r - fm. Is (-3171)/r - (-6)/8 a composite number? True Let u = 6 - 2. Suppose -3 = uc - 151. Is c a prime number? True Let j be -3 + 56 - (-1 - -3). Let l = j - 32. Is l prime? True Suppose -a = 47 - 54. Is a a composite number? False Suppose 2i = 3 + 3. Suppose 4y - 180 = -4p, -iy - y = 4. Is p prime? False Let u(i) = 3i*2 + 41i + 41. Is u(18) a composite number? True Let v(c) = -c*3 + 6c*2 - 4c + 3. Let q be v(5). Is (-2)/(3/((-4452)/q)) prime? False Let n be -17 + (2 - 2). Let f = 21 + n. Is f a composite number? True Let p = 256 - 140. Suppose -3h - s + 25 = -81, s = 3h - p. Is h composite? False Let w(s) = -s3 + 6s*2 - 4s - 7. Let o be w(5). Let t = 2 - o. Let r(i) = i*2 - i - 2. Is r(t) prime? False Suppose -145 = -5u - g, -5u + 3u = -2g - 70. Let v be -12(0 + u/(-9)). Let o = v - 27. Is o prime? True Suppose -j + 3 = j - p, -2p = -j + 3. Let a be (-8)/(-20)595/j. Suppose 2d - 84 = a. Is d prime? False Suppose -267 + 53 = -3g + d, -2*g = -d - 143. Is g a prime number? True Let g be -43 - (2/(-2) - -2). Let j = g + 186. Is j compos	{ "pile_set_name": "DM Mathematics" }
-5)). Put -4, b, q in increasing order. -4, q, b Let g = -3 + -4. Let i(o) = -2o3 - 3o*2 - 2o - 4. Let s be i(-2). Suppose 0 = 4m - m - b - 4, -4m + b = -s. Put -3, m, g in ascending order. g, -3, m Let g = 32 + -65. Let d be 4/6 + 352/g. Let b = -11 - d. Sort 0, -2, b. -2, b, 0 Let i be (-16)/24 + 1 - 124/(-6). Sort 36, -1, i. -1, i, 36 Let c = -0.03 + 3.83. Let k = c + 0.2. Let j be 0/2 + 1/1. Put k, j, -4/3 in descending order. k, j, -4/3 Let c(k) = 17k2 + 222k + 15. Let a be c(-13). Sort -80, a, 4. -80, a, 4 Let g = 2.813 + 1.187. Put 1/7, 45, g in ascending order. 1/7, g, 45 Suppose -4q - t = -2t - 64, 5q - 69 = 4t. Suppose 16z = -7z + 46. Sort z, -2, q in ascending order. -2, z, q Let o = 24/7 + -41/14. Let v = 746 + -753.26. Let n = -0.26 - v. Sort n, o, 2/9 in increasing order. 2/9, o, n Let s be 28/10 - (-48)/(-60). Suppose -s = z - 0z, -5 = 3i - 5z. Let n(d) = -d + 2. Let f be n(2). Put -3, i, f in decreasing order. f, -3, i Let p = 46 - 45. Suppose 7 = s + 3. Suppose 3v = 3n + 30, sn + 46 = 4v + v. Put v, p, 0 in decreasing order. v, p, 0 Let u = 333 + -332. Sort 4, u, -181 in ascending order. -181, u, 4 Suppose 0 = 2h - 26 + 8. Let l(d) = d*3 + 7d*2 + 4d - 7. Let k be l(-6). Sort -1, k, h, 2 in decreasing order. h, k, 2, -1 Let u(x) = x*2 - 4. Let r be u(-3). Let w = -33 + 36. Put r, w, 0, 1 in descending order. r, w, 1, 0 Let h = 1208 + -1213. Sort 0, h, -4 in decreasing order. 0, -4, h Let l(q) = -8q + 141. Let k be l(20). Sort -2, k, 3 in decreasing order. 3, -2, k Let g be -7((-12)/(-7))/(-3). Suppose -4d + 15 + 13 = gi, 8 = 2i. Sort 1, d, -4 in increasing order. -4, 1, d Let b be (-6)/812/(-3). Suppose 4a = ba + 6. Suppose 5 = -3g + f - af, 5g = -2f + 17. Sort -5, 2/5, g. -5, 2/5, g Suppose -4b - 5p = 9, -3p + 5 - 7 = -b. Sort b, 2, -67, -2 in descending order. 2, b, -2, -67 Let t(q) = q + 1. Let v be t(2). Put 1, 14, v in ascending order. 1, v, 14 Let r be 4(-1 + 2 + -2). Let t = 0 - r. Let x be (57/(-21) + 3)7. Put t, x, 0 in decreasing order. t, x, 0 Let g = -711 + 727. Sort 2, g, 4, 3 in increasing order. 2, 3, 4, g Let z = 0.068 - -0.432. Sort z, -2, -4, -5. -5, -4, -2, z Let l(b) = b*3 - b + 2. Let q be l(1). Suppose m = u - q - 2, -2m - 2u = -12. Suppose 2s + w + m = 2w, -s - 11 = -4w. Put s, -4, 4 in decreasing order. 4, s, -4 Let s be (-120)/32(-36)/27. Sort 43, 4, s. 4, s, 43 Let x = 9 - 9.2. Sort -5, 1/15, x in increasing order. -5, x, 1/15 Let l be 27/(-168)2 - 6/14. Let p be ((-6)/(-14))/((-28)/(-49)). Put p, -1/2, l in ascending order. l, -1/2, p Let n be ((-30)/42)/(-5) - 91/(-49). Suppose -5r - x + 20 = 0, -2r = -6r - 4x + 32. Put 4, r, -2, n in descending order. 4, r, n, -2 Suppose 3b - 2 = -5p - 3, -b - 4p = -2. Sort -1, b, -254 in descending order. -1, b, -254 Let w = -1921908203/805 + 2387463. Let a = -1/161 - w. Let n = -113/630 + -3/70. Sort a, 0.4, n. n, 0.4, a Let l(o) = -o2 - 4o + 1. Let n be l(-1). Let i be 10/(-4)(0 - 2). Suppose 5 = -3y - 2g, -ig + 10g - 7 = -y. Put 0, y, n in decreasing order. n, 0, y Let n be (4/(-14)1)/(1/7). Sort -7, n, 5 in descending order. 5, n, -7 Let p(f) = -f*2 + 11f - 28. Let l be p(6). Let u(k) = 4k - 4. Let z be u(5). Suppose 4s - s = 0. Put z, l, s in decreasing order. z, l, s Let z = -9 - -2. Suppose 0 = -69n - 10n + 316. Put n, -2, z, 3 in increasing order. z, -2, 3, n Let i = -0.05 - -3.05. Let g = i + -1. Let t = 1 - 0.5. Put g, t, 2/15 in descending order. g, t, 2/15 Let r be (2 + 4/(-6))/((-212)/318). Sort 3, 0, -29, r in descending order. 3, 0, r, -29 Suppose -4m + 5 = 3q, -5q - 4 = -2m - 21. Suppose -16s - 110 + 78 = 0. Sort m, 1, s in decreasing order. 1, m, s Let x be -2(2/4 - 0). Suppose 3b + 15 = 0, 3b = -h - 0h - 11. Suppose -ht + 17 = -2v + 1, -v = 2t + 4. Sort v, 5, x in descending order. 5, x, v Let g(s) = s*2 - 9s + 11. Let p be g(7). Let a be (-7 - p)(7/(-4) + 1). Sort 0, a, 1, -7 in descending order. a, 1, 0, -7 Let p = -18 - -33. Let c = 0.4 - 0.1. Sort p, c, -0.1, -4. -4, -0.1, c, p Let d = 435 - 438. Sort d, 0, 2, 35 in increasing order. d, 0, 2, 35 Let s = 44 + -118. Let m = s + 106. Put m, 5, -1 in increasing order. -1, 5, m Let p = -912 - -909. Sort -1, 0.3, p, 1/7. p, -1, 1/7, 0.3 Suppose 0 = 3c + 9, c + 27 = -4v - 4c. Suppose 2k = 3 + 5. Suppose -ky + 6 = -2y. Sort v, y, 4. v, y, 4 Suppose 2q = -q, 3n - 27 = -3q. Let v(z) = 13z3 - 5z - 1 - 5 - 5z2 - 12z*3. Let b be v(6). Put b, n, -3 in descending order. n, b, -3 Suppose -3v - 4 + 20 = 4b, 3v = 0. Suppose -9c = -5c + by + 36, -c - 13 = -y. Sort c, 0.1, -3 in descending order. 0.1, -3, c Let v(g) = 32. Let b(s) = -s - 15. Let i(w) = -7b(w) - 3v(w). Let f be i(-2). Let y = -0.2 + 1.2. Put f, y, 3 in descending order. 3, y, f Suppose 9t + 0t = 288. Let r = -37 + t. Suppose -5g + 5 = -5. Put -3, r, g in decreasing order. g, -3, r Let w = -6.41 + 5.81. Sort w, 0.2, 0.5, -0.4 in decreasing order. 0.5, 0.2, -0.4, w Let r = -45 - -38. Suppose -5b = 5q + 40, 4b + 46 - 11 = -5q. Let v be 15/(-2)2. Sort r, q, v. r, v, q Let k = -87 - -63. Let y be 0/((-8)/k - 4/3). Let p(h) = h*2 - h - 3. Let b be p(3). Put b, y, 9 in increasing order. y, b, 9 Suppose -k - 377 = -379. Put 9, 4, k in decreasing order. 9, 4, k Let b be (85/(-34))/((-3)/6). Sort 1, -4, -16, b in ascending order. -16, -4, 1, b Let s be -3 + (9 - (4 + -1)). Suppose sq - 4x = -6x + 10, -5q + 8 = -x. Put q, 5, -6 in increasing order. -6, q, 5 Let f be ((-18)/(-216))/((-2)/(-16)). Put 5, f, 0.2, 3/8 in descending order. 5, f, 3/8, 0.2 Let h be 13/(-3) - 6/9. Let m be (-4)/10 + 13/h. Suppose -16 = 7l - 15l. Put -4/5, m, l in decreasing order. l, -4/5, m Let u be 17 + -14 - (1 - -4). Sort 5, u, 10 in descending order. 10, 5, u Let z(s) = 0 + 6s - 10 + 1 + 8s2 + s3. Let q be z(-7). Let m(y) = y3 + 4y*2 + 2y - 1. Let o be m(-2). Sort q, 5, o. q, o, 5 Let w = 3412.95 - 3413. Let q = 0.4 - -0.1. Sort q, 6, w in descending order. 6, q, w Let q be (1/542)/(((-35)/10910)/(-1)). Let k = -1/271 + q. Let l be 0/1 - (-2)/8. Sort k, l, -0.5. -0.5, l, k Suppose h - 8 = 3h. Let n(c) = -2c*2 + 0c*2 - 6c + 1 + 3c + c2. Let m be n(-2). Put m, -5, h in decreasing order. m, h, -5 Let h = -343 - -343.01. Sort -0.5, h, 2.2, 2/15 in descending order. 2.2, 2/15, h, -0.5 Let m = -16 + 13. Let r = -2 + m. Let p = -6 - r. Sort 0.3, p, -0.3. p, -0.3, 0.3 Suppose 156 = 3r + 48. Let x = 10 - r. Let k = -31 - x. Sort -1, k, 11 in increasing order. k, -1, 11 Let h = 7 + -5. Let z(c) = -c*2 - 173c - 5676. Let b be z(-44). Sort 1, -8, h, b. -8, b, 1, h Let n = 0.96 + 2.04. Suppose 0 = 3h - 5l + 80, 3h + 2h + 5l + 80 = 0. Let j be ((-16)/h)/((-1)/5). Sort n, j, 2 in increasing order. j, 2, n Suppose s - 31 = -s - 5c, -3s = -2c - 37. Let n = s + -14. Put n, 2, -2, -0.3 in descending order. 2, -0.3, n, -2 Suppose -101s + 15 = -96s. Suppose -si - 35 + 89 = 0. Sort -5, 0, i, 2 in increasing order. -5, 0, 2, i Let h be (495/198)/(2/(-4)). Sort -82, h, -3 in increasing order. -82, h, -3 Let q = -2.9 + 2.814. Let u = q - -2.086. Sort u, -36/13, 5. -36/13, u, 5 Suppose 7k + 20 + 1 = 0. Put -5, k, 4, 14 in increasing order. -5, k, 4, 14 Let c = -23.1 - -22. Let b = 0.054 - 2.054. Sort b, 5, 1/7, c in decreasing order. 5, 1/7, c, b Let k = 18.84 + -2.04. Let q = k + -19. Let p = 2 + q. Put -4, p, -0.4 in descending order. p, -0.4, -4 Let h(k) = -4k2 + 3k*2 + 4k*2 - 4 - 2k*2 - 14k. Let o be h(14). Put 5, o, -2 in increasing order. o, -2, 5 Suppose -6t = -5t + 3. Let q(b) = b*3 + 10b*2 - 10b + 27. Let u be q(-11). Suppose -ud = -15d + 5. Put d, t, -1 in decreasing order. -1, t, d Let x be (310/(-248))/(45/(-12)). Let z = -19 - -28. Sort z, -0.3, x in increasing order. -0.3, x, z Suppose 40o - 36 = 28o. Put -5, 4, o, -19 in ascending order. -19, -5, o, 4 Let y(j) = -j + 5. Let k be 1 + 3 - (-10)/5. Let t be y(k). Sort 0.1, 6, t in descending order. 6, 0.1, t Let f be (1 + 5)/((-351)/522). Sort 2/17, -2/7, f. f, -2/7, 2/17 Let t be 23/69 + 2/(6-1). Sort 4, 3, 7, t in decreasing order. 7, 4, 3, t Let y = -240.4 - -240. Sort -5, 0.3, y, -3. -5, -3, y, 0.3 Suppose 8 = -3*r - 76. Let o be 8/r + (-144)/(-	{ "pile_set_name": "DM Mathematics" }
56.9? -69.9 -16.995 - 2 -18.995 What is 616 + -26? 590 What is -56.85 minus -0.5? -56.35 Work out -7.56 - 13. -20.56 Work out 146 + -0.4. 145.6 What is -4628 less than -2? 4626 Add together -1 and -41.27. -42.27 376+0.08 376.08 Work out 196 - 0.1. 195.9 2 - 472882 -472880 Sum 0.5 and -0.876. -0.376 What is -0.1 less than -803492? -803491.9 Total of -0.3 and 22527.8. 22527.5 What is -9440 plus -0.083? -9440.083 What is 20 minus 0.197? 19.803 2 + -2089 -2087 -0.025 + 531 530.975 -0.5 - -39 38.5 Total of -0.8 and -0.84692. -1.64692 Add 1.439 and -6. -4.561 -24.59+0.2347 -24.3553 Put together -0.2 and 6708. 6707.8 -92+-65.8 -157.8 1.353+-111 -109.647 15.288 - 0.5 14.788 Add together -382.8 and 9. -373.8 What is 106.7 - 1? 105.7 Work out 0.0357 - 0.3079. -0.2722 What is 4 minus 0.0315731? 3.9684269 Sum -5.84 and 7. 1.16 Add -39 and 0.21. -38.79 Sum 19104 and 11. 19115 -0.519857 - -0.4 -0.119857 What is 0.0277 plus 11? 11.0277 Add together 2 and -2328. -2326 Work out 5.3 + 699. 704.3 What is -2.716 minus -15? 12.284 What is 0.3 minus -957? 957.3 What is -1797 + 4? -1793 Sum 2442 and 8. 2450 Calculate -0.06 - 1247610. -1247610.06 Work out -951764 + 0.5. -951763.5 What is 0.4 minus 7? -6.6 Add 17305 and 0.6. 17305.6 Add together 228288 and 1.5. 228289.5 Calculate 0.082678 - 0. 0.082678 Add -294543 and -1. -294544 What is 7.9 - 20? -12.1 Add together 371.5958 and -2. 369.5958 Work out -4 - -0.01994. -3.98006 What is -22483 - 4? -22487 What is -0.1707 less than -2.9? -2.7293 Subtract 98.9 from -0.61. -99.51 -1192+0.143 -1191.857 Calculate 742 + 0.163. 742.163 What is 0.03 minus -0.49? 0.52 Calculate -0.4 - 4926. -4926.4 Add 0.75 and 0.05. 0.8 -0.0224 + 31 30.9776 What is -0.02 minus -9.736? 9.716 Add together 0.1023 and 2. 2.1023 What is 645 less than 0.3? -644.7 What is -9039974 take away -0.5? -9039973.5 What is 6.6 minus -0.0279? 6.6279 Add together -0.0778 and -216. -216.0778 What is 0.13 take away 1.333? -1.203 Sum -3680.49 and 0.08. -3680.41 What is 1217 - -5? 1222 Put together -0.315 and -0.113. -0.428 Work out -44 - 0.057. -44.057 Add together -0.56 and 184. 183.44 What is -7 take away 552? -559 Sum 0.12 and -12739. -12738.88 0.1 - -5658.6 5658.7 What is 0.3 - 35343? -35342.7 What is 18.04 minus -2? 20.04 Work out 1861.64 - -0.01. 1861.65 What is 0.9 + -0.029? 0.871 Subtract 0.327111 from -0.4. -0.727111 What is -0.12 - 249? -249.12 What is 12641 take away -51? 12692 What is -0.5 less than 0.016? 0.516 Calculate -57.206 + -3. -60.206 Calculate -13.54 - 4. -17.54 Add 5.1 and 1847. 1852.1 Put together -7933 and -1.1. -7934.1 What is -252 - 4? -256 Total of 4 and 133.5523. 137.5523 What is -0.4 less than -50333? -50332.6 Add 134 and 114.2. 248.2 Add together -13.7 and 352. 338.3 Total of -6728 and 0.69. -6727.31 Sum 6 and 0.57. 6.57 What is 9333409 plus 0.4? 9333409.4 Add -6.6 and 1.87. -4.73 Work out -0.3 - 4.413. -4.713 Total of -3 and 503379. 503376 Work out 3998 - -0.034. 3998.034 What is 2 - -20563? 20565 What is 5 minus 57329? -57324 Calculate 0.1 - 5.8669. -5.7669 What is -155.1 less than 22? 177.1 What is 14.1 plus -0.2? 13.9 What is the difference between -7.768 and -1? 6.768 Work out 484539 - 3. 484536 0.5 + 0.0083 0.5083 Calculate 0.42692 - 0.5. -0.07308 Calculate 305 - 3749. -3444 What is 142 + 0.052394? 142.052394 What is -3.1 - -3.36? 0.26 Work out -0.5 - -1088.7. 1088.2 Add together 4.198 and -0.1. 4.098 Work out -1.57 - 817. -818.57 What is 26 take away 44? -18 Add 41250 and -0.19. 41249.81 Add together 4 and -204. -200 What is 0.808 - -0.12? 0.928 Subtract 0.3 from 1.6349. 1.3349 Work out 2.244 - -0.34. 2.584 What is 0.9864 less than -3? -3.9864 What is -1058 plus 0.098? -1057.902 What is 5 take away 46? -41 What is -0.14 plus -2.262? -2.402 Add 0.56 and 24726. 24726.56 What is -2.8 take away -8? 5.2 What is the distance between -15.9 and 1.3? 17.2 What is 0.06 plus -1563658? -1563657.94 -3+34.02 31.02 What is the difference between 0 and 41.43? 41.43 -7533+-1361 -8894 What is -0.17 less than -907? -906.83 Subtract 0.09 from 617250. 617249.91 Add together 979 and -1.2652. 977.7348 Sum 1 and 289881. 289882 Add 0.762 and -1. -0.238 What is 1040 minus -1304? 2344 What is -1 minus -0.37875? -0.62125 Put together -0.0678 and -34. -34.0678 What is 4.9 - -23872? 23876.9 What is the difference between -5 and -223? 218 4 - 0.0693409 3.9306591 What is 8110 take away -0.067? 8110.067 -0.2+272 271.8 0.0345 + 96.2 96.2345 -79 + 2.684 -76.316 Add together -3.42 and 11. 7.58 Sum 253960 and 0. 253960 Add 0.3 and -37.58. -37.28 What is -0.55503 plus 32? 31.44497 Add -7.8 and 6.09. -1.71 Calculate 24.64876 + -3. 21.64876 Subtract 0.05 from -24.3. -24.35 What is -0.4 plus -124.6? -125 Calculate 103.0795 + -0.5. 102.5795 Total of -2.5 and 139.2. 136.7 Total of 0.3809 and -0.1. 0.2809 What is the difference between 0.1442 and -0.4? 0.5442 Work out 0.1272 - 5. -4.8728 What is 3 less than 12578.2? 12575.2 Put together 0.0133 and 0.1. 0.1133 Sum -1.52 and -7. -8.52 Work out 90 - -0.305. 90.305 -793618 - -5 -793613 Calculate -0.14653 - -0.36. 0.21347 Work out 8378 - -1.4. 8379.4 What is 36869 plus -0.234? 36868.766 -0.2 + 0.1724 -0.0276 What is -20344 less than -12? 20332 What is 0.28 plus 82757? 82757.28 What is the difference between 1.6 and 1485.37? 1483.77 Work out -0.024 - -1.2. 1.176 What is 347 plus 0.3? 347.3 Calculate -19128 - -4. -19124 Calculate 2491 - -6.3. 2497.3 What is -3 take away -7934? 7931 Sum 18.9 and -77082. -77063.1 What is -4 - 446? -450 5+-1903.5 -1898.5 Calculate -569 - 0.3. -569.3 Total of -1565 and 0.3. -1564.7 What is 0.058 + 0.03426? 0.09226 Work out 1.06 + -5. -3.94 -0.075+-0.2 -0.275 What is -0.5 + 61431? 61430.5 What is the difference between 2503 and -2.4? 2505.4 Put together -0.9 and -148. -148.9 What is the distance between -414 and -0.5? 413.5 Add -642 and 0.1. -641.9 Put together 63 and 3060. 3123 Add -1.68 and -0.015. -1.695 Sum 68991 and 6. 68997 Work out -691 + -0.03. -691.03 What is the difference between -27 and -5.3? 21.7 Work out -0.1 + -277516.3. -277516.4 What is 658304 - -0.06? 658304.06 What is -0.5 minus 0.11702? -0.61702 Work out 5.38 - 0.15. 5.23 What is 0.0222 - -0.4? 0.4222 Work out 2.62589 - -0.1. 2.72589 Sum -2.1394 and 11. 8.8606 What is -54 - 0.27? -54.27 Calculate 0.08 + 68221. 68221.08 Work out -43.088 - -1. -42.088 Add -5 and -138.7. -143.7 Work out -17 + 0.596. -16.404 Total of 781 and -26.1. 754.9 What is 3 less than -52.3? -55.3 -1107 + 0.056 -1106.944 Work out 0.028 - 120. -119.972 Sum -0.58643 and -10. -10.58643 What is the distance between -12 and 27308? 27320 Work out 19700 - -0.3. 19700.3 Put together -1.06 and 628. 626.94 What is -89328.3 less than 3? 89331.3 Work out -0.377 + 1.1. 0.723 Put together -0.2 and 2.54646. 2.34646 Put together 18733 and -0.01. 18732.99 Total of -1.46 and -52.47. -53.93 Work out 100 - -7174. 7274 23.94+-0.3 23.64 Calculate -121 - 0.277. -121.277 What is 504681 minus 1.5? 504679.5 Subtract 2.9 from -33376. -33378.9 What is 4064 take away -2? 4066 What is the difference between 2514.7 and -5? 2519.7 Subtract -5420 from -0.059. 5419.941 30581.4+4 30585.4 What is 0.8 less than 13? 12.2 Put together -151707 and -0.4. -151707.4 What is the difference between -11 and 277? 288 What is -28 take away -74? 46 Add together -117.54 and -0.3. -117.84 What is 240 - 0.06? 239.94 What is the difference between -55.2 and 12315? 12370.2 Sum -0.4 and 35. 34.6 What is -18 less than -1679? -1661 Add together 8114362 and -0.1. 8114361.9 What is the difference between -79.09 and 1.2? 80.29 What is -6.343 minus 0.3? -6.643 What is the distance between -0.00932 and 185? 185.00932 Put together -5 and 51.6209. 46.6209 What is -0.01019 minus 20.7? -20.71019 -0.1 + 0.933 0.833 What is 7825 minus -0.03? 7825.03 What is -0.1 + -5677.64? -5677.74 What is the distance between -3688 and -0.1? 3687.9 29.404+0 29.404 Add -143 and -0.13. -143.13 0.02 - 13671 -13670.98 What is the difference between 158.26 and -5? 163.26 Work out -6 - 37.326. -43.326 Put together 0.2 and 26485. 26485.2 -86651+-0.1 -86651.1 What is 3.08714 minus 0.2? 2.88714 What is the distance between 10 and -1930? 1940 What is -9 + -459204? -459213 -0.3 - 7269 -7269.3 -1097 - -399 -698 Work out -0.7551 + -3.6. -4.3551 Subtrac	{ "pile_set_name": "DM Mathematics" }
qrt(228) - (sqrt(228)1 - sqrt(228))) - sqrt(228))-1)/(-2sqrt(48) + sqrt(120)/(-1sqrt(10))). -sqrt(19)/5 Simplify ((sqrt(91)-36 + (sqrt(91) - sqrt(91)-2)4)/(-2(sqrt(7) + sqrt(7) + sqrt(28))25)-1)*2. 117/1600 Simplify (6(sqrt(104) + sqrt(104)-1 - sqrt(104)) + 6-2sqrt(104))/(-2(sqrt(32)/sqrt(4)4 - sqrt(56)/(-3sqrt(7)))). 27sqrt(13)/13 Simplify -5(5 + (42sqrt(34))/(sqrt(2) + (sqrt(2) - sqrt(12)/(2sqrt(6)))) + 1). -80sqrt(17)/3 - 30 Simplify ((-3(-1 + sqrt(567)) + (sqrt(567) - (sqrt(567) + 1 - sqrt(567))-6) + (sqrt(567) - (sqrt(567) + 0 + 4)) + sqrt(567) + -4)-2-6 + 2)*2. -3024sqrt(7) + 81844 Simplify 1((5 + -4sqrt(128) + 2 - (sqrt(128) + 1 + -2 + sqrt(128))1)2 + 4). -768sqrt(2) + 4676 Simplify 1 + -1 + (3 + 2sqrt(162) + -5)2 + -1 + 3. -72sqrt(2) + 654 Simplify sqrt(52)/(sqrt(180)/sqrt(5))5 - ((sqrt(156) - -5-1sqrt(156)) + sqrt(156))/(2sqrt(300)). 59sqrt(13)/30 Simplify (-5((-3sqrt(187)5 + sqrt(187))5)/((sqrt(66)/sqrt(2))/sqrt(3) + -2sqrt(11)1))2. 2082500 Simplify (5 + ((-1(-1sqrt(1053) + sqrt(1053)) + -1 + sqrt(1053) + 4)2 - (-5 + (sqrt(1053) - (sqrt(1053)-2 + 5)))*2))6 + 2. -51058 + 3564sqrt(13) Simplify 2 + 3((sqrt(75) - (1 + sqrt(75)-1 - sqrt(75)))2 + (sqrt(165)/(sqrt(20)/sqrt(4)))/sqrt(11))3 + -5. -261sqrt(3) + 6081 Simplify 5(((sqrt(300) + sqrt(300) + 3-1sqrt(300))/(sqrt(6) - sqrt(30)/sqrt(45)))*2 + -4((1 + sqrt(50))3 + sqrt(450)-5)). 1005/2 + 1200sqrt(2) Simplify (-11(sqrt(60)/sqrt(4) - sqrt(15))5)/(-6sqrt(1728)1 - sqrt(1728)) + 0. 0 Simplify -4(-2sqrt(114)-6-21)/(-6(sqrt(6) - (sqrt(6) - (sqrt(6) + sqrt(12)/sqrt(2)))-4 - (-1sqrt(18))/sqrt(3))). 8sqrt(19) Simplify ((-4(sqrt(204)-1 - sqrt(204)) - (-2-1sqrt(204) + sqrt(204)))/(-5(sqrt(108)5 + sqrt(108))/sqrt(9))1)*2. 17/36 Simplify (((sqrt(300)-2)/sqrt(5))/(-1sqrt(54)))/(((sqrt(16) - -4sqrt(48)/sqrt(3)) + sqrt(16))/(sqrt(24)/sqrt(3)6)). 2sqrt(5)/3 Simplify 2(2 + 3 + (sqrt(448) + 2 + sqrt(448) + sqrt(448))2 + (sqrt(21)/sqrt(3)-6 + (sqrt(14)/sqrt(50) - sqrt(7)))*2). 192sqrt(7) + 218234/25 Simplify 13(4(-2sqrt(252) + 3) - (-3 + sqrt(252) + -6(1 + sqrt(252) - sqrt(252))))2. -6804sqrt(7) + 62559 Simplify -4 + (6(sqrt(117) + sqrt(117) + sqrt(117)1) - -1(sqrt(117) + sqrt(117) + 2sqrt(117)))/(sqrt(36)/(sqrt(4) - sqrt(64)1)-1). -4 + 66sqrt(13) Simplify (((1 + sqrt(2299) + -3 - (sqrt(2299) - 6(-2 + sqrt(2299)))) + (5 + (4 + -1 + sqrt(2299) - sqrt(2299)))-5)1)*2-3. -257040 + 21384sqrt(19) Simplify 1(sqrt(1700)1 + -1 + (sqrt(1700) - 1sqrt(1700)1))2. -2 + 20sqrt(17) Simplify ((sqrt(847) + (sqrt(847) - (sqrt(847) + (sqrt(847) - ((2 + sqrt(847))3 - sqrt(847))))))-3)2 + (-1 + sqrt(112) + (-1sqrt(7))*2 + 0)-4. 2360sqrt(7) + 30792 Simplify (-1 + 0 + sqrt(468) + -6(2 + sqrt(468)))*2 - (4 + 1 + sqrt(468))-4. 804sqrt(13) + 11889 Simplify (3 + ((sqrt(42)/(sqrt(28) + sqrt(7)))/(sqrt(12)/(2sqrt(4))) - -6sqrt(10)/(sqrt(20)/sqrt(4)1)))*2. 40sqrt(2) + 881/9 Simplify (-4-2sqrt(1000)4)/(4(sqrt(72) - (sqrt(72) + sqrt(72)1))2). -20sqrt(5)/3 Simplify (-5(sqrt(112) + sqrt(112) + -1) + sqrt(112) + 1 + 5(sqrt(70)/(2sqrt(10)) - ((sqrt(7) - sqrt(112)) + -3)))*2 + 0. -777sqrt(7) + 11347/4 Simplify (2(-3sqrt(104) + sqrt(104)) - sqrt(104)2-4)/(sqrt(288)/(sqrt(27)/(sqrt(12)/sqrt(4)))). 2sqrt(13) Simplify (sqrt(364)/sqrt(7)-4 + 5sqrt(832))/((-3sqrt(484) - sqrt(484)) + sqrt(4) + (sqrt(32) - (sqrt(32) - sqrt(1568)))/sqrt(8)). -4sqrt(13)/9 Simplify -6((1(sqrt(119)/sqrt(7) + -5 + sqrt(17)) - sqrt(119)/(-2sqrt(343))) + -3)*2 + -3. -80817/98 + 1392sqrt(17)/7 Simplify -3((sqrt(70) + (sqrt(70) - sqrt(70)-24) + sqrt(70))-1-6)/(sqrt(40)/sqrt(4)-3 - sqrt(90)/(sqrt(36) - sqrt(9))). 99sqrt(7)/2 Simplify ((sqrt(4860)1)/(sqrt(6) + sqrt(150) + 1sqrt(150) + sqrt(150)))/(sqrt(242) + sqrt(242)-1 + sqrt(242) + sqrt(2) + sqrt(18)/sqrt(144) + sqrt(2)). 9sqrt(5)/212 Simplify 6(2(1sqrt(720) + (sqrt(40)/sqrt(2) - sqrt(20))1)/(sqrt(1000)2 + -1sqrt(30)/sqrt(3)))2. 1728/361 Simplify ((((sqrt(250)-2 + sqrt(250))-3 + sqrt(250) + sqrt(250))/(sqrt(100)/sqrt(160) - sqrt(10)))/(-1sqrt(5)353))2. 80/729 Simplify -6(1(1 + -6(sqrt(2299) + 1))-3)2-1. 35640sqrt(19) + 4470606 Simplify (5(-2sqrt(70) - sqrt(70) - sqrt(70)))/(sqrt(10) + sqrt(10)26) + (sqrt(784)-1 - sqrt(49))/(sqrt(1008)-2). -415sqrt(7)/312 Simplify ((6sqrt(102)-5 + sqrt(102))-6)/((sqrt(2646) - sqrt(54))-6). -29sqrt(17)/18 Simplify 2(-1(sqrt(448) - (2sqrt(448) - sqrt(448))) + sqrt(448) - (sqrt(448) - (sqrt(448) + sqrt(448) + 2 + -2 + sqrt(448))))*2-4 + 0. -32256 Simplify (sqrt(396) + (sqrt(396) - (sqrt(396) - (-2sqrt(396) + sqrt(396)))-1) + ((5sqrt(396) - sqrt(396))-3 - sqrt(396)) + 0)*2-2. -64152 Simplify ((sqrt(180)/sqrt(45))/((sqrt(192) + sqrt(12))-3) - (sqrt(300) - (sqrt(300) - 1sqrt(300)) - sqrt(300) - (3sqrt(243))2)) + 0. -sqrt(3)/45 + 2187 Simplify ((sqrt(156)-3 + sqrt(156))-4 + (sqrt(156) + -3sqrt(156) + sqrt(156))3)/((-4(sqrt(972) - (sqrt(972) - 1sqrt(972))) - sqrt(972))5). -sqrt(13)/45 Simplify (5(sqrt(1408) + sqrt(1408)-1)4)/(16(sqrt(2) + 5sqrt(98))). 0 Simplify (3(sqrt(240) + sqrt(60))/sqrt(12)6)*2 + (sqrt(5) - (-1sqrt(500) - sqrt(500))*2) + 1sqrt(5)2 + -1 + -4. 3sqrt(5) + 12575 Simplify 1 + 4 + -46(sqrt(320) + 2sqrt(320))-4. 5 + 2304sqrt(5) Simplify (-3 + 4 + sqrt(117)-3-1 + 2)2 + 4. 54sqrt(13) + 1066 Simplify 4 + 2 + -2 + (-2((sqrt(1008) - (sqrt(1008) + 1)) + sqrt(1008)))2 + (sqrt(1008) + 4 + sqrt(1008)-2 + sqrt(1008) + 0)*2. -96sqrt(7) + 4056 Simplify (0 + -4 + -3 + -6(sqrt(1573) + 1 + sqrt(1573))-6)*2. 45936sqrt(13) + 8155273 Simplify -6((sqrt(130)3-4)/((sqrt(70)3 + sqrt(70) - sqrt(70))/sqrt(7)) + -1 + -1)3. 36 + 72sqrt(13) Simplify (5(sqrt(60)/sqrt(192) - (2 + sqrt(5) + 0)) + -2 + (sqrt(245) - (sqrt(245) + 1)) + sqrt(245) + 2 + sqrt(245) + 2sqrt(245))*2-2. -48981/8 + 1067sqrt(5) Simplify ((sqrt(121) - -2sqrt(121))-4 - sqrt(121))/(sqrt(11) - sqrt(176)-6) + -2 + -6(sqrt(11) + 0) + 0. -163sqrt(11)/25 - 2 Simplify (-2(2 + sqrt(704) + -2 - sqrt(704)) + (1 + sqrt(704))-4 + (sqrt(704) - (sqrt(704)1 + -1)) + 5)2. -128sqrt(11) + 11268 Simplify -2(1sqrt(99))*2-1 + (sqrt(99) - (0 + sqrt(99)))1-3. 198 Simplify ((sqrt(847) + 0)-2 + sqrt(847) + sqrt(847)26)2 - (-2((sqrt(7) - (sqrt(7) + sqrt(343) + 5 - sqrt(7))) + 3))*2. -96sqrt(7) + 101463 Simplify (1-5(2 + (sqrt(475) - (4 + sqrt(475))) + -1 + -1 + (sqrt(475) - (4sqrt(475) + -3))))2. 750sqrt(19) + 106900 Simplify (sqrt(110)-1-1)/((sqrt(90)1)/sqrt(9)) + 4(sqrt(132)-1)/sqrt(12)-4. 17sqrt(11) Simplify (-2 + (((sqrt(162) + -3sqrt(162)-2 + sqrt(162))/sqrt(3))/(sqrt(20)/(-2sqrt(10)) + sqrt(18)1))2)6. 41172/25 Simplify (-5 + 4 + 0 + 0 + sqrt(1216) + (sqrt(1216) - (0 + sqrt(1216)))6-1 + 5)*2. 64sqrt(19) + 1232 Simplify ((1sqrt(1872))2 + -1)1 + sqrt(325)3 + (sqrt(104)/(-3sqrt(8)) + sqrt(13))*2. 15sqrt(13) + 16891/9 Simplify (-1sqrt(90)2 - (sqrt(90) - sqrt(90)-26))/((-1sqrt(3200))/(-1sqrt(40))). -45sqrt(2)/4 Simplify 5 + -5 + sqrt(18)/((sqrt(18)4)/sqrt(2)) + (-4(sqrt(8) + sqrt(2)) + sqrt(2) - 2sqrt(2)-4)2. sqrt(2)/4 + 18 Simplify -2(sqrt(15)/(sqrt(6)/sqrt(2)) + sqrt(5) + -5) + (-1 + sqrt(180))*2-4-2. -100sqrt(5) + 1458 Simplify -3(-4sqrt(108))*2 + sqrt(108) + (sqrt(108) + sqrt(108)4)6 - ((5 + 1 + sqrt(108) - sqrt(108)) + ((sqrt(108) + sqrt(108) + 0)-2)*2 + 4). -6922 + 186sqrt(3) Simplify ((-3sqrt(135))/sqrt(9) - sqrt(1500)-3)/((-2sqrt(1225) + sqrt(25))/(sqrt(45)/(sqrt(27)/sqrt(3)))). -27sqrt(3)/13 Simplify ((0 + sqrt(128) + 3 - (sqrt(128) + -1 + 1 - -3(0 + sqrt(128)))) + 2)2. -240sqrt(2) + 1177 Simplify (-4 + (6-6(sqrt(162) + 2))*2 + (-6(2 + sqrt(162)) - (sqrt(162) + -1 + (sqrt(162) - (sqrt(162)-3 + sqrt(162)))))2)2. 97272sqrt(2) + 462906 Simplify sqrt(26)/(sqrt(20)/sqrt(10)) - (sqrt(1053) + 1) - (-3(sqrt(117)/sqrt(9) - sqrt(13)) + (sqrt(468)1)2). -469 - 8sqrt(13) Simplify ((sqrt(121) - 2sqrt(121)2) + 6sqrt(121)2)/(-6-2sqrt(11)3) + 0. sqrt(11)/4 Simplify -2(sqrt(7)14 - (sqrt(7) - (-4sqrt(847) + sqrt(7))) - (sqrt(126)-1)/(sqrt(242)-2))*2. -5457823/242 Simplify	{ "pile_set_name": "DM Mathematics" }
120q2v*3 - 134v*2 + 4v Differentiate 2l4 - 683l*2 - 2l - 114248 wrt l. 8l3 - 1366l - 2 Find the third derivative of -552o4s + o*3s - 2o3t2 - o2s - o2t*2 - 3ost + 3ot - 5t2 wrt o. -13248os + 6s - 12t2 What is the derivative of 1888hm3t + 639hmt2 + 6m*3t + m*3 - 5m*2 + 7mt - 51t*2 wrt h? 1888m*3t + 639mt2 What is the third derivative of q5y2 + 1373971q*3t*2y + q*2t*2y2 - q2y2 - 7q*2 - 504qt2y*2 + 3q + y wrt q? 60q2y*2 + 8243826t*2y What is the derivative of 423257c2 - 397345? 846514c Find the second derivative of -g*4 + 225g*3o - 2g2o + 24go + 2g - 51 wrt g. -12g*2 + 1350go - 4o Find the first derivative of 41hy*3 - 236hy2 + 3hy - 95y*3 + 112y wrt h. 41y3 - 236y*2 + 3y What is the second derivative of -34237g3y + 2gy + 5g - 92y + 10 wrt g? -205422gy What is the derivative of 293ku*2 + 99ku + 1462k wrt u? 586ku + 99k What is the second derivative of -718v*4 + 29v*3 + 186772v - 1? -8616v2 + 174v Find the third derivative of 20j6w + 13j6 + 8948j*2w + 6w wrt j. 2400j*3w + 1560j3 Find the second derivative of 13s*3y*4 - 1027s*3 + 47s*2y - 69126y4 - 7 wrt y. 156s*3y*2 - 829512y*2 Differentiate 177483t*4 + 168425 wrt t. 709932t*3 What is the second derivative of 19j*4 - 73j*3 - 8j*2 + 7311j - 2 wrt j? 228j2 - 438j - 16 What is the third derivative of 51r4 - 4528r*3 + 4r*2 - 26183r - 5 wrt r? 1224r - 27168 What is the third derivative of -24mn3r*2 + 427mn3r - 3224mn*2r*2 - 27mnr*2 + mr2 + n3r wrt n? -144mr2 + 2562mr + 6r Find the third derivative of 170m3u*3 + 82m*3u - 2m2u*3 - 9632u*3 wrt m. 1020u*3 + 492u What is the first derivative of cg2q - 294854cg*2 - 55051g*2q + q wrt q? cg2 - 55051g*2 + 1 Find the second derivative of 2pq4 - 2pq3 + 2480pq2 - 88334pq wrt q. 24pq2 - 12pq + 4960p What is the second derivative of 393916i2w*2 + 7i*2w + 5i2 + 31i + 8w + 2 wrt w? 787832i*2 What is the second derivative of -12kq3 + 2k + 2q3 + 536q*2 - 8609q wrt q? -72kq + 12q + 1072 Find the second derivative of -105010y*2 - 37y + 685. -210020 What is the third derivative of -3n5 - 9995n*4 - 33n*2 + 5n - 3? -180n2 - 239880n What is the third derivative of -188300k3y*2 - 4k*2y*2 + 20k*2y + 8k2 wrt k? -1129800y*2 What is the second derivative of -32206g*4 - 2g*3 - 7072g + 2 wrt g? -386472g2 - 12g Find the first derivative of -2oq*4y + 16386oq*3y + 12oy + 5o + 6y - 12 wrt q. -8oq*3y + 49158oq*2y Differentiate -104552a4 + 116240 with respect to a. -418208a*3 Differentiate 2176d*2 - 4ds2 - 2d - 2s2 + 348541s with respect to d. 4352d - 4s*2 - 2 Differentiate 70449h + 79628. 70449 What is the derivative of -14v4 - 116v*2 - 2v - 139737 wrt v? -56v3 - 232v - 2 Find the second derivative of d*2h*2v - 53d2hv2 + d2hv - 6dh2v*2 + 5dh2v - 7dv - 36h2v wrt v. -106d2h - 12dh*2 Find the first derivative of 142067v*4 + 2v + 427791 wrt v. 568268v3 + 2 What is the first derivative of -88197k*2 - 99796 wrt k? -176394k What is the second derivative of -80070u2 - 286847u? -160140 Differentiate -7hm*3 - 17864hm2 - 172m*3 + 65m*2 - 8m wrt h. -7m3 - 17864m*2 What is the second derivative of -2p*3 - 19767p*2 - 1140p + 8? -12p - 39534 Find the second derivative of jm*3 - 3jm2u*2 + 3jm2u - 1963jmu2 - 3m*3u*2 + 895m*2u wrt u. -6jm*2 - 3926jm - 6m*3 Find the third derivative of 2d*3p*3s - 1581d3s*3 - 7d*3 - 25d*2p*3s*2 + dps - 317p*3s + 2s3 wrt d. 12p*3s - 9486s3 - 42 Differentiate 22871z*4 - 2z - 17032 wrt z. 91484z3 - 2 What is the second derivative of -32142h*3j*2 - 1072h*3j - 2h3p + 24hj*2p + hjp - 2h + 10jp - 2p wrt j? -64284h3 + 48hp Find the third derivative of -536505l*5 + 1081l*2 + 441 wrt l. -32190300l*2 Find the third derivative of -2546u*3z3 + u3 - 3u2z3 - u2z2 - 4uz - 4638z*3 wrt u. -15276z*3 + 6 Find the third derivative of -41f6 - f3l - 73f*3 - 11050f*2l - f*2 - 2f - l wrt f. -4920f3 - 6l - 438 What is the third derivative of 867723q4 + 298q*2 - 2q + 159 wrt q? 20825352q What is the third derivative of -22396w*3 - 437w*2 + 10? -134376 What is the second derivative of 5gt4 + 664gt - 29g - 20310t5 wrt t? 60gt2 - 406200t*3 Find the third derivative of 1226520f*5 + 27470f*2 + 69f wrt f. 73591200f2 Find the third derivative of -51c*4t*2 - 268c*3t + 9c3 + 205406c*2t*2 + 2ct2 wrt c. -1224ct2 - 1608t + 54 Find the second derivative of 65h5l*2 - 831h*5l + 2hl*2 - h + 201l*2 + 2 wrt h. 1300h*3l*2 - 16620h*3l Find the second derivative of 4hq*2s*3 + 38hq2s + 2hs - 2806q3s*2 + 12q*3 - 2s*3 wrt s. 24hq2s - 5612q3 - 12s What is the second derivative of 6q4 - 3278q*3 - 115356q? 72q2 - 19668q Find the third derivative of -4a4 - 44929a*3d*3 - 3a*2d*3 - 777834ad3 wrt a. -96a - 269574d3 Differentiate -303438h*2 - 204365 wrt h. -606876h Find the third derivative of -304521t4 + 2t*2 + 48t - 8. -7308504t What is the first derivative of -34744h*2 - 20674? -69488h Find the second derivative of -500438w2 - 464824w. -1000876 Find the third derivative of -57501s4 + 960s*2 wrt s. -1380024s What is the third derivative of 85676w3 - 64w*2 - 4w + 2 wrt w? 514056 What is the third derivative of -153991i5 + 11i*2 + 1173i - 1 wrt i? -9239460i2 Differentiate -963665d*2 - d - 956905. -1927330d - 1 Find the second derivative of 9474g2 + 27285g. 18948 Find the third derivative of 4gn*3tx - 5gn3x + 2gn*2 - 577gnt + 5gnx2 - gt + 1968n3x*2 - 4n*2x*2 + 2ntx*2 - 2tx wrt n. 24gtx - 30gx + 11808x2 Find the first derivative of -2ty2 + 69ty + 33830t + y*3 - 4y wrt y. -4ty + 69t + 3y*2 - 4 Find the second derivative of ht*2 + 1789ht + 12h + 3497t2 - 2t wrt t. 2h + 6994 Find the third derivative of 307q*4 - 4q*3 - 3449q*2 - 11q wrt q. 7368q - 24 Find the first derivative of 2381274p*2 - 2148866 wrt p. 4762548p Find the second derivative of 473329d3 - 467149d wrt d. 2839974d Find the first derivative of 3dgl + 14dlq - 3dl - 336dq + 2glq + 442988gl wrt g. 3dl + 2lq + 442988l Differentiate 4003t*2v*2 + 722609t*2 + 82tv2 wrt v. 8006t*2v + 164tv Find the second derivative of 20075p3 - 1150p - 22 wrt p. 120450p Differentiate 14480w4 - w2 + 134293 wrt w. 57920w3 - 2w What is the third derivative of 59843l3 + 40653l*2? 359058 What is the first derivative of -77075h + 1235544? -77075 What is the derivative of -575697d - 3962 wrt d? -575697 What is the derivative of -u3z*2 - 12u*3z + 27u - 145z*2 + 138 wrt u? -3u*2z*2 - 36u*2z + 27 Find the first derivative of -141n4 - 5n*3 + 21n + 372780 wrt n. -564n3 - 15n*2 + 21 What is the second derivative of -600c*4o*2 + 45c*2o*3 + co + 11935o3 wrt c? -7200c*2o*2 + 90o3 Find the second derivative of d2l2u - 3d2lu + 506d*2u - dlu - l*2u + 96l2 - 55lu wrt d. 2l*2u - 6lu + 1012u Differentiate 3it3 - 10i + 309529t3 - 35826 with respect to t. 9it2 + 928587t*2 What is the second derivative of 10s*3u*2 + 726s*3u - 15s3 + 227s*2u*2 + 3su2 + u2 wrt u? 20s*3 + 454s*2 + 6s + 2 Find the second derivative of -21459n2 - 10447n wrt n. -42918 Differentiate 2s3x - 719033s3 + 3sx + 117897x with respect to x. 2s3 + 3s + 117897 What is the second derivative of 1931306f2 - 1365114f wrt f? 3862612 What is the third derivative of -852v4 + 409v*3 + 11v*2 - 67174? -20448v + 2454 Find the second derivative of -4u2v*2x + 3u2v*2 - 2u*2vx + 19u*2x - uv2 - 29ux - 2v*2x wrt v. -8u2x + 6*u	{ "pile_set_name": "DM Mathematics" }
ppose 21m - dm - 750 = 0. What is the units digit of m? 5 Let l(m) = -131m + 15. Let n be l(2). Let d = n - -249. What is the units digit of d? 2 Let o(m) = -948m - 2547. What is the units digit of o(-6)? 1 Let s(b) = 2787b - 636b - 28 + 0 - 42 + 21. What is the tens digit of s(1)? 0 Let j = 703 - -5035. What is the units digit of j? 8 Let v = -264 + 286. Suppose -vn = -19n - 933. What is the tens digit of n? 1 Let x be (-2 + -2738)/2(-14)/(-35). Let s = 798 + x. What is the hundreds digit of s? 2 Let p(s) = -37s*2 + 3s + 4. Let f(y) = 111y2 - 9y - 12. Let h(z) = -6f(z) - 17p(z). Let w be h(-2). Let u = 226 + w. What is the tens digit of u? 7 Let i(k) = -k*2 + 67k - 771. Let g be i(28). Let a(p) = 6p3 + p - 3. Let z be a(-3). Let b = z + g. What is the tens digit of b? 5 Let j = -12 + -1. Let a(o) = o3 + 12o*2 - 14o - 11. What is the units digit of a(j)? 2 Let d = 1024 + -1019. Suppose -f - 1 + 5 = 0. Suppose -do = 10, 2o + 154 = fs + 3o. What is the units digit of s? 9 Let d(u) = 17u - 70. Let f(x) = 34x - 137. Let z(p) = -11d(p) + 6f(p). What is the tens digit of z(33)? 0 Let s = 8685 - -2645. What is the hundreds digit of s? 3 Let n(m) = -3m - 7. Let y be n(2). Let x = y - -183. What is the hundreds digit of x? 1 Suppose -52456 = -158y + 934577 + 272069. What is the hundreds digit of y? 9 Let q(t) = 94t2 + 114t + 67. What is the hundreds digit of q(9)? 7 Suppose 3k + k - 1327 = -3l, 4k - 4l = 1292. Let a = k - 240. What is the units digit of a? 8 Let o(a) be the first derivative of 5a3/3 + 5a*2/2 - 29a - 20. What is the hundreds digit of o(-7)? 1 Let o = -13 - -18. Suppose 4u = 5h - h + 4, -41 = -ou - 4h. Suppose -209 = -3t + ux + 174, 4x - 270 = -2t. What is the units digit of t? 1 Suppose 0 = -4a - u + 20941 + 4602, -3u = -3a + 19176. What is the hundreds digit of a? 3 Let l(i) = 18i*2 - 6i + 33. Let h = -122 - -128. What is the tens digit of l(h)? 4 What is the hundreds digit of ((-72)/(-75))/(-2)-3420 - (-44)/110? 6 Suppose -9s + 175 = -725. Suppose -5i - 5f = -130, -s = -2i - 3i + f. Suppose -3w - 2k + 487 = i, 2k - 10 = 0. What is the hundreds digit of w? 1 Let p be (-12)/(-21) - 55072/(-56). Let l = p + -715. What is the tens digit of l? 6 Suppose -27s + 18 = -279. Let x(l) = 5l - 1. Let f be x(-1). What is the units digit of 4/fs/(-22)279? 3 Let w = -4281 + 8303. What is the hundreds digit of w? 0 Suppose -51u = -4000 + 277. What is the units digit of u? 3 Let i(y) = y*3 + 34y*2 + 52y + 64. Let d be i(-34). Let z = d - -2452. What is the units digit of z? 8 Let q(l) = 27l - 118. Let p(h) = -4h. Let y(v) = -5p(v) - q(v). What is the units digit of y(-23)? 9 Suppose -v + 3t = 0, 0 = -2v - 0t - 3t. Suppose 0 = -3a - y + 1401, vy = -4a + 2y + 1878. What is the hundreds digit of (10/(-3))/(-5)a/2? 1 Let o(u) = 2u2 + 1381 + 23u + u*2 - 1398. What is the hundreds digit of o(6)? 2 Suppose 4k = -4v - 16, -2v + 1 = -3k - 11. Suppose -2l - 3g + 290 = v, 2l - 4g + 2g = 310. What is the hundreds digit of l? 1 Let f = 6755 - 3143. What is the thousands digit of f? 3 Let l(q) = -7q - 94. Let g(y) = -y2 + 35y - 91. Let v be g(33). What is the units digit of l(v)? 1 Let l(m) = -74m - 1560. What is the hundreds digit of l(-52)? 2 Let g(x) = 7x*2 - 2x - 167. Let u be g(-12). Let k = 1553 - u. What is the units digit of k? 8 Suppose -3s + 714 = 3v, 0 = -7s + 5s + 4v + 482. Suppose s = 24u - 169. What is the tens digit of u? 1 Suppose 0 = 3v - n - 25571, -2v - 2n = -3n - 17046. What is the thousands digit of v? 8 Suppose 5q - 6762 = -3q + 7q. What is the units digit of q? 2 Let q(c) = 73c + 149. What is the units digit of q(24)? 1 Let j = -233 - -245. Let o(h) = 47h + 46. What is the units digit of o(j)? 0 Let c(h) = -5h*2 - 16h + 67. Let i(w) = -7w2 - 15w + 67. Let u(f) = -3c(f) + 2i(f). What is the units digit of u(10)? 3 Suppose 78 = s - 3n, -134 = -5s + 5n + 306. What is the hundreds digit of s(64/3 - 6)? 4 Let f(j) = j*2 - 19j*3 + 5 - 3 - 14j + 0j2 - 14 + j2. What is the thousands digit of f(-4)? 1 Let t(s) = -11s + 52. Let u be t(4). What is the units digit of u/(-12) + (-85032)/(-54)? 4 Let v = -22 - 31. Let m = -135 - v. Let s = m - -136. What is the units digit of s? 4 Suppose 0 = -5o - 6w + 139383, -w + 94887 + 44456 = 5o. What is the ten thousands digit of o? 2 Let n = 78 - 82. Let t be n/(-22) + 249/337. Suppose -t + 179 = s. What is the hundreds digit of s? 1 Let b be ((-9)/(-18))/(2/(-4)) - -3. Suppose -br = -r - 71. Suppose 5d + r = 366. What is the units digit of d? 9 Let n = 66873 + -43815. Suppose 22j - 40j = -n. What is the thousands digit of j? 1 What is the units digit of 5/2020 - (26 - 7911)? 0 Suppose -1 + 4 = 3d. Let c be -538d/(2/(-3)3). Let t = -35 + c. What is the units digit of t? 4 Let u = 1 + -1. Let n(x) be the second derivative of -x4/12 - x3/3 + 9x2 + 25x + 1. What is the tens digit of n(u)? 1 Let f = 30 + 25. What is the tens digit of (f/(-25))/((-4)/100)? 5 Suppose 14i = 5u + 11i - 23160, 3u + 2i - 13896 = 0. What is the tens digit of u? 3 Let t(s) = 2s*2 - 24s + 74. Let v = -28 + 40. What is the units digit of t(v)? 4 Suppose -231621 - 645921 = -33l - 36l. What is the ten thousands digit of l? 1 Let x be (-708)/24 + (-2)/4. Let j = -22 - x. What is the units digit of (-12)/j + 194/4? 7 Suppose 173827 = 5i - 33s + 49s, 2i - 69535 = -5s. What is the ten thousands digit of i? 3 Let k be 108/11 + ((-14)/(-77) - 0). What is the units digit of 2102/k(-10)/(-3)? 0 Suppose -5i = 199 - 319. What is the tens digit of (i/(-10))/(27/(-5400))? 8 Let p be (5 + (-5)/2)/((-5)/(-10)). Suppose 31 - 19 = 3u, -pu - 3376 = -4q. What is the hundreds digit of q? 8 Suppose 3k - u - 67575 = 0, -28625 = -k - 3u - 6110. What is the units digit of k? 4 Let x = 823 - 814. Let a(r) = 162r + 10. What is the thousands digit of a(x)? 1 Let p(b) = 12b2 + 5b - 22. Let r be p(12). Suppose -5m = 0, -i - 2m + r + 1615 = 0. What is the hundreds digit of 2/(-9) - i/(-27)? 1 Suppose 277737 = 103q - 366131 - 295904. What is the hundreds digit of q? 1 Let z be 5/((-35)/(-749)) - (-1 + 7). Suppose -2d + 2k = -412, zd - 97d = k + 821. What is the units digit of d? 5 Let c(d) = -81 + 31d - d*2 + 25d + 11. What is the units digit of c(37)? 3 Suppose -5m = -d - 213, 5d = -5m + m + 153. What is the units digit of 396 + 7/(m/18)? 9 Let y = -1 + -19. Let p = -15 - y. Suppose pi - 14 = 11. What is the units digit of i? 5 Let d(u) = 3u2 - u + 2. Let f be d(0). Suppose fn - 5v = 69, -v - 4v + 15 = 0. What is the tens digit of n? 4 Suppose 1997502 = 64a + 1307508 - 2215094. What is the tens digit of a? 9 What is the hundreds digit of 1 - 2505902/(-34)(3 - 2)? 7 Let w be -16(-8)/(16/(-19)). Let i = 25 - w. What is the tens digit of i? 7 What is the tens digit of (-29 - (-6 + 19))/((-4)/2486)? 0 Let o = 33 + -33. Let h be 3/12 + (o - 37125/(-12)). Suppose 22y = 5y + h. What is the hundreds digit of y? 1 Suppose -1 = 3q - 3z - 7, -q + 14 = 5z. Suppose 2u - o - 3291 = 0, qu - 5o = -2o + 6579. What is the thousands digit of u? 1 Suppose 30j - 21j - 32j + 167440 = 0. What is the units digit of j? 0 Let z be -3(0 + (-476)/6). Let g be ((105/(-25))/21)/((-1)/15). Suppose 4n - z = gn. What is the units digit of n? 8 Let x be (6/4)/((-2)/(-4)). What is the hundreds digit of (1766 + -5)/x + -3? 5 Let b(c) = -c*3 - 28c*2 - 51c - 92. What is the hundreds digit of b(-30)? 2 Let h(x) = -246x - 54. Let a be h(-7). What is the tens digit of 10/(-5 + a/332)? 1 Suppose 1743 + 1326 = 3c. Let g = c - -801. Suppose 25s - g = 17s. What is the units digit of s? 8 Let l be (-23)/((-11280)/2255 + 5). Suppose 0 = 15b - 4b - l. What is the units digit of b? 3 Let a(g) = 54g2 + 604g + 36. What is the hundreds digit of a(22)? 4 Let d = 1499 - 807. Suppose 3002 = 14t + d. What is the tens digit of t? 6 Suppose -4i + 4d - 2450 = 6d, -1 = d. Let t = -340 - i. What is the tens digit of t? 7 Let a(w) = 2w3 - 9w*2 - 6w + 12. Let l be a(5). Suppose 9 = l*i + 9. What is the hundreds digit of 107 - (i/(-6 - -4) - 4)? 1 Let s = -142 + 664. Let o	{ "pile_set_name": "DM Mathematics" }
- kg + 3g - 4 = 0, -4 = 4m - 3g. Put 3, m, i in ascending order. m, i, 3 Let o = 8 + 27. Let v be (o/(-14))/((-2)/4). Sort 4, v, 3. 3, 4, v Suppose -5t = -2j - 22, 3t = 2t + 4. Let g be (2 - -1)/(1-1). Put j, g, 1 in increasing order. g, j, 1 Let x(n) = -n + 3. Let z be x(3). Let q = 2 + z. Sort 0, q, 5. 0, q, 5 Suppose k = 4m - 18, 0 = 4k + 3 + 5. Put 0, 5, -4, m in decreasing order. 5, m, 0, -4 Suppose 2d = 4, 3g - 21 + 7 = -d. Suppose 5s + 9 = 2s. Sort g, 0.1, s. s, 0.1, g Let m be 4/(-6) + 35/(-15). Put 3, 6, m, 5 in descending order. 6, 5, 3, m Suppose 0 = -3v + 7v + 4. Let n = -2 + 2. Suppose -5u - 5z + 2 = -u, n = 5u - 3z + 16. Put v, 5, u in increasing order. u, v, 5 Let i = 0.2 + -0.2. Let y = 4.09 + -0.09. Sort i, 2, y. i, 2, y Let i = 0.1 - 0.1. Let n = 0.1 - i. Let a = -2.7 - -3. Sort n, a, 1 in decreasing order. 1, a, n Let a = -275/3 + 93. Let z = -0.26 - 0.14. Sort -1, a, z in decreasing order. a, z, -1 Let l = -5 - -5. Suppose -j = -2 + 6. Put l, 3, j in descending order. 3, l, j Suppose m - 17 = -5k, -k + 2m - 6 + 16 = 0. Let r be (-4)/(-8)k/(-10). Sort r, 4, -1/7 in decreasing order. 4, -1/7, r Let b be ((-12)/5 - -2) + 0. Let u = 6.67 + -7. Let s = 0.03 + u. Sort b, s, 1 in decreasing order. 1, s, b Suppose -4f + f = -15, 2r = f - 9. Sort 5, -1, 6, r in descending order. 6, 5, -1, r Let x be 2/9 - (-25)/9. Let g(t) = -2t + 3. Let c be g(2). Sort -3, x, c in descending order. x, c, -3 Let j(g) = g + 3. Let d be ((-4)/(-6))/((-5)/15). Let v be j(d). Sort v, -5, -3. -5, -3, v Let z = -28 - -28. Let s = 0.39 + 0.01. Put s, 2/9, z in descending order. s, 2/9, z Let k = 0.3 + -0.4. Let b = 0.31 - 4.31. Sort b, k, -0.3. b, -0.3, k Let h = -59 - -58.8. Let b = 413/5 + -82. Sort -0.05, h, b in descending order. b, -0.05, h Suppose -3x + 2 = -7. Let c = x - -1. Sort -5, c, -2 in ascending order. -5, -2, c Let r = -90 - -64. Let i = r + 157/6. Sort i, 1, -1/5. -1/5, i, 1 Suppose 2l - 1 = 3. Suppose u - l = -t - 6, 4u = 0. Let n = -2 - 3. Sort t, 2, n in descending order. 2, t, n Let a = -103487/84 - -1232. Let t = a + 151/1428. Sort 3, t, -1/6. -1/6, t, 3 Let d = 5 + -4. Suppose 0 = -4x - 2 + 10. Let a be (-8)/3 + 4/6. Sort d, a, x in ascending order. a, d, x Let t = -29 - -29.4. Sort 4/5, -5, t. -5, t, 4/5 Let j be 7 + 6 + -3 + -6. Put 5, 3, j in ascending order. 3, j, 5 Let l be 90/25 - 2/(-5). Suppose 4q - 18 = u, -5u - 7 - 3 = -lq. Suppose 5d + 33 = 8. Sort d, 4, q in ascending order. d, 4, q Let k(o) = -o + 7. Let n be k(9). Let d be 4 + 1 + (-6)/3. Sort 5, n, d. n, d, 5 Let m be (-49)/39 + (-32)/(-24). Put 0.4, m, 0.5 in decreasing order. 0.5, 0.4, m Let i = 0.1 - -0.7. Let v = i - 1. Suppose 2l + 2w + w + 21 = 0, 4l = -2w - 22. Sort l, 2, v. l, v, 2 Suppose 0 = 4l - 9l + 5. Let f(t) = t - 7 - t2 + 0t*2 - l - 9t. Let c be f(-7). Put c, -3, 5 in increasing order. -3, c, 5 Let j = -0.1 + 0.4. Put 0, -3, j in ascending order. -3, 0, j Let g(o) = 1 - 4o + 16 + 0o + 5o. Let x be g(-17). Put -1, 2, x in descending order. 2, x, -1 Suppose 0 = 3b + 5a - 9, 3a - 1 = 3b - 10. Suppose 0 = n + 4 - 5. Sort 0, b, n in decreasing order. b, n, 0 Let a(b) = b + 1. Let t be a(-1). Put -2, -2/25, 3, t in decreasing order. 3, t, -2/25, -2 Suppose -16 = j + 5c, -6c = -2j - c + 13. Let z(d) = d*2 + 2d. Let t be z(1). Suppose 0v - 4 = -2v. Sort v, j, t. j, v, t Let y = 0 - -0.3. Let a = y + -5.3. Let x be 2/7 - (2 - 2). Sort x, a, -1/2 in decreasing order. x, -1/2, a Let u be (-4 + -5)/(1 - 0). Let y be -12(1 + 15/u). Suppose -g = 3g - y. Put g, 4, -3 in ascending order. -3, g, 4 Let f = -26/5 - -172/35. Let c be (-10288)/(-180)(-2)/(-192). Let b = -1/216 - c. Sort b, -1/6, f in decreasing order. -1/6, f, b Let s(w) = -w2 + 3w + 11. Let m be s(6). Sort 2, -4, m in decreasing order. 2, -4, m Suppose -21 = 4w + 3b - 2b, -21 = -w + 5b. Let g be (-2)/4(-2 - -2). Let i(p) = -p3 + 7p*2 - 5p - 8. Let m be i(6). Put g, m, w in descending order. g, m, w Let z(l) = -l*2 + 9l - 10. Let h be z(7). Let d be (-1)/(-3) - 93/9. Let t be 34/10 + d/25. Sort h, t, -2 in decreasing order. h, t, -2 Let s = -21/5 + 5. Sort 0.1, -5, s. -5, 0.1, s Suppose 2w + 3w = -15. Let l = 4 + w. Let i be l/(-1) + 5/4. Sort i, -1/4, -3 in decreasing order. i, -1/4, -3 Let b be 14/35 - (-2 - -2). Sort -3, b, -0.1 in ascending order. -3, -0.1, b Let m = 12 + -16. Put m, 4, 0 in descending order. 4, 0, m Let k be 5/25 + 2/15. Let v be (1 - (-8)/(-2)) + 0. Suppose 12 = 6m - 3m. Put k, v, m in decreasing order. m, k, v Let k = 61/3 + -259/12. Put -0.4, -5, k in decreasing order. -0.4, k, -5 Let g be ((-92)/(-15) - 2/15) + -3. Let x(y) = 6y + 6. Let s(r) = 7r + 5. Let n(a) = -5s(a) + 6x(a). Let b be n(-6). Sort b, g, -1 in descending order. b, g, -1 Suppose -2u + 23 = 3d, 3u + 2d - 4 = 18. Suppose -uf - 7 = -3. Put 5, -5, f in increasing order. -5, f, 5 Let b = 1 - 0.5. Let v = 3.49 - 4.49. Put 1/12, b, v in increasing order. v, 1/12, b Let w(c) = c2 - 12c + 12. Suppose 3v = -8 + 41. Let m be w(v). Put -4, 5, m in decreasing order. 5, m, -4 Let x = 13 - 17. Let q = 10 - 14. Let u(n) = n2 + 2n - 5. Let f be u(q). Sort 0, x, f in descending order. f, 0, x Let b = 5 - 8. Let y be 6/8 + 2 + b. Sort y, -3/5, -3 in descending order. y, -3/5, -3 Let y = -5.7 - -6. Let n(o) = o*2 + 1. Let i be n(0). Let u = -0.3 + 0. Sort i, y, u in increasing order. u, y, i Suppose -2k = k - 12. Suppose 5x - 15 = ks, -3x + 5s - 11 + 33 = 0. Sort 2, 4, x in increasing order. x, 2, 4 Suppose -4c - 10 = -0f - 2f, 3c = 0. Let x = 3 + 1. Sort f, -5, x in descending order. f, x, -5 Let n be (-12)/(-2)(-10)/15. Let q be (-4)/(-3(-4)/6). Put q, n, 1 in decreasing order. 1, q, n Let d(o) = o - 2. Let i be d(1). Sort i, 5, 36 in ascending order. i, 5, 36 Let j = 18 - 2. Put -3, j, -4 in descending order. j, -3, -4 Suppose -2n - d = 8, -5n - 2 = -3n + 4d. Suppose 0 = -3p + 4m - 28, -4p + 6m - 28 = 3m. Let a = -7 - p. Sort -2, n, a in ascending order. n, a, -2 Let n = -8 - -12. Let i = n + 3. Put i, 1, -2 in decreasing order. i, 1, -2 Let q(l) = -l3 - 4l*2 - 10l - 3. Let s(a) = 2a3 + 8a*2 + 19a + 6. Let h(p) = -11q(p) - 6s(p). Let r be h(-2). Sort 0, r, -2 in decreasing order. 0, -2, r Let z = 0.17 + -0.87. Let p = -3.7 - z. Let j = 2.6 + p. Sort -2, 2, j in descending order. 2, j, -2 Let g(d) be the first derivative of -d4/4 - d3 + 2d2 - 2d - 1. Let i be g(-4). Sort i, -5, 5. -5, i, 5 Let j be (1 + -13)/4(-2)/24. Let m = 2.3 + -2. Put j, 2/7, m in decreasing order. m, 2/7, j Let v = 6.3 - 6. Let x = 0 - -5. Put x, 0.4, v in descending order. x, 0.4, v Suppose 9j - 304 = -7j. Put -5, 0, j, 3 in descending order. j, 3, 0, -5 Let u be 2/(-8) - 39/(-104). Sort u, 2, 1 in descending order. 2, 1, u Let j(w) = -w2 - 8w + 1. Let r be j(-8). Put -1/2, r, -1.3 in ascending order. -1.3, -1/2, r Let m = -0.07 + 0.37. Sort m, -4, -1/4. -4, -1/4, m Let o be 2/(-3) - 112/(-150). Let g be 13 + 388/(-150). Let d = g - o. Put -0.1, d, 4 in decreasing order. 4, d, -0.1 Let p be (-24)/(-20)(-60)/18. Put p, 3, 16 in descending order. 16, 3, p Suppose 11 = o + 8. Put -2, o, 2 in decreasing order. o, 2, -2 Let q be (-2)/82/3. Let a = 4.04 + -0.04. Let o = a - 3. Put -1/4, o, q in ascending order. -1/4, q, o Suppose 0 = -5g + g, -f - 4g = 2. Put -1, 0, 3, f in increasing order. f, -1, 0, 3 Suppose 12 = -4u - 2a, -u - 14 = 3a - 1. Sort 4, 1, u. u, 1, 4 Let m = 13 - 9. Suppose mc + 25 = 5. Sort c, -4, 0 in decreasing order. 0, -4, c Let t be (-240)/(-45) - (-1)/(-3). Put -4/5, 1, t in ascending order. -4/5, 1, t Let z = 2 - 2. Let d be 1/21-2. Suppose 10q + 166 = 126. Sort z, q, d in descending order. z, d, q Let m be 1/(6/8)(-81)/(-54). Put -4, 5, -6, m in descending order. 5, m, -4, -6 Let s = 14 + -36. Put 3, 0, -3, s in increasing order. s, -3, 0, 3 Let t = -0.05 + -0.55. Let b = -1 + 1.02. Let l = b + 0.18. Sort l, t, -0.1 in decreasing order. l, -0.1, t Suppose -a + 2 = -2a. Let y be 2(9/a)/(-3). Put -1, -3, y in descending order. y, -1, -3 Let r = 45/238 - -475151/714. Let b = r - 720. Let j = 55 + b. Put 1, -5, j in ascending order. -5, j, 1 Suppose 19x = 11*x. Put 0.5, -0.5, x, 6/	{ "pile_set_name": "DM Mathematics" }
+ 0 - 2) as ia + y and give i. 62 Express 0q*2 + 3q*2 + 1452 - 1468 as bq + sq2 + x and give x. -16 Express (-184d - 194d + 2d - d)(2d*2 + 0d2 - d2) in the form b + pd + jd*2 + td*3 and give t. -377 Express 4s*2 - 4s2 + s2 + 1 - 1 - 2s2 + s2 + s2 + 0s*2 + 1 - 1 - 4s*2 + (-2 + 2 + 2s*2)(2 - 2 - 1) in the form ks + rs*2 + u and give r. -5 Rearrange -8z*2 + 7z*2 - 8z*2 to f + sz*2 + kz and give s. -9 Express (-5k + 0k + 3k)(10 - 7 - 6) + 4k + 0k - k in the form gk + i and give g. 9 Express 16m + 20m - m + 161m as z + gm and give z. 0 Rearrange 4v - 45v4 + 43v*4 + 4v - v*3 + 16v - 2v2 to xv*3 + iv*2 + yv*4 + f + lv and give i. -2 Rearrange -1 + 1 + 4q4 - 30q*2 + 28q*2 - 2q*3 - q to the form wq + nq4 + d + aq*3 + jq*2 and give n. 4 Express -3h*2 - 2h*4 - 2h - 2 - 2h2 + 3h*2 as ih + yh2 + q + kh*3 + ph*4 and give i. -2 Express -14p3 - p2 + 3 - 3 + 24p3 in the form w + bp*3 + xp*2 + ap and give x. -1 Express 41s - 3 - 18s*2 - 77s - s*3 + 5 + 38s in the form fs3 + rs + us2 + w and give w. 2 Express -4h - 6h3 + 2h*4 - 9h*3 + 17h*3 + 3 in the form u + qh + oh2 + rh*4 + sh*3 and give r. 2 Express -2p*4 - 2p*2 - 2p + 7p3 + 3 - 6p*3 - 1 - 2p*3 as ip*3 + hp + q + gp4 + jp*2 and give g. -2 Express 23y - 23y - 10y*2 as gy*2 + ky + f and give g. -10 Express -6r - 3 + 10 + 5 + 8r in the form c + ar and give c. 12 Express -z2 + 3z*2 + 24z*3 - 4z*4 + 0z*2 - 2z + 5z4 as i + lz*2 + mz*4 + kz + nz3 and give m. 1 Express -2k - 2k4 - 2k2 + k3 + 3k4 + 0k*2 in the form xk*4 + jk*3 + rk*2 + l + nk and give j. 1 Rearrange 61l - 116l + 86l to the form ml + y and give y. 0 Express -677t + 28t*2 + 677t in the form ct + lt*2 + n and give l. 28 Rearrange -5k*2 - 10k*2 - 7k*2 - 8k*2 to the form ak + g + zk2 and give z. -30 Express (3u - 2u + u)(-1213 + 1213 + 10u3) in the form pu*3 + hu*2 + ou + nu4 + c and give n. 20 Express (2d - 5d + d + (-2 + 4 + 0)(d + d - 3d))(0 - 2 + 4)(1 - 2 + 3) as jd + n and give j. -16 Express 109z - 117z - 103z in the form nz + t and give n. -111 Rearrange (1 - 9 + 2)(b + 14b - 7b) to the form pb + l and give p. -48 Express -14x2 + x2 + x + 59x*2 as n + dx + ox2 and give d. 1 Express 17 + 17 + 9o*3 - 37 in the form w + go*2 + mo + fo3 and give w. -3 Rearrange 5680 - 2j - 5680 to the form zj + h and give z. -2 Rearrange 0y + 0y + y3 + (-5y + 3y + 3y)(-y + y + 2y*2) - 539y + 127y3 + 539y to qy3 + ry + dy2 + z and give r. 0 Express 0n + n*2 + 2n - 2n - 14 as cn*2 + gn + h and give c. 1 Rearrange -8c2 + 17c*2 - 5c2 - c4 + 4 - 6c2 to the form rc*2 + u + fc*4 + lc*3 + pc and give r. -2 Rearrange -4u + 2u + 3u + (4 - 5 - 3)(-3u - 25 + 25) + (-1 + 6 - 3)(-3u + 6u - 2u) + 1 - 1 + 2u to v + hu and give h. 17 Rearrange 2m*2 - 2m*2 - 5m*2 to the form z + pm*2 + ym and give p. -5 Express (0 - 2 + 1)(n - n - n) - 4n + 2n - 5n - 2 in the form qn + s and give q. -6 Express 0 - 2v*4 - 2 - 2v2 - v3 + 5v4 as zv*4 + lv*2 + f + hv + dv3 and give f. -2 Rearrange (h4 - h4 + 2h*4)(-4 + 4 - 1 + (1 + 2 - 5)(-6 + 4 - 1)) to the form jh*3 + s + uh*4 + mh + nh2 and give u. 10 Express (2h*3 - 5h*3 + 2h*3)(4 - 3 - 3)(-h - 4 + 4) in the form kh*3 + rh*2 + t + oh*4 + sh and give o. -2 Rearrange -4o + 4o + 2o + (-3 + 3 + 3)(4 - 4 + o) + (3 + o - 3)(-14 - 17 + 16) to the form c + to and give t. -10 Express 6 + 5468r + 6 + r2 + 4 - 5469r as mr + l + gr*2 and give l. 16 Rearrange (-1 + 0 + 0 + 0 + 0 - 1 + (0 - 2 + 0)(-2 + 2 - 2) + 2 + 4 + 3)(-2q + 2 - 2)(2 - 2 - 1) to the form l + mq and give m. 22 Rearrange (2t + 0t - 8t + (-t + 3t - 4t)(2 + 1 - 1) - 3 + t + 3)(t2 + t2 - 4t*2) to the form pt + gt2 + bt*3 + o and give b. 18 Rearrange 2l + 2l3 + 2 - 3l*3 - l + 0l*3 to the form v + zl + fl3 + jl*2 and give f. -1 Express (-2h + 3 + h - 1)(8h*3 - 2 + 2) - 4h*4 + 5h*4 + 0h*4 in the form v + oh*2 + gh*3 + nh + mh4 and give g. 16 Express -2z*2 - 2z*2 + 0z2 + z3 + 1 + 0z3 in the form u + az + xz3 + hz*2 and give h. -4 Rearrange -13i*4 - 1 + 33i*4 - 11i*4 - 7i*4 - i to the form ui + qi3 + xi*2 + li*4 + f and give u. -1 Rearrange -5c + 39c + 28c to the form fc + z and give f. 62 Rearrange 3h - 5h2 + 0h - 3h to the form rh + l + mh2 and give m. -5 Rearrange -18y*2 + 39y*2 - 36y*2 - 1 to the form wy*2 + c + ay and give w. -15 Express -2z - 3z + 3z + ((4 - 1 - 5)(-3 - 2 + 3) + 0 + 1 - 7)(3z + 4 - 4) as f + az and give a. -8 Express -4j + 11 + 1 - 3 in the form oj + f and give f. 9 Rearrange 4b4 + b4 - 7b4 + b4 + 6b*3 + 1 to sb*2 + o + mb + kb4 + jb*3 and give o. 1 Rearrange 2z4 + z4 + 2z - 4z3 - 1 - z4 to the form y + tz4 + mz*2 + fz + bz3 and give f. 2 Express (-3501o + o*2 + 3568o + o*2)(-o + o - o*2) in the form d + fo + ro4 + qo*2 + xo*3 and give r. -2 Rearrange -1 + 0 - 7c*2 - 10c*2 to the form xc*2 + wc + z and give x. -17 Rearrange 9n2 - 2n*3 + 14 - 9n*2 to the form h + sn + tn2 + on*3 and give o. -2 Rearrange -17 - 18g - 48g + 17 to yg + w and give y. -66 Express -3 + q*3 - 6q*3 + 4q3 - q3 + 3q in the form fq*3 + u + jq*2 + aq and give a. 3 Express -4 - z*3 - 5z*2 + 4 + 34z*2 as mz + jz2 + iz*3 + p and give i. -1 Rearrange 86 - 86 + 24y to the form h + wy and give h. 0 Rearrange 6 - 13j*2 - 6 to the form m + vj*2 + cj and give c. 0 Rearrange (-1748 + 1748 - 76o)(-o + o*2 + o) to the form to*3 + v + jo*2 + no and give v. 0 Express -6t2 - 6t*2 + 4t*2 as xt + b + gt2 and give g. -8 Rearrange (9p + 3p - 7p)(p2 - 3p2 - p2)(p - p + p) to m + xp*3 + cp + rp4 + np*2 and give c. 0 Rearrange -1 + 1 + 0p*4 + 2 + 2p3 + p - p4 to the form dp3 + bp*4 + i + hp + vp2 and give v. 0 Express -5q2 + q4 + 2q2 + 3q3 + q2 + 0q3 in the form rq*4 + bq*3 + kq*2 + hq + a and give r. 1 Express 4g3 + g2 - 35 + 17 + 0g*2 + 19 as zg*3 + d + ug + lg2 and give z. 4 Express 17 + 20 - 34 - 3m + m*2 in the form tm*2 + zm + w and give z. -3 Rearrange (0 + 2 + 0)(-w + 0w + 0w) + 0w + 6w + 5w + 1 - 2w - 1 to the form dw + y and give d. 7 Rearrange 2 - 60x3 + 64x*3 - 6x + 2x4 - 2 to mx*2 + qx*4 + s + ux + fx3 and give f. 4 Rearrange (1 + 2 + 1)(4f3 - 6f*3 + 3f*3) + (2f*2 - 4f*2 + 5f*2)(-4f + 2f + f)(1 - 2 + 4) to the form yf*2 + qf + x + zf3 and give z. -5 Rearrange 23 + 4 + 6t - 8t to the form ot + r and give r. 27 Express (-73 + 46 - 49s + 28)(2s3 - s3 - 3s*3 + (-2s + 2s + s2)(-2s + 3s - 2s)) in the form ys + ts2 + ls*4 + k + is*3 and give l. 147 Rearrange 0r2 - r2 - 4r2 + (7r*2 - 2r*2 - 2r*2)(0 + 4 - 6) + r*2 + 2r2 - r2 to the form z + cr + br*2 and give b. -9 Express (1063 + 4q - 1065 + 8q)((-3q + 3q - 3q)(-5q + 4q - q) + q + 2q2 - q) in the form nq + c + hq2 + aq*3 and give a. 96 Rearrange (3q - 3q + 4q*2)((-4q2 + 5q2 + q2)(-2 + 4 - 1) - 5q*2 + 8 - 8) to the form nq + zq4 + rq*3 + xq*2 + a and give a. 0 Rearrange 2i - 4i + 0i - 14i + 20i - 12i + (i + 1 - 1)(-6 + 3 + 1) + 0i - 2i + 3i + 3i - 4i - i - 5i - 3i + 5i to the form yi + d and give y. -14 Express 4u*2 - 4u*3 - 3u*2 + 1 + 2u*3 - 3 in the form du*2 + v + tu + bu3 and give d. 1 Rearrange (2 + 4 - 3 - 5 + 2 + 2 + (0 + 2 + 0)(-2 + 5 - 1) + (0 + 1 + 0)(3 - 5 + 1))(3a2 - 7a*2 - 3a*2) to c + ha*2 + ta and give h. -35 Express (7 + 20 - 6)(-6t + 2t + 3t) as k + ot and give k. 0 Express 49n*2 - 103 + 55 + 48 as h + yn + xn2 and give y. 0 Rearrange -16u*2 - 13u*2 - 14u + 31u2 to pu + i + bu2 and give b. 2 Rearrange -103w + 1 + 52w + 49w to hw + s and give h. -2 Rearrange (-5c + 4c - c)(-1 + 1 - c)*(-2	{ "pile_set_name": "DM Mathematics" }
