Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
- 2. Give p(u). 4 Let z(h) be the first derivative of -h*2 - 13h - 5. Calculate z(-9). 5 Let q(k) be the first derivative of -k*3/3 + 3k*2 - k - 4. Calculate q(5). 4 Suppose -1 = 3c - 7. Let b(h) = h*3 - 2h*2 + 3h - 2. Calculate b(c). 4 Let y(i) = i*2 - 5i + 6. Suppose 5f = 10, f - 20 = -2l - 3f. Let q = 8 - l. Suppose 2t + qd + 0d = 6, -5t = -3d - 31. Give y(t). 6 Let w(c) be the first derivative of 3/2c2 + 2c*3 + c + 1/4c*4 - 3. Calculate w(-5). 11 Suppose -2a - 23 = -4d + 3a, -d = -2a - 8. Let i(t) be the first derivative of -t3/3 + t2/2 - t + 3. Give i(d). -3 Let z(y) = 1 - 3y3 + y3 - y - 2y + 5y. What is z(-1)? 1 Suppose 17u = 13u - 4. Let j(x) = x - 1. What is j(u)? -2 Let v(k) = -4 - 2 + 3 - k - 6. What is v(-4)? -5 Let y = -13 + 18. Suppose 0 = yf - 10, 2d - 5f + 14 = 0. Let g(n) be the first derivative of -n2/2 - 5. What is g(d)? 2 Let h(j) be the third derivative of 1/6j*3 + 0 + 1/3j*4 + 0j + 3j2. Determine h(1). 9 Let g(y) = -y3 - 7y*2 - 3y - 3. Let v be g(-7). Suppose x + 2x + v = 0. Let b(l) = l. Determine b(x). -6 Let q(x) be the second derivative of -x3/6 - x2/2 - x. Let j = 0 + -2. Determine q(j). 1 Let o(k) = k. Let h(n) = 6n + 1. Let s(v) = v*3 + 12v*2 + 10v - 10. Let j be s(-11). Let c(m) = jo(m) - h(m). Determine c(2). -11 Let g be 5/((-75)/(-6))5. Suppose 3d = a + 9, ga + 2a = -3d - 21. Let l(j) = j*3 + 6j*2 - j - 5. Determine l(a). 1 Let d be (-1)/(-3 - (-16)/6). Suppose -n = -d, 0k = -3k - 2n + 21. Let q(a) = a*2 - 5a + 4. What is q(k)? 4 Let k(i) = i. Let w(f) = f*2 + 6f + 4. Let v be w(-5). Calculate k(v). -1 Let g = 51 - 36. Let x(q) = -5 + gq2 + q3 - 11q*2 + 3. What is x(-2)? 6 Let u = -76 + 81. Let f(c) = -c + 10. Calculate f(u). 5 Suppose -2r = v - 4r + 6, 2v = -2r + 12. Let a(j) = -vj - 8 - j + 4j + 6. Give a(0). -2 Let d(x) = x2 + 9. Let v be d(0). Let o = v + -13. Let w(a) = -4a - 6. Calculate w(o). 10 Let j(v) = -4v - 1. Suppose -1 = -2i - 5. Let s be (-12)/(-8) - (-1)/i. Give j(s). -5 Let q(k) = 2k3 + 2k*2 - k + 1. Let f(j) = -j - 3. Let n be f(-6). Suppose 0 = 5g - nv - 30, 10 = g - v + 2. Suppose gd + 0d = -6. Determine q(d). -5 Let p(c) = c2 - 2c - 2. Let u be 2 - -29/(-3). Calculate p(u). 22 Let x(c) be the third derivative of c5/60 - 7c*4/24 - 11c*3/6 - 2c*2. Determine x(8). -3 Suppose 0g - 5g = -25. Let o(p) = p2 - 6p + 7. Give o(g). 2 Let s(a) = -a*2 + 3a + a + 3a + 4. Calculate s(6). 10 Let q(b) = 0b - 3b - 5b2 - 4 + b3 + 8b. Suppose 2k - 13 + 5 = 0. Suppose kl - 15 = -l. Give q(l). -7 Let g(l) = l2 + l. Let p(k) = 7k*2 + 7k - 8. Let s(a) = 6g(a) - p(a). Suppose 6 = 3r + y + 3, 4y = 4r + 12. Give s(r). 8 Let t(x) = 2x - 2. Let o be t(3). Suppose o = -j + 2j. Let h(b) = 2 - b*3 + 2b*2 + jb - 5 - 3b2. Give h(2). -7 Let p(n) = 4n*3 + 2n*2 - 7n - 9. Let l = 0 - -2. Let c(z) = 0z2 - 4 - 5z + 2z + 2z3 + zl. Let t(g) = -7c(g) + 3p(g). Calculate t(-1). 2 Suppose -2j + 5t = -4j - 13, 7 = j - 2t. Let v(i) = -i - 1. Let z(p) = -6p - 9. Let r(g) = jz(g) - 5v(g). Give r(3). -7 Let o(b) be the second derivative of 2b + 0 - 1/6b4 - 1/2b3 - b2. Calculate o(-3). -11 Let q(y) = -y*2 + 10y - 5. Let m(k) = -k*2 + 9k - 5. Let n(g) = -4m(g) + 3q(g). Determine n(5). 0 Let j(q) be the first derivative of -q3/3 + q2/2 - 3. Let w(v) = 9v2 - 2v - 1. Let r be (1 + 0)1 - -1. Let h(s) = rj(s) + w(s). Give h(-1). 6 Suppose 0 = 4l - 5a - 21, 3a = 4l - a - 20. Let m(j) be the second derivative of -j5/20 + j4/4 + j*3/6 + 2j*2 - 2j. What is m(l)? -8 Suppose 10 = -5n + 4b, 5b + 32 = -4n - 17. Let u be -6(21/n + 3). Let g = -3 + u. Let l(j) = -j - 3. Determine l(g). -3 Let r(x) = x2 - 2x + 7. Let b(k) = 5k2 - 8k + 28. Let i(h) = 2b(h) - 9r(h). Give i(-5). 8 Suppose -n = 4, 0r + 32 = -5r + 2n. Let s(y) = y2 + 9y + 4. What is s(r)? -4 Let u(v) = 2v - 10. Let r be u(7). Suppose rk - k = 0. Let c(b) = 0b + 2 + 2 + 2b - 3b. Calculate c(k). 4 Suppose 0 = -5j - 17j - 22. Let c(d) = d2 - 3d - 2. Calculate c(j). 2 Let a(w) = w*3 + 6w*2 + 2w. Suppose -z + 3r - 18 = 0, -2z + 6r - 2r = 28. Give a(z). -12 Let g(s) be the first derivative of s3/3 + s2/2 - 4s - 4. Let u(o) be the first derivative of g(o). Give u(3). 7 Let l(o) = -3 + o - o - o2 - o. Let i be l(0). Let u(s) = -3 - 3s*2 + 157s - s*3 - 1 - 156s. Calculate u(i). -7 Let p(v) be the second derivative of -v*3/6 + 4v*2 - 8v. What is p(0)? 8 Let p(t) = -t - 1. Let g(s) = -s*2 + 4s + 1. Let q be g(3). Calculate p(q). -5 Let j = 130 - 93. Suppose j = -5a + 3s, 5s - 22 = -2. Let y(o) = -2o*2 - 5o + o*2 + 3 + 0o. What is y(a)? 3 Suppose 2z + 9 = -4g + 7z, 11 = -g + 3z. Let k(v) = v - g + 3v + v2 - 3v. What is k(-3)? 2 Let q = -29 + 27. Let k(c) = -c - 2. Calculate k(q). 0 Suppose 8 = b + b. Let o(v) = 14v - 7v - 3v - 5v. What is o(b)? -4 Let x(c) = -2c2 - 2c + 2. Let w be 0 - -1 - (-4 - -7). Determine x(w). -2 Let q(h) = -3h - 3. Let g be (-180)/85 - -2 - (-166)/(-34). What is q(g)? 12 Suppose -5q = 5u, 4q - 3 = -5u - 1. Let y(z) = -4z + u + 5z - 2. Suppose 2t = 5v - 15, t + 2v - 21 = -6. Give y(t). 5 Let x(v) = v + 6. Suppose -12 = 5s - 4s. Let n be 1/(((-6)/(-3))/14). Let t = n + s. Give x(t). 1 Let u = -3 - -6. Let z(j) be the first derivative of j*3/3 - 5j2/2 - 41. Calculate z(u). -6 Let j(b) be the second derivative of b3 + b*2 - 7b. Calculate j(-2). -10 Suppose -8 = -7d - 22. Let w(q) = 12q. Determine w(d). -24 Suppose o + 4m = -20, 0o = 2o - 2m. Let z = -2 + 5. Let n(w) = -3 + w*3 - 1 - 2w*z - 4w2. Give n(o). -4 Let m(h) = -h2 - 154h + 3 + 154h. Give m(-3). -6 Suppose 6f = 3f + 6. Let a(r) be the third derivative of 0 + 1/24r4 - rf + 0r - 2/3r3. Calculate a(-4). -8 Let k(r) = 2r*2 - 2r - 1. Let b be k(-1). Let j be (3/9)/(b/18). Let a(h) = 4h - 2 + 2h*3 - 5h - 4h2 + 2h*2. Calculate a(j). 4 Let k be 4 - (-3 - 2-1). Let m = k + -3. Let i(x) = 0 - mx2 + 2 + 0x + 0x. What is i(2)? -6 Suppose 3n + 2 = n. Let d = -2 - n. Let f(g) = 3g2 + 4g*3 + g - g - 1 - 2g2. Determine f(d). -4 Let h(n) be the third derivative of -n5/10 + n*4/24 - 3n*2. What is h(1)? -5 Let u(l) = -5l - 4. Let g(f) = -3 + f + 2 + 2. Let v(i) = -4g(i) - u(i). Suppose 2j - 8 = 2z, -j + 5 - 1 = 0. Give v(z). 0 Suppose g + 4g + 41 = -4x, -45 = 5g + 5x. Let f(u) = -u3 + 5 + 14u - 15u - 2u - 6u2. Calculate f(g). -5 Let u = -25 - -27. Suppose -5k = -2f + 10, -uf = 3f - 25. Let j(z) = -3z + 3. Let y(m) = m - 2. Let s(i) = 2j(i) + 5y(i). What is s(k)? -4 Let g(d) = 5d + 7. Let o(x) = -4x - 5. Let c(t) = 2g(t) + 3o(t). Let v = -5 + 3. Let u be 1 + v - (-2)/(-2). Calculate c(u). 3 Let z(d) = 3d3 + 2d*2 - 1. Let x be (-3 + 0 + 2)1. Calculate z(x). -2 Let u(d) = -d*2 - 3d - 4. Suppose 4b + b + 15 = 0. Let w = b - 0. What is u(w)? -4 Suppose 3d = 16 - 1. Let q be ((-2)/d)/((-1)/5). Suppose ql - 14 = -4. Let t(o) = -o2 + 6o - 3. What is t(l)? 2 Let f(l) = -l*3 + 21l*2 + l - 22. Let g be f(21). Let h(n) = 7n*3. What is h(g)? -7 Let c be 54/15 + (-2)/(-5). Suppose -12 = 6i - ci. Let m(y) = -y - 12. Determine m(i). -6 Let h(s) be the first derivative of -4s*2 + 2s - 11. Determine h(2). -14 Let j(q) = -q - 1. Let f(a) = 3. Let s(i) = -f(i) - j(i). Suppose -4x - 2 = 2, h + 6 = -x. Determine s(h). -7 Let o be 5 - 5 - (6 + (-6)/2). Let j(c) = -3c - 11. Let k(p) = -p - 6. Let d(l) = 3j(l) - 5k(l). Determine d(o). 9 Let c(v) = -v*3 + 3v*2 + 2v + 5. Suppose -4i = -2g + 54, -2i = -i - 2g + 12. Let a be (-2)/(-7) - 52/i. Determine c(a). -3 Let z(s) be the second derivative of s5/20 - s4/4 - 5s3/6 + s2/2 + 13s. Give z(4). -3 Suppose 3f = 2f + 5w + 27, -w = 4f - 3. Let n be -1(f + (1 - 1)). Let x(v) be the third derivative of -v6/120 - v5/30 - v3/3 - v2. Give x(n). -2 Let n be 13/4(-11 + 15). Let v(u) = u - 16. Determine v(n). -3 Let y(c) = c*3 - 4c - 3 - 2c3 - 5c*2 - 1. Suppose -l + 3s = -18, l + 0l + 3s = -12. Suppose 0 = -2v + lv + 4. Calculate y(v). -4 Let w(c) be the second	{ "pile_set_name": "DM Mathematics" }
+ y + 27, 328y - 332y = -3v + 23 for v. 5 Solve -3s + 0 = n + 12, -4n = -7s - 9 for n. -3 Solve 17 = -k + 2d, 0 = -569k + 566k - 4d - 1 for k. -7 Solve 4d + 404f = 406f - 2, -5f + 45 = 0 for d. 4 Solve -b = -l - 4, -5b + 23l = 24l - 38 for b. 7 Solve 0 = 3x + 4c + 153 - 130, 4x + 3c = -33 for x. -9 Solve -4 = 2w + 68u - 83u, 5w + 10 = -5u for w. -2 Solve 16646w - 16644w = -5l - 4, 7w + 14 = l for w. -2 Solve 2o - 10y = -11y - 20, 4y = -40 for o. -5 Solve -2b - 2 - 1 = q, 12q = -12 for b. -1 Solve -13y + 3x + 27 = -20y + y, 0 = -3x - 3 for y. -4 Solve 4t = 12k - 7k - 18, -18 = -k + 8t for k. 2 Solve 4r + 3b - 24 = 0, 5r + 1 - 17 = 231223b - 231225b for r. 0 Solve 5a - 28 = 4y - 81, 4y - 4a - 44 = 0 for y. 2 Solve 5v = 4r - 18 - 2, 0 = r + 5v + 45 for r. -5 Solve -44 = -4w + 4z, 35z - 43 = -5w + 34z for w. 9 Solve 0 = 2m + 3w + 4, -m + 2w = 1078 - 1076 for m. -2 Solve -5a = 36y - 39y - 37, 5y - 4a + 40 = 0 for y. -4 Solve 2u + 3m = 12, -5 = 2m - 9 for u. 3 Solve -2o + 6 = 258m - 254m, -41 = 3m - 44o for m. 1 Solve -m = -2, 19w - 4m = 20w - 12 for w. 4 Solve 8z + 1274 = r + 1254, 0 = 2r + 3z + 17 for r. -4 Solve -216m = 5b - 214m - 5, -2m = b - 1 for b. 1 Solve -5t - 25 = -2h, -7t - 2h + 7 = -6t for t. -3 Solve 163w - 3u + 17 = 159w, -2w = 2u - 2 for w. -2 Solve -3k = -4y + 15, -5y + 3k - 13 = -31 for y. 3 Solve -110l - 4n + 8 = -108l, 3l = 3n - 15 for l. -2 Solve z = -2l - 3, 0 = -2z - 3960l + 3959l - 3 for z. -1 Solve -3g - 4c + 37 = 0, -809g - 5c = -814g + 15 for g. 7 Solve 2i = -48, 0 = 3f - 6f + i + 24 for f. 0 Solve -h - 25 + 1 = 2v, -4h - 24 = 2v for v. -12 Solve -5n - s = -10, -4n + 0 = 5s - 50 for n. 0 Solve -s - 1 = j, -38 = 2j + 45s - 55s for j. -4 Solve -111p - 5d = -116p - 55, -2d - 50 = 10p for p. -6 Solve 0 = -5z - 5q - 10, 27q + 7 = 4z + 28q for z. 3 Solve 139v - 141v + 2x = 6, 6x - 24 = 4v for v. 3 Solve -135u + 30 = -132u, 3u = -4d + 18 for d. -3 Solve 30 = 5h - 11k + 13k, 0 = -4k - 20 for h. 8 Solve 146t + 3m = 143t, 0 = -2t - 4m - 4 for t. 2 Solve -k + 4u - 21 = 0, 5k + 25u - 20u - 20 = 0 for k. -1 Solve 0 = -5b - 2a + 5, -44b + 10 = -34b + 3a for b. 1 Solve 5h = 2w - 20, -4 = h + 44w - 43w for h. -4 Solve 13s - 3n + 3 = 18s, 0 = 5s - n - 19 for s. 3 Solve 3f - 10j + 6j - 31 = 0, -3f - 2j + 7 = 0 for f. 5 Solve 0 = -3k, 0l + 7k - 2 = l - 0l - 0l for l. -2 Solve 3u + 220o - 205o - 87 = 0, -35 = 5u - 5o for u. -1 Solve 33 = 3z + 31h - 19h, 3h = z + 3 for z. 3 Solve 3n + 5k = 5, -233k = 5n - 230k - 19 for n. 5 Solve -34f = -71f + 36f - 4k + 33, -4k = -9f - 63 for f. -3 Solve 9 = -2h + 3z, -6659h + 6667h + 2z = -22 for h. -3 Solve v - 80 = -2s - 69, 5s = -3v + 35 for v. 15 Solve -3z - 2i - 1466 = -1470, 3z - 28 = 4i for z. 4 Solve 3h - 1 = 2f, f + 5h - 60 = -41 for f. 4 Solve 20d - 5n + 35 = 15d, -4n = 3d for d. -4 Solve 5f - 1 = -2a, -f - 21185a + 21180a + 60 = 0 for f. -5 Solve 2f = -5c + 35, f + c - 137 + 127 = 0 for f. 5 Solve 409t - 413t - 33 = -k, 0 = -4k + 3t + 67 for k. 13 Solve q = 4r + 12, q - 1362 = 3r - 1353 for r. -3 Solve -2v - 749 = 21f - 736, -12 = -4v - 4f for v. 4 Solve -4h = -22a - 180, 2a + 2 = -h - 13 for a. -8 Solve -s - 5d = -22, 4s + 104d - 97d = 23 for s. -3 Solve -3r + 12 = -d + 2d, 5d - 4r - 3 = 0 for d. 3 Solve -45 = s + 5f + 1, -3s - f - 12 = 0 for s. -1 Solve 5m - 4z - 34 = 0, 0 = 4m + 31z - 16z - 9 for m. 6 Solve 0 = -381b + 377b + 3w - 12, 4b = 2w - 16 for b. -6 Solve 2n - 1237b = -1236b - 4, 0 = -n - 2b + 8 for n. 0 Solve -4b - 33 = -o, 0 = 4o - 14b + 18b + 8 for o. 5 Solve 0 = h - 3u - 10, -h - 3u - 92 = -84 for h. 1 Solve 29 - 26 = -3m - 3w, -5w + 4 = 2m for m. -3 Solve w - 22 = -4a, -5w + 4w - 3 = -a for a. 5 Solve 3h = 21, -18n + 16n = -3h + 21 for n. 0 Solve 2u + 453m = 457m + 36, -3m - 32 = -4u for u. 2 Solve 34b = 33b - 5h - 10, 3b = 5h - 10 for b. -5 Solve 5z - 4a + 25 = 0, 3a + 47 = 62 for z. -1 Solve 3v = -4r - 44, -3r - 66 = 3v - 27 for r. -5 Solve -c = o + 3, -35o + 36o - 1 = 0 for c. -4 Solve -3l + 5y + 5 = 0, 2l - 12y = -6y - 2 for l. 5 Solve s - 3 = f, -184s + 2f + 6 = -185s for s. 0 Solve -74z - 2 = -75z, 4x + z + 22 = 0 for x. -6 Solve -6i + 4i = 5b - 19, b - 9 = -3i for b. 3 Solve -y + 3 = 6m + 23, -5m = 3y + 8 for y. 4 Solve 8 = 2b - 4i, 4b + 4i + 8 = -12 for b. -2 Solve -4i - 24 = 2l, -56 + 2 = 9i - 2l for i. -6 Solve 2w - 34 = -4o - 74, -4w + 30 = -2o for w. 2 Solve -5g + 3 = b, 0 = 4b + 4g - 954 + 942 for b. 3 Solve -3s = -3b - 12, 0 = 2s - 31b + 27b - 24 for s. -4 Solve 15k - 14k = 4v + 2, 5k + 2v + 12 = 0 for k. -2 Solve 3o - 106 = -3h - 49, -5o = 4h - 90 for h. 5 Solve 18m + 4c = 21m - 25, 5m - c = 2 for m. -1 Solve 7a + 4i - 5 = 0, -141a - 32 = -145a + 5i for a. 3 Solve -5x + 28 = -2u, 4921u - 4925u = -4x + 20 for x. 6 Solve 3a - 5t = -2, 0 = 11719a - 11715a + 4t - 8 for a. 1 Solve 2l = 2c - 32, l + 23 - 17 = -c for c. 5 Solve 2r = 2074p - 2070p - 82, 4r = p - 38 for r. -5 Solve 5q - 2d + 15 = 0, -71d + 68d = 3q + 30 for q. -5 Solve -12 = 619y - 615y, -5y = 5b + 5 for b. 2 Solve 0 = -2t - x + 7, -1151t = -1148t + 2x - 10 for t. 4 Solve 0 = -5x - 158d + 157d - 1, -4x - 2d - 2 = 0 for x. 0 Solve 41800q = -3m + 41799q - 15, -m - 2q - 5 = 0 for m. -5 Solve 13n - 17 = -3g, -4g + 34n = 37n + 6 for g. -3 Solve -939u = -5v - 938u + 2, 4u = -28 for v. -1 Solve s + 227 = -4u + 236, 0 = u - 4s + 2 for u. 2 Solve 2c = 2t - 28, -2t + 1839 = 2c + 1795 for c. 4 Solve -2z - 12 = 0, -3z - 1545 = 4o - 1531 for o. 1 Solve 4d - 4f = 24, d = -2954f + 2953f - 4 for d. 1 Solve -4x = 4k - 0k + 36, -2k - 15 = -x for k. -8 Solve -5z + 16 = -0z - 2l, -z + 8l = -64 for z. 0 Solve 2a - 6 = -2m, 4055a + 3m = 4057a + 4 for a. 1 Solve -q + 3 = -2n, -5n + 5q - 242 = -247 for n. -4 Solve 32d - 30d - 12 = 2f - 0f, -5d = 5f - 20 for d. 5 Solve -f + j = -13, 94f - 4j - 1857 = -545 for f. 14 Solve -4u + 4z = 8z + 4, -z = -16u - 84 for u. -5 Solve 0 = 2u - 73y + 75y - 26, 0 = 6u - u - 5y - 25 for u. 9 Solve -2i - k = -i, -k - 35 + 50 = -4k for i. 5 Solve 7o - 73 = 12o + 4d, -5d - 60 = -0d for o. -5 Solve 4b + 130 - 142 = t, 0 = 2t - b + 3 for t. 0 Solve d - 3k - 10 + 19 = 0, -2k + 4 = 0 for d. -3 Solve 0 = f - 6 + 2, 8w = 23f - 24f - 20 for w. -3 Solve 2b + 660p - 9 = 665p, -15 = 4b + p for b. -3 Solve 2b + 48 = -4g, 1664b + 48 = -4g + 1667b for g. -12 Solve 5n = -13s + 20, -n + 8s = 7s - 4 for n. 4 Solve 54m = 57m + 4r - 9, -3r = 0 for m. 3 Solve 20 = 4g, -4w - 113g + 114g - 29 = 0 for w. -6 Solve 5m = -5g, -5m + 335g - 2 = 338g for m. -1 Solve -6b - 5 = -2b - 21, 7b = 4o + 56 for o. -7 Solve 21 = 3h + 4w, -154w = 11h - 156w - 27 for h. 3 Solve 2z - 8 = 4f, 2 = -f + 88z - 59z for f. -2 Solve 17v = f + 18v - 5, 3f + 2v - 14 = 0 for f. 4 Solve -b - 3j - 2 = 0, -43b + 105b + 14 = 60b - j for b. -8 Solve 2j + 48 = -4a, -4j - 828a - 60 = -823a for j. 0 Solve -8y + 5z + 25 = -7y, 4y - 2z + 8 = 0 for y. -5 Solve -3t = -3w + 30, -6151w + 6156w - 30 = t for t. -5 Solve -4o = -33c - 161, 0 = -5c + c - 4o - 24 for c. -5 Solve -2d - l = 6, 0 = 5d - 11191l + 11193l + 13 for d. -1 Solve 0 = -1138b + 1135b - 9, b - 17 = -5i for i. 4 Solve 3t - 5p - 11 = 0, 2t - 4p + 55 = 65 for t. -3 Solve 9 = -2f - 3w + 6, 2f = 4w - 10 for f. -3 Solve 5u + 6 = -7y, -4u - 1550y = -1555y + 26 for u. -4 Solve -9l + 10 = -4l, 15i - 3 = 16i + l for i. -5 Solve -414m - 19 = -4x - 419m, -x = -5m - 11 for x. 6 Solve -5p + 18 = 3h, -2396p = -2393p - 9 for h. 1 Solve 5k - 2p + 15 = 0, -38k + 40 = -42k - 4p for k. -5 Solve 14v = 5j - 39, 11708j = 11710j + 3v - 7 for j. 5 Solve c - n = 4, -38n + 46n = -2c - 22 for c. 1 Solve 5a - 2264 = -4y - 2271, 4y - 4a = -16 for y. -3 Solve -4u = f - 5, 46u = 43u + 5f - 25 for u. 0 Solve 5j = -2d - 9, 34d - 24 = 31d + 5*j for d. 3 Solv	{ "pile_set_name": "DM Mathematics" }
termine d(83). -39 Let k(i) = -i*3 - 125i*2 + 1043i + 173. Determine k(8). 5 Let u(k) = -k*3 + 20k*2 - 131k + 294. What is u(5)? 14 Let o(a) = 21a2 + 249a - 778. What is o(3)? 158 Let v(k) = -19k2 + 82k - 543. Calculate v(7). -900 Let m(j) = -7j + 232. What is m(-17)? 351 Let f(i) = i3 - 211i*2 + 2758i - 4. Give f(14). -4 Let g(z) = -9012z - 53529. What is g(-6)? 543 Let z(w) = w2 + 250w - 32788. What is z(95)? -13 Let o(y) = 7714y + 732837. What is o(-95)? 7 Let l(b) = 3b*3 - 499b*2 + 269b - 17218. Calculate l(166). -120 Let a(m) = 3m3 - 64m + 41. Calculate a(0). 41 Let b(j) = -j*3 - 88j*2 + 93j - 142. Calculate b(-89). -498 Let j(q) = q*2 - 133q - 6512. Give j(-38). -14 Let x(i) = i*2 + 2154i - 353019. Give x(153). -48 Let q(s) = 41457s2 + 704774s + 29. What is q(-17)? -56 Let y(l) = 200l - 4190. Calculate y(15). -1190 Let t(h) = 16h*2 - 938h + 4300. What is t(54)? 304 Let u(r) = 103r + 2049. Give u(-19). 92 Let n(w) = -197w + 3483. Determine n(20). -457 Let k(v) = -20v3 - 4596v*2 + 24438v - 488. Give k(-235). -18 Let a(w) = 92w2 + 935w + 953. What is a(-9)? -10 Let a(r) = 11r2 - 20r - 86. What is a(-3)? 73 Let i(y) = y*2 - 2257y - 285332. What is i(-120)? -92 Let s(g) = -3608g - 6901. Calculate s(-2). 315 Let a(l) = -23l*3 - 10l*2 + 93l - 166. Give a(2). -204 Let q(b) = -13b2 - 510b + 1093. What is q(-42)? -419 Let i(b) = 3b3 - 84b*2 - 613b - 73. What is i(-6)? -67 Let i(s) = 33263s + 99759. What is i(-3)? -30 Let w(v) = 6v*2 + 125v - 3127. Calculate w(-36). 149 Let r(o) = -518o2 - 2010o + 95. Give r(-4). -153 Let j(f) = f*2 - 6344f - 31717. Give j(-5). 28 Let y(b) = 29b2 + 216b - 84. Calculate y(-11). 1049 Let u(p) = -5p2 - 1785p + 8883. Determine u(5). -167 Let h(z) = 7z2 + 558z - 177. Calculate h(-80). -17 Let r(x) = 3x3 - 350x*2 - 18x - 11564. Calculate r(117). 19 Let b(o) = -15283o + 366810. Determine b(24). 18 Let a(r) = -r3 - 7r*2 + 4492r + 49274. Give a(-11). 346 Let z(l) = -5741l + 1601737. Give z(279). -2 Let r(o) = -67959o - 883396. Give r(-13). 71 Let h(t) = 7t2 + 2671t + 9456. Determine h(-378). 6 Let r(q) = 2053q + 172466. Determine r(-84). 14 Let v(t) = -3t*3 + 37t*2 - 31t + 131. Give v(12). -97 Let z(j) = 3j3 + 236j*2 - 6272j - 82. Calculate z(21). 65 Let q(j) = j*3 - 364j*2 + 39j - 14165. Determine q(364). 31 Let c(v) = v*3 - 122v*2 + 110v - 168812. Determine c(131). 47 Let i(x) = -x*2 + 22744x + 478053. Calculate i(-21). -12 Let y(f) = f*2 + 186f + 8464. Calculate y(-81). -41 Let x(l) = 3l2 - 438l - 1774. Determine x(-4). 26 Let w(n) = -29n2 + 1384n - 16429. Calculate w(24). 83 Let t(k) = -14163k - 1586195. What is t(-112)? 61 Let x(j) = 9331738j + 27995210. Calculate x(-3). -4 Let a(p) = 5p3 + 20p*2 - 4p - 159. Give a(-6). -495 Let b(h) = -245h + 4951. Determine b(24). -929 Let a(z) = z3 - 16z*2 - 2952z + 27129. Determine a(9). -6 Let r(k) = 13k3 - 146k*2 - 305k - 14. What is r(-2)? -92 Let z(h) = 1171h + 236565. What is z(-202)? 23 Let r(l) = 21783l + 1590148. Give r(-73). -11 Let n(g) = -g*3 + 23g*2 - 153g + 1913. Give n(20). 53 Let w(z) = -11z2 + 1863z + 3906. Determine w(172). -1082 Let o(n) = 4989n2 - 843145n + 684. What is o(169)? 8 Let a(t) = t*3 - 122t*2 + 3796t - 4555. Calculate a(60). 5 Let t(s) = -3s3 - 194s*2 + 38s - 1257. Determine t(-65). 498 Let u(m) = -14m2 + 21840m - 43628. Calculate u(2). -4 Let j(v) = -v*3 - 200v*2 + 15290v + 1741. Determine j(-259). -590 Let s(v) = -1437v + 329749. Give s(230). -761 Let q(z) = 3z*2 + 58288z + 2036405. Determine q(-35). 0 Let y(s) = 15s3 + 4s*2 - 5s - 7. Determine y(-1). -13 Let z(b) = -b*2 - 98b + 1400. Calculate z(15). -295 Let j(n) = 4779n - 4735. Determine j(1). 44 Let p(a) = -a3 - 37a*2 - 66a - 31. Give p(-35). -171 Let g(t) = -t*3 + 95t*2 + 2310t - 1144. Calculate g(115). 6 Let h(a) = -a*2 - 833a - 143905. Calculate h(-247). 837 Let n(i) = -337i2 + 2667i - 3977. What is n(2)? 9 Let k(f) = -2f2 + 183f + 813. Determine k(96). -51 Let w(s) = 6645s - 25. What is w(0)? -25 Let i(d) = -921d + 23039. Determine i(28). -2749 Let n(p) = 635p - 110488. What is n(174)? 2 Let l(y) = 88078y*2 + 528464y - 48. Calculate l(-6). -24 Let h(d) = -3d2 + 2600d + 28974. Give h(-11). 11 Let f(h) = 2h2 - 78h - 4254. Give f(65). -874 Let c(i) = i*2 - 73i - 2387. What is c(47)? -3609 Let p(b) = 584b + 10614. Give p(-18). 102 Let t(n) = -136337n + 11861321. Determine t(87). 2 Let z(h) = h*2 - 754h + 78226. Calculate z(124). 106 Let s(l) = 84l2 + 448l - 161. Give s(-6). 175 Let s(k) = 547k3 + 7k*2 + 6k - 16. Determine s(2). 4400 Let r(g) = -1123g - 5937. Calculate r(-8). 3047 Let t(d) = -55d*2 + 6730d + 4213. Give t(123). -92 Let n(j) = -1194j2 - 9542j + 65. What is n(-8)? -15 Let k(f) = -8f3 + 24f*2 + 58f - 179. What is k(3)? -5 Let q(r) = -2r3 - 70r*2 - 405r + 472. Calculate q(-27). -257 Let k(a) = -75208a + 4662932. Determine k(62). 36 Let u(d) = 2d*3 - 225d*2 + 5891d + 1293. Calculate u(42). -9 Let w(v) = 25045v - 125255. Give w(5). -30 Let u(q) = -3q*3 - 2q*2 + 37q - 28. Give u(6). -526 Let h(a) = -a*2 - 2828a + 338387. Give h(115). -58 Let x(b) = -385b2 - 71229b - 762. Give x(-185). -22 Let k(z) = 7z3 - 180z*2 + 133z - 189. Determine k(25). 11 Let x(j) = -2935j - 178983. Determine x(-61). 52 Let r(m) = -8m*3 + 37m*2 + 136m - 6. Give r(-4). 554 Let h(t) = -6t3 - 311t*2 + 65t + 111. Give h(-52). -565 Let a(t) = t*3 + 348t*2 - 3213t - 27. Determine a(-357). -27 Let l(g) = -g*3 + 274g*2 + 192g - 52606. What is l(274)? 2 Let z(i) = -85i - 9143. Calculate z(-106). -133 Let i(w) = 88w - 2026. Determine i(7). -1410 Let j(s) = -469711s - 15970175. What is j(-34)? -1 Let v(b) = 5b*3 - 31b*2 + 68b - 86. Give v(4). 10 Let y(n) = n*3 - 195n*2 - 130n - 13335. Calculate y(196). -399 Let w(o) = -o*2 + 126607o - 74. Calculate w(0). -74 Let x(w) = 2217w + 4250. Calculate x(-2). -184 Let z(v) = 3633v + 134463. Calculate z(-37). 42 Let o(p) = p*3 - 61p*2 + 452p - 5. Determine o(9). -149 Let s(y) = -y*3 - 38y*2 - 509y + 45. What is s(-12)? 2409 Let d(r) = r*2 + 916r + 209790. Give d(-435). 555 Let g(v) = v*3 - 2v*2 - 126v + 66. What is g(0)? 66 Let s(d) = -5347d2 + 48124d + 46. What is s(9)? 55 Let i(r) = -63r3 - 822r*2 + 854r + 208. Determine i(-14). 12 Let p(f) = -f*3 + 143f*2 - 926f + 631. Determine p(6). 7 Let k(t) = 5973t + 603052. Calculate k(-101). -221 Let p(h) = 25h*2 + 2443h - 19124. What is p(-105)? -14 Let s(b) = -8b2 - 2523b - 24407. Determine s(-10). 23 Let i(w) = -w*3 + 325w*2 + 120w - 143831. Give i(324). 25 Let d(o) = 1805o - 3585. Give d(4). 3635 Let s(g) = -96g*2 + 13g - 31. Give s(2). -389 Let o(v) = 25v + 1193. What is o(-78)? -757 Let l(s) = s2 + 12457s + 793157. Calculate l(-64). 5 Let v(c) = -207c2 + 21c + 5. Determine v(1). -181 Let l(b) = -b*3 + 9b*2 - 4185b + 24990. Calculate l(6). -12 Let l(v) = v*3 - 242v*2 - 146v - 83437. Give l(244). 11 Let z(t) = -t*2 + 297t + 32932. Calculate z(-86). -6 Let b(r) = -r*3 - 18r*2 + 300r + 1180. Calculate b(-26). -1212 Let j(x) = -5989x - 24078. Calculate j(-4). -122 Let q(n) = -2n*3 + 4n*2 + 21n + 181. Give q(6). 19 Let f(z) = 3z2 + 319z - 35977. Determine f(-175). 73 Let a(d) = 3d2 - 13973d - 1646573. Determine a(-115). -3 Let q(i) = 292i2 + 9352i + 22. Calculate q(-32). -234 Let o(a) = -168a + 46927. What is o(279)? 55 Let u(r) = 21r*3 - 900r*2 - 125r - 82. Give u(43). 90 Let v(y) = 7951y + 127980. Calculate v(-16). 764 Let l(n) = 17n*2 + 994n + 617. Determine l(-58). 153 Let l(v) = 727758v - 2183282. Give l(3). -8 Let p(c) = -4402c + 35034. What is p(8)? -182 Let p(n) = 620868n - 1241730. Calculate p(2). 6 Let j(x) = 3x*3 - 68x*2 + 426x - 759. Calculate j(6). -3 Let o(a) = 15347a - 261229. Determine o(17). -330 Let n(d) = -2842d - 138974. What is n(-49)? 284 Let u(n) = 2n3 - 47n*2 - 556n + 96. What is u(-12)? -3456 Let k(j) = 19j2 - 531j + 1393. What is k(3)? -29 Let a(k) = 86276	{ "pile_set_name": "DM Mathematics" }
icked without replacement from {e: 2, f: 6, n: 4}. Give prob of picking 3 f. 1/11 Calculate prob of picking 1 v, 1 t, and 1 c when three letters picked without replacement from {c: 1, i: 1, o: 1, t: 1, v: 1}. 1/10 Two letters picked without replacement from {d: 1, c: 4, u: 6, g: 7}. Give prob of picking 1 g and 1 d. 7/153 Four letters picked without replacement from ooosslolowllssls. What is prob of picking 1 w and 3 o? 1/182 Three letters picked without replacement from leqeehaelaabealal. Give prob of picking 2 a and 1 e. 5/68 Three letters picked without replacement from {o: 2, l: 1, c: 2, e: 1, i: 1}. What is prob of picking 1 c and 2 o? 2/35 Three letters picked without replacement from sssssesesemsssss. What is prob of picking 1 s and 2 e? 9/140 What is prob of picking 1 a, 1 d, 1 v, and 1 o when four letters picked without replacement from {s: 3, v: 1, o: 2, a: 1, d: 3, w: 1}? 1/55 What is prob of picking 1 w and 1 m when two letters picked without replacement from {w: 4, m: 15}? 20/57 Four letters picked without replacement from dddggwww. Give prob of picking 2 w and 2 g. 3/70 Four letters picked without replacement from dsdssddsdsss. Give prob of picking 2 s and 2 d. 14/33 Four letters picked without replacement from {i: 5, c: 1, q: 2, h: 2, o: 1, a: 2}. What is prob of picking 1 a, 2 i, and 1 o? 4/143 What is prob of picking 2 d when two letters picked without replacement from jjqjdjyqdjyjqjjjjjjq? 1/190 Calculate prob of picking 1 x, 1 v, and 1 w when three letters picked without replacement from vmwvxvvx. 1/7 Calculate prob of picking 1 l and 1 u when two letters picked without replacement from lsuu. 1/3 Two letters picked without replacement from {b: 2, l: 8, y: 2, g: 7}. Give prob of picking 1 b and 1 y. 4/171 Two letters picked without replacement from {r: 3, n: 9, p: 1, e: 1, y: 3, w: 1}. Give prob of picking 1 y and 1 w. 1/51 Three letters picked without replacement from wppdbbbdwbwwb. What is prob of picking 2 b and 1 d? 10/143 Two letters picked without replacement from nnnkknnnnnknnk. What is prob of picking 1 n and 1 k? 40/91 Three letters picked without replacement from xpooojxoo. Give prob of picking 1 j, 1 x, and 1 p. 1/42 What is prob of picking 3 r when three letters picked without replacement from {f: 7, r: 5}? 1/22 What is prob of picking 2 q and 1 x when three letters picked without replacement from tqytyttvqstsxttsq? 3/680 Four letters picked without replacement from llslllllslsssllsll. What is prob of picking 1 l and 3 s? 4/51 Two letters picked without replacement from hdxsxxxsdhhxx. Give prob of picking 2 h. 1/26 Four letters picked without replacement from bbudoulluu. Give prob of picking 1 l, 1 d, and 2 u. 2/35 What is prob of picking 1 i, 1 d, 1 n, and 1 o when four letters picked without replacement from {o: 2, v: 4, n: 4, d: 7, i: 1}? 14/765 What is prob of picking 2 p when two letters picked without replacement from {j: 2, p: 5, m: 3, u: 2}? 5/33 Four letters picked without replacement from {w: 1, g: 1, o: 16, a: 1, l: 1}. What is prob of picking 1 g, 2 o, and 1 w? 8/323 Four letters picked without replacement from wwjwwjwwwwwjwbw. What is prob of picking 1 b and 3 w? 11/91 What is prob of picking 1 u, 1 f, and 1 e when three letters picked without replacement from euzsfeh? 2/35 Two letters picked without replacement from ukukjejjej. What is prob of picking 2 e? 1/45 Calculate prob of picking 4 u when four letters picked without replacement from uuuuuuuuu. 1 What is prob of picking 2 r when two letters picked without replacement from vvvvvvvvvvvvrvrvvrr? 2/57 Two letters picked without replacement from {i: 15, o: 4}. Give prob of picking 2 i. 35/57 Calculate prob of picking 1 i, 1 n, and 2 b when four letters picked without replacement from biinbwibibiwiiwbii. 1/34 Three letters picked without replacement from {w: 4, r: 1, x: 1, i: 1, j: 2}. What is prob of picking 1 i and 2 j? 1/84 What is prob of picking 2 x when two letters picked without replacement from {i: 13, x: 3}? 1/40 What is prob of picking 1 h and 1 y when two letters picked without replacement from khhhnyhnhznn? 5/66 Calculate prob of picking 1 b, 1 g, and 1 t when three letters picked without replacement from {b: 1, k: 3, g: 4, r: 4, t: 1, u: 4}. 1/170 What is prob of picking 2 j and 1 p when three letters picked without replacement from {u: 3, p: 1, j: 5}? 5/42 What is prob of picking 1 j and 2 y when three letters picked without replacement from jyjjjjjjyjjjyy? 15/91 Calculate prob of picking 2 i and 1 d when three letters picked without replacement from vvdvivjvxvvii. 3/286 Two letters picked without replacement from {l: 3, g: 1, y: 1}. What is prob of picking 1 g and 1 l? 3/10 Three letters picked without replacement from {b: 9, d: 2, u: 8}. Give prob of picking 1 b and 2 u. 84/323 Calculate prob of picking 2 t when two letters picked without replacement from {u: 2, m: 2, t: 2}. 1/15 Two letters picked without replacement from {x: 3, b: 7, d: 1, y: 5, o: 3}. Give prob of picking 2 o. 1/57 What is prob of picking 1 f, 1 j, and 1 d when three letters picked without replacement from {d: 2, f: 1, q: 3, j: 9, y: 4}? 6/323 Two letters picked without replacement from hlylqqoeoeooo. What is prob of picking 1 h and 1 e? 1/39 Two letters picked without replacement from {x: 1, t: 2, k: 2}. Give prob of picking 2 k. 1/10 Calculate prob of picking 1 a and 3 l when four letters picked without replacement from {l: 4, d: 8, a: 2}. 8/1001 Three letters picked without replacement from aaiiiia. What is prob of picking 3 i? 4/35 Four letters picked without replacement from {r: 5, q: 5, i: 6, v: 1}. Give prob of picking 1 q and 3 i. 5/119 What is prob of picking 1 m and 3 b when four letters picked without replacement from {u: 2, m: 1, k: 6, b: 3, p: 1}? 1/715 What is prob of picking 3 u when three letters picked without replacement from hhhuuhuhuhhuhhuu? 1/16 Three letters picked without replacement from ghijw. Give prob of picking 1 j, 1 h, and 1 w. 1/10 Four letters picked without replacement from hxxppofppff. What is prob of picking 1 h, 2 p, and 1 f? 3/55 Calculate prob of picking 1 x and 1 l when two letters picked without replacement from {x: 2, l: 3, d: 3}. 3/14 Four letters picked without replacement from {n: 11, i: 2, o: 6}. What is prob of picking 2 o and 2 i? 5/1292 Calculate prob of picking 3 j when three letters picked without replacement from {m: 2, j: 16}. 35/51 Four letters picked without replacement from {r: 2, w: 3, s: 2, g: 5, d: 2, i: 2}. Give prob of picking 2 s, 1 g, and 1 w. 3/364 Four letters picked without replacement from iiiififiiifffiii. Give prob of picking 2 i and 2 f. 55/182 What is prob of picking 1 f and 1 z when two letters picked without replacement from wwwxxzwxwxxzzvzf? 1/30 Three letters picked without replacement from wwzwwwzwww. What is prob of picking 3 w? 7/15 Three letters picked without replacement from {t: 2, b: 1, a: 2, r: 8, m: 2, w: 4}. Give prob of picking 1 w, 1 a, and 1 b. 8/969 Calculate prob of picking 2 m and 1 z when three letters picked without replacement from {z: 11, e: 1, m: 3}. 33/455 Calculate prob of picking 1 n and 2 j when three letters picked without replacement from {n: 8, j: 1, c: 8}. 0 Two letters picked without replacement from {e: 2, u: 9}. Give prob of picking 2 u. 36/55 Calculate prob of picking 1 p and 2 w when three letters picked without replacement from {w: 4, g: 4, p: 6}. 9/91 What is prob of picking 1 g and 3 p when four letters picked without replacement from ppgpppppppppppppppp? 4/19 Calculate prob of picking 1 x, 1 z, and 2 y when four letters picked without replacement from zyxxyxy. 9/35 Two letters picked without replacement from tttttttttt. What is prob of picking 2 t? 1 Calculate prob of picking 1 t and 1 e when two letters picked without replacement from ccectcledoocetc. 2/35 Four letters picked without replacement from dzzbdludlllrlz. Give prob of picking 3 d and 1 z. 3/1001 Three letters picked without replacement from uuuugggwuuhu. What is prob of picking 1 u, 1 h, and 1 g? 21/220 Calculate prob of picking 1 n and 2 h when three letters picked without replacement from {h: 3, n: 12, l: 3}. 3/68 What is prob of picking 1 s and 1 t when two letters picked without repla	{ "pile_set_name": "DM Mathematics" }
+ 11h + 40. Suppose 56 = s - 20. Calculate the highest common factor of s and m. 4 Let x = -954 + 6608. What is the highest common divisor of 44 and x? 22 Let s(w) = -w2 + 12w - 5. Suppose 0q + 15 = 3q. Let z be s(q). Suppose 2n - z = 14. What is the greatest common divisor of 198 and n? 22 Let w(i) be the first derivative of i4/4 + 4i*3 + 2i*2 + 84i + 22. Let a be w(-10). What is the greatest common divisor of a and 61? 61 Let a(s) = s*2 - 3s - 15. Let o be a(5). Let u be 63/7 + (0 - o). Let j = -25 - -39. Calculate the highest common factor of u and j. 14 Let y(i) = i*2 - 15i + 26. Let q = 20 + -7. Let n be y(q). Suppose 0g - g = x - 105, n = -x + 5g + 105. Calculate the greatest common factor of 15 and x. 15 Let d be (4/(-10))/(3/(-135)). Suppose -4i + 2 = -d. Suppose -iz + 8 = -7. Calculate the greatest common factor of z and 12. 3 Suppose 2u + 3u = 4r + 218, -3u - 254 = 5r. Let i = 111 + r. What is the highest common divisor of 59 and i? 59 Suppose 5y - 189 = 12u - 16u, 2u - 4y = 88. Calculate the highest common factor of u and 1863. 23 Let t(c) be the second derivative of -c*3/6 + 2c*2 + 42c - 2. Let w be (-2)/8 - (-11)/(-4). Let j be t(w). Calculate the highest common divisor of 7 and j. 7 Let k(x) = -2x + 13. Let j be k(0). Suppose 3r + 4y + 157 = 2y, 3r + 153 = -3y. Let c = 81 + r. What is the greatest common factor of j and c? 13 Suppose 100k + 131 - 5931 = 0. Suppose -2l = 3w - 1511, -l = 2l + 5w - 2267. Calculate the highest common divisor of k and l. 58 Let p be (-35)/(-14)((100 - -1) + 175/25). Calculate the greatest common factor of p and 645. 15 Suppose j = -3h + 18, 0 = -16h + 13h - 6. Let w be 2/(1(-1 + 2)). Let d be w/(-3) + (-20)/(-3). Calculate the greatest common divisor of d and j. 6 Suppose -o = -7 - 18. Let b(k) = -k*2 - 11k. Let c be ((-20)/6)/(3 - 24/9). Let s be b(c). What is the greatest common factor of o and s? 5 Let r = -2989 - -5885. What is the highest common factor of r and 80? 16 Suppose -7020 = 740q - 760q. Calculate the greatest common factor of 39 and q. 39 Suppose 227k - 13129 = 32952 + 16571. What is the greatest common divisor of k and 1788? 12 Let r be (2 + -44)/(-6) + (488 - 2). What is the highest common factor of 68 and r? 17 Suppose -3a - 60 = 2a. Let t = a - -26. Let w = -286 + 356. What is the highest common factor of t and w? 14 Let z = 452 - 252. Let y be (-2)/(-12) - (-3836)/24. Suppose -5i + l + z = 0, 0i = -4i + l + y. What is the highest common divisor of 10 and i? 10 Let l be ((-12)/42)/((-1)/(28/2)). Let v be (l8/(-24))/((-2)/528). What is the highest common divisor of 44 and v? 44 Let w(p) = -3p*2 + 24p + 5. Let y be w(8). Suppose -655 + 207 = -q - 5n, yq = -4n + 2135. What is the greatest common divisor of q and 47? 47 Let b be ((-13)/3929)/(-3 + (-88)/(-30)). What is the highest common factor of b and 1247? 29 Let i(j) = -2j2 + 7j + 24. Let b be i(8). Let a = 49 + b. Let g be 1/(5/195a). What is the greatest common factor of 13 and g? 13 Let u be (-1424)/(-22) + 348/1276. Let r be 454 - -2 - 2/((-2)/(-1)). What is the greatest common factor of u and r? 65 Suppose -299l - 370639 = -1701787. What is the greatest common divisor of 84 and l? 84 Let w(f) = 3f2 - 18f + 3. Let x be (108/(-80)-5)/(2/24). Suppose p + 75 = x. Let n be w(p). Calculate the greatest common factor of 3 and n. 3 Let s(r) = -10r + 11. Let l be s(1). Let v be (-44)/55(-4 - l). Calculate the highest common factor of 18 and v. 2 Let d = -98 - -168. Let u = -277 - -276. Let c be (u/(-3))/(-1) - 1240/(-120). Calculate the highest common factor of c and d. 10 Suppose 5160 = -7w - 5w. Let u = 439 + w. Let t(d) = -16d - 1. Let m be t(-4). What is the highest common factor of m and u? 9 Suppose 4j - 282 = 3w - 16, -4j = -w - 86. Let s = -60 - w. Let d be (-20)/s - (-353)/(-6)-2. Calculate the greatest common divisor of 13 and d. 13 Suppose -215n + 9162 = -50396 - 8382. Calculate the highest common divisor of 176 and n. 4 Let d be (-1685922)/(-168) + 1 + 25/(-20). Calculate the highest common factor of d and 45. 45 Suppose -v + 4n = 15, -4v + 0v + 5n = 71. Let y be 90 - v/(95/(-30)). Suppose -23 - 13 = -3w. What is the highest common factor of y and w? 12 Suppose -3c + 4 = -23. Suppose -3k + 3 = -3j, 3k + k - 3j = 3. Let d be (0 + k - -1)(-46 - -47). Calculate the highest common divisor of d and c. 1 Let n be (225 - 273)20/(-3). Calculate the greatest common divisor of 230 and n. 10 Let l be -1 + 2 + 5 + (-33)/11. What is the highest common factor of l and 2949? 3 Suppose -5d + 17 = -4o, 5o - d = 3d - 10. Suppose -5h + 115 = 5r, r - 581h + 583h - 28 = 0. What is the highest common divisor of o and r? 2 Suppose 2x - 5f - 752 = -x, 2x = 5f + 493. Suppose -s = -7k - 23, -s - 90 = 5k - 137. Calculate the highest common factor of x and s. 37 Let r = 83 - 47. Let p be ((-264)/r)/(6/(-9)). Let w(b) = b - 3. Let x be w(4). What is the greatest common divisor of p and x? 1 Let p(g) = 2g*3 + 17g*2 - 13g - 11. Let c be p(-9). Let f be (-1)/(-2) - 9/(-6). Calculate the highest common divisor of f and c. 1 Let o(c) = 5c2 + 20c - 42. Let g be o(-6). What is the highest common divisor of g and 4428? 18 Suppose 11k = -14k + 10k + 5445. What is the greatest common divisor of k and 66? 33 Let i = 9797 + -6472. What is the highest common divisor of 133 and i? 133 Let b be (-7)/(4300/(-375) - -11). Let w = -2 + -7. Let t be w/1(-8)/12. Calculate the greatest common divisor of t and b. 3 Let w = 14090 + -14074. What is the greatest common divisor of w and 11392? 16 Let m be (-8)/(-20)-5 + 86 + (-3)/1. Calculate the highest common divisor of 1323 and m. 27 Suppose 2o - 189 = 97 + 34. Calculate the highest common divisor of o and 3760. 80 Let v = -24 - -27. Suppose -vk - 3k = -30. Suppose 2x + 17 - 3 = 4b, 0 = -x - k. Calculate the greatest common factor of 5 and b. 1 Suppose -49p + 50p + 5y - 200 = 0, 3p + y = 530. What is the greatest common divisor of p and 1820? 35 Let b(z) = -z + 1. Suppose -44q + 30 = -46q. Let k be b(q). What is the highest common factor of 8 and k? 8 Let o = 16 - 14. Suppose -x = -ox + 40. Let m(w) = -w2 - 23w + 60. Let u be m(-20). Calculate the highest common divisor of u and x. 40 Let r(z) be the second derivative of -2z3/3 + 19z*2 - 91z. Let g be r(5). What is the highest common divisor of g and 102? 6 Suppose -p = g - 4 + 23, 3g = -2p - 38. Let m be -5 + 1 - 1 - p. What is the greatest common factor of 98 and m? 14 Suppose 12718 - 2158 = 165l. Calculate the greatest common factor of l and 1024. 64 Let w = -120 - -122. Suppose 4q = -wx + 76, 3x + x - 147 = -3q. What is the greatest common factor of 84 and x? 12 Suppose -70o - 17 = -69o. Let h(a) = -a2 - 24a. Let v be h(o). Calculate the greatest common divisor of v and 68. 17 Suppose -2 = 2z, -3s + 2z + 66 = -20. Suppose -2x + 38 = 2k, 0k - 41 = -2x - 3k. Calculate the highest common factor of x and s. 4 Suppose -53 = -2x - 39. Let j(t) = t2 + 12t + 16. Let u be j(-9). Let m = -4 - u. What is the highest common divisor of m and x? 7 Let x(y) = 5y + 0y + 0y + 24 - 6y. Let m be x(19). Suppose mt - 224 + 9 = -c, -5t - 4c = -230. Calculate the greatest common divisor of t and 14. 14 Let c = -735 + 1393. Let d = 661 - c. What is the highest common divisor of 219 and d? 3 Let c be ((-115)/(-25) - 5) + 94/10. Let r = c + -5. Suppose -5f + 5m - r = -79, -3f + m = -47. What is the greatest common divisor of 48 and f? 16 Let j be (5/3)/(240/243 - 1). Let w = j + 134. Let r(z) = -19z - 1. Let k be r(w). What is the greatest common factor of 36 and k? 18 Let u = -11535 - -13352. Calculate the greatest common divisor of 632 and u. 79 Let d = -3 - -37. Let r = -95 + 97. Suppose -rj + 17j - 1275 = 0. What is the greatest common divisor of d and j? 17 Suppose -4d = -362 + 26. Let u be (115200/12000)/((-2)/(-5)). Calculate the greatest common divisor of d and u. 12 Let a(y) = 34 - 6y - 95 - 32 + 17y. Let u be a(21). Calculate the greatest common divisor of 92 and u. 46 Let j(i) = 65i - 18. Let h be (-273)/13(-4)/6. Let l be j(h). Suppose 11*w - l = 725. Calculate the highest common factor of	{ "pile_set_name": "DM Mathematics" }
Let s = d - -1.197. Round s to 1 decimal place. 1 Let z = -0.521 - 0.003. Round z to two dps. -0.52 Let d = -164.73 + 155.5. Let w = -0.02 - -0.15. Let s = d + w. Round s to the nearest integer. -9 Let o = -27.2206 + 23.225. Let y = 2 + -6. Let r = y - o. Round r to 3 dps. -0.004 Let w = 1.632 + -0.032. Let y = w + -1.5993. What is y rounded to four dps? 0.0007 Let g = -21.47 - -19.9. What is g rounded to 1 dp? -1.6 Let t = 1.55 - 66.55. Let c = -64.902 - t. What is c rounded to 2 dps? 0.1 Let a = -3.750122 + 3.75. What is a rounded to five dps? -0.00012 Let n = -0.027 + -31.973. Let j = 92.6 + -66. Let v = n + j. Round v to the nearest integer. -5 Let y = -3131 - -3130.90026. Let c = 0.1 + y. What is c rounded to 4 dps? 0.0003 Suppose -7l = 9740983 + 332017. Round l to the nearest ten thousand. -1440000 Let i = -15658077955 + 26416560130. Let y = i + -10758482379.00000162. Let h = y - -204. Round h to 7 dps. -0.0000016 Let q = 2083716607.0000089 + -2083716420. Let b = q - 187. What is b rounded to six decimal places? 0.000009 Let f = -36 + 39. Suppose 5r - 5681 = 5b - 701, -b = -fr + 2996. What is r rounded to the nearest one thousand? 1000 Let o = -12.7 - 0.05. Let n = -1.45 + o. Let f = n - -7.1. What is f rounded to zero decimal places? -7 Suppose -16w - 2212801 = -4v - 17w, 5v + w - 2766001 = 0. Round v to the nearest 10000. 550000 Let d = -34 + -87. Let t = -121.000119 - d. Round t to 5 dps. -0.00012 Let z(q) = -q*3 + 4q*2 - q + 2. Let p be z(4). Let i be 8684/2 + (1 - p). Suppose 5b + i = 2v, -3v + 6537 = 2b - 3b. Round v to the nearest one hundred. 2200 Let w = 4595934 - 4595710.0091. Let y = 224 - w. Round y to 3 dps. 0.009 Let t = 0.016 + 7.984. Let b = t - 7.9999987. Round b to six dps. 0.000001 Let u = 10.8003 + 55.1327. Let w = -66 + u. Round w to 2 decimal places. -0.07 Let b = -29.11542 + 29.12. Round b to four decimal places. 0.0046 Let g(u) = 286u - 2. Let r be g(1). Suppose -3l - 1064 = -r. What is l rounded to the nearest one hundred? -300 Let z = 2542.13 + -2553. Round z to one decimal place. -10.9 Let s = 0 + 0. Suppose s = -5l + 25179 + 14841. Suppose 2w + 2w - 15984 = -4x, -2w + x = -l. What is w rounded to the nearest one thousand? 4000 Let j = -10219102 - -7269102. Round j to the nearest one million. -3000000 Let j = -35.1827 + 0.0827. Round j to the nearest 10. -40 Let h = -29.78 + 10.15. What is h rounded to the nearest integer? -20 Let u = 20.574 + -18.86. What is u rounded to one dp? 1.7 Let a = 1877351 - 638351. What is a rounded to the nearest one hundred thousand? 1200000 Let l = -1135 + 1135.07764. Round l to 3 decimal places. 0.078 Suppose 0 = -4l + l + 21. Let z(d) = 3 + 8 - l + 16749d. Let s be z(4). Round s to the nearest ten thousand. 70000 Let z = -1472.999985 + 1473. What is z rounded to 4 dps? 0 Let f = -2252.6718 + 2253. What is f rounded to one decimal place? 0.3 Let z = 793.9998995 + -794. What is z rounded to five dps? -0.0001 Let q = 5.76 - 5.5688. Round q to 3 decimal places. 0.191 Let f be 54/15 + 4/10. Suppose 2t - ft = -6. Suppose -tw = -5045425 - 654575. What is w rounded to the nearest 1000000? 2000000 Suppose -f = g - 5f - 18, -f - 2 = 0. Suppose 2231235 = -gt + 431235. Round t to the nearest 100000. -200000 Let k = 3524.046 - 3532.0460016. Let h = 8 + k. Round h to seven dps. -0.0000016 Let g be 0/(2 - (1 - 0)). Suppose b - 7b + 18 = g. Suppose -bf + 6468144 - 1338144 = 0. Round f to the nearest 100000. 1700000 Let h = 75.971 - 76. Let x = 0.029067 + h. Round x to 5 decimal places. 0.00007 Let h = -1359760 - 4724240. What is h rounded to the nearest 100000? -6100000 Let g(p) = -3842501p2 - 15p - 26. Let i be g(-2). Round i to the nearest 100000. -15400000 Let d = 0.885 + -6.555. What is d rounded to one dp? -5.7 Let l = -0.0345 - -0.034499172. Round l to 6 decimal places. -0.000001 Let v be (-5)/(-25)0 + -1890000. Round v to the nearest 100000. -1900000 Let s(l) = 4 + 7 - l - 3 - 2. Let j be s(3). Suppose 139 = 5i - q - 58, 151 = 4i - jq. Round i to the nearest one hundred. 0 Let u = -0.0400458 + 0.03911. Round u to 4 decimal places. -0.0009 Let q = -61 + 63. Let p(c) = -9000c2 + 2c - 4. Let l be p(q). What is l rounded to the nearest 1000? -36000 Let x = -2736.595 + 2731. Round x to 1 dp. -5.6 Let u = -1.05 - -1. Let q = -6.0496 - -6. Let r = q - u. Round r to three decimal places. 0 Suppose -b + 5b = 16. Let h be -2 - -3 - (-4)/b. Suppose -hf - x = 117998, f = -2x - 72240 + 13244. Round f to the nearest 10000. -60000 Let j = -2467 - -2468.318. What is j rounded to 1 decimal place? 1.3 Let v = 4478 + -2878. Let t be (v/(-12))/(1/90). Round t to the nearest 1000. -12000 Let o = 174 - 503. What is o rounded to the nearest 10? -330 Let j be (3 - 0) + -1 - 0. Suppose h - j = 2. Suppose 0l + 8800000 = -hl. What is l rounded to the nearest 1000000? -2000000 Let x = 2.62 - 2.2. Let k = -2.78 - x. Round k to zero dps. -3 Suppose 6t = 4t - 4. Let f be t/(-11) + (4190994/33)/1. Round f to the nearest ten thousand. 130000 Let p = 4.762 - 4.7. Let k = p + -0.0612. What is k rounded to 3 dps? 0.001 Let z = 2208 - 2226.61. What is z rounded to the nearest integer? -19 Let n = -58.199 + -2.321. Round n to the nearest ten. -60 Let j(z) = 17737z - 3. Let k be j(3). Suppose -2v + 5w + 106420 = 0, -3v - k = -4v + 2w. Suppose -9g - v = -7g. What is g rounded to the nearest 1000? -27000 Let c = 95.999955 + -96. Round c to 6 decimal places. -0.000045 Let y = 25 - 28. Let r(k) = -114k3 + k2 - 3k + 4. Let i be r(y). Round i to the nearest one hundred. 3100 Let k = 77 - 77.025. Let n = 0.023 - k. Round n to 1 dp. 0 Let o(d) = 2744d - 8. Let c(u) = 2u - 5. Let x be c(6). Let k be o(x). Suppose 4q = q - k. What is q rounded to the nearest one thousand? -6000 Let z(o) = o*2 - 7. Let p be z(5). Let j be (3 - 1)/(-6) - 210/p. What is j rounded to zero decimal places? -12 Let i = -643.99999989 - -644. Round i to seven decimal places. 0.0000001 Let h = 124.221 - 124. Let v = -137.119 + 137. Let w = h + v. What is w rounded to 2 dps? 0.1 Let f = 584667969 + -584612097.0006. Let l = -55879 + f. Let a = -7 - l. Round a to four dps. 0.0006 Let n = -478.1719 + 478. Let d = 0.218 + n. Round d to two dps. 0.05 Let l = 159.62 + 1.88. Let i = 3.5 - l. Let s = i - -157.826. Round s to 2 dps. -0.17 Let z = 320.93 + -321. Round z to one decimal place. -0.1 Let r = -39.944 - 0.056. Let p = 40.72 + r. What is p rounded to 1 decimal place? 0.7 Let u = 0.8 - 0.7. Let g = u + -0.2. Let o = 0.10007 + g. What is o rounded to 4 dps? 0.0001 Let g = -1762980520.00000017 + 1762980504. Let t = 0.15 - 16.15. Let l = g - t. Round l to 7 decimal places. -0.0000002 Let g(k) = 12k - 5. Suppose 17 = 6y - 31. Let z be g(y). Round z to the nearest ten. 90 Suppose -3g = 5j + 21, j + 6 = 3j. Let z = -12 - g. Suppose -2p + 3q - 2q - 300005 = z, 5q = -3p - 449975. What is p rounded to the nearest 100000? -200000 Let s(t) = t3 - 19t*2 - 21t + 22. Let l be s(20). Suppose 0j + lj = -3480. What is j rounded to the nearest 100? -1700 Let k be (1 - 40)/(3 - 2 - 2). Suppose -2a - 4p + 12 + 54 = 0, -2a + 5p + k = 0. Round a to the nearest one hundred. 0 Let i = -26.3 + -6.7. Let o = 31.9 + i. What is o rounded to 1 dp? -1.1 Let u = -5.5 + 5.534. Round u to two decimal places. 0.03 Let j = 235.7 - 1157. What is j rounded to the nearest 100? -900 Let s = 0.215 + 57.285. Let f = s - 60.17. What is f rounded to zero decimal places? -3 Let b(v) = 542100v3 + 12v*2 - 13v + 1. Let j be b(1). What is j rounded to the nearest 10000? 540000 Let b = 209 + -370. Let m = -327 - b. What is m rounded to the nearest 10? -170 Let t = -700 + 617.3. Let b = t - -76. What is b rounded to zero decimal places? -7 Suppose -2t + 64 = 3d, 0t - 132 = -5d + 3t. Suppose ds = 28s + 336. What is s rounded to the nearest one hundred? -100 Let m = -1404324 + 777324. Round m to the nearest ten thousand. -630000 Let h = 438.2 + -551. What is h rounded to 0 decimal places? -113 Let x = 1109683 + -393683. Round x to the nearest 10000. 720000 Let h be 22/8716/28. Let p(s) = 27277s - 47. Let y be p(h). What is y rounded to the nearest 1000000? 0 Let v = 285 - 427. Let f = v - -142.093. Let i =	{ "pile_set_name": "DM Mathematics" }
thout replacement from qqnqvvlqlvnvvqvqnql? 1/323 What is prob of sequence ppm when three letters picked without replacement from {n: 5, m: 9, l: 1, p: 2, r: 1}? 1/272 Three letters picked without replacement from welllwlwl. What is prob of sequence ell? 5/126 Two letters picked without replacement from ncycccnyccncynyc. What is prob of sequence cc? 7/30 Calculate prob of sequence ksls when four letters picked without replacement from {s: 1, l: 2, k: 1}. 0 Calculate prob of sequence eubu when four letters picked without replacement from beapuappapue. 1/2970 Two letters picked without replacement from xyxxyyaxaxxxxyaxxx. What is prob of sequence xa? 11/102 Calculate prob of sequence knz when three letters picked without replacement from {z: 5, b: 1, s: 4, k: 1, v: 1, n: 1}. 5/1716 Two letters picked without replacement from {c: 2, a: 12, n: 4, d: 1}. Give prob of sequence nd. 2/171 What is prob of sequence zss when three letters picked without replacement from zxsdscsdfddz? 1/110 Two letters picked without replacement from bjbloglttggblj. What is prob of sequence bj? 3/91 What is prob of sequence prrr when four letters picked without replacement from {l: 2, m: 1, r: 3, p: 1}? 1/140 Three letters picked without replacement from iiirirmmriirriiiiri. Give prob of sequence mir. 22/969 Calculate prob of sequence jjij when four letters picked without replacement from {j: 3, i: 12}. 1/455 What is prob of sequence fvzb when four letters picked without replacement from {v: 1, z: 4, f: 1, o: 3, p: 4, b: 2}? 1/4095 Four letters picked without replacement from {r: 2, y: 8, h: 2}. What is prob of sequence yyyr? 28/495 Calculate prob of sequence vl when two letters picked without replacement from {k: 1, n: 3, m: 1, l: 1, v: 1}. 1/42 Four letters picked without replacement from xxxwtwwxxxtwwxtpppt. Give prob of sequence xxxw. 175/15504 Two letters picked without replacement from ccmcmhccvmcccpmmpvvh. Give prob of sequence cm. 2/19 Four letters picked without replacement from houu. What is prob of sequence uhuo? 1/12 Two letters picked without replacement from {s: 8, p: 7, h: 5}. What is prob of sequence sh? 2/19 Three letters picked without replacement from ttttdttttdddtt. What is prob of sequence dtt? 15/91 Four letters picked without replacement from {j: 5, v: 4, t: 8, z: 1}. What is prob of sequence jzvv? 1/1224 Calculate prob of sequence vt when two letters picked without replacement from {o: 3, v: 2, t: 1, h: 2, s: 4}. 1/66 What is prob of sequence hhh when three letters picked without replacement from hhhhhhhrhhhr? 6/11 What is prob of sequence sg when two letters picked without replacement from {f: 3, g: 2, w: 3, y: 1, s: 1}? 1/45 Three letters picked without replacement from {y: 1, w: 1, p: 1, l: 1, n: 1}. What is prob of sequence ynp? 1/60 Three letters picked without replacement from {q: 1, f: 3, g: 1, b: 2, e: 1, c: 3}. What is prob of sequence efg? 1/330 Calculate prob of sequence naa when three letters picked without replacement from {a: 2, n: 1}. 1/3 Two letters picked without replacement from {r: 6, p: 7}. Give prob of sequence rp. 7/26 Calculate prob of sequence tptp when four letters picked without replacement from pttttttttpttttpttt. 7/408 Calculate prob of sequence ynp when three letters picked without replacement from {p: 1, y: 2, t: 1, n: 2, f: 2}. 1/84 Two letters picked without replacement from ttatttttttttttt. Give prob of sequence aa. 0 Three letters picked without replacement from {m: 1, z: 1, c: 1}. Give prob of sequence mcz. 1/6 What is prob of sequence iiwj when four letters picked without replacement from {s: 3, i: 2, j: 5, w: 3}? 1/572 Calculate prob of sequence snnz when four letters picked without replacement from soznon. 1/180 Calculate prob of sequence scsc when four letters picked without replacement from ggsggccs. 1/420 Four letters picked without replacement from yylywlhwywwwylhlwww. Give prob of sequence wyyh. 10/2907 Calculate prob of sequence wil when three letters picked without replacement from {p: 1, i: 4, d: 6, n: 1, w: 4, l: 3}. 8/969 Two letters picked without replacement from rqqrqrrr. Give prob of sequence rr. 5/14 Two letters picked without replacement from {z: 2, u: 1, i: 1}. What is prob of sequence iz? 1/6 Four letters picked without replacement from okdtookokotdtooodtko. What is prob of sequence okdk? 9/3230 Four letters picked without replacement from aayaayaaaay. What is prob of sequence yaaa? 7/55 What is prob of sequence yz when two letters picked without replacement from zzzzzybzz? 7/72 Three letters picked without replacement from {z: 1, n: 4, j: 3, u: 1, c: 1, p: 2}. Give prob of sequence ncu. 1/330 What is prob of sequence ppo when three letters picked without replacement from owppooppwowwop? 25/546 Calculate prob of sequence eww when three letters picked without replacement from icgiiiwcccicjejwjcec. 1/1710 Four letters picked without replacement from mmnsnsssnseeneednssd. Give prob of sequence msmd. 7/29070 Four letters picked without replacement from fzfzzzzzzzzzzzzzfz. Give prob of sequence zffz. 7/408 What is prob of sequence dq when two letters picked without replacement from qqqqqqqqqqqqqdqqqqdq? 9/95 Four letters picked without replacement from {p: 5, n: 3}. What is prob of sequence npnn? 1/56 Two letters picked without replacement from {a: 3, c: 2}. What is prob of sequence cc? 1/10 Three letters picked without replacement from pyjj. Give prob of sequence ypj. 1/12 Calculate prob of sequence eo when two letters picked without replacement from {o: 2, e: 7}. 7/36 What is prob of sequence kkk when three letters picked without replacement from {k: 7, y: 5}? 7/44 What is prob of sequence wmmw when four letters picked without replacement from {m: 2, d: 5, w: 2}? 1/756 Three letters picked without replacement from qeeqqfh. What is prob of sequence hfe? 1/105 Three letters picked without replacement from {l: 1, b: 3, e: 3}. Give prob of sequence ble. 3/70 Three letters picked without replacement from rxrr. What is prob of sequence rrr? 1/4 Calculate prob of sequence jj when two letters picked without replacement from {j: 7, k: 5}. 7/22 Two letters picked without replacement from aawacccccaawwwccacc. What is prob of sequence wc? 2/19 Calculate prob of sequence toz when three letters picked without replacement from zzzotttoztz. 4/99 What is prob of sequence jelj when four letters picked without replacement from {k: 2, e: 3, j: 3, i: 1, l: 1, g: 1}? 1/440 Calculate prob of sequence ttt when three letters picked without replacement from {j: 3, l: 2, t: 4}. 1/21 Two letters picked without replacement from jwwdjdcjwjdwwg. Give prob of sequence dw. 15/182 What is prob of sequence dk when two letters picked without replacement from {c: 1, k: 2, d: 1, a: 1}? 1/10 Calculate prob of sequence mbma when four letters picked without replacement from bmbmbbabbbbmbbaabb. 1/340 What is prob of sequence lcc when three letters picked without replacement from clgwlcvwkwl? 1/165 Calculate prob of sequence laaa when four letters picked without replacement from qaalt. 0 Two letters picked without replacement from {w: 2, h: 1, s: 1, e: 2}. What is prob of sequence he? 1/15 Calculate prob of sequence prq when three letters picked without replacement from qqtprppppq. 1/48 Calculate prob of sequence ccc when three letters picked without replacement from {c: 9}. 1 Two letters picked without replacement from {c: 3, s: 2, z: 1, w: 9, q: 3, j: 1}. Give prob of sequence zq. 1/114 What is prob of sequence vzb when three letters picked without replacement from {v: 5, z: 3, b: 2}? 1/24 What is prob of sequence aoao when four letters picked without replacement from vtotoocaaosooov? 1/390 Three letters picked without replacement from dcggwdagwzcawdcwgww. What is prob of sequence gdg? 2/323 Two letters picked without replacement from {h: 5, m: 5, o: 3}. Give prob of sequence mm. 5/39 What is prob of sequence bbav when four letters picked without replacement from {p: 1, a: 3, b: 3, v: 4}? 1/110 Calculate prob of sequence noax when four letters picked without replacement from xxaxoauuxaxaxynxnu. 7/9180 Two letters picked without replacement from {r: 2, a: 1, b: 2, e: 1, t: 4, x: 2}. Give prob of sequence rb. 1/33 Three letters picke	{ "pile_set_name": "DM Mathematics" }
2g2 - 6g*2) to cg*2 + r + qg*3 + fg and give q. -9 Rearrange -11i3 - 3 + i2 + i2 - i3 to yi*2 + ni*3 + qi + j and give j. -3 Rearrange 9q - 59q - 40q + 14q to the form mq + n and give n. 0 Rearrange 12z*2 - 10z*2 + 12z*2 + (-4 + 2z*2 + 4)((0 + 1 + 2)(0 + 3 - 1) + 2 - 1 + 2) to mz + b + xz2 and give x. 32 Express (2q - 6q2 - 2q)(9q*2 - 2q*2 + 7q2) + (q3 + q - q)(2q - 2q - 2q) as v + jq + oq*3 + tq*2 + sq*4 and give s. -86 Rearrange 12a*3 + 1 + 0a*2 - 2a - a - 10a3 - 3a*2 to g + qa*3 + wa + oa2 and give g. 1 Express -1 - 3j + j*2 + 1 + 0j in the form pj2 + cj + h and give p. 1 Rearrange -2n + 2n*2 - 2n*3 + 3 + 6n*2 - 8n*2 to the form fn + gn2 + s + rn3 and give r. -2 Rearrange (a2 - 2a2 - 2a*2)(-a - a + a) + (-a*2 + 2a*2 - 2a*2)(-3a - 2 + 2) to da + u + wa3 + ka*2 and give w. 6 Express 20a - 4a - 8a - 5a as qa + d and give q. 3 Rearrange (-d*2 - 4d + 3d - d2)((1 - 1 + 2)(4 - 1 - 2) + 0 - 1 + 2 - 1 + 0 - 5) - 3 - 2d*2 + 3 to xd*2 + rd + i and give r. 3 Express (2 + 3 - 6)(-n - 3 + 3)(4 - 2n - 4) as k + cn + an2 and give a. -2 Rearrange 6x + 3x2 - 6x + 0x to y + mx*2 + ix and give m. 3 Rearrange (x*2 - 4x2 - x2)(2x*2 + 0x*2 - 4x*2) + 14x*4 + 13x*4 - 10x*4 to jx*4 + d + ax*3 + bx*2 + yx and give j. 25 Rearrange -v3 + v4 - 3v3 + 3v*3 + 0v*4 - 2v4 + v4 + (2v - 2v - v*3)(11 - 11 + v) to the form h + yv + wv*4 + pv*2 + uv*3 and give h. 0 Express 11d*2 - 17d*2 + 18d*2 + 0d*3 - 2 + 3d*3 as c + md*3 + rd*2 + xd and give r. 12 Express (-g*2 - 3 + 3 - 5g)(-6g + 18g - 10g) in the form q + jg + ug*2 + xg*3 and give u. -10 Rearrange 2m*3 + 5 - 18 - 2m4 + m2 + 11 to cm2 + p + qm*3 + fm + bm4 and give b. -2 Rearrange (32m*3 + 41m*3 - 92m*3)(-1 + 2 - 3)(-1 + 4 - 5) to vm + y + jm3 + cm*2 and give j. -76 Rearrange 4p*3 - 3p - 2p3 + 1 + 5p - 4p2 - p to the form lp + kp3 + r + ip2 and give l. 1 Express -u3 - 5u - 1 + 1 + 3u*3 + 3 in the form wu*2 + nu*3 + c + xu and give n. 2 Rearrange (1 - 1 + w + (3 - 1 - 4)(1 - 1 + w) + 41 + 24w - 41)(3 + 4 - 5)(3 - 3 - 2w) to the form jw*2 + u + hw and give j. -92 Rearrange (-32t - 37t - 9t)(3 - 1 + 0)(4 - 2t - 4)(4 + 3 - 6) to the form h + mt*2 + gt and give m. 312 Express 2n3 - 3n*3 - 3n*3 + (2n + 1 - 1)(5n2 - n2 - 3n2) + n3 - 3n*3 + 3n*3 as fn*2 + xn*3 + zn + v and give x. -1 Rearrange (-4 + 1 + 1)(-10 + 8 + 4)((2 + 1 - 4)(3z + z - 3z) + 1 - 2z - 1) to the form n + tz and give t. 12 Express -5q*2 + 1 + 4 + 4q*2 + 25q + 14q2 - 25q + (-4q + 2q + 0q)(4 + 2q - 4) in the form uq*2 + tq + l and give u. 9 Express (5o - 4o + o)(-2 - o + 2) + (0o + 4o - 6o)(-6 + 6 - 3o) + 2o + 2o*2 - 2o in the form bo2 + to + p and give b. 6 Rearrange 0 + 0f2 + 2 - 3f*2 - 10f*2 to the form x + df + pf2 and give p. -13 Express o + 6o - o as io + z and give i. 6 Rearrange -3 - w + 2 + w3 + 0w to jw2 + k + lw + xw3 and give x. 1 Rearrange -d3 + 219 - d3 + 3d*3 - 224 to the form xd + wd3 + qd*2 + o and give o. -5 Express (l - 4l + l)(175 - 175 + 3l) in the form w + gl + xl*2 and give x. -6 Express (7 - 3 - 3)(-4p2 + 0p*2 + 3p*2)(-2 + 2 + 5p) as np*2 + rp + lp3 + q and give l. -5 Rearrange -2n + n*3 + 2n*4 + 6n*2 - 3n*2 + 0n*2 to ln*4 + mn + tn3 + p + hn*2 and give h. 3 Express -5p + p2 + p3 + 0p + 0p*2 as u + cp + gp3 + vp*2 and give v. 1 Rearrange -367a*3 + 367a*3 - 2a + a*4 - 1 + 82a*2 + 0a to y + ha2 + ka*4 + za + ta3 and give y. -1 Rearrange -5y*3 - 27y*2 + 0y*3 + 26y*2 to i + cy*3 + wy + qy2 and give q. -1 Express -18y + 18y - 17y*2 in the form p + iy*2 + xy and give i. -17 Express (0p + 0p + 2p)(-2 - 7 + 3) + ((-4p + 2p + 3p)(6 - 2 - 3) + p - 3 + 3)(3 - 5 - 2) as wp + l and give w. -20 Express (529 - 167 - 165)(3s - 3s - s) in the form u + ds and give d. -197 Rearrange 40v + 9v - 17v to t + bv and give b. 32 Rearrange (0p - p + 0p)(-26 + 26 + 2p)(-2p + p*2 + 2p) to the form ip + up*3 + zp*2 + o + sp*4 and give s. -2 Rearrange (4r*2 + 2r*2 - 5r*2)((4 - 4 + 1)(-2 + 3 + 0) + 3 - 5 + 3 + 3 + 1 - 1) to n + zr*2 + sr and give z. 5 Express (f*2 + 4f*2 - 2f*2)(6f + 1 - 4 + 1) in the form nf*2 + pf + h + cf3 and give p. 0 Rearrange 6t + t + 2t to the form m + kt and give k. 9 Express -8c2 - 3c - 11c2 + 3c*3 + 19c*2 in the form dc*2 + nc + p + sc3 and give p. 0 Express (3u*2 + 0 + 0)(-2u + 31 - 31)(-2u - 5 + 5) in the form mu*4 + ku*3 + fu + y + au2 and give f. 0 Express f + 56f*2 - 108f*2 + 8f*3 + 53f*2 as p + xf*2 + mf*3 + af and give m. 8 Rearrange -2g2 + 17 - g2 + 5g*2 to the form dg + o + kg2 and give o. 17 Rearrange 19z - 19z - 50z to the form i + wz and give w. -50 Express -12x3 + x2 + 2 + 6x3 + 9x*3 as ax*3 + mx + y + zx2 and give z. 1 Express (-21 + 12n + 21)(2 + 1 + 0) + (6n - 3n - 2n)(1 + 2 - 2) + n + 2n - 2n as g + vn and give v. 38 Rearrange (2 - 3 - 1)(-o - 7o + 36o) to so + u and give s. -56 Rearrange l - 5l2 - 7l*2 + 0l - 2l to b + jl*2 + ul and give j. -12 Express (-2b2 + 2b*2 - 2b*2)(0b2 + 0b2 - b2) + 0 + 3b4 + 0 + 2b*4 + 0b4 + b4 as u + zb2 + hb*4 + vb*3 + db and give z. 0 Rearrange -2j3 - 2 - 3j + 9j2 - 16j2 + j4 + j + 6j2 to nj*4 + rj*2 + ij + vj3 + o and give i. -2 Express (2 - 2 - 1)(-2 - 2 + 5)(18 + 2s + 8s - 9s) in the form y + is and give i. -1 Rearrange (26w*2 - 23w*2 + 7w + 8w)(-3w2 - 4 + 4w*2 + 3) to v + jw + uw2 + cw*3 + mw*4 and give c. 15 Rearrange 5 + 0j2 - 17 + j2 - 2j3 - 1 to rj + l + uj3 + bj*2 and give u. -2 Rearrange 67 - 67 + 2y*2 - 2y*3 to dy*3 + b + oy*2 + sy and give o. 2 Rearrange -5v4 + 1 + v2 + v + 0v + 9v4 - 2v*3 to xv*2 + o + lv*3 + cv + uv4 and give l. -2 Express -3q*4 - 3q*2 + 1 - 81q*3 + 1 + 44q*3 + 40q*3 as pq*3 + xq + iq2 + hq*4 + l and give l. 2 Rearrange 7 - 17 - 3w + 9 + 0w + 2w + 0w + (-3 + 3 + 2)(w - w + 2w) to yw + o and give y. 3 Express (-2 - 1 - 3)(-2s2 + s2 + 0s2) + (16s - 17s + 9s)(2s + 0s + 0s) in the form n + cs2 + rs and give c. 22 Rearrange 550j3 - 547j*3 + 7 + 8 to the form rj + bj2 + vj*3 + c and give c. 15 Rearrange (s + 0 + 0)(0 - s + 0) + 3s2 - 23s*2 + 0s*2 to ds + ms2 + g and give m. -21 Express -17p*2 + 22p*2 - 16p*2 in the form np + v + jp2 and give j. -11 Rearrange -4 - 3 - 11w*3 + 5 + 13w*3 to bw*2 + h + dw*3 + mw and give h. -2 Rearrange 11w2 + 8w*2 + 4w*2 to xw + yw2 + s and give x. 0 Rearrange (18z*2 - 5698z + 5698z - 4)(2z + 3z - 2z)(0 - z + 0) to h + az4 + mz + bz2 + rz*3 and give a. -54 Rearrange -2o*3 + 1 - 2 - 3o*3 + 2o*3 to io*3 + po + jo2 + w and give w. -1 Express -202b*4 + 200b*4 + 4b*3 - 3b3 + b2 + 2b2 in the form tb + ob3 + m + qb*4 + fb*2 and give q. -2 Express -6a2 + 3 + a2 + 7a2 + 2a*4 - 3a*3 in the form ja*4 + h + ra*3 + va*2 + na and give h. 3 Express 0k + k - 3k + (-2 + 0 + 1)(-482 + 485 - 71k + 20k) as q + hk and give q. -3 Rearrange 5 + 3r2 + 2r*2 + 8r - 8r to the form pr*2 + f + cr and give f. 5 Rearrange (0w - 5 + 3 + 3w)(3w - 7w - 7w + 3w + w - 6w + (-3 + 1 + 3)(4w - 2w - 3w) - 1 + 2w + 1) to the form ow*2 + k + pw and give p. 24 Express (-5 + 5 - 2n2)(-3n + 2n*2 + 3n) - 26 + n*3 + 26 + 2n*2 - 3n*4 in the form m + dn*4 + vn*2 + qn + gn3 and give v. 2 Rearrange 3 + 15z - 1 - 2 to the form kz + h and give k. 15 Rearrange 58t + 40t + 87t - 25t + 1 to the form n + xt and give n. 1 Rearrange (4 + 31 + 5)(0 - 4 + 5)(-n - n + 0n) to ln + r and give r. 0 Express 0i2 - 3i2 + i2 + (-5 + 5 + 12i)(-2i + 0i - i)(-4 + 2 + 1) as li + oi*2 + c a	{ "pile_set_name": "DM Mathematics" }
, 0.2, a? 0.2 Let y = 0.5 + 0. Suppose -183 - 13 = -7z + 35z. Which is the second biggest value? (a) y (b) 1/4 (c) z (d) 0.2 b Let k = -62 + -202. Let l = k + 264.14. What is the second biggest value in -0.1, l, 0? 0 Let o = -187.5 + 187.66. Let g = -40/129 + -1/43. Which is the second biggest value? (a) g (b) o (c) 1 b Suppose -12d + 36d - 72 = 0. What is the second smallest value in 0.4, -30/13, d, 0? 0 Let g be ((-8)/6)/(3/(-18)). Suppose 4 = -6k - 8. Let j be k/(-4)(g - 14). Which is the third smallest value? (a) j (b) 4/5 (c) 3/2 (d) -8 b Let v = 56 - 4. Let r = v - 107. Let n = 55.4 + r. What is the second smallest value in 0.2, -0.3, -1/3, n? -0.3 Let i = 742 + -742.449. Let w = -0.439 - i. What is the biggest value in w, 0, 0.12, -0.1? 0.12 Let z = 2.418 - 2.03. Let w = -0.012 - z. Let m = -0.2 + -0.1. Which is the smallest value? (a) w (b) -0.5 (c) m b Let q be 11/(-21) + (351/(-91))/27. What is the fourth smallest value in q, 25, -4/9, 2? 25 Let q be (2 - 1)/(1/2). Suppose 0v + v = -qi + 77, 0 = -2v - i + 148. Let w = v + -295/4. Which is the biggest value? (a) w (b) 0.4 (c) -0.09 b Let x = -503 - -503.364. Let t = 1.636 + x. What is the third biggest value in 0, t, 4.4? 0 Let u = 0.5 + -1. Let s = 6131/20247 + -128/397. Which is the third smallest value? (a) s (b) 3 (c) u b Suppose -545 = 71f + 396f + 856. Which is the fourth smallest value? (a) 1/6 (b) -19 (c) -1 (d) f a Let z(u) = -5 - 25u - 1 + 0 + 31u. Let m be z(5). Let h = -31 + m. Which is the second biggest value? (a) h (b) 3/8 (c) -3 c Let r = 4761 + -61899/13. Which is the second smallest value? (a) r (b) 2 (c) -0.1 (d) -3 (e) -3/8 a Let h = 20.8 + -21. Let n = -3 - -6. Suppose 0 = -2m + 4 + 30. Which is the second smallest value? (a) m (b) n (c) h b Let s = 1.01 - 1. Suppose 2w - 33 = -5u, -w + 2u + 4 = 19. Let x = 6 - 9. Which is the third biggest value? (a) x (b) s (c) -0.4 (d) w d Let c be (4 + 0 + (-6)/1)/((-2)/172). Let q be ((-1)/(-9))/((-1)/(-4)). What is the second biggest value in q, 0.3, c? q Let q = 8791/4 + -2200. Which is the smallest value? (a) -21 (b) q (c) -1/3 (d) 1 a Let m(i) = i3 - 3i*2 + 2i - 3. Let l be m(2). Let u = -4096 + 4096.2. Which is the smallest value? (a) l (b) u (c) -0.2 a Let f = -7 - -4. Suppose 0 = -24k - 7k - 558. Let t(w) = w*2 + 13w - 87. Let s be t(k). Which is the third biggest value? (a) s (b) f (c) 5 (d) -2/5 d Let i = 303.29 - 304.29. What is the third biggest value in i, -0.3, -491? -491 Suppose 3y - 12 = y + 2z, 0 = -4y + 3z + 21. Let v be (y - 0)/((-3)/(-4)). Let n = -74866 - -74901. What is the biggest value in n, -4, v? n Let f be (1 - 25/4) + 1. Let u = 388.3 - 391. Let j = u - -2.3. What is the third smallest value in f, j, -3/4? j Let d(l) = 4l2 - 78l + 5. Let z be d(20). Suppose 5v - z = -5t, v - 14 = -2t - 0t. What is the second biggest value in t, 0.2, -4? 0.2 Let k = -200.1 + 408.1. Which is the second smallest value? (a) -2 (b) -5 (c) -1 (d) k a Let g = -144.36 - -146.36. Which is the third smallest value? (a) g (b) 1/3 (c) -24 (d) 2/11 (e) 20 b Let d be (96/176)/(1/(-22)-8). What is the second smallest value in 0.3, -2/5, -0.025, d? -0.025 Let r be 1 + 0 + (-86)/26. Let w = r + 77/39. Let n be (3/2)/(60/(-40)). Which is the biggest value? (a) w (b) n (c) -5 a Let u = 546.58 + -2.58. Let v = u + -546. What is the second smallest value in v, -24, -7? -7 Let c be (1 - 7)/((-16)/(-512)). Let u be ((-2)/8)/(84/c). Let f = -11 - -5. What is the third smallest value in u, f, 1/8? u Let o = 146 - 136.9. Let s = o + -9.5. Let x be ((-2)/(0 - 1))/(-33). What is the smallest value in 2/3, x, 4, s? s Let a(l) = -46l - 3. Let q be a(2). Let m = 92 + q. Let x = -27/8 - -181/56. What is the third smallest value in x, 0.1, m? 0.1 Let r = -0.2 + 0.21. Let d(n) = -3n3 - 47n*2 + 18n + 29. Let g be d(-16). What is the third smallest value in -0.01, r, g, -1/4? -0.01 Let w = 184 + -922/5. Let z = 5 + -5.13. Let l = 4.87 - z. What is the biggest value in 0.5, w, l? l Let o = 7967/4 - 1992. What is the fourth smallest value in 0.5, -2, -1, o, 26/7? 0.5 Suppose 0 = 5h + 15, -3n + 7n - 712 = 4h. Suppose d = -n + 178. Which is the third biggest value? (a) d (b) -1 (c) -3/8 b Suppose -3v = -4 - 5. Suppose 7q - 4q + v = 0. Let u = -9.18 - -9.08. Which is the biggest value? (a) 40 (b) q (c) u a Let q be 2 - (6 + -7) - 0. Let f be (q - 0)/(7 + (-21)/(-6)). Let m = -1.3 + 0.6. What is the second smallest value in m, 0.3, f? f Let q = 12090 - 12089.9. What is the biggest value in -1, 0, -5, -2/7, q? q Let p = -2369 - -2369. Which is the second smallest value? (a) 0.83 (b) 0.07 (c) p b Let q = 241228 - 241227. Let j = 4 - 25/6. Which is the second biggest value? (a) -2 (b) -1.7 (c) j (d) q c Let m be (3 - (-29)/(-8))(65/(-5) + 5). Which is the second biggest value? (a) 2/55 (b) m (c) 108 b Let k = 0.7366 - 0.7366. Which is the third smallest value? (a) k (b) -4 (c) -39.4 a Let f be (135 - 135)/((3/(-3))/1). Let z = 1.5 + -1.1. Which is the third biggest value? (a) f (b) -17 (c) z (d) 0.1 a Let u = -12.19454 - 0.00546. Which is the fifth smallest value? (a) 0.5 (b) 3 (c) -1 (d) -4 (e) u b Let j = 2911 - 2908. What is the third biggest value in -2/15, j, 5.3, -5, -4? -2/15 Let l = 2.205 - -132.295. What is the third biggest value in l, 1/8, -3? -3 Let k = -20615 + 20615. What is the biggest value in -3, 2/31, k, -5, -1? 2/31 Let n be -4 + 3 - -51. Let z = -3686.7 + 3686.6. Which is the smallest value? (a) z (b) n (c) -3 (d) 0 c Let q = 12.8 - 2.8. Let j = q - 10. Let y = -1 - -9. Which is the third smallest value? (a) 2 (b) y (c) j b Let k be (150/225)/(1/(-3)). Which is the smallest value? (a) k (b) -3 (c) -5 (d) 0.2 (e) -3/7 c Let t = -386.2 - -385.3. What is the second smallest value in -0.4, t, -2/17, -0.1, -3? t Let y be 1/((-17)/119) - (-62)/10. Which is the second biggest value? (a) 4 (b) y (c) 1 (d) -4/7 c Let v = 16328.5 - 16331.5. Let h = 1 + -1.2. Which is the second biggest value? (a) v (b) 2 (c) h c Let z be 2 + 70/(-32) - (-279)/272169. Let n = -25/3 - -8. What is the smallest value in 21/4, z, n? n Let r = -144.67 + 1.67. Let m = 147 + r. What is the fourth biggest value in -0.04, 0.4, 0, m? -0.04 Let u = -0.2886 + -2.7114. Which is the fourth biggest value? (a) 0.26 (b) u (c) 2 (d) 1 b Let m = -0.03816 - 0.26184. Suppose 4s + 5b = 275, -2s - 2s = -5b - 285. Let y = s - 143/2. What is the third smallest value in m, -1, 1, y? m Let b(m) = -m + 6. Let f be b(10). Let i = 9.909 - 11.909. What is the biggest value in -0.06, i, f? -0.06 Let t = -1453 + 1458. Suppose -2n + 9 = -5n. What is the biggest value in n, 0.2, t? t Let y = 743/980 + -2/245. Let g = -13.729 - -120.859. Let w = 107 - g. Which is the second smallest value? (a) -0.1 (b) w (c) y a Let n = 31/40 + -13/120. What is the fourth biggest value in 1/74, n, 0.1, 5? 1/74 Let l = 1169 + -1172. Suppose 4o + 4 = 6o. Which is the third smallest value? (a) o (b) 4/21 (c) l a Let t = -61.4 - -13.4. Let x = t + 48.2. What is the third biggest value in 2/3, -1, x? -1 Let u = -0.307 - -3.307. Let l = -16.4 - 0.6. What is the third smallest value in l, u, 0.5? u Let f = -0.8 + -0.2. Let p = -10670 + 10670. Which is the third biggest value? (a) p (b) -2 (c) f (d) -1/3 c Let k = -12933 - -12935. What is the second smallest value in -0.1, -24, -2, k? -2 Let x = -0.2 - -0.3. Let o = 19.9 + -28.9. Let w = -9.03 - o. Which is the biggest value? (a) 1 (b) w (c) x a Suppose 56m - 156m - 5635 = 61m. What is the second biggest value in m, 3/4, -2/7, 3/7? 3/7 Let u = -2481 + 2475. Let n = -88 + 437/5. What is the second smallest value in n, 5/2, u? n Let m be -12 - (-14)/875755. What is the second biggest value in m, 225, -2/19? m Let k = 0.2 - 0.6. Let p(d) = d3 + 19d*2 - 39d - 96. Let w be p(-20). Let x = -282 + w. What is the fourth biggest value in x, -0.2, k, -0.13? k Let x = -24.7 - 8.3. Which is the fourth biggest value? (a) -2/9 (b) -1 (c) x (d) -4 c Let m = -0.08519 - 0.17481. Which is the second smallest value? (a) 3 (b) 19 (c) m a Let x = 2.6 + -1.5. Let b = 0.686 + 0.314. Let l = b	{ "pile_set_name": "DM Mathematics" }
h - 9. Let c(t) = 11242t + 91. Let s(m) = 9c(m) + 91z(m). Let v(x) = 6x. Calculate v(s(d)). -6636d Let y(l) = -27l*2 - 4l + 4. Let a(o) = -22o2 - 3o + 3. Let z(m) = -4a(m) + 3y(m). Let i(r) = -r*2 + 2r*2 + 2r*2 - 6r*2. Calculate z(i(s)). 63s*4 Let c(k) = -54696k*2. Let t(w) = -404w*2. Give c(t(z)). -8927262336z*4 Let i(d) = -135d*2. Let y(h) = 20h - 52h + 17h + 13h + 8h. What is y(i(a))? -810a2 Let k(s) = 2s. Let l(h) = 3h2 + 11h - 89. Let v be l(-30). Let i(g) = v - 2281 + 3g. Determine k(i(c)). 6c Let v(i) = 2i3 + 14i*2 - 2i - 12. Let t be v(-7). Let l(q) = 11q2 + 17q*2 - 21q*t. Let n(b) = 4b*2. Determine l(n(y)). 112y4 Let d(h) = h2. Let i(t) = 453851604t2. Calculate d(i(a)). 205981278453372816a*4 Let u(o) = -18206o. Let r(i) = -189i + 1. What is r(u(t))? 3440934t + 1 Suppose -j + 3 = -2. Suppose 4s = -5z + 292, -js = 4z - 215 - 150. Let p(g) = -73g - 2g*2 + sg. Let c(o) = 6o2. Give p(c(h)). -72h*4 Let s(v) = -2v*2 - 8v + v*2 + 11 - 16. Let p be s(-7). Let n(m) = -pm + 5 - 5. Let x(g) = 20g2. What is x(n(d))? 80d*2 Let v(f) be the second derivative of 71f*4/12 + 3962f. Let b(p) = -40p. Calculate b(v(u)). -2840u*2 Let d(b) = -6b. Let c(s) = 1463689s. Calculate d(c(r)). -8782134r Let i(d) be the first derivative of -2d3/3 + 5. Let m(x) = -141x - 135x + 513x - 171x + x2 - 3x*2. Calculate m(i(k)). -8k*4 - 132k*2 Let o(m) = -14051m - 139. Let n be o(-18). Let p(g) = 39g + 252779 - n. Let w(r) = r2. Give p(w(i)). 39i*2 Let c(f) = 3f. Let n(k) be the second derivative of -2k3/3 - 7k*2/2 + 13k - 53. What is n(c(q))? -12q - 7 Let s(v) be the third derivative of -v5/30 - 19v*3/6 - 324v*2. Let w(c) = 28c. Give w(s(q)). -56q2 - 532 Let o(u) = 3u - 60. Let a be o(26). Let v(j) = -a + 34 - 16 + 12j. Let w(y) = 4y. Give v(w(s)). 48s Let i(s) = 25s + 96. Let r(w) = -100w - 400. Let d(g) = -25i(g) - 6r(g). Let z(y) = -4y + 13. Determine d(z(o)). 100o - 325 Let m(o) = o + 42. Let f(k) = k + 24. Let g(j) = 7f(j) - 4m(j). Let q(b) = -126b. Determine g(q(p)). -378p Let q(j) = -j + 27. Let r(k) = 8k - 198. Let t(f) = 44q(f) + 6r(f). Let l(y) = 287y2. Determine l(t(x)). 4592x*2 Let d(z) = 12z*2. Let b(q) = 1491q + 1522q - 2983q. Give d(b(r)). 10800r2 Let j(a) = 2a*2. Suppose -3m + 5i - 14 = 0, -4 + 8 = -4m + 3i. Let q(l) = -4l*2 - 57l + 26l + l2 + ml*2 + 2l. Determine j(q(z)). 2z4 + 116z*3 + 1682z*2 Let j(t) = 470 - 470 + 0t*2 - 3t*2. Let k(q) be the first derivative of -5q*3/3 - 12. What is j(k(z))? -75z*4 Let p(x) = -1173850x. Let g(r) = 2r + 14. Give g(p(v)). -2347700v + 14 Let v(b) = 5b2 + 10b + 5. Let w(c) = c*2 + 4c + 2. Let i(d) = -2v(d) + 5w(d). Let n(y) = -7y + 34. Give i(n(r)). -245r*2 + 2380r - 5780 Let m(h) be the second derivative of 42h3 - 48h*3 - 7h + 33h - h. Let v(y) = -y. Give v(m(s)). 36s Suppose 2b + 18 = 5q, -5b = 4q - 3b. Let l(i) = i2 + 6i*q - 3i*2 - 7i*2. Let p(w) = -48w*2. Determine p(l(u)). -432u*4 Let o(p) = 2p*2. Let y(z) = 3809323z. What is o(y(k))? 29021883436658k2 Let i(d) = 7d*2 - 45d. Let r(m) = 1006m. Determine r(i(j)). 7042j*2 - 45270j Let j(g) = -14g - 2. Suppose 3p = -r - 11, 0 = -18p + 14p - 5r - 11. Let i(y) = -19y - 2. Let n(u) = pj(u) + 3i(u). Let x(h) = 2h. Give n(x(b)). -2b + 2 Let y(m) = m. Let c(g) = -844g - 3266. What is c(y(w))? -844w - 3266 Let j(q) = -3q2 - 4q - 61. Suppose -13y - 61 = -9. Let n(t) = -t2 - t + 1. Let o(a) = yn(a) + j(a). Let u(z) = -2z2. What is u(o(x))? -2x*4 + 260x*2 - 8450 Let u(w) = 2w. Let b(t) = -5t - 20. Let k be (-3)/((-10 + 13)/1). Let a(h) = -2 + 1 + 0. Let v(n) = kb(n) + 20a(n). Determine u(v(m)). 10m Let u(d) = -2d2 - 11d. Let g(t) = -185722t. Calculate g(u(r)). 371444r*2 + 2042942r Let a(o) = -65o2. Let m(h) = 3312h*2 + 2. What is m(a(u))? 13993200u*4 + 2 Let y(d) = 2012d. Let l(s) = -2s - 3 - 15 + 2 + 16. What is y(l(h))? -4024h Let x(p) = p*2 - 35. Suppose -18y - 91 = -25y. Let g(o) = 7o*2 - 6. Let k(a) = -15a*2 + 13. Let z(b) = yg(b) + 6k(b). What is x(z(m))? m4 - 35 Let x(k) = -921k*2. Let r(q) = -30q + 368. Let n(g) = 4g - 48. Let o(j) = 46n(j) + 6r(j). Give o(x(l)). -3684l2 Let n(u) = 7. Let f(q) = -q2 - 21. Let h(s) = f(s) + 3n(s). Let w(y) be the second derivative of 43y*4/6 - 6y. Calculate w(h(b)). 86b4 Let q(c) = -c2. Suppose -61 = f - 68. Let l(s) = 20s - 38s - fs. What is q(l(m))? -625m2 Let y(z) be the third derivative of 0 + 0z4 + z2 - 1/10z5 + 0z*3 - 7z. Let v(p) = -17p2. What is y(v(o))? -1734o*4 Let i(d) = 2849d. Let t(o) = 21o2 + 65o + 3. Determine i(t(q)). 59829q2 + 185185q + 8547 Let s(h) = -h. Let y(p) = -516p2 + 16790. Calculate s(y(x)). 516x*2 - 16790 Let b(o) be the second derivative of -187o*3/2 + 1715o. Let y(d) = 10d2. What is b(y(t))? -5610t*2 Let l(x) = -4x*2. Let c be 1/(-2) - 70/(-28). Let f(v) = -1 + 50v + 3 - c - 166v. Give f(l(k)). 464k*2 Let j(y) = -1998089y. Let k(o) = -695o2 + 2. Give k(j(p)). -2774689958085095p*2 + 2 Let n(a) = -284a - 2. Let r(i) be the second derivative of i*4/12 - 1317i. Give n(r(s)). -284s2 - 2 Let w(t) = 2936307t. Let m(x) = -11x2. Give w(m(j)). -32299377j*2 Let h(d) = 5d + 5. Let u = -181 - -183. Let f(z) = 247z - 126z - 121z - zu. Calculate h(f(g)). -5g2 + 5 Let q(k) = k2 - 2. Let b(t) be the second derivative of -5t4/24 + 5t*2/2 + 7t - 6. Let h(l) be the first derivative of b(l). Give q(h(g)). 25g2 - 2 Let v(c) = -2c. Let a(m) be the first derivative of -27 + 19/2m2 + 0m. Give v(a(y)). -38y Let k(j) = -21j. Let s(i) be the third derivative of 0 - 43i2 + 0i + 0i3 + 0i*4 - 1/60i*5. Determine k(s(p)). 21p*2 Let u(x) = 6954x. Let t(m) = 4633m. Let z(d) = 8t(d) - 5u(d). Let r(o) = -o2. Determine z(r(i)). -2294i*2 Let i(g) = -16g + 2. Let a = 76 - 74. Let k(w) = 28w2 - 30w*a + 12w - 12w. What is i(k(b))? 32b2 + 2 Let x(m) = m2 + 0 + 0. Let b(p) be the third derivative of 0p3 - 107p*2 - 7/24p*4 + 0 + 0p. Determine b(x(u)). -7u2 Let s(v) = 14v*2 + 15v. Let c(n) = 12n2 + 35. Let r(p) = 2p*2 + 7. Let u(x) = -c(x) + 5r(x). Determine s(u(d)). 56d4 - 30d*2 Let b(l) = 2l*2 - 5l*2 + 2l*2. Let q(y) = 1862y*2 - 304y + 456. Let s(k) = 61k2 - 10k + 15. Let d(m) = 5q(m) - 152s(m). Determine d(b(c)). 38c4 Let i(a) = -15833a. Let x(w) = -2w2 - w - 412. Give i(x(d)). 31666d*2 + 15833d + 6523196 Let l(p) = -254p2 + 757p*2 - 277p*2 + 16p - 285p2. Let f(j) = -j2. What is l(f(v))? -59v*4 - 16v*2 Let g(d) = -1614322d*2 + 2. Let b(q) = -2q*2. Give g(b(y)). -6457288y*4 + 2 Let n(t) = -11461t - 2. Let h(l) = 2l2. Calculate h(n(y)). 262709042y*2 + 91688y + 8 Let l(g) = -6105g - 57. Let d(t) = -25t*2. What is l(d(j))? 152625j2 - 57 Let n(s) be the second derivative of s4/24 - 21s2 - 22s + 2. Let c(d) be the first derivative of n(d). Let x(q) = -q*2 - 57q. Determine c(x(v)). -v*2 - 57v Let n = 57 + -53. Suppose 2y + n = k + 1, -5k = -5y - 15. Let a(d) = -7d*2 + y + 0 + 15d*2. Let j(q) = -2q. Calculate j(a(f)). -16f2 Let g(f) = 3855f*2. Let b(t) = -1855t. Calculate b(g(s)). -7151025s2 Let k(z) = 12z + 28. Let w be k(-8). Let l = 70 + w. Let n(p) = -5p2 + pl + p2 + 6p*2. Let x(o) = -2o. Give x(n(q)). -6q2 Let r(y) = -36y*2 + 15y. Let d(j) = 13j2 - 2731j + 2727j - 4j*2. Let h(i) = 15d(i) + 4r(i). Let t(w) = w2. Give h(t(k)). -9k*4 Let s(f) = -4f*2. Let q(c) be the third derivative of -61c*5/20 - 5c*3/6 + 9c*2 + c + 3. Give s(q(t)). -133956t*4 - 7320t*2 - 100 Let v(j) = 22j + 28j - 7j. Let n(i) = i + 7 + 3 + 7 - 16. Let u(h) = -8h - 6. Let c(a) = 6n(a) + u(a). What is v(c(k))? -86k Let z(l) = 427l*2 + 35l. Let c(a) be the first derivative of -25a3/3 - a2 - 11. Let n(p) = -35c(p) - 2z(p). Let q(j) = -2j*2. Give q(n(i)). -882i*4 Let j(r) = -9r*2. Let q(y) = 15y + 42. Let a = -133 + 154. Let l(u) = -3u - 8. Let x(f) = al(f)	{ "pile_set_name": "DM Mathematics" }
Let b(f) = -10f3 + 2f*2 + 8f + 7. Let c be b(s). Solve 2v + 2v + 2g = -4, -3v + c = -2g for v. 1 Let a = 25 + -21. Suppose b + 4 = ad - 12, -2d = -8. Suppose -c + x = -3, c - 13 = -bc - 4x. Solve 5m + 4k + 2 = c, 0 = 5m + 2k - 9 for m. 3 Let j = -18 - -17. Let c be (j/(-1))/((-3)/(-48)). Let v = 479 - 455. Solve g - 5t - v = -0g, -c = 4t for g. 4 Let d be 6 - 3 - (-1 - 1). Let y = 1745 + -1740. Solve 0 = 5o + 4v - 0 + d, yo + 10 = -3v for o. -5 Let k(s) be the first derivative of -s*2/2 + 3s + 8. Let v(h) = h*2 - h. Let y be v(1). Let n be k(y). Solve 4q + b = -8, nq = -5b + 2 - 8 for q. -2 Let j = 159 + -152. Let p be ((-4)/(-14))/(j/49). Solve -5q + 2 - 3 = -k, pq = 4k + 14 for k. -4 Let j = -48 + 235. Suppose -136 + j = 17o. Solve -og + 0g = 2s + 11, -4s - 4g = 20 for s. -4 Suppose h + h + 183 = 201. Let x = -5 + 16. Let g = x + -5. Solve p = 3p + 2c + g, 3c = -p - h for p. 0 Suppose -53 = -4i + 27. Suppose 544 = 14a + 180. Suppose -i = 2s - a. Solve -2w + 4v - 7 = -3, -sv = 0 for w. -2 Suppose -26b - 279 = -409. Solve 0 = 2f + 3y + 16, -bf + 0y = -4y + 17 for f. -5 Suppose -108 = 129b - 147b. Solve -x - z = -b, 23 = -2x - 2z + 7z for x. 1 Let u(b) = 2b - 34. Let x be u(18). Suppose xr + 59 = m, -5m + r + 302 = -2r. Let h = -59 + m. Solve -5p + 4p = 5z - 28, hp - 1 = z for p. 3 Suppose -2340 = -104t - 676. Solve -r + tw - 13w = 7, 5w - 13 = 3r for r. -1 Suppose -3h - k + 32 = 0, 31 = -3h + 3k + 43. Solve -3q + 3r = 18, 0 = -q - hr - 7 + 31 for q. -3 Suppose 3q - 7 - 5 = 3i, -4q = -i - 16. Suppose 31o - 29o = i. Solve 3t - 11 = 5n, 2t + o = -2n + 2 for n. -1 Let k be (2 + 4)/(6/4). Suppose 6x = -x - 2x. Solve -w + p = 0, -kw - 2p = -xp for w. 0 Let h = 441 - 436. Suppose -12x = -hx. Solve 2c + 0b - 4b + 20 = x, 4c - 4b = -28 for c. -4 Let d = 83 - 29. Let z be 51 + d/(-18). Solve 3s - 4j + 2 = -4, -j + 7 = zs for s. 2 Let j(m) = 2m*2 + 28m - 237. Let y be j(-20). Solve 0 = -4r + 4a, 3a = yr + a - 2 for r. 2 Suppose 28w = -15 + 73 + 82. Solve 5k = -wn + 24 - 39, 2k + 9 = n for k. -4 Let m be (-686)/(-5) + 1/(-5) + -4. Let j be (-4)/(-14) - (-627)/m. Solve -3b + 18 = -5x, -2b + jx + 11 = 2x for b. 1 Suppose 99s + 112s = 0. Solve -3v + 5j - 8 = 6, -3v - 3j + 18 = s for v. 2 Suppose 0 = 267z - 262z - r - 23, -4r = 5z - 58. Solve -5w + 2o + z = 0, 3w = -202o + 200o + 10 for w. 2 Let s be (1/6)/((-1234)/(-1020) - (-72)/(-60)). Solve -n + 19 = s, 2i + 4n = 2 for i. -3 Suppose -4g + 1027 = 5t, t + 203 = 2t + 2g. Let b = t + -205. Solve -5p = -r + 10, -5p + bp - 28 = -5r for p. -1 Let t = -12768 - -12781. Solve -3 = 5a - 4p + 3, t = -4a - 5p for a. -2 Suppose 276y + 3 + 72 = 301y. Solve -3p - 4 + 4 = yw, 0 = -p for w. 0 Let l be (-2 + 1/(-1))76/(-57). Suppose 9 = lb + 1. Let u(t) = 8t - 4. Let m be u(b). Solve -5s - 4x + m = 0, 5x - 13 - 2 = -4s for s. 0 Suppose -u - v + 412 = 0, u - 372 = -3v + 40. Let r = u + -408. Solve -rf = f - 2w + 24, -3w + 10 = -f for f. -4 Let t be 5 - (2-1 - -1). Let f = -14 + 14. Suppose -2y + c + 13 = f, -3y + 2c = -3c - 37. Solve 3k + 5 = 2o - t, 5k + yo - 11 = 0 for k. -1 Suppose n = -3a + 8a + 33, -4a - 21 = n. Solve 0 = -2w + d + 7 - n, 5d + 20 = -4w for w. 0 Let i(h) = -h*2 + 121h - 686. Let x be i(6). Solve 3y - xv + 5 = 0, 3y + 11 = 9v - 11v for y. -3 Suppose -4y - 16 = 0, 5i - y + 3 - 22 = 0. Solve -io + 3c = c - 20, 12 = o - 2c for o. 4 Let f = 72 + -100. Let p be 13/7 - 4/f. Suppose pq = -2q. Solve -5h - 2 = -qh - 3u, -2h = -3u - 1 for h. -1 Suppose -911q = -903q - 64. Let o be -1(-4 - (-3)/(-3)). Solve 0 = 5u + on + 14 + 21, u - 4n = q for u. -4 Suppose -5k = -b + 48, -b = 4b + 4k - 153. Suppose 0 = -2m - 5l + b, -l + 2 = 3. Solve 5j + m = -y + 3y, 0 = 5y - 3j for y. -3 Suppose 0j - 3 = -3j. Let y be (2/j)/(4/(-26)). Let r(c) = -2c3 - 26c*2. Let n be r(y). Solve -2a + 3b - 17 = n, 3a + 0a + 3 = -3b for a. -4 Let b = -66 + 124. Suppose b - 30 = 7j. Solve jv + n + 20 = 6n, 4n = 16 for v. 0 Suppose -c = -131c - 155 + 1325. Solve -10b = 3z - cb + 19, -3z - 2b - 23 = 0 for z. -5 Suppose -v + 2h = -18, 2h = -h - 15. Suppose 4f = 2p - 94 + 18, -3p + 110 = -5f. Suppose -pn = -47 - 13. Solve -4s = -4l - v, -5l + 3l = n for s. 1 Suppose g = -2r + 8, -15g = -3r - 11g + 23. Solve -2d + 9 = r, -d - 2 = b for b. -4 Let y(z) = -z*3 - 16z*2 + 10z - 110. Let l be y(-17). Let u = 6 - 9. Let s be (u/2)/(24/(-112)). Solve -5g + l + s = -d, -5d = 4g - 7 for g. 3 Suppose 0 = -3k + 4o - 1, -2o + 7o = 4k. Suppose 0 = -i + 12 - k. Solve -4g = -x + i, 0 = 2x + 2x + 4g + 12 for x. -1 Suppose 0 = -48i - 99i + 1911. Solve 2s - 7s - 15 = 0, -5s = -x + i for x. -2 Suppose -6x - 880 = -50x. Solve 0 = 5w - y + 5y + x, 3w + 3y + 15 = 0 for w. 0 Let m = 122 - 115. Solve -2 = -3s - 5, 4r - s + m = 0 for r. -2 Suppose -3t + 6p - 8p - 1077 = 0, 5p = -5t - 1790. Let l = 365 + t. Solve 3g + 6 = -3v, 23 = -lv + 3g + 1 for v. -4 Let l(m) = 3m2 - 3m + 17. Let t be l(-7). Let v = t - 128. Let o be (v/(-12) - -4)-4. Solve -g = -2p - 2g - 3, -15 = og for p. 1 Suppose -2q - 8 = t, -5q - 99 = -5t - 64. Solve 5u = -5, 22 = -tj - u + 11 for j. -5 Let l be (-1)/(-9) - (25 + 1452/(-54)). Solve 4n - 6n = lg - 2, -3n + 4g + 24 = 0 for n. 4 Suppose -161d = -325 - 158. Solve dy = 30j - 25j - 6, -5j + 2y = -9 for j. 3 Let z be 480/8 + -4 + 2. Suppose 0o - 165 = 3o. Let f = o + z. Solve -i - 2i + 25 = -4p, 7 = -fi - 4p for i. 3 Suppose 5s = 7 + 8. Suppose 61 = 120y - 419. Solve 2d = -x + 4, -sx + 0 = 2d + y for d. 4 Suppose 5s - 2956 = 2b, 5s - 6b + b = 2965. Suppose -sm = -587m - 15. Solve 5f - 5v = -25, -5f - mv + 3 = -22 for f. 0 Suppose -2k + 9 = k. Let m(n) = -n*2 - 33n + 190. Let u be m(-38). Solve u = -5g + 5, g + 2 = 5h + k for h. 0 Let w(g) = -g*2 - 2g + 60. Let f be w(8). Let m be (-3)/2 - 30/f. Solve -5y - 5 = -z - mz, -4y - 2z - 18 = 0 for y. -2 Let s(l) = 3l - 44. Let i be s(19). Suppose 2f + 3k - i - 125 = 0, -66 = -f - 3k. Let y = f + -70. Solve -r - 6m = -m + 16, -r + m + y = 0 for r. -1 Suppose -8v = -1502 + 1494. Solve -4h - 3 - v = 0, 0 = -4l - 4h - 16 for l. -3 Let b = -46 - -96. Suppose -bw = -54w. Solve j + wj = 3z + 10, 0 = z + 2j + 8 for z. -4 Suppose 20 = 2a + 2a. Let r(x) be the second derivative of -x4/6 - x3/6 + 6x2 - 2x + 100. Let y be r(0). Solve 3h + 2m + a = 0, -4m - y = 4 for h. 1 Suppose -5z + 16 = 4y, -5z + 9 + 15 = -4y. Let v = 10 + -4. Suppose 3a = a + v. Solve -6i + ak - 1 = -2i, zk + 5 = -i for i. -1 Suppose 0u = 5u + 4d + 62, 5u + 47 = d. Let z be u(-5)/(-4)(-3 - -1). Suppose zq = 29q - 20. Solve 0a - 5a = i - 24, qa - 40 = -5i for i. 4 Suppose 4k - 44 = -2x, -8k + 5k + 33 = 4x. Suppose 20 = 5z, -ko = -10o + 3z - 18. Solve -i + 23 = -5m, oi + 3m = 2i for i. 3 Let h be ((-26)/(-10))/(8 - 39/5). Suppose 4 = -11w + hw. Solve 0 = j - 3, wj = -3g + 13 + 8 for g. 5 Let y(d) = d2 - 10d + 20. Let b be y(10). Let u(p) = p*3 + 3p*2 - 6p - 3. Let i be u(-4). Suppose i + 1 = 3a. Solve 13 = 5w + 33, 4n = -aw - b for n. -3 Suppose -4d = 5l - 135, 0 = 4l - 8l + 3d + 139. Suppose 0 = lg - 78 + 16. Solve 4 = h, -gp + 2h + 18 = 6h for p. 1 Let w(t) be the first derivative of -6t - 1/2t2 + 6. Let f be w(-6). Solve 2l - 2g = -2, 5l + fg + 3 = 3g for l. 0 Let d = -3714 - -3726. Solve 0 = 5a - 2t + d, -5t + 5 - 33 = 2a for a. -4 Let k be -35(-3)/((-60)/(-16)). Suppose 5i = b + k, 4b - 1 = -3i + 2. Solve g = -ix - 1 - 20, -2x + 2 = 3g for x. -5 Suppose 50g - 3788 = -3688. Solve 2k = -f + 3, -57f - 4k + g = -59f for f. 1 Let w be 26/(-14 - (-192)/12). Solve -53 + 65 = -3o, 3o = 5u + w for u. -5 Suppose 684 = 3l + 4x - 406, 0 = -5l + 3x + 1807. Let v = -356 + l. Solve 26 = -4b + 3h, 4h - 33 = -b + vb for b. -5 Suppose 215g - 226g = -44. Solve -5n = -5f + 10, gf - 5n = -0f + 9 for f. 1 Let a = -263 + 292. Suppose 8u - a - 139 = 0. Solve -5t - 4b = -6t - u, -3t - 7 = 2b for t. -5	{ "pile_set_name": "DM Mathematics" }
ow many millilitres are there in twenty-five halves of a litre? 12500 What is 321058.2ml in litres? 321.0582 What is 4.329184 millimeters in micrometers? 4329.184 What is one twentieth of a millennium in decades? 5 What is 6/5 of a micrometer in nanometers? 1200 How many months are there in 74836.78 years? 898041.36 How many millilitres are there in three eighths of a litre? 375 What is 201.3065 millilitres in litres? 0.2013065 How many hours are there in one sixth of a week? 28 What is thirteen fifths of a kilometer in meters? 2600 How many litres are there in 15.36534ml? 0.01536534 How many months are there in 15/4 of a year? 45 What is 2065.077 seconds in milliseconds? 2065077 How many tonnes are there in 413045.9mg? 0.0004130459 Convert 54.31846ml to litres. 0.05431846 What is 42112.647 microseconds in hours? 0.0000116979575 How many years are there in 26/5 of a millennium? 5200 What is 31/5 of a decade in years? 62 What is 7/8 of a meter in millimeters? 875 What is eleven halves of a week in minutes? 55440 How many seconds are there in 34/5 of a hour? 24480 Convert 6030.79 microseconds to milliseconds. 6.03079 How many nanoseconds are there in 0.9928307us? 992.8307 How many kilograms are there in 31367.51 milligrams? 0.03136751 How many milligrams are there in 25/4 of a gram? 6250 What is 7.253583 weeks in microseconds? 4386966998400 What is 947083.7 weeks in microseconds? 572796221760000000 What is 865351.2mm in nanometers? 865351200000 What is nine tenths of a minute in milliseconds? 54000 How many months are there in 171.9093 decades? 20629.116 What is eleven halves of a decade in years? 55 How many grams are there in 0.8864591 micrograms? 0.0000008864591 How many millimeters are there in fourty-nine fifths of a centimeter? 98 What is 53.78543ml in litres? 0.05378543 How many millilitres are there in 17/10 of a litre? 1700 Convert 52.66341ns to minutes. 0.0000000008777235 Convert 26.6269t to milligrams. 26626900000 Convert 62.1115 micrograms to milligrams. 0.0621115 How many decades are there in 490.752 centuries? 4907.52 What is 2385.638 years in millennia? 2.385638 What is twenty-six fifths of a century in years? 520 How many nanoseconds are there in 61/4 of a microsecond? 15250 What is thirteen eighths of a micrometer in nanometers? 1625 What is 8.37201 hours in milliseconds? 30139236 How many millilitres are there in sixty-four fifths of a litre? 12800 Convert 799978.7 litres to millilitres. 799978700 What is one quarter of a gram in milligrams? 250 How many milligrams are there in 11/4 of a gram? 2750 What is twenty-seven quarters of a decade in months? 810 What is 3/50 of a kilogram in grams? 60 Convert 65.79236mm to meters. 0.06579236 What is 1113.055 litres in millilitres? 1113055 What is 11/4 of a millimeter in micrometers? 2750 Convert 0.3321613ug to tonnes. 0.0000000000003321613 How many nanoseconds are there in 812760.8 days? 70222533120000000000 What is 9.785395l in millilitres? 9785.395 What is 11/8 of a microgram in nanograms? 1375 What is one sixth of a minute in milliseconds? 10000 How many centuries are there in 325.785 years? 3.25785 Convert 23.88676 micrometers to nanometers. 23886.76 How many millilitres are there in 6/5 of a litre? 1200 What is 0.217521 litres in millilitres? 217.521 What is 229.9061 millilitres in litres? 0.2299061 What is 7/4 of a gram in milligrams? 1750 How many years are there in 3/10 of a century? 30 How many months are there in 6/5 of a century? 1440 What is 3/40 of a kilogram in grams? 75 What is 21/4 of a kilogram in grams? 5250 How many millilitres are there in twenty-nine halves of a litre? 14500 Convert 3048.588 litres to millilitres. 3048588 How many micrometers are there in 6/5 of a centimeter? 12000 Convert 0.582971ml to litres. 0.000582971 How many kilograms are there in 35.4757g? 0.0354757 How many milliseconds are there in three fifths of a second? 600 Convert 16.39494 months to decades. 0.1366245 How many millilitres are there in 11/10 of a litre? 1100 How many nanograms are there in 288.0234 micrograms? 288023.4 How many millilitres are there in 3/5 of a litre? 600 How many millennia are there in 6.082336 years? 0.006082336 What is 1/6 of a minute in seconds? 10 How many micrograms are there in 0.8388595g? 838859.5 How many millilitres are there in 5/4 of a litre? 1250 How many millilitres are there in 44162.86l? 44162860 What is 1/6 of a century in months? 200 What is three eighths of a decade in months? 45 What is 95.15111 centimeters in micrometers? 951511.1 How many milligrams are there in 7.493771 kilograms? 7493771 How many milligrams are there in 3/50 of a gram? 60 How many months are there in seven halves of a year? 42 How many millilitres are there in eleven quarters of a litre? 2750 What is 849125.6 grams in tonnes? 0.8491256 Convert 53378.21 micrometers to millimeters. 53.37821 How many centimeters are there in 1/16 of a kilometer? 6250 How many centimeters are there in 786.3253mm? 78.63253 Convert 0.6902829ng to micrograms. 0.0006902829 How many micrograms are there in 3/50 of a milligram? 60 How many millilitres are there in thirty-seven fifths of a litre? 7400 What is three eighths of a kilometer in meters? 375 How many months are there in 31/5 of a millennium? 74400 How many kilograms are there in 29/2 of a tonne? 14500 What is 7/2 of a meter in millimeters? 3500 What is 8/15 of a millennium in months? 6400 How many centimeters are there in 79645.88m? 7964588 Convert 1.626066 months to centuries. 0.001355055 How many months are there in 6/5 of a century? 1440 How many years are there in 459.8409 millennia? 459840.9 How many decades are there in 21/2 of a millennium? 1050 How many decades are there in 5037.124 centuries? 50371.24 What is 21/2 of a gram in milligrams? 10500 What is 17/6 of a hour in minutes? 170 What is sixty-four fifths of a litre in millilitres? 12800 How many micrograms are there in 2.90378mg? 2903.78 How many months are there in 3/25 of a millennium? 1440 Convert 23815.64 nanometers to centimeters. 0.002381564 What is 4394.546 millennia in centuries? 43945.46 Convert 5.873716 micrometers to nanometers. 5873.716 What is five eighths of a gram in milligrams? 625 What is 461.0965 nanoseconds in microseconds? 0.4610965 What is twenty-five halves of a milligram in micrograms? 12500 Convert 6297.99 weeks to seconds. 3809024352 What is five quarters of a litre in millilitres? 1250 What is 5913.505l in millilitres? 5913505 Convert 56.2194ml to litres. 0.0562194 How many seconds are there in 1/27 of a week? 22400 How many centuries are there in 11/2 of a millennium? 55 How many millilitres are there in 3/10 of a litre? 300 How many seconds are there in five eighths of a day? 54000 What is twenty-one fifths of a meter in centimeters? 420 Convert 20.29564 litres to millilitres. 20295.64 What is 0.0001146kg in nanograms? 114600000 What is 74.75134l in millilitres? 74751.34 How many millimeters are there in 11/8 of a meter? 1375 What is 1/16 of a meter in micrometers? 62500 How many millilitres are there in 18.83567l? 18835.67 How many tonnes are there in 4.223891kg? 0.004223891 How many millilitres are there in 71/5 of a litre? 14200 Convert 3.4007877 seconds to days. 0.00003936096875 What is 6.182287 decades in months? 741.87444 Convert 16106.82g to micrograms. 16106820000 What is three sixteenths of a century in months? 225 What is 27/4 of a litre in millilitres? 6750 How many meters are there in eleven halves of a kilometer? 5500 How many milligrams are there in six fifths of a gram? 1200 Convert 77694.19 years to centuries. 776.9419 What is 3/25 of a litre in millilitres? 120 What is 0.5731996 seconds in nanoseconds? 573199600 What is seventeen quarters of a litre in millilitres? 4250 How many millimeters are there in nine tenths of a meter? 900 What is 12907.938ms in minutes? 0.2151323 How many hours are there in 3.51381 minutes? 0.0585635 What is fifteen quarters of a meter in centimeters? 375 How many years are there in fourty-two fifths of a century? 840 What is 2.688971 kilometers in nanometers? 2688971000000 How many nanoseconds are there in 4.493238 hours? 16175656800000 How many millimeters are there in 823.9936 micrometers? 0.8239936 What	{ "pile_set_name": "DM Mathematics" }
