Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
he product of -19916.3866 and -2? 39832.7732 Calculate 343611155. 171805575 0.02 times 165296 3305.92 -307 times -1.2055 370.0885 Multiply -0.3 and 50319859. -15095957.7 Calculate 131-10655211. -1395832641 What is -5484.43094 times 0.4? -2193.772376 What is 1946.963 times -0.128? -249.211264 40791544 * -0.15 -6118731.6 -3 * -0.37124234 1.11372702 What is the product of 0.2 and 497966? 99593.2 1.92-16.4361 -31.557312 33165-0.172 -5704.38 What is the product of 18910389 and -0.1? -1891038.9 Product of 12446 and -0.23345. -2905.5187 944 * -114.5 -108088 Multiply -129.0358 and -96. 12387.4368 What is -0.2 times -17.668778? 3.5337556 Product of -0.344 and 0.25149. -0.08651256 Multiply 0.02 and -89025.6. -1780.512 Work out 1 * -15569967. -15569967 Multiply 0.2 and -1512881. -302576.2 Multiply 312.38 and -1164. -363610.32 Multiply -1.208 and 250893. -303078.744 Work out 286106317 * -0.5. -143053158.5 93375 times 180.5 16854187.5 What is 48512 times 0.13999? 6791.19488 Multiply 448290 and 6. 2689740 -322254902 -66764706 2284 -7046 -16093064 Work out 149 * 0.0574136. 8.5546264 What is the product of -3777074 and 0.5? -1888537 29374 times -10.2 -299614.8 Product of -0.248 and 39399. -9770.952 What is the product of 0.43 and -2.994002? -1.28742086 What is the product of 996502 and -11? -10961522 What is 3137.555 times 0.01? 31.37555 Calculate -1177.42038. -2399541.2 What is the product of 964364 and -394? -379959416 -85121275 times -1 85121275 Product of -5 and -2769.168. 13845.84 -0.4 66830352 -26732140.8 0.5 times -309081 -154540.5 -1269.63 -835.56 Work out -49 -22.934. 1123.766 Product of -0.03 and 0.0716142. -0.002148426 Product of -6636 and 176. -1167936 Calculate 1.3-75.46827. -98.108751 What is 27448660 times -0.6? -16469196 Calculate 0.05-12387290. -619364.5 -0.201 times 284.51 -57.18651 Work out -73029 * 1.4. -102240.6 Product of -50.52 and 0.2182. -11.023464 85-3.6059 -306.5015 Product of 29 and -15884.16. -460640.64 What is 7036 times -118.6? -834469.6 -36693384.8 -17612822.4 Product of 3764534 and 0.08. 301162.72 -2.07-3.923 8.12061 What is -31 times -308088? 9550728 Work out 0.13988276 3. 0.41964828 299055 times 0.05 14952.75 Product of 2363152 and 4. 9452608 15934752 3186950 Product of -0.194 and -46825. 9084.05 What is the product of -513 and -10616? 5446008 1 -3939573 -3939573 Work out 545889 * -9. -4913001 Multiply 2.14838731 and 1. 2.14838731 Calculate 0.2-69862. -13972.4 Product of 0.41 and 0.5732489. 0.235032049 -88 -771.042 67851.696 0.2 times -953190 -190638 -82.4-556.3 45839.12 1693460 times 3 5080380 Work out -44.26718 23. -1018.14514 What is the product of -262 and -4.5879? 1202.0298 35078042 7015608 -4478268-13.8 61800098.4 -0.176533 times 0.99 -0.17476767 What is -37933 times -83.4? 3163612.2 -114 * -50923 5805222 248798 times -4 -995192 What is the product of -463 and -0.7201? 333.4063 -33410 * -622 20781020 What is -2112 times 0.588? -1241.856 0.75863454 4104417.8 Multiply -48.66 and -0.07935. 3.861171 What is the product of -991 and 528423? -523667193 Calculate -32-42530. 1360960 -2.06 * 192462 -396471.72 Product of 171017907 and 0.5. 85508953.5 -203263120.3 -6097893.6 Calculate -0.371987.32. -2.7228936 What is the product of -7642 and 759.6? -5804863.2 141590253 22263542 -54524-61 3325964 88855415 13328310 2743649-163 -447214787 What is the product of -224.64605 and -1? 224.64605 Multiply -53338 and 53. -2826914 Calculate -3456.8845. -1370.6535 Calculate 2395518.9. 791037.8 4 times 3.1718582 12.6874328 What is the product of -0.5 and 612795? -306397.5 Calculate 09764048. 0 0.4 -18642294 -7456917.6 What is -16112 times 0.0911? -1467.8032 -5136767-0.1 513676.7 Calculate -0.3-0.06447256. 0.019341768 -1338871 * 8 -10710968 Multiply -0.04568 and -3.11305. 0.142204124 Multiply 856436.27 and 0.2. 171287.254 Multiply -0.07 and -62.35335. 4.3647345 What is 2183.2909 times -0.3? -654.98727 0.2596 times 34.227 8.8853292 What is the product of -6.20974 and -294? 1825.66356 Calculate 3913948-3. -11741844 What is 530.337 times -128? -67883.136 Calculate -9.67-483. 4670.61 Work out 0.256720974 * -4. -1.026883896 Work out 2417898 * 100. 241789800 Multiply 9527 and -22.39. -213309.53 Work out -742.5307 * 2. -1485.0614 Multiply -0.008436 and -307. 2.589852 0.11-2437009 -268070.99 What is the product of 29058 and 39.22? 1139654.76 What is -964 times -155083? 149500012 101229-5723 -579333567 Work out -36 * -0.77144. 27.77184 Multiply 199965.5 and -13. -2599551.5 3489808 times -10 -34898080 Work out -13154157 * -2. 26308314 Multiply -13978.7 and 2459. -34373623.3 Calculate -0.1-18.5777676. 1.85777676 Work out 0.047502 -0.00399. -0.00018953298 3282 times -5.9 -19363.8 Work out -5 * 0.1180834. -0.590417 Work out -1511 * 8230.3. -12435983.3 What is the product of 995853711 and 0.4? 398341484.4 Multiply 20 and -11776116. -235522320 1.42466 times -37 -52.71242 -311 * -37502 11663122 Work out 557950 * -1. -557950 Work out 0.142 * 0.048513. 0.006888846 Work out 0.0051 * -320.39. -1.633989 What is the product of -2456888 and 0.026? -63879.088 -21153.97 times 9.6 -203078.112 What is the product of 0.1659638 and 0.59? 0.097918642 -1.0939579 * 2 -2.1879158 Work out -989 * 0.06356. -62.86084 Work out 1 * -247099464. -247099464 -545 times -30.132 16421.94 12.6673 * -43 -544.6939 Work out -44957608 * -0.1. 4495760.8 -0.0280.2412 -1.604824 What is -0.5 times 7976566? -3988283 0.2 95341.766 19068.3532 What is -19.1 times 6.9417? -132.58647 What is the product of -308 and -2.60644? 802.78352 What is the product of 9704 and 0.4181? 4057.2424 -1.3-0.770018 1.0010234 Multiply -4.8 and 24088.77. -115626.096 -0.166 -34.9292 5.7982472 Product of 1584425 and 0.3. 475327.5 0.5 times 338739 169369.5 Calculate -436.980.223. -97.44654 What is the product of 1 and -2748.3413? -2748.3413 Work out 5679 175. 993825 -20 * -836.5613 16731.226 0.0317896 * 271 8.6149816 -1987672270.4 -79506890.8 -16238344 times -0.5 8119172 Product of 0.0036 and -268342. -966.0312 What is the product of 4.3855 and -782? -3429.461 -2 times -0.179538756 0.359077512 0.6539824.65 3.0410163 Product of -1095802.356 and -5. 5479011.78 What is the product of -92 and 0.5395? -49.634 0.38 * 8321007 3161982.66 -1.1859691 * -2 2.3719382 Product of -6 and -69197415. 415184490 -140.04173698 -0.58431772 Product of 0.04988195 and 2. 0.0997639 What is the product of 0.316002 and 0.01? 0.00316002 0.0251 152953 3839.1203 Work out 0.4 * -1728335. -691334 What is the product of -399595 and -0.07? 27971.65 What is the product of -0.04 and -202554.01? 8102.1604 What is 45130 times 53.6? 2418968 Multiply 3317 and -6912. -22927104 -7596290.19 -144329.51 What is the product of -2398237 and -4.6? 11031890.2 47 times 12950496 608673312 What is the product of 124977 and -9421? -1177408317 -0.0545894 times 0.06 -0.003275364 What is 0.1505 times -140558? -21153.979 Multiply 72862.687 and -0.6. -43717.6122 Work out -5 -4439947. 22199735 Work out -690985 * 11. -7600835 Calculate 57711471-0.8. -46169176.8 Calculate 122-356240.2. -43461304.4 -0.05 times 69284 -3464.2 Work out -8.03391023 * 4. -32.13564092 Calculate 2546.6340.6. 1527.9804 What is 59466666 times 3? 178399998 -7757-538 4173266 40 * 219464 8778560 -0.7092 * -26.6 18.86472 What is the product of 91392 and -44? -4021248 Work out 15578118.1 * -1. -15578118.1 Work out 9 * 155699950. 1401299550 What is the product of -287368 and -345? 99141960 Calculate 5163571974. 817859870 Product of 0.0932 and -1.3376. -0.12466432 Work out 260 -278.58. -72430.8 Multiply -140.403 and -0.11. 15.44433 Multiply 60129399 and -2. -120258798 -7.0339 * -12.44 87.501716 Multiply 0.63 and 6198. 3904.74 What is the product of 3 and 17.989157? 53.967471 -7772 times 2.05 -15932.6 Product of 0.01 and 3772188. 37721.88 26 times 5.9221 153.9746 2743 * -378915 -1039363845 Work out 0.3 * -16.930989. -5.0792967 15.144 * 1010 15295.44 Calculate -65.7-0.2. 13.14 906 0.48772 441.87432 Calculate -0.660195616. -3.96117366 What is 21636 times 13302? 287802072 What is 2329064 times -0.101? -235235.464 -0.924 times -4.51686 4.17357864 -97206-16 1555296 What is 127 times 72619? 9222613 522.35 times -0.92 -480.562 -18 * 55795179	{ "pile_set_name": "DM Mathematics" }
). Suppose 0 = 2c - 8, 5c - 29 + 2 = -y. Determine l(y). 19 Suppose 0k + 2k + 56 = 0. Let z = k + 33. Let b(q) = q*3 - 5q*2 - 2q + 7. What is b(z)? -3 Let j(d) be the third derivative of -8d2 + 0d + 1/12d4 - 1/120d*6 + 0d*3 + 1/20d*5 + 0. Let x be 5 - 1 - (4/4 - 0). What is j(x)? 6 Suppose -3q = 2g + 24, 14 = -4g - g + 4q. Let k(r) = 3r - 1. Give k(g). -19 Let s(f) = f + 11. Let h be (-2)/4-316/6. Suppose -m - 13 = -ho, 3m + 4o - o = -9. Determine s(m). 6 Let l(r) = 7r + 37. Let a(f) = -6f - 34. Let z(s) = 6a(s) + 5l(s). Determine z(-16). -3 Let j(q) be the first derivative of -q2/2 + 372. Calculate j(-3). 3 Let r(w) = w2 + 6w + 10. Suppose 0k = -2k - 4b - 6, 3 = 3b. Determine r(k). 5 Let g(q) = -q*3 - 3q*2 + 4q + 6. Let h = -24 + 48. Let x be 16/(-6)h/16. Give g(x). 6 Let o(g) be the third derivative of -g5/30 + g4/6 - g3/3 - 6g*2 + 15g. What is o(3)? -8 Suppose -5r + 0 = 55. Let q(d) = -2d + 7. Let p(u) = -u + 7. Let v(c) = -3p(c) + 2q(c). Let s be v(r). Let i(m) = -m*3 + 5m*2 - 4m - 5. What is i(s)? -5 Let a be (-6)/535/(-21). Suppose 9b - a + 20 = 0. Let z(g) = -11g2 - g3 + 16g*2 - 7g*2 + 2 - 2g. Determine z(b). 6 Let p be ((-3)/8)/((-2)/16). Let g(r) be the second derivative of -5/6rp + 0 - 1/12r*4 - 5/2r*2 + 9r. Give g(-5). -5 Let k(o) = 3o3 + 0o - 2o - 2o*3. Let r be k(2). Let v(g) = -r + g - 3g*3 + 0g + 3g2 + 2g*3 + 3g. Calculate v(3). 8 Let x(u) = -u*2 - u - 1. Let n(i) = 4i*2 + 7i + 11. Let k(l) = -n(l) - 5x(l). Let y be 1/6-2-18. Calculate k(y). 18 Let r(j) be the third derivative of 1/60j*5 + 1/8j*4 + 0j + 0 - 1/6j3 + 13j2. Suppose w + 0 + 3 = 0. Calculate r(w). -1 Let w(n) = -n2 + 13n + 5. Let g be 12/6 - (-8 - 1). Determine w(g). 27 Suppose o + s - 4 - 16 = 0, 0 = -3o + 5s + 36. Let m = o - 12. Let i(j) = -2 + m - 251j*2 + 250j*2. Determine i(4). -13 Let b be (-10)/6(-7 - -4). Suppose 0 = -2w - b + 1. Let t(k) = 1 + k2 + 4k*3 + 2k*2 - 3k*3 + 2k. Calculate t(w). 1 Let j = -37 + 36. Let q(p) = p. Let y(k) = k + 6. Let d(u) = jq(u) - y(u). Determine d(-6). 6 Let f(l) be the second derivative of l5/20 + l4/12 - l3/3 - 13l*2/2 + 4l. Let v(w) be the first derivative of f(w). Let o be -2 + (0 - 0/3). Give v(o). 6 Let t be ((-2)/6)/((-2)/30). Suppose -5 = -tz + 5. Let v(k) be the second derivative of -k4/12 + k3/6 - 103k - 1. Determine v(z). -2 Let v(z) = -z - 1 + 5 + 0z. Let k(m) = 3 + m2 - 7 - 7m - 3m. Let x be k(10). What is v(x)? 8 Let n(f) = f2 + 1. Let v(h) = -h3 + 6h*2 + h - 2. Let g(u) = -n(u) - v(u). Calculate g(7). -6 Suppose n - b + 1 = -0n, 0 = -4n - b - 24. Let y(q) = 5q - 1. Let l(m) = -11m + 2. Let s(k) = -4l(k) - 9y(k). Give s(n). 6 Let r(t) be the first derivative of t3/3 + 17t*2/2 + 6t - 100. Give r(-16). -10 Let w(k) be the third derivative of -k6/144 - k5/60 - 25k4/24 - 21k2. Let f(a) be the second derivative of w(a). Determine f(-4). 18 Let w(y) = -y3 + 5y2 + 3y - 7. Suppose -9h + 4h + 75 = 0. Suppose 4n - n = h. Give w(n). 8 Let m(j) = 2j*2 - 7j - 1. Let u be m(4). Let g(l) = -2 - 9 + 17 + ul - 1. Determine g(-4). -7 Suppose -8g - 10 = -82. Let d(z) = -27z2 + 15z*2 + 13z*2 + 8z + g. Let u be (1 - 24) + 0. Calculate d(u). 2 Let y(z) = -2z*3 - 8z + z*3 - 8z*2 - 2 - 2. Suppose 0 = -332w + 326w - 42. What is y(w)? 3 Let q be 74/8 + (-6)/24. Let y(c) = -c3 + 9c*2 + c - 4. What is y(q)? 5 Let w(s) = 247s - 1 - 1 + 243s - 488s + 25s2. Give w(1). 25 Let g(h) = -4h*2 - 2h + 4. Let q = -83 + 83. Suppose -5a - 4s = s + 15, -4a - s - 12 = q. What is g(a)? -26 Suppose -2t - 5 = -5l, -2t + 3 = 3l - 0t. Let f(s) = -15s2 - 6s - 13. Let g(w) = -5w2 - 2w - 5. Let p(z) = -3f(z) + 8g(z). Determine p(l). 6 Let q be -6(-4 - 26/(-6)) - 1. Let i(u) = u3 + 3u*2 - 3u + 4. Give i(q). 13 Let y(d) = d*3 - 6d*2 + 2d - 6. Let z = -115 - -117. Suppose 2p + 8 = 3t, zt - 7p = -2p - 13. Determine y(t). 6 Suppose 7i - 89 = -154 + 79. Let c(o) = -2 + 0o + 1 + 3o. What is c(i)? 5 Let i be (-189)/(-35) + 4/(-10). Let v = i - 1. Let o(r) = 41 - 4r - 24 + 8r - r*2 - 18. Determine o(v). -1 Suppose 50 = 6r + 4r. Let w(q) = -q2 + 2q - 1. Give w(r). -16 Let c(q) = 5q3 - 14q*2 + 9q - 8. Let n(b) = 9b3 - 27b*2 + 18b - 15. Let z(p) = -7c(p) + 4n(p). Give z(9). -4 Let y(n) = 7n + 165. Let r be y(-25). Let w(l) = -l2 - 10l - 6. Give w(r). -6 Let n(l) = l*2 + 5l + 2. Suppose 4d = 2h + 16, -5h - 88 = -d + 3d. Let q be -3 + 3/((-12)/h). Let b = -7 + q. What is n(b)? 8 Suppose 256 = -55w + 23w. Let r(d) = d + 5d + 5 - 2d - 3d. Determine r(w). -3 Let n(o) = -8o3 - o2 + 4o - 2. Let y be n(1). Let g(j) = j3 + 7j*2 - j - 4. Give g(y). 3 Let i(l) be the first derivative of 9l*2/2 - l - 2464. Let n(v) = -v + 5. Let p be n(4). Calculate i(p). 8 Let x(o) = -2o3 - o2 + 3o - 2. Suppose 4d = 3b + 5d + 9, -3b - 3d = 15. Calculate x(b). 4 Let i(s) = -5s + 1. Let f(o) = 9o - 1. Let n(g) = g*2 + 11g + 17. Let z be n(-8). Let m(r) = zi(r) - 4f(r). Calculate m(6). -9 Let u be 14/452/91. Let w(y) be the second derivative of -y3 + 3y + y*u - y - y. Give w(3). -16 Let o(i) = -15i + 215. Let h be o(14). Let m(d) = -d*3 + 6d*2 - 6d + 2. What is m(h)? -3 Let g(a) = -a*2 + 28a + 63. Let w be g(30). Let j(d) = d*3 - 4d*2. Give j(w). -9 Let o(j) = 3j*3 + 48j*2 + 48j + 20. Let p(q) = -4q3 - 64q*2 - 64q - 27. Let r(w) = 11o(w) + 8p(w). What is r(-15)? -11 Let s(z) = -3z + 3. Let v = 77 + -135. Let d = 55 + v. Give s(d). 12 Let f be -2 + (5 - 3) - -4. Suppose -2b + f = -4q - 12, -3q + 5b = 5. Let a(y) = -1 - 3 + 8y*3 - 7y - 14y3 + 5y*3 - 6y*2. Give a(q). 6 Let u(g) be the first derivative of 3g*2 + 5g + 529. What is u(-2)? -7 Let r = 95 + -37. Let g = r - 40. Let b be (-1)/(-1 + 21/g). Let q(n) = -n*3 - 7n*2 - 5n + 4. Calculate q(b). -2 Let z(v) be the first derivative of v*3/3 - 4v*2 + 5v - 7. Give z(7). -2 Let f(m) = 1 - 122m - 130m + 377m - 127m. What is f(2)? -3 Let o(q) = 4q2 + 2q - 1. Let v(x) = 4x2 + 3x - 1. Let h(w) = 5o(w) - 4v(w). Let d = -10345 + 10344. What is h(d)? 5 Suppose -2z - 61 + 63 = 0. Let i(q) be the third derivative of q6/144 + q5/120 + q4/24 + q2. Let g(f) be the second derivative of i(f). Calculate g(z). 6 Suppose 6s = 3u + 4s - 16, 3s - 12 = 0. Let i(l) = 2l - 11. Calculate i(u). 5 Let u(x) = -6x - 12. Let r(f) = -11f - 23. Let o(y) = -3r(y) + 5u(y). Let q be (-6 - ((-75)/(-10) + -3))(-4)/(-6). Give o(q). -12 Let m(a) be the first derivative of -a2/2 + 3a - 3. Let k = 5786 + -5784. Determine m(k). 1 Let u = 713 + -713. Let c(n) = -n + 3. Let s be c(0). Let a(t) = t*3 - 2 - s - 2t3. Calculate a(u). -5 Let i(y) be the first derivative of y3/3 - 3y2/2 - 14y + 809. What is i(6)? 4 Let p = 2 + 0. Let t = 24 + -12. Let q(o) = o + 0 + 4 - 3 + top. Calculate q(-1). 12 Suppose 4f - 9f - 10 = 2h, 3f + 2h + 10 = 0. Let k(s) = 14 - s - 2s2 - 7s*2 + 2 + 8s*2. What is k(f)? 16 Let t(d) = 13d*3 + 24d*2 + 29d - 16. Let p(i) = 7i - 4 - 2i*2 - 13i*3 + 8i*2 + 16i*3. Let n(k) = 9p(k) - 2t(k). Calculate n(-5). -4 Let s(b) = 410b + 408b - 817b. What is s(7)? 7 Let w(i) = -2 + i + 4i + 5. Let u(y) = 16y + 8. Suppose 4s - 22 = 6s. Let k(r) = sw(r) + 4u(r). What is k(-1)? -10 Let u(k) be the first derivative of k*2 + 3k + 1879. Let o be -1 + 0 + (-1)/1. Determine u(o). -1 Let m(p) = -5p - 16. Let c be m(-2). Let g(t) = -t3 - 5t*2 + 10t + 14. What is g(c)? -10 Let q(w) = -3w. Let f be q(-2). Let t(s) be the first derivative of s4/24 + 2s*3/3 + 15s*2/2 - 14. Let p(o) be the second derivative of t(o). Give p(f). 10 Let p(l) = -95l + 31l + 33l - 20 + 33l. Determine p(13). 6 Let s(k) be the second derivative of k3/3 - k2/2 - k. Suppose -11c + 45 + 21 = 0. What is s(c)? 11 Let d(c) = c*3 + 5c*2 + 4c + 4. Suppose 10 + 10 = m - 5y, -m - 15 = 2y. Determine d(m). -16 Let o be 7 + (50/(-60) - (-38)/(-12)). Let f(a) = -a + 8. Determine f(o). 5 Let x be (40/6 + -5)*3. Let r(m) be the second derivative of 0 + 7	{ "pile_set_name": "DM Mathematics" }
7, 138043, 138263, 138601, 139081, 139727? 140563 What is the next term in 266739, 533470, 800195, 1066914, 1333627? 1600334 What is the next term in 702, 1487, 2732, 4437? 6602 What comes next: 40, -362, -1702, -4448, -9068, -16030? -25802 What is the next term in 25524, 24884, 24244, 23604, 22964? 22324 What is next in -3076979, -6153960, -9230939, -12307916, -15384891, -18461864? -21538835 What comes next: -3134, -12530, -28188, -50108, -78290, -112734, -153440? -200408 What is the next term in -300939, -300856, -300721, -300534? -300295 What is the next term in -2981, -6449, -9917, -13385? -16853 What comes next: 6746, 13756, 20764, 27770, 34774, 41776, 48776? 55774 What is next in 5124549, 10249099, 15373649, 20498199? 25622749 What is the next term in 574404, 1148777, 1723150? 2297523 What is next in -17936, -37205, -56478, -75755, -95036? -114321 What comes next: -283214297, -283214285, -283214259, -283214213, -283214141, -283214037, -283213895, -283213709? -283213473 What is the next term in 1777123, 3554222, 5331321, 7108420? 8885519 What is the next term in -27743, -27646, -27485, -27254, -26947, -26558, -26081, -25510? -24839 What comes next: 156877852, 156877851, 156877850, 156877849, 156877848? 156877847 What is next in 1426234, 1426198, 1426116, 1425970, 1425742, 1425414? 1424968 What is next in 16875, 16301, 15321, 13935, 12143? 9945 What is the next term in -375327061, -375327060, -375327059? -375327058 What comes next: -1125209, -2250113, -3375015, -4499915, -5624813, -6749709? -7874603 What comes next: -577770, -577817, -577864, -577911? -577958 What is the next term in -5096, -23237, -53472, -95801, -150224, -216741? -295352 What is next in -16968, -18102, -19210, -20280, -21300, -22258, -23142? -23940 What comes next: 76065964, 76065960, 76065954, 76065946, 76065936, 76065924? 76065910 What is the next term in 274, 529, 702, 739, 586? 189 What comes next: 9723, 9699, 9657, 9597, 9519? 9423 What is next in -1306322, -2612576, -3918830, -5225084, -6531338? -7837592 What is next in -5193, -5205, -5243, -5313, -5421, -5573? -5775 What comes next: -3346529, -6693089, -10039669, -13386269, -16732889, -20079529, -23426189? -26772869 What comes next: 478, 3782, 12756, 30226, 59018, 101958, 161872, 241586? 343926 What comes next: -1128, -1077, -1018, -951? -876 What comes next: 322866, 644838, 966810, 1288782? 1610754 What is next in 20803, 34520, 48237, 61954? 75671 What is next in -38454066, -38454065, -38454064, -38454063, -38454062? -38454061 What is next in 204517, 409031, 613545, 818059, 1022573, 1227087? 1431601 What comes next: 42024, 169740, 383152, 682266, 1067088, 1537624, 2093880? 2735862 What is the next term in -5559, -8697, -11831, -14961? -18087 What is next in -1654, -825, 546, 2453, 4890, 7851? 11330 What is the next term in 280626, 280596, 280550, 280488? 280410 What is next in 1670185, 1670188, 1670191, 1670194? 1670197 What is next in -1209921, -2419960, -3629979, -4839972, -6049933, -7259856, -8469735? -9679564 What comes next: 1316809, 1316822, 1316835? 1316848 What is the next term in 107506, 107608, 107700, 107770, 107806? 107796 What is next in -840588, -840588, -840590, -840594? -840600 What is the next term in 418436, 418424, 418412? 418400 What is next in 43638, 52243, 60850, 69459? 78070 What is the next term in 5061, 5006, 5195, 5748, 6785, 8426, 10791, 14000? 18173 What comes next: -365, -2514, -8277, -19460, -37869, -65310, -103589? -154512 What is the next term in 8287177, 8287189, 8287201, 8287213, 8287225, 8287237? 8287249 What is the next term in -100951656, -100951657, -100951658, -100951659, -100951660, -100951661? -100951662 What is the next term in 1829, 7278, 16389, 29204, 45765? 66114 What is the next term in 3187820, 3187851, 3187886, 3187925? 3187968 What is next in 8578, 9279, 9992, 10723, 11478, 12263? 13084 What is the next term in -101041, -404033, -909021, -1616005? -2524985 What comes next: -2856587, -11426128, -25708625, -45704078, -71412487, -102833852? -139968173 What is next in -2664820, -2664816, -2664812, -2664808? -2664804 What is the next term in 1057981, 2115968, 3173955, 4231942, 5289929, 6347916? 7405903 What is the next term in 10331, 41343, 93131, 165791, 259419, 374111, 509963, 667071? 845531 What is next in -1348295021, -2696590042, -4044885063, -5393180084? -6741475105 What is next in 127690, 255374, 383072, 510790, 638534, 766310, 894124? 1021982 What is the next term in 1066325, 1066343, 1066367, 1066397, 1066433, 1066475? 1066523 What comes next: -199076, -197883, -196690, -195497, -194304? -193111 What comes next: -1863, -3393, -4281, -4533, -4155, -3153, -1533, 699? 3537 What is next in -15612, -15968, -16358, -16782, -17240, -17732, -18258? -18818 What is the next term in 1358, 1627, 2362, 3797, 6166, 9703, 14642? 21217 What is the next term in -40254, -38480, -36720, -34980, -33266? -31584 What is the next term in -893, 1226, 3347, 5470, 7595, 9722? 11851 What comes next: 206709, 206743, 206777, 206811? 206845 What is the next term in -103416385, -103416387, -103416389, -103416391, -103416393? -103416395 What is next in -5631172, -5631173, -5631174, -5631175, -5631176? -5631177 What is next in 14020, 28573, 43158, 57793, 72496? 87285 What is the next term in -6826403, -6826405, -6826407, -6826409, -6826411, -6826413? -6826415 What is the next term in 125847, 251789, 377753, 503751, 629795, 755897, 882069? 1008323 What comes next: -1065, -2150, -3145, -4002, -4673, -5110, -5265? -5090 What is the next term in 10472, 20797, 31120, 41441, 51760? 62077 What is the next term in -808, -1358, -2234, -3400, -4820, -6458, -8278? -10244 What is the next term in 11779, 47126, 106033, 188500, 294527? 424114 What is next in -16098, -16103, -16118, -16149, -16202? -16283 What comes next: 126395, 252813, 379227, 505631, 632019, 758385, 884723, 1011027? 1137291 What comes next: 6111, 24462, 55055, 97890, 152967? 220286 What is the next term in -908663, -908699, -908725, -908735, -908723, -908683? -908609 What is next in 1027, 1205, 1461, 1789, 2183? 2637 What is next in 443187, 886374, 1329559, 1772742, 2215923? 2659102 What is next in 15421512, 15421511, 15421510, 15421509, 15421508? 15421507 What is the next term in 706990, 706988, 706974, 706942, 706886, 706800, 706678? 706514 What comes next: -38465, -153871, -346213, -615491, -961705? -1384855 What is the next term in -1823, -6918, -15453, -27434, -42867? -61758 What is the next term in 65748, 65666, 65584, 65502, 65420? 65338 What is next in 282647, 565301, 847957, 1130615, 1413275, 1695937? 1978601 What is the next term in -233064, -466851, -700638, -934425, -1168212? -1401999 What is the next term in 615363, 1230725, 1846087, 2461449, 3076811, 3692173? 4307535 What is the next term in -127922, -127870, -127784, -127664, -127510, -127322? -127100 What comes next: -20616, -21018, -21420, -21822, -22224? -22626 What comes next: -1292117, -2584173, -3876229? -5168285 What is the next term in 11643, 11791, 11939, 12087, 12235? 12383 What comes next: 1428791, 1428787, 1428783? 1428779 What is the next term in -22848, -22167, -21486? -20805 What is the next term in 244, 212, 140, 40, -76, -196, -308, -400? -460 What is next in 23035, 24160, 25299, 26458, 27643, 28860, 30115, 31414? 32763 What comes next: -2469100, -2469097, -2469094, -2469091, -2469088, -2469085? -2469082 What comes next: -98, 1852, 7934, 20230, 40822, 71792, 115222? 173194 What is next in 86351849, 345407386, 777166615, 1381629536, 2158796149, 3108666454, 4231240451? 5526518140 What is the next term in 1850, 1946, 2066, 2222, 2426, 2690, 3026? 3446 What comes next: 34, 1442, 4212, 8344, 13838? 20694 What is the next term in -21986, -43982, -65972, -87956, -109934, -131906, -153872? -175832 What is the next term in -47235, -94531, -141831, -189135, -236443, -283755, -331071? -378391 What is the next term in 3282934, 6565875, 9848816, 13131757, 16414698, 19697639? 22980580 What is the next term in -1292342, -10338608, -34892736, -82708658, -161540306, -279141612? -443266508 What comes next: -3250, -21480, -69684, -162850, -315966, -544020, -862000? -1284894 What comes next: 13228, 105475, 356020, 844063, 1648804, 2849443, 4525180? 6755215 What comes next	{ "pile_set_name": "DM Mathematics" }
-1 Is -486 greater than -487? True Is -116 greater than -116? False Is -66/7 less than 246? True Which is smaller: 632/37 or 17? 17 Which is smaller: -6567 or -6570? -6570 Are -179 and -179 nonequal? False Which is smaller: -43 or -25? -43 Do 0 and 3/7 have the same value? False Do -1 and -20/1149 have different values? True Is 21 greater than or equal to 14? True Is 4459 at least as big as 4456? True Is 132 at most 134? True Is 67/131 bigger than 2? False Do -85 and -83 have the same value? False Which is smaller: -196 or -199? -199 Is 312 smaller than 311? False Is 0.1441 > 0.2? False Which is greater: -1372/9 or -151? -151 Which is greater: 0.4 or -0.514? 0.4 Which is smaller: -11 or -6/7? -11 Is 13 bigger than 592/45? False Do -10/127 and -1 have different values? True Are -1 and 5/3724 equal? False Which is smaller: -1 or 7/705? -1 Is 49/1641 != 0? True Which is greater: 136 or 131? 136 Which is greater: 55 or 488/9? 55 Which is bigger: -710 or -8? -8 Is -2/867 at least as big as 3/8? False Is -1 != -8/349? True Is -503 less than -503? False Is -10990 equal to -10990? True Do 14 and -11 have the same value? False Which is smaller: -389 or -390? -390 Is 17 less than -0.22? False Is 79 greater than or equal to 79? True Is -109 greater than or equal to -128? True Is -599 >= -599? True Are -8 and -19 non-equal? True Which is smaller: 557 or 2? 2 Which is bigger: 4/13 or 0? 4/13 Is 0 at least 2/1697? False Is 507 less than 501? False Is 62/7 at least 10? False Is -6/7 not equal to 0? True Which is smaller: -101 or -126? -126 Which is greater: 0 or -3/256? 0 Which is bigger: 4077 or 4076? 4077 Which is greater: 2 or -3/1810? 2 Is 1269 < 1274? True Is 107 at most as big as 107? True Is -9 at least as big as -7? False Is 197 less than 191? False Is -2 smaller than -0.905? True Which is smaller: -1 or -10/5047? -1 Which is greater: -0.05 or 40? 40 Which is smaller: 3500 or 3490? 3490 Is -1 at least as big as -14/19? False Which is bigger: 0.193 or -1/5? 0.193 Is 1 equal to 23/185? False Which is bigger: -2 or -165? -2 Is 0 smaller than -29? False Is 0 at most -4/69? False Which is smaller: -814 or -815? -815 Which is bigger: -125 or -127? -125 Which is bigger: -39 or 193? 193 Which is smaller: -27/43 or -1? -1 Is 14/5 smaller than 0.03? False Which is bigger: -2/3 or 434? 434 Is 14674 > 14674? False Is -31 bigger than -406/13? True Which is bigger: -284 or -2/3? -2/3 Which is bigger: -0.1 or -27? -0.1 Is -73 not equal to -32? True Is -337 greater than -339? True Is 5226 != 5226? False Is 879/19 bigger than 46? True Is -4/3097 at least as big as -1? True Is 8549 > 8550? False Which is greater: -9/1537 or 1? 1 Is -68/7 greater than or equal to -10? True Is 0 >= -3/1180? True Is 2/4245 bigger than 1? False Which is smaller: 102 or 91? 91 Which is smaller: -2/20231 or 0? -2/20231 Which is bigger: -69 or -70? -69 Is -3484 less than -4? True Which is greater: 14 or -120? 14 Which is greater: -10/77 or 0? 0 Which is greater: -4378 or 1? 1 Are -1 and 7/46 nonequal? True Which is smaller: 118 or 115? 115 Which is greater: 1143 or 8010/7? 8010/7 Which is bigger: -4310 or -4316? -4310 Is -3/6001 at least -1? True Is -1/29106 >= 0? False Are -0.2 and -220 unequal? True Which is smaller: 346/27 or 12? 12 Which is smaller: -1912 or -1915? -1915 Is -1044 < -1046? False Is -1199 at least as big as -1200? True Which is bigger: 122 or -2/19? 122 Is 1 at most as big as -11/468? False Does 0 = 9490? False Is -76 at most as big as -1270/17? True Which is smaller: -4 or -1092? -1092 Which is smaller: 260 or 261? 260 Is 11 less than -0.7? False Which is bigger: -219/103 or -3? -219/103 Which is bigger: 25 or 2? 25 Is 34 at least 265/8? True Which is greater: 3/314 or 1? 1 Which is bigger: 0 or -27/107? 0 Is 1 at least 0.0113? True Which is greater: -1168 or -1167? -1167 Do 4202 and 4202 have the same value? True Is 1/17 smaller than 33? True Is -1604 != 2/3? True Is -9 at least as big as -54? True Is 108 less than 2/9? False Is 1237 bigger than 1237? False Which is greater: 245/6 or 40? 245/6 Which is smaller: 0.13 or -3? -3 Is 1688/25 not equal to 67? True Which is smaller: -14517 or -14518? -14518 Is -188/7 at least -4? False Is -25684 bigger than -25684? False Which is smaller: 146 or 6? 6 Which is smaller: -725 or -726? -726 Is 93 < 92? False Which is smaller: 0.2 or 4.3? 0.2 Does 9/3569 = -1? False Is 0.55 at most as big as 4? True Is 2/157 <= 1? True Is -1 less than or equal to 34.98? True Is 3232 at least as big as 3235? False Is -1 < 82? True Which is bigger: -2/355 or -1? -2/355 Which is smaller: -2/3925 or -1? -1 Which is smaller: 1/2 or -208? -208 Is 1/3502 <= 0? False Is 0 less than -9/190? False Are 3 and -84 unequal? True Is -480 < -0.1? True Which is bigger: -1/935 or 1? 1 Is 84/73 at most 1? False Is 285 >= 304? False Which is smaller: -1 or -97/66? -97/66 Is -438 < -436? True Which is smaller: 19/6 or 3? 3 Is 1 greater than or equal to -314? True Which is bigger: 0.3 or -2525? 0.3 Which is bigger: 0.06 or -4/29? 0.06 Which is bigger: 0 or 93/229? 93/229 Which is greater: 58 or 57? 58 Is -209/56 greater than -3? False Which is greater: -21 or -470/21? -21 Is -1 >= 11/600? False Is -6 bigger than -11? True Which is smaller: -1097 or -1107? -1107 Which is greater: -1 or -39/98? -39/98 Is 2 not equal to -4? True Are 20 and 0 nonequal? True Which is smaller: -9 or -1/13? -9 Which is smaller: -36 or -14? -36 Is -17 greater than -342? True Is -0.233 greater than or equal to -3? True Is -0.0705 > -9? True Which is bigger: -108 or 78? 78 Which is smaller: -6/12923 or 0? -6/12923 Which is smaller: 31 or 30? 30 Which is smaller: -2/1321 or -1? -1 Which is smaller: -1 or 3/6670? -1 Which is greater: 4/8137 or 1? 1 Which is bigger: 408 or -3/5? 408 Is 12868 <= 12868? True Is -434 less than -435? False Is 62 equal to 63? False Is 161/24 not equal to 7? True Is -822/49 > -17? True Which is smaller: 90 or 547/6? 90 Which is smaller: -342 or -346? -346 Which is bigger: -1 or -29/23? -1 Are 0.4 and 0.395 non-equal? True Do 2/25 and 0 have different values? True Does -130 = -128? False Which is smaller: -66/211 or -1? -1 Which is bigger: -39 or -340/9? -340/9 Is 13394 equal to 13394? True Is -16277 less than or equal to -0.1? True Does 564 = 565? False Which is greater: 2/7 or -823? 2/7 Which is bigger: -1 or -2/14459? -2/14459 Is -0.2 at most -0.166? True Which is smaller: 3 or 31/7? 3 Is 17 at least 17? True Is -34 smaller than -2/7? True Is -310 > -312? True Is -1 != -31? True Which is greater: 191 or 150? 191 Which is greater: 244 or 1713/7? 1713/7 Which is smaller: -80 or -403/5? -403/5 Which is greater: 15/38 or -1? 15/38 Are 19 and 51 equal? False Is 4252 at most 0.2? False Which is smaller: 28 or 30? 28 Which is bigger: 486 or 488? 488 Do 206 and 207 have the same value? False Are -1191 and -4769/4 equal? False Which is greater: 1/249 or 1? 1 Are 945 and 945 equal? True Is 39 bigger than 561/14? False Which is greater: 19.6 or 0.1? 19.6 Is -7 >= -156/19? True Which is smaller: 1/31160 or -1? -1 Which is bigger: 0 or -625? 0 Which is smaller: -7/429 or 1? -7/429 Is -220 < -220? False Which is smaller: -3 or -257/166? -3 Is -20 <= -0.1? True Which is smaller: 26 or 15? 15 Is -1/2 at most as big as 61? True Which is smaller: 261 or 23? 23 Are 2/15089 and 0 equal? False Which is smaller: -768/29 or -26? -768/29 Which is smaller: -1164 or -1165? -1165 Which is smaller: -4640 or -4639? -4640 Which is smaller: -2 or 37/5? -2 Which is greater: -2 or -2607? -2 Is 8/371 equal to -1? False Which is smaller: 93/5 or 19? 93/5 Which is bigger: 21 or 16? 21 Are 107/38 and 3 equal? False Which is smaller: 1 or 9/1268? 9/1268 Are -10 and -32 equal? False Is -32/9 smaller than -5? False Is 4/211 smaller than 1? True Which is bigger: 9 or -68? 9 Which is bigger: -0.1 or 1/48? 1/48 Is 0 greater than -2/63? True Which is smaller: -4 or -26/17? -4 Which is bigger: -1657 or -1659? -1657 Is 9/89 not equal to 1? True Is 1338 < 1338? False Which is smaller: -35 or -40? -40 Is 70 less than 1188/17? False Is 588 >= 589? False Do 21434/9 and 2381 have the same value? False Is -3 > -70? True Which is greater: -1 or 1/17916? 1/17916 Which is greater: 19/2886 or 1? 1 Which is smaller: 1 or	{ "pile_set_name": "DM Mathematics" }
igit of q? 3 What is the units digit of ((-51)/34)/((-6)/45072)? 8 Let y(d) = d*3 - 7d*2 - 11d + 33. Let s be y(8). What is the units digit of (-6004)/(-32) + 2s/48? 8 Let i(f) = 49f*2 + 11f - 32. Let g be i(4). Suppose 0 = 2q - 5s - g, -4q + 5s = -5q + 368. Suppose -4t = -q - 144. What is the tens digit of t? 3 Let y(g) = g*3 - 19g*2 + 5g - 5. Let c be y(8). Let p = -58 - c. What is the tens digit of p? 1 Let j = -2065 - -2435. What is the units digit of j? 0 Let u = 10696 - 5454. What is the tens digit of u? 4 Let p(d) = -3d + 20. Suppose -g = -3u + 18, 4g + 3u = 6g + 21. Let c be p(g). What is the units digit of c + -30 + 249? 7 Let i = 368 - 373. Let b(g) = g*3 + 7g*2 + 6g + 11. What is the tens digit of b(i)? 3 Suppose 21435 = 4f + 2w - 79399, -3f = 3w - 75627. What is the units digit of f? 8 Let u(v) = 2v3 - 79v*2 - 111v - 859. What is the tens digit of u(47)? 5 Let f = -3640 - -5251. Suppose -2968 = -4t - 3q, 2t + 127 = -5q + f. What is the tens digit of t? 4 Let n(g) = -2g2 + g3 - 2 + 4g*2 + 76g + 2g2 - 79g. Let d be n(3). What is the units digit of (162/8)/(13/d)? 1 Let w = 163614 + -87604. What is the units digit of w? 0 Let x(o) = o*2 + 15o + 14. Let f = -2 - 12. Let g be x(f). Suppose g = -54v + 50v + 344. What is the tens digit of v? 8 Let z(c) = -183c3 - 3c*2 + 7c + 30. What is the thousands digit of z(-5)? 2 Let j = 2 + 549. Let f = j - 364. What is the tens digit of f? 8 Let h be 68/6(-12 - -9). Let c = h - -39. Suppose -26 = -2n - 2r, cn - n = r + 47. What is the tens digit of n? 1 Let c(b) = 36 - 32b - 12b + 11b + 10 - 17b. What is the thousands digit of c(-22)? 1 Let o = 482 + 74. Let n = 341 + o. What is the tens digit of n? 9 Let z(q) = -q*3 + 8q*2 - 3q + 1. Let f be z(8). Let m = -10 - f. Suppose -mw - 303 = -16w. What is the hundreds digit of w? 1 Let c be (-3 - 1) + 1323. Suppose 10f = 11f - c. What is the units digit of f? 5 Let h = -159 + 149. What is the units digit of -7 + (-2336)/(-40) - (-4)/h? 1 Let r(t) = -135t + 5. Let a be r(9). Let u be ((-1)/(-2))/(11/a). Let f = u - -149. What is the tens digit of f? 9 Suppose -8308 = -30l + 15482. Let q = l - 325. What is the hundreds digit of q? 4 Let r = 50 - 110. Let y = -62 - r. Let t(q) = -14q*3 + 3q*2 + 4q + 2. What is the hundreds digit of t(y)? 1 Let s be (4/(-6))/((-24)/(-18))-6. Suppose 0m - sm = -27. What is the units digit of m? 9 Suppose 0 = 4l - 5l + 82. Let q = 82 - l. Suppose 5c - 255 = -d, q = 2c - 5d - 23 - 79. What is the tens digit of c? 5 Suppose 0 = -a + 1 + 5. Suppose -aw + 33 = -5w. Let b = -15 + w. What is the units digit of b? 8 Let j = 19965 + -4696. What is the thousands digit of j? 5 Let u(k) = 3k + 12. Let q be u(-4). Suppose q = -j + 303 + 52. What is the units digit of j? 5 Let q(v) = v2 - v. Let t(o) = -184o*2 - 6o - 1. Let f(d) = d*2. Let x(b) = -6f(b) + t(b). Let y(l) = 6q(l) - x(l). What is the units digit of y(1)? 7 Let y(f) = 540f*2 + 228f + 55. What is the hundreds digit of y(-9)? 7 Suppose -s + 497 = -2i, 0 = 2i - 4i - s - 507. Let v(p) = -p3 + 15p*2 - 10p - 33. Let n be v(10). Let k = n + i. What is the units digit of k? 6 Let j = 526 - 474. Suppose -d - 3k + 8 = k, -2d = -k - j. What is the tens digit of d? 2 Let q(w) = -29 - 4w + 12w - 10w. Let m be q(-15). What is the hundreds digit of (-357)/(0 + -3) + m? 1 Suppose -r - 4 = 0, 4f - 1 = r + 39. What is the hundreds digit of ((-30)/25)/(f/(-1335))? 1 Let y = 9028 + -1884. What is the tens digit of y? 4 What is the tens digit of (-3)/((-8)/168 - 6/63)? 2 Let s(i) = -31i + 51. Let c(h) = 1. Let r(q) = 4c(q) - s(q). What is the hundreds digit of r(7)? 1 Let c = -29197 - -41524. What is the tens digit of c? 2 Let v = 1 + 5. Let q(j) = -163j - 7661. Let m be q(-47). Suppose -vf + 216 + 60 = m. What is the units digit of f? 6 Let s(l) = 47l2 + 211. What is the thousands digit of s(9)? 4 Let s(x) = 119x*3 - 4x*2 - 10x + 13. What is the thousands digit of s(4)? 7 Suppose c = -6c + 2226. Let m be c/(-4)90/(-27). Suppose 4n + 5q - 384 = 0, -5n + 2q + m = -182. What is the tens digit of n? 9 Let k(g) = -8g + 2g - 7g2 - g3 + 5g*3 + 16 - 43 - 7g*3. What is the hundreds digit of k(-7)? 7 Suppose -5r + 39 = 139. Let z = r + 38. What is the tens digit of 223/z15? 5 Let w = -377 - -5832. What is the units digit of w? 5 Let n(z) = z*2 + 4z - 10. Let b be n(-9). Let p = -20 + b. Suppose 21 = 2c - 4r - 15, c - p = r. What is the tens digit of c? 1 Let a = -57 + 31. Let x be (-9390)/a - (-42)/(-273). Suppose 0 = 6k - x - 173. What is the tens digit of k? 8 Suppose -2i = -5i + 225. Let j(x) = 2x*2 + 11x. Let z be j(-10). Let a = z - i. What is the tens digit of a? 1 Let l = 9 - 4. Suppose 18 = 3m + 3i, -2m - li + 22 - 7 = 0. What is the hundreds digit of ((-10)/(-4))/(m/210)? 1 Suppose -4y + 5s = -12842, -25y - 2s = -29y + 12824. What is the thousands digit of y? 3 Suppose -6 = 10k - 8k. Let c be k/9(-72)/12. Suppose -cu = -2a - 536, 3a = -0u - 3u + 816. What is the hundreds digit of u? 2 Let f be (-95)/38 - 22/(-4). Suppose 299 = 3h - 2h - 4a, h - fa = 303. What is the hundreds digit of h? 3 Suppose 13h - 2069 - 8043 = 18137. What is the units digit of h? 3 Let q be 0 - (-1 + -5 + 3). Suppose -922 = -qx - 103. Suppose -5y - o = -341, o - 2o = 4y - x. What is the units digit of y? 8 Suppose 68m - 48 = 56m. Suppose 0 = -3r + mt + 578, 3r + 11t = 6t + 533. What is the tens digit of r? 8 Suppose 0 = -3f + g + 133333, -92f + g = -91f - 44439. What is the tens digit of f? 4 Suppose -2h + 36740 - 16720 = -76116. What is the ten thousands digit of h? 4 Suppose 5y = -a + 2a - 56, 3a = y + 14. Let s = 15 + y. Suppose -sv + 8v = 252. What is the tens digit of v? 6 Let r(z) = z*3 - 11z*2 - 26z + 8. Let g be r(14). Let u = g - -65. What is the tens digit of u? 9 Let a(s) = 3s2 - 110s - 344. What is the tens digit of a(-37)? 3 Let f = 22891 - 5901. What is the hundreds digit of f? 9 What is the units digit of ((-9380)/(-5))/((-12)/(-24))? 2 Let w = -7455 + 4188. Let l = -2227 - w. What is the units digit of l? 0 Suppose -3q - 67 = -g, -4g + 11q - 7q = -268. Suppose k - 48 = g. What is the hundreds digit of k? 1 Suppose -2c - 182103 = -5n, -2n = -115c + 120c - 72847. What is the hundreds digit of n? 4 Suppose -9 = -5x + 1. Let f(h) be the first derivative of 7h3/3 - 3h*2/2 + 5h + 4. What is the tens digit of f(x)? 2 Let y = -499 - -502. Suppose 3k - 1475 = -4u, 495 = 12k - 11k + yu. What is the hundreds digit of k? 4 Suppose b = -k + 34183, -k + b + 102513 = 2k. What is the ten thousands digit of k? 3 Suppose 18u - 20u - 12 = 0. Let p be (4 - 1) + (-7 - u) - -1. What is the units digit of p3/((-27)/(-195))? 5 Suppose 4m - g = -0g - 20, -16 = -4g. Let b be -59 + (-2)/m-2. What is the units digit of -3 - -2 - -4 - b? 3 Suppose -i = -3n - 149, -3n - 105 = -n + 5i. Let m = n - -248. Let g = 358 - m. What is the tens digit of g? 6 Let s = 323 - 545. What is the tens digit of s/(-4)176/66? 4 Suppose 0v + 2v - 120 = -3f, 4f - 160 = 3v. Let n(w) = -10w3 + 2w*2 + w - 3. Let g be n(-2). Let j = g + f. What is the units digit of j? 3 Suppose 538n - 541n + 43445 = 5r, 0 = 5n + 5r - 72425. What is the ten thousands digit of n? 1 Let h be 52/(-14) - 1 - (-156)/(-546). What is the units digit of (-84)/(2 + 20/h)? 2 Let u(p) = 3p. Let l be u(2). Suppose lh + 43 - 199 = 0. What is the units digit of h? 6 Let v be (2/4)/(5/90). Suppose -16u = vu - 3400. What is the tens digit of u? 3 Let o(d) = -12d + 21. Let k be o(0). Suppose 28s - ks - 2632 = 0. What is the tens digit of s? 7 Let v = -1 - 11. Let p(f) = 2f*3 + 25f*2 - 19f - 11. What is the hundreds digit of p(v)? 3 Suppose 0 = 4i - 15 - 25. Let j be 2042/(-8) + (-2)/(-8). What is the units digit of (-10)/(3/(j/i))? 5 Suppose y - 11 = -14. What is the tens digit of y/(-18) - (-3334)/12? 7 Suppose -9a = 2a + 902. Let l = -78 - a. Suppose 0 = n + ls - 159, -3s + 2s = -4n + 619. What is the tens digit of n? 5 Suppose 5q = 5k + 35, 3k - 7k = -5q + 28. What is the hundreds digit of k*4/(-42) - 826/(	{ "pile_set_name": "DM Mathematics" }
(c*6c)c)/c)c/(((c*5/c)/cc)/c)c(-2/3)cc assuming c is positive. c(86/15) Simplify (m/(m/m3m))*(-3/20)((m/((m6/m)/m))/m)(-4/13) assuming m is positive. m(121/130) Simplify ((x/x(-2/3))*(1/15)/(xx*(3/5)x)(-28))4 assuming x is positive. x(13124/45) Simplify ((n(3/20)n)(-24))(12/11) assuming n is positive. n(-1656/55) Simplify ((i/(i/(ii*(4/7)i)))/i*7(ii/i2i)/ii1)(-4/33) assuming i is positive. i(32/77) Simplify (((o/(oo/(o*(-5)o)))/o)/o)*(2/3)/((oo5)/o)(-41) assuming o is positive. o(601/3) Simplify ((m/(m1/m))*(-30)mm/(mm/(m/(mm/m(2/11))))mmm(-1))(-4/25) assuming m is positive. m(1312/275) Simplify (x0x)(25/2)/(x0)(-23) assuming x is positive. x(25/2) Simplify (j(-2))(-10/3)/(j(3/8)j)(1/31) assuming j is positive. j(4927/744) Simplify o*5(o/((oo(-2/25))/oo))/oo(-8)/(o/o(-2/15)o) assuming o is positive. o(-454/75) Simplify (((y/(y(2/7)yy))/y*(-6))/((yy/y*(-5/2))/(y/(yy/(y*(-3/4)y)))))(-29) assuming y is positive. y(435/28) Simplify (((b*(2/5)/b)/b(b/(b/(b/(bb(-1/3)))))/bbb)(3/7))39 assuming b is positive. b(-156/35) Simplify ((o/(o/(o/(o/(oo*1oo)o)oo)))/(o/(o/o*29)))/(oo(-17))(-2/61) assuming o is positive. o(-1496/61) Simplify (w(1/23)ww)/(w((w((ww(3/22)w)/w)/www)/w)/w)(w/(w13w))/(w*(-19)w) assuming w is positive. w(2483/506) Simplify q7qqq/(q14/q)(q/((qq9)/q))/q(14/3) assuming q is positive. q(-47/3) Simplify ((ff*12)/((ff*(-2/7)/ff)/f))/(f*(-16/7)/(ff(1/14))) assuming f is positive. f(233/14) Simplify (h((hh*7)/h)/h(hh(h*(-9)h)/hh)/h)/(h12/hhhh/(h/(hh6))h) assuming h is positive. h(-21) Simplify m1/(m/(m/((m(m/(m(-4/7)mmm))/m)/mmm)m))(m(4/5))(-4/25) assuming m is positive. m*(2013/875) Simplify ((v(v(-2/3)/v)/v)/v)(-1/21)/(v/(v(vv(v/(vv/(vv(-1/3)))v)/v)/v))(1/23) assuming v is positive. v(226/1449) Simplify (u/(u*(-2/53)u)u/(u/((u(2/3)/u)/u)))1 assuming u is positive. u(-206/159) Simplify ((g/(gggg(2/27)))(-19))(-4/19) assuming g is positive. g(-224/27) Simplify ((a(2/7)/a)/a)(-6/11)/(a*(-13)(a/(a*3a))/aa) assuming a is positive. a(1304/77) Simplify ((b(-13)/((b/(bbbb/b*(-7)bb)b)/bb))(6/25))(-40) assuming b is positive. b(96/5) Simplify (j(-1)j/(j*(2/21)j))/(j/(j/j*(2/17))((jjj*12)/j)/jj) assuming j is positive. j(-5074/357) Simplify (z(-34)/zzz/(z*(-34)zz))/(z(-2/19)/(z/(z(-1/22)/z))) assuming z is positive. z(481/418) Simplify (q0/q(5/3))/(q/((qq*5)/qq))16 assuming q is positive. q(235/3) Simplify ((a(-2/9)/a6)34)19 assuming a is positive. a*(-36176/9) Simplify (k/(kk/((k/(k/((kk/(((kk*12)/k)/k))/kk)))/kk))kkk/(k*(-3/8)k))/(k*(-8)k(7/4)) assuming k is positive. k(-11/8) Simplify (u*(-2/9)u)/(u*16/u)u*(-19)(u(2/23)/u)/u assuming u is positive. u(-7273/207) Simplify (k(-1/4))(14/15)(kk*2kk)(1/7) assuming k is positive. k(101/210) Simplify (o18)40/((ooo(-14)/oooo)/(o/o(1/15))) assuming o is positive. o(10964/15) Simplify ((k(kk(3/10)/k)/k)/((k25k)/k))(18/7) assuming k is positive. k(-2223/35) Simplify (((k/((k/(k0/k))/k))/k)(-2/95)/(k(-1/4))(-38))(-35) assuming k is positive. k(12607/38) Simplify (h(-19))(1/24)h*3/(h(hhh(hh*(2/45)h)/hh)/hh) assuming h is positive. h(-1381/360) Simplify (m(-1)/(m/m*(1/12)))/(mm*1m(-1/11)/m) assuming m is positive. m(-373/132) Simplify v(2/31)/(v/(v/v(-18)))v/v(-1/5)v(1/3) assuming v is positive. v(9113/465) Simplify ((cc(-3/7)cccc/(c(-2/13)/cc))(-19))(1/59) assuming c is positive. c(-8170/5369) Simplify (i/i(-9))/iii/(i/(i*(2/9)/i))(i(-2/5))49 assuming i is positive. i(-467/45) Simplify ((p(-1/10)/p)/((p(-19)/p)/p))19 assuming p is positive. p(3781/10) Simplify ((r/r(-2/15))/r)/r*18r/((r(r/((rr*18rrrr)/r))/r)/r)rr(-2/45) assuming r is positive. r(274/45) Simplify (l(-6/7))(-23)(l(l(-2/15)/l)/l)(-28/9) assuming l is positive. l(21962/945) Simplify (k(3/5)/k)(20/11)/(kk*(1/4)k)(-1/16) assuming k is positive. k(-413/704) Simplify (j*6j/(((jj(2/9))/j)/jj)j)/(jj/(j/j(-1/2)))47 assuming j is positive. j(-283/18) Simplify ((p/p(-3/5))/p(p/(pp/(pp(2/3)p)))/p)/(p*(-4)p/p(-3/7)) assuming p is positive. p(403/105) Simplify (z(zzz/(zz((zzz20)/zz)/zz))/zz/(z((z(-20)z)/z)/z))/(z/z*(-2/63)zz16) assuming z is positive. z(-1136/63) Simplify (t(-7)/(t/t(-2/3))t*(-4/9)tt5)(10/17) assuming t is positive. t(-280/153) Simplify ((yy6)/y)(3/16)y(-18)/((((y3y)/yy)/y)/y) assuming y is positive. y(-151/8) Simplify (b(-2/39)/bb/(bbb(1/19)))/(b/(b(-2/35)b))30 assuming b is positive. b(-19805/5187) Simplify c/(cc*(9/5)c)(c(2/11)c)/ccc(c(-6))6 assuming c is positive. c(-2014/55) Simplify ((ii/(i*(4/9)i))/(ii(-13)))/(i(-4))(-6) assuming i is positive. i(-103/9) Simplify (t/t(-6))/(t/t19)(((t/(t*(-6/5)/t)t)/t)/t)40 assuming t is positive. t113 Simplify (x*2/(x/(xx*(-1/6)))x/(x*(-7/4)x)xx/x(4/9))(2/79) assuming x is positive. x(185/1422) Simplify (b/b(4/15)b/(b/((b(-15)b)/b))b)(-9/7) assuming b is positive. b(597/35) Simplify y(2/5)/(y/y14)(y/y*(-3/4)y)(-1/7) assuming y is positive. y(1821/140) Simplify (x*(1/5)x)*47(x(-2/7))(9/5) assuming x is positive. x(1956/35) Simplify (b(1/13)b)(-4/9)(b2)(-4) assuming b is positive. b(-992/117) Simplify (v(5/7))(-2/65)/(v(-3/4))25 assuming v is positive. v(6817/364) Simplify (n3/n(-23))/(((n*(-15)/n)/nn)/n(2/25)) assuming n is positive. n(1052/25) Simplify (h(-4)/(h7hh))/(h*(-1/4)hh/((h(-2)h)/h)hhh) assuming h is positive. h(-79/4) Simplify ((nn/((n(n(1/11)/n)/n)/n)n)/n(-4/9))(3/25) assuming n is positive. n(106/165) Simplify (d(-8)/d)(-45)/(d(3/5)d(-3/10)) assuming d is positive. d(4047/10) Simplify ((d27d)/((d(d(5/4)/d)/dddd)/d))/(d*(-34)/(dd(18/11)/d)) assuming d is positive. d(2701/44) Simplify d/d*(-3/4)d*(-24)d(dd(-11)/d)(-2) assuming d is positive. d(3/4) Simplify ((d/d1d/((d(2/11)d)/d))/((d/((d(-4/7)/d)/d))/d(-3)))(-4/7) assuming d is positive. d(1772/539) Simplify ((p*(-1/5)/(p/(p/(p/(pp*(-1/13)p)p))pp))/(p/(p/((p/(pp/(p*1p)))/p)))(-1/35))(1/19) assuming p is positive. p(-148/1235) Simplify (s/s(2/5))*(-2/19)s*(2/11)s(-2/11) assuming s is positive. s(-6/95) Simplify f(-1)/(f/(f(-1/16)/f))f(-4/5)/((f/(ff(3/10)))/f) assuming f is positive. f(-41/16) Simplify ((g/g(5/4))/(g/((g0gg)/gg)g)g3g/((g(-8)/g)/g))(-22/7) assuming g is positive. g(-605/14) Simplify (d(-17)/(d/(d*(-1/3)d)))/(d*9dd/(d1/d)) assuming d is positive. d(-85/3) Simplify ((a(1/54)/a)/a)/(a(6/7)/a)a*(-1/16)/(aa/(a(aa*(-8)/aaa)/a)) assuming a is positive. a(-29941/3024) Simplify (h(-1)/hhhh/h*(-10)(h*(-1)h)/h(4/9))(-49) assuming h is positive. h(-4655/9) Simplify ((l(2/3)l)/l)/(l(-15)l)((l/(l3l))/l)(3/16) assuming l is positive. l(167/12) Simplify (((l(-1/4))1)37)19 assuming l is positive. l(-703/4) Simplify ((s(-1/3)ss(2/15))/(s4ss*5s))(-30) assuming s is positive. s306 Simplify (m(-6)/m)(1/3)/(mm/(m/(m/(m(-2/19)m)))m8) assuming m is positive. m(-652/57) Simplify s/(s/s(1/19))s*(-4/5)(s/(s1/s))(-6/29) assuming s is positive. s(-2629/2755) Simplify (p(-1/3))*(-2/23)p*(4/5)p15 assuming p is positive. p(5461/345) Simplify (((d*7/d)/dd)/(d(d(1/12)/d)/d)(d0/d)(2/31))22 assuming d is positive. d(28039/186) Simplify (((m(-2/11)/m)/m)4((m5mmm)/m)/(mm/(mm*(-3)m)mm))3 assuming m is positive. m(-222/11) Simplify ((y*(5/2)y/y(-8/5))(-3/8))(2/15) assuming y is positive. y(-51/200) Simplify ((aa15)/a(-1))/(a(-2/5))(2/71) assuming a is positive. a(6039/355) Simplify (z(4/11)(z*6/z)/z(zz/z*(-4	{ "pile_set_name": "DM Mathematics" }
19w3 - 4w)(14 - 14 + 12) + 0w*2 + 0w2 + w3. -11w3 + 12w Expand (8t2 + 2t*2 - 5t*2)(0t + 2t*2 + 0t) - 49t2 - 4t*4 + 23t*2 + 27t*2. 6t4 + t2 Expand (-31f + 3f*2 + 31f)(8 - 9 + 7)(1 + 0 - 3). -36f2 Expand (-1 - 6 + 0)(170y4 + 20278 - 20278). -1190y*4 Expand (7w + 2w + 4w + (-4w + w + w)(0 + 3 - 1) + (-5w - 2w + 6w)(-6 + 2 + 2))(3 + 2 - 4). 11w Expand (-3n + 4n + 7n)(2n - 78 + 78) + (3n + 2n - 4n)(0n - 4n + 2n) + 3 - 2n2 - 3. 12n*2 Expand (1 + 0 - 2)(r*3 - 3r*3 + 4r*3) + 29 - 32 - 145r + r*3 + 139r. -r*3 - 6r - 3 Expand -2v3 + 1 - 3v*3 + 448v - 446v + (-2 + 2 - 2v)(2v - 2v - 3v2). v3 + 2v + 1 Expand -5 + 5 + 2r + (-1 + 0 + 3)((1 - 4 + 0)(0r + 4r + 0r) - 4r - 2r - 3r). -40r Expand (0 - x + 0)(3x3 - 2x*3 + 0x*3) + 2x*3 - 2x*4 - 2x*3 - 2x + 2x + x4 - x4 + x4 - 2x*4 + 6x*4 + 2 - 13x*4 - 10x*4. -21x*4 + 2 Expand (0 - 1 - 1)(-3 - 7 + 10 - 8)(-18 + 5i + 18). 80i Expand (0l - 16l - 10l)(4 - 1 - 1)(2 + 0l2 + 117l - 118l + 6l*2). -312l*3 + 52l*2 - 104l Expand (t + 0t + 2t)(2 + t - 2) + (3t + 0t - 5t)(-3t - 3 + 3)(-5 + 0 + 2). -15t*2 Expand 2j - 3j + 2j - 2j + 2j - j + (-2j + 0 + 0)(-1 + 1 - 2) + 2j - 2j + 2j + (-21j - 8 + 8)(3 - 1 + 4). -120j Expand -2t3 - t2 - 5t4 + t4 + 6t4 + 2 + 2t*4 - 2 + (8t*2 + 3t*2 + 6t*2)(2t - 2t*2 - 2t). -30t4 - 2t3 - t2 Expand (5 - 1 - 5)(3q + 2q - 8q)(-4 + 0 - 1). -15q Expand (0w + 3w - w)(-6 + 16 + 37 + 40). 174w Expand f*2 + 4f2 - f2 + (-f + 2f + f)(3f - 5f + 3f) + 2f2 + 1 - 1 + f2 + 4f2 + f2 - f2 - f2 + 10f*2. 22f*2 Expand (-b - 2 + 2 - 2 - 2b + 2 + (-1 + 0 + 3)(b + 3 - 3) + 2b + 3 - 3 - 4b + b - 2b - b + 0b + 3b)(-6b*4 + 9b*4 + 9b*4 - b). -24b*5 + 2b*2 Expand (15d*2 - 6d*2 + 15d*2)((2 - 3 - 1)(-3 + 6 - 2) + 2 - 2 + 3). 24d2 Expand (-g2 - 2g2 + 2g2 + g2 + 4g2 + 0g2 + 1 - 1 + g2 + 0g2 + 4g*2 - 3g*2 + (-1 + 4g + 1)(-g + 6g - 4g))(-2g + g2 + 2g). 10g4 Expand (0v5 - v5 + 2v5)(2 - 4 + 3) + v*5 - 3v*5 - 2v*5 - 7v*4 + 7v*4 - 11v*5. -14v*5 Expand (-18p - 5p - 15p)(3p - 2p + 9 + 0p). -38p2 - 342p Expand (1 - 3 + 0)(-2l + 4l - l + (-4 - 3 + 6)(2l - 1 + 1)). 2l Expand (0k2 + 137k*2 + 28k*2 - 20k*2)(0 - 1 + 4). 435k2 Expand 2l*4 + 2l*4 - 3l*4 + (-1 + 9 + 3)(0l4 + 2l*4 + 0l*4) + (-2l*2 + 5l*2 - 2l*2)(1 - l*2 - 1). 22l*4 Expand (135 - 109 - 232)(-42 + 42 - 8h3 - 6h*3). 2884h*3 Expand ((-l - l - 2l)(4 - 3 + 0) + 29l + 19l - 58l - 2)(3 + 1 - 6 + (1 + 3 - 3)(1 - 3 + 0))(l4 + 3l*4 - 3l*4). 56l*5 + 8l*4 Expand -4094u*2 + 4094u*2 + 99u*3 + (3 + 2u*2 - 3)(0u - u + 0u). 97u3 Expand 5t + t - 2t + (10 - 15 - 30)(10 - 2t - 5 + 4t). -66t - 175 Expand h4 - h4 + h4 + (-3h + 0h + 5h)(2h*3 + 0h*3 - 4h*3) + 4h*4 + 0h*4 - 3h*4 + 43 + 7h*4 + 5h*4 - 38. 10h*4 + 5 Expand (-3 + 5 + 5)(-2y - 26 + 26) - 3y + 4y - 3y. -16y Expand (-4v*4 - 3v*4 + 8v*4)(16 - 16 - 9v + (0v - 2v + v)(-2 + 0 + 4)). -11v5 Expand (22 - 36x*2 - 21 - 2x + 28x2)(1 - 1 - x). 8x3 + 2x*2 - x Expand (x - x - 2x)((-5 + 4 + 5)(0 + 2 - 1) + 0 + 3 - 2)(4x + x - 10x). 50x*2 Expand (5n + n - 11n)(2n3 + 0n*3 + 0n*3) - 3n*4 - 6n*2 + 6n*2 + 2n*3 + 5 - 5 - 8n*4. -21n*4 + 2n*3 Expand (o + 5o - 4o)(-129o + 68o + 60o). -2o*2 Expand (2 - 2 + v)(v2 - v2 - v*2) - 1 - 2v*3 + 1 - 10v*2 + 10v*2 + 8v*3 - 6v + 7v3 + 6v. 12v3 Expand (3i + 2i + 3 - 3i)(0i*2 - 3i*2 + 4i*2 + (0 + 0 - i)(i - 3i + i) - 4i*2 + 4i*2 + 2i2 + i2 - i2 + i2). 10i3 + 15i*2 Expand 9w + 4w - 6w + (3 + 2 - 4)(-2w + 0 + 0) + 3w - w + w. 8w Expand (-586 + 586 - 87t2)(0t3 - 4t*3 + 6t*3). -174t*5 Expand -c + c + 3c + (0c + 6c - c)(-5 + 3 - 2). -17c Expand -6h - 8 + 8 + (2h + 3 - 3)(3 + 0 - 5) - 3h - h + 3h. -11h Expand ((3 - 2u - 3)(3 + 2 - 3) - 8u - 7u + 10u)(2u - u - 3u)(-7u*3 - 17 + 17). -126u*5 Expand ((6 - 2 - 2)(0d - 4d + 0d) + 1 + d - 1)(1 + 3 - 3)(-29 + 8d + 29). -56d2 Expand ((5 - 2 - 2)(-3s + 2s - s) - 13 + 500s - 447s - 4)(2s + 1 - 1). 102s2 - 34s Expand (0r + 3r + 0r - 3r - 3 + 3 + (-3 + 5 - 4)(-r + 4r - 2r) - 2r + 6r - 5r)(0r + r + 7 - 7). -3r2 Expand (4 + 1 - 3 - 1 + 1 + 1 - 2 - 2 + 2 + 1 + 1 - 1 + (2 - 3 + 0)(4 + 0 - 3) + 0 + 2 + 0 + 0 + 0 - 2 + 1 + 4 - 3)(1 + 0o - 2o - 2). -6o - 3 Expand 127a3 - 9a - 9a4 - 127a3 + 0 + a4 + 0 + (2a3 + 2a*3 - 3a*3)(0a - a - a). -10a*4 - 9a Expand (-2 + 1 + 0)(2u*3 - 2 + 2) - 3u3 - u3 + 2u3 + 291u*2 - 291u*2 + 46u*3. 42u*3 Expand (-2569s + 3 + 1287s + 1292s)(-s - 1 + 1). -10s*2 - 3s Expand -45y2 - 15y*3 + 15y3 + y4 + y*4 - 4y*4 + 4y*4 + (2y*2 + 2y*4 - 2y*2)(-4 + 4 + 1). 4y4 - 45y*2 Expand (-2s*3 + 2s*3 - 3s*4)(3222 - 1488 - 1599). -405s4 Expand 2s*5 - 6s5 + s5 + (-50s + 84s + 142s)(3s4 + 3s*4 - 5s*4). 173s*5 Expand (5b + 2b + 0b)(6b + 2b - 7b) - b*2 + 0b + 0b. 6b*2 Expand ((-2 - 3 + 6)(-3 + 3 + y) - y - 4y + 3y + y + 2y - 4y + (9 - 9 - 3y)(3 - 5 + 0) + y + y - 3y - y - 3 + 3)(-3y + 0y + y). -4y2 Expand (4x*2 - 15 + 26 - 9)(0 + 2 - 1). 4x2 + 2 Expand (-2 + 4 + 0)(-5 + 6385n - 6390n + 4). -10n - 2 Expand (-1 + 2c + 4 + 0)(0 + 0 + 1 - 2 + 3 - 3 + (5 - 4 - 2)(2 + 2 - 5) - 5 + 5 - 6). -12c - 18 Expand (b - 3b - 2b)(3b2 - 4 + 4) - 2b*3 - 25b*3 + 8b*3. -31b*3 Expand (169 + 44p - 169)(-40p*2 - 3p*3 + 40p*2). -132p*4 Expand (-10z*3 - 2z3 + z3)(7 - 3 - 2)(7 - 6 + 6 + (2 + 1 - 5)(3 + 2 - 3)). -66z*3 Expand -8n*4 + 2n*4 - 2n*4 + (-4n*2 - 2n*2 + 7n*2)(-n*2 - 3n + 3n) + 7n*4 + 12n*4 - 6n*4. 4n*4 Expand (8j - 160 + 160)(j2 + 5j*2 - 3j*2)(3 + 1 - 7)((-3 - 3 + 5)(4j + j - 3j) + 0j - j - j). 288j*4 Expand (2f + f - 2f)(f*2 - 7f*2 + 3f*2) + 3f + 0f + 873f*3 - 867f*3. 3f*3 + 3f Expand -6m + 3m*2 + 0m3 - m3 + 4m + (-4m*2 - 3m*2 + 5m*2)(-5m + 2m - 3m). 11m*3 + 3m*2 - 2m Expand (-4g - g + 3g + (0g + 2g - g)(1 + 2 - 5) + 0 + 0 + g + g - 4 + 4)(40 - 10g - 35 + 0g). 20g2 - 10g Expand (276 + 15 + 6)(2 + 1 - 4)(-2a + 3a - 3a). 594a Expand ((-2 + 6 - 3)(-4r + 2r + r) + 0 - 3r + 0)(-1 + 3 - 1 + 0 - 3 + 2 + (2 - 1 - 2)(-1 + 3 - 4) - 5 + 2 + 5 + 3 + 1 - 5 + 1 - 6 + 2 + 16 - 28 - 33). 180r Expand 3p*3 - 2p*2 + 2p*2 + (2p2 - p2 + p*2)(-2p + 8p + p). 17p3 Expand (-11 + 4 - 3)(-5n3 - n4 + 5n*3) + (2 + 2 - 3)(4 - n4 - 4) + 0 + 0 - n4. 8n4 Expand (20k + 27k - 65k)(3 - 2 - 2)(-2 + 4 + 1). 54k Expand (-4 + 2f + 4)(4 - 3 - 2) - 4 + f + 4 - 3f + f + 0f + 4 + 6f - 4 - 4 - f + 4 + (-4f + 5f + 0f)(16 + 11 + 13). 42f Expand (2h - 3h + 3h)(-5h4 - h4 + 4h4) - 4h*5 + 0h*5 + 6h*5 + 672h*5 - 558527h*4 + 558527h*4. 670h*5 Expand (-4f*2 + 2f*2 + 0f*2)(3 + 112 + 2). -234f2 Expand 85n*2 - 122n*2 + 160n*2 + (-2 + 2 - 2)(-n*2 - n + n) + 0n + n*2 + 0n + 2n2 + 3n - 3n. 128n2 Expand -y4 + 4y - 4y + (-1 + 1 + 5y4)(-55 - 12 + 18). -246y4 Expand (2 - 4 + 0)(-v + 4v + v + 0v - v + 0v + (0 + 0 + 2)(-v + 2v + v))(3 - 2 - 2). 14v Expand 2r4 - 2 + 2 - r4 - r*4 - 2r*4 + (-2r3 + r3 + 3r3)(-r - 3r + 10r). 10r4 Expand (5c*2 - 2c2 - c2)(-11c - c - 6c). -36c*3 Expand (2q*2 + 9 + 92q*4 - 54q*4 - 42q*4)(-1 - 2 - 1). 16q4 - 8q*2 - 36 Expand (-3o + 0o + 2o)(-4 + 6 + 2)(39 + 41 - 48). -128o Expand (-3 + 0 + 0)(-2 + 0 + 4)(0g*5 + 2g5 + g5). -18g5 Expand (3a*4 - 3a*4 + 2a*4)(-30a - 19a + 85a)(1 - 3 + 0). -144a5 Expand (-438 + 438 + 64l*3)(l - 6l - l). -384l*4 Expand -2b*4 + 7b*4 - 3b*4 - 15b*4 + 7b*4 - 15b*4 + (-4b*3 + 0b*3 + 2b*3)(2b + 2b - 2b) + (-3b*3 + 3b3 + b3)(6b - 3*b -	{ "pile_set_name": "DM Mathematics" }
than 14837? False Is -369216 less than -2/3? True Is -1145/34 >= -35? True Is -2173705 less than or equal to -10868524/5? True Is 122474 smaller than 122474? False Which is bigger: -5362698 or -5362699? -5362698 Is 18763/5 smaller than 3754? True Are 19070 and 190699/10 non-equal? True Are 11238 and 11239 unequal? True Is 0 equal to 1/59440? False Which is smaller: -1 or -182/6729? -1 Is 0 at most as big as 2342/2405? True Is 94021/2 != 47011? True Which is smaller: -21/15901 or 1? -21/15901 Which is smaller: 1741 or 98? 98 Is 8/21669 at least 0? True Which is bigger: 1296 or -43.7? 1296 Is 3/136459 >= -1? True Is -4 greater than or equal to -121816? True Which is bigger: -131539 or -131535? -131535 Are 2/364285 and 1 equal? False Is -19911 greater than -19911? False Which is bigger: -1 or -14/46199? -14/46199 Is 1/25561 greater than or equal to 1? False Are 0 and 8/2795 non-equal? True Which is smaller: -1/38 or -1/5712? -1/38 Which is bigger: -112181 or -2/11? -2/11 Is 4053 < 4053? False Do -4376.03 and 2 have the same value? False Which is bigger: 0.04 or 42948? 42948 Is -67320 >= -67323? True Is 221/2334 at most -1? False Is -8/19519 < 0? True Which is smaller: 749 or 673? 673 Is 144 at least as big as -11526? True Which is greater: 324 or -9.6? 324 Are 9783 and 9800 equal? False Is -46643 at most as big as -46645? False Which is smaller: 1 or -6/14113? -6/14113 Are -2085 and -20841/10 equal? False Which is bigger: -1 or -379/292? -1 Is 835790/9 <= 92866? True Is -259927 less than or equal to -259927? True Which is bigger: -1002568 or -1002566? -1002566 Is 2/236905 > -1? True Is 143 at least 57? True Is 1419 less than 1/121? False Are -5299156 and -5299156 equal? True Which is greater: 184/1267 or -1? 184/1267 Which is smaller: -4/75 or -4/403? -4/75 Do -0.199 and 414 have the same value? False Is 0 less than -140/193? False Which is greater: 474 or 20415/43? 20415/43 Is -1408 >= 35/22? False Are 4 and 1162/319 equal? False Are 39740 and 39827 nonequal? True Is 6010/87 <= 68? False Is -10/13147 bigger than 0? False Is -366/355 not equal to -2? True Which is bigger: -14668 or -102677/7? -14668 Which is smaller: 68/20283 or -2/11? -2/11 Which is smaller: -9271 or -9228? -9271 Is -7043/46 > -154? True Are 197503 and -2/7 non-equal? True Are -2682 and -77754/29 unequal? True Does -82.597 = -2? False Which is smaller: 1 or -267513? -267513 Are -1 and 6/18527 equal? False Which is bigger: -8.043 or 11? 11 Is 1.6 < -2070? False Which is smaller: -385 or -348? -385 Are -0.3 and 66268 equal? False Are -1 and -4923507/5 nonequal? True Is -0.1 less than or equal to -3/285442? True Are -34063 and -33984 non-equal? True Which is greater: -14369 or 0.5? 0.5 Do -60884 and -0.2 have different values? True Which is greater: 162297 or 162307? 162307 Which is smaller: 17249/4 or 4312? 4312 Which is greater: -3360/11 or -304? -304 Is -17 bigger than 38? False Which is bigger: 1749 or 26? 1749 Which is smaller: 0 or -117/1934? -117/1934 Which is greater: 81 or 3998? 3998 Is 1 less than or equal to -38/18899? False Which is bigger: -42382 or -42372? -42372 Are 2/7 and -16/9063 unequal? True Is -0.02 at most as big as -344? False Is -166 bigger than -5619/34? False Do 11/136283 and 0 have the same value? False Which is smaller: -7031 or -32? -7031 Which is greater: -1022 or -1100? -1022 Is -2 at most as big as -1541/582? False Is -160045 at least -160045? True Which is greater: -0.7682 or -8/5? -0.7682 Are 3151 and 0.07 equal? False Is 53981/6 smaller than 8996? False Are -8212/21 and -392 equal? False Which is smaller: 0 or -10849? -10849 Which is greater: 18069/10 or 1806? 18069/10 Is -497 at least -15/46? False Which is smaller: 265735 or 265733? 265733 Which is bigger: 1/340 or 6? 6 Is 0.1 <= 96749? True Is 1147 < 1603? True Is -9942 bigger than -9971? True Which is bigger: -3 or -883272? -3 Is 3 less than -0.3618? False Which is bigger: -300557 or -300560? -300557 Is 1 at most as big as 8/30963? False Is -488/11007 <= 0? True Which is smaller: 1/86 or 844? 1/86 Which is greater: -5 or -1103/200? -5 Is -1 < -73951? False Which is bigger: 346 or 234? 346 Which is smaller: -537 or -16/9? -537 Which is greater: 2/12899 or -41? 2/12899 Which is smaller: -143 or -4988/35? -143 Is 0.07 > 0.07969? False Which is smaller: -4106/45 or -90? -4106/45 Are 0 and -17/17358 non-equal? True Which is bigger: 1 or 11/65550? 1 Which is greater: 117133 or 117135? 117135 Do -1 and 2/39729433 have the same value? False Are 122.2 and 0.48 nonequal? True Which is smaller: 155/3 or 1.5? 1.5 Is -2640664 < -2640664? False Are 1300/8331 and -1 nonequal? True Are -25308 and -25308 equal? True Is 1 > -2/2812611? True Is 202 at most -297? False Is -319 > 0.05? False Which is smaller: -29662 or 0.3? -29662 Which is smaller: -14862/67 or -222? -222 Is 233 greater than 313? False Is -121246 at least 0? False Is -2 at most 55612? True Is 94533 greater than 1228938/13? False Which is smaller: -2/45 or 5521? -2/45 Which is smaller: -93 or -10251/110? -10251/110 Which is greater: 25 or 154? 154 Which is greater: -2379.1 or 10? 10 Which is smaller: -7 or 2118? -7 Is 473303 < 473301? False Is 1 equal to -2/231635? False Which is smaller: -72 or 23392? -72 Which is smaller: 131 or -0.373? -0.373 Are -76895 and -76897 unequal? True Which is greater: 473/7357 or 1? 1 Which is bigger: -7.78 or 2.2? 2.2 Does -255338 = -255340? False Which is greater: 5845 or 1? 5845 Which is smaller: -2/80355 or 0? -2/80355 Which is smaller: -1985 or -65522/33? -65522/33 Is 163270 at most 489814/3? True Which is smaller: -618.9466 or 0.1? -618.9466 Which is bigger: -5/17576 or 0? 0 Which is greater: 72190 or 72191? 72191 Does 4073214/11 = 370291? False Is 971636 at least 971636? True Which is greater: 16110 or 16112? 16112 Is -168 at most as big as -6238? False Which is smaller: 1/3 or -1/336677? -1/336677 Which is smaller: 1.631 or 0.34? 0.34 Is 1/28653 < 0? False Which is smaller: 113 or 72? 72 Which is bigger: -4/193157 or 0? 0 Do -1 and 26/6533 have the same value? False Which is smaller: -9691/26 or -372? -9691/26 Which is smaller: -84/4325 or 1? -84/4325 Is 1599 greater than or equal to 2093? False Is -121611 greater than -121613? True Which is smaller: 66.115 or 1.5? 1.5 Is -137/152 <= -2? False Is -1519 equal to -1432? False Which is bigger: 40650 or 40648? 40650 Is 183727/4 < 45933? True Which is smaller: 0.062 or -2/1049? -2/1049 Is 0 at most 84/1285? True Are -3229 and -41994/13 non-equal? True Are -35982 and -35984 nonequal? True Is -21165 < 25? True Is -3681 less than or equal to -0.9? True Which is smaller: -53 or 8194? -53 Do 14/83 and 315 have the same value? False Which is bigger: 32220 or 32192? 32220 Are 0 and 6/1621501 nonequal? True Is -109511 smaller than -109510? True Does 378 = -1069? False Is 11584 bigger than 11581? True Is -0.2 bigger than 3006? False Which is smaller: -704 or -71? -704 Is 0 < -125/167? False Which is smaller: 1913/833 or 1? 1 Is 4/1058757 at most -1? False Is -34037 at least as big as -0.02? False Is 2159087 greater than or equal to 2159086? True Is -7983 < -7983? False Is -2230 less than -2205? True Which is smaller: -100199/9 or -11133? -100199/9 Is -895/439 greater than -2? False Which is greater: -29072 or 0.75? 0.75 Which is bigger: -13/79 or 0.049? 0.049 Which is bigger: -2 or 3213? 3213 Which is bigger: 954 or 3995? 3995 Are -33288 and -33288 equal? True Are 190 and 45 non-equal? True Which is bigger: -1 or 257/810? 257/810 Is 35/17558 smaller than -1? False Which is smaller: 1953 or 1922? 1922 Which is smaller: -597602 or -597619? -597619 Which is smaller: -31/36999 or 1? -31/36999 Which is smaller: -24/5 or -14/1353? -24/5 Which is smaller: -1 or -1296/1159? -1296/1159 Is 0 greater than 5/565737? False Is 3 bigger than 730/163? False Which is bigger: 1 or -1013032? 1 Which is smaller: 2240 or -7? -7 Which is greater: 1 or 47/36883? 1 Are 487141 and 487141 unequal? False Is -109 bigger than -308? True Is 13329 greater than 13246? True Which is smaller: 347 or 315? 315 Which is bigger: 11 or 146/1537? 11 Which is bigger: -4/362073 or 0.1? 0.1 Is -2543343 at least -2543341? False Which is smaller: 2624 or 2364? 2364 Does -27730 = -27757? False Which is bigger: 112	{ "pile_set_name": "DM Mathematics" }
500190.2. 10003.8 Multiply 9740 and -20. -194800 What is the product of -417 and 34? -14178 Multiply 526560 and 4. 2106240 0.33113 933.9 2803 times 0.072 201.816 Work out -5 * -4043.6. 20218 458 * 1228 562424 -17 * 37546 -638282 -0.4 times -3690 1476 Multiply -575.2 and -157. 90306.4 -0.2 * 0.5839 -0.11678 -0.16197.3 -31.568 Work out 0.017 -17624. -299.608 Work out 201899 * 3. 605697 Product of 45 and -0.09681. -4.35645 0.4-243412 -97364.8 10855 times -6 -65130 -20156 times -0.04 806.24 Calculate -0.1991130. -224.87 Work out 50657 * -0.4. -20262.8 Product of -1 and -124168. 124168 What is -0.06 times -14749? 884.94 Product of -1665 and -624. 1038960 What is the product of -2148 and -103? 221244 Product of 104774 and 0. 0 239604 79208 What is the product of 29731 and 2? 59462 What is the product of -0.038 and -0.0819? 0.0031122 -31613.4 times -14 442587.6 119761.9-0.1 -11976.19 Product of 31543 and 16. 504688 Multiply -241 and 78. -18798 -2.5 * 0.066 -0.165 6.0691 times -0.4 -2.42764 Work out 0.17 * 169382. 28794.94 -0.259 times -4528 1172.752 -0.5192 -96 Multiply -158.48 and -0.5. 79.24 Calculate 1501-0.233. -349.733 -0.910.699 -9.6291 -0.3 times -0.6926 0.20778 1090200 times 0.1 109020 Product of -313 and -39.2. 12269.6 Multiply 42477 and -15. -637155 -2491.34 times 0.5 -1245.67 Product of 0.3 and 231811. 69543.3 Calculate 318-2586. -822348 -49 * 0.2133 -10.4517 113720 40920 What is the product of -2052 and 11.4? -23392.8 Product of 259411 and -0.3. -77823.3 What is the product of 102.7 and 68? 6983.6 5871.720.01 58.7172 Product of 0.3 and 11999. 3599.7 Work out 912.4 * 3. 2737.2 Multiply -2.54 and 2212. -5618.48 103607-0.3 -31082.1 Calculate -111437.1. -15808.1 Product of -4 and 3413. -13652 What is the product of -168016 and -0.1? 16801.6 Multiply -0.3 and -5225. 1567.5 What is 3.8 times 152.3? 578.74 What is the product of 0.041 and -64.1? -2.6281 25090 * -0.4 -10036 11 * 26867 295537 0.3 * 5.11054 1.533162 0.029237 0.20461 Calculate 44986. 38614 Calculate -150.0899. -1.3485 What is the product of 3 and -35030? -105090 -1.1 times 0.275 -0.3025 What is -0.923 times 107? -98.761 0 times 469700 0 Calculate 6710501. 671050 Calculate -19064. -9064 Multiply 65 and -398. -25870 Product of -0.3 and 28964. -8689.2 -494.19 times 0.07 -34.5933 What is the product of -1007 and -0.37? 372.59 What is the product of -170010 and 0.16? -27201.6 Multiply -49 and -0.07. 3.43 0.175 -57.8 -10.115 0.483394 times 1 0.483394 Work out 226658 * 6. 1359948 Calculate -484-19.61. 9491.24 Calculate -37.46-5. 187.3 What is the product of 12176.8 and -2? -24353.6 Product of -4.225 and 0.01. -0.04225 -429330 times -3 1287990 Multiply 56 and -6.954. -389.424 Product of 5 and -5.86. -29.3 What is -6915.86 times 0.4? -2766.344 Product of 17843 and -3. -53529 What is the product of -0.05 and 0.014663? -0.00073315 Product of -0.07 and -399.3. 27.951 Calculate -0.068-538. 36.584 0.61 5850 3568.5 What is -6 times -464.266? 2785.596 Work out 0.08 * -8281. -662.48 -0.05824 * 0.02 -0.0011648 Product of 0.01309 and 21.7. 0.284053 -26.15 times -18 470.7 29.2741 29.274 Multiply -0.803 and -65. 52.195 What is the product of 1.76 and 3.401? 5.98576 What is the product of -1048.25 and -5? 5241.25 15.77 times -36.4 -574.028 Product of -4.4 and 0.61. -2.684 -2556 times 5 -12780 Multiply 0.81 and -329. -266.49 27.467 1835.8 Product of -9931 and 43. -427033 4.2964-0.05 -0.21482 0.575 times 704 404.8 Work out -1642 1. -1642 Calculate 108.447-1. -108.447 -410 23 -9430 Multiply -2040800 and 0.2. -408160 0.4 times -13252 -5300.8 Product of 70 and 205. 14350 -0.2 * 1383.1 -276.62 What is -53.5925 times -2? 107.185 What is -0.2 times 1348.9? -269.78 -2 times -95215 190430 Product of 0.6526 and -0.2. -0.13052 What is -34 times -1.20389? 40.93226 0.13 * 23306.8 3029.884 What is -3629 times 0.8? -2903.2 What is the product of -36.11983 and -1? 36.11983 Calculate 3250194. 630500 -0.112622 -2.4772 0.3 * -0.205577 -0.0616731 1810.3 times -233 -421799.9 Multiply 11 and 23551. 259061 Calculate -6.3-23945. 150853.5 1.47456 times -0.4 -0.589824 What is the product of -73.4 and -3192? 234292.8 Calculate 162752. 44032 Multiply 700 and -1146. -802200 What is -0.3 times 17079? -5123.7 What is -3754 times 0.058? -217.732 Multiply -0.23428 and -5. 1.1714 0.11.509 0.1509 -9328 -4 37312 What is the product of 6986 and -72? -502992 What is 2.459 times 114? 280.326 Calculate -1580398. -580398 What is the product of -301502 and 4? -1206008 Product of -369 and -215. 79335 109095 times 0.3 32728.5 0.3 3335 1000.5 -0.026 * -6999 181.974 Calculate 0.6170.065. 0.040105 What is the product of -20.195 and 5? -100.975 Calculate 256.61. 165.25 -290.6011 -17.4319 Multiply -446.69 and 0.2. -89.338 What is 297 times 957? 284229 Product of -1 and -23233. 23233 Calculate -23-523. 12029 What is -1252 times -684? 856368 0.08284 * 8 0.66272 -0.2-13631 2726.2 What is 0.2 times 50187.4? 10037.48 3 times -0.0091334 -0.0274002 Multiply -9 and -22.611. 203.499 -33186 times 0.1 -3318.6 Multiply 1431 and -182.2. -260728.2 What is the product of 7053 and -0.286? -2017.158 -1883.783 times -0.3 565.1349 Calculate -10.349. -504.7 Product of 51 and 10245. 522495 -1 * 35301 -35301 What is the product of -0.015 and -364? 5.46 Multiply 275.8 and -0.077. -21.2366 What is the product of 0.4 and -0.034216? -0.0136864 Product of 63 and -1.3449. -84.7287 Calculate -79227-1.5. 118840.5 -13.043-11 143.473 What is the product of -450 and 731? -328950 5.63-0.85 -4.7855 -1 0.32844 -0.32844 Product of 9 and -1.2337. -11.1033 Product of 0.413 and -2217. -915.621 Multiply 26172 and 0.5. 13086 What is -1779 times -111? 197469 What is the product of -447.2 and 41? -18335.2 Work out -0.26 * 3574. -929.24 What is the product of 4.8738 and 0.16? 0.779808 129412 15528 What is 134 times -0.206? -27.604 What is the product of 0.4072 and -0.243? -0.0989496 Product of 5.74475 and 0. 0 -1.01 209.96 -212.0596 What is 0.03 times -1966? -58.98 Product of 5 and 1738. 8690 What is the product of -11.81 and 35? -413.35 What is the product of 0.1 and -7275.7? -727.57 Work out -4 * -6794.5. 27178 Calculate 0.71-32. -22.72 What is the product of -4 and 3030.8? -12123.2 What is -30.532 times -36? 1099.152 Product of -126 and -599. 75474 Work out -0.07 -73954. 5176.78 What is 53 times -128.2? -6794.6 What is -28389 times -5? 141945 Multiply 4209 and 0.03. 126.27 Multiply -5 and 0.0475473. -0.2377365 8 times 60052 480416 2.8 * -74 -207.2 Work out 1008424 * 2. 2016848 -103.9 * -0.06 6.234 Calculate 57806-14. -809284 What is the product of 0.5 and -29.579? -14.7895 -1.2 times 47093 -56511.6 -125389 -48625 Calculate -9171.5. -1375.5 Calculate 4974.01. 3626.49 Calculate -754017-9. 6786153 Multiply -1.1 and 996.13. -1095.743 -57.912-0.1 5.7912 What is -30930 times -3? 92790 What is 0.6 times -2636? -1581.6 What is the product of -4 and 0.309616? -1.238464 Multiply 9.43 and 547. 5158.21 Multiply 0.77887 and 0.06. 0.0467322 0653730 0 Work out -0.19 -0.07094. 0.0134786 What is the product of 0.8 and 33.76? 27.008 Product of -10 and 0.092. -0.92 -27.21584 -43084.8 50.043 -8 -400.344 What is 0.3 times 663? 198.9 0.4-18514 -7405.6 Calculate -0.524326.1. -12163.05 602 * 556 334712 What is 1085.3 times -6.4? -6945.92 -0.27 * 253 -68.31 What is the product of 0.6 and -303923? -182353.8 What is -32.3 times 6432? -207753.6 Calculate 0.0368-470. -17.296 -0.010.0371 -0.000371 -0.1-22.09 2.209 What is 3910 times 2.8? 10948 120838 -3 -362514 Calculate -1.12.38004. -2.618044 Multiply -2.1667 and 0. 0 -115033 -34509 Calculate 24443.9-1. -24443.9 What is -6.14 times -487.3? 2992.022 -0.084107.2 -328.576 What is the product of -124487 and -27? 3361149 -193.6-1.05 203.28 Work out 301 -0.06. -18.06 -0.59835 times -0.3 0.179505 106.5 times 0.0125 1.33125 What is -0.23 times 2788? -641.24 245627 times 0.2 49125.4 -52364 * -0.5 26182 Calculate -0.45.756. -2.3024 Multiply -89 and 9.222. -820.758 Work out -17129 -25. 428225 Product of -1875 and 1. -1875 What is 10 times -5690? -56900 -5 times 1572095 -7860475 What is 0.3 times -0.518? -0.1554 Calculate 5-5851. -29255 Work out -1.7672 7.7. -13.60744 1051076 * -1 -105	{ "pile_set_name": "DM Mathematics" }
{b: 5, s: 2, t: 2}? 5/36 What is prob of sequence rr when two letters picked without replacement from {k: 9, r: 2}? 1/55 Two letters picked without replacement from aataomi. What is prob of sequence om? 1/42 Calculate prob of sequence tt when two letters picked without replacement from {i: 2, t: 6}. 15/28 Four letters picked without replacement from {r: 2, l: 2, s: 1, e: 4}. Give prob of sequence lels. 1/378 Four letters picked without replacement from ewtyv. Give prob of sequence yvwe. 1/120 What is prob of sequence hhhw when four letters picked without replacement from {h: 10, w: 10}? 20/323 What is prob of sequence wi when two letters picked without replacement from iwiiiiwiiwi? 12/55 Calculate prob of sequence np when two letters picked without replacement from {i: 3, z: 2, p: 2, n: 9}. 3/40 Calculate prob of sequence gh when two letters picked without replacement from {h: 2, g: 2, i: 2}. 2/15 Three letters picked without replacement from {d: 4, q: 9, e: 4, z: 3}. Give prob of sequence zeq. 3/190 What is prob of sequence qz when two letters picked without replacement from {z: 1, q: 2}? 1/3 Calculate prob of sequence ccx when three letters picked without replacement from {c: 3, t: 4, a: 3, x: 4}. 1/91 Two letters picked without replacement from {u: 4, e: 4, g: 3, r: 8}. What is prob of sequence gu? 2/57 Calculate prob of sequence nynn when four letters picked without replacement from ynnnnnnny. 5/36 What is prob of sequence vdj when three letters picked without replacement from vjd? 1/6 Two letters picked without replacement from yuuuagague. Give prob of sequence yg. 1/45 Four letters picked without replacement from rrrrkkrrbrrriribrkrr. Give prob of sequence ikkk. 1/9690 Two letters picked without replacement from totwtcouucctec. What is prob of sequence oe? 1/91 Three letters picked without replacement from {g: 4, q: 3, p: 2}. Give prob of sequence qqg. 1/21 Two letters picked without replacement from {i: 5, h: 1, o: 1, c: 2, z: 3}. What is prob of sequence zc? 1/22 What is prob of sequence yyoo when four letters picked without replacement from {o: 5, y: 7}? 7/99 What is prob of sequence ss when two letters picked without replacement from ypss? 1/6 Three letters picked without replacement from {l: 2, h: 2}. Give prob of sequence hlh. 1/6 Calculate prob of sequence mss when three letters picked without replacement from mppqpsmppmsspmqpspp. 8/969 Four letters picked without replacement from {r: 2, y: 2, v: 3, m: 9, w: 1}. What is prob of sequence vyvw? 1/4760 Three letters picked without replacement from nngkq. What is prob of sequence gnn? 1/30 Calculate prob of sequence xxes when four letters picked without replacement from {e: 1, x: 3, q: 2, s: 6, l: 2}. 3/2002 Four letters picked without replacement from {c: 7, e: 2, r: 6}. Give prob of sequence crce. 1/65 What is prob of sequence vuvu when four letters picked without replacement from {u: 3, g: 3, s: 2, y: 1, v: 1, m: 1}? 0 Three letters picked without replacement from pjsvnsk. What is prob of sequence pns? 1/105 Three letters picked without replacement from {k: 14, l: 5}. What is prob of sequence lkk? 455/2907 What is prob of sequence gxe when three letters picked without replacement from {b: 3, e: 4, g: 2, t: 1, x: 1}? 4/495 What is prob of sequence aw when two letters picked without replacement from {e: 1, w: 1, a: 4, h: 3, b: 2}? 2/55 Calculate prob of sequence spp when three letters picked without replacement from {k: 3, i: 3, w: 3, s: 7, b: 1, p: 3}. 7/1140 What is prob of sequence dqqg when four letters picked without replacement from gdnndnnvncnvqndcqv? 1/12240 Calculate prob of sequence kbkb when four letters picked without replacement from {b: 2, k: 16}. 1/153 What is prob of sequence gfg when three letters picked without replacement from {f: 5, g: 2}? 1/21 What is prob of sequence ddid when four letters picked without replacement from {d: 3, p: 2, i: 4}? 1/126 Calculate prob of sequence xnyn when four letters picked without replacement from nyxnynn. 1/35 What is prob of sequence ckr when three letters picked without replacement from {c: 2, r: 2, o: 3, k: 2}? 1/63 Three letters picked without replacement from xqqsxqsssgsxs. What is prob of sequence qsg? 3/286 Two letters picked without replacement from {m: 2, y: 1}. Give prob of sequence mm. 1/3 Calculate prob of sequence ay when two letters picked without replacement from {f: 2, z: 1, y: 2, a: 1, h: 1, n: 2}. 1/36 Three letters picked without replacement from {y: 4, h: 1, q: 1, w: 4, r: 1, z: 1}. What is prob of sequence hyr? 1/330 Two letters picked without replacement from keeeekeeekeeke. What is prob of sequence ek? 20/91 Calculate prob of sequence oo when two letters picked without replacement from {o: 14, t: 1}. 13/15 Four letters picked without replacement from {c: 3, v: 5}. Give prob of sequence vcvc. 1/14 Two letters picked without replacement from obov. Give prob of sequence ov. 1/6 Calculate prob of sequence vbv when three letters picked without replacement from {b: 8, v: 2}. 1/45 What is prob of sequence fuf when three letters picked without replacement from {f: 2, u: 1}? 1/3 Three letters picked without replacement from {u: 4, a: 6, b: 3, l: 1}. Give prob of sequence lba. 3/364 What is prob of sequence bpbp when four letters picked without replacement from {p: 8, b: 5}? 28/429 Four letters picked without replacement from yyyyhyhhyh. Give prob of sequence hhhh. 1/210 What is prob of sequence svhs when four letters picked without replacement from {o: 2, h: 2, v: 4, s: 4}? 4/495 Calculate prob of sequence urc when three letters picked without replacement from {t: 1, u: 1, s: 1, r: 1, c: 1}. 1/60 Calculate prob of sequence ho when two letters picked without replacement from ooorrohorrrh. 5/66 What is prob of sequence rre when three letters picked without replacement from reeeeeereerree? 5/91 Four letters picked without replacement from {r: 10, o: 4}. Give prob of sequence roro. 45/1001 What is prob of sequence zx when two letters picked without replacement from xxzxczzcxzzzxczz? 1/6 Two letters picked without replacement from {i: 2, e: 1, g: 1, q: 1, z: 1, h: 1}. Give prob of sequence qi. 1/21 Calculate prob of sequence llp when three letters picked without replacement from ppllpplplpllllppplpp. 11/95 Three letters picked without replacement from vtwvvjmvvvtttvjvwttc. What is prob of sequence jvv? 14/855 Two letters picked without replacement from ssjjjhssjjshs. What is prob of sequence sj? 5/26 Four letters picked without replacement from {d: 3, q: 4, f: 1, j: 1, w: 2}. What is prob of sequence wdjw? 1/1320 Two letters picked without replacement from {k: 1, e: 4, x: 2}. What is prob of sequence ke? 2/21 Calculate prob of sequence bq when two letters picked without replacement from bqqqqqqqqqqqqqqqqqq. 1/19 Two letters picked without replacement from {f: 1, u: 2, e: 1, m: 1}. What is prob of sequence uf? 1/10 Four letters picked without replacement from {h: 2, r: 1, g: 6, q: 4, b: 3, l: 3}. Give prob of sequence qbrb. 1/3876 Four letters picked without replacement from wykoiywi. Give prob of sequence ioyw. 1/210 Four letters picked without replacement from {b: 5, r: 2}. What is prob of sequence brrb? 1/21 Three letters picked without replacement from {g: 3, p: 5, n: 5}. Give prob of sequence npp. 25/429 What is prob of sequence anf when three letters picked without replacement from {n: 1, i: 1, f: 5, p: 1, a: 3}? 1/66 What is prob of sequence rzr when three letters picked without replacement from {r: 2, y: 1, s: 3, k: 4, p: 3, z: 2}? 2/1365 Three letters picked without replacement from thrnhbv. Give prob of sequence trv. 1/210 Two letters picked without replacement from saphlah. Give prob of sequence ph. 1/21 Three letters picked without replacement from {y: 2, x: 6, r: 7}. What is prob of sequence yxx? 2/91 Three letters picked without replacement from {r: 2, l: 2}. What is prob of sequence rrl? 1/6 Two letters picked without replacement from {j: 2, g: 1, o: 1, c: 6, v: 2}. Give prob of sequence gv. 1/66 Calculate prob of sequence yp when two letters picked without replacement from {c: 2, y: 2, n: 2, p: 3}. 1/12 What is prob of sequence qddg when four letters picked without replacement from {g: 4, q: 1, d: 2}? 1	{ "pile_set_name": "DM Mathematics" }
5(y - 1)2(y + 1)(y + 36) Let b(z) = -56z*4 - 44z*3 + 64z*2 - 24z - 20. Let p(l) = -3l4 - l3 + l2 - 1. Let y(m) = b(m) - 20p(m). Factor y(h). 4h(h - 3)(h - 2)(h - 1) Let y(t) be the second derivative of t*4/60 - 439t*3/15 + 192721t*2/10 - 364t. Factor y(m). (m - 439)*2/5 Let k(n) be the third derivative of 1/140n*5 - 5/2n*3 - 309n*2 + 17/28n*4 + 0n + 0. Factor k(o). 3(o - 1)(o + 35)/7 Suppose 0 = -327c + 331c + 8, -4n + 6 = -3c. Let x(t) be the first derivative of -2 + nt + 3/28t*4 + 3/7t*3 + 3/7t*2. Solve x(i) = 0. -2, -1, 0 Let m be 4/(-10)-3(12 + 3)/180. Let o(h) be the second derivative of mh*5 + 21h + 1/6h4 + 0h*2 + 0h*3 + 0. Factor o(v). 2v*2(v + 1) What is l in -5l2 + 525 - 20l + 244l + 296l = 0? -1, 105 Let t be 4 + -2(-470)/1200-5. Let a(p) be the first derivative of 0p + 4 - 9/8p*4 - tp*6 + 7/6p*3 - 1/2p*2 + 1/2p*5. Solve a(w) = 0. 0, 1, 2 Suppose -4o + 5q + 10 = 0, -q - 22 - 1 = -5o. Solve -135k3 - 44k + 0k2 + 16k - 125k2 - 55k*4 - 5k*o - 12k = 0 for k. -8, -1, 0 Let a(u) = -11 + 2 + u*2 - 4 + 5 - 10u. Let d be a(11). Factor 2/7t - 2/7t*d - 2/7 + 2/7t*2. -2(t - 1)*2(t + 1)/7 Let d be -1 + 6/1 - 2/1. Determine f so that df2 + 5540 - 456f + f*2 + 7456 = 0. 57 Let y(z) = -285z - 45. Let n be y(7). Let f = n + 8229/4. Let 3/4k3 + 9 - fk + 15/2k2 = 0. What is k? -12, 1 Let k(j) = 11j - 28. Let d(m) = -13m + 27. Let h(o) = -4d(o) - 5k(o). Let p be h(10). Factor 45l*2 - 147 + 14l - 94lp + 46l*2 + 28l. -3(l - 7)2 Let c(m) = -20m3 + m2 + 2m + 1. Let z be c(-1). Let k = z - 18. Factor -73s - 14s + 17s - 126sk - 5 - 119s*2. -5(7s + 1)2 Let h be 18/234 - (((-21)/156)/((-3)/24) + -3). Factor 27/7u*h - 12/7u - 18/7u3 + 0 + 3/7u*4. 3u(u - 4)(u - 1)*2/7 Find w such that -11 + 1179 + 334979w*2 - 100w*3 - 327759w*2 + 5824w = 0. -2/5, 73 Let u(m) be the second derivative of -5m7/42 - 3m*6 - 47m*5/4 - 25m*4/2 + m + 9. What is w in u(w) = 0? -15, -2, -1, 0 Factor -153/4t*3 - 207/2t*2 - 123t - 21/4t4 - 54. -3(t + 2)*3(7t + 9)/4 Factor -6x - 28/17x2 + 0 + 2/17x*3. 2x(x - 17)(x + 3)/17 Let o = -1/24733 - -74209/247330. Let h(a) be the second derivative of -oa6 + 3/10a*5 + 2a + 3/2a2 - 3/2a*3 - 5 + 1/14a*7 + 1/2a*4. Factor h(m). 3(m - 1)*4(m + 1) Let h(z) = z*3 + 37z*2 + 32z + 274. Let s be h(-36). Let y = s - 415. Find q such that -10/3q2 + 0 - 5q + 5/3qy = 0. -1, 0, 3 Let n(w) be the first derivative of -2w*5/35 - 15w*4/14 + 26w*3/7 + 79w*2/7 - 204w/7 + 83. Let n(d) = 0. Calculate d. -17, -2, 1, 3 Factor 3264 + 3c2 - 20c + 8c + 312c + 4236. 3(c + 50)2 Let f(h) be the second derivative of 1/90h*4 - 16/15h*2 + 0 + 1/3h*3 - 58h. Solve f(t) = 0. -16, 1 Let f = -195035 + 195038. Suppose 0 + 0o2 - 2/11o*f + 2/11o = 0. Calculate o. -1, 0, 1 Suppose 0 = -u - 4d + 21, 3u = 3d - 0d + 3. Suppose 5o = -6m + 10m, 0 = -um. Factor 2/9s5 + 2/9s + 0 + os2 - 4/9s*3 + 0s*4. 2s(s - 1)2(s + 1)*2/9 Let t(x) = -56x*3 + 534x*2 - 910x - 302. Let h(p) = -19p3 + 177p*2 - 305p - 101. Let a(r) = -14h(r) + 5t(r). Factor a(q). -2(q - 12)(q - 2)(7q + 2) Let b be 2/14 + (-5)/35. Let t(u) = -u*3 - 24u*2 - 26u - 24. Let i be t(-23). Determine k so that -3 - ik2 + b + 48k*2 = 0. -1, 1 Let f = -338 - -346. Let c be 2/3 - (-4 + 3)f. Factor -4 - cq + 10/3q*2. 2(q - 3)(5q + 2)/3 Suppose -3/4z3 + 63/4z*2 + 0 + 33/2z = 0. Calculate z. -1, 0, 22 Let r(n) = 47n + 22. Let c be r(6). Factor -3t + 303t2 - 10t - ct2. -t(t + 13) Let s be (-7)/(-18)420/980. Let k(c) be the first derivative of 1/9c*3 + 1/36c*4 + 30 + sc*2 + 1/9c. Determine h, given that k(h) = 0. -1 Factor -2172i2 - 295i*4 - 2450 - 247i*4 + 540i*4 + 667i + 4093i - 136i*3. -2(i - 1)*2(i + 35)2 Let h(u) be the second derivative of -u5/10 + 68u4/3 - 3700u*3/3 - 65712u*2 - 43u - 68. Factor h(m). -2(m - 74)2(m + 12) Suppose 9l - 4l - 10 = 0. Suppose 15o4 - 96o*3 - 32o + 5o4 + 98 - 110 + 157o*l - 37o*2 = 0. What is o? -1/5, 1, 3 Let x be (1860/21)/((-14)/(-49)). Factor -990 - 67 - xq - 5q2 - 3748. -5(q + 31)2 Let m(x) be the first derivative of x3/3 + 2930x2 + 8584900x + 6458. Factor m(k). (k + 2930)*2 Let -77/2x*4 + 0 + 79/6x*2 + 49/6x*5 + 75/2x3 + x = 0. Calculate x. -1/7, 0, 2, 3 Let r(n) be the third derivative of n6/30 + 86n5/15 + 880n*4/3 - 7744n*3/3 - 2n*2 - 879n. Factor r(d). 4(d - 2)(d + 44)*2 Factor -4617o + 479o2 + 121o*2 + 642o2 + o5 + o*3 + 7o*3 + 0o*5 - 5832 - 18o4. (o - 9)3(o + 1)(o + 8) Let f(o) be the third derivative of 2/105o7 + 0 + 6o - 1/5o6 + o4 - 5o*2 - 6o*3 + 8/15o*5. Suppose f(w) = 0. What is w? -1, 1, 3 Let y(o) = 5o*3 + 1135o*2 + 64969o + 63845. Let r(h) = 70h3 + 15890h*2 + 909565h + 893830. Let l(u) = 6r(u) - 85y(u). Determine c so that l(c) = 0. -113, -1 Suppose 4n - 2m = -10, -5n - 1984m = -1988m + 26. Factor 2r*4 + 1/2r*5 + 0 + 3/2r*3 - nr*2 - 2r. r(r - 1)(r + 1)(r + 2)2/2 Suppose 0 = -8k + 49 - 17. Suppose 0 = 5o + 2r - 27, kr - 3 = r. Solve 8c*3 + 3c*2 + 3c*4 + oc*2 + 12c*3 + 9c*4 = 0. -1, -2/3, 0 Let i(y) = -42 + 39y - 37 + 8 - 16 + 14. Let a be i(2). Factor -25/2b + ab*2 + 15/2. 5(b - 1)(2b - 3)/2 Let z be 14/6(-486)/(-189). Let d(q) be the second derivative of -8/3q*2 - 4/9q*3 - zq - 1/36q4 + 0. Factor d(m). -(m + 4)2/3 Factor 68/13a - 2/13a3 + 30/13a*2 + 0. -2a(a - 17)(a + 2)/13 Let k(r) = -r*2 + 39r - 95. Let l be k(40). Let d be -30 + 27 + l/(-39). Factor dc - 2/13c*2 - 4/13. -2(c - 2)(c - 1)/13 Let j be ((-60)/(-50))/(2/15). Let m be 134/j + (-29)/(-261). Find i, given that -6i - 36i3 - 858 + mi*4 + 27i*2 + 858 = 0. 0, 2/5, 1 Let y = -7114 - -7114. Let p(a) be the second derivative of -2/3a*3 - 1/7a*2 + y - 7/6a*4 - 15a. Determine m, given that p(m) = 0. -1/7 Let m(h) = -4h3 + 54h*2 - 12h - 302. Let q(n) = -n3 + n2 - 8n + 2. Let o(u) = -m(u) - q(u). Determine y so that o(y) = 0. -2, 3, 10 Let s be -1409512/(-180) + -9. Let g = s - 930. Factor -gt2 - 2/9t*3 + 0 + 0t. -2t2(t + 3)/9 Suppose -133d = -149d. Let u(m) be the first derivative of -5 + dm2 + 1/14m*4 - 2/7m*3 + 0m. Determine n so that u(n) = 0. 0, 3 Let g(b) be the first derivative of 5b6/6 + 996b*5 + 1230025b*4/4 - 4975010b*3/3 + 3120000b*2 - 2500000b + 7323. Solve g(v) = 0 for v. -500, 1, 2 Factor 0 + 1/2w3 - 33/2w*2 + 81w. w(w - 27)(w - 6)/2 Let o(a) be the first derivative of 4a5 + 28/3a*3 + 0a*2 + 61 + 12a*4 + 0a. Suppose o(s) = 0. What is s? -7/5, -1, 0 Let o(i) be the second derivative of 27i5/40 - 325i*4/4 + 2952i*3 - 1944i*2 - 514i. Suppose o(u) = 0. What is u? 2/9, 36 Let p(g) be the first derivative of -g*3/8 + 765g*2/16 + 771g/4 - 1819. Suppose p(r) = 0. What is r? -2, 257 Let q(g) be the first derivative of g*4/6 - 2g*3 + 2g*2 + 112g/3 - 329. Factor q(b). 2(b - 7)(b - 4)(b + 2)/3 Suppose -4k + 8 = 3a, 2k + 2a - 4 = -3a. Solve -32p2 - 27p*2 - 5p*3 - 2p*2 + 19p*k - 225p - 250 - 18p2 = 0 for p. -5, -2 Factor 3/8p*3 - 351/4 - 171/4p*2 - 1047/8p. 3(p - 117)(p + 1)(p + 2)/8 Let l = 2587/246 - 2/123. Let z = l - 47/6. Find k, given that -10/9k*3 + 4/9 + zk*2 - 2k = 0. 2/5, 1 Let i = 71 + -119. Let a be i/(-27) + 2/9. Let -2x2 - 180x + 6 + 176x + 0x*a = 0. What is x? -3, 1 Suppose 150 = 28u - 74. Let d(w) be the first derivative of 0w2 - 2/17w + 2/51w3 - u. Factor d(q). 2(q - 1)(q + 1)/17 Suppose -5l + 332 = -4u, 0 = -7l + 8l - u - 67. Let i(w) be the first derivative of 1/4w*4 - 5w*3 - 11 + 24w*2 + lw. Factor i(z). (z - 8)*2(z + 1) Let c be (-18)/99 - (-156)/11. Let y be c(4/3924 - 0). Factor 2/7o5 + 8/7o*3 - 8/7o*4 + 4/7o*2 - 10/7o + y. 2(o - 2)(o - 1)*3(o + 1)/7 Let n(s) = 383s + 113755. Let u be n(-297). Find v, given that 1/4v*u - 3v*2 - 16 + 20v - 5/4v3 = 0. -4, 1, 4 Suppose 28b = -56 + 140. Let p(f)	{ "pile_set_name": "DM Mathematics" }
.3 a Let u be 37/(-315) + 5 + 23/(-5). Let h = 2 - 1. Let a = -3 - 1. What is the nearest to u in h, -2, a? h Let s = 0.3 - 0.2. Let h = 5.39 - 2.39. What is the nearest to s in h, -1/4, 0? 0 Let d = 99 - 97. What is the nearest to d in -4/3, 2/11, -3? 2/11 Let i be (69/(-21) + -1)/(84/(-392)). What is the nearest to i in -4, 0.3, 2? 2 Let i be 1/(4/10 - 124/60). Let y = 3 - 5. Which is the closest to -2? (a) y (b) -5 (c) i a Let j = -0.082 - 0.118. Which is the nearest to 0.2? (a) 0.3 (b) 1/7 (c) j b Let m be (68/(-72) - -1)-4. Let z = 5/18 - m. Which is the closest to -1? (a) 0.4 (b) -5 (c) z a Let j be (-249)/(-332) + 3/(-3) + -1 + 1. Let c be 1/2 - 2/(-1). What is the nearest to j in 3, -1/9, c? -1/9 Suppose -28y = -27y. What is the nearest to -2 in 8, 1/3, y? y Let a = 108 - 108.2. Suppose -5d = -5h - 50, -2h = 2h + 4d + 8. Let j be (3/h)/((-3)/(-6)). What is the nearest to -0.2 in a, j, 1/2? a Let w = 18 - 92/5. What is the nearest to -1.2 in -2/9, 0, w? w Let d be 3/62/4. Let t = 0.111 - 31.911. Let k = -32 - t. Which is the nearest to k? (a) d (b) 5 (c) -2 a Let x = -4 - -10. Let q = 6.08 - x. Let t = q + -0.08. Which is the closest to 0? (a) t (b) 2/5 (c) 2/9 a Let d = -0.22 - -2.02. Let j = 3.8 - d. What is the closest to 0.1 in 3, -1, j? -1 Let q = -42 - -22. Let a = -757 - -731. Let m = q - a. What is the closest to 2 in m, 4, -1/3? 4 Let f be 2/20 + (-265)/150. Let z = -167/2 + 82. Which is the nearest to 0? (a) -3/5 (b) f (c) z a Let v be ((-1)/(-10))/(10/(-25)). Let h = -3 - -4. Which is the nearest to -0.2? (a) v (b) 2 (c) h a Let h = 8 + -7.97. Let s = 4.03 - h. Let n = -0.407 - -0.307. Which is the closest to n? (a) s (b) -1 (c) -2 b Let m be 30/(-9)(-3)/15. What is the nearest to -0.04 in 0.2, 0.4, -4, m? 0.2 Let g = 28/75 + -1/25. Let n = -209/402 + 4/201. Which is the nearest to g? (a) n (b) -4 (c) 0.33 c Suppose -5q + 3i = -45, 5i = q - 24 - 7. Let w(u) = -2u + 3. Let x be w(q). Let o = -5 - x. Which is the closest to 2? (a) -0.1 (b) o (c) 3 c Let h be (-4)/15(-24)/16. Which is the nearest to 2/3? (a) h (b) -4 (c) 2 a Let g = 3 - 34. Let d = g + 19. Let r = d - -12.5. Which is the nearest to -1? (a) -0.08 (b) 2 (c) r a Let m = 0.09 + 0.21. Let n = -33.1 + 33. What is the closest to n in 1/3, -9, m? m Let s be -1((3 - 20) + -3). Let x be -5 + 2 + 72/s. Which is the closest to -2/7? (a) -5 (b) -0.1 (c) x b Let h = 466 + -457. Which is the closest to 0? (a) -5/2 (b) h (c) 5 a Let i(w) = -w3 + 20w*2 - 18w - 15. Let m be i(19). Let x = 3.9 - 1.9. Which is the nearest to -0.1? (a) x (b) m (c) -2 c Let m = -41/86 - 1/43. Let n = -5 + 4. Let i = 1.1 + n. What is the nearest to i in m, 3, -3? m Let i be -1 + (0 - 6)/2. Let j be (-2 - (i + 0)/(-4))/5. Which is the nearest to -0.1? (a) -0.2 (b) j (c) 5/2 a Let s = -0.34 + 0.24. Let n = -0.7 - -0.6. Which is the closest to n? (a) 2/3 (b) 0.5 (c) s c Let h = -1.494 + 6.494. Suppose -4x = -3x + 6. What is the closest to x in h, 3, -1/3? -1/3 Let n = 8 + -8.03. Let r = -329 + 324. What is the nearest to n in -1/6, r, -4? -1/6 Let u = -0.05 - 3.95. Let s = -472 + 474. Which is the nearest to -0.2? (a) 1 (b) u (c) s a Let g = 2.0325 - 0.0325. Which is the closest to 2? (a) 3 (b) -2/5 (c) g c Let f = -9/437 - -937/3059. Let j be ((-6)/8)/((-1)/(-4)). Which is the closest to f? (a) 0.2 (b) -9 (c) j a Let n = -0.79 + 16.79. What is the nearest to -1 in 1/5, 0.1, n, 2? 0.1 Let y be 36/(-126) + 5/(-7). Let r = -154 + 466/3. Let u = 4 - 7. Which is the nearest to y? (a) -0.3 (b) u (c) r a Let r = -11 + 11. Suppose 2y + 2t - 2 = 0, 2t = -4y - 2 + 6. Which is the nearest to -2/13? (a) 3 (b) y (c) r c Let h = -2.04 + 2.2. Let t = h - 4.16. Let p = 2 + -3. Which is the nearest to p? (a) 1 (b) t (c) 5 a Let c = 0 - 0.1. Let s = -1.79 - 2.21. What is the closest to c in 0.5, -2, s? 0.5 Let b be (-6)/4(-2 - -4). Let g = 2647/102 + -155/6. What is the closest to 2 in 3, b, g? 3 Let c = 1721 - 1720.2. Let i = 0 - -1. What is the closest to -0.1 in c, i, -4? c Let m = 0.06 + -1.26. Let r = m + 0.2. Let y = -7.28 - -12.28. Which is the closest to 0.1? (a) r (b) -5 (c) y a Let z = 22.4 + -22. Let r = -0.8 - -1. What is the closest to 1 in z, 3, r? z Let j be -2 + (-2 - 0) + 2. Let n be j - (-5 + 1) - 2. Let b = -2.7 - -2.5. What is the nearest to 2/7 in b, 4, n? n Suppose -5d + 2 - 22 = -5s, 4s - 3d = 18. Let k(n) = -n2 + 7n - 3. Let g be k(s). Suppose -gp - 1 = 5. Which is the nearest to 2? (a) p (b) 4/7 (c) 3 c Let t = 759/91 - 2/273. Let o = t - 9. Let d be 2/(-9) - 50/(-144). What is the closest to 1 in d, o, 0.5? 0.5 Suppose -18j = 7j + 50. Which is the closest to -0.4? (a) j (b) -0.4 (c) -2/21 (d) -0.1 b Let o be (-2)/6 - (-2)/24. Let z = 8.93 + -4.93. What is the nearest to 0.5 in z, o, 5? o Suppose 156g = 149g. What is the nearest to 1/2 in -3, 7.2, g? g Let f be (6/20)/(5/(40/6)). What is the closest to f in 0.2, 1, -2? 0.2 Let s = 3.2 - 3.2. Let l = -3.5 + 4. Let w = l + -0.3. Which is the closest to 3? (a) w (b) s (c) 0.4 c Let g = 12.9 - 12.6. What is the closest to 0.4 in g, -0.4, -0.1? g Let t = 0.44 + 0.04. Let y = 0.4 + -0.32. Let f = t - y. Which is the nearest to -1? (a) 1 (b) f (c) 2 b Let u be (-4 + (11 - 3))(2 + -1). Let l(s) = -s*3 - 3s*2 - 5. Let v be l(-4). Suppose 0 = 4k - 6k. What is the nearest to k in 0.4, u, v? 0.4 Let x = -1.07 + 0.07. Let m = -11 - -8. What is the nearest to x in m, 3, -2? -2 Let h = -0.31 + 0.21. Let m = 0.9919 + 0.0081. Which is the nearest to -3? (a) m (b) h (c) -2 c Let q = 0.22 + -0.42. Let a = -1522 + 1522.06. Let p(f) = -f - 4. Let z be p(-6). What is the nearest to a in -0.4, z, q? q Suppose 3r + 2j = 10, 0r + 20 = 5r + 4j. Suppose rs - 2s = 8. What is the nearest to -0.1 in s, 2, 1/4? 1/4 Suppose 10 = 4b + 2. Suppose 0 = 8i - bi + 78. Let s be (-19)/12 - i/52. What is the closest to -0.1 in 0.4, s, 4/5? 0.4 Let s(k) = -k2 + 8k + 20. Let l be s(9). What is the nearest to 2/7 in 1/2, -0.3, -2, l? 1/2 Suppose -9k + 4 = -11k. Let m be (-2)/(-9) + 80/(-144). Which is the nearest to k? (a) m (b) -1/2 (c) 0.1 b Let b be 10/(-8) + (-2)/(-8). Let q = 2.16 + -3.31. Let t = q - 0.85. What is the nearest to b in -2/11, t, -2/19? -2/11 Let j = -0.217 + 2.217. What is the closest to 0.2 in -11, j, 3? j Let x be 40/(-42) + (-14)/(-21). Let a = 3 + -2.7. Let d = -119 - -116. What is the closest to 1 in a, d, x? a Let u be ((-40)/25)/(-8) - 13/15. Which is the nearest to 0? (a) -6 (b) u (c) -1 b Let m = -108 + 106. Which is the closest to 3? (a) -3 (b) m (c) 0.2 c Let k be (7/(-7))/(10/(-4) + 2). Let i(l) = l*3 - 7l*2 - 5. Let f be i(7). What is the closest to 4 in k, f, 1? k Suppose 5u - 14 - 71 = 0. Suppose -x = -4o + 7, 4x = -x + 2o - u. Which is the nearest to -1? (a) 0.2 (b) x (c) 4 a Suppose 2r = -5l + 26, -71 = -2r - 4l - 49. What is the nearest to -1 in 6, -0.5, r, -0.3? -0.5 Let r = 1 - 2. Let m = 5/3 + -4/3. Which is the nearest to -0.1? (a) m (b) -4 (c) r a Let y be (-3 - -1)/(252 - 1)-1. Let r = -763/1255 + y. Which is the nearest to 2? (a) -2/13 (b) r (c) 4 c Let y be (187/22 + -9)0. Let i = -0.03 - -2.03. What is the closest to y in -3, -4, i? i Let h be 54/135 - ((-1598)/980 - -2). Which is the nearest to 0? (a) h (b) 1/10 (c) -4 a Let z be -2 + 4 - -2106/(-27). Suppose -5d + 4d + 45 = 0. Let v = d + z. Which is the nearest to v? (a) 4 (b) -4 (c) -0.2 c Let o = 97.1 - 98.1. What is the closest to o in 0.3, -1/3, -0.7, -0.5? -0.7 Let u be 0 + ((-28)/(-8))/7. What is the closest to u in -8, 0.2, -6? 0.2 Let o be ((-41)/(-123))/(3/((-54)/309)). What is the nearest to 1/3 in o, -1/7, -4? o Let w = -74 + 80. Which is the nearest to w? (a) 4 (b) -1 (c) -3 (d) 5 d Let m = 1976 + -1975.8. Which is the closest to -0.1? (a) -6 (b) -0.9 (c) m c Let o = 29.6 + -33. Let x = o - -0.4. Let q = -2.27 + 2.27. Which is the closest to 2? (a) -5 (b) x (c) q c Let d = 8 + -7. Let n = 0.47 + -69.47. Let u = n - -69. Which is the closest to u? (a) d (b) 2 (c) -0.2 c Let w = 92.7 + -90. Let d = w + -2.6. Which is the closest to d? (a) 2/9 (b) 4 (c) 2 a Let u = -0.112 -	{ "pile_set_name": "DM Mathematics" }