38, -73562, -88584? -103604 What comes next: -30182970, -30182971, -30182972? -30182973 What comes next: -35054, -70217, -105536, -141011, -176642, -212429, -248372? -284471 What comes next: -57506265, -115012533, -172518801, -230025069, -287531337, -345037605? -402543873 What is the next term in 22773, 91234, 205335, 365076, 570457? 821478 What comes next: 46987, 93720, 140453, 187186, 233919? 280652 What is next in 484685, 969355, 1454021, 1938683? 2423341 What is the next term in 1204, 2431, 3610, 4741, 5824? 6859 What is the next term in -11083, -21795, -32505, -43213, -53919? -64623 What comes next: -3282338, -3282217, -3282082, -3281927, -3281746, -3281533, -3281282? -3280987 What is next in 313208, 626412, 939616? 1252820 What is next in -53434, -53382, -53332, -53284? -53238 What comes next: -50109, -52159, -54209, -56259? -58309 What is next in -25568368, -51136740, -76705122, -102273514, -127841916, -153410328? -178978750 What comes next: 1071128, 1071227, 1071326, 1071425, 1071524? 1071623 What is next in -26732, -25459, -24186, -22913? -21640 What comes next: -6657650, -53261077, -179756098, -426088511, -832204114, -1438048705? -2283568082 What comes next: 2131093, 2131361, 2131807, 2132431, 2133233, 2134213? 2135371 What comes next: -16321465, -16321446, -16321427, -16321408, -16321389? -16321370 What is the next term in 312647, 625399, 938151? 1250903 What is the next term in -17712, -19441, -21170, -22899, -24628? -26357 What is the next term in -62966, -125540, -188100, -250640, -313154, -375636? -438080 What is next in -1638854, -1639347, -1639840, -1640333, -1640826, -1641319? -1641812 What comes next: 541737311, 541737310, 541737309, 541737308, 541737307, 541737306? 541737305 What is the next term in 48222, 199657, 452048, 805395, 1259698? 1814957 What comes next: -311461, -311449, -311427, -311395, -311353, -311301? -311239 What is next in -317067, -634074, -951081, -1268088, -1585095? -1902102 What comes next: -1456, -2343, -3838, -5947, -8676, -12031? -16018 What is next in 13114810, 26229628, 39344446, 52459264, 65574082, 78688900? 91803718 What is the next term in 722448, 2890101, 6502856, 11560713, 18063672, 26011733? 35404896 What is next in -1027334, -4109333, -9245996, -16437323, -25683314, -36983969, -50339288? -65749271 What comes next: -52, -186, -568, -1324, -2580? -4462 What comes next: 6759250, 6759248, 6759246, 6759244, 6759242, 6759240? 6759238 What is the next term in 686, 3526, 10404, 23078, 43306, 72846? 113456 What is the next term in -3787280, -7574553, -11361822, -15149087? -18936348 What comes next: 4815, 4228, 3641, 3054? 2467 What comes next: -93135, -93079, -93023, -92967, -92911, -92855? -92799 What comes next: -157, 74, 1067, 3182, 6779, 12218? 19859 What is the next term in -12257759, -12257761, -12257763, -12257765, -12257767, -12257769? -12257771 What comes next: -130089, -130035, -129989, -129957, -129945, -129959, -130005? -130089 What is next in 421417, 1685623, 3792627, 6742423, 10535005? 15170367 What is the next term in 40605, 159779, 358403, 636477, 994001, 1430975? 1947399 What is next in 64287, 128605, 193003, 257523, 322207, 387097, 452235, 517663? 583423 What is the next term in 33479, 37301, 41121, 44939, 48755, 52569? 56381 What is the next term in -2794, -10341, -22646, -39709, -61530, -88109? -119446 What is the next term in 6151, 22061, 48589, 85729, 133475, 191821, 260761, 340289? 430399 What is the next term in 565147, 1130348, 1695611, 2260942, 2826347? 3391832 What is the next term in 120276, 240579, 360906, 481257, 601632, 722031, 842454? 962901 What is the next term in 12128, 25039, 39608, 56663, 77032, 101543, 131024? 166303 What is next in 17599, 70221, 157925, 280711? 438579 What comes next: -109404355, -109404357, -109404359, -109404361, -109404363? -109404365 What is next in 3102, 3998, 4940, 5952, 7058, 8282, 9648, 11180? 12902 What is next in -478440, -478442, -478456, -478488, -478544? -478630 What comes next: 164, 1201, 3924, 9143, 17668? 30309 What is next in 1299, 1749, 2199, 2649, 3099? 3549 What comes next: -5620399, -11240804, -16861209? -22481614 What comes next: -211, -654, -1387, -2464, -3939, -5866, -8299, -11292? -14899 What is next in 280, 43, -758, -2405, -5180? -9365 What comes next: -4723, -4818, -4945, -5110, -5319? -5578 What is the next term in -772407, -1545156, -2317897, -3090624, -3863331? -4636012 What is the next term in -16248, -34232, -52216, -70200? -88184 What is next in 255773491, 255773489, 255773487, 255773485, 255773483? 255773481 What is the next term in 439581, 439571, 439555, 439533? 439505 What comes next: -341, -648, -939, -1244, -1593, -2016, -2543? -3204 What is next in 23477, 47092, 70705, 94316, 117925, 141532, 165137? 188740 What is the next term in 78207891, 78207871, 78207851, 78207831, 78207811, 78207791? 78207771 What comes next: -8233, -6489, -3583, 485, 5715, 12107, 19661? 28377 What is next in 688, 2789, 6298, 11215, 17540, 25273, 34414? 44963 What is the next term in -59313, -59550, -59789, -60030, -60273, -60518? -60765 What is the next term in 14566, 14028, 13490, 12952, 12414, 11876? 11338 What is next in 38021, 75944, 113867? 151790 What comes next: -2145, -3588, -5031? -6474 What is next in 947, 7589, 25619, 60737, 118643, 205037, 325619, 486089? 692147 What comes next: 27999, 228245, 771765, 1830195, 3575171, 6178329, 9811305? 14645735 What is the next term in -607417, -1214817, -1822241, -2429701, -3037209, -3644777, -4252417? -4860141 What is the next term in -1041, -4390, -9965, -17760, -27769, -39986, -54405, -71020? -89825 What is next in 828410, 828558, 828694, 828812, 828906, 828970, 828998? 828984 What comes next: 451343584, 451343585, 451343586, 451343587? 451343588 What is next in 77393932, 154787868, 232181804, 309575740, 386969676? 464363612 What comes next: 354797420, 354797422, 354797424? 354797426 What is next in 7313, 7313, 7265, 7145, 6929, 6593? 6113 What is next in -19903, -79698, -179369, -318922, -498363? -717698 What is next in -6775, -8627, -10481, -12337, -14195, -16055? -17917 What comes next: 3985352, 3985358, 3985378, 3985418, 3985484, 3985582, 3985718? 3985898 What is the next term in -3801, 15692, 48181, 93666, 152147, 223624? 308097 What is the next term in -5746556, -11493114, -17239672, -22986230, -28732788, -34479346? -40225904 What comes next: 19776251, 19776250, 19776249, 19776248, 19776247, 19776246? 19776245 What comes next: -886, -6778, -22686, -53590, -104470? -180306 What comes next: 4377, 1733, -5417, -19317, -42211? -76343 What is next in -67, 445, 1835, 4541, 9001, 15653? 24935 What is the next term in 24901, 24468, 23747, 22738, 21441, 19856? 17983 What is the next term in 72702, 72701, 72694, 72681, 72662, 72637? 72606 What is the next term in -5515, -10965, -16347, -21625, -26763, -31725, -36475? -40977 What is the next term in -4525, -9162, -13799, -18436, -23073, -27710? -32347 What comes next: 74386, 297565, 669540, 1190311, 1859878, 2678241? 3645400 What is next in 207872, 415555, 623246, 830945? 1038652 What is next in -2655, -2833, -3325, -4287, -5875, -8245, -11553, -15955? -21607 What comes next: -4240, -1604, 2788, 8936? 16840 What comes next: -1557, -1625, -1691, -1755, -1817, -1877? -1935 What is the next term in -9038, -15106, -21196, -27320, -33490, -39718, -46016, -52396? -58870 What comes next: 2435056, 9740247, 21915594, 38961121, 60876852, 87662811? 119319022 What is next in 190, 377, 650, 1075, 1718? 2645 What comes next: -2312380, -4624794, -6937208, -9249622, -11562036? -13874450 What is the next term in 289939, 579887, 869835, 1159783, 1449731, 1739679? 2029627 What is the next term in 1794, 2094, 2398, 2706, 3018, 3334? 3654 What is next in -2840, -6810, -10780, -14750? -18720 What is next in 41329908, 41329913, 41329918? 41329923 What comes next: 599, 6233, 15623, 28769? 45671 What comes next: 2271647, 2271618, 2271589, 2271560, 2271531, 2271502? 2271473 What comes next: -190, -155, -58, 131, 442, 905, 1550, 2407? 3506 What is next in 6023, 11811, 17109, 21671, 25251? 27603 What is next in -2621566, -5243122, -7864678, -10486234, -13107790? -15729346 What is the next term in -1292969, -2585947, -3878925, -5171903, -6464881? -7757859 What	{ "pile_set_name": "DM Mathematics" }
second derivative of -w*3/6 - 7w*2 - 4w. Let p be g(-11). What is the smallest common multiple of (-4 + p)(-4)/14 and 16? 16 Let v = -589 + 1741/3. Find the common denominator of v and 7/(-1) + (-786)/(-99) + 0. 33 Let n = -12318 + 172551/14. Let p(j) = j3 + 8j*2 + 12j - 14. Let z be p(-6). Calculate the common denominator of n and (-2)/(-4)214/z. 14 Suppose -256 = -3x - 2o, -x + o = 33 - 120. Suppose -2z = -3a + 5a - x, 0 = -2a + 4z + 62. Calculate the common denominator of (6 - 3) + a/2 and 31/9. 18 Let w = -660/527 - -43/62. Find the common denominator of w and -75((-2)/1)/(-32). 272 Find the common denominator of -65/3 and -4 + 2 + 12/17. 51 Let y = 371 + -353. Calculate the smallest common multiple of 27 and y. 54 Suppose 4l = -n + 31, 2l + 2 = 2n + 30. What is the lowest common multiple of l and 189? 189 Let o = -5121 + 138221/27. Find the common denominator of 89/30 and o. 270 Let r = -82025 + 7382093/90. Find the common denominator of r and 73/18. 90 Find the common denominator of ((-550)/90 - -6)9/(-10) and (2/(-24))/((-21)/686). 90 Let p = 16 - -27. Suppose 3k + 6q - q - p = 0, -3k + 4q + 52 = 0. Calculate the lowest common multiple of k and 18. 144 What is the smallest common multiple of (44/(-6))/((-40)/60) and 4? 44 Let c be (-983082472)/160 - 6/(-4). Let r = c + 6159538. Let i = r + -15271. What is the common denominator of -23/20 and i? 20 Suppose -54q = -47q - 518. Calculate the smallest common multiple of 5 and q. 370 Let b = 62 + -66. Let d = 5 - 5. What is the common denominator of ((-325)/(-15))/(-1) - b and d? 3 Let u be 0 + 6/(-8) - 3534/(-8). Find the common denominator of (6/45)/(4 - 1752/u) and 99/260. 260 Let j(p) be the first derivative of -p2 - 15p + 1. Let z be j(-12). Suppose 3r = 63 - z. Calculate the smallest common multiple of r and 2. 18 Let r = -1512 + 24181/16. Calculate the common denominator of 33/20 and r. 80 Suppose -l + 0x - 8 = 4x, -4l + 2x = 68. What is the least common multiple of 10 and (-189)/(-2) + 8/l? 470 Suppose 318 = 2v - 3f, -5v = 2f - 1009 + 176. Calculate the smallest common multiple of v and 5. 165 Let o = -5 + 25. Suppose -l - l + 4 = 0. What is the lowest common multiple of o and (0 - l-2)/2? 20 Let f = -66 + 104. What is the least common multiple of f and 13 - (3 - 0/(-1))? 190 Let y = 23 - 15. Let r = 88 - 165. Let v = 85 + r. Calculate the smallest common multiple of v and y. 8 Suppose -6u = 46 + 26. Calculate the common denominator of ((-74)/33)/(8/u) and 36/7. 77 Suppose n = -n - 5d, -4d = 0. Suppose -h + 30 = 2v + 5, n = -h + 1. What is the lowest common multiple of v and 10? 60 Find the common denominator of (-21)/(-18)256/48 and -5/122. 1098 Let z = -2685/4 + 10671/16. Find the common denominator of z and -77/64. 64 Let a be 2/5 + 376/(-40). Calculate the common denominator of ((-4)/14)/((-2)/(-59)) and (-52)/(-6) - a/(-9). 21 Let f = 779 + -771. What is the lowest common multiple of 252 and f? 504 Suppose -w + 3w - 20 = 0. Let q(c) = -72c - 5. Let l be q(4). Find the common denominator of 29/10 and 2/w - l/110. 110 Let v = 20 - 22. Calculate the common denominator of ((-2)/7)/(v + (-4024)/(-1988)) and 13/22. 66 Suppose -48 + 54 = -3a, 0 = q - 5a - 90. Calculate the least common multiple of 110 and q. 880 Let d = 12/30835 + 180157/91703290. Let l = d + -101891/13383. Calculate the common denominator of l and 1/8. 72 Let q = 6/2491 + 271351/69748. Find the common denominator of q and 75/272. 1904 Let p = 2330/28103 - 8/179. Let i = -340477827337/3140 - -108432427. Let m = p + i. Find the common denominator of m and -51/2. 20 Let z = 23 + -12. Calculate the smallest common multiple of 7 + -3 + 5/5 and z. 55 Let a = 23987/18 + -4013/3. Suppose -p - 280 = 3p. Find the common denominator of a and 213/p + (-9)/15. 126 What is the common denominator of 1/12 and (-76)/40(-3 + (-5)/(-2))? 60 Let a = -29137/33 - -883. Let c = 15373/1638 + -121/91. Find the common denominator of c and a. 198 Let m = -293 + 2897/10. Calculate the common denominator of m and (213/(-10))/3 + -2. 10 Let i be (1/6)/(6/36). Find the common denominator of 29/44 and 47/(-8) + i + -2. 88 Find the common denominator of 43/40 and 1272/8064 - 6/14. 240 Let n = 16/31 + -1259/217. Let w = -100219/2 + 51986. Let f = w - 1828. Find the common denominator of f and n. 14 Let v(i) = 2i*3 - 53i*2 - 27i + 10. What is the least common multiple of 6 and v(27)? 30 Let a(d) = d3 - d2 + 3. Calculate the smallest common multiple of a(2) and 49. 49 Suppose -3g + 32 = 5y, 0y = 2g - 3y - 34. Suppose -8r + 1037 - 157 = 0. Let f = r - 88. Calculate the smallest common multiple of f and g. 154 Suppose n + y = 92, 3n = 2n + y + 96. Find the common denominator of -67/8 and ((-12)/240)/(2/n). 40 Let i = -823/85 + 49/5. Let g = i - -183/34. What is the common denominator of g and (85/390)/((-1)/(-3))? 26 Let n(m) = 8m + 37. Let y be n(-4). Find the common denominator of (-1 + (-104)/y)/4 and 143/18. 180 Let b = -1603 - -28939/18. Let p = 3145 - 50417/16. What is the common denominator of b and p? 144 Let c(v) = -v2 - v + 1. Let u be c(-10). Let m be u + -2 + 1-3. Find the common denominator of 52/7 and 4/(-12)m/(-6). 63 Let u = -941/20 - -289/5. Calculate the common denominator of 15/2 and u. 4 Let r(t) = -t2 + 23t - 69. What is the lowest common multiple of r(18) and 135? 945 Suppose 31 - 274 = 3g. Let u = g + 161. What is the least common multiple of 12 and u? 240 Let t be (-6 - -10)43/4. Let l = -37 + t. What is the smallest common multiple of 27 and l? 54 Let u = 11 + -9. Let b(f) = -f*2 - 16f + 0fu + 12 + 3f + 8f. What is the least common multiple of 1 and b(-6)? 6 Suppose 4v - 5r = 31 + 11, 0 = 4v - 3r - 38. What is the lowest common multiple of v and 1 + 0 - (-30 + 1)? 120 Let g = 12280 + -11874758/967. Let t be 11 + -5 + 187646/(-23208). Let w = t + g. What is the common denominator of -63/20 and w? 60 Suppose l = 3a + 986, a + 3a = 5l - 1333. Let x = -37757 - -152309/4. Let w = a + x. Find the common denominator of -35 and w. 4 Let x = 11913 - 524237/44. Find the common denominator of 4/18 - 485/(-288) and x. 352 Suppose -3q - 5s + 3 = -3, -5s = q + 8. Suppose 4x - 2l = 2x + 24, 0 = -3x - 3l + 42. Let r = x - q. What is the least common multiple of r and 1? 6 Suppose 0 = 2k - 1 - 7. Let f(s) = 2s*2 - 7s + 8. What is the smallest common multiple of k and f(3)? 20 Let z = -697/6 - -2485/24. Let h = -15303 - -1744397/114. Find the common denominator of h and z. 456 Suppose 0 = 5x - 6x + 330. Suppose -5w - 6w + x = 0. Calculate the lowest common multiple of 15 and w. 30 Suppose 0 = b + 3w - 3, 3b + 3w = -w + 9. Let u be 4/b + (-2)/(-3). Suppose -ui = -i - 10. What is the least common multiple of i and 3? 30 Let a be (-31)/36-21917. Let g = a + -3200. Calculate the common denominator of g and ((-966)/(-120) + -8)/(1/6). 60 Let c(r) = -r*2 - 6r - 3. Let b be (-4 + 3)3 - -5. Suppose -b = j + 3. What is the smallest common multiple of c(j) and 12? 12 Suppose -22d + 19d - 4m + 526 = 0, 2m - 886 = -5d. What is the smallest common multiple of 10 and d? 890 What is the common denominator of -43/33 and -766/77 - (-3938)/600? 3300 Let q(i) = -2i*2 - 22i - 9. Suppose 6y - 3y + 9 = 0. Let t = -13 - y. What is the smallest common multiple of 1 and q(t)? 11 Let i = -22 - -28. Suppose 220 = -ia + 2a. Find the common denominator of 10/a + 2234/308 and 63/8. 56 Let x be (0 - 3)/((-3)/2). Let g be x2/(-4) - -2. Suppose -g - 34 = -5n. Calculate the lowest common multiple of n and 4. 28 Let p = -1947 - -19491/10. Let o = p + -149/90. Let y = -5689/685 - 13/137. Find the common denominator of y and o. 45 Let n = 189 - 101. Calculate the smallest common multiple of n and 16. 176 Suppose 0 = 2u - 2f - 2f - 12, 6 = 2f. What is the smallest common multiple of (376/141)/(1(-1)/(-3)) and u? 24 Let q(n) = n2 + n - 72. Calculate the least common multiple of 70 and q(-12). 420 Suppose -3i - 4t + 85 = -61, -3i - 3t + 150 = 0. What is the smallest common multiple of 8 and i? 216 Suppose -m - 5o = -7, -o = -5m - 0o + 9. Suppose m = 5k + 47. Calculate the common denominator of (k/3 - -98)/18 and 43/2. 18 Let d(q) = q*3	{ "pile_set_name": "DM Mathematics" }
69n - 4161672n in the form cn4 + dn*3 + jn*2 + b + wn and give c. -32 Rearrange (3 + 0 - 5)(193 + 235 - 17)(3w - 2w - 2w) to the form bw + p and give b. 822 Rearrange (-4 - 3 + 4)((3 - 1 - 3)(2 - 7 + 9)(8y + 23y - 5y) + (-y + 3y - y)(0 + 2 + 0) - 4y + 3y + 4y) to the form my + p and give m. 297 Rearrange (-2 + 1 + 13n3 - n3)(91 - 137 - 399) to fn + qn*2 + r + vn*3 and give r. 445 Express 1 + 2c*2 - 9c*2 - 56c*2 + 14c*2 + 2 as t + mc*2 + qc and give m. -49 Rearrange (3 + 1 - 10)(-y3 - y3 + 8y*3)(-1 + 5 + 0) to qy3 + xy*2 + ly + f and give q. -144 Express 229p3 + 264p*3 - 381p*3 - 22p*2 + 22p*2 - 3p*3 + (-p + 0p + 0p)(-1 + 1 + p*2) as r + ip + gp2 + mp*3 and give m. 108 Rearrange -16m*2 - 2m*3 - 15m*3 - 15m - 74m2 + 81m*2 to bm*3 + gm + am2 + c and give a. -9 Rearrange -37a*4 + 5a*2 - 48a*4 + 3a - 6a2 + 10a*4 + 1 to ka + s + la2 + ga*3 + qa*4 and give q. -75 Rearrange 36f - 2 + 1 - 33f - 128f*2 - 5f*2 to the form jf*2 + u + cf and give u. -1 Rearrange -l4 + l3 - 576l2 + 274l*2 - 288l*2 to the form ol + al3 + tl*4 + rl*2 + d and give t. -1 Rearrange 0 - 115h - 171h3 + 95h*3 - 16h*3 + 0 to th + o + ih2 + wh*3 and give w. -92 Express -8441n*4 + 4236n*4 - 6 + 9n + 4209n4 + 13n*3 as on*3 + i + sn*4 + fn*2 + xn and give f. 0 Express (52h - 98h - 128h + (-4h + h + 5h)(2 + 0 - 4) - 3 + 3 - h + 2h + h - 5h)(36 - 35 - 49) in the form o + sh and give s. 8688 Rearrange -3s4 + s3 - 3s - 352 + 691 + 8s2 - 342 + 0s to the form ms2 + fs*3 + ts*4 + v + ps and give v. -3 Rearrange -2 - 326m2 + 661m*2 - 336m*2 + 275m + 0 to the form t + om + cm*2 and give o. 275 Rearrange (-2989 - 4378 + 1718)(1 - m - 1) to v + bm and give b. 5649 Express (-r - 2r + 5r + (6r - 2r - 2r)(-3 + 2 + 3) + (1 - 2 + 2)(-4r + 5r - 3r) + 7 - 7 + 4r)(64 - 78 + 43) as tr + u and give t. 232 Rearrange 3238 - 1607 - 1611 - w - w + 24w2 + 18w*2 to the form c + ow*2 + xw and give o. 42 Express 37644 - 37644 - 2u + 2992u*2 as cu + a + tu2 and give c. -2 Rearrange (83325u - 491 - 161 - 83318u)(-2u + 0u + 3u - 3u*2) to the form ju*2 + yu + z + ku3 and give y. -652 Express -10296t*2 + 59t*3 + 10296t*2 + 6 - 105 - 36 as lt*3 + h + vt + jt2 and give h. -135 Express (-428l - 2 + 447l + 1)(-5 + 10 + 31 + 1 - 2 + 0 + (-4 + 5 - 3)(2 - 6 + 2) - 5 + 3 + 1 - 2 + 2 - 1)(0 - 5 + 4) in the form r + cl and give r. 37 Express 3j - 2j2 + 3j - 7j + (2j + 0j + 0j)(3 - j - 3) - 3398j*2 + 874j*2 - 1708j*2 as z + uj*2 + rj and give r. -1 Rearrange -13c2 - 13c*2 - 18c*2 - 1522c + 51c2 - 11c*2 to w + nc*2 + oc and give o. -1522 Rearrange -252 - m*3 - 73m*2 + 67m + 249 + 86m2 to vm*2 + lm*3 + fm + c and give c. -3 Express 274 - 5q3 + 263 - 454q*2 + 455q*2 in the form fq*2 + yq*3 + jq + h and give y. -5 Rearrange -3542v + 5 + 2 + 3541v + 7v4 - 3v*2 to hv*4 + a + dv*3 + uv*2 + bv and give h. 7 Express 605 - 1023a - 604 - 890a as p + qa and give p. 1 Rearrange 3l - 1336 + 2680 - 3l + 2l - 1326 to the form h + xl and give x. 2 Rearrange (2 + 0 + 0)(-23 - 36 + 20)(1348 - 1348 - 168b) to n + mb and give m. 13104 Rearrange -3u*3 + 8u*3 + 2u*2 + 2 + 213367u*4 - u + 1 - 213368u*4 to the form ju*4 + mu + zu2 + au*3 + d and give a. 5 Express -48y + 15y + 42y*2 + 17y + 28 + 16y as ty*2 + g + fy and give g. 28 Rearrange 2770 - 21t - t3 - 2770 - 175 + 131t*3 + 175 + (-3 - 2 + 3)(2t3 - 2t3 + t3) to the form p + qt2 + rt + xt3 and give r. -21 Rearrange (-2l - 4l + 5l - 79 - 5l + 79 + 0l + 0l + 2l + (0l - 4l + 3l)(0 - 2 + 1))(-111l - 30l - 24l) to the form dl + n + fl*2 and give f. 495 Rearrange 2175m + 10701m + 3326m to h + zm and give z. 16202 Rearrange -4c - 183c2 - 25c*2 + 9c*2 + 3c to hc2 + m + zc and give z. -1 Express -58y2 - 58 - 20 + y - 3y + 79 as r + by + py*2 and give r. 1 Rearrange (527m*3 - 9m*2 - 522m3 - 433 + 431 - m4)(7 - 3 - 1) to the form qm*2 + nm + xm4 + u + jm*3 and give j. 15 Express (-1 - 3 + 2)(-56 + 5o + 56)(-16o2 - 37o*2 + 7o*2) as jo*2 + ro + g + no3 and give n. 460 Express (224 - 444 + 216 + 118r)(3r - 3r + 3r) in the form s + ir2 + qr and give i. 354 Rearrange -4a2 - 134a*3 - a - 1794484 - 85a*3 + 1794483 to k + xa + ua3 + oa*2 and give x. -1 Express 311 + 38v4 + v3 - v*2 + 33v*4 + 32v*4 - 104v*4 in the form mv*4 + jv*2 + bv + s + yv3 and give j. -1 Rearrange (-26 - 11 + 1)(-2f - 3 + f + 1)(14 - 8 + 2)(-1 + 1 + 2f) to vf2 + k + lf and give v. 576 Rearrange 2l2 - 8 + 47241l*4 - 47231l4 - l2 to ol2 + g + tl*4 + sl*3 + pl and give g. -8 Rearrange (83m + 9m - 43m)(2m - 1769m*2 + 1785m*2 - m) to the form gm*3 + km + l + sm2 and give s. 49 Express (-3h + 2h + 2h)(0 + 2h + 0) + (-3h + 6h + h)(h + 4h - 6h + 9) - 3h*2 + 8h*2 + 23h*2 as th + nh2 + g and give n. 26 Express (8 + 4 - 9 - 5p)(2 - 8 + 12p + 6p2 - 3p*2) as kp*2 + np*3 + d + hp and give k. -51 Rearrange (2u + 2 - 2)(0u2 - 2u*2 + 0u*2 + (6u*2 + u - 2u - 4u)(1 - 3 - 1)) to xu + bu*2 + i + cu*3 and give c. -40 Rearrange (6565 + 428 + 1777 + 747 + 878 - 1060)(-6t - t3 + 6t) to m + nt2 + ut*3 + gt and give u. -9335 Rearrange (3d3 - d3 + 3 - 2804d*2 + 2878d*2)(-2 + 6d + 2) to the form b + ad*4 + od + cd3 + jd*2 and give o. 18 Rearrange -2x + 0x - x + 55x + 6x + 40x + (0 + 0 - 2)(2x + 4 - 4) to the form kx + c and give k. 94 Rearrange -239c + 7c3 + 245c + c*3 + 6c*3 - 4 to the form lc + p + oc3 + mc*2 and give o. 14 Rearrange 3u - 3u - 8u + (-5 - 7 + 8)(-3u + 3u - u) to a + wu and give w. -4 Rearrange 4341f2 - 67f + 160f - 93f to xf2 + hf + r and give r. 0 Rearrange 76 - 1243k - 31 - 45 to the form w + ok and give o. -1243 Rearrange (-64 + 25i + 64)(-11 - 9 + 3) - 8i - 7i + 6i + 18i + 1 to h + mi and give m. -416 Rearrange 3w + 66 + 87 + 31 - 31 + 120 to m + bw and give b. 3 Express -906i*3 - 543i*2 + 306i*3 - 331i*3 - 544i*2 + 1079i*2 in the form s + zi + bi3 + ti*2 and give z. 0 Rearrange (-2 + 0 + 0 + (0 + 1 - 2)(11 + 1 + 1) + 0 + 0 + 1 + 1 - 5 + 2)(4g*3 + 0g*3 - 5g*3) to the form zg + a + yg2 + dg*3 and give d. 16 Express (7 - 10 + 36)((1 + 0 - 2)(2 + 0 - 1) + 2 - 2 + 1 - 1 + 1 - 2)(-1 + 2 + 3)(-2o + 34 - 34) as no + h and give n. 528 Rearrange 426 + 18t*2 - 16t*2 + 16t*4 - 422 - 4t to yt4 + n + mt + lt3 + zt2 and give m. -4 Express u3 + 16u + 1 - 10u*3 - 1605u*2 + 1600u*2 in the form wu + su2 + qu*3 + i and give i. 1 Rearrange 323 - 33338f*3 + 16672f*3 + 16671f*3 + 32 to the form p + uf + of3 + nf*2 and give o. 5 Rearrange 2366 - 290 + 223 - 601 + d to o + cd and give o. 1698 Rearrange 4s3 - 2s*3 + 172s + 6s3 - 173s + 1 to the form ds2 + os + ls3 + j and give o. -1 Express 8061n*2 - 714n*2 + 6237n*2 + 3801n*2 in the form sn*2 + m + an and give s. 17385 Rearrange (-8n2 + 26n2 + n2)(10n + 90 - 90) - 2 + 1 - 23n3 + 29n*3 to the form un*3 + pn + sn2 + j and give u. 196 Rearrange -123n - 40n3 + 149n + 4n3 + 94n to rn2 + ln + i + jn3 and give l. 120 Express 225221m*2 + 219242m*2 - 449633m*2 as w + ym + bm2 and give b. -5170 Rearrange (2u + u*2 - 2u)(-2u + u + 3u) - 492u + 492u - 368u*3 to the form h + nu + du3 + yu*2 and give d. -366 Express 10931c*4 + 6 - 2c*3 - 10925c*4 + 5c*3 + 3c - 4c3 + 4c*2 in the form nc*4 + wc*2 + g + oc*3 + sc and give w. 4 Express 5a3 + 105237a*2 - 4a*4 - 105244a*2 + 3a*4 as ca*3 + ka + za2 + p + da*4 and give d. -1 Rearrange (5f - 21f - 28f)(-17f + 10f + 86f) to kf2 + m + pf and give k. -3476 Express (1 - 1 + 1)(-37786g + 11g4 + 37788g + 295g3 + g4) as zg*2 + xg*3 + o + fg + ng*4 and give n. 12 Express	{ "pile_set_name": "DM Mathematics" }
/6)/(-5). Let x = -4 + 4. What is the third biggest value in 3, x, k? x Let y = -22 - -25. Which is the third biggest value? (a) 4 (b) -5 (c) y b Let w = -0.8 - 2.2. Let d = w - -2. Which is the second smallest value? (a) 2 (b) d (c) -3 b Let i = -3/71 + 151/213. Let s be 0 - 14/(-71). Let z = s - -193/355. Which is the second biggest value? (a) -3 (b) z (c) i b Let o be (10/(-5))/(2/4). Which is the second smallest value? (a) o (b) -5 (c) -0.5 a Let i = -119/165 - -4/33. What is the third biggest value in i, 1/7, 4/3? i Let c = 4 + -10. Let g(o) = -o3 - 7o*2 - 7o - 4. Let u be g(c). Let h = -24 + 23.5. What is the biggest value in 0.2, u, h? u Let n = -0.03 + 2.03. Let v be (-432)/44 + 4 - -6. Which is the biggest value? (a) -1/6 (b) n (c) v b Let t be (-39)/104 - (-1)/8. Which is the biggest value? (a) -1/3 (b) 3 (c) t b Let d be (2/(-30))/(2/(-12)). What is the biggest value in d, -2, 4? 4 Let h = -0.06 + -1.94. Let w = h + 6. Let g = w - -1. Which is the third biggest value? (a) 3 (b) g (c) -1/2 c Let h = -4.4 + 4. Let m = 1.05 - 0.68. Let n = 0.13 + m. Which is the biggest value? (a) -2/9 (b) n (c) h b Let a(r) = -r*2 - 3r. Let h be a(-3). Let p = h - -4. What is the smallest value in p, -4, -1? -4 Let k = 5.3 - 1.3. Let d = -58 - -292/5. Let t(z) = z + 10. Let u be t(-5). Which is the third smallest value? (a) u (b) k (c) d a Let j = 218/5 + -44. Suppose 0m - 4w - 10 = 3m, 2w = -2. Which is the third biggest value? (a) j (b) m (c) -4 c Let y = -12 + 5. Let l = y + 7.3. Let k = 0.1 - l. Which is the third biggest value? (a) 0.1 (b) k (c) -4 c Let a = 0.06 - -5.94. Let b = 327 - 329. What is the third biggest value in a, b, -0.1? b Let j be 75/(-10)(-1)/6. What is the second biggest value in j, 1/2, 2/11? 1/2 Let o(q) = q2 + q. Let l = -3 + 2. Let w be o(l). Which is the second smallest value? (a) w (b) -4 (c) 1/2 a Let c = 2 - 8. Let y = c + 10. Let r be 3/(-2)(-2)/(-12). What is the second biggest value in r, y, -1/2? r Let h = 4.55 + -0.15. Let f = h - 0.6. Let k = f - -0.2. Which is the third smallest value? (a) k (b) 3 (c) -2 a Let t = -5 - -4. Let k = t + 0.5. Let j = k - -0.5. Which is the third biggest value? (a) j (b) 1/4 (c) -1 c Let y be 14/21 + (-22)/6. Let f be y/12 + (-21)/(-4). Let p be (3/(-5))/(4/f). Which is the third biggest value? (a) p (b) 0.3 (c) 0.4 a Let o = -0.54 - -0.04. What is the biggest value in -0.6, o, -2, 4? 4 Let j = 0.3 - 0.2. Let h = -0.3 + j. Let p = 2.7 + 2.3. What is the second smallest value in h, -5, p? h Let s = -1 - -0.6. Let q = 0 - s. Which is the second smallest value? (a) q (b) 5 (c) -1/3 a Let t = 107 + -112.1. Let w = 0.1 + t. Which is the second smallest value? (a) w (b) 0 (c) 1/2 b Let g = -0.8 - -0.7. Which is the third smallest value? (a) -1 (b) 3/8 (c) g b Let o = -0.0936 + 5.2836. Let w = 0.19 - o. Which is the smallest value? (a) 3 (b) w (c) 0 b Suppose -14f = -12f. Which is the third smallest value? (a) f (b) 1/4 (c) 2/7 c Let l = 4361/16 - 273. Let k be 0/2 + 2/(-32). Let o = k + l. What is the third smallest value in -3, o, 1? 1 Let f = -15.2 - -20. Let l = 4 - f. Let i = -2.8 - l. What is the smallest value in i, -0.2, 4? i Let g = 23 + -22.96. Which is the third biggest value? (a) g (b) -5 (c) 3 b Let l be (-1)/((-4)/(-15))-4. Let c = 103/7 - l. What is the second biggest value in c, -0.3, 2? c Let l = -109.05 + 114. Let g = l + 0.05. What is the second smallest value in -1/6, g, 2? 2 Let n be ((-1)/3)/((-32)/12 + 4). Which is the third smallest value? (a) -5 (b) 5 (c) n b Let l = 0.4 - -4.6. Let z(u) = 0u + 4u + 2 - u2 - 4 + 9. Let p be z(5). What is the second biggest value in l, -1/3, p? p Let k = -0.5 + -4.5. Let c be 17/(-5) - 2/(-5). What is the second biggest value in k, c, -2/9? c Let m = -20.8 + 25. Let k = -4 + m. Let y = k - -1.8. What is the biggest value in y, 0, 1? y Let t = 0.5 - 1. Which is the second smallest value? (a) t (b) 0.1 (c) -5/2 a Let d = -0.1 - 0. Let y be -11 - 10241/(-88). Let u = 115 - y. Which is the smallest value? (a) 1/2 (b) d (c) u c Let z = 20 - 12. Let d(m) = m*2 - 8m + 5. Let x be d(z). Let h = 0.2 - 0.3. Which is the third smallest value? (a) h (b) x (c) 2/5 b Let u = -4.95 + 5. Let g = -1.95 - u. Which is the biggest value? (a) g (b) 0.1 (c) 2/9 c Let j(k) = -k + 2. Let w be j(6). Let s be w/(-3)2/(-12). Suppose 4l - 14 = -p - p, -5p = -l - 2. Which is the second smallest value? (a) p (b) -4 (c) s c Suppose -5n - 3 = -33. Suppose 2l = nl. Let f(k) = -k*3 - 2k*2 - k + 1. Let b be f(0). What is the second smallest value in 3, b, l? b Let x = -0.41 - -0.23. Let p = 4.42 - x. Let y = p + -5. What is the third biggest value in y, 4, 3? y Suppose -4s + 2v - 42 = 0, 5 = -5v - 10. Let w be (-3)/2s/9. Let z be (3/18)/((-1)/w). Which is the third biggest value? (a) z (b) 3 (c) 1/3 a Let o be 4/63/(-11). Which is the second biggest value? (a) 0.4 (b) o (c) 4 a Let s = 3 + -4.9. Let q = s - -2.5. What is the second smallest value in -0.3, 3, q? q Let h = -24 - -5. Let q = h - -18.5. Which is the third smallest value? (a) 3/5 (b) 2/7 (c) q a Let n = 0 - 0.5. What is the biggest value in n, -5, 6? 6 Let l = -75 + 977/13. Which is the fourth biggest value? (a) 0.1 (b) -3 (c) 0.5 (d) l b Let q = -302.03 - -304. Let v = 0.03 + q. Which is the second smallest value? (a) -0.3 (b) -5 (c) v a Let p = 22 - 23.9. Let w = p - -3. Let o = 1 - w. Which is the second smallest value? (a) 4 (b) o (c) 3 c Let c be -3 - 6 - (0 - 4). Let o = -0.4 + 0.3. What is the third biggest value in o, 0.5, c? c Let x = 3.9 + -4. Let f = 5 - 14. Let g = 5 + f. Which is the second biggest value? (a) -2 (b) x (c) g a Let b = -116/9 - -616/45. Let w = 136 - 277/2. What is the second biggest value in b, w, -2? -2 Let o = -6 + 8. Suppose 0 = 5x - 4 - 6. Suppose 0 = 2t + xt - og - 30, -5 = -5t - 4g. What is the third smallest value in t, -5, -3/7? t Let u = -0.031 + 0.631. Which is the smallest value? (a) 0 (b) 2/5 (c) 1/3 (d) u a Let k = 1088/3759 + -2/537. Let x = 11 - 6. Let v = 0.3 - 0.7. Which is the smallest value? (a) k (b) v (c) x b Suppose 0n + 2 = -n. Let o be 80/105 + 11/(-33). Which is the second biggest value? (a) o (b) 0.08 (c) n b Let k = 6.4 + -6. Which is the smallest value? (a) k (b) 0.1 (c) -3 c Let w = 3.03 + -3. Let q = 3.32 + -0.29. Let s = w - q. What is the second smallest value in 5/2, s, -1? -1 Let x = 3/46 + 11/184. Which is the second smallest value? (a) x (b) 2/5 (c) -2 a Let y(c) = -4c + 7. Let h be y(3). What is the smallest value in -1, -0.1, h? h Let x = 0.15 + -0.05. Let v = 0 - -5. Let k = -141/7 + 20. What is the smallest value in x, k, v? k Let h(q) = q*2 - 2q + 5. Let j be h(0). Which is the second biggest value? (a) -0.5 (b) 1 (c) j b Let d = -11 + 6. Let k be (-30)/(-12)3/(-5). What is the third smallest value in d, 2/9, k? 2/9 Let t(l) = -l3 - 2l*2 + 3l - 1. Let u be t(-3). Which is the biggest value? (a) -2/7 (b) u (c) -9 a Let p = -71/70 - -3/14. Which is the biggest value? (a) 2 (b) p (c) 2/3 a Suppose -5t = -5p + 15, t + 3p = -0 - 3. What is the third smallest value in 6, t, 3? 6 Let t = -5.2 - -0.5. Let s = -5 - t. Let d = s - -0.8. Which is the smallest value? (a) -5 (b) d (c) -0.4 a Let k = 1 + -1. Let z = 0.5 + 2.5. What is the biggest value in z, k, -0.5? z Let k = -8 - -8.3. Let m be -33/(-9) - -13. Let f be (-111)/21 - (-4)/m. What is the smallest value in 1, k, f? f Let k(o) = -17o + 1. Let l be k(-3). Suppose -h - 23 = -2m, 0m - 3m + 5h = -l. Let y = -9 + m. Which is the smallest value? (a) -4/9 (b) y (c) 3 a Let i be (-12)/(-2) - (-1 + 4). Suppose -2v + 3v + r - 4 = 0, -ir + 16 = 5v. Let j = 95/3 + -32. What is the second smallest value in -3, j, v? j Suppose y - 8 = -3y. Suppose -7p = -yp - 15. Which is the biggest value? (a) p (b) 2 (c) 1 a Suppose 0 = -3f + 5g - 127, 2f - 3f = 4g + 65. Let k be 2/2 + 35/f. Which is the second smallest value? (a) 0.4 (b) -1/3 (c) k c Suppose 0 = -x + 2x - 1. Suppose -22 = 3*y - x. Which is the smallest value? (a) -5 (b) -2/5 (c) y c Let r = 24 - 28. Which is the third smallest	{ "pile_set_name": "DM Mathematics" }
3, 19, -7? s Let t = -155677 - -155675. Let l = 0.6 - 0.1. Which is the fourth smallest value? (a) 2/3 (b) -1 (c) l (d) t a Suppose -169b - 1866 = -21808. What is the fourth smallest value in -1/7, b, 2/5, 0.3? b Let f = 470.72 + -475. Let d = f + 4.08. Suppose 35 = 5y - 45. What is the biggest value in d, 4, y, -3? y Let q = -550/7 + 1549/28. Let h = 24 + q. Let d be ((-4)/65)/(9/(315/14)). Which is the biggest value? (a) d (b) h (c) -0.5 b Let k = 577 - 576. Let s be 4/(-18)(0 + k). Which is the third biggest value? (a) 2/15 (b) 5 (c) -0.1 (d) s c Suppose -2v - 5y = 14, 3v + 12 = -v - 2y. Which is the third smallest value? (a) v (b) 0.4 (c) -5 (d) -2/15 (e) -0.218 e Let s = 390.07 + -390. Let f = -224 - -223.07. Let y = s - f. Which is the second smallest value? (a) y (b) 2 (c) -4/7 a Let v = -2.99 + -0.01. Let b be 45/(-75)(-146)/(-2). Let h = 43 + b. What is the second biggest value in v, h, -4? v Let h(t) = -t*2 - 14t - 17. Let k be h(-9). Suppose -7 = 7o + k. Let y be o/(5/23) + 2. Which is the biggest value? (a) y (b) 3/2 (c) 2 c Let f = 299.3 + -299. Let x = -7 - -6.98. Let d = x - -1.02. What is the smallest value in 0, f, d? 0 Let h = -2/79 + -148/395. Let m = 80 - 32. Suppose m = -7x + 13. Which is the third smallest value? (a) x (b) h (c) -3 b Let t(n) = 34n + 1193. Let l be t(-35). What is the smallest value in 5, -0.4, 0.048, 3/4, l? -0.4 Let s = 0.04 - -0.36. Let w = -16 - -15.9. Let k = 92 + -185/2. Which is the second smallest value? (a) s (b) k (c) w c Let l = -9 - -17. Suppose 0 = i + l - 38. Let p be (12/i)/(8/(-10)). What is the second smallest value in -9, p, 3? p Let i = -42.69 - -43. Let o = -2300.79 + 2301. Let v = o - i. Which is the third biggest value? (a) v (b) 8/7 (c) -4 c Let k = -148.2 - -145.2. Which is the third biggest value? (a) -23 (b) k (c) 1.3 a Let s be (-12)/9(-5)/(40/12). Let i(z) = -6 - z - s + 2 - 2. Let n be i(-10). Which is the third smallest value? (a) n (b) 2/11 (c) 0 a Let r(x) = x*3 - 9x*2 - 9x - 6. Let l be r(10). Let g = 1/9 - -11/9. Which is the third biggest value? (a) 7 (b) 2 (c) l (d) g b Let g be (-4)/(-3) - 1/1. Let q = 25501/3 + -25505/3. Which is the second biggest value? (a) 0.2 (b) -3/4 (c) q (d) g a Suppose -79c = 328c + 407. What is the fifth biggest value in c, 226, -3, 0.5, 1? -3 Let u be -9(-14)/21 + -15. Let n be (-1 - (-388)/336) + u/36. Let p = -13 - -8. Which is the second biggest value? (a) n (b) p (c) -10 b Let o = 84.15 + -56.15. Which is the third biggest value? (a) 2/21 (b) 2/15 (c) 1/238 (d) o a Let t be 11 - -3 - (19 + 297/(-66)). Suppose -5i - 28 = -3x + 7x, 0 = -i + 2x. What is the smallest value in 0, i, -0.3, t? i Let n be ((-14)/9 + 156/702)3/62. Which is the smallest value? (a) 3/4 (b) n (c) 0.2 (d) 24 (e) -4 e Suppose 47 = 3n + 5g - 3g, -34 = -2n - 2g. What is the biggest value in 4, 70, n, -2/9, -3? 70 Let j be (-1 - -2) + (-4)/(-4). Let q = -2/7499 - -7511/44994. What is the third biggest value in j, 2/7, q, 11/6? 2/7 Let g = -429 + 428.859. Let q = g + 0.441. Let m be (2/8)/(2/(-4)). Which is the second biggest value? (a) -0.3 (b) m (c) q a Let k = -24 - -17.5. Let t = -1.623 - -7.823. Let b = k + t. What is the biggest value in b, -0.4, 1? 1 Let w = 10006/5 + -2001. Which is the second biggest value? (a) 1/2 (b) -1.3 (c) w (d) -37 c Let z = -1 - -1.1. Let w = -10864.5 + 10865. Let m be (-3)/(-48)-22. Which is the second biggest value? (a) m (b) -1 (c) w (d) z d Let q = 9528 - 9526. What is the second biggest value in q, 2/277, -3? 2/277 Let x = -8357.94 - -8358. Which is the fourth biggest value? (a) x (b) -3/2 (c) -4 (d) 37 c Let h be (10/(-3) - -3)6. Let k = -270 + 300. Let s be ((-45)/k)/((-6)/h). What is the biggest value in s, 4, 3, 1? 4 Let z = 844 - 846. Let o = 3.997 - -0.003. Suppose -5u = -0u. What is the second biggest value in 9, u, o, z? o Let y = 2/3525 - -626/1175. Which is the second biggest value? (a) 0.5 (b) y (c) 12/11 b Let b = 11301 - 11308. What is the third biggest value in 1.9, b, -3, 3, 0.4? 0.4 Let y(n) = n*2 - 6n + 6. Let x be y(7). Let g = 354 - 345. Suppose 6 + 30 = -gp. What is the smallest value in -0.5, p, x, -0.4? p Let v be -1(-1533)/(-4200) + 2/16. Which is the fourth smallest value? (a) v (b) 0 (c) 0.3 (d) -2/9 c Let w = -0.0503 - 2.3497. Let g = 0.269 + 0.031. What is the smallest value in 2, w, g, 0? w Let f be ((-12)/21)/(6 - 544/56). Suppose n + 2n + 3c + 6 = 0, 0 = 3c. Let i = -0.05 + 0.35. What is the smallest value in i, n, f, 5? n Let x = 12 + -14. Let j be (-39)/65x/(-6). Let s = -336 + 4366/13. What is the third smallest value in 4, j, s? 4 Let j = 109 + -107. Suppose -2i - 2p = -3i - 11, 3p - 19 = ji. What is the second smallest value in 3/8, 6, i? 3/8 Let d = -0.193 + 0.059. Let x = d + -0.066. Which is the third biggest value? (a) -2 (b) x (c) 0.16 a Suppose 22v - 184 = 124. Let s be (-13)/(-15) + v/(-21). What is the smallest value in -2/7, -0.4, s, 0.03? -0.4 Let m be (6/45)/(4/(-5)). Let q = 9626/3 - 3209. What is the third smallest value in q, 8/7, 0.5, m? 0.5 Let q = 1759 + -1758.6. Let x be 773/2070 + 4/(-30). Which is the second smallest value? (a) -0.2 (b) q (c) x c Suppose 0 = 88j - 84j + 8. Let l(m) = -3m*2 - 2m + 5. Let g be l(j). What is the smallest value in g, 2/7, 0.8, -2/3? g Let a = 2602.8 - 2603. Let w = -11 + 13. Let p be w/510/(-14). What is the third biggest value in a, 21, p, 2? a Suppose -4j + 50 = 6l - 9l, 3j + l - 31 = 0. Suppose 4 + j = -15z. Which is the fourth biggest value? (a) -2 (b) z (c) 4 (d) -0.2 a Let f = 624 - 596.9. Let k = -23.1 + f. Which is the third biggest value? (a) 3 (b) 4/9 (c) k b Let p = -3185/2 + 1593. What is the third smallest value in 2, p, 13, 0.1? 2 Let m(z) = -z*3 + 18z*2 - 13z + 14. Let t be m(16). Suppose 0 = -22x - 606 - t. Let k be 2/(-18)10 + 1. What is the smallest value in k, 5, 4, x? x Let t = -80605/8 + 10059. Let o = t + 3309/200. What is the biggest value in -2, o, 3? 3 Let m = -2 - -2.4. Let g be (-37)/(-3)(5 - 1/7). Let f = g + -424/7. Which is the biggest value? (a) -2/5 (b) m (c) f b Suppose n + 4 + 1 = 0. Let s be (((-140)/6)/n)/(2/6). Let v(h) = 2h - 6. Let i be v(3). Which is the second smallest value? (a) s (b) 4 (c) i b Suppose 122j = -139j + 43j - 654. Which is the fourth smallest value? (a) 15 (b) j (c) 1/2 (d) -0.1 a Let x(t) = -812t + 815. Let r be x(1). What is the third biggest value in r, 1/8, -146? -146 Let v = -115/3 + 44. Let f = -193.5 - -201. Let o = 8.5 - f. What is the second smallest value in v, -4, o? o Let r = 160.045 + 9.955. What is the second biggest value in -1, -6, r? -1 Let o be (2 + 30/(-12))(-88 + 0). Suppose -f - 67 = -o. Let x = 89/4 + f. Which is the third biggest value? (a) x (b) -2/9 (c) 1 a Let r be (-4)/(-34) + 2440/(-3400) - -1. Which is the third biggest value? (a) 4 (b) r (c) 2/19 (d) -5 c Let l(f) = -90f - 3596. Let j be l(-40). What is the fifth biggest value in j, 5, 0.3, -5/6, -3? -3 Let o = 22297 - 156083/7. Let m = 0 - -2. Let y be ((-2)/12)/(m/8). Which is the second smallest value? (a) y (b) o (c) -0.4 (d) 0.5 b Let n = -1566.4 + 1568.4. Which is the fifth smallest value? (a) n (b) -9 (c) 1 (d) 4 (e) -2 d Let y = -5.373 + 3.373. Which is the third smallest value? (a) 2 (b) 0.863 (c) y a Let b = -579.35 - -579. Let h = -0.05 - b. What is the third biggest value in 2.2, -3, h? -3 Let v = 1777 + -1769. What is the third smallest value in -1, 0.3, v, 3.9? 3.9 Let p = -57 + 46. Let y = p - -31/3. Let l = -1.1 - -0.6. Which is the second smallest value? (a) y (b) 1/2 (c) l c Let m = -0.329 - -0.3532. Let l = m - 0.4242. What is the second biggest value in l, 5, 0.1? 0.1 Let l = -23.7 - -24. Let o = -0.86 - 28.14. Let r = 29 + o. What is the fourth biggest value in r, 1, l, -5? -5 Let u = -0.1 - 0.3. Let y = 127 + -455. Let h = -330 - y. Which is the third smallest value? (a) 0.19 (b) h (c) u a Let t = 45.29 + -42.7. Let l = t + -2.64. What is the fourth biggest value in l, 2/5, 1, -7/4? -7/4 Let w = 0.05286 + 3.94714. Which is the second smallest value? (a) w (b) 2 (c) -5/8 (d) -6/5 c Let z	{ "pile_set_name": "DM Mathematics" }
n base 11? a615 -303026 (base 7) to base 13 -1a573 What is -141 (base 16) in base 8? -501 -101000011111101 (base 2) to base 13 -958b What is -203 (base 6) in base 12? -63 Convert 32010332 (base 4) to base 3. 2221002122 211010221 (base 3) to base 12 9414 Convert 22720 (base 9) to base 11. 10437 Convert 2d8 (base 15) to base 5. 10103 a568 (base 13) to base 4 11211311 What is 1040 (base 10) in base 9? 1375 What is -302bb (base 12) in base 9? -104828 Convert 51e3 (base 16) to base 10. 20963 What is -31262 (base 8) in base 15? -3ca3 What is -101000110000 (base 2) in base 11? -1a61 Convert 602 (base 11) to base 9. 888 -3084 (base 9) to base 5 -33023 27620 (base 9) to base 4 10210221 What is -e4f (base 16) in base 4? -321033 What is 26263 (base 7) in base 6? 52231 -5b7b (base 16) to base 4 -11231323 Convert 1110110110 (base 2) to base 16. 3b6 What is 131343 (base 7) in base 5? 1241111 Convert 431 (base 6) to base 7. 322 20202122 (base 3) to base 5 124211 Convert -2540 (base 9) to base 16. -76b What is 3124 (base 13) in base 3? 100022111 -1001111001 (base 2) to base 7 -1563 Convert 255 (base 9) to base 8. 324 Convert 110110010011 (base 2) to base 7. 13063 What is -21504 (base 6) in base 8? -5660 -292 (base 12) to base 7 -1106 What is 124 (base 14) in base 6? 1020 Convert -312210 (base 4) to base 9. -4710 1300 (base 10) to base 5 20200 312553 (base 6) to base 3 1021122220 Convert -26a (base 15) to base 14. -2b4 What is 4447 (base 9) in base 15? e8d Convert -101 (base 3) to base 11. -a What is -995c (base 14) in base 9? -40361 What is -402411 (base 5) in base 3? -122122011 1021452 (base 6) to base 3 2112002112 221101 (base 6) to base 8 43735 What is 11011000000111 (base 2) in base 14? 507d Convert 3a0 (base 12) to base 9. 673 What is 535 (base 12) in base 14? 3c5 Convert 1102111 (base 3) to base 5. 13124 1c479 (base 13) to base 11 38938 Convert -239 (base 13) to base 7. -1061 What is -b5b (base 12) in base 11? -1275 What is 12112 (base 6) in base 10? 1772 Convert -4626 (base 8) to base 6. -15210 Convert -3003 (base 4) to base 5. -1240 -17b7c (base 15) to base 14 -2000a What is 2a49 (base 14) in base 13? 355c What is 1433 (base 5) in base 3? 100000 190a (base 14) to base 2 1000110100110 What is -1012122 (base 3) in base 13? -52a Convert a08 (base 12) to base 4. 112220 22111202 (base 3) to base 4 1200323 What is -503 (base 9) in base 2? -110011000 Convert 86b8 (base 14) to base 16. 5afa -210313 (base 4) to base 6 -14531 Convert -46fd (base 16) to base 3. -220221002 What is -15105 (base 8) in base 2? -1101001000101 What is 3331133 (base 4) in base 2? 11111101011111 What is -4616 (base 8) in base 9? -3317 84c (base 13) to base 2 10110001000 What is 875 (base 14) in base 2? 11010000111 Convert 10001110001 (base 2) to base 15. 50c -101111100 (base 2) to base 11 -316 Convert -14430 (base 5) to base 6. -5424 Convert -3003 (base 5) to base 13. -231 Convert -101101 (base 5) to base 12. -1a90 -10000000001100101 (base 2) to base 11 -45350 103 (base 13) to base 5 1142 24664 (base 9) to base 4 10003012 -1303122 (base 5) to base 2 -110001101000100 Convert -3751 (base 10) to base 13. -1927 Convert -17987 (base 10) to base 8. -43103 -654 (base 10) to base 13 -3b4 What is 1434 (base 5) in base 12? 184 What is -32367 (base 9) in base 16? -53c5 Convert 1000020 (base 3) to base 4. 23133 What is -d3a (base 14) in base 3? -10120022 What is 220201011 (base 3) in base 11? 12596 What is 1482 (base 11) in base 4? 131301 What is 100001111101101 (base 2) in base 7? 101461 2d26 (base 14) to base 8 17606 Convert 2877 (base 12) to base 6. 33431 Convert -253204 (base 6) to base 14. -8416 What is 18e (base 15) in base 11? 2a7 319a (base 16) to base 9 18368 da (base 14) to base 5 1232 What is -532104 (base 7) in base 16? -16749 Convert -536d (base 15) to base 6. -213421 1333323 (base 4) to base 15 265c What is -45066 (base 7) in base 12? -66b3 What is 1213212 (base 4) in base 5? 203010 What is 5503 (base 8) in base 9? 3853 What is 505250 (base 6) in base 12? 1b226 What is -555 (base 8) in base 14? -1c1 -2431 (base 11) to base 14 -1232 Convert 3410211 (base 5) to base 12. 2a908 -42242 (base 5) to base 11 -2136 What is -133342 (base 5) in base 4? -1111200 What is -1010011100 (base 2) in base 6? -3032 Convert 2300 (base 6) to base 3. 202000 -3 (base 8) to base 9 -3 -7557 (base 8) to base 7 -14343 Convert 30433 (base 7) to base 16. 1cff -1a033 (base 13) to base 15 -eeb8 What is -1499 (base 10) in base 15? -69e What is 8833 (base 12) in base 15? 46b0 10200 (base 4) to base 5 2123 What is 1101001100001 (base 2) in base 9? 10233 3245 (base 8) to base 12 b99 Convert -1098 (base 11) to base 16. -59e What is 101010010011 (base 2) in base 11? 2041 Convert -51f (base 16) to base 11. -a92 What is 104 (base 11) in base 6? 325 Convert -717 (base 16) to base 11. -1400 Convert -2c5 (base 15) to base 2. -1001111011 Convert -11101101 (base 2) to base 9. -283 What is -798 (base 13) in base 12? -910 What is 753f (base 16) in base 10? 30015 110111110111110 (base 2) to base 12 1467a Convert 41212 (base 5) to base 11. 2019 What is 1010100011 (base 2) in base 4? 22203 What is -131441 (base 5) in base 8? -12176 What is 1503 (base 7) in base 3? 210220 What is -11413 (base 8) in base 4? -1030023 Convert 32b5 (base 12) to base 15. 19de 12159 (base 12) to base 9 36426 302 (base 10) to base 7 611 Convert -1010010100 (base 2) to base 13. -3ba 13407 (base 8) to base 9 8070 What is -cbd (base 15) in base 10? -2878 -1304 (base 10) to base 11 -a86 What is 30863 (base 12) in base 13? 22b48 Convert 4330 (base 6) to base 4. 33132 Convert 30 (base 6) to base 12. 16 Convert -22270 (base 9) to base 2. -11100111010101 692 (base 12) to base 11 806 -2852 (base 13) to base 10 -5813 Convert 1344 (base 6) to base 8. 540 What is -232404 (base 5) in base 7? -33502 8785 (base 9) to base 5 201401 What is -62 (base 16) in base 11? -8a Convert 13080 (base 14) to base 13. 1838c Convert -110202 (base 3) to base 4. -11120 What is -19b (base 13) in base 14? -173 Convert -256 (base 14) to base 15. -213 1131 (base 4) to base 8 135 What is 217 (base 12) in base 7? 616 What is b0 (base 15) in base 3? 20010 6a (base 13) to base 10 88 Convert 8966 (base 11) to base 4. 2320201 What is -5ad (base 15) in base 11? -a71 What is -3111 (base 4) in base 7? -423 What is -2431 (base 12) in base 8? -7745 7769 (base 13) to base 12 9775 -202010 (base 3) to base 9 -663 1100111011010 (base 2) to base 11 4a77 What is -420 (base 5) in base 13? -86 What is c1 (base 16) in base 6? 521 -203 (base 5) to base 4 -311 What is 1913 (base 13) in base 4? 322112 11885 (base 9) to base 2 1111101001111 -1152 (base 7) to base 2 -110101101 -3536 (base 10) to base 12 -2068 Convert -4467 (base 8) to base 9. -3211 Convert -1ec (base 16) to base 13. -2bb Convert -4301 (base 5) to base 11. -484 What is -230 (base 13) in base 4? -11321 Convert 10012121 (base 3) to base 6. 14454 Convert 1261 (base 15) to base 11. 2a40 1001021101 (base 3) to base 4 11002003 7536 (base 8) to base 10 3934 Convert 82f (base 16) to base 9. 2777 18507 (base 10) to base 12 a863 485 (base 16) to base 4 102011 What is 15501 (base 6) in base 4? 213331 4030 (base 7) to base 15 62d What is 22003 (base 4) in base 2? 1010000011 Convert 59c2 (base 14) to base 4. 3310212 Convert -1907 (base 15) to base 10. -5407 Convert -10010100010 (base 2) to base 7. -3313 What is -105e (base 16) in base 2? -1000001011110 What is -312311 (base 4) in base 14? -13c9 What is -113301 (base 4) in base 3? -2002100 220 (base 3) to base 13 1b Convert 12026 (base 7) to base 10. 3107 Convert 251 (base 12) to base 15. 184 12322 (base 7) to base 13 1630 Convert -203013 (base 7) to base 5. -2102103 What is -20222 (base 3) in base 11? -161 What is -19a8 (base 13) in base 5? -110411 Convert -135 (base 11) to base 2. -10011111 -1938 (base 11) to base 9 -3334 Convert bc7a (base 13) to base 6. 321424 -801 (base 12) to base 9 -1521 Convert -13301 (base 9) to base 2. -10001100100000 What is 46a (base 14) in base 4? 31232 What is -1242411 (base 5) in base 11? -17643 What is 332 (base 4) in base 5? 222 Convert 1000011020 (base 3) to base 8. 46525 143 (base 5) to base 3 1210 What is -955 (base 14) in base 3? -2112010 Convert 525 (base 7) to base 14. 14c	{ "pile_set_name": "DM Mathematics" }
, -l + 60 = 5y. Is v a multiple of 15? False Let p = 113 + 21. Suppose -4f + 8f = 5v - p, -f + 124 = 4v. Is 30 a factor of v? True Let c be -48 - (0/(-9))/(-5 + 3). Is 37 a factor of 2/(c/(-10652)) - 2/(-12)? True Let m = -10420 - -10421. Let h(b) = -67b - 4. Let s(x) = -67x - 3. Let t(k) = -3h(k) + 2s(k). Does 29 divide t(m)? False Let u be 6/4-106/(-18). Let p be (-88)/110 - 26/u. Is 18 a factor of 3/(-18)-3 + (-213)/p? True Suppose 4f = 2h - 9232, 19346 = 5h - 4f - 3704. Is 49 a factor of h? True Suppose 4c + 535 = -u + 2025, 3u - 4487 = 5c. Suppose 5d + u = s, 4d + 1922 = 3s - 2571. Is 36 a factor of s? False Is 20 a factor of (35/(-2))/(21 + 30041/(-1430))? False Suppose 4a - 1289 = -3d - 402, 13a = -52. Does 7 divide d? True Let p be (-2 - -455 - 3)24/10. Suppose p + 936 = 14u. Does 6 divide u? True Suppose -97140 = -28328p + 28313p. Is 10 a factor of p? False Suppose 0 = 27b - 16104 - 3066. Is 5 a factor of b? True Let n be 12/(-9)284648/(-32). Suppose g = -3z + 4543, 5z - n = -g + 515. Is 17 a factor of z? True Suppose -22v - 433 + 5625 = 0. Is v a multiple of 2? True Let p = 167 - 179. Is 5 a factor of p((-45)/(-20))/(-9)20? True Let h be (2 + 1)/(-12)0/(-4). Suppose -15z + 33z - 5184 = h. Is z a multiple of 32? True Let v(g) = 3g3 - 28g*2 + 9g + 3. Let y be v(9). Suppose 0 = 2h + yc - 185, -8h + c = -10h + 191. Is 17 a factor of h? False Let r(t) = -t*3 - 27t*2 - 25t + 29. Let k be r(-26). Let b(m) = 2m2 - 11m*3 - k + 0m*3 - m + 1 - 10m3. Is b(-1) a multiple of 7? False Let a(w) be the third derivative of -w5/60 - 9w4/8 - 103w*3/6 - 123w*2. Is 17 a factor of a(-18)? False Let d = -16965 - -30944. Does 90 divide d? False Let t be 1/(262/52 - 5). Suppose -tn = -309 - 965. Is n a multiple of 7? True Let m = -4218 - -5644. Is 7 a factor of m? False Suppose -6m + 17 = 5. Suppose 4k - 3a - 1831 = -ma, 2a - 928 = -2k. Is k a multiple of 27? True Let u = 39 + -37. Let k be (6 - u) + -1 - 3. Suppose 269 = 3c + 5n, k = -4c - 2n + 73 + 267. Is 19 a factor of c? False Suppose 2s - 5c = 49, 3s = 5c - 3c + 79. Suppose 79 - s = 2r. Is r a multiple of 24? False Let d = -4 + 21. Suppose w + d + 122 = 3z, -5w - 200 = -4z. Suppose 9h - 711 = -z. Is h a multiple of 12? False Let q(o) = -274o + 62. Let z be q(-5). Suppose 20b - z = 2328. Is b a multiple of 40? False Let p(o) = 32o2 + 133o + 882. Is p(-7) a multiple of 19? False Let p be (4/(-6))/((-30)/135). Suppose -9 = -pz - a - 95, z + 27 = -2a. Let o = 41 + z. Does 4 divide o? True Suppose -5r + 14864 = -6386. Suppose -6l + r = -4l. Suppose l = 12i + 877. Does 13 divide i? True Is (-3)/(976/1024 - 1) a multiple of 32? True Let f = -14159 + 26362. Does 5 divide f? False Suppose 3i - 13k + 15k = -1165, -3i = 4k + 1175. Let q = 397 + i. Is 9 a factor of q? False Suppose 3x + o - 32 = -o, -5x + 32 = -2o. Suppose xk - 4140 = 2k. Does 15 divide k? True Suppose -2p - 723 = -3d - p, d + 2p - 234 = 0. Let m be 6/9 + (-1040)/(-78). Suppose mq - d = 8q. Is q a multiple of 10? True Suppose -90 = -6k - 60. Suppose x - 5t = -2t + 626, -kx - 5t + 3050 = 0. Is x a multiple of 15? False Suppose -x - 5c = -3x - 33, -4x = 4c + 24. Let z(j) = -20j + 29. Let r be z(x). Suppose 3h = 181 + r. Is h a multiple of 26? True Suppose z - 11 - 11 = 0. Let n(v) = 11 - z + v - 5v - v. Is 19 a factor of n(-8)? False Let z(m) = -13m*2 + 15m + 54. Let o be z(-4). Let v = -59 - o. Does 27 divide v? False Suppose 32 = 9r - 40. Let m = 169 - r. Is 7 a factor of m? True Let z(n) = 18n - 96. Let a be z(4). Is 16 a factor of (-15 + 0)(4 + 352/a)? True Is (156/8)/(48/10368) a multiple of 17? False Suppose 0 = -3g - 3u, 4u - u = 9. Is 49 a factor of (512 - g) + 45/9? False Suppose z = -3c + 637, 0 = 5c + 2z - 60 - 1002. Suppose 0 = -3v + 4m + 276, 5v - 234 = 2m + c. Let h = -50 + v. Is 19 a factor of h? True Let z(m) = -2140m + 100. Let s(u) = -428u + 20. Let c(n) = -14s(n) + 3z(n). Is 28 a factor of c(-1)? True Let v = -503 - -632. Let r = 16 + v. Is r a multiple of 29? True Let o = -23001 - -30297. Is 57 a factor of o? True Is ((212681/23)/(-7))/(((-2)/6)/1) a multiple of 23? False Is -1(-4)/34 + 92133375/3281 a multiple of 125? False Suppose 207v - 7144760 = -133v. Does 7 divide v? True Suppose -t + 0v - 862 = -3v, 0 = 3t - 3v + 2574. Let o be 6/10 - t/(-10). Is 7 a factor of 5/2(-1904)/o? True Let i = -77 + 153. Let x = 192 - i. Is x a multiple of 29? True Suppose -244 = 7n - 398. Suppose -ns + 15s = -2898. Is s a multiple of 46? True Suppose -3m - 4b = -96, 4m + 33b = 34b + 109. Does 3 divide m? False Let z = 898 + 3323. Is z a multiple of 21? True Let a = 162 + -182. Is 56 a factor of -2 - (6/15 + 11248/a)? True Let o be -28 + (-2 - 0) - 2. Let q be 3/(-9)212. Does 23 divide o/(-5)(-120)/q? False Suppose o + u - 28516 = 0, 0 = -1986o + 1983o - 5u + 85540. Does 15 divide o? False Let m be 210/(-8) + 24/96. Is 19 a factor of -3 - (4/26 - (-4112)/m)? False Suppose 2c + 3 = -t - 7, 4c = 2t - 20. Let z(o) = o*2 + 4o - 3. Let n be z(c). Let m(j) = 7j3 + 4j - 6. Is m(n) a multiple of 15? False Let f be ((-1428)/8)/3-6. Let r = -137 + f. Is 11 a factor of r? True Suppose -4b + 7b - 5r = -302, -493 = 5b + 2r. Let g = 107 + b. Let c(x) = -x*2 + 18x - 25. Is 9 a factor of c(g)? False Let l be 6/2 - (2 - 5). Suppose 0 = -0p - 3p - l. Does 12 divide (-4)/(-6) - (272/(-6) + p)? True Let i be (7 - (-1 - 0))519/12. Let r = -238 + i. Is r a multiple of 6? True Let m(n) = -n3 - 6n*2 - 2n - 8. Let x be m(-6). Let v(i) = i*2 - 2i - 3. Let a be v(x). Suppose aj - 162 = 3j. Is j a multiple of 27? True Let u be 9 + -2 + 2/4-2. Let k(i) = -i2 + 18i - 45. Is 27 a factor of k(u)? True Let p(k) = k2 + k + 9. Let i be p(-9). Is ((-13)/((-26)/4))/(3/i) a multiple of 11? False Let a(r) = r3 - 8r2 + 19r + 12. Let l be a(5). Suppose lh + 17h = 21364. Is 6 a factor of h? False Let n(w) = -2w3 + 15w*2 + 7w + 9. Let f be n(8). Is f((-4)/(-12) + 348/9) a multiple of 3? True Suppose 0 = 5p - 3o + 4, 14 + 4 = 3p + 5o. Let z be (-1p)/(33/2937). Let l = z + 95. Is 4 a factor of l? False Suppose -16i - 28837 = -4v - 17i, 3i = -5v + 36048. Is v a multiple of 66? False Let l(k) = -138k + 8115. Does 15 divide l(-25)? True Let k be 56/(-7)(-1)/2. Let c = 224 - k. Is c a multiple of 11? True Suppose 3o + 1455 = 4j + 325, -1411 = -5j + 3o. Let n = j - 160. Let q = n + -22. Does 33 divide q? True Let w(z) = 31z + 56. Suppose 3y - k = 2k + 39, 0 = k. Does 27 divide w(y)? True Let o be 12159/14 - (-12)/(-8). Suppose -a + o = -5d + 3d, -5a - 3d = -4348. Does 9 divide a? False Let m(p) = p*3 + 36p*2 + 10p - 42. Is m(-24) a multiple of 35? False Let h(f) = 4f2 + 42f + 24. Let v be h(-9). Let s = -2 - v. Is 4 a factor of s? True Let r(q) = 2268q3 + 2q*2 - 33q + 31. Does 9 divide r(1)? True Let p(a) = 10a + 225. Let d be p(31). Let z = 1310 - d. Does 71 divide z? False Let a(x) = -4x - 160. Let d be a(29). Let j = d - -444. Is j a multiple of 24? True Let o = 20337 - 13577. Is 180 a factor of o? False Let l(q) = -408q3 - 2q*2 + q. Let x(o) = 816o*3 + 5o*2 - 2o. Let v(i) = -7l(i) - 3x(i). Is 29 a factor of v(1)? True Suppose -n = 2n + 3x + 27, -2x = -5n - 10. Is n/(-10) + -3123(-6)/30 a multiple of 48? False Let h be 6/9(-113295)/(-70). Let l = -689 + h. Is 13 a factor of l? True Suppose 35497 = 217s - 206s. Is s a multiple of 25? False Let k = 12612 - -867. Is k a multiple of 46? False Does 11 divide 12 - ((-250349)/11 - -23)? True Let g be 4(-3)/(-16) - (-115899)/28. Suppose -70c - g = -75c. Does 23 divide c? True Let o = 311 + -289. Suppose -3349 = -ol + 8773. Is l a multiple of 29? True Let c = -10023 + 20550. Does 22 divide c? False Suppose -4k = -0b + 2b + 2, -2k = 3b + 11. Let n(g) = -291g + 2 + 6gk - g3 + 291g. Is n(4) a multiple of 26? False Suppose 2a = 3m + 3, 0 = 2m + 3m - 5a + 5. Does 13 divide -54 - -58 - (1 + m - 87)? True Let w be -22(45/6)/(-15). Suppose -2a - 6p + p = w, 4p = -a - 13. Does 3 divide a? False Suppose 7q - 2q = -5y + 1495, -1468 = -5q + 4y. Let t	{ "pile_set_name": "DM Mathematics" }
