Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
-2x2 + 7x. Let y be g(6). Let b be (24/(-9))/(4/y). Suppose -5o = -3w - 122, 2o - o = 5w + b. Does 12 divide o? False Let a be (254/2)/(-1 - -2). Suppose 7w - 2w = -25, 5w = -3j - a. Does 8 divide 3/((-6)/j) - 1? True Let b(v) = -v*3 + 10v*2 + 10v + 16. Is b(11) a multiple of 5? True Suppose 5 = -p - 2z, -2p - 13 = -p + 4z. Is 16 a factor of (-5 + p)/(2/(-16))? True Let i(d) = d - 20 + d + 0d + 7. Is 4 a factor of i(10)? False Let t(f) = f*3 + 7f*2 - 12f - 7. Let g be t(-8). Suppose 5s + 70 - g = 0. Does 6 divide 44/(-6)s/6? False Let r(a) = 135a2 + a. Let w be r(1). Suppose 5j - w = j. Is j a multiple of 12? False Suppose 2y + 3q - 23 = 0, 0 = -5y + 6y - 2q + 6. Suppose -11 = -yz + 1. Suppose -r = -zr + 50. Is 12 a factor of r? False Suppose -4j = -j + 267. Let k = -55 - j. Is k a multiple of 17? True Suppose 3u + 2u - 360 = 0. Suppose 3q + 0q = -5j + 172, 2j - 2q - u = 0. Suppose -4b = 5m - 37, -2m = -2b + m + j. Is 13 a factor of b? True Let j(r) = r3 - 7r*2 - 2. Let b be j(7). Is 22 a factor of b/(-4) - (-43)/2? True Let h(c) = -3c3 - c2 + c - 1. Let r be h(1). Suppose -4k - z + 3 = -3k, -3 = 5k - 4z. Is r + 10 - (-1 + k) a multiple of 2? True Let v(n) = 2n2 - 3n - 1. Let a be v(-1). Suppose -4s - 84 = -af - 0s, f = 2s + 16. Does 20 divide f? False Let n = -5 - -9. Is 4 a factor of n? True Suppose 4h + 2 = 4l - 2, -2l - 14 = 2h. Let c(j) = j + 5. Let r be c(h). Is 11 a factor of 1 + -15(-2 + r)? False Suppose -3h + 252 = 4z, -4h - 3z - 44 = -373. Does 10 divide h? True Suppose 18k - 5k = 2067. Is k a multiple of 17? False Suppose -5b + 11 = 1. Does 8 divide (62/(-5))/(b/(-5))? False Suppose -156 = 4w - 668. Does 16 divide w? True Suppose -r - 54 = 5f - 2f, -4r - 209 = 5f. Let p = 90 + r. Is 19 a factor of p? False Suppose 4f + 2k = 5f - 11, 3k + 27 = 5f. Is 11 a factor of 3/((-3)/(-57)f)? False Let h(i) = -21i - 4. Is h(-2) a multiple of 19? True Let w = -2 - -5. Suppose -4a = 3v - 0v - 179, -118 = -wa + v. Is 11 a factor of a? False Suppose -4n + n = 0. Does 13 divide 63 - (-2)/(-4)n? False Let p(f) = -f*3 + 5f*2 - 3f + 1. Let m be p(5). Let b be (-8)/5(7 - 2). Does 7 divide (-228)/m - b/(-28)? False Suppose 0n = -5m + n + 302, 0 = m - 3n - 66. Is 20 a factor of m? True Suppose -d = -5d + 720. Is 15 a factor of d? True Suppose 4q = 5a + 17, -4q + a = 5a - 44. Let f(i) be the first derivative of -i4/4 + 7i*3/3 + 13i*2/2 - 12i - 1. Is f(q) a multiple of 14? True Let v = -2 - -6. Suppose -2t - 8 = 2s - vs, t + 4 = 0. Suppose -72 = -sk - 2k. Is 13 a factor of k? False Let b(k) = -k + 3. Let p be b(8). Let v = p + 39. Does 17 divide v? True Let f = -114 + 145. Is f a multiple of 15? False Let g(q) = q2 + 2q. Let o be g(-2). Let b(s) be the third derivative of s5/60 + s4/24 + 5s3/6 - 4s*2. Is b(o) a multiple of 5? True Suppose -2n = -4, 0o - 4n = -3o - 8. Suppose 2 + o = x. Suppose xw = 4f + 7w - 87, -2f - 5w = -41. Is f a multiple of 16? False Suppose 0 = -4s - 20, -4s - 5 = 2r + 15. Suppose 0 = -rl + 5l + 10. Does 9 divide l + (-3)/(-1) - -21? False Suppose -24 = -5p - 9. Suppose k + 2k = -p, v + k = 107. Is v a multiple of 36? True Suppose 0 = -3t + 9, 3v + 2v - 5t = 55. Let o = -10 + v. Suppose -g - og + 70 = 0. Is 7 a factor of g? True Suppose -2u + 20 = 5l + 3u, -5l - 3u = -16. Let c be ((-6)/(-15))/(l/270). Suppose -q + 22 = s + 5, -c = -2q + 3s. Is q a multiple of 16? False Let a be ((1 - -2) + 1)1. Suppose ab - 12 = b. Is b a multiple of 4? True Let i = 815 - 415. Does 40 divide i? True Let d(b) = -b2 + 11b + 4. Let l be d(10). Suppose 4f + l = -2j - 4, -63 = 5j + f. Let q = 9 - j. Does 11 divide q? True Suppose -2w = f - 24, -2f - 7w + 2w = -52. Does 26 divide (-2)/1 - (-448)/f? True Let k = -2 + 7. Let d(o) = 1 - 5o*2 + ko + 1 + o*3 - 9o. Is d(6) a multiple of 14? True Let k(l) = -l*2 - 1 + 2l*2 - 9l*3 + 0l*2. Does 9 divide k(-1)? True Is 10 a factor of (-3 - -26) + (0 - -1)? False Is 44 + (1 + -1)/(-4) a multiple of 11? True Let z be ((-63)/4)/((-6)/16). Suppose a + z = -2a. Does 7 divide (-192)/a - 2/(-7)? True Is (-392)/7010/(-4) a multiple of 14? True Suppose -3f = g - 5g + 1287, -3g + 929 = 5f. Is 13 a factor of g? False Suppose 3c + 20 - 8 = 0. Let y be -4(-2 + (-34)/(-8)). Let n = c - y. Is 5 a factor of n? True Let w(i) be the first derivative of -5i*2 + 2i - 3. Let q = -4 - -1. Is 16 a factor of w(q)? True Suppose -3h - 5 = -x, 0 = x + 4x + 2h - 8. Suppose x = -c + 8. Let n(t) = t2 + t - 8. Is 12 a factor of n(c)? False Let w(j) = -j3 + 5j + 4. Let k be w(-3). Is 12 a factor of 2k + 2 - -2? True Let n be ((-45)/(-3) - 0) + -1. Suppose -5s - 4x + 5x + n = 0, -3s - 3x - 6 = 0. Does 10 divide 1(0/s - -20)? True Let f be (-16)/(-9) - 4/(-18). Let z(b) = -fb*2 + 2b - 1 + 5b2 + 0b. Is z(-3) a multiple of 10? True Let z(g) = -g + 7. Let c be z(7). Suppose c = -r - r - 2s + 52, -4s = -5r + 103. Suppose u + r = 2u. Is u a multiple of 15? False Let f(z) = 6z2 - 3z. Let g be f(3). Suppose 3 + g = 4p. Is p a multiple of 9? False Let g = -196 + 336. Is g a multiple of 14? True Let p be 2 + (-5 - 1)/3. Suppose pq - 2q = -18. Let y = q - 5. Is y a multiple of 4? True Suppose -4 = 2w + 38. Let d = 27 + w. Does 4 divide d? False Suppose -2l + 224 = -0l. Suppose 6o - 2o - l = 0. Is (-4)/(-14) - (-300)/o a multiple of 9? False Suppose 4i - r = 20, i - r = -2r. Suppose -i = 4b - 60. Is b a multiple of 14? True Suppose 0 = 2f - 664 + 126. Is 29 a factor of f? False Suppose w - 5r = -2w - 126, -4w - 163 = -5r. Let i = w + 76. Is 8 a factor of i? False Let k = 18 - 6. Is k a multiple of 12? True Let m = 16 - 10. Is 3 a factor of m? True Let u(a) = a - 5. Let b be u(8). Suppose -x - 5q + 50 = -3q, -278 = -5x - bq. Does 29 divide x? True Suppose 2b - 4 = 4b. Let z be (3 - 12)b/(-6). Is 1(-3)/(z/26) a multiple of 13? True Suppose -7k + 3k - d + 697 = 0, 5d = k - 169. Does 29 divide k? True Let m(i) = i + 3. Let k be m(7). Let c(y) = 2y*2 - 14y - 9. Let p be c(k). Suppose 0 = -5n + 3s + 87, -2s - s = -3n + p. Does 9 divide n? True Let q(i) = 9i2 - i. Does 5 divide q(-1)? True Suppose 0 = -3s - 3d + 22 + 2, -s + 2 = -d. Suppose 24 = sn - 26. Does 5 divide n? True Let y = 95 - 42. Suppose -t - y = -2t. Is t a multiple of 19? False Suppose 15 = c - 4u, 10 = -4c + 2u - 0. Let p = -2 - c. Is 13 a factor of p/(-2 + -1)-39? True Suppose 15 = 5n - 5z, -3n = 2n + z - 9. Let h(y) = 2 + 4y*3 + 2y*3 + 0yn - y2 - y. Is 22 a factor of h(2)? True Let m(k) = -k*3 - 8k*2 - k - 6. Let f be m(-8). Suppose -fd + 128 = 4y + 2d, -4y - 3d = -131. Does 16 divide y? False Let i be (21/(-9))/((-1)/(-30)). Does 15 divide (i/42)/((-2)/36)? True Let p(b) be the second derivative of 0 + 3b2 + b - 2/3b*3. Is 17 a factor of p(-9)? False Is 6 a factor of (-6)/27 + (-872)/(-36)? True Suppose 16m = 15m + 182. Is 12 a factor of m? False Is 24 a factor of ((-108)/(-15))/((-3)/(-10))? True Let r = 54 - 25. Let u = r + -9. Is 10 a factor of u? True Suppose 3w - 5o - 347 = 0, o = 5w - 521 - 72. Does 47 divide w? False Let d be (3 + 1)(-7)/(-4). Suppose 0 = -2g + d + 7. Does 7 divide g? True Let p = 0 - 0. Suppose -3a = -pa - 15. Is a a multiple of 2? False Let s = 145 - -36. Suppose 4n + 41 = s. Does 15 divide n? False Let m = 3 - 6. Let d = -4 - m. Does 17 divide 0 + -2 + (32 - d)? False Let f(d) = -d2 - 13d + 21. Is 33 a factor of f(-12)? True Let s(o) = -o*2 + o. Let l be s(-3). Let h be l/(-15)10/4. Suppose 48 = 4v - y, hv - 38 = -0v + 4y. Does 11 divide v? True Suppose 4p - 5l + 3l - 18 = 0, 0 = -5p + 3l + 25. Is 12 a factor of 3 + 48/(p - 1)? False Is (-3)/(-4) - (-5 - 498/8) a multiple of 17? True Let z(x) = -x3 - 6x*2 + 6x. Let c be z(-7). Let n = 34 - c. Does 9 divide n? True Let m(t) = 6t + 6t*2 - 2t*2 - 4t + 2. Let b be m(3). Is 11 a factor of b/(-12)-23? True Suppose -375 = -5y + 5g, 5y - 6g + 2g = 380. Is y a multiple of 15? False Let m(w) = -8w + 1. Let z be m(-1). Suppose z = 3r - 12. Is 4 a factor of r? False Suppose 3g + 9 - 3 =	{ "pile_set_name": "DM Mathematics" }