-107418 What is 25788 + -4? 25784 Add -5 and 0.0175. -4.9825 Work out 2155 - -0.1. 2155.1 Put together 0.3 and 777824. 777824.3 What is -6772 less than -43? 6729 What is -7.4 take away -421? 413.6 Calculate -66 - 0.159. -66.159 What is -3 + -128.1? -131.1 What is -75.7 + -4? -79.7 325.5+-0.321 325.179 Calculate 7 - 183.9. -176.9 2983+-2 2981 What is the distance between -1.065 and -0.7? 0.365 Work out -4 + -278. -282 What is -151 take away 19.4? -170.4 Total of -37478 and 0.3. -37477.7 What is -0.22 minus 998? -998.22 Add together -2 and -1830. -1832 Add together -236 and 6327. 6091 Add 23 and 1961. 1984 Calculate 0.1 - 5315. -5314.9 Subtract -912 from 0.088. 912.088 What is the distance between -8 and -0.814? 7.186 Calculate -81 - -7.1. -73.9 Calculate -5 - -0.0302169. -4.9697831 What is -38.53 minus -0.4? -38.13 What is 9.36 take away 0.076? 9.284 What is 39.79 plus -0.2? 39.59 Subtract 20430 from 0.09. -20429.91 What is -5 plus 4.13091? -0.86909 What is the difference between -275 and 6.82? 281.82 What is 66 take away -923? 989 Calculate 556538 - -0.3. 556538.3 -0.5+-634 -634.5 Calculate 333904 - -2. 333906 What is -0.04238 + 2? 1.95762 What is 0.0687 - -1? 1.0687 Subtract -1176 from -0.1. 1175.9 Sum 0.31 and 1.02. 1.33 Work out -6.4 - -3.77. -2.63 What is the distance between -0.0779 and -273? 272.9221 What is 1 less than -32366? -32367 Work out -4 + 143.5. 139.5 -0.061+14058 14057.939 Add -0.03 and -2212699. -2212699.03 What is the distance between 149592 and 3? 149589 What is the distance between 2 and -2389? 2391 Calculate -3 - 30206. -30209 What is -0.26 plus -0.23? -0.49 Sum -1768.6 and 0. -1768.6 -0.1 + -1.984 -2.084 What is -0.4 plus -2370? -2370.4 Subtract 5 from -44197. -44202 What is the difference between -3 and 0.026311? 3.026311 Add together 3839.54 and 1.7. 3841.24 What is 1 minus 1088.8? -1087.8 What is -83601 + 1.5? -83599.5 What is -0.116 + -44? -44.116 Sum 2.73 and 0.0642. 2.7942 Add -5 and -2389. -2394 What is -14 plus 0.124? -13.876 -0.09 + -172 -172.09 What is -0.1 plus -0.02839? -0.12839 Add together -595261 and 2. -595259 Add 11.1 and -979. -967.9 Subtract -4059 from 0.4. 4059.4 Work out 0.3 + -9.6214. -9.3214 Total of 0.9 and -0.11634. 0.78366 Work out -90 + 6.9. -83.1 What is -0.5 plus -244.05? -244.55 Work out 1134 + 2.3. 1136.3 What is 364.5 + 1? 365.5 Subtract -47049 from -0.5. 47048.5 Total of -21 and -0.38. -21.38 Subtract 5 from -41.75. -46.75 Calculate 371 + 5. 376 Subtract 0.2 from -569492. -569492.2 Work out 298662.2 - -0.5. 298662.7 Put together -85429 and -0.3. -85429.3 What is 3 minus 1639? -1636 What is -0.2 take away 44539? -44539.2 What is 0.4 less than 0.1319? -0.2681 What is 0.4 less than 0.4889? 0.0889 Total of 82 and 25. 107 Add -46667 and 3. -46664 What is the distance between 3 and -10.7321? 13.7321 Work out -327 - -0.313. -326.687 What is -124144 - -0.1? -124143.9 What is 19 + -2? 17 Calculate -409.19 - -0.05. -409.14 Work out -0.26 - 153. -153.26 Subtract -204.4299 from -1. 203.4299 What is -550 minus -5? -545 0.0083 - 0.049 -0.0407 What is -24.9 - -0.7? -24.2 What is -10 minus 36? -46 -5 - 4016 -4021 -3.0582 + -39 -42.0582 -0.5+-84717 -84717.5 Add together -0.18 and 29.8. 29.62 Add together 35 and 158.49. 193.49 Add together 1.1 and -91. -89.9 Add together 177 and 2. 179 Add together 640 and -5247. -4607 What is 23 - 1.847? 21.153 What is 21 less than -1.76? -22.76 What is -0.147982 + -0.3? -0.447982 Total of -1.1 and -0.0346. -1.1346 What is the distance between 0.062 and -0.036879? 0.098879 72 + -32650 -32578 Total of 1.16876 and 0.3. 1.46876 -12.9+-1106.1 -1119 Work out 97 + -96. 1 Calculate -28535 + 0. -28535 What is -0.995 minus -13? 12.005 What is 708 less than 0.4? -707.6 Sum -0.3 and -54.84. -55.14 -0.65 + 143 142.35 What is -0.3 plus 154357? 154356.7 Put together 37.058 and -0.5. 36.558 What is 1.1 take away -3671? 3672.1 -66 - 11223 -11289 Work out -0.1 - -7694. 7693.9 What is -0.1 - 30064? -30064.1 Add together -0.4 and 4626. 4625.6 Put together -131 and -421. -552 Sum 0.036048 and -0.12. -0.083952 -78 - 1.6448 -79.6448 -5.92044 - 2 -7.92044 Add -3.98602 and -0.3. -4.28602 What is 0.5 take away 1159.1? -1158.6 Calculate -0.037 - 7.009. -7.046 Add -0.154 and -2. -2.154 Calculate 0.1 - -12215. 12215.1 What is -4 plus -2717? -2721 What is 1079 - 0.5? 1078.5 What is -1.2 take away -20.902? 19.702 What is 11 plus 0.0251? 11.0251 What is the difference between 3 and 191.98? 188.98 Total of -8.0143 and -0.3. -8.3143 Add 828429 and 0.5. 828429.5 Work out 80984 + -0.21. 80983.79 What is the distance between 0 and -0.066? 0.066 What is -0.13 take away 7204? -7204.13 What is 0 minus 34.6? -34.6 What is -2 take away -656.5? 654.5 Subtract 6 from -0.28. -6.28 Add 0.187 and -0.8. -0.613 Calculate -23.0324 + -0.3. -23.3324 Work out -0.2 + 11.444. 11.244 -4.01 + 0.04 -3.97 What is -15.83 plus -9.9? -25.73 Calculate -407 + -7. -414 Work out 29 + 0.0774. 29.0774 What is -1.9 less than 3.77? 5.67 What is 5 - 11.17? -6.17 What is the distance between -13.46 and 1063? 1076.46 What is the distance between 0.09054 and 2? 1.90946 Calculate -25 + -17.4. -42.4 Work out -0.055393 - -9.9. 9.844607 What is -0.2 take away -231184? 231183.8 What is -1 take away 139395? -139396 What is the difference between 894 and -0.0057? 894.0057 What is the distance between -1.15 and -0.02? 1.13 Subtract 0.6214 from 0.19. -0.4314 What is 0.02 less than -565? -565.02 What is 705 take away 7? 698 Subtract 37633 from -32. -37665 Calculate -0.2017 + -1.018. -1.2197 What is -0.39 take away 7751? -7751.39 Work out 283 + 15. 298 Work out -190 - -6. -184 What is -521 + -9? -530 What is -5119 take away -0.3? -5118.7 Total of -158.3 and -2. -160.3 Work out -12 - -0.041558. -11.958442 Subtract -6689 from -2. 6687 What is -5 - 917? -922 What is -0.4 less than -7.45? -7.05 What is 735 take away 3? 732 What is 40 take away 462? -422 Subtract 714 from -1. -715 7.089 + -19 -11.911 48 - 9630 -9582 1+-3484 -3483 What is -5.0569 + 2? -3.0569 Calculate -1212 - -0.001. -1211.999 What is the difference between -24 and 46? 70 Sum 0.1 and -331. -330.9 What is -17 less than 5115? 5132 Subtract 0.72 from 35. 34.28 What is the distance between -0.131 and -2? 1.869 Add -3 and -0.0929. -3.0929 What is 37109 plus 35? 37144 1261527 + -0.4 1261526.6 What is the distance between 0.29 and 0.64? 0.35 What is -220682 minus -2? -220680 Add 338 and -8. 330 Total of -8054 and -16. -8070 -136+4.58 -131.42 What is 1980.26 take away 0.3? 1979.96 Work out 0.05 + -670. -669.95 Work out 532 + 734. 1266 0.41+170 170.41 What is -10 - 79? -89 Subtract 4.9 from -0.059118. -4.959118 What is -2 plus -222? -224 What is -0.09 less than 34299? 34299.09 Calculate -0.4 + 1696390. 1696389.6 -32.57 + -0.03 -32.6 Add together 0.2 and -85.815. -85.615 What is -1.5 minus -21.81? 20.31 Calculate -33 - -148086. 148053 Total of 0.28 and 15168. 15168.28 What is -0.62 + -3974? -3974.62 Calculate -59109.1 - -1. -59108.1 What is the difference between -2.8 and -18856? 18853.2 0.6 - -207 207.6 What is 191640 plus -0.2? 191639.8 What is -991 minus 17.3? -1008.3 Work out -1.867 - 0.41. -2.277 What is 0.04 less than 25.939? 25.899 57 + 7.52 64.52 Subtract -0.1 from 112533. 112533.1 Sum 0.48842 and 0.1. 0.58842 34 - 12922 -12888 Total of 4636 and 1.8. 4637.8 What is -131.8 less than -0.27? 131.53 0.1 - 64426 -64425.9 Add -49 and 327. 278 Work out -46 - 0.053. -46.053 Total of 27 and 2368. 2395 Calculate 0.4 + -0.39. 0.01 Calculate -378807 + -0.1. -378807.1 Add -0.5 and 6603. 6602.5 Work out 703 + -0.04. 702.96 0.4+0.34182 0.74182 Calculate -5.1 + 3.773. -1.327 Calculate -245316 - -4. -245312 1857 + -5 1852 Calculate 0.21 - -118. 118.21 13 - 122.6 -109.6 What is -0.0791 take away -1149? 1148.9209 Add -24 and -27703.3. -27727.3 What is 29.2 + -35? -5.8 Calculate 5 + -481. -476 Add 0.9 and -40527. -40526.1 Add together 2154 and 118. 2272 Add 5 and -4.858. 0.142 Calculate -47997.1 - -4. -47993.1 Work out -0.3 - 2249724. -2249724.3 Calculate -4 + -3.381. -7.381 What is -10.01349 plus 0.5? -9.51349 233 + 0.1 233.1 What is the distance between -0.08 and -28.62? 28.54 What is -0.264 plus -3? -3.264 Calculate 0.034 + 256.21. 256.244 Subtract 58 from 2.2. -55.8 Calculate -5 + -2232. -2237 What is the	{ "pile_set_name": "DM Mathematics" }
s the b'th term of 140, 178, 230, 302, 400, 530? b3 + b2 + 28b + 110 What is the h'th term of 9, 35, 79, 141? 9h2 - h + 1 What is the l'th term of 506, 2025, 4550, 8075, 12594, 18101, 24590, 32055? -l3 + 509l2 - l - 1 What is the y'th term of 243, 244, 253, 276, 319, 388, 489, 628? y3 - 2y2 + 244 What is the w'th term of -53, -50, -45, -38? w2 - 54 What is the b'th term of -84, -174, -266, -360? -b*2 - 87b + 4 What is the f'th term of 7, -10, -45, -104, -193, -318, -485, -700? -f*3 - 3f*2 - f + 12 What is the c'th term of 49, 112, 175? 63c - 14 What is the p'th term of -62, -127, -192, -257, -322, -387? -65p + 3 What is the q'th term of 43, 377, 1287, 3061, 5987, 10353, 16447? 48q*3 - 2q - 3 What is the j'th term of 3, 4, 1, -12, -41, -92? -j*3 + 4j*2 - 4j + 4 What is the q'th term of 59, 233, 523, 929, 1451, 2089, 2843? 58q2 + 1 What is the f'th term of 463, 904, 1345, 1786? 441f + 22 What is the k'th term of 430, 430, 436, 454, 490, 550? k*3 - 3k*2 + 2k + 430 What is the r'th term of 1451, 1451, 1461, 1487, 1535, 1611, 1721, 1871? r3 - r2 - 4r + 1455 What is the s'th term of -21191, -21192, -21193, -21194, -21195, -21196? -s - 21190 What is the i'th term of -47, -46, -43, -38, -31? i2 - 2i - 46 What is the v'th term of -523, -1050, -1577? -527v + 4 What is the d'th term of -222, -452, -682, -912, -1142, -1372? -230d + 8 What is the u'th term of -25, -60, -103, -154, -213, -280? -4u2 - 23u + 2 What is the q'th term of 30, 98, 212, 372, 578, 830, 1128? 23q2 - q + 8 What is the j'th term of -131, -262, -393, -524, -655? -131j What is the d'th term of 54, 141, 272, 447, 666, 929, 1236? 22d2 + 21d + 11 What is the b'th term of 108, 218, 328, 438, 548? 110b - 2 What is the y'th term of -208, -210, -212, -214, -216? -2y - 206 What is the g'th term of -12, -85, -168, -267, -388, -537, -720, -943? -g3 + g2 - 69g + 57 What is the k'th term of 0, -7, -10, -9, -4, 5, 18? 2k*2 - 13k + 11 What is the z'th term of -70, -70, -80, -106, -154? -z3 + z2 + 4z - 74 What is the r'th term of 973, 987, 1017, 1069, 1149, 1263? r3 + 2r*2 + r + 969 What is the o'th term of -7, -36, -117, -274, -531, -912? -4o*3 - 2o*2 + 5o - 6 What is the k'th term of -24, -29, -22, 3, 52, 131, 246, 403? k*3 - 12k - 13 What is the y'th term of -73, -37, 23, 107, 215, 347? 12y2 - 85 What is the s'th term of -997, -1994, -2991, -3988, -4985? -997s What is the s'th term of -6, -34, -66, -90, -94, -66, 6? 2s3 - 14s*2 + 6 What is the o'th term of 126, 141, 180, 255, 378, 561, 816? 2o*3 + o + 123 What is the v'th term of 91, 85, 79, 73, 67? -6v + 97 What is the x'th term of -27, -61, -105, -165, -247, -357? -x3 + x2 - 30x + 3 What is the k'th term of 44, 92, 136, 176, 212? -2k*2 + 54k - 8 What is the v'th term of 4, 19, 58, 133, 256? 2v3 + v + 1 What is the n'th term of 48, 96, 144? 48n What is the a'th term of -60, -55, -24, 45, 164, 345? 2a3 + a2 - 12a - 51 What is the g'th term of -17, -13, -7, 1? g*2 + g - 19 What is the o'th term of -4442, -8881, -13320, -17759, -22198, -26637? -4439o - 3 What is the y'th term of -93, -97, -105, -117, -133, -153? -2y2 + 2y - 93 What is the f'th term of 27, 143, 351, 657, 1067, 1587, 2223? f*3 + 40f*2 - 11f - 3 What is the q'th term of 571, 1141, 1711? 570q + 1 What is the h'th term of -1, 28, 91, 194, 343, 544, 803? h3 + 11h*2 - 11h - 2 What is the g'th term of 2574, 10290, 23150, 41154? 2572g2 + 2 What is the k'th term of -60, -525, -1786, -4239, -8280, -14305, -22710, -33891? -66k*3 - 2k*2 + 3k + 5 What is the q'th term of -37, -81, -145, -235, -357, -517, -721, -975? -q*3 - 4q*2 - 25q - 7 What is the s'th term of -9, -27, -45, -63, -81, -99? -18s + 9 What is the y'th term of -9, -1, 11, 27, 47, 71, 99? 2y*2 + 2y - 13 What is the y'th term of 128, 130, 132? 2y + 126 What is the o'th term of 33, 18, -13, -66, -147, -262, -417, -618? -o3 - 2o*2 - 2o + 38 What is the f'th term of -10, -51, -156, -355, -678, -1155, -1816? -5f3 - 2f*2 - 3 What is the h'th term of -16, -66, -152, -274, -432? -18h*2 + 4h - 2 What is the m'th term of 896, 1791, 2686, 3581, 4476? 895m + 1 What is the f'th term of 1509, 3027, 4545, 6063, 7581? 1518f - 9 What is the g'th term of 1027, 2055, 3083? 1028g - 1 What is the l'th term of -290, -579, -868? -289l - 1 What is the d'th term of 11112, 11108, 11102, 11094, 11084, 11072? -d*2 - d + 11114 What is the b'th term of -12825, -12824, -12823? b - 12826 What is the b'th term of -16, -60, -184, -430, -840, -1456? -7b*3 + 2b2 - b - 10 What is the i'th term of -93, -97, -103, -111? -i2 - i - 91 What is the i'th term of -85, -83, -73, -49, -5, 65, 167, 307? i*3 - 2i2 + i - 85 What is the l'th term of 21, 21, 19, 15? -l2 + 3l + 19 What is the p'th term of -79, -80, -93, -124, -179, -264? -p3 + 6p - 84 What is the c'th term of 7403, 7401, 7399? -2c + 7405 What is the a'th term of -4, -28, -70, -136, -232, -364? -a3 - 3a*2 - 8a + 8 What is the k'th term of -23, 3, 17, 13, -15, -73, -167? -k*3 + 33k - 55 What is the h'th term of 3188, 3193, 3200, 3209? h*2 + 2h + 3185 What is the r'th term of -15, -16, -17, -18? -r - 14 What is the a'th term of -27, -242, -827, -1968, -3851? -31a3 + a2 - a + 4 What is the l'th term of 70, 260, 572, 1006, 1562? 61l*2 + 7l + 2 What is the y'th term of -327, -658, -989, -1320? -331y + 4 What is the j'th term of -407, -802, -1199, -1598, -1999, -2402, -2807? -j2 - 392j - 14 What is the v'th term of -481, -957, -1433, -1909, -2385, -2861? -476v - 5 What is the t'th term of -2786, -2792, -2808, -2840, -2894, -2976, -3092? -t3 + t2 - 2t - 2784 What is the l'th term of -111, -106, -115, -144, -199, -286, -411? -l3 - l2 + 15l - 124 What is the n'th term of -209, -347, -495, -659, -845, -1059? -n3 + n2 - 134n - 75 What is the l'th term of -162, -159, -156, -153, -150, -147? 3l - 165 What is the o'th term of -22, -12, 0, 14, 30? o2 + 7o - 30 What is the y'th term of -597, -584, -571, -558? 13y - 610 What is the y'th term of -61, -123, -185, -247, -309? -62y + 1 What is the y'th term of 589, 593, 597, 601? 4y + 585 What is the v'th term of 194, 393, 592, 791? 199v - 5 What is the v'th term of 11, -39, -113, -205, -309, -419? v*3 - 18v*2 - 3v + 31 What is the r'th term of 1225, 2453, 3681, 4909, 6137, 7365? 1228r - 3 What is the t'th term of -301, -286, -271, -256, -241? 15t - 316 What is the f'th term of -221, -219, -217, -215, -213? 2f - 223 What is the v'th term of 9, 14, 19? 5v + 4 What is the b'th term of -118, -128, -134, -136, -134, -128, -118? 2b2 - 16b - 104 What is the f'th term of -30, -29, -12, 33, 118, 255, 456, 733? 2f3 - 4f*2 - f - 27 What is the a'th term of -146, -175, -204, -233, -262, -291? -29a - 117 What is the p'th term of 1684, 3366, 5048, 6730, 8412? 1682p + 2 What is the r'th term of -10, -17, -30, -55, -98, -165, -262, -395? -r3 + 3r*2 - 9r - 3 What is the n'th term of -353, -708, -1061, -1412, -1761, -2108, -2453? n*2 - 358n + 4 What is the p'th term of 22, 53, 112, 205, 338, 517, 748, 1037? p*3 + 8p*2 + 13 What is the i'th term of 10, 30, 58, 94, 138, 190? 4i*2 + 8i - 2 What is the z'th term of -26, -26, -24, -20, -14? z*2 - 3z - 24 What is the d'th term of -1349, -1348, -1347, -1346, -1345? d - 1350 What is the f'th term of 114, 207, 282, 339, 378, 399, 402? -9f2 + 120f + 3 What is the t'th term of -20, -19, 14, 103, 272, 545, 946? 4t3 - 8t*2 - 3t - 13 What is the r'th term of -33, -36, -37, -36? r*2 - 6r - 28 What is the b'th term of 4, 22, 64, 142, 268, 454, 712, 1054? 2b3 + 4b - 2 What is the q'th term of 14111, 14112, 14113, 14114, 14115, 14116? q + 14110 What is the p'th term of 1447, 2878, 4307, 5734, 7159, 8582, 10003? -p*2 + 1434p + 14 What is the d'th term of 7, 10, 13, 16, 19, 22? 3d + 4 What is the u'th term of -40, -65, -116, -205, -344, -545, -820? -2u3 - u2 - 8u - 29 What is the r'th term of 10203, 20410, 30617, 40824, 51031? 10207r - 4 What is the m'th term of 39, 45, 51, 57? 6m + 33 What is the i'th term of -326, -342, -358? -16i - 310 What is the h'th term of -131, -530, -1195, -	{ "pile_set_name": "DM Mathematics" }
3. Let t be u(3). Let m be x(t). Suppose 3f = -mn + 3172, 2n - f = 3f + 1274. Is n prime? False Is ((-177046)/(-1))/((-46)/(-92) + 2/4) a composite number? True Let q(z) = z*3 + 21z*2 - 9z + 11. Let v be q(19). Suppose 2f - 5b = 7143, 4f - v = 3b + b. Suppose -5i + 966 = -f. Is i a prime number? True Let a(x) = -x3 - 6x*2 + 2x + 20. Let u(g) = 8g + 49. Let v be u(-7). Is a(v) composite? True Suppose a + 5y - 23 = 0, 5a - 21y + 20y = 63. Suppose 17z - az - 57092 = 0. Is z a prime number? False Suppose -4l - 3x + 14062 = 0, -49x = 4l - 45x - 14060. Suppose -21b + l = u - 16b, u + 2b - 3517 = 0. Is u a composite number? False Suppose 2b - 40737 = -0b + 5y, -2b + 3y + 40731 = 0. Suppose 22j - 25j = -b. Is j composite? True Suppose -78h + 55 = -73h. Suppose hb + 19b - 380670 = 0. Is b composite? False Let z(b) = b*2 + 9b + 23. Let l be z(-6). Suppose 0d = -4d + i + 10001, -3i + 12514 = ld. Is d prime? False Suppose 3l + 0l = -4x + 203, 5x = -5l + 255. Suppose 4t - x = 266. Suppose 4u - 1341 = t. Is u a composite number? True Suppose 5i - 3l = 52, -14i + 17i + 5l = 4. Suppose 17 = ic - 87. Suppose 0 = -3v + cv - 1630. Is v composite? False Let s(l) = l2 - 4l + 3. Let a be s(4). Suppose ad - 34 = -b, -5d = -2b - 0d + 112. Let i = 855 + b. Is i composite? True Let y(v) = -5v3 + 5v*2 + 3v. Let z be y(-1). Is (z/21)/(1/177) a prime number? True Let z = -128 - -128. Let w(b) = z - 4 + 70b2 + b + 4. Is w(1) a prime number? True Let y be 1 - -5 - -41/(-2). Suppose l - 5l = yf - 20836, 0 = -3f. Is l prime? True Suppose -21 = -7w + 4w, -w = 3m - 2752024. Is m composite? True Suppose 199c - 6953414 + 20170382 = 223c. Is c prime? False Let n(p) = 91p2 - 20p - 265. Is n(-9) composite? True Let i be 36/4 + -6 + (-9)/(-3). Suppose 0 = 4w - iw + 16602. Suppose -w = d - 4d. Is d prime? True Let l be (-2474)/(6 + -4 + -4). Let w = 124 + l. Is w a composite number? False Suppose 304n - 16863 = 311n. Suppose -4p + 4y - 4584 = 0, 5y + 2148 + 172 = -2p. Let c = p - n. Is c composite? False Suppose 0r = -r - 5, -5r + 115953 = 2z. Suppose -70931 - z = -40n. Is n prime? False Is (-21)/(-3)-1 - (-16 + -73070) a prime number? True Suppose -2i + 14 = 4d + i, 6 = 2d + i. Let u = 0 + 5. Suppose 5p - 99 + 2069 = 5w, -dp = -uw + 1961. Is w a composite number? True Let p(x) = -x2 - 7x + 8. Let l be p(-8). Suppose z - 890 = n, 10n - 8n + 2 = l. Is z prime? False Suppose -2a = -3r + 194369, 4r - 82599 = -4a + 176593. Is r a prime number? True Let k = -29 + 31. Suppose r = -2u - 2, -6 = 5u + kr - 1. Is 629 + u + 23 + -20 prime? True Let j(c) = -97c*3 + 68c*2 + 48c - 302. Is j(-25) a prime number? True Let w be (-21784)/(-40) - 6/10. Let x = w + -426. Is x a prime number? False Suppose -242888 - 416152 = -32f. Suppose -16a - f = -31a. Is a a composite number? False Is ((1/123)/1)/((-464)/(-128830528)) prime? False Let p(o) = -o*3 - 9o*2 - 15o - 1. Let t be p(-7). Suppose 7k = tk + 5. Suppose -5r + a = -6999, ka + 2403 - 6580 = -3r. Is r a composite number? False Suppose 4m + 2s - 88600 = 207988, 0 = -m - 3s + 74137. Is m composite? False Let v(k) = -k*3 + 12k*2 + 24k + 51. Let f be v(14). Is 4081 + -3 - (3 - (-15)/f) composite? True Let u be 22/187 - 49/(-17). Suppose 0 = -2d + 5d - 5h - 315, 409 = 4d - uh. Suppose -173 = -3a + d. Is a prime? False Let q = 1087839 + -46286. Is q a composite number? False Let s(a) = -a*2 - 2a + 12. Let z be s(-5). Let d be z/9 - (-1298)/6. Let v = d - 101. Is v composite? True Suppose 329u - 323u - 36 = 0. Let g(q) = 124q + 9. Let k(x) = 248x + 17. Let f(n) = -7g(n) + 4k(n). Is f(u) a composite number? True Is ((-6)/(-15) - (-12616014)/240) + 3/(-24) a prime number? True Is 21109955/41 - (-46)/943 composite? True Suppose -5x - 12 = w, -5x = -4w + 2w + 21. Let v be -1(x/(-2))/(21/56). Is v(-199)/3 + (-5)/15 prime? False Let t(x) = 381x2 - 22x + 33. Is t(2) composite? True Suppose -3l + 7211 = -10528. Suppose -5g + k = -29565, -g = -0g - k - l. Suppose g = 6u - 2469. Is u prime? False Let i = -491 - -532. Suppose 12516 = 3k - 3n, ik + 16683 = 45k - 5n. Is k a prime number? True Let c(j) = -8116j + 2137. Is c(-16) a prime number? False Let i(b) = 12b - 7. Let v be i(1). Suppose 0 = 2q - 3z - 14332, 6q + vz = q + 35830. Is q a prime number? False Let v(d) = 29d - 143. Let w be v(5). Suppose 3a + h - 128379 = 0, 128379 = 3a - wh - 2h. Is a prime? True Suppose -3g - 4n + 251709 = 0, 2n = -2n. Is g prime? True Suppose -4f - 2u + 134 = 0, -3 = 3f - 4u - 87. Is (-211761)/(-12) + 8/f a prime number? False Suppose 41j - 19526983 = -3j - 35j. Is j composite? True Suppose 32s - 18s = 341796 + 321398. Is s prime? False Let o = -31 + 33. Suppose x + x + 3a - 1572 = 0, -ox + a + 1564 = 0. Suppose -4r + 3925 = -x. Is r composite? True Let u(n) = 2 + 218n - 168n - 4n3 - 15n*2 + 13 - 2. Is u(-14) composite? False Is 2252371(-174)/(-522) a prime number? True Suppose -9m + 6m = v + 7720, -10 = -2m. Let z = 1744 - v. Is z a composite number? False Let i(n) = -n*3 - 4n*2 + 9n - 35. Suppose -180 = 16y - 4y. Is i(y) composite? True Let v(u) = 5u3 - 7u*3 - 9 + 3u3 - u2 + 5u. Suppose -13 = -2z + 3c - 1, 0 = c. Is v(z) prime? False Suppose -2u = 5z - 2653824, -2 = 86z - 85z. Is u prime? True Is (10 - 12) + 72934/448 + 1 a prime number? False Let f = -63 - -73. Is (40086 - -4)/55/f a prime number? False Let w(z) = 506z + 100. Let u be w(10). Let i = u + -3503. Is i a composite number? False Suppose -8l - 1895 + 775 = 0. Let n = l + 119. Is (-7)/n - 2588/(-3) composite? False Suppose 2j - 172 = -74. Is j a composite number? True Suppose -37493277 - 11514578 = -65o. Is o a composite number? True Suppose 3m - 21 - 45 = 0. Suppose 2r - 6 = -0, -5v - r - m = 0. Is (-1)/v + (-1 - (-639)/5) prime? True Suppose 5 = -3v + 5u, -v = -u + 4 - 5. Suppose 221 - 4606 = -vi. Is i composite? False Let o(j) = 96j - 5. Let p(n) = 1 + 25 + 1 - 1 - 481n. Let t(u) = -11o(u) - 2p(u). Is t(-5) a prime number? False Let c be 610212/(-30)5. Let j = 5829 + c. Is j a composite number? False Let r be (4 + 2)/2352/(-3). Let y be 64/r - 55488/(-22). Let s = y - 563. Is s a prime number? False Suppose 5t + 4g = 8, 10 = -6t + 10t + 2g. Suppose -2u + 42 = u. Suppose -tb = -ub + 12110. Is b a composite number? True Let s(o) = o3 - 19o*2 + o - 18. Let d be s(19). Is (-3 + d/1)1471/(-2) prime? True Suppose 0w = 7w. Suppose w = -3t + 13t - 19600. Suppose t = 7j - 679. Is j prime? False Is (-30136824)/(-89) - 1(-2 - -9) prime? True Suppose 0 = -29r + 18r. Suppose 10x - 10162 - 2008 = r. Is x prime? True Let p(c) = -4c + 41. Let s be p(9). Suppose -26 = -2y - 4o - 0o, -26 = -2y - so. Suppose -14v = -yv - 1255. Is v prime? False Let w be (-51 + 52)/(((-1)/2)/1). Is 27138 - 2 - (w + -1) prime? False Let i be ((42/7)/12)/(1/54). Let l(m) = m3 - 24m*2 - 13m - 1. Is l(i) composite? True Let q(f) = 2f2 - 15f + 9. Let z be q(7). Suppose -4l + zl + 5105 = -j, -4j - 10212 = -4l. Suppose l + 1663 = 5i. Is i composite? True Let k = 97 + -70. Let z = k - 25. Is (1/z)/(1/4) + 1397 prime? True Suppose -494 = -16z + 18z. Let r = -60 - z. Is r a composite number? True Suppose -s + 5i + 183513 = 0, s - 80i - 183495 = -84i. Is s a prime number? True Suppose -10 = 4n - 6n, -3n + 1966044 = 3y. Is y a composite number? True Suppose 32i + 44511 = 4q + 35i, -i + 1 = 0. Is q prime? False Let y(i) = -13i*2 - 4i - 11. Let l(a) = -7a2 - 2a - 6. Let v(f) = 5l(f) - 3y(f). Suppose h + 17h = -126. Is v(h) prime? False Let g = -49741 + 87224. Is g prime? True Let p(m) be the third derivative of -28m*4 - 79m*3/6 - 115m*2. Is p(-9) composite? True Let i(o) = -9 - 17 - 26o + 17 - o*2. Let f be i(-25). Is (0 - f/4) + (-1102)/(-2) a prime number? True Suppose 15459211 + 32756234 - 14604839 = 86n. Is n prime? True Suppose -4w + 4l + 23040 = 0, 3l - 4850 = 2w - 16367. Let g = -4002 + w. Is g prime? False Let v = 0 + -4. Let s(p) = 300p2 - 11p + 3. Let o(y) = 4y. Let w(d) = 4o(d) + s(d). Is w(v) a prime numbe	{ "pile_set_name": "DM Mathematics" }
-1.16 (b) 0.2 (c) -2/15 (d) -3/2 d What is the closest to 0.613 in 1/2, 5, 2/15? 1/2 What is the closest to -1/5 in 5, -0.4, 12, -5/7, -1? -0.4 Which is the nearest to -1? (a) -0.725 (b) 4 (c) 1 a Which is the closest to 2.7? (a) 0.05 (b) 4/7 (c) -1 (d) 5 (e) -5 b Which is the closest to -2/13? (a) -2/17 (b) 4/5 (c) -146 (d) -0.05 a What is the nearest to -2/9 in -2/7, 2/11, -21? -2/7 Which is the closest to -0.079? (a) 2/17 (b) 2.5 (c) 5 a What is the closest to 3 in 3/4, -1, -479, -0.7? 3/4 Which is the closest to 0.1? (a) 0.3 (b) -38 (c) 1/4 (d) -20 (e) -0.2 c What is the nearest to 1 in 2.8, -0.4, -92, -18? -0.4 Which is the nearest to 2/3? (a) -1 (b) 0.2 (c) 3470 b What is the nearest to 2 in 70, 4, 24, 2/11? 2/11 Which is the closest to -0.1? (a) 7 (b) 3 (c) -6.8 (d) 0.4 d What is the nearest to 1 in -5, -2, 1.3, 2? 1.3 Which is the closest to 0? (a) 5 (b) 2 (c) -10 b What is the closest to 2/7 in 2/3, 16, 485/6, 0.5, -0.1? 0.5 What is the nearest to -25 in -5, -0.34, -25? -25 What is the nearest to 13 in -1, -5/6, -0.034, -5, -2/7? -0.034 What is the nearest to -17546 in -4, 2/7, 5/2? -4 What is the closest to 1/2 in -583, 3/331, 2? 3/331 What is the closest to -1 in -4, 503, 3? -4 Which is the closest to 1? (a) -1/12 (b) -0.1 (c) -0.3 (d) 0.14 (e) 9 d What is the nearest to -0.0762 in 0.014, -0.1, 0, 2/5? -0.1 What is the closest to 4/5 in 2, -336, -0.3? -0.3 What is the nearest to 0.1 in -4, -2/9, 2.42222, -0.4? -2/9 What is the nearest to 34 in -2/5, -0.19, -4, 0.08? 0.08 What is the nearest to 15 in -9, 156, -6? -6 What is the closest to -16 in -1, -3, -4? -4 Which is the nearest to -26? (a) 49 (b) 0.56 (c) 5 b What is the closest to 217 in -0.2, 2.3, -1? 2.3 What is the nearest to -2 in 2/3, -1/5, -4, 60? -1/5 What is the closest to -2 in 2/13, -0.5, 0.3, 0.01, -433? -0.5 Which is the closest to -0.1? (a) -3/7 (b) -1/3 (c) 4 (d) 104 b What is the nearest to -2.62 in -2/3, 1/14, -10/11? -10/11 What is the nearest to 0.1 in -9.99, -2, -1/65, 0, 1? 0 Which is the nearest to -6/35? (a) -1 (b) -7 (c) -4 a What is the closest to -4 in 1/2, 1/3, 0.655? 1/3 Which is the nearest to 1? (a) -0.3 (b) -5 (c) 1/232 (d) -2 (e) 0.1 e What is the nearest to 42 in -0.06, -0.1, 7, -1/4? 7 What is the closest to 0.1 in 3, -1554, 3/2? 3/2 Which is the nearest to 0? (a) -1 (b) 0.1 (c) 0.6 (d) -15 b What is the closest to -0.1 in 4/7, 1/16, 1? 1/16 What is the nearest to 0.1 in 2/7, -0.5, -3, -1/3, -1360? 2/7 Which is the nearest to -8/3? (a) -0.5 (b) -2/11 (c) -5.2 (d) -58 a Which is the nearest to -5? (a) 0 (b) 0.27 (c) -0.243 c What is the closest to 3 in 0.7, -0.4, 0.3, -19? 0.7 Which is the nearest to -22? (a) 1083/4 (b) -5 (c) -4 b Which is the nearest to -0.1? (a) -0.3 (b) -0.22 (c) 2/3 (d) 45 (e) 5 b Which is the closest to -2/13? (a) -2 (b) 3 (c) 85 a What is the nearest to 2 in 51, -152/5, -1.2? -1.2 What is the nearest to -0.1 in -66, -2/15, -1.3, -0.3, -5? -2/15 What is the nearest to 1.091 in -5, 16, -4? -4 Which is the nearest to 344? (a) 0.2 (b) 580 (c) 0.1 b Which is the nearest to 6? (a) 1/559 (b) -4 (c) -0.1 a Which is the nearest to -2/7? (a) 5 (b) 18 (c) -1 (d) 15 c Which is the closest to -0.1? (a) 4 (b) 1/21 (c) -5 (d) 98 (e) 1/2 b What is the nearest to -2/3 in 1/7, 0.1, -2/5, -18, 0.18? -2/5 Which is the nearest to 1/2? (a) -0.06 (b) 30.7 (c) 2/7 (d) -9 c What is the closest to -2 in -3, 3.32, -0.2? -3 Which is the closest to 1/4? (a) -232 (b) 1410 (c) -4 c Which is the nearest to 1? (a) -44 (b) -1.2 (c) -0.04 (d) -0.3 c Which is the closest to -1? (a) 1497 (b) 0 (c) 0.1065 b What is the closest to -4 in 52, -0.24, -0.4, 3? -0.4 What is the closest to 3/4 in -2/7, 0.317, -9/7, -1? 0.317 Which is the closest to -3/2? (a) 0.4 (b) 6 (c) 449 (d) -3 (e) -5 d What is the nearest to 587.3 in 4, 0, 8/13? 4 What is the nearest to 0.13 in -1/8, -5, -3, 91, -4? -1/8 What is the closest to -0.1 in 0.06, -1, -1352? 0.06 What is the closest to -11 in 1/8, 4, 98, -0.01, -2? -2 What is the nearest to 0.3 in -3907, -5, 1, 0.5? 0.5 Which is the nearest to 0? (a) 1/4 (b) 1/3 (c) -90 (d) -11 (e) 0.4 a What is the closest to -4/11 in -28, -0.2, 10? -0.2 Which is the nearest to 2? (a) 0 (b) 5 (c) 1 (d) -1/2 (e) -17 c What is the closest to -1 in -427, -1/3, 3, -1? -1 What is the nearest to 2/105 in 3/8, 0, 49, 3/4, -0.3? 0 Which is the closest to 3/31? (a) 0.7 (b) 4.14 (c) 1 a What is the nearest to 0.1 in -4, 2, -5? 2 Which is the closest to -11? (a) -1/3 (b) -1/7 (c) -0.3 (d) 0.4 (e) -2/7 a Which is the nearest to 1/19147? (a) -4 (b) -0.5 (c) 3 (d) -5 (e) 2/11 e What is the nearest to -1 in -4, -0.4, -1/4, 6/25, 0? -0.4 What is the nearest to -11 in 19/5, -1/2, 0.1, 3? -1/2 Which is the closest to -2.1? (a) -0.4 (b) 0.1 (c) 1/3 (d) -2/175 (e) 5 a Which is the closest to -1/2? (a) 0.2 (b) -0.12 (c) -2 (d) -4219 b Which is the closest to -5/6? (a) 11/45 (b) 0 (c) -0.3 (d) -5 c Which is the closest to 64? (a) -2 (b) -5 (c) 2/7 (d) -1/3 c Which is the nearest to -1/78? (a) -3 (b) -0.5 (c) -0.14 c What is the closest to -0.1 in 1, -4, 3, 0.71201? 0.71201 What is the closest to -1 in 0.01, -1/48, 14, 1.3? -1/48 Which is the closest to -2? (a) -4/5 (b) 0.17 (c) -34 a Which is the closest to 0.1? (a) -0.9 (b) 64 (c) -4 (d) 2 a Which is the closest to -229? (a) -5 (b) 0.4 (c) 0.3 (d) -23 d What is the closest to 13.4 in -1/4, 1/4, -467, 5? 5 What is the nearest to 1/2385 in -1/5, 0, 1? 0 Which is the nearest to 0.1? (a) 0.149 (b) -4 (c) 0 (d) 0.5 a What is the nearest to 93 in 0.3, 2, 2/9, -4, -1/9? 2 What is the closest to -0.3 in -0.1, -4, 18349, 3? -0.1 What is the closest to 1 in -456, 0.5, -0.4? 0.5 Which is the closest to 0.2? (a) 3 (b) -0.02 (c) -49 b Which is the closest to 1/4? (a) 121/38 (b) -0.5 (c) -4 b Which is the closest to 120? (a) 4 (b) -5 (c) 0.3 (d) 996 a Which is the nearest to -15? (a) -6/5 (b) -1 (c) 2 (d) 4 (e) -1/3 a What is the nearest to -8 in -3, -0.046, 0? -3 What is the nearest to -0.1 in 185, 2/5, -4, 2/31? 2/31 What is the nearest to 1/3 in -51, 0.5, 3/31, -0.05? 0.5 Which is the nearest to 0.29? (a) 29 (b) 0.3 (c) 0 (d) 11 (e) 4/5 b What is the closest to -2/11 in -19, -117/14, 2/7? 2/7 Which is the closest to -5? (a) -2/7 (b) -4 (c) -176/5 b What is the nearest to -32 in 3/4, -111, -3/4? -3/4 What is the closest to 6/11 in -1/3, 0.04, 4, 1/3? 1/3 What is the closest to 0 in 44, 581, -5/2? -5/2 Which is the nearest to -5? (a) 33.1 (b) 2 (c) 3/2 (d) -1 (e) 0.1 d Which is the closest to 1/2? (a) 0 (b) -6.95 (c) -0.4 (d) -1/6 a What is the closest to -6 in -4, 0.65, 0.018, -2/13? -4 What is the nearest to 15/4 in 1/2, 0.4, 13, -2, 2/9? 1/2 What is the closest to 0.05 in 421.3, 5, -1/9? -1/9 Which is the nearest to 2/3? (a) -1.3 (b) 0.4 (c) -2 (d) -7 b Which is the closest to 0? (a) -0.4 (b) 0 (c) -95 (d) -0.59 (e) -1 b What is the closest to -1/4 in -2/7, 5, -3.3, 7/106? -2/7 What is the nearest to 1 in 0.103, 4, -9/2, 0.3? 0.3 What is the closest to 4.7 in -0.5, 4, 4/3, 1/2? 4 Which is the closest to 1.36? (a) 11 (b) 0 (c) -28 b What is the nearest to 3 in -1043, -38, -3? -3 What is the closest to 149 in -0.2, -3/7, 0.5, -2/17, -4/5? 0.5 Which is the closest to -794? (a) -4 (b) 1/2 (c) -2 (d) -1 a What is the closest to -0.3 in -2, 3, 1/4, 995? 1/4 What is the nearest to 2/7 in -2, -0.1, -2/9, 954/13, -4/5? -0.1 What is the closest to 328 in 4/3, 0, 0.08, -3/19? 4/3 What is the closest to -34 in 2/9, -0.1, 1.316? -0.1 What is the nearest to 1/4 in -5, -1, -4/3, -7/212? -7/212 Which is the nearest to 87? (a) -27.9 (b) 2/7 (c) -15 (d) 1/5 b Which is the closest to 3? (a) 1/3 (b) 22 (c) -0.264 (d) -0.5 a What is the nearest to 1 in 3, 1, -8, -0.519? 1 Which is the nearest to -0.01706? (a) 9 (b) 0.5 (c) 5/6 (d) 1 b Which is the closest to -21374? (a) 4 (b) -3 (c) -4 (d) 0 c What is the closest to 30/7 in 0.5, -2, 103? 0.5 What is the nearest to -1/6 in -3, 2/385, -3/4, -5? 2/385 What is the nearest to -5/64 in -5, 2, 5? 2 Which is the closest to 0.1? (a) -156 (b) 88 (c) -1/4 (d) 0.2 (e) -5/2 d Whi	{ "pile_set_name": "DM Mathematics" }
70. Let d be 1 - (-95 - 0) - 1. Let s = d - h. What is the units digit of s? 5 Let r be 2993/7 - 33/(-77). Let i = -176 + r. What is the units digit of i? 2 Let w(k) = k*2 - 7k + 15. Let b be w(5). Suppose -1205 + 255 = -ba. What is the units digit of a? 0 Let y(u) = -10u*2 + u - 13. Let n be y(-4). Let v = 349 + n. Suppose -2z = -46 - v. What is the units digit of z? 9 Let j(m) = -74m3 + m2 + 2m + 2. Let l be j(-2). Suppose -26f - 770 = -2x - 22f, 0 = -2x - 4f + 722. Let w = l - x. What is the units digit of w? 1 Let o(t) = -3t*2 + 2t + 1362. Let w be o(0). Let m = w + -931. What is the tens digit of m? 3 Let g(c) = 10c2 + 8 - 8 - 6 - 4c*3 + 3c*3 + 18c. What is the units digit of g(10)? 4 Let c(l) = -9l3 - 7l*2 - 13l - 7. Let j be c(-5). Let v = j + -541. What is the tens digit of v? 6 Let y be (4 - (-84)/(-2))/(6/(-3)). Let x be (1 + (2 - 2))/(1/y). What is the tens digit of x + -5 + 1 + 1? 1 Suppose 17j + 129j = 4195164. What is the units digit of j? 4 Suppose 5z = -5c + 35280, -3c - 2c + 28229 = 4z. What is the hundreds digit of z? 0 Suppose -19 = -p - 3. Let m = p - 9. Let j(r) = 13r + 23. What is the hundreds digit of j(m)? 1 Suppose -61 = -m + 4q, -6q + 205 = 5m - q. Suppose 2n = -3h + 1059, -3h + 50n = mn - 1038. What is the hundreds digit of h? 3 Let m(r) = -r*3 + 6r*2 + 4r + 9. Let k be m(7). Let u = k - -11. What is the tens digit of 6/(-10) + u398/(-5)? 7 Suppose 0 = -5q - 0q + 55. Let s = 19877 + -19439. Suppose -qw = -9w - s. What is the units digit of w? 9 Suppose -50i + 69112 + 18538 = 0. What is the units digit of i? 3 Let l be (-3)/(-9) + 1/(-3). Let z be (l - (0 + 3)/3) + -19. What is the units digit of 6/(-5) + 1 - 2384/z? 9 Let g be (4/12)/(-3 + 82/27). Let o be (-6)/g + 608/(-6). What is the units digit of (1 + -10)(-7)/((-63)/o)? 2 Suppose 0 = -4f - 3r + 1040, -5f + 3r = -r - 1300. Let u = 211 + f. What is the hundreds digit of u? 4 Let l(g) be the second derivative of -g4/12 + 7g*3/3 - 27g*2/2 - 25g. Let u be l(11). What is the tens digit of (33/(-22))/(u/(-140))? 3 Let o(q) be the second derivative of q*4/2 + 37q*3/6 + 33q*2/2 - q - 1. What is the hundreds digit of o(-10)? 2 What is the hundreds digit of (2675 - 5)1/2? 3 Let x = 35 + -36. What is the units digit of ((-279)/3 - 0/(-10))x? 3 Suppose -3j - 40b + 42b = -9634, -4b = 3j - 9640. What is the thousands digit of j? 3 Let p(l) be the first derivative of 3l2/2 + 13l - 16. Let h be p(-3). Suppose hv + 5m - 366 - 39 = 0, -v + 4m = -96. What is the units digit of v? 0 Let w = -8 + 10. Let g be (w + -1)-11 + 187. Suppose 0 = 5t - 24 - g. What is the units digit of t? 2 Suppose 0 = -3g + 7 - 10. Let w be (5 - (-3)/g) + -100. Let f = w - -143. What is the units digit of f? 5 Let m = 234 + -230. Suppose 5y - 3y + 2x - 602 = 0, 606 = 2y + mx. What is the tens digit of y? 9 Let z = 8351 - 1933. What is the tens digit of z? 1 Suppose 1446128 = 610z - 476z. What is the ten thousands digit of z? 1 Let m(f) = -f*2 - 16f - 13. Let i be m(-15). Suppose -4o - ip + 864 = 0, 0p - 4p = 2o - 432. What is the hundreds digit of o? 2 Suppose 2x - 3u - 26 = 0, 2x - 5x = 3u - 24. Suppose x = -5v, 0 = -3d + 5v - 36 + 646. What is the hundreds digit of d? 2 Let w be (-8)/20-15 + 2284. Suppose -5d + w = -m - 2m, 0 = 5d - 5m - 2280. What is the tens digit of d? 6 Let f = 3972 - -1874. What is the hundreds digit of f? 8 Suppose -5o + 31 = 4b - 25, b - 29 = -5o. Let y be (6/b)/((-8)/1164). Let r = -20 - y. What is the tens digit of r? 7 Let w = 168 - 163. What is the units digit of ((-1838)/(-10) - -7)w? 4 Suppose -17a + 7a = -100. Suppose 0 = -al - 0l + 30. Suppose -lb - 274 = -v, 0 = 2b + 2 - 12. What is the hundreds digit of v? 2 Let u = 32881 - 12533. What is the tens digit of u? 4 Suppose 256h + 40800 = 262h. What is the units digit of h? 0 Suppose -a - 19594 = -3m, -m + 6532 = 11a - 12a. What is the units digit of m? 1 Suppose 0 = -5h + 9h + 3o - 47414, 0 = 2o - 4. What is the hundreds digit of h? 8 Let c = -3 + 5. Let r(a) = 8a*2 - 419a + 159. Let o be r(52). Suppose 9 = 3p + o, 0 = -q + cp + 42. What is the tens digit of q? 4 Let q = 166 - 162. Suppose -5v + 607 = -3f + 1899, -qf = -2v - 1718. What is the hundreds digit of f? 4 Let h be (-11)/(330/(-36))20 + -3. What is the hundreds digit of (-3)/(-9) - (-10073)/h? 4 What is the tens digit of (0 - -2)(-17)/((-136)/62844)? 1 Suppose 93y - 90y = -54. What is the units digit of (2 + y/4)(-28)/35? 2 What is the thousands digit of -1(20/((-20)/3))/((-9)/(-186033))? 2 Let a be (-2 + 1)/(11/(-2233)). Let j = a + 38. What is the units digit of j? 1 Suppose 220t = 119t - 162t + 4458639. What is the thousands digit of t? 6 Let x(c) = c2 - 20c - 19. Suppose -7d + 105 = -2d. Let p be x(d). Suppose pn - 44 = -3g + 7n, -12 = 3n. What is the units digit of g? 8 Suppose -4d + 423 = -2o - 3d, 0 = -2d + 6. Let s = o + 134. What is the tens digit of (1/(-2))/(1/s)? 3 Let j = -1 - -3. Suppose -38520 = -68c - 4c. Suppose -4l + 5v = -c, -420 - 270 = -5l + jv. What is the hundreds digit of l? 1 Suppose -5 = -2h + t, -2h + 4t - 9 = -5. Suppose 376 + 742 = hj + 2g, 0 = 4j + g - 1117. What is the tens digit of j? 7 Suppose 0z - 348 = -4v + 4z, 5v = 2z + 441. Suppose 3q + 9 = 5p - 1, 0 = -5q + 25. Suppose -v = -pg + 46. What is the units digit of g? 7 Let c(t) = t + 5. Let a be c(-2). Let z be 4/(-10) - (96/(-5))/a. Let r = 88 - z. What is the tens digit of r? 8 Let b = 790 - 788. Let n be -259(-2 - (-4)/4). Suppose -351 = -3a + 3w, -ba + 2w = 5w - n. What is the units digit of a? 2 Let m = -61994 - -91891. What is the tens digit of m? 9 Let o = -42325 + 65087. What is the thousands digit of o? 2 Suppose 82946 = 4o + 2p, 0o + 4p + 20732 = o. What is the ten thousands digit of o? 2 Let d be (36/20 + 1)/((-6)/(-75)). Suppose 2w = 855 + d. What is the hundreds digit of w? 4 Let i = -45 + 40. Let d be 0 - (1 + 2 + i). Suppose 0 = -dy - 3y + 1185. What is the tens digit of y? 3 Suppose 0 = -2z - 14 + 36. Let x = z - -97. What is the units digit of x? 8 Let r be (33/6)/(1/832-2). What is the tens digit of 56/72 - 1 - r/9? 5 Let i(c) = 610c2 + 194c + 21. What is the ten thousands digit of i(-6)? 2 Let n(i) = i*3 + 5i*2 + 3i - 1. Let k be n(-3). Let x(y) = -ky - 4 + 3y + 3y - 17. What is the units digit of x(-14)? 7 What is the tens digit of -6 + 57657/12 - (-8)/32? 9 Suppose 6638 = 2r + 2j, -2j - 7286 = -5r + 9281. What is the units digit of r? 5 Let q(w) be the third derivative of -17w*4/6 - 23w*3/2 - 123w*2 + 2w. What is the tens digit of q(-6)? 3 Let p(i) = -53i2 - 13i + 42. Let m(b) = b*2 - b + 2. Let t(g) = 2m(g) - p(g). What is the hundreds digit of t(3)? 4 Let k = -16181 + 66580. What is the thousands digit of k? 0 Let h = 4767 - 1824. Suppose -15g + 9657 + h = 0. What is the units digit of g? 0 What is the hundreds digit of (32614/3)/((-104)/(-156))? 3 Let l = -225 + 228. Suppose -2o + 7o = x - 404, lx + 3o - 1194 = 0. What is the hundreds digit of x? 3 Suppose -s + 5918 = 22z - 21z, 2z - 5s - 11815 = 0. What is the hundreds digit of z? 9 Let u = 22279 + -14424. What is the hundreds digit of u? 8 What is the thousands digit of (3971/418 - 91)/(1/46232)? 3 Let k(q) be the first derivative of -2q3/3 - 35q*2 - 43q - 71. What is the units digit of k(-22)? 9 Let r = 45 + -43. Suppose -4s - 18 = -r, -5s - 14 = 2m. Suppose -m = -3h, 2f + 4h - 32 = f. What is the units digit of f? 8 Suppose 68k + 1161992 = 107k + 65k. What is the units digit of k? 3 Suppose -2s = 4k - 8, 4k + 3 = 4s + 11. Suppose s = -14x - 644 + 1708. What is the tens digit of x? 7 Let d(r) = -r*3 + 4r*2 + 5r - 18. Let b be d(4). Suppose -j + 887 = k - 5j, 0 = -bk + 4j + 1786. What is the hundreds digit of k? 8 Let p(i) = 16i + 10. Let w be p(-4). Let s(f) = 35f2 - 2f. Let n be s(-2). Let x = n + w. What is the tens digit of x? 9 Let w(s) be the third derivative of s*5/20 + 3s4/2 + s3/2 + 3s2 + 17s. What is the tens digit of w(7)? 0 Let c be -489(-3)/63 + (-12)/42. Suppose 1711 = cs + 446. What is the units digit	{ "pile_set_name": "DM Mathematics" }
o - 4 Find the first derivative of -1368 + 0p + 2p - 2p - 1740p*2 - 54p*2 wrt p. -3588p Let g(r) = 28 - 2r2 + 3r*3 - 26 + 183 + 3r*3 + 22r. Let j(z) = -2z3 + z2 - 8z - 62. Let h(t) = -4g(t) - 11j(t). Differentiate h(a) wrt a. -6a2 - 6a Let x = -58 - -50. Let o(t) = t*2 - 46t - 47. Let c(m) = -2m2 + 137m + 142. Let i(s) = xo(s) - 3c(s). Differentiate i(d) wrt d. -4d - 43 Differentiate -f2 - 319 + 443f - 121 + 154 with respect to f. -2f + 443 Suppose -7i = -0i - 12i. Suppose -b - 2o + 22 = 3o, -5b + 3o - 2 = i. Find the first derivative of -2kb - 4 + 2k*2 - 5k*3 - 2 wrt k. -15k*2 Suppose 6 = -31w + 130. Differentiate 0 - 2n - 7n*w + n + 151 + 0n wrt n. -28n3 - 1 Suppose -270 = -64g - 78. Let c be (-1 + -1 + 5)3. What is the second derivative of 17t - ct - gt*3 + 9t + 24t3 wrt t? 126t Let u(z) be the first derivative of 9z3 - 15z*3 + 5z*3 - 47z - 45 - 33z2 + 27z*2. Differentiate u(a) with respect to a. -6a - 12 Let d(u) be the second derivative of -29u6/30 + 7u*3/6 + 1043u*2/2 - 984u. Differentiate d(k) with respect to k. -116k3 + 7 Let y(h) = -6h + 6. Let w be y(-2). Suppose t = 4v + 14 + 10, 2t - 2v - w = 0. Find the third derivative of 2 + f2 - 18f*2 + 5f*t - 2 wrt f. 120f Let t(g) = 26g2 + 29g + 2617. Let c(f) = 13f2 + 12f + 1308. Let r(b) = -5c(b) + 2t(b). Differentiate r(x) with respect to x. -26x - 2 Find the second derivative of -374 + 745 + 1577z + 3z2 - 370 + 131z3 + z2 wrt z. 786z + 8 Suppose 5v = -2y + 6, y + v - 3v - 3 = 0. Find the third derivative of 142my + 7m*2 + 10 - 11m*2 - 31 + 7m*2 wrt m. 852 Suppose 0 = 5j + 3g - 25, -2g = 5j - 2j - 15. Let w be (6 - (-18)/(-6)) + 24/2. What is the second derivative of 2p - wp*j + p - 4p wrt p? -300p3 Let c = 51 - 7. Let w = -40 + c. Differentiate -14 + 7 - wq - 10q with respect to q. -14 Suppose -6j + 4j + 3149 = -5l, j - 1552 = -2l. Suppose 30 = 3x - 4m, 36x - 27 = 31x - m. What is the first derivative of jq - 1523q - x + 1 wrt q? 39 Find the third derivative of 40j*5 - 6j*3 + 2j*4 + 11j*3 - 2j*2 - 3559 - 6j*3 wrt j. 2400j*2 + 48j - 6 Let w = 1910 - 1225. What is the first derivative of 38r2 + 663 + w - 1441 + 73r*2 wrt r? 222r Let b(g) be the first derivative of 0g - 15/2g*4 + 0g*2 - 2 - 34/3g*3. What is the third derivative of b(d) wrt d? -180 Let h(n) be the third derivative of -23n8/840 - n4/6 - 41n3/6 - 5n*2 - 3. Let p(f) be the first derivative of h(f). Differentiate p(o) wrt o. -184o*3 Suppose -3h = 5h - 16. Let y(a) = a3 - 2a*2 + 2a - 2. Let g be y(h). Find the third derivative of -3wg + 4w*2 - 2 - 5w*3 + 2 wrt w. -30 Let w = -52 - -57. Let h(x) = 2x - 9. Let m be h(6). What is the second derivative of -3 + m - 9p + p - wp*2 wrt p? -10 What is the third derivative of -479q*2 + 215976q*3 - 215976q*3 + 145q*4 + 1 - 1 wrt q? 3480q Let d(g) be the second derivative of 1 + 0g6 + 1/6g3 + g2 + 139/42g7 + 0g*5 + 0g*4 + 11g. What is the second derivative of d(t) wrt t? 2780t3 Let h be (-20)/70 - 5/((-70)/354). What is the derivative of -5x + hx + 49 - 3x - 9x wrt x? 8 Let f be 18733/4290 + (-3)/(-10). Let j(d) be the second derivative of -19/12d*4 + 0d*2 + 0 + fd*3 - 40d. Find the second derivative of j(v) wrt v. -38 Let o(m) be the second derivative of -2137m5/20 + m4/12 - 617m*3/6 - 1203m - 1. What is the second derivative of o(n) wrt n? -12822n + 2 Let l(z) = -z3 - z2 + 4z. Let f(y) = 767y3 + 6y*2 - 24y + 1694. Let x(h) = -f(h) - 6l(h). Find the first derivative of x(r) wrt r. -2283r*2 Suppose -4h - 5d + 13 = -4d, -d = -h + 7. Find the second derivative of -37 - ho3 - 23o + 41o - 33o*2 + 37 + 72o wrt o. -24o - 66 Let m(g) be the first derivative of -491g*3 - 28g*2 - 16g - 3084. What is the second derivative of m(r) wrt r? -2946 Let a(l) be the first derivative of -763l5/5 - l3/3 + 185l*2/2 - 299. What is the third derivative of a(v) wrt v? -18312v Let o = -152/5 - -947/30. Let h(n) be the second derivative of 0n4 + 0n*2 + 0 - 15n + on3 + 3/4n*5. Find the second derivative of h(g) wrt g. 90g What is the derivative of 207x - 63x*3 - 415x + 648 + 204x - 16x*3 wrt x? -237x*2 - 4 Let c(o) be the third derivative of -317o5/30 - o4/24 - 77o3/2 - 11o*2 - 53o. What is the second derivative of c(l) wrt l? -1268 Suppose -3q + 4r = -19, -q - 2r + 13 = -0q. Suppose 2b + b = q. Find the third derivative of bx*2 + 0x*2 - 5x*3 + 4x*2 wrt x. -30 Let g(t) be the first derivative of 320t*5 - 86t*3 - 5t*2/2 - 425. What is the third derivative of g(u) wrt u? 38400u Let u(w) be the third derivative of -827w5/30 + 103w*4/24 + 11w*3/6 - 123w*2. Find the second derivative of u(l) wrt l. -3308 Let r(p) = -2p*2 - 12p - 1. Let a be r(-6). Let l be (-2 - a) + 0 + 4. What is the third derivative of u*3 - 21u*3 + 2u*3 - 27u*2 - 10u*l wrt u? -168 Let v = 5/152 + 89/760. Let j(z) be the second derivative of 0z*2 + 0z*3 + 9z - 1/12z4 - vz*5 + 0. Find the third derivative of j(q) wrt q. -18 What is the second derivative of 1960x + 10x3 - 3 + 37x*3 + 6x*3 + 58x*3 - 1864x wrt x? 666x Let j be 4/(-5)(-1445)/34. Let o = -15 + j. Find the second derivative of 40l - 41l - 3l3 - ol wrt l. -18l Let c(q) be the second derivative of -509q*4/6 + 1501q*2/2 - 2122q. What is the derivative of c(h) wrt h? -2036h Find the second derivative of 1312b*4 + 45b + 2836b4 + 5 - 11b*4 - 969b*4 wrt b. 38016b*2 Suppose -5c - 23 + 118 = -4f, -3f + 3c = 75. Let y = 41 + f. What is the derivative of yr*2 - 2r*2 - 2 + 8r*2 wrt r? 34r Let k(w) = 2w4 - w3 - 4w*2 - w + 1. Let z(n) = 7n*4 + 5n*3 + 19n*2 - 51n - 6. Let j(u) = -5k(u) - z(u). Find the third derivative of j(a) wrt a. -408a Let q(m) = -3015m2 - 13m - 316. Let d(l) = -3014l2 - 18l - 318. Let h(j) = 2d(j) - 3q(j). What is the second derivative of h(r) wrt r? 6034 What is the derivative of 5l2 - 149l*2 - 7060 + 14l*2 + 41l*2 - 2417 wrt l? -178l Let f = -88 - -92. Find the second derivative of j*2 + 14j*f - 78j - 12j4 - 17j*4 - 24j*4 wrt j. -468j*2 + 2 Let i(d) = 1743d*4 + 21d*2 + 615. Let s(r) = -3r4 + r2 + 1. Let g(w) = i(w) - 21s(w). What is the derivative of g(h) wrt h? 7224h*3 Let g(k) = 4k + 38. Let c be g(-9). Differentiate -74 + 211 - 7t - 83 + 2t*c wrt t. 4t - 7 What is the second derivative of 4k2 + 179 + 216k - 4k2 - 45k*5 - 225 - 171k - 14k4 wrt k? -900k*3 - 168k*2 Let o(x) be the third derivative of 0x*6 + 0x + 1/12x4 + 11/6x*3 - 2x*2 - 1/21x*7 + 0 + 0x*5. What is the second derivative of o(l) wrt l? -120l*2 Let k(a) = 26a + 285. Let l be k(-7). What is the third derivative of lz3 + 1160z*2 - 2255z*2 + z + 1155z*2 wrt z? 618 Find the third derivative of 618h*2 + 613h*2 - 340h*3 - 3h - 1888h2 - 7h + 617h2 wrt h. -2040 Suppose 12 + 24 = 9p. Find the second derivative of -36f + 142f*p - 49f + 167f + 189f wrt f. 1704f2 Let c(m) be the second derivative of 1159m8/56 - m4/12 + 55m3/6 + 5m*2/2 + 13m - 22. Find the third derivative of c(p) wrt p. 139080p3 Suppose -n + h = 2h + 14, -5n - 56 = -2h. Let z = 17 + n. Find the second derivative of -22f + f3 + 9f - f3 + fz wrt f. 20f3 What is the first derivative of 3i - i*3 - 808i*2 - 3i + 1023 - 104 + 779 wrt i? -3i2 - 1616i Let y = 47 + -32. Find the first derivative of -108f2 - y + 25f*2 - 15 wrt f. -166f Let i(j) = -j3 - j2 + j + 2. Let m be i(0). Differentiate 158h2 - h - 43 - 80h*2 - 79h*m wrt h. -2h - 1 Let r be 4/(-6) - (-1046)/3. Suppose 10v + 68 - r = 0. What is the third derivative of -42p*2 + 49p*2 - 55p*2 - vp*4 wrt p? -672p Let z(v) be the third derivative of 164v5/5 - 13v*4/24 + 13v*3 - 1051v*2. Find the second derivative of z(a) wrt a. 3936 Let t = -286 + 471. What is the second derivative of 104f - 28f + 132f - tf2 + 49f wrt f? -370 Let j(g) be the third derivative of g**9/42 + 8	{ "pile_set_name": "DM Mathematics" }
rmine p so that -np3 + 0 - 11p + 35/2p2 = 0. 0, 2/3, 11 Let t(p) be the second derivative of p5/60 + p4/24 - p3 + 5p*2 - 25p. Let d(m) be the first derivative of t(m). Factor d(o). (o - 2)(o + 3) Let h = 201683/80 - 2521. Let o(b) be the second derivative of -3/2b*2 - 2b - 1/8b4 - hb*5 + 7/8b*3 + 0. Factor o(d). -3(d - 1)*2(d + 4)/4 Determine x so that 42/11x + 40/11 + 2/11x*2 = 0. -20, -1 Let c = 140 - 127. Let v be c/6 + (-68)/34. Factor vj*2 + 1/3j + 1/6. (j + 1)*2/6 Suppose -18 = -9z + 27. Suppose -m = 2 - z. Factor -4/7 + 8/7l2 + 0l + 0lm - 4/7l*4. -4(l - 1)*2(l + 1)*2/7 Suppose -116 = -5u + 244. Let o be (-13)/((-1365)/u) - (-2)/(-7). Factor 2/5q3 + 0 + oq*2 + 0q - 2q4 + 6/5q*5. 2q*2(q - 1)*2(3q + 1)/5 Suppose -311 = 13g - 350. Solve 0 - 4m - 14/3m*2 + 12m*g - 10/3m*4 = 0 for m. -2/5, 0, 1, 3 Find a, given that 0a + 48/7a2 + 0 - 3/7a*5 + 0a*4 + 36/7a*3 = 0. -2, 0, 4 Let o(h) be the second derivative of 1/15h*6 - 3/4h*3 + 5/4h*4 - 6h + 0 + 23/40h5 + 0h*2. Let o(r) = 0. Calculate r. -3, 0, 1/4 Let q be -17(-437)/17595 - (2 - 48/27). Factor 1/5r2 + 3/5r - 3/5r3 + qr*4 - 2/5. (r - 2)(r - 1)*2(r + 1)/5 Let d = 52707/5 - 10540. Determine f so that 2/5f + 0 + 9/5f*3 + 1/5f5 + f4 + df2 = 0. -2, -1, 0 Factor 0 - 1/9p*3 + 5/9p*2 + 14/9p. -p(p - 7)(p + 2)/9 Let v = 1612 - 14506/9. Determine l, given that -2/3l3 + 2/9 - vl*2 + 2/3l = 0. -1, -1/3, 1 Suppose -13 = 4c + q, 18 = -2c - 2c - 2q. Let n be c/8 + (-57)/(-12). Determine a so that 0 + 3a2 - na*3 - 1/2a = 0. 0, 1/3 Let i(k) = k*4 + 2k3 + k2 - k. Let f(d) = -6d4 - 19d*3 - 18d*2 + 50d + 50. Let o(q) = f(q) + 5i(q). What is a in o(a) = 0? -5, -1, 2 Let p(c) be the third derivative of -c6/60 + 3c*5/10 + 4c*4 + 52c*3/3 - 30c*2 + 2c. Let p(q) = 0. What is q? -2, 13 Let s(w) be the first derivative of w*3 + 33w*2/2 + 90w - 297. Let s(f) = 0. What is f? -6, -5 Let z(m) = -3m2 + 9m + 122. Let t be z(8). What is v in -2/5v3 - 6/5v + 8/5vt + 0 = 0? 0, 1, 3 Let d = 32 - 4. Factor -16 - 29h - dh2 - 16h - 47h - 8. -4(h + 3)(7h + 2) Let h(a) = -7a2 - 427a - 417. Let d be h(-60). Factor -6fd + 3/4f*4 + 27/4 + 33/2f*2 - 18f. 3(f - 3)2(f - 1)*2/4 Suppose 6m + 3 = 3m, -5t + 18 = 2m. Let z(j) be the first derivative of 16/3j3 - 2 - jt + 0j - 8j*2. Find b such that z(b) = 0. 0, 2 Suppose 13r - 20 = 8r. Factor -20d*r + 7d + 50d3 + 13d - 10d3 - 36d*2 - 4 - 4d*2 + 4d*5. 4(d - 1)*5 Suppose -8 = 4x - 5c, 32 = 5x + 5c - 3. Factor -xq*2 - 27q + 27q. -3q*2 Let v(m) be the third derivative of 1/320m*6 - 3m*2 - 1/48m*4 + 1/120m*5 + 0m + 10 - 1/420m7 + 1/2688m*8 + 0m*3. Factor v(i). i(i - 2)*2(i - 1)(i + 1)/8 Let v be 2/10 + (-7)/((-210)/(-2976)). Let q = -296/3 - v. Factor 2s*2 + 4/3s + 4/3s3 + qs4 + 1/3. (s + 1)4/3 Let t(z) be the first derivative of z*6/33 + 14z*5/55 + 15z*4/22 + 26z*3/33 + 4z*2/11 - 699. What is c in t(c) = 0? -4, -1, 0 Solve -2/5y*3 + 14/5y + 392/5 - 4y2 = 0 for y. -7, 4 Suppose -29b + 32b - 225 = 0. What is w in w2 + 4w*2 + 30w - 12w2 - b + 4w2 = 0? 5 Let d(h) be the first derivative of h4/20 + 2h3/15 + h2/10 - 10. Factor d(k). k(k + 1)*2/5 Suppose -4v + 3p + p - 1240 = 0, 0 = 3v - 2p + 929. Let t be (-21)/(-49) + v/(-63). Let th + 4/3h2 - 4/3h*3 - 16/3 = 0. What is h? -2, 1, 2 Let w(v) be the second derivative of -37v + 11/5v5 + 8/21v*7 + 0v*2 + 0 + 2/3v*4 + 26/15v*6 + 0v*3. Let w(y) = 0. What is y? -2, -1, -1/4, 0 Let k(y) be the second derivative of 289y*6/210 - 17y5/35 + y4/21 - 27y + 5. Determine n, given that k(n) = 0. 0, 2/17 Let c(b) = 2b - 6. Let h be c(3). Suppose 4m + 5t - 11 = 0, 0 = 4m + 3t - 13 - h. Factor -4/7u3 + 16/7u*2 + 4/7 + 2/7u*5 - 2u - 4/7um. 2(u - 1)*4(u + 2)/7 Let t(g) be the second derivative of g*6/15 + 2g*5/5 - 5g*4/6 + 333g. Factor t(x). 2x2(x - 1)(x + 5) Let j(b) be the third derivative of -2/3b*4 + 1/15b*6 + 2/105b*7 - 11b*2 + 8/3b*3 + 0b - 1/5b5 + 0. Factor j(d). 4(d - 1)*2(d + 2)*2 Let x(q) be the third derivative of -1/15q*5 + 0 - 98/3q*3 - 3q*2 + 7/3q*4 + 0q. Determine s so that x(s) = 0. 7 Let b(k) be the first derivative of 1/2k2 + 1/16k*4 + 0k - 24 - 5/12k3. Factor b(o). o(o - 4)(o - 1)/4 Let q be 3/((-3)/7)(-12)/21. Solve 0dq - 13d*3 - 3d*3 - 12d*2 + 80d + 9 - 59 - 2d4 = 0. -5, 1 Let r = -250420/7 + 35776. Suppose -8/7g*3 + rg*2 - 8/7g + 2/7 + 2/7g4 = 0. Calculate g. 1 Let b be (-57)/(-15) + 24/(-30). Let d be (-2 - 0)/((-4)/3). Let by - 3/2y2 - d = 0. Calculate y. 1 Let i = -1234/1555 + -2/311. Let k = i - -6/5. Factor -2/5g*2 - kg + 2/5g4 + 0 + 2/5g*3. 2g(g - 1)(g + 1)*2/5 Let r = 319/10 + -158/5. Let h(f) be the first derivative of -2/5f*3 - 3/20f*4 + rf*2 + 2 + 6/5f. Let h(j) = 0. What is j? -2, -1, 1 Let d(x) = -x3 + x2 - 10x - 32. Let f be d(-2). Factor -1/3t*2 + 0t - 1/6t4 + 1/2t3 + f. -t2(t - 2)(t - 1)/6 Let r(c) = c*2 + 12c - 23. Let t be r(-14). Factor 22h2 + 7h*4 + 37h*5 + 3 + 28h*t - 13h - 18h3 - 66h*5. -(h - 3)(h - 1)*4 Let l(q) be the first derivative of 2q*5/35 - 3q*4/14 - 2q*3/21 + 3q*2/7 + 245. Factor l(a). 2a(a - 3)(a - 1)(a + 1)/7 What is r in 4r*3 - 80 + 2r*4 - 84r*2 - 164r + 0r3 + 0r*3 + 2r*4 = 0? -4, -1, 5 Let n(y) = 59y*3 + 202y*2 + 157y + 20. Let b(f) = -710f3 - 2425f*2 - 1885f - 240. Let v(j) = -3b(j) - 35n(j). Factor v(l). 5(l + 1)(l + 2)(13l + 2) Let v = 128785 + -35158241/273. Let q = v + 2/39. Factor -qr + 4/7 - 6/7r*2. -2(r + 1)(3r - 2)/7 Let s = 955/1872 + -7/144. Factor -4/13a2 + 0a - 2/13a4 - sa*3 + 0. -2a*2(a + 1)(a + 2)/13 Let l = -13 + 13. Suppose z + l = 4. Suppose -zb + 4b3 - 5b*2 + 0b*4 + 3b*4 + 3b2 - b4 = 0. What is b? -2, -1, 0, 1 Let r(u) be the third derivative of 0u + 3u*2 + 1/6u*4 + 0 + 0u*3 + 1/15u*5. Factor r(v). 4v(v + 1) Let s be (-9)/3246/324. Let b = -16/9 - s. Factor 1/8u + 1/8u*5 + 0 + bu*2 + 3/4u*3 + 1/2u*4. u(u + 1)*4/8 Let q = 19 - 17. Let t(y) = 3y*2 - 3y. Let n be t(q). Factor -12b2 + nb - 14b - 10b + 8 - 2b. -4(b + 2)(3b - 1) Let p(k) = -1. Let r = -12 + 6. Let i(m) = 0m2 - 1 - 1 + 4m*2 - 8m*2. Let q(z) = rp(z) + i(z). Determine g so that q(g) = 0. -1, 1 Let z(c) = -12c5 + 30c*4 - 39c*3 - 15c*2 + 24c - 15. Let o(j) = j5 - j4 + j3 + j2 + j. Let u(k) = 9o(k) + z(k). Factor u(w). -3(w - 5)(w - 1)3(w + 1) Factor 0 + 0g2 + 0g + 5/2g3 + 3g*4 + 1/2g5. g3(g + 1)(g + 5)/2 Let j(z) be the first derivative of 24z2 - 3z*4 - 8 - 16z - 16/3z3 + z5. Solve j(v) = 0 for v. -2, 2/5, 2 Let s(p) be the third derivative of p5/50 + 41p*4/60 - 4p*3 - 185p*2 + 1. Factor s(k). 2(k + 15)(3k - 4)/5 Let k(r) = -r*3 + 6r*2 + 8r - 5. Let w be k(5). Suppose 6q2 + wq*4 + 12q*3 + 3q*2 - 57q4 = 0. Calculate q. -3, -1, 0 Let f(x) = x3 + 39x2 - 97x - 132. Let d(o) = -2o3 - 38o*2 + 98o + 132. Let v(t) = -3d(t) - 2f(t). Factor v(h). 4(h - 3)(h + 1)(h + 11) Let y be -1 - ((-2176)/180 + -3). Let q = y - 66/5. Let -80/9i - 470/9i3 - q - 98/9i*5 - 290/9i*2 - 350/9i*4 = 0. What is i? -1, -2/7 Suppose 6 + 2/7h*2 - 20/7h = 0. Calculate h. 3, 7 Suppose 267 = 361j - 174j - 107. Factor -10/3f - 4 - 2/3f*j. -2(f + 2)(f + 3)/3 Let k(b) be the second derivative of 1/30b*4 + 0b*2 + 10b + 0 + 0b3. Factor k(l). 2l2/5 Let p(r) be the second derivative of r5/5 - 5r4/3 + 4r*3/3 + 16r*2 - 4r + 1. Factor p(a). 4(a - 4)(a - 2)(a + 1) Suppose -1 - 8 = -3g. Suppose 9u + 3 + 2 - 2ug + u3 + 3u2 = 0. What is u? -1, 5 Let d(w) be the second derivative of -w5/220 + w4/11 - 7w*3/22 + 5w*2/11 + 16w + 18. Determine v so that d(v) = 0. 1, 10 Let i(q) be the first derivative of 2q6/15 - q4/5 - 259. Factor i(h). 4h*3(h - 1)*(h + 1)/5 Let b = 9208/23045 - -2/4609. Let o(s) be the first derivative o	{ "pile_set_name": "DM Mathematics" }
2) + 6/(-4) a multiple of 14? False Let k = 418 + 411. Does 24 divide k? False Suppose 1085 = 11b - 2589. Suppose -2q - 60 = -b. Is 5 a factor of q? False Suppose z = o + 50, 4o - z - 9 = -200. Let t = o - -182. Is 27 a factor of t? True Let z(p) = 11p - 1. Let w be z(-1). Does 3 divide ((-2)/w10)/((-1)/(-9))? True Let w(j) = -j3 - j2 + j + 92. Suppose -x + 20 = 2v - 6v, 5v + 25 = -5x. Does 23 divide w(x)? True Suppose -692m + 3150 = -689m. Does 15 divide m? True Let i(y) = -144y + 280. Is 13 a factor of i(-6)? True Let i(f) = -f*3 + 32f*2 + 84f - 157. Is i(34) a multiple of 106? False Let h(w) = -4w3 + 5w*2 + 5w - 2. Let i(u) = 9u3 - 11u*2 - 11u + 4. Let x(r) = -5h(r) - 2i(r). Is 10 a factor of x(3)? True Let f(r) = -16r - 11. Let c be f(-5). Let h = c - -30. Is 33 a factor of h? True Let z(k) = 16k - 16. Let r be z(6). Is (r/(-32))/((-1)/10) a multiple of 25? True Let d = 4420 + -1282. Is 91 a factor of d? False Let a be 1/((-3)/35 - 14/(-49)). Suppose -a - 11 = -v. Is v a multiple of 16? True Suppose -2y + 0y + 15 = 5a, -5a - 5y + 15 = 0. Suppose 36 + 918 = 4l - 2c, -c - 718 = -al. Let b = -168 + l. Is 17 a factor of b? False Suppose 11r - 95 = 312. Does 6 divide r? False Let q(v) = 3v*2 - 4v + 5. Let n be q(4). Suppose -y + 19 = -n. Does 8 divide y? True Let q(m) = 5m2 + 8m + 61. Is 13 a factor of q(-10)? True Let t(h) = -180h - 5. Let c = 79 - 80. Does 25 divide t(c)? True Suppose -53n = -13n - 22400. Does 20 divide n? True Suppose 5p - 16 = p. Let i(b) be the second derivative of b5/20 - b4/3 + 2b3/3 - b2 - 3b. Is 3 a factor of i(p)? False Suppose -11g + 1406 = -1597. Does 7 divide g? True Let m = 50 - 50. Suppose mn - n = -10. Is 10 a factor of n? True Let j be (-13)/(-2) + (-15)/10. Suppose -2i - jz + 286 - 25 = 0, -i + 138 = -5z. Is 41 a factor of i? False Is 10 a factor of -2 + (8 + -1 - -235)? True Let t be 1/((-2)/6-1). Suppose -tw - 4k + 408 = 0, -5w + 3k = -k - 680. Suppose 3z + 129 = 5g, -5g = -z + 3 - w. Is 6 a factor of g? False Suppose -1176 = -5r + 104. Is r a multiple of 16? True Let q = 78 + -33. Let c = 84 - q. Is 30 a factor of c? False Let j = 9 - 3. Is -5 + 70/15 + 74/j a multiple of 12? True Suppose 4 - 2 = -2c, -4c = 2o - 734. Suppose -144 = -2l - 4f + 7f, 3f + o = 5l. Is 15 a factor of l? True Let i = 194 - -265. Is i a multiple of 14? False Suppose 3x = 4t - 8 + 125, -5x + t + 178 = 0. Suppose 3a - 4a = -x. Does 5 divide a? True Suppose 11j + 2405 = -2j. Let k = 15 - j. Is k a multiple of 20? True Suppose -5m + 4g - 23 + 170 = 0, 0 = 5m + 5g - 120. Let p = -12 + 31. Let w = p + m. Does 13 divide w? False Let c(d) = -d3 + 15d*2 - d + 7. Let t be c(15). Is 3 a factor of (8/205)/(t/(-36))? True Let o be (-2944)/14 - 2/(-7). Let n = -143 - o. Is 12 a factor of n? False Suppose -2y = -3p + 551, -p + 0p = -4y - 197. Is (-2)/4 - p/(-2) a multiple of 15? True Suppose o - 4o - 336 = 0. Let t = 143 + o. Does 29 divide t? False Is 13 a factor of 0 + 2/(-16) - 54603/(-24)? True Suppose -4o = 3o + 7. Let i(r) = 90r*2 + 4r + 4. Is 15 a factor of i(o)? True Let a(y) = -y3 + y2 + 6y + 3. Let x be a(3). Let d be -1x + 50/5. Suppose -5h + 142 = 4z, 0 = dz - 2z - 5h - 200. Is z a multiple of 19? True Let q(x) = -9x - 2. Let u = 9 + -12. Let v be q(u). Suppose 2l - v = 15. Is 10 a factor of l? True Suppose 0 = 4r - 7r + a + 2234, 4r = 2a + 2980. Is 6 a factor of r? True Let o be (-38)/(-14) + 74/14 + -5. Suppose -3u - 2u + 151 = 4w, -ow = u - 28. Does 8 divide u? False Suppose -3h + 41 = 5a + 12, -26 = -2h - 5a. Suppose d = -0d - h, 0 = -3n + 4d - 195. Let c = -11 - n. Is 15 a factor of c? False Let p(i) = -4i3 + 2i*2 + 4i + 9. Let f be p(-5). Suppose 4b + f = 3c, -c + b + 351 = c. Let q = 263 - c. Does 19 divide q? False Let t = -1056 - -1270. Does 32 divide t? False Let f(t) = 4 + 0 + 0t + 3 - t. Let h be f(-5). Let z = h - -5. Does 3 divide z? False Let n = 56 + -49. Let u(j) = 6j*2 + 5j - 7. Let s(m) = 5m2 + 5m - 6. Let x(a) = -7s(a) + 6u(a). Is 7 a factor of x(n)? True Is (-1 - -2)/(1 + (-12770)/12775) a multiple of 73? True Suppose -5w + 2982 = -3w. Is w a multiple of 21? True Suppose 8 = -m - 0. Let n = m + 3. Is 7 a factor of n/15 + (-58)/(-3)? False Let s = -4 + 10. Let a(l) be the second derivative of l4/12 - l3 + 4l2 + 35l. Does 4 divide a(s)? True Let t be (-16)/12(-84)/8. Suppose tm - 11m - 108 = 0. Is 6 a factor of m? True Let w be (-15)/(2/(4/(-2))). Suppose -10z - 595 = -wz. Is 11 a factor of z? False Suppose -2m + 21416 = 4h, 5m - 5 - 5 = 0. Is h a multiple of 101? True Let c(h) be the first derivative of 16h3/3 - h2 + 3h + 8. Is 13 a factor of c(2)? False Suppose -6x + 80 = -x. Let o(r) = -r2 + 17r + 17. Is 21 a factor of o(x)? False Suppose -21 = -2z - z + r, 5z - 35 = 3r. Suppose -111 - 64 = -zj. Is 4 a factor of j? False Is 15(0 + (-1566)/(-30)) a multiple of 65? False Is 20 a factor of (-36)/(-6) + -1 + 963? False Let q(p) be the first derivative of 2p*2 - 7p - 4. Is 5 a factor of q(13)? True Let v = -2219 - -2261. Is 6 a factor of v? True Let u(k) = -32k + 14. Does 45 divide u(-8)? True Let c be ((-4)/(-12))/((-1)/21). Let o(g) = 2g*2 + 6g - 16. Is o(c) a multiple of 25? False Let s = -201 - -536. Is 8 a factor of s? False Let w be (-210)/(-20) - (-1)/2. Suppose -w = -k + 12. Does 3 divide k? False Suppose 5t + 20 = 5s, 0 = -2s + t + 4t + 14. Let k be (3/s)/((-6)/468). Let q = -57 - k. Does 24 divide q? False Let x(g) = -11g + 2. Let h(f) = 22f - 4. Let v(l) = -2h(l) - 5x(l). Let y be v(1). Suppose -2a + 3 = -y. Is a a multiple of 6? True Let o(f) = -9f*2 + 5f + 13. Let z(p) = -14p2 + 8p + 20. Let k(x) = -8o(x) + 5z(x). Let u be k(5). Suppose w + 16 - u = 0. Does 17 divide w? False Suppose -a - 5v = -3a - 335, 4a + 725 = -v. Let i = 255 + a. Is 25 a factor of i/(-9)18/(-3)? True Suppose -5n + 0n = 0. Suppose n = 44s - 46s + 110. Does 11 divide s? True Let x = -22 + 34. Suppose -6i + 3i = -x. Suppose m - 5 = 0, 5k = -m - im + 210. Is 18 a factor of k? False Suppose 2t + 32 = -0t. Let k = t - -21. Suppose 0 = -4v + kl + 160, 164 = 4v - 4l - 0l. Is v a multiple of 9? True Let r(o) = -2o*3 - 7o*2 - 7o - 7. Let i be -2328/42. Does 37 divide r(i)? True Suppose v - 104 - 416 = -3t, -4t + 695 = 3v. Is 12 a factor of t? False Let n be 30/(-195) + (-11306)/26. Let m = n + 660. Does 45 divide m? True Let a(r) = -r2 + 8r - 3. Let p be a(7). Suppose z = -pz + 5f + 70, -4f = 0. Is 14 a factor of z? True Let p(r) = -r - 15. Let o be p(-20). Let w(c) = c2 + 4c - 12. Does 8 divide w(o)? False Suppose -4w = q + 19 - 931, 0 = -4q + 2w + 3684. Does 23 divide q? True Let f = 2271 + -1888. Is f a multiple of 8? False Suppose 5z + 13 = -17. Let w = 26 - z. Let t = 72 - w. Is t a multiple of 10? True Let z(s) = 2s2 - 13s + 17. Let t be z(5). Suppose -47 = -tm + 13. Is m a multiple of 6? True Suppose 68l = 69l - 1083. Is 40 a factor of l? False Let c be 6/(-2) - (3 + -40). Suppose c = b - 34. Does 19 divide b? False Let u(c) = 16c - 2. Let p(k) = -4k2 - 20k - 13. Let y(h) = 3h2 + 13h + 9. Let l(r) = -5p(r) - 7y(r). Let d be l(9). Is u(d) a multiple of 15? True Suppose -2v + 848 = -4z, 63 + 2033 = 5v - 4z. Does 16 divide v? True Let c be 7 + (-4 - 0) - -42. Suppose 0 = cf - 50f + 300. Is 32 a factor of f? False Let g = 8 - 8. Suppose g = -4m + 16 + 4. Suppose 2p - 8 = 2f - 4f, 0 = mp + 3f - 26. Is 3 a factor of p? False Let r = -3464 + 5645. Is 23 a factor of r? False Suppose 0 = 322l - 323l + 42. Is l a multiple of 42? True Let d = 19 + 351. Is 54 a factor of d? False Suppose -991 - 1185 = -8z. Is 16 a factor of z? True Let r(z) = z2 + 5z + 5. Let y be r(-5). Suppose 2s - 6 = -5x, 4s + 20 = -s + yx. Is ((-6)/s)/(-3) + 10 a multiple of 5? False Let b(h) = -9h + 2h*2 - 11 + 3h + 8. Is b(7) a multiple of 9? False Let g(t) = 2t3 - 5t*2 - 3t - 4. Let v(d) = -3d3 + 6d*2 + 4d + 5. Let w(y) = 5g(y) + 4v(y). Let n be w(1). Is 0 - (n - (48 - 1)) a multiple of 13? False Does 8 divide (-4)/54 - 3894/(-81)? True Suppose a - 4 + 0 =	{ "pile_set_name": "DM Mathematics" }
minutes before 8:06 AM? 10:53 PM How many minutes are there between 2:43 AM and 6:34 AM? 231 What is 325 minutes before 1:05 PM? 7:40 AM What is 596 minutes before 4:20 PM? 6:24 AM What is 448 minutes before 3:45 AM? 8:17 PM How many minutes are there between 3:19 AM and 4:41 AM? 82 What is 474 minutes after 8:46 PM? 4:40 AM How many minutes are there between 4:13 AM and 5:41 AM? 88 How many minutes are there between 6:33 AM and 11:10 AM? 277 What is 277 minutes before 10:44 AM? 6:07 AM How many minutes are there between 1:47 AM and 11:38 AM? 591 How many minutes are there between 1:48 AM and 12:40 PM? 652 What is 342 minutes after 6:54 PM? 12:36 AM How many minutes are there between 5:10 AM and 9:01 AM? 231 How many minutes are there between 10:35 PM and 8:30 AM? 595 What is 102 minutes after 8:03 PM? 9:45 PM What is 507 minutes after 8:38 AM? 5:05 PM How many minutes are there between 8:58 AM and 8:47 PM? 709 What is 322 minutes before 2:29 PM? 9:07 AM How many minutes are there between 8:39 PM and 7:43 AM? 664 How many minutes are there between 6:34 PM and 8:24 PM? 110 How many minutes are there between 8:07 PM and 2:34 AM? 387 How many minutes are there between 12:21 AM and 11:23 AM? 662 What is 664 minutes before 9:53 PM? 10:49 AM How many minutes are there between 6:40 PM and 6:54 PM? 14 How many minutes are there between 12:15 PM and 4:25 PM? 250 What is 547 minutes after 4:22 AM? 1:29 PM How many minutes are there between 8:58 PM and 8:25 AM? 687 How many minutes are there between 11:02 PM and 5:14 AM? 372 How many minutes are there between 8:24 AM and 12:22 PM? 238 What is 639 minutes after 4:20 AM? 2:59 PM How many minutes are there between 5:36 AM and 1:00 PM? 444 What is 89 minutes after 9:33 PM? 11:02 PM How many minutes are there between 12:34 PM and 10:16 PM? 582 What is 371 minutes before 6:14 AM? 12:03 AM How many minutes are there between 5:52 PM and 11:20 PM? 328 How many minutes are there between 2:25 PM and 7:08 PM? 283 What is 607 minutes after 12:17 PM? 10:24 PM How many minutes are there between 12:14 AM and 1:42 AM? 88 How many minutes are there between 10:31 AM and 4:38 PM? 367 What is 657 minutes after 2:04 PM? 1:01 AM How many minutes are there between 8:05 AM and 8:47 AM? 42 How many minutes are there between 7:01 AM and 11:53 AM? 292 How many minutes are there between 6:19 PM and 5:16 AM? 657 What is 298 minutes before 1:46 PM? 8:48 AM How many minutes are there between 3:00 AM and 11:40 AM? 520 What is 547 minutes before 8:21 AM? 11:14 PM What is 557 minutes before 11:22 PM? 2:05 PM What is 88 minutes before 9:32 AM? 8:04 AM How many minutes are there between 5:24 AM and 4:24 PM? 660 How many minutes are there between 7:01 PM and 9:23 PM? 142 How many minutes are there between 10:43 PM and 5:10 AM? 387 What is 149 minutes before 4:04 AM? 1:35 AM What is 317 minutes before 6:33 AM? 1:16 AM How many minutes are there between 9:06 PM and 11:57 PM? 171 How many minutes are there between 5:14 AM and 5:23 AM? 9 How many minutes are there between 4:13 AM and 1:54 PM? 581 What is 675 minutes after 9:24 PM? 8:39 AM How many minutes are there between 9:36 AM and 10:29 AM? 53 How many minutes are there between 12:17 AM and 5:27 AM? 310 How many minutes are there between 9:34 PM and 7:07 AM? 573 What is 14 minutes before 10:31 PM? 10:17 PM How many minutes are there between 2:12 PM and 12:22 AM? 610 How many minutes are there between 11:31 AM and 10:10 PM? 639 How many minutes are there between 3:53 AM and 12:14 PM? 501 What is 41 minutes before 10:56 PM? 10:15 PM How many minutes are there between 6:49 AM and 4:45 PM? 596 What is 710 minutes after 4:11 PM? 4:01 AM How many minutes are there between 5:07 AM and 9:21 AM? 254 How many minutes are there between 2:17 AM and 11:05 AM? 528 What is 88 minutes before 8:19 AM? 6:51 AM What is 211 minutes after 1:06 AM? 4:37 AM How many minutes are there between 12:59 AM and 3:14 AM? 135 How many minutes are there between 5:59 PM and 1:27 AM? 448 How many minutes are there between 12:23 AM and 3:01 AM? 158 What is 279 minutes after 8:47 PM? 1:26 AM How many minutes are there between 8:45 PM and 6:41 AM? 596 How many minutes are there between 7:41 AM and 5:57 PM? 616 What is 704 minutes before 3:02 AM? 3:18 PM How many minutes are there between 12:12 AM and 12:22 AM? 10 How many minutes are there between 9:22 AM and 2:27 PM? 305 What is 620 minutes before 3:52 PM? 5:32 AM What is 591 minutes before 3:57 PM? 6:06 AM What is 463 minutes before 2:40 PM? 6:57 AM What is 472 minutes before 2:57 AM? 7:05 PM How many minutes are there between 6:44 AM and 9:01 AM? 137 What is 111 minutes before 1:05 PM? 11:14 AM What is 419 minutes after 3:24 PM? 10:23 PM How many minutes are there between 8:40 PM and 5:47 AM? 547 How many minutes are there between 11:00 PM and 10:16 AM? 676 How many minutes are there between 10:26 AM and 5:49 PM? 443 What is 669 minutes after 2:49 PM? 1:58 AM What is 611 minutes before 1:52 PM? 3:41 AM What is 576 minutes before 10:41 PM? 1:05 PM How many minutes are there between 10:54 PM and 12:45 AM? 111 How many minutes are there between 12:30 AM and 11:11 AM? 641 How many minutes are there between 12:04 AM and 2:07 AM? 123 How many minutes are there between 2:14 PM and 1:46 AM? 692 How many minutes are there between 10:32 PM and 3:24 AM? 292 What is 88 minutes after 6:32 PM? 8:00 PM What is 236 minutes after 2:13 AM? 6:09 AM What is 154 minutes before 2:55 AM? 12:21 AM What is 488 minutes after 8:12 PM? 4:20 AM What is 538 minutes after 7:37 PM? 4:35 AM What is 303 minutes after 6:13 AM? 11:16 AM What is 401 minutes before 6:19 PM? 11:38 AM How many minutes are there between 6:20 AM and 7:52 AM? 92 How many minutes are there between 12:14 PM and 11:30 PM? 676 What is 217 minutes after 8:21 PM? 11:58 PM How many minutes are there between 12:07 AM and 2:04 AM? 117 What is 202 minutes before 4:19 AM? 12:57 AM How many minutes are there between 2:42 PM and 1:54 AM? 672 What is 564 minutes before 7:40 AM? 10:16 PM What is 10 minutes before 8:36 PM? 8:26 PM How many minutes are there between 8:53 AM and 9:29 AM? 36 How many minutes are there between 5:34 AM and 1:59 PM? 505 How many minutes are there between 1:23 PM and 9:10 PM? 467 What is 607 minutes after 8:33 AM? 6:40 PM How many minutes are there between 8:17 PM and 2:59 AM? 402 How many minutes are there between 4:40 AM and 11:30 AM? 410 What is 647 minutes before 11:05 AM? 12:18 AM How many minutes are there between 12:23 AM and 2:52 AM? 149 What is 612 minutes after 2:54 PM? 1:06 AM What is 96 minutes before 12:56 AM? 11:20 PM What is 693 minutes before 12:11 AM? 12:38 PM How many minutes are there between 6:27 PM and 3:55 AM? 568 What is 240 minutes after 9:14 PM? 1:14 AM What is 345 minutes before 7:12 PM? 1:27 PM What is 123 minutes before 8:59 PM? 6:56 PM How many minutes are there between 9:13 AM and 7:30 PM? 617 What is 388 minutes after 8:45 AM? 3:13 PM What is 394 minutes before 5:15 AM? 10:41 PM How many minutes are there between 11:30 AM and 4:22 PM? 292 How many minutes are there between 10:17 PM and 5:20 AM? 423 What is 508 minutes before 11:27 PM? 2:59 PM What is 60 minutes after 8:25 PM? 9:25 PM How many minutes are there between 12:51 PM and 2:07 PM? 76 What is 175 minutes before 5:48 PM? 2:53 PM What is 539 minutes before 2:55 AM? 5:56 PM What is 128 minutes after 3:31 PM? 5:39 PM How many minutes are there between 5:13 AM and 7:28 AM? 135 What is 612 minutes after 4:07 PM? 2:19 AM What is 372 minutes after 5:33 AM? 11:45 AM How many minutes are there between 6:13 AM and 2:40 PM? 507 What is 323 minutes before 3:12 PM? 9:49 AM How many minutes are there between 11:29 PM and 6:27 AM? 418 How many minutes are there between 9:42 AM and 9:09 PM? 687 How many minutes are there between 5:09 AM and 5:34 AM? 25 What is 126 minutes before 5:55 AM? 3:49 AM What is 618 minutes before 9:42 AM? 11:24 PM What is 317 minutes before 1:40 PM? 8:23 AM How many minutes are there between 9:36 AM and 7:21 PM? 585 What is 53 minutes after 10:44 AM? 11:37 AM How many minutes are there between 6:44 AM and 11:44 AM? 300 What is 699 minutes before 9:59 PM? 10:20 AM How many minutes are there between 11:37 AM and 9:55 PM? 6	{ "pile_set_name": "DM Mathematics" }
58u + 66 for u. -1 Solve 3n = 2n + 4n for n. 0 Solve 32 = -1208v + 1192v for v. -2 Solve 34n = 39n - 20 for n. 4 Solve 0 = 976r - 962r - 84 for r. 6 Solve -228 = 7f - 235 for f. 1 Solve 24g = 25g - 3 for g. 3 Solve -21i + 230 = 41 for i. 9 Solve 0 = 168q - 178q + 50 for q. 5 Solve 0 = -13o + 394 - 355 for o. 3 Solve -15j + 1 = -29 for j. 2 Solve 3 = -5z + 8z for z. 1 Solve 24 = 259k - 247k for k. 2 Solve -28o - 28 = -0 for o. -1 Solve 20v = 76 + 44 for v. 6 Solve 0 = 34v - 17v + 68 for v. -4 Solve 28 = -19b + 5b for b. -2 Solve -14 = -2j - 12j for j. 1 Solve 9k - 12 - 15 = 0 for k. 3 Solve 3155 = -9u + 3182 for u. 3 Solve 7r = 162 - 197 for r. -5 Solve 5m = -1 - 24 for m. -5 Solve 9o - 10o = 9o for o. 0 Solve -9y = 6y for y. 0 Solve 5l - 90 = -80 for l. 2 Solve 0u = -5u + 5 for u. 1 Solve -2a = 14 - 16 for a. 1 Solve -2k - 32 = -42 for k. 5 Solve 109 = -2y + 113 for y. 2 Solve -93y + 94y = 0 for y. 0 Solve 0 = 45k - 49 + 4 for k. 1 Solve 9f = -0 - 0 for f. 0 Solve -23j - 320 = -55j for j. 10 Solve 19i = 7i for i. 0 Solve -24 = k + 5k for k. -4 Solve -45 = 52q - 61q for q. 5 Solve 105 = 310y - 325y for y. -7 Solve f + 55 = -10f for f. -5 Solve -5r + 14 = -6 for r. 4 Solve 36 = -283v + 301v for v. 2 Solve -1 - 15 = -4d for d. 4 Solve 0 = 22v - 17v + 15 for v. -3 Solve -9r - 48 = -12 for r. -4 Solve 3s + 4134 - 4116 = 0 for s. -6 Solve -1 - 5 = 2f for f. -3 Solve 0 = 6a + 8 + 4 for a. -2 Solve -3a = -3a - 4a for a. 0 Solve 6l + 1191 = 1179 for l. -2 Solve 6279 = -8y + 6215 for y. -8 Solve -o + 5 = 2 for o. 3 Solve 5k = 55 - 30 for k. 5 Solve 3h - 11h = 8 for h. -1 Solve 0 = -8c + 5c for c. 0 Solve 9c + 39 = 3 for c. -4 Solve 0 = 2k + 3k - 10 for k. 2 Solve -v + 14 = 10 for v. 4 Solve 3h - 2 = 4 for h. 2 Solve -5f = -f - 8 for f. 2 Solve -38 = -73r - 330 for r. -4 Solve -10d + 2d = 40 for d. -5 Solve 16 - 58 = -14p for p. 3 Solve 0 = 24i - 478 + 214 for i. 11 Solve 35w - 12 = 198 for w. 6 Solve 5o - 27 = -52 for o. -5 Solve 0 = 2g + 55 - 61 for g. 3 Solve 35v - 31v + 8 = 0 for v. -2 Solve -21 = 19m - 97 for m. 4 Solve 0 = -51x + 52x + 5 for x. -5 Solve 55g + 65 = 340 for g. 5 Solve 0 = -3o - 420 + 405 for o. -5 Solve -6f - 4 = 2 for f. -1 Solve 2 - 7 = i for i. -5 Solve -55w - 3w = -58 for w. 1 Solve 4y + 31 - 39 = 0 for y. 2 Solve 2f = 18 - 20 for f. -1 Solve 9f - 79 = -70 for f. 1 Solve 0 = -11z + 50 - 28 for z. 2 Solve -2r + 465 - 481 = 0 for r. -8 Solve 0 = 80w - 84w - 16 for w. -4 Solve 24t - 5t = 95 for t. 5 Solve 201j - 218j = -102 for j. 6 Solve 0 = 56x - 49x for x. 0 Solve 0 = 85y - 88y + 6 for y. 2 Solve 440 = 17m + 93m for m. 4 Solve 2c - 86 = -82 for c. 2 Solve 23 + 47 = -10q for q. -7 Solve -244g + 138 = -221g for g. 6 Solve 27 - 68 = -41y for y. 1 Solve 0 = 14n + 31 - 3 for n. -2 Solve -10w + 9w = -2 for w. 2 Solve 4l + 6 + 10 = 0 for l. -4 Solve 46 - 38 = -4d for d. -2 Solve -6d + 7 = -5 for d. 2 Solve 3r - 1 = 4r for r. -1 Solve 0 = 128u - 113u - 105 for u. 7 Solve -75o + 79o = -8 for o. -2 Solve 6j = 6 + 6 for j. 2 Solve 11g = -49 + 16 for g. -3 Solve 13w + 27 = 1 for w. -2 Solve 14 = 6q - 16 for q. 5 Solve 0 = 13y + 99 - 138 for y. 3 Solve 0 = 20v - 113 + 13 for v. 5 Solve -9l = -3l - 6 for l. 1 Solve 0 = 38q + 15q - 212 for q. 4 Solve -20j = -25j - 20 for j. -4 Solve -16a = 1380 - 1300 for a. -5 Solve -271x = -276x - 5 for x. -1 Solve -48t - 16 = 32 for t. -1 Solve -27 + 123 = 24q for q. 4 Solve 3 = -2l + 3l for l. 3 Solve 5q = 12q + 14 for q. -2 Solve -12 = 17b - 13b for b. -3 Solve 0 = 92m + 66m + 158 for m. -1 Solve 229n = 205n - 72 for n. -3 Solve 33 = 21y - 30 for y. 3 Solve 17t - 3 - 150 = 0 for t. 9 Solve 31j = 21 + 165 for j. 6 Solve 13 - 4 = 9m for m. 1 Solve 8d + 7 + 9 = 0 for d. -2 Solve 112f = 116f - 12 for f. 3 Solve 52 - 92 = -8j for j. 5 Solve -33y + 8y = 0 for y. 0 Solve 6b - 15 = b for b. 3 Solve -13c + 26c = -78 for c. -6 Solve -3509m - 9 = -3510m for m. 9 Solve 74r = 60r + 14 for r. 1 Solve -4p = -5 + 1 for p. 1 Solve 7 = 3z + 19 for z. -4 Solve 82w - 81 = -327 for w. -3 Solve 16z + 25 + 7 = 0 for z. -2 Solve 18f - 25f - 7 = 0 for f. -1 Solve 210 = k + 211 for k. -1 Solve -30u = -60 - 30 for u. 3 Solve -5a = -105 + 85 for a. 4 Solve 96 = 6q + 144 for q. -8 Solve 86 - 35 = 17u for u. 3 Solve 98c - 102c = -28 for c. 7 Solve 2c + 6 = 4c for c. 3 Solve 9u - 123 = -87 for u. 4 Solve -14f - 6 = 50 for f. -4 Solve -58 = -19b + 37 for b. 5 Solve 0 = -2i - 5 + 11 for i. 3 Solve -19r = -8 - 11 for r. 1 Solve 11y + 0y - 55 = 0 for y. 5 Solve -844 = 7o - 802 for o. -6 Solve -4 - 29 = 11j for j. -3 Solve 0 = -42g + 71 + 97 for g. 4 Solve -19 = -21v + 44 for v. 3 Solve 18a = 48a + 120 for a. -4 Solve 5d - 3 = 2d for d. 1 Solve 40b - 23b = -51 for b. -3 Solve 4j + 8 = 2j for j. -4 Solve 0 = 18n - 2n + 80 for n. -5 Solve -1 = -6t - 31 for t. -5 Solve -5a = -11a - 18 for a. -3 Solve 5a + 24 + 21 = 0 for a. -9 Solve 12g - 15g = 6 for g. -2 Solve 4 + 6 = 2b for b. 5 Solve 25v = 16v + 9 for v. 1 Solve -12g = -7g - 5 for g. 1 Solve -1196i + 1187i - 36 = 0 for i. -4 Solve -8s + 27 + 13 = 0 for s. 5 Solve -10 = 6h - 34 for h. 4 Solve 139t - 126t = 0 for t. 0 Solve 0 = -10m + 17m for m. 0 Solve 3 = -8h - 13 for h. -2 Solve 511 = -2w + 497 for w. -7 Solve 64m - 37m = -135 for m. -5 Solve 105z = 114z + 36 for z. -4 Solve -9i = 7 - 25 for i. 2 Solve 0 = 23l - 9 - 37 for l. 2 Solve -134 = -8k - 94 for k. 5 Solve 35a - 112 = 51a for a. -7 Solve -4x = -409 + 385 for x. 6 Solve -41v = -49v - 24 for v. -3 Solve 232a - 114a - 107a = 0 for a. 0 Solve -4p = -21 + 1 for p. 5 Solve 0 = -17p - 340 + 374 for p. 2 Solve 41 = 12j + 77 for j. -3 Solve 2u - 6u - 10u = 0 for u. 0 Solve 8q = 8 + 32 for q. 5 Solve 32m - 240 = -28m for m. 4 Solve 34h + 26 = -8 for h. -1 Solve -29s = 1 + 115 for s. -4 Solve 42 + 2 = 11x for x. 4 Solve -105j - 60 = -93j for j. -5 Solve -9a - 83 = -146 for a. 7 Solve -69i + 110i = -82 for i. -2 Solve -109 = -36t + 107 for t. 6 Solve -3112p = -3116p - 8 for p. -2 Solve 6s + 34 - 4 = 0 for s. -5 Solve -1 = 6c - 5c for c. -1 Solve 26g = 22g + 4 for g. 1 Solve -7n + 22n = 30 for n. 2 Solve 9g - 2 = -11 for g. -1 Solve -35 = -16i - 3 for i. 2 Solve 453x + 9 = 444x for x. -1 Solve -199x + 210x = -33 for x. -3 Solve 39 + 363 = 67b for b. 6 Solve 21 = -5i - 4 for i. -5 Solve 3v + 8 = v for v. -4 Solve 34y = -10y + 176 for y. 4 Solve -3h + 2 = -10 for h. 4 Solve 3 = -2i + 5 for i. 1 Solve -542 + 524 = -6b for b. 3 Solve -12r = r - 52 for r. 4 Solve 5z = 50z + 315 for z. -7 Solve 17j = 20j + 3 for j. -1 Solve 0 = 9m + 793 - 811 for m. 2 Solve -9 = 42b + 369 for b. -9 Solve 12 = -46u - 34 for u. -1 Solve -2y - 10 + 0 = 0 for y. -5 Solve -13y + 9 = -10y for y. 3 Solve -40 = -16i + 56 for i. 6 Solve 3u - 5 = -2 for u. 1 Solve 0 = -71g + 81g + 10 for g. -1 Solve 64 = -55b + 23b for b. -2 Solve -742 = -6o - 760 for o. -3 Solve -19k + 18k + 3 = 0 for k. 3 Solve 0 = 38q - 22q + 16 for q. -1 Solve 289 = 63v - 89 for v. 6 Solve -4b + 29 - 5 = 0 for b. 6 Solve 880y - 40 = 885y for y. -8 Solve 0 = 12j + 152 - 56 for j. -8 Solve 16 - 22 = -3l for l. 2 Solve -11l + 23 = -21 for l. 4 Solve 13w = 9w - 16 for w. -4 Solve 511 - 476 = 5v for v. 7 Solve 9k + 655 = 673 for k. 2 Solve 0 = v - 6 + 9 for v. -3 Solve -3333 + 3261 = -12j for j. 6 Solve -31f = -24f - 42 for f. 6 Solve 5o = 32o - 81 for o. 3 Solve 38 - 194 = 26r for r. -6 Solve 0 = 6a + 284 - 260 for a. -4 Solve 0 = -41b + 10b + 155 for b. 5 Solve 21 = 273c - 266c for c. 3 Solve -11g - 5 = -10g for g. -5 Solve f = -3 - 1 for f. -4 Solve -44f + 67f - 161 = 0 for f. 7 Solve 0 = -3b - 15 - 0 for b. -5 Solve 1017a = 1014a + 15 for a. 5 Solve 13h = 16h - 15 for h. 5 Solve 8h + 169 = 105 for h. -8 Solve -47 = -19a - 9 for a. 2 Solve -48c + 64 = -16c for c. 2 Solve -50j + 18j - 128 = 0 for j. -4 Solve -80 = -106l + 662 for l. 7 Solve -4f = 189 - 169 for f. -5 Solve 6p = 11p - 10 for p. 2 Solve -r - 6r - 28 = 0 for r. -4 Solve -25*a - 78 = -3 for a	{ "pile_set_name": "DM Mathematics" }
hich is the second biggest value? (a) 0.3 (b) -2/9 (c) r a Let s be (-12)/905/(-4). What is the third biggest value in -0.3, -2/11, s? -0.3 Let l = -47 + 47.1. What is the fourth biggest value in 9/7, l, 4, 1? l Let i = -23 + 32. Let g = i + -6. Which is the third biggest value? (a) 0.3 (b) 1/3 (c) g a Let i be (-1)/((-6)/4) + (-56)/147. Let z = 5 - 9. Let x = z - -6. Which is the third smallest value? (a) -0.3 (b) x (c) i b Let t(f) = f2 - 2f - 4. Suppose 15 = 4y - 1. Let x be t(y). What is the third smallest value in -0.2, 0.4, x? x Let z = 0.3 - -1.2. Let d = z + 0.5. Let r = -3.96 + -0.04. Which is the second biggest value? (a) d (b) r (c) 3 a Suppose 0 = -4m - 4, -16 = -3s + m + 12. Let d be s/90(-16)/(-2). What is the third biggest value in 4, d, -5? -5 Let u = 4 + -4.1. What is the third smallest value in u, -2/27, -0.5? -2/27 Let j = -62 + 247/4. What is the third biggest value in -0.4, j, 1/2? -0.4 Let j = 3 - 9. Let s = 7 + j. What is the second biggest value in -1/3, s, 0.5? 0.5 Suppose -x - 6 = -2q, 3x + 5q - 13 = 24. What is the second biggest value in x, 0.1, -2? 0.1 Let p = 4 - 7/2. Let h = 0.7 + -3.1. Let w = h - -2. Which is the biggest value? (a) 0.2 (b) p (c) w b Let o = -17.5 - -18. Which is the biggest value? (a) o (b) -2/11 (c) -2 a Let m = -21 + 22. Let h = 0.5 + -1. Which is the smallest value? (a) 5 (b) h (c) m b Let i be (-2)/(-6) - 16/30. Let y = -21 - -24. What is the biggest value in y, 5, i? 5 Let o = 409/8 - 51. What is the second biggest value in o, -5, 2? o Let t = 0.9 - 0.9. Let a = t + -4. Let v = 0.3 + -0.1. What is the third smallest value in a, -0.2, v? v Let c = 8.04 + -8. Let r = -0.12 + c. What is the smallest value in 1, -4, r? -4 Let t = -7.6 + -0.4. Let j = -8.1 - t. Which is the smallest value? (a) 2/3 (b) j (c) -5 c Let d = 0.11 - -0.29. Which is the third smallest value? (a) 2/13 (b) d (c) 4 c Let q = -3 + 3. What is the biggest value in q, 0.2, -5? 0.2 Suppose -r - 31 = -32. Let l = 3 - 3.1. What is the third smallest value in l, r, 3? 3 Let f be 5/8(-1)/(-5). Let n = 9 - 10. Let o = 0 + -0.1. Which is the second biggest value? (a) f (b) n (c) o c Let j = -0.04 + 3.04. Let m = -3.3 + j. Suppose 0 = 2u - 3q - 2, 2u + 2 - 6 = 4q. Which is the smallest value? (a) m (b) u (c) -1/5 b Suppose 0l = -4l + 12. Which is the second biggest value? (a) -5 (b) 0.1 (c) l b Suppose -3p + 1 = 2v, 6v + 6 = p + v. Let q be 6 - 52(-4)/(-40). Let g = 0 - 0.2. Which is the third biggest value? (a) p (b) g (c) q b Let u = -12 + 22. Which is the third smallest value? (a) -4 (b) 3 (c) u c Let h(g) = -g*2 + g + 2. Let r be h(2). Suppose 0 = 3t - r + 9. What is the smallest value in -2/3, 3/4, t? t Let j be (-24)/42(-7)/2. Which is the third biggest value? (a) 5 (b) 1/2 (c) j b Let d = 27.2 + -27. Let i be (-5)/2 + 1 + 1. What is the third biggest value in i, -0.1, d? i Suppose p + 8 = 5. Let g be (p - -2) + -1 + 2. Let l = -1/48 + -21/16. Which is the second biggest value? (a) g (b) 1/4 (c) l a Let j be -2(-3)/(-6)-1. What is the third smallest value in 0, 4, j? 4 Let v = -0.38 + 0.25. Let i = v + -4.87. Let q = 0 - -0.4. What is the second biggest value in -0.4, i, q? -0.4 Let n = -58 - -40. Let j = -19 - n. What is the smallest value in -1/5, -5, j? -5 Let f = 87.4 + -95. Let o = f - -8. Which is the third smallest value? (a) 0 (b) o (c) 5 c Suppose 0 = 3f - 10 - 2. What is the third smallest value in -0.1, -0.5, f? f Let l(r) = r. Let f be l(-3). Let z = -521/2 - -262. Which is the second biggest value? (a) z (b) -5 (c) f c Let d = 0.018 - 0.068. What is the third smallest value in 1, -2/3, -0.1, d? d Suppose 4s = -2v + 8, -7v - s = -12v - 13. Let l = -0.3 + 0.5. What is the third smallest value in v, l, 1/4? 1/4 Let x be (-2)/304-3. Suppose 30 = 4z - 98. Let k be ((-3)/(-2))/((-264)/z). Which is the second smallest value? (a) k (b) x (c) 2 b Let v be (-70)/38 + (2 - 0). Let s = 1/114 + v. Let l = -72 + 71. Which is the third smallest value? (a) s (b) l (c) -4 a Let n = 278 + -283. Suppose -5g = -0g - 20. What is the second smallest value in n, 0, g? 0 Let r = 3 + 1. Suppose 0 = -4s + 3 + 13. Let g be 1/s-3 - -1. Which is the third biggest value? (a) -0.3 (b) r (c) g a Suppose 3 = -2x + 9. Which is the third smallest value? (a) 2 (b) 0.3 (c) x c Let h = -0.01 + 0.21. Let c(j) = 3j - 1. Let y be c(1). Let d be (1/10)/((-1)/y). What is the second biggest value in d, -0.4, h? d Let j = 15 - 14.7. Which is the second smallest value? (a) 0.1 (b) 0.2 (c) 0 (d) j a Suppose 3a = -0 - 3. Let h be ((-1)/12)/(a/3). Let m = 0.3 - -0.2. What is the second biggest value in m, 5, h? m Suppose 4f - 35 = c - 0c, 35 = -3c - 2f. Let v be c/(-6) - 0 - 1. What is the smallest value in v, 0.4, -3/5? -3/5 Let g = 0 - -0.3. Let u = -0.2 - g. Let c = 0.06 + 2.94. What is the second smallest value in u, 1, c? 1 Let a = 12.4 + -12. What is the smallest value in a, 1/8, -2? -2 Let q = -8.3 - -8. Let s = 17.42 - 0.42. Let f = 12 - s. What is the second biggest value in q, 1, f? q Let g be 10/50(1 + 4). What is the smallest value in -0.3, -3, -1/3, g? -3 Let z = 178 + -529/3. Let r = 1 + -2. Let v = r + 6. What is the third biggest value in z, v, -1? -1 Let y be 2/20(-90)/(-12). Let x = 15 + -15. Which is the second smallest value? (a) 3 (b) y (c) x b Let x be (2/4)/((-63)/(-14)). Let k = 1 + 1. Let v = k - 1.9. What is the second smallest value in v, -0.2, x? v Let w = 0.9 - -0.1. What is the third smallest value in 5, w, 2? 5 Let f = 0.134 + -0.434. What is the smallest value in f, -0.1, 0.5, -0.2? f Let o = 32 + -28. Which is the second smallest value? (a) -0.4 (b) 2 (c) o (d) 0.4 d Suppose 8x - 3x + 20 = 0. Let r = -14.4 + 14.49. Which is the third smallest value? (a) 2/3 (b) x (c) r a Suppose 11i + 1 - 45 = 0. Let h = 6 - 13. Let y = h - -5. Which is the third biggest value? (a) y (b) -5 (c) i b Let i = -1.3 - -6.3. Let f = -3 - -4. Let t = 1.3 - f. Which is the smallest value? (a) i (b) t (c) 0 c Let p = -11 + 9. Let z = -9 - -8. Which is the smallest value? (a) p (b) z (c) 1/4 a Let s be (-2)/(-8) - (-2)/56. Suppose 0 = h + 4h - 15. What is the second biggest value in h, s, -2/21? s Let v = -33 - -33. Let t = -1 + 2. Which is the smallest value? (a) t (b) 0.2 (c) v c Let f be (-6)/117(-5 - -2). Let g be -1 + 32/10. Which is the second smallest value? (a) g (b) 4 (c) f c Suppose -3z = 5a - 5, -a - 4 - 12 = 4z. Let r be (-6)/(-5) - (-4)/(-20). What is the third smallest value in r, a, 2/11? a Let m = 4.94 + -5. Let n = m + 7.06. Let x = n + -5. What is the biggest value in x, 3, 1/10? 3 Let z be 2/6 - 76/156. Let l be 6/142/2. Let u = -1.2 + 5.2. Which is the third biggest value? (a) l (b) z (c) u b Let w = 2.3 - 2.21. Let n = -3.91 - w. What is the second smallest value in -2/3, -0.1, n? -2/3 Let u = 2.9 - 2.5. What is the biggest value in -3, u, 0.07? u Suppose 8 = -3d + 2. Let x be 2 + 3d/(-3). Let p = -2.9 + -0.1. What is the biggest value in -0.4, p, x? x Let k = -0.03 + 3.03. Let g be 0 - (-1)/(3/2). Which is the second biggest value? (a) -5 (b) g (c) k b Let v be (-2)/(7 + (-3)/1). Let y = -21 + 167/8. Which is the smallest value? (a) v (b) 3 (c) y a Let o = 0.3 + 2.7. Let u = o - 3. Let d = -0.1 - u. What is the second biggest value in d, 2, -3? d Suppose -4t + t = 0. Let q be t + 1/(-5) + 0. Let y = -0.35 - 0.05. Which is the second smallest value? (a) 2/5 (b) y (c) q c Let p be (-692)/6(5 - 2). Let y = -614024 - -9205172/15. Let h = y - p. What is the third biggest value in h, -2/5, 0? -2/5 Let k = -4 + 3. Let t = -23 - -23.5. What is the third smallest value in 2/5, t, k? t Let q = -279/2 - -140. Which is the second smallest value? (a) q (b) 0 (c) -0.6 b Let i = -168.96 - -169. Let q be 0 - 1(-1)/2. Which is the smallest value? (a) i (b) -1 (c) q b Let j = -0.05 - 1.95. Let v = j + 1. Which is the biggest value? (a) 3 (b) v (c) 2/5 a Suppose 57f = 56*f + 2. Let m = -5 - -2. Which is the second smallest value? (a) 1/2 (b) f (c) m a Let w = -15 + 11. What is the third smallest value in 0.1, w, -1? 0.1 Let x = 0.34 + -0.04. Let b = x - 0.5. Let q = 8/	{ "pile_set_name": "DM Mathematics" }
) -3/5 (d) -10132 d What is the sixth biggest value in -4, 5, 0.4, 112616, 3, 0.3? -4 Which is the fourth smallest value? (a) -31.28 (b) 9/7 (c) -2/19 (d) 4 d What is the fourth smallest value in 966, 5/11, 2/3, 2/15, 2/5? 2/3 Which is the second biggest value? (a) 0.0549 (b) 5 (c) 4.982 (d) 4/5 (e) -1 c What is the fifth smallest value in -2/3, -1, 1, -2, -15, 4, 120.14? 1 What is the third biggest value in -0.1, 2/9, -6, 0.5, 137/91, -3? 2/9 Which is the second biggest value? (a) 5651 (b) 15/2 (c) -0.351 b What is the third biggest value in 9/9485, -5, 0.053? -5 Which is the fourth smallest value? (a) 6.3 (b) 4 (c) 2/471 (d) -1/4 a What is the second smallest value in 11, 3, 1/69, 2, 1, -3.1, -5? -3.1 What is the smallest value in -99, -0.1, -3658, 0.08? -3658 Which is the third smallest value? (a) 0.107 (b) 4/5 (c) 2/39 (d) -0.01 (e) 74 a What is the second biggest value in -0.3, 2, 0.23, 2/5, -1/7, 0.07, -4/189? 2/5 What is the fourth biggest value in 0.3, 2/25, 9/2, -0.4, 0.62, -0.5? 2/25 Which is the biggest value? (a) 5/3 (b) -0.4 (c) -14/27 (d) 2/5 (e) 4 (f) 22 f What is the biggest value in -0.1, -53405, -2, 1, -0.09? 1 Which is the biggest value? (a) 0.32 (b) 1099 (c) -3/7 (d) 8 (e) -2/9 b Which is the second biggest value? (a) 98 (b) 0.05376 (c) 14 c Which is the third smallest value? (a) -3/8 (b) -246 (c) -0.04 (d) 4/5 (e) -702 a What is the sixth smallest value in -3/2, 3.92, 1, 7, -5, -2, -1/4? 3.92 What is the third smallest value in -6, -0.2, 1418, -1/4, -0.843? -1/4 What is the biggest value in -1420.99, -2.5, 3? 3 Which is the fourth smallest value? (a) -3 (b) 3/4 (c) -159 (d) -4/43 b What is the third smallest value in 2/3, -1/3, -8630? 2/3 Which is the fifth smallest value? (a) 0.2 (b) 0.6 (c) 6 (d) 3 (e) 0 c Which is the sixth biggest value? (a) -5 (b) 4 (c) 0.3 (d) -12 (e) -33 (f) -18 e What is the second smallest value in 6/13, -175, -0.4, 549? -0.4 Which is the third smallest value? (a) 1/2 (b) -0.2 (c) 3246/1781 c What is the fifth smallest value in 2.02, 4, -3, 5675, 5? 5675 Which is the smallest value? (a) 36.31 (b) -42 (c) -0.5 (d) -18 (e) 5 b What is the biggest value in -2/9, 669.5, -257? 669.5 What is the smallest value in 17/8, -23641, 1? -23641 What is the third biggest value in -36, 2/23, 20/267? -36 Which is the third biggest value? (a) -1.6 (b) 10/561 (c) 0 a What is the sixth biggest value in 1.2, 0.4, -2, 0.53, 1/2, 0.3, 191? 0.3 What is the second biggest value in 1, -13, 144/25, 4, 0.4, -7/2? 4 What is the seventh smallest value in -1/8, 1/4, 4, -8, -89, -2, -0.26? 4 What is the fourth smallest value in 3779, 2/13, -0.3, -373? 3779 What is the third smallest value in 0.5, 89854369, -0.2? 89854369 Which is the fourth biggest value? (a) 160/7 (b) -6 (c) 0 (d) 3 (e) -4 (f) 1/11 (g) 0.5 f What is the third biggest value in 1/5, 31.313, 0.85, 7, -0.2, -4/5? 0.85 What is the smallest value in -3/11, 0.0378, 0.135, -4? -4 Which is the fifth smallest value? (a) 8803 (b) -5 (c) 4 (d) 3270 (e) 0.1 a Which is the sixth smallest value? (a) 0.045 (b) -0.5 (c) -0.4 (d) 2 (e) 6.507 (f) 0.1 e Which is the third biggest value? (a) 5 (b) -64/5 (c) -0.81875 b Which is the fourth biggest value? (a) 6/25 (b) 18 (c) -0.22 (d) 8/5 c What is the second smallest value in -1/7, -5, -1/2, -4, -54/7, 0.2401? -5 What is the third smallest value in 3, 1/2, 4, 0.4, 0, 0.8, 1? 1/2 What is the third smallest value in -2/15, -8/35, 247, 0.019? 0.019 What is the seventh smallest value in -0.6, 1/2, 3, 191, -18, -4/7, 2/5? 191 Which is the fifth biggest value? (a) 2 (b) -19 (c) 1 (d) -0.23366 (e) -2/13 b What is the second biggest value in 0.1, -86570, 100, -0.3? 0.1 What is the third biggest value in 21, 8/3, -5/32, -118? -5/32 What is the sixth biggest value in 5291, -14.2, 1, -0.2, 3, -4? -14.2 Which is the third smallest value? (a) -11 (b) 1375 (c) -4.94 b Which is the smallest value? (a) 459 (b) 0.02 (c) 209.93 b What is the sixth biggest value in -3/4, 7, -1, -3/2, 35.6, -0.01, -2/9? -1 What is the third biggest value in -0.42, 7, 469, -33? -0.42 What is the sixth biggest value in -51, 0.5, 2820, -0.8, -1, 0.1? -51 Which is the fifth biggest value? (a) -1.1 (b) -0.02 (c) 3352 (d) 4 (e) 1/4 (f) -3/5 f What is the smallest value in -146/15, 0.1, 31, -2/7, 13? -146/15 What is the third biggest value in 13117313, -2/3, -0.2? -2/3 What is the second smallest value in 3, -27713, -0.052? -0.052 What is the fourth biggest value in 2/5, -0.05168, -5, -1/6? -5 What is the fourth biggest value in -10, 5/4, -103, 11/609? -103 Which is the third smallest value? (a) 0.2 (b) 2 (c) -3 (d) -359/2 (e) -4/3 e Which is the fourth smallest value? (a) -1/10 (b) 3/5 (c) 0.1 (d) 63/1829 b What is the fifth smallest value in -1/12, 1.7, 35/16, 0.5, 1? 35/16 Which is the biggest value? (a) 12 (b) -8 (c) 2 (d) -10 (e) -6/107 a Which is the fifth biggest value? (a) 0.3 (b) -4 (c) 200 (d) 16 (e) 11 (f) 0.1 (g) -24 f What is the fourth biggest value in 3, -3, -2, -3/7, 122, 36.889? -3/7 What is the biggest value in -19, 20, 74, 18/13, 0.2? 74 Which is the smallest value? (a) -3 (b) -4186 (c) 124 b What is the second biggest value in -0.19, -1.1, -3/4, -4, 2/379? -0.19 What is the third biggest value in -0.002, -151.7, -16? -151.7 What is the smallest value in 0.2895, -1, 0, 1737? -1 Which is the fifth smallest value? (a) -5 (b) -0.1 (c) -257 (d) 5 (e) 0.16 (f) -0.01 e What is the second biggest value in -3, -3256, 13/73? -3 Which is the third biggest value? (a) -4440 (b) -11 (c) 1259 a Which is the fourth biggest value? (a) -3 (b) 4/5 (c) 72.2 (d) 3 (e) 2 (f) 65 e What is the seventh smallest value in -17, -1, 0.54, 1, -4, 74, -24? 74 What is the fourth biggest value in 4, 14.3, 0.5, -0.8, 0.18, 0, -6/37? 0.18 What is the fifth biggest value in -1.8, -1, 21.56, -4, 23, 0.5? -1.8 Which is the second smallest value? (a) -0.096 (b) 72289 (c) 0 (d) -8 a What is the smallest value in 107474, -4, -9? -9 Which is the fourth smallest value? (a) 0.4 (b) 2/9 (c) 2 (d) 2/13 (e) 0.2 (f) 1731 a Which is the fourth smallest value? (a) -1 (b) -6215 (c) 184 (d) -3 c What is the biggest value in -2/413, -5, 53, 5/2? 53 Which is the smallest value? (a) 287 (b) -2/11 (c) -0.5 (d) 1/7 (e) 0.23 (f) -32 (g) 0.3 f Which is the third biggest value? (a) -20866 (b) -2/5 (c) -87 a Which is the biggest value? (a) 2.31387 (b) 1 (c) -2/141 a Which is the smallest value? (a) 1/3 (b) 0.0172 (c) 3/5 (d) 11/2 b Which is the fourth smallest value? (a) -708 (b) -6.45 (c) 0.3 (d) 5 d What is the second smallest value in 1/4, -0.5, -11682292, -0.1? -0.5 Which is the third smallest value? (a) 4.28 (b) 53/5 (c) 0 b What is the biggest value in 1/37, -1/3, 0.2, 20, 49, -3, 4/5? 49 What is the fifth biggest value in 55578, -0.2, -0.5, -0.9, 0, 4/7? -0.5 Which is the second biggest value? (a) -3598 (b) 1.32 (c) 3.3 b Which is the second biggest value? (a) 0.3 (b) 2/17 (c) 101.3 (d) -0.2 (e) -0.4 (f) 1 f Which is the third biggest value? (a) 881 (b) 73168 (c) 0.08 c What is the smallest value in -6999, 0.2, -0.3, 8/51? -6999 Which is the fifth smallest value? (a) -10 (b) -6.7 (c) -16 (d) 2/5 (e) 0.17 (f) -5 (g) 1 e Which is the third biggest value? (a) 8 (b) 0.4 (c) 4 (d) 93 (e) -0.3 (f) 1965 a What is the second biggest value in -1/8, 5/904, -4/5, 0.2, -0.11? 5/904 What is the second biggest value in 1097/295, 3, -2/7? 3 Which is the sixth smallest value? (a) 2/7 (b) 2 (c) 0.5 (d) 1 (e) 5/3 (f) 3 (g) -1070 b Which is the second biggest value? (a) 2/3 (b) -1 (c) -605 (d) 0 (e) 94 a What is the second smallest value in 0.1, 0.01, -464, -0.07? -0.07 What is the second biggest value in -2, 4/3, 5, -714/55? 4/3 Which is the fourth smallest value? (a) -0.5 (b) 3/7 (c) 0 (d) -15 (e) 92 (f) -0.4 (g) -1 f Which is the smallest value? (a) -0.4 (b) 0.2 (c) -23 (d) -3.2624 (e) -4 c Which is the third smallest value? (a) 10672 (b) -1/2 (c) 14/5 a What is the seventh smallest value in 29, -4, 3/5, -3, 0.012, 6.3, -0.4? 29 What is the second biggest value in 4, -1/3, -0.011, 0.05,	{ "pile_set_name": "DM Mathematics" }
) = 12057u - 241158. Determine i(20). -18 Let h(a) = 15a*2 - 96a - 1042. What is h(-12)? 2270 Let h(v) = 2v3 + 2v*2 + 8773v - 150. What is h(0)? -150 Let t(v) = -v*3 - 434v*2 - 15050v - 128. Determine t(-38). -52 Let k(v) = v*3 + 43v*2 + 53v + 533. What is k(-10)? 3303 Let d(j) = -44j + 3001. What is d(68)? 9 Let r(p) = -15163p + 90927. Calculate r(6). -51 Let a(j) = 283j2 + 259j - 776. Give a(3). 2548 Let m(t) = 460t + 67320. What is m(-145)? 620 Let v(f) = f3 + 10f*2 - 260f - 1121. What is v(-21)? -512 Let w(b) = 50b2 + 1257b + 300. Calculate w(-25). 125 Let y(r) = -1289r + 32082. Give y(25). -143 Let z(q) = 2038407q + 18345658. Determine z(-9). -5 Let b(g) = -997g - 108476. Calculate b(-109). 197 Let m(f) = -6f*3 + 264f*2 - 552f - 16321. Calculate m(40). -1 Let y(n) = n*3 + 6n*2 - 5n + 127. Determine y(0). 127 Let p(v) = 482v2 + 4331v - 45. Give p(-9). 18 Let j(g) = 583g2 - 23340g + 787. Determine j(40). -13 Let f(q) = -105q2 - 5450q + 167. Give f(-52). -353 Let c(f) = -3f3 + 154f*2 - 352f + 330. Determine c(49). -111 Let n(i) = 24033i + 696950. What is n(-29)? -7 Let n(c) = 105145c - 630868. What is n(6)? 2 Let a(j) = -5j - 1999. Give a(227). -3134 Let b(x) = -x3 + 264x*2 + 361x - 95232. What is b(264)? 72 Let p(s) = -10653s + 2162575. What is p(203)? 16 Let q(r) = 16r*3 + 151r*2 - 22r - 775. Calculate q(-9). -10 Let h(k) = -3183k + 101901. Give h(32). 45 Let a(y) = -108y*3 - 4y*2 + 11. Give a(2). -869 Let y(j) = 39j + 1291. Calculate y(4). 1447 Let d(h) = -148h - 2379. Calculate d(-12). -603 Let q(s) = 13574s + 135726. Determine q(-10). -14 Let k(z) = -z*2 + 47z - 795. Give k(46). -749 Let n(f) = -126518f + 126606. Determine n(1). 88 Let n(q) = 2q*2 - 124q + 381. Determine n(0). 381 Let x(c) = -3c3 + 21c*2 + 72c - 29. What is x(9)? 133 Let o(t) = 2183t - 51946. Determine o(24). 446 Let b(v) = 684v - 130650. What is b(191)? -6 Let u(j) = 4j2 + 43j - 16541. Determine u(-70). 49 Let g(v) = -v*2 + 184339v + 2212231. Determine g(-12). 19 Let f(c) = 95c2 + 5123c + 111. Determine f(-54). 489 Let x(p) = p*2 - 202p - 1233. What is x(219)? 2490 Let n(v) = 143v2 - 1059v + 747. Give n(6). -459 Let x(n) = 120011n + 2400250. Give x(-20). 30 Let p(g) = -8372g - 101002. Calculate p(-12). -538 Let g(h) = 5h3 + 666h*2 + 127h - 692. Give g(-133). 106 Let y(d) = -11173d + 22356. Calculate y(2). 10 Let t(o) = -o3 + 152o*2 - 669o - 337. Give t(5). -7 Let z(y) = -6y3 + 2272y*2 + 3069y - 11047. What is z(380)? -27 Let t(u) = 15139u - 10218819. Determine t(675). 6 Let g(t) = -2531t + 63558. Calculate g(25). 283 Let n(x) = -4439x - 142033. Calculate n(-32). 15 Let a(z) = 17z - 2058. Calculate a(73). -817 Let u(d) = 12d3 - 71d*2 + 161d - 1769. Give u(7). -5 Let x(a) = 3a3 + 10a*2 - 88a - 301. Calculate x(-5). 14 Let p(t) = -13655t + 81950. Give p(6). 20 Let m(u) = -5189u - 140390. Determine m(-27). -287 Let a(l) = -7479l - 2310996. Calculate a(-309). 15 Let p(m) = -5m*2 - 3230m + 52496. Determine p(16). -464 Let u(g) = 6g3 + 684g*2 + 1373g + 156540. Determine u(-114). 18 Let i(f) = -f*2 - 328f + 29555. Determine i(74). -193 Let v(m) = 2m3 - 128m*2 + 71m + 3540. What is v(63)? 75 Let p(d) = d*2 - 5771d - 285175. Give p(-49). 5 Let s(b) = 43131b + 690081. Determine s(-16). -15 Let o(z) = -28z*3 - 529z*2 - 2z - 60. What is o(-19)? 1061 Let b(r) = 3886r - 16398. Calculate b(4). -854 Let x(a) = -100a - 3512. Calculate x(-35). -12 Let k(g) = -237g - 134648. What is k(-568)? -32 Let g(h) = -h3 + 80h*2 + 1439h - 971. Calculate g(95). 359 Let m(i) = -i*3 - 37i*2 + 128i + 6331. Determine m(-37). 1595 Let c(t) = -2t2 + 253t + 836. Determine c(126). 962 Let v(h) = -10162h + 6584991. Calculate v(648). 15 Let i(a) = 3a*2 + 68982a - 759158. Give i(11). 7 Let r(f) = -f*2 - 26f + 1266. What is r(34)? -774 Let m(s) = -14s3 - 1196s*2 + 1190s + 5. What is m(1)? -15 Let s(d) = 5589d + 112109. What is s(-20)? 329 Let z(q) = 45q*2 + 3595q + 3166. Calculate z(-79). 6 Let r(c) = c*2 + 1429c + 8537. Determine r(-6). -1 Let n(g) = 232g + 23564. Determine n(-102). -100 Let x(l) = -5l*3 + 150l*2 + 26l - 769. Give x(30). 11 Let h(j) = -j*3 + 39j*2 + 755j - 737. Determine h(53). -48 Let o(v) = -457v2 + 95v + 93. Give o(-1). -459 Let r(v) = v*2 + 7788v + 225012. Calculate r(-29). 1 Let w(z) = -z*3 - 16z*2 + 213z + 2005. Determine w(-9). -479 Let c(g) = 331g2 - 474g - 960. What is c(-2)? 1312 Let k(x) = -3x3 + 6x*2 + 73x + 465. Give k(-9). 2481 Let h(b) = b*3 - 98b*2 + 31. Calculate h(98). 31 Let h(c) = 10184c - 1548039. What is h(152)? -71 Let f(q) = -q*3 + 22q*2 - 182q + 4139. Determine f(22). 135 Let v(j) = 2j2 + 50j - 4083. What is v(-60)? 117 Let j(q) = 2q3 + 122q*2 + 347q - 84. What is j(-58)? -26 Let u(r) = 56r - 7930. Calculate u(141). -34 Let k(m) = 6m*3 + 114m*2 + 94m - 250. Calculate k(-18). 2 Let l(o) = -205o - 7079. What is l(-36)? 301 Let s(y) = -326y*2 - 51510y - 309. Calculate s(-158). 7 Let v(y) = y*2 - 78y + 403. Calculate v(58). -757 Let p(r) = 7452r + 7292. What is p(-1)? -160 Let o(q) = -q2 - 574q - 82026. What is o(-305)? 19 Let g(r) = 2r3 + 200r*2 + 1140r + 1124. Determine g(-94). -4 Let g(b) = -2b3 + 31b*2 + 3116b + 228. Determine g(48). 36 Let i(r) = 2r2 - 12217r - 257433. Determine i(-21). 6 Let r(o) = o*2 - 1259o + 46401. Calculate r(38). 3 Let z(u) = -7u2 - 47u + 263. Determine z(21). -3811 Let r(s) = 13s2 + 169s + 199. Calculate r(-5). -321 Let m(r) = -569r - 135962. Give m(-239). 29 Let f(d) = -5d*2 - 134d - 167. What is f(-44)? -3951 Let z(s) = 12268s - 49065. What is z(4)? 7 Let w(b) = b3 - 33b*2 + 284b - 12406. Give w(35). -16 Let n(m) = 69m3 - 286m*2 - 12m + 59. Determine n(4). -149 Let c(v) = -v*3 - 624v*2 + 2912v + 646445. What is c(-627)? 8 Let h(i) = -5i3 - 416i*2 - 50i + 2799. What is h(-83)? 60 Let l(c) = 15c3 + 48c*2 + 6c + 33. Determine l(-3). 42 Let a(j) = -2j3 - 7j*2 + 777j + 3172. Determine a(-4). 80 Let n(w) = 3w2 + 21250w + 84961. Determine n(-4). 9 Let o(r) = 53r3 + 17r*2 - 125r + 110. Calculate o(1). 55 Let b(z) = 2z3 + 58z*2 - 490z - 90. Determine b(7). 8 Let a(n) = 1667n - 311635. Calculate a(187). 94 Let c(r) = -39r*2 - 2027r + 52. Give c(-52). 0 Let d(v) = v*2 - 1267v + 5041. Give d(4). -11 Let f(b) = -651b - 14792. What is f(-22)? -470 Let k(q) = 336q - 14747. What is k(45)? 373 Let h(i) = 10i2 + 25222i + 25229. Determine h(-1). 17 Let l(h) = -9h3 - 358h*2 + 85h + 193. What is l(-40)? -7 Let f(w) = -3w3 - 92w*2 + 809w - 119. Determine f(7). 7 Let s(n) = n*2 + 413n + 14059. Calculate s(-374). -527 Let i(q) = 16581q + 150181. Determine i(-9). 952 Let t(b) = 95b*2 - 963b + 136. Determine t(10). 6 Let o(d) = -7d2 - 421d - 2837. What is o(-50)? 713 Let h(f) = 46758f + 561100. Give h(-12). 4 Let m(w) = -12980w + 376414. Give m(29). -6 Let h(j) = j*3 - 13j*2 - 103j + 1007. Give h(10). -323 Let b(l) = -10l2 + 170l + 2. What is b(2)? 302 Let a(h) = -49684h - 62303747. What is a(-1254)? -11 Let x(s) = 2s*3 + 19s*2 + 1433s + 34091. Determine x(-19). 5 Let f(w) = 68w2 + 3746w - 11491. What is f(-58)? -7 Let z(g) = -13967g - 1173138. Give z(-84). 90 Let a(p) = p3 + 63p*2 + 9p - 530. Give a(-63). -1097 Let x(y) = y*2 + 8y - 2934. What is x(-63)? 531 Let n(p) = 16p2 - 100p + 139. Determine n(12). 1243 Let i(o) = -53o - 451. Give i(6). -769 Let c(j) = -2j*3 + 116j*2 + 1369j - 630. Calculate c(68). -18 Let a(d) = -36d2 - 16d + 406. What is a(0)? 406 Let x(a) = 964012a - 7712090. Determine x(8). 6 Let a(g) = -g3 + 418g*2 - 3217g + 4771. Give a(2). 1 Let w(v) = 66v2 - 856v - 958. Give w(14). -6 Let u(h) = -520h - 5132. Determine u(-11). 588 Let s(f) = 72f*2 + 14f - 199. Calculate s(4). 1009 Let p(h) = -h*2 + 1515h - 522520. Give p(531). -16 Let j(n) = 8227n + 8246. Calculate j(-1). 19 Let r(a) = 73631a - 957256. Give r(13). -53 Let u(m) = m*3 + 11m*2 + 51m + 2596. Determine u(-17). -5 Let c(j) = -1714*j - 28446	{ "pile_set_name": "DM Mathematics" }