= 4v + pr - 116, -5r - 110 = -5v. Is v prime? False Suppose -b = -6b + 35. Let m(a) = ba2 + a3 + 34 + 0a - 39 - 2a. Is m(-5) composite? True Suppose 0 = -2x - 5h - 45, -3x - 2x - 3h - 65 = 0. Let r = -6 - x. Suppose i = -ri + 30. Is i composite? True Suppose -3y - 4j + 2961 = -0y, -4y = 4j - 3952. Is y composite? False Suppose -4 = 3c + 2. Let d = c + 5. Is (2/d)/((-2)/(-69)) composite? False Suppose -4t = 5u - 43 - 165, 114 = 2t + 5u. Is t composite? False Let f = 170 - 97. Let p = f + -41. Let i = p + 171. Is i a composite number? True Suppose 6 = -5g + 21. Is g prime? True Suppose -2t - 3 = -1. Let c be (3 - t) + (-2 - -2). Suppose 0 = j - 5q - 68, 0j + q - 167 = -cj. Is j composite? False Let a(b) = -b3 - 7b*2 - 6b - 3. Let o be a(-6). Let c(w) = -5w3 + w2 - 2w - 1. Is c(o) a composite number? False Suppose n = 1 - 2. Is ((-178)/(-4))/(n/(-2)) a composite number? False Let r be (-280)/(-21) - 4/(-6). Suppose -2j - r = -j - 4n, 5n - 30 = -5j. Suppose b - 68 = -5z + jb, 5z = 3b + 64. Is z a composite number? True Is 5484/5 + (-8)/(-40) a prime number? True Suppose -2p = 5x - 30 - 22, 4p + 2x = 104. Let s = 63 - p. Is s composite? False Is -139(0 - (-2)/(-2)) a composite number? False Suppose 663 = 5k + 248. Is k a composite number? False Suppose -6i + 1041 = -5i. Is i prime? False Let a(u) = u - 3. Let z be a(7). Suppose 0 = zc - 2c - 174. Is c composite? True Suppose -3a = 2a - 2s - 17, -12 = -3s. Suppose -4y + 52 = 4b + b, ay + b = 44. Is -106(-2)/y4 a prime number? False Let g(c) = c2 + 7c - 3. Let k be g(-8). Suppose -j + kj - 284 = 0. Is j composite? False Let k = 2 + -4. Let n = 0 + k. Is n/6 + (-320)/(-6) a composite number? False Let r(o) = -3o - 2. Let v be r(3). Let p be (v/(-3) - 3)-3. Is ((-213)/(-6))/((-1)/p) a prime number? True Suppose -3q - 607 = -y, y = -0y + 5q + 603. Is y a composite number? False Suppose i - 3t - 289 = 0, 0 = -3i - 0t + 5t + 879. Is i prime? False Suppose 1730 = 15o - 445. Is o composite? True Suppose 0 = 2m + 2b - 770 + 18, 2b = -4m + 1510. Is m prime? True Let q = 56 - 187. Let c = 280 + q. Is c composite? False Let m be 47 - (10/2 + -3). Is 11375/m + (-2)/(-9) prime? False Is 2/((-4)/(-2546)) + 33 + -29 prime? True Let k be 1/((-23)/(-11) - 2). Suppose 27 = 5i + 3d, k = 5d - 9. Is ((-1)/3)/(i/(-477)) composite? False Let r = 792 - 559. Let i = r - 90. Is i composite? True Let w be (0 - (-2 + 1)) + 48. Suppose -12 = t - w. Is t composite? False Is (314/(-3))/(4 + 152/(-36)) a prime number? False Suppose r - 4r + 84 = 0. Suppose 17 = 2m - 5q - 114, m = -5q + r. Is m a composite number? False Suppose -245 - 1211 = -4t. Is (-2)/(-2)(t - -3) a composite number? False Let m = 33 - -2. Is m a composite number? True Let q(j) = -3j2 - 10j - 10. Let i(k) = 2k2 + 9k + 9. Let s(z) = -6z3 + z2 - z. Let w be s(1). Let g(u) = wi(u) - 5q(u). Is g(5) a prime number? False Let v be (-44)/1 - 3 - 0. Let a = v + 268. Is a a composite number? True Suppose c = -s + 1365, 0c - 4c = -16. Is s a prime number? True Let s(u) = 8u3 + u2 - 2u + 1. Let n be s(1). Suppose -4h - 4g - n = 4, -g = 3h + 3. Suppose -3y - 367 = -z + y, h = z - 3y - 368. Is z composite? True Let y be 0(0 + 2/(-4)). Suppose -2r = -yr + 4f - 10, -2f = -2. Suppose 5v - rv - 8 = 0. Is v a prime number? False Suppose -4h - l = -142, -82 = -2h + 3l + 2l. Let i = h + 15. Is (i/(-3))/((-1)/2) a composite number? True Let q be ((-2)/3)/((-6)/9). Suppose 5j - 23 = -2l, -5l + q = -3j - 10. Suppose 2t - n = 3t, 4t + jn - 3 = 0. Is t composite? False Let m(p) be the third derivative of p8/2520 - p7/5040 - p6/180 + p5/20 + 3p*2. Let u(l) be the third derivative of m(l). Is u(-3) a composite number? False Let i be (-1 + -7)/(-12). Suppose -a = 26 + i. Is (a/(-8))/(2/8) a composite number? True Let r(i) = 6i2 - 5i + 5. Is r(2) prime? True Let t = 9 - 7. Suppose -u + 3i = -277, tu + 3i - 534 = -i. Is u a composite number? False Suppose 0 = -3y + 26 + 10. Suppose 0 = -o - 2h + 8, 4o - 5h = -3h + y. Suppose -3r + or - 33 = 0. Is r a prime number? False Let h(d) = 3d2 + 2d - 14. Is h(-6) a composite number? True Let l(i) be the third derivative of 19i5/6 - i4/24 - 3i2. Is l(-1) composite? False Let a(r) = r3 - 4r2 - 4r - 3. Let h be a(5). Suppose -hj = -3j + 3. Is j composite? False Let a(d) = 236d + 3. Is a(1) a composite number? False Let c = 4 - 4. Let i = c + 3. Suppose 3u + 28 = 4u + o, 0 = 5u + io - 134. Is u prime? False Suppose -6o = -o - 1245. Is o a composite number? True Is (-13498)/(-8) + (216/32 - 7) a composite number? True Let h(s) = -34s - 7. Is h(-5) composite? False Let i be -2 + 1 + (-2)/(-1). Let l(c) = -2c - 2 - 2c2 + 134c*2 + i. Is l(-1) a composite number? True Let h(i) = 2i*2 + 1. Let o be h(1). Is 0 - o(-402)/9 a composite number? True Is (-14)/(-35) + (-783)/(-5) prime? True Let u(l) = -17 - 55 - 14 - l. Let i be u(0). Let w = 121 + i. Is w composite? True Let p be (0 - -1)4/2. Let s = -1123 - -2298. Suppose 0 = -pa - 3a + s. Is a prime? False Let g(z) = -16z + 3. Is g(-10) composite? False Let m = -6 + 1. Let a be 3352/(m + 3). Is a/(-9) + 18/(-81) a prime number? True Suppose -4q - 80 + 572 = 0. Is q prime? False Suppose 0 = -3x + 3b + 6, -3b - b - 2 = 2x. Is 12/(1 + x) - 0 composite? True Suppose 0 = p - 117 - 176. Is p prime? True Let s(u) = -4u3 - 41u*2 + 7u - 20. Let p(d) = -d*3 - 10d*2 + 2d - 5. Let f(z) = -9p(z) + 2s(z). Is f(-8) a composite number? False Let y(c) = c + 13. Let k be (-4)/(2 - 4/3). Let q be y(k). Suppose -28 = -4b - i, qi = 2i + 20. Is b prime? False Let d = 959 - 502. Is d composite? False Let o = -12 + 14. Suppose n - 188 = -of, -5f + 10f + 509 = 3n. Is n prime? False Suppose -2 = -4i + 3i. Suppose -h + ih = 287. Is h a prime number? False Suppose 22w - 33135 = 7w. Is w composite? True Let r(k) = 2k - 6. Let g be r(5). Suppose 70 = s + 3s - 3m, -65 = -3s - gm. Is s prime? True Suppose 4w = 4r - 44, -2r + 18 + 0 = -3w. Suppose f - 6f = -r. Let h(q) = 2q3 - 4q*2 - 2q + 2. Is h(f) a prime number? False Let y(j) = j*3 + 7j*2 - j - 4. Let q be y(-7). Let n(a) = -57a + 1. Let g be n(q). Is 4(g/(-8) - 2) composite? True Suppose 0 = -5o - 3 + 23. Suppose -ow + 84 = -0a - 2a, -2a = -2w + 46. Is w a prime number? True Let n = -116 - 39. Let q = -136 + 36. Let k = q - n. Is k a prime number? False Let q(x) = 2x*2 - 3x + 1. Let r be q(2). Suppose -rw + 256 = w. Suppose -5u + 664 = 4c, -4u + w = -3c + 531. Is c a prime number? False Let u(i) = -i3 - i2 - i + 389. Is u(0) composite? False Let o(a) = a3 + 4a*2 + 2a - 1. Let q be o(-3). Suppose 0 = 3t + qd - 153, -3t - 2d = d - 156. Is t a composite number? True Let n = -5 + 6. Let y = 3 + n. Suppose 0 = -2w + yv + 4, w + 4w - v - 28 = 0. Is w prime? False Suppose -106 - 529 = -5b. Is b a composite number? False Is 13250/8 + 33/44 a prime number? True Let a(d) = -260d - 221. Let m(y) = -7y - 6. Let w(h) = -6a(h) + 221m(h). Is w(5) prime? False Let j be 8/3(-3)/(-2). Suppose 0 = 4h - 6h, -z - 2 = jh. Is 3((-2)/z - -18) composite? True Let s(w) = 2w*2 + 27w + 2. Is s(17) prime? True Let d(l) = 11l2 - 2l + 5. Suppose -5n - 12 = -5m - 2, 0 = 2n + m - 11. Let f(p) = -12p*2 + 2p - 6. Let x(a) = nd(a) + 2f(a). Is x(2) prime? False Suppose 5d = -4o + 1133, 5o + 3d - 278 = 4o. Is o a prime number? False Suppose 2 + 0 = n. Suppose 2w - 80 = 1110. Suppose -nc - w = -7c. Is c prime? False Let y be (0 - 0)/(-10 + 8). Is 998/2 - y/1 composite? False Let t(v) = 6v2 - 3v - 5. Let i(c) = 0c - c + c2 + 0c + 1. Let j(k) = -5i(k) + t(k). Is j(7) prime? True Is -8212(9/12)/(-13) composite? False Suppose 234 = 5p - 201. Is p prime? False Let t = 36 - -51. Is t prime? False Let q be (-219 - -1)2-1. Suppose q = 6a - 2a. Is a a composite number? False Let f(r) = -954r3 + 1. Let w = -15 + 14. Is f(w) a prime number? False Let s(x) = 29x + 4. Suppose -y + 17 = 5m, -6m + 2m + 4y = -4. Is s(m) a prime number? False Suppose 6n + 2075 = 11n. Is n composite? True Let x(y)	{ "pile_set_name": "DM Mathematics" }
2h Expand q + 4 - 4 + 2q + 3q - 3q + (q - 2q - q)(-2 + 1 + 0) - 147 + 302 - 154 + 58q. 63q + 1 Expand (-34f2 + 973 - 973)(2f2 - 3f2 - f2)(-2f - 2f + 5f). 68f5 Expand (-3109l + 1046l2 + 3109l)(-2l - 4 + 4). -2092l3 Expand 3z*5 + 1 - 1 + (3 - 2z*3 - 3)(z*2 + 0z*2 + 0z2) + z5 + 2z5 - 4z*5 + 5z*3 - 5z3 - z5 + 213 + 67z5 - 213. 66z*5 Expand (397l + 393l + 23 - 787l)(3l2 - l2 - l*2). 3l*3 + 23l*2 Expand (1 - 6 + 2)(-17c - 17 + 3c + 15)(4 + 2 - 1). 210c + 30 Expand (252a - 107a - 360a)(a + 2a - 2a). -215a2 Expand (-7l - 14l - l)(1 - l - 1)(-2 + 5 - 2)(-3 + 3 - 2l3). -44l*5 Expand (2 + 5 + 9)(s + 0s - 3s + 0 + 0 - s - 2s + 2 - 2 + (1 + 1 + 0)(-5s + 0s + 4s) + 0 + 0 + 2s + 4s + 2s - 5s + (0 - 1 + 2)(0s + 0s - 2s)). -96s Expand (2s2 + 2s*2 - 5s*2)(3 - 1 - 4)(4s + 6s - 3s). 14s3 Expand (b - 2 + 2)((1 + 2 + 0)(15b*2 + 3649 - 3649) + 3b*2 + 0b*2 - 2b*2 + (b + 0b + 0b)(b - 3 + 3)). 47b3 Expand 2 - q5 - 3q*5 - 3 - 5q*4 + 8q*5 + 5q*4 + (-3q - 2q + 4q)(-2q*4 - 2q*4 + 3q*4). 5q*5 - 1 Expand (5 + 4y - 5 + (-6 + 2 + 3)(-2y - 3y + 3y) + y + 3y - 2y + 4y - y - y)(2y - 3y + 2y + (3 - 1 - 3)(-y - 5y + 4y) + 6y - 2y - 3y). 40y*2 Expand (r + 0r*2 - 3r + r*2)(21 + 44 + 80). 145r2 - 290r Expand (20w - 2w - w)(-3w*2 + 0w*2 + 0w*2). -51w*3 Expand (3 + 2n - n + 0n)(3n2 + 5n2 + n2). 9n3 + 27n*2 Expand (-1 - 1 + 0)(-4 + 4 + z + (4 - 1 - 1)(-2 - z + 2))(-13 - 4 - 29). -92z Expand (v + 0v + v)(-7784 + 3804 + 3660)(0 + 0 + 2v). -1280v*2 Expand (-5t + 3t + 0t)(-1 + 33 - 5)(2t3 - 4t*3 + 3t*3). -54t*4 Expand ((-2 + 2 - a)(1 - 2a - 1) + 3a*2 - 3a*2 - 7a*2)(-446 - 15a + 446). 75a*3 Expand (l - 1 + 1)(1 + 37 - 2)(-5l - 14l + 5l). -504l2 Expand (p - 2p - p)(157p - 4p - 32p + 102p). -446p*2 Expand (-3y - 1238 + 620 + 620)(4 + 0 - 5). 3y - 2 Expand (2d - 14d + 7d)((0 + 1 - 2)(0 + 1 - 4) - 4 - 5 + 3) - d + 2d + 0d. 16d Expand -c2 - c2 + c*2 + (7c - 16 + 16)(c + 0c - 2c) - 13c*2 + 4c*2 + 10c*2. -7c*2 Expand (1 - 2t*2 - 1)(-3t + 3 - 3 + 4t + 2t - 4t + (-5 + 2 + 1)(t - 3t + 6t) + 0t + 3t - t). 14t*3 Expand (-1 + 1 + 1)(2n4 + 0n*4 - 3n*4) - 142n*4 - 910 + 6n*2 + 910. -143n*4 + 6n*2 Expand (5a - 3a - 3a)((-1 + 4 - 1)(-4a + 4a - a) - 2a - 2a + 5a - a + 3a + 3a)(2a3 + 0a*3 + 0a*3). -8a*5 Expand (18m*4 + 10m*4 - 5m*4)(2m + 2m - 3m)(-1 + 5 - 2). 46m5 Expand (7 + 7 + 6)(5 - 4 - 3)(-j + j - j). 40j Expand (6 - 9 - 11)(-5u + 3u + 4u)(-4 + 0 + 2)(2 - 2 - 2u)(0 + 5 + 3). -896u2 Expand -m4 - m4 + m4 + (-2m - 3 + 3)(0 + 2m*3 + 0) - 5m*2 + 5m2 - m4 + 3m4 + 2m*4 - 7m4 + (m2 + 2m2 - m2)(0 + 2m2 + 0). -4m4 Expand (2 - d2 - 1 + 1)(-21d*2 - 19d*2 - 48d*2). 88d*4 - 176d*2 Expand (-2f*3 - f + f)(-4f + 3f + 3f) - 166f*4 + 79f*4 - 24f*4 + (4f - 6f + 0f)(-3f*3 + 0f*3 + 5f*3). -119f*4 Expand (4v*2 + 4v*2 - 5v*2)(v*2 + 0 + 0)(-56 + 1 - 32 + 25). -186v4 Expand (-s + s + 9s)(0 - 4 + 2)(-3s2 - 5s*2 + 35s*2 - 5s*2). -396s*3 Expand -12c*2 - 2c*2 + 3c*2 + (0c - 51c + 19c)(-c + 0c + 3c). -75c*2 Expand -2c*5 + 0c*5 + 0c*5 + (-3c2 - c2 + 5c2)(-2c3 + 3c*2 - 3c*2) + 36c*5 - 132c*2 + 132c*2. 32c*5 Expand (-1 + 1 - 2)(127 - 217 - 6)(-5u - u + 2u). -768u Expand (-1 + 0 + 0)(-4g - 2g + 3g) - 3g + 2g - 4g + 12g - 5g + 9g. 14g Expand -m - m2 + m + (-4m + m + m)(2m - 2m - 5m) + 19m2 - 3m*2 - 2m*2. 23m*2 Expand (2 + 9p - 16p - 13p + 54p)(-7 - 1 + 13). 170p + 10 Expand (18 + 0 - 3)(-3 - 2 + 4)(-4g - 6 + 6). 60g Expand (-2f - 4f + 5f)(-379f*4 + 80891 - 80891). 379f*5 Expand (-6r*5 + 0r3 + r3 + 5r5)(2 - 3 + 3) - 80r5 + 63r*5 - 50r*5. -69r*5 + 2r*3 Expand (-3 - 2v + 3)(14 + 9 - 21 - 263v*3). 526v*4 - 4v Expand (0o3 + 4o*3 + 0o*3)((6o + 3o - 2o)(-2o + o + 0o) - 3o2 + 6o2 - o2). -20o5 Expand (26 - 3 - 52)(2 - 5 - 2)(3 + 0 - 1)(-4c + 4c - 2c). -580c Expand (-1 - 2l2 + 1 + (4 - 2 - 4)(l*2 + 5l - 5l))(0l - 2l + 4l + (-2 + 0 + 3)(4l - 5l + 2l) - 2l + 2l - l - 4l + 3l + 2l + l - 6l - 40l). 168l3 Expand (-3a*3 + 3a*3 + 5a*3)(3a + 2a - 4a) + (0a3 + a3 + a*3)(0a - 3a - a). -3a4 Expand (-1 + 1 - 2g*2)((4 - 1 - 5)(-6g + 4g + 4g) - 2g + 5 - 5 + 5g - 2g - 4g)(9 - 3 - 45). -546g*3 Expand -5o*4 + 6o*4 - 4o*4 + (-6o + 3o + 2o)(-2o3 - o2 + o*2) - 942 + 942 - 60o*4 - 5o*4 + 4o4 - o4. -63o4 Expand (4l + 0l - 3l + (2l + 3 - 3)(0 - 5 + 3) - 2 + 2 - l + 2l + 0l - 3l)(30l2 - 30l*2 - 7l*3). 35l*4 Expand (0 + 0 - 2u)(-2u + 0u + 4u) + 0 - 101u2 - 11 - u + 9. -105u*2 - u - 2 Expand -5u*2 + 2u2 + u2 + 3u2 - 5u*2 + 0u*2 + (2u + u - 2u)(u + 0u - 3u) + 3u2 - 4u2 - u2 + 0 - 9 + 7 + 2u - 5u*2. -13u*2 + 2u - 2 Expand 22v2 - 17v*2 + 20v*2 + 2v - 2v + v2 + (-5v + 5v + v)(-1 + 1 - 2v) - 8 + 8 + 3v*2. 27v*2 Expand 0c*4 - 2c*4 + 3c4 + (1 - c3 - 1)(-2 - 2c + 2) + (165 - 40c3 - 165)(3c + 18c - 11c). -397c*4 Expand (3x - 3x - 6x)(2x*4 + 0x + 0x) - 2x*5 + 0x*3 + 0x*3 + 21x*5 + 9 - 9 + (-3 + 3 - 1)(3x5 - 2x*5 - 3x*5). 9x*5 Expand (-2q*3 + 6q*2 - 6q*2)(13q2 - 19q*2 + 7q*2 + 2q + 31). -2q5 - 4q*4 - 62q*3 Expand (-25c*4 + 269c - 269c)((2 + 1 - 1)(2 - 2 - 1) - 6 - 2 + 3). 175c*4 Expand (0 + 2a + 1 - a)(3 - 5 + 7)(-2a + a + 3a). 10a2 + 10a Expand -36 + 36 + 6l5 + (-10l2 - l2 + 6l2)(-l2 + l2 - 5l3). 31l*5 Expand (r - r + 2r)(132r + 98r2 + 24r*2 - 135r). 244r3 - 6r*2 Expand (3 - 3 + 2c)(-2 - 2c + 2)(-389 + 55 + 34). 1200c*2 Expand (6u2 - u2 - 4u2)(-6u - 4u - u) - 2u3 + 3u*3 - 3u*3 + (-2u*2 + 2u*2 - 2u*2)(0u + 0u + u). -15u3 Expand (-76 + 124 - 77)(x + 2x - 5x). 58x Expand 27m*5 + 21m*5 - 34m*5 + 0m5 - m5 + 3m5 + (4m*2 - 2m2 - m2)(2m - 2m - 2m3) + m - m5 - m. 13m5 Expand (9 + 32d*3 - 9)(-4d - 4d + 3d + (-4 + 1 + 1)(3d - 3d + d) - 4d + 4d + 3d). -128d*4 Expand (1 + 6 - 3)(-2n - 5n*2 + 2n). -20n2 Expand (542 - 824 - 560 - 539)(-5z + 3z + 0z)(1 - 5 + 5). 2762z Expand (2m*3 - 5m*4 - 2m*3)(-369 - 81m + 369). 405m*5 Expand (2a*2 + 2 - 2a*2 + 2a + a*2)(4a - 19a + 7a). -8a*3 - 16a*2 - 16a Expand (-381s - 8s*3 + 381s)(-6s - 2 + 4 + 1). 48s4 - 24s*3 Expand 1315 + 8q*5 + 9q*5 - 1315 + (2q*2 - 4q*2 + 0q*2)(-4q + 2q*3 + 4q). 13q5 Expand (17 + 25 - 79)(-2h3 - h3 - 2h*3). 185h*3 Expand (-13 + 6s*2 + 13)(0s + s - 9s). -48s3 Expand ((3 + 3 - 5)(1 + 3 - 3) - 1 + 10 + 0)(6i - 3i - 23i). -200i Expand (w + 0w + 2w)(-17w4 - 285w*3 + 285w3) + w5 - 7w5 + w5. -56w5 Expand (y2 - y2 + y2 - 5y + y2 + 5y + (-4 - 2y + 4)(-y + y - 2y) + 3y*2 - 3y2 - y2)(14y - 5y + 3y)(3y + 23y - 7y). 1140y4 Expand (2284q*2 + 2178q*2 - 28700q + 28700q)(-3q + 6q - 4q). -4462q3 Expand g5 + g3 + g4 - g2 - g4 + 1 + (-268g + 268g - 40g2)(g3 - g3 + 2g3). -79g5 + g3 - g*2 + 1 Expand (-4 - 1 + 7)(4 - 1 - 1)(-5 + 3 + 0)(11b - 11b + 14b) - 2b - 1 + 1. -114b Expand (-2p + 0 + 0)(-2p + 4p + 0p) + p*2 + 0p + 0p + (p + 0p + p)(-2p + 0p + 3p) - 3p + 3p - 2p2 + 13 - 13 - 19p*2. -22p*2 Expand (0k + 7k - 4k)(-16k + 13 - 13)(0k - 3k + 4k). -48k3 Expand (-1 + 2j*3 + 1)(6j - 193j - 5 + 54j - 80j). -426j4 - 10j*3 Expand (-2q + 0 + 0)(4 + 0 + 3 - 4). -6q Expand (-3z + 0z + 2z)(-2z + 5z - z) + (1 + 1 - 1)(292z - 34z2 - 292z). -36z2 Expand (1 + 4 - 4 - 13 - 41 + 18 + (2 - 2 + 2)(-1 + 2 - 3) + 1 + 0 + 2)(-2s*2 + 0s + 0s). 72s*2 Expand (111 - 26m - 111)(-m2 + 4m2 - m2)(4m - 7 + 7). -208	{ "pile_set_name": "DM Mathematics" }
+ (26 - (-34 + 28)) 20 Evaluate -9 + 3 - -6 - 11. -11 Evaluate (-4 - 6) + -2 + 9 + -20 + 8. -15 Calculate 263 + -221 + -62 + 1. -19 0 - 3 - (-164 - -192) -31 Calculate 1 + 5 + 2 + -8 - (12 - -1). -13 Calculate -5 - (-6 - (-3 - 0) - 7). 5 What is the value of 0 + -13 - ((-23 - 22) + 27)? 5 (12 - (-7 + 20)) + -4 -5 What is -9 + 5 + -1 + -9 + 4? -10 What is the value of -1 - 10 - (-16 - (-19 + 8)) - -4? -2 What is -21 + 0 + -22 + (-34 - -68)? -9 What is the value of 28 + (26 - 35) + -29? -10 What is -1 + 22 + (-4 - -9) + (-5 - -1)? 22 Calculate -5 + 7 + -16 + 13. -1 What is 0 + (-1 - 0) + (90 - 85)? 4 Calculate 39 - 54 - (3 - 11) - 9. -16 Calculate -4 + 19 + (6 - 8). 13 Calculate -4 + 5 + 7 + -2 + 8. 14 (-17 - (-36 - -23)) + 31 27 What is the value of 22 + -5 + -22 - 1? -6 15 + (2 - (-38 + 70)) -15 What is 1 - 1 - (6 + (-25 - -9) - 3)? 13 What is -7 - (9 + (-5 - -3) + -28)? 14 Evaluate -23 + 7 - (2 - 11 - 8). 1 Evaluate -1 + 1 - -15 - (-175 + 170) - 3. 17 What is the value of -5 + (0 - 5 - (53 - (55 + -25)))? -33 Evaluate 14 + (8 - 19 - -2). 5 Calculate -5 + 2 + -8 + 19 - 1. 7 What is the value of 154 - 148 - (-2 + 6)? 2 What is the value of 6 + (-5 - 2) + 1 + 8? 8 What is the value of -11 + -8 + 23 + (-20 - -34)? 18 Evaluate -19 + 26 + -26 - -1. -18 What is the value of (7 - (22 + 7)) + 20? -2 What is the value of (9 - 1) + (8 - (28 + -8))? -4 What is the value of -1 + (-3 - -2) + -4 + 3? -3 What is the value of 3 + 0 + 2 + 0? 5 What is the value of 10 + 2 + -65 + 44? -9 What is the value of -13 - -47 - (25 + 0)? 9 What is the value of (1 + -6 - 1) + (52 - 49)? -3 Evaluate 2 - (14 + -2) - (0 + 1). -11 -4 - (-6 - (19 + 0)) 21 What is the value of -14 + (5 + -9 - -9) + -9 + 3? -15 What is the value of -32 - (-10 - 2) - -10? -10 Evaluate 32 - 45 - (0 - (-2 - -2)). -13 Evaluate 18 + (-19 - 19) + 7. -13 Evaluate 7 - (-11 - (3 + -13)) - (-2 + 13). -3 0 + (-15 - (-9 + 1 - -11 - -3)) -21 What is 2 + 2 + 22 + -25 - 2 - 7? -8 Calculate -2 - (-3 + (-45 - (-15 + (-8 - -18)))). 41 26 - (0 - (-1 - 0)) - (-15204 + 15198) 31 Evaluate -6 - (-5 + -2 + 6) - 3. -8 Evaluate -5 + (2 - 1 - -4) + 5 + -1. 4 What is the value of (-35 - -64) + (0 - (1 - -1 - 8))? 35 What is 12 - 3 - ((6 - 1) + 1)? 3 -2 - (0 - 2) - (-7 - (-8 + -7)) -8 What is 12 - (-11 + (0 - -36))? -13 Calculate (-13 + 7 - 16) + 8. -14 What is the value of -8 - ((-12 - 0) + -10)? 14 Evaluate -5 + 7 - 0 - 13. -11 What is the value of 2 + 13 + -9 - (10 + (-4 - 0))? 0 Evaluate (0 - -10) + (6 - (17 - 4)). 3 ((8 - 16) + 8 - (0 + 29)) + -6 -35 What is -10 - ((-62 - -62) + -1 + 3)? -12 24 + -5 + -10 + (-1 - -16) 24 Evaluate 64 + (-63 - -45) - 14. 32 Evaluate (-19 - (0 + -6)) + 0 + 35. 22 14 - ((7 - -4) + 5) -2 Calculate 10 + -7 + 1 + (-1 - -1) - 3. 1 What is the value of 1 - -4 - (8 - (-8 + 4 - -9))? 2 Evaluate (-12 - (-13 - -1) - (-13 + 0)) + 0. 13 6 - 1 - (-6 - 0) 11 What is the value of 1 - (-29 + -12 + 24 - 5)? 23 What is the value of -7 - (11 + (0 - (-3 + 7 + 1)))? -13 What is -2 + 18 + (-29 - -4)? -9 What is 4 + (-8 - ((-1 - (-5 + 10)) + -2))? 4 Calculate 5 + 0 + 8 + (12 - 28). -3 Evaluate -2 - ((-20 - -82) + -27). -37 What is -15 + 23 + -19 + 11? 0 Evaluate (-3 - (7 + -14)) + -13 + 7. -2 -18 + -3 + 3 + -6 + 5 -19 Evaluate -10 + (25 + -30 - (-2 - 0)). -13 What is 1 - (7 + (2 - (6 + -8)))? -10 151 - 132 - (-3 - (-6 + 1 + -1)) 16 What is (-11 + 3 - (2 + -10)) + -9 + 3? -6 What is (2 - (15 - 1) - -6) + -12? -18 (13 - 18 - 2) + 2 -5 What is 8 + (-4 - -5) + -2 + -19? -12 Calculate -314 + 302 + (1 - 1 - 1). -13 Evaluate 832 + -819 - ((0 - -2) + 1). 10 (-2 + 9 - (0 - -7)) + 9 + -2 7 -287 - -269 - (1 + 5 - (-5 - -5)) -24 Evaluate (19 - 20 - -30) + (1 - 10). 20 Calculate 13 - (-15 + -15 + 72). -29 4 - (8 - (-6 + (5 - (-2 + -9)))) 6 What is -11 + (8 - 11) + -1? -15 What is the value of -5 - ((-2 - 6) + 2 - -8 - -1)? -8 What is the value of -8 + (2 - (7 + -22 + 5))? 4 Evaluate -27 - (18 + -20) - -21. -4 What is the value of (-21 - -1) + -1929 + 1930? -19 Calculate 112 - 126 - (-6 + -29). 21 Evaluate 1 - (3 + -6 - -11 - 4). -3 Calculate 1 - ((-100 - -100) + -6 + -1 + -12). 20 Calculate 13 - (4 + -3 + 23). -11 Evaluate 10 + (-38 - -14) + 1. -13 Evaluate (15 - 0 - 0) + (33 - 31) - 0. 17 What is (-25 - -10) + 1 + 17 - -6? 9 (7 - -1) + 2 + -1 + -25 -16 Evaluate (-3 - 11) + 8 - (-6 + 4 + -1). -3 What is the value of (-47 - (6 - (-10 + 27))) + 12 + 8? -16 Calculate 10 + -17 - (-60 - -59). -6 What is the value of (27 + -1 - 0) + (-47 - 1 - -48)? 26 What is the value of -1 - (-2 + -10) - (7 - 1)? 5 -7 - -2 - ((-26 - -8) + 15) -2 What is -5 - 0 - (47 + -49 + 3 + 1)? -7 Calculate -6 + 42 + -41 - 3. -8 Evaluate 6 + (21 + -5 + -8 - 33) + -6. -25 What is 18 + 7 + -17 - 20? -12 Calculate 6 + -4 - 2 - (135 - 140). 5 What is the value of -2 - (0 - -4) - ((7 - 10) + 7)? -10 Evaluate (-12 + 4 + 2 - -1) + 3. -2 What is the value of (-57 - -36) + 3 + 10? -8 What is -11 + -68 + 76 + 3 + -1? -1 What is the value of (6 - 2) + -5 + 4 + -8? -5 What is -6 + 5 + 10 + -3 + -9? -3 What is (0 - 2) + (-20 - -31 - 27)? -18 What is the value of -4 + (-10 - (-25 + 36))? -25 -12 + 1 + (-5 - (-23 + 7 + 14)) -14 Evaluate (-32 - (-9 + -13) - (-2 - 3)) + 18. 13 1 + -4 + 6 - -8 - 1 10 What is -25 - ((-25 - -8) + -21)? 13 (-1 - (5 - -4) - 0) + -7 -17 What is (26 - -3 - 65) + 54? 18 Calculate 27 + (-31 - 3) - (-16 + -3 + 2). 10 Evaluate -151 + 157 + (-18 - (-3 + 2 + 2)). -13 Calculate (-7 - (-9 + 1)) + -3. -2 What is the value of -37 + 16 + -13 + 20? -14 8 - (26 - -7 - 33) 8 What is the value of 5 + (-19 - -28) + (-6 - -2 - -5)? 15 What is 22 - (-4 + (1 - (-7 - 4)))? 14 Calculate (41 - 29) + 1 + 2 + 5. 20 What is (-3 - 9) + -84 + 98 + -28? -26 Calculate -49 + 23 + 4 + 3. -19 Evaluate -37 + 38 + 5 + -4 + 4. 6 Evaluate (-5 + -2 - (38 - 36)) + 34. 25 Evaluate -10 - 0 - (11 - (-51 + 54)). -18 Evaluate 0 + (3 - (-1 - 11)) + 1. 16 What is the value of -4 + (14 - (14 + -4))? 0 What is the value of 2 + -4 + 27 + -20 + 20 + -4? 21 Calculate (-1302 - -1292) + -2 + 26 + 0. 14 Evaluate (-25 - 13 - -20) + -1 + -5. -24 What is the value of (20 - 1) + -20 - 6? -7 11 - (-11 + (7 - -16)) -1 Calculate -5 + -1 + (-48 - -55). 1 Evaluate -1 + 3 + (-5 - 1) + 65 + -67. -6 Evaluate -37 - ((-62 - -9) + 38). -22 -7 - ((6 - 9) + (9 - (6 - -4))) -3 (351 - 363) + (-1 - -1) + 11 -1 What is -7 + (1 + -2 - (16 - 20))? -4 Evaluate (2 + (-6 - (-12 + 3)) - -8) + -5. 8 What is 9 + (-9 - -4) - (-2 + 22 - 7)? -9 Evaluate 29 - (41 + 3 - 16). 1 Evaluate 3 + 4 + -2 - (-83 - -80). 8 What is the value of 10 - 15 - 4 - (-1 - 6) - 20? -22 Evaluate -1 + 2 + (9 - 11) + -12 + 6. -7 Evaluate 10 - (11 + -6) - (2 - (4 + 14)). 21 What is 8 + (-10 - (-14 + 4)) - 28? -20 Evaluate (-9 + 18 - (24 + -6)) + 3. -6 What is the value of 449 + -447 + 0 + (-13 - 0)? -11 -182 + 189 - (-9 - 1) 17 Calculate 87 + -65 + (-16 - 0). 6 What is the value of 7 + (-3 - -1) + -3? 2 What is 8 + -8 + 0 - -10 - 4? 6 -16 + 7 + -3 + -2 - (-7 + 5) -12 What is the value of 20 - ((23 - 8 - 28) + 9)? 24 What is 13 + -1 + (-9 - -5 - -2)? 10 What is the value of 26 + -85 + (40 - 0)? -19 Calculate 36 + -2 + 3 + -10 + -1 + 8. 34 What is -4 + 21 - (-10 + 27)? 0 (0 - (11 + -18)) + -14 + -20 - -3 -24 Calculate -8 + 22 + (9 - 26). -3 Calculate 145 + -127 - (-3 + 1 + 5). 15 Evaluate 8 - (38 + -74 - -23). 21 Evaluate (3 - 3) + (7 - (2 - -1)). 4 Calculate -39 - (0 + 3 + -29). -13 -23 + 40 + -4 + (-4 - 3) 6 What is (-9 - ((-15 - -21) + -28)) + -24? -11 What is 13 + -2 - ((-4 - -3) + (-5 - -14))? 3 Calculate -12 + (-1 - ((3 - 11) + 2)). -7 Evaluate 10 + -6 + -1 + -5 - 3 - -4. -1 What is (-21 - -31) + (21 - 11)? 20 2 + 0 + -9 - (-7 - (49 + -33)) 16 -13 - (-2 - 12) - (-2 - -3) 0 (1 - 7 - (91 + -96)) + -8 -9 Evaluate -100 + 103 + (16 - 0). 19 What is the value of -7 + (9 - 11) + (5 - -1)? -3 What is the value of (1 + 1 - -4) + (-7 + 11 - 8)? 2 What is -7 - (8 + 1 - (-17 - -18))? -15 Calculate -5 + (-23 - -20 - ((8 - 6) + 2)). -12 Evaluate -43 + 35 + 23 - (-3 + 1). 17 3 - (-4 - (-1 - -14)) 20 What is the value of -580 + 551 + (26 - -2)? -1 -35 + -22 + (21 - -17) -19 What is the value of 11 + -15 - (-7 - 0) - -1? 4 Calculate 9 - 56 - (91 + -120). -18 Calculate (1 - 4) + -2 + (3 - -2 - -3). 3 What is the value of -29 - (11 + (-3 + 5 - 25))? -17 What is th	{ "pile_set_name": "DM Mathematics" }
mplify -5-64(((sqrt(891) + -3)-3)*2 + 4 + (sqrt(891)2)*2). -58320sqrt(11) + 1400160 Simplify (-5(0 + 1 + 0 + sqrt(252) + 1 + 0 + 1 + (2sqrt(252) - sqrt(252) - sqrt(252)) + ((sqrt(252) - (sqrt(252) + 1)) + sqrt(252))2))2. 900sqrt(7) + 56725 Simplify (-1 + -2(sqrt(405) + 0 + 0 + -3) + -5(sqrt(405)1 + -5)5)*2. -63180sqrt(5) + 312145 Simplify (-2(5 + -2-6sqrt(684) - (-1sqrt(209)1)/(1sqrt(66)/sqrt(6))))*2. 2920sqrt(19) + 405104 Simplify (4 + 2sqrt(128) + 2 + (sqrt(128)-1 - sqrt(128)) + (sqrt(128) + 1 + -3 + (sqrt(128) - 42sqrt(128)))-2)2. 1920sqrt(2) + 18532 Simplify (-1sqrt(98) + sqrt(98))-1 + 1 - (sqrt(98)2 + 3 + 6sqrt(98)-2). -2 + 70sqrt(2) Simplify -2(-1 + 3 + ((-1 + sqrt(180))-4 + sqrt(180) - (-5 + -2sqrt(180) + sqrt(180))))2-1. -528sqrt(5) + 1682 Simplify (3(-3 + (6(sqrt(102) + sqrt(102)2)2)/(sqrt(30)/(5sqrt(10)/sqrt(2))))5)2. -243000sqrt(17) + 123932025 Simplify ((sqrt(171)3)2 + (sqrt(19) - (-2 + sqrt(304) + sqrt(19)))2)1 - -2((6(sqrt(228)-5 - sqrt(228)) - sqrt(228))/sqrt(12))2. -16sqrt(19) + 53869 Simplify ((-4(-4 + sqrt(171)-2 - 3sqrt(171)-2) + 3)-6)2. -65664sqrt(19) + 1588932 Simplify ((4 + (sqrt(704) - (0 + sqrt(704) + sqrt(704) - sqrt(704))))*2 - -6(sqrt(704)-1)2) + -4 - 3(sqrt(1980) + -2sqrt(1980))/(sqrt(45)6). sqrt(11) + 4236 Simplify ((sqrt(180) - (-6sqrt(180)-2 + sqrt(180)))/sqrt(5)-1)/((sqrt(84) + -3(-1sqrt(84) + sqrt(84)))/(sqrt(21)/sqrt(75))). 12sqrt(3)/5 Simplify (sqrt(204)/sqrt(3) - (sqrt(17) - (sqrt(17) - (2 + sqrt(612) + sqrt(17)))*2 - sqrt(17)))5 - (((sqrt(833)-3 + sqrt(833))5 - sqrt(833)) + 0). 207sqrt(17) + 3080 Simplify (0 + 2 + 1sqrt(275) + sqrt(275))*22-2 + -4 + 4. -4416 - 160sqrt(11) Simplify 5 + -4 + 1((-1 + sqrt(396))-4 + 4)*2 + -4. -384sqrt(11) + 6397 Simplify (5-4sqrt(252)-2 - (sqrt(35)/sqrt(5) + 1 + sqrt(7) + sqrt(42)/sqrt(6) + 3))2 + -2. -1896sqrt(7) + 393197 Simplify (-5 + (-2 + -3(sqrt(242) + 2))2 + 3 + (22sqrt(242))2)-4. -24448 - 2112sqrt(2) Simplify -4(2 + -1sqrt(242)-2 + -4)1 + 1. -88sqrt(2) + 9 Simplify ((sqrt(550)-1-3)/(-5(sqrt(10) + (-1sqrt(10) - sqrt(10)))))/((sqrt(605) + (sqrt(605) + -1sqrt(605))-6)6). sqrt(11)/110 Simplify -4 + (-3 + (2 + 1 + (sqrt(448) - sqrt(448)-1)6)2)*2. 1152sqrt(7) + 258053 Simplify (sqrt(1088)1-5 + 0 + 1sqrt(1088) + 0)2 - ((sqrt(1088) - (sqrt(1088) - sqrt(1088)1-6 - sqrt(1088))) + (-3sqrt(1088)-6)2). -335104 + 40sqrt(17) Simplify ((2 + (sqrt(3) - sqrt(48)))-6 - (sqrt(132)/sqrt(11) + (sqrt(6)/sqrt(2) - sqrt(3))2))*2 + 5 + -6(sqrt(144)/sqrt(3)5)2. -6283 - 384sqrt(3) Simplify -4 + (3 + (5((sqrt(792)2 - sqrt(792) - sqrt(792)) + sqrt(792) + sqrt(792)))/(sqrt(22)/(sqrt(2)-1)6))*2 + 1. -60sqrt(2) + 206 Simplify (3(3 + 2 + sqrt(1331)))2 - (0 + (0 + sqrt(1584))6)*2. -44820 + 990sqrt(11) Simplify -2-5((sqrt(76) - (sqrt(76)2 - sqrt(76))-2)5)/((sqrt(4) - (sqrt(4) - (sqrt(4) - sqrt(100))-4))-4) + -2. -75sqrt(19)/32 - 2 Simplify -2(3(-1sqrt(18) - sqrt(18)))/(5sqrt(36)/sqrt(4)) + -5 + (sqrt(72)/(sqrt(12)/sqrt(3)))/(sqrt(576) + (sqrt(576) - 1sqrt(576)) + sqrt(576)). -5 + 197sqrt(2)/80 Simplify 3(5 + (6sqrt(1344)-3 + sqrt(1344))/(sqrt(36)/(sqrt(36)/(sqrt(3) - sqrt(243))))). 15 + 51sqrt(7) Simplify (sqrt(729) + -2sqrt(729))/(-1sqrt(243) + sqrt(3)) + (1 + (sqrt(3) - -3sqrt(3)) - (4 + sqrt(300))). -39sqrt(3)/8 - 3 Simplify 3 + (1sqrt(156)6 + -5(sqrt(156)-2 + sqrt(156)))/(2sqrt(300) + 1sqrt(3)-3). 3 + 22sqrt(13)/17 Simplify ((-336sqrt(2754))/(sqrt(98) - 1sqrt(98) - (sqrt(2) - (sqrt(8) + sqrt(48)/sqrt(6))/sqrt(4))))2. 4015332 Simplify -4 + (sqrt(72))2-6 + 1 + (3(sqrt(198) - 1sqrt(198)))/(sqrt(33)/sqrt(3)2). -435 Simplify ((-3sqrt(117) - sqrt(117) - sqrt(117))342)/(sqrt(144)2 + sqrt(576)1). -15sqrt(13)/2 Simplify -4(((sqrt(117) + sqrt(117)1 + sqrt(117))6)/((sqrt(81)2)/sqrt(9)) + 0 + -1(sqrt(52) + -1)). -28sqrt(13) - 4 Simplify ((54(sqrt(66) + 2sqrt(66))-4)/(sqrt(486) + ((sqrt(486) + -2sqrt(486))-1 - sqrt(486)) - (sqrt(486) + (sqrt(486) + 1sqrt(486))4)))2. 1100/9 Simplify ((sqrt(156)-1 + sqrt(156))5 - (-4sqrt(156) - sqrt(156))6)/((sqrt(60) - (sqrt(8640) + -2sqrt(8640)))/sqrt(5)-1). -30sqrt(13)/13 Simplify ((3 + sqrt(1573) + 0 + -4)5 - 2(3 + 1 + sqrt(1573) + -1))*2. -726sqrt(13) + 14278 Simplify -3(-1 + (-1 + 2 + -5(-4 + 2sqrt(108) - (sqrt(108) + sqrt(108)3 + sqrt(108))4))2). -2625720 - 68040sqrt(3) Simplify sqrt(572)/(sqrt(11) + sqrt(77)/sqrt(7)) + sqrt(156)/sqrt(48) + ((((sqrt(468) - (3 + sqrt(468))) + sqrt(468))2)2 - (sqrt(468) + sqrt(468) + 2 + -4)). -309sqrt(13)/2 + 1910 Simplify 5 + -2 + -1 + (-5(sqrt(325) + sqrt(325) + -2sqrt(325) + sqrt(325) + 1)3)2. 2250sqrt(13) + 73352 Simplify (sqrt(130)2141)/((sqrt(800)/sqrt(5) + (2sqrt(640) - sqrt(640)))-6). -sqrt(13)/9 Simplify (-5(sqrt(160) + sqrt(160)1)1)/((-1(sqrt(32) - sqrt(32)2))/(sqrt(4) - (sqrt(256)-1 - sqrt(4)))) + 5. -200sqrt(5) + 5 Simplify 2(1-1sqrt(130)-4)/(sqrt(400)/(sqrt(30)/sqrt(3))). 4sqrt(13) Simplify (-6(5 + -4(sqrt(1573) - ((sqrt(1573) + 2 - sqrt(1573)) + -3)) + -1(-3sqrt(1573) - sqrt(1573)) + 3))*2. 576 Simplify 3 + ((sqrt(7) - sqrt(63)-2) + sqrt(7))*2 + sqrt(175)-1 + ((sqrt(154)/sqrt(99) - sqrt(14)) + sqrt(14))/(sqrt(128)1 + sqrt(128)). -239sqrt(7)/48 + 451 Simplify (-1(sqrt(192) + 0 + 2 + 1(sqrt(192) + -1) + 4 + (3sqrt(192) + -5 - sqrt(192))))2. 3072 Simplify ((-2 + -4 + sqrt(50) + 1)4 + -3(sqrt(18) + sqrt(72)/sqrt(4) + 5 + -4))2. -92sqrt(2) + 537 Simplify 2 + (5 + -1((sqrt(1216) + sqrt(1216)-5 + -1 - sqrt(1216)) + sqrt(1216) + (sqrt(1216) - (2 + (sqrt(1216) - 1sqrt(1216)))))-3)*2. 576sqrt(19) + 98514 Simplify 3((sqrt(832) - -2sqrt(832)) + (sqrt(13) - (sqrt(13) - sqrt(91)/sqrt(7)))4 + (sqrt(1872) + -1)6-5)2. -59760sqrt(13) + 4301436 Simplify (-3(sqrt(176) + sqrt(176) + -1sqrt(176) + 4)2)2 - 5(sqrt(11) + 2sqrt(1100) - ((sqrt(77)-1)/sqrt(7))*2). 1047sqrt(11) + 6967 Simplify (-1 + (56(sqrt(612) + -2) + (sqrt(612) - (sqrt(612)1 + -1)) + (sqrt(612) - (1 + sqrt(612) + -1)))-4)*2. -338400sqrt(17) + 8868025 Simplify (5 + ((-5(sqrt(270) - sqrt(270)-2))/(sqrt(120)/(sqrt(36)/sqrt(3)))1-5)*2)-5. -759400 Simplify -2 + (1 + sqrt(125) + sqrt(125) - sqrt(125)) + ((sqrt(125)-25)*2 - sqrt(125)) + 4 + ((0 + sqrt(80))-3)*2. 13223 Simplify 1(5 + 1 + -6(-2(sqrt(539) - (sqrt(539) - ((1 + sqrt(539) - sqrt(539)) + sqrt(539) - sqrt(539)))) + 0 + sqrt(539) + 0 + sqrt(539)))-5. -90 + 420sqrt(11) Simplify (((2(-2 + sqrt(245)) - sqrt(245))2 - (sqrt(245) + 0)26) + 0)3 + -3. -3630 - 168sqrt(5) Simplify (-1(5-1sqrt(5) + -3(1 + sqrt(5))))2 - (sqrt(20) + (sqrt(20) - (sqrt(2420) + 1 - sqrt(2420))) + (sqrt(500))2 + -5). -165 + 44sqrt(5) Simplify (-4 + (3 + (sqrt(612) + -1)2 + sqrt(612))6 + -3((4 + sqrt(612)2 + sqrt(612))2 - ((sqrt(612) + -1 - sqrt(612)) + -1)2))-6. 2808sqrt(17) + 77208 Simplify 5(0 + ((sqrt(416) - (sqrt(416) + -1sqrt(416))2)/sqrt(8))/(sqrt(36)/(sqrt(9) - sqrt(81))5))*2. 52/5 Simplify (sqrt(2662)-1 - sqrt(2662))/(-2sqrt(162)) + (3 + (sqrt(704) - (sqrt(704)5)*2) + sqrt(704))4. -70388 + 587sqrt(11)/9 Simplify (2(2sqrt(1573) - sqrt(1573)) + 2sqrt(1573) + -3 + -3 + sqrt(1300) + ((-1sqrt(156))/sqrt(12))2)5. 35 + 270sqrt(13) Simplify (6(-4 + sqrt(448) + -4))2 + (sqrt(448) + sqrt(448) + 4 + sqrt(448) + sqrt(448) + 4 + 4)2 + -2. -3840sqrt(7) + 25742 Simplify sqrt(200)/(sqrt(10) + sqrt(80)/(-2sqrt(8)) + sqrt(10))2 + ((sqrt(20) - -3sqrt(2420)) + (sqrt(180) - sqrt(180)2) + sqrt(180))2. 8sqrt(5)/3 + 23120 Simplify (-5(sqrt(91)-3 - sqrt(91)) + (sqrt(91) - sqrt(91)4)4)/(sqrt(56)/sqrt(8)3 + 1sqrt(63)). 4sqrt(13)/3 Simplify ((-1(sqrt(420)1 + sqrt(420)))/(sqrt(12) - 3sqrt(60)/sqrt(5)))/(-5(sqrt(15)3)/sqrt(3)1). -sqrt(7)/15 Simplify -2 + sqrt(153)/(sqrt(81)-1) + (sqrt(17) + 3sqrt(833))5. -2 + 329sqrt(17)/3 Simplify (3 + (sqrt(80) - (sqrt(80) + 0))3)*2 + (sqrt(1500) + (sqrt(1500) - sqrt(1500)-2) + sqrt(15))/(1sqrt(243)). 9 + 41sqrt(5)/9 Simplify -5 + -4 + (6(-1 + sqrt(208)) + sqrt(208) + -1 - (-1 + (sqrt(208) - -1(sqrt(208) + -1)) + sqrt(208)))**	{ "pile_set_name": "DM Mathematics" }
d + 356 What is the w'th term of -1418031, -1418034, -1418037, -1418040, -1418043, -1418046? -3w - 1418028 What is the m'th term of 1175760, 4703052, 10581872, 18812220, 29394096, 42327500? 1175764m*2 - 4 What is the p'th term of 138595, 277185, 415801, 554455, 693159, 831925, 970765, 1109691? 2p3 + p2 + 138573p + 19 What is the p'th term of -175636, -175631, -175626? 5p - 175641 What is the k'th term of -4239763, -4239762, -4239759, -4239754, -4239747? k*2 - 2k - 4239762 What is the m'th term of -4229, -8510, -12761, -16982, -21173? 15m2 - 4326m + 82 What is the f'th term of 7648, 31224, 70722, 126136, 197460? -f*3 + 7967f*2 - 318f What is the x'th term of 915, 3983, 9093, 16245, 25439, 36675, 49953? 1021x2 + 5x - 111 What is the h'th term of 37641, 301105, 1016215, 2408793, 4704661, 8129641, 12909555? 37637h3 + h2 + 2h + 1 What is the d'th term of -4089, -15771, -35241, -62499, -97545, -140379? -3894d2 - 195 What is the r'th term of 4398808, 8797551, 13196294, 17595037? 4398743r + 65 What is the d'th term of -139206, -274813, -410434, -546075, -681742, -817441, -953178? -d3 - d2 - 135597d - 3607 What is the b'th term of 1608, 3307, 5128, 7131, 9376, 11923, 14832, 18163? 10b3 + b2 + 1626b - 29 What is the s'th term of -9731, -19500, -29253, -38984, -48687, -58356? s3 + 2s*2 - 9782s + 48 What is the v'th term of 6713, 6751, 6779, 6791, 6781, 6743? -v3 + v2 + 42v + 6671 What is the d'th term of 134264, 268515, 402762, 537005, 671244, 805479, 939710? -2d*2 + 134257d + 9 What is the m'th term of -95740, -382970, -861686, -1531888, -2393576? -95743m2 - m + 4 What is the q'th term of 1936, -2051, -8718, -18059, -30068? q3 - 1346q*2 + 44q + 3237 What is the g'th term of 9963000, 19925998, 29888996, 39851994? 9962998g + 2 What is the n'th term of -83839, -167393, -250947, -334501, -418055? -83554n - 285 What is the i'th term of -141667927, -141667925, -141667923, -141667921? 2i - 141667929 What is the c'th term of 1166180, 1166186, 1166192, 1166198, 1166204? 6c + 1166174 What is the h'th term of 3588, 14525, 32798, 58407, 91352, 131633, 179250? 3668h2 - 67h - 13 What is the q'th term of 1836, 1794, 1702, 1560? -25q2 + 33q + 1828 What is the j'th term of 39462, 39567, 39748, 40011, 40362? j*3 + 32j*2 + 2j + 39427 What is the v'th term of -6773, -6752, -6731, -6710? 21v - 6794 What is the n'th term of -228264047, -456528098, -684792161, -913056242, -1141320347, -1369584482, -1597848653? -n3 - 228264044n - 2 What is the z'th term of 276068, 276543, 277018, 277493, 277968? 475z + 275593 What is the r'th term of 3736, 29805, 100586, 238429, 465684, 804701, 1277830, 1907421? 3725r*3 + 6r*2 - 24r + 29 What is the d'th term of 1704124, 1704142, 1704158, 1704172, 1704184? -d*2 + 21d + 1704104 What is the d'th term of 145, 478, 1055, 1894, 3013? 3d3 + 104d*2 + 38 What is the y'th term of -81560, -82481, -83402, -84323, -85244, -86165? -921y - 80639 What is the f'th term of 1101468, 4405866, 9913198, 17623464? 1101467f2 - 3f + 4 What is the j'th term of -10772, -43081, -96920, -172283, -269164, -387557, -527456? j*3 - 10771j*2 - 3j + 1 What is the u'th term of -427465, -427450, -427417, -427360, -427273, -427150, -426985? u*3 + 3u*2 - u - 427468 What is the b'th term of 1960112, 7840372, 17640804, 31361408, 49002184, 70563132, 96044252? 1960086b*2 + 2b + 24 What is the v'th term of 17924, 34829, 51736, 68645, 85556? v*2 + 16902v + 1021 What is the g'th term of 178223, 712872, 1603961, 2851496, 4455483, 6415928, 8732837? g*3 + 178214g2 + 8 What is the s'th term of 491, 1801, 4031, 7187, 11275, 16301? s3 + 454s2 - 59s + 95 What is the h'th term of -1387954, -2775907, -4163860? -1387953h - 1 What is the t'th term of 57627, 461487, 1557815, 3692847, 7212819, 12463967, 19792527, 29544735? 57706t*3 - 2t*2 - 76t - 1 What is the m'th term of 125056, 125101, 125144, 125185, 125224, 125261? -m*2 + 48m + 125009 What is the r'th term of -2845, -2829, -2793, -2725, -2613, -2445, -2209? 2r3 - 2r*2 + 8r - 2853 What is the h'th term of -16753, -21282, -25811, -30340, -34869? -4529h - 12224 What is the w'th term of 994, 777, 402, -125, -798, -1611? w3 - 85w*2 + 31w + 1047 What is the p'th term of 7867, 7788, 7771, 7846, 8043? 5p3 + p2 - 117p + 7978 What is the h'th term of -6512, -13057, -19636, -26249, -32896, -39577? -17h2 - 6494h - 1 What is the p'th term of -1133265, -1133281, -1133297, -1133313? -16p - 1133249 What is the g'th term of -2070, -3575, -5080, -6585, -8090, -9595? -1505g - 565 What is the g'th term of 767096, 767102, 767108, 767114? 6g + 767090 What is the z'th term of 453, 756, 861, 774, 501? z3 - 105z*2 + 611z - 54 What is the p'th term of 84137, 84046, 83955, 83864? -91p + 84228 What is the s'th term of 63461, 125864, 188267, 250670? 62403s + 1058 What is the a'th term of -177671, -177665, -177655, -177641, -177623, -177601? 2a2 - 177673 What is the f'th term of -10007, -19924, -29773, -39554, -49267, -58912, -68489? 34f*2 - 10019f - 22 What is the l'th term of -6056, -11941, -17826, -23711? -5885l - 171 What is the c'th term of 26860, 26682, 26384, 25966, 25428? -60c*2 + 2c + 26918 What is the o'th term of -49687, -48791, -47895, -46999, -46103? 896o - 50583 What is the q'th term of -5629, -22755, -51295, -91243, -142593? q3 - 5713q*2 + 6q + 77 What is the k'th term of 2357148, 2357147, 2357148, 2357151? k*2 - 4k + 2357151 What is the r'th term of 3867574, 15470317, 34808216, 61881265, 96689458, 139232789, 189511252? -r*3 + 3867584r*2 - 2r - 7 What is the z'th term of 606422, 4851062, 16372226, 38808176, 75797174, 130977482, 207987362? 606377z3 + z + 44 What is the j'th term of 40553, 40531, 40501, 40463, 40417, 40363? -4j*2 - 10j + 40567 What is the p'th term of 2583, 10442, 23537, 41868, 65435, 94238? 2618p2 + 5p - 40 What is the y'th term of -272637, -272641, -272645, -272649, -272653, -272657? -4y - 272633 What is the t'th term of -12562129, -12562123, -12562117, -12562111, -12562105? 6t - 12562135 What is the q'th term of 71469358, 71469348, 71469338, 71469328? -10q + 71469368 What is the n'th term of 8664, 8587, 8452, 8253, 7984? -n3 - 23n*2 - n + 8689 What is the d'th term of -1506265, -1506224, -1506183, -1506142? 41d - 1506306 What is the q'th term of -32148, -30078, -28008, -25938, -23868, -21798? 2070q - 34218 What is the u'th term of -4082364, -4082717, -4083070? -353u - 4082011 What is the m'th term of 4253176, 4253174, 4253172? -2m + 4253178 What is the q'th term of -256, -600, -974, -1396, -1884, -2456, -3130? -3q*3 + 3q*2 - 332q + 76 What is the c'th term of -13927, -22235, -30543, -38851? -8308c - 5619 What is the k'th term of 810, 1079, 1478, 2073, 2930, 4115, 5694, 7733? 11k3 - k2 + 195k + 605 What is the k'th term of 534098, 1066683, 1599268, 2131853, 2664438, 3197023? 532585k + 1513 What is the b'th term of 16300, 16624, 16988, 17398, 17860, 18380, 18964, 19618? b*3 + 14b*2 + 275b + 16010 What is the c'th term of 1617607, 1617606, 1617605, 1617604? -c + 1617608 What is the y'th term of -944983, -1890158, -2835333, -3780508, -4725683, -5670858? -945175y + 192 What is the q'th term of -3457, -3383, -3335, -3325, -3365, -3467, -3643, -3905? -2q3 - q2 + 91q - 3545 What is the h'th term of -19810, -39125, -58440, -77755, -97070? -19315h - 495 What is the m'th term of 185, 971, 2657, 5555, 9977, 16235? 52m3 + 138m*2 + 8m - 13 What is the g'th term of -25112, -24971, -24758, -24491, -24188, -23867, -23546? -3g3 + 54g*2 - 25163 What is the b'th term of 12297, 21069, 29841, 38613, 47385? 8772b + 3525 What is the b'th term of -50514, -50301, -50088, -49875, -49662? 213b - 50727 What is the b'th term of -4217908, -16871618, -37961134, -67486456, -105447584, -151844518, -206677258? -4217903b*2 - b - 4 What is the t'th term of 466770, 466744, 466718? -26t + 466796 What is the b'th term of 280197, 280086, 279975? -111b + 280308 What is the q'th term of 551, 1674, 2831, 4022, 5247, 6506, 7799? 17q*2 + 1072q - 538 What is the b'th term of -501, -1843, -3983, -6927, -10681, -15251, -20643, -26863?	{ "pile_set_name": "DM Mathematics" }
0f3 - 5f + 1/18f4 + 0f*2 - 1/15f*5 + 1/45f*6. What is w in k(w) = 0? 0, 1 Let z be (-41/6)/(3/(-9)). Let r(w) be the first derivative of -1/9w3 + 0w - z + 1/6w2. Suppose r(n) = 0. What is n? 0, 1 Let s(j) be the third derivative of j7/280 - 9j*6/320 + 7j*5/80 - 9j4/64 + j3/8 + 8j2. Determine n, given that s(n) = 0. 1/2, 1, 2 Let y(u) = -6u*3 - 2u*2. Suppose -d - 4k + 3 = 0, k = -k + 2. Let r(h) = -h*3. Let p(z) = dy(z) + 4r(z). Solve p(x) = 0. -1, 0 Let c = 1 - 7. Let n be 2 - -1(c - -4). Factor 1/6d + 1/6d*2 + n. d(d + 1)/6 Suppose 0 = q - 3q - 8. Let y = 0 - q. Suppose 1/4v + 0 - 1/2v3 + 0v*y + 0v*2 + 1/4v5 = 0. Calculate v. -1, 0, 1 Let y(m) be the third derivative of m5/60 - m*4/2 + 8m*2. Let n be y(12). Let 7/3f*5 - 3f*3 + 2/3f + n - 5/3f4 + 5/3f*2 = 0. What is f? -1, -2/7, 0, 1 Suppose 4j + 3v + 6 = 3, 0 = -5j - 3v. Let n(u) be the third derivative of 1/420u*6 + 0 + 1/42u*4 + 0u + 0uj - 1/70u*5 + 2u*2. Factor n(r). 2r(r - 2)(r - 1)/7 Let a be (5/2)/(1/6). Suppose 0i + 3i = a. Suppose -2n + 4n - 1 + 2ni - 1 - 4n*3 - 2n*4 + 4n*2 = 0. What is n? -1, 1 Let k(i) be the first derivative of -2i3/9 + i2/3 - 36. What is p in k(p) = 0? 0, 1 Let d(n) be the third derivative of 1/16n8 + 0 + 23/70n*7 + 27/40n*6 + 13/20n*5 + 0n - 6n2 + 1/4n*4 + 0n*3. Solve d(j) = 0 for j. -1, -2/7, 0 Let z = -175/4 + 44. Factor 0 + zj - 1/4j2. -j(j - 1)/4 Let m = -86/3 + 29. Let x(t) be the first derivative of 2t + 4/3t*3 - mt*6 - 6/5t5 - 1 - t4 + 3t2. Determine s, given that x(s) = 0. -1, 1 Let a(r) be the first derivative of -2r*3/21 + 2r*2/7 - 5. Factor a(d). -2d(d - 2)/7 Let g(d) be the first derivative of -d6/8 + 9d*5/10 - 39d*4/16 + 3d*3 - 3d*2/2 - 21. Let g(a) = 0. Calculate a. 0, 1, 2 Factor -2 + 1/2z*2 + 3/2z. (z - 1)(z + 4)/2 Determine z, given that 23z*3 + 1 + z - 24z*3 - 5z*2 + 4z*2 = 0. -1, 1 Let b(v) be the first derivative of -2v3/21 - 30. Determine m so that b(m) = 0. 0 Suppose a3 + 3a3 - a3 - 3a*2 = 0. Calculate a. 0, 1 Let c = -14 - -16. Factor 2/7o*c + 0 - 4/7o. 2o(o - 2)/7 Let k(q) be the first derivative of q6/900 - q5/300 - q*3 + 6. Let u(b) be the third derivative of k(b). Find h such that u(h) = 0. 0, 1 Suppose -2x = -6x + 8. Let q(l) be the first derivative of 0l*3 + 0l*5 + 1/4l*4 - 1/12l*6 + 0l - 1/4lx + 3. Factor q(g). -g(g - 1)*2(g + 1)*2/2 Let o(t) be the first derivative of -2t*5/5 + 4t*3/3 - 2t + 8. Let o(a) = 0. What is a? -1, 1 What is d in -196/5 - 4/5d2 - 56/5d = 0? -7 Suppose 15 = 5v, -2v = -3j + v - 3. Let w(q) be the first derivative of 2q - j + 2/3q3 + 2q*2. Factor w(t). 2(t + 1)*2 Determine c so that -4/9c*2 + 2/9c*5 + 0c + 4/9c4 - 2/9c*3 + 0 = 0. -2, -1, 0, 1 Factor 3t3 - t3 + 28t4 - 2t + 4t2 - 1 - 31t4. -(t - 1)2(t + 1)(3t + 1) Let t = 520 + -4151/8. Let k(y) be the first derivative of 9/20y*5 - 1/2y*3 - 3/4y - ty2 + 1/8y*6 + 3/8y*4 + 1. What is p in k(p) = 0? -1, 1 Suppose -2i*2 - 6i + 4i2 - 4 + 4 = 0. Calculate i. 0, 3 Let c(l) be the first derivative of 0l - 7 - 2/9l3 + 0l*2 - 1/12l4. Factor c(y). -y2(y + 2)/3 Let j(k) be the second derivative of k + 1/30k*4 + 0k*2 + 0 - 1/75k*6 + 1/105k*7 - 1/50k*5 + 0k*3. Factor j(m). 2m*2(m - 1)*2(m + 1)/5 Factor 0 - 1/2b - 2b*3 - 5/2b*2. -b(b + 1)(4b + 1)/2 Let j(g) be the third derivative of -g*6/660 + 2g5/165 - g4/44 - 5g2. Determine x so that j(x) = 0. 0, 1, 3 Let t(l) be the third derivative of -l6/600 + l5/150 - l4/120 - 24l2. Determine s so that t(s) = 0. 0, 1 Let d(q) be the third derivative of -q7/6 - q*6/12 + 7q*5/12 + 5q*4/12 + 13q*2. Let d(c) = 0. What is c? -1, -2/7, 0, 1 Suppose -2k = 4a - 14, 3a + 4k + 2 = 20. Factor 0 - 1/2m*a + 0m - 1/2m3. -m2(m + 1)/2 Let z(d) be the second derivative of -1/4d4 + 0 + 0d*2 - 1/2d*3 - 2d. Factor z(r). -3r(r + 1) Let m(f) = f3 - f2 - f. Let o(w) = -6w3 - w2 - 6w - 6. Let c(i) = -10m(i) - 2o(i). Find y such that c(y) = 0. -3, -2, -1 Let l(a) be the third derivative of a6/360 - a5/90 + a*4/72 + 20a2. Solve l(c) = 0. 0, 1 Let u(v) be the third derivative of v6/360 - v*4/72 - 15v2. Solve u(a) = 0 for a. -1, 0, 1 Let z(s) = s3 - 7s - 8. Let i be 4(-1 - (-6)/3). Let c(l) = -1 + 4l - l3 + l - il. Let p(n) = 2c(n) - z(n). What is a in p(a) = 0? -1, 2 Let i(k) = k2 - k + 1. Let b(w) = -w2 + w - 1. Let o(y) = -3y + 2 - 5y + 2y + 5y. Let t(n) = 2b(n) - o(n). Let x(m) = 6i(m) + 2t(m). Factor x(d). 2(d - 1)(d + 1) Let s = 23 - 20. Let n(h) = h*2 - 2h - 3. Let v be n(s). Suppose -6/5i3 + 4/5i + v + 2/5i2 = 0. Calculate i. -2/3, 0, 1 Let c be (-3)/22/(-3). Factor c - 2f - 2 - 2f2 + f2. -(f + 1)2 Let l(g) = g2 - 4g - g3 + 3g + g + g. Let f(o) = 10o3 + 7o*2 + 4o + 2. Let p(q) = f(q) + 5l(q). Factor p(s). (s + 1)2(5s + 2) Factor -1/3f2 + 2/3 - f + f3 - 1/3f4. -(f - 2)(f - 1)*2(f + 1)/3 Let s(z) be the first derivative of -3z5/20 - z4/2 - z3/2 + 3z + 1. Let c(k) be the first derivative of s(k). Factor c(i). -3i(i + 1)*2 Suppose -3a + 33 = 3. Let g be 5/a + 0 + 1. Solve 0z + 0 - 1/2z*5 - 3/2z*3 - gz*4 - 1/2z*2 = 0 for z. -1, 0 Let m(f) = -4f*3 + 2f*2 - 4f - 3. Let c(u) = -u*3 - u - 1. Let r(t) = 3c(t) - m(t). Factor r(y). y(y - 1)2 Suppose 2z = -3z. Suppose z - 2/5m - 2/5m2 = 0. What is m? -1, 0 Suppose 2p + p - 7p = 0. Factor 0t*4 + 2/7t + pt2 + 2/7t*5 + 0 - 4/7t*3. 2t(t - 1)2(t + 1)*2/7 Suppose -4f + s = 3, 4f + s = -0 + 3. Let t = 5 - f. Factor -1 + 4y*2 - ty*3 - 14y*2 - 5y3 - y5 - 5y - 5y4. -(y + 1)5 Let t(y) be the third derivative of y7/1365 + y6/260 - y5/78 - y4/52 + 4y3/39 + 23y*2. Suppose t(z) = 0. What is z? -4, -1, 1 Let s = -10 - -18. Suppose -5m*4 + 8m*3 - sm*5 + 0m*3 + 3m*4 + 2m*2 = 0. Calculate m. -1, -1/4, 0, 1 Let i(w) be the second derivative of -3w + 0 + 1/21w4 + 1/21w*3 - 1/147w*7 + 0w*2 - 2/105w*6 + 0w5. Determine l so that i(l) = 0. -1, 0, 1 Let v(k) be the third derivative of -k5/510 + k*4/204 + 2k*3/17 - 5k*2. Determine h so that v(h) = 0. -2, 3 Let i = 268 + -268. Let 1/6d + 1/3d2 + i = 0. What is d? -1/2, 0 Let h(y) = 3y - 30. Let i be h(10). Let u(d) be the second derivative of -2d - 1/9d*4 - 1/6d*3 + 1/6d*2 + i. Determine v so that u(v) = 0. -1, 1/4 Suppose -7q + 18 = 2q. Factor 1/3i*4 + 0i*3 - 1/3i*q + 0i + 0. i*2(i - 1)(i + 1)/3 Suppose 5 = -2h - 3, -3u = h + 4. Suppose 1/5p*4 + 0p - 1/5p2 + 0p*3 + u = 0. Calculate p. -1, 0, 1 Factor -1/2 + 4q - 8q2. -(4q - 1)2/2 Let v(g) be the second derivative of g6/120 - g*5/40 - 5g*3/6 + g. Let k(h) be the second derivative of v(h). Solve k(b) = 0. 0, 1 Let h(i) = -i - 1. Let y(v) be the first derivative of -2v*3/3 + 7v*2 + 8v + 1. Let b(w) = 10h(w) + y(w). Find f, given that b(f) = 0. 1 Let n(m) = -m2 - 11m + 12. Let i be n(-12). Let a be i + (-2 - -5 - 0). Factor 0xa + 0 + 2/7x*4 + 2/7x*5 + 0x + 0x2. 2x*4(x + 1)/7 Suppose -4r = -2r - 2t - 4, 4t + 2 = 2r. Factor -2 - 3u3 - u5 + u*2 + 2 + ru4. -u2(u - 1)3 Let h(b) be the second derivative of -b8/168 + b6/30 - b4/12 + b2/2 - b. Let d(n) be the first derivative of h(n). Find w, given that d(w) = 0. -1, 0, 1 Find y, given that 6/11y*3 + 0 - 10/11y*4 + 2/11y + 10/11y2 - 8/11y*5 = 0. -1, -1/4, 0, 1 Suppose 4d = -2n + 8, 5d - 16 = d - 4n. Suppose 0y + 2/9y2 + d - 2/9y3 = 0. Calculate y. 0, 1 Let r(q) be the second derivative of q7/2520 - q6/360 + q5/120 - q4/72 - q3/6 + 3q. Let u(j) be the second derivative of r(j). Solve u(l) = 0 for l. 1 Let a(s) be the second derivative of -s6/120 - s5/8 - s4/2 + 5s*3/12 + 25s*2/8 + 34s. Suppose a(y) = 0. What is y? -5, -1, 1 Let d(j) be the first derivative of -49j5 - 175j*4/2 + 5j*3 + 50j*2 - 20j + 7. Suppose d(b) = 0. Calculate b. -1, 2/7 Suppose 0z - 3z = -9. Let g(f) = 5f*3 -	{ "pile_set_name": "DM Mathematics" }
= 10g + 116. What is the remainder when w is divided by g? 28 Let g(d) = -75d - 97. What is the remainder when g(-3) is divided by (-160)/(-6) - (-2 + 48/18)? 24 Let w(y) = -y*3 - 5y*2 - 68y - 285. What is the remainder when 789 is divided by w(-5)? 19 Calculate the remainder when 576 is divided by 9/33-2 - 99524/(-1969). 26 What is the remainder when 199 is divided by 7/(-1) - (-1 + -455)/19? 12 Suppose -5z + 127 = 2b, -17b = -4z - 15b + 80. Calculate the remainder when 1653 is divided by z. 20 Let r = -233 - -502. Let z = r - 142. What is the remainder when z is divided by 48? 31 Let h = 192 + -198. Calculate the remainder when 4/h - 7554/(-18) is divided by 30. 29 Let s(c) = 3c2 + 3c - 5. Let i be 1 + -1 + (-3 - 3). Calculate the remainder when s(i) is divided by (52/26)/((-1)/(-12)). 13 Calculate the remainder when 1446 is divided by (-327)/(-109)(4 + 152/12). 46 Suppose 45f - 34314 = -47f + 5522. Calculate the remainder when f is divided by 201. 31 Suppose -17i + 5043 = 5i + 19i. What is the remainder when i is divided by 5? 3 Let a(d) = d*3 - 17d*2 - d - 160. Calculate the remainder when 768 is divided by a(18). 38 Let i = 128 - -51. Suppose -30g + 1363 = -5g + 4g. Calculate the remainder when i is divided by g. 38 Let x(m) = -m*3 - 10m*2 - 61m - 461. What is the remainder when 467 is divided by x(-9)? 5 Calculate the remainder when 856 is divided by ((-108)/(-20))/((-30)/(-100)). 10 Suppose 5g + a = 204, g - 44 = 4a - 20. Suppose -5m - 8m = -1911. Calculate the remainder when m is divided by g. 27 Suppose 0 = j - 2d - 8, d = -3j + 3. Suppose -2a + j = -2. Suppose ab + 13 = 3b. Calculate the remainder when 48 is divided by b. 9 Calculate the remainder when 553 is divided by ((-2748)/96)/(2/(-16)). 95 Suppose 2t + 31 = -2i - 19, 3t - 2i + 100 = 0. Calculate the remainder when (12/10)/((-15)/(-2750)) is divided by 4/t - 842/(-15). 52 What is the remainder when 1202 is divided by 24 + -15(-3382)/285? 192 Suppose 30x - 10x + 120 = 0. Calculate the remainder when 124 is divided by 9 + 140/6 - 4/x. 25 Let n be -2(4 + 90/(-12)). Suppose -50 = -na - 3a. Calculate the remainder when a is divided by (-6)/10 + (-13)/(-5). 1 Calculate the remainder when 517 is divided by (34/4)/(45/90). 7 Let q be 0 - 21/(-1). Suppose -c = -3p + qp - 2, -31 = 5p + 2c. Let h(g) = g*3 + 8g*2 + 9g - 8. What is the remainder when 85 is divided by h(p)? 19 Let j(u) = 44u2 + 3u - 3. What is the remainder when 172 is divided by j(1)? 40 Calculate the remainder when 24 + 31 - -9(-6)/9 is divided by 8. 1 Let b(d) = -16d - 374. What is the remainder when 28 is divided by b(-24)? 8 Calculate the remainder when 1021 is divided by (-14)/(-20)6 - (-185)/(-925). 1 Suppose 429 = 7y - 915. Suppose -22t = -6t - y. Calculate the remainder when 56 is divided by t. 8 Let y(h) = -h*3 + 22h*2 + 2h - 26. Let n be 99/(-6)(3 + (-11)/3). Suppose -3v - 176 = -nv. Calculate the remainder when 47 is divided by y(v). 11 What is the remainder when 9/(-6)1(-6916)/78 is divided by 108? 25 Calculate the remainder when 591 is divided by 32/(-20)(-19)/(190/100). 15 Let b = 8 + 3. Suppose 459a - 5320 = 326a. What is the remainder when a is divided by b? 7 Suppose -3y = 3y + 6. What is the remainder when 1545/12 + 9/(-12) is divided by (6/y)/(-3)(-43)/(-2)? 42 Suppose -4 = -2l - 0l. Suppose -14 = -0k - lk. What is the remainder when -5 - -2 - -7 - -8 is divided by k? 5 Let o(i) be the second derivative of i5/20 - i4/12 - i3/6 + i2 + 14i. What is the remainder when (-1 - -1) + 10 + -2 + -1 is divided by o(2)? 3 Suppose 5w = -9t + 10t + 3, 3w - 11 = -4t. Suppose tc - 10c = -1472. What is the remainder when c is divided by 31? 29 Suppose 0 = 2l + 5x - 43, l - 4l = -2x - 74. Suppose 8r = 14r - 1284. Calculate the remainder when r is divided by l. 22 Let u(n) = 0n - 9 + 3 - 7 - 3n. Suppose 661 + 935 = 42g. What is the remainder when g is divided by u(-11)? 18 Let s(o) = 44o2 + o + 1. Let y be s(-1). Let n = y + -30. Let q(x) = -x3 - 24x2 - x + 31. Calculate the remainder when q(-24) is divided by n. 13 Let d = 114 + -78. Let i(k) = k2 - 90k + 1762. Calculate the remainder when i(66) is divided by d. 34 Let q = 177 - 147. Suppose 0 = qb - 3b - 1377. What is the remainder when b is divided by 22? 7 Let z(j) = 13j + 17. Let l be z(-1). Suppose -h = -lm + 311, 3m + 4h - 9h = 246. Calculate the remainder when m is divided by 27. 23 Let u be 5/(-3)240/(-50). Calculate the remainder when (7 - -172) + (u - 1) is divided by 39. 30 Let k be 496/2 + (0/2 - 2). Suppose 8y - k = 7y - 4p, 2p = y - 264. What is the remainder when y is divided by 37? 36 Suppose 14h = 30h - 895 - 849. Let b(z) = z3 + 6z*2 + z. What is the remainder when h is divided by b(-4)? 25 What is the remainder when 658 is divided by -2 - 10 - (-51 - -7)? 18 Suppose 0 = 6s + 4h - 686, -2h - 217 = -4s + 231. What is the remainder when s is divided by 53? 7 Suppose 4o - 2y - 236 = 0, -300 = -5o + 36y - 31y. Calculate the remainder when 3484 is divided by o. 4 Suppose 0 = -2t - 14p - 12, 5t + 61 - 139 = p. Suppose 0k = -3k. Suppose k = 4m + m - 45. What is the remainder when t is divided by m? 6 Let n = 9208 + -9113. Calculate the remainder when 260 is divided by n. 70 Suppose 4b + 5c - 3592 - 874 = 0, 4b - 2c - 4480 = 0. Calculate the remainder when b is divided by 23. 15 Let y(t) = 17t - 1218. What is the remainder when 746 is divided by y(78)? 98 Let b = -33415 + 33498. What is the remainder when 315 is divided by b? 66 Suppose 0 = -19s - 9s + 140. Suppose -3y = 4b - 221, -42 = 2b + sy - 135. Let c = 20 + 1. Calculate the remainder when b is divided by c. 17 Suppose 0 = -t - 4c + 47, -2c = t + 6 - 43. What is the remainder when 69 + -2 + 1 - (-5 - -1) is divided by t? 18 Let r = -43297 - -44267. What is the remainder when r is divided by 81? 79 Suppose -4 = -3l + 5. Let b(n) = n*2 - 2n + 4. What is the remainder when ((-68)/(-17))/(-2 - -16) + (12825/(-21))/(-15) is divided by b(l)? 6 Let z = -1681 + 1693. Calculate the remainder when 177 is divided by z. 9 Let n(k) = -13623k + 13622k + 61 + 42. What is the remainder when n(0) is divided by 24? 7 Let t = 42 + -49. Let p(v) = v*3 + 6v*2 - 10v - 21. Let x be p(t). What is the remainder when x + 666/10 - (-2)/5 is divided by 14? 11 Let j(g) = 2g - 50. Let i be j(9). Let x = i - -52. Calculate the remainder when (0 - (-3)/(-2))-36 is divided by x. 14 Let z be (20 - -13)(8/6 - 2). What is the remainder when z/(9 + 448/(-49)) is divided by 10? 4 Let u = 450 + -342. Suppose 3f - 5d = 135, 3f - 7d + 11d - u = 0. What is the remainder when 114 is divided by f? 34 Suppose -4v - 12r + 51 = -7r, -5v + 30 = -5r. Let j = -507 + 551. What is the remainder when j is divided by v? 8 Let t = -34 + 74. Suppose -37l - 36 = -tl. Let u = 29 + -11. Calculate the remainder when u is divided by l. 6 Let q(n) = n3 - 26n*2 - 153n + 21. Calculate the remainder when 285 is divided by q(31). 36 Suppose 178q - 2505 = 11q. Suppose 45 = 4y - 291. Calculate the remainder when y is divided by q. 9 Suppose 7r - 2r - 129 = -3h, 5h = -2r + 63. Calculate the remainder when (-2)/9 - 107088/(-1242) is divided by r. 14 Let r = 455 - 426. Suppose -26t - 462 = -rt - 3n, -5n - 184 = -t. Calculate the remainder when t is divided by 41. 36 Suppose 9 - 12 = -u - y, -4u + 12 = -2y. Let z(m) = -2m + 12 - m + 5m - 5m. Calculate the remainder when 13 is divided by z(u). 1 Suppose -5180 = -35o + 7o. Suppose -o = -18h + 157. Calculate the remainder when 54 is divided by h. 16 Suppose -7310j = -7273j - 222. Calculate the remainder when 20 is divided by j. 2 Suppose 101m = 106m - 2400. Suppose -7l + 10 + m = 0. Calculate the remainder when l is divided by 25. 20 Let y(m) = -2732m - 16162. What is the remainder when 1345 is divided by y(-6)? 195 What is the remainder when 197 is divided by 13 - 13 - (5 - 833/7)? 83 Let v = 6 - -12. Let g = -48 - -108. What is the remainder when v is divided by 5 + g/(-6) + (15 - -4)? 4 Let a be 3/((-3903)/489 - -8). Let l = a + -157. What is the remainder when 15 is divided by l? 3 Suppose 5v + 2	{ "pile_set_name": "DM Mathematics" }