n. 25 Solve 0 = -39747889c + 39748024c + 8505 for c. -63 Solve -217448v = -211581v - 152542 for v. 26 Solve -16956 = 996s - 83s + 44203 + 21011 for s. -90 Solve -9989i + 19970i + 1444 = 10117i + 18444 for i. -125 Solve -3682 - 168 = 110a for a. -35 Solve -2468i + 128657 + 39167 = 0 for i. 68 Solve -15638u + 95527 - 65882 = 4922u - 874995 for u. 44 Solve -1635j - 5184 - 4192 = 6974 for j. -10 Solve 3088x = 1483x - 2386x - 98202 - 65429 for x. -41 Solve 67789 - 78897 = 3961z + 135449 for z. -37 Solve 22326c - 3091599 + 144567 = 0 for c. 132 Solve 158s - 66s + 7s = -215s + 17584 for s. 56 Solve -180t + 69148 - 63928 = 0 for t. 29 Solve 0 = 280j - 6397 - 5923 for j. 44 Solve 662470q + 1900 = 662508q for q. 50 Solve 394x - 54x = 200x + 10220 for x. 73 Solve 241822 - 232880 = -263x for x. -34 Solve 267d + 4759 + 8743 = 4691 for d. -33 Solve -1344v = -1400v - 1008 for v. -18 Solve 250775 = 100n + 251175 for n. -4 Solve -165 = -307k + 7203 for k. 24 Solve 105410 = -2970o - 10420 for o. -39 Solve -39b - 102b + 273b = -453b + 54405 for b. 93 Solve -10917n = -10992n - 300 for n. -4 Solve 467a - 261a - 2642 = 14456 for a. 83 Solve 112w + 1709 - 362 = 227 for w. -10 Solve -24085 = -1111x - 26866 - 53880 for x. -51 Solve 3714z - 3654z + 1560 = 0 for z. -26 Solve -1439633y + 1439626y = 217 for y. -31 Solve 24760v - 172564 - 198506 = -90425 + 165035 for v. 18 Solve 5841 = 2920z + 8761 for z. -1 Solve 28302k - 28356k - 540 = 0 for k. -10 Solve -12259s + 12429s + 8840 = 0 for s. -52 Solve 140s - 53208 = 1566s + 52s for s. -36 Solve 1401q - 319q - 25968 = 0 for q. 24 Solve -88t + 2864 = -832 for t. 42 Solve 0 = 903o - 1180o - 1810 - 17285 - 4173 for o. -84 Solve 33x + 6523 + 2653 = -41x - 50x for x. -74 Solve -294r - 10402 = -305r + 754r for r. -14 Solve 80885p - 40343p - 40432p + 6490 = 0 for p. -59 Solve 781v + 81883 = 107656 for v. 33 Solve -222 + 445 = -3101t - 415t + 223 for t. 0 Solve -5717s - 1162 = -5551s for s. -7 Solve -592n + 9066 + 2255 - 1257 = 0 for n. 17 Solve 30547 = 357k + 83383 for k. -148 Solve -1551 + 1398 = 1309r + 2465 for r. -2 Solve -105d + 14d + 5655 = 45d + 59d for d. 29 Solve -1214j - 789j = 123j + 138190 for j. -65 Solve -32n = -27n + 67n - 41530 + 37786 for n. 52 Solve -4568 + 8786 = -222p for p. -19 Solve 1122 = -212951m + 212852m - 3432 for m. -46 Solve 0 = -5489k + 87479 + 186971 for k. 50 Solve 126r + 288 - 723 = 447 for r. 7 Solve 0 = -13749h + 13657h + 1932 for h. 21 Solve -8175 = -1031x - 59725 for x. -50 Solve 296d - 2829 - 5725 - 1003 = -85 for d. 32 Solve -3939k + 5210 - 178526 = 0 for k. -44 Solve 440c = 159c - 571c - 23004 for c. -27 Solve 0 = -744d - 206d + 24700 for d. 26 Solve 4101t - 3525 = 3960t for t. 25 Solve 797t + 22301 = -4509t + 24351 - 262044 for t. -49 Solve -1977 - 875 - 172 = -138b + 978 for b. 29 Solve 37032b = 34467b + 253935 for b. 99 Solve 92206s - 7740 = -92278s + 184613s for s. -60 Solve -2751h - 4047 = 9708 for h. -5 Solve 948d + 10018 + 8361 = -20489 for d. -41 Solve -63a - 176 = 41a + 9a - 402 for a. 2 Solve -279b - 329 = -31485 - 2324 for b. 120 Solve -338o - 10o - 4981 - 5459 = 0 for o. -30 Solve -2489l - 24120 = -2891l for l. 60 Solve -5f + 38f - 6460 = 223f for f. -34 Solve -343s - 5901 - 3964 = 5913 for s. -46 Solve -276w + 1196w - 14874 = 391w + 395w for w. 111 Solve 1641y = -798y + 29268 for y. 12 Solve -2788m - 330245 = 71227 for m. -144 Solve -2272 = -438f - 1620 + 2414 for f. 7 Solve 0 = -69365a + 69748a - 10341 for a. 27 Solve -100q - 5841 = -978q + 8207 for q. 16 Solve 0 = -3357k + 3459k + 3774 for k. -37 Solve 0 = -2264f - 29495 + 13647 for f. -7 Solve -110v + 4937 - 5214 = 2143 for v. -22 Solve 153d - 755d + 5103 = 514d - 21681 for d. 24 Solve -57d = -763492 + 761668 for d. 32 Solve -1428a - 3186 = -1310a for a. -27 Solve 1392g + 1311 = 1335g for g. -23 Solve -95v + 80v - 10v = 106v - 19257 for v. 147 Solve -109 - 108 = -25d - 17 for d. 8 Solve 7k - 141709 = -141471 for k. 34 Solve -31p + 1208 = -17p + 53p - 2142 for p. 50 Solve -4902o - 179559 - 43619 = 30014 - 8092 for o. -50 Solve 5c + 5 = 34c - 51c - 171 for c. -8 Solve -4427m - 1707m - 222864 - 40922 = 141058 for m. -66 Solve -8695p = 4536p + 70548 + 789467 for p. -65 Solve 660w + 517680 = 2184w + 4671w - 443w for w. 90 Solve -905 + 246 = -51d - 29 + 798 for d. 28 Solve 0 = -1452n + 16361n + 4652 - 360846 - 240166 for n. 40 Solve -164a - 4212 = -185a - 33a for a. 78 Solve -130h = -37h + 3441 for h. -37 Solve -6192u + 7281u = -57717 for u. -53 Solve 2731 - 1839 + 7163 = 383v - 14925 for v. 60 Solve -21516y = 557799 - 3419427 for y. 133 Solve 175o = -35221 + 22971 for o. -70 Solve -2149a - 888a = 351a + 497a + 27195 for a. -7 Solve -351p - 344p - 8264 + 26522 = 379p for p. 17 Solve 6663n = 3318n + 3342n + 315 for n. 105 Solve 213p = -8254 + 373 for p. -37 Solve -358w - 62411 = 1595w + 85 for w. -32 Solve -4136d - 108330 = 19886 for d. -31 Solve -232n + 81n + 540 = -68n - 38n for n. 12 Solve -31k - 236k - 207k - 1800 = -24k for k. -4 Solve 1139j + 26551 = -7619 for j. -30 Solve -1063h + 3888 = -847h for h. 18 Solve -471 = -18o - 33o - 1542 for o. -21 Solve -934v - 29579 - 8846 = -171v + 16511 for v. -72 Solve 3108 - 1947 = -204r - 3574 - 365 for r. -25 Solve -101c + 782c - 73193 = -700c for c. 53 Solve 222713 = -3730u + 36213 for u. -50 Solve -4097u = -3760u + 7414 for u. -22 Solve -223b = 115b + 11471 + 7119 for b. -55 Solve -12l = 1825435 - 1824943 for l. -41 Solve 947 - 1387 = 3q - 113q for q. 4 Solve -334p + 3583 = -1938p - 22954 - 10355 for p. -23 Solve -72m + 708 = -3482 - 1193 - 161 for m. 77 Solve 9071a - 32659 - 43469 = 14582 for a. 10 Solve 85n + 9497 = -71n - 3262 - 1125 for n. -89 Solve 109o - 46011 = -48300 for o. -21 Solve 4602q + 5505q - 360023 = 629565 - 150707 for q. 83 Solve 9x - 33 = 75 for x. 12 Solve -331m - 25826 = -6628 for m. -58 Solve -63946i + 63941i + 155 = 0 for i. 31 Solve 683 - 748 = -432w - 296 - 1065 for w. -3 Solve 630 = 289w + 375w - 769w for w. -6 Solve -49g = 2176g + 189125 for g. -85 Solve -136h = -35h - 4681 - 975 for h. 56 Solve -72d + 88331244 - 88333044 = 0 for d. -25 Solve -14683 = 164l - 480l + 7753 for l. 71 Solve -419909 = 7731i + 278269 - 56505 for i. -83 Solve 1061802 + 54815 + 35031 = 8468u for u. 136 Solve 134x - 3236 - 504 = 157x - 108x for x. 44 Solve -1662q + 232q + 1685 - 255 = 0 for q. 1 Solve -761t - 76t = 154t + 128830 for t. -130 Solve 15638 = -6643a - 870a - 194726 for a. -28 Solve -7i - 34i - 608 = -1633 for i. 25 Solve -5953 = 245r - 609r - 32161 for r. -72 Solve -1074 = -468c - 25410 for c. -52 Solve -1751y - 588y = 39763 for y. -17 Solve 2417l + 216 = 4821l - 2332l for l. 3 Solve -892a - 6614 - 1710 = -23195 - 30621 for a. 51 Solve -42901i = -21458i - 21451i + 272 for i. 34 Solve -300k + 86k + 69k = -97k - 2928 for k. 61 Solve -4519t + 270165 = -26132 - 199649 - 37296 for t. 118 Solve -1104h - 1843h - 1002h = 149h + 188508 for h. -46 Solve -1991951 = -19h - 1990526 for h. 75 Solve -69i + i + 25670 = 22610 for i. 45 Solve 0 = 16690g - 17077g + 31347 for g. 81 Solve 683n - 6896 = -53982 + 18123 - 33190 for n. -91 Solve -216y = -166y - 1081 + 281 for y. 16 Solve -3571b + 1366132 = -15348b for b. -116 Solve -1251388k = -1251170k + 10682 for k. -49 Solve 4938v - 2747v - 2784v = 65230 for v. -110 Solve 146m = -684375 + 700581 for m. 111 Solve -83740c + 84438c = 49558 for c. 71 Solve -606u = -71u + 210u - 35015 for u. 47 Solve -251i + 115i + 15508 + 3446 = 215i for i. 54 Solve 59r + 1005 + 392 = 99 for r. -22 Solve -16947 - 4500 = -348t - 915 for t. 59 Solve -29j - 1 + 33 = 3 for j. 1 Solve 0 = -342z + 479z - 2603 for z. 19 Solve -1518r - 15900 = -733r - 573r for r. -75 Solve -504x + 44456 - 43448 = 0 for x. 2 Solve -69896 = -850w - 2746 for w. 79 Solve 24x + 10466 = 13490 for x. 126 Solve 983 = -6579n + 6533n - 29 for n. -22 Solve 58r - 94r + 12r + 9266 = 202r for r. 41 Solve 53710p + 33232 = 54246p for p. 62 Solve 0 = 124q - 556 + 2176 + 3340 for	{ "pile_set_name": "DM Mathematics" }
t is -13 - 1006? -1021 In base 2, what is 100 - 100001? -11101 In base 10, what is 4 - -2643? 2647 In base 6, what is -10 + 521? 511 In base 9, what is 704 + 2? 706 In base 2, what is 10111110101 + 0? 10111110101 In base 14, what is 54 - 5? 4d In base 12, what is 82 - b? 73 In base 13, what is -14c + -1? -150 In base 16, what is 6 - -21? 27 In base 14, what is 36 - -150? 186 In base 10, what is -4 - 5740? -5744 In base 4, what is -11 - -11321? 11310 In base 8, what is -13 - 154? -167 In base 13, what is 11 + 5? 16 In base 8, what is -1253 - 2? -1255 In base 10, what is -7 - 3? -10 In base 11, what is 101 + -8? a4 In base 15, what is -127 - 10? -137 In base 8, what is -4 + -2? -6 In base 13, what is -158 + -2? -15a In base 5, what is 31 + -23? 3 In base 13, what is 50 + -72? -22 In base 4, what is 12100 - -2? 12102 In base 16, what is 13 + -7d? -6a In base 11, what is 9 - 56? -48 In base 7, what is -46 - -11? -35 In base 2, what is 10000100011 + -10? 10000100001 In base 3, what is 1000210 + -12? 1000121 In base 13, what is 2 - -890? 892 In base 5, what is 10 + -233? -223 In base 13, what is -55 + 3? -52 In base 7, what is 4 - 35? -31 In base 16, what is 1 + -2fd? -2fc In base 10, what is 114 + 4? 118 In base 7, what is -111 - 1? -112 In base 6, what is -13 - 122? -135 In base 4, what is -132012 + -11? -132023 In base 5, what is -341 - -23? -313 In base 4, what is -32 - -1113? 1021 In base 2, what is 1111 - 11110? -1111 In base 13, what is 23 - 0? 23 In base 8, what is 132 + -5? 125 In base 4, what is 3 + 1113? 1122 In base 16, what is 0 - 1b8f? -1b8f In base 11, what is -2 - -754? 752 In base 5, what is 23 + 114? 142 In base 4, what is 0 - 310? -310 In base 8, what is -1 + -13? -14 In base 6, what is -2 + 31? 25 In base 2, what is -11001111101 + 10? -11001111011 In base 16, what is 161 + 5? 166 In base 2, what is -101 - -10100011110? 10100011001 In base 4, what is -33 + 1300? 1201 In base 10, what is -6 - 670? -676 In base 3, what is -21 - -100? 2 In base 10, what is -4 + -2768? -2772 In base 5, what is 3 - -32333? 32341 In base 16, what is 30a - 1? 309 In base 15, what is 1 - -285? 286 In base 9, what is -201 - 6? -207 In base 8, what is -2 + 64? 62 In base 3, what is 0 - 2100221? -2100221 In base 6, what is -520 - -1? -515 In base 7, what is -30 + 66? 36 In base 10, what is 1 - -82? 83 In base 14, what is 346 - -2? 348 In base 10, what is 5730 - 1? 5729 In base 4, what is -2301 - 1? -2302 In base 2, what is -1 + 10110? 10101 In base 2, what is -10 - -1010001001? 1010000111 In base 5, what is -14 - 1232? -1301 In base 10, what is 1 - -34? 35 In base 2, what is 11101 + -111010111? -110111010 In base 13, what is -122 + 4? -11b In base 5, what is -130 + 11? -114 In base 9, what is -64 + -128? -203 In base 15, what is -6 - 165? -16b In base 10, what is -5 + 293? 288 In base 13, what is 4 + -210? -209 In base 9, what is 67 - -1? 68 In base 13, what is -46 - -1? -45 In base 15, what is -7 + 31? 29 In base 6, what is 0 + -11141? -11141 In base 10, what is 3 - 1085? -1082 In base 3, what is -11 + 0? -11 In base 8, what is 4 - 103? -77 In base 10, what is 209 - 3? 206 In base 15, what is 2c7 + -1? 2c6 In base 15, what is -7 - -1a7? 1a0 In base 7, what is -214 + 211? -3 In base 6, what is 10 + -1412? -1402 In base 10, what is -1 + 1013? 1012 In base 6, what is 3243 - 3? 3240 In base 5, what is -1013 - 11? -1024 In base 6, what is -20 - -2103? 2043 In base 4, what is -13 + -10023? -10102 In base 10, what is 2 - -55? 57 In base 14, what is 1 - -5a? 5b In base 10, what is -7 + 43? 36 In base 9, what is 2063 - 0? 2063 In base 13, what is c + -36? -27 In base 3, what is 0 - -2202? 2202 In base 15, what is 167 + 3? 16a In base 2, what is 1000 - -101? 1101 In base 6, what is -43 - 15? -102 In base 13, what is -2 - 1796? -1798 In base 4, what is 2220230 - 1? 2220223 In base 6, what is 204 + -1012? -404 In base 13, what is ca9 + 4? cb0 In base 10, what is 361 - -1? 362 In base 8, what is -275 + -3? -300 In base 11, what is 88 - -81? 159 In base 3, what is 21 - 122? -101 In base 9, what is -4 - -15? 11 In base 16, what is f8 + -4? f4 In base 7, what is 4 + 14363? 14400 In base 16, what is 6c - -38? a4 In base 15, what is -1 - 435? -436 In base 9, what is 3 + 106? 110 In base 16, what is -4 + -8? -c In base 15, what is -82 + 2? -80 In base 8, what is -175 - 2? -177 In base 5, what is 313 + -1? 312 In base 16, what is 45 + 13? 58 In base 5, what is -12 - 31? -43 In base 3, what is -2 + -2200? -2202 In base 14, what is 2 + -786? -784 In base 12, what is 302 - -10? 312 In base 6, what is -1 + 254? 253 In base 3, what is 121000122 - 11? 121000111 In base 13, what is 83b3 - -5? 83b8 In base 5, what is 4 + -11204? -11200 In base 16, what is b + 6? 11 In base 14, what is 82 - -2? 84 In base 13, what is -882 + -1? -883 In base 13, what is -2c3 + 5? -2bb In base 13, what is 46 - 2? 44 In base 13, what is 16 - 89? -73 In base 10, what is -5 + -514? -519 In base 15, what is -1d - 5? -23 In base 3, what is 1221221 + 11? 1222002 In base 14, what is 9 - -22? 2b In base 10, what is -5 + 1642? 1637 In base 2, what is 1110001110 - 110? 1110001000 In base 15, what is -61 - 12? -73 In base 10, what is -2627 + 3? -2624 In base 13, what is 12a - -4? 131 In base 4, what is 1103 + 21? 1130 In base 8, what is -6235 + -1? -6236 In base 10, what is 20962 + -4? 20958 In base 6, what is 235 - -20? 255 In base 14, what is -4 + 19? 15 In base 15, what is bd - 0? bd In base 11, what is -34a + -2? -351 In base 10, what is 5 - -516? 521 In base 11, what is -5643 - -5? -5639 In base 11, what is 1 + 18? 19 In base 11, what is 19 + -29? -10 In base 10, what is 3 + -5? -2 In base 13, what is 0 + 7c1? 7c1 In base 9, what is -68 + 445? 366 In base 15, what is 65d + -1? 65c In base 14, what is 3318 - 0? 3318 In base 6, what is 350230 - 5? 350221 In base 9, what is 2 + -2117? -2115 In base 9, what is -1 + 1835? 1834 In base 11, what is 0 - 5? -5 In base 3, what is 0 + -12010? -12010 In base 11, what is -473 + 18? -456 In base 9, what is 4 - 180? -175 In base 15, what is 1 - 27a? -279 In base 12, what is -43 + 5? -3a In base 14, what is -6 + -79? -81 In base 14, what is -4 + -d55? -d59 In base 3, what is -11 + -10? -21 In base 6, what is -2 + 3? 1 In base 5, what is -11 + -123? -134 In base 7, what is -42 + 20? -22 In base 7, what is -203 + 1? -202 In base 8, what is -50 + 11? -37 In base 16, what is -1d + -43? -60 In base 6, what is 23121 - 0? 23121 In base 4, what is 3303 - 133? 3110 In base 2, what is -100 - -1? -11 In base 15, what is -3b8 + 3? -3b5 In base 12, what is 4 - -28? 30 In base 12, what is 6 + -2811? -2807 In base 4, what is 1332 - 21? 1311 In base 8, what is -622 - 4? -626 In base 3, what is 200 + 21022? 21222 In base 8, what is 4 + -62? -56 In base 12, what is 117 + 5? 120 In base 7, what is 130 - -26? 156 In base 13, what is -5 - 233? -238 In base 4, what is 1010 - -10? 1020 In base 10, what is -221 - 5? -226 In base 13, what is 2c + 2? 31 In base 16, what is 30f - -2? 311 In base 10, what is -375 + 0? -375 In base 6, what is 544 - -235? 1223 In base 15, what is -180 - -2? -17d In base 14, what is -5 - 5b? -62 In base 15, what is 20 + -12? d In base 5, what is 2 + -10302? -10300 In base 11, what is 3784 + 2? 3786 In base 6, what is 21 - 1241? -1220 In base 6, what is 5 - -30105? 30114 In base 5, what is 4 - 100? -41 In base 10, what is 960 + 2? 962 In base 8, what is -34270 - 5? -34275 In base 9, what is 156 - 0? 156 In base 13, what is 5 - 73? -6b In base 14, what is 0 - 3b1? -3b1 In base 12, what is 194 - 4? 190 In base 15, what is 7b2 + -2? 7b0 In base 9, what is 4 - -671? 675 In base 5, what is -3334 - 1? -3340 In base 14, what is 41 + -10d? -ac In base 6, what is -12013 + -1? -12014 In base 6, what is -3 + 4433? 4430 In base 4, what is 11 - -2213? 2230 In base 6, what is 1334 - 4? 1330 In base 4, what is -11 + 3030? 3013 In base 10, what is -12 - 5? -17 In base 12, what is -19 + 272? 255 In base 9, what is -6667 + -5? -6673 In base 15, what is 12 + -14? -2 In base 6, what is -31133 + 3? -31130 In base 11, what is 2 + -99? -97 In base 13, what is 42 - -2b? 70 In base 13, what is 3085 + -4? 3081 In base 10, what is -4 - 789? -793 In base 2, what is 0 - 101101100001? -101101100001	{ "pile_set_name": "DM Mathematics" }
(c) -0.5 (d) -100 (e) -2/5 a Which is the sixth biggest value? (a) -1 (b) 442 (c) -2.1 (d) -4 (e) 1 (f) 4 d What is the fourth smallest value in 48, 1/4, 139271, -3? 139271 Which is the second biggest value? (a) -13/4 (b) 1/3 (c) 1.9652 b Which is the third smallest value? (a) 0.7 (b) -26/9 (c) 3 (d) -2 (e) 123 (f) -0.3 f Which is the second smallest value? (a) 0.05 (b) -223 (c) -545 b What is the third biggest value in -3/5, 18, 3/8, 3, 5549, -1? 3 What is the fourth biggest value in 1.519, 2/3, 0.3, -26/15, -5? -26/15 What is the second biggest value in 1, -51.3, -211.071? -51.3 What is the third smallest value in -45/4, 365, 3048? 3048 What is the fifth biggest value in -4, -84, 1, 7, 0.025109? -84 What is the biggest value in -0.3, -2, 7, 1, -0.5, -13/444, -4? 7 Which is the biggest value? (a) -13 (b) -1/10 (c) -700759 (d) 3/10 d Which is the third smallest value? (a) -6 (b) 784 (c) 118.2 b What is the third smallest value in 1/11905219, 1, -14? 1 Which is the second smallest value? (a) 1 (b) 4 (c) -0.33 (d) -215984 c Which is the third smallest value? (a) 171 (b) 0.5 (c) -16727 (d) 1 d What is the fourth smallest value in 5, 7, 3, 2/9, 0.41, -0.0871? 3 What is the seventh biggest value in 0.05, 1/3, -1, -5, 4/3, 36, 1/50? -5 What is the smallest value in -39, 35152/519, -0.3? -39 What is the fourth smallest value in 0, 67, -12976, 1/2? 67 What is the fourth smallest value in 0.5, 9, 165, 45, 29? 45 Which is the second biggest value? (a) -41.6 (b) 1 (c) -4 (d) -0.4 (e) 2/13 (f) 1/3 (g) 302 b Which is the second smallest value? (a) -10905/7 (b) -6 (c) 21 b What is the seventh biggest value in -0.5, 6.2, 0, -6, 1, -0.2, -3? -6 Which is the sixth biggest value? (a) 0.12 (b) 1.8 (c) 0.2 (d) -66/23 (e) 6.2 (f) -5 (g) -4 g Which is the fourth biggest value? (a) -91 (b) 105 (c) 0 (d) -17/5 (e) 0.3 (f) -1 f What is the third smallest value in 412, -1/155412, 3? 412 Which is the biggest value? (a) 3964 (b) -1.3 (c) -225 a What is the seventh biggest value in 0.4, -102.15, -0.2, -330, -1, 4, 1/4? -330 What is the third biggest value in 29.5, 7, 0, -153, 5? 5 Which is the second smallest value? (a) -3/7 (b) 98/3 (c) -5.8 (d) -1 (e) -4 e What is the biggest value in 5/3, 22, -8, 2/27, 14/5? 22 What is the smallest value in -1/4, 1/365, -1/18, 4, 0, 2/51? -1/4 Which is the third biggest value? (a) -0.397 (b) 1/3 (c) -0.2 (d) -15 (e) 5 c What is the third smallest value in -1/9, 0.8, -5, -216, 11? -1/9 Which is the fourth smallest value? (a) 0.132 (b) -0.3 (c) 3/7 (d) 214/23 d Which is the second biggest value? (a) -6 (b) -6/911 (c) -0.11 (d) 4 (e) 2 (f) -0.2 e Which is the biggest value? (a) 267 (b) 0.5 (c) 64/435 a Which is the fourth biggest value? (a) 0.01 (b) -5 (c) 3/254 (d) 5 (e) -16 b What is the third smallest value in -2, 0.4, 0.7, 1350620? 0.7 What is the smallest value in 10/167, 0.1, 1, -4, 7, 20.6, 6? -4 Which is the second biggest value? (a) 2 (b) -2 (c) 3 (d) 13 (e) 0.3 (f) -0.065 (g) 116 d What is the fourth smallest value in -2/3, 1/625, 5, 125, 1? 5 Which is the fifth biggest value? (a) 2 (b) 1 (c) -384 (d) -2/9 (e) 640 c What is the fourth smallest value in 0.1, -91869, -3, 11, -5? 0.1 Which is the fourth smallest value? (a) 2 (b) -2/10947 (c) -6/13 (d) -9 (e) -0.5 b What is the sixth smallest value in 1.2, 1/3, -8, -1, 5, -0.5, -16862.9? 1.2 What is the smallest value in 1, -76219, 4? -76219 Which is the second biggest value? (a) 1/766 (b) 1.9 (c) 1 (d) 1/28 (e) -1 (f) 2/11 (g) -10 c Which is the fourth smallest value? (a) 278 (b) 0.4 (c) 4815 (d) 2 (e) 4 a What is the third biggest value in -3, 0, 3099, 389, 5? 5 What is the second smallest value in -2/7, 1, -58/3, 2/5, 156, 5? -2/7 Which is the fourth smallest value? (a) -9/4 (b) -0.05 (c) 1/3 (d) -0.1 (e) 38925 c What is the sixth biggest value in -1/4, -0.5, -1537, 0.1, 27, 0.2? -1537 What is the third biggest value in -2/6383, 4/11, 432, 2/3? 4/11 Which is the seventh biggest value? (a) -18 (b) -127 (c) -0.6 (d) -1/8 (e) 0.1 (f) -0.01 (g) 2 b Which is the third biggest value? (a) 1 (b) -140 (c) 3 (d) 0.26 (e) 5 (f) 2 f Which is the fourth biggest value? (a) 6/5 (b) -11 (c) 88/9 (d) 6.5 b What is the fourth smallest value in -3628, -97, 0.3, 4/3, 6? 4/3 Which is the second smallest value? (a) 2.4819 (b) -1531 (c) 0 c What is the second smallest value in -49/6, 26645, 1.2? 1.2 Which is the seventh biggest value? (a) -1/92 (b) 0.4 (c) 0.2 (d) 51 (e) -2/5 (f) -1 (g) -4 g What is the third smallest value in 1/2, -3/4, 0.0881, -656, 0, 0.4? 0 Which is the sixth biggest value? (a) -5/6 (b) 57 (c) -1/3 (d) 2 (e) 3 (f) 1/3 a What is the second biggest value in -0.081, -4, 142014? -0.081 Which is the seventh biggest value? (a) 1/3 (b) 0.1 (c) 14/31 (d) -48 (e) 2/13 (f) 0.3 (g) 2 d Which is the fourth smallest value? (a) 2/5 (b) -0.08 (c) 22519/442 (d) -0.2 c Which is the fourth smallest value? (a) 115 (b) -2 (c) 1 (d) 506646 d What is the third smallest value in -13/4, 2/3, 20/9, 5, -0.068, -0.03? -0.03 Which is the third smallest value? (a) -1/2 (b) -686 (c) 253 c Which is the seventh smallest value? (a) 1319 (b) -26 (c) -3/2 (d) -0.5 (e) -0.4 (f) 57 (g) -0.1 a What is the third biggest value in 5, -171366, -0.5, 2, 81, 3, 4/5? 3 Which is the fifth smallest value? (a) 82 (b) -5 (c) 0.4 (d) 99 (e) 0.3 (f) -10 a Which is the fourth smallest value? (a) -49 (b) -1159 (c) 115 (d) 1/9 (e) 0 d What is the third biggest value in -3, 3/14, -2061? -2061 Which is the smallest value? (a) 10 (b) 0.1 (c) -5/6 (d) 0.5 (e) 4875 (f) -2 (g) -0.03 f What is the seventh biggest value in -2, -4/9, -3, 32, 1/8, 100, 0.2? -3 Which is the second biggest value? (a) -0.5 (b) -11.6 (c) -1/3 (d) 0.3 (e) 117.7 (f) -3 d Which is the biggest value? (a) -3 (b) -1/32 (c) -0.3 (d) -0.1 (e) -4/25 (f) -5 b Which is the third biggest value? (a) 1247 (b) -28 (c) -2031 c What is the biggest value in -3, -0.2, 20.3, 4, 10900/3? 10900/3 What is the fifth biggest value in -15, 0.3, -2/7, -0.5, 9/16, 0.2, 0? -2/7 What is the third biggest value in -2/5, 1, 4, -4, 0, 0.2, 99415? 1 What is the second smallest value in -12.619, -1, 193.11? -1 Which is the smallest value? (a) -463989 (b) 0.5 (c) 3/232 a Which is the fourth biggest value? (a) -5/2 (b) 0.1 (c) -4/3 (d) -1.585 (e) -0.073 d Which is the fourth smallest value? (a) -4/7 (b) 0.4 (c) 5 (d) 1/845 (e) -1/3 (f) -27 d Which is the smallest value? (a) 4 (b) -7.444 (c) -0.3 (d) -0.4 (e) -1/11 (f) 0.3 (g) 1/5 b Which is the second smallest value? (a) -18 (b) -2/7 (c) -0.387 (d) 3/13 c What is the third biggest value in -1431, 466, -4/13? -1431 Which is the fourth biggest value? (a) 3 (b) 28 (c) -1/13 (d) -3/11 (e) -23 d What is the sixth smallest value in 2/3, 0, -1/3, 3/7, 3732, -1? 3732 What is the biggest value in -45, -12, -2/13, 5, 22, -1, -2? 22 Which is the third smallest value? (a) 2 (b) 1/14 (c) -5 (d) -2/223911 (e) 0 e Which is the second smallest value? (a) 31/12 (b) -17 (c) -2/927 c What is the third biggest value in -914, 4/3, -1/32, 2, 111? 4/3 Which is the fourth biggest value? (a) -0.0494 (b) -0.02 (c) 0.79 (d) -0.6 (e) -3 (f) 10 a Which is the third biggest value? (a) 1 (b) 154290 (c) 129 (d) -4 a What is the fourth smallest value in -0.3, -2/17, -5, 3/7, -5/12971, -0.01, 0? -0.01 Which is the third biggest value? (a) 9 (b) 7631 (c) -0.8 (d) -4 (e) 4/3 (f) 1 e What is the second biggest value in -4, -8, -1238553? -8 Which is the smallest value? (a) 1 (b) -2433 (c) 0.4 (d) -12/7 (e) -1 b What is the second smallest value in 1, 0.228, -9864? 0.228 Which is the third biggest value? (a) -2/25 (b) -4 (c) -2/5 (d) 2/3 (e) 27 (f) -2/81 (g) -0.9 f What is the third smallest value in -736, -8/5, 2.12, -3, 0.5, -2/9? -8/5 Which is the fourth smallest value? (a) -1 (b) -2389 (c) 4 (d) 0 (e) -3 (f) -37 a Which is the biggest value? (a) 2 (b) -268 (c) 1165 (d) 2/261 c What is the second smallest value in 2/121, 5, 0.3711, 1, -2/13? 2/121 Which is the fifth smallest value? (a) 2 (b) 2/	{ "pile_set_name": "DM Mathematics" }
4s - 10 = ls for s. -2 Let b = 6 + 12. Let k be (-24)/108 - (-4)/b. Solve k = -0x + 4x for x. 0 Let v be 10/45 - (-160)/9. Let s = -12 + v. Solve -4 = -k - s for k. -2 Suppose -p + 3k - 3 = 0, -4p - 5k + 7 = 2. Suppose p = 2o + 4o - 66. Solve 0 = -5i + o - 1 for i. 2 Let o(d) = -d*2 - 21d - 48. Let n be o(-18). Solve -l = 9 - n for l. -3 Let u(n) = -10n2 - n. Let o(d) = 11d*2 + d. Let c(k) = 3o(k) + 4u(k). Let w be c(-1). Let b be (1 + w/4)-8. Solve -bl - 5 = l for l. -1 Let d = -2 + 5. Solve -dh + 8h - 10 = 0 for h. 2 Suppose -k - 1 = -3. Suppose kf = 4f - 12. Let q be (16/12)/(4/f). Solve 0a + q = -2a for a. -1 Let y(i) = 3i - 1. Let q be y(3). Suppose a = -a + q. Suppose -1 = an - 5. Solve n = 3r + 10 for r. -3 Let v(l) = l*3 - 2l*2 - 14l. Let a be v(5). Solve -7 = -w - a for w. 2 Suppose -3r + 5 = -4. Let v = -5 - -13. Suppose -j = 6p - rp - v, p + j - 4 = 0. Solve -pc - 3 = -5c for c. 1 Suppose -6a + 12 = -3a. Solve ab + 10 = -b for b. -2 Suppose -5c = -4f + 3, -3f + 3c = -2c - 6. Let h(r) = r3 + 3r2 - r + 1. Let p be h(f). Suppose -p = -u - 3. Solve 0 = y - 4 + u for y. 3 Let g be ((-4)/(-6))/((-4)/(-48)). Solve 0 = a + a - g for a. 4 Let c(n) = -n2 + 7n + 10. Let w be c(7). Solve i + i = w for i. 5 Let b(o) = 2o - 8. Let g be b(13). Let k be (-4 + 3)/((-2)/g). Let w = 18 - k. Solve 0 = -5h - w - 1 for h. -2 Suppose 2 = 2j + 14. Let i be 1/(0 - 1/21). Let c = j - i. Solve h + 4h = -c for h. -3 Let j be (-4)/(-4)1(7 - 2). Solve 4a = ja - 3 for a. 3 Let i be (-2 - -3)/(5/10). Solve -ib = -b for b. 0 Let r = 2 - 1. Let u(g) = 4g3 - 2g2 + 1. Let h be u(r). Let i(k) = k3 + 2k2 - 4k. Let p be i(-3). Solve 2m - h = p for m. 3 Suppose -5m + 30 = t - 0t, 15 = m + 2t. Let h(b) = -b + 5. Let v be h(m). Solve 1 = -k - v for k. -1 Let w(k) = k*3 + 7k*2 + 4k - 8. Suppose 2z = -18 + 6. Let c be w(z). Suppose 0o = 2b + 3o - 3, 0 = -4o - c. Solve bp = 7p + 4 for p. -1 Let r(j) = j3 - 7j*2 - 9j + 13. Let m be r(8). Solve my = 4y + 5 for y. 5 Let d be 45/4 + 7/(-28). Let v = -9 + d. Let g(h) = h*3 - 5h*2 - 5h + 2. Let p be g(6). Solve -vi = 2i + p for i. -2 Suppose -3r - 2 = -17. Solve -2j + rj = -15 for j. -5 Suppose -3q = -0q - 15. Suppose 2x - 64 = -0x. Suppose -6d + 2d = -2v - 24, -x = -4d + 4v. Solve -qb - 3 = -db for b. -3 Let v(p) = p*3 - 8p*2 - 10p + 5. Let k be v(9). Let q be (0/1)/(2 + k). Solve 4 = -qd + 2d for d. 2 Let j = 38 - 38. Solve j = 5n + 10 + 10 for n. -4 Suppose -2a = -1 - 3. Let v be a/((-14)/(-10) - 1). Suppose 4n - 5 = vq, -3q - n + 22 = 8. Solve qp - 6p = 6 for p. -2 Suppose 5r - 6 = 4r. Solve -rp + 20 = -p for p. 4 Let b(w) = -w*2 - 8w - 4. Let y(p) = p*2 - 8p - 7. Let j = -3 + 11. Let l be y(j). Let f be b(l). Solve -fa + 4 = -5a for a. -2 Let p = -8 - -16. Suppose 0 = -n + 5n - p. Suppose 3g - 47 + 13 = -nm, m = -2g + 22. Solve -j + g = 4j for j. 2 Let r(h) = -15h. Let b be r(1). Let p be 38/10 - 3/b. Let s = -2 + p. Solve u + su = -15 for u. -5 Let g = -3 + 4. Let r be 1/(0 - g - -2). Solve 4 = c + r for c. 3 Let p = 18 + -16. Solve -4 - 2 = -pi for i. 3 Let k be 12/6 - (1 - -1). Solve 0 = 2g - kg + 8 for g. -4 Let m be 3 - (-3 - (-1 - 3)). Suppose -4y + mi + 4 = 0, y = -4y - 2i - 4. Solve 5t = -yt for t. 0 Let i be (0 + 5/(-10))(1 + -1). Solve -l = -il for l. 0 Suppose 0 = -3x + 26 - 8. Let n = 2 + -3. Let v = n + 4. Solve vt = t - x for t. -3 Suppose -3h + 2w = 2h - 4, 4w + 8 = -4h. Solve -2g + g + 1 = h for g. 1 Let k be (40 + -42)(-3)/2. Solve -8n - 10 = -kn for n. -2 Let c = 4 - 0. Solve 20 = z + cz for z. 4 Let j(a) = a - 2. Let o(x) = -x*3 - 4x*2 + 5x + 6. Let n be o(-5). Let r be j(n). Solve i = ri for i. 0 Let c be ((-45)/(-4))/(15/40). Suppose 0 = 5t + 5o - 15, 6o - o + c = 4t. Solve 2r + 1 + t = 0 for r. -3 Let d be (0 - (1 + -1)) + 2. Let a be -1 + d + 1 - 0. Suppose as = s + 2. Solve -4 - s = -3l for l. 2 Suppose -4n + h = -15, -2n + 13h = 11h - 12. Let f = -4 - -1. Let s = 6 + f. Solve 0 + s = -nx for x. -1 Let k(a) = a2 + 4a. Let m be k(4). Let o be (2 - (-10)/(-4))-10. Solve 7 = ov + m for v. -5 Let v be (5 - (-2 + 16/4))/1. Solve -2q = q - v for q. 1 Let f = -2 + 6. Let m = 17 + -5. Solve -fv + 28 = m for v. 4 Suppose 5w + 2r = 4 + 8, -2w + 9 = 5r. Solve -wf = -f for f. 0 Suppose -40 = -10i + 10. Solve 0 = -ij + j + 12 for j. 3 Let d = 7 + -5. Suppose -189 = -18c + 117. Solve -d = 5k - c for k. 3 Suppose 12 + 0 = 4c. Let f be (-2 - 1)/(-3) + c. Solve -fo + 0o = -16 for o. 4 Let x(a) be the second derivative of a*3/3 + 5a*2/2 + a. Let z be x(6). Solve 3l = -8 + z for l. 3 Suppose 0 = -7n + 4n - 6. Let z be (-3 - n)/((-3)/6). Solve j + z = 1 for j. -1 Suppose 0 = 3k + h, -2h = -5k + 4k - 7. Let b = k + 1. Let a(i) = i*2 - 11i - 8. Let x be a(12). Solve b = -d - xd for d. 0 Let h(z) be the second derivative of z4/12 - z2/2 - 2z. Let r(k) = -k*2 - k + 1. Let d(c) = 4h(c) + 5r(c). Let o be d(-5). Solve 4 - o = -a for a. -3 Let t = -91 + 91. Solve tv + 3v + 12 = 0 for v. -4 Suppose b + 9 = 2v, -2b = 3v - b - 11. Solve 0 = -vl - 12 for l. -3 Suppose m = -3w + 3m + 8, 3m = 4w - 11. Suppose -2u + w = -2. Solve -uo + 5o - 15 = 0 for o. 5 Let i(v) = v*3 - 2v*2 - 3v. Let n be i(4). Solve -2m = 2m + n for m. -5 Suppose -3m + 4 = -2m. Let p = 4 - m. Let i(t) = t*2 + 2t - 2. Let r be i(-3). Solve -3l + r + 8 = p for l. 3 Let r = 55 - 39. Suppose 4 = 2i - 4w, w + 4w - 8 = -4i. Suppose 10 = 2y + i. Solve 0 = yo - r - 4 for o. 5 Suppose 0 = -29j + 24j. Let m be (-2 - -6) + -2 + -1. Solve j + m = x for x. 1 Let m be 1/4 - (-6)/8. Solve -3c + 5 = -m for c. 2 Let i(p) = -2p - 4. Let z be 3/(-9) + (-16)/6. Let a be i(z). Solve -aw + 0 - 2 = 0 for w. -1 Let o(c) = c*3 - 10c*2 + 8c + 11. Suppose -4 = -3h - 19, 0 = -5y - 4h + 25. Let f be o(y). Solve -fb + 4b + 8 = 0 for b. -4 Let m be -6 + 44/7 - (-138)/7. Solve 8k - m = 3k for k. 4 Let v(t) = 0t2 - t2 - 2 + 2t2. Let g be v(-2). Suppose -3a + 27 = -3c, -2c = -3a + 7a - 12. Solve 3h - a = -gh for h. 1 Let v be (0/(-2))/(1 - -1). Suppose -5s + 2z = -2z - 25, -4z = 5s + 15. Let d be v/(-2 - (2 - s)). Solve d = -l + 3 - 0 for l. 3 Let r(m) = m3 + 6m*2 + 5m. Let t be r(-2). Let v = 0 + -4. Let h be 2/(-8) + (-1)/v. Solve -2c - 2 - t = h for c. -4 Suppose 0l = 5l - o - 1, -4o = -16. Solve -w + l = -1 for w. 2 Let z = 23 - 8. Solve z = -5m - 5 for m. -4 Let y(w) = w2 + 10w - 11. Let j be y(-11). Solve j = -3n + 2 + 10 for n. 4 Let y be 168/(-16)12. Let l = -18 - y. Solve 0 = 4c + l + 9 for c. -3 Let p = 1 + 1. Solve 0 = pc - 6 for c. 3 Suppose 2g = -g + 15. Let l be 3 - (1 + -7)/3. Suppose 4b - 3o - 21 + 4 = 0, l = 2b - go. Solve -2j = 1 + b for j. -3 Suppose 3g - i - 24 = 2i, 0 = -3g - 2i + 44. Let u = g - 7. Solve -ur + 3r - 4 = 0 for r. -2 Let y(d) = d - 1. Let j be y(3). Suppose 2p + m + m + 6 = 0, 4m + 12 = jp. Suppose p = 5g + 25, -3g - g = x + 20. Solve xc - 1 = -c for c. 1 Suppose 4v + 35 = 3l + 9, -5v = l + 23. Solve -3r - 11 = -l for r. -3 Suppose 4 = 3q - 2. Let j be (20/35)/(2/7). Solve -qr - j = -r for r. -2 Suppose -3v - 11 = -4w - 4v, 0 = 4w + 5v + 9. Solve -wi = 9 + 11 for i. -5 Let l be 43/6 + 1. Suppose 3g - b - 7 = 0, 4b + 12 = lg + 2. Solve 1 = p - g for p. 3 Let u = 4 + -4. Solve -1 = -k - uk for k. 1 Let v(z) = -3z2 - 35z + 32. Let u(p) = -p*2 - 12p + 11. Let c(j) = 17u(j) - 6v(j). Let q be c(-7). Solve 4x + 18 = q for x. -4 Suppose 5f = -5v + 30, v - 7f + 6 = -5f. Solve -3g - 1 = -vg for g. -1 Suppose 4d - 4 = 3d + 2n, 6 = 4d + 2n. Suppose dz - 5m - 17 = 18, 10 = -2m. Suppose -zh + 3 = -12. Solve hu + 3 = -0 for u. -1 Suppose -2c - 36 = -6c. Let g(l) = -l2 + 23l - 38. Let v be g(21). Solve -vq = -q + c for q. -3 Let v(g) be the third derivative of 1/20g*5 + 0 - 1/6g*3 + 1/120g*6 + 0g - 1/12g4 - 3g*2. Let y be v(2). Solve -3o + 8o = -y for o. -3 Suppose 0 = -2z - 3z + 5. Let d be (1/((-3)/(-12)))/z. Suppose 5b = 1 + d. Solve -b = 2u + 1 for u. -1 Let r be (-9 + -3)(-2)/6. So	{ "pile_set_name": "DM Mathematics" }
2. 223600sqrt(7) + 11837396 Simplify ((sqrt(1088)1-2)2 + -4)-2 + 2 + 1(1 + (sqrt(68))2) + 1. -8624 Simplify (-1(-6(sqrt(1900)1 + 0 + (sqrt(3078)-1)/sqrt(2)) + 0))2 + -3. 681 Simplify -2 + 1 + (sqrt(3) + 6(sqrt(12)/sqrt(4))*2 - (sqrt(192) + -2 + sqrt(192))) + 4 + -3. -15sqrt(3) + 20 Simplify (6(-2 + sqrt(1700)) + 5 + sqrt(1700) + -1)2 + 5 + ((1 + sqrt(17))3 - sqrt(153)/(sqrt(18)/sqrt(2))). -1118sqrt(17) + 83372 Simplify (1 + (5 + 5 + sqrt(432) + 0 + -1)2)3. 648sqrt(3) + 1542 Simplify ((-5sqrt(171) + 4)6)2 + ((sqrt(19) - sqrt(76)/sqrt(4)2) + sqrt(19) - (sqrt(19)5 + -2)) + 4. -4325sqrt(19) + 154482 Simplify ((6sqrt(153)4 - sqrt(153)) + -61sqrt(153))/((sqrt(1089)4-4 + sqrt(1089))-4). 17sqrt(17)/660 Simplify -2 + (sqrt(190)/sqrt(10) - sqrt(19) - sqrt(19))*2 + 4sqrt(475) - (((sqrt(228)/sqrt(4))/sqrt(3) - sqrt(38)/sqrt(32))4)2. -154 + 20sqrt(19) Simplify -3((-3 + sqrt(2448))2 + -3 + 0 - (1 + (-5 + sqrt(17) + 1sqrt(17)-1)2)). -7284 + 216sqrt(17) Simplify (4 + ((sqrt(88) - (sqrt(88) + sqrt(88)-1))4 + (sqrt(88) - ((sqrt(88) + -1sqrt(88))-4 + sqrt(88))))/(-1sqrt(32) + sqrt(48)/(sqrt(18)/sqrt(3))))2. -32sqrt(11) + 192 Simplify (1 + 61sqrt(441)/(-4sqrt(7)1)6 + 5)2. -324sqrt(7) + 5139 Simplify ((2 + sqrt(162) + 1 + sqrt(162) - (-4 + -3 + sqrt(162))) + 26(0 + sqrt(162)) + 4)*2. 3276sqrt(2) + 27574 Simplify -2(-23sqrt(2)-4 - (-1 + sqrt(14)/sqrt(63)))*2. -20182/9 - 284sqrt(2)/3 Simplify ((-5 + sqrt(1872) + sqrt(1872)-4)2 - (1(sqrt(65) - sqrt(65)-2 - sqrt(65) - sqrt(65)))/(-1sqrt(80) + sqrt(80) + sqrt(80)))6. 4317sqrt(13)/2 + 101238 Simplify ((sqrt(1701)2)/(sqrt(847)-1) + sqrt(36)/sqrt(588) + 5 + sqrt(75) + 4)*2. 4860sqrt(3)/77 + 698949/5929 Simplify (sqrt(130)/sqrt(810))2 - ((sqrt(13) + 3 + sqrt(13))2-5 - sqrt(13)) - (-3 + 2(3 + sqrt(117) - sqrt(117)))*2. 61sqrt(13) + 23989/81 Simplify ((sqrt(2448) - (-2 + sqrt(2448)) - sqrt(2448))-5-51 - (sqrt(2448)-16 + 3sqrt(2448) + -4))*2 + 1. -28512sqrt(17) + 1187749 Simplify -1 + (sqrt(18) + (sqrt(1152) - -1sqrt(1152)) + 2sqrt(450))/(sqrt(144) + (sqrt(144) - 2sqrt(144)) - sqrt(1089)-1). -1 + 27sqrt(2)/11 Simplify 2 + 6(3 + (sqrt(18)/(3sqrt(6)))2 - (3 + (sqrt(540) + sqrt(15))/sqrt(5) + sqrt(3))). -48sqrt(3) + 4 Simplify 4 + (-1 + (sqrt(75)-6 + 4 - (-5 + (sqrt(75) - (sqrt(75) + -1 + sqrt(75)))))4 + 2)*2. -6600sqrt(3) + 31093 Simplify (((32sqrt(136) - sqrt(136)) + sqrt(136) - -3(-2sqrt(136) - sqrt(136)))6)/(-1(-2sqrt(288) - sqrt(288))1). -sqrt(17) Simplify (3(4 + ((sqrt(196)-2 - sqrt(196))/sqrt(7)-4)/(-2sqrt(324)6) + 1))2. -10sqrt(7) + 2032/9 Simplify 2(0 + 2 + (-2 + sqrt(5808)-1 + 0)*2)56. 10560sqrt(3) + 348840 Simplify (sqrt(18) + sqrt(72)-3)/(-1sqrt(225)) + (sqrt(20)/sqrt(40) - (sqrt(2) + 0)6)2 + 0. sqrt(2) + 121/2 Simplify (0 + (0 + 5(2 + 2(sqrt(112) + 0) + (-1sqrt(112)1 - sqrt(112))))3)*2. 900 Simplify 3(-3 + (-3(-3 + -3 + sqrt(800) + (sqrt(800) - 4(sqrt(800) + -6sqrt(800) + sqrt(800)))))2). -116640sqrt(2) + 6999363 Simplify (((2sqrt(252) - sqrt(252)) + sqrt(28))/sqrt(2) - sqrt(112)/(sqrt(8)16))/((sqrt(1029)2)/(sqrt(3) + -1sqrt(243))). -46sqrt(2)/21 Simplify (5(4 + (sqrt(153) - (-1 + sqrt(153) + 2))-4)-2)2. 6400 Simplify (((1 + sqrt(117))5 + 1 + sqrt(117) + 3)4)2 + ((-5 + sqrt(117)-2)*2 + ((sqrt(117) + 0)-4)*2)5 + 2. 5484sqrt(13) + 80515 Simplify ((-6(sqrt(68) + sqrt(68) + 2sqrt(68)-3 + sqrt(68) - (sqrt(68)1 + sqrt(68))5))/(sqrt(48)/sqrt(192) + sqrt(40)/sqrt(250)))*24. 18387200/9 Simplify -2 + (-2(sqrt(76)/sqrt(4) + 4 + 5sqrt(19)-2))2 + -2((sqrt(171) + sqrt(171) + sqrt(171) + -3 - sqrt(171)) + sqrt(171))*2-2. -504sqrt(19) + 12410 Simplify (6(-3(-6sqrt(360) - sqrt(360)))/(6-5sqrt(720)))*2. 441/50 Simplify -3(26(sqrt(325) + -1)31)*21. -1267488 + 38880sqrt(13) Simplify 5 + -6(sqrt(1300) - sqrt(1300)-3)2 + (-1sqrt(143)2)/(sqrt(11) + sqrt(11) + sqrt(88)/sqrt(72)). -124795 - 6sqrt(13)/7 Simplify (sqrt(108)/(sqrt(12)2)-6)/((3sqrt(18))/sqrt(6)-6). sqrt(3)/6 Simplify (sqrt(450) - (sqrt(450) - -2sqrt(450)))/(6(sqrt(6) + sqrt(18)/sqrt(3) + sqrt(6))) - ((sqrt(216)/sqrt(6))/sqrt(12) + sqrt(21)/(sqrt(7) - -5sqrt(7))). -31sqrt(3)/18 Simplify ((-3(sqrt(576)-3 + sqrt(576)) + sqrt(576))/((sqrt(768) - -2sqrt(768))-4))*2. 49/192 Simplify -1((sqrt(171) + 1 + 3 - (sqrt(171) + -1 - sqrt(171))2)2 + 1sqrt(171)-1 + 2 + (1sqrt(171) - sqrt(171)) + -1 + 2). -210 - 33sqrt(19) Simplify -2 + -4 + (sqrt(80)/(sqrt(196)2))/(-3(-1sqrt(90) - sqrt(10))) + 1. -5 + sqrt(2)/168 Simplify (2sqrt(65)-1 + 2sqrt(65)-2 + sqrt(65))/((sqrt(165)/sqrt(3)3)/(sqrt(44)/sqrt(16))). -5sqrt(13)/6 Simplify 1 + (sqrt(108)/sqrt(64) + (-1 + sqrt(3888))*2 - (-4(-1sqrt(363) - sqrt(363) - 3(1sqrt(3) - sqrt(3))))2). -19342 - 285sqrt(3)/4 Simplify (-6(-2 + -1(-1 + sqrt(68))65))*2-3. -6694272 + 362880sqrt(17) Simplify -3((3(sqrt(24) + (sqrt(24) - sqrt(384))))/(-5sqrt(32)/sqrt(4)) - (52sqrt(3) + -5 + 3))-6. -792sqrt(3)/5 + 36 Simplify -3 + 1 + -2sqrt(832) + (sqrt(91) + (sqrt(91) - (sqrt(91) + 1sqrt(91)))-5 + sqrt(91))/((sqrt(14)/sqrt(2)-3 - sqrt(7)) + sqrt(7)). -55sqrt(13)/3 - 2 Simplify (5(sqrt(363) - (1sqrt(363) - sqrt(363))))2 + 3(sqrt(363) + sqrt(363)-1 + sqrt(363) + sqrt(363))2 - (5 + 1 + 1sqrt(363) + -5). -11sqrt(3) + 13430 Simplify (sqrt(125) + ((0 + sqrt(125))5)*2 + 1 + 1sqrt(125))2 - (-2 + 5(sqrt(20) + sqrt(20) + 6sqrt(20)-2)). 120sqrt(5) + 6254 Simplify (sqrt(256)-2)/sqrt(2)-5 + (sqrt(2) + 0)2 + -1 + -5. -6 + 82sqrt(2) Simplify ((-6(sqrt(208) - (-1 + sqrt(208))))*2 - (2 + 2sqrt(208) - sqrt(208)) - (-2sqrt(208)2)*2-4)6. -24sqrt(13) + 80076 Simplify (sqrt(19) + 3sqrt(19)4 - (0 + sqrt(38)/sqrt(2)))*2 - (5 + 6-4sqrt(19)-4). -96sqrt(19) + 2731 Simplify (((-2 + sqrt(17))-6 + 3sqrt(833) + -5 + (-2 + -1 + sqrt(1088) - sqrt(1088)))6)*2. 4320sqrt(17) + 138276 Simplify ((sqrt(85)-1 + sqrt(85))2 + -6(sqrt(85) + sqrt(85)-3))/(-41(sqrt(720) + sqrt(720)1 + sqrt(720) + sqrt(720))). -sqrt(17)/16 Simplify (-5(sqrt(132) + sqrt(132)-1)-4)/(6(sqrt(75) + -2sqrt(75) + sqrt(75)) - sqrt(75)24). 0 Simplify -4(sqrt(50) - (sqrt(50) - (sqrt(50) + -2sqrt(50)1)))/((-1sqrt(90))/sqrt(9)) + ((sqrt(315)-6)/(sqrt(7) + sqrt(63)-3))*2. -4sqrt(5) + 405/16 Simplify (-6(sqrt(76) - (sqrt(76)31 + sqrt(76) + sqrt(76))))/((sqrt(64)-2 - sqrt(64)) + sqrt(64) + 2sqrt(4)-6). -6sqrt(19)/5 Simplify 4(3 + (((sqrt(832) - 3(2 + sqrt(832)) - (3 + 1sqrt(832) - sqrt(832))) + 4)-3)2). 5760sqrt(13) + 120720 Simplify (3 + (4 + 3 + (1 + sqrt(252) - sqrt(252)) - (sqrt(252) - (1(sqrt(252) + 1) - sqrt(252)) - (sqrt(252) + -1)3)*2))-2. -96sqrt(7) + 2002 Simplify ((5 + sqrt(637) + -2sqrt(637) + (sqrt(156) + sqrt(156)2)/sqrt(12) + 4 + sqrt(1573)-1 + sqrt(13) + 0 + -4)4)2. -2240sqrt(13) + 41168 Simplify (-3 + -2 + (((sqrt(80) + 0 + 3 - sqrt(80)) + 0 + sqrt(80) + -2)2 - (5 + -3 + -5 + (sqrt(80) - sqrt(80)-2) + sqrt(80))))*2. 320 Simplify 0 + 6(4(-4 + sqrt(288)-2)2)2. 73728sqrt(2) + 448512 Simplify 3 + (6(sqrt(11) - sqrt(22)/sqrt(2))1 + 5 + (-3(sqrt(110) + sqrt(110)2))/(sqrt(1440)1))2. -15sqrt(11)/2 + 547/16 Simplify (5-5(sqrt(500) - (sqrt(500) - (sqrt(500)2 + sqrt(500))) - sqrt(500)))/((-1sqrt(980))/sqrt(5)-4). -125sqrt(5)/14 Simplify ((4sqrt(57)/sqrt(3) - sqrt(19)) + (sqrt(19) + 1)-6 + 6sqrt(304) + -3 + 0 + sqrt(475) + -2sqrt(475)2 + -3)2. -144sqrt(19) + 828 Simplify -4(sqrt(3) + (sqrt(300) - (1 + sqrt(300) - sqrt(300))) + 1) - (-2sqrt(30)/(4sqrt(40)/sqrt(4)))2. -44sqrt(3) - 3/4 Simplify -6(0 + sqrt(112) + -4)-5 - ((sqrt(252) + 0 + sqrt(252) + 3)*2 - sqrt(252) - (-2sqrt(56)/(-2sqrt(8)))2). -1130 + 54sqrt(7) Simplify (2(3sqrt(1800)2 - sqrt(1800) - sqrt(1800)))/(-3(-1sqrt(225) - ((sqrt(72)-1)/sqrt(8) + sqrt(9)))). 16sqrt(2)/3 Simplify (-6((-1 + sqrt(891))2 + 0 + -1 + sqrt(891) + sqrt(891) - (-3sqrt(891)-5 + -1)))2. 14256sqrt(11) + 3881340 Simplify (4 + (6(1 + sqrt(343)) - -6(sqrt(343) + sqrt(343) + 1 + sqrt(343))) + -5 + -5 + 5(sqrt(343)-1 + sqrt(343)))*2. 2016sqrt(7) + 197604 Simplify 3 + (-1 + (sqrt(192) + sqr	{ "pile_set_name": "DM Mathematics" }
2, 17, 3209 List the prime factors of 318484. 2, 79621 List the prime factors of 8732426. 2, 41, 109, 977 List the prime factors of 814424. 2, 13, 41, 191 What are the prime factors of 4766223? 3, 7, 11, 47, 439 List the prime factors of 384466. 2, 192233 What are the prime factors of 1048937? 73, 14369 What are the prime factors of 6601582? 2, 13, 253907 What are the prime factors of 979373? 979373 List the prime factors of 153683. 313, 491 What are the prime factors of 2073437? 59, 113, 311 List the prime factors of 615916. 2, 7, 21997 List the prime factors of 65645. 5, 19, 691 List the prime factors of 678200. 2, 5, 3391 What are the prime factors of 113461? 83, 1367 List the prime factors of 329524. 2, 13, 6337 List the prime factors of 20089891. 31, 648061 What are the prime factors of 824105? 5, 164821 List the prime factors of 3286897. 953, 3449 What are the prime factors of 142766? 2, 13, 17, 19 What are the prime factors of 3857247? 3, 19, 73, 103 What are the prime factors of 8230699? 109, 75511 What are the prime factors of 1794633? 3, 53, 11287 What are the prime factors of 187356? 2, 3, 13, 1201 What are the prime factors of 8601909? 3, 2867303 What are the prime factors of 14508245? 5, 2901649 List the prime factors of 1054922. 2, 11, 47951 List the prime factors of 261513. 3, 7, 593 List the prime factors of 5051365. 5, 11, 29, 3167 List the prime factors of 8431197. 3, 2810399 What are the prime factors of 215240? 2, 5, 5381 What are the prime factors of 331834? 2, 83, 1999 List the prime factors of 1177585. 5, 47, 5011 List the prime factors of 226490. 2, 5, 11, 29, 71 What are the prime factors of 3757976? 2, 469747 What are the prime factors of 10500192? 2, 3, 4051 List the prime factors of 514919. 19, 41, 661 What are the prime factors of 12278035? 5, 7, 11, 31891 List the prime factors of 63306. 2, 3, 3517 What are the prime factors of 9360941? 9360941 List the prime factors of 6241610. 2, 5, 59, 71, 149 What are the prime factors of 15711254? 2, 13, 23, 43, 47 List the prime factors of 400711. 400711 List the prime factors of 30829. 30829 What are the prime factors of 52303? 193, 271 What are the prime factors of 7873071? 3, 2624357 List the prime factors of 18510. 2, 3, 5, 617 List the prime factors of 11218705. 5, 2243741 List the prime factors of 105212. 2, 29, 907 What are the prime factors of 12775090? 2, 5, 79, 103, 157 List the prime factors of 226644. 2, 3, 11, 17, 101 List the prime factors of 349944. 2, 3, 7, 2083 List the prime factors of 42399568. 2, 31, 73, 1171 List the prime factors of 1585623. 3, 13, 109, 373 List the prime factors of 14882. 2, 7, 1063 What are the prime factors of 20260883? 359, 56437 List the prime factors of 257253. 3, 85751 List the prime factors of 1517299. 7, 216757 List the prime factors of 123738. 2, 3, 41, 503 List the prime factors of 15268204. 2, 7, 77899 List the prime factors of 70189. 7, 37, 271 List the prime factors of 269846. 2, 134923 List the prime factors of 553554. 2, 3, 17, 67 What are the prime factors of 1562644? 2, 241, 1621 What are the prime factors of 826515? 3, 5, 18367 List the prime factors of 8757985. 5, 53, 33049 What are the prime factors of 158198? 2, 83, 953 What are the prime factors of 5933791? 5933791 List the prime factors of 12133960. 2, 5, 439, 691 What are the prime factors of 3862245? 3, 5, 37, 6959 What are the prime factors of 1008094? 2, 504047 List the prime factors of 2594586. 2, 3, 131, 3301 What are the prime factors of 1337154? 2, 3, 7, 13, 31, 79 List the prime factors of 1578402. 2, 3, 7, 12527 List the prime factors of 2152866. 2, 3, 358811 List the prime factors of 628246. 2, 31, 10133 What are the prime factors of 257787? 3, 28643 List the prime factors of 11845233. 3, 577, 2281 List the prime factors of 8722097. 8722097 What are the prime factors of 914574? 2, 3, 152429 What are the prime factors of 1054465? 5, 31, 6803 What are the prime factors of 220607? 167, 1321 What are the prime factors of 68238? 2, 3, 17, 223 What are the prime factors of 204397? 204397 List the prime factors of 7033662. 2, 3, 130253 List the prime factors of 167640. 2, 3, 5, 11, 127 List the prime factors of 2098169. 2098169 What are the prime factors of 127729? 7, 71, 257 List the prime factors of 165899. 23, 7213 What are the prime factors of 4741971? 3, 13, 47, 199 What are the prime factors of 2923267? 727, 4021 List the prime factors of 57299. 11, 5209 List the prime factors of 383917. 383917 List the prime factors of 5377415. 5, 31, 34693 List the prime factors of 5391526. 2, 7, 385109 List the prime factors of 112939. 112939 List the prime factors of 6076336. 2, 7, 227, 239 List the prime factors of 4766743. 107, 44549 What are the prime factors of 19089356? 2, 11, 13, 23, 1451 What are the prime factors of 2100203? 7, 19, 15791 What are the prime factors of 10858696? 2, 1357337 What are the prime factors of 7580337? 3, 31, 81509 List the prime factors of 29486563. 29486563 What are the prime factors of 5824597? 73, 1093 List the prime factors of 90871. 11, 751 List the prime factors of 13842401. 67, 206603 List the prime factors of 3052702. 2, 1526351 List the prime factors of 2395960. 2, 5, 7, 43, 199 List the prime factors of 699185. 5, 139837 List the prime factors of 105739. 41, 2579 What are the prime factors of 1017307? 1017307 What are the prime factors of 2292402? 2, 3, 7, 54581 List the prime factors of 8377811. 13, 644447 List the prime factors of 287140. 2, 5, 7, 293 What are the prime factors of 882529? 882529 List the prime factors of 7367584. 2, 7, 31, 1061 List the prime factors of 3351943. 7, 67, 1021 What are the prime factors of 33697? 31, 1087 List the prime factors of 218153. 13, 97, 173 What are the prime factors of 271159? 7, 38737 What are the prime factors of 3054047? 3054047 What are the prime factors of 7859833? 31, 253543 List the prime factors of 2026249. 2026249 What are the prime factors of 157409? 7, 113, 199 What are the prime factors of 145687? 145687 List the prime factors of 607929. 3, 7, 28949 List the prime factors of 3518475. 3, 5, 43, 1091 List the prime factors of 16004448. 2, 3, 61, 911 List the prime factors of 294926. 2, 239, 617 What are the prime factors of 21226945? 5, 89, 47701 What are the prime factors of 3716283? 3, 1238761 What are the prime factors of 456159? 3, 11, 23, 601 What are the prime factors of 784249? 784249 What are the prime factors of 11886082? 2, 13, 31, 14747 List the prime factors of 3819891. 3, 739, 1723 What are the prime factors of 377283? 3, 19, 6619 List the prime factors of 1685493. 3, 187277 What are the prime factors of 33299994? 2, 3, 7, 13, 71, 859 List the prime factors of 6596117. 11, 223, 2689 List the prime factors of 62855. 5, 13, 967 List the prime factors of 227320. 2, 5, 5683 List the prime factors of 96373. 17, 5669 What are the prime factors of 181218? 2, 3, 30203 What are the prime factors of 145915? 5, 7, 11, 379 List the prime factors of 3435664. 2, 214729 List the prime factors of 1757408. 2, 54919 List the prime factors of 1975546. 2, 61, 16193 List the prime factors of 1614372. 2, 3, 29, 4639 What are the prime factors of 533623? 23, 23201 List the prime factors of 872653. 677, 1289 What are the prime factors of 7716599? 11, 701509 What are the prime factors of 12231429? 3, 7, 83207 What are the prime factors of 12290813? 17, 131, 5519 List the prime factors of 479130. 2, 3, 5, 15971 List the prime factors of 4317514. 2, 23, 47, 1997 List the prime factors of 630167. 630167 What are the prime factors of 813233? 181, 4493 What are the prime factors of 61843? 61843 What are the prime factors of 932480? 2, 5, 31, 47 List the prime factors of 3553962. 2, 3, 41, 14447 What are the prime factors of 83321? 7, 11903 What are the prime factors of 16572907? 13, 61, 20899 List the prime factors of 1245815. 5, 193, 1291 What are the prime factors of 287291? 287291 What are the prime factors of 499374? 2, 3, 27743 What are the prime factors of 7385109? 3, 2461703 List the prime factors of 356784. 2, 3, 7433 What are the prime factors of 1273785? 3, 5, 84919 List the prime factors of 422820. 2, 3, 5, 29 List the prime factors of 1360671. 3, 13, 139, 251 What are t	{ "pile_set_name": "DM Mathematics" }
the tens digit of j(-4)? 1 Let n(t) = -1 - 1 + 0 - 3t. What is the units digit of n(-2)? 4 Let v(a) = a3 + 4a*2 - 4a + 3. Let i be v(2). What is the tens digit of (-10 - -9) + i + -1? 1 Let a = 1 + -3. Let y be (-2)/(-5) - a/(-5). Suppose 4s = -ys + 12. What is the units digit of s? 3 What is the tens digit of ((-8)/12)/(6/(-711))? 7 Let b(f) be the third derivative of f5/30 + f4/8 - 2f3/3 - 16f2. Let t = -12 + 8. What is the tens digit of b(t)? 1 Let g(x) = -x2 - 4x + 4. What is the units digit of g(-4)? 4 Suppose -4j = -5k - 243, 2j + 2k + 120 = 4j. What is the units digit of j? 7 Let l(d) = 3d3 + 8d*2 + 3d - 6. Let f(p) = -p*3. Let n(b) = 2f(b) + l(b). What is the units digit of n(-7)? 2 What is the hundreds digit of 8/(-24) + (-3)/((-18)/656)? 1 Suppose 7i = 180 - 26. What is the units digit of i? 2 Let q(d) = 4d*2 + 4. What is the tens digit of q(-3)? 4 Suppose 0 = 4j - 28 + 8. Suppose 9 = jf - d - 91, 4f - 5d = 80. What is the tens digit of f? 2 Let g(m) = 3m*2 - 2. What is the units digit of g(3)? 5 Suppose 0 = -2v + 3f + 17, -10 - 1 = -5v - 3f. Suppose 3h - 8 = -5t, 3h = vt + t - 2. Let x = t + 0. What is the units digit of x? 1 Suppose -i + 18 = -c, 4c = 3c + 5. Let x = i - 38. Let d = 34 + x. What is the units digit of d? 9 Let d = 125 - 70. What is the units digit of d? 5 Let j = -6 + 8. Suppose jp = 2g - 20, 0 = -g + 5p - 0 - 2. Suppose -h + 2i = -9, -h + 4i + g = i. What is the units digit of h? 1 Let g(v) = 11v + 3. What is the units digit of g(4)? 7 Suppose -6t - 7 = -169. What is the tens digit of t? 2 Suppose b + 14 - 1 = 5a, -4a = b - 14. Suppose 0 = i + ai - 40. What is the units digit of i? 0 Suppose 8r - 45 = 3r. Suppose -3i = -v - r, -i - 4 = -4v + 4. Suppose -4f + 21 = vm, m + f - 10 + 2 = 0. What is the tens digit of m? 1 What is the tens digit of 4/(-4)-1 - -54? 5 Suppose -o + 0o = 0. Let x(p) = p + 1. What is the units digit of x(o)? 1 Let t(q) = q2 + 1. Let m(g) = 3g*2 - 3g - 3. Let w(a) = -m(a) + t(a). Let x be w(3). Let d = 8 - x. What is the tens digit of d? 1 Let i = -14 - -10. What is the units digit of (-41)/(-4) - (-1)/i? 0 What is the tens digit of (-33)/(1 + 10/(-4))? 2 Let r = 67 - 48. Let z = 10 - r. Let g = 1 - z. What is the tens digit of g? 1 Let t = 24 - 26. Suppose 0 = q - 3i - 11, -4i = -2q + 7q + 21. Let n = q - t. What is the units digit of n? 1 Let a(x) = -27x + 1. Let w be a(-1). What is the units digit of w/(-3)6/(-4)? 4 Let z(a) = -a3 - a2 - 2a - 3. What is the units digit of z(-3)? 1 Let h be (-5 - -2)/1 + -17. What is the units digit of (3 + h/8)8? 4 Suppose 0 = -b - i - 0i + 25, 3b - 93 = 3i. What is the units digit of b? 8 Let o(z) = -z3 - 7z*2 - 8z - 19. What is the tens digit of o(-8)? 0 Suppose 4x = 3r - 0 - 20, 0 = -r - 3x - 15. Suppose 4h - 2h - 10 = r. What is the units digit of h? 5 Let k = -77 + 153. What is the tens digit of k? 7 Suppose 0a + 630 = 5a. Suppose -p = -4f - 0p + a, 114 = 4f + 5p. What is the tens digit of f? 3 Let o be 139/2 + 1/(-2). Suppose -2f = -k - o, 2f - 59 = -2k + k. Suppose h + 3h = -4u + f, -4u = -5h + 13. What is the units digit of u? 3 Let q(o) be the first derivative of -15o2/2 - 3o - 2. What is the tens digit of q(-2)? 2 Let x be -1((-12)/(-4) + -43). Suppose 5r - 3r - x = 0. What is the units digit of r? 0 Suppose 0 = 2k - 4i - 148, -4k = -3i - 0i - 321. What is the tens digit of k? 8 Let o = -95 + 189. What is the tens digit of o? 9 Let n = 3 - -34. What is the units digit of n? 7 Suppose -5m + 1 = -h, m = 4h + 19 + 23. Let j = h + 18. What is the units digit of j? 7 Let j(y) = y*2 + 2y + 10. What is the tens digit of j(-5)? 2 Let t = -6 - -12. Let k(h) = h*2 - 5h - 2. What is the units digit of k(t)? 4 Let o = 16 + -30. Let q = o + 20. What is the units digit of q? 6 Suppose -5y + 2u = 5u - 1414, -1118 = -4y + 2u. What is the units digit of y? 1 Suppose -4p = -4l + 20, p + 18 = 4l - 11. What is the units digit of l? 8 Let g(h) = -h + 5. Suppose 8 = -2u + 3w + 15, 4w + 20 = 0. Let k be g(u). Suppose 0 = 5c + 5j - 20, -2c + 0 + k = 3j. What is the units digit of c? 3 Suppose -2l - 6 = 0, -3n + 14 = -3l + 5. Suppose -x + 0x + 7 = n. What is the units digit of x? 7 Suppose -3b - 55 = -19. Suppose 3w + 1 = 5d, d = -w + 1 - 12. Let o = w - b. What is the units digit of o? 5 Suppose -3k + 4x = -8k + 28, 3k + 4x = 12. What is the units digit of k? 8 Let j(r) = -1 + 3 - 3 - 14r. What is the tens digit of j(-1)? 1 Let m = -2 - -5. Suppose -mx + 27 + 12 = 0. What is the units digit of x? 3 Let v(f) = -f3 + 6f*2 + 2f. What is the tens digit of v(6)? 1 Suppose 4t - 5u = 605, -3t + 0u + 450 = -3u. What is the hundreds digit of t? 1 Let g(k) = -50k + 4. What is the tens digit of g(-3)? 5 Let n(c) = 5c2 + 8 - 10c*3 + 11c3 + c2 - 6c. What is the units digit of n(-7)? 1 Let u = -410 - -585. What is the tens digit of u? 7 Suppose 0i - 5 = -i, 4w + 777 = -3i. What is the tens digit of (-16)/56 + w/(-7)? 2 Let j(p) be the first derivative of 7/3p3 + 0p*2 + p - 2. What is the units digit of j(1)? 8 What is the units digit of (-18)/(-12) - 2/(-4)? 2 Let n(i) = 4i + i*2 - i - 5 - 5i. What is the units digit of n(4)? 3 Suppose 4c - 3j - 23 = 0, -5c + 0c - 5j = -20. Let u(r) be the second derivative of r4/12 - r3/2 - 7r*2/2 + 2r. What is the units digit of u(c)? 3 Suppose q - 315 = 20. What is the hundreds digit of q? 3 Let v be -3 + 6 + -3 + -3. What is the tens digit of (-24)/(-4) + v + 8? 1 Let j be (-4)/5(-10)/2. Suppose jg + 4 = -3p - 2, 5g = -15. What is the units digit of p? 2 Suppose 0 = -0k + 3k + 15, 2z + 5k + 27 = 0. Let c = 3 - z. Suppose -cx + 14 = -2. What is the units digit of x? 4 Let t(w) = 2 - 4w*2 + 0w*2 + 3w2 + w3 - 5w. What is the units digit of t(4)? 0 Let b(w) = w3 - 8w*2 - 4w - 2. What is the units digit of b(9)? 3 Suppose 3l - 271 = -2l + 4b, -4l + 192 = 3b. Suppose -72 = -3h + 3r + r, -3r + l = 3h. Suppose 15 = 5o - h. What is the units digit of o? 7 Let g be 1 + 2 - 0/2. Let p(y) = y*2 + 2y - 1. Let c be p(g). Let w = c + -7. What is the units digit of w? 7 Let u(i) = -i3 + i2 + i. Let n(v) = -5v3 - v2 + 4v + 5. Let s(y) = -n(y) + 6u(y). What is the units digit of s(7)? 9 Suppose 4r + 152 = 8r. What is the tens digit of r? 3 Let s(n) = -2n - 11. Let q(z) = z + 5. Let k(g) = -13q(g) - 6s(g). Let l be k(-1). Suppose v = lv - 4, -28 = -4u - 3v. What is the units digit of u? 4 Let w(f) = f3 - 8f*2 - 13f + 2. Let r be w(10). Suppose s = -s + r. What is the tens digit of s? 3 Let q(h) = h3 - h2 - h + 2. Let y be q(0). Suppose 50 = 4o - 0o - yd, -3o - 2d = -34. What is the tens digit of o? 1 Let n be 0/(1/(1/(-2))). Suppose k + nk + 1 = 0. What is the units digit of (1/(-1))/(k/2)? 2 Suppose 2c + 5k + 39 = 3, 0 = -3c - 3k - 45. Let f = c - -32. Suppose -2t + f = -5. What is the units digit of t? 2 Let z = -16 + 19. What is the units digit of z + 2 + 0 + 18? 3 Suppose -5p = -3p + 6. Let n be (5 - -1)/((-2)/p). Let r = n + -6. What is the units digit of r? 3 Let q(c) = c3 - 5c*2 + c + 11. What is the hundreds digit of q(7)? 1 Let i = 92 + -55. What is the units digit of i? 7 Let t(w) = -3w*2 - 3w. Let j be t(-2). What is the units digit of 2/j-6 + 17? 9 Let g(l) = l2 + 11l + 12. Let u be g(-8). What is the units digit of 2/6 + (-80)/u? 7 Let x = 4 + -1. Let v = -2 + x. What is the units digit of v? 1 Suppose -5a = -2a - 12. Suppose -2v + 3n = 5 - 1, 2v - an = -4. Let w(c) = 2c2 + 2c - 2. What is the units digit of w(v)? 2 Suppose -76 = -2p + g - 13, 5p = 2g + 155. Suppose 0 = 5o - o + r - p, -2o = 5r - 1. What is the units digit of o? 8 Let z = -15 + 51. What is the units digit of z? 6 Suppose -n + 5n + 3j = 45, 5n - j - 61 = 0. Suppose n = -y + 4y. What is the units digit of y? 4 Suppose -5p + 5 = -15. Let r = p - -9. Let u = r + -7. What is the units digit of u? 6 Let v = 2 + 0. Suppose -vy - 85 = 5x, 3x + 2y + 51 = -2y. Let p = x + 26. What is the units digit of p? 9 Let q(g) = g + 6. Let s be q(-10). Suppose 4y = -3l - 4, -2*l + 2 = -	{ "pile_set_name": "DM Mathematics" }
et r(v) = 2v - 10. Let g(h) = 2h - 9. Calculate pr(u) - 2g(u). 2u - 12 Let j(s) = s2 - 3s. Let a be 8/4 + 3/3. Suppose -h = ah - 12. Let k(b) = -3b. Let x be (-4 - (-6)/2) + -2. Determine hk(l) + xj(l). -3l2 Let z(j) = 3 - 28j + 28j - 3j*2. Let u(l) = 18l*2 - 17. Give -6u(a) - 34z(a). -6a*2 Let a(p) be the second derivative of 5p4/12 + p3 + 3p2 + 16p. Let q = -33 + 39. Let g(u) = u*2 + u + 1. Determine qg(i) - a(i). i*2 Let p(r) = -4r*3 - 4r*2 - 3r. Let u(q) be the second derivative of 2q5/5 + 3q*4/4 + 7q*3/6 + 30q + 2. What is 7p(f) + 3u(f)? -4f3 - f2 Let h(w) = -3w*3 + 3w*2 - 4w - 3. Let l(t) = t*2 - t - 1. Let o = -921 + 925. Determine ol(j) - h(j). 3j3 + j2 - 1 Let s(i) = i + 1. Let o(v) be the second derivative of 5v*3/2 + 9v*2 + v - 33. Give o(z) - 18s(z). -3z Let u(x) = 5x*3 + 6x*2 + 4x. Suppose -4i + 5g + 3 = 10, 5g - 4 = 3i. Let k(f) = -f3 - f2 - f. Calculate ik(r) - u(r). -2r*3 - 3r*2 - r Let d(t) = -13t*2 + 28t + 157. Let i(z) = 7z2 - 15z - 78. What is -6d(w) - 11i(w)? w*2 - 3w - 84 Let i(g) = 12g3 - 12g*2 + 6g - 8. Let t(u) = 2u3 - u2 + u. Determine i(q) - 5t(q). 2q3 - 7q*2 + q - 8 Let p be -1(-190)/(-6) - 4/12. Let y = -26 - p. Let r(f) = f - 5. Let u(t) = 2t - 9. Give yu(h) - 11r(h). h + 1 Let f(k) = -63k*2 - 28k. Let w(j) = -31j2 - 12j. Determine -2f(r) + 5w(r). -29r2 - 4r Let u(f) = -3f3 - f2. Let m(g) = 10g*3 + 37g. What is -m(o) - 4u(o)? 2o*3 + 4o*2 - 37o Let g be 18/8 + (-3)/(-4). Let z(a) = -2 + g - 2 + 2. Let u(i) = 4i - 4. What is u(l) + 4z(l)? 4l Let g(y) = -42y*2 + 17. Let s(t) = -21t*2 + 8. Calculate -6g(i) + 13s(i). -21i*2 + 2 Suppose -10n = 8n - 90. Let o(l) = 6l*2 + 7l - 1. Let p(g) = -7g2 - 8g + 2. Calculate np(x) + 6o(x). x*2 + 2x + 4 Let g(p) = -15 + 3 + 5p + 11 - 4p. Let x(w) = 1 + 12w - 16w + 1. Calculate -5g(d) - x(d). -d + 3 Let g(o) = 9o*2 - 8. Let u(d) = 28d*2 - 22. Calculate -8g(k) + 3u(k). 12k*2 - 2 Let y(i) = 502i*2 - 109i - 5. Let n(t) = -254t2 + 55t + 2. Let j(m) = -5n(m) - 2y(m). Let s(d) = -19d2 + 4d. What is -4j(w) - 57s(w)? 19w2 Let v(j) = -2j*2 + 11j - 1. Let y(n) = 5n2 - 33n + 3. Calculate 8v(k) + 3y(k). -k*2 - 11k + 1 Let v(j) = -12j - 4. Let z(u) = -25u - 7. Give -5v(h) + 3z(h). -15h - 1 Let s(x) = 16x + 0x - 5x - 8x. Let y(n) = 4n - 1. Calculate 3s(b) - 2y(b). b + 2 Let a(u) = -2u3 + 2u*2 - 2u + 15. Let b(z) = z*2 + z + 2. What is -a(s) + 2b(s)? 2s3 + 4s - 11 Let d(p) = -2p2. Let r(t) be the first derivative of 2 - 2t3 - 7 - 5 + t3. Suppose -2w + 3 = 4n - 13, 3n = w + 2. Give wr(j) - 7d(j). 2j*2 Let s(i) = -8316i. Let q(p) = 177p. Determine 189q(m) + 4s(m). 189m Let o(z) = -557z3 + 11z - 11. Let s(y) = 186y3 - 4y + 4. Determine 4o(f) + 11s(f). -182f3 Let w(d) = -143d - 65. Let y(n) = -16n - 12. Let o(z) = 15z + 10. Let p(k) = -3o(k) - 2y(k). Give -65p(l) + 6w(l). -13l Let w(y) = 2y*2 + 8y + 1. Let q(j) = -j*2 + j. What is 2q(a) + 2w(a)? 2a*2 + 18a + 2 Let y(s) = s - 17. Let j(z) = 56z + 78. Calculate j(w) + 5y(w). 61w - 7 Let u(j) = -6j*3 - j + 17. Suppose 0p = 2p - 26. Let t(d) = 11d*3 + 2d - 35. Let z(k) = pu(k) + 6t(k). Let h(w) = w*3 - 1. Determine 22h(a) + 2z(a). -2a*3 - 2a Let a(b) be the first derivative of -22b3/3 + 8b*2 - 283. Let k(x) = 7x*2 - 5x. What is 5a(l) + 16k(l)? 2l2 Let b(d) be the third derivative of -7d*4/6 - 2d*3/3 + 30d*2. Let n(k) = -9k - 1. Calculate 3b(t) - 10n(t). 6t - 2 Let x(p) = -4p*3 - 5. Let h(u) = 3u3 + 4. Let g(c) = c2 - 25c + 41. Let s be g(23). Calculate sh(v) - 4x(v). v3 Let d(g) = 38 - g - 14 - 12 - 13. Let k(f) be the first derivative of f4/2 - f3/3 - 5f*2/2 - 3f + 1. Give 3d(h) - k(h). -2h3 + h2 + 2h Let n(b) = 5b*3 - 3b*2 - 3. Let u(r) be the first derivative of -29r*4/4 + 17r*3/3 + 17r - 150. Let g be (2 - 3)-1 + -7. Determine gu(a) - 34n(a). 4a3 Let q(h) = -h2 + 3h + 8. Let s(y) = y + 1. Let o be (4 + 5)/((-54)/(-12)). What is os(g) - q(g)? g*2 - g - 6 Let w(p) = p - 2. Let y(r) = 27. Let m(o) = -10 + 3 + 2. Let l(s) = -33m(s) - 6y(s). Suppose -x + 4v + v + 22 = 0, v - 6 = -5x. Calculate xl(u) + 3w(u). 3u Let q(k) = -11k2 - 5 + 3k + 2k2 + 3k. Let s(h) = 17h2 - 11h + 9. Give -11q(c) - 6s(c). -3c2 + 1 Let g(j) = 9j*2 - 26j + 2. Let s(y) = 17y2 - 47y + 3. Let n(a) = 11g(a) - 6s(a). Let k(r) = -3r2 - 3r + 3. What is -4k(q) + 3n(q)? 3q2 Let x(w) = -37w*3 + 8w*2 + 2w + 1. Let f(b) = 13b3 - 3b*2 - b. Give 8f(n) + 3x(n). -7n*3 - 2n + 3 Let s(k) = 116k3 + 8k*2 + 8k - 28. Let b(u) = -13u3 - u2 - u + 3. Give 28b(a) + 3s(a). -16a*3 - 4a*2 - 4a Let z(l) = 28l2 - 6l + 8. Let y(w) = -9w2 + 2w - 3. Determine -7y(v) - 2z(v). 7v2 - 2v + 5 Let t(v) = 4v - 5. Let p(h) = h + 4. Let s be p(-11). Let l(c) = c2 - 2c + 11 - c - 3c - 3c. Calculate st(a) - 3l(a). -3a2 - a + 2 Let v = -106 + 108. Let f(m) = -m3 - 5m*2 + 5m + 5. Let g be f(-6). Let t(x) = 12x2 + x. Let s(c) = -2c*2. Give gs(a) + vt(a). 2a*2 + 2a Let w(n) = 9n3 - 3n*2 + 10. Suppose 4l - q = -16, l - 36q = -37q - 9. Let j(i) = -4i3 + i2 - 5. Determine lj(y) - 2w(y). 2y3 + y2 + 5 Let g(l) = -9l3 - 5l*2 - 4l + 7. Let p(b) be the first derivative of -5b4/4 - b3 - b2 + 4b + 233. Calculate 4g(y) - 7p(y). -y3 + y2 - 2y Let d(j) be the third derivative of j4/4 + 2j*3 + 270j*2. Let g(s) = 1. Calculate d(a) - 12g(a). 6a Let c(r) = -4r - 103. Let n(z) = -2z - 51. What is 6c(b) - 11n(b)? -2b - 57 Let p(i) = -14i - 28. Let s(q) = -3q - 5. Give -4p(g) + 21s(g). -7g + 7 Let x = 1892 + -1898. Let l(y) = -17y + 1. Let a(m) = 50m - 3. Calculate xa(o) - 17l(o). -11o + 1 Let p(n) = 40n2 - 11n + 5. Let f(d) = 14d2 - 4d + 2. What is -17f(w) + 6p(w)? 2w2 + 2w - 4 Suppose -20 = -4u + 64. Let y(q) = 18 - 7q + 9q - u. Let n(i) = -2i + 3. Calculate -4n(w) - 3y(w). 2w - 3 Let g(y) = -2y - 2. Suppose -83v = -79v - m - 8, 0 = 2v - 3m - 14. Let r(i) = 1. Give vg(w) + 3r(w). -2w + 1 Let a(k) = k3 - k2 - 1. Let b(h) = -3h*3 + 2h*2 - 2. Let x = -41 - -45. Give xa(p) + 2b(p). -2p*3 - 8 Let g(n) = 10n*3 + 7n*2 + 7n. Suppose 9o + 186 = -291. Let u = o - -47. Let b(a) = 3a*3 + 2a - 5a2 + 0a*2 + 7a*2. What is ug(k) + 21b(k)? 3k*3 Suppose 38 = 3u - 5j + 52, 4u + 10 = -2j. Let m(a) = 3a - 8. Let d(v) = -1. Give ud(l) + m(l). 3l - 5 Let n(y) = 124y2 + 3y + 4. Let x(u) = 82u2 + 2u + 3. Give -5n(q) + 7x(q). -46q2 - q + 1 Let h(w) be the third derivative of w4/24 - w3/6 + 10w*2 - 2w. Let l(i) = 3i3 + 8 + 2i - 5i - 3i. Calculate -6h(q) - l(q). -3q*3 - 2 Let v = 4 - -1. Let r(l) = 4l*2 + 3l. Let g(c) = 10 - 7c2 + 16 - 5c - 26. What is vr(p) + 3g(p)? -p*2 Let b(z) = -563z + 14. Let l(c) = 281c - 6. Calculate -6b(v) - 14l(v). -556v Let k(l) = -10l. Let o(u) = 1395u + 2. What is 5k(p) + o(p)? 1345p + 2 Let t(g) = 2g2 + 4g - 2. Let i(c) = 2c2 + 4c - 3. What is -4i(d) + 5t(d)? 2d2 + 4d + 2 Suppose -209 = 113j - 548. Let s(q) = 9q*3 - 3q*2 - q + 3. Let i(b) = 19b*3 - 7b*2 - 2b + 7. What is ji(c) - 7s(c)? -6c3 + c Let n(q) = -27q + 1. Let o(l) = -2l. Determine n(h) + 5o(h). -37h + 1 Let q(c) = c + 2 + 1 + c - 3c2 + c2. Let f(d) = -9d2 + 5d + 8. Let m(k) = -k*2. Let w(z) = -f(z) + 4m(z). Determine 8q(a) + 3w(a). -a2 + a Let y(h) = -h3 - h*2 - 1. Suppose -1 - 11 = 12t. Let n(s) = 6s3 + 4s*2 + 2. What is tn(b) - 2y(b)? -4b*3 - 2b*2 Let k(q) = -13q*2 + 9q. Let r(o) be the second derivative of -o*4/2 + 2o*3/3 - 44o + 2. Determine 2k(j) - 5r(j). 4j2 - 2j Let v(b) = -4b + 24. Let x = -2454 + 2456. Let k(q) = -q + 8. What is xv(w) - 7k(w)? -w - 8 Let v(d) = -d3 - d2 - d. Let w(r) = 11851r*2 + 0r*3 + 5r*3 + r - 11843r*2. Give -4v(i) - w(i). -i*3 - 4i*2 + 3i Let a be ((-14)/4)/(-29/(-36)). Let g(o) = -5o - 3. Let f	{ "pile_set_name": "DM Mathematics" }
n o is divided by 92. 9 Suppose 3k - 2k = 30. What is the remainder when 20 is divided by k/(-45)(-1 + (-62)/4)? 9 Let r be 114 + (-5)/(5/(-2)). Suppose -4u - 4p = p - 229, -2u = 2p - r. Calculate the remainder when u is divided by 22. 17 Let m(j) = -j2 - 29j - 24. What is the remainder when 208 is divided by m(-27)? 28 Suppose -q + 312 = -8a + 7a, a - 627 = -2q. What is the remainder when q is divided by 11? 5 Let l(s) = -16s - 15. Let y = 7 + -2. Suppose 116 = 7x - 2x - 3v, -3x = yv - 90. What is the remainder when l(-4) is divided by x? 24 Suppose 3b + z + 201 = 4b, -801 = -4b + z. What is the remainder when b is divided by 72? 56 Suppose 2f + x - 91 = -0x, 188 = 4f - 4x. Let y = f + -28. Calculate the remainder when y is divided by 5. 3 Let p = -84 - -134. Let v = 60 + -43. Calculate the remainder when p is divided by v. 16 Let z(v) = v*2 + 3v - 2. Let a be z(-4). Let x(q) = -12q - 2 - 2q2 + qa + 0q2 - 5. What is the remainder when x(-6) is divided by 16? 13 Let p(a) = -a2 + 73a + 27. What is the remainder when 154 is divided by p(0)? 19 Suppose -175 = -30c + 125. Suppose -n - 2f + 11 = 0, 0n + 5f = 5n + 20. Let v(w) = 6w + 1. Calculate the remainder when c is divided by v(n). 3 Suppose -6 = 5b - 21. Suppose 3q + 2 = 2u + 8q, -2u - 2q = -2. What is the remainder when b is divided by u? 0 Let u be 1/6 - (-1)/(-6). What is the remainder when (u + (-28)/(-8))6 is divided by (2/6)/(1/33)? 10 Calculate the remainder when 266 is divided by (3/(-9))/(7/(-1134)). 50 Suppose 35 + 97 = 11g. Let k = 265 - 147. Calculate the remainder when k is divided by g. 10 Let a = -7 - -36. Calculate the remainder when a is divided by 8 - (-5 - -1)1. 5 Let f(s) = 3s + 5. Suppose 3k + 232 = 5l, 127l + k = 132l - 244. Calculate the remainder when l is divided by f(4). 16 Suppose -r - 4r - 183 = d, 5d = -3r - 937. Let i = d + 270. What is the remainder when i is divided by 21? 19 Let d(s) = -2s*2 + 28s - 76. What is the remainder when 105 is divided by d(9)? 7 Let a(d) = 11d - 9. Let c(y) = y3 - 5y2 + y + 1. Let j be c(5). Calculate the remainder when a(j) is divided by 20. 17 Let f(d) = d2 + 6d + 7. Let o be f(-5). Suppose 3b + 30 = 5j, 0 = -4j - 6b + ob - 8. Calculate the remainder when 11 is divided by j. 2 Let z(t) = -t - 2. Let k be z(-2). Let i(d) = d*3 + 19d*2 + 33d + 11. Calculate the remainder when (k/(-1) - -1) + 82 is divided by i(-17). 27 Let m be (36/(-48))/(2/(-24)). Let z(j) = -j. Let v(y) = -6y + 5. Let c(w) = -v(w) + 4z(w). Calculate the remainder when 38 is divided by c(m). 12 Let v = -8 + 17. Let q = 14 - v. Suppose -3u - 265 = -qn, -3n + n - 3u = -106. What is the remainder when n is divided by 18? 17 Suppose 4t - 26 + 174 = 4a, -70 = -2a + t. Let q be ((-10)/(-25))/(1/15). Calculate the remainder when a is divided by q/(-9) + (-76)/(-6). 9 Suppose -m - 49 = -2p, 5m + 3 = 5p - 132. Calculate the remainder when p is divided by 18. 4 Let x = 144 - 202. Let s(t) = 7t + 4. What is the remainder when (x - -10)(-3)/2 is divided by s(3)? 22 Let h = -1036 - -1064. What is the remainder when 221 is divided by h? 25 Suppose -i + 2 + 7 = 0. Let x(o) = o*2 - 8o + 14. Let l be x(6). Suppose ld + 98 = 4p, -p + 5p - 91 = -5d. Calculate the remainder when p is divided by i. 6 What is the remainder when 48 is divided by ((-7)/(-2) - -4) + (-10)/(-4)? 8 Calculate the remainder when ((-55)/(-3))/(19/57) is divided by 13. 3 Suppose c - 23c + 3036 = 0. What is the remainder when c is divided by -2 + 1 + 123? 33 Suppose 28i = 27 + 113. What is the remainder when 15 is divided by i? 0 Let h be 0 + 4 + -2 + 0. Suppose 0 = 4d - u - 23, 0 = -hu + 7u - 25. What is the remainder when d is divided by 8/(-3 + (5 - 0))? 3 Let a(b) = -b. Let d be a(-2). Suppose 5w + dq - 33 = 0, 10 = w + q - 4q. Suppose p + 2 - w = 0. What is the remainder when 14 is divided by p? 4 Let w(t) = 27t - 3. Suppose -3x = -a + 36, -a = 5x - 12 - 0. Calculate the remainder when w(4) is divided by a. 24 Suppose 2z + 7 + 65 = 0. What is the remainder when 13 is divided by (-8)/z + (52/9 - -2)? 5 Let v be 3/(-9)83. Let k = v + 22. Calculate the remainder when (-4)/10 - (-1182)/30 is divided by k. 11 Let q(x) = -12x - 11. Let j = 23 + -28. Let f(a) = a*2 + 2a - 2. Calculate the remainder when q(j) is divided by f(3). 10 Suppose -4z + 12 = -5g, -2 = -5z - 2g + 13. Let d = z - 1. Suppose dm - 7 = 3l, -2l - 10 + 2 = -3m. What is the remainder when m is divided by 2? 0 Let t = -93 - -136. Calculate the remainder when 124 is divided by t. 38 Calculate the remainder when (-1)/((-5455)/1090 - -5) is divided by 0 + 43 + (-16)/(-16). 42 Let w(p) = p*3 - 2p*2 + 5p + 13. What is the remainder when 115 is divided by w(0)? 11 Suppose -2d - 1506 = -2g, -2d - 2412 = -4g + 602. What is the remainder when g is divided by 14? 12 Suppose -4j - f = 99, 3j + 0j + 87 = -5f. Let h = j - -47. Calculate the remainder when 988/11 - 4/(-22) is divided by h. 21 Let x = 117 - -19. Suppose 17 = l - 5b, -4b = 3l - 2b - x. Calculate the remainder when 124 is divided by l. 40 Suppose -2639 = -39i - 845. Suppose 328 = -4h + 2h. What is the remainder when i is divided by h/(-14) + 4/14? 10 Let t(f) = -3f + 8f2 + f2 - 4f + 1 + 4f. Let v be t(2). Suppose 0 = -4a + v + 9. What is the remainder when 29 is divided by a? 9 Let c(t) = t*3 - 8t*2 + 10t - 9. Let i be c(7). Let m(q) = 3q - 9. Calculate the remainder when i/96 - 3 is divided by m(4). 2 Let t(p) = -2p2 - 14p - 11. Let i(s) = 2s2 + 15s + 11. Let y(r) = -6i(r) - 7t(r). What is the remainder when 68 is divided by y(-6)? 33 Suppose -y = 2y - a - 138, -92 = -2y - 3a. Suppose v + 4v - 45 = 0. Suppose 3t + v = 3, 3b - 2t = 52. What is the remainder when y is divided by b? 14 Suppose -1 = w - 2w - 3d, 5d + 45 = 3w. Let h = 34 - w. Calculate the remainder when h is divided by 14. 10 Let v(d) = -d - 3. Let j be v(-6). Suppose 5h - j = 7. Suppose n + 9 = hn. What is the remainder when n is divided by 2? 1 Suppose 3w = -16 + 73. Let z(q) = q*2 - 20q - 63. Let o be z(23). Let a = o + w. What is the remainder when 98 is divided by a? 23 Suppose 0 = -z - 5l + 2, 2z + 3 + 4 = l. Calculate the remainder when 87 is divided by 75/24 + z - 2457/(-56). 43 Suppose -7o = -5o. Suppose 3s + 50 = 5u, o = u - 3u + 4s + 20. Calculate the remainder when 28 is divided by u. 8 Suppose -5n = 3g - 1171 - 1009, 2g - 4n = 1446. Calculate the remainder when g is divided by 52. 49 Suppose -5t + 114 - 9 = 0. Let w = -26 - -67. What is the remainder when w is divided by t? 20 Suppose -19o - 2j = -15o - 140, 4j + 60 = 2o. What is the remainder when o is divided by 15? 4 Suppose r - 4m + m = 13, -2r - 5m = -37. Suppose 225 = 3g + 2g. What is the remainder when g is divided by r? 13 Let u be 16/3369/6. Suppose 0 = -6i + 2i + u. Suppose -4x = -s + i, -305 = 2s - 7s - x. Calculate the remainder when s is divided by 21. 20 What is the remainder when (-29)/232 - 1890/(-16) is divided by 12? 10 Suppose 4d = 5k - 809, -5k + 577 + 260 = 3d. Suppose 5i = -3p + 135 - 9, 210 = 5p + 2i. Calculate the remainder when k is divided by p. 39 Suppose 21 = 3c - 75. Suppose 334 = 5z - 136. What is the remainder when z is divided by c? 30 Let a(s) = 4s - 36. Let i(r) = 5r - 3r + 0r - 27 + 9. Let k(f) = 4a(f) - 7i(f). What is the remainder when 28 is divided by k(14)? 8 Let i be 5 + -102/(-5). Suppose ig - 476 = -170. What is the remainder when g is divided by 12? 10 Let t(k) = 6 + 2 + 6k*2 + k + 4 - 5k*2. Let z be t(-5). Calculate the remainder when 424/z + 1/(-4) is divided by 4. 1 Suppose -3q + 5n - 22 = -4q, -4q - 3n = -20. Calculate the remainder when 62 is divided by (-47 - 1)/((-1)/(-2) - q). 30 Suppose -4s - 157 - 3 = 0. Let r = 46 + s. What is the remainder when r is divided by 1? 0 Suppose 2x - 12 = 3x + s, 4s + 6 = 2x. Let u(q) = 0q*3 - 2q + 7q2 + q3 + 0q - 4. Calculate the remainder when 27 is divided by u(x). 7 Suppose -4o - m = o - 12, -15 = -3o + 2m. Let x(c) = 3c*2 - c. Calculate the remainder when x(o) is divided by 5. 4 Suppose 16w = 11w + 30. Suppose 0 = -4l +	{ "pile_set_name": "DM Mathematics" }
9553 + 2688o + 6288o as p + io and give p. -1 Express (7 + 2 + 2)(6 + 1 - 14)(3 + 2i - 3 + (-1 + 1 - 1)(7 - 13i - 7) + 2i - 6i + i) in the form o + zi and give o. 0 Express (2x + x - 2x - 1)(-1 + 1 - 2x)(57322 - 15413x2 - 57322) as wx*3 + lx*4 + s + vx + tx2 and give l. 30826 Express -30q*2 + 2q + 0q + 7q*2 + (-8 + 10 + 5)(0 + 0 + 5)(-q + 2q - 2q)(3 - 3 + q) in the form a + kq2 + cq and give k. -58 Express (18386 + 53j + 100j + 19878 - 151j)(j - 3j + 0j + (3 - 3 - 2j)(2 - 2 + 2)) in the form dj + f + rj*2 and give r. -12 Rearrange -2433s - 1081s - 1166s - 611s to the form us + b and give u. -5291 Express -3q + 6q + 0q + 487 + 227 + 544 in the form y + jq and give y. 1258 Rearrange -1252 + 289b + 2457 - 1193 + 171b to the form mb + k and give k. 12 Express (75 - 31 - 6 + 79)(-5 - 1 - 1)(-3b + 0b + 0b) as mb + f and give m. 2457 Rearrange j - j + j2 + (-2j + 0j + 3j)(2559121 - 2559121 + 2608j) to the form pj2 + yj + i and give p. 2609 Rearrange 4 + 32b2 - 15b2 - b3 - b + 8b2 + 30b*2 to the form s + rb + ub2 + tb*3 and give r. -1 Express 83x*2 - 33x*2 + 5x - 14 - 19x2 - 20x*2 - 2x in the form h + rx + ux*2 and give h. -14 Express -4 + 1 + j - 65j*2 - 197j*2 - 6 + 12 as qj*2 + lj + s and give q. -262 Rearrange (((-2 + 5 - 1)(0 - 5 + 4) + 1 + 3 - 3)(-2 - 2 + 2) + 151 - 80 - 260)(13y*2 + 0y*2 + 3y*2) to z + jy + py2 and give j. 0 Rearrange 106875 - 53464 + v - v3 - 53560 to the form yv + qv2 + c + av3 and give y. 1 Express -n3 + 2n + 8248 + 5n*2 - 2n*2 - 8271 as sn*3 + tn + f + an2 and give f. -23 Express (-2 - 1 + 5)(-4y3 + 3y*3 + 4y*3) + (-504 + 105 - 63)(-4y3 - y3 + 2y*3) as my + v + uy3 + cy*2 and give u. 1392 Express (11 + 9w - 11 + (-1 - 4 + 3)(4w - 3w - 2w) - 2w + 5w - 2w)(-65 - 346 + 204) in the form d + rw and give r. -2484 Express (7a*2 - 7a*2 - 5a*3)(-2 + 2 + 5)(-6a + 22 - 22)(-1 - 5 + 2) as ta*2 + x + fa + ra4 + ca*3 and give f. 0 Rearrange -583n + 1179n2 + 70n - 1177n2 - 2 to cn*2 + l + jn and give j. -513 Rearrange (-5 + 20387u + 4 - 20638u)(12 - 15 - 8) to the form t + zu and give z. 2761 Express 14772b - 25605b - 11139b as vb + c and give v. -21972 Rearrange -3k2 - 26 + 4k*2 + 482k - 960k + 479k + 12k3 + 42k*3 to the form lk*2 + y + ik*3 + sk and give s. 1 Express 545g2 - 545g*2 - 206g3 + g3 + 3g3 + 6g*3 + (-g + g + 2g*3)(-3 - 3 + 4) as qg + k + og*3 + yg*2 and give o. -200 Rearrange (5 - 1 - 1)(353z + 696z + 28z) to the form sz + l and give s. 3231 Rearrange 1174d4 - 441d*4 - 5 - 699d*4 + 8d*3 + d to ad*3 + y + vd*2 + jd + id4 and give y. -5 Rearrange 3r + 3 - 3 + 2r2 + (-2r*2 + 0r*2 + 3r*2)(-3 + 0 + 2) + r*2 + 1453084 + 20r + 0r2 - 1453047 to the form fr*2 + m + zr and give z. 23 Rearrange (-13p - 4p + 4p)(1 - 3 + 0) + 3974 - 1991 - 1983 + 2432p to vp + i and give v. 2458 Express (-5 + 2 + 4)(10 - 14m + 8 - 27 + 14)(2 + 0 - 13) as u + lm and give u. -55 Rearrange 52 + 4t + 2t*4 + 7865t*2 - 3930t*2 - 3937t*2 - 4t*4 - 3t*3 - 3t to ct2 + l + dt + ht3 + ut*4 and give c. -2 Express (-3v*2 - 3 + 3)(4438 - 2323 + 3875)(3v - 4v + 0v) as sv2 + wv*3 + xv + r and give w. 17970 Rearrange 11p2 + 4p - 2 - 186p4 - 7p*3 + 310p4 - p2 - 123p4 to up*2 + bp + np4 + w + dp*3 and give n. 1 Express (12 - 75 - 27)(-2 - 44g + 18g - 7g) as y + xg and give y. 180 Express -4167k2 - 393k*2 - 254 + 254 as zk + o + nk2 and give z. 0 Express 31 - 88 + 40 + 43 - 91c + 47c as j + qc and give q. -44 Express -2g2 - 7g*4 - 3 + 2694g - 2695g + 6g*4 as vg*2 + bg + x + cg4 + rg*3 and give c. -1 Express (683 - 420z*2 + 4170z*2 - 684)(-1 - 4 + 4) + (-z2 - z2 + 0z2)(0 + 5 - 3) in the form hz + q + cz*2 and give q. 1 Rearrange 2891a*2 + 2600a*2 + 2057a*2 - 459a*2 to qa*2 + ta + i and give q. 7089 Express 2675y3 - 316803 + 316801 + 2y*2 - 2y - y + 4y in the form o + ky*3 + hy*2 + ly and give k. 2675 Express 39141 - 26p2 + 21p - 5p4 + 25p*2 - 39137 in the form kp*4 + tp*2 + qp*3 + wp + n and give q. 0 Rearrange -2z + 21z*2 - 5z*3 - 36 - 7z*2 + 6z*3 to the form dz*3 + rz*2 + s + oz and give d. 1 Express (5974632 - 5974632 - 10724a3)(2 - 2 - 4a) as g + qa + oa2 + ca*3 + ha*4 and give h. 42896 Express (-4916o*2 + 2350o*2 - 10525o*2)(-2 - 1 + 4) in the form wo2 + x + jo and give w. -13091 Rearrange -10c - 138 - c4 - 3c*4 - 134 + 47c3 + 273 + c4 to the form v + mc3 + kc + hc2 + uc*4 and give m. 47 Rearrange -82q - 52q - 173q*2 + 13q + 187q2 + 3q to the form kq2 + b + vq and give k. 14 Rearrange (3 - 2 - 2)(7906i*4 + 29 + 809i*4 - 15 - 14) to ui*3 + fi + qi4 + ki*2 + p and give q. -8715 Rearrange 942j - 653j + 2643j + 2545j + 1336j to the form u + zj and give z. 6813 Express 5298w*2 - 7966w*2 - 6796w*2 in the form nw*2 + gw + s and give n. -9464 Rearrange -10u2 - u + 8003u*4 - 8006u*4 + 6u*2 - 382 to gu*3 + b + xu*4 + du + zu2 and give z. -4 Rearrange r + 18460r*2 + 2r*4 - 7r + 34 - 18460r2 to hr*4 + fr*2 + nr + or3 + t and give n. -6 Express (-6 + 3 + 1)(0h2 + 21h*2 + 36h*2)(117h + 4836 - 4836) in the form oh + th2 + gh*3 + v and give g. -13338 Rearrange 5508o + 1757o + 1579o to h + uo and give u. 8844 Express (0d + 0d - 2d)(-63 + 178 + 115) + 0d + 0d - 6d in the form cd + s and give c. -466 Express -614i + 380i - 177i - 3976 - 634i + 3980 as z + bi and give b. -1045 Express 7 + 11m - 4 - 20m + 5m - 3m - 3m + (4m + m - 4m)(-2 + 0 + 1) - 4553 - 228m + 4553 + (1 - m - 1)(-3 + 1 + 5) as bm + z and give b. -242 Rearrange (-10a - 415 + 415)(55a*3 - 173a*3 - 85a*3) to the form na + ma3 + j + ra*4 + ca*2 and give r. 2030 Rearrange (-3 + 5 - 1)(-431694x + 431694x - 5x2 + 235x*4 - 2) to the form gx*2 + ux*3 + v + yx + nx4 and give n. 235 Express -10i - 20i4 + 4 - 85i*3 + 79i*3 + 9i as ki2 + t + fi*3 + zi*4 + mi and give z. -20 Express (-1 + 1 - c)(2c*2 - 5c*2 + 2c*2) + 26c*3 + 30c*3 - 12c3 + c2 - 72c - 672c*3 + 72c as g + ic3 + fc + vc2 and give i. -627 Express (1133t + 1158t - 2209t + 1)(-3t - 9t - 4t) as kt2 + vt + y and give k. -1312 Express 23485 + 25317 + 2u - 51978 as pu + t and give p. 2 Rearrange -141w - 414w - 73w - 2w + 2w - w + (-3 + 2 + 0)(-7w - 3 + 3) to the form fw + y and give f. -622 Express -11 + 0y3 + 10y + 2y3 + 8y + 4y2 + 6y - 22y + y4 as j + by + my3 + hy*2 + ry*4 and give r. 1 Express 5405 + 5400 - 10758 + 41u - u4 + u3 as xu3 + v + yu + iu2 + fu*4 and give x. 1 Rearrange 2d*3 - 9280 - 9313 + 18591 + 2d*2 + 124d to md + sd*2 + od*3 + g and give m. 124 Rearrange -19481824 + 19481824 + 3424u to g + iu and give i. 3424 Rearrange 50 - 50 + 7q + (-536q - 193q + 191q)(-2 - 1 + 2) + 2q - 4q + 3q to jq + z and give j. 546 Express (7087205d - 7087205d - d*2 - 2829)(-3d - d - d) as w + jd*2 + id + md3 and give w. 0 Express 69 + 50 - f3 + 47 - 164 - 6f + 3f3 + 110f*2 as of*3 + rf*2 + d + bf and give b. -6 Express (3i3 + 0i + 0i)(i + 19 - 5 - 5 + 1370i - 8) in the form bi + ni2 + fi*4 + ci*3 + h and give c. 3 Express -169 + 37 + 103 + 29 - 7249g*2 + 2g in the form hg + fg*2 + w and give h. 2 Express -3j*4 + 3j*2 - 306 - 164 + 204 as bj*3 + nj*4 + oj + l + yj2 and give b. 0 Rearrange (-u2 - 3u2 - u2)(0 + 4 - 6) - 716u*2 + 317u*2 + 347u*2 - 2 + 2 + 3u*2 to the form xu*2 + v + zu and give x. -39 Rearrange 797 - 796 - q + 796q2 + 2347q*2 to vq*2 + oq + s and give v. 3143 Rearrange (-50i2 + 169i*2 - 75i*2 - 4i)(0i*2 - 4i2 + i2) to j + ti4 + ci*2 + yi*3 + ui and give t. -132 Express 3c - 3c - 3c2 + (1 + 2c - 1)(-61605 + 61605 - 74c) + 2c2 - 3 + 4 - 4 in the form bc*2 + ac + g and	{ "pile_set_name": "DM Mathematics" }
are there between 12:58 AM and 2:30 AM? 92 How many minutes are there between 3:27 PM and 2:01 AM? 634 How many minutes are there between 4:28 PM and 7:02 PM? 154 What is 320 minutes before 10:56 PM? 5:36 PM How many minutes are there between 9:10 AM and 11:27 AM? 137 How many minutes are there between 1:11 AM and 8:07 AM? 416 What is 699 minutes after 7:27 PM? 7:06 AM What is 82 minutes before 10:07 PM? 8:45 PM How many minutes are there between 3:48 AM and 3:19 PM? 691 How many minutes are there between 3:17 PM and 6:22 PM? 185 How many minutes are there between 10:36 PM and 8:28 AM? 592 What is 453 minutes before 1:25 PM? 5:52 AM How many minutes are there between 2:28 PM and 5:55 PM? 207 How many minutes are there between 10:35 AM and 12:04 PM? 89 How many minutes are there between 9:36 PM and 5:04 AM? 448 What is 553 minutes before 9:43 AM? 12:30 AM How many minutes are there between 3:52 AM and 5:43 AM? 111 How many minutes are there between 9:22 PM and 9:34 PM? 12 How many minutes are there between 5:35 AM and 4:50 PM? 675 How many minutes are there between 6:08 AM and 7:08 AM? 60 How many minutes are there between 2:14 AM and 10:22 AM? 488 How many minutes are there between 8:13 PM and 1:09 AM? 296 What is 680 minutes after 6:54 PM? 6:14 AM How many minutes are there between 10:59 AM and 1:49 PM? 170 What is 293 minutes before 11:14 PM? 6:21 PM What is 235 minutes after 7:53 AM? 11:48 AM How many minutes are there between 7:46 PM and 7:02 AM? 676 What is 589 minutes after 10:47 PM? 8:36 AM What is 482 minutes before 1:41 PM? 5:39 AM What is 132 minutes before 9:40 AM? 7:28 AM How many minutes are there between 7:35 PM and 12:44 AM? 309 How many minutes are there between 8:34 PM and 5:54 AM? 560 What is 77 minutes before 11:14 AM? 9:57 AM What is 706 minutes before 12:19 AM? 12:33 PM What is 502 minutes before 5:32 PM? 9:10 AM How many minutes are there between 9:42 PM and 5:06 AM? 444 How many minutes are there between 1:27 AM and 2:08 AM? 41 What is 27 minutes before 3:32 PM? 3:05 PM How many minutes are there between 12:21 AM and 1:37 AM? 76 What is 167 minutes after 3:46 PM? 6:33 PM How many minutes are there between 8:21 PM and 1:58 AM? 337 How many minutes are there between 12:15 PM and 3:21 PM? 186 What is 231 minutes after 2:15 AM? 6:06 AM How many minutes are there between 3:17 PM and 10:54 PM? 457 How many minutes are there between 5:53 AM and 7:43 AM? 110 How many minutes are there between 12:24 PM and 8:01 PM? 457 What is 236 minutes after 1:20 PM? 5:16 PM How many minutes are there between 11:42 AM and 3:19 PM? 217 What is 462 minutes before 6:22 PM? 10:40 AM What is 582 minutes after 12:17 AM? 9:59 AM How many minutes are there between 2:20 PM and 2:55 PM? 35 What is 96 minutes after 6:36 AM? 8:12 AM How many minutes are there between 1:19 PM and 3:48 PM? 149 How many minutes are there between 8:55 AM and 8:15 PM? 680 What is 155 minutes after 5:11 AM? 7:46 AM What is 91 minutes after 9:11 PM? 10:42 PM How many minutes are there between 2:00 PM and 1:42 AM? 702 How many minutes are there between 1:18 PM and 4:04 PM? 166 How many minutes are there between 9:26 PM and 11:50 PM? 144 How many minutes are there between 11:46 AM and 12:40 PM? 54 What is 547 minutes after 4:59 PM? 2:06 AM How many minutes are there between 11:29 PM and 2:09 AM? 160 What is 366 minutes before 3:44 AM? 9:38 PM How many minutes are there between 7:22 PM and 2:48 AM? 446 What is 405 minutes after 4:28 PM? 11:13 PM How many minutes are there between 8:44 AM and 1:37 PM? 293 How many minutes are there between 8:10 AM and 7:10 PM? 660 What is 25 minutes after 1:25 PM? 1:50 PM What is 599 minutes before 2:27 AM? 4:28 PM How many minutes are there between 12:40 AM and 7:08 AM? 388 What is 373 minutes before 6:50 PM? 12:37 PM How many minutes are there between 10:28 AM and 12:09 PM? 101 How many minutes are there between 1:11 AM and 8:48 AM? 457 What is 202 minutes after 2:20 AM? 5:42 AM How many minutes are there between 3:13 PM and 4:55 PM? 102 How many minutes are there between 11:39 AM and 10:55 PM? 676 What is 491 minutes after 8:18 PM? 4:29 AM What is 699 minutes after 8:12 PM? 7:51 AM What is 260 minutes before 7:51 PM? 3:31 PM What is 474 minutes after 12:08 PM? 8:02 PM How many minutes are there between 2:18 PM and 11:38 PM? 560 How many minutes are there between 5:28 PM and 3:04 AM? 576 How many minutes are there between 7:43 AM and 6:45 PM? 662 What is 142 minutes after 12:58 AM? 3:20 AM How many minutes are there between 7:08 PM and 5:44 AM? 636 How many minutes are there between 3:17 PM and 2:21 AM? 664 What is 584 minutes after 10:59 PM? 8:43 AM How many minutes are there between 12:12 PM and 3:08 PM? 176 How many minutes are there between 1:39 AM and 6:32 AM? 293 How many minutes are there between 3:35 PM and 1:11 AM? 576 What is 699 minutes before 4:01 PM? 4:22 AM How many minutes are there between 1:24 AM and 1:59 AM? 35 What is 167 minutes before 11:28 PM? 8:41 PM How many minutes are there between 3:50 AM and 5:51 AM? 121 How many minutes are there between 1:21 AM and 11:33 AM? 612 How many minutes are there between 8:00 PM and 9:55 PM? 115 How many minutes are there between 4:55 PM and 9:48 PM? 293 What is 639 minutes after 4:05 PM? 2:44 AM What is 627 minutes before 1:09 PM? 2:42 AM How many minutes are there between 3:53 PM and 1:31 AM? 578 How many minutes are there between 5:27 PM and 2:04 AM? 517 What is 194 minutes after 5:24 AM? 8:38 AM How many minutes are there between 4:30 AM and 3:39 PM? 669 What is 144 minutes after 7:59 AM? 10:23 AM How many minutes are there between 12:14 PM and 8:02 PM? 468 What is 662 minutes before 7:44 AM? 8:42 PM How many minutes are there between 8:27 AM and 12:10 PM? 223 What is 715 minutes after 10:17 PM? 10:12 AM How many minutes are there between 2:30 AM and 12:14 PM? 584 What is 388 minutes after 6:36 PM? 1:04 AM How many minutes are there between 1:34 AM and 4:08 AM? 154 How many minutes are there between 2:20 AM and 6:17 AM? 237 What is 692 minutes after 9:05 PM? 8:37 AM What is 137 minutes after 6:26 PM? 8:43 PM What is 679 minutes after 2:49 AM? 2:08 PM How many minutes are there between 2:23 AM and 12:09 PM? 586 What is 453 minutes before 8:32 PM? 12:59 PM What is 126 minutes after 6:45 PM? 8:51 PM How many minutes are there between 10:33 AM and 10:53 AM? 20 How many minutes are there between 1:49 PM and 11:34 PM? 585 How many minutes are there between 10:42 AM and 10:13 PM? 691 What is 556 minutes after 12:02 AM? 9:18 AM What is 246 minutes after 8:25 AM? 12:31 PM How many minutes are there between 4:07 PM and 2:32 AM? 625 How many minutes are there between 1:29 AM and 1:54 AM? 25 How many minutes are there between 7:58 PM and 5:40 AM? 582 What is 322 minutes after 6:03 AM? 11:25 AM What is 104 minutes after 2:22 PM? 4:06 PM What is 274 minutes before 10:04 PM? 5:30 PM What is 166 minutes before 1:42 PM? 10:56 AM How many minutes are there between 6:11 PM and 5:12 AM? 661 What is 54 minutes after 11:12 AM? 12:06 PM What is 274 minutes after 8:14 AM? 12:48 PM How many minutes are there between 5:50 PM and 7:33 PM? 103 How many minutes are there between 12:26 AM and 1:57 AM? 91 How many minutes are there between 8:09 AM and 9:16 AM? 67 How many minutes are there between 7:57 AM and 2:23 PM? 386 How many minutes are there between 12:53 AM and 6:52 AM? 359 How many minutes are there between 5:17 AM and 12:16 PM? 419 How many minutes are there between 3:49 PM and 5:49 PM? 120 How many minutes are there between 2:05 AM and 9:09 AM? 424 What is 675 minutes after 8:03 AM? 7:18 PM What is 394 minutes before 10:42 AM? 4:08 AM How many minutes are there between 9:48 AM and 11:48 AM? 120 What is 592 minutes after 3:37 PM? 1:29 AM How many minutes are there between 8:14 PM and 3:04 AM? 410 What is 485 minutes before 12:49 PM? 4:44 AM What is 305 minutes after 7:24 PM? 12:29 AM How many minutes are there between 7:22 PM and 3:14 AM? 472 How many minutes are there between 7:36 AM and 10:16 AM? 160 What is 53 minutes before 9:51 AM? 8:58 AM What is 458 minutes before 11:49 AM? 4:11 AM How many minutes are there between 5:43 PM and 10:47 PM? 304 How many minutes are there between 1:41 PM and 9:46 PM?	{ "pile_set_name": "DM Mathematics" }
2 + o - 8. What are the prime factors of n(x)? 2, 5 Let k = 68 + -5. What are the prime factors of k? 3, 7 Suppose -5x + 2 = -4x. Suppose 4l = 2u - 18, 2u + 7l = 3l + x. Suppose 2o - 1 - 24 = a, -uo = -a - 70. List the prime factors of o. 3, 5 What are the prime factors of 29/3(10 - 8/(-4))? 2, 29 Let y(k) = k3 + k2 - k + 5. Let h be y(0). Suppose 0 = hi - 3i - 8. Suppose 3o - 22 = -j, o + 0o = i. List the prime factors of j. 2, 5 Suppose -6m + 5m = -116. List the prime factors of m. 2, 29 Suppose 3f - 4v - 10 = 4f, -45 = -4f + v. Let s = f + 1. Let z = s - 6. What are the prime factors of z? 5 Suppose -2b + 0b = 6. Let p(w) = 0w*3 - 2 + 3w + 2w3 - w2 - 3w*3. List the prime factors of p(b). 7 Suppose 5c + 57 = -s, c - 48 = 4c - 4s. What are the prime factors of 70/20c/(-7)? 2, 3 Suppose 0 = i + 2i. What are the prime factors of (-21)/(1 + -4) - i? 7 Suppose -58 = -7j + 5j. What are the prime factors of j? 29 Let d(p) = p + 1. Let v be (-5)/(-20) + (-7)/(-4). What are the prime factors of d(v)? 3 Let s(x) = -x*3 - 3x*2 - 3x - 6. List the prime factors of s(-4). 2, 11 What are the prime factors of ((-3289)/26)/((5/(-2))/5)? 11, 23 Suppose s = 4k + 10, 5k - k + 64 = 4s. Let t be -2(-2 - (-14)/(-4)). Let q = s - t. What are the prime factors of q? 7 Let s(p) be the third derivative of -p*4/24 + 4p3/3 - p2. Let c be (-3)/(96/28 - 3). What are the prime factors of s(c)? 3, 5 What are the prime factors of (-4)/(-6) + (-80)/(-24)? 2 Suppose -2x - i = -47 - 118, -i + 420 = 5x. List the prime factors of x. 5, 17 Suppose -5w - 147 = -8w. List the prime factors of w. 7 Let z(w) be the second derivative of 2w4/3 + w3/3 - w2/2 - 2w. Let n be z(1). List the prime factors of 96/n + 1/3. 11 Let f = 7 + 27. List the prime factors of f. 2, 17 Let x be (-1)/((-1 - 0)/(-12)). What are the prime factors of (x/(-10))/((-9)/(-150))? 2, 5 Let j be 1 + 0 + -4 + -1. List the prime factors of (4/j - -29)/1. 2, 7 Let a(l) be the third derivative of -l*4/24 + 5l*3/6 + 2l*2. List the prime factors of a(-7). 2, 3 Let k be (-20)/(-4)(-12)/10. Let h be (-12)/(-7) + k/(-21). What are the prime factors of (-2)/(0 + h/(-4))? 2 Suppose 2n - 2c = 16, 4 = -n + c - 3c. Suppose 18 = -m - 2m + nr, m + 6 = -2r. Let o = 9 + m. What are the prime factors of o? 3 Suppose 4s - 16 = 0, 0 = 3q - 3s - 10 - 5. What are the prime factors of q? 3 What are the prime factors of -78(-4)/5 - (-21)/35? 3, 7 Let z(k) = k*2 - k. Suppose 3 = 2c + 5. Let g(o) = 3o2 - 8o - 5. Let s(j) = cg(j) + 2z(j). What are the prime factors of s(5)? 2, 5 Let a = -30 + 70. Suppose 0 = -4x - x + a. List the prime factors of x. 2 Let d(f) = 2f - 1. Let o be d(8). Suppose 0j = 3j - 9. Suppose 2b - o = -jb. List the prime factors of b. 3 Let l be (8/(-3))/(5/15). What are the prime factors of 50/l44/(-11)? 5 Suppose -19 - 5 = 4j. Let p be j/(-15) + 24/(-10). What are the prime factors of (1p + 1)-4? 2 Let o(k) = k*3 - 8k*2 + 7k + 5. Let p be o(7). Let i be p/3(0 - -6). Suppose i = 3x + 1. What are the prime factors of x? 3 What are the prime factors of (-1974)/(-24) - 1/4? 2, 41 Let z = -16 + 18. Suppose 4p + 14 = z, -4p = -2o + 56. List the prime factors of o. 2, 11 What are the prime factors of 6/(-9) - 46/(-6)? 7 Suppose 0 = -5l - 5 + 70. List the prime factors of l. 13 Let z(b) = -7b - 1. List the prime factors of z(-6). 41 List the prime factors of (-1)/(-3)361. 61 Let t(v) = 2v - 14 + 6 + v - 4v. Let d be t(-7). Let l(u) = -22u3 + u2 + 2u + 1. What are the prime factors of l(d)? 2, 11 Let i(a) = 2 - 5 - 2 + 4a. Let f(t) = -7t + 9. Let x(z) = 3f(z) + 5i(z). What are the prime factors of x(-4)? 2, 3 Suppose 12 + 2 = 7x. What are the prime factors of x? 2 Suppose 0 = 2d - 5i + 17, 0 = -d - 4i + 10 + 14. Suppose -d = -2n + 20. What are the prime factors of n? 2, 3 Let t(w) = 51w + 10. Let s be t(5). Suppose 6p - p = s. What are the prime factors of p? 53 Let j = -100 - -55. Let p = j - -99. What are the prime factors of ((-3)/9)/((-2)/p)? 3 Suppose -5t - 2g + 5 = -95, 0 = 2g - 10. List the prime factors of t. 2, 3 Let t = 44 + -7. What are the prime factors of t? 37 Let f = -5 + 8. Suppose -fy = -12, g - y - 31 = -5y. What are the prime factors of g? 3, 5 List the prime factors of (5 - (5 + -3)) + 1601. 163 Suppose 2 + 1 = d. Suppose 0y = -dy + 30. What are the prime factors of y? 2, 5 Let y be (8/3)/(6/18). What are the prime factors of y/(7/2 + -3)? 2 Let o be (-6 + 0 + 0)(-8 + 13). Let a = -1 + 4. What are the prime factors of o/(-8) + a/12? 2 Suppose -5t = -63 - 132. What are the prime factors of t? 3, 13 Let h = 12 + -10. Suppose 5w + y - 69 = 0, hw - y = -2w + 48. What are the prime factors of w? 13 List the prime factors of ((-168)/16)/(3/(-18)). 3, 7 Let i(x) = -6x - 10. What are the prime factors of i(-8)? 2, 19 Suppose 5b = -2v + 138, 0 = -3v - 2b + 238 - 53. What are the prime factors of v? 59 Suppose -2w + 4v = -6 - 2, 4w = -2v - 34. Let i(t) = t + 10. What are the prime factors of i(w)? 2 Suppose 7s = 3s - 140. Let i = s + 50. What are the prime factors of i? 3, 5 Let m(h) be the third derivative of 5h4/24 + h3/3 + 3h2. Let s(n) = -n2 + 3n. Let r be s(2). List the prime factors of m(r). 2, 3 Let i(f) = -f2 + 10f - 1. Let j be i(11). Let r = j - -20. What are the prime factors of r? 2 Let t(o) = -o*3 + 9o2 + o - 1. Let n be t(9). Let q(z) = z3 - 10z2 + 9z + 9. Let s be q(n). List the prime factors of (-2)/5 - s/5. 3 Suppose 0 = 2w - 4y - 106, -4w + 68 = -3w - 5y. What are the prime factors of w? 43 List the prime factors of (34/4)/((-1)/(-4)). 2, 17 Let j = -6 - -1. Let m(z) = 15z - 24. Let l(p) = -4p + 7. Let q(o) = -18l(o) - 5m(o). List the prime factors of q(j). 3 Let c be (2 - 357/6)-4. Let f be (-1)/(-4) - c/(-8). Suppose -5h + x = 3x - f, -3h + 33 = -4x. List the prime factors of h. 7 Suppose 0 = -15l + 17l - 248. List the prime factors of l. 2, 31 What are the prime factors of (-1)/(0 - (-4)/(-216))? 2, 3 Suppose 280 = 5q + 5s, q - 4s = 4q - 171. What are the prime factors of q? 53 Let u be ((-15)/12)/((-2)/8). Suppose 10n = 4h + un - 20, 0 = 3n. List the prime factors of h. 5 Let j = 45 - 27. What are the prime factors of j? 2, 3 Let b(m) = m*2 + 2m - 3. Let c be b(-3). Let t = 2 + c. Suppose -4l - 3q + 22 = -29, -tl - 2q = -24. What are the prime factors of l? 3, 5 Suppose 0 = 3d + d - 708. Suppose -3h + d - 57 = 0. Suppose -5v + 3v = -h. What are the prime factors of v? 2, 5 Suppose 4m + 15 = 99. Let z = 1 - 14. Let c = m + z. What are the prime factors of c? 2 Suppose f = -110 + 308. List the prime factors of f. 2, 3, 11 Let i(g) = g3 + 34. Let r be i(0). Let s = r - 4. List the prime factors of s. 2, 3, 5 Let d(c) = -c3 - 7c*2 - 6c - 5. Let l be d(-6). Suppose g = -y - 6, 0 = -0y + 4y - 2g - 6. Let k = y - l. What are the prime factors of k? 2 Let l be -2 - 4/(-1) - -28. Let d be ((-8)/10)/((-3)/l). Suppose -2i + d + 2 = 0. List the prime factors of i. 5 Let m(r) = r*3 + 17r*2 - 24r + 32. What are the prime factors of m(-18)? 2, 5, 7 Let k be -3 - (-63)/(3/(-1)). Let p = k - -38. List the prime factors of p. 2, 7 Let r = -3 + 6. Let j be r - ((-2 - -1) + 2). Suppose -16 = -ju + 5p - 3p, -1 = -p. What are the prime factors of u? 3 Let n(b) = 19b + 16. Let c be n(6). Suppose 2q = -2k + 48, -4q - 5k = -c + 35. What are the prime factors of q? 5 Suppose 8 + 0 = 4v. Suppose -i + 10 = -v. List the prime factors of i. 2, 3 Let w(i) = i2 + 2i - 5. Let b be w(-4). Suppose 0 = -5a + bg + 94, -3g + 2g = 4a - 65. List the prime factors of a. 17 Let y be (2 + 2/(-4))2. Let x = 22 + -16. Suppose yc + 24 = xc. List the prime factors of c. 2 Suppose 4c - 20 = 0, 3c - 11 = g - 0g. Let p = g - -8. What are the prime factors of p? 2, 3 Let j = -143 + 243. What are the prime factors of j? 2, 5 Suppose -2b = 3b - 10. Let c be 1/(b/(16 + 2)). Suppose 2h - 5 = c. What are the prime factors of h? 7 Let x be (3 - 18/4)22. Let w = x - -49. What are the prime factors of w? 2 Let w = -6 + 6. Suppose 3i - 5*i + 30 = w. List the prime factors of i. 3, 5 Let d = 78 -	{ "pile_set_name": "DM Mathematics" }
-8 (base 10) to base 11 -8 Convert -2 (base 16) to base 5. -2 Convert 3a (base 15) to base 3. 2001 What is 0 (base 16) in base 7? 0 2 (base 6) to base 14 2 What is -11100 (base 2) in base 10? -28 Convert e1 (base 15) to base 11. 182 -10 (base 3) to base 11 -3 -5 (base 14) to base 16 -5 What is 1 (base 7) in base 13? 1 What is 544 (base 6) in base 3? 21201 Convert 24 (base 6) to base 8. 20 What is 0 (base 6) in base 12? 0 Convert -1 (base 15) to base 4. -1 5 (base 6) to base 9 5 Convert 8 (base 15) to base 13. 8 3 (base 5) to base 3 10 -9 (base 11) to base 14 -9 2 (base 9) to base 10 2 -19 (base 11) to base 2 -10100 Convert -104 (base 5) to base 3. -1002 What is -23 (base 9) in base 15? -16 What is -10010 (base 2) in base 16? -12 6 (base 7) to base 8 6 Convert -5 (base 10) to base 8. -5 Convert -2 (base 16) to base 8. -2 -20 (base 3) to base 2 -110 -146 (base 15) to base 9 -353 -1 (base 8) to base 16 -1 Convert -3 (base 7) to base 16. -3 20 (base 16) to base 4 200 Convert -11010000 (base 2) to base 7. -415 Convert -64 (base 14) to base 9. -107 -10 (base 5) to base 13 -5 Convert 631 (base 7) to base 4. 10330 Convert -b (base 13) to base 6. -15 Convert -11 (base 4) to base 14. -5 What is 1 (base 15) in base 2? 1 -2 (base 16) to base 7 -2 What is 2 (base 16) in base 13? 2 What is 3 (base 12) in base 2? 11 What is -6 (base 9) in base 5? -11 -3 (base 4) to base 14 -3 What is -100 (base 8) in base 10? -64 Convert -4 (base 7) to base 2. -100 Convert 30 (base 13) to base 10. 39 What is 16 (base 11) in base 9? 18 -223 (base 4) to base 11 -3a -22 (base 12) to base 10 -26 3 (base 16) to base 4 3 Convert 187 (base 12) to base 16. f7 -2 (base 15) to base 9 -2 Convert 1220 (base 5) to base 12. 135 What is -31 (base 10) in base 13? -25 -1 (base 11) to base 6 -1 What is -1 (base 7) in base 13? -1 What is 2133 (base 4) in base 11? 135 -112 (base 5) to base 13 -26 56 (base 10) to base 4 320 What is 3 (base 11) in base 14? 3 What is -19 (base 14) in base 4? -113 Convert -20 (base 3) to base 6. -10 -3 (base 5) to base 13 -3 What is -67 (base 10) in base 6? -151 What is -4 (base 9) in base 6? -4 Convert 4 (base 9) to base 3. 11 Convert -110 (base 2) to base 5. -11 1221 (base 3) to base 11 48 36 (base 14) to base 15 33 What is 43 (base 14) in base 2? 111011 What is -3 (base 15) in base 8? -3 Convert -311 (base 6) to base 2. -1110011 a0 (base 11) to base 8 156 10 (base 7) to base 9 7 -231 (base 12) to base 16 -145 -1 (base 7) to base 13 -1 Convert -4 (base 14) to base 13. -4 What is 4 (base 13) in base 2? 100 1 (base 2) to base 12 1 What is 1342 (base 5) in base 3? 22020 Convert 1 (base 4) to base 14. 1 What is 129 (base 10) in base 13? 9c Convert -2a (base 11) to base 12. -28 What is 131 (base 7) in base 6? 155 What is -12 (base 3) in base 6? -5 What is 24 (base 11) in base 10? 26 8c (base 13) to base 12 98 6e (base 15) to base 5 404 Convert -2 (base 6) to base 7. -2 Convert -14 (base 6) to base 13. -a What is 14 (base 5) in base 15? 9 What is 32 (base 8) in base 5? 101 What is 3 (base 15) in base 13? 3 Convert 8 (base 12) to base 10. 8 Convert -12 (base 7) to base 8. -11 5 (base 7) to base 15 5 What is -23 (base 6) in base 12? -13 2 (base 10) to base 13 2 What is -3 (base 16) in base 6? -3 What is -2a (base 13) in base 2? -100100 -11 (base 4) to base 2 -101 What is -43 (base 12) in base 6? -123 -110 (base 2) to base 6 -10 Convert 1 (base 7) to base 15. 1 What is -45 (base 8) in base 7? -52 17 (base 11) to base 4 102 Convert 15 (base 6) to base 15. b What is -41 (base 9) in base 12? -31 2 (base 16) to base 5 2 -1 (base 12) to base 4 -1 What is -2a (base 11) in base 9? -35 What is -4 (base 5) in base 15? -4 43 (base 13) to base 10 55 What is 57 (base 9) in base 15? 37 -234 (base 5) to base 6 -153 Convert 320 (base 5) to base 9. 104 -10 (base 7) to base 2 -111 Convert 2 (base 12) to base 2. 10 What is -7 (base 15) in base 11? -7 a (base 16) to base 11 a What is 3 (base 13) in base 10? 3 Convert 112 (base 13) to base 2. 10111000 -344 (base 6) to base 10 -136 Convert -2 (base 13) to base 11. -2 3c (base 14) to base 3 2000 What is -14 (base 16) in base 15? -15 What is -1 (base 15) in base 12? -1 5 (base 6) to base 9 5 1220 (base 3) to base 11 47 What is 1 (base 7) in base 4? 1 9 (base 12) to base 3 100 Convert 203 (base 4) to base 2. 100011 Convert 6 (base 9) to base 14. 6 -8 (base 16) to base 8 -10 What is 11001101 (base 2) in base 14? 109 What is -1 (base 8) in base 16? -1 -6 (base 15) to base 3 -20 -1 (base 9) to base 4 -1 8 (base 14) to base 6 12 What is -153 (base 7) in base 8? -127 26 (base 16) to base 12 32 11111111 (base 2) to base 16 ff -48 (base 14) to base 15 -44 -2 (base 11) to base 8 -2 Convert 87 (base 9) to base 6. 211 Convert 10 (base 3) to base 8. 3 Convert -12 (base 3) to base 14. -5 What is -122 (base 8) in base 2? -1010010 Convert 243 (base 5) to base 4. 1021 What is 43 (base 7) in base 2? 11111 Convert 8 (base 10) to base 6. 12 Convert -33 (base 16) to base 9. -56 What is 21 (base 6) in base 15? d -12 (base 13) to base 11 -14 Convert 230 (base 7) to base 8. 167 2 (base 7) to base 9 2 What is 1101 (base 5) in base 6? 411 Convert -3 (base 12) to base 15. -3 -8b (base 13) to base 12 -97 -107 (base 10) to base 2 -1101011 -2021 (base 3) to base 4 -331 Convert -10 (base 4) to base 9. -4 Convert -311 (base 5) to base 3. -10000 1001 (base 2) to base 7 12 31 (base 4) to base 16 d What is 1 (base 12) in base 16? 1 What is 8 (base 9) in base 14? 8 Convert -31 (base 10) to base 11. -29 Convert 53 (base 7) to base 2. 100110 Convert -1 (base 8) to base 5. -1 Convert 7 (base 16) to base 8. 7 Convert -11 (base 2) to base 3. -10 -37 (base 12) to base 10 -43 0 (base 3) to base 11 0 Convert c (base 14) to base 5. 22 Convert 0 (base 4) to base 8. 0 What is 1 (base 2) in base 15? 1 What is 2 (base 13) in base 16? 2 Convert -8 (base 14) to base 3. -22 Convert -302 (base 5) to base 10. -77 What is 2 (base 15) in base 10? 2 What is -1 (base 16) in base 9? -1 -137 (base 11) to base 12 -115 ab (base 16) to base 11 146 Convert 433 (base 8) to base 2. 100011011 Convert 3 (base 10) to base 12. 3 Convert 210 (base 3) to base 5. 41 What is 1112 (base 3) in base 9? 45 0 (base 15) to base 11 0 Convert 1 (base 9) to base 8. 1 1a1 (base 11) to base 15 107 What is 1 (base 7) in base 12? 1 Convert 1010 (base 2) to base 5. 20 Convert -37 (base 16) to base 3. -2001 What is 3 (base 16) in base 14? 3 Convert -2 (base 7) to base 15. -2 11 (base 7) to base 2 1000 What is 21 (base 16) in base 12? 29 42 (base 13) to base 3 2000 Convert 0 (base 4) to base 12. 0 What is -2 (base 14) in base 13? -2 Convert -22 (base 15) to base 13. -26 Convert 12 (base 4) to base 8. 6 What is -b (base 14) in base 13? -b Convert -3310 (base 4) to base 7. -466 Convert 21 (base 4) to base 2. 1001 Convert 144 (base 11) to base 3. 20021 Convert -15 (base 14) to base 6. -31 Convert -1011011 (base 2) to base 16. -5b 33 (base 8) to base 5 102 What is 19 (base 11) in base 7? 26 Convert -5 (base 7) to base 15. -5 What is 0 (base 12) in base 13? 0 Convert -4 (base 7) to base 6. -4 -50 (base 16) to base 8 -120 -16 (base 11) to base 15 -12 What is -19 (base 10) in base 5? -34 Convert 22 (base 15) to base 9. 35 What is -8 (base 12) in base 5? -13 What is 0 (base 5) in base 13? 0 -19 (base 16) to base 4 -121 9 (base 16) to base 4 21 Convert -7 (base 10) to base 15. -7 Convert -44 (base 5) to base 11. -22 What is -212 (base 4) in base 3? -1102 What is 16 (base 14) in base 4? 110 What is -193 (base 10) in base 16? -c1 What is 3 (base 16) in base 12? 3 10 (base 4) to base 2 100 Convert 0 (base 9) to base 11. 0 1 (base 13) to base 11 1 23 (base 6) to base 9 16 What is 10 (base 10) in base 14? a Convert -9 (base 13) to base 5. -14 -15 (base 10) to base 11 -14 Convert 5 (base 12) to base 8. 5 What is -1001 (base 4) in base 7? -122 Convert -4 (base 11) to base 15. -4 Convert -282 (base 11) to base 9. -408 What is -2 (base 7) in base 5? -2 Convert 26 (base 8) to base 2. 10110 -1100010 (base 2) to base 13 -77 10 (base 2) to base 16 2 -104 (base 5) to base 7 -41 What is 3a (base 13) in base 2? 110001 Convert 10110000 (base 2) to base 3. 20112 20 (base 4) to base 9 8 11000 (base 2) to base 11 22 Convert -11 (base 4) to base 16. -5 Wh	{ "pile_set_name": "DM Mathematics" }