-3, k, 2? 2 Suppose 2r - 5l + 8l + 1 = 0, 5r - l = 6. Let d = 0.4 - 3.4. What is the nearest to r in d, -0.4, -1/2? -0.4 Let q = -6 - -6.5. What is the nearest to -2 in -5, q, 2? q Let q be 4/(-16) - 2/(-8). Let x = 0.06 + -0.66. Let r = x + -0.4. Which is the nearest to q? (a) 3/7 (b) -5 (c) r a Suppose 0 = -3u - 11 + 14. What is the closest to u in -0.5, -4, 1/5? 1/5 Let i = -0.04 + -1.96. Let n = -0.66 + 0.66. What is the nearest to n in 0.5, 1/3, i? 1/3 Suppose -j - 7 = 3k, 2k = 5k - 5j + 1. Let n be (k - -2)(-7 + 8). What is the nearest to 0 in 1, n, -0.2? n Suppose -9 - 16 = -5u. Let y = -3.94 + -0.06. Let x = -3 + 2.7. Which is the closest to 1? (a) u (b) y (c) x c Let r be (-42)/1331/(-3). Which is the nearest to -2/7? (a) -5 (b) 0.1 (c) r b Let z = -1 - -3. Let s = -5.7 - -5.5. Let d = 181 - 911/5. Which is the nearest to z? (a) s (b) 0.5 (c) d b Let t = 12 - 11.6. Which is the closest to -0.2? (a) 2 (b) t (c) 3 b Let g = 1 - 0. Let x = -25/6 - -53/12. Which is the closest to 0? (a) x (b) g (c) -5 a Let i = 0.6 + -3.6. What is the nearest to -2 in i, -0.2, 4? i Let b = 44 + -45. What is the nearest to b in 1/2, 3, -0.05? -0.05 Let j be (-1)/3 - (132/(-18) + 2). Which is the nearest to 0? (a) j (b) 14 (c) 1 c Let t = -1.7 - 1.3. Let r be 03/(1 + -4). Suppose r = 4d + o - 4o - 12, 0 = -2d + 3o + 6. Which is the nearest to d? (a) -5 (b) 4 (c) t b Let t = 55.9 + -56. Which is the closest to -2? (a) -2 (b) t (c) 1/14 a Let n = -412 - -19775/48. Let w = n - -11/16. Let s = -3 - -8. Which is the nearest to 1? (a) s (b) -1/9 (c) w c Let m = -587/5 + 117. What is the nearest to m in 0.3, -1/10, 4? -1/10 Let u(o) = -o3 - 6o*2 - 2o - 2. Let p be u(-6). Suppose 2x = -2f - p, 4x + 13 = f - 2. What is the closest to 0 in x, -1, 5? -1 Let k = 29 + -31. What is the nearest to k in 0, 2/17, 0.5? 0 Let v = 61 - 429/7. What is the closest to v in 2/3, -4, 1.4? 2/3 Let q = 0.36 + 0.04. Let f = 6.2 - 1.2. Let x = 20 - 19. What is the closest to -1/4 in q, x, f? q Let c = -25 + 22. Let i = 8/3 + -3. What is the closest to i in 5/3, 1, c? 1 Let b = -4.77 + -0.23. What is the nearest to 1 in -0.5, -2, b? -0.5 Let v = -1.6 + 3. Let h = v + -1. Let o = -11 + 16. What is the nearest to 0.1 in h, o, 3? h Suppose -3d + 2o = -2 - 2, 4o - 16 = 0. Which is the nearest to 2? (a) -4 (b) -5 (c) d c Suppose 0 = -3f + f. Let h = -0.05 - -0.15. Which is the nearest to -1? (a) h (b) f (c) 5 b Let d = -0.2 - 2.8. Which is the closest to 2/5? (a) d (b) 0.4 (c) -0.4 b Suppose 5x - 5i = -10, 2i + 6 = -3x - 0i. Let w(l) = -l*2 + 2l + 12. Let y be w(5). Which is the nearest to 0? (a) y (b) -0.5 (c) x b Let h = -63 + 66. Let i = -1397/9 + 155. Let z = 0.06 + -2.06. Which is the nearest to z? (a) i (b) 0 (c) h a Let y(z) = -z - 3. Let m be y(-5). Suppose 8 = -4x + mx. Let u be 14/x - (-7)/14. What is the closest to 2/5 in -1, u, -4/9? -4/9 Let r be (3(-12)/225)/((-2)/(-5)). Which is the closest to r? (a) -0.1 (b) 1/5 (c) 2 a Let x be 16/(-348)(0 + 9/6). What is the nearest to x in 0.2, 5, -2/5? 0.2 Let x = -1/7 - 2/35. Which is the nearest to 0? (a) -0.5 (b) x (c) -2 b Let p(c) = c*3 - 4c*2 - 4c + 2. Let n be p(5). Suppose -8 = -nm + 3m. What is the closest to m in -1/7, -3, -1? -1/7 Let p = -29/45 + 4/9. Which is the closest to p? (a) -3 (b) 2/5 (c) -0.5 c Let w = 0.61 + -2.54. Let l = 0.07 - w. Which is the nearest to -1? (a) -2 (b) l (c) -3 a Suppose 2f + 10 + 6 = 0. Let b be (f/30)/((-12)/10). Let n = 6 + -3. What is the closest to 0 in b, n, 0.4? b Let g = 0.08 + 0.22. Let n = -1.58 + -0.22. Let o = -0.2 + n. What is the closest to o in -1, g, 3? -1 Let g = -1.178 + -3.952. Let n = -0.13 - g. What is the closest to -1 in 0, -5, n? 0 Let k be -1 + (97148680/18483822)/4. Let c = -118/12339 + k. Let p = 2/107 - c. What is the nearest to 0 in p, -1, 0.3? p Suppose -5j + 33 = 4z - 3z, -3j + z + 15 = 0. Suppose -5r = -j + 1. Let d = r + 2. Which is the closest to 0? (a) -1 (b) 2 (c) d a Let z = 0.19 + 0.01. What is the nearest to -1 in -2/7, 4, z? -2/7 Suppose -y + 3 = 2j - 2, -4j = 3y - 13. Suppose -f = 4p - 26 + 2, -yf = -2p - 2. Which is the closest to 0? (a) -1 (b) p (c) 0.2 c Let g = -50.6 + 51. What is the nearest to -2/7 in g, 5, -2/11? -2/11 Let p be (-1)/6-3 - 0. Which is the closest to 2? (a) -2/43 (b) 3 (c) p b Let q be (2/4)/(3/4). Let w = 13.07 - 0.07. Let t = 9 - w. Which is the closest to q? (a) 2 (b) t (c) -4/9 c Suppose 4p - 20 = f + 3f, -f + 1 = 5p. Let d = -0.2 + 0.1. Which is the closest to d? (a) -0.2 (b) -5 (c) f a Let p = 41 - 49.3. Let x = 0.48 + 7.52. Let g = x + p. Which is the closest to -1/2? (a) 1 (b) 0.2 (c) g c Let p = -175576/11 - -1665153/110. Let b = 826 + p. Let k = 14/5 - b. What is the closest to -0.1 in 5, k, -2? k Let j = 1.2 - 0.2. Let a = 0 + 3. What is the nearest to -0.1 in j, a, -2? j Let w = 11 + -12.1. Let u = -1.4 - w. Which is the nearest to -4? (a) u (b) -1 (c) -3/5 b Let p = -219 + 218. Let l = 3889 - 116683/30. Let g = -1/10 - l. Which is the closest to -1? (a) p (b) 0.5 (c) g a Let x = 0.25 - 0.35. Let k be 2/3(-243)/(-8). Let o = k + -20. Which is the nearest to 0.2? (a) o (b) x (c) 0 a Let w = 0.161 + 1.839. Let v(z) = z2 + 7z + 6. Let t be v(-6). Suppose 0i = 3i + 15. Which is the closest to t? (a) 1 (b) w (c) i a Let u = 0.18 + 0.02. What is the closest to 5/2 in u, 2, -0.3? 2 Suppose -3s - 2s + 20 = 0. Let v be 7/6 + 14/(-21). Which is the closest to -1? (a) s (b) -1 (c) v b Let s = -13 + 6. Let x = s - -14. Let m = x - 5. Which is the closest to 2/5? (a) 0.1 (b) 0 (c) m a Let n = -0.29 - 11.71. Let a = n + 12. What is the closest to a in 3, 0, 0.03? 0 Let h = -54.2 + 54. Which is the closest to h? (a) 1 (b) -2/7 (c) 0.5 b Let r be (9/12)/(2/(-8)). Let v be (4/1)/(2/(-2)). Let q be 1(v/2 - -1). Which is the nearest to q? (a) 0 (b) r (c) 5 a Suppose 2z - 40 = 2f, -4f = 5z + f - 90. Let h = -14 + z. Let a = -4.2 - -0.2. What is the closest to 0.1 in 2/15, a, h? 2/15 Let o = 1.1 + -0.8. Let n = 37 + -37.2. Let j be ((-1)/(-2) - 0)2. What is the nearest to j in 2, o, n? o Suppose -5y - 4g = 1, g - 28 = -4y + 5g. Suppose 2c = yc. What is the nearest to c in 1/5, 0.3, 1? 1/5 Let d = -8 - -8. Let x be 1/3 + -1 - 0. Which is the nearest to -2/7? (a) x (b) -0.4 (c) d b Let b = -251 + 2763/11. What is the closest to 1/2 in 0, b, -5? b Let y(v) = -v + 3. Let l be y(4). Let u = -0.05 - -0.11. Let m = -0.46 + u. Which is the nearest to l? (a) m (b) 2/3 (c) 0 a Let l = 35 + -10. Let q be (2 + (-3)/2)l. Let p = 13 - q. Which is the nearest to p? (a) 3 (b) -0.2 (c) 2/3 c Let h = -0.04 - -2.04. Let d = -7 + 11. Let s = d + -5. Which is the nearest to h? (a) -0.5 (b) s (c) -1/4 c Let t = 0.85 - 0.05. Let f = 3.8 - t. Let c = f - 3.3. What is the nearest to 2/9 in c, -0.1, 4? -0.1 Let g = 14.3 - 14. Which is the closest to 1/3? (a) 0 (b) -0.3 (c) g c Let o = 0 + 1. Let q = 1258/7 + -180. Let d = -36 + 39. Which is the closest to o? (a) d (b) q (c) -5 b Let a = -0.01 - 2.99. Let n be ((-115)/(-55) + -2)-1. Let x = 1 + -1. What is the closest to x in a, n, -4/5? n Let k = 0.551 + -0.051. What is the nearest to 0.2 in -1, 0.4, k? 0.4 Let d = 97 + -96. Let m = -0.1 + -4.9. Which is the closest to d? (a) m (b) 3 (c) 0.4 c Let m be (-4)/(-1)(-2)/36. Let d = -6 - -1. Let q = 11 + -43/4. What is the nearest to q in 2/7, d, m? 2/7 Let b = -161 + 165. Suppose -3m + m = 4. What is the nearest to 0.1 in m, 5, b? m Let t(d) = 7. Let o(p) = -p - 1. Let x(u) = o(u) - t(u). Let g be x(-5). Let r = 2 + -1.9. Which is the nearest to r? (a) g (b) -2/5 (c) 2/7 c Let f = -0.25 - 0.05. Let k = -0.2 - f. Let n = -0.8 - 0.2. Which is the closest to -1? (a) -0.2 (b) n (c) k b Let y = -0.03 - -0.03. What is the closest to -1 in -1, 5, y? -1 Let p = 0.7 - 0.5. Let o = 0 + 0.2. Let z = o + 0.2. What is the nearest to 0 in 1/8, z, p? 1/8 Let h = -16 + 22. Let w = -5.5 + h. Suppose 0 = 3z - 7z. Which is the nearest to z? (a) 4 (b) w (c) -5 b Suppose 4 = -4*g + 8. Let m be 27/(-9) + (4 - g). Let s be 0 - -2 - 26/12. Which is the closest to m? (a) s (b) 1	{ "pile_set_name": "DM Mathematics" }
prime? True Let q(d) = -13d3 - d2 - d - 4. Let x be q(-3). Suppose -995 = -4j - 4r + x, -j - 4r + 334 = 0. Suppose -z = 3v - 248 - 98, -z = -v - j. Is z composite? False Let g = -2559 - -4464. Suppose -8t = -11t + g. Is t a composite number? True Let q(o) = 7o. Let s be q(1). Suppose -10i + 9i = -5. Suppose iz + 116 = sz. Is z prime? False Let y be 14/10 - 6/(-10). Suppose -yj = -0j - 502. Is j prime? True Suppose 0 = -126r + 150r - 443928. Is r prime? False Suppose 0 = -2l + 3l - 21. Suppose -7f + 0f + l = 0. Suppose -fg = -8g + 1655. Is g composite? False Is (-3)/2 - ((-106418)/(-4))/(-13) prime? False Suppose 4o + 2r = 156200, 10878 = -3o + 5r + 128015. Is o a composite number? True Let b = 55 - 51. Suppose b = -0w + w, 0 = 4c + 3w - 116. Is c composite? True Let o be 1071/2 - 1/(-2). Let j = 827 - o. Is j composite? True Let t = 23 + 46. Let b(o) = -o2 - 40o + 18. Let l be b(-40). Let c = t - l. Is c a prime number? False Let a = -17539 - -28968. Is a prime? False Let k(x) = x*2 + 11. Let z be k(0). Suppose 7j + 60 = zj. Is j composite? True Is (-8 - (-9 + 2))-4393 a prime number? False Let c be 1/(7/1085(-2)/14). Let m = c + 2466. Is m prime? True Let i be (-2)/7 - (-2 + 26982/(-14)). Let g = i + 1108. Is g a prime number? True Let n = -50573 + 86862. Is n a prime number? False Suppose 10g - 26g = -26960. Is g composite? True Let m = 7270 + 1296. Is m a composite number? True Is 1428174/44 + ((-2)/(-4))/1 prime? False Let y(j) be the third derivative of -17j*6/40 + 5j*2. Let b be y(-1). Suppose -b = 4t - 1111. Is t composite? True Suppose 3r + i = 4268, -4r - i - 4i + 5687 = 0. Is r a composite number? False Let m(a) be the first derivative of 35a3/3 + a2/2 + a - 2. Let r be ((-3)/(-2) - 2)-2-1. Is m(r) a composite number? True Is 4 + -1 + -7 - -1855 composite? True Let x be 272/(-1) - (-3 + -1). Let i = 411 + x. Is i prime? False Let o(s) = 1058s3 + 5s*2 - 10s + 3. Is o(2) composite? False Is 7/(-28) + 9865/20 a prime number? False Suppose 5r + 3o + 2 = -8, 0 = 3r + 3o. Let h(q) = -6q + 7. Let p be h(r). Suppose 2k - 189 - p = 0. Is k composite? False Let s(v) be the third derivative of v5/15 - v4/12 + 5v3/6 + 5v*2. Let h be 6/((-2)/(2 - 0)). Is s(h) a prime number? False Let y(v) = 