he highest common divisor of 822942 and 4806? 18 Calculate the greatest common factor of 15879753 and 8390. 839 What is the highest common factor of 4286 and 422087423? 2143 What is the highest common divisor of 3000 and 1123450? 50 What is the greatest common divisor of 82 and 12047071? 41 Calculate the highest common divisor of 743804 and 52. 4 Calculate the greatest common divisor of 5940270 and 245. 245 What is the highest common factor of 77904 and 43704? 72 What is the greatest common factor of 42329498 and 206? 206 What is the greatest common factor of 99035989 and 104? 13 Calculate the greatest common divisor of 646256 and 9295. 169 What is the greatest common factor of 42219 and 1386? 9 Calculate the highest common factor of 34143 and 90345. 57 Calculate the highest common divisor of 2805270 and 871. 13 What is the highest common divisor of 2397594 and 6493? 43 What is the highest common divisor of 2169042451 and 7543? 7543 What is the greatest common factor of 58 and 15476169? 29 What is the highest common factor of 259 and 9459901? 37 Calculate the greatest common divisor of 100 and 110026420. 20 Calculate the greatest common factor of 6237 and 3152520. 567 What is the highest common factor of 29734798 and 1? 1 Calculate the highest common divisor of 227907675 and 2565. 135 Calculate the highest common factor of 3816 and 78404490. 954 Calculate the highest common divisor of 197227 and 147625. 1181 What is the highest common divisor of 174 and 21465974? 58 Calculate the greatest common factor of 363579975 and 540. 135 What is the greatest common factor of 314086524 and 141? 141 What is the highest common divisor of 577615926 and 948? 474 Calculate the highest common divisor of 424442 and 736. 46 Calculate the greatest common divisor of 15 and 12663675. 15 What is the greatest common factor of 102778 and 190548? 134 Calculate the highest common factor of 222201 and 89523. 63 Calculate the greatest common factor of 3989104 and 70. 14 Calculate the greatest common factor of 22032 and 31331544. 408 Calculate the highest common divisor of 836 and 50232578. 22 Calculate the highest common divisor of 456537 and 255. 3 Calculate the greatest common factor of 1385 and 11328192. 277 What is the highest common divisor of 4864 and 846488? 152 What is the highest common divisor of 2596 and 14820? 4 Calculate the highest common divisor of 1564698 and 5586633. 11019 What is the highest common factor of 287056521 and 27? 27 Calculate the highest common divisor of 717 and 62275274. 239 Calculate the highest common factor of 37628 and 28289712. 1636 Calculate the greatest common factor of 8541504 and 8640. 1728 Calculate the highest common factor of 120796 and 2790268. 1196 Calculate the highest common factor of 12933158 and 1715. 343 What is the greatest common divisor of 42 and 2747955? 21 What is the greatest common divisor of 22904 and 2207464? 56 What is the greatest common divisor of 981 and 3565281? 327 Calculate the greatest common divisor of 225 and 2663350. 25 Calculate the greatest common divisor of 91 and 2310568. 13 What is the greatest common factor of 218431742 and 306? 34 What is the highest common divisor of 2805 and 457113? 51 What is the greatest common divisor of 154168 and 18116? 28 Calculate the highest common divisor of 1836384 and 26884. 2068 What is the highest common factor of 2669865 and 240? 15 What is the greatest common factor of 5478 and 269523078? 5478 What is the highest common factor of 1616571 and 15587? 11 Calculate the highest common factor of 250 and 27208850. 50 Calculate the greatest common divisor of 165 and 245815. 5 What is the greatest common divisor of 140973 and 74634? 21 What is the greatest common divisor of 15552 and 4025781? 243 Calculate the highest common divisor of 398 and 77633681. 199 What is the highest common divisor of 388038 and 210? 42 What is the greatest common divisor of 30 and 1806438? 6 What is the greatest common factor of 456602385 and 4514? 2257 What is the greatest common factor of 72 and 18677124? 36 Calculate the greatest common factor of 1517 and 10369. 1 Calculate the highest common divisor of 1397169 and 420039. 1269 Calculate the greatest common factor of 652 and 208495256. 652 What is the greatest common factor of 150719 and 3611? 23 Calculate the highest common divisor of 42 and 14466466. 14 Calculate the highest common divisor of 126592 and 372896. 1376 What is the highest common factor of 152356 and 100532? 164 Calculate the highest common factor of 4324 and 10224098. 2162 What is the greatest common factor of 36 and 16658916? 12 Calculate the highest common factor of 32729 and 253426339. 1423 What is the greatest common factor of 49989017 and 53? 53 Calculate the highest common factor of 26982505 and 165. 55 Calculate the highest common factor of 803223 and 9727. 71 Calculate the highest common divisor of 24 and 46466256. 24 What is the greatest common factor of 139 and 349781407? 139 Calculate the greatest common divisor of 462 and 39563328. 42 Calculate the greatest common divisor of 799 and 84141891. 799 What is the greatest common divisor of 2332 and 47632? 4 What is the greatest common factor of 40386 and 42506? 106 Calculate the highest common divisor of 1443 and 32407362. 39 Calculate the greatest common factor of 2286 and 233829. 9 Calculate the greatest common factor of 2492142 and 54. 6 What is the greatest common divisor of 954996 and 308? 28 What is the greatest common factor of 2052 and 156788? 76 What is the highest common factor of 245 and 5389895? 35 Calculate the highest common factor of 738 and 2645238. 246 Calculate the highest common factor of 12 and 72121092. 12 Calculate the greatest common factor of 636849 and 82503. 927 What is the highest common factor of 14758720 and 280160? 2720 Calculate the greatest common divisor of 37339690 and 40. 10 Calculate the highest common divisor of 9134905 and 19307. 449 Calculate the greatest common factor of 950 and 628425. 475 Calculate the highest common factor of 84448 and 11812976. 3248 Calculate the greatest common divisor of 69616 and 17200. 16 What is the greatest common factor of 15441272 and 77? 77 What is the greatest common divisor of 42845 and 1332705? 2255 Calculate the highest common divisor of 14144 and 283088. 208 What is the highest common factor of 631544 and 5963? 89 Calculate the greatest common factor of 3754650 and 4755. 15 Calculate the greatest common factor of 120033572 and 452. 452 Calculate the highest common factor of 676458 and 21744. 18 What is the greatest common factor of 5129 and 278527? 223 What is the greatest common divisor of 3210 and 1165337? 107 Calculate the highest common divisor of 29242950 and 6105. 6105 What is the highest common divisor of 831265988 and 686? 686 What is the highest common divisor of 132759 and 126671754? 4917 Calculate the highest common divisor of 71322640 and 60652. 1028 Calculate the highest common divisor of 471163 and 63511. 1477 What is the greatest common divisor of 348 and 308067? 87 Calculate the highest common factor of 1002 and 117587706. 1002 What is the highest common divisor of 428 and 756794308? 428 Calculate the highest common divisor of 7929350 and 67925. 3575 Calculate the highest common factor of 9924 and 43986476. 3308 What is the greatest common factor of 1651 and 49218469? 127 Calculate the greatest common factor of 234200820 and 140. 140 Calculate the greatest common divisor of 167410112 and 8. 8 What is the greatest common factor of 4920 and 19942728? 984 Calculate the highest common factor of 12270 and 229015460. 4090 What is the highest common divisor of 207058528 and 12416? 3104 Calculate the highest common factor of 50260 and 119950516. 10052 Calculate the highest common factor of 43609461 and 49. 49 Calculate the greatest common factor of 94185 and 2837763. 207 What is the highest common divisor of 120 and 15522680? 40 Calculate the greatest common divisor of 52660895 and 101. 101 What is the greatest common factor of 26983 and 3874625? 223 What is the greatest common factor of 75102 and 82? 2 What is the highest common factor of 15468300 and 170? 170 What is the greatest common factor of 7089 and 1809363? 417 Calculate	{ "pile_set_name": "DM Mathematics" }
ending order. h, -1, 1, 7 Suppose 3j + 1 = -2l - 2j, 4j = -2l - 2. Let p be 4/3l/1. Let i = -26043.3 + 26043. Sort p, i, 3 in increasing order. p, i, 3 Let b(f) = -2f3 + 25f*2 - 12f + 13. Let t be b(12). Put 0, 1, t in increasing order. 0, 1, t Let p = -2.263 + 0.263. Let r = -2/21 - -8/21. Sort p, r, -0.4, 3 in increasing order. p, -0.4, r, 3 Let p = -1.3 + 0.3. Let l = -26 + 21. Let b = 14 + -10. Sort p, l, b. l, p, b Let u = -82 + 74.4. Let s = u - -8. Let l = 1.4 + -1.5. Sort 2, l, s in decreasing order. 2, s, l Let q = -33 + 33. Let g be ((-6)/8)/(48/208). Sort 4, q, g in increasing order. g, q, 4 Let b be ((-4)/5)/(2/5). Suppose 0l - 4l = 8i - 184, -3l = -6. Put 1, -1, b, i in increasing order. b, -1, 1, i Let a be 2/(-7) + (-14)/(-49). Let c be a/5 + 2 - -3. Suppose 0 = -p - 5k - 0k - 6, 0 = -k - 2. Sort c, 2, p in increasing order. 2, p, c Let p(v) be the first derivative of -v*2 - 8v - 2. Let j be p(-6). Sort 3, -3, j, -9 in decreasing order. j, 3, -3, -9 Let v = -4603/29 + 159. Sort 1, v, -5. -5, v, 1 Suppose -4m = 2z - 5m, -5z = -2m - 1. Let k = -23 - -16. Suppose -12 = n + 4d, 2d + 0 = -4n + 8. Sort z, k, n in ascending order. k, z, n Let q = 63 + -44. Let h = q - 19.3. Put 2, 3/4, h, -4/3 in decreasing order. 2, 3/4, h, -4/3 Let m be 3/(2 - (-56)/(-16)). Sort 28, -4, m in decreasing order. 28, m, -4 Suppose 0 = -5p + 2i + 10, -2i = i. Suppose 0 = 3w + pr - 2, -2r + 8 = -2w - r. Sort w, -0.9, -1/8 in increasing order. w, -0.9, -1/8 Suppose -16a = 17 - 1. Sort 2, 1/4, 1/10, a in decreasing order. 2, 1/4, 1/10, a Suppose -6o + 5580 = 5550. Put 0.2, 5/2, o, -1/2 in decreasing order. o, 5/2, 0.2, -1/2 Let k = -0.9 - 8.1. Let b = 13.1 - 1.1. Let x = b + k. Sort x, -3/2, -0.3 in decreasing order. x, -0.3, -3/2 Let o(f) = 2f - 31. Let c be o(15). Put c, 2, -3 in ascending order. -3, c, 2 Suppose 0 = -z - 0z + 2. Suppose 9g = -48g + 171. Sort z, -2, g in decreasing order. g, z, -2 Let i(j) = -2j + 2. Let y be i(5). Let q be (-7)/5 - 4/(-10). Suppose -3t = -5d + 6, -d + 3t + 12 = 6t. Put d, q, y in decreasing order. d, q, y Let x = -112 - -120. Let s = 5 - 9. Let g(p) = -p*2 - p - 3. Let k be g(0). Sort x, k, s in decreasing order. x, k, s Let w(c) = 4c*2 - 1. Let h be w(-1). Let j = -1.9283 - 0.0717. Sort h, j, 1 in descending order. h, 1, j Suppose 0 = s + 4 - 18. Let u be ((-4)/5)/(s/(-10)). Let y = -39586/21 - -5656/3. Put 1/2, y, u in descending order. u, 1/2, y Let n = 6.2 + -5.8. Let f = 4.4 - n. Sort -4, f, 0.03 in increasing order. -4, 0.03, f Let t(m) = -14m - 2. Let u be t(-2). Suppose 4f - 59 = 37. Let i = u - f. Put i, 3, 5 in descending order. 5, 3, i Suppose 16h = 19h - 3. Suppose 3 = -l + h. Suppose 0 = -0o - 2o + 6. Sort o, 5, l. l, o, 5 Let w = -0.7 - -0.3. Let o = 18/205 + -2314/17015. Let n = o - 130/747. Sort 4, w, n in increasing order. w, n, 4 Let n(l) = -l2 - 4l + 5. Let c be n(-4). Suppose -4u + 2r = -u + 2, -5r = 5u - c. Suppose 3q + 5 + 1 = u. Sort -3, q, -7 in descending order. q, -3, -7 Let m be ((-260)/(-50))/((-6)/(-420)). Put 2/5, 4/7, m, 1/3 in descending order. m, 4/7, 2/5, 1/3 Suppose -26d + 28 = -33d. Sort d, -9, -3 in ascending order. -9, d, -3 Suppose 5 = r - 3. Suppose -3o + r = 14. Let n be (1/o)/(2/20). Sort n, 1, -4 in ascending order. n, -4, 1 Suppose -5l + 2r + 8 = 0, 4l + r + 20 = -4r. Sort l, 3, -52, 1 in increasing order. -52, l, 1, 3 Suppose 8h = -3h. Sort 3, -2/7, h, -0.5. -0.5, -2/7, h, 3 Let w = 3795/362 - -3/181. Sort 5, -1/3, w, 1 in ascending order. -1/3, 1, 5, w Let w = -2/887 - 877/4435. Let k be (0 - 2)/(-1 - 2). Sort w, k, -5, -0.5 in decreasing order. k, w, -0.5, -5 Let u = -70 + 69.9. Put -1, -16, 0, u in decreasing order. 0, u, -1, -16 Let o(t) = -t*2 + 40t - 239. Let f be o(33). Let a = -4 - -7. Let v be (-3)/(-2) + 0 + -1. Put a, f, v in ascending order. f, v, a Let b = -22.964 - 0.036. Let i = 20 + b. Sort -2/3, -2, i, -1/2 in descending order. -1/2, -2/3, -2, i Let g be 3/(24/(-32)) + 8. Sort 3, -7, 5, g in decreasing order. 5, g, 3, -7 Let c = 2 + 0. Let b = 2148 + -2147. Put b, 4, c, -1 in increasing order. -1, b, c, 4 Let f = 1838.8 - 1839. Put -0.5, -0.7, f in descending order. f, -0.5, -0.7 Let c be 1/((-126)/(-100)) - 384/672. Suppose -2z = j + 7, -5z = -4j - j + 10. Sort j, 5, c in increasing order. j, c, 5 Suppose k - 12 + 4 = 0. Let b be (-105)/20 + k/2. Sort -4, b, -5 in decreasing order. b, -4, -5 Let c(p) = p + 2. Suppose 12h - 12 = -48. Let u be c(h). Put 5, u, 0 in ascending order. u, 0, 5 Let j = 2770 - 2773. Put 4.6, j, -4, 0.2 in increasing order. -4, j, 0.2, 4.6 Suppose 0f = -4f - 4v + 64, 0 = -f - 2v + 16. Sort -2, f, 5, 2 in descending order. f, 5, 2, -2 Let b = 4.3 + -0.1. Let z = -4.37 + b. Let u = 0.27 + z. Sort -12, 5/4, u in ascending order. -12, u, 5/4 Let s = 100 + -82. Let f be 1 + 2/(2/(-19)). Let q = f + s. Sort q, 5, -3 in increasing order. -3, q, 5 Let m be (1 - (-12)/(-3)) + 144/45. Sort m, 0, -0.6 in ascending order. -0.6, 0, m Suppose -41 = 12w - 5. Put 1, 30, 5, w in decreasing order. 30, 5, 1, w Let q = 556/5 - 112. Let p be ((-5)/50)/(2/(-15)). Let g be (-2)/(-10) - (-9)/(-20). Put q, p, g in descending order. p, g, q Let n = -2/225 - 209/1800. Sort -1/3, 0.1, n, 5 in increasing order. -1/3, n, 0.1, 5 Let f = -0.2 - -0.2. Let d = -535 - -535.1. Put f, 4, d in descending order. 4, d, f Let w = 17 + -9. Let f = 186 + -184. Sort w, f, 0.4, -4 in decreasing order. w, f, 0.4, -4 Suppose 400 + 660 = 5f - z, -5z = -5f + 1080. Let r = -2319/11 + f. Sort r, 0, -0.2 in descending order. r, 0, -0.2 Let k(i) = -i*2 - 4i + 187. Let s be k(12). Sort -38, 0, -3, s. -38, s, -3, 0 Let q = 54 + 10. Put q, -2, 2, -1 in descending order. q, 2, -1, -2 Let v be 4/(-6)(-12)/(-20). Let k = -207 + 203. Put k, 1/4, v in descending order. 1/4, v, k Suppose -4f + 15 = -25. Suppose -fz = -5z + 35. Let i(a) = a*3 - 3a*2 - 4. Let d be i(3). Sort -5, d, z in decreasing order. d, -5, z Let i = -3562/7 - -508. Sort -1, 11, i, 0.4. -1, i, 0.4, 11 Let v = 5 + -4.48. Let l = v - -0.08. Let p = 1.4 + l. Put p, 4/9, 0.02 in decreasing order. p, 4/9, 0.02 Suppose 2l = 760 - 754. Put l, -2, 24, -4 in descending order. 24, l, -2, -4 Let q be (18 + -16)2/(-4). Sort -2, q, -5, -4 in decreasing order. q, -2, -4, -5 Suppose 0 = 2u - 13q + 16q, -4u - q + 10 = 0. Put 0.2, u, -8, -2/9 in descending order. u, 0.2, -2/9, -8 Suppose 4x - 2o + o = 19, 5x - 10 = 4o. Suppose -24 = xu + 24. Put -5, u, 0 in descending order. 0, -5, u Let u(s) be the first derivative of -s*4/4 - 2s3/3 - s2/2 + 2s + 2. Let a be u(-2). Let c be (-6)/a(-3)/27. Sort -8, -1, c. -8, -1, c Let c = -309.91 - -310. Put c, -6/5, 0.3 in decreasing order. 0.3, c, -6/5 Let c = 1303 + -1303.3. Sort -3/4, c, 59, -1/2. -3/4, -1/2, c, 59 Let d(k) = -k*3 + 6k*2 - 12k + 9. Let o be d(3). Sort 95, 1, o in ascending order. o, 1, 95 Let z = 1317263/485 - 2716. Sort 2, z, -2/19 in descending order. 2, z, -2/19 Let l = 85 + -257/3. Let x = 18 - 18.24. Let n = x + 3.24. Sort n, l, 2. l, 2, n Let m = 23 + -19. Suppose 3r - 5i = -m, -r + 3i - 7 + 3 = 0. Let o be (r + -3)(0 - 3). Put -17, 4, o in increasing order. -17, o, 4 Let u = -0.32 - -0.52. Sort 3/7, 2, u, 0.01 in decreasing order. 2, 3/7, u, 0.01 Suppose 29l = -8l - 111. Let j be 0/((-3)/(9/(-6))). Suppose jn - n - 14 = 3a, 5a + 24 = -n. Put l, n, 2 in decreasing order. 2, n, l Let v(f) = 11f + 122. Let c be v(-11). Put 0, -4, 4, c in ascending order. -4, 0, c, 4 Suppose -7c + 41 - 6 = 0. Suppose -y + cp = 22, 5 + 9 = 3y + 5p. Let h = 1 + -1. Sort y, h, 0.1 in ascending order. y, h, 0.1 Suppose -3q + 9 = 2a, 5q - 31 + 0 = 2a. Sort q, -39, -5, 4 in ascending order. -39, -5, 4, q Let z = -42 + 46. Let r be z/(-6) + (-56)/24. Let q be (1/(-2))/(1/(-8)). Put r, 0, q in descending order. q, 0, r Suppose p - 10 = 2k + 5, 0 = 5k + 4p + 5. Let z = -0.108 - 59.892. Let h = -57 - z. Sort h, k, -1. k, -1, h Let g = -0.11 + -0.19. Let x = g + 0.49. Let f = x - -1.81. Sort 12/5, f, 2/9 in increasing order. 2/9, f, 12/5 Let l = 0 - 0.02. Let h = 4.32 + -0.3. Let r = l + h. Sort -2/19, r, 3/7. -2/19, 3/7, r Let w be (2 + -2)/(0 + -2). Suppose w = 5m - 25 -	{ "pile_set_name": "DM Mathematics" }
(78))/(-4sqrt(6)-1))*2. 637/16 Simplify ((sqrt(216)1 - sqrt(216))1)/(sqrt(108) + sqrt(108) + (sqrt(108) - ((1sqrt(108) - sqrt(108)) + sqrt(108))-2)). 0 Simplify (((sqrt(78) - (-1sqrt(78)-3 - sqrt(78))) + sqrt(78))2)/((sqrt(12)/sqrt(2)2 - sqrt(6))4). 0 Simplify (0 + -4((sqrt(1100) + sqrt(1100) + 3 + sqrt(1100) - sqrt(1100))6 + -5(sqrt(1100) + -3)))2. 73920sqrt(11) + 879824 Simplify 6-2(5 + (2 + sqrt(117))*2 + sqrt(117) + 2 + -2). -1512 - 180sqrt(13) Simplify 1((sqrt(64)/sqrt(2))/sqrt(8))/(sqrt(16)/sqrt(2))5. 5sqrt(2)/2 Simplify (2(sqrt(19) - sqrt(76))2 - sqrt(209)/sqrt(99)) + (sqrt(19) + sqrt(57)/sqrt(3) + 4 - (sqrt(19) + 0 + sqrt(2736) + sqrt(2736))2). -11833 + 5sqrt(19)/3 Simplify ((sqrt(243) - (-5sqrt(243))2) + 3 - (-2 + sqrt(243) + 0)2)2. -12638 + 90sqrt(3) Simplify (sqrt(24)/(-2sqrt(288)) - (2sqrt(12) - 5(0 + sqrt(3))))2. 121/48 Simplify 4(sqrt(14)/(-4sqrt(7)2 + sqrt(7)) - (-3 + sqrt(8)/(sqrt(4)3))). -40sqrt(2)/21 + 12 Simplify ((sqrt(96)/(sqrt(36)/sqrt(3)) - 4sqrt(32))/(sqrt(48)/(sqrt(12) - (sqrt(48) + sqrt(12))) + 5(sqrt(64) + sqrt(4))))*2. 8/49 Simplify (sqrt(240)/(sqrt(32)/sqrt(4)) + (sqrt(1470)-1 - sqrt(30)))/(6(sqrt(640) + -2sqrt(640) - sqrt(640))). 7sqrt(3)/96 Simplify 2(sqrt(1617)-1)/(sqrt(66)/(sqrt(42)/sqrt(7) + sqrt(6))). -28sqrt(3) Simplify (sqrt(1375) - (sqrt(1375) + -1sqrt(1375) - sqrt(1375))6)/((sqrt(1715)-6)/sqrt(7)). -5sqrt(11)/6 Simplify 6(sqrt(130) + sqrt(130) + 2(sqrt(130) + 2sqrt(130)) + sqrt(130))/(sqrt(360)1). 9sqrt(13) Simplify (5(sqrt(117) + 0))*2-3 - (sqrt(117) + ((sqrt(117) + 6(sqrt(117) + 1) - sqrt(117)) + sqrt(117) - sqrt(117)))5. -8805 - 105sqrt(13) Simplify (-3 + (sqrt(275)/sqrt(5)-1)/(5(sqrt(5) - (sqrt(80) + sqrt(5) - sqrt(5)))) + 0)2. -2sqrt(11)/5 + 2036/225 Simplify -4(((1 + sqrt(228)/sqrt(108))3)*23 + 1). -340 - 72sqrt(19) Simplify sqrt(75)-33 + (sqrt(3) - (-2(0 + sqrt(3)) + sqrt(3))) + sqrt(3) + (sqrt(6)/sqrt(2) + sqrt(3) - sqrt(3))-1. -43sqrt(3) Simplify -1 + ((sqrt(187) + sqrt(187)-2)/sqrt(11) + (1sqrt(17))*2-6 + -2 + sqrt(1377) + 1)2. -207 + 16sqrt(17) Simplify -3(1 + sqrt(11) + 1 + sqrt(704) + sqrt(704) - (4 + 0 + sqrt(1584))). -15sqrt(11) + 6 Simplify (((sqrt(209) - sqrt(209)-3)3)/sqrt(11))*2 + sqrt(152)/(-1sqrt(512)). -sqrt(19)/8 + 2736 Simplify 3((sqrt(242) + sqrt(242) + -2sqrt(242)-1)2 + -5)3-1. -34803 Simplify -6((1 + sqrt(1053))-1 + sqrt(1053)) - (-5 + sqrt(1053) + 0 + -3)2. -1111 + 144sqrt(13) Simplify (sqrt(486) + (sqrt(486) - (sqrt(486) + sqrt(486) + sqrt(486)3-5)) - sqrt(486) - sqrt(486))/(sqrt(200)-1 - (sqrt(2) + sqrt(224)/sqrt(7))). -39sqrt(3)/5 Simplify ((-1sqrt(1620) + 3)2 - ((sqrt(20) - (sqrt(20) + sqrt(180))) + 4)2-6)2. -792sqrt(5) + 5610 Simplify -3 + 5 + sqrt(448)3 - (4(sqrt(448)-1 + sqrt(448)) + 3 + sqrt(448) + (sqrt(448) - (sqrt(448) + 1)2)). 24sqrt(7) + 448 Simplify 1(sqrt(3) + 1)-4 + (1 + ((2 + sqrt(3))5 - sqrt(3)))2. 84sqrt(3) + 165 Simplify 3((sqrt(54)/sqrt(3))/sqrt(9) + 3 + 1 + -1). 3sqrt(2) + 9 Simplify 2 + 2(1 + (1 + (sqrt(108) - (1 + sqrt(108) - sqrt(108))) - sqrt(108) - sqrt(108)) + 0)2. -24sqrt(3) + 220 Simplify (sqrt(255)/(sqrt(5) + 5sqrt(50)/sqrt(10) - sqrt(5)))/(4sqrt(48) + (sqrt(81)/sqrt(3))/sqrt(9)). sqrt(17)/85 Simplify (-1sqrt(85)2 + sqrt(85) + sqrt(85) + 4sqrt(85)-2)/(2sqrt(500)2). -sqrt(17)/5 Simplify -1 + -31(2 + sqrt(720)) + 2 + 0. -36sqrt(5) - 5 Simplify (2sqrt(700) - sqrt(700))4 + -1 - (sqrt(700) + sqrt(700) + 6(sqrt(700) + 2sqrt(700) - sqrt(700)) + sqrt(700) + sqrt(700) + sqrt(700) + 2 + 3)2. -202326 - 1660sqrt(7) Simplify -4 + (2sqrt(2700))2 + 4sqrt(21)/(sqrt(7)1) + 2. 4sqrt(3) + 10798 Simplify -4 + -2(sqrt(78)/(sqrt(48)/(sqrt(48)/sqrt(6))))26. -160 Simplify (-6(sqrt(85) - 1sqrt(85)-2))/(sqrt(15)/((sqrt(18)1)/sqrt(6))). -18sqrt(17) Simplify sqrt(50)/(sqrt(10)1) + sqrt(405) - (-3 + sqrt(5)22). 3 + 6sqrt(5) Simplify (5(sqrt(2299) - 2(sqrt(2299) + 1) - (sqrt(2299) - (sqrt(2299) - -4(sqrt(2299) - (sqrt(2299) + 0))))))*2 + 3. 1100sqrt(19) + 57578 Simplify -2 + (-2 + sqrt(1539))*22 + sqrt(1539) + -1 + 1. -63sqrt(19) + 3084 Simplify 4((3(-2 + 1 + sqrt(128)))2 + (5 + sqrt(128) + sqrt(128) + -1)4). -320sqrt(2) + 4708 Simplify ((sqrt(3) + 2(-1 + sqrt(3)))*2 + 3 + 1)2. -24sqrt(3) + 70 Simplify (-6-1sqrt(136) + sqrt(136) + (sqrt(136) - 2-1sqrt(136)))/(-6(sqrt(8) - (-1sqrt(56))/sqrt(7))). -5sqrt(17)/6 Simplify ((sqrt(99) + -1sqrt(99)4 + sqrt(99) + sqrt(99))/(sqrt(72)/sqrt(72)))*2. 99 Simplify (sqrt(432) + -2 + 1 - (sqrt(432) - (sqrt(432) + -1sqrt(432)2)2))-4. -1724 Simplify (-3((-5(sqrt(2448)1 + sqrt(2448)) - sqrt(2448)) + (-1 + sqrt(2448))-4))*2 + -2. -12960sqrt(17) + 4957342 Simplify (5 + sqrt(147) + 1)*2 - sqrt(48)2. 76sqrt(3) + 183 Simplify sqrt(363) + (sqrt(363) - 62sqrt(363)) - (sqrt(363)1)*23 - ((sqrt(252)/(sqrt(28)/sqrt(4)))/(sqrt(120)/sqrt(40)))*2. -1101 - 110sqrt(3) Simplify -4(3((sqrt(72) - 1sqrt(72)) + -1) + -1(sqrt(72) + 1) + 3). 4 + 24sqrt(2) Simplify -3 + ((4 + 0 + sqrt(539))2 - (1 + sqrt(176) + 3)). 52sqrt(11) + 548 Simplify -3 + (sqrt(833) + (sqrt(833) - (-1 + sqrt(833))) + -3 + sqrt(833) + sqrt(833)2 + 3)2-5. -66648 - 280sqrt(17) Simplify (sqrt(5) - (sqrt(35)/(sqrt(28)/sqrt(4)))2) + 2 + sqrt(180) + 1 + -1. -3 + 7sqrt(5) Simplify 5 + ((sqrt(3) - (2 + sqrt(147)) - sqrt(3)) + -5 + sqrt(3) + sqrt(3)5)2. 14sqrt(3) + 57 Simplify (-5(sqrt(2299) + -2 + 4) + -4)21. 1540sqrt(19) + 57671 Simplify sqrt(12)/(sqrt(16)-5 - sqrt(16) - sqrt(16)) + (-5sqrt(30)/sqrt(10)4)*2. -sqrt(3)/14 + 1200 Simplify -2(sqrt(125) + -1 + 0)*2 + (-5(sqrt(140) + sqrt(35)))/(sqrt(7) - sqrt(84)/sqrt(3)). -252 + 35sqrt(5) Simplify 1(-2sqrt(11)2 - (sqrt(11) + -3)3)4. -28sqrt(11) + 36 Simplify (3sqrt(14)/(sqrt(288)2) + 0 + -5)2. -5sqrt(7)/4 + 1607/64 Simplify (2 + -3sqrt(20))2-32 + -1. -1105 + 144sqrt(5) Simplify ((sqrt(130) + (sqrt(130)1 - sqrt(130)) - sqrt(130))2)/(6(sqrt(10)4 - sqrt(10))). 0 Simplify 6((sqrt(110) + sqrt(110) + 4sqrt(110))/sqrt(5))/(3sqrt(99)). 4sqrt(2) Simplify sqrt(60)/(sqrt(36)/sqrt(3)) + -4 + 3sqrt(15)/sqrt(3)6. -4 + 19sqrt(5) Simplify ((-2sqrt(704)-4 + sqrt(704))2 + -5 - (sqrt(704) - (0 + sqrt(704)))-6-5) + -4. 57015 Simplify (((sqrt(2) - (sqrt(2)2 + -2)) + sqrt(2) - sqrt(6)/(sqrt(3)-3))11)2. 4sqrt(2)/3 + 38/9 Simplify ((sqrt(2448) - (sqrt(2448) + sqrt(2448) + -3sqrt(2448) + -1 + sqrt(2448))) + -5 + -5)2. -216sqrt(17) + 2529 Simplify (2 + ((2sqrt(3) - sqrt(3))-6 - sqrt(36)/(sqrt(36)/sqrt(3))))*24. -112sqrt(3) + 604 Simplify -5(0 + sqrt(468))*2 - (sqrt(1872)6)*26. -406692 Simplify (-3 + ((sqrt(85) + (sqrt(85) - ((sqrt(85) + sqrt(85)-1 + sqrt(85))-3 + sqrt(85) + sqrt(85))))/sqrt(5))*2)-1 + -4. -154 Simplify -6(sqrt(88)/sqrt(4)-3)/(-1sqrt(1331)). -18sqrt(2)/11 Simplify 5((sqrt(3) - 3sqrt(3)) + 3)-1-6. -60sqrt(3) + 90 Simplify (-1(sqrt(170) - -3((sqrt(170) - 1sqrt(170)) + sqrt(170))))/((-1sqrt(90) - sqrt(90))6 + sqrt(90)). 4sqrt(17)/33 Simplify 5(sqrt(540)/(sqrt(18)/sqrt(2)))/(sqrt(1728)-2 - sqrt(1728)). -5sqrt(5)/36 Simplify ((-5(sqrt(363) + -1) + 4 + (-4 + sqrt(363) + sqrt(363)-1)4)-6)*2. 27720sqrt(3) + 328464 Simplify sqrt(3) + -2 + -2 + 2 + 1 + (sqrt(3)-2)2 + sqrt(3) + -4(0 + sqrt(3)). -2sqrt(3) + 11 Simplify (sqrt(2160) + -1sqrt(2160)-1)/(sqrt(20) + -3sqrt(720)). -12sqrt(3)/17 Simplify ((3sqrt(228) - sqrt(228))-4)/(sqrt(12) + sqrt(1452)-4 + sqrt(1452) + sqrt(12) + sqrt(12)). 4sqrt(19)/15 Simplify sqrt(12)/(sqrt(24)/sqrt(4)-6) - ((sqrt(2) - (sqrt(2) + 1sqrt(2) + sqrt(2))2)-5)2. -1250 - sqrt(2)/6 Simplify 5 + (-4 + 3 + sqrt(147)-1 + 3 + -1)*2. -14sqrt(3) + 153 Simplify (2(sqrt(55) - (sqrt(55) + sqrt(3520)))4)/(sqrt(176)-3-4). -4sqrt(5)/3 Simplify ((1sqrt(162) + sqrt(162) - sqrt(162))-5)2 + 5 + 4 + sqrt(162) + (sqrt(162)-2)*2 + ((0 + sqrt(162))5 - sqrt(162)). 45sqrt(2) + 4707 Simplify -5 + (5 + -2 + sqrt(112) + -4(sqrt(7) + 3 + -2))*2. -4 Simplify ((sqrt(224) + 1sqrt(224))/sqrt(8) - sqrt(28))/(sqrt(196) - (-2sqrt(196) - sqrt(196) - sqrt(196))) + 0 + 2 + sqrt(28) + -5. -3 + 71sqrt(7)/35 Simp	{ "pile_set_name": "DM Mathematics" }
. Let c be 4 - (0 - 0)/((-8)/z). Solve -3b + 8 = -c for b. 4 Let w be 286/4 - (-75)/825(-22)/(-4). Solve ws - 89s + 85 = 0 for s. 5 Suppose 0 = 24c - 17c + 574. Let q = 84 + c. Solve -qx + 21 = 17 for x. 2 Let i(w) be the first derivative of -5w*4/2 - 2w*3/3 - 5w*2/2 - 3w + 53. Let s be i(-1). Solve -g + s = -3g for g. -5 Suppose -42l + 26l + 400 = 0. Suppose 17 = 3n - 2w, lw + 4 = 21w. Solve -4f + nf = -5 for f. -5 Suppose 18s = 38s - 60. Suppose 0 = -6y - 133 + 37. Let w = -16 - y. Solve w = f - s - 2 for f. 5 Let y = 2403 - 2363. Solve yi + 96 = 8i for i. -3 Suppose 3i + 35 + 49 = 0. Let t = i + 34. Let a be 18/(-30) + (-3 - 72/(-20)). Solve a = -h + 3h - t for h. 3 Let w(d) = -28d - 176. Let a be w(-9). Suppose 0 = -14x - 5x + a. Solve -4g = xg for g. 0 Let s = 16243 - 16214. Solve -sr = 482 - 250 for r. -8 Suppose -20 = -4n, 3o + 2n - 5 = -1. Let q(b) = 8b*2 + 3b + 5. Let y be q(o). Solve 2 = -yw + 30w for w. -2 Let b(i) = -i*3 + 151i*2 - i + 166. Let z be b(151). Solve 0 = -zw + 91w - 304 for w. 4 Let w(z) = -z2 - 15z - 21. Let q(u) be the first derivative of -u*4/4 + 2u*3 + 2u*2 + 8u - 19. Let x be q(7). Let r be w(x). Solve -d = -rd + 4 for d. 1 Let b be 2/11 + 1/((-11)/(-20)). Suppose -bc - t + 22 = 0, 17c - 58 = 12c - 4t. Solve -cq + 13q - 15 = 0 for q. 5 Suppose 4y = -0o - 2o, 3y = -3o. Suppose 3g + 5d = 28, 0 = -2g - 0g + d - 3. Suppose -g = -11s + 43. Solve y = -t - s - 1 for t. -5 Let x be (38/(-6))/((260/60)/(-13)). Solve 9b - xb = -20 for b. 2 Suppose -368 - 337 = 21r - 68r. Solve -5 = 14x - rx for x. 5 Let z be (-11)/((-594)/1305) + (-20)/(-24). Solve 5d + z = 10d for d. 5 Let r(b) = 2b - 6. Let x be r(2). Let s = x + 13. Solve 7z + 8 = sz for z. 2 Let s = -67 - -114. Suppose 0 = 16p + 15 - s. Solve 0 = -7v + 6v - p for v. -2 Let a(i) = -107i3 - i2 + 2. Let v be a(-1). Suppose -4s = 14c - 17c - v, -2s = 5c - 28. Solve -sl + 18l = 24 for l. -4 Let w = 64 + 95. Let v = -159 + w. Solve v = 4z - 2z - 6 for z. 3 Let l(g) = -278 + 553 - 43g - 285 + 2g. Let q be l(-1). Solve -16 = 35o - qo for o. -4 Let i(v) = 8v*2 - 36v + 10. Let p be i(5). Suppose 0q - 2q = -p. Solve -4n = -q + 7 for n. 2 Suppose -3g = 5z - 37, 2z + 2z = 4g + 36. Suppose -4067b + 3802b + 530 = 0. Solve -z = bx + 2 for x. -5 Let j(g) = g + 13. Let a be j(-8). Let n = 23559 - 23548. Let t be (-3)/((-2)/(-6)-1). Solve -t = as + n for s. -4 Let z(w) = -7w*3 + 175w*2 + 10w + 36. Let u be z(25). Solve -u = -15p - 196 for p. 6 Let z(f) = -2f*2 - 11f - 5. Let i be (-1)/(2/8) + 3 + -10. Let q be z(i). Let t = -122 - q. Solve t = 5x - 1 for x. 1 Let o = 4 - -7. Let i = o + -6. Let w(k) = -3k*2 - 212k + 75. Let d be w(-71). Solve -1 + i = -dr for r. -1 Suppose -5a + 105 = -2k, -a + 7k - 2k = 2. Solve -6j - 87 = aj for j. -3 Suppose 17g - 40 = 28. Suppose 0 = -2f - 2, gj - 9 - 11 = 4f. Let a(x) = 4x + 2. Let r be a(1). Solve -js + r = -s for s. 2 Suppose 0 = -a + 7r - 2r + 28, -2a - 5r = 19. Suppose -a = -t + v, 5t - 4v - 3 = 12. Solve t = 7u - 10u for u. -1 Let f = -3440 - -3440. Solve -45 = -fj - 15j for j. 3 Suppose -395p - 138 + 743 = -185. Solve 8x - p = 9x for x. -2 Let l be (3 + 1)/(0 + 1). Suppose 5r = -2o - 0 + 5, -4 = -4r - lo. Let t = 6 - 6. Solve t = j - r + 4 for j. -3 Let m = 681 + -669. Let z be 6/(-2) + 11 + 2. Solve 10 = -zt + mt for t. 5 Let u(a) = a*2 - 11a + 46. Let c(n) = -2n2 + 23n - 91. Let m(w) = 3c(w) + 5u(w). Let g be m(7). Solve 16r - gr = 50 for r. 5 Let y = 656 + -920. Let k be 16/28 - y/(-21). Let w = 13 + k. Solve 5 = 3m - w for m. 2 Let y = 364 + -207. Let v = 160 - y. Solve 1 + 2 = -vn for n. -1 Let x be 0/2 + (-1)/(3/273). Let v = 91 + x. Suppose 4p + p - 45 = v. Solve -5s + 11 = -p for s. 4 Suppose -7f + 586 + 1038 = 0. Let w = f - 206. Solve w - 6 = -5a for a. -4 Let s be (-3 - -6 - 6) + 2 + 1. Suppose 2g - 4g + 4 = 4n, -2g - 5n = s. Solve 0 = -8r + gr + 10 for r. -5 Let u(i) = 2i - 25. Let k(v) = -v. Let z(p) = -3k(p) - u(p). Let s be z(-22). Let m be (-4 - 1 - (-3 + s))/(-1). Solve 0 = -mx - 3 - 22 for x. -5 Let u be (-245)/(-6) + 123/41020/36. Solve 0 = f - u + 35 for f. 6 Suppose -q - 214 = v + 125, 4q + 1363 = 3v. Let a = q + 351. Solve -a = -4s - 7s for s. 1 Suppose 2k = 2u - 6, 2k - 317 = 3u - 325. Suppose 0 = -0m + 2m + 5l + 9, 3l - 5 = 4m. Let n be ((-2)/(-2))/(m/(-14)). Solve t + n = u for t. -5 Let n(t) = t*2 - 19t + 70. Let a be n(14). Suppose 5q + 11 - 11 = a. Solve 3s - 44 + 56 = q for s. -4 Let b = 6279 - 6269. Solve -727 = bw - 777 for w. 5 Suppose 5l = -2d + 191, -185 = -97l + 92l - 5d. Solve 10s + 79 - l = 0 for s. -4 Suppose -142x + 378 = -79x. Solve xf - 51 = -11f for f. 3 Suppose 2g + 8 = 2s - 0, -3s + 2g + 13 = 0. Suppose 143 + 207 = -sq. Let m = q - -70. Solve 20 = -mf + 4f for f. 5 Let a(m) be the first derivative of m4/4 - m3 + m*2/2 - 17m + 13. Let k be a(4). Suppose 2u = -ku + 20. Solve -10 - 2 = uw for w. -3 Suppose 0 = w + 5z + 1237 - 1408, 0 = 2z - 10. Solve -170x - 48 = -wx for x. -2 Suppose 30j - 11 = 79. Suppose -14o - jt = -19o + 33, 3o - 2t - 19 = 0. Solve -5g = o - 14 for g. 1 Let h(l) = 8l2 + l + 1. Let j be h(-1). Let o = -9230 - -9239. Solve 11i + o = ji for i. -3 Let y = 18 + -6. Suppose -y = -3m, m = -7t + 5t + 178. Let s = t + -85. Solve -h = sh - 6 for h. 2 Suppose 2y = -4 + 2. Let m be (y + 0 - (-8)/16)-4. Suppose mt - 5t = -12. Solve 0g + tg + 4 = 0 for g. -1 Suppose 2h = 7h. Let j(w) = -4w + 1. Let s be j(-3). Let c(r) = r*3 - 15r*2 + 27r - 7. Let l be c(s). Solve -2f + h = l for f. -3 Suppose -272 = -12a - 8. Suppose -180 = ab - 840. Solve 0y = -6y - b for y. -5 Suppose 3b - 134 = b. Suppose -bq = -65q - 8. Solve -q + 0 = 4d for d. -1 Suppose 0 = -93i + 749 + 1483. Solve n = i - 18 for n. 6 Suppose 2n + 40 = 12n. Let b be (-1 - (-4)/1)17/3. Suppose 0 = by - 15y - n. Solve f = -yf + 3 for f. 1 Let z(n) be the second derivative of n*3/6 - 7n*2/2 - 55n - 1. Let v be z(8). Solve v = 5d + 26 for d. -5 Let w be (-352222)/(-910) + 34/(-595). Solve -w = -3i - 378 for i. 3 Let i(z) = 71z + 4766. Let b be i(-39). Solve 2019 - b = -11u for u. -2 Suppose 0 = -2g - 10m + 5m + 195, -189 = -2g - 3m. Solve -gb + 91b = -3 for b. -3 Let u(o) be the second derivative of o5/20 + 23o4/12 - o3/6 - 9o2 - 78o. Let j be u(-23). Solve 0 = ja - a + 4 for a. -1 Suppose x + q = -13 + 116, -520 = -5x - 4q. Let o = 117 - x. Solve 0 = -3a - 0a - o for a. -3 Suppose -5k - 5j = 0, 8k + j = 10k - 15. Suppose 5u + 4h - 9 = 38, 4h + 23 = ku. Solve un - 15 + 1 = 0 for n. 2 Let m be 0/(55/25). Suppose m = -7v + 56 + 28. Let a(n) = -9n - 24. Let j be a(-3). Solve -v = -3f - j for f. 3 Suppose -40q + 698 - 600 + 11062 = 0. Solve 9g = -315 + q for g. -4 Suppose -4y = 3o - o + 12, 0 = -5o + 5y. Let a be (-38 - -36)/((-7)/3 - o). Solve -11d - a = -14d for d. 2 Suppose -16100 - 913 = -107m. Solve -134 + m = -5k for k. -5 Let p = -6879 - -6882. Solve -pa - 24a = -81 for a. 3 Let p = 191 - 191. Suppose p = 3h - 0l + 5l + 14, -5h + 6 = l. Solve -18 = 4x - h for x. -4 Suppose -143 = 7f - 1739. Let d = f - 226. Solve j + dj + 6 = 0 for j. -2 Let p(k) = -5k. Let g be p(0). Suppose gw + 20 = 4w + 4m, -45 = -5w - m. Solve 3c - w = 2 for c. 4 Let g = -5 + 21. Let u = -13 + g. Suppose 5i = 3v, -8v = 5i - 7v. Solve u = -is - s for s. -3 Suppose 181x + 204 = 187x. Suppose 4i - 2c = x, 4i + 4c = -c + 13. Solve -iz + 4 = -5z for z. 2 Let i = 12 + -9. Suppose 4z - 9 = iv + 35, -v = 2z - 22. Solve -4j + z + 5 = 0 for j. 4 Suppose 24x = -1187 - 61. Let z be x/(-20) + 10/25. Solve -5n - z = -13 for n. 2 Suppose z - 51h + 54h = 13, -5z = -3h - 137. Solve -zf - 155 = -56f for f. 5 Suppose -5o + 2 + 18 = 0. Let d = 568 - 550. Let l be (6/d)/(o/36). Solve -2v + lv = 1 for v. 1 Let o be 12((-1)/(-12))/(29/116). Let i = 6 - 3. Suppose -22 = -ox - 2n, -i = -3x + n + 11. Solve xw = 2w for w. 0 Suppose -920 = -4f + 423 - 271. Solve -272b = -fb - 24 for b. 6 Suppose -12a -	{ "pile_set_name": "DM Mathematics" }
(b) u (c) n b Let l(r) = -r*2 + 13r - 39. Let n be l(6). Let x = 7.5 - 5. Let m = x + -0.5. Which is the closest to -0.06? (a) m (b) 1 (c) n b Let o = 0 + 4. Let j be o/(-26) - 8/(-390). Let s = j + -1/105. Which is the nearest to 0.1? (a) s (b) -3 (c) 1 a Let w be 8 + -11 + 70/22. Let h be (5/(-45))/((-2)/4). Let f = -4 + 3.9. Which is the closest to w? (a) f (b) h (c) 5 b Let h = 0.5 + -0.3. Suppose -11 - 1 = g + 2k, -2k = -2g - 12. Let f be 36/g + (-1 - -5). Which is the nearest to f? (a) h (b) 4 (c) 2/5 a Let m = 3.131 + -0.131. Which is the closest to -1/2? (a) -0.4 (b) m (c) 0.2 a Let v(u) = u3 + 17u*2 - 2u - 34. Let j be v(-17). Which is the closest to 1/4? (a) 5 (b) j (c) -45 (d) -2/11 b Let o = -643 + 639. Let n(s) = -10s3 - s2 - s. Let g be n(-1). Suppose -g = p - 3f, 4f - 14 = -2. Which is the closest to p? (a) 2/15 (b) o (c) -0.1 c Let u be (-2)/(-4) + (-1)/14. Let y(t) = -t3 - 8t*2 - 8t - 10. Let m be y(-7). Which is the closest to 2/7? (a) m (b) u (c) 0.2 c Let y = 23 - 21. Let o = 65/2 + -461/14. What is the closest to 0.1 in y, o, -2? o Let f = 4489/10 - 5843/10. Let j = f - -135. Which is the nearest to -2? (a) j (b) 0 (c) 0.5 a Let g = -258.1 + 258. Let v = -28/13 - -334/143. Which is the closest to g? (a) 3/2 (b) -5 (c) v c Suppose 29p + 235 = 24p. Let r = -45 - p. Which is the closest to 0.2? (a) 1 (b) r (c) 1/8 c Let t = 591 + -592. Which is the closest to t? (a) -0.4 (b) -2/3 (c) -1 c Let t = -0.0389 - 4.9611. Let l = 42 + -127/3. Which is the nearest to l? (a) t (b) 6 (c) -4 c Let g be (-3 - 2)((-30)/5 + 5). Which is the nearest to -1? (a) 0 (b) g (c) 2/15 (d) 2/5 a Let r = -2.859 - 1.141. Which is the nearest to -2? (a) r (b) -2 (c) 0.2 (d) -37 b Let u be 3/(3540/1184 - 3). Let h be (-2)/6 - u/960. Let k = h + -9/40. Which is the nearest to -1/4? (a) -1 (b) k (c) 0.4 b Let k be (-4)/18 + 2/(-18). Let n = -35 - -15. Let b = n - -17. What is the closest to -1 in 0, k, b? k Let z = -275 - -273. What is the closest to 1/3 in z, 1/2, -0.2? 1/2 Let j = 2 + -3. Let c be (-252)/(-5460) + 1/(-5) + 0. What is the closest to j in -1, c, -0.4? -1 Let n = -1.1 + 0.1. Let d = 6.2 - 6.126. Let v = -0.074 + d. Which is the nearest to n? (a) 2 (b) 4 (c) v c Let r = 0 - 2. Let h be 108/231 + r/7. Let k be (-8 - -12) + (-4 - 1). Which is the closest to 1? (a) h (b) 0 (c) k a Let j(m) = -m2 - 38m - 282. Let r be j(-10). Let f be -2 - ((-9)/21 + -3). Which is the closest to 2? (a) r (b) 2/7 (c) f c Suppose -6v + 2v + 12 = 0. Let w be (1/3)/((-2)/v). Let u = -3 - -6. Which is the closest to w? (a) 5 (b) -3 (c) u b Let q = 1.92 - 0.22. Let z = 22.6 - 20.3. Let d = q + z. Which is the nearest to -0.2? (a) -0.03 (b) 1 (c) d a Let o = 1.2 - 0.2. Suppose 6 = -4v + 3a - 8, -4v + a = 18. What is the nearest to -0.2 in o, 5, v? o Suppose 5v + 12 - 82 = 0. Which is the closest to v? (a) 5/2 (b) 0 (c) -5 a Let s = -3.9 + 4. Let j = 31/2 - 15. Let u = 7 - 6. What is the closest to s in j, 0.2, u? 0.2 Let u = -7 - -10. Let f be (-1 + u)2/26. Let j = 4 - 1. What is the nearest to 0.1 in f, 0.5, j? f Let y = -54.9 + 91.9. Which is the closest to -1/3? (a) 3 (b) 1/3 (c) y b Let p = -0.321 - 0.779. Which is the nearest to 0.2? (a) p (b) 5 (c) -0.5 c Let y = -4 + 5. Let g be (13/(-4))/(-1) - 2. Which is the nearest to g? (a) y (b) -2/3 (c) 1/5 a Let d = 136.5 + -136. What is the closest to -2/5 in d, 0.4, -21? 0.4 Let r be 14/(-8)996/(-1162). Let d = 2 - 3. Let q = -0.1 - -0.2. What is the closest to d in 4, q, r? q Let k = -32 + 28. Let j be 1-6(-20)/(-35). Let u = 127/35 + j. What is the closest to -0.2 in u, k, -0.2? -0.2 Suppose 3t + 75 = -2t. Let f be 8/20 - (-16)/t. Let n = 3.2 - 3. Which is the closest to f? (a) -1 (b) -0.3 (c) n a Let l = -7/16 - -1/16. What is the nearest to 2 in 0.5, l, 9? 0.5 Let p = -2.952 + 0.052. Let y = 2.8 + p. Which is the closest to 0.1? (a) -0.3 (b) -4 (c) y c Suppose 8 = 2w - 6w. Let n = -4.8 - 0.2. Let o = n + 4.5. What is the nearest to 6 in w, -2/3, o? o Let o be (-1 - (-46)/44)/(3/(-12)). What is the nearest to 0.3 in -0.3, -11, -3/7, o? o Suppose -c = -4s - 3c + 354, -20 = -4c. Let x be (-2)/((-140)/s) - (-20)/(-25). What is the closest to -0.1 in -3, x, -5? x Let d = -3 + 0. Let k be ((-20)/360)/(2/(-8)). Let x = -1 - -2. What is the closest to 0 in x, k, d? k Let u = -27.9 + 27. Let g = 1.05 - 0.55. Which is the nearest to -2/7? (a) 1 (b) g (c) u c Let b = -1.2 + 1.26. Let q = 0.27 - b. Let w = q + -1.21. What is the nearest to 0.1 in -5, -0.3, w? -0.3 Let u(d) = -d3 - 2d - 3. Suppose -4h = -2k + 7 + 3, 0 = k + 2h + 7. Let t be u(k). What is the closest to 0.1 in -0.4, t, -0.2? t Let z = 330 - 330.2. Let w be (-1236)/105 - (-9)/3. Let l = w - -67/7. What is the nearest to l in -2, -2/3, z? z Let z = 60/109 + -131/436. Let n = 0.3 - 0.3. What is the nearest to -0.1 in 2/3, z, n? n Suppose 2p - 3d - 17 = -3, 5d = p - 7. Suppose 8 = -3o - p. Let t be (27/36)/(18/(-16)). Which is the closest to 1? (a) o (b) 0.5 (c) t b Let z = -0.069 - -0.106. Let f = 19.963 + z. Let o = f - 19.8. Which is the closest to -1/2? (a) o (b) 2/5 (c) -2/11 c Let f = -102 + 102. Let k be (-2)/(-5) - 18/70. What is the nearest to -2/9 in f, -1/6, k? -1/6 Let y = 145671/17 - 8569. Let z = 5 + 1. Let x = z + -1. What is the closest to 2 in -0.1, y, x? -0.1 Let w = -1.02 + 1.535. Let o = -0.015 + w. What is the nearest to -4 in 1/7, o, -0.5? -0.5 Let y = -383.1 - -383. What is the closest to -2 in y, 3, -1/3? -1/3 Let x = -0.87 + -69.13. Let g = x - -67. Let v = 1 - -2. Which is the nearest to 2/3? (a) v (b) g (c) -1 c Suppose 2u + 15 = u + 4z, 4u - 4z + 24 = 0. Let y = -10 - -10.4. Let j = 0.5 - y. Which is the nearest to -1? (a) u (b) 2/5 (c) j c Let d = -2/341 + 64/341. Let t be 6/10 - 4/(-10). Which is the closest to t? (a) d (b) -7/5 (c) -1 a Let o = 28 + -70. Let w = -41.6 - o. Which is the closest to -1? (a) -2/9 (b) w (c) 4 a Let h = -2 + -1. Let f = -1322/63 + 194/9. Let z = 382 - 383. Which is the nearest to z? (a) f (b) h (c) -2 c Let q = -38 + 38.4. Let v = 3.9 - 0.9. Let p = v - 2.5. Which is the closest to -2/5? (a) q (b) p (c) 1/4 c Let h(z) = 12z - 24. Let p be h(3). Let i be (-20)/p - (-20)/15. Let x = 0.2 - 0. Which is the nearest to i? (a) -2/7 (b) 0.3 (c) x a Let d(f) = -f + 9. Let w be d(8). Let i(y) = -y*2 - 24y - 59. Let t be i(-21). Which is the nearest to 3? (a) w (b) t (c) -3/7 b Let t = 8717/16 - 545. Which is the closest to 1/3? (a) 3/4 (b) t (c) -0.2 a Let z = -0.91 - -0.91. Which is the nearest to z? (a) 1/5 (b) -0.1 (c) 5 b Let d be ((-3)/6)/((-1)/(-8)). Let i(o) = o + 8. Let z be i(d). Let y be 5/(2/z-2). Which is the nearest to 0.1? (a) 2 (b) 1 (c) y b Let u = 310.6 + -285.71. Let p = 29 - 54. Let b = u + p. What is the nearest to -0.1 in 2/5, -1/2, b? b Let o = -38 + 112/3. Let u = 0.25 - 0.1. Let s = u + -0.55. Which is the closest to o? (a) 2/5 (b) -0.1 (c) s c Let p = 353 + -356. Which is the nearest to 1? (a) p (b) 0.4 (c) 1/6 (d) -2 b Suppose -6s = -4s + 10. Let t = -15.53 + 15.93. Which is the nearest to t? (a) 0.4 (b) -1/2 (c) s a Let y be 7/(-5) - (-1 + 0). Let j = -8.3 - -82.3. Let p = j + -74. Which is the nearest to p? (a) 4 (b) -0.2 (c) y b Let j = 0.2 + -0.2. Let u = 18/1627 - 1699/6508. What is the nearest to 0.2 in -5, j, u? j Let y = -5.06 + 0.06. Let d = 5 - 3. Let r = 4.17 - -0.83. Which is the nearest to 0.1? (a) r (b) d (c) y b Let y = 14 - -11. Let z = -25.4 + y. Which is the nearest to -0.3? (a) 0 (b) z (c) 4 b Let i = -8 - -7.95. Let m = -0.45 - i. Which is the nearest to -2? (a) m (b) -2/17 (c) 0.1 a Let p = 6 + 5. Let v = 8 - p. Which is the nearest to -0.1? (a) -1.6 (b) -0.2 (c) v b Let f = 168.2 - 168. Let n = 31/14 - 12/7. Which is the nearest to n? (a) 3 (b) f (c) 5 b Let n = 10323/11 + -939. Which is the closest to 2? (a) -0.1 (b) 8 (c) n (d) -0.2 a Let h = -19 - -19.2. Let x be 1 - (-3)/(3 + -2). What is the closest to h in 1/4, x, 5? 1/4 Let y = 0.528 + -0.328. Which is the closest to -1.71? (a) 0.5 (b) y (c) 2/7 b Suppose 5i + 2k - 58 = 0, 0k + 2*k	{ "pile_set_name": "DM Mathematics" }
factor of 3 and i? 3 Suppose -h + 2j + 4 = -11, 5h = 2j + 43. Let u be 153 - (h - 6). What is the greatest common factor of u and 11? 11 Let o be (-4)/18 + (8/(-36))/(-1). Suppose 4d - 456 = -od. What is the greatest common factor of d and 6? 6 Suppose -12x - 411 + 435 = 0. Calculate the greatest common divisor of x and 54. 2 Let q be 7/28 + 10/(-8). Let r be -1 + q + 2 + 3. Let k(n) = -n3 + 3n*2 + n - 1. Let c be k(r). Calculate the highest common divisor of c and 2. 2 Let k be ((-60)/(-9) + -3)75. Let s(q) = -q*3 - 6q*2 + 7. Let p be s(-6). Let u be 102/4 + p/(-14). What is the greatest common divisor of u and k? 25 Let f(d) = 9d*3 + 2d*2. Let y be f(2). Suppose -13h = -18h + y. Calculate the highest common divisor of h and 64. 16 Let r = -252 + 344. What is the greatest common divisor of 828 and r? 92 Suppose -x + 84 = 13x. What is the highest common divisor of x and 13? 1 Suppose -5u + 54 = -2k, 2k - 4u = 30 - 88. Let c = k - -363. Suppose c = 6q - 94. Calculate the highest common factor of q and 10. 10 Let u = 190 - 109. Let b(p) = -p3 - 4p*2 - p - 1. Let y be b(-4). Suppose yn = -3n + 54. Calculate the greatest common factor of u and n. 9 Let t(l) = -l2 - 27l - 101. Let a be t(-22). What is the greatest common divisor of 3087 and a? 9 Let i = -141 - -246. Let a(r) = r*3 + 19r*2 + 25r + 17. Let n be a(-18). Let x = n - -130. Calculate the highest common factor of x and i. 21 Let b(q) = -10q3 + 1. Let r be b(-1). Let n = 19 - r. Let v = 58 - 26. Calculate the greatest common divisor of n and v. 8 Let l = 50 - 29. What is the greatest common divisor of l and 56? 7 Let x be -1 + 2 - -14 - (8 - 12). Suppose -g - x + 45 = 0. What is the highest common factor of g and 2? 2 Let c = 854 - 692. Calculate the greatest common divisor of 2 and c. 2 Let n = -71 + 45. Let h be (n/5 + 4)-60. What is the greatest common factor of h and 9? 9 Let p(g) = 2g2 + 22g - 110. Let m be p(4). Let i(h) = -5h. Let s be i(-5). Calculate the highest common divisor of m and s. 5 Suppose -4j = -0j + 40. Let t = j + 48. Calculate the greatest common factor of t and 95. 19 Suppose 0w + 1080 = 6w. Calculate the greatest common factor of 130 and w. 10 Let b(x) = 29x + 7. Let p be b(-3). Let h = 203 + p. What is the highest common factor of 82 and h? 41 Let m(z) = -81z + 6. Let c be m(0). What is the greatest common divisor of 384 and c? 6 Let n(g) = 13g*2 - 34g - 120. Let v be n(-11). What is the greatest common divisor of v and 29? 29 Let p be -61/(-18)30. What is the greatest common factor of p and 14? 2 Suppose -24 + 8 = -l + 2x, -124 = -5l - x. What is the highest common divisor of 84 and l? 12 Let g(f) = 2f2 - 6f + 17. Let a be g(2). Suppose 18 = 2i - 8. What is the highest common divisor of i and a? 13 Suppose -825 = -3d + 5h, -10d + 546 = -8d - 2h. Calculate the highest common factor of 585 and d. 45 Let j = -88 + 128. Calculate the highest common factor of 16 and j. 8 Suppose -h - 37 + 366 = 0. Let w be h/284/1. Suppose -2g - 5z = -w, -4 = 2g - z - 33. What is the highest common factor of g and 24? 8 Suppose -2376 = -30s + 21s. Suppose -189 + 69 = -5a. Calculate the greatest common divisor of a and s. 24 Let z be ((-2)/(-8))/(6/129297618). Calculate the highest common divisor of 41 and z. 41 Let v = 207 - 306. Let l = -83 - v. Calculate the highest common divisor of 16 and l. 16 Let w = 35 - 33. Suppose -wy + 32 = 2y. Let b(v) = 2v2 + v - 2. Let g be b(2). Calculate the greatest common divisor of g and y. 8 Let c(r) = -r2 - 2r + 50. Let i be c(6). Suppose -l - il = -48. What is the greatest common factor of 12 and l? 4 Let p(x) = 2x + 42. Let d be p(-16). Suppose 9h - 28 = -d. What is the highest common divisor of 38 and h? 2 Let d = 87 - -111. Let y = 4169 - 4147. Calculate the greatest common divisor of y and d. 22 Let p(q) = -89q + 184. Let j be p(-4). What is the highest common factor of 20 and j? 20 Let r(l) = -41l + 396. Let z be r(0). Calculate the greatest common divisor of z and 44. 44 Let t be -13(2 - 1 - 4). Let x = t + -38. Calculate the greatest common divisor of x and 9. 1 Let d(b) = 7b2 - 20b*2 + 14b2 - b - 6 - 18. Let r be d(6). Calculate the highest common divisor of r and 114. 6 Let y(j) = -j3 - 14j2 + 6. Let k be y(-14). Suppose 0 + k = -3d. Let x be d/(-3)(44 + -14). Calculate the highest common factor of x and 5. 5 Suppose 3o = -17s + 15s + 1504, 2s - 1494 = 2o. Calculate the greatest common factor of 7 and s. 7 Let l = 39 - 12. Suppose 13 = 4o - l. Calculate the greatest common divisor of o and 10. 10 Suppose -2k - t = -33, 0t = -4k + 4t + 60. Let a = -17667 + 17731. Calculate the highest common factor of a and k. 16 Suppose 30a = 8a + 990. Let x be 84/2(-6)/7. Let r be 8/x + 328/18. Calculate the highest common divisor of r and a. 9 Let a be -1 - ((10 - -2) + (-4 - -3)). Let x be 1/((30/(-105))/(a/7)). What is the highest common divisor of 42 and x? 6 Let m = -58 - -64. Let v be 18/4(-12)/(-27). Calculate the highest common factor of v and m. 2 Suppose -2j - 3y + 68 = 0, -2j - 2y = -y - 76. Let o be 5 - 0 - (5 - 5). Calculate the greatest common factor of j and o. 5 Let o be 9/(-15)630/(-7). Calculate the greatest common divisor of 18 and o. 18 Let w = -146 + 231. Let u = -57 + w. What is the greatest common factor of u and 112? 28 Let g be (-1)/((9/(-1))/3 - -2). Let o be (-3 + 35)g + -2. Calculate the greatest common divisor of o and 15. 15 Let x(r) = 696r3 - r2 + 4r - 3. Let n be x(1). What is the greatest common factor of n and 87? 87 Suppose 3v + 5i - 31 = -0i, 0 = -3v + 5i - 19. Let t = 25 - 15. What is the greatest common factor of t and v? 2 Suppose -13 = -7a + 22. Calculate the greatest common factor of a and 445. 5 Suppose 26t - 660 = 23t. What is the greatest common divisor of 20 and t? 20 Let o = 30 + -19. Let s = 303 + -182. What is the highest common factor of o and s? 11 Let y = -779 - -803. What is the highest common divisor of 768 and y? 24 Suppose -3n + 230 = 5g, -5n = -g + 4g - 394. What is the greatest common factor of 176 and n? 16 Suppose 2y - 7 = q, 3q + 4 + 3 = -y. Let p = 52 + q. Let g = -35 + p. What is the highest common factor of g and 14? 14 Let t be 1512/(-96)40/(-3). What is the highest common divisor of t and 150? 30 Let p(v) = 3v2 + 8v - 10. Let y be p(2). Suppose o + o = 396. What is the highest common factor of y and o? 18 Let b be (114/(-15))/((-4624)/(-1160) + -4). What is the highest common factor of 58 and b? 29 Suppose -5x = -48 - 87. What is the highest common divisor of x and 36? 9 Let l be 2230/5 - (-2)/(-1). Let w be l/9 - (-2)/(-6). Let v = 81 - w. What is the highest common divisor of 16 and v? 16 Let u(h) = -h2 - 5h + 8. Suppose 4 + 26 = -5f. Let p be u(f). Suppose -pc = 3c - 200. What is the greatest common divisor of c and 60? 20 Let m(d) = -d3 - 31d*2 + 3d + 168. Let c be m(-31). Calculate the greatest common divisor of c and 100. 25 Suppose -n + 5 = 4c + 17, 0 = -2c - 10. Calculate the highest common factor of n and 336. 8 Suppose -2 = -z + 23. What is the highest common factor of z and 75? 25 Let j be 3 - -1 - 281/(-1). Let f(a) = -a2 + 4a - 1. Let s be f(6). Let z = s + 29. Calculate the highest common divisor of j and z. 16 Let o(d) = 8d2 - 58d + 62. Let y be o(8). What is the greatest common divisor of y and 594? 22 Suppose 2r - 76 = -0s + 2s, 0 = -r + 4s + 26. Calculate the greatest common divisor of r and 224. 14 Let l(y) = 4 + 15y + 3 - 5y - 11y. Let b be l(-3). Let g = b - 2. What is the greatest common divisor of 4 and g? 4 Let j(t) = -3t - 13. Let b be j(-7). Let y be (b/8)/((-2)/(-18)). Calculate the greatest common divisor of y and 63. 9 Let p(n) = n + 14. Let t(y) = 5. Let a(g) = 4p(g) - 11t(g). Let o be a(2). Calculate the greatest common factor of 9 and o. 9 Suppose -u - 27 = 2u. Suppose g = 3v + 16, -5g + v + 108 - 42 = 0. Let n = g + u. What is the highest common factor of n and 28? 4 Let p be (6/4)/(114/17024). What is the highest common divisor of 616 and p? 56 Let j = 65 + -63. Suppose 3q = -js + 57, s + 4q - 108 = -3*s. What is the highest common factor of 3 and s? 3 Let z be (1	{ "pile_set_name": "DM Mathematics" }
value of (153/(-78))/(1015/26390)? -51 4235/1155120/66 20/3 What is the value of 8/(-175)600/480? -2/35 1209/(-2015)(-4)/31 4/5 Evaluate 3131/((-1736)/(-14))(-8)/33. -2/11 Evaluate (3087/(-19404))/((-98)/(-112)). -2/11 Evaluate (((-2426256)/(-830))/203)/((-18)/(-80)). 64 What is ((3485/23698)/((-50)/(-85)))/(2/(-688))? -86 Calculate (-21)/(-16)(-195)/117((-144)/10)/(-36). -7/8 Evaluate ((2/(-21))/(1/(-54)))/(401/2807). 36 Calculate (6/(-4))/((9/930)/(9773/35405)). -31 Evaluate (-95)/9(-9536)/90592. 10/9 What is the value of (666/370)/(99/(-6710))? -122 What is the value of (21/2009733)/(2/1(-20)/(-80))? 2/29 What is ((-299)/(-253))/(7605/117)? 1/55 (18/(-126))/(3/(-7))5/((-160)/(-32)) 1/3 Calculate 22/(6776/(-14652))14/6. -111 What is the value of -3162(-5)/(-25)300/360? -16 Evaluate 7/(212583/3824/12). 2/53 Evaluate -6(-73)/((-11169)/34)45/155. -12/31 What is ((-16)/3585/1092)/(54/21)? -10/9 What is the value of -390(15436/(-408))/227? 65 What is the value of (47/1)/(-9-5(-1)/45)? -47 Calculate (-72)/(-180)((-1625)/26)/25. -1 Calculate 90/(-7722)-261/(-4)52/65. -2/33 Calculate ((-18090)/5226)/((-165)/130)2/8. 15/22 What is the value of ((-6)/(-5))/((9/1)/((-2046)/682))? -2/5 What is 155/((-20460)/726)(-18)/11? 9 What is (1/62)/(2/(-20)(-345)/15318-37)? -6/31 Calculate (11/(-99)3)/(6417/408). -1/8 Calculate ((((-2)/(-18))/(18/540))/2)/(283/12735). 75 Calculate (61(-18)/(-2745))/(24/(-5)). -1/12 Calculate 73/(-4380)(-90)/12. 1/8 What is 45/16(-68)/17024/108? -1/4 Evaluate (((-192855)/(-92))/65)/(6/(-8)). -43 What is the value of (9/156)/(174/30160-26)? -5/13 What is 35/42418/10? 6 What is 110/18(-44964)/(-1423860)? 1/57 What is (15/(-125)148/370)/(-1(-6)/20)? -4/25 45/(-50)(2989/(-61))/(-98)2/(-3) 3/10 Evaluate ((-4986)/(-9972))/((-2)/(-234)). 17 Calculate 182/(-26)165/(-33). 35 (-4)/528250/175189/12 -3/44 Calculate (257/(-4369))/(50/170). -1/5 Calculate 2133/158(-6572)/(-1674). 53 Calculate ((-64200)/42800)/((-4)/(-10)). -15/4 Calculate 195/702263. 35 What is -4(-49)/(-42)(4402/(-651))/(-71)? -4/9 Calculate (-3)/((-32)/(-1016)1(345/(-92))/(-5)). -127 Calculate (-6417)/3723/(18/(-16)). 46 Calculate 2135/(-14)(-82)/(-7995)39. -61 ((-20)/(-16))/(92910/1956) 1/38 (-1(-14)/56)/(-2)(-2)/((-12)/(-9)) 3/16 What is (131/(-11004))/((-6)/(-24)32/(-28))? 1/24 What is -184/(-120)((-20405)/132)/(-53)? 7/4 Evaluate (3/106)/((-468)/3900). -15 ((-42)/54)/(5/6120/150) -7/6 What is (77(-570)/(-627))/(36/(-4))? -70/9 Calculate ((4/(-49))/((-632)/553))/((-25)/(-20)). 2/35 What is (1/(8(-105)/240))/(2/224)? -32 (30(-18)/840)/15 -3/70 Evaluate (-5280)/(-90)837/(-2232). -22 What is 4/(-2)((-12)/(-90))/((-192)/22320)? 31 What is the value of ((-27)/135)/(32/(-180))6/(-9)? -3/4 What is the value of (-548768)/(-65478)14/48? 22/9 Evaluate (-20)/(-14)(-18060)/(-344). 75 36/(-21)5/((-110)/42) 36/11 Evaluate ((-12)/(-10))/((-14)/245)(-4836)/1092. 93 What is the value of ((-3)/(3/7))/(-23)-56(-82)/32144? 1/23 What is (8/11)/(-9(-70)/189)? 12/5 What is the value of (6/(-4)1)/(6/(-16)440/1650)? 15 What is the value of (((-32)/70185/74)/2)/((-1)/84)? 48 What is the value of (-10)/(-366)((-4326)/(-309))/(14/1210)? 2/61 Calculate 4-12-44(-545)/28776. -20/3 Calculate (-150)/90(-64)/(-400). -4/15 Calculate (1722/(-861))/(((-336)/224)/(2/((-16)/690))). -115 What is -152(36/(-918)-34)/(2/(-2))? 40 Evaluate 17-1(-22906)/29954. 13 (-755)/604608/62700 -2/165 Evaluate (50258/106315)/(156/40). 4/33 Evaluate ((-1)/((-2)/3))/((9/60)/((-1015)/(-157325))). 2/31 What is the value of (1/(-80))/(-49(-140)/(-68600))32/106? 2/53 What is (-7)/(-10((-30)/20)/(-1))? 7/15 What is the value of 1(-1245)/(-9)((-9306)/(-1175))/66? 83/5 235/(-245)21/(-108) 1/18 Evaluate (-444)/5(-27090)/(-21672). -111 Evaluate (-82)/(-123)(396/(-104))/11. -3/13 Calculate (43/(-35690))/((-9)/(-15))-12. 2/83 (18/75)/((-1428)/(-280))4/(64/(-120)) -6/17 What is (((-3)/(135/(-140)))/((-2)/(-3)))/((-563)/10134)? -84 Calculate 250/(-5)(40/(-70))/(5/(-140)-8). 100 What is (80/(-2800))/((2/(-20))/((-2)/(-4)))? 1/7 What is the value of (((-4)/10)/(8/(-5)))/(-4(-682)/(-4224))? -12/31 Evaluate (101272/50636)/((2/36)/(3/(-20))). -27/5 What is the value of (-6)/(-10)(-970105)/(-5763)? 101 ((36960/(-275))/56)/6 -2/5 Calculate (-120)/62402/88/(-20)10. 1/52 Calculate ((-6)/63(-70)/(-5))/(306/(-27)). 2/17 ((-1)/2-2)/((-24293)/(-1429)) 1/17 Evaluate ((-2)/(-38))/((-692)/407588). -31 What is (-270)/(-153)(-45798)/(-74085)? 12/11 (-15)/5070-362028/468 6/13 81/(-9)4/(-414)(-2)/4 -1/23 Calculate ((3996/(-54))/74)/((-1)/(-104)). -104 Evaluate (11(-54)/(-1683))/(((-8)/34)/(-4)). 6 Calculate (896/304)/((-21)/399). -56 What is the value of -11122/121(-48)/11184? 2/233 Evaluate (6/(-2))/(((-49005)/(-630))/363). -14 Evaluate (15/((-7875)/50))/((-3)/(84/(-4))-3). 2/9 What is ((-3)/75)/((-98)/(-2695))(-14)/385? 1/25 What is ((17472/80)/42)/(1(-13)/(-325))? 130 What is the value of ((22560/(-300))/(-94))/((-2)/80)? -32 What is the value of (24/(-112))/((3876/(-665))/34)? 5/4 What is the value of (16/(-100))/((-58)/6525)? 18 Calculate (739/455)/((-153)/(-1955))6. 46 What is -2(-4615)/10(-12)/(-156)? 71 What is the value of 216/(-12636)1331? -2/3 Evaluate (-1232)/(-14)6/(-16)(-3056)/(-2292). -44 (-18496)/(-2720)((-3)/15)/(168/(-350)) 17/6 What is the value of 160/(((-29792)/(-38))/49)? 10 Calculate (-27024)/(-5067)(-54)/64. -9/2 Calculate (40/(-200)85)/(-1)2/2-2. -34 What is (80/12)/((-10)/((-1170)/117))? 20/3 What is 90/(-21)35/45-518/20? 68 What is the value of ((36/(-308))/(-9))/((33/154)/(3/4))? 1/22 What is the value of ((-5390)/28)/5584/26215(-10)/(-6)? -2/107 What is the value of 107/(-1391)15158/44? -53/2 (-17)/(102/72)(1092/616)/(-39) 6/11 What is the value of ((-475)/133)/(-25)3/(((-117)/42)/(-1))? 2/13 What is the value of (((-198500)/400)/(-397))/((15/(-144))/(-5))? 60 What is the value of ((-13)/(-650))/(644/(-828)(-24)/70)? 3/40 What is ((-6237)/(-540))/(399/76)? 11/5 What is ((110/880)/(1/(-4)))/((-31)/(-806))? -13 Evaluate ((-278656)/17416)/((3/15)/(-1)). 80 What is 1755/409/(7371/91)? 39/8 Evaluate 5/(15/6)-1(-17)/(-680)20. -1 What is the value of 42/(-42)81/(-3888)? 1/48 Evaluate (3/(-45))/((-8)/15(-120)/80). -1/12 What is (((-186)/(-1302))/((-2)/36))/(15/(-245))? 42 (-6)/10655/1029664 -2/131 -33(-66)/181550/(-26) -30/13 What is (30/(-450)15)/(-3(-2)/(-186))? 31 What is the value of 6/56(-113)/((-339)/232)-7? -58 Calculate ((-2)/(-5))/2515/(-618)(-12)/22. 1/11 What is 56(-4)/(720/270)? -84 What is (212/4242/(-24))/(5/(-155))? 31 What is the value of (407/(-74))/((-10)/4)26/(-936)-18? 11/10 17248/704176/231 56/3 What is the value of (2/(14/3)(-4522)/798)/((-4)/4)? 17/7 470/(-3290)3/((-8)/(-12)9) -1/14 Evaluate (-40)/3420/350. -16 What is 50/(-8)314/3925? -1/2 What is the value of ((-64148)/79)/581-1? 14 What is 166/1494(-36)/294? -2/147 Evaluate ((442/234)/17)/(5/(-30)). -2/3 Evaluate ((-3)/542-12)/((-114)/7011). -82 What is ((-378)/14770/100)/(6/(-170))? 51 (1482/494)/((-1)/((-6)/9))(-94)/4 -47 What is the value of -1-57(-52)/63726? -2/43 What is (-4)/365967/(-5083)6? 18/23 What is the value of ((-60)/96)/((-360)/96)476/(-21)? -34/9 (-102)/16(-7)/375/((-27300)/(-104)) 17/4 What is (5/(-2))/(1704/77248)4(-6)/20? 136 Calculate (-15)/(-48)27/(-45). -3/16 (-40)/(-25)(-3920)/(-59584) 2/19 (-80)/(-98000)-75(-14)/(-8) -3/28 What is ((-6)/8)/((-309)/(-3296))? -8 Evaluate (-558)/(-372)(-208)/((-32)/(-4)). -39 What is 20/(-6)406/3045? -4/9 ((-18)/(-22599))/((-1656)/44712) -2/93 Evaluate (-32760)/(-624)(240/(-28))/5. -90 Calculate ((-131720)/72446)/((-2)/(-11)). -10 What is the value of (40/3)/(-5)(-45240)/4640? 26 Calculate (-9570)/638(-1)/((-12)/(-28)). 35 Evaluate 3724/55860(-10)/(-24). 1/36 Calculate (858/3003)/((-30)/945). -9 ((-15603)/(-18575))/(24/1800) 63 Evaluate (6/252)/((-1)/(-15))350/1000. 1/8 Evaluate (292/3942)/((-3)/1863). -46 (-576)/(-336)8/(168/(-49))20 -80 Calculate ((-708)/(-5310))/((-28)/42). -1/5 Evaluate ((-8)/3842136)/(6/12). -89 What is ((-28)/(-10))/(-280104/(-353600))? 34 Calculate (-432)/(-24)*(-765)/306. -4	{ "pile_set_name": "DM Mathematics" }