0388237001 rounded to six decimal places? -0.038824 Round 0.021594888 to 4 decimal places. 0.0216 What is -0.132436147 rounded to 2 decimal places? -0.13 What is -0.0211523819 rounded to 2 decimal places? -0.02 What is -430443.915 rounded to the nearest 10000? -430000 What is 330057047 rounded to the nearest ten thousand? 330060000 Round 9063719000 to the nearest one million. 9064000000 What is -46916.94702 rounded to the nearest 1000? -47000 Round -486626.4559 to the nearest ten. -486630 What is -0.000474162065 rounded to seven decimal places? -0.0004742 What is -11219.610597 rounded to the nearest one hundred? -11200 Round -176.3720592 to one decimal place. -176.4 Round 1878.1805406 to 0 dps. 1878 Round 325016.586 to the nearest 100. 325000 What is -76358629 rounded to the nearest 1000000? -76000000 What is 0.988402067 rounded to 4 decimal places? 0.9884 Round 0.001859014 to five dps. 0.00186 What is -0.0000480021375 rounded to six dps? -0.000048 Round 85019842.7 to the nearest 10000. 85020000 What is 578942.667 rounded to the nearest one thousand? 579000 What is -0.00002852542 rounded to six decimal places? -0.000029 What is 405974683.3 rounded to the nearest 1000000? 406000000 What is 0.000040022282 rounded to five dps? 0.00004 What is -0.044357879 rounded to 2 decimal places? -0.04 What is -523381534 rounded to the nearest 1000000? -523000000 Round -29.0576548 to two dps. -29.06 Round -1027333110 to the nearest one million. -1027000000 Round -0.0688499897 to three decimal places. -0.069 Round -1.2906529037 to 1 dp. -1.3 Round 1286.47659 to the nearest one thousand. 1000 What is 0.002566325454 rounded to 4 dps? 0.0026 What is 2006.811886 rounded to 1 decimal place? 2006.8 Round 4.108138588 to 1 decimal place. 4.1 Round -68561.17111 to 0 decimal places. -68561 What is 4894341.72 rounded to the nearest 1000000? 5000000 Round 0.0000186148653 to 5 decimal places. 0.00002 Round 18855.83227 to the nearest one thousand. 19000 Round 0.05336601 to two decimal places. 0.05 Round -60161020.5 to the nearest one thousand. -60161000 Round 21.8693477 to 3 dps. 21.869 Round -0.535912092 to two dps. -0.54 What is -0.00000796895776 rounded to seven dps? -0.000008 Round -30959215.06 to the nearest one hundred thousand. -31000000 Round 0.0000928301039 to four dps. 0.0001 Round 0.00212375811 to 6 dps. 0.002124 Round 956.882 to the nearest one hundred. 1000 Round -336.8573475 to the nearest integer. -337 Round 0.107679488 to two dps. 0.11 Round -0.00120577021 to 6 dps. -0.001206 Round -8501.72 to the nearest one hundred. -8500 What is -56.97414458 rounded to two decimal places? -56.97 Round 181075737.9 to the nearest 1000000. 181000000 Round 713391.445 to the nearest one hundred thousand. 700000 What is -69235306.65 rounded to the nearest ten thousand? -69240000 What is -801072.95 rounded to the nearest 100? -801100 What is -1.995404 rounded to the nearest 100? 0 What is -347.40601 rounded to 1 dp? -347.4 Round 2574.81391 to zero dps. 2575 Round -210.098254 to 0 dps. -210 What is 12341.0208 rounded to the nearest 1000? 12000 What is 291.006224 rounded to the nearest 10? 290 What is -0.256168965 rounded to four dps? -0.2562 Round 1683.6303 to the nearest 100. 1700 Round -1647.16615 to the nearest integer. -1647 Round 0.00000153710429 to six decimal places. 0.000002 What is -19512018.9 rounded to the nearest ten thousand? -19510000 Round -0.00017954521 to four dps. -0.0002 Round -0.01004282661 to 4 decimal places. -0.01 Round -21553.502 to the nearest one hundred. -21600 What is -23959684.5 rounded to the nearest 1000000? -24000000 What is -0.00023738346 rounded to seven decimal places? -0.0002374 Round 0.00045608849 to 7 decimal places. 0.0004561 Round -13.07627037 to the nearest ten. -10 Round -0.000010855133 to seven decimal places. -0.0000109 What is -4050847.06 rounded to the nearest one hundred thousand? -4100000 What is 9366367.04 rounded to the nearest one hundred thousand? 9400000 What is 19971713 rounded to the nearest 100000? 20000000 Round -3236.601512 to the nearest 100. -3200 What is 8.32832762 rounded to 3 dps? 8.328 Round 1168.76768 to the nearest integer. 1169 What is -0.140515292 rounded to 3 decimal places? -0.141 Round 0.045635038 to 3 decimal places. 0.046 What is 85462.5536 rounded to the nearest 1000? 85000 What is -26.044003939 rounded to 4 dps? -26.044 What is 0.09348699 rounded to 1 decimal place? 0.1 What is 1068.5571262 rounded to the nearest one hundred? 1100 Round -2231795744.1 to the nearest ten thousand. -2231800000 What is 0.0000728239035 rounded to six dps? 0.000073 Round -0.00143628123 to 6 decimal places. -0.001436 What is 8379446.25 rounded to the nearest one million? 8000000 Round -132.5476 to 2 dps. -132.55 Round 237862.8 to the nearest one thousand. 238000 What is 0.3991152714 rounded to two dps? 0.4 What is 0.001819600608 rounded to 3 dps? 0.002 Round 1511.178207 to the nearest one hundred. 1500 Round -448.14758 to 1 decimal place. -448.1 Round 2.049879503 to 1 dp. 2 Round 0.7869694474 to 4 dps. 0.787 Round -0.06368328941 to two decimal places. -0.06 What is 0.000044213153 rounded to seven dps? 0.0000442 What is -35429.194 rounded to the nearest one hundred? -35400 What is -0.0010687713 rounded to 3 decimal places? -0.001 What is 5613.40436 rounded to the nearest 10? 5610 What is -0.761304396 rounded to one dp? -0.8 What is 130.882712 rounded to the nearest integer? 131 What is 4.9466236 rounded to three decimal places? 4.947 Round -0.01071889886 to six dps. -0.010719 What is -27853.04 rounded to the nearest ten thousand? -30000 Round 3337209170 to the nearest 1000000. 3337000000 What is 0.00500506812 rounded to 6 decimal places? 0.005005 What is 4018.34285 rounded to the nearest 100? 4000 What is -0.03264203442 rounded to four dps? -0.0326 What is -3529797.679 rounded to the nearest ten thousand? -3530000 What is -2.62272489 rounded to three dps? -2.623 What is 1987.8327928 rounded to the nearest ten? 1990 Round 12.9810193 to two decimal places. 12.98 What is -0.026304211 rounded to 2 decimal places? -0.03 What is 13894.30542 rounded to zero dps? 13894 What is -18124420.06 rounded to the nearest one hundred thousand? -18100000 Round -4025005700 to the nearest one million. -4025000000 Round -9734280959 to the nearest 1000000. -9734000000 What is -0.000721542905 rounded to 7 dps? -0.0007215 Round 174083.27268 to the nearest ten thousand. 170000 What is -1316.1134 rounded to the nearest 1000? -1000 Round 0.000314276144 to six dps. 0.000314 What is -0.00000256011499 rounded to seven dps? -0.0000026 Round -0.0002378388323 to 5 dps. -0.00024 Round -0.000139854431 to six dps. -0.00014 Round 166568027200 to the nearest one million. 166568000000 What is 3846016.45 rounded to the nearest ten thousand? 3850000 What is -7595499700 rounded to the nearest 1000000? -7595000000 What is -2.86877177 rounded to two dps? -2.87 What is -0.44350945 rounded to four dps? -0.4435 Round 3356372 to the nearest one hundred thousand. 3400000 What is 179589.4656 rounded to the nearest 1000? 180000 What is -617602.69 rounded to the nearest 100000? -600000 Round -2106.73883 to the nearest integer. -2107 Round -17.04997995 to 4 dps. -17.05 What is 24.69438 rounded to 1 dp? 24.7 Round -4183.473875 to one decimal place. -4183.5 What is -1259287.99 rounded to the nearest 10000? -1260000 Round -0.10784849589 to 4 decimal places. -0.1078 What is 573051.848 rounded to the nearest 100? 573100 Round -0.06792764859 to 2 decimal places. -0.07 What is 0.0080580371 rounded to 5 dps? 0.00806 Round 2.523241015 to two dps. 2.52 Round -56638.37 to the nearest one hundred. -56600 What is -0.0007447744525 rounded to 4 decimal places? -0.0007 What is 1677.888652 rounded to the nearest 100? 1700 Round -3309735600 to the nearest 1000000. -3310000000 What is -0.0178445603 rounded to 3 dps? -0.018 Round 12430459.15 to the nearest 10000. 12430000 Round -0.000089081658 to 5 decimal places. -0.00009 What is 2192251.7 rounded to the nearest one hundred thousand? 2200000 Round 85.178383 to the nearest 100. 100 What is -24211.805 rounded to the nearest ten thousand? -20000 Round 20.110758 to 0 decimal places. 20 Round -1.072409227 to two decimal places. -1.07 What is -85195.418	{ "pile_set_name": "DM Mathematics" }
+ 235/4w = 0. -24, 1 Let s(b) be the second derivative of -b4/3 - 77b*3/6 - 19b*2/2 + 3b - 4. Factor s(t). -(t + 19)(4t + 1) Let h = 225 - 241. Let d be ((-6)/144)/(4/h). Solve -1/6b4 + 1/3b*3 + 0b + 0 - db2 = 0 for b. 0, 1 Let b be 5/(-2) - (-2)/(-4). Let i(h) = 11h*2 - h - 2. Let v(a) = 22a*2 + 20a*2 - 1 - 32a*2 - 1 - 2a. Let x(w) = bi(w) + 4v(w). Factor x(t). (t - 1)(7t + 2) Suppose -5i = v - 31, -2v + 3i - 2i = -7. Let d be 0/(((-9)/v)/((-2)/(-4))). Factor x - 1/2x2 + d. -x(x - 2)/2 Let b(f) = f + 9 - f - 4 - f. Let x be b(0). Determine h so that -h*2 - 8h3 + h2 + 7h4 + xh*4 = 0. 0, 2/3 Let x = -1816/13 - -140. Let 10/13j*4 + 2/13j*3 + xj - 10/13j2 - 6/13j*5 + 0 = 0. Calculate j. -1, 0, 2/3, 1 Determine o so that 39o - 2o2 - 43o*2 + 31o - o*3 + 4o*3 + 2o3 = 0. 0, 2, 7 Let w(s) be the second derivative of -s7/14 - 3s6/10 + 3s*5/5 - 2s + 42. Solve w(i) = 0. -4, 0, 1 Let a(r) be the second derivative of 5r6/6 + 7r*5/4 - 5r*4/12 - 5r*3/2 + 10r + 1. Suppose a(i) = 0. What is i? -1, 0, 3/5 Let z(y) be the third derivative of y*8/42 + 421y*7/735 + 247y*6/140 - 2y*5/105 - 13y*4/21 - 179y*2. Find l such that z(l) = 0. -13, -2, -2/7, 0, 1/4 Let o be 9 + (1316/(-120) - -2). Let u(y) be the second derivative of 0y*5 - 3y - oy6 + 0y*3 + 0y*2 + 0 + 0y4. Factor u(l). -l4 Let g(n) be the second derivative of n*5/5 + 5n*4/3 - 2n + 4. Suppose g(v) = 0. Calculate v. -5, 0 Let l = -4/3139 - -37696/21973. Solve 36/7 - 132/7k - 9/7k*4 + lk*3 + 69/7k*2 = 0 for k. -3, 1/3, 2 Suppose 3 - 3g*2 + 0g*2 - 9g - 6 - 3 = 0. What is g? -2, -1 Suppose 0 = 31k - 29k - 4. Suppose -kj - 32 = -10j. Let -27nj + 19n - 10 + 4 + 2n - 8n*3 + 33n*2 - 13n*3 = 0. Calculate n. -1, 2/9, 1 Factor 201798 + 3n*4 - 201798 - 187n*3 + 10n*3. 3n*3(n - 59) Let d = -429 + 434. Let i(k) be the third derivative of 1/210kd + 0k - 3k2 + 1/21k*3 + 1/42k*4 + 0. Let i(x) = 0. What is x? -1 Let z = -26 + 29. Factor 14f - 3f - 5f - 3f2 - 3f*z. -3f(f - 1)(f + 2) Suppose 0 = -3t - 0 + 12. Suppose -2 = -p + o, 2p - 4o + t = 6. Solve 3y*2 - 3y*3 + 0y*2 + 2y*p = 0. 0, 3 Let i be (3/(-9) - 62/(-6)) + 2. Suppose 2h + 2h + 22 = n, -n + 2h = -i. Find p, given that -3/4 + 3/4pn + 0p = 0. -1, 1 Suppose 301 = -6y + 85. Let i be (-30)/9y/30. Factor 0 - 4/13f3 - 2/13f*2 + 0f - 2/13fi. -2f*2(f + 1)*2/13 Let y = -14655 - -73882/5. Let b = y - 121. Factor 8/5p*2 + 0 + bp*3 + 8/5p. 2p(p + 2)*2/5 Let -16/7w + 4/7w4 - 4/7w*2 + 16/7w*3 + 0 = 0. Calculate w. -4, -1, 0, 1 Suppose 290b - 18 = -n + 289b, -3b = 0. Factor n + 22/5m2 + 2/5m*3 + 78/5m. 2(m + 3)2(m + 5)/5 Let q = -438 + 231. Let b = q - -210. Factor 0w + 0 - 1/4w*b - 1/4w2. -w2(w + 1)/4 Find a such that -8/3a*2 + 0 + 2a*3 + 8/9a = 0. 0, 2/3 Let c(v) = v. Let w(i) = 3i2 - 18i + 12. Let g be (21/28)/(2/32). Suppose -j - g = j. Let q(o) = jc(o) - w(o). Factor q(f). -3(f - 2)*2 Let j be -1 + 4/((-252)/(-93)). Let v = 8/7 - j. Suppose -2/3c*5 + 2/3c*3 + 0 + 0c - 2/3c4 + vc*2 = 0. Calculate c. -1, 0, 1 Let j(y) = -16y + 787. Let d be j(49). Let 1/2 - 1/2p2 - 1/2p*d + 1/2p = 0. Calculate p. -1, 1 Let x = 7702/187 - 694/17. What is i in 0i3 - xi*2 + 0 + 0i + 1/11i4 = 0? -2, 0, 2 Let m(t) be the first derivative of -t3/3 + 7t*2/2 + 8t + 33. What is d in m(d) = 0? -1, 8 Let i(u) be the third derivative of 18u2 + 0u*6 + 0u - 1/105u7 + 0 + 1/252u*8 + 0u*3 + 1/90u*5 + 0u*4. Suppose i(q) = 0. Calculate q. -1/2, 0, 1 Let k(z) = 3z*2 - 3z + 6. Let u be k(5). Suppose -3h - 82 = -5f, 3h - 2h = -5f + u. Factor 2p + 52p4 - fp*5 - 68p*3 + 32p*2 - 32 + 16 + 12. -2(p - 1)*4(7p + 2) Let b be (-56)/7 + (-2 - 1). Let y be (12 + b)13. What is w in -yw*4 - 4w*5 + 0w4 - w4 = 0? -1, 0 Let y be (-12)/(-22) - (-102)/(-187). Let o(x) be the third derivative of -1/300x5 + 0 - 1/30x*3 - 1/60x*4 - 4x*2 + yx. Factor o(c). -(c + 1)*2/5 Factor -96/11 + 16/11y + 2/11y2. 2(y - 4)(y + 12)/11 Solve 4y*2 + 36 - 21y + 27y + 16y - 2y2 = 0. -9, -2 Let a(k) be the second derivative of k7/135 + k6/108 - k5/135 - 12k*2 + 29k. Let z(m) be the first derivative of a(m). Determine u so that z(u) = 0. -1, 0, 2/7 Let j(g) be the first derivative of g8/84 - g6/30 - 16g2 - 8. Let o(x) be the second derivative of j(x). Factor o(t). 4t*3(t - 1)(t + 1) Let k(y) = 7y*5 - 36y*4 + 245y*3 + 298y*2 + 5y. Let b(v) = 10v5 - 55v*4 + 367v*3 + 446v*2 + 7v. Let d(a) = -5b(a) + 7k(a). Factor d(o). -o*2(o - 12)*2(o + 1) Let m = -28 - -86/3. Let k(x) be the first derivative of 2/5x5 + 1/3x*6 - 1/2x*4 - 4 + 0x + 0x2 - mx*3. Determine f, given that k(f) = 0. -1, 0, 1 Let b be 1/(-1 + 0 - 31/(-30)). Let v be (15/18)/(b/18). Determine h so that 1/4h*2 + 0 + vh = 0. -2, 0 Let t(f) = -245f3 - 144f*2 - 16f + 4. Let r(o) = -o*2 + o + 1. Let c = -57 + 53. Let l(j) = cr(j) + t(j). Factor l(g). -5g(7g + 2)2 Suppose -5 = 5u - 25. Let v(q) be the second derivative of -1/30qu + 3q + 0 + 0q2 - 1/25q*5 + 2/15q*3 + 1/75q*6. Factor v(f). 2f(f - 2)(f - 1)(f + 1)/5 Let k(a) be the third derivative of 0 + 0a + 5/24a4 + 1/12a*5 - 5a*3 + 11a*2. Solve k(z) = 0. -3, 2 Let i(t) = -16t*3 + 63t*2 - 501t - 2159. Let n(l) = 9l3 - 31l*2 + 251l + 1079. Let a(y) = -4i(y) - 7n(y). What is h in a(h) = 0? -3, 19 Let b(r) be the third derivative of 1/20r5 + 0 + 1/4r*4 - 3/40r*6 + 0r + 18r2 - 1/70r*7 + 0r*3 + 1/112r*8. Factor b(h). 3h(h - 2)(h - 1)(h + 1)2 Let v be 4542/27 - 4/2. Let x = v + -166. Factor -2/9b + 2/9b3 - x + 2/9b*2. 2(b - 1)(b + 1)2/9 Let s(v) = -12v*5 - 123v*4 - 213v*3 + 15v*2 + 54v. Let c(m) = -m*4 + 2m*2. Let f(r) = 9c(r) + s(r). Suppose f(p) = 0. Calculate p. -9, -2, -1/2, 0, 1/2 Let h(k) be the first derivative of k*4/30 - 4k3/15 + k2/5 + 4k/3 - 128. Factor h(o). 2(o - 5)(o - 2)(o + 1)/15 Suppose -9 = -2c + 35. Determine w so that -12w*3 + 2 - 16w*2 - 8 + cw*2 - 15w*2 + 27w = 0. -2, 1/4, 1 Let n(k) be the third derivative of -k8/20160 - k7/5040 + 13k5/60 + 2k*2. Let g(x) be the third derivative of n(x). Factor g(i). -i(i + 1) Factor -t*3 - 27t + 0t3 - 2t + 26t - 4t*2. -t(t + 1)(t + 3) Suppose 5l = 7l - 4, -2k + 3l = 6. Let i(y) be the third derivative of 0 + ky*3 + 0y*4 - 1/30y*5 - 1/60y*6 + 0y + y*2. Factor i(n). -2n*2(n + 1) Let l be (-13)/(-26) + 9/6. Let n be 3 + ((-4)/(-8) - l/28). Let -4/7 + nk - 3k*2 - 7k*3 = 0. What is k? -1, 2/7 Let t be -2 + 3 + 1 + 3 + -5. Find z, given that 3z*4 + 5z*2 - 3z - 8z2 + tz + z*3 + 2z*3 = 0. -1, 0, 1 Let q = 426 + -423. Let u(c) be the first derivative of -25/3c*q + 15c*2 - 9c - 7. Find g such that u(g) = 0. 3/5 Let z(w) = w*2 - 4w - 5. Let l be ((-1)/(-3))/(3/63). Let h be z(l). Factor -j + j - 88j2 - 18j*4 - 38j*3 + hj + 114j3. -2j(j - 2)2(9j - 2) Let n(z) be the first derivative of -z7/168 + 7z*5/24 - 5z*4/4 - 4z*3/3 - 34. Let l(r) be the third derivative of n(r). Suppose l(y) = 0. What is y? -3, 1, 2 Let r be (-1)/((-208)/64 + (-5)/(-20)). What is n in 1 - 2/3n - rn2 = 0? -3, 1 Suppose 6 = -2k + l + 3l, 2k - 3l = -2. Determine n, given that -393n*4 - 5n*3 - 2n*5 + 383n*4 - 3n*k = 0. -1, 0 Let w be -4(-2 + 1)(-5)/4. Let n(v) = -11v*2 + 40v - 21. Let f(l) = -72l2 + 260l - 136. Let o(s) = wf(s) + 32n(s). Factor o(h). 4(h - 2)(2h - 1) Let d(r) be the third derivative of -r6/450 + r5/75 - r4/30 - 7r*3/2 - 10r*2. Let q(c) be the first derivative of d(c). Find x, given that q(x) = 0. 1 Factor 0 + 2l + 9/2l2 + 1/2l*4 + 3l*3. l(l + 1)*2(l + 4)/2 Let i = 321 + -319. Let d(n) be the second derivative of -1/22n4 + 6n + 4/11ni + 13/110n*5 + 0 - 4/165n*6 - 16/33n3. Find c, given that d(c) = 0. -1, 1/4, 2 Let t = 177 - 174. Let f(u) be the first derivative of -9 + u2 - 1/9u3 - tu. Suppose f(m) = 0. What is m? 3 Suppose 4*f = 2	{ "pile_set_name": "DM Mathematics" }
late prob of picking 1 j and 1 k when two letters picked without replacement from {y: 1, n: 3, d: 2, k: 3, b: 1, j: 5}. 1/7 Calculate prob of picking 1 j and 1 m when two letters picked without replacement from ajjqjxm. 1/7 What is prob of picking 2 t and 2 w when four letters picked without replacement from wetewqwxewtxwe? 10/1001 What is prob of picking 1 a and 1 f when two letters picked without replacement from {u: 5, f: 1, d: 1, a: 13}? 13/190 Calculate prob of picking 1 m and 1 x when two letters picked without replacement from {w: 7, m: 4, o: 2, x: 5}. 20/153 Two letters picked without replacement from {v: 1, y: 1, j: 2, f: 2, r: 1, g: 1}. Give prob of picking 1 v and 1 y. 1/28 Calculate prob of picking 1 u and 1 n when two letters picked without replacement from {u: 4, n: 1, s: 5}. 4/45 Calculate prob of picking 1 l and 1 k when two letters picked without replacement from klkkklklu. 5/12 Four letters picked without replacement from eteietwleliwivlt. Give prob of picking 1 e, 2 i, and 1 w. 6/455 What is prob of picking 2 z and 1 l when three letters picked without replacement from {l: 1, o: 2, z: 4}? 6/35 What is prob of picking 2 j when two letters picked without replacement from {n: 1, t: 1, j: 2, a: 1, w: 2}? 1/21 Two letters picked without replacement from ggwz. What is prob of picking 1 w and 1 z? 1/6 Three letters picked without replacement from {k: 7, c: 6}. What is prob of picking 2 k and 1 c? 63/143 Two letters picked without replacement from xxmmx. What is prob of picking 1 m and 1 x? 3/5 Two letters picked without replacement from {c: 1, m: 1, j: 1, f: 2}. What is prob of picking 1 j and 1 f? 1/5 What is prob of picking 2 z when two letters picked without replacement from {z: 3, m: 1}? 1/2 Three letters picked without replacement from {j: 2, g: 6, e: 6, k: 4}. What is prob of picking 2 g and 1 e? 15/136 Two letters picked without replacement from {c: 1, f: 1, v: 2, l: 4, s: 3, q: 1}. Give prob of picking 1 v and 1 f. 1/33 Four letters picked without replacement from {e: 9, x: 3}. What is prob of picking 1 e and 3 x? 1/55 Calculate prob of picking 1 t and 1 r when two letters picked without replacement from tgrgtgrtgrrtgtg. 4/21 Calculate prob of picking 1 t and 1 n when two letters picked without replacement from nintxnnnwnintt. 3/13 Calculate prob of picking 3 x when three letters picked without replacement from dxddddddddddxdddddd. 0 Four letters picked without replacement from ddddddd. What is prob of picking 4 d? 1 What is prob of picking 3 g when three letters picked without replacement from {r: 1, g: 3}? 1/4 Calculate prob of picking 2 a when two letters picked without replacement from {a: 2, w: 2, h: 1}. 1/10 Calculate prob of picking 1 o and 1 x when two letters picked without replacement from {x: 6, g: 10, o: 2}. 4/51 Three letters picked without replacement from {g: 9, x: 4, s: 2, c: 4, m: 1}. Give prob of picking 1 m and 2 s. 1/1140 Calculate prob of picking 2 k when two letters picked without replacement from klkbtb. 1/15 What is prob of picking 1 b and 2 m when three letters picked without replacement from {h: 3, r: 1, b: 3, m: 5}? 3/22 Calculate prob of picking 2 q and 1 m when three letters picked without replacement from mmmqqqqmmmqqq. 63/143 Two letters picked without replacement from {y: 2, e: 1}. What is prob of picking 1 e and 1 y? 2/3 Four letters picked without replacement from {y: 2, x: 14, l: 1}. What is prob of picking 1 x, 2 y, and 1 l? 1/170 Three letters picked without replacement from aaabttbiatiittt. Give prob of picking 2 t and 1 i. 9/91 Calculate prob of picking 1 m, 1 u, and 1 v when three letters picked without replacement from {v: 1, m: 2, u: 1, j: 2, k: 2}. 1/28 Two letters picked without replacement from {s: 3}. What is prob of picking 2 s? 1 Calculate prob of picking 1 w, 1 n, and 2 b when four letters picked without replacement from wgwbjeeengwb. 1/165 What is prob of picking 1 v and 1 g when two letters picked without replacement from gttutvpgtu? 2/45 Two letters picked without replacement from tvvdfhd. Give prob of picking 1 t and 1 d. 2/21 What is prob of picking 1 h, 1 n, and 1 u when three letters picked without replacement from {u: 6, p: 3, h: 5, r: 1, n: 3}? 15/136 Calculate prob of picking 2 w when two letters picked without replacement from {z: 2, w: 3, q: 4}. 1/12 Three letters picked without replacement from {s: 2, a: 1, j: 2, e: 2, w: 1, y: 1}. Give prob of picking 1 j, 1 y, and 1 s. 1/21 What is prob of picking 2 z when two letters picked without replacement from {z: 9, d: 7}? 3/10 Three letters picked without replacement from {s: 12, b: 3}. What is prob of picking 3 s? 44/91 Three letters picked without replacement from {o: 11, l: 2, s: 1, w: 1, u: 1}. Give prob of picking 1 w, 1 l, and 1 s. 1/280 Two letters picked without replacement from wxodduddx. Give prob of picking 1 x and 1 o. 1/18 Three letters picked without replacement from rorrhhar. What is prob of picking 1 r, 1 h, and 1 o? 1/7 Calculate prob of picking 3 a when three letters picked without replacement from {i: 2, l: 3, a: 5}. 1/12 Two letters picked without replacement from fvzvvyfffvvfzvvffzzf. What is prob of picking 1 v and 1 z? 14/95 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from oprpcrcpcpocp. 4/39 What is prob of picking 1 r and 1 n when two letters picked without replacement from mymnynyrjn? 1/15 Calculate prob of picking 1 n and 2 i when three letters picked without replacement from {n: 4, i: 2, t: 4}. 1/30 Two letters picked without replacement from {o: 2, l: 6}. What is prob of picking 2 l? 15/28 What is prob of picking 3 v when three letters picked without replacement from {v: 4, b: 3}? 4/35 Two letters picked without replacement from {q: 2, o: 2, w: 8}. What is prob of picking 2 o? 1/66 Two letters picked without replacement from rgrbgrr. What is prob of picking 1 r and 1 b? 4/21 Calculate prob of picking 2 w when two letters picked without replacement from {s: 7, w: 3}. 1/15 What is prob of picking 2 t when two letters picked without replacement from tftaafftttf? 2/11 Calculate prob of picking 3 o and 1 p when four letters picked without replacement from {a: 4, n: 3, o: 3, t: 6, p: 4}. 4/4845 Four letters picked without replacement from {k: 3, n: 4}. What is prob of picking 4 n? 1/35 Two letters picked without replacement from ffhhhahfhf. What is prob of picking 1 a and 1 f? 4/45 Two letters picked without replacement from eqeeeeeeqeeeqeqeeee. Give prob of picking 1 e and 1 q. 20/57 Calculate prob of picking 2 e when two letters picked without replacement from eejeeeeeejeeeeeeeeee. 153/190 Three letters picked without replacement from {j: 3, b: 4, n: 1, q: 4, c: 3, y: 5}. What is prob of picking 2 q and 1 y? 1/38 Calculate prob of picking 1 e and 2 m when three letters picked without replacement from mmeewep. 3/35 Three letters picked without replacement from qxtjjtxxjjmjjjx. Give prob of picking 1 t, 1 m, and 1 q. 2/455 Four letters picked without replacement from eennenerne. Give prob of picking 3 e and 1 r. 1/21 Two letters picked without replacement from {v: 1, a: 8, j: 5, r: 4}. What is prob of picking 1 a and 1 j? 40/153 Four letters picked without replacement from {v: 2, k: 6}. What is prob of picking 4 k? 3/14 Two letters picked without replacement from {r: 3, q: 10, c: 2}. What is prob of picking 2 q? 3/7 Two letters picked without replacement from vkbhc. Give prob of picking 1 k and 1 v. 1/10 Calculate prob of picking 1 u and 1 x when two letters picked without replacement from qqqqxquuqxqqxqqxqxq. 10/171 Three letters picked without replacement from {x: 3, g: 7}. What is prob of picking 3 x? 1/120 Calculate prob of picking 1 i, 1 c, and 1 n when three letters picked without replacement from {i: 1, p: 1, t: 5, n: 2, c: 3}. 3/110 Four letters picked without replacement from {e: 4, z: 8, s: 1, w: 2}. What is prob of picking 1 e, 1 z, 1 w, and 1 s? 64/1365 Two letters picked without replacement from {r: 9}. What is prob of picking 2 r? 1 Calculate prob of picking 2 k when two letters picked without replacement from mmzfkfkfmfk. 3/55 Three letters picked without replacement from {m: 7, l: 3, y: 2}. Give prob of picking 2 y and 1 l. 3/220 Two lette	{ "pile_set_name": "DM Mathematics" }
be (-2 + 32/12)3. Suppose -3o - 14 + 6 = -5a, -3a = -vo - 4. Calculate the remainder when 50 is divided by 3/6 + 66/o. 16 Let u be (-6)/(-18) - 46/(-6). Suppose ua - 5a = 9. Calculate the remainder when (2/(-3))/((-1)/6) is divided by a. 1 Suppose -10q = -12q + 10. Let h = 347 - 338. Calculate the remainder when h is divided by q. 4 Let h(x) = x3 + 7x*2 + 3x - 11. Suppose 4c + 5p - 26 = 0, -5p = -c + 2c + 1. Let g = -15 + c. Calculate the remainder when 26 is divided by h(g). 5 Suppose 0 = 5r - 4d - 657, -54r + 53r + 139 = 3d. Calculate the remainder when r is divided by 17. 14 Let l = 57 - 35. Suppose x - 36 = -2x. What is the remainder when l is divided by x? 10 Suppose 397 + 1089 = -2o. Let p = o - -507. Let s = -151 - p. Calculate the remainder when s is divided by 22. 19 Let o = 50 - 46. Let v(p) = 52p - 10. Calculate the remainder when v(o) is divided by 40. 38 Suppose -3x + 12 = -3z, 4x = -7z + 3z + 56. Let r(b) = b3 - 9b*2 + 9b - 4. What is the remainder when r(x) is divided by 8? 5 Let l = 1860 - 871. What is the remainder when l is divided by 90? 89 Suppose -b = -0 - 124. Suppose b = -0q + 4q. What is the remainder when 122 is divided by q? 29 Let a(o) = -o*3 + 11o*2 - 9o - 10. Let z be a(10). Suppose -3w - 13 + 67 = z. Calculate the remainder when (5/1)/(12/84) is divided by w. 17 What is the remainder when (-3 + 10 + -15)(-29)/2 is divided by 12? 8 Let o be -1271 - (2 + 0). What is the remainder when (18/(-6))/(9/o) is divided by 22? 21 Let z = 618 - 324. What is the remainder when z is divided by 11? 8 Suppose 4x + c = 601, -x + 3c - 6c + 142 = 0. Calculate the remainder when x is divided by 9. 7 Let w = -14 - -20. Let b be (14/42)/((-2)/6). What is the remainder when w is divided by ((-3)/(-2) + b)6? 0 Let m(q) = 18q + 39. Calculate the remainder when 82 is divided by m(-1). 19 Let q = -2398 + 2425. Let k = 23 - 12. Calculate the remainder when q is divided by k. 5 Let j(y) = 6 - 3y - y + 5y. Suppose -24w - 65 = -29w. Calculate the remainder when j(w) is divided by 7. 5 Suppose -c + 692 + 1755 = 5q, 0 = -5q - 3c + 2441. What is the remainder when q is divided by 25? 15 Suppose -3l - 84 = -222. Calculate the remainder when 159 is divided by l. 21 Suppose 4j = -3x - 2x + 5, j = -2x + 2. Suppose n + n - 14 = j. Calculate the remainder when n is divided by 2 + (3 - (0 + 1)). 3 Let f(t) = -t*2 + 6t - 2. Let b(k) = 5k - 1. Let l be b(1). Let q = 20 + -9. What is the remainder when q is divided by f(l)? 5 Calculate the remainder when (-55 + 54/3)/((-1)/7) is divided by 83. 10 What is the remainder when (-218)/(-4) + 35/70 is divided by 28? 27 Let b = 103 - 19. Suppose 4i - b = -16. Suppose 2p + 13 = -3t + 4t, 5t - 5p = 50. Calculate the remainder when i is divided by t. 3 Suppose 5 = -2f + 4b - 7, -2f - 10 = -3b. Let m be 2/4f - -1. Suppose -p - 4p = -3r - 58, -4r + 16 = m. Calculate the remainder when 26 is divided by p. 12 Suppose 2g - 1 = 5g + 4p, -2p - 3 = -g. What is the remainder when 2 is divided by g? 0 Let a(i) = 2i*2 + 41i + 295. What is the remainder when 593 is divided by a(-10)? 83 Let s = 43 - 31. Let a = 14 + -4. Suppose 45 - a = 5d. Calculate the remainder when s is divided by d. 5 Let j(k) = k2 - k + 68. Let x be j(0). Suppose 10 = 6u - x. What is the remainder when 25 is divided by u? 12 Let g = -238 - -262. Calculate the remainder when 455 is divided by g. 23 Suppose 4i - 15 = 3z, 0 + 4 = -4z. Suppose -i = 2t + t, -16 = -3x + t. Suppose x = 3h - 4. What is the remainder when h is divided by 1? 0 Suppose 3z = -1 + 10, 0 = -2y - z + 11. What is the remainder when 102 is divided by y? 2 Suppose 12p + 15 = 13p. Let i = 33 - p. Let h(z) = 9z2 - 3z - 3. What is the remainder when h(3) is divided by i? 15 Suppose 22s - 365 = 141. Calculate the remainder when s is divided by 2. 1 Let n(q) = -2 + 5 + q + 1. Suppose -63u + 2592 - 573 = -186. What is the remainder when u is divided by n(8)? 11 Let b(a) = -49a + 250. Suppose -4x - x + 35 = 0. Suppose 3y + x = -5, -v - y = -9. What is the remainder when v is divided by b(5)? 3 Let h be 9/6(-4)/(-3). What is the remainder when ((-1)/(-4) + h)/(1/16) is divided by -2 + 10/23? 10 Suppose -3s + 131 + 193 = 0. Let c = -4594 - -4622. What is the remainder when s is divided by c? 24 Let i(h) = -h*3 - 5h*2 - 2h - 5. Let z be i(-5). Calculate the remainder when (z-2)/((-6)/15) is divided by -2 - 306/(-12). 12 Let f(k) be the first derivative of k*2 - 10k - 1. Let y = 2 - -1. Calculate the remainder when f(7) is divided by y. 1 Suppose -3z + 12 = 0, 2z + 48 = -4s + 6z. What is the remainder when (-4)/(-2) + (s - -13) is divided by 2? 1 Let f(o) = -7o + 5. Let q be f(-5). Let v = -31 + q. What is the remainder when 42 is divided by v? 6 Suppose w = 12r - 7r - 11, 5w - 33 = 3r. Let h = -1 + -45. Let d = h - -80. What is the remainder when d is divided by w? 7 Suppose -64 = -5h + h. Suppose 4a = -109 + 101, -3p + 131 = 2a. What is the remainder when p is divided by h? 13 Suppose 0 = 4w - 8, 5b - 103 = -3w + 4w. Let j = 30 - 30. Suppose v - 62 = -jv. What is the remainder when v is divided by b? 20 Let t(d) = d*3 - 7d*2 + 11d. Suppose 0 = -2g + 9 + 1, 2k + 5g = 37. What is the remainder when t(k) is divided by 11? 8 Let n(l) = -6l - 47. Let v(q) = -q - 1. Let k(x) = n(x) - v(x). Calculate the remainder when 70 is divided by k(-14). 22 Let j = 11 + -11. Suppose 4y + w - 250 = -jy, 0 = 5y + w - 312. What is the remainder when y is divided by 32? 30 Let q(f) = -11 - 8f - 4f3 - 9f*2 - 4f*3 + 4f*3 + 5f*3. What is the remainder when 15/666/5 is divided by q(10)? 6 Suppose 357m = 346m + 814. What is the remainder when m is divided by 60? 14 Let i = 3556 + -3473. Let f(s) = 43s3 - 1. Let r be f(1). Suppose -k + 21 = -3d - 0, r = 2k + 4d. Calculate the remainder when i is divided by k. 20 Suppose 2f = -5q - 95 + 291, 3f - 199 = -5q. Let h = q - 29. Calculate the remainder when h is divided by 5. 4 Let q(g) = -53g - 64. What is the remainder when q(-3) is divided by 7? 4 Let b = -8 + 11. Let d = 6 - b. Suppose 0 = -dv + 6v - 33. What is the remainder when 31 is divided by v? 9 Suppose 0 = -3t + 7t - 8. Suppose -24 = -4w + 2w. Calculate the remainder when -1428/(-8) - t is divided by w. 11 Suppose 15 + 1 = 2v. Let k(d) = d - 6. Let i be k(8). Suppose -ia = -0a - 58. What is the remainder when a is divided by v? 5 Suppose -432i = -415i - 272. What is the remainder when 103 is divided by i? 7 Let w = 23 + -22. Let l = 6 - w. What is the remainder when 27 is divided by l? 2 Let k(t) = t + 1. Let x be k(-2). Calculate the remainder when 71 is divided by ((8/10)/x)/(4/(-180)). 35 Suppose 133o = 138o - 695. What is the remainder when o is divided by 47? 45 Let w(t) = 850t + 5. Let b be w(1). Suppose -3h - h + i + b = 0, -3i + 217 = h. What is the remainder when h is divided by 54? 52 Let c(v) = -16v + 33. Calculate the remainder when 117 is divided by c(1). 15 Let q(p) = 5p*2 + 21p + 31. Calculate the remainder when q(16) is divided by 16. 15 Suppose 5j - 2c + 0c = 8, -j = 3c - 5. Suppose -jm - 3m + 5s = -170, 4s + 105 = 3m. Calculate the remainder when 89 is divided by m. 27 Let q be (-2 - (-10)/15)(-156 - 0). Let i = q - 38. What is the remainder when i is divided by 43? 41 Let c be 49 - 2/(7/((-63)/(-6))). Let j = c - 16. Calculate the remainder when 86 is divided by j. 26 Let s(f) = -3f - 12. Let n be s(-5). Suppose -17 = -3d - 5u, nd + 3u + 5 = 5d. Let x = 6 + d. Calculate the remainder when 38 is divided by x. 8 Let w = 434 - 290. What is the remainder when w is divided by 76? 68 Let m = 7 - 2. Suppose l - 51 = -5a + 2l, a = ml + 15. Calculate the remainder when 19 is divided by a. 9 Let l(n) = -n - 8. Let d(w) = -9. Let u(f) = -3d(f) + 4l(f). What is the remainder when u(-7) is divided by 5? 3 Suppose -13z - 76 = -479. What is the remainder when 35 is divided by z? 4 Calculate the remainder when 145 is divided by (-7303)/(-201) - (-5)/3. 31 Suppose -m - 16 = -2m. Let l(q) = -31q*3 - 2q**2 + q + 1. Let u(j) = j + 3. Let b be u(-4). What is the remainder when l(b) is divided by m? 1	{ "pile_set_name": "DM Mathematics" }
6 + 106a2 - 24a. Let p(h) be the first derivative of k(h). Factor p(j). 2j2(j - 5)(j - 1)(j + 1) Let v = 23393 + -23390. Let i(k) be the second derivative of 1/6k4 + 2k*2 - 2k + 0 - k*v. Factor i(o). 2(o - 2)(o - 1) Let t(w) = -10w + 44. Let h be t(4). Factor 16a - 11a - 8 + 12a3 + 4a*2 + 4a*h - 17a. 4(a - 1)(a + 1)*2(a + 2) Suppose 2a - 30 = -3x, -5a + 4x = -628 + 645. Factor -4332/7s - 54872/7 - 1/7s*a - 114/7s2. -(s + 38)3/7 Let i(s) be the second derivative of -s6/1260 - s5/60 - 2s3/3 - 15s*2/2 - 2s + 64. Let n(p) be the second derivative of i(p). Factor n(h). -2h(h + 7)/7 Let s be (1 - 2)3 - (-250 - -3). Suppose -sd + 245d = 2. Factor -1/7q*d + 0 + 4/7q. -q(q - 4)/7 Let q = -6 + 9. Factor 22a*2 - 5a*2 - 18a2 + aq. a*2(a - 1) Let l(c) = -2c2 + 2c + 12. Let d(z) = 3 + 11 - 13. Let r(u) = -8d(u) + l(u). Factor r(t). -2(t - 2)(t + 1) Suppose -z + 162 = -246. Let h be 4 + z/(-105) - (-8)/28. Factor 0b + hb4 + 0 + 6/5b*3 + 4/5b*2. 2b*2(b + 1)(b + 2)/5 Let a(d) be the first derivative of 0d*2 + 0d - 1/120d6 + 44/3d*3 + 14 - 1/4d*4 - 3/40d*5. Let p(s) be the third derivative of a(s). Factor p(t). -3(t + 1)(t + 2) Let h = -14/2259 + 9106/11295. Suppose 14/5d*4 - 18/5d*3 - 2d*2 + 18/5d - h = 0. What is d? -1, 2/7, 1 Let w(t) be the third derivative of 0t - 25/9t*3 + 171t*2 - 5/9t*4 - 1/720t*6 + 19/360t5 + 0. Find k such that w(k) = 0. -1, 10 Let m(k) be the first derivative of -k3/9 + 274k2/3 - 75076k/3 - 2174. Suppose m(f) = 0. Calculate f. 274 Let j(t) be the first derivative of 37 - 4/5t5 - 576t - 2t4 + 92/3t*3 + 48t*2. Factor j(u). -4(u - 3)*2(u + 4)2 Let i(s) be the third derivative of s5/180 + s4/6 + s2 + 7. Factor i(k). k(k + 12)/3 Let v = -45 + 57. Suppose 4w - v = -4d, 3d - d - w = 6. Factor i*3 - 7i + 6i2 + 2 + 0i + i - 3id. -2(i - 1)*3 Find t such that -120t + 60t3 - 3392 - 64t*3 + 132t*2 + 3136 = 0. -1, 2, 32 Let t be (-2 - (-16)/(-4)) + 22. Let l be 10/t - ((-3 - 2) + -5). Solve l + 1/2h2 - 7/2h = 0 for h. 2, 5 Suppose -3q + 32 = 8. Suppose 0 = qa - 3a - f - 15, -2f = 0. Suppose -1 - j*4 - 2j + 4 - 3 + aj2 = 0. Calculate j. -2, 0, 1 Let x(m) = 11m*3 + 77m*2 - 177m + 79. Let c(p) = p*3 - 2p. Let w(s) = -30c(s) + 3x(s). Factor w(u). 3(u - 1)2(u + 79) Let y = 942001/45 - 20933. Let r(z) be the second derivative of 1/30z4 + 0 + 25z - yz6 + 2/5z*3 - 44/75z*5 + 0z*2. Let r(a) = 0. What is a? -3/4, 0, 2/5 Let i = 5470/17871 - 52/2553. Let -iy*3 + 2/7y - 8/7y2 + 8/7 = 0. What is y? -4, -1, 1 Let w be ((-12)/(-48)-2)/((-3)/30) - 3. Factor 1/4g3 + 1/4g*w + 0 - 1/2g. g(g - 1)(g + 2)/4 Let t(x) = -x*2 - 7x + 983. Let u be t(28). Let z(m) be the first derivative of -6/5mu - 1/5m*2 - 8 + 0m - 4/5m4. Let z(s) = 0. Calculate s. -1, -1/8, 0 Let u = 25666 + -25664. What is n in 5/3 - 5/3n*u - 8n = 0? -5, 1/5 Let g be 18/(-39) + ((-189744)/(-14807) - 12). Suppose 8/17n2 - 48/17 + 46/17n - gn3 = 0. What is n? -8/3, 1, 3 Let c(o) be the first derivative of 640o + 30o3 - 224 - 400o*2 + 65/4o4 + o5. Solve c(j) = 0. -8, 1, 2 Let y(w) = w*3 + 22w*2 + 655w + 14410. Let u be y(-22). Determine g so that 0g + 0 + ug*2 - 2/7g3 = 0. 0 Let f(d) be the first derivative of d5/210 + 3d4/28 + 6d*3/7 + 5d*2 + 5d - 55. Let y(q) be the second derivative of f(q). Let y(r) = 0. Calculate r. -6, -3 Let r(h) be the second derivative of h9/15120 - h7/1260 + h*5/120 - 91h*4/12 - 87h. Let p(g) be the third derivative of r(g). Factor p(c). (c - 1)*2(c + 1)*2 Let c = 7829/183 + -2569/61. Factor -c - 50/3a*2 + 20/3a. -2(5a - 1)*2/3 Let g(b) be the first derivative of 3b*5/20 + 399b*4/8 + 17953b*3/4 + 13167b*2 + 13068b + 9174. Factor g(h). 3(h + 1)2(h + 132)2/4 Suppose -g2 - 21g - 171 + 10g + 86 - 11g = 0. What is g? -17, -5 Let c(w) be the second derivative of w6/180 - 11w4/72 - w3/2 - 2w2/3 - 314w. Determine g so that c(g) = 0. -2, -1, 4 Let y be (-2)/15 + (-1724)/(-330) + -4. Let p be (-25 + 21)1/(-2). Factor yu - 18/11 + 6/11up. 6(u - 1)(u + 3)/11 Factor 465/7f*2 - 56169/7 + 17301/7f + 3/7f3. 3(f - 3)(f + 79)2/7 Suppose -735b - 20 = -737b. Suppose -8 = -9v + b. Suppose 8j - 4j*v + 2/3j*3 - 16/3 = 0. What is j? 2 Suppose 5m - 5 = -4h + 27, h - 23 = -5m. Solve 117t - th + 24t2 - 373 - t3 + 3t3 + 35 = 0 for t. -13, 2 Let y(v) be the first derivative of -21v - 4v6 - 411/4v*4 + 222/5v*5 - 131 + 3/2v*2 + 77v*3. Let y(d) = 0. Calculate d. -1/4, 1/2, 1, 7 Determine u, given that 18257u*2 - 36453u*2 + 825u*4 + 1480u + 19071u2 + 300 - 2315u*3 - 45u5 = 0. -1/3, 2, 15 Let x(m) be the second derivative of -m4/78 + 71m3/39 - 70m*2/13 + 43m - 8. Factor x(u). -2(u - 70)(u - 1)/13 Suppose -37 = -6m + 107. Factor 24 + 16v*2 - 8v*4 + 67v - mv - 14v - 24v3 + 4v*5 + 23v. 4(v - 3)(v - 2)(v + 1)3 Let m(p) be the third derivative of 0 - 1/60p*4 - 24p*2 + 1/300p*6 + p - 1/50p*5 + 2/15p*3 + 1/525p*7. Factor m(v). 2(v - 1)*2(v + 1)(v + 2)/5 Let i(q) be the second derivative of -1/80q*5 - 25q + 0 - 5/24q3 + 1/4q*2 + 1/12q*4. Let i(n) = 0. What is n? 1, 2 Let v = 6099 - 60987/10. Let d(h) be the second derivative of -9/4h*2 - 3h + 0 + 9/8h4 + 5/2h*3 - vh5. Determine u, given that d(u) = 0. -1, 1/4, 3 Let o(l) be the third derivative of l5/15 - 9l4 - 114l*3 + 207l*2. Factor o(u). 4(u - 57)(u + 3) Let i be 464/36 - (-24 + 36). Factor -2/3m*3 + 0 + im + 2/9m4 + 0m*2. 2m(m - 2)2(m + 1)/9 Factor 1/3i2 - 10i - 175/3. (i - 35)(i + 5)/3 Let u be 4/((-60)/(-2151)) + 0/8. Let a = -143 + u. Solve 1/5t*5 - 1/5 + 2/5t*2 - at*3 + 1/5t - 1/5t4 = 0 for t. -1, 1 Let m = -72 - -74. Let s(w) = 15w*3 - 147w*2 - 213w - 53. Let k(n) = -405n3 + 3970n*2 + 5750n + 1430. Let j(v) = mk(v) + 55s(v). Factor j(u). 5(u - 11)(u + 1)(3u + 1) Let b(l) be the third derivative of 1/108l4 + 67l*2 + 1/270l*5 + 0 + 0l - 2/9l3. Let b(t) = 0. What is t? -3, 2 Let z = 58 - 113/2. Let y = -388 + 785/2. Suppose zv*2 + y + 6v = 0. Calculate v. -3, -1 Factor -39/2b2 - 75/2b + 6875/2 - 1/2b3. -(b - 11)(b + 25)2/2 Let d(o) = o3 - 9o2 - 5o - 13. Let s be d(10). Let r = s + -34. Factor 2v2 + rv*3 - 3v*4 + 2v*4 + 0v*3 - 2v3. -v2(v - 2)(v + 1) Let s = -108/6695 + 6911/13390. Suppose -29791/2 - su3 - 93/2u*2 - 2883/2u = 0. What is u? -31 Let u(v) = -445v3 - 3v*2 + 4v + 4. Let s be u(-1). Let b = s - 883/2. Factor -ba4 + 1/2a*3 - 1/2a + 0 + 1/2a2. -a(a - 1)*2(a + 1)/2 Factor -12x3 + 130x*4 - 59x*4 + 72x*2 - 75x*4. -4x*2(x - 3)(x + 6) Let m(l) = -21l - 121. Let s be m(-6). Factor -4b2 + 8b*2 + 32b2 + b3 - 6b2 - 14b - sb3. -2b(b - 7)(2b - 1) Let s(c) be the first derivative of -c4/18 + 20c*3/27 - 16c*2/9 - 2133. Factor s(k). -2k(k - 8)(k - 2)/9 Let f be (2535 + -2547)/(8(-3 - -2)). What is w in -1 - fw + 1/2w2 + 1/2w*4 + 3/2w3 = 0? -2, -1, 1 Let d(i) be the third derivative of -i7/420 + 7i6/240 - i5/15 - i4/3 - 2i*2 + 687. Factor d(r). -r(r - 4)*2(r + 1)/2 Let b(k) = 9k - 61. Let l be b(7). Factor 17t + 0t3 + 12 - 45t - 4t2 + lt*3 + 18t. 2(t - 3)(t - 1)(t + 2) Let q(y) = -y2 + 72y - 36. Let l be q(0). Let v be (26/6 + -4)l/(-5). Factor -vu - 2/5u2 - 16/5. -2(u + 2)(u + 4)/5 Let t = -707252 - -707254. Factor 69/4y*3 - 3 + 30y + 201/4yt. 3(y + 1)(y + 2)(23y - 2)/4 Let p(g) be the first derivative of -4/15g*5 + 21 + 0g - 4/9g3 - 1/2g*4 - 1/6g*2 - 1/18g6. Find w such that p(w) = 0. -1, 0 Let t(n) be the third derivative of n5/40 + 47n4/16 - 49n*3/2 - 2431n*2 - 2n. Suppose t(d) = 0. Calculate d. -49, 2 Let p(j) be the second derivative of -j*7/42 - 8j*6/15 + 2j*5 + 35j*4/6 - 13j*3/2 - 27j*2 + 127j - 6. Find t such that p(t) = 0. -18, -1, 1, 3 Let r = -276 - -287. Let c(o) be the third derivative of 1/25o5 + 0o + 0 - ro2 + 8/15o**3 + 13/	{ "pile_set_name": "DM Mathematics" }
d = 5c - 2756407, -4c + 2205119 = -107d + 102d. Is c composite? False Let i = -42472 + 114431. Is i prime? False Suppose 2r = 3 + 5, -4r = 5j - 14036. Let i = j - 1853. Suppose -i = -l + 104. Is l composite? True Suppose 5n + 76 = 226. Let y = -28 + n. Suppose -yb - 388 = -2406. Is b composite? False Let q = -2253435 - -3953512. Is q a composite number? False Let z = -280 - -282. Suppose -5b = -116 + 16. Is z + (-1102)/(-5) + 12/b a composite number? False Suppose 36b - 41b - 395890 = -r, -395893 = -r + 4b. Is r a composite number? True Let b(f) be the first derivative of 45f*2/2 + 37f + 3. Let j be -54/30-9. Is b(j) composite? False Let b(k) = 2. Let w(g) = -157g3 - g2 - 2g + 5. Let a(p) = -3b(p) + w(p). Suppose 0 = 3z + 1 + 2. Is a(z) a prime number? True Let u(z) = 238z + z3 - 17z*2 - 239z - 40z3 + 1. Is u(-4) composite? True Let b(v) = -26v + 52. Let o be b(2). Suppose 64831 = 13w - ow. Is w composite? False Let t = 90795 - 53248. Is t a prime number? True Suppose -4247o = -4250o + 159927. Is o a composite number? False Let q(l) = 791l + 17. Let x = 141 - 137. Is q(x) prime? True Let b(x) = 3x*3 - 7x*2 + 5x - 1. Let t be b(4). Is (4126/(-12)4)/((-66)/t) prime? True Suppose -33u - 137 + 137 = 0. Suppose -2a = -31 - 63. Suppose -a = -z - uz - 2w, -4w = 5z - 211. Is z a composite number? True Let k = 137273 - 20634. Is k composite? False Let u(f) be the third derivative of 2/5f*6 + 0 - 1/60f*5 + 0f - 1/6f3 + 15f*2 + 1/24f*4. Is u(1) prime? True Is 592/(-74) + (-71474)/2-1 composite? False Suppose -4l + 2t - 869 = 233, 2t = 2. Let y = l + 364. Is y a composite number? False Let c = 29630 - 13249. Is c a prime number? True Suppose 7w + 20 = -3w. Is 778/(w/7 + (-112)/(-49)) prime? True Let r(z) = 14478z*2 + 248z - 2191. Is r(9) composite? True Suppose -b + 325 - 1036 = -3o, 0 = 2b + 6. Let q(c) = 91c2. Let v be q(1). Let y = v + o. Is y prime? False Let l be (0 - 1)(1 + 2473). Suppose -3s + 5v + 3048 + 7580 = 0, s - v = 3542. Let q = l + s. Is q a prime number? False Suppose -19t - 8t = 1215. Is 9/t + 13612/10 a composite number? False Let y(z) = 3z2 - 14z + 30. Let v(q) = -2q2 + 14q - 30. Let w(m) = -4v(m) - 3y(m). Let u be w(-15). Let t(x) = 129x + 32. Is t(u) prime? False Suppose 4i = j + 883441 - 146602, -2j + 921065 = 5i. Is i composite? False Is -156/32 - (-4700291)/4 a composite number? False Suppose 48574 + 2776 = 13y. Suppose 4b - 5452 = -4v, 4v + y = 3b - 146. Suppose 416 = 4t + 2g - b, 0 = 3t - 5g - 1335. Is t a prime number? False Let k(o) = -o*3 + 12o*2 + 50o + 22. Let s be k(-15). Suppose -2b - 5r + 5397 = 2b, -4b + 5r = -s. Is b a composite number? True Let f = 2722 - 1811. Let y = 5 + 6. Is (f/3)/(y/33) a prime number? True Let p = 123173 + -68071. Is p prime? False Suppose 16028949 = 1316v - 1157v. Is v a prime number? True Let l(n) = 907n*3 + 3n*2 + n + 7. Is l(6) a composite number? False Let a = 189 + -184. Suppose -ay + 3y + 190 = 0. Is y prime? False Let z(j) = 63523j - 318. Is z(1) a composite number? True Suppose -3v + 4u = -20, 2u = -2v - 5 - 5. Suppose v = 2s + 204 - 15446. Is s a prime number? True Suppose v + 3n - 4369 - 5776 = 0, -20278 = -2v - 3n. Is v a composite number? False Suppose -17z - 20567 = 19z - 83819. Is z prime? False Suppose 5l - 1415 = 5k, 0 = 4l + k - 3k - 1130. Let v = l + 469. Let w = v + -248. Is w composite? False Suppose -a - 5946456 = -25a. Is a a prime number? True Is 181170 + ((55/10)/(-11) - 60/(-40)) a composite number? True Suppose -9k + 14k = -16505. Let m = k - -6888. Is m a prime number? False Suppose 0 = -5x + 20x + 60. Let y(l) = -13l*3 + 2l*2 - 5l + 3. Is y(x) composite? False Let f(y) = 234y3 + 3y*2 + 11y - 35. Let h be f(4). Suppose 4u + 5l - 25683 = 0, 4u - l - h - 10680 = 0. Is u a composite number? False Let l = 7697 - -3292. Let h = 38820 - l. Is h a composite number? True Let p(s) = -4s + 60. Let o be p(15). Suppose o = -16q - 2206 + 29838. Is q a prime number? False Suppose i - 3 = -m, 0 = -4m - i + 19 + 2. Suppose mx - 5295 - 1107 = 0. Is x composite? True Let v(d) = 290d - 45. Is v(4) composite? True Let b = 15272 - -173829. Is b composite? True Let p = -39 + 35. Is (20-184 - p)/(-2) a composite number? True Suppose r - 3h - 24 = -3, -h = -4r + 62. Suppose 20 = -rc + 20c. Suppose -cy + 2431 + 3261 = 0. Is y a composite number? False Let i = -154 + 150. Let u(v) = -2335v + 23. Is u(i) a prime number? False Suppose 0 = -m + 2t + 175476, -4t + 8 = -0t. Is (3/(-2))/(m/175504 + -1) a composite number? True Let y = -31310 + 58181. Let f = y + -11890. Is f a prime number? False Let i be (-48)/(-9) - (-8)/(-6). Let m(b) = -107b - 81. Let q(d) = -36d - 27. Let w(t) = im(t) - 11q(t). Is w(-22) composite? False Suppose -6k + 8224 + 4712 = 0. Suppose -j + z = 3z - k, 4j - 5z = 8572. Suppose c = -j + 6533. Is c a prime number? False Let i = 22949 - 7511. Suppose 8l - 1802 = i. Is l prime? False Let g be 5 - 2/(1 - 0). Let i be ((-4)/(-2))/(g(-4)/(-18)). Suppose -2 = -v, 5p - 7115 - 246 = -iv. Is p composite? False Suppose 0 = -5i + 20, -138i + 285389 = 3q - 139i. Is q composite? False Suppose -2m - 2i = -268952, 5m - 3m - 3i - 268987 = 0. Is m composite? True Let l(z) = -183z*3 - 4z*2 + 5z - 17. Let n be l(-5). Suppose 0 = -b - k + 3k + n, 4k = -b + 22733. Is b a prime number? False Let l be ((-3)/(-2) - 0)/(129/258). Is 7302/18 - (-4)/l prime? False Let g = -2016 + 4977. Let d = 1742 + g. Is d a prime number? True Suppose -4 = -4o, 3p = -6o + 7o + 460508. Is p a prime number? False Is 2 + (20695 - 19) - (-4 - -1) prime? True Let l(y) be the third derivative of 187y5/60 - y4/12 - 2y*3/3 - 7y*2. Let t be l(-8). Suppose 2j + q = 4789, t = 7j - 2j - 5q. Is j composite? True Let f be 1 + -2 + (1 - 8/(-2)). Suppose -4612 = -fn + 21060. Suppose n = 8s - 4774. Is s composite? False Let m = 164 + -159. Suppose -5r + 10820 = -10a + ma, 4r = a + 8659. Is r composite? True Let h be ((-18)/(-8))/(-3)-24. Let l(a) = -342 + 161a - 320 + 627. Is l(h) a composite number? True Is ((-70253480)/(-176))/(3 - 15/6) composite? True Suppose -u + 12124 = -9150. Suppose 9z - 7z = u. Is z composite? True Let q = 144209 - 81418. Is q a prime number? True Let y(f) = 45f*2 + 5f - 35. Suppose -l + 3x + 1 - 5 = 0, -2l + 22 = 4x. Is y(l) composite? True Suppose -4o - 8 = -5p - o, 4p - 5o + 4 = 0. Suppose 5u = r - pr + 7712, -5u + 10291 = 4r. Is r a prime number? True Suppose -347t - 3 = -346t. Is (t + (-55)/(-10))-2 - -3042 a prime number? True Let c(a) = -a*3 + 7a*2 + 14a + 39. Let k be c(9). Suppose -2059 = 5d - kg - 22253, -g - 20188 = -5d. Is d a composite number? True Is 3 + -26 + (434265 - 73) a composite number? True Is (15/30-536306)/(-1) prime? True Is (-1644018)/(-54) - ((-245)/2520 + (-1)/8) a composite number? True Suppose 2m = -m - 729. Let i = m - -587. Suppose 3t + 42 + i = f, 0 = 5f + 2t - 1947. Is f a prime number? True Let d(a) = -38a*3 - 8a*2 - 17a + 5. Let y be d(-6). Let r = 13528 - y. Is r prime? True Suppose 0 = -14d + 235296 + 581506. Is d composite? True Suppose -19h - 28 = -104. Is (2/h)/(3/(43690 - -8)) a prime number? True Suppose -4q - 5r = -73194, -8167 - 10132 = -q - r. Is q composite? False Let c(d) = -8811d - 3176. Is c(-17) a prime number? False Let w = -464 - -474. Suppose 0 = -2b - wb + 59964. Is b a prime number? False Suppose -n = -t - 5, -3n - 2t = -8 - 7. Suppose -3q = 2f + 2f - 22, -5q = nf - 30. Is q/2 + -3 + 1153 prime? True Let w(o) = 35o3 - 2o + 4. Let r = 28 - 26. Let k be w(r). Let q = k - -13. Is q prime? True Suppose -2t = 24 - 40. Let a be t/16 + 9/2. Suppose 728 = 4n + 2p - 1436, 2n = ap + 1094. Is n composite? True Suppose 338814 = 2x + 4n, 299x - 300x + 5n + 169379 = 0. Is x prime? True Let o = 1810 - 3125. Let c = 2194 + o. Is c composite? True Suppose 0 = -2x - 5x + 56. Suppose -2l + 79370 = xl. Is l a composite number? False Let j = -234402 - -436909. Is j a composite number? True Let l be 18/(-8) + 2 - (-90)/8. Suppose lo + 15 = 16o. Suppose -4u + 4559 = 5q - 2*u	{ "pile_set_name": "DM Mathematics" }
Is 20954 composite? True Is 147919 a prime number? True Is 5981 prime? True Is 118705 a prime number? False Is 7421439 a prime number? False Is 96353 prime? True Is 47711 composite? False Is 1382 a composite number? True Is 2539 a composite number? False Is 237563 a prime number? True Is 164701 a composite number? False Is 81331 prime? True Is 191099 composite? False Is 3907 prime? True Is 13799 a prime number? True Is 56227 composite? True Is 594857 a composite number? False Is 55109 prime? True Is 3862 a prime number? False Is 29947 a composite number? False Is 29443 prime? True Is 20783 a prime number? False Is 1883 prime? False Is 748513 composite? False Is 2809 prime? False Is 144539 a prime number? True Is 466601 a prime number? False Is 276197 a composite number? True Is 5501 prime? True Is 18757 a prime number? True Is 45941 prime? False Is 25153 a composite number? False Is 314903 composite? False Is 150063 a composite number? True Is 1813169 a prime number? False Is 71867 composite? False Is 2785 prime? False Is 7121 prime? True Is 54101 prime? True Is 3967 a prime number? True Is 85265 composite? True Is 2218751 a composite number? False Is 414157 a prime number? True Is 588277 composite? False Is 38953 a prime number? True Is 467098 prime? False Is 535 composite? True Is 16787 prime? True Is 18973 a prime number? True Is 557 prime? True Is 86035 prime? False Is 440431 composite? False Is 6509 prime? False Is 571469 prime? False Is 7039 a composite number? False Is 127 prime? True Is 454726 a prime number? False Is 865 a prime number? False Is 8257 composite? True Is 14837 composite? True Is 4835 composite? True Is 11113 prime? True Is 18269 a prime number? True Is 131611 a composite number? False Is 117853 a prime number? False Is 1425007 composite? False Is 28043 composite? True Is 714485 composite? True Is 299197 composite? False Is 336481 a composite number? True Is 1434723 a prime number? False Is 1693 composite? False Is 605923 a composite number? True Is 922451 prime? True Is 234277 a prime number? False Is 65497 a prime number? True Is 141257 a composite number? False Is 23 a composite number? False Is 3511 a composite number? False Is 992261 composite? True Is 289631 a composite number? True Is 591083 a composite number? True Is 130631 a composite number? False Is 3120803 prime? False Is 198889 a prime number? False Is 311813 a composite number? True Is 107641 composite? False Is 4711 prime? False Is 20789 a composite number? False Is 249253 a prime number? True Is 80897 prime? True Is 15187 prime? True Is 1212469 a prime number? False Is 28957 composite? True Is 9871 prime? True Is 31199 composite? True Is 95531 a prime number? True Is 244837 a prime number? True Is 500861 composite? False Is 520819 a composite number? True Is 187106 a composite number? True Is 29773 prime? False Is 3661285 a composite number? True Is 22757 composite? True Is 161947 composite? False Is 13994 a prime number? False Is 5147 prime? True Is 68959 composite? True Is 115865 a composite number? True Is 36889 a composite number? True Is 301109 a composite number? True Is 138707 a composite number? True Is 7993 a prime number? True Is 21457 a composite number? True Is 281051 prime? False Is 13267 composite? False Is 202 prime? False Is 1623 composite? True Is 71113 prime? False Is 239 a composite number? False Is 7897 a composite number? True Is 96598 a composite number? True Is 206021 composite? False Is 516899 a composite number? True Is 128697 a composite number? True Is 1543 a composite number? False Is 1195 a prime number? False Is 548083 a composite number? False Is 2721 a composite number? True Is 48131 a prime number? True Is 47543 a prime number? True Is 19645 a prime number? False Is 51163 a prime number? False Is 1219 prime? False Is 195539 prime? True Is 110221 a composite number? False Is 129031 a composite number? True Is 850991 a prime number? False Is 161 a composite number? True Is 17377 a prime number? True Is 4279 a prime number? False Is 3641 prime? False Is 116026 composite? True Is 58202 prime? False Is 18137 composite? True Is 76085 a composite number? True Is 470779 a composite number? False Is 7247 prime? True Is 58361 composite? True Is 232567 a composite number? False Is 31747 composite? True Is 1139 a prime number? False Is 24933 a composite number? True Is 26479 prime? True Is 209861 prime? True Is 35591 prime? True Is 52707 a composite number? True Is 62807 prime? False Is 586 a composite number? True Is 32066 a prime number? False Is 1439 prime? True Is 355277 composite? True Is 24061 a composite number? False Is 223282 prime? False Is 12197 prime? True Is 326 a composite number? True Is 50889 prime? False Is 38009 composite? True Is 317153 a prime number? False Is 73669 composite? True Is 698917 a composite number? True Is 234163 a prime number? False Is 12197 composite? False Is 2118641 a composite number? True Is 1399 a composite number? False Is 7477 a composite number? False Is 14851 prime? True Is 1076639 a composite number? False Is 1862045 a composite number? True Is 1797407 a composite number? False Is 227869 composite? False Is 77417 a composite number? False Is 63197 composite? False Is 4909 a composite number? False Is 71629 a composite number? True Is 29813 prime? False Is 20219 composite? False Is 9617 prime? False Is 4201 a prime number? True Is 2153 prime? True Is 315407 a prime number? True Is 1397 a composite number? True Is 3017 prime? False Is 259 composite? True Is 872027 composite? True Is 6559 a prime number? False Is 14767 a prime number? True Is 12527 a prime number? True Is 20837 a prime number? False Is 724562 composite? True Is 136229 composite? True Is 10843 a composite number? True Is 92987 a prime number? True Is 17042 composite? True Is 35729 composite? False Is 1151 a composite number? False Is 524039 a composite number? True Is 28961 composite? False Is 4507 a prime number? True Is 13465 a composite number? True Is 528371 a prime number? False Is 4737 composite? True Is 63191 a composite number? True Is 509837 composite? False Is 135461 composite? False Is 7237 a prime number? True Is 882202 a composite number? True Is 76421 prime? True Is 89807 a composite number? True Is 2927 a prime number? True Is 10589 a composite number? False Is 3869 a prime number? False Is 20593 composite? False Is 312043 composite? False Is 554537 a prime number? False Is 15133 a prime number? False Is 120149 prime? False Is 37217 a composite number? False Is 52271 prime? False Is 364829 a composite number? False Is 4127 a composite number? False Is 29123 a composite number? False Is 41381 composite? False Is 327971 prime? False Is 45455 a composite number? True Is 1923 a composite number? True Is 45634 prime? False Is 3552463 prime? True Is 762041 a prime number? False Is 30367 a composite number? False Is 15571 prime? False Is 3187985 a prime number? False Is 15177 prime? False Is 22019 a prime number? False Is 20477 a prime number? True Is 618227 a prime number? True Is 48957 a composite number? True Is 34311 prime? False Is 3403 a prime number? False Is 503749 a composite number? True Is 12539 a composite number? False Is 1561 a composite number? True Is 91477 composite? True Is 1834721 a composite number? True Is 3943 a composite number? False Is 2218361 composite? False Is 19523 a prime number? False Is 2199 a composite number? True Is 83659 prime? False Is 24014 a prime number? False Is 47237 prime? True Is 2333 composite? False Is 39079 prime? True Is 11665 composite? True Is 3899 a composite number? True Is 61129 a prime number? True Is 3593 a prime number? True Is 11027 composite? False Is 6739 prime? False Is 130379 a composite number? False Is 19369 a composite number? True Is 1138 prime? False Is 1672126 a prime number? False Is 27338 prime? False Is 544741 composite? True Is 993793 a composite number? False Is 22846 a prime number? False Is 126393 prime? False Is 160829 a composite number? False Is 188963 a prime number? False Is 729749 a composite number? False Is 73517 a prime number? True Is 14081 composite? False Is 1861 a prime number? True Is 1452931 a composite number? True Is 60317	{ "pile_set_name": "DM Mathematics" }
n be 1/(o - 3/2). Suppose -2b = -3l + 32, -2b - 51 = -5l - b. Solve l = -5f, 0f - 29 = 5c + nf for c. -5 Suppose 0 = y - 5, -5y - 9 = 2g - 38. Let p(z) = 3z. Let r be p(1). Solve -c - 4i = -1, c - ri = -gi + 6 for c. 5 Let u be ((-8)/12)/(1/(-18)). Suppose u + 18 = 5c. Solve i + 2a - 4 = 0, 2i + 2a = ca for i. 2 Suppose 16 = 3o + 7. Suppose -3n = d - o - 4, -3n - 13 = -d. Solve -m = 2y - 4y + d, -y + 5 = 5m for m. 0 Suppose 3v - 9 = -5k, v + 6 = 3v - 5k. Suppose 3j - 6 = -5m, vj = -2j + 10. Solve 4g + 20 = -m, -5f = 5g + 30 for f. -1 Suppose -3k = f + 1, 2k + 4f = 4k - 4. Suppose 3x - 3d = k, -d - 4 = -2x - x. Solve 13 = 3a - g, g = 5a - xg - 19 for a. 5 Let j = -734 + 737. Let f = 2 - 0. Solve -m = 3g, jg = -2m - fg - 1 for m. -3 Suppose i - 3 = -1. Let y = -2 - -4. Let o be 8(4 - y)/4. Solve 0 = 2h - oj - 6, ih + h - j = 9 for h. 3 Let h(d) = -2d + 2. Let a be h(-5). Solve -2v = l - a, v + 19 = 2l + 4v for l. 2 Let u(j) = 6j - 16. Let b be u(3). Solve 5s = 15, -3t - 4s = -7 - b for t. -1 Let m(k) = -k*3 + 8k*2 + 9k + 6. Let o be m(9). Suppose o = -4x + 5q, 5q = -2x - 8 - 10. Let v be 5/(-3)12/x. Solve d = -vh - d + 9, -15 = 5d for h. 3 Let a(s) be the second derivative of -s4/12 - s3/6 + 3s*2/2 + 4s. Let y be a(0). Solve -n = 2u - y, 4n - 6n + 7 = 3u for u. -1 Suppose -o - 9 = -4o. Suppose 21 - o = 3c. Solve 0 = -n + 2b - c, -n + 0b = -3b + 9 for n. 0 Let d be -3(-12)/(-9) + 2. Let g = 33 + d. Solve 4y = 3r - 0y - g, -2r + y + 14 = 0 for r. 5 Let p(m) = -m*3 + 2m*2 + 3m + 3. Let w be p(3). Let v be (-6)/(-9) - (-1)/w. Let r be (-39/(-3))/v. Solve 3u - 3s + s = -r, s = u + 2 for u. -5 Suppose 0 = -3m - 0m + 9. Solve -o - t = t + 10, -mo - 18 = 3t for o. -2 Suppose 0 = 2w - 5f + 7, w + f - 6f = -11. Suppose 132 = -u + 7u. Solve 2g + u = -2z - 2z, -3g + wz = 3 for g. -5 Let b = -165 + 165. Let o be (-86)/(-18) - 4/(-18). Solve h - 7 = -of - bh, 2f - 7 = h for f. 2 Suppose 4q - 12 = 12. Solve 5r = 4b - 21, -3r + 3 = 3b - q for r. -1 Let l(i) = -i + 4. Let d be l(0). Suppose -2 = q - d. Suppose -2c = 3c - 3v - 21, 4c - 16 = qv. Solve g = -0g + cn - 19, -4 = -4g - 4n for g. -4 Let o(z) = z + 1. Let t be o(-7). Let x be 1 + 1 - t/(-3). Suppose x = -6i + i. Solve -2n + 0n - 3s + 22 = i, -4n + 24 = s for n. 5 Let x = -24 - -28. Solve 2a = 4z + 2, z - xa = -0z - 4 for z. 0 Let o = -22 + 26. Solve 2h + o = -2r - 3r, 10 = -5h - 2r for h. -2 Suppose 4b + b - 2w = 26, 3w = 3b - 21. Solve 14 = bm + 5n, -4m - 2n = -2m - 6 for m. 1 Let v be 0 + -3(3 - 4). Solve -f + 3d = 4f - 25, -vf - 4d = -15 for f. 5 Let k be (-2)/11 + 48/22. Solve -5i = 4f + 23 - 9, 0 = 4f - 3i - k for f. -1 Let f(b) = -6b + 6. Let n be f(-3). Suppose -3j - 2c = -5c - n, -5j + 32 = 3c. Solve -5i = -3r + 19, -3r - 4i - 19 = j for r. -2 Let a = 46 - 27. Solve -3r - 2r = -4z - a, 14 = 4r - 2z for r. 3 Suppose -12 = -r + 4r. Let n(d) = d + 4. Let s be n(r). Suppose -3j + j + 8 = s. Solve -5o - 29 + 4 = -5m, -jo - 5m - 20 = 0 for o. -5 Let l = -13 - -18. Suppose -5w + 2o = -0 - 21, 0 = -3o - 9. Let d = 27 + -12. Solve 4m - 12 = -wy, -3y = lm + y - d for m. 3 Suppose 0 = 4c - 7c - 114. Let y = -18 - c. Solve 5k + 4o - 3 = y, -15 = -3k - 3o for k. 3 Suppose 9n = 14n - 105. Let h be 4/(-16) + n/4. Solve 0 = -4u + hj - 6 - 14, 5u - 4j + 16 = 0 for u. 0 Let z be (-24)/10(-60)/(-9). Let s = 19 + z. Suppose 3x + 2m - 14 = 0, -4x = 2m + m - 18. Solve -3n = -2g - 19, -sg + xg = -5n for g. -5 Let b be (-1467)/(-99) + (-2)/(-11). Solve -4z + 6o + b = 3o, 0 = 4z + 3o - 9 for z. 3 Suppose 8g - 162 + 42 = 0. Solve u + 4l = -15, 4u + 2l + 3 + g = 0 for u. -3 Let b be 04(-2)/(-16). Suppose bw = -w. Suppose -2u - 20 = -3r + 2u, 3u + 14 = 2r. Solve 0 = -rl - 10 - 2, 3q - 3l - 18 = w for q. 3 Suppose 9 - 1 = -4l. Let s be 3/l24/(-18). Solve -2m - 2v = sm - 8, v = 5m - 17 for m. 3 Suppose 0 = 5s + 9 + 21. Let t = s + 10. Solve -tn = y + 18, n - 2y = 3y + 6 for n. -4 Suppose -12 = 7i - 4i, 3y - 2i - 8 = 0. Suppose -5c + 4n = -94 - 23, 0 = 2c + n - 39. Solve -m - 4d = c, 4m + yd = -5d - 29 for m. -1 Let z(i) = -i*3 + 13i*2 + 13i + 19. Let k be z(14). Solve -10 = -2u - 5w, -14 = ku + w - 39 for u. 5 Suppose -b = 4b. Let o be (6/(-9))/(4/(-30)). Let y = -5 - -8. Solve b = yd - 4r + 26, -od - 5 = r for d. -2 Let m(x) = x2 + 5x - 6. Let y be m(-6). Suppose -3d - d = y. Let v be (2/1)/2d. Solve 4q - 2q = -2u - 4, v = -3u + 3q for u. -1 Let y(n) = n2 + 5n - 10. Let l be y(-7). Solve 0 = -j - 4h + 2, -lh + 0 + 4 = 2j for j. 2 Suppose 0 = 2h - 24 - 28. Solve 0 = -3x - 5j + 20, 0 = -11x + 6x - j + h for x. 5 Let l be -1 - (4 - (3 - 11)/(-1)). Solve 0 = 2k + g, -4k - 11 = -lg + 9 for k. -2 Let g(i) = i2 + 12i - 23. Let z be g(-14). Solve -za + 1 = -2v - 2a, -5a = -15 for v. 4 Suppose -58 - 102 = -8y. Solve -2f + 2a + 3 = a, 4a + y = 0 for f. -1 Let s = -14 + 19. Solve -5 = si - o, 0 = 5o - 3o - 10 for i. 0 Let j(l) = l3 + l + 2. Let y be j(0). Suppose 3h - 45 = -yh. Solve -3z + 3v - 3 = v, 4v = 3z + h for z. 1 Suppose -o - 1 = 2v, -2v - 4 = v + 2o. Suppose -v = -2r + 10. Let k = 3 + 2. Solve -kt - a = -10, -t + r = 2t + 4a for t. 2 Suppose -7v = -2v. Let x = 3 - v. Suppose u - 30 = -4i, i = 3u + 13 - 38. Solve -2s = -xa - 9, 8s - a = 3s - u for s. -3 Let q(h) = -4h + 29. Let j be q(6). Solve -3f - 10 = -2l, f - 3l = -2l - j for f. 0 Let o = 16 - 10. Let p = -4 + o. Solve b - 19 = 5d, 2b - 4 = -pb + 2d for b. -1 Suppose -3f - 2f = 0. Suppose -3 - 21 = -2y + i, -4y + 5i + 60 = f. Solve -2w + 15 = -7w - 4p, -2p - y = 0 for w. 1 Suppose -4g = -2k + 24, -4k - 13 + 6 = 3g. Suppose -ku = u. Let s(p) = -p + 15. Let l be s(11). Solve -4i - 4m + u = -l, 4m - 20 = 0 for i. -4 Let c(i) = 9 - 3 - 6i + 5i. Let w(f) = -f + 7. Let a(t) = 4c(t) - 3w(t). Let u be a(3). Solve 3v + 2k = 16, -v + k = -u + 3 for v. 2 Let r be 3/2 + 5/10. Suppose rc - 5 = 3. Solve a - 6 = -l, ca = 5l - 0a + 15 for l. 1 Let o(b) = b*2 - 11b + 4. Let p be o(11). Solve pw + 0k + k = 14, 1 = -w + 2k for w. 3 Let f be 10/3(-3)/(-2). Let p be (-3)/f + 224/40. Solve -2x + 7 = -w, px = -2w - 5 - 0 for w. -5 Let n(b) = -2 + 2b + 12 - 3b. Let g be n(7). Solve -4k + x + 16 = -gx, 3k - 5x - 18 = 0 for k. 1 Suppose 3 - 1 = -2f. Let l = 4 - f. Suppose lr - 13 = -3. Solve -5j = -5k - 45, -rk = 5j - j - 6 for j. 4 Suppose 0 = -4q - 2o - o + 5, 5o = 3q - 11. Let x be (-1)/(2/(42)). Let c be (x/(-10))/(q/40). Solve -k - k - c = -4u, 4k + 16 = -u for k. -4 Suppose -5f + 2 = -4f. Suppose -26 = -7t + 5t. Let c = t - 9. Solve v - cl + 16 = fv, 5l = 15 for v. 4 Let s = -32 + 52. Solve i = -w + 4i + 13, 0 = 5i + s for w. 1 Let o(j) = 3j - 3. Let i be o(4). Suppose -4r + i = -r. Solve 5m + w + 10 = -3w, rm + 3w + 9 = 0 for m. 2 Let y be ((-8)/12)/(3/(-27)). Suppose i - 4x + 0x = y, 0 = -3i - 2x + 18. Solve -s + i = -n, n = -4s + 4n + 22 for s. 4 Let x(h) = h + 9. Let k be x(-8). Solve z = -2z - 5u - 5, -5z - u - k = 0 for z. 0 Suppose 1 = r - 1. Let n be (1 + (-1)/r)0. Suppose 2a - a - 8 = n. Solve -5x = g - a, 0g + 4g + 18 = 5x for x. 2 Suppose -4z - q - 22 = 0, 2z - 3z + 2 = 4q. Let a be z + 7 + (1 - 0). Solve 0 = ad - 0b - 4b - 24, -5d - 2b = 0 for d. 2 Let m be 4/10 + (-8)/(-5). Let q(r) = -11r*3. Let p be q(-1). Let v = p + -7. Solve -vs - m = 4i + 2, i - 3s = -9 for i. -3 Let g be (-6 + 1)(-2)/(-5). Let n be 11/(g - -3 - 0). Suppose -3f - 4 = l - 0l, l = f + 4. Solve -3q + 2d = -2d, -n = lq + d for q. -4 Let s = 49 + -46. Solve 15 = v - sh, 3v - 4h - 20 = -2v for v. 0 Let x(t) = 3t - 6 + 0t + 0t - 4t. Let m be x(-11). Solve 4w - 5g - 26 = 0, 1 = -3g - m for w. 4 Suppose 2f - 20 = -8f. Solve -4g + fa + 2 + 6 = 0, 0 = 5a - 20 for g. 4 Let v(j) = j3 + 8j*2 + 6j + 1. Suppose 5y + 7 = 4y. Let k be v(y). Let f = k + -3. Solve -fi + g - 30 = 6g, 3g = -15 for i. -1 Let u = -21 - -25. Solve -uy + h + 2h = 5, 15 = -2y - h for	{ "pile_set_name": "DM Mathematics" }
Let z(v) = -2v - 4. What is -5i(b) + 14z(b)? 2b + 4 Let o(q) = q*3 - 3q*2 - 3q. Let l(v) = -2v3 + 5v*2 + 5v. Suppose -10 + 50 = -4f. Calculate fo(p) - 6l(p). 2p*3 Let x(f) = 7f*2 - 9f. Let v(l) be the second derivative of -l*4/4 + 2l*3/3 - 3l. Suppose 2k - 6k = 0. Suppose -2z - 10 = -k. What is zv(h) - 2x(h)? h2 - 2h Let f(d) = -6d2 - 2d - 2. Let j(k) = 5k2 + 2k + 1. Give -4f(u) - 5j(u). -u*2 - 2u + 3 Let o(p) = -5p3 + 4p. Let i(c) = -c3 + c. Let l(r) = r3 - 6r2 + r - 2. Let h be l(6). Give hi(u) - o(u). u*3 Suppose 2q + 1 = r, 5r = 3q + 1 - 10. Let y(o) = 15o - 7. Let c(a) = -7a + 3. Let u(z) = -13c(z) - 6y(z). Let t(x) = -2x - 4. Give ru(l) - 2t(l). l - 1 Let g(w) be the second derivative of w3/6 - w2/2 - w. Let m(o) = o2 - 4. Calculate 2g(i) - m(i). -i*2 + 2i + 2 Let d(m) = -m*3 + 3m2. Let f(q) be the third derivative of q6/120 - q5/60 - q4/24 + 39q2. What is -d(i) - 2f(i)? -i3 - i2 + 2i Let v = 77 - 78. Let w(i) = 1. Let q(b) = 2b - 6. Calculate vq(u) - 5w(u). -2u + 1 Let i(t) = -9t - 1. Let w(y) = 4y + 1. What is -2i(l) - 5w(l)? -2l - 3 Suppose 0 = -h - 14 + 7. Let n(w) = -2w2 + 7w. Let g(u) = u*2 - 3u. Calculate hg(t) - 3n(t). -t*2 Let z(d) = -6d*2 + 3. Suppose -59p + 8 = -51p. Let t(f) = -1. What is pz(v) + 3t(v)? -6v*2 Let s(z) = -z + 8. Let q be s(6). Suppose -5d - p = -49, 2 + 26 = 4d - qp. Let g(i) = -1 + 0i - 1 + d + i. Let y(n) = -n - 4. Determine -3g(o) - 5y(o). 2o - 1 Let m(q) = q*3 + q. Let i(s) = 5s3 - s2 + 18s. Give -i(o) + 4m(o). -o3 + o2 - 14o Let b = 28 - 16. Let h = b - 19. Let q(x) = -13x + 13x2 - 10 + 13x. Let c(i) = 4i2 - 3. What is hc(z) + 2q(z)? -2z*2 + 1 Let p = 14 + -7. Suppose 2z = 5f - 16, -4f + z - p = 6z. Suppose 6 = fh - 3h. Let d(k) = -k2 + k. Let q(v) = 8v*2 - 7v. Calculate hd(w) - q(w). -2w*2 + w Let q(w) = -2w*2 - 9w + 11. Let p(h) = 2h2 + 10h - 12. Let k(u) = -6p(u) - 7q(u). Let j(f) = -f*2 - 2f + 3. Calculate 5j(r) + 3k(r). r*2 - r Let t(c) = -5c*3 + 5c*2 - 3c - 3. Let k(l) = -24l3 + 26l*2 - 16l - 16. What is 3k(n) - 16t(n)? 8n3 - 2n2 Let m be (-6)/30 - (-22)/10. Let y(q) = -q3 + 2q + 2. Let g(u) = -3u - 3. Give mg(o) + 3y(o). -3o3 Let d(g) = 4g3 + g2 - 6. Let v(w) = 3w3 + w2 - 4. Let m be 3/15 - 144/20. Calculate mv(t) + 5d(t). -t3 - 2t2 - 2 Let x(j) = -j2 + 4j - 4. Let o = 1 + 2. Suppose ow - 2g = 6w + 27, -3g = -w + 2. Let k(z) = -z2 + 3z - 3. Determine wk(t) + 5x(t). 2t2 - t + 1 Let v(i) = 6i*2 + 4. Let y = 6 + -4. Let d = y - 7. Let h(b) = 3 + 8b*2 - 2b2 + b2 + 2. What is dv(c) + 4h(c)? -2c2 Let k be 30/(-9) + 2/6. Let x(i) = -i3 + 2. Let b be (-5)/2 - 4/(-8). Let y(g) = -3 + 3g*3 + 2g*3 - 3g*3. Determine by(f) + kx(f). -f3 Let t(b) = -9b*2 - 17b + 19. Let a(s) = -4s2 - 8s + 9. Determine -13a(w) + 6t(w). -2w2 + 2w - 3 Let f(m) = 7m2 - 8m - 1. Suppose 0 = 3l + 4r - 14, 3l + 5r - 12 = 4. Let k(a) = a + 1 + 5a - 8a*l + 2a*2 + a. Calculate -5f(x) - 6k(x). x2 - 2x - 1 Let t be 1 - 1 - (2 + -4). Let v(y) = 0y + y + 0y2 + y2 - t. Let i(a) = 4a + 1. Let g(r) = -3r. Let f(b) = -3g(b) - 2i(b). What is -3f(p) + 2v(p)? 2p2 - p + 2 Let k(r) = -3r*2 + 6r - 6. Let a(f) = 9f2 - 11f + 11. Let g(p) = -26p2 + 33p - 33. Let y(s) = 11a(s) + 4g(s). What is -11k(c) + 6y(c)? 3c2 Let y(a) = -a + 6. Let b(h) = 9h - 1. Let s(q) = 5q - 1. Let d(v) = 6b(v) - 11s(v). Let u(z) = -z2 + 11z + 17. Let w be u(12). Calculate wy(p) - 6d(p). p Let t(g) = -10g + 3. Let f(r) = 19r - 6. Give 3f(p) + 5t(p). 7p - 3 Let t(f) = -2 + 3 + 6 + 6f - 4. Suppose 0 = -2u + 4u + 10. Let z(n) = 7n + 4. What is uz(a) + 6t(a)? a - 2 Let j(m) = -125m*2. Let n(q) = 7q*2. Calculate 6j(d) + 110n(d). 20d*2 Let j(m) = 3m*3 + 11m2 - 5. Let u(h) = h3 + 5h2 - 2. Calculate 2j(p) - 5u(p). p3 - 3p2 Let d(o) be the third derivative of o5/60 - o*3/6 + 12o*2. Let z(s) = 4s*2 - 5. What is -6d(v) + z(v)? -2v2 + 1 Let x = 1 - -1. Let h(g) be the first derivative of -g3 - 2g + 47. Let t(c) = -9c2 - c - 7. What is xt(m) - 7h(m)? 3m*2 - 2m Let w(n) = -2n2 - 4n - 5. Let l(v) = -4v2 - 7v - 9. Suppose -5g + 100 = 3z, -3z + 2 + 38 = 2g. Let h be (11/5)/(4/g). Determine hw(f) - 6l(f). 2f2 - 2f - 1 Let i(v) = 2v - 3. Let g be 36/15(-5)/(-2). Let t(c) = -7c + 11. Let n be 8/699/6. Determine gt(r) + ni(r). 2r Let v(w) = -9w*3 - 5w*2 + 5w - 5. Let d(u) = -10u3 - 6u*2 + 6u - 6. Determine -5d(b) + 6v(b). -4b3 Let b(k) = -5k - 1 + 0k + 4k. Let r(v) = 3. Let o = 6 + -4. Determine ob(g) + r(g). -2g + 1 Let u(i) = i*3 + i. Let h(d) = 11d*3 - 4d. Calculate h(g) + 3u(g). 14g3 - g Let b(i) = -i2. Suppose 3h + 5 - 47 = 0. Let j(q) = -2q*2. Give hb(s) - 5j(s). -4s*2 Let v(k) = -15k*2 + 17k - 2. Let x(b) = -8b + 12b*2 - 355 - 5b*2 + 356. Give -6v(h) - 13x(h). -h2 + 2h - 1 Let f(d) = -5d + 11. Suppose -30 - 12 = -7b. Let z(k) = -2k + 5. Determine bf(x) - 13z(x). -4x + 1 Let n(f) = 11f2 - 5f + 11. Let l(o) = -5o2 + 2o - 5. Determine -13l(j) - 6n(j). -j*2 + 4j - 1 Let m(s) = 27s2 + 15s + 15. Let y(d) = 7d2 + 4d + 4. Calculate 4m(b) - 15y(b). 3b2 Let t(v) be the third derivative of 1/3v*3 + 0v - v*2 + 0. Let q(r) = -r - 1. Suppose 6 = -2j - j + 4z, -2z = 0. Give jq(k) - t(k). 2k Suppose 0 = 2c + 5v - 33, -7 = -c - v + 2. Let y(u) be the third derivative of -2u4/3 - 8u*3/3 + 2u*2. Let b(f) = -3f - 3. Determine cy(g) - 22b(g). 2g + 2 Let g(h) = -h - 3. Let m(v) = -3v - 8. Let d(c) = -8g(c) + 3m(c). Let k be (-60)/(-33) - (-4)/22. Let o(r) = 5r + 1. What is ko(s) + 9d(s)? s + 2 Let w(d) = -d + 1. Let s(u) = 12u - 6. Calculate s(i) + 10w(i). 2i + 4 Let z(a) = 3a - 2. Let q be 2 + -2 - 15/3. Let v(s) = -4 - 9s + 9 + 2s. Let o be (2/(-3))/((-5)/(-15)). Give ov(g) + qz(g). -g Let g(v) = -110v. Let c(r) = -22r. Determine 22c(d) - 4g(d). -44d Let b = 11 - 7. Let t(q) = 2. Let d(c) = c - 3. What is bt(u) + 3d(u)? 3u - 1 Let y(m) = -3m. Let g(k) = -14k. Let c(x) = -3g(x) + 16y(x). Let l(j) = -j. What is c(p) - 3l(p)? -3p Let z(m) = m2 + 1. Let o(t) = -4t*2 + t - 6. Calculate -o(w) - 6z(w). -2w2 - w Let a(n) = -n3 - n2 - 1. Let j(i) = -2i*2 + 13i - 14. Let f be j(4). Let p(q) = -8q3 - 6q*2 + 2q - 4. Give fa(d) - p(d). 2d*3 - 2d - 2 Let c(v) = -4v2 + 6v + 3. Let n(y) = -5y2 + 6y + 2. Give -4c(u) + 3n(u). u*2 - 6u - 6 Let l(r) be the first derivative of 2r2 + 1. Let g(q) = 9q + 1. Suppose -5d + 5 = -10. Let x be ((-6)/d)/(8/20). Give xl(j) + 2g(j). -2j + 2 Let p(s) = 84s - 35. Let w(g) = -5g + 2. Calculate 4p(f) + 70w(f). -14f Let s(i) = -i2. Let m(u) be the second derivative of -u5/4 - 5u*4/6 - 29u. Determine m(j) - 10s(j). -5j*3 Let x(i) = -6i*2 + 3i + 4. Let h(k) = -7k2 + 3k + 5. Calculate 5h(w) - 6x(w). w*2 - 3w + 1 Let t(r) = 2r3 + 11r*2 + 9r - 9. Let j(q) = -2q3 - 9q*2 + 8q + 6. Let g be j(-5). Let v(h) = h*3 + 5h*2 + 4h - 4. Determine gv(f) + 4t(f). -f3 - f2 Let i(z) = -9z3 - 6z2 + 6. Let p(y) = y3 + y*2 - 1. Suppose -5q = 3 - 13, -2q = 5l + 1. Determine li(r) - 6p(r). 3r3 Let r(b) = 6b*3. Let z(m) = -3m*3. Determine 6r(i) + 13z(i). -3i*3 Let x(y) = -7y3 - y2. Let f(l) = l*2 - 1. What is -f(q) - x(q)? 7q3 + 1 Let r(a) = a2 + 5a + 1. Let s(h) = h + 1. Determine -r(b) + 2s(b). -b*2 - 3b + 1 Let p(d) = 43d2 - 8. Let g(q) = 14q*2 - 3. What is 8g(j) - 3p(j)? -17j*2 Suppose -5f + 4 + 16 = 0, 3z - 4f = -22. Let x(p) = -p*2 + p. Let j(d) be the first derivative of 4d3/3 - d2 + d + 1. Give zx(a) - j(a). -2a*2 - 1 Let j(v) = -7v*2 - v. Let s(x) be the second derivative of 1/3x*3 + 0x*2 + 13/12x*4 + x + 0. Give -11j(n) - 6s(n). -n2 - n Let z(s) = s3 + 9s*2 + 3s + 2. Let j be z(-8). Suppose -3f = -6f - j. Let y(r) = 4r2 + 4r - 1. Let a(u) = -9u2 - 9u + 2. What is fy(w) - 6a(w)? -2w*2	{ "pile_set_name": "DM Mathematics" }
2 + 3w + 34. What is y(-3)? 88 Let x(d) = d3 + 62d*2 - 2972d + 6358. What is x(30)? -2 Let r(s) = 9835s - 2458777. What is r(250)? -27 Let x(y) = 19y*3 + 171y*2 - 61y - 538. Calculate x(-9). 11 Let r(t) = 2t2 + 480t + 5894. Calculate r(-13). -8 Let s(h) = -5938690h + 5938692. Give s(1). 2 Let i(n) = 23n*3 - 394n*2 + 98n - 385. Calculate i(17). 414 Let v(k) = -24k2 + 1878k - 462. Determine v(78). 6 Let t(v) = -10v2 + 162v - 1097. Give t(12). -593 Let c(l) = 4l3 - 252l*2 - 511l + 12. Determine c(-2). -6 Let i(t) = 30493t + 1128256. Calculate i(-37). 15 Let z(s) = 41895s + 209477. Calculate z(-5). 2 Let a(u) = 2166u - 119099. What is a(55)? 31 Let v(l) = -369l*2 + 10365l + 25. Calculate v(28). 949 Let p(y) = -544182y + 2176725. Determine p(4). -3 Let j(q) = -2514q - 318322. What is j(-127)? 956 Let v(c) = c*3 - 3c*2 - 98c + 64. Give v(11). -46 Let i(w) = 19w3 - 19w*2 - 463w - 445. What is i(-1)? -20 Let r(q) = q*3 - 43q*2 - 125q + 3521. Calculate r(44). -43 Let h(z) = 3z3 + 15z*2 - 76z - 351. Give h(-4). 1 Let f(d) = d*3 - 1085d*2 - 8695d + 396. What is f(-8)? 4 Let j(o) = 2204o3 + 3o*2 - 466o - 469. Calculate j(-1). -2204 Let b(d) = 22d2 - 2774d - 290. Calculate b(126). -542 Let a(t) = 2t3 + 504t*2 + 29304t + 167. What is a(-161)? -155 Let p(t) = -5t3 - 10t*2 + 68t + 76. Determine p(-1). 3 Let c(b) = -3993b - 403411. Determine c(-101). -118 Let k(b) = 137b*2 + 3552b - 91. Calculate k(-26). 169 Let n(r) = -58r2 - 4189r - 16631. Determine n(-68). 29 Let z(s) = s*2 - 1745s - 49629. Give z(-28). 15 Let i(c) = -15c2 - 521c - 3707. Determine i(-10). 3 Let y(s) = 128s + 8670. What is y(-63)? 606 Let j(g) = -6g*2 - 802g - 307. Determine j(-133). 225 Let r(a) = -9883a + 59334. Give r(6). 36 Let w(p) = 2835p*2 - 11250p - 19. What is w(4)? 341 Let o(z) = -721z3 + 153z*2 + 306z + 3. Give o(-2). 5771 Let p(g) = -g*2 + 54709g - 328219. Calculate p(6). -1 Let r(p) = -p*3 + 7p*2 + 199434p - 1595402. Determine r(8). 6 Let b(n) = -2n2 + 279368n - 35. Calculate b(0). -35 Let r(k) = k*3 + 145k*2 - 172k + 17651. Calculate r(-147). -283 Let h(x) = -2x2 + 7467x + 625748. What is h(-82)? 6 Let j(o) = -277o2 - 26286o - 122. Calculate j(-95). -2877 Let v(r) = -180r + 371. Give v(-12). 2531 Let d(u) = u3 - 61u*2 + 55u + 119. Determine d(60). -181 Let x(j) = -155j2 - 22630j - 56. Determine x(-146). -56 Let i(b) = -5b2 - 1222b - 4130. Calculate i(-241). -33 Let h(t) = -13854t - 1385414. Calculate h(-100). -14 Let u(m) = -2m*3 - 103m*2 - 180m - 2203. Determine u(-50). -703 Let c(b) = 174b3 + 14b*2 - 19b - 22. Determine c(2). 1388 Let p(c) = 353c2 + 1391c - 25. Give p(-4). 59 Let c(q) = -77082q + 1233560. Give c(16). 248 Let d(f) = 3f*3 + 27f*2 + 243f - 4057. Give d(7). -4 Let d(u) = -18u2 + 1002u + 1408. Give d(57). 40 Let h(z) = -59z2 + 3837z - 127. What is h(65)? 3 Let o(u) = -12797u2 - 115214u + 4. Give o(-9). 373 Let x(k) = 72k3 + 61k*2 + 132k - 5. Give x(-2). -601 Let z(q) = -657q - 127490. Determine z(-194). -32 Let l(k) = 3k*2 - 2280k + 6806. Give l(3). -7 Let x(i) = 5i2 + 76i + 286. Determine x(-7). -1 Let j(a) = 817131a - 6537037. Calculate j(8). 11 Let f(g) = g3 + 105g*2 - 29822g + 486. What is f(-233)? 20 Let n(k) = 9868k - 29807. What is n(3)? -203 Let c(z) = 1981z + 24810. Determine c(-12). 1038 Let j(g) = 4g2 + 314g + 2651. Determine j(-68). -205 Let s(m) = 6m3 - 163m*2 + 8m + 359. What is s(27)? -154 Let s(g) = -30g + 1069. Give s(30). 169 Let k(o) = -2116o - 19724. Determine k(-8). -2796 Let z(m) = -53m + 14264. What is z(270)? -46 Let b(l) = -2272l + 154528. What is b(68)? 32 Let h(d) = 1470d - 7372. What is h(5)? -22 Let d(i) = -25213i - 3781931. Calculate d(-150). 19 Let t(r) = 6239r - 467932. Give t(75). -7 Let g(b) = -60289b + 422025. What is g(7)? 2 Let v(b) = 4b2 - 1452b + 8006. Calculate v(354). -4738 Let u(f) = -9f3 - 2f*2 + 5f + 52. What is u(4)? -536 Let a(v) = -v*3 + 11v*2 + 16v - 10. Determine a(-6). 506 Let o(g) = -g*2 - 13357g - 3687145. What is o(-282)? 5 Let b(u) = -u*3 - 43u*2 - 318u + 397. Calculate b(-33). 1 Let r(b) = -26b2 - 2684b - 498. What is r(-103)? 120 Let g(p) = 5p2 - 205p - 1883. Determine g(-25). 6367 Let r(f) = 24f2 + 298f + 166. Calculate r(-12). 46 Let f(m) = 13m3 + 6m*2 + 231m + 222. What is f(-1)? -16 Let c(l) = -9l - 835. Determine c(-99). 56 Let x(i) = 6i*3 - 210i*2 - 1221i + 102. Give x(-6). -1428 Let b(c) = -2c2 - 468c - 16550. Give b(-192). -422 Let l(a) = -90a2 + 12a - 17. Determine l(4). -1409 Let f(u) = 2u2 + 12535u - 301990. Give f(24). 2 Let n(v) = 4v3 + 460v*2 - 251v + 24716. Give n(-116). 8 Let h(s) = -811s - 7062. What is h(-9)? 237 Let l(k) = -169k + 2520. What is l(16)? -184 Let u(m) = 2m2 - 8m - 1781. What is u(41)? 1253 Let y(c) = -11c2 - 686c - 243. Calculate y(-62). 5 Let h(a) = -19a2 - 17528a - 130830. Give h(-915). 15 Let p(w) = -42w + 1583. Calculate p(60). -937 Let a(q) = -95q + 2636. Give a(27). 71 Let p(t) = -t*3 - 496t*2 - 3869t + 9902. What is p(-10)? -8 Let c(k) = -18801k + 770835. Calculate c(41). -6 Let p(h) = -523h + 6796. What is p(13)? -3 Let o(y) = 52y2 - 1144y + 5704. Determine o(5). 1284 Let s(t) = -t*2 + 51t - 219. Give s(31). 401 Let s(b) = 377b3 - 9b*2 + 23b + 28. Determine s(-1). -381 Let y(k) = 147k2 + 19k + 231. Calculate y(6). 5637 Let f(j) = -j*3 + 31j*2 - 234j + 3455. Calculate f(27). 53 Let n(j) = -97j - 2994. What is n(-30)? -84 Let c(s) = 7453s + 469563. Determine c(-63). 24 Let n(k) = -7k2 + 191k - 458. Calculate n(6). 436 Let i(u) = 3511u + 1783559. What is i(-508)? -29 Let a(m) = 59m*2 - 41946m - 86275. What is a(713)? -2 Let q(u) = -169u2 + 14919u + 14920. Determine q(-1). -168 Let p(q) = -q*3 - 599q*2 - 4730q - 15. Give p(-8). 1 Let h(k) = -k*3 + 206k*2 - 528k + 25858. What is h(204)? 1378 Let z(v) = -v*2 - 44958v - 14. Calculate z(0). -14 Let f(i) = i*3 + 5863i*2 - 23465i - 7. Calculate f(4). 5 Let l(d) = 123d2 - 42d - 63. What is l(1)? 18 Let a(n) = -13n2 + 461n - 2314. Determine a(5). -334 Let x(r) = -95r2 - 110r + 26073. Determine x(16). -7 Let i(r) = -280r - 31279. Calculate i(-112). 81 Let u(p) = 485p*2 - 11636p - 103. Calculate u(24). -7 Let g(o) = -o*3 + 36o*2 - 74o - 1205. Determine g(8). -5 Let h(q) = -q*3 - 29q*2 + 48q + 767. Give h(-29). -625 Let d(k) = 1272k + 44324. Give d(-35). -196 Let x(o) = 654o + 35318. Calculate x(-54). 2 Let w(r) = -r*2 - 329r + 7326. Calculate w(21). -24 Let k(j) = -4j3 + 10j*2 + 55j + 245. Calculate k(-4). 441 Let g(j) = -j*2 - 355j - 619. Calculate g(-5). 1131 Let r(b) = -19b2 - 370b - 1668. What is r(-13)? -69 Let a(t) = 49t2 - 114t + 55. Give a(1). -10 Let m(d) = -24d2 - 88d + 4018. Calculate m(-16). -718 Let c(l) = -73l2 - 804l - 198. Give c(-11). -187 Let r(z) = 166z - 267. Give r(6). 729 Let b(l) = 11l*2 + 215l - 7. Calculate b(-18). -313 Let j(n) = -n*2 - 734n + 9402. Calculate j(13). -309 Let g(a) = a*3 + 39a*2 - 571a - 20082. Determine g(-41). -33 Let h(s) = 8s - 2061. What is h(199)? -469 Let a(j) = 112j*2 + 53j - 156. Determine a(3). 1011 Let f(l) = -2071l + 30749. Give f(15). -316 Let r(b) = -2b*3 + 224b*2 + 482b - 2311. Give r(114). 653 Let m(v) = -479v - 1553. Calculate m(-5). 842 Let d(i) = 591i + 122344. Calculate d(-207). 7 Let y(p) = -195p - 10047. Determine y(-58). 1263 Let r(l) = l2 - 69l + 364. Give r(59). -226 Let j(g) = -30g2 + 10916g - 185452. Give j(346). 4 Let b(n) = 1003n - 154454. Determine b(154). 8 Let x(l) = -911l - 4555. Calculate x(-5). 0 Let z(h) = -1256690h - 5026784. Determine z(-4). -24 Let w(p) = -3395p - 129000. What is w(-38)? 10 Let k(n) = 1601n + 47471. Calculate k(-32). -3761 Let n(m) = 1064m - 20146. Calculate n(20). 1134 Let l(d) = 6d2 - 324d - 10682. Give l(-23). -56 Let i(f) = -f*3 - 4f*2 - 98f - 711. Give i(-6). -51 Let t(j) = 2j3 - 230j*2 + 904j + 13. Calculate t(4). 77 Let v(t) = -t*2 - 440t + 26122. Give v(-493). -7 Let n(	{ "pile_set_name": "DM Mathematics" }
*6/30 - 12t*2 - 4t + 5. What is the first derivative of d(u) wrt u? 28u3 Suppose 7 + 8 = 5b. Suppose 2 = 3z - 4. What is the second derivative of 0l - 2l + bl*4 - zl*4 - l wrt l? 12l2 Let p(l) = l3 - 3l + 1. Let z be p(2). Let x = z + -1. What is the third derivative of -2s*x + 2s*5 + 4s*5 - 3s*5 wrt s? 180s2 Let b(u) be the third derivative of u6/180 - u5/30 - u3/6 - u*2. Let q(y) be the first derivative of b(y). Find the second derivative of q(t) wrt t. 4 Let r(v) be the second derivative of -29v6/30 + v4/12 + 29v2/2 + 25v - 2. What is the third derivative of r(h) wrt h? -696h Let t(n) be the second derivative of n7/210 - n5/15 + 3n*2/2 + 3n. Let v(r) be the first derivative of t(r). Find the third derivative of v(a) wrt a. 24a Let n be (2/3 - 2)-3. What is the third derivative of u*2 + 3 + 1 + 2u*n - 4 wrt u? 48u Find the second derivative of -10q - 2 + 1 - 10q*2 + 1 wrt q. -20 Find the second derivative of 15f + 47f - 35f + 42f2 - 2f*3 wrt f. -12f + 84 Let y(q) be the first derivative of 10q6/3 + 14q*2 + 12. What is the second derivative of y(t) wrt t? 400t*3 What is the first derivative of 78i - 18i + 15 - 41i wrt i? 19 Let b(v) be the first derivative of 2v2 - 7v - 7. Find the first derivative of b(n) wrt n. 4 Let p be (-9)/12(-3 + -1). Let a = 11 + -7. Find the second derivative of 3v - pv - 2v + v*a wrt v. 12v*2 Let o(j) = 5j*4 - 4j*3 + 5. Let g(h) = -6h*4 + 3h*3 - 4. Let x(u) = -4g(u) - 3o(u). Find the first derivative of x(r) wrt r. 36r*3 Find the second derivative of 20z*3 - 6z - 20z3 + 15z - 11z4 wrt z. -132z*2 Let d(s) be the third derivative of 0s*3 + 2s*2 + 1/60s*6 + 1/30s*5 + 0 + 0s + 0s4. What is the third derivative of d(q) wrt q? 12 Let y(n) = -1 - 3 + 0 + 1 - 11n. Let m(u) = -5u - 1. Let o(w) = 5m(w) - 2y(w). What is the derivative of o(x) wrt x? -3 Let u(b) be the third derivative of b7/35 - b4/12 + 2b*2. What is the second derivative of u(s) wrt s? 72s*2 Suppose 4g - 9 = 4l + 15, 0 = -3g - 3l + 18. What is the third derivative of -5s*3 + 15s*2 - 2s*3 - gs*2 wrt s? -42 What is the derivative of -4 - 2 - 8h + 0 wrt h? -8 Find the second derivative of 11k + 6k - k*3 + 8k wrt k. -6k Let q = 6 - 3. Suppose -qd - 4 = -4d. Find the second derivative of -8h*3 + 2h*3 + 6h*3 + 2h*d + 2h wrt h. 24h2 Let c(l) be the second derivative of -l8/56 + 4l5/5 - l4/6 - 5l3/2 + 4l + 1. Find the third derivative of c(d) wrt d. -120d3 + 96 Let f = -2 - -12. What is the third derivative of -k2 + fk*2 + 12k6 + k6 - 9k6 wrt k? 480k*3 Suppose 0 = x - 0x + 5q - 22, -5q + 20 = 0. Let h be 0 + -2 - 1-3. Differentiate -x + h - v - 1 wrt v. -1 Suppose -12m + 8m = 28. Let r(w) = 2w + 1. Let o(v) = -3v - 2. Let q(t) = mr(t) - 5o(t). Find the first derivative of q(j) wrt j. 1 Let f(j) be the third derivative of j5/4 - j4/2 + 16j*2. Find the second derivative of f(k) wrt k. 30 Let o(b) be the second derivative of 43b*3/6 + 21b*2 + 44b. Find the first derivative of o(d) wrt d. 43 Let o(p) = 5p + 12. Let d(b) = -b2 - 4b - 11. Suppose 5f + 8 = -3q, f - 6 = -3q + 2. Let g(u) = qo(u) + 5d(u). Differentiate g(k) with respect to k. -10k Differentiate -g - 8 - 2 + 7g + 5 wrt g. 6 Let z(a) = a3 + 3a*2 + 2a + 1. Let f be z(-2). Differentiate 4 - f + 5b2 + 1 wrt b. 10b Let i(b) = 3b2 + 10b + 3. Let c(p) = 4p2 + 9p + 2. Let j(o) = 3c(o) - 2i(o). Find the second derivative of j(m) wrt m. 12 Let b(y) = -7y6 + 3y*4 - 14y*2 + 3. Let l(i) = -13i*6 + 5i*4 - 28i*2 + 5. Let p(c) = -5b(c) + 3l(c). Find the third derivative of p(f) wrt f. -480f*3 Let g(r) = 2r*2 + 3r. Let p be (3/(-6))/((-2)/(-8)). Let x be g(p). What is the derivative of 3y3 + 4y*x - 1 - 4y*2 wrt y? 9y2 Let y(z) be the second derivative of -z5/5 - 4z2 + 13z. What is the first derivative of y(n) wrt n? -12n2 Let p(c) be the third derivative of c6/72 - 5c*4/24 - 5c*3/6 - 4c*2. Let q(z) be the first derivative of p(z). Find the first derivative of q(m) wrt m. 10m Let n be 20/(-2)12/(-20). Find the third derivative of 82t*2 - 2t*n + 6t*6 - 78t*2 wrt t. 480t*3 Let n = -1 - -5. What is the first derivative of -7o*2 + 3o*n + 7o*2 + 1 wrt o? 12o*3 Let k(o) be the second derivative of 0o*2 + 1/10o*6 + 0 + 0o*4 + 0o*5 + 4o - 5/6o3. What is the second derivative of k(n) wrt n? 36n*2 Find the second derivative of -s - 2s*3 - 10s*3 + 5s*3 wrt s. -42s Let d(c) = -c + 1. Let i(x) = -3x3 + 7x*2 - 4x + 4. Let n(u) = -4d(u) + i(u). What is the third derivative of n(f) wrt f? -18 Suppose -z + 8 = -2. Differentiate 10d - 2 - 3d2 + 1 - zd wrt d. -6d Let z(f) be the third derivative of -f7/14 - 17f*4/24 - 11f*2. What is the second derivative of z(k) wrt k? -180k2 Let n = -17 + 23. Find the second derivative of -2 - g4 + 3g - 4 + n wrt g. -12g*2 Let s(v) be the first derivative of -4 - 4v + 0v2 - 5v - v*2 + 4v. What is the first derivative of s(g) wrt g? -2 Let i(z) be the third derivative of 1/3z3 + 1/40z*6 + 0z - 3z2 + 0z*5 + 0z*4 + 0. Differentiate i(r) wrt r. 9r*2 Let x(v) be the third derivative of 3v7/70 - v5/20 + 5v2. Find the third derivative of x(h) wrt h. 216h Let a(i) be the second derivative of -i*6/5 + 5i*2/2 - 4i. Find the first derivative of a(d) wrt d. -24d3 Let u(d) = 37d*3 + 2d*2 - 34d - 2. Let t(b) = 184b3 + 11b*2 - 170b - 11. Let x(p) = 2t(p) - 11u(p). Find the second derivative of x(k) wrt k. -234k Let k(c) be the first derivative of -3/2c*2 + 0c*3 - 2 - 1/2c*4 + 0c. Find the second derivative of k(r) wrt r. -12r Let v(r) be the third derivative of 5r*6/24 - 31r*5/60 + 5r2. What is the third derivative of v(j) wrt j? 150 Let s(t) be the second derivative of -t6/120 + t5/60 - t2 + t. Let o(d) be the first derivative of s(d). What is the third derivative of o(r) wrt r? -6 Find the first derivative of 16 + 4f3 + 7f*3 - 8f*3 + 7f*3 wrt f. 30f*2 Let q(u) = 21u + 6. Let y(w) = -11w - 3. Let o(d) = -4q(d) - 7y(d). Let x(f) = 11f + 5. Let l(n) = -8o(n) - 5x(n). What is the derivative of l(v) wrt v? 1 What is the third derivative of 0v + 0v + 14v5 - 6v*2 - 24v*5 wrt v? -600v*2 Let d(f) = -10f*3 + 4f. Let j(o) = o*3. Let y(n) = -d(n) + 2j(n). What is the second derivative of y(x) wrt x? 72x What is the third derivative of 36f*2 + 3f*3 + 5f*3 - 25f2 wrt f? 48 Let v(d) be the second derivative of d8/3360 - d*6/90 - 2d*4/3 - 8d. Let r(j) be the third derivative of v(j). Find the second derivative of r(f) wrt f. 12f What is the first derivative of 15p - 31p - 45p - 8p + 65 wrt p? -69 Let a(m) = m3 - 3m - 8. Let f(d) = -d*3 + 4d + 9. Let z(b) = 4a(b) + 3f(b). Differentiate z(h) wrt h. 3h2 Let x(o) be the third derivative of -19o*9/252 - 17o*5/60 - 28o*2. What is the third derivative of x(m) wrt m? -4560m*3 Let v = -10 - -14. Find the second derivative of -3p + 0p + 3p*4 + p + 3p*v wrt p. 72p2 Let q(j) be the first derivative of -j9/756 - j5/30 - j3 - 3. Let z(p) be the third derivative of q(p). What is the second derivative of z(f) wrt f? -80f3 What is the third derivative of 7i*2 + 24i*2 - 6i*3 - 4i2 wrt i? -36 Let m(w) = -w3 - 5w2 + 5w + 4. Let r be m(-6). Let c be 15/r(-4)/(-3). What is the third derivative of 3qc - q4 + 0q2 + 2q5 + q4 wrt q? 120q2 Let j be (-2)/13 - (-67)/13. Find the third derivative of -5q*2 + jq*2 + 2q*2 + 3q*6 wrt q. 360q*3 Suppose u = 1 - 3. Let r(y) = 6y*2 + y. Let s(d) = -13d*2 - d. Let h(v) = us(v) - 5r(v). What is the second derivative of h(n) wrt n? -8 Let o(c) = -5c*4 - 5c*3 - 17c*2 + 5c. Let j(z) = 3z4 + 2z*3 + 8z*2 - 2z. Let x(l) = 5j(l) + 2o(l). What is the third derivative of x(n) wrt n? 120n Find the second derivative of 17z*3 - 86z + 165z - 84z wrt z. 102z Let t(s) be the third derivative of s6/60 + 7s*5/60 + 2s**2. Find the third derivative of t(v) wrt v. 12 Find the third derivative of	{ "pile_set_name": "DM Mathematics" }
Let i be (-12)/54(-90)/5. Solve -in + 4 + 8 = 0 for n. 3 Let a(f) = -5f - 35. Let o be a(-9). Solve ob = 5b for b. 0 Suppose 0z + h + 238 = 5z, h + 3 = 0. Let l = z + -44. Solve -ly = -y - 8 for y. 4 Suppose -10p = -12p + 6, -2p + 111 = 5z. Solve -z + 6 = -5m for m. 3 Suppose 3s + 5n + 43 = n, -4n = -3s - 83. Let t = s + 23. Solve 2v + 0v - t = 0 for v. 1 Suppose 2i + 12 = 2t, -2i - 14 = -2t + i. Let s = 4 + 0. Suppose 2g + f - 12 = 0, f - 12 = -g - f. Solve -t = gb + s for b. -2 Suppose 392c = 403c - 132. Solve -7d = -9 - c for d. 3 Let s(c) = c3 - c2 - c - 19. Let f be s(0). Let g = f + 37. Suppose -y = -4w - 30, -4w - g - 2 = 0. Solve -2t = 3t - y for t. 2 Let v(c) = -5c2 - 33c + 20. Let q be v(-7). Solve 0 = 8y - qy for y. 0 Let n(s) = -11s + 12. Suppose k - 3f = 7, 0f - 3f - 1 = 5k. Let d be n(k). Solve m = 2m + d for m. -1 Let a(k) = 13k3 + 3k*2 - k - 1. Let t be a(1). Solve -5z = t + 6 for z. -4 Let s(a) = -a*2 + 9a - 1. Let w be s(8). Suppose 0 = d + w - 10. Solve 2 = dm - 2m for m. 2 Suppose 0 = 5a - 5x - 65, -2x = -6a + 11a - 37. Solve ay + 16 = 13y for y. 4 Let k(j) = -6j - 9. Let v be k(-2). Suppose h + 25 = 4h + g, vg = -5h + 35. Solve -2 + h = -4q for q. -2 Let b(k) = k*2 + 5k - 2. Let q be b(-6). Suppose -qh = m - 81, 2h - 2m + 22 = 3h. Let z = h + -20. Solve j = -zj - 5 for j. -5 Let s be 12/(-6) + (1 - -4). Suppose 10j - 35 = sj. Solve 0 = -4h - j + 21 for h. 4 Suppose 15v = -4 - 11. Let k be (3(-5)/3)/v. Solve -i = -ki - 12 for i. -3 Let l be 16/(-152) + 2 - 4/(-38). Solve 6 = li - 0 for i. 3 Let r be (-3)/(-5) + 90/(-25). Let i be (19/(-3) - 2)r. Solve -4v = -9v + i for v. 5 Let f be 1/((1/(-5))/((-6)/15)). Suppose -fj - 2 = 0, 0 = 4v - 4j - j - 5. Solve 3y + vy = 15 for y. 5 Let n = 9 - 21. Let u be (54/15)/(n/(-80)). Let w = 26 - u. Solve 0 = wx + 3x + 25 for x. -5 Suppose -16q + 2l - 2523 = -21q, 2004 = 4q - 2l. Solve -9 = -qu + 500u for u. 3 Let f(d) = 15d*2 - 23d + 4. Let l be f(2). Solve -10 + l = 2z for z. 4 Suppose -3s + 6s = -27. Let f = 9 + s. Suppose fj = -j + 1. Solve -2 - j = d for d. -3 Suppose -3q + 25 + 53 = 0. Let w = -5 + 10. Suppose -o + 3h - 1 = -0, -wh = 3o - 25. Solve -om + q = 6 for m. 4 Let p(w) = w - 1. Let a be p(5). Let k = -31 + 33. Solve -a = -kr - 2r for r. 1 Suppose -6l = 3q - 9l - 60, -5q + l = -108. Solve v + qv = 0 for v. 0 Suppose -2l = -4l + 24. Suppose h + 2h = l. Suppose -3u - 2z = -12, z + 17 = 4u + 4z. Solve 2 = -ho + uo for o. -1 Let s = 185 - 179. Solve 8a + s = -2 for a. -1 Let m = 40 + -36. Solve 0a = -ma for a. 0 Suppose -a + 49 = -h, 4a - 2h = -7h + 205. Suppose -2m + a - 10 = 0. Solve -7g = -3g - m for g. 5 Suppose 5l - 42 = -22. Let z be ((-93)/(-42) - l/(-14))2. Solve -zn - 2 = -3n for n. -1 Let g = -135 + 136. Let c be 1/3 + (-68)/6. Let i be g + -4 - (c + -3). Solve 3q + 2 - i = 0 for q. 3 Suppose 4k + h = 3h + 76, 3k + 3h - 57 = 0. Suppose kf = 20f - 4. Solve -12 = fd + 4 for d. -4 Let m be 155/(-2)24/(-30). Solve mg - 10 = 57g for g. 2 Let f = 22 + -20. Suppose -4x - 12 = -4i, 0 = fi - 0x + 5x - 20. Solve -28 + 3 = -id for d. 5 Let b = 1119 - 1095. Solve -4 = -25a + ba for a. 4 Suppose -2y + 0z = 4z + 8, 5z + 4 = -4y. Let l(c) = -c*3 + 6c*2 - 6c + 3. Let b be l(4). Suppose -4h + 9 = -b. Solve hf - yf = 0 for f. 0 Suppose 0 = 25d - 27d + 220. Let p = -110 + d. Solve -4v - 5 - 3 = p for v. -2 Let u = 53 - 35. Let a be (u/(-27))/(1/(-18)). Solve 0s - a = 4s for s. -3 Suppose 0u - 2v = 3u - 79, 5u = 3v + 119. Suppose -5n = 15, 4 = -a - 2n + u. Solve a - 7 = -4j for j. -5 Let w(r) be the first derivative of r*2 + 29r - 2. Let k be 230/(-18) + -3 + 175/63. Let t be w(k). Solve 7j = tj + 8 for j. 2 Let p(o) = -o*2 + 6o - 2. Let q be p(5). Let t be (-2)/4 - (-35)/10. Suppose t = 8k - 5k. Solve -qd = 4 - k for d. -1 Let b(v) = -v2 + 12v - 28. Let h = -5 + 9. Let w be b(h). Solve -o = wo for o. 0 Suppose 11t - 12 = 10t. Let m be (-5 - -2)/t - (-5)/4. Let r be 3 + 1/(-1)0. Solve -rd = -2d + m for d. -1 Let r(z) = z*2 - 7z + 3. Let x be r(6). Let l be -1(-2 - 1 - x). Suppose ls - s + 6 = 0. Solve -2i - s - 4 = 0 for i. -5 Let o(i) = -2i + 14. Let f(q) = q + 1. Let s(z) = -5f(z) - o(z). Let v be s(-8). Solve -3y + vy + 10 = 0 for y. -5 Let h be 0/(-2)83/(-581). Solve -11k + 5k - 24 = h for k. -4 Suppose -4h = -12h + 104. Solve -8q - 15 = -hq for q. 3 Suppose -f - a + 5 = -3, 2f - 5a = -19. Suppose 4u = -i - 6, fi - 16 = 5u - 0. Suppose -5y = 4g - i, 6g = -4y + 3g + 2. Solve -yt = 3t for t. 0 Let d(j) = -j*3 + 5j*2 + 14j + 2. Let u be d(7). Suppose 0 = -5q + 25 - 10. Suppose 7y = qy. Solve -uw - w + 9 = y for w. 3 Suppose -2y + 560 = 5x, 4y = -11x + 10x + 130. Solve 0 = -xp + 114p + 12 for p. -3 Suppose 5p + 47 = 4a - 5, 4p = -2a. Let w(c) = -c3 + 7c*2 + 8c + 12. Let f be w(a). Solve 3r + r = f for r. 3 Let d(z) = 23z - 1294. Let a be d(57). Solve -l + a - 22 = 0 for l. -5 Suppose 2m - 60 = 2x - 4x, -4m + 122 = 2x. Let q = m + -51. Let s = q - -21. Solve -n = -0n + s for n. -1 Suppose 8v = 5j + 6v - 24, -j = -v - 3. Solve j = 3g + 3 for g. 1 Suppose -3k - t = -6 - 10, 18 = 3k + 3t. Suppose 3l - 2i = 36, 0 = -5l + ki + 61 + 4. Solve 2q - l = -0 for q. 5 Suppose -244 = -5f + 196. Solve 5 = fw - 87w for w. 5 Let g = -345 + 351. Solve 0 = gw - 10 + 28 for w. -3 Suppose 176 - 22 = 7s. Let c(u) = -u + 1. Let o be c(2). Let r = s - o. Solve 8 = 3k + r for k. -5 Let r be 68/12 - 3/(-9). Let y(d) = -2d - d3 - 6d + 3d + rd*2. Let s be y(5). Solve s - 2 = -f for f. 2 Suppose 3k = k - 28. Let x = 17 + k. Suppose 4c - 13 - x = 0. Solve -25 = -cq - q for q. 5 Suppose -2w - 4 = 4k, -3w + 2k + 0 = -18. Solve wm + 0 = -20 for m. -5 Let c(z) = 2z*3 + 94z*2 - 3z - 139. Let w be c(-47). Solve -18 = wq - 12 for q. -3 Let a = 19 + -17. Let f be (a/(-5))/(6/5)-15. Solve -4t - 3 - f = 0 for t. -2 Suppose 0v + 9v = -360. Let a = v + 43. Solve aq + q = 0 for q. 0 Let r(h) = 22h + 350. Let d be r(-15). Solve 5 = -5u - d for u. -5 Suppose 29 = -6f + 8f - o, -4f + 3o = -57. Solve 2p + 9 = f for p. 3 Let i = 524 - 519. Solve 18 = -ib + 13 for b. -1 Suppose 4k + 528 = 48k. Solve -k = -h - 7 for h. 5 Let o(t) be the second derivative of t*4/6 - 2t*3 - 3t*2 - 6t - 1. Let r be o(7). Solve -4l - r = -8l for l. 2 Let g(o) = -3o - 37. Let l be g(-11). Let m be 2-2 - ((-3 - 0) + l). Solve -2y = -1 - m for y. 2 Let f(w) = w - 7. Let x be f(12). Let q = x + 3. Suppose -qi + 3i = -5. Solve 5a - 11 + i = 0 for a. 2 Let u = -32 + 32. Solve u = k - 6k + 25 for k. 5 Let r = 98 + -97. Suppose -2y - 3f - 2 = -r, -3y = -4f - 24. Solve yh = h for h. 0 Let u be 7 - (-297)/(-44) - (-638)/8. Solve -72q + 16 = -uq for q. -2 Let w(d) = -7 - d*3 + 9d + 4d2 + 3d*2 + d - 1. Let z be w(8). Suppose 2b = -b + 5x + 26, -2b + x + z = 0. Solve 5 = bi - i for i. 5 Suppose 0 = 192z - 194z. Solve 3h + 0 - 12 = z for h. 4 Let m(s) = -s*3 - 15s*2 - 30s - 48. Let j be m(-13). Solve 0 = -5y + jy - 4 for y. -4 Let f = 30 - 24. Suppose q = -5z + 19, fz + 2q = z + 18. Solve -z = 3c + 5 for c. -3 Let z be (-415)/85 + (-6)/51. Let r be 2/z - ((-84)/10)/1. Solve 0 = -t + 5t + r for t. -2 Suppose 2z = 3i + 23, 30 = 5z - 5i - 15. Solve -54m = -58m - z for m. -1 Let u = 9 + -5. Suppose -t - 2f - f = 2, -2t - 2f = -u. Solve -3j = j + t for j. -1 Let z be (117/195)/((-9)/(-60)). Solve 0 = -zt + 8 + 8 for t. 4 Suppose 0 = -5b + 924 + 126. Suppose -16d + b = -2d. Solve -c - 4c = d for c. -3 Let f = -5 - -8. Let i = 387 - 383. Solve fq = q - i for q. -2 Suppose 14v + 20 = 19v. Solve i = -vi - 5 for i. -1 Let o be (1-1)/(18/(-630)). Let l = o - 32. Solve 9 = -2n + l for n. -3 Let a be (5/2)/((-236)/64 + 4). Solve 6o + a = 2o for o. -2 Let i = 704 + -703. Suppose 2d - 3 = 1. Let x = i + d. Solve 7v + 8 = xv for v. -2 Let l(f) = f2 + 15f + 69. Let o be l(-14). Solve -o = 11m - 0 for m. -5 Suppose -56 + 186 = 5n. Suppose -3m = 0, -4j - 10 = 3m - n. Solve -ja = a + 15 for a. -	{ "pile_set_name": "DM Mathematics" }