1447 + 3v - 465 + 0v. Is y(0) a prime number? False Suppose 4p - 6 = -2n, 9 = 3n + p - 0p. Suppose -272 - 109 = -nq. Is q prime? True Suppose 2o + 2h - 29 = -3, -4o - 2h + 52 = 0. Let q(n) = -n + 19. Is q(o) composite? True Let m(d) = -148d3 - 2d*2 + 2d + 3. Let c be m(-2). Suppose 3u = c - 392. Is u + 1/(3/(-12)) a composite number? False Is (0 - (-3124034)/22) + (-60)/110 composite? True Is (-90)/(-21) + (-2)/7 - -1897 composite? False Let g be ((-6)/(-8))/(12/48). Let j = 1 + g. Suppose 3i + 1 = 5k, jk + 6 - 2 = 4i. Is i composite? False Suppose -843 = -4k + 1613. Suppose -9m + k = -1285. Is m prime? True Let g(x) = -9x*3 + 2x*2 - 1. Let u be g(-1). Let k(n) = -3 - 4 - 7n*2 + 7n*3 + 22n - 6n3 - un*2. Is k(16) a prime number? True Suppose 10 = -8x + 34. Suppose -o - 1832 = -xd, 0d + 2o + 2442 = 4d. Is d prime? False Let v(j) be the third derivative of 2j5/3 - 5j4/24 + j3/3 + 25j2 + j. Is v(5) prime? True Suppose -614 - 916 = 3z. Let k = 899 - z. Is k composite? False Let h = 967 - 986. Let s(l) = -l*2 + l + 1. Let m be s(-2). Let t = m - h. Is t a composite number? True Is (-2 + -10)/(-6) - -10165 a composite number? True Let r = 71139 - 42454. Is r prime? False Suppose 9y + 11800 = 5u + 4y, -3y - 9445 = -4u. Suppose -4 = t - 3, 3f - 4t - u = 0. Is f composite? False Let u(g) be the first derivative of g*2/2 - 10g + 1. Let j be u(10). Suppose j = -5o - d + 638, -3o + 4d + 186 + 183 = 0. Is o a composite number? False Let h be (1/(-1))/(-1) - -2. Let u be -2 + 10/2 - h. Let z(v) = -v + 39. Is z(u) prime? False Let t(u) = 3595u*2 - 15u - 3. Is t(-3) prime? False Suppose -9j = -14j - 3p + 244669, -195738 = -4j - p. Is j composite? True Let z(h) = -3h2 + h - 1. Suppose -3p - 4w + w = -12, p - 7 = -2w. Let i be z(p). Let u(o) = -3o3 - 3o*2 + o - 2. Is u(i) prime? False Suppose 8 - 20 = -6n. Suppose nm = -0m + 2426. Is m composite? False Suppose 0 = -4h - 5r + 482 + 6520, h - 3r = 1759. Is h a composite number? False Let t = 1208 + 2571. Is t prime? True Is 586(-23)/(0/(-5) + -2) a composite number? True Let w be ((-6)/9)/((-6)/81). Suppose 0 = 5g - wg + 264. Let d = g + -29. Is d a composite number? False Suppose -5u = -4d + 15 - 50, -4u + 17 = -d. Suppose -uz - 5x = -323, -6z + z + x = -529. Is z/(3/3 + 1) a prime number? True Let a(c) = 9c + 4. Let q be a(3). Let f = 31 - q. Suppose fu + 5u = 335. Is u a composite number? False Let b(a) = -295a*3 - 5a*2 + 5a - 4. Let j(r) = 296r3 + 6r*2 - 6r + 5. Let m(x) = -6b(x) - 5j(x). Is m(1) composite? True Suppose -11o + 6o = 1030. Let r = o + 289. Let v = r + -16. Is v a composite number? False Let i = 156 + 425. Is i a composite number? True Suppose v = 5x + 681 - 9914, 4x = 4v + 7380. Is x prime? True Suppose -4t + 3x + 27136 = 0, -15t = -20t - x + 33939. Is t a composite number? True Suppose -3i = -6i - 5f - 2317, 5i - 2f = -3810. Let h = 1201 + i. Is h a composite number? True Let d(u) = 17u2 - 2u. Suppose 2v - 3v = 5. Let z be d(v). Suppose 0 = t + 2t - z. Is t prime? False Suppose 0 = -4g - 3d - 18 - 0, -g - d - 4 = 0. Let b(t) = 6t*2 + 2t + 9. Is b(g) prime? False Let j(f) = 7f2 + 5f - 11. Suppose 50 = -9d - 22. Is j(d) composite? False Suppose 1786 = 6b - 4b. Is b a prime number? False Let w be 2/(-6)(3 + -3). Suppose w = -8p + 4p + 1508. Is p a prime number? False Let u(s) = -6s - 6. Let j be u(-1). Suppose -c + 2487 = m + c, j = -c - 4. Is m composite? True Suppose 0u + 6 = -l - 3u, 4u + 4 = -2l. Suppose -7 - 1 = -4r. Suppose m + t - 181 = 3t, rt - l = 0. Is m prime? False Suppose 26661 - 261060 = -4h + 5j, 0 = h - 4j - 58597. Is h prime? True Let a(p) = p2 + p - 3. Let k be a(-3). Suppose 0 = kv + v - 84. Is (658/v)/(4/6) prime? True Let o be 3 - (7 - (0 + 4)). Suppose 1288 + 273 = d - 4f, o = f. Is d a prime number? False Suppose -h = m + 3h - 2, -m = -2h - 2. Suppose -b + mb = -4z + 1147, -1152 = -b + z. Is b prime? True Suppose -18z + 17833 = -z. Is z a composite number? False Let l(r) = -2898r3 + r2 + 13r + 11. Is l(-1) composite? False Let p(k) = -k*2 - 7k - 4. Let y be p(-5). Is (-9)/27 - (-8864)/y prime? False Let h(i) be the first derivative of 2i3/3 - 17i*2/2 + 7i - 19. Is h(12) prime? False Let d = -21 - -24. Suppose 2p + 4x = -0p, -4p = dx. Suppose -12f + 6f + 762 = p. Is f composite? False Let q be -10-1(-3)/(-6). Suppose qu - 20 = -5, -1 = -4o + 5u. Suppose -5x - l = -395, l + 362 - 46 = ox. Is x a prime number? True Let b = 36495 - 8788. Is b prime? False Suppose -7w = -201575 + 74266. Is w a prime number? False Let b(k) = 11k + 5. Let g be b(-2). Let n = g + 20. Is (n/6)/(5/890) prime? True Suppose -5t - 51 = -291. Let m(c) = -23c - tc3 + 319c3 - c2 + 25c - 1. Is m(1) composite? False Suppose -58k = -122354 - 38132. Is k a composite number? False Let l be 5(3 - (-81)/(-15)). Let u = 14 - l. Is u prime? False Let g be -28 + 3 + -1 + -3. Let f = g - -33. Suppose 188 = fc - 0c. Is c composite? False Let r(l) = -505l + 5. Let p be 1/(2/(-6)) + 10. Let o(i) = 252i - 2. Let m(f) = po(f) + 3r(f). Is m(2) composite? False Let o be 2/(-6) - (-48)/9. Suppose -or + 1125 = 5t, -2r = -t - 3t + 888. Is t prime? True Let k = 84797 - 40944. Is k prime? True Let m(p) = 0 + 6p + 0p - 2 - 4 + 3p*2. Is m(9) a prime number? False Suppose b + 438 = 1626. Let s = b - 115. Is s prime? False Let m(w) = 10 - 2w - 330w + 50w - 39. Is m(-4) a composite number? True Let z(r) = -23226r3 + r2 + 89r + 89. Is z(-1) composite? False Let d(t) = t - 17. Let k be d(20). Suppose -o + ky + 582 = -0o, 5y = -4o + 2277. Is o a composite number? True Let p(w) = -4w3 - 10w*2 + 3w + 28. Suppose -67o = -64o + 33. Is p(o) composite? True Suppose -22x + 158240 = -138474. Is x prime? True Let u(t) = -1543t + 3	{ "pile_set_name": "DM Mathematics" }
than 0.05? 21.05 Calculate -0.2 + 179941. 179940.8 -0.332 - 6 -6.332 Calculate 0.0473 - 246. -245.9527 Calculate 863 + -0.159. 862.841 Work out 11.02 + 0.1. 11.12 2+-1518 -1516 What is the distance between 0.4 and -0.081? 0.481 Calculate 0.0639 + -327. -326.9361 What is 0.27 + -2624? -2623.73 Calculate 432.5 - 2. 430.5 Subtract -0.315 from -72. -71.685 6 - 9264 -9258 Subtract 342 from 0.8. -341.2 Subtract 1 from -874. -875 What is 30.7 + -41? -10.3 Work out -164 + -782. -946 What is the difference between 5.35 and 1.5? 3.85 What is the distance between 1116 and 3.3? 1112.7 Calculate 16.7 - -0.8. 17.5 -1041+-17 -1058 Add together -4130457 and -3. -4130460 Add together 9 and 20. 29 Subtract 0.2 from -27650. -27650.2 Work out -0.057797 - 0.07. -0.127797 Add together 3.112 and -0.052. 3.06 Total of 4767 and 0. 4767 -34.304 - -5 -29.304 What is -492 plus -196? -688 Work out -97 + 16.4. -80.6 Work out -5.603 - -0.6. -5.003 -0.2 + -746 -746.2 Put together 13.9 and -10. 3.9 Calculate 28.9 + -259. -230.1 Work out -2.4 - 195. -197.4 Calculate 9424 - 4. 9420 Add together -0.2194 and -0.3. -0.5194 Work out -0.94 - 1450.3. -1451.24 -406.7 - 0.1 -406.8 9566.2 + 7 9573.2 -0.111+-13 -13.111 Calculate -575.055 - -0.08. -574.975 -2+-3.7608 -5.7608 Calculate -4756 - -2. -4754 Calculate -0.5 + -11453. -11453.5 What is the distance between -147.14 and 0.5? 147.64 69+-56 13 What is -4 + 0.07632? -3.92368 Work out 0.3 - 0.1474782. 0.1525218 Calculate -660 - -0.05. -659.95 Add -160791 and -0.5. -160791.5 What is 175 less than -3? -178 What is the distance between -0.123 and -457? 456.877 What is -4640 take away -1.2? -4638.8 What is -5 take away -85.857? 80.857 What is 0.04 plus 15047? 15047.04 Total of 9.82 and 0.01. 9.83 Work out 8.0399 - 5. 3.0399 Add together -0.4 and -206382. -206382.4 Add -0.0578 and 4. 3.9422 What is -81950 less than 0.05? 81950.05 What is -2394657 plus 4? -2394653 What is -0.1761596 plus 4? 3.8238404 Subtract -0.81 from -13. -12.19 Calculate -0.08 + -0.031. -0.111 Work out 0 + 0.205802. 0.205802 Sum -5 and -28391. -28396 What is 11 less than 0.018? -10.982 Put together -7875 and 30. -7845 Add together -7 and 12. 5 Calculate -97 + -115.6. -212.6 What is -0.2259 take away 0.083? -0.3089 Total of -2 and 0.0676. -1.9324 Subtract -35 from -33554. -33519 What is -3 plus -307.01? -310.01 Calculate 419 - 0.235. 418.765 What is -1 - 7.267? -8.267 Calculate -0.2 + 170.2. 170 Add 0.0310338 and 0.4. 0.4310338 What is 10020 plus -8? 10012 What is 4.910786 plus 0? 4.910786 0.6 - 4217 -4216.4 Put together 0.3 and -136.4. -136.1 3+-12962 -12959 What is -57 minus -1.27? -55.73 -17.75+-22 -39.75 What is -0.1313 less than -4? -3.8687 Work out -19.0994 + 1.3. -17.7994 What is 58578 less than 0.6? -58577.4 0.27 + 258 258.27 Add together -858 and 0.3. -857.7 Add -6.32 and 27. 20.68 Add 9082 and -0.5. 9081.5 Put together -0.03 and -2.13. -2.16 930+27 957 Work out -1.2 - -0.7. -0.5 Calculate -4 - 454821. -454825 What is 0.04 take away -517? 517.04 What is -0.0754 minus 0.089? -0.1644 Calculate -0.58 - 1352. -1352.58 -0.3+25434 25433.7 Subtract 10160 from 0.24. -10159.76 What is the difference between 168.79 and -49? 217.79 Subtract -3.4 from -5. -1.6 -15.59+0.4 -15.19 Add together 4 and 1528. 1532 What is -712.12 take away 0.2? -712.32 What is -0.7 plus -703? -703.7 Calculate -9421 + -3.1. -9424.1 What is 227.62 plus -85? 142.62 What is -5 - -3.3591? -1.6409 What is the difference between 4.75 and -1? 