4 + 0h*n wrt h. 12h*3 Let a(f) = -15f*2 + 3f + 68. Let p(l) = -31l2 + 5l + 135. Let j(x) = 5a(x) - 3p(x). Differentiate j(r) wrt r. 36r Let y(q) = 223q*5 + 6q*3 + 8q - 104. Let l(z) = -2z5 + z3 + z - 1. Let m(a) = 6l(a) - y(a). What is the second derivative of m(p) wrt p? -4700p3 What is the third derivative of -877z*3 + 251z*2 - 158z*2 - 136z*2 wrt z? -5262 Let q be (0 - 7)25/(-35). What is the second derivative of -5n5 + n3 - 14n - n*3 + 8n*q wrt n? 60n*3 Let f be -3(0 + (2/(-6) - 1)). Let h(o) be the first derivative of o*2 + 0o*3 - f + 5/4o*4 + 0o. Find the second derivative of h(t) wrt t. 30t Find the third derivative of -7 + 47c*2 + 2c*4 - 219c*6 - 2c*4 - 45c*2 wrt c. -26280c*3 Let m(b) = 3 - 1 - b + 6 - 1. Let s be m(5). What is the second derivative of -5i*2 - 9i*2 + 2i + 15is wrt i? 2 Let h(i) be the first derivative of -i3/3 - 6i*2 - 270i + 266. What is the first derivative of h(d) wrt d? -2d - 12 What is the second derivative of -271n*5 - 133n - 105 - 93n + 227n wrt n? -5420n3 Find the third derivative of -8g*3 - 15g*2 + 11g*5 - 44g*5 + 11g*5 - 23g*3 + 18g*5 wrt g. -240g*2 - 186 Let g(s) = -26s*5 - 7s*4 - 4s*2 + 4s. Let r(l) = -18l5 - 5l*4 - 3l*2 + 3l. Let o(b) = 5g(b) - 7r(b). Find the second derivative of o(x) wrt x. -80x3 + 2 Suppose -8m = -20m + 60. What is the second derivative of -28v + 28v + 0v*5 + 5v*m - 31v wrt v? 100v3 Let g(p) be the first derivative of -p6/3 + 6p*4 - 26p*2 - 59. Find the second derivative of g(q) wrt q. -40q*3 + 144q Let v(h) = 2h - 5. Let n be v(4). Let j = -378 - -381. Find the third derivative of -8d*6 - n + 8d*2 + j wrt d. -960d*3 Let y(s) = s + 1. Let l(g) = 4g*3 - 46g*2 + 3g + 2. Let p(c) = l(c) - 2y(c). What is the third derivative of p(r) wrt r? 24 Let a = -110 - -110. Let w(i) be the third derivative of -6i*2 + 3/2i*3 + 0i + a - 5/12i4. What is the derivative of w(k) wrt k? -10 Let t(q) = 23q*3 - 4q2 + q + 5. Let h(r) = -r2 - r + 1. Let i(f) = -5h(f) + t(f). Find the third derivative of i(a) wrt a. 138 What is the derivative of -3765a - 407 + 12a2 + 3765a + 9a2 wrt a? 42a What is the second derivative of -3o2 + 2o*2 - 2286o*3 - 22 + 2291o*3 + o + 3o*2 wrt o? 30o + 4 Let z(x) = -142x - 8. Let g(a) = 2a + 3. Let l(c) = -4g(c) - z(c). Find the first derivative of l(p) wrt p. 134 Let f(c) = -257c*3 - 127c*2 + 2c - 2. Let t(b) = 257b3 + 127b*2 - 3b + 3. Let z(w) = 3f(w) + 2t(w). What is the third derivative of z(s) wrt s? -1542 Let m(c) be the first derivative of 87c5 - 210c - 446. What is the derivative of m(n) wrt n? 1740n3 Suppose 2h + 2b = 5h - 55, -2b = 2h - 20. What is the first derivative of 30 - 7 + 18y2 - 11 - h wrt y? 36y Find the second derivative of 33l5 + 15l - 161l - l3 - l wrt l. 660l*3 - 6l Let q(l) = 11l4 - 5l*3 + 5l*2 - l. Suppose 5d - 5 = 6d. Let u(z) = -z3 + z2. Let s(w) = du(w) + q(w). Find the second derivative of s(a) wrt a. 132a2 Let a(l) = l5 - l4 + l + 1. Let t(y) = 2y*5 + 3y*4 - 7y*2 - 3y - 3. Let p(n) = -6a(n) - 2t(n). What is the third derivative of p(m) wrt m? -600m2 Let a be ((-16)/(7 + -3))/(-2). Let m be 0(-3 + a)1. Find the first derivative of -4r + 2r + 6 + mr wrt r. -2 What is the third derivative of -2q + 0q - 13q3 - 134q*2 + 113q*2 - 5q*4 wrt q? -120q - 78 Let o(j) be the third derivative of j*8/168 + 53j5/60 - j4/12 - 17j3/3 - 10j*2. What is the second derivative of o(t) wrt t? 40t*3 + 106 Suppose -u - 14 = -5b + 36, -u - 45 = -4b. Let j = u + 33. Find the third derivative of 0o*4 + jo*5 + 0o4 - o5 - 7o2 wrt o. 420o*2 Find the third derivative of -48l*6 - 12264l*5 + 12264l*5 - 59l*2 wrt l. -5760l3 Let v(c) = c3 + c - 1. Let a(o) = -75o3 + 63o*2 + 5o - 5. Let h(l) = -a(l) + 5v(l). What is the third derivative of h(t) wrt t? 480 Let o(v) be the first derivative of 0v*6 - 8v*3 + 23 + 0v*5 + 15/7v*7 + 0v + 0v2 + 0v*4. Find the third derivative of o(b) wrt b. 1800b3 Let z(f) be the second derivative of f8/420 + f*4/4 - 11f*3/6 + 9f. Let v(n) be the second derivative of z(n). Differentiate v(q) with respect to q. 16q3 Let r(u) be the second derivative of 79u*5/10 - 101u*4/12 - 165u. What is the third derivative of r(g) wrt g? 948 Let b(m) be the second derivative of 0m3 + 0 + 0m*5 + 2/5m*6 - 12m*2 + 0m*4 - 28m. What is the first derivative of b(j) wrt j? 48j3 Let f = -11 + 13. Let b be (-6)/f + 12/4. Differentiate 1 + bp*2 + 2 + 2p*2 with respect to p. 4p What is the second derivative of 24z4 + 3z*5 + 0z - 31z4 - 3z - 5 + 6z wrt z? 60z*3 - 84z*2 Find the third derivative of -132r*2 - 107r*2 + 26r*6 - 253r*2 + 612r*6 wrt r. 76560r*3 Let v(u) be the second derivative of -131u*4/12 + 551u*2/2 + 182u. What is the derivative of v(p) wrt p? -262p What is the third derivative of -19w*4 - 275w*5 - 26w*2 + 547w*5 - 273w*5 wrt w? -60w*2 - 456w Let g(w) = w3 - w2 + w. Let j(b) = 14b3 - 3b*2 + 3b - 4. Suppose 0 = -2o + 2 - 0. Let f(z) = oj(z) - 3g(z). Differentiate f(i) wrt i. 33i*2 Suppose 5r + r - 30 = 0. Suppose -2m + ru = 10, -u = -4m + 4u. Differentiate -m - v*3 - 2 + 1 with respect to v. -3v*2 Let f = 99 + -96. Differentiate -fu*4 + 19 + 2u*4 - 2u*4 wrt u. -12u3 Let f(x) be the third derivative of x9/252 - x8/336 - x5/60 - 19x3/2 + 7x*2. Find the third derivative of f(i) wrt i. 240i*3 - 60i*2 What is the third derivative of -362r*2 - 25r*2 + 24r*2 + 70r*4 - 289r*4 - 70r*4 wrt r? -6936r Let s(n) = -31 - 6n - 5n + 2 - 4n. Let k(u) = 104u + 204. Let r(v) = -3k(v) - 20s(v). Find the first derivative of r(z) wrt z. -12 Let o(c) be the third derivative of 0c5 + 5/84c*8 - 19c*2 + 0c*3 + 0 + 0c + 0c7 + 0c*6 - 17/24c*4. What is the second derivative of o(r) wrt r? 400r*3 Let o be ((-4)/6 - 0)-3. Suppose 3p = 2u + 25, 31 = 3p - u + 5u. Find the third derivative of 6k5 - pk*2 + 8k*o - 4k*2 wrt k. 360k2 Let t(m) = -m5 + m + 1. Let b = -45 + 46. Let n(c) = -28c5 + 39c - 2. Let f(u) = bn(u) + 2t(u). What is the second derivative of f(d) wrt d? -600d3 Let f(o) = -2o*4 + 5o*3 + 514o*2 + 10o - 1337. Let j(s) = -s*4 + 2s*3 + 257s*2 + 4s - 668. Let l(r) = 2f(r) - 5j(r). Differentiate l(m) wrt m. 4m3 - 514m Let k be -128(-1)/63. What is the first derivative of 3 - 87p + 9 + kp wrt p? -23 Suppose -4 + 0 = 4d + 2a, 5a - 20 = 0. Let n = d + 5. What is the third derivative of -3j*2 + 4j5 + j2 - j*n - 5j*5 wrt j? -60j*2 Suppose -f = f - 6. Let b(h) be the first derivative of -h + 24 - 9 - 5 + fh*4. Differentiate b(p) with respect to p. 36p2 Let t(c) = -c3 + 21c2 - 19c - 22. Let k be t(20). Let f be (-1 - k)/((-5)/(-30)). What is the second derivative of fj2 - 8j + 11j + 5j2 wrt j? 22 Let u(r) = -r2 - 10r - 18. Let c be u(-7). Find the third derivative of 2l*3 - 45l3 + lc - l*2 + 11l wrt l. -252 Let n(a) be the first derivative of -a7/70 + a6/45 + 2a3/3 - 2. Let t(r) be the third derivative of n(r). What is the third derivative of t(d) wrt d? -72 Suppose 0 = 4a - 4t - 28, -19 = -a - 0a + 5t. Find the first derivative of 5b*a + 0b*4 - b + 9 - 2b - 65 wrt b. 20b3 - 3 Let y(s) be the first derivative of 6s4 - 30 + s4 - 11s2 - 2s*4. Find the second derivative of y(v) wrt v. 120v Let u(f) = 12f5 - 6f*4 + 4f*3 + 19f*2 + 132f + 6. Let y(n) = n*4 - 3n*2 - 1. Let r(h) = u(h) + 6y(h). What is the third derivative of r(j) wrt j? 720j2 + 24 Let u(w) = 47w*3 + 6w*2 + 6w + 32. Let o(z) = -z3 - z2 - z - 1. Let p(h) = 6o(h) + u(h). Find the first derivative of p(y) wrt y. 123y2 Let x(p) be the third derivative of -p7/210 - 13p4 - 58p*3/3 - 366p*2 + 1. Find the first derivative of x(r) wrt r. -4r*3 - 312 Let u(t) be the third derivative of 0 + 0t - 13/12t4 + 0t*5 + 0t*6 + 0t*7 + 0t*3 - 21t*2 - 1/56t**8. What is the secon	{ "pile_set_name": "DM Mathematics" }
etters picked without replacement from bdibsqt. 1/420 What is prob of sequence azzl when four letters picked without replacement from {a: 8, z: 2, g: 1, w: 2, l: 5}? 1/918 Four letters picked without replacement from {v: 2, d: 8, y: 1, t: 4}. What is prob of sequence vytv? 1/4095 Calculate prob of sequence rv when two letters picked without replacement from vyyqrqryqyvqvryrryy. 5/114 Two letters picked without replacement from sjyqyjvjjjjjsg. What is prob of sequence jg? 1/26 Three letters picked without replacement from iwibi. What is prob of sequence biw? 1/20 Three letters picked without replacement from docsrioidids. Give prob of sequence csd. 1/220 Four letters picked without replacement from {p: 4, a: 3}. What is prob of sequence apaa? 1/35 Three letters picked without replacement from {y: 10, m: 4, t: 6}. What is prob of sequence ymm? 1/57 What is prob of sequence bq when two letters picked without replacement from {r: 1, e: 1, q: 1, b: 1, m: 1}? 1/20 Two letters picked without replacement from iililiiiiiiilliiiiii. Give prob of sequence li. 16/95 Two letters picked without replacement from kgwwnggkswgnagg. What is prob of sequence gn? 2/35 Two letters picked without replacement from {i: 4, g: 1, y: 8, m: 3, c: 1}. Give prob of sequence yi. 2/17 What is prob of sequence gs when two letters picked without replacement from {h: 4, z: 4, d: 3, c: 4, s: 4, g: 1}? 1/95 Calculate prob of sequence wuw when three letters picked without replacement from {r: 4, w: 2, u: 5}. 1/99 What is prob of sequence ax when two letters picked without replacement from {x: 1, a: 1, t: 1, j: 2}? 1/20 Two letters picked without replacement from wzwzz. What is prob of sequence zz? 3/10 Calculate prob of sequence bi when two letters picked without replacement from uubbbuuubbubububbiuu. 9/380 Two letters picked without replacement from whuhwahuhuua. Give prob of sequence hh. 1/11 What is prob of sequence vvf when three letters picked without replacement from {z: 2, l: 1, f: 3, x: 2, n: 6, v: 6}? 1/76 What is prob of sequence gpc when three letters picked without replacement from {k: 1, s: 2, g: 2, r: 1, c: 2, p: 4}? 2/165 Calculate prob of sequence ov when two letters picked without replacement from {f: 1, o: 1, q: 2, v: 1, g: 2}. 1/42 What is prob of sequence hh when two letters picked without replacement from hddddhddddddddddddd? 1/171 What is prob of sequence wk when two letters picked without replacement from wwwwwwitwiktwmm? 4/105 Three letters picked without replacement from fffffffoofo. Give prob of sequence ooo. 1/165 What is prob of sequence rt when two letters picked without replacement from {t: 3, g: 1, r: 1}? 3/20 Four letters picked without replacement from nnwwanwawanwanw. Give prob of sequence wana. 1/91 Two letters picked without replacement from {g: 2, f: 1, p: 1, n: 4, y: 4, a: 6}. What is prob of sequence gg? 1/153 Calculate prob of sequence yt when two letters picked without replacement from txzye. 1/20 Three letters picked without replacement from ezegsggzveee. What is prob of sequence sve? 1/264 Two letters picked without replacement from {s: 2, u: 6}. What is prob of sequence us? 3/14 Four letters picked without replacement from {n: 7, d: 5, x: 6, e: 1}. Give prob of sequence dndn. 35/3876 What is prob of sequence bbc when three letters picked without replacement from ccbmbcmchcbccbbc? 1/21 What is prob of sequence fop when three letters picked without replacement from dcdfocdfffp? 2/495 Calculate prob of sequence pppp when four letters picked without replacement from piippippiiippppippp. 165/1292 What is prob of sequence un when two letters picked without replacement from nnnnncunun? 7/45 What is prob of sequence sdm when three letters picked without replacement from csccmmdzcmdadd? 1/182 Calculate prob of sequence kk when two letters picked without replacement from dkdahdkad. 1/36 Three letters picked without replacement from {i: 9, s: 2}. Give prob of sequence iis. 8/55 Two letters picked without replacement from kkkkkeekeeekekkeeke. What is prob of sequence ek? 5/19 Two letters picked without replacement from {a: 5, x: 3, i: 9, s: 2}. What is prob of sequence xs? 1/57 Two letters picked without replacement from syllyer. What is prob of sequence ry? 1/21 What is prob of sequence qm when two letters picked without replacement from {q: 1, s: 4, m: 4, f: 3, c: 1, e: 4}? 1/68 Four letters picked without replacement from {y: 9, r: 4, e: 4, j: 3}. Give prob of sequence rrrj. 1/1615 Calculate prob of sequence qz when two letters picked without replacement from sdsdqsdeqzle. 1/66 Two letters picked without replacement from {e: 3, k: 1, v: 2, m: 1}. What is prob of sequence mk? 1/42 Calculate prob of sequence woq when three letters picked without replacement from ownonwqwwo. 1/60 What is prob of sequence mig when three letters picked without replacement from mmtmjitgtggmiim? 3/182 Two letters picked without replacement from lvitp. What is prob of sequence ti? 1/20 Two letters picked without replacement from ozzkzzzzzkxxzklkxlk. What is prob of sequence ll? 1/171 Three letters picked without replacement from iiiiiniiiinii. Give prob of sequence iii. 15/26 Two letters picked without replacement from {y: 2, h: 1, x: 1, i: 2, v: 2, b: 4}. What is prob of sequence hv? 1/66 Four letters picked without replacement from {j: 2, g: 1, u: 1, n: 4}. Give prob of sequence gjuj. 1/840 Calculate prob of sequence tk when two letters picked without replacement from {e: 1, u: 3, l: 2, t: 2, k: 2, g: 2}. 1/33 Four letters picked without replacement from {q: 2, r: 2, m: 5}. Give prob of sequence rmqq. 5/756 Four letters picked without replacement from tktttwtkpwkuwwtt. What is prob of sequence ttuk? 3/1040 What is prob of sequence ofqn when four letters picked without replacement from qqfqoqfnqfqnfoqofnqq? 9/2584 Calculate prob of sequence yimb when four letters picked without replacement from bipmymb. 1/210 Three letters picked without replacement from {q: 4, s: 1, d: 1, y: 2}. What is prob of sequence qsd? 1/84 What is prob of sequence qt when two letters picked without replacement from bspsswpbsqstw? 1/156 Two letters picked without replacement from {d: 1, z: 1, q: 1, t: 1, l: 1}. Give prob of sequence lt. 1/20 Four letters picked without replacement from {w: 1, d: 3, q: 3, g: 6}. What is prob of sequence dggq? 9/572 Two letters picked without replacement from dpdbvvddodvodvjv. What is prob of sequence dv? 1/8 Calculate prob of sequence gkg when three letters picked without replacement from ggggkgkkggkggg. 15/91 Calculate prob of sequence ezqq when four letters picked without replacement from {i: 6, e: 7, q: 3, z: 1, g: 2}. 7/15504 Two letters picked without replacement from sshvh. What is prob of sequence vs? 1/10 Calculate prob of sequence zcqz when four letters picked without replacement from czqz. 1/12 Calculate prob of sequence jnn when three letters picked without replacement from jwjwnjjjjjjwjwjjnn. 11/816 Calculate prob of sequence pdw when three letters picked without replacement from pprrxpwrrrrddarda. 3/1360 What is prob of sequence wgg when three letters picked without replacement from {g: 18, w: 1}? 1/19 What is prob of sequence qq when two letters picked without replacement from {x: 8, q: 3}? 3/55 Three letters picked without replacement from zdrujww. Give prob of sequence wrj. 1/105 Calculate prob of sequence kcw when three letters picked without replacement from lsmmmsckskkslwl. 1/910 Four letters picked without replacement from {o: 7, e: 3, b: 1, u: 4, y: 3}. What is prob of sequence yeuy? 1/1020 Three letters picked without replacement from {v: 9, u: 1, h: 4, q: 2}. Give prob of sequence quq. 1/1680 Two letters picked without replacement from {z: 1, r: 1, t: 1}. Give prob of sequence rz. 1/6 What is prob of sequence xxd when three letters picked without replacement from {s: 2, d: 2, x: 9}? 12/143 Calculate prob of sequence pd when two letters picked without replacement from {z: 2, d: 1, e: 1, p: 1}. 1/20 Calculate prob of sequence ee when two letters picked without replacement from {e: 6}. 1 What is prob of sequence nf when two letters picked without replacement from nnfnnnnnnnnnnnn? 1/15 Calculate prob of sequence il when two letters picked wi	{ "pile_set_name": "DM Mathematics" }
2 - v + 5. Let f(k) = -g(k) + 4h(k). Let p(c) = -4c*2 + 2c - 1. Give -2f(u) + p(u). -2u*2 + 1 Suppose 0 = -3s - 5 + 20. Let m be -3 + 8/4 - 1. Let x(w) = 4w3 + w2 - 1. Let v(r) = 9r*3 + 2r*2 - 2. What is mv(b) + sx(b)? 2b3 + b2 - 1 Let h(r) = -2r3 + 4r*2 + 3r - 4. Let x(o) = -4o3 + 7o*2 + 5o - 7. What is -5h(f) + 3x(f)? -2f3 + f2 - 1 Let q(y) = -y + 4. Suppose 12r = 13r + 4. Let i(j) = j - 5. Calculate rq(o) - 3i(o). o - 1 Let c(t) = -4t + 10. Let h(w) = -5w + 11. What is -6c(x) + 5h(x)? -x - 5 Let c(l) = 62l*3 + 3l + 3. Let b(z) = 61z3 + 2z + 2. Determine 3b(d) - 2c(d). 59d3 Let k(x) = -64x. Let p(d) = d. What is k(c) + p(c)? -63c Let n(w) = 3w*3 + 6w. Let b(l) = -2l3 - l2 - 5l. Calculate 4b(t) + 3n(t). t*3 - 4t*2 - 2t Let d(y) = -y*3 + 2y + 1. Suppose 0g - 2g + 8 = 0. Let t(c) = -3 + 7 - c - 1 - g. Determine 2d(h) + 3t(h). -2h3 + h - 1 Let d(z) = -40 - 4z + 20 + 18. Let x(o) = 6o + 3. Give -7d(a) - 5x(a). -2a - 1 Let w(c) = -2c + 3. Let l(b) = b - 9 + 9. Give -4l(j) - w(j). -2j - 3 Let y(i) = -4i*3 - 17i2 - 13. Let c(v) = v3 + 4v2 + 3. Let s = -144 + 118. Calculate sc(a) - 6y(a). -2a*3 - 2a*2 Let b(f) = 6f + 2. Let k be b(-1). Let r(m) = m. Let x(z) = -2z2 + 4z. Suppose 1 = 4h - 3. Determine hx(j) + kr(j). -2j*2 Let w(g) = -2g - 3. Let m = -17 - -18. Let o(n) be the first derivative of -m + 1/2n2 + n. What is 5o(y) + 2w(y)? y - 1 Let k(p) = 8p*2 + 2p + 3. Let z(d) = 7d2 + d + 2. Give 2k(t) - 3z(t). -5t*2 + t Let o(j) be the first derivative of 5j*2/2 - 1. Let q(g) = 11g. Let k = -4 + 13. Let i be 1/5 - (12/(-15) + 5). Give iq(s) + ko(s). s Let y(o) = -2o + 3. Suppose -3 + 10 = v. Let d(i) = -5i + 7. Determine vy(u) - 3d(u). u Let c(x) = 2x2 - 3x. Let r(q) = -4q2 + 5q. Give 5c(p) + 3r(p). -2p2 Let b(h) = 13h*2 - 4h - 10. Let c(n) = 4n2 - n - 1. Let o(d) = -12d*2 + 3d + 2. Let t(g) = 7c(g) + 2o(g). Let k = -3 + 5. Give kb(s) - 7t(s). -2s2 - s + 1 Let a(u) = 3u*3 + 2u*2 + 2u + 1. Let l(z) = z3 + z2 + z. Let x = 0 + 3. Let i be 0 + (x + -5 - -3). Calculate ia(p) - 2l(p). p*3 + 1 Let x(o) = -7o*3 + 4o*2 - o - 1. Let a(f) = 20f*3 - 11f*2 + 3f + 3. Calculate 3a(g) + 8x(g). 4g3 - g2 + g + 1 Let s(g) = -g3 - 2. Let v be s(-2). Let z(m) = -4m - 9. Let l(b) = -2b - 5. Calculate vz(i) - 11l(i). -2i + 1 Let f(u) = -2u2 - 6u. Let o(j) = -11j2 - 35j. Calculate -34f(l) + 6o(l). 2l2 - 6l Let i(h) = 3h2 - 2. Let r(w) = -6w*2 + 4. Determine 5i(k) + 2r(k). 3k2 - 2 Let f(h) = h3 + 13h2 + 8h - 5. Let n(m) = -12m2 - 8m + 4. Let r(b) = 4f(b) + 5n(b). Let s(i) = -i3 + i2 + i. What is r(g) + 8s(g)? -4g*3 Suppose -5r = -5, 0 = 3s + 2r - 6 - 2. Let p(k) = k*2 + 4k - 2. Let j(h) = 5h2 + 16h - 9. Give sj(y) - 9p(y). y*2 - 4y Let b = 27 - 28. Let l(q) = -1. Let w be 2 - (1 + (-2 - -1)). Let c(g) = 0 - 6g2 + 2 + 4g*w. What is bl(m) - c(m)? 2m2 - 1 Let n = -18 - -19. Let f(l) = -2l - 6. Let y(t) = t + 1. Let u(s) = 2f(s) + 6y(s). Let m(z) = -z + 1. Determine nu(a) + 4m(a). -2a - 2 Let u = 2 + -1. Let p(c) = -2c + 7. Let t(w) = 5. Suppose 0f + 3 = -f. Let s(v) = 2. Let a(b) = ft(b) + 8s(b). What is up(z) - 6a(z)? -2z + 1 Let c(s) = 52s2 + 48s - 48. Let d(h) = 105h2 + 95h - 95. Let v(u) = -5c(u) + 3d(u). Let q(n) = 5n2 + 4n - 4. Determine -45q(b) + 4v(b). -5b2 Let b(x) = -2x3 - x2 + x - 2. Let f(s) = -6s3 - 3s*2 + 4s - 7. Suppose 18 = -6g + 60. Give gb(k) - 2f(k). -2k3 - k2 - k Suppose -5l + 5q + 25 = 0, -9 = -2l + 3q + 6. Let d(y) = -4y + 6 - y - 4 + l. Let z(w) = 3w*3. Let o be z(-1). Let n(t) = t - 1. Determine on(x) - d(x). 2x + 1 Let l(q) = 1. Let n(p) = -4p + 5. Determine 2l(i) - n(i). 4i - 3 Let y(c) = -11c + 10. Let f(v) = 11v - 9. Let w(k) = 5f(k) + 4y(k). Suppose n + 6 - 1 = 0. Let i(d) = -5d + 2. Calculate ni(z) - 2w(z). 3z Let d(a) = 28a2 - 5a + 3. Let g(s) = 28s2 - 4s + 2. Give 3d(x) - 4g(x). -28x2 + x + 1 Let r(a) = -16a - 16. Let p(q) = 3q + 3. Let v(s) = 22p(s) + 4r(s). Let g(w) = w2 + 8w + 9. Give 2g(n) - 9v(n). 2n2 - 2n Let s(j) = -7j2 - 6j + 6. Let d(y) = -20y2 - 17y + 17. Suppose 2g = g - 7. Let n = 24 + g. Give ns(q) - 6d(q). q2 Let r(k) = 7k*3 - 2k - 5. Let c(n) = n2 - n3 - n*2 + 1. Suppose -20 = -5l + 10. Suppose -2m = 4 + l. Determine mc(g) - r(g). -2g3 + 2g Let l(q) = q*2 - q + 1. Let f = 2 + 0. Suppose -d = -0d - 5c - 17, 23 = -5d - fc. Let o(s) = -s2 + 3s - 3. Calculate dl(t) - o(t). -2t2 Let x = 2 - 0. Let j(i) = -ix + i2 - i2. Let r(v) = v*3 - 3v*2. Let d be (2/(-4) + 2)-2. Determine dj(p) + r(p). p3 Let g(h) = -3h - 8 + 6 + 2h. Let k(s) = -s - 2. What is -4g(i) + 5k(i)? -i - 2 Let f(a) = 10a + 3. Let t(u) = -11u - 4. What is -5f(n) - 4t(n)? -6n + 1 Suppose -2n + 2 = 5u, 9 = -3u + 3. Let y(t) = 6t*2 - 8t - 5. Let d(v) = -7v2 + 9v + 6. Calculate ny(o) + 5d(o). o*2 - 3o Let i(f) = 2f3 + 7f*2 - 4f - 7. Suppose -4 = 5s - 19. Let x(b) = -2b2 + b2 + 2b2 + s + 2b - b*3 - 4b*2. Calculate 3i(j) + 7x(j). -j3 + 2j Let o(c) = -13c3 - 13c*2 + c - 9. Let w(j) = -3j*3 - 3j*2 - 2. Calculate 2o(h) - 9w(h). h3 + h2 + 2h Let r(n) = -n*2 - n + 1. Let x(u) = 10u*2 + 5u - 8. Let w(b) = 31b2 + 14b - 23. Let o(g) = -2w(g) + 7x(g). What is -2o(c) - 18r(c)? 2c2 + 4c + 2 Let d(m) = -5m3 - 9m*2 + 3m. Let g(l) = 9l3 + 17l*2 - 6l. Calculate -7d(n) - 4g(n). -n*3 - 5n*2 + 3n Let y(a) = 2a3 + 11a2 - 3. Let m be (10/(-4))/(4 - (-54)/(-12)). Let u(k) = -k3 - 7k2 + 2. Determine my(b) + 8u(b). 2b3 - b2 + 1 Let x(p) = -3p - 24. Let i(h) = -4h - 24. Calculate -4i(y) + 6x(y). -2y - 48 Let r(w) = 12w*2 - 2w + 2. Let n(y) = 455y2 - 77y + 77. Give -2n(m) + 77r(m). 14m2 Let q(i) = -i. Let k(m) = 4m. Determine 3k(y) + 15q(y). -3y Let v(o) = o + 4. Let n = -9 + 9. Let x(t) be the third derivative of -1/24t*4 - 5/6t*3 + 3t*2 + 0t + n. Determine -6v(q) - 5x(q). -q + 1 Let n(q) = 24q - 144. Let f(w) = 1. Give -144f(c) - n(c). -24c Let l(t) = 10t*3 - 4t*2 + 3t - 6. Let o(m) = -29m3 + 11m*2 - 8m + 17. Determine 11l(x) + 4o(x). -6x3 + x + 2 Let h(k) be the third derivative of k6/60 + k5/60 + 7k*4/24 + 26k2. Let d(y) = y3 + y*2 + 4y. What is -5d(z) + 3h(z)? z*3 - 2z*2 + z Let x(h) = 3h + 7. Let q(m) = -m*2 + 15m - 17. Let f be q(15). Let i(s) = -8s - 20. Determine fx(g) - 6i(g). -3g + 1 Let s(i) = 2i - 2. Let r(c) = 6 + 2 - 9 + 0. Give -2r(x) + s(x). 2x Let g(i) = 5i - 1. Let x(o) = 9o - 1. Determine -7g(b) + 4x(b). b + 3 Let u(i) = -i + 2. Let x be u(-4). Let n(k) = -2 + 7k*3 + 1 + 4 + 3. Let s(b) = 20b*3 + 17. Determine xs(r) - 17n(r). r3 Let d(f) = f - 2. Let a = 10 + -6. Let y = a - 9. Let u(o) = 7o - 8. Let g(q) = -6q + 7. Let b(i) = yg(i) - 4u(i). Give -5b(w) + 8d(w). -2w - 1 Let r(p) = -p2 - p. Let y(h) = h2 - 6h - 11. Let c be y(8). Suppose 0 = -b - b, -cg + 3b = -5. Let k(u) = -u2 - 2u. Determine gk(v) - 3r(v). 2v2 + v Let r(a) = -a3 - 3a*2 - 6a + 1. Let q(l) = 6l3 + 16l*2 + 31l - 5. Give 2q(y) + 11r(y). y3 - y2 - 4y + 1 Let f(k) = -5k*3 - 11k2. Let r(h) = -h3 - 2h2. Let w be (1 + 5)2/2. Let c = 8 - w. Suppose u = -8 - 3. Determine cf(d) + ur(d). d*3 Let k = 152 - 149. Let w(q) = -q + 1. Let r(s) = 4s*2 + 3s - 3. Determine kw(b) + r(b). 4b*2 Let c(g) = 5g*3. Let n(v) = 2v*2 + 3v*3 + 5v*2 - 7v*2. Let t be (-2)/(-12) + 473/(-66). Calculate tn(z) + 4c(z). -z3 Let d(q) = 2q*2 - 9q - 1. Suppose 0 = -l - 0l - 1. Let t(y) = -y. What is ld(n) + 6t(n)? -2n*2 + 3n + 1 Let p(f) = f3 - f + 1. Let v = 18 - 15. Let c(d) = dv - 2d + d2 - 1 - d3 + 3d*3 + 2. Calculate c(l) - 2p(l). l3 + l2 - 1 Let y(i) = 3. Let d(a) = -a*3 + 16. Calculate -2d(g) + 11y(g). 2g*3 + 1 Let b(g) = -14g*2 + 5g + 4. Let l(f) = -9f2 + 3f + 3. Determine 5b(k) - 8l(k). 2k2 + k - 4 Let z(a) = -11a	{ "pile_set_name": "DM Mathematics" }
e -4 = -i + 2. Let a = 1705.83 + -1697. Let d = a + -3.83. What is the biggest value in i, -2, -5, d? i Let o = 0.039 - -107.961. Let h = 288 - 287.8. Which is the third biggest value? (a) o (b) h (c) 0 c Let s = 0.0741 - 0.5741. Let h be (2/(-2))/(2/4). Let r = 0.3 + -0.1. Which is the biggest value? (a) s (b) -1 (c) r (d) h c Suppose -322515 = 239n + 14714. Which is the second smallest value? (a) -3 (b) n (c) -9 c Let s = 56.99 + 2.01. Let i = 56 - s. Which is the second biggest value? (a) -0.5 (b) i (c) -1.6 (d) -2 c Let s = 9488 + -9500. Which is the second smallest value? (a) -2/5 (b) 2/3 (c) -1 (d) -0.16 (e) s c Let x(y) = -y3 - 16y*2 + 39y + 57. Let v be x(-18). Which is the third biggest value? (a) v (b) -11/16 (c) -5 c Let y = -1105.7 - -1106. Which is the second biggest value? (a) 21 (b) 5 (c) -0.5 (d) y b Let h = 0.0424 - 1.9144. Let p = 0.128 - h. Let v be (-2)/2 - 6/(-9). Which is the biggest value? (a) p (b) -0.2 (c) 1/6 (d) v a Let t(p) = -p*3 + 4p*2 + 94p - 14. Let x be t(-8). Which is the biggest value? (a) x (b) 0.586 (c) 0.3 a Let o be (-4 - 20/72-1) + -2. Let a = o + 56/9. Let d = 107 - 857/8. What is the second biggest value in d, a, -0.1? -0.1 Let j(c) = c2 + c - 5. Let z be j(0). Let q be ((-22)/(-363))/((-2)/36-3). Let t = -1/33 + q. What is the smallest value in 1, t, 1/5, z? z Let j = -75109 - -75109.1. Let u be 2/(-3) + (-13)/3. Which is the biggest value? (a) 0.09 (b) j (c) u b Let p = -10372 + 10386. Which is the third biggest value? (a) p (b) 2/3 (c) 2 (d) 0 b Let u = 44 + -44.112. Let o = u + -1.888. Let f = 0.6 + -1.1. Which is the second smallest value? (a) -1.2 (b) o (c) f a Let q = 1117/8 + -140. Let l be 25333/(-294) + 63/54. Which is the smallest value? (a) 1 (b) l (c) q b Let g = 1608 - 1499. Let o = -78 + 194. Let c = g - o. What is the second smallest value in 0.4, c, 3? 0.4 Let y = -13.943 + 2.213. Let p = -0.27 + y. Which is the smallest value? (a) 3/5 (b) -2/11 (c) p c Let k = -577936.079 + 578210. Let p = k + -274. Which is the biggest value? (a) -3/5 (b) -3 (c) p c Let z = 1657.3 + -1657. Which is the fourth biggest value? (a) -0.4 (b) -2.7 (c) z (d) 1/3 (e) -2 e Let j = -14 - -3. Let x = 513 - 507.05. Let v = x - 6.15. What is the second biggest value in j, v, -1/6? v Let i(z) = z*2 - 9. Let d be i(-3). Suppose d = 6j + j - 42. Which is the third smallest value? (a) -0.5 (b) j (c) 3 b Let n = 0.5 + 14.5. Let c = n + -10. Let j = -21.3 - -20.9. What is the biggest value in j, c, -2? c Let w = 167.523 + -0.023. Let o = -168 + w. What is the second biggest value in o, 0.1, -2/25, -5? -2/25 Let s = -2/24907 - 24903/49814. Which is the second smallest value? (a) -1.1 (b) s (c) 0.266 b Let l be (-22 + -1 + 25)(3 - 4)/(-5). Let b = 0.228 - 99.228. What is the smallest value in -1, b, l? b Let q = 786.5 + -549. Let n = q - 238. What is the second biggest value in n, 2/9, 14? 2/9 Let o = 15.1 + 0.9. Let j = 0.04 - 0.24. Let r = -0.1 + j. Which is the biggest value? (a) o (b) 4 (c) r a Let g = -4.07 - 623.93. Let q = g + 628. Which is the second smallest value? (a) 3/4 (b) 3 (c) q (d) -36 c Let w = 0.35 - 0.3. Let j = 1122.94 - 123.97. Let i = 999 - j. Which is the second smallest value? (a) w (b) i (c) 3 a Let m be 32/(-2)(-1)/5. Which is the second smallest value? (a) -0.4 (b) 6/77 (c) -3 (d) 0.03 (e) m a Let d = -936 - -935.68. Which is the third smallest value? (a) d (b) 0 (c) -1/2 b Let w = -160 + 165. Which is the fourth smallest value? (a) -0.5 (b) -0.077 (c) 3/4 (d) w d Let t = -16.04 + 16. Let f = t + -1.96. Let o = -4.65 + 5.15. Which is the second smallest value? (a) f (b) -1 (c) o (d) -3 a Let t = 207 - 204. Suppose 3j - 119 - 49 = 0. Let g be 5/(-20) - (-6)/j. What is the third smallest value in t, 0, g? t Let a = 333/1465 - 8/293. Let k = -46 + 45.5. What is the smallest value in 2/9, a, 0.6, k? k Let x = -6312 - -12623/2. Which is the third smallest value? (a) -16 (b) -1 (c) x (d) 2 c Let m = 2.1 - 2. Let o = -97.987 - -97.887. What is the third smallest value in o, -2/9, m, 0? 0 Let p be 16/9 - (-1382)/6. Let v = -234 + p. What is the smallest value in -4/3, v, -0.23, 4? v Let g = 4402 - 4396.973. Let r = 31.973 + -32. Let q = r + g. Which is the third smallest value? (a) 2 (b) 29 (c) q b Suppose 3h + 20 = x, -3h - h = -2x + 30. Let q = -3.6 - -3.1. Which is the third smallest value? (a) -15/8 (b) q (c) h b Let r(v) = -2v3 - 7v*2 + 4v - 1. Let d be r(-4). Let z be (-4)/20(d - 4). Which is the third smallest value? (a) -6 (b) -0.6 (c) z c Let p = 0.03 + -5.03. Suppose -512r = -502r - 60. Let z be r + ((-36)/(-120))/(9/(-168)). Which is the fourth biggest value? (a) z (b) -4 (c) 1 (d) p d Let g be 9/(-21) + 5 + -5. Let f = 865/9 + -96. Let z = -4/9 + f. What is the smallest value in g, 5, z? g Let n = -851 + 559. Let f = -328 - n. Which is the second biggest value? (a) f (b) -0.3 (c) 0.2 b Let z = 1502.6 + -1503.6. Which is the second smallest value? (a) 10/59 (b) -19 (c) z c Suppose -76n + 69n = 7. Which is the second biggest value? (a) n (b) -5/2 (c) 2/11 a Suppose -4w - 34 = -14. Let q = 7.6 - 8.6. Let z be (-1)/(-2)(-4 - -6). Which is the fourth biggest value? (a) w (b) q (c) -0.1 (d) z a Let o be (-15)/(-114)(603/15 + -41). Suppose -2t + 5t - 15 = 0. What is the second smallest value in 0.008, o, t? 0.008 Let x = -28.06 + 28.36. Which is the fourth biggest value? (a) x (b) -16 (c) -0.04 (d) -1/3 b Let a = -0.149 + 79.149. Let q = a - 84. Let s = -1 + 0. What is the second biggest value in s, -2, -2/7, q? s Let g = 39 + -6. Let o = g - -8. Let w = 28 - o. Which is the biggest value? (a) -0.4 (b) w (c) 5 (d) 4 c Let z = -9.11 + 9. Let n = 2.03 - 0.03. Let p = -2.5 - -2.5. What is the third smallest value in p, z, n? n Let o = -3117 - -3122. Which is the third biggest value? (a) 1/8 (b) -5 (c) 0.4 (d) 0.3 (e) o d Let w = 90075/13 - 6929. What is the third biggest value in w, -58, 0, -0.4? -0.4 Let y(a) = -51a + 1792. Let r be y(33). What is the third biggest value in -3, -0.1, -1/3, r, 3/4? -0.1 Let l(v) be the first derivative of -v3/3 - 13v*2/2 - 32v - 43. Let f be l(-10). What is the second biggest value in 2, 73, f, -0.4? 2 Let m be ((-27)/(-6) + -4)/((-49)/14). What is the fourth smallest value in -1/3, -24, m, 0.5? 0.5 Suppose -264d + 303d = 0. What is the third smallest value in 5, 13.5, d? 13.5 Let c(d) = d*2 - 6d - 5. Let l be c(6). Let t be -3(l/35)/(-1). What is the smallest value in t, -5, -3, -6? -6 Let l = -141.1 + 141.1. What is the third smallest value in l, -3, -3/29? l Let g(p) = 238p*3 - 4p*2 - p + 1. Let d be g(-2). Let o = d + 42183/22. Let b = -10/11 + o. What is the fourth smallest value in 2/11, -1, 0.4, b? 0.4 Let t = -9748 + 9743.747. Let h = 0.253 + t. Which is the biggest value? (a) 0 (b) h (c) -38 a Let v = 109 + -2. Suppose -4p + v - 91 = 0. Suppose -pu - 5 = 7. What is the second smallest value in 1/6, u, 3, -0.4? -0.4 Let d = -1726 + 5176/3. What is the smallest value in 1.5, d, -1/4, 2, 20.1? d Let s = 105 - 97. Let q be s/(-44) - (-57)/11. Let x be 6/330 + (-1)/q. What is the third biggest value in x, 3, -14/9? -14/9 Let x = -473 + 19397/41. What is the fourth smallest value in 2/5, 0.3, 2, x? 2 Let p = 98443/15 + -6560. Which is the second biggest value? (a) p (b) -7 (c) -2/9 c Suppose 0 = -2x - 8, -3x = -4r + 2x - 80. Which is the fourth smallest value? (a) -4 (b) 0.4 (c) 4 (d) -5 (e) r b Let a = -1 - -1.2. Let t = 3.63 + -4.03. What is the third smallest value in -1, a, t, -17? t Let g = 2/787 - -203829/1574. Let u = g - 130. What is the biggest value in -3, u, -0.1? -0.1 Let c be (-60)/(-40) + 46/(-20). What is the smallest value in c, 2/7, -19? -19 Let j be (-3)/15(-1 - (-9)/24). Let l = -0.0561 - 0.6439. Which is the fourth biggest value? (a) l (b) j (c) 0.1 (d) 0.5 a Let s = -8 + 12. Let j = -1060 + 3176/3. Which is the second biggest value? (a) -0.07 (b) -1/2 (c) j (d) s a Let v = -2/3 - -3/5. Let o = -0.9 - 0.1. Let k = -6745 + 26977/4. Which is the biggest value? (a) k (b) o (c) v c Let l be 2/2*(-63)/63. Which is the second biggest	{ "pile_set_name": "DM Mathematics" }
56q - 88q). 804q2 + 268q Expand -2h + h + 2h*4 + 2h + (5h - 5h - h)(-109 + 109 - 26h*3) + 0h*4 - 3h*4 + 2h*4. 27h*4 + h Expand (-4h*2 - 2h*2 + 0h*2)(0 - 2h2 + 0) - 7h*4 + 4h4 - h4 + 2h4. 10h*4 Expand (-5x + 4x - 2x)(2x*2 + 2 - 2)(-15x - 6x + 6x). 90x*4 Expand (3n3 - n3 - 3n3)(-5n + n + 5n)(-4 + 2 + 4)(2 + 2 - 5)(0 + 14 - 4). 20n*4 Expand (-25i + 4 - 8 + 5)(1 - 1 + 2). -50i + 2 Expand (-2q3 + q3 - q3)((-2q - 2q + 0q)(q - q - 2q) - 36q*2 + 17q*2 - 8q*2). 38q5 Expand -x4 + x*4 + 11x*4 + (3 - 4 + 2)(-x*4 - 3x + 3x) + (2x*3 + 4x*3 - 3x*3)(-x - 6x + 3x). -2x4 Expand (13j + j - 6j)(-3j4 - 16j*4 - 23j*4 + 1). -336j*5 + 8j Expand (20a + 50a + 3a)(0 - 3 + 6)(a3 + 1 - 1). 219a*4 Expand (13b + 9b + 42b - 3b + 4b - 3b + (-1 + 2b + 1)(-4 + 0 + 2))(0b3 + 2b*3 - 3b*3). -58b*4 Expand 5n*3 - 2n*4 - 5n*3 + (0n3 + n4 + 0n3)(0 + 4 - 3) + 11n4 - 2n4 + n4. 9n4 Expand 2 - 2 - 2w*2 + (-w - 4w + 0w)(w - 3w + 0w) + w - w - w*2. 7w*2 Expand (82g + 1 - 46g + 19g)(-3g*4 + 2g*4 + 4g*4). 165g*5 + 3g*4 Expand (0l*2 - 9l*2 + 21l*2)(-11l + 8l*2 + 11l). 96l4 Expand (132y*2 - 3y*5 - 132y*2)(6 + 2 - 4 + (-3 - 2 + 6)(5 - 1 - 3)) + 1 - y5 - 1. -16y*5 Expand (q + 0q + q)(-48 + 124 - 48). 56q Expand (60l2 - 91l*2 - 134l*2 - 127l*2)(2l2 + 3l*3 - 2l*2). -876l*5 Expand (20 - 10 + 5)(-a - 4a - 2a). -105a Expand 8o*2 + 2o*2 - 4o*2 + 7o - 7o + 6o*2 + (-o - 1 + 1)(o + 2o - 4o) + (3o + o - 3o)(3 - o - 3). 12o*2 Expand 15h - 17h - 8 - 6h2 + 5 + 0 - h2 + 0 + 4h2 + 2h*2 - 5h*2 + (-2h2 + h2 + 3h2)(-2 + 6 - 2). -2h2 - 2h - 3 Expand (q + 1 + 0 + 0q)(38 - 12 - 115). -89q - 89 Expand (-8 + 10d + 8)(-1 - 2d + 1) + (-3 + 3 + 2d)(-25 + 25 + 17d). 14d*2 Expand (-3 + 7 + 7)(6s2 - 3s2 - s2)(5 - 5 + 6s). 132s3 Expand (-2r*2 + 2r*2 + 5r*2 + (-2r + 2r - 2r*2)(2 - 1 + 0) + 6r2 + 14r - 14r)(2 + 4 - 3). 27r2 Expand (4 + w2 - 4)(5 - 6w - 1 - 5). -6w3 - w2 Expand (-6 + 1 + 4)(13 - 5 - 2)(0y + 2y - 5y). 18y Expand 3s4 + s4 - 2s*4 + (-14s*3 - 31s3 + s3)(1 + 2s - 1). -86s4 Expand (0 + 0 + 4r)(5r + 2r - 5r) + 6r2 - 5r*2 - 3r*2 + 2r2 + r2 - r*2. 8r*2 Expand (2 - 2 + 2)((-2s2 - 2s*2 + 5s*2)(-2s - s + s) - 22s*3 + 271 - 271 + (2 - 2 - 2s*2)(-3s + 3s + s)). -52s3 Expand -8 - 7023v2 + v3 + 7023v2 - 3v + (5v - v - 3v)(3 - 2v*2 - 3) + 2v3 - v3 - 2v3. -2v*3 - 3v - 8 Expand (-1 - 2 + 5 + (-1 + 2 + 1)(2 - 5 - 2))(0 + 0 - u + (-2 + 3 - 2)(-5u + 0u + 3u) + 0u + 2u - 3u + (0 + 4 - 2)(0 + 0 + u) - u + 3u + u). -40u Expand (-2u - 2 + 2u*2 + 2)(74 - 25 - 14)(-2 + 0 + 4)(0 + 0 - 2). -280u2 + 280u Expand (-578v2 + 351v*2 + 4 + 388v*2)(0v + 4v - 3v)(0 - v + 0). -161v4 - 4v*2 Expand (0 + 1 - 3)(f2 + f3 - f*2) - 22f*3 + 10f*3 - 69f3 + (-f3 - 2f3 + 4f*3)(2 + 2 - 1). -80f3 Expand (-1 + 0s - 3s + 4s)(-5s + 4s - s) + 37 - 23s*2 - 37. -25s*2 + 2s Expand (d - d + d + (0d + d + 0d)(0 + 1 - 3) + 5d - 1 + 1)(35d - 36d - 64d). -260d2 Expand (93f - 35f + 33f)(-7 + 3 - 1)(1 - 1 + 2f). -910f*2 Expand (7u2 + u2 - 4u2)((1 - 1 + 2)(5u*3 + 21 - 21) - 3u3 + u3 + 4u3). 48u*5 Expand (0 + 0 - 2p)(192 + 50 + 230). -944p Expand (5j - 2j - j)(1 - 3 - 1)(-1 + 4 + 0 + (1 + 1 - 4)(-4 - 4 + 6) - 20 - 9 - 2). 144j Expand (4z4 + 0z*4 - 3z*4)(4z - 2z + z) + (2z2 + 356 - 356)(3z2 - 3z*2 + 2z*3). 7z*5 Expand 45 - 41 - 50f*2 + 9f*2 - 3 + 2f*2 + 3 - 2f + 2f - f2 + (-3f + f*2 + 3f)(1 - 1 - 1) - 2f2 - 3 + 3 + f + f2 - f. -42f2 + 4 Expand (0f - 5f + 4f)(12f*2 - 11f*2 - 18f2) + f3 + 0f + 0f. 18f3 Expand (-4 + 2 - 2 + (4 - 2 - 3)(2 - 2 + 1)(1 - 3 + 1))(-y*4 - 2y*4 + 2y*4). 3y*4 Expand -3j - j + 5j - 5j - j + 3j + (1 + j - 1)(4 - 3 + 0) + 7j - j - j + (-22 - 4j + 22)(1 - 1 - 2). 12j Expand (2x - 7x + 6x)(2x - 5x + x)(7 - 17 + 21). -22x*2 Expand (9209 - 167p - 9209)(2p + p*2 - 3p - 2p2). 167p*3 + 167p*2 Expand (-2 + 2i + 5 + 14)(-i2 + i2 - i2) - 3i3 - i3 - i*3. -7i*3 - 17i*2 Expand (-2a - 19a - 4 + 3)((-2 + 2 + 2)(-3 - 1 + 5) + 4 + 0 - 2). -84a - 4 Expand (y - y + 2y)(-1 + 1 - y)(1633 - 808 - 772). -106y*2 Expand (-147c - 696c + 498c - 1218c)(2c4 - 5 + 5). -3126c*5 Expand -7r + 2 - 3r + 27r - 4r + 4r - r + (1 - 3 + 1)(r + 2r - r). 14r + 2 Expand (-29 - 2u + 3u + 17)(23u + 2u*4 - 23u + 2). 2u5 - 24u*4 + 2u - 24 Expand (-5 - h + 5)(-1 - 5 + 5)(-163 + 85h2 + 163). 85h*3 Expand -2w*2 - 3w*2 - 2w*2 - 5w + w*2 + 5w + 3w - w2 - 3w + (-3 + 3 - 2w)(-4 + w + 4) - 3w2 - 2w*2 + 4w*2. -10w*2 Expand 7k + 15k - 629 + 641 - k - 4k + 6k - 4k - 3k + 6k - k - 4k + 3k + (3 - 2k - 3)(-1 - 2 + 4) - k + 0k - k. 16k + 12 Expand (-4r + 2r - 3r)(-1 + 5 - 1) - 6r + 7r + 9r. -5r Expand (6 - 7 + 5)(6w - 3w + 30w)(0w + 0w - 2w). -264w2 Expand (-4h + 6 - 4 + 6h)(384h3 + 385h*3 - 803h*3). -68h*4 - 68h*3 Expand (-33p*2 + 15p*2 + 24p*2 + 4)(7p - 4p - p)(-3p*2 + 0p + 0p) + (-2p + p + 3p)(2p3 - 2p*3 + 2p*4). -32p*5 - 24p*3 Expand (-241 + 119 + 2r + 118)(-3 - 2 + 4). -2r + 4 Expand -6 + 4s5 + 6 + (-3s*3 + 5s3 - s3)(11s - 11s + s2). 5s*5 Expand -5i - i - 7i + (0 + 2 + 8)(-4 + 4 - 2i). -33i Expand (-2l2 + 7l*2 - 3l2 + 0 + l2 + 0 + (-4 + 8 + 1)(-2l*2 + 4l2 - l2) + l*2 - 1 + 1)(-4l + 2l + l)(-1 + 2 + 4)(2 - 3 + 0). 45l3 Expand ((z + 0z - 3z)(3 - 5 + 4) + (1 + 2 - 4)(2 + 1 - 2)(2z + 4z - 4z))(-57 + 63 + 157). -978z Expand (586w*4 + 2w - 598w4 - 6w)(-w + 0 + 0). 12w*5 + 4w2 Expand s2 + 2s2 - s2 + (s + 1 - 1)(3 - s - 3) - 12s + 80 - 80 - 5s*2. -4s*2 - 12s Expand (2w2 + 0w + 0w)(-w2 + w2 - w*2) + (-4w*2 + 2w*2 + 0w*2)(-22w2 + 25w*2 - 71w*2). 134w*4 Expand (-983t*2 + 49 - 12 - 35)(-2 + 3 + 1). -1966t2 + 4 Expand (-2w + 4w + 0w)(3w + 0w - 5w) + (-3w2 - 1 + 1)(0 - 3 + 2) - 5w2 - 11w + 11w. -6w*2 Expand (1 + 0 + 1)(-33 + 9 - 27)(3t*4 + 0t*3 + 0t*3). -306t*4 Expand (2i*2 - 5 + 5)(3 - 2 - 2) + (-3 + 2 + 5)(-2i*2 - 4i2 + i2)(0 + 0 + 2). -42i*2 Expand (-u + 4u - 5u)(0u - 4u*4 + 0u) + 7u5 - 6u*5 - 25u*5. -16u*5 Expand (3357 + 3364 - 6751)(z - 2z - z). 60z Expand -3f + f2 + 3f + (-2f - f + 2f)(-f - 1 + 1) + 2f*2 - 6f*2 + 2f*2 - 14f*2 - 4f*2 - 6f*2. -24f*2 Expand -35019 + 35019 + 213s*5 + (2s*3 - 3s*3 + 3s*3)(0s2 - 4s*2 + 3s*2). 211s*5 Expand (2d*4 + 2 - 2)(10d + 3d + 17d) + 5 - 7d*5 - 5. 53d*5 Expand 2b*5 - 2b*2 + 2b*2 + (28 - 2b*2 - 28)(-2b - 4b + 3b)(-6b + 4b + 4b)(-4b - b + 2b). -34b5 Expand (-3w2 - w2 + 5w2 + (-w2 + 2w2 + w2)(-2 - 3 + 6) - 2w*2 + 3w*2 - 3w*2)(-7w2 + w2 + 21w*2). 15w*4 Expand (-40 - 2594b*2 - 41 + 81 - 935b*2)(-2b3 + 3b*3 + 0b*3). -3529b*5 Expand -32n*2 - 283n - 280n + 564n + 4 - 2n2 + 7n*2 - 3n*2 + (n - 3n + 0n)(0 - n + 0) - 3n2 - n2 + 2n*2. -30n*2 + n + 4 Expand (-a - 1 + 1)(-3 + 3 - 2a2) - 4a3 - a3 + 6a3 + (2 - 2a - 2)(a2 + 31a*2 - 18a*2). -25a*3 Expand (-8 + 17 + 11)(-3p - 3p + 9p). 60p Expand (3 - 1 + 0)(0 + 0 - q3) - 3q*3 - 2q*3 + 6q*3 + 5 - 11q*3 - 5 + 2q*2 + 24q*3 - 2q*2. 12q*3 Expand (2 + 1 - 1)(p + 0p + 0p) - p - 2p + 2p + 3954 - 3954 - 111p. -110p Expand 8o4 + 391o*2 - 391o*2 + 0o*3 + 0o3 - o4 + (-3 - 2o3 + 3)(-2 - 2o + 2). 11o*4 Expand (3 + 2 - 4)(-4c2 + 34c*2 - 17c*2) + 0c*2 - 3c*2 + 4c*2. 14c*2 Expand (-3b*3 + 4b*3 + 4b*3)(b*2 + 3b*2 + 12b*2 + 4b*2). 100b*5 Expand (40g*2 + 0g*2 + 50g*2)(-3g + 4g - 3g). -180g*3 Expand (0l*2 + 0l**2 + l	{ "pile_set_name": "DM Mathematics" }
AM What is 126 minutes before 7:47 PM? 5:41 PM How many minutes are there between 7:36 AM and 4:31 PM? 535 What is 344 minutes before 4:18 AM? 10:34 PM How many minutes are there between 8:12 PM and 4:13 AM? 481 How many minutes are there between 1:43 PM and 1:05 AM? 682 How many minutes are there between 5:39 AM and 8:04 AM? 145 What is 240 minutes before 12:39 AM? 8:39 PM What is 62 minutes before 1:29 PM? 12:27 PM How many minutes are there between 7:22 PM and 8:51 PM? 89 How many minutes are there between 9:34 PM and 12:30 AM? 176 How many minutes are there between 4:10 AM and 7:53 AM? 223 What is 141 minutes after 8:42 AM? 11:03 AM How many minutes are there between 8:17 PM and 6:33 AM? 616 How many minutes are there between 12:19 AM and 4:17 AM? 238 What is 682 minutes before 2:52 AM? 3:30 PM How many minutes are there between 7:38 PM and 10:43 PM? 185 How many minutes are there between 10:20 PM and 7:58 AM? 578 How many minutes are there between 11:56 AM and 7:22 PM? 446 How many minutes are there between 6:07 PM and 2:44 AM? 517 What is 456 minutes after 6:15 PM? 1:51 AM What is 385 minutes before 11:22 AM? 4:57 AM How many minutes are there between 9:30 AM and 4:09 PM? 399 What is 524 minutes before 7:19 AM? 10:35 PM What is 690 minutes before 7:00 PM? 7:30 AM What is 530 minutes before 2:22 AM? 5:32 PM How many minutes are there between 3:51 PM and 11:38 PM? 467 How many minutes are there between 1:38 PM and 8:28 PM? 410 How many minutes are there between 4:01 PM and 7:12 PM? 191 What is 623 minutes before 10:35 AM? 12:12 AM How many minutes are there between 9:57 AM and 9:15 PM? 678 How many minutes are there between 8:47 PM and 9:43 PM? 56 How many minutes are there between 5:33 PM and 1:49 AM? 496 What is 588 minutes before 5:40 AM? 7:52 PM How many minutes are there between 8:46 PM and 4:36 AM? 470 How many minutes are there between 9:13 AM and 2:05 PM? 292 How many minutes are there between 7:54 PM and 11:09 PM? 195 How many minutes are there between 2:29 AM and 12:07 PM? 578 How many minutes are there between 6:28 PM and 7:17 PM? 49 What is 525 minutes after 5:51 PM? 2:36 AM What is 252 minutes after 9:01 AM? 1:13 PM What is 617 minutes before 6:40 AM? 8:23 PM What is 617 minutes before 4:57 AM? 6:40 PM What is 504 minutes before 9:35 AM? 1:11 AM How many minutes are there between 3:14 AM and 10:47 AM? 453 What is 342 minutes after 8:11 AM? 1:53 PM How many minutes are there between 4:22 AM and 12:16 PM? 474 What is 104 minutes before 7:25 PM? 5:41 PM How many minutes are there between 10:20 PM and 10:32 PM? 12 What is 39 minutes before 10:27 PM? 9:48 PM What is 155 minutes after 7:28 AM? 10:03 AM How many minutes are there between 5:05 PM and 1:30 AM? 505 What is 237 minutes before 5:43 PM? 1:46 PM What is 50 minutes before 3:11 AM? 2:21 AM How many minutes are there between 8:05 AM and 3:17 PM? 432 How many minutes are there between 10:02 AM and 1:07 PM? 185 How many minutes are there between 5:13 AM and 4:40 PM? 687 How many minutes are there between 2:20 AM and 12:05 PM? 585 What is 286 minutes before 5:39 PM? 12:53 PM How many minutes are there between 3:46 PM and 12:44 AM? 538 What is 719 minutes before 5:47 AM? 5:48 PM What is 139 minutes after 5:08 PM? 7:27 PM What is 456 minutes before 1:13 AM? 5:37 PM How many minutes are there between 3:22 AM and 3:28 AM? 6 What is 401 minutes before 6:58 PM? 12:17 PM What is 692 minutes after 11:43 PM? 11:15 AM How many minutes are there between 9:55 PM and 11:55 PM? 120 What is 249 minutes after 2:46 PM? 6:55 PM What is 678 minutes after 10:16 PM? 9:34 AM How many minutes are there between 4:07 PM and 11:55 PM? 468 What is 145 minutes after 6:39 AM? 9:04 AM What is 235 minutes after 3:17 PM? 7:12 PM How many minutes are there between 1:51 PM and 3:57 PM? 126 How many minutes are there between 10:15 PM and 2:27 AM? 252 How many minutes are there between 2:53 AM and 1:39 PM? 646 How many minutes are there between 5:08 PM and 4:29 AM? 681 What is 628 minutes after 8:52 PM? 7:20 AM What is 59 minutes after 9:48 AM? 10:47 AM What is 503 minutes after 3:56 AM? 12:19 PM How many minutes are there between 9:47 PM and 2:17 AM? 270 What is 145 minutes after 2:16 PM? 4:41 PM What is 404 minutes before 12:17 AM? 5:33 PM How many minutes are there between 12:06 AM and 1:15 AM? 69 What is 166 minutes after 1:57 AM? 4:43 AM How many minutes are there between 10:25 PM and 9:01 AM? 636 How many minutes are there between 7:07 AM and 9:10 AM? 123 How many minutes are there between 9:11 PM and 10:49 PM? 98 How many minutes are there between 10:49 AM and 5:02 PM? 373 How many minutes are there between 9:54 AM and 8:06 PM? 612 How many minutes are there between 10:49 AM and 9:49 PM? 660 What is 443 minutes before 2:54 AM? 7:31 PM How many minutes are there between 10:31 AM and 12:09 PM? 98 What is 424 minutes before 2:55 AM? 7:51 PM How many minutes are there between 5:42 PM and 6:51 PM? 69 What is 207 minutes before 2:55 PM? 11:28 AM How many minutes are there between 10:57 PM and 7:55 AM? 538 How many minutes are there between 9:06 AM and 1:52 PM? 286 How many minutes are there between 12:04 AM and 8:50 AM? 526 What is 135 minutes after 4:44 PM? 6:59 PM How many minutes are there between 8:39 AM and 12:01 PM? 202 What is 627 minutes before 12:09 AM? 1:42 PM How many minutes are there between 9:06 AM and 2:47 PM? 341 What is 710 minutes before 11:26 PM? 11:36 AM What is 144 minutes after 12:13 PM? 2:37 PM How many minutes are there between 10:48 PM and 3:53 AM? 305 What is 657 minutes before 8:27 AM? 9:30 PM What is 620 minutes before 12:10 PM? 1:50 AM What is 139 minutes after 11:49 PM? 2:08 AM How many minutes are there between 10:00 PM and 4:31 AM? 391 What is 355 minutes after 6:30 AM? 12:25 PM How many minutes are there between 7:00 AM and 6:20 PM? 680 What is 617 minutes before 9:44 PM? 11:27 AM How many minutes are there between 1:48 PM and 9:50 PM? 482 How many minutes are there between 6:47 AM and 10:10 AM? 203 What is 123 minutes after 11:32 PM? 1:35 AM What is 315 minutes before 3:42 AM? 10:27 PM What is 501 minutes before 4:26 AM? 8:05 PM What is 359 minutes after 2:39 PM? 8:38 PM How many minutes are there between 3:57 PM and 10:47 PM? 410 How many minutes are there between 2:54 PM and 10:32 PM? 458 What is 586 minutes after 1:44 PM? 11:30 PM How many minutes are there between 5:34 PM and 7:10 PM? 96 What is 618 minutes after 1:24 PM? 11:42 PM What is 44 minutes after 1:11 AM? 1:55 AM How many minutes are there between 12:53 AM and 12:23 PM? 690 What is 148 minutes before 1:56 AM? 11:28 PM What is 14 minutes before 4:26 PM? 4:12 PM What is 25 minutes before 3:35 PM? 3:10 PM How many minutes are there between 11:49 PM and 12:56 AM? 67 What is 235 minutes after 12:37 AM? 4:32 AM What is 530 minutes before 12:20 AM? 3:30 PM What is 685 minutes after 4:37 PM? 4:02 AM How many minutes are there between 7:30 AM and 3:09 PM? 459 How many minutes are there between 8:06 AM and 10:45 AM? 159 How many minutes are there between 5:21 PM and 12:57 AM? 456 What is 547 minutes before 10:45 PM? 1:38 PM How many minutes are there between 11:24 PM and 2:10 AM? 166 What is 223 minutes before 1:06 PM? 9:23 AM What is 132 minutes after 7:06 AM? 9:18 AM How many minutes are there between 4:08 PM and 5:49 PM? 101 How many minutes are there between 10:21 AM and 9:48 PM? 687 What is 40 minutes before 7:59 AM? 7:19 AM How many minutes are there between 6:18 PM and 2:20 AM? 482 How many minutes are there between 1:26 PM and 6:43 PM? 317 What is 504 minutes after 12:11 AM? 8:35 AM How many minutes are there between 5:18 PM and 2:30 AM? 552 What is 366 minutes before 5:22 PM? 11:16 AM What is 432 minutes after 6:01 PM? 1:13 AM What is 186 minutes before 11:10 PM? 8:04 PM What is 54 minutes before 5:14 AM? 4:20 AM What is 283 minutes after 6:03 PM? 10:46 PM What is 491 minutes before 2:16 PM? 6:05 AM How many minutes are there between 7:53 AM and 7:38 PM? 705 How many minutes are there between 2:00 PM and 11:57 PM? 597 How many minutes are there between 4:06 PM and 7:28 PM? 202 How many minutes are there between 9:55 PM and 8:39 AM? 644 How many minutes are there between 12:59 PM and 9:12 PM? 493 What is 126 minut	{ "pile_set_name": "DM Mathematics" }
) -24/11 (c) 5699 (d) -3 (e) 1/4 (f) -0.3 b What is the nearest to -2/5 in -1861, 0.04, 3, -8? 0.04 What is the nearest to 0.03 in 1, -2, 3/7, -101/11, 2, -1? 3/7 What is the closest to -45 in 0.4, -3020/7, -36? -36 What is the nearest to 1/4 in -12, 3.3, 4/17, 0.25, -0.9? 0.25 Which is the closest to 1/4? (a) 0.3 (b) -0.08 (c) -0.3 (d) 120 (e) -12 a Which is the closest to 56922? (a) 0 (b) -2 (c) -64 (d) -2/7 a What is the closest to 0 in 68/11, 4/33, 42, 0, 1? 0 Which is the closest to 1? (a) 0.4 (b) -3/11 (c) -1887 (d) 0.12 (e) -4 a What is the nearest to -1 in 0.1, 3/2, -1215.3, 2? 0.1 What is the closest to 8 in -28, 2, -4, 0.02, 1.1? 2 What is the closest to -1 in 2/339, -0.0491, -1/8, -1/2? -1/2 What is the nearest to -0.1 in 1, 4, -1, -77, -0.14, -168? -0.14 What is the nearest to -1 in -0.171, -29, -13.537? -0.171 Which is the closest to 7? (a) 16 (b) 0.026 (c) 2/3 c What is the nearest to 0.2 in 2/19, 3/7, -3, 650, -324? 2/19 Which is the nearest to -7? (a) -14.2 (b) -7 (c) -0.01 (d) 0 b Which is the closest to -1/7? (a) 3 (b) 1.622 (c) -1.4 c Which is the nearest to -1? (a) -42 (b) -0.4 (c) 1/351 b What is the nearest to 1/3 in 0.01, -43/5, 47? 0.01 Which is the nearest to 2182? (a) -2/9 (b) -3/2 (c) 2 (d) -0.77 c What is the closest to -1 in -2, -5, 0.09, 2.5, 5? -2 Which is the closest to -96? (a) 3 (b) 12.98 (c) 0 c Which is the closest to 2/17? (a) 0 (b) -2161 (c) -5 a What is the nearest to -1/2 in -30, -1, -2/17, -2/1679, 0.2, 3/7? -2/17 What is the closest to 1/2 in -2/3, 1.9, -6885, -0.4? -0.4 What is the closest to -4 in 0, -2/15, 0.4, -3, -0.34? -3 Which is the nearest to -30/7? (a) -16 (b) 1 (c) -5 (d) -5/9 (e) -2 c What is the nearest to 1/23 in 3.93, -103, 2, 2/9? 2/9 What is the nearest to -0.01 in -467, -0.5, -2, 9, 35, -0.2? -0.2 What is the nearest to 4/3 in 1/5, -5, 1, 7/5, 1/326? 7/5 What is the nearest to 11 in -24, -1/2, 103/7? 103/7 What is the closest to 0.2 in 2, 1019, 1/3, 454, 0.3? 0.3 What is the nearest to -9/5 in 0.8, 1, 0.4, 5, -2/86887? -2/86887 What is the closest to 5/8 in 0.04, 2/5, -676, 5? 2/5 What is the closest to -12 in 0.12, -0.5, 18, 0.4, 3, -2/9? -0.5 What is the nearest to -5 in 2, -574, -445? 2 Which is the closest to 7? (a) -1431 (b) -2/17 (c) -1/2 b What is the closest to 0.1 in -0.2, -2, 221, -0.29, 191, -0.5? -0.2 Which is the nearest to 35? (a) -93 (b) -1/5 (c) -8/11 b What is the closest to -1775 in 3, -63, -4? -63 What is the nearest to -2 in -4, -388, 15, 0.1, 4? -4 What is the closest to -119 in 1, -3/2, 12, -0.2, -6? -6 What is the nearest to -0.1908 in -1/32, -37, -0.5, -0.2, 3/4, 0? -0.2 What is the closest to -1 in 7, -21, 0.15, 113, -0.5? -0.5 Which is the closest to 36/7? (a) -76 (b) -0.2 (c) -0.06 (d) 3/4 d What is the closest to -2/15 in 0.035658, 2/11, -0.4, 33? 0.035658 Which is the nearest to -1.5? (a) 21 (b) -4 (c) -2/15 (d) -0.04 (e) -0.7 e Which is the closest to -2/11? (a) -0.1 (b) -13 (c) -11 (d) -0.2 (e) -0.21 d What is the nearest to 0.2 in -1553.78, -0.5, -3, 0.07? 0.07 Which is the closest to 15/6866? (a) -0.5 (b) -2 (c) -4/3 a What is the closest to 61 in 2/7, 12, -0.2, -6, -18? 12 Which is the closest to 0.1? (a) -802.94 (b) -1 (c) 9 b What is the nearest to -0.2 in -27, 11, 0.7238, 5/4? 0.7238 Which is the closest to 16? (a) -2/7 (b) -9 (c) -0.2 (d) 0.9274 d What is the closest to -0.02583 in -3, 0.2, 1? 0.2 Which is the nearest to -193? (a) -10 (b) -27 (c) 1/7 (d) 5 b Which is the nearest to 2? (a) 0.34 (b) -8238 (c) 3/8 c Which is the closest to 16/7? (a) 0.3 (b) -0.03 (c) 0.4 (d) -607/4 c What is the nearest to 1/4 in 0.13, -7.58, -6/83, -1, 5, 2? 0.13 Which is the nearest to 1827? (a) 4 (b) 20 (c) -3.6 b What is the nearest to -0.237 in -1/4, 18.713, 18? -1/4 What is the closest to 0 in 1/4, -5.46, -2/25, 32? -2/25 What is the closest to 1/3 in 111, 5/2, 2/9, 0, -0.02? 2/9 Which is the closest to -59? (a) -379.5 (b) 11/6 (c) 0.1 c What is the closest to 949 in -5, -110.9, 0.1? 0.1 What is the closest to -1 in -1/9, 3, -6, 0.1, 12894, 1/4? -1/9 Which is the nearest to -65? (a) 11 (b) -0.11 (c) 0 (d) -0.4 (e) -1/39 (f) -0.03 d What is the closest to 1 in -1422, -449/7, 2, -1/2, -2? 2 Which is the nearest to -0.1372? (a) -1/1467 (b) -0.5 (c) -0.3 a What is the closest to 18005 in 309.9, 4, -0.4? 309.9 What is the closest to -109.7 in -2, 28/9, 4, 26, -8, -1? -8 What is the nearest to -1 in 1, 18/65, 72.7, 2/3? 18/65 What is the closest to 2 in 1, 330401, -0.1, 2, -2/11? 2 Which is the nearest to -755? (a) -4/5 (b) -1.1 (c) 140 b Which is the nearest to -7/4? (a) -2/13 (b) -62 (c) -0.9 (d) -0.133 c What is the closest to -0.04 in 0.2, 0.081, -1/71? -1/71 What is the closest to 0.229 in 5, -0.3, -6239? -0.3 Which is the nearest to -1? (a) 1/4 (b) 3 (c) -16025655 a What is the closest to -538/5 in 4, -1/3, -1.67, 5, 1/2? -1.67 What is the nearest to 144 in 6/37, 2/3, 9/5, -4? 9/5 What is the closest to -8 in 5, -7/96, -12? -12 What is the closest to 150 in 2/7, -2, -30, 3/2, 41? 41 What is the closest to 9678 in 53, 1/3, 0? 53 Which is the nearest to -2494? (a) -2/3 (b) -7/5 (c) 3/5 (d) -0.3 (e) 2/3 b What is the closest to 14 in 46/9, 4, -1.7677? 46/9 What is the nearest to -388 in -0.3, 4, 7, -1007? -0.3 What is the nearest to 2/5 in 0, 7.2234, -25.8? 0 What is the nearest to -42 in 1/17, 0.5, -3/14? -3/14 What is the nearest to 222.9 in 0, 0.3, 2/7, -8862? 0.3 What is the closest to 0 in 27, -0.5, 1/137, 4/3, 0.1? 1/137 Which is the nearest to -1? (a) -0.2 (b) -0.1 (c) -35 (d) 13 (e) 407 a What is the nearest to 2/19 in 0.1, -2.1, 6, 1/19, -1/8? 0.1 Which is the closest to -2? (a) -2.37724 (b) -4 (c) -1/30 a Which is the closest to -0.1? (a) 3 (b) 1.7 (c) -0.3 (d) -0.04 (e) -87 (f) 2/13 d What is the nearest to -83/5 in -0.3, 1/7, -1, 1, 35.49? -1 What is the closest to -1 in -0.3, 701, -130, 1, 0.1? -0.3 Which is the closest to -676? (a) -7 (b) 12 (c) -52 c What is the nearest to -2/39 in -126, 2/3, 2, 4, -5, -2/17? -2/17 What is the nearest to 141.388 in -1, -14/11, -7? -1 What is the closest to 1 in 2/693, 0.9, -21? 0.9 What is the nearest to 4 in -0.2, 11/7, 1/161408? 11/7 What is the closest to 785 in 2/3, -51, 7, 5, 2? 7 Which is the nearest to -13899? (a) 0 (b) -7/9 (c) 139/5 b Which is the nearest to -2/3? (a) -4 (b) 2/5 (c) -13/1693886 c What is the closest to -1365 in -1/2, -23, 2/11, -0.06? -23 What is the closest to -25.082 in 2/15, 1/4, 2/7, 0.3? 2/15 Which is the nearest to 4/5? (a) -293/5 (b) -4/3 (c) 0.5 (d) -4 (e) 10 c What is the nearest to 3/8 in 0.09, -2/7, -303, -4, 80? 0.09 What is the closest to -1/3 in 517, -1/8, 4807? -1/8 Which is the closest to -0.2? (a) -4 (b) 4/9 (c) 2195 (d) -49.2 b What is the closest to -315 in 2, 0, -0.1, -755, -5? -5 What is the closest to -0.1 in -0.103, 0.2, 21.6, -1/2? -0.103 What is the nearest to -882.95 in 0.4, -0.4, -3, 5? -3 Which is the closest to -5.429? (a) -6 (b) -1 (c) 2 (d) -3.2 a Which is the closest to -2/5? (a) -17 (b) -74 (c) 1 (d) -177 (e) 4 c Which is the nearest to 0.09? (a) 0.1 (b) -103144 (c) -2/29 a What is the nearest to -3 in 3/17, -40, -81? 3/17 What is the closest to -310/11 in -0.1, 3, -0.051, 33/7? -0.1 Which is the closest to 0.09? (a) 9 (b) 20 (c) -17 (d) 0.3 (e) -3/5 d Which is the nearest to 1? (a) 4 (b) 3.260942 (c) 3 c Which is the closest to -128? (a) 72 (b) -3 (c) 4 (d) -2 (e) 6/13 b What is the closest to -1 in 24/95, -0.3, -233.7? -0.3 What is the nearest to -1/4 in 3/5, 3/2, -2813, 9? 3/5 What is the closest to -3.6 in 5/2, -4, -4/5, -55? -4 What is the nearest to 0.1 in 398, -0.2776, 1/6, 3, 3/7, -2/7? 1/6 What is the closest to -272 in -1/3, 0.0733, 2/11, -0.7? -0.7 What is the nearest to -10 in -0.23, -0.00249, -1/3, 0.2, 2, -5? -5 What is the nearest to 0.4 in -0.5, 0, -104, -2/3, -0.2? 0 What is the nearest to 1/2 in -0.5, 4, 0.8, 0.2144? 0.2144 What is the closest to -0.0516 in -0.2, 3, 0.05, 1.1, 0.1? 0.05 What is the nearest to 0 in 1112/9, 3, 0.56, 5? 0.56 Which is the nearest to 9? (a) -5 (b) -2/11 (c) 2/149 (d) -2318 (e) 5 e Which is the nearest to -778? (a) -3 (b) 1 (c) -	{ "pile_set_name": "DM Mathematics" }