*2/2 - 30f. Differentiate j(t) with respect to t. 78t2 Suppose t = -4g + 1, -6g + 2g - 29 = -5t. Let q be (t - 2) + (1 - -1). Find the second derivative of b3 + 2b + b - qb3 wrt b. -24b Let b(h) be the third derivative of 0h5 + 0 + 1/24h*4 + 0h + 0h6 - 3h*2 + 0h*3 + 1/105h*7. What is the second derivative of b(d) wrt d? 24d*2 Let x(f) = 13f*4 - 5f*3 - 2f. Let z(y) = 12y4 - 4y*3 - y. Let m(u) = 4x(u) - 5z(u). Find the second derivative of m(q) wrt q. -96q2 What is the third derivative of -w4 + 3w2 - 4w*2 + 5w*4 wrt w? 96w Let y(g) be the third derivative of 0 + 0g5 + 0g*6 - 1/210g*7 + 0g - 2/3g3 + 0g4 - g2. Differentiate y(z) with respect to z. -4z3 Let y(n) be the first derivative of -3 + 1/4n*4 + 3n + 0n3 + 0n*2. What is the derivative of y(q) wrt q? 3q*2 Let j be (-4)/63/2. Let t(m) = 7m3 + 4m2. Let r(g) = -g3 - g*2 + g. Let u(p) = jt(p) - 4r(p). Find the second derivative of u(w) wrt w. -18w Let h(t) be the third derivative of t*6/40 + 7t*5/60 + 7t*2. Find the third derivative of h(y) wrt y. 18 Find the second derivative of -22s*3 - 12s - 2s3 + 11s*3 wrt s. -78s Let t(y) be the third derivative of 5y8/56 - y5/2 + 24y*2. Find the third derivative of t(i) wrt i. 1800i*2 What is the third derivative of 4f4 - f4 - 53f2 + 11f*2 + 26f*2 wrt f? 72f Let y(c) = -c*3 + 3c*2 + c - 1. Let t be y(3). Let u be (-1)/5 - 16/(-5). Find the first derivative of -3 + 3 + 1 + ta*u wrt a. 6a2 Let j(o) = o4 + 3o3 - 3o*2 + 3o - 3. Let t(y) = y*4 + 4y*3 - 4y*2 + 4y - 2. Let i(d) = -4j(d) + 3t(d). Differentiate i(x) wrt x. -4x3 Let b(h) be the third derivative of 11h*8/336 + 13h*5/30 + 26h*2. Find the third derivative of b(r) wrt r. 660r*2 Let h be (-8)/28 - (-44)/7. Let n = 9 - h. What is the derivative of nm*3 + 3 - 2m*3 - 1 wrt m? 3m*2 Suppose -b = -3 - 0. Find the first derivative of -bk*4 - 4k*4 - 1 + 3k*4 wrt k. -16k*3 Let k(d) be the first derivative of d - 4 + 0d*2 - 2/3d*3. Differentiate k(o) wrt o. -4o Let p be (18/4 + -3)2. Let a be (p - 0)/(6/6). Differentiate -2 + 8k*3 + 0k*a - 4k*3 with respect to k. 12k*2 Let b = 55 + -273/5. Let t(k) be the first derivative of -bk5 - k2 + 0k3 + 0k - 1 + 0k4. Find the second derivative of t(p) wrt p. -24p2 Let h(a) be the third derivative of -a8/42 + a*4/12 + 9a*2. Find the second derivative of h(s) wrt s. -160s*3 Suppose -5d + 14 + 1 = 0. Suppose 0 = 3q - 3 - d. What is the third derivative of vq - 2v*6 - 4v2 + v2 wrt v? -240v3 Let u = -15 - -15. Let h(s) be the first derivative of 0s + 0s2 + 2/3s*3 + 1/5s*5 + us*4 - 3. Find the third derivative of h(a) wrt a. 24a Differentiate -7 - 5 - 7 + 8 + 22r2 wrt r. 44r Let h(x) be the first derivative of -2x5/5 + 14x - 11. Differentiate h(f) wrt f. -8f3 Let s(o) be the first derivative of 2o*7 + 8 + 0o7 - o3 + 3o3 - o7. What is the third derivative of s(g) wrt g? 840g*3 Let m(u) be the third derivative of 13u7/210 + u5/15 - 15u2. Find the third derivative of m(t) wrt t. 312t Find the first derivative of -3k2 - 8k*2 + 7 - 3k*2 wrt k. -28k Let p(g) = 3g4 - 5g*3 + 5g*2 + 17. Let r(q) = 2q*4 - 2q*3 + 2q*2 + 9. Let w(i) = -2p(i) + 5r(i). Differentiate w(o) with respect to o. 16o3 Let b(m) be the first derivative of -m6/6 - m*2/2 + 4. What is the second derivative of b(k) wrt k? -20k*3 What is the derivative of 46a*4 + 54a*4 - 79a*4 + 30 wrt a? 84a*3 Differentiate 14 - 9h*3 + 385h*2 - 385h*2 wrt h. -27h2 Let n(f) = f2 - f + 4. Let z(d) = -11. Let h(w) = 5. Let c(x) = -13h(x) - 6z(x). Let o(m) = -4c(m) + n(m). Find the second derivative of o(r) wrt r. 2 Suppose -1 = 2v - 5. Differentiate 7 + va3 + 0 - 5a*3 - 2 wrt a. -9a*2 Let v(l) be the first derivative of 17l*6/6 + 3l*2/2 + 32. What is the second derivative of v(p) wrt p? 340p*3 Let f(v) be the second derivative of -3/10v*5 + 0v4 + v3 + 0v2 + 0 + 6v. What is the second derivative of f(q) wrt q? -36q Suppose -3z - 2u + 0u - 4 = 0, 6 = -3u. Find the second derivative of 4t - t*4 + 3t*4 - 2t + zt wrt t. 24t*2 Let m = -2 + -5. Let l = m - -11. What is the second derivative of 0t*l + 3t*4 + 2t + 0t4 wrt t? 36t2 Let d(t) be the first derivative of -t5 + 10t3/3 - 3. Find the third derivative of d(j) wrt j. -120j Suppose 5f + 15 = -20. Let c(l) = -l2 + 6l + 7. Let w(p) = -3p - 3. Let t(y) = fw(y) - 3c(y). Find the second derivative of t(s) wrt s. 6 Let a(x) = x2 - x. Let w(c) = 3c*2 + 3c - 7. Let y(b) = -3a(b) - w(b). Differentiate y(p) with respect to p. -12p Suppose 2q + 30 = 7q. Let d = q - 4. What is the third derivative of 0f6 - 2f2 - f2 - 4f6 - fd wrt f? -480f*3 Suppose 3i = -i - 8. Let d(k) = -7k - 3. Let q be d(i). What is the third derivative of ql2 + l5 - 10l2 + l5 wrt l? 120l*2 Let n be ((-3)/(-4))/(1/4). Let l = -30 - -35. Find the second derivative of 6r*l - 25r + 26r - nr*5 wrt r. 60r*3 What is the third derivative of 32t*3 - 28t*3 + 12t*3 - 17t*2 wrt t? 96 Let s(b) be the first derivative of -8b*6/3 - 13b*3/3 + 6. What is the third derivative of s(g) wrt g? -960g*2 Let b(d) be the first derivative of 0d*5 - 2 - 1/2d*6 + 0d - d*2 + 0d*3 + 0d*4. What is the second derivative of b(a) wrt a? -60a*3 Let f(b) be the third derivative of 0b*6 - 3b*2 + 0 + 1/60b*5 + 0b*7 + 1/112b*8 + 0b + 0b3 + 0b*4. Find the third derivative of f(u) wrt u. 180u*2 What is the third derivative of 2t*5 + 8t*3 + 17t*2 + 5t*5 - 8t*3 wrt t? 420t*2 Let m(b) = -4b*2 - 3 - 2 + 3b - 1 + 2b. Let j(c) = -c. Let z(l) = 5j(l) + m(l). What is the first derivative of z(s) wrt s? -8s Let w be (24/15)/((-8)/(-20)). What is the derivative of -3 - y4 + 0y*4 + 0y*w wrt y? -4y*3 Let u(d) = 6d*3 - 3d*2 - 3d + 7. Suppose b = -3b + 12. Let z(p) = -p3 + p2 + p - 1. Let j(n) = bz(n) + u(n). Differentiate j(k) wrt k. 9k2 Find the second derivative of 25c + 4c5 - 16c - 18c wrt c. 80c*3 What is the second derivative of -29m*2 + 5m + 15m2 - 14m2 wrt m? -56 Let r(d) = d2 - 9d + 10. Suppose 5b - 32 = b. Let q be r(b). Find the second derivative of 0a2 + 3a + a + 0aq - a2 wrt a. -2 Let o(y) be the second derivative of -3y5/5 - y4/6 + 22y3/3 - y - 29. Find the second derivative of o(k) wrt k. -72k - 4 Let k(n) = -17n3 + 4n*2 - 22. Let u(g) = -18g*3 + 3g*2 - 22. Let y(j) = -2k(j) + 3u(j). Find the third derivative of y(i) wrt i. -120 What is the third derivative of 40a*5 - 8a*2 + 184 - 184 - 8a*5 wrt a? 1920a*2 Let z(u) be the first derivative of -5u*4/4 + 23u*3/3 + 17. What is the third derivative of z(s) wrt s? -30 Suppose j + 3j - y = 27, -30 = -4j - 2y. Let r = 25 - 23. Find the third derivative of -8w4 + jw*4 + rw*2 + 2 - 2 wrt w. -24w What is the first derivative of 2z - 5z + 6 + 10z3 + 3z wrt z? 30z2 Find the first derivative of 2 + 14 + 1 + 8z*3 - 9 wrt z. 24z*2 Let p(q) = 9q*3 + 8q*2 - 24. Let n(i) = 6i*3 + 5i*2 - 16. Let w(u) = 8n(u) - 5p(u). Differentiate w(a) wrt a. 9a*2 Find the second derivative of -3w*5 + 9w*5 + 3w + w*5 wrt w. 140w3 What is the third derivative of -m5 - 11m2 + 18m*2 + 7m*5 wrt m? 360m*2 Let k = 5 - 0. What is the second derivative of -m + 2m + 3m5 - 2m*k + 2m wrt m? 20m3 What is the second derivative of 10w*3 - 6w - 5w + 5w wrt w? 60w Let a(j) be the third derivative of j7/42 + 5j*4/24 + 7j*3 - 7j*2 + 2. What is the derivative of a(f) wrt f? 20f*3 + 5 Let u(m) = 17m*2 - 7m. Let k be (-6)/6(1 + -6). Let y(o) = 9o*2 - 4o. Let z(f) = ky(f) - 3u(f). What is the second derivative of z(h) wrt h? -12 Let f(v) = 33v3 - 19v*2 - 6v + 6. Let g(c) = -65c3 + 39c*2 + 13c - 13. Let z(m) = -13f(m) - 6g(m). Find the third derivative of z(r) wrt r. -234 Let f(y) be the first derivative of -y*4/4 + y + 2. Let u(j) = 6j*3 - 2j - 3. Let i(s) = -3*f(s) - u(s). What is the second deriv	{ "pile_set_name": "DM Mathematics" }
124.2 - 139. Let b = h + 15. Let s = 359 - 363. What is the smallest value in 0.5, s, b? s Let m = 305/84 - 92/21. What is the second smallest value in m, -40, -9? -9 Suppose -4j - 12 = c, -3c = j - 7 - 1. What is the second biggest value in -0.25, 0.6, c? 0.6 Let w = -6757 - -6757.4. What is the second biggest value in -27, w, -8? -8 Let w(a) = 95a + 2097. Let c be w(-22). Let l = -1 - -1. What is the smallest value in c, -1/4, -4, l? -4 Let k be (99/(-24))/(27/(-12)). What is the second smallest value in k, -0.5, -0.3? -0.3 Let v be ((-10)/(-15))/(8/(-6)). Suppose -t - 5n = -8, -2t - 20 + 8 = -4n. Let u = 3.9 + 0.1. What is the smallest value in t, v, u? t Let g = 370 - 305. Let v = g - 64.7. Which is the second biggest value? (a) 0.021 (b) v (c) 2/3 b Let y = -16663 - -16663.05. What is the fourth biggest value in 10, y, -3, 0.5? -3 Let i = -0.2 - 0.3. Let p be 38/8 + (-24)/32. Let z be (-90)/936 + p/(-26). What is the third smallest value in z, i, 2? 2 Let w = -2.2 - -2. Let m = 0.098 - 140.098. Let z = m - -141. Which is the fourth smallest value? (a) w (b) -2 (c) z (d) -0.3 c Let l = 0.68748 - -0.19252. Which is the third biggest value? (a) 1/3 (b) l (c) -3/4 (d) 3 a Let m = -9.6 + 63.6. Let s = m + -59. What is the third smallest value in 3, -2, 2/5, s? 2/5 Let l = -91 + 90.5. Let p = -1056 - -1054. Which is the smallest value? (a) p (b) 0.02 (c) l a Let s = -208577/32 + 6518. Which is the third biggest value? (a) -17 (b) s (c) -0.1 a Let o = -1298.5 - -1298.7. Let d = 0.031 + 10.769. Let x = d + -11. What is the third smallest value in o, -2/3, x? o Let n = 671 + -670. Let s = 4 - 4. Which is the second smallest value? (a) -1/11 (b) n (c) 5 (d) s d Let p = 12678 + -12682. What is the smallest value in 1, 5, p, 118, 3/8? p Let f = -221 + 227. Suppose 0 = 7x - 80 + 24. Suppose -10 = -xv + 6v. Which is the smallest value? (a) v (b) 0.4 (c) 4 (d) f b Let g be (1 + -3 - -1)/((-3)/6). Let z be (-52)/14 - 14/49. Which is the fourth smallest value? (a) z (b) g (c) 0.3 (d) 7 d Let z be (-3)/4 - (315/(-36) + 10). Let x be (192/(-160))/(z1/15). What is the biggest value in 5, x, 0.2, -1/5? x Let b = 0.26557 + -0.28857. What is the biggest value in 0.3, -11/6, b? 0.3 Let y = -1152 - -429. Let t = y - -727. What is the third smallest value in -0.1, t, 47? 47 Let i = 1346 + -888. Let s = i + -452. Which is the third biggest value? (a) s (b) 5 (c) 0 c Let y = 307 + -307. Let g = -29 + 25. Let q = g - -4.6. Which is the smallest value? (a) q (b) y (c) 3/8 b Let k = 15.157 - 15.2. Let u = k - -4.403. Let s = -0.64 - u. What is the biggest value in 3, 5, s, -2? 5 Let r be 15/105 - (1 - (-20)/(-14)). Let m = r - 94/189. Which is the second smallest value? (a) m (b) -0.3 (c) 3 a Let o = 273 + -523. Let y = o + 249. Let p = -167/132 - -13/12. Which is the fourth smallest value? (a) p (b) 5 (c) 2/3 (d) y b Let u = -6.5 - -17. Let l = 13.5 - u. Let h = -3.3 - 0.7. Which is the second smallest value? (a) 2/13 (b) -6 (c) l (d) h d Let h = -353 + 351.46. Let t = h - -0.54. What is the smallest value in t, -19/5, -2/5, 1? -19/5 Let z = 11.9138 - -1.0862. Which is the smallest value? (a) -3 (b) -1/2 (c) z (d) -4 d Let n = 0.05 - 7.05. Let t = -0.428 - -0.045. Let f = 0.783 + t. What is the second biggest value in f, 0, 0.5, n? f Let t = 0.002 + 9.998. Let o = -13 + t. Let c = 9 + -4. What is the second smallest value in c, -6, o? o Let v(f) = f*2 + 12f + 17. Let l be v(-2). Let s = -94 - -90. Which is the third biggest value? (a) s (b) l (c) -12 c Let i = 52.57 + -0.57. Let u = -11867 + 11870. What is the second biggest value in 1/2, i, u? u Let y(m) = -m*3 - 21m*2 - 77. Let r be y(-21). Let d = -488.2 + 488. What is the smallest value in d, r, 3, 1? r Let g = -0.05594 + -0.94406. Which is the fourth biggest value? (a) 0.3 (b) 0.08 (c) g (d) -0.4 (e) -0.17 d Let m = -9321 - -27961/3. Which is the second biggest value? (a) 23 (b) m (c) 2/3 (d) -0.4 c Let r = 900.499 - -1.501. Let s = r - 895. Which is the second smallest value? (a) 0.8 (b) -0.5 (c) s a Let v be 146/292(-44)/3. What is the second smallest value in -0.05, v, 5, -2/7, -3? -3 Let y = -0.8409 - -0.5409. Let o be 2-1 - 1/(-2). Which is the second smallest value? (a) -3/7 (b) o (c) y (d) -4 b Let g be -21 - (-123)/(-4(-27)/18). Let h = 0.1 - -0.1. Which is the third biggest value? (a) 3 (b) h (c) g (d) 20 b Let q be 38/(-22) + (-1 - -2). Let z = 3 - 224. Let u = z - -217. Which is the third smallest value? (a) u (b) q (c) -1/4 (d) 5 c Let x be (-162)/126 + -14 - -15. What is the fifth smallest value in 0, 0.2, x, 5, -36/7? 5 Let g be (30/(-12))/(64/384). What is the second biggest value in g, -2, 0? -2 Let l be (-5)/(16/(-8) + 3). Let p = -556/831 - -2/831. Which is the second smallest value? (a) p (b) l (c) -1.7 c Suppose u - 3y - 9 = -0, u = -y + 1. Let m be ((-5)/15u)/(4-1). Which is the second biggest value? (a) m (b) 0.3 (c) 0.09 (d) -6 a Let a = 1 - 0.8. Let y = 71 - 69. Let l = 2.3 - y. What is the second smallest value in l, 3, a, -1/7? a Let z = -4693 + 4692. Which is the biggest value? (a) -4 (b) z (c) 27 c Let s = -2196.6 + 2192.6. What is the second biggest value in 0.0012, s, 2/9? 0.0012 Let u = 814.6 + -1036.6. Which is the smallest value? (a) 5 (b) -2 (c) u (d) 1 c Let m = -8277 + 8279. Let y = -21.47 + 0.47. Let w = 20.1 + y. What is the second smallest value in 4, w, m? m Let c be 294/(-63)22/77. Let a = -1 + 0.6. What is the third smallest value in c, a, -3/13, -2? a Let j = -2564.2 + 2559.2. Which is the biggest value? (a) 0.5 (b) 5 (c) j (d) -3 (e) 18/95 b Let z = -21856 + 21851. What is the second smallest value in 1/4, 36, -2/7, z, -2? -2 Let n(z) = 6z3 - 4z*2 - 18z - 12. Let p be n(-1). Which is the biggest value? (a) -1/3 (b) -0.7 (c) 4.4 (d) p c Suppose -578 + 98 = 32n. Which is the smallest value? (a) 2/9 (b) 0.2 (c) n (d) 5 c Let w = 4/4315 + 1722/4315. What is the second smallest value in w, -11, -41? -11 Let o = 2.84 + -2.64. Let d = -6 + 6.7. Let q = d - -0.3. What is the third biggest value in -2, q, o? -2 Let c = -459.8928 - 0.1072. Let b = 458 + c. Let j = -4 + 4.3. What is the second biggest value in b, j, -5, 3? j Let k = 35597 - 35601. What is the fourth smallest value in -5, k, 0.1, -4/5, 2/5? 0.1 Suppose 4x = 5o - 196 + 221, 0 = -2x - 5o - 25. Which is the second smallest value? (a) 1 (b) x (c) -2/59 (d) 5 b Let n = 1960.9 - 1961. What is the second smallest value in n, -2, 2, -5? -2 Let s = 340.1 - 339.6. Which is the biggest value? (a) -101 (b) 3 (c) s (d) -0.3 (e) 5 e Let o(i) = i3 - 44i*2 - 164i + 5360. Let y be o(45). Let g = -0.01 + 0.61. Which is the biggest value? (a) 1/5 (b) y (c) g (d) 3 b Let m = 4.3 + -0.3. Let z be (-1659)/(-474)1/(-7). What is the fourth biggest value in m, 0.3, z, -1? -1 Let h = -159.824 - 0.176. Let a = -159.6 - h. What is the third smallest value in 3, 0.1, a, 4? 3 Let r be ((-24)/(-30))/(-7 - (5 + 462/(-30))). What is the second biggest value in r, 0.3, 1/5, 1/11? r Let q = 731/5 - 146. Let l be ((-1222)/(-8))/(45/20). Let t = -68 + l. Which is the fourth biggest value? (a) q (b) -0.4 (c) t (d) -3 d Let x = -966 + 606. Let c = 365 + x. What is the second smallest value in -0.06, -2/9, c? -0.06 Let l = -22.2909 - 0.0091. Let h = l - -22.3. What is the third biggest value in 0.2, 2, h, -2/7? h Let k = -6 - -5.92. Let z = -66652 - -133301/2. Let l = 21 - 18. Which is the biggest value? (a) k (b) z (c) l c Let i be (-11)/3 - (-2)/(-6). Suppose 24h - 448 = 8h. Let u be 120/(-50)30/h - -2. Which is the smallest value? (a) i (b) 10 (c) u (d) 3 a Let v = -0.031 - 0.069. Let m be 2 + 3/31. What is the second biggest value in v, 13, m? m Let k = 3475 - 1009. Let i be k/72 - 3/(-1). Let n = 37 - i. What is the second biggest value in -2, -4/9, n, -1? -4/9 Let y = 2914222/7 + -416317. Suppose 0 = -o - 5c + 25 + 11, 3*c - 6 = 0. What is the biggest value in y, o, 5? o Let t = -3734.2 - -3721.2. Which is the smallest value? (a) t (b) -0.5 (c) 25 a Let o = -57 - -33.7. Let u = 28.3 + o. Which is the biggest value? (a) -2/11 (b) 4/3 (c) 2/9 (d) u d Let m be 8/(-1 + -	{ "pile_set_name": "DM Mathematics" }
(-22)/55 - 2/20. -1/2 (-10)/(-2)(4 - 3) 5 What is the value of 42/8 - (-84)/112? 6 What is the value of (-64)/80 - 1/5 - -4? 3 What is (3/(-2))/((-5)/(40/6))? 2 Evaluate 12 - ((-2)/4 + 15). -5/2 What is -8 + (-6)/(-4)(1 - -1)? -5 Evaluate (-32)/(-7) - (-33)/77. 5 What is 1(-12 - -5) - 0? -7 Evaluate (-3)/4 - (-598)/(-184). -4 What is the value of (-32)/14 + (4 - 2)? -2/7 Calculate (14/28)/(6 - 11). -1/10 ((-6)/(-10))/(28/28) 3/5 Calculate 12/(-96) + 33/72. 1/3 What is the value of 20/8 + 14/4? 6 Calculate -6((-2)/3 + (-119)/(-102)). -3 Evaluate (-15)/(-10) - 10/(-4). 4 (6/(-4))/(-6 + 44/8) 3 What is the value of 12/(-2) + (22 - 13)? 3 Evaluate ((-1)/4)/((-9)/27). 3/4 What is the value of 4/((-12)/15) - (-128)/28? -3/7 What is the value of (12/3)/(-20 - -18)? -2 What is the value of 42/(-10) + (-6)/(-30)? -4 Calculate 0 - 1/(-2)-10. -5 What is 81/108 - (-17)/4? 5 ((-3)/((-108)/80) - 2)-6 -4/3 Calculate (-4)/(-4) + (-10 - -10). 1 (-3 - 2)(-17)/(-17) -5 What is the value of (-12/35)/((-60)/(-300))? -2/7 What is (-157)/(-785) + 9/5? 2 What is the value of -4 - -8 - (-5 + 5)? 4 Evaluate 2/21 + 80/(-105). -2/3 What is 2(-6 + 2/(-4) + 3)? -7 What is ((-2)/142)/(21/(-49))? 2/3 Evaluate ((-2)/20)/(392/(-100) - -4). -5/4 What is (1 - 1) + 1/55? 1 Calculate (-4 - -4)/(-6) - 3. -3 What is the value of 2/(-11) + 102/(-165)? -4/5 Evaluate -2 + (3/4)/(6/(-24)). -5 Calculate 1 - 2 - 70/(-28). 3/2 What is (-8)/(-20)10/14-1? -2/7 What is 2 + (2/(-7))/((-1)/(-8))? -2/7 -3 + 552/208 - 1/(-2) 2/13 What is the value of 4/14(-71 - -57)? -4 Calculate (-171)/(-285) + (-3)/(-2) + -2. 1/10 Calculate (4 - 1)4/6. 2 What is 17/21 + 34/(-84)? 2/3 Calculate -8 - (-159)/18 - 2/4. 1/3 What is the value of 282/126 - 10/6? 4/7 Calculate (2/(-4)1)/(763/(-872)). 4/7 (-41)/(-451) + (-41)/88 -3/8 What is -2 + ((-126)/(-24) - 3)? 1/4 98/40 + -2 - (-253)/(-1012) 1/5 What is the value of (4/20)/(-2 + 3 - 2)? -1/5 Calculate (-6)/12-1 - 0. 1/2 Evaluate (356/(-72) + 5)4. 2/9 Evaluate -1(-11 + 7 + (-70)/(-17)). -2/17 Evaluate (6 - 66/12)8. 4 Calculate 0 + 7/(-2) - (2 + -6). 1/2 (-88)/132 - (-32)/66 -2/11 Calculate (-1)/(2/(-14)) - 7. 0 Evaluate -178 + 175 + (14 - 1). 10 What is the value of 11/6 + 1/8414? 2 ((-110)/33)/(-5) + (-1)/(-3) 1 Calculate -6 + 3 + 0/(-3). -3 Calculate (-1)/(-21)7 - (-55)/(-30). -3/2 What is (-6)/(-2) - (-1 - (-10)/2)? -1 Calculate (-1)/(-16) + 189/(-720). -1/5 ((210/12)/7)/((-10)/(-2)) 1/2 ((-1)/(-3))/((-5)/15) -1 Evaluate (-140)/(-98) - (-44)/(-21). -2/3 (-1)/(0 - ((-12)/(-20))/(-3)) -5 Calculate (-20)/903(-21)/14. 1 Calculate (-4)/(-15)(-3)/2. -2/5 What is (-12)/(-8)(-12)/(-126)? 1/7 Evaluate 1/(-8) - (-49)/392. 0 253/77-3 + 9 -6/7 What is the value of (-3)/(39/2) - 4563/(-15379)? 1/7 Calculate 8/(-32)0 - 2/(-13). 2/13 Evaluate 6 + (60/70 - (-151)/(-21)). -1/3 What is -37/((-210)/20)? 2 Calculate -64/54-1. 4/9 Evaluate -102/6 - (-43)/129. -3 What is (-35)/(-7) - 28/8? 3/2 Calculate (-336)/60 - (-7 + (-6)/(-3)). -3/5 Calculate 3(10/15)/(30/(-9)). -3/5 What is (-44)/23 - 4 - -6? 2/23 1/(-2)208/156-12 8 Calculate (-7)/(-2) - ((-7)/(-2) - 6). 6 3 + -7 + 460/69 8/3 (9/(-7) + 4/14)1 -1 Calculate -2 - 16/(-9) - (-325)/(-117). -3 224/28 - (-58)/(-8) 3/4 What is (-2)/((-44)/(-4))-6? 3 Evaluate (0 - -3)/(-143 + 154). 3/11 What is the value of (-121)/(-726)((-13)/(-4) - 1)? 3/8 Calculate (-33 - -29)/(-31 + 1). 2/15 Calculate (1 - 16/6)/(101/(-303)). 5 (-4)/10 + (561/(-55))/(-3) 3 What is the value of 2/((-2)/3 + (-16)/12)? -1 What is the value of (-51)/45 + (-6)/(-45)? -1 What is the value of 13/(260/72)(-5)/2? -9 What is -3 - (270/75 + (-2)/(-5))? -7 What is the value of (7 + (-54)/10)/((-4)/10)? -4 (4/(-60))/(3/18) -2/5 Evaluate ((-5)/(-10))/(3/(-2)). -1/3 3-1(-104)/(-52) -6 -2 - (38/14 + 12/42) -5 What is the value of (-155 - -163) + (-65)/8? -1/8 2(1 - (-57)/(-54)) -1/9 (-7 - -5)/((-3)/5 - -1) -5 What is (-4 + (-18)/(-4))0/(-2)? 0 What is (103/12 + -8)3? 7/4 What is the value of (-152)/627 + (-1)/11? -1/3 What is ((-6)/14 - 0)(-6)/(-9)? -2/7 Calculate 15/12(-6)/(-45). 1/6 What is ((-152)/(-20) - 1) + -6? 3/5 Calculate -4 + -8 + (-248)/(-20). 2/5 Evaluate 13/4 + ((-9)/(-12) - 1). 3 What is (1/(-6))/((-3)/(-15))? -5/6 What is the value of 3 + (5/((-20)/(-12)))/3? 4 Evaluate (8 - 2) + (-403)/1953. -1/5 What is the value of (-144)/(-30) + ((-36)/(-3))/(-2)? -6/5 Evaluate 0 + (-2)/9 + 112/(-144). -1 What is 93/18 - -30(-6)/36? 1/6 (18/(-150))/((-1)/(-5)) -3/5 What is ((-40)/(-25))/(22/(-55))? -4 Calculate (-57)/(-38)-41/(-2). 3 (18/(-10))/((-204)/340) 3 What is (42/(-105))/((-4)/(-10)) + 5? 4 Evaluate (-621)/1265 - 4/(4-11). -2/5 What is (-36)/198 + -3 + 459/165? -2/5 Evaluate (45/405)/((2/(-3))/2). -1/3 Evaluate -5(1 + (-301)/315). -2/9 Evaluate (3/(-27)-6)/(8/(-12)). -1 4/729 - (-2)/12 2/3 2 + 4 + (-4 - (-16 + 17)) 1 Calculate (-5)/15 - (-2)/((-12)/22). -4 -33(-4)/60 3/5 Evaluate 360/(-144)(-4)/(-6). -5/3 -5(-12)/150-1 -2/5 (-32)/80 - (-2)/(-20) -1/2 Calculate ((-2)/(-13) - (-114)/(-234))0. 0 What is the value of (03/(-15))/3? 0 Evaluate ((-200)/24 + 8)-1. 1/3 -140/(-84) - 2/6 1/7 Evaluate (-2)/3(-639)/(-1562). -3/11 Calculate (-3 - -2)4/((-4)/1). 1 What is the value of (-9)/((-45)/20)-1? -4 Evaluate -31-85/(-480). -1/4 Calculate (11/2 + -6)12/14. -3/7 What is (-14)/21 + 16/42? -2/7 (0 + 2)(-9)/42 -3/7 What is the value of 3/(-8) + (-5 - 94/(-16))? 1/2 Evaluate (-4 - (-123)/12) + -2 - 4. 1/4 What is (4 - 245/56)/(3-1)? 1/8 Evaluate (9/6 + -1)8. 4 ((-1)/3)/(64/(-192)) 1 (208/195)/(-1) - 2/(-5) -2/3 Evaluate 4/(-32)88/(-33). 1/3 (-4)/14 + -1 + 9/7 0 ((-96)/(-80))/(80/(-25)) -3/8 What is the value of (3 + -2)/(-3 - -2)? -1 What is the value of 96/20 + 12/(-3)? 4/5 ((-108)/(-26) - 6/39) + 0 4 What is 2175/1218 - 2(-1)/(-7)? 3/2 What is 18/36 - (-18)/4 - -2? 7 What is the value of (18/(-4))/((-63)/(-12))? -6/7 (119/(-238))/((-2)/(-8)) -2 Calculate 58/(-232)(-4)/11. 1/11 Evaluate (-3(-8)/(-6))/(-26). 2/13 (145 - -2)/21(-2)/7 -2 What is the value of ((-4)/(-10))/((-4)/20)? -2 Evaluate 336/70 - 8/10. 4 Evaluate (-2)/(-31) + (-10251)/(-2077). 5 (-64)/(-10) - (-847)/(-121) -3/5 What is the value of 1 - (27 + -26)(0 + -3)? 4 (2(-9)/45)/(4/5) -1/2 Evaluate (9/18)/((-6)/(-8)-2). -1/3 What is -4 + (9 - 8 - (-4 - 0))? 1 Evaluate (0 + 72/8)-1. -9 What is the value of 3/(-2)172/430? -3/5 Evaluate (-7)/(-28)-4-1. 1 What is the value of ((-18)/(-48))/((-18)/(-32))? 2/3 What is the value of -6 + 0 - (-92)/15? 2/15 Calculate (-3)/30(-2)/(-2). 0 Evaluate 37 + -45 + 0 + 14. 6 (-51)/(-34)(4 + 204/(-45)) -4/5 Evaluate 7/(-2) - 114/(-12). 6 8 - (-75)/(-10)2 -7 -3((-20)/3)/(-10) -2 What is the value of (-1)/(-7)(-308)/(-66)? 2/3 (-29)/9 - 2/(-9) -3 80/606/(-24) -1/3 What is the value of (-6)/6(4 - 2)? -2 What is the value of 3/21(-21)/18? -1/6 12/20 - (-115)/(-25) -4 What is the value of 93/15 + (7 - 61)/9? 1/5 What is 251/(-78) + 91/546? -2/13 Evaluate -13 + 11 - (-8 + 4). 2 What is the value of ((-45)/10 + 3)(-4)/(-6)? -1 What is 465/1350 + (-44)/99? -1/10 Calculate ((-4812)/(-348) + -14)(-2)/5. 2/29 Calculate (112/204)/(-1) + 6/(-51). -2/3 What is 61/122(-13 - -1)? -6 Evaluate (-1 + -7 - -2) + 52 + -47. -1 What is (-5 + 7)(3 - 5)? -4 Calculate (0 - -7) + (-1)/(0 - -1). 6 Calculate (-7 - 0)/7 + (3 - -1). 3 What is (6/(-14))/(-3) - (1 + -1)? 1/7 Evaluate 10/(-60)(-4)/1. 2/3 Calculate ((-9)/8)/(3 - (-9)/(-2)). 3/4 What is 4 + 60/(-52) + (-2 - 1)? -2/13 Evaluate ((-1)/44)/((-3)/(-9)). -3 What is 68/7 + -10 - 12/7? -2 Evaluate 3/(-2)66/132. -3/4 What is the value of 8/(-12)9/42? -1/7 What is the value of ((-30)/9)/(14/(-6) - -3)? -5 -8 + -1 + 12/12 -8 (-4 + 2)(-2)/8 1/2 Calculate 4 + -9(-2)/(-3). -2 What is 0 + ((-34)/9 - -4)? 2/9 What is ((-2)/(-18))/((-8)/(-8))? 1/9 What is the value of (-32)/(-96) + (-1 - (-38)/48)? 1/8 Evaluate (21/(-42))/(33/(-12)). 2/11 (140/(-63))/4(-36)/30 2/3 What is (-5)/(-25) - (2 - 58/10)? 4 What is (-3)/4 + (-4)/(-8)? -1/4 Evaluate (-43)/(-516) - (-26)/(-24). -1 Calculate (64/6)/2. 2 Calculate (5 - 3 - 7)(-18)/(-10). -9 What is the value of (8/14)/((-126)/49)? -2/9 What is (-5)/(-20)8 - 0? 2 Evaluate 7/((-315)/(-12))(-9)/3. -4/5 What is 2 - (12/8)/1? 1/2	{ "pile_set_name": "DM Mathematics" }
d to 7 dps? 0.0000034 Let v = 1418.46836 + -439.10837. Let i = v + -978.96. Let t = -0.4 + i. What is t rounded to 4 decimal places? 0 Let n = 19705.9 - 19706.089981. Let m = 0.028 - 0.218. Let y = m - n. Round y to five decimal places. -0.00002 Let d(u) = -u*2 - 3u + 3. Let f be -7 + 1 + (-9 - -13). Let y be d(f). Suppose yg + 4099992 = -4c, -c = 3c - 8. Round g to the nearest 100000. -800000 Let t = 372177305.999817 + -372177664. Let u = -358 - t. Round u to 4 decimal places. 0.0002 Suppose -5d - 5l = -1814490, 130236 = d - 3l - 232670. What is d rounded to the nearest one thousand? 363000 Let j be 818999(-1)/4-4. Let w = j - 175999. Round w to the nearest one hundred thousand. 600000 Let w = 353.0409 - 0.0409. Let c = w + -353.0064. What is c rounded to 4 dps? -0.0064 Let z = 123.67794 + -1259.38934. Let x = 1134.01139532 + z. Let s = 1.7 + x. Round s to 6 dps. -0.000005 Let d = -461 - 14. Let c = -474.997852 - d. Round c to four dps. 0.0021 Let d = -1713.19999938516 - -1713.2. What is d rounded to seven decimal places? 0.0000006 Let a = -0.18355 - -0.169641. Let i = -0.01607 - a. What is i rounded to 4 decimal places? -0.0022 Let t = -1679.900084 - -1679.9. Round t to five dps. -0.00008 Let t(g) = 13g2 + 2g + 161. Let u(d) = 28d2 + 3d + 323. Let v(z) = 7t(z) - 3u(z). Let a be v(31). Round a to the nearest 1000. 7000 Let q = 175.45 - -114.27. Let p = 295 - q. What is p rounded to the nearest integer? 5 Let r = -7542723600 + 7545789602.29917. Let l = r - 3065984. Let d = l - 18.3. Round d to four decimal places. -0.0008 Suppose -1875 = -3f + 5c, -45f + 4c - 3162 = -50f. What is f rounded to the nearest one hundred? 600 Let t = -101246 - -22122. What is t rounded to the nearest 10000? -80000 Let v = 87361.496999822 + -87361.621. Let r = -0.124 - v. What is r rounded to seven decimal places? 0.0000002 Let u = -438.127 + 438. Let y = -1.12917 + 1.0027. Let l = u - y. What is l rounded to four decimal places? -0.0005 Suppose -w = 2q - 13, 4q = 6q - 8. Suppose -wn + 9000000 = 5a, 4n - 7200000 = -0n + 4a. What is n rounded to the nearest 100000? 1800000 Let d = -11369 + 11411.908. Let z = d + -43. Let r = 0.084 + z. What is r rounded to 3 decimal places? -0.008 Let b = -0.0209 - 126.9791. Let s = 126.998096 + b. Round s to four dps. -0.0019 Let z = -99404 - -153709. Let s = z - 54613.59. Let c = -310 - s. What is c rounded to 1 dp? -1.4 Let w = -113.68 + 113.57682. Let f = -0.1 - -0.202. Let i = w + f. Round i to 4 dps. -0.0012 Let p = 43.508 + -43. Let h = -21430.4 + 21429.892478. Let f = h + p. What is f rounded to five decimal places? 0.00048 Let b = -10445453 - -10445527.70397. Let j = -1571 - -1645.7. Let z = j - b. Round z to four decimal places. -0.004 Let t = 6610 - 6610.37206. Round t to 2 decimal places. -0.37 Let o = 58575.447 + -58600. Let y = -23.9 - o. Round y to 2 dps. 0.65 Let t = -444 - 752. Let o = 1196.0691 + t. Round o to 2 decimal places. 0.07 Let x = -1.757 + 0.017. Let h = 989988 + -989986.260198. Let u = x + h. Round u to five decimal places. -0.0002 Let x(c) = 13c - 1. Let h be x(2). Let z(d) = -d*3 - 8d*2 - 3d - 3. Let v be z(-8). Suppose vf = hf + 16. Round f to zero decimal places. -4 Let o = -1.39 + 35.39. Let k = -56.6 - o. What is k rounded to the nearest 10? -90 Let d be -2 - -1 - (-135)/9. Let g be (d + -14)(-2)/4. Suppose 0 = -gr - 2r + 2k + 12804, -3r = 2k - 19196. What is r rounded to the nearest 1000? 6000 Let u = 44.658 - -0.642. Let i = -41.12 + u. Round i to the nearest integer. 4 Let k = 0.97 + 661.03. Let v = 1288.5 + -1831.8. Let h = v + k. Round h to the nearest ten. 120 Let j(w) = 116391w2 - 4w - 105. Let q be j(-10). Suppose 28o = -q - 16808965. What is o rounded to the nearest 100000? -1000000 Let y(j) = j3 - 5j*2 - 8j - 2. Let u be y(5). Let l be (-56280007)/u - (-1)/(-6). What is l rounded to the nearest 100000? 1300000 Let r(y) = -y*3 - 9y*2 + 6y - 10. Let m be r(-10). Let p be (4 + -3)3 + m. Suppose pj - 27j = 223200. What is j rounded to the nearest one thousand? 37000 Let o = -0.62201 + 0.62174211. What is o rounded to 4 dps? -0.0003 Let t(x) = 5x*3 + 2 + 4051x - 4036x + 15 + 3x*2. Let c be t(-9). What is c rounded to the nearest one hundred? -3500 Let l = -0.004209 - -279.714209. Round l to the nearest integer. 280 Suppose -4 = 4s - 36, 0 = h + 4s - 295052. Round h to the nearest one thousand. 295000 Suppose 95p - 101p + 60 = 0. Let q(u) = -20999u*2 - 11u + 10. Let l be q(p). Round l to the nearest 1000000. -2000000 Let l = 31.692 + -5.902. Round l to the nearest integer. 26 Let f = 9.309999901 - 9.31. Round f to 7 dps. -0.0000001 Let m = -322 + 3206. Suppose 7f = -245 + m. What is f rounded to the nearest one hundred? 400 Let y = 2845 + -3163.8. Let k = 279 + y. What is k rounded to the nearest 10? -40 Let c = 8.079 + -8.078765. Round c to 4 dps. 0.0002 Let a = -15145 + 15144.9818. What is a rounded to 1 decimal place? 0 Let t = -0.4404 + 0.211. Let l = 0.0506 + t. What is l rounded to two dps? -0.18 Let b = 46913.642 + -46857. What is b rounded to the nearest ten? 60 Let y = 183549 - 183572.0662. Round y to 0 decimal places. -23 Let x = 161638830 + -161638904.9999448. Let s = x + 75. What is s rounded to 5 decimal places? 0.00006 Suppose 0 = 5j + q + 1182798, 562108 + 620698 = -5j + 3q. What is j rounded to the nearest one thousand? -237000 Let f = 64 + -106. Let s = 46.401359 - 4.401489. Let n = f + s. Round n to four decimal places. -0.0001 Let d = -207 + 203.89. Let w = 160.11 + d. Let c = w + -156.99999867. Round c to 7 dps. 0.0000013 Let n = -6862.67 - -7460.4. What is n rounded to the nearest one hundred? 600 Let w = 9.996 + 1022.204. Round w to the nearest 100. 1000 Let k(m) = -2830m3 + 2m*2 + 42m + 10. Let s be k(-5). What is s rounded to the nearest 100000? 400000 Let v = -199865 - -199986.601. Let m = v - 122.2. What is m rounded to 2 dps? -0.6 Let f = 0.36 + 449.64. Let d = f + -450.000031. What is d rounded to four dps? 0 Let y = 31.98 - 31.9807058. What is y rounded to four dps? -0.0007 Suppose 0 = -13c + 37321731 + 19930321. Suppose 4s + c = 2o, -5s = -o + 4277061 + 1227941. Round s to the nearest one hundred thousand. -1100000 Suppose -4w + 220 - 4 = 0. Suppose -3h = 3x - w, 0 = -3x - x + 4h + 56. Suppose xy = 11y + 215000. What is y rounded to the nearest 10000? 40000 Let b = -91.698635473 - -77.76135916. Let i = b + -0.062730187. Let y = 14 + i. Round y to six dps. -0.000007 Suppose -105n - 12858 = -111n. Round n to the nearest 100. 2100 Let k = 5067.6 + -5691. Round k to the nearest one hundred. -600 Let b(z) be the second derivative of 499z5/20 - z4/12 + 5z3/6 + 11z*2 - 149z. Let h be b(6). What is h rounded to the nearest one hundred thousand? 100000 Let w = 7.58 + -1.03. Let x = -6.5499637 + w. Round x to six dps. 0.000036 Suppose -4g - 5q = -231605, 0g = -2g - q + 115801. Suppose 8h - 23h - g = 0. Round h to the nearest one hundred. -3900 Suppose 3z - 3t = -4461000, -16z - 4t + 4461000 = -19z. What is z rounded to the nearest 100000? -1500000 Suppose 6f + 4563063 = 7f - 40937. What is f rounded to the nearest 100000? 4600000 Let l = 0.026 - 336.026. Let b = 336.000237 + l. What is b rounded to 5 decimal places? 0.00024 Let d = -2318.300224 + 2318.3. Round d to five dps. -0.00022 Let v = -273.37 + 309.394. Round v to the nearest integer. 36 Let n = 231.4 - 1511.4. Let i = n - -1141.9. What is i rounded to the nearest 10? -140 Let s = 0.4625 - 0.473234. What is s rounded to 4 decimal places? -0.0107 Let j = 12878 - 12435.8. Round j to the nearest integer. 442 Let d = 1401.9 + 47.7. Let b = d + -1822. Round b to the nearest one hundred. -400 Let a = 11791 + -11682.07. Round a to the nearest integer. 109 Suppose -2g - 17 - 13 = 2t, 5g + 73 = -3t. Let f = -10 - g. Let y be 1 + 103001(-4)/f. Round y to the nearest 10000. -100000 Suppose -2376z + 2436z - 34761600 = 0. Round z to the nearest one thousand. 579000 Let u = 15302.999969352 - 15303. Round u to seven decimal places. -0.0000306 Let c be ((-86)/8)/(15/242340). Let w = 177323 - c. What is w rounded to the nearest one hundred thousand? 400000 Let w = 6299.4 + -1489.8. Let v = 4809.6139708	{ "pile_set_name": "DM Mathematics" }
7z3 + 150z*2 + 3z + 6. Let v(p) = 16p3 - 298p*2 - 8p - 14. Calculate -5s(h) - 2v(h). 3h3 - 154h*2 + h - 2 Let m be (3 + -2)(-3)/(-7(-4)/(-28)). Let z(r) = 3r3 - r3 + 3r3 + 12r + 8r2. Let p(i) = -2i*3 - 3i*2 - 4i. What is mz(w) + 8p(w)? -w*3 + 4w Let s(d) = -2d + 1. Let x = 582 - 578. Suppose -2r - 5h = 0, h - 4h = xr + 14. Let l(o) = o3 - 5o + 2. What is rs(i) + 2l(i)? 2i3 - 1 Let j(t) be the first derivative of -t5/15 + t3/3 - 43t*2/2 + 53. Let k(x) be the third derivative of j(x). Let o(w) = 15w. Calculate 5k(b) + 3o(b). 5b Let n(w) = 1 + 21w - 21w + 2w*2 + 7w. Let d be n(-2). Let v(g) = g*2. Let l(j) = 2j*2. What is dl(y) + 8v(y)? -2y*2 Let k(w) = 39w - 27. Let v(z) = 168z + 64. Let r(q) = 5q + 2. Let x(s) = 33r(s) - v(s). Let j(d) = 2d - 2. Let c be j(2). What is ck(l) + 27x(l)? -3l Let b(o) = -o2 + o + 1. Let v(s) = 488s*2 - 477s*2 + 5s - 2s - 7 + 9. What is 6b(n) - 2v(n)? -28n2 + 2 Let t(d) be the first derivative of d4 + 3d2/2 - 3d + 156. Let x be (-34)/(-4) - (4/8)/1. Let v(h) = 11h3 - h2 + 8h - 8. Determine xt(z) - 3v(z). -z*3 + 3z*2 Let h(i) = 2i*3 - 13i*2 + 7i. Let n(r) be the first derivative of 0r + 3/2r*2 - 32 + 1/4r*4 - 2r*3. Determine -6h(d) + 13n(d). d3 - 3d Let t(p) = 14p2 + 6. Let r be ((-10)/4)/(2/(-4)). Let z(u) be the first derivative of 3u*3 + 4u - 57923. Give rt(f) - 8z(f). -2f2 - 2 Let o(w) = 10w*2 - w - 6. Let j(r) = 10r*2 - r - 9. What is 2j(k) - 3o(k)? -10k*2 + k Let v(c) = c + 1. Let b be (-68)/(-28) + -3 - 5/3524. Let x(t) = t. What is bv(r) + x(r)? -3r - 4 Let q(d) = -559d + 6. Let w(u) = 338762u - 3638. What is 3638q(k) + 6w(k)? -1070k Let a(o) = -19o*3 - 6o*2 + 6o + 39. Let y(f) = 19f3 + 5f*2 - 5f - 39. Determine 5a(v) + 6y(v). 19v3 - 39 Let w(b) = 5b + 15. Suppose -2z + 4o - 24 = 0, 0 = -33z + 31z + 3o - 20. Let v(a) = -14a - 44. Calculate zv(n) - 11w(n). n + 11 Let y(z) = -12z3 + 134z*2 + 62z - 17. Let a(x) = -4x3 + 45x*2 + 22x - 6. Give 17a(m) - 6y(m). 4m3 - 39m*2 + 2m Let k(d) be the third derivative of 13d5/30 + 13d4/12 - d3 + 132d2 - d. Let y(x) = 5x*2 + 5x - 1. Give -3k(l) + 16y(l). 2l2 + 2l + 2 Let b(d) = 2d3 - 7d*2 + 3d - 2. Let r(n) = 6n3 - 20n*2 + 8n - 6. Let q = 273 + -276. Determine qr(a) + 8b(a). -2a3 + 4a*2 + 2 Let p = -8 - -13. Let y(r) = 4r*3 - 5r*2 + 2r - 5. Let h(q) = 2q + 3q + 7q3 - 11 - 11q*2 - 9q*3 + 6q*3 + 5q*3. Determine py(t) - 2h(t). 2t*3 - 3t*2 - 3 Let q(o) be the second derivative of -13o*3/6 - 11o + 15. Let h(k) = -7k. Determine -7h(s) + 3q(s). 10s Let p(w) = -206w2 - 26w - 670. Let j(v) = -40v2 - 5v - 134. What is -26j(m) + 5p(m)? 10m2 + 134 Let o(m) = 13m + 283. Let z(g) = 34g + 565. Give -10o(y) + 4z(y). 6y - 570 Let j(c) = -3c2 - 2c + 9. Let h(k) = -20k2 - 1606k + 50. What is h(a) - 6j(a)? -2a*2 - 1594a - 4 Let s(g) = 4g. Let f(c) = -11c - 2. Let m(n) = f(n) - 2s(n). Let q(o) = o. Give -m(t) - 3q(t). 16t + 2 Let q(a) = a - 15. Let h be -6(-5)/3(-6)/(-3). Let w be q(h). Suppose -5o + 40 = wo. Let d(x) = 5x + 3. Let m(p) = 5p + 4. Determine od(b) - 3m(b). 5b Let x(u) = 3u + 2u*2 - 2u*2 + 2u*2 - 5u*3. Let i(j) = 93j*3 - 194j*3 + 3j - 4j - j2 + 289j*3 - 187j*3. What is 3i(c) + x(c)? -2c3 - c2 Let r(p) = -5p*2 + 9p - 5. Let c(q) = -3q2 + 5q - 3. Let o(h) = 7c(h) - 4r(h). Let x(b) = 2b2 - 4b - 2. What is -2o(m) + x(m)? 4m*2 - 2m Let f(g) = -g*3 - g - 1. Let u(w) = -5w*3 - 15w*2 + 16w - 7. Determine 7f(m) - u(m). -2m*3 + 15m*2 - 23m Let j(p) = -7p - 17. Let w(m) = -21m - 89. Let l(b) = 6b + 25. Let r(y) = -22l(y) - 6w(y). Determine -5j(h) + 6r(h). -h - 11 Let h(v) = 5v + 4. Let l(c) = -c - 1. Let s(i) = h(i) + 4l(i). Let m(d) = 32d + 21. Let k be m(-1). Let p(o) = 2o. Let w = 8 - 4. Give ks(f) + wp(f). -3f Let m(l) = -l*2 - 1. Suppose 10326d = 10312d - 14. Let b(g) = -37g*3 + 3g*2 + 3. What is db(i) - 3m(i)? 37i*3 Let f(x) = -20x*3 - 6x. Let j be (-938)/804 - (-58)/(-12). Let q(b) = b*3 - b. Determine jq(a) + f(a). -26a3 Let s = -48 + 45. Let v(n) = 3n*2 - 1. Let o(t) = 7t*2 - 2t - 9. Let i(q) = -8q2 + 3q + 12. Let d(g) = 3i(g) + 4o(g). Determine sv(y) + 2d(y). -y*2 + 2y + 3 Let s(v) = -18v - 1096. Let k(l) = 5l + 364. Determine -14k(o) - 4s(o). 2o - 712 Let u(w) = 7w*2 + 24w. Let d(j) = -4j2 - 10j - 3. Let m(l) = -l*2 + 2l - 3. Let i(q) = -d(q) + m(q). What is -5i(f) + 2u(f)? -f*2 - 12f Let x(r) = 99r - 2366. Let q(i) = 10i - 239. Calculate 21q(m) - 2x(m). 12m - 287 Let g(r) = 40r*3 + 154r*2 + 36r + 28. Let o(x) = 8x3 + 31x*2 + 8x + 6. What is 3g(s) - 14o(s)? 8s3 + 28s*2 - 4s Let k(r) = -3545r - 9. Let x(t) = 804712t + 2040. Calculate -680k(u) - 3x(u). -3536u Let n(b) = -8b*3 - 8b*2 - 8b - 8. Let w(m) be the third derivative of m5/60 + m4/24 + m*3/6 + 327m*2. Determine n(a) + 8w(a). -8a3 Let b(d) = -3d*2 - 6d - 7. Let g(i) = -2i2 - 5i - 6. Let h be 4/4-4-1. Suppose 2 - h = -z. Suppose j + zj = 15. Calculate jg(v) - 4b(v). 2v*2 - v - 2 Let d(i) = i. Let m = -7435 + 7425. Let q(b) = -36b + 2. What is md(u) - q(u)? 26u - 2 Suppose 7 = 4s + i, 32s = 29s + 5i - 12. Let m(b) = -6b3 + 2b + 4. Let c(u) = -u*3 - 1. Calculate sm(x) + 2c(x). -8x*3 + 2x + 2 Let p(c) = 0c - 29 - 311 + 340 + c. Let b(w) = 5w - 14. Determine -b(l) + 2p(l). -3l + 14 Let f(t) = 38t - 5. Let y(h) = -57h + 7. Let s(z) = z*3 + 65z*2 + 16z + 1035. Let c be s(-65). Determine cy(d) - 7f(d). 19d Suppose 75b + 281b - 2136 = 0. Let t(i) = 3 - 4 + 5 - 3i. Let n(m) = 3m - 5. Determine bn(o) + 7t(o). -3o - 2 Let a(n) = 12n2 + 9n - 7. Suppose 0 = m + 1, 53 - 73 = -2i - 2m. Let b(o) = 6o2 + 5o - 4. Give ib(w) - 6a(w). -6w2 + w - 2 Let l = 277 - 517. Let f = l - -236. Let w(m) = 1. Let x(o) = 3o*2 + 2o + 6. Determine fw(y) + x(y). 3y*2 + 2y + 2 Let y(k) = 105k - 1. Let d(g) = -1435028g + 13538. Calculate -d(s) - 13538y(s). 13538s Let d(k) be the first derivative of k4/12 + k2/2 + 79k + 93. Let y(u) be the first derivative of d(u). Let b(j) = 5j*2 - 1. What is -b(g) - y(g)? -6g*2 Suppose 2f - 2a + 8 = 0, -2f - a - 20 = -0f. Let z(x) = 62x - 3 - 1 - 129x + 86x. Let q(r) = 29r - 6. Give fz(u) + 5q(u). -7u + 2 Let h(p) = 2860p3 + 20p*2 + 10. Let y(x) = 953x*3 + 6x*2 + 3. What is 6h(n) - 20y(n)? -1900n*3 Let x(j) = 16j*2 - 185j + 13. Let p(h) = 4h2 - 46h + 3. Determine -13p(o) + 3x(o). -4o2 + 43o Let z(m) = 12m3 + 238m*2 - 39m + 50. Let y be z(-20). Let c(x) = 9x3 - 15x*2 - 15x - 15. Let l(w) = -w3 + w2 + w + 1. What is yl(b) + 2c(b)? -12b3 Let f(d) = -3d*3 - 11d*2 + 15d + 7. Let m(o) = -2o3 - 6o*2 + 8o + 4. Suppose 879v + 10 = 4g + 877v, -g + 34 = 4v. Determine gf(l) - 11m(l). 4l3 + 2l - 2 Let t(k) = 4k3 + 2k*2 + 2k + 9. Let q(i) = 4i3 + 3i*2 + 5i + 14. What is 2q(x) - 3t(x)? -4x3 + 4x + 1 Let d(c) = 5c - 2. Suppose 11o - 163 = -8b, 3b - 2o + 12 = 2o. Let j(z) = -1 + 3z - 3z + 3z. What is bj(f) - 5d(f)? -f + 2 Let t(g) = 12g*2 + g - 3. Let z(s) = -13s*2 - s + 4. Suppose 0 = -n + 3j - 1, 2n + j = -0n + 12. What is nz(a) + 6t(a)? 7a2 + a + 2 Let v(u) = 5u + 396. Let l(a) = 8a + 395. What is 2l(y) - 3v(y)? y - 398 Let b(z) = -z3 - 3z*2 + 3z. Let s = -79 + 100. Suppose 2u = 15 - s. Let j = 8 - 16. Let p(x) = 2x*3 + 8x*2 - 8x. Give jb(d) + up(d). 2d3 Suppose 0 = -g + 5f + 16, -236g + 2f - 8 = -232g. Let m(q) = q. Let j(h) be the second derivative of -4h3/3 - h2/2 - 2h. Give gm(b) - j(b). 4b + 1 Let h(m) = -4m. Let v(t) = -t. Suppose q = 6q + 305. Let z = q - -65. Suppose -5f = 9 - z. Calculate fh(b) + 2v(b). 2b Let i(j) = -13j*2 + 7j - 14. Let z(y) be the first derivative of -7y3/3 + 2y*2 - 7y - 2844. Give 3i(g) - 5z(g). -4g2 + g - 7 Suppose 0 = -5j - 2j - 518. Let b(c) = 70c - 1. Let i be b(1). Let x = j	{ "pile_set_name": "DM Mathematics" }
354 (base 16) in base 8? -1524 -7ed (base 15) to base 3 -2110121 Convert 101001 (base 2) to base 5. 131 -197 (base 14) to base 4 -11021 Convert -51 (base 7) to base 6. -100 Convert -1041 (base 9) to base 12. -53a Convert 101302 (base 6) to base 14. 2d4a Convert -1001 (base 6) to base 12. -161 What is -174 (base 12) in base 16? -e8 What is -445 (base 11) in base 9? -652 -d8f (base 16) to base 5 -102341 Convert 40082 (base 9) to base 13. bc96 Convert -1123 (base 4) to base 12. -77 3401 (base 6) to base 4 30121 Convert 1574 (base 9) to base 3. 1122111 -54740 (base 8) to base 3 -1011120011 Convert -17078 (base 10) to base 5. -1021303 Convert -12011 (base 3) to base 6. -351 Convert -13721 (base 12) to base 14. -9b73 What is -22141 (base 6) in base 10? -3085 100012 (base 3) to base 6 1052 Convert 1209d (base 14) to base 10. 44043 -cc7 (base 13) to base 8 -4217 -37153 (base 9) to base 3 -1021011210 What is 10110110 (base 2) in base 12? 132 Convert 113 (base 9) to base 13. 72 10100110000101 (base 2) to base 15 3239 -764 (base 11) to base 16 -395 Convert -116240 (base 7) to base 11. -15088 -2928 (base 16) to base 12 -6120 Convert 247 (base 9) to base 14. 109 1cdc (base 16) to base 4 1303130 17711 (base 8) to base 12 4861 What is -56 (base 7) in base 16? -29 302031 (base 4) to base 8 6215 Convert -350 (base 16) to base 7. -2321 Convert -1032 (base 13) to base 3. -10001220 -1a98 (base 13) to base 11 -3018 11011021 (base 3) to base 15 d71 What is 3350 (base 9) in base 12? 1523 What is 707 (base 14) in base 11? 1044 Convert 23b (base 13) to base 15. 1ad 1001131 (base 4) to base 8 10135 What is 8c5 (base 13) in base 16? 5e9 21202210 (base 3) to base 9 7683 Convert 42104 (base 6) to base 10. 5656 -5115 (base 8) to base 14 -d65 What is -34 (base 6) in base 5? -42 What is 11878 (base 14) in base 2? 1010011101010010 Convert 112102 (base 3) to base 15. 1ae What is 345 (base 8) in base 4? 3211 -288 (base 16) to base 14 -344 4032 (base 5) to base 7 1336 665 (base 11) to base 2 1100011101 Convert 10ab (base 14) to base 13. 1419 Convert -110136 (base 9) to base 3. -10100011020 35d3 (base 15) to base 3 120201000 What is -27162 (base 8) in base 4? -2321302 Convert -45 (base 10) to base 6. -113 What is -1654 (base 8) in base 15? -42a -45069 (base 10) to base 11 -30952 Convert -24225 (base 9) to base 5. -1004343 101001000 (base 2) to base 11 279 -321555 (base 7) to base 8 -155053 -200111 (base 3) to base 4 -13303 Convert -456 (base 12) to base 5. -10032 -2212 (base 3) to base 2 -1001101 15600 (base 8) to base 10 7040 What is 103575 (base 8) in base 6? 424325 Convert -52245 (base 6) to base 12. -4085 2001 (base 3) to base 15 3a Convert -8770 (base 11) to base 3. -120212121 Convert -101010111001 (base 2) to base 7. -11001 What is 1000010001010 (base 2) in base 15? 13c4 a296 (base 12) to base 10 17682 Convert -31110100 (base 4) to base 2. -1101010100010000 What is 2112222001 (base 3) in base 2? 1100010001100011 Convert -210020 (base 3) to base 13. -351 What is 10223 (base 4) in base 15? 14e 6050 (base 7) to base 12 1265 Convert 11501 (base 7) to base 4. 232232 -91 (base 15) to base 11 -114 -cab (base 13) to base 12 -1309 What is a3 (base 13) in base 7? 250 1001 (base 5) to base 2 1111110 Convert -1000100111 (base 2) to base 16. -227 What is -1022020 (base 3) in base 13? -582 -101110112 (base 3) to base 7 -31145 What is 1465 (base 9) in base 11? 921 What is -2c1 (base 13) in base 14? -275 -102212010 (base 3) to base 16 -21c3 Convert 11100100 (base 2) to base 12. 170 -123311 (base 5) to base 8 -11337 What is 14123 (base 7) in base 4? 323333 What is -4415 (base 9) in base 15? -e6e What is 556 (base 10) in base 2? 1000101100 What is 1fa (base 16) in base 9? 622 13414 (base 6) to base 9 2781 8315 (base 10) to base 5 231230 What is -835 (base 11) in base 16? -3ee Convert c41 (base 13) to base 6. 13345 26410 (base 8) to base 12 6808 Convert -4e6 (base 16) to base 2. -10011100110 8a (base 14) to base 12 a2 What is 102002 (base 4) in base 13? 6aa What is 4c8c (base 13) in base 7? 43605 What is 52b (base 12) in base 13? 461 -122032 (base 4) to base 12 -b7a What is -115007 (base 9) in base 15? -157c7 -3246 (base 7) to base 8 -2211 Convert 1100111001101 (base 2) to base 7. 25154 What is -412203 (base 5) in base 14? -4c72 -1188 (base 16) to base 6 -32440 What is -2230 (base 6) in base 12? -376 Convert 414b (base 13) to base 6. 105432 What is 54226 (base 7) in base 4? 3102313 Convert 61861 (base 9) to base 3. 2001222001 20155 (base 6) to base 11 2001 Convert 21311230 (base 4) to base 12. 1b3a4 112515 (base 6) to base 15 2d15 What is 6ee (base 15) in base 12? ab2 Convert 191c (base 14) to base 8. 10666 -4147 (base 14) to base 13 -5163 What is -401 (base 16) in base 6? -4425 -13400 (base 5) to base 10 -1100 Convert -103203 (base 4) to base 12. -883 What is 1000111111 (base 2) in base 6? 2355 Convert aa9 (base 12) to base 15. 6e9 Convert -11212202 (base 3) to base 10. -3557 1263 (base 8) to base 7 2005 What is -8814 (base 13) in base 16? -4a01 -1211202 (base 5) to base 6 -252553 1101031 (base 4) to base 2 1010001001101 -b15c (base 13) to base 7 -131114 Convert -8448 (base 10) to base 11. -6390 What is 413 (base 12) in base 3? 210220 What is 436 (base 9) in base 3? 111020 11111000110010 (base 2) to base 6 201414 What is -330 (base 12) in base 15? -213 Convert 111214 (base 6) to base 15. 2b9a -5620 (base 9) to base 13 -1b72 What is -410 (base 6) in base 14? -aa 64cc (base 13) to base 4 3123022 What is -428 (base 9) in base 15? -185 Convert 200211101 (base 3) to base 11. a349 What is -1223214 (base 5) in base 9? -35276 What is 340244 (base 5) in base 4? 2322231 What is 279 (base 15) in base 5? 4224 -12623 (base 10) to base 14 -4859 What is -12a4 (base 11) in base 15? -777 What is 314 (base 7) in base 10? 158 Convert 11001110110 (base 2) to base 16. 676 3ce4 (base 16) to base 12 9030 Convert -295 (base 15) to base 8. -1116 What is -100000111110101 (base 2) in base 5? -1020020 84c (base 16) to base 8 4114 What is 10011001101110 (base 2) in base 15? 2dad Convert -12847 (base 10) to base 13. -5b03 100110011101 (base 2) to base 6 15221 Convert -839c (base 16) to base 11. -2334a What is -1523 (base 8) in base 15? -3bb bcc (base 15) to base 9 3583 -ce (base 15) to base 10 -194 Convert -11598 (base 12) to base 13. -a7b4 -66c2 (base 15) to base 8 -52426 Convert 2ca (base 13) to base 9. 620 Convert 1c034 (base 13) to base 6. 1102252 What is 65064 (base 8) in base 14? 9ca0 Convert 1200211020 (base 3) to base 11. 23109 Convert 11111111 (base 2) to base 16. ff -d93 (base 16) to base 2 -110110010011 What is -16515 (base 11) in base 4? -11223100 Convert -6a8a (base 14) to base 10. -18546 Convert bea (base 16) to base 6. 22042 What is -2113211 (base 4) in base 13? -4553 -1110 (base 7) to base 15 -1b9 Convert -11200233 (base 4) to base 13. -a377 -2104 (base 6) to base 13 -2a4 What is 1100001011 (base 2) in base 15? 36e Convert -208c (base 15) to base 10. -6882 What is 30053 (base 6) in base 3? 12101020 Convert -234021 (base 6) to base 4. -10331131 Convert -1c1 (base 16) to base 4. -13001 What is d44d (base 16) in base 5? 3214344 2984 (base 11) to base 5 110333 -320 (base 10) to base 4 -11000 -36715 (base 9) to base 11 -17569 20011 (base 7) to base 6 34134 -1441 (base 8) to base 2 -1100100001 Convert 68e2 (base 16) to base 5. 1324400 -2102022 (base 3) to base 10 -1763 What is 425 (base 8) in base 10? 277 Convert 1111010111010110 (base 2) to base 14. 18d14 What is 223d (base 14) in base 6? 43251 What is -20e0 (base 15) in base 12? -4040 What is -301332 (base 5) in base 11? -7230 What is 12331 (base 4) in base 9? 544 Convert 922 (base 13) to base 14. 7c9 What is 655 (base 14) in base 9? 1640 What is 1231113 (base 4) in base 5? 210444 What is 4b0 (base 13) in base 8? 1463 Convert 14252 (base 6) to base 2. 100011011000 Convert 2781 (base 9) to base 13. c55 -134d (base 15) to base 11 -3109 -63340 (base 7) to base 13 -714a -106a (base 14) to base 5 -42323 5525 (base 8) to base 6 21233 Convert 168 (base 13) to base 8. 377 What is -112404 (base 7) in base 16? -4e7e 2e1 (base 16) to base 9 1008 What is -b22 (base 12) in base 8? -3112 Convert 524 (base 6) to base 13. 121 -614 (base 9) to base 8 -763 -101023 (base 4	{ "pile_set_name": "DM Mathematics" }
.04, 2 Let b be (208/15)/8 - (-91)/(-39). Let f = 0 + -0.5. Sort 2, 13, b, f in ascending order. b, f, 2, 13 Let i = -0.116 - 0.084. Let x be (-24)/13 - (61 - 63). Put x, -1, 0, i in increasing order. -1, i, 0, x Let s = 6517 + -6527. Suppose 5 = 4a - 3j, 3a - 5j = 11 + 1. Put a, 2, -4, s in increasing order. s, -4, a, 2 Suppose -59k + 966 = 1202. Sort -25/23, k, 4 in descending order. 4, -25/23, k Let i be ((-15)/126)/(-5) + (22/154)/1. Sort 71, i, -0.2 in ascending order. -0.2, i, 71 Let g = -162.5 - -162.3. Sort -4, -2/11, 0.67, g. -4, g, -2/11, 0.67 Let o = 3364 - 3369. Put 2/9, o, -230 in descending order. 2/9, o, -230 Let n = -7.58 - -12.58. Put -0.4, n, 111, -3 in descending order. 111, n, -0.4, -3 Suppose 3c - 3r = 0, -r - 15 - 5 = -5c. Suppose 2o - 26 = 3p, 566o = 579o + 4p - 28. Put o, 9, c in decreasing order. 9, c, o Let i = -576.4 + 613. Let n = -37.6 + i. Let y = -46.1 + 49. Put n, -0.4, y in increasing order. n, -0.4, y Let u = 183173/36 - 5088. Put -2/69, u, -2/13 in decreasing order. u, -2/69, -2/13 Let d = -67.43 + 67.13. Put d, -6, -1/2, -0.05 in decreasing order. -0.05, d, -1/2, -6 Let o = 9 - 7. Let c(r) = 480r + 2396. Let d be c(-5). Sort 77, o, d in increasing order. d, o, 77 Let i(z) = 7z2 + 194z - 60. Let x = 234 + -262. Let b be i(x). Sort b, -5, 23. -5, b, 23 Let q(n) = 31n - 369. Let o be q(12). Sort -5, -4, -1, 2, o. -5, -4, -1, 2, o Suppose 0 = -3016n + 3001n - 30. Put 2/3, 3, n, -0.3, -6/7 in ascending order. n, -6/7, -0.3, 2/3, 3 Let s be ((-183)/122)/(-3 - 27(-5)/20). Sort -95, 3/7, s in descending order. 3/7, s, -95 Let r = -13 + 11. Let h(x) = x + 128. Let y be h(-126). Sort -1, y, r, 0. r, -1, 0, y Let l = -2137 - -2137. Sort -4, -3, 2/149, l in ascending order. -4, -3, l, 2/149 Let a(k) = -5k + 65. Let q be a(13). Let j = -16 + 13. Sort q, j, -39 in increasing order. -39, j, q Let i = -0.01 + -0.047. Let k = -19.057 - i. Let a = k - -17. Sort a, -5, 4, -0.4. -5, a, -0.4, 4 Suppose 5b = 7z + 42, -8b + 6b = -5z - 30. Sort z, 2, 1, -41 in ascending order. -41, z, 1, 2 Let i = 11256 + -11251. Let m(b) = -b*2 + 7b - 3. Let h be m(5). Let g(w) = w*2 - 6w - 8. Let j be g(h). Sort i, -3, j in decreasing order. i, j, -3 Let w(g) = -2g - 13. Let i be w(-5). Let j be i + 6 + 4/2. Let x be ((-5)/(-30) + (-28)/24)-3. Sort j, x, 0, -3 in descending order. j, x, 0, -3 Let m = 961 + -608. Let s = -348 + m. Put s, 3/8, -4, 0.1 in descending order. s, 3/8, 0.1, -4 Let y(i) = -6i2 + 4i. Let z be y(7). Let v = -264 - z. Sort -27, -5, v, 3. -27, -5, v, 3 Let o(n) = n*2 - 44n + 1. Let a be 6270/1431 + (-4)/(-26). Let b be o(a). Put 0.2, 2/13, -1, b in decreasing order. b, 0.2, 2/13, -1 Suppose -4y - 144 = -2y. Let s be 34/y - (-14)/56. Let o = 177/4 + -44. Put -1/4, o, s, -2/13 in descending order. o, -2/13, s, -1/4 Let x(d) = 2d - 6. Let f be x(5). Let w be ((-5)/f)/((-2)/(-8)). Let z be (-2520)/(113 + -41) + (-715)/(-20). Sort w, z, -1/3, -2/53 in decreasing order. z, -2/53, -1/3, w Let g(k) = k*2 + 15k - 694. Let n be g(20). Suppose -5m + 2m - 6 = 0. Put 1, 12, m, n in descending order. 12, n, 1, m Suppose 9a - 10201 = -10165. Sort 7/106, 5, a in descending order. 5, a, 7/106 Suppose 0 = -4t + 10 + 14. Suppose -3i + t = 0, -3i = -0m + 3m + 3. Let w be ((-13)/m + -4)/(1/(-2)). Put -3, w, 0.5 in increasing order. -3, w, 0.5 Let d = 229 - 341. Let n = d - -111.932. Sort 4, n, -0.4 in decreasing order. 4, n, -0.4 Let f(b) = -12b - 8. Let r be f(-1). Suppose -rg = -203 + 211. Put 21, g, -5 in ascending order. -5, g, 21 Let y = 15 - 14.5. Suppose -5b - 5v + 31 = -v, 0 = -2b + 5v - 14. Put b, y, -1/3, 1/9 in increasing order. -1/3, 1/9, y, b Suppose 328w - 347w - 57 = 0. Put 1, 261, w in decreasing order. 261, 1, w Let j = 730 - 268. Let d = -3231/7 + j. Sort d, 5, 4, 8 in ascending order. d, 4, 5, 8 Let g(b) = 17b + 1687. Let r be g(-99). Sort 42, 3, r, -1 in ascending order. -1, 3, r, 42 Let d = -79937.03 - -80301. Let a = 364 - d. Sort -0.2, a, 10 in increasing order. -0.2, a, 10 Suppose -87 = 50t - 337. Suppose -4o = -3z + 613, 0o - tz + 765 = -5o. Sort -4, o, -3. o, -4, -3 Suppose 5n = -3i - 47, -2n + 47 = -i + 46. Let o = 1 + 0. Sort o, -2, n, 0 in increasing order. n, -2, 0, o Let o = -204.4 + 204. Put -1, 0.3, -0.04, o in descending order. 0.3, -0.04, o, -1 Let w = 24.83 + -20.83. Sort 0.4, -0.3, -3, w in descending order. w, 0.4, -0.3, -3 Let f = -152912.9 - -152913. Let z = -358/3 - -122. Put 3/2, z, f, 2 in increasing order. f, 3/2, 2, z Let z = 620.83 + -621. Put 5, 1/5, z, 2/29, 3/8 in descending order. 5, 3/8, 1/5, 2/29, z Let i = 28702 - 28702. Let w = 1.02 + -0.02. Sort i, -1, w. -1, i, w Let s be 12 - (-1860)/(11 - 17). Put -1, 4, 2, s in increasing order. s, -1, 2, 4 Suppose -10 = 17d - 19d. Suppose dl = 211 + 89. Let r = 56 - l. Put 0, 1, -2, r in ascending order. r, -2, 0, 1 Let g = 15773 + -15774. Sort 5, g, -97, -9. -97, -9, g, 5 Let i(v) = 2v*2 - 6v - 8. Let x be i(-4). Let b = -6 - x. Let u = b + 49. Sort -1, -3, u, -4. u, -4, -3, -1 Let k = 56.1 + -56.4. Let x be (-21)/(-18)(-64)/(-112). Sort 1, -2, x, k in ascending order. -2, k, x, 1 Suppose -2b + 0b + 34 = 4n, -4n - 3b + 33 = 0. Suppose 3f + 1 = -c, -13c + 4f = -nc + 4. Put 8, c, 16 in descending order. 16, 8, c Let k = 140 - 139. Let a(c) = -c*3 + 7c*2 - 6c + 4. Let y be a(4). Let s be y/(-13) + 5/(130/4). Sort s, 0, k in ascending order. s, 0, k Let g be (12/(-4) - 3) + 3/(-3). Let b(c) = -7c - 45. Let l(r) = -3r - 23. Let p(i) = 6b(i) - 13l(i). Let w be p(11). Put -3, g, w in decreasing order. -3, w, g Suppose -5w = -5q, 2 = -3w + 4q - 3. Put w, 0, 14, 2 in increasing order. 0, 2, w, 14 Suppose 5f + 16 = 5t - 4, -4f - 10 = -t. Suppose -20 = 2g + 3g + 2q, 4g - 2q = -34. Let d be 10/(-6) + (-4)/g. Sort d, f, -4 in ascending order. -4, f, d Let u(v) = v*3 - 12v*2 + 20v. Let r be u(10). Suppose -9d - 24 + 24 = r. Sort -0.2, d, 3, -4 in decreasing order. 3, d, -0.2, -4 Let a be 2/(-5) - 72/(-105). Let s be 2/(-18) + (-263)/(-1071). Let q = -1/119 - s. Sort q, 5, a in descending order. 5, a, q Suppose 0 = 2u - 4i - 274, 0 = -359u + 354u + 3i + 657. Sort 2, -2, -1, u, -3 in descending order. u, 2, -1, -2, -3 Suppose 3z + 26g = 31g - 73, 4g = -z + 4. Put z, -2, 2, -12 in descending order. 2, -2, -12, z Let d = 1.19 + -68.19. Let y = 46 + d. Let n = 21.3 + y. Put 0.2, n, 0.5 in descending order. 0.5, n, 0.2 Let l be 4/21(33/(-22) + 3). Let f = 99.9 + -103.9. Let g = 2 + -2.01. Sort g, l, f in decreasing order. l, g, f Let g = 532 - 359. Let n = g - 178. Put n, 3/8, 4 in decreasing order. 4, 3/8, n Let k be 4/(-5)45/(-6). Let c = 136493 + -136488. Put k, c, -0.01 in decreasing order. k, c, -0.01 Let p(v) = -v*3 + 11v*2 + 7v - 65. Let y be p(11). Let b(c) = 6c3 + c2 + c + 1. Let r be b(-1). Sort r, y, 4 in descending order. y, 4, r Suppose 2m = 4l - 22, 5l - 10m + 15m - 50 = 0. Sort -190, l, 2 in decreasing order. l, 2, -190 Suppose -94 = 6l + 21l + 14. Sort l, 46, 1, -36. -36, l, 1, 46 Suppose -5g = -0g - 20, 0 = -2k - g + 14. Sort k, 4, -1, 3, -5 in increasing order. -5, -1, 3, 4, k Suppose -67k + 561 = -55 + 4234. Sort k, 16, 3 in decreasing order. 16, 3, k Let m = 10261 + -10262. Put -4, m, 2/341 in descending order. 2/341, m, -4 Let l = -537 + 536.9516. Let a = 1.5484 + l. Sort a, 2/7, 4, -3. -3, 2/7, a, 4 Let w = 1676 - 1674. Sort -1, -7, -5, w. -7, -5, -1, w Let y be (-14 + 1110/60)(-8)/18-1. Put y, 21, 4, -141 in ascending order. -141, y, 4, 21 Let y = 747 - 1555/2. Suppose 8l - l = 224. Let j = l + y. Sort -0.13, 2/7, j in descending order. j, 2/7, -0.13 Let i = 3 + -5. Let d be 3 - (-2)/(1 + i). Let l = 212432 - 212429. Put l, d, 4 in descending order. 4, l, d Let w = 74.41 - -49.59. Sort w, 2, 0.1 in descending order. w, 2, 0.1 Let a(j) = -j3 + 6j*2 + 4. Let b be a(6). Let o = -10788 + 10786. Sort 2, o, -9, b in decreasing order. b, 2, o, -9 Suppose 111 - 375 = 22n. Let k be 1/(30/24 - (-6)/(-8)). Sort n, k, 3 in increasing order. n, k, 3 Suppose -4 = n + 1. Let j(r) = r*3 - 74r*2 + 124r + 1438. Let g be j(72). Sort g, 69, n in ascending order. n, g, 69 Let q = 13667/2 + -6832. Sort 1076, -1/7,	{ "pile_set_name": "DM Mathematics" }
3h(k) - 5y(k). Calculate the least common multiple of s(-16) and 2. 30 Suppose 4l = 203 + 25. Let z = l - 101. Let t = -17 - z. What is the smallest common multiple of 21 and t? 189 Let g be (-3)/5 + 364/140. Find the common denominator of (8g/(-42))/(414/(-2093)) and -14/57. 513 Let r = 9 - 1. Let o = 10 - r. Calculate the lowest common multiple of ((-40)/(-15) + -3)/((-12)/1368) + -6 and o. 32 Find the common denominator of -101/1230 and (-2)/20(-1775)/135. 11070 Let c = 25/152 - 2351/19608. Calculate the common denominator of -67/430 and c. 2580 Let f be (4 + -7)/((-4)/((-152)/(-6))). Suppose 31 = 5h + 2u, 4h + u - f - 7 = 0. Let w = 9 + h. What is the smallest common multiple of w and 40? 80 Suppose 3t = 15t - 1332. Find the common denominator of (-6)/(-84)-1t and 13/2. 14 Suppose 0 = 4n - 3w + 309, n = -6w + 4w - 91. Let g = 110 + n. What is the smallest common multiple of g and 1? 29 Let z = -21029 - -21043. Find the common denominator of z and 0 + (220/(-3))/(-4). 3 Let q(i) be the third derivative of 17i5/60 - i4/12 + 4i*2. Let s be q(1). What is the smallest common multiple of 80/12s/10 and 18? 90 What is the lowest common multiple of (92046/(-348))/((-5 - -7)(-2)/8) and 1? 529 Let a = -85 + 90. Suppose -5x - ah - 146 = -3h, 2x + 5h = -50. Calculate the common denominator of ((-402)/(-16))/((x/(-4))/(-5)) and 69/26. 52 Suppose 12c - 651 = -81c. What is the lowest common multiple of 1981 and c? 1981 Let c = 3292 - 3004. What is the smallest common multiple of 180 and c? 1440 Let s = 0 + -69. What is the common denominator of 23/4 and ((-9)/s + 0)(-62)/4? 92 Let s = -38691/85904 - -45/1456. What is the common denominator of (3 - 162/60)(6 + (-793)/18) and s? 708 Let c(d) = 21d + 9. Let k be c(1). Let z = -6811 - -367807/54. Calculate the common denominator of k6/20(-3 - -5) and z. 54 Let s(f) = f2 + 13f + 49. Let d be s(-8). Calculate the lowest common multiple of (d/(-36))/(1/(-12)) and 69. 69 Let j be 10334/14 - (-5 + (-108)/(-21)). Find the common denominator of -1 - 372/j25/(-10) and -99/8. 984 Let p be 27 + 6/(-3) + -1. Let a be 32/p((-6)/(-4))/1. Suppose -5j = -am + 38, -m + 0j = -j - 19. Calculate the smallest common multiple of 1 and m. 19 Let y = -10938 - -11070. Suppose 198 = 2m + 3u, -3m + 86 = -2m - 5u. What is the smallest common multiple of y and m? 1056 Let u = 135409/44880 + -512/187. Let o = 10/14097 + -136351/112776. What is the common denominator of o and u? 240 Let j be 7/14 + 2249/48. Let l = -75689/1587 + 14/529. Let k = j + l. Find the common denominator of 107/20 and k. 80 Let h = -9528 + 9530. Calculate the lowest common multiple of h and 26. 26 What is the common denominator of 1886/9120 - (-6 + (-552)/(-90)) and -157/120? 4560 Calculate the common denominator of 64/24(-25)/20(-34)/(-696) and 95/406. 3654 Let m(o) = 5o3 - 3 + 10 + 9o - 7o3 + 8o2 + o3. What is the least common multiple of m(9) and 4? 28 Let k be 50/75210/4. Suppose -b - 2b = -2m - k, m = 5. Calculate the smallest common multiple of b and 42. 210 Suppose 0 = 7u - 4u + 2u - 4900. What is the lowest common multiple of u and 98? 980 Suppose v + 2v = 4g + 11, 4v - 56 = -5g. Suppose -h = -2t, -5h - 2t = v - 57. Calculate the smallest common multiple of h and (-2 + 1)/(4/(-36) + 0). 72 Let n(l) = -2l - 32. Let m be n(-22). Let d be (-83)/(18/m). What is the common denominator of -37/9 and (2 - (-24)/(-9))d? 9 Let q = 1791/32 + -215527/3872. Calculate the common denominator of q and (24/462)/(((-3)/(-14))/((-1768)/(-416))). 363 Let x = 180016 + -46984106/261. What is the common denominator of x and 54/145? 1305 Let c = -1230953/30 + 41037. Calculate the common denominator of (3/27)/(565/(-465)) and c. 3390 Let f(t) = 3t2 - 159t + 378. What is the smallest common multiple of f(51) and 1080? 1080 Suppose 7w = 10w + 18. Calculate the common denominator of (-2)/(-6)13/11 and (-117)/w99/81. 66 Let r = 18845/18 + -1043. Let u be 0 - (-2)/1 - -5. Find the common denominator of r and (((-35)/(-40))/u)/((-6)/(-164)). 36 Suppose 5w - 5 - 30 = -2f, 5w + 3f = 40. Suppose -wt = u - 22, 0t + 20 = u + 4t. Let b(a) = -a + 24. What is the smallest common multiple of 22 and b(u)? 132 Suppose 12747 + 205013 = 16g. Let r = 598911/44 - g. What is the common denominator of r and -11/36? 396 Let x(k) = 3 + k*2 + k + 12k2 - k3 - 8k2. Let l be x(5). Suppose l = -2w, -w - 13 = 5r - 34. What is the least common multiple of r and 5? 5 Let z be 1039801/(-574)(1 - (-3 + 2)). Let p = -1398775 + 12556415/9. Let v = p - z. What is the common denominator of -46/13 and v? 117 Suppose 1162 = 25j - 6938. Calculate the smallest common multiple of 3 and j. 324 Suppose 0 = -3u - 40s + 36s + 178, -129 = -u + 5s. Suppose 4 = 2y - 0. Calculate the least common multiple of y and u. 74 Let p = -740 + 746. Find the common denominator of 53/22 and (-8869)/(-126)10/98 - p. 1386 Let q = 9252658/7 - 101788509985/77007. Let m = q - -19/386. What is the common denominator of -44/15 and m? 570 Let s = -14722 - -677179/46. What is the common denominator of s and 13/110? 2530 Suppose -35383 = -5y + l, -2y - 2l + 28312 = 2y. Suppose 7i = 4i + y. Let b = 18849/8 - i. Find the common denominator of 137/48 and b. 48 Let n(z) = z3 + 44z*2 + 207z - 6. Calculate the lowest common multiple of 1100 and n(-38). 19800 Let q(h) = 14h2 + 211h + 848. Let t(m) = m*3 + 8m*2 + 5m + 10. What is the lowest common multiple of q(-8) and t(-7)? 168 Let i(y) = 3y2 + 14y - 90. What is the smallest common multiple of 655 and i(5)? 7205 Let u be -96/(-36)-342. Let v = 576 + u. What is the smallest common multiple of 14 and v? 126 Suppose 0 = -w + 3g + 8, 5g + 0 = 4w - 4. What is the common denominator of 2425/(-30) - w and 3/(-12) + 161/(-12)? 3 Let w = 2071193/308106 + -2/17117. Let y be (-2)/(-5) + 3591/(-5). Let z = 57089/80 + y. Calculate the common denominator of z and w. 144 Suppose -37536 = -116z - 24372 + 59916. Calculate the least common multiple of z and 420. 1260 Suppose -3 = -4d + 1. What is the common denominator of (-1)/(d - 88/58) and -1 + (-15)/(-14) + (-36608)/462 + 77? 30 Let q(n) = n. Let c(f) = -f + 1. Let z(u) = -4c(u) - 2q(u). What is the smallest common multiple of z(5) and 26908/280 + (-2)/12 + (-1)/(-15)? 96 Let c = 18/91589 + -3976937/196458405. Calculate the common denominator of c and 37/130. 4290 Let p = -4/5107 - 413627/51070. What is the common denominator of p and (-10)/(-30)-15 - 0? 10 Calculate the common denominator of (-14)/49 + 704/210 and 4890/500(-10)/(-108). 180 Let r = -697135/305226 + 1366/547. Find the common denominator of -71/2 and r. 558 Let u = 1880 + -2991. Calculate the common denominator of (-19 - -3)/(-4) - u/132 and 27/56. 168 Let w be (-978)/(-10) - 1/(-5). Suppose -w = -2a - 18. Suppose -5g = 5, 3k - 5g - a = 2k. Calculate the smallest common multiple of k and 8. 280 Suppose -40d = 54d - 74166. What is the smallest common multiple of d and 6? 1578 Find the common denominator of (6/27 - (-2744)/(-6705)) + (-76)/(-570) and 9. 149 What is the lowest common multiple of 252 and (8 + -1453)/(-17) - 13? 504 Calculate the common denominator of 28/11 and ((20/44)/(-1))/((-77)/(-99)). 77 What is the least common multiple of 2931 and 36 - 7126/49? 17586 Let g = 22640 - 21804. What is the least common multiple of g and 532? 5852 Let q = -12311 + 14348. Calculate the lowest common multiple of q and 15. 10185 Let u be ((-97583)/15)/((-9)/39). Let i = -28189 + u. What is the common denominator of i and -23/63? 315 Let m(n) = n*2 + 3n - 7. Let u(a) = a*3 + 27. Calculate the lowest common multiple of m(4) and u(0). 189 Suppose 27 + 3 = 2g. Suppose 0p = -5p + g. Suppose -7q + 5v = -3q - 22, 5v = 2q - 16. What is the least common multiple of q and p? 3 Let i(y) = y3 - y2 + 7y - 9. Let o be i(4). Suppose -2k - 19 = -o. Suppose -2a = 4a - k. Calculate the least common multiple of 12 and a. 12 Suppose 4q = 3l - 248, -q + 2l - 310 = 4q. What is the smallest common multiple of 40 and (q - -55) + (14 - -1)? 40 Suppose 4h + 6832529 = 3h + 3o, 5h + 34162681 = 3o. Let x be 85/h*910421/5. Let d = x + 6/11821. Find the co	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from xxzxxzx. What is prob of picking 2 z and 1 x? 1/7 Two letters picked without replacement from ppppcpcpp. Give prob of picking 1 p and 1 c. 7/18 What is prob of picking 2 j when two letters picked without replacement from {j: 4}? 1 Two letters picked without replacement from {m: 4, x: 3}. What is prob of picking 2 x? 1/7 What is prob of picking 1 n and 3 j when four letters picked without replacement from {j: 4, n: 2, r: 1}? 8/35 Calculate prob of picking 2 m and 1 h when three letters picked without replacement from {a: 4, p: 3, l: 4, h: 6, m: 2, k: 1}. 1/190 Two letters picked without replacement from yypyovpypo. What is prob of picking 1 o and 1 y? 8/45 What is prob of picking 1 r and 1 c when two letters picked without replacement from ccrwrrf? 2/7 What is prob of picking 2 i and 2 s when four letters picked without replacement from {s: 4, c: 1, i: 2, a: 1, n: 1}? 1/21 Three letters picked without replacement from gwpkpwtfgpwkgt. Give prob of picking 1 f and 2 p. 3/364 Two letters picked without replacement from lrlrlffolrf. What is prob of picking 2 f? 3/55 Three letters picked without replacement from {c: 1, i: 2, g: 1, q: 3, p: 2, d: 3}. Give prob of picking 1 i, 1 d, and 1 g. 3/110 Two letters picked without replacement from {w: 2, m: 4, u: 3, z: 1}. Give prob of picking 2 m. 2/15 What is prob of picking 1 w and 1 i when two letters picked without replacement from {h: 8, m: 1, v: 8, i: 1, w: 2}? 1/95 Two letters picked without replacement from ueezududencz. Give prob of picking 1 n and 1 e. 1/22 Two letters picked without replacement from pkpmmrrpprkpm. Give prob of picking 1 m and 1 p. 5/26 Four letters picked without replacement from {k: 3, f: 1, e: 4}. What is prob of picking 4 e? 1/70 Calculate prob of picking 1 m and 1 f when two letters picked without replacement from ffffmffmfffff. 11/39 Calculate prob of picking 1 r, 1 q, and 1 i when three letters picked without replacement from rrurrrrrqcxirrixrr. 11/408 What is prob of picking 1 i and 2 z when three letters picked without replacement from gzzzi? 3/10 Calculate prob of picking 1 c, 1 y, and 1 t when three letters picked without replacement from {c: 1, y: 1, p: 1, t: 2, i: 1, l: 2}. 1/28 What is prob of picking 1 a and 1 j when two letters picked without replacement from {e: 7, a: 1, j: 2, p: 4}? 2/91 Three letters picked without replacement from {z: 7, s: 9}. Give prob of picking 3 s. 3/20 Calculate prob of picking 4 q when four letters picked without replacement from qqckcqcqqkpkqkkqkpk. 35/3876 Four letters picked without replacement from {q: 6, t: 2, i: 4, w: 3}. What is prob of picking 2 t, 1 q, and 1 w? 6/455 What is prob of picking 1 y and 1 p when two letters picked without replacement from atyavvapuuvyayp? 2/35 Four letters picked without replacement from hhhhnhnhhhn. Give prob of picking 3 n and 1 h. 4/165 What is prob of picking 3 c when three letters picked without replacement from {k: 3, c: 5, j: 1}? 5/42 What is prob of picking 1 h, 1 p, and 1 u when three letters picked without replacement from {o: 2, p: 3, d: 1, h: 1, u: 4, i: 1}? 3/55 Calculate prob of picking 1 a and 1 r when two letters picked without replacement from {r: 1, q: 1, h: 1, n: 1, a: 1}. 1/10 Three letters picked without replacement from {d: 1, s: 3, o: 3, b: 1, t: 2}. What is prob of picking 2 t and 1 d? 1/120 Two letters picked without replacement from {b: 1, i: 5, x: 1, p: 2, c: 7}. What is prob of picking 1 i and 1 b? 1/24 What is prob of picking 1 a, 1 g, and 1 f when three letters picked without replacement from {t: 1, s: 5, c: 1, g: 1, f: 2, a: 3}? 3/143 Calculate prob of picking 2 j when two letters picked without replacement from bjjgbjbbbc. 1/15 What is prob of picking 2 j when two letters picked without replacement from jjjjjjjjjjee? 15/22 Two letters picked without replacement from tuttttut. What is prob of picking 1 u and 1 t? 3/7 Three letters picked without replacement from vvqnufvuvfuuqvy. Give prob of picking 3 v. 2/91 Two letters picked without replacement from {b: 1, t: 3, s: 7, y: 1, f: 7}. What is prob of picking 2 t? 1/57 What is prob of picking 2 a and 1 x when three letters picked without replacement from xaakkknnkkknn? 1/286 Two letters picked without replacement from {n: 1, q: 11, o: 8}. Give prob of picking 1 n and 1 o. 4/95 Calculate prob of picking 1 p and 1 h when two letters picked without replacement from hoooouhphghpuhggspoo. 3/38 Three letters picked without replacement from xmommmhmhmhmoxxoxo. What is prob of picking 1 o and 2 m? 7/68 Calculate prob of picking 2 p and 1 f when three letters picked without replacement from rdpdpjrfddfprddr. 3/280 Two letters picked without replacement from {w: 3, d: 1, m: 3, x: 1, f: 3}. Give prob of picking 1 f and 1 w. 9/55 Four letters picked without replacement from {j: 6, k: 1, r: 8, z: 1}. Give prob of picking 1 r, 1 k, and 2 j. 6/91 Calculate prob of picking 1 l and 3 b when four letters picked without replacement from llsllbbllssbbbll. 4/91 Two letters picked without replacement from {o: 1, d: 1, x: 1, e: 2, c: 4}. What is prob of picking 1 x and 1 e? 1/18 Two letters picked without replacement from evae. Give prob of picking 1 e and 1 v. 1/3 What is prob of picking 1 o and 2 v when three letters picked without replacement from {p: 2, n: 1, k: 1, v: 2, o: 1, g: 1}? 1/56 Calculate prob of picking 1 o and 1 a when two letters picked without replacement from {g: 1, o: 1, a: 1, u: 6}. 1/36 Four letters picked without replacement from {i: 4, t: 4, m: 5, s: 6}. What is prob of picking 4 m? 5/3876 Two letters picked without replacement from {n: 2, v: 3, j: 3, i: 5, e: 5}. What is prob of picking 2 v? 1/51 Three letters picked without replacement from {d: 19, a: 1}. Give prob of picking 3 d. 17/20 Two letters picked without replacement from hizquzghzzhzh. Give prob of picking 1 h and 1 u. 2/39 Two letters picked without replacement from {p: 1, g: 12, x: 3}. Give prob of picking 1 g and 1 p. 1/10 Three letters picked without replacement from liilcincineilince. Give prob of picking 1 n, 1 c, and 1 e. 9/340 Two letters picked without replacement from gjegzgzzmmmmzcgjzz. Give prob of picking 1 j and 1 c. 2/153 What is prob of picking 4 e when four letters picked without replacement from eeeenen? 1/7 Calculate prob of picking 1 j and 1 r when two letters picked without replacement from {r: 4, s: 2, j: 2}. 2/7 What is prob of picking 1 i and 1 s when two letters picked without replacement from iivivsvsvvs? 9/55 Calculate prob of picking 3 c and 1 d when four letters picked without replacement from {l: 1, c: 13, d: 1}. 22/105 Four letters picked without replacement from scppc. What is prob of picking 2 p, 1 s, and 1 c? 2/5 Three letters picked without replacement from vkxkovm. What is prob of picking 1 o, 1 m, and 1 x? 1/35 What is prob of picking 1 i and 1 p when two letters picked without replacement from {d: 1, t: 1, p: 1, b: 1, i: 1, e: 2}? 1/21 Three letters picked without replacement from tvababtntatn. Give prob of picking 1 n and 2 t. 3/55 What is prob of picking 2 y and 1 r when three letters picked without replacement from {r: 3, p: 4, h: 2, s: 3, y: 1, d: 2}? 0 Calculate prob of picking 1 o, 1 m, and 1 x when three letters picked without replacement from xmom. 1/2 Calculate prob of picking 3 t and 1 e when four letters picked without replacement from etkeekttttk. 1/11 Calculate prob of picking 1 m and 2 s when three letters picked without replacement from {q: 4, s: 7, m: 4}. 12/65 Two letters picked without replacement from {f: 2, n: 1, x: 6, c: 3, y: 2}. Give prob of picking 1 f and 1 c. 6/91 Two letters picked without replacement from wnrgnyggrns. What is prob of picking 1 r and 1 y? 2/55 Calculate prob of picking 1 l and 1 v when two letters picked without replacement from ollvwwolvlomoovolwo. 5/57 Two letters picked without replacement from sssdddddddsddddddddd. What is prob of picking 2 s? 3/95 Two letters picked without replacement from {u: 7, j: 3}. What is prob of picking 1 u and 1 j? 7/15 What is prob of picking 3 o and 1 z when four letters picked without replacement from oooooahaozzaaooahaza? 56/1615 What is prob of picking 1 q, 1 h, and 1 p when three letters picked without r	{ "pile_set_name": "DM Mathematics" }
8 + 2/(-9))? 9 Let z(g) = 49g3 + g2 - 1. Let u = 5 - 4. Let t be z(u). What is the units digit of (-72)/14t/(-14)? 8 Let i(b) = 17b + 3. Suppose -1 = 2z + 1. Let o(f) = -1. Let g(m) = zi(m) + 6o(m). What is the tens digit of g(-3)? 4 Suppose 0 = 22s + 64s - 621694. What is the units digit of s? 9 Let a = 17051 + 48807. What is the thousands digit of a? 5 Let l(f) = -2f2 - f + 179. Suppose 0 = 2r - 4r - i, -4i = 5r. Let b be l(r). Suppose -45 = -4p + b. What is the units digit of p? 6 Suppose -t + 2w = 3w - 1609, 0 = -2t + 4w + 3200. Suppose m = l - 89 + t, -3l - 7593 = -5m. What is the units digit of m? 1 Suppose 6962 = 2v - 4f, 267f + 6983 = 2v + 270f. What is the thousands digit of v? 3 Let b be -2 + ((-116)/(-5))/((-14)/(-35)). Let x be (2730/(-4))/(-47/b). Suppose -12l - l = -x. What is the units digit of l? 5 Let s be 10/14 - 1 - (-706548)/84. Suppose 49j - 62j = -s. What is the units digit of j? 7 What is the hundreds digit of ((-11821)/6)/((-127)/762)? 8 Suppose -4i + 5l = -19024, 0i + l + 19024 = 4i. What is the units digit of i? 6 Let y = -2254 - -13361. What is the hundreds digit of y? 1 Let a(n) = 2n*2 - 6n + 7. Let u be a(2). Suppose -3f + y - uy + 230 = 0, -4f + 5y = -276. Suppose -2q = -28 - f. What is the tens digit of q? 5 Let f = 20647 - 18258. What is the thousands digit of f? 2 Let d = 45 + -21. Let p = d + -23. What is the tens digit of ((-682)/(-33))/(p/3)? 6 Suppose 0 = 5b + 3h - 1662, -b + 0b - 5h + 350 = 0. Suppose 4o + 4g = 1180, b + 882 = 4o - 4g. What is the tens digit of o? 9 Suppose 0 = -7p + 205 - 170. Suppose 5d - 3o - 1171 = 0, -po + 553 = 4d - 406. What is the units digit of d? 6 Suppose -4f + 79326 = 2a, 0 = 8a - 5a - 5f - 119011. What is the tens digit of a? 6 Suppose 3s = -3z + s - 93, -z = -5s + 31. Let t = z - -27. Let f(h) = -h*3 + 5h + 11. What is the units digit of f(t)? 5 Let i(a) = a*2 - 6a + 2. Suppose -58k + 4 = -57k. Let v be i(k). Let m(q) = -q*3 - 3q*2 + 17q - 3. What is the units digit of m(v)? 3 What is the units digit of (8639/2)/(43/6 - (113 + -106))? 7 Let q(w) = 950 - 236w + 254w + 62 - 69. What is the units digit of q(0)? 3 Let n(x) be the second derivative of x*4/4 + 2x3/3 + x2/2 - 8x. Let c be n(-2). What is the units digit of 56/c20/8? 8 Let n = -862 - -194. Let r = n + 1773. What is the tens digit of r? 0 Let g be ((-492)/(-18) - 0)/((-3)/63). Let j = g - -886. What is the units digit of j? 2 Suppose 35s - 12060 = 5s. Let b = -233 + s. What is the units digit of b? 9 Let q be (-10)/(-2)2/5. Suppose qy - 446 = 362. What is the tens digit of (-28)/35 - y/(-5)? 8 What is the units digit of ((-6041)/4 + 2)/(756/(-1008))? 1 Suppose 3n = 12, 11o + n - 646 = 8o. Let h = 951 - o. What is the units digit of h? 7 Suppose 37i - 41i + 208 = 0. Let o be (1 - 14)(0 - -1). Let f = i + o. What is the units digit of f? 9 Let g(k) = 262k - 1. Let q be g(1). Suppose 3y = -0y - q. What is the units digit of ((-57)/(-6))/(3 + y/30)? 5 Let q = -36955 + 55584. What is the hundreds digit of q? 6 Suppose -35 = -5n, 5j + n - 96248 = 664. What is the tens digit of j? 8 Let a(q) = -q2 - 254q + 65751. What is the units digit of a(0)? 1 Let i = 31 - -60. Let r(t) = t*2 + 7t - 8. Let f be r(-8). Suppose f = -6g + 269 + i. What is the units digit of g? 0 Let k(i) = -2i. Let a(g) = -g - 37. Let d(l) = a(l) + 5k(l). Let z be d(-4). Let f(b) = 5b*2 - 10b - 2. What is the hundreds digit of f(z)? 1 What is the hundreds digit of (-304)/(-3)(-19)/(608/(-432))? 3 Let t(c) = -27 + 29 + 16 + 21 + 31 - 178c. What is the tens digit of t(-10)? 5 Suppose 157k = 170k - 105911. What is the units digit of k? 7 Let a be 0 + -98 - 0/2. Let i = 83 + a. Let k(j) = -j*3 - 14j*2 + 7j + 46. What is the tens digit of k(i)? 6 Let w = -18177 + 52834. What is the thousands digit of w? 4 What is the ten thousands digit of (277730/(-15))/((-10)/24 + (-26)/104)? 2 Let i be (2/6)/(5/(-4 - 26)). Let v be 0 + (20 - (4 + i)). Suppose 588 = vl - 15l. What is the hundreds digit of l? 1 Let b(p) = 5p3 + 151p*2 - 4p + 44. What is the thousands digit of b(-30)? 1 Let q = 3980 + -2772. What is the hundreds digit of q? 2 Let d(w) = -w + 2. Let q be d(-5). Suppose -2835 = -qo - 868. What is the units digit of o? 1 Let v(o) = -2310o - 4363. What is the ten thousands digit of v(-10)? 1 Let w be 2/((0 + -2)/(-2)) + 2. Suppose -5d = j - 3j + 1490, 0 = -wj + 20. Let b = -124 - d. What is the tens digit of b? 7 What is the hundreds digit of (97384/(-470))/((-2)/120)? 4 Let m(z) = 185z*2 - 7z - 38. What is the hundreds digit of m(3)? 6 Let c be -3 + 52/28 + (-2)/(-14). What is the units digit of c/((3/1191)/(-1))? 7 Suppose -d + 3u = -1132, 3d + 17u - 3382 = 12u. What is the thousands digit of d? 1 Suppose d - 4o = -1096 + 8035, d - 2o = 6943. What is the units digit of d? 7 Let o(f) = -101f3. Let j = -145 - -115. Let k be 1 - ((-4)/(-6))/((-10)/j). What is the units digit of o(k)? 1 Let l be 2 - 1 - (1 + -95)2. Let s = 52 - l. Let m = s - -209. What is the units digit of m? 2 Let s(d) = 52d2 - 2d - 29. Let x(w) = 17w2 - 10. Let q(r) = -2s(r) + 7x(r). What is the hundreds digit of q(-5)? 3 Let q be 41/((-4000)/(-1984) - (0 + 2)). Suppose q = 2c + 158. What is the tens digit of c? 9 Let c(k) = -6k + 23. Let q be c(-17). Suppose 0 = 5h - 1161 + 31. Let p = h - q. What is the tens digit of p? 0 What is the hundreds digit of (-6 - -36493) + (4 - 5/(-5))? 4 Let m(o) = 31 - 3o - 8 + 17 + 46 + 2o*2. Let f(l) = 2l*2 - 2l + 87. Let r(w) = 4f(w) - 3m(w). What is the units digit of r(0)? 0 Suppose 3x = -13j + 9j + 23419, 5x - 23421 = -4j. What is the hundreds digit of j? 8 Suppose -q - 3m = -15, 2m - 14 = -3q + q. Suppose qw + 57 = 6w. What is the units digit of -32/((-6)/w)? 9 Suppose 2048556 = 64j + 558572. What is the tens digit of j? 8 Let y = 37 + -16. Let v(d) = -d - d + 6d + 7d + y. What is the tens digit of v(7)? 9 Let a = 946 - 69. Let m = a - 568. What is the units digit of m? 9 Let p(x) = -x*2 - 46x - 88. Let y be p(-22). Suppose 2d = n + y, -2d - n = 2n - 448. What is the units digit of d? 1 What is the hundreds digit of (-331210)/(-35) - (-30)/35? 4 Let c(s) = 6060s - 2544. What is the tens digit of c(3)? 3 Let v be 1/5 - (-2 - 17170/25). Suppose 4y - v = 107. What is the tens digit of y? 9 Let x be 2/(-3) - -24(-6)/27. Let w(b) = -3b3 - 9b*2 + 11b + 4. What is the hundreds digit of w(x)? 2 Suppose -2i + 4i = -4g + 53268, g = -7. What is the ten thousands digit of i? 2 Let b = -52 - -70. What is the tens digit of 246 - (b - -2)/5? 4 Let q(v) = -594v + 5124. What is the units digit of q(7)? 6 Let q = 151 + -156. Let x(g) = -2g3 + 4g*2 + g + 13. What is the units digit of x(q)? 8 Suppose 6v - 10v = 3i - 11300, -8462 = -3v + i. What is the units digit of v? 2 Suppose 0 = -15q - 4q + 1539. Suppose -5b + 5g + 3609 = -q, 3b + 5g = 2174. What is the tens digit of b? 3 Let d = 140 - 141. Let w(l) = -94l + 3. What is the tens digit of w(d)? 9 Let z(p) = -8p2 + 58 - 75p - p*3 - 4p*2 + 21p*2 + 24p*2 + 35. What is the hundreds digit of z(30)? 5 Suppose 79211 = 123x - 975391. What is the units digit of x? 4 Let l = 812 + -812. What is the tens digit of (l - -1)(1946 + (7 - 2))? 5 Suppose -11t - 14742 = -53t. Let m = t - -860. What is the units digit of m? 1 What is the tens digit of 3799758/(-2692)((-7)/3 - 1)? 0 Suppose 9f - 22 = 77. Let a be ((-280)/(-5))/(1/6). Suppose -1810 = -fx - a. What is the units digit of x? 4 Suppose 3q - 10 - 22 = -4v, -5v = 5q - 40. Let g(s) = 2s2. Let d be g(-1). Suppose 3x + 7h - 382 = vh, -3h - 257 = -dx. What is the tens digit of x? 2 Let n = 1360 + -1363. Let l(b) = -38b2 - 12b. Let v(d) = 25d2 + 8d. Let c(m) = 5l(m) + 8v(m). What is the units digit of c(n)? 8 Let u(p) = -p*2 - 1. Let v(q) = -10q + 4. Suppose 11x + 2 = 9x. Let w(f) = xv(f) + u(f). What is the tens digit of w(7)? 1 Let s(o) = -1670o + 1515. What is the ten thousands digit of s(-6)? 1 Suppose -9252 + 12 = -5i. Suppose 2024 + i = 4n. What is the units digit of n? 8 Let r = 37427 - 5765. What is the thousands digit	{ "pile_set_name": "DM Mathematics" }
e of 546 and 15054. 105378 Calculate the common denominator of 79/1965750 and -74/33. 21623250 Calculate the lowest common multiple of 1118 and 52. 2236 Calculate the common denominator of -16/2175 and 49/59400. 1722600 Calculate the smallest common multiple of 10 and 36438. 182190 What is the lowest common multiple of 70618 and 5797? 776798 What is the common denominator of 16/81 and 63/9755? 790155 What is the least common multiple of 170 and 1121286? 5606430 Find the common denominator of -119/1032 and -7/291024. 291024 Calculate the least common multiple of 471602 and 4. 943204 Calculate the smallest common multiple of 432 and 70560. 211680 What is the least common multiple of 209304 and 2736? 418608 Calculate the smallest common multiple of 9 and 87414. 262242 What is the common denominator of 53/3100 and 107/558? 27900 Find the common denominator of -63/304 and 47/14060. 56240 Calculate the common denominator of -5/31543 and 51/7. 220801 What is the lowest common multiple of 1316 and 1368? 450072 What is the common denominator of 137/115830 and 31/90? 115830 What is the smallest common multiple of 134 and 3? 402 What is the smallest common multiple of 2415636 and 22? 26571996 What is the common denominator of 49/10 and -79/152998? 764990 Calculate the least common multiple of 30 and 240729. 2407290 Calculate the smallest common multiple of 36 and 42720. 128160 Calculate the common denominator of 5/378148 and 63/200. 18907400 Calculate the lowest common multiple of 3638 and 94588. 94588 Calculate the common denominator of 3/2578 and 49/12. 15468 What is the common denominator of -54/5 and 111/14890? 14890 What is the lowest common multiple of 194088 and 4? 194088 What is the smallest common multiple of 66 and 69564? 69564 Calculate the least common multiple of 258160 and 840. 774480 Find the common denominator of 49/3260 and 43/490. 159740 What is the common denominator of -59/532 and 149/852? 113316 Find the common denominator of 2/69 and -73/1296. 29808 What is the common denominator of 53/2337 and -5/489? 380931 Calculate the common denominator of 22/3375 and 49/165. 37125 Calculate the common denominator of 45/119 and 33/66619. 1132523 Calculate the least common multiple of 7116 and 2000. 3558000 What is the common denominator of 109/183668 and 67/584? 367336 Calculate the smallest common multiple of 19390 and 155120. 155120 What is the common denominator of -15/5642 and -113/102? 287742 Find the common denominator of -101/317655 and -35/78. 635310 Find the common denominator of 19/26 and -93/284284. 284284 What is the least common multiple of 11007 and 11007? 11007 Calculate the common denominator of 93/23518 and 68/1815. 3880470 Calculate the smallest common multiple of 62970 and 33584. 503760 Calculate the smallest common multiple of 99 and 20436. 674388 What is the lowest common multiple of 220 and 5200? 57200 Find the common denominator of -43/12 and 121/550464. 550464 Calculate the smallest common multiple of 385 and 70. 770 What is the common denominator of -95/1722 and 13/16113? 225582 What is the lowest common multiple of 43890 and 21? 43890 What is the least common multiple of 5833 and 614? 11666 Calculate the common denominator of 47/17604 and -113/216. 35208 Find the common denominator of -127/30970 and -17/171. 278730 What is the least common multiple of 164 and 609342? 1218684 What is the common denominator of -61/177606 and -125/13662? 177606 What is the common denominator of -38/170469 and -61/2223? 3238911 What is the common denominator of -127/13170 and 119/4390? 13170 What is the smallest common multiple of 1755 and 424710? 424710 Find the common denominator of -53/2891 and -31/588. 34692 Calculate the lowest common multiple of 12825 and 1080. 102600 What is the common denominator of 117/160 and -73/10016? 50080 Calculate the common denominator of 89/13362 and 13/1310. 66810 What is the common denominator of -85/14664 and -35/1248? 58656 Find the common denominator of -51/172996 and -91/6. 518988 What is the least common multiple of 72 and 5787? 46296 Calculate the least common multiple of 12 and 500. 1500 Find the common denominator of 28/140293 and -3/1174. 280586 What is the least common multiple of 15800 and 15800? 15800 Calculate the least common multiple of 224 and 52. 2912 Find the common denominator of -7/89297 and -41/31. 2768207 Calculate the least common multiple of 892525 and 475. 892525 Calculate the lowest common multiple of 128055 and 45. 384165 What is the common denominator of -79/189684 and 82/21555? 948420 What is the smallest common multiple of 154 and 11414? 878878 Calculate the common denominator of -65/2 and 10/5479. 10958 Calculate the common denominator of -53/1014 and -53/754. 29406 Calculate the common denominator of -1/128 and 91/132688. 1061504 Calculate the least common multiple of 5096 and 65520. 458640 Calculate the common denominator of -139/480 and 83/43968. 219840 What is the lowest common multiple of 83 and 1178? 97774 Find the common denominator of 137/3408 and -35/660584. 3963504 Find the common denominator of -103/456 and -25/14649. 117192 Calculate the lowest common multiple of 45780 and 8. 91560 Calculate the least common multiple of 1365 and 2730. 2730 Calculate the common denominator of 83/12280 and -51/282440. 282440 What is the smallest common multiple of 72 and 606? 7272 What is the lowest common multiple of 2072 and 6783? 2007768 Calculate the least common multiple of 41992 and 4872. 881832 What is the least common multiple of 3720 and 13516? 405480 What is the lowest common multiple of 288795 and 866385? 866385 What is the common denominator of -87/157142 and 103/10? 785710 Calculate the common denominator of -64/141685 and 103/226696. 1133480 What is the smallest common multiple of 1309 and 11220? 78540 Calculate the common denominator of 85/509528 and -55/14. 3566696 Find the common denominator of 91/9068 and -77/1360. 3083120 What is the common denominator of 67/175592 and 21/87796? 175592 Calculate the lowest common multiple of 60 and 270. 540 Calculate the common denominator of -27/130 and -29/138558. 9006270 What is the lowest common multiple of 220399 and 4? 881596 Calculate the lowest common multiple of 79758 and 45. 398790 What is the smallest common multiple of 7 and 3253? 22771 Calculate the common denominator of -57/2108 and 131/47430. 94860 Calculate the smallest common multiple of 1536 and 960. 7680 Calculate the common denominator of 44/31 and 25/2542. 2542 What is the common denominator of -47/6966 and -13/1620? 69660 Calculate the common denominator of 67/113420 and -7/20. 113420 What is the common denominator of -44/15 and 50/6507? 32535 Calculate the lowest common multiple of 38 and 10712. 203528 Calculate the least common multiple of 1554 and 1702. 35742 Calculate the smallest common multiple of 48 and 11522. 276528 Calculate the least common multiple of 7230 and 20580. 4959780 What is the common denominator of 26/1701 and -55/538839? 4849551 Find the common denominator of -32/64989 and -59/6723. 194967 What is the least common multiple of 108 and 9204? 82836 What is the smallest common multiple of 21000 and 56? 21000 Calculate the least common multiple of 35 and 17920. 17920 What is the least common multiple of 496000 and 64? 496000 Find the common denominator of 64/18585 and 95/708. 74340 What is the common denominator of 103/1842228 and -2/39? 23948964 Calculate the least common multiple of 448 and 9800. 78400 Find the common denominator of 21/39311 and 74/9. 353799 Calculate the smallest common multiple of 235 and 10380. 487860 Find the common denominator of 1/34748 and -95/136. 69496 What is the lowest common multiple of 15882 and 18? 47646 What is the least common multiple of 14 and 1269476? 8886332 Find the common denominator of 22/87 and -105/290464. 871392 Find the common denominator of 31/18 and -83/250264. 2252376 Find the common denominator of 31/684 and -131/8436. 25308 Calculate the common denominator of 59/67929 and 62/15. 339645 Find the common denominator of -17/45216 and -91/30144. 90432 What is the common denominator of -55/169216 and 103/704? 1861376 Find the common denominator of -33/4160 and -83/740. 153920 Find the common	{ "pile_set_name": "DM Mathematics" }
nits digit of r? 2 Suppose 976 = c + 2n, -2599 = -3c - 3n + 335. What is the tens digit of c? 8 Let h(m) = -8m + 210. What is the units digit of h(-34)? 2 Let h(m) = -m*3 - 4 - m - 2m*2 + 0m*3 - 6m*2 - 4m. Let i be h(-8). Suppose 98 = 2u - 4w + 14, u = 4w + i. What is the tens digit of u? 4 Suppose 2o = 9 - 9. Suppose 8m - 1331 + 11 = o. What is the tens digit of m? 6 Let z = 6626 - 4257. What is the units digit of z? 9 Let j(a) = a2 + a - 10. Let w be j(-6). What is the tens digit of w4 + ((-21)/3 - -4)? 7 Let p be (4/(-6))/((-2)/84). Let a = 3 - 0. What is the units digit of p/a - 3/9? 9 Let f be (5 - -1)(-9)/(-6). Suppose h - 2h = f. What is the tens digit of (h + -12)/(-11)? 2 Suppose 42u = 43u - 139. What is the units digit of u? 9 Let l(x) = -x + 1. Let a be l(-1). Suppose 462 = 4m + ap, 3p = -5 + 2. What is the units digit of m? 6 Let z = -9 + 34. Suppose -5m - z = 0, 2x + m = 5m + 144. What is the units digit of x? 2 Let y be 126/45 + 1/5. Suppose -2o - yh + 424 = 61, 0 = 4o - h - 719. Suppose 0 = -u + 5u + 5k - 185, 4k + o = 5u. What is the units digit of u? 0 Let o(m) = 3m2 - 62m - 111. What is the units digit of o(30)? 9 Suppose -9k = 102 + 78. Let w(m) = m2 + 9m + 14. What is the hundreds digit of w(k)? 2 Suppose -2i - 15 = 3a + i, -5i = -3a + 9. Let v = 18 - a. Suppose -w + 6w = v. What is the units digit of w? 4 Suppose -h + 8 = 2. Suppose 0 = 2m + o + 12, 2m + h = m - 2o. Let p = m - -29. What is the tens digit of p? 2 Suppose 7v + 4j - 869 = 4v, -2v + 606 = -4j. What is the units digit of v? 5 Suppose -35p + 3653 = -22p. What is the units digit of p? 1 Suppose 0 = n + 4i - 0 + 5, 5n - 3i = 90. Suppose -11f = -nf + 64. Suppose c - f = 5. What is the units digit of c? 1 Suppose 0 = -4g - 16, -2o = 2o - g - 88. Let s(n) = -8n + 9n + on + 5n. What is the units digit of s(1)? 7 Let j(i) be the first derivative of i3/3 + 2i*2 - 14i + 6. Let d be j(-7). What is the units digit of (-191)/(-7) - 2/d? 7 Let t be 150/(-39) - (-8)/(-52). Let u = t + 4. Suppose u = -2i - h + 43, 0 = -0i + 5i - 3h - 113. What is the tens digit of i? 2 Suppose 98 = -4d + 5r - 1178, 5d = r - 1574. Let j = d - -559. What is the hundreds digit of j? 2 Let w = 5 + 1. What is the units digit of ((-805)/(-50) + (-6)/10)w? 3 Let f(y) = y*3 + 27y*2 - 16y - 32. What is the units digit of f(-19)? 0 Suppose 0 = 4u + 2u - 30. Suppose -4r = 5l - 77, -l + 58 = 2r - ul. What is the tens digit of r? 2 Let c be (-568)/(-3) - 3/9. Let z = 18 + c. What is the units digit of z? 7 Let b = 4 - -14. Suppose -7a = -5a - b. Suppose -7x = -ax + 20. What is the tens digit of x? 1 Let b = 16 + -13. Let d(r) = r*2 - r - 3 + 3r + 6rb - 1 + 5. What is the units digit of d(2)? 7 Suppose 0 = 7d - 638 - 468. What is the tens digit of d? 5 Let h(p) = p*3 + 4p*2 - p - 1. Suppose -2g = -q + 10, -5g - 29 = 2q - 13. Let r be h(g). Suppose 12 + 24 = rv. What is the units digit of v? 2 Suppose -16 = 2x - 0. Suppose -11q + 3491 + 3329 = 0. What is the units digit of (4/(-10))/(x/q)? 1 Suppose 3n - 4p + 846 = 0, -p + 4p - 1399 = 5n. Let u = n - -549. What is the hundreds digit of u? 2 Suppose z + 15k - 17k = 1884, 2k - 5620 = -3z. What is the thousands digit of z? 1 Suppose 9l - 5 + 5 = 0. Suppose l = 2a + 27 - 147. What is the units digit of a? 0 Let w be ((-9)/(-18))/((-2)/4). What is the units digit of 4/(-2) + (-27)/w? 5 Let v be 6/((84/(-8))/7). Let o be ((-6)/v)/((-1)/(-88)). What is the tens digit of o19/27? 4 Let z(t) = 53t*3 - 2t*2 + t + 1. What is the hundreds digit of z(2)? 4 Suppose 3b = -b, 0 = 5v - 3b - 280. Suppose p - 4d = -2p - 116, p = -3d - v. Let a = 83 + p. What is the tens digit of a? 3 Let i = 108 + -51. Suppose 343 = 5g - i. What is the tens digit of g? 8 Suppose 4n - q - 8494 = 0, -2n + 2q - 5q + 4254 = 0. What is the tens digit of n? 2 Suppose -3w - 5z - 7 = 5, 33 = -4w - z. Let m be 0 - -1 - (w + 8). Suppose -5h + 75 + 47 = -3q, mq - 58 = -3h. What is the tens digit of h? 2 Let u be (0 - 2)/(22/99)-3. Suppose ui = 26i + 115. What is the hundreds digit of i? 1 What is the tens digit of 3 + -8 + 836 - -6? 3 Let i = 8 + 2. Let k be (16/i)/((-12)/(-390)). Suppose 0 = -3j + j + k. What is the units digit of j? 6 Let v = -83 - -1010. What is the units digit of v? 7 Suppose 24470 = 72p - 62p. What is the tens digit of p? 4 Let d be ((-18)/(-4))/(-3)40/(-2). Suppose -2c + 5z + 64 = 3z, 2z + d = c. What is the units digit of c? 4 Let r(n) = 15n - 17. Let o be r(10). Suppose 0 = -i + o - 8. What is the hundreds digit of i? 1 Let n(u) = 1. Let a(d) = -d - 2. Let j(i) = -a(i) - 3n(i). Let k be j(3). Suppose -4x + 38 = -kx. What is the units digit of x? 9 Let u be (4 - (3 - (1 + -2)))/(-3). Suppose -7l + 108 + 130 = u. What is the units digit of l? 4 Suppose -a + 3o = -20, 2o - 55 - 25 = -4a. Suppose -2r + 62 = -a. What is the tens digit of r? 4 Suppose 0p + 3p - p = 0. Let t = -1 - -1. Suppose 5w + 4m - 81 = t, 2w - 3m + 15 - 52 = p. What is the tens digit of w? 1 What is the units digit of (-645)/(-86)(966/10 + 1)? 2 Suppose 0 = -4s + 298 + 470. What is the tens digit of s? 9 Suppose -103l = -87l - 28192. What is the thousands digit of l? 1 What is the hundreds digit of (-60)/(-690) - (-127646)/46? 7 Let h(c) = c2 - 12c - 8. Let y be h(13). Suppose -4d = d + yb - 780, 0 = -d - 2b + 157. What is the tens digit of d? 5 Let v(l) = 9l*2 - 31l - 7. What is the hundreds digit of v(-7)? 6 Let y be ((-52)/12 - -4)1237. What is the tens digit of y/(3-12/6)? 7 What is the thousands digit of 1139 - (5 + 6(-2)/4)? 1 Suppose -5984 = 14u - 67752. What is the hundreds digit of u? 4 What is the tens digit of (-9)/30 - 113488/(-160)? 0 Let u = 1236 + -375. What is the tens digit of u? 6 Suppose 10g - 2268 = 4g. Suppose -2v = -5d - 3v + g, -4d = 3v - 298. What is the units digit of d? 6 What is the units digit of (-2 - -3)/(8/3768)? 1 Let z(x) = -16x3 - x2 - x + 1. Let p be z(1). Let a be p/51(-30 + 0). Suppose -ay = -9y - 30. What is the tens digit of y? 3 Let f(a) = -a - 11. Let j = -13 - -16. Let w(i) = -2i*2 + 4i - 7. Let x be w(j). What is the units digit of f(x)? 2 Suppose -56 = -0w - w. Let v = -517 + 481. Let x = v + w. What is the units digit of x? 0 Let c(j) = -10j + 8 + 10 + 13j2 - 4j - j*3 - 6. Let i be c(12). Let h(r) = -3r + 9. What is the units digit of h(i)? 5 Let j(p) = 12p3 - 19p*2 + 43p - 5. What is the hundreds digit of j(2)? 1 Let c(m) = m*3 + 5m*2 - 8m - 2. Let h be c(-6). Let r(f) = 2f - 2. Let k be r(5). What is the units digit of k(-5)/(h/(-3))? 2 Let h be 11/((-33)/12)-26. Suppose -38 = -3i - 5q + 50, 0 = 3i + q - h. What is the tens digit of i? 3 Suppose 23192 = 61z - 17861. What is the hundreds digit of z? 6 Suppose 5h - 1201 = -21. What is the hundreds digit of h? 2 Let u = 2344 + -1244. What is the hundreds digit of u? 1 Suppose 2h = 9c - 12c + 210, 3c + 525 = 5h. What is the hundreds digit of h? 1 Suppose 121748 = -3o + 47o. What is the units digit of o? 7 Suppose -3v = -p - 6v + 36, p = 3v + 60. What is the tens digit of p? 4 Let y be 0/(-1 - (-6)/2). Suppose -84 = -2d - yd. Suppose 3b = b + d. What is the tens digit of b? 2 Let y(o) = -7o. Let j be y(-5). Let m = 35 - j. Suppose m = 7g - 331 - 61. What is the units digit of g? 6 Let l(t) = t3 + 5t*2 + 6t + 2. What is the units digit of l(4)? 0 Let d be (-7)/7(0 - 0). Suppose 3b - t - 218 = -31, d = 2t + 8. What is the units digit of b? 1 Let t(o) = -3 + 15 + 22o + 6o. What is the units digit of t(3)? 6 Let o(k) = 7k - 44. What is the tens digit of o(11)? 3 Let s(l) = 4l - 10. Let y be s(5). What is the units digit of (y - (-3 + 3)) + 4? 4 Let f(w) = 44w + 29. Let z be f(-9). Let o = -236 - z. What is the units digit of o? 1 Let g = 21 + -16. Suppose j = -2 + g. What is the units digit of j? 3 Let n = 384 + -142. What is the hundreds digit of n? 2 Suppose 68 = -9p + 3434. What is the tens digit of p? 7 Let w = 1541 - -977. What is the hundreds digit of w? 5 Suppose -4h - 1757 = -3u, u - 586 = -4h + 5*h. What is the units digit of u? 7 Let m be (-72)/36	{ "pile_set_name": "DM Mathematics" }
h). -h*3 + 2 Let g(z) = -4z + 34. Let k be g(10). Let t(d) = 4d2 - 4d + 2. Let f(q) = 7q2 - 7q + 3. What is kf(w) + 10t(w)? -2w2 + 2w + 2 Let a(o) = o*3 + 3o*2 + 3. Let s be a(-3). Let q(i) = -i - 2. Suppose -3h + 5 = -2l, 2h = -2l + 16 + 4. Let b(j) = 2j + 4. Calculate hq(k) + sb(k). k + 2 Let z(a) = 2a2 - 7a - 5. Let t(w) = -2 - 4w - 1 + 9 - 9 + w2. Give 10t(x) - 6z(x). -2x*2 + 2x Let g(d) = -6d2 - 11d + 5 - 13d + 13d. Let m(o) = -4o2 - 7o + 3. Determine -5g(f) + 8m(f). -2f2 - f - 1 Let n(a) = a + 3. Let k(l) = -3l - 6. Calculate -3k(s) - 7n(s). 2s - 3 Let x(g) = -g + 1. Let n(q) = 4 - 11 + q + 7q. Let j = -112 - -98. Determine jx(c) - 2n(c). -2c Let a(g) = -12g*2 - 3g + 11. Let x(s) = 23s2 + 5s - 22. Let f(h) = -5a(h) - 2x(h). Let y(d) = -9d2 - 3d + 7. Calculate -5f(o) - 8y(o). 2o2 - o - 1 Let p(l) = 7l + 3. Let c be -8 - -5 - -6(-4)/12. Let w(m) = 8m + 4. Calculate cw(h) + 6p(h). 2h - 2 Let o = -12 + 6. Let k(z) = -20z*2 + 11z + 23. Let b(l) = 7l2 - 4l - 8. Determine ok(u) - 17b(u). u*2 + 2u - 2 Let b be 15 + (0 - -1)0. Suppose b = 2k + k. Let s = k - 6. Let t(l) = 4l + 2. Let r(v) = -v. Determine st(p) - 2r(p). -2p - 2 Let l(s) = -5s2 - 1 + 4 + 6s*2 + 2s - 4. Let x(y) = 2y2 + 2y - 1. Let w = -2 - 2. Let z be 2 - (-4)/(w/5). Give zl(q) + 2x(q). q*2 - 2q + 1 Let i(z) = -5z - 4. Let h(o) = -18o - 22. Suppose 2j - 2 = -n, 4j + 1 + 7 = 4n. Let s(y) = -6y - 7. Let q(d) = nh(d) - 7s(d). Determine 5i(g) + 4q(g). -g Let g(y) = -23y - 115. Let t(p) = -1. What is -g(h) + 115t(h)? 23h Suppose -3c + 2 = -4, -5s = 5c + 25. Let q(k) = -k*2 - 2k - 2k + 8k. Let x(t) = -4t2 + 13t + 1. What is sq(j) + 2x(j)? -j*2 - 2j + 2 Let q(v) = v + 24. Let o(h) = 1. Calculate -5o(y) - q(y). -y - 29 Let g(a) = a - 16. Let y(w) = 2w - 33. What is -7g(q) + 3y(q)? -q + 13 Let v(n) = -n. Let a(g) = -1. Let x(h) = -h - 5. Let f be x(-6). Let y(r) = -2 + 4r + 3 - 4. Let u(j) = fy(j) - 2a(j). What is u(z) + 6v(z)? -2z - 1 Let j(l) = l + 0l - 2 - 2 + 1. Let g(r) = -r - 3 + 6 + 1. What is -4g(o) - 6j(o)? -2o + 2 Let a(g) = 3g*3 + 6g + 11g2 - 11g*3 - 16g - g2. Let c(i) = i3 - i*2 + i. Calculate a(r) + 10c(r). 2r3 Let q(z) = 9z - 5. Let o(f) = 14f - 8. Let i = -35 + 30. Give io(c) + 8q(c). 2c Let d(x) = -7x + 5. Let w(q) = -8q + 16. Let g(j) = 1. Let a(t) = -10g(t) + w(t). Let c be (-64)/(-10) + (-4)/10. Give cd(i) - 5a(i). -2i Let j(o) = -6o - 2. Let u(g) = 9g + 3. Calculate -8j(m) - 5u(m). 3m + 1 Let i(h) = h3. Let d(g) = -2g*3 + 3g*2 + 2g. Give -d(c) - 5i(c). -3c*3 - 3c*2 - 2c Let j(i) be the second derivative of -3i5/20 - i4/6 + i3/3 - 3i. Let t(z) = -13z3 - 9z*2 + 8z. Determine 9j(q) - 2t(q). -q*3 + 2q Let f(i) = -i*2 - 9i + 4. Let v be f(-9). Let c(z) = z - 1. Let x(q) = -q + 1. Calculate vx(t) + 5c(t). t - 1 Let a(d) = -4d. Let o(z) = -z. Let p(l) = 2a(l) - 9o(l). Suppose 5k = 5, 4c - k - 6 = -3k. Let f(s) = 1. Determine cf(w) - p(w). -w + 1 Let h(r) = -23r - 17. Let n(p) = 8p + 6. Let f(v) = -6h(v) - 17n(v). Let d(m) be the first derivative of -m2/2 - 51. Determine -6d(z) - 4f(z). -2z Let i(t) = t2 - t. Let x(d) = d3 + 5d2 - 5d. Determine 10i(h) - 2x(h). -2h3 Let t(g) = 29 - 3g*2 + 2g*2 - 29. Let k(q) = 3q*2 - 1. Calculate -k(v) - 6t(v). 3v2 + 1 Let s(n) = 7n*3 - 2n2 + n + 4. Let u(h) = h3 + h*2 + h - 1. Calculate s(k) + 2u(k). 9k3 + 3k + 2 Let g(l) = -2l3 - 9l*2 - 11l + 4. Let x(n) = n*3 + 5n*2 + 6n - 2. Give -6g(r) - 11x(r). r3 - r2 - 2 Let w(i) = -i. Let f(v) = 2v - 1. Give f(h) + 5w(h). -3h - 1 Let s(h) = 20h*3 - 3h - 5. Let d(j) = -10j3 + j + 2. Give -5d(b) - 2s(b). 10b*3 + b Let m(u) = -2u + 12 - 8u + u - 3. Let l(x) = 5x - 5. Give 11l(f) + 6m(f). f - 1 Let y(m) = 9m3 - 9m - 6. Let l(p) = 3p3 - 3p - 2. Give -11l(g) + 4y(g). 3g3 - 3g - 2 Let f(w) = -5w3 - w2 + w - 3. Let m(t) = 4t3 + t2 - t + 2. Give -5f(r) - 6m(r). r3 - r2 + r + 3 Let g(f) = -7f + 1. Let r(j) = -10j + 2. Give 7g(m) - 5r(m). m - 3 Let a(t) = 3 + 1 - 3. Let i be ((-5)/5)/((-1)/5). Let v(w) = -4w2 + 10 + 5w*2 + 0w*2 + 2w - i. What is -5a(j) + v(j)? j2 + 2j Let u(x) = -4x3 - 6x*2 - 2x + 1. Let a(l) = l3 + l2. What is 3a(z) + u(z)? -z3 - 3z*2 - 2z + 1 Let k(b) = 3b3 + 1 + b2 - b2 - 5b*2 - 4b - 3. Let n(t) = -t3 + t2 + t + 1. What is k(c) + 2n(c)? c3 - 3c*2 - 2c Let f(z) = 2z3 + 4z - 4. Let b(l) = -3l3 - 5l + 8. Let i be (-16)/5 + (-1)/(-5). Let q(w) = 1. Let a(x) = iq(x) + b(x). Determine -4a(o) - 5f(o). 2o3 Let f(i) = i3 - i*2. Let v = 7 - 17. Let l(k) = 18k*3 - 11k*2. Let x(g) = -34g*3 + 21g*2. Let o(b) = 11l(b) + 6x(b). Determine vf(a) - 2o(a). 2a*3 Let o(h) = -15h - 3. Let x(s) = -22s - 5. Calculate -8o(d) + 5x(d). 10d - 1 Let v(t) = 8t + 4. Let z(o) = 7o + 3. What is -6v(d) + 7z(d)? d - 3 Let t be -8 + 1 - (-2 + 1). Let m be -3 + 2 + 3 - -2. Let u(v) = 0v2 + 0v2 + v2 + 5 - m. Let s(g) = 4g2 - 2g + 6. Determine tu(d) + s(d). -2d*2 - 2d Let o(s) = -s2 + s - 1. Let t(d) = d3 + 8d2 - 9d + 10. Let h be 49 - (0 - 2) - 0. Let z = h + -90. Let w = z + 57. Calculate wo(p) + 2t(p). 2p3 - 2p*2 + 2 Suppose -2y + 2m = 14, 4y - m + 15 = -7. Let g(z) = 6z - 4. Let v(f) = 7f - 5. Give yg(r) + 4v(r). -2r Let t(i) = -3i*3 + 11i*2 + 11i + 11. Let j(b) = 63b + 72b - 2 + 5 - b*3 - 132b + 3b2. Determine 22j(d) - 6t(d). -4d*3 Let q be 5/(-4 - 20/(-4)). Let j(r) = -4r - r3 - r2 + r*2 + 6r2. Let n = 3 + -4. Let i(z) = z2 - z. Calculate nj(w) + qi(w). w3 - w2 - w Let l(w) = -w + 1 + 0w + 0w. Let t(i) = -14i + 4i + 14i - 3. What is 6l(r) + 2t(r)? 2r Let f(k) = 3k - 11. Let c(w) = w - 5. Suppose -u = 4q - 23, -2u = 3u + 3q - 47. Give uc(r) - 3f(r). -2r - 2 Let o(x) = x + 2. Let m be o(6). Let p(h) = -4h - 7. Let y(a) = a - 13a - 7 + 5 - 20. Let g(w) = 18w + 33. Let i(z) = 5g(z) + 7y(z). Give mp(d) + 5i(d). -2d - 1 Suppose 0 = -v - 3. Let o(x) = -2x2 - 3x. Let n(t) = -2t2 - 3t - 1. Let k(l) = -3n(l) + 4o(l). Let h(s) = -s*2 - s + 1. What is vh(g) + k(g)? g2 Let s(r) = -r3 + 2r2 + 5r - 2. Let p(x) = -4x3 + 11x*2 + 25x - 11. Determine -2p(z) + 11s(z). -3z3 + 5z Let u(d) = 4d2 + 3. Let j(w) = w2 + 1. Determine 15j(b) - 5u(b). -5b*2 Let a(b) = b + 1. Let g(p) = -5p - 45 + p + 35. Let h be g(-4). Let v(l) = -4l - 2. Calculate ha(r) + 2v(r). -2r + 2 Let f(b) = 3b3 - b. Let j(x) = x. Suppose 2w + 16 = -l - w, 0 = -2l - 4w - 22. What is lf(u) - j(u)? -3u*3 Let r(n) = 21n. Let j(k) = -k*2 + 41k - 1. Give -2j(t) + 5r(t). 2t2 + 23t + 2 Let c(n) = 21n + 1 - 11n - 6n. Let d(s) = s. Determine 2c(g) - 9d(g). -g + 2 Let b(t) = -1. Suppose 0 = 2q + 2o + 4, -q + 4o = -2 - 16. Let a(l) be the first derivative of -2l + 1/2l*q - 1. Determine -a(w) + 3b(w). -w - 1 Let r(u) = -4u3 - 5u*2 + 5u. Let l(y) = 3y3 + 4y*2 - 4y. Suppose -7v + 14v = 28. What is vr(j) + 5l(j)? -j*3 Let y be 2 - 22/42. Let m(x) = -4x + 2. Let u = 10 - 8. Let s(k) = -uk + k + 1 - 3k + 2k. Give ys(r) + 4m(r). 2r - 1 Let p(c) = c2 - 2c - 2. Let x(s) be the third derivative of -s*5/60 + 20s*2. What is p(g) + 3x(g)? -2g2 - 2g - 2 Suppose -5b = -2b + 15. Let m(o) = -6o + 5o - 6o. Let j(s) = 6s. Determine bj(c) - 4m(c). -2c Let n(t) = 15t - 33. Let l(m) = m - 2. Let o be 2/3-3 + (10 - 12). Determine on(j) + 66l(j). 6j Let x(j) = -8j + 8. Let f(h) = 17h - 17. Determine -6f(q) - 13x(q). 2q - 2 Let j(m) = -m + 1. Let s be j(7). Let u(n) = 4n - 44. Let p(r) = 1. Let c = -5 - -3. Let a(q) = cu(q) - 88p(q). Let w(t) = -17t. Give sw(d) + 13a(d). -2d Let g(v) = 5v - 7. Let h(b) = b. Let t(p) = -g(p) + 6h(p). Let d = 7 + -12. Let y(q) = -1. Let a(x) = -1. Let s(j) = 3a(j) - 4y(j). What is ds(k) + t(k)? k + 2 Suppose -2z = 2r - 8, 15 = 4r - 0r + 3z. Let a(q) = 3 + 3q - rq*2 + 0q*2 + 5q2 - q2. Let h(w) = w*2 + 2w +	{ "pile_set_name": "DM Mathematics" }