5.75 What is -0.04906 minus -1.684? 1.63494 What is 1.1 + -51? -49.9 Calculate 3 + -9.02. -6.02 What is 0.6 plus 10939? 10939.6 Total of -55 and 29859. 29804 Calculate 29 + -0.163. 28.837 What is -570 take away 0.104? -570.104 Work out 53 + -325.9. -272.9 What is the distance between -0.1023 and -0.08? 0.0223 What is the difference between -0.04 and -4.3746? 4.3346 What is 27211 plus -0.5? 27210.5 0.0698 - 5752 -5751.9302 What is -20055 + 1? -20054 7.54 + 1559 1566.54 Total of 101.346 and -6. 95.346 Subtract 300 from -0.0965. -300.0965 Add together 1 and -0.1578. 0.8422 Put together -10 and -958. -968 What is the difference between -0.074 and 1912? 1912.074 What is the difference between -178.84 and -0.2? 178.64 Calculate 4 + 10.75. 14.75 What is -2 plus -0.0291? -2.0291 114168 + 0 114168 Calculate 0.461 + 6742. 6742.461 Calculate 0.5 + 508.63. 509.13 What is -583 less than 9.67? 592.67 -718 - 14 -732 What is 0.1 + -36.691? -36.591 What is -0.5 + 299? 298.5 Work out -1 - 1507046. -1507047 What is the distance between -1969 and -0.3? 1968.7 Add -1437681 and 0. -1437681 What is the distance between 23313 and 112? 23201 Subtract -597 from 10. 607 What is the distance between 0.3 and 1045864? 1045863.7 What is the distance between -3.63335 and 0.2? 3.83335 What is the distance between 0.3 and -2791? 2791.3 What is -4 less than -441? -437 What is -0.5 - 338753? -338753.5 What is -0.052 plus -65.6? -65.652 Add 1.3 and -17.3. -16 What is 18578 plus 1? 18579 Calculate -47 - -0.005187. -46.994813 Add 1.731533 and 0.1. 1.831533 Total of 0.3 and 0.2293. 0.5293 What is 0.33 take away 1281? -1280.67 -21.2 - -0.06 -21.14 -5+3.7603 -1.2397 What is -0.3 take away 6182? -6182.3 Work out 82.1 + -0.1289. 81.9711 Calculate 0.34785 - 0.051. 0.29685 -0.2662 + -4 -4.2662 What is 7 less than -2.72? -9.72 What is the difference between 5 and -0.0247? 5.0247 Work out 0.05297 - 0.4. -0.34703 592.156 - -0.3 592.456 What is -0.959 + -5? -5.959 What is 2.03 - -7? 9.03 Work out 72375 - 0.1. 72374.9 Calculate 180688 + -0.5. 180687.5 126+-2567 -2441 -21126+0.016 -21125.984 Put together -12.4444 and 0. -12.4444 -16.54163+-1 -17.54163 What is -15 take away -0.112? -14.888 Add -0.426 and -0.06. -0.486 Work out 5383 - -7. 5390 -3026 - 18 -3044 Total of -2 and -1262722. -1262724 What is -0.5 less than 4.7151? 5.2151 What is the distance between 569 and 0.0406? 568.9594 What is -275377 + -0.01? -275377.01 Put together 0.375334 and -2. -1.624666 Add together 75 and 0.41. 75.41 Subtract -71606 from 8. 71614 -98910 - -2 -98908 Work out 0.7 - -0.142. 0.842 What is -0.2 minus 48.25? -48.45 What is -13171 minus -0.9? -13170.1 Add 359 and -0.449. 358.551 Put together 0.202 and 93.73. 93.932 What is 0.3 less than -24744? -24744.3 What is -2538 minus -154? -2384 What is the distance between -0.9934 and -21.4? 20.4066 What is -0.15 minus -0.5? 0.35 What is -84 plus -7916? -8000 Calculate 114.8 - 4.9. 109.9 What is 5351 less than -7.4? -5358.4 What is 0.104 - -6848? 6848.104 Calculate -225 - -3.75. -221.25 Total of 53 and 651. 704 Calculate -3.3 - 19.92. -23.22 Work out -79 + 984.7. 905.7 What is -2000.7 take away 20? -2020.7 Calculate -7.42 + 9057. 9049.58 Subtract -0.098424 from -0.2. -0.101576 -0.23+-1 -1.23 Add together -574.34 and -7.3. -581.64 Add 1.1709744 and -5. -3.8290256 Calculate 76 + 11. 87 Work out 1401.7 + 0.05. 1401.75 What is -5 + 1074? 1069 What is 5376 - -0.5? 5376.5 What is 0.041 less than -0.04217? -0.08317 Add 10082975 and -0.4. 10082974.6 What is 0.3 minus -339.1? 339.4 What is the distance between -2448 and 31? 2479 0.51 + 0.042168 0.552168 Put together 174 and -1.34. 172.66 Sum -12098293 and -4. -12098297 Sum -0.2 and 954. 953.8 What is -8254 + -9.8? -8263.8 What is 3.5 - 40? -36.5 What is the distance between -6767 and 0? 6767 What is -3 plus 1093823? 1093820 Subtract 20.66 from -0.074. -20.734 -100 - 21 -121 Add together 1186 and -0.353. 1185.647 -0.1 + 1232 1231.9 What is 1712 + 15? 1727 Work out -11 + -0.051. -11.051 Total of -4477 and 0. -4477 -64.3+-8.3 -72.6 Add -0.0192 and 0.07. 0.0508 Total of -48 and -4. -52 What is -659.582 - -0.5? -659.082 Total of 10149 and -0.1. 10148.9 What is the difference between 0 and -413111? 413111 Calculate -436.089 + 2. -434.089 Add together -111 and 0.2. -110.8 Calculate 21 + 0.47. 21.47 Add -31526 and 156. -31370 What is -0.5 take away 0.892? -1.392 What is 19.6 plus 40.3? 59.9 Subtract -0.0298 from -2464. -2463.9702 What is the distance between -17.566 and 0? 17.566 Work out -36.75 - 1. -37.75 Subtract -10292 from 0.2. 10292.2 What is -0.1 minus 29.9? -30 Calculate 4 - 0.0824. 3.9176 What is 0.9 minus 247? -246.1 -16.83+-4 -20.83 Work out 78 + 0.061. 78.061 What is 0.1 - -0.1734995? 0.2734995 What is -0.9 take away 0.095? -0.995 Add together -115	{ "pile_set_name": "DM Mathematics" }
t is the product of -0.26615 and 8436? -2245.2414 Work out 45429 * 5.98. 271665.42 Work out -13.55939 * 499. -6766.13561 What is -0.622 times 8.8343? -5.4949346 17 * -4090103 -69531751 Multiply -0.2328177 and 0.5. -0.11640885 Work out -3 * 17296107. -51888321 What is the product of -818.6 and 53.74? -43991.564 5.3913 times 0.247 1.3316511 0.12926444 292644.4 Multiply 17.589 and 538.3. 9468.1587 What is 248681 times 13? 3232853 What is the product of 178 and 1.9463? 346.4414 Work out -25058014 -1.5. 37587021 -4803097-2 9606194 -11036601 -0.05 551830.05 Product of -14792 and 633. -9363336 Multiply 0 and -27183.64. 0 What is -11914.175 times -4? 47656.7 0.615359 times -0.2 -0.1230718 Work out 0.0191 * 6.2293. 0.11897963 What is the product of 1624191 and 0.06? 97451.46 Work out 32525754 * -0.1. -3252575.4 2174 times 6377 13863598 0.29-2578126 -747656.54 Multiply -255909 and 50. -12795450 -0.07142480.17 -0.012142216 0.4 * 88395569 35358227.6 What is 24813551 times 5? 124067755 Multiply -40287 and 245. -9870315 Work out -11510.6 * 0.3321. -3822.67026 Product of -1.86 and 9.1793. -17.073498 Product of 0.05871 and 0.0514. 0.003017694 -0.431.74286 -0.7494298 Multiply 0.4 and -34826606. -13930642.4 65508 -0.61 -39959.88 Product of 0.0684 and 0.1997. 0.01365948 Work out -0.3 * -1644433.2. 493329.96 What is the product of 16 and -100738.6? -1611817.6 -813 times -963.2 783081.6 -4.238 * -0.417 1.767246 0.5-153787.83 -76893.915 Work out 34.392483 -0.1. -3.4392483 3066088 times -2 -6132176 Multiply -25083527 and -3. 75250581 Multiply 898.634 and -2. -1797.268 -22186 * 2016 -44726976 Product of -0.33655975 and -5. 1.68279875 -3.3703.9446 -2323.01718 Multiply 0.5 and 284127. 142063.5 Product of 882 and -7237. -6383034 -0.02832524.05 -0.11471706 -164.48812 times -0.3 49.346436 What is -0.15044 times -637? 95.83028 What is -8.454 times 1.27? -10.73658 What is -456695 times -770? 351655150 Work out -0.1 * -39.318804. 3.9318804 What is -368016 times -47? 17296752 Calculate 2.4341751. 2.434175 What is the product of -33.12 and 13186? -436720.32 Multiply 19897557 and 0.04. 795902.28 0.08001949 times 0.3 0.024005847 Calculate 11.02788235-0.5. -5.513941175 Product of -20631 and 30498. -629204238 0-28004086 0 Calculate 70812111. 7081211 Product of 5 and -2.4213648. -12.106824 122847976 times 0.3 36854392.8 Multiply 5 and 45804191. 229020955 Product of -0.5 and -181.77957. 90.889785 What is 0.1 times -325704? -32570.4 What is the product of 22817360 and -1? -22817360 -132.69 times -0.0493 6.541617 164138592 32827718 0.8289 times -20506 -16997.4234 027678463 0 What is the product of 540952 and -21? -11359992 90316.554 times 0 0 Multiply 413.5 and -13185. -5451997.5 Multiply 1.49123 and 856. 1276.49288 Work out -17.66 * 0.62202. -10.9848732 Work out 10 * -895476. -8954760 What is 0.06 times -28093.05? -1685.583 What is -1261696 times -30? 37850880 0.9504163.87 453747.483 Work out -0.2421 1461. -353.7081 -573012.65 -151847.65 0.09360461.5 0.1404069 Product of -225257 and -9.2. 2072364.4 -0.7371-0.0356 0.02624076 What is the product of 5 and -0.2312467? -1.1562335 -9.91007683 -9976061.7 Work out 0.27 * 0.100527. 0.02714229 -164.91125 * 0 0 Work out -444.43046 * -2. 888.86092 Work out 8 * -2280.141. -18241.128 What is the product of -6 and 33181814? -199090884 What is the product of 357.2 and -2435? -869782 What is 0.17405755 times -4? -0.6962302 1.631-23032 -37565.192 What is the product of 65 and -212180? -13791700 997 times 230907 230214279 Work out -110.779 85. -9416.215 Calculate 0.21918728.4. 6.2249108 Calculate -0.08-1037890. 83031.2 Multiply -89 and -1.7064. 151.8696 -459 * -268.9 123425.1 205.0845 * 0.094 19.277943 Calculate -0.4-139211.5. 55684.6 What is 23 times 112030? 2576690 583-0.3682 -214.6606 30245935 * 8 241967480 Product of -4 and 5265155. -21060620 What is -0.5 times 81657548? -40828774 1.5901 * -39.39 -62.634039 0.183.908454 0.70352172 39.16549-0.37 -14.4912313 115491488 56359608 278661.3 23 6409209.9 Product of 250 and 2418.2. 604550 92.78909 times -0.1 -9.278909 Calculate -6661314-18. 119903652 3472.5189 -3 -10417.5567 Multiply -4913004 and -0.1. 491300.4 Work out -0.35 * -0.8828. 0.30898 Work out 44953212 * -0.3. -13485963.6 What is the product of -799197 and -0.13? 