ctor -5m2 + 175820m - 1545633620. -5(m - 17582)2 Factor -4d*2 - 69828d + 209520. -4(d - 3)(d + 17460) Solve 5n2 - 11800n - 35445 = 0. -3, 2363 Factor k*3/2 + 14353k*2/2 - 2k - 28706. (k - 2)(k + 2)(k + 14353)/2 Factor 2r3/5 - 274r*2/5 + 12096r/5 - 169128/5. 2(r - 54)2(r - 29)/5 Suppose 808083s3/7 - 541836s*2/7 + 297s - 2/7 = 0. What is s? 1/519, 2/3 Solve -4i2 + 3264i - 57456 = 0. 18, 798 Solve -2q3/5 + 8774q*2/5 - 1907798q - 184421942/5 = 0 for q. -19, 2203 Factor 2l3/15 + 194456l*2/15 + 1555552l/15 + 622208/3. 2(l + 4)2(l + 97220)/15 Factor -150u2 - 862u + 6380. -2(u + 10)(75u - 319) What is z in -5z*5 + 120z*4 + 435z*3 - 770z*2 - 1080z = 0? -4, -1, 0, 2, 27 Solve o*3/5 - 94o*2/5 + 277o - 1292/5 = 0 for o. 1, 17, 76 Let -q*3/5 - 4361q*2/5 + 8726q/5 = 0. What is q? -4363, 0, 2 Let z*4/6 - 67z*3/3 + 1234z*2/3 + 9340z/3 + 4400 = 0. What is z? -4, -2, 30, 110 Factor -d*3/3 + 1479d*2 - 1635392d - 34560988/3. -(d - 2222)*2(d + 7)/3 Factor b*3/5 - 43b*2 - 52056b/5 - 10368. (b - 360)(b + 1)(b + 144)/5 Determine s so that -60s3 - 728s*2 + 98604s + 13160 = 0. -47, -2/15, 35 Factor 3u3/7 - 25953u*2/7 - 3708u. 3u(u - 8652)(u + 1)/7 Suppose s3/3 - 1604s*2/3 - 3211s/3 - 1606/3 = 0. Calculate s. -1, 1606 Determine p so that 3p4 + 132066p*3 + 1453452360p*2 - 132066p - 1453452363 = 0. -22011, -1, 1 Solve -2k2/3 - 295468k + 886406/3 = 0. -443203, 1 Factor 18q3 + 87879q*2 - 73248q - 14649. 3(q - 1)(q + 4883)(6q + 1) Factor -4z2 - 49880z - 99744. -4(z + 2)(z + 12468) Determine l, given that 2l2/13 + 9352l/13 - 9354/13 = 0. -4677, 1 Let 2m3/5 - 108222m*2/5 + 1463729568m/5 + 1464270728 = 0. Calculate m. -5, 27058 Determine h, given that 2h4/11 - 10h*3/11 - 136h*2/11 - 360h/11 - 288/11 = 0. -3, -2, 12 Solve k*2/5 - 101k - 5676/5 = 0 for k. -11, 516 Factor z*2 - 27850z + 193905625. (z - 13925)*2 Let -4h*2/5 + 248h/5 + 3852 = 0. What is h? -45, 107 Solve -3g2/4 - 1069275g/4 = 0. -356425, 0 Suppose -5b5 - 100b*4 + 785b*3 + 4180b*2 + 4500b = 0. What is b? -25, -2, 0, 9 Factor -4l3 - 4076l*2. -4l*2(l + 1019) Find u such that 16u3/5 - 193u*2/5 + 444u/5 - 27/5 = 0. 1/16, 3, 9 Suppose 2b3/3 - 260b*2 - 6386b/3 + 2388 = 0. What is b? -9, 1, 398 Suppose -2g5/9 + 106g*4/3 - 1312g*3 - 51112g*2/9 - 5824g = 0. Calculate g. -2, 0, 72, 91 Solve 70577v3/4 - 548v2 - v = 0. -2/1157, 0, 2/61 Factor v2/7 - 199v/7 + 4930/7. (v - 170)(v - 29)/7 Suppose q*3 + 352q*2 - 228099q - 83814498 = 0. Calculate q. -417, 482 Find c, given that -4c4 + 1172c*3 + 4732c*2 + 5932c + 2376 = 0. -2, -1, 297 Determine t, given that -2t2/7 - 1014t/7 - 19480/7 = 0. -487, -20 Suppose -d*2 - 12828d - 41139396 = 0. What is d? -6414 Factor 4l4 + 274976l*3 - 4125240l*2 + 20627200l - 34379500. 4(l - 5)3(l + 68759) Factor -4z4 - 15224z*3 - 14516052z*2 - 57881648z - 57820816. -4(z + 2)2(z + 1901)*2 Let 2l*5 + 76l*4 + 868l*3 + 1784l*2 - 12630l + 9900 = 0. Calculate l. -15, -11, 1, 2 Factor -4c2 - 78728c - 387381124. -4(c + 9841)2 Factor 5p*3 + 145p*2 - 4645p + 12495. 5(p - 17)(p - 3)(p + 49) Factor 2a*3/3 - 30a*2 + 400a - 5000/3. 2(a - 25)(a - 10)*2/3 Factor 32q*4 - 1072q*3 + 10098q*2 - 29160q. 2q(q - 20)(4q - 27)*2 Factor 2r*2/3 - 27134r/21 + 1292/7. 2(r - 1938)(7r - 1)/21 Factor -6h*3/7 + 2718h*2/7 - 35424h + 916608. -6(h - 341)(h - 56)*2/7 Let -2c*3 + 23938c*2 - 215236c - 526240 = 0. What is c? -2, 11, 11960 Find m such that m*5/4 + 397m*4/4 - 399m3/2 + m2/2 + 797m/4 - 399/4 = 0. -399, -1, 1 Find h such that 5h*3 - 510h*2 + 505h = 0. 0, 1, 101 Suppose 5x4 + 1325x*3 + 1300x*2 - 5300x - 5280 = 0. What is x? -264, -2, -1, 2 Let 5l2 - 4772990l + 1139071677005 = 0. What is l? 477299 What is y in -4y2/9 + 2096y/9 + 91060 = 0? -261, 785 Let -2u4/3 + 994u*3/3 - 42298u*2/3 - 994u/3 + 14100 = 0. Calculate u. -1, 1, 47, 450 Find d such that d*2 - 37d + 322 = 0. 14, 23 Let -3b3 + 24b*2 + 177b + 234 = 0. What is b? -3, -2, 13 Solve 2q2 + 6074q + 12140 = 0 for q. -3035, -2 Suppose -3v4 - 144v*3 + 324v*2 + 1200v = 0. What is v? -50, -2, 0, 4 Let -2z3/5 - 50z*2 + 1562z/5 - 262 = 0. Calculate z. -131, 1, 5 Factor -4r3 - 552612r*2 + 1105236r - 552620. -4(r - 1)2(r + 138155) Factor 12o2/5 + 1564516o/5 + 521504/5. 4(o + 130376)(3o + 1)/5 Factor 4119886092o*3 - 3432349018o*2 - 741112o - 40. 2(6o - 5)(18529o + 2)2 Factor -x3 + 1835x2 - 840888x - 842724. -(x - 918)*2(x + 1) Solve -6975i2 - 711444i + 612 = 0 for i. -102, 2/2325 Factor -2o2 - 17432o - 34856. -2(o + 2)(o + 8714) Factor -4z3 + 17536z*2 - 1621876z + 37906440. -4(z - 4290)(z - 47)*2 Factor 7i*3/5 + 117i*2/5 + 386i/5 - 24. (i + 5)(i + 12)(7i - 2)/5 Suppose l3/3 + 278l*2/3 - 93l = 0. What is l? -279, 0, 1 What is b in -2b2 + 3115b/2 - 57741/2 = 0? 19, 3039/4 What is m in 4m2 + 8328m - 8332 = 0? -2083, 1 Factor -4a5 - 12980a*4 - 10549480a*3 - 31570600a*2 - 31544660a - 10510564. -4(a + 1)3(a + 1621)*2 Factor 4n*3 + 15n*2 - 169n + 180. (n - 4)(n + 9)(4n - 5) Solve m3 - 7839m*2 - 536520m - 9140492 = 0. -34, 7907 Suppose -p*2/2 - 6151p/2 - 39897 = 0. What is p? -6138, -13 Let -15w3/2 - 981w*2 + 57957w/2 + 131130 = 0. Calculate w. -155, -4, 141/5 Suppose -l*4/2 - 7691l*3 - 59228305l*2/2 - 295288434l + 324910278 = 0. What is l? -7686, -11, 1 Factor 3h3/4 - 4353h*2/4 - 12h + 17412. 3(h - 1451)(h - 4)(h + 4)/4 Suppose -34r*4/5 + 10142r*3/5 - 23108r*2/5 + 1184r = 0. Calculate r. 0, 5/17, 2, 296 Factor -2a4/3 - 4a*3/3 + 82a*2/3 + 28a. -2a(a - 6)(a + 1)(a + 7)/3 Suppose -p*4/6 - 2017p*3/2 - 6049p*2/2 - 18145p/6 - 1008 = 0. Calculate p. -6048, -1 Determine u so that 2u2/5 - 1136808u/5 + 161541553608/5 = 0. 284202 Let -160a2 - 2004a - 5792 = 0. What is a? -8, -181/40 Factor 3t3 - 67899t*2 - 67902t. 3t(t - 22634)(t + 1) Determine k, given that -56k*3 + 604k*2 - 876k - 216 = 0. -3/14, 2, 9 Factor 3c3 - 2487c*2 + 24570c. 3c(c - 819)(c - 10) Factor -a2 - 22762a - 91032. -(a + 4)(a + 22758) Solve 4a*2 - 94340a - 566184 = 0. -6, 23591 What is n in -2n2/9 + 59656n/9 - 444854792/9 = 0? 14914 Determine f, given that -2f4/7 - 480f*3/7 + 5000f*2/7 = 0. -250, 0, 10 Factor 5f*2 - 1170f - 354960. 5(f - 408)(f + 174) Determine q so that -2q3/17 + 16364q*2/17 - 179782q/17 + 163420/17 = 0. 1, 10, 8171 Solve -y*2/6 - 905y/3 + 604 = 0. -1812, 2 Factor 5q2 + 58705q + 58700. 5(q + 1)(q + 11740) Determine n, given that -4n5 - 2392n*4 + 24324n*3 + 2392n*2 - 24320n = 0. -608, -1, 0, 1, 10 Suppose -22c4 - 540c*3 + 11746c*2 + 19104c + 6840 = 0. Calculate c. -38, -1, -6/11, 15 What is n in -28n4 - 596n*3 - 3696n*2 - 5936n - 1408 = 0? -11, -8, -2, -2/7 Factor -3u2 - 1258u/5 + 12537/5. -(u - 9)(15u + 1393)/5 Find d, given that -3d5 + 12d*4 + 573d*3 + 3042d*2 + 4428d + 1944 = 0. -6, -1, 18 Factor -5m3 - 615m*2 - 11715m - 61105. -5(m + 11)2(m + 101) Factor -2x2/19 - 18410x/19 + 18412/19. -2(x - 1)(x + 9206)/19 Determine a, given that -2a2/5 + 4580a - 45792/5 = 0. 2, 11448 Find z such that z*2 - 927706z + 215159605609 = 0. 463853 Find h such that -2h5/13 - 1442h*4 - 131154h*3/13 - 280998h*2/13 - 168588h/13 = 0. -9366, -3, -1, 0 Suppose 3o4 - 75o*3 - 18o*2 + 4224o + 11616 = 0. What is o? -4, 11, 22 Factor -5c2 + 143560c - 1030473680. -5(c - 14356)2 Factor -9d*4/8 - 1947d*3/8 + 651d*2/4. -3d*2(d + 217)(3d - 2)/8 Factor -s*3/10 - 874s*2/5 + 54824s - 3974880. -(s - 140)*2(s + 2028)/10 Suppose 3t5 - 1035t*4 + 116181t*3 - 3989817t*2 - 27188784t - 42436548 = 0. Calculate t. -3, 99, 126 Factor 124a2/9 + 2a. 2a(62a + 9)/9 Let -24a*2 - 28a - 4 = 0. Calculate a. -1, -1/6 Factor 2z2/3 - 4336z/3 - 1446. 2(z - 2169)(z + 1)/3 What is q in -5q4 - 3325q*3 + 13365q*2 - 10035q = 0? -669, 0, 1, 3	{ "pile_set_name": "DM Mathematics" }
e of 11j2 + 5j4 - j4 - 14j4 wrt j? -240j Suppose -5f + 2t - 4t - 16 = 0, -4f = 5t + 23. Let y = 1 - f. What is the derivative of y + a - 2 + 0 wrt a? 1 Let w(a) = 34a*3 - 6a + 1. Let x(v) = -33v3 + 5v - 1. Let r(c) = -5w(c) - 6x(c). Differentiate r(t) wrt t. 84t2 Let v be 7/4 + (-5)/(-20). What is the third derivative of 4i*2 + 5i*4 - 7i*4 + 0i*2 + 0i*v wrt i? -48i Let u = 20 - 17. Let c(j) be the second derivative of -j + 0j2 - 1/10j*5 + 0j*u + 0 + 1/12j*4. What is the third derivative of c(o) wrt o? -12 Let v = 14 + -11. Suppose h - 13 = -5i + 2h, -3i + 3h + 15 = 0. What is the second derivative of -is*5 + vs*5 - 2s + 0s5 wrt s? 20s*3 Let l be (-4)/(-1) + (5 - 4). What is the third derivative of 0k*l + 2k2 + k5 - 4k5 wrt k? -180k*2 Let j(o) be the third derivative of 0o*4 + 0o*3 - 1/120o*6 - 4o*2 + 0o + 0 - 7/60o5. What is the third derivative of j(r) wrt r? -6 Suppose 2g = 2k - 2, 2k - 1 = -2k + g. Let m = 3 - 1. Find the second derivative of k + 0 - mx*3 + x wrt x. -12x Let i = 2 - -1. What is the third derivative of 5 - 2k2 + ik*6 - 5k*6 - 5 wrt k? -240k3 Let u = 3 - 3. Find the third derivative of c2 - c*4 + 0c*4 + uc*4 wrt c. -24c Suppose -4n + 12 = -4w, n - 4w = -2w + 2. What is the second derivative of -4t + nt3 + t3 - 9 + 9 wrt t? 30t Let s(f) be the second derivative of 9f*5/20 + 13f*3/6 + 10f. What is the second derivative of s(o) wrt o? 54o Let d(t) be the first derivative of 3t5 + t3 + 33. What is the third derivative of d(w) wrt w? 360w Let x be 2/(-1)(-3 - -2). Let n(g) be the second derivative of 0 - g*x + 0g*3 - 1/6g*4 + 2g. Differentiate n(w) wrt w. -4w Let t = -7 + 5. Let f be 0 - -3 - t/(-1). What is the first derivative of f - c4 + 5 - 5 wrt c? -4c*3 Let m be -2 - ((-4 - -1) + 1). Let q = m - -1. Differentiate 5d - q - 4d + 0d wrt d. 1 Let i(z) = -4z - 1 + 9z + 4z + 7. Let p(t) = -4t - 3. Let w(u) = -2i(u) - 5p(u). Differentiate w(k) with respect to k. 2 Let x be (-1 + -1)(8 - 9). What is the third derivative of -3kx + k6 + 4k6 - 4k*6 wrt k? 120k*3 Suppose 3 + 14 = 4j + l, 0 = -5j - 5l + 40. What is the third derivative of 5h2 + 5h*j - 2h3 + h3 - 4h2 wrt h? 24 Suppose -j - 4b + 10 = -13, -3j - 4b = -29. Suppose -j = -o - 0. What is the third derivative of -8g6 + 0g*2 - og*2 + 7g*2 + 5g*6 wrt g? -360g*3 Let z(l) be the second derivative of -3l*8/7 - 25l*4/12 + 28l. Find the third derivative of z(p) wrt p. -2880p3 Let l(s) = 6s*3 - 6s - 3s3 - 2s*3 - 6s*2 - 3. Let j be l(7). What is the third derivative of -4n*3 + 3n*2 + 2n*5 + jn*3 + 0n*2 wrt n? 120n2 Let x(l) = l4 + l + 1. Let m(j) = 7j4 + 5j + 6. Let k(i) = -4m(i) + 20x(i). Differentiate k(q) with respect to q. -32q3 Find the first derivative of -2m2 + m2 + 4m2 - 8 wrt m. 6m What is the third derivative of 2z3 + 130 + 38z*2 - 6z*5 - 130 wrt z? -360z*2 + 12 Let r(l) be the second derivative of 1/6l*3 + 0 - 3l + 0l4 + 0l*2 - 5/42l*7 + 0l*5 + 0l*6. Find the second derivative of r(a) wrt a. -100a*3 Let z = -59 + 63. Let w(a) be the second derivative of 0a*2 - 1/3a*z + 0a*3 - a - 1/30a*6 + 0a*5 + 0. Find the third derivative of w(n) wrt n. -24n Suppose n + 2p - 3 = 9, 6 = -2n + 2p. What is the second derivative of 0c - c - nc5 - c5 wrt c? -60c*3 Let w(j) = 774j*3 + 450j + 99. Let i(n) = 31n3 + 18n + 4. Let c(d) = -99i(d) + 4w(d). Find the second derivative of c(g) wrt g. 162g Let p be 1/5 + 18/10. Suppose 5k = 2k + 6. What is the second derivative of -klp + l2 - l + 3l2 wrt l? 4 Let o(f) be the first derivative of 3f*4/4 - 10f - 8. What is the first derivative of o(d) wrt d? 9d2 Differentiate -8r*2 + 8r*2 + 3r*4 + 0 - 1 with respect to r. 12r*3 Suppose -3x + 1 = j - 3j, 14 = 2j + 2x. What is the third derivative of jr*5 - 9r*2 + 2r*2 + 3r*2 wrt r? 240r*2 Find the second derivative of -5x*5 - x - 4x*5 + 3x*5 + 4x*5 wrt x. -40x3 Let h(g) be the first derivative of g8/840 - 7g4/24 + 2g*3/3 - 3. Let r(w) be the third derivative of h(w). What is the first derivative of r(l) wrt l? 8l*3 Let z(b) = -24b*2 - 44b - 2. Let w(d) = -47d2 - 88d - 5. Let m(g) = 2w(g) - 5z(g). What is the second derivative of m(n) wrt n? 52 Let p(d) be the second derivative of 0d4 + 0d*5 + 2d*2 + 0 - 1/5d*6 + 0d*3 - 3d. Differentiate p(c) wrt c. -24c3 Let g(t) be the second derivative of 0t*3 + 0t*4 - 3/20t*5 + 2t + 1/2t2 + 0. Differentiate g(y) wrt y. -9y*2 Let g(f) = 3f*3 + 2f*2 + 2. Let k(u) = 10u*3 + 7u*2 - u + 7. Let y(t) = -7g(t) + 2k(t). Find the second derivative of y(v) wrt v. -6v Let m(t) be the first derivative of 1/5t5 + 5t + 0t3 + 0t*4 + 0t*2 + 4. What is the first derivative of m(q) wrt q? 4q*3 Let x(c) = 2 + 0 - 4 - 4c. Let k(o) = o. Let r(s) = 2s2 - s - 1. Let z be r(-1). Let y(i) = zk(i) + x(i). Differentiate y(n) wrt n. -2 Let y(u) be the third derivative of -11u6/120 - 7u*5/30 + 11u2. What is the third derivative of y(h) wrt h? -66 Let x(g) be the second derivative of -g7/140 - g4/24 + g3 + 5g. Let n(l) be the second derivative of x(l). What is the first derivative of n(r) wrt r? -18r*2 Let b(t) be the third derivative of 13t*5/60 - 7t*3/3 - 17t*2. Differentiate b(c) wrt c. 26c Let c = 31 + -28. Let s(k) be the second derivative of 0k2 - 1/15k*6 + 1/6k*4 + 0k*3 + ck + 0k5 + 0. What is the third derivative of s(b) wrt b? -48b Let x(a) be the first derivative of 0a3 + 2/5a*5 + 1 + 0a*2 + 2a + 0a4. Find the first derivative of x(o) wrt o. 8o3 Let h(s) be the second derivative of -s6/10 - s*4/6 + 6s. Find the third derivative of h(o) wrt o. -72o Let u(q) be the second derivative of -q7/2 + 13q*4/12 + 19q. Find the third derivative of u(h) wrt h. -1260h2 Let c(w) = -2w*3 - 5w*2 - 5w - 7. Let q(h) = h3 + h2 + h. Let o = -14 + 13. Let t(y) = oc(y) - 5q(y). Find the first derivative of t(x) wrt x. -9x2 Let i(h) be the second derivative of -2h6/15 - h4/3 - 2h. Find the third derivative of i(z) wrt z. -96z Let i be 11 - 3(-6)/(-9). Find the second derivative of 17a - a - ia - 10a*5 wrt a. -200a*3 Let q(k) be the first derivative of -4k*3 - 4k - 2. Differentiate q(o) with respect to o. -24o Let y(o) = 0o - o + 10 + 5o2 + 5o - 5. Let h(i) = -4i2 - 3i - 4. Let d(v) = 4h(v) + 3y(v). Differentiate d(b) wrt b. -2b Let y be 3/(-5) + 3/5. What is the third derivative of -3d*4 - 3d*2 + yd4 + d2 wrt d? -72d Let r(h) = h2 - h. Let a(p) = -3p*3 - 44p*2 + 3p. Let j(f) = a(f) + 3r(f). What is the third derivative of j(t) wrt t? -18 Let x(i) be the first derivative of -1/2i*4 + 0i*2 + i + 0i*3 + 6. Differentiate x(u) with respect to u. -6u*2 Let p(v) be the third derivative of -2v*2 - 5/3v*3 + 0v*4 + 0 + 0v + 1/10v5. What is the derivative of p(y) wrt y? 12y Find the third derivative of 11x6 + 25x*2 + 93x*5 + 16x*2 - 93x*5 wrt x. 1320x*3 Let p(z) = z + 3. Let c(u) = -7u - 19. Let v(h) = -7h - 19. Let r(b) = 5c(b) - 6v(b). Let n(j) = -39p(j) + 6r(j). Differentiate n(g) wrt g. 3 Let b(g) be the second derivative of -2g*6/5 + 2g*2 - 10g. What is the derivative of b(k) wrt k? -48k3 Suppose 0 = 3t + 3a - 12, 6a = 2a - 8. Let h(l) = 3l - 6. Let i be h(4). What is the third derivative of -d*2 - 3dt + di - d*2 wrt d? -240d*3 Let j(w) = -2w - 3. Let d be j(-2). Let o(f) = 3f2. Let c be o(d). Differentiate 1 - cx*2 - 2 + 4 wrt x. -6x Suppose 0d + 5b = 3d - 38, -4b = -2d + 28. Let z = -3 + d. What is the third derivative of -2v2 - v3 - 5v3 + 4v*2 + zv3 wrt v? -18 Find the second derivative of n5 + 3n4 + n4 - 4n*4 - 7n wrt n. 20n3 Suppose -2y - 3y = 3o - 1, 2y = 3o + 13. Find the third derivative of 2z4 - 4z*4 - 4z*y + 2z*2 wrt z. -48z Let v(l) be the first derivative of 2 - 3/5l5 + 0l*4 + 0l*2 + 0l**3 + l. What is the first derivative of v(s) wrt s? -12	{ "pile_set_name": "DM Mathematics" }
7.9 What is -45926.46973 rounded to the nearest 10? -45930 What is 436.797214 rounded to one dp? 436.8 Round 1107404.123 to the nearest 10000. 1110000 Round 42888.756 to 0 dps. 42889 Round -2480148358 to the nearest 1000000. -2480000000 What is -523.0236308 rounded to two decimal places? -523.02 What is -0.0000055760514 rounded to 7 dps? -0.0000056 Round 3.535506 to 4 dps. 3.5355 Round -0.000000708488149 to 7 decimal places. -0.0000007 What is 2851.55395 rounded to the nearest integer? 2852 Round -2893.75225 to the nearest ten. -2890 What is -73.28442 rounded to one dp? -73.3 What is -0.00000273589794 rounded to six decimal places? -0.000003 Round -81032.469 to the nearest 10. -81030 Round 0.0001200288283 to 5 decimal places. 0.00012 Round 7.270381 to the nearest 10. 10 What is -6028716656 rounded to the nearest 100000? -6028700000 Round 20565.3125 to the nearest integer. 20565 Round 0.4358471726 to two decimal places. 0.44 Round 5286.93171 to the nearest integer. 5287 Round -35.381621 to the nearest integer. -35 Round 845565.957 to the nearest 10. 845570 What is -9753.2282 rounded to the nearest 10? -9750 Round -63838.6114 to the nearest ten thousand. -60000 Round 0.043638085 to 4 dps. 0.0436 Round -1.349696666 to one decimal place. -1.3 What is -0.105357173 rounded to four decimal places? -0.1054 Round 1.4802382 to 1 decimal place. 1.5 Round -273.414509 to two decimal places. -273.41 What is -0.2149172947 rounded to 3 decimal places? -0.215 What is -127942717.5 rounded to the nearest 100000? -127900000 What is -15406.7284 rounded to the nearest one hundred? -15400 What is 0.000027288061 rounded to five decimal places? 0.00003 What is 82989.8525 rounded to the nearest 1000? 83000 Round 2258.0551 to zero decimal places. 2258 Round -1823.383801 to zero decimal places. -1823 Round -4.54229164 to three decimal places. -4.542 What is 0.01089486046 rounded to 3 decimal places? 0.011 What is -29178.481 rounded to the nearest 1000? -29000 What is -165.0328465 rounded to 3 dps? -165.033 What is 4929.455009 rounded to the nearest 100? 4900 Round -49674.3287 to the nearest one thousand. -50000 Round -756550.958 to the nearest 100000. -800000 Round -677549.6111 to the nearest 10000. -680000 What is -30.117142 rounded to the nearest integer? -30 Round 0.0000118142203 to seven dps. 0.0000118 Round -6680.688048 to the nearest 10. -6680 Round -0.0000123530524 to six dps. -0.000012 What is -45062081 rounded to the nearest one hundred thousand? -45100000 Round -382.7549811 to the nearest 10. -380 Round -0.008426412962 to six decimal places. -0.008426 What is 812.35382 rounded to the nearest 10? 810 Round -0.000040891799 to six decimal places. -0.000041 Round -243009.698 to the nearest one thousand. -243000 What is 12737.5594 rounded to the nearest 1000? 13000 Round 0.016537628 to three dps. 0.017 What is -13167252.3 rounded to the nearest 10000? -13170000 What is 3352.8958 rounded to 1 decimal place? 3352.9 What is -0.00885583875 rounded to six decimal places? -0.008856 Round 48261.25 to the nearest 1000. 48000 What is -645.654051 rounded to the nearest integer? -646 Round -3671034.3 to the nearest one thousand. -3671000 Round -1187.229019 to zero dps. -1187 Round 750465930 to the nearest one hundred thousand. 750500000 Round -556100.64 to the nearest 10000. -560000 Round 703033.71 to the nearest one hundred thousand. 700000 Round 0.000000160916811 to seven decimal places. 0.0000002 Round -156906.5 to the nearest 1000000. 0 What is 14283524.795 rounded to the nearest one million? 14000000 What is -0.0010588167 rounded to 5 dps? -0.00106 Round -0.001529087455 to four decimal places. -0.0015 Round 577.82445 to the nearest ten. 580 Round -23748.70789 to the nearest one thousand. -24000 What is -18460.90938 rounded to the nearest 1000? -18000 What is -1793.503563 rounded to the nearest one hundred? -1800 Round 26.1409102 to three decimal places. 26.141 What is -0.000042461671 rounded to five dps? -0.00004 What is -170.2661783 rounded to two dps? -170.27 What is 152.03568 rounded to the nearest ten? 150 Round -48188.0626 to the nearest 10. -48190 What is 0.81675449 rounded to 1 decimal place? 0.8 What is -12082472.4 rounded to the nearest one thousand? -12082000 Round 0.2383982611 to five dps. 0.2384 What is 0.0120957004 rounded to three dps? 0.012 What is 105581557 rounded to the nearest one million? 106000000 Round 0.44525833 to 1 decimal place. 0.4 What is -7071.18566 rounded to the nearest integer? -7071 Round -0.000090478765 to seven dps. -0.0000905 Round -0.00009603769 to 6 decimal places. -0.000096 Round 0.04608133446 to five dps. 0.04608 What is 140001.5519 rounded to the nearest ten? 140000 What is 0.0798033407 rounded to three decimal places? 0.08 Round -2.3749011 to one dp. -2.4 What is -3.879148648 rounded to the nearest integer? -4 What is 0.225334301 rounded to 3 dps? 0.225 What is 0.113577049 rounded to five decimal places? 0.11358 What is 0.00002613387723 rounded to six decimal places? 0.000026 What is 0.000337183778 rounded to 7 decimal places? 0.0003372 Round -75418845.9 to the nearest 10000. -75420000 What is 933668479 rounded to the nearest one million? 934000000 What is -0.000005414207 rounded to 6 decimal places? -0.000005 What is -12261.87131 rounded to the nearest ten? -12260 Round 0.00921810052 to four decimal places. 0.0092 What is -0.00010520943125 rounded to 5 dps? -0.00011 What is -14755.16508 rounded to the nearest 10000? -10000 Round -0.0000215014068 to 6 dps. -0.000022 Round -570.648999 to the nearest 100. -600 Round 32810192 to the nearest one hundred thousand. 32800000 What is 126040.705 rounded to the nearest 100? 126000 Round -0.0279575476 to 3 dps. -0.028 Round -0.0006438179638 to 5 decimal places. -0.00064 Round -33039774.85 to the nearest one million. -33000000 Round -0.00179265725 to seven dps. -0.0017927 Round -4396318567 to the nearest one million. -4396000000 What is 22084958 rounded to the nearest one thousand? 22085000 What is -3092398.816 rounded to the nearest one hundred? -3092400 Round -316.16468 to the nearest integer. -316 What is -0.01905790356 rounded to five decimal places? -0.01906 What is -0.001721483881 rounded to six dps? -0.001721 What is -29306.24304 rounded to the nearest one thousand? -29000 Round 269.76147 to the nearest ten. 270 Round -174830.54 to the nearest one thousand. -175000 Round -40710.6257 to the nearest 10. -40710 What is -134806692 rounded to the nearest one million? -135000000 Round 0.57313524 to 1 dp. 0.6 What is -17.070705 rounded to the nearest 10? -20 What is 0.001726172502 rounded to 5 dps? 0.00173 What is -268.05566 rounded to the nearest integer? -268 Round 0.1510289617 to three dps. 0.151 What is -99274.22015 rounded to the nearest integer? -99274 What is 9866210.4 rounded to the nearest one million? 10000000 What is -54356406 rounded to the nearest 10000? -54360000 What is -2.01976938 rounded to 1 decimal place? -2 Round -0.0045395424 to 5 decimal places. -0.00454 Round -0.01124569273 to 3 decimal places. -0.011 What is -60536.5931 rounded to the nearest one hundred? -60500 Round 0.04734954914 to 3 dps. 0.047 Round -43252629.86 to the nearest 1000000. -43000000 Round -0.0000324944846 to five dps. -0.00003 Round 2272529.623 to the nearest ten. 2272530 What is 0.0077552512 rounded to six decimal places? 0.007755 Round -57745502.24 to the nearest one hundred thousand. -57700000 What is 405.495916 rounded to 1 decimal place? 405.5 What is -0.2148704378 rounded to 4 decimal places? -0.2149 Round -0.000852425352 to 6 dps. -0.000852 What is -0.00060250184 rounded to 6 decimal places? -0.000603 Round 8.07531104 to three dps. 8.075 Round 1.031809415 to five dps. 1.03181 What is -0.001259596234 rounded to 4 decimal places? -0.0013 What is 0.000003355521972 rounded to 7 decimal places? 0.0000034 Round 37912110.54 to the nearest one million. 38000000 What is 31787.7764 rounded to the nearest one thousand? 32000 What is 1076269.42 rounded to the nearest one hundred thousand? 1100000 What is -1321.8388 rounded to the nearest one hundred? -1300 What is -3931.596434 rounded to zero decimal places? -3932 What is -5455063418 rounded to the nearest 1000000? -5455000000 What is -13.373682 rounde	{ "pile_set_name": "DM Mathematics" }
e terms in 287c3 - c + c + 345c*3 + 727c*3 + 51c*3. 1410c*3 Collect the terms in 72 - 46929873u*3 - 72. -46929873u*3 Collect the terms in 30073d*3 - 8493d*3 - 21577d*3 + 5d - 2d - 3d. 3d3 Collect the terms in 68c*3 - 8c*2 + 9c*2 + 75c*3 - 147c*3. -4c3 + c2 Collect the terms in -477208c3 + 7 - 3 - 4. -477208c*3 Collect the terms in 30v*2 - 29v - 86v - 6 - 85v - 100v + 300v. 30v2 - 6 Collect the terms in -292a + 1764a - 289a - 296a - 287a - 311a - 286a. 3a Collect the terms in j2 - j2 + 21929574695 - 63j*3 - 21929574695. -63j*3 Collect the terms in -18 + 1798y - 1184y + 35 - 18. 614y - 1 Collect the terms in -330001l2 - 330011l*2 + 659993l*2 + l. -19l*2 + l Collect the terms in -39163k - 39156k + 0k3 - k3 + 117552k - 39233k. -k*3 Collect the terms in -3i*2 - 58597495750155i + 58597495750155i. -3i*2 Collect the terms in -22525902 - 41h*2 + 22525902 - 3h*3. -3h*3 - 41h*2 Collect the terms in -61g*2 - 41g + 6g3 - g3 - 8g*2 + 69g*2. 5g*3 - 41g Collect the terms in -1014u3 - 1198u*3 + 1405u*3. -807u*3 Collect the terms in 332321r*2 - 166296r*2 - 166248r*2. -223r2 Collect the terms in 668 + g2 - 2158 + 771. g*2 - 719 Collect the terms in 538818x*3 - 271066x*3 - 267754x*3. -2x*3 Collect the terms in 2390s*2 - 795s*2 - 788s*2 - 54s - 797s2 + 58s. 10s2 + 4s Collect the terms in -5 + 12 - 7 + 57375w. 57375w Collect the terms in 6 + 1149b - 15b*2 - 1149b + 3b3 - 7b*2. 3b*3 - 22b*2 + 6 Collect the terms in 4916o - 14853o + 4956o + 4935o. -46o Collect the terms in 1964w + 22w*2 - 26w*2 - 3924w + 1960w. -4w*2 Collect the terms in -43122y - 43104y + 129310y - 43084y + 6y*2. 6y*2 Collect the terms in -136064 + 8l*2 - 6l*3 + 6l*3 - 136040 - 4l*3 + 272104 - 8l*2. -4l*3 Collect the terms in 281v*3 - 1128v*3 + 295v*3 + 247v*3 + 311v*3. 6v*3 Collect the terms in 1372a*2 + 1381a*2 + 1894a*2. 4647a*2 Collect the terms in -235a + 476a + 4566 - 239a - 4566. 2a Collect the terms in -6491 + 7779s*2 + 6491. 7779s*2 Collect the terms in -12712p*3 + 87p*2 + 25391p*3 - 12680p*3 - 87p2. -p3 Collect the terms in -738n3 - 855n*3 + 3896n*3 - 770n*3 - 770n*3 - 764n3. -n3 Collect the terms in 67y - 1268y*2 + 8y - 1964y2 - 13y. -3232y2 + 62y Collect the terms in -1174 - 1175 - 1168 - 1433p + 3517. -1433p Collect the terms in -2f + f + 218f*2 + 0f + 0f2 - 323f*3 + 1346f*3 - 217f*2. 1023f3 + f2 - f Collect the terms in -1515 - 42d + 1515 - 229d. -271d Collect the terms in 9u*2 + 23u*2 + 1742u*3 - 1752u*3. -10u*3 + 32u*2 Collect the terms in 244 - 244 - 2618w*2 - 333626w*2. -336244w*2 Collect the terms in 1594r + 1600r + 1600r + 1594r + 1597r - 7986r. -r Collect the terms in 64541o + 581 - 581. 64541o Collect the terms in 0j*3 - 28068785j + 28068785j + 0 + 8j*3 + 0. 8j*3 Collect the terms in -40q*2 - 55q*2 + 57q*2 + 30q*2 + 151q*2 + 50q*2. 193q*2 Collect the terms in -16a - 25a - 9a + 76a - 13a - 19a. -6a Collect the terms in 0 - 7y2 + 605y*2 + 0 - 218y*2 + 0. 380y*2 Collect the terms in -207503587k*2 + 103751773k*2 + 103751817k*2. 3k*2 Collect the terms in 122 + 376y*2 - 45 - 41 - 36 - 517y*2. -141y*2 Collect the terms in 27d - 61d + 34d - 116885d2. -116885d*2 Collect the terms in 0w + 2w - 183466w*2 - 183467w*2 + 366931w*2. -2w*2 + 2w Collect the terms in -1305f + 113 - 208f - 225 - 2105f + 112. -3618f Collect the terms in 371b + 4b*2 - 1128b + 370b + 387b. 4b2 Collect the terms in -268324 + 0h*3 + 268321 + 16h - 16h - 5h*3. -5h*3 - 3 Collect the terms in -486011b*2 + 217 - 217. -486011b2 Collect the terms in -c3 + c3 + c3 - 3c3 + c3 + 1111. -c3 + 1111 Collect the terms in 25925 + 25923 + b2 - 51733. b2 + 115 Collect the terms in -7263 - 13l*3 + 14l3 - 1237 + 2574 - 4077. l3 - 10003 Collect the terms in -143659q - 279593q - 170553q. -593805q Collect the terms in 3r2 + 4r*2 + 12834252644122 - 4r*2 - 4r*2 + 5r*2 - 12834252644122. 4r*2 Collect the terms in -183j*2 - 15j - 563j2 + 126j*2. -620j*2 - 15j Collect the terms in 6p - 7p - 10p - 7p - 19p + 36p + 9. -p + 9 Collect the terms in -8b + 2104b*2 - 1048b*2 - 997b*2 - 11b + 19b. 59b*2 Collect the terms in -4m + 7m + 222m*2 - m - 182m*2. 40m*2 + 2m Collect the terms in 8u + 13u*3 + 9u*3 - 23u*3 - 49u*3. -50u*3 + 8u Collect the terms in -645a2 + 725a*2 + 1190a*2 + 321a*2 - 150a*2. 1441a*2 Collect the terms in 212677i*2 - 425755i*2 - 15i*3 + 213078i*2. -15i*3 Collect the terms in -34015j + 1 + 102052j - 34021j - 7 - 34017j. -j - 6 Collect the terms in 109g + 34 - 55171g3 - 204g - 35 + 95g. -55171g*3 - 1 Collect the terms in -7 + 22l*2 + 24 - 2 - 8 - l. 22l*2 - l + 7 Collect the terms in 2552b*2 - 3330b*2 - 8528 + 8525. -778b*2 - 3 Collect the terms in -44i*2 - 23i*2 - 74i*2 + 50i - 28i - 22i. -141i2 Collect the terms in -2750815b*2 + 1951b + 2750818b2 - 1951b. 3b2 Collect the terms in -13778580i*2 + 13778580i*2 - 566i*3. -566i*3 Collect the terms in -296y - 333y - 314y - 287y + 1463y - 316y - 1. -83y - 1 Collect the terms in 18535h - 9212h + 27355h + 4h*3 - 2. 4h*3 + 36678h - 2 Collect the terms in 772i + 3 - 771i + 10 + 7 + 28. i + 48 Collect the terms in 67 + 14971x - 40057x - 67. -25086x Collect the terms in -40039386a*2 - 4a + 4a + 40039406a*2. 20a*2 Collect the terms in 57781c*2 - 114981c*2 + 2 + 58944c*2. 1744c*2 + 2 Collect the terms in 539 + 25k3 + k3 - 626 - 4k3. 22k*3 - 87 Collect the terms in -10059n - 9842n + 19910n. 9n Collect the terms in 7h + 81076759h2 - 7h - 81076431h2. 328h*2 Collect the terms in -132281016m + 290m2 - 1 + 132281016m. 290m2 - 1 Collect the terms in -143 - 147 + r2 - 160 - 136 + 586 - 3r*2. -2r*2 Collect the terms in -3103c*2 + 3101c*2 + 716c + 7c3 - 716c. 7c3 - 2c2 Collect the terms in -205473 - 205463 - o3 - 2o + 2o - 205468 + 616404. -o3 Collect the terms in -u2 + 6u2 - 445 + 152 + 139 + 153. 5u*2 - 1 Collect the terms in -1017x*3 - 641x*3 + 228x*3 - 97x*3 + 120x*3. -1407x*3 Collect the terms in 47y*3 + 2 - 4y + 177y2 + 1 + 166y*2. 47y*3 + 343y*2 - 4y + 3 Collect the terms in 21n + 12n + 47n + n - 59n. 22n Collect the terms in 7561k + 21 + 2 - 14 - 9. 7561k Collect the terms in 2q + 12740 - 26201 + 13463. 2q + 2 Collect the terms in -407139 - 407166 + 814305 + 48p. 48p Collect the terms in -41t*2 + 65t*2 - 86t*2 + 0t + 7t + 61t2. -t2 + 7t Collect the terms in 87d + 1396 - 97d + 13886. -10d + 15282 Collect the terms in -3 + 2931432i - 2931432i - 38i2 + 3 + 15i*2 + 26i*2. 3i*2 Collect the terms in -31884m - 2 + 7972m + 7965m + 7978m + 7967m + 2. -2m Collect the terms in 212271w*3 + 6 + 212276w*3 + 212284w*3 - 636847w*3. -16w*3 + 6 Collect the terms in -8 + 5675728b - 5675687b + 2. 41b - 6 Collect the terms in -16t2 + 418875 + 418687 - 837562. -16t*2 Collect the terms in -28114l*3 + 55209l*3 - 27093l*3. 2l*3 Collect the terms in 218 + 123s*3 + 254s*3 - 391s*3. -14s*3 + 218 Collect the terms in -4228 - 4222 - 4225 - 4228 - 4225 + 5b + 21128. 5b Collect the terms in 9662w - 1 + 81977w + 84175w. 175814w - 1 Collect the terms in -1096p*3 + 200722p*2 - 5p + 9p - 200722p*2 - 4p. -1096p3 Collect the terms in -4319l + 329l - 7587 + 3791 + 3796. -3990l Collect the terms in 14451z + 1 - 43373z + 14460z + 14462z + 35z2. 35z*2 + 1 Collect the terms in 121y - 121y + 1018276y*2 - 1018276y*2 + 16y*3. 16y*3 Collect the terms in 58f*2 - 84f*2 + 547f + 455f2. 429f*2 + 547f Collect the terms in 38820a + 38082a - 76897a. 5a Collect the terms in 238 + 256126775n - n2 - 256126775n. -n*2 + 238 Collect the terms in 1439685517149770a - 6a2 - 1439685517149770a. -6a*2 Collec	{ "pile_set_name": "DM Mathematics" }
by (-4)/(-4(-7)/(-189)). 24 Let r(x) = x. Let y(g) = 2g*2 + 10g - 9. Let o(k) = 5r(k) + y(k). Suppose 0b - 2b + 20 = 0. What is the remainder when o(-9) is divided by b? 8 Let s(r) be the first derivative of 55r3/3 + r2/2 - r - 2. Let p = 4070 + -4051. What is the remainder when s(1) is divided by p? 17 Suppose -63 = -3l + r - 8, 5r - 29 = -l. What is the remainder when 947 is divided by l? 16 Suppose -285 = -156g + 137g. What is the remainder when 695 is divided by g? 5 Suppose -43t - 563 + 4304 = 0. Calculate the remainder when t is divided by 46. 41 Suppose -4c = -136 - 264. What is the remainder when c is divided by 21? 16 Let g = 428 + -186. Suppose -4q + g = 2s, -q + 3s + 267 = 3q. What is the remainder when q is divided by 22? 19 Let m(g) = g*3 - 7g*2 + 6g - 1. Let v(y) = 7y2 - y - 1. Let z be v(-1). What is the remainder when m(z) is divided by 11? 8 Let j = 143 + 20. Calculate the remainder when j is divided by 43. 34 Suppose -1952 = -10t + 2t. What is the remainder when t is divided by 7? 6 Let f = 36 - 7. Let s = -17 + f. Calculate the remainder when 45 is divided by s. 9 Suppose -25x + 162 = -16x. Calculate the remainder when x is divided by ((-1)/2)/((-7)/140). 8 Let h = -4 - -11. Suppose -50b = -47b - 57. Suppose 22q = bq + 57. Calculate the remainder when q is divided by h. 5 Suppose 0 = -0o + 3o - 9. Suppose -3s = 2d - 4 - 2, 4s - od = 25. What is the remainder when s(-2)/(-4)1 is divided by 1? 0 Let n(v) = 2v*2 + 4v + 28. What is the remainder when n(-3) is divided by 6? 4 Suppose 23y + 0y = 782. Calculate the remainder when 97 is divided by y. 29 Let p = -492 + 1000. Suppose 39s + p = 43s. Calculate the remainder when s is divided by 32. 31 Suppose 11z = 1034 + 2310. What is the remainder when z is divided by 6? 4 Let l = 391 - 368. What is the remainder when 64 is divided by l? 18 Let j(l) = l2 - l - 5. What is the remainder when 20 is divided by j(4)? 6 Suppose 4p = -p + 10. Let t = 27 + -24. Suppose 0 = -pl, -tw - 2l + 288 = w. Calculate the remainder when w is divided by 15. 12 Suppose -68 = -2h + 5m + 327, 0 = h - 2m - 197. What is the remainder when 595 is divided by h? 10 Suppose -5o = 322 - 337. Suppose 4i + 58 = -5n, n - 2n + 5i = 29. What is the remainder when 1 + 3/((-6)/n) is divided by o? 2 Suppose 564t - 140 = 559t. Let d be (1 + 4)(-4 - -5). Suppose -u = -5u + b + 58, 83 = du + 4b. What is the remainder when t is divided by u? 13 What is the remainder when 86 - (2 + (0 - (-8)/2)) is divided by 11? 3 Let m = 24 + 97. Calculate the remainder when m is divided by 118. 3 Suppose -44h + 40h + 72 = 0. What is the remainder when (4/(-6))/(4/(-498)) is divided by h? 11 What is the remainder when 679 is divided by (-2 + 128/10)/((-633)/(-2110))? 31 Suppose 0 = 2z + 2h - 150, 3h - 122 = -2z + 25. Let q = z - 27. Suppose q = -2t + 5t. Calculate the remainder when t is divided by 5. 2 Let z(a) = 66a*2 - a. Let k be 2/(-13) - (-533)/169. Suppose -4 - 106 = -5g + 5d, kd + 89 = 4g. Calculate the remainder when z(-1) is divided by g. 21 Let x be (-42)/9(-12)/8. Suppose -2w = -5b - xw + 295, -2w = 4b - 234. Calculate the remainder when b is divided by 20. 18 What is the remainder when 60 is divided by (-402)/(-16) + 7/336-6? 10 Suppose m + 1 - 6 = 0, 0 = -2c + 3m - 39. What is the remainder when 38 is divided by (0 - (c - -1)) + -1? 8 Suppose -4 = -c + 23. Suppose -c = -7r - 6. What is the remainder when 28 is divided by r? 1 Let l = -9 + 12. Let k(n) = ln - 12n2 - 2n - 2n + 27 + n3 - n. Calculate the remainder when 15 is divided by k(12). 0 Suppose -k = 33 - 36. Let g = 12 + -5. Calculate the remainder when g is divided by k. 1 Let x(u) = 4u2 - u3 - 3u2 + u2 - 3u*2. Let v be x(-1). Suppose -3n + 3l + 42 = v, n + n = 3l + 29. What is the remainder when 50 is divided by n? 11 Suppose -89r + 90r - 22 = 0. Calculate the remainder when 83 is divided by r. 17 What is the remainder when 251/2 - ((-14)/4)/(-7) is divided by 6? 5 What is the remainder when 87 is divided by (9/((-108)/(-256)))/(4/6)? 23 Suppose 0n - 3n + 2z + 35 = 0, 5n + z - 67 = 0. What is the remainder when 76 is divided by n? 11 Suppose -54 = w - 4m, -3w - 127 = -3m - 2m. Let o = w + 49. What is the remainder when 25 is divided by o? 10 Suppose w = 3r - 39, -9w + 4r = -5w + 180. Let o = -16 - w. Calculate the remainder when o is divided by 7. 4 Suppose 14 = -5j + 12j. Suppose -3m = jh - 202, m + 6h = 7h + 74. Calculate the remainder when m is divided by 25. 20 Let o = -27 + 61. Suppose 5g + o = 164. What is the remainder when 102 is divided by g? 24 Let i(y) = -y3 - 11y*2 - 8y - 84. Calculate the remainder when 29 is divided by i(-11). 1 Suppose 2w + 1222 = 4l, -4l + 0w = 4w - 1240. Calculate the remainder when l is divided by 10. 7 Suppose -132 = -5w - 3k, 26w - k = 25w + 36. Calculate the remainder when 0 + 1151 + -1 is divided by w. 24 Suppose 0b - 4b - 208 = 0. Let l be 30/(-26) + (-8)/b. What is the remainder when (l - -1) + -2 - -42 is divided by 14? 12 Suppose 25n - 2010 = 20n. Calculate the remainder when n is divided by 15. 12 Let b = 2 + -1. Suppose -f + 4l - 11 = 0, l = -22 + 25. What is the remainder when f is divided by b? 0 Let z(l) = l3 - 7l*2 + 9l - 8. What is the remainder when 289 is divided by z(6)? 9 Let f(a) = 10a2 - 2a + 1. Calculate the remainder when f(1) is divided by 10/(8 + -5 + -1). 4 Let j(h) = 3h - 6h + 5 + 7 - 3. What is the remainder when 35 is divided by j(0)? 8 Let m = 59 - 42. Let v be (-4 - -23)/(2/(-14)). Let t = v + 198. Calculate the remainder when t is divided by m. 14 Let i(y) = y*2 - 18y - 131. What is the remainder when i(26) is divided by 18? 5 Suppose -5n + 6n + 8 = 0. Let u(d) = d*3 + 7d*2 - 13d - 13. What is the remainder when u(n) is divided by 17? 10 What is the remainder when 151 is divided by ((-26)/(-6))/(71/426)? 21 Let s(j) = j*3 + 11j*2 + j + 15. Calculate the remainder when (-7 + 1 + 1)/(-1) is divided by s(-11). 1 Let d = 91 - 106. Let u(l) = -3l*3 - 2l + 1. Let q be u(-2). Let r = q + d. What is the remainder when 55 is divided by r? 13 Suppose 3u - 81 + 57 = 0. What is the remainder when 21 is divided by u? 5 Calculate the remainder when -192(0 + -9 + 8) is divided by 105. 87 Suppose 4u = 20, -3q + 116 = 4u - 78. Calculate the remainder when q is divided by (4 + 22/(-5))-30. 10 Let m(c) = -c*2 + 12c - 8. Let y = 9 - 11. Let w be 39/(-2 + 5) + y. Calculate the remainder when m(w) is divided by 1. 0 Let t(b) = b*2 - 2b - 2. Calculate the remainder when 40 is divided by t(-4). 18 Let d = 24 + -16. Suppose 0 = -5c + d + 7. Suppose m = ca + a + 3, 2m + 5a - 19 = 0. Calculate the remainder when m is divided by 5. 2 Let q(a) = -2a2 - 9a - 1. Let o be q(-6). Let z = -14 - o. What is the remainder when 16 is divided by z? 1 Suppose -10 = 3r - 4a, -5r + 0r + 14 = a. Suppose 0 = 5s - 15, -7s = 4d - 2s - 27. What is the remainder when r is divided by (3 - 5)/(-5 + d)? 0 Suppose 52 = 4g - 0g - 4o, 27 = 2g - 3o. Suppose -10h + 276 = -54. Calculate the remainder when h is divided by g. 9 Let y(s) = -5s2 + 171s + 77. Calculate the remainder when y(33) is divided by 140. 135 Let y = 53 + -19. Suppose -46 = -9f - 10. Calculate the remainder when y is divided by f. 2 Let h(o) = -o3 + 6o*2 - 2o - 4. Suppose 0 = -4j + 2z + 28, 0j + 5z + 25 = j. Calculate the remainder when h(j) is divided by 31/5 + 20/25. 4 Let q(o) = -o*2 + 37o + 63. What is the remainder when q(35) is divided by 21? 7 Let l(g) = 144g + 26. What is the remainder when l(3) is divided by 46? 44 Let p = -113 - -50. Let w = p + 86. What is the remainder when 77 is divided by w? 8 Let l = -309 + 324. Calculate the remainder when 141 is divided by l. 6 Calculate the remainder when (4183/235)/((-18)/20 + 1) is divided by 12. 10 Suppose 0 = -5r - 5b + 40, 3r - 4b = -7 + 3. Suppose -5c + 117 = 2p - rc, c = 3p - 188. Calculate the remainder when p is divided by 17. 10 Let x = 217 - 95. What is the remainder when x is divided by 36? 14 Let i be (-6)/(-2) - 3(4 - 8). Suppose 22s - 70 = is. Calculate the remainder when s is di	{ "pile_set_name": "DM Mathematics" }
)/30). Sort 0, -3, a, -1. -3, a, -1, 0 Let r = -4.6 - 26.4. Let q = r - -20. Let t = q + 11. Sort -1, 6, -3/2, t. -3/2, -1, t, 6 Let q = 32 + -22. Let m = q - 5. Suppose 5h - 3t + 0t + 30 = 0, -h - mt = -22. Sort 1, h, 5 in increasing order. h, 1, 5 Let h = 3 + -2. Let q be 3/((-9)/(-12)) + -6. Let i be (-9)/604(-5)/q. Sort -2, -0.1, i, h in increasing order. -2, i, -0.1, h Let j(n) = 4n + 19. Let f be j(-4). Let c = -2.9 - -6.4. Let x = c - 3.7. Put f, -0.5, -3, x in increasing order. -3, -0.5, x, f Let r be 2/(2-1)(-58)/29. Suppose -x + 2 = 0, -rx - 21 = 3q - 5x. Sort -16, 5, q in decreasing order. 5, q, -16 Suppose -705 = 220n + 175. Suppose -51 = -5m - 186. Let r = -47 - m. Put r, n, 5 in ascending order. r, n, 5 Let f(j) = -12j3 + 7j*2 + 9j - 5. Let u be f(4). Let d = -620 - u. Put 2, 4, -4, d in ascending order. -4, 2, 4, d Suppose -174j + 5g = -177j + 22, -g = -4j - 32. Put j, -4, -256, 5, -1/2 in descending order. 5, -1/2, -4, j, -256 Let j = -3.9382 - 0.0618. Sort j, 1, 51/2 in decreasing order. 51/2, 1, j Let p = 248.57 + 18.23. Let f = -230 + p. Let r = -37 + f. Sort 0.07, 1/3, r. r, 0.07, 1/3 Let m = 626 + -574. Suppose -6f - m = -58. Put f, -6, 3, -3 in descending order. 3, f, -3, -6 Suppose 0 = -3n + 15, 5s - 45 = 2n - 7n. Suppose -sd = -3v - 6, 2d - 6d = 4v + 8. Let w be (-8)/132 - 10/(1980/978). Put 5, w, v in increasing order. w, v, 5 Let m(v) = 14v2 + 1. Let x(h) = -h2 + 5h - 1. Let s be x(5). Let a be m(s). Suppose -an + 3n = -48. Sort -5, n, 2, 3 in increasing order. -5, 2, 3, n Let t = -3.6 + 3. Let s = 84354.8 - 84354.9. Sort s, 3, t in descending order. 3, s, t Let r = -0.08076 - 0.01924. Sort 0, 38, r, 17 in descending order. 38, 17, 0, r Let k = -7125 - -8692. Sort 4, 5, k in decreasing order. k, 5, 4 Let g = 11686 - 11683.7. Let h = 5.7 - 2.4. Let w = g - h. Sort -26, -3, w in decreasing order. w, -3, -26 Suppose 16o = 17o + 106 - 103. Sort o, -1044, -2 in descending order. -2, o, -1044 Let c(k) = -k + 8. Let s be c(6). Suppose -27 = 3u, -17327u + 17326u = -t + 9. Sort t, s, -3, 18. -3, t, s, 18 Let k = -1062 - -1059. Put -480, 1/9, -4, k in increasing order. -480, -4, k, 1/9 Let k = -0.3 - -0.8. Let m = 30293 - 30293.4. Put m, 0, k, -5 in increasing order. -5, m, 0, k Suppose -2f + 22 = 4q, -5q + 2 = 5f - 13. Let y be q/(224/(-98)) - (-6)/4. Put y, -4, -3, -36 in decreasing order. y, -3, -4, -36 Let v(s) = -s + 3. Let g be v(5). Let f(x) = x2 + 114x - 471. Let r be f(4). Sort r, -3, g, 5 in ascending order. -3, g, r, 5 Let l(u) = u*2 - 39u - 18255. Let r be l(156). Suppose 2w + 2c + 56 = 0, -w - 4c + 38 = -3w. Sort r, -1, w. w, r, -1 Suppose 260r + 1012 = 352r. Sort -62, r, 5 in decreasing order. r, 5, -62 Suppose -4n - 5k = -13, -16 + 4 = -4n - 4k. Let f = -312 - -311. Sort n, 0, f, 4. f, 0, n, 4 Let k be ((-1)/(-6)-2)/((-247)/(-1482)). Suppose 3c = 5b - 18, 3b - 5b + 5c - 8 = 0. Let m be ((-9)/k4/b)/1. Put -5, 2, m, 5 in decreasing order. 5, m, 2, -5 Let p(w) = w + 1. Let a be p(2). Suppose 0 = -4k + 40, 537x - 5k = 540x - 50. Put 8, a, x in decreasing order. 8, a, x Let m(l) = l3 - 185l + 2l2 + 180l + 9l2 + 11 - 7l2 + l2. Suppose 0c + 6 = -c. Let h be m(c). Put -5, h, 2 in ascending order. -5, 2, h Let l be 15(216/(-486) + (-14)/(-18)). Put 11, -4, -1, l, 0 in ascending order. -4, -1, 0, l, 11 Let m = -120.6708 + -0.0292. Let y = m - -121. Sort 0.4, -0.3, y. -0.3, y, 0.4 Let m(k) = k*2 + 37k - 598. Let h be m(12). Sort -3, h, 0, -2. h, -3, -2, 0 Let o be -12(3 + 10/(-4)). Let w = 6 + o. Suppose 10g = -17g - 135. Put g, w, 6 in ascending order. g, w, 6 Let p = -166 - -170. Suppose -20 = -j - 2. Sort -5, -3, p, j. -5, -3, p, j Let c be (-6 - (-1 - 0))/((-175)/(-35)). Put 7, c, -17, 2 in descending order. 7, 2, c, -17 Let y = 3641 + -3645. Let o = 12 + -13. Sort o, y, 1.2 in descending order. 1.2, o, y Let a(l) be the first derivative of l3 + 22l*2 + 27l - 227. Let m be a(-14). Let j = -0.2 + 0.2. Sort j, 0.5, m, 2/3 in descending order. 2/3, 0.5, j, m Let z = -810.5 - -810.57. Sort -1, 27, z in ascending order. -1, z, 27 Let b(i) = 122i + 2448. Let c be b(-20). Put c, -6, -13, 0 in ascending order. -13, -6, 0, c Let m = 1824 + -1824. Let j = -1.9 - 1.1. Let x = 4 + -2. Put j, m, -2, x in ascending order. j, -2, m, x Suppose -5w - 3m = 9, m - 4 = -2w - 7. Suppose 6z + 2 = 20. Sort w, 15, z in increasing order. w, z, 15 Suppose g = -4d + 8, 12 = 5d - 3g + 2. Sort d, 20/189, 0.2, 2/15 in ascending order. 20/189, 2/15, 0.2, d Let q = 1905.6 + -1906. Sort q, 0.01, -0.5, 4. -0.5, q, 0.01, 4 Let z = 678 - 675. Sort -1/5, z, -3/5, -23. -23, -3/5, -1/5, z Suppose -18x = -2x + x. Suppose -2y = u - 8, -3y + xy = u - 10. Sort y, -1, 3 in ascending order. -1, y, 3 Let i be ((-5)/3 + (-38)/114)/2. Sort 10, i, 1, -54 in descending order. 10, 1, i, -54 Let f = 62/79 + -1708/1975. Sort -60, -4, 2/3, f in decreasing order. 2/3, f, -4, -60 Let y = 6 - 0. Suppose -59 = -3t - 68. Suppose 65 = -7x + 20x. Put y, -5, x, t in decreasing order. y, x, t, -5 Let k = 25596 + -25593. Sort k, 4, -8, -18, -2. -18, -8, -2, k, 4 Let b = 7884 - 7882. Sort 0, 4/5, -48, b, 0.3 in descending order. b, 4/5, 0.3, 0, -48 Let q = -5032 + 4980. Put 3, q, -4 in decreasing order. 3, -4, q Let y = 11 - -100. Let p = -109 + y. Sort 2/7, p, -18. -18, 2/7, p Suppose -4j - k - 11 = 0, k + 2 = -j - 0k. Suppose -4s = 5m + 71, m - 1514 + 1476 = 5s. Sort j, s, 0, -4 in decreasing order. 0, j, -4, s Let y be (13/(-2))/(-3 - (-55)/18). Let a = y + 118. Put -2, 5, a, -4 in ascending order. -4, -2, a, 5 Let g = 0.51656 + -0.31656. Sort 0.69, 1/4, -0.1, -3/5, g. -3/5, -0.1, g, 1/4, 0.69 Let o = 15 + -20. Suppose -3m - 5h + 4 + 47 = 0, -3m + 2h + 51 = 0. Suppose 0 = -2a - 7 + m. Sort o, -1, a, 4. o, -1, 4, a Let q = 3633 - 3632. Suppose -2u - 4 = -3u - 2y, -3u + 3y - 15 = 0. Sort 36, u, q in descending order. 36, q, u Suppose b + 73 = 5f, 5b - 27f = -24f - 299. Sort 2, 4, 5, b in descending order. 5, 4, 2, b Suppose -29c + 12 = -25c. Let n(j) = -cj + 3j + 5j - 21 - 6j. Let m be n(-20). Put m, 1, 4, -5 in descending order. 4, 1, m, -5 Let o = 8/13 - 1/65. Let w be 390/(-609) + 4/(-14). Let j = w + 2/29. Sort 2/3, o, j in decreasing order. 2/3, o, j Let m(p) = -p2 - 6p - 5. Let n be m(-4). Suppose -nl - l + z = 7, 5l - 3z = -7. Let r be ((-45)/(-48))/((-363)/(-484)). Sort r, 4, l, 4/7. l, 4/7, r, 4 Let r(s) = -s2 - 2s + 87. Let b be r(8). Suppose -12 = -10i + bi. Sort -2/3, i, -1 in ascending order. -1, -2/3, i Let k = 17939/80685 + -1/8965. Let f be (-1 + 0)/(6/5). Sort -3/7, -3, f, k in descending order. k, -3/7, f, -3 Suppose 0 = -5l + 3f + 28, -12f + 7f + 15 = 4l. Let a = -46.4 - -43. Let c = 0.6 - a. Sort -2/9, c, l in increasing order. -2/9, c, l Let j be (1 - -14) + (-225)/15. Let o be (-3)/4 - (-2)/2. Put o, j, -2/5, -4 in descending order. o, j, -2/5, -4 Let w = -0.050452 + -9.949548. Let j = 0.03 - -0.37. Let b be (-24)/(-9)(-6)/(-4). Put 0, w, b, j in descending order. b, j, 0, w Let m = -13/3 + 11/3. Suppose 1130g = 1133g + 9. Sort 0.1, 5, g, m. g, m, 0.1, 5 Suppose -385 = 45m - 610. Suppose -4r + q = 0, 2r = 2q - 0 + 6. Let n = 0 - 5. Sort m, r, -3, n. n, -3, r, m Let g = 2 - 2.01. Let b = -28664 + 28649. Sort g, -5, b in decreasing order. g, -5, b Suppose 0 = -0p + 2p - 5y + 7, 12 = 4y. Let c(z) = 8z2 + 3z - 4. Let h be c(-4). Let o = 115 - h. Sort o, -13, p in decreasing order. p, o, -13 Let a = 368 + -136. Let g = a - 232.3. Sort -0.1, g, -4/5 in descending order. -0.1, g, -4/5 Let w be 24/2 - (60 + -49). Sort w, 2, 3, 7, -5. -5, w, 2, 3, 7 Let s = 8057 - 8062. Sort 19, s, -2, 1. s, -2, 1, 19 Let q = 2.043 + 0.457. Let w = -2.5 - q. Put -0.4, w, 5, -3/5 in descending order. 5, -0.4, -3/5, w Let k = -10 + 14. Let q(h) = -1083h + 1109h + 26 + 126. Let p be q(-6). Sort k, 1, p, -13 in descending order. k, 1, p, -13 Let x = -0.6285 - -255.7285. Let q = x + -256. Let b = -8 + 8.2. Sort b, q, 2 in descending order. 2, b, q Suppose 0 = -9w + 7w - 100. Let z = -45 - w. Let p(n) = -4*n - 59. Let h be p(-15). Put 0, -3, z, h in descending order. z, h, 0, -3 Let a = -363 + 368. Suppose -d =	{ "pile_set_name": "DM Mathematics" }
What is u(12)? -168 Let t(f) = 3f - 28. Determine t(7). -7 Let d(r) = r3 + 8r*2 - 4r - 14. What is d(-8)? 18 Let h(t) = t*3 - 13t*2 - 28t - 23. What is h(15)? 7 Let n(y) = 61y + 370. Give n(-6). 4 Let p(k) = -3k + 5. Determine p(3). -4 Let z(d) = d. Determine z(3). 3 Let v(g) = 25g - 171. Calculate v(7). 4 Let i(j) = -3j + 21. What is i(5)? 6 Let c(k) = -5k2 + 8k - 7. Calculate c(1). -4 Let r(y) = -y*2 + 7y + 24. Give r(-6). -54 Let i(d) = 4d + 72. Calculate i(-20). -8 Let n(d) = d3 + 3d*2 + 10d + 33. Give n(-4). -23 Let h(c) = c*3 + 24c*2 + 19c - 45. What is h(-23)? 47 Let h(m) = 2m2 + 33m + 114. Determine h(-12). 6 Let y(z) = -5z - 42. Determine y(-24). 78 Let a(x) = -x3 - 17x*2 + 13x - 17. What is a(-18)? 73 Let j(x) = -3x3 - 45x*2 - x - 16. Calculate j(-15). -1 Let f(i) = -11i - 249. Calculate f(-20). -29 Let u(h) = -2h - 4. Calculate u(-10). 16 Let v(q) = -2q*3 + 2q*2 + 6q - 16. Calculate v(4). -88 Let b(c) = c*3 + 11c*2 - 23c + 38. Give b(-13). -1 Let d(i) = -i*3 + 10i*2 - 13i + 53. Give d(9). 17 Let c(o) = o + 3. Give c(-5). -2 Let l(o) = -o*3 - 2o*2 + 2o + 1. Give l(-3). 4 Let p(t) = 2t2 - 30t + 38. Determine p(13). -14 Let l(r) = -r + 47. Determine l(7). 40 Let i(n) = -n*3 + 8n*2 + 9n - 6. What is i(9)? -6 Let o(u) = -u*3 + u + 2. What is o(-2)? 8 Let v(f) = 3f*2 - 11f + 3. Determine v(3). -3 Let u(g) = g*2 - 3. What is u(-3)? 6 Let v(p) = 7p*3 - 9p*2 + 11p + 4. What is v(2)? 46 Let z(j) = 2j3 + 14j*2 + 18j + 10. Calculate z(-5). 20 Let x(d) = 4d2 - 10d - 2. Determine x(3). 4 Let d(n) = n*3 + n + 6. What is d(0)? 6 Let u(w) = -19w*2 - 3w + 2. What is u(1)? -20 Let j(n) = -6n - 37. Calculate j(-7). 5 Let x(c) = -c2 + 8c + 20. Give x(10). 0 Let x(l) = -33l3 - 2l*2 - 3l - 1. What is x(-1)? 33 Let v(h) = h*3 + 30h*2 - h - 29. Calculate v(-30). 1 Let o(c) = 7c*2 + c + 1. Determine o(2). 31 Let o(h) = -3h*2 - 27h - 40. Calculate o(-7). 2 Let u(p) = 4p3. Determine u(1). 4 Let x(z) = -z3 + 16z*2 + 81z - 21. What is x(20)? -1 Let f(o) = -o*2 - 7o + 2. What is f(-6)? 8 Let k(b) = b*2 + 21b + 17. Determine k(-20). -3 Let v(d) = d*2 + 12d + 24. What is v(-10)? 4 Let l(q) = -q*3 - 3q*2 - q. What is l(-4)? 20 Let x(h) = 2h*3 - 2h*2 - 12h - 4. Determine x(-2). -4 Let z(s) = s*3 - 11s*2 + 9s - 3. Calculate z(10). -13 Let k(c) = -4c2 - 2c - 1. Determine k(-1). -3 Let c(q) = q*2 + 7q - 2. Calculate c(-9). 16 Let c(x) = x + 25. What is c(-8)? 17 Let x(v) = v*3 - 10v*2 + 9v + 10. Calculate x(9). 10 Let b(g) = g*2 - 22g + 19. Determine b(15). -86 Let s(i) = 2i3 + 9i*2 + 4i - 3. What is s(-4)? -3 Let g(z) = -3z + 3. Give g(-3). 12 Let f(t) = -t2 - 4t - 12. What is f(7)? -89 Let i(b) = b*2 + 35b - 23. Give i(-36). 13 Let w(a) = a*3 + 13a*2 + 3a + 14. Calculate w(-13). -25 Let m(b) = 15b2 + b. What is m(-1)? 14 Let m(h) = -h3 - 8h*2 + 10h + 7. Calculate m(-9). -2 Let p(h) = h*3 + 15h*2 + 14h - 6. Determine p(-14). -6 Let h(t) = -19t + 304. Determine h(16). 0 Let t(x) = -x2 + 11x - 11. Calculate t(9). 7 Let i(c) = c*3 + 19c*2 - 21c - 7. What is i(-20)? 13 Let l(n) = -3n - 4. Give l(-6). 14 Let s(g) = g3 - 6g*2 - 11g + 10. Calculate s(7). -18 Let c(s) = 2s + 6. Determine c(6). 18 Let a(b) = -b2 - 21b - 26. Give a(-19). 12 Let q(k) = -k*3 + 5k*2 + 10k - 15. Calculate q(6). 9 Let f(n) = n3 + n2 - 8n + 11. What is f(2)? 7 Let u(q) = 2q*3 + 6q2 + 1. Calculate u(-4). -31 Let c(q) = q3 + 8q2 + 8q + 10. What is c(-7)? 3 Let w(j) = -3j2 + 25j - 36. Give w(6). 6 Let t(x) = -5x - 3. Calculate t(-1). 2 Let n(w) = -10w - 414. Determine n(-41). -4 Let d(k) = -2k2 - 10k + 22. Determine d(-11). -110 Let g(k) = 3k3 - 131k*2 - 46k + 81. Calculate g(44). -7 Let t(z) = z*3 - 11z*2 + 9z + 14. Calculate t(10). 4 Let s(p) = -p + 64. Calculate s(23). 41 Let v(i) = 12i - 7. Calculate v(6). 65 Let x(j) = -j2 - 1. Determine x(-1). -2 Let s(c) = c2 + 58c + 670. Give s(-16). -2 Let p(w) = -w3 + w2 + w - 3. What is p(3)? -18 Let c(v) = 2v3 + 16v*2 - 4v - 18. Give c(-8). 14 Let j(q) = -5q - 54. Give j(-10). -4 Let v(w) = w3 - w - 51. Give v(0). -51 Let g(r) = -r2 + 14r + 35. What is g(15)? 20 Let f(n) = -9n3 - n. Calculate f(1). -10 Let f(x) = -x - 40. Calculate f(-25). -15 Let z(w) = -w3 - 4w*2 - 5w - 4. Give z(-4). 16 Let j(k) = k + 20. What is j(-11)? 9 Let s(t) = t + 83. Determine s(-18). 65 Let v(z) = -4z - 14. Give v(-5). 6 Let f(n) = 2n*2 + 49n + 90. Calculate f(-23). 21 Let i(u) = 26u - 2. What is i(1)? 24 Let a(g) = -g3 - 4g2 + g + 13. What is a(-3)? 1 Let f(d) = d3 + 9d2 + 6d - 5. What is f(-8)? 11 Let h(i) = i*3 + 9i*2 - 12i - 14. What is h(-10)? 6 Let x(f) = -12f + 115. What is x(0)? 115 Let c(g) = g3 + 23g2 - g - 30. Determine c(-23). -7 Let r(l) = -l2 - 4l + 34. Determine r(-8). 2 Let d(y) = y3 + 8y2 + y - 1. Determine d(-5). 69 Let x(z) = -z3 + 11z2 + 11z + 19. Give x(12). 7 Let c(x) = x*3 - 3x*2 - 19x + 12. Calculate c(6). 6 Let g(j) = -j*3 + 3j*2 - 6j + 15. Calculate g(3). -3 Let c(d) = 11d + 2. Give c(2). 24 Let g(r) = 2r*3 + 3r*2 - 10r + 3. What is g(2)? 11 Let a(m) = -m*2 - 6m + 13. What is a(-8)? -3 Let p(c) = 13c + 2. Give p(-1). -11 Let i(w) = -4w - 61. What is i(-10)? -21 Let b(q) = -3q + 19. Give b(11). -14 Let f(z) = -z3 - 17z*2 - 5z - 92. What is f(-17)? -7 Let l(x) = -9x2 + 6x - 5. What is l(2)? -29 Let o(l) = l*2 + 9l + 14. Give o(-7). 0 Let c(m) = -20m - 303. Calculate c(-15). -3 Let h(p) = p3 - 14p*2 + 14p - 12. Determine h(12). -132 Let j(h) = -h*2 + 12h - 1. Give j(5). 34 Let n(q) = q*3 - 3q*2 - 4q + 2. Calculate n(-2). -10 Let i(j) = 5j + 26. Calculate i(-12). -34 Let c(q) = -q - 18. Calculate c(-12). -6 Let p(v) = -v3 - 22v*2 - 26v - 102. What is p(-21)? 3 Let p(j) = 2j3 - 2j2 + j + 3. What is p(-2)? -23 Let z(q) = -q3 + 11q2 - 12q + 19. What is z(10)? -1 Let h(q) = 2q + 28. Give h(-4). 20 Let r(w) = -8w*2 + 4w + 1. Determine r(-3). -83 Let f(z) = z*3 - 8z*2 + 9z - 2. Calculate f(7). 12 Let w(s) = -s*3 - 11s*2 - 4. Give w(-11). -4 Let i(y) = -14y - 5. What is i(-4)? 51 Let g(k) = k*2 + 9k - 24. Give g(4). 28 Let t(k) = -2k2 + 12k - 6. Calculate t(5). 4 Let u(t) = t + 12. Calculate u(-4). 8 Let c(p) = p*3 - 9p*2 - 7p + 14. Determine c(10). 44 Let u(h) = h*2 + 6h + 4. What is u(-5)? -1 Let b(y) = -2y2 + 16y + 8. What is b(8)? 8 Let y(i) = -2i - 5. What is y(0)? -5 Let j(x) = -3x*2 - 58x + 42. Determine j(-20). 2 Let o(g) = -82g - 247. Determine o(-3). -1 Let d(b) = 4b*2 + 74b - 31. Determine d(-19). 7 Let t(n) = 12n - 8. Calculate t(3). 28 Let u(c) = c3 - 8c*2 + 14c + 23. What is u(8)? 135 Let w(k) = k3 + k + 23. Calculate w(0). 23 Let u(r) = r2 + r - 5. What is u(2)? 1 Let h(p) = -12p + 81. What is h(7)? -3 Let f(a) = 2a*2 + 8a + 8. Calculate f(-5). 18 Let v(f) = -19f - 64. Determine v(-3). -7 Let j(z) = -z3 + 5z*2 - 2z. Give j(4). 8 Let z(x) = x*3 + 4x*2 - 4x + 3. What is z(-5)? -2 Let q(m) = 45m2 + 1. Calculate q(1). 46 Let y(o) = -o3 - 9o*2 + 2o - 12. Calculate y(-10). 68 Let x(k) = -5k - 86. Determine x(-11). -31 Let b(q) = -q2 - 10q + 170. Give b(11). -61 Let j(y) = y*2 - 15y - 82. Determine j(16). -66 Let s(t) = -t*2 + 15t + 49. Calculate s(18). -5 Let v(y) = -2y2 - 13y + 11. Give v(1). -4 Let i(a) = -a + 1. Determine i(-3). 4 Let g(l) = l2 + l - 3. Give g(-4). 9 Let i(k) = k2 + 10k - 24. Give i(-11). -13 Let l(b) = b2 - 21b + 14. Determine l(8). -90 Let z(g) = g*2 - 8g - 11. What is z(9)? -2 Let m(h) = h + 5. What is m(-2)? 3 Let s(g) = g + 5. Give s(-4). 1 Let d(a) = 7a + 24. Give d(-3). 3 Let n(l) = 19l*2 - 2l - 1. Determine n(-1). 20 Let u(a) = -a*2 + 6a + 3. Calculate u(-4). -37 Let b(p) = 64p + 383. Determine b(-6). -1 Let l(g) = -g3 - 6g*2 - g - 7. Determine l(-6). -1 Let h(j) = -17j - 6. Calculate h(-3). 45 Let q(i) = -i*2 - 17i + 3. Calculate q(-18). -15 Let l(o) = -o*2 + 4o - 7. Calculate l(5). -12 Let a(u) = 8u - 16. Give a(5). 24 Let i(u) = -u3 - 9u*2 + 7u - 12.	{ "pile_set_name": "DM Mathematics" }