-c*3 + 178c Collect the terms in -16c - 20c - 3c - 17c + 9c + 3. -47c + 3 Collect the terms in 4n2 + 702241n - 702241n. 4n*2 Collect the terms in 6174 - 350x*2 - 6174. -350x*2 Collect the terms in 64995v + 2 - 3 - 65000v + 1. -5v Collect the terms in 82c2 - 191 - 94 - 84c*2. -2c*2 - 285 Collect the terms in 23h - 22h + 2h2 - h2. h2 + h Collect the terms in -v3 + 444v2 - 893v*2 - 59 + 449v2. -v3 - 59 Collect the terms in 219h2 - 1 + 371h*2 - 144h*2. 446h*2 - 1 Collect the terms in -4317q*2 + 2164q*2 + 2146q*2. -7q*2 Collect the terms in 26976 - 13495 + 32c - 13481. 32c Collect the terms in 92s*3 + 352s*3 + 56s*3. 500s*3 Collect the terms in 9071r - 9071r - 210r*3. -210r*3 Collect the terms in -20a*2 - 19a + 13a + 48a*2 + 6a. 28a2 Collect the terms in -189o*2 - 24o + 13o + 64o*2. -125o*2 - 11o Collect the terms in 22c3 + c2 + 20c*3 - 53c*3 + 10c3 - c2. -c*3 Collect the terms in -125 - 134 + 42 + 2x*2. 2x*2 - 217 Collect the terms in -18h*2 + 54h*2 - 34h*2 - 19h*2. -17h*2 Collect the terms in 108k + 95k + 107k + 105k + 107k - 518k. 4k Collect the terms in 19s2 - 41s*2 + 98s*2 - 31s*2 - 44s2. s2 Collect the terms in -5i + 7i + 32i2 + 0i*2. 32i*2 + 2i Collect the terms in -621v2 + 52v - 27v + 619v*2 - 25v. -2v2 Collect the terms in -12l*2 + 39l*2 + 1951l - 1951l. 27l*2 Collect the terms in -7z*3 + 36265z*2 - 12086z*2 - 12085z*2 - 12094z*2 + 2z*3. -5z*3 Collect the terms in 0 + 0 - 116g*2 + 2009g*2 + 502g*2. 2395g*2 Collect the terms in -1447 - 1451 + 5s - 1445 + 4349. 5s + 6 Collect the terms in 1644 - 9n - 717 - n - 927 - 6n. -16n Collect the terms in -32516v + 16260v + 16263v. 7v Collect the terms in -1754 + 6906 - 1762 - y3 - 1752 - 1638. -y3 Collect the terms in 522k3 - 125k + 125k. 522k*3 Collect the terms in -33924239 + 33924239 + 6y*2. 6y*2 Collect the terms in 12y + 24 - 24 - 122y. -110y Collect the terms in 16 + 28 + 750l + 27. 750l + 71 Collect the terms in -94588f2 + 0 + 189150f*2 + 0 - 94579f*2. -17f2 Collect the terms in 1239 - 554 - 685 - q3. -q*3 Collect the terms in 8q + 9q - 29q + 12q + 8q*2. 8q*2 Collect the terms in -6841738c + 6841738c + 5c*2. 5c*2 Collect the terms in 88 - 130y*3 + 37y*3 + 94y3 - 88. y3 Collect the terms in 117 + 45 + 50 - 212 + 5r. 5r Collect the terms in 5 - 2 - 86034z + 84968z - 3. -1066z Collect the terms in -450g - 445g + 4 - 449g + 1785g - 442g. -g + 4 Collect the terms in -66038v + 0 + 1 - 1. -66038v Collect the terms in 33738s3 + 33746s*3 - 67491s*3. -7s*3 Collect the terms in -7292614g + 14585216g - 7292600g. 2g Collect the terms in 9 + 10 - 19 + 134l*3. 134l*3 Collect the terms in -2y + 11011y3 - 11021y*3 - 2y - 10y - 11y. -10y3 - 25y Collect the terms in -2 - 67g2 + 97g*2 - 72g*2 + 2 + 33g*2. -9g*2 Collect the terms in -63 + 1 + 3 - 13k*2 + 6k*2. -7k*2 - 59 Collect the terms in 4297 - 2148 - 2146 - 12h. -12h + 3 Collect the terms in -478b - 4281b + 55090b + 26169b. 76500b Collect the terms in 159r + 1486r*3 - 159r. 1486r3 Collect the terms in v - v + 7558v*3 + 5v - 7559v3. -v3 + 5v Collect the terms in 113 + 107 - g - 241. -g - 21 Collect the terms in 7 + h - 15 + 7h + 7. 8h - 1 Collect the terms in 82s - 36s - 38s. 8s Collect the terms in -6u - u + 70 + 6u - 71. -u - 1 Collect the terms in -86a - 11150 + 11150. -86a Collect the terms in 75a2 + 34a + a - a*3 - 56a2. -a3 + 19a2 + 35a Collect the terms in -7q + 2987 + 5q - 3103. -2q - 116 Collect the terms in -6n + 136n - 144n. -14n Collect the terms in 141k*2 + 5k - 22k + 10k + 7k. 141k*2 Collect the terms in -8 + 3j + 19 + 14 - 1 + 26. 3j + 50 Collect the terms in 1485b + 1419b + 1489b - 4397b. -4b Collect the terms in 1 + 36u + 22 + 15 - 38. 36u Collect the terms in -4273863 + 87x2 + 4273863. 87x*2 Collect the terms in -592988 - 77v*2 + 592988. -77v*2 Collect the terms in -268f*3 + 518f*3 + 391f*3. 641f*3 Collect the terms in u - 3u + 3u2 + 2u*2 + 0u + 4u. 5u*2 + 2u Collect the terms in -10k - 8k + 5k + 5k - 7k. -15k Collect the terms in -7 - 36588p3 + 36593p*3 + 7. 5p*3 Collect the terms in -392 + 392 + 10j - 41j. -31j Collect the terms in 57z3 + 0z*2 - 2238683z + 0z2 + 2238683z. 57z3 Collect the terms in -1020i + 245i - 555i. -1330i Collect the terms in 158k*2 - 51k*2 + 142k*2. 249k*2 Collect the terms in 84 + 77h*3 - 62h*3 + 84 - 168. 15h*3 Collect the terms in -7 + 8 - 156z - 459z + 123z. -492z + 1 Collect the terms in -p3 + 666902p + 0p3 - 666902p. -p*3 Collect the terms in 1954l - 1040l - 821l. 93l Collect the terms in -3 - 6l + 7l - 40 + 45l. 46l - 43 Collect the terms in -103090w*2 + 9w*3 + 103090w*2. 9w*3 Collect the terms in -2336r*2 - 793r*3 + 2336r*2. -793r*3 Collect the terms in -51v*2 - 336v*2 + 2v + 2v - 5v. -387v2 - v Collect the terms in 0 + 503r*2 + 507r*2 + 0. 1010r*2 Collect the terms in 791h*2 + 957h*2 - 1480h*2. 268h*2 Collect the terms in 339p*2 + 418p*2 - 746p*2. 11p*2 Collect the terms in 72173192 + 5x*3 - 72173192 - 2x*3. 3x*3 Collect the terms in 39b + 3b2 + 8b*2 - 8b2 - b2. 2b2 + 39b Collect the terms in -408o + o3 + 4o*3 - 7o*3 + 4o*3 + 38o*2. 2o*3 + 38o*2 - 408o Collect the terms in -11238j3 + j - 11137j*3 + 33487j*3 - 11220j*3. -108j*3 + j Collect the terms in -2 + 2 + 22696q + 22696q + 22698q - 68091q. -q Collect the terms in -2 + 234k - 409k - 10k. -185k - 2 Collect the terms in 4k - 413k3 - 418k*3 - 4k + 817k3. -14k*3 Collect the terms in -164b - 8 + 1 + 74b + 70b. -20b - 7 Collect the terms in 91j - 341j - 287j + 26j. -511j Collect the terms in -3333297v - 4 - 3333292v + 4 + 6666590v. v Collect the terms in 45u*3 - 212u*3 + 57u*3. -110u*3 Collect the terms in 3n + 1200 - 4n2 - 4n - 1200. -4n2 - n Collect the terms in -2o + 31923930 + 31923938 - 63847868. -2o Collect the terms in -98115964t*3 + 0 + 98115963t3 + 0. -t3 Collect the terms in -5m2 - 672 + 1319 - 647 + 4m*3. 4m*3 - 5m*2 Collect the terms in 3p - 17p2 - 4p*2 - 20 + 22 - 2. -21p*2 + 3p Collect the terms in -226s2 - 503s*2 + 141s*2 - 1414s*2. -2002s*2 Collect the terms in -41c - 67c3 + 57c - 16c. -67c*3 Collect the terms in -310y*2 - 2464y*2 - 1513y*2 - 4821y*2. -9108y*2 Collect the terms in -25 + 23 - 853j*3 + 871j*3. 18j*3 - 2 Collect the terms in -13w*2 - 53w - 4w2 + 11w*2 + 53w. -6w2 Collect the terms in -10437 + 10437 + 3m*2. 3m*2 Collect the terms in -114586s + 57293s - 1 + 57293s + 30s2. 30s*2 - 1 Collect the terms in -1 - 1796a + 3587a + 1 - 1796a. -5a Collect the terms in 90 - 79 - 11 - 36d. -36d Collect the terms in 0n - 2n - 5n + 2n - 5n + 9n. -n Collect the terms in 557 + 629 + t2 - 1343. t2 - 157 Collect the terms in -16 + 16 + 1078o*2. 1078o*2 Collect the terms in 28 - 28 - 644k*2 + 644k*2 + 7k*3. 7k*3 Collect the terms in -173969167f + 173969167f - 4f*2. -4f*2 Collect the terms in -5781 + 11569 - 5788 - 18w. -18w Collect the terms in -75w*2 + 298w + 146w2 - 298w - 17 - 72w2. -w2 - 17 Collect the terms in -1411u + 682u + 726u. -3u Collect the terms in 695v - 340v - 341v. 14v Collect the terms in -1 + 12 + 63r*2 + 6 - 65r*2. -2r*2 + 17 Collect the terms in 19t + 129086 - 129086. 19t Collect the terms in 1378t + 883t - 2270t. -9t Collect the terms in -128n*2 + 2n + 1 - 2n + 168n*2. 40n*2 + 1 Collect the terms in 211 - 626 + 210 - 503c + 205. -503c Collect the terms in -42p - 25p + 40p + p. -26p Collect the terms in -2d + 4 + 561265d2 - 561263d*2 - 4 + 2d. 2d2 Collect the terms in 8x - 233 + 25x + 233 - 3x. 30x Collect the terms in -2b - 60b + 73 + 5 + 0. -62b + 78 Collect the terms in -562n3 + 3n + 0n + 41n*2 - 41n*2. -562n*	{ "pile_set_name": "DM Mathematics" }
-3u3 + 5u*2 + 3u. Let l(b) = 4n(b) - 5r(b). Determine l(-4). -4 Let k(r) = -r3 + r2 - r + 1. Let h(f) = -3f3 - 3f*2 + 9. Let n(g) = h(g) - 2k(g). Give n(-5). -3 Let x(q) = q - 6. Suppose 0 = -5t + 46 + 19. Suppose 3g + 2g = c - t, -c - 3g + 5 = 0. Suppose 24 = ch - 3h - m, m = 1. What is x(h)? -1 Let s(z) be the first derivative of -z*4/24 - 5z3/6 + z2 - 1. Let j(t) be the second derivative of s(t). What is j(-4)? -1 Let i(q) = q + 8. Suppose -2c = -5c + 18. Give i(c). 14 Let m(x) = 7x3 + 11x + 6. Let u(f) = -f3 + f2 - f - 1. Let o(j) = m(j) + 6u(j). What is o(-5)? 0 Let d(b) be the second derivative of b5/24 - b4/24 + b3 + 6b. Let u(t) be the second derivative of d(t). Give u(1). 4 Let g(k) = k*3 + 8k*2 - 9k. Let f be g(-9). Let h be -2 + f - (3 + -4). Let q(p) = 4p2 - 2p - 1. Determine q(h). 5 Let d(y) = -3y3 + 4y*3 + 0y*2 - 6y + 4y2. Let p be d(-5). Suppose pf + 3 = 2f. Let m(s) = 3s*2 + s + 1. Give m(f). 3 Let m(a) = -23a*2 - 3a3 - 2 + a3 + 21a2 + a. Calculate m(-2). 4 Let x(b) = 3b + 6. Let t(r) = 4r + 7. Let m be 3/(-2 - 1)5. Let l(k) = mx(k) + 4t(k). Determine l(8). 6 Let n(h) = h*3 - 3h*2 + 4h - 2. Let d = -7 - -21. Let y be d/6 + (-2)/6. Determine n(y). 2 Let n(o) = -2o3 - 5o2 - o + 1. Let p(z) = -z3 - 1 + 18z2 - 18z*2 - z. Let s(w) = n(w) - 3p(w). Give s(3). -8 Let w(g) = -16g + 10. Let c(l) = -3l + 4. Let j be -1 - -1 - 1/1. Let p(t) = t - 1. Let i(b) = jc(b) - 6p(b). Let n(s) = -11i(s) + 2w(s). Calculate n(2). 0 Suppose -6j = -2j + 28. Let b = j + 3. Let p(n) = -3 + 3 - n*3 - 5n*2 - 5n. Give p(b). 4 Let d(h) = 11h3 - 4h*2 + h - 1. Suppose 0 = -4s - s - 10. Let i(g) = 10g3 - 3g*2 - 1. Let v(r) = sd(r) + 3i(r). Suppose -4c - 4 = -0c. Give v(c). -8 Let w(f) = -2f*3 + 2f*2 - f + 1. Let r be w(2). Let h = 1 + r. Let y = h + 4. Let l(x) = 2x + 2. Determine l(y). -6 Let y(p) = p + 2. Let i = 5 - 9. Let r be y(i). Let q = r - 2. Let l(g) = -g*2 - 6g - 3. What is l(q)? 5 Let h(l) be the third derivative of l4/12 + l3/6 + l*2. Let j(i) = -3i - 2. Let m(q) = -8h(q) - 5j(q). What is m(5)? -3 Let i(u) = -u*3 - 6u*2 - 5u - 2. Let c be (-14)/3 - 9/27. Calculate i(c). -2 Let b(r) be the first derivative of r*4/4 - 4r*3/3 - 2r*2 + 4r - 6. Calculate b(5). 9 Let q(m) = m*3 - 4m*2 - 2m - 4. Suppose -2 = -2h - 0. Let y be -5(-1)/(h + 0). Calculate q(y). 11 Let u(z) be the first derivative of -1/2z2 - 8z + 4. Calculate u(-4). -4 Let s(p) = p*2 + 3p. Let y(h) = -2h2 - 3h + 1. Let v(b) = 3s(b) + 2y(b). Give v(3). 2 Let c(o) = -2o + 5. Let k(w) = w. Let v be k(2). Let m be 6/v - (-6 + 3). Let b(j) = -j2 + 6j + 5. Let q be b(m). Calculate c(q). -5 Suppose 0 = -2d + 4, 4n + 2d - 19 = -n. Let k(p) = 3p*2 - 4p*3 - 8p - 4 + p*2 + np*3 - 11p2. Determine k(-6). 8 Let t(w) = w3 - w - 8. Let v = 0 - 2. Let n = -2 - v. Calculate t(n). -8 Let m(u) = -5u3 + u2 - 2u + 1. Let j(b) = b*2 - 3b*2 + 3b*2 + 9b + 9. Let w be (-26)/3 + 4/6. Let a be j(w). What is m(a)? -5 Let j(l) = l + 0 - 5l + 0l2 + 1 - l2. Calculate j(-2). 5 Let m(i) be the second derivative of i8/6720 + i7/2520 + i*4/12 - 3i. Let y(n) be the third derivative of m(n). Determine y(-2). -4 Let f(l) = -l3 - l + 1. Let d(r) = r3 - 3r2 - 1. Let s(k) = d(k) + 2f(k). Suppose -5o + 14 = -2z - 3o, 4z + 3o = 7. What is s(z)? 1 Let u(s) = -3s*2 - 9s - 1. Let l(w) = -7w2 - 19w - 1. Let c(i) = -2l(i) + 5u(i). What is c(-5)? 7 Let y(d) be the second derivative of -3/2d2 - 2d - 5/6d3 - 1/12d*4 + 0. Determine y(-4). 1 Let b = -3 - -2. Let z be 3/(6/b)10. Let r(s) = -s - 2. Determine r(z). 3 Suppose -2 = -2p + 5s - 0s, -5p + 2s - 16 = 0. Let m(w) = w2 + 2w + 2. Give m(p). 10 Let d(o) be the third derivative of -o7/2520 + o5/40 - o*4/24 + 4o2. Let a(p) be the second derivative of d(p). Give a(0). 3 Let s(i) be the first derivative of -i4/24 + i*3/6 + 7i*2/2 + 4. Let o(n) be the second derivative of s(n). What is o(5)? -4 Let j(n) = 2n*2 + 2n - 5. Let k(l) = 6l2 + 5l - 14. Let w(a) = 8j(a) - 3k(a). Let m be (-9)/4(-48)/18. Let i be (-4)/(-3)m/4. Give w(i). -4 Suppose -2s = -6s + 3o + 116, -4o + 48 = s. Suppose -i = 2z + 3, 5i - s = 5z + 13. Let n(a) = 5a + 7 - 1 - a*2 + 2a*2. Give n(z). 2 Suppose -f + 5f = 12. Let b(i) = i + 3i + f - 3i. Let u be 1 - (12/2 + -1). Give b(u). -1 Let u(a) = -a*3 + 3a*2 + 4a - 3. Let x = 6 - 1. Let h = x - 2. Determine u(h). 9 Let m(x) = x*2 + 4x. Let r be (-2)/(-9) - (-68)/18. Let f = r + -7. Determine m(f). -3 Let i(t) = 13t - 28. Let b(r) = -7r + 15. Let u(f) = 11b(f) + 6i(f). Determine u(0). -3 Let f(b) = b + 2. Let x(n) = n + 4. Let l(d) = 6f(d) - 5x(d). Suppose -5k - 9 = 2s + 2s, -3s = -5k - 37. What is l(s)? -4 Let f(a) = 2a*3 - 2a*2 - a - 2. Let u be 132/(-20) + (-2)/5. Let y = u + 9. Give f(y). 4 Let d(g) be the second derivative of 5/12g*4 + 3g - 1/2g3 + 0 + 3g*2 - 1/20g5. What is d(5)? -9 Let n = 17 + -14. Let l(j) = j3 - 2j2 - j + 4. Determine l(n). 10 Suppose -2 = r - 3. Let y(s) = -3s + s + r + s. Let a(h) = -h + 11. Let n be a(6). Give y(n). -4 Let g(d) = d*3 - 6d*2 + 3d - 8. Let q(v) = 5v2 - v. Suppose 3y - 6 = 3k, -2 = 5k - 3y + 6. Let u be q(k). Give g(u). 10 Let f be -3 + 10/(-12) + 4. Let p(n) be the third derivative of 0n + 0n5 - fn*3 - 3n*2 + 1/120n*6 + 0n*4 + 0. Give p(0). -1 Let z(d) = -5d + 10d - 16d. Give z(-1). 11 Let v(w) = -9w2 + 1. Let o(t) = -3t - 2. Let z be o(-2). Suppose -15 = -5b - zu, -5b + u = -u + 15. Calculate v(b). -8 Let j(r) = 2r - 5. Let p = 14 - 8. Calculate j(p). 7 Let o(d) = -d + 2. Let f(n) = n - 3. Let m(a) = -4f(a) - 6o(a). Let y be (1/2)/((-2)/(-24)). Suppose -u = -yu + 5. Give m(u). 2 Let f(q) = q2 + 5q - 5. Suppose 4y - 19 = -3. Let p be -2 + -9 + 2/2. Let k = y + p. Determine f(k). 1 Let v(u) = 14u + 6. Let f(b) = 5b + 2. Let t(g) = 17f(g) - 6v(g). Give t(2). 0 Let a(l) = l2 + 2l - 3. Let r be a(-4). Let p(i) = i - 3. Determine p(r). 2 Let i(a) = -a*3 + 2a2 + a - 2. Let q(j) = j2. Let h(r) = -i(r) + 2q(r). Determine h(-2). -4 Suppose 3z - 3 = 2z. Let d(j) = 0j*2 + 11 - 4 + 3j + 3j + jz - 6j*2. What is d(5)? 12 Let a(o) = -o - 6 + 5 - o. Let r(n) = n + 2. Let j be r(0). Suppose 5x - 3g = -1, 5g - j = 8. Give a(x). -3 Suppose 9n + 84 - 3 = 0. Let k(r) = -r3 - 9r*2 - 10. Give k(n). -10 Suppose 51 = 2c + c. Suppose 3f = -6a + a - c, -f = -5a - 21. Let z(b) = 8b*3 + b - 1. Give z(f). 8 Suppose -4z + 3z + 2y + 1 = 0, -5z = -3y - 26. Let s(k) = -k - 6. Calculate s(z). -13 Suppose -1 = 3r + 8. Let n(q) = -q - 1. Give n(r). 2 Let i(c) be the first derivative of -c3/3 - c2/2 + c + 27. Give i(0). 1 Suppose 3i - 12 = -i + 4n, 3i - n = 7. Let a(q) = -q*3 + 5q*2 - 1 + iq + 2q3 + 1 - 4. Give a(-3). 8 Let z(t) be the first derivative of 5 + 1/2t*2 - 1/3t*3 + 4t - 1/4t4. Give z(0). 4 Suppose 4u + 3q + 16 = -u, 0 = -4q - 8. Let a(i) = -i*2 - 1. Let h = -5 - -6. Let g(k) = 4k*2 - k + 7. Let z(n) = hg(n) + 6a(n). What is z(u)? -5 Let y(a) = -a3 + 5a*2 - 3a - 1. Suppose 0 = -m + 4 - 2. Suppose -2u + d - 13 = -5u, md = -3u + 14. Determine y(u). 3 Let l(v) = -6v - 2. Let p = -6 - -8. Give l(p). -14 Let k(m) be the first derivative of m3 + 1/2m*2 + 2m - 2 - 1/4m4. What is k(2)? 8 Let k(d) = 4. Let j(x) = x + 1. Suppose -2a + 16 = -6. Suppose 0 = 5r - 2b - 2b - a, 0 = -4r + 3b + 8. Let u(g) = rk(g) + 2j(g). Calculate u(2). 2 Let j(l) = -l - 1. Let s(c) = c - 3. Let a be s(0). Let p be ((-2)/4)/(a/6). Let f(k) = -5k - 6. Let i(b) = pf(b) - 4j(b). Determine i(-5). 3 Let o(v) = v + 1. Suppose 13m = 12m - 15. Let h = m + 14. What is o(h)? 0 Let h = 14 - 13. Let c be (h(-8 + 3))/(-1). Let r(n) = 7n - 6. Let b(q) = -13q + 12. Let g(a) = 6b(a) + 11r(a). Give g(c). 1 Suppose 3c - 8 = 1. Let a be 64/28 + 4/(-14). Let i(g) = g2 + 1 - 3 + ga - 3g. Determine i(c). 7 Let q = -3 - -3. Suppose ql = l. Suppose lg + 4g + 20 = 0. Let n(c) = c*2 + 5c + 6. Determine n(g). 6 Let x(l) = -2*l + 1. Le	{ "pile_set_name": "DM Mathematics" }
Solve -pi - 1 = 1 for i. -1 Suppose 4q + 51 = 5o, 4o + 3q = 178 - 162. Solve of = 5f + 4 for f. 2 Let a(j) = 56j + 1702. Let d be a(-30). Solve -dh = -34 + 56 for h. -1 Let l be 228/(-38) + (2 - (0 + -1)) - -4. Let z = -6 - -9. Let x = 2 + 0. Solve -xn = -l + z for n. -1 Let p be (-1585)/(-75) - (-4)/(-30). Let n be 44/2 + p + -23. Solve 0t = -4t + n for t. 5 Suppose 5i + 1 = 3p - 20, 0 = -3p - 3i - 3. Suppose -pm - m = -15. Suppose -93 = -36c - 22c - 28c - 7. Solve 6k - mk = c for k. 1 Let z = -23873 - -23908. Solve -zq + 43q - 56 = 0 for q. 7 Suppose -2k + 47 = -831x + 830x, 3x = 4k - 99. Solve 7i = -0i - k for i. -3 Let f = 4662 - 4658. Solve -fv + 3v = 4 for v. -4 Let g(f) = 156f + 14667. Let i be g(-94). Solve -io - 12 = o for o. -3 Suppose 31f + 577 + 1004 = 0. Let l be (-2)/1 + 272. Let w = f + l. Solve w = c + 4 for c. -3 Let k(m) = -4m + 11. Let g(f) = -f + 5. Let n(d) = 9g(d) - 4k(d). Let o be n(1). Solve 0 = -ov + 2v for v. 0 Suppose -39n + 17 = -61. Let x(p) = -p2 + 29p + 67. Let z be x(31). Solve -z = -nb - 9 for b. -2 Let c(s) = -4s*2 - 28s + 10. Let w be c(-7). Let l be 279/15 + w/25. Solve -lo = -18o + 3 for o. -3 Let o(n) be the first derivative of 3n2 + 59n + 76. Let u be o(-9). Solve u = 4i + i for i. 1 Suppose g + 7 = -5c, 38c = 36c - 8. Solve -q = -7 + g for q. -6 Suppose 20a + 273 = 1093. Suppose -38o + a = 3. Solve -4q + 7 = -o for q. 2 Let i(m) = -42m*2 - 504m + 10. Let s be i(-12). Solve 47v + 37 + s = 0 for v. -1 Let d(u) = 11u - 4u - 24 - 3u + 2u - 2u. Let z be d(7). Solve 3n - zn + 5 = 0 for n. 5 Let w be 8/(-1(-2 - 0)) + 16/4. Let q be 3 - (2 + -3 + 0). Suppose 0 = qc - c - 12. Solve 0u + w = -cu for u. -2 Let z = 18 + 22. Let k = 40 - z. Suppose -5d + 20 = -kd. Solve -2h = -dh for h. 0 Let j be (1 - 8) + -1(-270)/3. Suppose 462 = 5d + 92. Let l = j - d. Solve 6 + l = 5u for u. 3 Let k = -243 + 244. Let v(g) = -g3 + 7g*2 + 2g - 12. Let l be v(7). Solve -ld + 3d + k = 0 for d. -1 Let i be -190(52/39)/(10/3). Let j be 64-13/3 + -2. Let y = j - i. Solve 4f + y = 2 for f. -2 Let b be -1(-6 + (2 - -1) - 0). Let c(f) = -f3 - 6f*2 - 6f + 1. Let v = 7 - 12. Let y be c(v). Solve -3 - y = bu for u. -3 Let a be (1 + -10)/((-6)/4). Suppose 2s = 2b - 28, -3b - 3s - 23 = -41. Suppose al + b = 40. Solve -lv = -4v for v. 0 Suppose 5 = 5k - 5. Let r = -486 + 489. Solve rv = 4 + k for v. 2 Let w be (1/2)/(26/52) - -1. Suppose 3l - a = 11, -2l = wl + a - 3. Solve 3f - l = -11 for f. -3 Let x(n) = n*2 - 7n + 3. Let c be x(7). Suppose -4d + d = c. Let t be 3/d - 84/(-14). Solve k + 0k = t for k. 3 Suppose -9o - f = -11o + 117, 4f + 114 = 2o. Let s = 59 - o. Solve 5q - 12 - 13 = s for q. 5 Let z = 23 + -10. Let l = 44 + -47. Let g be l/1 + (-18 - -23). Solve -gb - z = -3 for b. -5 Let r(v) = v*3 + 11v*2 - 238v + 99. Let b be r(-22). Solve 179 - 102 = -bp for p. -7 Suppose 0 = 161h - 1026 - 101. Solve 2 = 3o - h for o. 3 Suppose -3b = -2r + 6r - 7, r + 2b = -2. Suppose -y - 4k + 23 = -0y, -rk - 22 = -2y. Solve -4u - y = u for u. -3 Suppose 2m + 290 = 4m - r, 2m - 2r - 292 = 0. Let k = m + -102. Solve s - k = -46 for s. -4 Let m be 24/20((-315)/(-81))/(1/6). Solve mr - 3 = 53 for r. 2 Suppose 7c = 2577 - 729. Let x = -253 + c. Solve -2 = -12m + xm for m. 2 Suppose 0c - 5c = -3t - 21, -c = -2t. Suppose -16 = -5h + 3s, -ch + 14 = -h - 2s. Solve 0 = b + b - h for b. 1 Suppose -5f + 3r = 18, 4f = 5r + 536 - 566. Solve f = 57i + 6i + 315 for i. -5 Let k = -23 - -29. Let n(z) = 3z*3 - 5z*2 - 7z + 11. Let q(x) = -x*3. Let a(r) = n(r) + 2q(r). Let p be a(k). Solve -p + 1 = -v for v. 4 Suppose 3t + 3k + 53 = 71, 2t - 2k - 32 = 0. Solve -9l - t = -20l for l. 1 Suppose 0 = b + s - 4, 6b - 3b + 28 = 5s. Let d be 1b(-10 - -13)-2. Solve 0 = dg - 16 - 8 for g. 4 Let m = -230 + 237. Let l be 2/(-1) - (44/(-4) + m). Solve 0 = -j + 4 - l for j. 2 Suppose 145a = 144a + 5m + 23, -2m + 34 = 2a. Solve 162 - 198 = ao for o. -2 Let v = 366 - 312. Let i = v + -49. Solve -s - is - 24 = 0 for s. -4 Let i = 39 + -35. Suppose p + 10 = -ip. Let v be p(-2)/(-1) + 10. Solve b + v = 3b for b. 3 Suppose 4t = -t + 2x + 85, 4t + 4x = 40. Let a be -4 + 50/5 - (1 + 3). Solve 0 = td - 17d + a for d. 1 Suppose 2a - 1469 - 412 = -55a. Solve 0 = -43w + 53 + a for w. 2 Let s = 2615 - 2584. Solve sj - 22j + 27 = 0 for j. -3 Let b = 91 + -86. Let k = 0 + 0. Let o be ((-270)/40 - -6)/((-6)/16). Solve -t + b - o = k for t. 3 Let t = 3403 - 3400. Suppose 0x + 4x = 100. Suppose 0 = 6j - j - x. Solve -1 = -ti + j for i. 2 Let p(j) = -j*3 - 8j*2 + j + 8. Let m(y) = 14y - 14. Let f be m(4). Suppose -4d + 10 = f. Let n be p(d). Solve 4a + 6 + 6 = n for a. -3 Let r be 2/8 - 140/(-16). Suppose -6m + 3 = -r. Suppose -p - 1 = -f, -2p = mf - p + 1. Solve -a - 2a + 6 = f for a. 2 Suppose 0 = 9087n - 9063n - 144. Solve -42o = -40o - n for o. 3 Let v(l) = -124l + 2l*2 + 7 + 280l - 146l. Let x be v(-7). Solve -8n - x = -n for n. -5 Suppose 0 = -3l + i + 7, 6l + 36 = 10l + 4i. Suppose -lm + 5w = -40, -5m + w = -4m - 10. Solve -mt + 9t = 2 for t. -2 Let t = 1041 + -721. Suppose 0 = -6z - 4z + t. Let p = z + -29. Solve pm = 4m for m. 0 Suppose 587v - 536v = 3315. Solve -74h - 72 = -vh for h. -8 Suppose 0 = -2d + y - 0y + 15, -d + 10 = -3y. Suppose -2u - d = -5f, -f + 12 = 9. Solve 0v + 16 = -uv for v. -4 Let p = 908 + -645. Let r = p + -250. Solve 8n = rn for n. 0 Let a = 171 - 166. Suppose 0 = 3w - 5r - 82, w - ar + 62 = 4w. Solve 0 = -5c + w - 4 for c. 4 Suppose -b - 4b = -25, 0 = -y + 5b - 21. Suppose -yt + 4 = 2p - 6p, 2p - 22 = -4t. Solve -47 = pj - 32 for j. -5 Let f(n) = 36n + 1979. Let i be f(-36). Solve -ij + 673j = 20 for j. -2 Let t = 13 + 7. Let i be t/2(-3)/2. Let c be i/(-10)6/3. Solve -4p = -cp - 4 for p. 4 Let o(l) = -8l - 28. Let a be o(-4). Suppose 12d - ad - 568 = 0. Let t = d + -59. Solve v + 2v = -t for v. -4 Let g be (7 - 31 - -9) + 26. Solve -g - 6 = 17w for w. -1 Let v be (-38)/(-12) + (-145)/(-174). Solve -99 = -vu - 79 for u. 5 Suppose 3951y - 176 = 3929y. Solve -yw - 8w = 0 for w. 0 Let p be (-4 + 50/15)(-3)/(-1). Let b(o) = o - 4o + 0o - 2o. Let z be b(p). Solve 0 = -4h + 2h - z for h. -5 Let m(x) be the second derivative of -x3/6 + 4x*2 - 2x - 5. Let n be m(8). Solve -5t - 15 + 40 = n for t. 5 Let v(h) = 4h*3 + h - 1. Let z be v(1). Let q be z(2 - (2 + -1)). Solve 5x - q = 4x for x. 4 Let u(r) = 56r + 2592. Let t be u(-46). Solve -td = -13d + 6 for d. -2 Let m(q) = q2 + q. Let b(f) = -47f*2 + 29f - 34. Let t(l) = -b(l) - 6m(l). Let u be t(1). Solve -12h + u = -2h for h. 4 Let t be -7(-1)/(21/18). Suppose -p - 4j = -2j, 0 = p + 3j. Let m(b) = -19b3 + b2 + b + 1. Let l be m(-1). Solve p = tu - u + l for u. -4 Suppose -4u + 18u - 294 = 0. Suppose 0 = 5s - 4i - 40, -2i - u = -s - 7. Solve -5o - 11 = s for o. -3 Suppose 0 = -b - 3c + 15, -54b - 25 = -55b - 5c. Solve 6v + 14 + 4 = b for v. -3 Let t = 2 - -2. Suppose -6j = tk - j - 21, 5j - 5 = 0. Let u be ((-28)/(-8) + -5)k/(-3). Solve 0c = -uc for c. 0 Let x(s) = -s*3 - 5s*2 + 3s - 18. Let c be x(5). Let o = 253 + c. Let k = -7 + 10. Solve o = -g + k - 1 for g. 2 Let d be (8/(-14))/((-4)/84). Suppose -4j + d = -16. Solve 0 = -jf - 18 - 10 for f. -4 Suppose -3961m = -3960m - 3. Solve 10 = -13i - m for i. -1 Let i(t) = -2t + 17. Let f(b) = 2b3 - 2b*2 - b + 2. Let g be f(2). Let c be i(g). Suppose -4h + 8 = 2a, 4 = 5h + 5a - c. Solve 0 - 12 = hu for u. -4 Let z be ((-420)/(-45))/(2/3 + 0). Let i be 0 + 173/7 - z/(-49). Solve 5u = -15 + i for u. 2 Let q = 28605 - 28425. Solve -21p = -q + 96 for p. 4 Let p be 10598/16 - 132/352. Let o = p - 653. Solve 0 = ok - 2k + 28 for k. -4 Let p(v) = v*3 + 10v*2 + 23v + 11. Let k be p(-7). Let t(a) = 2a2 - 2a - 18. Let d be t(k). Solve -4w = 2 + d for w. -2 Suppose -25 = 4v + v, 0 = 2b - 3v + 335. Let p be ((-5)/3)/(b/105). Solve c - p = -2 for c. -1 Let z(k) = -2k2 + 229k + 352. Let h be z(116). Let d be 1*4/(-1 -	{ "pile_set_name": "DM Mathematics" }
0, 21, 4 in decreasing order. 129, 51, 21, 6, 4, 0 Put -1.68705, 31/4, -5/3 in decreasing order. 31/4, -5/3, -1.68705 Sort -0.03, 2, -5.0541. -5.0541, -0.03, 2 Put 31, 53, -26 in increasing order. -26, 31, 53 Sort 4973053, 4, -2 in decreasing order. 4973053, 4, -2 Sort 2, 1, 6/5, -2735/9, 1/3, 0 in descending order. 2, 6/5, 1, 1/3, 0, -2735/9 Put 39, 5158, -4/7 in ascending order. -4/7, 39, 5158 Sort 3.854, -103, 5 in descending order. 5, 3.854, -103 Sort 2106, 0, -2, 43, -3, 12 in increasing order. -3, -2, 0, 12, 43, 2106 Put 2309, 0.3, 0.1, 1/12, 60 in decreasing order. 2309, 60, 0.3, 0.1, 1/12 Put -1, 656, -3, -6, 62 in descending order. 656, 62, -1, -3, -6 Sort -1/4, -3.9, 41158.1, 0.4 in ascending order. -3.9, -1/4, 0.4, 41158.1 Put -23461, -2, -5050, -3 in ascending order. -23461, -5050, -3, -2 Put 1, -19, -1/4, 6, 0, -147 in increasing order. -147, -19, -1/4, 0, 1, 6 Sort -34, -2, -253, 0.4. -253, -34, -2, 0.4 Sort -5, -4, 103944, 3, 0, 5 in decreasing order. 103944, 5, 3, 0, -4, -5 Put -3, 1, -4, 277, 3, 35, 52 in decreasing order. 277, 52, 35, 3, 1, -3, -4 Put -829, 215, -594 in decreasing order. 215, -594, -829 Sort 170, 0.5, -9, 117.66 in ascending order. -9, 0.5, 117.66, 170 Put 2, -21, 41, -11, -26 in decreasing order. 41, 2, -11, -21, -26 Sort 88, 11, -993, 1 in descending order. 88, 11, 1, -993 Put -1.4, 1.4, -1710, -2, 5 in increasing order. -1710, -2, -1.4, 1.4, 5 Put -0.4, -5, 2/7, 0, -81, -45 in decreasing order. 2/7, 0, -0.4, -5, -45, -81 Sort 6, -24, -1, 30422, -4 in decreasing order. 30422, 6, -1, -4, -24 Put -6, 24760, -959 in decreasing order. 24760, -6, -959 Put 4, -5, 8881, -1, 13 in decreasing order. 8881, 13, 4, -1, -5 Put -21, 1401, -8, -1, 2, 0, 4 in decreasing order. 1401, 4, 2, 0, -1, -8, -21 Put -8, -5, 0.02, -45 in decreasing order. 0.02, -5, -8, -45 Sort 5, -2535284, 7, 1. -2535284, 1, 5, 7 Sort -2/27, -65715, 1/10, 1. -65715, -2/27, 1/10, 1 Sort -6.09, -2/3, 0.2, 1/10 in decreasing order. 0.2, 1/10, -2/3, -6.09 Put 0.3, -2, 48724, 0, 0.2 in descending order. 48724, 0.3, 0.2, 0, -2 Sort 5, -38, -1359069. -1359069, -38, 5 Put 78, 800, -0.5, 0.131 in descending order. 800, 78, 0.131, -0.5 Sort 482, -4, 35, 3, 4, -2, 5. -4, -2, 3, 4, 5, 35, 482 Sort -0.2, 0, -4/5, -17, 26/25, -3 in descending order. 26/25, 0, -0.2, -4/5, -3, -17 Sort 3, -201, -2161, -1/3. -2161, -201, -1/3, 3 Put -0.63, -44.8, 33, 2/11, -3, 5 in decreasing order. 33, 5, 2/11, -0.63, -3, -44.8 Put 5/4, 14, -117155/3 in increasing order. -117155/3, 5/4, 14 Sort -5, 181, 8, -0.8, 13. -5, -0.8, 8, 13, 181 Sort -5, -15, -30, -45, -541, 1 in decreasing order. 1, -5, -15, -30, -45, -541 Sort -116, -5, 10614. -116, -5, 10614 Sort 0.6, 0, 28/2781, -62 in ascending order. -62, 0, 28/2781, 0.6 Put -5, -10, 22.97, -502 in increasing order. -502, -10, -5, 22.97 Sort -5, 162, -2/3, -38 in increasing order. -38, -5, -2/3, 162 Sort 2, -23, -3, 37, -7 in ascending order. -23, -7, -3, 2, 37 Sort 3, 6, 0, 1, -3645, 5, 4. -3645, 0, 1, 3, 4, 5, 6 Sort -1, -2, 1, 4, 169, 9 in decreasing order. 169, 9, 4, 1, -1, -2 Put 12, 3, -3, 194, 4, 27, -1 in descending order. 194, 27, 12, 4, 3, -1, -3 Sort -335, 23, -185, -3, -5 in increasing order. -335, -185, -5, -3, 23 Sort 10368627, -4, 23 in ascending order. -4, 23, 10368627 Put 2, 1, -181290, 3 in ascending order. -181290, 1, 2, 3 Put -3615984, -11, 1/6 in ascending order. -3615984, -11, 1/6 Sort 8, 3, -545, 12, 2, -2 in ascending order. -545, -2, 2, 3, 8, 12 Sort -42, 2, -15, -7, 3, 5, -26 in increasing order. -42, -26, -15, -7, 2, 3, 5 Sort 5142, 4/5, -15, 0.1. -15, 0.1, 4/5, 5142 Put 210.21, 2/7, -3, -2/119 in decreasing order. 210.21, 2/7, -2/119, -3 Sort -4, -11, -65, -58, 5, -1. -65, -58, -11, -4, -1, 5 Sort 2, -5, 1, -2, 85, 8, 9 in descending order. 85, 9, 8, 2, 1, -2, -5 Sort 46833721, 4, -3, 0.1. -3, 0.1, 4, 46833721 Put 53811, -3, 79 in decreasing order. 53811, 79, -3 Sort -4, -3, 38, -20, -1, 4, 257 in decreasing order. 257, 38, 4, -1, -3, -4, -20 Sort 138374, 4, 2, 0, -9 in increasing order. -9, 0, 2, 4, 138374 Put -123, 265362, 0 in descending order. 265362, 0, -123 Sort 1, -4, -6437478 in increasing order. -6437478, -4, 1 Put -8, -1, -5, -7910, -2.63 in descending order. -1, -2.63, -5, -8, -7910 Sort 20/31, 13/4, 155, -0.3 in descending order. 155, 13/4, 20/31, -0.3 Sort 6, 40, 79, 68. 6, 40, 68, 79 Put -418, 2, -445 in increasing order. -445, -418, 2 Put 3, -11, -0.025, 3786/7 in descending order. 3786/7, 3, -0.025, -11 Sort 7, 0.085, 11, -5, -2/15 in decreasing order. 11, 7, 0.085, -2/15, -5 Sort 37, 1, -19, 544, 6 in descending order. 544, 37, 6, 1, -19 Sort 0, -7141, 21, 3, 4 in ascending order. -7141, 0, 3, 4, 21 Put 5, -1, -6, 11571, -2 in decreasing order. 11571, 5, -1, -2, -6 Put 25, -129, 0, -5, -84 in descending order. 25, 0, -5, -84, -129 Sort -153/13, -0.2, -5, 16.5, -1 in ascending order. -153/13, -5, -1, -0.2, 16.5 Sort 65, 2521, -1, 8, -4, 3 in increasing order. -4, -1, 3, 8, 65, 2521 Put -0.1, 0.4, 8/439, 312.1 in ascending order. -0.1, 8/439, 0.4, 312.1 Sort -129, 0, 3, 15, 60, -6 in decreasing order. 60, 15, 3, 0, -6, -129 Sort 0.2, 14, 5, 1/3, -151, 1/6 in descending order. 14, 5, 1/3, 0.2, 1/6, -151 Put 4330, -5, -3, -86, 0 in ascending order. -86, -5, -3, 0, 4330 Put 2, -1828, 1, 9/8, -28 in ascending order. -1828, -28, 1, 9/8, 2 Sort 46, 5, 103, -4, 0, -8 in descending order. 103, 46, 5, 0, -4, -8 Put 0.0968, -0.09, 0.5, -4, -8748 in descending order. 0.5, 0.0968, -0.09, -4, -8748 Sort 0.1, -18, -134, 2, -3, 0.012 in ascending order. -134, -18, -3, 0.012, 0.1, 2 Put 0.3, 31/4, 9931, -0.3, 9, 0, 2 in descending order. 9931, 9, 31/4, 2, 0.3, 0, -0.3 Sort -1, -708, -6, -4. -708, -6, -4, -1 Sort 356, -751, -2, 1, -6, -3 in ascending order. -751, -6, -3, -2, 1, 356 Sort -4, 3010757, 8 in descending order. 3010757, 8, -4 Put -33, 421, 11, 1 in decreasing order. 421, 11, 1, -33 Sort 0.5, 1/6, 7002, 3, -0.1, 1 in decreasing order. 7002, 3, 1, 0.5, 1/6, -0.1 Put 0, -4, -117052, -20, -3 in increasing order. -117052, -20, -4, -3, 0 Sort 0.8, 2/11, -362, 1, -3/8, -2/7. -362, -3/8, -2/7, 2/11, 0.8, 1 Put -82, -33, 3, -822 in ascending order. -822, -82, -33, 3 Sort 1, 582194, 0.5, 5 in descending order. 582194, 5, 1, 0.5 Sort -1, -19, -1297707. -1297707, -19, -1 Sort -0.1, -1/3, -1516, -199. -1516, -199, -1/3, -0.1 Sort 5, -106, 24, 0, 164 in ascending order. -106, 0, 5, 24, 164 Sort -38672, -2, 85, 1. -38672, -2, 1, 85 Sort 2881, -4, -5, 3, 4, 21 in ascending order. -5, -4, 3, 4, 21, 2881 Put 4/3, -20, 4/19, 0.2, 2, 0.054 in decreasing order. 2, 4/3, 4/19, 0.2, 0.054, -20 Put -18, 13, 1, -7, 12, -2, 5 in increasing order. -18, -7, -2, 1, 5, 12, 13 Put 25, -7113, 0.1, -0.06 in decreasing order. 25, 0.1, -0.06, -7113 Put -2034, 32, -5, 5, 4, 3 in increasing order. -2034, -5, 3, 4, 5, 32 Sort -1/6, 330718, -0.009 in decreasing order. 330718, -0.009, -1/6 Sort 7, 1/10, 0, -18, 4/3, 170/9 in ascending order. -18, 0, 1/10, 4/3, 7, 170/9 Put -12, -264438, 4 in decreasing order. 4, -12, -264438 Sort 559, -3891, -11 in decreasing order. 559, -11, -3891 Put 3, 6, -680, -5, 17 in ascending order. -680, -5, 3, 6, 17 Sort 119, 3, -4, -11, 5, 2, -241 in descending order. 119, 5, 3, 2, -4, -11, -241 Put 8.439, 2, 571, -4, 4/9 in descending order. 571, 8.439, 2, 4/9, -4 Sort -5, -3, -60, -18, -1, -126, 0 in descending order. 0, -1, -3, -5, -18, -60, -126 Put 2, -19, 14, 16, -2, -3 in decreasing order. 16, 14, 2, -2, -3, -19 Put 1/6, 1, -29, 0, 4, 13, 107 in increasing order. -29, 0, 1/6, 1, 4, 13, 107 Sort 4, -3/4, -7/13487, -4 in descending order. 4, -7/13487, -3/4, -4 Sort -20, 2, -43, 5, 121, -8, -3 in increasing order. -43, -20, -8, -3, 2, 5, 121 Put -65, 3, 4, 2/9, -4, 0.1, -5 in descending order. 4, 3, 2/9, 0.1, -4, -5, -65 Sort -2/5, 3, 1/15, -1, 708, 1 in increasing order. -1, -2/5, 1/15, 1, 3, 708 Sort 68.1026, 1/5, 3, 5 in ascending order. 1/5, 3, 5, 68.1026 Sort 2, -6, 4, -28, 0, 1, -1560 in increasing order. -1560, -28, -6, 0, 1, 2, 4 Put 0.3, -4, -700952 in descending order. 0.3, -4, -700952 Sort -400459, 4, 1 in increasing order. -400459, 1, 4 Put -1/4, 91, 0.44, -5, -580 in decreasing order. 91, 0.44, -1/4, -5, -580 Sort 4, -59, 3, 2, -3645 in ascending order. -3645, -59, 2, 3, 4 Put -122, -10,	{ "pile_set_name": "DM Mathematics" }
y)). -3528y4 Let a(d) = 8d*2. Let o(f) be the second derivative of -29f*3/2 + 3f + 38. Give o(a(w)). -696w2 Let l(n) = 23448n*2. Let r(q) = 2q*2. Determine r(l(x)). 1099617408x*4 Let a(o) = -3o*2 - 2o*2 + 3o*2 - 5 + 3 + 5o2. Let d(m) = -m2. Give a(d(b)). 3b4 - 2 Let d(m) be the third derivative of -5m*5/24 - 5m*3/6 + 10m*2. Let l(y) be the first derivative of d(y). Let k(x) = 2x*2. What is k(l(z))? 1250z*2 Let b(t) = -52t - 3. Let a(l) = 209l + 11. Suppose 5y + 165 = 20y. Let i(v) = yb(v) + 3a(v). Let m(w) = -2w*2. Calculate i(m(h)). -110h*2 Let x(o) = -o. Let y(h) = 19h*2 - 24h2 - h2. Give x(y(d)). 6d2 Let d(i) = 17i. Let r(k) = -12495k2. Determine r(d(u)). -3611055u2 Let d(b) = -b2 + 4b + 2. Let c be d(3). Let r(f) = 4 - c + 1 + 2f. Let s(w) be the second derivative of 5w3/6 + 38w. Give r(s(l)). 10l Let n(a) = a2. Let h(y) be the first derivative of 0y - 19 - 1/2y2. What is n(h(l))? l2 Let n(z) = -25z - 21. Let f(y) = -22y2. Calculate n(f(t)). 550t*2 - 21 Let v(f) = -6508f. Let j(z) = -8z2. Calculate v(j(r)). 52064r*2 Let s(f) = -16f*2 + 5. Let i(k) = -15k*2 + 4. Let a(z) = -5i(z) + 4s(z). Let q(m) = 84772m*2 - 42385m*2 - 42385m*2. Determine a(q(x)). 44x*4 Let s(z) = -3z + 1. Let m(c) = -c - 1. Let r(p) = 3m(p) + 3s(p). Let w(b) = 4b2. What is r(w(t))? -48t*2 Let y(g) = 47g*2 + 2g - 90. Let p(w) = -8w. Give y(p(q)). 3008q*2 - 16q - 90 Let d(y) = 8y. Let j(n) = 2n*2 - 2n - 8812. Determine j(d(z)). 128z2 - 16z - 8812 Let d(u) = u*2 + 5u + 1. Let o(r) = 10r + 2. Let h(v) = -2d(v) + o(v). Let q(s) = 3s2 + 24s. What is q(h(z))? 12z4 - 48z*2 Let a(z) = -13z*2. Let t(w) = -2w*2 - 338w + 27. Determine t(a(v)). -338v4 + 4394v*2 + 27 Let g be (-2)/10 - 31/(-5). Let k(q) = 3q - gq + 4q + 3q. Let s(l) = -l. Let y(p) = -k(p) - 2s(p). Let f(m) = m. Determine y(f(o)). -2o Let q(v) = -15v + 10. Let x(u) = 1. Let z(y) = q(y) - 10x(y). Let d(s) = s - 2s - 2s + 2s. What is d(z(f))? 15f Let n be 3/7 + 354/7. Let m(y) = -3y. Let u(f) = -25f. Let z(r) = nm(r) - 6u(r). Let j(l) = -5l. Calculate j(z(c)). 15c Let n(o) = -5o. Let t(f) = 3f - 4. Let b(z) = 4z - 5. Let j be 4/((-6)/3) + 3. Suppose 3u - j = -13. Let k(g) = ub(g) + 5t(g). Determine k(n(a)). 5a Let v(l) = 2l2 + 4l + 15. Let f(i) = 2i2 + 3i + 11. Let z(u) = 4f(u) - 3v(u). Let o(n) = -10n. Give o(z(d)). -20d*2 + 10 Let w(g) = -3g. Let c(y) = -2785y. Calculate c(w(a)). 8355a Let a(v) = -176v2. Let h(l) = -407l*2. What is h(a(x))? -12607232x*4 Let m(r) = 6r*2. Let d(c) be the first derivative of -6c*3 + c - 12. Give d(m(y)). -648y*4 + 1 Let o(d) = 2d. Suppose 0s - 5q = 3s - 20, -s - 3q = -8. Let r(f) = 14 + 2f - 21 - s. Determine r(o(w)). 4w - 12 Let p(h) = 136h + 28. Let i(t) = 11t. What is i(p(y))? 1496y + 308 Let p(d) = 7d*2 - 7d + 2. Let b(j) = -13j + 3. What is b(p(k))? -91k*2 + 91k - 23 Let z(o) = -o*2 - 1. Let g(v) = 1. Let t(m) = 3. Let c(r) = -2g(r) + t(r). Let d(l) = 5c(l) + 5z(l). Let p(y) = -5y. Give p(d(b)). 25b*2 Let q(v) be the first derivative of 0v - 27 + 23/3v3 + 0v*2. Let k(c) = -2c. Calculate k(q(f)). -46f2 Let c(d) = 2397d*2 - 2d - 2. Let p(w) = -2w. Calculate p(c(l)). -4794l*2 + 4l + 4 Let x(d) = -d*2 - 1. Let w(a) = 3. Suppose 3c = 4k - 2, 4c = 2k + c + 2. Let j(h) = kw(h) + 6x(h). Let o(i) = -i. Determine o(j(v)). 6v*2 Let p = 14 + -7. Let w(g) = pg - 4g - 4g. Let f(c) = -82c. Calculate f(w(h)). 82h Let i(j) = 13j2 + 9j + 9. Let g(c) = -3c2 - 2c - 2. Let r(z) = 18g(z) + 4i(z). Let t(w) = -3w + 16. Calculate t(r(k)). 6k*2 + 16 Let a(c) = 3c*2 + 3c. Let u(d) = -2d - 373. Determine u(a(i)). -6i*2 - 6i - 373 Let d(g) = -g. Let s(z) be the second derivative of -425z3/6 + 185z. What is s(d(m))? 425m Let t(y) = 2y*2. Let z(o) = 17o*2 - 5. Let r(i) = -18i*2 + 4. Let g = 52 + -57. Let m(f) = gr(f) - 4z(f). Determine m(t(l)). 88l*4 Let c(o) = 193o - 1. Let w(k) = 2k + 322. Give w(c(y)). 386y + 320 Let y(p) = -128p. Let h(a) = -3a*2 - 15a. Let c(q) = -2q2 - 12q. Let o(f) = 5c(f) - 4h(f). Calculate y(o(u)). -256u2 Let d(q) = -2q. Let p(g) = -3g + 2. Let z(a) = 15a - 7. Let r(j) = -2p(j) - z(j). What is r(d(m))? 18m + 3 Let q(v) = 12v. Let z be (0/(-15 - -5))/(1 + -3). Let s be (02/4)/(-1). Let r(f) = -f - f + zf + sf. Determine q(r(c)). -24c Suppose -340 = -11b + 6b. Let o(p) = p + b + 4p - 68. Let m(j) = j. Calculate m(o(l)). 5l Let t(u) = u2 - 1. Let h(r) = 6r*2 - 12. Let b(g) = -h(g) + 12t(g). Let a(d) be the third derivative of -d*5/60 + 2d*2. What is a(b(k))? -36k*4 Let f be (34/(-51))/(4/(-18)). Let t(b) = fb - 4b + 2b + 0b. Let g(y) = y2 + 14y. Give g(t(n)). n*2 + 14n Let v(a) = 2a2. Let j(m) be the second derivative of m4 - 13m*2/2 - 11m. Let y(c) be the first derivative of j(c). Calculate v(y(l)). 1152l2 Let v(y) = 8y - 10. Let c(t) = -2t2 + 108t. Calculate c(v(s)). -128s2 + 1184s - 1280 Let w(s) = -5s2. Let d(h) = 63743h. Determine d(w(v)). -318715v2 Let n(t) = -t2 + 6t + 5. Let r be n(6). Suppose rw + 19 - 59 = 0. Let c(b) = -wb2 + b2 + 6b2. Let m(x) = -2x. Calculate m(c(k)). 2k2 Let v(k) be the first derivative of -4k*3 + 404. Let r(g) = -15g*2. Give v(r(z)). -2700z*4 Let w(j) = 33099j. Let h(s) = -47s. Calculate w(h(a)). -1555653a Let w(y) = 161y + 147y + 145y + 154y - 593y. Let l(g) = -45g. What is w(l(a))? -630a Let j(y) be the first derivative of -23y*3/6 - 13y + 20. Let q(i) be the first derivative of j(i). Let u(n) = n. What is q(u(w))? -23w Let i(a) = -2a*2. Suppose s - 12 = -5s. Let z(l) = 11l2 - 28l*2 + 12l*s. Determine z(i(g)). -20g4 Let y(k) = -k2. Let j(t) = 66463t2. Give y(j(q)). -4417330369q*4 Let w(j) = 8j. Let b(h) = 7h2 + 3h + 258. Determine w(b(l)). 56l2 + 24l + 2064 Let o(m) = -9m. Let p be o(-1). Let y(l) = pl + 16l - 28l. Let s(q) = -8q + 5. Let t(u) = -9u + 6. Let d(b) = 6s(b) - 5t(b). Give y(d(g)). 9g Let v(k) = 1767k. Let g(l) = -5l2 - 38. What is g(v(r))? -15611445r*2 - 38 Let m(n) = 2n. Let r(z) = z*2 + 10z + 2. Let k be r(-10). Let f(j) be the first derivative of 3jk + 2 + j2 - 3j*2. Calculate m(f(v)). 4v Let a(v) = v. Let w(f) = 55f. Let m(l) = 132a(l) - 3w(l). Let p(d) = 5d. Give p(m(i)). -165i Let v(l) = 2l*2 - l + l. Let c(w) = 27w - 105. Let j(r) = 106r - 441. Let i(s) = -21c(s) + 5j(s). Determine v(i(g)). 2738g*2 Let y(h) be the second derivative of -3h*4 - 6h. Let j(u) = 1 + 7 - 8 + u. What is j(y(w))? -36w2 Let q(a) = -26a*2 + 35a*2 - 11a*2. Let i(f) = 120f. What is q(i(t))? -28800t2 Let z(l) = -43l. Let q(v) be the second derivative of -5v3/2 + 389v. Give z(q(u)). 645u Let h(v) be the first derivative of 25v*3 - 78. Let d(i) = -4i. Give d(h(w)). -300w2 Let k(b) = -21b*2 + 42. Let t(p) = 6p - 218 - p*2 - 6p + 219. Let l(n) = -k(n) + 42t(n). Let w(d) = -3d. Give l(w(u)). -189u2 Let n(c) = 6c - 12. Let y(v) = 14v. Let l(r) = r2 + 12r. Let g(k) = 7l(k) - 6y(k). Calculate n(g(t)). 42t2 - 12 Let d(g) = -3g*2. Let j = 15884 + -8837. Let n(r) = -14r*2 + 7047r - jr. Calculate n(d(l)). -126l*4 Let y(h) = -36h - 3. Let v(r) = -r*2. Let m(l) = -4l*2. Let p(o) = 2m(o) - 9v(o). Determine p(y(z)). 1296z*2 + 216z + 9 Let p(b) = -6b + 6. Let s(k) = 2k + 206. Calculate s(p(v)). -12v + 218 Let k(s) = -s - 3. Let f(v) = -2. Let l(d) = 6f(d) - 4k(d). Let g(b) = -b. Let o(a) = 6g(a) + l(a). Let j(m) = 2m2. Calculate o(j(u)). -4u2 Let b(n) = -n2 - 10n + 3. Let y be b(-5). Suppose 5s - y = -2s. Let h(p) = sp + 2p + p + 0p. Let a(q) = 2q. Give h(a(k)). 14k Let r(w) = 5w2. Let q(v) = -767v*2 + 52v + 52. Let p(s) = 73s2 - 5s - 5. Let k(g) = 52p(g) + 5q(g). Determine r(k(n)). 7605n4 Let j(z) = -z. Let a(d) be the third derivative of 7d*6/720 - 3d*4/4 + 26d*2. Let h(n) be the second derivative of a(n). What is j(h(b))? -7b Let f(k) = 4k. Let u(z) = 137607z. Determine u(f(y)). 550428*y Let s(o)	{ "pile_set_name": "DM Mathematics" }
3k + 1920. Let c = k + -1287/2. Solve -cg + g*2 - 1/2g*3 + 0 = 0. 0, 1 Let 2/3m + 50m3 + 4/3m*4 + 26 - 78m*2 = 0. What is m? -39, -1/2, 1 Let i = 44 - 44. Suppose -5x + 22 - 2 = i. Factor -55 - xl3 - 2l*4 + 2l*2 + 4l + 55. -2l(l - 1)(l + 1)(l + 2) Let t(p) be the second derivative of -3/56p7 + 3/40p*5 + p - 2 + 0p*3 + 0p*2 + 1/40p*6 + 0p*4. Factor t(b). -3b*3(b - 1)(3b + 2)/4 Let q(x) = 17x3 - 529x*2 + 4832x - 36. Let j(h) = -19h3 + 528h*2 - 4829h + 42. Let y(u) = -6j(u) - 7q(u). Factor y(n). -5n(n - 97)(n - 10) Let z(l) be the second derivative of -l7/21 + 3l*6/5 + 21l*5/10 - 245l*4/6 - 388l - 10. Let z(t) = 0. What is t? -5, 0, 7 Let c = 1078324 + -1078322. Let -10/9j4 + 0 + 2/9j*3 - 2/9j*5 + 0j + 10/9jc = 0. Calculate j. -5, -1, 0, 1 Let q(s) = -7s + 65. Let t be q(9). Factor 0w2 - 3w*3 + 4w*5 - 9w*3 - 16w + 4w2 + 8w*4 - 36w*t. 4w(w - 2)(w + 1)*2(w + 2) Let f(y) = y - 27. Let v(t) = -t + 27. Let b(m) = -3f(m) - 2v(m). Let u be b(27). Solve 1/6w3 - 1/3w*2 + 0 + uw = 0 for w. 0, 2 Let x(w) be the second derivative of 0w2 + 1/8w*4 - 31w + 0 + 1/60w5 + 3w*3 - 1/360w*6. Let o(u) be the second derivative of x(u). Factor o(q). -(q - 3)(q + 1) What is w in 16124w + 751728w*2 - 751740w*2 - 1101 + 6477 = 0? -1/3, 1344 Let l = 94/49 + -3838/2205. Let n(b) be the first derivative of -3 + 0b*2 + 0b - lb5 + 0b*3 - 1/27b*6 - 2/9b*4. Determine a so that n(a) = 0. -2, 0 Suppose 4y - 11 = -3. Let q(b) be the first derivative of 6b2 + 0b*3 - 7b*2 - 20 - 3b - b*3 - yb*2. Factor q(a). -3(a + 1)*2 Suppose 8r + 20 = 52. Let h(o) be the third derivative of 0 + 1/24or + 1/18o*3 + 0o + 15o2 - 1/120o*6 + 2/315o*7 - 1/36o5. Factor h(g). (g - 1)2(g + 1)(4g + 1)/3 Let v = -156 - -160. Solve vs*4 + 3s*5 - 753s - 6s2 + 3s*4 + 750s - s*4 = 0 for s. -1, 0, 1 Let r be (-14)/12 - 23/(5382/(-525)). Let n = 9 - 5. Factor rj*2 - 4/13j + 6/13jn - 16/13j*3 + 0. 2j(j - 1)2(3j - 2)/13 Let z(s) be the first derivative of -s3 + 1/5s5 - s4 - 217 + 8s + 5s*2. Solve z(l) = 0 for l. -1, 2, 4 Let v(x) be the second derivative of 1/150x*4 + 4/25x*2 - 4/75x*3 + 0 + 100x. Determine h, given that v(h) = 0. 2 Let k(l) be the third derivative of l*5/30 + 2009l*4/6 + 4036081l*3/3 - 2l*2 + 24l - 7. Factor k(w). 2(w + 2009)2 Let y(u) = 15182u + 45546. Let x be y(-3). Factor 0i - 4/7i*5 - 8/7i*3 + 0i*2 - 12/7i*4 + x. -4i*3(i + 1)(i + 2)/7 Let u = -13496 + 13523. Let p(a) be the third derivative of 0 + 0a + 1/90a6 - 1/3a*4 + 0a*3 + 1/45a*5 + ua*2. Factor p(c). 4c(c - 2)(c + 3)/3 Let g(o) be the third derivative of o*8/840 + 2o*7/525 - 13o*6/300 - 13o*5/75 + 3o*4/5 + 24o*3/5 + 10701o*2. Determine v, given that g(v) = 0. -3, -2, 2, 3 Let k = -713419 - -6422140/9. Factor 74/9p + k + 1/9p2. (p + 37)2/9 Solve -2/13w*3 + 144/13 + 28/13w*2 - 114/13w = 0. 3, 8 Let y(b) be the third derivative of 16/9b3 - 1/540b*6 + 2/27b*4 - 81b - 1/54b5 + 0 + b2. Suppose y(c) = 0. What is c? -4, 3 Let b(c) be the second derivative of c5/200 + 17c*4/120 - 28c*3/15 - 539c*2/5 - 7160c. Let b(s) = 0. What is s? -14, 11 Let x be (-1359)/(-90) + (-6873)/474. Determine a so that -3/5a4 + 9/5a*2 - 3/5a*3 + xa - 6/5 = 0. -2, -1, 1 Suppose -189q + 1485 = -134q. Let l(c) be the first derivative of -1/27c3 + 4/9c - 1/6c2 + q. Factor l(w). -(w - 1)(w + 4)/9 Let n(u) be the first derivative of -u*4/42 + 808u*3/63 - 5771u*2/3 - 23548u/3 + 2997. Determine x, given that n(x) = 0. -2, 203 Find j, given that 344/19j - 2/19j*3 + 360/19 - 18/19j*2 = 0. -18, -1, 10 Let d(n) be the first derivative of 3n*4/4 - 8n*3 - 1305n*2/2 + 14850n - 4337. Factor d(j). 3(j - 15)2(j + 22) Let j(f) = -2f3 + 10f*2 + 13f - 3. Let a be j(6). Determine u, given that -40 + 12u + 24u*2 - 6u*3 + au*3 + 7u*3 = 0. -5, -2, 1 Suppose 72b = 18b - 50b - 13b. Factor -c4 + 0 + bc*2 - 1/6c*5 + 0c - 3/2c3. -c3(c + 3)*2/6 Let w(u) = -4u - 8. Let j be w(-23). Let n be j/240 + (-3)/(-12). Suppose -3/5 + ng2 - 3/5g + 3/5g3 = 0. What is g? -1, 1 Determine u so that -102/5u*4 + 60u*2 + 3/5u*5 + 666/5 + 1203/5u - 342/5u3 = 0. -3, -1, 2, 37 Let m be (-48)/21 - (-1036)/196. Let u(t) be the second derivative of 1/3t*4 - 2t + 5/6t6 - t5 + 0t*m + 0t*2 + 0. Suppose u(g) = 0. What is g? 0, 2/5 Let c be -3 + -3 + -6 + 671/55. Factor 1/5m*3 + 1/5m*2 - 1/5m + 0 - cm4. -m(m - 1)*2(m + 1)/5 Let u(o) be the second derivative of 11881o4/6 + 218o*3 + 9o*2 - 1226o. Determine q, given that u(q) = 0. -3/109 Let c = 126 - 122. What is i in -5i5 - 2i*c - 1 + 1 + 103i*3 - 106i*3 + 6i*5 = 0? -1, 0, 3 Suppose -3d*5 + 11652d*2 - 5880d*2 - 5916d*2 + 18d*4 + 42d*3 + 126 - 39d = 0. What is d? -3, -1, 1, 2, 7 Let v(n) be the second derivative of -n*4/12 - 50n*3/3 + 1332n. Find r such that v(r) = 0. -100, 0 Let p = 42453 + -42450. Factor 0r + 0 - 3/4r*p + 1/2r*2 + 1/4r4. r2(r - 2)(r - 1)/4 Let w(d) be the first derivative of -115 + 1/10d5 - 5d + 3/2d3 + 11/4d*2 - 11/8d*4. Factor w(s). (s - 10)(s - 1)*2(s + 1)/2 Let g(q) be the first derivative of -14q2 - 5q - 11q3 + 3q - 221 + 23q3 - 6q. Find j, given that g(j) = 0. -2/9, 1 Let c(p) be the third derivative of -p8/672 - p7/84 + p*6/16 + 13p*5/24 + 35p*4/24 + 2p*3 + 1170p*2. Solve c(w) = 0. -6, -1, 4 Let l be 8 + -5 + (-4 - -3). Suppose -30g*3 + 21g*4 - 2g*5 + 10227g*2 - 3g5 - g4 - 10207gl - 5g = 0. What is g? 0, 1 Let n(z) be the first derivative of z*5/100 - 19z*4/20 + 361z3/10 + z2/2 + 13z + 19. Let s(q) be the second derivative of n(q). Factor s(o). 3(o - 19)*2/5 Let y(a) = -506a - 2024. Let b be y(-4). Let r(v) be the third derivative of bv3 - 1/180v*6 + 0v - 1/36v4 + 17v*2 + 0 + 1/45v*5. Factor r(c). -2c(c - 1)2/3 Let w(k) = -k2 + 11k - 8. Let j be w(7). Let z = j - 17. Factor -8dz + 83d - 7d4 - 83d + 3d4. -4d*3(d + 2) Let c(o) be the second derivative of o*4/12 + 115o*3/3 - 4o - 142. What is w in c(w) = 0? -230, 0 Solve 2/9v3 - 5476 + 440/9v*2 + 7918/3v = 0. -111, 2 Let v(o) be the first derivative of -o*5/10 + 8o*4/9 + 4o*3/3 + 36o - 40. Let t(l) be the first derivative of v(l). Let t(n) = 0. What is n? -2/3, 0, 6 Suppose -1789t = -1856t + 201. Let -6/7qt + 4q*2 + 46/7q + 12/7 = 0. Calculate q. -1, -1/3, 6 Let i(p) be the third derivative of -215p2 + 4/9p*3 + 1/6p*4 + 0 + 1/40p*5 + 0p. Factor i(l). (3l + 4)2/6 Let y(w) be the first derivative of 12w*2 - 5/6w*4 + 4/5w*5 - 132 - 1/9w*6 + 0w - 16/3w3. Suppose y(t) = 0. Calculate t. -2, 0, 2, 3 Let d(v) = -4v*3 - 312v*2 + 2688v - 5508. Let i(o) = -1. Let n(m) = d(m) - 4i(m). Factor n(c). -4(c - 4)*2(c + 86) Let i be (-812)/(-6902) + (-678)/(-595) - 6/7. Let 2/5m3 + 0m*2 + 1/5m*4 - im - 1/5 = 0. What is m? -1, 1 Let j(p) be the third derivative of -7p8/2880 + p7/360 - p6/720 - 13p*5/12 + 2p*2 + 38. Let y(t) be the third derivative of j(t). Factor y(i). -(7i - 1)2 Solve p5 - 631120p + 304460p*3 + 19637p*2 - 92872p*3 + 423200 + 1840p*4 + 3p*5 - 25149p*2 = 0. -230, -2, 1 Let s = 1415653/9 - 157293. Find g such that -4/9g*3 + 8/9g*2 + s + 28/9g = 0. -1, 4 Let h = -12149/5 + 2430. Let k be (-6 - -3)/(2/(-3 + 1)). Factor -hyk - y2 - 4/5 - 8/5y. -(y + 1)(y + 2)2/5 Let c be ((-277)/(-9418))/(6/153). Suppose cl*2 - 33/2 - 27/4l = 0. What is l? -2, 11 Let o(c) be the first derivative of -2c5/15 - 7c*4/6 + 20c*3/9 + 16c2/3 + 3928. Solve o(l) = 0 for l. -8, -1, 0, 2 Let v = -522 + 525. Let z4 - 268zv - 267z*3 - 4z + 538z3 = 0. Calculate z. -2, 0, 1 Suppose -5g = -5, -3b - 5g - 63 = -68. Suppose -9q2 + 0q + b - 12q4 + 39/2q*3 + 3/2q5 = 0. What is q? 0, 1, 6 Let u(j) = -j4 - j - 1. Let p(r) = -43r2 + 40r*3 + 53r + 26r2 - 48r - 13r4 + 3. Let v(y) = 2p(y) + 6u(y). Factor v(h). -2h(h - 2)(4h - 1)	{ "pile_set_name": "DM Mathematics" }
nteger? 69 What is the square root of 364456360 to the nearest integer? 19091 What is 20593697 to the power of 1/10, to the nearest integer? 5 What is the cube root of 5312979434 to the nearest integer? 1745 What is 60306544 to the power of 1/3, to the nearest integer? 392 What is 545726381 to the power of 1/3, to the nearest integer? 817 What is the cube root of 38809285 to the nearest integer? 339 What is the third root of 298585350 to the nearest integer? 668 What is 90072145 to the power of 1/3, to the nearest integer? 448 What is 250916116 to the power of 1/2, to the nearest integer? 15840 What is the ninth root of 806525389 to the nearest integer? 10 What is 1073022524 to the power of 1/9, to the nearest integer? 10 What is 41212050 to the power of 1/2, to the nearest integer? 6420 What is 67435612 to the power of 1/3, to the nearest integer? 407 What is the square root of 246371464 to the nearest integer? 15696 What is the fifth root of 26402663 to the nearest integer? 31 What is the fourth root of 31561858 to the nearest integer? 75 What is 109114124 to the power of 1/6, to the nearest integer? 22 What is 2112502 to the power of 1/7, to the nearest integer? 8 What is the ninth root of 596882445 to the nearest integer? 9 What is the tenth root of 104706616 to the nearest integer? 6 What is 9596976 to the power of 1/3, to the nearest integer? 213 What is the third root of 828172392 to the nearest integer? 939 What is the cube root of 15700819 to the nearest integer? 250 What is 111442417 to the power of 1/5, to the nearest integer? 41 What is 2077374657 to the power of 1/6, to the nearest integer? 36 What is the cube root of 995972048 to the nearest integer? 999 What is 148323930 to the power of 1/4, to the nearest integer? 110 What is 48158354 to the power of 1/10, to the nearest integer? 6 What is the fifth root of 140525442 to the nearest integer? 43 What is the cube root of 162026260 to the nearest integer? 545 What is 4653493987 to the power of 1/2, to the nearest integer? 68217 What is the cube root of 103501071 to the nearest integer? 470 What is 575874297 to the power of 1/6, to the nearest integer? 29 What is the square root of 2353347469 to the nearest integer? 48511 What is 317539427 to the power of 1/10, to the nearest integer? 7 What is 41138931 to the power of 1/2, to the nearest integer? 6414 What is the tenth root of 39080549 to the nearest integer? 6 What is 9025677232 to the power of 1/2, to the nearest integer? 95004 What is 6351057 to the power of 1/8, to the nearest integer? 7 What is the third root of 153492204 to the nearest integer? 535 What is the third root of 27474236 to the nearest integer? 302 What is the eighth root of 822141309 to the nearest integer? 13 What is the square root of 1887624062 to the nearest integer? 43447 What is 2269869206 to the power of 1/3, to the nearest integer? 1314 What is the third root of 75009905 to the nearest integer? 422 What is 356248363 to the power of 1/2, to the nearest integer? 18875 What is 232557697 to the power of 1/4, to the nearest integer? 123 What is the cube root of 43024292 to the nearest integer? 350 What is the cube root of 97920750 to the nearest integer? 461 What is 240321630 to the power of 1/2, to the nearest integer? 15502 What is the third root of 10340108 to the nearest integer? 218 What is the third root of 40374428 to the nearest integer? 343 What is the cube root of 3170718410 to the nearest integer? 1469 What is the cube root of 4535192595 to the nearest integer? 1655 What is the eighth root of 293141343 to the nearest integer? 11 What is the square root of 1975607775 to the nearest integer? 44448 What is the square root of 2516625918 to the nearest integer? 50166 What is the square root of 687594225 to the nearest integer? 26222 What is the cube root of 1585086595 to the nearest integer? 1166 What is the third root of 1850098789 to the nearest integer? 1228 What is 936739845 to the power of 1/8, to the nearest integer? 13 What is 2698358048 to the power of 1/2, to the nearest integer? 51946 What is 50371903 to the power of 1/3, to the nearest integer? 369 What is the cube root of 5085918084 to the nearest integer? 1720 What is the third root of 462040396 to the nearest integer? 773 What is the seventh root of 232267234 to the nearest integer? 16 What is the square root of 604385244 to the nearest integer? 24584 What is the third root of 57655129 to the nearest integer? 386 What is 220785706 to the power of 1/3, to the nearest integer? 604 What is 3085679 to the power of 1/2, to the nearest integer? 1757 What is 156359233 to the power of 1/9, to the nearest integer? 8 What is 57085719 to the power of 1/9, to the nearest integer? 7 What is the sixth root of 161130817 to the nearest integer? 23 What is the fifth root of 83257396 to the nearest integer? 38 What is the third root of 124175617 to the nearest integer? 499 What is the third root of 3150197 to the nearest integer? 147 What is 75821915 to the power of 1/10, to the nearest integer? 6 What is 2157684293 to the power of 1/8, to the nearest integer? 15 What is 257323860 to the power of 1/8, to the nearest integer? 11 What is the third root of 2796084299 to the nearest integer? 1409 What is 378531195 to the power of 1/2, to the nearest integer? 19456 What is 30080045 to the power of 1/3, to the nearest integer? 311 What is the square root of 2277587148 to the nearest integer? 47724 What is 69948867 to the power of 1/6, to the nearest integer? 20 What is 820882193 to the power of 1/10, to the nearest integer? 8 What is the third root of 402302880 to the nearest integer? 738 What is the tenth root of 8861153 to the nearest integer? 5 What is the eighth root of 51009168 to the nearest integer? 9 What is the fifth root of 105291913 to the nearest integer? 40 What is the square root of 554109669 to the nearest integer? 23540 What is the ninth root of 420898980 to the nearest integer? 9 What is the ninth root of 781913938 to the nearest integer? 10 What is 2544402087 to the power of 1/5, to the nearest integer? 76 What is the third root of 2368624756 to the nearest integer? 1333 What is 10742982 to the power of 1/5, to the nearest integer? 25 What is the cube root of 574768356 to the nearest integer? 831 What is 1794778238 to the power of 1/3, to the nearest integer? 1215 What is the eighth root of 33115953 to the nearest integer? 9 What is the cube root of 430717519 to the nearest integer? 755 What is the fourth root of 184774726 to the nearest integer? 117 What is 102664862 to the power of 1/2, to the nearest integer? 10132 What is the square root of 56521017 to the nearest integer? 7518 What is 1388325089 to the power of 1/2, to the nearest integer? 37260 What is 116512776 to the power of 1/10, to the nearest integer? 6 What is the square root of 2717379757 to the nearest integer? 52128 What is the square root of 1386130019 to the nearest integer? 37231 What is the square root of 282799759 to the nearest integer? 16817 What is the third root of 2539478049 to the nearest integer? 1364 What is the square root of 93972116 to the nearest integer? 9694 What is 2874367463 to the power of 1/6, to the nearest integer? 38 What is the cube root of 427029672 to the nearest integer? 753 What is the square root of 2472686056 to the nearest integer? 49726 What is the eighth root of 20082701 to the nearest integer? 8 What is the square root of 217960313 to the nearest integer? 14763 What is the sixth root of 226799611 to the nearest integer? 25 What is the square root of 681013699 to the nearest integer? 26096 What is the cube root of 285363533 to the nearest integer? 658 What is 45160019 to the power of 1/6, to the nearest integer? 19 What is the sixth root of 1294529394 to the nearest integer? 33 What is the square root of 492442062 to the nearest integer? 22191 What is 74471399 to the power of 1/8, to the nearest integer? 10 What is 615540010 to the power of 1/7, to the nearest integer? 18 What is the square root of 37069183 to the nearest integer? 6088 What is the square root of 7865113 to the nearest integer? 2804 What is 462441900 to the power of 1/6, to the nearest integer? 28 What is the eighth root of	{ "pile_set_name": "DM Mathematics" }
5q + 1 - 35 for q. 1 Solve 530 + 861 = -348x - 1 for x. -4 Solve 5638 = 777x - 9125 for x. 19 Solve 777 - 281 = -31q for q. -16 Solve 79f = 178f + 2079 for f. -21 Solve -74u = 27u - 49u + 1196 for u. -23 Solve -20i - 4i + 31 = -113 for i. 6 Solve -669o - 364 = -697o for o. 13 Solve -59h - 44 = 34h + 421 for h. -5 Solve -35n = 125n - 2240 for n. 14 Solve -444q = -459q - 135 for q. -9 Solve -34 = -145l - 1150 - 1784 for l. -20 Solve 43d + 114d - 1032 = 538 for d. 10 Solve -83d = -59d - 120 for d. 5 Solve -55g - 187g = 583 + 385 for g. -4 Solve 491t - 6650 = -18925 for t. -25 Solve 115k = -9k + 1300 + 808 for k. 17 Solve 347 = 17n + 313 for n. 2 Solve 0 = 194f - 149f + 360 for f. -8 Solve 31x - 170961 + 170961 = 0 for x. 0 Solve 32 = -21v - 2v - 175 for v. -9 Solve 252 = -93q - 45q - 2094 for q. -17 Solve 0 = 271w + 1777 + 3319 + 1950 for w. -26 Solve 692y - 66 = 686y for y. 11 Solve -78h - 19643 + 20267 = 0 for h. 8 Solve 95k + 68 = -929 - 333 for k. -14 Solve 0 = 76j - 191j - 225j - 3740 for j. -11 Solve 15a + 11 + 61 - 222 = 0 for a. 10 Solve -246l - 346 = -392 - 1430 for l. 6 Solve 40 = 2o + 3o for o. 8 Solve -74j - 1566 = -335j for j. 6 Solve -21n + 10n - 16 = 105 for n. -11 Solve 1372 = 186i - 1976 for i. 18 Solve 52 = 6139x - 6135x for x. 13 Solve -31h + 290 = 27h for h. 5 Solve 78 = -277h + 1254 + 1317 for h. 9 Solve -86 = 83k + 744 for k. -10 Solve 32160 - 31998 = -9w for w. -18 Solve 0 = 22o - 743 + 523 for o. 10 Solve -8s + 147 = 83 for s. 8 Solve 13903z + 2262 = 13729z for z. -13 Solve 13n + 886 + 216 = 71n for n. 19 Solve 266 = -12919i + 12900i for i. -14 Solve 2i - 436 + 589 = 19i for i. 9 Solve 242u + 3u = -374 + 2089 for u. 7 Solve 75633 = -50h + 74733 for h. -18 Solve 169k + 7794 = -228k - 2131 for k. -25 Solve 15 = -200d + 201d for d. 15 Solve -225253a - 800 = -225213a for a. -20 Solve 0 = 363d - 398d - 105 for d. -3 Solve 6843p - 6866p - 414 = 0 for p. -18 Solve 143v = -160v - 370v + 7403 for v. 11 Solve -46 = -8o - 38 for o. 1 Solve 116c + 942 - 478 = 0 for c. -4 Solve 14 = 18k - 40 for k. 3 Solve -7784 = 1132k - 576k for k. -14 Solve -830 = -264u - 6374 for u. -21 Solve -28897 + 29281 = 12q for q. 32 Solve 576m - 514m + 496 = 0 for m. -8 Solve 31q = -36q - 23 - 178 for q. -3 Solve 17x - 37x - 83x = -1442 for x. 14 Solve 8y - 23y - 15 = -14y for y. -15 Solve -1089h + 4050 = -2243 - 7864 for h. 13 Solve -1093s - 344s + 10112 = -173s for s. 8 Solve -14l + 2l - 112 = 4l for l. -7 Solve 121w - 4631 = -300w for w. 11 Solve -72i + 22i - 284 = 266 for i. -11 Solve 37y = 2690 - 356 - 1298 for y. 28 Solve -44y + 6295 - 3145 = 3062 for y. 2 Solve 811o - 405o = 422o - 64 for o. 4 Solve 354s + 1716 = -4302 for s. -17 Solve 1122 = -96f - 10 - 20 for f. -12 Solve -141i + 63i = -59i + 152 for i. -8 Solve 40u - 7572 = -7852 for u. -7 Solve 280 = -3z + 8z + 285 for z. -1 Solve -154p + 9029 - 10877 = 0 for p. -12 Solve -1327 = -33l - 1723 for l. -12 Solve 5904 = -28k + 172k + 184k for k. 18 Solve 2x - 24x = -6x + 272 for x. -17 Solve 0 = 137f - 7972 + 7287 for f. 5 Solve -88 = -136u + 22 + 570 for u. 5 Solve 115m - 2649 = -2186 + 3217 for m. 32 Solve 0 = -6q + 72 for q. 12 Solve 15q = -36 - 46 + 67 for q. -1 Solve -11s - 50 + 242 = -19s for s. -24 Solve 5794h - 5785h = -108 for h. -12 Solve 22m - 186 = 166 for m. 16 Solve -157w + 47w - 1536 - 444 = 0 for w. -18 Solve 0 = 12273u - 12240u for u. 0 Solve -29 = 231o - 202o for o. -1 Solve -28283 = -131c - 25401 for c. 22 Solve 29g + 90 = 74g for g. 2 Solve 10c - 17 + 199 = -4c for c. -13 Solve -166w - 1336 = 280 + 542 for w. -13 Solve 60n = 65n - 50 for n. 10 Solve 95r = -8r - 11r + 1368 for r. 12 Solve -752d - 16713 = -133d for d. -27 Solve -73 = -9m - 61m - 143 for m. -1 Solve 760 = -504l + 544l for l. 19 Solve 913x = 356x + 211x - 4152 for x. -12 Solve -124y + 38y - 516 = 0 for y. -6 Solve -1564r + 120 = -1576r for r. -10 Solve -12i - 43 = 81 - 4 for i. -10 Solve -98p - 93p - 41p - 3248 = 0 for p. -14 Solve 2383 = 439b - 4534 + 771 for b. 14 Solve 2i - 16 = 11 - 61 for i. -17 Solve -479t - 766t - 7880 = -260t for t. -8 Solve 8029 - 6706 = 49z for z. 27 Solve 64p - 13p = 114p - 315 for p. 5 Solve -191 = 193u + 3862 for u. -21 Solve 201f + 1040 + 2176 = 0 for f. -16 Solve -5h - 6 - 15 = -12h for h. 3 Solve -3026 = 503r + 3010 for r. -12 Solve 3o + 2755 = 2725 for o. -10 Solve 1344 + 223 = -49x + 244 for x. -27 Solve -242m - 152 = 2029 + 481 for m. -11 Solve -91z = -103z for z. 0 Solve -15m + 16 = 16m - 15 for m. 1 Solve 84z - 4104 = -87z for z. 24 Solve 0 = -928p + 503 - 9783 for p. -10 Solve 4k - 59k = -19k + 32k for k. 0 Solve 24010 = 871x - 185x for x. 35 Solve 21s - 565 = -34s - 1170 for s. -11 Solve 448w = 52w - 1656w - 73872 for w. -36 Solve 0 = -17r + 9r + 99 - 395 for r. -37 Solve -110 - 209 = 56s + 129 for s. -8 Solve 0 = 40u - 5836 + 4876 for u. 24 Solve -679x = -644x - 175 for x. 5 Solve 178z = 191z - 36 - 107 for z. 11 Solve -31w - 32 + 145 = 20 for w. 3 Solve -797m = 20m + 4085 for m. -5 Solve 73s - 132s + 45 = -68s for s. -5 Solve 78v - 115 = 614 - 27 for v. 9 Solve -400h - 356h - 3780 = 0 for h. -5 Solve -o + 0o + 9 = 16 for o. -7 Solve 0 = -50582i + 50577i + 35 for i. 7 Solve -60a - 10077 - 7794 = -543a for a. 37 Solve -14w + 4 + 74 = -6 for w. 6 Solve 12h + 70h = 1558 for h. 19 Solve 68 = 58y + 300 for y. -4 Solve 41i - 252 = -651 + 71 for i. -8 Solve 114 = -103n + 80 - 687 for n. -7 Solve 290 = 402u - 832u + 401u for u. -10 Solve 154p - 44 = 165p for p. -4 Solve -1236b = -1150b + 2580 for b. -30 Solve -49l - 3 = -64l - 123 for l. -8 Solve -23753w + 23650w = 2163 for w. -21 Solve 34p + 47p + 15 + 147 = 0 for p. -2 Solve 4i + 88 = 173 - 73 for i. 3 Solve 516x - 310x = -2678 for x. -13 Solve 85m = 235m + 1650 for m. -11 Solve -29y - 6y = 41 - 6 for y. -1 Solve -18360 = 97n - 862n for n. 24 Solve 0 = 135c - 42c - 56c - 740 for c. 20 Solve 227241z = 227189z - 1404 for z. -27 Solve 174j - 252 = -774 for j. -3 Solve -840a = -853a + 13 for a. 1 Solve 594372 - 594504 = -6h for h. 22 Solve 0 = -47r - 60r + 321 + 535 for r. 8 Solve -654 - 462 = 55k + 7k for k. -18 Solve 43072p - 52 = 43087p - 7 for p. -3 Solve 132 - 7 + 127 = -21o for o. -12 Solve 55755i - 55738i = 680 for i. 40 Solve 9l + 1062 = 127l for l. 9 Solve 860k = 875k - 95 - 130 for k. 15 Solve -8x - 194 = -66 for x. -16 Solve 3507 = 184g + 184g - 201g for g. 21 Solve 296v - 164 = 730 + 586 for v. 5 Solve 198i + 98 - 692 = 0 for i. 3 Solve 155u - 143u = 144 for u. 12 Solve 352t + 0 = 13 - 2477 for t. -7 Solve 18z = -119 - 133 - 36 for z. -16 Solve -r + 10r = 15 - 123 for r. -12 Solve 297h - 605h + 284h + 192 = 0 for h. 8 Solve 680w - 14261 - 699 = 0 for w. 22 Solve 0 = -107v - 28218 + 25650 for v. -24 Solve 12f + 65f - 66 = -836 for f. -10 Solve -47n = -62n + 69n + 918 for n. -17 Solve 109 - 33 - 34 = 6u for u. 7 Solve 36 = 169r - 167r for r. 18 Solve -12v + 70v - 1606 = -88v for v. 11 Solve -24z + 5 = -43z + 18z for z. -5 Solve 36n + 52n - 124n = -432 for n. 12 Solve 0 = 4499k - 4530k - 527 for k. -17 Solve -7o = -1711 + 1774 for o. -9 Solve -3p - 19p = 7p - 87 for p. 3 Solve 6436 + 44 = -59u - 211u for u. -24 Solve 1976 + 1676 = -166j for j. -22 Solve -36h - 89h = -500 for h. 4 Solve 21f - 138f + 1963 = 34f for f. 13 Solve 2606h + 1458 = 4013 + 15687 for h. 7 Solve -1218 = -111u + 336 for u. 14 Solve 69b - 149b + 68 = -46b for b. 2 Solve 2422f = 2086f for f. 0 Solve -236a - 575a - 23519 = 0 for a. -29 Solve -3756 = 294f + 5777 - 1889 for f. -26 Solve -4w + 663 = 3w + 677 for w. -2 Solve 20 - 212 = 24f for f. -8 Solve 5278 + 9198 - 3783 = 629n for n. 17 Solve -465 = 6q + 54q - 105 for q. -6 Solve -9634z - 18036 = -8966z for z. -27 Solve 471047 = -125a + 472172 for a. 9 Solve -5620l + 5599l = -420 for l. 20 Solve -263h + 1606 = 192h - 528h for h. -22 Solve 7c - 7c = 13c - 39 for c. 3 Solve 0 = -8h - 27h + 44 - 254 for h. -6 Solve 36d + 318 = -114 for d. -12 Solve -22*k	{ "pile_set_name": "DM Mathematics" }
) - r(z). Let p(v) be the third derivative of 5v4/24 + 27v*2. Calculate x(p(l)). 30l Let z(o) be the first derivative of 3o3/2 + 3o - 11. Let s(i) be the first derivative of z(i). Let a(x) = 2x2. Give s(a(k)). 18k*2 Let b(m) be the third derivative of 0 - 28m*2 - 1/12m*4 + 0m + 0m3. Let t(a) = 2a - 1. Calculate t(b(i)). -4i - 1 Let r(j) = 13j - 3 + 3. Let d(v) be the first derivative of v*2 + 100. Determine r(d(z)). 26z Let o(n) = 23n2. Let d(w) = 13w - 36. Give d(o(t)). 299t2 - 36 Let d(k) = -430648k2. Let g(h) = h2. Calculate d(g(j)). -430648j4 Let o(q) = 237q + 15q2 + 246q - 478q. Let p(k) = -2k*2. Give o(p(h)). 60h*4 - 10h2 Let d(j) be the third derivative of -j8/20160 + 7j5/60 - 11j*2. Let b(i) be the third derivative of d(i). Let t(p) = 3p*2 + p - p. Determine t(b(g)). 3g*4 Let s(p) = 2310413p. Let h(w) = -2w2. Determine s(h(g)). -4620826g*2 Let l(a) = 42a - 9. Let t(q) = -10q + 2. Let i(v) = 4l(v) + 18t(v). Let s(h) = -5h. Determine s(i(c)). 60c Let h(o) = -4o*2 + 4o. Let l(i) = -2i2 - 33636 + 33636. Determine h(l(y)). -16y*4 - 8y*2 Let z(n) = -14n + 6. Let t(s) = 1663s. Determine z(t(b)). -23282b + 6 Let u(f) = -580846 + 580846 + 9f. Let v(z) = 2z*2 + 2z - 2. Let r be v(-2). Let s(h) = h - h*r - h. Calculate s(u(d)). -81d*2 Suppose -3u = -5u - t - 15, 3u - 4t - 5 = 0. Let h(b) = -3b. Let i(j) = 7j. Let r(l) = uh(l) - 2i(l). Let a(k) = 27k. Determine r(a(v)). 27v Let b(v) = -21548v. Let x(h) = 66h2. Determine x(b(k)). 30644876064k*2 Let b(y) = 3y*2. Suppose 4h + o = 2o + 13, 2h = 2o + 14. Suppose -hl + l + 2 = 0. Let j(z) = -3zl + 2z*2 - z + z. What is j(b(s))? -9s4 Let g(x) be the third derivative of -x6/360 - 29x3/3 + 3x*2 + 2. Let p(y) be the first derivative of g(y). Let w(f) = -6f. Determine p(w(n)). -36n2 Let l(w) = -4w + 4547. Let h(n) = 6n2 - 12n. What is l(h(v))? -24v2 + 48v + 4547 Let g(a) = 34a + 10. Let c be g(10). Let i(z) = -350z + 6z2 + cz. Let f(r) = -r + 1. Let b(l) = l - 2. Let p(t) = b(t) + 2f(t). Calculate p(i(q)). -6q2 Let i(l) be the second derivative of l3/3 + 12l. Let m(f) be the first derivative of 2f*3/3 + 11. Calculate i(m(a)). 4a*2 Let h(m) = -2m. Let x(v) be the first derivative of 45v2/2 + 55. Give h(x(i)). -90i Suppose 0 = -4n + 6n - 4. Let x(h) = 2h2 - 2h*2 + nh*2 - 6h2. Let m(c) = -c2 + 3c2 - 6c*2. What is m(x(a))? -64a*4 Let p = -142 - -222. Let b(x) = 40x*2 + 39x*2 - px2. Let t(u) = u. Give b(t(a)). -a2 Let v(q) = 1324q. Let w(u) = -36u*2. Determine v(w(b)). -47664b*2 Let f(h) = 4h. Let n(b) = -87b2 - 28. Calculate f(n(z)). -348z*2 - 112 Let b(q) = -6q*2 + 1. Let u(z) be the second derivative of 2z*3/3 - 2z - 155. Calculate b(u(x)). -96x2 + 1 Let q(r) = r2. Suppose -5s + 43 = 2a, 2a + 59 = 5a + 2s. Suppose 4d - a - 13 = 0. Let y(f) = -6f*2 - df*2 - 11f*2. Determine y(q(b)). -25b*4 Let n(k) = -105318k. Let f(i) = 3i. Give f(n(z)). -315954z Let p(v) = 3v. Let l(g) = 23152g. Determine p(l(y)). 69456y Let o(d) = -7248 - d2 + 7248. Let z(w) = -7w + 5. Let v(u) = -18u + 12. Suppose -3f = 2k + 27, f - 8 = 4k + 39. Let n(y) = kz(y) + 5v(y). Give n(o(h)). 6h2 Let p(k) = 80k + 35. Let n(w) = 9w + 4. Let j(a) = 35n(a) - 4p(a). Let t(x) = -54x*2. What is t(j(l))? -1350l*2 Let u(q) = 4q. Let p be 2(8/(-4) - (-9)/6). Let f(x) = 8x*2 - 2. Let h(r) = -1. Let j(t) = pf(t) + 2h(t). Determine j(u(b)). -128b*2 Let h(p) = 3p. Let n(s) = s*2 - 2. Let m be (7/4)/(8/(-96)). Let g(v) = -9v*2 + 21. Let d(c) = mn(c) - 2g(c). Determine d(h(u)). -27u2 Let h(a) = a2. Let i(k) = 292968k2. Calculate i(h(t)). 292968t*4 Let g(f) = -4f*2 + 4. Let q(m) = -1. Let r(a) = -g(a) - 4q(a). Let s(p) = p*2 + 54. What is s(r(x))? 16x*4 + 54 Let h(l) = -6l + 4. Let w(d) = -5d + 3. Let f(x) = -3h(x) + 4w(x). Let y(p) be the first derivative of 3p - 2p - p + p2 - 5. Give f(y(u)). -4u Let l(g) = 4188g. Let n(q) = -13q*2. Calculate l(n(r)). -54444r*2 Let f(d) = -7d. Let l(p) = -p*3 + 13p*2 + 14p + 2. Let h be l(14). Let b(k) = 0kh + 0k2 + k2 + 2k2. Calculate b(f(q)). 147q*2 Let b(m) = -3m. Let r = -11 - -24. Let g(j) = 0j2 + 9j*2 - rj*2. Determine b(g(d)). 12d2 Let d(s) be the second derivative of s4/2 + 58s. Suppose 2r - 16 = -0r. Let q(f) = 4f + 5. Let x(u) = 6u + 8. Let b(g) = rq(g) - 5x(g). Give d(b(i)). 24i*2 Let u(q) = -4q*2 - 3q - 3. Let x(z) = 9z2 + 7z + 7. Let v = 1 + -8. Let m(j) = vu(j) - 3x(j). Let f(y) = 21y2. What is m(f(r))? 441r*4 Let w = 25 + -23. Let j(y) = 3y*2 + 0y*w - 16y*2 - 5y*2. Let r(d) = -d. Determine j(r(z)). -18z*2 Let q(s) = 26s*2. Let i(n) = -4295n*2. What is q(i(y))? 479622650y*4 Let o(p) = -p. Let c(g) = -455820g. Calculate c(o(k)). 455820k Let c(s) = -3s. Suppose 5j - 8 - 12 = -4u, u - 5 = -2j. Let h(q) = -uq*2 + 2q*2 + 49 - 49. Give c(h(y)). 9y*2 Let q(b) = 4b. Let u(g) = 14g2 - 37g*2 - 12g*2 - 49g*2 - 29g*2. Give q(u(r)). -452r*2 Let n(t) = -7t*2. Suppose 19 = x - 0. Let o(c) = -xc + 39c - 19c. Calculate n(o(g)). -7g2 Let s(b) = -181432b. Let x(u) = 2u2. Give x(s(v)). 65835141248v*2 Let m(w) = -37w*2. Suppose 20 = -5l, 2l - 6 = -2y + 24. Let j(v) = 19v + 2v*2 - yv. Determine j(m(s)). 2738s4 Let n(j) = -3j. Let m(d) = -2913794d. What is n(m(x))? 8741382x Let t(z) = 2z. Let f(g) = -6016g*2. Determine t(f(c)). -12032c*2 Let y(i) = 20i*2 + 72. Let k(s) = 4s*2 + 15. Let g(b) = -14k(b) + 3y(b). Let p(n) = -3n*2. Calculate p(g(w)). -48w*4 - 144w*2 - 108 Let n(s) = -s. Let w be (-172)/(-8) - (-3)/(-6). Let d(m) = -wm - 21m + 11m. Give d(n(i)). 31i Suppose 0 = 2r - 4. Let v(p) = p + rp + 3p - 7p. Let f(h) = 14h*2. What is f(v(g))? 14g*2 Let t(h) = -7439h + 9 + 7441h + 4. Let s(o) be the third derivative of o5/30 + 2o*2. Give t(s(k)). 4k*2 + 13 Let q(g) = 4g*2. Suppose 35 = f + 34. Let c(i) = 1 - f + 41i - 40i. What is c(q(u))? 4u*2 Let f(k) be the first derivative of 2k*3 + 25k*2/2 - 265. Let a(j) = -j. What is f(a(x))? 6x*2 - 25x Let x(g) = -3g. Suppose z + 2 = 2z. Let o(n) = -3 + 2nz + n2 - 6 + 7. Let h(c) = 6c*2 - 5. Let y(k) = -2h(k) + 5o(k). Determine x(y(j)). -9j*2 Let l(o) = 7o - 9. Let n(t) be the third derivative of t*5/20 + 4t*2 + 18. What is l(n(b))? 21b*2 - 9 Let v(j) = 2j - 31j + 11j + 12j. Let g(y) be the first derivative of -7y*2/2 - 28. Calculate g(v(k)). 42k Let f(l) = -6l2. Let h(j) = 5j*2. Let q(m) = -7m*2. Let n(y) = 4h(y) + 3q(y). Calculate f(n(z)). -6z*4 Let f(g) = 4g*2 + 5g. Let s(q) = q*2 + q. Let d be (14/(-7))/(0 + -1). Let k(p) = df(p) - 10s(p). Let l(x) = x - 2x + 7x. Determine k(l(a)). -72a*2 Let m(g) be the second derivative of -2g*3 - 9g. Let b(z) be the first derivative of z*2 + 2. Determine b(m(p)). -24p Let p(x) = 1093x2 + 2x - 6. Let c(w) = -6w. Give c(p(t)). -6558t*2 - 12t + 36 Let s(b) = -14b - 24. Let k(c) = -9c - 15. Let l(u) = -8k(u) + 5s(u). Let d(o) = 107o2 - o. Calculate d(l(p)). 428p*2 - 2p Let u(k) = 12k2. Suppose 3h = h - 14. Let s = h + 13. Let x(w) = sw2 - 2w*2 - 4w*2 - 2w*2. Give x(u(y)). -288y*4 Let i(o) = 6o*2 + 3o. Let v = 13 + -11. Let k(r) = 9rv + 8r*2 + 0r + 6r + 2r. Let l(s) = 8i(s) - 3k(s). Let m(t) = t*2. Determine m(l(h)). 9h4 Let m(h) = h2. Let w(f) be the third derivative of 0f3 + 0f*4 + 0f + 1/12f5 + 0 - 14f*2. Give m(w(t)). 25t4 Let a(u) be the third derivative of u5/120 - 4u3/3 + u2. Let k(h) be the first derivative of a(h). Let j(v) = 2v*2. Give k(j(c)). 2c*2 Let x(a) = 10260a. Let o(s) = s + 21. Determine o(x(k)). 10260k + 21 Let b(g) = -g. Let j = 18 + -13. Suppose 0 = -4q + 3 + j. Let l(a) = -8 + 8 - a*2 - 3a*q. Calculate l(b(i)). -4i*2 Let b(d) = 3623d. Let n(k) = -89k. What is b(n(q))? -322447q Let n(t) = 128t2 - 2001. Let z(i) = 2i*2. Calculate n(z(a)). 512a*4 - 2001 Let v(d) = -6d. Suppose -22 = -3*c - 85. Let p = c + 27. Let q(r) =	{ "pile_set_name": "DM Mathematics" }
196. Let y = -8/769 - 7675/75362. Let u = y - v. Find the common denominator of -35/16 and u. 16 Find the common denominator of -121/10 and (-179)/20 - (-31 - -23). 20 Let k = 861 - 265. Calculate the smallest common multiple of 8 and k. 1192 Calculate the common denominator of 47/14 and (-16)/(-4) - -2 - (-24)/(-42). 14 Let r(l) be the first derivative of l*2/2 + 19l - 18. Calculate the smallest common multiple of r(-11) and 8. 8 Let b = -97/85 + -9703/510. Calculate the common denominator of b and 32/21. 42 Let i(m) = 9m3 + 11m*2 - 26m + 2. Calculate the smallest common multiple of 54 and i(2). 594 What is the common denominator of 5/14 and ((-108)/248)/9 + 0? 434 Let h = 5 - 4. What is the lowest common multiple of (-10)/(-5) - (h + -7) and 11? 88 Let r(k) = -k*2 + 14k - 43. What is the smallest common multiple of r(5) and 5? 10 Let y(n) = 28n + 10. Let w be y(9). Find the common denominator of 91/44 and (-37)/(6/(-39) + w/13). 220 Let m = -7475723/132 + 56635. What is the common denominator of -85/24 and m? 264 Let o = -922/63 - -97/7. Find the common denominator of (46/(-32) - -2)-5 and o. 144 What is the common denominator of 20332/32760 - (-6)/7 and 35/72? 360 Calculate the smallest common multiple of (1 + (-3 - 1))/(6/(-40)) and 2/((2/(-72))/((-72)/16)). 1620 Let c be 0 - (-1 + 6 + -7). Suppose 2t = cy + 72, 2t - 3y - 36 = 36. Suppose -80 = -3z - 2z. Calculate the smallest common multiple of t and z. 144 Suppose -5n = -20y + 19y + 55, 0 = -3n - 15. What is the least common multiple of y and 10? 30 Let k = 165 + -155. What is the least common multiple of 5 and k? 10 Suppose -2h = -5 - 3. Let p(v) = -3v + 4 + v + 5v - 2v. What is the least common multiple of h and p(8)? 12 Let d = 25136/11 - 2287. Calculate the common denominator of d and 7/489. 5379 Let j(s) = s*2 + 6s + 12. Let x be j(-6). Suppose 16 = f + x. Calculate the least common multiple of f and 8. 8 Let g = 1642/1169 + 4/167. Calculate the common denominator of (7/(-3))/(82/(-30) + 2) and g. 77 Let z(t) = -7t3 + 6t*2 - 3t - 10. Let i(x) = -2x3 - x2 - x. Let u(f) = 4i(f) - z(f). What is the least common multiple of u(-10) and 16? 80 Let y be 1/3 - (-210)/18. Suppose 0 = 10d - yd + 24. Calculate the smallest common multiple of d and 21. 84 What is the common denominator of ((-303)/15)/((-20)/(-50)) and -43/18? 18 Suppose 2x - m - 1377 = -0m, 2x + 5m - 1359 = 0. Let k = x + -7531/11. What is the common denominator of k and (1133/484)/(6/93)? 88 Suppose 260 = -4h - 4p, -8h = -3h - 2p + 325. Let b = -58 - h. Calculate the lowest common multiple of b and 11. 77 Let p = 11155 - 111673/10. Find the common denominator of p and -29/18. 90 Let h be (-8)/2 - (1 + -2833). Let n = h - 28377/10. Calculate the common denominator of -107/12 and n. 60 Let f(v) = -2v - 1. Let t(b) = -b2 - 21b + 13. Let u(m) = -4f(m) + t(m). Let y = 25 - 15. Calculate the lowest common multiple of y and u(-10). 470 Suppose 0 = 4q - 21 + 9. Let w be ((-14)/q)/((-10)/45). Suppose -3n = -0n - w. Calculate the lowest common multiple of n and 12. 84 Calculate the common denominator of (-1)/4 + 126/48-2 and -85/38. 38 Suppose -h = -4z + 29, 4z = -3h + 13 - 4. Calculate the lowest common multiple of ((-84)/24)/(42/(-456)) and z. 114 Let c = 26 + -40. Calculate the common denominator of 2/6 + (-32)/33 and (-12)/c105/100. 110 Suppose 0x = -5k + 3x + 10, -2k + x + 4 = 0. What is the least common multiple of (-4 + 1)-1 - k and 13? 13 Suppose -7n = 1624 + 3087. Let z = 17519/26 + n. Find the common denominator of z and -27/10. 130 Let q = -2/721 - -2179/5768. Let a be (7/2)/(36/(-24)). Let o = -32/9 - a. Calculate the common denominator of o and q. 72 Let y(m) = m2 - 22m + 15. Let j be y(20). What is the least common multiple of (-740)/j + 4/10 and 15? 30 Suppose 0 = 6s - 118 - 98. What is the least common multiple of s and 4? 36 What is the lowest common multiple of 72 and (-48 - -39)/(6/(-8))? 72 Suppose -4j + 4u - 138 = 2u, -3j - 116 = -4u. Let p = j - -72. Find the common denominator of -53/18 and p/(-96) - (1 + -1). 36 Let r(m) = m*3 - 22m*2 + 60. What is the smallest common multiple of r(22) and 60? 60 Suppose -l - u = -74, 268 = 4l - 3u - 0u. Let f = l + -46. What is the least common multiple of 27 and f? 216 Suppose 360282 - 1655606 = -2t. Let x = 3859169/6 - t. Let j = x + 4449. What is the common denominator of -65/2 and j? 6 Let h = -4447 + 97787/22. Suppose 2m = 1190 - 204. Let t = -8963/18 + m. What is the common denominator of h and t? 198 Suppose 4d = -16 + 72. Suppose 0 = -4b + 5v - 23, -b + 1 + 9 = 4v. Calculate the smallest common multiple of d and (-2 + 3)/(b/(-16)). 56 Suppose j - 10 = -5. Find the common denominator of j/6(-540)/200 - 2 and (1 + (-101)/12)1. 12 Let z be (165/20)/((-6)/(-32)). Suppose 5b - 5x - 25 = 0, 4b - 3x - z = -5x. Calculate the lowest common multiple of 6 and b. 18 What is the common denominator of (-116)/6 + -1 - -2 and 2 + (-363)/30 + 8? 30 Calculate the common denominator of 0 + 7 - 2406/432 and 67/81. 648 Let i be 1262/(-4) - -16/(-6). Let r = 4124/13 + i. What is the common denominator of r and 134/132 - (-4)/6? 286 Find the common denominator of (-2)/(-7) + 986/1904 and 17/4. 56 Let b = -92665 + 11119919/120. Calculate the common denominator of b and 137/60. 120 Let o be ((-64)/(-6))/((-2)/(-3)). Suppose 4k - o - 32 = 0. Let i(y) = y3 - 7y*2 + 6y + 2. What is the smallest common multiple of i(6) and k? 12 Let v = 2108/9 + -92977/396. Let w = -909/220 + v. Let l = 12/181 + 17123/1086. What is the common denominator of l and w? 30 Suppose -4s - 5s + 54 = 0. What is the common denominator of (-4494)/(-432) - (-2)/9 and 556/240 - s/15? 24 Let u be (-303)/15(-4 - 1). Suppose -4f + u = 21. Calculate the lowest common multiple of 16 and f. 80 Let p = -3340 - -26659/8. What is the common denominator of p and 41/20? 40 Let r(z) = 19z + 2 - z2 - 3z - 5z. Calculate the least common multiple of 12 and r(9). 60 Suppose -3r + 132 = -5r. Let v = 76377/16 - 4776. Calculate the common denominator of v and r/120 - (1 - 2). 80 Let t(s) = -11s + 28. Let x be t(2). Suppose -xu = u - 238. Calculate the least common multiple of 6 and u. 102 Suppose k = -0 - 5. What is the smallest common multiple of 8 and (14/5)/((-2)/k)? 56 Suppose 828 = -4o - 3q, 0o - 1058 = 5o - 2q. What is the common denominator of 493/o - 2/10 and ((-18)/16)/((-3)/27)? 168 Let z(a) = 4a + 3a - 9a - 46. What is the lowest common multiple of 12 and z(-25)? 12 Suppose -18 - 12 = 3f. What is the common denominator of (-2)/10 - 198/(-20) and 2 + 1 + 139/f? 10 Let x = -20789/14 - -1482. Let h = -41/2 - -29. Calculate the common denominator of h and x. 14 Let l = 2422/1163 + -2097717/179102. Let y = 69/7 + l. What is the common denominator of -71/6 and y? 66 Let b(n) = -n + 24. Let g be b(14). What is the common denominator of g/(-4)(-7 - 2) and -49/15? 30 Let s = 1277/5 - 4813/20. Find the common denominator of s and -49/16. 16 Calculate the common denominator of -97/6 and ((-34)/1105)/(1 + 163/(-155)). 156 Let q(d) = d2 + 21d + 1. Let m be q(-21). Calculate the common denominator of -7/2 and (70/(-25) + 3)49/m. 10 Suppose -3 + 43 = 5k. Let t(h) = 2h - 12. What is the least common multiple of t(k) and (1 + -6)/(-7 - -6)? 20 Suppose -2k - 4f = 202, f - 4f - 206 = 2k. Let h = -69 - k. Calculate the smallest common multiple of 16 and h. 80 Let f(j) = 3j*3 - j + 1. Let u = 15 - -46. Let p = -56 + u. Calculate the least common multiple of f(1) and p. 15 Let x = 1601 - 1535. What is the least common multiple of x and 222? 2442 Let b be (-187)/(-204)1641. Let j = 763/6 - b. What is the common denominator of -43/16 and j? 48 Suppose -2i - 12 = -0i - 3q, q = -5i - 13. Find the common denominator of ((-11)/132)/(i/(-82)) and (-24)/(-7) + 2/4. 126 Let u be 182/(-56)(-8)/(-2). Let k = -3 - u. What is the smallest common multiple of 11 and k? 110 Let s(h) be the first derivative of -h*3/3 - 5h*2/2 + 14h - 13. What is the smallest common multiple of 16 and s(-6)? 16 Let f = -230248126 - -284586654401/1236. Let w = -5/309 + f. Find the common denominator of w and 2461/(-552)*4/3. 36 What is th	{ "pile_set_name": "DM Mathematics" }
arest to d in 4, -1/3, -6? -1/3 Let f = -2 + 4. Let t(w) = w*2 + 7w + 7. Let p be t(-8). Let r = p - 193/13. Which is the nearest to 1? (a) -0.2 (b) f (c) r c Let d = 80/7 + -734/63. What is the nearest to -0.1 in 2, 0.5, d? d Let r = -18.4 - -17. Let w = r + 1.4. Which is the nearest to w? (a) 1/4 (b) -5 (c) -4/7 a Suppose -k + 2 = 2k - y, 4k - 4y + 8 = 0. Let p be 0 + 2/9 - (-77)/99. Which is the closest to -1/2? (a) k (b) 2/3 (c) p b Let f = -4.6 - -5. Suppose 0 = -11z + 6z + 25. What is the closest to 2/5 in z, 2, f? f Let z = 272/5 + -54. Which is the closest to z? (a) 3 (b) -0.1 (c) -4 b Let w = 0.1 + 0.2. Suppose -4 = -0d + 4d. Which is the closest to d? (a) -0.2 (b) 2/11 (c) w a Suppose 0 = -v - 2v + w + 3, 0 = w - 3. What is the nearest to -6 in 5/2, -4, v? -4 Let q = 28.4 + 0.6. Let d = q - 34. Let p = -0.2 - -0.3. Which is the closest to 1? (a) p (b) d (c) -2 a Let z = -2 - -1. Let l = 14.3 + -13.3. Which is the nearest to l? (a) -2/7 (b) z (c) -2 a Let p(z) = 5z - 1. Let t be p(1). Let r be 4 - t - (-4)/18. What is the nearest to r in -2/3, -3/5, 0.2? 0.2 Let j = -36.2 - -40. Let k = -4 + j. What is the nearest to k in 1, -4, 1/5? 1/5 Let h = -1231/33 - -113/3. Which is the closest to 1? (a) 3/4 (b) h (c) -2 a Let r = 0 - 4. Let h be (2/6)/(3/18). Suppose -w + 2w = -h. Which is the nearest to -1? (a) w (b) -1 (c) r b Let s = 2.89 + 0.11. Let v = -2 - -2. Which is the closest to s? (a) v (b) 3 (c) -1/2 b Let o = -11.9 + 12. Which is the closest to 1? (a) o (b) -0.5 (c) 3 a Suppose 1 + 0 = n + 2i, -4n = -4i - 64. Let h = n + -19. What is the closest to 0 in 0.4, h, -1/4? -1/4 Suppose 0 = -4o - 3u - 30, -o + 5o = 3u - 18. Which is the nearest to 0? (a) -0.5 (b) o (c) -1 a Let a = 16 + -17. What is the nearest to 0 in 3, a, 5? a Let u = 0.58 + -0.38. Which is the nearest to 0? (a) -1/8 (b) u (c) -3 a Suppose 2g + 4d = 2, 5g + 0g + d = 23. Suppose -gt = 1 + 9. Which is the closest to 0? (a) 0.3 (b) t (c) -2/11 c Suppose -53 = -10v - 3. What is the closest to 1/4 in v, -1, 19? -1 Let p = -9 - -4. Let n = -1 - -2. Let b = -1 + n. What is the nearest to 0 in p, b, -2/9? b Let m = 18 - 17. What is the closest to -2/7 in 2/5, m, 2/7? 2/7 Let w be (-23)/(-63) - 4/18. Let b = 0.9 - 1.9. Let c = -0.9 - b. What is the nearest to -1 in 2, c, w? c Let w = -11 - -15. Let p = w + -3.7. Let u = -0.5 - -0.6. Which is the nearest to u? (a) -2/15 (b) p (c) 4 b Let t = -1 + 1.3. Let d = 0.02 - -0.98. Let h = 2.2 - -0.8. Which is the closest to d? (a) -2/9 (b) t (c) h b Suppose 3u + 8 = -u. Suppose -j - 25 = -6j. Suppose m + jw + 2 = 0, 3m - 4m + 4w = 2. Which is the nearest to u? (a) -1 (b) 0.5 (c) m c Let n = 44 - 43.9. Which is the nearest to -7? (a) -0.5 (b) n (c) 5 a Let s = 19 - 19. Which is the closest to s? (a) 1 (b) 0.1 (c) -4/7 b Let t = 19 + -18.97. Which is the nearest to -1? (a) t (b) -2/5 (c) 3 b Let k be 0/(((-2)/(-2))/(1 - 0)). Which is the nearest to 2? (a) -5 (b) k (c) 1 c Suppose -15 = 5u + 5s, 4u + 4s = 3u - 18. Let x be 6 + -9 + (-13)/(-4). What is the nearest to u in 0.2, 2, x? 2 Let n = 0.45 + -0.75. Let d = 679/18 - 75/2. What is the nearest to d in -1/7, 1/4, n? 1/4 Let t = 0.19 - -0.21. Which is the nearest to 0.1? (a) -3 (b) t (c) 5 b Let i be ((-2)/6)/(1/6). Let g = 289/18 - 95/6. Which is the closest to 1/2? (a) 0 (b) i (c) g c Let k = 0 - -0.1. Let z = -93 + 96. What is the closest to k in -3, 5, z? z Let s = 1.3 - 1.2. Which is the nearest to s? (a) -3 (b) 5 (c) 0.2 c Suppose -4i = -4a - 16, 5a - 2a - 2i = -7. Let s = 31882/1581 - -1/1054. Let l = 20 - s. What is the nearest to a in 5/4, l, -4/7? 5/4 Let m(i) = -i3 - 3i*2 - 4i - 4. Let x be m(-3). Let t be x/18 - 10/15. Which is the nearest to 1? (a) -2 (b) t (c) -0.3 b Let q = -2.8 - -4.9. Let l = -2 + q. Let f = 1/14 - 17/42. Which is the nearest to l? (a) f (b) -3/4 (c) 0 c Let m be -2 + (-240)/(-39) + -4. What is the nearest to 0.1 in -4, 1, m? m Let t be (-11 + -1)12/(-18). Let i = t - 6. Which is the closest to 1? (a) -2/23 (b) 1/2 (c) i b Let g = 5 - 2. Suppose 2l = -3l + 5o, -4 = 2l + 2o. Suppose 7q = 3q. Which is the nearest to g? (a) 1 (b) l (c) q a Let r be 4/(-16)(-8)/6. Let o = -459/1096 + 6/137. Which is the nearest to r? (a) 2 (b) o (c) 4 b Let t = -5.009 + 0.009. Let x(y) = -y3 + 5y*2 + 7y - 7. Let v be x(6). Which is the nearest to v? (a) 2/7 (b) t (c) -2 c Let h = 76 + -71.74. Let j = -0.26 + h. Which is the closest to j? (a) -2/3 (b) -0.1 (c) -3 b Suppose n - l = -6, -4n = -2n + 5l - 9. Which is the nearest to -1? (a) -2/9 (b) n (c) 1/16 a Suppose -3w + 0 = -3. Let m = 1 + -1.1. Let l = 4.2 + -4. Which is the nearest to l? (a) -5 (b) w (c) m c Let d = -0.151 - 0.049. Which is the closest to 0.1? (a) 0.5 (b) -5 (c) d c Suppose -3d + 14 = 2. Let g be -2(26/(-8) + d). Which is the nearest to 0? (a) g (b) 2/5 (c) 0.5 b Let s = 99.1 + -99. What is the nearest to s in 4, -2/5, -3? -2/5 Let n = 0.29 + -2.29. What is the nearest to 2/3 in -39, -0.2, n? -0.2 Let i(p) = p*3 - 5p*2 + p - 2. Let z be i(5). Let d be (6/54)/(2/z). Which is the closest to 1/4? (a) 2/7 (b) 0 (c) d a Let y = -4 + 8. Let v = -0.7 + 0.8. Let r = -16 + 16. Which is the closest to v? (a) y (b) r (c) 3 b Let r = 0.048 + 0.152. Let j be 30/4(-4)/(-6). What is the closest to 0.1 in r, -3, j? r Let t = -7 + 11. Let m = 5 - 7. Let v = 1/6 + -17/30. What is the closest to m in t, -1/2, v? -1/2 Let y be 3 + (-1 - (-14)/(-10)). Let g = 36 + -54. Let m = g - -13. Which is the closest to 1/2? (a) m (b) 1 (c) y c Let z = 0 - 15. Let d be 1 - 1 - 9/z. Let n be 1(-1)/(-4)1. Which is the nearest to d? (a) -0.1 (b) -0.5 (c) n c Let d = 14 + -18.2. Let k = d + 5. Let p = k + -5.8. Which is the nearest to -1? (a) -3 (b) p (c) -1 c Let i = -34.31 + 34. Let g = i + -0.09. Let j(s) = s*3 + 6s*2 + 5s - 1. Let n be j(-5). Which is the nearest to n? (a) 3 (b) -0.2 (c) g c Let b = -0.088 - -0.088. What is the closest to b in 0.3, -5, -4? 0.3 Let h = -1.95 + -0.05. Let z be -7 + 30/3 + (-1 - 2). What is the closest to z in 3, h, 2/9? 2/9 Let u = -2 + 5/3. Let s(k) = -2k + 2. Let w be s(1). What is the closest to -2/7 in w, u, 3? u Let f = 22 - 21. Which is the closest to -1? (a) 3 (b) 0.2 (c) f b Let w be 2/28 + 4/(-7). What is the closest to w in 3/4, 11, 1? 3/4 Suppose 0 = 4u - 41 + 1. Suppose u = 2x - 4f, -25 - 5 = 3x + 3f. Let z = -0.15 - 1.85. What is the nearest to 1 in x, 0.2, z? 0.2 Let u = 15 - 12. Let o = -4 + 3. Let i be (-1)/(-10)o-2. Which is the closest to 1? (a) u (b) i (c) -2 b Suppose 4q = -3 - 1, 4c - 2q = 2. What is the nearest to 2 in -3/10, 1/2, c? 1/2 Let b be 84/99 + (-4)/6. Let w = 14.5 + -15. What is the closest to -2/5 in -3/4, b, w? w Let z = -8.6 + 8.6. What is the closest to 0 in z, -2/7, -0.06? z Let m = 43 - 41. Which is the closest to 0? (a) 3 (b) m (c) -3/5 c Let s = -1.8 - -3.1. Let j = 1.1 - s. What is the nearest to -1 in 0.2, -0.1, j? j Let y = 1 + -4. Let g = 1.1 + 6.9. Let n = 7.7 - g. What is the closest to 0 in -4, y, n? n Let d = -1293/2 - -624. Let l = 24 + d. Which is the nearest to 0.5? (a) l (b) -5 (c) -3 a Let f = 6 - 8. Let z be (-1)/(-1) + (0 - f). Suppose r - z = -5. What is the nearest to -1 in -2/15, r, -4? -2/15 Let p = 0.06 - -3.94. Let y = -9 + p. Which is the nearest to 1/4? (a) -4 (b) -1 (c) y b Let q be (-2)/(-6)12/38. Let k = 3 - -1. Suppose -5 = 4w - 1. Which is the closest to 0? (a) q (b) k (c) w a Suppose -2u + 14 = w, 4w - 41 = -0u - 5u. Let y = 0 + 1. Which is the nearest to -1/3? (a) -1 (b) y (c) w a Let v = -285/4 - -71. Suppose -k + 5m - 7 = -2k, 3k + 5m = 11. Let o be k/(-6) - (-34)/48. What is the nearest to v in o, -3/4, 1/6? 1/6 Let g = -101/18 + 52/9. Which is the nearest to -0.1? (a) -3 (b) g (c) 5 b Suppose -h + 3k + 0 - 2 = 0, -3h = 4k - 20. Let q = 118/5 - 23. Let c be ((-4)/6)/(4/6). What is the closest to c in h, q, 2? q Let o = 57 + -227/4. What is the nearest to 0 in o, -4, 0.4? o Let h = -0.54 + 0.14. Let b = 0.8 - 1. What is the closest to 0.1 in b, h, -5? b Let b = 2.1 + -2. Let g = -4 - -	{ "pile_set_name": "DM Mathematics" }
w. Let v(z) = -26z*3 - 11. What is sg(j) + 4v(j)? 6j*3 Let o(k) = -17k*2 - 37k - 19. Let r(g) = 8g2 + 18g + 9. Calculate 6o(m) + 13r(m). 2m2 + 12m + 3 Let o(u) = -134u + 255u - 118u. Suppose 0 = -4w + 67 + 65. Suppose -2s - s + 7 = -4y, 5s = -4y + w. Let d(l) = 4l. Calculate so(t) - 4d(t). -t Let c be (-6)/44-1. Let p(m) = cm + 5 - 15 - 9. Let q(l) = -4l + 13. What is 5p(i) + 7q(i)? 2i - 4 Let l(i) be the second derivative of -i*4/12 - i. Let s(w) = 5w*2 + 2w + 5. Let c(x) = -1 + 0 + 0. Let g(m) = 5c(m) + s(m). Give g(a) + 4l(a). a*2 + 2a Let t(h) be the first derivative of h3/6 + h2 - 7h + 12. Let k(a) be the first derivative of t(a). Let w(c) = 2c + 2. Determine -5k(x) + 4w(x). 3x - 2 Let m be 2/(16/18)(-344)/129. Let t(z) = -4z - 7 + 2 + 0z - 1. Let b(y) = -5y - 7. Calculate mb(s) + 7t(s). 2s Let n(r) = -17r - 11. Let k(q) = -30q - 20. Let m(j) = 6k(j) - 11n(j). Let a(c) = -13c - 2. What is 3a(h) + 5m(h)? -4h - 1 Let q(a) = -15a3 + 13a*2 - 10a - 11. Let c(i) = 8i3 - 7i*2 + 5i + 6. Let b = 1441 - 1435. Determine bq(f) + 11c(f). -2f3 + f2 - 5f Let l(f) = 5f + 28. Let g(v) = -3v - 14. Let d(i) = -11g(i) - 6l(i). Let m(q) be the first derivative of d(q). Let u(j) = j + 3. Determine -3m(s) + 2u(s). 2s - 3 Let a(c) = 515c*3 - c - 9. Let f(g) = 514g*3 - g - 6. Determine -2a(o) + 3f(o). 512o*3 - o Let l = 1584 - 1585. Let j(o) = 1. Let n(u) = u - 5. Calculate ln(y) - 3j(y). -y + 2 Let n(f) = -f. Let y(s) = 2s. Let w(p) = -p*2 + 3p + 27. Let m be w(-4). What is my(j) - 4n(j)? 2j Let t be (-4)/2 - 155 - 0. Let x be (44/t)/((-4)/182). Let y(g) = -17g2 - 4g - 5. Let n(l) = 4l2 + l + 1. What is xn(r) + 6y(r)? 2r*2 + 2r - 4 Let x = -11 - -15. Let u be (-100)/30(-6)/x. Let q(s) = -2s + s + 1 - 2s + s. Let m(c) = -4c + 2. What is uq(a) - 3m(a)? 2a - 1 Let m(t) = 1. Let q(z) = 2z + 97. Give 3m(u) - q(u). -2u - 94 Suppose -5o - 14 = -4o. Let w(l) = 17l2 - 3l*2 + 11l + 140 - 34l3 + 3l - 126. Let q(u) = 7u3 - 3u*2 - 3u - 3. Determine oq(z) - 3w(z). 4z3 Let r(o) = 14o + 11o + 3o - 4 + 7o - 22o. Let f(v) = 7v - 2. Give 5f(c) - 3r(c). -4c + 2 Let h(k) = 226489k3 - 2344k. Let x(z) = 290z3 - 3z. Determine 3h(i) - 2344x(i). -293i3 Let r(o) = 8o + 4. Let c(q) = -1. Let d(a) = 4c(a) + r(a). Suppose 3k - 9k - 168 = 0. Let g(z) = -z. Give kg(j) - 4d(j). -4j Let f(z) be the first derivative of z*2/2 - 185. Let c(n) = 8n. Determine 3c(y) - 15f(y). 9y Let h(a) = 76a - 7. Let j(z) = -224z + 22. What is -7h(f) - 2j(f)? -84f + 5 Let m(s) = s + 117. Let w(n) = -n - 117. Calculate 6m(x) + 7w(x). -x - 117 Let z(f) = -7f - 6. Suppose -3u + i = -0i + 2, -5u = i + 6. Let v = 9 + -3. Let k(o) = 2o - vo + 3o - 1. Calculate uz(d) + 6k(d). d Let z(s) = -15s*2 - 65s + 6. Let q(y) = -13y2 - 64y + 5. Calculate 7q(a) - 6z(a). -a*2 - 58a - 1 Let u(g) = -33g - 9. Let a(w) = 67w + 18. Give -6a(v) - 13u(v). 27v + 9 Let v(f) = -2. Let x(s) = -s - 5. Let n(z) = 2v(z) - x(z). Let b(h) = -3h - 7. Let j = 0 - -2. Suppose jt - 4 = 6t. Determine tb(u) - 4n(u). -u + 3 Let m(i) = 2i*2 + i. Let n(v) = 10v*2 + 6v. Suppose -4l = y + 90 - 97, -4l - 2y + 6 = 0. Give ln(q) - 11m(q). -2q*2 + q Let z(b) = 12b*2 + 6b - 11b2 - 3b + 7 + 3b. Let f(a) = 2 + 0a2 - a2 - 8 - 2 - 7a. Give 4f(g) + 5z(g). g2 + 2g + 3 Let x be 2/8 + 25/(-4). Let b(v) = -2v. Let h(s) = 2s + 0s - 1 + 2s + 2s2 - s2. Let j be h(-5). Let r(y) = -y. Give jb(l) + xr(l). -2l Let h(d) = 19d - 1. Suppose 4q - 2u - 34 = 0, -q + 19 + 12 = 4u. Let t(y) = -95y + 6. Give qh(r) + 2t(r). 19r + 1 Let q(u) = 8u2 - 43. Let j(a) = -7a*2 + 43. What is -5j(g) - 4q(g)? 3g*2 - 43 Let a(f) = -5f*3 + 6f. Let w(m) = 6m3 - 7m. Suppose 22n - 28 = 29n. Determine nw(x) - 5a(x). x*3 - 2x Let c(f) = -2f3 + 2f + 2. Let g(k) = -2k3 + 3k + 2. Let w(t) = t*2 + 39t + 196. Let v be w(-6). Calculate vg(s) + 3c(s). -2s3 + 2 Suppose 4y = 16y + 204. Let x(t) = 9t + 23. Let z(d) = -3d - 8. Give yz(m) - 6x(m). -3m - 2 Let b(a) = 6a3 + 6a*2 - 10a - 7. Let f(o) = -4o2 + 7o + 2o3 - 39 + 44 - 6o*3. Determine -5b(v) - 7f(v). -2v*3 - 2v*2 + v Let m(z) = z. Let f(n) = 10n - 16. Let a(c) = -c + 2. Let d(y) = 40a(y) + 5f(y). Determine -d(h) - m(h). -11h Let m(j) = -35j*3 + 3 - 23j*3 - 3j*2 + 43j*3 - 3j + 0. Let y(g) = -14g3 - 2g*2 - 2g + 2. Determine 2m(r) - 3y(r). 12r3 Let o(p) = -161p*3 + 49p*2 + 49p + 49. Let r(t) = 5t2 + 5 + 8t - t - 5t + 3t - 69t3 + 53t*3. Calculate 5o(n) - 49r(n). -21n*3 Let m(q) = 11q*2 - 10. Let j(h) = 23h*2 - 17. What is -6j(b) + 11m(b)? -17b*2 - 8 Let w(c) = 64c*2 - 19c - 10. Let a(v) = 98v2 - 29v - 16. Let k(t) = -5a(t) + 8w(t). Let n(q) = -11q2 + 3q. Give -4k(j) - 9n(j). 11j2 + j Let w(o) = -14 + 28 - 52o + 18o + 27o. Let f(l) = -3l + 7. What is -5f(g) + 2w(g)? g - 7 Let r(b) = 3b*3 - 6b*2 - 3b + 7. Let z(v) = 2v2 + v - 1. Give r(n) + 3z(n). 3n3 + 4 Let d(g) = 3g*3 + 2g*2 + 3g + 2. Let k(o) = -5o3 - 5o*2 - 6o - 4. Determine -5d(w) - 2k(w). -5w3 - 3w - 2 Let m(b) be the first derivative of -b*3 + 2b*2 + 3b + 722. Let c be (-54)/(-10) + (-8)/20. Let p(w) = 4w2 - 5w - 4. Give cp(q) + 6m(q). 2q2 - q - 2 Let t(m) = -1 - m - 13m*2 + 12m2 + 0. Let v = 8 + -11. Let j be (2 - (-6)/(-3)) + v. Let w(d) = -d3 + 3d2 + 5d + 2. What is jt(a) - w(a)? a3 - 2a + 1 Let u(g) = -5g + 5. Let o be (-20)/(-16) + (-3)/12. Let r(i) = o + 1 - 4 + 3. Let y(b) = 2r(b) - u(b). Let d(h) = -9h + 5. Calculate 3d(j) + 5y(j). -2j Let g(u) be the third derivative of -5u4/24 + u3/3 + 260u*2. Let s(c) = -5c + 2. Give 2g(w) - 3s(w). 5w - 2 Let u(y) = -y. Let q(g) = 2g*2 + g - 1. Let t be q(1). Let o(a) be the first derivative of -3a*2/2 + a - 125. Determine to(f) - 5u(f). -f + 2 Let v(c) = -4c*2 + 6c - 5. Let k(i) = 3i2 - 7i + 6. Suppose 8 = 15h + 98. What is hk(t) - 7v(t)? 10t*2 - 1 Let a(f) = -f + 1. Suppose 5m - 24 = 26. Let p be (16/(-3))/(m/(-15)). Let w(y) = 3 + y*3 - 12y2 + y2 - 3y + 2y*2 + py*2. Calculate -3a(t) + w(t). t3 - t2 Let q(t) = 928t3 + 9t2 - t - 3. Let u(m) = -m3 + 9m2 - m - 1. Determine -q(c) + u(c). -929c*3 + 2 Let r(p) = -11p - 8 + 4 + 15p + 9p. Let a(c) = 4c - 1. What is 7a(y) - 2r(y)? 2y + 1 Let y(a) = a3 + a2 + a + 1. Let x(g) = 5g3 + 3g*2 + 5g + 4. Suppose 5f + 11 = 4o, -3o - 2f + 7 = 16. Determine ox(m) + 3y(m). -2m3 - 2m - 1 Let v(b) = 7b - 29. Let q(p) = -2p. What is 3q(y) + v(y)? y - 29 Let c(w) = -45w*3 + 7w*2 - 2w + 5. Let z(g) = 42g3 - 9g*2 + 2g - 6. Calculate -6c(h) - 5z(h). 60h3 + 3h*2 + 2h Let n(c) = 1931 + 1930 + 8c - 3866 - 3c. Let y(t) = -14t + 14. Let a = 48 + -78. Let r = a + 47. Give rn(m) + 6y(m). m - 1 Let h(a) = 7 - 3 - 3. Let y(d) = d + 6. Let r(c) = 2c + 18. Let g(p) = 3r(p) - 8y(p). What is g(q) - 3h(q)? -2q + 3 Let h(c) = -363c2 - 363c. Let u(d) = 2d2 - 3d. Give h(r) - 121u(r). -605r*2 Let b(l) = -584l + 14. Let f(s) = 585s - 18. Give 5b(z) + 4f(z). -580z - 2 Let a(w) = -w + 130. Let h(k) = 3k - 263. Determine 7a(v) + 3h(v). 2v + 121 Let d(m) = m3 + m2 - m + 1. Let k(b) = b*2 - 15b + 29. Let o be k(13). Let a(r) = r2 - o + 3 + 3 - 2. Give -a(u) + d(u). u3 - u Let r(o) = 1. Suppose 3x = -3w - 4 + 1, 2x = 0. Suppose -4s - 16 = m, -3m - 20 = 5s - 0. Let j(p) = -3 + 3 - 4 + 2p - p. Calculate sr(g) + wj(g). -g Let o(m) be the third derivative of m5/10 + 5m4/24 - m3/6 + m*2. Let y(b) = -1 - 10b + b*2 + 1 - 7b + 18b. Calculate -o(t) + 4y(t). -2t2 - t + 1 Let x(i) = -5i. Let n(z) = 4z - 20. Let h(r) = -5r + 28. Let p(o) = 5h(o) + 7n(o). Suppose 50 = 5c + 15. Calculate cp(m) + 4x(m). m Let j(w) = 2w. Let t(v) = -9v + 1. Let i(u) = -15j(u) - 3t(u). Let a(q) = -q + 1. Determine 4a(c) + i(c). -7c + 1 Let q(w) = 19w + 9. Let b(z) = 9z + 4. Suppose -2o - 30 + 12 = 0. What is ob(h) + 4q(h)? -5*h Let	{ "pile_set_name": "DM Mathematics" }