103895.61 Work out -863539 * 8. -6908312 Calculate 337.9730.1495. 50.5269635 Product of 54081.3 and 6. 324487.8 What is -0.35 times 0.5019068? -0.17566738 -510098881.4 -50494407 -899 * 231371 -208002529 What is -13635.4248 times 0.5? -6817.7124 -71.183670 -261230.6 Work out 9.6 141276.8. 1356257.28 Work out 0.2 * 0.022461. 0.0044922 977 times 123 120171 -10545373 * -0.3 3163611.9 3493005.7 times -0.5 -1746502.85 7321.3060.2 1464.2612 Multiply -608.012529 and -0.5. 304.0062645 -1007045 -0.158 159113.11 Multiply -10689 and -61.7. 659511.3 Multiply 0.3 and -41879043. -12563712.9 31565 times 1.08 34090.2 Multiply -61239 and 120. -7348680 Work out 345622625 * 0. 0 2062901.48 * 0 0 Work out -28115 * -5. 140575 Calculate 0.3494.2018. 32.028612 -26001.6530.3 -7800.4959 243.4-3360 -817824 Work out 67.2754 14.4. 968.76576 -5994040 times 2 -11988080 -125-980770 122596250 Work out 0.16 1779272. 284683.52 -213870-573 122547510 What is 17 times 119.03332? 2023.56644 Product of -2650.1 and 1361. -3606786.1 Work out -1303 -8684. 11315252 Work out -18 * 7.70752. -138.73536 2.1422 times -5.44 -11.653568 What is 9476 times 23.31? 220885.56 31664 * 96 3039744 Product of -527 and 1.5694. -827.0738 Product of -241930 and -3.14. 759660.2 Work out -18.1 * -0.09731. 1.761311 Work out 519 * -19.1744. -9951.5136 Work out 17462 * -0.16. -2793.92 Product of 264625 and 0.231. 61128.375 Work out 82241 * -68.3. -5617060.3 Calculate -2214157. -428314 0.2 times -1.8164644 -0.36329288 -14 times -4974320 69640480 Calculate 0.3-10998638. -3299591.4 Product of -12319691 and -1. 12319691 2.6 * 271156 705005.6 -158 * 33638 -5314804 1.5479863-1 -1.5479863 Product of -22876 and -149. 3408524 Work out 141868 -1.27. -180172.36 Multiply 123 and 363.63. 44726.49 Work out 3353584 * 12. 40243008 Calculate 1401132. 158480 What is the product of 382.62576 and 5? 1913.1288 What is the product of -0.4 and -87.185? 34.874 -2 times 2247732 -4495464 Calculate -0.11-2045.72445. 225.0296895 Product of 7.26295 and 1028. 7466.3126 Work out -91083096 * -0.2. 18216619.2 Multiply -1503.5 and 205. -308217.5 Work out -37 * -51636. 1910532 Product of -0.2 and -0.1471794. 0.02943588 -3 * 4.8132614 -14.4397842 -3.942 * -17863.7 70418.7054 Calculate 5-60531623. -302658115 Calculate -1-45.5348. 45.5348 -5.81644998 -9540988.4 Product of -1.5977 and -18.91. 30.212507 9 times -25897917 -233081253 Product of 0.042 and -1831465. -76921.53 What is the product of -6.42 and -75.8? 486.636 Calculate 3.7971399. 5312.003 -0.00417-350.3 1.460751 Multiply 0.1913927 and -173. -33.1109371 Work out -75 56.6775. -4250.8125 Work out -34704 * -138. 4789152 What is 11484820 times 3? 34454460 What is the product of -36 and 0.0891922? -3.2109192 What is -46204.1 times 0.75? -34653.075 Calculate -88.9-639.301. 56833.8589 Product of -1 and -108015692. 108015692 Calculate 255936.28. 160724.04 What is the product of -0.1 and 9194089? -919408.9 -2.3 * 0.56432 -1.297936 Product of 11042881 and 1. 11042881 Work out -1.0477 * -7003. 7337.0431 What is the product of -143281929 and 2? -286563858 Multiply -804880 and 5. -4024400 Multiply 0.21 and -35396.288. -7433.22048 Work out -40018367 * -4. 160073468 Product of 8586101 and -0.02. -171722.02 Product of -0.7 and -73813169. 51669218.3 What is the product of 114940838 and 4? 459763352 -1 times -7.6642304 7.6642304 1.878 * -7488 -14062.464 Calculate 207949633.7. 131777281.3 Multiply -10 and 291.438. -2914.38 Product of 0.14639 and 32.7. 4.786953 Work out -4.09 109909. -449527.81 Calculate 3-1620607. -4861821 -1.3101904 times 0.1 -0.13101904 What is the product of 0.18 and 1.168741? 0.21037338 Calculate 4.545017-20. -90.90034 -1265 * -58697 74251705 What is the product of -45.67 and -1443? 65901.81 What is the product of -0.3 and -50833439? 15250031.7 Work out -17.757 * 25.3. -449.2521 -28952929 * -5 144764645 4 times 5232359 20929436 Product of -1.1 an	{ "pile_set_name": "DM Mathematics" }
f a microgram? 75 What is 62/7 of a week in hours? 1488 What is 908861.7 millimeters in nanometers? 908861700000 How many millimeters are there in eleven eighths of a meter? 1375 How many minutes are there in three sixteenths of a week? 1890 What is twenty-seven quarters of a meter in centimeters? 675 How many milliseconds are there in 5.852401 microseconds? 0.005852401 What is 0.5983908 millilitres in litres? 0.0005983908 What is 89112.99ml in litres? 89.11299 What is 31/5 of a milligram in micrograms? 6200 How many centimeters are there in 49/5 of a meter? 980 How many millilitres are there in 59/5 of a litre? 11800 Convert 96.42848 minutes to nanoseconds. 5785708800000 How many minutes are there in 9165.543us? 0.00015275905 What is one twentieth of a litre in millilitres? 50 How many nanoseconds are there in 0.6340759s? 634075900 What is 7.110932 millilitres in litres? 0.007110932 How many nanoseconds are there in 66.1937 minutes? 3971622000000 What is 3/40 of a litre in millilitres? 75 What is 1/5 of a day in minutes? 288 How many centimeters are there in three tenths of a kilometer? 30000 Convert 1268912.52 milliseconds to days. 0.0146864875 What is twenty-one eighths of a litre in millilitres? 2625 How many millimeters are there in 13575.59m? 13575590 What is 1/4 of a day in seconds? 21600 How many millilitres are there in 21/5 of a litre? 4200 What is 17/4 of a milligram in micrograms? 4250 What is 1626.567 litres in millilitres? 1626567 What is 73/4 of a litre in millilitres? 18250 What is 3348273.6 nanoseconds in hours? 0.000000930076 What is 97722.04 weeks in seconds? 59102289792 What is nine tenths of a kilometer in meters? 900 How many seconds are there in one quarter of a minute? 15 What is 2470.591ml in litres? 2.470591 Convert 85.38235us to seconds. 0.00008538235 How many millimeters are there in 25/2 of a centimeter? 125 What is eleven tenths of a millennium in centuries? 11 Convert 326535.39us to hours. 0.000090704275 What is three fifths of a litre in millilitres? 600 What is three eighths of a milligram in micrograms? 375 Convert 1.713602mm to centimeters. 0.1713602 How many months are there in 3/50 of a millennium? 720 What is 5/8 of a millisecond in microseconds? 625 How many litres are there in 9580.766 millilitres? 9.580766 How many hours are there in eight thirds of a week? 448 What is 216.76521s in minutes? 3.6127535 What is 8/25 of a litre in millilitres? 320 What is seven eighths of a microgram in nanograms? 875 What is 9.416194t in nanograms? 9416194000000000 What is 13/4 of a millennium in years? 3250 How many minutes are there in three sixteenths of a week? 1890 What is 883.5355 micrograms in grams? 0.0008835355 What is 19/4 of a tonne in kilograms? 4750 What is 10801673.4 hours in weeks? 64295.675 What is 68430.852 milliseconds in weeks? 0.00011314625 What is three eighths of a millisecond in microseconds? 375 How many centuries are there in 1021.801 decades? 102.1801 Convert 915356.2ml to litres. 915.3562 What is 26/5 of a century in decades? 52 Convert 0.324413 decades to months. 38.92956 Convert 2.461555 millennia to months. 29538.66 How many kilograms are there in one quarter of a tonne? 250 Convert 4.5727l to millilitres. 4572.7 How many millilitres are there in 1/4 of a litre? 250 Convert 9.205014us to minutes. 0.0000001534169 How many millilitres are there in 53.1196 litres? 53119.6 How many kilograms are there in 9.459042 nanograms? 0.000000000009459042 How many years are there in 18/5 of a century? 360 What is 59.23539 millennia in decades? 5923.539 Convert 9.773359l to millilitres. 9773.359 What is 7/2 of a year in months? 42 What is 34.06971g in tonnes? 0.00003406971 What is eight fifteenths of a millennium in months? 6400 How many seconds are there in 1/4 of a hour? 900 What is 5396.752 micrometers in nanometers? 5396752 How many millimeters are there in one tenth of a centimeter? 1 Convert 0.6602037 millennia to months. 7922.4444 Convert 788.1326 kilometers to nanometers. 788132600000000 Convert 787527.6ml to litres. 787.5276 How many millilitres are there in 0.2692889l? 269.2889 What is 7.977965 hours in milliseconds? 28720674 What is 6774.261 weeks in seconds? 4097073052.8 Convert 24.21664 micrometers to centimeters. 0.002421664 What is 43/2 of a century in years? 2150 What is seven quarters of a litre in millilitres? 1750 How many centimeters are there in twenty-six fifths of a meter? 520 What is 1/10 of a gram in milligrams? 100 What is 1/28 of a week in minutes? 360 How many years are there in 0.8080321 decades? 8.080321 What is 47/4 of a kilometer in meters? 11750 How many milligrams are there in 9.97428ug? 0.00997428 What is thirty-one sixths of a year in months? 62 Convert 3745.19ml to litres. 3.74519 What is twenty-one fifths of a millennium in months? 50400 How many nanograms are there in eleven halves of a microgram? 5500 What is 585801.7 years in millennia? 585.8017 Convert 769505.7 hours to seconds. 2770220520 How many hours are there in fourty-three halves of a day? 516 How many milligrams are there in seventy-four fifths of a gram? 14800 What is 55/4 of a litre in millilitres? 13750 How many tonnes are there in 5.288953mg? 0.000000005288953 What is five quarters of a micrometer in nanometers? 