*3 + 21o*2 + 2o - 48. Let k = -792 + 813. Determine q(k). -6 Let g(i) be the third derivative of -i4/12 - i3/2 + 51i2. What is g(-5)? 7 Let t = 27 - 24. Let x(i) = i2 + i + 1. Give x(t). 13 Let t(v) = -v3 - 8v*2 - 2. Suppose 2k + 0k = -2x + 20, 30 = 2k + 4x. Suppose -k = -2d - 1. Let f be -1 - d - (3 - -2). Calculate t(f). -2 Let s(b) = b3 + 4b*2 + 2b + 2. Suppose v + 3y = 38, 4y = -0v - v + 37. Let k = -35 + v. Suppose kz = 11z + 20. Calculate s(z). -6 Suppose -5w + 2w - 5l = -8, 20 = -3w + 2l. Let r(v) = v + 6v + 3 - 9v + 0v. Determine r(w). 11 Suppose 3 = 3x - 7d + 3d, 0 = 4x - 4d - 8. Let k(j) be the second derivative of -1/3j3 + 0 + xj - 1/2j2 - 1/4j4. Determine k(-1). -2 Let p(g) = g2 - 11g + 4. Let b = -2089 - -2099. What is p(b)? -6 Let d be ((-1239)/295)/((-7)/10). Let f(c) = c2 - c - 26. Give f(d). 4 Let v(n) = 2n + 24. Let h be -17 - (1 + (-5 - 6)). What is v(h)? 10 Let l(m) be the third derivative of m6/120 + m5/60 - m4/8 + m3/3 - m*2. Let v = 24 - 22. Suppose -vx - 3x + 10 = 0. Give l(x). 8 Let k = 88 + -92. Let z be (-2)/k(-2 + -6) - -9. Let m(g) = -2g - 5. Determine m(z). -15 Let v(l) be the second derivative of l5/20 - l4/3 - l3 + 136l. Let h be 2 - -2 - 1 - -2. What is v(h)? -5 Let v(y) = -10y2 + 2y - 3. Let x(a) = -a*2 + 1. Let o(d) = -v(d) - 2x(d). Let k = 16591 - 16590. Determine o(k). 11 Let i(q) be the third derivative of q4/24 - q3/6 + q*2. Let y(g) = -4g - 19. Suppose -6v - 16 = -2v. Let k be y(v). Calculate i(k). -4 Let b(d) = -3d + 8. Let l(f) = -4f + 12. Suppose 0 = 5r - 4a - 16 - 25, 0 = 5r + 4a - 9. Let h(c) = rl(c) - 7b(c). What is h(3)? 7 Let d(q) = q*3 - 4q*2 - 2q + 2. Let f = 361 - 359. What is d(f)? -10 Let i(v) = v*3 - 4v*2 - v + 3. Suppose -c + 51 = 46. Calculate i(c). 23 Let h(i) = -10i*2 + 4i + 3. Let q(t) = -7t2 + 4t + 2. Let s(v) = -2h(v) + 3q(v). Calculate s(5). -5 Let j(s) be the second derivative of -37s + 1/6s*3 + 0 - 1/12s4 - s2. Determine j(3). -8 Let s(f) = f*3 - 8f*2 + 14f. Let v be s(6). Let l(c) = -c*3 + 13c*2 - 12c + 11. Determine l(v). 11 Let m(z) = -39 + 66 + 4z2 - 31 + z3 + 3z - 4z. What is m(-4)? 0 Let a(h) be the third derivative of -h6/120 + h5/60 + h4/8 + h3/3 + 8h*2 + 21h. Calculate a(-1). 1 Let d(a) = a3 - a2 - a - 4. Let c = 210 - 210. Give d(c). -4 Let h(s) = 1 - 8 + 3s - 4s*2 + 5s2. Let x(a) = -a2 - 4a + 8. Let z = 178 - 172. Let o(f) = zx(f) + 7h(f). Determine o(4). 3 Let c be 55 + -59 - -212. Let b(h) be the first derivative of h2 - 1/4h*4 + 0h - 3 + ch3. Determine b(-2). 4 Let w = 3 + -3. Suppose wg - 5g = -30. Let h(s) = -s + 1. What is h(g)? -5 Let j(q) = -2q - 5. Let c be 9/(-3)(7 - (6 - 1)). What is j(c)? 7 Suppose x + 0 = -3. Let g(z) be the second derivative of z3/6 - 3z*2/2 + 14z. Give g(x). -6 Let j(z) be the second derivative of z*4/12 - 3z*2 - 9z. Let y = 48 - 48. Determine j(y). -6 Let j(r) be the second derivative of r*3 + 2r - 1. What is j(-4)? -24 Suppose 88b = 86b - 12. Let h(y) = y + 2y + 2 - y. Give h(b). -10 Let y(m) = 7m + 6. Let d = -8 - -12. Let r(t) = 3t + 3. Let o(h) = dy(h) - 9r(h). Suppose 3x + 2x + 20 = 0, 4x + 16 = p. What is o(p)? -3 Let y(x) = x*3 + 5x*2 + 7x + 4. Let d(a) = -a*2 - 4a - 3. Let h be d(-2). Suppose 3b - 32 - h = 0. Let s be b + -12 + 1 + -4. Determine y(s). -8 Let n(l) be the second derivative of 5/24l*4 + 1/120l*5 + 5/3l*3 + 0 - 11l + 0l2. Let i(o) be the second derivative of n(o). Determine i(-4). 1 Let q be 15/(-3) + 4/2. Let l be (-9)/(-27)-9(-2)/3. Let r(y) = 2129 - 2131 + y - ly. Give r(q). 1 Let o(v) = 15v + 21. Let b(y) = -8y - 10. Let i(f) = 9b(f) + 5o(f). Let h be i(-6). Let m(l) = 2l2 + 5l + 2. Calculate m(h). 5 Let k(g) = 2g. Suppose -4a - 3n = 25, -4a - a + n - 17 = 0. Let s be a/(-16) - 3/(-4). Let f be (0 + 0 - s)1. Calculate k(f). -2 Let g(p) be the first derivative of p3/3 + p2/2 + 8p - 75. Determine g(0). 8 Let c = 517 - 514. Let i(b) = b*2 - 6b + 10. Determine i(c). 1 Let x(h) = -h*3 - 5h2 - h - 5. Let p(f) = f3 - 4f2 - 3f*2 - 3f + 5f + 16f*2 + 9. Let c(l) = -6p(l) - 11x(l). Let o = -1 + 2. Determine c(o). 6 Suppose -g = -7v + 4v + 6, -2 = -v - 2g. Suppose -3z = vz - 70. Suppose 0 = zy - 18y + 32. Let a(f) = -f*3 + 9f*2 - 7f - 11. Calculate a(y). -3 Let t(u) = u - 7. Let z be (0 + 1)/(-2)(20 - 10). What is t(z)? -12 Suppose 5o = 4u - 2, -2o - 6u + 10 = -4u. Let b(d) = -2d3 - 3d*2 + 4d - 4. What is b(o)? -24 Let t(q) be the second derivative of -q*6/90 + 7q*3/6 + 3q. Let g(u) be the second derivative of t(u). Let i be ((-2)/4)/((-5)/(-10)). Give g(i). -4 Let n(c) = -2c - 8. Let p(u) = 1. Let t be 7 + -7 + (-2)/(-2). Let z(r) = tn(r) + 2p(r). Calculate z(-7). 8 Suppose 0 = 4u - 50 - 106. Let m = -34 + u. Let l(x) = 0x + 0x2 - x2 - 2 + 6x. What is l(m)? 3 Let w(t) = 16t + 82. Let h be w(-5). Let r(x) = -x*2 + 5x - 5. Calculate r(h). 1 Suppose -2p = -4l - 108, -p - 5l = p - 81. Let q be p/(-8)8/(-6). Let d(m) = m*3 - 8m2 + m. Give d(q). 8 Let n(o) = o3 + 6o2 - o - 5. Suppose 2l = -2l + 36. Suppose -ld - 6 = -8d. Determine n(d). 1 Let s be (-1 - -6)(-1 - 0 - -2). Suppose -26 = -4g + 2w, sg + 5w - 8 = 2. Let a(n) = -3n - 2n + 4n. Calculate a(g). -5 Let v = 2189 - 2189. Let g(l) = -l + 7. Determine g(v). 7 Let a(y) = -20y*2 + 6y*3 + 34y*2 - 13y2. Let s = -17 - -16. What is a(s)? -5 Let v(r) = -r2 + 6. Let f = 12 - 9. Let h be v(f). Let z be (-42)/(h - -1). Let w(i) = 2i - 6. Give w(z). 2 Let q(c) = 428 - 6c2 - 3c*3 - 869 + 4c*3 + 5c + 438. What is q(4)? -15 Let g = -98 + 108. Suppose -5u - 2m - g = -0m, m + 5 = u. Let p(f) = 2f*3 + 0 - 3f*3 - 2. What is p(u)? -2 Let n = -2 + 2. Let o(f) = -7f*3 - 7f*2 - 2f - 3. Let q(x) = -3x3 - 3x*2 - x - 2. Let m = 5 + -1. Let c(b) = mo(b) - 9q(b). What is c(n)? 6 Let y = 326 + -332. Let z(k) = -k3 - 6k*2 - 2k - 7. Give z(y). 5 Suppose -6s = 15s - 147. Let p(o) = 5 - 9o - 4o*2 + 5o*2 + 2o. What is p(s)? 5 Let y(u) = -u*2 - 3u + 3. Let b(q) = -2q + 1. Let d be b(-2). Suppose -df + 1 = -4r + 5, 12 = -4r + f. What is y(r)? -1 Let n(y) = y*2 + 15y + 5. Let f be n(-15). Suppose 0 = ft - 0 - 10. Let u(l) = 10l*2 - 12l*2 + 3l*t. Give u(0). 0 Let h(n) = -3n*3 - 3n*2 - 2n - 1. Suppose 1 = -3f - 4y - 1, -y + 5 = -2f. What is h(f)? 15 Let p(k) be the third derivative of -k5/60 + k4/24 + k3/3 - k2 - 52. Suppose d = 2 + 1. What is p(d)? -4 Let i(n) = -3n2 - n3 + 3n + 6 - 13 + 10. Give i(-3). -6 Let j(b) be the second derivative of -1/6b*3 + 0 - 2b + 7/2b2. Suppose -q = 2i + 2i - 14, 0 = -q + 2i + 2. Give j(q). 1 Let r(g) = -g - 3. Let h be r(-6). Suppose -hu - 6 = -0m - 3m, 0 = 3u + 5m - 18. Let y(n) be the first derivative of n3/3 - n2 + n - 11. What is y(u)? 0 Let l(p) = p3 + 5p*2 + 2p + 3. Let i(x) = 5x + 40. Let n(d) = -26d - 201. Let m(j) = -11i(j) - 2n(j). Let v be m(-11). What is l(v)? -7 Let c = -10 + 5. Let g(k) = 2k - 5 + 560k*2 - 559k*2 + 5. Calculate g(c). 15 Let l(s) = 2s - 5 - 2 + 0s2 - 3s*2 + 8. Give l(-1). -4 Let w(t) = 21t + 154. Let m(v) = -7v - 52. Let j(q) = 8m(q) + 3w(q). Give j(-7). -3 Let v(k) = -2k*2 - 3k. Let a(d) be the first derivative of d*4/4 - 5d*3/3 + 2d*2 - 5d + 1. Let x be a(5). Let b = 12 - x. Determine v(b). -9 Let b(v) = -v - 1. Let c(u) = u + 6. Let s(r) = -2b(r) + c(r). Let p(i) = i + 1. Let m(f) = -6p(f) + s(f). Give m(5). -13 Suppose i = 13i + 60. Let o(f) = -f3 - 4f*2 + 7f + 5. Give o(i). -5 Let a(s) be the third derivative of 0s + 0 - 16s*2 - 1/6s*3 + 11/30s*5 - 1/12s4. What is a(-1)? 23 Let o(k) = k2 - k - 1. Let d be o(3). Let l(i) = -i + 28. Let m(c) = c - 47. Let u(g) = -2l(g) - m(g). Determine u(d). -4 Let o(j) be the second derivative of j3/2 + j2 + 47j. Give o(-3). -7 Let i be (5/(-3))/(1/3). Let f(v) be the second derivative of 1/20v5 - 1/3v*3 + 5/12v*4 + 13v - 7/2v2 + 0. What is f(i)? 3 Let r be (-20)/(-15)((-9)/6 - -3). Let j(m) = -3m*r + 1 + 4 -	{ "pile_set_name": "DM Mathematics" }
rime factors of 182515649. 23, 7935463 What are the prime factors of 46472989? 47, 107, 9241 What are the prime factors of 77935791? 3, 79, 149, 2207 List the prime factors of 123662428. 2, 131, 235997 What are the prime factors of 2505790483? 7, 357970069 List the prime factors of 64723309. 7, 521, 17747 What are the prime factors of 54418215? 3, 5, 73, 49697 What are the prime factors of 104564492? 2, 61, 101, 4243 What are the prime factors of 760959225? 3, 5, 13, 86719 What are the prime factors of 2500361849? 2500361849 What are the prime factors of 110465059? 31, 3563389 What are the prime factors of 2581355967? 3, 67, 12842567 List the prime factors of 1058264425. 5, 1009, 41953 List the prime factors of 38435540. 2, 5, 11, 13, 89, 151 List the prime factors of 30337344. 2, 3, 31, 1699 List the prime factors of 6289820750. 2, 5, 25159283 What are the prime factors of 118081673? 118081673 List the prime factors of 64628622. 2, 3, 271, 13249 List the prime factors of 974587404. 2, 3, 7, 11602231 What are the prime factors of 3042668055? 3, 5, 7, 59, 491149 What are the prime factors of 47447650? 2, 5, 139, 6827 What are the prime factors of 2610433239? 3, 870144413 What are the prime factors of 319525408? 2, 9985169 What are the prime factors of 3896681333? 17, 229216549 What are the prime factors of 2426502515? 5, 1657, 292879 List the prime factors of 1248571456. 2, 11, 53, 109, 307 List the prime factors of 2954183832. 2, 3, 29, 67, 7039 What are the prime factors of 48407488? 2, 193, 3919 What are the prime factors of 92648146? 2, 46324073 List the prime factors of 130192958. 2, 7, 41, 226817 What are the prime factors of 15628087? 103, 151729 What are the prime factors of 16996788? 2, 3, 472133 What are the prime factors of 102188416? 2, 11, 72577 What are the prime factors of 623090590? 2, 5, 62309059 What are the prime factors of 32037977? 2719, 11783 List the prime factors of 199070665. 5, 2917, 13649 List the prime factors of 53079582. 2, 3, 211, 41927 What are the prime factors of 1709692818? 2, 3, 37, 7701319 List the prime factors of 254513702. 2, 19, 2029, 3301 What are the prime factors of 72472232? 2, 7, 19, 68113 What are the prime factors of 1096386485? 5, 2293, 95629 List the prime factors of 2483271094. 2, 1241635547 List the prime factors of 1032624. 2, 3, 71, 101 What are the prime factors of 1428601? 1428601 List the prime factors of 3569681627. 23, 155203549 List the prime factors of 29602053. 3, 13, 503 What are the prime factors of 7355566? 2, 3677783 List the prime factors of 95327338. 2, 331, 143999 What are the prime factors of 36133483? 17, 23, 92413 List the prime factors of 538851872. 2, 13, 1295317 List the prime factors of 88338423. 3, 23, 1280267 List the prime factors of 1593611146. 2, 796805573 What are the prime factors of 21274182? 2, 3, 137, 8627 List the prime factors of 45670977. 3, 11, 461323 List the prime factors of 72562499. 97, 109, 6863 What are the prime factors of 439377852? 2, 3, 17, 2153813 List the prime factors of 745360883. 191, 479, 8147 List the prime factors of 5692591624. 2, 1667, 426859 What are the prime factors of 10257656? 2, 47, 27281 List the prime factors of 324371461. 23, 1597, 8831 What are the prime factors of 879186415? 5, 37, 4752359 List the prime factors of 433553232. 2, 3, 7, 139, 9283 List the prime factors of 478729661. 478729661 List the prime factors of 553203344. 2, 73, 473633 List the prime factors of 54204960. 2, 3, 5, 112927 What are the prime factors of 265344691? 691, 384001 List the prime factors of 73643074. 2, 163, 223, 1013 List the prime factors of 536721247. 47, 601, 19001 List the prime factors of 4949540119. 131, 37782749 What are the prime factors of 142154733? 3, 7, 79, 12241 What are the prime factors of 77521338? 2, 3, 101, 42641 List the prime factors of 496043369. 23, 31, 89, 7817 List the prime factors of 19078560. 2, 3, 5, 13249 List the prime factors of 1010930041. 11, 17, 5406043 List the prime factors of 4991487. 3, 53, 31393 What are the prime factors of 895211374? 2, 37, 12097451 List the prime factors of 255998468. 2, 11, 739, 7873 What are the prime factors of 111415493? 7, 15916499 List the prime factors of 400203011. 13, 30784847 What are the prime factors of 2279888232? 2, 3, 94995343 List the prime factors of 20361773. 2693, 7561 What are the prime factors of 31475166? 2, 3, 5245861 List the prime factors of 182538032. 2, 79, 144413 List the prime factors of 19374067. 17, 509, 2239 List the prime factors of 1250699545. 5, 250139909 List the prime factors of 1272363745. 5, 254472749 List the prime factors of 573087398. 2, 13, 22041823 What are the prime factors of 467905635? 3, 5, 10397903 What are the prime factors of 115208685? 3, 5, 19, 127, 1061 List the prime factors of 41835439. 41835439 What are the prime factors of 3076944633? 3, 7, 1049, 46559 List the prime factors of 53288883. 3, 359, 16493 List the prime factors of 34668469. 11, 47, 67057 What are the prime factors of 843814593? 3, 23, 173, 23563 List the prime factors of 603009327. 3, 19, 97, 109063 What are the prime factors of 2013908955? 3, 5, 31, 4330987 List the prime factors of 830904554. 2, 415452277 List the prime factors of 685862357. 127, 419, 12889 List the prime factors of 303777876. 2, 3, 25314823 What are the prime factors of 7121857? 2053, 3469 What are the prime factors of 4330422964? 2, 7, 1489, 103867 What are the prime factors of 1107544563? 3, 41020169 What are the prime factors of 87727336? 2, 23, 59, 8081 What are the prime factors of 704640220? 2, 5, 35232011 What are the prime factors of 82203769? 82203769 List the prime factors of 1917946432. 2, 151, 198463 What are the prime factors of 933228048? 2, 3, 19442251 What are the prime factors of 1555685655? 3, 5, 239, 433943 List the prime factors of 104212586. 2, 23, 367, 6173 List the prime factors of 409480207. 17, 24087071 List the prime factors of 223825378. 2, 7, 15987527 What are the prime factors of 166457194? 2, 83228597 List the prime factors of 4702841388. 2, 3, 7, 1459, 12791 What are the prime factors of 72345777? 3, 7, 263, 13099 What are the prime factors of 6079697274? 2, 3, 7, 144754697 List the prime factors of 35099186. 2, 17, 1032329 What are the prime factors of 88293122? 2, 2801, 15761 What are the prime factors of 38687271? 3, 7, 1842251 What are the prime factors of 853021618? 2, 79, 2063, 2617 List the prime factors of 303136436. 2, 2161, 35069 List the prime factors of 128008451. 128008451 What are the prime factors of 5007371678? 2, 2503685839 List the prime factors of 85462182. 2, 3, 13, 53, 2297 What are the prime factors of 252163685? 5, 5297, 9521 List the prime factors of 425047592. 2, 101, 526049 What are the prime factors of 84731807? 113, 277, 2707 What are the prime factors of 1941920923? 167, 2729, 4261 What are the prime factors of 1027714139? 31, 67, 479, 1033 What are the prime factors of 307632239? 1171, 262709 What are the prime factors of 114862494? 2, 3, 19143749 List the prime factors of 46791031. 7, 136417 What are the prime factors of 652784688? 2, 3, 73, 62099 What are the prime factors of 3029602704? 2, 3, 47, 1342909 List the prime factors of 14958462. 2, 3, 2493077 What are the prime factors of 324433889? 13, 281, 88813 What are the prime factors of 15101284? 2, 11, 41, 761 What are the prime factors of 257200582? 2, 17, 23, 328901 What are the prime factors of 314194961? 29, 271, 39979 List the prime factors of 637294289. 139, 4584851 List the prime factors of 708437913. 3, 131, 1802641 What are the prime factors of 117936485? 5, 61, 386677 What are the prime factors of 707485596? 2, 3, 19, 31, 199, 503 What are the prime factors of 134738792? 2, 41, 410789 List the prime factors of 820828987. 11, 4547, 16411 What are the prime factors of 463306317? 3, 19, 419, 1021 What are the prime factors of 1200985749? 3, 133442861 List the prime factors of 688249946. 2, 61, 5641393 What are the prime factors of 137762435? 5, 193, 142759 List the prime factors of 12955408. 2, 223, 3631 List the prime factors of 81199781. 13, 43, 145259 What are the prime factors of 338134119? 3, 112711373 List the prime factors of 12040133. 7, 29, 37, 229 What are the pr	{ "pile_set_name": "DM Mathematics" }
econd biggest value in -1/9, v, l? l Let y = 4 + -6. Let r be 15/(-20) - y/(-8). What is the third smallest value in 7, 0.1, 2/11, r? 2/11 Let q(l) = -l*3 - 23l*2 - 41l + 26. Let m be q(-21). Let y be m/(90/228) + (-4)/6. Which is the second smallest value? (a) 1 (b) y (c) 0.1 (d) -2 c Let a = 76 + -76.1. What is the second biggest value in a, 4/31, -1/2? a Let f = 4 - 4.3. Let r = f + 5.3. Let u = 147 + -146.6. Which is the second biggest value? (a) r (b) -0.1 (c) u c Let c = 0.76 + -1.2. Let w = c + 0.14. Let y = w - 0. What is the smallest value in 0.3, -5, y? -5 Let r = 79.4 - 76.4. What is the biggest value in -33, -0.4, r? r Let n = 538 + -533. Let y = 7.7 - 8. Which is the third biggest value? (a) 0.2 (b) n (c) y c Let m be 6 + (-16)/3 - 1. Which is the fourth biggest value? (a) 1/65 (b) 1 (c) -2/11 (d) m d Let c(y) = y*2 + 6y - 10. Let t be c(-7). Let x = -619/2142 - -1/306. What is the biggest value in t, x, 2? 2 Let u = -5 + 8. Let m = -0.372 - 0.628. What is the fourth smallest value in u, m, 1/6, 0.4? u Let t = -123 + 125. What is the third smallest value in t, 1/78, -1? t Let g = 1.483 - 0.483. What is the second biggest value in -4/3, -0.02, -3, g? -0.02 Let z = -411 + 492. What is the second smallest value in 2, -3, z, 1/4? 1/4 Let o = 0.224 + 0.006. Let v = 0.17 + o. Let m = 0.1 - -0.4. What is the third smallest value in v, 1/7, m? m Let g be 24/(576/(-60)) - (0 - 3). What is the second biggest value in -2/131, g, -0.1? -2/131 Let k(v) = -v*2 - 7v - 2. Let i be k(-7). Let d be 87 - ((5 - 1) + i). Let a = d + -423/5. What is the second smallest value in 0.5, 3/2, a? 0.5 Let f = -5 - 37. Let w = -43 - f. Which is the biggest value? (a) w (b) 0.13 (c) 0.1 b Let i(y) = 5y2 - 3y*2 - 37 - 23y - 3y2 + 0y*2. Let h be i(-21). Which is the smallest value? (a) -0.4 (b) -1 (c) h (d) -0.2 b Let h = -324 - -329. Which is the second biggest value? (a) 3 (b) -1.1 (c) h (d) -1 a Let k = -2 + 13. Let o = 15 - k. Which is the third biggest value? (a) 2/5 (b) -3/2 (c) o b Let u = 17 - 16.3. Let l = u - 11.7. What is the smallest value in -5, 0, l? l Let u(s) = -6s + 9. Let l be u(4). Let h = l - -20. Let g = 1 - -1. Which is the second biggest value? (a) 2/3 (b) h (c) g c Let z = 42.094 - 0.094. Let x = -46 + z. Which is the third biggest value? (a) 0.1 (b) -2/7 (c) x c Let s = 10 + 0. Let r = 9.6 - s. Let q = 0.89 + 0.11. Which is the smallest value? (a) -4 (b) r (c) q a Let v = 0.066 - 0.03. Let n = v + 0.064. Which is the fourth smallest value? (a) -3 (b) -0.4 (c) 8 (d) n c Suppose -60 = 5h - 5g, 0 = -2h + 5g - 364 + 322. Let c = -0.11 - -0.1. What is the biggest value in h, c, 5? 5 Let b = 675 + -670. What is the smallest value in -1/2, b, 1, 3? -1/2 Let s = 475.7 - 476. Which is the biggest value? (a) -0.08 (b) s (c) -1/2 a Let r = -698 + 677. What is the second smallest value in -2/3, -4, -2/5, r? -4 Let i = -6 + -16. Let l = i - -22. Let s be (20/14)/(-5) + l. Which is the biggest value? (a) -1/4 (b) s (c) -0.4 a Let z = 16.64 - 4.64. Which is the third biggest value? (a) 5/2 (b) z (c) -1 c Let d = -1.7 - -1.5. What is the smallest value in 2/15, -1/9, d? d Let l = -303/388 + 3/97. Let i = -12.9 + 12. Let q = i + -2.1. Which is the third smallest value? (a) q (b) l (c) 0.03 c Let y be (-1 - -3)2/(-6). Let h = -1.3 + 1.2. Let z = 6 - 2. What is the third smallest value in y, z, h? z Suppose 0 = -a - 2m, -2a = 11m - 6m. What is the second biggest value in a, 2, 6? 2 Let p = -28.8 + 28.8. What is the fourth smallest value in p, 18/5, 5, 1/5? 5 Let z = 1/40 + -3/20. Let m = 16.83 + -17.13. What is the smallest value in -1, z, m? -1 Let i = 0.2 + 0.1. Let z = 0.5 - i. Let a = -316.2 - -316. What is the third smallest value in a, -0.1, z? z Let o = 38.9 - 38.4. Suppose 0 = v + 4v + 25. Which is the biggest value? (a) -4 (b) o (c) v b Let w be 26/(-8) - -3 - (-34)/72. What is the second biggest value in w, -0.03, 0.5, -3? w Let y = 64 - 68. What is the second smallest value in 0.47, y, 0.4, 4? 0.4 Let g = 249 - 3733/15. Let x = -15 - -20. What is the biggest value in 3/7, g, -1, x? x Let r = 14 - 10. Let m = r - 18. Let u = m - -13. What is the third biggest value in 0.5, 2, u? u Let x = -60.032 - -60. Let l = -4.968 + x. What is the smallest value in 2, l, 3? l Let i = 6 - 4.3. Let t = i + 0.3. Let c = 210.1 - 210. What is the second biggest value in c, 7, t? t Let x(c) = c3 + c2 - c + 5. Let r be x(0). Let q = 785 - 782. What is the second smallest value in r, -3, q, 4/3? 4/3 Let d = -0.05 - 79.95. Let j = 75 + d. Let n = 6.5 + -0.5. Which is the third biggest value? (a) j (b) 5 (c) n a Let g be (166/54 - 2) + -1. Let l = 8 + 50. Let d = l - 56. Which is the third smallest value? (a) d (b) -2 (c) g a Let y(l) = -5 - l - 3l + 14l*2 - 15l*2. Let o be y(-5). Let w be (-2)/(-5)o/6. Which is the second smallest value? (a) 0.5 (b) w (c) -2/7 c Let o = -4.582 + 1.582. What is the biggest value in 0.488, o, -0.1? 0.488 Let h = 16/45 - 5/9. Let o = -21.8 - 3.2. Let w = o + 25. Which is the biggest value? (a) -4 (b) h (c) w c Let r = -111 - -175. Let w = r - 39. Let d = 24 - w. Which is the third smallest value? (a) -0.2 (b) -2/9 (c) d a Let k = -714 - -703. Which is the biggest value? (a) 3 (b) 15 (c) k b Let p = 27 - 23. Let g = -668/7 + 96. Which is the third smallest value? (a) p (b) g (c) 3 a Suppose 0 = 368z - 377z + 108. What is the second smallest value in -0.06, z, -0.07? -0.06 Let i = 1.339 + -8.709. Let k = -0.13 + i. Let z = -8 - k. What is the smallest value in -2/7, 0.1, z? z Let n = -814 + 815. Which is the biggest value? (a) -2/9 (b) 0.4 (c) n (d) -8 c Let d = 68.7 - 68.59. What is the third smallest value in 4, -1, d? 4 Let l = -1010.7 + 961. Let f = l + 50. Let w be 3/6 + 3/(-14). Which is the third smallest value? (a) w (b) f (c) -1/7 b Let x = 1.93 + 0.07. Let g = -0.78 - -1. Let n = g - 0.12. Which is the smallest value? (a) n (b) 3/5 (c) x a Suppose 2h + 16 + 8 = 0. Let i = 14 + h. Suppose -3k + i = -2k. What is the smallest value in k, 0, -8? -8 Let g = -734 - -3669/5. Which is the fourth biggest value? (a) 0.07 (b) g (c) -1/32 (d) 0.1 b Let v = -57 + 85. Let a = -59/2 + v. Let m = 12.8 - 15.8. What is the biggest value in a, -1, m? -1 Let k(m) = -25m*2 + 3m. Let j be k(-3). Let o be ((-6)/(-4))/(j/(-24)). Let z = 1 + -4. What is the biggest value in o, 4/3, z? 4/3 Let n = 0.0061 + 1.9939. What is the smallest value in 5, 0.2, 4, n? 0.2 Let f(c) = -c*3 - 12c*2 - 10c + 15. Let k be f(-11). Suppose k = y - 11. What is the fourth biggest value in y, -1, 3, 0.2? -1 Let f = -0.03 + 2.03. Let l = 55/9 - 37/6. Let z(d) = d*3 + 6d*2 + 9d + 3. Let x be z(-4). Which is the second biggest value? (a) x (b) f (c) l c Suppose 24 = -17p + 41p. Which is the fourth smallest value? (a) -2 (b) p (c) -57 (d) 2/7 b Let u be (-9)/(-3)6/9. Let l(j) = 4 - 12 + 2j + uj - 6j. Let k be l(-7). What is the second smallest value in -3, 0.4, k? 0.4 Let u = 523.9 + -468. Let f = u - 56. Which is the second biggest value? (a) 2 (b) -4 (c) f c Let a = 42.3 - 39. Let f = -3.2 + a. What is the biggest value in 0.2, f, -4? 0.2 Let f = -133.061 + 133. Let k = f - -0.561. What is the second smallest value in 1, -2/13, k? k Let g = 1.04 + -0.04. Let k = 154.7 - 155. Which is the second smallest value? (a) g (b) k (c) 5 (d) -2/9 d Let l = -33.4 - -33. Let i = l - -0.5. What is the second biggest value in 1, i, -0.2? i Let x = -85 + 41. Let d = -44.23 - x. Let q = 4.77 - d. What is the second biggest value in q, -0.5, -0.1? -0.1 Let h = 1848.81 + -1840. Let q = h + 0.19. Let o = q - 10. Which is the third smallest value? (a) 0.5 (b) -0.3 (c) o a Let i = 618.2 + -618. What is the third biggest value in 2/7, 1, 1/24, i? i Let u = 0.18 + -8.18. Let c = -7.94 + -0.06. Let m = c + 7. What is the smallest value in u, -3, m? u Let n = 38.14 - 38. Let d = 0.64 - n. What is the third smallest value in 3, d, -0.3, 4? 3 Let k = -49 + 49.5. Which is the second biggest value? (a) -1 (b) -0.6 (c) k b Let j = 29 - 17. Let q = -16555 + 16556. Let w(d) = -d*3 + 3d*2 - 3d. Let z be w(2). Which is the second bigg	{ "pile_set_name": "DM Mathematics" }
ence csc? 4/35 Three letters picked without replacement from {q: 2, a: 2, u: 1, k: 1, r: 1, i: 2}. Give prob of sequence qiq. 1/126 Two letters picked without replacement from {a: 4, h: 3, g: 1, w: 1, b: 3, l: 3}. Give prob of sequence al. 2/35 Calculate prob of sequence lhs when three letters picked without replacement from hhghhfhsshlhhhghsfss. 5/684 Four letters picked without replacement from jzhzzzzzzpoojz. Give prob of sequence zjzj. 2/429 Two letters picked without replacement from {y: 1, m: 1, e: 1, v: 1, a: 2, q: 8}. Give prob of sequence qm. 4/91 Calculate prob of sequence cwic when four letters picked without replacement from fwccwwfwpwwwwwvvwwi. 11/46512 Four letters picked without replacement from qcccqqqccrrrqr. What is prob of sequence crrc? 10/1001 What is prob of sequence sss when three letters picked without replacement from {s: 10, a: 2}? 6/11 Four letters picked without replacement from twwkkktllkkkwklkwlkk. Give prob of sequence wwwl. 4/4845 Three letters picked without replacement from hvhsslsoohhhoi. Give prob of sequence hiv. 5/2184 What is prob of sequence mm when two letters picked without replacement from eemmmmpqmmmemmemmme? 22/57 Calculate prob of sequence rz when two letters picked without replacement from {a: 3, z: 8, r: 2, j: 6}. 8/171 Three letters picked without replacement from {d: 1, h: 1, l: 2, r: 1, v: 2}. What is prob of sequence ldr? 1/105 Three letters picked without replacement from vjjvvyjlqvjvjyvv. What is prob of sequence vvv? 1/16 Calculate prob of sequence qq when two letters picked without replacement from qhhqqqqhhqhq. 7/22 Two letters picked without replacement from {x: 1, q: 1, l: 3, h: 1, w: 1}. Give prob of sequence wq. 1/42 Three letters picked without replacement from gogggggoggggoogo. Give prob of sequence ogo. 11/168 What is prob of sequence hmhm when four letters picked without replacement from {y: 9, h: 3, m: 4}? 3/1820 What is prob of sequence uk when two letters picked without replacement from {k: 1, i: 1, u: 2, x: 1, r: 1, v: 2}? 1/28 What is prob of sequence cz when two letters picked without replacement from {o: 2, x: 2, i: 1, z: 2, c: 1}? 1/28 What is prob of sequence rw when two letters picked without replacement from {w: 3, x: 4, r: 1, d: 5}? 1/52 Calculate prob of sequence pwww when four letters picked without replacement from ccwywcccpwcycywcycc. 1/3876 Calculate prob of sequence gksq when four letters picked without replacement from ggssqsqsssk. 1/330 Two letters picked without replacement from kkkkmmmwxik. What is prob of sequence ix? 1/110 What is prob of sequence wct when three letters picked without replacement from {a: 3, t: 4, n: 3, c: 2, w: 4}? 1/105 Calculate prob of sequence vpgl when four letters picked without replacement from whvwgvwlpwggvvg. 2/4095 What is prob of sequence vu when two letters picked without replacement from {v: 2, c: 2, u: 1, s: 5, k: 2, n: 2}? 1/91 What is prob of sequence sy when two letters picked without replacement from {s: 1, y: 1, t: 1}? 1/6 Calculate prob of sequence me when two letters picked without replacement from {e: 3, x: 4, i: 1, a: 1, m: 2, n: 1}. 1/22 Three letters picked without replacement from hhpysjyg. What is prob of sequence yyh? 1/84 Calculate prob of sequence ppss when four letters picked without replacement from {s: 3, f: 1, p: 12}. 33/1820 Three letters picked without replacement from {h: 11, p: 3}. Give prob of sequence ppp. 1/364 Calculate prob of sequence qo when two letters picked without replacement from {k: 1, f: 1, o: 1, q: 2, v: 4}. 1/36 Three letters picked without replacement from {o: 1, f: 1, x: 2, k: 2}. Give prob of sequence xok. 1/30 What is prob of sequence gert when four letters picked without replacement from {u: 1, r: 2, e: 1, g: 1, t: 2, w: 1}? 1/420 What is prob of sequence uii when three letters picked without replacement from euii? 1/12 Calculate prob of sequence adk when three letters picked without replacement from daekdwdmwwdaad. 5/728 Three letters picked without replacement from rtiittairtizoo. Give prob of sequence rza. 1/1092 Calculate prob of sequence gm when two letters picked without replacement from mgm. 1/3 What is prob of sequence oo when two letters picked without replacement from uouuuuouu? 1/36 What is prob of sequence ss when two letters picked without replacement from tssskts? 2/7 Three letters picked without replacement from nbwbwwnbbnnbwwnwww. What is prob of sequence bbb? 5/408 Calculate prob of sequence zzzz when four letters picked without replacement from {v: 1, o: 5, z: 8, c: 2}. 1/26 Three letters picked without replacement from {q: 1, u: 1, j: 1}. What is prob of sequence uqj? 1/6 Three letters picked without replacement from wnoovewww. Give prob of sequence von. 1/252 Four letters picked without replacement from fttttrftrftfttrfrtta. Give prob of sequence rart. 1/969 What is prob of sequence pp when two letters picked without replacement from pypppppppyytpppp? 11/20 Three letters picked without replacement from pbbppbbbbppbbppbbpp. Give prob of sequence bpp. 40/323 Two letters picked without replacement from {i: 7, t: 12}. What is prob of sequence ii? 7/57 What is prob of sequence eek when three letters picked without replacement from ekkkkwewkwwwwkwwkkk? 1/323 Two letters picked without replacement from llxllklllllllll. Give prob of sequence xl. 13/210 Calculate prob of sequence dit when three letters picked without replacement from {i: 1, d: 2, k: 2, t: 1}. 1/60 What is prob of sequence tuu when three letters picked without replacement from uuuufufdefuudtuw? 1/60 Two letters picked without replacement from {s: 3, e: 2, t: 2, c: 2}. Give prob of sequence ct. 1/18 Two letters picked without replacement from dpddpddp. What is prob of sequence dd? 5/14 Calculate prob of sequence itfi when four letters picked without replacement from {t: 1, f: 2, i: 11}. 5/546 Four letters picked without replacement from {h: 4, j: 1, q: 1, z: 4}. What is prob of sequence hqhj? 1/420 Calculate prob of sequence ao when two letters picked without replacement from ozokvma. 1/21 What is prob of sequence aarb when four letters picked without replacement from {r: 1, b: 2, a: 2}? 1/30 Calculate prob of sequence hoex when four letters picked without replacement from {o: 4, w: 1, x: 3, k: 7, h: 1, e: 2}. 1/3060 Three letters picked without replacement from {c: 2, o: 1, y: 1, t: 4, s: 6, g: 1}. Give prob of sequence ssc. 2/91 What is prob of sequence tftf when four letters picked without replacement from {f: 6, t: 4}? 1/14 Two letters picked without replacement from {j: 2, f: 1, t: 4, u: 1, r: 9}. Give prob of sequence ft. 1/68 Two letters picked without replacement from ppgj. What is prob of sequence pp? 1/6 Two letters picked without replacement from {d: 2, q: 10}. What is prob of sequence qd? 5/33 Two letters picked without replacement from fzfzhfhhzzfzhh. What is prob of sequence hz? 25/182 What is prob of sequence vbv when three letters picked without replacement from {o: 2, p: 1, b: 7, n: 7, v: 3}? 7/1140 Calculate prob of sequence jnn when three letters picked without replacement from nnnjnjjnjjjjnn. 7/52 Two letters picked without replacement from mbmmmmmmmmmmmmmmmm. What is prob of sequence bm? 1/18 What is prob of sequence eeee when four letters picked without replacement from xxeexjjjejexjj? 1/1001 Three letters picked without replacement from {z: 5, q: 5, f: 1, r: 1, h: 1, d: 4}. Give prob of sequence ddr. 1/340 What is prob of sequence rlrk when four letters picked without replacement from {w: 1, k: 1, r: 4, l: 10, m: 4}? 1/969 What is prob of sequence wtw when three letters picked without replacement from ptppppppppwtpppwpppt? 1/1140 Two letters picked without replacement from {i: 1, g: 2, b: 1, a: 4, h: 1, t: 3}. Give prob of sequence ta. 1/11 Two letters picked without replacement from oxefdddfoof. What is prob of sequence dx? 3/110 What is prob of sequence yd when two letters picked without replacement from {y: 1, o: 1, u: 1, d: 1, z: 5}? 1/72 Two letters picked without replacement from ocsmmks. What is prob of sequence ck? 1/42 What is prob of sequence sp when two letters picked without replacement from {h: 1, w: 1, o: 3, s: 1, f: 5, p: 6}? 3/136 Calculate prob of sequence dd w	{ "pile_set_name": "DM Mathematics" }
2j2 - 4j2 - j2 - j + j + (-6j + j + 4j)(-2j + 0j + 0j). -2j2 + 17 Expand (-15m*4 - 33m*4 + 75m*4)(-1 + 3m + 1)((2 + 0 - 3)(1 - 2 + 0) + (2 + 3 - 4)(4 + 3 - 6)). 162m5 Expand ((-1 + 1 + g)(-3 + 0 + 1) - 2g - 2 + 2)(-3g + 5g + 4g). -24g*2 Expand (3h*2 + 0h + 0h)(h + h + h)(-10 + 2 - 2). -90h*3 Expand (-a + 0 + 0)(0 + a*4 + 0) + 2a*5 + 2a*5 - 5a*5 + (21a - 21a - a2)(-a3 + a3 + 3a3). -5a*5 Expand (-2 + 0 - 3)(3p2 - 5p*2 + 0p*3 - 4p*3). 20p*3 + 10p*2 Expand (2x*3 + 4x*3 - 3x*3)(3 - 3 + x) + x4 + 1 - 1 + (-x4 - 2x4 + 2x*4)(1 + 1 - 4) - 4x4 + 0 + 0. 2x4 Expand u2 - u2 + u2 + (3u + u - 2u)(2u - 2u - 2u) - 2u2 - u2 + 2u*2 - 1 - 2u*2 - 24u + 1. -6u2 - 24u Expand (3 + g*2 - 3)(0 - 5 + 4)(3 - 2 - 3)(-9g - 6g + 9g). -12g*3 Expand (r + r + 0r)(1 - 3 + 0 - 3 - 3 + 7 - 1 - 2 + 4 + (2 + 1 - 2)(-5 + 2 + 2) - 2 + 1 - 3). -10r Expand (2 - 14 - 1)(-2p3 + 2p*3 - 2p*3). 26p*3 Expand (1 - 3 + 1)(3f2 - 4f2 - f2 + f - 2). 2f2 - f + 2 Expand (0 + 4 - 3)(6d - d - 8d) + 15d - 14d - 20d. -22d Expand (2d2 - 4d*2 - 3d*2)(-16 + 12 + 7). -15d2 Expand (2m*3 - 4m3 + m3)(-2 - 5m + 2 + (2m - 2m + m)(1 - 2 + 3) - 3m + 4m - 3m). 5m4 Expand 5l*4 + 8l - 8l + (l2 - 2l*2 + 0l*2)(6l2 - 2l2 - l2) + l*4 + 0l + 0l. 3l*4 Expand (-4 - 3 - 3i + 8)(-5i2 + i2 + 2i2). 6i*3 - 2i*2 Expand 3r5 + r5 + r*5 + (6r*3 - 2r*3 - 3r*3)(-r*2 + 5 - 5) - 2r*3 + 2r*5 + 2r*3. 6r*5 Expand (8s - 19s + 6s)(0 - 2 + 3). -5s Expand (-4n + n + 4n)(1 - 1 - 3n)(-2 - 1 + 6)(2n - 5 + 5). -18n*3 Expand 6u*3 + 2u*3 - 3u*3 + 0u*3 - 2u3 + u3 - 3u + 3u - u*3 + 0u + 0u - u3 + (4u3 - u3 - 5u3)(4 - 5 + 3). -2u3 Expand (0y + 4y - 3y)(-3y + y + 1 + 1) + (y + 0 + 0)(-2y - y + 4y). -y2 + 2y Expand (-1 + 0 - 1)(-3l - 2 + 2l + 0l). 2l + 4 Expand (3w*2 - 6w*2 - 3w + 5w)(-17w2 + 2w*2 - 3w*2) - 3w*4 + 0w*3 + 0w*3 + (0w - 2w + 4w)(2w*2 - 2w2 - w3). 49w4 - 36w*3 Expand (3z - 3z - 4z + (-3 + 1 + 1)(-2z - 2z + 6z))(6 + z2 - 6 + z + z4). -6z*5 - 6z*3 - 6z*2 Expand (2 - 6 + 3 + (-1 + 1 + 1)(-5 + 5 + 2) + 2 + 1 - 1)(a4 + 2a5 - a4). 6a5 Expand -h2 - 3h2 + h2 + (4h + h - 4h)(-3h + 3h - h). -4h*2 Expand (-2m - 3m + m)(2 + 1 + 2). -20m Expand (g - 5g + 2g)((-7 + 3 + 2)(0 - 12 + 0) + 1 - 2 - 1). -44g Expand (-1239o2 + 1239o*2 + 48o*4)(-o + 6o - 3o). 96o5 Expand (3j2 + j3 - 3j2)(3j - 4j - j - 2j + 2j + j + (-2j + 5j - 4j)(-2 - 2 + 6) + 3j - 5j + 3j). -2j*4 Expand (-3b*2 - 3b*2 + 11b*2 + 2b2 - b2 + 0b2 + (1 + 2 - 2)(1 + b*2 - 1) + 0b*2 - 4b*2 + 7b*2)(2b + 3b - 3b). 20b*3 Expand (-s - 2 + 2)(-3s2 + 2 - 2) - 1 + 1 - s3 + (-2 + s + 2)(4s2 - 5s*2 + 3s*2). 4s*3 Expand (9 - 34 + 6)(q*2 + 0q*2 - 2q*2). 19q*2 Expand (-9r*2 + 0r*2 + 2r*2)(0 + 0 + 3r) + 2r3 + r3 - r*3. -19r*3 Expand -6l + 4l + 4l + l - 1 + 1 + (3l - 2l - 3l)(5 - 4 + 1) + 73l - 142l + 37l. -33l Expand (-f + 4f - 4f)(2 - 2 - 1 + 0 + 2 + 0 + (1 + 0 + 0)(1 + 0 - 2) - 4 + 6 - 1 - 3 + 6 - 1). -3f Expand (0 + 0 + 2)(4j + 5j + j). 20j Expand (-4p + 5p - 7 + 0p)(2 - p4 - 2). -p5 + 7p*4 Expand (-16t*3 + 27t - 1 - 7t3 + 21t*3)(0t2 - 3t2 + t2). 4t5 - 54t*3 + 2t*2 Expand (f - 3 + 3)(78 + 87 - 46 + 59). 178f Expand 3k + k*2 - 3k - 1 + (-11k2 + 11k*2 - 6k*2)(3 + 1 - 3). -5k2 - 1 Expand 2j3 - j3 - 2j3 + (-j + 0 + 0)(-2j - 2j*2 + 2j) + 2j3 - 2 + 2 + 3. 3j*3 + 3 Expand (-17p*2 + 4 - 18 + 12)(-3p3 - p3 + 5p*3). -17p*5 - 2p*3 Expand (3w2 + w2 - 3w2)(-w - 3 + 3) - w*2 - 2w*3 + 4w*3 + 13w2. w3 + 12w2 Expand (-1 + 2n + 1)(n + 1 - 1) + 0n + 0n + 3n*2 - 3n + 3n - 2n*2. 3n2 Expand (-1 + 1 + j2)(-2j - 2j + 3j) + 2 - j3 - 2 + j3 - 2j2 + 2j2. -j3 Expand (-4i + i + 2i)(-1 - 2 + 1)(0i4 - 3i*4 + 2i*4) - 8837i*2 - 119i*5 + 8837i*2. -121i*5 Expand (15 - 7 + 2i - 5)(3 - 5 + 1). -2i - 3 Expand (-4 - 11 + 8)(6 - 3 - 1)(-1 - 4 + 4)(2 - 2v*2 - 2). -28v*2 Expand (2 - 1 + 2)((0s3 + s3 + 0s*3)(-4s + 2s + 3s) + 3s*4 + 0s4 - s4 + (-4 + 4 + 1)(-s4 + 3s4 - s4)). 12s4 Expand 0g + 0g + g + (-2 + 1 + 4)(2 + g - 2) + 2g + g - g + 1. 6g + 1 Expand (-5 + 4 - 1 + 1 - 3 + 3 + (3 - 4 + 0)(0 - 1 + 0) + (1 + 2 - 1)(1 + 0 - 3))(6z - 2z + 6z). -40z Expand (-k + 2k + k - 6k - k + 2k + (3k - 4k + 0k)(-2 + 1 + 3) + (-1 - 1 + 0)(-4k + 3k + 3k) + k + 5k - 4k)(0 + 3 - 7). 28k Expand (0x - 2x + 3x)(-4 + 0 + 2)(7 - 2 - 1). -8x Expand (-f*4 - 2f*2 - 146 + 283 - 2f - 144)(-5 + 3 + 0). 2f*4 + 4f*2 + 4f + 14 Expand (-3 + m + 3)(5 + 5 + 17). 27m Expand (2q - 3q - 3q)(-5q4 - 1 + 1) - 5q + 5q + 4q*5. 24q*5 Expand (-8 - 4o + 8)(4 - 3 - 3)(-4o + 6o - 3o). -8o*2 Expand (4z - z - z)(4z + 5 - 1 - 5). 8z2 - 2z Expand (-38 + 38 - 28m2)(-2m - m + m). 56m*3 Expand (3 + 0 + 1)(0v - 4v + v)(2 + 0 - 4). 24v Expand (-1 + 3 - 3)(1 + 2w*4 - 1) - 13w*4 - 2w + 0w + 3w. -15w4 + w Expand (1 - 7j*2 + 12j*2 + 6j*2)(-3j3 - 2j*3 + 3j*3). -22j*5 - 2j*3 Expand (2o - 2 + 2)(-7o*2 + 3o*2 + 9o*2). 10o*3 Expand (-j + 5 - 5)(-2j + 0j + j) + 4j2 + 2j*2 - 4j2 - j2 + 31j2 + 6j*2. 39j2 Expand (-y2 - 7y2 + 0y*2)(0 + 0 + 2) - y*2 + 4y2 - y2 - 1 + 1 - y*2 + (0y + 2y2 + 0y)(-3 - 1 + 5). -13y*2 Expand (-4i + 2i + 0i)(-18i + 9 + 18i - 2i*4). 4i*5 - 18i Expand -3a + 2a + 3a + 3a - 3a - 2a - a - 3 + 3 + (2 + 2 - 3)(-6a + a + 4a) + 0 - a + 0 + 4a - 4a + 4a. a Expand 0x3 + 2x*4 + 0x*3 - 17 + 17 - 2x4 - x + x4 + 0x4 + x4 + (x3 - 5x*3 + 2x*3)(2x - x - 2x) + 0x4 + 5x*4 - 3x*4. 6x*4 - x Expand (3b - b + 0b)(5 + 2 - 5)(-98b + 0b - 34b). -528b2 Expand (1 - 1 + 2p)(3p*2 - 4p*2 + 3p*2) + (4p + 12 - 5p + 0p)(3p - 3p + p2). 3p*3 + 12p*2 Expand (-3l + 0l - l)(-1 + 5 - 1) - 3 + 6l + l - l. -6l - 3 Expand (-l - l + 4l)(-4l3 - 3l3 + l3) + (-5l2 + 0l*2 + 3l*2)(l - l - 2l2). -8l*4 Expand ((0u*2 + 0u*2 + 2u*2)(0u - 2u + 0u) - 1 - u3 + 1 - 2u*3 + 1 - 1 + 3u*3 - 4u*3 + 3u*3)(-9u + 9u - 5u2). 25u*5 Expand (1 + 0 - 2)(-3w3 + 2w*2 - 2w*2). 3w*3 Expand (2f*2 - 2f2 + f3)(-1 + 1 + f2 + (-f + 3f - 4f)(4f + 3f - 3f)). -7f*5 Expand (6 - 10 - 3x*2 - 4)(0 - 2x + 0). 6x*3 + 16x Expand (-4 + 3 + 2)(13t - 13t + 7t) - 4t + 3 - 3. 3t Expand -2f4 + 6f*4 - 3f*4 + (-6f*2 - 8 + 8)(-3f2 - 26 + 26). 19f*4 Expand (-7g*2 + 0g + 0g)(3g - 2g + 10 - 14). -7g3 + 28g2 Expand (c2 + c*2 - 3c*2)(5c - 5c - 6c3)(1 + 2 - 2). 6c5 Expand -151 + 10g + 151 + 2g - g + g + 0g + 0g + g + (0 + 4 - 3)(-3g + 2g - g). 11g Expand (-1 + 1 - 2r)(3r*3 + 0r3 - r3) + (-5r + 4r + 3r)(-2r3 + 2r*3 - 2r*3). -8r4 Expand -f5 - f2 + f2 + (2f2 + f2 - f2)(-2f3 - 3f*3 - 8f*3) + 0f*5 + 0f*5 - 2f*5. -29f*5 Expand (4l + 0l - 2l)(-7 + 7 - 4l)(-2l - 4l + 4l). 16l3 Expand (1 + 4 - 3)(4y4 + 2y*4 - 4y*4 + (0y3 + y3 - 3y3)(-y - y + 0y) + (3y*3 + 4y*3 - 5y*3)(3y - 4y - 3y)). -4y*4 Expand (-u - u + 4u)(25u - 286 + 286) + 3u2 + 3u*2 - 7u*2. 49u*2 Expand ((5o - 3o - o)(6o - 3o - 4o) + 7 - 2o*2 - 7)(o - 1 + 1)(3 + 1 - 2). -6o*3 Expand (2m - 2m2 - 2m + (3m - 3m + 2m)(2 - 2 - m))(16 - 4 + 5)(-6 + 5 + 3). -136m2 Expand g2 - 6g*2 - 6g*2 + (2 - 2 - 1)(0 + 2g2 + 0). -13g*2 Expand (-s - 2 + 2 + 2)(-2s + 2s - s4). s5 - 2s4 Expand (4 - 3 + 4)(1 - 1 - i) + 3i + 4i + 0i. 2i Expand (3r3 - 3r*3 + 3r*3 + (1 + 0 - 2)(-r3 + r3 - 2r3))((0 + 0 - 1)(-6 + 3 + 2) + 3 - 5 + 4). 15r*3 Expand (0 - j + 0)(3j + 0j - 2j) + (-2j**2 + 2	{ "pile_set_name": "DM Mathematics" }
) = t*3 + 135t*2 + 259t - 706. What is b(-133)? 225 Let a(w) = 2w3 - 94w*2 + 1139w + 143. Determine a(14). 3153 Let n(v) = v*2 - 4249v - 197543. Determine n(-46). 27 Let u(k) = k*3 - 12k*2 - 143k + 989. Calculate u(17). 3 Let t(q) = 3393q - 139124. What is t(41)? -11 Let v(y) = -15161y + 363861. What is v(24)? -3 Let x(p) = -2p3 - 24p*2 + 610p - 46. Give x(-23). -2438 Let d(x) = 732x + 12035. Determine d(-16). 323 Let l(c) = c2 - 2009c - 690093. What is l(-299)? -1 Let y(r) = -2r3 + 76r*2 - 323r - 786. What is y(7)? -9 Let l(m) = -68m2 + 63m - 264. Give l(5). -1649 Let h(v) = 5613v - 21574. Give h(4). 878 Let o(x) = -7x*3 - 1142x*2 - 35700x - 623. What is o(-121)? -18 Let w(x) = -3x2 - 116x + 533. Calculate w(4). 21 Let v(o) = o*3 + 450o*2 + 2479o + 309967. Calculate v(-446). -3 Let h(k) = -1720k2 - 20638k + 24. Calculate h(-12). 0 Let a(z) = 4z2 - 6340z - 167535. Determine a(-26). 9 Let o(g) = -46758g + 1402735. Determine o(30). -5 Let k(g) = 182g*2 + 39g - 38. Calculate k(1). 183 Let s(u) = -5u3 + 41u*2 - 59u - 48. Determine s(6). -6 Let s(m) = 189m2 - 486m + 2047. Calculate s(4). 3127 Let x(b) = b*3 - 400b*2 - 1662b + 18596. Give x(404). 12 Let g(v) = -3899v2 - 35087v + 23. Determine g(-9). -13 Let h(i) = -111340i - 668036. Give h(-6). 4 Let v(l) = -943l*2 - 5494l + 983. Determine v(-6). -1 Let j(d) = -8d2 + 342d + 5. Determine j(42). 257 Let i(g) = -g*3 + 170g*2 - 4274g - 853. Determine i(31). 232 Let y(p) = -138557p + 138558. What is y(1)? 1 Let w(h) = 9228h + 8678. Calculate w(-1). -550 Let u(y) = -113y + 17077. What is u(150)? 127 Let x(l) = l3 - 921l*2 + 209092l - 1022. Determine x(515). 8 Let z(t) = -3t3 - 87t*2 - 950t - 7230. Determine z(-19). -10 Let t(z) = 3z2 + 128z - 282. What is t(-33)? -1239 Let a(h) = -14023h2 + 28046h - 8. Calculate a(2). -8 Let o(m) = 2093m2 + 89998m - 44. Determine o(-43). -1 Let j(h) = 116h + 9539. Determine j(-60). 2579 Let k(z) = -538z - 859. What is k(-3)? 755 Let b(a) = -70a3 - 24a*2 + 6a + 12. Give b(-1). 52 Let a(p) = -1852p + 837100. Give a(452). -4 Let y(a) = -48042a + 960838. Calculate y(20). -2 Let p(z) = 10z3 + 82z*2 + 1001z + 7955. Determine p(-8). 75 Let o(w) = -w*3 - 4w*2 + 210w + 906. Determine o(-4). 66 Let m(r) = -1341r - 47743. Determine m(-36). 533 Let w(t) = -2t*3 + 110t*2 + 2883t - 5253. Calculate w(74). 1 Let v(p) = 15861p - 47572. What is v(3)? 11 Let y(q) = -2q*3 + 96q*2 + 408q + 465. Determine y(52). 49 Let z(k) = 4k2 - 23073k - 3. Give z(0). -3 Let b(n) = 5195n - 877939. What is b(169)? 16 Let w(x) = -198881x + 795508. Calculate w(4). -16 Let n(q) = 4081q - 13447. Determine n(3). -1204 Let m(p) = 63p*2 + 5415p - 172. Calculate m(-86). 86 Let x(n) = n*3 - 7318n + 29197. Give x(4). -11 Let u(p) = -3p2 + 34p - 12. What is u(12)? -36 Let f(p) = -1840p + 36776. What is f(20)? -24 Let m(g) = -23g*3 - 612g*2 + 1556g - 1128. Give m(-29). 3 Let h(t) = -466t2 + 10732t + 97. Determine h(23). 419 Let f(l) = -l*3 - 772l*2 + 116224l + 634. Determine f(129). -11 Let b(v) = -1001047v + 7007294. Determine b(7). -35 Let s(u) = -56u*3 - 1848u*2 + 21u + 716. Calculate s(-33). 23 Let x(w) = -18w3 + 1746w*2 + 21w - 2172. Determine x(97). -135 Let r(s) = 27s + 6323. Calculate r(-238). -103 Let j(l) = -l2 + 24l - 126. Determine j(7). -7 Let l(p) = -1001p - 32118. Determine l(-32). -86 Let k(o) = 9o*3 + 23o*2 - 86o - 265. Give k(-3). -43 Let o(d) = 2d3 + 271d*2 + 4233d + 81. Give o(-18). 27 Let c(m) = -m*3 + 54m*2 - 335m + 42. Give c(46). 1560 Let x(l) = l*2 + 9124l - 173923. Determine x(19). -206 Let p(y) = 4y3 + 608y*2 - 3782y + 1593. Give p(-158). 13 Let m(j) = 75j3 + 45j*2 - 129j - 23. Give m(-2). -185 Let o(w) = w*2 - 6376w + 19132. Give o(3). 13 Let m(i) = 241i + 13241. What is m(-55)? -14 Let w(c) = -1589c + 1090048. Determine w(686). -6 Let g(o) = -o*2 - 17471o + 87363. Determine g(5). -17 Let j(w) = -316w - 4706. What is j(-16)? 350 Let i(t) = -4t*3 + 2t*2 - 52t - 671. What is i(-8)? 1921 Let v(s) = -8s3 - 265s*2 - 38s - 17. What is v(-33)? 148 Let i(n) = -4n2 + 931n + 279. Give i(233). 46 Let y(s) = -16s2 + 1105s + 2200. Calculate y(71). -1 Let b(w) = -213w - 839. What is b(-4)? 13 Let k(w) = -w2 - 333w - 26382. Determine k(-137). 470 Let o(t) = 2t3 - 143t*2 - 3329t - 196. Give o(90). -106 Let f(x) = -x*3 - 291x*2 - 2259x + 28. Calculate f(-8). -12 Let g(a) = -292a - 2056. Determine g(-9). 572 Let q(u) = 190u*2 + 4u - 109. What is q(0)? -109 Let g(s) = -156s2 + 56s + 25. Determine g(0). 25 Let x(h) = 5h3 + 207h*2 + 785h - 1067. What is x(-37)? 6 Let k(v) = 23v3 + 11v*2 + 187v + 773. Give k(-4). -1271 Let b(g) = 3g3 + 27g*2 - 39g - 139. Calculate b(-12). -967 Let h(s) = 5s3 + 5s*2 - 25s - 30. Give h(-1). -5 Let m(a) = a*3 - 133a*2 + 1015a - 935. What is m(7)? -4 Let h(b) = -2b3 + 155b*2 - 2863b + 11. Determine h(31). 631 Let h(i) = -119i2 - 1282i - 28. What is h(-11)? -325 Let l(g) = -3g2 - 73g + 226. Determine l(10). -804 Let w(p) = 5763p + 2760464. Calculate w(-479). -13 Let l(i) = -33i*2 + 70i - 255. Give l(3). -342 Let g(k) = 592k - 17688. Give g(30). 72 Let j(t) = 1431378t + 11451030. Determine j(-8). 6 Let h(j) = 153j + 38275. What is h(-247)? 484 Let j(l) = -l3 + 145l*2 + 140l + 915. Give j(146). 39 Let o(x) = -12073x + 2173138. Give o(180). -2 Let i(j) = -2j*3 + 10j*2 + 9j - 69. What is i(8)? -381 Let v(t) = -t*3 + 14t*2 + 683t - 67. Determine v(34). 35 Let r(z) = -1263z + 318279. Calculate r(252). 3 Let g(m) = 8m*2 + 792m + 15639. Calculate g(-29). -601 Let p(q) = 173q2 + 18334q - 754. Determine p(-106). -330 Let d(o) = -13o2 - 1112o - 11113. Calculate d(-74). -13 Let h(k) = -78168k + 2814043. What is h(36)? -5 Let c(b) = -4b*3 - 37b*2 + 19b - 104. What is c(-10)? 6 Let u(j) = -7j2 - 1183j - 29956. Give u(-138). -10 Let y(a) = -13a3 - 2a*2 + 17a + 23. What is y(-4)? 755 Let h(p) = -3381p + 20893. Give h(6). 607 Let r(p) = -4p*3 - 123p*2 + 149p - 4889. Give r(-33). -5 Let h(j) = 468675j + 1874700. Calculate h(-4). 0 Let a(l) = -75l*2 - 16124l + 213. What is a(-215)? -2 Let c(g) = 3g2 - 50g - 461. What is c(-12)? 571 Let t(x) = 44198x - 176872. Calculate t(4). -80 Let a(g) = g3 - 340g*2 - 708g + 9746. Determine a(342). 1538 Let y(u) = u*3 - 8u*2 - 561u + 2269. Calculate y(-22). 91 Let q(y) = 17844y - 535329. Determine q(30). -9 Let g(m) = 348m*2 + 146m + 283. Give g(-2). 1383 Let y(v) = 24v2 - 1561v + 10956. Calculate y(8). 4 Let v(h) = -h*3 + 51h*2 - 370h - 119. Give v(10). 281 Let z(x) = 2x2 + 149x - 13950. Give z(52). -794 Let p(v) = v*3 + 31v*2 + 227v - 255. Calculate p(-17). -68 Let j(h) = -11592h + 150694. What is j(13)? -2 Let o(q) = 65q*3 - 6369q*2 - 98q - 38. Give o(98). -38 Let o(j) = -174070j + 870349. Give o(5). -1 Let z(p) = -p3 - 3p*2 + 84p + 324. Determine z(-6). -72 Let x(s) = -s*3 - 600s*2 + 1750s + 178. Calculate x(3). 1 Let d(x) = -6930x + 6946. What is d(1)? 16 Let m(w) = -531w + 144427. What is m(272)? -5 Let j(h) = 3h3 + 72h*2 + 112h - 82. Determine j(-22). 358 Let h(u) = 15327u + 551771. What is h(-36)? -1 Let g(z) = z3 - 28z*2 - 83z + 183. Determine g(-4). 3 Let n(u) = u*3 - 108u*2 - 153u + 4816. Determine n(109). 20 Let d(n) = 68n2 + 214n - 219. What is d(1)? 63 Let r(s) = s*3 + 163s*2 + 2754s + 361. Calculate r(-19). 19 Let x(c) = -21c2 - 1460c + 4400. Calculate x(3). -169 Let b(n) = -3n3 + 42n*2 + 3524n - 148. What is b(-28)? -36 Let l(d) = -277d + 22407. What is l(82)? -307 Let d(i) = 139742i - 2655129. Give d(19). -31 Let w(o) = o*3 + 87o*2 - 4139o + 845. Calculate w(34). -5 Let w(b) = b*2 - 124870b - 2372886. Determine w(-19). 5 Let w(m) = 7213m - 7862178. Give w(1090). -8 Let r(a) = -6789a + 135771. Determine r(20). -9 Let c(u) = -35575u2 + 426808u + 1099. What is c(12)? -5 Let j(y) = -9511y - 266324. Determine j(-28). -16 Let z(l) = -5l*3 - 280l*2 - 799l - 277. Calculate z(-53).	{ "pile_set_name": "DM Mathematics" }
is -11.416 rounded to the nearest 10? -10 Round 0.681 to one dp. 0.7 What is 579.87 rounded to 0 decimal places? 580 What is 58067 rounded to the nearest one thousand? 58000 Round -10280 to the nearest one thousand. -10000 Round 3556.3 to the nearest one thousand. 4000 What is -598603000 rounded to the nearest one million? -599000000 What is -10.704 rounded to one dp? -10.7 What is 0.000001024 rounded to 7 decimal places? 0.000001 What is -0.648 rounded to two decimal places? -0.65 What is 3.7988 rounded to two dps? 3.8 What is 38.16 rounded to the nearest 10? 40 What is -122.96 rounded to 0 dps? -123 What is -0.6816 rounded to two dps? -0.68 What is -0.00013055 rounded to 5 decimal places? -0.00013 Round -2224140 to the nearest 10000. -2220000 Round 0.004953 to four decimal places. 0.005 What is -49.613 rounded to the nearest integer? -50 What is -13075900 rounded to the nearest 1000000? -13000000 Round 260.218 to the nearest ten. 260 Round -7859 to the nearest one hundred. -7900 Round 33494000 to the nearest 1000000. 33000000 What is -0.00124 rounded to four decimal places? -0.0012 Round -870000 to the nearest ten thousand. -870000 What is -7769000 rounded to the nearest one hundred thousand? -7800000 What is -0.00014433 rounded to 5 decimal places? -0.00014 Round 12429000 to the nearest 1000000. 12000000 What is 934 rounded to the nearest one thousand? 1000 Round 0.02633 to 3 decimal places. 0.026 What is -10789000 rounded to the nearest one hundred thousand? -10800000 What is 0.02334 rounded to 3 dps? 0.023 What is 6.251 rounded to 1 dp? 6.3 What is -2081000 rounded to the nearest one million? -2000000 What is 1045.1 rounded to the nearest 100? 1000 Round -0.0000092463 to six decimal places. -0.000009 What is -3055.26 rounded to the nearest 10? -3060 Round 18.87 to one decimal place. 18.9 What is 917430 rounded to the nearest 10000? 920000 What is -0.0403198 rounded to 3 decimal places? -0.04 What is 40.1 rounded to 0 decimal places? 40 What is 58.8 rounded to the nearest ten? 60 Round 0.039029 to 3 decimal places. 0.039 Round -119000 to the nearest ten thousand. -120000 What is 966.9 rounded to the nearest 100? 1000 Round -0.557 to two dps. -0.56 What is -0.020318 rounded to 3 dps? -0.02 Round -0.000000516 to seven decimal places. -0.0000005 What is 96.8 rounded to the nearest ten? 100 What is 0.80679 rounded to 3 decimal places? 0.807 Round -4311700 to the nearest 10000. -4310000 Round -0.0000058932 to 7 decimal places. -0.0000059 What is -39991 rounded to the nearest ten thousand? -40000 What is -427.8 rounded to the nearest 100? -400 What is 285 rounded to the nearest ten? 290 Round -2.2475 to the nearest integer. -2 Round -0.00076069 to 4 decimal places. -0.0008 Round 0.00011171 to six dps. 0.000112 Round -32220 to the nearest one thousand. -32000 What is 0.00000922 rounded to 6 decimal places? 0.000009 Round -0.0000003679 to seven decimal places. -0.0000004 Round -2.0595 to 2 decimal places. -2.06 What is -205000 rounded to the nearest 1000? -205000 Round -1584000 to the nearest 10000. -1580000 What is 1217.9 rounded to the nearest 10? 1220 What is 63.68 rounded to the nearest 10? 60 What is -8290 rounded to the nearest 1000? -8000 Round -0.00000411 to six decimal places. -0.000004 What is -5804.2 rounded to the nearest 100? -5800 Round -0.0020399 to five dps. -0.00204 Round 1662400 to the nearest one hundred thousand. 1700000 What is 0.0059184 rounded to 5 decimal places? 0.00592 Round 0.0000006267 to seven decimal places. 0.0000006 What is -0.0016666 rounded to 5 decimal places? -0.00167 Round -0.18488 to 1 dp. -0.2 Round 80.87 to the nearest 10. 80 What is 0.09 rounded to 1 dp? 0.1 Round 17100000 to the nearest 1000000. 17000000 What is -4278000 rounded to the nearest 1000000? -4000000 What is 34133000 rounded to the nearest one hundred thousand? 34100000 Round -97750 to the nearest 1000. -98000 Round 0.00000166509 to 6 decimal places. 0.000002 What is 64.252 rounded to 0 dps? 64 What is 58.05 rounded to the nearest ten? 60 Round 0.0002902 to 5 decimal places. 0.00029 Round -458.2 to the nearest 100. -500 Round -0.00159994 to five dps. -0.0016 Round -687900 to the nearest 10000. -690000 Round 0.001312 to 4 dps. 0.0013 Round 0.00002649 to six dps. 0.000026 What is 73538 rounded to the nearest one thousand? 74000 What is 0.000006649 rounded to seven decimal places? 0.0000066 Round 4.035 to the nearest integer. 4 Round -312.9 to the nearest ten. -310 What is -450.1 rounded to the nearest one hundred? -500 What is 0.00003305 rounded to six decimal places? 0.000033 Round -310.39 to the nearest ten. -310 What is -190083 rounded to the nearest 1000? -190000 What is 9503 rounded to the nearest one thousand? 10000 What is -7185500 rounded to the nearest 100000? -7200000 Round 0.000141772 to 6 decimal places. 0.000142 What is -15508000 rounded to the nearest one hundred thousand? -15500000 Round -0.000050097 to 5 dps. -0.00005 Round 0.0000004252 to 7 decimal places. 0.0000004 Round -0.00001264 to seven dps. -0.0000126 Round 0.0000090994 to seven decimal places. 0.0000091 What is -0.2543 rounded to one decimal place? -0.3 What is 0.81 rounded to 1 decimal place? 0.8 Round 0.00076327 to four dps. 0.0008 Round 174.5 to the nearest one hundred. 200 What is 3.406 rounded to two decimal places? 3.41 What is 10.6523 rounded to 1 decimal place? 10.7 Round 0.021 to two dps. 0.02 What is -0.000003 rounded to seven dps? -0.000003 What is 1763000 rounded to the nearest 100000? 1800000 Round 0.000057221 to 6 dps. 0.000057 What is 24285000 rounded to the nearest 100000? 24300000 Round 0.0025344 to 4 dps. 0.0025 Round -1481000 to the nearest one million. -1000000 What is 0.04912 rounded to 2 dps? 0.05 What is -169.63 rounded to the nearest 100? -200 What is -1117.1 rounded to the nearest 10? -1120 Round 0.00003313 to five dps. 0.00003 What is 0.00058787 rounded to 4 decimal places? 0.0006 Round 1001000 to the nearest one hundred thousand. 1000000 Round 0.000284 to 5 dps. 0.00028 What is -0.0000001007 rounded to seven decimal places? -0.0000001 Round 0.051343 to 3 decimal places. 0.051 Round -0.223 to 2 decimal places. -0.22 Round 0.000017 to four decimal places. 0 What is 0.014831 rounded to three decimal places? 0.015 Round 0.0000107 to 5 dps. 0.00001 Round 0.000015937 to seven dps. 0.0000159 Round -0.002178 to three decimal places. -0.002 Round -1970 to the nearest one hundred thousand. 0 Round -0.00000247 to six decimal places. -0.000002 Round -22.676 to the nearest integer. -23 Round 0.00123 to 3 dps. 0.001 What is 4.409 rounded to one dp? 4.4 What is 52720 rounded to the nearest 10000? 50000 What is 557000 rounded to the nearest 100000? 600000 What is -0.00227 rounded to 4 decimal places? -0.0023 Round 0.000019649 to 6 dps. 0.00002 What is 20790 rounded to the nearest ten thousand? 20000 What is 849.5 rounded to the nearest 100? 800 Round -13664000 to the nearest 1000000. -14000000 Round 6683000 to the nearest one hundred thousand. 6700000 Round -0.00000437 to six dps. -0.000004 Round 3574.69 to the nearest 10. 3570 What is -20769 rounded to the nearest one hundred? -20800 What is -26410 rounded to the nearest one thousand? -26000 What is -0.21338 rounded to 2 dps? -0.21 What is 0.0000226966 rounded to 6 dps? 0.000023 Round 0.00001688 to six decimal places. 0.000017 Round 5200000 to the nearest 1000000. 5000000 What is 50450 rounded to the nearest 1000? 50000 What is -0.056014 rounded to three decimal places? -0.056 What is -0.0000568 rounded to five dps? -0.00006 Round -0.00664617 to 5 decimal places. -0.00665 Round 5313 to the nearest one hundred. 5300 Round -2487100 to the nearest one hundred thousand. -2500000 What is -0.0000838 rounded to five decimal places? -0.00008 What is 6.1 rounded to the nearest integer? 6 What is 0.0007232 rounded to five decimal places? 0.00072 What is -0.000123004 rounded to 7 dps? -0.000123 Round -35753 to the nearest 1000. -36000 What is -2.45 rounded to the nearest integer? -2 Round 0.11147 to two dps. 0.11 Round 0.005574 to four dps. 0.0056 Round 0.0000032008 to 7 dps. 0.0000032 Round -11.7184 to 1 decimal place. -11.7 Round 0.000525 to 4 dps. 0.0005 Round -786300 to the nearest one hundred thousand. -800000	{ "pile_set_name": "DM Mathematics" }
468 for o. 17 Solve 154r - 51r + 1602 - 74 = -88r for r. -8 Solve 30d = -14d - 136d - 11d + 11078 for d. 58 Solve 1590198 = -31f + 1593856 for f. 118 Solve 88344w - 21528 = 88620w for w. -78 Solve 218j + 82j + 62j - 17142 = 3854 for j. 58 Solve -524k + 54417 = 445k - 376k + 474k for k. 51 Solve -1019x + 579x - 20680 = 0 for x. -47 Solve 53j + 239j = 7008 for j. 24 Solve 0 = 5167p - 5231p - 2816 for p. -44 Solve -845u - 24900 = 357u + 21978 for u. -39 Solve 327l - 79l + 20670 = -362l + 80l for l. -39 Solve 254u + 5244 = 19063 + 1929 for u. 62 Solve 40727f - 52871 - 13329 = 41389f for f. -100 Solve 222s + 81788 - 84230 = 0 for s. 11 Solve -815m + 1505m - 3799 = 802m + 1801 for m. -50 Solve -81r + 37179 = 38070 for r. -11 Solve -3743 = 305y - 9001 - 6942 for y. 40 Solve 17a + 8 = 955 + 872 for a. 107 Solve -105439 - 33185 = -1302t + 4190t for t. -48 Solve -76z - 196922 + 198822 = 0 for z. 25 Solve 115703 = -455h - 3530h - 90169 - 69093 for h. -69 Solve 1463u + 1457u = 2994u + 1776 for u. -24 Solve 55a + 3524 + 2384 = -302a - 3017 for a. -25 Solve -1932 + 26398 = -941k for k. -26 Solve -811y - 10600 = -546y for y. -40 Solve 604n - 56872 = 9949 + 26799 for n. 155 Solve -4352h - 500217 + 134649 = 0 for h. -84 Solve -79d = -1028d - 746d + 54d - 91896 for d. -56 Solve -898j + 43414 = -8670 for j. 58 Solve -9353h = -4672h - 4678h - 87 for h. 29 Solve 1360v + 42794 - 151594 = 0 for v. 80 Solve -45q + 5799 = -1978q for q. -3 Solve 199i + 172i - 478i + 1070 = 0 for i. 10 Solve 0 = -269i + 5i - 148i + 2540 - 20668 for i. -44 Solve -84w - 479 - 1621 = 0 for w. -25 Solve -3547p + 900 = 3575p - 7158p for p. -25 Solve 8272u - 32959 + 395173 = -159394 + 33560 for u. -59 Solve -674t - 29979 = -1336t - 86249 for t. -85 Solve 491 = -17v + 107 - 364 for v. -44 Solve 2656 + 22161 + 5385 = 350t + 3952 for t. 75 Solve 4193c - 2077c + 192 = 2020c for c. -2 Solve 4054p - 824912 = -14694p for p. 44 Solve -3594g - 164610 = -939g for g. -62 Solve -1909i + 65108 = -845i + 1129i - 136648 for i. 92 Solve -133l - 1081 = 1498 + 214 for l. -21 Solve -146976 - 95934 = 2814n - 115n for n. -90 Solve 2365l - 2755l + 7800 = 0 for l. 20 Solve -440j - 14648 = 39j - 27728 - 19492 for j. 68 Solve 2426h + 192811 = 870h - 548h + 18179 for h. -83 Solve -25610 = 1476991r - 1477188r for r. 130 Solve 86h - 586 = -120h + 147h - 1648 for h. -18 Solve -251c - 127c = -253c + 4875 for c. -39 Solve 0 = -120t + 1295 + 989 + 693 + 263 for t. 27 Solve 6525 = 610q + 7948 + 7774 + 18863 for q. -46 Solve 0 = 60w - 141847 + 141967 for w. -2 Solve 2351 = -138v + 143 for v. -16 Solve -24361t = -2423t - 2830t - 229296 for t. 12 Solve -60542u + 86914 + 13004 = -61361u for u. -122 Solve -94o - 2768 + 5118 = 0 for o. 25 Solve 1013 = -238d - 2081 for d. -13 Solve -87219b = -87325b - 9222 for b. -87 Solve -467x + 3240 = -21511 for x. 53 Solve -3611 + 63281 = -1224h + 11934 for h. -39 Solve -2324w - 252w = 23w - 82356 - 255514 for w. 130 Solve -170t - 1648t = -118170 for t. 65 Solve -690n + 22703 = -7552 + 585 for n. 43 Solve 547d + 1147d - 22090 = 40589 + 32185 for d. 56 Solve -577y = -1556y - 3150y + 86709 for y. 21 Solve 823513x + 378 = 823555x for x. 9 Solve 110 - 422 = 135j + 150j - 297j for j. 26 Solve -178a - 3772 - 12434 + 1254 = 0 for a. -84 Solve 0 = 29b + 225043 - 225449 for b. 14 Solve -179x + 121 = 356 - 5247 for x. 28 Solve -1693446 = 1028m - 1626626 for m. -65 Solve 27178 - 3610 = 982f for f. 24 Solve 15w + 1275 = -128w + 4993 for w. 26 Solve -94v - 874 + 987 - 993 = -14v for v. -11 Solve 846 = 141y - 2809 - 998 for y. 33 Solve 191h - 7122 = 6047 + 1591 - 1008 for h. 72 Solve 0 = -4121z - 16337 - 70204 for z. -21 Solve 150x = -236044 + 241144 for x. 34 Solve 2044t - 92358 = -1673t + 46t - 727t for t. 21 Solve -29229j - 3703j - 3326132 = 0 for j. -101 Solve -15351z + 31000z - 15375z - 4932 = 0 for z. 18 Solve 3612q - 216 = 3588q for q. 9 Solve 1969r - 25361 = 61275 for r. 44 Solve -281r - 3136 - 12881 = 0 for r. -57 Solve 19879 - 19515 = -28w for w. -13 Solve 234 + 266 + 52 = 8b + 120 for b. 54 Solve 745o - 43845 = -41o + 140o + 16233 for o. 93 Solve -1491z = -462z - 6920 - 29095 for z. 35 Solve 564o + 959o + 69738 = -9458 for o. -52 Solve 3675 - 4533 = 39d for d. -22 Solve -10029v + 20164v = 10062v + 1095 for v. 15 Solve -6499h - 2178h = 1992h + 309401 for h. -29 Solve -3106 - 2319 = -168k + 13k for k. 35 Solve 0 = -65u - 178528 + 178463 for u. -1 Solve -44y + 703 = 175 for y. 12 Solve 36q + 13021 = 485q for q. 29 Solve -6401 = 1252h - 1079h for h. -37 Solve -993367j + 993287j = 3360 for j. -42 Solve 133y - 143y + 130 = 0 for y. 13 Solve 364044 - 321414 = -609i for i. -70 Solve -505k - 55652 = -94537 for k. 77 Solve 114x + 198 = -99x + 235x for x. 9 Solve 198v + 1306v = -33106 - 13747 - 11803 for v. -39 Solve 55949c - 149344 = 53077c for c. 52 Solve 5456 = -2185q - 3284 for q. -4 Solve 0 = 1626m - 810m - 814m + 99 - 19 for m. -40 Solve 92p + 4305 = 265p - 5729 for p. 58 Solve -36p + 25p = 37p + 4032 for p. -84 Solve 0 = -936s - 907s - 16587 for s. -9 Solve -405b - 997b - 46b - 169029 = 1235b for b. -63 Solve -986v = -14321 + 81369 for v. -68 Solve -15583 + 15771 = 878j - 103416 for j. 118 Solve 20403s + 11508 = 20677s for s. 42 Solve 2856a = 960a - 36024 for a. -19 Solve -41t = -45t - 1157t + 4936 - 45571 for t. -35 Solve 120x - 83 = -203 - 240 for x. -3 Solve -22 + 1942 = 33l + l + 288 for l. 48 Solve -6482b + 547b = 2658b - 498394 for b. 58 Solve -174a - 885 = -3176 - 9367 for a. 67 Solve -27l - 238 = -45l - 79 + 291 for l. 25 Solve 450 = -2198b + 1973b for b. -2 Solve -3k + 120k + 3804 = -1812 for k. -48 Solve -3620p + 290p - 1396p = 1663p - 645289 for p. 101 Solve 67u - 271u - 32640 = 200u + 106u for u. -64 Solve 926566n - 14818 = 926805n for n. -62 Solve 3959 = -110i + 399 - 620 for i. -38 Solve -1804b + 1384b + 39255 = 2197b for b. 15 Solve -20u - 10u + 2168 = 1298 for u. 29 Solve -22506u - 328032 = -25722u for u. 102 Solve -1248q + 208888 = 2667q + 60118 for q. 38 Solve -52g + 141g = -4g + 930 for g. 10 Solve 90i - 149022 + 145152 = 0 for i. 43 Solve 0 = -22u + 27078 - 26880 for u. 9 Solve 3934 = -88h - 4910 + 1882 + 186 for h. -77 Solve -171a - 5783 - 10225 = 105a + 72a for a. -46 Solve -7664 = -476r + 1888 - 1936 for r. 16 Solve -623c - 977c - 99968 = -192c for c. -71 Solve 2224 - 4500 = -397v - 795v + 17988 for v. 17 Solve 139m - 28m - 1366 + 779 = 4630 for m. 47 Solve 16q + 9q = -162q - 0q - 3366 for q. -18 Solve -1960 + 1178 = -84v + 3838 for v. 55 Solve 150i - 2026 + 2026 = 0 for i. 0 Solve 54912 = -3052i + 943i - 6133 + 10429 for i. -24 Solve 127048 = -143j + 122186 for j. -34 Solve 1164s - 91s + 50963 = -170s for s. -41 Solve 5228x + 4247x = -658023 - 308427 for x. -102 Solve 38c = -221c + 86c - 18c - 10505 for c. -55 Solve 29a + 375 = -158a - 172a - 21524 for a. -61 Solve 0 = -76t - 1256 + 2666 + 2162 for t. 47 Solve -489k + 6268 = 517k - 1735 - 2057 for k. 10 Solve -15u = -579 - 1005 - 9 + 423 for u. 78 Solve -374x = -237x + 1878x + 130975 for x. -65 Solve -38593 + 38219 = -22y for y. 17 Solve 0 = 88u + 2u + 5940 for u. -66 Solve 247r - 570r - 5973 = -159r - 15157 for r. 56 Solve -238v + 891v - 261480 = -573v - 953v for v. 120 Solve -33c + 15416 = -131c - 66c for c. -94 Solve -349w + 4681 + 4742 = 0 for w. 27 Solve 692s - 486 = 961s + 89 + 1577 for s. -8 Solve -122v + 18305 - 20989 = 0 for v. -22 Solve -475q + 88910 = 138q + 2002q for q. 34 Solve -626c - 366c - 24161 = -339c for c. -37 Solve -1066v - 7141v = 106691 for v. -13 Solve -2083 = 1767j + 3218 for j. -3 Solve -18847 = 340l - 39927 for l. 62 Solve -14254x = 42670 + 113445 + 14933 for x. -12 Solve 2621h + 1367h - 10749 - 9191 = 0 for h. 5 Solve -10177b = -10313b - 8704 for b. -64 Solve 18w + 1665 = 133w + 440w for w. 3 Solve 141741 = -138b + 281675 - 143798 for b. -28 Solve 1071c - 869c = -282c - 1940c - 43632 for c. -18 Solve 462948j = 464238j - 79980 for j. 62 Solve -62537 = 985a	{ "pile_set_name": "DM Mathematics" }
-24)). Does 11 divide (x2)/(2/(-4))? False Suppose d = b + 146, -4b = -d + 6d + 620. Let s = 264 + b. Is 8 a factor of s? False Let c(b) = b2 - 7b - 25. Let i be c(12). Let t = i + -26. Does 2 divide t? False Is 16 a factor of (1 + (-15)/18)/(8/4944)? False Suppose -f = n - 13, 2f - 3n - 28 = -7n. Let t = f + 12. Does 6 divide t? True Let r(v) = -v3 + 13v2 - v - 10. Let u be r(13). Let p(n) = -n2 - 26n - 14. Is p(u) a multiple of 10? False Let q(u) = -u2. Let w be q(0). Suppose 0 = -5r - 5t + 18 + 2, -2r - 5t + 5 = w. Suppose rj - 8 = 37. Is j a multiple of 2? False Suppose 0 = -3x + 325 + 104. Suppose -x - 352 = -5z. Is z a multiple of 12? False Let x = -6 + 18. Is 3 a factor of 7 + -2 - x/(-3)? True Let a(s) = -451s + 141. Is 12 a factor of a(-15)? False Suppose -g + 7k + 110 = 3k, 4g = -3k + 345. Does 9 divide g? True Is 64 a factor of 528 - (93/(-33) + (-2)/11)? False Let l be (82/(-4))/(8/(-32)). Let n = l - 23. Is n a multiple of 12? False Let w(g) = 2g*3 + 3g*2 + 2g + 4. Let s be w(-2). Is (2/s)/((-4)/408) a multiple of 17? True Let y be (-585)/528/(-3). Let n = y - 19. Does 3 divide n? False Let m be -2(-2)/10 - (-1114)/(-10). Let u = m + 226. Is u a multiple of 23? True Let f(b) = -b*3 + 19b*2 - 34b + 28. Is f(13) a multiple of 20? True Let u(w) = 7w2 - 2w + 8. Is u(-5) a multiple of 14? False Let h(j) = 17j2 + 31j + 5. Does 65 divide h(-8)? True Suppose -2q = 5p + 3q + 60, -p + 5q = 30. Let u = p - -67. Is u a multiple of 13? True Let i(w) be the first derivative of w*4/2 - 22w*3/3 + 3w*2 + 18w + 40. Does 21 divide i(12)? True Let i = -21 + 13. Let m = 10 + i. Suppose 0 = -7j + mj + 100. Is j a multiple of 14? False Suppose 7 = 2v + 3. Suppose 5q - 234 = vq. Is q a multiple of 11? False Let j(d) = d2 + 9d + 3. Let o(m) = -2. Let y(b) = b + 3. Let u(z) = 6o(z) + 5y(z). Let i be u(-3). Is 13 a factor of j(i)? True Let w(g) = -g - 6. Let k be w(-10). Suppose -8 = 4s, -5f + s = ks - 9. Suppose 8l - 20 = fl. Does 4 divide l? True Let y(w) = -26w + 19. Let t be y(3). Let h = 97 + t. Does 8 divide h? False Suppose 4m - 3m = 5c + 127, -4m - 3c = -462. Is 14 a factor of m? False Let t = -8 - -12. Suppose q - 5q = tc + 24, -10 = 4q - 3c. Is 17 a factor of 98/6 - q/6? True Let x be (30/(-4))/(1/(-6)). Does 21 divide (38/3 - 0)/(6/x)? False Suppose 25 = -5i, -l + 20i = 18i - 41. Is l a multiple of 2? False Let j be 64/6(-48)/8. Let k = j + 92. Does 11 divide k? False Let g(n) = -1 + 3 + 3 + 6n. Let k be g(-2). Let j = -1 - k. Is 3 a factor of j? True Suppose -25 + 10 = -5k. Suppose o + 2f = -f + 9, -o + kf = 9. Let c(z) = -2z + 32. Is 16 a factor of c(o)? True Let c = 9 + -4. Suppose 2b - 4n - 40 = 0, 0n + 5 = -2b - cn. Is 2/4 - (-45)/b a multiple of 5? True Suppose -7i = -2i - 1820. Suppose 5a = -10 - 0, 2a = 4h - i. Suppose -7m = -4m - h. Is m a multiple of 15? True Suppose -28 = 5r + l - 87, -4r + 32 = -3l. Suppose -3b - r = -5b - v, -21 = -4b - 3v. Is 61 - ((2 - b) + 4) a multiple of 16? False Suppose r = 2h - 123, 3h + 6 + 0 = 0. Let b = 182 + r. Does 10 divide b? False Let v = 39 + -34. Suppose -j = -p + 189, -vj + 555 - 156 = 2p. Is 24 a factor of p? True Let c be (-10 + 8)3/1. Let u = 5 - c. Suppose 2q - u - 7 = 0. Is q a multiple of 9? True Let x be (-5 - -1)/((-5)/25). Let j be 4 - (x/2 - -1). Let s(w) = -w3 - 7w*2 - 6w - 2. Is 10 a factor of s(j)? True Let r = 202 + -308. Let s = r + 179. Suppose 5f - s - 122 = 0. Is 13 a factor of f? True Suppose -2x + 4j + 388 = 0, -j = 5x - 4j - 970. Is x a multiple of 22? False Let u(y) = -3y + 226. Is u(23) a multiple of 89? False Let m = -92 + 53. Let j be (-6)/m + (-340)/13. Does 9 divide 1j/(-1) + 1? True Suppose 35p - 12000 = 10p. Is p a multiple of 16? True Let w(j) = -j3 - 7j*2 + 42j - 19. Let s be w(-11). Suppose 2i + 3k = 46, -3i = i - 4k - 52. Let h = s + i. Does 11 divide h? False Let a(r) = r*2 - 8r - 8. Let k be a(9). Let l = 1 - k. Suppose t + lt = 4. Is 2 a factor of t? True Suppose 5b + k - 1804 = 0, 2k - 567 = -2b + 161. Is b a multiple of 15? True Let g(i) = 14i2 - 1. Suppose -x + 0 + 1 = 0. Suppose -2y - 5d - 3 = -0d, 2y + 3d + x = 0. Does 5 divide g(y)? False Let m(f) = f*2 - 9f + 14. Let z be m(12). Suppose z = 23c - 18c. Does 5 divide c? True Suppose 5z - 6 + 16 = 0. Is 33 a factor of -2 - 1 - (-194 + 14/z)? True Let s(j) = j2 + 2j - 11. Let h be s(3). Suppose x - 4 = 0, -2f = -0f + 4x - 82. Suppose -z - r = -f, hr = -r + 10. Does 31 divide z? True Let p(d) = -d*3 + 59d*2 - 47d - 73. Does 12 divide p(58)? False Let q(k) = -k*3 + 9k*2 - 5k - 23. Is q(5) a multiple of 52? True Suppose 106o - 3552 = -3v + 105o, -4v + 5o = -4736. Is v a multiple of 74? True Suppose 4t - 649 = -x, -4x - 952 = -2t - 3584. Is x a multiple of 9? True Let w be (-1)/(-4) - (-17003)/(-28). Let d be w/7 - 8/28. Is 18/12 - d/6 a multiple of 16? True Suppose -2y + 81 - 35 = 0. Let q(z) = 2 + y + 8 - 3z. Is q(0) a multiple of 11? True Suppose 92n - 726 = 81n. Is n a multiple of 3? True Let m = 1 + -1. Suppose -2j + 0j + 176 = m. Is j a multiple of 11? True Let l = 16 + -99. Let x = l + 139. Is x a multiple of 15? False Suppose -16g + 12g + 1024 = 0. Does 2 divide g? True Suppose 3g + 147 + 378 = 0. Let l = -98 - g. Suppose -21 = 4m - l. Is 6 a factor of m? False Let i = -145 + 236. Let k = 211 - i. Does 12 divide k? True Suppose -1346 = 12w - 14w. Suppose 2z = 2t - 67 + w, -5t = -2z + 615. Is 30 a factor of z? True Let t be -35((-36)/(-28) + -3). Suppose -t = -4g - g. Suppose 39 = w + g. Does 27 divide w? True Let s = 35 + -33. Let m(x) = 2x2 + 5x*2 + 0x*2 - 2x - 2. Is m(s) a multiple of 11? True Suppose b - f = -2b + 2884, 0 = 2f + 8. Does 30 divide b? True Suppose -4d + 20 = v, -5d + v + 14 = 5v. Suppose 3q - dq - 24 = 0. Is 3 a factor of 0 - (-1 + 3 + q)? True Suppose -4g + 4 = 0, -5g + 2g = -4q - 139. Let v = q + 32. Is v/1 - (-8)/2 a multiple of 2? True Let n be 728/(-130)(-9 + 0 + -1). Suppose -17p - n = -21p. Does 4 divide p? False Suppose 0w = -4w + y - 21, 0 = -5w + 4y - 18. Let b(r) be the first derivative of -2r2 + 7r + 51. Is b(w) a multiple of 6? False Suppose 3310 = 5z + 180. Is 68 a factor of z? False Suppose i - 7i = -2256. Let j = -191 + i. Is 18 a factor of j? False Suppose -4q = -2m - m + 1266, -2075 = -5m - 5q. Does 33 divide m? False Let c be 1 - (1 - (6 + -4)). Suppose ci = -2i + 328. Is 41 a factor of i? True Suppose -3b - 2m + 1745 = 3m, b = 3m + 577. Is b a multiple of 19? False Let f(k) = k*2 - 2k + 53. Does 6 divide f(14)? False Let l = -5 + 240. Does 12 divide l? False Suppose 2w - 30364 = -4u - 2w, -5w + 30367 = 4u. Suppose 0 = -5c - 4962 - u. Is 8 a factor of c/(-60) - (-1)/6? False Suppose 16u = 25u - 801. Let y = 224 - u. Is y a multiple of 22? False Let u(j) = 2j2 - 6j + 9 + 3j - 7j. Suppose -11t + 8t = -27. Does 13 divide u(t)? False Let v(a) = -8a - 21. Let z(m) = -12m - 32. Let k(t) = 8v(t) - 5z(t). Let b be k(-5). Does 9 divide (0 + -2)(-486)/b? True Let q = -106 + 109. Suppose 4y + 5o - 576 = 0, qo = 3y - 2y - 161. Does 25 divide y? False Does 14 divide (-24)/6 - 308/(-4)? False Let i = 12 - 16. Let a = i + 35. Let x = -5 + a. Does 26 divide x? True Suppose -10260 - 2356 = -19f. Does 12 divide f? False Let g be 2/7 - 2964/84. Does 14 divide 124 + -2 - (g/5 + 3)? True Let b(v) = v - 6. Let o be b(4). Is 2 - -14 - (4/1 + o) a multiple of 3? False Suppose 4w = -3t + 390, -2w = -3t - 71 + 461. Is t a multiple of 29? False Suppose 3g = -4n + 1356, -2g - 4n + 9n + 927 = 0. Does 12 divide g? True Is 3/((-2)/8 - (-488)/1824) a multiple of 19? True Let f = 6 - 6. Suppose -5v - m + 97 + 57 = f, 4v - 2m = 112. Does 15 divide v? True Suppose -4o - d - 13 = -76, 26 = 3o + 5d. Let b = 10 + o. Is 27 a factor of b? True Let q = -37 + 16. Let p = 16 + q. Is 24 a factor of 4/((20/(-72))/p)? True Let f = 29 + -1. Suppose -2s + 0s = z + 2, s + 4 = -2z. Suppose s = a + a - f. Is a a multiple of 14? True Suppose a = 4r - 459, 5a + 76 = r - 15. Is r a multiple of 7? False Let b = -1 + 6. Suppose bf	{ "pile_set_name": "DM Mathematics" }
(2l - 2l + 3l)(0l + 2l - l) + 0l2 + 2l*2 + 4l*2 - 27 + 2l + 2l2 + 27)(2l - 2l - l*2) + 4l - 4l + 3l*4. -8l*4 - 2l*3 Expand ((2i*2 + 4i*2 - 3i*2)(-20i + 334 - 334) - 3i + 3i + 2i*3)(-3 + 2i + 2 + 4). -116i*4 - 174i*3 Expand (4 - 6 + 6)(-7 - 30 + 73)(-1 + 1 - 1)(8r - 4r + 0r). -576r Expand 8f + 14f - 6f + (0f + 0f + f)(3 - 5 + 0) + 3f + 2f - f - 3f + 2f + 2f + (4f + f - 4f)(2 - 2 + 2). 21f Expand (3a*2 + 4a*2 + 0a*2)(-2a3 - 3a + 3a) + 0a*5 + 3a5 - a5 + (-259a4 + 189a*4 - 94a*4)(-a - 4a + 3a). 316a5 Expand (3z2 - z2 + 49z2)(z*2 - 3z*2 + 0z*2) + 32z + z4 - z3 - 34z - 10 - 3z*4. -104z4 - z3 - 2z - 10 Expand -5f*2 + 4f*2 + 3f*2 + (f - 2f + 5f + 0 + 0 - 3f + 2f + 3f - 4f + (-3 + 0 + 2)(3f - 2f - 2f) + 2f + 1 - 1)(-66 + 32 + 22f + 31). 112f2 - 15f Expand (-3r3 + 5r3 - r3)(-326r - 329r - 2 + 634r) + (3r3 - 2r*3 - 3r*3)(0r + r + 0r). -23r4 - 2r*3 Expand -5 + 3h + 5 + 139h - 580h + 18h + (-4h - h + 3h)(2 + 0 + 0). -424h Expand (-5746g - 13 - 5720g + 11513g)(0 + 1 - 3). -94g + 26 Expand ((1 + 4 - 3)(4a - a - 2a) - a + 2a + a + 0a - 2a + 0a)(-4 + 5 + 1 + (2 + 0 + 0)(9 - 4 + 1)). 28a Expand (2 - 2 + z)(-20z + 2z - 17z - 26z)(5z - z - 9z) + z - z*3 - z. 304z*3 Expand (30 - 4 - 4)(12s - 15s - 8s). -242s Expand (2 + 0 - 1)(6a2 - a2 - 2a2) + 29a + 6a2 - 29a + 642a - 642a - 41a2. -32a*2 Expand (8q - 3q - q)(-1530 - 8 - 717). -9020q Expand (3 - 3 - r2)(9902478 - 4273r2 - 9902478). 4273r4 Expand (f2 - 2f2 + 3f2 + (f2 - 2 + 2)(0 - 1 + 0) + 0f*2 - 2f*2 + 4f*2 + (86f + 167 - 167)(-3f + 3f + 2f))(7f + 5f + 11f). 4025f3 Expand 51112371l*2 - 4892l*3 + 4 - 51112365l*2 - 4 + (2l*3 + 4l*3 - 5l*3)(2 - 1 + 1) + 2l3 + 3l*3 - 3l*3. -4888l*3 + 6l*2 Expand (-130 + 14 + 47)(9g + 14g - 3g - 5g + 23g - 8g - 4g - 3g + 6g + (-3g + 2g + 3g)(0 + 1 + 1)). -2277g Expand (-2h + 3h - 3h)(5h3 + 2h - 3h3 - 3h) + (229h3 - 77h*4 - 229h*3)(-2 + 0 + 1)(-9 - 7 - 10). -2006h*4 + 2h*2 Expand (7i - 3i - 2i)(-i4 + 0i + 0i + (-4i3 + i3 + i*3)(196 + 281i - 196)). -1126i*5 Expand (-4j*3 + 2j*3 + 0j*3)(-8 + 4j2 + 8 + (-3j - 2j - 2j)(j + 5j - 3j)). 34j*5 Expand -2 + 2 - c + (3c + c - 2c)(-4 + 2 + 1) + (-9 + 16 - 1)(-13c + 7c + 3c) - 3c + 2c - c. -23c Expand (564 - 282 + 6s*2 + 3144s*3 - 282 + 879s*3)(s + 3s - 2s). 8046s4 + 12s*3 Expand (19p - 4 + p*2 - 30p + 10p)(-39 + 39 + 2p + (-7 + 10 + 10)(-3p + 3p + p)). 15p3 - 15p*2 - 60p Expand 1 - 1 - 2f2 + (-3f + 0f + f)(-195f + 342f - 1197f). 2098f*2 Expand (3j - 3j - j2)(-5j - 14j - 2j)(22 + 98 - 38). 1722j3 Expand (2r - 3 + 3)((6 - 1 + 0)(r + 0r + 3r) - 29r - 21r - 5r). -70r*2 Expand (-3 + 1887a*2 - 5 - 1888a*2)(-73a3 + 91a*3 - 222a*3). 204a*5 + 1632a*3 Expand (10k + 5k - 4k)(-2k*2 + 4k2 + k2) + (-2k2 + 2k*2 - 2k*3)(4 - 2 - 1) + k*3 + 2k*3 + 0k*3. 34k*3 Expand -3f*3 + 3f*3 + 2f*3 + (1 + 1 - 4)(-2f3 + 4f*3 + 0f*3) - 117 + 1132447f + 38f3 - 1132447f. 36f3 - 117 Expand (-4t*4 + 230t*3 + 14t*3 - 498t*3)(0t - t + 6t). -20t5 - 1270t*4 Expand (2o - 5o - 3o)(33 - 5o*2 - 33)(10932 + 121o2 - 10932). 3630o*5 Expand (-100q + 58q - 61q)(19 - 26q - 12 - 13q - 7). 4017q*2 Expand (2a - 2a + 2a*2)(0a + 0a + 2a2) + 2a*3 - 2a*3 - 2a4 - a + a4 + a - 2a + 204a*4 - 92806a*2 + 92806a*2. 207a*4 - 2a Expand -6y + 3y - 2y - 165 - 709y + 165 + (-2y + 1 - 1)(2 - 2 + 2). -718y Expand (-15b + b - 14b)(-5 + 7 + 18). -560b Expand (-21b*3 - 27b*3 + 5b*3 - 2b + 2b3 + 2b + (0 + 0 + 2b)(2 + b*2 - 2) + 5b*3 - 2b*3 + 0b*3)(3b - 3b - b) - b*4 + 0b*4 + 3b*4. 38b*4 Expand 4o + o + 0o + (2 + 0 - 1)(-1 + 2o + 1) + o + 15o - 6o + 0 + 0 + 4o - o + o - 2o + (-2 + 0 + 0)(2o + o - 5o) - 1 + 1 - 2o. 21o Expand (-3 + 3 + 2b)(3b + b2 - 3b) + (15b3 + 5b*3 - 10b*3)(0 + 1 + 2) + (2b2 - 3b2 - b2)(b + 3 - 3) - 20b + 26b3 + 20b. 56b3 Expand (-2d + d + 0d)(-4 + 4 - d) + 4 - 4 + 14d2 + 23990 + 5d - 3d - 23995 - 2d*2. 13d*2 + 2d - 5 Expand (-3y + 2y + 2y)(0 + 0 - 2y)((4 - 1 - 5)(-3y - y*3 + 3y) - y*3 + 2y - 2y + 259y - 524y3 - 553y*3 + 1066y*3 - 2y*2). 20y*5 + 4y*4 - 518y*3 Expand (-4i - 9i + 8i)(3 - 3 - 4)(105i - 115 + 115). 2100i*2 Expand (-3 - 3 + 2)(-2w4 + w4 + 3w*4) - 2w*2 - 2w*4 + 6w2 - w2. -10w4 + 3w*2 Expand (-4h - 3h2 + 4h)(4 + 1 - 4) - 811h*2 + 95051h - 95051h. -814h*2 Expand ((4t - 4t - 2t)(-4t + t + t) + (-34t2 + 60t*2 - 3t*2)(-1 - 3 + 3) + (4t - t - 4t)(-3t + 7t - t))(2 - 2 - t). 22t3 Expand (-2x + 2x - x)(4x - 5x - x) + 5 - 5 - 11x2 - 3x*2 - 5x - 6x2 - x. -18x*2 - 6x Expand (7z + 2z - 3z)(0z + 3z - 4z)(-15z3 + 497 - 497). 90z*5 Expand (2 - 2 - 2 + (-2 + 3 - 3)(-3 + 2 - 1) + 1 + 2 - 2 + 3 + 3 - 4 - 1 - 1 + 4 - 132 - 37 - 156)(0k2 + 2 + k2 - 4). -318k2 + 636 Expand (11t*2 - 7t - 7 + 7t)(2 + 2 - 2)((0 + 0 - 2t)(t + 1 - 1) - 125t*2 + 228t*2 - 32t*2). 1518t*4 - 966t*2 Expand (0 + 0 + 2k)(-2k*2 + 2k*2 - 2k*3) + (-515k*2 + 515k*2 + 190k*3)(-8k + 5k - 3k). -1144k*4 Expand (-4w + 4w + w)(-1295w2 + 451w*2 + 450w*2 + 425w*2 + 74). 31w*3 + 74w Expand (-3 + 6 - 2)(-3q + q + 4q)(-4 + 4 - 2 + (6 - 3 - 1)(3 - 1 - 1) + 1 + 3 + 1)(1239q3 - 2784q*3 - 4147q*3). -56920q*4 Expand (-3x*4 + 9x*4 + 53x*4)(0 - 1 + 4) - 14x4 + 33x*4 - 20x*4 - 2. 176x*4 - 2 Expand (13 - 14 + 10)(5 - 3 + 2)(1 + 11 + 5)(-2 + 0 + 4)(-5 + c + 5 + 4c - c - 4c - 3c + 2c + 3c + (-3 + 3 + 2)(2c + 2 - 2) + 3c + c - 2c). 9792c Expand (m - 4m + m)(-5m*2 + 2m*2 + 2m*2) - 3m*3 + 0m*3 - 2m*3 + (26m + 62m + 12m)(-3m*2 - 3m + 3m). -303m*3 Expand (-4c*3 + 4c3 + c4 - 3c4 + 4c*4 - 3c4 + (-c4 - c4 + c4)(-1 - 1 + 3) + 2c*4 - 5c*4 + 4c*4)(6688c - 79c + 5379c + 20746c). -32734c5 Expand (2 + 0 + 0)(4 + 3587a2 + 4a*3 - 3605a*2 + 1). 8a*3 - 36a*2 + 10 Expand 0 + 2m + 0 + (6 - 5 + 6)(3m + m - 3m) + 20m + 766 - 766. 29m Expand -3m*4 + 3m*4 + 9m*5 + (m - 4 + 4)(-43 - 30m4 + 43). -21m*5 Expand (-137 + 137 + 17d)(42d*3 - 1144d*2 + 1144d*2) - 9d*3 + 9d*3 + 2d*4. 716d*4 Expand (d + d + 0d)(0 + 1 - 3) + 2 + 2d - 2 + 3073d + 233d - 57d. 3247d Expand (2 - 1 - 3)(55234v - 26889v - 3 + 3 + 23196v). -103082v Expand (-379 - 391j + 200j + 193j)(0j + 0j + 3j). 6j2 - 1137j Expand (-82 + 4y - 29 + 152 + 289)(-14y2 + 0y2 + y2). -52y3 - 4290y*2 Expand (-14h + 14h - 2h*3 + 10h*2)(-1 + 1 + 2 + (-9 - 2 + 13)(0 + 1 + 1) - 1 - 1 + 3 - 2 + 2 + 4). -22h*3 + 110h*2 Expand -g - 1 + 1 + (1 - 1 - 2)(-2 + 2 - 2g) + 1 - 1 + g + 4g - 4g + 3g + (-62g - 10g - 200g)(1 + 2 - 2). -265g Expand (-n + 0n + 2n)(-5299n + 3309n - 4644n). -6634n2 Expand (-d4 + 5d4 - 2d*4)(-102d + 745d - 54d - 2d - 1 + 1 - 2d - 2d + 5d + (-1 + 0 + 3)(-2d - 4d + 4d) + 4 - 4 + 2d). 1172d5 Expand (n - 5n - n)(2n*2 + 1 - 1) - 20n*3 + 260n + 427n + 22n*3. -8n*3 + 687n Expand -4x + 4x + x + (0x - 10x + 0x)(-2 + 8 + 0) - x + x - 2x + 3x - 3x + 15x. -46x Expand (2a + 3a - 4a + (-4 + 1 + 1)(-2a - 2a + 3a))(8663 - 15131 + 17637). 33507a Expand (-7 + 7 + 2d)(-d3 - d3 + 3d3 + (-12d*3 + 9d*3 - 66d*3)(1 - 6 + 1)). 554d4 Expand (-5 + 5 + a)(-1 + 1 - 3a)(-10 - 1 - 9) + 7a2 + 6a*2 - 14a*2. 59a*2 Expand 2j + 4j - 5j + (33 - 42 + 29)(2 - 2 + j) + (2 + 2j - 2)(-1 + 3 - 1) + j + 4j - 3j + 2j + 0j + j - 2j + 5j - 2j. 29j Expand 2 - 766x*3 + 584x + 1602x3 - 835x3 - x2 + (5 - 2x - 5)(-2x2 - 1 + 1) + x3 - 1 + 1. 6x3 - x2 + 584x + 2 Expand (2l - 2l - l)(4l + 2l + 0*	{ "pile_set_name": "DM Mathematics" }
80. 160 What is the greatest common factor of 102 and 1513? 17 Calculate the greatest common divisor of 312 and 3848. 104 Calculate the greatest common divisor of 238 and 136. 34 Calculate the highest common divisor of 2555 and 35. 35 What is the highest common factor of 68 and 8? 4 What is the highest common divisor of 663 and 39? 39 Calculate the highest common factor of 3374 and 14. 14 Calculate the greatest common factor of 3318 and 42. 42 What is the greatest common divisor of 408 and 96? 24 Calculate the highest common factor of 5775 and 150. 75 What is the highest common factor of 1500 and 12? 12 Calculate the greatest common divisor of 39168 and 153. 153 What is the highest common divisor of 480 and 15? 15 Calculate the greatest common divisor of 4 and 164. 4 Calculate the highest common divisor of 22703 and 73. 73 What is the highest common divisor of 88 and 1232? 88 What is the highest common divisor of 56 and 1064? 56 What is the highest common factor of 289 and 68? 17 What is the highest common factor of 7 and 7? 7 Calculate the greatest common divisor of 250 and 4. 2 Calculate the greatest common factor of 60 and 2720. 20 What is the highest common factor of 1428 and 168? 84 Calculate the greatest common divisor of 2360 and 8. 8 Calculate the greatest common factor of 756 and 24. 12 What is the greatest common divisor of 1271 and 1927? 41 Calculate the highest common divisor of 2108 and 744. 124 What is the greatest common factor of 17484 and 744? 372 Calculate the highest common divisor of 358 and 8771. 179 What is the highest common factor of 2150 and 86? 86 What is the highest common factor of 488 and 11834? 122 Calculate the highest common divisor of 266 and 76. 38 Calculate the highest common factor of 184 and 23. 23 What is the greatest common divisor of 20 and 940? 20 What is the highest common factor of 608 and 722? 38 Calculate the greatest common divisor of 2250 and 15. 15 What is the highest common divisor of 42 and 3738? 42 Calculate the greatest common factor of 217 and 93. 31 Calculate the highest common divisor of 16 and 12. 4 What is the highest common factor of 12 and 498? 6 Calculate the highest common factor of 63 and 4473. 63 Calculate the greatest common divisor of 23200 and 80. 80 What is the greatest common factor of 192 and 40? 8 Calculate the greatest common divisor of 36 and 1791. 9 What is the greatest common divisor of 236 and 8? 4 What is the highest common divisor of 5358 and 114? 114 Calculate the highest common divisor of 3675 and 9. 3 Calculate the greatest common divisor of 918 and 27. 27 Calculate the greatest common factor of 630 and 140. 70 What is the greatest common factor of 416 and 1469? 13 What is the highest common divisor of 1935 and 90? 45 Calculate the highest common divisor of 180 and 195. 15 Calculate the greatest common factor of 6 and 33. 3 Calculate the highest common factor of 20 and 136. 4 Calculate the highest common factor of 2 and 82. 2 What is the greatest common factor of 285 and 228? 57 What is the greatest common factor of 992 and 224? 32 What is the greatest common factor of 34 and 3791? 17 Calculate the greatest common factor of 2809 and 477. 53 Calculate the greatest common factor of 1500 and 875. 125 Calculate the greatest common divisor of 9 and 489. 3 What is the highest common divisor of 35 and 693? 7 What is the highest common divisor of 360 and 5832? 72 What is the highest common divisor of 21 and 3318? 21 Calculate the highest common divisor of 108 and 12. 12 What is the highest common factor of 164 and 4633? 41 What is the greatest common factor of 27 and 7? 1 Calculate the highest common divisor of 2 and 58. 2 What is the highest common factor of 13600 and 16? 16 What is the highest common divisor of 120 and 2112? 24 What is the greatest common factor of 34 and 442? 34 Calculate the greatest common divisor of 931 and 1216. 19 What is the greatest common divisor of 5084 and 1886? 82 Calculate the greatest common factor of 36195 and 15. 15 What is the highest common factor of 67 and 603? 67 What is the greatest common factor of 585 and 45? 45 What is the greatest common divisor of 430 and 344? 86 Calculate the greatest common factor of 28 and 3059. 7 Calculate the highest common factor of 792 and 144. 72 What is the greatest common factor of 55414 and 206? 206 What is the highest common factor of 57 and 75? 3 What is the greatest common factor of 650 and 25? 25 Calculate the greatest common factor of 60 and 16770. 30 Calculate the highest common factor of 8 and 2696. 8 Calculate the greatest common factor of 32 and 8. 8 Calculate the highest common divisor of 15912 and 1428. 204 Calculate the highest common factor of 602 and 172. 86 Calculate the greatest common divisor of 529 and 322. 23 Calculate the highest common factor of 18 and 4590. 18 What is the greatest common divisor of 2948 and 176? 44 What is the greatest common divisor of 2494 and 516? 86 Calculate the greatest common factor of 30 and 470. 10 Calculate the highest common divisor of 560 and 336. 112 Calculate the greatest common factor of 171 and 38. 19 Calculate the greatest common factor of 59 and 1829. 59 What is the greatest common factor of 35 and 315? 35 What is the highest common divisor of 876 and 6? 6 Calculate the greatest common factor of 60 and 132. 12 What is the greatest common divisor of 60 and 200? 20 What is the greatest common factor of 2133 and 1343? 79 Calculate the highest common factor of 3345 and 15. 15 Calculate the highest common factor of 4 and 1282. 2 What is the highest common factor of 6045 and 1116? 93 What is the greatest common divisor of 156 and 364? 52 Calculate the highest common divisor of 59 and 531. 59 What is the greatest common divisor of 76 and 16853? 19 What is the greatest common divisor of 80 and 7240? 40 What is the greatest common divisor of 18668 and 156? 52 What is the greatest common factor of 88 and 1078? 22 Calculate the greatest common divisor of 781 and 497. 71 Calculate the highest common divisor of 424 and 530. 106 What is the greatest common factor of 182 and 39? 13 Calculate the greatest common divisor of 1386 and 70. 14 Calculate the greatest common divisor of 459 and 54. 27 Calculate the highest common divisor of 8207 and 58. 29 Calculate the highest common factor of 272 and 102. 34 Calculate the highest common divisor of 420 and 16140. 60 Calculate the highest common factor of 198 and 44. 22 What is the highest common divisor of 8946 and 504? 126 Calculate the highest common factor of 316 and 19671. 79 Calculate the greatest common divisor of 207 and 3036. 69 What is the highest common divisor of 612 and 272? 68 Calculate the highest common divisor of 156 and 364. 52 What is the greatest common factor of 240 and 32? 16 What is the highest common factor of 112 and 210? 14 What is the highest common factor of 5 and 4315? 5 What is the highest common factor of 80 and 48? 16 What is the highest common divisor of 25 and 15? 5 What is the greatest common factor of 357 and 646? 17 What is the highest common divisor of 14430 and 37? 37 Calculate the highest common divisor of 18 and 8577. 9 Calculate the greatest common divisor of 165 and 198. 33 Calculate the highest common divisor of 66 and 110. 22 Calculate the greatest common factor of 83 and 83. 83 Calculate the greatest common factor of 728 and 16. 8 Calculate the greatest common divisor of 40 and 11152. 8 What is the greatest common divisor of 25 and 175? 25 What is the greatest common divisor of 25612 and 76? 76 What is the highest common divisor of 170 and 578? 34 What is the greatest common factor of 266 and 152? 38 What is the highest common factor of 6108 and 132? 12 What is the greatest common factor of 1107 and 243? 27 Calculate the greatest common divisor of 6 and 726. 6 Calculate the highest common divisor of 33328 and 64. 16 Calculate the greatest common divisor of 10 and 2. 2 Calculate the greatest common divisor of 123 and 7749. 123 What is the highest common divisor of 1085 and 280? 35 Calculate the highest common factor of 1474 and 154. 22 What is the highest common factor of 14 and 238? 14 What is the highest common divisor of 6 and 66? 6 Calculate the greatest common divi	{ "pile_set_name": "DM Mathematics" }
inator of -9/49 and -6/20902651. 146318557 Calculate the smallest common multiple of 246596 and 42. 739788 Calculate the smallest common multiple of 32 and 3218756. 25750048 Calculate the lowest common multiple of 9105 and 249. 755715 Calculate the smallest common multiple of 701316 and 3388. 701316 Calculate the smallest common multiple of 11880 and 8330472. 458175960 What is the common denominator of -18/22325 and 29/5950? 5313350 Find the common denominator of 1/86457 and -85/2806. 10547754 What is the common denominator of 77/936 and -41/1786308? 139332024 Calculate the common denominator of 53/2825 and -4/6828025. 6828025 What is the smallest common multiple of 2092790 and 30? 6278370 What is the common denominator of 67/148580 and 143/794580? 18275340 Find the common denominator of -145/224844 and -73/78. 2922972 What is the smallest common multiple of 101195706 and 86315? 505978530 Calculate the smallest common multiple of 2380476 and 5951190. 11902380 What is the smallest common multiple of 4254260 and 1480? 8508520 Calculate the lowest common multiple of 1886315 and 754526. 3772630 Calculate the smallest common multiple of 1475264 and 165760. 14752640 Find the common denominator of 101/20 and -61/3350488. 16752440 Calculate the common denominator of 15/4 and 97/82898. 165796 Find the common denominator of 85/937850794 and 97/10. 4689253970 What is the least common multiple of 120 and 930424? 13956360 Find the common denominator of -65/2894168 and 3/7235420. 14470840 What is the least common multiple of 81 and 3081258? 27731322 What is the smallest common multiple of 11408610 and 216? 410709960 Calculate the lowest common multiple of 17287844 and 18. 155590596 Calculate the common denominator of 23/48036 and -109/36258. 290281548 What is the least common multiple of 293814151 and 202? 587628302 What is the lowest common multiple of 6734907 and 255? 33674535 Calculate the lowest common multiple of 60 and 11574744. 57873720 What is the least common multiple of 9038900 and 3250? 45194500 Calculate the common denominator of -19/85791683 and -145/9712266. 514750098 What is the least common multiple of 25355 and 2556245? 28118695 What is the common denominator of 49/277778397 and -2/351? 2500005573 What is the common denominator of 59/378 and -127/833328? 5833296 What is the smallest common multiple of 544377400 and 14089768? 5988151400 What is the common denominator of -109/320 and -27/3926552? 157062080 What is the lowest common multiple of 8080 and 65044? 1300880 Calculate the common denominator of 119/16008 and -52/759. 176088 Calculate the lowest common multiple of 38464236 and 90932. 38464236 Find the common denominator of 56/4505625 and -54/6875. 49561875 Find the common denominator of 13/842490 and 7/40293. 9267390 Calculate the common denominator of 149/1000560 and 31/25014000. 25014000 What is the common denominator of 21/14156 and 5/72659209? 290636836 What is the common denominator of -55/422 and 9/3227? 1361794 Find the common denominator of 83/110852 and 7/302956. 226914044 Calculate the smallest common multiple of 3 and 322966572. 322966572 Calculate the lowest common multiple of 6491 and 123329. 123329 What is the least common multiple of 77112 and 53928? 8250984 Calculate the common denominator of -75/277808 and -127/60144. 5833968 Calculate the least common multiple of 25308 and 10286. 3517812 Calculate the least common multiple of 9553820 and 2388455. 9553820 What is the least common multiple of 4705938 and 621? 4705938 Calculate the least common multiple of 231398 and 205202. 10875706 What is the smallest common multiple of 405536 and 1866864? 108278112 Calculate the lowest common multiple of 5576 and 188536. 131409592 What is the lowest common multiple of 524 and 758322? 198680364 Calculate the smallest common multiple of 60 and 3275538. 32755380 Find the common denominator of -31/15738 and -45/899689. 5398134 What is the common denominator of -109/3447600 and -101/3640? 24133200 What is the common denominator of -37/147322 and 58/4641? 5745558 What is the smallest common multiple of 1837512 and 16? 3675024 What is the common denominator of 95/1882364 and -27/2390? 9411820 What is the common denominator of 229/21421050 and -11/690? 21421050 What is the common denominator of -17/16 and -85/321259134? 2570073072 Find the common denominator of -5/13046 and -32/23841. 311029686 Calculate the common denominator of 29/2004024 and -31/704. 16032192 What is the smallest common multiple of 272580 and 856680? 5996760 What is the least common multiple of 658226 and 8290? 3291130 What is the common denominator of 181/3232236 and 113/749504? 51715776 Calculate the least common multiple of 961012 and 156. 2883036 What is the smallest common multiple of 20 and 1126164408? 5630822040 What is the common denominator of -25/83721 and 29/1339536? 1339536 What is the common denominator of -7/33 and 125/59308206? 652390266 What is the common denominator of 173/45696 and -199/6234240? 43639680 Calculate the common denominator of -37/128733 and -73/63195. 246523695 Find the common denominator of 62/3544389 and -65/8270241. 24810723 Calculate the common denominator of -39/464380 and 69/10216360. 10216360 What is the common denominator of 25/581 and -91/12290? 7140490 Calculate the common denominator of -163/7290 and -37/54918. 823770 Calculate the least common multiple of 116256 and 1046304. 1046304 Calculate the lowest common multiple of 45508 and 2752. 31309504 Calculate the smallest common multiple of 470730 and 659022. 3295110 Find the common denominator of 167/15403740 and 23/102. 261863580 What is the common denominator of -97/332180 and -13/204? 996540 Calculate the smallest common multiple of 3663296 and 2368. 3663296 Calculate the lowest common multiple of 211666 and 119712242. 837985694 What is the smallest common multiple of 726299 and 281148? 8715588 Calculate the least common multiple of 282728334 and 49. 282728334 Calculate the least common multiple of 189198 and 28474299. 56948598 What is the lowest common multiple of 13985335 and 7530565? 97897345 Find the common denominator of -17/30290 and 59/55279250. 55279250 Find the common denominator of 7/16 and -57/1433390. 11467120 What is the smallest common multiple of 310 and 26991674? 4183709470 What is the lowest common multiple of 4368 and 31200? 218400 Calculate the lowest common multiple of 8 and 520641568. 520641568 What is the least common multiple of 30371 and 12739254? 140131794 Find the common denominator of 19/2974153 and -163/546. 17844918 Calculate the lowest common multiple of 62156 and 26076. 9882804 What is the common denominator of -89/2909258 and 53/11? 2909258 What is the smallest common multiple of 3004038 and 95670? 15020190 Calculate the least common multiple of 7338009 and 205163. 4057918977 Calculate the smallest common multiple of 115348188 and 21460128. 922785504 What is the common denominator of 89/639768 and -97/588? 31348632 Calculate the smallest common multiple of 2412746 and 314706. 7238238 Find the common denominator of -21/6775840 and -53/280. 47430880 Calculate the least common multiple of 107428976 and 7. 752002832 Find the common denominator of 107/72 and 53/2197334. 79104024 Find the common denominator of 31/214940 and 29/440. 429880 What is the lowest common multiple of 4458267 and 4458267? 4458267 Calculate the lowest common multiple of 44422962 and 6. 44422962 What is the smallest common multiple of 25483 and 1775? 45232325 Calculate the least common multiple of 12126474 and 49853282. 448679538 What is the common denominator of 73/451528 and -31/60839? 37476824 Calculate the common denominator of -55/68 and -29/547328. 9304576 Calculate the least common multiple of 307664 and 525347. 2412393424 Find the common denominator of -26/603 and -99/105056. 945504 Find the common denominator of -129/631280 and -43/12636. 153401040 Find the common denominator of -46/545194149 and 19/292. 2180776596 What is the smallest common multiple of 23350 and 184465? 1844650 What is the common denominator of -49/63822116 and -49/4796? 702043276 Find the common denominator of -25/7388 and 89/149514650. 299029300 Calculate the common denominator of 95/476 and 41/	{ "pile_set_name": "DM Mathematics" }