/((v/v(-2/9))/v))(-7/2) assuming v is positive. v*(31423/306) Simplify ((o(o/(o*9o))/oo)(16/5)(oo(1/4)oo)7)(-3) assuming o is positive. o(171/20) Simplify ((a(-9)a20)/((a/a(-4/27))/(aa/(a(-11)a))))(15/2) assuming a is positive. a(1475/9) Simplify ((v/((vvv*1)/v))/(vv/v*(-3/4)))/(vv*5v*(-1/7))(v*(-2/3)vv(-8))34 assuming v is positive. v(-22703/84) Simplify ((f(-5)/f(-5))/((fff/(ff*(-3))f)/f0))/((f(-1))*(-9/11)(f/((f*(2/3)f)/f))(-3)) assuming f is positive. f(-64/11) Simplify (f4/(f(-1/9)/f))/((f((fff(f/f*(-5))/ff)/f)/f)/(f/f*0))(f*(2/3)/ff(2/5))21 assuming f is positive. f(-22/45) Simplify (u(2/43)u(-13))(-2/61)(u7/u(-2/9))/(u(-9)/(u/((u/((u/u(-4/7))/u))/u)u)) assuming u is positive. u(3175814/165249) Simplify (((w/(ww*2ww))/w)/w(-3/4))/(ww*3w*(5/2))ww(4/9)ww(-5)w(w(-1))(-2/79) assuming w is positive. w(-34925/2844) Simplify (z1/z(-1/4)(z(-1))(1/51))/((z(1/2))41z(-3)zz(-1/9)) assuming z is positive. z(-10501/612) Simplify ((((aa(2/3))(7/6))(-2/9))5)(-21) assuming a is positive. a(1225/27) Simplify ((c*(2/7)c)(-38))(-13/5)(ccc/(ccc/c(-1)c))(9/2)/(c(-7)c/((c/(c(5/6)c))/c)cc) assuming c is positive. c(25241/210) Simplify (b(1/8)/b(-5/2))(2/35)(b/(((bb/b*(-2/3)b)/b)/b))*(-36)(b/((bbb*(1/4)b)/b))(-34) assuming b is positive. b(1333/20) Simplify (xx(-2/13)xxx(4/9))37/(((xx/(xx/x*(1/8)))/(xxx(-2/7)/x))/(x0/(xxxx(1/7)))) assuming x is positive. x(780989/6552) Simplify (dd(-4/3)dd/(d/d(-2/7))d)/(d0)(-22/5)((dd*(-2)d)(1/9))(-48) assuming d is positive. d(29/21) Simplify (((b(2/9)b)/b)/bbb(1/5)(b(-2/5))(-6))/((bb/b3)(2/3))21 assuming b is positive. b(757/45) Simplify ((((s(-4)/s)/(ss*12ss))(-10))(-1/93))(-50) assuming s is positive. s(10000/93) Simplify (i/i14)(-27)i18/i(-19) assuming i is positive. i*388 Simplify ((ll/(ll6/l))/((l/(ll/((l/((l*(-23)l)/l)l)/l)))/l))/(ll(3/14)/l)28 assuming l is positive. l*(-32) Simplify (uuu(-2/3)uuu*(2/9)u)/(u/u*(3/7)u*0u)u(-1/3)/(uu*(-2/5))uuu*(1/4)uu(3/5) assuming u is positive. u(1487/252) Simplify ((i/i(-5/4))/(i/(i/(i/(ii(-3/7))))))(1/30)((((ii*(-2))/i)/iii)/i)46i*(-1/2)/iii(-6/5)/i assuming i is positive. i(-26499/280) Simplify (ff/(ff28)f35)/(f(-2)f30/f) assuming f is positive. f(-19) Simplify ((r5)(-37)r(-12)/r(-15))(-44) assuming r is positive. r8008 Simplify ((w(-6))15w(-4)ww/w5w)(6/11) assuming w is positive. w(-576/11) Simplify (((aaa/(aa(2/91)))/(aa*23a))(-9/10))35 assuming a is positive. a(18855/26) Simplify ((z26)*46z*(-5/16)z(2/23))(1/41) assuming z is positive. z(440045/15088) Simplify (((o/(o/(((o(2/3)oo)/o)/o)))/oo(-21)/o)/(o/o2((o*(10/11)/oo)/o)/o))(-20) assuming o is positive. o(13360/33) Simplify (k/(k/(kk(-14)))kkk/k*5(kk13kk)/(k(-16)k))(1/13) assuming k is positive. k(16/13) Simplify ((j*(1/4)j)/j(((jj*1/jj)/jj)/j)/j)/(j(-2)/j(-1))(j(1/2))4j(-1/3)jj3 assuming j is positive. j(83/12) Simplify ((c/(c/(c/(c/(c/((c/(cc/(c/(cc0))c))/c))))))*(-37)(cc(1/4))/c(1/2))/((cc(-2/7))9(c/c(-4))/(c/c(-3/8))) assuming c is positive. c(-8809/56) Simplify (((f/(f/f(-1/7)))/ff)/(ff(-2)))(-34)/(f(-8)ff/(f(-2/9)/f)ff(2/7)/ff(2/17)/f) assuming f is positive. f(-25456/1071) Simplify (t(2/19)/t)/t(2/5)(t(-2/7))(2/33)((t(1/4))0)26 assuming t is positive. t(-28793/21945) Simplify (w*1/(w/(ww*(-1/3)))w*14w/(w/w(-8/5)))(-15/4) assuming w is positive. w(-49) Simplify (a(-3/4)a/(aa/((aaaaa/a*(-12)aa)/a)a))/(a/((a/a(-6/25))/a))(-45) assuming a is positive. a*(989/20) Simplify ((m/(m/((m/(mm/(((m(m(-1/10)m)/m)/m)/m)m))/mm))(mm/m(-18))/m)/(m(-3/2)m(1/14)))(-11) assuming m is positive. m(-13343/70) Simplify (((f6f)/f)/(ff/(f(-3/2)/f)))(-1/24)(f*(-2)f1)/(f(-4)f1) assuming f is positive. f(31/16) Simplify ((c(1/4))(-16)/((c/(c(-1)/c))/((c(-7)/c)/c)))/(c(4/7)/(cc/(c/((c/(cc(3/10)))/c))))(-9/8) assuming c is positive. c(-8411/560) Simplify ((z/z(1/8)z)(7/8)/(z43z(-11/2)))(-5) assuming z is positive. z(11475/64) Simplify (((mm(mm(-1/4))/m)/(m(-1/13)/m))/(m(3/2))23)(-1/19) assuming m is positive. m(1647/988) Simplify (((y*3((y*(-5/7)/yy)/yy)/yyyyy)/(y(1/4)(yyy/(yy11))/yy))(-13))(-4) assuming y is positive. y(5109/7) Simplify ((z/(z1z))(-2/63)z/(zz(1/4)z)z(-23))(-23) assuming z is positive. z(140369/252) Simplify ((x1)(3/4))(46/7)/(((x/x(-3/4))/(x(-1/9)/xx))/(xx/(x(-2/7)/x)xx5)) assuming x is positive. x(3113/252) Simplify ((a(-8)aa4)/(((a/a(2/13))/a)/a7))/(((a7/a)/aaa/a2)/((a/(a4/a)a)/(a(-1)/a))) assuming a is positive. a(2/13) Simplify ((((d/(dd(-1/9)d))/d)/(d/(d/(ddd/(d(d/(dd*28)d)/dd)))))/(d(-14/3)dd/(d/d(-9/4))d))(-46) assuming d is positive. d(21505/18) Simplify b/b*(1/6)b*(-2)b*(-4/3)bb0b((bb2)(1/48))(-38) assuming b is positive. b(-23/8) Simplify ((a/(aa1aa))(-28)a(a/(a/(a/(aa(a/(a/(a/(a/(a(-18)aa)))))/aa))))/aa(4/13))(14/11) assuming a is positive. a(18074/143) Simplify (p(p*(-3/4)p)/pp(10/13)(p/(pp/(pp*(-5/2))p))(-21))37 assuming p is positive. p*(143375/52) Simplify (pp*3p/((p*(2/13)p)/p)(p(6/13))(-14/9))(-29) assuming p is positive. p(-4669/39) Simplify ((mm0)/m)(-34)/(m(-28)/m(1/20)) assuming m is positive. m(561/20) Simplify (i(3/2)i/i5)0/((ii/(i/i(-2/7)))14)(-7) assuming i is positive. i70 Simplify (x/(((xx(-2/9)/x)/x)/x))(-2/95)xx(-1/6)xx(xx(-2)x)/x((x(-1/4)/x)/(xx/x(-9)))15 assuming x is positive. x(-622387/3420) Simplify (((r/(r/r(1/3))r)/r)(-1/11))(2/25)r*(3/7)/(rr/r*(2/5)rr)r*(-6)r(3/2) assuming r is positive. r(-88633/11550) Simplify ((ww/w(-1/3))(12/7)(w(-1/2))24)/(w/w*(-1/3)ww/w(2/7))(-8) assuming w is positive. w(344/21) Simplify (((q(2/3))(-48)(q(-7)/q)/q(3/7))0)23 assuming q is positive. 1 Simplify ((ppp(-3))34)(20/11)/((p(-6)p)/p(3/13))18 assuming p is positive. p(4624/143) Simplify (((f(-1/3))(3/13)(f2/f)(-14))40)(5/9) assuming f is positive. f(-12200/39) Simplify (g/(g0/g))(12/17)/(g(-4/5)g/(((g(5/3)/g)/g)/g))(g2/(g/(g(-2/19)/g)))/((gg(-3))/(gg/(g6/g))) assuming g is positive. g(-5944/4845) Simplify (h(-4/3)/(h/h2))*(-23)((hh0h)(2/7))(2/131) assuming h is positive. h*(21115/2751) Simplify (((xx*(-24)/xx)/x)/xx)(-4/9)/(x/x(-3/11))(17/2) assuming x is positive. x(-5/33) Simplify a(-7)a*8a*(-3/5)(a/(aa(1/5)/a))/aa(a7aa(1/11)aa)/((aa/a*(1/8)a)/a(-7)) assuming a is positive. a(623/440) Simplify (l*(-1/2)/(ll/(ll/l(1/3)l)l))/(((l/(ll*(-2/9))l)/l)/(l/(l*(4/3)/l)))(l(-2/3))(-24/7)l(-2/19)/(ll(2/7)) assuming l is positive. l(173/342) Simplify (((s10/s)/s(3/4))/(s*(-3/5)/(sss/s(-7))))(2/99) assuming s is positive. s(377/990) Simplify ppp(-2)p/((p*(-3)/pp)/p)p/(p0p)p(-3/5)(((p/(p/p1))/p)/(p/(p(-2/3)p)))5 assuming p is positive. p(16/15) Simplify (z(1/2))(-6/11)/(z(-5)/zzz3)((z(1/3)/z)20)(-23) assuming z is positive. z(10177/33) Simplify (((d(-1/16)/(d(-12)/d))33)(-1/4))(-34) assuming d is positive. d(116127/32) Simplify ((i(-1/4))3)26/(i4/i*(-1/5)i(i(-7)/i)/iii(iii*3ii)/i) assuming i is positive. i(-237/10) Simplify (p(14/5)p*23/p(p/(p*(-13)/p))/ppp(22/5))(-13) assuming p is positive. p(-2873/5) Simplify ((bb(-2/5))(-3/43)(bb(-1))(47/3))/((b*2b)*18b*(-1)b(-3)) assuming b is positive. b(-10759/215) Simplify (((ww(4/5)w)/(w*(-5)/ww))/((www(3/2))/w(-6/7)))/(((ww2)/w)(2/23))*(1/19) assuming w	{ "pile_set_name": "DM Mathematics" }
Which is the closest to 0.1? (a) d (b) -2 (c) w a Let n = 10141 + -10137.6. What is the nearest to 3 in n, -1, 3, -3? 3 Let t = -803.9 + 757. Let g = t - -47. Suppose -10q - 5 = -5q. Which is the nearest to g? (a) q (b) 0 (c) 2/3 b Let p = 4 - 4.3. Let u = 66 - 68. Let j be ((-8 + 9)0/u)/(-2). What is the closest to j in 0, -1, p? 0 Let k be -4(21/(-18) - -1). Let g = 148617.5 + -148618. Which is the nearest to k? (a) -3 (b) 2/7 (c) g (d) 0.2 b Let g = -0.22 + 2.22. Let l = -6/1093 - -2240/9837. Which is the nearest to 1? (a) g (b) -0.04 (c) l c Let v be ((-6)/9)/(288/(-108)). Which is the closest to 1? (a) 4/43 (b) 3/5 (c) v b Suppose -53p = -58p + 115. Suppose pa - 6a + 85 = 0. What is the closest to -1.7 in 5, -0.4, a? -0.4 Let a = -31 - -22. Let n = -32 - a. Let q = 23.1 + n. What is the nearest to 0.1 in q, 1/5, 4? q Let n = -820 + 819. What is the closest to 0 in -3, 0.07, n, 19? 0.07 Let n be (209/3)/((-30)/(-90)). Suppose 0 = -l - n + 210. Let r = -0.3 - 0.2. What is the nearest to -2 in 0.2, l, r? r Let d(i) = -5i + 35. Let p be d(23). Let s be ((-4)/(-10))/((-8)/p). Which is the nearest to -1? (a) s (b) 5 (c) 0.2 c Let r = -42 - -46. Let m be 12/1842/r. Suppose -6j = 11 + m. What is the nearest to 9 in 4, 1, j? 4 Let v = -345 - -344.5. Suppose 8x = 9x - 1. What is the closest to 3 in x, -2, v? x Let n = -0.7 + 0.5. Let h = 57/1790 - 11367/19690. Which is the closest to n? (a) h (b) 4/9 (c) 1 (d) 9 a Let l = 0.5 - 1. Let g(u) = -u3 + 10u*2 - 21u + 2. Let v be g(6). Let w be 1/(-1)8/v. Which is the closest to w? (a) -4 (b) l (c) -6 b Let v = 1.2 - 13.2. Let y = 0.0413 + 0.1217. Let w = -1.163 + y. Which is the nearest to v? (a) 0 (b) -4 (c) w b Let d = 449659/4 - 112415. Let l = -2.9 + 3. Which is the closest to -0.1? (a) l (b) d (c) 2/11 b Let o = -3.647 - -3.947. What is the nearest to 1/3 in -3/4, o, -2/11, 0.2? o Let a = 4.7 + -5. Let o be (5/(-18))/(((-6615)/108)/(-49)). What is the closest to 4 in 0.2, a, 0.4, o? 0.4 Let p be ((-18)/(-24) - (-42)/56) + (-98)/68. Which is the closest to 1/2? (a) 2 (b) 0.1 (c) p b Let t(o) = -8o3 + o2 - 6o + 2. Let u be t(-3). Let z = u - 245. Which is the nearest to z? (a) -2/7 (b) -4 (c) 2 a Let n = -466 + 469.13. Let r = n + -3.19. Which is the closest to 1/3? (a) r (b) 1 (c) -0.5 a Let t be 6680/16(-8)/5. Let w be (-70)/63t/(-10). Let m = w - -74. What is the nearest to 0.1 in 5, m, -5? m Let m = -25/63 - -1/9. Let i = 65527 - 65532. Which is the closest to -3/4? (a) i (b) m (c) -0.4 c Let h = -6353 - -6361. What is the closest to -0.3 in h, 5, -0.5? -0.5 Let r be 52/402 - (-3)/(-1). Let h = -395 - -396. What is the closest to r in -5/7, h, 1/2? -5/7 Let x(t) = t*2 + 2t + 3. Let z be x(-3). Suppose -2j = -zj. Let f = 0.1013 - -1.8987. What is the closest to -0.12 in f, j, -0.4? j Let p = 6 + -7. Suppose 0 = -t + 8t - 14. Let w be 25(-19)/(-38). Which is the closest to p? (a) 5/3 (b) w (c) t a Let r(h) be the first derivative of -9h*2/2 + 134h + 111. Let d be r(15). What is the closest to 1 in 0, d, 25? 0 Let t = 0.061 + -2.361. Let x = -13.7 - -20. Let s = t + x. What is the nearest to 1/4 in s, -0.2, -2? -0.2 Let q = -114 - -240. Let p = -130 + q. Which is the closest to -1? (a) 0 (b) p (c) 3/5 a Let s = -0.1064 + 0.3064. Suppose -b - b + 12 = -3z, -3b - 8 = 2z. What is the nearest to s in z, -2/7, 0, 0.07? 0.07 Let s = -3.5 - -3.4. Let p = 4803 - 4801. Which is the nearest to s? (a) 0.3 (b) p (c) -2 (d) 0.5 a Let m = -75 + 74. Let n = -25 + 26. Let y(p) = 2p*2 - 7p + 7. Let q be y(3). What is the closest to n in q, m, -5/4? m Let g be ((-6)/18)/(-4 - 44/(-12)). Let x = -6343/5 + 1268. Which is the nearest to 2? (a) g (b) x (c) 41 a Let k = -6 - -5.6. Suppose -7i - 38 + 45 = 0. Let n be ((-12)/1040/(-16))/i. What is the closest to 2/3 in n, k, 0.4? 0.4 Let t = -51.09 - -53.09. Which is the closest to -96? (a) t (b) 1 (c) 0.1 c Let f = -756 + -314. Let o = 1070.3 + f. Let n = -0.05 + 5.05. What is the nearest to 54 in -4, o, n? n Let m be (416/448 - (-9)/(-21))(-4)/(-6). Which is the nearest to 2/3? (a) 42 (b) m (c) 3 (d) -4 b Let q = -0.6 - -0.6. Let t = -67 - -69. Let d(i) = 15i - 31. Let a be d(t). What is the closest to -0.2 in q, 2/9, a? q Let x = 20.66 - 20.4. Let r = -1.74 - x. What is the closest to -2/7 in -3/2, r, 0.2? 0.2 Let a = 8.6737 - -0.3263. What is the closest to 3 in a, 5, 0.3? 5 Let k be (-11 - 23/(-2)) + (-11)/30. Let n = -483/13 - -37. What is the closest to n in k, 12, 0.4? k Suppose 16o = -5l + 19o + 2, 0 = 4o - 4. Let p = 132.89 - 133. Let q = -65/2 - -133/4. What is the nearest to l in 2, p, q? q Let p be -18(252/8)/7. Let i be 6/10 + (-4)/((-240)/p). Which is the closest to 1? (a) -1/2 (b) i (c) -2/3 a Let z = -3.6 + 4. Let r be -1(-2)/(430/(-15)). Let h = r - 71/215. Which is the closest to 1? (a) z (b) h (c) 0.1 a Let y = -204 + 208. Suppose -k + 5d - 1 = -7, yk - 4d - 8 = 0. Let l(r) = -r2 + 8r - 9. Let w be l(6). Which is the closest to 2/5? (a) k (b) 5 (c) w a Let t = 23 - 23.11. Let n = -502.07 + -16.93. Let i = -518 - n. What is the closest to i in t, 0.1, 5? 0.1 Let s be (-1 - 0 - -1) + (34 - 18550/550). Suppose 5d - 2u = 20, -3u + 8 = 2d - u. Which is the nearest to 3? (a) d (b) s (c) 1/5 a Let f = 0.698 + -2.138. Let d = -1.24 - f. What is the closest to -1/7 in 5/2, d, 2/3, -2/11? -2/11 Let x = 6.438 + -6.338. Which is the closest to x? (a) -3 (b) 0 (c) -16.2 (d) 1 b Let k = 6 - 9. Let z = -19/11 + 155/77. Let y = -3.879977 + -0.120023. Which is the nearest to k? (a) y (b) 4/5 (c) z a Let w = -9.96 + 4.96. Which is the closest to 160? (a) -0.2 (b) w (c) 0 c Let i be (-4543)/(-413) + (2 - 2 - 34). What is the nearest to -1 in 2.7, 0.2, i? 0.2 Let v be (-3)/1 - 15/(-4). Let d = -0.18144 + 0.58144. What is the nearest to -3 in -0.1, v, -4, d? -4 Let t = 3869 + -3869.5. Which is the closest to 0.039? (a) 0 (b) -8 (c) t (d) -1 a Let v = 16.6 + -16.557. Let f = -0.133 + v. Which is the closest to f? (a) 1/6 (b) 2 (c) -1/4 c Let x = 0.413 - -54.587. Let s = x - 55.4. Which is the closest to -2? (a) 0 (b) 1 (c) s (d) 22 c Let q(w) = -w*2 + 13w + 24. Let n be q(15). Let m be (1/(-2))/(n/24). Let l = -11 - -9. What is the nearest to -0.1 in l, -6, m? l Let h = -311 - -224. Let x = 90 + h. Let c = 12 - 7. What is the closest to 4/3 in x, c, -0.3? -0.3 Suppose -5j - 999 = 5g + 2076, 0 = 5j. Let f = -3689/6 - g. Let v = -5.7 - -6. Which is the closest to -2/3? (a) v (b) f (c) 5 b Let i = -105 + 105.1. Let o = -80 + 83. What is the nearest to 0 in o, i, -1/16? -1/16 Let i be ((-92)/69)/(0 + (-4)/18). Let a be i/22 + 564/(-132). What is the nearest to 4 in -3/8, -1/8, -3/4, a? -1/8 Let s = -329.5 + 329. What is the nearest to 0 in -4, -0.3, 82.1, s? -0.3 Suppose 77i + 1 = 78i. Let g be i + (-7)/2 - 6/(-4). Let w = -3.5 - -3. What is the closest to g in w, 5, 3? w Let y be 12/10 + (-15)/25. Let v = 8.06 - 0.06. Let a be (-45)/(-18)5/(75/4). What is the closest to -0.2 in v, a, y? y Let t = -2/85 + 212/1785. Let g = 1.7 + -1.8. Which is the closest to t? (a) 0.1 (b) g (c) -3/5 a Let b = 76/41 - 298/205. What is the nearest to b in -3/5, -1, -1/694, 2? -1/694 Let m = 5308 - 5307.6. Let k = -1 + -2. Let v = 1 + -0.5. Which is the nearest to 2/7? (a) m (b) v (c) k a Let z = -30.9 - -31. Let p(u) = -u - 4. Suppose 0 = -5g - 3 - 2. Let q be p(g). What is the closest to z in q, -0.07, -3/7? -0.07 Let u = 536117/18 + -29793. Let o = u - -17/2. Let q be (-11)/(-12) - 2/8. Which is the nearest to q? (a) 3 (b) o (c) -0.2 c Let x = 597 - 602. Which is the closest to -0.2? (a) 0.24 (b) -0.4 (c) x (d) -4/9 b Suppose -5r - t + 785 = 0, -5r + 4t + 253 = -532. Let p = r + -154. Which is the nearest to 0? (a) p (b) -4/7 (c) 0.4 c Suppose -76i + 704 = 151 - 1119. Which is the nearest to 1? (a) i (b) -3 (c) 4 (d) -4 c Let r = -2.08 + 0.08. Let z = -406.384 + 406. Let l = 0.084 + z. Which is the closest to -0.08? (a) l (b) -3 (c) r a Let s = 24.366 - 23.866. Which is the nearest to 1? (a) s (b) 332 (c) 2 a Let i be (0 + (-1)/4)(-7032)/270. Let j = i + -32/5. What is the closest to -0.1 in	{ "pile_set_name": "DM Mathematics" }
lue of 48/16910/210? 13 What is the value of ((-17)/68)/(20/(11040/(-46)))? 3 What is the value of (0/3875)/((-5)/(-1)8/10)? 0 Calculate ((22368/108)/(-233))/(((-2)/63)/(-1)). -28 4/((2025/60)/27) 16/5 What is (5/((-135)/18))/((-96)/128)? 8/9 What is the value of (-3)/(-861)490/(-175)? -2/205 What is 129429/28762(-8)/(-486)? 2/27 What is the value of (-1)/(-5(-11)/(-88)13/(455/(-238)))? -4/17 Evaluate 5/((-15)/(-3))-1962(-75)/(-1350). -109 What is (1210/(-385))/((-60)/210)? 11 What is (5/(-15)3)/(((-6)/9)/((-104)/4))? -39 3((-2565)/945)/((12/7)/(-4)) 19 (-55258/(-4730))/((-27)/(-99)) 11 ((-34960)/(-8418))/95-1(-5)/(-20) -2/183 (((-6)/(-3))/2)/(4(1/1)/(-124)) -31 What is the value of ((-351)/130(-30744)/1134)/((-9)/15)? -122 Calculate (120/(-80))/((-6)/(-164)). -41 What is (9/(-18))/((-84)/(-42))2-34? 17 Calculate (-24)/(-4)(-15232)/2688. -34 What is the value of -6((-1)/(27/3))/(42/(25578/7))? 58 What is the value of (-691145)/(-50778)(-12)/(-140)? 7/6 Calculate (6/(-10))/((-42)/(-58800)-20). 42 Calculate 527/(44795/(-102))((-20)/66)/(2/(-45)). -90/11 ((-16191)/(-25186))/(((48/63)/4)/(14/63)) 3/4 Calculate (-122/3)/(((-1148)/328)/(21/(-3))). -44/3 What is the value of (160/(-24))/(13/((-364)/7))? 10 Evaluate ((-305)/61)/((-525)/(-30)). -2/7 (-2145)/1321836/255 -117 What is the value of 14/9150700/130? 60 Calculate (9200/(-46))/(-20)9/(-30)(-5)/6. 5/2 What is 17((-36)/1623)/((-8)/93)? 17/4 Evaluate 3/(-12)-1((-352920)/(-3633))/(2/7). 85 ((-32)/(-40))/(114/1425) 10 Calculate (-190)/(-855)21/(-12)(-8)/70. 2/45 Evaluate (-17)/((104/(-13)10/603)/(-20)). -85 What is ((-17)/((-833)/21))/((-12)/126)? -9/2 What is the value of ((-3680)/240)/((20/(-6))/(-5))1? -23 What is the value of ((-61875)/(-8250))/(1/(-8)(-8)/(-12))? -90 4/143788/4728 1/7 Calculate 300/(-9)((-412)/2060)/(2/4). 40/3 Evaluate (-9)/(54/28)-6(-1974)/71064. -7/9 Evaluate (16/2030/72)/((-6)/76). -38/9 Calculate (-14)/((-30)/1350-45). -14 Evaluate (727/(-34896))/(1/(-96)). 2 What is (50/75)/((-265)/477)? -6/5 Calculate ((-135)/(-12))/(((-465)/(-1736))/(75/315)). 10 What is the value of (289775/21080)/((-4)/(-96)-3)? -85 Evaluate (2/(4/4))/(801/(-32040)). -80 (11/11008832)/(((-32)/216)/((-2)/(-3))) -2/139 Evaluate (24/(-32))/(729/(-180))(-1)/((-2)/2). 5/27 Evaluate 1/(-100)454(-6)/108. 1/10 (114/8)/((212925/(-2672))/(-425)) 76 What is the value of (4230/282)/(12/(-16))? -20 What is 104/(-325)-5(-48)/(-4800)? 2/125 (3/(4350/10))/(105/(-50)(-13)/91) 2/87 Calculate (-36)/(1728/(-16))84/49. 4/7 What is the value of ((4/(-245))/2)/(1244/3047898/40)? -4/49 What is the value of -38957/1164/661? -19 What is the value of ((-576)/(-96)5/(-15))/(2/(-79)1)? 79 What is the value of ((-3)/6(-210)/45)/7? 1/3 Calculate (8/(-116))/(642/(-963)). 3/29 What is 11080/(-2025)(-15)/(-108)? -2/27 Evaluate (-1)/(15/(-120)20)(-3002)/(-4). 60 Evaluate 6(-20)/7543/((-1051092)/315). 2/97 What is the value of ((-35)/((-11760)/(-96))42/72)/(2/20)? -5/3 (-561)/(510/(-10))1 11 Calculate (-9585)/(-852)(-10)/188/2. -25 Calculate (1259/12590)/(((-3)/435)/1). -29/2 (6972/(-2324))/(((-6)/((-24)/(-44)))/(-5)) -15/11 What is the value of (-12)/(-45)((-2)/(-3))/(-10(-1)/(-585))? -52/5 Calculate (2/207)/((-59)/1062)1. -4/23 Calculate ((-45)/27)/(695/834). -2 What is the value of ((-2844)/(-94800))/((-78)/(-50))? 1/52 Evaluate (-350)/(-10)30/35(-4)/4. -30 What is (835/10855)/(1/39)? 3 What is ((-90)/(-20))/((-63)/203)? -29/2 Evaluate (68/(-84))/((-7548)/(-3996)). -3/7 Calculate (167/((-28056)/672))/((-3)/((-18)/44)). -6/11 Evaluate ((-500)/(-24))/((-43)/20640-200). 50 What is 72/336(-532)/228? -1/2 Evaluate ((-324)/66)/((-89)/979). 54 Evaluate (-24)/(-180)1555/(-1866). -1/9 What is (13/(-728)-21)/(12/(-672)7)? -3 Evaluate (11/635817)/((-4)/2). -1/68 Evaluate ((-51633)/63107)/(6/(-902)). 123 What is the value of ((-1)/(-6))/(-3856/421344)? -33 Evaluate (14/2520)/(27/(-12)(-7)/(-42)). -2/135 What is 759/1380(-18)/660-10? 3/20 ((-1)/(-1))/(22/(4928/(-350)))70/28 -8/5 What is ((-4)/2)/(((264/15)/(-4))/(19544/3490))? 28/11 What is (15(-20)/(-45))/(2798/1323)? 10/3 What is (-4)/(-3)(-6327)/223554? -2/53 What is -1411/308(-94)/(-1)? -47 What is the value of 1/((-14)/(1960/(-182)))? 10/13 Calculate (-110)/(-4)(4/13)/(190/247). 11 (((-120)/54)/1)/(2428/60093(-22)/(-4)) -10 (-1(-2)/(-8))/((-615)/73800) 30 What is the value of (-60)/(-7)-10(-91)/260-1? -30 (-26)/4(-3596)/(-806) -29 (-27)/(702/8)(-5)/(30/663) 34 What is the value of (-109)/((-3597)/(-231))68/(-4)? 119 Calculate (-360)/(-8)3((-700)/70)/10. -135 Calculate (7265/17436)/((-40)/592). -37/6 Evaluate ((-2)/24)/((-2527)/(-113715)). -15/4 Evaluate 2/((126/(-14)16/(-2664))/2). 74 Evaluate 300/(-2)(5/(-9))/(((-38285)/186)/(-247)). 100 ((-4)/(-1830)(-96)/(-8))/(194150/36375) 2/61 What is the value of -1(-4128)/(-23220)6/8? -2/15 (275/1980)/(-23/1020/48) -5/9 What is the value of 1/5853450/(-6565)? -26 (-192)/80(-5655)/(-348) -39 What is 2(-65)/39(-132)/275(-90)/(-6)? 24 Calculate (-5)/((7/28)/((-224)/128)). 35 Evaluate (-92)/(24288/132)14/1. -7 What is the value of (-140)/(-60)112/(-14)(-12)/(-600)? -1/25 Evaluate ((-23049)/117)/(-591)(-252)/(-1). 84 What is (6/37)/((-849)/849)? -6/37 Calculate (-280)/22031229/(-334). 119 Evaluate (336/735((-450)/(-20))/(-9))/(2/(-35)). 20 (1/(-7))/(((-6000)/(-12375))/(80/15)) -11/7 What is the value of (32/(-672))/((56/(-56))/(-21))? -2/21 What is (-252/18)/(11/(-198)-12)? -25/6 Evaluate (5(-5)/(-2))/((-19)/2432-64). 25 ((2/7)/((-139)/(1315496/(-832))))/(2/(-16)) -26 What is ((-3925)/(-13345))/(15/(-12)2)? -2/17 (3/(-735)-5)/1(-4)/(-144)-21 -1/84 What is the value of ((340400/333)/230)/5? 8/9 ((-690)/1725)/(128/(-10)) 1/7 What is ((-1499)/164890)/((-2)/(-8))? -2/55 (1482/104016)/(7/((-140)/2)2) -114 Evaluate (2/(-240))/(((-5560)/9730)/(16/7)). 1/30 Evaluate 8/(-96)4((-26)/338)/(20/(-65)). -1/12 Evaluate (((-108)/9(-24)/384)/(2/(-72)))/5. -27/5 What is 21/(-385)((-40)/(-15)-6)/((-22)/(-165))? 72/11 What is the value of (1/(-82)-1)/((-70)/(-4)(-8415)/117810)? -2/205 What is the value of (18980/40)/((-6760)/(-1040))? 73 What is the value of ((-3)/(-90)-5)/(705/29610)? -7 What is the value of ((-275)/(-29700))/((-22)/(-99))? 1/24 ((-2910)/5820)/((-2)/188-1) -47 What is the value of -2(1512/21)/(-4176)? 1/29 Evaluate (-1(-74)/(-12))/((-5228)/(-5228)). -37 What is (11/66)/((-75)/(-4050))? 9 Calculate ((-50)/(-70))/((-5490)/161406). -21 Calculate 76(-150)/4560014. -1 Evaluate ((-38)/95)/(((-6160)/(-1900))/22). -19/7 What is (-4200)/(-520)(-1248)/72? -140 Calculate 1/520835/(-2315). -9/5 Evaluate (-6)/74(-39331)/3189. 1 151/(58588/(-1455))20 -75 ((-5880)/(-36))/(-7)(-287)/(-164)6/7 -35 What is the value of 15(-24)/(-10)78/(-416)-8? 54 Calculate (-54)/(-10)-412/57650/5. -9/2 Calculate 3332/(-336)8(-252)/294. 68 Evaluate 32((-40)/2505)/(472/1475). -80 What is (-396)/2880(-104)/(-572)? -1/40 What is ((-176)/(-12))/(32264/8832)? 44/7 Calculate 510/((-1734)/(-51))(-3)/(-6). 15/2 Evaluate 27(-3)/4338-6(-28)/378. -2/241 Calculate -28/(-150)(-720)/(-960). 2/25 -11/(-10)4685615/(-85193) -11/2 ((-147)/(-273))/((-1032)/2236) -7/6 Evaluate (16((-81)/9)/(-225))/(18/(-180)). -32/5 Calculate ((-32)/(-80))/((2/8)/(219/584)). 3/5 -3((-6)/(-42))/(34/(-3094)) 39 Evaluate (-4)/(-6)(-99)/(-330)75/(-45). -1/3 38/38117 17 What is the value of (5115/39897)/(2/13)? 5/6 What is (63/(-60))/(-26(-791)/(-105768))? 27/5 What is (7/(-16))/(1200/(-57600))? 21 ((10/(-28))/1)/((-84)/(-15288)91) -5/7 What is 60/(-8)((-1)/(-5))/(((-950)/2736)/(-25))? -108 Evaluate (6/(-9))/(56/42)(-15)/(1800/(-16)). -1/15 2/756/(5264/235) 5/7 Evaluate (25543/3649)/(1/10). 70 What is (-50)/4102/17260/390? -50 Calculate 84/(-2736)1212/(-21). 4/19 Calculate ((-13)/73/5)/(272/(1610240/(-1776))). 26/7 Evaluate (145/(-23(-90)/1656))/(4/((-4)/2)). -58 What is 27083/742((612/(-24))/17)/((-3)/(-4))? -73 Calculate ((-6546)/22911)/((-2)/60)17. 60 Evaluate ((-2015)/(-5239))/(3/39). 5 Calculate 816/(-10)(-14380)/34512. 34 Evaluate (448/630)/(((-20)/(-100))/((-7)/14)). -16/9 Calculate ((-218)/(-436))/(2/4)-39. -39 What is (	{ "pile_set_name": "DM Mathematics" }
z2 and give m. -13272 Rearrange (-2 + 4 + 0)(4 - 4 - m) + (-2m + m + 2m)(1 + 0 + 0) + (1 + 2 - 1)(12 + 54m - 12) - 3m + 2m + 6m to the form tm + h and give t. 112 Rearrange (0p*2 + 4p*2 - 6p*2)(-6 + 2 - 3 + (0 + 0 + 1)(64 - 228 - 63)) to l + yp + kp2 and give k. 468 Rearrange 2d + 1 - 1 - 3d + d + 0d + 0d + 0d + 2d + (-4 + 0 + 5)(-2d - 2d + 6d) + (6 + 8 - 7)(151d - 78d - 83d) to o + kd and give k. -66 Rearrange 2w4 + 2w*2 + 482w*3 - 3w*4 + 482w*3 + 2w*2 - 7w*2 to vw + r + aw3 + bw*4 + hw*2 and give h. -3 Rearrange 43400z - 2 + 4 - 41354z to the form n + hz and give h. 2046 Rearrange 9 - 18 + 10 + 685y + 2 to the form f + zy and give z. 685 Rearrange 7316f3 - 12 - 4895f*3 + 6955f*3 + 11 to the form gf*3 + lf*2 + kf + o and give o. -1 Rearrange -64i3 + 136i*3 - 2i*2 + 216682i + 1 + 108i3 - 216680i to the form xi3 + ai*2 + h + ki and give h. 1 Rearrange (67 - 18 + 329m - 53)(12 + 10 - 6) to s + rm and give r. 5264 Rearrange -1828p + 1980 + 126p - 1980 to hp + y and give h. -1702 Express w*4 + 2 - 15w*3 - 20w*4 + 20w*4 + 0w*4 - 3 - 2w*2 + w as rw*3 + fw*2 + c + hw + mw4 and give h. 1 Rearrange (3 - 1 - 4)(-1115a3 + 16a*4 - 2613a*2 - 5786a*2 + 8399a*2) to ta + b + va4 + la*2 + na*3 and give l. 0 Express -68964u*3 - 68959u*3 - 16u*2 + 6 + 2u - u*4 + 137922u*3 as k + yu*3 + au*4 + ju + fu2 and give a. -1 Express (127157 - 127157 - 375n)(4n2 - n2 - 5n2)(-4n + n + 5n) in the form pn + gn*3 + hn*4 + qn*2 + k and give h. 1500 Express 102 - 35 - 92v - 28 + 2v2 - 31 as g + kv + yv2 and give g. 8 Express -14k*4 + 14k*2 - 6k*2 - 12k*2 + (-2k*2 + 3k - 3k)(13k2 - 39k*2 + 6k*2) as x + mk + bk2 + nk*4 + fk3 and give n. 26 Rearrange o2 + 16o + 2o*4 - 16o*3 + 0o*2 + 22o*3 - 15 + 15 to po*3 + xo*4 + zo + ao2 + b and give p. 6 Express (1614k*2 + 2742k*2 + 1464k*2 - 1 - 806k*2)(12 - 12 - 6k)(-4 + 2k + 4) in the form uk*3 + dk + b + rk4 + ck*2 and give c. 12 Express ((-4 - 2 + 4)(3a - a + 0a) + a + 2a + 0a)(-4 + 0 + 2)(-5 + 8 + 12)(-63 + 104a + 63)(-3 + 3 + 2) in the form wa*2 + u + na and give w. 6240 Express -37z - 9z + 8z - 4 + 3 - 4 + 3z + (5 - 1 - 2)(-2z + 2z + 2z) + 3z + 0z + 0z in the form g + lz and give l. -28 Rearrange -9080k - 12 + 12 - 3049k to y + zk and give z. -12129 Rearrange (-1769k - 11142k + 2279k + 1046k - 9278k)(2k*2 - 2 + 2) to b + nk*2 + vk*3 + xk and give v. -37728 Rearrange -2u2 + 31u + 22516 + 13u4 - 45033 + 16u*4 + 22517 to lu*4 + mu*2 + au + b + ju3 and give m. -2 Express (-183 + 148 - 310 - 2 + 3 - 2 + (3 - 4 + 0)(3 - 4 + 0))(19o*3 + 47 - 47) in the form fo + wo3 + d + uo*2 and give w. -6555 Express (-396480c*2 + 792962c*2 - 396478c*2 - 115c)(-c2 - 3 + 5 + 2c - 1) as ac2 + p + nc + mc4 + ic*3 and give n. -115 Express 79b*3 + 4 - 39b*3 - 6 + 6b*2 + 3b - 47b3 - 17b*3 as tb + xb2 + ab*3 + h and give h. -2 Rearrange -629 + 1881 - 627 - 625 + 7210w to the form n + uw and give u. 7210 Rearrange -139n*2 + 414n*2 - 11 - 2n - 51n2 - 99n*2 to the form in*2 + xn + p and give p. -11 Express -27h2 + 4790h + 25h2 - 4793h + 2 + 683h3 as kh*2 + nh*3 + d + qh and give d. 2 Express (-4w2 - 21 + 21)(-3w + 4 - 4) - 14905 + 14905 - 279w*3 in the form zw + kw2 + l + uw*3 and give u. -267 Rearrange 370o + 369o - 1494o + 378o + 379o - 2374 to xo + c and give x. 2 Express -251 - 184x*2 - 30x + 251 - 107x2 as ax + u + wx2 and give a. -30 Express -b2 - 3b*2 + 5b*2 - 64 + 35 + 85 + 3b*2 - b + b - 4b*2 + (3b*2 - 1 + 1)(-3 + 1 + 4) as h + wb + jb*2 and give h. 56 Express -72n*4 + 3499 - 3n - 2n3 - 3492 + 0n as kn4 + dn*3 + ln*2 + b + un and give u. -3 Express 3y - y - 4y + (-6y - 2 + 2)(-9 - 72 + 26) in the form o + xy and give x. 328 Express 9a*2 + 5 + 6a*2 + 37a - 35a - 30a*2 + 1 - 3a*3 in the form wa*2 + s + ca + ha3 and give c. 2 Express -r2 - 1280r*3 - 22 + 42 + 2r*2 - 23 + 0r*2 in the form o + nr + vr3 + yr*2 and give o. -3 Express 0 + 0 + 2s + (-3 + 3 - 2s)(0 - 3 + 5) - 2s + 3s - 2s + 1121s + 14742s - 5953s + (-s + 2s - 2s)(0 + 2 + 0) in the form ls + g and give l. 9905 Express -3g + 7g*3 - 9120560 + 5g*2 + 5g*3 + 9120562 as yg + x + fg2 + vg*3 and give x. 2 Express -308x*2 + 95x + 2130x2 - 95x + 990x2 in the form ox + z + sx2 and give s. 2812 Express -51q*3 + 18q*3 - 2q*2 + 7q*3 + 9q*3 + 27q - 7q as mq*3 + pq*2 + n + lq and give m. -17 Rearrange -j*2 + 104j*3 - 86j + 220j - j4 - 58j - 106j3 to the form pj*4 + sj*3 + yj + i + rj2 and give r. -1 Express (-1 + 1 - 4l)((162l - 276l + 143l)(-1 - 1 - 7) + (1 - 2 + 3)(l - 4l + 0l)) in the form x + il2 + hl and give i. 1068 Rearrange 5 + 148923o - 2586o*2 - 148923o - 2 to qo2 + w + jo and give w. 3 Rearrange 46 - 5 + c2 + c2 - 173c - 230c + 405c to g + xc + fc2 and give x. 2 Rearrange -g3 + g2 + 7 - 12g*4 + 22g*3 + 2g*3 to sg + pg4 + cg*3 + bg*2 + l and give c. 23 Express (4 + q - 5 + 2)(-107 + 151 + 869) as lq + d and give d. 913 Rearrange 2q*3 + 78472 - 57q*4 - 78463 + 16q*4 to the form lq + wq2 + fq*3 + zq*4 + n and give n. 9 Express (1 - 1 - 2p)((65 + 21 - 11)(-3 + 2 - 2) + 5 + 0 + 4) as i + vp and give v. 432 Express 5253m + 3485m + 2474m as t + wm and give w. 11212 Express 39d*3 + 4d*2 - 2d + 47d3 - 96d*3 in the form yd*2 + cd*3 + s + bd and give b. -2 Express (28 - 11u2 - 28)(5 + 2 + 1) + (u - u - 2u)(-6 - 16u + 6) as du + m + iu2 and give i. -56 Express 72g + 78 - 4g3 - 2g*2 - 77g - 138 + 2g3 - 2g*3 in the form zg + mg2 + y + lg*3 and give y. -60 Express 474 + 110r*2 - 56r*2 - 53r*2 + 248 - 2r in the form fr2 + u + sr and give f. 1 Express (4u - 2u + u)(-6 + 6 - 6985u + 8403u) as mu + n + gu2 and give g. 4254 Express 1166u + 1068u - 149u + 1241u in the form b + hu and give h. 3326 Rearrange -40q4 - 47q*4 + 0q*2 + 27q*2 + 85q*4 + 49 to the form xq + w + nq3 + tq*2 + kq*4 and give k. -2 Express 50d - 3d + 109d + 490d3 - 491d*3 - 3 + 2d*2 in the form n + zd*3 + ld + vd2 and give z. -1 Rearrange (-3u + 3u + 2u)(5 + 24 + 24)(-91u + 91u - 2u3) to pu*3 + yu*4 + mu + su2 + b and give y. -212 Rearrange (-1 - 4 + 2)(6o - 2o - 3o) + (o - 6 + 6)(-4 + 6 + 5) + (1 + 0 + 0)(211 - o - 211) to b + to and give t. 3 Express (-17o + 5o + 4o2 + 13o)(8303 - 5780 - 4975) as s + do*2 + uo and give d. -9808 Express (26q2 - 52q*2 + 23q*2)(2q - 1 + 1) - 19q*3 + 41q*3 - 9q*3 as tq*2 + iq + kq3 + r and give t. 0 Rearrange 131247m2 + 13 - 4 - m4 - 61m3 - 131245m*2 + 0m*4 to lm + u + hm4 + nm*2 + gm*3 and give n. 2 Rearrange -616z*2 + 1234z*2 + 7z3 - z - z3 - 621z2 - 4 + 2z*4 + 2z to the form s + vz2 + gz*4 + oz*3 + mz and give m. 1 Express ((-2 + 2 - 1)(-71 - 46 + 168) - 1 + 2 - 3)(-23a - 13a + a + (5 - 3 + 0)(-2a - 1 + 1)) as ra + m and give r. 2067 Express 180 - 25j*2 + 71 - 273 + 44 as zj*2 + x + pj and give x. 22 Rearrange -16673t + 16672t - 7t4 + 5t4 - t2 - 30 to the form gt + it*4 + kt*3 + ht*2 + o and give h. -1 Rearrange (-3 + 0 - 1)(-k + k - 2k) + 3k + 2 + 11k - 2k + (2k + k - 4k)(-60 + 27 + 19) to fk + l and give l. 2 Express -126u3 + 46u*3 + 0u*3 + (-1 - 1 - 1)(-23u3 - 2u*3 + 2u*3) as mu + hu2 + cu*3 + n and give c. -11 Rearrange -4680k - 21244k - 20425k + 1503k to mk + p and give p. 0 Rearrange 40p3 - 1039p*2 + 1010p*2 - 80p*3 - 5p + 37p3 to n + wp + ap3 + up*2 and give w. -5 Rearrange 2i*4 + 11i*4 - 5i*4 + (-5i*3 + 4i3 - i3)(-14i - i + 44i) to the form h + xi + oi4 + ji*3 + vi*2 and give o. -50 Express 4i*3 + 5731 - 412i + 2i3 - 5731 in the form ai*2 + li*3 + m + ti and give t. -41	{ "pile_set_name": "DM Mathematics" }
((-4)/16)/(1/4). Let v be (-1)/((h - 1) + -2). Which is the third smallest value? (a) -5 (b) v (c) 2/7 c Let s be (-11)/((-495)/18) - 13/(-30). What is the second smallest value in 0, s, 2, -5/21? 0 Let f = -1273/460 - -2/115. Suppose l - 31l = -l + 37l. Which is the second biggest value? (a) 0.2 (b) l (c) f (d) -0.5 b Let i = 9.4 + -12.4. Let m = -2/27 - 23/54. Which is the fourth smallest value? (a) -2 (b) i (c) -1/4 (d) m c Let z = 41/24 - -19/24. Which is the third smallest value? (a) -2/3 (b) 5 (c) z (d) 0 c Let o = 3.91 - -0.09. Let q = 109.141 - 0.141. Let f = q - 106. What is the second smallest value in o, f, -6? f Let c = 4 + -9. Let w = -500 + 496. What is the third smallest value in c, w, 0.5? 0.5 Let l = 22 - 88. Let b = 66.4 + l. Let j be (-2)/(-11) + (-47)/77. What is the second smallest value in j, -5, b? j Let r = 3 - -1. Let j = -3078 + 3076. Which is the fourth biggest value? (a) 5/2 (b) r (c) j (d) -3/8 c Let f = -0.3 - -0.3. Let r = 3.35 + 0.65. Let t = -4.2 - -1.2. What is the biggest value in r, t, f? r Let p = 275/3 - 3007/33. Which is the biggest value? (a) 2 (b) p (c) -0.3 (d) -2/9 a Let w be (1 + 0)(-2 + 2). Suppose 17r = 9r + 8. Let t be (-3)/7-1r. Which is the third biggest value? (a) -2/13 (b) w (c) t a Let d be 1/(5/((-40)/(-8))). What is the second smallest value in -0.3, -22/13, 4, d? -0.3 Let d = 0 + 0.3. Let t = 3.628 - -0.372. What is the smallest value in -3, d, t? -3 Let g = -601.6 + 602. Let y = -18 - -18.6. Let i(p) = p + 2. Let s be i(-6). What is the second smallest value in s, y, g? g Let p = -3340.4 + 3340. Let h = 0.02 + -0.52. Which is the biggest value? (a) p (b) h (c) 0.5 (d) 0.3 c Let d(g) = 4g*3 + 26g*2 - 13g + 3. Let c be d(-7). What is the smallest value in c, -34, 1/2? -34 Let i(k) = 3k + 5. Let y be i(5). Suppose 6f - f = y. Which is the third smallest value? (a) -2/7 (b) 3 (c) f c Suppose -5y + 78i - 74i = -5, 0 = 4i. What is the biggest value in 5, y, -12.4? 5 Let z be ((-231)/(-154))/(((-6)/10)/(-1)). Which is the second smallest value? (a) 4 (b) -4/5 (c) z (d) 80 c Let r be (-2)/(-20) + (-132)/120. What is the third smallest value in 1, 5, r? 5 Let i = -0.14 - 0.012. Let x = -0.052 - i. Which is the biggest value? (a) 4 (b) -1 (c) -2 (d) x a Let t = 0.0014 + 3.9986. What is the biggest value in -18, t, 0.2? t Let v = 17 + -13. Let u = 25 - 24.5. Which is the smallest value? (a) u (b) 3/4 (c) v a Let q be (-1316)/16 + (-3)/(-12). Let u be 10/(-45) - (-1)/36q. Which is the fourth smallest value? (a) 2 (b) -1 (c) 7 (d) u c Let v(z) = -38z + 232. Let w be v(6). Which is the third smallest value? (a) w (b) 2 (c) 895 c Let f(o) = -o + 0o - 5 + 2o. Let w(r) = -r*3 - 11r*2 - 9r + 14. Let y be w(-10). Let s be f(y). Which is the smallest value? (a) 3 (b) s (c) -3 c Let v = -22.3 - -22. Which is the smallest value? (a) 44 (b) v (c) -1/7 b Let j be 5(4 - 3)4/(-4). Let x = 2 - 20. Let o be x/8 + 5 + -3. Which is the biggest value? (a) o (b) j (c) 4/9 c Let o be (-3)/58/6. Let s = 0.88 - 0.38. Which is the second biggest value? (a) s (b) -2 (c) o (d) 2 a Let k = -18 - -13. Let c(u) = u - 3. Let t be c(k). Let w be ((-4)/t)/((-6)/(-4)). What is the biggest value in 2/13, w, 4? 4 Let q be 120/21 - 8/(-24)-18. What is the biggest value in q, 5, -6, 0.5? 5 Let x = -0.064 - 14.936. Let q = -50.1 + 50. Which is the second biggest value? (a) q (b) x (c) 0.2 a Let a be (10/35)/(2/14). Let h = -11/3 + a. Let w be (10/20)/(18/4). What is the third smallest value in w, 1/6, h? 1/6 Let s = -0.05 - -17.05. Let l = s + -16.8. Which is the second smallest value? (a) 0.3 (b) 0.17 (c) 1 (d) l d Let k = 225/7 + -32. Let s = 143/18 + -58/9. Which is the smallest value? (a) s (b) k (c) -5 (d) 3 c Let f = 1429 + -1430. What is the smallest value in f, -6, 1? -6 Let u = -276 - -281. Which is the biggest value? (a) 2 (b) -0.076 (c) u c Let j = 179.1 + -183.1. Which is the smallest value? (a) -3 (b) 3/5 (c) j c Let c = -0.212 - -0.232. What is the second smallest value in c, 3/4, 4, -5? c Let p be 59/(-39) - 4/26. Let m be 34(26/(-8) - -3). Let t = m + 9. Which is the second biggest value? (a) p (b) 0.4 (c) t b Let t(i) = 2i*3 - 13i*2 + 4i + 8. Let u be t(6). Let s(p) = p*3 + 3p*2 - 3p + 4. Let k be s(u). What is the third biggest value in -0.06, k, -3? -3 Let l = 0 - -5. Let z = -0.488 - -4.488. Which is the fourth biggest value? (a) z (b) 0.4 (c) l (d) -3 d Let o = 13197.07 - 13197. Let r = -1 - 1. Which is the second biggest value? (a) 0.4 (b) r (c) o (d) 4 a Let h be (-8)/(-32)42/(-10). Let q be 3/44 + 1/(-4). Which is the second biggest value? (a) h (b) q (c) -1/3 (d) 0 b Let h be (-10)/(-6)(336/30 + -10). Suppose -3z = 2z - 15. What is the second biggest value in h, z, -3? h Let w = -21.88 - -21.78. Let l = 0.6 + -1. Which is the third biggest value? (a) 0 (b) w (c) l (d) -2/17 d Let t = -748 - -749. Which is the biggest value? (a) -77 (b) t (c) 2 c Let w = 285 - 286. What is the second biggest value in 5, w, 0.27? 0.27 Let j = -5063/6 + 844. Which is the biggest value? (a) j (b) 1/8 (c) -2 (d) -25 a Let p = 1.9 + -1.876. Let z = 1.776 + p. Which is the third smallest value? (a) 2/9 (b) z (c) 0.3 b Let f = 2125 + -2124.94. What is the second biggest value in 0, f, -1/7, -4? 0 Let o = 2.2 + -2. Let d(u) = -u3 - 3u*2 - 3u - 5. Let q = 83 - 85. Let f be d(q). Which is the third biggest value? (a) f (b) -0.2 (c) o a Let s = 1.31 + -13.61. Let y = s + 13.3. Which is the third biggest value? (a) -0.4 (b) -0.1 (c) y (d) 3 b Let i = 0.109 - 0.059. Let h = 0.15 - 3.15. Let r be 1 + 0 - (-6)/(-15). Which is the second smallest value? (a) r (b) h (c) i c Let o = 62 + -251/4. Which is the biggest value? (a) 0.5 (b) 2/7 (c) o a Let d = -538 - -534. What is the second smallest value in 1/3, 12, 3, d? 1/3 Let y = 954 + -955. Which is the fourth smallest value? (a) y (b) -0.2 (c) 25 (d) -3/4 c Let v = -1.3057 + 0.9057. Let r be 9/(-7) - 4/(-14). Let m be -3 + (r - 0/2). What is the smallest value in v, -5/6, m? m Let x = -4/493 - -505/1479. Which is the fourth smallest value? (a) -2 (b) 7/2 (c) 1 (d) x b Let i = -9.2 + 22.2. Which is the second smallest value? (a) 3 (b) -2/3 (c) -24 (d) i b Let j be (-416)/80(-5)/2. Suppose -ju = 41 + 24. Let m = 4 + -2. Which is the third biggest value? (a) u (b) m (c) 0.3 a Let u = 5 + -31. Let a = -1.5 - -28. Let p = u + a. What is the second smallest value in 0.2, 3, p? p Let p = -0.8 - -4.3. Let h = p - -1.5. What is the fourth smallest value in 1/4, 0, h, 3? h Let p = -0.87 + -1.13. What is the third smallest value in p, 0.5, 0.4, -7? 0.4 Let o = 1/13 + 6/91. Let u be 2/17 - (-432)/(-1071). Let t be (-2)/7 - 32/(-14). What is the second biggest value in o, u, t? o Let s be 0 - 1 - 480/(-484). Let j = -359/484 + s. Let l = -5 + 4.9. Which is the second biggest value? (a) j (b) l (c) -5 a Let x = -0.116 - -0.0469. Let q = -4.8991 - x. Let l = q + -0.17. Which is the second biggest value? (a) l (b) 3/5 (c) 0.5 c Let j = -15.5 - -15.7. What is the third smallest value in -35, j, -1/8? j Let u(m) = m - 5. Let k be u(0). Let p be (-5)/8236/(-295). Which is the fourth smallest value? (a) -3 (b) -0.1 (c) p (d) k c Let d = -0.008 - 52.992. Let u = d + 53.2. Let y = 0.6 - 2.6. Which is the third smallest value? (a) y (b) -3 (c) u c Let y = -5.408 - -0.008. Let j = 5 + y. Let p be (-3)/3(10 - 9). Which is the biggest value? (a) j (b) p (c) 2 c Let v be 29/5 - (-5)/25. Suppose 14k + 3211 = 3225. Which is the second biggest value? (a) -0.5 (b) v (c) k c Let y = 439/550 + 1/550. What is the fourth biggest value in y, 0.5, -0.02, -4? -4 Let o be 11/(-2)(-3 - -1). Let s be ((-5)/20)/((-28)/o). Let x = -3/16 - s. Which is the second biggest value? (a) 3 (b) 0.3 (c) x b Let n be (-7)/(-10) - (-5)/(-25). Let m(q) = 5q - 33. Let t be m(6). What is the second biggest value in n, -2/23, t? -2/23 Suppose 5d - 537 = -132. Let y = 569/7 - d. Which is the second smallest value? (a) 1/3 (b) 0.2 (c) y c Let d = -37.1 + 35. Let v = d + 0.7. Let s = -1.7 - v. Which is the third smallest value? (a) 1/	{ "pile_set_name": "DM Mathematics" }
(a) 2/3 (b) 4 (c) -1.15 (d) -0.2 (e) 8 a Which is the fourth biggest value? (a) -0.3 (b) 2/5 (c) 6.8 (d) -1/5 (e) -2/3 a What is the second biggest value in -0.6, 1128, -1? -0.6 Which is the fourth biggest value? (a) -372 (b) 2 (c) -2 (d) 129 (e) 0.1 c Which is the smallest value? (a) 5 (b) -0.05878 (c) 3 b What is the biggest value in 0.2, -0.4, -2/17, 13, -5, 0.1? 13 What is the third smallest value in -2/35, 8/19, 0.2, 2/7, -5, 4? 0.2 Which is the second smallest value? (a) -2.24 (b) -1.3 (c) -4 a What is the third smallest value in 11/9, 0.5, -5, -1.644? 0.5 What is the third biggest value in 5, -8/5, 31/12, 0.4, -1/3? 0.4 What is the biggest value in -0.1, 0, 0.5, -249? 0.5 What is the third smallest value in -6/49, -1, -0.313? -6/49 What is the second biggest value in -808, 1, 769? 1 Which is the third smallest value? (a) -2/9 (b) 39 (c) -233 b Which is the fifth smallest value? (a) 5927 (b) -2 (c) -4/5 (d) 4/3 (e) 0.2 a Which is the second biggest value? (a) 344 (b) -111 (c) -0.5 c What is the third smallest value in 265, 0.4, 4/3, 27, -4? 4/3 What is the sixth smallest value in -4103, 1/3, -5, 0.5, 1/9, 0.1? 0.5 What is the biggest value in -0.5, -551, -0.2, -6? -0.2 Which is the smallest value? (a) -3 (b) 2 (c) -7544 c What is the biggest value in 0.1, -17, 13.19? 13.19 What is the biggest value in 641.91, -2, 0.02? 641.91 Which is the fourth biggest value? (a) 0 (b) 31 (c) -4 (d) -1/3 (e) 3/41 d What is the smallest value in 0.02, -0.4, -13244? -13244 Which is the fourth biggest value? (a) 1/6 (b) -4/7 (c) 264 (d) 2/9 b Which is the fifth biggest value? (a) -4 (b) 2/5 (c) -32 (d) 14/25 (e) 2 (f) -23 f What is the biggest value in 1.5467, -1.7, -1? 1.5467 Which is the second smallest value? (a) 2/7 (b) -3/2 (c) -560 (d) 5 (e) -2 (f) -0.03 e What is the fourth biggest value in 22, 1/2, -167, 0? -167 Which is the second smallest value? (a) 2/7 (b) -1598 (c) -2/9 (d) 5 (e) -1 e What is the second biggest value in -2, 0.4, 2.7, -86, -23? 0.4 Which is the second smallest value? (a) -0.07 (b) -4 (c) 0.3 (d) -7 b What is the second smallest value in 0.16, 1/6, -22/7, 2? 0.16 Which is the fourth biggest value? (a) 4/25 (b) 31 (c) 9 (d) 1 a Which is the third smallest value? (a) -12877 (b) 0.5 (c) -0.8 b What is the third biggest value in -0.03, 5/2, 5, 80? 5/2 Which is the third smallest value? (a) -3 (b) -2/11 (c) -6/7 (d) 0.5 (e) -1 (f) -3/5 c Which is the fifth biggest value? (a) 0.24 (b) 0.1 (c) -5/4 (d) 2/5 (e) -3 (f) -18 e What is the second biggest value in 0.3, -9, 2476? 0.3 What is the second smallest value in -956, 1/39, 5, 0.1? 1/39 What is the smallest value in -19.2, -50, -26? -50 Which is the fifth biggest value? (a) 7 (b) 4/7 (c) 10/13 (d) -2.2 (e) 2/7 (f) 1/3 e What is the smallest value in 39, 3, 5, -613, 8? -613 Which is the second smallest value? (a) 3 (b) -1/7 (c) 1/11 (d) -4/5 (e) 3/4 b What is the smallest value in -2, 3, 19/2857, 4? -2 What is the smallest value in 0.09, -3576, -0.1? -3576 Which is the second smallest value? (a) -0.3 (b) 1/6 (c) 2557 (d) -1/6 d What is the third smallest value in -13, -0.5, 7.5, -2/13? -2/13 What is the second smallest value in 0.4, 4, -26034? 0.4 What is the fourth biggest value in -1/2, 0, 11/6, 0.01, 6, 0.05? 0.01 What is the second biggest value in -1/452, -0.2, 0.3, -11/12, 3/2? 0.3 What is the sixth biggest value in -3.4, 0.3, -1/2, 7, 1/7, -2? -3.4 What is the fourth biggest value in -39, -14, -1/4, 8, 1/3, 2? -1/4 Which is the fourth biggest value? (a) 8 (b) -4 (c) -83 (d) 11 c Which is the fourth biggest value? (a) -0.5 (b) -2/7 (c) 280 (d) -3 d Which is the third smallest value? (a) -1/5 (b) 0.02 (c) -2739/5 (d) 1/6 (e) -0.1 e Which is the third biggest value? (a) -0.3 (b) 0.4 (c) -97/40 (d) 2 a Which is the fifth smallest value? (a) -0.5 (b) 0.012 (c) -3 (d) 0.19 (e) -5 d What is the smallest value in 2/11, 114, 8406? 2/11 What is the fifth smallest value in 1562, -4, -3/5, 0.3, -2? 1562 What is the fourth biggest value in 536, -2, 77, -1, -3? -2 Which is the biggest value? (a) -1 (b) -0.5 (c) 5 (d) -2 (e) 930 e What is the fourth smallest value in -0.15, -0.2, 51, -0.5, -3/4? -0.15 What is the second smallest value in -0.2, -20377, -0.5, 1/2? -0.5 Which is the biggest value? (a) -5 (b) 0.717 (c) 423.8 c Which is the second smallest value? (a) -184.1 (b) -33 (c) 3/4 b Which is the biggest value? (a) -0.3 (b) 4 (c) -5588 (d) 0.5 (e) -2.5 b What is the smallest value in -1.1, 5, -3.4, 1/5? -3.4 Which is the third smallest value? (a) -1/7 (b) 2/243 (c) 1191.9 c What is the smallest value in -2.4, -56/15, -2/9? -56/15 What is the second smallest value in -225, 1, 128? 1 Which is the second biggest value? (a) -0.4 (b) 139/3 (c) 204 b What is the fourth smallest value in -58, -0.06, 4/3, -1/3? 4/3 Which is the third biggest value? (a) -40.9 (b) -0.1 (c) 0.4 a Which is the second smallest value? (a) 0.2 (b) -0.19 (c) -2/9 (d) 178.4 (e) 5 (f) -2/3 c Which is the fourth smallest value? (a) 1/5 (b) -0.3 (c) -5/3 (d) 13 d Which is the biggest value? (a) 19 (b) 0 (c) 0.03 (d) -792 a Which is the second smallest value? (a) 2 (b) 10389 (c) 1 a What is the third smallest value in 1/2, -18, 1, -0.3, 24? 1/2 What is the biggest value in 4, 5, 9, 0.1, 43? 43 Which is the smallest value? (a) 1/3 (b) 365 (c) 0 (d) 11 c Which is the second biggest value? (a) -4 (b) -3 (c) 710 (d) 8 d Which is the fourth biggest value? (a) 2/13 (b) 52 (c) -2/11 (d) -4/375 c What is the second biggest value in -0.16, 7, -3426? -0.16 Which is the smallest value? (a) 7 (b) -0.374 (c) -7 (d) 0.5 c Which is the smallest value? (a) -2973 (b) 0.2 (c) -4 (d) 1/3 a What is the third smallest value in -125, 120, -2, 3? 3 What is the sixth biggest value in -94, 4, 1, -2.6, -4, 2? -94 Which is the biggest value? (a) -6/17 (b) -3 (c) 4 (d) 10/9 (e) -1/5 (f) -0.4 c What is the smallest value in -0.3, 504, -0.5, 2? -0.5 Which is the second biggest value? (a) 0.036 (b) -2 (c) 1/6 (d) -6 a What is the smallest value in 2/5, 0.49, -95, -3, -1? -95 Which is the second smallest value? (a) 536 (b) -7 (c) 0.4 (d) 0 (e) 3/5 d Which is the third biggest value? (a) -0.58 (b) -0.5 (c) 1/4 (d) -7 a Which is the smallest value? (a) 1 (b) -4 (c) -1 (d) -26 (e) 852 d What is the fourth smallest value in -0.2, 1, 0, 23, -112? 1 What is the biggest value in -3/5, -34, -10? -3/5 What is the fifth biggest value in 2, -0.66, 0.02, -3, -1/6, -36? -3 Which is the smallest value? (a) 0 (b) 0.089 (c) -66 (d) -5 (e) 4/5 c Which is the fifth biggest value? (a) -4 (b) 230/7 (c) -3 (d) 2/65 (e) 0.1 a What is the biggest value in -1/5, 1, 129, -4? 129 Which is the smallest value? (a) 0.07 (b) -5 (c) -85.89 c Which is the third biggest value? (a) 0.0057 (b) -4 (c) -0.4 (d) 3/7 (e) -6/11 c What is the second smallest value in -0.05, -2/3, 3/20, -15, 1/8, 0.1? -2/3 Which is the second biggest value? (a) -142 (b) 0.1 (c) 24 b What is the biggest value in 5, 11124, -5, 0.19? 11124 Which is the biggest value? (a) -0.4 (b) 0.5 (c) -6/119 (d) -3 (e) 1/7 b What is the third smallest value in 2, 1/14, 35589? 35589 What is the biggest value in -0.48, -1.9, 4, -103, 1? 4 What is the third biggest value in -1/3, -0.106824, 2, 0? -0.106824 What is the second smallest value in -0.27, 4, -261, -0.4? -0.4 What is the third biggest value in 4, 36, 87, -2/9, 3, -0.5? 4 Which is the second smallest value? (a) -1.6 (b) -77.7 (c) 12 a What is the second biggest value in 155, 0.1, -1/2, -1/4, -0.4, -3? 0.1 Which is the third biggest value? (a) -4 (b) 5 (c) -8/3 (d) 1/15 c Which is the third smallest value? (a) 4 (b) -0.5 (c) 0 (d) 5 (e) 35414 (f) -13 c Which is the third smallest value? (a) 1 (b) 1/2 (c) 0.018 (d) 3/7 (e) 0.06 (f) 3 d What is the biggest value in -28, 0, 5, 12, 2/7? 12 What is the third biggest value in 0.3, -2/7, 3, 334, 4/3? 4/3 Which is the third smallest value? (a) 1 (b) 369 (c) -71 (d) -0.5 a What is the second smallest value in -0.2, 8, 80, 1, 2/15? 2/15 Which is the third biggest value? (a) 0.1 (b)	{ "pile_set_name": "DM Mathematics" }
2k2 + k - 5. Suppose -5p + 5i = 10, -76p = -77p - 2i + 13. Let q(u) = 4u3 - u2 + u - 3. Calculate pa(t) - 5q(t). 4t3 - t2 - 2t Let b be 0/(6(-3)/6). Suppose b = -0v + 4v - 20. Let r(q) = 3q2 + q - 3q + 2q. Let l(s) = -2s*2. Determine vr(f) + 6l(f). 3f*2 Let o(h) = 2h + 0h - h - 2h. Let q(c) = -c*2 - 5c + 1. Suppose 0 = -3x - 3m - 15, -5x - 18 = -x + 2m. Let f be (-15)/10 - 2/x. What is fq(s) + 6o(s)? s*2 - s - 1 Let n(m) = -15m*3 + 32. Let x(q) = 29q*3 - 62. Determine 11n(v) + 6x(v). 9v3 - 20 Let z(c) be the second derivative of c4/6 - c*3 + 3c*2/2 + 151c. Let q(a) = -a + 1. Give -4q(x) + z(x). 2x*2 - 2x - 1 Let u(h) = 3h3 - 4h*2 + 3. Let w = -350 + 347. Let n(b) be the first derivative of 3b*4/2 - 7b*3/3 + 5b - 1. What is wn(x) + 5u(x)? -3x3 + x2 Let q(d) = -3 + 3d + d - 3d. Let h be q(6). Let a(n) = -4n*2 + 2n + 4. Let c(u) = 7u2 - 3u - 7. Give hc(b) + 5a(b). b*2 + b - 1 Let r(p) = 149p*3 + 2p*2 - 2p - 4. Let j(w) = 1938w3 + 27w*2 - 27w - 54. Determine -2j(g) + 27r(g). 147g3 Let j(o) = -o3 + o2 - o - 1. Let m(y) = -2y*3 + 16y*2 + 15y + 28. Let n be m(9). Let w(t) = -5t3 + 4t*2 - 6t - 5. Calculate nw(h) - 6j(h). h*3 - 2h*2 + 1 Let a(d) = 2d - 468. Let z(j) = -j + 5. Give a(o) + 4z(o). -2o - 448 Let m(k) = -k + 1. Let s = 10 - 11. Let o(d) = -7d2 - 21d + 21. Give so(g) + 21m(g). 7g2 Let n(k) = 7k - 104. Let g(i) = -6i + 103. What is -6g(c) - 5n(c)? c - 98 Let b(x) = 16x - 38. Let j(n) = 3n - 8. Determine -6b(m) + 28j(m). -12m + 4 Let v(j) be the second derivative of -29j4/12 - 17j*3/6 + 3j. Suppose 0 = 25h + 4h - 174. Let p(q) = -10q2 - 6q. Determine hv(l) - 17p(l). -4l2 Let d = 1 - 2. Let l(q) = 23q + 13. Let a(x) = -66x - 37. Let f(p) = 6a(p) + 17l(p). Let u(m) = m. What is df(z) - 6u(z)? -z + 1 Let s(n) = 2n*2 - 10n + 4. Let u be (2/(-2))/(-6) - 435/(-90). Let g(i) = -2i2 + 11i - 5. Determine us(r) + 4g(r). 2r2 - 6r Let v(w) = -35w + 480. Let t(a) = -8a + 119. What is 9t(c) - 2v(c)? -2c + 111 Let r(j) = -1 + 2j + 2 - 3. Let a(f) = -f*3 + 9f*2 - 8f + 7. Let o be ((-2)/20-12)/(6/40). Let v be a(o). Let g(q) = 3q - 3. Calculate vr(b) - 5g(b). -b + 1 Let r(b) be the third derivative of b6/120 + b5/12 - 3b4/8 - 5b*3/6 + 271b*2. Let v(s) = 2s*3 + 7s*2 - 13s - 7. Determine -7r(m) + 5v(m). 3m3 - 2m Let j = -77 + 126. Suppose -12x = -5x - j. Let r(q) = -4q3 - 5q*2 - 7. Let v(n) = -6n*3 - 7n*2 - 10. What is xr(g) - 5v(g)? 2g*3 + 1 Let p(m) = -9m*3 + 4m*2 - 2m + 8. Let y(i) = -20i3 + 9i*2 - 5i + 16. Give 9p(s) - 4y(s). -s*3 + 2s + 8 Let u(f) = 4f2 + 7f + 13. Let a(j) = 9j2 + 15j + 28. Let o(b) = 6a(b) - 13u(b). Let v(r) = -r2 + r. Give o(c) + v(c). c2 - 1 Let w(a) = 2a2 + 1. Let l(b) = b3 + 6b*2 - 4. What is -l(r) - 4w(r)? -r*3 - 14r2 Let p(q) = q2 + q + 1. Let r(u) = -5u2 - 11u - 10. Calculate -4p(o) - r(o). o2 + 7o + 6 Let u be 2/(-1)1 + (-30)/30. Let c(n) = -2n*3 - 11n + 4. Let v(o) = -o*3 - 10o + 3. Give uc(w) + 4v(w). 2w3 - 7w Let l(d) = 23d3 + d2 + 2d + 2. Let g(z) = 22z3 + 3z*2 + 3z + 3. Determine 2g(r) - 3l(r). -25r3 + 3r*2 Suppose -2t - 3o = -0o + 11, 2o + 4 = -3t. Let f(d) be the third derivative of d4/24 + d3/2 - 3d2. Let v(x) = 1. Give tf(c) - 6v(c). 2c Suppose -5m = 3k + 25, 0 = m - 2k - 8. Let j(l) = 56l*3 - 11l*2 - 11l. Let y(t) = -11t3 + 2t*2 + 2t. Give mj(r) - 11y(r). 9r3 Let z(g) = -g2 - 2g - 3. Let o(n) be the first derivative of -n*3/3 - 3n*2/2 - 4n + 116. Determine 5o(i) - 6z(i). i*2 - 3i - 2 Let d(k) be the second derivative of k*4/12 + 3k*2/2 + 4k. Let n = 592 - 590. Let f(a) = -a*2 - 1. Calculate nd(s) + 6f(s). -4s*2 Let n be (0 + 1 + -1)/(-1). Suppose 0 = -ng + 3g - 6. Let l(z) = 4z - 3z + g - 3. Let x(q) = -2q*2 + 4q - 2. Give 2l(m) - x(m). 2m*2 - 2m Let t(f) = -f*3 - 5f*2 - 6f - 2. Let i(l) = 3l3 + 11l*2 + 14l + 4. Determine -2i(u) - 5t(u). -u*3 + 3u*2 + 2u + 2 Let z(u) = -342u3 - 7u + u - 1 - 14u2 + 340u*3 - 7. Let s(n) = -4n*3 - 2n - 5n2 - 2 - 1 + 3n*3. Determine -8s(d) + 3z(d). 2d*3 - 2d*2 - 2d Let v(b) = b3 + b2 + b + 1. Let h(x) = -5x3 + 10x*2 - 6x - 6. Calculate -h(f) - 4v(f). f3 - 14f*2 + 2f + 2 Let q(m) = 2m - 8. Let n be q(6). Let f be ((-60)/(-16))/(-5)23-4. Let g(w) = 65w - 3 - fw + 4 - 6. Let s(r) = 2r + 2. Give ng(z) + 9s(z). 2z - 2 Let n(x) = -13x + 5. Let g(j) = 6j - 2. Let w(c) = 7g(c) + 3n(c). Let u be (1 + 13/(-10))(-50 - -40). Let a(k) = 3k + 1. Calculate uw(d) - 2a(d). 3d + 1 Let v(a) = -7a3 + 7a*2 + 2a - 11. Let o(k) = 17k3 - 13k*2 - 5k + 23. What is 2o(z) + 5v(z)? -z*3 + 9z*2 - 9 Let v(q) = -3q - 321. Let c(u) = 7u + 637. Calculate -4c(y) - 9v(y). -y + 341 Let u(i) = -i3 + i2 + i. Let f(g) = 87g*3 - 5g*2 - 5g + 1. What is f(m) + 5u(m)? 82m*3 + 1 Let f(x) = 20x*3 - 9x*2 + 13x - 3. Let d(n) = -10n3 + 4n*2 - 6n + 1. Give -9d(t) - 4f(t). 10t3 + 2t + 3 Let o(c) = -2c3 + 12c*2 - 6c + 30. Let h(n) = -n*3 - 2n*2 + n - 2. Give 6h(k) + o(k). -8k3 + 18 Let q(n) = -n2 + 2n + 2. Let x(a) = 2a2 - 6a - 6. Suppose -p + 8p - 21 = 0. Calculate px(h) + 10q(h). -4h*2 + 2h + 2 Let k(s) = 9s2 - 7s - 7. Let v(z) = 4z2 - 3z - 3. Let r be (-128)/(-22) + 44/242. Let w(p) = p - 12. Let d be w(r). Determine dk(o) + 14v(o). 2o2 Let k(n) = -8n*3 - 26n*2 - 13n + 73. Let y(w) = -4w3 - 12w*2 - 6w + 37. Determine 6k(p) - 13y(p). 4p3 - 43 Let q(c) = -247c + 4. Let m(s) = -5929s + 98. Give -2m(l) + 49q(l). -245l Let l(j) = 122j + 2. Let p(h) = 62h + 1. Determine -3l(w) + 7p(w). 68w + 1 Let c(r) = -4r*3 - 7r*2 - 5r - 1. Let l(a) = -a3 - a2 - a. Determine c(t) - 6l(t). 2t3 - t2 + t - 1 Let i(w) = 3w2 - w + 10. Let r(y) = 1. Determine 2i(t) - 22r(t). 6t*2 - 2t - 2 Let w(y) = 7y2 + 3y - 4. Let c = -7 + 11. Let p(g) = -2g2 - g - 2g*2 + 9g2 + g2 - 3 + 3g. What is cw(q) - 5p(q)? -2q*2 + 2q - 1 Let h be -3 + 8/1 + 0. Let d(q) = -2q3 - 3q + 1. Let i(k) = 3k3 + 5k - 2. Let f be ((-9)/12)/((-3)/12). Give fi(x) + hd(x). -x3 - 1 Let v(z) = -z2 - z - 4. Let x = 4 + 1. Let f(i) be the third derivative of 10i2 + 1/24i*4 + 5/6i*3 + 0 + 0i + 1/60i5. What is xv(m) + 4f(m)? -m2 - m Let i(b) = -6b + 21. Let z(h) = h - 2. Determine -i(n) - 4z(n). 2n - 13 Let a(d) = 4d2 + 9d - 5. Let k(t) = 9t2 + 19t - 11. Let j be 104/(-312) + 86/6 + -1. Give ja(h) - 6k(h). -2h2 + 3h + 1 Let j(l) = -2l2 - 2l. Let u(x) = -3x2 - 4x + 5. Give -4j(h) + 2u(h). 2h2 + 10 Let t(q) = 2. Let w(n) = 2n - 35. Calculate 6t(c) - w(c). -2c + 47 Let v = -216 + 219. Let p(h) = 9h + 5. Let d(z) = 3z - 1. Let j(w) = -w + 1. Let y(n) = 4d(n) + 7j(n). Calculate vp(u) - 5y(u). 2u Let w(r) = -r - 17. Let f = -1 - -1. Let s be w(f). Let m(h) = -6 - 10645820h + 3h3 + 10645820h. Let l(i) = 9i3 - 17. Determine sm(t) + 6l(t). 3t*3 Let z(f) = 21f*3 + 11f*2 - 16. Let y = 383 - 405. Let l(v) = 4v*3 + 2v*2 - 3. Determine yl(m) + 4z(m). -4m*3 + 2 Let p(z) = 11z + 2. Let m(r) = 10r + 2. Let q(v) = -4m(v) + 3p(v). Let o(h) = h + 2. Let s(w) = w + 1. Let i(k) = -o(k) + 2s(k). Give 6i(g) + q(g). -g - 2 Let b(m) = m3 + 7m*2 + 5m - 4. Let p be b(-6). Let s be -1(40/(-6) - 2/6). Let v(z) = z - 2z*2 + 0z - z2. Let x(q) = q2. Give pv(c) + sx(c). c*2 + 2c Let s be -2 - (130/39 - (-2)/3). Let i(w) = -31w3 - 11w*2. Let d(c) = 16c*3 + 6c*2. Calculate si(v) - 11d(v). 10v3 Let y(l) = -l2 - l - 1. Let u(c) = -5c2 - 21c - 3. Give u(k) - 2y(k). -3k*2 - 19k - 1 Let o(u) = 3u3 + 2u*2 - 6u - 6. Let c(a) = 6a3 + 3a*2 - 13a - 13. Calculate 6c(i) - 13o(i). -3i3 - 8i*2 Let c(f) = -3f*3 - f - 6. Suppose 21y = 19y + 6, 0 = 5b - 2y - 49. Let j(n) = 16n*3 + 4n + 31. What is bc(h) + 2j(h)? -h*3 - 3h - 4 Let z(k) be the third derivative of -k6/15 + k5/15 -	{ "pile_set_name": "DM Mathematics" }
2 + 10, -u = 0. Let b(k) be the second derivative of 0k3 + 0 + k - 1/6k*4 - rk*2. What is the derivative of b(d) wrt d? -4d Suppose -5q = -4b + 3b - 10, 18 = 3b + q. What is the third derivative of -5r2 - 37r*5 + 29r*b - 3r*2 wrt r? -480r*2 Let h be (-9 + 5 - -4) + (-2)/(-12). Let g(b) be the third derivative of -5b*2 + 0b + 1/6b3 + hb*4 + 0. What is the first derivative of g(o) wrt o? 4 Let k(g) be the second derivative of -31/30g*6 + 37/2g*2 + 0 + 0g*5 + 0g*4 + 28g + 0g3. What is the derivative of k(f) wrt f? -124f*3 Let t(k) be the first derivative of 3k7/70 + k5/30 + k*2/2 + 10. Let h(o) be the second derivative of t(o). What is the third derivative of h(p) wrt p? 216p Let o(s) = s6 + s4 - s3 - s2 - s. Let i(y) = -203y6 - y4 + y3 - 93y*2 + y. Let t(l) = -i(l) - o(l). What is the third derivative of t(b) wrt b? 24240b*3 Let b(u) be the second derivative of 36u*7/7 + 3u3 + u2 + 83u. Find the second derivative of b(l) wrt l. 4320l*3 Suppose 4a + 0t - 8 = t, 16 = 4t. Find the second derivative of 670r5 + 4r - ar - 684r*5 wrt r. -280r*3 Let p(j) = 3j*3. Let c(i) = -393i*3 + 154i*2 - 2. Let s(w) = -c(w) - 4p(w). Find the third derivative of s(q) wrt q. 2286 Differentiate 79x - 25 - 83 - 62x*4 + 60x*4 + 17x wrt x. -8x3 + 96 Find the second derivative of -37z + 3595z2 - 3391z*2 + 12 + 1 wrt z. 408 Let z = 16 - 9. Find the first derivative of 135j - 2 - z - 155j wrt j. -20 Suppose -10 = -4m + 10. Suppose 5o - 5 = m. Differentiate -1 + oi - 3i - 2 wrt i. -1 Let v(m) = 35m - 64. Let x(h) = 173h - 322. Let d(k) = 22v(k) - 4x(k). Differentiate d(y) with respect to y. 78 Let u(w) = w - 2. Let a be u(5). Let p = 213 - 208. What is the second derivative of -ac*2 + pc*2 + 8c*5 + 4c - 2c2 wrt c? 160c*3 Differentiate 19c*3 + 4c*2 - 15c*3 + 20c*3 + 44 - 2c*2 with respect to c. 72c*2 + 4c Let u be (-664)/(-136) - (-4)/34. Find the third derivative of -20b2 + ub*2 + 12b*2 + 2b*5 + 2b*5 wrt b. 240b*2 Find the first derivative of 231 + l - l - 3l - 280 wrt l. -3 Let g(z) be the second derivative of z4/2 - z3/6 - 31z2 - 37z + 2. Differentiate g(w) with respect to w. 12w - 1 Let x(s) = 131s*3 + 6s*2 - 3. Let f(m) = 130m*3 + 5m*2 - 2. Let h(w) = -6f(w) + 5x(w). What is the first derivative of h(c) wrt c? -375c*2 Suppose 0 = 6k - k - 270. Let d = k - 17. Find the second derivative of -8t4 + 37t*3 - 3t - dt3 wrt t. -96t*2 Let y(v) be the first derivative of -151v5/5 - v4/2 - 5v3/3 - 3v*2/2 - 84. What is the third derivative of y(s) wrt s? -3624s - 12 Let s(p) be the second derivative of -5p2 + 0 - 19p - 23/6p3. Differentiate s(i) wrt i. -23 Let g(p) be the third derivative of 0p*3 - 13/60p*5 + 0p*4 - 1/21p*7 + 0p*6 + 6p*2 + 0 + 0p. Find the third derivative of g(r) wrt r. -240r Let d(t) = 2t*2 - 4t - 1. Let k(j) = 952j2 + 4j - 4. Let b(s) = 2d(s) + k(s). What is the second derivative of b(q) wrt q? 1912 Let o be (-2)/1 - (0 - 4). Suppose 2l = -5w + 6, 5 = 5l + ow - 10. Find the second derivative of 8r*l - 10r - 8r3 - 8r*4 wrt r. -96r*2 Let k(r) be the first derivative of -5r9/3024 + r6/90 - 4r3/3 + 11. Let l(p) be the third derivative of k(p). Find the third derivative of l(j) wrt j. -300j2 Let x(v) be the third derivative of v6/120 - v4/12 - v3/6 - 2v2. Let m be x(-1). Find the second derivative of -y4 - 3y + 4y4 + my wrt y. 36y2 Let w = -1002 - -1002. Let o(p) be the first derivative of 0p*3 + 5/4p*4 + wp - 8 + 1/2p2. Find the second derivative of o(g) wrt g. 30g What is the third derivative of -2662p6 + 2568p*6 + 92p + 0p5 + p2 - p5 + 2p*5 wrt p? -11280p*3 + 60p*2 Let l = 38 - 34. What is the third derivative of -11o*2 + 33o*5 - lo*2 + 32o*2 wrt o? 1980o*2 Suppose -2f = f. What is the third derivative of -4q3 - 9q*2 + 4q*3 + fq*3 + 13q*4 wrt q? 312q Find the third derivative of -46o5 - 35o4 - 3 + 3 + o6 + 35o4 + 236o*2 wrt o. 120o*3 - 2760o*2 Let k = 202 + -201. Let c(q) be the first derivative of 0q + 0q2 - 5/3q*3 + 0q*5 + k + 5/6q*6 + 0q*4. What is the third derivative of c(m) wrt m? 300m*2 Let g be ((-3)/(-2))/(2/(-24)3). Let s(w) = 13w - 39. Let j(h) = -11h + 38. Let y(o) = gs(o) - 7j(o). Differentiate y(c) wrt c. -1 Let f = 22 + -45. Let k = 29 + f. Find the third derivative of 5mk + 5m*2 + 2m*6 + 10m2 - m6 wrt m. 720m3 Let y = -45 - -7. Let j = y - -40. Find the second derivative of 2g - g*2 - jg*2 + 6g*2 - 6g wrt g. 6 Let o(r) be the third derivative of -34r7/15 - r5/60 - 59r*4/12 + 53r*2. What is the third derivative of o(f) wrt f? -11424f Suppose 50 = 53u - 51u. Find the first derivative of 7 - 3 + 13 - ur2 - 4 wrt r. -50r Let z(x) be the first derivative of x*6/40 - 13x*5/60 + 6x*2 + 16. Let m(b) be the second derivative of z(b). Find the third derivative of m(p) wrt p. 18 Let v(g) be the third derivative of 0g*6 - 22g*2 + 0g*3 + 2/15g*5 + 0g - 2/21g7 + 0g*4 + 0. Find the third derivative of v(s) wrt s. -480s Suppose v = 4t - 1, -4v - 3t + 6 + 9 = 0. Find the first derivative of 0f*v - 3f*3 + 7 + 3 wrt f. -9f*2 Differentiate -4606m*2 + 9215m*2 - 4611m*2 - 710 + 156m wrt m. -4m + 156 Let g(a) be the second derivative of 0 + 23/3a*3 - 58a + 33/2a2. What is the derivative of g(v) wrt v? 46 Let i(k) be the second derivative of 0 + 0k*3 + 0k*2 + 0k*5 - 10/3k*4 + 13/30k*6 + 36k. What is the third derivative of i(u) wrt u? 312u What is the third derivative of -24p*4 + 34p*4 + 37p*4 + 17p*2 + 18p*4 wrt p? 1560p Let p(w) = 94w - 113. Let j(o) = -1. Let m(a) = -6j(a) + p(a). Differentiate m(h) with respect to h. 94 Let m = 20 - 10. Suppose 2h = -l + m - 3, -2h = 2l - 8. Find the second derivative of -hr - 5r2 + r + 7r*2 - r wrt r. 4 Find the second derivative of 523b + 535b3 + 180b - 541b3 - 9b*5 wrt b. -180b*3 - 36b Let p(y) be the third derivative of -14y2 + 0 + 0y*3 + 0y*6 + 0y + 0y4 + 2/21y*7 - 17/60y*5. What is the third derivative of p(a) wrt a? 480a Let s(v) = 322v3 - 3v - 408. Let b(x) = -323x3 + 4x + 409. Let k(i) = 3b(i) + 4s(i). Find the first derivative of k(n) wrt n. 957n2 Let u(a) be the first derivative of -20a*5 - 8a*3 - 67. What is the third derivative of u(q) wrt q? -2400q Let v(s) be the second derivative of -27s5/20 + s4/6 + 3s*3/2 - s + 86. What is the second derivative of v(z) wrt z? -162z + 4 Let f(q) = -49q3 - 17. Let v(p) = 145p*3 + 52. Let l(o) = -17f(o) - 6v(o). Differentiate l(c) wrt c. -111c*2 Suppose -3i = -x + 4, -x + i + 8 = -2x. Let j(p) = 2p + 1. Let z(a) = -5a - 3. Let o(v) = xj(v) - 3z(v). Differentiate o(n) with respect to n. 5 Let l be 15/(-30)(0 + 6). Let r(u) = -19u2 + 2u - 4. Let q(a) = 20a2 - 3a + 3. Let v(w) = lr(w) - 4q(w). Find the second derivative of v(c) wrt c. -46 Let t(k) be the third derivative of 5k4/24 - 25k3/2 - k2 + 56k. Differentiate t(g) wrt g. 5 Let c be (-24)/273/(-4). Let x(n) be the second derivative of -1/12n4 + 4n + 0n2 - cn3 + 0. Find the second derivative of x(v) wrt v. -2 Let i(t) = -t2 - 8t + 2. Let y be i(-8). Find the second derivative of 9m - ym - m2 - 2m - 6m2 wrt m. -14 What is the third derivative of 15u*2 - 10081 - 52u*3 + 10u2 + 10083 wrt u? -312 Let b(c) = c2 - 4c - 1. Let d be b(-3). Differentiate -dw*2 + 4 - 3 + 58w*2 with respect to w. 76w Let o(u) = 5u2 - 10u - 6. Let n(j) = -13 - 14 + 6j2 + 10 + 8j*2 - 29j. Let t(f) = -6n(f) + 17o(f). Find the second derivative of t(b) wrt b. 2 Differentiate 3x3 - 3x3 - x4 + 167 + 5x3 - 237 with respect to x. -4x*3 + 15x*2 What is the second derivative of -2x - 2 + 1 - 4 - 9x3 - 269x*3 wrt x? -1668x Let p(u) be the first derivative of 8u5/5 + 55u*2/2 + 2u - 33. What is the second derivative of p(z) wrt z? 96z2 What is the second derivative of -311u*4 + 3 + 157u + 155u4 + 251u*4 wrt u? 1140u**2 Let	{ "pile_set_name": "DM Mathematics" }
s prob of sequence ot? 1/102 Three letters picked without replacement from {k: 4, x: 2, t: 6, o: 3}. What is prob of sequence otx? 6/455 Three letters picked without replacement from bwbw. Give prob of sequence bww. 1/6 What is prob of sequence dd when two letters picked without replacement from {s: 1, d: 14, k: 2, f: 2}? 91/171 Calculate prob of sequence tsx when three letters picked without replacement from {x: 6, t: 1, e: 2, s: 2, b: 1}. 1/110 Two letters picked without replacement from {o: 2, m: 3, c: 3}. What is prob of sequence cc? 3/28 What is prob of sequence uq when two letters picked without replacement from tqfuvtfqfuftbquff? 9/272 Calculate prob of sequence em when two letters picked without replacement from {s: 4, e: 1, k: 3, m: 2}. 1/45 Two letters picked without replacement from cwj. Give prob of sequence wj. 1/6 Calculate prob of sequence nn when two letters picked without replacement from {z: 1, n: 19}. 9/10 Four letters picked without replacement from oooonhnoononooooooon. Give prob of sequence oonh. 91/11628 Three letters picked without replacement from yryyrrryrrrrrr. Give prob of sequence ryy. 5/91 Four letters picked without replacement from zxieqzqzqqixqq. Give prob of sequence ziqq. 15/2002 Two letters picked without replacement from nqcqcnqqkkcqkkq. What is prob of sequence qn? 2/35 Calculate prob of sequence rn when two letters picked without replacement from {j: 1, n: 5, r: 3, s: 3}. 5/44 Four letters picked without replacement from mmmmmmmmm. Give prob of sequence mmmm. 1 What is prob of sequence lhh when three letters picked without replacement from hhlll? 1/10 Calculate prob of sequence inh when three letters picked without replacement from {c: 5, h: 1, n: 6, i: 3, y: 5}. 1/380 Four letters picked without replacement from {r: 6, l: 6}. What is prob of sequence lrlr? 5/66 What is prob of sequence kejj when four letters picked without replacement from {j: 7, k: 1, i: 1, t: 10, e: 1}? 7/19380 Four letters picked without replacement from {m: 2, g: 2, x: 5, q: 3}. What is prob of sequence xqgg? 1/396 Calculate prob of sequence xx when two letters picked without replacement from xxxxxxxppxtxtxxpx. 33/68 Four letters picked without replacement from vnvnvn. What is prob of sequence vnnn? 1/20 What is prob of sequence gffy when four letters picked without replacement from {g: 7, y: 2, f: 3}? 7/990 Three letters picked without replacement from {l: 3, u: 1, k: 1, i: 1, r: 1}. Give prob of sequence ilr. 1/70 Calculate prob of sequence vzzq when four letters picked without replacement from {q: 2, v: 1, z: 4}. 1/35 Calculate prob of sequence prp when three letters picked without replacement from {e: 1, p: 2, o: 4, r: 8}. 8/1365 Calculate prob of sequence edpe when four letters picked without replacement from penpeneeedenenneeepp. 1/323 Two letters picked without replacement from {c: 1, d: 2, e: 4}. Give prob of sequence ed. 4/21 Four letters picked without replacement from {s: 1, m: 7, z: 5}. Give prob of sequence mzmm. 35/572 Four letters picked without replacement from {c: 4, d: 1, y: 4, k: 1, i: 1}. What is prob of sequence yddy? 0 Three letters picked without replacement from nxnvblj. Give prob of sequence vxl. 1/210 Calculate prob of sequence vvtx when four letters picked without replacement from vttxxttvtv. 1/84 Calculate prob of sequence maam when four letters picked without replacement from njsnnsnfsnmnsma. 0 Calculate prob of sequence os when two letters picked without replacement from {o: 2, k: 1, s: 1, d: 12, c: 2}. 1/153 Calculate prob of sequence svk when three letters picked without replacement from kossvzh. 1/105 Calculate prob of sequence jw when two letters picked without replacement from {e: 3, l: 1, w: 2, n: 13, j: 1}. 1/190 Calculate prob of sequence eeee when four letters picked without replacement from {e: 6, t: 7}. 3/143 Three letters picked without replacement from qsqcqsssqcs. What is prob of sequence qcq? 4/165 What is prob of sequence yyfy when four letters picked without replacement from {y: 11, f: 5}? 165/1456 Three letters picked without replacement from {k: 5, x: 3, f: 2}. Give prob of sequence xkk. 1/12 Two letters picked without replacement from {j: 5, l: 1, a: 1, r: 2, u: 4, w: 2}. What is prob of sequence al? 1/210 Two letters picked without replacement from eeennneneennennnnnn. Give prob of sequence ee. 7/57 What is prob of sequence sds when three letters picked without replacement from {d: 4, a: 2, s: 5}? 8/99 Four letters picked without replacement from btlolsblobll. Give prob of sequence lbst. 1/792 Two letters picked without replacement from {t: 2, l: 7, k: 4}. What is prob of sequence kk? 1/13 Three letters picked without replacement from juijg. What is prob of sequence iju? 1/30 What is prob of sequence bbs when three letters picked without replacement from sbssbss? 1/21 Three letters picked without replacement from zzmzxcxxzczxz. Give prob of sequence xzx. 6/143 Two letters picked without replacement from {a: 5, l: 7}. What is prob of sequence aa? 5/33 Calculate prob of sequence mm when two letters picked without replacement from mhhmhmhhhm. 2/15 Calculate prob of sequence zdz when three letters picked without replacement from {d: 17, z: 3}. 17/1140 What is prob of sequence ror when three letters picked without replacement from {d: 2, f: 1, o: 1, r: 2}? 1/60 What is prob of sequence evve when four letters picked without replacement from {e: 3, f: 3, v: 13}? 13/1292 Calculate prob of sequence kc when two letters picked without replacement from kckktsssscsskktkkkk. 1/19 Two letters picked without replacement from {n: 3, a: 8, q: 5}. Give prob of sequence aq. 1/6 Two letters picked without replacement from nznnzafiiian. Give prob of sequence nf. 1/33 Three letters picked without replacement from xxxxxxx. What is prob of sequence xxx? 1 Calculate prob of sequence hw when two letters picked without replacement from {w: 10, h: 2, n: 4}. 1/12 Three letters picked without replacement from {f: 1, t: 1, j: 2, w: 1, n: 1, c: 1}. What is prob of sequence twc? 1/210 What is prob of sequence uffu when four letters picked without replacement from {u: 2, f: 3, s: 3}? 1/140 Two letters picked without replacement from qqnnddnqddqqqqqnq. Give prob of sequence nd. 1/17 Calculate prob of sequence ru when two letters picked without replacement from ufurfgrffrkfru. 6/91 Four letters picked without replacement from {u: 1, i: 2, w: 3, h: 5, c: 1, n: 3}. Give prob of sequence hiwi. 1/1092 What is prob of sequence qz when two letters picked without replacement from pxpppzppzppppqp? 1/105 Calculate prob of sequence xx when two letters picked without replacement from vbbxx. 1/10 Three letters picked without replacement from {a: 6, w: 8, y: 3, o: 2}. Give prob of sequence ywa. 8/323 Calculate prob of sequence espz when four letters picked without replacement from {h: 3, f: 1, e: 3, s: 1, z: 3, p: 4}. 1/910 Two letters picked without replacement from qjdkqqj. What is prob of sequence qk? 1/14 What is prob of sequence eehh when four letters picked without replacement from {u: 1, x: 2, e: 3, d: 5, h: 8, n: 1}? 14/4845 What is prob of sequence us when two letters picked without replacement from cpcccuscc? 1/72 What is prob of sequence jccm when four letters picked without replacement from {v: 1, j: 2, c: 5, m: 1}? 5/378 Calculate prob of sequence xu when two letters picked without replacement from uuxxxxuuuxxuuxxuuxux. 5/19 Two letters picked without replacement from {l: 8, g: 2, h: 9}. Give prob of sequence hl. 4/19 What is prob of sequence jcaa when four letters picked without replacement from acccxcxjjacjajj? 5/1092 What is prob of sequence zl when two letters picked without replacement from vlsszzsssvslsvsvsvv? 2/171 Two letters picked without replacement from tggbngvtcvgb. What is prob of sequence cv? 1/66 What is prob of sequence jdjj when four letters picked without replacement from djjjddjjjjddj? 14/143 Calculate prob of sequence pu when two letters picked without replacement from uuuuuuuuuupuuuuuuu. 1/18 Calculate prob of sequence huaa when four letters picked without replacement from uquuuyhaammyuua. 1/910 Calculate prob of sequence zz when two letters picked without replacement from szwzzzzzzazzzzw. 11/	{ "pile_set_name": "DM Mathematics" }
Suppose -3g = 3y + g - d, -3g = 4y - b. Is y a multiple of 11? True Suppose -6j + 3j + 9 = 0. Is 3/1 + j - -3 a multiple of 9? True Let s = 664 - 595. Is s a multiple of 23? True Suppose 3l = r + 4l + 21, 2r + l + 44 = 0. Let f = r + 47. Is 12 a factor of f? True Suppose b - 6 = 2w - 3b, -w = 5b + 10. Let h = w + 8. Suppose -5f - 2d + 115 = hd, 2d = -2. Does 8 divide f? True Suppose 61 = 2s - 4i - 663, 3i = s - 367. Is 32 a factor of s? True Let m(q) = 12q + 16. Let x be m(8). Suppose 0 = 5s - 33 + 13. Suppose -j = sh - 15, -x = -3j - j - 3h. Does 9 divide j? False Suppose 5p + 0v = -v - 18, 4p - 5v + 26 = 0. Does 37 divide (-445)/p + 12/(-48)? True Suppose 0m + 9 = 3m, g - 5m = -12. Suppose -4i + 5 = -gi. Suppose -u + 2u + 159 = 5d, -u = id - 161. Is d a multiple of 14? False Let m = -41 + 38. Is 4 a factor of -4m/(-66) - 488/(-22)? False Let c(l) = -l3 - 9l*2 + 8l + 14. Let x be c(-10). Let j = 59 - x. Let s = j - -7. Does 18 divide s? False Suppose -13f - 2000 = -18f. Does 8 divide f? True Suppose -3o = -4r + 132, -2r + 40 = -o - 26. Suppose -3t - r = -3w + t, -5w + t = -38. Does 7 divide w? True Let o(a) = a*2 - 20 - 143a + 282a - 146a. Is 39 a factor of o(17)? False Let b = 208 - -133. Does 26 divide b? False Let z = -37 + 28. Is (-6)/z - 172/(-12) a multiple of 8? False Suppose q = 5p - 688, p = 2p + 5q - 148. Let m = 12 + p. Suppose -7g - m = -12g. Does 14 divide g? False Let z = 40 + -47. Let j = 84 - z. Is 8 a factor of j? False Let s = -5 - -7. Suppose sn - 16 = -5u, 0n - 4u - 7 = -5n. Suppose 0j = -4j - 5t + 26, j + nt = 3. Is j a multiple of 3? True Let v be 20/(-30) + (-8)/(-3). Let s = v + 1. Suppose 0 = z + b - 16, -5z + 3b + 12 = -sz. Is z a multiple of 4? True Let m(u) = 69u*2 - 48u + 24. Is 93 a factor of m(7)? True Let f be 3/18328. Let b be 7(-12)/f1. Is 7 a factor of 195/(-10)b/9? False Let w = -2 - -2. Suppose w = 2x - 1 - 5. Suppose xr - 27 = 18. Does 15 divide r? True Let m(f) = -f3 + 9f*2 + 11f - 17. Let r be m(10). Let y = 38 - r. Is 15 a factor of y? True Is (-2565)/(-75)15 - (2 - -1) a multiple of 15? True Is (-177)/236(-3639 + -1) a multiple of 14? True Let f = -24 + 43. Suppose -3 = -2u - f. Let a(c) = -c3 - 9c*2 - 10c - 6. Is 10 a factor of a(u)? True Let b(r) = -4r + 4. Let y(k) = -k + 1. Let d(x) = 5b(x) - 16y(x). Is 16 a factor of d(-11)? True Let p = 355 - 163. Is 16 a factor of p? True Let x(t) = 4t + 1. Let a be x(1). Suppose aq - n - n - 581 = 0, -q + n + 118 = 0. Let u = q + -73. Is 14 a factor of u? True Let z = -22 + 36. Suppose -4l + 17 = -3o - z, 2l - 29 = -3o. Is 10 a factor of l? True Suppose 8x = -179 + 59. Is ((-18)/x)/(14/100) a multiple of 6? True Let g be (6 - 49) + 6/2. Let j be (27/18)/(6/g). Does 19 divide 2448/45 + 4/j? False Suppose -51l + 56l - 430 = 0. Is l a multiple of 12? False Let j = 695 + -417. Is 13 a factor of j? False Let j(t) = -2t*3 - 2t + 119. Is 20 a factor of j(0)? False Let k be ((-70)/15)/(1/21). Let t = -16 - k. Is 6 a factor of t? False Let l be (3 + 0)/((30/95)/(-6)). Is (-76)/l - 239/(-3) a multiple of 23? False Let w(j) = -3j + 48. Let p be w(16). Suppose 32 = 2v - v. Let x = v + p. Does 16 divide x? True Let y(u) = -u*3 - 6u*2 + 4u + 7. Let l be (-18)/(-6) + (-1 - -3). Suppose li + 5 = -30. Does 6 divide y(i)? False Let l = -263 + 1307. Is 6 a factor of l? True Suppose 2d + 4h + h = -16, h = -2d - 32. Let o = -10 - d. Is o a multiple of 7? False Does 46 divide (6/(-5))/(36/(-5670))? False Let l(y) = -17y + 10. Is l(-1) a multiple of 2? False Is (-14 - (12 - 18))/((-1)/59) a multiple of 16? False Suppose 0 = -y - 2, 3i = -4y + 2y - 136. Suppose -2j + 6j = 2u - 36, -8 = -4j. Is (-1136)/i - (-4)/u a multiple of 11? False Let g = 27 + -22. Let w be -4 + g/((-15)/(-21)). Suppose -z + 1 = -w. Is z a multiple of 3? False Suppose -24s - 78s = -27948. Is 55 a factor of s? False Let t = -28 - -37. Suppose -tr + 106 + 29 = 0. Is 4 a factor of r? False Suppose -4x = 5j - 3176, 3x - 7x - 4 = 0. Suppose -2f - j = -2h, -4h + f + 284 + 991 = 0. Does 40 divide h? False Let r(i) = 4i. Let q be r(1). Let v be 128/22 - q/(-22). Suppose -4w - 144 = -vw. Is 18 a factor of w? True Let r(g) = -g3 + g2 - g + 44. Let f be r(0). Suppose -d = 3d - 80. Suppose 0 = t + t + 3n - f, 2n - d = -t. Does 14 divide t? True Suppose z - 4z = -5y - 8, 2y + 2 = z. Let c be 23/z4. Is 9 a factor of (-3 + 5)/(c/18)? True Let p(k) = 146k3 + k2 - 1. Let n be p(1). Let v = n - 77. Let t = -29 + v. Is t a multiple of 18? False Suppose s + 2 = 0, -29s + 28s = y - 709. Is 42 a factor of y? False Let v = -402 + 807. Does 27 divide v? True Let g = -222 - -312. Is 18 a factor of g? True Suppose 7b - 424 = 3b. Suppose bz - 32 = 105z. Is 8 a factor of z? True Let c(y) = -2y3 - 9y*2 + 10y - 95. Is 36 a factor of c(-11)? True Does 20 divide (-344)/(-258) + 5032/6? True Suppose 3u = 2s - 19, -5s - 5u = 17 - 2. Suppose 4v = 4t - 216, -t + 62 = -sv + 3v. Does 15 divide t? False Let o(a) = -3a2 - 2a + 6. Let d be o(5). Let t be 14/28(-77 - -3). Let b = t - d. Is b a multiple of 12? False Suppose 26 = 4n + 2i - 0, 0 = -n + i + 5. Suppose 2k - 48 - n = 0. Is k a multiple of 9? True Suppose 5c = -4y + 20, 0y - 5y + 4 = c. Let m be 3/c-2-12. Suppose j = 2j - m. Is j a multiple of 9? True Let i = -1043 + 1799. Is 15 a factor of i? False Let w(f) = f2 + 7f - 2. Let m(n) = n3 + n2 - 3n - 1. Let c be m(-3). Does 9 divide w(c)? False Suppose -22 + 2 = -5h. Suppose -t + 5z + 65 = -75, -t + hz = -136. Is 24 a factor of t? True Let a(f) = f*3 - 10f*2 + 7f + 13. Let g be a(9). Is 26 a factor of ((-10)/3)/(g/45)? False Let h(l) = -l*3 - 3l*2 + 4l - 4. Let u be h(-4). Is (370/u)/(-5)(9 - 3) a multiple of 37? True Suppose -2q + 12 = -2l + 3q, q = 4l - 12. Suppose -16 = -2w - l. Suppose -4r - 4s = -112, wr = 3r + 4s + 84. Does 7 divide r? True Let n be (2/(-3))/((-4)/114). Suppose nr - 475 = 14r. Is 22 a factor of r? False Suppose 0 = -4y - 2t + 7 + 7, 4y = t + 29. Suppose yg = g. Suppose g = -5b + 71 + 44. Does 10 divide b? False Suppose 307 = 2j - 29. Is j a multiple of 6? True Let v be 80/(-45) - (-8)/(-36). Let b be (-12)/(-14)(v - 5). Is -64/(-8) - b a multiple of 9? True Let w(k) = 3k*3 - 3k*2 + 4. Let c(s) = 5s*3 - 7s*2 - s + 9. Let i(f) = -4c(f) + 7w(f). Does 2 divide i(-6)? True Suppose 17g + 795 = 7969. Is g a multiple of 46? False Suppose -1261 + 37 = 8j. Let d = j + 249. Is d a multiple of 32? True Let r = 4 + -3. Let c(g) = -86g3 - g2 - 5g - 2. Let p(i) = 87i3 + i2 + 3i + 2. Let u(m) = 3c(m) + 4p(m). Is u(r) a multiple of 15? True Let h(y) = -2y*3 - 12y*2 + y + 8. Let f be h(-6). Let m(d) = 35d + 2. Is 12 a factor of m(f)? True Suppose 0k - 11 = -k. Let b be k/9 - 10/45. Let v = b - -19. Does 6 divide v? False Suppose -2j = 3j + 2760. Let a be ((-2)/(-1))/(3/j). Is 7 a factor of (-2)/7 + a/(-14)? False Let g be (1 - 0) + 0 + 1. Suppose 4 = -gl + 88. Is 6 a factor of l? True Suppose -2 = -5k + 13. Let h be k(-4)/120. Let y(f) = f + 65. Does 13 divide y(h)? True Let i be ((-70)/(-21))/((-2)/(-6)). Let o(b) = -2b - 10. Let k(d) = -6d - 29. Let n(v) = -3k(v) + 8o(v). Is 11 a factor of n(i)? False Let n = 1623 + -199. Does 8 divide n? True Suppose 3h = 3b - h - 535, 0 = -2b + 3h + 355. Suppose -x + 3j + b = -2j, j = -2x + 403. Does 40 divide x? True Let y = 1789 - 998. Is y a multiple of 30? False Suppose -10m - 911 = -4841. Is m a multiple of 4? False Let a(o) be the third derivative of -o5/60 + 7o4/24 - o3 - 3o2. Let k(c) = -c2 + 8c + 4. Let q be k(8). Is a(q) a multiple of 2? True Let m(b) = 43b2 + 8b + 7. Is 14 a factor of m(-1)? True Suppose 4a - 3z + 6z = 20, 5z - 24 = -2a. Suppose u + a = 0, -3v + 2u + 20 = v. Suppose 16 = p - 3t, vt - 103 = -4p + 3t. Is p a multiple of 7? False Suppose -5y + 3 = -4y. Suppose 4f - 68 = -m + 3f, 5f + 180 = ym. Is m a multiple of 18? False Suppose -p - 2p - 6110 = -5i, -5i + 5p = -6100. Is 35 a factor of i? True Let g(d) = 2 - 4 + 0 - 3d - 1. Is g(-6) even? False Let f = 513	{ "pile_set_name": "DM Mathematics" }
x be j(-9). Let v(s) = -3s + 0 + 4 + 2s. What is xu(a) + 2v(a)? a - 1 Let i = 35 - 39. Let t = -10 - i. Let f(j) = 3j3 + 5. Let z(a) = -4a*3 - 6. What is tf(c) - 5z(c)? 2c*3 Let y(m) = -m + 2. Let n(p) = 63p + 9. What is n(c) - 4y(c)? 67c + 1 Let m(h) = -3h2 - 4h + 5. Let s(k) = -k. Let r(f) = -m(f) - s(f). Let o(z) be the first derivative of r(z). Let x(p) = -5p - 4. Calculate 4o(w) + 5x(w). -w Let b(v) = v2 - 2v - 1. Let y(a) = 9a2 - 5a - 3. Determine 6b(g) - y(g). -3g*2 - 7g - 3 Let q = 7 + 2. Let y(v) = 13v + 11. Let s(x) = -6x - 6. Let l(h) = qs(h) + 4y(h). Let o(p) = -8 + 11 - 4. Determine l(g) - 12o(g). -2g + 2 Let z(k) = -9k3 + 3k*2 - 5k. Suppose 2a = -15 + 5. Let h be 12/a + (-14)/(-35). Let c = h - 1. Let w(o) = 5o*3 - 2o*2 + 3o. Give cz(s) - 5w(s). 2s3 + s2 Let p(y) be the first derivative of -y3/3 - y2/2 + 281. Let x(j) = 8j*2 + 6j. Calculate -6p(g) - x(g). -2g*2 Let g(h) = -17h + 105. Let b(z) = -11z + 69. Calculate -8b(o) + 5g(o). 3o - 27 Let b(o) be the third derivative of o5/6 - o4/8 - o*3/2 - 62o2. Let r(c) = -c2 - c - 1. What is -b(p) + 3r(p)? -13p*2 Let b(a) = -5a*3 + 9a*2 + 5a - 7. Let s(g) = -2g2 - g + 1. Give b(c) + 5s(c). -5c3 - c2 - 2 Let h be (-1 - 0) + -10 + 17. Let d(f) = -1. Let a(y) = 3y + 4. Determine hd(k) + a(k). 3k - 2 Let j(y) = 7y2 + 5y - 5. Suppose 5m = 2u + 15, 2m - u + 2 - 7 = 0. Let v(a) = -77a*2 - 56a + 56. Determine mv(x) + 56j(x). 7x2 Let u(w) = -5w*2 + 6w + 6. Suppose 5 = -4s + 13. Suppose 4a = -sx + 7 - 17, -a - 2 = 0. Let t(h) = -h2 + h + 1. Give xu(c) + 6t(c). -c2 Let r(x) = -2x + 7. Let l(f) = -2f + 6. Let t(p) = -4l(p) + 3r(p). Let i(y) = 9y - 13. Let q be 5/(15/(-6)) - 4. Determine qi(m) + 26t(m). -2m Let u(f) = -3f*2 + 2f - 3. Let r(n) = -7n2 + 4n - 6. Suppose 3s + 3 = m, -21m + 25m + 6 = 3s. Determine sr(g) + 5u(g). -g*2 + 2g - 3 Let x(w) = 27w + 38. Let p(t) = -13t - 18. Calculate -9p(b) - 4x(b). 9b + 10 Let u(a) = 37a + 6. Let q(o) = 18o + 4. Calculate 5q(m) - 3u(m). -21m + 2 Let i(y) = 13y2 - 13y. Let d = -247 + 236. Let m(l) = 7l2 - 7l. Determine dm(f) + 6i(f). f*2 - f Let f(a) = 15a*3 + 9a*2 + 5a - 7. Let q be (-60)/(-14) + (-4)/14. Let x(z) = 5z2 - 10z3 + z2 + 17z3 - 3 - 2z*2 + 2z. Give qf(h) - 9x(h). -3h3 + 2h - 1 Let g(i) = -7i + 2. Suppose -5c - 2s - 22 = 0, -4 + 8 = -4s. Let d(f) = 14f - 5. What is cd(j) - 9g(j)? 7j + 2 Suppose 0 = -7y + 1959 - 62. Let u(p) = -p + 272 + 3p + 7p - y. Let b(n) = 5n. What is 5b(k) - 3u(k)? -2k - 3 Suppose 3b = -5t + 14 + 7, 0 = 4b + 12. Let f(o) = 7o2 + 7o - 1. Let h(n) = -6n2 - 6n. Give th(x) + 5f(x). -x2 - x - 5 Let x(h) = h2 + 4h - 3. Let c = 27 - -7. Suppose 8 = -4j - 0. Let w be j/(-6) - (-38)/(-6). Let n(f) = 6f2 + 23f - 17. What is cx(p) + wn(p)? -2p2 - 2p Let c(o) = o - 1. Let j(a) = 8a3 + 11a*3 + 6a - 26a3 + 5a*3. What is -4c(w) + j(w)? -2w3 + 2w + 4 Let t(n) = -202n - 5. Let l(p) = -402p - 12. Determine 2l(i) - 5t(i). 206i + 1 Let a(h) = -1127h*3 - 3h. Let o(w) = 2964010w3 + 7889w. Give -7889a(k) - 3o(k). -1127k3 Let a(w) = -1. Let f(o) = o2 - 6o - 4. Let n(y) = -4a(y) + f(y). Let x(s) = s + 2. Let c be x(-5). Let h(m) = 3m. What is cn(r) - 6h(r)? -3r2 Let n = -318 - -309. Let w(q) = -14q*3 + 4q*2 - 4q + 4. Let i(y) = 29y3 - 9y*2 + 9y - 9. Calculate nw(k) - 4i(k). 10k3 Let z(l) = -15l + 33. Let f(y) = -y + 2. Let s be f(4). Let b(j) = -18j + 15. Let x(m) = -5m + 4. Let n(d) = -2b(d) + 7x(d). What is sz(q) - 33n(q)? -3q Let z(g) = -7g + 2. Let r(y) = -y + 1. Let x = 922 - 923. Determine xz(t) + 3r(t). 4t + 1 Let x(j) = j + 31264 - 31264. Let i(l) be the second derivative of -5l3/6 - l2/2 - l. Give i(a) + 6x(a). a - 1 Let l(t) = 17577t + 4t2 + 5 - 17571t + 3. Suppose 0 = -5d + 6 - 1. Let i(g) = g2 + g + 1. Determine dl(u) - 6i(u). -2u*2 + 2 Let g(w) = 1489 + 2w - 2978 + 1489. Let p(t) = 3t + 1. Give -4g(j) + 3p(j). j + 3 Suppose -10 = 2u - 4s, 3u - 2u + 3s - 15 = 0. Let t(l) = 6 - l*u - 1 - 5. Let y(w) = 2w*3 - 2. Let x be 0 + (-3 - -2)/(-1). What is xt(r) + y(r)? r*3 - 2 Let n(j) = 10j*3 + 4j*2 + 2j - 1. Let w(y) = 11y3 + 5y*2 + 3y - 1. Determine -3n(m) + 2w(m). -8m3 - 2m*2 + 1 Let n(l) = 86l*2 + 86. Let x(m) = 2m*2 + 1. Give n(i) - 86x(i). -86i2 Let u(n) be the second derivative of -n2 - 34n. Let j(p) = 11. Let r(s) = -j(s) - 6u(s). Let h(m) = m + 5. Give h(z) - 5r(z). z Let n(s) = -6s3 - 7s*2 + 39s - 5. Let i(d) = -8d3 - 11d*2 + 59d - 7. Give 5i(m) - 7n(m). 2m3 - 6m*2 + 22m Let d(y) = -7y3 + 6y*2 - 3y + 2. Let t(k) be the second derivative of k5/20 - k4/12 - 697k. Give d(q) + 6t(q). -q*3 - 3q + 2 Let g(p) be the first derivative of -9p2/2 + 7p - 3. Let f(d) be the third derivative of -d4/8 + d3/3 + 35d2. Determine 7f(b) - 2g(b). -3b Let x = 144 - 114. Suppose -27p + x = -17p. Let w(b) = -3b2 - b + 2. Let l(q) = -q3 - 5q*2 - 2q + 3. Determine pl(k) - 5w(k). -3k3 - k - 1 Let b(d) = 7d - 22d + 16d. Let j(z) = -3z. Give -7b(f) - 3j(f). 2f Let v(x) = -18x2 - 5x + 17. Let c(n) = -20n2 - 6n + 19. Give 6c(q) - 7v(q). 6q2 - q - 5 Let o(b) = -2b. Let t(i) = 26i + 24. Determine 12o(x) + t(x). 2x + 24 Let k(g) = -4g*2 + 4g + 3. Suppose -183j = -179j + 4. Let l(p) = p + 1. Determine jk(n) + 4l(n). 4n2 + 1 Suppose -b - 1999 + 1950 = 0. Let l(i) = -14i*2 + 6. Let c(g) = 112g*2 - 49. Give bl(d) - 6c(d). 14d*2 Let o be (-4)/(-62) + -32198/1302. Let j(z) = 6z3 - 4z*2 - 3z*2 + 5 + 0z*2. Let c(n) = 9n*3 - 11n*2 + 8. Determine oc(t) + 8j(t). 3t3 - t2 Let i(h) = 444h3 - 5h*2 - 5h. Let u(w) = -445w3 + 6w*2 + 6w. Determine 6i(s) + 5u(s). 439s3 Let k(o) = -6o*3 - 5o2 + 4. Let c = 31 + -21. Let g(i) = i2 - 16 + i*3 - 6 + 21. Calculate cg(b) + 2k(b). -2b3 - 2 Let s be ((-32)/24)/((-4)/42). Let y = 11 - s. Let z(m) = m2 + m. Let p(b) = -7b2 - 3b. What is yz(x) - p(x)? 4x*2 Let g(k) = 440k - 1. Let r(u) = 3u. What is -g(w) - r(w)? -443w + 1 Let x be 1-21520/(-50). Suppose -4b + 6 = t + t, -3b = 4t - x. Let l(n) = -2n2 - 2n - 3. Let d(c) = -c*2 - c - 1. Calculate td(a) - l(a). -a*2 - a Let c(n) = 2n + 47. Let o(r) = -r + 1. Give c(k) + 4o(k). -2k + 51 Let l(k) = 4k + 11. Suppose -3m + 2p + 2 = 0, 4p = 2m + 74 - 62. Let s(v) = -1. Determine ml(a) + 44s(a). 16a Let r(u) = -u*2 - 4u + 1. Let l be r(-4). Let t(z) be the second derivative of -2z5/5 + 327z. Let b(n) = n*3. Give lt(g) + 6b(g). -2g*3 Let n be -3 - (-3 - (-10 + 3)). Let y(v) = -4v*3 + 2v*2 - v. Let w(b) = 25b*3 - 13b3 - b3 - 20b3 - 3b + 5b2. Determine ny(j) + 3w(j). j3 + j2 - 2j Let u(k) = k - 3. Let x(l) = l - 2. Let m = -31 + 36. Suppose -8w + 12 = -mw. Determine wx(d) - 3u(d). d + 1 Let g(r) = -31020r3 + 242r. Let j(i) = 517i3 - 4i. Determine -2g(l) - 121j(l). -517l3 Let z(x) = 3x*3 + 2x*2 + 2x + 2. Let c be (-12 - -11)/((-3)/(-6)). Let b(o) = -35o3 - 25o*2 - 25o - 25. Give cb(i) - 25z(i). -5i3 Let f(i) = 6i*2 + 7. Let g(w) = -11w*2 - 13. Suppose -5h + 4 - 14 = -2d, 3d = 2h - 7. What is hg(t) - 7f(t)? 2t*2 + 3 Let d be (-20)/130 - 41/(-13). Let c(j) = -5 + dj + 0 + 2. Suppose u - 7 = -s, 4u + s - 6s - 1 = 0. Let t(m) = m - 1. Determine ut(x) - c(x). x - 1 Let f = 217 + -216. Let q(j) = j2 + j - 1. Let i(g) = g3 - 3g*2 - g. Calculate fi(a) + q(a). a*3 - 2a*2 - 1 Suppose 5 = 2a - 1. Suppose -3y - a = -0. Let l(j) = -j2 + j - 1. Let i(o) = -1 - o2 + 0 + 2o - 2o2 - 1. Give yi(u) + 2l(u). u2 Let s(p) = -10p*3 - 5p. Suppose -3i + 15 = -r - r, i = -r. Let u(c) = 9c*3 + 4c. Calculate rs(a) - 4u(a). -6a3 - a Suppose -4x + 15x = -33. Let h(y) = 2y - 6. Let l(m) = -2m + 5. What is xh(i) - 2l(i)? -2i + 8 Let a(d) = d + 112. Let n(h) = -37. What is -3a(x) - 8n(x)? -3x - 40 Let q(w) = w2 + 6w + 5. Let u be q(-6). Suppose 5*y + 20	{ "pile_set_name": "DM Mathematics" }
rb - 9 for n. 1 Suppose 17 = -2t + 23. Suppose -2i + 21 = l, 2i - 7l - 36 = -tl. Solve 0 = 3o - 3j - i, 3j - 2 = 4j for o. 2 Let i(l) = -130 + 61 + l + 65. Let f(c) = -4c - 4. Let d be f(-2). Let u be i(d). Solve -4r + x + 9 = u, -2r + r + 4 = -2x for r. 2 Let c = 15596 - 15593. Solve 0 = -5v + x + 27, -2v + 9 + c = -x for v. 5 Let s = -37 - -41. Suppose -7x = s - 4. Suppose 0 = 3w + 5t - 16, 4w + xt + 2 = 5t. Solve -z - 5l = -wz, 2l = -4z - 22 for z. -5 Suppose -55r = -69r + 28. Solve 8 = 4h - 2s, -rh - s = 4s + 20 for h. 0 Let u = 4 + -2. Let o = -20393 - -20404. Solve 5p + 20 = 0, -3p = um + o + 7 for m. -3 Let l be (-9 + -63)(-5)/(-4). Let j = l + 90. Solve h - 2d - 1 - 3 = 0, 3h + 2d + 4 = j for h. 0 Let p = -7 - -2. Let s be (-2)/(p - 115/(-25)). Solve -x - 3l - 12 = -2x, sl + 20 = -5x for x. 0 Let z(v) = -8v*2 - 20v + 15. Let x be z(-3). Solve -2 = 3w - 2n, 4 = -11w + 6w + xn for w. -2 Suppose 2m = 3n - 14, 2m = -5n - 2 + 4. Suppose 0 = 8w - nw + 54. Let a be (-60)/w - 8/12. Solve -2o + a = -4h - 0, -5o - 5h = 0 for o. 1 Let r be -4(-2 + -2)/8. Suppose -6 = -3q + 2b, 3b - 15 = -rb. Solve qs - 4 = -4c, 4s + 5 = 2c - 21 for c. 5 Suppose 3z = 2v - 9 + 18, 5z + 4v = 37. Let x be 52/20 + (-6)/(-15). Let i be x2/(-6)-5. Solve 0 = 2p - zj + 10, 2p + 2p + ij - 40 = 0 for p. 5 Let y = 297 + -151. Suppose 74 = -4x + y. Let h be 58/x - 16/72 - 0. Solve -4q + u + 6 = -9q, u - 10 = hq for q. -2 Let b = 129 + -117. Let z(a) = a3 - 14a*2 + 17a + 3. Let t be z(b). Let y = 100 + t. Solve -y = 3g + 4i, 0i + 2i - 3 = g for g. -5 Suppose 0 = -3q + q + 108. Suppose 0 = 14s - q - 16. Let f(n) = n*3 + 2n*2 - 2n + 5. Let c be f(-3). Solve 5p + sz + 10 = 0, 2p = -cp - 2z - 8 for p. -2 Suppose 3b = 7b - 8. Let l(k) = 11k - 5 + b - 12k + 0. Let p be l(-5). Solve -6 = s - y, s + py = -4s - 9 for s. -3 Let v = 5119 + -5119. Suppose 5j = 2d, 0j + 3d = 2j. Suppose 0 = -3w - 6, -3 - 21 = -3q + 3w. Solve jy - 2y = 6, v = -s - 2y - q for s. 0 Suppose 0 = 3b + 15, 48g + 30 = 53g + 5b. Solve -23 = 3z + 3x - 17, -z - 4x - g = 0 for z. 1 Let a = 4 + -4. Let d(v) = 5v*2 + 152v + 64. Let p be d(-30). Let o = a + p. Solve -ot = -3s + 10, t + 2t = -5s + 7 for s. 2 Let g = -59868 - -59870. Let r(b) = 3b. Let l be r(1). Solve c = -3, 4s - lc = -gc + 15 for s. 3 Let f be (-4)/6 - (-3)/((-54)/(-48)). Let k be -7(-8)/28 + -2. Solve k = -q + m + 3, -3q - f = -m - 3 for q. -1 Let q(y) = 78 + 116 - 492y + 501y - 27. Let v be q(-18). Solve -3f - 2 = -vf - x, 4f = x - 2 for f. 0 Suppose 5 + 39 = -4w. Let j(i) = -12i - 16i2 - 13 - i3 + 2 + i*2 + 2 + 3i*2. Let a be j(w). Solve -2k - 4n - 12 = 2k, an + 6 = k for k. 0 Let v be 15/(-9)(2 + 0 - 5). Suppose 0 = vz + 2p - 68, -5z + 0z + 3p = -48. Suppose zr = 18r. Solve u + 4 = -2u + 5i, r = -i + 2 for u. 2 Suppose 4i - 4f = -7f + 2, -i = 5f + 8. Suppose 8a - 13a - x + 21 = 0, 2x = ia - 6. Solve -25 = 5z - d, -2z - ad = 6 + 4 for z. -5 Let k = 0 + 0. Let q(i) = 14i + 14. Let b(u) = 57u + 54. Let h(p) = -4b(p) + 15q(p). Let g be h(-1). Solve 2f - 5z + 3z + g = k, -5f - 29 = -4z for f. -5 Let p be -35(-5)/25 - 4. Solve -py = 9, 4j - 2y + 6y = -20 for j. -2 Let j = -82 - -88. Let c(n) = -8n. Let t be c(j). Let k be 8/t + (-57)/(-18). Solve -ky + 7 = z, 6z - z + 7 = -y for z. -2 Let q(w) = -17w + 83. Let k be q(7). Let u = -34 - k. Solve -5h + 3v = -12, -h + 20 = uh - 5v for h. 0 Let h(z) = -z*2 + 24z + 29. Let v be h(25). Let p(j) = j3 - j2 - 13j + 4. Let c be p(v). Solve -2g - 7 = -y - cg, -4y + 3g + 18 = 0 for y. 3 Let p(z) = 28z + 1 + 2z2 - 17z - 6z. Let g be p(-3). Solve -4d - 9 = c + 14, 4c + 32 = -gd for d. -5 Let f(p) = 63p - 1131. Let b be f(18). Solve 5y - 43 = bk - 38, y + 4k - 1 = 0 for y. 1 Suppose 36u - 29u = 1106. Let v = 162 - u. Solve -4y = 3d - 8, -vd + 24 = -4y + d for y. -1 Let z = 1074 + -687. Let v = z + -370. Solve -3c = 2k + v, 4k - 7 = c + 6k for c. -5 Suppose -4h = -4v - 20, 27h = 2v + 23h + 14. Let d be (-1)/v + 13/(-39). Solve 5s - z + 6z + 5 = d, -2s = -4z - 4 for s. 0 Let l(z) = z3 + 4z*2 - 7z + 11. Let o be l(-5). Suppose -5s = -o - 59. Solve -s + 0 = 2h - 4p, -4h = 4p - 4 for h. -2 Suppose o - 15 = j, 142j - 145j + 39 = 4o. Solve -9u + 2w + 2 = -ou, -2w + 4 = 0 for u. -2 Let i be (342/(-152))/(2/(-16)). Suppose -5t + 28 - i = 0. Solve -14 = tl - 4o, -2o = -4l - 3o - 1 for l. -1 Let c(p) = 75p - 214. Let a be c(3). Let l be 2/(-2) + a/((-99)/(-36)). Solve lm - 4o + 5 = -3o, -3m - 15 = -3o for m. 0 Suppose -80 = -26u + 10u. Let q be -6(-4)/6 + u. Solve c = 4a - q, -a = -c - 2 - 4 for a. 1 Let v = 11759 + -11731. Solve 5d + 2u + 10 = 0, -31d + vd = 5u - 13 for d. -4 Let y be 10 + -5 + -1 + 4. Suppose yc = -40c + 96. Solve -9 = -3z - ci, -5z = -i + 5i - 17 for z. 1 Let g(l) = 36l + 220. Let q be g(-6). Let k be (5/2)/((-20)/(-40)). Solve kn - 4d = -4, 4d = -2n + 5n - q for n. -4 Let w = 9782 + -9780. Solve -10y - m - 6 = -14y, wm + 3 = -y for y. 1 Let q(f) = 9f - 21. Let m be q(4). Suppose m - 21 = -6l. Let j be l-3 + -6 + 12. Solve -h - 35 = 4i + 2h, -ji = h + 20 for i. -5 Suppose -1060 = -51x + 62. Solve 4i - 3l + 5 - 8 = 0, -x = 4i + 2l for i. -3 Let d = -5505 + 5516. Solve 0p = -3n + p + d, 2n - 5p - 16 = 0 for n. 3 Suppose 0 = -q - 0q + 8. Let w = -174 - -219. Let j be (-6)/10 - -3 - 18/w. Solve 0 = -3h - jt - 0 - q, 0 = 3h + t + 4 for h. 0 Let i = 38 + -14. Suppose 3a + i = 3b, 3b - 3a + 7a - 17 = 0. Suppose 3v = 2d - 19, 3v + b + 2 = -3d. Solve -2x = 2n + d, -x + 0 + 1 = 2n for n. 2 Let v(o) = 2o*2 + 28o. Let b be v(-14). Let i be -7 - (4 + (-3 - -1)). Let u be (-45)/i + 0 + 0. Solve b = z - ud, -4 = -4d - 0 for z. 5 Suppose -111q = -129q + 36. Solve 3h - 6h - 3 = -x, 2x - 2 = qh for x. 0 Let j(o) = -2o - 3. Let u be j(-6). Suppose -6b = -15 - u. Suppose 4v + 2f = b, -2v + 2f = -0f - 8. Solve -3n + 2k = -vk - 2, -n - 12 = 5k for n. -2 Let a be -613/(1092/(-266)). Solve -21 = 5x - t, 18 = -5x + at - 21t for x. -4 Suppose -2d - d + 5 = -4p, -2p = -d + 1. Let r(b) = -4 - 1 + 2b - d - 2. Let x be r(5). Solve -4z - 4m + 2m - 6 = x, 15 = -5m for z. 0 Let r be (-165)/55 - (1 + -8). Suppose -3f + 2k + 21 = 0, 0f - rf = -2k - 26. Let a be (-3)/(-9) + 5/3. Solve -a - 4 = 3w - 4z, -fz = -15 for w. 2 Suppose z - 513 = -5k, 5k - 5z - 189 = 3k. Let x = k - 84. Suppose -13c = -xc + 35. Solve -3u + 7 = m, m + c = u - 2 for u. 4 Let s be 10/(-2 - (-6 + 2)). Let u be 3/3(4 + (-10)/2). Let f be 2 + (6/(-18))/(u/(-3)). Solve 15 = -2r - 3j, sr - 4j - f + 4 = 0 for r. -3 Let f = -4559 - -4563. Solve ft + 12 = -w, -6 = 5t - 3t + 5w for t. -3 Let p be 1 - (-27)/(-24) - 959/(-56). Suppose 26d - pd - 45 = 0. Suppose 0c - 5c = -t - 3, -2t = 5c - 9. Solve -o = 3m - dm - 4, -m + c = o for m. -1 Suppose -18 = -3d + 24. Suppose -dc + 10 = -12c. Let o(n) = 2n*2 - 11n + 9. Let z be o(c). Solve 4a - 5g - 10 = 0, 3g - 24 = -za + g for a. 5 Suppose -173 - 86 = -18k + 155. Solve -2y - 3s = k, 4y - 25 + 36 = s for y. -4 Let o(j) = 5j - 52. Let h be o(11). Suppose hy - 6 = -3w, 0 = 6w - 4w - y + 2. Solve 2k - 3x + 5 = w, 5k - x + 19 = -0x for k. -4 Let w(c) = -3c*3 + 83c*2 + 118c + 56. Let u be w(29). Solve 0 = -2o - 2l + 16, -uo - 3l - 8 = -119o for o. 4 Suppose 0p - 39p + 5 + 1204 = 0. Solve 3c - p = 4z, -17z + 18z + 9 = c for z. -4 Let h(p) = p2 + 156p + 5603. Let d be h(-56). Solve 0 = 3c - c + 3w - 1, -w + 5 = dc for c. 2 Let d be ((-80)/104)/(-5) - ((-111)/39 - 1). Solve 0 = 2s - 2o - 8, 19s - 20s - o + d = 0 for s. 4 Let x = -148 + 167. Let l(s) = -s2 + 18s + 19. Let i be l(x). Solve i = -4k - 2g + 6, k = 6k + 5g - 5 for k. 2 Let r(b) = 2b - 83. Let j be r(18). Let u = j + 59. Solve -2x + u = -2z, -2z + z = x for z. -3 Let p be (-114)/(-513) + (4 - (-22)/(-18)). Solve d + 18r - 1 = 19r, p = -5d + r for d. -1 Let k be 190/21 + (-6)/21. Solve 3r = -ku - 32, 2r + 0r + 3*u = -23 for r. -4	{ "pile_set_name": "DM Mathematics" }
divided by 57. 55 Let t be (-14)/((-448)/144) + 2/(-4). Suppose 562 = 4w - 2p, tp - 6p + 574 = 4w. What is the remainder when w is divided by 4? 2 Let w = -159 - -153. Calculate the remainder when 316 is divided by 80/(-6 - (w + -1)). 76 Suppose -280 - 26 = -17n. Let s(r) = -28r - 4. Let f be s(-5). Suppose -3h + f = -h. What is the remainder when h is divided by n? 14 Suppose w - 2w = -46. Suppose -9d + 54 = -4d + 2z, -4z - 12 = 0. What is the remainder when w is divided by d? 10 Let y be ((-40)/10)/4 + -1 + -66. Let p = 89 + y. Calculate the remainder when p is divided by 16. 5 Calculate the remainder when 664 - (5 + 20 + -25) is divided by 49. 41 Suppose -1195 = 208d - 213d. Let q = 349 - d. What is the remainder when q is divided by 34? 8 Suppose -56y - 25y + 227286 = 0. Calculate the remainder when y is divided by 37. 31 Let p(t) = -t*3 + 11t*2 - 9t - 1. Let k be p(10). Suppose -kw - 29 = -263. What is the remainder when w is divided by 14? 12 Suppose 0 = -10d + 14d - p - 702, 330 = 2d - 4p. What is the remainder when 478 is divided by d? 124 Suppose 5t - 325 = 5f, -277f - 1 = -278f. Calculate the remainder when 6730 is divided by t. 64 Let o = 12 - 7. Suppose 4t + 5 = z - 6, 0 = ot + 5. Let w(n) = 398n + 3203. What is the remainder when w(-8) is divided by z? 5 Let g be (((-64)/6)/4)/((-4)/18). Suppose -j = -gj + 132. Let l = 5 - -17. What is the remainder when l is divided by j? 10 Suppose 2g = 7g - 20. Suppose gr = -r + 10. Suppose -2n + a = -34, -2n + 5n + ra - 44 = 0. What is the remainder when 63 is divided by n? 15 Suppose -5r + 53 = -37. Suppose 1136 = 8f - 0f. Suppose 0 = -12u + 10u + f. What is the remainder when u is divided by r? 17 Suppose -9b = -14b. Suppose -2x - 7x = b. Suppose x = -3h + 33 + 30. Calculate the remainder when h is divided by 8. 5 Let f = -1077 + 1756. Calculate the remainder when f is divided by 138. 127 Let z be ((-150)/(-6)2)/(-1). Let y = 43 - 2. Calculate the remainder when y is divided by (-240)/(-17) - z/(-425). 13 Suppose -2z + 7 = -5. Suppose 0m = 2m - 5i - 47, 4m - 4i = 112. What is the remainder when m is divided by 20/z48/20? 7 Let a = 89 - 85. Suppose 3f - 44 = -u + 77, -4f + au + 140 = 0. Let o = 96 - f. What is the remainder when 111 is divided by o? 54 Suppose -2556 = -4m + 4g, 5m - 4g + 1611 - 4804 = 0. Calculate the remainder when m is divided by 108. 97 Suppose 0 = 7g - 10g - 657. Let a = g + 248. Calculate the remainder when a is divided by 7. 1 Suppose 3t + 49 = 52. Let q = 59 - t. Suppose q = h - 50. Calculate the remainder when h is divided by 22. 20 Suppose y - 7 = 4i, 5y - 41 = 3i + 79. Let f = -92 - -227. Let g = f - 84. Calculate the remainder when g is divided by y. 24 Let f(p) = 6p - 170. Let l be f(29). Suppose 35 - 463 = -lv. Calculate the remainder when v is divided by 27. 26 Suppose 445 - 1322 = -10y + 323. Suppose -23 = -m - 0. What is the remainder when y is divided by m? 5 What is the remainder when 303/3((-312)/13 + 31) is divided by 174? 11 Suppose -443 = -33f - 1928. Let r = f + 52. Calculate the remainder when 61 is divided by r. 5 Suppose -74w - 6950 = -99w. Calculate the remainder when w is divided by 35. 33 Let k be (-7070)/15-12 + -4. Suppose -41o + k = -5o. Calculate the remainder when o is divided by 16. 13 Calculate the remainder when 117/(-13) + 7 + 2029 is divided by 35. 32 Calculate the remainder when 908 is divided by (-2889)/(-243) + 34 + 1/9. 34 Suppose 0 = -34u + 29u - 2y + 76, -2u + 5y = -13. Calculate the remainder when 2/5 + 408/5 is divided by u. 12 Let j = -3926 + 2204. Calculate the remainder when 142 is divided by j/(-72) + (-7)/(-84). 22 Let w(u) = -6u + 56. Suppose 0 = 32z + 74 + 182. Calculate the remainder when w(z) is divided by 27. 23 Let l = 139625 + -139579. Calculate the remainder when l is divided by (-94)/(-8) + (-1)/(-4). 10 Suppose -9380b = -9522b + 2982. What is the remainder when 6319 is divided by b? 19 Suppose -4v + 3i = -1186, -v + 183 = -2i - 106. What is the remainder when v is divided by 59? 6 Suppose 2o - 2k - 418 = 326, 0 = -4o - 7k + 1543. Calculate the remainder when o is divided by 66. 47 Let x(z) = z3 - 19z*2 - 22z + 50. Let m be x(20). What is the remainder when ((-1794)/115)/((-12)/m - -1) is divided by 32? 14 Let n be (-1984)/480 + 2/15. What is the remainder when 80 is divided by ((-6)/n)/(9/246)? 39 Suppose 20 = -q + 5q. Let j be 3 - 1 - 12(-18)/72. Suppose 10t - 122 = 7t - js, -2t - s = -93. What is the remainder when t is divided by q? 4 Let q(z) = -2z - 237. Let s be q(41). Let m = s - -325. What is the remainder when 56 is divided by m? 2 Let d = -111 + 146. Let p be ((-9)/(-4))/((-3)/(-24)). Calculate the remainder when (1 - 200/(-2)) + (19 - p) is divided by d. 32 Suppose 3i = -9, -q - i - 339 = -4q. What is the remainder when 139 is divided by q? 27 What is the remainder when 2011 is divided by (-35)/105 - (-138)/9? 1 Suppose 0 = 5u + 3j - 472, -549u = -553u - 4j + 360. Suppose -2p - 68 = -4p. What is the remainder when u is divided by p? 33 Suppose 3y = 2o + 117, -58y + 78 = -56y - 5o. Calculate the remainder when 419 is divided by y. 29 Let x(r) = -4r*3 - 33r*2 + 64r - 7. Suppose -4q + 5f = -2q - 30, -4q = -3f - 74. Calculate the remainder when x(-10) is divided by q. 13 Let j(q) = q3 - 4q*2 + 3q - 4. Let i be j(3). Calculate the remainder when (0 - 54/i)22 is divided by 76. 69 Let p(z) = -7 + 3z - 6z - 3z. Let l be p(-2). Suppose -ls - 10 = -7s. What is the remainder when s is divided by 4? 1 Suppose -7 + 89 = 2a. Let d = 137 - a. Calculate the remainder when d is divided by 33. 30 Suppose 0 = 32f - 30f - 8, -4f = -3s + 2210. Calculate the remainder when s is divided by 191. 169 Suppose 168o - 163o = -3u + 910, 159 = o - 4u. Suppose 15k - 6k - 423 = 0. Calculate the remainder when o is divided by k. 38 Let u = -353 + 586. Let p = -113 + u. Calculate the remainder when p is divided by 62. 58 Let j = 60 - 4. Calculate the remainder when (70 + -28 + -40)/((6/(-405))/(12/(-9))) is divided by j. 12 Suppose 35 = 3d - 2t - 8, 2t = -4d + 76. What is the remainder when 823 is divided by d? 7 Let d be 99/1328/(-1). Let v be 3(d - 4 - 6/(-9)). Let s = 42 + v. Calculate the remainder when s is divided by 6. 2 What is the remainder when 1503 is divided by 16/(-160) - 521/(-10)? 47 Suppose 1332 = 14u + 632. Calculate the remainder when 214 is divided by u. 14 Let n(q) = -q*2 + 6q - 6. Let w be n(4). Suppose -ws - 14 = -u, -u + 8s + 12 = 4s. Calculate the remainder when 57 is divided by u. 9 Calculate the remainder when ((-377)/26 + 14 - (3 - 5))26 is divided by (1 - (0 - 3))/1. 3 Suppose -7h - 4 = 4l, -2l - 10h + 8h = -10. Calculate the remainder when 7444 is divided by l. 8 Suppose -4j = -3i + 245, 4j + 55 = -i + 158. Suppose -i = -0a - 3a. Calculate the remainder when 46 is divided by a. 17 What is the remainder when 822/2 - 2592/(-324) is divided by 110? 89 Suppose -3s - 4h = -1415, -2h = 106s - 111s + 2367. What is the remainder when s is divided by 68? 65 Suppose -1861 = -4w + 3c + 2c, -4c + 2357 = 5w. Let u = w + -289. Calculate the remainder when u is divided by 46. 42 Suppose 0 = -k - 2k - 420. What is the remainder when (6/4)/((-14)/k) - 0 is divided by 3? 0 Let p(y) = y2 - 20y + 200. What is the remainder when p(39) is divided by 237? 230 Let p(q) = 67q2 + 19q + 85. What is the remainder when p(-3) is divided by 86? 29 Let i = -10 - 21. Suppose y + 3 = 3o + 42, -y + 54 = 2o. Let n = i + y. Calculate the remainder when n is divided by 4. 1 Let o = 34 - -41. Suppose 4w = -16n + 11n + o, 2w = 10. What is the remainder when 64 is divided by n? 9 Suppose 0 = -47n - 83n + 15n + 108215. What is the remainder when n is divided by 27? 23 Let t = -4 - -9. Suppose -ty - 69 = -194. Calculate the remainder when y is divided by ((-10)/(-4))/((-4950)/(-13860)). 4 Let d(f) = -21f - 313. Calculate the remainder when 129 is divided by d(-16). 14 Suppose -190c + 2337 = -22c - 1863. What is the remainder when 597 is divided by c? 22 Let m(k) = 3k*2 - 12k + 13. Suppose r - 630 = -5r. Suppose 0 = -2g + 9*g - r. Cal	{ "pile_set_name": "DM Mathematics" }