l + c - 1 = 0. What is the smallest common multiple of 4 and l? 16 Let r(t) = 17t + 6. Let u be r(-2). Calculate the smallest common multiple of 32/(-4) + (-266)/u and 9. 72 Let j = -1314 + 2304. Let k = 1/34739 + 71180209/69478. Let p = j - k. What is the common denominator of p and 57/8? 8 Let n = 6731/2310 + -1/210. Suppose 11y + 14 = 4y. Calculate the common denominator of n and y + (279/80 - (-3)/15). 176 Let l(k) = 51k2 - 3k + 4. Let r be l(1). What is the common denominator of ((-278)/(-16))/(273/r) and 337/(-80) + 4/10? 336 Let a(y) = 210y + 76. What is the smallest common multiple of a(1) and 182? 2002 Find the common denominator of (2 - 37/18)106 and -113/150. 450 Let s = 19 + -9. Let c be 1230/(-50) + 6/s. Let j = -14 - c. Calculate the least common multiple of j and 8. 40 Let d(j) = 4j3 - 2j*2 + 11j - 17. What is the smallest common multiple of d(5) and 18? 4392 What is the smallest common multiple of 125 and (0 - 24/(-20))350/42? 250 Suppose 8c + 999 - 1087 = 0. Calculate the least common multiple of c and 1/(-4) + 9/4. 22 Let b = 40 + 0. Suppose 4u - 5t - 68 = 0, 0 = -2u - t + 48 - 0. Calculate the smallest common multiple of u and b. 440 Suppose -9m + 38 = -8m. Suppose 0 = 2p + 22 - m. What is the least common multiple of 1 and p? 8 Suppose -3u + 4l = -16, -6u - 2l + 18 = -u. Calculate the lowest common multiple of 74 and u. 148 Let v(k) = k*2 + 6k + 4. Let l be v(-6). Suppose -lu = 2u + 150. Let w = u - -35. What is the smallest common multiple of w and 14? 70 Let m(t) = -2t2 + 23t - 31. Calculate the lowest common multiple of 56 and m(9). 56 Let n = 16 + -12. Suppose 5b - ni = -9, -b + 3i - 6 = -2. Calculate the common denominator of -53/4 and b. 4 Let m = 16765/6 + -2774. Let k = -30409958838 - -404513272146049/13302. Let v = k - 2/6651. Calculate the common denominator of m and v. 6 Suppose 3n + 5 = -5b + 13, 20 = 4n + 2b. Let z(k) = 3k + 5. What is the least common multiple of n and z(5)? 60 Let d be (-2)/(((-14)/4)/(-7)). Calculate the smallest common multiple of (-3d/(-5))/((-3)/20) and 20. 80 Suppose 0 = 3q - 3k + k + 3, -4q + 3k = 5. Find the common denominator of q + 3 + (-110)/52 and 53/10. 130 Let p(h) = 2h + 37. Suppose 5l = -3w - 67, 5w + 4l + 68 + 48 = 0. What is the common denominator of p(w) and -5/2? 2 Let q(p) = 2p - 4. Let h be q(5). Let g be (-4)/h - 26/6. Calculate the common denominator of 225/10(-11)/g and 19/10. 10 Calculate the common denominator of 103/56 and 121/(-11) - 2889/(-252). 56 Let z be -412(-2 + 36/(-16)). Let b be (-3579)/2 + 16/8. Let d = z + b. What is the common denominator of d and -15/8? 8 Let a = -491 + 7406/15. Calculate the common denominator of a and -76/717. 3585 Let v = 44/285 + 3631/1710. What is the common denominator of ((-2)/(-24))/(7/(-57)) and v? 252 Let l(z) = 2z*2 - z. Let c = 5 + 65. What is the least common multiple of l(2) and c? 210 Let m = 166785404 - 1391990891351/8346. Let z = -3/1391 + m. Find the common denominator of z and 17/172. 516 Let s be 309/(-12)-14. Suppose -5x - s = -4p, 124 = -x - 4x - 3p. Let u = 39 + x. Calculate the least common multiple of 6 and u. 48 Let d(o) = -286o*2 + o + 7. Let s be d(3). Let p = s - -15535/6. What is the common denominator of -43/5 and p? 30 Let z(h) = -16h + 39. Calculate the lowest common multiple of z(0) and 51. 663 Let o = -1019 + 1028. Calculate the least common multiple of o and 102. 306 Let s = -39/11 + -923/22. Calculate the common denominator of -18 and s. 2 What is the common denominator of -63/20 and (-358)/160 + ((-440)/75 - -6)? 240 Suppose -h = 2f - 21, -3f - 21 = -6f + 2h. Let b be 573/f + (-2)/3. Find the common denominator of -43/9 and 6/14 + 540/b. 9 Suppose -3q = -4q. Let c(a) = a2 - a + 6. Calculate the least common multiple of 22 and c(q). 66 Find the common denominator of (112/(-3150))/((-4)/(-160)) and 37/9. 45 Let n(u) = -u2 + 8u + 22. Calculate the smallest common multiple of n(10) and 1. 2 Let y = -25327/1242764 - -24/3203. Let r = -89077/666 - -88157269/646020. Let u = y + r. What is the common denominator of u and 87/8? 40 Let j = 26 + -14. Find the common denominator of (-105)/j + -3 + -4 and -1/2. 4 Let t be 611972/(-234) + -3(-8)/156. Let p = t - -2621. What is the common denominator of p and 69/4? 36 Let n = 1239676376522057/27558 + -44984265054. Let l = 6/1531 - n. Find the common denominator of (1 - 2) + (-67)/10 and l. 90 Let z(f) = 3f3 - f - 2. Let j be z(-2). Find the common denominator of (207/(-46))/((-1)/((-2)/j)) and -13. 8 Let t = -903741/701734 + -1/95691. Calculate the common denominator of t and -49/33. 66 Let h = 34 - 36. What is the common denominator of (-5)/h(138/(-48) + 4) and -143/18? 144 Suppose -26q = -21q + 60. What is the common denominator of ((-74)/q)/(91/(-117)) and 65/16? 112 Suppose 4f - 85 + 29 = 0. Let w(y) = y3 + 10y*2 + 9y + 2. Let g be w(-9). Suppose -34 = -2m + g. Calculate the lowest common multiple of m and f. 126 Let s = 113 - 63. Let x = -914 + 918. Calculate the lowest common multiple of s and x. 100 Suppose -68d = -67d - 249. Calculate the least common multiple of d and 15. 1245 What is the common denominator of 127/102 and 93/1071 - 0 - (-8)/28? 102 Let n = 4991721/272 + -18352. Calculate the common denominator of -25/8 and n. 272 Let d = 5430892544746028148/798655 - 6800048262074. Let a = d - 3/14521. What is the common denominator of a and -111/20? 220 Let m(b) be the first derivative of b3/3 - 3b*2 + 40b + 7. Find the common denominator of m(7) and 65/8. 8 Let d = 98 - 76. Suppose 0 = 2k + 9 - 117. Suppose -2p = p - k. Calculate the smallest common multiple of d and p. 198 Let l = 598/909 - -13/202. What is the common denominator of l and -64/81? 162 Let p(j) = -2j2 + 18j - 31. What is the least common multiple of 8 and p(5)? 72 Let h = -8534 + 238891/28. Let c be (-25)/2 - (-8)/(-16). Find the common denominator of ((-242)/(-24))/(((-156)/(-8))/c) and h. 252 Let d = -824/139 + 1267908/695. Let m = d - 1830. What is the common denominator of ((-132)/(-18))/((-4)/(-13)) and m? 30 Suppose 0 = -z - 2q + 13, -4z + 0z - 5q = -37. Suppose 16 = p + y, -3p + 43 = zy - y. Calculate the lowest common multiple of p and 7. 77 Suppose -80b = -78b - 188. Let l = b - 32. What is the smallest common multiple of 8 and l? 248 Let q = -376343/26 - -14479. Let w = q - 1509/52. Find the common denominator of -89/2 and w. 4 Let p be 46/6 + 32/(-48). Calculate the lowest common multiple of 10 and -2 + (-80)/(2 - p). 70 Suppose 10 + 0 = 5b. Suppose ba + 157 + 39 = 0. What is the common denominator of 41/10 and a/(-40) - 6/(-3)? 20 Let v = 27243/10 - 2729. Calculate the common denominator of 6/11 and v. 110 Let h be (-105)/(-33) - 8/44. Let s(v) = -v*3 + 3v*2 + 3v + 2. What is the lowest common multiple of 2 and s(h)? 22 Let a = 24887/6 - 4133. What is the common denominator of -73/12 and a? 12 Let w = -36879035/30404268 - 2/281521. Calculate the common denominator of 77/270 and w. 540 Suppose -5z = -4j - 46 - 174, z - 33 = 3j. What is the lowest common multiple of z and 40? 240 Let z(v) = -5v + 35. Let q be z(-17). Find the common denominator of 157/832/q and 145/12. 60 Suppose z - 14 - 22 = 0. Let v = -27 + z. Calculate the smallest common multiple of 10 and v. 90 Find the common denominator of 49/21 + (1585/885 - 4) and -25/3. 177 Suppose -g = -3v - 91, 2g - 6v = -2v + 184. What is the lowest common multiple of 3 and g/8 - ((-7)/4)/7? 12 Suppose u = -2x + 19, -x + 16 + 4 = -3u. What is the lowest common multiple of x and 1? 11 Suppose d + 0 = 2. Suppose 84 + 20 = 49r - 2248. Calculate the least common multiple of r and d. 48 Let o(k) = k*2 - 63k + 116. Calculate the lowest common multiple of 2 and o(0). 116 Let y = -233253/50 + 4666. What is the common denominator of -79/110 and y? 550 Let q = -1971/2 + 943. Find the common denominator of (-3)/(-1) - 680/140 and q. 14 Let r be (-4)/(-9) - 6155080/(-1584). Let z = r - 3882. Calculate the common denominator of z and -19/10. 110 Let h(o) = -o*3 - 2o*2 + 5o - 2. Let u(y) = y*2 - 14y + 24. Let z be u(11). What is the lowest common multiple of (z/(-5))/(18/60) - 2 and h(-4)? 20 Let k be	{ "pile_set_name": "DM Mathematics" }
ate the common denominator of -61/6872148 and 77/4617. 61849332 Calculate the lowest common multiple of 2570800 and 60. 7712400 What is the lowest common multiple of 98 and 730012? 35770588 Calculate the common denominator of 149/2677512 and 31/5916. 45517704 What is the common denominator of 24/138787 and -73/33108? 148224516 Calculate the least common multiple of 3671730 and 543960. 14686920 What is the common denominator of 87/60112 and -99/22828? 26389168 Calculate the smallest common multiple of 50880 and 89040. 356160 Calculate the lowest common multiple of 520701 and 140730. 5207010 What is the smallest common multiple of 1821759428 and 2? 1821759428 Calculate the common denominator of 17/37448 and 54/3815015. 30520120 Calculate the least common multiple of 27972 and 8511480. 59580360 Calculate the least common multiple of 436320 and 288. 436320 What is the lowest common multiple of 106012 and 195194? 608614892 What is the smallest common multiple of 14648499 and 13020888? 117187992 Find the common denominator of -223/5712000 and -139/1224. 17136000 What is the least common multiple of 146 and 5085545? 10171090 Calculate the common denominator of -25/11382 and -93/85334648. 256003944 Find the common denominator of -119/1716 and -65/509388. 6622044 Calculate the lowest common multiple of 20477976 and 12. 20477976 Calculate the common denominator of 85/2738604 and -89/871374. 19170228 What is the least common multiple of 154 and 43064371? 947416162 What is the lowest common multiple of 3399339 and 3084? 13597356 Calculate the common denominator of -64/205175 and -11/95037060. 475185300 Calculate the common denominator of -53/8151042 and -55/63. 171171882 What is the least common multiple of 1700022 and 1416685? 8500110 Find the common denominator of 43/352151016 and 51/7722610. 1760755080 Calculate the common denominator of -97/1414602 and 89/1962. 1414602 Find the common denominator of -73/468 and 71/97029270. 194058540 What is the common denominator of 61/22785 and -2/95263? 10002615 Calculate the lowest common multiple of 8 and 4175264. 4175264 Find the common denominator of -107/4440 and -133/1300032. 6500160 What is the common denominator of 67/684912 and 137/3302898? 502040496 Find the common denominator of -89/14490 and 37/15456. 231840 Find the common denominator of 3/31991930 and 97/12796772. 63983860 What is the common denominator of -43/364 and -91/60916? 5543356 What is the common denominator of 125/8098902 and -97/8098902? 8098902 What is the least common multiple of 78 and 1540097? 9240582 What is the common denominator of 35/1353 and 13/468753? 5156283 Calculate the smallest common multiple of 27251802 and 9032. 109007208 What is the common denominator of -109/1391112 and 67/12? 1391112 What is the lowest common multiple of 3246103 and 274991297? 1924939079 Calculate the common denominator of 97/30 and -37/281500. 844500 What is the common denominator of -53/11 and 51/2994653? 32941183 What is the smallest common multiple of 25438530 and 4180? 559647660 Calculate the lowest common multiple of 387528 and 12114. 782419032 Calculate the common denominator of 47/533757 and -97/6174. 22417794 Find the common denominator of 65/1296 and -115/26495496. 476918928 Calculate the common denominator of 39/567100 and 69/26500. 2835500 Calculate the common denominator of -173/71370 and -19/2100. 4995900 What is the smallest common multiple of 10307297 and 3850? 515364850 What is the least common multiple of 107913 and 427791? 1183697697 What is the smallest common multiple of 2478 and 1012? 1253868 Find the common denominator of 50/14103 and -74/4122777. 12368331 Calculate the common denominator of 1/12 and 10/18640329. 74561316 What is the common denominator of -103/46638396 and -5/21168? 186553584 Calculate the least common multiple of 2839104 and 57240. 14195520 What is the common denominator of 61/1842674 and -31/16428? 11056044 Calculate the common denominator of -27/127856 and -115/1464. 383568 Find the common denominator of -139/276675306 and 8/1436031. 830025918 Find the common denominator of 133/6 and -69/43016242. 129048726 What is the common denominator of -30/65149717 and 51/937406? 130299434 Calculate the common denominator of 101/2733549 and 88/15561. 8200647 What is the common denominator of -32/12088021 and 65/2? 24176042 What is the least common multiple of 8208991 and 14? 16417982 Calculate the smallest common multiple of 6769040 and 15948. 60921360 What is the least common multiple of 8 and 137414904? 137414904 Find the common denominator of 81/20 and -77/443030066. 4430300660 Calculate the least common multiple of 11527950 and 5. 11527950 What is the lowest common multiple of 131541390 and 261? 131541390 What is the common denominator of -22/1924121 and -10/3? 5772363 Calculate the lowest common multiple of 70 and 8495522. 42477610 Calculate the common denominator of -22/2401 and 57/571585. 28007665 What is the smallest common multiple of 17415058 and 1833164? 34830116 What is the smallest common multiple of 1719 and 1699794? 324660654 What is the common denominator of 47/9244 and -4/295398953? 1181595812 Find the common denominator of -67/28293984 and 29/153. 28293984 Calculate the smallest common multiple of 95480 and 760. 1814120 What is the common denominator of 61/48 and 29/194530548? 778122192 Calculate the lowest common multiple of 260 and 279396. 1396980 Calculate the least common multiple of 330 and 1319736. 6598680 Calculate the smallest common multiple of 650792 and 813490. 3253960 Calculate the smallest common multiple of 876288 and 1293568. 27164928 Find the common denominator of 113/78 and -85/1089764. 3269292 Calculate the common denominator of 73/442122 and 149/2322. 171101214 Calculate the common denominator of -35/19333878 and 71/90224764. 270674292 What is the lowest common multiple of 70719168 and 4176? 212157504 What is the least common multiple of 383370 and 405? 10350990 Calculate the lowest common multiple of 284568 and 23524288. 70572864 Calculate the common denominator of -113/1628 and 51/5412952. 59542472 Find the common denominator of -25/3057174 and 2/15. 15285870 What is the common denominator of 43/7400 and 61/544990? 403292600 What is the lowest common multiple of 14267232 and 4044? 14267232 What is the common denominator of 52/5983 and 25/45322? 8747146 What is the lowest common multiple of 105064012 and 36? 945576108 What is the common denominator of 139/51798636 and 145/12268098? 466187724 What is the common denominator of 53/7866 and -35/19044? 361836 Calculate the smallest common multiple of 18 and 970820. 8737380 What is the common denominator of -35/1959 and 62/118545? 77409885 What is the common denominator of 71/30240 and -115/27409536? 137047680 What is the lowest common multiple of 4328 and 39409145? 315273160 Find the common denominator of 22/32053149 and 127/114. 1218019662 What is the smallest common multiple of 10492000 and 31476? 31476000 What is the least common multiple of 74150 and 7030? 52127450 Calculate the least common multiple of 2 and 66596674. 66596674 What is the common denominator of -57/110 and -81/17902000? 196922000 Find the common denominator of -31/24762 and -63/158419022. 475257066 What is the common denominator of 107/630840 and -19/204? 10724280 Calculate the least common multiple of 104219543 and 3. 312658629 What is the lowest common multiple of 36063903 and 12? 144255612 What is the lowest common multiple of 27314395 and 40? 218515160 Calculate the smallest common multiple of 15710464 and 23565696. 47131392 What is the smallest common multiple of 23413734 and 2601526? 23413734 Calculate the smallest common multiple of 79907837 and 707149. 79907837 Find the common denominator of -47/766837 and -77/7221. 66714819 Find the common denominator of 67/4420 and -83/12847614. 128476140 Find the common denominator of 43/3785457 and -121/1305330. 37854570 What is the common denominator of 17/1149280 and 41/2896? 208019680 Calculate the least common multiple of 1160 and 26540. 1539320 Calculate the lowest common multiple of 992555 and 1006972. 901239940 What is the lowest common multiple of 38480 and 9472? 615680 Calculate the common denominator of 33/8449	{ "pile_set_name": "DM Mathematics" }
2t)(-2 + 1 + 0) + 0 + t + 0). -3t5 Expand (-4h + 4h - h)(-1 - 3 + 2) - 5h - 6h + 7h. -2h Expand (j*5 + 11j5 - j5)(-1 + 0 + 0). -11j*5 Expand (-2k3 - k3 + 4k3)(-2k - 6k + k)(-5 + 0 + 3). 14k4 Expand (-1 - n2 + 1)(-6n + 15n - 13n - 5n3). 5n*5 + 4n*3 Expand (-2 - 3 + 3)(0p - 3p + 2p) + 5p + 3p - 6p - 1 + p + 1 + 12p + 12p - 14p. 15p Expand -r + r + r*2 + (1 + 1 - 1)((-2 - r + 2)(r - 4r + 0r) + 0r + 0r + 2r*2 - 4r*2 + 4r2 + r2). 7r2 Expand (1 + 12 - 4 + 2 - 1 + 0 + (-4 + 3 + 3)(0 - 1 + 0))(-i - 3 + 3). -8i Expand 3y + 20 - 7 - 4y + (-y + 5y - 2y)(-4 + 3 + 3). 3y + 13 Expand 2z3 - 6z*3 - z + 0z*3 + (3z + 3z - 7z)(-3z*2 + 0z*2 + 2z*2) + (2z - 3z + 3z)(4z2 + z2 - 4z2). -z3 - z Expand (-2x - 3x + 3x)(x - 4 + 5 - 7) + (3x - 2x - 2x)(-3x + 7x - 3x). -3x2 + 12x Expand (-14 + 4 - 15)(-2n + 5n - 5n). 50n Expand -2n + 2n - n2 + 2n*2 - 6n*2 + 2n*2 + (3n - 2n - 3n)(0 + 0 + 2n). -7n2 Expand -x2 - 4x*2 + 2x*2 + (-2x + 1 - 1)(-2x + 1 - 1) + 2x2 - 8 + 3x - 2x + 6. 3x*2 + x - 2 Expand (-1 + 1 - 2)(-1 - 2 + 0)(2q - 23 + 23). 12q Expand -6s*3 + 15s*2 - 15s*2 + 2s*3 + s - s + 3s3 - s3 + 0s3 + (0 - 1 + 2)(-3 + 3 - 2s3) - s3 - 2s*3 + 2s*3. -5s3 Expand -i5 - 4i5 + 3i*5 + (4i*3 - 3i3 + i3)(1 - 2i*2 - 1) + 0i*5 + 2i5 - i5 - 3 - 2i5 + 3 - 2i*2 - 2i*3 - 2691 - 5i*5 + 2691. -12i*5 - 2i*3 - 2i*2 Expand (7 + 1 - 3 + k)(0 - 2 + 4). 2k + 10 Expand (p5 + 0p*5 + 0p5 + p3 + 3p5 - p2 + p2 + (-3p4 + p5 + 3p4)(1 - 3 + 0))(2 - 4 + 0). -4p*5 - 2p*3 Expand 0x2 - x4 + 0x2 - 55x + 12x4 + 55x + (-x*3 + 2x3 + x3)(-2 - x + 2) + 2x*4 - 3x4 - x4 + 3x4 + x4 - 3x*4. 8x*4 Expand (-5a + 2a - a)(-2 - 3 + 7) + a + 0a + a. -6a Expand -n3 + n3 + n*3 + (n - 2n + 6n)(2n2 + 4n - 4n). 11n*3 Expand (3f*2 - 3f*2 - 2f*4)(0f + 4f - 2f) + (-6f2 + f2 + 3f2)(5f + f3 - 5f) + (-222f - 17f*3 + 222f)(-2f*2 + f - f). 28f*5 Expand (2p + 0p - 3p)(-p3 - 8p - 3p3 + 5p3). -p4 + 8p2 Expand (24j*2 + 166 - 166)(0 - j + 0). -24j3 Expand -60y*3 + 33y*4 + 128y*3 - 66y*3 + (-3 + 3 + 2y)(-3y3 + y3 + 4y3). 37y*4 + 2y3 Expand (-3 + f2 + 3)(-f + 2 - 2). -f3 Expand -3 - o3 + 3 + (o - 1 + 1)(-5o2 + o2 + 2o*2) - 3o*3 + 4o*3 + 0o*3. -2o*3 Expand -2d*2 + 2 + 2d - 2 + 0 + 0 - 3d2 + (0 - d + 0)(-2d - 4d + 4d) + 4d - 4d + 2d2. -d2 + 2d Expand 3r*2 + 2r*2 + 5r*2 + (4r - 4r + r)(-r + r + 2r) + 3r - r*2 - 3r. 11r2 Expand 4f - 2f - 4f + (3f - 3f - 2f)(4 - 4 + 1) + (-5f + f + 2f)(-4 + 5 + 1). -8f Expand (5 + 0 - 1)(2 + 2 - 2 - 2t). -8t + 8 Expand (-1 - 2 + 0)(4h + 2h - 5h) - 3h + 5h - 3h. -4h Expand (40 - 1 - 1)(0o - o + 3o)(0o - 1 + 0 + o). 76o2 - 76o Expand (-2 + 5 - 2)(2 + 2q*4 - 2) + (0q + q - 5q)(4q3 - 3q*3 - 2q*3). 6q*4 Expand (-1 + 4 - 4)((3 + 2f - 3)(5 + 1 - 4) + 3f + 0f - 5f - 4f + 3f + 3f) - 20f + 111f - 48f. 39f Expand 2x3 - 7x3 + x3 + (-4x3 + 8x3 + x3)(1 - 1 + 2). 6x*3 Expand (-7b + 17b + 2b)(1 + 0 - 4). -36b Expand (v2 - v2 + 5v4)(v + 4v - 2v) + (0v2 + 0v2 - v2)(2v*3 - 5v3 + v3) - 3v5 + 3v*5 + 2v*5. 19v*5 Expand -4h + 2h - 6h + (-5h + 4h + 2h)(-2 - 3 - 1). -14h Expand -1 + 1 - 2u*4 + (-4u + 5u + u)(-4u3 + 2u3 + u3) - 2u4 + 6u*4 - 2u*4 + 6u4 + u - u4 + 7u. 3u*4 + 8u Expand i4 + 0 + 0 + (-i3 + 3i3 + 0i*3)(3 - 2i - 3) - 11i*4 + 24i*4 - 15i*4. -5i*4 Expand (-2 + 1 + 2)(-13 + 8 + 1)(3 - 3 + 3q*2). -12q2 Expand (f3 + 2f3 - 4f*3)(0 - 1 + 2) - 74f3 + 9f*3 + 7f*3. -59f*3 Expand ((-2 + 2 + 2)(0 + 0 + 2) + 1 - 4 + 2 - 4 + 1 - 1)(1 - 3 + 0)(3 + 2o - 3). 4o Expand (7 + 2 + 0)(9s - 44 + 44). 81s Expand (-3w - 2w + 3w)(1 + 0 + 0 + w + (0w + 3w - w)(0 + 0 - 1)). 2w2 - 2w Expand -y*4 - 2y*4 + 5y*4 + 5y - 5y + 2y*4 - 3y*2 + 3y*2 - 2y*4 + (-2 + 1 + 3)(0y4 + 3y4 - y4) + (-4 - 3y3 + 4)(0 + y + 0). 3y4 Expand (-2k - k + k)(-6k + 2k + 9k*2 + 6k). -18k3 - 4k*2 Expand (4 - 4 + 2)(-5z + 4z - 3z)(-5 - 1 - 1)(3 - 1 - 3). -56z Expand (-2l4 + 7l*3 - 16l + 16l)((2l - 4 + 4)(3 + 0 - 5) - 2l - 2l + 2l). 12l*5 - 42l*4 Expand (m + m - 5m)(2 + 1 + 1)(-3m - m2 + 3m). 12m3 Expand 95v*2 + 93v*2 - 201v*2 - 4v*2 + 6v*2 - 4v2 - v2 - v + v + (-3 + 0 + 2)(-v + v - 2v*2). -14v*2 Expand (5 + k + 1 - 2)(4 - 4 + 9). 9k + 36 Expand (2z + 0z + z)(4z - 2z + 0z) + 8 + 3z*2 - 8 + 2z*2 - 3z*2 + 2z*2. 10z*2 Expand (11 - 3 + 4)(-4l + 5 - 3l + 6l). -12l + 60 Expand 3x2 + x2 - 3x*2 + (-2x + 0x + 0x)(0x + 0x - 3x) - 2x2 + 2x*2 + 2x*2. 9x*2 Expand (-s + s - 3s*2)(-s + 9s - 8s*2 - 6s). 24s4 - 6s*3 Expand (0 - 2 + 1 + 0 + 3 - 4 + (-1 + 3 + 0)(3 - 2 - 2) + 1 - 4 + 1 + 3 - 2 + 0 + 0 + 2 - 1)(0j + 0j - 2j)(-7 + 0 + 0). -56j Expand (-y*2 + 0y*2 + 2y*2)(y - 4y + 4y) + (-1 + y + 1)(3 - 3 + 2y*2) - 4y*3 + 6y*3 + 2y*3. 7y*3 Expand (4 + 4c*2 - 4)(2c - 5c - c + (1 + 2 - 1)(-4 - 2c + 4) + 2 - c - 2). -36c3 Expand 16z - 16z + 17z - 3z4 - z4 + z2 - z2 + 1 - z4 - 1 + (0z*2 + 4z*2 - 2z*2)(-2z2 - 2z*2 + 2z*2). -9z*4 + 17z Expand (-2i + 0i - 3i)(0 - 1 - 1). 10i Expand (2j - 3j + 2j)(51 + 21j*3 - 51). 21j*4 Expand (0 - d + 0)(32 - 10d + 9d - 7). d*2 - 25d Expand 5y - 5y + 2y5 + 0y5 - y5 + 3y5 + (3 - 2y - 3)(-y4 + 0y4 - y4) + (1 - 1 - y)(-y4 + 4y4 + y4). 4y5 Expand (3 - 4 - 4)(-4 + 4 - 6r). 30r Expand (-66 + 99 + 0 + 109)(-2 + h + 2). 142h Expand (-2 - 3 + 4)(-2x - 3 + 3)(3 - 13 + 28). 36x Expand (-3m2 + 4m2 + m2)(-28m*2 + 11m*2 + 24m*2). 14m*4 Expand (4p*2 - 5p*2 + 3p*2)(-p*2 + 2p - 2p - p + p - 2p*2 + (2p + 1 - 1)(3 - p - 3)) + 7p*4 - 2p*4 - 3p*4. -8p*4 Expand 4c5 + c5 - 3c5 + (-c + 0c - c)(c4 - 3c4 + c4) + 13c2 - 11c*5 - 13c*2. -7c*5 Expand -43j + 0j - 18j + (j + 4 - 4)(-3 + 5 - 3). -62j Expand (-4 + 3 + 2)(-5q - 8q + 0q). -13q Expand -3h*4 + 2h*4 + 0h*4 - 7 + 7 - 4h*4 - 3h*4 - 2h*4 + 4h4 + (h2 + h*2 + 0h*2)(1 + h2 - 1) + (-h4 + h4 + h4)(4 + 3 - 6). -3h*4 Expand (6i - 4i - 3i)(-2i - i + 4i) + 2i*2 - 3i + 3i + 13 - 2i + 6i2 + 4i - 12. 7i2 + 2i + 1 Expand -2v3 + 2v*4 + 2v*3 + (2v - 4 + 4)(2v*3 - 3v*3 + 2v3) - v4 + 2v4 + v4. 6v*4 Expand (-2d*4 - 3d*4 + 2d*4)(1 + 30 - 8 + 9). -96d4 Expand (-4 + 1 + 1)(6n2 + 2n*5 - 67n*4 + 61n*4 - 5n*2). -4n*5 + 12n*4 - 2n*2 Expand (2u + u - u)(4u*2 - 4u*2 - 2u*2 - 2u*2 + 0u*2 + 0u*2 + (-3u - u + 3u)(0 - u + 0)) + 4u3 + 2u3 - u3. -u*3 Expand (-2 + p + 2)(4p - 4p + p) + (-p - p + p)(2 - p - 2) - 2p*2 - 5p2 + p2. -4p2 Expand (-2j + 3j + j)(-j*2 + 3j*2 - 3j*2) + (-4j*2 + 3j*2 + 3j*2)(4j + j + 2j). 12j3 Expand 2l3 - l3 - 3l3 - 2l + 2l - l3 + (0l + 0l + l2)(-4l - l + 3l) + 3l3 + l3 - 3l*3 + 6l*3 + 7l3 + l3. 10l3 Expand (10 - 9 - 13)(0l + 4l - 2l). -24l Expand (1 - 7 + 13 + (0 + 4 - 2)(3 + 1 - 3))(-z*3 + 4z*3 - 4z*3) + 3z*3 - 5z*3 + 4z*3. -7z*3 Expand (-2u + 76 - 76 + (3u - 5u + 0u)(4 - 2 - 1))(-u + 0u + 0u). 4u*2 Expand (-1 + 1 + g)(2 + 2 - 6) - 14g + 14g - 35g. -37g Expand (14 - 6l - 14)(-2 + 2 + 1). -6l Expand (-2v*2 - 41 + 6v + 41)(2 + 3 + 4). -18v*2 + 54v Expand (3 - 3 - 2a2)(0a + a - 2a) - 16a2 + 16a*2 + 9a*3. 11a*3 Expand (-6 + 3m*2 + 6)(0 + 2m - 4m - 1). -6m3 - 3m*2 Expand (5 - 7 - 24)(-2o + 3 - 3). 52o Expand (-3 + 3 + 2b)(0 + 1 + 0 + (3 - 4 + 0)(0 + 0 - 1)). 4b Expand (-7b2 - 5b*2 - 5 + 4)(1 - 4 - 3). 72b2 + 6 Expand (-3c*2 + 4c*2 - 5c + 4c)((-1 + 4 - 2)*(-3 + 2	{ "pile_set_name": "DM Mathematics" }
Let w = -402 + b. What is the units digit of w? 9 Let b be 0/(((-6)/(-4))/(84/(-56))). Suppose 2q - 5h - 1417 = 0, -2q - 3h + 909 + 548 = b. What is the tens digit of q? 2 Suppose -3r + 9 = -4o + 2r, -o - 11 = -3r. Suppose -k = -5 - o. Suppose 0 = kv + 188 - 503. What is the tens digit of v? 3 Suppose -2g + 1062 = 2r - 2524, -3r = g - 1799. What is the units digit of g? 0 Suppose 18 = 6t + 3t. Let n(l) = 20l + 4. Let d be n(t). Suppose -p + d = 5. What is the units digit of p? 9 Suppose 0 = -3g - 13g + 80. Suppose w = -m + 457, -gm + 2w + 2253 = -w. What is the units digit of m? 3 What is the tens digit of (-220 - -2008)(-7)/(-4)? 2 Let j(g) = 95g2 + 8g - 38. What is the thousands digit of j(7)? 4 Let a(n) = n*3 + 30n*2 + 24n - 9. Let d be a(-30). Let h = -350 - d. What is the hundreds digit of h? 3 Suppose -5u - 15526 = h, 0u - u - 2h - 3107 = 0. What is the units digit of (-39)/(-91) + u/(-7)? 4 Let u(b) = -b + 1. Let r(v) = -56v - 71. Let q(p) = r(p) + 2u(p). What is the hundreds digit of q(-10)? 5 Suppose i = -156 + 108. What is the tens digit of -2 + 2510/6 + i/(-72)? 1 Suppose -24 = 4b - 8, 2b = -2q + 574. Let o = -207 + q. Let w = o - 38. What is the tens digit of w? 4 Let v be 40/3-1(-18)/15. Suppose vn = 21n. What is the tens digit of (-404)/(-8)(n - -2)? 0 What is the tens digit of 8/52 - (9707684/91)/(-14)? 2 Suppose -28y - 250795 = -1025583. What is the thousands digit of y? 7 Suppose -22 + 24 = q. Let y = 2 + q. What is the units digit of (y/6)/((-474)/162 + 3)? 9 Suppose 3t = -251 + 4043. What is the thousands digit of t? 1 Let b = 7836 - -13288. What is the hundreds digit of b? 1 Let v(z) = -22z + 2. Let q(l) = l*2 - 7l - 24. Let c be q(10). Suppose cf + 6 = 3f. What is the tens digit of v(f)? 4 Let b be 18876/8 - (-30)/20. Suppose 5i = 3o + 2379, 7i + 3o - b = 2i. What is the hundreds digit of i? 4 Let o be (-3 + 1)(-3)/2. Let y be ((0 - 4)/2)/o-6. Suppose ya - 286 = 2. What is the units digit of a? 2 Let q(t) = 16t3 + 43t*2 - 187t - 14. What is the ten thousands digit of q(10)? 1 Let r(v) = -6v3 + 6v*2 + 76v - 33. What is the ten thousands digit of r(-15)? 2 Suppose -59y + 13596 = -57y + 4b, 3y + 3b = 20418. What is the hundreds digit of y? 8 Suppose k = 1087 - 1074. Suppose kn - 22n + 11871 = 0. What is the thousands digit of n? 1 Let i(p) = -p3 + 3p*2 - p - 13. Suppose 9 - 3 = -2f + d, -2f + 5d + 2 = 0. What is the tens digit of i(f)? 0 Suppose 0 = 5s - 856 - 834. Let u be s/(0 + 5 + -3). Suppose 9r = 637 - u. What is the units digit of r? 2 Let b(y) = 230y2 - 6y + 6. Let q be b(1). Let c = q + -28. What is the hundreds digit of c? 2 Let r be 525/(-1)(-6 - 1477/21). Suppose 23n - r + 5230 = 0. What is the units digit of n? 5 Suppose -2p = -2k - 4, -6p + 16 = -3p - 5k. What is the units digit of 615 - (3/p + 6)? 0 Let p(b) = -56b + 18. Let x be p(-7). Let j = x - 180. What is the tens digit of j? 3 Suppose 167i - 179i + 148056 = 0. What is the ten thousands digit of i? 1 Suppose 23l = 19l - 228. Let p be (-8)/32 - l/4. Suppose -o + 2o = p. What is the units digit of o? 4 Let y be (-1)/(-3 - 40/(-12)) + 36. Let r = 62 - y. Suppose -24w = -rw + 255. What is the tens digit of w? 5 Suppose -3f = 2s - 10442, -5s + 18486 = 4f - 7605. What is the hundreds digit of s? 2 Let r = 44 - 50. Let b(h) = -22h - 104. What is the tens digit of b(r)? 2 Suppose 108406 = 67a - 1011767. What is the hundreds digit of a? 7 Suppose 625c + 18270 = 688c. What is the tens digit of c? 9 Let w be 1 + -2 - -4(-4)/(-8). Let h(u) = 356u2 + 2u + 1. What is the units digit of h(w)? 9 Let a(b) = b*2 + 18b - 24. Let u be a(-20). Let n(h) = h + 18. What is the tens digit of n(u)? 3 Suppose 0 = -167y + 175y - 88. Suppose yv = 13v - 58. What is the tens digit of v? 2 Suppose 0 = -20s + 24s - 1092. Suppose 3g = f + s, 2g - f = -6f + 182. Let k = g + -22. What is the tens digit of k? 6 Let v(z) = z3 + z2 - 635. Let p(u) = -3u*3 - 2u*2 - 2u + 1906. Let m(x) = 3p(x) + 8v(x). What is the units digit of m(0)? 8 Let g = -22758 + 56515. What is the ten thousands digit of g? 3 Let v(c) = -c - 1. Let q(l) = 4l2 + 17l - 21. Let g(h) = q(h) + v(h). What is the tens digit of g(11)? 3 Let j = 73 - 65. Suppose -jy + 2100 = -2y. Suppose -124 = -m + 2v, 261 = 5m - v - y. What is the tens digit of m? 2 Suppose -572132 - 472104 - 422908 = -142o. What is the units digit of o? 2 Suppose 0 = -14w + 38 + 4. What is the units digit of ((-8)/2 - -8) + w? 7 Let r = -8702 - -17062. What is the hundreds digit of r? 3 Let a(v) = -v*3 + 20v*2 - 39v + 18. Let y be a(16). Suppose y - 84 = 2k. Suppose -1047 + k = -4d. What is the units digit of d? 0 What is the hundreds digit of (-37)/422((-14 - -19) + -209)? 5 Let l = 10199 - -4036. What is the units digit of l? 5 Let v be 0 + 0 - (-68)/(-17). What is the units digit of 1/(-2 + -2) - 1229/v? 7 Let d(h) = 20h - 22. Let l be d(19). Let j = -180 + l. What is the hundreds digit of j? 1 Let a = 4394 - 2978. Suppose -n = -4s + 1888, 4n = 4s - s - a. What is the hundreds digit of s? 4 Let z(a) = -70747a - 1569. What is the thousands digit of z(-1)? 9 Suppose -4l - 251 + 5066 = 5s, -5s = -5l - 4860. What is the tens digit of s? 6 Let h be (88/(-132))/((-2)/(-117)). Let r = h - -101. What is the units digit of r? 2 Let n = 21 - 25. Let f be (-5 - n)/((2 + 1)/(-2655)). Suppose 5s + 5a - f = 0, 4s - 2a + 178 = 5s. What is the hundreds digit of s? 1 Let i(k) = 2k + 58. Let s be i(0). Let b = s + 130. What is the tens digit of b? 8 Suppose 0 = 4q - 4t - 123588, 12t - 8t + 92698 = 3q. What is the ten thousands digit of q? 3 Suppose -5d + b + 159218 - 51028 = 0, -d + 21612 = 5b. What is the tens digit of d? 3 Let i(q) = 21q3 - 7q*2 + 35q + 70. What is the thousands digit of i(8)? 0 Let h = 15357 - 5717. What is the thousands digit of h? 9 Let r(m) = -9m + 13. Let b be r(1). Suppose -2w - g = g - 100, bg = 2w - 76. What is the units digit of w? 6 Let j(r) = 28r + 116. Let u be j(-4). Suppose 2x - um - 2086 = 0, -16 + 0 = -4m. What is the units digit of x? 1 Let a(x) = -3656x - 1768. What is the units digit of a(-6)? 8 Suppose 5w + 3z - 336517 = 0, 0 = 160w - 157w - 5z - 201849. What is the ten thousands digit of w? 6 Let r(g) be the second derivative of 7g4/12 + 19g*3/2 + 47g*2/2 + 8g - 1. What is the thousands digit of r(-17)? 1 Suppose 3f + y = 95611, -2f - 571y + 567y + 63714 = 0. What is the tens digit of f? 7 Suppose -4d - 5v + 47 = 0, -2v - 79 = -3d + 3v. Suppose 34l = dl + 16816. What is the units digit of l? 1 Suppose 0s - 2s = 5w - 8911, 4w - 2s - 7118 = 0. Suppose 4m - 595 = w. What is the tens digit of m? 9 Suppose -18w = -26w - 14w + 671704. What is the units digit of w? 2 Suppose 1510 = -2y - 2k, -y + 2269 = -4y - 2k. Let v = 1066 + y. What is the units digit of v? 7 Let h = 411 - 875. Let y = h - -318. What is the hundreds digit of (y/(-5))/(-1 + (-12)/(-10))? 1 What is the thousands digit of ((-22 - -19)195294/9)/(-1)? 5 What is the units digit of (3 + 7-65)/((128/(-360))/8)? 0 Suppose 63q - 2993614 + 709265 = -64q. What is the thousands digit of q? 7 Let d = 283 - 278. Suppose 142 = dm + 4f - 3397, -2826 = -4m + 2f. What is the tens digit of m? 0 Suppose 6t + 10850 = -t. Let j be (-138)/24 + 5 - t/8. Suppose j = 5v + 3. What is the tens digit of v? 3 Suppose -5n + 3t + 23 = 0, 5t + 2 = 3t. Suppose nq - 230 = -q + 5y, -4y + 160 = 4q. What is the tens digit of q? 4 Suppose 5t - 15p + 11p + 58 = 0, 4t - 5p = -41. Let d(j) = 4j*2 - 22j + 51. What is the hundreds digit of d(t)? 1 Let l(h) = 6h2 - 11h - 32. Let i be l(9). Suppose i = 6n - 1379. What is the units digit of n? 9 Suppose -2366 = -5n - 4h, 3n + 0h - 1406 = h. Suppose -n - 74 = 4s. Let a = -58 - s. What is the tens digit of a? 7 Let b be (8/6)/(15/45). What is the tens digit of 3 - 4 - b - -66? 6 Suppose -5g = 25, 2a + g - 114 = -3g. Suppose 0 = 14x + a - 277. Suppose 0 = -xm + 20m - 545. What is the hundreds digit of m? 1 Let v be -4*1/20 - (-64)/(-5). Let g = 15 + v. Suppose 0 = z - g - 11. What is the tens digit of	{ "pile_set_name": "DM Mathematics" }
(1 + sqrt(891) + -3 + 2))*24. -2376sqrt(11) + 431280 Simplify -5(-1 + (sqrt(605) + -1)*2 - (sqrt(320) + (sqrt(320) - (sqrt(320) + 1)) + sqrt(320) + -2 - sqrt(320))). -3040 + 150sqrt(5) Simplify -3 + -3((-3 + sqrt(637) + 0)2 + -3). -1932 + 126sqrt(13) Simplify 6(((sqrt(567) + -3sqrt(567)-1 + sqrt(567) - sqrt(567)) + sqrt(567))-2)*2-1. -340200 Simplify (-1(-3 + (sqrt(1377) - -1sqrt(1377))))*2-61 + 2. -33100 + 648sqrt(17) Simplify 4 + (sqrt(1728) + sqrt(48))*2 + -2(-3sqrt(75) + sqrt(75))2. 1756 Simplify 24sqrt(39)/sqrt(3) - (sqrt(364)/(sqrt(7)-2))/sqrt(4). 17sqrt(13)/2 Simplify (sqrt(51) - sqrt(612)/(-3sqrt(12)))/((sqrt(18)-2)/sqrt(6)). -2sqrt(17)/3 Simplify 6(35(sqrt(108) + 1) + 2 + 5sqrt(108)-1)2. 12240sqrt(3) + 66534 Simplify -2 + -1sqrt(34)/sqrt(2) - ((5(0 + sqrt(17)))*2 + -3). -424 - sqrt(17) Simplify 0 + ((sqrt(300)-1)/sqrt(6) + -4)6-2. 48 + 60sqrt(2) Simplify (-2sqrt(180) + sqrt(180))/(sqrt(576)-2). sqrt(5)/8 Simplify -1 + ((sqrt(2) - (sqrt(20)/(-2sqrt(10)) + sqrt(2))) + sqrt(128)/sqrt(4))*2 + 0. 79/2 Simplify (-5(sqrt(21) + (sqrt(21) + sqrt(63)/sqrt(3))-5))/(sqrt(14)/(sqrt(8)/sqrt(4)) - (-1sqrt(70))/sqrt(10)). 45sqrt(3)/2 Simplify 5(2 + -2(sqrt(165)/sqrt(3)-3)/((sqrt(5) + sqrt(15)/sqrt(3))-4)). -15sqrt(11)/4 + 10 Simplify -1 + (1 + 5sqrt(1100) + 5 + 2)2. 800sqrt(11) + 27563 Simplify (-4(sqrt(2) + 2)-3 - (sqrt(288) + sqrt(288) + 1 + -4 + sqrt(288) + sqrt(288) + sqrt(288)))*2. -2592sqrt(2) + 5337 Simplify 0 + (-4(1 + sqrt(76)-2 + sqrt(76) + sqrt(76)))*2 + 5. 21 Simplify ((sqrt(605) + sqrt(605)-1)/sqrt(11))/((sqrt(90)/sqrt(3))/sqrt(6)) + -4. -4 Simplify (sqrt(180)/sqrt(5)2)/((5sqrt(144))/sqrt(12)). 2sqrt(3)/5 Simplify (sqrt(242)/((sqrt(275)/sqrt(5))/sqrt(5)))/(6sqrt(8)-3). -sqrt(11)/36 Simplify ((sqrt(432) - (sqrt(432) - 1sqrt(432))) + -3)*2 + 1 + 0 + -2. -72sqrt(3) + 440 Simplify (5(sqrt(17) + 1sqrt(17)))*2 + sqrt(272) + -1 + sqrt(272) - -3((sqrt(153) - 2sqrt(153) - sqrt(153))/sqrt(9))2. 8sqrt(17) + 1903 Simplify ((sqrt(1225)5 - sqrt(25))/(sqrt(25)/(sqrt(15)/sqrt(3))) + -5)2. -340sqrt(5) + 5805 Simplify (2sqrt(162))26 - sqrt(24)/((sqrt(240)/sqrt(4))/sqrt(5)). -sqrt(2) + 3888 Simplify (3(-12(sqrt(133)-2 + sqrt(133) - sqrt(133))/sqrt(7) + -5) + -1)*2. -384sqrt(19) + 2992 Simplify (sqrt(156) + sqrt(156) + (sqrt(156) - (sqrt(156) + sqrt(156) + (sqrt(156) - 5sqrt(156)1 - sqrt(156)))) + sqrt(156))/(sqrt(120)/sqrt(10)-3). -7sqrt(13)/3 Simplify -5 + (sqrt(1088) - (4 + -1 + sqrt(1088)) - ((sqrt(1088) + sqrt(1088) + -2)4)2). -69704 + 1024sqrt(17) Simplify (0 + -5 + (sqrt(99) + -4sqrt(99) + 0 + sqrt(99))2)-5. -1955 Simplify -16((sqrt(10)/sqrt(2)2)2 + -2sqrt(80)). -120 + 48sqrt(5) Simplify ((sqrt(567)2)/sqrt(9))/((3sqrt(81))/sqrt(9)). 2sqrt(7)/3 Simplify ((sqrt(77) + 2sqrt(77))-6 - -4sqrt(77)-1)/(-5sqrt(175) - (-4(sqrt(7) + sqrt(7) + (sqrt(63) - sqrt(7))) - sqrt(7))). 11sqrt(11)/4 Simplify -4 + ((-1sqrt(1008))*2 + -1)-44. -16116 Simplify 3 + sqrt(114)/(sqrt(72)/sqrt(192)) - (1(sqrt(209) - (sqrt(209) + sqrt(209)1)))/(sqrt(99)-1). 3 + 11sqrt(19)/3 Simplify (0 + sqrt(832) - sqrt(13) - (sqrt(117)2)/sqrt(9) - sqrt(52)/(sqrt(4) - 3((sqrt(4) - (sqrt(4) + sqrt(4)-2)) + sqrt(4) - sqrt(4))))6. 156sqrt(13)/5 Simplify (sqrt(19) - (sqrt(19) + 2))-4 - (sqrt(171) - sqrt(19))-6 - (2 + 5 + sqrt(38)/sqrt(2)). 1 + 11sqrt(19) Simplify (5 + 5(1 + sqrt(968) + 1))*2. 3300sqrt(2) + 24425 Simplify (-5 + (-1sqrt(76))/sqrt(4) + -5 + (3(sqrt(19) + -2) - (sqrt(19) - (sqrt(19) - (sqrt(19) + sqrt(19)2)-3))))*2. -352sqrt(19) + 2555 Simplify (sqrt(288)16 - ((sqrt(288) - (2 + sqrt(288))) + sqrt(288) + 0))*2. 240sqrt(2) + 7204 Simplify (-2((sqrt(363) + 2sqrt(363) - sqrt(363)) + sqrt(363) + sqrt(363))6-4)*22. 26763264 Simplify -1 + 5 + sqrt(425) - (((sqrt(34)/sqrt(8))*2 - sqrt(17)) + sqrt(17) + sqrt(85)/sqrt(5) + -4). 15/4 + 4sqrt(17) Simplify (((-3 + sqrt(10)/sqrt(2))6)2 - (1sqrt(315))/sqrt(7))-1. -504 + 219sqrt(5) Simplify ((1 + sqrt(180))-2 + (sqrt(360) - (sqrt(360) - (sqrt(360) + (sqrt(360) - (sqrt(360) + sqrt(360) + -1sqrt(360))))))/sqrt(8))1. -9sqrt(5) - 2 Simplify (sqrt(98) + (0 + (sqrt(98) - (sqrt(98) + -1))*2 - sqrt(98)))-4 + (-3 + -1 + sqrt(98) + sqrt(98) - 52sqrt(98))*2. 448sqrt(2) + 6284 Simplify -1 + -4 + -1(sqrt(200) + -3 + sqrt(200) + 0). -20sqrt(2) - 2 Simplify ((1 + sqrt(300) + 5)*2 - sqrt(300)) + 0 - ((-1sqrt(300) + -1)4)2. -4480 - 210sqrt(3) Simplify (sqrt(28)/sqrt(4)-4 + sqrt(7))-4 + 1 + sqrt(700) + sqrt(28) + 1. 2 + 24sqrt(7) Simplify ((sqrt(70)/(sqrt(10)-2))*2 - (3 + (sqrt(7) - sqrt(63))))-5 + 2. -10sqrt(7) + 33/4 Simplify (-1(sqrt(567)/(sqrt(18)/sqrt(2)))/(-2sqrt(36)/sqrt(4))6)*2. 63 Simplify (3 + sqrt(108)-1 - -4(sqrt(15)/(sqrt(5)1) + sqrt(3)))*262. 144sqrt(3) + 252 Simplify ((sqrt(245) - (-5(sqrt(245) + sqrt(245)-1) - sqrt(245)))/sqrt(7))/(-1(sqrt(35)/sqrt(5) + sqrt(7))3) + 2. -sqrt(5)/3 + 2 Simplify (sqrt(72)1 + (sqrt(2) + sqrt(2)-2 + sqrt(2))*2-1)4 + 1. 1 + 24sqrt(2) Simplify (sqrt(119) + sqrt(119) + sqrt(119) + (sqrt(119) - 5(sqrt(119) - sqrt(119)4)))/(sqrt(448)4). 19sqrt(17)/32 Simplify (sqrt(30)/(sqrt(24)/sqrt(8) + sqrt(3)))/(sqrt(140)/sqrt(7)). sqrt(2)/4 Simplify (((4sqrt(70)-3 - sqrt(70) - sqrt(70) - sqrt(70)) + sqrt(70))/(-3sqrt(10)-5 - sqrt(10)))*2. 7 Simplify -1-45sqrt(6)/sqrt(2)1. 20sqrt(3) Simplify ((-2(sqrt(832) - (((sqrt(832) + 0)-2 - sqrt(832)) + sqrt(832)) - (1 + sqrt(832) + sqrt(832)1)) + -5)1)*2. 96sqrt(13) + 3337 Simplify -4 + ((-2sqrt(3200) - sqrt(3200))6)/(-6sqrt(40) - sqrt(360)2). -4 + 6sqrt(5) Simplify (-2(sqrt(13) + sqrt(13) + 1 + 1) - (sqrt(104)/(sqrt(32)/sqrt(4)) + 2))*2. 60sqrt(13) + 361 Simplify (-6(sqrt(7) - (1sqrt(448) + sqrt(7))) - (2 + sqrt(7) + -5sqrt(28)/sqrt(4)))2. -208sqrt(7) + 18932 Simplify 5(sqrt(242) - (sqrt(242) - ((-1 + sqrt(242))-1 + sqrt(242)))*2)-5 + 4. -825sqrt(2) + 6079 Simplify 6((-1(sqrt(605) - (sqrt(605) + 0)))2 + 1 - ((sqrt(605) - sqrt(605)23) + sqrt(605)2 + 4)). -18 + 198sqrt(5) Simplify (sqrt(400)/sqrt(10)-6)/sqrt(8) + 3 + sqrt(5) + 3sqrt(5)-2. -11sqrt(5) + 3 Simplify (-1((sqrt(605) + 2 - (sqrt(5) + sqrt(20)/sqrt(4) + 2)) + sqrt(720) + sqrt(720) + 2sqrt(720)4))*2. 83205 Simplify 5(sqrt(684)1 - sqrt(684))-2 - ((1sqrt(684) + sqrt(684))-1 - (-5 + (sqrt(684) - (0 + sqrt(684)))))*2. -2761 + 120sqrt(19) Simplify (sqrt(152)-13)/(1sqrt(72)) + (sqrt(114)/sqrt(6)-4 - (1 + sqrt(19) + -5))*2. -41sqrt(19) + 491 Simplify (sqrt(2240)-22)/((sqrt(448) - sqrt(448)-31) + sqrt(448) - sqrt(448)). -sqrt(5) Simplify ((sqrt(119) - -1sqrt(119))-5 - sqrt(119)-16)/(sqrt(112) - (6(sqrt(112) - (sqrt(112) + (sqrt(112) - sqrt(112)-2 - sqrt(112)))) - sqrt(112))). -sqrt(17)/14 Simplify (5 + sqrt(176) - ((sqrt(88)/sqrt(2))*2 - sqrt(11))) + -1 + sqrt(44)/sqrt(16). -40 + 11sqrt(11)/2 Simplify 2sqrt(288) + -5 + -2 + ((sqrt(288) + 1 + sqrt(288) + 0)-3)*2 + 0. 456sqrt(2) + 10370 Simplify ((sqrt(240)1)/sqrt(8) + (sqrt(360) + sqrt(360)1 + sqrt(360))/sqrt(12))/(1sqrt(10)-2 + (-2sqrt(80) - sqrt(80))/sqrt(8)) + -5. -5 - 4sqrt(3)/5 Simplify (2 + -5sqrt(700))21 + -4. -200sqrt(7) + 17500 Simplify 4 + (sqrt(15)/(sqrt(3) + sqrt(75))2-3)2 + -5. 4 Simplify ((2(sqrt(204) - (sqrt(204) + (sqrt(204) - -11sqrt(204) - sqrt(204)) + sqrt(204))))/(26sqrt(24)/sqrt(2)))*2. 17/9 Simplify 3 + sqrt(20)/sqrt(4) + -4 - sqrt(45)-3-4. -35sqrt(5) - 1 Simplify (sqrt(110)/(sqrt(10) + sqrt(40)/((sqrt(4) - (sqrt(4) - 2sqrt(4))) + sqrt(4))) + -1 + (-1 + sqrt(11))-2)*2. -5sqrt(11)/2 + 291/16 Simplify (1(sqrt(117) + sqrt(117)-1-1))/(3(sqrt(36) - sqrt(9)) + sqrt(72)/(sqrt(8) - (sqrt(24)/sqrt(3) + sqrt(8)) - sqrt(8))). 4sqrt(13)/5 Simplify ((sqrt(187)11 - 2sqrt(187)-6)/(sqrt(396) + sqrt(396) + 1(-4sqrt(396) - sqrt(396)) - sqrt(396)))2. 2873/576 Simplify (sqrt(44)/sqrt(4) + 2 + sqrt(22)/sqrt(2) + 2)2 + sqrt(44) + -5 + (-5 + sqrt(22)/sqrt(2))2. 8sqrt(11) + 91 Simplify (-3(sqrt(85)-2 + sqrt(85) - sqrt(85)))/(sqrt(20)/(-2sqrt(4))) + -3. -12sqrt(17) - 3 Simplify ((sqrt(91) - -1sqrt(91))3 + sqrt(91))/((sqrt(35) + sqrt(70)/sqrt(2))/sqrt(5)	{ "pile_set_name": "DM Mathematics" }
)/h*(-2/17)(h*(1/6)h/(hh/(h(-2/19)hhh)))(-47) assuming h is positive. h(-842203/7752) Simplify (((m*(-2/7)m)*17((m*(-1/4)/m)/mm)(-7))8)31 assuming m is positive. m(36270/7) Simplify (v(1/3)/(v8/v))*(-29)(vv(2/5))/v(-3/2)(v*3/v)/((vv(-1/2))/v) assuming v is positive. v(2981/15) Simplify (o/o*(-22)o(-2/35))/(o/(o/(o/(o(-14/9)o)oo)))17 assuming o is positive. o(-11813/315) Simplify p(-5/3)p*(1/3)p*(1/5)(p*(-4)p)/p(p/(pp*0p))*32(p(2/7))(-4/5) assuming p is positive. p(-3923/105) Simplify ((l(-2)l)12/(ll*3l/(lll20/l)))(-1/16) assuming l is positive. l(-1/4) Simplify q/q7q2qq(-2/11)/q5q*(-1/6)(q/((q/(q/q*(-5/2)))/q))/qq(q/(qq(-1)))(8/11) assuming q is positive. q(-103/33) Simplify ((((w/w(-2/11))/(w/(ww(-1)/w)))/((w(ww/w(-1/4))/w)/www(-1/5)))(-29/5))24 assuming w is positive. w(109794/275) Simplify (c18/(cc*(-11))(((cc(-1/25)/c)/c)/c)/(cc(-13)))(-38) assuming c is positive. c(-36062/25) Simplify ((o(-7)/o)/(ooo*(-2))ooo*(1/3)o*(-6))/((o(o/(o*(-2/9)o)oo)/o)*33(o(1/4)/o)10) assuming o is positive. o(-155/2) Simplify (((d/d(-1/3)d)/d)(-5/19)(dd/((d(-2/5)d)/d))*(-18))/((dd(-1/4))(6/11)/(d*(-2/5)ddd/(d/(d(d/d(-5))/d)))) assuming d is positive. d(-227977/6270) Simplify ((x(-2/33)/x(-12))/((xx(-2/29))/x12))(3/17) assuming x is positive. x(22019/5423) Simplify ((((n(n/((n/n(-1/4))/nnnn))/n)/(n/(n/(nn7))n))/(n*4/(n(n(2/17)/n)/n)))(-50))48 assuming n is positive. n(658200/17) Simplify ((zz/(z(-5)z)zz)*(-9)(z0)10)(-19) assuming z is positive. z1368 Simplify ((t/((t*(2/5)tt)/t))(8/5))19/(t(4/3)t(t(2/13)/t)/tttt(t(1/7)/t)/ttt(-1)tt) assuming t is positive. t(-107767/6825) Simplify (y0y(1/3))(-6/13)/((yy/y(-2/3))24)19 assuming y is positive. y(-15810/13) Simplify z(z/(z/(z*32z)))/zzz*(2/43)zz(zz/z31)(1/84) assuming z is positive. z(128953/3612) Simplify ((y/y(-3)yy(-2)y)/(y/(yy(15/4))y(13/3)))(-1/42) assuming y is positive. y*(-41/504) Simplify ((l/(ll/(l/(l*5l))l))/(lll(-5)l))*(-10)(((l/l*1)/l)/(ll(1/13)))(-48) assuming l is positive. l*(1946/13) Simplify (f/(ff*38f))/fff*(-4/5)f*45ffff/(f((f*(-29)/f)/f)/ff) assuming f is positive. f*(196/5) Simplify ((rr*9rr)/((rr(-5/7))/r))(-1/3)(r(-2/9))(-1/22)/(r(-5)/((r(r/(r*(-3/5)r)r)/rr)/r)) assuming r is positive. r(8219/3465) Simplify (((q(-3)q)/q)(-45))(-47)(q*(-2/17)q/q(-2/19))(1/34) assuming q is positive. q(-69680471/10982) Simplify (((c3cc5)/(c/((c0/c)/c))(-7))(-1/12))(-2/35) assuming c is positive. c(1/7) Simplify ((((w/w*(-2/75))/w)/(ww(w/(w/((ww/((w/(w/(ww10/ww))w)/w))/ww)))/www))/(((ww(7/3)www)/w)/(ww0w)))22 assuming w is positive. w(4444/75) Simplify h3/h(-20)((hh27)/h)/(h(-32)hhh) assuming h is positive. h79 Simplify ((uu*(2/5)uu(-9)u)/(u(uu*(-4/3))/uuu(2/15)))/((u/u(-7)u(-3))/((u(-1/5)/u)/((uu(-7)u)/u))) assuming u is positive. u(-33/5) Simplify (((q(-21)/q)(-2/71))(4/3))(-25) assuming q is positive. q(-4400/213) Simplify (v(-6))35(v(3/22)v)8 assuming v is positive. v(-2210/11) Simplify ((ii(((i/(i(2/7)/i))/i)/i)/i)/(i(-5/2)/i))*(-29)((i/(i*(1/4)i)i)/i)18/(i/((i(2/15)i)/i)i(-5)) assuming i is positive. i(-12871/105) Simplify ((q(-1/4)q(-4))/(q/(q/(q/q1)))(-21))/((q(-1))(-38))(-49) assuming q is positive. q(7431/4) Simplify (((u(-2/9)/u)/u)*(5/7)(u/(u/(uu10)))/(u/(uuu/(uu*17uu))))(-2/39) assuming u is positive. u(1082/2457) Simplify (((z/(z8z))/zzzz/z(-1)z(z/(zz/z*(-7)))/zzz(z/z(-8))/z)(-13))(-1/5) assuming z is positive. z(-39/5) Simplify ((ii(-5/2))(7/8)/(i(-3/13))(3/32))(-34/9) assuming i is positive. i(3043/624) Simplify p(-20)((p/(p*19p))/p)/p(p(-3/17)/p)(-42) assuming p is positive. p(143/17) Simplify ((n/(nn/(((nn(-2/7))/n)/n)nn))/n)6/((nnn(2/7)/nn)/n)*47(n/n*(-3)(nn(-1/10)/n)/n)(-1/4) assuming n is positive. n(-26003/280) Simplify (((a/a5)/(a/(a3a)))/(((a*(-7)/a)/a)/(aa/a*(-2)aa)))/((a(-7)a)/a*3a*(-3/5)/aaa(-6/11)) assuming a is positive. a(1328/55) Simplify ((zz(1/4))(1/49))*(-33)(z(1/2)/(z/z(2/7)))/(z(1/2))(-32/7) assuming z is positive. z(241/196) Simplify (z(-1/9)zzz/z(-5/6))(-49)/((zz/(z/z*(2/3))z)*(-49)((z/z(-2/31))/z)/z(-2/13)) assuming z is positive. z(-376777/7254) Simplify ((i(-1)/i)*(-3)i*2/(ii*(-3/11)))/(((ii(-2/5))/i)47)(-29) assuming i is positive. i(-29586/55) Simplify ((z*(-2)z/(zz5z))/(z*(-1/7)/(zzz/(z/z(-2)))))/((zzz(z*(-1/4)/z)/zzz)/z(-1))(-40) assuming z is positive. z(995/7) Simplify (((f1ff/f3)/((ff*(-2/3))/ff(-1/20)))20)3 assuming f is positive. f43 Simplify (ii/(ii/(i/i*(-3)))i)/ii(6/13)((i/i(-10/11))/i)35 assuming i is positive. i*(5188/143) Simplify ((x/(xx(x/(x/x6x))/x))/(x/(x/(xx0/x))))(-4)/(x(1/2)x/(x(xx(x/(x/(x/(xx*(2/11)/x)x)x))/x)/x))25 assuming x is positive. x(615/22) Simplify (p(23/2))(-36/11)/(p(2/59)pp)(3/4) assuming p is positive. p(-25416/649) Simplify (((l/(l(5/6)/llll))/lll/((ll(-4)l)/ll)l)/(l(-1/4))(-1/4))/(l(l/(lll(-1)ll))/ll7)(5/9) assuming l is positive. l*(-97/144) Simplify (((((iii(-1/4))/i)/i)(2/55)(i(i(-4/9)/i)/i)/(i(i(i/(i(5/6)/i))/ii)/i))(5/6))(-5/16) assuming i is positive. i*(280/297) Simplify ww(w(3/22)/w)/ww*(-3/29)w*(30/13)ww/(w(-34)w)w assuming w is positive. w(317997/8294) Simplify (((ll*(1/26)l)/lll)/l)/l*(-45)(l22)(-33) assuming l is positive. l(-17653/26) Simplify (i(2/33)/i*(-2/41)(i(-6/11))(-5/3))(-6) assuming i is positive. i(-2756/451) Simplify (((p/(p/((pp(-4))/p))pp/(p/(pp*3/pp)))48)(-19))(1/14) assuming p is positive. p(-456/7) Simplify ((f/(f*(-1)f))36/(f(1/4)(f/(ff*0f))/f))/(ff(-5)f4)44 assuming f is positive. f(151/4) Simplify (v(-5)v/(v(1/10)/vv))(3/7)/((v(-6)/vv)/vvvvv8v(((v(v/(v/(vv(-2)vv)))/v)/v)/v)(-13)) assuming v is positive. v(-1383/70) Simplify (z/z3z*(2/5)z)/(z*(2/9)/(zzz(2/13)))(z*(-1/2)z6)(-2/101) assuming z is positive. z(72244/59085) Simplify ((a/((a/a(-1/6)a)/a))(-25)/((a/(a(5/4)/a))/((a10/a)/a)))21 assuming a is positive. a(959/4) Simplify (l(-2)ll(-1/4)l)*(-38)/(ll(ll*0)/ll(-4/9))(4/9) assuming l is positive. l*(1427/162) Simplify mmm(-12)mmm/(m/(m*22/m))((m/m*(1/28)m)/m)/m(4/7) assuming m is positive. m(375/28) Simplify (b*(-1/3)bb/((b/((bbb(-6))/b))/b)b)/(((b*(-1/7)/bb)/b)/b(b0/b)/b)(b/(bb(-2/3)))18b/b*(1/4)bb(-4) assuming b is positive. b(971/84) Simplify (c(-16)/(cc*10)(cc(-35)/c)(2/61))(8/13) assuming c is positive. c(-13736/793) Simplify ((d2/d)/d(4/5))20/(((d(2/3)d)/d)*(-1/12)d*(1/13)d*(-2/7)d) assuming d is positive. d*(5347/1638) Simplify (bbb(b/(b*(-2)bb))/bb)/(b*(-1)/b)(b(-1/3)/b)(-40/3)b(-2/7)b*2b(-6)/(b/(b/b(-7))) assuming b is positive. b(1669/63) Simplify d/d(-18)dd*(1/59)(ddd*37)/dd(-3/7) assuming d is positive. d(23784/413) Simplify (((ss(-1/38))/((s(-4/29)s)/s))(-2/93))41 assuming s is positive. s(-50225/51243) Simplify ((p0pp(-7))/(p(2/19)/pp/(p/(p/(p(p(((p1/p)/pp)/p)/p)/ppp)))ppp))/(p(-3)ppp*(-11)/pp)(2/41) assuming p is positive. p(-5858/779) Simplify (a/(aa(-1/4))a*(-2/3)aa(-6)a*(2/7)a)/(a*(2/5)a(1/2))(-2/3) assuming a is positive. a*(-1483/420) Simplify ((gg*9/gg(((g12/g)/g)/g)/g)/((g(-6)g)/g(-3)))(-30) assuming g is positive. g(-600) Simplify (o32/o(29/5))/(o(2/3))(1/2) assuming o is positive. o(388/15) Simplify ((d*(-1/7)d(1/4))/(d0d/(dd/d(-2/15))))/((((d(2/9)d)/d)/dd(-6))/(d(1/2)d(d/(d/d*	{ "pile_set_name": "DM Mathematics" }
t u(t) = 5t - t2 - 1 + 3 + x. Let z be u(5). Solve 2h = z + 1 for h. 4 Let p = -4 + 1. Suppose -5w - 31 = 9. Let f = p - w. Solve -f - 1 = 2m for m. -3 Suppose -i - 3i - 1 = 3o, -4 = 4o + 4i. Let t be (-5 - o)1 + 2. Solve tq = -2q + 4 for q. 2 Suppose -19 = 5a + 1, 5i = 3a + 87. Let v = i - 14. Solve -v = -k - 6 for k. -5 Let p be ((-2)/(-5))/((-10)/(-25)). Let g(x) = x*3 + 4x*2 - 2x - 6. Let t be g(-4). Let i be 4/33/t. Solve 0 = -ih + 3 + p for h. 2 Let z be 780/25 - (-1)/(-5). Solve -5s - z = -6 for s. -5 Let g(x) = -4x - 6. Let r be g(-4). Solve 3u - 5 = r for u. 5 Let m be 3/2(-32)/(-6) - 4. Solve 0 = mf - 11 + 3 for f. 2 Suppose -2w - 7 = -3l, 0 = 2w + 3w - 5. Solve 2d - 25 = -ld for d. 5 Let q be (0/(-1 - 1))/1. Solve -3f + 3 = -qf for f. 1 Let w be (-3 + 7)3/(-2). Let m be w/(-15) + (-18)/(-5). Solve m = y + 3 for y. 1 Let q be 2/7 - (-4)/(-14). Solve 2x = -qx for x. 0 Let w(m) be the first derivative of 9m4/4 + 2m3/3 - m2 + m - 1. Suppose -4 = -3d - 1. Let l be w(d). Solve 3x + l = 22 for x. 4 Let l = 33 - 28. Solve -i + 0i = l for i. -5 Let d = 20 + -14. Suppose dx - 69 = 3. Solve 6p = 2p + x for p. 3 Let o(d) = d*2 - 2d. Let h be o(3). Suppose 3 + 0 = 3w - 3v, 0 = hv - 6. Let s(q) = 5q - 4. Let g be s(w). Solve -5r = 31 - g for r. -4 Suppose -5a + 20 = -0a. Solve 4r - 4 = a for r. 2 Let j = 8 + -3. Solve 8o - jo - 12 = 0 for o. 4 Suppose 7b - 2b - 22 = -s, 3b - 2 = 5s. Suppose br - 16 = -2z, -2z = -r + 3r - 12. Suppose 1 - 9 = -ro. Solve c + o = -c for c. -2 Let y be ((-18)/5 - -2)-5 + 1. Let s(z) = 6z - 1. Let k be s(1). Solve -kb - 34 = -y for b. -5 Suppose 0 = -2u - 2l - l + 13, 3l - 9 = 0. Solve 5f = uf + 3 for f. 1 Suppose 4f + 0f - 32 = 0. Let i(k) = k2 - 7k - 5. Let y be i(f). Solve -yw + 4w = -3 for w. -3 Let t = 1 + 3. Let z be (-588)/(-27) - (-2)/9. Suppose -8k + 26 = -3k + 3s, tk + 3s = z. Solve -n = -5n - k for n. -1 Suppose l - 7 = -5. Solve 6 = -w - lw for w. -2 Let i be 32(-2)/3. Let l(u) = -u + 1. Let s(z) = -3z + 1. Let f(h) = -5l(h) + 2s(h). Let p be f(i). Solve -5o + p - 21 = 0 for o. -4 Let q(j) = -j + 1. Let m(c) = -2c - 8. Let i(a) = -m(a) + 3q(a). Let x be i(9). Solve -8 = -0w + xw for w. -4 Let l(k) = 4k - 15. Let s be l(5). Let x = 101 - 69. Suppose -5n - c + x = c, -sn + 60 = -5c. Solve -4r + n = -8 for r. 4 Suppose -4p - 5 - 11 = 0. Let i(w) be the third derivative of w6/120 + w5/20 - w4/4 - w3/2 - 12w*2. Let r be i(p). Solve d - 16 = rd for d. -4 Suppose 6 = -b + 3b. Suppose 5u - 22 - 12 = 3g, 0 = -bu + 5g + 30. Suppose -4q + 3q + 83 = 4t, -3t + 48 = -4q. Solve uv = v - t for v. -5 Suppose 0 = -l - 2a + 3 + 22, 3l = -2a + 71. Suppose -5h + 20 = -0h, 2h - l = -3f. Solve -4y + f = y for y. 1 Suppose -l + d = -2l, -30 = -4l + 2d. Suppose -14 - 1 = -lg. Suppose -12 = 3p - 4m, -2p + 0m = m - g. Solve 3y = -py for y. 0 Suppose -3 = p - 2p. Let y = 5 - p. Suppose 5a - 22 + 2 = 0. Solve -2i - y = -ai for i. 1 Suppose j - 2j - 1 = 2i, 2i - 19 = 3j. Solve 0 = w - 3w + i for w. 1 Let q be ((0 + -1)4)/1. Let r = q - -9. Let f = 12 - 7. Solve fa = 4a + r for a. 5 Let n be 2/5(2 + 3). Let p = n - 2. Solve -l + 3 + 2 = p for l. 5 Let y(v) = -v. Suppose 0 = 4n - 3z - 6, 3n + z + 3 = 1. Let w be y(n). Solve -k - 4k + 20 = w for k. 4 Let l(g) = g + 5. Let a be l(4). Solve -b - a = -4b for b. 3 Let s(f) = -3f + 2. Let g(h) = -h + 1. Let n(j) = 4g(j) - s(j). Let v be n(2). Let z be v - (5/(-1) - 1). Solve 4r - r - z = 0 for r. 2 Let r be (1 - (-1 - -2)) + 2. Let l(g) = -2g2 + g3 + g2 - g2. Let a be l(r). Solve 0 = 2f - af for f. 0 Suppose -9j = -8j - 25. Solve 0 = -0r + 5r - j for r. 5 Let w(n) = -2n + 3. Let o be w(-6). Solve 2g - o = 7g for g. -3 Let q(f) be the first derivative of -f*2 - f - 2. Let n be q(-2). Solve d = -0d - n for d. -3 Let n = -47 + 51. Solve ns - 2 = 2 for s. 1 Suppose 4b = 8 + 44. Let f be (-3)/9 - b/(-3). Suppose -fg = -0g. Solve 2q - 8 = -gq for q. 4 Let g = 38 + -37. Solve -c = -2 - g for c. 3 Let g be ((-1)/(-1))/((-2)/(-4)). Suppose gm = m. Solve -3w + 7w + 20 = m for w. -5 Let v(h) = -h2 - 11h - 9. Let a = 14 - 24. Let s be v(a). Solve i - s + 2 = 0 for i. -1 Let f(w) be the third derivative of -w6/120 + w5/15 - w4/12 - w3/6 + w*2. Let g be f(3). Solve -2j = 10 - g for j. -4 Let t be (4 + -4)(-2)/(-4). Let h(j) = 2j. Let k be h(1). Let v be (tk/2)/2. Solve l + 4l = v for l. 0 Let u(h) = h + 7. Let b be u(8). Let t = b + -12. Solve tq = 6q for q. 0 Let s be 32/(-3) - 1. Let z(y) = -y2 + 7y - 4. Let u be z(5). Let b = u + s. Solve bh = -h - 12 for h. -3 Let y be 1 + 1 + -2 + 0. Suppose -4c = -8 - y. Suppose 4h + 4v = 68, -h - 4v = -v - 17. Solve 0 = 5p + c - h for p. 3 Let w be (3 + (-26)/8)/(5/(-60)). Solve -2r + 3 = -wr for r. -3 Let g(j) = -j*2 + 7j - 5. Let v be g(5). Suppose vk - 13 = 4m, 3m + k - 4k = -6. Solve 2b + 3 + m = 0 for b. -3 Suppose 4s + 48 = 72. Solve 3w = sw + 6 for w. -2 Let g(l) = -l*2 + 5l - 4. Let s be g(4). Solve s = -0v - v + 5 for v. 5 Let f(a) = -a - 8. Let p be f(9). Let s = 38 + p. Solve -5y - s = 4 for y. -5 Let i = -7 + 13. Suppose 3d - 32 = -d - 5k, -3d = 5k - 29. Suppose 3t - 30 = -4q, t + dq = -q + 10. Solve -4f + if = t for f. 5 Suppose 0 = -5n + 5, -13 = -3x - 0x + 5n. Suppose -xh = -h. Let b be (-1)/(3/(-9)) + h. Solve -bm - m = -16 for m. 4 Let t be 16/6 + (-7)/(-21). Let r be (t - 3)/1 + 0. Solve r = n - 0 - 3 for n. 3 Let s = 1 - -1. Suppose -sw + 22 = -12. Suppose t + 2 - w = 0. Solve 7z - t = 2z for z. 3 Let v be (-10)/6 + 6/9. Let r = v + 1. Solve f - 1 = -r for f. 1 Let h = 152 + -152. Solve -m - 5 + 7 = h for m. 2 Let f = -9 - -15. Suppose t + 4 = f. Solve 6 + 0 = to for o. 3 Let v be 1(-2 + 1)-3. Suppose -5c + 28 = -vc. Suppose -m = 2m + 4b + c, 5m - 25 = 3b. Solve -mw = 2w - 20 for w. 5 Let i = -23 + 24. Suppose -2 + 14 = 3x. Solve u - i = x for u. 5 Suppose 7a - 32 = 3a. Let r = -5 + a. Suppose -g = 3k - 10, -6 = -5k + 2k + rg. Solve -9 = kc + 3 for c. -4 Suppose 9 = 3i + z, 5 = 2i + z - 2. Solve is = 1 - 11 for s. -5 Let g = 7 + -2. Suppose 3n + 0n - 11 = gv, n + v = 1. Solve z = -2 - n for z. -4 Let m(b) be the second derivative of -1/6b*3 - b + 9/2b*2 + 0. Let j be m(8). Solve 2 = -l + j for l. -1 Let v = -6 - -15. Let z be v/12 + (-3)/4. Solve zq - 4q = 12 for q. -3 Let k = -10 + 3. Let o = k + 10. Solve -1 - 2 = os for s. -1 Let j = -5 + 7. Suppose 0 = jz - 0z. Solve z = -3w + 3 for w. 1 Suppose 0 = 4k, -4y + 0y + 2k + 16 = 0. Suppose 4 = -d - d. Let q = d - -5. Solve -ym - q = 5 for m. -2 Suppose 2s - 19 = 7. Let n = -10 + s. Suppose 5 = nf - 13. Solve fy - 8 = 4y for y. 4 Let a be (-28)/(-6) + 1 - (-12)/(-18). Solve 8j - aj = 9 for j. 3 Let l be ((-9)/6)/((-6)/8). Suppose -2d + 2 = -3d. Let s be 0(d - 15/(-6)). Solve lu - 4 = -s for u. 2 Suppose -11 = -5g + 9. Suppose 0 = 4n - 9 + 1. Suppose -4c + nc = -2. Solve 3a + c = ga for a. 1 Suppose -6g + 5g + 3w + 18 = 0, 0 = 5g - 3w - 30. Suppose gs = s. Solve s = -5j + 26 - 1 for j. 5 Suppose -o = 4o - 15. Suppose -u + 5 + 0 = 0. Let w be (6 + -1)14/7. Solve -oa + ua = w for a. 5 Suppose -2o = -3o + 2. Suppose 4f = of. Solve -4w - 11 - 9 = f for w. -5 Let i be 4/6 + 20/6. Suppose -4d - 3z - 48 = -7z, -2d - 5z = 38. Let f = d - -17. Solve -2o + fo - i = 0 for o. 4 Let m = 18 + -10. Solve 3s + 7 + m = 0 for s. -5 Let i(r) = 0r2 + 23r + 1 - r*2 - 21r. Let q be i(2). Let o be 4/3 + 2/3. Solve u - o = -q for u. 1 Let h be -1(-1 - (7 - 3)). Solve s + h = -4s for s. -1 Suppose 0 = 5n - 0n - 10. Suppose -5c + 5w - 93 = 67, -5w = nc + 92. Let m be (-8)/c + 4/(-18). Solve m = z + z + 4 for z. -2 Suppose -5f = 3x + 3, -4f + 3 = -4x - 1. Let j(a) = 2a2 + 2a - 2. Let y = 7 + -10. Let z be j(y). Solve -2r - z = -f for r. -5 Suppose 0 = -s - s + 4. Suppose -4 = 4r, -4m + r = -2r + 21. Let z = m - -14. Solve -sw - z + 0 = 0 for w. -4 Let x be (-1 + 0)2 + 9. Let o = 13 - x. Solve -o = -q - 1 for q. 5 Suppose 33 = 4l + 4u + 1, -3l + 5u - 16 =	{ "pile_set_name": "DM Mathematics" }
2 - 1 Let g(d) = -17d*2 + 93d - 3014. Let o(t) = 3t2 - 17t + 603. Give -2g(q) - 11o(q). q*2 + q - 605 Let n(h) = 2h + 12. Suppose 7g - 6g + 8 = 3o, 4g - 16 = 0. Let k(f) = -1 - 14f + 13f - o. Suppose -2j = -6j + 48. Calculate jk(y) + 5n(y). -2y Let b(p) be the first derivative of -p4/4 - p2/2 + p - 1080. Let a(c) = 0 - 29c*3 - 3 + 27c*3. Give a(v) + 2b(v). -4v3 - 2v - 1 Let t(u) = 273u + 105. Let c(f) = -8f - 3. Let a(d) = 35c(d) + t(d). Let b(x) = 13x. Give -13a(i) - 6b(i). 13i Let b(t) = -503t - 24. Let a(i) = -126i - 7. Calculate 11a(n) - 3b(n). 123n - 5 Let c(r) = 3r3 + 8r*2 - 15r + 8. Let u(t) = -t*3 - 10t*2 + 15t - 10. Give 5c(j) + 4u(j). 11j3 - 15j Let v(c) = -9c3 - 4c*2 + 285c + 4. Let b(g) = -26g3 - 11g*2 + 857g + 11. Give -4b(o) + 11v(o). 5o3 - 293o Let f(w) = -1. Let x(a) = 6 + 2 - 5 - 9 + 10 + 10a. Calculate 3f(y) + x(y). 10y + 1 Let w(c) = 5c*2 + c + 4. Let b = -23 + 26. Let d = 1995 - 1991. Let q(z) = -4z*2 - z - 3. Give bw(o) + dq(o). -o2 - o Let b(y) be the first derivative of -2y*4 - 2y3 - y2/2 + 8y + 2824. Let p(z) = -7z*3 - 5z*2 - z + 7. Give -5b(k) + 6p(k). -2k*3 - k + 2 Let h(j) = 2 + 61971j*2 - 61638j*2 - 2 - 60j - 12j. Let g(m) = 23m*2 - 5m. What is 72g(d) - 5h(d)? -9d2 Let y(s) = 73s - 4812. Let n(l) = -52l + 3208. What is -7n(x) - 5y(x)? -x + 1604 Let k(y) = -5y*2 - 509y*3 + 2y + 512y3 - 23 + 3y. Let n(b) = 4b3 - 7b*2 + 7b - 35. Give -7k(c) + 5n(c). -c*3 - 14 Suppose 0 = -13l + 3l - 640. Let p = 60 + l. Let b(k) = -k - 1. Suppose 3r = -0 + 6. Let f(q) = -1. Determine pf(x) + rb(x). -2x + 2 Let n(v) = -1364v*2 - 88v + 88. Let q be (54 + -53)/(1-3 - (-80)/24). Let g(a) = -47a*2 - 3a + 3. What is qn(b) - 88g(b)? 44b2 Suppose 3i + 2l - 10 - 2 = 0, -2l - 4 = i. Let a(f) = -47f2 + 5f - 5. Let d(c) = 71c2 - 8c + 8. What is ia(m) + 5d(m)? -21m2 Let x(o) = -2o. Let n be 9/(-15) - 86/(-10). Let d(r) = -34r - 21. Let h(z) = 15z + 9. Let k(p) = 6d(p) + 14h(p). What is nx(y) + 3k(y)? 2y Let c(k) = 13k*2 - 22k + 14. Let u(v) = 9v2 - 14v + 11. Give 5c(a) - 7u(a). 2a2 - 12a - 7 Let m(k) = 7k2 + 8. Let l = -58 - -65. Let s be 3/(-5 - -2)(l - 1). Let n(d) = -13d2 - 15. Give sn(b) - 11m(b). b2 + 2 Let k(y) = y3 - 2y*2 - 4y + 1. Let a(f) = -61f3 - 4f*2 - 16f + 2. Determine a(u) - 2k(u). -63u*3 - 8u Let x(z) = -9z3 - 6z*2 - 230. Let d(o) = 43o*3 + 29o*2 + 1145. What is 6d(b) + 29x(b)? -3b3 + 200 Let r(h) = -h3 - h*2 - 2. Let j(p) = -173p*3 + 6p*2 + 2. Determine -j(n) - 6r(n). 179n3 + 10 Let h(t) = 356t*3 + 3t*2 - 30. Let r(c) = -1425c*3 - 13c*2 + 130. Determine 26h(b) + 6r(b). 706b*3 Let k(u) = -4u*3 + u - 1. Suppose 5s - j + 16 = 8, -5s = -5j + 20. Let x be -3 + 1 + 0 + 8. Let m(f) = 1 - 7f - f3 + 0 + xf. Calculate sm(g) - k(g). 5g*3 Suppose -3c - 5z = -3z - 227, -2c + 152 = z. Suppose 0 = 70l - cl + 42. Let j(t) = -5t*3 + 6. Let p(a) = 11a*3 - 13. Give lp(w) + 13j(w). w3 Let m(w) = -2061w - 53580. Let p be m(-26). Let z(s) = 4s3 - s2 + 3s + 3. Let u(y) = 8 + 9y3 - y2 + 7y - 4 + 3. What is pu(o) - 14z(o)? -2o3 + 8o*2 Let m(u) = 3u - 1 - 4 - 2. Let v(j) be the first derivative of j*2 - 6j + 27. Let n = -567 - -573. Give nv(s) - 5m(s). -3s - 1 Let s(n) = n2 + n. Let o(c) = c2 + 16c - 6. Let p be o(0). Let a(z) = 12z2 + 9z. What is ps(w) + a(w)? 6w*2 + 3w Let y(u) be the first derivative of -4u2 + 4u + 7320. Suppose -m + 21 = 5p, 0p + 40 = 4p - 5m. Let g(r) = -3r + 6 - 1 - 6r. Give py(s) - 4g(s). -4s Let h(s) = -17s*3 - 333s*2 + 21s - 17. Let b(t) = 4t3 + 83t*2 - 5t + 4. Give 25b(z) + 6h(z). -2z3 + 77z*2 + z - 2 Let d(m) = -13m*3 - 21m*2 - 2m - 3. Let g(q) = 130q3 + 210q*2 + 21q + 32. Calculate 21d(k) + 2g(k). -13k3 - 21k*2 + 1 Let d be 6((-30)/(-8))/1540/(-15). Let h(l) = -2l + 26. Let g(f) = -3f + 27. Calculate dg(n) + 5h(n). 2n + 22 Let l(n) = -14n3 + 23n*2 - 26n + 14. Suppose 2g = 444r - 445r + 29, -4g + 73 = -r. Let z(w) = -5w3 + 8w*2 - 9w + 5. What is gz(v) - 6l(v)? -v*3 - 2v*2 + 3v + 1 Let s(b) = 4b3 + 3b*2 + 15b - 135. Let v(l) = -5l3 - 4l*2 - 17l + 136. Determine 4s(g) + 3v(g). g*3 + 9g - 132 Let p(x) = -239875x2 + 119941x*2 - x + 119935x2 - x3 - 1. Let r(l) = 3l3 - 5l*2 + 5l + 13. Calculate -5p(f) - r(f). 2f3 - 8 Let d(n) = -n2 - 85n + 2. Let u(f) = -3f*2 - 173f + 3. Give -5d(p) + 2u(p). -p*2 + 79p - 4 Let y(p) = -67p3 - 3p*2 + 3p + 23. Let x(j) = -25j3 - j2 + j + 8. Determine 8x(d) - 3y(d). d3 + d2 - d - 5 Let u(f) = -332f - 317f - 318f + 8 + 971f - 3. Let p(m) = -2m + 11. Let b(y) = 3y - 21. Let a(h) = -5b(h) - 9p(h). Give -5a(j) + 4u(j). j - 10 Let d(w) = 23 - 61 + 13 + 28. Let x(z) = z + 4. Give 3d(h) - 2x(h). -2h + 1 Let g(v) = 2v2 - 9v + 3. Let m(y) = y*3 + 6y*2 + 7y + 2. Let f be m(-3). Let p(d) = -13d2 + 0d*2 + 10d*2 + 14d - 5. Give fg(b) + 5p(b). b*2 - 2b - 1 Let l(g) be the second derivative of -2g4/3 - 7g*3/6 + 3g*2/2 - 1508g. Let d(j) = j*2 + j. Give -14d(o) - 2l(o). 2o*2 - 6 Let j = 6532 + -6529. Let f(h) = -4h*2 + 2h + 3. Let v(b) = 4b2 - 3b - 4. Determine jv(y) + 4f(y). -4y2 - y Let b(o) = 5o - 4. Suppose -12m = 66 - 6. Let h(k) = 6864k - 6868k + 2 + 2. Determine mb(y) - 6h(y). -y - 4 Let j = -6 + 12. Let u(i) = -3i + 53 - 53 + 3i + 5i. Let m(t) = 6t + 1. What is jm(c) - 7u(c)? c + 6 Let k(d) = 3d + 63. Let i(a) = 16a + 320. Calculate -5i(s) + 24k(s). -8s - 88 Let r be 0/23(1 - (-3)/(-2)). Let q(f) = -144f + 1 + r + 150f - 2. Let i(t) = -7t + 2. Calculate -2i(h) - 3q(h). -4h - 1 Let k(v) = -v - 8. Let l(u) = -63. Let w(a) = 142. Let t(y) = 9l(y) + 4w(y). Determine k(b) + 5t(b). -b - 3 Let i(o) = -3o3 - 3o*2 - 3. Suppose -4x = 27 - 3. Let b = 1 + x. Let m(s) = -7s3 - 5s*2 - 5. Give bi(r) + 3m(r). -6r3 Let u(r) = -r3. Let h(g) = -9g3 - 2g*2 + 3g + 1. Suppose 0 = 36y - 1183 + 967. Give yu(n) - h(n). 3n3 + 2n*2 - 3n - 1 Let j = 174 - 165. Suppose -x = -4x + j. Let v(o) = -o2 + 3. Let s(r) = 12r*2 - 32. Calculate xs(t) + 32v(t). 4t*2 Let w(y) = -2y*3 - 7y*2 - 2y - 6. Let x(j) = 2j3 + 8j*2 + 3j + 7. Suppose 1017 = 23p + 1132. Calculate px(c) - 6w(c). 2c*3 + 2c*2 - 3c + 1 Let x(o) = -3o + 4. Let j(k) = k - 1. Suppose z + 33 = 3b + 37, 0 = 3z - 2b + 9. Calculate zj(w) - x(w). -2w + 1 Let m(u) = 89u - 173. Let s be m(2). Let i(q) = -1. Let d(v) = -13v - 7. Give si(c) - d(c). 13c + 2 Let i(c) = -4c2 + 9c + 5. Let d(v) = -4v2 + 9v + 6. Suppose 5j - 3s = 9j, 0 = -j - 5s - 34. Determine jd(y) - 7i(y). 4y2 - 9y + 1 Let s(f) = -2f3 + 18f*2 - 9f - 5. Let j(v) = -2v3 + 17v*2 - 9v - 4. Give 6j(o) - 5s(o). -2o3 + 12o*2 - 9o + 1 Let y(c) = -c3 + c2 + 5c - 6. Let l be 22 - (-33 - (-380)/19). Let i(w) = 3w3 - 3w*2 - 15w + 17. What is ly(b) + 6i(b)? b3 - b2 - 5b Let u(j) = 111j + 85. Let h(b) = -336b - 255. What is 5h(v) + 14u(v)? -126v - 85 Let q be 171/27 + 4/(-12). Let i(r) = -82r - 6. Let x(k) = -247k - 19. Give qx(c) - 19i(c). 76c Let m(j) = -j3 + j2 + 1. Let x(r) = 3r3 - r2 - r - 3. Let c = 27 - 28. Let b be ((-2 - 3 - c) + 2)/2. Calculate bx(a) - m(a). -2a*3 + a + 2 Let n(k) = -1590k + 8. Let s(g) = 3179g - 18. Determine -7n(u) - 3s(u). 1593u - 2 Let g(f) = 146f3 + 2 - 376f*3 + 2f + 231f3 + f2. Let p(c) = 4c*3 + 5c*2 + 9c + 9. Determine -9g(h) + 2p(h). -h3 + h2 Let b(s) = -402s3 + 14s*2 + 5s. Let d(y) = 199y3 - 7y*2 - 2y. Calculate 2b(x) + 5d(x). 191x3 - 7x*2 Let q(o) = -38o + 17. Let p(t) = 13t - 6. Suppose -11d = -9d - 460. Suppose dr - 55 = 235r. What is rp(c) - 4q(c)? 9c - 2 Let l(k) = 73395k3 - 11k + 11. Let u(o) = 58716o3 - 9o + 9. What is -9l(h) + 11u(h)? -14679h3 Let v(w) = -377w*3 + 9w*2 + w - 4. Let r(n) = -378n*3 + 6n*2 + n - 3. Give -4r(k) + 3*v(k). 3	{ "pile_set_name": "DM Mathematics" }