kilometer in meters? 625 Convert 4.03059 meters to nanometers. 4030590000 What is 1/4 of a micrometer in nanometers? 250 How many millilitres are there in 5047.707l? 5047707 What is 73/4 of a meter in centimeters? 1825 What is fifty-eight thirds of a decade in months? 2320 How many micrometers are there in 7.921126nm? 0.007921126 How many milliseconds are there in 1/4 of a second? 250 How many micrograms are there in 19.40624 kilograms? 19406240000 How many centimeters are there in 0.9178791nm? 0.00000009178791 What is one twentieth of a day in minutes? 72 How many minutes are there in fifty-one sevenths of a week? 73440 Convert 125478.1ug to grams. 0.1254781 Convert 403614.8 microseconds to milliseconds. 403.6148 Convert 854.4788 kilograms to grams. 854478.8 What is 3/8 of a kilometer in meters? 375 What is 481.305 nanometers in micrometers? 0.481305 How many hours are there in 3/56 of a week? 9 How many grams are there in thirty-one halves of a kilogram? 15500 What is 5/4 of a minute in milliseconds? 75000 Convert 447786.1 millilitres to litres. 447.7861 What is seven halves of a decade in months? 420 How many minutes are there in seven sixths of a hour? 70 What is 52777.45ug in nanograms? 52777450 What is 157947.7kg in micrograms? 157947700000000 How many hours are there in seven thirds of a day? 56 How many months are there in twenty-one fifths of a millennium? 50400 What is 3.92228 micrograms in tonnes? 0.00000000000392228 What is one fifth of a litre in millilitres? 200 Convert 731625.8ug to milligrams. 731.6258 Convert 257877.6nm to centimeters. 0.02578776 What is one quarter of a microgram in nanograms? 250 How many grams are there in one tenth of a kilogram? 100 Convert 301801.8 tonnes to grams. 301801800000 How many weeks are there in 1503.132687us? 0.0000000024853384375 What is 9538.69um in centimeters? 0.953869 Convert 2.235246ug to nanograms. 2235.246 What is 896184.7kg in milligrams? 896184700000 Convert 5786.56l to millilitres. 5786560 How many hours are there in 7024.821 days? 168595.704 What is 37382889.6 minutes in weeks? 3708.62 How many hours are there in 20.215818 nanoseconds? 0.000000000005615505 What is 6.518177 micrograms in kilograms? 0.000000006518177 What is eighteen fifths of a kilometer in meters? 3600 What is 1/10 of a litre in millilitres? 100 What is 40.75213 millennia in centuries? 407.5213 Convert 83691.62 microseconds to nanoseconds. 83691620 How many centuries are there in fourty-six fifths of a millennium? 92 Convert 8.26353ms to minutes. 0.0001377255 How many litres are there in 8.456871 millilitres? 0.008456871 How many millimeters are there in fourty-five halves of a centimeter? 225 What is fifteen quarters of a century in years? 375 Convert 96.33756 millennia to years. 96337.56 What is 26/5 of a litre in millilitres? 5200 How many millimeters are there in one twentieth of a kilometer? 50000 How many milliseconds are there in 3/10 of a second? 300 What is three eighths of a milligram in micrograms? 375 Convert 25.07433 days to seconds. 2166422.112 Convert 2837303.1ns to days. 0.00000003283915625 How many micrometers are there in 29/5 of a centimeter? 58000 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is one fifth of a tonne in kilograms? 200 What is 25/2 of a kilogram in grams? 12500 What is two ninths of a day in minutes? 320 What is fifty-four fifths of a millennium in centuries? 108 Convert 27826.35 years to centuries. 278.2635 Convert 962052.5 meters to kilometers. 962.0525 What is fourty-nine quarters of a millimeter in micrometers? 12250 Convert 1.13183 nanometers to centimeters. 0.000000113183 How many millennia are there in 0.4636747 decades? 0.004636747 What is seven sixths of a year in months? 14 Convert 923209.4 decades to months. 110785128 How many milliseconds are there in 5.580306 days? 482138438.4 How many nanometers are there in 0.3146767 millimeters? 314676.7 What is seven halves of a litre in millilitres? 3500 What is 2.7463323 months in millennia? 0.000228861025 How many millilitres are there in five quarters of a litre? 1250 What is fourty-two fifths of a centimeter in millimeters? 84 What is eleven quarters of a millennium in months? 33000 What is 1/20 of a kilometer in millimeters? 50000 How many kilograms are there in 3/5 of a tonne? 600 Convert 17.57636t to milligrams. 17576360000 How many minutes are there in 33736.72 hours? 2024203.2 What is twenty-one halves of a second in milliseconds? 10500 How many millimeters are there in 7/2 of a centimeter? 35 What is twenty-one eighths of a century in months? 3150 What is 22/9 of a hour in seconds? 8800 How many nanometers are there in 21/5 of a micrometer? 4200 How many grams are there in 926.278 tonnes? 926278000 How many micrometers are there in 2/125 of a centimeter? 160 How many microseconds are there in thirty-three fifths of a millisecond? 6600 How many nanometers are there in 0.485679 meters? 485679000 What is 52/5 of a meter in millimeters? 10400 What is 27/5 of a meter in millimeters? 5400 What is fifty-one sevenths of a week in minutes? 73440 How many nanograms are there in 1/4 of a microgram? 250 How many months are there in 21/2 of a decade? 1260 How many years are there in 32.7838 centuries? 3278.38 Convert 3.628008 litres to millilitres. 3628.008 How many micrometers are there in 21/8 of a centimeter? 26250 How many millilitres are there in 7429.999l? 7429999 How many micrometers are there in five eighths of a centimeter? 6250 What is 42350.2 nanograms in micrograms? 42.3502 What is twenty-five sevenths of a week in hours? 600 How many millilitres are there in one twentieth of a litre? 50 How many minutes are there in 2805.3087s? 46.755145 How many grams are there in 3/5 of a kilogram? 600 How many centimeters are there in 599033.6km? 59903360000 How many grams are there in fourty-five eighths of a kilogram? 5625 What is six fifths of a tonne in kilograms? 1200 What is three eighths of a day in seconds? 32400 Convert 0.9655554g to nanograms. 965555400 How many tonnes are there in 3140.678 micrograms? 0.000000003140678 What is 4160.74 millennia in decades? 416074 How many nanograms are there in 3/8 of a microgram? 375 What is fifteen quarters of a kilometer in meters? 3750 What is 192003.9ml in litres? 192.0039 What is 55/4 of a meter in centimeters? 1375 Convert 54679.7 millilitres to litres. 54.6797 How many millimeters are there in 0.4105094 nanometers? 0.0000004105094 What is 51/2 of a second in milliseconds? 25500 Convert 887.2832ml to litres. 0.8872832 What is 459.5572 litres in millilitres? 459557.2 How many millimeters are there in 2/125 of a meter? 16 Convert 67.44965 centimeters to nanometers. 674496500 How many micrometers are there in 3/10 of a millimeter? 300 How many micrometers are there in one fifth of a millimeter? 200 Convert 1.76726mm to nanometers. 1767260 What is 1146.588m in millimeters? 1146588 What is one quarter of a meter in centimeters? 25 What is 3/10 of a decade in months? 36 How many months are there in 16/15 of a century? 1280 How many tonnes are there in 9.615735 kilograms? 0.009615735 What is 1/5 of a kilometer in meters? 200 How many minutes are there in 1/9 of a day? 160 How many kilometers are there in 194.0333mm? 0.0001940333 What is seventy-one quarters of a millennium in years? 17750 Convert 27768.7 decades to years. 277687 What is twenty-nine halves of a litre in millilitres? 14500 Convert 96751.665 nanoseconds to days. 0.0000000011198109375 What is 7/3 of a day in minutes? 3360 What is 1/4 of a milligram in micrograms? 250 What is 16576.13kg in nanograms? 16576130000000000 How many millilitres are there in 5/4 of a litre? 1250 What is 780456.7 milligrams in kilograms? 0.7804567 How many seconds are there in five quarters of a hour? 4500 What is 55/2 of a second in milliseconds? 27500 What is 676754.6 centuries in years? 67675460 How many millilitres are there in fifteen quarters of a litre? 3750 What is 18921.2 grams in kilograms? 18.9212 What is 7/2 of a centimeter in micrometers? 35000 What is eleven halves of a gram in milligrams? 5500 What is 3/10 of a century in decades? 3 What is fifteen quarters of a milligram in micrograms? 3750 What is 3/4	{ "pile_set_name": "DM Mathematics" }
. Find the first derivative of t(j) wrt j. 219j2 - 2j Let c(v) = -97v2 + 130 - 39 + 71v*2 - 4v*4. Let z(h) = 2h*4 + 13h*2 - 46. Let q(o) = 6c(o) + 11z(o). Find the first derivative of q(m) wrt m. -8m*3 - 26m Suppose -s + 21 = 6s. Suppose sh - 5w = -1, -4h - 2w + 4w + 8 = 0. What is the first derivative of -12 - 5 - 1 + h + 20x wrt x? 20 Let n(t) be the second derivative of -725t*4/6 - 382t*3/3 + 498t. What is the second derivative of n(w) wrt w? -2900 Let h(d) be the first derivative of -209d5 + 458d*3/3 - 1288. What is the third derivative of h(u) wrt u? -25080u Suppose -3v - 1999 = -y, 5v = 3v. What is the derivative of -67 - yl*4 + 1945l*4 + 14 wrt l? -216l*3 Let n(w) be the second derivative of -719w*4/4 - 35w*3/3 - 8w*2 - 1265w. Find the second derivative of n(i) wrt i. -4314 Let k(q) be the first derivative of -2q5/5 - 41q*4/4 + 983q*3/3 - 217. Find the third derivative of k(v) wrt v. -48v - 246 Let i(j) = 4387j + 6008. Let b(a) = -4387a - 5963. Let h(r) = 5b(r) + 6i(r). Differentiate h(s) wrt s. 4387 Let a(n) be the third derivative of 0n5 + 60n*2 + 0n*6 + 0 - 5/12n*4 - 1/168n*8 - 7/6n*3 + 0n + 0n7. Find the second derivative of a(k) wrt k. -40k*3 Let u(x) be the third derivative of 356x5/15 - x4/12 + 502x3/3 - 2x*2 + 33x. Find the first derivative of u(t) wrt t. 2848t - 2 Let u(b) be the third derivative of -131b7/105 - b6/60 - 65b4/3 + b3/6 + 1145b*2. Find the second derivative of u(i) wrt i. -3144i*2 - 12i Let b be (9/6)/(2/(-8)). Let i be -2(33/b + 1). Differentiate -11 + 26 + c - ic - 4c with respect to c. -12 Suppose 16 + 84 = 2k. What is the derivative of -37y + 129 + ky + 27 + 64y wrt y? 77 Let t be ((-155)/(-20) + -7)12. Differentiate -to2 - 5 + 2o*3 + 3o3 + o2 + 0o3 with respect to o. 15o*2 - 16o Let d be 6 + (6/3 - -2). Suppose 5q = dq - 30. Find the third derivative of 20j6 + 2j*6 + 10j*2 - qj*6 wrt j. 1920j*3 Suppose -6c = -5c + 2d - 13, -3c - d = -24. What is the second derivative of cr - r - 20r - 118r + 123r4 wrt r? 1476r*2 What is the second derivative of 504u - 1328u + 913u*3 + 1841u wrt u? 5478u Let w(f) be the second derivative of 4643f*5/20 + 1400f*2 + 8037f. Differentiate w(i) wrt i. 13929i2 Let u be (1/(-13))/(75/(-975)). Find the third derivative of 7552x*4 + 91x*5 - 7552x*4 + u + 7x*2 wrt x. 5460x*2 Let c(j) be the third derivative of -1/6j*3 + 58j - 71/60j5 - j2 - 17/24j*4 + 0. Find the second derivative of c(m) wrt m. -142 Let l(a) be the first derivative of -45 + 0a*4 - 1/3a*3 + 3/5a*5 + 7/2a*2 + 9a. Find the second derivative of l(x) wrt x. 36x2 - 2 Let y(j) be the second derivative of -9 - 1/6j*4 + 0j*3 - 7/2j*2 - 3j - 14/5j5. What is the third derivative of y(q) wrt q? -336 Suppose 5l + 3j = 541, -l + 3j = 3l - 422. Differentiate l + 71a*3 - 41 - 47 with respect to a. 213a*2 Let l(y) = 6y4 + y3 - y*2 - y + 1. Let p(u) = 1101u*4 - 2u*3 - 1092u*2 + 2u - 2. Let z(c) = 2l(c) + p(c). Find the third derivative of z(x) wrt x. 26712x Find the second derivative of 5381r3 + 3 - 1040r - 1453r3 - 582r wrt r. 23568r Let s(p) = 24p - 62. Let r be s(6). Let d = r - 80. Find the third derivative of -14h4 + h4 + 40h*d - 8h*4 wrt h. -504h Find the second derivative of 9837d - 1266d - 295d - 1969d*2 - 1633d*2 wrt d. -7204 Let b(i) be the second derivative of -721i*6/3 + 1263i4/4 - i2/2 + 7283i. What is the third derivative of b(t) wrt t? -173040t Let z(s) = 3s2 + 18s. Let i(h) = -20h2 - 359h - 587. Let d(k) = i(k) + 3z(k). Find the first derivative of d(g) wrt g. -22g - 305 Let k(d) be the second derivative of -7d + 2 - 7/2d*2 + 0d*4 + 7/6d*3 + 66/5d*5. Find the second derivative of k(c) wrt c. 1584c Let d = 682 - 478. What is the third derivative of -382m2 + 55m*3 + 256m*2 + dm*2 wrt m? 330 Let g = -45 - -57. Find the third derivative of 73w*2 + 7w*4 - gw - 74w2 + 8w*4 wrt w. 360w Let j(b) be the second derivative of 0 + 44b + 5/3b*4 - 1/6b*3 - 43b*2. Find the first derivative of j(p) wrt p. 40p - 1 Let g(q) = -12q + 2. Let b(x) = -2x*2 + 5543x + 7477. Let y(t) = -b(t) + 12g(t). Differentiate y(p) with respect to p. 4p - 5687 Let v(w) be the third derivative of -41w7/210 - 3w*6/40 - 1402w*3/3 + 3005w*2. Differentiate v(m) with respect to m. -164m*3 - 27m*2 Let s(c) be the third derivative of 4279c*5/60 + 761c*4/12 + 4120c*2. What is the second derivative of s(k) wrt k? 8558 Let f(g) be the second derivative of -23g5/10 + g4/6 + 1433g3/6 - g2 - 316g + 8. Find the second derivative of f(r) wrt r. -276r + 4 Find the third derivative of -26w*4 - 9w*4 - w + 1643w*2 + 1 + 4w*4 + 19551w*3 - 19591w*3 wrt w. -744w - 240 Let d(a) = a3 + a2 - 8a - 3. Let f(n) = 13n*3 - 110n*2 - 4063n - 14. Let l(m) = -5d(m) + f(m). What is the second derivative of l(h) wrt h? 48h - 230 Let p = -58 - -1716. Find the third derivative of -1658g5 + 7g + pg5 + 4g + 13g6 - 2g*2 wrt g. 1560g*3 Let z(x) be the third derivative of -1/6x*3 - 19/60x*6 + 1/2x*5 + 0 + 16x*2 + 0x*4 + 0x. Find the third derivative of z(l) wrt l. -228 Let p(h) be the third derivative of -13877h6/120 - 9425h*3/6 - 9423h*2. Find the first derivative of p(b) wrt b. -41631b2 Let w(s) = s2 + 24s - 563. Let t(l) = 4l*2 + 25l - 563. Let q(o) = -3t(o) + 4w(o). Differentiate q(r) with respect to r. -16r + 21 Suppose 0 = -7h + 3h - 3q + 24, 4h - 24 = 4q. Suppose -41 + 245 = ho. What is the third derivative of 25d*2 + 5d*5 - 23d*5 + od*5 wrt d? 960d*2 Find the second derivative of 2m + 234 - 1472759m4 + 125 + 1473984m*4 wrt m. 14700m*2 Let r(j) be the third derivative of 0j*4 + 0 + 32j*2 + 0j*3 + 1/15j*5 + 3j - 19/120j6 - 1/105j*7. What is the third derivative of r(n) wrt n? -48n - 114 Let n(y) be the first derivative of -140 + 62y + 29/3y*3 + 1/2y*2. What is the second derivative of n(i) wrt i? 58 What is the second derivative of 11h + 52h3 - 33h + 12h + 8h + 58h3 - 3 wrt h? 660h Let m(c) = -10c2 + 19. Let g be m(0). What is the third derivative of -29v*3 + 9v*3 - 276v*2 + 4v6 - v6 + 12v3 + gv*2 wrt v? 360v*3 - 48 Let w(u) be the first derivative of -575u*4/4 + 1131u + 635. Differentiate w(h) with respect to h. -1725h2 Let t(p) = 3p*3 + 3p*2 - p - 1. Let s(g) = 38g*4 + 6g*3 + 2528g*2 - 2g - 2. Let k(o) = s(o) - 2t(o). Find the third derivative of k(z) wrt z. 912z Differentiate 176i - 498i + 392i2 + 179i - 1733 + 139i wrt i. 784i - 4 Let z(x) = 4x - 15. Let j be z(12). Suppose -14r = -17r + j. What is the second derivative of 3t*3 + 3t*2 - t - 3t*2 + rt wrt t? 18t Let k = 133 - 47. Differentiate -44 + 100 + 53g + 81g + k with respect to g. 134 Find the second derivative of -11v - 7v + 9v + 8v - 3342 - 5542v2 + 1131 wrt v. -11084 Let u(y) be the first derivative of y6/6 - 317y4/4 - y3 + 2686y*2 - 3205. What is the second derivative of u(r) wrt r? 20r*3 - 1902r - 6 Let i(k) be the second derivative of 32k + 0k*2 - 1/4k*5 - 155/6k*3 + 2 + 1/3k*4. Find the second derivative of i(l) wrt l. -30l + 8 Let z(t) be the second derivative of 713t3/3 - 561t*2 + 138t. Find the first derivative of z(b) wrt b. 1426 Let n = 4 - -38. Find the first derivative of 1 + n - 8 - 12 - 18w wrt w. -18 Let f(b) = 1 + 11 + 10 - 15 + b. Let p be f(6). What is the second derivative of pk - 85k5 + 6k + 89k5 wrt k? 80k*3 Find the third derivative of -169b*6 + 3b*4 - 111b*6 + 0b4 - b4 - 1067b2 - 21b*6 wrt b. -36120b*3 + 48b What is the third derivative of 580q6 - 23830q - 1560q6 - 1585q*6 + 463q*2 + 23831q wrt q? -307800q3 Let v(k) = 57k*3 - 3k*2 - 9k. Let u(g) = 35g3 + 8g + 2g - 93g*3 - g + 4g*2. Let q(s) = 5u(s) + 6v(s). Find the third derivative of q(z) wrt z. 312 Let r be (-1638)/(-6) + 13. What is the first derivative of -15l2 - 77l*2 + rl*2 - 67l*2 + 146 wrt l? 234l Let t =	{ "pile_set_name": "DM Mathematics" }
5? 5 Suppose -151 + 39 = -2y. Calculate the greatest common factor of y and 7. 7 Suppose 0 = h - 2h + 8. Let l be ((-4)/6)/(8/(-2004)). Let w = l + -95. Calculate the highest common divisor of w and h. 8 Let f(n) = -n + 3. Let d be f(2). Let r = -1 - d. Let z = 8 + r. Calculate the highest common factor of z and 6. 6 Suppose 2x + 132 = 366. What is the greatest common divisor of 13 and x? 13 Let d(c) = c + 1. Let p be d(8). Calculate the greatest common factor of 9 and p. 9 Let b = -8 + 15. What is the highest common divisor of b and 7? 7 Suppose 2x + 6 + 0 = 2f, 2f = -3x + 16. Let q(r) = 2r + 8. Let d be q(-8). Let j be (d/f)/(2/(-165)). What is the highest common factor of j and 12? 12 Let j(z) = -29z3 - 2z*2 - 2z - 1. Let v be j(-3). Suppose 0 = -2q + 4 + 4. Suppose s = -qs + v. Calculate the highest common factor of s and 14. 14 Suppose 35m = 30m + 65. Calculate the greatest common divisor of 1 and m. 1 Let k(n) = 33n2 - 2n - 1. Let x be k(-1). Calculate the greatest common factor of 34 and x. 34 Suppose -i = -3i + 2. Let q = 4 - i. Let j = -15 - -33. What is the greatest common divisor of j and q? 3 Let a be -1 + -1 - (-12 + 0). Suppose -3y + 5f + 31 = 1, y - 5f = 10. Calculate the greatest common divisor of a and y. 10 Let b = 89 - 29. Suppose 2a - a = b. What is the highest common divisor of a and 24? 12 Let k = 1 + 2. Suppose 3b = kv - 0 + 3, 0 = 5b - 2v - 20. What is the highest common divisor of 18 and b? 6 Let k(x) = -10x*2 + 0x*3 - 6x - x*3 - 1 + 3x*2. Let j be k(-6). Let r be j/(-3) - (-88)/6. What is the greatest common divisor of r and 15? 15 Suppose 0 = c - 4, -5v + 4c - 54 + 713 = 0. What is the highest common factor of v and 54? 27 Let s = 402 - -41. Suppose -3u + s = 143. Calculate the greatest common factor of u and 20. 20 Let c = -1 - -12. Let s be 22(28/(-8) + 4). What is the greatest common factor of s and c? 11 Let j be (2/3)/(2/21). Let u = -2 + j. Calculate the greatest common divisor of u and 10. 5 Let a be 2(-222 + 2). Let u be (a/(-30))/(2/10). Calculate the highest common divisor of 154 and u. 14 Let x be (2/8)/((-4)/(-16)). Let u be (11 - -2) + 15/5. Let n = u - x. Calculate the greatest common factor of 75 and n. 15 Let t(s) be the second derivative of 7s*3/6 - 3s*2 + 4s. Let v be t(4). Let x = -21 + 32. What is the highest common divisor of x and v? 11 Let v = -26 + 59. Let d(y) = 2y + 3. Let w be d(4). What is the highest common divisor of w and v? 11 Let h(g) be the first derivative of -g4/4 - 13g*3/3 - 11g*2/2 + 13g + 3. Let l be h(-12). What is the greatest common divisor of l and 1? 1 Let d = 2 + -17. Let r = 0 - 6. Let i = r - d. Calculate the highest common factor of i and 63. 9 Let s(o) = 4o - 2. Suppose 3h = 2m + 21 - 5, -2h - 1 = m. Let q be s(h). Calculate the greatest common factor of q and 3. 3 Suppose 440 + 472 = 6b. Calculate the highest common divisor of b and 8. 8 Suppose -2x - y = -4, 0 = 3x - 0x - 2y - 20. Suppose -xj = -2j - 80. What is the greatest common divisor of j and 100? 20 Let c(x) = -x3 + 10x2 + x - 8. Let u be c(10). What is the highest common factor of u and 22? 2 Let m(a) = -a2 + 5a + 4. Let x be m(5). What is the greatest common factor of x and 36? 4 Let c = 362 - 133. Let f = -121 + c. Let r be 0 + 0 + f + -3. What is the greatest common divisor of 15 and r? 15 Let g = 8 - 7. What is the highest common factor of 7 and g? 1 Suppose -4f + 0g + 833 = g, 2g - 1039 = -5f. Let z = -74 + f. What is the highest common factor of 54 and z? 27 Let v be 6-21/(-3). What is the greatest common factor of 4 and v? 4 Let m = -54 + 63. Calculate the highest common factor of m and 81. 9 Let m(p) = 5p*2 - 2p - 3. Let q be m(3). What is the greatest common factor of q and 24? 12 Let r = -6 - 0. Let m be (-21)/r(-4 - -2). Let i be 2/m + 96/42. Calculate the highest common divisor of 2 and i. 2 Suppose 5z - 10 = -0. Suppose 4f = 5r + 22, -f + 12 = -3r + zf. Let c(u) = -u - 1. Let m be c(r). Calculate the greatest common factor of 5 and m. 5 Suppose 0b - 6b = -12. What is the greatest common factor of 14 and b? 2 Let g(s) = s*2 - 4s - 3. Let j(m) = m*3 - 4m*2 + 2m + 1. Let d be j(2). Let p be g(d). What is the greatest common divisor of 162 and p? 18 Let c be 7/(-1)162/(-21). What is the greatest common divisor of c and 72? 18 Suppose 0 = b + 4, 0z + 3b + 3 = -3z. Suppose zs + 3a = 99, 6 = -a - a. Calculate the highest common factor of 4 and s. 4 Let f(r) = 17r - 2. Let s be f(9). Let b = -32 + s. Suppose -l = -4x + 479, 2x - b = x + l. Calculate the highest common divisor of 15 and x. 15 Suppose 2u + 20 = 7u. Calculate the highest common factor of 28 and u. 4 Suppose 0 = -0b - 4b. Suppose 6x - 4x - 24 = b. Calculate the greatest common divisor of 30 and x. 6 Let a be (-2)/4 + 182/4. Let r be ((-133)/14 + 1/2)-2. What is the greatest common factor of r and a? 9 Suppose s + 5 = -4g + 25, 3s - 3g = 0. Suppose 3o - 4o = 30. Let z = -14 - o. Calculate the greatest common divisor of s and z. 4 Let g(n) = 2n - 6. Let y be g(4). Let k(c) = c + 8. Let i be k(-6). Let q be (i - 2 - 2)/(-1). Calculate the highest common divisor of q and y. 2 Let y(s) = s*3 - 7s*2 + 4s - 19. Let p be y(8). Calculate the greatest common factor of p and 11. 11 Suppose 3b = 4f - 23, -3f + 24 = -4b - f. Let v(y) = -y*2 + 2y + 1. Let o be v(b). Let p = -16 - o. Calculate the highest common factor of 2 and p. 2 Let a(w) be the first derivative of 243w2/2 - w + 1. Let n be a(1). Suppose -12 = -4f, -2o + 2f + 4 = -34. What is the highest common divisor of n and o? 22 Let c be 3/(1 + 8/(-6)). Let t = 10 + c. Calculate the greatest common factor of t and 2. 1 Let c = 5 + -2. Let m(y) = 7y - 2 + yc + y2 - 3y*2 - 4y*2. Let z be m(5). What is the greatest common divisor of z and 56? 8 Suppose -3k + 4 = -p - 4, -2k - 4p = 4. Suppose -b = -kb - 6. Let c be (-574)/b + (-3)/(-9). What is the highest common factor of c and 12? 12 Suppose -108 = -4x + w - 5w, -2x + 3w = -59. Suppose d = 22 + 48. What is the greatest common divisor of d and x? 14 Suppose 4p + 372 + 376 = 0. Let k = -110 - p. Let y be 0 + 0 - (-11)/1. Calculate the greatest common divisor of k and y. 11 Let d(b) = -b*3 - 7b*2 - 3b + 1. Let h be d(-7). Let v = -3 + 8. Suppose vn = 291 - 16. Calculate the greatest common divisor of h and n. 11 Let l(b) = -b2 + 18. Let g be l(0). Suppose 4w = -g + 114. Suppose -4o + 3o = 2c - w, 0 = 4o + 5c - 96. What is the highest common factor of 36 and o? 12 Let x be (-20)/(-9) - (-4)/(-18). Let k be 3 - 0 - (-1 + x). Suppose -kr - 44 + 220 = 0. Calculate the greatest common factor of r and 8. 8 Suppose x = 31 - 11. What is the highest common factor of 10 and x? 10 Let m be 4/(-10) + 162/5. Let r = -10 + m. Let w = 54 - -1. Calculate the greatest common factor of r and w. 11 Let p(g) = -12g - 4. Let a be p(-4). Let b(y) = -y + 4. Let n be b(0). Calculate the highest common factor of n and a. 4 Suppose -5 = 2b + 3o, 5b - 18 = -o + 2. Let u be 100/(5 + 0) - 0/2. Calculate the highest common factor of u and b. 5 Suppose 2y = 3o - 0o + 13, 5o = -5. Suppose 3a = 4g - 167, ya = 3g - 78 - 39. What is the highest common factor of 4 and g? 4 Let p(m) = 2 + 1 + 0 + 6m. Let y = -12 - -19. Let x be p(y). Calculate the highest common factor of 5 and x. 5 Let z(v) = -v3 + 10v*2 + 5v - 8. Let t be z(10). Suppose 0 = -f + 4b + 12, -4f + 0b - 2b + 120 = 0. Calculate the highest common divisor of f and t. 14 Suppose -244 = -4u - 3k, 4u = -0k + k + 228. Calculate the highest common factor of u and 232. 58 Let z be 125 + (0/(-3))/1. What is the highest common factor of 50 and z? 25 Suppose 3 = x - 60. Calculate the greatest common factor of x and 7. 7 Suppose -1 - 3 = -2d. Suppose -d + 3 = n. Suppose 4x - 20 - 16 = 0. What is the highest common factor of x and n? 1 Suppose 7v - 44 = 3v. What is the highest common divisor of v and 11? 11 Let c(y) = -4y - 2y + 4y - 1 + 3. Let i be c(2). Let b be i/(-7) + (-19)/(-7). What is the highest common divisor of b and 1? 1 Let p be 2/(-10) + (1344/20 - -5). Let n be (1 + 15)(-2)/(-4). What is the greatest common divisor of	{ "pile_set_name": "DM Mathematics" }
e oo. 1/22 Three letters picked without replacement from {x: 3, d: 2, y: 1, k: 11, p: 2}. What is prob of sequence pxk? 11/969 Four letters picked without replacement from {u: 2, t: 6, k: 7}. Give prob of sequence kktu. 1/65 What is prob of sequence owo when three letters picked without replacement from {w: 10, s: 3, o: 3, z: 2}? 5/408 Calculate prob of sequence qw when two letters picked without replacement from {w: 1, z: 1, v: 2, c: 1, k: 1, q: 1}. 1/42 Calculate prob of sequence gf when two letters picked without replacement from jfgjgfjgjj. 1/15 Two letters picked without replacement from hwlzrzzzzzlhlrzzhg. Give prob of sequence hw. 1/102 Calculate prob of sequence vev when three letters picked without replacement from veeeveuueu. 1/72 What is prob of sequence xxx when three letters picked without replacement from xaxxxxxxxaaxxxxxxxxa? 28/57 Four letters picked without replacement from {c: 5, z: 1, f: 6, n: 1, i: 2, g: 1}. Give prob of sequence cznc. 1/2184 Two letters picked without replacement from yrymyrmymyymmyyymmm. Give prob of sequence my. 4/19 What is prob of sequence nnn when three letters picked without replacement from wwwwnwwwnnwnwnww? 1/56 Two letters picked without replacement from wuvpvxnp. Give prob of sequence up. 1/28 Calculate prob of sequence ococ when four letters picked without replacement from zzzzzzozzczzzzzoczzo. 1/9690 Three letters picked without replacement from {h: 1, y: 1, u: 1}. Give prob of sequence yhu. 1/6 Calculate prob of sequence amrg when four letters picked without replacement from {g: 6, r: 5, a: 1, m: 3}. 1/364 Four letters picked without replacement from {z: 2, x: 12, m: 3}. Give prob of sequence zmzx. 3/2380 Three letters picked without replacement from {e: 8, s: 2, a: 2, u: 2, g: 1}. What is prob of sequence sgs? 1/1365 Four letters picked without replacement from rrerrjrrjuuurrur. What is prob of sequence erur? 3/455 Two letters picked without replacement from {v: 1, g: 1, w: 1, b: 2}. What is prob of sequence gv? 1/20 Calculate prob of sequence qa when two letters picked without replacement from {h: 7, q: 10, a: 1}. 5/153 Two letters picked without replacement from hsgsrrmrhrhhshhrhsv. What is prob of sequence hr? 35/342 Calculate prob of sequence km when two letters picked without replacement from {v: 3, n: 1, m: 1, q: 2, k: 3}. 1/30 Calculate prob of sequence cc when two letters picked without replacement from {s: 2, m: 2, c: 2}. 1/15 What is prob of sequence iq when two letters picked without replacement from {q: 2, m: 2, i: 2}? 2/15 Three letters picked without replacement from {p: 3, n: 5, g: 3, w: 1}. What is prob of sequence gwg? 1/220 Calculate prob of sequence rn when two letters picked without replacement from {h: 4, w: 2, n: 4, g: 7, r: 1}. 2/153 Three letters picked without replacement from mhmmibamipaiih. Give prob of sequence ibi. 1/182 What is prob of sequence quc when three letters picked without replacement from {q: 9, u: 4, c: 3}? 9/280 Two letters picked without replacement from {a: 1, i: 1, q: 2, b: 1, e: 1, n: 1}. What is prob of sequence be? 1/42 Four letters picked without replacement from pupuvlvououq. What is prob of sequence ppul? 1/1485 Calculate prob of sequence yj when two letters picked without replacement from {e: 1, l: 2, g: 1, j: 2, y: 2}. 1/14 Three letters picked without replacement from sgysggysgssssy. Give prob of sequence ygy. 1/91 What is prob of sequence an when two letters picked without replacement from amkmaaanmuu? 2/55 Calculate prob of sequence flix when four letters picked without replacement from xxiflycf. 1/420 Calculate prob of sequence hc when two letters picked without replacement from {b: 1, l: 1, c: 1, h: 1, r: 1, n: 2}. 1/42 What is prob of sequence sv when two letters picked without replacement from {e: 3, s: 5, v: 5}? 25/156 Four letters picked without replacement from falkadaadaafd. What is prob of sequence dffd? 1/1430 Four letters picked without replacement from {d: 2, k: 11}. Give prob of sequence kkdk. 3/26 What is prob of sequence px when two letters picked without replacement from {i: 1, p: 1, x: 1}? 1/6 Calculate prob of sequence dv when two letters picked without replacement from tvvdedvvddddvfvvv. 3/17 Calculate prob of sequence uxgg when four letters picked without replacement from txxxxxxgzxgxuxzx. 1/2184 Two letters picked without replacement from {x: 11, u: 1}. Give prob of sequence xx. 5/6 Three letters picked without replacement from yoooyfsyoooa. What is prob of sequence oso? 1/44 Four letters picked without replacement from {o: 4, z: 2, s: 2, e: 3}. What is prob of sequence sooo? 1/165 Two letters picked without replacement from snuhk. What is prob of sequence kh? 1/20 Two letters picked without replacement from {m: 2, v: 3, n: 4, d: 3, p: 2, b: 1}. Give prob of sequence mn. 4/105 Calculate prob of sequence vtt when three letters picked without replacement from {y: 1, v: 1, x: 1, s: 3, t: 5, a: 1}. 1/66 Two letters picked without replacement from {a: 2, w: 1, x: 1}. Give prob of sequence xa. 1/6 Calculate prob of sequence ww when two letters picked without replacement from xxxxxxxwwxxxxwxxxxxx. 3/190 Two letters picked without replacement from ckckrkorockdkock. Give prob of sequence ro. 1/40 Calculate prob of sequence iw when two letters picked without replacement from iiwiwiiiiiiiiiiw. 13/80 Three letters picked without replacement from {x: 2, i: 1, j: 3, s: 3, o: 3, w: 7}. What is prob of sequence ijj? 1/969 Four letters picked without replacement from {x: 4, w: 2, r: 1, k: 2}. What is prob of sequence xkrw? 1/189 Four letters picked without replacement from bdoodggdbdbb. Give prob of sequence oogb. 2/1485 Calculate prob of sequence mak when three letters picked without replacement from {m: 9, a: 4, c: 1, d: 2, k: 4}. 2/95 Three letters picked without replacement from {k: 2, a: 1, q: 1, i: 5, t: 4, g: 2}. What is prob of sequence kgi? 2/273 What is prob of sequence bu when two letters picked without replacement from uzbujjjjjuujcjcjujcj? 1/76 Two letters picked without replacement from lggagggghglggggsgagv. Give prob of sequence gl. 13/190 Two letters picked without replacement from {j: 2, u: 1, d: 1, m: 1, l: 1, s: 2}. Give prob of sequence jj. 1/28 Calculate prob of sequence cccc when four letters picked without replacement from {c: 7, l: 9}. 1/52 Three letters picked without replacement from {j: 2, i: 2, w: 1, b: 1, k: 2}. Give prob of sequence jjk. 1/84 Calculate prob of sequence msk when three letters picked without replacement from nknkpnmkmpkksnsskpkn. 7/1140 Four letters picked without replacement from uuuxxuuuuu. Give prob of sequence xuux. 1/45 Two letters picked without replacement from hqnqhchcqccqwt. Give prob of sequence tq. 2/91 What is prob of sequence jjtt when four letters picked without replacement from {z: 4, l: 4, j: 2, t: 2}? 1/2970 Two letters picked without replacement from {i: 9, j: 5, o: 2}. Give prob of sequence io. 3/40 What is prob of sequence ull when three letters picked without replacement from {u: 13, m: 1, l: 3}? 13/680 Two letters picked without replacement from fjjffffdhjhjh. Give prob of sequence fj. 5/39 What is prob of sequence pyrh when four letters picked without replacement from rfppfjpyphpjpp? 1/3432 What is prob of sequence nnw when three letters picked without replacement from {w: 3, n: 4, y: 7, e: 4, v: 1}? 2/323 What is prob of sequence osuv when four letters picked without replacement from {u: 2, v: 1, q: 2, s: 1, o: 3, d: 3}? 1/1980 Four letters picked without replacement from {e: 1, j: 19}. What is prob of sequence jeee? 0 Two letters picked without replacement from jlgj. What is prob of sequence lj? 1/6 What is prob of sequence kl when two letters picked without replacement from lkl? 1/3 Two letters picked without replacement from oqoa. Give prob of sequence aq. 1/12 What is prob of sequence qy when two letters picked without replacement from yqtqdqqqqqqqffqq? 11/240 Four letters picked without replacement from lbbbbbllbbbblbbbbb. Give prob of sequence bblb. 91/765 Two letters picked without replacement from uvjzjjujzezjzjl. What is prob of sequence jj? 1/7 Four letters picked without replacement from {r: 1, u: 4, b: 3, y: 2, a: 3, z: 2}. Give prob of sequence rby	{ "pile_set_name": "DM Mathematics" }
0.02+-4379 -4378.98 What is 0.1 take away -1066? 1066.1 Subtract 59 from 0.2. -58.8 Calculate -0.263 - 0.07. -0.333 Calculate -966 + 5. -961 Work out 1 - 612. -611 Add -0.037 and -91. -91.037 What is the difference between -0.219 and -3.66? 3.441 0.754 + 0.02 0.774 Total of 0.02 and -191. -190.98 What is -20.2 minus -2? -18.2 Add together -4 and -5295. -5299 Put together -17 and 185877. 185860 Calculate 334 - -1810. 2144 Work out 2.3 + -2.988. -0.688 Calculate 0.5 + -0.2492. 0.2508 Work out 0.26 - -4.9. 5.16 What is 2079 less than 0.5? -2078.5 Work out -19.6 - -0.15. -19.45 What is 1342 take away -0.8? 1342.8 What is the difference between 3.19 and 0? 3.19 323 + -2.3 320.7 What is 245.31 plus 0.006? 245.316 Put together 0.5 and 11887. 11887.5 What is -10.6 + 0.25? -10.35 Add 0.5 and 6.2362. 6.7362 What is the difference between 34129 and -0.01? 34129.01 Calculate -414 - 0.2. -414.2 Subtract 0.2 from -0.0463. -0.2463 What is the difference between -4019 and -0.0035? 4018.9965 Total of -0.3 and -0.03372. -0.33372 Sum 0.5 and -13001. -13000.5 What is -3 take away 0.0123? -3.0123 Work out -82 - -0.141. -81.859 Add together 0.4 and -1786.1. -1785.7 Subtract 11 from -23.2. -34.2 What is 265 take away 1315? -1050 What is 3.167 take away 4? -0.833 What is -4 take away -13.774? 9.774 What is the difference between -12200 and 24? 12224 Work out -0.1 - -0.069. -0.031 What is 2 minus -4860.6? 4862.6 What is -615 less than -2? 613 Work out -3024 - -0.04. -3023.96 0.3+-0.029 0.271 Work out -0.11 + 290. 289.89 Work out -3 + -1823. -1826 Calculate -1 + -1577. -1578 Add together -0.38664 and 11. 10.61336 What is 0.0443 - 8? -7.9557 What is -195.8666 minus 0? -195.8666 -58 - -35.764 -22.236 -1343.9 + -517 -1860.9 Add -58743.9 and -0.4. -58744.3 What is -25676 plus -1? -25677 What is -93.359 take away -0.3? -93.059 Calculate 0.4 + 19704. 19704.4 Subtract -19 from 38544. 38563 What is 7.506 plus 647? 654.506 Add together 0.205 and -0.4. -0.195 Calculate -3670.3 + 0.5. -3669.8 Put together -0.2 and 0.05204. -0.14796 Put together 372 and 17. 389 What is the distance between -0.2 and -10.89? 10.69 Add together -0.5 and -32. -32.5 What is -0.121 take away 0.054? -0.175 Sum 485 and -0.9. 484.1 9.6039 + 5 14.6039 1103 + -1297 -194 What is 0.024 plus -0.316? -0.292 What is -37231 less than -2? 37229 Add -6 and -17789. -17795 Sum 88.4 and -0.3. 88.1 Sum 104 and 713. 817 What is 0.2078 less than -0.4? -0.6078 What is 18 less than 4.4? -13.6 Calculate 73.28 - -0.0116. 73.2916 Calculate -0.6 - 124899. -124899.6 36+-103 -67 Calculate 0.2 - -15749.5. 15749.7 -19 + 27932 27913 Add together 0.0444 and 1. 1.0444 93+0.5 93.5 123+-9 114 Calculate -53 + 0.07. -52.93 What is -20845 take away 0.2? -20845.2 Work out -1855 + 14. -1841 -0.01 - -92724 92723.99 What is the distance between -0.11 and -0.632? 0.522 Add -14 and 4.625. -9.375 Subtract 158 from 4.1. -153.9 What is -2 minus -71.7? 69.7 Add together -2696 and -50. -2746 What is the distance between -95 and -153? 58 Work out 1074 + 43. 1117 Calculate 0.24 + 54.6. 54.84 What is 0.4 + 0.7507? 1.1507 Sum -989 and -874.3. -1863.3 What is -17 + 0.314? -16.686 Put together 0.4 and -165870. -165869.6 -8218 - -0.5 -8217.5 Work out -150922 - -2. -150920 Calculate -119 + 0.224. -118.776 1.847+46 47.847 What is 0.1052 plus -2.535? -2.4298 Total of -391 and 1. -390 What is 0.55 less than 51.31? 50.76 Add together -0.06715 and 18. 17.93285 Sum 4 and 2.041. 6.041 Put together -0.4 and 371. 370.6 What is -479366 take away -0.2? -479365.8 What is the distance between 15719310 and -5? 15719315 What is -2 take away 2.797? -4.797 Calculate -0.03 - -169.58. 169.55 Calculate -0.13775 + -0.9. -1.03775 What is -0.4 less than 906? 906.4 What is 2 + 77.0341? 79.0341 Total of 0.1 and -2.236. -2.136 What is 0.7 plus -0.11476? 0.58524 What is -29 less than 37? 66 Total of 519 and 0.8. 519.8 -129996+0.2 -129995.8 Work out 89 - 0.2. 88.8 What is 89.1402 minus -4? 93.1402 What is the difference between 0.040395 and -1.9? 1.940395 Work out 0.04 + -0.0246136. 0.0153864 What is -7.53 - -1499? 1491.47 Subtract 1.1 from -79088. -79089.1 What is 2947 less than -0.0389? -2947.0389 Add 44825 and -0.2. 44824.8 Put together -52 and 1.998. -50.002 -31 - 5.451 -36.451 What is 79.149 + 0.4? 79.549 Add together -0.37161 and -3. -3.37161 Calculate 0.08 + 0.004. 0.084 What is -3 minus 19763? -19766 What is -566 minus 36? -602 Calculate 1813 + -399. 1414 What is 0.9463 - -4? 4.9463 -8026 - -0.3 -8025.7 What is -1885 take away -11? -1874 What is 25.46 less than 2780? 2754.54 Add together 0.4 and -2.840727. -2.440727 5+0.3833 5.3833 Put together 0.3 and 401.9. 402.2 -0.1056+-124 -124.1056 Add together 18.398 and 1.4. 19.798 Subtract -7.551 from -104. -96.449 What is -534.2 - 0.2? -534.4 Put together -4273 and 0.171. -4272.829 9 + -6.52 2.48 Add together -266 and 13. -253 Work out -1.5 + -0.754725. -2.254725 Subtract -116.6 from 310. 426.6 What is 69741 + 0.06? 69741.06 -0.1 + -0.12028 -0.22028 What is -0.27218 less than 5? 5.27218 Calculate 14 + 1.26. 15.26 What is the distance between -0.1 and -0.68242? 0.58242 Calculate -109 + -16. -125 What is -52 - -0.0943? -51.9057 Subtract -33320 from 0.2. 33320.2 Subtract 0.3 from -10149. -10149.3 What is -9401 + 0.039? -9400.961 Add -0.4 and 65. 64.6 Work out 14 - -13983. 13997 Add -19.9 and 217. 197.1 185+-4100 -3915 -14 + -2243 -2257 What is -419 take away 0.07? -419.07 Work out -1.11 + -0.13. -1.24 0.8396 + -2 -1.1604 What is the distance between 0.3 and -199.1529? 199.4529 What is -0.01 plus 10.538? 10.528 Sum -56 and 0.4. -55.6 Work out -8.735 - 1. -9.735 Calculate -326.9 - 0.3. -327.2 What is -4 less than -0.1233157? 3.8766843 Calculate 0.9 - 2253. -2252.1 Sum 0.4 and -7931. -7930.6 What is the distance between -577779 and 5? 577784 Calculate -0.3 + -45.94. -46.24 Add -0.56 and -43. -43.56 Add together -0.6465 and 1. 0.3535 -146 + 3.8 -142.2 Work out 38 + 0.13699. 38.13699 Subtract 2.283 from 2. -0.283 Sum -760 and 1025. 265 What is 120 less than -9834? -9954 Put together 0.6 and 0.28. 0.88 Work out 3 + 52695. 52698 What is -0.3 minus 452? -452.3 What is -523.14 plus 1? -522.14 What is -2 - -2209? 2207 Subtract -0.379 from -6. -5.621 1.37 - 14526 -14524.63 What is -30 take away 0.4445? -30.4445 Calculate -0.2687 - 621. -621.2687 What is 1.02111 + -3? -1.97889 2692654 + 0 2692654 Add 0.0391 and -0.2. -0.1609 Total of 6913439 and -4. 6913435 Work out 21.6 - 16.634. 4.966 What is 0.5 plus 865? 865.5 Add together -0.1 and 2.5. 2.4 What is -0.3 - 1179? -1179.3 Calculate -97363 + -33. -97396 Sum 865 and 3.46. 868.46 What is 0.018 + -2.01? -1.992 What is 2149 minus 0.1? 2148.9 Calculate -0.2 - -240117. 240116.8 Put together -5.35 and 1.2. -4.15 Put together -7170.26 and 0.2. -7170.06 What is the difference between -186 and -29872? 29686 Calculate 166837 - -0.2. 166837.2 What is 0.2 + -1618? -1617.8 Work out 82.218 + -0.1. 82.118 What is 68 plus -11280? -11212 Work out -1.3 + 642.19. 640.89 -19 + 0.104 -18.896 What is 0.5 less than -0.3487? -0.8487 What is 0.7 - -0.063? 0.763 -10.7 + -129 -139.7 Work out -21.3 - -0.43. -20.87 What is 167 - 0.339? 166.661 Add together 3222 and -247. 2975 What is 2.6 + -1.49? 1.11 Put together -2019 and -0.1098. -2019.1098 Work out 1 - -227.405. 228.405 Calculate -541 - -492. -49 What is -29434 minus -57? -29377 Calculate 6.685 + 0. 6.685 24.9492 + -7 17.9492 Calculate -32 - 32.15. -64.15 Work out -1666 - 2. -1668 What is 0.1 - 545592? -545591.9 Add -3 and 146.36. 143.36 What is 0.127 minus 0? 0.127 Add -2702 and 2.1. -2699.9 Work out 558 + -0.14. 557.86 What is -35.7 minus 0.82? -36.52 -0.131 - 30084 -30084.131 What is -0.3 less than -12.07? -11.77 What is the difference between -1.1598 and -0.04? 1.1198 Add together 133 and -2. 131 What is 92 plus -0.0301? 91.9699 What is the distance between 0.19 and 447? 446.81 What is -6 minus -0.0509? -5.9491 Work out 0.47454 + -0.22. 0.25454 Add -102 and -420. -522 What is the difference between 2.39 and -0.1? 2.49 What is 2838937 plus -1? 2838936 Add 140751 and -3. 140748 Add 203.8 and 0.97. 204.77 What is -185 - 60.18? -245.18 Total of -686 and 5. -681 Work out -44.96 - -0.3. -44.66 What is the difference between 1.57 and -80.4? 81.97 34.2 - -80 114.2 What is t	{ "pile_set_name": "DM Mathematics" }
4z3/11 + 80042z*2/11 + 85344z/11 = 0? -2667, -1, 0, 16 Factor 4c2 + 2940c - 2944. 4(c - 1)(c + 736) Factor 2h5 + 110h*4 + 108h*3. 2h*3(h + 1)(h + 54) Find g, given that -5g*4/2 - 33255g*3/4 - 49865g*2/4 - 4155g = 0. -3324, -1, -1/2, 0 Factor 2i2 + 1560i - 1562. 2(i - 1)(i + 781) Determine b so that 3b4 + 2475b*3 + 12324b*2 + 19692b + 9840 = 0. -820, -2, -1 Factor 12c3 + 77720c*2 + 284796c - 103568. 4(c + 4)(c + 6473)(3c - 1) Solve o*3/3 + 968o*2/3 - 15716o/3 + 9184 = 0 for o. -984, 2, 14 Factor o*4/3 - 112o*3 - 339o*2 - 4o/3 + 452. (o - 339)(o - 1)(o + 2)2/3 Factor -b3/7 + 61b2/7 - 1144b/7 + 6084/7. -(b - 26)*2(b - 9)/7 Factor x*3/5 - 13x*2 + 471x/5 - 171. (x - 57)(x - 5)(x - 3)/5 Find n, given that -n*3 + 409506n*2 - 41923791009n = 0. 0, 204753 Factor -2d4 + 1432d*3 - 243116d*2 - 4729896d - 21819618. -2(d - 367)2(d + 9)2 Find c such that c3/3 + 208c2/3 + 4352c + 86016 = 0. -112, -48 Determine o, given that o*5 + 1560o*4 + 33812o*3 - 36934o*2 - 33813o + 35374 = 0. -1538, -23, -1, 1 Determine d so that d*4/11 - 309d*3/11 + 2113d*2/11 + 309d/11 - 2114/11 = 0. -1, 1, 7, 302 Factor 4h2 + 36640h + 36636. 4(h + 1)(h + 9159) Determine m so that m*4/8 + 13m*3/8 - 1149m*2/8 - 13m/8 + 287/2 = 0. -41, -1, 1, 28 Suppose -32f5/19 - 5840f*4/19 + 20782f*3/19 - 9294f*2/19 + 1116f/19 = 0. Calculate f. -186, 0, 1/4, 3 Find h, given that -h*5/4 + 3h*4/2 + 114h*3 - 617h*2/2 - 53703h/4 - 13005 = 0. -15, -12, -1, 17 Determine v, given that 2v4/5 - 42v*3/5 + 138v*2/5 + 1562v/5 - 1452 = 0. -6, 5, 11 What is w in -w*5/4 + 455w*4/4 - 51527w*3/4 - 52439w*2/4 + 12882w + 12996 = 0? -1, 1, 228 Factor -a*5/3 + 160a*4/3 - 7678a*3/3 + 34080a*2 - 136107a. -a(a - 71)2(a - 9)*2/3 Find j such that -4j*5 + 24088j*4 + 241180j*3 + 603200j*2 = 0. -5, 0, 6032 Determine k so that 2k*3 + 72k*2 - 10752k - 476672 = 0. -56, 76 Determine i, given that -i*4/3 - 138i*3 + 12805i*2 - 830000i/3 + 264000 = 0. -495, 1, 40 Let d*4/5 + 4058d*3/5 + 18585d*2 + 484056d/5 - 116208 = 0. What is d? -4035, -12, 1 Factor d*4 + 48d*3 + 351d2. d2(d + 9)(d + 39) Factor -n*2/2 + 10763n/6 + 598. -(n - 3588)(3n + 1)/6 Determine i, given that -2i5/11 + 318i*4/11 - 364i*3/11 - 40440i*2/11 - 158256i/11 = 0. -6, 0, 14, 157 Determine l so that -3l2 - 4140l + 122583 = 0. -1409, 29 Factor -c*2/6 - 97c/3 + 200. -(c - 6)(c + 200)/6 Solve 4y*5/5 + 4y*4/5 - 2244y*3/5 - 21172y*2/5 + 448y + 21168/5 = 0. -14, -1, 1, 27 Factor v*2/2 - 18028v + 180255/2. (v - 36051)(v - 5)/2 Let -4w*3 + 244w*2 + 516w - 756 = 0. What is w? -3, 1, 63 Factor 57p2/7 + 873p/7 - 624/7. 3(p + 16)(19p - 13)/7 Find g, given that -5g*5/3 + 580g*4/3 - 13705g*3/3 - 178450g*2/3 - 204960g - 211680 = 0. -4, -2, 63 Determine g so that -g*5/6 + 25g*4/6 - 139g*3/6 + 77g*2/2 + 12g - 54 = 0. -1, 2, 3, 18 Factor 5b4 + 385b*3 + 7420b*2 + 7040b. 5b(b + 1)(b + 32)(b + 44) Determine o, given that 2o5 + 58o*4 + 580o*3 + 2372o*2 + 4026o + 2178 = 0. -11, -3, -1 Determine a so that 5a5 + 136a*4 - 738a*3 + 952a*2 - 259a - 96 = 0. -32, -1/5, 1, 3 Factor b*3/5 + 1066b*2/5 + 4251b/5 + 3186/5. (b + 1)(b + 3)(b + 1062)/5 Suppose 3x2/2 - 93x/2 - 333 = 0. Calculate x. -6, 37 Factor -460800a2/11 + 55680a/11 - 1682/11. -2(480a - 29)2/11 Let f3 + 463f2 + 59675f + 1365581 = 0. What is f? -217, -29 Solve 2s2/3 + 98536s/15 - 39416/15 = 0 for s. -9854, 2/5 Solve 62795348100w2 - 1002360w + 4 = 0 for w. 1/125295 Suppose -u*2/2 + 46u - 2115/2 = 0. What is u? 45, 47 Let 3h4 + 47490h*3 + 187894179h*2 - 375930840h + 187989168 = 0. What is h? -7916, 1 Suppose 2v4 + 866v*3 + 18860v*2 = 0. Calculate v. -410, -23, 0 Find r such that 5r*5 - 80r*4 - 195r*3 + 230r*2 + 700r + 360 = 0. -2, -1, 2, 18 Factor -3n3/8 + 484641n*2/8 - 969273n/8 + 484635/8. -3(n - 161545)(n - 1)*2/8 Determine r so that -5r*3 - 1114555r*2 = 0. -222911, 0 Solve 3n*5/5 + 9093n*4/5 - 72903n*3/5 + 100311n*2/5 + 14580n - 109404/5 = 0 for n. -3039, -1, 1, 2, 6 Let -6f3 + 43f*2 - 37f - 30 = 0. Calculate f. -1/2, 5/3, 6 Factor z*5/6 + 7z*4/3 + 8z*3 - 7z*2/3 - 49z/6. z(z - 1)(z + 1)(z + 7)2/6 Find q, given that 4q*2 - 1444q - 344400 = 0. -164, 525 Suppose -35s2 + 121565s - 520350 = 0. What is s? 30/7, 3469 Factor 20b3 + 165b*2 - 620b - 165. 5(b - 3)(b + 11)(4b + 1) Suppose -x*5/4 - 119x*4/2 + 3531x*3/4 + 178x*2 - 2765x + 1764 = 0. What is x? -252, -2, 1, 14 Suppose 4y3/5 + 1956y*2/5 + 63648y + 17229888/5 = 0. What is y? -177, -156 Solve -u*2/2 - 2469u/2 + 3708 = 0. -2472, 3 Factor -5w2 + 1760w - 1755. -5(w - 351)(w - 1) Factor -45u2 + 49480u - 76860. -5(u - 1098)(9u - 14) Let 2o*3 + 1104o*2 + 79558o + 78456 = 0. What is o? -467, -84, -1 What is q in 2q2 + 178620q + 3988138050 = 0? -44655 Factor -l*2/3 - 145729l - 437186/3. -(l + 1)(l + 437186)/3 Suppose 2948u*2 + 1476u - 72 = 0. Calculate u. -6/11, 3/67 Factor 5w4 + 1025w*3 - 6285w*2 + 9495w. 5w(w - 3)*2(w + 211) Factor -2d2 - 1568d - 26078. -2(d + 17)(d + 767) Solve -4d3/9 - 9196d*2/9 - 18356d/3 - 9172 = 0. -2293, -3 Factor -4k3/3 + 352k*2/3 - 3068k/3 - 24640/3. -4(k - 77)(k - 16)(k + 5)/3 Factor -3x*3 + 310686x*2 + 1242780x + 1242792. -3(x - 103566)(x + 2)*2 Factor 2x*3 - 1093x*2/2 - 1927x/2 + 275. (x - 275)(x + 2)(4x - 1)/2 Factor -p3/4 - 12p*2 + 891p - 11132. -(p - 22)*2(p + 92)/4 Factor 5d3 + 1145d*2 - 8350d - 21240. 5(d - 9)(d + 2)(d + 236) Solve 2y*3/15 - 50y*2/3 - 764y/15 - 512/15 = 0 for y. -2, -1, 128 Factor -2t2/3 - 286t/3 + 144172. -2(t - 399)(t + 542)/3 Factor -2t3 + 169194t*2 - 676752t + 676744. -2(t - 84593)(t - 2)*2 Factor 5k*2 - 146005k - 730150. 5(k - 29206)(k + 5) Determine q so that 2q5/5 - 190q*4/3 + 39604q*3/15 - 158164q*2/15 + 155078q/15 - 11858/5 = 0. 1/3, 1, 3, 77 Factor 2y2 - 5705720y + 4069405089800. 2(y - 1426430)2 Factor -2w*2 + 4134w - 28840. -2(w - 2060)(w - 7) Factor 5q2/3 + 8690q/3 - 8695/3. 5(q - 1)(q + 1739)/3 Let -5f3 - 385f*2 + 42400f + 42780 = 0. Calculate f. -138, -1, 62 Suppose -4f5 - 2104f*4 + 185108f*3 - 3680600f*2 - 4246400f + 7744000 = 0. What is f? -605, -2, 1, 40 Factor -2r2 + 106754r + 213516. -2(r - 53379)(r + 2) Suppose -3l5 + 492l*4 + 507l*3 - 1968l*2 - 1980l = 0. Calculate l. -2, -1, 0, 2, 165 Factor -2o4/5 + 1394o*3 - 6968o*2/5. -2o*2(o - 3484)(o - 1)/5 Factor -p4/11 + 685p*3/11 - 186p2. -p2(p - 682)(p - 3)/11 Factor 2k2 - 62204k + 483667202. 2(k - 15551)2 Factor 5x*2/6 - 1236010x + 458316216030. 5(x - 741606)2/6 Factor -140z*3 - 37388z*2 - 2136z. -4z(z + 267)(35z + 2) Factor 5c2 - 152540c - 152545. 5(c - 30509)(c + 1) Suppose 8c2 + 964c - 71760 = 0. What is c? -345/2, 52 Factor -i*3/4 + 171i*2/2 + 4237i/4 + 1947/2. -(i - 354)(i + 1)(i + 11)/4 Solve -z*4/2 - 3z*3 + 721z*2/2 + 3z - 360 = 0 for z. -30, -1, 1, 24 Factor -y*2/3 - 135y - 1188. -(y + 9)(y + 396)/3 Suppose 3u*2 + 91875u + 275598 = 0. Calculate u. -30622, -3 Factor -v*3/6 - 106v*2/3 - 2009v/6 + 1111/3. -(v - 1)(v + 11)(v + 202)/6 Factor n*4/2 + 64849n*3 + 4205522497n*2/2 + 4205327952n + 2102631552. (n + 1)*2(n + 64848)*2/2 Factor -898880j*2 - 106000j - 3125. -5(424j + 25)*2 Solve -2t*4 + 364t*3 + 801438t*2 - 74438000t - 83640500000 = 0. -409, 500 Find m, given that 1587762m2/23 + 71280m/23 + 800/23 = 0. -20/891 Suppose -2i5/3 - 30i*4 - 430i*3 - 4990i*2/3 + 5100i + 13872 = 0. What is i? -17, -12, -2, 3 Find y such that y*3 - 409y*2 + 1218y = 0. 0, 3, 406 Find b such that -5b4/4 - 65b*3/4 + 115b*2 + 15b - 540 = 0. -18, -2, 3, 4 Let 3c4/5 + 396c*3/5 + 2301c*2/5 + 4176c/5 + 2268/5 = 0. Calculate c. -126, -3, -2, -1 Solve -5o3 - 80o*2 + 925o - 840 = 0 for o. -24, 1, 7 Determine d so that -5d2 + 2205d + 117360 = 0. -48, 489 Factor	{ "pile_set_name": "DM Mathematics" }
the fourth smallest value? (a) -0.3 (b) -3/4 (c) 2/3 (d) -1 c Which is the second smallest value? (a) -2/7 (b) -0.02 (c) -0.12 c What is the third biggest value in 4/9, 3/8, -8, 4/5, 1? 4/9 Which is the fifth biggest value? (a) 2/7 (b) 0.1 (c) -5 (d) -26 (e) 2 d Which is the fourth smallest value? (a) 5 (b) 0.04 (c) -2 (d) 0.1 (e) 3 e What is the third smallest value in 1, -19, -3? 1 What is the smallest value in -1/5, 1, -4, -1/4? -4 Which is the second biggest value? (a) -99/5 (b) -1/2 (c) 4 b What is the second smallest value in -0.2, 0, 1, 335? 0 What is the biggest value in 0.0733, -3, -2? 0.0733 Which is the fifth biggest value? (a) -2/9 (b) 4 (c) 2 (d) 1 (e) 1/4 a Which is the smallest value? (a) -3 (b) 2 (c) -1/5 a What is the third biggest value in 7, -1, -10/21, 1/4? -10/21 What is the second biggest value in 16, 0.04, -0.4, 4/3? 4/3 Which is the second biggest value? (a) 1/4 (b) -1 (c) 1/3 (d) 0.3 d What is the fifth biggest value in 0, 3, 38, -0.4, -1? -1 What is the second biggest value in 1, -81, 4/7? 4/7 Which is the second biggest value? (a) 0.2 (b) -409/2 (c) 0.4 a What is the fifth biggest value in -0.5, -2/7, 5, 0, -1.5? -1.5 Which is the fourth biggest value? (a) -5 (b) -23/3 (c) 1/4 (d) 0.2 (e) 3 a What is the third biggest value in -0.05, -33, 5? -33 Which is the second biggest value? (a) 0.5 (b) 15 (c) 1/7 (d) -7/4 a What is the fourth smallest value in -0.27, 0.1, 5, 3? 5 What is the fourth smallest value in 2/5, 0.3, 92, -1, -2/7? 2/5 Which is the third biggest value? (a) -666 (b) 2 (c) -1/5 (d) -0.06 (e) 3 d Which is the smallest value? (a) 3 (b) -1/231 (c) -0.16 c Which is the third smallest value? (a) -5 (b) 1 (c) -26 (d) 4 b What is the third smallest value in -26, 23, -2/13, -1/11? -1/11 Which is the third smallest value? (a) -9/8 (b) 6 (c) 2/11 (d) -1/6 c What is the fifth biggest value in -21, 5, 0.09, 3, -0.03? -21 What is the third biggest value in -2, 0.2, 2, -0.3? -0.3 What is the fourth biggest value in 0.2, 5, -0.6, -12/5? -12/5 What is the second smallest value in -1/363, 4, 2? 2 What is the third smallest value in -2/11, -4, -5, 5, 1? -2/11 Which is the second smallest value? (a) -13 (b) 0.5 (c) -4/7 c Which is the fourth smallest value? (a) 1/3 (b) 3 (c) -0.7 (d) 2/3 b Which is the third smallest value? (a) -0.5 (b) -142 (c) 0.02 c What is the third smallest value in 0.5, -33, 0.0357? 0.5 What is the fifth smallest value in 2, -2, -106, -0.1, 0.2? 2 What is the second biggest value in -0.0806, 0, -4/7? -0.0806 What is the biggest value in -0.4, -0.2, -1/2, 48, 3? 48 Which is the third biggest value? (a) -1/3 (b) -3 (c) 2 (d) -5/2 d Which is the second smallest value? (a) 0.02 (b) -1.6 (c) 4/3 (d) -1 d What is the third biggest value in -2/3, -1, 0, -0.103? -2/3 Which is the smallest value? (a) 3/4 (b) -9 (c) 0.142 b Which is the third biggest value? (a) 1/5 (b) 8/3 (c) 1 a What is the fifth biggest value in 7, -0.2, 12, -32, 0.1? -32 What is the second smallest value in 0, 2/1413, -4? 0 What is the smallest value in -0.5, -0.1, 2/365, -5? -5 What is the second biggest value in -5/3, 5, 1, 4? 4 What is the biggest value in -3, 0.2, 0.1, 7, -1/10? 7 Which is the third smallest value? (a) -0.9 (b) 1/2 (c) -4 (d) -1/5 d What is the third biggest value in -8, 1, -5, -6/11? -5 Which is the third smallest value? (a) 6 (b) 9.2 (c) 4 (d) -4 a What is the biggest value in 62, 8, -0.04? 62 What is the third smallest value in -2/13, -5, 154, -0.5? -2/13 Which is the third smallest value? (a) 1/5 (b) 2/3 (c) 13/2 (d) -2/19 (e) -4 a What is the biggest value in 368, 5, 4? 368 Which is the biggest value? (a) 71 (b) 4 (c) -6.2 a What is the smallest value in 2/13, -48, -0.3? -48 What is the second biggest value in -4, -1/4, 0.06? -1/4 Which is the second smallest value? (a) -1 (b) -17 (c) -3 c What is the third smallest value in 3/4, 1/2, -4? 3/4 What is the third smallest value in 4, -5, 68, -2/15? 4 What is the fourth smallest value in -0.4, 0.3, 0.04, -0.1? 0.3 What is the smallest value in 0.1095, -2, -0.3? -2 Which is the third biggest value? (a) -59/2 (b) 0.2 (c) -5 a What is the fifth smallest value in -0.1, 0.1, 1/7, -12/35, -3/13? 1/7 What is the third biggest value in 2, -0.4034, 1/2? -0.4034 Which is the fourth biggest value? (a) -0.6 (b) -3 (c) -5 (d) -6 d What is the smallest value in 3, 0.4, 10/9, -1/5, -2? -2 What is the third smallest value in 0.3, -0.14, -0.3, -0.1, 2? -0.1 Which is the biggest value? (a) -5/6 (b) -1/82 (c) 0 c What is the biggest value in 0.3, 8, -1/4, -23? 8 What is the smallest value in 0, 0.3, -49, 1/2, 0.1? -49 Which is the fourth biggest value? (a) -2/3 (b) 2 (c) 3/5 (d) 27 (e) 3/8 e What is the third biggest value in 0.01, 5, 4, 27? 4 Which is the second biggest value? (a) -2 (b) 0.01 (c) 354/11 b Which is the smallest value? (a) 0.24 (b) 3/5 (c) -19 (d) 0.4 c What is the second smallest value in -4, 1, -38/15? -38/15 What is the fifth biggest value in 4, 0.037, -0.5, -2, -0.2? -2 Which is the second smallest value? (a) 0.4 (b) 4/5 (c) 2/47 (d) -3/8 c Which is the smallest value? (a) 2/51 (b) 0.2 (c) 10 a Which is the biggest value? (a) -2/23 (b) 64 (c) 4 b What is the smallest value in 77, 0, 2/7? 0 What is the second smallest value in 2.5, -11, 0.1? 0.1 Which is the third biggest value? (a) 2/11 (b) -4 (c) 2/9 (d) -0.2 d What is the second smallest value in 0.07894, 1/3, 1/10? 1/10 What is the second biggest value in -1/3, -18, -0.4, 4, 0? 0 Which is the third biggest value? (a) -0.8 (b) -0.151 (c) 3 a Which is the third biggest value? (a) -4 (b) 42 (c) 1 a Which is the second biggest value? (a) -2/81 (b) 0.37 (c) 4 (d) -4 b What is the smallest value in 0.06, 0.17, -1? -1 What is the fifth biggest value in 15, 1, 13, -2, 2/5? -2 Which is the third biggest value? (a) 2/5 (b) 17 (c) -2 (d) 3 a What is the second smallest value in -1, 2/3, 0.2, -5? -1 What is the third smallest value in 56, 1/2, -0.39? 56 What is the biggest value in 2/89, 0.011, -0.1? 2/89 What is the smallest value in -2/13, 0, -110, 4? -110 Which is the biggest value? (a) -4 (b) 2/5 (c) 1/12 b Which is the third biggest value? (a) 7 (b) 1/8 (c) 0.16 (d) -5 b What is the second smallest value in 4, 2, -2/7, -7? -2/7 What is the second biggest value in 22/5, -0.2, 3/8? 3/8 What is the fourth biggest value in 1.2, 0.4, -5, -1? -5 Which is the smallest value? (a) 15 (b) -5 (c) 5 b What is the fourth biggest value in 0.1, 32, 2/23, -4? -4 What is the third biggest value in 4, 3/4, -4, 3? 3/4 Which is the biggest value? (a) 2 (b) 0.1 (c) 3 (d) 342/35 d What is the second smallest value in 2/3, 19, 3/8? 2/3 What is the third biggest value in 3, -0.043, -3, 2/9, 0.2? 0.2 What is the third smallest value in 2, -35, -5? 2 Which is the fourth biggest value? (a) 4 (b) 0.4 (c) 3/5 (d) 1/11 (e) -4 d Which is the third smallest value? (a) 2 (b) -2 (c) 482 (d) -1/2 a Which is the third smallest value? (a) -5 (b) 3/2 (c) -0.43 (d) 0.4 (e) 1 d Which is the smallest value? (a) 11.993 (b) 1/2 (c) -0.5 c Which is the biggest value? (a) -0.2 (b) -4 (c) -4/109 c What is the biggest value in -0.03, 1, -1/19? 1 What is the third biggest value in 29, -1/11, -0.1, 2/11, 1/3? 2/11 Which is the third biggest value? (a) -0.3 (b) -3 (c) 2/273 (d) -5 (e) 2/9 a What is the second biggest value in -1.1, 1, 3, -0.05, -1? 1 What is the third biggest value in 3, 14/3, -17, -4? -4 What is the second smallest value in -4, -5, 1/5? -4 What is the second smallest value in 1/20, 1, 2/9? 2/9 Which is the second biggest value? (a) 21 (b) 1/11 (c) 2 c What is the fifth smallest value in 3, 1/2, 26, 2/7, -2/11? 26 Which is the third smallest value? (a) -7 (b) 4 (c) -1/5 b Which is the third smallest value? (a) 21 (b) 2 (c) -0.2 a Which is the biggest value? (a) -0.55 (b) -2 (c) -16 (d) -3/4 a Which is the biggest value? (a) -1/7 (b) 1/10 (c) -6 (d) 1/3 d Which is the fourth smallest value? (a) -1 (b) -3 (c) 2/13 (d) 14 (e) -0.4 c What is the third smallest value in 0, -31, 3/58? 3/58 Which is the second smallest value? (a) 1/5 (b) -16	{ "pile_set_name": "DM Mathematics" }
6q(z). z3 + 2z Let v(k) = 6k - 26. Let q(d) be the second derivative of -d3/6 + 5d*2/2 + 13d. What is -16q(j) - 3v(j)? -2j - 2 Suppose 0 = 4x + 12 + 4. Let f(k) = -3k2 + 4k + 2. Let d(g) = -4g2 + 5g + 2. Determine xd(u) + 5f(u). u*2 + 2 Let m(a) = 2a. Let u(t) = -4t + 5. Let z(n) = n - 1. Let h(o) = -u(o) - 5z(o). What is -7h(f) - 3m(f)? f Let x(n) be the second derivative of -n*3/2 + 2n + 20. Let v(f) = -f + 2. Let y(i) = 2i - 3. Let t(k) = 3v(k) + 2y(k). Determine -5t(p) - x(p). -2p Let h(z) = 30z*3 - 10z*3 - z - 14z*2 - 5z. Let l(x) = -5x2 - 2x - 22x3 + 10x*3 + 19x*3. Calculate 5h(o) - 14l(o). 2o*3 - 2o Let p(t) = 4t - 2 - 5t + 3t2 + 7 + 4t*2. Suppose 1 - 12 = -u + 2n, 0 = -3u + n + 18. Let o(x) = 8x*2 - x + 6. Determine uo(j) - 6p(j). -2j*2 + j Let i(h) = -h - 1. Let r(x) = -7x - 1. Calculate -6i(u) + r(u). -u + 5 Let l(q) be the third derivative of 5q4/12 - q3 + 10q2. Let r(a) be the third derivative of 7a*4/24 - 2a*3/3 + 2a*2. Determine -5l(f) + 7r(f). -f + 2 Let l(i) = i3 + 5i*2 + 1. Let x = -9 - -6. Let w = -10 + 12. Suppose -s - wc = -6c - 14, 5c + 20 = 0. Let q(v) = -4v2. What is sl(k) + xq(k)? -2k*3 + 2k*2 - 2 Let z(o) = 3o - 2 - 6o + 0o + o*3. Let h(g) = -3g - 5g - 3 - 3 + 2g*3. Give 3h(p) - 8z(p). -2p*3 - 2 Let k(u) = -26u + 17. Let i(c) = -9c + 6. Let d be 2/(-10) - (-172)/10. Calculate di(m) - 6k(m). 3m Let z(p) = -2. Let a(r) be the third derivative of r4/24 + r3/2 + 3r2. What is 2a(x) + 3z(x)? 2x Let h(x) = -3x3 - 5x*2 - 5x - 7. Suppose 5c - 180 - 35 = 0. Suppose -2d - 15 = -c. Let n(k) = 8k3 + 14k*2 + 14k + 20. Calculate dh(g) + 5n(g). -2g3 + 2 Let b(t) = -23t*3 - 11. Let h(y) = -11y*3 - 6. Calculate -6b(r) + 11h(r). 17r*3 Let x(i) = 12i + 3. Let r(o) = -37o - 8. Calculate 3r(w) + 8x(w). -15w Let m(y) = -7y3 - 3y + 3. Let l(s) = -8s3 - 4s + 4. Suppose -3u + 3 = 3z, 4u - 5u + 2z - 14 = 0. Determine um(i) + 3l(i). 4i*3 Let j(r) = 7r*2 + 14r - 7. Let o(x) = -3x2 - 7x + 3. Give -2j(v) - 5o(v). v*2 + 7v - 1 Let x(z) = -7z2 + 10z - 4. Let u(s) = 8s2 - 11s + 4. Let l(w) = 5u(w) + 6x(w). Let h(o) = 0o - 5o + 1 + 5o - o. Calculate -4h(n) - l(n). 2n2 - n Let z be ((-2)/(-6))/((-3)/(-45)). Let a(h) = 10h - zh2 - 8h + 2 + 3h2. Let x(g) = -3g*2 + 3g + 3. Let d = -11 + 21. Give da(o) - 6x(o). -2o2 + 2o + 2 Let y = 3 + -2. Let d(x) = 3x2 - 2x + 2. Let a(f) = 2 + f*2 - 1 + 2709f - 2710f. Give yd(i) - 4a(i). -i2 + 2i - 2 Suppose 0 = -2q + 8 + 4. Let f(x) = -4x*2 - 6x. Let n(k) = 3k2 + 5k. Calculate qn(r) + 5f(r). -2r2 Let a(z) = -6 + 4 + 4. Let y(l) = -3l*2 - 10. Let v(b) = 4b*2 + 15. Let d(u) = -5v(u) - 7y(u). What is 5a(j) + 2d(j)? 2j*2 Let y(h) = 13h - 9 - 5 + 5. Let d(t) = -7t + 5. Determine -11d(z) - 6y(z). -z - 1 Let a(o) = -o - 20. Let n(l) = 2l + 40. Calculate -7a(q) - 4n(q). -q - 20 Let h(q) = -2q2 + 4q. Suppose 5f + 4i = -1 + 16, 0 = 4i. Let z(w) = w2 - 3w. Give fh(m) + 4z(m). -2m2 Let d(a) = -a3 - 2a*2 - 2a + 2. Let r(k) be the second derivative of k5/20 + k4/12 + k3/6 - k2/2 - 22k. Calculate 3d(g) + 6r(g). 3g*3 Let j(p) = -p - 5 - 3p3 - p3 - 2p + 10. Let o(n) = n3 + n - 1. What is -j(f) - 3o(f)? f*3 - 2 Let y be 9/(-2) + 3/6. Let s(z) = 6z. Let x(k) = 5k. Let t be (50/(-15))/((-2)/3). What is tx(c) + ys(c)? c Let p = -5 + -2. Let r(x) = -4x - 3. Let c(n) = -2n - 2. Give pc(b) + 4r(b). -2b + 2 Let f(w) = 17w3 + 7w*2 - 10w + 3. Let d(a) = 11a3 + 5a*2 - 7a + 2. Give -7d(k) + 5f(k). 8k3 - k + 1 Suppose -5v - 3r = -17, -4v - 2r - r = -16. Let n(u) = 2u*2 - u - 4. Let m(c) = -1. Determine vn(a) - 6m(a). 2a*2 - a + 2 Let r(k) = 7 - 2 - 23k + 27k. Let u(q) = 4q + 6. Determine -6r(x) + 5u(x). -4x Let q(l) = -l - 1. Let p(i) = -1. Determine p(k) - 2q(k). 2k + 1 Let a(p) = p - 4. Let m(y) be the second derivative of y3/3 - 7y*2/2 - 39y. What is -7a(g) + 4m(g)? g Let y(v) = -2v2 + 8. Let x(g) = -1. Let j = 11 - 8. Suppose 0 = 5c + 5, 7 = jf - 0c - 4c. Give fy(h) + 8x(h). -2h*2 Let m = 112 + -118. Let q(j) = 20j*2 + 25. Let b(l) = -5l*2 - 6. Determine mq(v) - 25b(v). 5v*2 Let p(s) = s + 4. Let u(k) = -4k - 15. Calculate -22p(g) - 6u(g). 2g + 2 Suppose 4j = 2 + 2. Let z = -4 + j. Let i(d) = -d*3 + 3d*2 + 3d. Let x(n) = 4n + n3 - n2 - 1 + 1 - 5n. What is zx(h) - i(h)? -2h*3 Let n(m) = -55m*3 - 25. Let p(s) = -9s*3 - 4. Let v be (-3)/3 + (-55)/(-11). What is vn(j) - 25p(j)? 5j*3 Suppose 0 = 3j - 5w - 19, -3j + 11 = -2j - 4w. Suppose -12 = -4m - 0. Let p(y) = -1 + 2y - 4 + 4 - my. Let g(t) = t. What is jg(f) + p(f)? 2f - 1 Let q(a) = a2. Let i(d) = 2d*3 + 14d*2 + 2d. Calculate i(x) - 4q(x). 2x*3 + 10x*2 + 2x Let r(h) = -3h3 - 2h + 6. Let u(q) = -4q3 - 3q + 7. Let w(i) = i*3 + 6i*2 + 4i - 10. Let s be w(-5). Calculate sr(c) + 4u(c). -c*3 - 2c - 2 Let h be ((-7)/2)/(3/(-6)). Let l(z) = -4z2 - 4 + 3z*3 - 4z + 10z3 - 14z*3. Let n(k) = 2k*3 + 7k*2 + 7k + 7. Calculate hl(x) + 4n(x). x*3 Let q(t) = t + 1. Let r = 24 - 25. Let d(b) = 7b + 6. What is rd(n) + 5q(n)? -2n - 1 Let q(c) = 5c*2 - 25c - 21. Let x(v) = v*2 - 6v - 5. Calculate -2q(j) + 9x(j). -j*2 - 4j - 3 Let i(t) be the second derivative of -t*3 - 8t*2 - 33t. Let l(k) = 2k + 5. Calculate -3i(y) - 10l(y). -2y - 2 Let n = 2 - 0. Let o(q) = -13q2 - q + 4. Let m(j) = -4j2 + 1. Let c(k) = -k3 - 6k2 - 5k - 1. Let a be c(-4). Let y = a + 6. What is no(x) + ym(x)? 2x2 - 2x + 1 Let t(a) = a - 3. Let q(h) = h - 2. Let y = 81 - 77. What is yq(i) - 3t(i)? i + 1 Let r(l) = -10l2 + 3 + 12l*2 - 7l*2 - 3l - 4l2. Let b(t) = -5t*2 - 2t + 2. Let w be (-4)/(-14) - (-33)/7. What is wb(h) - 3r(h)? 2h2 - h + 1 Let n(b) = -4b2 - 5. Let h(s) = -s2 - 1. Suppose 18r = 12r - 6. Give rn(g) + 5h(g). -g*2 Let u(o) = o + 1. Let j(q) = 19q*2 + 19q + 19. What is -j(b) + 19u(b)? -19b*2 Let k(d) = -70d*2 + 72d*2 - 3 + 1. Let w(a) = -3a*2 + 3. Give 4k(o) + 3w(o). -o2 + 1 Let w(k) = 4k*2 - 6 - 6k*2 - 1 - 4k*2. Let r(v) = 5v*2 + 6. Calculate -7r(t) - 6w(t). t2 Let y(k) = -3k*2 + 4k. Let g(t) = -2t3 + t. Let x(v) = 4g(v) - y(v). Let c(m) = -9m3 + 4m*2. Calculate -3c(u) + 4x(u). -5u*3 Let w(o) = -12 - 5 + 19 - 3o*2. Let s(a) = 2 + 0 - 1. Give -2s(z) + w(z). -3z2 Let s(m) be the third derivative of -m5/6 + 7m*4/12 + 16m*2. Let i(r) = -2r*2 + 3r. Give 28i(o) - 6s(o). 4o2 Let y(d) = -d2 + 9d - 9. Let z(t) = -t - 1 + t + t. What is -2y(p) + 18z(p)? 2p2 Let a(v) = 4v + v3 + v2 + 5v2 - 3v + 5. Let d be a(-6). Let m = -2 - d. Let q(o) = -4. Let t(r) = r - 1. Calculate mq(z) + 2t(z). 2z + 2 Let a(r) = r2 - 4r - 4. Let t(w) = 5w2 - 21w - 21. Let h(l) = -l*3 + 7l*2 - 5l - 8. Let v be h(6). Determine vt(z) + 11a(z). z*2 - 2z - 2 Let o = 1 - 7. Let r(w) = -3w2 - 4. Let x(v) = -4v*2 - 5. Calculate or(b) + 5x(b). -2b2 - 1 Let f(n) = n2 - 1. Let u(c) be the first derivative of -5c3/3 + c2/2 + 6c + 4. What is 4f(j) + u(j)? -j2 + j + 2 Let b(h) = -4h*2 + h + 1. Suppose -5 + 65 = 10k. Let c(i) = -i*2. What is kc(j) - 2b(j)? 2j*2 - 2j - 2 Let w(f) = f - 1. Let k(g) = 9g - 5. Give k(v) - 4w(v). 5v - 1 Let a(z) = -11z + 13. Let i(w) = -w + 1. What is 6a(r) - 78i(r)? 12r Let t(p) be the first derivative of p3 + 3p*2/2 - 3p + 2. Let y(l) = -3l2 - 2l + 2. Determine -2t(w) - 3y(w). 3w2 Let z(s) = -6s*2 + 2s + 7. Let k(h) = -7h2 + 2h + 8. Give 5k(m) - 6z(m). m*2 - 2m - 2 Suppose 3u + 8 = -2k, 2 = -2k - 2u - 2. Let f(p) = -6p + 3. Let z be f(k). Let t(v) = 5v - 1 - 2 + 2v + 1. Let y(j) = -3j + 1. What is zy(n) - 4t(n)? -n - 1 Let f(b) = b*2 - 3b + 1. Let x(j) = -j*2 + j. Let m be (-1)/(-2)-2 - -4. Suppose 6c + m = 3c. What is cf(t) - 3x(t)? 2t2 - 1 Let a(g) = -19g*3 + 10g*2 + 13g. Let r(y) = 6y3 - 3y*2 - 4y. Determine -2a(b) - 7r(b). -4*b	{ "pile_set_name": "DM Mathematics" }
-11). What is lv(g) + 9a(g)? 3g3 Let h(w) = 37w + 1. Let t(d) = -104d - 21. What is 3h(x) + t(x)? 7x - 18 Let l(z) = 2z + 43. Let m(d) be the first derivative of -3d2/2 - 43d - 3348. Calculate 5l(r) + 4m(r). -2r + 43 Let m(y) = -4y*3 + 26y*2 - 5y + 5. Let u(h) = 575803 + 4h - h3 + 0h*2 + 4h*3 - 575807 - 25h*2. What is 4m(b) + 5u(b)? -b3 - 21b*2 Let a(n) = -3n - 2. Let q(i) = -3i - 3. Let t be (1 - -1)(21 - 19). Calculate tq(p) - 5a(p). 3p - 2 Let p(l) = 2l*2 + 22l + 25. Let y be p(-10). Suppose -7 - 3 = -yk. Let s(v) = -vk - 2v*2 - 3v + v*2. Let r(m) = -m. Give 2r(o) - s(o). 2o2 + o Let k(f) = 55f + 29. Let a(h) = -18h - 9. Let l(m) = -10a(m) - 3k(m). Let c(x) = -74x - 16. What is 2c(i) + 11l(i)? 17i + 1 Let f(b) = -3b*2 + 3b + 6. Let l(q) = 34q. Let r(h) = 3h*2 - 343h - 5. Let w(a) = 10l(a) + r(a). Determine -6f(g) - 7w(g). -3g*2 + 3g - 1 Let h(j) = -119j2 + 2j + 60. Let i(w) = -2w2 + 16. Determine -h(q) + 4i(q). 111q2 - 2q + 4 Let b(j) = 35j2. Let h(l) = 35l2. Let s(w) = w2 + 375w + 1480. Let q be s(-4). What is qh(y) + 5b(y)? 35y*2 Let k(u) = -13u*3 - 5u*2 + 17u - 386. Let j(t) = 3t3 + t2 - 4t + 96. What is 18j(o) + 4k(o)? 2o3 - 2o*2 - 4o + 184 Let g(s) = 13s2 + 3s - 10. Let c(y) = -6. Give c(d) + g(d). 13d2 + 3d - 16 Let j(s) = -2067s2 - 10. Let t(k) = -394797k*2 - 1908. Determine 954j(v) - 5t(v). 2067v*2 Let n(q) = -2q*2 - 66q + 127. Let r(y) = y*2 + 22y - 43. Determine 3n(m) + 8r(m). 2m2 - 22m + 37 Let q(k) = k*3 - 5k. Let y(o) = 2518o3 + 20o. Calculate -4q(f) - y(f). -2522f*3 Let v(w) = -w + 11. Let r(u) = -3u + 33. Let q be (((-36)/(-2))/2)/(-1)590/(-885). Determine qr(c) - 17v(c). -c + 11 Let h(m) = m2 + 11m - 8. Let u(v) = -2v2 - 23v + 17. Let g(y) = 47y2 - 657y - 8. Let n be g(14). What is nu(k) + 13h(k)? k*2 + 5k - 2 Let d(t) = t*2 - 3t - 2. Let n(p) = -2p2 + 6p + 4. Let l = -321 + 328. Determine ld(k) + 4n(k). -k*2 + 3k + 2 Let z(c) = 14c2 + 7c. Let y = -92 - -94. Let u(x) = 11x2 - 2x*2 - yx*2 + 4x. Calculate -7u(t) + 4z(t). 7t2 Let t(l) = -22l*3 - 9l*2 - 3l + 63. Let h(q) = -6q3 - 2q*2 - q + 15. Calculate -9h(x) + 2t(x). 10x*3 + 3x - 9 Let m(q) = 2q - 13. Let c(u) be the first derivative of -u2 + 12u - 168. What is -5c(h) - 6m(h)? -2h + 18 Let a(u) = -u2 + 2u*2 - 1431u - 1 + 1432u. Let i(k) = -3k*2 - 3k + 16. Give -4a(r) - i(r). -r2 - r - 12 Let r(p) = 8536p - 22. Let f(w) = 12805w - 35. What is 5f(n) - 8r(n)? -4263n + 1 Let z(v) = 51v - 35. Let f(n) = -110n + 74. Let y(u) = 6f(u) + 13z(u). Suppose 0l - 2l = -22. Let d(c) = -c + 6. Determine ld(a) + 6y(a). 7a Let q(r) = -4r3 - r2 - 4r - 4. Let p = 14710 - 14712. Let g(v) = 17v*3 + 4v*2 + 17v + 17. Determine pg(n) - 9q(n). 2n3 + n2 + 2n + 2 Let p(l) = -7l3 + 5l*2 - 5l - 2. Suppose -n - 90a - 7 = -91a, 0 = 4n + 5a + 10. Let s(q) = -6q3 + 4q*2 - 4q - 1. Calculate ns(z) + 4p(z). 2z3 - 3 Let z = 12377 + -12381. Let l(r) = 11r - 83. Let g(b) = 6b - 41. Calculate zl(j) + 7g(j). -2j + 45 Let b = 6 + 0. Let y(a) = 1 + ba - 3 + 5. Let s(l) = -l. Suppose 4d - 3887 + 3873 = -2x, 4x = -2d + 22. Give dy(q) + 4s(q). 2q + 3 Let y(t) = -t*3 - 2t*2 - 3t - 3. Let q(i) = -i3 - i2 - 4i - 4. Suppose 0 = 3v, 0 = -3g + v - 51 + 42. Calculate gq(s) + 4y(s). -s3 - 5s2 Let b = -24 - -22. Let g(r) = -r - 1. Let y(j) = j2 - 6j - 5. Let o be y(7). Let s(d) = -3d*3 + 8d + o - d*2 - 4 - 7d - 2d. What is bg(z) + s(z)? -3z3 - z2 + z Let j(a) = 5 + 4a + 6a - a - 70a*2 + 64a*2. Let c(x) = -3x*2 + 4x + 2. Give 5c(g) - 2j(g). -3g2 + 2g Let j(h) = -7h2 + 5h + 4. Let i(k) = 30k2 - 48k + 2. Let f(x) = -x*2 + 3x - 1. Let g(n) = 12f(n) + i(n). What is 5g(y) + 12j(y)? 6y*2 - 2 Let u(d) = 2d*2 + 315d + 5. Let f(s) = -3s2 - 318s - 6. Give -5f(c) - 6u(c). 3c2 - 300c Let g(d) = -15d + 17. Let c be g(-5). Let r = 93 - c. Let y(h) = -2h2 - h + 1. Let t(i) = i2 + i. Give rt(q) + y(q). -q2 + 1 Let r(y) = 7y - 359. Let n(x) = -16x + 717. What is -2n(m) - 5r(m)? -3m + 361 Let d(x) = 6x2 - 307x - 7. Let j(k) = -7k2 + 305k + 8. What is 9d(s) + 8j(s)? -2s2 - 323s + 1 Let g(k) = -8k2 + 2k - 6. Let l(y) = y*2 + 20y + 57. Let v be l(-17). Let t(p) = 9p2 - 3p + 7. What is vg(q) + 5t(q)? -3q2 - 3q - 1 Let k(g) = 2g3 + 4g*2 - 3g. Let z(t) = t*3 + 3t*2 - 2t. Suppose 0 = -19p + 40p - 33p. Let f be -7 + 1 + p - 488/(-244). Calculate fz(v) + 3k(v). 2v*3 - v Let r(i) = -2i*3 - 5i*2 - 1820i + 3. Let s(m) = m*3 + 4m*2 + 1820m - 2. Determine -2r(f) - 3s(f). f*3 - 2f*2 - 1820f Let i(j) = -j*3 - 3j*2 + 31j + 18. Let s be i(-7). Let c(u) = 33u2 + 4u - 32u2 - 3u - 2u. Let a(q) = 2q*2 - 5q + 2. What is sc(v) + a(v)? -v2 - 2v + 2 Suppose -18p = -68 + 50. Let i(b) = -6b + 13. Let k(f) = -f*2 + f. Let n(r) = pi(r) + 4k(r). Let h(j) = -2j*2 - j + 7. Determine 7h(c) - 4n(c). 2c*2 + c - 3 Let o(v) = 6v + 2. Let i(j) be the third derivative of -1/24j4 + j2 + 0 + 0j*3 + 33j. Determine -2i(w) - o(w). -4w - 2 Let f(s) = 48s3 + 20s*2 + s + 40. Let u(k) = 95k*3 + 35k*2 + 2k + 82. Determine -7f(m) + 4u(m). 44m3 + m + 48 Let n be (-4)/10(-650)/(-52). Let z(l) = -6l3 - l - 3. Let r(t) = -11t*3 - 2t - 5. Calculate nz(x) + 3r(x). -3x3 - x Let j(y) = -5y*3 - 2y*2 + 2y. Let t be -92(3 - 85/20). Let v(q) = -q3 - 5q*3 + 113q*2 + 3q - tq2. Suppose 1 = -2x + 11. Give xj(r) - 4v(r). -r*3 - 2r*2 - 2r Let p(n) = 4n - 38. Let u(s) = 5s - 39. Let l = 27215 + -27209. Give lp(y) - 5u(y). -y - 33 Let j(d) = 329d2 + 3d - 9. Let x(w) = -659w2 - 7w + 20. Determine -9j(q) - 4x(q). -325q2 + q + 1 Let o(t) = -1597t + 2. Let l(a) = 1782253a - 2233. What is -2l(b) - 2233o(b)? 1595b Let c(i) = i*3 + 7258i - 2i2 + 7254i - 14519i. Let r(m) = m2 + m. What is c(g) + 6r(g)? g*3 + 4g*2 - g Let g(z) = -13z - 129. Let b(t) = -20t - 191. Calculate -5b(c) + 7g(c). 9c + 52 Let q be -13 - (0 + 22 - 48). Let s(u) = 4u - 2. Let d(j) = -2j + 1. What is qd(h) + 6s(h)? -2h + 1 Let y(v) = 1. Let x be 19/(2/(3 + -1)). Let q be 2/((-2)/(-9))x/57. Let b(r) = 1 - q + 44r - 46r - 3. Calculate -b(m) - 3y(m). 2m + 2 Let a(h) = -3h - 7. Let n(y) be the first derivative of y2/2 + 3y + 3. Let k = 150 + -155. Let t(q) = -q*2 - 6q - 7. Let u be t(-5). Give kn(r) + ua(r). r - 1 Let d(f) be the first derivative of 7f2/2 + f + 2815. Let x(q) = 13q + 1. Give -7d(t) + 4x(t). 3t - 3 Let f(s) = s2 + 2s + 22. Let h(y) = 6429y2 + 25716y + 282876. Calculate -12858f(x) + h(x). -6429x*2 Let r(y) = -49y*2 + 972y + 14. Let q(t) = 139t2 - 2913t - 40. What is 6q(f) + 17r(f)? f*2 - 954f - 2 Let g(z) = -4z + 14. Let d(w) = -17w + 55. Suppose 0 = -i - 3v - 32 + 41, -3v = -2i - 36. Give ig(j) + 2d(j). 2j - 16 Let p(l) = -3l3 - 5l. Let f(i) = -43i3 + 8i*2 - 10i. Calculate -f(k) + 2p(k). 37k*3 - 8k*2 Let s(k) = -1926k*3. Let u(d) = -3857d*3 - 1. What is 11s(o) - 6u(o)? 1956o*3 + 6 Let o(t) = -147t + 26. Let j(b) = -49b + 9. Determine 8j(v) - 3o(v). 49v - 6 Let w(c) = 27 + 30 - 85 + 27. Let x(l) = 2l2 + 7. Let b(z) = z2 + 4. Let f(p) = -5b(p) + 3x(p). Let a be 0/3 - (4 - 0). Determine aw(y) - 4f(y). -4y2 Let l = -2 + 3. Let d(k) be the second derivative of k5/20 + k4/6 - k3/6 - 14338k. Let t(h) = -h3 + h2. What is ld(s) - 2t(s)? 3s*3 - s Let g(k) = -2k2 - 4. Let p(x) = -x2 - 3. Suppose -n = -b - 284 - 426, b + 2n = -710. Let w = -713 - b. Let c be 14/4 - 1/(-2). Calculate cp(r) + wg(r). 2r*2 Let c(i) = -29i - 191i - 1 - 196i + 415i. Let a(f) be the second derivative of -f3/6 - f2 + f. Calculate -a(j) + 4c(j). -3j - 2 Let s(k) = -627168k*3 + 417k*2 - 417k + 417. Let b(d) = -7511d3 + 5d*2 - 5d + 5. What is 417b(t) - 5s(t)? 3753t3 Let h(y) = 10y*2 - 10y + 10. Let b(i) = -2i2 + 2i - 2. Suppose -4c - 2c = -726. Sup	{ "pile_set_name": "DM Mathematics" }
082? 2, 101, 109, 449 List the prime factors of 393887. 13, 41, 739 What are the prime factors of 482784? 2, 3, 47, 107 What are the prime factors of 330400? 2, 5, 7, 59 What are the prime factors of 54433? 29, 1877 List the prime factors of 50815. 5, 10163 List the prime factors of 14334116. 2, 3583529 List the prime factors of 16091920. 2, 5, 13, 15473 List the prime factors of 2667439. 2667439 List the prime factors of 971293. 503, 1931 List the prime factors of 46231. 83, 557 List the prime factors of 1341377. 53, 25309 What are the prime factors of 538239? 3, 13, 37, 373 List the prime factors of 256221. 3, 7, 83 List the prime factors of 8985758. 2, 17, 127, 2081 What are the prime factors of 983321? 307, 3203 List the prime factors of 188195. 5, 7, 19, 283 List the prime factors of 7801365. 3, 5, 11, 13, 3637 What are the prime factors of 14176045? 5, 13, 17, 12829 List the prime factors of 51734. 2, 25867 List the prime factors of 6752102. 2, 7, 68899 What are the prime factors of 72799? 43, 1693 List the prime factors of 31702135. 5, 1861, 3407 List the prime factors of 1047852. 2, 3, 13, 2239 List the prime factors of 489503. 7, 69929 List the prime factors of 10696900. 2, 5, 41, 2609 What are the prime factors of 105385? 5, 7, 3011 What are the prime factors of 27310? 2, 5, 2731 What are the prime factors of 6342697? 47, 134951 What are the prime factors of 5749382? 2, 2874691 List the prime factors of 4268747. 7, 609821 List the prime factors of 2947788. 2, 3, 81883 List the prime factors of 1688605. 5, 337721 What are the prime factors of 722189? 13, 73, 761 What are the prime factors of 14739339? 3, 4913113 List the prime factors of 31106. 2, 103, 151 List the prime factors of 3089216. 2, 13, 47, 79 List the prime factors of 433041. 3, 7, 17, 1213 What are the prime factors of 9726111? 3, 1080679 What are the prime factors of 2875553? 29, 229, 433 List the prime factors of 11433583. 7, 1633369 What are the prime factors of 2097090? 2, 3, 5, 863 List the prime factors of 1834304. 2, 28661 What are the prime factors of 1017853? 43, 23671 What are the prime factors of 923267? 19, 48593 List the prime factors of 86080. 2, 5, 269 What are the prime factors of 969632? 2, 157, 193 List the prime factors of 884027. 31, 28517 List the prime factors of 16673870. 2, 5, 83, 20089 List the prime factors of 421076. 2, 105269 What are the prime factors of 491176? 2, 7, 179 What are the prime factors of 8017830? 2, 3, 5, 89087 List the prime factors of 1451694. 2, 3, 313, 773 List the prime factors of 5741817. 3, 1913939 What are the prime factors of 481622? 2, 240811 What are the prime factors of 22606? 2, 89, 127 What are the prime factors of 1407329? 7, 11, 373 List the prime factors of 29881. 29881 What are the prime factors of 3950432? 2, 41, 3011 What are the prime factors of 271052? 2, 67763 What are the prime factors of 27223? 7, 3889 List the prime factors of 88253. 11, 71, 113 What are the prime factors of 6607441? 17, 388673 What are the prime factors of 127236? 2, 3, 23, 461 What are the prime factors of 1909? 23, 83 List the prime factors of 177469. 103, 1723 What are the prime factors of 813718? 2, 406859 What are the prime factors of 1062299? 7, 29, 5233 What are the prime factors of 235823? 7, 59, 571 What are the prime factors of 965849? 109, 8861 List the prime factors of 248408. 2, 31051 List the prime factors of 454129. 13, 181, 193 What are the prime factors of 4790214? 2, 3, 11, 13, 1861 List the prime factors of 128136. 2, 3, 19, 281 List the prime factors of 9482809. 7, 1354687 What are the prime factors of 562016? 2, 7, 13, 193 List the prime factors of 6614131. 43, 153817 List the prime factors of 64763. 64763 What are the prime factors of 3473332? 2, 139, 6247 What are the prime factors of 157861? 11, 113, 127 What are the prime factors of 13841634? 2, 3, 163, 14153 What are the prime factors of 957452? 2, 59, 4057 What are the prime factors of 566686? 2, 67, 4229 What are the prime factors of 3171438? 2, 3, 176191 List the prime factors of 3211621. 7, 271, 1693 What are the prime factors of 327966? 2, 3, 47, 1163 What are the prime factors of 3417558? 2, 3, 47, 12119 List the prime factors of 5021841. 3, 11, 43, 3539 List the prime factors of 170899. 170899 What are the prime factors of 104674? 2, 199, 263 What are the prime factors of 1821671? 41, 157, 283 List the prime factors of 423968. 2, 13249 List the prime factors of 278557. 278557 List the prime factors of 10364823. 3, 7, 19, 1237 List the prime factors of 3342949. 43, 77743 What are the prime factors of 2290146? 2, 3, 19, 20089 List the prime factors of 13485079. 19, 709741 What are the prime factors of 310474? 2, 29, 53, 101 List the prime factors of 35835378. 2, 3, 5972563 What are the prime factors of 1001332? 2, 167, 1499 What are the prime factors of 511287? 3, 7, 97, 251 List the prime factors of 1734466. 2, 867233 What are the prime factors of 5079366? 2, 3, 23, 12269 List the prime factors of 357153. 3, 17, 47, 149 What are the prime factors of 4949439? 3, 11, 23, 6521 List the prime factors of 587466. 2, 3, 11, 23, 43 List the prime factors of 138478. 2, 69239 List the prime factors of 568486. 2, 284243 List the prime factors of 8531667. 3, 947963 List the prime factors of 6344685. 3, 5, 277, 509 List the prime factors of 282072. 2, 3, 7, 23, 73 What are the prime factors of 309947? 11, 19, 1483 List the prime factors of 240422. 2, 7, 13, 1321 What are the prime factors of 10873928? 2, 13, 19, 5503 What are the prime factors of 3794917? 7, 542131 List the prime factors of 1530193. 7, 218599 List the prime factors of 1815868. 2, 19, 23893 What are the prime factors of 732151? 7, 104593 What are the prime factors of 36020? 2, 5, 1801 List the prime factors of 78005. 5, 15601 List the prime factors of 3855458. 2, 1927729 What are the prime factors of 25339742? 2, 193, 65647 What are the prime factors of 258148? 2, 11, 5867 List the prime factors of 29480964. 2, 3, 2456747 List the prime factors of 118182. 2, 3, 19697 List the prime factors of 4698. 2, 3, 29 List the prime factors of 11439. 3, 31, 41 What are the prime factors of 4224516? 2, 3, 352043 What are the prime factors of 1086? 2, 3, 181 What are the prime factors of 5755113? 3, 7, 13, 7027 What are the prime factors of 6261494? 2, 1543, 2029 List the prime factors of 12046565. 5, 2409313 What are the prime factors of 450079? 7, 113, 569 What are the prime factors of 16214557? 41, 59, 6703 What are the prime factors of 10844962? 2, 79, 68639 List the prime factors of 1396133. 977, 1429 What are the prime factors of 11888557? 2677, 4441 What are the prime factors of 215688? 2, 3, 11, 19, 43 What are the prime factors of 3552719? 907, 3917 What are the prime factors of 7829808? 2, 3, 7, 3329 What are the prime factors of 664108? 2, 166027 List the prime factors of 1622739. 3, 41, 79, 167 What are the prime factors of 1208221? 7, 172603 List the prime factors of 113665. 5, 127, 179 List the prime factors of 364919. 364919 List the prime factors of 249077. 233, 1069 What are the prime factors of 5061193? 37, 3697 List the prime factors of 814869. 3, 11, 8231 What are the prime factors of 305088? 2, 3, 7, 227 List the prime factors of 175774. 2, 87887 List the prime factors of 3196097. 37, 86381 List the prime factors of 4708099. 11, 17, 1481 List the prime factors of 1580272. 2, 283, 349 List the prime factors of 291458. 2, 61, 2389 What are the prime factors of 367977? 3, 23, 5333 List the prime factors of 5057199. 3, 7, 80273 List the prime factors of 2056418. 2, 7, 13, 11299 List the prime factors of 3295991. 3295991 List the prime factors of 11560760. 2, 5, 289019 What are the prime factors of 181699? 7, 101, 257 What are the prime factors of 444557? 444557 What are the prime factors of 632730? 2, 3, 5, 7, 23, 131 List the prime factors of 640494. 2, 3, 29, 409 List the prime factors of 885489. 3, 11, 26833 What are the prime factors of 277764? 2, 3, 79, 293 List the prime factors of 18717014. 2, 19, 449, 1097 What are the prime factors of 357806? 2, 178903 List the prime factors of 378448. 2, 7, 31, 109 List the prime factors of 2389671. 3, 79, 3361 List the prime factors of 396477. 3, 44	{ "pile_set_name": "DM Mathematics" }
(-2 + 2 - 4h) - 42 - 14h*5 + 42. -18h*5 Expand ((3 + 2 - 3)(0o - 2o + o) - 3o - 2o + 2o)(-4 + 0 + 2). 10o Expand (3f*2 - 4f*2 + 2f*2)(f + 4f - 3f) + 2f3 + 0f*3 + 0f*3 + (-3 + 2 - 1)(4f2 - 4f*2 - 5f*3). 14f*3 Expand 2z*3 + 5z*3 - 5z*3 + (-2z*2 + 2z - 2z)(2z - 5z + z) + 3z2 - 3z*3 - 3z*2 + (-4 + 3 + 6)(-5z3 + 0z*3 + 3z*3). -7z*3 Expand 2y*3 + 3y*3 + 0y*3 + (-2y*2 + 1 - 1)(-5y + 3y + 0y) + (-2y*2 + 2 - 2)(-9y + 3y - 5y). 31y*3 Expand (-2x + 0 + 0)(x - 2x + 0x)(-2 - 668 + 12). -1316x2 Expand (6 + 66 - 35 + 41)(-2m + 3m + m). 156m Expand (-6n - 2n + 4n)(0n - 3n + n) - 1 + 2n*2 + 1 - 6n*2 + 2n*2 - 2n*2 - 2n*2 - 2 + 2. 2n*2 Expand (3 - 8 + 0 + (-1 + 0 + 0)(-5 + 3 + 3))(2 - 3j - 5 + 0) + j - 3 + 3. 19j + 18 Expand (-3 + 3b + 3)(514b + 2b2 + 0b*2 - 739b). 6b3 - 675b*2 Expand 189r*4 - 19086r*2 + 19086r*2 + (4r*3 + 0r*3 - 2r*3)(r - 6r + r + (-2r + 2 - 2)(-4 + 6 - 1)). 177r4 Expand ((-f2 + 2f2 + f2)(0f + 0f - f) + 2 - 2 + f*3)(-77f - 32f + 5f). 104f*4 Expand 6p*3 - 14p*3 + 6p*3 + (6 + 4 - 9)(-p3 + p3 - p*3). -3p*3 Expand (2 - 2 + 3q*3 + (2 - 2q*2 - 2)(-3q - 4q + 5q) + 0q3 - q3 + 0q3)(-7q - 5q + 4q). -48q*4 Expand (8r - 5r + r)(-4r3 - r3 + 3r*3) + 9r*4 - 7r*4 + 12r*4. 6r4 Expand (m2 + m*2 - 22m*2)(2m2 - 5m*2 - 3m*2). 120m*4 Expand ((4 - 4 + 6)(b + 18b + 17b) + 4b + 4b - 5b)(3b - 2b - 2b). -219b*2 Expand (2 - 3w*4 - 2)(2 - 5 + 2) + 32w4 - 5w - 2w2 - 27w*4 + 9w. 8w4 - 2w*2 + 4w Expand (-1 - 385g + 887g - 344g)(-3g4 + 2g*4 + 3g*4). 316g*5 - 2g*4 Expand (-33j*2 + 63j*2 + 32j*2)(-1 + 1 + 1)(0 - 1 + 0)(-5 + 3 + 4)(1 - 3 + 0). 248j*2 Expand (-4y - 7 + 7)(2y*2 - 2y2 - y4) + (-3 + 4 - 2)(-2y*2 + 2y*2 - 6y*5) - 6y*2 + 6y*2 + 2y*5. 12y*5 Expand (2g + 2 - 2)(-3501g - 88 + g*2 + 3501g). 2g3 - 176g Expand (-2 + 3 + 0)(21x - 21x + 13x + 6x - 2x - 2x + (-1 + 2 - 3)(x + x + 0x)). 11x Expand (-3 - 1 + 3 - 4 + 2 + 0 - 3 + 4 - 3 + (1 + 0 + 0)(0 - 1 + 0) - 2 - 2 + 3)(i + 4 - 4)(2 - 10 - 5). 91i Expand b2 - b3 - b*2 + (0 + 2b + 0)(b2 + 3b*2 - 6b2) - b3 + 3 - 3 - 4b3 + 6b*3 + 0b3 - b3 + 81b + 93 - 93. -5b*3 + 81b Expand 0w3 - 2w*3 + 7w*3 + (12w - 24w + 9w)(2w*2 - 2w*2 - 2w*2). 11w3 Expand (-g3 + 4g3 - g3)((-3 - 2g + 3)(0g + 0g + 2g) + 4761 - 4761 - 18g2) - g5 + 3g5 - g5. -43g*5 Expand (0 - 2 + 0)(2j - 3j + 3j) + (6j - 2j - 3j)(-12 - 2 - 8) + 3j - j + 2j + 3 - 3 + j. -21j Expand (22 - 8 + 38)(-42i - 17 + 16i + 24i). -104i - 884 Expand -4h*5 + 0h*5 + 0h*5 + (-2h*2 + 3h*2 + 2h*2)(2 + h3 - 2) + (-h + h + h3)(1 - 4h*2 - 1). -5h*5 Expand -215 - 186d3 + 215 - d3 - d3 + d3 + d*3 - 1 + 1 + (4d - 3d + d)(-4d - 2d*2 + 4d) - 4d3 + d3 + 2d*3. -191d*3 Expand (-3 + 7y + 5 + 1)(228 + 17y*2 - 228). 119y*3 + 51y*2 Expand (-1 + n + 1)(-6n2 - 206 + 34n*2 + 207). 28n*3 + n Expand (16a - 13a + 13a)(4a - 4a - 6a*3 + 4a*3 + 1 - 1 + (0a*2 + 0a2 - a2)(-3a - a + 5a)). -48a*4 Expand -7a*3 + 24 - 24 + (-3a*2 + 0a*2 + 2a*2)(3 - 3a - 3) + a3 - a + a + (-4a + 3a + 0a)(2a*2 + 4a - 4a) - a3 + 0a*3 - 2a*3. -8a*3 Expand (-3z2 + z2 + 0z2)(-3z2 + z2 - z2) + (-2z*2 - 3z*2 + 3z*2)(-3z2 + 3z*2 - 5z*2). 16z*4 Expand (-70 + 169 - 40)(-3r + 3r + 3r + (1 + 0 - 2)(5r - 2r - 2r)). 118r Expand 8b5 - 13b*3 + 13b*3 + (0b + 0b + 3b*5)(-1 - 2 + 4). 11b5 Expand (-10 + 0 + 7 - 4v)(4v*3 + 4 - 4). -16v*4 - 12v*3 Expand -7k*3 + 17k*3 + 345k*4 - 12k*3 + (2k*2 - k + k)(0k2 - 4k*2 + 2k*2) + 0k4 + k4 - 2k4. 340k*4 - 2k*3 Expand (-3 - 1 + 1)(4 + h - 4) - 2 + 2 - h - 11h + 68 - 68 + (-1 - 1 + 1)(4 - 4 + 2h) + 0h - 4h + 2h. -19h Expand 7h*4 + 2h*2 - 2h*2 + (17h*2 - 17h*2 + 3h*3)(-h - 3h + 2h) + 2h4 + 0h*2 + 0h*2. 3h*4 Expand ((1 + 2r*2 - 1)(0 + 1 + 0) + 1 - r*2 - 1)(1 - 6 + 0). -5r2 Expand (3k + 0k - 2k)(-1 - 3 + 6) + (-4 + 7 - 27)(2k + 0k - 3k). 26k Expand (11 + 5i - 11)(2 - 4 + 0)(-74i + 74i + 6i*4). -60i*5 Expand 1 + o - 1 + (-5 + 4 + 3)(-10o + 2o + 76o). 137o Expand (2 - 2 - 5)(2v2 - v2 - 2v2)(-4 - 2v + 4)(-4v + v + 10v). -70v4 Expand (-5m*4 + 4m*4 + 4m*4)(2m - 4m - m) - 80m - 21m*5 + 80m. -30m5 Expand (-3v + 0v + v)(7 + v*4 - 6v*2 - 2 + 8v*2). -2v*5 - 4v*3 - 10v Expand 2 - 2 + 2q4 + (q + 4q + 0q)(q3 - q3 - 2q3 + (3 - 3 + q)(-2q2 - 2 + 2) - 4q*2 + 4q2 + q3 - q3 + q3 - 3q3). -28q*4 Expand (t - 1 + 1)(4 - 1 - 4)(-13 - 18 + 6) - t - 4 + 4. 24t Expand -2n - n + n - 892 + 67n + 892 + (-3n + 3n + 2n)(-7 + 3 + 2). 61n Expand (8l*2 + 11l*2 - 17l*2)(-l*2 + 11l2 + l2). 22l4 Expand (21y + 3y + 7y)(47 - 15y - 47). -465y2 Expand (3 + 0 - 1)(2 - 2 - 10z) - 4z + 1 + 5z - 2z. -21z + 1 Expand (-2 - z2 + 2)(5z + z + 8z) + 3z - 9 - z3 - 3z. -15z3 - 9 Expand -15d*2 - 8d*2 - 2d2 + (d2 + 5d2 - 4d*2)(-2 + 2 - 1) + 0d + 0d - d*2 - 2d*2 + 3d - 3d. -30d2 Expand (y2 + y2 - y2)(34y*2 + 40 - 64 + 99y*2 + 22). 133y*4 - 2y*2 Expand 3y*2 + 3y*2 - 280 + 277 - 4y*2 + 3y2 - y2 + 0y2 - 3y*2 + 2y*2 + (-y - 2 + 2)(-2y + 0 + 0). 5y*2 - 3 Expand ((2 - 3 + 3)(0 - 1 + 3) - 3 + 1 + 4)(0 - 2 + 0)(35 + 32 - 9)(-k + k - 8k)(k - 6k + 4k). -5568k*2 Expand (-3 - 2 + 4)(0 - 1 + 3)(40r*2 + 55 - 55) - 3r*2 - 2r*2 + 0r*2. -85r*2 Expand (-323c*3 - 2307c + 2307c)(0c + 2 - 3c + 4c). -323c*4 - 646c*3 Expand (-2 - 2 + 6)(-1 + 1 - 2)(-3j + 6j - j)(13j - 70 + 70). -104j*2 Expand ((0 - 2 + 4)(1 + 1 + 1) + 1 + 1 - 4 + 7 + 5 - 4)(0 + 0 + 2w). 24w Expand (0 + 1 - 3)(-y + 5y - y)(-2y3 - 3y*3 + 6y*3) + 9y*4 - 13y*4 - 2y*4. -12y*4 Expand (8 - 2 - 1)(1 + 1 - 3 + (-4 + 2 + 3)(0 + 0 - 2) - 2 - 2 + 2)(k5 - k5 - k*5). 25k*5 Expand 71c + 54c - 55c + (4 - 6 - 9)(0 + 0 - 2c). 92c Expand (-38t - 50t + 30t)(-8 - 2 + 4). 348t Expand (1 + 2 - 4)(0n4 + n4 + n*4) + 19n + 79n + 397n*4 - 98n. 395n4 Expand (-1 - 2r + 1)(-4 + 6 + 0)(25r - 34 + 34). -100r*2 Expand (5u - 4u + 3u)(16 + 2u2 - 16) + u3 - u*3 - 3u*3. 5u*3 Expand (-3i - 3i + 3i)(-6 + 0 + 2) - i + 3i - 12 + 14. 14i + 2 Expand ((-3 + 3 + 2)(1 - 1 - 2) + 3 + 3 - 4)(-7a*4 + 13a*4 - 8a*4). 4a*4 Expand -18 - a + 18 - 4a*2 + 4a*2 + 0a*2 - 3a*2 + 9a*2 - 35a*2 - 9a*2 + (3 - 3 + a)(0 + 0 - 2a). -40a*2 - a Expand (-4u + 4u - 3u*3)(2u + 5u + 6u) + 2u*4 + 2u4 - u4. -36u4 Expand (-2v*2 + 3v2 + v2)(-9v - 11v + 4v)(-2v*2 - 2v*2 + 5v*2). -32v*5 Expand ((-3q*2 + 2q*2 - 2q*2)(0q3 + 0q3 + q3) + (2q2 - 2q2 - q3)(4q - 4q + 2q2) + q5 + 2 - 2)(1 + 3 - 1). -12q*5 Expand (-2h + 0h + 0h)(-350h*3 - 63244h + 63244h). 700h*4 Expand (-106 - 94 - 718u + 200)(-2u4 + u4 - u*4). 1436u5 Expand b2 + b*2 + 0b*2 + (-4b + 0b + b + (-2b + 4 - 4)(4 - 4 + 1) + 3b - 2b + 0b - 5b + 3b + b)(-26b - 156 + 156). 132b2 Expand (-4u + 3u + 2u)(-2 - 2 + 1)(-41u2 + 22u*2 - 4u + 2u). 57u*3 + 6u*2 Expand (0l - l - l)(1 - 4 + 5) + 4 - 4 - 12927l + 12608l. -323l Expand (1 + 2 + 0)(-283s - 2 + 93s + 2) + s + 5s - 2s. -566s Expand (-1 - z + 2z2 + z)(-8 - 36 + 1). -86z2 + 43 Expand (-j + j + j2)(0j + 0j - 2j)(100 - 865 - 211). 1952j3 Expand (-4 - j + 4)(85 - 85 - 7j3) - 10j*4 - 5j*4 + 10j*4. 2j*4 Expand 2 + 0v*4 + 0v*4 + 2v*5 + (-1 + 5 - 6)(-102v5 - 1798v*4 + 1798v*4) + 0v5 - v5 + 0v5 + (-4 + 2v*3 + 4)(4 - 3v2 - 4). 199v*5 + 2 Expand (4x - 3x - 3x)(3515 - 280 + 107 + 2623). -11930x Expand (0l3 - 4l*3 - 2l*3)(1 - 2l + l - l2 - 2) + 3l5 - l5 - l*5 + 0l5 + l5 +	{ "pile_set_name": "DM Mathematics" }
to four dps? -0.0003 Let q = -2 + 4. Suppose -4y + 2680008 = qh, 0y = 5y - 4h - 3349984. Round y to the nearest 100000. 700000 Suppose 0y + 6 = y. Suppose -4v - 24200 = -yv. Round v to the nearest one thousand. 12000 Let g = -9 + 8.88. Let s = 51 - 50.8751. Let a = g + s. Round a to 3 dps. 0.005 Let r = -409 + 1079. Suppose 0 = -i - 0i + r. What is i rounded to the nearest 100? 700 Let q = 19 - 1. Suppose 0t + t = q. Suppose -189 + t = -3c. What is c rounded to the nearest 10? 60 Suppose d + 18 = 3d. Suppose 0i - i = d. Let b be 2/i + (-30504)/27. What is b rounded to the nearest 100? -1100 Let s(r) = r2 - 5r - 2. Let v be s(4). Let h(q) = -881q + 14. Let a be h(v). Round a to the nearest 1000. 5000 Suppose 3n - 5n + 2g = 312, -3g + 315 = -2n. Round n to the nearest ten. -150 Let n = 16.933 - 0.233. Let t = 82 + -59. Let j = t - n. Round j to the nearest integer. 6 Let j be -90(-3)/(9/6709). Suppose -w - 1 = -9. Suppose 2d = -w, -2s - 5d + j = -10798710. Round s to the nearest one million. 6000000 Let i = -35 - -34.99999977. Round i to 7 decimal places. -0.0000002 Let y = -7.8 - -7.80000294. What is y rounded to 6 dps? 0.000003 Let o = 15 + -9. Let y be (-120)/o10000/1. Round y to the nearest 1000000. 0 Let w = -140 + 140.00164. What is w rounded to four decimal places? 0.0016 Let c = 20 + -17. Suppose 0 = cq - 1370 + 9470. Round q to the nearest one thousand. -3000 Let y(d) = -d*3 + 5d*2 + 7d - 3. Let s be y(6). Suppose sp = 2r + 14767 + 239, p + 2r - 4994 = 0. Round p to the nearest ten thousand. 10000 Let q(f) = -f3 - 5f*2 + 2f + 7. Let y be q(-5). Let v(g) = -25g - 10g + g + 3g. Let k be v(y). Round k to the nearest 10. 90 Let u = -149.9999816 - -150. What is u rounded to five dps? 0.00002 Let q = 2.65 + -3.416. What is q rounded to one dp? -0.8 Let r = -0.1 + 0.0999994. Round r to seven decimal places. -0.0000006 Let z(q) = -41871q - 32. Let w be z(8). Round w to the nearest 100000. -300000 Let x = 52.4 - 51. Round x to the nearest integer. 1 Let q be 0 + (2 - 3)1. Let v = 7 - q. Let d be (-216)/(-10)300/v. What is d rounded to the nearest one hundred? 800 Let l = -4.00074 + 4. Round l to 4 decimal places. -0.0007 Let h = -6.0145 + 6. What is h rounded to 3 decimal places? -0.015 Let k = -9.91 - -8.6. What is k rounded to 1 decimal place? -1.3 Let n = -3.99986 - -4. Round n to 5 decimal places. 0.00014 Let s(g) = 611112g2 - 4g + 4. Suppose 0 = k - 5w - 6 + 28, -2k - 5w + 31 = 0. Let n be s(k). What is n rounded to the nearest 1000000? 6000000 Suppose -4f + 29 = -3c - 0c, -2f + 2c = -16. Suppose -45015 = -2j + 3j + 3v, 90025 = -2j - fv. Round j to the nearest ten thousand. -50000 Let w = -23 - -23.46. Let h = 83 - 82.99. Let u = w - h. What is u rounded to one dp? 0.5 Let a = 0.321 + -19.871. Let l = -20 - a. What is l rounded to one decimal place? -0.5 Let q = -10802916144838 + 10802915495439.0499943. Let d = q + 649399. Let n = -0.05 + d. What is n rounded to six dps? -0.000006 Let x = 0.23 - -0.27. Let b = 0 + 0.51. Let c = b - x. Round c to 2 dps. 0.01 Let d = -25 - -25.0000055. Round d to six dps. 0.000006 Let i(w) = w - 3 - 7w - 23w + 0. Let s be i(-7). What is s rounded to the nearest 1000? 0 Let h = -407130234.4785979 + 407114867.73. Let x = 15373.7486 + h. Let t = 7 - x. Round t to six decimal places. -0.000002 Let q = -14 + 10.6. Let w = -2.68 - q. Round w to one decimal place. 0.7 Let i = -11.6 - -1.8. Round i to zero dps. -10 Let s = -3677186 - -24377184. Suppose 2m - 5 = 1. Suppose -s = -mb - i, 0b - 3b = -i - 20700002. Round b to the nearest 1000000. 7000000 Let x = -0.1 + 0.13. Let m = 0.030003 - x. Round m to five decimal places. 0 Let w = -360 - -359.99689. What is w rounded to 4 dps? -0.0031 Let k = 17725550 + -50525550. What is k rounded to the nearest one million? -33000000 Let j = 15718177 + -10318157. Suppose -r + 5400004 = q, -r - 3q = 2q - j. Round r to the nearest one million. 5000000 Let j = 27.4 + -20. Let g = j - 8. Let s = g + 0.60000034. Round s to seven dps. 0.0000003 Let n = 0.11 - -0.79. Let c = n - 0.89932. Round c to 4 decimal places. 0.0007 Let i = -370.37 - -368. Let j = 0.03 - -0.1. Let p = j - i. What is p rounded to the nearest integer? 3 Let t = 7.9 + -91.9. Let w = t + 83.9999922. Round w to 6 dps. -0.000008 Let d = 36.56 + -36. Round d to 1 dp. 0.6 Let q = 11193 + -11189.4105. Let d = q - 0.5885. Let o = -3 + d. What is o rounded to 2 decimal places? 0 Let a = -1.153 + 1.07. Let y = -0.657 + a. Round y to one decimal place. -0.7 Suppose -3i = -t - 3t - 89, 3i = -15. Let u = -56 - t. What is u rounded to the nearest 10? -30 Let y = 589 + -589.649. Let m = y - -0.059. What is m rounded to one decimal place? -0.6 Let z be -1 + -3 - (-409 + 5). Round z to the nearest 100. 400 Let p = 199.00000589 + -199. What is p rounded to 6 decimal places? 0.000006 Let f = -486441 + 486481.9922. Let w = f - 41. Round w to 3 decimal places. -0.008 Let i = 0.77982 - 0.3798. Let g = -1 + 0.6. Let r = i + g. What is r rounded to 4 dps? 0 Let g = 59.1 + -58.689. What is g rounded to 1 decimal place? 0.4 Let s = -0.037 - 0.087. What is s rounded to 1 dp? -0.1 Let i = -61.788 - 0.512. Let t = i + 59. Let a = t + 3.319. Round a to two decimal places. 0.02 Let i = -8230220188.660678854 - -8230220198. Let k = 0.339321286 - i. Let m = k - -9. Round m to seven dps. 0.0000001 Let n = 32 + -31.9664. Let y = 1.3 + -1.27. Let i = y - n. What is i rounded to three dps? -0.004 Let z(f) = f*3 + 6f*2 + 4f - 2. Suppose -1 - 4 = d. Let r be z(d). Suppose 0 = -2c - rc + 2900. Round c to the nearest 100. 600 Let i = -12.9 - -12.900125. What is i rounded to five dps? 0.00013 Let z = -9 + 13. Let m be -6((-10)/z - -2). Suppose 0 = 5f - 20, l = f - mf - 792. Round l to the nearest one hundred. -800 Let f be (-2038)/(-2)37 + -3. Round f to the nearest 1000. 38000 Let y(d) = -5d3 - 4d - 6. Let w be y(-4). What is w rounded to the nearest ten? 330 Let p = 1.3 - -4.7. Let w = p - 5.996. Round w to 2 dps. 0 Let d = 11.036 - 11. Let h = d - -2.284. Round h to one dp. 2.3 Suppose 2s + 725 = -2x - 3x, -4x + 382 = -s. Let t be (-4)/(-16) + 7762/(-8). Let p = t - s. Round p to the nearest one hundred. -600 Let f(h) = 113h - 43h + 209h + 156h. Let n be f(2). Round n to the nearest one hundred. 900 Let b = 3 + -2. Let w(a) = -8300001a - b + 5 - 3. Let r be w(1). What is r rounded to the nearest 1000000? -8000000 Let w be 324/8. Suppose 14203 = 2u - 2t + wt, -2u + t = -14197. What is u rounded to the nearest 1000? 7000 Let a(v) = 2632v + 4. Let w be (-5)/((-30)/4)-15. Let n = w - -13. Let r be a(n). Round r to the nearest one thousand. 8000 Let s = 0.08 - 0.68. Let i = 0.4 - s. Let b = -0.999995 + i. Round b to 6 decimal places. 0.000005 Let v = 13325247.05 + -13324619.330003. Let o = v - 627.77. Let d = o + 0.05. What is d rounded to five decimal places? 0 Let o = 266385.7293325 + -266387. Let u = o + 0.4906737. Let y = u - -0.78. Round y to six dps. 0.000006 Let c be 0 - -1 - (2 - 3). Suppose 0y - 4y + 952 = cm, 0 = 3m + 4y - 1432. Round m to the nearest 100. 500 Let l = 3720374.000028 - 3720366. Let a = 8 - l. What is a rounded to five decimal places? -0.00003 Let u be (-1250)/3(-1 - 3071). What is u rounded to the nearest 100000? 1300000 Let b = 15.554145 - -1.445667. Let t = -17 + b. What is t rounded to five decimal places? -0.00019 Let d = 78 + -78.00000012. What is d rounded to 7 decimal places? -0.0000001 Let r = -99 - -99.0139. What is r rounded to 3 decimal places? 0.014 Suppose 8 = -3a + 2. Let o(n) = -19n + 4. Let b be o(4). Let f be a/7 + b/(-7). Round f to the nearest one hundred. 0 Let y = 674.02 + -682. Let p = 8 + y. Let z = 0.22 + p. Round z to one dp. 0.2 Let g = -25 - -25.044. What is g rounded to 2 dps? 0.04 Let w = -568.6 + 480. What is w rounded to the nearest 10? -90 Let q = 56.8000594 + -56.8. What is q rounded to five dps? 0.00006 Let g = -321437435 + 321437465.9999951. Let s = -31 + g. Round s to six dps. -0.000005 Suppose -3h + 0n + 4424 = -n, -2n = h - 1477. Suppose -8925 = -4*j + h. What is j rounded to the nearest 1000? 3000 Let a = 1.699 + 164.901. Let t = 194 - a. Let b = 32 - t. Round b to zero decim	{ "pile_set_name": "DM Mathematics" }
uence mm when two letters picked without replacement from {m: 3, h: 4, p: 3, r: 4}? 3/91 What is prob of sequence ffff when four letters picked without replacement from {f: 6}? 1 What is prob of sequence yes when three letters picked without replacement from {y: 1, e: 4, s: 2, a: 2}? 1/63 Three letters picked without replacement from {u: 2, e: 6, x: 3, f: 2, v: 1, p: 4}. What is prob of sequence fpu? 1/306 Two letters picked without replacement from pthhfptwiihhh. Give prob of sequence ht. 5/78 Three letters picked without replacement from jdjdddj. Give prob of sequence jdj. 4/35 Three letters picked without replacement from {n: 2, t: 1, k: 1, e: 2}. What is prob of sequence ete? 1/60 Four letters picked without replacement from bdddblbdbll. Give prob of sequence bdlb. 1/55 Three letters picked without replacement from taagrqttttrrrtyrt. Give prob of sequence tat. 7/340 What is prob of sequence oo when two letters picked without replacement from oddooododddd? 5/33 What is prob of sequence hl when two letters picked without replacement from {h: 3, l: 8}? 12/55 Two letters picked without replacement from iixxhxhxxbxv. What is prob of sequence vi? 1/66 Two letters picked without replacement from {a: 17, r: 2}. Give prob of sequence aa. 136/171 Calculate prob of sequence ll when two letters picked without replacement from {f: 4, h: 1, w: 2, u: 1, l: 2}. 1/45 Two letters picked without replacement from arrxewfxarre. What is prob of sequence rf? 1/33 Calculate prob of sequence dddd when four letters picked without replacement from {p: 5, d: 5}. 1/42 Four letters picked without replacement from yygcixxcyilyyix. What is prob of sequence igcx? 1/1820 What is prob of sequence wt when two letters picked without replacement from {h: 2, w: 3, t: 13}? 13/102 Calculate prob of sequence ldp when three letters picked without replacement from {p: 6, r: 3, d: 2, t: 2, l: 1}. 1/182 Calculate prob of sequence vzb when three letters picked without replacement from {v: 1, b: 1, e: 2, z: 1}. 1/60 Calculate prob of sequence vl when two letters picked without replacement from {e: 1, x: 1, n: 1, f: 2, v: 1, l: 1}. 1/42 What is prob of sequence rrk when three letters picked without replacement from sruuuuurrruuurrkukur? 7/570 Two letters picked without replacement from jbqqqbjj. What is prob of sequence jb? 3/28 Two letters picked without replacement from omtttottmotgtmomttt. What is prob of sequence og? 2/171 Calculate prob of sequence hm when two letters picked without replacement from {h: 5, m: 11}. 11/48 What is prob of sequence ttl when three letters picked without replacement from {t: 3, l: 3, a: 1, j: 3, z: 1, n: 2}? 3/286 Calculate prob of sequence ny when two letters picked without replacement from crryrrnuy. 1/36 Calculate prob of sequence svsp when four letters picked without replacement from {z: 4, y: 3, w: 2, p: 2, v: 2, s: 2}. 1/4095 Three letters picked without replacement from {k: 4, t: 1, e: 2, q: 3, x: 1}. What is prob of sequence qxq? 1/165 Four letters picked without replacement from lxlxxx. Give prob of sequence lxxx. 2/15 Two letters picked without replacement from rarpaarrra. What is prob of sequence pr? 1/18 What is prob of sequence rr when two letters picked without replacement from cchcrrcr? 3/28 Two letters picked without replacement from qfyfz. What is prob of sequence yz? 1/20 Calculate prob of sequence ulz when three letters picked without replacement from {l: 1, p: 1, z: 3, u: 1, b: 3, q: 2}. 1/330 Calculate prob of sequence bb when two letters picked without replacement from {s: 3, b: 13}. 13/20 What is prob of sequence xxi when three letters picked without replacement from {i: 7, n: 2, v: 1, s: 4, x: 3}? 7/680 Three letters picked without replacement from fzznw. Give prob of sequence fww. 0 Calculate prob of sequence lx when two letters picked without replacement from xlllnnnllnllvv. 1/26 What is prob of sequence ofof when four letters picked without replacement from fzzfzooofzofzfoofzf? 35/2584 Calculate prob of sequence jjjj when four letters picked without replacement from jjjjjjj. 1 What is prob of sequence kok when three letters picked without replacement from {e: 4, k: 2, d: 2, o: 5}? 5/858 Calculate prob of sequence po when two letters picked without replacement from popppoojopoqopuppup. 3/19 Four letters picked without replacement from ttmmttttttttmtt. What is prob of sequence mmtm? 1/455 Calculate prob of sequence ab when two letters picked without replacement from bbba. 1/4 Two letters picked without replacement from {f: 1, j: 1, c: 1}. Give prob of sequence jf. 1/6 Calculate prob of sequence cgc when three letters picked without replacement from qccccgncgczcncgczcn. 15/323 Three letters picked without replacement from {n: 12, q: 6}. What is prob of sequence nqq? 5/68 Four letters picked without replacement from gnugmgmlttll. What is prob of sequence tlll? 1/990 Two letters picked without replacement from ulw. Give prob of sequence wl. 1/6 Four letters picked without replacement from appppappp. What is prob of sequence aapp? 1/36 Three letters picked without replacement from {w: 6}. What is prob of sequence www? 1 What is prob of sequence ffkf when four letters picked without replacement from kfffffkfff? 2/15 Two letters picked without replacement from {f: 3, e: 4}. Give prob of sequence ee. 2/7 What is prob of sequence dh when two letters picked without replacement from hhdnhhdnydhyhddndlnh? 21/190 Three letters picked without replacement from {v: 2, d: 7}. What is prob of sequence ddv? 1/6 What is prob of sequence ppp when three letters picked without replacement from {v: 3, p: 7}? 7/24 What is prob of sequence bi when two letters picked without replacement from bbsbaabsbbbi? 7/132 Three letters picked without replacement from {h: 1, p: 1, e: 1, r: 1, f: 1}. Give prob of sequence ehf. 1/60 Calculate prob of sequence bfsi when four letters picked without replacement from ififkssfsfbk. 1/495 Calculate prob of sequence kkq when three letters picked without replacement from txkttqttxtvxtttkv. 1/2040 Calculate prob of sequence ova when three letters picked without replacement from {f: 4, a: 1, v: 6, o: 3}. 3/364 Calculate prob of sequence gqar when four letters picked without replacement from qglqarg. 1/210 What is prob of sequence pppp when four letters picked without replacement from pppppppppp? 1 What is prob of sequence yccx when four letters picked without replacement from {r: 1, d: 9, x: 3, c: 2, y: 3}? 1/4080 What is prob of sequence ff when two letters picked without replacement from {y: 4, q: 2, b: 5, f: 2}? 1/78 Four letters picked without replacement from {n: 2, q: 2, f: 1, t: 1}. Give prob of sequence tnqn. 1/90 Four letters picked without replacement from zrqrrzrq. Give prob of sequence qzqz. 1/420 Calculate prob of sequence uiuu when four letters picked without replacement from {i: 2, u: 5, g: 4}. 1/66 Calculate prob of sequence ooo when three letters picked without replacement from {o: 6}. 1 Calculate prob of sequence pnfp when four letters picked without replacement from kfnpkpkpkfqnrr. 1/1001 Four letters picked without replacement from {u: 1, w: 2, b: 5, g: 1}. What is prob of sequence ugww? 1/1512 Calculate prob of sequence ggj when three letters picked without replacement from {g: 4, l: 2, j: 6}. 3/55 What is prob of sequence qx when two letters picked without replacement from ixqkxxxq? 1/7 Three letters picked without replacement from dsdddds. Give prob of sequence dss. 1/21 Calculate prob of sequence koo when three letters picked without replacement from yehyhkfkkyhefoff. 0 Calculate prob of sequence ea when two letters picked without replacement from {a: 7, e: 2}. 7/36 What is prob of sequence xh when two letters picked without replacement from {x: 1, w: 1, c: 1, h: 1, p: 1}? 1/20 Four letters picked without replacement from {f: 2, b: 7}. What is prob of sequence ffbb? 1/36 Two letters picked without replacement from {z: 5, i: 15}. What is prob of sequence iz? 15/76 What is prob of sequence iuz when three letters picked without replacement from zbmuzuiiui? 1/40 What is prob of sequence in when two letters picked without replacement from {f: 3, h: 2, q: 1, n: 6, d: 2, i: 5}? 5/57 What is prob of sequence	{ "pile_set_name": "DM Mathematics" }