d 3:36 AM? 159 How many minutes are there between 7:40 AM and 4:59 PM? 559 What is 414 minutes before 6:07 AM? 11:13 PM How many minutes are there between 6:46 AM and 8:23 AM? 97 How many minutes are there between 4:32 AM and 8:42 AM? 250 How many minutes are there between 3:07 AM and 1:17 PM? 610 What is 353 minutes after 8:08 AM? 2:01 PM What is 467 minutes before 3:51 PM? 8:04 AM How many minutes are there between 9:39 AM and 2:41 PM? 302 How many minutes are there between 3:26 AM and 7:03 AM? 217 How many minutes are there between 6:40 PM and 12:33 AM? 353 How many minutes are there between 12:29 AM and 7:00 AM? 391 How many minutes are there between 5:08 PM and 6:24 PM? 76 What is 317 minutes after 3:54 PM? 9:11 PM What is 398 minutes before 8:41 AM? 2:03 AM What is 546 minutes before 5:20 PM? 8:14 AM How many minutes are there between 6:25 PM and 12:31 AM? 366 What is 173 minutes after 12:35 AM? 3:28 AM How many minutes are there between 3:25 PM and 10:06 PM? 401 How many minutes are there between 3:27 AM and 1:58 PM? 631 What is 685 minutes before 12:23 PM? 12:58 AM How many minutes are there between 9:54 PM and 5:27 AM? 453 How many minutes are there between 12:42 PM and 4:04 PM? 202 What is 318 minutes after 2:01 PM? 7:19 PM How many minutes are there between 2:27 AM and 5:05 AM? 158 How many minutes are there between 4:19 PM and 6:52 PM? 153 How many minutes are there between 4:51 PM and 4:31 AM? 700 What is 310 minutes after 5:55 AM? 11:05 AM What is 293 minutes after 2:21 AM? 7:14 AM What is 398 minutes after 7:36 PM? 2:14 AM How many minutes are there between 6:28 PM and 11:24 PM? 296 What is 344 minutes after 6:00 PM? 11:44 PM What is 585 minutes after 3:00 PM? 12:45 AM How many minutes are there between 11:43 PM and 10:47 AM? 664 How many minutes are there between 11:12 PM and 3:23 AM? 251 What is 591 minutes after 8:02 PM? 5:53 AM How many minutes are there between 7:40 PM and 11:44 PM? 244 How many minutes are there between 3:27 AM and 1:52 PM? 625 What is 191 minutes after 10:35 AM? 1:46 PM How many minutes are there between 3:02 PM and 7:15 PM? 253 What is 104 minutes after 5:43 PM? 7:27 PM What is 111 minutes after 4:46 PM? 6:37 PM How many minutes are there between 7:34 AM and 9:03 AM? 89 How many minutes are there between 5:59 AM and 6:37 AM? 38 What is 165 minutes before 11:20 PM? 8:35 PM How many minutes are there between 12:19 PM and 1:28 PM? 69 How many minutes are there between 10:15 AM and 5:43 PM? 448 How many minutes are there between 12:47 PM and 11:48 PM? 661 What is 88 minutes after 12:13 AM? 1:41 AM What is 530 minutes before 2:05 AM? 5:15 PM How many minutes are there between 1:05 AM and 6:33 AM? 328 How many minutes are there between 11:36 AM and 3:34 PM? 238 What is 91 minutes before 9:21 PM? 7:50 PM What is 657 minutes after 4:07 PM? 3:04 AM What is 678 minutes after 9:03 PM? 8:21 AM How many minutes are there between 8:16 AM and 3:35 PM? 439 How many minutes are there between 5:30 AM and 8:41 AM? 191 What is 321 minutes after 12:16 PM? 5:37 PM How many minutes are there between 3:59 PM and 3:20 AM? 681 How many minutes are there between 6:13 PM and 7:57 PM? 104 How many minutes are there between 12:45 AM and 1:54 AM? 69 How many minutes are there between 5:55 PM and 9:01 PM? 186 How many minutes are there between 3:02 AM and 5:37 AM? 155 What is 630 minutes after 4:29 PM? 2:59 AM How many minutes are there between 4:05 AM and 6:26 AM? 141 What is 400 minutes after 1:55 AM? 8:35 AM What is 63 minutes after 11:30 PM? 12:33 AM What is 2 minutes before 12:43 PM? 12:41 PM How many minutes are there between 10:12 AM and 9:45 PM? 693 What is 507 minutes after 7:35 PM? 4:02 AM What is 400 minutes before 7:02 AM? 12:22 AM How many minutes are there between 6:09 PM and 9:00 PM? 171 What is 302 minutes after 8:25 AM? 1:27 PM How many minutes are there between 11:20 AM and 2:49 PM? 209 How many minutes are there between 9:16 AM and 1:40 PM? 264 What is 418 minutes after 4:23 AM? 11:21 AM How many minutes are there between 7:20 AM and 7:58 AM? 38 How many minutes are there between 3:02 PM and 3:21 PM? 19 How many minutes are there between 3:05 AM and 3:15 AM? 10 How many minutes are there between 11:45 AM and 8:31 PM? 526 What is 156 minutes after 12:17 PM? 2:53 PM What is 704 minutes after 7:33 PM? 7:17 AM How many minutes are there between 3:55 AM and 3:12 PM? 677 How many minutes are there between 4:07 PM and 1:24 AM? 557 How many minutes are there between 6:02 PM and 5:51 AM? 709 How many minutes are there between 7:20 AM and 1:26 PM? 366 What is 44 minutes before 7:22 AM? 6:38 AM What is 517 minutes before 7:30 PM? 10:53 AM What is 655 minutes before 7:43 PM? 8:48 AM What is 401 minutes after 5:54 AM? 12:35 PM What is 35 minutes before 10:35 AM? 10:00 AM How many minutes are there between 1:35 AM and 7:07 AM? 332 What is 631 minutes before 11:15 PM? 12:44 PM What is 443 minutes before 8:29 PM? 1:06 PM What is 40 minutes before 12:51 PM? 12:11 PM What is 665 minutes after 3:26 PM? 2:31 AM What is 391 minutes before 12:18 AM? 5:47 PM How many minutes are there between 2:05 PM and 6:35 PM? 270 How many minutes are there between 6:05 PM and 1:13 AM? 428 How many minutes are there between 5:12 PM and 6:01 PM? 49 How many minutes are there between 5:32 PM and 7:49 PM? 137 How many minutes are there between 1:36 PM and 12:51 AM? 675 What is 20 minutes after 4:08 AM? 4:28 AM What is 705 minutes after 8:08 AM? 7:53 PM What is 62 minutes before 1:39 AM? 12:37 AM How many minutes are there between 4:13 PM and 3:31 AM? 678 How many minutes are there between 10:32 PM and 1:00 AM? 148 What is 655 minutes before 9:46 PM? 10:51 AM How many minutes are there between 7:12 PM and 7:56 PM? 44 How many minutes are there between 9:05 AM and 3:53 PM? 408 What is 33 minutes after 9:12 PM? 9:45 PM How many minutes are there between 2:27 AM and 10:20 AM? 473 How many minutes are there between 4:33 AM and 4:58 AM? 25 How many minutes are there between 1:25 PM and 5:31 PM? 246 How many minutes are there between 12:44 PM and 7:12 PM? 388 What is 324 minutes after 12:01 PM? 5:25 PM What is 9 minutes before 3:16 AM? 3:07 AM How many minutes are there between 7:27 PM and 12:18 AM? 291 How many minutes are there between 12:47 PM and 3:43 PM? 176 What is 321 minutes after 3:16 AM? 8:37 AM How many minutes are there between 12:21 AM and 11:00 AM? 639 How many minutes are there between 10:50 PM and 1:22 AM? 152 What is 104 minutes before 2:23 AM? 12:39 AM How many minutes are there between 10:48 PM and 3:14 AM? 266 What is 107 minutes before 10:51 PM? 9:04 PM What is 89 minutes after 2:12 AM? 3:41 AM What is 56 minutes before 6:50 AM? 5:54 AM What is 386 minutes after 4:14 AM? 10:40 AM How many minutes are there between 10:46 AM and 6:39 PM? 473 What is 485 minutes after 12:12 PM? 8:17 PM What is 11 minutes after 6:53 PM? 7:04 PM How many minutes are there between 5:46 PM and 3:38 AM? 592 What is 117 minutes after 1:42 PM? 3:39 PM How many minutes are there between 11:52 AM and 2:53 PM? 181 How many minutes are there between 5:34 PM and 2:08 AM? 514 What is 682 minutes after 11:29 PM? 10:51 AM How many minutes are there between 12:58 PM and 7:04 PM? 366 What is 36 minutes before 10:01 AM? 9:25 AM What is 402 minutes after 12:50 AM? 7:32 AM How many minutes are there between 6:58 PM and 9:04 PM? 126 How many minutes are there between 3:48 PM and 9:12 PM? 324 What is 702 minutes after 5:39 PM? 5:21 AM What is 255 minutes before 11:09 AM? 6:54 AM How many minutes are there between 4:32 AM and 1:39 PM? 547 How many minutes are there between 4:36 AM and 5:16 AM? 40 How many minutes are there between 8:35 AM and 2:48 PM? 373 How many minutes are there between 1:42 AM and 6:28 AM? 286 How many minutes are there between 8:39 PM and 3:47 AM? 428 How many minutes are there between 3:35 PM and 3:54 PM? 19 What is 371 minutes before 12:19 PM? 6:08 AM How many minutes are there between 10:38 AM and 1:14 PM? 156 What is 617 minutes after 5:33 PM? 3:50 AM What is 488 minutes after 8:38 AM? 4:46 PM What is 564 minutes after 10:20 AM? 7:44 PM How many minutes are there between 6:17 PM and 10:13 PM? 236 What is 607 minutes after 12:40 PM? 10:47 PM What is 40 mi	{ "pile_set_name": "DM Mathematics" }
-7. Let n = -4 - -2. Let s = -22 + 89/4. What is the nearest to s in n, v, -1? -1 Suppose -23o = -19o. Which is the closest to 0.03? (a) o (b) 2/3 (c) -1/3 a Let p be ((-6)/9)/(4/(-18)). Suppose 0 = pd + d + 8. Let v = 151/2 + -74. Which is the nearest to -3? (a) v (b) d (c) 2 b Suppose 0 = x - 5x. Suppose 2j + 2n + n + 15 = 0, x = j - 3n - 6. Which is the nearest to j? (a) -3/5 (b) -3 (c) -0.3 b Let c = 0 + 0. Let k = -0.409 + 0.009. What is the closest to c in k, -5, 2? k Let q = 0.09 - -1.91. Let h = -14.06 - -18.1. Let f = h + -0.04. What is the nearest to 1/2 in q, 0.1, f? 0.1 Let i = 22.1 + -21. Let r = 0.1 + -0.2. Let g = r + i. Which is the closest to -1/3? (a) -4 (b) -0.2 (c) g b Let g be (-454)/(-9)(-12)/(-16). Let z = g - 38. Let n = 61 + -60.9. Which is the closest to n? (a) -1 (b) 1/3 (c) z b Let o = -21104/3 - -6967. Let s = o - -67. Let t = 1 - 1.5. Which is the nearest to -1? (a) s (b) -3 (c) t a Let z = 3.8 - 4. Let j = z + 0.2. Let l = j + 0.5. What is the closest to -0.1 in l, -1, 3/7? 3/7 Suppose -15 = 3z, 0q - 5q + 30 = -3z. Let o be (-11)/(-4) - q/(-12). Which is the closest to 0? (a) o (b) 0 (c) -2/5 b Let t be 6/(-14) - 26/(-28). Which is the nearest to -1? (a) -0.3 (b) 9 (c) t a Let o = 16 + -15.9. What is the closest to 0 in o, 1/4, 3? o Let g = -16 - -16. Let x = 13 + -13. What is the closest to g in 1/2, -4, x? x Let c be ((-11)/(-33))/((-4)/(-6)). What is the closest to c in -0.5, -3, -4? -0.5 Suppose -2g + g = -3, -4r + 19 = 5g. Let f be 3/60 + 2/(-8). Which is the closest to 2? (a) f (b) -1 (c) r c Let w = -7 + -4. Let h = 12 + w. What is the closest to h in 2, 5, -0.5? 2 Let q be 1/1641. Let y = -3.6 + 0.6. Let d = y + -1. Which is the closest to 2/13? (a) d (b) q (c) -5 b Let y be -1 + ((-10)/(-18)3)/1. Which is the nearest to -0.1? (a) -6 (b) y (c) -1/8 c Let z = -0.2 + 2.2. Let a = 0.23 - 0.43. What is the closest to 0.1 in -5, z, a? a Let k = 0.06 - 1.06. Let y = 3 + k. Let d = y + -2. Which is the nearest to d? (a) 0.1 (b) 1/7 (c) -4 a Let o = -0.21 + 4.21. Let w = -0.1 - -0.1. What is the closest to -2/3 in w, 1/7, o? w Let w = -2/15 - -23/60. Which is the nearest to w? (a) -2 (b) 0.1 (c) -2/13 b Suppose -2 = -6b + 5b. Let f be (b/(-28))/(9/(-36)). What is the closest to 0.1 in 0.2, f, 1/6? 1/6 Let t = -23.2 + 23. Let y be 3/41/(-3). Which is the nearest to 2/7? (a) 0.2 (b) y (c) t a Let v = -11 - -11. Let x = -1311/7 + 187. Which is the closest to v? (a) -0.1 (b) 0.4 (c) x a Let f = 87 + -781/9. What is the closest to 0.4 in 0.2, f, 2/17? f Let n = -5.9 + 6.9. What is the closest to 3 in -5, -2/11, n? n Let s = 1.96 + 0.04. Suppose -2u + 2 = -0. What is the nearest to u in 2/7, s, -3? 2/7 Let o = -8 + 9. Let u = -2 + 1.7. What is the closest to o in u, -0.1, 1? 1 Let m be (6/9)/(6/81). Let p = -21 + m. Let u = -25/2 - p. Which is the nearest to -1? (a) 1 (b) u (c) -2 b Let z = -9 - 1. Let p = z - -10. Which is the nearest to 1? (a) p (b) -5 (c) -0.03 a Let v = 4.9 - -1.1. Let o = v - 2. Which is the nearest to o? (a) 4 (b) -2/5 (c) -2/19 a Let q be 4/6 - (1 + -1). Let s = 15 + -15. Let a = 0.23 - -0.07. What is the nearest to s in -1, a, q? a Let q = 0 + 2. Let x = -0.05 + -0.45. Which is the nearest to -3? (a) x (b) q (c) -4 c Let g = -5 - -5. Let x = 1/3 - g. Which is the nearest to x? (a) -1/6 (b) -0.1 (c) 2/7 c Let v = -4.9 - 0.1. Let q = -5.3 - v. Let h = 9 + -9. Which is the nearest to h? (a) -2 (b) q (c) -1/4 c Let v = -0.1 + 0. Let x = -4.8 + 5. Let n = -0.1 - x. Which is the closest to v? (a) n (b) -4 (c) -3/2 a Let l = -35.2 - -34.8. Let x = -2/51 - 22/17. Let s = 0.2 + -0.2. What is the closest to s in x, l, -2/7? -2/7 Let k = -24.4 + 14.1. Let t = k - -10. What is the closest to t in 3, -5, -1? -1 Let z = 0.139 - -0.061. Let v(i) = i*2 + 3i - 4. Let x be (-2)/((-2)/(-3))1. Let j be v(x). Which is the nearest to -0.1? (a) z (b) -0.3 (c) j b Let u = 37 + -37.3. Which is the closest to 0? (a) -0.8 (b) u (c) 2 b Let k = -0.002 - -0.002. Let m = -3.5 + -0.5. What is the nearest to k in 5, m, 1/7? 1/7 Let o = -0.035 - -0.135. Let x = 0.5 + -2.5. Let t = x - -2.2. Which is the nearest to o? (a) -1/4 (b) t (c) -4 b Let d = 32 + -31. What is the closest to d in 0, -2/7, 5? 0 Let y = -2/3757 + -5143311/41327. Let u(p) = 31p*2 + 1. Let i be u(-2). Let g = i + y. What is the closest to 1 in g, 2, -2/11? g Let y be 4/(-14) + (-60)/(-14). Let m be 0 - (-2 - (0 + -1)). Let h = -1.33 - -0.33. What is the closest to m in 0.3, y, h? 0.3 Suppose 2t - 4t = 12. Let m be 4/(-6) + t/(-9). Suppose -z - 2i + 2 = m, 0 = -3z - 2i - 3 + 13. Which is the nearest to 2/9? (a) z (b) -2/3 (c) -0.2 c Let t = 0.22 - -0.08. Let i = 21 + -21. Which is the nearest to i? (a) 2/7 (b) t (c) -3 a Let n = 70 + -419/6. What is the closest to 0 in 4, n, -0.5? n Let k = -249 - -429. Suppose 2d + 11 - 80 = -r, 4r - k = -5d. Let h be (d/(-40))/(1 + 1). Which is the nearest to -1? (a) h (b) 2/17 (c) 0 a Let k = 65/3 + -22. Let y = 1807/6 - 302. Let d = y + 7/12. Which is the nearest to d? (a) 1 (b) -0.2 (c) k b Let s = -0.07 + 0.47. Which is the nearest to 0.1? (a) s (b) 2/7 (c) 3 b Let n = -0.04 - -0.07. Let q = n + 1.97. What is the nearest to 1 in -1, 4, q? q Let f = -116 - -122. What is the nearest to f in -3, 5, 2? 5 Let f = 3.1 - 3. Let h be 44/(-154) + (-23)/(-7). Which is the nearest to f? (a) h (b) 0.3 (c) 4 b Let y = 111 - 186. Let p = 76.92 + y. Let g = p - -0.08. Which is the nearest to 0.1? (a) 1/5 (b) -0.2 (c) g a Let q be (-1)/5 - (-4)/(-20). Let t = 1 + -6. Let x = 10 + t. Which is the closest to q? (a) x (b) 0.3 (c) -4 b Let s = -770 - -662.06. Let m = s - -104. Let r = -0.06 + m. Which is the closest to 1/2? (a) 3 (b) -3/2 (c) r b Let p = -227/22 - -21/2. Let t be 6/(-4)(-8)/12. Suppose r + 0r - 3 = 0. What is the nearest to r in -0.4, t, p? t Let z = 3.3 - 2.3. Let a(o) = 26o. Let x be a(-3). Let t = x - -856/11. What is the closest to z in 2, -1/4, t? 2 Let q = 0.06 - 1.06. Let x = 1 + q. Which is the nearest to x? (a) -2/3 (b) 1/2 (c) 2/11 c Let a = -1 - -1. Let t = 2.9 + 0.1. Let z = 1 + t. What is the nearest to a in -0.3, z, 0? 0 Suppose g + 6 = k, -k + 0 = -2g - 8. What is the closest to g in -0.1, 3, -2? -2 Suppose 4r = -4i + 2i + 4, -r - i + 1 = 0. Let h(q) = -108q2 + q. Let p be h(r). Let k = p - -751/7. Which is the closest to k? (a) 4 (b) 2/23 (c) 0.2 c Let i be (-51)/(-45) - 3/(-15). What is the closest to -1 in 0, i, -4? 0 Let q = 0.118 - 0.076. Which is the closest to 0.1? (a) 4 (b) q (c) -2 b Let m = 0.947 - -0.053. Let n = 0.02 + 0.28. Which is the nearest to n? (a) 0.2 (b) m (c) -4 a Let c be 0/((-3 - (-1 - -2)) + 2). What is the closest to c in -0.1, -2, 1/6? -0.1 Let a = -2 - -2.2. Let c(v) = -2v + 7. Let w be c(3). What is the nearest to w in 1/4, a, -0.4? 1/4 Let u = 3.4 - 3.9. Let p = -0.1 + 0.1. Let y(s) = -s*2 + 4s + 2. Let h be y(4). Which is the nearest to p? (a) 0.1 (b) h (c) u a Let f be 10/50 + (-14)/(-30). Let i = 0.4 - 0.2. What is the closest to f in -0.3, -1, i? i Let n = -20 - -83/4. Let r = 5 - 10. Let g = -4 - r. Which is the closest to -1/2? (a) n (b) g (c) 5 a Suppose -3z + x + 9 = 0, 17 = z - 6x + x. Suppose -9 = 3m, zf + m + 8 + 1 = 0. Let y be -10f/6. Which is the nearest to y? (a) 0.3 (b) 1 (c) 2/3 a Let n = -5 + 9. Let d = -65.5 - -65. Which is the closest to -1/2? (a) 3 (b) d (c) n b Let g be (-12)/(-6)6/16. Let v = 4 + -4. Suppose v = -3n, 5n = -2o + n. Which is the closest to o? (a) g (b) 0.4 (c) 0.2 c Suppose -3g + 5s = -30, 2g + 2s + 0s - 4 = 0. Let u = -17 + 12. Let v = u - -2. Which is the nearest to 2? (a) 4 (b) v (c) g a Let x = -45 - -47. Which is the nearest to -1? (a) 3 (b) x (c) 0.1 c Let o = 1.75 + -1.73. What is the closest to 0 in o, 2, -0.2? o Suppose 9 = 7k - 4k - 5w, 0 = -k + 4w + 10. Let z be 2/3 + (-86)/96. Let a = 7/16 - z. What is the closest to a in -4/3, k, -0.5? -0.5 Let u be (3 - 7)18/8. Let l = 8 + u. Which is the closest to -0.1? (a) 1/5 (b) -0.1 (c) l b Let l = 16.6 + -18. Let d = l - -0.8. Let p = 0.2 + d. Which is the nearest to -0.1? (a) 4	{ "pile_set_name": "DM Mathematics" }
ime factors of 34028. 2, 47, 181 What are the prime factors of 29197? 7, 43, 97 List the prime factors of 22790. 2, 5, 43, 53 List the prime factors of 13620. 2, 3, 5, 227 List the prime factors of 2321. 11, 211 List the prime factors of 10492. 2, 43, 61 What are the prime factors of 178248? 2, 3, 7, 1061 What are the prime factors of 43868? 2, 11, 997 What are the prime factors of 6013? 7, 859 What are the prime factors of 67556? 2, 16889 What are the prime factors of 7937? 7937 What are the prime factors of 9587? 9587 What are the prime factors of 17950? 2, 5, 359 What are the prime factors of 1509? 3, 503 What are the prime factors of 3631? 3631 List the prime factors of 6346. 2, 19, 167 List the prime factors of 551. 19, 29 What are the prime factors of 1336? 2, 167 What are the prime factors of 6116? 2, 11, 139 List the prime factors of 1030. 2, 5, 103 List the prime factors of 3956. 2, 23, 43 List the prime factors of 121. 11 List the prime factors of 5271. 3, 7, 251 List the prime factors of 12338. 2, 31, 199 What are the prime factors of 6720? 2, 3, 5, 7 What are the prime factors of 242? 2, 11 List the prime factors of 238. 2, 7, 17 List the prime factors of 13243. 17, 19, 41 List the prime factors of 6056. 2, 757 What are the prime factors of 1174? 2, 587 List the prime factors of 6381. 3, 709 What are the prime factors of 2559? 3, 853 What are the prime factors of 1592? 2, 199 List the prime factors of 52174. 2, 19, 1373 List the prime factors of 31397. 31397 List the prime factors of 2044. 2, 7, 73 What are the prime factors of 570? 2, 3, 5, 19 What are the prime factors of 9696? 2, 3, 101 What are the prime factors of 48712? 2, 6089 List the prime factors of 5127. 3, 1709 What are the prime factors of 4804? 2, 1201 List the prime factors of 4043. 13, 311 List the prime factors of 29031. 3, 9677 List the prime factors of 19946. 2, 9973 What are the prime factors of 16709? 7, 11, 31 What are the prime factors of 38687? 11, 3517 What are the prime factors of 1705? 5, 11, 31 What are the prime factors of 470? 2, 5, 47 List the prime factors of 432. 2, 3 What are the prime factors of 3297? 3, 7, 157 What are the prime factors of 12301? 12301 What are the prime factors of 1573? 11, 13 List the prime factors of 10439. 11, 13, 73 What are the prime factors of 8598? 2, 3, 1433 List the prime factors of 46039. 7, 6577 What are the prime factors of 2718? 2, 3, 151 What are the prime factors of 39324? 2, 3, 29, 113 What are the prime factors of 17817? 3, 5939 What are the prime factors of 139? 139 What are the prime factors of 41460? 2, 3, 5, 691 What are the prime factors of 1125? 3, 5 What are the prime factors of 4903? 4903 What are the prime factors of 451? 11, 41 List the prime factors of 1574. 2, 787 What are the prime factors of 40537? 7, 5791 What are the prime factors of 4645? 5, 929 What are the prime factors of 1365? 3, 5, 7, 13 List the prime factors of 6524. 2, 7, 233 List the prime factors of 12389. 13, 953 What are the prime factors of 21629? 43, 503 What are the prime factors of 4526? 2, 31, 73 List the prime factors of 33405. 3, 5, 17, 131 List the prime factors of 1630. 2, 5, 163 What are the prime factors of 1196? 2, 13, 23 What are the prime factors of 4729? 4729 What are the prime factors of 119? 7, 17 List the prime factors of 1230. 2, 3, 5, 41 List the prime factors of 2232. 2, 3, 31 List the prime factors of 110418. 2, 3, 7, 11, 239 What are the prime factors of 10717? 7, 1531 What are the prime factors of 970? 2, 5, 97 What are the prime factors of 446? 2, 223 What are the prime factors of 2174? 2, 1087 List the prime factors of 664. 2, 83 What are the prime factors of 26330? 2, 5, 2633 List the prime factors of 5390. 2, 5, 7, 11 What are the prime factors of 37834? 2, 18917 What are the prime factors of 126494? 2, 63247 List the prime factors of 47579. 7, 971 What are the prime factors of 3326? 2, 1663 List the prime factors of 2153. 2153 What are the prime factors of 9853? 59, 167 What are the prime factors of 1669? 1669 List the prime factors of 5140. 2, 5, 257 What are the prime factors of 6576? 2, 3, 137 What are the prime factors of 9271? 73, 127 List the prime factors of 5960. 2, 5, 149 What are the prime factors of 1599? 3, 13, 41 What are the prime factors of 1013? 1013 List the prime factors of 12489. 3, 23, 181 What are the prime factors of 29283? 3, 43, 227 What are the prime factors of 220? 2, 5, 11 List the prime factors of 414. 2, 3, 23 List the prime factors of 4193. 7, 599 List the prime factors of 32742. 2, 3, 17, 107 List the prime factors of 2248. 2, 281 What are the prime factors of 1396? 2, 349 What are the prime factors of 1292? 2, 17, 19 What are the prime factors of 2267? 2267 List the prime factors of 9801. 3, 11 What are the prime factors of 873? 3, 97 What are the prime factors of 185643? 3, 20627 List the prime factors of 1119. 3, 373 List the prime factors of 6673. 6673 List the prime factors of 58907. 58907 What are the prime factors of 33425? 5, 7, 191 What are the prime factors of 17? 17 List the prime factors of 19536. 2, 3, 11, 37 List the prime factors of 19252. 2, 4813 List the prime factors of 42028. 2, 7, 19, 79 List the prime factors of 30576. 2, 3, 7, 13 What are the prime factors of 4872? 2, 3, 7, 29 What are the prime factors of 32516? 2, 11, 739 List the prime factors of 857. 857 What are the prime factors of 24566? 2, 71, 173 What are the prime factors of 1108? 2, 277 List the prime factors of 1568. 2, 7 List the prime factors of 66672. 2, 3, 463 List the prime factors of 4824. 2, 3, 67 List the prime factors of 1833. 3, 13, 47 What are the prime factors of 865? 5, 173 What are the prime factors of 67341? 3, 22447 List the prime factors of 933. 3, 311 List the prime factors of 127450. 2, 5, 2549 What are the prime factors of 93702? 2, 3, 7, 23, 97 List the prime factors of 748. 2, 11, 17 List the prime factors of 10001. 73, 137 List the prime factors of 9680. 2, 5, 11 List the prime factors of 168949. 11, 15359 What are the prime factors of 23903? 11, 41, 53 What are the prime factors of 85000? 2, 5, 17 What are the prime factors of 38404? 2, 9601 What are the prime factors of 119478? 2, 3, 19913 List the prime factors of 26177. 26177 List the prime factors of 171115. 5, 7, 4889 List the prime factors of 581. 7, 83 What are the prime factors of 821? 821 List the prime factors of 3081. 3, 13, 79 What are the prime factors of 112754? 2, 56377 List the prime factors of 6678. 2, 3, 7, 53 What are the prime factors of 85784? 2, 10723 What are the prime factors of 214? 2, 107 List the prime factors of 3385. 5, 677 What are the prime factors of 294? 2, 3, 7 List the prime factors of 45374. 2, 7, 463 What are the prime factors of 36192? 2, 3, 13, 29 List the prime factors of 649. 11, 59 List the prime factors of 1667. 1667 What are the prime factors of 4077? 3, 151 List the prime factors of 382. 2, 191 List the prime factors of 21927. 3, 7309 What are the prime factors of 251? 251 List the prime factors of 8130. 2, 3, 5, 271 List the prime factors of 4838. 2, 41, 59 List the prime factors of 6097. 7, 13, 67 List the prime factors of 1503. 3, 167 What are the prime factors of 877? 877 List the prime factors of 51440. 2, 5, 643 What are the prime factors of 17510? 2, 5, 17, 103 List the prime factors of 511. 7, 73 List the prime factors of 44892. 2, 3, 29, 43 What are the prime factors of 3288? 2, 3, 137 What are the prime factors of 86181? 3, 23, 1249 List the prime factors of 44212. 2, 7, 1579 List the prime factors of 475. 5, 19 List the prime factors of 2820. 2, 3, 5, 47 List the prime factors of 88763. 37, 2399 List the prime factors of 46029. 3, 67, 229 What are the prime factors of 1952? 2, 61 List the prime factors of 65756. 2, 17, 967 List the prime factors of 5866. 2, 7, 419 List the prime factors of 3821. 3821 What are the prime factors of 2063? 2063 List the prime factors of 21630. 2, 3, 5, 7, 103 What are the prime factors of 15216? 2, 3, 317 List the prime factors of 2192. 2, 137 What are the prime factors of 113? 113 What are the prime factors of 8820? 2, 3, 5, 7 What are the prime factors of 375? 3, 5 List the prime factors of 721. 7, 103 List the prime factors o	{ "pile_set_name": "DM Mathematics" }
, 11, 53 Let b = -70 - -50. Let o = b - -85. List the prime factors of o. 5, 13 Let c be 192/20 - (-3)/(-5). Suppose cn - 10n = -41. List the prime factors of n. 41 List the prime factors of (-1844)/(-6) - (-7)/(21/2). 2, 7, 11 List the prime factors of (-5)/(5/(-476)) - -5. 13, 37 Suppose -2l + 8l = 18. Suppose -5n - 18 = -4n + lz, 3z = 4n + 87. What are the prime factors of 480/72n/(-2)? 2, 5, 7 Let a(v) = -v*2 - 9v - 14. Let c be a(-7). List the prime factors of (c + 4 + -3)15. 3, 5 Suppose -5o - j = -2j - 13, -4o + 11 = -j. Suppose oz + 2r = -3z + 121, -3z + r = -66. Suppose 19b - zb = -120. List the prime factors of b. 2, 3, 5 Let m = 417 + -10. What are the prime factors of m? 11, 37 Suppose -39y - 11016 = -51y. List the prime factors of y. 2, 3, 17 Let n(z) = 23z2 + 16z + 36. List the prime factors of n(-4). 2, 5, 17 Let k(l) = l*2 - 9l + 3. Let a be k(9). Suppose -4y - 49 = -ay. List the prime factors of (-105)/y - 1/7. 2 Suppose 0 = -40s - 4883 + 12283. List the prime factors of s. 5, 37 Let t = 22 + -10. Suppose 2r - v + 12 = 0, -r + 0v - t = v. Let w = r + 11. What are the prime factors of w? 3 Let g(n) = 2n*2 + n - 5. Let a be g(-10). Let p = 265 - a. List the prime factors of p. 2, 5 Let m = -8 - -13. Suppose -282 = -8a + ma. List the prime factors of a. 2, 47 What are the prime factors of 9993((-33)/(-45) - 12/30)? 3331 Let u(g) be the second derivative of g*3/3 + 11g*2/2 + 2g. Let p(m) = 5m + 22. Let l(f) = -3p(f) + 7u(f). List the prime factors of l(-8). 19 Let u = -134 + 1788. What are the prime factors of u? 2, 827 List the prime factors of 12/10 + (-15)/((-525)/22393). 641 Suppose 4l = 2h - 160, -l - 2l = 4h - 287. Let y = 48 + h. List the prime factors of y. 2, 61 Let k(j) be the third derivative of 7j*2 - 11/24j*4 + 0j + 1/60j5 - j3 + 0. What are the prime factors of k(13)? 2, 5 Let i(b) = 126b - 96. What are the prime factors of i(13)? 2, 3, 257 Let k be (-2)/(-6) + 50/(-15). Let i(z) = -8z2 - 2z - 9. Let h(f) = -f*2 - 1. Let l(d) = 14h(d) - 2i(d). List the prime factors of l(k). 2, 5 Let v(x) = 3x*2 + 12x. Let c(i) = -i + 1. Let t(k) = 5c(k) + v(k). What are the prime factors of t(-3)? 11 Suppose -2u + 3q + 1468 = 0, 56q - 3670 = -5u + 53q. List the prime factors of u. 2, 367 Suppose -i - 2543 = -w, w + 2i - 2729 + 198 = 0. What are the prime factors of w? 2539 List the prime factors of (-1 - -3) + -2 + (345 - 2). 7 Suppose -2g - 5c + c = -138, 4g - 276 = 3c. Suppose -3r - g = -222. List the prime factors of r. 3, 17 Let h(t) = 7t2 + 4t - 40. What are the prime factors of h(6)? 2, 59 Let i(q) = 24 - 5q2 - 8 - 15 + 3q3 - q3. What are the prime factors of i(4)? 7 Suppose -5c = 5m, 6c - 9c = -3m. What are the prime factors of (1 - 180)/(-1 + m)? 179 Let q(a) = -464a - 5. List the prime factors of q(-1). 3, 17 Suppose 0 = -3g - 0 + 3, 4u = 5g + 235. Suppose -3r = q - 19, u = 3q + q + 4r. List the prime factors of (-3 - -2) + q - 1. 11 Suppose -41n = -34n - 532. List the prime factors of n. 2, 19 Suppose -4d + 80 = -0d. Suppose d = -4l, 3f - 80 = -2l - 0l. Suppose 4q - 3o = -o + 10, 2q = -4o + f. List the prime factors of q. 5 Suppose 0 = 3r - 28 + 4. Suppose 25 = -5w + 2b, -3b + 20 = w + r. List the prime factors of (-2)/3 + (-77)/w. 5 Suppose 2 = -o - 0o - 3g, -2o = -3g - 14. Suppose -28 = ot - 8t. Let w = 14 + t. What are the prime factors of w? 3, 7 Let v = 9 + -7. Suppose c - 80 = -3q, vq - 9 - 37 = 3c. Let f = q + 3. List the prime factors of f. 29 Let w = -95 + 98. Suppose -5h + 260 = 3m, 4h + wm + 49 = 254. What are the prime factors of h? 5, 11 Let g(z) = -z2 - 10z + 21. Let b be g(-10). Let k = -19 + b. Suppose -v - 18 = -kv. What are the prime factors of v? 2, 3 Let n(a) = -a + 8. Let d(t) = -t3 - 4t*2 + t + 6. Let h be d(-3). Let p be 36/(-8)4/h. List the prime factors of n(p). 5 Let d = -1040 - -1973. What are the prime factors of d? 3, 311 Suppose -139f + 127f + 21288 = 0. What are the prime factors of f? 2, 887 Let u(w) = -w*3 + 6w*2 + w + 12. Let g(s) = 4s + 10. Let n be g(6). Suppose -4y - 14 = -n. What are the prime factors of u(y)? 2, 3, 7 Let c(j) = -j3 - j2 + 3j. Let i be c(0). Suppose 2p - 192 = -ip. List the prime factors of p. 2, 3 Suppose 6a - 1802 = 148. List the prime factors of a. 5, 13 Suppose 6 = -c - 6. Let h = c - -8. What are the prime factors of (-10)/h(-344)/(-20)? 43 Let a(k) = 9k2 - 26k - 2. Let v(o) = -2o2 + 5o + 1. Let l(u) = a(u) + 4v(u). Let w = -9 - -4. List the prime factors of l(w). 3, 19 Let s be (-4011)/42(1-1 + 3). Let d = -76 - s. List the prime factors of d. 5, 23 Suppose 5c = -49 - 11. Let k(a) be the second derivative of -a*3/6 + 15a*2/2 - 17a. List the prime factors of k(c). 3 Suppose a - 4i + 13 = 0, 9a = 4a - 3i - 157. Let g = 38 + a. What are the prime factors of g? 3 What are the prime factors of (-98595)/(-126) + 2/4? 3, 29 Let d(m) = 31m + 57. Let n(y) = -21y - 38. Let c(k) = 5d(k) + 7n(k). Let b be c(-9). List the prime factors of b/2(-13 - -11). 53 Let q(g) be the third derivative of -g5/60 - 29g*4/24 + 2g*3/3 - 4g*2 - 2g. What are the prime factors of q(-20)? 2, 23 Suppose -6 = -2p + 2. Suppose 5n - 65 = -3l + 121, 2n - pl - 90 = 0. What are the prime factors of n? 3, 13 Suppose 0 = 5y - h - 18, -4y = 2h + 5 - 25. Suppose -5q - 485 = -yb, 3b + q = -3q + 325. List the prime factors of b. 5, 23 Let o(l) = -l*2 + 6l - 12. Let c be o(8). Let v = -32 - c. Let t(s) = 4s2 + 7s + 10. List the prime factors of t(v). 2, 23 Suppose -v = -3 + 1. Let y be (28/8 + -4)/((-2)/8). Let s = v + y. List the prime factors of s. 2 Let v(x) = -25x - 10. Let q be v(-6). Let y = q + -70. What are the prime factors of y? 2, 5, 7 Let g(t) be the third derivative of 0 + 1/6t*4 + 0t - 2t3 - 4t*2. List the prime factors of g(6). 2, 3 Let o(f) = -64f*3 - 3f*2 + f + 4. Let b(m) = -65m*3 - 2m*2 + m + 3. Let i(r) = 4b(r) - 3o(r). List the prime factors of i(-1). 2, 17 Let j be (4 + 1)/(7/21). Suppose jy - 11y = 188. Suppose 2d - y = -8t + 3t, -80 = -3d + 2t. List the prime factors of d. 2, 13 Suppose -26 = -3o - 2p + 25, -5o = 2p - 81. Let c(l) = -l*3 + 14l*2 + 9l - 15. Let m be c(o). Let d = m + 156. List the prime factors of d. 3, 17 Let y = -492 + 934. List the prime factors of y. 2, 13, 17 Suppose 0m - 6 = -3m. Let l = 14 + m. Suppose l = n + 4n + 3r, 3n + 5r - 16 = 0. List the prime factors of n. 2 Suppose -3v + 3554 = 4s, 0 = -2v + 2 + 2. What are the prime factors of s? 887 Let x(q) = q3 + q2 - 2q + 353. What are the prime factors of x(0)? 353 Let w(o) = -211o - 301. List the prime factors of w(-7). 2, 3, 7 Let i(z) = -z3 + 8z*2 + 12z - 17. Let r be i(9). Suppose -rt - 125 = -15t. What are the prime factors of t? 5 Let x(a) = 21a2 - 5a + 4. Let o(j) = -20j2 + 6j - 5. Let f(u) = 3o(u) + 4x(u). Suppose 0 = 2h - 5h + 3. What are the prime factors of f(h)? 23 Suppose -5c = 126p - 124p - 14163, 2c - 5p = 5671. List the prime factors of c. 2833 Let o(b) = 52b + 8. What are the prime factors of o(2)? 2, 7 Suppose 2a = -a + 798. Suppose 3f + a = 5f. List the prime factors of f. 7, 19 Let i = -242 - -343. Let u = i + -54. Suppose 0 = -o - 0o + u. List the prime factors of o. 47 Let d be ((21/(-7))/(-3))/((-1)/(-3)). List the prime factors of 56/d15/82. 2, 5, 7 Suppose s = -2s - 4t - 22, -s - 4t = 10. List the prime factors of ((-620)/12 + -3)/(s/9). 2, 41 Suppose -25k + 22 = -24k. Suppose 347 = 3r - 4j, -20r - 231 = -kr + 3j. List the prime factors of r. 3, 13 Let u(a) = -5a3 - 2a*2 + 2a - 1. Let d be u(1). Let n be (8/d)/((-9)/27). Suppose 0 = 3x - 6, ny - 7y - 5x + 19 = 0. List the prime factors of y. 3 Let q = 7 + -4. Suppose t = 5c - 52, 0 = -qt - 2t - 10. Let p = -6 + c. List the prime factors of p. 2 Let b = -39 - -42. Let x(k) = 3k*2 - 3. Let z be x(b). What are the prime factors of (z/(-10))/((-63)/210)? 2 Let r be 24/(-20) - (-2)/10. Let p be (r - -2)/(9/36). Suppose 9f = p*f + 70. What are the prime factors of f? 2, 7 Let f = 63 - -192. What are the prime factors of f? 3,	{ "pile_set_name": "DM Mathematics" }
2py2 + 208b*2y*2 + 103bpy + 243by*2 + by - ip wrt b. -8i + 6py*2 + 416y*2 Find the third derivative of -45896204v*3 - 33058505v*2. -275377224 Find the third derivative of 11937717u*6 - 8620075u*2. 1432526040u*3 What is the second derivative of -20357832k*2 - 15792381k? -40715664 What is the first derivative of -12r3 - 1970567r*2 + 17r - 36208029? -36r2 - 3941134r + 17 What is the second derivative of -194771b2l*3 + 3b*2l - 3b2 - 209bl - 24b + 359l3 + 15l - 4 wrt l? -1168626b2l + 2154l Find the second derivative of 3997p*5 + 1783p*3w + 4pw + 10p + 2196w + 1 wrt p. 79940p3 + 10698pw What is the first derivative of 2m*3 - 329m*2 + 550m - 2839648 wrt m? 6m2 - 658m + 550 What is the third derivative of 38cy*3 + cy*2 - 3cy - 132812y*3 - 1512336y wrt y? 228c - 796872 What is the second derivative of 4562v*4 + 2v*3 + 34v*2 - 123414v - 57? 54744v2 + 12v + 68 Differentiate -16827542z4 - 12216433. -67310168z*3 Differentiate 15535l*2u + 154lu*3 + 1209u*3 + 10u*2 + 6u - 3 with respect to l. 31070lu + 154u3 Find the third derivative of -g3t*3 + 2350348g*3t - 2g2t + 2gt*3 + 2158070gt2 + 2t*3 wrt g. -6t*3 + 14102088t What is the second derivative of 39533495a2 + 84831191a wrt a? 79066990 What is the derivative of 393401872ru + 119572134u wrt r? 393401872u Find the second derivative of -90337853k2r + 2kr + 2965k - 4r - 1437 wrt k. -180675706r What is the second derivative of 8g*3x*3 - 3g*3x*2 + 2g*3x - 290g3 - 4149g*2 - 169gx2 - x wrt x? 48g*3x - 6g3 - 338g Differentiate -48839853b4 + 735592670. -195359412b*3 What is the second derivative of -2cp3 - 2cp2 + 2cp + 58797c + 372083p3 + 10p wrt p? -12cp - 4c + 2232498p What is the third derivative of 2m4 + 32858719m*3 - 57485608m*2 wrt m? 48m + 197152314 Find the third derivative of 9n2o*4 + 4241088n*2o*3 + 17n*2o*2 - 24n*2o + 19no*2 + 5o + 123 wrt o. 216n2o + 25446528n2 Find the third derivative of -27587266u*5 + 3u*2 + 1268942u + 3. -1655235960u2 Differentiate -188259684c*3w + 103905721c3 with respect to w. -188259684c*3 What is the first derivative of 5930739h - 28373013 wrt h? 5930739 What is the second derivative of -179k3 + 708877k*2 + 2k + 327941498? -1074k + 1417754 Differentiate -266468g*2 - 3552810 wrt g. -532936g Find the first derivative of -16755940o2 - 2065682. -33511880o What is the first derivative of -397935111kp*2x*2 + kp*2x + 124p2x*2 - 2px2 - 84px - 19x + 19 wrt k? -397935111p2x2 + p2x What is the second derivative of -4752p*3 + 4480p*2 - 2233139p + 17? -28512p + 8960 What is the third derivative of 206q*6 - 26211q*4 - 2q*3 + 67q*2 + 40271q? 24720q3 - 629064q - 12 Find the third derivative of -6237190l3x + 3l2x - 1547830lx wrt l. -37423140x Find the first derivative of -3x*4 - 2x*3 + 4417747x - 84430398. -12x3 - 6x*2 + 4417747 What is the derivative of -434191701j - 211508483 wrt j? -434191701 What is the second derivative of 65356fv*2 - 17fv + 15v*2 - 17629v wrt v? 130712f + 30 Differentiate 97i*2j*3 + 233i*2j + 99i2 - ij + 28i + 461 with respect to j. 291i*2j*2 + 233i*2 - i Find the second derivative of -22h*2kw - 5h*2k - 140h2w*2 - 2189h*2w + 1196hkw2 + 13hw2 - 8hw + 1 wrt w. -280h*2 + 2392hk + 26h What is the derivative of 9b4 + 6373b*2 - 1145938 wrt b? 36b*3 + 12746b Find the third derivative of -9117ab*3i*4 - 4ab3i + abi*2 - 2b*3i + 2b2 - 240bi4 + 975bi2 wrt i. -218808ab3i - 5760bi Differentiate 75c3q + 90869c3 + 241q - 117411 with respect to c. 225c2q + 272607c2 Find the second derivative of 306o*2y*3 - 347236o*2y*2 - 197206o*2y + 2o2 + 468oy wrt y. 1836o*2y - 694472o2 Differentiate -goz2 - 3081428go - 12gz - 190oz2 - 173655oz wrt g. -oz*2 - 3081428o - 12z Find the third derivative of -3510617a*5 - 57030a*2 + 16a - 1. -210637020a2 What is the third derivative of 1719755l*5 - 4l*4 - 7498302l*2 wrt l? 103185300l*2 - 96l What is the third derivative of 8604an*4 - 233an3 + 30an2 - 36an - 32a wrt n? 206496an - 1398a What is the first derivative of -n2v*3y - n*2v*2 + 21n*2v - 16868276n2y - 50n2 - nv*3 - 3658n wrt y? -n*2v*3 - 16868276n*2 What is the second derivative of 107279d*4 + 2460d*2 - 229880123d wrt d? 1287348d2 + 4920 What is the second derivative of 286920u*4 - 39u*3 + 54u - 275434? 3443040u2 - 234u Differentiate -3lv*3 + 201lv2 + 2061lv + 3242v*3 + 13v*2 - 2v + 18 wrt l. -3v3 + 201v*2 + 2061v Find the third derivative of -825921815v4 + 3v*2 - 121363274. -19822123560v Find the third derivative of 17456055h4 + 174856h*2 - 2h + 167 wrt h. 418945320h Find the first derivative of 69087712y + 26383198 wrt y. 69087712 What is the third derivative of 7653982o5 + 46o*2 + 3o - 4336? 459238920o2 What is the first derivative of -14761233t - 12984409 wrt t? -14761233 What is the third derivative of 3l6 + 2l*5 - 627l*4 + 3378294l*2 - 1? 360l*3 + 120l*2 - 15048l Find the second derivative of -104jv*2z*2 + 2jvz*2 - 4531738jz - 127v*2z*2 - 10v*2z wrt v. -208jz*2 - 254z*2 - 20z What is the third derivative of -10km*3n + 2km*3 + 160km2n + 2194kn + 3268m3 - 6m*2 wrt m? -60kn + 12k + 19608 What is the second derivative of 14u2w4 - u2w + 2u*2 + 74607uw5 + 94w - 1897 wrt w? 168u2w*2 + 1492140uw3 What is the derivative of -2576973m*4 - 3759170? -10307892m*3 Find the third derivative of -53643705n3 + n2 + 521n + 403 wrt n. -321862230 What is the second derivative of -6864265y*2 + 450106y - 22? -13728530 Differentiate 220079517i - 100698736. 220079517 Find the second derivative of -3a*4 - 1973000a*3 - 6552a + 1421 wrt a. -36a2 - 11838000a Find the second derivative of 601077848k2 + 40243k - 1968. 1202155696 What is the third derivative of bc3g - 2bc*3 - bc*2 - 19146bcg + 26b + 8881580c*3g - c*3 - 3c*2g + 3c2 wrt c? 6bg - 12b + 53289480g - 6 Find the second derivative of -37060696j*3 + 332131j + 72 wrt j. -222364176j Find the first derivative of 3954a*3 - 22aq3 - 4q*3 - 51388q*2 wrt a. 11862a*2 - 22q*3 Find the third derivative of -3k*2t*3 + 2k*2t*2 + 293047k*2t + 13853942kt*6 + 2t*2 wrt t. -18k*2 + 1662473040kt3 What is the second derivative of -46c*3k*2 - 10895655c*3 + 2c*2k*2 + 65279ck2 + k + 3 wrt k? -92c*3 + 4c*2 + 130558c Find the first derivative of 3068s4 - 387s*2 - 2s + 296953824 wrt s. 12272s3 - 774s - 2 Find the second derivative of 107236263a4 - 174467036a wrt a. 1286835156a2 Find the third derivative of -101435277n*3 + 74n*2 - 5174n - 4. -608611662 Find the second derivative of 43247544i2n*2 + 331292642i*2n wrt n. 86495088i2 Find the third derivative of 30348550h*3 + 126h*2 + 83421 wrt h. 182091300 Find the first derivative of -942a*3w - 9351a3 - 13a*2w + 112w - 112 wrt w. -942a*3 - 13a*2 + 112 Find the third derivative of -6113312aw3 - 171aw2 + 3aw - 15w*2 + 241 wrt w. -36679872a What is the third derivative of 11559001i5 + 5668584i*2 wrt i? 693540060i*2 Find the first derivative of 1218923gn + 4g - 2299395 wrt n. 1218923g What is the second derivative of -11463a*2q*3 - 3a*2q*2 - 4a*2q - 3a2 + 1817700aq3 wrt a? -22926q*3 - 6q*2 - 8q - 6 Differentiate 8139652d - 1094020 with respect to d. 8139652 What is the second derivative of 101899771g*4 - 180153g + 14 wrt g? 1222797252g2 What is the derivative of -520043w*3 - 3205225 wrt w? -1560129w*2 Find the second derivative of 4518990a*3 + 2a*2f + 57af + a + 4f + 73 wrt a. 27113940a + 4f Find the second derivative of 283898h*3 + 14h*2 - 935976h - 3 wrt h. 1703388h + 28 Differentiate -4l*4 + 36311045l**2 -	{ "pile_set_name": "DM Mathematics" }
-4 (c) j (d) -4/7 d Let r be (2/(-180))/((-4)/188). Let n = r - -5/18. What is the third smallest value in 0.1, 2.4, n? 2.4 Let f = 6835 + -6818. Which is the third smallest value? (a) -8/13 (b) f (c) 0.5 (d) -4/5 c Let t = -0.7 + 0.4. Let h be 5/302/(-3). Let i = 103/4 - 25. What is the second smallest value in -4, h, t, i? t Let p = -603 - -1808/3. Let x = -4.7 + -11.3. Which is the second smallest value? (a) x (b) 0.2 (c) p c Suppose -4g = 5n + 7, 0g - 4g + 5 = n. Let y be n + ((-45)/(-15))/((-3)/1). Let i = -2.6 + 2. Which is the second smallest value? (a) y (b) 2 (c) i c Let h = 1.171 + -1.251. What is the second smallest value in 0.3, h, -59? h Let z be -10515/(-3780)3/25. Let t be (-2)/64/22. What is the second smallest value in t, 4, z? z Let q = 3779 - 3782. What is the fourth smallest value in q, -5/4, 23, -4? 23 Let u = -712.6 + 625. Let h = 87.1 + u. What is the biggest value in 0, -2/7, h? 0 Let y(r) = 2r - 40. Let s = 297 + -275. Let f be y(s). Which is the fourth smallest value? (a) 23 (b) f (c) 2/7 (d) 0.2 a Let u = 12832.021 - 12832. Which is the third biggest value? (a) u (b) 0.4 (c) 2/25 a Suppose 0 = 3q - 15, -7q = 4a - 3q - 28. Let r = -292 - -225.4. Let u = r - -67. What is the third smallest value in -3, 5/3, u, a? 5/3 Let p = -93.2 - -93.11. Let n = -392 + 398. What is the second biggest value in n, p, -0.2? p Let z(k) = -k2 - 26k - 116. Let p be z(-19). Suppose 8g = pg - 297. Which is the third biggest value? (a) -2/5 (b) g (c) 0 a Let o(m) = -4m2 + 72m - 333. Let v be o(6). Which is the fourth smallest value? (a) v (b) -0.4 (c) 0 (d) -3/2 c Let y be (1-2)/((-36)/36). Which is the smallest value? (a) 19 (b) -5 (c) y (d) -7 d Let d = 256.188 + -256. Let n = 0.218 - d. Which is the third biggest value? (a) n (b) -1/10 (c) 2 b Let q be (8/(-12))/((-28)/(-18)). Let o = -60490.6 + 60492. Which is the second biggest value? (a) q (b) -1 (c) o a Let h = -25199/5 - -5040. Which is the fourth biggest value? (a) 5 (b) -18 (c) 1/7 (d) h b Let j = -0.286 + 0.139. Suppose 5n = -v + 30, -10v + 15v = 4n + 5. Which is the biggest value? (a) 3 (b) j (c) n c Let b = -44 - -8. Let x = b - -37. Let z = -0.343 - -0.443. What is the second biggest value in z, x, 1/4? 1/4 Suppose 3w + 123 + 51 = 0. Let u = -81945 - -81946. What is the third smallest value in 3, w, u? 3 Let k = -9996 + 49978/5. Which is the fourth biggest value? (a) -2 (b) -0.07 (c) k (d) 0.06 (e) -1/3 c Let s = 210578/107 + -1968. Let h = -141 + 140.7. Which is the second biggest value? (a) s (b) h (c) 0.5 a Let k = 7377 - 7377.2. Which is the second biggest value? (a) 0.02 (b) -18 (c) 1 (d) k (e) 5 c Let m be ((-25)/275)/(16/(-132)). What is the smallest value in -5, 1/6, m? -5 Let b = -302 + 431. Let r = -142.25 + b. Let j = 13.4 + r. What is the fourth biggest value in 5, -0.3, -2/5, j? -2/5 Let a = 27.9 - 27.6. What is the biggest value in 2/303, a, -1/2? a Let k = 25 + -24.7. Let r = 2166.7 - 2166. Which is the fourth biggest value? (a) -5 (b) r (c) -2 (d) k a Let q = -33 - -40. Let j = -2735 + 2734.6. What is the biggest value in j, -4/5, q? q Let w be -2 + (-90)/(-8 - -3) + -1. Suppose -10g + 5g = w. Which is the fourth biggest value? (a) -1 (b) 0.02 (c) g (d) -0.2 c Let q = 697155 + -2788619/4. Let t = -1.9 + -0.1. Which is the second smallest value? (a) t (b) q (c) -1/5 (d) -6 a Let p = 23817 - 1595738/67. Which is the fourth biggest value? (a) p (b) 0.29 (c) -1/4 (d) -0.2 (e) 1/2 d Let v = 1.6 + -1.14. Let c = 0.43 - v. What is the smallest value in -1/7, 2, c? -1/7 Let p = -0.1535 - 0.907. Let m = 0.0605 + p. What is the second biggest value in -0.2, m, -3, -14? m Let j = -11 + 16. Let g be (-2)/j + 4/35. Let m = 71.5 + -72. What is the fourth smallest value in -1, m, 2/3, g? 2/3 Let c = -0.07 - -0.47. Suppose 205h - 207h = 2b - 2, -5b = -4h + 40. What is the third biggest value in c, b, -0.5? b Let l = 300 + -2098/7. Let q = 15 + -15.02. Let r = q - -3.02. What is the second smallest value in r, l, -1/3? l Let w = 10.1 + -5.83. Let p = 0.27 - w. Let v = -676 - -676.5. What is the second smallest value in p, 1, v? v Let m = 0.024667 - 0.017667. Let c = 0.01 - 3.01. What is the second smallest value in m, c, 1/3? m Suppose 5k = 2k + n + 22, 5n - 2 = k. Let w be ((-13)/39)/(4/3). What is the second biggest value in k, -0.3, w? w Let k be 9((128/(-168))/8)/2. What is the fourth smallest value in 1/6, 3, -4.9, 0.9, k? 0.9 Let q = -2/59 + -104/413. Let v be 4(-2)/(-12)162/54. What is the fourth smallest value in q, -2/13, -5, v? v Let r = 27 + -15. Suppose 3j - 4u + 7u + 3 = 0, -19 = -2j + 5u. Let s be ((-11)/(-242))/(j/8). Which is the second smallest value? (a) r (b) s (c) -0.4 b Suppose 3x = 16 - 13. Let g = -73.7 - -101. Let f = 27 - g. Which is the second biggest value? (a) x (b) f (c) 4 a Let x = -19021 + 19021. Let d = -19 - -18. Let p(i) = -i2 - 4i + 7. Let u be p(-5). What is the third smallest value in d, u, -3, x? x Let v be (-4)/3(1 + 0). Let g = 374 + -386. Let z be (-3)/(-1(-6 - g - 1)). Which is the biggest value? (a) 3/7 (b) 2/3 (c) v (d) z b Let x be 35/(-5985)196/(-5). Which is the third biggest value? (a) x (b) -2/9 (c) 3 (d) -0.34 (e) 0.04 e Let g(x) = x + 169. Let t be g(0). Let l = -2/4493 + 2259985/13479. Let z = t - l. Which is the third biggest value? (a) 0.3 (b) 1 (c) z (d) 0.5 d Let q = 8 - 8.06. Let j = q - -0.36. Let a be (-54)/15(-190)/(-152). What is the biggest value in j, 1, a, -2/5? 1 Let q = 289991/9 - 32221. What is the second smallest value in -51, 5, q? q Let v = 90 - 178. Let q be v/(-80) + 30/(-50). Let p be 1/(-2) + 8/6. What is the second biggest value in -2/7, q, p? q Let j be (27 - 24) + (1 - -50). Suppose jv - 100 = 8. What is the second smallest value in -5, -2/7, v, -6? -5 Let i = 3.157 + -3.357. Which is the third smallest value? (a) -0.07 (b) -23 (c) i a Let r be 3/(-33) - (-18)/(-297)(-558)/(-24). Let m = -257/4 + 64. What is the third smallest value in r, 12, m? 12 Suppose -3h - f + 11 = 0, -126f + 121f - 13 = -2h. Which is the biggest value? (a) 183 (b) 0.02 (c) h a Let h = 0.04 - -41.96. Let q = -45 - h. Let v = 80.2 + q. What is the smallest value in v, 4, 0.1? v Let m = 15 - 13.7. Let n(r) = -r3 + 11r*2 + 29r - 14. Let o be n(13). Let z = o + -22. What is the second biggest value in z, -2/7, m? m Let l = 38 + -34. Let r = -0.1806 + -0.1194. Let p = -2/5 - -9/10. Which is the second biggest value? (a) l (b) -0.1 (c) r (d) p d Let p be (-32)/(-48) + (-34)/6. Let w = -239 - -143. Let g be p/(140/w) - 3. Which is the smallest value? (a) 0 (b) 32 (c) g a Let x = -0.213 - 137.787. Let f = 138.004 + x. Which is the third biggest value? (a) 4 (b) -3/2 (c) f b Let c = -3 + 2. Let p(l) = l*3 - 2l*3 + 235 + 3l*2 - 117 - 97. Let u be p(4). What is the second biggest value in 0.3, c, u, 1? 1 Let x = 2 + -2.1. Suppose -s = -8s - 2506. Let o = s - -355. Which is the second smallest value? (a) x (b) -4 (c) o c Suppose 0 = 57q + 86q - 89 - 54. What is the third biggest value in -2, q, -0.1869? -2 Suppose -6s = 375 + 849. Let g = s + 616/3. What is the third smallest value in 3, 0.6, g? 3 Let f(g) = -g + 4. Let p be f(5). Let m be 8/(-4) - (-3)/p. Let h = -117 - -116.7. What is the smallest value in h, m, 0.4? m Let k = 234 + -4442/19. Let o = -28371/136 + 14211/68. What is the third biggest value in o, 1/6, k? 1/6 Let m = 2.1418 + -2.1418. Which is the biggest value? (a) m (b) 3 (c) 22 (d) -211 c Let u = 0.479 + -0.479. Let t = -203/69 - -60/23. Let k = -0.46 - -0.4. What is the third smallest value in t, k, u? u Let g = 5.5 - 5.2. Suppose -52t + 60t = -8. Let j(u) = -u + 9. Let y be j(9). What is the second biggest value in t, g, y? y Let t = 0.14 - 0.44. Let h = -62/3 + 21. Let s = 4.895 + -4.795. Which is the smallest value? (a) s (b) h (c) t c Let u = -166 - -168.06. Let s = 50.06 - 50. Let i = u - s. Which is the fourth smallest value? (a) 0 (b) i (c) -2 (d) 1 b Let v = -0.98 + 1. Let f = -18.7368 - -18.5368. Which is the second smallest value? (a) 9 (b) v (c) f b Suppose -37 + 13 = -6z. Suppose 8w + zw - 156 = 0. What i	{ "pile_set_name": "DM Mathematics" }
osest to 0 in 2/5, -2, -2/7, 1/17? 1/17 What is the nearest to -1 in 2/5, 4, 1? 2/5 What is the nearest to -4 in -0.3, -1.4, -7, -0.2? -1.4 Which is the closest to 1? (a) 1 (b) 0.11 (c) -4 (d) 4 a Which is the closest to -0.3? (a) -5 (b) 19 (c) 3 c What is the nearest to -0.1 in -0.7, -2/5, -21? -2/5 Which is the closest to 0? (a) -2 (b) 5 (c) -0.09 (d) -23 c What is the nearest to 6/17 in -2/7, -1, -5? -2/7 What is the closest to -124 in 0, -2/13, -0.3? -0.3 Which is the closest to 0? (a) -2/93 (b) -2 (c) -3 a Which is the closest to -7? (a) 23 (b) -5 (c) -10 (d) 2 b Which is the closest to 1/2? (a) 5 (b) -3 (c) 14 b What is the nearest to 0.8 in -2/47, 0.5, -2/11? 0.5 Which is the nearest to 1/14? (a) -0.5 (b) -3/5 (c) 0.5 c Which is the closest to 3.2? (a) -3/5 (b) 3 (c) -2 (d) 2/3 b What is the closest to -4 in -0.04, 4, 0.4, -3/2? -3/2 What is the nearest to 0 in 1, 3, 52? 1 Which is the closest to 2? (a) 0.1 (b) 4 (c) -0.5 (d) -10/7 a What is the closest to -2/7 in 2, -3, 292.3? 2 What is the nearest to -2 in 0.2, -0.2, 0.9? -0.2 Which is the nearest to 0.1? (a) 2/13 (b) 0.5 (c) -3/5 a What is the closest to 0.01 in 5, 5.8, 4? 4 What is the closest to 2/9 in -2/3, 33, 0.4, -24? 0.4 Which is the closest to 0.1? (a) 7 (b) 2/11 (c) 2 b Which is the nearest to -0.1? (a) -3610 (b) -1/5 (c) -3/2 b Which is the closest to -0.01? (a) 0.3 (b) 1/2 (c) -2 a Which is the closest to 0? (a) -4/3 (b) 1/4 (c) -8 (d) 9 b Which is the closest to 2? (a) -0.014 (b) 3 (c) 0.4 b Which is the closest to -2/11? (a) 2/3 (b) 6/13 (c) 6/7 b What is the closest to -2/5 in 2/15, 4, 0, -5/111? -5/111 What is the nearest to 3 in -2/5, -5/3, 0.4? 0.4 What is the nearest to -0.3 in 9.3, 3/2, 0, 0.5? 0 Which is the closest to -1? (a) 21 (b) 6 (c) -1 c Which is the closest to 0? (a) -5 (b) 1/3 (c) -0.5 (d) -2/97 d Which is the closest to -2? (a) -285 (b) -2/7 (c) -1 (d) 2/51 c What is the closest to 30 in 1/8, -0.1, -0.3? 1/8 Which is the nearest to 2? (a) 2 (b) -5/3 (c) 8 (d) -0.4 a Which is the nearest to -5? (a) -0.5 (b) -2/3 (c) -4 (d) -5 d What is the nearest to 2/5 in -4/7, -0.1, 5, -1/4? -0.1 Which is the closest to 3? (a) 5/8 (b) -2 (c) 6 a Which is the nearest to -2.2? (a) 1/10 (b) 0.6 (c) -0.1 (d) 3 c What is the closest to 4/3 in -189, -1, -2/7? -2/7 What is the closest to 0 in 1, 0.671, 4? 0.671 What is the closest to -2 in -0.1, -3, 1/20? -3 What is the nearest to 3 in 0.5, 2, -5, 0.226? 2 What is the nearest to 6 in 5, -1.2, 1? 5 Which is the closest to -4/11? (a) -1 (b) 0 (c) 17 (d) -0.3 d What is the closest to 1 in 2, -7, -0.2, 0.02? 0.02 Which is the closest to 3? (a) -4 (b) -724 (c) -5 a What is the closest to 0.2 in -2/3, -29/5, 2? -2/3 Which is the nearest to -0.2? (a) 4 (b) -4 (c) 0.2 (d) 4/3 c Which is the nearest to 2? (a) 7.6 (b) 4/5 (c) -5 b Which is the closest to 0.042? (a) 2/7 (b) 4 (c) 0 (d) 0.2 c Which is the nearest to 0? (a) 185 (b) -1/6 (c) -2/15 c Which is the nearest to 1? (a) 1123/3 (b) 3 (c) -5 b Which is the closest to -7/6? (a) 0.2 (b) 2 (c) -0.1 (d) -0.5 d Which is the closest to 0? (a) 0.3 (b) 51 (c) -9 a Which is the closest to 0.1? (a) -56 (b) 1/10 (c) -5 b What is the nearest to 0 in -21, -0.02, 0? 0 Which is the closest to -1? (a) 11/3 (b) -2/13 (c) -2 (d) 0.5 b What is the nearest to -1 in 2, -0.02, -0.16? -0.16 What is the closest to 3/13 in -0.2, 3, -5? -0.2 Which is the closest to 0? (a) -0.2 (b) 9 (c) -0.3 (d) 0.1 d Which is the nearest to 0? (a) 8/3 (b) 3/2 (c) -1/4 (d) 2/9 d Which is the closest to -2.376? (a) -0.1 (b) -5 (c) -1 (d) 0.2 c Which is the nearest to 4? (a) 23 (b) -2 (c) -3/5 c What is the nearest to -14 in -3, 1, 0.5? -3 What is the closest to -75 in 0.1, 0.2, 4, -3? -3 What is the closest to -0.2 in 4/7, -2, -6? 4/7 What is the closest to -1/2 in 0, -4/5, -104/11, 2/25? -4/5 What is the nearest to 2 in 472, -0.4, 2/5? 2/5 Which is the closest to -0.9? (a) -2/11 (b) 0.5 (c) 6 (d) 0.1 a What is the nearest to 41.8 in -0.3, -4, 1/2? 1/2 What is the closest to 1 in -0.2, 2, 30, 4? 2 What is the nearest to -0.1 in 2, -2/23, -1/5? -2/23 Which is the nearest to -18? (a) 0.2 (b) 0 (c) -5 (d) 0.4 c Which is the nearest to 199? (a) -0.3 (b) 2 (c) 2/17 b What is the nearest to -1 in 0.054, -0.3, 2/9, 0? -0.3 Which is the nearest to -1? (a) -2/19 (b) 5 (c) 1 (d) 3 a What is the closest to 3 in 1, -2/23, -0.68, 0.5? 1 What is the closest to -56 in -0.06, -2/7, 0, -2/15? -2/7 What is the closest to -1 in -0.4, 0.517, -0.1? -0.4 What is the closest to 0 in -5, -3, 0.3, -1? 0.3 What is the nearest to -1/3 in -1/6, 2, -0.3, -4? -0.3 What is the closest to 4/7 in 1/22, 2, 0.5, -0.03? 0.5 What is the nearest to 0.1 in -0.5, -1, 15, -10.8? -0.5 Which is the nearest to 2/9? (a) -0.9 (b) -5 (c) -2/3 (d) -0.3 d What is the nearest to 2/21 in -1/5, 0, 0.2? 0 Which is the closest to 2/5? (a) 8.3 (b) 3 (c) -2/7 c What is the nearest to -1 in -0.8, -3/5, 2, 1? -0.8 Which is the closest to 1/6? (a) 74 (b) -2 (c) -5 b Which is the closest to -4? (a) -0.1 (b) 1/10 (c) 0 (d) -1/3 d What is the closest to -35 in 9, 3, 0.5? 0.5 Which is the nearest to 1? (a) -0.4 (b) -10/11 (c) 2/13 (d) -1/3 c What is the closest to 2/9 in -0.12, -4, -5? -0.12 Which is the nearest to -1? (a) -0.3 (b) -1/2 (c) 0.1 (d) -106 b What is the closest to 7 in -2/5, 32, -1? -2/5 What is the closest to 2/3 in -250, -3, 3? 3 What is the closest to 7 in 44, -0.1, -2, 0.1? 0.1 What is the nearest to 2/3 in 0.21, 3, 5? 0.21 What is the closest to 0 in 3, -4/5, 5, 0.16? 0.16 Which is the nearest to 0? (a) 0.02 (b) -0.3 (c) 2 a Which is the closest to 0.4? (a) -4 (b) 0.3 (c) -8 b What is the closest to -0.4 in -3/2, 3, 1, -7? -3/2 What is the closest to 0.03 in 2, 0.4, 1, 6? 0.4 Which is the nearest to -69? (a) 6 (b) 1 (c) 0 c What is the nearest to 2/7 in 3/2, -5, 2.3, 1? 1 What is the nearest to -0.1 in -3, -0.26, -4? -0.26 What is the nearest to 1 in 8, -4, 2/11? 2/11 Which is the nearest to 8? (a) 10 (b) -4 (c) 5 a What is the nearest to 92 in 2/9, -2/9, -0.4, 1? 1 Which is the closest to -0.1? (a) 3/4 (b) -4 (c) 6.2 (d) -3/2 a Which is the nearest to 1/4? (a) -0.2 (b) -0.02 (c) -0.1 (d) 4 b Which is the closest to 2? (a) 2/3 (b) -12 (c) 1/13 a Which is the closest to -2? (a) 0.2 (b) 1 (c) -2/29 c Which is the nearest to 1/4? (a) 0.4 (b) 11 (c) 0.03 a What is the closest to 1 in 1/3, -20, 4, -5/2? 1/3 What is the closest to 1/3 in -3, -5, -5/79? -5/79 Which is the nearest to 0.1? (a) -88 (b) 2/9 (c) 0 (d) 0.4 c What is the nearest to -8 in -0.1, -3, 5, 4/5? -3 What is the closest to -2/7 in -2/3, 0.027, 14? 0.027 Which is the nearest to -1/2? (a) 2/5 (b) 9 (c) -5 a Which is the closest to -0.1? (a) -1 (b) 61 (c) -3 a What is the closest to -1 in 1/5, 18.3, -0.4? -0.4 Which is the closest to -0.1? (a) 4 (b) -10 (c) 2 (d) -4/5 d Which is the closest to -1? (a) -1/2 (b) 0.5 (c) 3 (d) -17 a What is the closest to 0.3 in 6, 4, 3, 0? 0 Which is the closest to 0.1? (a) 0.133 (b) -7 (c) 1 a Which is the nearest to 0? (a) 4 (b) -1/9 (c) -1/4 (d) -1/11 d What is the nearest to -1/4 in -2, -6, 3, 10? -2 What is the nearest to -4 in 8, -0.8, -5, 1/2? -5 Which is the nearest to 2? (a) -0.2 (b) -1/4 (c) -6 a Which is the nearest to 50? (a) -2 (b) 5 (c) -3/5 (d) -0.2 b What is the nearest to -2 in -1/2, 9/4, 0.1? -1/2 Which is the nearest to 0.2? (a) -5 (b) 5 (c) 0.14 c What is the closest to -18 in -1/2, 8, 1, -3? -3 Which is the nearest to -0.3? (a) 21 (b) 3/4 (c) 0.2 c What is the nearest to 93 in -5, -1.4, -3? -1.4 What is the closest to 1/2 in -0.04, -2, -2/27, -0.2? -0.04 What is the closest to -0.2 in 1/2, 1/8, -5, -0.4? -0.4 Which is the nearest to -2? (a) 1 (b) 2 (c) 4/71 c What is the nearest to -1/4 in 0.4, -3, -1.6, -2/35? -2/35 Which is the nearest to 2/7? (a) -3 (b) -4 (c) -2/7 (d) -13 c Which is the closest to -0.06? (a) -35 (b) -1 (c) -5 (d) 1/6 d Which is the nearest to 1? (a) 1/23 (b) -1 (c) -0.3 (d) 1/65 a What is the closest to -0.03 in -0.3, 4/7, 18? -0.3 Which is the closest to 7? (a) 0.09 (b) -2.6 (c) 3	{ "pile_set_name": "DM Mathematics" }
. Suppose -u = 5b - 6u, 4u - 12 = b. Suppose -o = bo - t. Solve 0 = 2r - o for r. 1 Let r be (4 - 7)/((-1)/4). Suppose 3k = 7k - r. Suppose 0 = q + kq - 12. Solve q = -2h - 3 for h. -3 Suppose 10 = a - 6k + 8k, 0 = -5a + 2k + 14. Solve -35 = -ay - 23 for y. 3 Let x(h) = 3h2 - 118h - 70. Let g be x(40). Solve 5t - 5 = -g for t. -1 Let k = 18 - 6. Suppose 2j + 2j = a + 6, 0 = 2j + 4a - k. Let b = -17 + 19. Solve ju = u + b for u. 2 Suppose -3s - s + 3u - 13 = 0, 0 = -5s + 5u - 15. Let f be (s/10 + 23/(-5))/(-1). Solve -2q + f = 3q for q. 1 Let h = 83 - 89. Let z be (-5)/(-10) + (-9)/h. Solve zd = 7d for d. 0 Let y(n) = -97n + 590. Let l be y(6). Solve -a + l = -3a for a. -4 Let v be (4 + -3 - 0) + 3 + -1. Suppose -vj = 4 - 1, -t = -j - 6. Solve -6 = -th + 9 for h. 3 Let l be (2 - 4) + 4/2. Suppose 3o - 115 = -2o. Suppose 5k - 3k = -r + o, 0 = -2r + 6. Solve q - 6q - k = l for q. -2 Let z be 5 - (1/1 + -4). Let n(c) be the second derivative of c*5/20 - 7c*4/12 - 4c3/3 + c2 - c. Let v be n(z). Solve v - 5 = -k for k. 3 Let y be (-1 + 28/8)48/60. Let c = 2 + 0. Suppose o + 0o = 4k + 12, 3k + 9 = co. Solve -yl = -ol + 2 for l. -1 Let u = 1533 + -1533. Solve up = -10p + 10 for p. 1 Let m be 1/3 + 92/12. Solve -mt + 2 = -9t for t. -2 Let r be (12 - 9)(-1 + 7/3). Solve 5s = 21 + r for s. 5 Let i = 304 + -300. Suppose u - 8 = -k, 0u = 5k + u - 20. Suppose ih - v = 0, h + 2v = kh. Solve h = 5a + 1 - 6 for a. 1 Let x = 23 - -28. Suppose -12 = -xh + 49h. Solve 3k - h = -18 for k. -4 Let l = 17 - 10. Let x(r) be the first derivative of r*2 - 2r - 10. Let y be x(2). Solve -lv = -yv + 20 for v. -4 Let c(h) = 3h2 - h - 15. Let n be c(-3). Solve 11i - n = 29 for i. 4 Suppose -24p + 21p = -6. Let u be p + -3 + (4 - 1). Solve 0 = 2m + um for m. 0 Let p(s) = -s*3 - 12s*2 + 14s + 15. Let w be p(-13). Let a be 1/(1 - w/3). Solve an - n = 6 for n. 3 Suppose 31 = 5w + 6. Let l = w - 2. Let d = 2 - -1. Solve ly = 2y + d for y. 3 Let f be 90/8 - (-2)/(-24)3. Solve 8y = fy - 15 for y. 5 Let s(o) = o - 3. Let y be s(3). Let d(u) = u2 + 3. Let g be d(y). Suppose 0 = 4j - 31 + 3. Solve jl = gl - 16 for l. -4 Suppose -26b + 60b = 29b. Solve b = q - 6 + 7 for q. -1 Let n(x) = 3x*2. Let f = 9 - 7. Suppose -h = h + f. Let k be n(h). Solve ks = s for s. 0 Suppose 5x + 2u = 374, 5x + 4u = 2x + 230. Let n = -69 + x. Solve 1 = 6j - nj for j. 1 Let g = -467 - -477. Solve -51u + g = -53u for u. -5 Let p be (-80)/45 + 23/(-27). Let o be (-2)/(p + 0) + 4. Solve -ow - 4 = 1 for w. -1 Let m(k) = -k2 - 11k + 11. Let z be m(-11). Suppose -5n + 1 = z. Let f = 3 - n. Solve 3 = 4b - f for b. 2 Let b(w) = w*3 - 17w*2 - 20w + 39. Let t be b(18). Suppose -to = -o - 16. Solve o = i - 5i for i. -2 Suppose 2d - 4n + 30 = 0, -2n = 2d + 2n + 30. Let u = 17 + d. Suppose 0 = 2z + ub - 4, -8 = -7z + 3z + 5b. Solve -3f = zf for f. 0 Let g(b) = -b*2 - 5b. Let l be g(-5). Let t(w) = -2w - 9. Let j be t(-6). Suppose i - j + 1 = l. Solve z + i = 1 for z. -1 Let z = -44 - -44. Let g = z + 5. Solve 8 - 28 = gu for u. -4 Let n be 24/10 + (-396)/(-660). Solve 0 = -2m + nm - 4m for m. 0 Let z(d) = d3 + 12d*2 - 32d + 9. Let r be z(-14). Solve -8i - 5i - r = 0 for i. -5 Suppose 2r + r + 19 = 5z, 0 = 5z + r - 7. Suppose x + zx = 0. Solve 3t = -6 - x for t. -2 Suppose -3o - 19 = -1. Let c = o + 9. Solve 2n - n = -c for n. -3 Suppose -n - 2 = -4w + n, w = 5n + 5. Let h be 0 + (-7)/(0 + -1). Suppose -5q + 25 = m - 0m, -3m = 0. Solve w = 3o + q + h for o. -4 Let k(a) = a3 + 69a*2 - 138a + 288. Let m be k(-71). Let z(q) = -q*2 + 9q - 6. Let w be (-48)/(-9) - (-4)/6. Let b be z(w). Solve -n + b = -mn for n. -4 Let l(q) = -4q*3 - 48q*2 + q + 12. Let m be l(-12). Solve m = 8h + 7h - 3h for h. 0 Let u be (138/12 + -1)/(1/2). Suppose -ug + 17g = -4. Solve g + 2 = c for c. 3 Suppose -50x + 62x = 72. Solve 8 = -xa - 22 for a. -5 Let r be (10/(-8))/(3/(-24)). Let x be (-3)/(4/(-4))1. Suppose d = 6d - xs - 26, -2d + 2 = 3s. Solve -dt + r + 2 = 0 for t. 3 Let j(a) = a2 - 4a - 18. Let y be j(6). Let t = 16 + y. Solve -5z + tz = 10 for z. 2 Let t be (-2)/((3/7)/((-3)/2)). Let y = t - -10. Solve -4b + 3 = -y for b. 5 Suppose -2r + 4 = -0r, -24 = -4u - 2r. Solve 4 = ua + 29 for a. -5 Let p = -3 + 8. Let h = -42 - -98. Suppose -8g + 24 + h = 0. Solve -c + p = g for c. -5 Suppose 0 = -4l + 16 + 88. Let p = l + -21. Suppose -5f = v - 14, 2f = f - pv + 22. Solve 4x - fx = 0 for x. 0 Let d(s) = -s + 1. Let b be d(-14). Solve 5i + 0 = b for i. 3 Suppose -103 = 5z - 113. Let w be (-1)/(-7)z - 94/(-14). Solve -2o = -wo for o. 0 Let p = 678 + -668. Solve l + p = 10 for l. 0 Suppose -2i + 9 = -31. Let b(u) = 2u*2 + 77u + 737. Let y be b(-21). Solve -2t = yt + i for t. -5 Let g(h) = -h*2 + 16h + 2. Let t be g(16). Suppose -tq - 3q + 20 = 0. Solve 0a + q = 2a for a. 2 Let r be (9/18)/(1/2). Solve 5 + r = 2i for i. 3 Suppose 0 = -3w + 5w - 10. Let h(o) = wo*3 - 8o*3 - 4 + 2o*3 + 5o*2 - 2o. Let i be h(4). Solve 3g - i + 1 = 0 for g. 1 Let i(p) = -8p*2 + 16p*2 + 9p - p3 + 14 + p2. Let z be i(10). Suppose -zq + 7q - 3 = -3s, q = -2s. Solve -qu - 2 = -u for u. -2 Let r(u) = u3 + 3u*2 - 6u - 3. Let x = -19 + 15. Let o be r(x). Suppose -2v - v = oj - 9, 0 = j. Solve 7g = vg for g. 0 Suppose u + 6d - 9d = 2, 50 = 3u + 2d. Solve -10 - u = 12r for r. -2 Let r(g) = -g3 + 9g*2 - 4g + 41. Let j be r(9). Suppose -5t - 15 = -7p + 4p, -j = p - 5t. Solve 0b + 2b = p for b. 5 Suppose 7n + 57 = -279. Let k = n + 48. Let o(a) = a - 1. Let h be o(6). Solve -hp + p + 20 = k for p. 5 Let j be (10/(-4))/((-236)/(-40) + -6). Let a = j + -9. Solve 0 = -5w + 1 - a for w. -3 Let s be (-52)/(-39) - (-32)/(-6). Let h be (2 - 3)(4 + s). Solve h = -j - j for j. 0 Let d be 120/(-18) + (20/(-6) - -3). Let l be (50/(-6) - d)-32. Solve -3a + 5a = l for a. 4 Let r(g) = -g*2 + 25g - 11. Let t be r(22). Let l = -51 + t. Solve 0 = -lv + 7v - 15 for v. 5 Let g be -2 + ((-4)/(-10) - 16/(-10)). Let j be (-3 - -2) + -2 + 6. Suppose 3q = 2i - 25, -i - 3q + 5 = -2q. Solve g = ja + 17 - i for a. -3 Let r be 14/5 - (140/(-25))/(-7). Let n(c) = -c3 - 6c*2 + 4c - 10. Let v be n(-7). Let l = v + -7. Solve 0 = -rp + l for p. 2 Let i(w) = -w3 - 18w*2 - 2w - 16. Let c be i(-18). Suppose -2n = v - 20, -4n + 30 = -3v - c. Solve 2z - n = -13 for z. -1 Let y(p) = -p + 15. Let g be y(12). Let d be g + -4 + 3 - -4. Solve -3o + d = 18 for o. -4 Suppose 0 = -0h - 5h + 5. Let z(s) = 1 + 0s*2 - 2s2 + s2 + 9s + h. Let c be z(9). Solve 0 = cn - 0 + 2 for n. -1 Suppose 0i - 51 = -3w + i, 3w = -2i + 51. Solve 7d = -4 - w for d. -3 Let a(y) = -3 + 6y - y*2 - 10 + 20 + 2. Let f be a(7). Solve -fw = 3w + 15 for w. -3 Suppose 0 = -2t - 27 + 31. Solve tq + 20 = 22 for q. 1 Let t = -993 - -995. Solve -ti = -8i - 30 for i. -5 Let b(c) = -c2 + 2c + 5. Let k be b(5). Let q = 14 + k. Suppose 0 = -221l + 231l - 40. Solve qp = -l - 12 for p. -4 Suppose 0 = 4t - 3p - 9, -5t + 35 = p. Solve -17b - 23 + t = 0 for b. -1 Let q be 8 - 0(18/(-12) + 2). Solve -25i - q = -21i for i. -2 Suppose 2a + 10 = 2. Let h be (0 - -4) + (a + 1 - -2). Solve 2y + hy + 20 = 0 for y. -4 Let z be 5/15 + 26/(-6). Let a be 3/(((-1)/z)/(2/6)). Solve -3k = k + a for k. -1 Suppose -h + 5h - 4 = 0. Let d(k) = k2 + 1. Let z be d(h). Suppose -x - 2x - 5c + 19 = 0, x + zc - 6 = 0. Solve x = -5o - 12 for o. -4 Let w(v) = 7v - 70. Let j be w(10). Solve 2p + 6 = -jp for p. -3 Suppose -125t = -105t - 160. Solve -14s = -6s - t for s. 1 Suppose 22f = 23 + 1143. Solve 11m - 2 - f = 0 for m. 5 Suppose 0 = 2o + 1173 - 1187. Solve oa + 24 = -a for a. -3 Let d(c) = -c + 4. Let o be d(-3). Let s = 19 + -17. Suppose -s = -2q + 8. Solve 0 = qh - 13 - o for h. 4 Let f = 1104 + -1095. Solve -45 + f = 9g for g. -4 Let t = 18 - 65. Let b = t - -50. Solve 17 = 5u - b for u. 4 Let l(n) = n*3 - 2n + 17. Let h be l(0). Solve 12y - hy = -8*y for y. 0 Let h be 1/(372/(-42) - -9). Solve -4 = j - h for j.	{ "pile_set_name": "DM Mathematics" }
4r = -3b + 67 - 18. Calculate the least common multiple of r and v. 176 Find the common denominator of -11 + (-5073)/(-712) + 8/(-2) and -41/1016. 1016 Let n be (-804)/28 - -1(-6)/21. Let j = -31 - n. Calculate the common denominator of (j - (553/(-18))/7) + 0 and -4/11. 198 Let w be 10/(-4)10/(50/(-10)). Suppose 0 = -3b - wl + 9 - 3, -4b + 8 = 3l. Calculate the lowest common multiple of b and 20. 20 Let h = 103/83 - 6424/3237. Let z = 73/57 - -1/19. What is the common denominator of z and h? 39 Suppose 24a - 3550 - 17540 = -14a. What is the least common multiple of 481 and a? 7215 Let g(j) = -j*3 + 6j*2 - 6j + 6. Let x be g(5). Let i be -6 - -1 - -3 - (-4)/x. Find the common denominator of (i - (-423)/(-4))(-2)/15 and -59/20. 60 Let x = 179/2 + -86. Let l = -5090 + 7778. Let b = l + -45650/17. Find the common denominator of x and b. 34 Let o be (-204)/81(-6)/9. Find the common denominator of (14/12)/(3/o) and 101/6. 18 Suppose -60 = -25b + 15b. What is the common denominator of 28/b((-348)/(-63) - 6) and -67/44? 396 Let q = -335 - -347. Suppose 9 = -4r + 45. What is the least common multiple of r and q? 36 Find the common denominator of -113/48 and (-5)/3 - (-4)/24 - (-1395)/1320. 528 Let v be (-262)/(-4) - ((-11)/2 - -7). What is the common denominator of (-4)/(v/(-6))55/(-3) and 5/18? 72 Let h = -68 - -106. Suppose -c + h = 2m, -4m - c = -22 - 52. Calculate the least common multiple of m and 33. 198 Let r = -105 + 155. Suppose 0h + 2h = -i + 16, -5i + r = 4h. What is the smallest common multiple of i and 22? 66 Suppose -6n + 11 = -3n + h, -5h - 5 = 0. Calculate the lowest common multiple of 48 and 5/(30/4)(n - -14). 48 What is the common denominator of -63/940 and (-4444)/(-280) + (-555)/37? 6580 Let v(t) = 109t + 1213. What is the lowest common multiple of v(-11) and 229? 3206 Let y = -635867/30 + 21190. Calculate the common denominator of 28/177 and y. 1770 Let p(d) = 6d + 8. Let u(i) = i*2 - 15i + 17. Let w be u(14). Calculate the lowest common multiple of 35 + 1/((-1)/w) and p(1). 224 Let k be 6/(-4(-12)/10304). Suppose -40c = -47c + k. What is the least common multiple of c and 10? 920 Suppose 5x + 4m = 6m + 3910, -x + 5m = -759. What is the lowest common multiple of x and 7? 784 Let n be 2148/(-216108)431829/2370. Let m = n + -4/52693. Find the common denominator of m and 34/63. 630 Suppose -3q = 2g - 233, -3g + 352 = 44q - 40q. Calculate the lowest common multiple of 16 and g. 496 Let g = -9084895/114 - -79691. What is the common denominator of g and -99/350? 19950 Let d(g) = -g2 - 10g + 7. Let w be d(-10). Suppose -5 = 3k + w. Calculate the lowest common multiple of 46 and 1(0 - k) + 4. 184 Let d = 197 + -147. Suppose -4c + 14 = -d. What is the smallest common multiple of 10 and c? 80 Let v = 682151/100 + -6821. Find the common denominator of -111/200 and v. 200 Let l = 44978/21 + 240827/105. Let d = -665389/150 + l. Find the common denominator of -19/40 and d. 600 Suppose 3a + 30 = 4h, -5 - 4 = -3h. Let x be 1066/39 - 4/a. Let g = -4 + x. What is the least common multiple of g and 33? 264 Let s(n) be the first derivative of 2n3/3 - 5n*2/2 + 8n + 54. Calculate the smallest common multiple of 34 and s(4). 340 Suppose 23n - 15888 = -n. Suppose 0 = -5g + 2x + 640, 5g - x + 17 - n = 0. Calculate the smallest common multiple of 12 and g. 780 Suppose 6f - 13 + 1 = 0. Suppose -58 - 6 = fv. What is the common denominator of 59/8 and (-248)/v(-4)/14? 56 Let g = -14/53 + 3367/106. Let z = 20011/8 + -2491. What is the common denominator of z and g? 8 Let b(h) = -h3 + 5h*2 - 5h + 4. Let f be b(4). Suppose f = d + 5y + 1, -y = -2y - 1. What is the least common multiple of d and ((-16)/28)/(4/(-14))? 4 Let b = 63065/1229904 + -45/949. Calculate the common denominator of 37/162 and b. 1296 Suppose 5t = w + 37, 3w = 2w - 2. Suppose -h - th = -32. Suppose -3l = i - 8l + 3, 2 = 3i - hl. Calculate the lowest common multiple of 5 and i. 10 Suppose -5 = -5l + 980. Suppose lm + 9 = 198m. Calculate the lowest common multiple of m and 4/(-20) + (-32)/(-10). 9 Suppose 10s = -58s + 93500. What is the least common multiple of 440 and s? 11000 Let p(o) = o2 - 28o + 85. Let x be p(25). Let j = 18 - x. Suppose 9i = -2i + 77. Calculate the lowest common multiple of j and i. 56 Let b(m) = m - 1. Let g(q) = 10q - 6. Let a(i) = -b(i) + g(i). Calculate the smallest common multiple of 564 and a(3). 6204 Let w = -13593774268 - -3921205750358419/288456. Let k = w - 82/1717. Find the common denominator of 41/18 and k. 504 Suppose -38r + 29700 = -43r. Let t = r - -302978/51. Find the common denominator of -47/4 and t. 204 Let b = 163054081/18 - 9065672. Let z = b - -7114. Find the common denominator of 57/2 and z. 18 Let r be (-28082)/7087 - (1 - 0)-4. Let m = 58141/11190 + r. Calculate the common denominator of -51/4 and m. 60 Let j be 212813/10626 + (-116)/638. Let f = -388/21 + j. Find the common denominator of -39/4 and f. 92 Suppose 67z = 76z + 54. Find the common denominator of 0/2 + (-18)/(-40) and (-8)/(-20) + z/(900/3635). 60 Suppose -3x = 2s + s - 1185, 2s - 393 = -x. Let l = -202/471 - 6377/628. Calculate the common denominator of l and x/(-20) - (-4)/(-10). 12 Let h(i) be the first derivative of -i4/4 - 3i*3 - 5i*2 - 4i + 126. Let z(q) = q*2 - 8. Let x be z(0). What is the least common multiple of h(x) and 10? 60 Find the common denominator of -67/56 and ((-5500)/2000)/((18/10)/(-3) - 1). 224 Let q = -6113 - -6117. Calculate the lowest common multiple of 2068 and q. 2068 Suppose 5 = 4o + o. Suppose -9f + o = -10f. Calculate the common denominator of 21/(-72)(f + (-38)/(-7)) and 11/12. 24 Suppose 0 = 5a - 97 - 38. Let y = 32 - a. Calculate the least common multiple of y and (-1 + 0)(3 + 5)/(-1). 40 Let d be 6/(-15) + 2 + 187/5. Let h = -17 + d. What is the common denominator of -13/6 and (1h/(-3))/(5/6)? 30 Let w = 513932 - 1118316077/2176. What is the common denominator of w and -93/68? 2176 Suppose f - 114 = -4f + 4q, 3q - 63 = -3f. Calculate the smallest common multiple of f and 17. 374 Let g be 11 + 891/(-77) - 6/14. Calculate the smallest common multiple of 22g/((-9)/27) and 6. 12 Let x = 227069/20 + -11351. What is the common denominator of x and (-10)/(-10) + ((-1)/(-42))/((-6)/681)? 420 Let l(k) = -513k - 79. Calculate the lowest common multiple of 5 and l(-2). 4735 Let t = -2884 + 3020. Calculate the smallest common multiple of 136 and t. 136 Let s = -5421/748 - 1/374. What is the common denominator of 458/(-808)1 + 81/108 and s? 404 Let a = 14409/910 - 111/7. Find the common denominator of a and 53/55. 1430 What is the common denominator of (7/(-378))/((-80)/1860) and 53/108? 216 Let t = -405121/561210 - -28/4317. Find the common denominator of t and 2 + (1 - -3 - 1390/208). 520 Let p = -17/6825 + -3487286/116025. Let x = 11637/442 + p. What is the common denominator of x and -21/26? 26 Calculate the least common multiple of 44 and (13266/27)/(35/(-6) - (-34 + 28)). 2948 Suppose -6p + 2394690 = -12p. Let f = 221109629/554 + p. Calculate the common denominator of -77/10 and f. 2770 Let t = 69830 + -418993/6. Calculate the common denominator of (5/(-1))/(86/16) and t. 258 Let a = -736773/2482985 - -245/787. Calculate the common denominator of a and -20/5679. 28395 Let t(k) = 3k - 321. Let z(j) = j - 160. Let i(b) = 3t(b) - 7z(b). What is the lowest common multiple of 4 and i(29)? 860 Let d be (-355720)/(-324)429/(-44). Let v = 10704 + d. Calculate the common denominator of 37/180 and v. 540 Let p = 4/3843 + 395093/707112. Let l = -1267/4 + 312. Find the common denominator of p and l. 184 Let g = -32415 + 5445673/168. Let m = 5021/126 - 279/7. Find the common denominator of m and g. 504 Let s = -5604977/447 + 12539. What is the common denominator of 59/48 and s? 7152 Let d be (-4 - 132/(-30))10. Suppose 0f - df + 24 = 0. Calculate the smallest common multiple of f and 158. 474 Let n be (8/10)/(60/750). Let d be (-1)/((1/(-5))/(-3 - -11)). Find the common denominator of -103/20 and 202/48n/d. 480 Let a = -2909 + 3011. What is the least common multiple of 12 and a? 204 Suppose 2x - 5x = -f + 915, 0 = 4f + 3x - 3	{ "pile_set_name": "DM Mathematics" }
2, 3, 163 List the prime factors of 479. 479 List the prime factors of 2440. 2, 5, 61 What are the prime factors of 925? 5, 37 What are the prime factors of 1047? 3, 349 What are the prime factors of 16154? 2, 41, 197 List the prime factors of 1161. 3, 43 What are the prime factors of 9528? 2, 3, 397 List the prime factors of 3060. 2, 3, 5, 17 What are the prime factors of 27358? 2, 13679 What are the prime factors of 49801? 49801 What are the prime factors of 55381? 55381 List the prime factors of 4584. 2, 3, 191 What are the prime factors of 4157? 4157 What are the prime factors of 2563? 11, 233 What are the prime factors of 761? 761 What are the prime factors of 6423? 3, 2141 What are the prime factors of 4047? 3, 19, 71 List the prime factors of 18012. 2, 3, 19, 79 List the prime factors of 17260. 2, 5, 863 What are the prime factors of 65516? 2, 11, 1489 List the prime factors of 2014. 2, 19, 53 What are the prime factors of 761? 761 List the prime factors of 22637. 22637 List the prime factors of 241. 241 List the prime factors of 762. 2, 3, 127 What are the prime factors of 518? 2, 7, 37 List the prime factors of 67928. 2, 7, 1213 What are the prime factors of 36719? 73, 503 List the prime factors of 105195. 3, 5, 7013 What are the prime factors of 386? 2, 193 List the prime factors of 12963. 3, 29, 149 What are the prime factors of 25774? 2, 7, 263 List the prime factors of 1547. 7, 13, 17 List the prime factors of 656. 2, 41 What are the prime factors of 3522? 2, 3, 587 What are the prime factors of 9681? 3, 7, 461 List the prime factors of 21123. 3, 2347 List the prime factors of 846. 2, 3, 47 What are the prime factors of 2403? 3, 89 List the prime factors of 50643. 3, 17, 331 List the prime factors of 1071. 3, 7, 17 List the prime factors of 638. 2, 11, 29 What are the prime factors of 1848? 2, 3, 7, 11 List the prime factors of 39724. 2, 9931 List the prime factors of 12404. 2, 7, 443 What are the prime factors of 73031? 7, 10433 What are the prime factors of 157? 157 List the prime factors of 2308. 2, 577 List the prime factors of 571. 571 What are the prime factors of 85218? 2, 3, 7, 2029 What are the prime factors of 2264? 2, 283 What are the prime factors of 964? 2, 241 List the prime factors of 15238. 2, 19, 401 What are the prime factors of 1278? 2, 3, 71 What are the prime factors of 229? 229 What are the prime factors of 1475? 5, 59 List the prime factors of 102588. 2, 3, 83, 103 List the prime factors of 2111. 2111 List the prime factors of 375. 3, 5 What are the prime factors of 51778? 2, 25889 What are the prime factors of 1339? 13, 103 List the prime factors of 5620. 2, 5, 281 List the prime factors of 2618. 2, 7, 11, 17 What are the prime factors of 6288? 2, 3, 131 List the prime factors of 16508. 2, 4127 What are the prime factors of 30175? 5, 17, 71 What are the prime factors of 5566? 2, 11, 23 What are the prime factors of 5546? 2, 47, 59 List the prime factors of 4539. 3, 17, 89 List the prime factors of 148058. 2, 181, 409 List the prime factors of 15973. 15973 List the prime factors of 76469. 47, 1627 List the prime factors of 18503. 18503 List the prime factors of 45048. 2, 3, 1877 List the prime factors of 916. 2, 229 What are the prime factors of 2152? 2, 269 What are the prime factors of 2721? 3, 907 What are the prime factors of 474? 2, 3, 79 List the prime factors of 12948. 2, 3, 13, 83 What are the prime factors of 107494? 2, 71, 757 List the prime factors of 2659. 2659 What are the prime factors of 818? 2, 409 List the prime factors of 16648. 2, 2081 What are the prime factors of 38024? 2, 7, 97 List the prime factors of 984. 2, 3, 41 List the prime factors of 302. 2, 151 What are the prime factors of 51294? 2, 3, 83, 103 List the prime factors of 2565. 3, 5, 19 What are the prime factors of 22507? 71, 317 What are the prime factors of 4750? 2, 5, 19 What are the prime factors of 4224? 2, 3, 11 What are the prime factors of 1523? 1523 What are the prime factors of 531? 3, 59 List the prime factors of 15692. 2, 3923 What are the prime factors of 481? 13, 37 What are the prime factors of 1357? 23, 59 List the prime factors of 2121. 3, 7, 101 List the prime factors of 2294. 2, 31, 37 List the prime factors of 52792. 2, 6599 What are the prime factors of 766? 2, 383 What are the prime factors of 1907? 1907 What are the prime factors of 13115? 5, 43, 61 What are the prime factors of 1927? 41, 47 List the prime factors of 1869. 3, 7, 89 List the prime factors of 19318. 2, 13, 743 List the prime factors of 682. 2, 11, 31 List the prime factors of 122. 2, 61 What are the prime factors of 24865? 5, 4973 What are the prime factors of 30? 2, 3, 5 List the prime factors of 243. 3 List the prime factors of 4000. 2, 5 What are the prime factors of 912? 2, 3, 19 What are the prime factors of 602? 2, 7, 43 List the prime factors of 343. 7 List the prime factors of 848. 2, 53 What are the prime factors of 6329? 6329 What are the prime factors of 1605? 3, 5, 107 List the prime factors of 1479. 3, 17, 29 What are the prime factors of 18739? 7, 2677 What are the prime factors of 83194? 2, 41597 List the prime factors of 28507. 29, 983 What are the prime factors of 50397? 3, 107, 157 List the prime factors of 8576. 2, 67 List the prime factors of 32344. 2, 13, 311 List the prime factors of 35957. 41, 877 What are the prime factors of 13010? 2, 5, 1301 What are the prime factors of 201321? 3, 22369 What are the prime factors of 2306? 2, 1153 What are the prime factors of 2423? 2423 List the prime factors of 3897. 3, 433 List the prime factors of 7293. 3, 11, 13, 17 What are the prime factors of 10281? 3, 23, 149 What are the prime factors of 948? 2, 3, 79 What are the prime factors of 19239? 3, 11, 53 What are the prime factors of 28571? 28571 List the prime factors of 647. 647 What are the prime factors of 20570? 2, 5, 11, 17 List the prime factors of 3457. 3457 What are the prime factors of 39641? 7, 809 List the prime factors of 220. 2, 5, 11 What are the prime factors of 4875? 3, 5, 13 What are the prime factors of 664? 2, 83 What are the prime factors of 1167? 3, 389 What are the prime factors of 1416? 2, 3, 59 What are the prime factors of 26797? 127, 211 List the prime factors of 16230. 2, 3, 5, 541 List the prime factors of 10731. 3, 7, 73 What are the prime factors of 2983? 19, 157 List the prime factors of 1466. 2, 733 What are the prime factors of 845? 5, 13 What are the prime factors of 13977? 3, 1553 What are the prime factors of 4712? 2, 19, 31 What are the prime factors of 221? 13, 17 What are the prime factors of 4756? 2, 29, 41 List the prime factors of 8444. 2, 2111 List the prime factors of 8028. 2, 3, 223 What are the prime factors of 135? 3, 5 What are the prime factors of 5151? 3, 17, 101 What are the prime factors of 315? 3, 5, 7 What are the prime factors of 1499? 1499 What are the prime factors of 3606? 2, 3, 601 What are the prime factors of 1278? 2, 3, 71 List the prime factors of 10555. 5, 2111 What are the prime factors of 345? 3, 5, 23 What are the prime factors of 3558? 2, 3, 593 What are the prime factors of 614? 2, 307 What are the prime factors of 17051? 17, 59 What are the prime factors of 769? 769 What are the prime factors of 103971? 3, 7, 4951 What are the prime factors of 1953? 3, 7, 31 List the prime factors of 22469. 22469 List the prime factors of 8195. 5, 11, 149 What are the prime factors of 133213? 133213 What are the prime factors of 40790? 2, 5, 4079 What are the prime factors of 1243? 11, 113 What are the prime factors of 573? 3, 191 List the prime factors of 43336. 2, 5417 What are the prime factors of 17087? 7, 2441 List the prime factors of 129. 3, 43 List the prime factors of 163613. 163613 List the prime factors of 42973. 7, 877 List the prime factors of 737. 11, 67 List the prime factors of 4391. 4391 What are the prime factors of 20819? 109, 191 List the prime factors of 6974. 2, 11, 317 List the prime factors of 6072. 2, 3, 11, 23 What are the prime factors of 2279? 43, 53 What are the prime factors of 3557? 3557 What are the prime factors of 1504? 2, 47 What are the prime factors of 9181? 9181 List the prime factors of 156. 2, 3, 13 List the prime factors of 1349.	{ "pile_set_name": "DM Mathematics" }
2802. Round l to the nearest 1000. 83000 Let m = -88 - -102.5. Let q = m - 8.6. Let s = q + -5.90495. Round s to four dps. -0.005 Let t be ((6 - 30/5) + -43)(-1677)/3. Round t to the nearest one thousand. 24000 Let c(f) = -5f + 15. Let y(p) = -10p + 31. Let s(v) = -5c(v) + 2y(v). Let n be s(-19). Round n to the nearest ten. -110 Let z = -100108.7 + 94890. What is z rounded to the nearest 10? -5220 Let n = -884144.72374302 - 96320409.27616798. Let m = 97204710 + n. Let j = m + -156. What is j rounded to five dps? 0.00009 Let w(f) = -f3 + 8f*2 + 32f + 20. Let d be w(11). Suppose 5886000 = 18k - dk. What is k rounded to the nearest 10000? 650000 Let n = 6120.61 + -6075. Round n to the nearest integer. 46 Let h = -0.010876039 + 0.01088. Round h to six dps. 0.000004 Let l = -12258 - -53548. What is l rounded to the nearest 10000? 40000 Let y = 89 - 87. Let g be 128184938/155 - (-3)/(15/y). What is g rounded to the nearest 10000? 830000 Let g = -406.43740573 - -384.4374049. Let s = -21.964 - 0.036. Let x = g - s. Round x to 7 decimal places. -0.0000008 Let p = 3183.2 - 3183.19843549. What is p rounded to 4 dps? 0.0016 Let i = 1268494743394.379991 - 1268495644165. Let q = i + 900771. Let d = q - 0.38. What is d rounded to six decimal places? -0.000009 Let u = 178.3 - 164.604. Let q = 0.096 - u. Round q to the nearest 10. -10 Suppose 5s = 53 - 28. Suppose 5g - 3g + 41492 = sm, m + 2g - 8308 = 0. What is m rounded to the nearest 10000? 10000 Let t = -0.5389 + -181.7611. What is t rounded to the nearest ten? -180 Let s = 0.16568 + -0.246814. Round s to 2 decimal places. -0.08 Let m = 20458.5 + -20541.927. What is m rounded to one decimal place? -83.4 Let u = -0.235 + 107.235. Let k = -76.56699 + -30.43307. Let v = u + k. What is v rounded to three decimal places? 0 Let l = -0.086 + -26.414. Let y = 54 - 25. Let t = y + l. What is t rounded to zero decimal places? 3 Let v = 203320045.02 - 203320035.036579729. Let n = 0.016580379 + v. Let s = -10 + n. Round s to seven dps. 0.0000007 Let o = -472.04338 + -216.9267. Let b = o + 689. Round b to 3 decimal places. 0.03 Let c(w) = -119419w*2 + 39w + 28. Let m be c(-11). What is m rounded to the nearest 100000? -14500000 Let o(m) = -579995m + 75. Let t be o(-12). Suppose 0 = b + g + 1740003, 4g + g = -4b - t. What is b rounded to the nearest one million? -2000000 Suppose 402x + 178217 = 411x + 48437. What is x rounded to the nearest 100? 14400 Let c = 20151.495006 - -0.004994. What is c rounded to the nearest 1000? 20000 Let k = -104677848 + 73148848. Round k to the nearest one hundred thousand. -31500000 Suppose 2s + o - 171 = 0, -5s + 3o + 191 = -3s. Let p be (s/(-12) - -2) + (-8)/12. Let m be (p/4)/(2(-2)/216). Round m to the nearest one hundred. 100 Suppose 3b + 95k - 26646012 = 99k, 5k + 17764015 = 2b. What is b rounded to the nearest one million? 9000000 Let k = -417 - -419.216. Let p = k + -0.106. Let i = -2.11099 + p. Round i to 4 decimal places. -0.001 Let c = -76 + 76.65. Let u = -0.6499959 + c. What is u rounded to 7 decimal places? 0.0000041 Let n = 12273.8 - 11831. What is n rounded to the nearest 10? 440 Let r(y) = 158 - 171 - 4y + 3y. Let t be r(-13). Suppose t = -7v + 4v + 90000. Round v to the nearest 10000. 30000 Let b = -331.70001591 - -331.7. What is b rounded to five dps? -0.00002 Let u = 8327 - 8326.96439. Let z = u - 0.033081. What is z rounded to 4 dps? 0.0025 Let h = -198 - -61. Let w = h + 141.75. What is w rounded to 1 dp? 4.8 Let m = 127.83 - 129. Let c = -1.1699857 - m. Round c to 6 decimal places. 0.000014 Let k = 17451.015126 + -17451. What is k rounded to three decimal places? 0.015 Let z = 38.944 - 38.06405. Let j = z - 0.18. Let t = j - 0.7. What is t rounded to four decimal places? -0.0001 Let d = -163079002 + 107225632. Let q = d - -55853376.4200459. Let j = q - 6.42. What is j rounded to five decimal places? 0.00005 Let f(v) = -17v - 26. Let p be f(-7). Let l = -92 + p. Let w be 0/((-1)/((-1)/l)). What is w rounded to six dps? 0 Suppose -4o + 145 = 2t + 3t, -4o + 100 = -4t. Let w be (-1o)/6 + 844005. Round w to the nearest ten thousand. 840000 Let a = -2537.05 - -219219.05. Let p = a + -216695.49981. Let w = p - -13.5. What is w rounded to 4 dps? 0.0002 Let f = -4.61 + 7.14. Let r = 2.5298454 - f. Round r to five decimal places. -0.00015 Let z = 80668.99999926607 - 80669. Round z to seven decimal places. -0.0000007 Let y = 642.811 + -643.0572714. Let a = y - -0.246. Round a to 5 decimal places. -0.00027 Let i = -354 - -379. Suppose 21q + iq = 435160000. Round q to the nearest 1000000. 9000000 Let v(p) = -26087p + 1258. Let q be v(4). What is q rounded to the nearest 10000? -100000 Let j = -187.695 - 1.605. Let v = 182.363 + -0.363. Let n = j + v. What is n rounded to the nearest 10? -10 Let v = 0.15987 + -17.36587. What is v rounded to one dp? -17.2 Let a = 47452410 + -179872410. Round a to the nearest 1000000. -132000000 Let b = -3.954 - -4. Let o = -93 - -92.921. Let h = b - o. What is h rounded to 2 decimal places? 0.13 Let s = -327656.468 - -328511. Let y = 860 - s. Round y to the nearest integer. 5 Let k = -24941562 - -24941556.9900035. Let g = k - -5.01. What is g rounded to 7 decimal places? 0.0000035 Let r = -5277957.10954 - -5278001. Let x = -0.05846 + r. Let f = x + -0.032. What is f rounded to the nearest ten? 40 Let b = -0.513 + 0.82. Let a = b - 0.30700593. Round a to six dps. -0.000006 Let a = -0.01354 + 0.03754. Let f = -170.97462 + 171. Let z = f - a. What is z rounded to four dps? 0.0014 Let v = -0.00981 - -1.53651. Round v to two dps. 1.53 Let j = 0.157837289 - 0.1579. Round j to 7 dps. -0.0000627 Let g = 0.38485 + 215.52515. What is g rounded to the nearest 10? 220 Let c = -485.305489 - -485.584. Let x = c - -3.121514. Let v = x + -3.4. What is v rounded to 6 dps? 0.000025 Let t = -61991 + 61990.9999939034. What is t rounded to 6 dps? -0.000006 Let c = 8 + 174. Let b = c - 181.882. What is b rounded to 2 decimal places? 0.12 Let l = 583786372179596220 + -583786360957095114.99999818. Let b = 11222501004 - l. Let g = 101 + b. Round g to seven decimal places. -0.0000018 Let v = 91.8 - -16.2. Let s = -64 + v. Let r = s + -44.0000047. Round r to 6 decimal places. -0.000005 Let h = 1320 + -1319.992046. Round h to 3 decimal places. 0.008 Let l = 93 + -11.3. Round l to the nearest one hundred. 100 Let g = -4672.6 - -4218. Let o = 429 + g. Round o to the nearest integer. -26 Let y = 30330.59469 + -30331. Round y to 2 decimal places. -0.41 Suppose -3i = -16m + 18m - 57, 5i - 18 = -m. Suppose 34g - 834 = mg. What is g rounded to the nearest ten? 830 Let p = -2516.54 - -2480. Round p to the nearest ten. -40 Let x = -56.272 + 29.126. What is x rounded to 1 dp? -27.1 Let v = -74746704.999994 - -74747051. Let u = v - 346. What is u rounded to five decimal places? 0.00001 Let l = 31.71817 - -0.07183. Round l to the nearest 10. 30 Let p = -0.243 + 0.064. Let z = -169.179 - p. Let c = -169.000067 - z. What is c rounded to four dps? -0.0001 Let s = -28244.137001879 - -28243.4921. Let r = 11.055096791 - s. Let c = 11.7 - r. What is c rounded to 7 decimal places? 0.0000013 Let k = -0.044352 - -0.04528753. What is k rounded to 5 decimal places? 0.00094 Let f = 1.78 - 1.79782. Round f to 3 dps. -0.018 Let r = -142 + 362. Let t = 239 + r. What is t rounded to the nearest 10? 460 Let n = -657.6502654 - 4442.3473676. Let q = -5100 - n. What is q rounded to four decimal places? -0.0024 Suppose -2 = 28o - 29o. Suppose -w - 478 = -os - 0s, -2w = -8. Suppose 2x + p - s = -2x, 3p = 3x - 162. What is x rounded to the nearest ten? 60 Let q(p) = 8p3 - 66p*2 - 6p - 6. Let w be q(-9). Round w to the nearest ten thousand. -10000 Let k be 2/(-7) + (-186)/(-14) + -1. Let f be (-39266)/(-22) + k/66. What is f rounded to the nearest 100? 1800 Let m(u) = -7 + 72u + 3 - 12 - 8. Let n be m(7). Let x be (n/(-14))/(((-9)/158375)/9). Round x to the nearest 1000000. 5000000 Let a = -7721.75611 + -860.20498. Let j = a + 8582. What is j rounded to three dps? 0.039 Suppose 6j + 1 + 11 = 0. Let m(r) be the first derivative of r**3/3 + r + 7. Let s be m(j). What is s rounded to 0 dps? 5 Let r = 1220293224.5 + -1223156253.49934. Let t	{ "pile_set_name": "DM Mathematics" }
emainder when 1/(p/(-237) - -3) is divided by r? 19 Let x = 66 + 28. Let p(o) = 11o3 + 3o*2 - 3o + 2. Let y be p(2). Calculate the remainder when x is divided by (-1)/(-23/y). 14 Suppose -5h + 25 + 10 = 0. What is the remainder when ((-15)/(-2))/((-28)/(-16) + -1) is divided by h? 3 Let w(v) = -3v + 8. Let t = 85 - 92. What is the remainder when w(t) is divided by 10? 9 Suppose b - 3 = -0, 0 = 2v - 4b + 14. Let q be 45 + 1 - v - -3. Calculate the remainder when 46 is divided by 5/(-10) - q/(-4). 10 Suppose -2052 = -55g + 4658. Calculate the remainder when g is divided by 5. 2 Let d = 251 + -170. Let q(i) = 2i2 + 6i - 66. What is the remainder when d is divided by q(5)? 11 Calculate the remainder when 172 is divided by 261/1 + 10. 28 Suppose 2a + 3d - 36 = -0a, -3d = -2a + 24. Calculate the remainder when a is divided by 11. 4 Let m(d) = -99d - 26. Calculate the remainder when m(-3) is divided by 11. 7 Let w(g) = -g2 + 9g - 10. Suppose 2v = 88 - 38. Calculate the remainder when v is divided by w(5). 5 Suppose 24p - 90 = 19p. Calculate the remainder when 72 is divided by p. 0 Let y = -1 - 14. Let z be (54 - 56)(-1)/(2/3). What is the remainder when 8z/y-25 is divided by 14? 12 Suppose -f = 4f - 5, 5q = -3f - 322. Let b = q - -91. Calculate the remainder when 101 is divided by b. 23 Let c(a) = -a3 - 4a*2 - 13a - 13. Calculate the remainder when c(-4) is divided by 0 + (-1 - (-13 - -2)). 9 Let y = 814 - 774. What is the remainder when 202 is divided by y? 2 Let y = 170 + -71. Let i = -44 + y. What is the remainder when i is divided by 231/12 + 2/(-8)? 17 Suppose -4g - 7g + 187 = 0. What is the remainder when 406 is divided by g? 15 Let u(b) = b - 8. Let w be u(2). What is the remainder when 25 is divided by (-86)/w - 5/15? 11 Let q(o) = 4o + 1. Let w = -2 - -3. Let b = -296 - -304. What is the remainder when b is divided by q(w)? 3 Calculate the remainder when 1 + (-10)/4 + (-21641)/(-134) is divided by 142. 18 What is the remainder when 6/(-4)(-2 + 3080/(-30)) is divided by 67? 23 Suppose 0 = k - 2c - 6, -k + 0c + 3c + 7 = 0. Suppose -kb + 4s = -2b - 128, 0 = 5b + 4s - 250. What is the remainder when b is divided by 19? 16 Suppose -2b + 50 = 4t - 12, 4b + 4t = 116. Suppose l = 5s - 401, -s = -5s - 2l + 318. Calculate the remainder when s is divided by b. 26 Let x(n) = 2n*3 - 7n*2 + 6n. Suppose -49d + 52d - 351 = 0. Calculate the remainder when d is divided by x(4). 37 Let j(h) = 34h - 45. Calculate the remainder when 160 is divided by j(2). 22 Let r(f) = f3 - 18f*2 + 18f + 176. What is the remainder when r(17) is divided by 15? 13 Let v(w) = 5w + 39. Calculate the remainder when v(13) is divided by 10. 4 Let w = 643 - 604. Calculate the remainder when w is divided by 24. 15 Let n be (-138)/(-9) + 2/(-6). Suppose 0 = -5y + n, -2t - 18 + 65 = 5y. What is the remainder when 623/(-6)-1 is divided by t? 15 Suppose 3c = -2f - 2, f - 3c - 3 = 5. Let v be (f - 3)-11 + -2. Suppose 5n = vn - 124. Calculate the remainder when n is divided by 17. 14 Let b be 96/432 + (0 - (-130)/(-18)). Let z(l) = -l*3 - 6l*2 + 8l + 10. What is the remainder when 21 is divided by z(b)? 0 Let a = -13 + 14. Suppose 4l + 5t - 3 = 50, -3t = -3l + 6. What is the remainder when l is divided by 2a/(-2)-3? 1 Let j(u) = 7u + 124. Calculate the remainder when 93 is divided by j(-15). 17 Let o(s) = 3s + 5. Let b(d) = -d*2 + 20d - 33. Calculate the remainder when b(5) is divided by o(4). 8 Suppose 0 = -5h - 26 + 91. Let x(z) = 4z*2 - 7z + 78. Calculate the remainder when x(4) is divided by h. 10 Suppose 3n = -5r + 76, -5n + 8 = r + 6. What is the remainder when r is divided by 5? 2 Let t = 73 + -66. Calculate the remainder when 390 is divided by t. 5 Suppose 0 = -14v + 25v - 66. Let j(x) = 3x*2 + 16x - 48. What is the remainder when j(v) is divided by 53? 50 Suppose -25t - 19 + 369 = 0. What is the remainder when 488 is divided by t? 12 Let f = -31 + 33. Suppose -fp + 6p - 298 = 2i, 3p - 2i = 225. What is the remainder when p is divided by 19? 16 Suppose -646g = -621g - 27800. What is the remainder when g is divided by 21? 20 Let m = 345 + -232. Let c = m - 67. Calculate the remainder when c is divided by 10. 6 Let n = -31 - -65. Suppose -4v = 0, -34 = -4w - 3v + n. What is the remainder when w is divided by 10? 7 Suppose 202 - 767 = -5c + 5m, 0 = -c + 4m + 113. Suppose -34 = 4u - 42. Suppose -131 = -uw - 73. What is the remainder when c is divided by w? 26 Calculate the remainder when ((16/(-56))/1)/(1/(-119)) is divided by 17. 0 Let j be (2/4)/((-1)/(-22)). Let m(d) = d3 + d2 - 3d + 49. Let n be m(0). Let u = n - j. What is the remainder when u is divided by 10? 8 Suppose p - 9 = -4. Suppose -22 = pr - 62. Calculate the remainder when 21 is divided by r. 5 Suppose -5h = 4m - 59, 2h + 33m = 37m + 18. What is the remainder when 207 is divided by h? 9 Let g = -654 - -665. What is the remainder when g is divided by 3? 2 Let s = 4 - 2. Suppose -3z - x = -6x + 32, 0 = -4z - sx - 34. Let r(c) = c3 + 9c*2 - 2c - 6. Calculate the remainder when 47 is divided by r(z). 11 Let h = 266 - 55. Calculate the remainder when h is divided by 43. 39 Suppose 871l - 881l + 280 = 0. Let h be (-4 - -2)159/6. Calculate the remainder when (-8)/2h/4 is divided by l. 25 Let u = -83 + 141. Suppose -5o + u = -7. Calculate the remainder when 21 is divided by o. 8 Suppose 5u + 8 = 6u. Calculate the remainder when 30 is divided by u. 6 Suppose s + g = 48, 2s - 3g - 218 = -122. What is the remainder when s is divided by 7? 6 Let u = -117 - -251. Suppose -42y = -40y - u. What is the remainder when y is divided by 7? 4 Let h = 44 + -15. Suppose 2v = -2c + 3v + h, 68 = 4c - 4v. Calculate the remainder when 31 is divided by 52/6 - 8/c. 7 Calculate the remainder when (-40)/8 + 1 - 146/(-2) is divided by 4. 1 Let k = -799 + 908. Calculate the remainder when k is divided by 39. 31 Suppose -38j - 8 = -34j, 3b = -4j + 61. What is the remainder when b is divided by ((-13)/(-3))/(2/6)? 10 Let m = 84 - 47. Calculate the remainder when (-2)/(-15) - 2173/(-15) is divided by m. 34 Let w(b) = b*3 - 2b*2 + 7b - 4. What is the remainder when w(5) is divided by 50? 6 Suppose -2 = -y + 3f, y - 2f - 26 = -19. Let r(l) = -28l. What is the remainder when r(-1) is divided by y? 11 Suppose -6 = -22g + 24g. Let a(i) = i3 + 3i*2 - 6i - 8. What is the remainder when 28 is divided by a(g)? 8 Suppose 0 = -2c - 28q + 24q + 132, -24 = -6q. Calculate the remainder when c is divided by 32. 26 Let n(z) = 14z2 + 3z - 11. Calculate the remainder when n(2) is divided by 19. 13 Suppose -4t + 126 = -2r, -2r + 0r - 24 = -t. Suppose 5v - 240 + 15 = 0. Suppose v = 3u + 2u. Calculate the remainder when t is divided by u. 7 Suppose -2r + 124 = 5n, -r + 4r - 186 = -3n. What is the remainder when r is divided by 11? 7 Suppose 5p - 454 = 3z, 5p - p + 4z = 376. Let d(l) = 49l3 - l2 - l + 1. Calculate the remainder when p is divided by d(1). 44 Let q = 41 + -49. What is the remainder when (-4)/22 + q + (-12719)/(-77) is divided by 32? 29 Let y = 45 - 70. Let l = y - -42. What is the remainder when l is divided by (-2)/(3/(-33))? 5 Let x(h) = h2 + 2h - 17. Suppose n - 6 = 10. Calculate the remainder when x(-10) is divided by n. 15 Suppose -69 = -4c + l, 8l + 24 = c + 10l. Calculate the remainder when 57 is divided by c. 3 Let h be 11 + -6 - (-1 + 4). Suppose 23g = 24g - h. Let c(q) = -q3 + 2q*2 + q. What is the remainder when g is divided by c(2)? 0 Let j = -121 + 179. Calculate the remainder when 114 is divided by j. 56 Let u = -1 + 16. Let b = -7 + u. Let l = 11 - b. What is the remainder when l is divided by 2? 1 Suppose -5t + 77 = 2t. Suppose 2h - 4 = -0h. Suppose 0 = hw + w - 126. What is the remainder when w is divided by t? 9 Let i = 371 - 147. Calculate the remainder when i is divided by 9. 8 Let m(s) = 88s + 769. What is the remainder when 93 is divided by m(-8)? 28 Let d be ((-1)/(-1))/((-2)/154). Suppose b - 128 = -0b - 3x, 5x = -3*b + 384. Let m = b + d. What is the remainder when m is divided by 18? 15 Let m be (-2 + (-21)/(	{ "pile_set_name": "DM Mathematics" }