1250 How many millilitres are there in eleven tenths of a litre? 1100 How many millilitres are there in twenty-five halves of a litre? 12500 What is 674.7494 millimeters in kilometers? 0.0006747494 Convert 5482.176 decades to centuries. 548.2176 How many nanoseconds are there in 1/10 of a millisecond? 100000 What is 3.75493 seconds in milliseconds? 3754.93 How many meters are there in 5703.289 micrometers? 0.005703289 What is 9.695725 years in months? 116.3487 How many months are there in one fifteenth of a millennium? 800 Convert 0.7054616 days to minutes. 1015.864704 How many centimeters are there in 31/5 of a meter? 620 What is 71/4 of a milligram in micrograms? 17750 How many kilograms are there in fifty-one quarters of a tonne? 12750 How many nanograms are there in one tenth of a microgram? 100 What is 62/7 of a week in hours? 1488 What is 3/28 of a week in minutes? 1080 How many months are there in 1/4 of a year? 3 How many micrograms are there in 76935.75kg? 76935750000000 Convert 69594.6 millimeters to centimeters. 6959.46 Convert 90959.18 milligrams to micrograms. 90959180 What is 21/2 of a millennium in decades? 1050 What is one fifth of a week in minutes? 2016 How many millilitres are there in six fifths of a litre? 1200 What is 52.13842 minutes in seconds? 3128.3052 How many litres are there in 9.786135ml? 0.009786135 What is twenty-five quarters of a micrometer in nanometers? 6250 What is 8.0117424 nanoseconds in days? 0.0000000000000927285 Convert 5025.151 litres to millilitres. 5025151 How many kilograms are there in 1440.111g? 1.440111 Convert 55.12069ug to nanograms. 55120.69 How many millilitres are there in three fifths of a litre? 600 Convert 0.9215344 centuries to millennia. 0.09215344 What is 582137.8 decades in years? 5821378 Convert 6440.909 micrometers to meters. 0.006440909 What is 1.099124ml in litres? 0.001099124 What is twenty-one fifths of a meter in centimeters? 420 Convert 555.1452 meters to nanometers. 555145200000 What is eight sevenths of a week in hours? 192 What is 9462.045 microseconds in minutes? 0.00015770075 What is 6.29429mm in kilometers? 0.00000629429 How many millimeters are there in 477.122 meters? 477122 How many decades are there in 8/25 of a millennium? 32 What is seventy-four fifths of a second in milliseconds? 14800 What is 3.915028 microseconds in seconds? 0.000003915028 Convert 1325.8893 months to decades. 11.0490775 How many milligrams are there in 47/4 of a gram? 11750 Convert 0.4366867 millilitres to litres. 0.0004366867 Convert 91208.78 weeks to milliseconds. 55163070144000 How many months are there in 1/6 of a decade? 20 Convert 3.361643 milligrams to grams. 0.003361643 How many nanoseconds are there in one fifth of a microsecond? 200 What is 3/40 of a millennium in years? 75 How many kilograms are there in 42203.9 nanograms? 0.0000000422039 How many kilograms are there in twenty-six fifths of a tonne? 5200 How many nanometers are ther	{ "pile_set_name": "DM Mathematics" }
? -50 Evaluate (915/16470)/((-2)/30). -5/6 What is the value of 42(-33)/(-99) - (-29)/11? 43 What is (-3)/4 - ((-5501646)/460)/137(-20)/(-24)? 72 What is the value of 92/6 - (-81)/(4860/40)? 16 Calculate (-683704)/(-20208) + (-15)/18. 33 What is 108 + 45/(60/(-24) - -1)? 78 Calculate (-8349475)/2905920 - (-1)/(-64). -26/9 What is the value of 266/(-342) + (-40)/(-48)? 1/18 Calculate (18 - (-3265)/(-180))/((32/(-8))/32). 10/9 877/(-25) + 158/1350 + 3(-67)/5427 -35 Evaluate (60320/(-2160) - -28) + (-916)/(-27) + -1. 33 What is 53/((-2862)/180)(-72)/20? 12 What is 7172/6006 - (16/(-5))/(1176/(-420))? 2/39 ((-2)/(-3))/(((-68)/(-187))/((-15300)/(-330))) 85 What is 1/4(-1129296)/6722? -42 2772/110888/(-18) -1/9 Calculate 74 + (-37151)/119504238. 1/88 What is the value of (-16)/16061419/516? -2/73 Evaluate 1050/945 + 2568/(-27) + (-22)/2. -105 (2265/4)/(-5) + ((-336)/(-32))/(166 + -172) -115 14040/4843812/(-200) -2/115 Calculate 2/(-11)(-198 - (-92026)/(-356)). 83 Evaluate ((-68)/(-187))/((-1764)/154). -2/63 Evaluate (26/143-22)/((12/(-15))/1). 5 Calculate (-8)/497650/1600. -61 Calculate 4/((-12)/(-39)) + 25088/784. 45 Calculate (1509/(-84504))/(-6 - (-142)/24). 3/14 Evaluate 0 + 4 + -18 + 613 + -598. 1 What is the value of 3731/164 + (-216)/9 - (-4)/1952626? 2/61 43(-2)/222 - 312/(-340548)59 -1/3 What is (-13 - 74) + 102 + 830/(-55)? -1/11 Calculate (1/(-6))/(((-105)/(-50))/(32/40)). -4/63 Calculate (-548)/6 - ((-2698)/6745)/((-6)/10). -92 12 - 4 - (24 + 5) - (-90 - -68) 1 Calculate ((-31977)/(-1292))/((-21)/(-28)). 33 275((-7308)/(-1575))/29 44 What is the value of -61 - (-68 + (15 - -6))? -14 Evaluate (29 - 7707/266)/(4/19). 1/8 What is (4/(3-4))/(((-222)/(-888))/((-9)/12))? 1 What is 9/((-144)/80) + (-2134)/(-440)? -3/20 Evaluate (5 - 14)642/(-46224). 1/8 Evaluate 2 + (-6)/45 + -13 + 16169/690 + -12. 3/10 What is 1064/(-114) + 10 + (-1 - -1) + (-3 - -6)? 11/3 What is (-56 - (-9932)/169)(-3 - -2)(-1)/(-4)? -9/13 398/(-33) - 3130/(-6435) -12 What is the value of (-1)/(-756) + 246/(-1074528)-156? 1/27 What is (26/4095)/((-242)/17545) + -1(-8)/9? 3/7 Evaluate 262/65 + 290450/(-98753) + (-18)/17. 2/65 Evaluate (72/(-504))/((2/6)/1). -3/7 (149/1490)/((-3)/(-10))-2(-51)/(-8) -17/4 What is the value of 14/6 + (-7 - 870/18)? -53 What is 11893/195 - (-743 + 804)? -2/195 Evaluate (((-54)/5)/(-9)20 - 13) + (-446)/40. -3/20 Evaluate 36/(-2) + (-58 - (-6164)/67). 16 What is the value of ((-1452)/102 - 2) + (-304)/(-1292) - 32? -48 Evaluate ((12452/72)/11 + -15)/((-1)/3). -13/6 Evaluate (-17775)/(-65175)2068/6. 94 Calculate (-13 - (-16)/8881) + (-2)/1. -3/11 (-80850)/(-72765)81/(-12) -15/2 (2/27 - 20064/(-9072))(-10)/24-9 60/7 69((-11)/(-6) - (5 - 4))/((-1895)/1516) -46 (-1 + 17 + (-10812)/1020)(-10)/(-3) 18 (322/(-161))/(18/423) -47 (((-6)/(-8))/(-3(-52)/(-24)))/(90/360) -6/13 Calculate ((-6288)/112 - -55)(-3)/((-12)/70). -20 Calculate (134/(-7705))/(130/(-150) - -1). -3/23 Evaluate (-8 - ((-4)/18)/((-2272)/(-208) + -11))-9. 98 Evaluate (-339)/35 + (-12)/20 - (5665 + -5679). 26/7 Evaluate 46/(12144/99) + (-375)/40. -9 Evaluate 58/(3074/(-1219)) - 39. -62 What is the value of 696/1381/6-118? -59 What is the value of (-61 - -65) + 1(42 + 2)? 48 What is 10((-1346803)/18705 - -72)? -2/87 Evaluate (-11)/(-143) + 6/((-23166)/(-1809)). 6/11 (-1046)/2615 + 141/90 - (-103)/(-6) -16 Evaluate 20 + (117/6)/(148035/(-151940)). -2/139 Evaluate (-8)/6(-693)/(-6 - -27). 44 What is ((-3)/66)/((-545)/654)? 3/55 Calculate (10/48)/(26/(-15392)-74). 5/3 What is the value of 2682 + -2676 + 3/(171/(-339)) + 6152/76? 81 What is (266/63-6)/(-12 - 936/(-81))? 57 Evaluate (-27738)/(-2412) - (-298)/4. 86 What is the value of ((-6 - -2)35/140)/(2/102)? -51 What is 288/30 + -12(-34)/(-24)? -37/5 What is ((-49)/14)/742/3 + (241 - 281)? -47 What is the value of (-41284)/144494(1 - 3)? 4/7 (707006/(-24663))/((-4)/30(-3 + -2)) -43 (45164/(-33873))/(49/(-9)(-42)/(-7)) 2/49 Evaluate (-83)/((-35690)/(-31992)) - -81. 33/5 Calculate (-1094133)/374003 + (-36)/(-46). -15/7 Calculate ((-2354)/24717)/(1/(-462)) - 1. 43 ((-40)/3 - 1/6) + ((-477)/18)/53 -14 What is the value of ((-218070)/10908 + 20)-13(-60)/(-1300)? -1/202 Calculate (46/((-1288)/602))/(7/(-28)). 86 ((-4554)/(-368) - 27)/(6/(-16)) 39 Calculate ((-4899)/1704)/((-1)/16). 46 Calculate 19/3-3 - (-88)/(5280/(-150)). -43/2 What is the value of (-1557)/(-54) + (-63 - 10991/(-174))? 29 Calculate (16/(-184))/(-5 + (-10 - -21 - 8)). 1/23 Calculate (-566706)/(-12051) + (-94)/2. 1/39 What is (-120)/(-45)(2 - 21/((-84)/(-176)))? -112 What is 8300/350 - (-76)/(-665)15? 22 1/(280/28 + -11) - 29 -30 Calculate (-145)/5 - -5(-635)/(-50). 69/2 Evaluate (-28)/(-12)9/(-84)-24 + 6 + 111. 123 What is 34 + -41 + -9 + -1 + 15? -2 What is the value of 54162/(-2124)(-4)/(-6)? -17 ((-89207)/(-45809))/(3/57) 37 Evaluate (-15)/9(158 - 161)(-2 - 132/(-20)). 23 What is the value of (2-4)/(112/1489628)? -38 Calculate (-2709)/(-99) - (18 + (-55)/(-11)). 48/11 What is (18/40)/(295/(-7080))? -54/5 Calculate (225/(-50))/(4/16) + (-2 - (2 - 4)). -18 Calculate ((5/(1220/(-8)))/((-127)/(-254)))/2. -2/61 Calculate (-5600)/(-560) - (1 + (-922)/(-8) - (-143)/(-572)). -106 What is (5/(-65))/((-19)/(-3 - -1200)) - 6/(-39)? 5 Evaluate (-330)/12(-456)/1368(-3)/15. -11/6 What is (26/((-104)/(-18)))/(261/4988)? 86 Calculate 3/(-2) - ((-163)/7622 + 3126/(-9899)). 46 Evaluate (-56)/20(-840)/(-588). -4 Calculate (1077/1436)/((-693)/(-360) + -2). -10 What is the value of 24 + (-5)/4 + (-378)/(-168)? 25 What is the value of 24 + 92 + (-1888730)/16281? -2/243 4/6(9 - -4 - (-245)/(-10) - 2) -9 Evaluate (32/84(-2457)/(-4368))/(5/(-2)). -3/35 What is (57/76)/((-26)/16 - -2)8632/208? 83 ((-12)/16)/(978/120 + -8) - -49 44 What is (-75174)/23919(-56)/11? 16 Evaluate 132791/31958 + 99/(-22). -10/29 What is the value of ((-32)/40 - -10)/(1212/120 - 10)? 92 ((-2)/(-5))/(((-229031)/4935 - -46) + (-2)/(-5)) -42 What is 6/(((-1)/12)/(38/304))? -9 Calculate 138/3 + (-3861)/((-5291)/(-37)). 19 What is the value of 5238/4420(12 - -14)? 7 Calculate 117 - ((-34 - 27) + 47). 131 Calculate (41600/(-225))/(-32) - (-6)/(18-3)-2. 