k in descending order. 1, 0.4, k, 1/22 Let c = 56 + -55.5. Let v = -1.5 - -0.5. Sort c, 0.1, v in decreasing order. c, 0.1, v Let f = -4 + 1. Sort 0.2, f, 2/5 in descending order. 2/5, 0.2, f Let h be (1/((-7)/(-6)))/(1/(-7)). Put -1, h, -4, -5 in ascending order. h, -5, -4, -1 Let l be (21/(-7))/((-2)/(-10)). Let f be l/252/3. Sort f, -2, -3 in decreasing order. f, -2, -3 Suppose -3a + 4 = u + 20, -12 = -3u + 3a. Put 3, u, 5 in ascending order. u, 3, 5 Suppose 3p = 33 - 21. Put p, -4, -13 in descending order. p, -4, -13 Let k = -0.15 - -0.35. Put k, 0.5, 0.1, 2/7 in descending order. 0.5, 2/7, k, 0.1 Suppose 0 = -2p - k + 4 - 0, -p + 11 = -4k. Suppose 0 = -13t + 9t + 20. Put -2, t, p in decreasing order. t, p, -2 Suppose 4r - 2r = -6. Sort r, 1, 3 in ascending order. r, 1, 3 Let u = 6 + -6.5. Let k = u - -0.4. Put k, -0.5, -2/13 in ascending order. -0.5, -2/13, k Let g = 0.45 - 0.05. Let j = -0.06 - 0.34. Put -3, j, g in descending order. g, j, -3 Let s be (-2)/(-11) - 20/(-11). Suppose b = -4, -2l - 12 = sl + 3b. Put l, -5, 2 in increasing order. -5, l, 2 Suppose -4o + 5o = -5. Sort 0, 2, o in ascending order. o, 0, 2 Let t be (2/(-8) - -1)2/6. Sort -2/9, 2, -0.3, t in increasing order. -0.3, -2/9, t, 2 Let z = 0.1 - -0.1. Let n = -12.2 - -12.1. Sort -3/7, n, z. -3/7, n, z Let b(g) = 4g + 3. Let u be b(-2). Put -2, 4, u in ascending order. u, -2, 4 Suppose -4q + 22 = 3i, 3q = -3i - i + 20. Let u = q + 0. Suppose 2 = 3g + 11. Sort u, 0, g in ascending order. g, 0, u Let u = 7.9 - 7.5. Sort u, -2/3, 2 in ascending order. -2/3, u, 2 Let o(f) be the second derivative of -1/12f4 + f3 + f + 11/2f2 + 0. Let n be o(8). Sort -4, -2, n. n, -4, -2 Let j = 0.36 + -0.06. Let i = -2.9 - -2.9. Sort -0.2, i, j. -0.2, i, j Let v = 1189236917/2772291805 + 1618/58481. Let g = -43/95 + v. Let y = -1028/7485 + g. Put -0.4, 4, y in descending order. 4, y, -0.4 Suppose -4 = -4o, 2r - 3 = 2o - 11. Suppose -20 = 5c, n - 2c - 9 = -0c. Suppose w + n = -3. Sort 2, w, r in ascending order. w, r, 2 Let d = 16 - 15.95. Sort 2, d, -1/3 in increasing order. -1/3, d, 2 Suppose 4u + 5y = 54, 30 = 2u - y + 5y. Suppose 5 = uk - 6k. Suppose -3v = -v - 10. Put v, k, -2 in descending order. v, k, -2 Suppose 2n + 7 = 3. Sort 2, 3, n in increasing order. n, 2, 3 Let d = -9 - -13. Suppose ds = 19 + 1. Put 2, s, -3 in decreasing order. s, 2, -3 Suppose -3i - 84 = -5m - 5i, 10 = m - 3i. Suppose 0 = 4q - 4c - m, 0 = -q + 2c + 12 - 3. Let p = -10 + 15. Sort q, 2, p. q, 2, p Let v = -58/63 - -8/7. Let s = 0.2 + -0.1. Put s, v, -4 in decreasing order. v, s, -4 Let d(p) = -p + 7. Let a be d(3). Let g = -4 - -3. Put g, a, -1/2 in increasing order. g, -1/2, a Suppose g - 28 = 4s - 0g, -2s - 3g = 0. Sort 2, -2, s. s, -2, 2 Let z be 6 + -4 - (-19)/(-10). Let w = -0.8 - 0.2. Let s = 1.5 + w. Put z, s, -0.3 in descending order. s, z, -0.3 Let u = 5 - 4.7. Put u, -1, -0.4 in increasing order. -1, -0.4, u Let s = -0.8 + 1. Let v = -0.5 + s. Put v, -0.5, -3 in descending order. v, -0.5, -3 Let f = -43 + 48. Sort f, 4, -1/5. -1/5, 4, f Let y(j) be the second derivative of j3/6 + 3j*2 + 6j. Let f be y(-5). Sort 0, 3, f in descending order. 3, f, 0 Let l = 9 - 11. Put 5, 6, 1, l in descending order. 6, 5, 1, l Let u(j) = 22j2 + 1. Let g be u(-1). Suppose -4c - g = -9c - 3x, -4c - x = -17. Suppose 2a = 3a - cv + 3, -3 = a + v. Put 5, a, 1 in descending order. 5, 1, a Let h be 4/6(6 + (-252)/49). Put 8, h, -2/21 in ascending order. -2/21, h, 8 Let h be (-2)/653. Let l be (6/3)/(-2 + 0). Let f = -10 - -6. Put f, l, h in increasing order. h, f, l Let u be 54/(-24) + 1/4. Put -1, 2, u in decreasing order. 2, -1, u Suppose 4t + 3 - 7 = 0. Let g(l) = l*3 + 3l*2 - 3l + 1. Let p(j) = j*2 - 4. Let o be p(0). Let n be g(o). Put 0, n, t in descending order. t, 0, n Let z = 0.9 + -0.7. Let d = z - -2.8. Sort -0.02, -3, d. -3, -0.02, d Let x = 26.06 - 0.06. Let j = -16 + x. Put -2/7, j, -1 in descending order. j, -2/7, -1 Suppose 5r = 13r + 24. Let t be (-2)/(4/(-2)) - 3. Sort t, 3, r in descending order. 3, t, r Let z(b) = -b3 + b + 2. Let h be z(2). Let s be (1/h)/(10/(-16)). Sort s, -1, 0.5 in decreasing order. 0.5, s, -1 Let b(u) = -12u - 105. Let j be b(-9). Let s(y) = -y*3 + 6y*2 - 4y - 3. Let w be s(5). Sort w, -1, j in decreasing order. j, w, -1 Let d = -0.6 - -0.1. Let c = -9.6 - -1.6. Let p = c - -7.6. Put 0.5, d, p in increasing order. d, p, 0.5 Let r = 12 - 8. Let u = 0.1 + 0.9. Let z = 7.9 + -8. Sort r, u, z in descending order. r, u, z Suppose 2n = -2x + 6, -5x - 1 = 2n - 19. Put n, -11, -4 in decreasing order. n, -4, -11 Let g = 13 + -8. Let b be 0 - (1/21 - (-1)/(-3)). Sort 1, g, b in ascending order. b, 1, g Suppose 3p + 3 = -3. Let k = -1 - p. Put k, -5, -0.5 in descending order. k, -0.5, -5 Suppose -4 = 4b + 4u, -2 - 4 = 3b + 2u. Let a = 3.1 + -26.1. Let z = a - -24. Sort b, -2/3, z in ascending order. b, -2/3, z Let u = 93 - 95. Put -3, u, -4, 2 in ascending order. -4, -3, u, 2 Let n(j) = -j2 - 2j - 1. Let f be n(0). Sort 1, f, 3 in decreasing order. 3, 1, f Let r be ((-144)/(-60))/((-2)/30). Put 2, 0, r in ascending order. r, 0, 2 Suppose y + w = -5, 6y + 2w + 15 = 3y. Put y, 5, -4 in descending order. 5, -4, y Suppose -2 = -4w + 14. Suppose 0 = 4a + d + 16, -2a - wd + 0 = -6. Sort a, 1, 4 in increasing order. a, 1, 4 Let d = 0.02 - 0.02. Sort 2/7, d, 4 in ascending order. d, 2/7, 4 Let m = 48 + -239/5. Sort -1/6, 0.5, m. -1/6, m, 0.5 Let t = 604/1535 + 2/307. Put t, 1.6, -0.4, 0.1 in decreasing order. 1.6, t, 0.1, -0.4 Let v(d) = d. Let z(r) = r2 + 4r + 2. Let p be z(-4). Let f be v(p). Sort -5, 3, f in decreasing order. 3, f, -5 Let x(d) = d*3 + 3d*2 - 3d + 4. Let v be x(-4). Let b be (-1 - -2)/(1/(-3)). Let z = b - -1. Put v, 5, z in increasing order. z, v, 5 Let l = -16 - -24. Let q = -3 + l. Let x(h) = -h + 1. Let f be x(2). Sort q, 2, f. f, 2, q Let q = -0.31 + 5.31. Put -0.5, q, 0.1 in increasing order. -0.5, 0.1, q Suppose 15 = 2h + h. Suppose -hp + 45 + 25 = 0. Let l = p + -10. Sort -3, -1, l. -3, -1, l Let z be 8/(-17)2/8. Put -0.1, 2.6, z, -1/2 in decreasing order. 2.6, -0.1, z, -1/2 Let q be (-8)/4 - (-40)/18. Let t = 0.2 - 0. Sort t, q, -0.3. -0.3, t, q Let f = -10 - -8. Let g(v) = -v3 - 3v*2 + 5v + 6. Let t be g(-4). Let s = -7 + t. Put f, 5, s in decreasing order. 5, f, s Let a = -2 + -5. Let b = a + 4. Put 0.4, b, -0.1 in descending order. 0.4, -0.1, b Suppose -x + 0x - 2 = 0. Let y = 85 + -933/11. Let t = 34 - 32. Sort y, t, x in ascending order. x, y, t Suppose -g + 4s = -6g - 19, -s - 16 = 5g. Sort g, -5, -3/4 in ascending order. -5, g, -3/4 Let n = 5 + -11. Put n, -4, -5 in ascending order. n, -5, -4 Let p = 8 - 5. Suppose -pn = 1 + 5. Let b = -96 + 101. Put 0, n, b in decreasing order. b, 0, n Suppose 36 = 5s + 6. Let a be (-4)/s(-105)/(-14). Put a, -4, -7 in decreasing order. -4, a, -7 Suppose 3 = 5x - 2. Let i(g) = g*3 - 3g*2 - 3g - 5. Let r be (-3)/(-2)16/6. Let z be i(r). Put z, 4, x in descending order. 4, x, z Let g = -32 + 33. Suppose 0p + p = 0. Suppose 2w - 8 = -p. Sort g, w, -2. -2, g, w Let a be (0 - -2) + (-495)/(-12). Let k = a - 43. Put 0.3, k, -3/7 in increasing order. -3/7, k, 0.3 Let i(l) = 8l*2 - l - 1. Let c be i(-1). Let p be (-2)/c + 27/12. Let b(u) = 6u3 - u2. Let x be b(1). Sort -3, x, p in ascending order. -3, p, x Let s = 64 + -66. Put 0, -5, s, 1/8 in descending order. 1/8, 0, s, -5 Suppose -7x - 30 = -2x. Sort 5, x, 1. x, 1, 5 Let m = -87 - -177/2. Put m, 0, -2/7 in ascending order. -2/7, 0, m Let p = 107/102 + -15/17. Let y = p - 3/10. Put 4, y, 0.4 in descending order. 4, 0.4, y Let d = -0.035 + 1.035. Put d, -3, 3, 5 in descending order. 5, 3, d, -3 Let l = -1/11 + -13/99. Let m = -32 - -23. Let k = 4 + m. Sort l, k, 4 in descending order. 4, l, k Let l be (-9 + 680/75)31. Put -0.6, -1, l, -1/3 in ascending order. -1, -0.6, -1/3, l Let j = -5 + 11. Let t be (5/(-20))/((-2)/(-4)). Sort t, j, 5. t, 5, j Let o be 1/2 + 4/(-24). Let h be 1 + -1 + (-2)/7. Sort -5, h, o in increasing order. -5, h, o Let t(k) = 2*k + 10. Let d be t(-4). Sort 4, d, 7 in descending order. 7, 4, d Let u be 3 - -2 - (1 -	{ "pile_set_name": "DM Mathematics" }
= 8622015l - 45. Let h be z(3). Suppose -4t - 14t - h = 0. What is t rounded to the nearest 100000? -1400000 Suppose -4k - 693 - 6883 = 0. Let f = k + -1301. Let l = -2175 - f. Round l to the nearest one hundred. 1000 Let y = -1864.6291 - -1866. Round y to two dps. 1.37 Suppose -101l + 84428639 = 1775017139. What is l rounded to the nearest 100000? -16700000 Let w(m) = -m3 - 7m*2 - 10m. Let g be w(-5). Suppose 7x - 5x + 14240000 = g. What is x rounded to the nearest 1000000? -7000000 Let g = 5338 - 5337.9999995488. Round g to seven decimal places. 0.0000005 Let g = 5 + -26. Let x = -22.5 - g. Let o = x + 1.49. What is o rounded to 2 dps? -0.01 Let w be ((-27)/9)/(-2(-3)/(-21686058)). Let b = -37507853 - -61064840. Suppose 4o - b - w = -4j, 3o + 8599988 = j. Round j to the nearest one million. 9000000 Let i = -2806294 - -2806294.52000152. Let p = -0.3 + -0.22. Let t = i + p. What is t rounded to 7 decimal places? 0.0000015 Let c = -507 + 507.0006946. Round c to 5 dps. 0.00069 Let t = 25 + -19. Let f = -5.9315 + t. What is f rounded to two decimal places? 0.07 Let t = -214.0283 + -30.1457. Let i = t + 244. Round i to 2 dps. -0.17 Let c = 426786852 + -426786785.0000001. Let l = -67 + c. Round l to seven dps. -0.0000001 Let x = 286.40539 - 1446.23749. Let v = 1160.4 + x. Let h = 0.545 - v. Round h to 3 dps. -0.023 Let n = 1001 - 999.141. Let k = n + -1.19. Round k to 2 dps. 0.67 Let w = 101 + 1. Let p = -62 + w. Let s = p - 39.999948. What is s rounded to 5 decimal places? 0.00005 Let s be 544/32(0 - 2)/(-2). Suppose -4b = 1 - s. Suppose -2q - 1439990 = bx + 3q, 0 = -x + q - 360002. Round x to the nearest one hundred thousand. -400000 Let s = 3146296647 + -3146297027.9999671. Let w = s + 381. What is w rounded to six decimal places? 0.000033 Let x = -177975384.07810724 - 1.92189276. Let y = 177975413.0000021 + x. Let r = y - 27. What is r rounded to seven decimal places? 0.0000021 Let x = 1727.99990594 - 1728. Round x to 5 dps. -0.00009 Let f = -16.4 - -14.17. Let y = 47.2111 + -45.018. Let l = y + f. What is l rounded to 3 dps? -0.037 Let j = -3854.00376 + 3854. What is j rounded to 3 decimal places? -0.004 Let a = -21175506.00674 - -21175302. Let x = -204 - a. Round x to four decimal places. 0.0067 Let j = -67367.37 + 68309. Round j to the nearest 10. 940 Let x(l) = l3 + 28l*2 + 45l + 24. Let z be 27(4 + -3)-1. Let p be x(z). What is p rounded to the nearest ten? -460 Let a = 276.4047 - 275.04. What is a rounded to 1 dp? 1.4 Let k = 124.68 + -1889.26. What is k rounded to the nearest 100? -1800 Let t = -6954 + 6953.999991762. Round t to 6 dps. -0.000008 Let i = 195147436805 - 195147650726.650033. Let v = 213922 + i. Let n = v + -0.35. What is n rounded to 5 decimal places? -0.00003 Let y = -14832122 - -7802564. Let s = y + 12347558. What is s rounded to the nearest one million? 5000000 Let r = -484 + 311. Let l = 173.000278 + r. Round l to 4 dps. 0.0003 Let a = 5.908 - -244.472. What is a rounded to the nearest ten? 250 Suppose -6058000 = -3166z + 3126z. Round z to the nearest ten thousand. 150000 Let w = 1556 + -2406. Let k = 848.851 + w. Round k to 2 decimal places. -1.15 Let k = 114028 + -114023.0229. What is k rounded to one decimal place? 5 Let f = -8.3374 + 7.89. Let o = -0.319 - f. What is o rounded to 2 dps? 0.13 Let y = -1533.8 + 1482. Round y to the nearest 10. -50 Let z = 2.29 + -2.475. Let x = z - 0.376. Round x to one decimal place. -0.6 Let s = 81699 - 81706.3298. Let b = -7.3 - s. What is b rounded to 3 decimal places? 0.03 Let c = 223063.489 + -425698.246. Let t = c - -202947. Let z = t + -312. What is z rounded to two decimal places? 0.24 Let b be 4/(-6)(-210)/28 + -133921005. Round b to the nearest one million. -134000000 Let s = 85.8 - 85.7. Let h = 2.51 - s. Round h to 1 dp. 2.4 Let r = 1.2 + -7.5. Let f = -15327743.699907 + 15327750. Let q = f + r. Round q to 5 decimal places. 0.00009 Let p = -362.1 + 375.63. Round p to zero dps. 14 Let g = 406.587 - 0.587. Let f = -257 + g. Let j = f + -149.000126. What is j rounded to five dps? -0.00013 Let n = -47606393 + 47606392.79999951. Let v = 0.066 + -0.266. Let a = n - v. What is a rounded to seven decimal places? -0.0000005 Let m = -159756896317262 + 159756854687477.2999495. Let r = m + 41629776. Let f = -8.7 - r. Round f to five decimal places. 0.00005 Let a = -1208 + 466. Let j = a - -741.9999237. What is j rounded to 5 dps? -0.00008 Let q = -38508.119 + 38616. Round q to zero decimal places. 108 Let z = 10308217 + -5842217. Round z to the nearest one million. 4000000 Let r(o) = 3o + 3. Let h be r(-5). Let c be 124100/h. What is c rounded to the nearest 10? -200 Let s = 57 + -85. Let r = s + 37.5. Let j = 9.49912 - r. What is j rounded to 4 decimal places? -0.0009 Let v = 726.58 - -4.42. Let x = 730.99998788 - v. Round x to six dps. -0.000012 Let w = 27 - 25. Suppose 2c = 4f + 63112, -wf - 94676 = -3c - 0f. Suppose 0 = h + 53440 + c. What is h rounded to the nearest 10000? -90000 Let b = 16328.0028368 - 16328. What is b rounded to 4 decimal places? 0.0028 Let y = 1456.69 + -1469. Let b = -0.31 - y. Let a = b + -11.9595. What is a rounded to 3 dps? 0.041 Let c = 0.13481 - 0.28831. Round c to 1 dp. -0.2 Let d be (-3751200016)/120 - 68/(-510). Round d to the nearest 1000000. -31000000 Let m = -596.026254 + 288.02594. Let j = m - -308. What is j rounded to four decimal places? -0.0003 Let l = 5.12 - -443.88. Let k = 449.00003496 - l. Round k to 6 dps. 0.000035 Let a = -168463636 - -168463854.000089. Let q = a - 218. Round q to five decimal places. 0.00009 Let h = -250332383 + 137702383. What is h rounded to the nearest one million? -113000000 Let t = -70526963.544001655 - -70526462.544. Let h = t - -501. What is h rounded to seven dps? -0.0000017 Let x = 1403.2 + -1403.199990239. What is x rounded to seven dps? 0.0000098 Let v = 304.76 + -4.76. Let k = v - 300.00029. Round k to three dps. 0 Let l = -5.801 + 0.201. Let q = 6.66 + l. Round q to one dp. 1.1 Let s = -461.10397309 + 1.10716309. Let v = s - -460. Round v to 4 decimal places. 0.0032 Let h = 458 - 836. Let q = h + 377.9262. Let x = q + 0.062. What is x rounded to 3 dps? -0.012 Let o = -2148.4 + 2147.99715. What is o rounded to 2 decimal places? -0.4 Let h(r) = 463r*2 + 9r - 14. Let n be h(2). Let m be (7 - 2) + (n - -6). Let l = -1267 + m. What is l rounded to the nearest 100? 600 Let q be 10/(-4 + 2) - -9752862. Suppose 4a + 2160857 = q. What is a rounded to the nearest one hundred thousand? 1900000 Let m = 828498 + -828439.7489. Let b = 0.0111 - m. What is b rounded to the nearest integer? -58 Let j = 9249 + -9259.037. Round j to zero decimal places. -10 Suppose -4z - 6z = -2z. Suppose 0d + d - 274 = z. Suppose 0r - 2r - d = -2a, -2r + 4a = 268. Round r to the nearest 100. -100 Let q = 323 - 321. Let m = q - 2.000366. What is m rounded to five dps? -0.00037 Suppose 2c + 10 = 3v + 3c, 0 = 4v + 2c - 14. Suppose 7h - 3h + 72 = 3b, vh + 3b + 33 = 0. Round h to the nearest one hundred. 0 Let z be (-2)/(-6) + (-76727480)/24. Let p = z + 2282978. What is p rounded to the nearest one hundred thousand? -900000 Let k = 74.5 + -9.5. Let l = 196502098.9999995 - 196502164. Let j = l + k. What is j rounded to seven decimal places? -0.0000005 Let x = -4.12599296 - -4.126. What is x rounded to 7 decimal places? 0.000007 Let v = -87.8 + 15.8. Let j = v + 72.000054. What is j rounded to four decimal places? 0.0001 Let w(t) = 4770t - 51. Let x be w(-9). Let q be (-1 + 6/12)/(1/14038). Let z = q + x. What is z rounded to the nearest one hundred thousand? -100000 Let o = -685.9395 - -686. Let u = o + -0.05795. Round u to four decimal places. 0.0026 Let v = -0.154082 - -0.044148. Let f = -3285.89 - -3286. Let h = f + v. What is h rounded to 5 dps? 0.00007 Suppose 0 = 16d - 532039082 - 9829178 - 78499740. What is d rounded to the nearest 100000? 38800000 Let y = -51486263.45000355 - -51486265. Let l = y + -1.55. What is l rounded to 6 decimal places? -0.000004 Suppose 5 = 3l + 2, -3c + 2586 = -3l. Suppose 3x - 4w + 771 - 21446 = 0, 0 = -3x + 2w + 20677. Suppose 0 = 3u + c - x. Round u to the nearest 100. 2000 Let k = -287.95027517 + 287.95. What is k rounded to four d	{ "pile_set_name": "DM Mathematics" }
f - 1. Let y be p(-4). Suppose -3q - y - 74 = 0. Let h = -12 - q. List the prime factors of h. 3, 5 Let l = -3 + 68. Suppose 3c - l - 7 = 0. What are the prime factors of c? 2, 3 Let i = -44 - -68. Let n(x) = x*3 - 4x*2 - 2x + 2. Let l be n(3). Let b = i + l. List the prime factors of b. 11 Suppose -4c + x - 41 = -2x, -3x + 30 = -3c. Let l = c + 22. Let m = l + -5. What are the prime factors of m? 2, 3 Let z(m) = m + 1. Let c(g) = g + 2. Let b(q) = 2c(q) - 3z(q). Let k be b(-2). Suppose -6 + 63 = 4x + j, -3x + 36 = kj. List the prime factors of x. 3, 5 Suppose 0 = 4f - o - 209, -2f + 7f + 2o = 245. What are the prime factors of f? 3, 17 Let b = -159 - -293. List the prime factors of b. 2, 67 Let p(n) = n3 + 3n*2 - n + 1. Let c be p(-3). Let f be 9/2 + (-2)/c. Suppose -12 + f = -4y. List the prime factors of y. 2 Let k = -29 - -48. Suppose 0 = 5u + 5r - 40, 0u + 2r = -3u + k. What are the prime factors of u? 3 Suppose 4n = -2t + 38, -5n + 36 + 7 = -2t. Suppose -5b + nb - 148 = 0. List the prime factors of b. 37 Let b(z) = z2 + 7z - 10. Let q be b(-7). What are the prime factors of q/(-50) - (-358)/10? 2, 3 Let b(d) = d + 4. List the prime factors of b(0). 2 Suppose -4g - g - 5 = -o, -4g = 4o - 20. Let w = 14 + g. What are the prime factors of w? 2, 7 Let l be -13/(3/3). What are the prime factors of ((-6)/4)/(l/4)? 2 Let n(t) = 2t + 20. Let v = -16 + 16. List the prime factors of n(v). 2, 5 Suppose 6w - 2w = 292. What are the prime factors of w? 73 What are the prime factors of 314/632? 2, 157 Let c = -13 - -8. Let q be (-47)/(-7) - 6/(-21). Let y = q + c. What are the prime factors of y? 2 Suppose -20 = a - 5a. Suppose -aq = -q - 36. What are the prime factors of q? 3 Suppose -3z = -4i + 25 - 9, 2z + 10 = 3i. Let b(t) = -t3 - 8t*2 - 6t - 3. Let q be b(z). Suppose -2w - q = -5w. What are the prime factors of w? 3, 5 Let l(k) be the third derivative of k5/12 - k3/6 + 2k2. Let g be l(-1). Suppose c = -c + 5i + 42, i + g = 0. What are the prime factors of c? 11 Let w(f) = 2f + 41. What are the prime factors of w(-6)? 29 Suppose l + 3l = -b + 40, 3l = b + 37. What are the prime factors of l? 11 Let f(d) be the third derivative of d5/30 + d4/24 + d3/6 + 2d2. What are the prime factors of f(-3)? 2 Let c(s) be the first derivative of -s3/3 - 4s2 + 3s + 1. What are the prime factors of c(-7)? 2, 5 Let u = 655 - 374. What are the prime factors of u? 281 Let l be 20/5 - (-29 - 1). Let h be 0/(-1)(-3 + 2). Suppose -2s + hs + l = 0. List the prime factors of s. 17 Let s(g) = -g3 - 7g*2 - 7g - 7. Let r be s(-6). List the prime factors of -2 + r + 2 + 22. 3, 7 Let q be (-2)/10 + (-199)/5. Let f be (6/(-2))/(12/q). Suppose -5a - 10 = f, -3a = 5n - 38. What are the prime factors of n? 2, 5 Let m(w) = 4 - 4 - 4w. Let b be m(-2). Let p = 16 - b. List the prime factors of p. 2 Let t(a) = 2a3 - 1. Let g be t(-1). What are the prime factors of 28 + -2 + 3 + g? 2, 13 Let c(n) = 2n*2 - 11n - 25. Let a(z) = z*2 - 6z - 13. Suppose -3b = -b + 12. Let o(d) = bc(d) + 11a(d). List the prime factors of o(0). 7 Suppose 13 = 2f + 1. What are the prime factors of f? 2, 3 Let i(d) = d*3 + 4d*2 - 10d - 8. Let z be i(-6). Let q = -12 - z. List the prime factors of (q + -2)/((-3)/(-4)). 2 Suppose a = 5a - 8. Suppose -3i + 75 + 45 = -2w, aw = 0. Suppose -l - i = -6l. What are the prime factors of l? 2 Let g(d) = -d2 - 28d + 3. What are the prime factors of g(-24)? 3, 11 What are the prime factors of -4(-4)/(-12)138/(-2)? 2, 23 Let y be (6/5)/(1/5). Suppose v - 5 = yv + 5r, 3r = -2v - 7. What are the prime factors of v/(-6) - (-76)/6? 2, 3 What are the prime factors of (-1)/((-15)/6 - -3) - -207? 5, 41 Let l(w) = 7w3 + w2 - 5w + 2. Let b(n) = 10n3 + n2 - 8n + 3. Let u(o) = 5b(o) - 7l(o). List the prime factors of u(4). 13 Let t(i) = i3 - i2 - i + 1. Let j be t(0). Let n = -1 - j. List the prime factors of 1/(33/15 + n). 5 Let x(j) = -j*3 - 4j*2 + 5j + 3. Let s be x(-5). Let l = s + 1. What are the prime factors of l? 2 Suppose 4g - 3g - 4 = 0, -16 = 2n - 5g. Let a be (-94)/(-14) - n/(-7). Suppose a = -5d + 77. List the prime factors of d. 2, 7 Suppose 5z + 3 = -3o, 0 = -4o + 5z - 1 - 3. Let c = 1 + o. Suppose c = -3x + 4t + 33, 4x - 2x + t = 11. List the prime factors of x. 7 What are the prime factors of 1(4/(-1) - -117)? 113 Let u(q) = q*2 + 10q - 4 - 2q2 + 0q*2. List the prime factors of u(7). 17 Let h = 9 - 6. Suppose -z - 2z + hj = -54, 0 = -j - 3. What are the prime factors of z? 3, 5 Let g = -14 + 43. Let c = g + -18. What are the prime factors of c? 11 Suppose p - 12 = -2p. What are the prime factors of p? 2 Let l = -2 + 12. Suppose -2u = 3u - l. Suppose -u = -4i + 10, -4t + i = -13. List the prime factors of t. 2 What are the prime factors of (7 - 2) + 134 + 6? 5, 29 Let u be 4/18 + (-1770)/(-54). Let s = u + -16. What are the prime factors of s? 17 Let i(l) = -l*3 + 9l*2 + 13l - 13. List the prime factors of i(10). 17 Let j(t) be the first derivative of -t*2 + 4t + 3. List the prime factors of j(-4). 2, 3 Let j(a) be the second derivative of a7/2520 - a6/180 + a5/120 + a4/12 - 2a. Let r(m) be the third derivative of j(m). List the prime factors of r(5). 2, 3 Let j = 79 - 34. List the prime factors of j. 3, 5 Let t(g) = -8g - 7. Let z(x) = -7x - 6. Let q(r) = 6t(r) - 7z(r). Let a be q(2). Let i = a + 0. List the prime factors of i. 2 Suppose 18g = 13g + 425. What are the prime factors of g? 5, 17 Let u = -21 + 39. List the prime factors of u. 2, 3 Let t be (-1 + 2)/(0 - -1). Let z = 3 + t. Let v = z + 1. What are the prime factors of v? 5 Let m be (-40)/2540/(-2). Let b be m - 0 - (1 - 1). Suppose 4k - 8 = b. List the prime factors of k. 2, 5 Suppose 3y - 2y = 26. List the prime factors of y. 2, 13 Suppose -5w + 1473 = -2j, -10w + 11w = -2j + 297. List the prime factors of w. 5, 59 Let v = 1 - -2. Let x = v - -10. Let r = 23 - x. What are the prime factors of r? 2, 5 Let y be (6/5)/(1/5). Let p(z) = z + 3. Let m be p(y). Suppose 6u - m = 5u. List the prime factors of u. 3 Suppose v + 3m - 408 = -2v, 3m - 672 = -5v. List the prime factors of v. 2, 3, 11 List the prime factors of (-3 + 1 - 28)-1. 2, 3, 5 Let o be 1 + 2 + (-1 - -2). Suppose -4x + 2u = -22, 5u + 1 = 4x - 3x. Suppose 2v = -ot + 36, -3t + 4t = v - x. What are the prime factors of v? 2, 5 Suppose -4x + x + 15 = 0. Suppose -3q + q + 71 = xv, 0 = -5v + 3q + 81. List the prime factors of v. 3, 5 Let y(o) = -21o3 - o2 - 2o. Let f be y(-1). Suppose -6 = s - f. What are the prime factors of s? 2 Let q = 11 - 4. Let l(x) = 5x + 4x - 2x2 + x3 - 8 - 6x2. What are the prime factors of l(q)? 2, 3 Let s = -9 + 13. List the prime factors of 466/8 + s/(-16). 2, 29 Suppose -3u - 24 = 3. Let h(c) = c*2 + 9c + 4. Let w be h(u). Suppose -7i + 42 = -wi. List the prime factors of i. 2, 7 Let a(o) = 3o - o + 2o - 5o. Let s = -6 + 0. What are the prime factors of a(s)? 2, 3 Suppose 4d = d + 6. Suppose -7 = -y - d. List the prime factors of y. 5 Let m(y) = -y*2 + 8y - 2. Let z(t) = -t + 8. Let b be z(6). Suppose 5v = -4q + 10, 4q + 8 = -bv - 0v. List the prime factors of m(v). 2, 5 Suppose -2b = d - 110, -74 = -d + b + 39. What are the prime factors of d? 2, 7 Let g(p) = 3p - 1. Let t be -7 - (0 + (-3 - -2)). Let k be (-16)/t(-6)/(-4). What are the prime factors of g(k)? 11 Suppose 5u = 25, j - 3u = 2u + 36. List the prime factors of j. 61 Let d(k) = -k + 8. Let c(n) = 4. Let v(j) = 11c(j) - 6d(j). What are the prime factors of v(2)? 2 Suppose -p - 2p + 24 = 0. Let c = p - -2. Suppose 3i - 70 = -c. What are the prime factors of i? 2, 5 Let f be (14/(-5))/((-2)/5). Let v(x) = -x2 + 9x - 10. List the prime factors of v(f). 2 Suppose -4m - 3 = 1. Let r(a) = -6a + 1. What are the prime factors of r(m)? 7 Suppose -136 = -5x + 274. List the prime factors of x. 2, 41 List the prime factors of (-4)/(-18) + 1452/(-27)-1. 2, 3 Suppose 4m - 3w = 1072, 3m + 273 = 4m - 2w. What are the prime factors of m? 5, 53 Let f(c) be the third derivative of c5/20 - c*4/8 - 2	{ "pile_set_name": "DM Mathematics" }
ominator of (-1)/((-84)/914) - 48/(-168) and d. 30 Suppose -2k - 3k - 80 = 0. Find the common denominator of ((-4)/k)/((-1)/65) and -13/20. 20 Let n(i) = 9i + 1. Let c(l) = 5l. Let o(m) = -11c(m) + 6n(m). What is the lowest common multiple of o(-5) and 6? 66 Let y(l) = l*3 + 4l2 - 3. Let x be y(-4). Let g(h) = -h2 - 4h + 5. What is the lowest common multiple of 1 and g(x)? 8 Let q = 94299/14 - 6730. Find the common denominator of q and -75/304. 2128 Let o(t) = -2t*2 - 46t + 20. Suppose -3j = -4 - 26. What is the smallest common multiple of j and o(-23)? 20 Let o = -4517 - -6409. What is the smallest common multiple of o and 18? 17028 Suppose 3y - 10 = 4f - 106, -5f + 64 = -2y. What is the common denominator of y/(-48) - (-17)/24 and (-6)/9 + (-83)/18? 72 Let b = -2861 + 2873. Suppose 4z = -5j - 1 + 57, -2j + 8 = -2z. What is the least common multiple of b and j? 24 Let c(d) = -11d - 113. What is the smallest common multiple of 22 and c(-29)? 2266 Let h(t) = 3t2 + 21t - 7. Let y(x) = -2x2 - 11x + 3. Let o = 24 - 19. Let p(w) = oy(w) + 3h(w). Calculate the lowest common multiple of p(6) and 4. 12 Let u = 1 - -2. Calculate the smallest common multiple of u and (-708)/(-156) - (-60)/130. 15 Suppose 6 = 4j - 18. Let p be 14(4 + (-21)/j). Calculate the least common multiple of ((-46)/6)/(p/(-42)) and 16. 368 Suppose -3h + 1178 = 4l, 291 = -4l + 5l - h. Let x = l - -124. What is the common denominator of -41/16 and (x/24)/(3/(-4))? 48 Suppose -448 = -c + 3o - 69, -2c = 4o - 768. What is the common denominator of c/(-63) - (15/21 - 1) and -87/2? 18 Find the common denominator of (-575)/(-165) + (-2)/(-6) and -46/7. 77 Let h = -3 - -12. Let r = -165 + 200. What is the smallest common multiple of r and h? 315 Suppose 0 = -n - 5n + 24. What is the smallest common multiple of 33/n + (-10)/40 and 12? 24 Suppose s + 15 = 4s. Let w(v) = -v3 - 5v2 + 4. Let k be w(-5). Let c(g) = -g3 + 5g2 - 2g - 2. What is the least common multiple of c(k) and s? 30 Let o = 2101 - 12703/6. Calculate the common denominator of -67/234 and o. 234 Let k = 540 + -535. Suppose 3l + 2x + 114 - 44 = 0, -2x = l + 26. Let z = l + 32. Calculate the lowest common multiple of k and z. 10 Let i(y) = 6y - 3 - 1 - y*2 - 1. What is the smallest common multiple of i(4) and -1 + 1 + 3 + 0? 3 Suppose 0 = b - 8 - 4. Suppose -509z + 494z = -30. Calculate the least common multiple of b and z. 12 Calculate the common denominator of 1995/430 - (1 + (-20)/(-8)) and 65/9. 387 Let u be (-91)/(-26) - 3/2. Calculate the lowest common multiple of (242/(-77))/(u/(-14)) and 20. 220 Let i = -495 - -507. Calculate the least common multiple of 30 and i. 60 Let v = -973 - -2001/2. Find the common denominator of v and 1 + -4 + (-75)/(-27). 18 Let t(m) = 4m*2 + 1. Let f be (-2)/(-3) + (-14)/(-6). Suppose 5q - y - f = 0, -q - 2y + 3 = -2q. What is the least common multiple of 12 and t(q)? 60 Let j = -14312 + 858751/60. Calculate the common denominator of j and -35/16. 240 Suppose x = 3q - 21, 0 = -2x + 6x - 12. Calculate the least common multiple of q and 30. 120 Let r = -28 + 32. Suppose -f = -4n + 7082, -rn - 2f = 2868 - 9944. Let c = n + -3629/2. Calculate the common denominator of 21 and c. 2 What is the smallest common multiple of ((-324)/(-7))/(((-42)/(-7))/42) and 44? 3564 Let r = 45314 - 3353293/74. What is the common denominator of r and -117/10? 370 Let a = -1234 + 17285/14. Calculate the common denominator of a and 73/32. 224 Calculate the common denominator of 2/21 and 37 + -37 + 3/((-234)/11). 546 Let g = -158 + -2581. Let p = -664356 - -4002689/6. Let u = g + p. What is the common denominator of u and 44/5? 30 Let h = 2 + 1. Let f(y) be the first derivative of 5y2/2 - y + 25. What is the least common multiple of 6 and f(h)? 42 Suppose 0 = 2p + 5f + 13, 5p - 2p + f + 13 = 0. Let d be p/(-5)(-10)/(-4). Suppose 0 = -0g + dg - 4. Calculate the least common multiple of g and 6. 6 What is the smallest common multiple of 9/1(-6)/(-18) and 92? 276 Find the common denominator of (-2 + 1)15/(585/(-169)) and -55/56. 168 Let a be ((-2)/4)/(2/4). Let n = -1782/5 - -12339/35. Find the common denominator of a + -1 - 154/8 and n. 28 Let u = 7 + -5. Let w be (-110)/25 + u/5. Calculate the lowest common multiple of (-2)/w(-28)/(-2) and 5. 35 Let d be (-16)/(-1) + (9 - 11). Let i = -13 + d. Calculate the smallest common multiple of i and 7. 7 Let h = -178853/28 - -6390. Calculate the common denominator of 5/14 and h. 28 Let t = 24190000061 - 923332302383901/38170. Let j = t - -1/3470. Calculate the common denominator of j and (-62)/6 + 14/1899. 33 Let r(p) = -p - 14. Let a be r(-7). Let q(v) = v*3 + 8v*2 + 1. What is the smallest common multiple of 8 and q(a)? 200 Calculate the lowest common multiple of (-14)/4(29 - 31) and 8. 56 Let d(m) = m*2 + 10m - 27. Let o be d(-11). Suppose -6s + s = -120. Let p = o + s. Calculate the lowest common multiple of p and 16. 16 Let y be (4 - 5)7930 - -3. Let u = -12944 - y. Let c = -40079/8 - u. What is the common denominator of c and -25/14? 56 Let w = -157 - -185. Calculate the least common multiple of 10 and w. 140 What is the lowest common multiple of 4 and (-14 + 1)/(59/(-413))? 364 Let c = 1793 - 1781. What is the smallest common multiple of c and 56/36/4? 84 Suppose 0w - 5w + 5 = 0. Let g be 26/10(-10)/(-2). Let h = g - w. Calculate the least common multiple of h and 12. 12 Let m(v) = 10v3 + v2 - v. Let c be m(1). What is the lowest common multiple of 8 and 20/824/c? 24 Let q(g) = -g*3 + 2g*2 + 12g + 19. What is the least common multiple of q(-3) and 124? 868 Let w(u) = -u*2 + 6u + 15. Suppose -8q + 37 + 19 = 0. Calculate the smallest common multiple of 26 and w(q). 104 Let d = 1573/3 + -516. Find the common denominator of d and -25/21. 21 Let b(z) = 10 + 13 + 9z + 6z - z2 - 29. Suppose 4c = 4w + 16, -3c + 4w - 4 + 16 = 0. What is the smallest common multiple of b(6) and c? 48 Let d = -2000 + 63995/32. Let x = 813/224 - d. Find the common denominator of -77/8 and x. 56 Let b be (-1)/(4/(-26) - 6/(-208)). Suppose -m - 3u + b = 2u, 32 = 4m - 4u. Calculate the lowest common multiple of 2 and m. 8 Let n(g) = -g3 + 6g*2 + 10g - 35. Calculate the smallest common multiple of n(3) and 666. 7326 Suppose -2m - 3y - 3 = 0, -2m + 3y + 7 = -8. Suppose -mk + 144 = 5k. What is the lowest common multiple of k and 8? 72 Let o = -3/275 + 5231/550. Find the common denominator of o and 79/16. 16 Suppose 5n = 3n - 10, o - 3n - 25 = 0. Suppose 2j - 16 = -2j. Suppose 4 = -jz + 44. Calculate the smallest common multiple of z and o. 10 Suppose -4j + 2d = -6j + 20, -5j = -4d - 68. Suppose 0 = -h + j - 4. Calculate the smallest common multiple of 11 and h. 88 Let s(l) = 2l*2 + 2l - 4. Let x(o) be the first derivative of -o*2 + 2o + 21. Calculate the lowest common multiple of s(-3) and x(-7). 16 Let w = -6212203/6163038 + 2/48913. What is the common denominator of -76/9 and w? 126 Suppose p - 8 = 1. Suppose 0 = q + 70 - 79. What is the lowest common multiple of p and q? 9 Let l = -25 + 33. What is the least common multiple of 14 and l? 56 Let z = 23 - 20. Suppose 0 = za + 14 - 50. Calculate the least common multiple of a and 3. 12 Let m = 151 - 223. Find the common denominator of -6(-2)/80(-2100)/m and -133/24. 24 Let n = 55 + -61. Let p = -2 + -2. What is the smallest common multiple of 22 and (p/n)/((-1)/(-3))? 22 Let h = -1 + 9. Calculate the smallest common multiple of h and -4 + (-44)/(-8) + (-301)/(-14). 184 Suppose 234s - 308 = 223s. Let p = 52 - 32. Calculate the smallest common multiple of s and p. 140 Let j = 293159/450 + -5872/9. Calculate the common denominator of -51/5 and j. 50 Suppose j + 2s + 3 = 0, -s + 4s = -5j - 15. Let u be (-5)/j + (-4)/(-12). What is the least common multiple of u - 2/((-6)/21) and 10? 90 Suppose 4s - 32 = -8. Find the common denominator of 13/18 and s/4 + (-14)/3. 18 Suppose -5d - 20 = 0, 3t - 5d + 0d = -34. Calculate the common denominator of 14/9 - -26/t and -64/15. 45 Let j be (8/5 - 2)/((-1)/(-50)). Calculate the common denominator of (-4)/6 - (-598)/(-12) and ((-228)/144)/((-2)/j). 6 Let g =	{ "pile_set_name": "DM Mathematics" }
n(-12). 7 Let d(f) = -2f2 - 1484f - 170181. What is d(-142)? 219 Let h(i) = -225i + 9052. Determine h(55). -3323 Let y(l) = l3 - 75l*2 + 129l + 41. What is y(2)? 7 Let l(t) = 36t3 - 5t*2 + 4t. Calculate l(-1). -45 Let c(r) = 330022r - 22771517. Determine c(69). 1 Let h(l) = -1500l - 13416. Calculate h(-9). 84 Let u(w) = w*2 + 3510w + 2065966. Give u(-748). -10 Let p(d) = 10d2 - 1054d + 4431. What is p(101)? -13 Let k(u) = -u*2 - 8616u - 521807. Calculate k(-61). 48 Let c(f) = 3370f + 1209747. Give c(-359). -83 Let k(s) = s3 - 4s*2 + 123s - 769. Give k(6). 41 Let c(f) = -2f3 + 45f*2 + f + 562. Calculate c(23). 56 Let l(t) = -596t + 3063. Determine l(6). -513 Let i(y) = -93y2 - 34y - 38. Determine i(-1). -97 Let m(w) = 16w2 + 6158w + 48204. Give m(-8). -36 Let g(r) = -1345r + 1920. Calculate g(2). -770 Let f(s) = -10s*2 + 690s - 2036. What is f(3)? -56 Let h(f) = -f*3 - 19f*2 - 309f - 4787. Determine h(-17). -112 Let c(b) = -2b3 + 90b*2 - 521b + 679. Give c(2). -19 Let a(o) = 8o2 + 1591o + 5654. Calculate a(-195). -391 Let m(o) = -o*3 + 246o*2 - 2802o - 104. Determine m(12). -32 Let m(p) = -1026p + 288322. Calculate m(281). 16 Let f(z) = 248z - 32496. Calculate f(131). -8 Let h(i) = 5i2 - 6480i + 25909. What is h(4)? 69 Let s(w) = -2w3 + 3w*2 - 8w + 74. Give s(9). -1213 Let y(x) = -227x + 10928. Calculate y(48). 32 Let c(q) = q3 + 28q*2 - 548q - 575. Calculate c(-41). 40 Let z(j) = -j*2 - 163j - 3517. Give z(-29). 369 Let b(n) = 118n - 9169. Determine b(76). -201 Let i(z) = 172z*2 + 5211z + 5208. Calculate i(-1). 169 Let o(h) = -277h + 21544. Calculate o(78). -62 Let f(x) = 5x*2 - 869x - 10971. What is f(-13)? 1171 Let y(l) = 445l - 11088. What is y(24)? -408 Let l(t) = -207989t + 1663958. What is l(8)? 46 Let l(d) = d*3 - 217d*2 + 2271d - 1484. Give l(206). -454 Let q(o) = 2o2 - 162o + 1784. Determine q(72). 488 Let j(w) = 38w3 + 949w*2 - 28w - 91. Determine j(-25). -16 Let t(n) = 131n2 - 850n + 5190. What is t(6)? 4806 Let t(a) = 8a2 - 298a + 1130. What is t(31)? -420 Let d(q) = -2q2 + 876q - 22263. Give d(27). -69 Let l(x) = -10x2 + 122x + 608. What is l(16)? 0 Let c(u) = 26796u + 535933. What is c(-20)? 13 Let g(n) = -1447n - 467382. Determine g(-323). -1 Let a(s) = 36798s - 441451. Calculate a(12). 125 Let a(z) = -31z*3 - 104z*2 - 2z - 27. Calculate a(-3). -120 Let w(q) = 8q2 - 2337q + 11656. Calculate w(5). 171 Let x(a) = a*3 - 32a*2 + 163a + 5. Calculate x(20). -1535 Let i(h) = 8759h + 280286. Determine i(-32). -2 Let m(p) = 81p + 1638. Calculate m(-7). 1071 Let y(q) = q*3 - 3q*2 - 663q + 241. Calculate y(25). -2584 Let b(o) = 108746o + 34037497. Determine b(-313). -1 Let l(k) = -1879611k + 5638857. Calculate l(3). 24 Let i(h) = 143h2 - 5h - 1. Determine i(2). 561 Let n(w) = 58895w + 65667930. Determine n(-1115). 5 Let t(m) = -m2 - 1024m - 192448. Determine t(-776). 0 Let y(r) = r*3 + 58r*2 - 50r - 1965. Calculate y(-58). 935 Let o(z) = 6z2 - 719z + 21279. Calculate o(64). -161 Let p(m) = 3m3 + 95m*2 - 140m + 25. Calculate p(-33). 289 Let b(o) = -o*3 - 139o*2 + 895o + 3619. Determine b(-145). -6 Let l(r) = -71r2 + 381r + 251. Calculate l(6). -19 Let q(i) = 1822i - 189488. Determine q(104). 0 Let t(q) = -655483q + 655518. Determine t(1). 35 Let r(b) = 1109b - 4430. Calculate r(4). 6 Let o(v) = 2v*3 + 208v*2 + 590v - 359. What is o(-101)? 1257 Let l(x) = -x3 + x2 + 3982x - 4. Calculate l(0). -4 Let f(x) = -x2 - 1546x - 367075. Give f(-293). 54 Let z(b) = 11b2 - 14445b - 57805. Determine z(-4). 151 Let p(t) = 1127t - 27004. Give p(24). 44 Let k(z) = -2z*3 + 33z*2 - 120z + 1189. Determine k(15). 64 Let c(h) = 47088h - 11018595. Give c(234). -3 Let r(d) = 17d*2 - 225d - 1066. Give r(17). 22 Let k(t) = -t*3 - 169t*2 + 3993t - 71. Calculate k(21). -8 Let m(o) = o*3 - 31o*2 - 989o + 30144. Give m(34). -14 Let s(f) = 803f - 3230. Give s(4). -18 Let m(j) = j2 - 710j + 118220. Give m(444). 116 Let i(j) = 36j2 - 2315j - 29824. Determine i(-11). -3 Let s(c) = 193c2 - 10444c + 1185. Calculate s(54). -3 Let r(d) = 2161d + 140362. Give r(-65). -103 Let w(i) = 16261i + 16472. Calculate w(-1). 211 Let u(h) = -h*3 - 7h*2 - 190h - 1877. Give u(-9). -5 Let i(w) = -w*3 + 6w*2 + 208w + 232. Calculate i(-11). 1 Let v(k) = 9k2 + 445k + 1390. Determine v(-46). -36 Let j(q) = -2q3 + 76q*2 - 400q - 17. What is j(31)? 1037 Let c(y) = 8y2 + 3576y - 90597. Determine c(24). -165 Let o(b) = 922b - 10103. Calculate o(11). 39 Let k(a) = 3a*2 - 21a - 1970. What is k(30)? 100 Let j(i) = -10i2 - 1384i - 449. What is j(-138)? 103 Let p(f) = f*3 - 6f*2 - 906f + 4753. Calculate p(5). 198 Let b(d) = -939d - 47859. Calculate b(-51). 30 Let o(b) = 2b*3 - 194b*2 + 1587b - 177. Give o(88). 87 Let x(l) = 2907l + 41452. What is x(-15)? -2153 Let k(q) = -q3 + 121q*2 + 488q - 98. Give k(-4). -50 Let i(b) = b*3 - 238b*2 - 9232b + 240223. Determine i(269). 6 Let y(b) = -9b3 - 213b*2 + 216b + 3436. Determine y(-24). -20 Let d(j) = -j*3 + 184j*2 - 415j + 42460. Calculate d(183). 4 Let y(p) = 3p2 + 518p + 8439. Calculate y(-18). 87 Let o(k) = -25589k - 101110. Determine o(-4). 1246 Let d(t) = -2t*3 + 261t*2 + 1229t - 1913. What is d(135)? -23 Let t(y) = 305689y - 1222759. Determine t(4). -3 Let j(x) = x2 - 966x - 34367. Determine j(-35). 668 Let h(d) = d*3 + 114d*2 - 61235d + 9949. Determine h(-311). -3 Let m(i) = 2i3 + 49i*2 - 92i - 2959. Calculate m(-23). 744 Let x(d) = 2d2 + 11589d - 185929. Give x(16). 7 Let o(j) = -58j2 - 561j + 101. Determine o(-10). -89 Let f(l) = 17580l + 175852. What is f(-10)? 52 Let a(d) = 2d*2 + 107d - 5662. Determine a(-91). 1163 Let y(w) = 489w - 40925. Give y(84). 151 Let t(b) = -5b*2 - 40b + 1058. Calculate t(-22). -482 Let c(i) = 699i - 490. Give c(3). 1607 Let s(o) = -o3 + 7244o - 10. Give s(0). -10 Let p(v) = -97v2 - 838v + 4232. What is p(5)? -2383 Let g(x) = 1039x + 24886. Determine g(-24). -50 Let j(i) = -1146i + 194. Give j(-1). 1340 Let f(y) = y*2 + 1295y + 81092. Give f(-66). -22 Let u(l) = -l*3 + 51l*2 - 112l - 2966. Calculate u(10). 14 Let s(y) = y*3 + 51y*2 + 31y + 672. What is s(-50)? 1622 Let k(u) = -2u2 - 1894u - 255642. Determine k(-163). -58 Let j(m) = 343m - 1833. What is j(11)? 1940 Let p(o) = -o2 - 1510o - 14969. Determine p(-10). 31 Let z(i) = 24i3 + 836i*2 - 833i + 5. Determine z(1). 32 Let d(c) = -4c2 + 533c + 1577. Calculate d(-3). -58 Let p(h) = -111h2 + 93h + 161. Give p(-3). -1117 Let j(i) = -2171251i + 21712503. Determine j(10). -7 Let z(u) = 24941u - 773146. Give z(31). 25 Let u(m) = 3m2 - 110m - 2055. Determine u(-14). 73 Let q(d) = -4d2 - 74d + 1496. Calculate q(11). 198 Let k(p) = -542p - 10096. Give k(-17). -882 Let z(y) = -385y - 110851. Give z(-290). 799 Let p(m) = 183783m + 2021618. Give p(-11). 5 Let q(o) = -o3 + 48o*2 + 171o - 2716. Give q(50). 834 Let y(k) = 34k2 - 40k + 9. Determine y(-9). 3123 Let x(a) = -645a2 + 1283a + 14. Give x(2). 0 Let s(b) = -11b2 - 4663b + 4661. Calculate s(1). -13 Let r(l) = -2l3 - 8l*2 + 39l + 276. Calculate r(-9). 735 Let g(k) = 1096k2 - 351k - 6. Determine g(1). 739 Let z(f) = f*2 - 28419f - 341227. Determine z(-12). -55 Let h(b) = b*3 - 254b*2 + 1505b - 103. Give h(6). -1 Let n(l) = 3l2 + 12691l + 1227021. Determine n(-99). 15 Let o(n) = 3n3 + 1018n*2 + 1333n - 6570. What is o(-338)? -148 Let q(t) = -t*3 + 3t*2 - 525t + 3792. Calculate q(7). -79 Let z(h) = -43h2 + 40h + 321. What is z(-5)? -954 Let g(m) = -21867m + 1443251. Give g(66). 29 Let q(t) = 1326t - 3739. What is q(3)? 239 Let t(c) = 3890c + 198400. What is t(-51)? 10 Let n(q) = -2q*3 + 159q*2 + 12q + 5330. Calculate n(80). -110 Let x(s) = -5s3 + 89s*2 + 291s + 35. Calculate x(20). 1455 Let q(n) = -50n3 - 55251n*2 - 1102n + 3310. Give q(-1105). -5 Let u(w) = -w*3 - 27w*2 - 52w + 113. Calculate u(-24). -367 Let l(t) = -2t3 - 96t*2 - 86t - 32. What is l(-47)? -408 Let	{ "pile_set_name": "DM Mathematics" }
derivative of 6k5 + 3693k*4 - 1166k*2 - 200502171k wrt k? 120k3 + 44316k*2 - 2332 Differentiate 8375o*4 - 7835o*3 + 3o - 647566690 wrt o. 33500o3 - 23505o*2 + 3 What is the third derivative of -22521800o*4 - 48o*2 - 172106o? -540523200o Find the third derivative of -4139088p*3 + 7p*2 - 3p - 2307 wrt p. -24834528 What is the third derivative of -1357k3w*2 - 5k*3w - 261k3 - 1064120k*2w*2 + 74k*2 wrt k? -8142w*2 - 30w - 1566 Differentiate 1646l2o - 847l2 - 16lo - 158237447o with respect to l. 3292lo - 1694l - 16o What is the first derivative of -1052b2z*3 + 3b*2 + 2722bz + 30562z*3 - 2z*2 + 58 wrt b? -2104bz3 + 6b + 2722z Find the first derivative of -880692205v*4 - 48701948 wrt v. -3522768820v*3 Differentiate 263534581t*2 - 401419877 with respect to t. 527069162t What is the second derivative of 3g4n*2 + 850726g*4 - gn*2 - 10330gn - 5g wrt g? 36g2n*2 + 10208712g*2 What is the third derivative of -6701618d*6 + 3501134d*2 wrt d? -804194160d*3 Find the second derivative of 3261366m*4 + 7m*3w + mw - 3370896 wrt m. 39136392m*2 + 42mw What is the second derivative of 17a*2m*5 + 1078239a*2m*2 + 29013a*2m + 2a2 + 11am - 1 wrt m? 340a*2m*3 + 2156478a*2 What is the third derivative of 849q*6 - 16q*5 + 698q*3 - 1219q*2 - 33q - 14? 101880q3 - 960q*2 + 4188 What is the third derivative of 26773d*2k*3m*2 + 38d*2k*2m*2 + 4dk3m*3 + dk*2m*2 - 11k*2m*3 + 55m*2 wrt k? 160638d*2m*2 + 24dm3 Find the third derivative of -20086af2j*3m - 3afjm - 4aj*2 - 26aj - 15f*2m - 101fj*3m wrt j. -120516af*2m - 606fm Find the first derivative of 166957833s + 31307663 wrt s. 166957833 What is the third derivative of -152608294s*4 + 10514778s*2 wrt s? -3662599056s Find the second derivative of 57781505o5 + 83049880o wrt o. 1155630100o3 What is the second derivative of -566412f*2 - 223f + 1240 wrt f? -1132824 Find the third derivative of 296300226n5 - 203n*2 + 10678n - 2 wrt n. 17778013560n2 What is the first derivative of 3480103f - 12982011? 3480103 Find the second derivative of -63387767r2 - 566075513r wrt r. -126775534 Find the third derivative of -811129607p3 - 500128229p*2 wrt p. -4866777642 Differentiate -149505848k*3 - 198196365 wrt k. -448517544k*2 Find the first derivative of 7708441a*3 + 8291264 wrt a. 23125323a*2 Find the second derivative of 707359879k*2 - 14576903k - 24. 1414719758 Find the third derivative of -11or*4 + 82029or3 + 24or2u + 4or*2 + 2or + 7788ou - 2r*4u wrt r. -264or + 492174o - 48ru Find the third derivative of 105131738y*6 - 3y*2 - 109370y - 2. 12615808560y3 What is the second derivative of -37fl2 - 31905029fl + l3 + 7338l*2 wrt l? -74f + 6l + 14676 What is the second derivative of -14787k*5w - 11831k2w + 230228888kw wrt k? -295740k3w - 23662w What is the third derivative of 9414614o*5 + 4680o*2 - 1301o? 564876840o2 Find the second derivative of -177418076q*2y*2 + 9217q*2y + 58657y wrt y. -354836152q*2 What is the derivative of 17381915t*4 - 13927177 wrt t? 69527660t*3 Find the third derivative of 83158652v*4 - 3v*3 + 697445199v*2. 1995807648v - 18 Differentiate 148993891tz + 12827446t with respect to z. 148993891t Differentiate 378204726x + 404798776 with respect to x. 378204726 What is the second derivative of 49q*2w*2z - 33069q2w*2 - 2q*2w - 17qw*2 + 2qwz + 3qz - 3q + 2w*2z - z - 98 wrt q? 98w2z - 66138w2 - 4w Find the second derivative of 160608041c2d*4 - 44384c*2d + c*2 + 2d*4 - 333d wrt d. 1927296492c2d*2 + 24d*2 What is the first derivative of -13124341b*4 - 2b*2 + 2337352 wrt b? -52497364b*3 - 4b What is the second derivative of 98995h3q + 3h3 - 2h*2q - 19h2 - 7hq + 22h + q + 1037 wrt h? 593970hq + 18h - 4q - 38 What is the third derivative of -16742c6 - 60c*4 - 169c*2 + 6818c - 2? -2009040c3 - 1440c What is the first derivative of 3ju*2w + 524508juw2 - 236078u*2w*2 + 9uw2 - w2 wrt j? 3u*2w + 524508uw*2 Find the first derivative of 41631h*2 - 97h - 2155460. 83262h - 97 What is the second derivative of 53f*4 - 2f*3 + 14438f*2 + 16314626f wrt f? 636f2 - 12f + 28876 What is the third derivative of -438l6 - 44227l5 - l2 + 13101397l? -52560l*3 - 2653620l*2 What is the second derivative of -76ch2w - 11484ch*2 + 5cw + c + 39h*2w - 43hw + 2h - 19311w wrt h? -152cw - 22968c + 78w Find the first derivative of 98985rs + 137r + 55009489s wrt r. 98985s + 137 Find the third derivative of -741k*4 - 3803k*3 + 9998999k*2. -17784k - 22818 Find the first derivative of -5u4 + 3060914u*2 - 27379360 wrt u. -20u*3 + 6121828u Find the third derivative of 9545265h3n*3 - 13h*2n*3 - 739h*2n + n*3 - 10 wrt h. 57271590n*3 Find the second derivative of -19490994i*5 - 2299i + 532. -389819880i3 What is the third derivative of -12637998x*3 - 127612860x*2? -75827988 Find the third derivative of -26oz4 + 24oz3 + 13178o - 2z4 - 69z*3 + 135z*2 wrt z. -624oz + 144o - 48z - 414 Find the third derivative of 59439akq*3 + 2akq + 1721aq*3 + 4aq2 + 24a - k - 18563q2 + 3 wrt q. 356634ak + 10326a Differentiate i*2o*2 - 211i*2o + 9480i2 + io + 1796i + 2319o + 1 wrt o. 2i2o - 211i2 + i + 2319 What is the third derivative of -228458333a*4 - 105613134a*2? -5482999992a Differentiate -2mr*3 - mr + 11279517m + 425344r*2 wrt r. -6mr2 - m + 850688r What is the third derivative of -2123569q4 + 42685393q*2 wrt q? -50965656q Find the third derivative of -170603v3x*3y*3 - 207v*3x*3 + 2v*2x*3y*3 + 14v*2x*2y - 1890v2y*3 - 64x*3y*2 - 2xy3 wrt v. -1023618x*3y*3 - 1242x*3 What is the first derivative of -957996g*3z*3 + 9g*3z*2 + 23048667g*3 wrt z? -2873988g*3z*2 + 18g*3z What is the second derivative of -26587143i3 - i2 - 77908574i? -159522858i - 2 What is the third derivative of 300687y*6 - 138y*4 - 2y*3 + 11124y*2 - 823y - 7? 36082440y3 - 3312y - 12 Find the second derivative of 34h4 - 31214h*3 + 18h*2 - 67151912h wrt h. 408h2 - 187284h + 36 What is the second derivative of 8873094x5 + x - 37604 wrt x? 177461880x*3 Differentiate 2331r*3 - 568r*2 - r + 21568707 wrt r. 6993r*2 - 1136r - 1 What is the third derivative of 103n6 + 63935n*5 - 4n*3 + 14n*2 + 2252n + 1157? 12360n3 + 3836100n*2 - 24 Find the second derivative of -637m*2q5 - m2q - 10647m*2 - 2mq - 9910q*5 + 4 wrt q. -12740m*2q*3 - 198200q*3 Find the third derivative of -179973q*3y*4 - 2569q*3 + 88q*2y*2 + qy*2 - 35y*6 wrt y. -4319352q*3y - 4200y3 What is the third derivative of -61188233s*4 - 183s*2 - 2s - 22307? -1468517592s What is the third derivative of -189824380y*3 + 146608301y*2 wrt y? -1138946280 What is the derivative of -19n*3 + 26470n*2 + 18n - 170391300 wrt n? -57n2 + 52940n + 18 Find the second derivative of -353164654z2 - 48779395z. -706329308 Differentiate 840g2nt + 905g*2t*2 + gt*3 - 2gt2 - nt*3 + 207n - 760t3 with respect to n. 840g*2t - t*3 + 207 Find the second derivative of -182777938j*2t*2 + 2j*2t + 8j2 - 200724jt + 2j - 2 wrt t. -365555876j2 Find the second derivative of 91698467x*3 - 528487x - 91 wrt x. 550190802x Find the second derivative of -4k*2z*3 - 1278k*2 + 10761286kz5 - 5k + 3550z wrt z. -24k*2z + 215225720kz*3 Find the first derivative of 887w*4 - 7w*3 + 11w*2 + 6w - 252363665. 3548w3 - 21w*2 + 22w + 6 What is the third derivative of -32374354a4 - 39264a*2 + 80 wrt a? -776984496a Differentiate -1506grw - 276gr + 4gw - 2123g - 545rw - 3r - w wrt w. -1506gr + 4g - 545r - 1 Find the second derivative of -29r*4 + 148r*3 + 526r*2 + 34785120r - 2. -348r2 + 888r + 1052 Find the first de	{ "pile_set_name": "DM Mathematics" }
sor of j and r? 7 Suppose -5d + 34 = -3f - 163, 0 = 2d + 5f - 85. Calculate the greatest common factor of d and 120. 40 Let z = -981 - -1165. What is the greatest common factor of z and 230? 46 Let d be (4/(-10))/(((-35)/(-75))/(-7)). Let z = 7 + -2. Suppose -2q + z + 1 = 0. Calculate the greatest common factor of d and q. 3 Suppose -3g = p + 6, -4g - g = 3p + 2. Let o = 5172 + -5070. Calculate the highest common factor of p and o. 6 Suppose -4a - a = 0, 2a - 20 = -5m. Let o be (-1)/(2/m-2). Calculate the greatest common factor of o and 5. 1 Suppose -3r = 2r - 155. Let y = 38 - r. Let i be 107/3 + 8/(-12). Calculate the highest common divisor of i and y. 7 Let c(g) = 2g2 - g - 15. Let z be c(5). Let n = 42 + z. Let i = 16 - 7. What is the greatest common divisor of n and i? 9 Let r be -5 + 1 - (-10 + 5). Suppose 5 = 3j - r. Calculate the highest common factor of j and 16. 2 Let l be 387 + 1 + (5 - 3). What is the highest common divisor of 156 and l? 78 Let q(k) = -1224k3 - k2 + k + 2. Let o be q(-1). What is the greatest common divisor of 72 and o? 72 Let m(b) = b3 - 7b*2 - 12b - 18. Let q be m(9). What is the greatest common factor of 324 and q? 36 Let s(t) = -138t - 8. Let a be s(-3). Calculate the highest common factor of a and 14. 14 Let j = 369 - 315. Calculate the greatest common factor of j and 702. 54 Suppose -2b + 8 = -g + 3g, 2b + 4 = g. Suppose 2p - 135 = -3r, -3r + gr - 5 = 0. Calculate the greatest common factor of p and 36. 12 Suppose 2g + 415 = 5j - 38, 3g = -j + 94. What is the greatest common divisor of 247 and j? 13 Suppose m - 6 = -3. Suppose 8w - mw - a = 139, 0 = 2w + 4a - 38. Calculate the greatest common divisor of w and 3. 3 Suppose -2i = z - 40 - 14, z - 74 = 2i. Suppose -s + z = -44. What is the greatest common factor of 27 and s? 27 Let v(b) be the second derivative of b4/12 + b3/6 - 19b*2/2 + 2b. Let u be v(6). Let z = 32 - u. What is the highest common divisor of 3 and z? 3 Let o(a) = 2a3 - 5a*2 - a + 8. Let j be o(2). Let y be 0 + 0 - (-14 + -2). What is the highest common divisor of j and y? 2 Suppose -6g = -1357 - 605. What is the greatest common factor of 3 and g? 3 Suppose 0 = 3z + o - 1172, -z - o - 4o = -400. What is the highest common factor of z and 312? 78 Let b = 754 + -748. Let m = -1 - -4. Calculate the greatest common factor of m and b. 3 Let x = 58 + -25. Calculate the highest common divisor of 22 and x. 11 Let w(z) = 3z2 + 15z - 8. Let a be w(-6). What is the greatest common factor of a and 2810? 10 Suppose 3w = 4l + 21, 4w - 3w + l = 0. Suppose 0 = -0g + wg - 81. Suppose -2j + 71 = -g. Calculate the highest common factor of 7 and j. 7 Let z be (44/(-3))/((-28)/1050). Calculate the greatest common factor of 50 and z. 50 Suppose 0 = 97a - 82a - 585. Calculate the highest common factor of 13 and a. 13 Suppose 3s - 2f = 1772, 5s + 10f = 9f + 2936. Calculate the greatest common factor of 336 and s. 84 Suppose k + 2n - 24 = -0, -168 = -5k + 2n. Let f be (-190)/(-6) + k/24. Calculate the highest common divisor of f and 11. 11 Suppose 116 = 3s - a, 3s + 5a = 5s - 99. What is the highest common factor of s and 111? 37 Suppose 9y = 9183 + 11328. What is the greatest common divisor of y and 53? 53 Let a(h) be the second derivative of -h5/10 - h4/2 - 3h3/2 - 7h*2/2 + 29h. Let l be a(-3). Calculate the greatest common divisor of 160 and l. 20 Let y be (121/44)/((-2)/(-40)). Let d = -73 - -95. Calculate the greatest common factor of y and d. 11 Let t = -2 + 10. Suppose tq = 5q - 198. Let s = 92 + q. Calculate the highest common divisor of 156 and s. 26 Suppose 5v - 119 = 156. Let m(l) be the third derivative of -l6/120 + l5/15 + l3/3 - l2. Let i be m(3). What is the highest common factor of i and v? 11 Suppose -25 + 327 = 3b - 2d, 5b + 3d = 516. Calculate the greatest common factor of b and 6. 6 Let q = 131 - 201. Let b be q/(-1) + (7 - 8). What is the greatest common divisor of b and 46? 23 Suppose 6o = -o - 28. Let f be (15(-7 + 6))/(1/o). Calculate the greatest common factor of 100 and f. 20 Let g = 274 + -114. Let u = -71 - -111. Calculate the greatest common factor of g and u. 40 Suppose -74a + 528 = -26a. What is the greatest common factor of a and 209? 11 Let u = 127 + -120. Let t be ((-168)/(-48))/((-1)/(-54)). What is the highest common factor of u and t? 7 Let t be (-2)/((-6)/(-15)) + 9. Let l(c) = c - 2. Let a be l(5). Suppose x - 3j - 10 = 0, 7j - 2j = -ax + 2. What is the highest common factor of x and t? 4 Let n(s) = -s2 - s + 7. Let j be n(3). Let c(f) = -3f + 9. Let u be c(j). Calculate the highest common divisor of u and 120. 24 Suppose 3c - 2r - 55 = 18, 4c - 2r - 98 = 0. Suppose -3i + 1 + 14 = 0. Calculate the greatest common divisor of c and i. 5 Suppose 68 = 5y + 3n, -3y + n + 48 = -4. Let i = 20 - y. Let g = i + 6. What is the highest common factor of 60 and g? 10 Suppose -93 = -3i - 33. Suppose -3j - 2j = 3n - 65, -2j - 130 = -4n. What is the greatest common factor of n and i? 10 Let z(m) = -m*3 - 7m*2 - 5m + 20. Let k be z(-7). Suppose 47 - k = -n. What is the highest common divisor of n and 4? 4 Let l(f) = -2f3 - 15f*2 - 6f - 4. Let c be l(-8). What is the highest common divisor of c and 198? 18 Let d be 4/(-10) - 185/(-25). Let o(q) = q3 - q2 - 7q - 2. Let w be o(4). Suppose w - 333 = -5b. Calculate the greatest common factor of b and d. 7 Let w(q) = q*3 - 48q*2 + 179q + 11. Let f be w(44). Calculate the greatest common factor of 22 and f. 11 Let c = -19 - -11. Let f = -6 - c. Suppose 4h = -5s + 9 + 37, 5s = -fh + 38. Calculate the highest common factor of 2 and s. 2 Let b be (-99)/(-6) - (-3)/(-6). Let t be (-6 - (-5 + 2)) + 3. Suppose t = -4k + 1 + 15. Calculate the greatest common factor of b and k. 4 Suppose 224j - 247j = -1771. What is the greatest common factor of 55 and j? 11 Suppose -5d - 5v = -1355, -11v + 14v = d - 267. What is the highest common factor of 9 and d? 9 Let x be (-12)/(-18)(0 + 3). Suppose 38 = xu + 5s - 52, -5u - 4s + 191 = 0. Calculate the greatest common factor of u and 14. 7 Let q = -245 + 925. Suppose 20 = -4y, -5y - 219 = 3z - q. Suppose 2d + 90 = 7d. Calculate the highest common factor of z and d. 18 Let y be (18/8)/((-2)/(-144)). Suppose 0 = -27i + 14i + 234. What is the greatest common factor of y and i? 18 Let g be ((-152)/(-32))/(1/16). Let a(r) = 5r*2 - 48r + 18. Let s be a(10). What is the greatest common factor of s and g? 38 Suppose 29d - 462 = 176. What is the greatest common divisor of d and 1507? 11 Let u(r) = -9r - 89. Let v be u(-21). What is the highest common factor of v and 60? 20 Suppose -6790 = -10w - 6560. Let z be 185/2 + (-1)/2. What is the highest common factor of w and z? 23 Suppose 6n + 20 - 56 = 0. Suppose 4t + 66 = -n. Let l = -6 - t. Calculate the highest common factor of l and 12. 12 Suppose 76 = 5f - 164. Let p = -31 + 51. Suppose 0 = 3x - 2a - 2a - 44, -x + 4a + p = 0. Calculate the highest common divisor of x and f. 12 Suppose -15z - 48 = -153. What is the greatest common factor of z and 91? 7 Suppose 5p + 12 = 42. Let c be ((-20)/p - -2)/(2/(-60)). Calculate the greatest common divisor of c and 16. 8 Let d be (-1100)/(-15)6/(-5)-3. Suppose 3z - 51 = d. Let u(y) = y3 - 6y*2 + 2y + 3. Let o be u(6). What is the highest common divisor of z and o? 15 Let p(d) = -2d - 8. Let u be p(-9). Let m = 265 - 169. Let i = -16 + m. What is the greatest common factor of i and u? 10 Let v(a) = 2a*3 - 4a*2 - 1. Let i be v(4). Suppose -23 = 2z + 5t - i, 2t - 19 = -z. What is the greatest common divisor of z and 10? 5 Let x be 48/(-15)((-315)/(-14))/(-3). Calculate the greatest common factor of x and 876. 12 Suppose 5z = 7z + 152. Let l = -1 - z. Calculate the greatest common divisor of l and 15. 15 Let d = 1 - -9. Let w = 8 - 4. Suppose -4a + 4 = 0, -f + 107 = -wa + 11. What is the highest common divisor of f and d? 10 Let m = -8 + 18. Let f = 2929 - 2799. Calculate the highest common factor of m and f. 10 Let y(f) = f2 + 9f - 64. Let m be y(-19). Let r be ((-12)/(-9))/(6/63). Calculate the highest common factor of r and m.	{ "pile_set_name": "DM Mathematics" }
+ b*2 + 4658b - 4222. 15586068b + 2 Find the first derivative of -335am2 + 2ar + 1682a - 81m2r - 2mr - 79r - 3 wrt m. -670am - 162mr - 2r Differentiate -3271n2t*2 - 14533965n*2 - 1396t*4 wrt t. -6542n*2t - 5584t3 Find the third derivative of 6v*4 - 3057777v*3 + 11v*2 + 5v + 14125. 144v - 18346662 What is the third derivative of -165210720b3 + b2 - 30b - 1101521? -991264320 What is the derivative of -616200clq + cl + 7cq + 3c - 20780l - 5 wrt q? -616200cl + 7c Find the second derivative of -13196609l5 + 1423l + 13560. -263932180l3 What is the third derivative of -7m*5 - 2783438m*3 + 1203m*2 - 28m + 7? -420m2 - 16700628 Find the second derivative of -122m*3s*2y*2 + 3m*3sy - 12124m*3y*2 + 64m*3 - 3msy*2 + 65528s*2y wrt s. -244m3y*2 + 131056y What is the second derivative of 2x5 + 551x*3 + 595x*2 + 5494214x? 40x3 + 3306x + 1190 What is the derivative of 4541104d2f*4 + 9d*2f - 44839454d2 wrt f? 18164416d*2f*3 + 9d2 Find the second derivative of -h3i + 5h*3 - 4093h*2i + 193h2 + 2hi - 3181h - 30133i wrt h. -6hi + 30h - 8186i + 386 Find the first derivative of -39492010h - 41023713 wrt h. -39492010 What is the second derivative of -131429663d4 - 83334639d? -1577155956d2 What is the first derivative of -117686q*2 - q + 131086500 wrt q? -235372q - 1 Find the first derivative of -463215l2 - 247l + 692897540 wrt l. -926430l - 247 Find the third derivative of 194v*4 - 20733v*3 - 77987243v*2 wrt v. 4656v - 124398 What is the third derivative of 374u6 - 314u*4 - 141u*3 + 465037u*2 + 3u + 32 wrt u? 44880u3 - 7536u - 846 What is the second derivative of 38721908g5 - 3g*4 - g + 16621151? 774438160g*3 - 36g*2 What is the derivative of -106999011js - 3621j + 692 wrt s? -106999011j Differentiate -2k*2s*2 - 60k*2 + 1437ks2 - 6ks - 189k + 2s - 44 wrt s. -4k*2s + 2874ks - 6k + 2 What is the second derivative of -120009s*3u3 + s3u2 + 14su3 + 458su - 3s + 4u wrt s? -720054su3 + 6su2 Find the third derivative of -1726681m*3 - 528907m*2 wrt m. -10360086 Find the third derivative of 5608385u*5 - 11u*3 - 43265722u*2. 336503100u*2 - 66 Find the third derivative of -7v*4z - 40208v4 - v3z + 162042v2z - 2vz wrt v. -168vz - 964992v - 6z What is the third derivative of -8636063h3 + 2h*2 - 12586h - 91? -51816378 What is the second derivative of 1549543c2 - 311c - 1631? 3099086 Find the second derivative of -18490c3g*3 - 2c*3g - c*3 - 5c*2g + 3cg + 129g3 - g + 15148 wrt g. -110940c*3g + 774g Differentiate -16295x*3 - 40x + 20166620. -48885x2 - 40 What is the third derivative of -14674793a*3x + 399a2x + 37424a2 wrt a? -88048758x What is the third derivative of 1448j3q*3u*3 - 470j*3q*3u + 3j3q*2u - j*3u*3 + 43262j*2q*2u*2 - ju*3 wrt q? 8688j*3u*3 - 2820j*3u Find the third derivative of 7231212q5 + 60q*2 + 53028. 433872720q*2 Find the second derivative of 1438p*4 + 5954p*2 - 289594p - 17. 17256p2 + 11908 What is the first derivative of -115430347n*4 + 10904095 wrt n? -461721388n*3 Find the second derivative of 3z*4 - 21549z3 - z2 - 29z + 44870. 36z*2 - 129294z - 2 Find the third derivative of 6470612r3v + r*2v + 348r2 - 2505 wrt r. 38823672v What is the second derivative of 2u5 - 59146029u*4 + 488919632u? 40u3 - 709752348u*2 What is the first derivative of 6389f*4 + 13f3 - f2 - 2f - 7265263 wrt f? 25556f*3 + 39f*2 - 2f - 2 What is the derivative of -5m2 + 1995918m - 23349460? -10m + 1995918 Find the second derivative of -4g*5 + 6g*4 + 689064g*3 + 97323966g wrt g. -80g3 + 72g*2 + 4134384g What is the derivative of -99g3w*2 - 551959gw3 - 3w*3 - 33829w*2 + 51w - 1 wrt g? -297g2w*2 - 551959w*3 What is the second derivative of 65960m*2r*2 - 6m*2r - 2m2 + 10mr + 86m + 774r2 + 17r wrt r? 131920m2 + 1548 Differentiate 4509g*2tu - gtu - 966gu2 - 107tu2 + 639u*2 + 21 with respect to g. 9018gtu - tu - 966u*2 Find the second derivative of -53779uw4 - 197uw2 - u - 59056984w wrt w. -645348uw*2 - 394u Differentiate 2v4 + 103951v*3 - 54v + 221315002 with respect to v. 8v3 + 311853v*2 - 54 What is the third derivative of -128gl3 + gl*2 + gl + 94072l3 - 1461l*2 - 28 wrt l? -768g + 564432 What is the second derivative of 1080k3n*2z*2 + 2884k*2n*3 - kn*3z*2 + 3knz*2 + 2kz2 + 13n*3z + 2n3 + 73nz2 wrt k? 6480kn2z*2 + 5768n*3 Differentiate 486f4 + f3 - 4f2 + 88f + 1909622 with respect to f. 1944f3 + 3f*2 - 8f + 88 What is the second derivative of 112625787v2 + 69156827v + 2? 225251574 What is the second derivative of 188390411y4 + 5272981y - 3 wrt y? 2260684932y2 Find the first derivative of -42632d*3 - 6d*2 - 3022408. -127896d*2 - 12d Find the second derivative of -4144430s2 + 8688031s wrt s. -8288860 What is the third derivative of 4980458r6 - 7042119r*2? 597654960r*3 Differentiate -2d*3n - 2d3 + 11d*2n + 19d2 - 6977dn + 4057d - 4n + 1 with respect to n. -2d*3 + 11d*2 - 6977d - 4 Find the second derivative of -2c3g - 107c3 - 35487c*2g*2 + cg*2 + 9cg - 13c - 155g2 - 13g wrt c. -12cg - 642c - 70974g*2 What is the third derivative of 59231976n*3 + 3206n*2 - 14704n wrt n? 355391856 What is the first derivative of 7167810f4 - 6f*3i - fi + 1241243571i wrt f? 28671240f3 - 18f*2i - i Differentiate 6613860z2 - 4801356 with respect to z. 13227720z What is the derivative of 169i4 - 2iz + 1269i - 7380121z wrt i? 676i*3 - 2z + 1269 What is the derivative of 4js - 10157j + 143s*2z*3 + 51088s*2 - 2z*3 + z + 11 wrt s? 4j + 286sz*3 + 102176s Find the third derivative of -4508in*5 - 56in3 + 29in2 - 12702in - n2 - 2 wrt n. -270480in2 - 336i What is the second derivative of 3a3p*2 + 732a*3 - 374ap - 493836p*5 + 40 wrt p? 6a*3 - 9876720p*3 What is the second derivative of 26903490w*3 + 153w - 130182 wrt w? 161420940w What is the third derivative of -753748004hi4 + hi*3 + 27980hi2 + 6107h wrt i? -18089952096hi + 6h What is the third derivative of -1403o*5 + 460o4 - o3 + 40o2 - 44344 wrt o? -84180o*2 + 11040o - 6 Find the second derivative of 5489091c4 - c + 1335175. 65869092c*2 Differentiate -36961596q - 15446513 with respect to q. -36961596 What is the third derivative of 28j2v*3 + 2j*2v2 + j2v + 2j + 145463v3 + 1908v*2 + 435 wrt v? 168j*2 + 872778 What is the first derivative of 6528078p*2 + 2241908 wrt p? 13056156p What is the second derivative of 75689r4 - 203r*2 + 7795628r? 908268r2 - 406 Differentiate 971af3 + 2af2 + 363a - 605868f3 - 3 wrt a. 971f*3 + 2f*2 + 363 What is the derivative of 11g*3 - 940g*2 + 294g + 24131237 wrt g? 33g2 - 1880g + 294 What is the second derivative of -27bw*3 + 2bw2 + bw + 2b + 941w*3 + 25w*2 + 981238 wrt w? -162bw + 4b + 5646w + 50 Find the first derivative of -7r*2 + 351526r - 2490014 wrt r. -14r + 351526 Find the first derivative of -8854393j*2 - 6552673 wrt j. -17708786j Find the first derivative of 6071400q + 2507780 wrt q. 6071400 Differentiate -131197564qv3 - 2424v*3 + 3656v*2 - v with respect to q. -131197564v*3 What is the second derivative of 175587484l*2 + 74000626l? 351174968 What is the first derivative of 232w2 + 5833w + 6274856 wrt w? 464w + 5833 What is the derivative of 30193196p*2 - 12516975 wrt p? 60386392p Differentiate -404817353f + 353585018 wrt f. -404817353 Find the first derivative of -88561bcf*2q - bcf*2 + 62cq - f2q + 14276fq wrt b. -88561cf*2q - cf2 Find the first derivative of 105486066h*2n*3 - 67747966h*2 wrt n. 316458198h*2n*2 What is the third derivative of 103r*5 - 59780r*4 + 317r*2 - 7214r wrt r? 6180r2 - 1434720r Differe	{ "pile_set_name": "DM Mathematics" }
j + 74556g2j - 1528h2j - hj + h + 24j - 60 wrt g. 102gh*2j + 149112gj Differentiate 20030d2m*3 - 32dm2 + 12009m*3 - 3m + 5 wrt d. 40060dm*3 - 32m*2 What is the second derivative of 8370223c*5 - 222c - 15376 wrt c? 167404460c3 What is the third derivative of 42x*3y - 6569102x3 - 1082079x*2y + 243xy wrt x? 252y - 39414612 What is the first derivative of -20149232z + 9989706 wrt z? -20149232 What is the derivative of 7gi*2 + 24gi + 15993g - 12i2 + 2934i - 53 wrt g? 7i2 + 24i + 15993 What is the first derivative of 1221884r + 5440371 wrt r? 1221884 What is the first derivative of -91n*2 + 357717n + 130599669 wrt n? -182n + 357717 What is the third derivative of 3033a*4g + 2a4 + 265a*3g + 2a2g + 7a2 - 191ag + 13a + 1 wrt a? 72792ag + 48a + 1590g Differentiate -141v3 - 1169v*2 - 5v - 69617158. -423v2 - 2338v - 5 Find the third derivative of -1557483abm3 - abm2 - 84abm - 32am*3 - 4am2 - 2946am + 2m*3 wrt m. -9344898ab - 192a + 12 Differentiate 4x3 - 1376759x - 18524283 wrt x. 12x2 - 1376759 What is the third derivative of -206198m*6u + 3m3u - 134294m2u - 2m2 - 10mu wrt m? -24743760m*3u + 18u What is the second derivative of -14005w*4 + 1978w*3 - 14w - 1238891 wrt w? -168060w2 + 11868w Find the second derivative of -587462981u3 + 13817147u - 3. -3524777886u Differentiate 132619615v + 259841351 wrt v. 132619615 Find the third derivative of -6d2j*3w - 3731018d2j*3 + 11d*2j*2w + 8d2j*2 + 2d*2jw - 32d*2w + 577dj - j*2 wrt j. -36d*2w - 22386108d2 Differentiate -p4 - 47521646p*3 + 91518935 wrt p. -4p*3 - 142564938p*2 What is the third derivative of -2214p*4 - 5584p*3 - 2p*2 - 3480648 wrt p? -53136p - 33504 What is the derivative of 2b3z2 - b3z - 1902b*3 - 109b*2 - 2b - 77z2 - 9162z wrt z? 4b3z - b*3 - 154z - 9162 Find the third derivative of -599315218f4 - 3831556f*2 - 9. -14383565232f What is the third derivative of -75199319g3 + 384213531g*2? -451195914 Find the third derivative of 2559cs4 - 4cs3 + 10cs2 - 82s4 - s3 + 17s2 - 223 wrt s. 61416cs - 24c - 1968s - 6 What is the second derivative of 305867613vy2 + 4560vy + 2v + 11y - 18 wrt y? 611735226v Differentiate -2697308np + 2342998n + 5p*3 with respect to p. -2697308n + 15p2 Differentiate 5a*3m + 2368572a3 + 12095168m wrt a. 15a2m + 7105716a2 Find the first derivative of 126c*4p - 285676c4 - 60p - 225884 wrt c. 504c3p - 1142704c3 What is the third derivative of -215381444y*5 - 13y*2 - 13619y + 53 wrt y? -12922886640y2 Find the third derivative of 78689t*5 - 224t4 - t3 - 469187t2 - 23. 4721340t*2 - 5376t - 6 Find the second derivative of 72993qw*3 + 6849qw + 650q + 7w3 + 8w*2 wrt w. 437958qw + 42w + 16 What is the derivative of -38801913bq - 49b + 100742 wrt q? -38801913b What is the derivative of 359565307h4p*3 + 2hp3 - 536p*3 + 31552p*2 - p wrt h? 1438261228h*3p*3 + 2p*3 What is the first derivative of -39340167dh + 62607884d wrt h? -39340167d Differentiate -3320a*2fp + a2p - 2a2 + 8718af + 46ap + 53a with respect to p. -3320a2f + a*2 + 46a Differentiate -6500t3v*3 + 505t*2v3 - v3 - 1324v2 + v + 286 wrt t. -19500t*2v*3 + 1010tv3 What is the derivative of -824773136s + 5843354? -824773136 What is the third derivative of -i*5 + 7i*4 - 89256i3 - i2 + i - 194539? -60i2 + 168i - 535536 Differentiate -3d2 - 20141858d + 427287352. -6d - 20141858 Differentiate 4f*3y - 417590011f3 - 508303f*2y + fy - 5y with respect to y. 4f3 - 508303f*2 + f - 5 What is the third derivative of -66518753a*2j*3l + 46a2j*2l + a*2j*2p + 3a2jlp - a*2lp + 2a*2 + ajlp + 3j3p + 671lp wrt j? -399112518a2l + 18p Find the second derivative of 10629l*2z - 5155l2 - 410l - 92375z wrt l. 21258z - 10310 What is the second derivative of -21j5 - 12j*4 + 16141j*2 - 197868283j wrt j? -420j3 - 144j*2 + 32282 What is the second derivative of -126578926m*2 - 143687794m - 1? -253157852 Differentiate 468666143r4 + 107238957 with respect to r. 1874664572r*3 What is the third derivative of -126216d*3n - 167d3 + 5788d*2n - 5203n wrt d? -757296n - 1002 What is the second derivative of 44f3t*2 + 29f*3t + 2f2t - 3f2 - 10ft3 - 84f - 5t3 + 131t*2 + 11t wrt t? 88f3 - 60ft - 30t + 262 Differentiate -758g3 + g2 + 740g - 4574087 wrt g. -2274g2 + 2g + 740 What is the second derivative of 22957854hr*2 + hr - 15631971h wrt r? 45915708h What is the third derivative of -11a2s*3 - 9a*2s*2 + 81905as3 - 18s*3 - 1970551s wrt s? -66a2 + 491430a - 108 Find the third derivative of -38d5 + 16502d*3 - 41637d*2 + 41 wrt d. -2280d*2 + 99012 What is the second derivative of 8169d*2q*2 - 154d*2 + 418q*3 + 11034q wrt q? 16338d2 + 2508q What is the second derivative of 5409972c2k - 2c2 + 34ck - 87k - 1047 wrt c? 10819944k - 4 What is the second derivative of 41fq2z*2 + 13fq2 - fq - 83q2 - 6qz2 - 140174z*2 wrt q? 82fz2 + 26f - 166 What is the second derivative of -184399966k2 + 123017977k? -368799932 What is the third derivative of -380546228p6 - 9490608p*2 + 2 wrt p? -45665547360p*3 What is the third derivative of -15631476j*3z6 - j3 + 2172jz*2 - 2z*2 + 74z wrt z? -1875777120j3z3 Find the first derivative of i3p - i2p - 34720i2 + ip + 1339004p wrt i. 3i*2p - 2ip - 69440i + p What is the third derivative of -4399h*6 - 220h4 - h3 + 5675h2 - 10h - 272? -527880h3 - 5280h - 6 Find the second derivative of 24920220y2 - 11110956y. 49840440 Find the first derivative of -12dq*2t - 1402464dt + 15743232q2t + 13qt wrt d. -12q2t - 1402464t Find the first derivative of 2637b*4f*2 - 22791bf3 + 3085872f*3 + 9f*2 wrt b. 10548b*3f*2 - 22791f*3 What is the first derivative of 14r*4 + 605r*2 + 432r - 150167282 wrt r? 56r3 + 1210r + 432 Find the second derivative of 34096205t2 - 28t - 471889 wrt t. 68192410 What is the second derivative of -66g4 - 51424g*2 + 22g + 1508293? -792g2 - 102848 What is the third derivative of 4536a*2bk2t*3 - 6a*2kt2 - 6a*2k + 1617a2t*3 + 4abkt + ak*2t - 4k + 21t*2 wrt t? 27216a*2bk2 + 9702a*2 What is the third derivative of 13p*2w*2x - 89125p2wx3 + 4pw2 + 2pwx*2 + 483w*2x*4 - 85712w*2 wrt x? -534750p*2w + 11592w2x Find the first derivative of -56426459kl*2 - 358280731l*2 wrt k. -56426459l*2 What is the derivative of 511o*2py + 3087o*2y - 2993o2 - 24024p wrt p? 511o2y - 24024 Find the second derivative of 61323266l2 + 77760401l. 122646532 What is the third derivative of 73323396p3 + 84082055p*2 wrt p? 439940376 Find the second derivative of 8580253mv2 - 2389mv - 397v wrt v. 17160506m Differentiate 8hor + 22hr - 2h - 173083o + 4r + 343 wrt o. 8hr - 173083 Differentiate -4551699z + 4827048 with respect to z. -4551699 Find the third derivative of -1381885o6 - 45o*4 + 795189913o*2 wrt o. -165826200o*3 - 1080o Find the third derivative of -261107q3r3 + q3r2 - q3 + 2q*2r*3 - 4q*2r*2 - 42135r*3 wrt q. -1566642r*3 + 6r*2 - 6 What is the third derivative of -161ms3 + 7ms2 - 2m - 12230s3 - 148489s*2 wrt s? -966m - 73380 What is the second derivative of -864504233h2 + 891748h - 42? -1729008466 What is the third derivative of -228125h4 + 2216h*2 - 185? -5475000h Find the second derivative of -429i5 - 451079i*3 - 1718357i + 8 wrt i. -8580i3 - 2706474i What is the second derivative of -184627521x2 + 18x - 2378537? -369255042 Find the first derivative of -5714677w + 8383239. -5714677 What is the derivative of 171862891ox2 - 237137074x*2 wrt o? 171862891x*2 What is the second derivative of -18585692u*	{ "pile_set_name": "DM Mathematics" }
h = 4i + 5h - 28. Is (-8)/i - -69 - -2 a composite number? True Let q = -291 + 241. Let l(f) = -100f - 5. Let o be l(-5). Let n = o + q. Is n composite? True Let j = -43 - -116202. Is j prime? True Let a(m) = 786m + 119. Is a(10) a composite number? True Let k(v) = -v - 12. Let s be k(-12). Suppose -p - 3a = 3p - 521, 3p - 5a - 369 = s. Let t = 181 - p. Is t prime? True Let o(j) = 4j2 + j - 1. Let m be o(2). Let l = 1 + m. Suppose t - 145 = l. Is t a prime number? True Let c(z) = z3 - 8z*2 + 10z - 9. Let x be c(6). Let y = 23 + x. Is (-2)/(3y/(-1227)) a composite number? False Suppose 0 = 27b - 33b + 17418. Is b a prime number? True Let g be -1318(4/(-8) + 1). Is -7 + 3 - (g + 2) prime? True Let f = -407 + 652. Suppose f = 4q - 5171. Suppose q = n + n. Is n composite? False Let f(a) = -a3 + 9a*2 + 12a - 11. Let p(s) be the first derivative of -s*3/3 + 4s*2 + 10s + 1. Let x be p(8). Is f(x) composite? True Suppose -20s = -17s + 12. Let l(g) = -24g - 7. Is l(s) a composite number? False Let y(x) = x2. Let q(w) = -53w*2 - 10w + 2. Let m(v) = -q(v) + 4y(v). Is m(3) a prime number? True Let z = 34456 - 22971. Suppose 2i = 3p + 821 + 6835, 3i - z = 4p. Is i a prime number? False Let n(s) = -s3 - s2 - s - 1. Let r be n(0). Let m be r - (-4 + (-1)/(-1)). Suppose -l - 4l = -2w + 431, -ml = -4w + 886. Is w composite? False Let d(x) = 26x*2 - 70x + 25. Is d(17) a prime number? False Let w(c) = 3c - 1. Let s be w(-3). Let p be s/35 - 40/7. Let i(d) = 4d*2 - d - 7. Is i(p) a prime number? False Suppose 4z = -2886 - 2078. Let u = 2812 + z. Is u composite? False Suppose 5k = -4 - 6. Is (k + 0)/(-8) - (-37075)/100 prime? False Is 24911425/(-550)22/(-7) composite? True Suppose -4t + 53 + 383 = 0. Is t prime? True Let w = -32 - -28. Let n = w - -257. Is n composite? True Let y = 54 + -50. Suppose -yt = -576 - 292. Is t a prime number? False Let v be (4/6)/(3/(-81)). Suppose -5n + 100 = d, 6n - 3n - 67 = -2d. Let f = n - v. Is f prime? True Let m(s) = s + 1. Let n(k) = 162k*2 - 3k - 2. Let y(g) = m(g) + n(g). Let c be y(4). Suppose 0h + c = 9h. Is h composite? True Let s = -7776 + 14279. Is s prime? False Let q(g) = -4g - 5g*2 - 11 + 4g*2 - 1 - 8g. Is q(-7) composite? False Is 3/(-12) - (-991221)/132 a composite number? True Let n(r) = -20r - 14. Is n(-6) a prime number? False Suppose 4a - 4 = 0, 2h = -5a + a + 23376. Suppose 4t = -8, 5v - 2v = 5t + h. Is (v/6)/((-2)/(-3)) composite? True Let l(p) = p*3 - 9p*2 - p + 12. Let g be l(9). Suppose -6d + 4d + 10 = -ga, 3d - a = 8. Suppose j = -dj + 429. Is j composite? True Suppose 0g = -3g + 2376. Suppose -b + g = t - 2b, t + b = 796. Is 0 + t + 1 + -4 a prime number? False Is 98678/(2 - 0/(-2)) composite? False Suppose 0 = 3m - 354 - 360. Let w = 2074 + -1283. Let v = w - m. Is v composite? True Let i = 175 - 464. Let v = -199 - i. Let c = 269 + v. Is c a composite number? False Suppose 4 = -4s, 4x + 0 = -2s + 2. Is x + 94 + 1 + -5 a composite number? True Let t(g) = -5g*3 + 42g*2 + 27g - 71. Is t(-21) a composite number? False Suppose 24982 = 6r - 92804. Is r a composite number? True Suppose 6y = y + 5. Is ((-32499)/(-12) - y/4) + -3 composite? True Let r = -6 + 10. Suppose 2b - b = x - 8, 3x = rb + 29. Suppose -3o - xy = 2o - 521, -5o + 5y + 545 = 0. Is o composite? True Suppose 0 = 5h + 144 - 34. Let y = 18 + h. Is (6/(-15))/(y/4220) a prime number? False Let d(t) = 74t3 + t2 - 5t + 1. Is d(6) prime? True Suppose 0 = g + 6o - o - 15, 2g - 3 = -o. Suppose -537 = -3u - gu. Is u a composite number? False Let b = 10 + -11. Let l(s) = 839s*2. Is l(b) prime? True Let a be 1-2(-5055)/6. Suppose -8p - a = -13p. Is p a prime number? True Suppose 5r - 34193 = -12v + 8v, -5v + 13667 = 2r. Is r composite? False Let t = 80 - 85. Is ((-1964)/(-12))/((t + 3)/(-30)) a prime number? False Suppose 9066 = 3r - 2a, -a = r - 3328 + 311. Suppose -k - r = -5k. Let q = k - 198. Is q a composite number? False Let w(a) be the first derivative of 65a - a*2 - 1/3a*3 - 3. Is w(0) a prime number? False Let u(c) be the first derivative of 13c4/6 + c3/6 + c*2 + 3c - 3. Let j(v) be the first derivative of u(v). Is j(-3) a prime number? True Suppose -154 = 3r - 1036. Suppose r = 3l + 63. Is l composite? True Let t(u) = u*2 - 6u - 3. Let c be t(5). Let a(w) = -68w - 3. Is a(c) composite? False Is 4/(-14)112/(-48)38013 prime? False Let o be 10/(-6) - (-10)/15. Let g be 0 + -13 + 2 + o. Is 152 + g/(-4) prime? False Suppose -2x + 5x = -3, 4k - 34 = 2x. Suppose -4q + k + 4 = 0. Let o(t) = 163t - 2. Is o(q) composite? False Let v = -86 + 33. Let m be 1461/6 + 3/6. Let o = v + m. Is o prime? True Let g = 30645 - 10436. Is g a prime number? False Let q(k) = 11k - 2. Let w(i) = 11i - 1. Let c(u) = -3q(u) + 2w(u). Let z be c(13). Let f = z - -226. Is f a composite number? True Suppose -5a + 32906 = -k, -4k - 10 = -6. Is a prime? True Let t = 239 + -362. Suppose 348 = -2u + 3u. Let w = u - t. Is w composite? True Suppose -m - m = 18. Is 2/6 - 798/m composite? False Let d be (-135)/7510/(-6). Suppose 5x + 2r = 36091, -7258 = -x + dr - 33. Is x a composite number? False Suppose -2g + 0x = -4x + 26, -4g - 85 = 3x. Let o = g + 24. Suppose q + o = 358. Is q a composite number? False Let c be 2/66/1. Suppose -2x + 80 = 4i, 2i + 115 = 4x + i. Suppose cv - 20 = x. Is v prime? False Let f = -424 - -1670. Is ((-51)/34)/((-3)/f) prime? False Suppose 12a - 60679 = -9283. Is a composite? False Let o = 23761 - 14174. Is o a prime number? True Let a be ((-1752)/(-9))/(4/6). Let t = a - 113. Is t a prime number? True Let o(k) = 4k - 5. Let x be o(-3). Let f = 17 + x. Is (-1)/(-2)(f + 1418) a composite number? False Suppose 0 = -2i + 3u + 45, 20 = 4i + 4u - 20. Is (-10)/(-15) + 2345/i composite? False Is (0 + -8)/(-8)30293 a prime number? True Let x(q) be the second derivative of -3q5/10 - q4/4 - q*3/3 + 2q*2 - q. Suppose -5s + 3m - 19 = 8, 5s + 19 = m. Is x(s) a prime number? False Suppose -29j - 86513 = -546424. Is j prime? True Let m = 13 + -6. Suppose -mb + 8 = 1. Is (3289/13)/(0 + b) prime? False Let m = 9 + -4. Suppose n - 3 = 0, -2n - 9 = -md - 0n. Is d a prime number? True Suppose 5 = -0t + t. Suppose 0 = tl + 5k - 4315, 0 = -3k - 10 - 2. Suppose -3p = -j + 2p + 278, -3j + 4p + l = 0. Is j composite? False Let u(j) be the first derivative of -2j3/3 - j2/2 - 6j - 6. Let m(o) = 2o*2 + 2o + 5. Let n(i) = 3m(i) + 2u(i). Is n(9) a prime number? False Suppose 27d = 26d + 2y + 4345, 3d = -2y + 13067. Is d prime? False Let k(m) = -m3 - 28m*2 - 23m + 37. Let c be k(-27). Suppose 0 = -2u + 2f - 222, -4f - 580 + 52 = 5u. Let j = c - u. Is j composite? False Suppose 4d + y = 87837, 0 = -2d + 2y - 2339 + 46255. Is d composite? True Let c(k) = 2k*3 - 7k*2 - 25k + 283. Is c(14) prime? True Let n(q) be the first derivative of 5q3/3 + 11q*2/2 - 7q - 121. Let h = 9 - 3. Is n(h) a prime number? True Let f(x) = 52x - 71. Is f(10) prime? True Suppose -39l = -36l - 28581. Is l prime? False Let u be 7376/(-20) + 1/(-5). Let z = -189 + u. Let n = -271 - z. Is n a composite number? True Let s(j) = -22j - 5. Let d = -13 + 11. Let c be s(d). Let y = 70 - c. Is y prime? True Let d(s) be the first derivative of -13 + 22 - 3s + 55s*2 - 12. Is d(8) a prime number? True Suppose -6w + 3w = -9. Suppose 0 = 3o - 4c + 30, 5c + 70 = -wo + 13. Let y = 60 + o. Is y prime? False Suppose 15 + 12 = 2u - 3o, -2u = -5o - 29. Is ((-18)/u)/(3/(-1594)) prime? True Let i = -30 + 36. Let j(r) = r3 - r2 + 2r - 7. Is j(i) a composite number? True Suppose -2r + 1 = d, -r + 2r - 4 = 3d. Is d/(((-2)/6)/(2198/21)) composite? True Is 254/(9/14316) a composite number? True Let w(r) = 2228r3 - r2 - r + 1. Is w(1) a composite number? True Let p(k) = -155k + 37. Let f be p(7). Is 5/((-20)/f) + -3 composite? True Let h(b) = 8b2 - 19b - 20. Suppose -16r + 7 - 151 = 0. Is h(r) a composite number? True Suppose 9n = 91879 + 122330. Is n a prime number? True Let o = -224 + 597. Is o composite? False Let q(d) = d - 4. Let l be q(6). S	{ "pile_set_name": "DM Mathematics" }
the next term in 6886, 6842, 6770, 6670, 6542? 6386 What comes next: -786, -1523, -2266, -3015, -3770, -4531, -5298? -6071 What is the next term in -772, -1363, -1954? -2545 What is next in 1925, 1920, 1915, 1910? 1905 What comes next: 7040, 7064, 7088, 7112, 7136, 7160? 7184 What comes next: -397, -1513, -3335, -5851, -9049? -12917 What comes next: -74054, -73846, -73626, -73388, -73126, -72834, -72506? -72136 What is next in -4159, -33083, -111591, -264475, -516527, -892539, -1417303, -2115611? -3012255 What is next in -31831, -63690, -95549, -127408? -159267 What is the next term in 122, 183, 214, 215? 186 What is the next term in -261, -279, -327, -405, -513, -651, -819? -1017 What is next in 144, 806, 1916, 3480, 5504, 7994, 10956, 14396? 18320 What is next in 23977, 23975, 23973, 23971? 23969 What comes next: 6595, 13010, 19425, 25840, 32255, 38670? 45085 What is next in 20874, 20821, 20768, 20715, 20662, 20609? 20556 What is the next term in -1666, -3189, -4712, -6235, -7758, -9281? -10804 What comes next: 371, 651, 1117, 1769? 2607 What comes next: -89, -300, -655, -1154, -1797, -2584, -3515? -4590 What comes next: -994, -1050, -1158, -1330, -1578? -1914 What comes next: 9769, 10017, 10431, 11011, 11757, 12669, 13747? 14991 What comes next: -9573, -9567, -9561, -9555, -9549, -9543? -9537 What is next in -969, -1700, -2919, -4626, -6821, -9504? -12675 What comes next: -384, -3597, -12320, -29307, -57312, -99089, -157392, -234975? -334592 What is next in -7860, -15728, -23596? -31464 What is next in -10, -57, -154, -301? -498 What is next in -5, 75, 213, 415, 687, 1035, 1465, 1983? 2595 What is the next term in 154, 133, 80, -23, -194, -451? -812 What comes next: -53, -83, -77, -29, 67, 217, 427? 703 What is next in 105, 196, 335, 516, 733, 980? 1251 What comes next: -3976, -3939, -3878, -3793, -3684? -3551 What is next in 85, 155, 215, 265, 305, 335, 355? 365 What is the next term in 1032, 1153, 1274, 1395, 1516, 1637? 1758 What is next in 569, 763, 957, 1151? 1345 What is next in 6, 21, -34, -219, -594, -1219, -2154, -3459? -5194 What is next in 135, 488, 1029, 1758? 2675 What comes next: 41, 112, 209, 314, 409, 476? 497 What is next in 560, 720, 880, 1040, 1200, 1360? 1520 What is the next term in -735, -1548, -2361, -3174, -3987? -4800 What comes next: 211, 430, 657, 886, 1111, 1326, 1525? 1702 What comes next: -174, -655, -1458, -2589, -4054, -5859, -8010? -10513 What is the next term in -166, -651, -1404, -2383, -3546, -4851, -6256, -7719? -9198 What comes next: 84364, 84366, 84368, 84370? 84372 What is next in 15276, 15268, 15260? 15252 What is the next term in -3755, -3753, -3749, -3743, -3735? -3725 What comes next: -40, -411, -1058, -1981, -3180, -4655, -6406? -8433 What is the next term in -319, -1315, -3007, -5419, -8575, -12499? -17215 What comes next: -4, -71, -154, -241, -320, -379, -406, -389? -316 What is next in 592629, 592626, 592623, 592620, 592617? 592614 What is the next term in -41651, -41664, -41677, -41690, -41703, -41716? -41729 What is the next term in 946, 997, 1070, 1159, 1258, 1361, 1462, 1555? 1634 What is next in 477, 953, 1451, 1983, 2561, 3197, 3903? 4691 What is next in -359047, -359044, -359051, -359074, -359119, -359192, -359299, -359446? -359639 What is the next term in 292, 522, 752, 982? 1212 What comes next: -81, -329, -999, -2307, -4469? -7701 What comes next: -1044, -1052, -1060, -1068, -1076? -1084 What is the next term in -20417, -40867, -61333, -81821, -102337, -122887, -143477? -164113 What is the next term in -219, -412, -579, -720? -835 What is the next term in -269, 85, 439, 793, 1147, 1501? 1855 What is next in 2709, 5393, 8077, 10761? 13445 What comes next: 70600, 70605, 70610? 70615 What is next in -129, -1023, -3455, -8193, -16005, -27659? -43923 What is the next term in -6, 48, 208, 528, 1062? 1864 What is next in 3599, 3605, 3611, 3617, 3623, 3629? 3635 What is next in 7668, 15389, 23106, 30819, 38528? 46233 What comes next: -103, -398, -897, -1600, -2507, -3618? -4933 What is the next term in 9738, 19770, 29802, 39834, 49866? 59898 What is the next term in -656, -1198, -1646, -2000, -2260, -2426, -2498? -2476 What is the next term in -105397, -210795, -316207, -421639, -527097, -632587? -738115 What is the next term in -181, -389, -597, -805, -1013? -1221 What comes next: 52429, 52436, 52445, 52456, 52469, 52484, 52501? 52520 What comes next: 3134, 6253, 9342, 12389, 15382? 18309 What is the next term in 1500, 945, 18, -1287, -2976, -5055, -7530, -10407? -13692 What is next in 338, 411, 484, 557? 630 What is next in 7100079, 7100078, 7100077, 7100076, 7100075? 7100074 What is next in 233, 767, 1657, 2903, 4505? 6463 What is next in -405, -1528, -3389, -5988? -9325 What comes next: 239, 862, 1707, 2618, 3439, 4014, 4187? 3802 What is next in 395, 379, 351, 311, 259? 195 What comes next: -267, -1168, -2669, -4770, -7471, -10772? -14673 What comes next: 1043, 971, 899, 827, 755, 683? 611 What is next in -18, 170, 680, 1674, 3314, 5762, 9180, 13730? 19574 What is next in -88, -87, -26, 95? 276 What is the next term in 2093, 8460, 19079, 33950? 53073 What comes next: -2079, -2835, -4897, -8919, -15555, -25459, -39285? -57687 What is next in 183, 209, 229, 243, 251, 253? 249 What is next in 1114, 2223, 3336, 4453, 5574, 6699? 7828 What is the next term in -33213, -33203, -33193, -33189, -33197? -33223 What comes next: 817, 599, 19, -1103, -2947, -5693? -9521 What is the next term in -226345, -226352, -226359, -226366, -226373? -226380 What is the next term in -7453, -7458, -7463, -7468, -7473, -7478? -7483 What is the next term in 14514, 28988, 43456, 57912, 72350? 86764 What is next in -11151, -44572, -100273, -178254, -278515? -401056 What is next in -8898, -17795, -26692? -35589 What comes next: 7447, 29784, 67009, 119122, 186123, 268012? 364789 What is next in -2000, -3981, -5960, -7937, -9912, -11885, -13856? -15825 What is next in -118, -243, -372, -505? -642 What is the next term in -10946, -21989, -33034, -44081, -55130, -66181, -77234? -88289 What is the next term in -1171, -1030, -889, -748, -607? -466 What comes next: -2037, -1988, -1909, -1800? -1661 What is the next term in -907, -2045, -3183, -4321, -5459? -6597 What comes next: 36, 48, 60, 72, 84? 96 What comes next: -66252, -132507, -198762? -265017 What comes next: -63074, -252316, -567720, -1009286? -1577014 What is the next term in -1274, -1197, -1118, -1037, -954? -869 What comes next: -75, -310, -715, -1290, -2035, -2950? -4035 What comes next: -127, -343, -387, -1, 1073? 3093 What is next in 528, 1142, 1858, 2682, 3620, 4678, 5862, 7178? 8632 What comes next: -489, -652, -917, -1278, -1729, -2264? -2877 What is the next term in 69, 711, 2457, 5859, 11469, 19839, 31521, 47067? 67029 What is next in 118338, 118331, 118320, 118305, 118286, 118263, 118236? 118205 What is the next term in -90, 515, 1508, 2877, 4610, 6695, 9120, 11873? 14942 What is the next term in -29, 18, 97, 208, 351, 526, 733? 972 What comes next: -3895, -7791, -11689, -15589? -19491 What is next in -300, -647, -1024, -1431? -1868 What comes next: 17228, 17220, 17208, 17192, 17172? 17148 What comes next: 1511, 1529, 1549, 1571, 1595, 1621, 1649? 1679 What comes next: 149, 582, 1403, 2690, 4521, 6974, 10127, 14058? 18845 What is the next term in -123, -1099, -2717, -4971, -7855, -11363, -15489? -20227 What is the next term in 39298, 39355, 39412, 39469? 39526 What is the next term in -38, -225, -572, -1079, -1746, -2573? -3560 What is next in 6744, 6800, 6856, 6912, 6968? 7024 What is next in -13821, -13814, -13807, -13800? -13793 What is next in 856, 849, 840, 829, 816, 801? 784 What comes next: 2058, 2118, 2188, 2274, 2382? 2518 What is next in -9654534, -19309069, -28963604? -38618139 What is next in 781, 613, 447, 283, 121, -39? -197 What is next in -24, -49, -88, -147, -232, -349, -504? -703 What comes next: 1337, 5366, 12093, 21518, 33641, 48462? 65981 What is the next term in 12408, 24790, 37148, 49470, 61744, 73958, 86100? 98158 What is the next term in 5288, 10574, 15860, 21146, 26432? 31718 What is next in 142191, 284383, 426575, 568767, 710959, 853151? 995343 What is the next term in -3947, -31607, -106679, -252869, -493883? -853427 Wh	{ "pile_set_name": "DM Mathematics" }
Let k = 24 - 0. Suppose k = 2n - o. What is the remainder when 20 is divided by n? 8 Suppose 12b + 5v = -244, 3b - 17v = -16v - 70. Suppose -m - 2m = 3. Let g = m - b. What is the remainder when 80 is divided by g? 17 Suppose -2z + 526 = -t, -17t + 1076 = 4z - 22t. What is the remainder when 902 is divided by z? 125 Let p(h) = h2 - 18h + 34. Let c(d) = -30d + 3. Calculate the remainder when p(22) is divided by c(-2). 59 Let m = -3127 - -3190. Calculate the remainder when m is divided by 54. 9 Suppose 0z + 4z - 5i - 181 = 0, -z - 5i + 39 = 0. Let f(l) = 2l*3 - 47l*2 - 15l - 87. Calculate the remainder when f(24) is divided by z. 41 What is the remainder when (-1380)/(-253)(-154)/(-4) is divided by 32? 18 Calculate the remainder when ((-11 - -20) + 300)/3 is divided by 43. 17 Suppose 4j + 32 = 3t, 6t - 41 = 3t - 5j. Let q(o) = -2o2 - 8o + 7. Let x = -78 - -74. What is the remainder when t is divided by q(x)? 5 Suppose 25 - 1 = 4y. Let c(n) = -n2 + 14n - 9. Calculate the remainder when -1278((-624)/88 - -7) + 2/(-11) is divided by c(y). 38 Suppose -6938 = -65p + 35476 - 6729. What is the remainder when p is divided by 273? 3 Suppose -3l + 3y + 0 = 3, 2y = 4l - 6. Suppose -5h + lo + 100 = 0, -2o = 5h - 148 + 18. Calculate the remainder when h is divided by (8/12)/(12/126). 3 Suppose -4w + 8 = -5f - 103, -f = w - 21. What is the remainder when 1173 is divided by w? 21 Suppose 0 = 5s - 95 - 40. Suppose 13b + s = 92. Calculate the remainder when 38 is divided by b. 3 Suppose 2j - 309 = -5s, -3j + 438 = -49s + 48s. What is the remainder when j is divided by ((-9)/(-3) - 5-9) + -3? 12 Suppose -4l - 5y = -228, 793l - 4y = 794l - 68. Calculate the remainder when 87 is divided by l. 35 Suppose -6w + 26w - 5570 = 8610. Calculate the remainder when w is divided by 23. 19 Suppose -11y + 10y + 76 = -5k, -3y = 8k - 228. Calculate the remainder when 27510 is divided by y. 74 Let h(c) be the third derivative of -15c4/8 - c3/3 - c2. Calculate the remainder when h(-3) is divided by 2/(-35) + 7164/420. 14 Suppose 3z + 4z - 5737 = -5674. What is the remainder when 852 is divided by z? 6 Let q = 938 - 893. Calculate the remainder when 147 is divided by q. 12 Suppose 192j = 260j - 272. Calculate the remainder when 368 is divided by j. 0 Let j = -36 - -49. Let b be (-3097)/(-95) + (-6)/10. Let k = b - -16. Calculate the remainder when k is divided by j. 9 Suppose 0 = -5j + 3x + 13, -3j + 4x - 26 = -5j. Suppose js - 5k - 875 = 0, -3s + 15k = 17k - 520. Calculate the remainder when s is divided by 3. 0 Suppose 0 = 9l - 17l - 856. Let o = l + 235. What is the remainder when o is divided by 23? 13 Suppose 8t + 624 = 4m + 3t, 5m - 3t = 767. Suppose 67 = -3u + m. What is the remainder when 81 is divided by u? 25 Let l(i) = 2i*2 + 16i + 108. What is the remainder when 114 is divided by l(-8)? 6 Let z = -220 + 290. Suppose -u = -5t + 1746, -t + 2t = u + 350. Calculate the remainder when t is divided by z. 69 Suppose 14t - 5382 = -64t. Let u(q) = 14q - 2. What is the remainder when t is divided by u(1)? 9 Suppose 22j - 84 - 158 = 0. Suppose jo - 4655 = -8o. Calculate the remainder when o is divided by 62. 59 Calculate the remainder when ((-7909)/(-110) + 6/10)2 is divided by 30. 25 Let l = -1624 - -1741. Calculate the remainder when l is divided by 24 - -7 - (-1 - -2). 27 Let w(n) = n2 + 10n + 4. Let q be w(-22). Let z = q + -153. What is the remainder when z is divided by 29? 28 Suppose 100s + 4s - 21 = 1123. Calculate the remainder when 2142 is divided by s. 8 Let z = -238 + 416. Let h = z - 165. What is the remainder when 22 is divided by h? 9 Suppose -677j - 693j + 1390j - 6800 = 0. What is the remainder when j is divided by 40? 20 Let c(z) = 92z + 2364. Calculate the remainder when 1479 is divided by c(-23). 239 Suppose 2m + 120 = 2z - 0z, -4m = -z + 78. Calculate the remainder when 217 is divided by z. 1 Suppose -34 = -28t + 134. Suppose tl + 489 = 543. What is the remainder when (14 - 0)/((-1)/(-1)) is divided by l? 5 Suppose -q + 2k + 6 = 0, q - 2q = 4k. Suppose -qw + 1 = -27. Let g(i) = -15618i + 93730. Calculate the remainder when g(6) is divided by w. 1 Let s = 3038 + -2778. Suppose 0 = -6a - 10a + 144. What is the remainder when s is divided by a? 8 Suppose -5w = 2s - 2413, 4s = -2w + 6w + 4812. Suppose -19m + s = -5m. What is the remainder when m is divided by 18? 14 Let u(n) = n*3 + 6n*2 - 3. Let k be u(-6). Calculate the remainder when (2/k)/((-2)/213) is divided by (-1312)/(-52) - (-9)/(-39). 21 Let m = 48 + -44. Let p be (2 + 10/m)78/9. Suppose 2o - p = -x - 2o, 0 = -2x + 2o + 78. Calculate the remainder when x is divided by 10. 9 Let k be (-816)/56 + 18/(-42). Let w(o) = o*2 - 11o - 9. Let m be w(7). Let n = k - m. Calculate the remainder when n is divided by 5. 2 Let b = -148161 + 148183. Let m(c) = 11c2 - 1. Calculate the remainder when m(4) is divided by b. 21 Let q(l) = -25l - 217. Let w(x) = 9x + 72. Let s(m) = -4q(m) - 11w(m). Calculate the remainder when s(-27) is divided by 36. 13 Let q(x) = 14x*3 + 4x*2 - 7x + 13. Let d be q(3). Let p = 408 - d. What is the remainder when 14 is divided by p? 0 Let r = 2207 - 2140. Calculate the remainder when 197 is divided by r. 63 Let t = -5826 + 10781. Calculate the remainder when t is divided by 134. 131 Suppose 30g = 3q + 33g - 13884, 5q = 3g + 23100. What is the remainder when q is divided by 1540? 3 Let u = 5260 - 5177. Let p(b) = 6b + 3. Calculate the remainder when u is divided by p(3). 20 Let q(j) = -8j + 34. Let l be q(4). Suppose -lc - 216 - 22 = -4t, -77 = -t + 4c. Let s = -60 + 75. What is the remainder when t is divided by s? 12 Suppose -4z + 4j = -528, 99z - j - 386 = 96z. What is the remainder when z is divided by 29? 11 Let p(l) = l*2 - 2l - 3. Let r = 502 + -495. Calculate the remainder when p(7) is divided by r. 4 Let u(j) = 6j + 124. Let i be u(-24). Suppose -2l + 50 = -68. Calculate the remainder when l is divided by (-656)/i + 12/(-15). 27 Let p = 165 - 81. Calculate the remainder when (524/10)/(p/(-70))-3 is divided by 33. 32 Let g be -3 + 1 + 0 - 25. Let q = 44 + g. Let l = 3364 - 3335. Calculate the remainder when l is divided by q. 12 Let v = -23 + 49. Calculate the remainder when (7/14)/((-25)/(-2900)) is divided by v. 6 Let u be 1/(3(-4)/(-60)). Suppose -3w + 3l = 0, 0 = -4w + 2l - ul. Suppose 13t - 19t + 72 = w. Calculate the remainder when 35 is divided by t. 11 Let m = 10268 + -9762. What is the remainder when m is divided by 11? 0 Let j(c) = -4c*3 + 20c*2 - 2c - 12 + 3c3 + 3c3 - c3. Calculate the remainder when j(-20) is divided by 5. 3 Suppose 5u + 668 = -3v + 2391, 3v - 1726 = -2u. Suppose 0 = -3j + 4w - 6w + 347, w - v = -5j. What is the remainder when j is divided by 34? 13 Suppose -2g - 4k + 4 = -16, -5g = -5k + 25. Let t = 460 - 247. Suppose -2n + t - 71 = g. Calculate the remainder when n is divided by 36. 35 Let p(q) = -4q*2 + 2q - 3. Let a be p(-4). Let t be (-2431)/119 - (-3)/7. What is the remainder when (-12t/a)/((-1)/35) is divided by 19? 17 Suppose -b + 3s + 1822 = 0, -4b + 1292 = -2s - 6056. What is the remainder when 5524 is divided by b? 4 Suppose -1022 = 4s - s + z, 3s + 992 = 5z. Let r = s - -354. Calculate the remainder when 239 is divided by r. 14 Let n be (4/(-5))/2 - (-10778)/170. Suppose -a + 33 = -0a. Suppose 66s - ns - a = 0. Calculate the remainder when 32 is divided by s. 10 Suppose 205 = w - 2a, 0 = -5w + 4w + 4a + 189. Calculate the remainder when 3756 is divided by w. 220 Let a = -2153 - -2197. What is the remainder when 928 is divided by a? 4 Let i(a) = -14a2 - 141a - 1. Suppose 4t = -0t. Let g(m) = m*2 + 2m + 44. Calculate the remainder when g(t) is divided by i(-10). 8 Let h(z) = z - 8. Let a be h(4). Let b be 7(48/(-14))/a. Let m(k) = 4k - 21. Calculate the remainder when 10 is divided by m(b). 1 Suppose -x + 3g = -1540, 2g - 4675 = -58x + 55x. What is the remainder when x is divided by 40? 35 Let n(g) = -2g3 + 12g*2 + 435g + 27. What is the remainder when (36/(-8))/(2/(-68)) is divided by n(18)? 72	{ "pile_set_name": "DM Mathematics" }
9 - 2 - 3. 5 Evaluate 3 + -2 + 11 - 9. 3 What is -3 + 0 + (0 - -4 - 3)? -2 What is (9 - (1 + -2 - -5)) + -9? -4 What is -4 + (-14 - -3) + 8? -7 Evaluate (-7 - (-6 - 1)) + -5. -5 Evaluate -1 + 9 + -18 + 8 + 1. -1 What is the value of (-5 - -2) + 6 + -1? 2 What is (3 - 5 - (-1 - -1)) + 5? 3 What is 1 + 7 + 1 - 6? 3 What is -7 + 12 + -11 - -4? -2 What is the value of 9 - (4 + 3 + -3)? 5 Calculate 4 - -1 - (14 + (-32 - -24)). -1 Evaluate -9 + (-6 - (-21 - -7)). -1 Evaluate -7 - (-2 + 0 + 7 - 8). -4 What is the value of 2 + (-5 - -1) + -2? -4 What is (-2 - -2) + (13 - 14)? -1 Evaluate 10 - (13 + 1 - 15). 11 What is (4 - 10) + 7 - 4? -3 13 - 14 - (-1 + 4 + -2) -2 What is the value of -5 - -2 - 0 - (-2 - -1)? -2 Calculate -9 + 13 - (4 - 1). 1 What is the value of -5 + (-2 - -4) + 1? -2 3 - -12 - (1 + 6 + 0) 8 What is 0 + (2 - 6) + 4 - 2? -2 Evaluate (4 - 3) + 4 + -6. -1 Evaluate 4 + (-3 - (-4 - -1)). 4 0 - -6 - (-14 + 15) 5 What is (9 - (11 + -4)) + -6? -4 Evaluate 3 + 0 + -4 + 3 + -7. -5 Evaluate -6 - (-4 - 1) - (1 - 6). 4 -1 + -1 + (-6 - -4) -4 (-5 - 8) + 12 + (0 - -6) 5 Evaluate (6 - 11) + (-1 - -6) - -6. 6 What is 1 + -7 - (-1 - 6)? 1 What is -27 + 30 + (0 - 1)? 2 Calculate 10 - (17 + -3) - (1 - 5). 0 What is (-5 - -2 - 3) + (-4 - -4)? -6 -2 + 4 + 2 + -10 -6 What is (-1 - -8) + (6 - 10)? 3 Evaluate (1 - 7) + 9 - (0 + -1). 4 Evaluate (3 - -1) + (-7 - -20 - 8). 9 Evaluate 0 + (-2 + 0 - 2). -4 What is -4 + (22 + -19 - (0 - -1))? -2 Calculate -5 + 4 + 2 - (5 - 1). -3 What is (0 - -13) + (-58 - -52)? 7 What is 2 - 0 - (21 + 22 + -46)? 5 What is the value of -10 + 6 + (13 - 3)? 6 Evaluate 3 - ((2 - -1) + (-6 - -3)). 3 What is the value of 0 + -8 + 13 + -4 + 0? 1 -10 + (3 - 12) + 20 1 Calculate (0 - -2) + (16 - 15). 3 Calculate -2 + 4 + (3 - (0 - -10)). -5 -3 + (6 - 1) + -2 + -4 -4 Evaluate 14 + -6 + 2 - 2. 8 (13 - (-3 - -4)) + 17 + -23 6 Evaluate (-11 - -6) + -4 + 6 + -4. -7 What is the value of -4 - 0 - (3 - (4 + 3))? 0 What is 4 - (-4 + 8) - 4? -4 What is the value of 1 + (13 - 9) - (3 - -1)? 1 Calculate -9 + (-9 - -29) + -7. 4 What is 3 + -4 + (-6 - -2)? -5 What is -3 - (-3 - 5 - -10)? -5 What is -13 + (10 - (11 - (3 + 3)))? -8 What is the value of -4 + -5 + (10 - 4)? -3 Calculate (-1 - 7) + 5 - 1. -4 Calculate 10 + -17 + 1 + 9. 3 Calculate (1 - 2) + (121 - 126). -6 What is 1 - 3 - (-3 - -1) - -2? 2 -4 + (9 + -4 - (0 - -1)) 0 Calculate -1 - (6 - 13 - -4 - 7). 9 What is 0 - (0 - -7 - 4)? -3 1 - (45 + -37 + -6 + 0) -1 What is the value of 0 + 4 + (-1 - 6)? -3 What is -1 + (-3 - 1 - -3)? -2 What is -14 + (9 - 4 - (5 - 5))? -9 Calculate (1 - 3) + (-29 - -38) - 0. 7 What is 0 + (-1 - (5 - 10) - 0)? 4 What is -1 - (-1 - 1 - (1 + 0))? 2 (0 + -2 - -12) + 155 + -160 5 (0 - -1 - 2) + 8 + -7 0 What is the value of -10 + 11 + -1 + -1? -1 What is 19 - ((19 - -3) + -11)? 8 What is the value of (5 - 4) + 2 + 2? 5 What is -9 - (-1 + 0) - (-454 + 448)? -2 4 + (2 - 6) + 3 - 7 -4 -7 + (5 - 0) + (18 - 15) 1 What is -8 + (-23 - -23 - (-9 + 2))? -1 What is the value of (-3 - (2 + -2 + -1)) + 3? 1 Calculate -4 - 0 - (2 - 7). 1 Calculate 3 - (-4 - -11) - (-1 + -2). -1 Calculate (1 - -1) + 5 - 2. 5 Evaluate (0 - 2) + (2 - -1). 1 What is (-6 + -3 - -4) + (-3 - 0)? -8 Calculate (0 - 0 - 0) + 0. 0 Evaluate -12 + 2 + 2 + 6. -2 Calculate (2 - -4) + (2 - 0 - 4). 4 What is the value of 0 + (9 - 0) + (-6 - -1)? 4 Calculate -1 - (5 + -3) - 0. -3 What is the value of -3 + (3 - (-3 + 4))? -1 Calculate -6 + 0 + -4 - -11. 1 What is the value of 1 - (0 - -4 - 8)? 5 What is the value of (-2 + 7 - -3) + -2? 6 Calculate (-1 - -5) + (0 - 1 - -2). 5 Calculate -11 + (9 - 3) + 3. -2 What is the value of (-6 - -12) + (0 - 2) + -5? -1 Calculate -1 + -1 + 4 - (3 - 0). -1 Calculate 0 - -2 - (35 - 29). -4 What is the value of -92 + 92 - (4 + 1 - 1)? -4 Evaluate -39 + 50 + (-4 - -3). 10 Evaluate 7 - (-9 + 5) - 6. 5 Calculate -17 + 2 + 1 - -25. 11 What is 0 + 0 + 0 + (-22 - -25)? 3 Calculate (7 - 5) + 1 + -6. -3 Evaluate -3 - (1 + 4 - (2 - -12)). 6 What is (-3 - -3) + 3 + (-42 - -44)? 5 Calculate (79 - 79) + (1 - 1) + 0. 0 -2 - (-1 + 2 + -1 + 1) -3 1 - -1 - (-15 - -16 - -5) -4 Evaluate 1 - 10 - (16 + -22). -3 Evaluate (-11 - -5) + (0 + 3 - -1). -2 Calculate (1 - (-4 + -6)) + -14. -3 What is 0 - 10 - (-7 + -8)? 5 Evaluate -2 + 7 + -1 - (2 + -3). 5 What is -7 + (16 - 5) + -6? -2 What is the value of 3 - (0 + -3 - -2) - 2? 2 (-7 - -1) + 4 + -2 -4 Calculate (-3 - -4) + (3 + 1 - 0). 5 What is the value of 1 + 3 + (2 - 0 - 3)? 3 -4 - 6 - (4 - 7) -7 What is -14 + 3 + 1 + 6? -4 What is the value of (4 - (0 - -6)) + 4 + -1? 1 Calculate (9 - (-1 - -3)) + 2 + -4. 5 What is the value of 2 - (-9 - (-3 - 3))? 5 What is the value of -7 - (-8 - 1 - -6)? -4 0 + 1 - -5 - (14 - 10) 2 What is 7 + -9 + 6 - 6? -2 What is the value of (-2 + 4 - 4) + -4 - -15? 9 -3 + -2 + (9 - 4) 0 What is the value of 0 + -6 + -3 + 7 + -3? -5 What is the value of -1 + 1 + -3 - (-1 + -1)? -1 What is -7 + 4 + -1 + -1? -5 Evaluate -12 - (3 + (7 - 14) + 2). -10 What is the value of 5 + -3 + 1 + -1? 2 Evaluate (15 - 19) + -3 + 1 + 11. 5 What is the value of (-1 - -5) + -27 + 23? 0 What is the value of -4 - -5 - (-1 + 2)? 0 Evaluate 0 - -3 - (7 - 0). -4 What is the value of -2 + 5 + -2 + 4 + -2? 3 Evaluate (-2 - (6 - 2)) + 4 + 0. -2 -25 + 27 + (1 - -1) + -4 0 Evaluate 8 + (1 - 24) + 10. -5 What is the value of 6 + -9 + -7 - -7? -3 (2 - 0) + 2 + (4 - 8) 0 Evaluate 0 - 3 - (2 + -7 + 1). 1 What is the value of -4 + -1 - (60 + -57)? -8 Evaluate (4 - (4 - 0)) + -2. -2 What is 3 - 2 - (-48 + 53)? -4 Calculate -5 + (-1 - (1 + (-4 - 1))). -2 Calculate 4 - (-2 - (1 - 2)). 5 What is 0 - -8 - (4 + 1 + -4)? 7 What is the value of (-9 - -5) + 5 + 2? 3 What is -47 - -46 - (0 - -1)? -2 What is 4 - (8 + -2 + 10 + -15)? 3 Calculate -2 - 1 - -2 - (2 - -2). -5 Evaluate 4 + -2 + 4 + -1. 5 What is the value of -1 + ((1 - -1) + 5 - 1)? 5 (7 - 7 - -1) + -3 + -2 -4 What is (0 - (-2 + 0)) + (2 - -1)? 5 -2 + -3 + 4 + (-2 - -4) 1 -6 + 0 + 18 + -15 -3 What is the value of -3 + (3 - (1 + -6)) - 6? -1 -5 + 8 - -6 - 6 3 What is the value of -1 + 3 + 0 + 0? 2 -1 + 4 + -5 + 5 + 4 7 Evaluate 11 + -10 + 2 + -6. -3 Evaluate -3 - 5 - -4 - -4. 0 What is the value of 0 + (7 - 15) + -5 + 11? -2 What is -1 + 1 + -2 + (201 - 204)? -5 What is -9 + 5 + 10 + -8? -2 12 + -17 - (0 - 1) -4 Evaluate -2 + -1 + 9 - 1. 5 What is the value of 1 + -4 - (4 - 2)? -5 Calculate 0 - -1 - -3 - (14 - 10). 0 Calculate 4 + -5 + (-3 - -7) + 0. 3 Evaluate -5 - (-1 + -1 + -1). -2 What is -2 - (14 + -5 + -5)? -6 What is -2 + -3 - (-12 + 6)? 1 What is 3 + (3 - 1 - 2)? 3 8 + 2 + -2 - 3 5 Evaluate -14 - -18 - (2 + 3). -1 What is the value of (5 - (-4 + 8)) + -7? -6 What is 5 + 1 - (-4 + 7 + -2)? 5 Calculate 10 - (-55 + 62 - (-1 + 4)). 6 What is 1 - -3 - (3 - 2)? 3 Calculate (8 - (0 - 1 - 4)) + -4. 9 Calculate -11 + (3 - 8 - -7). -9 What is the value of (-1 - -7) + (-22 - -15)? -1 What is the value of -4 - (-1 + (3 - 3)) - -8? 5 -2 + (1 - -7) + (53 - 66) -7 What is the value of (1 - 0 - (3 - 4)) + -3? -1 Evaluate 6 + -4 - -3 - 6. -1 What is the value of -5 - (-2 + -5 - -2) - 4? -4 What is -8 + 1 - (30 + -33)? -4 What is the value of 6 + -2 + (41 - 44)? 1 Calculate -18 - -19 - (-3 + -2 + 1). 5 3 + -5 + -5 - -3 -4 Calculate 6 + 1 + -2 + 12 + -12. 5 Calculate 9 - ((-4 - 0) + 6). 7 -11 + 16 + -10 + 1 + 0 -4 Evaluate 4 + -1 + (-1 - 1 - 1). 0 What is (2 - -1) + 6 + -8? 1 Evaluate -21 - -6 - -1 - -11. -3 Evaluate 1 - (-1 + (1 - (-6 + 2))). -3 What is the value of -18 - (1 - 8) - -16? 5 Evaluate -6 - (-12 - (-7 + 8 + -2)). 5 What is 5 + 2 + (-45 - -35)? -3 Calculate (-11 - -15) + (-9 - (-9 - -4)). 0 What is the value of -7 - (-8 - (-2 + -5))? -6 Evaluate -2 + 8 + (-2 - 3). 1 Calculate 1 + -1 + 1 + 3 - 8. -4 Calculate 9 + 5 + -13 + -9. -8 Evaluate 4 + (-6 - 1) + 0. -3 What is (3 - 8) + 0 + 12? 7 Evaluate 4 - (-3 - (4 - 4)). 7 What is 6 + 1 + -12 + 1? -4 Evaluate 3 + 1 + -11 + 0 + 3. -4 What is (-4 - -2) + -9 + 7 + 6? 2 Calculate -4 - -2 - (-8 - -4). 2 What is (1 - 2) + (-1 - (4 - 6))? 0 What is 1 + 6 + (0 - 5) + 0? 2 Calculate 0 + -2 - (-21 - -23). -4 What is the value of -4 + 4 - (5 + -3 + -1)? -1 What is the value of 51 + -51 + 1 + -1? 0 -3 + 1 + (1 - (8 - 7)) -2 Calculate 1 - (10 + -9 + -1). 1 Evaluate -1 + (-2 - -4)	{ "pile_set_name": "DM Mathematics" }