(8/7) assuming t is positive. t(-2) Simplify (o/o(-1/18)o)(-22)((oo((((oo(4/7)o)/o)/o)/oo)/oo)/o)(-46) assuming o is positive. o(-7403/63) Simplify (hh/(hhh(2/5)))(-7/6)/(h(3/28)hhh*(-25)h) assuming h is positive. h(9391/420) Simplify (n(1/17)/n)/n(n(5/8)/n)/nnn(-7)n*(-26)n assuming n is positive. n(-4667/136) Simplify ((d(-1/9)d)/(dd*(8/13)/dd))/(d*(2/9)dd)(-17) assuming d is positive. d(1445/39) Simplify ((o/(ooo(2/31)o))/(o*(-15)o))(-33) assuming o is positive. o(-12210/31) Simplify ((q(q/q0)/qq)/(q/(q/q*(-16/3))q))10 assuming q is positive. q(190/3) Simplify i*(5/2)i*(-5/2)i(i(-15)/i)/i(-13) assuming i is positive. i(-2) Simplify ((l(2/3)l)21/(l4/((ll(-5))/l)))(-41) assuming l is positive. l(-1066) Simplify (g4ggg*(2/29))/(g/(gg*(-4/11))g1/g) assuming g is positive. g(1820/319) Simplify b/(b/(b/((bb(-2/9))/b))b)b(-7)/bbbb*(7/3)b(-1/5) assuming b is positive. b(-164/45) Simplify ((((rr/r7rr)/r)/r)/((r/((r(2/7)/r)/rr)r)/r))/(((rr(-1/11))/r)/(r(-4/17)/r)) assuming r is positive. r*(-10287/1309) Simplify (h(hh(4/5))/h(hhh*0/h)/h(h(1/2))(-2/9))22 assuming h is positive. h(1672/45) Simplify ((((s/((((s/s*(4/3))/s)/s)/sss))/s)/ss4)50)11 assuming s is positive. s(7150/3) Simplify ((mmmmm/(mm20)m)/m(1/4))/(m(-1/5)/m(-3)) assuming m is positive. m(-361/20) Simplify (p1/(p(2/7)p))/(p(2/5)p)29 assuming p is positive. p(-1431/35) Simplify ((j(j/j(-10))/jj)/(j/(jj(-13))j))/((jjj*(-7/5)/j)/jj/(j*(-15)j)) assuming j is positive. j(-78/5) Simplify (((w/(w/w(1/3)w))/(www(-6)w))/(w/(ww(1/2)))6)38 assuming w is positive. w(608/3) Simplify (u/u(-17)u)/(u*(-12)u)u3uuu(-3) assuming u is positive. u32 Simplify t*(-8)/tt*5t(tt/(tt7))(-1/71) assuming t is positive. t(-207/71) Simplify ((b(2/9))(-2/7)(b2)(13/6))(-2/91) assuming b is positive. b(-538/5733) Simplify (((p/(p/(p*(1/3)/p)))/pp(-1/3))/(p/(p2p))(-2/97))(-13/3) assuming p is positive. p(858/97) Simplify ((dd/d(-12/13))/d)/(d(2/27)/d)(d(18/5)d)(-10/3) assuming d is positive. d(-4382/351) Simplify ((qq/(((qqq0)/q)/q))/q)(-39)(q(-2/5))(3/5) assuming q is positive. q(-981/25) Simplify (h(-7/6)h/(hh/(h/h(-20/9))))(-2/7) assuming h is positive. h*(-19/63) Simplify (g/(g(g((gg/g*(-2/11))/g)/gg)/gg))(27/4)/((gg*19g)/((gg(3/7))/g)) assuming g is positive. g(-2718/77) Simplify (((n(n/(nn/(n/n(-1/5))))/nn)/n)19/((n(-2/13)/n)/n(-9)))(-8/3) assuming n is positive. n(2104/195) Simplify ((t0tt(-1))/(t(1/3)/(tt(-1/5)t)))(-38) assuming t is positive. t(-836/15) Simplify (zz28)(-6/5)/(zz/(z/(z(z(5/3)z)/z)))(-4/11) assuming z is positive. z(-502/15) Simplify (s((s/(s/s(10/3))s)/s)/ss/s(2/27))(-49) assuming s is positive. s(-5635/27) Simplify (m(-2/29))(-4)m/m*(2/69)mm(-6/7)m assuming m is positive. m*(33473/14007) Simplify ((q/(qq/(qq(-2/23))))/(q/q(-2/9))(q(-1/4))(-3/19))(4/7) assuming q is positive. q(-19975/27531) Simplify (h(-8))(-45)/((h*(-6/5)h)/((h(h/h(11/5))/h)/h)) assuming h is positive. h358 Simplify (c26/c)/(c/((c/c9)/cc))(c/(cc*(-9)))/(c/(cc(-19))) assuming c is positive. c6 Simplify (x(-2))(-34)/((xx(-15)/xx)/((x*(-2/7)x)/x)) assuming x is positive. x*(572/7) Simplify (gg*5g(-14))/(g(-1/8)ggg(9/2)) assuming g is positive. g(-115/8) Simplify (((m7/m)/m(-11))37)(-7/9) assuming m is positive. m(-4403/9) Simplify (r/((rr*4)/r)r/r*(-1/4)(rr/r(-2/5)r)29)(-4/31) assuming r is positive. r*(-1937/155) Simplify (p/(pp/((pp/(p32p))/p))pp*(2/107))/(pp*31p(-2)) assuming p is positive. p(-6632/107) Simplify (d*(2/7)d*(-35)d)9 assuming d is positive. d(-2124/7) Simplify ((y(y/(yy*(3/8)yyy))/yy)/((y/((y/y9)/y))/y)yy/(yy*(4/5)y)yyyy(-2/7))(3/4) assuming y is positive. y(-7947/1120) Simplify o(-4)/o*(-6)oo(-7)o/(o/(o*(-11)o)) assuming o is positive. o(-14) Simplify (h(-2/5))*(-20/7)(h(-1/11)/h)22 assuming h is positive. h(-160/7) Simplify (a/(a/a(4/19))a(-5/11)/a)/(a19/(a/(a/((a/a(-31))/a)))) assuming a is positive. a(2248/209) Simplify ((zz(-2/15))/z)/(z(2/23)/z)z/z11z(4/9)/z assuming z is positive. z(-10118/1035) Simplify (b*(-8)bb0b(((b((b*(-2)bb)/b)/b)/b)/bb)(-5/11))19 assuming b is positive. b(-1064/11) Simplify (p(-2/19))*(-27)(((pp/(p/(pp/((p*14p)/p)p)))/p)/p)(10/9) assuming p is positive. p(-598/57) Simplify ((oo/(o/(oo/(o/(o(-3/8)/o))o)))/o(o6/o)/o)/(o(-1/2)o)0 assuming o is positive. o(37/8) Simplify bb(1/10)bbbbb*(-2/19)(b/(((b/(b*(-1)b))/b)/bbb))33 assuming b is positive. b(949/190) Simplify ((g/g*(-2/5)g)/(gg(g/g*1)/g))/(gg*(5/4)gg(-12)g) assuming g is positive. g*(183/20) Simplify (ww*(-6/13)wwwww/(ww(-15))wwww)11 assuming w is positive. w(3366/13) Simplify (l(-3/2)l(l/(l/(l(ll(-3/13))/l))l)/l)/(((l*(-2)/l)/l)/lll7l) assuming l is positive. l(-97/26) Simplify o20/(o*(3/4)oo)((oo3)/o)(-25) assuming o is positive. o(-231/4) Simplify ((((jj*(-4/11))/jj)/j)/(j*(4/11)j))/((jj23j)/(j/((j/(jjj*7))/jj))) assuming j is positive. j*(-195/11) Simplify ((kk(2/77))(-19))(-4/5) assuming k is positive. k(6004/385) Simplify (b/b*(-2/31)bb/b8b)(-2/81) assuming b is positive. b(244/2511) Simplify f/(f(f((ff/(f/(f(-7/2)f)))/f)/f)/f)f(1/14)f*(-7)fff*(3/5)f assuming f is positive. f(6/35) Simplify (((x(-2/5)/x)(-1/47))(3/4))(-17) assuming x is positive. x(-357/940) Simplify q*11q*11qqq*(-16)(q/(q/(q*16q)))/q assuming q is positive. q*24 Simplify (((w((w*(11/3)w)/w)/w)/w)/w(-22))/(w/w3)(-21) assuming w is positive. w(-52/3) Simplify ss/((s/s(-1))/s)ss/(s/s(-5))(ss/(s/(s/(ss/((sss/(s(1/5)/s))/s)))))/(((s/(s(1/4)/s))/s)/sss) assuming s is positive. s*(-39/20) Simplify ((((p/((pp/(pp(p/p*(-9)pp)/pp)p)/p)p)/p)/(p/(pp(3/7))))/(p/(p/(((p(1/5)p)/p)/p))p)(-2/21))(2/85) assuming p is positive. p(2824/8925) Simplify (uu*(6/13)u)9/(u/((((u/(u13u))/uu)/uu)/u)u*(-4/23)u) assuming u is positive. u(1892/299) Simplify (((((b4/bb)/b)/b)/b)/(b(-22)b))/(b(-4/5))23 assuming b is positive. b*(202/5) Simplify (((x/(xx/x(5/6)))49)(-1/12))(-6/5) assuming x is positive. x*(-49/60) Simplify (nn/n*(2/13)(n/(nnn*(-3/2)nnn))/n(n0)(8/11))15 assuming n is positive. n(-645/26) Simplify (j((j(-1/4)/j)/j)/j)49/((jjj*(1/4)jj)/jjj)(-8) assuming j is positive. j(-273/4) Simplify (((v(-3)vv)/v)(-35))(-41) assuming v is positive. v(-2870) Simplify n(-2/37)n/n*6nnn*24/n((n*(-16)/nn)/n)/nn assuming n is positive. n(109/37) Simplify ((j/(jjj(-9))j(jj*(-7)/j)/jj)7)12 assuming j is positive. j*168 Simplify (((ii*(2/9)i)26)(2/17))35 assuming i is positive. i(36400/153) Simplify (g*(3/2)/gg)*39(g/((g/(g/(gg2)))/g))(-40) assuming g is positive. g(197/2) Simplify ((((l/((ll(-5/6)/l)/l))/l)/l1)(10/21))(3/7) assuming l is positive. l(25/147) Simplify (g/(g3g))(3/7)gg(3/7)ggg/g(-1/4) assuming g is positive. g(95/28) Simplify (a*(2/21)/aa(aa/(aa(13/4))a)/a)(1/26) assuming a is positive. a(-181/2184) Simplify (g/g*(1/5)g*(1/9)(gg(-9)g)/(gg(-3/5)g))(10/7) assuming g is positive. g(-674/63) Simplify (j/((jj(-6/13))/j)j/(jj(-3)))/(j(1/2)j4) assuming j is positive. j(-1/26) Simplify (qq(8/7)qq25q)(13/3) assuming q is positive. q(884/7) Simplify (o*(2/3)o/(o/(o/o*(-10/11))o)o)7 assuming o is positive. o(595/33) Simplify (k1)(-48)/(k5/(k(-7)k)) assuming k is positive. k(-59) Simplify (t(-1/21)/((t/(t/((t((t15/tt)/t)/t)/t))t)/ttt))(2/71) assuming t is positive. t(-632/1491) Simplify (((s(s/s(2/45))/s)/s)/s(12/7))/(((s	{ "pile_set_name": "DM Mathematics" }
Let u be (-6)/(-6) + -2 + 3. Suppose 5r + 0z - z = 326, -ur + 2z + 124 = 0. What is the tens digit of r? 6 Suppose 0 = s - 1 - 5. Let n be -42/4 + s. Suppose -nt - t + 75 = 0. What is the units digit of t? 5 Let g = 15 - 21. Let y(m) = 11m + 2. Let a(l) = -12l - 2. Let b(o) = -4a(o) - 5y(o). What is the units digit of b(g)? 0 What is the thousands digit of 3736/69/2412? 2 Suppose 3t - 2j = 5177, -7t + 2j - 6912 = -11t. What is the hundreds digit of t? 7 Suppose 0n - j + 1235 = 4n, -3n + 5j + 932 = 0. Let a = n - 96. What is the tens digit of a? 1 Let q(b) = 15b*2 + 29b - 11. Let p be q(-10). Suppose 943 + p = 9l. What is the hundreds digit of l? 2 Suppose -30 = -4g - 22. Let i = g - -206. What is the hundreds digit of i? 2 Let p = -26 - -61. Suppose -5g - 34 = 3h, 4h - 43 = g - 119. Let y = h + p. What is the tens digit of y? 1 Let z = -137 - -77. What is the units digit of 3 - (z + -3 + 2)? 4 Let r be 11 + -8 + -31. Suppose r = 5i - 2i + 30. Let b(c) = -c*3 - 10c*2 + 2. What is the units digit of b(i)? 2 Let g(d) = 19d*3 - 3d*2 + 3d - 4. What is the units digit of g(5)? 1 Let k(m) = -m*3 - 9m*2 - 9m - 3. Let q be k(-8). Suppose -4x - f - 11 = -q, -3 = -3x + 3f. Let w = x - -10. What is the units digit of w? 9 Let o(m) = -m3 - 52m*2 + 6m - 152. What is the tens digit of o(-53)? 3 Let m(k) = k*2 - 3k - 4. Let s be m(4). Suppose -h + 0h = s. Suppose h = j - 4f - 26, 4f - 78 = j - 4j. What is the units digit of j? 6 Suppose 0 = o - j - 718, -5j - 1044 = -o - 318. What is the tens digit of o? 1 Suppose 0 = 5l - 14l + 459. Suppose 5p + 0p - 229 = q, -p = 5q - l. What is the tens digit of p? 4 Suppose 0 = 2u + t - 282, -u + t + 95 = -52. Suppose -5r + u = -987. What is the units digit of r? 6 Suppose -392 = 3k + o, -k = -7o + 3o + 135. Let x = -88 - k. What is the units digit of x? 3 Let a = 4 + -2. Let t(j) = -5 - 5j - 8j + ja + 11j. What is the units digit of t(7)? 0 Suppose 5k - 1026 = -i, k - 3k + 1032 = i. What is the tens digit of i? 3 Suppose -h - 3 = 3j, 0h + 4j = 2h - 4. Suppose -o - 19 = -4m, ho = -o + 5. Let b(d) = 2d2 - 7d - 7. What is the tens digit of b(m)? 2 Let g(y) = -2 + 9y3 + 5 + 0y*2 - 10y*3 + 3y + y2. Let w be g(4). Let i = w + 62. What is the units digit of i? 9 Let n(s) be the second derivative of -s3/6 + 6s2 + 5s. Let v be (44/(-20))/((-2)/10). What is the units digit of n(v)? 1 What is the hundreds digit of -20 - -21 - 1-5318? 3 Let m(k) = 2k*2 + 4k + 5. Let q be m(-2). Suppose qy - 309 + 79 = 0. What is the tens digit of y? 4 Suppose 5c - c - 4 = -3u, 0 = 3u + 3c - 6. Suppose 4f - 6f - 5t + 347 = 0, -uf + 661 = -t. What is the hundreds digit of f? 1 Let o(l) = 11l - 7. Suppose 28 = 3v + h, -v + 2h = -0v - 14. Suppose -7i + vi = 12. What is the tens digit of o(i)? 3 Let u(p) = p - 4. Let x be u(-4). Let o = 114 + x. What is the tens digit of o? 0 Suppose 24 = 5j - j. Let h(c) = -c*3 + 5c*2 + 6c + 1. Let u be h(j). Suppose 0 = 4z - 69 + u. What is the units digit of z? 7 Suppose 5h - 1 = -q + 7, -2 = h + 2q. Suppose r + 4r = -hm + 331, -2r = 4m - 126. What is the units digit of r? 7 Suppose -4c - 27 = -y - 0y, -2 = -c + 2y. Let b = c + 11. Suppose 70 = 2t - t + 3l, -l = b. What is the tens digit of t? 7 Let d = -166 + 326. Suppose -4g - 3u + 625 = 0, -2g - u - d = -471. What is the hundreds digit of g? 1 What is the hundreds digit of ((-1608)/9)/(1/(-3))? 5 Let u be 2/(-4)-10-1. Let g(r) = 3r3 + r2 + 5r - 44. Let k(q) = -q3 - 2q + 15. Let w(h) = 6g(h) + 17k(h). What is the tens digit of w(u)? 3 Let n(m) = 0m + 4m + 21 + 2m + 2m. What is the units digit of n(4)? 3 What is the hundreds digit of (-14840)/(-15) + 1 - 2/6? 9 Let z(n) = n*2 + 5n - 12. Let c be z(-9). Suppose 4s - c = s. Let j = 24 - s. What is the units digit of j? 6 Suppose 0j - j + 88 = 0. Let a = -42 + j. What is the tens digit of a? 4 Let l(u) = -u*3 - 5u*2 + 8u + 5. Let q be l(-6). Let s(i) = i*3 + 8i*2 + 4i - 16. What is the units digit of s(q)? 5 Suppose 114 = 5k - 31. What is the units digit of k? 9 Let l(v) = 97v + 38. What is the tens digit of l(7)? 1 Let q be 10/(-4)((-53)/5 + -3). Suppose -qo - 230 = -36o. What is the hundreds digit of o? 1 Let k(r) = 3r*2 - 3r - 3. Suppose -10i + 6i = 12. Let n(l) = l*2 - l - 7. Let o be n(i). What is the units digit of k(o)? 7 Suppose 3i - 30 = -3i. Let q = -1 - -1. Suppose -iw = -qw - 60. What is the units digit of w? 2 Let z(o) = 209o - 314. What is the thousands digit of z(15)? 2 Suppose 1 - 26 = -2x - 5l, -3l = -15. Suppose -5d - d + 144 = x. What is the units digit of d? 4 What is the tens digit of -238((-343)/(-14))/(-7)? 3 Suppose -3u = 9, f + 4f - 4222 = 4u. What is the tens digit of -32/36 - f/(-12)? 7 Suppose -22b + 19440 = 5b. What is the units digit of b? 0 Let i(x) = -2x*2 - 5x + 809. Let w be i(0). What is the tens digit of (-19)/76 - w/(-4)? 0 Let z(f) = -17f - 11f + 12f. Let c be (-2)/3 - 1/3. What is the tens digit of z(c)? 1 Suppose -12q = -5q - 1260. What is the tens digit of q? 8 Suppose -4w - 2c + 1198 = -4c, w = -c + 298. Suppose 3k - w = 5m, 2m - 521 = -5k - m. What is the tens digit of k? 0 Let r(q) = 22q2 + 19q - 14. What is the units digit of r(6)? 2 Let m(x) = 63x2 + 2x - 57. What is the units digit of m(5)? 8 Let m(n) = n*3 + 4n*2 + 3n + 1. Let k be m(-2). Let c = -84 - -128. Let j = c - k. What is the tens digit of j? 4 Suppose 83q + 59299 = 102q. What is the thousands digit of q? 3 Let i = -10 - -13. Suppose d - 38 = 4f - 17, 5f + 5 = -3d. Suppose u - 27 = -dk - 0k, 0 = iu - 2k - 13. What is the units digit of u? 7 Let h(q) = -q3 - 10q*2 + 3. Let r be h(-10). Suppose 5j - 3i = -i + 239, rj = -2i + 153. What is the units digit of j? 9 Suppose -5q + 2320 = l - 3l, -3q + 3l = -1383. Let h = -197 + q. What is the hundreds digit of h? 2 Let i(j) = j + 4. Let x = -18 + 27. Let n be i(x). Let q = 28 - n. What is the units digit of q? 5 Suppose -34f + 17523 = -7f. What is the units digit of f? 9 Let g = 52 - 61. Let x(l) = -l2 - 16l + 11. What is the tens digit of x(g)? 7 Suppose 6g - 5c + 1380 = 11g, 4g + c - 1113 = 0. What is the hundreds digit of g? 2 Let s(x) = x*3 + 15x*2 + 3x - 13. Let t be s(-15). Let r = 22 - t. Suppose -r - 45 = -5o. What is the tens digit of o? 2 Suppose p + 2r = -16 - 3, 7 = -3p + 4r. What is the units digit of -2 - ((-1 - 1) + -2) - p? 1 Let g be 4/((-3)/(-3) + 0). Let r be (2 + 0)/(g/40). Suppose -95 = -ri + 15i. What is the units digit of i? 9 Suppose 617 = -16x + 2073. What is the tens digit of x? 9 Let a(b) = -b3 + 10b*2 + 6b - 17. Let m = 86 + -77. What is the units digit of a(m)? 8 Let w = 27 + -31. What is the tens digit of 0 - -4 - 118/w2? 6 Let h = 22 - 17. Suppose 396 = 3k - w, -3w + w = hk - 660. What is the tens digit of k? 3 Let k(o) = -38 - 2o - 12o + 0o. What is the tens digit of k(-10)? 0 Let z(c) = -c3 + 3c*2 - 2c + 169. Let o(w) = 2w2 - 20w - 22. Let p be o(11). What is the tens digit of z(p)? 6 Let x = 195 - 117. Let m = x + -12. What is the units digit of m? 6 Let f = 1632 - 932. What is the hundreds digit of f? 7 Let x = 1225 - -346. What is the tens digit of x? 7 Suppose 32i - 2 = 3326. What is the units digit of i? 4 Let z(t) = 1. Let x(i) = i - 6. Let w(l) = -2x(l) - 4z(l). Let q = -47 + 47. What is the units digit of w(q)? 8 Let c(f) be the second derivative of f7/2520 - f5/60 - f4/2 - 3f. Let v(j) be the third derivative of c(j). What is the units digit of v(-2)? 2 Let d = 747 + -447. What is the tens digit of d? 0 Suppose 4q - 2f + 0 = 16, -2q - f + 4 = 0. What is the tens digit of 69 + q/(9/(-3))? 6 What is the hundreds digit of 72 + 706 - (-2 - 0)/2? 7 Let z(m) be the third derivative of -m6/120 + m5/6 - 5m*4/12 + 5m*3/6 - 40m*2. What is the units digit of z(5)? 0 Let p be (-4 + -1)(-424)/(-20). Let f = 227 + p. What is the tens digit of f? 2 Suppose 2454 = 2w - 2424. What is the tens digit of w? 3 Suppose -d - 14 = 2h + 2h, -2d = -4h - 8. Let s be (12/d)/(-2 + 0). Suppose sl - 9 = -0*l. What is the units digit of l? 3 Suppo	{ "pile_set_name": "DM Mathematics" }
pose 0 = 18l + rl - 1450. Calculate the remainder when l is divided by 3. 2 Let m = 179 + 85. Suppose m = 19y - 13y. Calculate the remainder when y is divided by 4. 0 Suppose -110d + 98d + 504 = 0. Calculate the remainder when 3400 is divided by d. 40 Suppose 3m = -4k + 233 + 43, -4k + 368 = 4m. Calculate the remainder when 233 is divided by m. 49 Let l(n) = -163n + 1209. Let w(p) = p3 - 8p*2 - 7p + 1. What is the remainder when l(7) is divided by w(9)? 11 Let d be 3 + -1(-241 + (1 - -4)). Let h = -185 + d. Calculate the remainder when h is divided by 31. 23 Let i = 4517 + -4480. Calculate the remainder when 1061 is divided by i. 25 Suppose 66 = n + 5u, 0 = -n + 3u + u + 21. Calculate the remainder when 832 is divided by n. 12 Suppose -185 = 2a - 4m + 985, a = 4m - 583. Let h = a - -656. Calculate the remainder when 137 is divided by h. 68 Suppose -547j + 235116 = -1463319. What is the remainder when j is divided by 61? 55 Let g(f) = 2f*3 - 27f*2 - 11f + 11. Calculate the remainder when g(14) is divided by -4(-18)/4 - -1. 15 Let k be (-6 + (-9)/(-2))/(6/(-1720)). Suppose 0 = -8r + 186 + k. What is the remainder when r is divided by 42? 35 Suppose -2y = 0, -t + y + 115 = 4t. Let j(h) = 2h + 5h + 11 - 25 - 51. What is the remainder when j(22) is divided by t? 20 Let r be 0 - -4 - (-2 - -4). Let j(m) = -2m2 - 6 - 13 + 4m*r - 1. Calculate the remainder when j(-5) is divided by 15. 0 Let j = 5 + -5. Let q(d) = jd + 20d2 - 3d*3 + 0d + 2d3 + d - 13. Calculate the remainder when 41 is divided by q(20). 6 Let y = -671 - -681. Calculate the remainder when 607 is divided by y. 7 Let f = 25256 - 25217. What is the remainder when 1520 is divided by f? 38 Suppose w + 4u - 7 - 3 = 0, -2w - u = -41. Suppose 3n + 2h = -h + 3855, -4h = 5n - 6421. What is the remainder when n/15 - (-2)/(-5) is divided by w? 19 Let h(j) = 12j - 2. Let o(a) = 5a - 8. Let i = -93 + 103. What is the remainder when o(i) is divided by h(2)? 20 Let w(n) = -n3 - 8n*2 + 36n + 34. What is the remainder when 254 is divided by w(-11)? 0 Let j(d) = -109d + 36. Let q be j(-6). Suppose 67z = -2z + q. Calculate the remainder when (1-3)/((-1)/13) is divided by z. 9 Let a be 69/12 - 3 - 2/(-8). Suppose ay - r + 50 = 0, 0r - r + 34 = -2y. Let c(g) = 3g + 55. Calculate the remainder when 68 is divided by c(y). 5 Let o(n) = 3n2 + n + 2. Suppose 6s + 1 + 5 = 0. Let g be o(s). Suppose -3x - 95 = -gx. What is the remainder when x is divided by 14? 11 Let o(q) = 3q + 4. Let l = 267 - 277. What is the remainder when (12/l)/(96/(-4480)) is divided by o(4)? 8 Let y(g) = 0g + 9g2 - 755 + 11g*2 + 711 - 19g. What is the remainder when y(-2) is divided by 15? 14 Suppose 4300 = 2h - 6576. Suppose 40x - 6002 = h. What is the remainder when x is divided by 48? 46 Let a = 4460 - 4374. What is the remainder when 155 is divided by a? 69 What is the remainder when 834 is divided by (-6)/((-465)/420 - -1)? 50 Suppose -6f + 14 = -4f. Suppose -24 - 26 = -5b - 2v, 2v + 6 = 2b. What is the remainder when b is divided by f? 1 Let x(k) = -29k - 3. Let q = 2799 + -2644. What is the remainder when q is divided by x(-2)? 45 Suppose -22f + 1849 = 21f. What is the remainder when (-165)/(-1) + (-4)/(1 - 5) is divided by f? 37 Suppose 99t - 101t - 128 = -2p, 12 = -4t. Calculate the remainder when 293 is divided by p. 49 Let z = -47 - -56. Let x be ((-12)/z)/(4/18). What is the remainder when 43 is divided by x155/(-15)? 21 Suppose 56d - 18 - 167 = 51d. What is the remainder when 219 is divided by d? 34 Let y = 3952 + -3302. What is the remainder when y is divided by 109? 105 Calculate the remainder when 1120 is divided by 15/(-18)(-87 + -195). 180 Let d be (-4 + 7 - (-58)/10)-5. Let z = -36 - d. Suppose 117 + 147 = zk. What is the remainder when k is divided by 7? 5 Let o(w) = 212w2 - 92w - 353. What is the remainder when o(-4) is divided by 24? 23 Let b(k) = 95k3 + 5k*2 - 6k + 3. Let p = 6 + 45. What is the remainder when b(1) is divided by p? 46 Suppose -g - 76 = 5w, 158 = -12g + 9g - w. Calculate the remainder when 100 is divided by g/((3/(-5))/((-18)/(-45))). 32 Let v = -26431 - -26452. What is the remainder when 1760 is divided by v? 17 Let r = 2407 - 1610. What is the remainder when r is divided by 101? 90 Let u(j) = -j2 + 17j + 27. Let y(z) = 8z + 7. Calculate the remainder when u(15) is divided by y(2). 11 Let f(q) = 2q*2 + 10q + 15. Let y be f(-2). Suppose -yd + 3u + 207 = 0, 6d - 5d - 2u - 74 = 0. Calculate the remainder when d is divided by 34. 30 Let c(s) be the third derivative of 0s + 0 + 1/30s5 - 35/24s*4 + 8/3s*3 + 36s2. What is the remainder when 135 is divided by c(18)? 33 Let s = -12 - -6. What is the remainder when 2/s + (-1855)/(-21) is divided by ((-1530)/(-68) - 20)/((-1)/(-10))? 13 Let s(q) = -q2 + 37q - 169. Suppose 2912 = 69v - 53v. What is the remainder when v is divided by s(31)? 12 Let m(y) = 15y*2 + 17y + 3. Let k be m(-4). Suppose 5d + 5a - k = 95, -3d + 5a = -170. Calculate the remainder when 67 is divided by d. 12 Let q be (8/(-12))/((-3)/(594/12)). Suppose 3l = 5w + q, 2l + 0w - 20 = -3w. What is the remainder when l is divided by 7? 0 Let f(k) = 33k + 949. Let j = 134 + 12. What is the remainder when j is divided by f(-28)? 21 Let k(o) be the first derivative of o*3/3 - 22. Let w(g) = 7g*2 + 21g + 26. Let b(d) = 6k(d) - w(d). What is the remainder when b(-19) is divided by 3? 0 Let f = -3965 + 3989. What is the remainder when 740 is divided by f? 20 Let x(m) = 7m - 19. Let n be 4 + -2 + 6 + -6. Let k = n + 141. Calculate the remainder when k is divided by x(8). 32 Let d be 163/(-5) - 21/(-35). What is the remainder when 22 is divided by 16/48 - d/3? 0 Let h = 14805 + -14676. What is the remainder when 3992 is divided by h? 122 Suppose -12a = -51 - 321. Calculate the remainder when 236 is divided by a. 19 Let h(u) = u3 + 16u*2 - 24u - 34. Let g(w) = -2w - 5. Let m be g(-5). What is the remainder when h(-17) is divided by (-342)/(-15) + (-4)/m? 19 Let q = 29 + -5. Let p(k) = -2k + 57. Let m be p(q). Suppose -93 = -mx + 33. Calculate the remainder when 41 is divided by x. 13 What is the remainder when 3891 is divided by (4 + 1 + (-50)/5)34/(-10)? 15 Suppose 14c - 58 = 157 + 1297. Calculate the remainder when 1079 is divided by c. 107 Suppose -71750 - 12079 = -15v - 12954. Calculate the remainder when v is divided by 24. 21 Let n = 23006 + -22942. What is the remainder when 2419 is divided by n? 51 Suppose -23008 = -42c - 11453 + 27295. What is the remainder when c is divided by 187? 177 Suppose -8m + 1640 = -1496. Suppose 4u = 6u + 5t - m, 3u = 2t + 569. What is the remainder when u is divided by 49? 44 Suppose -4p = 5s + 2s - 175, 4s - 100 = -5p. Calculate the remainder when 8871 is divided by s. 21 Let n = -314 - -482. What is the remainder when n is divided by 81? 6 Let g = -2575 + 3391. Calculate the remainder when g is divided by 73. 13 Let g be 2 - ((-72)/3 + 0). Let o = g + -23. Suppose -ou + 20 = -4j, -4u + 3j = -u - 18. What is the remainder when u is divided by 4? 0 Let q = 582 - 306. Calculate the remainder when q is divided by 28. 24 Suppose 0 = -19d + 21d - 242. Let h = 198 - d. Calculate the remainder when 382 is divided by h. 74 Let v = -641 + 661. Let t be 155/((-30)/(-4)). Let f = v - t. Calculate the remainder when f is divided by 4. 2 Suppose -23s + 20s = -3b + 786, -8 = -2s. What is the remainder when b is divided by 34? 28 Let p = -4895 - -5192. Calculate the remainder when p is divided by 55. 22 Let n = 4767 - 4739. What is the remainder when n is divided by 27? 1 Let l(n) be the second derivative of n4/12 - n3/3 + 2n*2 + 15n - 3. Let h(d) = -12d + 1. What is the remainder when h(-6) is divided by l(-3)? 16 What is the remainder when -217/(850/(-725)) is divided by (-6)/(-8) + 18/8? 2 Let w = -3175 + 3859. Calculate the remainder when w is divided by 15. 9 Suppose -3w - j + 87 = 0, 3w + 78j - 87 = 76j. Let t = -4 - 5. Let m = -1 - t. Calculate the remainder when w is divided by m. 5 Suppose 36x + 138 = 42x. Suppose xo - 6o - 2873 = 0. Calculate the remainder	{ "pile_set_name": "DM Mathematics" }
2 for a. -3 Let r = 8 - 6. Suppose 3 = -5g - u, rg - 4u = 9 + 3. Suppose -q - 4q = g. Solve 4j - j + w = 3, -j + 4w + 14 = q for j. 2 Let t = 4 + -2. Suppose -c - tc = -48. Suppose 2g + c = 6g. Solve 0 = 3z + 4x + 12, -gz + 1 - 4 = x for z. 0 Let h be (3 + -1 - 2)/1. Let x be h + 1 + 2 - -2. Suppose 3f = xo + 6, 5 = -f + 7. Solve -5q - 10 = -0q, o = -3g - 5q - 19 for g. -3 Suppose -4b + 8 = 4. Let c be (-9 - b)(-5)/10. Solve i + 3 = 2x, -cx + 13 = 4i - i for x. 2 Suppose 0 = 5w - 15. Suppose wr - r = 4. Solve -4i - rf - 2 = -2i, -2i + 4f = -22 for i. 3 Let y(p) = -p*3 - 7p*2 - 6p - 8. Let b be y(-6). Let a = -6 - b. Suppose -2s - s + 36 = 0. Solve -4r = -16, -4f = ar - 0r - s for f. 1 Suppose 5 = -4w + 33. Let h be (24/5)/(w/35). Solve -3v = 3l, -3v + 0v + 3l + h = 0 for v. 4 Suppose 4c = 26 - 10. Solve o + 15 = 2s, 4s + 0o = -co for s. 5 Let c(t) be the first derivative of 2t3/3 - 3. Let h be c(-1). Solve -d + 3a + 9 = 0, hd + a = 2 + 2 for d. 3 Suppose n = 3z + 2, -2n - 2n - z + 8 = 0. Solve 3g + na = 0, 8g - 3g - 2a = 0 for g. 0 Let z(n) = -n2 + 8n - 5. Let g be z(7). Solve -2w - 4 = g, 3w = -5q + 16 for q. 5 Suppose 20b = 17b + 6. Solve -3h + 4a + 15 = 0, -bh + 9 + 1 = -5a for h. 5 Let a = 7 - -8. Let n = 20 - a. Solve np - 4 = -3r + 5, -4p = 3r - 6 for r. -2 Suppose -3a + 0d + d + 5 = 0, 0 = -5a + d + 9. Solve 30 = 4j - 5u, -2j = 2j - au - 24 for j. 5 Let q(o) = -4o - 1 - 2 - 2. Let p be q(-5). Solve -2r + p = 3c + 2c, 2c = -3r + 17 for r. 5 Let z = 24 + 6. Let x = -14 + z. Solve 2w = y, y - 4 + x = -4w for y. -4 Let g(s) = 2s + 1. Let a be (-45)/(-12) - (-2)/8. Suppose p + 2p = -ac + 23, -8 = -3p - c. Let v be g(p). Solve 0h - 4h - 5 = 3t, -5t + v = h for t. 1 Let r = 16 - 19. Let f = r - -8. Solve -3g + 3 + 24 = 3a, fg + a = 29 for g. 5 Let r = -2 - -2. Let x be (-3 + r)/(3/(-12)). Solve 2y - x = -4l, 0l = y + l - 4 for y. 2 Suppose 5b + 5o = 40, 2b - 7o + 14 = -3o. Let h = 16 - 16. Solve i + 5 = 0, bx - 40 = -hx + 5i for x. 5 Let p = 11 - 8. Let m be (-4)/12 + 10/p. Solve -4x - v = mv, 0 = -2x - 3v - 1 for x. 1 Let h = -10 - -16. Let m = -4 + h. Solve mt = -4i + 18, 2t = -5i - 0t + 20 for i. 2 Let w = 76 - 43. Let j be 1029/w - (-4)/(-22). Solve 3f = -5r - j, 3r + 3 = 4f - 4 for r. -5 Suppose 5 = 2r - r. Suppose rs + 19 = -2b, -8b - 5s = -4b + 13. Solve -5f = 2q + 17, -bq = -4q - 5f - 21 for q. 4 Let j = 14 + -9. Let p be 1/5 + 14/j. Solve -pa - 25 = -5s - 0a, 5s - 25 = -3a for s. 5 Suppose -2u = 2p, 4u + u + 3p = 2. Let g = u + 1. Solve -x - 5d = 24, -2x + gd + 2d + 8 = 0 for x. -4 Suppose -l = -6 + 4. Suppose 4c - 1 = -r + c, 4r = lc + 46. Solve 5n + 4s = 4, s - r = -5n + 6 for n. 4 Let r(f) = -f*3 + 5f*2 - 4f + 5. Let a be r(4). Solve ap = -2l, 2p - 11 - 5 = -4l for l. 5 Let n be (11 + 1)4/12. Solve -2h = 5s + 7 + 4, -nh = 5s + 7 for s. -3 Suppose u + 4u = 0. Suppose -p + 4 = -up. Let m(k) = 9k + 72. Let t be m(-6). Solve -4f - pw = w - t, 2 = -f + 2w for f. 2 Suppose 37 = 5s + 12, 4d = -3s + 35. Solve 0 = da - 4a - p, 0 = 5p + 25 for a. -5 Let m = 116 - 116. Solve m = -3c - y + 2 - 1, -7 = -5c + y for c. 1 Let r(g) = -g2 + g + 1. Let q = 8 + -5. Let c be r(q). Let k(n) = -n2 - 7n - 5. Let x be k(c). Solve xw = -5z, 3z - 1 = -2w + 4 for z. 5 Let c be 238/63 - 8/(-36). Solve 3m - cb = -2m + 4, -m + 3 = -3b for m. 0 Let t = 21 + -36. Let p be (t/10)/((-2)/4). Solve -2a = -pu - 4a - 16, -5a - 10 = 0 for u. -4 Let g(z) be the second derivative of -z*3/6 + 5z*2 + 7z. Let o be g(5). Solve 4j - oj - d = 5, -5d = 0 for j. -5 Let q(i) = 8i*2 - i. Let d be q(1). Let o = 5 + -3. Suppose og = 7g + 20, c = -3g - 2. Solve -4z = -l + c - 2, 5z = -3l + d for z. -1 Let r(z) = 4z*2 - z. Let y(s) = s - 1. Let b be y(2). Let g be r(b). Suppose 4n - 13 = gn. Solve 0 = -5x - k + n, -3x + k + 5 = 2 for x. 2 Let z(a) = a2 - 5a + 2. Let p be z(5). Solve -4d + 5g - pg - 35 = 0, d + 30 = 5g for d. -5 Let d be 0 - (0 + (3 - -6)). Let t be (-42)/d(-6)/(-4). Solve -v - t = v - 5a, -4a = -2v - 6 for v. -1 Suppose 2t = 3t. Suppose t = h + 1 - 3. Suppose -2m - 3l + 6 = -l, -3 = -m - hl. Solve -mp - 4z = 2 + 9, 0 = -3p - 3z - 6 for p. 3 Let u(t) = t. Let n be u(3). Suppose 4o + 1 = -b, 3o = -4b + 1 + 8. Let i be (2 + 0)(o + 2). Solve 31 = 3w + 4c, -3w + nc + 13 = iw for w. 5 Let j = 21 + -17. Solve 2p - 5 = -jt + 1, -6 = -p - 5t for p. 1 Suppose 4g - 26 = 2f, 4g - 32 = g + 4f. Let x be g - (-2 - -2)/(-1). Solve -5p + z = -11, -3p + x = -3z - 5 for p. 2 Let b = 4 + -2. Let y = b - -20. Solve 5l + 4f - 29 = 0, -2l + 6l - y = -2f for l. 5 Let k(d) = d + 5. Let p = -1 - -1. Let u be k(p). Let n be (10/3)/(1/3). Solve 2o - uq + n = 0, 0q = -q for o. -5 Let o = 30 - 25. Solve -6b = -oc - 3b - 20, 2c = -5b - 8 for c. -4 Suppose 5w + 5x - 30 = 0, -5x = -4w - w + 10. Solve wh - 8h - 2r + 6 = 0, 0 = 4h - 2r - 2 for h. 1 Suppose -127q = -126q - 4. Solve 5r - 30 = -2p + qp, 2r - 23 = 3p for r. 4 Let y be 17/6 + (-7)/(-42). Solve -r - v - 1 = 0, 0r + yr - 3v = -3 for r. -1 Suppose -24 = -5r - 3j, 4 + 8 = 4j. Suppose 1 = 2k - r. Suppose 0y - 2 = -y. Solve 3s = u + 10, 3s = ku - ys + 16 for u. 2 Suppose -v + 2 = -0v. Let w = 2 + v. Solve -10 = -wr - 2g, g - 2g = -4r + 1 for r. 1 Let w(i) = -i. Let g be w(-3). Suppose 5f + 2 = -3. Let q be g + -4 + (0 - f). Solve -5y - 1 = -a, y = -qy - a - 5 for y. -1 Let g = -11 - -11. Suppose p + 0f - 7 = -f, g = 2p + 4f - 18. Let w be (1 - (-4)/2)/1. Solve 0 = -3z + po + w, o - 5 = -5z - o for z. 1 Let x(p) be the first derivative of p2/2 - 13p - 4. Let u be x(15). Solve 5q + u = 7, -t - q = 4 for t. -5 Let f be 0 + 6 + (-4 - 0). Solve -fr = 2r + 20, 5r = 5t - 10 for t. -3 Let z(j) = j - 3. Let c be z(7). Solve 5x + 3 = -ci + 12, -x = -4i - 21 for i. -4 Suppose -28d + 23d + 75 = 0. Solve -u + 9 = -6i + 4i, -u = 4i + d for u. 1 Let f be 63/28 + 2/(-8). Solve -4h + 4s = 0, -2h + 5s = fh + 2 for h. 2 Let m be (-5 - -4)/(3 - 4). Solve 3o = -c - m, -2o - 2c - 14 = -4c for o. -2 Suppose -5d = -v - 246, -2d - v + 99 = -2v. Suppose -3x - d = -7. Let t be 4/x - 30/(-7). Solve -n + 21 = -2h - 3h, -tn + 16 = -3h for h. -4 Suppose 34 + 14 = 4j. Suppose -4s - j = -32. Solve 5r + 2d = -3, 0r - d + 1 = sr for r. 1 Let m = 9 - 6. Suppose 0f + 36 = mf. Solve 2b + h + 0h - 1 = 0, 3b - f = 2h for b. 2 Let g be 2 - (-5 - -2)/3. Let j be (g + -1)(-12)/(-2). Let i = 16 - 12. Solve j = -3k + k + ib, -10 = -5b for k. -2 Let m(w) = 4w2 + w - 3. Let t be m(2). Solve -4n + 5 = 2c + t, 12 = -5c + 3n for c. -3 Let z(k) = k3 + 5k*2 + 5k + 5. Let c be z(-4). Let b = 3 - c. Solve o - 9 = 3t + 4o, bt - 2o = 14 for t. 2 Suppose 0 = -2k + 3k + 4w - 21, -w = 3k - 30. Solve 3n = -3t, -2n + k = -6n - t for n. -3 Let s be (-2 + 3)/(4/16). Solve -3a = -15, -sa = -3i - 0i - 14 for i. 2 Suppose -4v + 0z + 25 = -z, 2v + 3z = -5. Solve vh + 25 = 5s, -2s = 3s + 4h - 25 for s. 5 Let j(p) = -p - 2. Let s be j(-3). Solve -3f = -d - 2, 0f + f - 2d + s = 0 for f. 1 Suppose 0 = -2u + 2. Suppose -8 = m - u. Let s = m - -13. Solve 5z + s = 2n + n, -5z + 5n = 10 for z. 0 Let a(z) = -7z - 9. Let y be a(-2). Solve 3v = -yh, -3v + h = 2h + 12 for v. -5 Let a(x) = -x*2 + 13x - 9. Let n be a(12). Solve 5v + 4 - 9 = 0, 2m - nv = -9 for m. -3 Let y = -5 - -9. Suppose -k = -2d - 5k + 12, d = yk. Solve 2j = 4j + 5g + 2, d = -4j - 4g for j. -1 Let w be (5/2)/(2/4). Suppose 6 = wd - 39. Solve 0 = 4b + 5h - 10, -3b - 2h + d = -2 for b. 5 Let r be 0 - 5/((-15)/6). Suppose k - 2 = -n, 0k = 2k - 4n - 34. Suppose 3y = ky - 24. Solve -2g - rd + 0d + y = 0, -g = 2d - 3 for g. 3 Let z(r) = 5r*2 - 5. Let s be z(4). Let o be s/10 - (-2)/4. Let b = o - 5. Solve -4y + 2j + b = -11, y + 4j + 1 = 0 for y. 3 Let b be (6 + (-48)/8)-11. Solve 2o + 3o + 5v - 35 = b, 3v = -5o + 25 for o. 2 Suppose 0 = -4d + 5p + 126, -4p + 62 = 2d - 6p. Solve -5q = -2y - d, -q + 1 =	{ "pile_set_name": "DM Mathematics" }
b? -2b Let j(v) be the third derivative of 17v*9/504 + 17v*5/60 + 9v*2. What is the third derivative of j(c) wrt c? 2040c*3 Let z(f) be the second derivative of 2f*5/5 - 2f*4/3 - 9f. What is the third derivative of z(b) wrt b? 48 Let a(k) = k*2 + k + 1. Let f(v) = -7v*2 - v + 3. Let w(u) = a(u) + f(u). Find the first derivative of w(b) wrt b. -12b Suppose -7r = -2r - 10. Let v = r + 0. What is the second derivative of vd + 5d*4 - 5d4 + d4 wrt d? 12d2 Let f(w) be the first derivative of 4w7/7 - w3/3 - 6. What is the third derivative of f(y) wrt y? 480y3 Suppose -u + 6 = 3. What is the second derivative of 3q - 6q - qu + 3q + 3q wrt q? -6q Let q(y) be the second derivative of 4y7/21 - 7y*4/3 - 24y. What is the third derivative of q(w) wrt w? 480w2 Suppose 2s - 3c - 17 = 0, -c = 2s + s + 2. Suppose -3 = -2b + s. Differentiate -k2 + 1 - kb + 0 with respect to k. -4k Let s(g) be the first derivative of -g7/14 + g3/6 + 2g + 8. Let f(n) be the first derivative of s(n). Find the second derivative of f(u) wrt u. -60u*3 Let x(h) be the third derivative of -19h*6/60 + 7h*4/4 + 33h*2. What is the second derivative of x(s) wrt s? -228s Let n(d) be the second derivative of -3d + d2 + 0 + 0d*3 + 1/6d*4. What is the derivative of n(a) wrt a? 4a Let z(b) = -18b3 - 6b - 17. Suppose 5f + 0f = -30. Let a(l) = 6l3 + 2l + 6. Let g(r) = fz(r) - 17a(r). What is the second derivative of g(u) wrt u? 36u Let f = -25 - -27. Let p(a) be the second derivative of 2a + 1/6a3 + 1/30a*6 + 0a*4 + 0a*f + 0a*5 + 0. What is the second derivative of p(n) wrt n? 12n*2 Let h(s) be the second derivative of -5s8/336 - s5/20 - 3s2 - 5s. Let j(w) be the first derivative of h(w). What is the third derivative of j(b) wrt b? -300b2 Let h = -131 + 131. Let o(n) be the first derivative of 0n*4 + 2/5n*5 + 0n*3 + hn*2 - 3n - 3. What is the first derivative of o(a) wrt a? 8a3 Let y(k) = -k2 + k + 2. Let n be y(3). Let t be (2/(-8))/(n/80). Find the third derivative of -4v - 4v2 - 4v*t + 4v wrt v. -240v2 Suppose 5f = 7 - 22. Let h be 2/f105/(-10). What is the second derivative of -hx*3 - x + 2x*5 + 7x*3 wrt x? 40x*3 Find the second derivative of 13y + 32y2 - 15y - 8y2 wrt y. 48 Let d(w) = -17w + 5. Let l(r) = -8r + 3. Let a(s) = -6d(s) + 11l(s). Find the first derivative of a(c) wrt c. 14 Find the third derivative of -3n*2 - 7n*2 + 0n*4 - 6n*2 - 16n*4 wrt n. -384n Let c(j) be the third derivative of j8/20160 - j6/240 + j*5/30 - 3j*2. Let k(x) be the third derivative of c(x). Find the first derivative of k(v) wrt v. 2v What is the first derivative of -32 + 35l3 - 7l*3 + 11 - 12 wrt l? 84l2 Let a(o) be the third derivative of -o6/60 - 2o3 + o2. Differentiate a(l) with respect to l. -6l*2 Let a = 8 - 6. Let r = a + 0. Find the second derivative of 2q*r + 0q*2 + 0q*2 - q wrt q. 4 Let q(n) be the first derivative of -5n*4/4 - n + 8. Find the first derivative of q(f) wrt f. -15f*2 Let z(h) = -35h - 35. Let f(v) = 17v + 18. Let k(n) = 5f(n) + 3z(n). What is the first derivative of k(r) wrt r? -20 Differentiate -37n - 4 + 27n + 7 with respect to n. -10 Let a(c) = -20c2 + 15. Let q(n) = -n2. Let u(h) = -a(h) - 3q(h). What is the first derivative of u(r) wrt r? 46r Suppose -l = 2l + 5o - 27, 5l = 2o + 14. Suppose -lm + 5 + 3 = 0. Differentiate 3 + my*3 + 7y - 7y wrt y. 6y*2 Let i(u) be the second derivative of 3/2u*2 + 0 + 0u*3 - 3u + 1/6u6 + 0u*4 + 0u*5. What is the first derivative of i(r) wrt r? 20r*3 Let h(z) be the second derivative of 19z*6/15 + 19z*4/6 + 17z. What is the third derivative of h(s) wrt s? 912s Let m(b) be the second derivative of -3b*6/10 + 9b*2/2 + b. What is the derivative of m(f) wrt f? -36f*3 Let n be -2 - 14/(2 - 4). Suppose -5z - 1 = 2a, 5a = 4z + 9 + n. What is the first derivative of 0i*2 - 2i2 + a + i2 + 3i2 wrt i? 4i Suppose 0 = -4x + 19 - 7. Suppose 5m = 5t + 45, xm + 5t = -3 - 10. Find the third derivative of -k5 + 2k*2 + mk*3 - 4k*3 wrt k. -60k2 Let k(z) be the third derivative of -z4/12 + z*3/2 - 8z*2. Find the first derivative of k(o) wrt o. -2 Let z(u) = -2u - 1 - 3u + 6u. Let j(s) be the third derivative of s4/4 - s3/2 - 2s2. Let x(c) = j(c) - 4z(c). Differentiate x(n) wrt n. 2 Let p(n) be the first derivative of -14n5/5 + n3/3 + 15n - 14. What is the first derivative of p(u) wrt u? -56u3 + 2u Let x(g) be the first derivative of 21g5/5 + 25g*3/3 + 43. Find the third derivative of x(z) wrt z. 504z Find the second derivative of 6o4 + 21o - 2o4 - 22o wrt o. 48o2 Let v be 54/5010. Let r(l) be the first derivative of 1/5l*5 + 0lv - l2 - 2 + 0l3 + 0l. Find the second derivative of r(h) wrt h. 12h2 Let t(c) be the first derivative of 2c*4 + 7c*2/2 - 4. What is the second derivative of t(z) wrt z? 48z Let a(j) = -j*5 - 2j*3 + 4j2 - 2. Let o(s) = -s3 - 1. Let y(p) = 2a(p) - 4o(p). What is the third derivative of y(w) wrt w? -120w2 Let i(v) be the second derivative of -49v*6/30 + 4v*3/3 + 34v. Find the second derivative of i(d) wrt d. -588d2 Find the third derivative of -9w*2 + 0w*2 - 15w + 6w3 + 15w wrt w. 36 Let v be 7 + -5 - (0 + 2). Let d(t) be the second derivative of -t - 1/6t3 + 1/10t*5 + vt*4 + 0t*2 + 0. What is the second derivative of d(g) wrt g? 12g Let y(n) = n*2 - 4n + 2. Let z be y(4). Find the first derivative of 2 + 3w - 1 - zw - 4 wrt w. 1 Let s(l) be the third derivative of -l7/70 - l5/12 + 5l2. Find the third derivative of s(k) wrt k. -72k Differentiate -16 + 26y2 + 3y*2 - 8y*2 with respect to y. 42y Let n be (-1 - 0)/1 + -2. Let x be (3 - 6)/(n/2). What is the second derivative of -v - v*5 - 2v*2 + 2v*x wrt v? -20v*3 Let t be 5/((-5)/2) + 5. Let j be 3 - (t - 4)/(-1). Find the second derivative of 3o - jo - 5o - 4o2 + o wrt o. -8 Let k(t) be the third derivative of -19t*6/120 - 2t*5/15 - 10t2. What is the third derivative of k(u) wrt u? -114 Let u(t) = t3 + 7t2 + 5t - 3. Let m be u(-6). Differentiate m - 2z + 4z - 4 with respect to z. 2 Differentiate 21z2 - 40z*2 - 9 + 22z*2 wrt z. 6z Let x(d) = -d*2 - 9d - 6. Let y be x(-8). Let f be 0 + (0 - 0)/2. Find the third derivative of 2p2 - yp*3 + 0p + fp wrt p. -12 Let p(b) be the first derivative of -3b*6/2 + 2b*2 - 14. What is the second derivative of p(i) wrt i? -180i3 Let w(f) = f2 + 7f - 3. Let n be w(-8). Let u(v) = v4 + 5v2 + 8. Let t(x) = -x2 - 1. Let j(q) = nt(q) + u(q). Differentiate j(g) wrt g. 4g*3 Let q(d) be the third derivative of 8d*7/105 + 4d3/3 + d2. What is the first derivative of q(z) wrt z? 64z3 Let d(x) be the third derivative of -22x7/105 + x6/120 + x5/30 + x3/6 - 18x2. What is the third derivative of d(i) wrt i? -1056i + 6 Let p = -15 - -10. Let d = p - -8. Find the second derivative of 5v3 - v4 - 5v*d - 3v wrt v. -12v2 Differentiate -13o*4 + 8 - 22o*4 + 3 + 13o*4 with respect to o. -88o*3 Let t(j) = 6j*2 - 7j + 4. Let l(x) = 7x2 - 8x + 5. Let p = -8 - -4. Let z(q) = pl(q) + 5t(q). Find the second derivative of z(w) wrt w. 4 Let w(b) be the second derivative of -b5/12 - b4/12 + b*2/2 + 3b. Let i(a) be the first derivative of w(a). What is the second derivative of i(x) wrt x? -10 Let a(b) = -3b2 + 3b. Let o be a(2). Let r be (9/o)/((-3)/8). Find the second derivative of rt + 3t + 2t5 - 5t wrt t. 40t3 What is the first derivative of -5 - 21 - 5 - 23v wrt v? -23 Find the third derivative of 12m2 + 24m*3 + 25m*3 - 15m*3 + 2m*6 wrt m. 240m3 + 204 Let d(h) be the second derivative of h8/336 + 2h5/15 + 3h*2 - 5h. Let f(l) be the first derivative of d(l). What is the third derivative of f(y) wrt y? 60y2 Let i = -1 - -8. Suppose -3s = -is. What is the second derivative of -3a*2 + 2a - a*2 + sa*2 + 5a*2 wrt a? 2 Let h(s) = 2s*4 - 6s*2 + 7s + 6. Let g(o) = o*4 - 5o*2 + 7o + 5. Let r(v) = 6g(v) - 5h(v). Fi	{ "pile_set_name": "DM Mathematics" }
x3 - 24x*2 - x + 4. Let m be t(2). Which is the closest to -2/3? (a) m (b) 4/9 (c) 5 b Let n be -2(-3 + 15 - (-61)/(-5)). Suppose 21q - 20q - 5 = 0. Which is the closest to n? (a) 2 (b) q (c) -0.5 (d) -0.2 d Suppose i - 96 = -47i. Let d = -0.69 + 4.69. What is the nearest to d in 0.2, 4/9, i? i Let w = 252 + -245.48. Let o = w - 3.52. Which is the closest to -8/9? (a) o (b) -2/3 (c) -2/13 (d) 1/5 b Suppose -924 = 5m + 12d, -5m - 21d + 26d - 890 = 0. Which is the nearest to m? (a) 1 (b) -3/4 (c) -0.2 b Let f = 4441/2966 - -4/1483. Which is the nearest to -1? (a) f (b) -2/3 (c) -1 (d) 4 c Let v = 5/4 + -3/2. Let g = -86978 + 86975. What is the closest to -0.1 in 0.5, v, g, -12? v Let d = 1467 - 1562. Let o = 149 + -55. Let x = o + d. Which is the nearest to x? (a) -1 (b) 15 (c) 1 a Let d be (-22)/((-4488)/(-425))4/10. Suppose 5p - 3f - 54 = 0, 3p + 5f = 2f + 42. Which is the nearest to p? (a) d (b) 4 (c) -1 b Let f = 90 - 88.6. Let k = f - 1.9. What is the nearest to -2/7 in 1/2, -2/5, k? -2/5 Let t(a) = -a*2 + 5a - 1. Let g be t(5). What is the closest to 1/3 in 3/5, -2/31, 5, g? 3/5 Let q(p) = -p*3 - 11p*2 - 51p - 298. Let n be q(-9). Which is the nearest to -10? (a) n (b) -2/5 (c) 1/2 (d) -7 d Let p be (2/1)/26(15 + -13). Let n = 285 - 285.04. What is the closest to 4 in n, p, -4? p Let h = -1.101 - 513.899. Let q = 516 + h. What is the closest to -5 in -1/3, 5/2, -5, q? -5 Let k = -91/8 - -151/8. Let j = 8 - k. Let f = -9.8 - -9.7. What is the closest to 2 in -2, j, f? j Let t = 24 - 83/3. Let c = t + 19/6. Let n = 0.1 + -0.2. What is the closest to 0.1 in c, -2/15, n? n Let z = 10523 - 10523. Which is the nearest to z? (a) 0 (b) -663 (c) 0.08 a Let h be ((-64)/30 - -2)/((-20)/(-32800)). Let q = h + 219. Which is the nearest to 0.1? (a) q (b) 5 (c) 4 (d) -0.3 a Let h = 0.78 + -0.98. Let y be 4/312/8. Which is the nearest to 1/2? (a) y (b) -0.4 (c) h c Let m be (-13)/(117/27) - (-2)/4. What is the closest to 0 in -0.2, 60, m? -0.2 Let t be (8/70)/((-244)/(-610)). What is the nearest to t in 22, 1, 19? 1 Let q = -1513 + 1512. What is the nearest to -3 in -4, -4/7, q? -4 Let t = -179.5 - -141. Let j = -38 - t. Which is the nearest to -1? (a) -4 (b) 1/7 (c) j b Let h = 5423 - 5425. Let m = -1.006 - -0.006. Let p = -43/10 - 16/5. Which is the nearest to m? (a) h (b) 1 (c) p a Let s(k) = -2k3 - 5k*2 - k + 8. Let z be s(-2). Which is the closest to z? (a) 0 (b) -0.06 (c) -0.5 a Let u = -1.784 - -0.784. Which is the nearest to -0.1? (a) 5 (b) u (c) -3 (d) 27 b Let u = 59.93 - 59.93. Which is the closest to u? (a) -0.1 (b) 1 (c) 0.3 (d) 0.6 a Suppose -n - 5x - 9 = -1, -x = -5n + 12. Suppose 6 = -nt - 5v, -t - 1 - 2 = -v. Let y = 23.8 - 23.8. What is the nearest to y in -1/7, -1/5, t? -1/7 Let d = -20846 - -20853. Let i be (2/(-6))/((-13)/6). What is the nearest to 0 in 0, d, i? 0 Let d be 2/11 - (-5)/33. Let o = 12 + -11. Suppose 17z - 26z = -45. Which is the nearest to o? (a) d (b) -0.3 (c) z a Let q be 126/105 - (-17)/(-10). Which is the closest to 3? (a) 4 (b) q (c) -18 (d) -5 a Let h = -3978 - -3974. What is the closest to h in 0, 1/7, -3, -2? -3 Let q = 70.1 + -69.6. Which is the nearest to 2/3? (a) -0.1 (b) 2/3 (c) q b Let k = -36.148 + 33.148. Let v be (-9)/21 - (-4)/336. Which is the closest to -0.1? (a) v (b) 0.4 (c) k a Suppose 3i = -4g + 3g + 1, -5g + 5 = -3i. What is the closest to i in 1/5, -0.5, -5, -3/5? 1/5 Let o = -15970 + 47905/3. Which is the nearest to 57? (a) 39 (b) o (c) 0.3 a Let k = -11.4 + 11. Let d = k - 1.6. Let s = -202 + 1009/5. Which is the nearest to -1? (a) d (b) 3 (c) s c Let k = 129 - 141.4. Let u = k + 12. Let g = -11/14 + -1/70. Which is the closest to g? (a) -1/4 (b) u (c) -1/2 c Let j = 12002 + -11725. What is the closest to 2/3 in j, 3, 0.2? 0.2 Let l be 64/(-1568) - 990/(-245). What is the nearest to -0.1 in -0.2, l, -2, -3.6? -0.2 Let l = -22.707 + 22.707. What is the nearest to -1 in -2/5, -5/3, -34, l? -2/5 Let r = -0.046 + -0.914. Let j = -1 - r. Let n = 226.2 - 226.2. Which is the closest to n? (a) -0.5 (b) j (c) -1 b Let p = 6.6 - 20.6. Let r = 12.82 + p. Let m = r - -0.18. Which is the nearest to 7? (a) m (b) 0.2 (c) 0 b Let u = -16818 - -16817.502. What is the nearest to 0 in -1, 0.1, 3, u? 0.1 Let p = -19 + 30. Let b = p + -7. Let q(u) = 3u3 + u2 - 2u. Let h be q(1). What is the nearest to -7 in h, -5, b? -5 Let o = 15.68 + -15.88. What is the closest to -1/12 in 0, 0.1, o, -2/9? 0 Let t be (-1023)/2728 + 22/144. Which is the nearest to 0.2? (a) 2/5 (b) 3/4 (c) 149 (d) t a Let i = -16.2981 + 30.2981. Let k = -19/6 - -7/2. Which is the nearest to i? (a) -3 (b) k (c) 0.4 c Let n = 975 + -975.3. Which is the nearest to 1/5? (a) -3 (b) 4/3 (c) n (d) -5 c Let q = -14258 + 14254. What is the nearest to 0.72 in 0.5, -0.8, q, -5? 0.5 Suppose -3a = 3u + 930, 147 = -u - 4a - 175. Let b be u/6(-2)/3. Let x = -36 - -35.5. What is the closest to -2 in x, b, 2? x Let z = 18 + -17. Which is the nearest to z? (a) 11 (b) 5 (c) 0 (d) -33 c Let y = -6.39 + 10.345. Let n = -0.045 - y. What is the closest to 2 in -0.5, -33, n? -0.5 Suppose -4f = -3f. Suppose f = 3k - 7 - 2. Let u = 54662/19 + -2877. Which is the nearest to 1? (a) 2 (b) u (c) k a Let n = 0.022 - 0.222. Let g = 851/208 + -63/16. Which is the nearest to 2? (a) n (b) g (c) 0 b Let j = 0.522 + -0.722. Let i = 0.41 - 4.41. Let t = 69 + -415/6. What is the nearest to j in i, -5, t? t Let n = 0.9 + -1. Let d = -22.028 + 22.428. Let z be (-20)/21 + 4/14. What is the closest to n in d, 3/4, z? d Let k be (-1)/2 + (-1)/(-10). Let l be ((-20)/(-35) + (-2)/(-7))560/720. Which is the closest to k? (a) l (b) -2/7 (c) 0 b Let z = -151/7 - -446/21. Let w = 55 + -51. What is the closest to 1 in z, w, 2/5? 2/5 Let q = -75.41 + 75.31. Let o = -4.8 - -4. What is the nearest to q in 3, o, 2? o Let t = 0.2563 - 4.6563. Which is the closest to 0.1? (a) t (b) -1/4 (c) -50 b Let k = -2016 + 2016.3. Which is the nearest to -1/3? (a) -5 (b) k (c) -0.4 (d) -4/7 c Let j = -0.3 - -0.5. Let f = 2/325 - 329/650. Let g be -2(-132)/(-64) + 4. Which is the nearest to 1/3? (a) j (b) g (c) f a Let j be 4(1 + (-2)/(-36)) - 4. Let n be ((-3)/(-54))/((-17)/(-102)). Let v = -3.94 - 0.06. Which is the closest to n? (a) -1/2 (b) v (c) j c Let w = 2347 + -2353. Which is the nearest to 1/4? (a) w (b) -0.21 (c) -2 (d) 2 b Let k = -384/19 - -1939/95. Which is the nearest to k? (a) -1/6 (b) 5/3 (c) -5 a Let w be -115/(-33)(-2)/(-10). What is the nearest to 2/3 in -0.04, 48, w? w Let b = 3.76 - 0.76. Let r = -17 + 33. Let a = -1442 - -1446. What is the nearest to -1 in a, b, r? b Let y = -85/4 + 21. Let o = -0.027 + 23.027. Let n = -22 + o. Which is the nearest to 1/2? (a) y (b) 5 (c) n c Let z = 3.22 - 4.3. Let d = -6.08 - z. Let j = 0 + -1. What is the nearest to j in -1, d, 1? -1 Let s = -8/29 - -1822/87. Let i = -121/6 + s. Which is the closest to -1? (a) i (b) 0.1 (c) -1/6 c Let b = -171 - -262. Let a = b - 96. What is the closest to 0 in 0, -2, a? 0 Suppose 4i - 1682 = -4t + 7t, 5i - 2805 = 5t. Let v be -4 - (t/136 - (-1)/4). What is the nearest to 1 in -9, -0.4, v? v Let z = 6 + -13. Let q be 1 + 14483/(-11118) - (-126)/1071. Let m = -2/109 - q. What is the nearest to -2/3 in z, -4, m? m Let f = 17253 - 17256. What is the closest to -3 in f, 4, -3/61? f Let n be (-7(-7)/343)/(-9 - -8). What is the closest to -2/9 in -31, -1.4, -5, n? n Let d = -485 - -485.1. Let g = 3.8 - 4. Which is the closest to d? (a) 5 (b) g (c) 0.09 c Let t be -1 + 4 - ((-13)/(-78) + 30/36). Which is the closest to -14? (a) -5 (b) -0.3 (c) t a Let q be ((-16)/(-12) + 14/(-168))/1. What is the closest to 3 in q, -2/19, 0? q Let u = 2.95 + -3.376. Let m = u - -0.426. Which is the closest to m? (a) -0.3 (b) -53 (c) -0.5 a Let h be 8/36 + 50/18 - 150. Let v be (56/h)/(2/(-3)). Which is the closest to 11/6? (a) -0.3 (b) v (c) 1 c Let s = 992 - 997. Which is the closest to 9? (a) 8 (b) -1 (c) s a Let x = -10982 + 10977. Which is the nearest to 1/22? (a) -4/3 (b) 1/3 (c) x b Let v = 9723/26 + -374. Let q = -57/13	{ "pile_set_name": "DM Mathematics" }
. i*(38153/5054) Simplify (((x/((xxx(4/13))/x)x)/(x*(-26)/x))/(((xxx22x)/x)/(x/x(-4))))(-10) assuming x is positive. x*(-1130/13) Simplify ((((i/(i/(ii1)))(7/4))18)(-29))1 assuming i is positive. i(-1827) Simplify ((r*(10/7)r/(r(r/(r/((r/r(1/19)r)/r)))/r))/(r*(-22/7)r/r*(-12)rr))(-7/3) assuming r is positive. r(460/19) Simplify ((mm/m(-1))(-46)m(-9)m*(-1/4)m)/((m/m0)(-24)/(mm(-2/5)/mm)(-49)) assuming m is positive. m(-3033/20) Simplify ((((oo12o)3)(-5/7))(-1/71))(-16/5) assuming o is positive. o*(-96/71) Simplify (mm1)(2/155)/(m/(m/m*(3/7))m*(-2)m)(m(2/7)/m)(14/15)m*(-4)mm(2/13) assuming m is positive. m(-123373/42315) Simplify ((p(-32)p)/p(-4/13))/(p(-1/10)/(pppp/p(2/9))) assuming p is positive. p(-31373/1170) Simplify ((a(-2)/a)/aaa/(aa(-2/9)))(4/5)((a/(a/a(-1/3)))/a(-5))(2/55) assuming a is positive. a(-1016/495) Simplify (((q(-2/3)q)/q)(-31))(-12/7)(qq*(-2/5)qq)/(qq*(-5/2)/q)((q/q*0qq)/q)30 assuming q is positive. q(2077/70) Simplify ((((zz*(4/7))/zz)/(z/(z*5z)))/(z3/(z/(z4z)z)))0 assuming z is positive. 1 Simplify u/(u(-4)/u)u3(uu/(uu(-1)))(-34)((u(2/11)u)/(uu(2/7)))/(u(-1/4)u)17 assuming u is positive. u(-22131/308) Simplify (y*28y)/y(y/(y/(y/((y/(y(10/3)/y))/y))))/yy((y/(((y/((y(-35)y)/y))/y)/y))/y)(-2/51) assuming y is positive. y(98/3) Simplify ((p*(-5)/((pp*(-7)pp)/p)p(p/(((p/(p(-2/9)/p))/p)/p))/pp(p(-5)/pp)/p)(-34))(-32/3) assuming p is positive. p(-41344/27) Simplify (k(-2/57)/((k/k(-1/5))/k))/(k/((k/k(-5))/k)k14) assuming k is positive. k(-2917/285) Simplify ((ii*4i)/i(-1))0(i/i0)(-2/37)((i/i1)/i)31 assuming i is positive. i*(-1149/37) Simplify (((uuu13u)/(((uu(-4/5)u)/u)/u))/(u*(1/5)u(1/13)))(-1/6) assuming u is positive. u*(-179/65) Simplify (((qq(-2))(1/47)/(q*8qqq/(qq/(q/(qq*(-1/2))))qq))(2/73))(-4/17) assuming q is positive. q(4332/58327) Simplify ((y/y(-2/31)y13)/(y(1/6))(-12))(-4) assuming y is positive. y(-1992/31) Simplify (n(-3/4)/n*(1/6)(((nn(-2/7))/nnn)/n)(-19))/((n(1/3))(-2/19))(1/19) assuming n is positive. n(-146427/10108) Simplify (p(-8/3)/(p30p))/((p(p/((p/p(-2/51)p)/pp))/p)/(p/p(3/16))) assuming p is positive. p(-25961/816) Simplify ((gg(-1/3)/g)(1/24))*(-46)((g(-1/3))(1/49))(1/2) assuming g is positive. g(1121/1764) Simplify r4/r(-4)r(-6)r*(-5)r*(-2/3)r/(r*(1/3)r)r(r/r*(1/8))/(rr(-1/5)) assuming r is positive. r(-117/40) Simplify (u/(((u/(((u/(uuu*(1/2)u))/u)/uu))/uu)/u))(-17)/(u1u)22(u(-1))22u/u7u*(-1/2)uuu assuming u is positive. u(-27) Simplify ((a(-2/37))(12/17)/((a/a37)/(a/a29)))(5/13) assuming a is positive. a(25040/8177) Simplify (w2w(1/4))/((w/((w(-3)ww)/w))/ww/w*7w)(w1)(-18)(w(1/3))(-1) assuming w is positive. w(-157/12) Simplify (g4/(gg(-13)))/(gg*6/gg)(-45) assuming g is positive. g331 Simplify (f*(-23/5)f*(-16/7))/(((ff*(-10/3)/f)/f)/(f/(ff(-20)/f))) assuming f is positive. f(1937/105) Simplify (((ww22)/(www(-10)/ww))/(w/(w/w*(6/5)w)ww(-21)))(-44) assuming w is positive. w(-11176/5) Simplify (t5t8)(-44)/((ttt(4/3)tt(t*(-2/17)ttt)/t)/(t(-2)/t)(2/19)) assuming t is positive. t(-561566/969) Simplify ((k(-2/11)k)/k(-5))/(k6k(k/(k9/kk))/k)(k(-4/3)k*1k)/(kkk0)(-3/4) assuming k is positive. k(659/66) Simplify (l(-3/10)l/(ll*(-7)/l)(l(-1/3))17)(-7/12) assuming l is positive. l(-427/360) Simplify (((m/(((m/(m*(-16)/m)m)/mm)/m)m(-17))(-3/2))41)(6/13) assuming m is positive. m(12546/13) Simplify ((c(-2/3))(-3/26)/(c(3/4))(-1/5))(-27) assuming c is positive. c(-1593/260) Simplify ((c(-1/3)/cc(2/23)c/(c*5c)(cc*7cc)/c)(-1/5))3 assuming c is positive. c(-38/23) Simplify ((d(-4))(5/7)(d(d/(d7/d))/d)(3/32))(-8/11) assuming d is positive. d(745/308) Simplify ((p(2/7)/p)/p)(-1/5)(pp(3/2)p)/(pp/p2p)p7p/p*(-2/19)(p*(-9)p)/(p/(p*(-4/9)p)) assuming p is positive. p(29969/11970) Simplify (l(3/5)/(ll(-2/5)))/((ll(-5))/(l4/l))(l(-1))(-16/5)(l0)(-2/7) assuming l is positive. l(51/5) Simplify ((l(4/7)/l)/(ll/l(1/6))l15/l(-12))50 assuming l is positive. l(25975/21) Simplify s*(-3)/(s/(ss*3/ss))(s(-1/4))(4/7)(s*(-9)/(ss5))40 assuming s is positive. s(-4201/7) Simplify (n(-28)/n(2/17))/((n35/n)/n(-18)) assuming n is positive. n(-1362/17) Simplify (o11/o)(-1/38)oo*(11/3)o(10/9) assuming o is positive. o(943/171) Simplify (((v*6v*(-1/3))/(vv0)(-7/3))43)(2/21) assuming v is positive. v(688/21) Simplify ((p2)*43/(ppp13(pp/((p/(p/p(1/6)))/pp)p)/pp))(35/2) assuming p is positive. p(14315/12) Simplify ((q*(-1/5)q)/(qq/q2))/((q/((q/q8)/qq)q)/(q/((qq*(-2))/q)))(q*(-2/23)qq(-1))/(qq(-1))(-7/2) assuming q is positive. q(-608/115) Simplify (b(-27)/(bb(b*(-27)/b)/b)(b(-4))37)(-9/11) assuming b is positive. b(1332/11) Simplify ((b/b1)32((b1/b)/b)(3/7))/(bb*(-3/2)b*(-1/10)((bb/b(2/9)b)/b)/(b/b(2/11))) assuming b is positive. b(-2731/3465) Simplify ((p*(-6)/(p(p*(3/10)p)/p))/((p/p*6)/ppp/(p/(pp/(p*7p)))))/((ppppp*(-2)p)*40p*2/((p/(pp*(5/4))p)/p)) assuming p is positive. p*(-2391/20) Simplify ((((aaa(-24))/aa/a(-3/19))(20/7))(-1/5))(-1/11) assuming a is positive. a(-1660/1463) Simplify (b(2/3))(-49)/(b(-1/2)((bb*4bb)/b)/b)(b*0bb/b(-4/7)b)/(b*(-3)b(3/7)) assuming b is positive. b(-1303/42) Simplify (m/(mm/m(2/3)))(-4/5)m*(2/3)/(m/(mm*(-2/13)))((mmm/m(1/5))(-37))(-11) assuming m is positive. m(222374/195) Simplify (z*(-4/3)/zz*(2/17)z)36/(z(-2/21)/z*(1/3)(z/(zz(5/6)))/zz0) assuming z is positive. z(-29633/714) Simplify ((u/(u*(2/5)u))(1/15)/(u(-4/7)/(uu/(uuu(-1/4)uu))))/((u(5/3)u)/(u/u5))(-1/2) assuming u is positive. u(4469/2100) Simplify ((o(-2/17)o/(oo*8o))/(o*(-8/7)oo/(oo(-3/16))))(-7/2) assuming o is positive. o(17445/544) Simplify ((v(-7))*(1/4)v*(-15)v/v7)(-36) assuming v is positive. v819 Simplify (((n(-1/2)n)/n)/n5)(-47)/(((n/n(-1/5))/n)/nn(n(n*3nn)/n)/n(n(n/(n/(n/(n(-1)/n)n)))/n)(-5/16)) assuming n is positive. n(5111/20) Simplify ((((v/v*(-6)v)/v)/v)*(2/21)/(v/((vv/(((v/(v/(vv(v/(v/v*(-11/5))v)/v)v))/v)/v))/v)v(-15/4)))41 assuming v is positive. v(43173/140) Simplify ((d(7/5)/d)/d)/d*(-1/37)d*(-5)dd(-35)/d assuming d is positive. d(-7506/185) Simplify (((o/o10)/(o/((o/o(1/3))/o)))/((ooo7)/o)(-5/4))(7/3) assuming o is positive. o(-7/9) Simplify (((t(3/8)t)/(tt/t(4/15)t))/(t*(-14)/(t/((tt/t(-26))/t))))(-31/2) assuming t is positive. t(49693/240) Simplify (w5w(-2)(ww3)/w(-2))/(((w/w(-1))/w)(1/5)/((w1/ww)/ww)(-42)) assuming w is positive. w(-166/5) Simplify ((n/(nnnn*(-1/43))n/(nnnnnn(-4/11))n)/(n(-4)/(n/n10)))46 assuming n is positive. n(-209162/473) Simplify ((q(1/4))10/(q/q(-11))(-23))(2/105) assuming q is positive. q(557/105) Simplify (qq/(q/(qq/q*(-3/17)))qq)/(q/(q(2/55)q)q)(qq/q(-24)q)/(qq/q(-37)q) assuming q is positive. q*(-8216/935) Simplify (cc*44cc(3/23))/(cc/c(-6/11))11 assuming c is positive. c(417/23) Simplify z21/(z/z*(-5/8)zzz)(z43z)/(z/z14) assuming z is positive. z(587/8) Simplify (ff(-2/9))(2/63)/(f/(ff*3/f)fff*(-1/2))(fff(1/2))/((f/((f6f)/f))/f)f*(2/7)ff(f*(-7/5)/f)/ff assuming f is positive. f*(25261/2835) Simplify ((((g/(((ggg(3/4))/g)/g))(-1/4))38)(-23/5))(-2/11) assuming g is positive. g(-437/220) Simplify (g(1/6)g(2/71))/((g(-8/17)gg)/g)(4/27) assuming g is positive. g(281/2414) Simplify ((s(s/s(1/6))/s)(1/7)/((ss*5)/(s/(s/(ss((s/((sssss*	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.