6 What is (2 - -2 - 6360/848) + 3? -1/2 What is 2935/2348(8/(-14))/((-40)/(-28))? -1/2 Calculate 216/(-3591)((-4921)/38)/37. 4/19 What is (-19052)/1732 + 370/34 + 72/34? 2 What is (588/(-480) - -1)/(437/38 + -10)? -3/20 ((-6)/(-5))/((-1636)/20 - 14/35) -2/137 Calculate 2143140/(-102498) - (-12)/(-11). -22 Calculate (-57 + 48)48/2527. -12 Evaluate ((-185)/296)/(((-20)/16)/((-120)/160)). -3/8 Evaluate (-2737)/101269 - 3916/222. -53/3 What is (-36108)/767 - (-84)/78? -46 7 - (59 - 79) - 401/15 4/15 What is the value of ((-1644)/(-165) - 306/(-8415))(-1 - 2/30)? -32/3 (-660)/13860 + (-74)/(-966) 2/69 Calculate (2/(-10))/(173443/(-5980) + 29). 52 Evaluate 1154/64 - ((-99)/(-96))/33. 18 Calculate (9945/135 + -75)/((-5)/(75/(-2))). -10 What is the value of (1 - -2)/(135 + (-18928)/140 - (-278)/40)? 4/9 What is (-4 - (-170)/351) + (-10 - 21472/(-2352))? -2/147 What is the value of -1636/3168 + (-1365)/55? -25 What is the value of 3971/(-1311) + 54/1863 - (-90)/33? -3/11 Evaluate 6764/(-133) + (1/3)/((-14)/6). -51 What is the value of -115/10(12 - (-380120)/(-31691))? -2/67 What is (-2)/2 - (15/13)/(41 + (-935)/22)? -3/13 Evaluate 22944/188 - 22162/83754. 122 Evaluate (81/(-162))/(0 - (-11)/(2 + 0 - -2)). -2/11 What is -20((-20682)/2295 + 9)? 4/17 What is the value of (48/(-7))/(150(-168)/(-176400))? -48 What is -1517 - -1508 - (2 - 363/36 - 1)? 1/12 Calculate (2((-26)/8 - -4))/((-2632)/(-32) - -16). 2/131 What is the value of 1152/324828/6992? 8/19 (-16947)/2690(-37)/(-666) -7/20 Evaluate (-10)/(-15) + -38(780/(-792) + 1). 1/11 Evaluate (1173/5865)/(21). 1/10 What is the value of ((-1)/(-2))/(1020/3570)(-6 + 1752/294)? -1/14 What is the value of ((-14)/(-42))/(5 + 583/(-110))? -10/9 Calculate (-4175)/(-2505) - 4(-5)/((-300)/(-1415)). 96 What is 1793 - 1800 - (-415)/246/15? -1/12 7264/231 - ((-1225)/(-84) - 7) 5/12 What is the value of (3/63)/((-388)/(-28) - 13) + 260/12168? 1/13 (2/(-33) - 148162/(-18381))/(-1) -8 ((16 - 18)*(1025/50 + -19))/((-6)/128) 64 Calculate (-2 + (-63)/(-32))/(40/(-120)	{ "pile_set_name": "DM Mathematics" }
x - 26. Let o(l) = -8d(l) - 5h(l). Let f be o(8). Solve 12 = 5r - 3t, 13 = fr - 3t + 1 for r. 0 Suppose -15 = -3g - 2g. Suppose 2x - 3 = 3o, 2o = 2x + 4 - 12. Solve -5v + g = -2v + w, -2v - 3w + x = 0 for v. 0 Let g(p) = -13p2 + 12p*2 + 2p - 2 - p - 6p. Let v be g(-4). Solve -m + 4o = 2o + 6, 14 = -4m - vo for m. -4 Suppose 14 = 5u + 4. Let r(y) = -y*2 - uy*2 + 8y + 2y2. Let p be r(4). Solve 2f + 5l + 22 = 3f, 3f - 5l = p for f. -3 Let w(j) = -j*3 - 11j*2 - j - 6. Let x be w(-11). Solve a + 0d = 5d + 14, -10 = xd for a. 4 Suppose 2h + 4 = 4h. Let o(m) = m*3 + 3m*2 - 4m + 2. Let b be o(-4). Solve 4q = bl - 1 - 3, -hl + q - 5 = 0 for l. -4 Let f be -3 + 1 - (-3 + 5). Let u = 4 + f. Solve u = 5r + 5t, 0 = r + 2r - 4t - 7 for r. 1 Suppose 3a = a + 32. Let j be (-2)/(1/((-2)/4)). Suppose f + j = -3t - f, 2t + 2 = -2f. Solve -3u = -3m - 16 + t, 4m + a = 2u for u. 2 Suppose -5s + 3x + 265 = 0, -4s - x - 4x + 175 = 0. Solve 0 = w + i + 10, w + 5i - 20 = -s for w. -5 Let s = 7 - 5. Suppose -sy + 11 = 3. Let h be (-8)/(-5)10/y. Solve 5q = -20, 0 = g + q + h - 0 for g. 0 Suppose -x = -4 + 2. Let w be 22/(-8) + (-2)/8. Let d = -1 - w. Solve 5a + v - d = 4v, -v - x = -3a for a. 1 Suppose 2l - 3t - 4 = -5t, 5l + t - 14 = 0. Solve -3w = 3i, -2i - 1 + l = 3w for i. -2 Let h be 12/1020/6. Solve 14 = hm - 2b, 16 = 3m - 2b + 4 for m. 2 Suppose -4 = -0z - 2z. Solve 5o = zy + 12, 4y - y - 5o + 8 = 0 for y. 4 Let a(z) = z2 - z. Let l(r) = -7r*2 + 11r + 3. Let n(x) = -6a(x) - l(x). Let s be n(6). Solve 5u = -c - 10, -c + su = 3c + 17 for c. -5 Let a be ((-138)/30 - -6) + (-4)/10. Solve 3l - p - 2 - a = 0, -3p - 9 = -l for l. 0 Let w(g) = -g*3 + 4g*2 - 2g + 12. Let a be w(4). Solve 15 = -2c + 5y, 3 = -y + a for c. -5 Let m be 4 + 0 + (2 - 3). Solve -mi + 4f = -28, -i + 2f + 4 = -2i for i. 4 Suppose -4c - 1 + 5 = 0. Let o(f) = f3 - 2f + 1. Let g be o(c). Solve 2x + 3 = z, 2x + gz + 2z = 12 for x. 1 Suppose 0x + x - 4 = 0. Suppose j + xj = 30. Let k be j/(-15) + 7/5. Solve 3s + 6 = 0, a - 3s + k = -s for a. -5 Let u = -4 - -8. Let f(y) = -y*2 + 3y - 2. Let g be f(1). Suppose uv - 9 - 3 = g. Solve -va + 32 = 5p, 24 = 3p - p + 4a for p. 4 Let t be -1 + 1(-3)/(-1). Solve -p + 6p + 14 = 3q, -14 = 3q + tp for q. -2 Let s(f) = -f + 12. Suppose -5v + 3k = -53, -3k - 2k = 5. Let z be s(v). Solve z = 5r - 5b + 17, 2b + 1 = -5r for r. -1 Let z(v) = 5v + 3. Let s be z(4). Let t = s - 13. Let u = -1 + 3. Solve 4g + 5n = -7, -8n = -ug - 4n - t for g. -3 Let t = -5 + 10. Suppose 2y - y = -n + 9, -5y + 5 = -tn. Suppose -ng = g. Solve 0m = 5m - 2u + 30, g = -4m + u - 21 for m. -4 Let b = -5 - -4. Let k = 1 - b. Solve -2i = -kc + 3i - 16, 4c - 4i = -20 for c. -3 Suppose -2g - 2h = -6g + 18, -g - 6 = 3h. Solve 0 = -gk - 3b - 3, -5b = -7k + 3k + 32 for k. 3 Let b(d) be the third derivative of d*4/24 + 2d*3 + 3d*2. Let a be b(-12). Solve s = 5w, -s + w - 6w + 10 = a for s. 5 Let p(m) = 3m*2 + 1. Let x be (-2)/10 - (-12)/10. Let n be p(x). Solve 6a - 2a - 5w = -4, 2w + n = -4a for a. -1 Suppose 2a = r - 10, 3r = 5a + 24 + 3. Let q be -15 + 3/a. Let b(c) = -c + 2. Let f be b(q). Solve 0 = -t - 3y + f, -2y + y = -1 for t. 5 Suppose 3 = 2q - c, -2q + 32 = 5c + 11. Solve -3t + 2g = 0, -g + 0 - q = 0 for t. -2 Suppose -t - 6 = t. Let p be 1/3 - 14/t. Solve -o = h + 3, -2o + 6o - ph = 15 for o. 0 Let f = -29 + 32. Solve 4a - 5m - 19 = 0, 9 = -fa + 3m - 7m for a. 1 Let q(o) = -o2 - 7o - 4. Let v be q(-6). Let p = -10 + 14. Suppose 2n - p = u, -2u = 3n + 2u - 6. Solve 5m + 18 = vw, nw = -3m + 1 + 1 for w. 4 Suppose 0 = -v - 0g + g + 1, 2v = 4g + 2. Let r(n) = n3 - 8n*2 - 11n + 20. Let h be r(9). Let k = v + h. Solve 3q = 3b + 3, -b - kq = 15 - 2 for b. -4 Let x = 1 - -2. Solve 3c + xv - 21 = 0, -4c = -2c - v + 1 for c. 2 Let w be (2/(-3))/(7/(-21)). Suppose wf - 9 = -1. Solve -fi + s - 5 = 0, i - 4 = -0i + 2s for i. -2 Let v be (7/2)/((-3 + 4)/2). Solve 0 = -j + 2d + 2 + v, 5d = 4j - 30 for j. 5 Let z(d) = -d*2 + 2d + 2. Let x be z(0). Solve -xs = s - 6, -3s = a - 1 for a. -5 Let q(o) = 2o2 - 4o + 4. Let a be q(2). Solve n - ab - 2 = -b, 4n + 4b + 24 = 0 for n. -4 Let i = -8 - -11. Suppose -12 = -3d + 9. Let b = d - 3. Solve bc = -n + 18, -4n - ic + 3 = -17 for n. 2 Let j = 8 - 6. Suppose 3i = -ji + 545. Suppose 17 = -4x + i. Solve 4o + 5h - x = 0, 3o + h - 9 = -0o for o. 2 Let w = 3 + 0. Suppose wo - 3p = 12, -6p + 2 = -o - 3p. Suppose -2m = -om + 10. Solve -5i + 29 = -2k + 3k, -2i + 3k - m = 0 for i. 5 Let c = 22 - 18. Solve -2g = -4d - 0d + 14, 2d = 4g + c for g. 1 Let w = -1 + 3. Suppose 12 = -wf + 6f. Solve -11 = k + 5l, fk - 2l + 0l = 18 for k. 4 Let o be 6/(-21) + 60/14. Solve -5u = -3m + 25, 0 = -4m + 3u - ou - 5 for m. 0 Let d(t) = -t2 - 8t - 7. Let o be d(-7). Let w = 5 + -3. Let x be 5(2 + (-2)/w). Solve 4m - 3b + 17 = o, -5m + xb = 19 + 6 for m. -2 Suppose -o - o + 4 = 0. Suppose or - 7 = l, l - 8 = 2r + 5l. Solve -4x = -4u + 12, 5u = -rx + 9 - 1 for u. 2 Suppose 0 = -z - 5g + 9 + 12, 2z = 5g + 72. Let t(q) = -q3 - 6q*2 + 4. Let h be t(-6). Solve ho + 3v + z = 0, o - 5v - 11 = -2v for o. -4 Let o = 9 - 8. Suppose o = 3x - 5. Suppose 0m - 8 = -4m - 3a, -2m - xa + 2 = 0. Solve 5f - 10 = 2v, -f + 3v - m - 6 = 0 for f. 4 Let b be 2((-9)/(-2) - 3). Solve -2z - m + 0m = 3, -3z - bm = 0 for z. -3 Let n = -1 - -3. Suppose -5y = 3m + 25, 0 = -m + 3m + 4y + 20. Suppose -1 = -4r - 4l + 15, l - n = m. Solve 5c + 1 = -rq - 6, 0 = q - c - 7 for q. 4 Let b(l) = -3l - 3. Let o be b(-3). Solve -o - 6 = 3w - 5g, 16 = -4w + 2g for w. -4 Suppose i = 3s - 4i - 9, -3i - 15 = -5s. Solve y - 19 = sr + 2r, 3r - 3y + 21 = 0 for r. -3 Suppose -6 - 4 = -2w. Suppose 3b - 6 = u, b + 3 - w = -5u. Suppose -3m + b + 10 = 0. Solve h + 2t + m = 10, 0 = 3t - 6 for h. 2 Suppose 5 = k - 0. Solve 2c + 4m + 14 = 0, 5m + 10 + k = 0 for c. -1 Let x = 2 - -1. Suppose 4j + x - 19 = 0. Solve -2f + 29 = 5p, -jf + 2p - 1 = 1 for f. 2 Suppose 0 = 4j - 3j - 46. Let v = j - 30. Solve -r - 12 = 2z, 5r + v = z - 0z for r. -4 Let f = 28 - 24. Suppose 0 = 2a - 8 - f. Solve -8 = -5w + 2o, -16 = -aw + 2w + 4o for w. 0 Let o = -124 - -124. Solve -g = f + 7, o = -2f - f + 3g + 9 for f. -2 Let o = 0 + 4. Solve 20 = -oj + 2v, -4j - v - 28 = -5v for j. -3 Let b(r) = r3 + 9r*2 + 6r - 11. Suppose -10 = -5g + 40. Let n be (-6)/g + (-74)/10. Let l be b(n). Solve -lv = -4c + 19, -1 + 13 = -5v - 3c for v. -3 Let t(o) = -4o - 3. Let d be t(-3). Suppose 0 = -c - 2c + d. Let z be (-45)/106/(-9). Solve -h - 4h - 4p = z, -h + 6 = cp for h. -3 Suppose g - 6 = 2. Suppose 5h + 4a - 12 = 0, 3h + 3a = -2 + g. Suppose -2 = 3x - 5i + 1, 0 = hi - 12. Solve -xb + 7o - 3o = 20, -4o + 20 = 4b for b. 0 Suppose 35 = -6j - 1. Let r be j/(-9)(8 + -5). Solve -3x - 2b - 2 = 5, -2x = rb + 6 for x. -1 Suppose 4q + 5y - 5 = -0q, -3 = 5q - 3y. Solve 3w = -s - 2s + 6, q = 5w - 10 for s. 0 Suppose -2 - 2 = -2m. Suppose 1 = -mi + 13. Let b = i + -1. Solve -4n + 5z = -1, n = -3n - z - b for n. -1 Let t(u) = u*2 + u - 4. Let c be t(-3). Suppose -1 = -5v + 4. Suppose 8 = 3a - v. Solve 2y + 6 = cf, -y - f - f - a = 0 for y. -3 Let j = 10 - 7. Solve v - 5 = -v - jh, -5v = 2h + 15 for v. -5 Let h = 9 - 20. Let p = h - -15. Solve 3b - 3q - 10 + 4 = 0, -3b + pq + 7 = 0 for b. 1 Suppose -3w + 2g + 4 = 0, 3w + 3g + 6 = -0. Suppose t + wj - 5j - 12 = 0, 12 = 3t - 3j. Solve -o - 6x = -x - 21, -10 = -to - 2x for o. 1 Suppose -4v = 2v - 30. Solve vf = -2j + 8, 3f + 4j - 3 = -1 for f. 2 Let g be (-13)/(-2) - -95/(-30). Solve 3q - 3 = -2j - 16, 0 = -gj + 4q + 25 for j. 1 Suppose 0 = 2v + 4n + 4, 3v = -0n - 5n - 3. Suppose -2s - v = -3s. Let q be ((-22)/3)/(1/(-3)). Solve h + 5 = 0, 5h = -5t + st - q for t. 3 Suppose 0 + 6 = 2c - 2r, 0 = -c + 4r + 12. Let h be 9 + c/(2/1). Let z be (-4)/((2 - 3)1). Solve h = 3s, 2 = zk	{ "pile_set_name": "DM Mathematics" }