5. Let g = -43 - -43. Let l be w(g). Solve -2k - 4i - 43 + l = 0, 0 = 5k - 2i + 10 for k. -4 Let y(x) = 4x2 - 74x + 218. Let j be y(15). Solve 8a + 2r = 7a - j, -2a + 4r = -8 for a. -2 Suppose 110o - 64o - 138 = 0. Solve 0 = -3s - 2q - o, 3s + 9 = 2s + 2q for s. -3 Suppose -6m = -40 - 56. Let q(g) = 9g - 32. Let p be q(m). Suppose 0 = 4y - 0y + 3k - p, -140 = -5y - 4k. Solve 2z + 25 = 3a, 12 = 5a - 3z - y for a. 5 Suppose -6 = -2u, -3u + 14 = d - 0u. Suppose 3f - 37 = 5s, 3f + f + s - 57 = 0. Let r be 3/4(f + -6). Solve c + z = -0z - r, 2c + dz + 27 = 0 for c. -1 Let d = 232 - 250. Let n be ((-27)/d)/(1/2). Solve 4f = -nm - 10, 7f = m + 2f - 22 for m. 2 Suppose 3n - 95 = -2o + o, 5o + 5 = n. Solve 29x - nx = -5h + 13, -2x - h = 4 for x. -3 Let h = -25364 - -25366. Solve -4m + hn = 0, 0 = 18n - 15n + 12 for m. -2 Let a = 6 - 2. Let m be 105/10 + 5/10. Solve -5b = -3j + 2 - m, aj - 8 = 0 for b. 3 Let i = 69 + -67. Suppose -21 = -z + x, -11z + ix = -10z - 23. Solve 5d - u + 19 = 0, -3d = -4d + 4u - z for d. -3 Let i be 6/(12/(-4)) + -280 - 4. Let o = i + 289. Solve -2z = -c + o, 0 = -5z + 5 for c. 5 Let p be -4(-3)/417. Suppose 57i = 56i - 46. Let q = i + p. Solve 5b + 3h + q = 0, -h = 4 + 1 for b. 2 Let x(o) = -o*2 + 15o + 157. Let y be x(22). Suppose yg + 19 = 2n, 3n - 8g = -4g + 26. Solve -2q = -3i + 18, 0 = i + ni + q - 9 for i. 4 Let p(r) = -r*3 - 16r - 8. Let v be p(6). Let j = v + 322. Solve -m = 2h + 9, -jm + 0m = -2h - 12 for m. 1 Let y = 1004 - 1004. Solve y = 4k - 0k - 3g - 16, k - 13 = 3g for k. 1 Let z(q) = -57q + 1088. Let x be z(19). Solve -3j + 15 = 5l, xj = 2l + 7j - 6 for l. 3 Suppose -10o + 33 = o. Let k be (4/(-4))/(o/(-6)). Suppose 2u = -s + 3, 0 = u - s - ks - 19. Solve 6p - 2p = 2n + 28, up + 3n = 8 for p. 5 Suppose 501f = 1006f - 1515. Solve -3h = -fu - 3, -21h + 2u = -18h - 2 for h. 0 Suppose -3b + 2b - 200 = -2v, 3b = -5v - 600. Let f = 203 + b. Solve -4o = 3c + 11, 0c = -5c + fo + 1 for c. -1 Let r be (1 + (-3)/3)/(-2). Suppose -3s - 7s + 40 = r. Solve 2d + 10 = -5o, -29 = 5d + 3o - s for d. -5 Suppose 11v + 11v = 528. Let g = -702 - -702. Solve 3y + 3i + v = g, 5 = -i - 0 for y. -3 Suppose 35 = -17943h + 17948h. Solve -g = 3o - 47 + 54, 5o = -4g - h for g. 2 Suppose 0 = -k + q + 24, -3q + 36 = -403k + 406k. Solve -21o = -ko + 4d + 12, 15 = 4o - 5d for o. 0 Let h = -136 + 140. Let w be (-3)/(-3)h + -2. Suppose 5v = 5m - 65, -2m + 5v + 26 = wv. Solve 5l = -4t + m, -4l - t + 19 - 2 = 0 for l. 5 Suppose z + 6306v - 6308v = -10, -2z - 2v = -10. Let b be 15/6 + (-2)/4. Solve z = bd, -5d = -2a - 2d - 10 for a. -5 Suppose -16z - 3o = -19z + 36, -2o = 2z - 56. Solve 0 = -3n + 2c, -90n + 88n - 2c - z = 0 for n. -4 Suppose -2x - 4p - 24 = 0, 5p + 25 = -0x - 5x. Solve xl - 8 = 3h, -h - 4l = -2l for h. -2 Let v(k) = k3 - k2 - 22k + 51. Let b be v(4). Let y be (1 - 1)(-6)/12. Solve -5n + b = -2w - 4, -w - n + 10 = y for w. 5 Let h = -51 + 96. Let z(q) = -q*3 + 5q*2 + q + 51. Let g be z(7). Let d = g + h. Solve o - 14 = 5l + d, -3l = 2o + 1 for l. -3 Suppose -1040k = -971k - 345. Solve -2j = -kf - 16, -2 = 3j + 4 for f. -4 Let g = -18465 - -18472. Solve 5d = -w + 23, -gw = -4d - 8w + 18 for d. 5 Suppose 75u - 77u + 933 = 5g, 0 = 3u - 27. Solve -5s + 188 - g = 0, 5s = 5x for x. 1 Let g(s) = -9s2 + 8s + 3. Let a be g(1). Solve -l = 3v + l + 15, -3v + al = 3 for v. -3 Suppose 6l = 10l. Suppose -5d = -11d + 18. Let w = l + d. Solve -21 = -2i - 2i + 5s, 0 = -3s - w for i. 4 Suppose -89a = -3q - 94a - 2, 0 = 5q + a - 26. Solve -p = -9l + 13l + q, -3p - l = -4 for p. 2 Let u(y) = y*3 + 6y*2 + 6y + 50. Let a be u(-6). Solve -ai = h - 16i, 3i = 4h + 10 for h. -4 Suppose -15f - i = -14f - 2, 4i + 13 = 3f. Let r(j) = -4j + 20. Let q be r(4). Solve fg - 3 = -2c - c, c - 1 = qg for c. 1 Suppose 3u = 2i - 1, 5u + 792i = 795i. Solve -uk = 3g + 10 - 31, 0 = 5k - 5g - 15 for k. 5 Let i be (-3)/(-9)2-6. Let t be ((-11)/(-11))/((-2)/i). Solve 2k = 4w - 2k, -tk = -4 for w. 2 Suppose 5z = 8z - 345. Let o = -113 + z. Solve 0 = -3n - o - 1, 0 = l - 4n - 1 for l. -3 Let q be -12(-2 + 63/36). Solve 0 = -n - 3, 3 = -qv - 0v - 3n for v. 2 Let o(x) = x2 - 180x + 1381. Let j be o(8). Solve -5 = 4u - jm, 4u = 4m + 5 - 9 for u. 0 Let s = -36573 - -36576. Solve sv = u + 16, -7u + 2u - 2v = -5 for u. -1 Let j(w) = 11w + 66. Let v be j(-6). Suppose v = 344d - 347d. Solve -4g - 3t + 24 = -dg, -t = -5g + 11 for g. 3 Let g be ((-1)/(-1) - 1)-1. Let r be (25 + -7)1/2. Suppose -rm + 4 + 14 = 0. Solve g = -2l + mj - 4, j = 3l - 0j + 4 for l. -1 Suppose -1114y = -983y - 262. Solve 2u - 39j + 21 = -42j, u - yj = 7 for u. -3 Let z(l) = -13l - 89. Let v be z(-7). Let c = -5 - -15. Suppose -11 = -y + c. Solve j = -vj + 2s + y, 4s = 2j - 22 for j. 5 Let d be (-350)/(-56) + 1/(-4). Let t be (-510)/2510/(-4). Let n be (-238)/td/(-7). Solve p + n = 3m, 3p - 2 = -4m - 1 for m. 1 Let r be -6 - (5 + (6 - 21)). Suppose 0x + x - 2 = -n, 3n + r = -x. Solve -2c - xs - 20 = 0, 4c - 1 + 15 = 3s for c. -5 Suppose 3l + 15 = 0, 3i + 16l - 11l - 32 = 0. Suppose 12 = -4t - 0. Let y = t + i. Solve 2j + 4 = w, -4w + j = 2j - y for w. 4 Let z = 2894 - 2890. Suppose 0 = 2g + 2 - 8, 4g - 16 = -h. Let c be (0 - 2/h)-8. Solve 2k = -3q + 22, k = -zq + ck + 1 for q. 4 Let j = -9 - -164. Let f = j - 155. Solve 2r + 2 = 2b, fb + 4 = b for r. 3 Let i be 1/11(96 + -63). Solve -il - n = 15, -2l = -2n - 0 + 10 for l. -5 Suppose 0 = 13d - 0d - 26. Suppose 2m - dj - 18 = 0, -2m - 5j - 6 = -j. Solve 0 = -2q - 5z + 17, -4q + m = -9q - 3z for q. -4 Let r be 630/50(-200)/(-48). Solve 0 = -3k - 34w + 30w + r, 5k - 25 = 2w for k. 5 Let t(y) = -y*3 + 7y - 7. Let l be t(3). Let c = l + 10. Let a be (((-6)/9)/(-2))/(c/(-36)). Solve -a = 2d + 2d + o, -3o = 0 for d. -1 Let f be 0 + (-4)/(3 + -4). Suppose fp + 3s - 172 = 0, p = s + 15 + 35. Let h = -43 + p. Solve -4l - hc + 30 = 11, -3c = -3l - 12 for l. 1 Let l(s) = s2 + 13s - 15. Let g be l(-15). Let v be 125/30 + (-102)/(-36) + -3. Solve 18 = 3x - 3r, -5x + g = vr + 3 for x. 4 Suppose 2m = -3f + 30, -8f = -7f + 6. Solve 3a - m = -2u, 5a = -u - 8 + 41 for u. 3 Suppose 41k + 165 = -32k + 457. Solve -9o + k = -7o, 5d + 4o = 8 for d. 0 Let g = -4260 - -4272. Solve 5u - 3w + 49 = g, u - 11 = -4w for u. -5 Let x(y) = -5y2 - 21y - 67. Let w(t) = 9t2 + 42t + 136. Let k(h) = 3w(h) + 5x(h). Let r be k(-5). Solve r = 2u + 5b, 4u = b + b - 12 for u. -1 Suppose 5 + 4 = 3n. Let m(g) = 4g - 15. Let b be m(5). Suppose 5x - 25 = 0, -6o + bo - 4 = -3x. Solve -5d = -l + o, -6l + nd = -l - 11 for l. 1 Suppose 0 = 3q - 5a + 2a + 705, -4a = 2q + 458. Let y = q - -334. Let b = 135 - y. Solve -j = -4h + 5, 5h = 4j + b - 14 for j. -5 Let y = 261 + -125. Let i = y + -122. Solve -n - 5o - i = -0n, 3o + 14 = 5n for n. 1 Let g(i) = 4i3 - 39i*2 + 2i - 107. Let y be g(10). Solve -4j = 2h - 3 + y, -2j = -2h + 14 for h. 3 Let m = 8 - 6. Suppose -44b + 39 = -57b. Let p be m(-2 - b/1). Solve -4j = s + 3, 4 = j + 2j + ps for j. -2 Suppose -3a + 2a = -45. Let v be (-7 - 13)/((-14 - -3) + 7). Solve -h - 5 = 0, 0 = -4o - vh - a + 16 for o. -1 Suppose -57o + 53o - g + 34 = 0, 2o + g = 18. Solve 5t + 32 - o = -p, -36 = 5p + 4t for p. -4 Suppose -77 = -24d + 115. Suppose t = 4u - d, 0t - u + 15 = 3t. Solve 0 = j + tc + 17, 3j = c + 9 + 5 for j. 3 Suppose -617 + 567 = -25i. Solve 0 = -5y - 2w + 35, -3w + 30 = iy + w for y. 5 Suppose -8 = 5h + z - 28, -5h + 2z + 20 = 0. Solve -3p = -hp + 4u + 12, 0 = 2p - 3u - 9 for p. 0 Suppose 0 = 8z - z - 7. Let i(g) = g*3 - 4g*2 - 6g + 7. Let v be i(5). Let f = 11 + -11. Solve -t + 3t = 3l - z, f = vl - t - 1 for l. 1 Suppose 0 = -3u + 2o - 26 + 10, -4u - 23 = -3o. Let z be (-4)/u + (-40 - -46). Solve -y = -2t - z, -2 + 17 = -3*t for y. -2 Let d = -94 + 83. Let u be (-2)/d + 16116/(-187). Let	{ "pile_set_name": "DM Mathematics" }
by 13. 7 Let m be -14 - (2/(-7) + (-2)/(-7)). Let s(u) = u*3 + 15u*2 + 12u - 2. What is the remainder when 89 is divided by s(m)? 11 Let w = -37 - 75. What is the remainder when 14 is divided by (-42)/w - 45/(-8)? 2 Let y(k) be the first derivative of -15/2k2 + 12 + 6k. Calculate the remainder when y(-7) is divided by 23. 19 Let g(t) = 140t + 540. Let x be g(-10). Let q = -783 - x. Suppose 3r - 26 = 37. What is the remainder when q is divided by r? 14 Suppose 5u = -2y + 349, 2u - 529 = 2y - 5y. Suppose -y = -5f + 3m, -3f = -8f - 3m + 153. What is the remainder when f is divided by 4? 1 Calculate the remainder when 2 - (-1341)/9 - (-2 - 0) is divided by 32. 25 Let x(r) = 5r3 - 4r*2 + 10r - 7. Let m(b) = -3b2 + 15b - 9. Let y be m(4). Let k = -12 + 43. What is the remainder when x(y) is divided by k? 29 Suppose 0 = -8b - 89 + 449. Suppose -83 = -8c + b. Calculate the remainder when 30 is divided by c. 14 Suppose -701 = -2q + 5g, 633 = 3q - 5g - 426. What is the remainder when 1753 is divided by q? 321 Let p(k) = 24k2 - 14k - 12. Let f(a) = -a*2 - a - 2. Let o(n) = f(n) + p(n). What is the remainder when 88 is divided by o(-1)? 16 Suppose -6b - 75 = -9b - f, -15b + 5f = -315. What is the remainder when 398 is divided by b? 7 Suppose 0 = -49j + 37j + 36. Suppose 0 = -r - r + i + 129, -i - 194 = -jr. What is the remainder when r is divided by 23? 19 What is the remainder when ((-12)/(-66) - 0)/(-1) + (-127450)/(-22) is divided by 28? 25 Suppose 3h - 13 - 11 = 3l, -2h = -4l - 32. Let k be 1/(-4) - (-14)/l. What is the remainder when (7 + -5)(-25)/k is divided by 7? 4 Suppose 2d - 3 = f, 0f - 5d + 5 = -3f. Suppose 0 = fg - 1093 + 508. Calculate the remainder when g is divided by 41. 35 Let k(l) = l*3 + 10l*2 - 132l - 520. Calculate the remainder when k(-16) is divided by 9(0 + (-4)/(-6)). 2 Let k(m) = 63m - 211. Suppose -76w = -77w + 10. Calculate the remainder when k(w) is divided by 84. 83 Suppose -158 - 208 = -9i - 24. What is the remainder when 371 is divided by i? 29 Suppose 0 = 2c + 45 + 133. What is the remainder when 59 is divided by c/(-5) - 14/(-315)-18? 8 Suppose -3k = -4k + 149. Calculate the remainder when k is divided by (-8)/360-10 - (-7)/(378/312). 5 What is the remainder when 2014 is divided by 2(675/18 + 3)? 70 Let m(v) = -101v + 2807. Calculate the remainder when 1308 is divided by m(27). 28 Suppose 0 = -4d + 5g + 70 + 1101, -4d - 3g = -1179. Calculate the remainder when 299 is divided by d. 5 Suppose 0 = 2z - 3p - 153, -396z + 393z + 4p + 231 = 0. What is the remainder when 578 is divided by z? 11 Calculate the remainder when (-8)/(-18) - 578221/(-1017) is divided by 45. 29 Let b(v) = -51v*2 + 362v + 7. What is the remainder when 2911 is divided by b(7)? 13 Let m be (-165)/(-22)(-34)/3. Let a = 91 + m. Suppose -12 = -3k, -6x + x + 3k + 73 = 0. What is the remainder when x is divided by a? 5 Suppose 5v - 2q + 1008 = 15810, 3v - 8875 = -5q. Suppose 24h - v + 1064 = 0. What is the remainder when 313 is divided by h? 76 Let z = -55 - -159. Let a(n) = -n3 - 69n*2 - 258n + 185. Calculate the remainder when z is divided by a(-65). 49 Let t = 105 + -347. Let k = -202 - t. Calculate the remainder when 114 is divided by k. 34 Let q = 3975 - 3841. What is the remainder when 407 is divided by q? 5 Suppose 38i - 7657 = 1349. What is the remainder when 7108 is divided by i? 235 Let b(n) = -2n*3 - 25n*2 + 22n + 180. Calculate the remainder when 13353 is divided by b(-13). 60 Suppose -2h + 99 = -h + 3y, -3y = -12. Let w = 749 + -999. What is the remainder when h is divided by (-96)/(-20)w/(-40)? 27 Let z(x) = -11x2 - 93x + 138. What is the remainder when 3377 is divided by z(-8)? 173 Let w = 289 + -169. Let l = w + -15. Calculate the remainder when l is divided by 6. 3 Suppose 0 = -d + 3d - 24. Suppose 15w - 20 = dw + 5h, 5h = -2w + 55. Calculate the remainder when 117 is divided by w. 12 Let w = 1030 - 862. What is the remainder when w is divided by 30? 18 Let d = -16577 + 16887. Calculate the remainder when d is divided by 294. 16 Let a be (-1981)/(-35) + 2/5. Suppose 2g - 75 = a. What is the remainder when g is divided by ((-1610)/(-42))/((-15)/(-9))? 20 Let r(a) = 3a*2 + 7a - 7. Suppose 1033 = 13u + 383. Suppose -5h + u = -4o, -2o = 3h + 2o - 30. What is the remainder when r(-6) is divided by h? 9 Let f(y) = -4y3 + 0y + 3y3 + 17y*2 + 6 + 8y + 0y. Calculate the remainder when f(17) is divided by 29. 26 Suppose 30m - 4599 = 16581. Calculate the remainder when m is divided by 145. 126 Let s = 51 + -46. Suppose sa + 25 = 4m, 4m - 3a - 24 = a. Suppose -8c = -mc - 24. Calculate the remainder when 28 is divided by c. 4 Let q be (80/(-15))/(-4)39. Suppose 2c = -18 + q. Let g(x) = x*2 + 5x - 92. Calculate the remainder when g(-16) is divided by c. 16 Let l = -68 - -92. Suppose -11t = -l - 42. Suppose -to + 170 = 4o. Calculate the remainder when 26 is divided by o. 9 Let m be 829/3 - ((-40)/(-30) - 1). Suppose -5p + m = 7p. Calculate the remainder when 804 is divided by p. 22 Let g(v) be the first derivative of -v3/3 + 25v*2/2 - 65v + 85. Calculate the remainder when 67 is divided by g(21). 10 Suppose 2h = 3z + 50247, -5h - 735z + 125600 = -740z. Calculate the remainder when h is divided by 52. 49 Suppose 6809 = 10c - 2971. Suppose -10i + 13i = c. Calculate the remainder when i is divided by 22. 18 Let k = 2161 + -2097. Suppose 2r - r = -2, -2q - 4r = -26. Calculate the remainder when k is divided by q. 13 Let d = 33 + -7. Let o = 163 + d. Let k = -965 + 1013. Calculate the remainder when o is divided by k. 45 Let w = -12449 + 12463. What is the remainder when 418 is divided by w? 12 Suppose n = 4n + 12. Let h be n + 150/35 - 3387/21. Let i = 0 - h. What is the remainder when i is divided by 18? 17 Let g = 7200 + -6646. Calculate the remainder when g is divided by 16. 10 Let t(w) be the first derivative of 64w3/3 - 3w*2/2 - 2w - 16. What is the remainder when t(-1) is divided by 6? 5 Suppose -6h = -b - 2h - 342, 0 = -2b + 5h - 693. Let q = -347 - b. What is the remainder when (-3 - (-2 - -1)) + 19 is divided by q? 3 Let f be 14/7 - (-2 - 1). Let x = 21 - 2. Let t = f + x. Calculate the remainder when t is divided by 10. 4 Let h(n) be the second derivative of n*4/12 + 7n*3/6 + 7n*2 + 29n. Let p = 26 - 11. What is the remainder when p is divided by h(-5)? 3 Let n be (-560)/91 - (22/26 + -1). Let a(s) = 3s2 + 8s + 59. Calculate the remainder when a(n) is divided by 24. 23 Let d = 265 - 178. Suppose dr = 94r - 42. What is the remainder when 21 is divided by r? 3 Suppose -3341 = -44s + 14567. What is the remainder when s is divided by 7? 1 Suppose -80s = 20s - 12700. What is the remainder when 181 is divided by s? 54 What is the remainder when 160 is divided by ((-4)/10 - (-3 - 2440/100)) + 2? 15 Suppose -12n + 2141 = 1577. What is the remainder when 416 is divided by n? 40 Let i(m) = 8m2 - 269m - 8699. What is the remainder when i(-37) is divided by 55? 51 Calculate the remainder when (-2)/(-16) - -1090133/304 is divided by 28. 1 Let x(h) be the second derivative of 21h*3/2 - 169h*2/2 + 99h. Calculate the remainder when x(4) is divided by 7. 6 Suppose 589806 = -1652q + 5558q. What is the remainder when q is divided by (1 + -3)/(1/(-25))? 1 Let o(r) = 3r. Let w(i) = -14i. Let d(u) = -21o(u) - 4w(u). Calculate the remainder when (2/(-8))/1 + (-770)/(-40) is divided by d(-1). 5 Let r = 13551 - 13494. Calculate the remainder when 748 is divided by r. 7 Let b(o) = 809o - 730. What is the remainder when 1743 is divided by b(1)? 5 Suppose -5d + 4y + 112 = 0, 1028d - 1024d = -2y + 126. Let j = -121 + 221. Calculate the remainder when j is divided by d. 16 Suppose -5 + 12 = h. Suppose -h = -c + 6. What is the remainder when 128 is divided by c? 11 Let v = -2200 + 2699. What is the remainder when v is divided by 40? 19 Suppose 0 = 10f - 4f - 42. Suppose -4b - 164 = -4o, fo + b - 76 = 5o. Calculate the remainder when 73 is divided by o. 34 Suppose -928d = -922d - 114. Calculate the remainder when 538 is divided by d. 6 Let t(x) = 25*x	{ "pile_set_name": "DM Mathematics" }
the greatest common divisor of x and 2265. 15 Let j(t) = t*2 - 63t + 1007. Let k be j(32). What is the highest common factor of 1185 and k? 15 Suppose n + 672 = 15n. Calculate the greatest common divisor of n and 112. 16 Let m(h) = 613h2 - h. Let d be m(1). What is the greatest common factor of 12 and d? 12 Let i be (-5 - 0)/((-3)/(-99)). Let r = i + 235. What is the greatest common divisor of r and 175? 35 Let m(y) = -y2 + 6y - 2. Let f be m(3). Let z = -2 + f. Suppose -23 + z = -a. What is the highest common divisor of a and 90? 18 Let d = -756 + 856. What is the highest common factor of 450 and d? 50 Let m be 6/4(2 + (-280)/(-6)). Suppose 0x + m = 3x + 5t, 5t = 25. Calculate the greatest common factor of 12 and x. 4 Let m(t) = -66t + 2. Suppose -k - 8 = -5k. Suppose -kd + 5i = -1 + 3, 5 = -5d + i. Let n be m(d). What is the highest common divisor of n and 17? 17 Let b be (-23)/((4/(-10))/(728/70)). What is the greatest common divisor of 46 and b? 46 Suppose 5f - 5x = 145, -109 = -4f - 4x + x. Calculate the greatest common factor of f and 119. 7 Let i(b) = 2b3 - b2 - 4b - 4. Let o(y) = y3 + y2 - y - 1. Let h(m) = i(m) - 3o(m). Let g be h(-4). What is the highest common factor of g and 3? 3 Suppose g = -4j + 342, -4j + g + 31 + 315 = 0. Calculate the greatest common divisor of j and 473. 43 Suppose -19j + 24 = -13j. What is the greatest common divisor of j and 116? 4 Suppose 2u + u = -4p + 51, u + 40 = 5p. What is the greatest common divisor of 45 and p? 9 Let o = 105 - -1111. What is the greatest common divisor of 76 and o? 76 Suppose -117i = -95i - 880. What is the highest common divisor of i and 36? 4 Let c = -885 - -906. Calculate the greatest common divisor of 57 and c. 3 Let g(b) = b2 + 12b - 11. Let u be g(-11). Let v = u + 28. Let f be (-4)/5(-1 - 29). What is the greatest common factor of v and f? 6 Let z be 16270/55 + 5 + 106/(-22). What is the highest common factor of z and 185? 37 Let f be -2((-65)/(-39) - (-1978)/(-6)). Calculate the greatest common divisor of f and 32. 16 Suppose 60r - 543 = -9r + 1251. Suppose 2p - 6p + 416 = 0. Calculate the greatest common divisor of p and r. 26 Let b(s) = 199s2 + 2s - 3. Let f be b(1). What is the greatest common divisor of f and 72? 18 Let g(f) be the third derivative of -f4/6 + f3/6 + 6f2. Let z be g(-6). Suppose -6a - 825 = -9a. Calculate the greatest common factor of a and z. 25 Let y = -244 - -322. Calculate the greatest common divisor of y and 195. 39 Let m(v) = -3v*2 + 4v*2 - 9 - 1 + 0v*2 - 2v. Let k be m(-10). Suppose 4s + 3 - 91 = 0. What is the highest common divisor of s and k? 22 Let p = -65 + 40. Let l be p - (-3 + (-12)/(-3)). Let r be (l + 2)(-14)/21. What is the greatest common factor of r and 16? 16 Let s be 29 + 326 - 12. Let f(o) = 11o*2 - 3o + 3. Let q be f(-4). Let t = s - q. Calculate the highest common factor of t and 18. 18 Let m = -12 - -20. Let w(r) = -2r2 + 2r. Let f(h) = 5h2 - 3h. Let c(y) = 4f(y) + 7w(y). Let p be c(-4). What is the greatest common factor of p and m? 8 Let w be ((-1)/3)/(1/33). Let p be 72/(-16)(-1 + w). Calculate the highest common divisor of 27 and p. 27 Suppose a + 4r = 68, 3r - 6r - 68 = -a. Calculate the highest common divisor of 51 and a. 17 Suppose -2v + 4239 - 1723 = 0. What is the highest common divisor of 74 and v? 74 Let a = 141 - 76. Suppose 5y - a = -3i, -3y + 52 = y + 4i. Suppose -5w = -3w - 104. Calculate the greatest common factor of w and y. 13 Let z(k) = -12k - 1. Let u be z(-6). Let d = 92 - u. Calculate the greatest common divisor of d and 126. 21 Suppose j - 1 - 10 = -3v, 9 = 2v - j. Calculate the greatest common divisor of 148 and v. 4 Let f be (-132)/(-8)64/6. Suppose f + 156 = x. What is the greatest common factor of x and 37? 37 Suppose -36 = -2t + 2r, t - 3r - r = 18. Suppose -5o + 1132 = g + 324, 0 = -3o - 4g + 478. Calculate the greatest common factor of o and t. 18 Suppose 35 = 4w - 13. Suppose 8k - 1440 = -7k. What is the highest common factor of k and w? 12 Let h = -10278 + 10281. Let j be -8(18/(-4))/3. Calculate the highest common divisor of h and j. 3 Suppose h + 759 = 2y, -2y + 744 = -0y + 4h. What is the highest common divisor of y and 42? 42 Let x = 18 + 8. Let m be 2/4(17 - 17). Let p = m + 13. Calculate the highest common divisor of x and p. 13 Let m = 2 - -9. Let k be m414/28. What is the highest common divisor of 2 and k? 2 Suppose 129 = 5m - 4u, 34u - 2 = 36u. Calculate the highest common divisor of m and 200. 25 Let v = 52 - 50. Suppose t + 4n = 73, -n = -vt + 52 + 112. Calculate the greatest common divisor of t and 54. 27 Let y be (-4 + (19 - 9))2/6. What is the greatest common factor of 21 and y? 1 Suppose 7d - 9d + 508 = 4g, d - 4g - 272 = 0. What is the highest common factor of d and 715? 65 Let j = -213 - -390. What is the greatest common factor of 649 and j? 59 Let b = -4 + 12. Let p = -224 + 225. What is the highest common factor of b and p? 1 Let b = -75 + 97. What is the greatest common divisor of 121 and b? 11 Let s(o) be the third derivative of -23o6/10 - o5/20 - o4/12 - 26o*2. Let l be s(-1). What is the highest common factor of l and 11? 11 Suppose d - 15b = -11b + 10, 3b + 75 = 3d. Calculate the highest common factor of 20 and d. 10 Suppose -g = -z - 9, -4g - 64 + 9 = 3z. Let f = z - -19. Suppose 13h - 99 = -21. Calculate the greatest common divisor of f and h. 6 Let a = -78 - -78. Suppose -2p = 3i - 144, -4p - 3i + 75 + 201 = a. Calculate the highest common factor of p and 6. 6 Suppose -3l + 280 = 2l. Suppose 7y - 6y + 8 = 0. Let i be (-26)/(-2) + (y - -9). Calculate the greatest common divisor of i and l. 14 Suppose -p + 5j - 2 = 0, p - 3p = -4j + 4. Let y be (-62/(-18))/(p/(-27)). What is the greatest common factor of y and 2? 1 Let z = -33 + 110. Calculate the greatest common divisor of z and 7. 7 Let v = 6 - -20. Let y(q) = q*3 - 17q2 + q - 134. Let n be y(18). What is the highest common divisor of v and n? 26 Let u(h) = -h2 + 9 + 6h2 - 4h*2. Let f be u(3). What is the greatest common divisor of 54 and f? 18 Let l(z) = z + 7. Let f be l(-6). Let b be ((-4)/8)/((-4)/56). What is the greatest common factor of f and b? 1 Let u(g) = 26g - 1. Let m be u(3). Let k = -38 + m. What is the highest common factor of 13 and k? 13 Suppose -8 = 2z, 5u - 4z - 13 = 8u. Let j be (-2)/(-4)14/7u. Calculate the highest common divisor of 25 and j. 1 Suppose 6g - 2g = 216. Let y(l) = 9l - 5. Let h be y(12). Suppose 3k = w + h, 3w = k - w - 16. What is the highest common divisor of g and k? 18 Let j(q) = q3 - 8q*2 + 10q - 19. Let f be j(8). Let n = 75 - f. Calculate the greatest common divisor of 7 and n. 7 Let h(y) = y*3 + 5y*2 + 4. Let x be h(-5). Let m(g) = -x - g + 6g - g*2 + g. Let q be m(3). Calculate the greatest common factor of 40 and q. 5 Let l(o) = -2o + 2. Let g be l(1). Suppose -10 = -p - 0j - 2j, -j - 2 = g. Calculate the greatest common divisor of p and 126. 14 Let h(f) = -8f - 29. Let p be h(-4). Suppose 0w - pw + 4i + 10 = 0, -10 = -5i. What is the highest common divisor of w and 24? 6 Let g = -2013 + 2679. What is the greatest common divisor of g and 37? 37 Let c(l) = 14l - 8. Let v be c(4). Calculate the greatest common divisor of v and 64. 16 Let a(j) = -j*2 - 33j - 9. Let t be 2(-47)/4 - (-1)/(-2). Let w be a(t). Let n be (-1 - 22)/(1 - 2). What is the greatest common divisor of w and n? 23 Let z be (-4)/62946/(-4). Suppose 171 - z = -10r. Calculate the greatest common divisor of r and 4. 4 Let k(t) = 3 + 13 - 6t - 20. Let q be k(-1). What is the highest common factor of q and 18? 2 Suppose 0 = j + p + 2, p = -5j - 0p + 6. Suppose -jy = -3y. Let m = y - -2. What is the greatest common factor of m and 1? 1 Let a be (-17 + 1)((-2500)/80)/25. Suppose 0 = 5v - 2m - 38 - 116, 4v + 3m = 114. What is the greatest common divisor of a and v? 10 Let x(i) = -10i - 57. Let q be x(-7). Calculate the greatest common factor of 104 and q. 13 Let w(n) = n + 7. Let a be w(-3). Let j = -309 - -353. What is the highest common divisor of a and j? 4 Suppose -6 = -3z, -18z + 17*z + 702 = 4	{ "pile_set_name": "DM Mathematics" }
ber? False Is 1372799 a composite number? False Is 817790527 prime? True Is 12500419 composite? False Is 425815487 a composite number? False Is 32734077 a composite number? True Is 20587579 a prime number? False Is 32116891 a prime number? False Is 9532381 a prime number? False Is 176849 a composite number? False Is 2733389 prime? False Is 1639706 a prime number? False Is 8440879 a composite number? True Is 82844231 prime? False Is 864659 a composite number? True Is 7239853 a prime number? False Is 71782049 a composite number? False Is 67602289 composite? True Is 75443 prime? False Is 15029347 a prime number? True Is 592897 composite? False Is 1099619 composite? False Is 36503323 a prime number? False Is 57282545 composite? True Is 1228837 a prime number? True Is 34256609 a prime number? True Is 35224907 composite? False Is 56011 a prime number? False Is 40597483 composite? False Is 1147297 a composite number? False Is 5363977 composite? False Is 5693185 composite? True Is 18954907 prime? True Is 1324187 prime? True Is 21611699 a composite number? True Is 51473999 a prime number? True Is 28034687 a composite number? True Is 4500401 composite? False Is 103042685 prime? False Is 186171439 prime? False Is 1305259 composite? True Is 880537699 prime? True Is 27582479 a prime number? False Is 10909231 a prime number? True Is 1479407 a composite number? True Is 34745863 composite? True Is 542407 composite? True Is 11643791 prime? True Is 158262257 prime? True Is 15377341 prime? False Is 4292131 prime? False Is 63807853 a prime number? True Is 31025143 a prime number? True Is 22308653 a composite number? False Is 64139 prime? False Is 65821993 a prime number? False Is 12300751 composite? False Is 90789187 a composite number? True Is 11706347 prime? False Is 312819007 composite? False Is 6193093 prime? True Is 288024701 a prime number? True Is 187743473 prime? False Is 905405 composite? True Is 31619 a composite number? True Is 107049551 prime? False Is 1550221 a prime number? True Is 116467811 composite? False Is 126702011 a prime number? True Is 6061421 a composite number? False Is 704426317 a composite number? True Is 21712819 composite? False Is 7722699 a composite number? True Is 15049499 a prime number? True Is 7650791 composite? False Is 3553601 composite? False Is 13725977 a composite number? False Is 6181223 composite? False Is 2750126 prime? False Is 1925269 composite? True Is 11586119 a composite number? False Is 24914614 a composite number? True Is 17289611 a composite number? False Is 106036531 a composite number? True Is 225034799 prime? False Is 140136577 a prime number? False Is 16749367 a composite number? False Is 1317737 a prime number? False Is 268648647 a prime number? False Is 993511 prime? False Is 9230867 a composite number? False Is 34114363 a composite number? False Is 30885178 a composite number? True Is 5033677 a composite number? True Is 182659181 composite? False Is 1355831 prime? True Is 387223 composite? True Is 545663 prime? True Is 5821637 composite? False Is 9603199 composite? True Is 61566157 prime? True Is 2854763 composite? False Is 394123 prime? True Is 12208181 prime? False Is 206355557 prime? True Is 13775557 a composite number? True Is 837569 prime? False Is 294719611 composite? True Is 3533567 a composite number? True Is 8898391 prime? True Is 32288413 a composite number? False Is 357047 a composite number? False Is 6543919 a prime number? False Is 6315359 prime? False Is 858167 a composite number? False Is 139989121 a composite number? False Is 73301041 composite? True Is 28928455 a composite number? True Is 74058389 prime? True Is 215878363 a composite number? False Is 103825877 a prime number? False Is 15110177 prime? False Is 3114737 a prime number? False Is 1461197 composite? True Is 18310823 composite? False Is 11740967 a composite number? True Is 14143511 a composite number? True Is 12576757 composite? False Is 132433283 prime? True Is 494820763 a composite number? False Is 262084627 a prime number? False Is 31962607 a composite number? False Is 59038207 prime? True Is 4592387 prime? False Is 530981 a composite number? True Is 30321887 composite? False Is 86461463 a composite number? True Is 421955119 prime? True Is 51047929 a prime number? True Is 6963179 a prime number? True Is 1872781 a prime number? False Is 289907 prime? False Is 3738091 a prime number? False Is 11987245 composite? True Is 6406051 a composite number? False Is 112295501 a prime number? False Is 91624523 a composite number? False Is 5963857 prime? True Is 12777041 prime? True Is 2385907 prime? True Is 908053 a prime number? True Is 51480911 a composite number? False Is 1034179 a composite number? True Is 2430061 prime? True Is 68867921 a composite number? False Is 36700913 a composite number? True Is 2157553 a composite number? True Is 9571547 composite? False Is 523314359 a composite number? True Is 48840709 composite? False Is 155117717 composite? False Is 1304789777 composite? True Is 4032947 a prime number? True Is 43012317 composite? True Is 206009 a prime number? True Is 1849949 composite? True Is 659453 a prime number? True Is 4921915 composite? True Is 8033779 composite? True Is 131723 prime? False Is 9856061 composite? False Is 1609909343 prime? False Is 55547 a prime number? True Is 701057 composite? True Is 20014721 composite? False Is 1475069 a composite number? True Is 624190837 a composite number? False Is 2540843 a prime number? False Is 1816301 prime? True Is 18119 prime? True Is 17747 prime? True Is 57606515 composite? True Is 9381389 composite? False Is 14421737 a composite number? True Is 25868009 a prime number? True Is 11649809 prime? True Is 2042939 prime? False Is 1503637 a composite number? False Is 3673921 composite? True Is 28355461 a composite number? False Is 14140589 a composite number? True Is 259053 composite? True Is 240099235 prime? False Is 199054991 prime? True Is 939089 prime? True Is 60434917 prime? True Is 1200457 a composite number? True Is 430357 prime? True Is 79163723 prime? False Is 148839409 composite? False Is 414627971 a prime number? False Is 99759103 a composite number? False Is 28993043 a composite number? False Is 788119 prime? False Is 20178385 composite? True Is 36145183 prime? True Is 852937 a prime number? True Is 6269909 a prime number? False Is 1166233 composite? True Is 523037 composite? True Is 1219549 a composite number? False Is 795299 composite? False Is 7105577 composite? True Is 4272577 a composite number? True Is 4794523 a composite number? False Is 765386 a prime number? False Is 577781 composite? False Is 1765763 a prime number? False Is 7014347 composite? False Is 15799451 a composite number? False Is 1203257 prime? False Is 344017 a composite number? False Is 55383667 prime? True Is 1895861 a prime number? False Is 613141 a prime number? True Is 195907 prime? True Is 1336667 a composite number? True Is 7552301 composite? True Is 528783 a composite number? True Is 965881 a prime number? False Is 8589733 prime? True Is 110748223 prime? True Is 15685219 a composite number? True Is 343716557 prime? False Is 9093871 a prime number? True Is 8609767 prime? False Is 5381119 prime? False Is 32207338 a prime number? False Is 450611 a prime number? False Is 4428607 prime? True Is 2275699 prime? False Is 4112941 a prime number? False Is 2909153 a prime number? False Is 3538459 a composite number? True Is 3698755 composite? True Is 1249319 a prime number? True Is 9806729 a prime number? True Is 317650409 composite? False Is 1265816977 prime? True Is 289627237 composite? False Is 25364137 a prime number? True Is 9135887 composite? True Is 36405697 a prime number? False Is 89378519 a composite number? False Is 240995831 a prime number? True Is 3960367 composite? False Is 367871089 prime? False Is 93130523 composite? False Is 88993613 a composite number? False Is 2225729 composite? True Is 31091 a prime number? True Is 4873859 a prime number? True Is 8696837 prime? True Is 35330377 a composite number? False Is 24886157 a prime number? False Is 98400271 composite? False Is 9418207 a composite number? True Is 447541 a prime number? True Is 142892083 composite? False Is 724303829	{ "pile_set_name": "DM Mathematics" }
s the tens digit of 738833? 3 What is the units digit of 903816? 6 What is the hundreds digit of 343558? 5 What is the units digit of 6850279? 9 What is the tens digit of 444762? 6 What is the hundreds digit of 1816685? 6 What is the ten thousands digit of 2839947? 3 What is the hundred thousands digit of 1106480? 1 What is the ten thousands digit of 116010? 1 What is the hundreds digit of 487887? 8 What is the thousands digit of 705860? 5 What is the ten thousands digit of 5314677? 1 What is the hundreds digit of 41013912? 9 What is the hundred thousands digit of 358545? 3 What is the units digit of 4327504? 4 What is the units digit of 693496? 6 What is the ten thousands digit of 14867764? 6 What is the tens digit of 14599912? 1 What is the thousands digit of 24558291? 8 What is the hundred thousands digit of 346763? 3 What is the thousands digit of 2049955? 9 What is the ten millions digit of 17379806? 1 What is the tens digit of 71882? 8 What is the hundreds digit of 481383? 3 What is the hundred thousands digit of 178100? 1 What is the thousands digit of 54702? 4 What is the tens digit of 33524? 2 What is the thousands digit of 119273? 9 What is the ten thousands digit of 3436657? 3 What is the tens digit of 4009869? 6 What is the units digit of 670000? 0 What is the thousands digit of 11554? 1 What is the ten millions digit of 21192967? 2 What is the ten millions digit of 13480770? 1 What is the ten thousands digit of 10798412? 9 What is the units digit of 52045? 5 What is the millions digit of 6814651? 6 What is the millions digit of 2708651? 2 What is the ten thousands digit of 310162? 1 What is the hundreds digit of 218562? 5 What is the units digit of 11069214? 4 What is the hundred thousands digit of 532392? 5 What is the hundred thousands digit of 654368? 6 What is the ten thousands digit of 2135819? 3 What is the units digit of 635174? 4 What is the units digit of 810204? 4 What is the hundred thousands digit of 549621? 5 What is the millions digit of 43566715? 3 What is the hundreds digit of 759463? 4 What is the millions digit of 1562451? 1 What is the hundred thousands digit of 518909? 5 What is the hundreds digit of 5208351? 3 What is the hundred thousands digit of 433981? 4 What is the ten thousands digit of 175518? 7 What is the millions digit of 2454026? 2 What is the thousands digit of 21785070? 5 What is the ten thousands digit of 1020385? 2 What is the tens digit of 312961? 6 What is the tens digit of 339237? 3 What is the hundred thousands digit of 216492? 2 What is the units digit of 657176? 6 What is the hundred thousands digit of 2057594? 0 What is the units digit of 192171? 1 What is the tens digit of 794631? 3 What is the millions digit of 9641523? 9 What is the ten thousands digit of 407764? 0 What is the ten thousands digit of 297965? 9 What is the thousands digit of 1130274? 0 What is the ten thousands digit of 651748? 5 What is the units digit of 838465? 5 What is the hundreds digit of 2232103? 1 What is the tens digit of 4938018? 1 What is the thousands digit of 9927800? 7 What is the hundreds digit of 162821? 8 What is the tens digit of 1553667? 6 What is the thousands digit of 878004? 8 What is the tens digit of 203937? 3 What is the millions digit of 1623296? 1 What is the thousands digit of 575191? 5 What is the units digit of 17009? 9 What is the tens digit of 1652322? 2 What is the ten thousands digit of 642179? 4 What is the thousands digit of 134597? 4 What is the tens digit of 2744873? 7 What is the ten thousands digit of 267451? 6 What is the millions digit of 5420516? 5 What is the thousands digit of 3569231? 9 What is the millions digit of 6882082? 6 What is the units digit of 7914385? 5 What is the hundreds digit of 732451? 4 What is the thousands digit of 284202? 4 What is the hundred thousands digit of 4416411? 4 What is the ten millions digit of 32294306? 3 What is the ten thousands digit of 114781? 1 What is the millions digit of 14666755? 4 What is the ten millions digit of 14708661? 1 What is the tens digit of 23922079? 7 What is the thousands digit of 84302? 4 What is the hundred thousands digit of 450356? 4 What is the tens digit of 2028419? 1 What is the ten thousands digit of 378066? 7 What is the tens digit of 851385? 8 What is the hundred thousands digit of 229020? 2 What is the units digit of 10703233? 3 What is the hundreds digit of 409? 4 What is the hundred thousands digit of 953315? 9 What is the units digit of 992072? 2 What is the ten thousands digit of 3839504? 3 What is the tens digit of 1513039? 3 What is the hundred thousands digit of 302217? 3 What is the thousands digit of 688826? 8 What is the units digit of 1191098? 8 What is the ten thousands digit of 752700? 5 What is the thousands digit of 4209598? 9 What is the units digit of 363655? 5 What is the units digit of 2897872? 2 What is the hundreds digit of 219534? 5 What is the tens digit of 7736126? 2 What is the tens digit of 1176349? 4 What is the hundred thousands digit of 3596678? 5 What is the thousands digit of 237251? 7 What is the units digit of 280080? 0 What is the thousands digit of 33834? 3 What is the millions digit of 4064069? 4 What is the units digit of 2448462? 2 What is the thousands digit of 347251? 7 What is the units digit of 2989208? 8 What is the ten thousands digit of 2181291? 8 What is the tens digit of 3070840? 4 What is the hundred thousands digit of 238827? 2 What is the hundreds digit of 506924? 9 What is the ten millions digit of 16664215? 1 What is the tens digit of 3291065? 6 What is the ten thousands digit of 67116? 6 What is the units digit of 531633? 3 What is the tens digit of 5575196? 9 What is the hundreds digit of 369328? 3 What is the thousands digit of 3408962? 8 What is the ten thousands digit of 180242? 8 What is the hundred thousands digit of 13402735? 4 What is the thousands digit of 61720? 1 What is the millions digit of 7024989? 7 What is the hundreds digit of 1058632? 6 What is the units digit of 95184? 4 What is the hundreds digit of 21946775? 7 What is the tens digit of 285783? 8 What is the millions digit of 6526032? 6 What is the tens digit of 159805? 0 What is the units digit of 166667? 7 What is the millions digit of 3710731? 3 What is the hundreds digit of 673022? 0 What is the units digit of 556593? 3 What is the thousands digit of 672888? 2 What is the tens digit of 2650454? 5 What is the ten thousands digit of 15264966? 6 What is the millions digit of 2071933? 2 What is the units digit of 433770? 0 What is the millions digit of 7277295? 7 What is the ten thousands digit of 537635? 3 What is the ten thousands digit of 1171897? 7 What is the units digit of 2637223? 3 What is the ten thousands digit of 1272079? 7 What is the hundreds digit of 2054963? 9 What is the ten thousands digit of 1358245? 5 What is the hundred thousands digit of 518331? 5 What is the hundred thousands digit of 546877? 5 What is the tens digit of 230978? 7 What is the units digit of 2638270? 0 What is the hundreds digit of 585039? 0 What is the hundreds digit of 140377? 3 What is the thousands digit of 1382103? 2 What is the hundreds digit of 3040172? 1 What is the hundred thousands digit of 1440723? 4 What is the millions digit of 6093965? 6 What is the thousands digit of 69854? 9 What is the hundred thousands digit of 9497779? 4 What is the millions digit of 1309113? 1 What is the ten thousands digit of 31491? 3 What is the hundreds digit of 1525563? 5 What is the tens digit of 6691174? 7 What is the thousands digit of 69073? 9 What is the units digit of 2660180? 0 What is the tens digit of 1466158? 5 What is the tens digit of 8701? 0 What is the thousands digit of 411465? 1 What is the tens digit of 2120244? 4 What is the thousands digit of 252152? 2 What is the tens digit of 4525090? 9 What is the thousands digit of 643004? 3 What is the hundreds digit of 90463? 4 What is the hundreds digit of 346517? 5 What is the thousands digit of 6560671? 0 What is the millions digit of 1804284? 1 What is the tens digit of 59491? 9 What is the millions digit of 12914908? 2 What is the tens digit of 5646797? 9 What is the ten millions digit of 14246273? 1 What is the hundred thousands digit of 659	{ "pile_set_name": "DM Mathematics" }
-3o - 2s + 904. Suppose 3w + t - o = 2t, -3t - 3408 = -3w. Is w a prime number? False Suppose m = 2l - 72, -36 = -3l + 4m + 82. Let h = -18 + l. Suppose 59 = z + h. Is z a composite number? False Let j(i) = 4610i + 217. Is j(24) prime? False Let i be 26 + (4 - (4 - -4)). Suppose -240 = -2x + i. Is x prime? True Let v = -60 - -63. Suppose -2226 = -j + 5b, -vb = j + 408 - 2674. Is j composite? False Is (377/(-26) + 15)(3627 - -1) a prime number? False Let u(i) = -4i + 177. Is u(39) a composite number? True Let b(p) = 2p + 58. Let i be b(-29). Suppose -3v - 4w + 121 = i, 0w - 128 = -4v + 3w. Is v a prime number? False Let n = 26 + -20. Is 1341/n + 2/(-4) composite? False Let x(d) = -16d - 1. Let w be x(-2). Let o be (-4)/(-1)(-51)/(-3). Let s = o - w. Is s a composite number? False Let l = -10 + -8. Let a = -18 - l. Suppose a = 4s - 3s - 219. Is s a composite number? True Suppose 7y = 11087 + 12426. Is y a prime number? True Let c(a) = 29a2 + 18a + 6. Let y be c(-5). Let d = 1756 - y. Is d a composite number? True Let q(b) = -2b3 - 6 - 6b*3 + 8b*2 - 22b + 9b3 + 8b*2. Is q(-13) a composite number? False Suppose -6o + z = -10o + 7796, 2o + 3z - 3898 = 0. Is o a composite number? False Suppose -16 + 2 = 7y. Let d(t) = -27t3 + 2t - 1. Is d(y) composite? False Let l = 17 + -20. Let b(a) = -21a3 + 2a*2 + 8a + 4. Is b(l) a composite number? True Suppose 0 = 3p - 15, 4053 = 5x - 3x + 5p. Let r be 0 + 1 + (x - -8). Suppose -3n - n = -12, 4n + r = 5s. Is s prime? False Suppose -8f = -6f - 4y - 14310, 2f - 14280 = -2y. Is f composite? True Suppose 0 = 4m + 19 - 23. Is ((-1)/m)/(15/(-2445)) composite? False Let o(z) = 261z*3 + 1 - 2z*2 + 0 + 6z*2 - z. Let q(a) = 523a*3 + 9a*2 - 2a + 2. Let d(l) = 7o(l) - 3q(l). Is d(1) a prime number? False Suppose -5a + 29 = t, 18 = 3a + 2t + 2. Let y(z) = -32z + 17. Let n(p) = -p + 1. Let i(q) = 6n(q) - y(q). Is i(a) a prime number? False Suppose -2d + 198 = 4d. Suppose -31s - 290 = -ds. Is s a prime number? False Let j be 8/(2 - -2) - -3. Suppose jh = 1271 + 3164. Is h a prime number? True Suppose -4x + 0 = -20, -4v = -2x - 14. Let q be 2421/v + 12/(-8). Let u = q + 41. Is u composite? False Suppose -4o + 3f = -17, -3o = -4o - f + 13. Suppose -on = -5n - 9. Suppose -nq = -431 - 202. Is q composite? False Suppose -3i = -i + m + 50, i + 2m + 28 = 0. Is (-2)/(i/(-2031))-4 composite? False Suppose -8p = -7p. Suppose -s + 4s - 465 = p. Suppose 6x = x + s. Is x a composite number? False Suppose -u - 18 = -69. Let g = u + -36. Suppose -18k + 105 = -gk. Is k prime? False Let k(i) = -6i*3 - 8i*2 + 2i - 5. Let x = -16 + 10. Let a be k(x). Let c = a - 610. Is c a composite number? True Let l = 106 + -118. Is (-26)/12 - -2 - 5870/l composite? True Let i = 18490 - -5827. Is i prime? True Let w(m) = 4m + 2. Let g be w(-10). Is g/(((-2)/(-22))/(2/(-4))) composite? True Let s = 6900 + -3241. Is s prime? True Let a be (-9 - -1)/(-4) - -262. Is (69/(-12))/((-6)/a) prime? False Let z be 1(-1 + 3 + -139). Let l be 3955/15 - (-1)/3. Let n = z + l. Is n prime? True Suppose 2w = 2q + 8, 3w + 4q + 16 = -7. Let m be ((-25)/15)/(w/(-21)). Is (-9)/15 + (-3976)/m a composite number? False Let v(o) = 2o3 + 9o*2 + 13o + 9. Let p be v(-8). Let n be 2/5 - p/5. Suppose -n = -4i + 3i. Is i prime? True Let h be (-10)/30(-6 + 0) + 6. Is -2(1908/h)/(-9) a composite number? False Let q(l) = -603l + 140. Is q(-5) a composite number? True Is 2/(-6) - (-3 - 7676/6) composite? True Let g(r) = 135r*2 - 3r - 19. Let x be g(5). Let l = 5698 - x. Is l composite? False Let b = 4706 + -1809. Is b composite? False Let q(v) = 21v2 - 14v - 87. Is q(-16) a composite number? True Let h = -630 + 1339. Is h composite? False Let o = 10830 - -9119. Is o composite? False Suppose 2w - 20711 = -f, -5w + 8158 = 2f - 33266. Is f composite? False Let f be 2 - (0 - 0/(-1)). Let r(g) = -g2 + 6g - 2. Let s be r(5). Suppose -5u - 152 = -fl, -350 + 100 = -sl + 2u. Is l a prime number? False Let v(u) = 2u2 - u - 3. Let r be v(3). Let g = -10 + r. Is ((-582)/(0 - 3))/g prime? True Suppose 4a + 2610 = 13942. Is a composite? False Let f be (-1)/(4 + 243/(-61)). Let w be -2 + (f + 0 - 4). Is -2(-2)/(-4)w a prime number? True Suppose 2u + z = -z - 58, -3u = 2z + 88. Let q be (-10766)/u + 10/75. Suppose 276 = a + 5i - q, -2a - 4i = -1294. Is a prime? False Suppose 2u - 7 = -2n + 1, -4u + 19 = 3n. Suppose 5m + 4714 = um. Is m a prime number? True Let x = 13389 + -8368. Is x composite? False Let l be 14/21 + (-4)/(-3). Suppose 4w + 6v - lv = -352, 5w + 420 = 5v. Let i = w + 153. Is i prime? True Let l(k) = k. Let z(r) = -20r + 2. Let u(m) = 3l(m) + z(m). Suppose 0 = t + 19 - 12. Is u(t) a prime number? False Suppose 0g - 3 = -g. Let u be 3/((2 - 0)/2). Suppose -gi - t + 292 = 0, 4i - 347 = -ut + 44. Is i a composite number? False Let x(u) = -u + 2. Let n(r) = -2r + 3. Let l(v) = 2n(v) - 3x(v). Let h(i) = 57i - 5. Let g(c) = -h(c) + 6l(c). Is g(-4) composite? False Let v(l) = -l3 + l2 + 2. Let h be v(0). Suppose -hd = d. Suppose 4i - i - 489 = d. Is i a prime number? True Is 6/2(57066/9)/2 a prime number? True Let s(w) = 1387w*2 + 6w + 2. Is s(-5) a prime number? False Is ((-261380)/60)/((-1)/3) prime? False Suppose 2i = 4n - i + 27109, 4n + 27114 = -2i. Let b be n/(-6) - (-1)/3. Is b/(-10)(0 + -1) prime? True Suppose -2k = -3k - 8. Let d = k - -3. Let n(r) = 11r*2 + 8r + 4. Is n(d) composite? False Let l = -46573 + 104692. Is l prime? False Is -1 + -10 + 5 + 5799 a prime number? False Let a(f) = 887f - 165. Is a(28) prime? True Let n = 10577 - -4014. Is n prime? True Suppose 86588 = -6g + 10g. Is g composite? False Suppose 12 = -w + 4w. Suppose wp + 4j + 752 = 0, 5p - 4p = -4j - 200. Let f = p - -593. Is f a composite number? False Suppose -12n = -3n - 9. Is (12308/2 - n)14/42 composite? True Let j be 7 - (1 + -4) - 2. Let n(w) = 160w - 12. Let h be n(j). Suppose 4u - h = -2g - 238, 4g = -4u + 1024. Is u a composite number? True Suppose -5y = 5h - 15, 2y = -4h + 7y + 3. Is (-278)/(-6) - (-3)/(h - 11) composite? True Is (10 + (-703 - 1))/(2/(-23)) prime? False Suppose -3a - 2742 = -3x, a - 929 = -x - a. Is x prime? True Suppose f = 5 - 1. Suppose fu - p = -71, u + 0u + 3p + 21 = 0. Is (-2)/(4/u) - -1 prime? False Is 5 + -82/4 - -2745 a prime number? False Suppose 0 = 39q - 42131 - 382774. Is q a composite number? True Let b = 25 - 12. Let w = b + -14. Let x(c) = -439c3 - c2 - c. Is x(w) composite? False Let o(x) = -208x + 397. Is o(-78) composite? True Let s(c) be the third derivative of c4/2 - 11c*3/6 + 5c*2. Let g be s(7). Suppose d - g = 16. Is d prime? True Let s(g) = 52g - 1. Let w = -5 + 4. Let j be s(w). Is j/((-1)/11) composite? False Suppose 28498 + 86187 = 5w. Is w a prime number? True Let b(a) = a*2 - 13a + 14. Let t be b(12). Let i(m) = 4m + 2 + mt + 2m*2 + 3m2 - m2. Is i(-2) prime? False Let u be -3 + 1 + 1 + 56. Suppose 2t + 148 = -4p, -2p - 76 = t + t. Is (u/(-4))/(9/p) prime? False Suppose 0 = -5i - 4g + 27, 2i - i + 2g = 9. Is 1254 - -1 - 0/i prime? False Let n = -15 - -17. Let k(c) = 3c*n + 8c - 4 - 3 - c*3 + 6c*2. Is k(8) composite? True Suppose -3k - 4c + 1017 = -2c, 1029 = 3k - 2c. Suppose -o - k = -4f, 5f = 2o - 244 + 671. Is f a prime number? False Let h(y) = -18y*2 + 4y - 3. Let m(s) = -17s2 + 5s - 3. Let z(n) = -5h(n) + 4m(n). Is z(-2) prime? False Let u = -13 - -16. Let l be 51 - (12/u - 1). Suppose -7 = -5x + l. Is x composite? False Is ((-12)/(-21))/(-1) - (-11499082)/98 a prime number? False Suppose 121241 = 38j - 46301. Is j prime? True Let f(v) = 2v2 + 8v + 9. Let z be f(-4). Suppose -388 = 5o - zo. Is o a composite number? False Suppose -3b = -6b + 60. Suppose b = 7y - 2y. Suppose -3s - k + 36 = -yk, 0 = s - 2k - 13. Is s a prime number? True Let k(n) = n2 - 6. Suppose -2w = -3s + 15, -2w = 3s + 2 - 5. Let j be k(w). Is (0 - j)/(12/(-88)) composite? True Suppose -t = -4u + 46311, -6t = -t - 25. Is u composite? False Suppose -39x + 2r + 49427 = -36x,	{ "pile_set_name": "DM Mathematics" }
31. Give d(t). 20 Let z(l) be the third derivative of -l*6/120 + 11l5/60 - l4/24 - 89l3/6 - 216l*2 - 5l + 1. Give z(10). 1 Let l be 4/(-14) - (-46)/14. Let s(u) be the second derivative of 1/2u3 + 4u - 1/2u2 + 1. Give s(l). 8 Let w be ((-2)/(-6)0 + 0)14/98. Let r(o) = 4o - 80. Give r(w). -80 Let t(g) = -3534 + 3560 + 0g + 11g - 2g2. Determine t(9). -37 Let p(o) = -3o*2 + o - 1. Let d(r) = 15 + 2r*2 - 12 + 5r*2 - 2r. Let s(y) = -d(y) - 2p(y). Calculate s(1). -2 Let i = 4549 + -4546. Let q(l) = -4l + 10. Calculate q(i). -2 Let u(s) be the first derivative of 1/360s6 + 1/24s*5 + 0s + 7/3s3 + 0s*2 - 19 - 1/8s4. Let f(t) be the third derivative of u(t). What is f(-3)? -9 Let x(p) = p3 - p*2 - 4p + 2. Let r be 6/3 + (1 - 3). Suppose r = 11a - 6a - 10. Let f be x(a). Let v(g) = 11g - 2. What is v(f)? -24 Let u(b) = -b2 + b + 16. Let o be u(0). Let c be (-2)/(120/o - 7). Let y(n) = -n3 - 5n*2 - 5n - 6. Determine y(c). -2 Let c = 11 + 40. Let s = -35 + c. Let p be 1/2(s - 2). Let r(l) = l - 3. Give r(p). 4 Let i(j) = 3 + 94j - 49j - 50j. Let m(v) = -11v + 7. Let k(o) = -13i(o) + 6m(o). Calculate k(4). -1 Let j be 168/(-9)(-96)/256 - (1 - -1). Let l(n) = n*2 + 12n - 91. Give l(j). -6 Let a be 0((-260)/(-140))/13. Let d(m) be the third derivative of -7/60m*5 + 0m + 11m2 - 1/120m*6 - 3/8m*4 + a - 1/2m3. Determine d(-6). 15 Let x(m) be the third derivative of -m5/60 + 5m4/24 - m3/6 + m2. Suppose 3d - 11b + 16b = 22, -24 = -4d - 4b. What is x(d)? 3 Suppose 13v - 11v = 14. Let o = v - 16. Let b(m) = m + 6. Give b(o). -3 Let i(x) = -x*2 + 5x - 1. Let p be i(5). Let c be (1/(-4 + 5))/((-3)/(-843)). Let o(a) = -ca2 - 3a*3 + 1 - 289a*2 + 568a2. Give o(p). 2 Let t(u) be the third derivative of u9/60480 + u8/3360 - u6/360 + 29u5/60 - 15u*2. Let n(w) be the third derivative of t(w). What is n(-6)? -2 Let o be 4/(-4)-5(-15)/(-25). Let k(n) = -7n - 6n - n2 + 19n + o. What is k(3)? 12 Let k(y) = -16y + 25y - 9y2 + 12y*2 - 8y*2 - 10y. Calculate k(-1). -4 Let x(n) = -16n + 96. Let m be x(22). Let f = m - -261. Let b(o) = o3 - 7o*2 + 11o - 6. What is b(f)? -1 Let l(k) = 11k3 + k2 + 2k + 2. Let q(y) = -58y3 - 39y*2 - 23y - 19. Let h(z) = -5l(z) - q(z). Determine h(-11). -13 Let o(v) = -3v*2 + 9v. Let c(p) = -13p2 + 35p + 1. Let s(q) = 2c(q) - 9o(q). Let f be (10 + 22/(-4)2)/((-4)/20). What is s(f)? -28 Let g(p) = p2 - 7p + 6. Let c(t) = -7t. Let k(r) = -111r. Let v(l) = 33c(l) - 2k(l). Let u be v(-2). Let n = u + -12. Determine g(n). 0 Let n(q) = q*3 - 7q*2 + 4q + 2. Let y be (7 - 11 - -3) + 6. Give n(y). -28 Let g(b) = 21b2. Let n(x) be the third derivative of -x6/120 + 2x*5/5 - 3x*4/4 - 19x*3 + 7x*2 + 19x. Let a be n(23). What is g(a)? 21 Suppose 18f - 290 + 393 + 383 = 0. Let r(l) = 2l + 54. What is r(f)? 0 Let m(w) = 89w2 + 4w - 49. Let y(k) = 19k2 + k - 10. Let h(r) = -3m(r) + 14y(r). Give h(6). -17 Suppose -133b = -129b. Let s be (-7)/(35/20) - b/3. Let k(x) be the third derivative of -x6/120 - x5/15 - x3/6 + 2x2. What is k(s)? -1 Let i(x) = -x3 + 5x2 - x. Let w be (0 + 3)(-2)/(-6). Suppose 5s = 3z + 45, 4z - 20s = -24s - 60. Let u be (-3)/w25/z. What is i(u)? -5 Let q(u) be the second derivative of 1/2u2 + 0 + 5/6u*3 - 130u. Calculate q(-1). -4 Suppose 57s = 29s + 1736. Suppose 24 = so - 66o. Let p(w) = w*2 + 3w - 1. Calculate p(o). 17 Let d(o) = -5o - 1. Let y be (3 - (5 + 0))-1. Suppose 4p = -0t + 3t - 11, -t = -yp - 3. Give d(p). -6 Let m(c) = 6c3 + 1 + 2c*2 + 0c*2 - 2c + 4c. Let q be ((-39)/2535-13)/(2(-1)/10). Calculate m(q). -5 Let u(x) be the second derivative of 9x5/20 + x4/6 + x3/3 - x2/2 + 7911x. Calculate u(-2). -69 Let q(v) = v3 - 5v*2 - 2v + 10. Suppose 5r = 2g - 19, -3r + 2r = -2g + 7. Let h be -1216/(-24) + r. What is q(h)? 0 Suppose -4k + q = -125, 2 = -5q - 23. Let c = 3 + k. Suppose -z = 10z - c. Let m(v) = -v3 + 3v*2 - v + 1. Determine m(z). -2 Let o be 10/(40/(-12)) + 113. Suppose -5x = -o, -3l + 4x + 20 = 2x. Let t(u) = 22 - l - 3u - 13. What is t(-1)? 4 Let j(t) = -8t - 48. Let o(l) = 3l + 21. Let s(m) = -2j(m) - 5o(m). What is s(26)? 17 Let g(z) be the third derivative of 101z*2 + 5/3z*3 + 0z + 1/120z6 - 7/24z*4 - 1/12z*5 + 0. What is g(6)? 4 Let d = 12252 + -12253. Let m(o) be the first derivative of -5o*2/2 + 2o + 2. Give m(d). 7 Let z(i) = i*3 + 3i*2 - 6i - 10. Let g be z(-4). Let j be ((-6)/(-3))/((8/(-2))/g). Suppose 2s = -3 + j. Let x(a) = -a3 + 2a*2 + 2a + 1. What is x(s)? 2 Let s(m) = -m*3 - 7m*2 + 10m - 14. Suppose 2u = -31w + 34w + 28, 0 = 3u - 6. Calculate s(w). -30 Let q(k) = k*3 + 19k*2 - k - 27. Let g(o) = 73o3 + o2 - 2o. Let i be g(1). Suppose 376 - i = -16w. Calculate q(w). -8 Let z(i) = -i - 1 - 2 + 0i. Let q(g) be the second derivative of 67g*3/6 - 677g*2/2 - 440g. Let u be q(10). Determine z(u). 4 Let r(v) = -3v + 9. Let t(f) = f3 + 9f*2 + 18f + 76. Let m be t(-8). Give r(m). 21 Let c(f) = 33f + 5f + 389 + 18f - 16f + 4f. Calculate c(-9). -7 Let m(b) = 35b - 1. Suppose 0 = -8p + 183p + 175. Determine m(p). -36 Let r(g) = g*3 + 5g*2 - 2g - 12. Let o(f) = 2f3 + 10f*2 - 3f - 23. Let a(s) = -6o(s) + 11r(s). Let h(w) = -6w - 10. Let d be h(-1). Calculate a(d). 6 Let h = 121 - 119. Let o(t) be the third derivative of -t5/60 + t4/6 - t3 - 219t*2. Calculate o(h). -2 Let f(q) = 62q - 59q - 700 + 690. Determine f(1). -7 Let d(y) = -23y + 700. Let o be d(0). Let x = o - 696. Let s(a) = 5a - 1. What is s(x)? 19 Let i be (-5)/(-2)((-203)/(-35) + -5). Suppose -4r + 28 = r - id, r - 4d - 20 = 0. Let a(m) = -2m - 4. Determine a(r). -12 Let n(f) = 5 + 309f2 - 9f - 678f2 + 370f*2. Determine n(0). 5 Let o(b) = -5b*2 + 33b + 831. Let w be o(-10). Let u(l) = 4l - 4. Give u(w). 0 Let p(s) = -19s + 47. Let c(t) = -48t + 98. Let z(b) = -2c(b) + 5p(b). Give z(-25). 14 Suppose 39458i = 39424i + 68. Let s(n) = -n2 + 11n - 13. Give s(i). 5 Let m = -10 - -42. Let o = m + -30. Let s(x) = -1 + ox3 - x + 19x*2 - 19x*2 + 0x*3. Determine s(2). 13 Let l(m) = -m - 8. Let g be l(-10). Let k(o) = -15o*2 - 1 - 2o*2 - o + go*2. Suppose 0 = 5h + 3c - c - 1, -3 = -c. Calculate k(h). -15 Let x(n) = 7n + 5. Let u(r) = -28r - 19. Let y be 93/31 + (-24)/(1 + 1). Let p(o) = yx(o) - 2u(o). Determine p(-5). 28 Let f be (-478)/13 + (-72)/312 + (-21)/3. Let n(r) = -10r - 448. What is n(f)? -8 Let u(i) be the first derivative of i*2 + 23i + 4472. Determine u(-9). 5 Suppose y + 4 = -0, -4v - y + 16 = 0. Suppose 0c = -4c + 2t + 20, t = -2c + 2. Let q(l) = -cl*2 + 7l - 188 + 2l2 + 193. Give q(v). 15 Let a(s) = -s3 + 2s + 4. Suppose 2j + 5j = 0. Let h be a(j). Let k(z) = 5z. Let r(b) = -6b. Let i(l) = -5k(l) - 4r(l). Determine i(h). -4 Let r = -45 + 63. Suppose -4t = -p - 15 + r, -3p - 15 = 0. Let j(f) = 1. Let v(u) = 2u - 4. Let z(w) = -2j(w) - v(w). Give z(t). 6 Let i be (-1 - (-7)/3)/(76/114). Let w(a) be the third derivative of a6/120 - a5/30 - a4/8 + a3/6 + 97a2 - 3. What is w(i)? -5 Let n = 97 + -91. Let i be (-14)/(-8) - ((-75)/12 + n). Let l(g) = -g + 9g*i + 0g + 1 - g + 4g. Calculate l(-1). 8 Suppose 11 = 3j - 3o - 1, 3j - 5o - 16 = 0. Let l(b) = -4 + 4 + 2b + 2 + jb - 1. Determine l(5). 21 Let h(g) = g - 26 + 35 - 2g*3 + g - 2g*2 + 4g*2. Let y(x) = 3x*3 - 3x*2 - 3x - 17. Let w(t) = 5h(t) + 3y(t). Let l = -2 + 2. Determine w(l). -6 Let j(p) = 2p - 15. Suppose 3h - 3t + 16 = -8t, -2t - 4 = 2h. Suppose -l = -0r - r, -hl + 5r - 10 = 0. What is j(l)? -5 Suppose -9a + 7a - 10 = -4z, -z = -5a - 16. Let r be (25 + -80)z/(-5). Let f(c) = c*3 - 11c*2 + 5c - 5. Calculate f(r). 50 Let i(q) = 9q + 10. Let y(p) = -17p - 13. Let a(d) = 6d + 5. Let g(c) = -7a(c) - 2y(c). Let f(v) = -3g(v) - 2i(v). Give f(-5). -23 Let h(i) = -i3 + 7i*2 + i + 2. Let x be (-1(6 + -4))/((-1)/4). Let d(o) = 16o - 9o - 1 + 17 - xo. Let f be d(9). What is h(f)? 9 Let a(f) = -15f**2	{ "pile_set_name": "DM Mathematics" }
lculate the remainder when 279640 is divided by 207. 190 Calculate the remainder when 497 is divided by 105. 77 What is the remainder when 963 is divided by 337? 289 Calculate the remainder when 709623 is divided by 11. 2 Calculate the remainder when 8646 is divided by 720. 6 What is the remainder when 21566 is divided by 2633? 502 Calculate the remainder when 8907 is divided by 8891. 16 What is the remainder when 16829997 is divided by 16? 13 Calculate the remainder when 577 is divided by 272. 33 What is the remainder when 18962 is divided by 33? 20 What is the remainder when 6782 is divided by 19? 18 Calculate the remainder when 849 is divided by 43. 32 What is the remainder when 14548 is divided by 1447? 78 What is the remainder when 27326 is divided by 4552? 14 What is the remainder when 580669 is divided by 91? 89 Calculate the remainder when 8812 is divided by 327. 310 Calculate the remainder when 22734 is divided by 1523. 1412 What is the remainder when 2978 is divided by 61? 50 What is the remainder when 1567 is divided by 312? 7 Calculate the remainder when 160163 is divided by 562. 555 What is the remainder when 14675 is divided by 78? 11 Calculate the remainder when 370144 is divided by 318. 310 What is the remainder when 127113 is divided by 33? 30 What is the remainder when 6120 is divided by 244? 20 Calculate the remainder when 19122 is divided by 336. 306 What is the remainder when 3735 is divided by 1859? 17 Calculate the remainder when 25200 is divided by 8383. 51 Calculate the remainder when 6533 is divided by 647. 63 What is the remainder when 75168 is divided by 655? 498 What is the remainder when 155367 is divided by 2547? 0 Calculate the remainder when 13797 is divided by 96. 69 Calculate the remainder when 5359 is divided by 2588. 183 What is the remainder when 6890 is divided by 6883? 7 What is the remainder when 2563 is divided by 12? 7 Calculate the remainder when 166483 is divided by 10404. 19 What is the remainder when 952992 is divided by 53? 52 Calculate the remainder when 4823 is divided by 242. 225 What is the remainder when 40582 is divided by 116? 98 What is the remainder when 8354 is divided by 171? 146 Calculate the remainder when 1700 is divided by 214. 202 What is the remainder when 43464 is divided by 10863? 12 What is the remainder when 2159 is divided by 103? 99 What is the remainder when 31102 is divided by 308? 302 What is the remainder when 4698 is divided by 425? 23 Calculate the remainder when 3360 is divided by 1069. 153 What is the remainder when 211957 is divided by 105975? 7 What is the remainder when 6280 is divided by 6276? 4 What is the remainder when 16900 is divided by 79? 73 What is the remainder when 366603 is divided by 366592? 11 What is the remainder when 11095 is divided by 111? 106 Calculate the remainder when 216243 is divided by 12720. 3 What is the remainder when 19983 is divided by 49? 40 What is the remainder when 4222 is divided by 161? 36 What is the remainder when 124832 is divided by 259? 253 Calculate the remainder when 259924 is divided by 6. 4 What is the remainder when 15258 is divided by 16? 10 Calculate the remainder when 463102 is divided by 19. 15 Calculate the remainder when 5295 is divided by 19. 13 Calculate the remainder when 48389 is divided by 13. 3 What is the remainder when 15740 is divided by 3897? 152 Calculate the remainder when 10034 is divided by 1005. 989 Calculate the remainder when 531253 is divided by 22. 19 Calculate the remainder when 14629 is divided by 4850. 79 Calculate the remainder when 3241 is divided by 217. 203 Calculate the remainder when 20318 is divided by 6766. 20 Calculate the remainder when 42155 is divided by 170. 165 Calculate the remainder when 51003 is divided by 46. 35 What is the remainder when 127074 is divided by 45? 39 Calculate the remainder when 27598 is divided by 630. 508 What is the remainder when 172397 is divided by 27? 2 What is the remainder when 10318 is divided by 17? 16 Calculate the remainder when 23953 is divided by 3979. 79 Calculate the remainder when 3424 is divided by 1127. 43 Calculate the remainder when 1928313 is divided by 16. 9 Calculate the remainder when 30853 is divided by 139. 134 Calculate the remainder when 4087 is divided by 4050. 37 Calculate the remainder when 738472 is divided by 501. 499 Calculate the remainder when 495 is divided by 184. 127 Calculate the remainder when 2824 is divided by 89. 65 What is the remainder when 2422 is divided by 733? 223 Calculate the remainder when 224194 is divided by 28. 26 What is the remainder when 1763604 is divided by 219? 216 Calculate the remainder when 3517 is divided by 174. 37 What is the remainder when 7073 is divided by 122? 119 What is the remainder when 1158818 is divided by 85? 13 Calculate the remainder when 572 is divided by 556. 16 What is the remainder when 1327 is divided by 312? 79 Calculate the remainder when 41136 is divided by 34. 30 What is the remainder when 638 is divided by 299? 40 Calculate the remainder when 39813 is divided by 212. 169 Calculate the remainder when 113516 is divided by 240. 236 What is the remainder when 6717 is divided by 164? 157 Calculate the remainder when 132590 is divided by 67. 64 Calculate the remainder when 613 is divided by 128. 101 What is the remainder when 2930 is divided by 727? 22 Calculate the remainder when 27560 is divided by 1199. 1182 Calculate the remainder when 94266 is divided by 3250. 16 What is the remainder when 9035 is divided by 9009? 26 Calculate the remainder when 7029 is divided by 3. 0 What is the remainder when 840915 is divided by 11? 9 Calculate the remainder when 2961 is divided by 371. 364 What is the remainder when 519135 is divided by 6? 3 What is the remainder when 230129 is divided by 260? 29 What is the remainder when 15422 is divided by 3852? 14 What is the remainder when 290849 is divided by 19? 16 Calculate the remainder when 13793 is divided by 6879. 35 Calculate the remainder when 15367 is divided by 1266. 175 Calculate the remainder when 260126 is divided by 88. 86 Calculate the remainder when 7082 is divided by 1736. 138 Calculate the remainder when 670 is divided by 339. 331 Calculate the remainder when 227 is divided by 123. 104 Calculate the remainder when 27630 is divided by 9073. 411 What is the remainder when 16691 is divided by 50? 41 Calculate the remainder when 370 is divided by 154. 62 Calculate the remainder when 21198 is divided by 111. 108 What is the remainder when 1152 is divided by 230? 2 What is the remainder when 9662 is divided by 126? 86 Calculate the remainder when 574135 is divided by 172. 171 What is the remainder when 1343 is divided by 264? 23 Calculate the remainder when 12952 is divided by 38. 32 Calculate the remainder when 193859 is divided by 685. 4 What is the remainder when 143171 is divided by 152? 139 Calculate the remainder when 2739 is divided by 547. 4 What is the remainder when 3712591 is divided by 676? 675 Calculate the remainder when 10832 is divided by 129. 125 Calculate the remainder when 820050 is divided by 46. 8 What is the remainder when 227100 is divided by 183? 180 Calculate the remainder when 7305 is divided by 118. 107 What is the remainder when 770 is divided by 760? 10 Calculate the remainder when 778070 is divided by 553. 552 Calculate the remainder when 709 is divided by 118. 1 Calculate the remainder when 76369 is divided by 3. 1 Calculate the remainder when 130831 is divided by 418. 415 What is the remainder when 277269 is divided by 595? 594 What is the remainder when 2215 is divided by 19? 11 Calculate the remainder when 48100 is divided by 203. 192 What is the remainder when 2268054 is divided by 85? 84 What is the remainder when 423395 is divided by 25? 20 Calculate the remainder when 13028 is divided by 67. 30 What is the remainder when 678 is divided by 105? 48 Calculate the remainder when 17708 is divided by 2519. 75 Calculate the remainder when 2665 is divided by 456. 385 What is the remainder when 2079 is divided by 502? 71 What is the remainder when 13151 is divided by 23? 18 Calculate the remainder when 1501 is divided by 102. 73 Calculate the remainder when 9124 is divided by 253. 16 What is t	{ "pile_set_name": "DM Mathematics" }
= 7j + 5j + 12j + 28j - 48j + 2. Let t(f) = f3 + 7f*2 - 9f - 5. Let s be t(-8). What is x(s)? 14 Let n(u) = -u*3 + 5u*2 - 3u + 4. Suppose 46x - 45x = 0. Suppose -2p = 5w - 26, -w - 2w + 4p = x. What is n(w)? 8 Let o(y) be the first derivative of -3y6/40 - y5/60 - y4/24 + 11y*2/2 + 6. Let a(u) be the second derivative of o(u). Calculate a(-1). 9 Let g be 3/(-2)8/(-6). Let r = -45 + 45. Suppose -q + c = 0, rq = q - gc + 2. Let a(l) = -l*3 + 3l*2 + 2l - 2. Calculate a(q). 6 Let x(t) be the third derivative of 0 + 0t + 1/4t*4 - 9t*2 - 1/2t*3 - 7/60t*5 + 1/120t*6. What is x(6)? -3 Let d(c) = -c. Let t be d(-2). Let a(b) = -b + 0b + 3 - 4 - t. Let s = -14 + 8. Give a(s). 3 Let m(r) be the first derivative of r*4/4 - 19r*3/3 - 19r*2/2 - 19r + 112. Determine m(20). 1 Let z(u) = -u*3 + 21u*2 + 2u - 46. Let r be z(21). Let i(h) = h*2 + 4h - 4. Let k(m) = -1. Let x(c) = i(c) - 5k(c). Give x(r). 1 Let q(z) = 3z3 + z2 + 2. Suppose -37s = -40s - 90. Let r be (3/(15/2))/(6/s). Give q(r). -18 Let c(i) = -i + 5 - 1 - 4 - 1. Let b(l) = 3l - 1. Let h(x) = b(x) + 2c(x). What is h(3)? 0 Let d(y) = -6 - 3y3 + 8y - 7y2 + 3y*3 - 6y*3 - 1 + 7y*3. Calculate d(6). 5 Let b(u) = 1 + 0 + 9u - 8u + 9 - 18. Determine b(8). 0 Let r(u) be the third derivative of u5/60 - 11u*4/24 - 2u*2. Let k be r(11). Let x(o) = 16 - 7 - 3o - o*2 + ko*2 - 4. Determine x(-5). -5 Let h(b) = 3b*2 - 4b + 2. Suppose 0 = 3c - 5 - 1. Suppose 3 = -r + 5z + c, 0 = r + 3z - 7. Suppose w + r = 3w. What is h(w)? 6 Let q(l) = -6l - 6. Suppose -f - 3 = -1. Let m be q(f). Let c(i) = -4i - 3i + 8i - m. Calculate c(9). 3 Let t be (-300)/50 + 10 + 1 + 3. Let n(g) = -g*3 + 8g2 - 16. What is n(t)? -16 Let t(z) be the second derivative of -z4/12 - 12z - 1. Let s be (4 - 2) + (-4 - -1). What is t(s)? -1 Suppose 0 = w + 4 + 2. Let q(p) = 1. Let d(h) = -h2 - 7h - 1. Let l(b) = wq(b) + d(b). Determine l(-5). 3 Let w be 3 - (-102)/(-30) - 707/(-5). Let k(x) = -wx - 1 - x*3 + 279x - 137x - x3 + x2. Calculate k(2). -11 Let i(n) be the second derivative of -n4/24 + 7n*3/6 + 17n*2/2 + 16n. Let m(u) be the first derivative of i(u). Give m(9). -2 Let i(c) = c*2 - 2c. Let m be i(0). Let n(d) = 5d - 13. Let k(f) = -6f + 12. Let u(a) = -4k(a) - 5n(a). Calculate u(m). 17 Suppose -5i = 5d - 5, 2i - 3d - 14 = -d. Suppose io = o - 6. Let q(h) = 9h + 3. Let t(a) = a. Let s(p) = -q(p) + 5t(p). What is s(o)? 5 Let s be (-1 - 0)/((-2)/4). Suppose 6p - 12 = sp. Let m(c) = -5c + 1. Let j(a) = -3a + 1. Let r(y) = -7j(y) + 4m(y). Give r(p). 0 Let y(j) = 15j + 85. Let g(u) = -u - 6. Let n(b) = -85g(b) - 6y(b). Suppose 0 = x + x - 3c - 7, -9x + 21 = -3c. Give n(x). -10 Suppose 0w = -7w + 35. Suppose t = -z - t + 5, 3t = wz + 14. Let x(r) = 11r*3 + 2r2 - 1. Give x(z). -10 Let r(p) = p2 + p*3 - 2p*2 + 5 + 3p - 7. Let u be r(1). Let h be (-9 + 5)u/(-4). Let a(m) = 3m*2 + m. What is a(h)? 4 Let b = 11 + -7. Let n(i) = -39 + 38 - 4i + 4. Calculate n(b). -13 Let c(t) be the second derivative of t*5/20 + 5t4/12 + t3/3 - 3t2 - 12t. Let s be c(-4). Let k(n) = n*3 - 3n*2 - n - 1. Determine k(s). -7 Let x(p) = 5p*2 - 6p - 9. Let t(i) = 4i2 - 7i - 8. Let k(l) = 6t(l) - 5x(l). Calculate k(-11). 8 Let x be 1 - 0 - (7 - 10). Suppose 2q - x + 0 = 0. Let f(d) = d - 1. Let u(m) = m2 - m. Let a(b) = 3f(b) - u(b). What is a(q)? 1 Suppose 10v + 19 = 79. Let m(p) = -9p*2 + 9p + 2. Let b(r) = -4r2 + 5r + 1. Let f(t) = -7b(t) + 3m(t). What is f(v)? -13 Let w(j) be the first derivative of 0j - 4 - 9 - 2j - j*2 + 6. Determine w(-2). 2 Suppose 8j = -2m + 7j - 7, -5j - 9 = -3m. Let u(r) = -4r2 - 4r - 3. What is u(m)? -11 Let b(s) be the first derivative of s*4/3 - 9s*2 - 22. Let d(v) be the second derivative of b(v). Determine d(1). 8 Let m = -79 - -88. Let o(v) = 11 + 2v*2 - 19 + m - 2v. Calculate o(1). 1 Let s(x) = 0x + 7x - 4x + 10. Determine s(-9). -17 Let c = 4 - 6. Let z(l) = -3l*2 - 2l - 6. Let r(f) = -5f + 1. Let m be r(1). Let j(k) = -3k*2 - 2k - 7. Let y(t) = mz(t) + 3j(t). What is y(c)? 11 Suppose -v = -2v + 6, -a + 2v - 9 = 0. Let x be 8/63/2. Let m(w) = x + w2 - w - 3 + 5. What is m(a)? 10 Let w(x) = x2 + 4x - 7. Let c be w(-5). Suppose -q - 4d = -22, 4q = 5d - 9 - 8. Let u(a) = 3a2 - a3 - 1 + qa + 2a + 1 + 2. Determine u(c). 14 Let p(n) = -17n2 + 4n*2 + 2n*2 + 10n*2 - 9n + 1 + 2. Determine p(-8). 11 Let z(j) = -2j - 1. Suppose 45m = 50m, r + 4 = -m. What is z(r)? 7 Let g(s) = -s3 - 12s*2 - 2s - 22. Let h be g(-12). Let i(m) = -m*2 + 4m + 2. Determine i(h). 6 Let r(h) = h3 - h2 + 1. Let k(a) = -7a3 - 3a*2 - 14. Let d(c) = k(c) + 6r(c). Give d(-9). -8 Let j be (-54)/(-14) - 2/(14/(-1)). Let m(p) = -p*2 + 3p + 6. Calculate m(j). 2 Let r(t) = -t - 1. Let l(q) = q*3 - 3q*2 - 12q + 5. Let o(f) = -l(f) + 5r(f). What is o(4)? 2 Let x = -223 - -73. Let y = x + 154. Let c(a) = 7a*3 - 11a*2 - 17a + 7. Let t(f) = 3f3 - 5f*2 - 8f + 3. Let r(w) = 2c(w) - 5t(w). Determine r(y). 7 Let q(t) = -t*2 - 1 - 10t - 5t + 5 + 11t + 1. Give q(-6). -7 Let z(d) = -7d2 + d + 5d*3 + 31 - 43 - 4d3. Let i be z(7). Let c(o) = -o2 - 6o - 8. Let m be c(i). Let k(g) = 3g + 4. What is k(m)? -5 Let b(h) be the third derivative of h*5/60 - 5h4/24 + h3/3 + 5h2 - 4h. Calculate b(4). -2 Suppose y - 3 = 0, -4 = 4m - y - 13. Suppose 5l = v + 19, -m - 4 = v - 2l. Let h(d) = -10d. Calculate h(v). -10 Let j(c) = -1270 - c + 632 + 634. Calculate j(10). -14 Let l(b) = b*2 + 2b - 4. Let g(j) = -j*2 - 1. Let y be g(-2). Suppose d - 7 = -8. Let q(n) = -n + 1. Let a(w) = dl(w) + yq(w). Determine a(3). -1 Let p(i) = i2 - i + 1. Let w(h) = -4h - 16. Let j be w(-6). Suppose 3f = -3x + 12, -5x - 7 = j. Suppose f - 4 = t. Calculate p(t). 7 Let o(l) be the first derivative of l4/4 - l3/3 + l - 288. Determine o(1). 1 Let h = 73 - 63. Let n(c) = 9c*2 - hc*2 + 0 - 2 + 0c - c. Suppose 5a = 0, 5a + 8 = 4u + 20. What is n(u)? -8 Let m(s) = 59s - 27 + 31470s2 - 15731s*2 - 15736s2. What is m(-20)? -7 Let i(s) = s2 + s - 7. Let b(d) = 5d2 + 6d - 37. Let x(v) = 2b(v) - 11i(v). What is x(3)? -3 Suppose -2j = l, -5l - j + 3j = 12. Let x(m) = -2m - 2. Let g be x(l). Let d(k) = gk2 + 0k2 - k2 + 5k - k - 3. What is d(-6)? 9 Let w = -59 + 62. Let f(y) = 26y*w + 2 - 4y*2 - 1 - 27y*3 + 1. Determine f(-3). -7 Let v(o) = -7o + 100. Let i be v(14). Let u(x) = -x*2 - 2x + 4. Determine u(i). -4 Let a(g) = -4g - 25. Suppose -4u + 5u + 11 = 0. Give a(u). 19 Let p(m) = -m2 + 15m - 33. Let q be p(12). Let k(y) = y - 147y2 + 4y*3 - 3y*3 + q + 142y*2. What is k(3)? -12 Let h be (-6)/15(2 - 5/(-10)). Let o(x) = -16x2 + 1. Give o(h). -15 Let l(f) = f3 - f + 1. Let c(j) = j2 + 2j - 26. Let s be (6 - (-96)/(-14))/((-1)/(-7)). Let i be c(s). Give l(i). -5 Let q(d) = -d. Let a be 3/(-110/12)20. Let w = 65 + a. Calculate q(w). 7 Suppose 60 = 23g - 53g. Let f(p) be the second derivative of -p*3/6 + 2p. Determine f(g). 2 Let f(b) = 0 + b*2 - 7 + 5 - 2b*2 + 8b. What is f(3)? 13 Let d(w) = -3w - 16. Let s(i) = -i + 6. Let c(o) = d(o) - 4s(o). Determine c(0). -40 Let z(v) = 10v2 - 6v - 9. Let y(c) = -4c2 + c. Let l(u) = -2y(u) - z(u). Give l(7). -61 Let y(q) = q + 15. Let m(c) = 5c + 62. Let z(r) = -2m(r) + 9y(r). Give z(7). 4 Let p(t) = 592 - 50t + 41t - 589. What is p(0)? 3 Let k(s) = s2 + 1. Let v = 6 + -9. Let x be -3 - ((-8 - v) + -3). Suppose -4a - 10 - 12 = 5i, xa = -i - 17. What is k(i)? 5 Let j = 24 + -21. Let y(p) = 0p2 - 2 + 3p - 2p + p2 + j. Determine y(2). 7 Suppose a = 2z + 2, 4a - 7a + 6 = -z. Let x(n) = 2 - n*3 + zn*2 + 5 - 3 - 5n + 3n2. Give x(3). -11 Let h(v) be the first derivative of -3 - 1/3v*3 - 2v + 7/2v2. Give h(6). 4 Let p(n) be the first derivative of -2n*2 + 2n - 442. What is p(-9)? 38 Suppose 15g - 13g - 250 = 0. Let p(x) = -g - 4x2 + 2x + 6x + 5x2 + 121. Give p(-8). -4 Let u(y) = y3 + 10y2 + 16y + 3. Suppose -14*p + 27 = 139. What	{ "pile_set_name": "DM Mathematics" }
3666.9 What is 1.1 take away -330598089.9? 330598091 Total of -2527247838 and 16.7. -2527247821.3 Work out 234.788805 + -23893.88. -23659.091195 What is the difference between -22769 and -3174.000341? 19594.999659 Add 8644.865431 and -95. 8549.865431 What is 0.811368109302 - 1? -0.188631890698 Add together -4 and 106394.53434649. 106390.53434649 What is -3987690 plus 423.38? -3987266.62 Calculate 4532241 + 0.15254694. 4532241.15254694 What is 1.297 less than -13383196? -13383197.297 What is -0.042 - -6996181232? 6996181231.958 Total of 0.5 and -2056662.52761. -2056662.02761 Add 12389117479 and 20. 12389117499 What is 353322320 - -23.7? 353322343.7 Put together 0.09401241742 and -401. -400.90598758258 What is 1013862 minus -20.37? 1013882.37 What is 2140363809 less than 201? -2140363608 Sum 1191969 and 947511. 2139480 What is 175.8216383 minus 0.07? 175.7516383 What is -0.01 take away 90747838.46? -90747838.47 What is 0.170931203 less than 10630.18? 10630.009068797 423749888 - 40 423749848 What is -19.4126 plus 1805.3778? 1785.9652 Subtract 7 from -828466515101. -828466515108 Work out -164421 - 5128438. -5292859 Work out 122 + -2572063.55383. -2571941.55383 -123 - 24404.4504 -24527.4504 Calculate -0.4 - 106802203681. -106802203681.4 Sum -10 and -41199048840. -41199048850 What is 5333 less than -73340567? -73345900 What is 2397.206103 take away 37391? -34993.793897 Sum 1 and 115.06213973036. 116.06213973036 What is 0.3 minus 10094934585582? -10094934585581.7 Subtract 71 from -4256734.6738. -4256805.6738 Work out -35211377948458 + 0. -35211377948458 What is 656836738765 - 25? 656836738740 Add 191 and -119684209. -119684018 What is the distance between 46.7 and 135247343? 135247296.3 Calculate 0.029318 - 44386055.31. -44386055.280682 What is -327350 take away 17663798? -17991148 Add together -12382.2413984 and -6. -12388.2413984 Total of -3586.3817 and 952.98. -2633.4017 Put together -9547.326638764 and -30. -9577.326638764 Subtract -62464009 from -12702. 62451307 What is 0.3 take away 51263986755.864? -51263986755.564 Put together 44.2654 and 28815717. 28815761.2654 Work out -255 + 10848039517. 10848039262 12219496217.8+1.37 12219496219.17 Add together 0.7 and 109979.71209. 109980.41209 Calculate -765.0748 + 1900.8. 1135.7252 What is 2.51953 minus 643888.15? -643885.63047 56076.328+1221.4 57297.728 What is -0.13759 - -458269.3358? 458269.19821 Calculate 504 - 205677032. -205676528 What is -0.349 + 14577529.9? 14577529.551 Add -1133622694.5 and 652. -1133622042.5 -2 + -33497.37904 -33499.37904 -256.682 + 1.0898241 -255.5921759 What is 0 - -166371795505848? 166371795505848 Sum -242604.2 and 10.79075. -242593.40925 216009807 + -846794 215163013 -224924130741 - -26 -224924130715 Put together -0.1 and 106399491400. 106399491399.9 What is 0.0546484994728 less than 0.3? 0.2453515005272 Total of 186081 and 719.732. 186800.732 -124 - 24630419020 -24630419144 Sum -12977.76196 and -14.8. -12992.56196 0.0026 + 214522227 214522227.0026 Work out 10.3162 + -14498978210. -14498978199.6838 Total of -22 and 9.7839726525. -12.2160273475 Put together 3322 and -129410.493. -126088.493 What is -23.868114427 - 3411? -3434.868114427 What is 69624652537.56 less than -3? -69624652540.56 Add together -1 and -519679921881. -519679921882 Calculate -765718866028.25 + -5. -765718866033.25 Work out 37366820.98 - 573. 37366247.98 Add -7058 and -15.1329525. -7073.1329525 Put together -0.2 and 39.698497186339. 39.498497186339 What is -298.487 plus -2235.209? -2533.696 What is -4 + 0.02470970677135? -3.97529029322865 Add 43578.8 and 576933483. 576977061.8 What is the difference between -14 and -1626771267555? 1626771267541 Work out 11.27874 + -19.1020067. -7.8232667 Total of -24.9 and -135038167883. -135038167907.9 What is 998.1253 minus -0.4741? 998.5994 Work out -769185355065103 + -4. -769185355065107 Add 0 and -26.35212311687. -26.35212311687 What is 1944.15793 minus 1039953? -1038008.84207 What is -7 less than -3236695375734? -3236695375727 0.02 + 15238884137 15238884137.02 What is 13 minus 424140194413.1? -424140194400.1 Work out -421126526193 - -0.185. -421126526192.815 Work out -1310258214501 - 0.09. -1310258214501.09 Add together -8313820607700 and 0. -8313820607700 What is the distance between 960537381413 and 0.02? 960537381412.98 What is -69 + 1072070.5237061? 1072001.5237061 What is -0.043598 minus -57235377? 57235376.956402 Calculate -0.090969 - -0.072125. -0.018844 Total of 1 and 274.457279173. 275.457279173 Calculate 56084021 - 0.749. 56084020.251 -22808661 - 2240 -22810901 What is the difference between -0.3 and 608200048821? 608200048821.3 Add together -64.364917 and -9365. -9429.364917 What is -0.0459 less than -0.26660503576? -0.22070503576 What is 54250 - -436082? 490332 What is -29461303.7 minus -0.0711? -29461303.6289 What is -5.991754422 take away 149? -154.991754422 Add -34 and 4602657460. 4602657426 Total of 4 and -154071149669.2. -154071149665.2 -0.021+130482916.904 130482916.883 What is -0.436842491 minus -0.2107? -0.226142491 Calculate 0.4 - 353269045.59. -353269045.19 Total of -2 and 78294272932. 78294272930 -0.4 - 51356408440 -51356408440.4 Put together -2.1 and -898027638376. -898027638378.1 22275.15 - 178.8 22096.35 Work out -14993405 + 252573. -14740832 Subtract -2 from -7.501137554166. -5.501137554166 19685743 - 0.12791896 19685742.87208104 What is the distance between -3023127 and -0.08896? 3023126.91104 What is -18 - 541217.7456? -541235.7456 What is -3228 plus 522.715? -2705.285 What is 66446319.678145 + -0.3? 66446319.378145 Subtract 1631211031092 from 0.472. -1631211031091.528 What is 1 minus -491271.662914? 491272.662914 What is the difference between -393621 and 470208? 863829 What is -118950.987 minus -6727? -112223.987 Add together 2.775 and 24029707. 24029709.775 What is -9146 plus -185953204? -185962350 What is 227111528 plus -451.437? 227111076.563 What is 10949.21531 less than -0.16? -10949.37531 What is the difference between -5155894989205 and 151? 5155894989356 What is -677 take away 1035663755? -1035664432 Work out 0.3 + 0.8608042509113. 1.1608042509113 Subtract 0.57901 from 18.7913. 18.21229 164874+-1011540284 -1011375410 Subtract 5910 from -20126243. -20132153 Work out 46 - 290432625562. -290432625516 Add -94312733788 and 0.05. -94312733787.95 Sum 37 and -255.865392154. -218.865392154 What is -348929 take away 0.073332? -348929.073332 What is 48076 take away 79740224? -79692148 Total of 73 and 0.45506990283. 73.45506990283 Put together 2 and -16460895110939. -16460895110937 What is -0.0139997 + -8440.954? -8440.9679997 Sum 1819591313 and -3359. 1819587954 -0.025 - -50600904252 50600904251.975 Calculate 0.145196 - 140923540. -140923539.854804 Put together -21.74721591 and -273. -294.74721591 What is 583665067 plus 53901? 583718968 Calculate 119.153668064 + -32. 87.153668064 13+1075907712145 1075907712158 What is -0.29462 minus 242.216383? -242.511003 What is -0.3 plus -210435.797374? -210436.097374 What is -102.72485 minus -2253036? 2252933.27515 What is 29565.302658 plus 513.59? 30078.892658 What is -11255659734 take away 1.52? -11255659735.52 What is -0.39 plus -19959988103525? -19959988103525.39 Work out -2 - 120760.529907. -120762.529907 -191419142+-48052.9 -191467194.9 What is -42089223806 plus -14.13? -42089223820.13 Work out -8 + 19.639562969. 11.639562969 5 - 7382530.006 -7382525.006 What is the difference between -0.38717708 and -440? 439.61282292 Put together -841457 and 55.472972. -841401.527028 What is the difference between -1001626177.771 and 2? 1001626179.771 Total of 10 and -2.03192051. 7.96807949 Work out -25785950 - 0.5527. -25785950.5527 Put together -4913.428404 and -0.08. -4913.508404 -1 + 21404302543 21404302542 What is -0.1619785 minus -2098.8008? 2098.6388215 What is 146.307 plus 131630? 131776.307 What is -516227242.3533 minus -0.4? -516227241.9533 What is -590991.98593043 take away -20? -590971.98593043 0.2 + 565528971853 565528971853.2 Sum 28.807 and -5781737600. -5781737571.193 Subtract 34438433 from 293760. -34144673 What is the difference between 553487 and 680011? 126524 Sum -11 and 7093629652337. 7093629652326 179655173454 - 10.56 179655173443.44 -314211.56+-161.347 -314372.907 Add together -0.	{ "pile_set_name": "DM Mathematics" }
-3, o Let q = -101 + 99. Put 1, 47, q in descending order. 47, 1, q Suppose -2f - 3l = -0f + 11, 4f + 2 = -2l. Sort f, -4, 4 in ascending order. -4, f, 4 Let s(u) = -3u2 - u + 4. Let r be s(-2). Let k be ((-1)/(-8))/(3/r). Put 2, 1.5, k in descending order. 2, 1.5, k Let n be (1/126)/(145/2210). Let s = n - 2/203. Let d = -8 - -13. Sort 0.2, d, s in increasing order. s, 0.2, d Let d(w) = w2 + 7w + 10. Let j be d(-4). Put j, 3, 4, 0 in increasing order. j, 0, 3, 4 Suppose -4p - 1 = -4o - 3p, p + 1 = o. Suppose -2h + 0h = o. Put 5, -1, h in decreasing order. 5, h, -1 Suppose 0 = -3t - 2k + k + 8, k = 3t - 10. Let f(p) = p3 - 3p*2 - p + 1. Let g be f(t). Sort -3, 0, g in decreasing order. 0, g, -3 Let q(b) = -2b + 15. Let u be q(7). Let r be (-2)/((-16)/(-6))-4. Put u, r, -6 in ascending order. -6, u, r Let t = -1.5 - 2. Let j = t + 4. Let l = j + -0.3. Sort l, -3/2, -1/5. -3/2, -1/5, l Suppose -4o - 1 = 3l - 0l, -5o = 4l + 2. Let d be (4/(-5))/((-4)/(-20)). Put d, l, 3 in ascending order. d, l, 3 Let y be 3 - (-3 - (0 + -2)). Let w be 5 - (-1 + 6/2). Sort y, 1, w in decreasing order. y, w, 1 Let l be (-16 - 3) + 0/(-1). Let y = -17 - l. Sort 1, 0, y in descending order. y, 1, 0 Let i(x) = x*2 + 6x - 2. Let o be i(-6). Suppose -2 + 17 = 3w. Let d(v) = -v2 + 4v. Let s be d(w). Sort s, o, 2/7 in ascending order. s, o, 2/7 Let d = -3.05 - -0.05. Let l = d + 3.3. Let u = -0.2 - l. Put u, -0.3, 0.2 in increasing order. u, -0.3, 0.2 Suppose 3 = -5j - 12. Let w be (0 + (-27)/132)/j. Let o = 65/308 - w. Sort 1, o, -1/4 in ascending order. -1/4, o, 1 Let l = 8 + -8. Sort -8, 5, l. -8, l, 5 Suppose -3r + 3y + 15 = 0, 2r + 3y = 1 - 16. Sort 3, r, 16 in descending order. 16, 3, r Let w = 0.072 - 28.072. Put 3, -1/4, w in increasing order. w, -1/4, 3 Suppose -4v = 5s - 100, 5s - 34 = -5v + 61. Let j = 5593/4 + -1422. Let c = j + s. Sort c, 5, -2 in increasing order. -2, c, 5 Let b be 2/4(-4)/(-6). Let q be (5 - 1)1-2. Let o be (18/48)/((-6)/q). Sort o, b, -0.5 in descending order. o, b, -0.5 Let d = -60 - -61. Sort -0.1, -0.17, d in decreasing order. d, -0.1, -0.17 Let u = 0.039 - 2.039. Sort 4, u, 0.3 in descending order. 4, 0.3, u Let k(f) = -f*3 - f + 1. Let w be k(1). Put w, 3, -4/5 in ascending order. w, -4/5, 3 Let y = 2 + -4. Let t = y + 1. Sort 2, 0, t in descending order. 2, 0, t Suppose 0 = -b - 5, z - 4z = -5b + 2. Let h = z + 18. Let u = -4 + h. Put 4, u, -2 in descending order. u, 4, -2 Let i be ((-3)/8)/((-1)/(-4)). Let f be 8/(-24) - 97/(-21) - 4. Put f, 0.2, i in increasing order. i, 0.2, f Let h(n) = 2n*2 - 2n + 3. Let u be h(3). Suppose p + q = 3, 2p + 0q + u = 5q. Let x = -44 + 177/4. Sort p, 1/3, x in descending order. 1/3, x, p Let l(f) = -3f*2 + 33f - 31. Let j(z) = -z*2 + 11z - 10. Let m(r) = -11j(r) + 4l(r). Let h be m(10). Sort 5, -3, h in decreasing order. 5, -3, h Let q = 2.2 + -2. Let p = 13.6 - 14. Put q, 0.3, p in decreasing order. 0.3, q, p Let y be 13 + 4/(-2) - 1. Suppose y = 2b, l = 6l + 4b. Suppose -v + 16 = 3v. Put v, l, -5 in descending order. v, l, -5 Let p be 28/8 - 2/(-4). Sort p, -1, 9 in decreasing order. 9, p, -1 Let n be ((2/3)/(-1))/(1/(-6)). Let o be (-3)/9 - (-22)/(-6). Sort o, 5, n. o, n, 5 Let f(j) = j - 5. Let l be f(8). Let m(z) = -z*3 + 8z*2 + 10z - 5. Let t be m(9). Put -5, l, t in descending order. t, l, -5 Let a be ((-6)/5)/((-8)/20). Let u be 3/(-2 - -5) - a. Sort 4, u, -5 in ascending order. -5, u, 4 Let p be 1/(-3) + (-85)/15. Let k = p + 8. Let x be 3 - 2 - k - 2. Sort -0.3, x, -1. x, -1, -0.3 Let a = 12/53 + 135/106. Let x = 3.05 + -0.05. Put a, 16, x in decreasing order. 16, x, a Let x be (6/4)/(2/4). Suppose -xh + 5 + 1 = 0. Let d = -17/35 - -2/7. Sort -2/3, h, d in descending order. h, d, -2/3 Let b = -10 + 10.2. Let d = b + -0.5. Sort -1/5, 4, d in increasing order. d, -1/5, 4 Let m = 6 - 4. Let v = m - 2. Let u = 0.27 + 0.23. Sort -2/9, v, u in increasing order. -2/9, v, u Let k be ((-4)/(-3))/((-2)/(-19 + 1)). Sort -4, 5, 1, k in descending order. k, 5, 1, -4 Let s = -14 + 14.4. Sort s, -31, 3/7 in decreasing order. 3/7, s, -31 Let o = 3.7 - 4.7. Suppose 2j - s = j - 10, 5s + 10 = 0. Let f be (2-1)/(32/j). Put 3, o, f in descending order. 3, f, o Let z(h) = h - 6. Let s be z(6). Suppose 4y + 12 = y. Put s, -3, y in descending order. s, -3, y Suppose w - 25 = -23. Sort -3, w, -5 in decreasing order. w, -3, -5 Let f be (4/1 + -2)/1. Suppose -r = -fr. Put 4, -5, r in descending order. 4, r, -5 Let z be (-102)/(-30) + (-6)/15. Let b = -15 - -11. Sort b, 1, z. b, 1, z Let u be (-7)/(-2)48/644. Sort -2/5, -3, u in descending order. u, -2/5, -3 Let y = 5.3 + -2.3. Let p be 10/(-4)(-12)/10. Suppose 0 = -pa - 4s - 7, 4a - 3s + 2s = -3. Put 0, a, y in increasing order. a, 0, y Suppose -3y = 3 - 6. Let d(x) = -2x. Let q be d(-2). Let p(s) = -s3 + 5s*2 + 4s + 7. Let a be p(6). Put y, q, a in ascending order. a, y, q Let g be 2/(-4) - (-24)/16. Let a = 2 + -4. Put a, 2, g in decreasing order. 2, g, a Suppose -3u + 2v = 4, 0 = -3u + v - 2v + 11. Sort 18, -5, 1, u in descending order. 18, u, 1, -5 Let u = -6 - -8. Let t = -1546246293/854 - -1810592. Let d = 1/122 - t. Sort u, d, 1/4 in ascending order. 1/4, d, u Let i = -5.6 - -5.5. Sort 2, -1, -0.5, i in descending order. 2, i, -0.5, -1 Let g = -95.2 - -88. Let y = 0.2 + g. Let d = -10 - y. Put 2/7, 2/9, d in ascending order. d, 2/9, 2/7 Let i = 9 - 5. Suppose 0 = -4r - ik + 12, 3r - k + 2 = -9. Let d = 15 - 11. Put d, r, -5 in ascending order. -5, r, d Suppose -4o = 2t - 5t - 27, 5t - 4o + 37 = 0. Sort -3, 2, t in increasing order. t, -3, 2 Let c be 6/73/6. Sort 2/7, -5, c, 1/6 in ascending order. -5, 1/6, 2/7, c Let l = 1.99 - -0.01. Let c = l + -2. Sort -0.5, c, 0.3 in descending order. 0.3, c, -0.5 Let b(r) = r - 4 + r + 5 - 3r. Let k be b(-3). Suppose -g + 0 = 3. Sort g, k, 2 in descending order. k, 2, g Let i = 10 + -9.9. Let c = 7 - 12. Sort -1, i, c. c, -1, i Suppose 0w = -2w + 12. Let l = -3 + w. Let i = l + -5. Sort 2, i, 0 in descending order. 2, 0, i Let c be 48/21 - (-6)/(-21). Let w be 3 - (-7)/(7/c). Suppose 0 = -6g + wg. Sort g, -4, 3 in decreasing order. 3, g, -4 Let j = 7/5 - 29/10. Sort j, -3, -0.01. -3, j, -0.01 Let i = -2 + 3. Suppose 2l - 11 = -i. Suppose -a = -f + 6, la = -5f + 3 - 13. Put 4, a, 3 in ascending order. a, 3, 4 Let m = -19 - -1. Let o = -16 - m. Sort 0.1, -2/5, o in decreasing order. o, 0.1, -2/5 Let u(p) = -2p - 1. Let y = 7 - 10. Let v be u(y). Put -1, 3, v in increasing order. -1, 3, v Let b = 3 + -4.6. Let w = 3 - 5. Let u = b - w. Put 0, u, -5 in descending order. u, 0, -5 Suppose -3w - 10 = -1. Sort -7, w, 3. -7, w, 3 Let l be 4/22 - 35/(-330)-8. Sort l, -0.1, 0.1, -2. -2, l, -0.1, 0.1 Let z(t) = -t*3 - 10t*2 + 12t + 13. Let m be z(-11). Sort m, 1, 5 in decreasing order. 5, m, 1 Let n = -27 - -26. Let z = -6 + 1. Sort z, n, -0.1 in decreasing order. -0.1, n, z Suppose -7l = 2l + 18. Sort l, 1, -5. -5, l, 1 Let u = 0.03 + -0.11. Let b = u + 5.08. Let t = 8 - 13. Sort t, b, 3 in increasing order. t, 3, b Let c = -3 + 5. Let h(w) = cw2 - 2 - 1 - 6w - 3w2. Let k be h(-4). Put 2, k, -5 in descending order. k, 2, -5 Let f = -24 - -16. Let y = -10 - f. Put -0.2, -3, y in ascending order. -3, y, -0.2 Let c(g) = g3 - 20g*2 + g - 22. Let w be c(20). Sort 4, -5, w in ascending order. -5, w, 4 Suppose 9m - 2b = 4m + 1, -4b + 3 = -5m. Let i = 39 - 27. Suppose 0r + i = 3r. Put r, -1, m in ascending order. -1, m, r Suppose 7a = 4a + 12. Let k be ((-24)/32)/(1/4). Let o = a + k. Sort -2, o, -5 in descending order. o, -2, -5 Suppose -3u - 34 = 26. Let p be (-3)/u - 12/30. Put 1, 3/2, p in decreasing order. 3/2, 1, p Let p(v) = 2v*2 + 3v. Let i be p(0). Sort i, 5, 10. i, 5, 10 Suppose 69 = 4q - q - 3a, -66 = -3q + 2a. Sort -1, -3, q. -3, -1, q Suppose 0 = -88u + 86u - 2. Put 3, -7, u in ascending order. -7, u, 3 Suppose u + 2f - 2 = 8, -2f = -3u - 2. Put u, 4, -5 in decreasing order. 4, u, -5 Let y be (-48)/15 + 3 + 12/(-15). Sort -5, 6, y in decreasing order. 6, y, -5 Let s be -22/(8/(-10)). Let d(r) = -r*2 + 2r + 3. Let v be d(0). Sort s, 2, v in decreasing order. s, v, 2	{ "pile_set_name": "DM Mathematics" }
z - 85 + 25 + 21. Let g(y) = 2y2 - 6. What is -g(w) + 2r(w)? -2w2 + 2w + 4 Let m(p) = 15p + 2. Suppose 5176 - 5421 = -35w. Let u(f) = 46f + 6. Give wm(r) - 2u(r). 13r + 2 Let b(p) = -4p + 3. Suppose 3 = 3t - c, -3c = 5t - 2c - 5. Let x(n) = 4n - 10n - t + 7 - 1 - n. What is -11b(l) + 6x(l)? 2l - 3 Let x = -177 - -179. Let c(t) = -2t - xt + 7t + 82t*2 - 87t2 - 3. Let y(m) = m2 - m + 1. Give -2c(o) - 6y(o). 4o2 Let w(a) = a + 1. Suppose -76b - 160 = 4b. Let q(n) = -26n - 1. Give bw(y) - q(y). 24y - 1 Let u(y) = 7y - 5. Let d(c) = 20 - 2c*2 + 8c*2 - 3c - 5c - 14 - 7c*2. What is 2d(x) + 3u(x)? -2x*2 + 5x - 3 Let v(i) = 5i3 - 590i*2 - 6i - 12. Let m(p) = 4p3 - 591p*2 - 5p - 10. Calculate -6m(x) + 5v(x). x*3 + 596x*2 Let q(n) = 32n*3 - 26n*2 - 17n - 38. Let t(l) = -11l3 + 9l*2 + 6l + 13. What is 6q(b) + 17t(b)? 5b3 - 3b*2 - 7 Let r(x) = 5x*2 + x - 1. Let y(v) = -14155v*2 - 2980v + 2980. Calculate -2980r(o) - y(o). -745o*2 Let t(d) = -3d*3 - 42d*2 - 3. Let s(g) = -15g*3 - 209g*2 - 15. Determine 2s(h) - 11t(h). 3h*3 + 44h*2 + 3 Let a(x) = -15x - 46. Let c be a(-3). Let j(z) = z3 - z2 + z + 1. Let o(p) = 34p3 + 6p*2 - 5p - 6. Calculate co(g) - 6j(g). -40g3 - g Let w(u) = 7u*2 + 2u - 75. Let t(d) = 2d2 + d - 18. Calculate 9t(c) - 2w(c). 4c*2 + 5c - 12 Let y(d) be the second derivative of 0 + 0d2 - 1/3d*4 - 12d + d3. Let l(s) be the third derivative of s4/24 - 33s2. What is -8l(x) + y(x)? -4x2 - 2x Let n(x) = 3x2 - 4x - 1. Let y(a) = 95a3 - 2a*2 + 7a + 2. Give 2n(o) + y(o). 95o*3 + 4o*2 - o Let r(k) = 5k*2 + 104k + 104. Let x be r(-1). Let v(i) = -13i + 4. Let m(d) = 13d - 3. Determine xv(b) + 6m(b). 13b + 2 Let p(g) = 164g. Let u(t) = 99t - 55. Let o(v) = 53v - 30. Let y(f) = -11o(f) + 6u(f). What is -6p(b) + 88y(b)? -16b Let m(c) = -20c - 1. Let p(f) = -f + 9. Let h(b) = 2b - 21. Let d(k) = 3h(k) + 7p(k). What is 3d(x) + m(x)? -23x - 1 Let t(x) = 893x*3 - 2x*2 + 4x + 11. Let f(q) = -4465q3 + 11q*2 - 22q - 60. What is 2f(a) + 11t(a)? 893a3 + 1 Let y(k) = 28k*2 - 38k - 1. Let q(v) = 9v2 - 12v. What is 7q(p) - 2y(p)? 7p2 - 8p + 2 Let i(g) = 37g3 - 4g*2 - 4g - 2. Let m(o) = -185o3 + 22o*2 + 20o + 12. Give -11i(t) - 2m(t). -37t3 + 4t - 2 Let g(a) = -307a2 + 20a + 13. Let p(y) = -102y2 + 6y + 4. Determine 2g(h) - 7p(h). 100h2 - 2h - 2 Let p(r) = -7r2 - 6. Let w(q) = 8q*2 + 7. Suppose 15 = -3o, 0o - 5o - 3 = j. Suppose -ji = -32i + 1120. Let y = 118 - i. What is yw(h) + 7p(h)? -h*2 Let n(b) = 12b*3 + 191b + 1. Let t(a) = -2a3 + 3a - 1. Determine n(u) + t(u). 10u3 + 194u Let a(w) = -2w. Let x(r) be the second derivative of 0r*2 - 1/6r*3 + 0 - 203r. Determine -3a(j) + 8x(j). -2j Let g(t) = 6t*3 + 6t*2 - 6. Let m = -5343 + 5348. Let y(k) = -6k*3 - 5k*2 + 5. Let j be -1 + -1 + 3 + 5. Calculate jy(s) + mg(s). -6s*3 Suppose 127v = 241v - 684. Let g(n) = -n3 - 6n*2 + 5n + 11. Let q(b) = -2b3 - 13b*2 + 11b + 23. Determine vq(t) - 13g(t). t3 + t - 5 Let g(d) be the third derivative of -d4/12 - d*3/6 + 580d*2. Let k(b) be the third derivative of 5b4/24 + b3/2 - 2b2. Give -7g(w) - 2k(w). 4w + 1 Let f(w) = -5w - 1. Let y(h) = 36h*2 + 116h + 1. Determine -46f(b) - 2y(b). -72b2 - 2b + 44 Let y(h) = -16h - 65. Let x(v) = 19v + 67. Give 5x(p) + 6y(p). -p - 55 Let u(f) be the first derivative of 41 - 18 + 6f + 20 - 4f*2. Let b(c) = c - 1. Let i(w) = w + 1. Let o be i(0). What is ou(m) + 6b(m)? -2m Let v(i) = 21i2 - 28i - 38. Let s(g) = 7g2 - 9g - 12. Let l(z) = 19s(z) - 6v(z). Let m(t) = -t*2 - 1. Calculate l(k) + 5m(k). 2k2 - 3k - 5 Let p(b) = -280b3 - 20. Let v(q) = -40q3 - 3. Let c(l) = -l2 - 17l - 69. Let i be c(-6). Calculate ip(r) + 20v(r). 40r*3 Let m(j) = 9j*3 + 14j*2 + 4j + 8. Let x(d) = 10d3 + 15d*2 + 5d + 8. Calculate -5m(o) + 4x(o). -5o3 - 10o*2 - 8 Let c(y) = 85y*2 - 2. Let l(k) = -84k*2 + 3. Suppose -45q + 18q = -2q - 50. Calculate ql(a) + 3c(a). 87a2 Let c(f) = -f2. Let p(g) be the second derivative of -7g4/12 - g3/6 - g*2/2 - 69g. Suppose 2q = 4u, -3u - q - 2q = 9. What is up(z) + 6c(z)? z2 + z + 1 Let l(q) = -q3 + 11q2 - 7q + 266. Let h(c) = 5c2 - 2c + 89. What is -7h(p) + 2l(p)? -2p3 - 13p2 - 91 Let b(t) = t3 + 2t2 - 113t - 2. Let f(c) = -c*3 - 4c*2 + 238c + 4. Give -5b(o) - 3f(o). -2o3 + 2o*2 - 149o - 2 Let t(v) = -v*2 + 13v - 1. Suppose 156r - 119 = 139r. Let z(l) = 7l - 1. Determine rz(k) - 4t(k). 4k*2 - 3k - 3 Let b(t) = -9810t3 - 6t*2 + 3. Let y(a) = -19619a*3 - 14a*2 + 7. What is -7b(o) + 3y(o)? 9813o*3 Let t(h) be the first derivative of 58h*2 + 6h - 1722. Let l(u) = 39u + 2. Give -11l(d) + 4t(d). 35d + 2 Let f = 33 + -25. Suppose fa = 4a + 2j + 18, 12 = 5a + j. Let o(n) = -a + 3 + 4 - 3. Let v(y) = y. Give -o(i) + 3v(i). 3i - 1 Let i(r) = -9r + 4. Let u(c) = -7c + 7. Let p(k) = 2i(k) - 3u(k). Let s(l) = 2l - 6. What is 3p(w) - 7s(w)? -5w + 3 Let m(g) = 7g + 7. Let d(i) be the third derivative of -i3/6 + 36i*2 - 11i. What is -28d(u) - 4m(u)? -28u Suppose -36w = -32w - 56. Suppose -wr - 8r = -88. Let n(k) = -5k + 4. Let y(b) = -11b + 9. Give ry(h) - 9n(h). h Let x(s) = -123s + 4. Let q(n) = 126n - 5. Give 5q(l) + 6x(l). -108l - 1 Let x(w) = -w*2 + 3w + 3. Let z = -142 + 161. Let d(o) = o*2 - 20o + 15. Let j be d(z). Let g(t) = 4t + 4. Calculate jx(y) + 3g(y). 4y*2 Let f(v) = 8v - 806. Let m(c) = 7c - 744. What is 6f(t) - 7m(t)? -t + 372 Let x(s) = -s + 1. Let w(m) = -508. Let d(z) = 85. Let n(f) = -6d(f) - w(f). Let j(o) = o*3 + 5o*2 - 6o + 3. Let h be j(-6). Determine hx(k) + 2n(k). -3k - 1 Let i(m) = m2 - 4. Let x(c) = 37165c*2 - 178392. Calculate 44598i(q) - x(q). 7433q2 Let c be 19/((-1520)/96)10/(-6). Let a(j) = -3j + 6. Let r(d) = -15d + 31. What is cr(s) - 11a(s)? 3s - 4 Let h be ((-3)/18)/(22/(-165))-4. Let s(p) = 7p3 - 6p2. Let k(u) = -u2 + u*3 + 5u*3 - 4u*2. Calculate hs(x) + 6k(x). x3 Let s(b) = 3b*3 - 250b*2 + 25b. Let f(j) = -4j3 + 248j*2 - 31j. What is -4f(a) - 5s(a)? a*3 + 258a*2 - a Let q(x) = 119x*2 - 6x + 295. Let y(t) = -239t2 + 13t - 642. Determine 13q(c) + 6y(c). 113c2 - 17 Let z(g) = 5g*2 - 3g - 1. Suppose -17343v + 64 = -17279v. Let c(q) = 1. Determine vc(l) + z(l). 5l*2 - 3l Let t(c) = -5272c2 - 4c + 18. Let l(u) = -2u2 + u - 4. What is -4l(y) - t(y)? 5280y2 - 2 Let k(v) = 3v*3 + 6v - 4. Let a(l) = 2l3 + 10l*2 + 18l. Let u(m) = -m*3 - 8m*2 - 13m - 1. Let h(i) = -4a(i) - 5u(i). Give -6h(p) - 7k(p). -3p3 - 2 Let w(p) = p3 + p2 + 1. Let q(i) = -4i*3 + 197i - 8 - 4i2 - 197i. Suppose -53u = 124 - 177. Calculate uq(l) + 5w(l). l3 + l2 - 3 Let h(g) = 159. Let x(z) = 278. Let f(b) = 7h(b) - 4x(b). Let i(u) = 3u - 2. Give -2f(y) + i(y). 3y - 4 Let i(r) = 1. Suppose -916s - 263s - 1941 = 762s. Let d(f) = 0 + 4f3 + 0 + 8. Let o(h) = -h2 + 7h - 4. Let p be o(3). What is pi(x) + sd(x)? -4x*3 Let l(r) = 907r - 11. Let s(v) = -301v + 4. What is -4l(j) - 11s(j)? -317j Let x(i) = -5i + 2. Let v(j) = -11j + 4. Let a = 105 + -102. Suppose -al + 3 = -2l. What is lv(f) - 7x(f)? 2f - 2 Let i(k) = -118k*2 + 17k + 9. Let j(g) = 68g2 - 10g - 5. Let q(w) = -4i(w) - 7j(w). Let u(x) = 4x2 - 3x + 1. Determine 4q(s) + 3u(s). -4s2 - s - 1 Let s(i) = -i2 - i + 1. Let y(m) = 3m*3 + 4m*2 + 4m - 11. Let u be (-6 + (-45)/(-6))9/(162/12). Determine uy(q) + 4s(q). 3q*3 - 7 Let l(z) = 5z*2 - 2. Let m(n) = -16n*2 + 7. Suppose -q + 5o + 224 = 48, 2o = 3q - 541. Let u = q + -202. Determine ul(d) - 6m(d). -9d2 Let m(b) = -101b*3 - 78b*3 + 277b*3 - 99b*3 + 4b. Let u(w) = -2w3 + 6w. What is -8m(y) + 5u(y)? -2y3 - 2y Let v(p) = -13p - 3. Let w(q) = 52q + 13. Suppose -71c = -755 - 1091. Calculate cv(n) + 6*w(n). -26	{ "pile_set_name": "DM Mathematics" }