17/5q + 1/5q2. -(q - 1)2(q + 3)(q + 4)/5 Let r(y) be the second derivative of y*6/10 - 3y*5/4 - 11y*4/2 - 8y*3 - y - 6. Factor r(t). 3t(t - 8)(t + 1)(t + 2) Let h(z) = z2 + 7z - 2. Let x be h(-2). Let q be 0 + (x/7)/((-99)/154). Factor -4y + 4/3y*2 + q. 4(y - 2)(y - 1)/3 Let z(s) be the first derivative of s6/6 - 11s*5/15 + 7s*4/6 - 2s3/3 - s2/6 + s/3 + 61. Let z(b) = 0. Calculate b. -1/3, 1 Factor 25/2s2 - 15/4s*3 - 15/4s + 0. -5s(s - 3)(3s - 1)/4 Let m(d) = -d*3 + 33d*2 + 121d + 131. Let o(p) = -p*3 + p - 1. Let k(q) = m(q) - 4o(q). Factor k(s). 3(s + 3)2(s + 5) Suppose q + 0 - 4 = 0, 2v - 4q = 26. Factor 24y2 - 51y + 48y3 - 16y + 3y5 - 48 + 19y + vy4. 3(y - 1)(y + 2)4 Let p be (((-279)/100)/((-6)/4))/(-3). Let z = -3/25 - p. Factor -1/4y + 3/4y3 + 0 + zy*2. y(y + 1)(3y - 1)/4 Let o be (-6)/(-4) - 50/(-4). Factor 70x2 - 38x*2 + 12 - 30x*2 - ox. 2(x - 6)(x - 1) Suppose -3 = -4t + q + 8, -2t - 5q = -33. Suppose 24 = th + 2h. Factor -5c*2 + 6c - 4 - c + hc2. -(c - 4)(c - 1) Let z = -254/7 + 2801/77. Let t(q) be the first derivative of -5 + 0q + zq*2 - 1/22q*4 + 0q3. What is w in t(w) = 0? -1, 0, 1 Let t(z) be the first derivative of z4/8 + z3/3 + z2/4 - 44. Suppose t(i) = 0. What is i? -1, 0 Let m be ((-126)/70 - -2) + 4. Suppose 3g = -2v - 2, 2v - 5g - 25 = 5. Solve 48/5fv - 69/5f*3 + 21/5f*2 + mf - 24/5f4 + 3/5 = 0 for f. -1, -1/4, 1 Let v = 32 + -25. Solve -2p + vp3 + p5 + 7p*5 + 13p*3 + 5p*2 - 35p*4 + 4p5 = 0. -1/3, 0, 1/4, 1, 2 Let j(g) be the third derivative of -g5/140 - 43g4/56 + 22g*3/7 - 2g*2 - 2. Suppose j(y) = 0. What is y? -44, 1 Let 3a + a*4 + 10a*2 + 0 - 31/4a*3 = 0. Calculate a. -1/4, 0, 2, 6 Let g(l) be the second derivative of 0 + 0l*3 - 1/108l*4 - 8l - 1/270l6 - 1/90l*5 + 0l2. Factor g(s). -s2(s + 1)2/9 Let v(i) be the first derivative of 1/7i*3 + 9/7i - 6/7i2 - 8. Factor v(l). 3(l - 3)(l - 1)/7 Let r(m) = m. Let h be r(5). Let f be (45 - h)(-6)/(-15). Suppose -8 + 18p3 + 2p*2 - 20p + 4p2 - 12p + fp = 0. Calculate p. -2/3, 1 Let w(l) be the third derivative of -l6/1200 + 7l5/600 + l4/60 - 7l3/15 - 321l*2. Factor w(q). -(q - 7)(q - 2)(q + 2)/10 Let c(h) be the third derivative of h7/8820 + h6/840 - h5/105 + 7h*4/8 - 2h*2. Let g(b) be the second derivative of c(b). Factor g(z). 2(z - 1)(z + 4)/7 Factor 2b*3 + 36/7 - 4/7b*2 - 18b. 2(b - 3)(b + 3)(7b - 2)/7 Suppose -16 = 4v, 2w - v + 6 = 18. Let g(j) be the third derivative of 0 + 0jw + 0j*3 + 0j - 1/180j5 + 7j*2 + 1/360j6. Factor g(m). m2(m - 1)/3 Let d = 65 + -58. Let g be (-3)/212/(-9). Determine v, given that -20v2 + 6 + dv - 4v - 3v*3 + 14v*g = 0. -2, -1, 1 Suppose 51 = 3c + 12. Let k = c + -9. Factor -2q3 + 0q*5 + 9q2 + qk + 2 - 3q4 - q2 + q5 - 7q. (q - 1)*4(q + 2) Let k be (-97)/(-291) - (2 + -2). Solve -1/3b4 - 1/3b*3 + 1/3b + 0 + kb2 = 0. -1, 0, 1 Let k(w) be the first derivative of -w3/12 + 2w*2 - 16w + 281. Factor k(f). -(f - 8)*2/4 Let p(d) be the first derivative of 2d*2 + 6d*4 + 7d*3 - 15d*3 + 9 + 3d*4. Factor p(r). 4r(3r - 1)*2 Suppose -86v + 64 = -70v. Let n(z) be the third derivative of 0z*3 - 1/20z*5 + 1/8z*v - 1/40z*6 + 1/70z*7 + 0 + 0z - 6z2. Solve n(o) = 0 for o. -1, 0, 1 Let q(i) be the third derivative of 19i5/270 + i4/12 - 10i3/27 + 45i*2 + 2i. Factor q(c). 2(c + 1)(19c - 10)/9 Let z(b) be the first derivative of 30 + 8b - 13/3b2 + 2/9b*3. Factor z(x). 2(x - 12)(x - 1)/3 Let d be (-1 + -3)/(-2 + 0). Determine g so that -3g - 4gd - 3g*3 - 3g2 + g2 = 0. -1, 0 Let f(v) be the second derivative of -3v5/20 + 29v*4/4 - 112v*3 + 294v*2 - 524v + 2. Suppose f(i) = 0. What is i? 1, 14 Let t(v) be the second derivative of -v*4/12 - 7v*3/6 + v - 28. Factor t(u). -u(u + 7) Let u be (-4)/14 - (-32)/14. Suppose 3x + 4 = f + 4f, -uf = -4. Suppose -3d*4 + 4d - 2d - 7d*3 - 5d*x + d - 4d*3 = 0. Calculate d. -3, -1, 0, 1/3 Let z(p) be the first derivative of 1/18p*6 + 1/3p*2 + 1/9p*3 + 5 - 1/4p*4 + 0p - 1/15p5. Find g, given that z(g) = 0. -1, 0, 1, 2 Let w(o) be the first derivative of -26o*3/27 - 37o*2/9 + 4o/3 - 172. Factor w(b). -2(b + 3)(13b - 2)/9 Let r(j) = -6j*2 + 328j + 6125. Let n(m) = m*2 - 66m - 1225. Let d(l) = 11n(l) + 2r(l). Factor d(a). -(a + 35)*2 Find r, given that 155r - 20r4 - 18r*2 + 199r*3 - 69r*3 + 38r*2 - 167r*2 - 40 - 5r*5 - 73r*2 = 0. -8, 1 Factor 0 - 70q*3 - 55/2q*2 - 75/2q*4 + 5q. -5q(q + 1)*2(15q - 2)/2 Let w = 25967/28 + -6490/7. Factor ws*3 - 1/4s*4 + 1/2 + 3/4s*2 - 5/4s. -(s - 1)*3(s + 2)/4 Let n(d) be the second derivative of -3d6/2 + 25d*5/4 - 5d*4 - 10d*3/3 - 3d + 36. Factor n(a). -5a(a - 2)(a - 1)(9a + 2) Factor 0 - 22o*3 - 1/4o*5 + 48o*2 + 4o*4 - 36o. -o(o - 6)2(o - 2)*2/4 Let h be -1 + (-50)/(-22) - 0/5-1. Determine a, given that 12/11a - h + 2/11a*2 = 0. -7, 1 Let d = 7 + -3. Suppose dq - 5p + 9 = 0, 7p = 2q + 5p + 2. Let -4k2 - 2k + qk2 - k - 3k*2 = 0. What is k? -1, 0 Let a = -2/715 + 191/17160. Let b(y) be the second derivative of -1/18y*4 - 1/9y*3 + 0 - ay*5 + 0y*2 + 4y. Factor b(z). -z(z + 2)2/6 Let w(g) be the first derivative of -2g*6 - 63g*5/5 - 123g*4/4 - 37g*3 - 45g*2/2 - 6g + 220. Find r such that w(r) = 0. -2, -1, -1/4 Let p(u) = u*3 - 5u*2 - 7u + 13. Let g be p(6). Suppose -a = 6a - g. Find i such that 2i*2 - 1/2i*3 + a - 5/2i = 0. 1, 2 Let k be (1/(-2)3)/(48/(-416)). Let b(p) be the second derivative of kp + 1/2p4 + 0 + 0p*3 - 2/5p*5 + 0p*2 + 1/15p*6. Suppose b(y) = 0. What is y? 0, 1, 3 Suppose 2c - 3d + 9 = 5c, -2c = -d - 9. Determine f, given that -4f*5 + 8f*3 + 2f*5 - 2f*c + 8f*2 + 0f5 = 0. -2, -1, 0, 2 Let o(j) be the third derivative of j8/3024 + j7/1890 - j6/216 + j5/180 - j2 + 12. What is q in o(q) = 0? -3, 0, 1 Suppose 5q + 148 = 3y, 2y + 0q - 2q - 92 = 0. Let 12f + f*4 - y - 9f*2 - 12f*3 - 4f*4 + 53 = 0. Calculate f. -2, -1, 1 Let d(p) = -9p - 4p + 15p + 3p4 - p2 + 2 - 2p3. Let t(n) = -n4 - 1. Let w(x) = -d(x) - 2t(x). Determine y so that w(y) = 0. -1, 0, 1, 2 Let s(i) = -6 + 5 - 2i3 + i2 + 0i2 + i3. Let x(q) = 2q*3 - 6q*2 - 4q*2 + 4 + 4q*3. Let h(o) = 4s(o) + x(o). Factor h(r). 2r2(r - 3) Let k(b) be the third derivative of 3/4b3 - 3b*2 + 1/80b*6 + 0 - 5/16b*4 + 0b + 1/40b5. Find j such that k(j) = 0. -3, 1 Suppose 20 = 5p - 2x, 3p + 8x = 3x + 12. Suppose -8/7 - 18i5 + 142/7i*3 + 18i*2 - 16/7i - 118/7ip = 0. What is i? -1, -2/9, 2/7, 1 Solve 23m*4 - 20m*2 + 4m*5 + 30m - 6m - 26m*3 - 3m*4 - 2m*3 = 0 for m. -6, -1, 0, 1 Let c(d) be the first derivative of 1/35d*5 + 0d + 1/21d3 + 1/14d*4 + 0d2 - 24. Factor c(h). h2(h + 1)2/7 Find v, given that 20/3v - 2/3v3 - 16/3 - 2/3v*2 = 0. -4, 1, 2 Let c be (-3)/(-5) + (-1 - (-4179)/35). Let z = 122 - c. Factor 0w + 3/5w4 + 0 + 1/5w*2 - 1/5w*5 - 3/5wz. -w2(w - 1)3/5 Let r(t) be the second derivative of t6/540 + t5/270 - 13t*2/2 - t. Let d(k) be the first derivative of r(k). Factor d(c). 2c*2(c + 1)/9 What is k in 1/2 - 3/4k2 + 1/4k - 1/4k3 + 1/4k*4 = 0? -1, 1, 2 Let u(a) = -2a*2 - 40a - 292. Let k(b) = -4b2 - 78b - 585. Let x(v) = -4k(v) + 9u(v). Factor x(m). -2(m + 12)2 Let o(c) = 2 + 4c*2 + 3 - 7c - 5c - 2c2. Let q(t) = -t2 + 6t - 3. Let y(n) = -6o(n) - 13q(n). Factor y(m). (m - 3)2 Let k(v) = 2v*2 + 20v + 12. Let t be k(-10). Determine m, given that 0m + 8 - 21 + 1 + tm - 3m2 = 0. 2 Suppose 0 = 121h - 170 - 193. Let 0 - 2y + 5/3y*h + 13/3y*2 = 0. Calculate y. -3, 0, 2/5 Solve 2/9w*4 + 0w + 0w3 - 2/9w*2 + 0 = 0. -1, 0, 1 Let n(k) = 21k*2 + 90k + 19. Let f(p) = -p*3 + 6p*2 - 4p - 4. Let h be f(5). Let x(v) = 1. Let z(q) = hn(q) + 5x(q). Factor z(s). 3(s + 4)(7*s + 2) Let l(h) be the first deri	{ "pile_set_name": "DM Mathematics" }
is the greatest common factor of 192038 and 522? 58 What is the highest common factor of 10 and 45834? 2 Calculate the greatest common divisor of 34505 and 14935. 515 Calculate the highest common factor of 3067419 and 93. 93 Calculate the greatest common factor of 680 and 7344. 136 Calculate the highest common divisor of 508 and 358013. 127 Calculate the highest common factor of 120 and 8616. 24 Calculate the highest common divisor of 15929 and 476. 17 What is the greatest common divisor of 24 and 2334306? 6 What is the highest common factor of 15554 and 154? 154 What is the highest common factor of 214302 and 714? 102 Calculate the highest common factor of 15488 and 81152. 128 What is the greatest common divisor of 152303 and 4743? 527 Calculate the greatest common factor of 199350 and 4. 2 Calculate the greatest common divisor of 93 and 20739. 93 Calculate the greatest common divisor of 139674 and 6. 6 What is the greatest common factor of 45246 and 30? 6 What is the greatest common divisor of 667632 and 336? 336 What is the highest common factor of 280 and 1620? 20 Calculate the greatest common factor of 230 and 1065. 5 What is the highest common divisor of 6716 and 6440? 92 What is the highest common divisor of 30 and 75120? 30 Calculate the highest common factor of 2949778 and 26. 26 Calculate the greatest common divisor of 574 and 4662. 14 Calculate the greatest common divisor of 40117 and 21. 7 What is the greatest common factor of 2629 and 16969? 239 What is the highest common factor of 881435 and 519? 173 Calculate the greatest common factor of 1208 and 4450876. 604 What is the highest common divisor of 3726 and 276? 138 What is the greatest common divisor of 185200 and 600? 200 Calculate the greatest common factor of 590505 and 25. 5 What is the greatest common divisor of 3196385 and 1910? 955 What is the greatest common factor of 21406 and 231? 77 Calculate the highest common factor of 94490 and 220. 110 Calculate the greatest common divisor of 168 and 14376. 24 What is the greatest common divisor of 222788 and 8? 4 Calculate the greatest common factor of 244215 and 15. 15 Calculate the highest common divisor of 1107 and 109962. 369 Calculate the highest common factor of 1032 and 2472. 24 Calculate the greatest common factor of 20 and 830. 10 Calculate the highest common divisor of 31257 and 207. 207 What is the greatest common divisor of 92631 and 11? 11 Calculate the highest common factor of 652 and 3348509. 163 Calculate the greatest common divisor of 286858 and 1870. 374 Calculate the greatest common factor of 26287 and 97. 97 Calculate the highest common factor of 9434256 and 156. 156 Calculate the greatest common divisor of 21919 and 6854. 23 What is the greatest common factor of 5424 and 312? 24 What is the highest common divisor of 172255 and 2199? 733 What is the greatest common factor of 27848 and 88? 8 What is the greatest common factor of 2844 and 508? 4 What is the greatest common divisor of 943 and 7981? 23 Calculate the greatest common factor of 42947 and 1139. 67 What is the greatest common divisor of 16 and 4113632? 16 What is the greatest common divisor of 89 and 1201? 1 Calculate the highest common divisor of 4085452 and 371. 371 What is the highest common divisor of 761 and 240? 1 Calculate the greatest common factor of 5028 and 372. 12 Calculate the greatest common factor of 280 and 120344. 56 What is the greatest common factor of 191836 and 796? 796 What is the highest common divisor of 61349 and 1519? 31 What is the highest common divisor of 483 and 81167? 23 What is the greatest common factor of 745 and 635? 5 What is the greatest common divisor of 16224 and 295074? 1014 Calculate the highest common divisor of 6116 and 11308. 44 What is the highest common divisor of 53284 and 84? 28 What is the highest common factor of 438365 and 15? 5 Calculate the highest common factor of 1551 and 2021. 47 What is the greatest common factor of 13968 and 2304? 144 What is the greatest common factor of 22579 and 8425? 337 What is the highest common divisor of 514477 and 508? 127 Calculate the highest common factor of 7597 and 2033. 107 Calculate the highest common factor of 4544 and 1065. 71 Calculate the highest common factor of 846 and 3854. 94 Calculate the highest common factor of 163859 and 1. 1 Calculate the highest common divisor of 1078 and 292. 2 What is the greatest common divisor of 540033 and 182? 13 Calculate the greatest common divisor of 5156879 and 929. 929 What is the highest common factor of 18139069 and 1079? 1079 What is the highest common divisor of 108 and 4668? 12 What is the greatest common divisor of 11616 and 244299? 363 Calculate the highest common divisor of 71961 and 498. 249 What is the greatest common divisor of 11656 and 1395? 31 What is the highest common factor of 10185 and 595? 35 What is the greatest common factor of 31100 and 11507? 311 What is the greatest common factor of 2984 and 9325? 373 Calculate the greatest common factor of 794 and 99647. 397 What is the greatest common divisor of 6 and 200649? 3 Calculate the highest common divisor of 3143 and 224. 7 What is the greatest common factor of 3225 and 1462? 43 Calculate the highest common divisor of 30515 and 4675. 85 Calculate the highest common factor of 80 and 72160. 80 What is the greatest common divisor of 261 and 317289? 87 Calculate the highest common divisor of 93430 and 10. 10 What is the greatest common factor of 400 and 46520? 40 Calculate the greatest common factor of 325 and 6305. 65 What is the greatest common divisor of 223 and 416564? 223 What is the greatest common divisor of 5 and 3749? 1 What is the greatest common divisor of 2004 and 384? 12 What is the highest common divisor of 52150 and 2250? 50 Calculate the highest common factor of 3245 and 15510. 55 Calculate the greatest common divisor of 285785 and 610. 305 Calculate the greatest common divisor of 854965 and 20. 5 What is the greatest common factor of 161486 and 52? 26 What is the highest common factor of 2018 and 44? 2 What is the highest common divisor of 218 and 2095307? 109 Calculate the greatest common divisor of 703 and 447959. 37 What is the highest common factor of 3258 and 10? 2 What is the greatest common divisor of 58870 and 140? 70 Calculate the highest common divisor of 143 and 588368. 11 What is the highest common factor of 800 and 13768? 8 What is the greatest common divisor of 105 and 43905? 15 Calculate the highest common factor of 1233 and 36579. 411 Calculate the greatest common factor of 635 and 102997. 127 What is the highest common divisor of 10241 and 110? 11 Calculate the highest common divisor of 194584 and 364. 52 Calculate the highest common factor of 331 and 84736. 331 Calculate the highest common factor of 27 and 3439881. 27 What is the highest common factor of 92563 and 151? 151 What is the highest common divisor of 620 and 23770? 10 What is the highest common factor of 126 and 251454? 42 What is the greatest common factor of 96 and 182256? 48 Calculate the greatest common divisor of 1789974 and 277. 277 Calculate the highest common divisor of 12644 and 580. 116 Calculate the greatest common divisor of 15891 and 45. 3 Calculate the greatest common factor of 49552 and 57. 19 What is the greatest common divisor of 12 and 879678? 6 Calculate the highest common divisor of 3297975 and 60. 15 What is the greatest common factor of 1437 and 153280? 479 What is the highest common divisor of 862 and 1124048? 862 What is the greatest common factor of 83 and 19007? 83 What is the highest common divisor of 187496 and 552? 184 What is the greatest common divisor of 470023 and 3101? 443 What is the greatest common divisor of 6275 and 575? 25 Calculate the highest common divisor of 84240 and 130. 130 Calculate the greatest common factor of 86962 and 2. 2 Calculate the greatest common factor of 9 and 3433761. 9 Calculate the greatest common divisor of 449140 and 3060. 340 Calculate the highest common divisor of 50 and 870. 10 What is the highest common divisor of 291 and 388097? 97 Calculate the greatest common factor of 105 and 1351. 7 Calculate the greatest common factor of 39 and 6144. 3 What is the highest common divisor of 126759 and 31	{ "pile_set_name": "DM Mathematics" }
+ l = -0 for h. 1 Let i be ((-16)/20)/((-2)/(-5))-1. Solve i - 1 = -t for t. -1 Let i(g) = 6g*2 + 1 + 0g*3 - 2g*3 + 5g + 3g3. Let x be i(-5). Let v be (-5 - -1)(1 - 2). Solve v = -3y + x for y. -1 Let i(j) = -3 - 7j + j*2 + 0 + 3j. Let b be i(5). Suppose bf - 2l = 0, 2l + 2 = 4. Solve -z + f = -1 for z. 2 Let x be (-12 - -14)(-9)/(-2). Solve 0 = -l - 2l - x for l. -3 Suppose -d = -6d. Suppose d = 3r + 5 + 4. Let q(z) = z3 + 4z*2 + 3z. Let k be q(r). Solve kv + 15 = 5v for v. 3 Let n(p) = -p*2 + 5. Let a be n(-4). Let v = a - -12. Solve 2j - 5 = -v for j. 2 Let k(g) = -g. Let y be k(-2). Solve yv = 6v for v. 0 Let g be (3 - 1) + (-6)/(-2). Suppose g = 3m - 4. Solve 2 = -p + m for p. 1 Suppose 4u - 2w - 34 = 0, -2u + 7 = 2w - w. Solve 0 = -uq + q for q. 0 Suppose 5p = 6 + 4. Solve 0 = -3h + p + 4 for h. 2 Let f(x) = x. Suppose -9 = -d - p, 4p + 13 = 5d + 4. Let r be f(d). Solve 0 = ra - 2a - 9 for a. 3 Let r(p) = -p - 7. Let d be r(-10). Suppose 0 = a - da. Solve a = 4j - 11 - 5 for j. 4 Let g(j) = j*2 - 5j + 2. Let n be g(5). Solve -4y + 10 = -n for y. 3 Let l(c) = 2c3 - c2 - 11c + 1. Let z(g) = -g3 + g2 + 6g - 1. Let h(y) = -3l(y) - 5z(y). Let f be h(-3). Solve fv = v - 5 for v. -5 Let v = -4 + 3. Let r = -1 - v. Solve 3a - 8a + 5 = r for a. 1 Let g(w) = -2w - 11. Let z be g(-7). Solve -zj - 9 = -0j for j. -3 Let w = -3 - -4. Suppose w = x - 3. Suppose 0r + 3 = -3r + 3o, -5o + 19 = 2r. Solve -r + x = 2q for q. 1 Let d = 6 + -4. Let k be (1 - -1)(-1)/(-2). Let n be k - 1/((-1)/2). Solve dt + n = -7 for t. -5 Let z(q) = -6q3 + 2q*2 + 3q + 2. Let c be z(-1). Solve -1 = 4m + c for m. -2 Suppose k + k = 8. Let l be ((-1)/2)/((-1)/4). Suppose 4u - ks + 12 = 0, -u + 3u = -ls + 14. Solve -7 = -3a + u for a. 3 Suppose -15 = 4u + 1. Let n = 8 + u. Solve -i + 0 = n for i. -4 Let g(t) = 2t*2 - 1. Let m be g(2). Suppose 4a - 4s - 32 = 0, -a + 0 = s - 4. Suppose 5n + 25 = -r + 3r, 0 = 2n + a. Solve 0 = -4d + m + r for d. 3 Suppose -25 = -2k - 3t, t = 2k - 3t + 10. Let h(m) = m3 - 4m*2 - 3m - 4. Let b be h(k). Solve 3n + b = n for n. -3 Suppose p = 2p - 2x - 25, 5p = 5x + 140. Solve -28 = n - p for n. 3 Let s = -3 - -6. Suppose -4d = -0d - 8. Solve sp + d = p for p. -1 Let x be (-1)/2-42. Solve r - x = 2r for r. -4 Suppose 3n = 5f + 15, -5f + 25 = -3n + 4n. Solve ng = 13g + 15 for g. -5 Let c = 178 - 176. Solve 0 = l - cl - 2 for l. -2 Suppose -2h - 2 = -4d + 4, 0 = -5d + 3h + 7. Let f be d/(-4)0-1. Solve f = -3n - n + 12 for n. 3 Suppose -7s + 9 + 5 = 0. Solve 0x + 8 = -sx for x. -4 Suppose -2f - 4f = -12. Solve -fu - 25 = 3u for u. -5 Let t = 7 + -2. Suppose 9 = -2s + ts. Solve 5 = -sk - 4 for k. -3 Let l(m) = m + 3. Let v be l(-2). Let y be 3 - -3 - (3 - v). Solve 2f + 6 = y for f. -1 Let c(a) = -a + 9. Let l be 0 + (8 - (-3 + 2)). Let d be c(l). Solve dp - 4p + 4 = 0 for p. 1 Let n be (4/10)/(1/5). Let z be n + (-3)/3-1. Solve zb = 2 - 8 for b. -2 Let i = 31 + -19. Suppose -2w - 4 = -i. Suppose -wc = c - 10. Solve 5t + 12 = ct for t. -4 Let n(r) be the second derivative of -r3/6 + 4r*2 - r. Let d be n(6). Suppose -dv + 27 = 5p, -3v = -7v - 16. Solve -pw + 5w + 6 = 0 for w. 3 Let m = 20 + -10. Solve 5w - m = -0 for w. 2 Let x = 12 + 3. Solve -h - 4h = -x for h. 3 Suppose -4g + 5p = -17, -5g + 0p = -p - 16. Let d = g + 1. Suppose -5q = -dy - 2, 0y - y + q = 0. Solve -2 = -yc - 6 for c. -2 Let c(a) = 6a - 45. Let b be c(8). Solve -bz + 2 = -10 for z. 4 Let s be 8/(-16)(-52 + -2). Solve -2 = 5o - s for o. 5 Suppose -4o + 0q = 2q + 18, -q + 3 = -4o. Let a = 0 - o. Let n = 4 - a. Solve 2l = -nl + 12 for l. 3 Suppose 5z - 45 - 30 = 5h, 0 = 2h - 2. Suppose 0 = 4f + m - 24, -z = f - 4m - 5. Solve 0 = -2t - f + 15 for t. 5 Let f(c) = c2 + 2c - 5. Let a be f(-4). Suppose -x = -9m + 4m + 10, -2x = -am - 1. Suppose 2p - 20 = -mp. Solve pi = -i for i. 0 Let s be (-68)/2 + 9/3. Let r = -16 - s. Solve -r = -2k - 7 for k. 4 Suppose 0 = -4t + 6t + 24. Suppose 0 = 3f - f + 16. Let w be t/f4/2. Solve -r - 2 = -w for r. 1 Let w = -45 + 27. Let l be (-100)/(-36) - 4/w. Solve -li = -4i + 1 for i. 1 Let m be (-10)/46/(-5). Suppose 5u - 3 = 2b - 46, -u - mb = 12. Let g(x) = x*2 + 9x. Let o be g(u). Solve o = -w - 6 + 1 for w. -5 Let b(k) = -2k - 2. Let g be b(-3). Solve y + 2 = g for y. 2 Let o(z) = 2z - 2. Let u be o(4). Let p be (-4)/(12/(-3)) - -1. Suppose uy - py + 68 = 4w, -3y = 2w - 9. Solve w = 3g - 0 for g. 4 Let h = -5 + 5. Suppose 4x + 2u - 62 = h, 4x - 20 = 3x - 5u. Solve 3i + x = 6i for i. 5 Let o(q) = q2 + 1. Suppose -3g - 2a - 8 = 0, g + 16 = -3a - a. Let y be o(g). Suppose 0 = -c + 2c - y. Solve 0 = 3i - c + 13 for i. -4 Let y = -2 - -9. Let v = y - 5. Solve -1 = -vo + 3 for o. 2 Let z(h) = -h3 - 10h*2 + h + 6. Let c be z(-10). Let v be c/(-10) - (-16)/10. Solve -vg = -g for g. 0 Let l be (-4 - -2)/6-3. Let q be ((-6)/2)/(l-1). Suppose -2n = -2k - 2, -n - 3k + 5 = -0k. Solve -n - q = t for t. -5 Suppose 0 = 2x - 5x + 24. Let j = x - 5. Solve -5 = -2c - j for c. 1 Let j(o) = o2 + 4o - 5. Let g be j(-5). Solve 3 = -gs - 3s for s. -1 Suppose -3 = -s - 5x, 0s - x + 9 = 3s. Solve -2h = sh - 25 for h. 5 Let y = 91 - 91. Solve y = -3d + 6 + 3 for d. 3 Let t = 8 + 6. Suppose -f + v = -3v - t, -v = -2f. Let b be f/4 - 5/(-10). Solve -g + b = 3 for g. -3 Let h(k) = k*2 + 7k + 4. Let z be h(-7). Suppose 3 + 5 = zw. Solve -wo = o - 12 for o. 4 Suppose -z = 0, -2m - 2z - 4 = -z. Let l = m + 2. Solve la - 15 = -5a for a. 3 Let p(x) = -x*3 - 5x*2 - x - 1. Let r be p(-5). Let i be (24/(-36))/(4/(-54)). Solve l - i = rl for l. -3 Let n(q) be the first derivative of 3/2q2 - 1/3q*3 + 2 + 0q. Let c be n(3). Solve cb + b - 3 = 0 for b. 3 Suppose -4d + 3p + 5 = 0, 0 = -5d + 2d + 3p. Solve 15 = db - 2b for b. 5 Suppose -t + 2t = 6t. Let d be (1 + 8 + 1)1. Solve -6g + g + d = t for g. 2 Suppose 25 = -0d + 5d. Let a = 8 - d. Solve -5k - 8 = -ak for k. -4 Let n = 136 + -116. Solve -10 = 6b + n for b. -5 Suppose 4x = 35 + 85. Suppose 3a - x = a. Suppose -5y - a = k, 5k - y + 10 - 65 = 0. Solve 0 = -0l + 2l + k for l. -5 Let g be (-1 + 0)/(1/(-3)). Suppose -2f + q = g - 5, 0 = -2q + 4. Suppose -2x + 20 = fx. Solve 0 = xv - 0v - 25 for v. 5 Suppose 0 = 3a + 6, -b + 0a + 3a + 6 = 0. Solve b = -n - 2n - 3 for n. -1 Suppose 5 + 27 = -4g. Let l be -1 - (-3)/((-3)/g). Let y = -2 - -5. Solve -5q - l = y for q. -2 Suppose -3y + y + 2 = 0. Solve -3q - 5 = y for q. -2 Let i(l) = -l3 - 5l*2 - 5l. Let m be i(-4). Solve 2w + 2 = m for w. 1 Suppose 0 = -4y + 11 - 7. Solve 4c + y + 7 = 0 for c. -2 Suppose -3 = -0l - l. Suppose 2i + 0i = 0. Suppose -4x = -0x - 32. Solve i = xa - la + 15 for a. -3 Suppose 10c = 5c + 10. Solve 0 = -5t + ct for t. 0 Suppose -g - 3g = 0. Suppose -2d - 4 = -gd, -d - 20 = -3y. Let b(r) = -r*2 + 6r + 2. Let t be b(y). Solve 0 = -l + tl - 2 for l. 2 Let b be -2 - -1 - -1 - -5. Suppose 2m = k + 4, -4m + 9m + 4 = -k. Solve 0d + bd = m for d. 0 Let x(r) = r - 5. Let p be x(7). Solve 3w - p = 4 for w. 2 Let n = 14 - 12. Solve 5l = nl + 3 for l. 1 Let b(v) = -3v + 3. Suppose m = -1 - 2. Let a be b(m). Solve 4o + a = o for o. -4 Suppose -3c + 0c + 6 = 0. Suppose 1 = 2i - 1. Solve -c - i = 3y for y. -1 Let y(m) = 5 + m - 3m - 1 - m2 - 3. Let s be y(-2). Let z(c) = -c2 + 4c + 2. Let u be z(3). Solve up = -4 - s for p. -1 Suppose 0 = o - 5o. Solve 2 + o = v for v. 2 Suppose -3t + 0 + 3 = 0. Let u be (-3)/((t + -2)-1). Let l be (-6 - -6) + (0 - u). Solve 3 - 6 = -la for a. 1 Let l be ((-3)/6)/((-1)/2). Suppose -l - 3 = -n. Let t be 0/(-1(-3 - -1)). Solve u = -tu + n for u. 4 Let j(y) = 10y2 + y. Let x be j(-1). Suppose -5 = -5u, -2u + x = m + u. Solve m = -0p + 3p for p. 2 Suppose 0 = -m + 5 - 1. Solve -4s - m = 4 for s. -2 Let i be 0 - -1 - 0 - 0. Let p = 9 - 2. Suppose p = q + 3. Solve -3u = i - q for u. 1 Let h(k) = k2 - 6k + 3. Let m be h(6). Let s(f) be the first derivative of -f3/3 - f2/2 + 2*f - 4. Le	{ "pile_set_name": "DM Mathematics" }
in descending order. 1, 0, -2, j Let d = 173 - 176. Let x = 14.1 + -14. Put 1, x, d in increasing order. d, x, 1 Let q = -2.05 - 0.95. Sort q, -4/9, 5/2 in ascending order. q, -4/9, 5/2 Let a be 126/(-70)(-5)/1. Put -2, a, 3, -3 in descending order. a, 3, -2, -3 Let b be (8 - 6/(-3))/2. Suppose 2x - 3p = -7p + 40, -2x + 30 = 2p. Suppose 0g + 30 = xg. Sort g, -1, b. -1, g, b Let h be (2/410)/(-1). Suppose 2a - 397s + 400s - 9 = 0, 5a + 4s = 12. Put 6, h, -4, a in increasing order. h, -4, a, 6 Let w(s) = s*2 - 15s + 19. Let b be w(10). Let a = b + 52. Sort 5, -3/2, a. -3/2, 5, a Let u = -3.4 - -3.403. Sort u, 1, -1.3 in descending order. 1, u, -1.3 Let d = -123 + 159. Let l = d - 43. Sort 2/3, 0.2, l in ascending order. l, 0.2, 2/3 Suppose 0 = k + 4u - 8 - 5, k = 3u - 15. Let v be (-93)/33 - 27/(16 + -25). Sort v, k, 5 in descending order. 5, v, k Let x = -454.4 + 454. Put -3/7, 46/9, -5, x in decreasing order. 46/9, x, -3/7, -5 Suppose 2m - 5m = -15. Suppose 0 = w - 2c - 7, 3w + c - 24 = 4c. Suppose 0h - 9 = -wh. Sort h, m, -5. -5, h, m Let n = 1386 - 1411. Sort n, 5, -1. n, -1, 5 Suppose -13 - 15 = -2v. Suppose -2 + v = 3m. Let w = 278 - 281. Sort 3, m, w in descending order. m, 3, w Let b = -951 - -930. Sort 4, -4, 5, b in decreasing order. 5, 4, -4, b Suppose 0 = 2c + 8, t - 5c - 8 - 16 = 0. Suppose 75r - 73r = 0. Suppose r = ti - 3i. Sort i, 0.8, 1/7 in decreasing order. 0.8, 1/7, i Suppose -2z + 8 = -2. Let r(n) = 3n - 3. Let h be r(9). Let v be h/(-4)(-2)/4. Sort 4, v, z in decreasing order. z, 4, v Suppose -3 = -7t + 4. Sort 37, -4, t. -4, t, 37 Let a(y) = y3 + 2y*2 - 8y + 5. Let p be a(-4). Let w = 4 - 4. Suppose p = -v - w. Sort 3, 20, v in ascending order. v, 3, 20 Let v(b) = 63b2 - 567b - 5. Let s be v(9). Let c(g) = -g*2 + 5g - 3. Let o be c(5). Sort o, 2, s in increasing order. s, o, 2 Let z(b) = b*3 - 3b*2. Let y be z(2). Sort 2, 4, -6, y in decreasing order. 4, 2, y, -6 Let o = 101 - 82. Sort -2/29, o, -3 in descending order. o, -2/29, -3 Suppose w + 3w - 12 = 0. Suppose -v - 3l - w = 0, 4 = 2l + 8. Suppose -3d = 3t + v, d = 3t - t - 13. Put t, 1/4, 1 in descending order. t, 1, 1/4 Let d = 24/37 - 553/111. Let r = 9.61 + -9.81. Sort d, 1, r. d, r, 1 Let b = 5.6 + -10.6. Let c be -2 + 1 - (-3)/(-1). Let d = -0.7 - -2.7. Sort c, d, b in decreasing order. d, c, b Suppose 0 = 5c + j - 72 + 11, -22 = -2c - j. Let p be c/(-3) - 28/42. Sort -1, 0, p in ascending order. p, -1, 0 Let h be -499/84 - 8/28. Let q(a) = 67a + 1. Let r be q(-1). Sort r, h, 5 in ascending order. r, h, 5 Let i = -5 - -5. Suppose -2p = -ip + 10. Put p, 3, -8 in descending order. 3, p, -8 Suppose -10 = -3h - v + 7, -3h = 5v - 13. Suppose 30 = -9o - h. Sort -13, -5, o in descending order. o, -5, -13 Let g be 1((-6)/(-2) - 2). Let u = -23 - -26. Let i(o) = o*3 - 5o*2 + 5o - 2. Let x be i(u). Sort g, 4, x in descending order. 4, g, x Let c(a) = -6a - 38. Let v be c(-6). Let y = 9 + -4. Let u be v + 5 + (-17)/y. Put -3, 1, u in ascending order. -3, u, 1 Suppose -5p + 10 = 0, 5p - 3 = -5s + 6p. Sort 1/2, 0.07, s in descending order. s, 1/2, 0.07 Let b = 0.003 - 0.613. Let p = -0.71 - b. Put -2/3, 5, p in decreasing order. 5, p, -2/3 Let c(d) = -8d - 11. Let f be c(-4). Suppose 6l + 3 = -f. Put l, 2, 7 in descending order. 7, 2, l Let y be -3 - -12-1. Suppose -5h - 20 = -5a, 7h - 6h = 5a - 24. Let l be 0 + (-8)/(-2) + -7. Put l, y, h in increasing order. y, l, h Suppose -27 = -g + 5w + 8, 8 = -2w. Let q(s) = -6s + 93. Let x be q(g). Sort 0, -4, 2, x in decreasing order. x, 2, 0, -4 Let p = -550 + 553. Sort p, 29, -2, -3 in decreasing order. 29, p, -2, -3 Let g = -0.01 + -6.19. Let n = -7.2 - g. Put -0.04, -0.3, 5, n in descending order. 5, -0.04, -0.3, n Let l = -16 + 7. Suppose -3t - 6 = -3d, 4t + 2d - 5 - 11 = 0. Suppose 6j + 20 = tj. Sort j, l, -2 in decreasing order. -2, j, l Let r(c) = c2 + 4c. Let t be r(3). Let s = -21 + t. Let k(m) = -3m2. Let h be k(-1). Sort -5, h, s in descending order. s, h, -5 Let k = 1 + 13. Suppose -5c = 11 + k. Let t be (1 - -1)(-2)/2. Sort 3, t, c. c, t, 3 Let q be -5 - -10 - (-231)/(-45). Sort -1, 4, q. -1, q, 4 Let t(q) = 71q + 91. Let s be t(-1). Put -12, -1, s in increasing order. -12, -1, s Let b = -179 + 1251/7. Let t = 0.2 + -2.2. Suppose 0 = 3l - l + 2. Sort l, b, t in ascending order. t, l, b Let o(h) be the first derivative of -h3/3 - 3h*2/2 - 3h + 27. Let r be o(-2). Put 1, -5, r in descending order. 1, r, -5 Suppose -4m = 14 - 34. Let s(k) = -k3 + 4k*2 - k - 3. Let b be s(3). Let a be 6076/(-2108) - 2/17. Sort b, m, a in ascending order. a, b, m Let a = 4.8 - 5. Suppose -s + 124 = 121. Put a, -1, s in descending order. s, a, -1 Let n be (-2)/7(7 + -14). Let y be 1/(7 + -4 - n). Let v(a) = -a + 11. Let x be v(7). Sort -2, x, y in decreasing order. x, y, -2 Suppose 3g - 99 = -3. Suppose 0 = -2l - 2l + 16, -3l = 4k - g. Sort -2, k, -4 in increasing order. -4, -2, k Let l = 23 + -41. Let a be (0 + l/(-15))/(-2). Let m = 0.08 - -0.12. Sort a, m, -5 in decreasing order. m, a, -5 Let q(l) = l3 + 8l*2 + 5l - 10. Let x be q(-7). Sort x, 1, -164. -164, 1, x Let s = 1856.1 - 1856. Sort 1, -2, 0, s in increasing order. -2, 0, s, 1 Let w = -13 + 13. Suppose -3z + 6z + 9 = w. Let y = -2 + 6. Put y, z, 5 in decreasing order. 5, y, z Suppose q + 0t - 12 = -3t, 8 = 4t. Let b be (q + -6 + -2)/(1/2). Sort 1, b, 4, 3. b, 1, 3, 4 Let p be (-16 - -1) + (-164)/41. Let w = 7 + -4. Put p, w, -2 in descending order. w, -2, p Let x(i) = -i3 - 25i*2 - 22i + 44. Let b be x(-24). Put 9, b, 1, 5 in ascending order. b, 1, 5, 9 Let g be 0/(-4) + (1 - 1). Let u be 2((-1210)/405 + 3). Let o = u - -148/567. Sort g, o, -4. -4, g, o Let k be 3/(-6) + (3/(-6))/1. Suppose -10 + 3 = -p. Let q = 5 - p. Sort k, q, 2 in ascending order. q, k, 2 Let k = 83.5 - 82.5. Let z = -9/41 - -125/943. Sort 0.5, k, z. z, 0.5, k Suppose 27k - 125 = 10. Put k, 1, 4, -5 in increasing order. -5, 1, 4, k Let g = -57063 + 398589/7. Suppose 4z - 16x = -14x + 494, 5z - 601 = -3x. Let v = z + g. Put v, 0.4, 0.3 in descending order. 0.4, 0.3, v Let v(h) = 6h + 21. Let r be v(-3). Sort 2, r, 15 in ascending order. 2, r, 15 Let b be (-1)/4(-15 + 15). Put 1, -4, 4, b in increasing order. -4, b, 1, 4 Suppose -4u + 25 = u. Sort -7, u, -1 in descending order. u, -1, -7 Let j = 61/92 - -2/23. Suppose 32 = 4h + 4c, 0 = 2h - 7h + 4c + 13. Put -1/6, h, j in descending order. h, j, -1/6 Let y = -14.05 + 10.05. Put 195, 0.2, y in decreasing order. 195, 0.2, y Let h = 1.5 - 1. Let w = -141451/9 + 15717. Sort 0.03, w, 4, h in descending order. 4, h, w, 0.03 Let a be (-891)/1144 - (-2)/13. Let i = a - -1/40. Put -0.4, -5/3, i in decreasing order. -0.4, i, -5/3 Let u = 5.88 - 6. Let b = -0.2 - u. Let s = 0.42 - b. Sort 0.1, s, -3/7 in descending order. s, 0.1, -3/7 Suppose -2h = -5b + 7, 5h - b + 1 + 5 = 0. Let r be h61/(-3). Suppose -25 = -7n + 2n. Sort -2, n, r in descending order. n, r, -2 Let a = -0.51 - -0.444. Let u = a - 0.234. Put -0.6, -3/4, u in descending order. u, -0.6, -3/4 Let i be (2 - (-26)/(-6)) + (-1)/(-3). Let t be 0 - (0 - -1) - i. Put -1, t, 0 in ascending order. -1, 0, t Let a be 4/(-30)45/27. Let r(u) = -u2 + 10u - 12. Let o be r(8). Let z be (51/(-15) + o)/3. Put a, 1, z in descending order. 1, z, a Let p = -135 + 138. Sort -1, 1, p, -4. -4, -1, 1, p Let x = 17 - -25. Let c = -211/5 + x. Let j be (-16)/84(-7)/(-3). Sort c, -2/19, j in ascending order. j, c, -2/19 Suppose -3s + 2s + 3 = 0. Let j = -41 + 42. Let l be j/(-2) + (-3)/2. Sort l, s, -3 in decreasing order. s, l, -3 Suppose -5g + 2h = -2, -2g - 3h - 2 = 1. Suppose g = -4r - 2l - 6 - 0, -l - 1 = r. Let m = 4 + -5. Sort r, m, 5 in descending order. 5, m, r Let u = 56 - 5. Let i = u + -58.1. Let g = -7 - i. Sort -2, g, 3 in ascending order. -2, g, 3 Let q = -300 - -205. Let g = -92 - q. Sort 17, g, -1. -1, g, 17 Let g = 5590 + -5588. Let k(b) be the first derivative of b2/2 + 4b + 1. Let f be k(-3). Sort -2, f, g in ascending order. -2, f, g Let q be 1/((-3)/(-8)6/9). Suppose -2v + qz - 70 = 0, -145 = 3v - 5*z - 42. Sort 2, v, 4, -5. v, -5, 2, 4	{ "pile_set_name": "DM Mathematics" }
+ 264x - 141x to s + yx and give s. 0 Express (-8 - 23u + 6 - 86u)(-2 + 1 + 3) in the form wu + d and give d. -4 Rearrange -19u + 37u - 78u*2 - 18u to the form ju2 + s + pu and give j. -78 Rearrange (-y*2 + 0y*2 + 3y*2)(-19 + 60 - 770y2 + 736y*2) to the form ky + j + vy2 + ay*4 + cy*3 and give v. 82 Rearrange -8 - 6 + 20 + 1706r - 6 to k + ir and give i. 1706 Rearrange 125f - 178f - 168f to the form bf + a and give b. -221 Rearrange (0x + x + 0x)(19x + 5 + 141x + 41x) to the form k + ix + nx2 and give i. 5 Express (0q*2 - 3q2 + q2)(-2q + 2q - 2q*2) - 14 + 4737q*2 - 3q*4 - 4737q*2 as zq*2 + l + uq + cq4 + sq*3 and give c. 1 Rearrange -58g*2 - 19g*2 - 5g*4 + 6g4 + g3 to ng3 + kg*4 + q + ag*2 + xg and give k. 1 Rearrange (-3h + 12h + 5h)(-5 + h + 2 + 5) to r + mh + fh*2 and give f. 14 Express (0s + 2s3 + 0s)(-2s + 4s - 4s) + 87s4 + 57s*4 - 118s*4 in the form ms*2 + as*3 + qs*4 + js + x and give q. 22 Rearrange 2f3 - 2f*4 - 2f*3 + (2 + 1 - 8)(0f4 + 4f*4 - 2f*4) - 5402 + 5402 + 140f*4 to j + cf*2 + zf*4 + yf + kf3 and give c. 0 Rearrange (-256f - 143f + 172f)(5 - f - 3 + 2) to the form sf*2 + j + bf and give s. 227 Express -2608 - 912w + 2608 in the form uw + s and give u. -912 Express (-16q + 12q*2 + 16q)(-223 - 74q*2 + 223) as sq*3 + zq + p + mq4 + cq*2 and give m. -888 Rearrange (-16u - u - 6u)(-6u2 + 5u*2 - 15u*2)(1 - 1 + 2) to the form ou + pu*3 + ku*2 + c and give p. 736 Express 2f*4 + 62f*2 - 34f*2 + 5f*3 - 27f*2 as cf + xf2 + z + gf*3 + qf*4 and give q. 2 Express 7n*4 + 53 - 9n*4 - 51 - 2n*3 as fn*3 + wn*4 + j + in*2 + cn and give f. -2 Rearrange (-3y - 2y + y)(0 + 1 - 3) + (12 + 13 - 34)(2 + 4 - 4)(-2y - 3y + 4y) to a + ly and give l. 26 Express (4 - 7 - 11)(4y - 3y + 0y)(106 - 23 + 59) as p + ky and give p. 0 Express 54 - 2p*3 + 9p*2 - 10p*2 + 3p*2 in the form kp*3 + c + hp*2 + jp and give h. 2 Express (-292i - 5058i + 13i)(6 - 5 - 2)(1 - 3 + 1) in the form ci + t and give c. -5337 Express 3o3 - 2o*3 - 2o3 + (-o3 + 5o3 - 2o*3)(-3 - 1 + 2) + 5744 + 99o3 + 2o*2 - 5744 in the form q + bo*3 + ao*2 + po and give a. 2 Express (0u + 3u - 2u)(6u + 2u - u)(-3 + 3 + 3u + (4 - 4 - 1)(2u - 3 + 3)) in the form h + nu3 + ku*2 + tu and give n. 7 Rearrange -19 - 4r2 + 5r - 6r - 3r + 2r4 + 21 + r to the form kr*2 + vr + z + pr4 + tr*3 and give t. 0 Rearrange -4z2 + z2 + 2z2 + (z + 2z + 0z)(2z + 2z - 2z) - 1430 + 48z*2 + 1430 to v + tz + rz2 and give t. 0 Express (-2d*4 + 0d*4 + 4d*4)(4 + 1 - 3)(-5 - 1 + 1) as n + cd*4 + md*3 + jd + ld2 and give c. -20 Rearrange (81 - 12 + 21)(-p3 - p3 - 4p3) to the form i + op + vp2 + hp*3 and give h. -540 Rearrange (4 - 5 + 2 + (-1 + 1 - 1)(-3 + 0 + 1) - 1 - 1 + 4 + 1 + 4 - 3 - 2 + 0 + 1)(-141 + 298 + 23p - 149) to j + xp and give x. 138 Rearrange -3j + 4j - 91j*2 + 1 + 70j*2 + 0j to the form lj + w + mj*2 and give m. -21 Rearrange 0u + 15u2 + 103u*3 - 55u*3 - 22u*3 + 0u to yu2 + ou*3 + lu + c and give y. 15 Express -56y + 3y*2 - 17952y*4 + 2y*2 - 4y*3 + 17953y*4 + 6y*3 - 6y*2 in the form qy*4 + sy*2 + r + fy + hy3 and give q. 1 Rearrange q3 - 1310 + 3q - 2q3 + 1313 to the form d + hq*2 + jq*3 + vq and give v. 3 Express 2 - 3o3 + o2 + 2012o*4 - 4023o*4 + 17o*2 + 2012o*4 as h + qo*3 + ao*4 + so + ko2 and give h. 2 Rearrange 2 - 2 + 168y - 29y - 27y to ty + d and give t. 112 Rearrange -z3 + 1484z - 1484z - 17 to the form wz*3 + nz + h + vz2 and give h. -17 Rearrange -563s*3 + 344s*3 - 384s*3 + (1 + 0 + 1)(2s3 + 1 - 1) to cs*2 + bs + ds3 + f and give d. -599 Express z - 2z + 160z3 - 55z*3 as y + nz*2 + sz*3 + az and give s. 105 Express (z - z + z*2)(-23z + 77z + 31z) as uz*2 + a + lz*3 + kz and give l. 85 Express 5 + 15 + 16c3 + 1116c*2 - 1116c*2 as jc + p + ac3 + dc*2 and give a. 16 Rearrange 4m*3 - 3m*2 - 1858 + 0m2 + 1860 + m4 to the form cm + am*3 + im*4 + km*2 + h and give a. 4 Rearrange 3 + z + 2z - 42z to u + bz and give b. -39 Express (713 + 47 + 716 + 336)(4h*2 - 4h*2 - 3h*2) in the form bh*2 + d + kh and give b. -5436 Rearrange 7 + 31x2 - 12 + 11x*2 - 3x + 8 to ox + sx*2 + l and give l. 3 Express 2w3 - w4 - 2w3 + (-4w2 - w2 + 3w2)(-2 + w*2 + 2) + (4 - w - 4)(-4w3 - 14 + 14) as cw*2 + rw*3 + hw*4 + s + qw and give h. 1 Express (-26376r3 + 26376r*3 + 503r*4)(6 - 3 - 2) as v + mr2 + ur*4 + kr*3 + wr and give u. 503 Express (18 + 8 - 1)(0 + 0 - 1)(3 - 5 - 5 + 2k) in the form sk + m and give m. 175 Rearrange -49 - 4 + 2s - 23 + 16 to the form l + js and give j. 2 Rearrange (7 - 1 - 19)(4k + 0k - 5k) + (3k + k - 2k)(-1 - 7 - 1) to the form t + bk and give b. -5 Rearrange -29z + 19z*3 - 30z - 11z3 + 2z*2 - 1 + 58z to the form gz3 + qz + xz2 + l and give x. 2 Rearrange 2v*2 + 55v*3 + 160v*3 - 69v*3 to the form i + zv*3 + lv*2 + mv and give z. 146 Express r*2 + 222r*3 - 268r*3 + 0r*2 as gr*2 + z + ur + lr3 and give g. 1 Rearrange -v4 - 29v*2 + 51v*2 - 23v*2 - 6v - 2 - 3v3 to bv*3 + iv*2 + rv*4 + o + hv and give r. -1 Express -1 + 1 - 2a + (3a - 7a - 11a)(-2 + 0 + 7) - 2a + a - 6 + 5 in the form ja + b and give b. -1 Express 2y*4 + y - 2y*2 + 10y*2 - 7y*2 + 20 - 3y in the form cy2 + jy*4 + f + zy + gy3 and give z. -2 Rearrange (-s - 3 + 3)(3 - 3 + 1) + 2s - 4s + 4s + 2555s + 2831s - 5923s + (-2s + 2s + 4s)(0 + 0 - 1) to vs + l and give v. -540 Rearrange 0d - d + 26d3 + 240d - 27d3 to nd*3 + md + h + bd2 and give n. -1 Rearrange 4 - 71u*3 + 38u*3 - 2 - 36u*3 to s + xu*3 + vu + nu2 and give s. 2 Express (-342 + u - 72u*3 + 342)(-u + 2u - 6u) in the form tu2 + bu*3 + au*4 + c + pu and give a. 360 Express (4b2 - 5b*2 + 3b*2)(179 + 176 - 5302b - 355) as db + ub2 + tb*3 + j and give t. -10604 Rearrange 332 - 331 + 2v + v + 17v2 to pv*2 + jv + c and give p. 17 Rearrange b + 2b2 + 1 + 9 - 11 + b - 94b*3 to j + wb + vb2 + ab*3 and give j. -1 Express -3 + 3 - 2a3 + a4 + (2a + a4 - 2a*4 + 0a*4)(7 + 16 - 18) in the form ia2 + ua*3 + ga*4 + z + da and give g. -4 Express -28z2 + 48z*2 + 20z*2 + 45z*2 as a + gz + vz2 and give v. 85 Rearrange (2 - 2 - 2)(0z + 4z + 0z + (-3 - 2 + 2)(-1 - 2z + 1))(3 - 8 - 27) to n + az and give a. 640 Rearrange -841o*2 + 422o*2 + 420o*2 - 249 - o to the form qo + fo2 + c and give f. 1 Rearrange -21a + 26a + 46a + 35a to the form y + xa and give x. 86 Express 0l2 - 6l*2 - 2l*2 + (l + 0 + 0)(-10 - 3 + 5)(l + l - l - 2) in the form d + gl*2 + al and give a. 16 Express 0j + j - 2j + 1 - 1 - j + (4 - 4 + 2j)(2 + 0 - 3) + (-671 - 300 + 284)(-j + 0j + 0j) as gj + w and give g. 683 Rearrange 5m3 - m3 + 3266m - 3292m to the form rm*2 + vm*3 + n + sm and give v. 4 Rearrange -2 + 69r2 - 217r + 217r to the form i + tr + qr2 and give q. 69 Express -96v + 1 + 119v + 69v + 81v in the form jv + a and give a. 1 Rearrange 2 - 2s3 + 5s*2 + 13s*3 - 29s*2 + 26s*2 + 2s to fs2 + is*3 + j + ys and give y. 2 Express -93t - 89t + 274t - 1413t*2 - 92t as z + vt2 + ot and give v. -1413 Rearrange (-4l - l + 2l)(-2 - 2 - 7)(-6 + 2 + 3) to the form fl + d and give f. -33 Rearrange (-2 - 2p*3 + 2)(-10 - 3 + 4)(25 - 64 - 57) to the form qp*2 + yp*3 + bp + x and give y. -1728 Rearrange 12t3 + 5t*3 + 2 - 5t3 + t3 to the form gt + st*3 + ht*2 + b and give g. 0 Express -108s*2 - 60s*2 - 445s*2 + 77s*2 - s - 202s*2 as vs + p + ns2 and give v. -1 Express (0g - g - 9g)(-5 - 3g3 + 5) in the form ag*4 + bg*2 + c + lg*3 + vg and give a. 30 Express (-3 - 4x + 0x + 6x)(-3x + 4x - 3*x) as g	{ "pile_set_name": "DM Mathematics" }
t common factor of 48 and 4865964. 12 Calculate the highest common factor of 2721 and 5467396. 907 Calculate the greatest common factor of 64524 and 8232. 12 Calculate the greatest common factor of 280476 and 5512. 212 Calculate the highest common divisor of 10256922 and 2736. 342 What is the greatest common factor of 3199791 and 255? 51 What is the highest common factor of 11511724 and 41412? 812 Calculate the greatest common divisor of 44785 and 5785. 65 Calculate the greatest common divisor of 1927478 and 401868. 7442 What is the greatest common divisor of 7168 and 1355844? 28 Calculate the highest common divisor of 1764 and 2640204. 252 Calculate the greatest common factor of 17567824 and 6944. 496 Calculate the highest common divisor of 48841 and 264004. 13 Calculate the highest common factor of 79932291 and 8556. 2139 Calculate the greatest common divisor of 1322496 and 18144. 2016 Calculate the highest common factor of 1692963 and 9. 9 Calculate the highest common factor of 10112 and 2252928. 128 Calculate the greatest common factor of 93442064 and 4352. 272 Calculate the highest common divisor of 38365568 and 96. 32 Calculate the greatest common factor of 6596634 and 2706. 66 Calculate the highest common factor of 859756 and 50. 2 What is the highest common divisor of 2009 and 960822331? 2009 What is the greatest common factor of 1283962777 and 181? 181 Calculate the highest common divisor of 673821 and 1251. 9 Calculate the greatest common divisor of 25896943 and 361. 19 What is the greatest common divisor of 1873583 and 2? 1 What is the greatest common factor of 530532 and 1614? 6 Calculate the greatest common factor of 288 and 7680928. 32 What is the greatest common factor of 1522695 and 29265? 15 What is the highest common factor of 3798662 and 70? 14 What is the greatest common divisor of 75537 and 5229? 63 What is the greatest common divisor of 87915660 and 9? 3 Calculate the highest common factor of 18774050 and 150. 50 Calculate the highest common factor of 142926 and 116522. 574 Calculate the greatest common divisor of 7826 and 16647778. 14 What is the highest common factor of 3706282 and 913? 83 Calculate the highest common divisor of 26211972 and 12. 12 What is the highest common factor of 2831230429 and 3001? 3001 Calculate the highest common divisor of 273 and 9989553. 21 Calculate the highest common divisor of 1300201 and 548863. 623 What is the greatest common divisor of 41 and 63438234? 41 Calculate the highest common divisor of 7259292 and 1488. 12 Calculate the highest common factor of 2496 and 52848. 48 What is the highest common divisor of 76676902 and 185222? 5006 Calculate the highest common divisor of 7003141 and 2071. 109 Calculate the greatest common factor of 14679900 and 2400. 300 Calculate the highest common factor of 2814068 and 471. 157 Calculate the greatest common factor of 3278778066 and 102. 102 Calculate the highest common factor of 96873 and 11844. 21 What is the greatest common divisor of 231 and 78982365? 231 What is the greatest common divisor of 267 and 183017642? 89 Calculate the greatest common divisor of 1000252 and 116713. 127 Calculate the highest common divisor of 42021 and 6148. 29 What is the highest common factor of 3285932 and 3016? 1508 What is the highest common divisor of 205306974 and 108? 54 Calculate the greatest common factor of 139 and 15081917. 139 Calculate the greatest common factor of 56994 and 444545058. 8142 Calculate the highest common factor of 11935 and 1779260. 35 Calculate the highest common factor of 212215601 and 13. 13 What is the greatest common divisor of 189308 and 126? 14 Calculate the greatest common divisor of 18830487 and 5714. 2857 What is the greatest common factor of 38783800 and 73304? 1496 What is the highest common factor of 3594 and 397171742? 1198 Calculate the greatest common divisor of 2812386 and 9400. 94 What is the greatest common factor of 28985 and 558217? 341 Calculate the greatest common factor of 1308314 and 56. 14 What is the highest common divisor of 666 and 6541164? 18 What is the greatest common factor of 46222558 and 68? 34 What is the greatest common factor of 4691605 and 7815? 2605 Calculate the highest common divisor of 3465690 and 6990. 30 What is the highest common divisor of 6 and 52004508? 6 What is the greatest common factor of 33 and 28070009? 11 What is the highest common factor of 166465642 and 80066? 4214 What is the greatest common divisor of 2067 and 2676288? 159 What is the highest common divisor of 546543194 and 5337? 593 What is the greatest common divisor of 740 and 3720239? 37 Calculate the greatest common divisor of 6775902 and 84. 42 Calculate the greatest common factor of 334 and 29703121. 167 What is the greatest common factor of 2405 and 15185540? 185 What is the greatest common divisor of 54420408 and 57? 57 Calculate the greatest common divisor of 44 and 96763876. 44 Calculate the highest common factor of 105177986 and 4. 2 What is the greatest common factor of 261003411 and 6462? 3231 What is the highest common factor of 18399109 and 1? 1 Calculate the highest common factor of 16203 and 526647. 33 Calculate the greatest common factor of 4246908 and 647. 647 Calculate the greatest common divisor of 63869 and 761345. 221 What is the highest common divisor of 969169 and 107623? 281 Calculate the highest common factor of 72531 and 6639. 3 Calculate the highest common factor of 10062 and 25259. 13 What is the greatest common factor of 5529744 and 352? 176 What is the greatest common divisor of 5614 and 76482329? 2807 Calculate the highest common factor of 732 and 1626626. 122 Calculate the greatest common divisor of 949 and 55585777. 949 Calculate the highest common factor of 168 and 18354444. 12 What is the highest common divisor of 108 and 717295257? 27 What is the greatest common divisor of 36480 and 4245? 15 What is the highest common divisor of 22 and 1036744676? 22 Calculate the greatest common factor of 282304180 and 88484. 8044 Calculate the highest common divisor of 12926 and 1978. 46 What is the highest common factor of 9192022 and 1676? 838 Calculate the highest common factor of 121220 and 16340. 380 What is the highest common factor of 143750 and 34842700? 1150 Calculate the greatest common factor of 139138643 and 291. 97 Calculate the highest common factor of 54180 and 43. 43 What is the greatest common divisor of 1 and 227257? 1 What is the highest common divisor of 6162 and 3874? 26 Calculate the greatest common divisor of 14 and 8676563. 7 Calculate the greatest common divisor of 374 and 38154358. 374 What is the greatest common divisor of 30851855 and 2967? 989 What is the highest common divisor of 33 and 45256101? 33 What is the highest common divisor of 76636296 and 54? 18 What is the highest common factor of 438840567 and 2151? 2151 Calculate the greatest common factor of 8 and 774436. 4 What is the greatest common divisor of 177 and 32964244? 59 What is the highest common factor of 361726 and 799? 17 What is the highest common divisor of 434 and 12482? 2 What is the greatest common divisor of 380 and 56220? 20 Calculate the greatest common factor of 556 and 1146909155. 139 What is the greatest common factor of 99 and 45771297? 33 What is the greatest common divisor of 76 and 5023334? 38 What is the highest common factor of 188 and 14954366? 94 Calculate the greatest common divisor of 11452 and 311857. 7 What is the greatest common factor of 35816 and 2965772? 148 What is the greatest common factor of 43253272 and 760? 152 Calculate the highest common divisor of 742 and 169421. 7 Calculate the highest common divisor of 98 and 31799922. 98 Calculate the greatest common factor of 31177967 and 129. 43 Calculate the highest common factor of 669627645 and 3. 3 Calculate the highest common factor of 1253248 and 20928. 64 What is the greatest common factor of 1610 and 198062522? 322 Calculate the highest common divisor of 63899 and 18055. 157 What is the highest common divisor of 1220336 and 351? 13 What is the highest common factor of 664 and 4668314416? 664 Calculate the highest common factor of 79430 and 888095. 845 Calculate the greatest common divisor of 101399805 and 870. 435 What is the hi	{ "pile_set_name": "DM Mathematics" }
fy (q/(q/(qq(5/2))q)qqq(2/15)/q)/(qqq(-7)qq(-9)q) assuming q is positive. q(469/30) Simplify ((n/n(3/5))/n15)/(n(1/6))(-2/51) assuming n is positive. n(-11164/765) Simplify v*(7/3)v*(-1)v*(-1)/(vv/((v/v(-11/4))/v)) assuming v is positive. v(13/12) Simplify (r(-10)/(r(-8/5)r))/(r0/(r/(r4r))) assuming r is positive. r*(-67/5) Simplify ((qqq(-13/3))3)(-1/87) assuming q is positive. q(7/87) Simplify (www(6/7)w)(3/2)/(w/(w2/w)www(-33)) assuming w is positive. w(515/14) Simplify gg*15gggg(-2/3)gg(-13)gg(-5/2)g assuming g is positive. g(35/6) Simplify ((j8/j)/j*(3/4)((j/j(-2))/j)(-28))(-7/5) assuming j is positive. j(1393/20) Simplify (gg7g((g(-4/3)/g)/g)/g(g(-1/2)/g)/(g/g(-13)g))(-35/6) assuming g is positive. g(2485/36) Simplify x(x*(-1/5)x)/xxxx22((x/(x/x*(-5/7)x))/x)/x(-22) assuming x is positive. x(1543/35) Simplify (x*(1/3)/xx)(-2/37)/(x(1/9)x(-8/7)) assuming x is positive. x(2363/2331) Simplify ((f/f(36/7))/(fff(2/13)))32 assuming f is positive. f(-18336/91) Simplify (l(-9)l)/l*(1/6)(l2)27 assuming l is positive. l*(275/6) Simplify (((c/(cc(((((c(-10)c)/c)/c)/ccc)/c)/cc))/c(-4/5))/(c(-2/5)cc/(c/(cc*(-6)))c))(-15/4) assuming c is positive. c(-213/4) Simplify (s0)18/(s*(2/25)s(3/13)) assuming s is positive. s(-101/325) Simplify ((b*(-1/5)(bb/((bb(-7))/b))/b)/(b(1/3)/(b/(b*(-3/2)b))))(3/7) assuming b is positive. b(269/70) Simplify ((d/d*24)/d)/d(((d*(-2/11)d)/d)/d)/dd(dd(-1/5)d)(8/5) assuming d is positive. d(-6408/275) Simplify (v/(v/v*(-1))vv(-11))/(vv/(v/v(-2/5)))(-9) assuming v is positive. v(-28/5) Simplify (g(1/43))*(2/21)/((gg/(g*(-16)/g)g)/gg(g/(g/g(1/6)))/g) assuming g is positive. g(-11537/602) Simplify ((u/u(-2))(-7)/(u/(u/(u/(u2/u))))28)(2/11) assuming u is positive. u(-42/11) Simplify (zz(-2/3)z)*2(z*(-1/7)zz)/z(1/9) assuming z is positive. z(278/63) Simplify (c/(c13/c))(-2/3)c(5/12)/c(-10) assuming c is positive. c(71/4) Simplify (l(-1/12)/l)/(l/(ll(-16)))ll(1/25)l(l(3/19)l)/l assuming l is positive. l(-84847/5700) Simplify (v/((v(-2)/v)/v))*29/(vv*(-3/4)v/(vv(3/10))) assuming v is positive. v(2901/20) Simplify ((c/c(-14))/c(-7/3))/((cc/(ccc*(3/10))cc)/cc)26 assuming c is positive. c(-403/15) Simplify ((l/(l(l3/l)/lll))(-5/2)((ll(-1/4))/ll)/ll/(l/l(4/3)))(-23/2) assuming l is positive. l(-2369/24) Simplify j18jj(-6/5)(jj/(j(2/5)/j))13 assuming j is positive. j(258/5) Simplify (d(-5/3)d/((ddd(-8)/d)/d))/(d(1/4))(2/43) assuming d is positive. d(1889/258) Simplify ((ff(-5/6))/(f/(f16/f)))(-40) assuming f is positive. f(-1700/3) Simplify ((f/(f/(f/f(-27))))/(f/(((ff*(3/7)ff)/ff)/f)))/(ff(12/11)(fff*(-3/20))/ff) assuming f is positive. f(39251/1540) Simplify ((i(1/4)/ii3)(-3/4))(-20/7) assuming i is positive. i(135/28) Simplify (q/(qq*(-2/123)qqq)q(-33))/(q(-1/27)q)37 assuming q is positive. q(-79276/1107) Simplify ((zz2/zz)/(zz(2/7)))/(z1)(-7/9) assuming z is positive. z(157/63) Simplify ((g(-7)/gg(-5))/(g(1/3))(-26))(1/12) assuming g is positive. g(-13/36) Simplify ((u(-10)/u)/(u(1/12)/u))/(u(-4))(5/9) assuming u is positive. u(-283/36) Simplify (cc(-1/7)c)/c*(-2/31)(c/(c/(c*(-4)c)cc))(-30) assuming c is positive. c(32967/217) Simplify (c*(-1/4)c)*17/(c/(cc/c7))(-6/13) assuming c is positive. c*(807/52) Simplify (m/((mm(-6/13))/m))/m3mm/m*(4/9)m*(-7)m assuming m is positive. m*(-700/117) Simplify (wwww*(-5)ww)(-3/32)(w*(2/17)/ww)(-5/2) assuming w is positive. w(-5/17) Simplify ((y/y(4/21))/y21)/(y(3/10)/y)(1/70) assuming y is positive. y(-42379/2100) Simplify (j(-13)/j(-14))/((j/j1)/j)28 assuming j is positive. j29 Simplify (hh(1/4))/h(-2/5)(h(-2))(-18) assuming h is positive. h(753/20) Simplify (((w/w(-8))/w)/ww(12/5))/(w(3/4)/ww(w/w(-6/7))/w) assuming w is positive. w(1091/140) Simplify (((h(-1/5)/h)/h)(-19/4)/((hh/h*(-1/8)hh)/h(-2/7)))(-17/4) assuming h is positive. h(-28747/1120) Simplify (m(4/9)m)(-21)/(m(-26)/m(2/31)) assuming m is positive. m(-397/93) Simplify ((rrr*1/rr)/r(-3))/(r(-8)r(r/(r/(((rr12)/r)/r)))/r) assuming r is positive. r3 Simplify ((s0)(-1)s/s*(2/17)ss(-8))(-49) assuming s is positive. s(5096/17) Simplify ((y/y(-6)y/y(-18))(-30))(-29) assuming y is positive. y22620 Simplify (c*(-31)/c)/((cc/c*(2/27))/cc)c(1/11)ccc19 assuming c is positive. c(-3812/297) Simplify (((i(-16)/i)/i)/(i/i26))/((ii(-1))/i29) assuming i is positive. i36 Simplify (zzz(2/9)z)*(2/11)((z*8/z)/zz)/z(-9/7) assuming z is positive. z(6148/693) Simplify ((y/(y/y(-2/29)))/y(-10))(5/4) assuming y is positive. y(360/29) Simplify ff9ff(1/19)(fff/f*(-7))/(fff(2/5)) assuming f is positive. f(1772/95) Simplify o/(oo*(-7/2)o)o/(o(-1/4)/o)o*(-9)o(-3) assuming o is positive. o(-29/4) Simplify (((s/(s*(-1/9)s))/(ss(-4/7)s))/(s*(1/2)s)(-4/27))41 assuming s is positive. s*(-943/21) Simplify ((yy*8)/y)/(yy/y*(-33))(yyyy(-3/8)yy)(12/7) assuming y is positive. y(-267/14) Simplify ((r/r(-9)r(-4/5))/((r0/rr)/rr/((r/(r/(rr/((r(2/3)/rr)/rr))r))/r)))(-25) assuming r is positive. r(-640/3) Simplify ((kk(4/7)k/k0)/(k/k(-3/7)((((k/((kk/(k((kk*3)/kk)/k))/k))/kk)/kk)/k)/k))(6/11) assuming k is positive. k(-36/77) Simplify (rr/((rr*(-22/5)r)/r)rr*23)/((((rr*(-3/7))/rr)/r)/(r/((rr(6/5)r)/r))) assuming r is positive. r(1002/35) Simplify v(1/5)/(vv(-4/19))((v/(v*1vv))/v)/((vv(5/8)/v)/v) assuming v is positive. v(-2443/760) Simplify ((d/(dd(-1/4)/dd)dddd/d*8d)/(d*2((dd(-6))/d)/dd))(-2/57) assuming d is positive. d(-5/114) Simplify ((bb/(b9/bb))/b(-14))/(b/(b/b(-11))bb*9/bbb) assuming b is positive. b7 Simplify (((r/(r(-2/11)r))/(rr1/rr))42)42 assuming r is positive. r(-35280/11) Simplify (p(3/2)/pppp/p(2/41))/(p(-12)/(p(4/9)/p)) assuming p is positive. p(10993/738) Simplify ((d13dd/((d(-3)d)/d))(2/15))41 assuming d is positive. d(492/5) Simplify g13/(g(g17/g)/g)gg/g15(gg(-8/5))/g assuming g is positive. g(-88/5) Simplify ((s(3/16)ss(1/6)s)(16/5))(-31) assuming s is positive. s*(-3503/15) Simplify ff/(ff(3/11))f/((f/(((f*(2/39)/f)/ff)/f))/f)ff*(30/7)ffff30 assuming f is positive. f(114307/3003) Simplify (((v(2/9)v)/(v(v(-4)/v)/vv))/(v(-1/4)/(v/v(-6))))(-13/5) assuming v is positive. v(-5837/180) Simplify p*(-11)/(p(p/(p/(p*(-10)/p)))/p)p*7pp(-16) assuming p is positive. p(-8) Simplify (c(1/19)/c(11/4))38 assuming c is positive. c(-205/2) Simplify (l(-8/11)ll/((l(-28)l)/lll))(2/15) assuming l is positive. l(40/11) Simplify t(2/23)/t(-1)(((t(-12)t)/t)/t)/(t/((t*(2/21)t)/t)t) assuming t is positive. t(-6674/483) Simplify c(-4/7)/(c(c((c/(c/(c(-10)c)))/c)/cc)/cc)(ccc(-2/13))/c(-7) assuming c is positive. c(1481/91) Simplify (y/y(-2/5)yy(yy(2/21))/y)/((y(yyy*(-2/7))/yyyyy)/(y3y)) assuming y is positive. y(187/105) Simplify (((q/q(2/15))/q(2/5))/(q(2/7)qqqq*1/qq))13 assuming q is positive. q(-5213/105) Simplify (u(1/32)/(u/(u(4/3)/u)))/(uuu(-4/7))(-2/59) assuming u is positive. u*(-23273/39648) Simplify (((ff*(-2))/(ff(-5)))15)(-37) assuming f is positive. f(-1665) Simplify ((p/(p(p12/p)/p))/(pp/p(-14)))/(p(-1/2)/pp)(-4/3) assuming p is positive. p(-80/3) Simplify (l(-3)/l(-2/7)(l*1l)1)(-45) assuming l is positive. l(225/7) Simplify ((y2/y)*(-2/103)/(yy*(-4/9)yy(2/31)))(2/37) assuming y is positive. y(-94228/1063269) Simplify rrr/(r/(r/(rr*(-3/4))))r*(1/11)((rrr(2/7))/r)(1/7) assuming r is po	{ "pile_set_name": "DM Mathematics" }
What is the y'th term of -21638, -30879, -40122, -49367, -58614, -67863? -y*2 - 9238y - 12399 What is the z'th term of -517116, -1034265, -1551414, -2068563, -2585712, -3102861? -517149z + 33 What is the d'th term of 1798146801, 1798146802, 1798146803? d + 1798146800 What is the n'th term of -609, -4654, -12147, -23088, -37477, -55314? -1724n*2 + 1127n - 12 What is the o'th term of -117680, -119419, -121158, -122897? -1739o - 115941 What is the u'th term of -71726, -286191, -643632, -1144049, -1787442, -2573811, -3503156? -71488u2 - u - 237 What is the b'th term of 23202572, 23202562, 23202550, 23202536, 23202520, 23202502? -b2 - 7b + 23202580 What is the s'th term of 292879, 585752, 878637, 1171540, 1464467? s3 + 292866s + 12 What is the r'th term of 200346, 200332, 200314, 200292, 200266, 200236, 200202? -2r2 - 8r + 200356 What is the c'th term of -9536, -38261, -86150, -153203? -9582c2 + 21c + 25 What is the h'th term of -1696, -1751, -1834, -1957, -2132, -2371, -2686? -2h3 - 2h*2 - 35h - 1657 What is the w'th term of -84576, -171169, -257760, -344349? w*2 - 86596w + 2019 What is the a'th term of -93522, -374104, -841730, -1496394, -2338090? a*3 - 93528a*2 - 5a + 10 What is the v'th term of 875217068, 875217067, 875217066, 875217065? -v + 875217069 What is the s'th term of -84555899, -169111807, -253667715, -338223623, -422779531? -84555908s + 9 What is the y'th term of -10317, -15177, -20037, -24897, -29757, -34617? -4860y - 5457 What is the r'th term of -14725390, -14725387, -14725384, -14725381, -14725378, -14725375? 3r - 14725393 What is the n'th term of 1387, 6634, 15379, 27622? 1749n2 - 362 What is the k'th term of -191990, -383351, -574710, -766067, -957422, -1148775? k2 - 191364k - 627 What is the b'th term of 2244, 9063, 20724, 37467, 59532? 40b*3 + 2181b*2 - 4b + 27 What is the m'th term of -4022, -7942, -11874, -15824, -19798, -23802, -27842? -m*3 - 3913m - 108 What is the u'th term of 5095, 9960, 14591, 18988, 23151, 27080, 30775? -117u2 + 5216u - 4 What is the z'th term of 398, 429, 38, -985, -2850? -35z3 - z2 + 279z + 155 What is the w'th term of 698398, 2793628, 6285688, 11174578, 17460298, 25142848? 698415w2 - 15w - 2 What is the v'th term of -21769, -20591, -19413, -18235? 1178v - 22947 What is the f'th term of -1311, -2747, -4585, -6825, -9467? -201f*2 - 833f - 277 What is the u'th term of -6101661, -12203451, -18305241, -24407031, -30508821? -6101790u + 129 What is the r'th term of -965077, -1930304, -2895533, -3860764? -r2 - 965224r + 148 What is the z'th term of 144995, 278992, 412989, 546986, 680983, 814980? 133997z + 10998 What is the g'th term of 291810, 583604, 875398, 1167192? 291794g + 16 What is the s'th term of 44059, 44024, 43979, 43924, 43859? -5s2 - 20s + 44084 What is the j'th term of -4090, -12344, -20598? -8254j + 4164 What is the q'th term of 686516249, 1373032500, 2059548751? 686516251q - 2 What is the i'th term of -60762, -60729, -60684, -60627, -60558? 6i2 + 15i - 60783 What is the g'th term of 21584, 22299, 23516, 25235, 27456, 30179, 33404? 251g2 - 38g + 21371 What is the s'th term of 173466, 173393, 173200, 172827, 172214? -10s3 - 3s + 173479 What is the r'th term of -142544, -285237, -427930, -570623, -713316? -142693r + 149 What is the r'th term of 3472010, 6944081, 10416152, 13888223, 17360294? 3472071r - 61 What is the p'th term of 115, -880, -2529, -4826, -7765, -11340, -15545, -20374? p*3 - 333p*2 - 3p + 450 What is the z'th term of -305, -495, -387, 13, 699, 1665, 2905, 4413? -z*3 + 155z*2 - 648z + 189 What is the u'th term of -77511, -155042, -232573, -310104, -387635? -77531u + 20 What is the n'th term of 38748, 39221, 40002, 41085, 42464, 44133, 46086? -n3 + 160n*2 + 38589 What is the b'th term of 24345, 48178, 71499, 94308, 116605, 138390, 159663? -256b*2 + 24601b What is the f'th term of 203, 718, 1579, 2786, 4339, 6238, 8483? 173f2 - 4f + 34 What is the o'th term of -305403, -610842, -916259, -1221642, -1526979, -1832258, -2137467? 2o3 - o2 - 305450o + 46 What is the g'th term of 2588, 3007, 3354, 3623, 3808, 3903? -g*3 - 30g*2 + 516g + 2103 What is the u'th term of 6, -72, -250, -570, -1074, -1804, -2802? -7u3 - 8u*2 - 5u + 26 What is the p'th term of -190819, -357342, -523877, -690430, -857007, -1023614, -1190257? -p*3 - 166516p - 24302 What is the i'th term of 758, 1286, 1284, 488, -1366, -4542? -44i3 - i2 + 839i - 36 What is the k'th term of -180, -765, -1644, -2817, -4284, -6045, -8100? -147k2 - 144k + 111 What is the n'th term of 404465, 404468, 404461, 404438, 404393, 404320, 404213? -n3 + n2 + 7n + 404458 What is the k'th term of 3870555, 3870473, 3870391, 3870309? -82k + 3870637 What is the w'th term of 9094, 34518, 76914, 136300, 212694, 306114, 416578, 544104? 3w3 + 8468w*2 - w + 624 What is the o'th term of -15654, -31323, -47086, -62991, -79086, -95419? -8o3 + o2 - 15616o - 31 What is the f'th term of -192582, -192585, -192590, -192597? -f2 - 192581 What is the q'th term of 2689, 2621, 2473, 2245? -40q*2 + 52q + 2677 What is the r'th term of -47873, -95759, -143655, -191567, -239501, -287463? -r3 + r2 - 47882r + 9 What is the y'th term of -9169, -7445, -4573, -553? 574y*2 + 2y - 9745 What is the b'th term of -16088106, -16088109, -16088112? -3b - 16088103 What is the w'th term of 56543, 57716, 59671, 62408? 391w*2 + 56152 What is the c'th term of -159, -2681, -9559, -22971, -45095, -78109? -363c*3 + 19c + 185 What is the k'th term of -3462472, -13849908, -31162310, -55399684, -86562036, -124649372, -169661698? -k*3 - 3462477k*2 + 2k + 4 What is the k'th term of 1363, 1125, 731, 181, -525, -1387? -78k2 - 4k + 1445 What is the s'th term of 297, 806, 1669, 2892, 4481, 6442, 8781? s*3 + 171s*2 - 11s + 136 What is the d'th term of -5968443, -11936915, -17905389, -23873865? -d*2 - 5968469d + 27 What is the r'th term of 93, 254, 587, 1140, 1961? 8r3 + 38r*2 - 9r + 56 What is the n'th term of -35554, -71503, -107452? -35949n + 395 What is the q'th term of 608900, 1217819, 1826740, 2435663? q2 + 608916q - 17 What is the o'th term of 2094, 3348, 4562, 5730, 6846, 7904? -o*3 - 14o*2 + 1303o + 806 What is the l'th term of 99021, 98951, 98881, 98811, 98741, 98671? -70l + 99091 What is the i'th term of -1551, -6785, -15701, -28299, -44579, -64541? -1841i*2 + 289i + 1 What is the u'th term of -26642, -106531, -239672, -426065, -665710, -958607, -1304756? -26626u2 - 11u - 5 What is the v'th term of -6228228, -12456454, -18684680, -24912906? -6228226v - 2 What is the a'th term of -10849, -43649, -98385, -175063, -273689, -394269? -a3 - 10962a*2 + 93a + 21 What is the p'th term of 804, 941, 1070, 1191, 1304? -4p2 + 149p + 659 What is the o'th term of 33733, 33426, 33117, 32806? -o*2 - 304o + 34038 What is the p'th term of -11726, -93850, -316770, -750884, -1466590, -2534286, -4024370, -6007240? -11733p3 + 7p What is the q'th term of -8947, -35835, -80577, -143113, -223383, -321327? 10q3 - 8987q*2 + 3q + 27 What is the c'th term of -100534, -406508, -916464, -1630402? -101991c2 - c + 1458 What is the x'th term of 856, 6638, 22084, 51946, 100976, 173926? 792x*3 + 80x*2 - 2x - 14 What is the k'th term of -6384, -12901, -19434, -25983, -32548, -39129, -45726? -8k2 - 6493k + 117 What is the a'th term of 20981565, 41963141, 62944717, 83926293, 104907869, 125889445? 20981576a - 11 What is the k'th term of -5114835, -10229672, -15344509, -20459346, -25574183? -5114837k + 2 What is the j'th term of 5471, 4565, 3659, 2753, 1847? -906j + 6377 What is the x'th term of 2914277, 5828553, 8742829, 11657105? 2914276x + 1 What is the c'th term of 53016, 105112, 157208, 209304, 261400? 52096c + 920 What is the v'th term of -691, -3577, -8655, -15931, -25411, -37101, -51007? -v3 - 1090v*2 + 391v + 9 What is the i'th term of 3337, 12190, 26561, 46450? 2759i2 + 576i + 2 What is the j'th term of -99493, -198761, -297811, -396643, -495257, -593653, -691831? 109j2 - 99595j - 7 What is the v'th term of -6119, -4912, -2901, -86, 3533? 402v*2 + v	{ "pile_set_name": "DM Mathematics" }
is the nearest to s in -0.2, c, i? -0.2 Let i = 122 + -119. Let j = -18 + 17.9. Which is the closest to j? (a) -0.2 (b) 5 (c) i a Let l = -2522.7 - -2523. What is the closest to -109/8 in 5, l, -0.4? -0.4 Let o = -2 - -3. Suppose -20d + 2d = -25 - 11. Suppose o = -h + dp, -p - 3p = -4. Which is the nearest to 2/5? (a) 1/3 (b) -3 (c) h a Let u = -91.05 + 91.1. What is the closest to 2/3 in -3, 3, u? u Let t = -5.0541 + 0.0541. Which is the closest to 3? (a) -0.093 (b) t (c) -0.2 a Let w(m) = m*3 - 15m*2 + 2m - 34. Let b be w(15). What is the nearest to -3 in -9.2, -0.3, b? b Suppose -2z + 4z - 5 = -3l, -z - 5l = 1. Let n(k) = -20k + 86. Let r be n(z). Which is the nearest to 2/21? (a) 3 (b) r (c) -2 c Let t = 25836 + -594225/23. Which is the nearest to 2/5? (a) -1 (b) 1/11 (c) t c Let y be (1/4)/(3/6). Let w = -3441 - -519593/151. Let o = w - -276/1963. Which is the closest to 2/7? (a) o (b) y (c) -2 a Let d = -1.5 - -2.9. Let j be (-80)/(-360)((-8)/(-20) - 36/40). What is the closest to 2 in j, -2, d? d Let h = 8.5209 + 0.0191. Let d = -0.46 - h. Let g = 4 + d. Which is the nearest to -0.1? (a) g (b) 4 (c) 0 c Let x = 1 - 2. Let m = 27/4 - 123/20. Let w = -1091 - -1094. Which is the nearest to -2/7? (a) w (b) m (c) x c Let p = 57 - 57. Let j = -32.2 - -24. Let d = 7.2 + j. Which is the nearest to d? (a) -4 (b) p (c) 4 b Let r = -8641 - -8637. Let u = 2 + -1. Let w = u - 0.9. What is the closest to -0.3 in w, r, -0.1? -0.1 Let n be ((-4)/6)/(((-930)/(-9))/(-62)). Which is the closest to -6? (a) -2/9 (b) n (c) -5 (d) 28 c Let k = -110.132 - -0.132. Let s = k + 49. Let m = 61 + s. Which is the nearest to 0? (a) -1/4 (b) m (c) 0.4 b Let j = 0.9 + -1.2. Let l = -0.76 + 0.78. Let r = -5.2 + 5.3. Which is the closest to 1? (a) r (b) j (c) l a Let n = 0.96762 - -0.03238. Let z be 4/14 - (-8)/70. Let y = 44 + -42. Which is the nearest to z? (a) n (b) -5 (c) y a Let d = 0.06 - -0.94. Let i be 5 + 6/((-630)/545). Let w = i - -37/84. Which is the nearest to 1/4? (a) w (b) d (c) 3 a Suppose 61z + 191 - 1847 = -11z. What is the nearest to 0 in -4/5, 0.3, z, -1/6? -1/6 Let t = -0.97 - -5.97. Let u = 213/4 - 1049/20. Which is the nearest to -1? (a) t (b) -2/3 (c) u b Let p = 839 - 840.9. Let o = 44 + -43.9. What is the nearest to o in p, -3, 1/6? 1/6 Suppose 5 = -n - 1022f + 1024f, 5n + 11 = 3f. Let j = 3 + -2.97. Let a = -23 + 67/3. What is the closest to 1 in a, j, n? j Let t = -351.1 - -352.6. Let d = -4 - -4.5. What is the closest to 2 in 3, t, d? t Let c = 2.8 - -1.2. Let y be (-6)/8 + (-108)/(-16) + 2. Let d be ((-3)/y-1)/((-3)/(-2)). What is the closest to -1 in d, c, 0? 0 Let l be (927/105 - 9)410/(-246). Let z be (-1)/((-3 - -1)/(-2)). Which is the nearest to 1? (a) -1/4 (b) l (c) z (d) 1 d Let k = 10573 - 10569. What is the nearest to -2 in k, -0.06, -212, 2? -0.06 Let h = -1805 - -1805.9. Which is the nearest to -2? (a) -2 (b) h (c) -2/25 a Let n be 4564/18 - (-14 + 18). Let u = 250 - n. Let w(z) = z*2 - 5z - 4. Let m be w(6). Which is the closest to m? (a) 5 (b) u (c) 1 c Suppose -2v + 5q = 235 + 57, 0 = -2v - 4q - 274. Let h = -144 - v. Let s = 2/7 + -11/14. Which is the nearest to 1? (a) 1/5 (b) s (c) h a Suppose -711k = 3x - 710k + 9, -2x - 14 = 2k. What is the nearest to x in -230, -1/2, 2/5? -1/2 Let a = 154.3 + -157. Let m = 4.7 + a. Let g be (4 + (-2)/1)-2. What is the nearest to m in -1, 1, g? 1 Let p = -460 - -713. Let x be (-4)/(-22) + 1978/p. What is the closest to 2 in 6/7, -2, x? 6/7 Let g(x) = -297x + 1783. Let u be g(6). What is the closest to u in -2/5, -4/29, -0.3, 1/4? 1/4 Let n be -2 + 2 + 20 + 1 + 0. Let k be ((-6)/n)/(-1 - (-36)/21). Which is the nearest to -0.07? (a) -0.1 (b) 2 (c) k a Let i = -10 - -7. Let d(o) = -o2 + 2o + 28. Let h be d(6). Let k be (-11 - (-1240)/112)/(2/h). What is the nearest to -1 in -1, i, k? -1 Let w be 9/15 + (-162)/420. Which is the nearest to 2/7? (a) 1 (b) w (c) 5 (d) -1/9 b Let s = 27579 + -110319/4. Let o be (-3 - -4)/((-2)/(-4)). Which is the nearest to o? (a) s (b) 5 (c) 2.1 c Let m = -0.11472 - -0.01472. Which is the closest to 0.2? (a) -52 (b) m (c) -4 b Let l = 0.1 - 0.4. Let h = 16219 - 16219. Which is the closest to h? (a) -4 (b) -7/2 (c) l c Let i = 34.2 + -34. Let s = 530 + -529. Let k = -8 - -2. What is the closest to -0.1 in i, k, s? i Let k = 115/7 + -1049/63. Let s be (-6 - (-270)/20)1/(-20). Let g = 171 - 166. Which is the nearest to k? (a) g (b) s (c) -4 b Let o = 90.2 + -63. Let f = o - 26.9. Let i = 0 + 4. Which is the nearest to -1? (a) -2 (b) i (c) f a Let f = 23 - 23.09. Let k = f + -0.11. Let h = 38/15 + -32/15. Which is the nearest to -0.2? (a) -2 (b) k (c) h b Let y be 2 - 2(-3)/6. Suppose 0 = -3p + y - 0. Let f = -1282/6435 - 1/1287. What is the nearest to 2 in f, p, 2/15? p Suppose k + 4p - 18 = 0, -116 + 128 = 2k + 4p. Which is the nearest to k? (a) -0.05 (b) 1 (c) -0.01 a Let i = -632.401 - -632. Let q = 0.201 + i. Let m = 2/79 + 71/316. Which is the nearest to m? (a) 3/2 (b) q (c) 0 c Let a = 563.7 + -570.7. What is the closest to -0.4 in a, -4, -0.5, 4? -0.5 Let y = -1736/13 + 8719/65. What is the closest to -0.8 in -2/17, y, 4? -2/17 Let z = -12396 - -12393. Which is the closest to 2/7? (a) z (b) -10.7 (c) -0.5 (d) 0.01 d Let o = -6163 - -6163. What is the closest to o in -3, -7, -65? -3 Let a = 2.99 - -0.41. Let q = a + 1.6. Let c be ((-6)/(-5))/((-93)/1550). What is the nearest to 0 in c, q, -0.2? -0.2 Let v = 4686 + -4699. Which is the closest to 4? (a) -1/5 (b) -5 (c) v a Suppose 0 = q + 1 + 2. Let h = 74.896 + -75. Let w = h + -2.896. What is the nearest to w in q, -4, -1? q Let i = -1158.2 - -1158. Which is the closest to i? (a) 0.2 (b) -3/2 (c) -147/8 a Let k(a) = a*2 - 12a + 2. Let v be k(12). Suppose -2y + 1 = -3b, -y + 3b + v = -0. What is the closest to y in 2/15, -4, 2/7? 2/15 Let d be (18/84)/(3/(-36)) - 6/14. What is the nearest to 0.1 in 4/9, -1, d, -2.19? 4/9 Let v be (4 - 28/12) + 78/18. What is the closest to v in 0.1, 0.5, 0.3, 41? 0.5 Let y be 4/6 - (-5)/(-6). Let w = -1288 - -864. Let n = 423 + w. What is the closest to 2/5 in n, 2/5, y? 2/5 Let t = -34860 - -34860.3. What is the closest to 0.06 in -2, 2/33, t, -5? 2/33 Let j = -14970.1 + 14970. What is the closest to j in -0.02, -0.5, -515? -0.02 Let q = 29197 + -29197.06. Which is the closest to 2? (a) q (b) 0.08 (c) -0.05 b Let v be (-1 - -1) + (5 - 1). Let m = -1529 + 1536.1. Let u = m + -7.1. What is the closest to 1 in 0.2, u, v? 0.2 Let n be 14/(-42) + ((-20)/(-6) - -1). Let r = -1.22 - 76.78. Let j = -77.8 - r. What is the closest to 0.1 in j, -1, n? j Let k = -46.768 + 13.373. Let v = 0.495 + k. Let y = v + 33. Which is the nearest to 12/11? (a) 2 (b) y (c) 1 c Let z be (-181392)/322/66. Let h = 343/2 + z. What is the nearest to 0.2 in 0.02, h, -0.2? 0.02 Let m = -16311 + 16311.06. What is the nearest to 3/5 in 5/18, m, 1/3, -2/7? 1/3 Let k = -0.28 + -0.02. Let o = 44 + -287. Let u = o + 247. Which is the closest to u? (a) k (b) -3/4 (c) -2/7 c Let h = 3834.05 - 3833. What is the closest to 2 in h, 1, -5, 0.4? h Let s = -0.335 - -0.035. Which is the closest to -0.3? (a) 0.5 (b) 0.15 (c) -1 (d) s d Let h = 0.03774 + -13.03774. Which is the closest to -2/5? (a) -3 (b) h (c) -0.2 c Let h = -15.269 - 0.731. What is the nearest to h in 1, 3, -31? -31 Let q = -12348.99 - -12349. Which is the nearest to 2/13? (a) 0.4 (b) 0.6 (c) q c Let l be (-986)/2142 + 7/252-4. Which is the nearest to 2? (a) l (b) -11.6 (c) -0.2 c Let x = 2 - 0. Suppose 0 = -xs - s - 3. Let p be 301/(-258) + (-2)/(-3). What is the closest to p in 1, s, 0.11? s Let b = -181 + 280. Let f = b + -97. What is the nearest to 0.1 in f, -8, 0.09? 0.09 Let h = -30 - -30.5. Suppose 121 = -u + 117. Which is the closest to -1/3? (a) u (b) -36 (c) h c Let z = 12 - 22. Let y = -9.7 - z. Let f be (3/(-5))/(189/(-70)). What is the closest to f in 2, -0.2, y? y Let z be (-9 + 8)(-13 - -2). Let h = z - 7. Let p be 3/h(-3 - 213/(-63)). What is the closest to p in 3/2, 0, 1? 0 Let m = -8419 - -1978462/235. Let o = 211/1880 - m. Which is the nearest to 2/5? (a)	{ "pile_set_name": "DM Mathematics" }
1 = 150z + 1096 for z. 5 Solve -62n + 1984 = 3472 for n. -24 Solve 73772i - 73734i + 950 = 0 for i. -25 Solve -2759 - 2624 + 1783 = -200h for h. 18 Solve 205d + 1204 + 1094 = -1392 for d. -18 Solve -28t = -83t - 44t + 1089 for t. 11 Solve 0 = 19f - 18795 + 18909 for f. -6 Solve 0 = 10y + 1298 - 1268 for y. -3 Solve 0 = -2m + 211 - 219 for m. -4 Solve -412h - 4420 = -14720 for h. 25 Solve -8x - 1436 = -1420 for x. -2 Solve -27a - 98a = -158 - 2217 for a. 19 Solve -119q + 371 = -172q - 636 for q. -19 Solve -510a = 1978 + 4652 for a. -13 Solve 192m = -193m - 6160 for m. -16 Solve 210s + 17160 = 690s + 300s for s. 22 Solve 12u - 3u + 130 = -4u for u. -10 Solve -1630t - 208 = -1646t for t. 13 Solve 1089 = 292a - 193a for a. 11 Solve 171 - 58 = -26l - 173 for l. -11 Solve 9d - 65 = -2d - 208 for d. -13 Solve 30f + 790 = -49f for f. -10 Solve -7d + 4 = -219 + 20 for d. 29 Solve 63p = 234p + 88p - 1295 for p. 5 Solve -689 = 216s - 8033 for s. 34 Solve -238g + 201g = 360g + 7543 for g. -19 Solve -211i + 3714 = 16i - 372 for i. 18 Solve -2310 = -339001v + 338896v for v. 22 Solve -230s = -273s + 43 for s. 1 Solve -123 = -28955d + 28996d for d. -3 Solve -9202v + 9203v = 6 for v. 6 Solve -211i - 1 + 518 = -327 for i. 4 Solve -37u + 16 = 90 for u. -2 Solve 9 = 50m - 107 - 84 for m. 4 Solve 278u + 4580 - 140 = -18u for u. -15 Solve -449 = -18k - 125 for k. 18 Solve 29g + g - 330 = 0 for g. 11 Solve 1370d = 1092d + 5004 for d. 18 Solve 0 = -237t - 1155 + 1591 + 2171 for t. 11 Solve -581 - 259 = -56g for g. 15 Solve -18o = 84o + 119o + 2431 for o. -11 Solve 1050 = -20336r + 20371r for r. 30 Solve 2970f = 2817f + 1071 for f. 7 Solve -155 + 2570 = -69r for r. -35 Solve 0 = 12k - 39123 + 39135 for k. -1 Solve 57k - 1683 = 228k + 16k for k. -9 Solve -3157 = -1555p + 170p - 8697 for p. -4 Solve -173 = 62d + 1097 + 32 for d. -21 Solve 18559k - 18614k = 880 for k. -16 Solve 45 = -6n - 15 for n. -10 Solve 115539i = 115544i + 150 for i. -30 Solve -111a - 2a - 202a = -3150 for a. 10 Solve -99g + 4592 = 188g for g. 16 Solve -13l = -0l - 275 + 106 for l. 13 Solve 91f - 66f + 162 + 63 = 0 for f. -9 Solve -9699i + 9691i = -40 for i. 5 Solve 16121t + 23 = 16122t for t. 23 Solve -84d - 59d = 52d - 975 for d. 5 Solve -93y = -291 - 732 for y. 11 Solve 987 - 395 = 37a for a. 16 Solve -194s = -26s + 1344 for s. -8 Solve 14c - 2c + 528 = 56c for c. 12 Solve -128 = -7798y + 7862y for y. -2 Solve -53w + 1626 = -2w + 220w for w. 6 Solve 29j + 37j = -149j - 430 for j. -2 Solve -130s + 339 - 68 = -249 for s. 4 Solve 120l + 44l = -9l + 1557 for l. 9 Solve -154r + 76r + 81r = -24 for r. -8 Solve 5840 = 666m + 65m - 739 for m. 9 Solve -1238s = -1515s + 2770 for s. 10 Solve 731 - 731 = 6d for d. 0 Solve 495n + 905n - 16706 = -1306 for n. 11 Solve -68 = -7t - 103 for t. -5 Solve -476 = -3157u - 3167u + 6290u for u. 14 Solve -6716 = 458d + 1070 for d. -17 Solve 83u - 531 + 33 = 0 for u. 6 Solve -445q + 366 = -1859 for q. 5 Solve -610 = -32s - 4s + 38 for s. 18 Solve 196p = 213p + 110 + 60 for p. -10 Solve -127a + 78 = -557 for a. 5 Solve -79401 = 3s + 22s - 79226 for s. -7 Solve 6h - 255 = -243 for h. 2 Solve 14j - 43j = 116j + 1740 for j. -12 Solve 20 = -1295z + 1314z - 18 for z. 2 Solve 0 = -163m - 2436 + 6511 for m. 25 Solve -542t - 4244 - 1846 - 956 = 0 for t. -13 Solve 26s = -518s - 6729 + 745 for s. -11 Solve -195r + 326r - 12516 = -316r for r. 28 Solve -65d - 18810 = 505d for d. -33 Solve 0 = -6005w + 6130w - 750 for w. 6 Solve 35c - 211 = -7c - 1849 for c. -39 Solve 380 = 7i - 83i for i. -5 Solve 12m + 5 = 1 - 8 for m. -1 Solve -24w + 47w - 27w = -72 for w. 18 Solve 2732g = 2698g + 680 for g. 20 Solve -811r + 23 - 23 = 213r for r. 0 Solve 546v + 153v - 14762 = 28v for v. 22 Solve -182m - 1813 = 2919 for m. -26 Solve 121l = 362l - 2169 for l. 9 Solve -2s - 10s - 7 = -103 for s. 8 Solve -1329b - 23977 = 4995 + 266 for b. -22 Solve 0 = 39t - 5391 + 4806 for t. 15 Solve -7q - 347 + 466 = 0 for q. 17 Solve -25k = 2447 - 2097 for k. -14 Solve -14 - 459 = 19j - 74 for j. -21 Solve 1730i - 1577i - 1836 = 0 for i. 12 Solve 49v = 6590 - 7374 for v. -16 Solve -1369a = -1403a - 374 for a. -11 Solve -489t - 490t + 976t = -27 for t. 9 Solve 0 = 31k + 3980 - 3577 for k. -13 Solve -97t + 28t = -621 for t. 9 Solve -10v - 333 + 233 = 0 for v. -10 Solve -149y + 154y + 40260 = 1347y for y. 30 Solve 247y - 235y - 36 = 0 for y. 3 Solve 0 = 96i + 296 + 376 for i. -7 Solve -62q = 32576 - 32700 for q. 2 Solve -123f - 1489 = -13 for f. -12 Solve 372 - 122 = -43w - 180 for w. -10 Solve -19709r = -19683r - 260 for r. 10 Solve 210j - 149j = 0 for j. 0 Solve 0 = 223m - 2539 - 137 for m. 12 Solve 56r = 87r - 152 - 251 for r. 13 Solve -300z = -318z for z. 0 Solve 100d - 37 = 135d + 383 for d. -12 Solve 152f - 186 = -642 for f. -3 Solve 1385l + 414 = 1523l for l. 3 Solve 5q = -160 + 135 for q. -5 Solve 23z - z - 505 = -505 for z. 0 Solve -830 + 2070 = -98r - 1406 for r. -27 Solve -415 - 1135 = -62f for f. 25 Solve 0 = -13m - 1634 + 1621 for m. -1 Solve 12555 = 306l + 275l - 2551 for l. 26 Solve -64j + 48j - 76j + 828 = 0 for j. 9 Solve 100f - 3492 = -94f - 97f for f. 12 Solve 848 - 814 = 161d + 3415 for d. -21 Solve 0 = 13x + 12822 - 12848 for x. 2 Solve 120 - 276 = 12p - 0p for p. -13 Solve 2679 - 669 = 201k for k. 10 Solve 0 = 177436x - 177399x - 1147 for x. 31 Solve 18i - 54 = 20i + 25i for i. -2 Solve 41r = 7r + 34 for r. 1 Solve 632 = -39i - 40i for i. -8 Solve -27 + 17 = 2l + 8 for l. -9 Solve 1447 = -975c + 11197 for c. 10 Solve -18s = 421 + 444 - 271 for s. -33 Solve -124 = 34k + 52k + 134 for k. -3 Solve -24u + 27u + 0u = 21 for u. 7 Solve 430 = -162g + 2352 + 508 for g. 15 Solve 2n - 6 = 33n + 490 for n. -16 Solve 87v - 932v + 25160 = -105v for v. 34 Solve -269 = 277v + 2224 for v. -9 Solve -10y = 13y + 102 - 10 for y. -4 Solve -411k + 3072 + 3509 + 3283 = 0 for k. 24 Solve 463 = -27q + 382 for q. -3 Solve -406 = -29x - 116 for x. 10 Solve 0 = 165p + 4310 - 4475 for p. 1 Solve -1145 = 113p - 342p for p. 5 Solve -165 - 645 = -80n - 10n for n. 9 Solve 0 = -64x - 87x - 2416 for x. -16 Solve 325s = -355s + 10200 for s. 15 Solve -22605 = 1838n + 21507 for n. -24 Solve 111f + 730 = -158 for f. -8 Solve 112a + 299 = 56a - 317 for a. -11 Solve 152219o - 152233o + 140 = 0 for o. 10 Solve 21 = -11m - 19 - 59 for m. -9 Solve -558b - 2306 = -117b - 542 for b. -4 Solve -1383l - 1356l = -2769l + 510 for l. 17 Solve 13s - 163 = -59 for s. 8 Solve 0 = -18y + 43y + 198 + 202 for y. -16 Solve -927s = -893s - 510 for s. 15 Solve -53o = 30580 - 31852 for o. 24 Solve 1 + 11 = -2q - 2 for q. -7 Solve 0 = -182k + 50k - 1008k + 21660 for k. 19 Solve 41 + 29 = -8a - 2a for a. -7 Solve -10a + 0a - 5a - 195 = 0 for a. -13 Solve 0 = -15u + 47u + 45u - 539 for u. 7 Solve -29d + 19d = -3 - 97 for d. 10 Solve -52710c + 380 = -52690c for c. 19 Solve 66h - 112h - 644 = 0 for h. -14 Solve 155j = -314j + 6364 + 1609 for j. 17 Solve 0 = 10t - 19005 + 19225 for t. -22 Solve 31y = -14y - 4y + 637 for y. 13 Solve 111 = -48y - 223 - 2 for y. -7 Solve -97 - 184 = 19k + 42 for k. -17 Solve 591 - 691 = 50h for h. -2 Solve -1347t + 1416t - 69 = 0 for t. 1 Solve -147f + 14490 = -395f - 235f for f. -30 Solve -788d + 10786 + 14430 = 0 for d. 32 Solve 0 = -72a + 13a - 5a + 384 for a. 6 Solve -498i - 2113 = -40i + 2009 for i. -9 Solve 391v - 2441 + 11483 = 802v for v. 22 Solve -4s = -0s + 784 - 852 for s. 17 Solve -47m + 9430 = 10323 for m. -19 Solve 5j + 8207 = 8177 for j. -6 Solve 22f + 4f + 95 = 407 for f. 12 Solve -148 = 114u + 308 for u. -4 Solve 873d - 1476d - 9612 = -870d for d. 36 Solve 33f = -f for f. 0 Solve -33t + 1226096 - 1226129 = 0 for t. -1 Solve 976 = -213o - 302 for o. -6 Solve 162m = 150m + 24 for m. 2 Solve -139i + 53i = -1720 for i. 20 Solve 0 = 2l - 3 + 29 - 14 for l. -6 Solve 10l + 19l + 423 = -18l for l. -9 Solve 134c - 996 = -1298 - 2914 for c. -24 Solve -114v - 1973 + 833	{ "pile_set_name": "DM Mathematics" }
+ 0l3). 4l*4 + 12000l*3 Expand (3y*2 - 2y*2 - 10y*2)(5y3 + 28y - 28y). -45y5 Expand 0 + 0 - v2 + (2v - 2v + v)(0 + v + 0) + 10783v - 10783v - 3745v*2. -3745v*2 Expand (-27b - 17b - 8b)(-15 - 2b*2 + 15 + 2b)(b - 2b + 9b)(1 + 2 - 2). 832b4 - 832b*3 Expand (-1 + 0 - 1)(-7k5 + 153 - 153) - 15k*5 - 22k5 - k5. -24k5 Expand (-11 + 14 - 23)(-5j4 + 6j4 + j4) - 98j3 + 98j*3 - 2j - j*4 + 3j*2. -41j*4 + 3j*2 - 2j Expand (11501x + 12654x - 8038x + 7359x + 9612x)(-1 + 1 - 2). -66176x Expand -4o + 9o + 36o - 44o - 15o - 13o + (3o - o + 0o)(-4 + 2 + 1). -33o Expand (-2x + 4 - 4)(1818x - 891x - 903x - 2x + 4x - x + 1 + 2x - 1 - 4x - 2x + 5x + 2x + 0x - x + (4 - 1 - 2)(-3x + 2x + 3x)). -58x2 Expand (1 - 1 + 3)(-84t + 44t + 47t) - t + t + 2t + 2t + 3 - 3 + 0t + 2t - t - t - 1 + 1 + (0 - 3 + 1)(1 - 1 - t). 27t Expand (-9n*5 + 4n*5 - 2n*5)(-131 - 207 - 3 - 115 - 109). 3955n5 Expand (-2b*4 - 3b*4 + 4b*4)(2639 - 819 + 3989 + 52 + 3534 - 717). -8678b4 Expand (-3j - 2j + 8j)(4 + 0 - 1) - 4j - 30j - 12j + 15 + 5j - 15. -32j Expand (-4q + 2q + 0q)(2q - 1 + 1) + q2 + q2 - 3q*2 + (-143 - 132 + 95)((2q - 3q + 2q)(4q + 0q - 2q) - q2 + 2q*2 + 0q*2). -545q*2 Expand (0 + 0 - 3q)(3q - 5q + 3q)(-27q*3 + 1336 - 1336). 81q*5 Expand (-28181 - x - 28017 + 56353 + 4x*2)(-5x + 5x - 2x)(-10 + 10 + 3x). -24x*4 + 6x*3 - 930x*2 Expand 2p*3 + 5p - 5p + p3 + 2p*3 - 5p3 - p2 + p*2 + 2p*3 + (0p*3 + 2p*3 - 4p*3)(7 - 2 - 3) + 1037p3 + 354p*3 + 889p*3 + 764p*3. 3042p*3 Expand (u + 2u - u)(3 - 7 + 3) + u - 2u + 0u + 2u + 0u - u + (4046 - 1691 - 1938)(-u + 1 - 1). -419u Expand (2b - b + 6b)(-91b - b3 - 91b - 15b2 + 184b). -7b4 - 105b*3 + 14b*2 Expand -2r*4 + 3r*5 - 3r*5 + 3r*5 + (17r*4 + 2r*4 - r - 4r*4)(8r + 0r - 19r). -162r*5 - 2r*4 + 11r*2 Expand (2t*2 - 3t*2 + 0t*2)(t - t + 2t2) - 13t4 - t4 + 0t4 + 180t*4 + 279t*4 - 548t*4. -105t*4 Expand -2j*5 + 0j*5 + 5j*5 + (2 + 3j*5 - 2)(1 + 3 - 6) + 309j5 + 169j*5 - 149j*5 + 2j5 - j5 + 2j5 + 0j*4 + 0j4 - j5. 328j5 Expand (-h + h - 2h)((-2h + 0h + 0h)(-2 + 6 + 3) + (-4h + 0h + 5h)(1 + 2 - 2) - 2h + 2h + h). 24h*2 Expand ((5 - 3 - 3)(5j - 4j - 3j) + 2j - 4j + 3j + 16j + 10j - 31j)(-3 - 8 + 3). 16j Expand (1133 + 2n - 1221 - 6n + n)(-25 + n*2 + 25). -3n*3 - 88n*2 Expand (-19y - 31y2 + 22y - 58y2)(1 + 0 + 0)(-3y - 3y + 0y). 534y3 - 18y*2 Expand (4 - 3 - 2)(-2c - c + c) + (5 - 2 - 2 + (0 + 2 + 0)(2 - 4 + 3))(-3c - 86 + 86). -7c Expand (-1 + 0 + 3)(-103 - 107 + 212 + 53g) - g + 3g + 0g. 108g + 4 Expand (64u - 124u + 45u)(9 - 8 + 11)(-u + 9 - 9). 180u*2 Expand (0 - 6 + 0)(8r3 - 7r*3 + 12r*3)(-5r + 2r + 2r) + 0r*3 + 0r*3 + 2r*4 - 2r*3. 80r*4 - 2r*3 Expand (-249n + 125n + 1 - n2 + 127n)(38n*3 - 14n*3 - 19n*3) + 0n*2 + 0n*2 - 4n*5. -9n*5 + 15n*4 + 5n*3 Expand (279r + 402r - 21r)(-1 + 7 + 0)(2 + 0 - 3). -3960r Expand (2322z - 4641z + 2321z - 1717)(-2z*2 - 4z*2 + 5z*2). -2z*3 + 1717z*2 Expand 3x*2 - 2x*5 - 3x2 + (x2 - x + x)(0x3 + x3 - 3x3) - 2x5 - x5 + x*5 + 7x*5 + 5x*5 - 5x5 - x3 + 5x3 + 4 + x5 - 2x*3. 2x*5 + 2x*3 + 4 Expand (-4c*3 - 8c*3 + 2c*3)(-3c2 + 2c2 - c2 + (-2c - 2 + 2)(-18 + 11c + 18)) + c5 + 0c*2 + 0c*2. 241c*5 Expand (-7 + 2f*2 + 7)(-1 + 3 - 3) - 502 + 986 - 484 + f*2 - 3f*2 + 146f. -4f2 + 146f Expand (4 - 4 - 1)(2p + 0p - 4p) + 19p - 10p + 0p + (5 - 4 - 2)(20p - 21p - 81p). 93p Expand (-32428s4 + 32440s*4 - 4s + 4s)(s + 3s - 2s)(-8 + 1 - 12). -456s*5 Expand (-h + 0h - h)(-4h + 4 - 4) + 3h2 - 3h*2 + 2h*2 + 15205h - 15205h + 71h*2. 81h*2 Expand (-51k + 70k + 38k + (k + k + 0k)(-1 + 2 - 2))(-4k*2 - 7k + 7k) + (-2 + k3 + 2)(1 - 1 + 1). -219k3 Expand (65z*2 - 34z*2 + 169z*2)(2z - z + 0z)(6z*2 + 2z - 8 + 8). 1200z5 + 400z*4 Expand ((-2 + 1 + 0)(s*2 - 2s + 2s) - 26s*2 + 5 - 5)(-4s - 56 + 53 + 9s). -135s3 + 81s*2 Expand (0 - 3 - 1)(-19 + 19 + 24z) + 2 - 2z - 2 - 32z + 143 - 143. -130z Expand -246h2 - 236h*2 + 81h*2 + (-4h + h + 2h)(0h + h - 4h). -398h2 Expand (v3 - 2v*3 + 5v*3)(457v2 + 205v*2 + 411v*2). 4292v*5 Expand (-8i - 9i + 9i)(3i - 9 + 9)(-1 - 4 + 1) + (0i + i + 0i)(-4i + 2i + 4i) + 2i2 - i2 + 0i2. 99i2 Expand (v3 + v2 - v2)(-3 + 3 - v2) - 3v + 0v5 - 4006v*4 - 2v*5 + 4050v*4. -3v*5 + 44v*4 - 3v Expand 11l2 - 2l*2 + 8l*2 + (-24 + 24 - 4l)(-2 + 2 + 2l) + 4l2 - 2l*2 + 3l*2. 14l*2 Expand (6 - 16 + 3)(-3688d + 2041d + 2178d). -3717d Expand 5r3 + 3r*3 - 4r*3 + (r - r + r)(3r - 3r - 2r2) + (-r2 + r2 + 2r*2)(-219r + 242r + 195r). 438r*3 Expand (-911b*2 - 84073 + 84073)(-12b2 + b3 + 15b*2 + 2b*3). -2733b*5 - 2733b*4 Expand (-4 - 2 + 3)(200c + 594c + 269c). -3189c Expand (-2 + 2 - o)(4 - 6 + 9) + o + o + 0o + 4004 - 4004 - 349o. -354o Expand (-857 - 931 - 39c2 + 1938)(0 + 0 + c*3). -39c*5 + 150c*3 Expand (19 - 63l + 17 - 36)(83l*3 + 616l - 616l)(l - 4l + 7l). -20916l5 Expand (467u + 430u - 722u)(-3 + 1 + 5) + (7 - 3 - 2)(-u - 5 + 5) - 2 + u - u - 2u. 521u - 2 Expand -5 + 9 - 2 + 39w - 266w + (-2 + 0 + 0)(-2w - 2 + 2). -223w + 2 Expand (0h + 6h - 4h)(0 - h + 0 - 4h - h + 4h + (-2 + 2 + 1)(3 - h - 3) - h - h + 0h + (6 + 5 + 1)(3h - 116h - 43h)). -3754h*2 Expand (-5 + 3 + 4 + (-2 + 0 + 1)(-2 + 0 + 0) + 84 - 20 + 108 + 0 - 3 + 0)(-3z*5 + 0z*5 - 7z*5). -1730z*5 Expand (i + 2i + 2i)(11 - 11 - 4i) + (-i + 0i + 0i)(i + 4 - 4 + (18 - 53 - 24)(i + 0i - 3i)). -139i*2 Expand 546t*3 - 602t*3 + 0 + 2 + (-3t2 - t2 + 0t2)(-4t + 4t + 2t). -64t*3 + 2 Expand (-12 + 9 - 9)(-8x - 4x + 4x)(-x + 0x + 8x). 672x2 Expand (5 - 5 - 6)(3j - 1 + 1)((2 - 4 + 0)(3j - j - 3j) + (-13 - 10 + 0)(3 - 2j - 3)). -864j*2 Expand (652w + 1079w + 105w - 323w - 47w)(-2 - 1 + 1). -2932w Expand (0m - 2m + 3m)(-3m2 - 3m*2 + 5m*2) - 2980m*3 + 1 + 22 - 23. -2981m*3 Expand (-73d + 228d - 22d)(16d - 7d + 2 - 8d). 133d2 + 266d Expand (1 + 2r - 1 - 5r + 3r + 3r + (-2r - 2r + 2r)(3 - 1 + 0) - 3r - r + 3r - 30r + 3r + 3r + (-2r + r - r)(-2 + 4 - 1))(-89 + 131 - 111). 1932r Expand (3b*2 - 2b2 + b2 + 3b2 - b2 - b2 + (3 - 2b - 3)(-5b + 2b + 2b) + b2 - b2 - 2b2)(-4441b + 6b - 588b). -15069b*3 Expand (1 - 1 + 2w)(2w*2 + 5w - 5w)(-104w2 + 98w*2 - 111w*2). -468w*5 Expand -478 - 184r*4 + 478 + (r + 2r - 2r)(2r3 - 2r*3 - 2r*3). -186r*4 Expand (0 + 2 - 1)(3l5 + l5 - 5l*5) + (-146l - 206 + 206)(42l*2 - 42l*2 - 36l*4). 5255l*5 Expand (-7 + d - 7 - 19)(7d - 18d - 19d)(3 - 3d + 2d - 4). 30d3 - 960d*2 - 990d Expand (-4j - 3j - 4j)(1 - 2 - 1) - 28j - 37j - 12j. -55j Expand 3v5 + 3v*5 - 4v5 + (1 - 1 - v3)(-21957 + 80v + 21957)(-v - 4v + 2v). 242v5 Expand d4 + 0d4 - 3d*4 + (-6d*2 + 2d*2 - 3d*2)(-5d2 - d2 + 10d*2) - 207 - 5d - 5d2 + d4 + 4d + 208. -29d4 - 5d*2 - d + 1 Expand (-3z - z + 2z)(-3284z2 + 3284z*2 - 17z*4 + (-2z*3 + 0z*3 + 0z*3)(1 - 1 - z)). 30z5 Expand (9 - 28v*2 - 9 - 64v*2)(0v2 + v2 - 5v*2). 368v*4 Expand (6f*3 - 13f*3 + 4f*3 + (f - 2f*3 - f)(2 + 1 - 1))(0 + 0 + 2 + (5 - 2 - 4)(0 + 0 - 2) - 1 + 1 + 4 + 1 - 3 + 4 + (1 + 0 + 1)(-1 - 2 + 1)). -42f*3 Expand (0a - a - a)(6071a - 2241a - 409a). -6842a2 Expand (2 + 2 + 1)((2 + 3 - 3)(-2h + 2h - 2h) + h + 0h - 3h + 0h + 3h - h) + (-3 + 0 - 2)(12 - 13h - 12). 45h Expand (102t*2 - 49t*2 + 59t*2)(-33t + 43t + 21t). 3472t*3 Expand (2u + 1681 - 1683 - 2u - 507u*3)(-6 + 6 - 6u). 3042u**4	{ "pile_set_name": "DM Mathematics" }
-0.54, 5, 0, -35, -1/9, 59 in descending order. 59, 5, 0, -1/9, -0.54, -35 Put 30, 1, 22, 9, 51 in descending order. 51, 30, 22, 9, 1 Sort -529, 3, 2, 71247 in increasing order. -529, 2, 3, 71247 Sort 4, -4, 82, 2, 2601 in ascending order. -4, 2, 4, 82, 2601 Sort -222, -6539, 20 in descending order. 20, -222, -6539 Sort 15/31, -0.1, 164620 in increasing order. -0.1, 15/31, 164620 Sort -6, 2, -5, -4, -5818 in descending order. 2, -4, -5, -6, -5818 Sort -7, -0.03, -3, -1, 439, 0.1 in descending order. 439, 0.1, -0.03, -1, -3, -7 Put 2, 3, -11, -4, -8592 in decreasing order. 3, 2, -4, -11, -8592 Put -5, -4, -664, -30, -20 in decreasing order. -4, -5, -20, -30, -664 Sort -0.0139, -2/7, -0.5, 0, -2. -2, -0.5, -2/7, -0.0139, 0 Sort 100, 110734, -5. -5, 100, 110734 Put -3, 56, 14, 1, 0, 2 in ascending order. -3, 0, 1, 2, 14, 56 Sort 3, -45, 11327, -4. -45, -4, 3, 11327 Sort 924, 4, 4700 in increasing order. 4, 924, 4700 Sort -1, -2148, 58990, 3 in increasing order. -2148, -1, 3, 58990 Put -1, -3, 21, -88, 4, -4, -2 in decreasing order. 21, 4, -1, -2, -3, -4, -88 Sort 1, 26, -0.09, 0, 5, -131/3 in ascending order. -131/3, -0.09, 0, 1, 5, 26 Put 12, -46377, 0, 4 in increasing order. -46377, 0, 4, 12 Sort 5.3, -0.3, -158/19, -0.4. -158/19, -0.4, -0.3, 5.3 Put -1, 2/45, 5, -0.38, -55/2 in decreasing order. 5, 2/45, -0.38, -1, -55/2 Sort 9, -8, 161292, 0 in ascending order. -8, 0, 9, 161292 Sort -3.54, -192064, -4/3 in descending order. -4/3, -3.54, -192064 Sort 1, 12, 0.2, -1.2, -2/3 in descending order. 12, 1, 0.2, -2/3, -1.2 Sort 2, 4, 27, 0, 1718, 1, -1 in descending order. 1718, 27, 4, 2, 1, 0, -1 Put -13090, 4, -1 in ascending order. -13090, -1, 4 Sort 14, -30, 163549, 1, 0.3. -30, 0.3, 1, 14, 163549 Sort 253, 16/13, 3/5, 2/3 in descending order. 253, 16/13, 2/3, 3/5 Sort 8, -3, 186, 82, -5, 3. -5, -3, 3, 8, 82, 186 Sort 77, -4, -2, 1, -3, 5025 in descending order. 5025, 77, 1, -2, -3, -4 Sort 6, -356, 0.603, -0.5 in decreasing order. 6, 0.603, -0.5, -356 Sort 20, -156, 1, -4, 3 in descending order. 20, 3, 1, -4, -156 Sort 10, 1, 5, -72, -288 in descending order. 10, 5, 1, -72, -288 Sort -1, 0, -2, 35, -3, -6, -7. -7, -6, -3, -2, -1, 0, 35 Put -93, 0, 132603 in decreasing order. 132603, 0, -93 Sort -9347, -0.01, -4, 1/7, 4 in decreasing order. 4, 1/7, -0.01, -4, -9347 Put -31, -18, 13, 5, -2 in decreasing order. 13, 5, -2, -18, -31 Sort -5, 2, -67, -522, -2 in decreasing order. 2, -2, -5, -67, -522 Put 20, -0.1, -6936843 in descending order. 20, -0.1, -6936843 Put -7, 4, 1, 3, 2, 959, 15 in descending order. 959, 15, 4, 3, 2, 1, -7 Put 4, -14231, -2, 16, 9 in ascending order. -14231, -2, 4, 9, 16 Put 3, 18, -16, 6, -1, 14, -43 in increasing order. -43, -16, -1, 3, 6, 14, 18 Sort 16, -3, -1, -12, -443, 3, -6 in decreasing order. 16, 3, -1, -3, -6, -12, -443 Sort 1.691, 49, 11 in ascending order. 1.691, 11, 49 Sort 2/899, -2, 2, 8/17. -2, 2/899, 8/17, 2 Sort 0.1, -109, -864.9 in descending order. 0.1, -109, -864.9 Sort 2/7, 338, -0.5, 5, 3497, -0.01 in ascending order. -0.5, -0.01, 2/7, 5, 338, 3497 Put 46964, 2/89, -1/6, 4 in descending order. 46964, 4, 2/89, -1/6 Put -1/2, -1/3, 4, 4/5, 40143/2 in descending order. 40143/2, 4, 4/5, -1/3, -1/2 Put 11, 1, -6, 108, 0, 4, -4 in descending order. 108, 11, 4, 1, 0, -4, -6 Put -14063, 3.9, -4 in increasing order. -14063, -4, 3.9 Put -2, 10, 2, 1, -481, 66 in decreasing order. 66, 10, 2, 1, -2, -481 Put 3/2, 6575, -2/4591 in decreasing order. 6575, 3/2, -2/4591 Put 166, 172, -261, -2 in decreasing order. 172, 166, -2, -261 Sort 3/2, -0.9, -3/7, -8, -36/73 in decreasing order. 3/2, -3/7, -36/73, -0.9, -8 Sort 2/723, -2/11, -101.34 in increasing order. -101.34, -2/11, 2/723 Put -173, -3, 57, -11, 0 in ascending order. -173, -11, -3, 0, 57 Sort -0.0822, -4/3, 2/3, 985, 0.2 in descending order. 985, 2/3, 0.2, -0.0822, -4/3 Sort 2/5, -102, 5, 12/5. -102, 2/5, 12/5, 5 Sort 9.38, -3/7, 22, 8, -2, 0 in decreasing order. 22, 9.38, 8, 0, -3/7, -2 Sort 1/2, -33/34, 13, -3 in ascending order. -3, -33/34, 1/2, 13 Sort -21423, -1.59, 5, 0.2 in descending order. 5, 0.2, -1.59, -21423 Put -0.0168, -3, 0.1, -0.8, -9 in decreasing order. 0.1, -0.0168, -0.8, -3, -9 Sort 4, -86, -11, -2, -4, 80 in decreasing order. 80, 4, -2, -4, -11, -86 Sort -8, 2/139, 2, -1837 in decreasing order. 2, 2/139, -8, -1837 Sort -6, 0, 161, 3, -11, -17, 6. -17, -11, -6, 0, 3, 6, 161 Put -5/4134, -4.5, 23, 3 in ascending order. -4.5, -5/4134, 3, 23 Sort 2/7, -1, -5889707. -5889707, -1, 2/7 Sort 0, -40374, 17, 3 in increasing order. -40374, 0, 3, 17 Put 19, -6, 4914 in decreasing order. 4914, 19, -6 Put 5, 143584, -4, 0 in descending order. 143584, 5, 0, -4 Put 39, 616, -422 in increasing order. -422, 39, 616 Put 0.4, 7, -0.1244, -67 in decreasing order. 7, 0.4, -0.1244, -67 Sort -1, 28850, 97 in ascending order. -1, 97, 28850 Put -46495, 154, -1, 5, 3 in decreasing order. 154, 5, 3, -1, -46495 Sort -429, 0.14, -90, 5 in decreasing order. 5, 0.14, -90, -429 Put 39, 0.3, 7, 0.07214, -2 in increasing order. -2, 0.07214, 0.3, 7, 39 Put 2, -4, 24, -5633214 in ascending order. -5633214, -4, 2, 24 Sort 0.07158, -2/21, 1, -0.03 in descending order. 1, 0.07158, -0.03, -2/21 Sort 11, -2, 34079, -1. -2, -1, 11, 34079 Put -2, 1, 2954, 0.5, -1, 3/7 in ascending order. -2, -1, 3/7, 0.5, 1, 2954 Sort 70, 75, 5, 2, -4, 4 in descending order. 75, 70, 5, 4, 2, -4 Put -2, -11, 7, -139, 5, 3, 0 in increasing order. -139, -11, -2, 0, 3, 5, 7 Sort -1, 8, 12594, -5. -5, -1, 8, 12594 Put 2, -453.1, -5, -69 in ascending order. -453.1, -69, -5, 2 Put 3, 15479, 118, -4 in descending order. 15479, 118, 3, -4 Sort -8, 8494, 0, 3 in decreasing order. 8494, 3, 0, -8 Sort 240102, -6, -2, 3 in ascending order. -6, -2, 3, 240102 Sort -992, 3, -143, 5, -4, 17 in ascending order. -992, -143, -4, 3, 5, 17 Put -242, 7, -4558, 4, -1, -2, 2 in descending order. 7, 4, 2, -1, -2, -242, -4558 Sort -5, -1, -4, -2, 22, 3, -11731 in decreasing order. 22, 3, -1, -2, -4, -5, -11731 Sort -2, 1/10, -300, -8, 0, -0.16 in decreasing order. 1/10, 0, -0.16, -2, -8, -300 Put -1, 5932, 3, -29 in decreasing order. 5932, 3, -1, -29 Sort -416/5, 2, -5, 0.17, 10, 4, 1 in descending order. 10, 4, 2, 1, 0.17, -5, -416/5 Put 912, 16, 11340 in increasing order. 16, 912, 11340 Sort 1, 40, 5, -3142, 2, 0, -3. -3142, -3, 0, 1, 2, 5, 40 Put -1/6, 2/7, -2.17, 200, 514, -4 in decreasing order. 514, 200, 2/7, -1/6, -2.17, -4 Put 2, -2, 0, 3, -40323, 1 in decreasing order. 3, 2, 1, 0, -2, -40323 Sort 66, 5, -3, 24, -36 in increasing order. -36, -3, 5, 24, 66 Put -89, 1516, 1 in decreasing order. 1516, 1, -89 Sort -19, 54, 808, -7 in increasing order. -19, -7, 54, 808 Put -44, 4327, -0.19 in decreasing order. 4327, -0.19, -44 Put 234, 1/3, 1/6, 8.2035 in descending order. 234, 8.2035, 1/3, 1/6 Sort 0.0407, 15, -21, 0, -2. -21, -2, 0, 0.0407, 15 Sort 0, 5, 39, -58259, 4, -13. -58259, -13, 0, 4, 5, 39 Put 3, 0.2, 2, -398.3, 5/7, -5 in increasing order. -398.3, -5, 0.2, 5/7, 2, 3 Sort 1135, -1, -5, -195. -195, -5, -1, 1135 Put -23, 1, 2, -8, 270 in descending order. 270, 2, 1, -8, -23 Put -2, 7, 1/3, 12, -1/8096, -1/9 in decreasing order. 12, 7, 1/3, -1/8096, -1/9, -2 Sort 45/38, -3/23, -0.0309. -3/23, -0.0309, 45/38 Put 7/4, 42505, -2/3, 5 in increasing order. -2/3, 7/4, 5, 42505 Sort 25932, -5, -1668 in ascending order. -1668, -5, 25932 Put -2, 14, 666, -59/98 in ascending order. -2, -59/98, 14, 666 Sort 1/2, 2, -9, 11.57, 2/13, 0, 4 in decreasing order. 11.57, 4, 2, 1/2, 2/13, 0, -9 Sort 11, 26, 1, 925, 4 in decreasing order. 925, 26, 11, 4, 1 Put -9, 0.4, 0.01, 220.71, 1 in decreasing order. 220.71, 1, 0.4, 0.01, -9 Sort 83/31, -25/2, 1, 0.2 in descending order. 83/31, 1, 0.2, -25/2 Put 4, 1, 5, -4, -3, -1, 402092 in ascending order. -4, -3, -1, 1, 4, 5, 402092 Sort 2, 11698888, 3. 2, 3, 11698888 Put 218087, -5, 6, -2 in ascending order. -5, -2, 6, 218087 Put 5/4, -1773, -0.09 in decreasing order. 5/4, -0.09, -1773 Put 1, -0.16, 1.421, -3/10 in ascending order. -3/10, -0.16, 1, 1.421 Sort -119, 5, -19288 in decreasing order. 5, -119, -19288 Put -561, -1, -805, -30 in ascending order. -805, -561, -30, -1 Put -4, 10, 4, 2, 8891, 5 in descending order. 8891, 10, 5, 4, 2, -4 Sort -1, 233, -5, -11, 22, 6, 0 in decreas	{ "pile_set_name": "DM Mathematics" }
244540 What is the next term in 25, 14, -21, -74, -139, -210, -281? -346 What comes next: -2358, -2402, -2518, -2742, -3110? -3658 What is the next term in 51, -41, -305, -831, -1709? -3029 What comes next: 170687, 170710, 170735, 170762, 170791? 170822 What is the next term in -87410, -349597, -786572, -1398329, -2184862, -3146165, -4282232, -5593057? -7078634 What is next in 29, 66, 137, 260, 453? 734 What is the next term in -81872, -81870, -81868, -81866, -81864? -81862 What is the next term in -4857713, -4857714, -4857715, -4857716? -4857717 What comes next: 209, 193, 139, 35, -131? -371 What is the next term in 571920, 571925, 571934, 571947? 571964 What comes next: 2177, 2959, 3741, 4523, 5305? 6087 What is next in -2091, -1902, -1585, -1140, -567, 134? 963 What comes next: -17399, -17410, -17431, -17468, -17527, -17614? -17735 What is next in -438, -765, -1078, -1371, -1638, -1873? -2070 What comes next: 110807, 110802, 110797, 110792, 110787? 110782 What is next in 16902, 33810, 50718, 67626, 84534, 101442? 118350 What comes next: -2842, -2802, -2762, -2722? -2682 What is the next term in -1524, -1831, -2156, -2505, -2884? -3299 What comes next: -97751, -97752, -97753, -97754, -97755? -97756 What is the next term in 2744, 2752, 2766, 2786, 2812, 2844, 2882? 2926 What is next in -13612, -13775, -13938, -14101? -14264 What is next in 5358, 10726, 16094, 21462? 26830 What is next in -309731, -619464, -929197, -1238930, -1548663? -1858396 What is next in 77, 258, 551, 956, 1473? 2102 What comes next: 4939, 4872, 4805, 4738, 4671? 4604 What is next in -47, -176, -423, -830, -1439, -2292, -3431? -4898 What is the next term in 518, 464, 410, 356, 302, 248? 194 What comes next: -22, -103, -246, -481, -838? -1347 What is next in -46813, -187246, -421301, -748978, -1170277, -1685198, -2293741? -2995906 What is the next term in 94, 355, 842, 1597, 2662, 4079? 5890 What comes next: 17125, 34266, 51433, 68638, 85893, 103210, 120601? 138078 What is next in -49722, -99423, -149106, -198771, -248418, -298047? -347658 What is next in -568, -4500, -15146, -35854, -69972, -120848, -191830? -286266 What comes next: 13515, 13495, 13475? 13455 What is next in -20, -159, -546, -1307, -2568? -4455 What is next in 59, 133, 225, 335, 463? 609 What is the next term in -77, -412, -1189, -2588, -4789, -7972? -12317 What comes next: -961, -1875, -2789, -3703? -4617 What comes next: 62, 285, 676, 1253, 2034, 3037, 4280, 5781? 7558 What is next in 4785, 9615, 14443, 19269, 24093, 28915? 33735 What is the next term in 4461, 4471, 4489, 4515? 4549 What is next in 97395, 194788, 292179, 389568, 486955? 584340 What comes next: -9283, -18530, -27755, -36952, -46115? -55238 What comes next: 93, 426, 975, 1734, 2697, 3858, 5211? 6750 What comes next: -84, -122, -160? -198 What is the next term in 6784, 6490, 6198, 5908, 5620, 5334, 5050? 4768 What is the next term in -316, -293, -256, -211, -164, -121, -88? -71 What comes next: 499, 1019, 1545, 2077? 2615 What is the next term in -1918, -3841, -5764? -7687 What comes next: 20003, 40008, 60013? 80018 What comes next: 5961, 11919, 17877, 23835? 29793 What comes next: -667, -1436, -2295, -3244, -4283, -5412, -6631? -7940 What comes next: 97053, 194106, 291159, 388212, 485265? 582318 What comes next: 15724, 15952, 16180, 16408, 16636? 16864 What comes next: 178, 332, 506, 706, 938, 1208? 1522 What is next in 15587, 62352, 140299, 249434, 389763? 561292 What is the next term in 23, 71, 189, 407, 755, 1263, 1961, 2879? 4047 What is next in 246, 478, 718, 966, 1222, 1486, 1758? 2038 What is next in -2186, -4368, -6540, -8696, -10830? -12936 What is next in 1200, 2385, 3572, 4761, 5952, 7145, 8340? 9537 What is the next term in 3356, 3272, 3054, 2636, 1952, 936, -478, -2356? -4764 What comes next: -19432, -19341, -19190, -18979, -18708, -18377, -17986? -17535 What comes next: 4649, 18606, 41865, 74426, 116289? 167454 What comes next: 10326, 20664, 31002, 41340? 51678 What comes next: -307, -1254, -3823, -8824, -17067? -29362 What comes next: -15955, -31923, -47891? -63859 What comes next: -1480, -1449, -1408, -1363, -1320, -1285, -1264? -1263 What is the next term in -1550354, -1550353, -1550352, -1550351? -1550350 What is next in -42120, -42125, -42132, -42141? -42152 What is the next term in -706696, -706689, -706682, -706675? -706668 What is next in 43618, 174490, 392608, 697972, 1090582, 1570438? 2137540 What is next in 80, 185, 346, 563, 836, 1165? 1550 What is the next term in -2823, -4886, -6949, -9012, -11075, -13138? -15201 What is next in -5154, -5167, -5194, -5241, -5314? -5419 What comes next: -433, -797, -1161? -1525 What is next in 20881, 41760, 62639, 83518, 104397, 125276? 146155 What comes next: 54, -78, -260, -474, -702? -926 What comes next: 247, 703, 1927, 4297, 8191, 13987? 22063 What is the next term in 2320, 4639, 6958, 9277, 11596, 13915? 16234 What is the next term in -25663, -51299, -76935, -102571, -128207? -153843 What comes next: 221, 248, 275, 302, 329? 356 What is the next term in -147237, -147242, -147245, -147246, -147245? -147242 What is next in -220, -1050, -2494, -4552, -7224, -10510, -14410? -18924 What is the next term in -1662139, -1662140, -1662141, -1662142? -1662143 What is the next term in -2415, -9540, -21393, -37968, -59259? -85260 What is the next term in 4293, 4297, 4315, 4353, 4417, 4513? 4647 What comes next: 131, 46, -217, -754, -1661, -3034, -4969? -7562 What is next in -1320, -2896, -4718, -6786, -9100? -11660 What comes next: 3005, 3006, 3007, 3008, 3009, 3010? 3011 What is the next term in 63675, 127339, 190999, 254655, 318307, 381955, 445599? 509239 What is next in 440, 805, 1198, 1631, 2116, 2665, 3290, 4003? 4816 What comes next: 7943, 16176, 24409, 32642, 40875, 49108? 57341 What is next in -31, -45, -29, 17, 93? 199 What is the next term in 1766, 1859, 1952, 2045, 2138? 2231 What is the next term in 10, -79, -332, -833, -1666? -2915 What is the next term in 68280, 136556, 204832, 273108? 341384 What comes next: -1384479, -2768957, -4153435, -5537913, -6922391? -8306869 What comes next: 1790, 2561, 4662, 8759, 15518, 25605, 39686? 58427 What is next in 148, 127, 70, -41, -224, -497, -878? -1385 What comes next: 3708273, 3708274, 3708275, 3708276? 3708277 What is the next term in -2, -57, -148, -275, -438, -637? -872 What is the next term in -214577, -214566, -214555, -214544? -214533 What is next in 1016458, 1016472, 1016496, 1016536, 1016598, 1016688, 1016812? 1016976 What is next in 3488, 3473, 3458, 3443? 3428 What comes next: -491, -151, 419, 1219, 2249, 3509, 4999? 6719 What comes next: -142434, -284886, -427338, -569790, -712242, -854694? -997146 What is next in 1564179, 1564181, 1564183, 1564185, 1564187? 1564189 What is next in 1872, 7514, 16924, 30102, 47048, 67762? 92244 What is the next term in 234, 381, 446, 429, 330, 149? -114 What comes next: -3167, -6365, -9563, -12761, -15959, -19157? -22355 What is next in 61949, 61973, 61997? 62021 What is next in 411, 1633, 3655, 6471, 10075, 14461, 19623, 25555? 32251 What is the next term in -114, -339, -676, -1125, -1686, -2359? -3144 What comes next: -444517, -889033, -1333545, -1778053, -2222557? -2667057 What is next in 2, -56, -122, -202, -302? -428 What comes next: -4762, -19017, -42772, -76027, -118782, -171037, -232792? -304047 What comes next: -504, -833, -1160, -1485, -1808, -2129, -2448? -2765 What is the next term in 22408, 44824, 67244, 89668, 112096? 134528 What is next in 8244, 16486, 24718, 32934, 41128, 49294, 57426, 65518? 73564 What is the next term in 522, 343, 44, -375, -914, -1573, -2352? -3251 What is next in -6, -123, -350, -717, -1254, -1991? -2958 What is next in -707, -1536, -2909, -4820, -7263, -10232, -13721? -17724 What is the next term in -2321335, -2321337, -2321339? -2321341 What is next in 21527, 43052, 64585, 86132, 107699? 129292 What is next in 2652, 2648, 2644, 2640, 2636, 2632? 2628 What is the next term in 2528, 2661, 2794, 2927, 3060? 3193 What is the next term in 240, 535, 830, 1125? 1420 What comes next: -166999, -166998, -166997, -166996? -166995 What is the next term in 201, 629, 1305, 2235, 3425, 4881? 6609 What is next in -18939, -18961, -19019, -19131, -19315? -19589	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.