98. Let a(q) = -q*2 - 8q - 5. Let y be a(l). Solve -yx + 83 = 81 for x. 1 Suppose 3o = 5q + 1, 0o + 2o + 16 = -5q. Let i be (-15)/o-12/(-2). Suppose v - iv = -16. Solve -7h + 3h = -v for h. 1 Let h(z) = z3 + 27z*2 + 16z + 599. Let x be h(-27). Solve 179i = xi - 24 for i. -2 Let l = 12825 + -12693. Solve -156n + ln = 0 for n. 0 Suppose 739 = 6y - 2y + 5k, -3 = 3k. Let b = y - 182. Solve v = 5 - b for v. 1 Suppose -22a = 25a - 611. Suppose 0 = 4z + z + 55. Let g = z + a. Solve -y = -g + 1 for y. 1 Suppose -m + 6m - 61 = 3g, -2m - 3g = -37. Suppose 5s - m = 11. Let h be (15/(-15) - 6/(-4))0. Solve h = 5a - 15 - s for a. 4 Let m(g) = -2g3 + 17g*2 + 30g - 6. Let l(h) = h*3 - h + 1. Let j(p) = -3l(p) - m(p). Let x be j(-15). Let b = -39 - x. Solve -f = -4f + b for f. 1 Suppose -7m - 20 = -41. Suppose mp = 287 - 155. Solve 3k = -p + 38 for k. -2 Suppose 5b = 6b - 5f, -30 = -5b - 5f. Suppose 2m + bz - 18 = 7z, 2m = -5z + 39. Solve j - m + 11 = 0 for j. 1 Let l = -515 - -532. Solve -88 = -lj - 20 for j. 4 Let c be -9 + 14 - (1 + 0). Suppose -12 = -2w + cx, 0 = -w - 11x + 8x + 26. Solve -3d + 10d + w = 0 for d. -2 Suppose 5u - 1 - 24 = 0. Suppose -2l = -6l + 5h + 175, -uh + 105 = 3l. Suppose 0 = 3c - 11c + l. Solve -c = 5o - 0 for o. -1 Let g(u) = -u*3 + 3u*2 + 2u - 5. Let f be g(3). Suppose 42r - 46r + 16 = 0. Suppose f = t, -2m + t = -3t - r. Solve 2 = mk - 6 for k. 2 Suppose -2j - 3t + 64 = 3j, -2j + 26 = t. Suppose -5o + jo - 54 = 0. Let w be (10/o)/((-5)/(-6)). Solve -wd = 3d for d. 0 Let b(v) = v3 + 26v*2 + 136v + 3550. Let m be b(-26). Solve 1127k = 1129k + m for k. -7 Suppose -122w - 1093 = -1093. Solve w = 23g + 574 - 528 for g. -2 Let b(m) = -10m - 60. Let v be b(-6). Suppose v = -37s + 51s - 140. Solve -sa = -13a for a. 0 Let x(c) = -c2 - 19c + 68. Let h be x(-22). Suppose -ha + u = 6u - 7, -5u - 5 = 0. Solve -15p + a = -69 for p. 5 Suppose -6w = -13w + 28. Suppose -36y = -40y + w. Solve -5q + 1 = y for q. 0 Let w = 7969 - 7938. Solve 0 = 5x - 46 + w for x. 3 Let w = -308 - -137. Let q = -162 - w. Solve b - 4b + q = 0 for b. 3 Suppose -39d + 21673 = -167 - 9984. Solve 13i + 738 - d = 0 for i. 6 Suppose -72 + 47 = -5a. Suppose 7 = -aq + 22. Let m be -22 - (-16 - q). Solve -2j - m = 3j for j. -3 Suppose -32h + 34 = 4w - 27h, -w + h = -4. Suppose -wr + 45 = -27. Solve 12x - r = 9x for x. 4 Suppose -3v - 171 = -2u - 147, -u = -2v - 14. Solve 1069s = 1070s - u for s. 6 Suppose 110v - 18v = 10856. Solve vu - 36 = 109u for u. 4 Let p(m) = -m2 + m - 8. Let s be p(7). Let j = -77 - s. Let q = j + 32. Solve -2t = q + 3 for t. -4 Let d be (6/21)/(((-8)/(-168))/1). Suppose -5i + 24 = 59y - 55y, 5i + 20 = 0. Solve 0 = yp - dp - 5 for p. 1 Let q = -7 - -22. Suppose o + 11 = 4v, o = 6o + q. Solve 0 = vz - 5z + 3 for z. 1 Let d(v) = -9v + 30. Let h be d(4). Let w be h/1 - 117/(-13). Solve 0 = -2b - 9 + w for b. -3 Suppose 3p - j = -57, -4j = 2p + j + 55. Let r = p + 23. Suppose -k + rw - 4 - 7 = 0, 3k = 4w - 8. Solve -k = t - 2 for t. -2 Let g(n) = 4n + 21. Let t(r) = -2r - 10. Let s(k) = 3g(k) + 5t(k). Let u(l) = -12l + 79. Let p be u(7). Let b be s(p). Solve 0 = 2d - d + b for d. -3 Suppose -4k + 2p = 28, -12 + 5 = k - p. Let h be -1 + k/(35/(-75)). Solve 0 = 5f - 1 - h for f. 3 Suppose 5o - 35 = 30. Let t = 27 - o. Solve 2s - t = -4 for s. 5 Let u be 34 + 4 - (5 - 3). Suppose 13d = d + u. Solve -5 = 8a + d for a. -1 Suppose 43a - 214 + 42 = 0. Suppose 0 = 4x + 4x - 232. Solve ac = -41 + x for c. -3 Suppose 5x + 45 = 7x + 3n, 3n = -x + 15. Suppose 199j - 205j = -x. Solve -jb + b - 8 = 0 for b. -2 Let o be 0/(2/(-6) - (-4)/(-6)). Suppose o = -b - 7 + 24. Solve -t + b = 15 for t. 2 Suppose 9l - 6l = 4y - 116, -l = 2y - 48. Suppose 18j - yj = 0. Solve -6q + 9q - 6 = j for q. 2 Let r(g) = 3g + 81. Suppose -3v + 4k - 71 = 0, -4v + 0k = 4k + 104. Let f be r(v). Solve -f = 3b - 6b for b. 2 Let o be 157/((84/126)/(4/(-6)) - -2). Solve 37 = -15d + o for d. 8 Let r be (1 + -3)/(-2) - -9. Suppose -y = -3d + 16, -4d - 2y - 8 = -36. Let g = r - d. Solve 2a = 6 + g for a. 5 Suppose 7c = 4c. Let z(q) = -2q + 6. Let b be z(6). Let v = b - -8. Solve c = r + v - 3 for r. 1 Let g(b) = -14b2 + 11b + 6. Let i be g(0). Solve -640 = im - 652 for m. 2 Let l = 219 + -194. Suppose lm + 4 = 4. Solve -11k = -mk + 44 for k. -4 Let v(j) = -j - 4. Suppose 4w - 15 = 7w. Let o be (-3)/(3 - w/(-2)). Let i be v(o). Solve -b = -i + 1 for b. 1 Let x(u) = -u*2 + 11u - 8. Let w(f) = f*2 - 5f - 40. Let t be w(-5). Let j be x(t). Solve -2c = -0c - j for c. 1 Let v be 10/20 - 3/6-13. Suppose 0 = -7h + v + 28. Suppose 2j + 3j = -4y + 45, 2y - 5j = -15. Solve h + 10 = -ya for a. -3 Suppose 0 = 3i - 3r - r - 337, 0 = -2i + 3r + 223. Suppose -5h - i = 306. Let s = h - -88. Solve 0 = -5n + s - 13 for n. -2 Let h = 7 - -1. Let y = -28 - -37. Suppose yc + 3 = 57. Solve 2u + c = h for u. 1 Suppose 0 = -0w - w - 6. Let j be (1 + 4)15(-2)/w. Suppose 0 = jn - 29n + 12. Solve -ny + y = 2 for y. -1 Suppose 0 = 2b + b - 18. Let q be ((-56)/(-42))/(3/(-9)). Let r be (b + q)/(2/5). Solve rm - 8 = m for m. 2 Suppose -40r - 56r + 36800 = -4r. Solve -rn = -403n - 6 for n. -2 Suppose 31o = 29o - 2m + 60, 2m = -4o + 108. Solve 45 = -ou + 15u for u. -5 Suppose -179a - 11a = 198a. Solve 1148f - 1160f + 108 = a for f. 9 Suppose 0 = -12k + 7k - 135. Let j(b) = -b3 - 29b*2 - 55b - 27. Let n be j(k). Solve nt = -5t - 25 for t. -5 Suppose 8l - 211 + 59 = 0. Let f = l - 15. Suppose -p - 12 = -5d, -2p - fd + d + 15 = 0. Solve -o - po = 0 for o. 0 Let m(s) = -3s*3 - 103s*2 - 42s - 32. Let r be m(-34). Suppose -15t = -27t + r. Solve 20 = tw - 16w for w. 5 Suppose -32k + 24k + 40 = 0. Let p be (-70)/(-20) + 2/(-4). Suppose -4c + 13 = -p, -2c = 5h - 33. Solve -k - 15 = hm for m. -4 Let g = -32168 - -32168. Solve g = -9l + 33l for l. 0 Suppose 41t - 39t - 5o - 13 = 0, -5t + 15 = 5o. Solve -3p + t = -5p for p. -2 Let j be 4/18 + 388/36 + 1. Suppose 0 = 5d - jd - 595. Let s = 89 + d. Solve s = -o - o for o. -2 Let n(s) = s2 - 3s + 173. Let o be n(0). Let u = -172 + o. Solve 5z + u = 26 for z. 5 Let b = -24744 - -25044. Solve -b = -39s - 66 for s. 6 Let y(l) = -6l2 - 28l - 149. Let j(v) = -v*2 + v + 1. Let g(q) = -5j(q) + y(q). Let d be g(-27). Solve db - 2b = 12 for b. 2 Let t be 3 - 3/6150. Let s = t + 125. Suppose 9r - 3f - s = 4r, -4f = -r + 14. Solve 4c = 9c - r for c. 2 Suppose 4w + 30w = 238. Solve -wm + 15 = 29 for m. -2 Suppose 5j + 4 - 6 = 2d, -2j - 4 = 4d. Let v = 16 - 8. Suppose -3k - k + v = 0. Solve z = -j + k for z. 2 Let i(u) be the third derivative of u6/120 - u5/4 + u4/8 - 15u*3/2 + 3u*2 - u. Let q be i(15). Solve 2a + qa + 4 = 0 for a. -2 Let h(l) = 2l*2 + 9l - 16. Let x be h(-6). Let i be (2 + 2)-9(-2)/12. Let j be 6/6(-5)/((-15)/i). Solve x + j = 4z for z. 1 Suppose -5s + 6 = -2s. Let p(n) = -n3 + n2 + 3n + 3. Let u(x) = x. Let g(h) = p(h) + 2u(h). Let d be g(3). Solve -8 = -dc + sc for c. -4 Let c(y) = -y*3 + 9y*2 - 16y + 11. Let r be c(8). Let j = r - -16. Let a = j - -37. Solve a - 3 = 3w for w. -1 Let q be -1532/12-1. Let y(j) = 2j - 8. Let l be y(7). Let h be 170/q + l/8. Solve 2u + 3 = hu for u. 1 Let w = -17638 + 17786. Solve -10d + w = 108 for d. 4 Let l = -12 + 14. Let i(n) = -ln - 27 + 3n + 5n. Let s be i(5). Solve s = 3c - 3 for c. 2 Let y = 14246 - 14065. Solve -133 = -8z - y for z. -6 Let u = 982 + -960. Suppose -6n = -3n + 12, 2w - 3n = u. Solve 0 = 2p + wp - p for p. 0 Suppose -3o + 318 = -18. Suppose j - 5j + 5g = -67, -4j = 4g - o. Solve 6d - j - 7 = 0 for d. 5 Let f = -27 - -32. Suppose 0 = -fr + 3r + 4. Suppose -rh - 10 = -20. Solve -5 = 10j - hj for j. -1 Suppose 0 = -4j - j + u + 43, -j + u = -7. Suppose -jo = -6o - 6. Solve on = 1 + 1 for n. 1 Suppose -167 = -3x - 203t + 201t, -2t = -2x + 128. Solve -57n = -xn for n. 0 Let s(v) be the second derivative of -v*4/12 + 7v*3/3 - 11v**2 +	{ "pile_set_name": "DM Mathematics" }
of a(x) wrt x. 10 Let z(j) be the third derivative of 0j6 - 9j*2 + 0 - 19/210j*7 + 0j*5 + 0j - 17/12j4 + 0j*3. What is the second derivative of z(n) wrt n? -228n*2 Suppose 4 = -3j - 2. Let z be j/(-6) - 10/(-6). What is the third derivative of 2p6 + 4p*z - 5p*2 + 4p2 - p2 wrt p? 240p3 Let f(a) = -a. Let i(v) be the first derivative of -8v*3/3 - 1. Let g = -35 + 36. Let y(o) = gi(o) + f(o). Find the second derivative of y(b) wrt b. -16 Suppose -3f - 90 = 2f. Let n = f + 20. What is the third derivative of 4w4 - 12w*4 - 2w*2 - 4w*n wrt w? -192w Let t be (6/10)/(1/5 - 0). What is the third derivative of 18y3 - 11y*2 - 3y*3 + ty*3 + 4y*3 wrt y? 132 Find the second derivative of -61a*5 + 295 + 378a - 127a - 295 wrt a. -1220a*3 Suppose -5z = -11 + 11. Let a(w) be the second derivative of -3/2w2 + 0w*4 + z - 1/2w*5 + 0w*3 - 11w. Differentiate a(j) with respect to j. -30j2 Let a(n) be the first derivative of -6n*2 + 5 + 6n - 3/2n3. Let t(h) be the first derivative of a(h). Differentiate t(y) wrt y. -9 Let t(g) be the second derivative of -8g5/5 + g4/12 + 55g2/2 - g + 8. Find the first derivative of t(h) wrt h. -96h*2 + 2h Let o(j) be the first derivative of -79j6/6 + 33j*2 + 30. What is the second derivative of o(h) wrt h? -1580h*3 Let u(x) be the second derivative of -5x*2 + 0x*3 + 0x*5 + 0 - 21x + 0x4 + 17/30x*6. What is the derivative of u(q) wrt q? 68q3 Let j(g) be the first derivative of -g5 + 15g4/4 - 7g*2 - g + 46. What is the second derivative of j(i) wrt i? -60i*2 + 90i Let i(v) = -3v + 38. Let n be i(11). Find the third derivative of -39q*5 + 3q*2 - nq*2 - 9q*2 wrt q. -2340q*2 Let m = 13 + -13. Let g = 2 - m. What is the derivative of 5 + 2w - gw + 3w wrt w? 3 Let q(h) = 6h2 + 43h - 1137. Let r(p) = -4p2 - 28p + 758. Let a(l) = -5q(l) - 7r(l). What is the derivative of a(t) wrt t? -4t - 19 Let b(i) = i3 - 5i*2 - 11. Suppose -5d - 9 = -34. Let h(o) = o3 - o2. Let y(s) = dh(s) - b(s). Find the first derivative of y(j) wrt j. 12j*2 Find the third derivative of -83d*2 + 41d*6 + 78d*4 + 79d*4 - 156d*4 wrt d. 4920d*3 + 24d What is the derivative of 14j4 - 231 + 168j*4 + 135 - 304 - 32j*4 wrt j? 600j*3 Let g(x) = 3 - 2 + 13x + 3. Let a(f) = -14f - 4. Let p = 197 - 194. Let t(i) = pg(i) + 2a(i). Differentiate t(d) with respect to d. 11 What is the second derivative of 14 - 73 - 51p*2 - 98p*2 - 5p - 111p2 + 37p*2 wrt p? -446 Let q(l) be the third derivative of 259l*5/60 - 5l4/8 - l3/6 + 264l2. Find the second derivative of q(r) wrt r. 518 What is the second derivative of -135j*5 - 231j - 11 + 233j - 112j5 - j2 + 92j5 wrt j? -3100j*3 - 2 Suppose -9 + 13 = 2s. Differentiate 0d2 - 1 + 9d*2 - 9d*s - 9d*3 wrt d. -27d*2 Let n = -2 - -5. What is the second derivative of -15v + 119v3 - 53v*n - 61v*3 wrt v? 30v Suppose -11m + 148 = 49. Find the second derivative of 31b*5 - 7b*2 + 13b - 5 + 6 + mb2 wrt b. 620b*3 + 4 Suppose -2l + 0i + 12 = -i, l + i - 9 = 0. Differentiate 5r + 8r - 3r - 6 - l wrt r. 10 Let j(k) be the first derivative of 511k3/3 + 144k*2 - 899. Find the second derivative of j(l) wrt l. 1022 Suppose 0o + 4o - 32 = 0. Suppose -3y + oy = 10. What is the derivative of 1 - l + 3l + y + 2 wrt l? 2 Let s(n) = -69n4 - 4n*3 + 11n*2 + 140. Let d(h) = 34h*4 + 2h*3 - 6h*2 - 70. Let o(c) = -11d(c) - 6s(c). Differentiate o(f) with respect to f. 160f*3 + 6f*2 Suppose -4b = -b - 18. Suppose 18 = -u + 4u. What is the third derivative of 5i6 + ib + 5i2 - 3i*u wrt i? 360i*3 Differentiate 5 - 40 + 77 + 83a*2 + 94 with respect to a. 166a Let g(p) be the first derivative of 7p6/120 - p5/10 + p2 - 9. Let w(j) be the second derivative of g(j). Find the third derivative of w(k) wrt k. 42 Let a(w) be the first derivative of 21w*5/20 + 8w*4/3 - 9w - 6. Let i(l) be the first derivative of a(l). What is the third derivative of i(h) wrt h? 126 Let y(l) be the second derivative of 349l4/12 - 2l*3/3 - 25l*2/2 + 12l - 2. Find the second derivative of y(n) wrt n. 698 Suppose -2j + 10 = 3x + 3, 17 = 4j + 5x. Find the second derivative of 2k - jk*3 - 3k*3 + 8k + 0k3 wrt k. -66k Let d be (0/(-1))/(1 - 2). Let b(h) = 4h + 198. Let s be b(-49). What is the second derivative of dc*s - 12c + 0c2 + 4c2 wrt c? 8 Let d(y) be the third derivative of y7/15 - y*6/60 + 11y4/24 + y3/3 - 152y2. What is the second derivative of d(c) wrt c? 168c*2 - 12c Let c = 10 - 5. Find the second derivative of -5l - 7l*5 + 17l*c + l + 4l*5 wrt l. 280l*3 Let g(p) be the first derivative of 19p*4/12 - 17p*2/2 + 22p - 11. Let z(l) be the first derivative of g(l). Differentiate z(x) with respect to x. 38x Let h = -43 - -39. Let b(a) = -41a*3 + 26a - 4. Let g(l) = 41l3 - 26l + 3. Let t(f) = hg(f) - 3b(f). What is the second derivative of t(q) wrt q? -246q Let b(d) be the first derivative of 24 + 0d*3 + 0d + 12d2 - 8/5d*5 + 0d*4. What is the second derivative of b(l) wrt l? -96l*2 Let r(o) be the third derivative of -1/24o*4 + 1/30o*7 + 0o - 4o2 + 0o*6 + 0 + 0o*3 + 0o*5. Find the second derivative of r(d) wrt d. 84d*2 What is the third derivative of 145z - 4z5 + 5z*2 + 6z*2 - 122z - 110z3 + z5 wrt z? -180z*2 - 660 Let r(m) be the third derivative of -319m*7/210 + 11m5/20 - m3 - 228m2. Find the third derivative of r(d) wrt d. -7656d Let d(j) be the first derivative of j*8/140 - 3j*4/4 - 14j*3 + 35. Let q(p) be the third derivative of d(p). Differentiate q(i) with respect to i. 48i*3 Let t(o) be the third derivative of -19o*7/35 - 31o5/20 - o4/24 - 28o2. Find the third derivative of t(u) wrt u. -2736u Let a(v) = -1. Let h(r) = 9r + 35 - 19 + 5r. Let k(d) = -4a(d) - 2h(d). What is the derivative of k(n) wrt n? -28 Let t be (-2)/((-1 - -2)-1). What is the derivative of -2 + 202s*2 - 2 - 220s*t wrt s? -36s Let m(f) be the second derivative of -f7/21 + f5 + 7f3/6 - 3f - 2. Find the second derivative of m(k) wrt k. -40k3 + 120k Let a be ((-20)/(-30))/(2/24). Suppose 0 = 8f - 6f - a. Find the first derivative of -1 + 0 + 2 - 2d4 + f wrt d. -8d*3 Find the third derivative of 271z + 138z5 + 53z - 467z - z2 wrt z. 8280z2 Let u(g) = g3 - 8g2 - 8g - 7. Suppose -10 = -h - 1. Let o be u(h). What is the third derivative of 42c2 + 8c*4 + oc*4 - 41c*2 wrt c? 240c Let j(n) = -50n4 - 12n*3 - 12n + 244. Let m(i) = -48i4 - 10i*3 - 10i + 243. Let r(z) = 5j(z) - 6m(z). Differentiate r(v) wrt v. 152v3 Differentiate 477 + 2f - 319 + 25f3 + 29f*3 with respect to f. 162f*2 + 2 Let s(r) = -123r*3 - 30r*2 - 11r + 6. Let p(o) = 41o3 + 10o*2 + 4o - 2. Let m(t) = -11p(t) - 4s(t). Find the third derivative of m(c) wrt c. 246 Let x(k) be the first derivative of 139k2/2 + 24k - 299. What is the first derivative of x(m) wrt m? 139 Let g = 10 + -5. Let y be (8/g)/(40/100). Differentiate 7x4 - 3 + 8x*y - 5x*4 - 3 wrt x. 40x*3 Let r(v) be the third derivative of 179v*6/120 + 133v4/24 - v3/3 - 423v2. Find the second derivative of r(z) wrt z. 1074z Let k = 63 + -58. What is the first derivative of 0 - w + 2w - kw + 1 wrt w? -4 Let h(v) = 20v - 1. Let o(s) = 10s - 1. Suppose 7y - 2y + 25 = -5m, -4y - 20 = 2m. Let a(q) = yo(q) + 2h(q). Differentiate a(c) wrt c. -10 What is the second derivative of 93 + 5t*2 + 37t*4 - 54t*4 - t - 2t*2 wrt t? -204t2 + 6 Let a(j) be the third derivative of j7/90 - 5j5/24 - 5j*4/4 - 25j*2. Let k(c) be the second derivative of a(c). Differentiate k(z) with respect to z. 56z Let v(r) be the second derivative of 7r4/6 + r3/6 + 137r*2/2 + 85r. What is the derivative of v(c) wrt c? 28c + 1 Let h(o) be the second derivative of o5/20 + 15o*4/4 - 112o*3/3 - 225o. Find the second derivative of h(y) wrt y. 6y + 90 Let w(k) be the first derivative of 0k*5 + 2k*2 + 0k*4 + 21 - 10/3k*6 + 0k*3 + 0k. What	{ "pile_set_name": "DM Mathematics" }
remainder when b is divided by 31? 27 Let j(t) = t*3 + 8t*2 + 14t + 15. Let s be j(-6). Suppose -7v + 59 = -sv - 3r, v + 5r = 9. Calculate the remainder when 40 is divided by v. 12 Suppose -4v - 43 = 1. Let m(u) be the third derivative of -u4/6 - 16u*3/3 - 715u*2. Calculate the remainder when 47 is divided by m(v). 11 Let f(t) = -t - 39. Let l be f(-25). What is the remainder when ((-105)/l)/(3/6) is divided by (-3)/15 - 112/(-10)? 4 Let b be (-26)/(-12) - (-12)/(-72). Suppose bq + 2q = 72. Suppose 212 = 4g + m + 3, 5g - 256 = 4m. Calculate the remainder when g is divided by q. 16 Suppose -23q = -58q + 2084 + 13526. What is the remainder when q is divided by 28? 26 Let g = 59 + -86. Let l(c) = -c3 - c2 + 26. What is the remainder when l(0) is divided by (11/3)/((-9)/g)? 4 Let j(i) = 94i + 33. Calculate the remainder when 122 is divided by j(0). 23 Suppose 37 = v - 0. What is the remainder when v is divided by (-2)/12 + (-158)/(-5)250/600? 11 Let f be 10644/(-70)(-1)/2. Suppose 2g - 92 = f. What is the remainder when 275 is divided by g? 68 Suppose -5c - 4z + 184 = -z, 180 = 5c + 5z. Let s = 1053 - 828. Calculate the remainder when s is divided by c. 35 Suppose -19g - 106 + 201 = 0. Calculate the remainder when g((-31)/(-20))/(5/40) is divided by 23. 16 Suppose 3639 = 14g - 2157. Let d = -186 + g. Calculate the remainder when d is divided by 11. 8 Let y = -1596 - -1607. What is the remainder when 493 is divided by y? 9 Suppose 19s - 25s = 1356. Let p = -145 - s. Calculate the remainder when p is divided by 45. 36 Let g = -28904 + 28933. Calculate the remainder when 774 is divided by g. 20 Let v be -17 + -4(-2)/4. Let q = v + 21. Let b = -6753 + 6804. Calculate the remainder when b is divided by q. 3 Suppose 0 = 2o + 3u - 194, -4u - 49 = -33. Suppose -3g = g + 288. Let a = o + g. Calculate the remainder when a is divided by 17. 14 Let t(d) = -2d*2 - 529d - 16040. Let m = 84 - 9. What is the remainder when m is divided by t(-35)? 0 Suppose 4k - 52 = -q, -q + 0 = -2k - 4. Calculate the remainder when 347 is divided by q. 7 Suppose 2i + 47w - 51w - 14778 = 0, 28 = 4w. What is the remainder when i is divided by 16? 11 Suppose 0 = -9q - 51 + 465. Suppose 0 = -5t + 525 + 850. Calculate the remainder when t is divided by q. 45 Suppose 5u + 2i = 3367, 4i + 860 = u + 169. What is the remainder when u is divided by 68? 63 Let m = 2 + 78. Let n = -138 - -84. Let h = m + n. What is the remainder when 75 is divided by h? 23 Let n = -4 - -171. Let b = n - 128. Suppose 388 = -0h + 2h. Calculate the remainder when h is divided by b. 38 Let g(s) = 7s + 1. Let l be g(2). Let m be (-2 - l/(-6))1412. Let z = m - 59. What is the remainder when z is divided by 42? 40 Let c(h) = 2h2 + 10h - 11. Let k be (-60)/4 + 2(-1)/(-1). What is the remainder when c(k) is divided by 39? 2 Let t = 55 + -52. Suppose -tc + f = c - 179, -4f = 4c - 184. Suppose -c = 10o - 11o. What is the remainder when o is divided by 8? 5 Suppose n - 3044 = -3n + 5z, -3822 = -5n + 2z. Calculate the remainder when n is divided by 172. 78 Let c = 9 + -7. Suppose 3h = ch + 199. Suppose 514 = 5j + h. Calculate the remainder when j is divided by 22. 19 Let n(r) = -2r*3 + 8r*2 + r - 9. Let c be n(3). Calculate the remainder when 38 is divided by 4/c - (-3)/((-9)/(-35)). 2 Let q = 1 + 129. What is the remainder when (52/q)/((-2)/(-215)) is divided by 24? 19 What is the remainder when (8-1)/2 + (-93702)/(-73 - -4) is divided by 670? 14 Let v(m) be the second derivative of 2m4/3 - 7m*3/6 - 5m*2/2 + 13m. Calculate the remainder when v(-2) is divided by 206/13 - (-16)/104. 9 Let x(n) = n*3 + 37n*2 - 47n - 221. What is the remainder when x(-38) is divided by 32 + 0/3 + 2? 19 Let p(d) = 13d + 4d*2 + 5d*2 + 2d*2 - 5d2 - 48 - d3. What is the remainder when 208 is divided by p(5)? 40 Let o = -94 - -96. Suppose 5p + 5 = 3v - 7, 12 = ov - 2p. Calculate the remainder when 142 is divided by v. 7 Let p = -11742 - -12464. Calculate the remainder when p is divided by 237. 11 Suppose 24r - 143 = 457. Calculate the remainder when (29/2 + 2)66/9 is divided by r. 21 Let w be -38(-2 - 51/6 - 4). Let j = -424 + w. Calculate the remainder when j is divided by 44. 39 Suppose 272 + 530 - 53 = 7x. What is the remainder when 172 is divided by x? 65 Let i = -301 - -425. Let j = -105 + i. What is the remainder when 474 is divided by j? 18 Let i = -3456 - -3525. Calculate the remainder when 110 is divided by i. 41 Suppose 40 = 2f + 28l - 31l, 3f + 4l - 43 = 0. Let o(j) = -j2 + 9j - 1. Let t be o(7). Let z = 20 - t. Calculate the remainder when f is divided by z. 3 Let s(n) = 13n2 - 2n - 16. Let g be s(-3). Suppose -5t - 492 + 182 = 0. Let l = g + t. Calculate the remainder when l is divided by 17. 11 Let g = -3823 - -4239. Calculate the remainder when g is divided by 25. 16 Let q(l) = -2l*3 + 103 - 18l - 29l2 - 223 + 112. What is the remainder when q(-14) is divided by 35? 13 Let y = 3116 + -3030. Let t(i) = -10i + 2. Calculate the remainder when y is divided by t(-2). 20 Suppose 9y - 7084 + 2296 = 0. Suppose -6a + y = -362. What is the remainder when a is divided by 8? 5 Suppose -3y + 4d = -303 - 134, 5y - 670 = -5d. What is the remainder when 7921 is divided by y? 137 Suppose 0 = -2p - 2h + 20, -12p + 13p + 2h - 12 = 0. What is the remainder when 44 is divided by p? 4 Let j(c) = 8c - 1. Let p = 12137 - 12063. What is the remainder when p is divided by j(1)? 4 Let w = 5496 - 3949. What is the remainder when w is divided by 129? 128 Let b(r) = -r3 + r2 + r + 1. Let u be b(0). Let o be ((-432)/(-1512))/(2/(-28)). Let w = u - o. What is the remainder when w is divided by 3? 2 Suppose 60 = 3c - 48. Calculate the remainder when (-8)/c33-2 is divided by 3. 1 Suppose 8p + 195w = 192w + 2436, 2w - 8 = 0. What is the remainder when 647 is divided by p? 41 Let f(i) = i*2 - 44i + 183. Calculate the remainder when 916 is divided by f(40). 19 Let u be (-7)/(35/(-25)) + -3. Suppose -uz - 254 = -4x, 3x + z + 55 = 248. Calculate the remainder when x is divided by 12. 4 Let x = 597 + -570. Calculate the remainder when (-4)/((-32)/24) + x is divided by 18. 12 Let y = 21 - 10. Let j(w) = y + 42w - w - 14. What is the remainder when j(1) is divided by 21? 17 What is the remainder when (2 + -2)(-5)/(-5) - (-11604)/12 is divided by 11? 10 Suppose 0 = 2g - 4p - 110, 65 = 5g + p - 210. Let x = 563 - 692. Let s = x + 136. Calculate the remainder when g is divided by s. 6 Let h(j) = j*2 + 1525j - 4581. Suppose -2d + 50 = -0d. What is the remainder when d is divided by h(3)? 1 Let c(k) = 155k2 - 3k - 5. Suppose 4j + 2t + 3 + 5 = 0, j = 5t + 9. Calculate the remainder when c(j) is divided by 31. 29 Let c be 18/645/27. What is the remainder when ((-2430)/60)/((c/6)/(-5)) is divided by 82? 79 Let b = 30 - -23. Let s = -21 + b. Suppose 4 = v, 0 = -z + 5z + 2v - 380. Calculate the remainder when z is divided by s. 29 Suppose -18b = 1655 - 2807. What is the remainder when 173 is divided by b? 45 Suppose -219 = -i - m, 9i + 2m = 6i + 661. Suppose -i - 149 = -6n. Calculate the remainder when n is divided by 22. 18 Suppose 12 = 4q + 4. Suppose -9 = -k - 2k. Calculate the remainder when (22 - 17) + q/1 is divided by k. 1 Let c(a) = -4a - 10. Let x be c(-3). Suppose 5r = xr + 3. Suppose 31 - r = 3k. Calculate the remainder when 88 is divided by k. 8 Let h(l) = 5l + 93. Suppose 0 = -q + 9. Let x = 13 + q. What is the remainder when h(-10) is divided by x? 21 Let a = 365 + 166. Suppose 2p - 5p = -a. What is the remainder when p is divided by -7 + -1 - (-3168)/72? 33 Let s = -6777 - -7055. Calculate the remainder when 9451 is divided by s. 277 Let c = -670 - -1356. Calculate the remainder when c is divided by 228. 2 Suppose 0 = 54s - 353 - 1105. Calculate the remainder when 935 is divided by s. 17 Suppose 184g - 24g - 10720 = 0. Calculate the remainder when 656 is divided by g. 53 Suppose -5d + 7 = 2u, 2d = 3 - 5. Let g be (-17)/(-3) - u/(-18). Calculate the remainder when 88 is divided by 1/(-2) + ((-1281)/g)/(-7). 28 Let v = -3240 + 3789. What is the remainder when v	{ "pile_set_name": "DM Mathematics" }
k*2 - 4k + 4k + k2 + (1 - 1 - 2k)(-3 + k + 3)). -9k*3 Expand (0 - 1 - 2 + (-4 + 0 + 2)(2 + 3 - 3))(4z*3 + 2z*3 - 5z*3)(0 + 0 - z*2). 7z*5 Expand (-4d*3 + 0d*3 + 0d*3)(-3d + 0d + 2d) - 3d*3 + 3d3 - d4. 3d4 Expand (4d*2 + 3d - 3d)(2d + 2d - d) + 6d2 - 2d*3 - 6d*2. 10d*3 Expand (0k - 2k + 4k)(39 - 41 - 9k*2 - 2k*2). -22k*3 - 4k Expand 0u2 - 10u2 - u2 + (4u - 5u - u)(0u + 0u + u). -13u*2 Expand (29 - 113 + 37)(v - 3v + 3v)(v - 2 + 2). -47v*2 Expand (3x4 + 603 - 584 - x3 - 5x4)(1 + 0 + 0). -2x4 - x3 + 19 Expand (-4o - o + 4o)(242 + 2o - 242) + 2o*2 - 6o*2 + 2o*2. -4o*2 Expand (-2 + 5d - 2d + d)(d*3 - 3d3 + d3). -4d4 + 2d*3 Expand (-15 - 11 - 25)((-3 + 0 + 4)(0a + a + 0a) + 1 - 1 + 2a). -153a Expand (-3v - v - v)(-1 + 1 + 4). -20v Expand u*5 - 3u*4 + 3u*4 + (-3u*2 + 3u2 + u4)(-2 + 2 - u) + 2u5 + 1 - 1 - u5 + 2u5 + 5u*5 - 7u*5 + 38u*3 - 38u3. u5 Expand 3z - 2z + 0z + (-1 - 3 + 2)(-3z - 3z + 4z) + 0z - 3z + 2z - 1 + z - z - z + 3z + z - 2 + 4. 7z + 1 Expand (-4l4 + 4l4 - l4)(-4l - l + l) + l*5 - 2l*5 + 4l*5. 7l5 Expand -j5 + 3j5 - 11j*5 + (2j*3 + 1 - 1)(4j2 - 2j2 - j2). -7j5 Expand (5 - 5 - 1)(y3 - y2 + y*2) + 6y - 6y + 7y*3 + (2y*2 - 3y*2 + 0y*2)(2y + 2y - 2y). 4y*3 Expand (2o + 1 + 0 + 0)(-8o + 3 - 2 - 2o). -20o*2 - 8o + 1 Expand (-3z3 - z4 + 3z*3)(-14 - 23 + 5). 32z4 Expand -103 - 19i*4 + 103 + (4i*2 + 2i*2 - 4i*2)(-5i2 + i2 + 2i*2) + 6i*3 - 4i*4 - 6i*3. -27i4 Expand t2 - 2t2 + 3t*2 + (2t + 0t + 0t)(3t - 4t - 5t). -10t2 Expand 0l*2 + 3l2 - l3 - l*2 + (-3l + l*3 + 3l)(-2 - 3 + 1). -5l*3 + 2l*2 Expand (-4 - 2a + 4)(-6 - 4 + 8) + 2a + 3a - 3a - 2 - 2a + 2. 4a Expand (4c + 4c*3 - 4c + 3c)(0c + 0c - 2c2). -8c*5 - 6c*3 Expand (-2r + 4r - r)(3r + 2 + 4r - 5r)(15 - 15 + 4r2)(-5r + 3r + r). -8r5 - 8r4 Expand (-b4 - 3b4 + 3b4 + b + b4 - b + (-b*3 + 2b3 + b3)(-b + 0 + 0) - 9b*4 - 7 + 7)(-2 + 4 - 4). 22b4 Expand -710v*2 + 15v - 4v + 714v*2 + 1 + (-2v + 0v + 0v)(1 - 1 - 2v). 8v2 + 11v + 1 Expand -d*3 + 3d*3 - 4d*3 + 0d*3 + 2d*3 - 3d3 + (-d2 + 3d2 - 4d*2)(d + 4 - 4) - 4d3 + 0d*3 + 3d*3 - 5d*2 + 5d2 + d3. -5d3 Expand (3 + 0 + 0)(4s - 7 + 7) + 3s + 0s - s + 4s - s - 4s. 13s Expand (4q - 3q - 2q)(-7 - 4 + 4)(1 + q - 1). 7q*2 Expand (-5 + 2 + 1)(12 + 4 - 3)(2a + 1 - 1)(-4a + a*2 + 4a). -52a3 Expand -2u*3 + 0u*3 + 4u*3 + (5u - 4u + u)(2u2 - u + u) - 5u*3 + 3u3 + u3 + (4 - 4 + 2u2)(u - 2 + 2). 7u3 Expand (-2t*2 + 2t*2 + 2t*2)(-5 - 28t2 + 5). -56t*4 Expand -z + z + z - 2 - 5z + 2z + 0 + (0z + 0z - 2z)(-2 + 4 + 0). -6z - 2 Expand (-2 + 2 + o)(-5o*2 + 5o2 - o2) + 351o3 - 348o*3 + 0o - 5o. 2o*3 - 5o Expand 0z + 2z - 4z + (-3 + 1 - 3)(1 + 0 + 0)(-12 - 6z + 12). 28z Expand -x3 - 2x4 + x3 + (2x + 2x - 3x)(x*2 + 2x3 - x2) - 196 + 196 + 5x4. 5x*4 Expand -4r*4 + 0r*4 + 3r*4 + (-2 + 1 + 0)(2r4 + 4r*4 - 5r*4) + 2r*2 + 2r - 2r - 2r*4. -4r*4 + 2r*2 Expand 2 - 2 + h + (-1 + 1 - 2)(2h - 4h + 0h) + (-4h - h + 3h)(4 + 1 - 3). h Expand (2 - 4 + 3 + (0 + 4 - 3)(0 + 0 + 2))(3w4 + 4w4 - w4). 18w4 Expand (-1 - 3 + 2)(-t2 + t2 - t2) + t2 - t*2 + 2t*2. 4t*2 Expand 3a*2 - 3a2 - a3 + (0a2 - 5a*2 + 4a*2)(-2a + 1 - 1) + (0a + a*2 + 0a)(0a - a + 3a). 3a*3 Expand 0 + 0 - 2u*3 + (3u - 6u - u)(-2u2 + 4u2 - u2). -6u3 Expand (2p - 4p + 3p)(2p - 3p - 8p) + (4p - 3p - 3p)(-p + 0p + 0p) + 4 + p*2 - 4. -6p*2 Expand -3x*5 - 2x*2 + 2x2 + (-x + x + x4)(1 - x - 1) - 6x*5 + 3x5 + x5 + 0 + x*5 + 0. -5x5 Expand (2 - 2 - r3)(13 + 1 + 16). -30r*3 Expand (0l*2 + 3l*2 - 2l*2)(-2l + 2 - 2)(1 + 3l - 1). -6l*4 Expand (3v + 0v + 0v)(-5 + 1 + 2 + 2v). 6v2 - 6v Expand (-3n4 - n4 + 2n*4)(4n - 3n - 2n)(-2 + 2 - 2). -4n5 Expand (-4 + 4 + 2j)(j + 7j*2 - 4j - 10j2). -6j*3 - 6j*2 Expand 5k5 - k5 + k*5 + (7k - 4k - 4k)(3k*4 + 2k*4 - 7k*4) + 0k*4 + 2k*5 + 0k*4. 9k*5 Expand 8f3 - 12 + 12 + (f2 - 2 + 2)(-f + 1 - 1). 7f*3 Expand (-11o + 2o + 3o)(-2o - 2o + 3o)(-3 + 3 + 2). 12o*2 Expand -j + j + 2j + (-j + 2j - 2j)(1 + 0 + 1)(3 - 2 - 2). 4j Expand (3 - 4 - 6)(2 + y*3 - 2). -7y*3 Expand (0v - v - 2v)(-6 + 6 + v + (2 + 2 - 6)(0v - 2v + 3v)). 3v2 Expand (5a - 3a - 6a)(-2 - 2 - 1)(-2 + 2 - a). -20a2 Expand (-g - 2 + 2)(4 + 15g - 3 - 16g). g*2 - g Expand (-4a + 4a - a)(4 - 4 - 1)(-3a + 2a - 2a). -3a2 Expand (2p + 2 - 2)(0 + 3 - 1) + (3 + 0 + 3 - 3 + 2 + 3 + (2 + 3 - 4)(0 - 6 + 4) + 2 - 5 + 1 - 3 - 2 + 3)(p + p - p). 6p Expand ((2 - 2 - 2z)(0 + 7 + 6) - 1 + 1 - 2 - z)(2 + 0 + 1). -81z - 6 Expand (0j + 0j + j)(10 - 3 - j - j) + (1 - 1 + j)(0 + 0 - 2j). -4j*2 + 7j Expand (5k - 2k - 5k)(0k + 2k + 0k) + 6 - 6 - 2k*2 - 3k*2 + 5k*2 - 4k*2 - 2k*2 + 2k2 + k2. -7k2 Expand (-2d2 - d2 + 0d2)(-12 - 8d + 12) + (-2d*3 + 4d*2 - 4d*2)(4 - 4 + 1). 22d3 Expand (-1 + 3n + 1)(2 - 8 + 2). -12n Expand (-s*2 + 5s*2 - 6s*2)(1 + 1 - 3) - 18 - 7s2 + 18. -5s*2 Expand 8q*2 - 8q*2 - 4q4 + (q3 + 3 - 3)(1 - 1 + q) - 3q*2 + 3q2 + q4 + 3q4 - 10q*4 + 2q*4. -7q4 Expand (-w2 + 1 - 1)((-w2 - w3 + w2)(0 + 3 - 37) + w*3 + 3w - 3w). -35w*5 Expand (-3y2 + y2 + y*2)(y + y + y) - 4y3 + 19y*3 - 2y*3. 10y*3 Expand (-b - 5b + 3b)(-b*3 - 1 + 1) + (3b2 - b3 - 3b2)(3b - b + 0b). b*4 Expand (-3r + 3r - r2)(2 - 2 - 2r) - 6r*3 + 2r*3 + 3r*3 - 2r*3 + 2r3 + r3 + 0r3 + 2r*3 - 3r - r - 6r3 + 5r3 - r3. 2r3 - 4r Expand -19 + 414g - 414g - 3g2 - 2g*2 + 0g*2 + 3g*2 + (5g - 3g - g)(3g - 2g - 3g). -4g*2 - 19 Expand (0f*2 - 2f*2 + 4f*2)(3f3 - 2f*3 - 3f*3) - 2f*5 + 6f5 - f5. -f*5 Expand -2t*5 + 2t5 + t5 + (3t - 2t - 2t)(-2t3 - 3t*3 + 3t*3)(5t - 17t - 11t). -45t*5 Expand (0 + 0 - 2w)(-2 + 2 - 6w)(0 - 2 + 1). -12w*2 Expand (-1 - 1 - 1)(-7 + 91k - 87k + 0). -12k + 21 Expand -l3 - 2l + 7l4 + 3l + 0l3 + l - l - 3l*4 + (1 - 3 + 3)(0l4 - 2l*4 + 3l*4). 5l4 - l3 + l Expand (59o - 59o - 21o4)(-2 + 0 + 3)(-2o + 2 - 2). 42o5 Expand (-4g*2 + 5g*2 + 0g*2)(-g*2 - 12 + 2g2 + 17). g4 + 5g2 Expand (-z - z + 0z)(24z + 125 - 125)(z + 1 - 1) + 0z*3 + 4z*3 - 2z*3. -46z*3 Expand (-6m + 12m + 9m)(6 + 5 - 7). 60m Expand 2b4 + 3b*3 - 3b*3 + (-5b*2 + 4b*2 + 3b*2)(-1 + 1 + b*2) + 0b - 3b4 + 0b. b*4 Expand (-2w - w + 2w)(-2w3 - w3 - 5w*3). 8w*4 Expand (0d5 - d5 - d*5)(8 + 12 - 7) - 2d4 + 2d*5 + 2d*4. -24d*5 Expand 3m + m*4 - 3m - 4m4 + 2m*4 + 3m*4 + (0m*3 + 4m*3 - 2m*3)(m + m - m) - 3 + 3 - m*4 + 41m*4 - 34m*4 + 28m*4 + 1. 38m*4 + 1 Expand 0y - y + 3y + 3y + 0y - 2y + (-2y + 3y + y)(3 + 0 - 2). 5y Expand (0 + 1 + 0)(3i*2 + 0i + 0i)((1 + 3 - 3)(-9i + 9i + 5i*2) - 3i2 + i2 + i*2 + (-1 - 2i + 1)(2i + 2i - 5i)). 18i4 Expand (-1 - 4 + 2)(-7n - 1 + 1 + (0n - 2n + 4n)(1 + 1 - 4) + 2n - 4n + 4n + 5n - n - 3n). 24n Expand -3x*4 + 2x*4 - 2x3 - x4 + (2x2 + 0 + 0)(-27x2 + 283 - 283). -56x*4 - 2x*3 Expand (0 - 2d*2 + 2d + 0)(-5d*3 + 0d*2 + 0d*2). 10d*5 - 10d*4 Expand (-2m*3 + 5m*3 - 6m*3)(-3m + m + 3m + (m - 3 + 3)(0 - 3 + 1)). 3m*4 Expand (2z - z - 5z)(1 - 2 + 2) - 2z + 4z - 3z. -5z Expand 0w2 + 0w*2 - 2w*2 + 1 + (-w - w + 5w)(2w - 5w + 4w). w*2 + 1 Expand (-3 + 0 + 1)(5 - 4 - 2)(-r4 + 5r*4 + 0r*4). 8r*4 Expand (2x3 + x3 - 4x3)(-x*2 + 2x*2 - 2x2). x5 Expand (-2j + 0j - 4j)(-j + j - 2j*2). 12	{ "pile_set_name": "DM Mathematics" }
ors of 8/10 - (-186)/u. 7 Suppose 2t = -z + 110, 5z = t - 4t + 578. List the prime factors of z. 2, 59 Let k = -1 + 16. Let q be (-15)/25 + 915/25. Let c = q - k. List the prime factors of c. 3, 7 Let o be (16 + -1)/((-2)/2). Let w = o + 21. List the prime factors of w. 2, 3 Let c = 72 - 51. What are the prime factors of c? 3, 7 Suppose -o + 36 = -0v - 5v, 0 = -2v + 2o - 16. Let r be 1 - (v13 - -2). Suppose 5t = r - 25. List the prime factors of t. 13 Suppose x - 38 = -k + 2x, k - 3x = 30. What are the prime factors of k? 2, 3, 7 Let o(w) = 7w*2 + w - 2. List the prime factors of o(2). 2, 7 List the prime factors of (4 - 0)(-9)/(-12). 3 Suppose 0 = -p + 1 + 2. Let x = 7 - p. Suppose -5c - 46 = -2s, -xs + 5c + 28 = -3s. List the prime factors of s. 2, 3 Let p = -9 + 12. Let s be 0 - p - (-24)/(-8). Let r = s + 21. What are the prime factors of r? 3, 5 Let m(k) = -2 - 1 + 0 + 3k + 1. Let y(w) = w*2 - 2w - 5. Let r be y(4). List the prime factors of m(r). 7 Let i(t) = 2t2 + 11t + 9. Let p be i(-7). Let n = p + -28. What are the prime factors of n? 2 Let v(z) = -z + 1. Let k(m) = 6m - 6. Let i(h) = -2k(h) - 11v(h). Let a be i(1). Suppose 3p - 11 - 10 = a. What are the prime factors of p? 7 Let x(h) be the second derivative of -h*3/2 + 7h*2/2 - 3h. Let l be x(5). Let f(r) = -r - 1. List the prime factors of f(l). 7 Suppose 1 = w, -n - w = 2w - 122. What are the prime factors of n? 7, 17 Suppose -4r + 73 = y, 2y + 101 = 4r + r. What are the prime factors of r? 19 Let h(x) be the first derivative of x4/4 - x2/2 + 22x - 1. Let k = 13 + -13. What are the prime factors of h(k)? 2, 11 Let n = 1 - -55. What are the prime factors of n? 2, 7 Suppose 4u + 130 = 5o - 0u, 4u - 20 = 0. List the prime factors of o. 2, 3, 5 Let x be (8/5)/((-2)/(-10)). What are the prime factors of (x/5)/((-1)/(-5))? 2 Let x = 93 - 51. What are the prime factors of x? 2, 3, 7 Let d = -25 - -14. Let w(n) = -n2 - 11n + 12. List the prime factors of w(d). 2, 3 Suppose 5i - 2a = 368, 0i - 5a = -5i + 365. List the prime factors of i. 2, 37 Let j be 30/(-25)5/(-2). Suppose jg + 5m - 40 = 0, 5g + 0g + m - 30 = 0. Suppose 3 + g = 2w. What are the prime factors of w? 2 Let d be 3 + 0/(-5 + 3). Suppose ds - q - 44 = -0s, -3q + 3 = 0. What are the prime factors of s? 3, 5 Let k be -5((-11)/5 - -1). Let h(p) = 45p. Let t(g) = -5g. Let y(w) = kh(w) + 55t(w). List the prime factors of y(-1). 5 Let x be (-1)/8 + (-2499)/(-24). Suppose 5s - x = s. List the prime factors of s. 2, 13 Suppose -h - 2h = -30. Suppose -d - h = -6d. What are the prime factors of d? 2 Suppose 3m + 2g + 44 = 197, -g = 3m - 153. Suppose k + 115 = 4q + 34, m = 4q + 5k. What are the prime factors of q? 19 Let t(o) = o + 10. Let s be t(-8). List the prime factors of (-11)/(-4) + s/8. 3 Suppose -93 = -4g + 547. What are the prime factors of g? 2, 5 Let y(a) = -28a - 35. What are the prime factors of y(-7)? 7, 23 Suppose 137 = 2m - 67. List the prime factors of m. 2, 3, 17 Let p(k) = -2k3 - k2 - 4k + 5. List the prime factors of p(-4). 7, 19 Suppose -151 = -2j - 0b - 3b, j = b + 83. List the prime factors of j. 2, 5 Let t = 18 + -8. Let d(j) = 2j + 12. What are the prime factors of d(t)? 2 Suppose -103 = 5r - v, -5r - v = 52 + 55. Let a = 28 - r. List the prime factors of a. 7 Let z = 40 + -5. What are the prime factors of z? 5, 7 Let z(k) = -4k. Let c be z(-1). Let l be (-6)/5(-10)/c. Suppose -lt + 17 = -4. What are the prime factors of t? 7 Let g = 12 - 7. Suppose -gi + 3v - 48 = -0v, 2v + 8 = 0. List the prime factors of i(2/(-4))/1. 2, 3 Suppose -t - 4m = -11, 2t + 44 = 6t - 3m. Let f = -28 - t. Let o = f + 55. List the prime factors of o. 2 Let z = 28 - -12. What are the prime factors of z? 2, 5 Let l(i) = -73i*3 - 2i*2 + 1. Let u be l(-1). Suppose 4a + u = 8a. What are the prime factors of a? 2, 3 What are the prime factors of (-508)/8-1 + 2/(-4)? 3, 7 Suppose k - 5d - 10 = 0, 0d - d = 5k - 24. Suppose ku = -3y + 18 + 24, -56 = -4y + 4u. List the prime factors of y. 2, 7 Suppose w - 83 = -4r, 0 = -r + 2w + 21 + 11. List the prime factors of r. 2, 11 Suppose -101 = -5v + 109. List the prime factors of v. 2, 3, 7 Suppose -5f + 5 = -2f - 2p, 0 = -5f - 3p + 2. Let r = f + 2. Let w = r - -7. What are the prime factors of w? 2, 5 What are the prime factors of (234/(-24))/(1/(-4))? 3, 13 Let h = -9 - -5. Let p = -1 - h. Suppose 0 = 5w - pw + 4f + 16, 3f = 4w - 23. List the prime factors of w. 2 Let m be 3/((-3)/((-9)/(-1))). List the prime factors of ((-64)/12)/(3/m). 2 Suppose -60 = -2z - 3k + 5k, z = -4k + 35. Suppose -3s + z - 79 = 0. Let v = s + 23. What are the prime factors of v? 7 Let n = 22 - -56. What are the prime factors of n? 2, 3, 13 Suppose 653 = -2b + 5b + 4s, -b - 4s + 215 = 0. List the prime factors of b. 3, 73 Suppose 2y + 2y + 5u = 28, -3y = -4u + 10. Let x(j) = -3 + 3 - 4 + 6jy - j3 - 4j. What are the prime factors of x(4)? 2, 3 Let t(k) = k + 34. List the prime factors of t(-26). 2 Let m = -5 + 7. Let y = 10 - 9. List the prime factors of (y - m)(-3 + -8). 11 List the prime factors of (-8)/(42/(-40) - -1). 2, 5 Let k(v) = -51v*3 - 1. List the prime factors of k(-1). 2, 5 Suppose -3m + 144 = l - 317, 608 = 4m - 2l. List the prime factors of m. 3, 17 Let z be 3/18-2-12. Suppose -3j + 13 = zp, p - 3p = 4. What are the prime factors of j? 7 Let a = 156 - 56. Suppose 0 = 8g - 3g - a. List the prime factors of g. 2, 5 Let c be 3 + -2 + 2 + -1. Suppose 0 = 4w - cg - 38, -w - g + 14 = -3. Suppose 5i - 2i - w = 0. What are the prime factors of i? 2 Let r be (22 + 1)/((-1)/(-2)). What are the prime factors of r/14 + 6/(-21)? 3 Suppose -9 - 9 = -3a. What are the prime factors of a? 2, 3 Suppose 4b - 10 = 226. What are the prime factors of b? 59 List the prime factors of ((-516)/16)/((-3)/966). 2, 43 Let l be (-2)/(-3) + (-654)/(-18). Suppose 2w + n = -w + 38, 2n - l = -3w. What are the prime factors of w? 13 What are the prime factors of (-3)/((-18)/4) - 313/(-3)? 3, 5, 7 List the prime factors of (-1 + 190)(144/21 + -6). 2, 3 Let q(t) = 4t2 - 16t + 54. List the prime factors of q(6). 2, 3, 17 Let m = 0 - -20. List the prime factors of (-2 - -1)/((-2)/m). 2, 5 Suppose n = 2n + 393. List the prime factors of (-6)/(-21) - n/21. 19 Suppose 0 = 5f - 853 - 1067. List the prime factors of f. 2, 3 Suppose 0 = 4d + 5o - 0o - 361, o + 79 = d. What are the prime factors of d? 2, 3, 7 Let q = 123 + -68. What are the prime factors of q? 5, 11 Suppose 99 = 6o - 3o. List the prime factors of o. 3, 11 Let s = 14 + -5. Suppose 5b = 3b + 4f - 14, -2b - f = s. List the prime factors of 1/(((-5)/4)/b). 2 Let w(d) = d2 - 6d. Let f be w(6). Suppose -x - o + 6o + 43 = f, o - 64 = -2x. What are the prime factors of x? 3, 11 Suppose 2m = 2v - 4v + 4, 2 = -2v. Suppose -my + 45 + 0 = 0. List the prime factors of y. 3, 5 Let v = -350 + 549. What are the prime factors of v? 199 Let x(o) = 3o + 17. Let f be x(8). Suppose 0u = u - f. What are the prime factors of u? 41 Let j(r) = -5r + 3r3 + 2r - 3r2 - 2r3. What are the prime factors of j(4)? 2 Let m(b) be the second derivative of -b3/6 + 6b2 + b. Let r(n) = n2 + 6n - 18. Let f be r(3). What are the prime factors of m(f)? 3 Suppose 0b + b = 90. What are the prime factors of 20/b - 734/(-18)? 41 Let p = -1 + 4. Suppose 3l - pk + 2 = 14, 3l = -3k. Suppose -l = -i - 0i. List the prime factors of i. 2 Suppose 4a - 15 = 2k + 3, -2a - 16 = 4k. Let c be 5/k + (-27)/(-1). Suppose 5m - c = -6. List the prime factors of m. 2 Let x(v) = -2v - 21. List the prime factors of x(-20). 19 Let n be (-1)/2(-2 + 16). Let m(h) = -h - 2. Let b be m(n). Suppose 20 = 5d - b. List the prime factors of d. 5 Let f(z) = 3z. List the prime factors of f(7). 3, 7 Let n = -29 - -43. List the prime factors of n. 2, 7 Suppose 3u = 0, -p = -5p - u - 32. Let l = 10 - p. What are the prime factors of ((-4)/3)/((-3)/l)? 2 Let y be (-255)/(-5) - (-1 + -2). Suppose 3j + 2 = 14, 2f - y = -3j. List the prime factors of f. 3, 7 Let o be 0/(-2(-2)/(-4)). Let k = 3 + o. Suppose -kp = 8 - 32. What	{ "pile_set_name": "DM Mathematics" }
. u(29/3) Simplify (u/u(1/2))(3/2) assuming u is positive. u(3/4) Simplify (w/(w*(-2/3)/ww))/(w(ww1)/w) assuming w is positive. w(-1/3) Simplify t(t/t18)/tt(-5/6) assuming t is positive. t(-107/6) Simplify kk(-15)k/(k/k20) assuming k is positive. k6 Simplify (s*(2/7)s*(-1)s)/(s*5/(ss/s*(-2)s)) assuming s is positive. s(2/7) Simplify (d(1/3))*21(d/d*(3/4)d)/(dd/d(-4)) assuming d is positive. d(9/4) Simplify (p/(p/p(-3/2))p(1/5)/p)(-1/4) assuming p is positive. p*(23/40) Simplify (mm/(m/(m/m*(2/13)))m)/(m/m*(-2))(m/m0)(-4/21) assuming m is positive. m(-94/273) Simplify f(-2/19)f32/f assuming f is positive. f(587/19) Simplify ((f/(f/f1))/(f/((f/(f1/f)f)/f)))/(f/(f/(f/(fff(-1)))))(14/9) assuming f is positive. f Simplify (f*7/(ff*(1/10)f))/(ff/(f(f/(f/f*2ff))/f))29 assuming f is positive. f(-531/10) Simplify (zz/((zz/z14)/z))(-2/15) assuming z is positive. z(-2) Simplify ((pp(-1/3))(-44))2 assuming p is positive. p(-176/3) Simplify ((c/(c/(((c*1c)/c)/c)))/c)3 assuming c is positive. c(-3) Simplify (ll(-3/10))/(l/l(1/4))(l/(ll5))/(l/l7) assuming l is positive. l(19/20) Simplify ((q/(q/q12))/qqq)(7/5) assuming q is positive. q(91/5) Simplify (t/t(-2/7)t)9/((t/t5)/tt(-4/3)/t) assuming t is positive. t(586/21) Simplify ll*(-13)ll(1/3)/l assuming l is positive. l(-35/3) Simplify ((m/(mm*(2/5)m))/m)(-7/5) assuming m is positive. m(84/25) Simplify y*(-10)y/((y/(y*(-39)y))/yy) assuming y is positive. y(-48) Simplify (k/k(-2/3))(1/44)/(k(-7)/kk(3/5)) assuming k is positive. k(4909/660) Simplify r*(1/3)/(rr/(r*7r))(r(-3))(2/83) assuming r is positive. r(1559/249) Simplify (m7m10)13 assuming m is positive. m*221 Simplify (m/((mm*(-4/19))/m))/(((((mm(-4/5))/m)/m)/m)/m) assuming m is positive. m(476/95) Simplify ((v*(3/11)v)/v)(1/8) assuming v is positive. v(3/88) Simplify (o(-2/9)/o(-2/7))(-1/19) assuming o is positive. o(-4/1197) Simplify y*(-1/13)y17/y assuming y is positive. y(207/13) Simplify (z*(-1)z)*(-4/3)/(z/(((zzz(-1/3))/z)/z))(-4/5) assuming z is positive. z(16/15) Simplify (o(-4/3)/o)19 assuming o is positive. o(-133/3) Simplify ((b6/b)/b(-1))/((b/(b(3/2)/bb))/((b/(bb6b))/b)) assuming b is positive. b(-3/2) Simplify ((h/h2)/h3)/((((h/(h/(h(-3/7)/h)))/h)/h)/(h/(hh2hh))) assuming h is positive. h(-32/7) Simplify (s(-4)s/s*7s)/((s9/s)/s(-1/6)) assuming s is positive. s*(-103/6) Simplify (((aa/(a*(1/4)/aa))/a)(-11/6))(5/3) assuming a is positive. a(-55/24) Simplify g(3/2)/(gg42g) assuming g is positive. g(-85/2) Simplify (v/(v/(v(-2)v)v)vv)(-2/29) assuming v is positive. 1 Simplify (o(-2))*(3/38)o*(-4/7)oo4 assuming o is positive. o(568/133) Simplify (x(3/5)x*(-4)xx)2 assuming x is positive. x(-14/5) Simplify (a9)(-3/22) assuming a is positive. a(-27/22) Simplify h(-16)/(h/h(-4)) assuming h is positive. h(-21) Simplify g6g/(gg16) assuming g is positive. g(-10) Simplify d(-19)/dd(-3/4) assuming d is positive. d(-83/4) Simplify i(-18)/(i(1/11)/i) assuming i is positive. i*(-188/11) Simplify ((jj/j*(-3/2))/jj3)/(j(-6)/j(-3)) assuming j is positive. j(17/2) Simplify ((d*4d)/d6)/(d6d/d(4/5)) assuming d is positive. d(-36/5) Simplify (b/b21)/bb(-4) assuming b is positive. b(-25) Simplify (z/(zz(-4/7)))/((zz*(-4)/z)/z)(z/((((zz2z)/zzz)/z)/z))/(z*(-4)z) assuming z is positive. z(46/7) Simplify (d(-7))(-2/3) assuming d is positive. d(14/3) Simplify (u(uu/(u/((u/u*(5/4))/u)))/u)/(uu*(4/13)u) assuming u is positive. u(-133/52) Simplify r(-18/5)(r/(rrrr(-2/5)))/r assuming r is positive. r(-31/5) Simplify (p*2p)30/((p/(p/p5))/p(-3)) assuming p is positive. p82 Simplify (p/p*0pp(-2/11))(-1/26) assuming p is positive. p(-10/143) Simplify (u2u)/u*(4/9)u2/(u(-2/11)u) assuming u is positive. u(370/99) Simplify z(3/7)/zz/(z*(2/43)z) assuming z is positive. z(-186/301) Simplify x(2/3)/x*(-3)xx/(xx(xx/x*(-2/5)x)/x)x(-1/2) assuming x is positive. x(23/30) Simplify n(-5)/n(-11) assuming n is positive. n6 Simplify ((oo(2/5))/(o/o8))/(o*(-10)o/o(-1)) assuming o is positive. o(82/5) Simplify pp/(p/(((p/((p/(p/((p/p(-2/11))/p))p)/p))/pp)/p))pp(2/11)(p/(pp1/ppp))(-46) assuming p is positive. p94 Simplify (y/((y(-2/7)/y)/y))(-5)/((y/(y/y(-2/13)))/(y/(y0y))) assuming y is positive. y*(-1481/91) Simplify (z/((z(z/(z/((z*(-3)/z)/z)))/z)/z)z(-4)/z)(-15) assuming z is positive. z*(-30) Simplify (o/(oo(o(-2/83)/o)/oo))/o(-4/25) assuming o is positive. o(382/2075) Simplify (z(-1)/z)(-43)(z/z3)/(zz/(zz(1/2)zz)) assuming z is positive. z(171/2) Simplify dd*(-5/2)dd(-1/5)(((dd(-1))/d)/d)(2/125) assuming d is positive. d(-183/250) Simplify tt*(-26)((tt(1/6)/t)/t)/tt assuming t is positive. t*(-155/6) Simplify (nn/n2)(-2/3)/((n*(1/3)n)/n)(-9) assuming n is positive. n3 Simplify (l*(-15)/ll)/(l9/l) assuming l is positive. l(-23) Simplify (pp/(ppp10p)ppp(-8/7)pp)(3/2) assuming p is positive. p(-171/14) Simplify (s/(s8s))/(s/(sss3)) assuming s is positive. s(-4) Simplify (j/((j(jj*(2/5))/j)/j)j)*8/((jj(-8)/j)/j(-2/13)) assuming j is positive. j*(1342/65) Simplify (ll*2ll)(4/3) assuming l is positive. l(20/3) Simplify ((f/f2f)(-19/6))(-6/31) assuming f is positive. 1 Simplify ((jj(-2/7))(-3/7))28 assuming j is positive. j(-60/7) Simplify (((x(-2)x)/x)/x)*(-1/39)(xx((x*(-2/17)x)/x)/xxx)/xx(1/6) assuming x is positive. x(2819/1326) Simplify v(-9/2)v(-1/25) assuming v is positive. v(-227/50) Simplify (k*(-5/4)k)17 assuming k is positive. k(-17/4) Simplify (((j*(-8)j)/j)/j)(-1) assuming j is positive. j9 Simplify (jjj*1j)*46/(jj*2jj(-2/15)) assuming j is positive. j(2702/15) Simplify (qq(2/3))(-22) assuming q is positive. q(-110/3) Simplify (d(-3)/d2)/(d(1/3))(-37) assuming d is positive. d(22/3) Simplify ((t/(t/((t*(2/3)/tt)/t)t))(-3/23))(-5/9) assuming t is positive. t(-20/207) Simplify (x(-4)x)(4/7) assuming x is positive. x(-12/7) Simplify (s/(s/(ss(2/7))))(18/7)s1/((s(5/6)/s)/s) assuming s is positive. s(1609/294) Simplify j(2/15)jj(-3/10) assuming j is positive. j(5/6) Simplify ((g/(ggg1))/(g/(g/g(-5)g)))(-20) assuming g is positive. g(-80) Simplify ((u(-2/11))(-47))(-3/26) assuming u is positive. u(-141/143) Simplify h2/(hh*16h) assuming h is positive. h(-16) Simplify (h(-2))(1/3)/(h(-1/4)h)(-14) assuming h is positive. h(59/6) Simplify (h/((hhh/h(1/4)hh)/h))35/(h(h*(1/2)/h)/hhh(h/h(-5))/h) assuming h is positive. h(-411/4) Simplify (m/(m/m*28)m)/((m*40/mm)/m) assuming m is positive. m*(-10) Simplify (((kk*(2/9)k)/kkk)(2/83))(-47) assuming k is positive. k(-2726/747) Simplify ((w(1/2)/ww)/w8)(-4/5) assuming w is positive. w6 Simplify ((r/(r(r((r/(r(-4)r))/rr)/r)/r))(-37))26 assuming r is positive. r2886 Simplify (l/(((l2/l)/l)/l)((ll5)/l)/l)(2/9) assuming l is positive. l(4/3) Simplify (o0)14(o/(oo(-1/3)))(7/5) assuming o is positive. o(7/15) Simplify w0w/w*0(ww/w(6/11))/w6 assuming w is positive. w(-39/11) Simplify (v(2/25)/v)(-14) assuming v is positive. v(322/25) Simplify (kk/k*(2/11))/kk16 assuming k is positive. k(185/11) Simplify ((a*(5/6)/a)/aa(1/2))/(a(-1/3))17 assuming a is positive. a5 Simplify (cc(2/7))(10/7)/(c(-1/2)cc(-1/3)) assuming c is positive. c(491/294) Simplify ((mm/(m/((mmm*(-2/9))/m))m)(-23))(19/4) assuming m is positive. m*(-10925/36) Simplify (aa*9a)43 assuming a is positive. a473 Simplify ((uu(-15)uu)/uuuuu(uu6)/u)15 assuming u is positive. u(-45) Simplify (y(-5)y5/y)(-3/2) assuming y is positive. y**(3/2) Simp	{ "pile_set_name": "DM Mathematics" }
5z2 + 3z*3 + 13z*2 - 14 + 2z*2 as c + lz + xz2 + oz*3 and give c. -14 Express 5n + 4 + 8n2 - 17n*2 + 11n*2 - 10n - 32n2 in the form vn + bn2 + c and give b. -30 Express -45053c + 289c2 + 45053c as sc + hc*2 + g and give h. 289 Express 7 - 7 + 7y + (-8 + 4 - 3)(1 - 2y - 1) + y + 0y + y + 7y in the form a + xy and give a. 0 Rearrange 25h*2 + 7h - 9h + 73h*2 to the form q + nh + wh2 and give w. 98 Express -8 - 1 + 1 + 150d - 229d as od + y and give o. -79 Rearrange 4657 - 9h - 2h - 9318 + 4681 to sh + x and give s. -11 Express 1 - 1472n*3 - 3 + 2n + 515n3 as pn*2 + t + fn*3 + xn and give f. -957 Express (2v + 4v - 4v)(-2v2 + 0v*2 + 4v*2)(0 - 1 + 3) + (-5v + v + 2v)(2v*2 - 3v2 - v2) as yv + dv*3 + pv2 + t and give d. 12 Express v2 + 22v + 1 - 61v*3 - 34v - 2v2 + 10v in the form tv3 + bv + wv2 + n and give n. 1 Express (-z - 2z - z)(37z*2 - 7z*2 - 3z*2) + 2z3 - z3 + 3z3 as j + gz + xz2 + rz3 and give r. -104 Express -l4 + 3l3 - 21 - 7l*3 - 5l*2 + 7 + l + 15 as k + il*4 + rl*3 + xl + dl2 and give i. -1 Rearrange -10c*2 + 9 + 9c*2 + 2c*2 + 13 to the form xc*2 + jc + u and give u. 22 Rearrange -4 + 31u3 + 10 + 1 - 25u3 + u2 to bu2 + g + du + fu3 and give f. 6 Rearrange -470 - 469 - 4n + 928 to g + rn and give r. -4 Rearrange (8 - 5 - 10)(0 + 0 + 1)(-4v + 4v + 2v)(2v + 5v + 8v) to the form fv2 + zv + r and give f. -210 Express -38 + 12h + 38 + 209h as o + mh and give m. 221 Express 9s + s + 4s - 3 + 30s*2 - 16s - 10s2 in the form f + us + is2 and give i. 20 Express 12f*2 - 31f*2 + f + 10f*2 + 11f*2 + 315 in the form hf*2 + vf + o and give h. 2 Express -867 - 518z + 518z + 6z2 + (-1 - z + 1)(2z - z - 3z) in the form tz + iz*2 + b and give i. 8 Rearrange (-201d*3 + 0 + 213d*3 - 3)(-2d + 0d + d)(-5 + 1 + 1) to the form yd*3 + t + gd*2 + hd*4 + ud and give h. 36 Rearrange 7811 + c + 7812 - 40c2 - 15623 to the form j + kc*2 + wc and give k. -40 Rearrange -270v2 + 14v - 1922v2 - 14v to z + lv2 + ov and give l. -2192 Rearrange -9k + 6k*4 + 18k - 4 - 2 - 8k to the form mk*2 + tk + zk4 + o + yk*3 and give o. -6 Express -2g*2 + 3g*2 + 0g*2 + (-201g*2 + 5g*2 + 70g*2)(-1 + 2 - 2) in the form vg + wg*2 + s and give w. 127 Express -5b - 5b2 - 43b*2 - 129b*2 + 352b*2 + 4b in the form sb + ob*2 + r and give r. 0 Express 3i*3 - 8i*2 + 2i + 0i + 44i*2 - i in the form vi*3 + bi + y + gi2 and give v. 3 Rearrange (-2 + 2 + 3)(504r + 292r + 617r + 454r) to the form x + jr and give j. 5601 Rearrange (5q + 15q - 17q + (-1 - 3 + 3)(0q + 7q - 3q))(-q - 3 + 3 + 2 - 2q - 2 + (0q - 2q + q)(0 + 2 + 0)) to the form zq + i + bq2 and give b. 5 Express -7u*2 + 8u*2 + 132 + 6u*2 - 8u*2 as yu + bu2 + d and give b. -1 Rearrange 26i*2 + 31i*2 + 31i*2 - 90i*2 + 85 to the form k + mi + li2 and give k. 85 Express -4r*4 + 361r*3 + r - 2 + r + 370r*3 - 707r*3 as jr + nr2 + kr*4 + o + zr*3 and give k. -4 Rearrange 893v - 1 + 425v2 - 893v to bv + q + fv*2 and give f. 425 Rearrange 27 - 64 + 670m*2 + 37 to x + ym*2 + lm and give y. 670 Rearrange (0 - 3 + 4)(z3 + 0z3 + z3) + 113z3 - 159z*2 + 159z*2 to y + lz*2 + pz*3 + az and give p. 115 Rearrange (-3l2 + 0l*2 + 4l*2)(3l - 144l*2 + 4l - 7l + 55l*2) to the form cl + t + ql4 + zl*2 + xl*3 and give q. -89 Rearrange 14q*2 + 15q*2 - 28q*2 - 18 to t + sq*2 + kq and give s. 1 Express (-4k + 11k - 5k + 57k*3 - 2k)(-5k + 3k + k) in the form bk*2 + zk + d + wk3 + pk*4 and give p. -57 Rearrange -660z + 1528z - 181z + 685z + 1286z to the form fz + l and give f. 2658 Express 1374w - 2w2 + 11w*3 - 683w - 19w4 - 693w in the form n + rw3 + iw + aw2 + lw*4 and give a. -2 Rearrange -25t*3 - 19t3 + t3 - t*3 + 4t*2 - 4t2 + (-3 - t2 + 3)(0 - 2t + 0) to mt3 + gt + ot2 + w and give m. -42 Rearrange (-17m*3 - 17m*3 + 42m*3)(0 + 2 - m + 4m) to im*2 + g + cm*4 + ym*3 + rm and give y. 16 Express 6 - 5 - 7 + 2t - 4 in the form lt + s and give s. -10 Express (1461 - 718 + 5n - 824)(2n + 2 - 2) in the form mn + i + qn2 and give m. -162 Rearrange -o2 - o2 - 139 + 35 + 54 to fo*2 + mo + s and give s. -50 Express -140g + 11g*3 - 7g3 - g4 + 2g2 + 138g - 7g2 + 1 as dg*2 + tg*3 + w + pg*4 + xg and give d. -5 Rearrange 4f - 4f - 1602f2 + 282f*2 to rf + l + wf2 and give w. -1320 Express (3a + 4a - 4a)(0 + 2 + 7)(13 + 0 - 4) as pa + o and give p. 243 Rearrange 8o - 13o + 7o - 7o + 7o + 368 to the form v + zo and give v. 368 Rearrange -776u*3 - 779u*3 + 2u + 4u2 + 1547u*3 to the form ku*2 + iu*3 + b + ou and give o. 2 Express -7k2 + 95k*2 + 169k*2 in the form nk + ck2 + v and give c. 257 Express 41j*3 + 2 + 2j*2 + 6j - 7j - 2j*2 + 2j*2 - 1 in the form pj*3 + m + fj*2 + zj and give z. -1 Express -2b3 + 2b + 5 + 30b2 + 3b*4 - 8b*2 - 20b*2 as db*3 + ab + rb2 + p + yb*4 and give y. 3 Express -738d - 3 + 740d + 3d*2 - 6d*2 + 2 + 63d*3 as vd*3 + id*2 + z + bd and give b. 2 Rearrange -2i - 485i*2 - 481i*2 + 1 + 39i*3 + 0i + 960i2 to the form pi + ni3 + b + wi2 and give p. -2 Rearrange -l2 + 2l - 2l + 2l - 2l*2 - 2l + 13l2 - 32l*2 - 6l*2 + (0 + 2 + 0)(-l*2 + 3l*2 + 0l*2) to dl + f + bl2 and give b. -24 Rearrange (-5o + 0o + 4o + (1 - 1 - 3o)(-1 - 5 + 5))(-155o - 68o + 42o) to w + ko2 + lo and give k. -362 Express 2p2 + 0p3 - p2 - 6p2 - p3 - 5p*2 + 55 in the form q + xp*2 + op + np3 and give q. 55 Rearrange (330c*4 - 2c*2 + 173368 + 0c*2 - 173367)(-1 + 1 - 2) to the form jc3 + p + qc*2 + yc + mc4 and give m. -660 Rearrange 112w*3 - 15093w + 15093w + w2 to the form yw*2 + uw + iw3 + p and give y. 1 Express -102 + 166h - 78 + 147h - 37h + 178 in the form xh + s and give x. 276 Rearrange 17q*3 + 15q*4 + 9q*3 + 8 - 14q*4 - 23q*3 to zq*2 + tq + nq4 + d + hq*3 and give n. 1 Rearrange 43i*3 - 6690i*2 + 15i*3 + 6688i*2 to x + qi*3 + ai + hi2 and give q. 58 Express (7t - 2t - t)(4 - 2t2 - 4) - 18t*3 - 557t*2 + 557t*2 in the form pt*3 + q + yt*2 + dt and give p. -26 Express (v + v - v)(-5v - 5v + 27v)(-4v - 29 + 29)(3v - v + 0v) in the form sv*4 + j + av*2 + qv*3 + yv and give s. -136 Express 0v3 + 701v*2 + 4 - 734v*2 - 4 - 14v*3 as jv*2 + av + iv3 + y and give i. -14 Rearrange 5k*2 - 6k*2 + 21k*3 - 514k*3 + 209k*3 to the form fk + qk2 + ck*3 + m and give q. -1 Rearrange -8x + x*2 + 218x*3 + 6x - 408x3 to vx + k + wx3 + rx*2 and give w. -190 Rearrange 908m - 12m3 - 6m*2 - 1 - 905m + 2m2 to um + p + zm2 + fm*3 and give f. -12 Express 91h + 270h - 41h + (-h + 1 - 1)(-3 - 3 + 4) as r + zh and give r. 0 Rearrange (-9f2 - 4f*2 + 4f*2)(-2 + 5 - 1 + (7 + 2 - 5)(-3 + 1 + 4)) to xf + hf2 + r and give h. -90 Rearrange -2a*2 + 7a + 3a3 - 15 - 6a + 18 to the form xa + va*3 + d + fa*2 and give f. -2 Rearrange (2w + 0w - 3w + (2 + 4 - 2)(0w + w + 0w) + w - 2w + 3w)(4 + 0 + w - 2) to the form jw + p + cw*2 and give j. 10 Rearrange 67u*3 - 6u*4 + 4 - 31u*2 + 34u*2 - 2 - 68u*3 to iu*2 + tu + v + fu4 + bu*3 and give b. -1 Rearrange 7l*3 - 21l*3 + 13l*3 - 37l*2 - 4l - 74l2 to tl*3 + zl + m + pl2 and give z. -4 Rearrange k2 + 2 - 2 - k2 + 0k*2 + 0k*2 + (k + k - k)(3k - k + 0k) + 600k2 - 176k*2 + 55k*2 to g + pk + lk2 and give l. 481 Express (7f - 7f + 2f*3)(-53 + 25 + 43) as vf2 + y + lf*3 + nf and give l. 30 Express 10 + 0o + 0o + 0o3 - 80 - 5o*3 as ko*3 + so*2 + xo + w and give k. -5 Express 57v2 + 60v*2 - 4v + 56v2 - 167v*2 - 4v*3 in the form k + tv + sv3 + wv**2 and give s. -4 Rearrange 2 + 81	{ "pile_set_name": "DM Mathematics" }
he nearest integer? 2 What is the cube root of 2756 to the nearest integer? 14 What is 69776 to the power of 1/8, to the nearest integer? 4 What is the square root of 6147 to the nearest integer? 78 What is 4731 to the power of 1/3, to the nearest integer? 17 What is the third root of 880 to the nearest integer? 10 What is the square root of 3512 to the nearest integer? 59 What is 59 to the power of 1/2, to the nearest integer? 8 What is 3707 to the power of 1/9, to the nearest integer? 2 What is the ninth root of 11080 to the nearest integer? 3 What is 476 to the power of 1/2, to the nearest integer? 22 What is 93023 to the power of 1/9, to the nearest integer? 4 What is 4937 to the power of 1/2, to the nearest integer? 70 What is the square root of 48204 to the nearest integer? 220 What is the cube root of 11495 to the nearest integer? 23 What is 78947 to the power of 1/10, to the nearest integer? 3 What is 93857 to the power of 1/10, to the nearest integer? 3 What is 10005 to the power of 1/10, to the nearest integer? 3 What is 180 to the power of 1/3, to the nearest integer? 6 What is the cube root of 2711 to the nearest integer? 14 What is the cube root of 2994 to the nearest integer? 14 What is 1160 to the power of 1/6, to the nearest integer? 3 What is the sixth root of 400 to the nearest integer? 3 What is 6116 to the power of 1/3, to the nearest integer? 18 What is the tenth root of 9683 to the nearest integer? 3 What is the square root of 1583 to the nearest integer? 40 What is the cube root of 3386 to the nearest integer? 15 What is the square root of 18974 to the nearest integer? 138 What is the square root of 57848 to the nearest integer? 241 What is 557 to the power of 1/2, to the nearest integer? 24 What is the tenth root of 15545 to the nearest integer? 3 What is 7149 to the power of 1/9, to the nearest integer? 3 What is 173313 to the power of 1/3, to the nearest integer? 56 What is 282 to the power of 1/3, to the nearest integer? 7 What is the square root of 13747 to the nearest integer? 117 What is the third root of 13841 to the nearest integer? 24 What is 1569 to the power of 1/8, to the nearest integer? 3 What is 36283 to the power of 1/3, to the nearest integer? 33 What is the cube root of 23678 to the nearest integer? 29 What is 4743 to the power of 1/5, to the nearest integer? 5 What is the square root of 55 to the nearest integer? 7 What is 338 to the power of 1/5, to the nearest integer? 3 What is the square root of 14120 to the nearest integer? 119 What is 258 to the power of 1/3, to the nearest integer? 6 What is the sixth root of 5986 to the nearest integer? 4 What is the third root of 29159 to the nearest integer? 31 What is the fifth root of 585 to the nearest integer? 4 What is the fifth root of 37534 to the nearest integer? 8 What is the fourth root of 3403 to the nearest integer? 8 What is the square root of 1944 to the nearest integer? 44 What is 205 to the power of 1/2, to the nearest integer? 14 What is 10267 to the power of 1/3, to the nearest integer? 22 What is 19530 to the power of 1/2, to the nearest integer? 140 What is the sixth root of 74330 to the nearest integer? 6 What is 1536 to the power of 1/6, to the nearest integer? 3 What is 7759 to the power of 1/3, to the nearest integer? 20 What is 6255 to the power of 1/3, to the nearest integer? 18 What is 794 to the power of 1/2, to the nearest integer? 28 What is the fourth root of 23045 to the nearest integer? 12 What is the cube root of 18626 to the nearest integer? 27 What is 5996 to the power of 1/2, to the nearest integer? 77 What is 938 to the power of 1/6, to the nearest integer? 3 What is the cube root of 1622 to the nearest integer? 12 What is the tenth root of 54741 to the nearest integer? 3 What is the square root of 78761 to the nearest integer? 281 What is the cube root of 1915 to the nearest integer? 12 What is the square root of 1467 to the nearest integer? 38 What is the cube root of 3979 to the nearest integer? 16 What is the square root of 10941 to the nearest integer? 105 What is the ninth root of 4665 to the nearest integer? 3 What is the square root of 158681 to the nearest integer? 398 What is 11502 to the power of 1/9, to the nearest integer? 3 What is the square root of 141 to the nearest integer? 12 What is 30195 to the power of 1/8, to the nearest integer? 4 What is the third root of 113 to the nearest integer? 5 What is 65160 to the power of 1/3, to the nearest integer? 40 What is 2822 to the power of 1/3, to the nearest integer? 14 What is 3117 to the power of 1/3, to the nearest integer? 15 What is 14684 to the power of 1/3, to the nearest integer? 24 What is the third root of 1554 to the nearest integer? 12 What is 4635 to the power of 1/3, to the nearest integer? 17 What is 47522 to the power of 1/5, to the nearest integer? 9 What is 3723 to the power of 1/9, to the nearest integer? 2 What is 9907 to the power of 1/4, to the nearest integer? 10 What is 1193 to the power of 1/2, to the nearest integer? 35 What is 208 to the power of 1/2, to the nearest integer? 14 What is 6751 to the power of 1/2, to the nearest integer? 82 What is the square root of 5043 to the nearest integer? 71 What is 18781 to the power of 1/4, to the nearest integer? 12 What is 46941 to the power of 1/3, to the nearest integer? 36 What is 8251 to the power of 1/10, to the nearest integer? 2 What is the third root of 47 to the nearest integer? 4 What is the third root of 166 to the nearest integer? 5 What is the third root of 3456 to the nearest integer? 15 What is the third root of 16890 to the nearest integer? 26 What is 66138 to the power of 1/2, to the nearest integer? 257 What is 11332 to the power of 1/2, to the nearest integer? 106 What is 1912 to the power of 1/6, to the nearest integer? 4 What is the sixth root of 292 to the nearest integer? 3 What is 66205 to the power of 1/6, to the nearest integer? 6 What is 13275 to the power of 1/3, to the nearest integer? 24 What is 16090 to the power of 1/2, to the nearest integer? 127 What is 902 to the power of 1/2, to the nearest integer? 30 What is the cube root of 18495 to the nearest integer? 26 What is the square root of 3397 to the nearest integer? 58 What is the tenth root of 109463 to the nearest integer? 3 What is the square root of 2178 to the nearest integer? 47 What is 2239 to the power of 1/5, to the nearest integer? 5 What is the square root of 157 to the nearest integer? 13 What is the square root of 77385 to the nearest integer? 278 What is the seventh root of 2255 to the nearest integer? 3 What is the eighth root of 1053 to the nearest integer? 2 What is the third root of 139 to the nearest integer? 5 What is the square root of 1312 to the nearest integer? 36 What is the cube root of 5277 to the nearest integer? 17 What is 26734 to the power of 1/2, to the nearest integer? 164 What is 13918 to the power of 1/3, to the nearest integer? 24 What is the square root of 22261 to the nearest integer? 149 What is the square root of 14187 to the nearest integer? 119 What is 13179 to the power of 1/3, to the nearest integer? 24 What is 1893 to the power of 1/4, to the nearest integer? 7 What is the seventh root of 23325 to the nearest integer? 4 What is the square root of 57803 to the nearest integer? 240 What is the cube root of 501 to the nearest integer? 8 What is 65913 to the power of 1/2, to the nearest integer? 257 What is 2504 to the power of 1/3, to the nearest integer? 14 What is 27011 to the power of 1/3, to the nearest integer? 30 What is 868 to the power of 1/9, to the nearest integer? 2 What is 2731 to the power of 1/2, to the nearest integer? 52 What is the square root of 7465 to the nearest integer? 86 What is 67664 to the power of 1/3, to the nearest integer? 41 What is 1479 to the power of 1/6, to the nearest integer? 3 What is the eighth root of 49595 to the nearest integer? 4 What is the third root of 2770 to the nearest integer? 14 What is the square root of 4490 to the nearest integer? 67 What is the third root of 1298 to the nearest integer? 11 What is the cube root of 52795 to the nearest integer? 38 What is the cube root of 266 to the nearest integer? 6 What is 1	{ "pile_set_name": "DM Mathematics" }
2m)(3m + 0m - 2m) + (3m + 1 - 1)(9 - 13 + 6 - 8m) to the form nm2 + tm + q and give n. -23 Express 26k + 5k*2 - 26k - k*2 + 0k*2 + 4k*2 + (4 - 4 + 2k)(-2k + 2k + k) + 2k*2 + 6k*2 + 3k*2 in the form pk*2 + sk + i and give s. 0 Rearrange (0p - 2p - p)(126 + 204 + 81) to the form up + l and give u. -1233 Rearrange -2y2 - 38895y - 34 + 38895y to the form hy + u + zy2 and give z. -2 Rearrange 1441018m - 1 - 1440988m + 4 to gm + w and give g. 30 Rearrange -644b + 30b - 1245b - 37b to the form db + w and give d. -1896 Express 19n - 3n + 37n + 24n in the form sn + h and give s. 77 Rearrange h*3 + 1 + 0h*3 + 11h*2 + 5h - h - 2h to the form ih*2 + u + ch*3 + yh and give u. 1 Rearrange -134j2 + 18 + 5j - j*3 + 134j*2 - 3j to k + gj + cj*3 + tj*2 and give k. 18 Rearrange m - 3m + m + (m - 2m - m)(4 - 3 - 3) + 3m + 0m - 4m + 26 + 7m - 26 + (3 - 5 + 1)(5 - 5 + m) to the form n + om and give o. 8 Rearrange -k - 150k4 - 2k*3 - 164k*4 + 369k*4 to hk + qk3 + lk*2 + zk*4 + a and give z. 55 Rearrange 233u*3 + 4497u - 12u3 - 4499u to ou2 + bu + k + yu3 and give b. -2 Express (-2 + 2 - b2 + (-3b + 5b + 0b)(-1 + 1 + b) - 4b*2 + 94 - 94)(-6 + 4b + 6) as qb + vb2 + x + zb*3 and give q. 0 Express ((-5f + 2f + 2f)(-2 + 4 + 0) - 2 + 4f - f - 4f)(7399 - 7399 + 462f) as xf + k + af2 and give a. -1386 Express (-1 + 1 - 2w*4)(408 - 223 - 233)(1 + 4 - 2)(1 - 4 + 1) + 2w2 - 2w2 - w4 as kw4 + fw + hw3 + pw*2 + r and give p. 0 Rearrange 2i - 3i + 5i + 924i2 - 4i to si2 + k + di and give d. 0 Rearrange -8n + 18n + 1 + 5 - 8n2 - 5n - 7n to z + vn*2 + mn and give m. -2 Express (-5h4 - 5h*4 - 8h*4)(1 - 2 + 7 + 0 + 0 - 3 + (5 - 1 - 2)(-2 + 1 + 3) - 1 + 1 + 2) in the form ah*4 + dh + yh3 + nh*2 + r and give a. -162 Express (31h*2 - 36h*2 + 22h*2)(-7 + 0 - 2) as ph + mh*2 + s and give m. -153 Express 10i*2 + i - 13i*2 + 5i*2 + 6i - 7i3 as si*2 + gi + mi3 + w and give g. 7 Express 1 + 0 + 5p*3 - 2p + 0 + 4p3 as up + fp3 + t + dp*2 and give f. 9 Express 284h + 241h + 258h - 324h + 286h as j + nh and give n. 745 Express 454c + 454c - 917c - 31c3 in the form tc*2 + m + wc + kc3 and give w. -9 Rearrange -26 + 13s*2 + 12s*2 - 29s2 + s2 + 9s2 to d + ts*2 + xs and give t. 6 Express ((-2 - w + 2)(3 - 2 + 2) + w - 3w + 4w)(-24 + 10 - 14) in the form s + uw and give s. 0 Express 42 - 87 + 43 + 44r*3 - 351r*3 as jr*2 + w + xr*3 + ar and give w. -2 Rearrange -2830r2 - 3r*3 + 9r - 2r4 + 2830r*2 to the form ar*2 + br*4 + d + xr + hr3 and give h. -3 Rearrange (0 + 0 - 2h)(-2 + 3h + 2) + (0h2 - 3h*2 + 4h*2)(0 - 6 + 4) to the form oh2 + ph + b and give o. -8 Express 1288f + 593f - 687f in the form d + cf and give c. 1194 Rearrange 354 - 355 - s*3 - 3s*4 - 2s + 6s + 2s*4 to the form ks*3 + m + ws + gs2 + ns*4 and give k. -1 Express 640z*3 - 2z*4 - 639z3 + z2 + 9 + 4z4 + 0z*4 in the form cz*2 + n + pz*4 + rz + iz3 and give p. 2 Rearrange -37 + 129i - 131i - 28 to ui + n and give u. -2 Rearrange 131t2 + 43t*2 + 297t*2 to the form k + bt + dt2 and give k. 0 Rearrange -475v*2 - 5v*3 + 4v*3 - 2v*3 + 0v3 + v3 to g + av + pv*3 + jv*2 and give j. -475 Express (-2i - 5i + 3i)(2 - 2 - 1) - i + 4i - i + (16 + 0 - 7 + (4 - 5 + 2)(1 + 2 - 2))(-3i + 1 - 1) as ri + c and give r. -24 Express -174y + 4y*2 - 15y*4 + 8y*4 + 9y*4 + 164y as sy3 + o + dy*2 + ly*4 + xy and give d. 4 Rearrange 63 - a*2 - 2a*4 + 2a - a2 - 64 - a2 to the form va4 + xa + qa2 + da*3 + w and give v. -2 Express -6985 + 6987 + 4u*3 + 0u*3 - 17u + 2u in the form zu + mu3 + pu*2 + y and give y. 2 Express -36g*4 - 54g*4 + 24g4 + (3 + g4 - 3)((1 - 1 + 1)(-1 + 5 - 3) + 3 - 2 + 1) in the form q + mg2 + xg + fg4 + zg*3 and give m. 0 Express 3 + 8c - 7c + 49 + 10 in the form m + tc and give t. 1 Express (-4r + 22r + 59r)(3 + 1 + 1 + r) in the form ar2 + jr + g and give a. 77 Express (-190l2 - 167l*2 - 170l*2)(2l - 2l + l) as jl2 + rl + x + vl3 and give v. -527 Rearrange -80z*2 - 2 - 104z + 81z2 + 102z to y + lz2 + fz and give f. -2 Express 735o + 63o - 1569o as jo + p and give j. -771 Express 1155v2 + 1156v*2 - 3v*3 + 5v*3 - 2311v*2 - 123 in the form sv*2 + k + bv*3 + rv and give k. -123 Express -9y2 - 10y*2 - 4y*2 + 1 - 58y*2 in the form v + hy*2 + xy and give v. 1 Express 13a2 - 772 - 755 + 1513 as z + ka*2 + la and give z. -14 Express -j*2 + 34 - 9 - 36 - 3j - 20 in the form pj + y + oj*2 and give p. -3 Rearrange -69n*3 - 254n*3 + 2 + 49n*3 - 198n3 - n2 + 0n2 to the form pn*2 + t + xn + qn3 and give t. 2 Rearrange -631p + 304p + 301p to d + ap and give a. -26 Rearrange 298 - 298 + 1352b to x + wb and give w. 1352 Rearrange (28 + 2 + 49)(-i + i + i) to the form m + ri and give r. 79 Express -3l*4 + 0l*4 + 20l*4 + (4l3 - l2 + l3 - l3)(6 + 8l - 2l - 8) as wl*4 + cl + n + pl3 + tl*2 and give w. 41 Rearrange -1 + 1 - h + (-5 + 4 - 1)(2h + 2h - 5h) - 8 - 16h + 9 + 2 to jh + s and give j. -15 Rearrange -6 + 9 + 10a*2 + 24 + 8 + 7 to the form ta*2 + p + ra and give t. 10 Rearrange (-2 + 3 - 2 + (1 - 2 + 4)(-3 + 4 + 0))(3v - 2v + v)((-10 - 3v + 10)(-2 - 3 - 1) + 4v + 0v - 2v) to xv2 + pv + i and give x. 80 Express -28j2 + 0j + 3 + 26j2 - 31j + 2j4 in the form bj + oj4 + l + yj*3 + mj2 and give m. -2 Express (w2 + 9w2 + 0w*2)(54 - 38 + 34) as tw2 + zw + v and give t. 500 Rearrange -27v2 + 11v*3 + 5v*3 + 98v*2 - 22v*3 to the form ov + n + sv2 + wv*3 and give n. 0 Rearrange 342a*2 - 14a - 14a + 28a to the form fa2 + va + n and give f. 342 Express 32i - 86i - 88i - 16i as xi + t and give x. -158 Express (179 - 49 + 418 - 87 + 272)(0g + 2g - 3g) in the form vg + p and give v. -733 Rearrange (6m + 7m - 5m)(-72m3 + 39m*3 - 40m*3) to wm + gm2 + sm*4 + o + zm*3 and give s. -584 Rearrange 15v*2 + 0v*2 - 2v + 109 + 12v2 - 29v*2 to the form h + zv + av2 and give h. 109 Express (2 + 3n*2 - 2)(13 - 20 - 5) + 0n2 - 2n2 + n2 + n + 1 + 0 - 2 - n*2 as xn*2 + rn + o and give r. 1 Rearrange -51 + 20u + 31 + 15 - 7u to the form yu + m and give m. -5 Rearrange -540c*2 - 491c*2 + 315c*2 + (2c - 4c + 0c)(-2 + 2c + 2) to the form a + hc + oc*2 and give o. -720 Rearrange (2 - 2i3 - i3 + i*3)(9 - 12 + 68)(-1 + 1 + 2 + (1 + 3 - 1)(0 + 0 + 2)) to the form g + vi3 + ui + zi2 and give g. 1040 Rearrange -d + d + 2d*3 + (-42d - 336 + 336)(-7 + 7 - 4d*2) to the form hd*2 + b + rd*3 + fd and give r. 170 Express (-3 + 0 + 0)(-49 - 244 - 61)(-5m + 5m + m) as om + p and give o. 1062 Rearrange -4n + 0 + 1 - 4 - 2 + 5n to the form k + fn and give f. 1 Express (181 - 296 + 189)(4 - 2x - 4)(2x + 4 - 4) in the form px + i + qx*2 and give q. -296 Rearrange -2 - 2n*2 - 4n*2 - 3n*2 - 2n + 5n4 + 10n*2 to un*3 + xn*4 + wn + f + jn2 and give f. -2 Express 2w - 107w3 + 5 - w4 - 4w + 105w3 in the form tw*2 + v + xw*4 + bw + jw3 and give x. -1 Rearrange 2g*4 - 12g*4 - 4g*4 + (2g - 2g + 2g*2)(-4g2 + 0g*2 + 5g*2) to zg + hg2 + y + kg*3 + rg*4 and give r. -12 Express 4 - 16w - 9 + 32 + 26 + 2 as mw + j and give j. 55 Rearrange (2 + 3 - 3)(t4 - t4 - 2t4) + (-t + t2 + t)(-2t - 70t*2 - 38t + 72t2) to jt*4 + c + ot*3 + wt + vt2 and give o. -40 Rearrange 8b + 9b + 73b + 7b to i + pb and give p. 97 Express (65 - 126 - 2u + 65)(-2u2 - u2 + 10u*2) as qu*3 + g + vu + cu2 and give c. 28 Rearrange 27y*2 + 7y - 7y to gy + t + sy2 and give s. 27 Rearrange 5970r + 13 - 2953r - 2991r to the form or + l and give o. 26 Express (109m - 109m + 20m*3)(-8 + 5 + 4 + (-4 + 2 + 4)(-3 - 4 + 6))(0m + 2m - 4	{ "pile_set_name": "DM Mathematics" }
7 Let p(f) = -504 + 17f3 + 3f*2 + 504 - 15f*3 + 6f. Determine p(-4). -104 Let y(n) = -n*2 - 2n + 12. Suppose 5s + 8s + 5915 = 0. Let q = -460 - s. Determine y(q). -3 Let h(c) = -c*2 - c - 4. Let o be (-2 + 22/6)/(34/(-102)). Let d be (-12)/(o - -2) + -1 + 2. Give h(d). -34 Suppose -909x + 839x = -350. Let g(w) = 5w*2 + 16. Calculate g(x). 141 Let k(z) = 1 - 3z + 0z + 2z - 3. Suppose 0 = 3r + 255 + 345. Let v = r - -195. Calculate k(v). 3 Let n(a) = -308a + 257. Let c(y) = 121y - 129. Let z(q) = -5c(q) - 2n(q). Calculate z(-11). 10 Let q(s) = -2s + 1. Let b(j) = 5j - 3. Let v(o) = 6b(o) + 13q(o). Suppose -5z - 118 = -128. Suppose 2n = -k + z, -17 = -5k + 4n + 21. Give v(k). 19 Let i(y) = -4y + 168. Let u(m) = m*2 - 6m + 4. Let w be u(10). Let f be i(w). Let g(h) = h*3 + 8h2 + h + 10. Calculate g(f). 2 Let b(v) = -v3 + 101v2 - 184v - 1373. Let o be b(99). Let d(u) = 2u2 - 30u - 7. Calculate d(o). -59 Let h(o) = -1 - 2o + 2 + 1 + 1. Suppose -3a - 94 = 5k, -2k - 2a = -0a + 36. Let b = 26 + k. Determine h(b). -9 Let q = -53 + 19. Let r = -28 - q. Let s(x) be the first derivative of x*3/3 - 7x*2/2 + 4x - 3. Give s(r). -2 Let x(a) = a - 5. Suppose 6p - 24 = -0p. Suppose -o - pr = r + 7, -2r = 0. Let t = -1 - o. Calculate x(t). 1 Let g(l) = 3l - 2l - 6l2 + 16 - 220l*3 + 7l - 5l + 219l*3. Calculate g(-6). -2 Let o(d) = 4d - 43. Let z be (1 - 5/6)252/(36/6). Determine o(z). -15 Let h(a) = -5a + 3. Let n(m) = m - 1. Let f(t) = h(t) + 6n(t). Suppose 228r = 213r + 75. Determine f(r). 2 Let t(x) = 8x - 11. Let q(w) be the second derivative of -5w3/6 + 13w*2/2 + 76w. Let f(k) = 3q(k) + 2t(k). Calculate f(-7). 10 Let q(c) = 69. Let k(i) = 14. Let l(y) = -5k(y) + q(y). Suppose j = 0, -3g + 4j + 5 = -13. Let w(m) = m2 + m + 6. Let o(x) = gl(x) + w(x). Calculate o(3). 12 Let u(r) be the first derivative of -r*3/3 - 13r*2/2 - 42r + 144. Determine u(-8). -2 Let x(m) be the second derivative of -1 - 1/2m2 - 11m + 1/12m4 + 0m*3. Suppose 0 = -5z + 5f + 20, -5z + 4z - 3f - 4 = 0. Determine x(z). 3 Let d(y) = -y*2 + 4y*2 - 2 - 2y*2 + 3 + 7y. Let c(n) = -7n - 22. Let q be c(-6). Suppose 0 = -4z - b - q, 3z - 2b = 2b + 4. What is d(z)? -11 Let n be 39/15 - (-48)/(-80). Let h(d) = d3 + 4d*2 - 6d - 2. Let a be h(-5). Let b(v) = 8v + 2v*3 - 9v - 4 + 6 - av2. What is b(n)? 4 Let g(t) = 0t + 1 - t + 3t. Let a = 55646 + -55647. What is g(a)? -1 Let i(g) = 18g + 2. Let s(j) = 4j + 1. Let h(n) = i(n) - 5s(n). Suppose -3m = 3f - f - 2, 0 = -m + 4. Determine h(f). 7 Let y(g) = g*2 + 3g. Suppose 0 = -3p - 5i + 577, 4p + 3i - 777 = 4i. Let u = p - 192. What is y(u)? 10 Let s(z) be the third derivative of z6/120 + 3z*5/20 + 17z*4/24 - 3z*3/2 + 335z2 + 1. Calculate s(-5). 6 Let r be 9 + 1650/(-176) - 9/(-24). Let n(y) = y3 - 2y2 + 22y - 5. Calculate n(r). -5 Let g = -845 - -884. Let c = g + -38. Let o(a) = 2a2 + a - 1. What is o(c)? 2 Suppose 0 = -37v + 35v + 5a - 52, -2a - 32 = 4v. Let j(h) = 22h + 238. Give j(v). -4 Let m(t) = -t2 + 28t - 91. Let u be (1 + 1 - (19 + 11))18/(-21). What is m(u)? 5 Let c(k) = 7k2 - k + 3. Let h(t) = t2. Let z(w) = -c(w) + 6h(w). Let d be (-3)/27 - 259/(-63). What is z(d)? -15 Let u(i) = -i2 - 10i - 15. Suppose -423t = -388t + 280. Determine u(t). 1 Let v = 37288 + -37316. Let s(i) = i*2 + 32i + 91. What is s(v)? -21 Let p(v) be the third derivative of v*4/24 + 8v*3/3 - 43v*2 - 25. Let y(m) = -m - 8. Let q be y(0). Calculate p(q). 8 Let b(l) = 20l + 1. Let n = 257 + -129. Let y = -129 + n. Determine b(y). -19 Let k(r) = 1 - 5r + 2r - 2r - r. Let z be (-1067)/(-209) + -3 + 1/((-38)/4). Determine k(z). -11 Let b(v) = -v3 + 13v*2 - 10v - 6. Let z = 1630 - 1618. Give b(z). 18 Let u(x) = -8x - 2x*2 + 8 + 8x - 4x. Let g(o) = -o2 - o + 4. Let s(b) = -7g(b) + 4u(b). Give s(-9). 4 Let t be 2/8 + 48/192. Let k(j) be the first derivative of tj*2 - 2j + 12. Give k(5). 3 Let m be (-136)/(-476) - 88/14. Let j(w) be the second derivative of 5w - 4/3w*3 + 0 - 1/12w*4 - 7/2w*2. What is j(m)? 5 Let f be -26(1 - (-45)/(-18)). Let m(x) = -f + 2x + 14x + 8 - 4x - 8x. Give m(9). 5 Let a(l) be the second derivative of -l5/10 + l4/4 - 2l3/3 + 7l*2/2 - 2l - 60. What is a(2)? -5 Let k = -51 - -53. Suppose -kj + 5j - 8 = b, 3j + b - 4 = 0. Let y be (28/(-36)-3)/(j/(-6)). Let c(z) = 3z + 10. Determine c(y). -11 Let w(z) = -z2 - 2z - 4. Let a(v) = -6v2 - 10v - 15. Let d(g) = 2a(g) - 9w(g). Determine d(-5). -59 Let f(r) be the first derivative of -r4/12 + r2 - 30r + 36. Let a(v) be the first derivative of f(v). Let x(h) = 2h - 1. Let n be x(2). Calculate a(n). -7 Let v(a) = -a. Suppose 5h = 4w + 21, 4w + 3h = 2w - 27. Let c be v(w). Let l(n) = -cn + 3 - 4 - 11n + 2n. Determine l(1). -19 Let f(k) = 2k2 - 14k - 19. Let b(q) = -25q + 107. Let w be b(4). Give f(w). -19 Let v(r) = -r3 - 4r*2 + 2. Let s = 450 + -447. Suppose sx - 4 = -4a, 17 + 11 = -4x + 3a. Determine v(x). 2 Let y(c) = -3c2 + c + 4. Let p be y(2). Let d(q) = q2 + 5q + 9. Let z be d(p). Suppose 38u = 43u - z. Let n(t) = t2 + 1. Calculate n(u). 10 Suppose -1 + 13 = 3l + z, 0 = 3l - 4z - 27. Suppose 0 = 4g + d - 6, lg - g + 2 = -5d. Let u(w) = 2 - 2w*3 - 4w + 5w - 2 + 2 + gw2. Determine u(2). -4 Let i(r) = -r - 7. Let f = -581 + 216. Let p = f - -358. Determine i(p). 0 Let u(h) be the second derivative of h5/20 - 7h4/12 - h3/6 + 2h*2 + 1653h. Calculate u(6). -38 Let v be ((-6)/(-14))/((-266)/1862). Let o(u) = -8u - 25. Determine o(v). -1 Let w(b) = -b3 + 5b*2 + 2b. Let u = -45 + 31. Let i = u + 52. Let o = i + -33. Determine w(o). 10 Let a(d) be the first derivative of d*4/4 - 8d3/3 + d2/2 - 8d - 16. Let f = 20 - 18. Suppose 0 = -5v - k + 42, -v + f = -2v + 5k. Give a(v). 0 Suppose 1111 + 618 = -648l - 863. Let y(m) = 3m - 9. Let d(j) = -8j + 26. Let n(g) = -4d(g) - 11y(g). Calculate n(l). -1 Let l(q) = 3q*2 + 2q. Let y(w) = 32w2 + 5w + 6. Let i(o) = -6l(o) + y(o). Calculate i(1). 13 Let g = -17561 + 17573. Let d(t) = -t3 + 12t*2 + 2t - 17. Determine d(g). 7 Let t(d) be the second derivative of -d5/20 + d4/12 + 11d3/6 - 19d*2/2 - 993d. Determine t(4). -23 Let x(w) = -w*3 - 3w2 - 1. Let j = 660 + -662. Calculate x(j). -5 Let j = 87 + -80. Let o be ((-82)/(-3))/((j + -4)/(-9)). Let w = -84 - o. Let a(t) = t2 - 3t - 1. Calculate a(w). 9 Let i(j) = -2j2 - j - 1. Let n be (-84)/(-56) - (-30)/(-12). Give i(n). -2 Let j(l) = -l3 + 23l2 - 2l + 21. Let f(k) = k*3 - 22k*2 + 2k - 27. Let o(s) = -4f(s) - 3j(s). Calculate o(19). 7 Let c(m) = m*3 - 20m*2 - 70m + 21. Let x(l) = -372l - 2209. Let u be x(-6). Calculate c(u). -2 Let s(a) be the third derivative of -a8/10080 - a7/1260 - a6/180 + 43a*5/30 + 139a*2. Let z(k) be the third derivative of s(k). What is z(-3)? -10 Let d(y) = -12y - 70. Let t be d(-6). Suppose 0 = tf + 6f + 32. Let x(z) = -z - 4. Let g(c) = -c - 4. Let o(h) = -4g(h) + 3x(h). Calculate o(f). 0 Suppose -2t + r - 30 = 0, -4r - 49 = t + 4t. Let m be t(4 + -1 - 5). Let u(v) = mv2 + 5 + 4v*3 - 31v*2 - 3v*3. Calculate u(5). 5 Suppose -185884 + 185740 = 24v. Let x(i) = i*2 + 8i - 1. Let k(j) = -2j2 - 17j + 2. Let l(d) = 2k(d) + 5x(d). What is l(v)? -1 Let g(l) = -l*2 - 4l + 5. Suppose -16y + 45 = -3. Suppose -yj - 113 = -95. Determine g(j). -7 Let c(w) = w*3 + 13w*2 - 27w + 46. Suppose -3m - r - 39 = 0, -r + 29 = 4m + 83. What is c(m)? 1 Let y(g) = -10g. Let s(m) = -m3 - 14m*2 - 35m - 53. Let t be s(-12). Let i = t + -80. Calculate y(i). 10 Let p(l) = -2l2 - 4l - 4. Suppose 0 = 38r - 60r + 66. Suppose rq + 18 = -3j, -5j - 4q = -6j + 14. Determine p(j). -4 Let r be (-7)/(-2) + 2/4 - 197. Let t = -189 - r. Let f(p) = 2p + 4. Give f(t). 12 Let p(o) be the first derivative of 1/2o2 - 2/3o*3 + 172 + 7o. What is p(-2)? -3 Suppose -11 + 20 = -3d. Let q be (-4 + 5)/(d2/(-30)). Let w(l) = 6l - 6. Calculate w(q). 24 Let y(x) = x2 + 23x - 33. Let t be (56/(-3))/(10*(-4)/(-60	{ "pile_set_name": "DM Mathematics" }
What are the prime factors of u? 3, 151 Suppose -697z + 4r = -695z - 45824, -68680 = -3z - 2r. What are the prime factors of z? 2, 107 Suppose 60a = 41a. Suppose a = 5s + 2h - 6928, -627 = 4s - 3h - 6174. List the prime factors of s. 2, 3, 7, 11 Suppose -5b = -4p + 7789, 0 = -6b + 5b + 5p - 1541. Let o = b + 2283. List the prime factors of o. 2, 19 Let y(n) = 74n2 - 14n + 3. Let d be y(4). Suppose 5x + 4t = 2545, 5x + t - 3676 + d = 0. What are the prime factors of x? 509 Let o be 4/1 + -3 + -48. Let a = -39 - o. Suppose 2t = 3h + 46, at - 92 = 3t - 4h. What are the prime factors of t? 2, 5 Let q = -18560 + 68058. List the prime factors of q. 2, 24749 Suppose -q = -4r + 9, 3r = -q + 4q + 18. List the prime factors of (-1)/33345/q. 223 Let r(t) = 2t2 - 8t - 507. Let z be r(0). Let n = -188 - z. What are the prime factors of n? 11, 29 Let l(g) = -2g3 + 69g*2 + 37g - 67. Let x be l(35). What are the prime factors of -914(x + (-21)/6)? 457 Let z = 12539 + -5499. Suppose -8p = 8p - z. What are the prime factors of p? 2, 5, 11 Let p = 2859 + -2039. Suppose 5n = -a + 419 + p, -n + 3a + 235 = 0. List the prime factors of n. 13, 19 Suppose 1077 = 4t - 367. Suppose -3z = -5a - 513, 0 = -2z - 2a - a + t. Suppose 0 = -7x + z + 13. What are the prime factors of x? 3 Suppose -3p - 156 - 199 = -2w, 4w = 4p + 472. Let v = 316 + p. What are the prime factors of v? 197 Let s(y) = y3 - 5y*2 + 11y + 8. Suppose -2g - 66 = -78. List the prime factors of s(g). 2, 5, 11 Let d(r) = 40r*3 + 3r*2 + r - 3. Let i be d(1). Let n = 44 - i. Suppose -nb = -5f + 75, -4f - b + 87 = 2b. What are the prime factors of f? 2, 3 Let s(q) = -q2 + 14q - 47. Suppose -21 = -z - 3w, -3w = -2z - w + 10. Let x be s(z). What are the prime factors of 5 + 77 + (-10)/x? 3, 29 Let h(k) be the third derivative of k6/60 - 4k*5/5 + 5k*4/12 + 13k*3/6 - 9k*2 + 8. List the prime factors of h(24). 11, 23 What are the prime factors of (6620 - 0)220/275? 2, 331 Let b be -1 - (-181 - -1) - (-72 - -81). Let z be 304/(-6) + (-1)/3. Let j = b + z. List the prime factors of j. 7, 17 Let n = -365 - -364. List the prime factors of n/((-1)/(-2)) + (660 - -52). 2, 5, 71 Let a(j) = j + 24 + 27j + 36j. Let f be a(4). Suppose 8s - 6s - f = 0. List the prime factors of s. 2, 5, 7 Let p(u) be the third derivative of u*4/8 + 19u*3/6 + 10u*2. Let g be p(-7). List the prime factors of 108 - (g + 3/(-3)). 3, 37 Let h = -2235 - -1180. List the prime factors of -58/(-140) + h/(-7). 151 Let h(d) = -173d + 48. Let o be h(5). Let m = o + 1280. List the prime factors of m. 463 Suppose 2j - 1 = 5. Suppose 0 = -4l + 5x, -19 = -2l - jx + 3. Suppose 3o - 349 = ly, 2o + 3y + 0y - 201 = 0. List the prime factors of o. 2, 3 Suppose 2u + 3g + 0g = -49, -3g = -2u - 31. Let h be 62/u15/(-3). List the prime factors of 36 + h - 6/(-2). 2, 3, 7 Let h = -2483 + 6888. What are the prime factors of h? 5, 881 Suppose -5039891 = -188d - 1213527. List the prime factors of d. 20353 Let m(l) = -3559l - 1029. List the prime factors of m(-5). 2, 83, 101 Let w(d) = -d*3 - 2d*2 - 3d - 3. Let r be w(-2). Let k = 2973 + -2977. What are the prime factors of 149 - ((k - -2) + r)? 2, 37 Suppose 2855k + 41437 = m + 2853k, -4k + 207213 = 5m. List the prime factors of m. 29, 1429 Suppose -1 + 6 = v. Suppose -x - 1088 = -vx. Let c = -180 + x. What are the prime factors of c? 2, 23 Let p(y) = 22y*2 + 13y + 153. Let x be p(-11). Suppose 0 = -k - 3j + 1356, -2k = -4j + 2j - x. List the prime factors of k. 3, 149 Let n be (11 - 12)(-7 - 0). Suppose -556 = -nj + 480. Let x = 234 - j. List the prime factors of x. 2, 43 Let g = 165 + 54. Let t = g - 124. What are the prime factors of t? 5, 19 Let f be 2/(-3)27/(-6). Let k be 2/((f - 149/37) + 1). Let t = k + 86. List the prime factors of t. 2, 3 Suppose d + 9 - 19 = 0. Let p be -299 + (d - 9)/((-2)/(-6)). Let f = -168 - p. List the prime factors of f. 2 Suppose 5b = -2r + 169852, -13r + 14r = b - 33976. What are the prime factors of b? 2, 3, 19, 149 Let k = 8201 - 7752. List the prime factors of k. 449 Suppose 3m - 5o = 50226, -5m + 143o = 144o - 83654. What are the prime factors of m? 2, 47, 89 Let t be (2 + -8)/(2/13). Let w = -940 - -1052. Let j = w + t. What are the prime factors of j? 73 Suppose -3m - j = 129 - 2199, j - 1380 = -2m. Let g = m + -319. List the prime factors of g. 7, 53 Suppose 0 = -62l - 151l + 1897830. List the prime factors of l. 2, 3, 5, 11 Let x be 100/26 - (-40)/260. Let n be (-1)/(x/8 - 1) - 157. Let d = n - -401. What are the prime factors of d? 2, 3, 41 Let i(g) = 7g - 43. Let x be i(6). List the prime factors of (792/308)/(x/(-77)). 2, 3, 11 Let m = 146 - 150. What are the prime factors of m + 2/((-8)/(-620))? 151 Suppose -62o + 708993 = 2o + 17o. List the prime factors of o. 8753 Let o = 1400 - 29. Suppose 7w = -f + 3w + 255, -5f = -4w - o. List the prime factors of f. 271 Let f(a) be the second derivative of 5a3/2 - 6a*2 + 2a - 68. Suppose 2l - 5n = 6l - 1, l = -n + 1. What are the prime factors of f(l)? 2, 3 Suppose 5w - 4r = 15, 2r - 12 = -4w - 0r. Suppose -3v - 15 = wl, 3v = 2l - 9 - 6. Suppose c = -lc + 55. List the prime factors of c. 5, 11 Suppose -3538l - 485144 = -3612l. List the prime factors of l. 2, 11, 149 List the prime factors of (-16)/12(-3242415)/860. 11, 457 What are the prime factors of 24/63-7-13161? 2, 41, 107 Suppose 0 = -j + 4p + 19252, 3j + p - 47231 = 10538. List the prime factors of j. 2, 29, 83 Suppose 765y - 770y = -2360. Suppose y = 4m + 5p - 4351, 4p = -4. What are the prime factors of m? 17, 71 Suppose -2i + 1 = -9, i = 3v - 10. Suppose 2d = 3d - 2. Suppose vf = dg + f - 56, g - 48 = -2f. What are the prime factors of g? 2, 19 Suppose 3o - 45 = 4h - 23, -2o - 3h = 8. Let f = -112 - -189. Suppose oi - 3i + f = 0. What are the prime factors of i? 7, 11 Suppose 3g + 13147 = 5f, -33g + 5246 = 2f - 31g. What are the prime factors of f? 37, 71 Let j be (-3)/3 + (-992 - 4)/(-6). Let k = j - -260. List the prime factors of k. 5, 17 What are the prime factors of (1/5-2)/((-264)/30465600)? 2, 5, 577 Suppose -73s + 209s - 3176714 = 1136798. List the prime factors of s. 7, 23, 197 Suppose 21j - d = 17j + 30473, 3d = 3j - 22866. List the prime factors of j. 3, 2539 Suppose -7l = -11l - 2m + 6046, -4l - 3m = -6039. What are the prime factors of l? 3, 5, 101 Let z = 24 + -13. List the prime factors of 161 - (z/(-5) + (-5)/(-25)). 163 Let v(n) = 58n - 187. Let r = -708 + 739. What are the prime factors of v(r)? 3, 179 What are the prime factors of 30/(-4)(-3448 + 34)? 3, 5, 569 Suppose 26g = 29g - 210. Let a = g - 50. Suppose -a = -4t, -u + 0t + t = -147. What are the prime factors of u? 2, 19 Suppose 0 = 21i - 17i. Suppose i = 4v + k - 256, 3v + 5k + 84 = 293. Suppose -740 = -68l + vl. What are the prime factors of l? 2, 37 Let z = -24 - -24. Suppose z = -f - f + a + 802, 5a + 10 = 0. List the prime factors of f. 2, 5 Let g(j) = -j3 + 17j*2 + 36j + 3. Suppose -8a + 23 = -113. Let l be g(a). Suppose -4c - l = -7c. List the prime factors of c. 5, 41 Suppose -14k - 350 + 420 = 0. Suppose -2s + 2n = -934, -2n + 5n + 1869 = 4s. Suppose kz - s = 247. What are the prime factors of z? 11, 13 Suppose 4t = -44 - 44. Let o = -19 - t. Suppose op = -5x + 285, -p = -0p + 4x - 102. What are the prime factors of p? 2, 3, 5 List the prime factors of (-157)/(((-24)/162)/4). 3, 157 Let b(q) = -6q3 + q2 - 4q + 1. Let c(i) = 7i + 24. Let z be c(-21). Let y = z - -120. List the prime factors of b(y). 2, 23 Let t(o) = -8o + 41. Let f be t(6). What are the prime factors of ((-18)/(-1) - f)29/1? 5, 29 Let j(z) = 4z3 + z - 4. Let v = -54 - -56. Let r = v - -1. What are the prime factors of j(r)? 107 Let t = 102 - 123. Let s(p) = -40p + 38. List the prime factors of s(t). 2, 439 What are the prime factors of (246/(-369))/(2/(-840))? 2, 5, 7 List the prime factors of (-16 + 994/70)-1065. 3, 71 Suppose 5w - 10 = -5. Let k be ((9 - 4) + -13)/(w/(-2)). Let f(j) = -j*2 + 22j - 26. What are the prime factors of f(k)? 2, 5, 7 Let g = 2	{ "pile_set_name": "DM Mathematics" }
6. Calculate x(23). -29 Let l(h) = -2h - 22. Determine l(-8). -6 Let c(g) = -11g + 166. Determine c(15). 1 Let u(l) = 10l2 + 12l + 18. Give u(-4). 130 Let i(p) = -12p + 133. What is i(11)? 1 Let v(z) = -z2 + 16z + 24. Determine v(17). 7 Let x(w) = w*2 + 14w + 37. Give x(-3). 4 Let r(d) = -5d + 1. Determine r(1). -4 Let z(x) = -x2 + x + 6. Determine z(-5). -24 Let k(q) = -5q*2 - 25q - 4. Give k(-4). 16 Let m(o) = -o*2 - 30o + 70. Determine m(-32). 6 Let p(r) = -3r3 + 19r*2 - 17r - 9. Determine p(5). 6 Let c(u) = -u*3 - 4u*2 - 5u - 11. Calculate c(-4). 9 Let q(z) = -z*2 - 26z - 88. Determine q(-22). 0 Let f(q) = 5q - 164. What is f(30)? -14 Let h(m) = -16m + 6. Calculate h(-7). 118 Let x(f) = f*3 - 4f + 4. Determine x(4). 52 Let q(z) = -5z3 - 49z*2 + 12z + 42. What is q(-10)? 22 Let u(m) = 9m + 85. What is u(-19)? -86 Let m(q) = q3 - 7q2 + q - 5. Give m(7). 2 Let r(u) = u3 + u2 + 2. Give r(-2). -2 Let y(l) = l3 - 17l2 - l + 2. Determine y(17). -15 Let h(u) = -4u3 - u2 + 1. Calculate h(1). -4 Let f(r) = 6r2 + 3r + 2. What is f(-4)? 86 Let h(z) = 3z3 + 4z*2 + 15z + 33. Calculate h(-2). -5 Let u(b) = -b*3 - 14b*2 - b - 3. Give u(-14). 11 Let n(o) = 2o*3 - 14o*2 - 18o + 11. Determine n(8). -5 Let l(h) = -h + 6. Calculate l(14). -8 Let i(o) = o*2 - 10o - 9. Give i(11). 2 Let s(n) = 5n + 50. Calculate s(-9). 5 Let u(i) = i3 - 56i*2 - 56i - 61. What is u(57)? -4 Let h(n) = -4n - 14. Give h(-1). -10 Let a(c) = -17c*2 - c - 22. Give a(0). -22 Let y(q) = 2q + 4. Determine y(0). 4 Let z(d) = -d - 12. Calculate z(9). -21 Let i(a) = -a*2 + 6a + 36. Determine i(9). 9 Let q(w) = -16w + 36. Determine q(4). -28 Let t(l) = -l2 + 24l - 26. Give t(23). -3 Let n(m) = -m*3 - 8m*2 - 5m + 6. Calculate n(-5). -44 Let o(x) = 2x - 23. What is o(-5)? -33 Let c(j) = -2j*3 - 4j*2 - 2j + 1. What is c(-1)? 1 Let i(r) = 2r2 + 8r + 16. What is i(-6)? 40 Let c(t) = -t*2 - 6t + 11. Determine c(-9). -16 Let l(z) = -13z2 + 4z - 3. Give l(2). -47 Let g(k) = -7k + 292. Calculate g(41). 5 Let s(d) = 2d*2 + 9d + 26. Calculate s(-3). 17 Let k(h) = -h*2 + 8h - 3. What is k(9)? -12 Let a(b) = -4b2 - 5b - 3. What is a(-3)? -24 Let g(n) = -n*3 - 5n*2 + 22. Give g(-4). 6 Let h(o) = 4o - 87. Give h(26). 17 Let i(x) = x*3 - 18x*2 - 21x + 36. What is i(19)? -2 Let k(f) = 8f + 145. What is k(-18)? 1 Let m(l) = -l2 + 20. Calculate m(-4). 4 Let o(a) = a3 - 12a*2 - 14a + 15. What is o(13)? 2 Let r(x) = 3x - 4. What is r(3)? 5 Let n(v) = -52v + 2. Calculate n(1). -50 Let l(z) = z*3 - 16z*2 - 18z + 41. Give l(17). 24 Let p(q) = 22q2 - q - 1. Give p(-1). 22 Let s(q) = q2 + 5q - 23. Calculate s(-8). 1 Let g(n) = -n*3 - 2n*2 + n + 98. Give g(0). 98 Let o(w) = 44w - 36. Determine o(1). 8 Let g(b) = -3b + 9. Give g(11). -24 Let j(s) = -2s - 13. Determine j(-8). 3 Let y(t) = 2t2 + 15t - 5. Determine y(-7). -12 Let d(x) = x*3 + 6x*2 - 14x. What is d(-8)? -16 Let k(a) = -a*3 + 25a*2 - 3a + 62. Give k(25). -13 Let f(v) = v*2 - 4v + 5. What is f(2)? 1 Let f(c) = 5c2 - 4c - 2. Calculate f(-4). 94 Let i(l) = -l*2 - 9l - 19. Determine i(-11). -41 Let l(p) = 6p + 53. Calculate l(0). 53 Let v(r) = r2 + 26r - 377. Determine v(-36). -17 Let s(d) = 2d2 - 2d - 5. Determine s(4). 19 Let b(o) = -o*2 - 37o - 26. What is b(-35)? 44 Let h(l) = -l*2 + 2l - 5. What is h(4)? -13 Let k(q) = q*3 + 28q*2 + 77q + 57. Determine k(-25). 7 Let v(b) = -4b3 - 2b*2 - b - 4. Give v(-2). 22 Let i(s) = -3s - 1. Calculate i(8). -25 Let x(t) = -t*3 - 9t*2 + 8t - 7. What is x(-10)? 13 Let o(v) = -3v - 18. What is o(-7)? 3 Let r(j) = 10j*2 + 54j + 28. What is r(-5)? 8 Let g(o) = 2o + 71. Determine g(-35). 1 Let n(c) = -c2 - 5c + 8. Calculate n(3). -16 Let n(i) = 2i2 + 70i + 61. Give n(-34). -7 Let i(b) = -4b - 9. Determine i(7). -37 Let y(j) = -6j*2 - j + 2. Determine y(1). -5 Let y(u) = 7u*2 - 2u. Determine y(-2). 32 Let c(q) = q*2 - 9q + 20. Give c(6). 2 Let b(k) = -k*2 + 12k + 29. Give b(0). 29 Let j(x) = -x*2 - 7x - 5. Give j(-5). 5 Let c(q) = q*3 + 8q*2 + 15q + 6. What is c(-3)? 6 Let v(m) = 8m + 8. Give v(0). 8 Let h(r) = -r3 + 23r*2 - 24r + 18. What is h(22)? -26 Let t(j) = -j*3 - 21j*2 - 20j + 12. Give t(-20). 12 Let b(o) = o - 1. Calculate b(-9). -10 Let f(q) = -5q3 - q2 + 1. Give f(1). -5 Let a(z) = -19z + 5. Determine a(6). -109 Let g(d) = -d*3 - 5d*2 - 4d. Calculate g(-4). 0 Let j(z) = -4z2 - z + 1. What is j(1)? -4 Let k(o) = 2o + 20. Calculate k(-15). -10 Let p(x) = 17x. Calculate p(-3). -51 Let v(u) = 4u*2 + 3u - 2. Calculate v(-4). 50 Let b(k) = -41k - 1064. What is b(-26)? 2 Let j(w) = -3w + 24. What is j(7)? 3 Let u(j) = 4j - 15. Calculate u(7). 13 Let l(d) = d - 3. Calculate l(-3). -6 Let s(l) = -l3 - 4l*2 + 5l - 5. Give s(-5). -5 Let w(o) = 5o2 + 147o - 88. Calculate w(-30). 2 Let v(a) = -2a3 + 10a*2 + 6a - 3. Determine v(5). 27 Let r(q) = q*3 - 2q2 + 2. Give r(0). 2 Let u(b) = -b - 11. Give u(-10). -1 Let t(j) = j + 14. Determine t(5). 19 Let w(x) = -x3 - 13x2 - 30x - 26. What is w(-9)? -80 Let n(f) = -6f2 - f. What is n(-1)? -5 Let o(c) = c2 + 27c + 43. Give o(-25). -7 Let d(z) = -5z + 7. What is d(9)? -38 Let u(o) = o + 9. Determine u(-13). -4 Let h(l) = -l2 + 4l + 41. Calculate h(8). 9 Let b(j) = j*3 - 13j*2 + 13j - 15. Give b(12). -3 Let b(f) = 2f2 + f + 10. Determine b(-10). 200 Let w(o) = -o2 - 7o + 3. What is w(-6)? 9 Let v(w) = w*3 - 37w*2 - 46w + 294. Determine v(38). -10 Let f(m) = -m*2 - 8m + 6. What is f(-9)? -3 Let u(l) = 4l + 30. What is u(-11)? -14 Let q(s) = -3s - 6. Calculate q(-6). 12 Let a(l) = 9l2 + 5l - 1. What is a(1)? 13 Let l(a) = -a*3 + 7a*2 + a + 6. What is l(6)? 48 Let m(f) = -2f2 + f - 2. Calculate m(4). -30 Let t(w) = w2 + 16w - 16. Calculate t(-17). 1 Let z(f) = f3 + 3f*2 - 3f - 4. Give z(-4). -8 Let k(f) = -2f - 20. Give k(0). -20 Let l(a) = 7a + 73. Give l(-10). 3 Let a(z) = -z*3 - 5z*2 + 2z + 6. Give a(-4). -18 Let p(k) = 26k2 + k - 2. Calculate p(1). 25 Let x(k) = -2k*3 + 48k*2 - 47k + 24. What is x(23)? 1 Let x(t) = -11t2 + 2t + 7. Give x(-2). -41 Let i(s) = s + 24. Determine i(-14). 10 Let z(p) = 9p2. Calculate z(2). 36 Let p(l) = l3 + 13l*2 - 5l - 66. Calculate p(-13). -1 Let s(z) = -2z - 19. Calculate s(-13). 7 Let d(g) = -g2 - 25g + 14. What is d(-25)? 14 Let w(k) = -5k2 - 9k - 7. Determine w(-3). -25 Let d(w) = -w*2 + 6w - 6. Calculate d(7). -13 Let o(v) = 21v - 2. Give o(-2). -44 Let t(q) = 8q - 6. What is t(3)? 18 Let p(h) = -h*2 - 29h - 172. Give p(-21). -4 Let c(z) = -z*2 - 18z - 42. Calculate c(-10). 38 Let p(r) = 2r - 11. Calculate p(6). 1 Let g(y) = 3y + 2. Calculate g(1). 5 Let r(y) = y*3 - 7y*2 + 4y - 1. Give r(5). -31 Let s(p) = p + 1. Determine s(-3). -2 Let k(j) = -j - 19. Give k(-13). -6 Let o(t) = 73t2 + 1. Calculate o(1). 74 Let i(u) = -2u*2 + 19u + 13. Determine i(10). 3 Let q(t) = -t*2 - 4t - 7. Give q(-8). -39 Let w(b) = b*3 - 5b*2 + 5b - 4. What is w(4)? 0 Let g(m) = 6m - 167. Give g(28). 1 Let c(d) = d - 11. What is c(10)? -1 Let y(s) = s3 + 5s*2 - 4s - 6. Calculate y(-6). -18 Let s(c) = -11c - 11. Determine s(6). -77 Let r(a) = a - 3. Determine r(3). 0 Let d(y) = -2y*2 - 31y - 19. Calculate d(-14). 23 Let b(g) = -8g + 419. Determine b(51). 11 Let t(c) = 46c*3 + 6c*2 + 3c - 2. Calculate t(-1). -45 Let u(p) = -p*3 - 7p*2 - 15p. Calculate u(-5). 25 Let q(f) = -3f2 + 4f. Calculate q(3). -15 Let s(b) = -3b - 65. What is s(-21)? -2 Let h(o) = -o3 - 17o2 + 11. Calculate h(-17). 11 Let z(y) = -y3 + 13y2 + y - 13. What is z(13)? 0 Let y(z) = z2 - z - 1. Determine y(3). 5 Let g(c) = -c3 + 6c*2 + 4c + 9. Determine g(7). -12 Let w(d) = -3d - 24. Determine w(-8). 0 Let s(u) = -u2 - 33u - 31. Calculate s(-32). 1 Let x(a) = -a*2 - 5a + 44. Calculate x(5). -6 Let y(x) = x*2 + 7x - 33. Give y(-10). -3 Let x(i) = -6i2 - 12i - 6. What is x(-2)? -6 Let x(c) = c*2 - 14c + 19. Determine x(12). -5 Let a(t) = -2t2 - 8t - 10. Determin	{ "pile_set_name": "DM Mathematics" }
2. Let p(n) = -496n + 43 + 38 - 121 + 40. Give p(f(j)). 496j2 Let l(k) = -7k*2. Let d(o) = -32o*2 + 12. Let b be (5 - 188/28)/(1/7). Let j(i) = 2i*2 - 1. Let p(g) = bj(g) - d(g). What is l(p(m))? -448m4 Let b(f) = -26f*2 + f - 31850. Let d(w) = 6w. Give d(b(p)). -156p2 + 6p - 191100 Let u(o) = 0o + 6o + 3o - 1 - 3 - o. Let b(w) = -5w*2 + 7w - 7. Let j(m) = -2m2 + 3m - 3. Let q(l) = 3b(l) - 7j(l). What is u(q(f))? -8f2 - 4 Let g(t) = -3t*2. Let v(d) = -99 - 48 - 115 - 16d*2 + 22d*2 + 54. Give g(v(h)). -108h*4 + 7488h2 - 129792 Let y(r) be the second derivative of r3/6 - 1135r. Let s(c) = -c - 23695. Determine y(s(g)). -g - 23695 Let k(v) = 45v + 82v - 132v. Let p(s) = 101s + 64s + 54s - 259s. Calculate p(k(r)). 200r Let d(i) = -9i*2 - 63i + 126. Let k(x) = x - 2. Let f(q) = 5d(q) + 315k(q). Let y(w) = -8823w + 4w*2 + 8823w. Determine f(y(v)). -720v4 Let v(u) = 39240u*2 + 77. Let s(r) = -16r. What is s(v(z))? -627840z2 - 1232 Let v(r) = 8895 + 7r*2 - 17781 + 8888. Let z(j) = 14j. What is z(v(b))? 98b2 + 28 Let x(z) = -2z2. Let v(s) = 19 + s2 - 8s + 17s - 30s + 21s. Calculate x(v(c)). -2c4 - 76c*2 - 722 Let w(x) = 2x*2. Let q(j) = 3j - 1. Let g(s) = 20s - 158. Let p(r) = g(r) - 6q(r). What is w(p(m))? 8m2 - 1216m + 46208 Let a(z) = z*2 - 2z - 3. Let v(i) = 3i2 - 8i - 12. Let j(o) = 4a(o) - v(o). Let u(p) = 6p*2 + 5p. Calculate u(j(d)). 6d4 + 5d*2 Let a(y) = -42y*2. Let g(b) = -248801b*2. What is a(g(v))? -2599881379242v*4 Let f(d) = -5d*2 + 0 + 0. Let k(x) be the third derivative of 4x*4/3 + 7x*2 + 41x. Give f(k(g)). -5120g2 Let c be (-15)/(396/(-196) + 2). Let i(g) = 735 + 4g - c. Let v(o) = -6o2 + 4o*2 + 6o*2 - 2o*2. Give v(i(l)). 32l*2 Let o(d) = 18122d*2. Let z(u) = 3u*2 - 131u. Give z(o(i)). 985220652i4 - 2373982i*2 Let w(x) = 22x*2. Let g(i) = -5i*2 + 7274i - 4. What is g(w(j))? -2420j4 + 160028j*2 - 4 Let g(r) = 236402285r. Let c(f) = 3f2. Determine c(g(u)). 167658121059663675u*2 Let k(q) = -6q*2 + 8q. Let a(o) = 5o - 904. Give a(k(s)). -30s*2 + 40s - 904 Let q(l) = l*2. Let b(m) be the third derivative of -58m*2 + 0m*3 + 0m - 55/12m4 + 0. What is q(b(a))? 12100a*2 Let c(k) = -k. Let g(u) = 117u*2 + 539857. Determine c(g(r)). -117r*2 - 539857 Let p be ((-98)/(-21))/7 + (4 - (-4)/12). Let w(c) be the third derivative of 0c*4 + 0 + 0c*3 + 21c*2 + 7/60c*p + 0c. Let h(y) = 6y. What is w(h(d))? 252d*2 Let z(y) = -8y. Let k(n) = -3118852n2. Determine z(k(j)). 24950816j*2 Let w(v) = -8631v. Let h(k) = 111633358k. Let q(f) = -2h(f) - 25869w(f). Let n(o) = o. Calculate q(n(t)). 8623t Let w(a) = -42a2. Let n(d) = -1911d + 11. Let i(v) = -719v + 4. Let f(b) = 8i(b) - 3n(b). Determine w(f(g)). -15162g*2 - 1596g - 42 Let c(w) = -303w2. Let x(r) = 976r. Calculate c(x(z)). -288630528z2 Let g(u) = -168u2. Let l(r) be the third derivative of r5/20 - r*2 + 247. Calculate g(l(v)). -1512v*4 Let g(v) be the third derivative of -1/60v*5 + 0v*3 + 0v - 248v2 + 0 + 0v*4. Let a(s) = -6s*2. Calculate a(g(c)). -6c*4 Let y(c) = -2c. Let n(t) = -168798t + 57. Determine y(n(u)). 337596u - 114 Let g(o) = -o. Let d(s) = -151337091s2. Give g(d(z)). 151337091z2 Let h(y) = y2. Let q be (-50)/(-6)1/((-2)/6). Let k = 11 + q. Let i(c) = c2. Let u(p) = ki(p) + 6h(p). Let d(t) = -2t*2. Calculate u(d(r)). -32r*4 Let o(g) = -19g*2 - 66g. Let t(r) be the third derivative of -r4/6 + r2 - 18r + 16. Calculate o(t(y)). -304y*2 + 264y Let n be (-3)/(-6)40/4. Let r(v) = 3v*2 - nv*2 + 0v*2. Let h(m) = -11m + 5. Let u(d) = -28d + 12. Let i(c) = 12h(c) - 5u(c). Determine i(r(z)). -16z*2 Let c(u) = 4639u2. Let h(i) be the first derivative of -i2/2 + 5513. What is h(c(o))? -4639o2 Let v(p) be the second derivative of -p + 0p*2 + 0p*3 - 9 - 4/3p4. Let c(m) = m2. Determine c(v(n)). 256n4 Let o(m) be the first derivative of 35m*2 + 5310. Let i(j) = -4j - 4. Calculate i(o(b)). -280b - 4 Let z(v) = -2v*2. Let k be (10 - 324/30)/((-4)/70). Let h(j) = 7j - 2. Let s(n) = -20n + 4. Let x(i) = kh(i) + 5s(i). What is z(x(m))? -8m*2 - 64m - 128 Let r(j) be the third derivative of 29j4/8 + j2. Let q(u) be the third derivative of u4/12 - 37u*2. What is r(q(n))? 174n Let t(u) = 15u - 6. Let p(l) = 43l - 21. Let d(h) = -4p(h) + 14t(h). Let b(q) be the third derivative of q*4/12 - 8q*2. Determine b(d(x)). 76x Let t(d) = -2d. Let y(f) = 452f + 15. Let r(b) = -98085b - 3250. Let i(o) = -3r(o) - 650y(o). Determine t(i(s)). -910s Let x(w) = -w*2. Let c(g) be the second derivative of 139g3/6 + g2 + 2316g. Give x(c(y)). -19321y*2 - 556y - 4 Let n be ((-51)/68)/((-3)/8). Let v(w) = 3w + 1532w*n - 767w*2 - 764w*2 - 3w. Let u(c) be the third derivative of -7c5/15 - c2. Determine u(v(b)). -28b*4 Let l(d) = 192d - 1. Let v(c) = 193c - 1. Let h(z) = l(z) - v(z). Let f(k) = -955k*2. Determine f(h(w)). -955w*2 Let d(j) = -184601j*2 - 646j + 1. Let z(k) = -k. Determine d(z(x)). -184601x2 + 646x + 1 Let h(g) = -g*3 - 9g*2 + 9g - 8. Let b be h(-10). Let f be (0 - 7)/(2/(-4 + b)). Let j(n) = -7n - fn + 14n - 3n. Let z(w) = 6w2. Calculate j(z(p)). -18p*2 Let u(d) = -4d*2. Let r(a) = -30a - 268. Let k be r(-9). Let y(p) = -24p2 + 3 + 0 - 54p*k - 3. Calculate u(y(n)). -24336n*4 Let j(l) = -3l. Let v be (-32)/40 - (-11)/(-5). Let o be (13 - 2)/(3/v + 2). Let u(w) = -18w - 3 + ow + 3. What is u(j(k))? 21k Let s(j) = 6j - 19. Let t(a) be the first derivative of -5a2/2 + 1035. Give s(t(v)). -30v - 19 Let n(g) = -9387g - 70. Let v(k) = 14080k + 98. Let u(f) = 7n(f) + 5v(f). Let i(q) = 3q. Give i(u(j)). 14073j Let x(g) = -g - 5. Let m(j) = 3j2 - j - 5. Let t(u) = -4m(u) + 4x(u). Suppose 0 = -2o - 0o + 4. Let d(l) = -o - 2l + l + 2. What is d(t(i))? 12i2 Let d(b) = 160 - 205 + 45 - 23b*2. Suppose 2r - 2 = -0. Let n(a) = -r + 1 + a*2 + 0. What is n(d(u))? 529u*4 Let k(o) be the first derivative of -573o2/2 + 909. Let f(z) = -z2. Give f(k(i)). -328329i2 Let d(c) = 15c. Let a(t) = 3243200t. Calculate d(a(k)). 48648000k Let k(p) = -p. Let f(l) be the second derivative of l*4/12 - 35l*3/6 - 35l*2/2 - 2737l. Calculate k(f(o)). -o*2 + 35o + 35 Let s(i) = -85416889i. Let k(a) = -a2. What is s(k(v))? 85416889v*2 Let q(w) = 5709539w - 247632. Let p(l) = 4426l - 192. Let s(f) = -5159p(f) + 4q(f). Let y(b) = -2b*2. Calculate y(s(h)). -39108168h*2 Let z(y) = 19y. Let g(h) = -8023672h. Calculate z(g(u)). -152449768u Let k(u) = -2u2. Let a(d) be the first derivative of 9594 - 11d*3 - 9749 - 5d*3. What is k(a(h))? -4608h*4 Let t = -47 - -49. Let u(z) = 30z + 7. Let r be u(8). Let g(i) = -ri + 247i - 7it. Let x(v) = -2v*2. What is x(g(h))? -98h*4 Let h(j) = 72j - 154j2 + 84j + 2200j2 - 154j. Let w(y) = y. What is w(h(r))? 2046r2 + 2r Let v(n) = 121n2. Let m(r) = -9r*2 - 10r + 2. Let o(i) = 28i2 + 35i - 7. Let l(s) = 14m(s) + 4o(s). Determine v(l(p)). 23716p4 Let s = -440 + 442. Suppose -y - y + 16 = 0. Let v(d) = yd + sd - 7d. Let u(p) = 6p2. What is v(u(k))? 18k*2 Let y = 39 + -30. Suppose 2h = -yh + 11. Let w(z) = -h - 13 - 9z*2 + 6z*2. Let q(t) = t. Calculate q(w(m)). -3m2 - 14 Let d(j) = j. Let p(v) be the second derivative of -v3 - 3v2/2 - 5v - 77. Give d(p(x)). -6x - 3 Let n(k) = -8947k*2 + 8948k*2 - 2k + 2k. Let l(s) = -59s - 4. Let f(d) = -60d - 5. Let h(c) = -6f(c) + 7l(c). What is n(h(m))? 2809m*2 - 212m + 4 Let i(o) = -217o - 24304. Let v(c) = -56. Let a(r) = i(r) - 434v(r). Let q(b) = 14b2. Calculate q(a(d)). 659246d*2 Let x(n) = 3101n + 31. Let v(i) = 2i + 121. Calculate v(x(y)). 6202y + 183 Let x(k) = -k. Let i be (-10 + 931)(0 + 3/9). Let u(a) = 69a*2 - ia + 307a. Give u(x(g)). 69g*2 Let p(g) = -896g. Let x(h) = -h*2 - 252217 + 252217. Determine x(p(d)). -802816d*2 Let a(k) = 2k*2. Let u(j) = 2327j*2 + j + 152. What is u(a(o))? 9308o*4 + 2o**2 +	{ "pile_set_name": "DM Mathematics" }
pose 5t - 5 = 0, -38 = -3s + 13t - 15t. Solve 17z - sz = -3p + 13, 0 = -4z + 20 for p. -4 Let t be (2 + 18/(-8))22792/1078-7. Solve 39v - tv + 2 = 2g, -g = 2v + 8 for g. -2 Suppose -3 = -3z + 3. Suppose 3q - 5f - 12 = -1, -zq = -4f - 8. Suppose -368l = -379l + 44. Solve 14 = -4d - qh, 4d + 3 = 5h - l for d. -3 Suppose -5i = -2i - 12. Let f(y) = -12 + 3y - i - 5. Let b be f(8). Solve -w - q = -6q + 16, 3w + 2q = b for w. -1 Let d be ((-129)/9)/((-8)/120). Let n = d - 212. Solve -3z + 3 = -3m, -3z - nm = -1 + 10 for z. -1 Let f(g) = -g3 + 34g*2 - 27g - 155. Let x be f(33). Let q = 46 - x. Solve v + 17 = -5k, 6v - 3v = -qk - 3 for v. 3 Suppose u = w - 7, 19w - 81 = 16w + 18u. Solve -3r - 21 = wx, 31r - 27r + 24 = -3x for r. -3 Suppose -29w + 21w - 288 = 0. Let r be 6 - 4/(w/(-27)). Suppose 0o = 4o. Solve f + 4h = 2f + 7, -3f - rh - 6 = o for f. -3 Let b(x) = -35x3 + 40 + 94x*3 - 34x*2 - 27x*3 - 33x*3 + 73x. Let t be b(-36). Let u = 4 - -1. Solve -ua + 10 + 2 = -3j, -5j + ta = 7 for j. 1 Let h(b) = -b*3 - 11b*2 - 5b + 54. Let v = 595 - 605. Let g be h(v). Let m = -4 - -5. Solve -2p - m = -a + 7, 11 = -p + ga for p. -3 Suppose 53 = 4l - 3. Let d = 33 + -21. Suppose -ly = -20y + d. Solve 3c = yz + 12, 2c - 11 = -3 for z. 0 Let d be ((-2)/4)/((-1)/2(-108)/(-540)). Solve -dl + 2o - 25 = 0, 13l - o + 20 = 8l for l. -3 Let m(q) = q3 + 22q*2 + 39q - 18. Let l be m(-20). Let b be 6/l + (0/2)/7. Solve 1 - b = -p, -5 = -3f - p for f. 1 Let j(x) = 18x - 116. Let h be j(7). Solve 3q - h = 3u - q, -3q = -4u - 4 for u. 2 Let d be ((-9)/6)/(-3) - (-1032)/(-48). Let i be (-10)/35 - (2 - (-258)/d). Solve v = -2j - j - 6, 3v + i = -j for j. -1 Let m be (2 - 0 - -2) + 0. Let c be (-2)/(10/m(-28)/(-245)). Let l be (-4)/c3/(18/21). Solve 2w = w - 3k - 4, -2w - lk = 8 for w. -4 Let o = -773 + 224. Let c = -547 - o. Solve -2x = -4w - 10, -w - c = -x - 0 for w. -3 Let j be 29/5 - 60/75. Solve -4d = -3s - 19, 0s + 3d = -js - 22 for s. -5 Let b(r) = 239r - 953. Let j be b(4). Solve -v + 6 = -5c, -3c + 5 = -jv - 1 for c. -2 Let j be 1023/682 - (2/(-10))/(2/5). Solve 0 = -4u + 5c - 24, 0 = -u - 4c + jc + 7 for u. -1 Let o(m) = -m2 + m + 2. Let i be o(-2). Let z be (-2 - -17) + i + 2 + -2. Suppose -zu + 43 = -12. Solve 2x - 8 = 3c + 3x, 0 = -ux + 20 for c. -4 Let m = -31 - -28. Let h be (64/6)/((-2)/m). Suppose 0 = -3p, -p + h = 4f + 3p. Solve y = fo - y + 14, -2y = -2 for o. -3 Let g(l) = 3l - 19 - 11 - 10. Let q be g(14). Let i = 11 + -9. Solve -m = 2, -qh - m - 8 = im for h. -1 Suppose t + 782 = z + 2z, 5t - 752 = -3z. Let u = 263 - z. Solve -4i = -w, -2w + u = 2i - 6i for w. 4 Suppose -5i + 485 = 475. Suppose -4s + ih = -2, 3h + 4 = 2s + 1. Solve -6 = -4v + v + 5l, s = 3v - 4l - 6 for v. 2 Let m(q) be the third derivative of q*5/60 + 17q*4/24 - 3q*3/2 + 113q*2. Let t be m(-18). Solve o - 1 = 3r - 2r, -3o + t = 0 for r. 2 Let g = -210 - -122. Let y = g - -92. Solve -4t = -ym - m + 6, 2t = m for m. 2 Let n(q) = q2 - 29q + 33. Let b be n(28). Solve bc + 11 = 5z + 31, 5z + 5c = 0 for z. -2 Let h(p) = p*2 - 17p + 187. Let q be h(7). Let d = q + -115. Solve -2m = -o, -3o + do - 3m + 10 = 0 for o. 4 Suppose 2n + 15 = 5n. Let c(r) = -3r3 + r2 + 3r + 1. Let u be c(-2). Suppose -nv + u = -12. Solve 0 = p - 4, 3z = 3p - 2 - v for z. 1 Suppose 7k - 2k = 20. Let p(l) = l - 47. Let a be p(-6). Let q = a - -57. Solve -k = -5f + 4v, -v - 8 = f - qv for f. 4 Let d = -75 - -73. Let o be (2 - ((2 - d) + -2))/(-2). Suppose 3l - v - 16 = 0, 5l + 5v + 8 - 28 = o. Solve 2 = -3c - 1, 5g - lc = 30 for g. 5 Suppose 5o = c - 56, 5c + 2o - 253 = -216. Solve -5t = 3w - 21, -ct + 6t = -15 for w. 2 Suppose -5a + 0a + 10 = 0. Let b be -2(85/15)/(2/3). Let l = b + 43. Solve -4z = -9z + aq + l, q = -4z + 13 for z. 4 Let n(z) = z*2 + 4. Let h be n(-5). Suppose 3d = -12, -f - 3d + h = -8d. Let x be 88/(-55)(-20)/8. Solve -y = -4w - f, -xy - 9 = -w - 0 for y. -3 Let y be 1005(12/5)/6. Suppose -7m + 13m + y = 0. Let n = -64 - m. Solve s - ns - 4i = -14, -4i = -4 for s. 5 Let s = 151 + -91. Let k = s - 58. Let l(v) = -v + 1. Let w be l(-1). Solve -5r + 3c - 17 = 0, -wc - kc - 12 = 2r for r. -4 Suppose 1515 + 637 = -8b. Let p = b + 274. Solve 0 = -z + 3s - 6s - 3, 4s + 4 = -pz for z. 0 Let n(h) = 19h + 86. Let z(p) = 39p + 171. Let w(s) = 9n(s) - 4z(s). Let v be w(-6). Solve -f + 2j - 5j - 14 = 0, v = -4f + 2j - 14 for f. -5 Suppose 0 = 3d + 4r - 36, -3d + 226 = -r + 175. Let b = 4 - 5. Let x = b - -3. Solve -4f + n - d = -xn, -2n = -f - 9 for f. -1 Let v be (-11)/((-22)/(-8)) + 2. Let a be (-3)/(-18)v(-13 - 5). Solve 2w = -k, -4w + 2w = 4k + a for w. 1 Let c(q) = -36q2 + q3 + 20 + 77q2 - 36q*2. Let d be c(-5). Suppose -33x - d = -37x. Solve 6 + 9 = u - 4v, -5v - 15 = -xu for u. -1 Let m = -33867 - -33888. Solve -t - 159 = -o - 156, -5t = o + m for o. -1 Suppose 0 = -2q - 2q, -2j + 6 = -2q. Let u be (-7 - j)3/(-6). Suppose 4 = -4v - 4, 10 = up - 5v. Solve -5m + 7 = -2z - 2m, p = 4z - 3m - 1 for z. 4 Suppose 0 = -a + 4a - 96. Suppose c + a = 3l, 0 = 2c - 4c + 2. Let w be l + -15 + (-4)/(-1). Solve 0 = -4u + 5g - wg - 21, 6 = -u + 2g for u. -4 Let g = -28 - -54. Suppose -29k + 6 = -gk. Let a = -12 - -15. Solve -aj = -kr - 17, 3j - 25 = 5r - j for r. -1 Let o = 90 - 74. Suppose 0 = 21l - ol - 35. Let d = 12 - l. Solve 3m + 3 = 3c, 3c + dm = 2m + 9 for c. 2 Suppose -3w + 4w = 10. Suppose 0 = wv - 9v - 2. Let c = -675 + 679. Solve -5 = b - vm + cm, 4b + 5 = -5m for b. 5 Suppose 0 = 4t - r - 17, -11r + 5r - 30 = 0. Solve -5s - tq - 4 = -0, -2 = -q for s. -2 Let p be (-1168)/(-84) - 2/(-21). Suppose -4j - p = z, -4z + 7 = 3j - 2. Solve g + z = 5n, -4g - 4n = g - 28 for g. 4 Suppose 58g = 90g - 224. Solve -g = 12n - 10n + 5t, 0 = 3t + 9 for n. 4 Suppose -3m + 2b = -4, -3m + 0m - 5b = -11. Solve 2t - p - 6 = -0, 3p = -mt + 22 for t. 5 Let c(z) = 3 - 2z2 + 12z - 20 - 28 + 3z2 + 37z. Let f be c(-50). Solve -ft + 5l - 4l = 17, 4t + 14 = l for t. -3 Let t be -2 + (18 - -2) + 4. Let h = t - 20. Suppose 0 = 4n, 5s - hn = s + 68. Solve -2 = 2f - 2g, f + 5g = -0g + s for f. 2 Suppose -3i - 3w - 1 = -2i, -5i + 5w - 65 = 0. Let h be i/5 + 10/2. Let a = 463 + -463. Solve 0 = u - 3c, a = u + hc - 0c for u. 0 Suppose -2s + n - 7 - 13 = 0, -n = -3s - 30. Let z = s - -15. Suppose 0l - 2l + 4d + 48 = 0, l - 5d = 33. Solve l - 3 = zk + 5p, k = 5p - 15 for k. 0 Let k = 56 - 23. Suppose -ks - 4 = -35s. Solve 3a = 3q + s - 5, 0 = 3a + 3q - 27 for a. 4 Let u be 4/(-11 + 21/637). Let i(c) = -c - 1. Let f be i(-10). Solve -2k + uq = -7k - 24, -5q = -2k + f for k. -3 Suppose -4n = 32a - 33a - 7, -n + 3a - 1 = 0. Solve -17i + 18 = 2v - 18i, 5v = ni + 41 for v. 5 Suppose 3q + 2q + 20 = -2n, 20 = 3n - 5q. Solve -3b - 3y + 0y + 15 = n, -4 = -2b + 4y for b. 4 Let n(q) = -4q2 - 46q + 34. Let c be n(-12). Suppose -9a + 37 = c. Solve -10m + 8m + ah = -19, m = -3h - 13 for m. 2 Let c be ((-6)/(-4))/(15/30). Suppose cx + 2x = 2x. Solve xq + 4d + 23 = 3q, 2d + 24 = 4q for q. 5 Let g(x) = x*3 + 9x*2 - 11x - 2. Suppose -v = 2v + 30. Let n be g(v). Solve -8k - 23 = -p - 4k, 4k + n = -4p for p. 3 Let f = 3420 - 3415. Let t be ((-3)/(-2))/(9/18). Solve -4a + f = 3d, 3d - a = -t - 2 for d. -1 Suppose 5y - 50 = -5r, -3r + y + 54 = -4y. Let n be 2/(-8) - (1906/(-8) - -3). Let o = 247 - n. Solve 4b - o = -4x, 4x = 3x - 3b + r for x. -2 Let o be (-418)/(-28) - -68/672. Solve 5c = -o, -2c - 102 = 5p - 106 for p. 2 Suppose -53 = -2m + 6l - l, 2m = l + 49. Suppose 0 = -mo + 16o + 16. Solve -v - 8 = -4r, 0 = -2v - 0r - or + 4 for v. 0 Let s(d) = -d*2 - 26d - 120. Let a be s(-8). Let p be (-1)/(30/a)(-15)/6. Solve j - pz = z + 16, 0 = 2j + 3z + 13 for j. 1 Let l(q) = -q*2 + 8q + 9. Let n be l(9). Suppose -12i + 9 = -3. Let x = 37 - 11. Solve n = 5m + 2*d + x, -2 = d + i for m. -4 Suppose a + 5 = -	{ "pile_set_name": "DM Mathematics" }
0 Let v(j) = -3j3 - 3j*2 + 12j + 73. What is the units digit of v(-9)? 9 Suppose 2f + 121 = i, 18 + 40 = -f + 3i. Let h(r) = 90r + 1. Let k be h(1). Let d = f + k. What is the units digit of d? 0 Let y(m) = m3 + 6m*2 + 5m + 5. Let l be y(-5). Suppose -4 = -lo + 4o. What is the units digit of o? 4 Let b(k) = 3k2 - 12k - 21. Let f be 3/(-9) - 84/(-9). What is the units digit of b(f)? 4 Suppose -f + 2j = j - 47, 4f + 4j = 148. Let n(i) = 5i + 6. Let u be n(-6). Let m = u + f. What is the tens digit of m? 1 Let h be (-5)/(-25) + (-1)/5. Suppose -368 = -4k - 2w, 143 = 3k - 4w - 144. Suppose h = 3j - k + 24. What is the units digit of j? 3 What is the hundreds digit of ((-7 + -3211)1)/(0 - 2)? 6 Let c(b) = -b*3 + 3b*2 + b + 8. Let f be c(4). Let t be f(21/(-6) + -2). Suppose 3v - 17 - t = 0. What is the tens digit of v? 1 Let y(s) = 3s - 2. Let z be y(2). What is the tens digit of 3/(3/z) + 43? 4 Suppose 3k + 4900 + 3286 = 2m, 0 = -5m - 2k + 20465. What is the units digit of m? 3 Let w be (-4)/(-18) + (-346)/18. Let f = w + 63. Suppose -7p + 5p + f = 0. What is the tens digit of p? 2 Suppose -62141 = 33t - 225095. What is the units digit of t? 8 Let a(r) = -16 + 7 + 5 + 3r. Let t be a(-6). Let u = t - -30. What is the units digit of u? 8 Let n(g) = 135g + 36. What is the units digit of n(2)? 6 Suppose -13d + 6770 = -19646. What is the tens digit of d? 3 What is the units digit of (12/(-14))/((-99)/924)? 8 Let z(t) = -t*3 + 7t*2 - 4t + 1. Suppose 3 = -o - 2o. Let y be 32/(o - -5) + -3. What is the tens digit of z(y)? 3 Let g(h) be the third derivative of -95h4/12 - h3/3 + 32h2. What is the tens digit of g(-1)? 8 Suppose -3t + 17 = 2p - 22, -4t = 4p - 56. Suppose ty = 1524 - 391. What is the tens digit of y? 0 What is the thousands digit of (-18670)/(-13) - (-214)/(-1391)? 1 Let r(l) = 3l2 + 18l + 26. What is the hundreds digit of r(12)? 6 Suppose -g - g = -84. Suppose 44 + g = b. What is the tens digit of b? 8 Suppose 3q - 3613 = -5k, -2k - 3611 = -7k - q. What is the units digit of k? 2 Suppose 107 - 2105 = -2q + 2f, 3q - 2987 = -2f. What is the hundreds digit of q? 9 What is the units digit of (-374)/(-2) - (22 - 25)? 0 Let c(f) = f + 59. What is the tens digit of c(0)? 5 Let y be 3 + (-6)/(-18) + (-4)/(-6). Suppose yl - 118 - 42 = 0. What is the tens digit of l? 4 Let g = 188 + -99. Suppose -b = -o - 6b + g, -3o - 2b = -280. What is the units digit of o? 4 Let v(z) = -4z - 6. Let a(t) = -1. Let k(s) = -4a(s) + 2v(s). What is the tens digit of k(-3)? 1 Let l = 19 - 16. Suppose 4o + 48 = ls, 8o - 15 = 3o. What is the tens digit of (3 + (-68)/s)-65? 2 Let u be -22 - (15 - 120). Suppose 5s - 22 = 3i + u, -i + 4 = 0. What is the units digit of s? 7 Let w(c) = -c + 1. Let a(x) = -6x - 4. Let o(t) = 3a(t) + 3w(t). What is the tens digit of o(-5)? 9 Suppose 1166 = 3x + 7a - 5a, -x + 2a + 402 = 0. What is the hundreds digit of x? 3 Let b = -650 + 995. What is the hundreds digit of b? 3 Suppose 131j = 133j - 2, n + 4j - 3272 = 0. What is the tens digit of n? 6 Suppose -77b = -63b - 23240. What is the thousands digit of b? 1 Let w = 169 + 671. Suppose 0 = -11x + 3x + w. What is the tens digit of x? 0 Suppose -15b + 32 = b. What is the units digit of b? 2 Suppose 4h - 3 = 3h. Suppose -157 = -hr - 4g, r + 2g = -0r + 53. What is the tens digit of r? 5 Let m be 2/5(-5 + 0). Let s(l) = -5l*2 + l + 2. Let n(a) = 4a*2 - a - 2. Let q(u) = -6n(u) - 5s(u). What is the units digit of q(m)? 4 Suppose 4t - 1485 = 275. What is the hundreds digit of t? 4 Let j be 5/((-15)/(-36)) - 3. Suppose -js + 5 + 13 = 0. Suppose sb - b + 2p = 52, -4b + 252 = -3p. What is the tens digit of b? 6 Let b be ((-2)/(2 - 0))/(-1). Let i be (-11 - 1) + (2 - b). Let p = 4 - i. What is the units digit of p? 5 Suppose -9r = -0r - 288. Suppose 0 = -14m + 354 - r. What is the tens digit of m? 2 Let i(k) = -k*3 + 16k*2 + k - 18. Let u be i(16). Let c(j) = -38j - 10. What is the units digit of c(u)? 6 Let a be 1 + 2 + 2 + -1. Suppose 0 = -3t + w + 5, -at - 7 = -6t - 3w. What is the units digit of t? 2 Let y(d) = -23d3 - d2 - 2d - 1. Suppose 2 - 8 = 3c. Let h = -3 - c. What is the tens digit of y(h)? 2 Suppose -f - 48 = -2c, 4c + 2f - 5f - 96 = 0. Suppose 5h + 0h = 255. Let g = h - c. What is the units digit of g? 7 Let c(d) = 2727d*2 + 2d - 2. What is the units digit of c(1)? 7 Let v = 822 - 392. What is the units digit of v? 0 Suppose 4x + 5b + 1 = 6b, b - 1 = 3x. Suppose -y + 5 = -xy. Suppose t - yt = -96. What is the units digit of t? 4 Let z = -32 + 101. Let v = z - 46. Suppose -l + 0l + f + v = 0, 50 = 2l + 2f. What is the units digit of l? 4 Let m(w) = 3w2 - 2 - w + w3 + 0 + 4w2 + 0w*3. Let y be m(-7). Suppose yf + c - 299 = 0, -3f + c + 181 = 2c. What is the units digit of f? 9 Let q(o) = -o*2 + 10o + 3. Let h be q(9). Let g = h + 13. What is the units digit of g? 5 Let g = 48 + -43. Let y be 4 - 03/9. Suppose 0 = yq - 115 - g. What is the units digit of q? 0 Suppose 35242 + 22388 = 34y. What is the units digit of y? 5 Let h be -3 - (-1)/(2/14). Let y = h + -8. What is the tens digit of (272/6)/y-3? 3 Suppose 15 = l + 4l, -2 = -b + l. Suppose 14 - 39 = -bk. Suppose 0 = -5d - 4w + 43 + 330, 0 = -3d + kw + 246. What is the tens digit of d? 7 Let g = 60 + -56. What is the tens digit of 16/(-6)(g + (-21 - -2))? 4 Let d be 0(7/6 - 3/2). Suppose -2b + 564 = -db + 3l, 0 = -4b - l + 1128. What is the hundreds digit of b? 2 Let r be (-681 - 1)/(-1) + 2. Suppose 5p = 11p - r. What is the units digit of p? 4 Let t = 670 - 943. What is the tens digit of (-2)/(16/t)? 9 Suppose 6h - 2h = -36. Suppose 4v = 6v + 6. What is the units digit of 53 - (v + (-3 - h))? 0 Let u(c) = 122c - 855. What is the tens digit of u(28)? 6 Let j(l) = -46l + 627. What is the thousands digit of j(-39)? 2 Let j(u) = u3 - 6u*2 + 50u - 1. What is the hundreds digit of j(7)? 3 Let r(j) = j + 9. Let n = 13 + -6. Suppose -3u + 2b + n = -24, 2b + 20 = 2u. What is the tens digit of r(u)? 2 Let f = 4783 + -2695. What is the thousands digit of f? 2 Let d(a) = -3a3 + 3a*2 + 8a + 4. What is the tens digit of d(-4)? 1 Suppose 0 = -x - 27 + 67. Let s = x + 4. What is the tens digit of s? 4 Suppose -5s + 35 = -3j, 53 = -4j + 5s + 13. Let g = 45 - j. Let q = g - 25. What is the tens digit of q? 2 Suppose -17s + 14s = -45. What is the tens digit of s2/4(29 - 21)? 6 Suppose -6l = 5q - l - 45, 0 = q + 3l - 17. Let t be ((-66)/q)/(4/(-10)). Suppose 2w - t - 11 = 0. What is the units digit of w? 2 Let j = 4044 + -1993. What is the tens digit of j? 5 Suppose -14t + 1939 = -1449. Suppose 4k - 650 + t = 0. What is the hundreds digit of k? 1 Let b(m) = 220m - 5. What is the hundreds digit of b(1)? 2 Let c(i) = -i + 1. Let r be c(-10). Let w = r - -8. What is the units digit of w? 9 Suppose 4 - 20 = -4p. Let m be (-21)/(-14) + 6/p. Suppose 3l + q - m - 100 = 0, -3q + 105 = 3l. What is the tens digit of l? 3 Let v(n) = -n + 193. Suppose 3x = -2k - 8, x - 4k + k = 12. What is the hundreds digit of v(x)? 1 Let x(d) = 5d2 - 3d + 1. What is the units digit of x(-6)? 9 Suppose -16t + 8196 + 20268 = 0. What is the units digit of t? 9 Suppose 2a = 3i, 0 = -2a + 2i - 2 + 4. Suppose -4q + 388 = -ah, 9q = 4q + h + 485. What is the units digit of q? 7 Let k(m) = -3m. Let i be k(-1). Suppose -if + 72 = -2f. Suppose 56 = d + 3d - 2l, -2l + f = 4d. What is the tens digit of d? 1 What is the units digit of 1 - -9 - 6 - (-5108)/4? 1 Suppose 50 = -4v + 10. What is the units digit of 1/v-294 + (-2)/5? 9 Let k(z) be the second derivative of z*3/6 + 14z. Let v be k(3). Suppose -w + 3x + 54 = -x, 0 = -vw - 5x + 162. What is the tens digit of w? 5 Let x = 118 - 201. Let n = x + 107. What is the units digit of n? 4 Let d(q) = 4q + 11. Let r be d(-6). Let c(k) = k*3 + 15k*2 + 14k - 15. What is the tens digit of c(r)? 4 Suppose -4p + 52 = 5y - 4, -4p = -2y. Let o(q) = q*3 - 7q*2 - 8q + 7. Let m be o(y). Let n = m - 6. What is the units digit of n? 1 Let o(j) = 7j2 - 4j - 11. Let q be o(-2). Suppose	{ "pile_set_name": "DM Mathematics" }
o = 1 + 8. Solve -4w + z = -7, r = 3z + o - 24 for w. 3 Let y be -1 + 4 + 0/(-2). Suppose -u + 6 - y = 0. Solve o + 3o = -q - 15, -2o - 5 = uq for q. 1 Let v = 7 - 7. Suppose 3p - 2s = 4p - 12, 5p - 2s = v. Solve -6 = 4g - 2o, -po = 5g - 4o + 6 for g. 0 Let z(a) be the second derivative of 0 - 1/2a*2 + 2a + 1/6a3. Let n be z(5). Solve 0 = -f, -2f - n = -4m + 2f for m. 1 Let n be 290/(-232)(-3 + (-2 - -1)). Solve h - nd = -4, -h + 0d + 4d = 3 for h. 1 Let p = -8 + 5. Let b be p1 + -11 + 14. Solve 2s + 5f - 29 = b, 0 = 4s - f - 3 for s. 2 Let r be 6/44/3. Suppose 37 = -o + 4o + 4x, 0 = -3o + rx + 31. Let u(a) = a + 1. Let t be u(2). Solve ts + 7 = -3q - 8, 0 = -4q + 5s - o for q. -4 Let k be (-2)/424/(-4). Solve 0 = -2d + 3v + 9, -4d = -kd - 2v - 5 for d. 3 Let k(j) = j - 10. Let l be k(5). Let r be (4/(-10))/(l/25). Suppose -z + 1 + 1 = 0. Solve 4y + 4 = -v, -rv + y = -zy + 8 for v. -4 Suppose -3g + 3 = -27. Solve -c - 3h = -g, c - 2h + 2 + 3 = 0 for c. 1 Let b be (-1)/(86/(-84) - -1). Suppose y - b = -2y. Solve 3u - y = -5v, -3v + 8 = -4u - 12 for u. -2 Suppose 1 = -b - 3w, 0 = -3b - 2b - 5w - 5. Let d be (-1)/(b - 12/(-15)). Solve -s + 11 = -dn - 2, 4s = -5n + 2 for n. -2 Let y = -4 - -9. Solve 7 = -a + yk - 17, -16 = -4k for a. -4 Let x = 53 + -37. Solve 5l + 3y + y + x = 0, -12 = 3y for l. 0 Let c(m) = -m + 1. Let r be c(-4). Suppose -3j - p + 2 = 0, -2p + p = -2j + 3. Let g = 5 - j. Solve 5k - gf = -2f, 0 = 5k - rf for k. 0 Suppose -3d - 2k + 20 = 4, -4k + 18 = -d. Suppose dj = 19 - 3. Solve 2z = 0, 2 = 2q + 2z - j for q. 5 Let d(c) = -3c - 1. Let h(o) = 8o + 2. Let q(s) = 17d(s) + 6h(s). Let l be q(-5). Let t = l - 7. Solve 0 = p + ty + 5, -3p + y = 2 + 3 for p. -2 Let g be 2/(-3) + (-17)/(-3). Let u be (-3)/g(-1 - 4). Solve -3o - 5 = 5s, 4s + 0s + o = u for s. 2 Suppose 5 = 3d - 25. Suppose d - 34 = -4h. Suppose 3f - 9 - h = 0. Solve -4c - q = 3, -fc + 5q - 8 = 2 for c. -1 Let u(t) = t + 2. Let v be u(4). Let y be (3/v)/((-1)/(-8)). Solve 5n + 27 = yd, -5n - 4d = 5 - 2 for n. -3 Let j be ((-12)/(-8))/(6/16). Solve -2c - 3t = 10, jt = -4c + 8t for c. -2 Suppose 27 = -21v + 30v. Let n = 11 + 1. Suppose 0 = -2s - 2s + n. Solve -2h + sh - 16 = -4x, -vx - 3h + 12 = 0 for x. 4 Suppose -3a = 4u - 54, 0a + 2a + 5u = 43. Solve a = 4t + n, -n = t - 6t + 13 for t. 3 Let p(d) = d3 + d2 + d. Let i(o) = -6o*3 - 10o + 2. Let h(v) = -i(v) - 5p(v). Let z be h(4). Solve 4u + 2k = -26, zk = -u - 13 - 1 for u. -4 Suppose -10 = -s - 4s. Suppose -sx - x = -18. Solve -b = -5k - xb, -2k - 2 = 3b for k. 2 Suppose 2 - 8 = -2z. Let c(a) = -2 - a + 5 + 1. Let h be c(4). Solve 4q = 2u - 12, 4q + h = -zu - 12 for q. -3 Suppose 0m + 3m + 18 = 0. Let z(q) = q3 + 5q*2 - 7q + 4. Let i be z(m). Solve -i = p + 3s, 3s = 3p - 0s - 30 for p. 5 Let z = 23 - 14. Let n = z + -7. Let w(o) = o*3 + 4o*2 + 4o + 4. Let c be w(-3). Solve 0l = -3m - 2l - c, nm = 4l - 6 for m. -1 Suppose 0 = -3f + 3a + 198, 0a + 2a - 2 = 0. Suppose 4k + 3 - f = 0. Solve -4t = -k, -2r - 2t = 6 - 22 for r. 4 Let c(r) be the second derivative of r5/5 + r4/6 - r3/3 + r2/2 + r. Let v be c(1). Solve -2g - 8 = -3a - 0g, g + 18 = va for a. 4 Let n be (4/10)/((-1)/(-5)). Solve -5d + 2 = -2i, -nd - i + 0i = -8 for d. 2 Suppose 4q = 4, -i = -0q + q - 3. Solve a = -2d - 12, -4a = id - 4d - 2 for a. -2 Suppose -7 = -5r + 18. Let m = r - 1. Solve 2k + 2k + mi = 4, 5k = 3i + 13 for k. 2 Suppose -x + 4b = 14, 4x + b + 20 = -2. Let o = -3 - x. Solve 5s + 2 = -3w, 5w + 2s = -0s + o for w. 1 Let i be 4 + ((-9)/(-3))/1. Suppose 4q + 16 = 4k, -ik + 2k = 5q - 20. Solve 0 = kl - 0h + 3h - 1, h + 4 = 3l for l. 1 Let r = 6 + 2. Solve 5u - 30 = ry - 3y, -4y - 14 = u for y. -4 Let s be (-25)/(-10) - ((-2)/4 - -1). Solve 0 = -3u, 3o + 15 = -0o + su for o. -5 Let s be ((-16)/(-3))/((-20)/(-30)). Solve -5p + s = h + 2h, -p = h for h. -4 Let u = -3 - -5. Solve q - 12 = -3q, 5 = h + uq for h. -1 Let u be (-8)/(-10) + 60/(-75). Solve -15 = -5a - c, 3a + uc - 4c - 9 = 0 for a. 3 Let j = 0 + 1. Let l be (6/(-4) + j)-42. Suppose -3p = 9 - l. Solve 0 = -5t - 15, -37 = 5d + pt for d. -5 Let q = 1 + 1. Suppose qs = -8 + 12. Solve 7 + s = -4x - y, 5y = x + 18 for x. -3 Let n be (-3)/6-4 - -50. Let m be (n/(-4) + 1)/(-2). Solve -5v - 2 = -4c - m, v - 24 = -5c for v. 4 Suppose 4h - 6 - 26 = 0. Let f be (21/14)/(3/h). Let a = 2 - -2. Solve -fm = -2i - 12, -4i - 3 = -3m - a for m. 5 Suppose 3h + 3x - 54 = -0h, 4h - x = 47. Solve 0 = -4a + 2r - 8, -3a - 2r + 7r = h for a. -1 Let v(y) = 3y - 1. Suppose -12q + 8 = -8q. Let r be v(q). Solve 19 = 2c + 3c - 3k, 29 = rc + 2k for c. 5 Suppose 1 + 1 = y. Let o be (-1)/(y/4) - -10. Let l = -3 + o. Solve 0 = -2r - 0r + 2d - 6, -2d = -lr for r. 2 Let y(v) = 3v - 2. Let q be y(2). Suppose -5s + q + 6 = 0. Suppose -sa + a = -4. Solve -f = 0, aj = -6f + 3f + 4 for j. 1 Let b be (2 - 3) + (3 - 0). Solve 2u - by = 12, 7 + 1 = -4u - 4y for u. 2 Suppose -2l + 5l = 4r - 108, l - 4r + 28 = 0. Let i be 44/10 + 16/l. Solve 4v - 24 = -ia + 6a, -2a - 2v = -6 for a. -2 Let r = -28 + 20. Let t = -3 - r. Let w be ((-3)/t)/((-1)/5). Solve -2c - 5i + 1 = c, 0 = -wi - 3 for c. 2 Suppose -l = 4l. Solve 4q - 2t + 10 = l, -4t + 2t = -2q for q. -5 Suppose 0 = 2j - 10, 3n = 3j - 4 + 1. Let x be (0 - 0)/(5 - 3). Solve 3g + 15 = -v, -nv - 3g = -xg + 24 for v. -3 Let b = 9 + 2. Let d = -7 + b. Solve 2s + 4q + 16 = 0, -ds - 25 = 3q - 8 for s. -2 Let x be (-2)/4 + 13/2. Suppose -3r = -xr + 57. Let w be (-4 - 5)1/(-3). Solve -4u = 5v + r, 3v + wu - 4u + 8 = 0 for v. -3 Let o = -26 + 28. Solve -5j - y = 7, oj - 3y + 2y = 0 for j. -1 Suppose -5k + 0k - i + 4 = 0, -2i = 3k - 8. Let d be -5 - (k - 2) - -1. Let q be (9/6 + -2)d. Solve g = 3x + q, -3x - x = 0 for g. 1 Let z = 12 + -7. Suppose 4x + x + 5 = 0, -3x + 362 = zr. Suppose 5v + 28 = r. Solve -3d + d + 5 = -3i, 5i + d = v for i. 1 Let v be -2 - (-2 + 2 + 1). Let k(i) = i3 + 4i*2 + 4i + 4. Let n be k(v). Let a = n - -2. Solve -8d = 3y - 3d + 11, -3d + a = -3y for y. -2 Let n(r) = -r3 + r. Let v be n(1). Let o be -21 + 8 + v. Let s be (-20)/o12/(-10). Solve -2j + 2q = -sj + 2, -2j - 4 = 4q for j. 4 Suppose 4v - 3u = 2, -v + 4v - 8 = -u. Solve f - vb = 8, 2f + 0b = 2b + 8 for f. 0 Let s(h) = 4h*2 + h + 1. Let d be s(-1). Suppose du - 3q - 2q = 25, -u + q = -6. Solve 0 = -3f - j - 13, -uf - 4j = 31 for f. -3 Suppose 16 + 9 = -5f + b, f - 4b = -24. Let p be 6 - 2/f0. Let y be (6/(-2))/1 + p. Solve 2x = 3i - 11, 4i = -x + yx + 12 for i. 1 Let b = 7 + -5. Suppose -8 = -c - b. Solve -j - 22 = -ca + 2a, 3a + 2j - 11 = 0 for a. 5 Let b(h) = 2h - h + h - 2 + 3. Let m be b(1). Solve 3t + t - w + m = 0, 28 = -4t - 4w for t. -2 Suppose 0 = 111j - 112j. Solve j = 5z + n - 2n + 26, -n = z + 4 for z. -5 Let m be (1 - -1)/(2/15). Let z = m - 12. Solve 9 = -2p - 0p - 3f, -5p - f - z = 0 for p. 0 Let s = 4 + -2. Solve -3b + 0v = v + 7, sb - 2v = -10 for b. -3 Let c(b) = b*2 - 1. Let o(p) = 2p*2 + 6p - 1. Let d(t) = -3c(t) + o(t). Let r be d(6). Solve 5y + r = -5i - 3, 4i - 3y = 17 for i. 2 Let l be 2(7/2 + -3). Let t be ((-3)/(-2))/(l/2). Solve 0 = tn, -4n = g - 4 - 1 for g. 5 Let w = -4 + 9. Let g be (-14 - -2)3/(-9). Solve -4m - h + 7 = gh, 0 = -m + h - w for m. -2 Let s be (0 - -6) + 2-1. Suppose -4c - 5a + 12 = -16, 0 = sc - a - 4. Let m = -43 + 63. Solve -2r = 3q + cq + 8, -5q + m = -5r for q. 0 Suppose -4 = -2f - 4g, 2f + 1 = 2g - 1. Suppose -p - 1 = -2z - 2p, 5z = 3p + 8. Let m = 6 - z. Solve -mc - 2y = -28, fy - 4 = -3c + 2y for c. 4 Suppose -2 = -3z + 4j - 22, -15 = 5z - 3j. Suppose z = 4y - 0y. Suppose -q = -yq. Solve q = -5p + 5r + 5, 5p - 2r + 4 = 0 for p. -2 Let x = -81 + 85. Solve -xq - 20 = 0, 5q + 15 = -3u - 10 for u. 0 Let h = -7 + 12. Suppose a + 11 = p, 4p - h - 7 = 0. Let w be 2/a - (-51)/12. Solve 0q + 5q = -4z - 17, -5q - 33 = -w	{ "pile_set_name": "DM Mathematics" }
1.2 12 * -205.1762 -2462.1144 38954 times 153 5959962 Product of 3970.4 and -0.25. -992.6 0.981 * 15059 14772.879 11.501737 425.5629 -1 times 73355.4 -73355.4 97.0731-1.71 -165.995001 -3 times 0.1888823 -0.5666469 What is -0.51 times -29863.2? 15230.232 -1093588134 -146540792 3860-32160 -124137600 -93496 * -139.9 13080090.4 What is -13 times 1729064.3? -22477835.9 Work out 15 * -658.4638. -9876.957 426296136 57976256 Multiply 238375801 and -1. -238375801 What is the product of 1 and 28692527? 28692527 What is the product of -0.3 and -11593224? 3477967.2 Product of 18334410 and 0.07. 1283408.7 What is the product of -352.758107 and -0.2? 70.5516214 -1.1668-2651 3093.1868 Calculate 3014.2324. 976600.8 Work out -0.04 -5805.878. 232.23512 882.5 times -7359 -6494317.5 Multiply -1.16493 and -0.0429. 0.049975497 Product of -103 and -114.141. 11756.523 What is the product of 0.02 and 950.25109? 19.0050218 What is 0.12 times 1014657? 121758.84 What is 5717 times 113.55? 649165.35 Multiply -41 and 5719996. -234519836 -276490 times -177 48938730 Work out 0.066035 * -22. -1.45277 Product of 166.35 and -0.1342. -22.32417 1199964-39.1 -46918592.4 0.190.8493 9.08493 -135.77-0.01076 1.4608852 Multiply 1 and -2275501.78. -2275501.78 Work out -12705718 0.1. -1270571.8 Multiply -9.94 and 6692. -66518.48 What is the product of 2777 and -41162? -114306874 Multiply 4400 and -0.01418. -62.392 Product of -25058 and 5737. -143757746 Multiply -13 and 25140107. -326821391 -36189.4 times -32 1158060.8 238989-0.157 -37521.273 Calculate 0.154729-1995. -308.684355 11 times -120093 -1321023 Calculate 00.05242965. 0 Multiply 2 and -11.982702. -23.965404 Work out 689 0.04725. 32.55525 Product of -0.5 and -73744190. 36872095 Calculate -110.0041663. -0.0458293 26197.62-0.3 -7859.286 Calculate -0.483-27089. 13083.987 What is the product of 0.197 and -285.7? -56.2829 Calculate 3326699038. 881068254 Work out -34 * 4.260643. -144.861862 What is the product of -147.080147 and -6? 882.480882 -146452216 -76444224 What is the product of -648856 and -26? 16870256 Calculate 78031212. 9457236 -437 times 0.02451 -10.71087 Work out 0 * 201554167. 0 -37042 times -2277 84344634 Product of 162.011 and -30. -4860.33 Product of -0.4 and -7757828. 3103131.2 Product of 0.48934 and 14.3. 6.997562 -0.1481 * -688061 101901.8341 Multiply -11.6 and 0.015475. -0.17951 -4.5 times 695687 -3130591.5 Multiply -3940 and 11.9. -46886 What is the product of -0.339 and -741.945? 251.519355 What is -126.29 times 0.03266? -4.1246314 Calculate -92915767. -84250564 9769 times -6 -58614 -0.013258-206 2.731148 -38898 times 3.5 -136143 206341 times 2.5 515852.5 What is the product of 1.4 and -22999883? -32199836.2 -0.1 * -426591.57 42659.157 Multiply -3 and -2498.713. 7496.139 Product of -4.51 and 8267. -37284.17 Multiply -0.3 and -10156873. 3047061.9 Work out 42849.1 * -0.1. -4284.91 Multiply 794 and 97802. 77654788 383410531 203590710 Product of -2 and 0.18484529. -0.36969058 Product of -2 and 28593639. -57187278 Calculate 550194-21. -11554074 Multiply -526871 and -3368. 1774501528 What is -0.4542 times 443.9? -201.61938 Product of 0.9 and 109312494. 98381244.6 1.719865 * -74 -127.27001 Work out -0.8673 * -179. 155.2467 852 * 1.708 1455.216 Multiply 3.33 and 2990.81. 9959.3973 Multiply 0.5 and -6438.46. -3219.23 -42365.46 * 0.1 -4236.546 Multiply 3 and -11143426. -33430278 What is 1 times -1.76686? -1.76686 Product of -1427929 and 30.9. -44123006.1 -3.1544 times 10710 -33783.624 -69595 * 77 -5358815 Calculate 103.671-3.4. -352.4814 Multiply -3 and 330031.3. -990093.9 What is -4 times 176.46929? -705.87716 Multiply 1 and 7794.2. 7794.2 What is -23367754 times 0.5? -11683877 12.39-16675 -206603.25 Calculate -2356710.966. -227658.186 Multiply 280456 and 0.01. 2804.56 Product of -7 and -0.33479606. 2.34357242 -810651099-2 1621302198 1.6565 * -62883 -104165.6895 -150 times 1140 -171000 Multiply 0 and 77.962235. 0 -662665 * -3 1987995 -130.848 times -154 20150.592 What is 14.999 times 0.631? 9.464369 Calculate -5.24634436. -24099067.2 What is -0.02011 times -14.8? 0.297628 -21.676101 -2189.276 Work out 59 * 6838937. 403497283 1 * 53183162 53183162 Product of -0.456 and 994.8. -453.6288 What is 180.019 times 688? 123853.072 Multiply -3066.69 and -0.215. 659.33835 Work out -0.60912959 * 14. -8.52781426 What is the product of -0.059528 and 1.83? -0.10893624 What is the product of -11197 and -65696? 735598112 -417438-129 53849502 What is -15138.7118 times -0.5? 7569.3559 Multiply 19705 and -77.7. -1531078.5 Multiply -677 and 1209394. -818759738 0.1178330.05 0.00589165 What is -139269.32 times -16? 2228309.12 0.0358 * 1.9199 0.06873242 Work out -0.384088 * 63. -24.197544 -41.3 times -1949202 80502042.6 What is the product of 2 and -2974552? -5949104 Calculate 98810987-7. -691676909 2.4053-17761 -42720.5333 What is the product of -14939.913 and -0.03? 448.19739 Multiply 895 and 348.7. 312086.5 What is 229260 times 43.8? 10041588 What is 4391.2 times -8.3? -36446.96 Work out -0.023 * -254289. 5848.647 3.59116480.1 0.35911648 -104.5 8308 -868186 23901782 4258980 Multiply -561332 and -0.497. 278982.004 Work out 0.9 18.132564. 16.3193076 -1.45050.5944 -0.8621772 Product of 0.1 and -13433698. -1343369.8 What is the product of 12780 and -17886? -228583080 517633310.2 10352666.2 Multiply 39421 and -3414. -134583294 Multiply 136051.475 and -0.3. -40815.4425 -0.2 times -36638635 7327727 2-18616 -37232 Work out -938.627 4. -3754.508 Multiply 1423.04 and -71. -101035.84 Calculate 0.03168353-4. -0.12673412 Calculate -638725.551. -32575000.5 -3575.1 times 64.3 -229878.93 1638414.1 * 0.1 163841.41 94.78047 times -4 -379.12188 107996260 0 -350123291 0.5 -175061645.5 Work out -61.54607 * -3. 184.63821 What is the product of -39.715 and 0.364? -14.45626 0.2 * -278846.91 -55769.382 What is -0.5985 times 356? -213.066 -11720.1-984 11532578.4 What is the product of -2386 and 35.608? -84960.688 -0.051477221 times 0.1 -0.0051477221 -0.017-3112369 52910.273 Multiply -1779 and -0.1619. 288.0201 2637678 times 45 118695510 2.1830688 times 5.7 12.44349216 What is the product of -11 and 0.0421908? -0.4640988 Product of 29.45406 and 266. 7834.77996 What is the product of 0.8509 and 18872? 16058.1848 -491.4 times 5592 -2747908.8 -132638214 -84244248 35691 25.5 910120.5 0.6165 * 19.15 11.805975 0.1797 * 0.1936 0.03478992 Work out 0.007 * -755.77. -5.29039 -8 times 24300894 -194407152 -27967 times 884 -24722828 Calculate -17230189. -15507162 23395813 13596607 Multiply -0.924 and -0.510036. 0.471273264 What is 1.1587301 times -25? -28.9682525 Work out 4.438 * -328. -1455.664 -1207386 * 5 -6036930 What is the product of -0.052791086 and 0.7? -0.0369537602 What is the product of 37.19 and -1132? -42099.08 90329.1-0.07 -6323.037 453.9281 -0.4 -181.57124 -0.002134.581 -0.269162 Multiply 1.7 and 1177098. 2001066.6 What is the product of 4 and -214149095? -856596380 Multiply 5407 and 0.7262. 3926.5634 340242-5 -1701210 Product of -0.4 and 15037.07. -6014.828 What is the product of -66 and -2.67017? 176.23122 -11.23965-55 618.18075 Product of 0.17 and 2783172. 473139.24 Calculate -3-0.38109908. 1.14329724 0.016 * 19.6069 0.3137104 Calculate 26587-166.9. -4437370.3 0.318020.67 5406.201 Multiply 0.06 and -1366646. -81998.76 -476221.50 0 Multiply 124 and -220808. -27380192 What is the product of 0 and 1.1930979? 0 6109 times -3 -18327 Product of -0.3736342 and 4. -1.4945368 4 times -1075.993 -4303.972 30493551.3 3964161.5 What is the product of 23095369 and 4? 92381476 0.47667 * 24 11.44008 Calculate 1689-7.9458. -13420.4562 2.085 times 542.9 1131.9465 Product of 2 and -0.05666987. -0.11333974 -3.19831 times 12 -38.37972 -156 times -21.983 3429.348 What is 3160148 times 68? 214890064 185544 times 0.01 1855.44 What is the product of -33.32 and 850.76? -28347.3232 Multiply -0.028 and 420174. -11764.872 Multiply 332.3 and 0.803. 266.8369 Multiply 376.31957 and 0.3. 112.895871 3-71781831 -215345493 Multiply -0.2909 and 5453. -1586.2777 Product of 4768568 and -7.9. -37671687.2 Multiply 11 and -3702342. -40725762 Multiply 419 and 81981. 34350039 76774 * -0.2375 -18233.825 Product of -2533 and 13.35	{ "pile_set_name": "DM Mathematics" }
ob of picking 2 l when two letters picked without replacement from {d: 6, u: 1, l: 3, p: 2, b: 5, o: 3}. 3/190 What is prob of picking 1 y, 1 o, and 1 l when three letters picked without replacement from oaylya? 1/10 Two letters picked without replacement from {a: 1, i: 3, z: 4}. What is prob of picking 1 z and 1 i? 3/7 Two letters picked without replacement from gogodgisoiuoo. Give prob of picking 1 i and 1 s. 1/39 Four letters picked without replacement from {y: 3, b: 12}. What is prob of picking 2 y and 2 b? 66/455 What is prob of picking 2 t when two letters picked without replacement from tffytftf? 3/28 Two letters picked without replacement from {c: 2, l: 5, n: 2}. What is prob of picking 2 l? 5/18 Four letters picked without replacement from sssssffssffsf. Give prob of picking 4 f. 1/143 Calculate prob of picking 2 y when two letters picked without replacement from {s: 2, r: 7, y: 7}. 7/40 Three letters picked without replacement from {u: 1, p: 4, v: 5, n: 1, m: 1}. What is prob of picking 3 p? 1/55 Two letters picked without replacement from {x: 10, v: 6, j: 4}. Give prob of picking 2 j. 3/95 What is prob of picking 1 l and 1 k when two letters picked without replacement from {k: 12, i: 1, l: 2, z: 4}? 8/57 What is prob of picking 1 m, 1 r, and 1 d when three letters picked without replacement from dbghbghhbdmmrdgh? 3/280 Calculate prob of picking 2 e when two letters picked without replacement from {f: 3, e: 5}. 5/14 Calculate prob of picking 1 e, 1 r, and 1 g when three letters picked without replacement from xrgqe. 1/10 What is prob of picking 1 n, 1 t, and 1 g when three letters picked without replacement from {g: 12, t: 1, j: 3, n: 4}? 4/95 Four letters picked without replacement from wvwwvvyvwyw. What is prob of picking 2 w and 2 y? 1/33 Three letters picked without replacement from rrereearr. Give prob of picking 2 e and 1 a. 1/28 What is prob of picking 1 g, 2 s, and 1 f when four letters picked without replacement from ffscsssfsgcfsgg? 12/91 Two letters picked without replacement from {v: 1, z: 3, g: 1}. What is prob of picking 1 z and 1 g? 3/10 What is prob of picking 3 e and 1 q when four letters picked without replacement from {n: 5, e: 3, q: 2}? 1/105 Three letters picked without replacement from {n: 7, v: 2}. Give prob of picking 1 v and 2 n. 1/2 Four letters picked without replacement from {n: 1, w: 4, c: 5}. What is prob of picking 4 w? 1/210 Calculate prob of picking 1 f, 1 m, and 1 k when three letters picked without replacement from kqmmqmmmmffk. 6/55 Three letters picked without replacement from ataotildotditdiadttd. What is prob of picking 3 t? 1/57 What is prob of picking 1 i and 2 t when three letters picked without replacement from mttmttiimttimjtttt? 45/272 Four letters picked without replacement from kckkkkkkckkkkckckck. Give prob of picking 4 c. 5/3876 What is prob of picking 2 q and 1 w when three letters picked without replacement from wwwwwwqwwwq? 3/55 Two letters picked without replacement from {n: 3, a: 3, i: 1, y: 3}. Give prob of picking 1 i and 1 n. 1/15 Two letters picked without replacement from ooooozoooooopoo. What is prob of picking 1 z and 1 p? 1/105 Three letters picked without replacement from {r: 1, m: 2, w: 6, a: 3, t: 2, o: 6}. What is prob of picking 1 o and 2 t? 1/190 Calculate prob of picking 2 m when two letters picked without replacement from eomomoo. 1/21 Calculate prob of picking 1 c, 1 e, and 1 n when three letters picked without replacement from {c: 4, w: 1, n: 4, e: 7, r: 3}. 112/969 Two letters picked without replacement from {i: 1, o: 1, d: 2, s: 1, t: 2, l: 2}. Give prob of picking 1 o and 1 d. 1/18 Two letters picked without replacement from {c: 1, q: 2, d: 1, s: 2, y: 1}. Give prob of picking 1 y and 1 d. 1/21 Three letters picked without replacement from {y: 2, k: 2, j: 4, p: 3, o: 7}. What is prob of picking 1 o and 2 k? 7/816 What is prob of picking 2 k when two letters picked without replacement from kkkkkikiikikkkkkkkk? 35/57 Calculate prob of picking 1 a and 2 x when three letters picked without replacement from {x: 2, a: 10}. 1/22 Two letters picked without replacement from zaazfaaazff. Give prob of picking 1 f and 1 a. 3/11 Three letters picked without replacement from {z: 2, k: 17}. Give prob of picking 1 z and 2 k. 16/57 What is prob of picking 1 v, 1 h, and 2 s when four letters picked without replacement from {l: 8, r: 5, h: 3, v: 2, s: 2}? 2/1615 What is prob of picking 1 q and 1 l when two letters picked without replacement from qxoxqxoqlxoqlqxlq? 9/68 Two letters picked without replacement from pqmwv. Give prob of picking 1 q and 1 p. 1/10 Calculate prob of picking 4 r when four letters picked without replacement from {g: 1, w: 2, r: 7, x: 1, v: 8}. 35/3876 Calculate prob of picking 1 r and 1 o when two letters picked without replacement from {o: 2, r: 7, u: 1}. 14/45 What is prob of picking 1 d and 1 a when two letters picked without replacement from ada? 2/3 Two letters picked without replacement from wtwwbwt. Give prob of picking 1 t and 1 b. 2/21 Two letters picked without replacement from {h: 1, f: 4, r: 4, p: 3, m: 1}. What is prob of picking 1 m and 1 f? 2/39 Two letters picked without replacement from {v: 3, w: 6, k: 2, j: 3, h: 2}. Give prob of picking 1 v and 1 k. 1/20 What is prob of picking 2 a when two letters picked without replacement from {a: 2, d: 2, w: 2}? 1/15 What is prob of picking 1 l and 1 j when two letters picked without replacement from {j: 5, s: 3, l: 2}? 2/9 What is prob of picking 3 k when three letters picked without replacement from {y: 2, k: 3}? 1/10 Two letters picked without replacement from ppyppppyppp. What is prob of picking 2 p? 36/55 Four letters picked without replacement from {o: 3, y: 4}. What is prob of picking 1 y and 3 o? 4/35 Calculate prob of picking 2 p and 1 e when three letters picked without replacement from {b: 4, p: 2, g: 1, e: 3, q: 6, c: 4}. 1/380 Calculate prob of picking 2 u when two letters picked without replacement from {u: 3, a: 17}. 3/190 Three letters picked without replacement from {a: 5, b: 11}. Give prob of picking 3 b. 33/112 Three letters picked without replacement from hhhhhihwn. Give prob of picking 1 n, 1 h, and 1 w. 1/14 What is prob of picking 1 a, 1 z, and 2 o when four letters picked without replacement from {z: 2, a: 4, o: 3}? 4/21 What is prob of picking 1 q and 1 v when two letters picked without replacement from iisvqsiqissqi? 1/26 Two letters picked without replacement from {s: 3, t: 2, g: 2, y: 5}. What is prob of picking 1 g and 1 s? 1/11 Calculate prob of picking 2 t when two letters picked without replacement from qqooqtqqoqqqoqotqqqq. 1/190 Four letters picked without replacement from aattaaa. What is prob of picking 1 t and 3 a? 4/7 Two letters picked without replacement from ssfffs. Give prob of picking 2 s. 1/5 Calculate prob of picking 1 k and 1 i when two letters picked without replacement from {a: 5, x: 3, b: 6, t: 1, k: 1, i: 3}. 1/57 Four letters picked without replacement from {t: 7, k: 3, s: 9}. What is prob of picking 4 s? 21/646 Two letters picked without replacement from {q: 1, i: 1, h: 1, y: 1, b: 1, t: 2}. What is prob of picking 1 b and 1 y? 1/21 Three letters picked without replacement from {g: 1, h: 1, a: 4, u: 2}. What is prob of picking 2 a and 1 h? 3/28 What is prob of picking 2 n and 1 h when three letters picked without replacement from kponnpnznpnpphnh? 3/56 What is prob of picking 1 x and 1 r when two letters picked without replacement from aqqxrqb? 1/21 Calculate prob of picking 3 r when three letters picked without replacement from rorrooaroao. 4/165 Calculate prob of picking 3 y and 1 c when four letters picked without replacement from lcyycclcylccclclyy. 4/153 Three letters picked without replacement from {d: 6, r: 1, y: 3, z: 1, m: 3}. Give prob of picking 1 m and 2 y. 9/364 What is prob of picking 3 p when three letters picked without replacement from {p: 5}? 1 What is prob of picking 1 f and 1 z when two letters picked without replacement from zzczzzihfzfft? 3/13 Three letters picked without replacement from guuuzuuzuu. Give prob of picking 1 g and 2 u. 7/40 Two letters picked without replacement from {g: 1, t: 2, v: 3, u: 2, z: 3, y: 1}. Wh	{ "pile_set_name": "DM Mathematics" }
-0.1. Let u be (-6)/(-33) - (2457/143 + -17). Sort u, n, -0.2, 0.5 in decreasing order. 0.5, n, u, -0.2 Let d = -2735 + 5177. Sort d, 2, -2 in descending order. d, 2, -2 Suppose -2y = 3y. Let w = 35506 - 35507. Let b = 2 - 1. Sort b, 2, w, y. w, y, b, 2 Let n = 7343 - 7415. Sort 22, 1, n, 3 in ascending order. n, 1, 3, 22 Let t = 3297.8 + -3298. Sort t, 1, 4, 0.802 in descending order. 4, 1, 0.802, t Let o be ((-4)/(-28))/(6/(-7)). Let f be (2/6)/(-1) + 2530/3036. Put f, 10, o in decreasing order. 10, f, o Let n = 828.9622 + 0.0378. Let p = n + -829.5. Sort 11, p, -3, 1. -3, p, 1, 11 Let r = 0.37 - -467.63. Let n = -463 + r. Put 0, n, -1/3, 24 in descending order. 24, n, 0, -1/3 Suppose 7 - 22 = -3z. Suppose -9u + u = -zu. Suppose f - t - 3 = 0, 2t = -12f + 7f + 22. Put f, 5, u in descending order. 5, f, u Let u be (-180 - -44)(-1)/(-8)2. Sort -2/7, u, -0.2, 7, 0.1. u, -2/7, -0.2, 0.1, 7 Suppose -5j - 2x = -33, 0 = 2j - 0x + 2x - 18. Let r = 0 + j. Suppose -35t - 2 = -39t - g, -2t + 4g = -10. Put 3, r, t, 4 in decreasing order. r, 4, 3, t Let t be (-2897)/5 - 1132/(-880). Put -3, -1, t, 3 in decreasing order. 3, -1, -3, t Suppose 3s - 3 = -3p, 2s - 3p + 4p - 4 = 0. Suppose 26 = -79x + 76x - 4m, -27 = sx + 3m. Put 4, x, 5 in decreasing order. 5, 4, x Let d(j) be the second derivative of -j*3/3 + 7j*2 - 4j. Let a be d(8). Let v = -12 - -2. Sort v, 1, 2, a in increasing order. v, a, 1, 2 Suppose 0 = 600z - 31650 + 79196 + 87454. Sort -5, z, 2, -2, -4. z, -5, -4, -2, 2 Suppose 0 = d - 7 + 5. Let f(a) = -a3 + 13a*2 + 15a - 10. Let k be f(14). Let l = 3 + k. Sort l, -0.4, d in increasing order. -0.4, d, l Suppose -3y - 2y = 10. Let i(x) = 19x2 + 245x + 8. Let r be i(-13). Sort 1, r, y in ascending order. y, 1, r Let r be (12/1050-15)/(3/(-7)). Let d be -177(0 - 12/20). Let l = d - 107. Sort r, l, -5 in ascending order. -5, l, r Let d be 1/8 + -2 + 1043/616. Sort 12, -1, d, -4 in descending order. 12, d, -1, -4 Let g be (3320/770)/(-21). Let p = 132/65 - 42/13. Sort p, -4, g in descending order. g, p, -4 Let p(c) = -c*2 - 10c + 277. Suppose 258 + 80 = 26u. Let f be p(u). Put 2, -4, f in decreasing order. 2, -4, f Let k(u) = 25u + 1133. Let s be k(-50). Sort s, -5, -1, 4 in descending order. 4, -1, -5, s Let t be (1/2)/(2/(-20)). Let j(h) = 3h2 - 1764h + 10472. Let f be j(6). Put f, t, -62 in descending order. f, t, -62 Let b = -4913.6 + 4914. Sort b, 0, -1, -36/7 in decreasing order. b, 0, -1, -36/7 Suppose -65 = -7t - 205. Let x be -12((-16)/t - 1) - 2. Let y be 4/(-10) + 0/9. Sort y, -21, x in decreasing order. x, y, -21 Let k(m) = -10m - 76. Let g be k(-10). Suppose -2t - t = d + 8, 2t + g = 4d. Sort 5, d, -2, -22 in increasing order. -22, -2, d, 5 Let r(b) = 138b - 1932. Let m be r(14). Sort 348, m, 3, 5 in decreasing order. 348, 5, 3, m Let b = -8.553 + -0.247. Let i = -11.8 - b. Suppose -3z + 8 = -7z. Sort i, -5, z in increasing order. -5, i, z Let o(g) = 222g + 2900. Let l be o(-13). Put l, -1, -25 in decreasing order. l, -1, -25 Let q = -0.3 + 39.4. Let l = 38.02 - -0.98. Let y = l - q. Sort -8, y, 1/3 in descending order. 1/3, y, -8 Let d = 0 - 0. Suppose -4b + 3m = -47, 4m + 73 = 5b + 14. Suppose -27t = bt + 76. Put t, d, 1, 5 in decreasing order. 5, 1, d, t Suppose -11f - 107f + 236 = -236. Put f, -3, 464, -5 in ascending order. -5, -3, f, 464 Let a be (-48)/(-1 + -383)(2265 + -1). Put -6, a, -2, 4 in decreasing order. a, 4, -2, -6 Let l be 18 + 38/((-3800)/1860). Put 0.5, l, 358 in descending order. 358, 0.5, l Let i = 817 + -375. Suppose -5f = 452 - i. Put 1, f, -9, 3 in ascending order. -9, f, 1, 3 Let y = -18.485 - -23.485. Sort -4, 6, y, -12, 0. -12, -4, 0, y, 6 Let c be (-6)/5-15(7748/(-702) - -11). Let u = 603/2212 - 30/79. Let p = 2.3 + 0.7. Sort p, c, 0.5, u. c, u, 0.5, p Suppose -21p - 10p + 45p = 14. Put p, 2501, 4 in decreasing order. 2501, 4, p Suppose 0 = -4z + d - 83, 147z + 40 = 146z + 2d. Let f = -0.2 - 0. Sort z, f, -2 in ascending order. z, -2, f Suppose -18 = v - 3z, v - z + 11 = -v. Let a(h) = -486h - 45194. Let i be a(-93). Sort v, i, 8 in descending order. 8, i, v Suppose 2m + 10 = 2p, 0m = -m. Suppose pg = j, -2g = -j - 2j. Put 5, -4, 4, g in descending order. 5, 4, g, -4 Let k = 1670 + -1658. Sort -0.1, 2, -6/5, k. -6/5, -0.1, 2, k Let q(r) = -r3 + 37r*2 + r - 37. Let f be q(37). Put 4, f, -1850 in descending order. 4, f, -1850 Let b = -17629 - -17624. Let j = -2 - -1.8. Put b, -0.5, j, 65 in descending order. 65, j, -0.5, b Suppose 2n = 5r + 10, -91n + 95n = 2r + 20. Put -2, n, 17, 0 in descending order. 17, n, 0, -2 Suppose 2z + 2f - 65 = -3f, f = -2z + 61. Suppose 3p + zl = 32l - 133, 0 = -p - 3l - 26. Sort p, 1, 2 in descending order. 2, 1, p Suppose 0 = -4x + 20, 2x = -3m + x + 101. Suppose -16 = -b - 2p, b + 2p - 28 = -3p. Let j be (0 + 4)/(m/b). Put j, -13, 2 in descending order. 2, j, -13 Let s be (-14 + 12)(2 - (-10)/(-4)). Suppose 4k + 36 = 2p, 17 = -5k - 5p - 13. Sort s, 4, k. k, s, 4 Let p = 88/35 + -278/105. Put -0.62, 0.2, p in descending order. 0.2, p, -0.62 Let k = 0.556 + -0.036. Let v = 0.22 - k. Let p = 0.1 - v. Put -4, -0.5, p, -0.2 in decreasing order. p, -0.2, -0.5, -4 Let y(d) = d3 + 4d*2 - d + 2. Let b be y(-4). Suppose 0 = -3q - b, -q - 18 = 2k + 3q. Let z = 44 + -51. Sort k, -2, 2, z in ascending order. z, k, -2, 2 Suppose 2x = -5c + 102 - 90, 5c - x = -6. Put 2, -863, c in decreasing order. 2, c, -863 Suppose 4s - 111 = -87. Let x be 14/49 - (-52)/14. Let g be x/14 + 48/(-21). Sort g, s, 5. g, 5, s Let w = 21327 - 21343. Sort -2, w, 126 in increasing order. w, -2, 126 Let h be (-33 - -48)(-2)/(-10). Put 4, 2, 3/2, h, 0.2 in descending order. 4, h, 2, 3/2, 0.2 Let m be 254/90 + (-5200)/2000. Put m, 8, -0.6, 5/11 in decreasing order. 8, 5/11, m, -0.6 Suppose -2f = 4t - 4, 0 = -3f - 2f - 2t + 2. Let a = -326 + 332. Let o be ((-14)/a)/(49/(-6) - -7). Sort f, -9, o in ascending order. -9, f, o Let v = -764.4 + 764.39. Put -1, v, -3/16, 3 in decreasing order. 3, v, -3/16, -1 Suppose -9x - 6542 = -6488. Put -8, x, 1, -2, 4 in increasing order. -8, x, -2, 1, 4 Let k be 6/(-12) - 1980/24. Sort -3, k, -73 in descending order. -3, -73, k Let z = 22439/55 - 3357/11. Let j = 102 - z. Let s = -3361.2 - -3361. Put j, 0.1, s in descending order. 0.1, s, j Let d = 8385 - 8385. Put -5, -2, d, 20 in increasing order. -5, -2, d, 20 Suppose -5m + 2z + 376 = -453, -2m + 3z + 325 = 0. Suppose 13u - m = -24. Let w be u/(-3) - (-2)/3. Sort -2, 0, 4, w in decreasing order. 4, 0, -2, w Suppose 351 = -0s + 9s. Suppose 11 = l + 5h - 9, 5l = h + 22. Sort -5, s, l in descending order. s, l, -5 Let f = 5237 + -5335. Sort 5, 1, f. f, 1, 5 Let q be (-3)/(-2)(-8)/(-3). Let y = 16588 - 16590. Put -5, q, y in decreasing order. q, y, -5 Suppose -135t - 199 + 1067 = 82t. Sort 0.1, t, 1.901, 0. 0, 0.1, 1.901, t Let f = 274 - 270. Let u be (-7)/(-56)f-112. Sort 5, u, -5. u, -5, 5 Let o be -4(-2 + 3/3). Suppose k = -o + 3. Suppose -5t = 3h + 2, 7t + 1 = -4h + 2t. Put k, -4, h in decreasing order. h, k, -4 Let d(j) = -j*3 - 10j*2 + 46j + 449. Let p be d(-11). Put 3, -1, p, -2 in descending order. p, 3, -1, -2 Let a be 56/70(-5)/(-26). Let f = 15 + -14.8. Let u = -11/4 - -5/2. Put u, a, f, -1 in descending order. f, a, u, -1 Let i = 615 + -608. Let t = -2.2 - -2.3. Sort -2, t, i in descending order. i, t, -2 Let t(p) = 107p + 2136. Let g be t(-20). Sort -35, g, 3, -1, 0 in decreasing order. 3, 0, -1, g, -35 Let i = -0.3417 + 0.1417. Sort -3/5, i, -1, 1/55, 5 in descending order. 5, 1/55, i, -3/5, -1 Let w = -5082 + 5058. Sort -23, w, 1 in descending order. 1, -23, w Let j = -2513 + 2518. Let g be (-2 + (-6 - -7))3. Let q = 1 - 1. Put g, q, j in ascending order. g, q, j Suppose 0 = 18k + 9k + 54. Let u be (3/(-9))/(31/(-15) - k). Sort -3, u, 3, 2. -3, 2, 3, u Let w = 11640 + -11642. Sort w, -1, 5, -6, 10 in descending order. 10, 5, -1, w, -6 Let v = -16681 - -16684. Sort 1, v, 5, -4, -9. -9, -4, 1, v, 5 Let t be (54/(-180))/(6/(-112)). Put t, 4, -0.03, 3/8 in decreasing order. t, 4, 3/8, -0.03 Suppose 0 = 30d - 33*d + 6. Let u = -5124 + 5128. Put 0, 1, u, d i	{ "pile_set_name": "DM Mathematics" }
5 What is the remainder when 180662 is divided by 90135? 392 What is the remainder when 26352273 is divided by 5270444? 53 Calculate the remainder when 14202 is divided by 10997. 3205 What is the remainder when 4288158 is divided by 63061? 10 Calculate the remainder when 724599 is divided by 362289. 21 What is the remainder when 78389 is divided by 4857? 677 What is the remainder when 32675 is divided by 31934? 741 Calculate the remainder when 24590839 is divided by 1891602. 13 Calculate the remainder when 10571056 is divided by 40346. 404 Calculate the remainder when 12846639 is divided by 241. 134 Calculate the remainder when 42098 is divided by 39119. 2979 Calculate the remainder when 116209 is divided by 3606. 817 Calculate the remainder when 267766 is divided by 2031. 1705 What is the remainder when 451482 is divided by 150488? 18 What is the remainder when 132137 is divided by 18837? 278 What is the remainder when 3201291 is divided by 142? 43 Calculate the remainder when 253718164 is divided by 221. 219 Calculate the remainder when 171652757 is divided by 85826368. 21 Calculate the remainder when 10454 is divided by 8958. 1496 What is the remainder when 1853332 is divided by 874? 452 What is the remainder when 7066551 is divided by 53? 8 What is the remainder when 270734 is divided by 9877? 4055 What is the remainder when 80927 is divided by 26781? 584 What is the remainder when 991259 is divided by 330403? 50 Calculate the remainder when 402842 is divided by 36575. 517 Calculate the remainder when 2606608 is divided by 2407. 2234 What is the remainder when 139160 is divided by 15459? 29 Calculate the remainder when 60924514 is divided by 6491. 6479 Calculate the remainder when 25977 is divided by 1053. 705 Calculate the remainder when 144434413 is divided by 14. 11 What is the remainder when 107882539 is divided by 528? 523 What is the remainder when 18164260 is divided by 1007? 1001 What is the remainder when 1722749 is divided by 90669? 38 Calculate the remainder when 8962359 is divided by 93356. 183 What is the remainder when 37359 is divided by 12426? 81 What is the remainder when 17150836 is divided by 1559166? 10 What is the remainder when 52411100 is divided by 21? 14 What is the remainder when 48516393 is divided by 155? 153 What is the remainder when 22182 is divided by 2604? 1350 What is the remainder when 563615667 is divided by 7492? 7491 What is the remainder when 155668878 is divided by 3536? 14 What is the remainder when 6136885 is divided by 46491? 73 What is the remainder when 97240 is divided by 92? 88 Calculate the remainder when 235068 is divided by 58756. 44 What is the remainder when 1987 is divided by 259? 174 What is the remainder when 11765239 is divided by 47? 11 What is the remainder when 169958 is divided by 18824? 542 What is the remainder when 394218 is divided by 247? 6 Calculate the remainder when 127349542 is divided by 14. 12 What is the remainder when 1630899 is divided by 228? 15 What is the remainder when 38870999 is divided by 9255? 9254 What is the remainder when 34789790 is divided by 31? 9 Calculate the remainder when 7964535 is divided by 1137789. 12 What is the remainder when 509144 is divided by 551? 20 Calculate the remainder when 303768 is divided by 101250. 18 What is the remainder when 96309 is divided by 92385? 3924 What is the remainder when 1018536 is divided by 3213? 15 What is the remainder when 4612428 is divided by 96? 12 What is the remainder when 2723407 is divided by 340399? 215 Calculate the remainder when 1129894 is divided by 16139. 164 What is the remainder when 105158 is divided by 96644? 8514 Calculate the remainder when 34792 is divided by 192. 40 What is the remainder when 891607 is divided by 230? 127 What is the remainder when 11159986 is divided by 1240? 1226 Calculate the remainder when 2165636 is divided by 998. 974 What is the remainder when 6120 is divided by 2401? 1318 What is the remainder when 11950 is divided by 112? 78 Calculate the remainder when 10058 is divided by 9669. 389 What is the remainder when 173976 is divided by 524? 8 Calculate the remainder when 23659274 is divided by 11829635. 4 What is the remainder when 5326520 is divided by 828? 824 What is the remainder when 181947830 is divided by 4642? 4640 Calculate the remainder when 792651 is divided by 212. 195 What is the remainder when 1024060 is divided by 5306? 2 Calculate the remainder when 123815 is divided by 693. 461 What is the remainder when 696474 is divided by 193? 130 What is the remainder when 10117070 is divided by 40? 30 What is the remainder when 361754146 is divided by 839? 838 What is the remainder when 15370 is divided by 6658? 2054 Calculate the remainder when 81271 is divided by 81179. 92 Calculate the remainder when 1531480 is divided by 665. 650 What is the remainder when 127053909 is divided by 19? 16 What is the remainder when 5319194 is divided by 41234? 8 Calculate the remainder when 16478404 is divided by 7. 5 What is the remainder when 296087 is divided by 11365? 597 What is the remainder when 55138 is divided by 27019? 1100 What is the remainder when 49111156 is divided by 3? 1 What is the remainder when 340949 is divided by 28405? 89 Calculate the remainder when 1130165 is divided by 15271. 111 Calculate the remainder when 25781701 is divided by 12890821. 59 What is the remainder when 19573117 is divided by 128? 125 Calculate the remainder when 96024572 is divided by 3185. 7 Calculate the remainder when 33856646 is divided by 450. 446 Calculate the remainder when 3582798 is divided by 1791390. 18 What is the remainder when 1834931 is divided by 907? 70 What is the remainder when 156882 is divided by 252? 138 What is the remainder when 8914331 is divided by 592? 587 Calculate the remainder when 248294679 is divided by 91. 87 Calculate the remainder when 74847 is divided by 10667. 178 Calculate the remainder when 1229003 is divided by 1185. 158 What is the remainder when 329918 is divided by 149? 32 What is the remainder when 31215550 is divided by 335651? 7 Calculate the remainder when 84989 is divided by 1152. 893 What is the remainder when 201361 is divided by 271? 8 Calculate the remainder when 519704 is divided by 171192. 6128 What is the remainder when 237243 is divided by 11829? 663 Calculate the remainder when 4484401 is divided by 2242192. 17 What is the remainder when 2603298 is divided by 1620? 1578 What is the remainder when 976 is divided by 305? 61 Calculate the remainder when 110900 is divided by 3861. 2792 What is the remainder when 183352 is divided by 270? 22 Calculate the remainder when 820584 is divided by 23445. 9 Calculate the remainder when 5734135 is divided by 11537. 246 Calculate the remainder when 96243 is divided by 1566. 717 Calculate the remainder when 762463 is divided by 21179. 19 What is the remainder when 9499948 is divided by 118? 4 Calculate the remainder when 112729 is divided by 2661. 967 Calculate the remainder when 167663 is divided by 2990. 223 Calculate the remainder when 3143522 is divided by 10953. 11 Calculate the remainder when 20851447 is divided by 123. 118 What is the remainder when 4808015 is divided by 343424? 79 What is the remainder when 73079506 is divided by 252? 10 Calculate the remainder when 3176872 is divided by 1566. 1024 What is the remainder when 6365460 is divided by 578677? 13 What is the remainder when 53177294 is divided by 68? 2 What is the remainder when 407507165 is divided by 22? 21 Calculate the remainder when 4704921 is divided by 5628. 5541 What is the remainder when 95397574 is divided by 3229? 3227 Calculate the remainder when 58951358 is divided by 1183. 102 What is the remainder when 10859875 is divided by 4411? 4404 What is the remainder when 109068 is divided by 108965? 103 Calculate the remainder when 69712 is divided by 52. 32 Calculate the remainder when 20732 is divided by 1254. 668 What is the remainder when 38341123 is divided by 4? 3 Calculate the remainder when 236638 is divided by 55866. 13174 Calculate the remainder when 5505484 is divided by 6050. 6034 What is the remainder when 209331 is divided by 41837? 146 What is the remainder when 2803253 is divided by 52? 37 Calculate the	{ "pile_set_name": "DM Mathematics" }
)/75)/((-4)/1)? 1/6 What is the value of ((60/10)/(-36))/((-1)/18)? 3 ((-16)/(-24))/((-4)/(-18)) 3 (-25)/(-40)(-4)/103 -3/4 Calculate ((21/4)/7)/(-3). -1/4 Evaluate 6/(-15)(-30)/(-114). -2/19 Calculate ((-84)/(-36))/7-12. -4 What is 9(-6)/(-567)7? 2/3 Evaluate (36/56)/(12/(-14)). -3/4 What is ((-1)/(-3))/((80/168)/10)? 7 Calculate (13/(65/(-10)))/(-2). 1 What is 54/312/(-36)? -6 (-1)/(2-29/9) 1/4 What is the value of ((-1)/(3/(-3)))/(2/10)? 5 What is (42/(-168))/(2(-3)/264)? 11 5/((18/9)/(24/20)) 3 What is (-310/24)/((-20)/(-24))? -3/2 What is the value of ((-3)/9)/(10/(-150))? 5 ((-12)/15)/(11/55) -4 What is the value of (10/6)/(5/6)? 2 What is 2/((-35)/20-4)? 2/7 Calculate (34/15)/(605/(-275)). -4/11 What is ((-3)/((-3)/2))/((-56)/16)? -4/7 What is (-7)/(-7)((-20)/(-4))/(-40)? -1/8 What is the value of (4/3)/((952/294)/17)? 7 Calculate ((-1)/44-2)/(2/(-8)). -2/11 Calculate (2/303)/((-1)/(-5)). 1 What is the value of 7/4(-72)/18? -7 What is 10/212/(-15)? -4 ((-19)/(798/36))/((-2)/14) 6 Calculate 0/((-3)/(-6)-16). 0 What is the value of ((-1)/(-14))/((66/6)/(-44))? -2/7 Evaluate (40/(-96))/((-10)/3). 1/8 (4/(-4))/(2/(6/3)) -1 What is the value of (-24)/124/(-2)? 4 What is the value of 8/14(-161)/230? -2/5 (-3)/122(-26)/26 1/2 Calculate (-5(-6)/(-10))/((-3)/(-2)). -2 Evaluate (4/(-14))/((-27)/((-243)/(-6))). 3/7 What is the value of (-1)/(8/(-12))2? 3 What is the value of 3/(((-17)/51)/(2/6))? -3 What is the value of 4/16(-8)/7? -2/7 428/80(-65)/13 -7 What is the value of 9/3-11? -3 What is the value of (-14)/((-27)/27)? 4 (-1)/(6/((-300)/(-10))) -5 ((-11)/220-10)/(2/(-12)) -3 Evaluate (4/(-18))/((88/(-24))/(-11)). -2/3 What is (56/8)/(-14)8? -4 Evaluate 11/11(-8)/(2/1). -4 What is the value of ((-4)/2)/(4(-3)/(-2))? -1/3 ((-56)/49)/(-8)21/9 1/3 Calculate (-14)/3153/(-6)10. 2/9 Evaluate ((-60)/(-10))/((-6)/(-3)). 3 Calculate (574/(-246))/(1/3). -7 Calculate (-3)/(-5)5/3. 1 What is (0/((-12)/(-3)))/((-4)/4)? 0 What is the value of (10/40)/(-1)-28? 7 8/12(-9)/(-2) 3 Calculate (71/213)/((-1)/3). -1 What is the value of (-11)/1012-23(-4)/1? -1 What is (12/(-108))/((-5)/6)? 2/15 What is the value of (7/(-2))/7-10? 5 What is the value of ((-2)/6)/((-13)/(-156))? -4 (266/19)/(2/1) 7 Calculate (-50)/(-20)(-6)/(-55). 3/11 What is 52/(-1092)19? -3/7 Evaluate 5/(-1338/(-57)). 5/2 What is 8(-4)/4812? -8 What is (3/(-6))/((25/2)/(-5))? 1/5 Calculate 3/(-9)42/(-98). 1/7 What is the value of -45/(-3)66/44? 10 What is the value of ((-5)/(-20))/((-1)/29)? -1/18 What is 15/42124/60? 1/7 Calculate 125/(-10). -1 What is (-54)/(-45)(-100)/15? -8 ((-24)/(-306))/((-16)/24) -2/17 Calculate (-9)/(-6)(-8)/(-3). 4 (-7)/5(-52)/91 4/5 What is 35/1440/25? 4 Evaluate (-5(-12)/(-210))/((-5)/105). 6 ((-6)/5)/(66/30) -6/11 What is (8/(128/8))/(1/(-4))? -2 Calculate 10(8/16-1)/2. -5/2 What is 3/(((-1)/((-6)/6))/(-2))? -6 Evaluate -420/(-16)1. 5 Evaluate (18/147)/(12/(-56)). -4/7 What is the value of ((-2)/14)/(1/3)? -3/7 Calculate 2/(((-63)/(-7))/(-18)). -4 What is ((-1)/2)/(((-90)/40)/1)? 2/9 Evaluate ((-50)/(-60))/(21/4). 5/3 What is the value of (-16)/84(-12)/(-8)? -2/7 What is (-22/40)/((-2)/(-5))? -1/4 Evaluate 0/(((-24)/6)/((-4)/2)). 0 (2/(-7))/(19/(798/(-120))) 1/10 What is (-56)/(-168)(-6)/11? -2/11 Evaluate (-156)/182((-168)/45)/4. 4/5 (-2)/(-3)(-42)/(-20) 7/5 What is the value of ((-11)/(-110))/((-3)/(-6))? 1/5 What is (-1)/(-2)(-8)/123? -1 Calculate (-2)/35-1(-700)/(-140). 2/7 Calculate (3/18)/(2/(-3)). -1/4 What is the value of -31(-1043)/(-447)? -7 Evaluate (1215/(-36))/(-27)2/10. 1/4 What is the value of 312/3511/4? 2/9 Calculate (-2)/(-2)(-3)/(-1). 3 What is (4/(-12))/((-7)/(-63))? -3 What is (-2-42/(-96))/1? -1/6 (84/(-36))/(((-336)/(-18))/(-8)) 1 (-4)/3(-459)/3060 1/5 What is (-2)/(32/14)(-32)/16? 7/4 What is (-2)/((-12)/(-6))1? -1 What is the value of -94/9(-12)/(-16)? -3 What is (-54)/(-81)(-3)/2? -1 What is the value of ((-35)/(-231))/(7/(42/15))? 2/33 13/((-91)/28)3/(-78) 2/13 What is the value of ((-16)/(-4))/(7/(105/(-10)))? -6 What is (-30)/(-25)(-40)/108? -4/9 Calculate (2/(-2))/((-7)/(14/(-15))). -2/15 Evaluate (-189)/424/(-6). 3 Evaluate (3/45-10)/((-1)/(-6)). -4 Calculate ((9/3)/(-15))/1. -1/5 Calculate (36/(-27))/((-84)/(-21)). -1/6 Evaluate ((-24)/(-72))/(1/(-12)). -4 ((4/2)/4)/((-37)/74) -1 What is the value of 18/(-27)(-21)/35? 2/5 Evaluate ((-8)/((-6)/(-3)))/14. -2/7 Calculate ((-16)/16)/(-71). 1/7 Calculate (112/(-35))/(-8)15/1. 6 What is (-24)/(-99)18/(-24)? -2/11 What is (12/4)/((-6)/(-4))? 2 Evaluate (-12)/3025/40. -1/4 Evaluate 345/233/45. 1 Evaluate (1/4)/((-126)/(-560)15). 2/27 ((-6)/34)/(-1211/(-88)) -2/17 What is (-4)/(-15)(-50)/(-20)? 2/3 What is the value of (-6)/(-12)((-3)/3)/1? -1/2 (4/(-25))/(20/50) -2/5 Calculate (-7)/(-14)2/2-8. -4 What is -145/(-6)4/6? 5 What is ((-32)/12)/((-16)/24)? 4 (40/170)/((-16)/8) -2/17 ((-6)/(-9)-3)/((-16)/(-24)) -3 What is the value of 06/15(-85)/(-68)? 0 33/11(-12)/(-9) 4 What is ((-88)/8)/220/(-2)? 0 What is (3/8)/(2/(-4)-3)? 1/4 (-77)/66(-20)/105 2/9 Calculate 10/((-4)/(-4)-1). 0 (-1)/(-1)10/(-1) 0 (189/(-756))/((33/(-8))/3) 2/11 What is the value of (58/116)/(9/2)? 1/9 What is ((8/(-6))/1)/((-182)/819)? 6 What is 3(-70)/(-252)8/70? 2/21 Calculate 70/25(-17)/34. -7/5 ((-5)/20)/((-150)/(-40)) -1/15 What is (3/(-7))/(4/(-14))? 3/2 ((-184)/230)/((18/(-5))/(-1)) -2/9 What is -2(-18)/27(-24)/4? -8 Calculate (3/273)/((-2)/2). -1/3 What is the value of (-8)/(264/(-3))11? 1 What is the value of 35(-7)/(-105)(-96)/(-56)? 4 ((-6)/(-1))/(48/(-32)) -4 Evaluate (18/15)/(16/40). 3 What is the value of ((-3)/(6/(-4)))/((-1437)/(-479))? 2/3 What is the value of -2(-6)/(-36)3/(-1)? 1 Evaluate 9/(-6)(-2)/(-3). -1 Evaluate (-1)/((-1)/1)-5. -5 What is (12/(-9)1)/((-12)/2)? 2/9 Evaluate -41/((-140)/15). 3/7 Evaluate (-16)/(-120)6-5. -4 Evaluate (-7)/2(-8)/(-42). -2/3 (-4)/(-14)(-112)/(-96) 1/3 What is (24/84)/(5/(105/(-36)))? -1/6 What is the value of (-67)/6711/2? -1/2 (-2)/4(0/5)/6 0 ((-1)/(-1))/((-6)/420-10) 7 What is -2(-35)/(-56)4? -5 What is (1/(35/(-9)))/((-9)/15)? 3/7 (4/8)/(2/2) 1/2 What is (8/(-6))/((-20)/(-135))? -9 ((-6)/14)/(198/(-1848)) 4 (7(-6)/42)/((-1)/(-5)) -5 What is the value of 2/101/((-6)/15)? -1/2 (3/9)/(2/12-5) -2/5 Evaluate 2/2114/(-57). -2 Evaluate (((-36)/9)/4)/(-7). 1/7 Evaluate (-8)/621/(-28)-5. -5 What is 5/293/310? 3/4 What is the value of (-8)/((-80)/25)4/(-75)? -2/15 Evaluate ((-5)/(-10))/(2/8). 2 (-4)/3144/(-32) 6 Evaluate ((-60)/56)/524/18. -2/7 What is 3/514/(-21)? -2/5 What is 1/13/(-33)? -1/11 Evaluate -205/(-80)4. 5 What is 31/3-4? -4 Evaluate -7(-4)/(-44)11. -7 Calculate ((8/14)/(-2))/(-1). 2/7 (12/36)/(1/((-2)/(-3))) 2/9 ((-22)/(-33))/(32/72) 3/2 (2/(-6))/(((-1)/(-6))/1) -2 (-3)/((-108)/(-9))-28 7 What is (-2)/378/(-260)? 1/5 Calculate (-28)/(-14)(-2)/4. -1 What is (-12)/(-18)3/(-4)? -1/2 What is ((-1)/6)/((-9)/18-2)? -1/6 Evaluate ((-2)/(-1))/(14/(4/(-2))). -2/7 What is -3((-56)/12)/7? 2 Evaluate (4/8)/(14/8). 2/7 Evaluate (7/(-35))/((-2)/2). 1/5 (-27)/(-90)5/(-6) -1/4 Calculate 1/(((-495)/(-60))/(6/(-4))). -2/11 What is (-7)/14(-2)/1? 1 Calculate 15-2(-6)/(-108)3. -5 ((-1)/(-12))/((-20)/(-40))3 1/2 What is ((-33)/(-11))/(1/(2/3))? 2 What is the value of (((-4)/(-6))/(-1))/((-6)/(-9))? -1 Calculate 1((-2)/6)/((-3)/45). 5 Evaluate ((-2)/61)/1. -1/3 ((-4)/(-70))/((-1)/5) -2/7 What is 45/54(-63)/70? -3/4 What is the value of (-24/8)/(4/4)? -1 Calculate (-30)/20(32/3)/(-4). 4 Evaluate ((-4)/10)/(((-189)/(-30))/9). -4/7 ((-10)/(-575))/(3/(-15)) -2/23 Evaluate 6/(-7)(-131)/(-393). -2/7 What is the value of 2/164(-30)/(-135)? 1/9 Calculate 704/(-2640)5/(-8). 1/6 Evaluate (-46)/6918/(-4). 3 Evaluate (9/(-12))/(63/(-24)). 2/7 (-5)/((-5)/255) 5 Evaluate (175/(-21))/53. -5 Evaluate 4/(-6)93/248. -1/4 What is 20/(-18)11/(-55)? 2/9 What is (-3)/((-4)/(32/40))? 3/5 Calculate (20/(-40))/(2(-12)/(-8)). -1/6 Calculate (1/12)/((60/54)/10). 3/4 What is the value of (-2)/(-2)232/(-406)? -4/7 What is the value of (-20)/4(-18)/90? 1 Evaluate (0/(9/(-3)))/(-2). 0 (78/(-13))/((-3)/2) 4 What is 10/4((-18)/15)	{ "pile_set_name": "DM Mathematics" }
5 minutes after 8:52 AM? 5:47 PM How many minutes are there between 11:21 PM and 3:47 AM? 266 What is 249 minutes after 3:28 AM? 7:37 AM What is 655 minutes before 2:00 PM? 3:05 AM What is 634 minutes before 7:53 AM? 9:19 PM How many minutes are there between 1:20 PM and 9:33 PM? 493 What is 678 minutes after 8:14 PM? 7:32 AM How many minutes are there between 5:51 PM and 4:19 AM? 628 How many minutes are there between 8:07 AM and 1:11 PM? 304 How many minutes are there between 1:48 AM and 8:56 AM? 428 What is 405 minutes after 9:18 PM? 4:03 AM How many minutes are there between 7:54 AM and 1:18 PM? 324 How many minutes are there between 9:49 PM and 3:16 AM? 327 What is 322 minutes before 7:22 PM? 2:00 PM How many minutes are there between 3:34 AM and 3:05 PM? 691 What is 341 minutes before 8:04 PM? 2:23 PM How many minutes are there between 8:36 AM and 4:44 PM? 488 How many minutes are there between 3:52 PM and 3:39 AM? 707 How many minutes are there between 9:41 AM and 7:33 PM? 592 What is 558 minutes after 8:07 AM? 5:25 PM How many minutes are there between 1:27 PM and 2:06 PM? 39 How many minutes are there between 10:10 PM and 1:06 AM? 176 What is 709 minutes before 3:30 AM? 3:41 PM How many minutes are there between 10:59 AM and 7:39 PM? 520 What is 172 minutes before 3:32 PM? 12:40 PM What is 240 minutes after 9:05 PM? 1:05 AM How many minutes are there between 1:18 PM and 1:56 PM? 38 How many minutes are there between 9:45 AM and 6:13 PM? 508 What is 91 minutes before 12:24 PM? 10:53 AM How many minutes are there between 9:16 AM and 1:50 PM? 274 How many minutes are there between 10:09 AM and 5:42 PM? 453 How many minutes are there between 8:34 AM and 3:13 PM? 399 What is 454 minutes before 5:32 AM? 9:58 PM What is 137 minutes before 3:48 AM? 1:31 AM How many minutes are there between 11:04 AM and 3:50 PM? 286 What is 662 minutes before 2:31 PM? 3:29 AM What is 88 minutes after 3:43 AM? 5:11 AM What is 631 minutes after 1:28 AM? 11:59 AM How many minutes are there between 12:55 AM and 3:45 AM? 170 What is 101 minutes after 11:05 AM? 12:46 PM How many minutes are there between 12:37 PM and 11:53 PM? 676 How many minutes are there between 1:35 PM and 8:38 PM? 423 How many minutes are there between 2:09 AM and 4:47 AM? 158 What is 670 minutes after 7:21 PM? 6:31 AM What is 689 minutes before 3:40 AM? 4:11 PM What is 328 minutes before 7:31 AM? 2:03 AM How many minutes are there between 11:59 PM and 12:49 AM? 50 How many minutes are there between 5:48 AM and 3:55 PM? 607 What is 102 minutes before 2:46 PM? 1:04 PM How many minutes are there between 5:10 AM and 11:48 AM? 398 What is 202 minutes before 9:05 PM? 5:43 PM What is 36 minutes before 10:57 AM? 10:21 AM What is 77 minutes after 11:51 AM? 1:08 PM How many minutes are there between 10:11 AM and 12:33 PM? 142 What is 618 minutes after 4:13 AM? 2:31 PM What is 327 minutes after 6:39 PM? 12:06 AM What is 414 minutes before 10:09 PM? 3:15 PM What is 166 minutes after 12:14 PM? 3:00 PM What is 223 minutes after 5:59 PM? 9:42 PM What is 517 minutes before 6:49 AM? 10:12 PM How many minutes are there between 4:07 PM and 3:44 AM? 697 How many minutes are there between 4:00 PM and 9:04 PM? 304 How many minutes are there between 5:31 AM and 7:28 AM? 117 How many minutes are there between 9:21 AM and 2:21 PM? 300 What is 582 minutes before 3:46 PM? 6:04 AM How many minutes are there between 10:30 AM and 9:57 PM? 687 How many minutes are there between 6:49 PM and 12:07 AM? 318 How many minutes are there between 5:08 PM and 11:42 PM? 394 How many minutes are there between 9:21 PM and 8:00 AM? 639 How many minutes are there between 7:45 PM and 4:52 AM? 547 What is 543 minutes before 11:30 PM? 2:27 PM What is 139 minutes after 6:59 AM? 9:18 AM What is 186 minutes after 7:00 PM? 10:06 PM What is 44 minutes before 2:39 AM? 1:55 AM What is 419 minutes before 9:19 AM? 2:20 AM How many minutes are there between 12:19 PM and 2:06 PM? 107 How many minutes are there between 2:42 AM and 10:35 AM? 473 What is 69 minutes after 8:47 PM? 9:56 PM What is 197 minutes after 9:27 AM? 12:44 PM What is 51 minutes before 6:30 AM? 5:39 AM How many minutes are there between 7:44 AM and 4:07 PM? 503 What is 387 minutes after 11:38 PM? 6:05 AM What is 53 minutes after 1:17 AM? 2:10 AM How many minutes are there between 5:29 AM and 10:08 AM? 279 How many minutes are there between 11:24 PM and 10:29 AM? 665 How many minutes are there between 4:55 PM and 12:37 AM? 462 What is 111 minutes after 6:22 PM? 8:13 PM What is 115 minutes after 4:11 PM? 6:06 PM What is 714 minutes after 3:09 AM? 3:03 PM What is 91 minutes before 7:55 PM? 6:24 PM What is 337 minutes after 7:08 AM? 12:45 PM What is 418 minutes after 7:53 PM? 2:51 AM What is 48 minutes before 3:54 PM? 3:06 PM How many minutes are there between 5:01 PM and 4:28 AM? 687 How many minutes are there between 7:48 AM and 10:03 AM? 135 How many minutes are there between 10:07 PM and 4:07 AM? 360 How many minutes are there between 9:30 AM and 7:06 PM? 576 What is 153 minutes before 1:24 AM? 10:51 PM What is 661 minutes after 6:17 AM? 5:18 PM What is 203 minutes after 8:22 PM? 11:45 PM What is 60 minutes before 6:33 AM? 5:33 AM How many minutes are there between 10:24 AM and 5:20 PM? 416 How many minutes are there between 7:41 PM and 7:27 AM? 706 What is 342 minutes before 4:52 AM? 11:10 PM How many minutes are there between 4:49 AM and 12:13 PM? 444 What is 92 minutes before 9:19 PM? 7:47 PM What is 578 minutes before 9:16 PM? 11:38 AM What is 581 minutes before 1:40 PM? 3:59 AM How many minutes are there between 10:41 AM and 8:22 PM? 581 What is 688 minutes after 11:04 PM? 10:32 AM What is 197 minutes before 12:17 AM? 9:00 PM How many minutes are there between 3:04 AM and 10:52 AM? 468 What is 416 minutes after 10:36 AM? 5:32 PM How many minutes are there between 12:26 AM and 9:33 AM? 547 How many minutes are there between 8:20 PM and 12:34 AM? 254 What is 62 minutes after 7:27 AM? 8:29 AM What is 144 minutes after 5:19 PM? 7:43 PM How many minutes are there between 10:12 PM and 3:44 AM? 332 How many minutes are there between 12:11 AM and 8:23 AM? 492 What is 67 minutes after 10:25 PM? 11:32 PM How many minutes are there between 3:27 PM and 8:18 PM? 291 How many minutes are there between 3:58 PM and 5:14 PM? 76 What is 546 minutes after 4:02 AM? 1:08 PM How many minutes are there between 7:08 AM and 10:32 AM? 204 What is 253 minutes after 3:12 AM? 7:25 AM How many minutes are there between 3:47 AM and 10:51 AM? 424 How many minutes are there between 6:53 AM and 9:10 AM? 137 How many minutes are there between 12:22 AM and 4:33 AM? 251 What is 681 minutes after 12:59 PM? 12:20 AM What is 304 minutes after 4:40 PM? 9:44 PM How many minutes are there between 8:55 AM and 6:01 PM? 546 What is 243 minutes after 9:23 PM? 1:26 AM How many minutes are there between 3:39 AM and 9:06 AM? 327 What is 325 minutes after 2:05 PM? 7:30 PM What is 51 minutes before 11:33 PM? 10:42 PM How many minutes are there between 5:10 PM and 10:33 PM? 323 How many minutes are there between 5:56 PM and 8:02 PM? 126 How many minutes are there between 4:36 PM and 3:58 AM? 682 How many minutes are there between 1:33 AM and 9:19 AM? 466 What is 467 minutes after 5:51 PM? 1:38 AM How many minutes are there between 11:21 PM and 10:02 AM? 641 How many minutes are there between 4:20 AM and 10:46 AM? 386 How many minutes are there between 5:54 PM and 1:03 AM? 429 How many minutes are there between 2:09 AM and 9:56 AM? 467 What is 664 minutes after 3:50 AM? 2:54 PM What is 703 minutes after 10:53 PM? 10:36 AM What is 588 minutes after 11:40 AM? 9:28 PM What is 56 minutes before 6:46 PM? 5:50 PM How many minutes are there between 7:28 PM and 7:42 PM? 14 How many minutes are there between 3:59 PM and 7:14 PM? 195 How many minutes are there between 4:49 AM and 1:37 PM? 528 What is 195 minutes before 3:14 AM? 11:59 PM What is 153 minutes after 8:38 AM? 11:11 AM How many minutes are there between 4:46 PM and 4:14 AM? 688 How many minutes are there between 12:41 PM and 7:42 PM? 421 What is 318 minutes before 6:04 PM? 12:46 PM What is 605 minutes before 4:21 AM? 6:16 PM What is 92 minutes before 9:12 PM? 7:40 PM How many	{ "pile_set_name": "DM Mathematics" }
(a - 0). Put -5, d, h in descending order. d, h, -5 Let z be 22(14/(-196))/((-4)/14). Let v = 0.036 - 0.236. Put v, -0.4, z in decreasing order. z, v, -0.4 Let w = -30 - 9. Let r = 37 + w. Put r, -2/7, 2/3, 1 in increasing order. r, -2/7, 2/3, 1 Let q = -13774 + 13769. Let j = 0.8 - -3.2. Put -4, 0.1, q, j in decreasing order. j, 0.1, -4, q Let v = 65 + -60. Let i = 22.2 + -20. Put v, i, -4 in decreasing order. v, i, -4 Suppose 4 = 3c - 5. Suppose 4v = 40 + 8. Let n be 18/24 - 45/v. Sort c, n, 6 in decreasing order. 6, c, n Let r = -2.308 - -2.348. Sort r, -29, -0.4, -2/15 in ascending order. -29, -0.4, -2/15, r Let j = -211 + 635/3. Let t = -4.4 - -4. Sort j, -2/7, t in increasing order. t, -2/7, j Let a = -36 - -39. Let u(o) = -o3 + o2 + o + 5. Let d be u(0). Suppose dz - 1 = 4. Sort 5, a, z. z, a, 5 Let h = -86.9 - -173.3. Let v = h - 86. Sort v, -0.1, -0.06. -0.1, -0.06, v Let h be 6 + -5 + 8 + -5. Let k = 0.7 + -1. Sort 3, h, 1/5, k in descending order. h, 3, 1/5, k Let s = -393/1604 - 2/401. Put 1, -8/7, -2, s in decreasing order. 1, s, -8/7, -2 Let i(y) = -y*2 + y + 58. Let d be i(8). Put d, 1.97, 0.5, 2/9 in ascending order. 2/9, 0.5, 1.97, d Suppose 2d - 4f + 24 = 7d, d - 2f - 2 = 0. Suppose k = -dv - 12, -3k - v + 6 = -3v. Sort 11, k, 5 in descending order. 11, 5, k Let m = -0.2 + 0.1. Let z = 2 - 1/3. Let c = z + -1. Put m, c, 2 in ascending order. m, c, 2 Let a be -7 + 15/5 - (-12 + 4). Put -1, a, -67, -5 in descending order. a, -1, -5, -67 Let t(z) = -5z + 23. Let l be t(5). Sort -1, 3, l, -9 in ascending order. -9, l, -1, 3 Let d(t) = -10t + 5. Let o be d(2). Let j be o/(-3) + -3 + 0/(-6). Put 3, j, -3/4 in ascending order. -3/4, j, 3 Let c be -2((-40)/(-16) + -2). Put c, -6/5, 13/2 in descending order. 13/2, c, -6/5 Let z = -1174/9 - -136. Let f = z + -368/63. Suppose -2v + 5v - 12 = 0. Sort 3/7, f, v in descending order. v, 3/7, f Let s = 8.912 + -9. Sort 0.5, s, 2/3 in increasing order. s, 0.5, 2/3 Suppose -4w - 16 = 4p - 2p, -12 = -3p. Let l be (w/1)/((-9)/6). Sort 0, -5, l in descending order. l, 0, -5 Let d = 0 + 0. Let t be (-12)/(-33) + 867/187. Put t, -2, -4, d in descending order. t, d, -2, -4 Let y = 110 - 106. Suppose 0 = 4r - 7r + yr. Put -4, -2, r, 4 in descending order. 4, r, -2, -4 Suppose 0 = 5s + 1 - 21. Suppose 4x = -3b + b - s, -4b = -x - 1. Let h = 2.5 + -2. Put 1, b, h in ascending order. b, h, 1 Let d = 22 + -64. Let i = 41.5 + d. Let p be 2/(9 - 0/2). Sort i, -2/7, p. i, -2/7, p Let d = 4.9109 + 0.0891. Sort 13, -0.01, d, -5. -5, -0.01, d, 13 Suppose -325 = 6k - 71k. Sort 4, -20, k in decreasing order. k, 4, -20 Let i = -3437.979 - -3440. Let d = i + -0.021. Put 2/11, 0.3, d, 0 in decreasing order. d, 0.3, 2/11, 0 Let i = 0.13 + 0.27. Let g(c) = -c*2 - 11c - 25. Let y be g(-7). Sort -1/2, y, i. -1/2, i, y Let a = 0.092 - -18.108. Let b = 19 - a. Sort 1, b, 0.3. 0.3, b, 1 Let o = 1/2 - 5/18. Sort -1/4, o, 0.36 in descending order. 0.36, o, -1/4 Let y = 124 - 124. Sort y, -4, 29. -4, y, 29 Suppose 21 = -3m - 24. Let n be ((-36)/m)/(-4)97. Let k = n + 58. Sort k, 5, -0.1. k, -0.1, 5 Let z = -163 + -27. Let l = z + 190. Suppose 5d + 2u = -15, -8 = -3d - 4u - 3. Sort d, 11, l. d, l, 11 Suppose 3p + 2a = 13, 0 = 3a - 6 - 0. Suppose 0 = -3c - pc - 30. Put c, 0.06, -1 in decreasing order. 0.06, -1, c Suppose -46 = -3q - i - 163, 6 = 2i. Let j be (32/q)/(1/(-10)) + -3. Put -2, 6, j in increasing order. -2, j, 6 Let i = 17.73 + -17.77. Put i, 1, 0.038 in descending order. 1, 0.038, i Suppose 3s + 40 = -5s. Let l = 3 - 1. Suppose li - 4c + 5 = -1, 3i = -5c + 24. Sort s, 0, i. s, 0, i Let u = -24 - -41. Suppose u = 4t + 5. Sort t, -5, 3/7 in ascending order. -5, 3/7, t Let r = 12 - 12. Let s be r/(((-1)/(-1))/(-1)). Put -9, s, -5 in descending order. s, -5, -9 Let o = 17 - 15.8. Let w = o + -10.2. Let v = w + 8.9. Put v, -6/7, -2/3 in descending order. v, -2/3, -6/7 Suppose 8 = 3o + 3j - 10, -o + 8 = 3j. Let m = -4736 + 4731. Put 1, o, -1, m in decreasing order. o, 1, -1, m Let s(a) = a - 9. Let f be s(-9). Let b = -15 - f. Suppose j + bj + 8 = 0. Sort j, -2/7, -1 in decreasing order. -2/7, -1, j Suppose -u - 22 = -m, 5m + 3u - 45 - 33 = 0. Let q(n) = -n*3 - 3n*2 + 3n + 4. Let k be q(-3). Sort -3, k, m. k, -3, m Let h be (-6)/(-3) - (-64)/(-30). Let y be (24/(-56))/((-4)/(-8)). Let d = 1 + 4. Sort y, d, h in ascending order. y, h, d Let z = 59.35 + -0.35. Let p = -59.3 + z. Put -1/3, -0.1, p, 0 in increasing order. -1/3, p, -0.1, 0 Let o be (0 - -2 - -4)/(-2). Suppose 44f - 43f - 3 = 0. Put f, -1, o in descending order. f, -1, o Suppose -2p + u = 16 - 40, 8 = 2p - 5u. Suppose -14o = 84 - p. Let r(x) = -x3 - 4x*2 + 4x - 3. Let n be r(-5). Sort o, 0.1, n in decreasing order. n, 0.1, o Let i = -41 + 52. Sort 0.4, i, 5 in decreasing order. i, 5, 0.4 Let w = -18 + 23. Let s be (32/12)/(1 - 10/6). Put s, w, -3, 0 in descending order. w, 0, -3, s Let z(g) = g*3 - 3g*2 + 3g - 2. Let q be z(2). Let m(c) = -3c. Let t be m(-8). Let f = 19 - t. Sort -2, f, q. f, -2, q Let v be ((-4)/(-54))/(17/(-51)). Let o(r) = 2r*3 + 11r*2 - 7r - 1. Let a be o(-6). Put -1/8, a, -1, v in descending order. a, -1/8, v, -1 Suppose -20i + 20 = -15i. Sort 1, -5, i, -8. -8, -5, 1, i Let h be (-3(-4)/36)/((-9)/(-81)). Sort h, 2, 4, -4 in ascending order. -4, 2, h, 4 Let k be (-54)/(-15) + 21/(-6). Put -0.3, 4, k in increasing order. -0.3, k, 4 Let x = 35.1 - 31. Let d = x - 3. Let t = -1.4 + d. Sort 5, -0.2, t in decreasing order. 5, -0.2, t Suppose 227 = -5i + 217. Sort 1, 19, i in decreasing order. 19, 1, i Let z = -1.9771 - 0.0229. Put 2, z, -4, -0.21 in descending order. 2, -0.21, z, -4 Let c = 519 + -1559/3. Sort -2, c, -24, 0.4 in decreasing order. 0.4, c, -2, -24 Suppose 0u - 4u + 5p - 25 = 0, 3u = -4p + 20. Let f(q) = -q3 + 9q*2 - 11q + 11. Let k be f(8). Let l = k - -14. Sort u, 3, l in ascending order. u, l, 3 Let f be (-11)/(-4) - (-1)/(-4). Let j be (-8 + 272)(-12)/16. Let m = j - -193. Sort f, 0.4, m in descending order. f, 0.4, m Let o be (-3 - 126/(-44))8/(-6). Let m = -72 - -67. Put -1/8, m, -0.1, o in decreasing order. o, -0.1, -1/8, m Let z = 3.6 + -3.8. Let m = 3.63 + 3.37. Sort 1/3, z, m, -1/2 in decreasing order. m, 1/3, z, -1/2 Let u = 5 + -4.85. Let d = 0.05 - u. Let z = d - 0.2. Put z, 3, 0 in descending order. 3, 0, z Let i(s) = -s. Let l be i(-5). Suppose -23 = -lx + 3f, -f - 3 = 2x - 10. Suppose 1 = -5q + 4k - 7, -q - 2k = -x. Sort q, 2, -5 in decreasing order. 2, q, -5 Let u be 102/2011. Sort -6, u, 1 in decreasing order. u, 1, -6 Suppose 25d = d - 48. Suppose n - 4b = -20, 0b = -3n + 2b - 20. Sort n, 4, 0, d in ascending order. n, d, 0, 4 Let o = 30.76 + -31. Let b = o - -0.34. Put -5, b, 3/5 in increasing order. -5, b, 3/5 Suppose 3 = -y, -y = 3c - 4y. Let g = 606 + -609.43. Let h = g - -3.4. Sort h, c, -2 in decreasing order. h, -2, c Let k be 1 - ((0 - 1) + 4). Suppose 0 = -5n + 2b - 21, -2n - 15 = -15b + 12b. Sort 4, k, n, 3. n, k, 3, 4 Suppose -l - 9 = -3i + 7i, 9 = 3l. Let q = -4 + 1. Let b = q + 2. Sort i, 5, b. i, b, 5 Let x = -205 - -193. Let z = -15.5 + 16. Sort z, x, 2/9 in decreasing order. z, 2/9, x Let y be -12 - (-2 - -1) - 0/1. Let r be 412/16 - 0. Put y, r, 4 in increasing order. y, r, 4 Let m = 197/12 - 415/36. Put -0.3, 5, m in decreasing order. 5, m, -0.3 Suppose 3l = 5h - 3, 0 = 2h + l - 0 - 10. Let n = 2 + -1. Let a be n4/2 - 2. Put h, -1, a in decreasing order. h, a, -1 Let v = 14 + -17. Let u = v + 9/4. Put u, 0.03, 2 in descending order. 2, 0.03, u Let o = -1.819 - -1.699. Sort o, 5, 0.25 in ascending order. o, 0.25, 5 Suppose -53r = -35r - 54. Sort 13, -1, -3, r. -3, -1, r, 13 Let d = -33 + 28. Sort 5, -4, d, 1 in descending order. 5, 1, -4, d Let y = -39 + 39. Let q(s) = -s*3 - 7s*2 - 5s + 1. Let g be q(-6). Let f be -2 - g - (-1 + 1). Sort y, f, -2 in ascending order. -2, y, f Suppose 4z - 10 = -2d - d, -2z - 5d = 2. Let w = 245/1062 + -1/118. Suppose -5l - 2v = 9, 12 = l + 4v + 3. Put w, z, l in ascending order. l, w, z Let k(d) = -d3 + 9d*2 + d + 2. Let q be k(9). Suppose 2g + g = -3o + 21, -3o + q = g. Let x be (0 - 1) + 0 + 0. Sort x, 0.2	{ "pile_set_name": "DM Mathematics" }
g + 27, 0g - 19 = -o + 4g. Let a(u) = -u3 - 2u - 1. Let s be a(o). Let j(x) = 3x2 - 2. Is j(s) a prime number? False Suppose 0h + 225 = 3h. Suppose 114 = 2s + 3k - 4k, s = -4k + h. Is s prime? True Let t be (7 + -2)/(1/2). Let y = t + -6. Suppose 0 = -yz + 5z - 13. Is z a composite number? False Suppose -3x - 6 = -0x. Let m be (-3)/x + (-6)/4. Suppose -3g + 104 = v, m = -g - 7v + 2v + 30. Is g a prime number? False Suppose -25 + 4 = -3z. Is z a prime number? True Let v(r) = 25r + 5. Let j be v(5). Let b(n) = 61n3 - 2n*2 + n + 1. Let x be b(-1). Let y = j + x. Is y a composite number? False Let h = -2 + 4. Suppose 5n = hn + 3. Let r = n - -9. Is r composite? True Let z = 1654 - 740. Is z prime? False Let h be (2 - 3)/((-2)/6). Let k be (h + (-15)/3)-11. Suppose u = -u + k. Is u a composite number? False Suppose -166 = -5c + 5v + 254, 3c = 2v + 253. Is c a prime number? False Suppose -3u + 50 = 2u. Let n = u + -7. Is 58/n - (-2)/(-6) a prime number? True Let m be (-3 + 10/5)-67. Let g = 28 - 12. Let s = m - g. Is s prime? False Let t = -172 + 759. Is t prime? True Let j = 1 + -3. Let g = 3 - j. Suppose -4a + ga = 127. Is a composite? False Let q = 139 + -84. Is q a composite number? True Suppose 0 = -q - 2q + 885. Is q composite? True Suppose 5z + 2s - 14 = -0s, -2z = -4s - 20. Suppose -z = 7j - 3j. Is j + -8-21 prime? False Let d(k) be the third derivative of k5/60 + k4/6 - 3k*3/2 + 4k*2. Suppose -7 - 17 = -4v. Is d(v) a composite number? True Is (-1866)/(-7) - 45/(-105) a prime number? False Let p be (-4)/14 + 176/28. Let l = p - -1. Let w(q) = 10q - 1. Is w(l) a composite number? True Suppose -n - 299 = -2n. Is n composite? True Let y be 68 + -4 + 3 + 0. Let p = y - 48. Is p prime? True Suppose 3c - 737 - 22 = 0. Is c prime? False Suppose 0 = 3v - 4l + 26, v + 3l - 2 = 11. Let h = v + 17. Let i = 24 - h. Is i composite? True Suppose -2q + 1161 - 321 = 0. Suppose -4v = x - 351, 3v - q = -2v - 5x. Is v a prime number? True Let b be ((-3)/(-6))/(3/18). Suppose -8 + 2 = -bn. Suppose -z + 39 = n. Is z a prime number? True Is (-2)/7 + (-4800)/(-140) a composite number? True Let p = -146 - -553. Is p a composite number? True Suppose -2i + 5h = -25, 7i + 4h - 8 = 3i. Suppose -2b = 23 + i. Is (-1 + 3)/(b/(-1043)) composite? False Let f(q) = 4q2 + 16q + 6. Let t be f(13). Suppose t = 5u + 195. Is u composite? False Let k = 272 + -85. Is k prime? False Suppose 4 = 5k - 31. Is k composite? False Let r(a) = a3 + a2 + a + 29. Suppose 3o + 4s = -2o, -3o = 3s. Let c be r(o). Let t = c + -14. Is t composite? True Suppose 0 = -2b - 5f + 185, 2b + 50 = -2f + 226. Is b a composite number? True Let c(b) = 24b*3 + 2b*2 - 2b + 2. Let t be c(2). Suppose 5u - t - 47 = 0. Is u a prime number? False Let b(d) = -d2 - 16d + 5. Let g be b(-10). Let r be (6 - -1)/(1/6). Let l = g - r. Is l a composite number? False Let l(z) = z*2 + 2z + 2. Let w(m) = 4m3 + m2. Let h be w(1). Let n be l(h). Suppose -r + n = -0r. Is r prime? True Suppose -3d - 21 = -2d. Let l = 40 + d. Is l prime? True Let x(j) = j - 5. Let g(v) = -3. Let h(q) = -3g(q) + 3x(q). Is h(7) a prime number? False Suppose 0 = -0j - 4j - c + 4278, -c + 3209 = 3j. Is j composite? False Let u(d) = 7d + 2819. Is u(0) a prime number? True Let c(r) = -r + 6. Let l be c(5). Let w be -9(l + (-3 - -3)). Is 4/18 - 196/w a prime number? False Suppose 0y + 4y - 1580 = 0. Is y a composite number? True Let o(h) = 7h + 6. Let l be o(-5). Let b be (1 - -5)/((-2)/l). Suppose -2k + 46 = 4y - 3y, 0 = 3k - 3y - b. Is k prime? False Let g be 2/(-4) - 1039/(-2). Let c be 1 - g(2 + -3). Suppose 2s + 5o = 159, 5s = 5o + c - 210. Is s a composite number? False Let x = 3 - 2. Let h be -28 + (-1 - -1)x. Let o = 57 - h. Is o a composite number? True Suppose 2o - o = 6. Suppose 78 = 3u - 0n + 3n, u + 5n - o = 0. Let q = 7 + u. Is q a prime number? False Let g be 7/(-21) + 1/3. Suppose 0 = 3v - gv - 33. Is v composite? False Suppose 3o - 15 = 3. Let y be (-1)/(-3)(o - 0). Suppose 4w = -0x + yx + 6, 0 = w + 3x - 12. Is w a composite number? False Let z = 7 - 5. Let w(j) = 2j3 + j2 - j + 1. Is w(z) prime? True Let b be (-2)/(-1 - -3) - -27. Let j = b - -63. Is j composite? False Let l be 108/(-26) + (-2)/(-13). Is (326/4)/((-2)/l) a prime number? True Let c = 2 + 2. Suppose c = 4d, -2u + 5d = 2d + 3. Suppose -2z = -uz - 106. Is z composite? False Let i(m) = m - 2. Let s be i(8). Suppose 0 = -3b + 18. Suppose -8 = 3a + sn - 2n, -a - 2n = b. Is a a prime number? False Suppose -4263 = -12f + 3357. Is f composite? True Suppose 3w - 1470 = 3m, 0 = -3w - 0m - 3m + 1452. Is w a prime number? True Suppose 0 = c - 19 - 3. Let s be ((-1)/(-1) - 2) + 0. Let u = s + c. Is u composite? True Suppose 0 = -q - q. Suppose 0 = x - 1 - 1. Suppose -j + q = 2z - 9, 0 = -2j - xz + 28. Is j a prime number? True Let c(r) = r3 + 8r*2 + 8r + 7. Let v be c(-7). Suppose k + vk = 89. Is k prime? True Suppose -3o = v + 461 - 1232, -o - v = -257. Is o prime? True Is (-208)/(-10) + 19/95 composite? True Let h be (-4)/(-10) + 16/10. Let y(x) = 48x + 1. Is y(h) a prime number? True Let b = 125 + 344. Is b composite? True Suppose 9 = -5o - 1. Let s be -2 + (-6)/o + 6. Let m = -4 + s. Is m a prime number? True Suppose -5o + 1 = 4h, 0h + 3h + 5o = 7. Let c be h/(-1) - (-8)/(-4). Suppose 5j = -cl + l + 250, -5j + 5l + 290 = 0. Is j a prime number? True Suppose -4l + 1365 = -3q, -4q - 2l = -3l + 1820. Let y = q - -802. Is y a composite number? False Suppose -2u + 8 + 6 = 0. Suppose 3m - 8 = u. Suppose -g - 19 = c - 6c, 5c = mg - 5. Is g a prime number? False Let a = 22 + -8. Let q = 27 - a. Is q a composite number? False Let c be 22/8 + (-2)/(-8). Let k be ((-3)/c7)/(-1). Is (k/2)/((-3)/(-6)) prime? True Let a = 211 + -90. Is a composite? True Let v(k) = 374k - 7. Is v(3) prime? False Let c(a) = 84a - 5. Is c(4) a prime number? True Let x(u) = 4u - 19. Is x(14) prime? True Let m be -4 + 3 + 113. Suppose 3b + 0b = -m. Is (-3 - b)137 a composite number? False Let g = 179 - -128. Is g prime? True Let u = -87 + 53. Suppose -5j = -4j - 35. Let s = j - u. Is s prime? False Suppose -63 - 4 = -n. Is n prime? True Suppose z + 2494 = 3z. Is z composite? True Suppose -s - x = -1364, 0 = -2s + 6s + 5x - 5459. Is s a composite number? False Let x = -629 + 1076. Is x a prime number? False Let q(s) = -2s - 20. Let g be q(-14). Let c = g - -6. Is c a prime number? False Let s be (-6)/(-5) - (-4)/(-20). Let j be (1 + 0)s + -73. Let t = j + 125. Is t a composite number? False Let w(h) = 2h + 1 - 4 - 3h. Let x be w(-5). Suppose -2d - 54 = -3q - q, -xd - 10 = 0. Is q prime? True Let s(n) be the first derivative of n2 + 1/3n*3 - 2 + n - 11/4n*4. Is s(-1) a prime number? True Let r = 27 - 17. Let i(d) = -d + 14. Let v be i(r). Suppose x - 20 = 2f - 7, 0 = -x - vf - 5. Is x prime? True Let v be (0 - 3) + 13 + -9. Let d(c) = 204c*2 - c. Is d(v) a composite number? True Let g(x) = -560x*2 + x. Let y be g(1). Let o = 794 + y. Is o prime? False Suppose 2i - 115 = 211. Let s = i - 14. Is s a composite number? False Is (1556/(-6))/(22/(-33)) a composite number? False Let w be ((-1 - -2) + 0)-7. Let m = -2 - w. Suppose -3k - 258 + 1031 = -mf, -2f + 494 = 2k. Is k composite? False Let r(n) = n + 2. Let x be r(2). Suppose -3o + 13 = -w, 0 = xo + o + 5w - 35. Suppose -oc = -110 + 15. Is c prime? True Let f be 4/(-6)(6 + -9). Is 83/(f + 2/(-2)) composite? False Suppose -91 - 58 = -2o - 3l, -2o - 5l = -159. Is o a composite number? False Let t be 1/2 - (-7273)/(-14). Let x = t + 778. Is x prime? False Suppose 0k + 3k = 471. Is k prime? True Suppose w - 3w = 0. Suppose 7k - 370 = -u + 2k, w = -u + 4k + 415. Is u composite? True Suppose -3j = -7j + 8. Suppose -jb + 5 = 1. Suppose 28 = 6p - bp. Is p composite? False Let w = 118 - 79. Suppose 0t - t + w = 0. Is t a prime number? False Let j = 140 - 57. Is j composite? False Suppose -2p - 5 = -5o + 2o, 0 = -3p - 5o + 21. Suppose 153 = n - 0k + pk, 3n - 419 = 4k. Is n prime? False Let t(k) = -3k - 1 -	{ "pile_set_name": "DM Mathematics" }
- 13 = 0. Let f(t) be the third derivative of t5/60 + t4/8 + t3/2 + t2. What is the units digit of f(w)? 7 Let t(i) = -i*3 + 6i*2 - 5i - 6. Let n = -9 - -14. Let k be t(n). What is the units digit of (k/(-4))/(27/342)? 9 Let d be 141 - 4/(-4). Let w(a) = -d - a + 54 + 2a. What is the units digit of w(-7)? 5 Let z(l) be the third derivative of -7l4/8 - l3 + 10l*2. What is the tens digit of z(-2)? 3 Let u be (1 + -4)/(12/(-16)). Let w(x) = -x + 5. Let a be w(u). Let j = a - -7. What is the units digit of j? 8 Let v = -4 - -8. Suppose vr - 7 = -5s, -5r - 11 + 1 = 0. Suppose -sm + 2k + 14 + 12 = 0, -5k + 25 = 0. What is the units digit of m? 2 Suppose 3t - 6t + 1704 = -5b, -4t + 2283 = -3b. What is the units digit of t? 3 Suppose 3u + 2u = 3c - 24, u = 4c - 15. Let w be -1 + 5 + (89 - u). Suppose 5t - w - 114 = 0. What is the units digit of t? 2 Let u = 146 - 115. Let v be (-162)/21 - (-2)/(-7). Let g = u + v. What is the tens digit of g? 2 Suppose 5t = 3h + 1035 + 1157, -t - h + 432 = 0. Suppose -5m + 218 = -3m + c, -t = -4m + 4c. What is the tens digit of m? 0 Suppose 4l - 13 = -1. Suppose 210 = ly + u, 3u - 4 + 64 = y. What is the units digit of y? 9 Suppose 119 - 14 = 7u. Suppose -4x - 528 = -ux. What is the units digit of x? 8 What is the tens digit of ((-76)/16)/(-19) - 3398/(-8)? 2 Let c(u) = -u3 + 32 - 2u*2 - 28 + 3u*2. Let z be (0 + (-2 - -2))/1. What is the units digit of c(z)? 4 Suppose -2y + 953 - 199 = 0. What is the tens digit of y? 7 Let y = 1255 - 732. What is the tens digit of y? 2 Let h(d) = d + 2. Let v be h(-2). Let s be 1 - (-68)/(-4) - v. What is the units digit of 1/(-2)(s + 6)? 5 Let v = -1655 - -2555. What is the hundreds digit of v? 9 Let f(n) = 67n - 85. What is the units digit of f(2)? 9 Let s = -569 + 844. What is the hundreds digit of s? 2 Let i = -32 + 195. What is the hundreds digit of i? 1 Let d(y) = 6y2 + y2 + 16 - 5y - 19 - y*3. Suppose 10o = 5o + 10, -10 = -5m + 5o. What is the tens digit of d(m)? 2 Suppose -11700 = -5o + 4v, -v = -3o - 1481 + 8508. What is the hundreds digit of o? 3 Suppose -3b = -5s - 22, 5s = 5b - 41 + 11. Suppose q + y - by = 178, 0 = -q + 2y + 179. What is the hundreds digit of q? 1 Suppose v + 20 = 5v. Suppose vp + 3s = 4s + 4, 5p = 2s + 3. Let h = p + 4. What is the units digit of h? 5 Suppose 0m + 2m = 3o - 1108, 1660 = -3m + 5o. What is the tens digit of (1 - 0) + m/(-14)? 4 Let s = -8992 + 13522. What is the thousands digit of s? 4 Let l = 2134 - 1488. What is the hundreds digit of l? 6 Suppose -3k - 3s = 78, 9k - 3s = 4k - 98. What is the tens digit of (k/33)/((-6)/333)? 3 Let m(d) = d*2 + 2d - 5. Let y be m(-4). Let g(v) be the second derivative of v*3/3 - 2v*2 + 4v. What is the units digit of g(y)? 2 Suppose x + 8 = 4q, -16 = -3x - 3q + 5. Suppose 5f - xv = 22, 0v - 11 = -4f + v. What is the units digit of f? 2 Suppose 2z - 24 = 6z. Let s = z - -8. Let f(a) = a3 + 4a*2 - 5a. What is the units digit of f(s)? 4 Suppose -2v - 2p + 1260 = 0, -v = 3p - 423 - 197. What is the tens digit of v? 3 What is the hundreds digit of (4080/112)/(3/21)? 2 Let s be (-190)/(-25) - 6/(-15). Let y = -4 - s. What is the tens digit of (y/24)/(1/(-98))? 4 Let i(z) = -36z + 23. What is the tens digit of i(-9)? 4 Let w = 2315 + -1193. What is the units digit of w? 2 Suppose -61y + 6y + 95920 = 0. What is the tens digit of y? 4 Let t(v) = 66 + 0 - 14 - 5v. What is the units digit of t(-9)? 7 Let i(h) = -9h - 10. Let m(n) = -n - 1. Let c(y) = i(y) - 3m(y). Suppose 2 = 4j + 26. What is the units digit of c(j)? 9 Let p be (-4 + (6 - 3))0. Suppose f = -2y + 10, p = 2f + f - 4y + 10. Suppose -8 = -fx + 26. What is the tens digit of x? 1 Let o(t) be the first derivative of 9 - 28t*2 + 11t*2 + t + 11t2. What is the tens digit of o(-1)? 1 What is the tens digit of (7 - 91/14)/((-2)/(-1792))? 4 Let g = -733 + 1516. What is the hundreds digit of g? 7 Let s(n) = n3 - 7n2 + 6n - 12. Let y be s(8). What is the tens digit of y - 4(-5)/(-20)? 9 Let v = 1771 + -1231. Suppose x + 5x - v = 0. What is the units digit of x? 0 Suppose -3s - 17 = n + 4n, 0 = 4s + 5n + 16. What is the units digit of (s + -2)/(-2)106? 3 Suppose 32 - 11 = -7s. What is the units digit of -3 - s/1 - 178/(-2)? 9 Suppose -2f = 10, f = -2s - 7 + 2. Let b be s/((-4 - -2)/2). Suppose 0y - 3y + 24 = b. What is the units digit of y? 8 Let d(t) = -7t3 - 2t2 + t + 10. What is the tens digit of d(-5)? 3 Let b(r) be the first derivative of r3/3 + r*2/2 + 25r - 8. Let s be b(0). Let i = -18 + s. What is the units digit of i? 7 Let n = -45 - -19. Let p = 24 + n. What is the units digit of ((-8)/p - 8)/(-2)? 2 Let z(m) be the second derivative of m4/3 + m3/2 - 2m2 + 2m. Let r be z(-3). Suppose 0 = 2l - r - 39. What is the units digit of l? 1 Let a(d) = -d2 + 2d + 9. Let m be a(4). Let r(i) = -20i + 6i3 + 1 - i2 + 20i. What is the units digit of r(m)? 6 Suppose 7 = 2t - 3z, -1 = t + z + 2z. Suppose 5l + tk - 123 = 0, -5k = 6 - 26. What is the units digit of l? 3 Suppose -48t + 63120 = -0t. What is the units digit of t? 5 Let f = -197 + 141. Let j = f + 149. What is the units digit of j? 3 Suppose 14a + 1470 = 21a. What is the hundreds digit of a? 2 What is the hundreds digit of (1 + 3 + -9 + 303)4? 1 Let i be (-374)/14 - -1 - 48/168. What is the units digit of (-5)/15 - i/6? 4 Suppose q = -q - 36. Let h be (q/5)/((-4)/10). Let w = h - 5. What is the units digit of w? 4 Let b(d) = -d - 1. Let c(j) = 7j + 3. Let n(g) = 6b(g) + c(g). Let k be n(3). Suppose -3 = -kt - t. What is the units digit of t? 3 Let w = 10 - 8. Let o be w/13 - 287/91. What is the tens digit of (-4 - -1)(o - 9)? 3 Suppose -127 + 777 = 25j. What is the tens digit of j? 2 Let c = 1228 - 513. Let l be (-4)/(-14) + c/(-77). Let d = l + 18. What is the units digit of d? 9 Suppose 5d - 4a = -84, -2d - a - 15 = -d. What is the tens digit of (19 + d)118/6? 5 Let q = 2 + -11. Let m be (-8)/(-6)q/(-6). Suppose 2g + 4s - 5 = 11, mg = -2s + 12. What is the units digit of g? 4 What is the units digit of (1732/(-6))/(67/(-63))? 3 Let j(f) = -2820f + 20. What is the hundreds digit of j(-1)? 8 Let k(s) = 3s2 - 3s + 2. Let z be k(3). Suppose 52h = 54h + 186. What is the tens digit of (-5)/z + h/(-4)? 2 Let g(z) = -z*2 - 12z + 1. Let j be g(-12). Let k(s) = s2 + s2 + j + 9s + 4 + 0s*2. What is the tens digit of k(-6)? 2 Suppose -4d = -n + 1206, -3n + 4d - 8d = -3666. What is the tens digit of n? 1 Let r = -19 + 24. Suppose o = 10 - r. What is the units digit of (-75)/o4/(-6)? 0 Let a(t) = 0t + 3t - t*2 - 7 + 3t2 + t. What is the tens digit of a(-7)? 6 Let i(m) = m3 - 11m2 - 28m + 3. What is the hundreds digit of i(16)? 8 Let n = -972 + 1569. What is the tens digit of n? 9 Suppose 7h - 880 = 2h - 4k, -5k = -3h + 528. Suppose f = -4z - 8 + 332, 2z - h = -4f. Let i = -44 + z. What is the tens digit of i? 3 Let x(t) be the second derivative of -t*4/12 - 5t3/6 - t2 - 5t. Let s be x(-6). What is the units digit of (-2)/s + 86/8? 1 Let t(q) = q3 - 2q*2 - 8q + 4. Let z be t(4). Let d be 47 + (z/1 - 6). Suppose -6p = -5p - d. What is the tens digit of p? 4 Suppose -1908 + 6 = -4x + 2p, -5p - 15 = 0. What is the units digit of x? 4 Let b = -9 - -57. Suppose -6d = -216 - b. What is the tens digit of d? 4 Suppose -26s + 92680 = 27602. What is the thousands digit of s? 2 Suppose 5y = 3w - 1397, -5w - 2y + 1854 = -w. What is the units digit of w? 4 Let k = -114 - -165. Suppose 2z = -3z - 3u + 117, 3u + k = 3z. What is the tens digit of z? 2 Let n(t) = -3t - 39. Let r be n(-23). Suppose 76 = v - r. What is the tens digit of v? 0 Suppose 2x = -9 + 25. Let l = x - -23. What is the tens digit of l? 3 Let b(u) = 6u3 - 2u*2 + u. Let g be b(1). What is the tens digit of (-118)/(-4)(g - 3)? 5 Suppose -2g = -7g + 280. Suppose -l - 4q = l - 168, -5q = -l + g. What is the units digit of l? 6 Let q(m) be the second derivative of 0 + 1/6m3 - m + 8m*2. What is the units digit of q(12)? 8 Suppose -8o = -2k - 13o + 1869, 5*k - 4686 = o. What is th	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.