suming i is positive. i*(-1504/801) Simplify (((dd*2d)/d)/d*(-1)d6/(d(-1)d))/((dd/((dd/(d/(d(-2)d)))/dd))/d(-2/11)d*0d(1/9)/d) assuming d is positive. d(862/99) Simplify (j(-1))(-19)(j/j1)(5/7)(j/j*0jj)(-49)(j/j(-2/5))(-7) assuming j is positive. j*(-689/5) Simplify ((xx(1/3)/x)29((x(-6)/x)/x)/x(4/3))/((x/(x/(x1xxx)))*(1/18)(x/(x*(9/4)/x))/xx(-6)) assuming x is positive. x(265/36) Simplify (((((d/(dd(((d*(-2/3)/d)/d)/d)/dd))/d)/d)/dd)/d)(45/4)/(d6/ddd(-7))((d(-2/7))(-2/71))47 assuming d is positive. d(-4715/1988) Simplify ((p*(-1/6)p)*18((p*(1/22)p)/pppp)/((p/(p/(p(18/5)p)))/p))(-36) assuming p is positive. p(-28602/55) Simplify ((i(-2))(1/26)/(i(2/9)/((i(-8)i)/ii)))/((i*8(i/(i/(i*(5/4)i)))/ii)/(i/i(-2))(-3/2)) assuming i is positive. i(-10319/468) Simplify ((c(-1)/c)(-8/3))(-2/3)/((c/(c/(cc*(-2)))c(-6))/(c2/c(2/11))) assuming c is positive. c(521/99) Simplify (y*(-11)y4)(15/2)(y(1/4)y(-3/4))/(y5y/(yy(1/4))) assuming y is positive. y(-231/4) Simplify ((www(-4/5))(-5/3)/(w*(1/6)w(1/11)))(-19) assuming w is positive. w(2831/66) Simplify ((((r/r(1/3))/r)/rr)/((rrr/(r/r1)rr)/rr)((r(1/4)r)/r)46)/((r(-2/5))(-1/25)/(r(-2/7))(-2/173)) assuming r is positive. r(5589343/908250) Simplify (g(-2/11))(1/4)/(g(6/19)/g(-3/13)) assuming g is positive. g(-3217/5434) Simplify ((o/(o2o))/(o/o(1/20)))(-9)/(((oooo*(-8)o)/((oo4/oo)/o))/(oo(2/7))(-13/2)) assuming o is positive. o(3667/140) Simplify (((u(5/3)u)/u(-23))/((u18/u)/u(-13/4)))24 assuming u is positive. u*130 Simplify ((oo(-2))(-1/9)(o0o)(-35))(-42) assuming o is positive. o(4396/3) Simplify (o/o(2/3)oo/o(2/13))(2/127)(oo*(4/3)/ooooo(-1))(2/3) assuming o is positive. o(33530/14859) Simplify (((q(-5)/q(-1/5))/((q/(qq*5q))/(qq9)))(-34))(-10/3) assuming q is positive. q(3808/3) Simplify ((r/(r0r))*(2/19)/(rrr6/rr*4))/((r/(rr/(r/r(-1/3))))(-2/151)/(r*(-2/5)rr/r4)) assuming r is positive. r(-30341/2265) Simplify (c/(ccc5))/(c(2/3)c)((c/c(-1/3))/cc)*14((c/(c/c(1/13)))/c(-4))/(c(1/2)/c)(-4/9) assuming c is positive. c(1738/117) Simplify (s(-9)/s*(-4)(ss(-1/15)/ss)/(s*(-18)s))(13/6) assuming s is positive. s(1261/45) Simplify (d(-26))21/((d*(5/8)d)/d)(1/3) assuming d is positive. d(-13109/24) Simplify (n*4nn(1/7)/n)(2/43)n((nn*(2/5))/n)/nnn/n(5/3)(nn1n)(33/5) assuming n is positive. n(93578/4515) Simplify (((fff(2/3)/f)/((f(-15)f)/f))/((ffff/f*(-5)f)/f(-4/5)))(-12) assuming f is positive. f(-352/5) Simplify (g/(((g(-2/5)/g)/gg)/g))26/((((gg/(((ggg*(-7))/g)/g))/g)/g)/(g/((gg*0/gg)/g)))(g(-1/2))19g*2gg1gg assuming g is positive. g(789/10) Simplify (k(-1/2))(-18)k*(-1)/kk/(kk(k/k*(-4/9))/kk)k((kk(6/13))/k(2/37))2 assuming k is positive. k(36236/4329) Simplify ((b/b(-1))(-47)/(b(-3/5)/(b(3/2)b)))/((b5)(2/9))30 assuming b is positive. b(-3727/30) Simplify (v1)(-3/5)/(v(-3/2)/v)(1/48) assuming v is positive. v(-263/480) Simplify (((a(-6)a)/a(-3))/(aa*6a(a(-1/6)/aa)/aa))/(a(-1/3)/(a/a5))7 assuming a is positive. a(-71/2) Simplify ((f/(fff(-1/5)))(-22))(2/15)/((f/((ff*(3/2))/ff)ff(-9)/f)/(((f/f(1/2))/f)/f(2/3))) assuming f is positive. f(292/25) Simplify ((ccc*(-9)c)/c*16(c/((((cc1)/c)/c)/cc))/(cc(1/10)))20 assuming c is positive. c(-442) Simplify (l(-2/31)l(-40))/((l(-2/3)l)/l25) assuming l is positive. l(-1432/93) Simplify (j2/j(-18)(j*(-4/25)jjj)/(j/j(-2/49)))(3/10) assuming j is positive. j(40056/6125) Simplify ((u/u(-2/31))/uuu(-5))(1/44)(u2u)*(-17)u/(u*(-6)/u)u/((u/(u/((u*(2/9)u)/u)))/u) assuming u is positive. u(-253571/6138) Simplify (u(1/2)uu*(-6)(u*(-1)u)/uuu*(-2)u)/((u*(-1/3)/uuu)/(u/((u(-1/5)/u)/u)u)(u/u4)/(u/(uuu(-1/4)uu))) assuming u is positive. u(-103/60) Simplify ((ss/((s/((s/(ss(1/24)))/s))/s)ss(-4))/(s(-2/3)s/(s/(s/s(-14)))))(-1/6) assuming s is positive. s(131/48) Simplify ((l(-2)/l)/(l/l(-7)))(-2/107)((ll1)(-42))(-4/5) assuming l is positive. l(36062/535) Simplify n(-1/11)/n(-2)nn*(8/3)n*(-1/2)(n(2/7)/n(2/17))/((nn/n(-2/3))/n(-7)) assuming n is positive. n(-11579/2618) Simplify ((b(-1/12)b)*(-2/23)(bb(-21))/(((b/b(4/3))/b)/b))(2/11) assuming b is positive. b(-2449/759) Simplify b(-3/7)/b(-2/9)(b/b*(-1)bb)(-43)(b/(bb(-3))b8)(-39) assuming b is positive. b(-37876/63) Simplify (((t1)(-5)/(t1)12)(-4/23))(-46) assuming t is positive. t(-136) Simplify (((r/r*1r)/r)*(-10/7)(r(-1))(-2/33))/((r(2/5))(7/2)/(r(-2/3))(-41)) assuming r is positive. r(4289/165) Simplify (((t5/t)/tt(-5/3))/(t(1/4)/t2))/(t(-4)/t(-1)t*4(tt4)/t) assuming t is positive. t(-23/12) Simplify (((cc*1c)/cc(-1))(-4/13))(-2/63) assuming c is positive. c(8/819) Simplify ((v/((v/(vv/(vv(1/6))))/vv))/((((v(v37/vv)/v)/v)/v)/v))/(vv(-1)v((vv/(v*(-5)/v))/vv)/v) assuming v is positive. v(-247/6) Simplify ((g/(g4/g)ggg(((g*8g)/g)/gg)/g)/(g(-1)/(g/g(-1)g)))(14/5) assuming g is positive. g(168/5) Simplify ((((k*(-6)/k)/k)/k)/(kk*20/kkk))/(k(-2/27)kk(-41)k) assuming k is positive. k*(218/27) Simplify (((((zz(-1/21))/z)/z)/z(3/2))/(z(-1))(-4/3))(3/7) assuming z is positive. z(-163/98) Simplify ((w0/(w(-1/2)w))/(w2/(ww*5)))/((w(w/((w*(-2/7)/ww)/w))/w)*(-5/6)(w/w0)/w(-1/2)) assuming w is positive. w(82/21) Simplify (((a1a)(-2/111)(aaa/(a/(a*(-3/2)a)a))/((a(-6)a)/a))(2/7))(4/7) assuming a is positive. a(820/777) Simplify (((a/((a(22/5)/a)/a))/(a/a(-9)))(19/4))(-3/11) assuming a is positive. a(3249/220) Simplify (a(-1))48/(a0)(-40)(a(2/5))(-18)/(a(2/7))(9/13) assuming a is positive. a(-25206/455) Simplify (((a/a(-15))/(a/a(-5)))/((a16aaa)/(a/a(-21))))19 assuming a is positive. a247 Simplify (((j(1/4)/(j/(j*(6/5)jj)))/(jj/(j(1/5)/j))(-49))(-14/9))(-7/11) assuming j is positive. j(45619/330) Simplify (((k(-2/21)k)(-46))(5/9))(-32) assuming k is positive. k(139840/189) Simplify ((o(1/8)/o)/o(4/5))/(((oo(-3))/o)/o(-2/13))((o(-2/3))(-11))32 assuming o is positive. o(367907/1560) Simplify q/(qq*(-36/7))qqq*8qq/(q/q(-6/25))q(1/2) assuming q is positive. q(5741/350) Simplify (ccc*(2/5)c*(-3)(c(ccc(c/(c*(-4)c))/ccc)/c)/((c/(cc(-2)))/c))/(c0/(c/c4))(24/5) assuming c is positive. c(-8) Simplify (((m(-3/2)/m(-29))29)(-2/9))(-1/3) assuming m is positive. m(1595/27) Simplify ((((kk(-3/4))/k)/k)/(k/(k/k0)k))/(k(-2/3))(-9)(k3/(k(-5)kk))(-11) assuming k is positive. k(-299/4) Simplify (j*(-2/3)jj(-2)(j/((j*(-17)j)/j))/j6)27 assuming j is positive. j*279 Simplify ((u/(u/((uu/(u*6u))/u)u)u*8/u)/((u/((uu*(1/8))/u))/(uu/(uuu(-7/5)))))/(u(-4/3)/((u*2/u)/u)(u(-1/4))22) assuming u is positive. u(883/120) Simplify ((y(-33)y)/yy*(6/5)y(-2/107)/((y(2/27)y)/y))2 assuming y is positive. y(-921382/14445) Simplify ((ssss*(-29))/(ss*(-5))(s(s3/s)/s)/(s/(ss/((s(ss*(8/3)/s)/ss)/s))))(3/10) assuming s is positive. s(-13/2) Simplify ((u*4u)/((((u/(u*(1/8)/u))/u)/u)/u))/(uu*(1/3)u)*(-31)(u(-1))(3/37)/(u/(uu/u(-2/5))(uu(-1/3))/u) assuming u is positive. u(355691/4440) Simplify (q(-2/5)qq(q*(-13)qqqq)/q)(-3/11)((qq3)6)(2/77) assuming q is positive. q(102/35) Simplify ((((x/(xx/((x*(-2)x)/x)x))/(x6x))(-3/25))(5/2))22 assuming x is positive. x(363/5) Simplify ((v(-5)/v(-2/21))/((v/(v*7/v))/(v/((vv1)/v))))28 assuming v is positive. v*(8/3) Simplify ((ccc/(c(cc(-6)c)/c))/(c*(-2)c)c(2/33)c/(c/c6))(9/10) assuming c is posi	{ "pile_set_name": "DM Mathematics" }
42) Simplify ((vv2)/v)21(v(2/3))(-33/4) assuming v is positive. v(73/2) Simplify ((j6jjjjj(-3))/(jj(-1))(2/55))(7/4) assuming j is positive. j(49/4) Simplify (f(ff*(-3)/fff)/ffff)*(-4/7)(f(-2))(-7/8) assuming f is positive. f(17/28) Simplify (t15tt(2/13)/t)(-2/47) assuming t is positive. t(-394/611) Simplify (f/f3)*(1/27)/(f/(f/(ff/f(1/2))))(-4/37) assuming f is positive. f*(88/999) Simplify (d/(d/(((dd/(dd6d))/d)/d))d8)/((d(-4/9)/d)/ddd/(d(-37)d)) assuming d is positive. d(-320/9) Simplify (t(-3/11)/(tt(-1/11)))/((tt/(t*(11/4)t)t)/(t(-2/31)t)) assuming t is positive. t*(687/1364) Simplify ((s/(s((s/(s/s*14s))/ss)/s))(-13))(5/14) assuming s is positive. s(390/7) Simplify ((xx(-1))(-1/17)x/x(1/8)xx/x(2/9))(-40) assuming x is positive. x(-955/9) Simplify (s(1/51)/(s(-29)s))/(s*(-4/13)/ss(2/17)) assuming s is positive. s(19366/663) Simplify ((k*(2/3)/(k/(((kk*(-10))/k)/k)))/(kk*(2/27)k(-7/5)))(2/9) assuming k is positive. k(-2972/1215) Simplify h(-1/34)h24hhh*(-2/29)hhh/h(-2/59) assuming h is positive. h(1683295/58174) Simplify ((o*(9/5)o(-18))(-2/21))(-9/7) assuming o is positive. o(-486/245) Simplify g12/(g/g(-2/9))(g/g(5/8))/g(4/13) assuming g is positive. g(10151/936) Simplify (((pp(-5))/(p/(p(1/6)/pppp)p))/((p((p((p((pp/(((p/(pp(-8)))/p)/p)p)/p)/p)/p)/p)/p)/p)/pp/p(-4)))18 assuming p is positive. p(-33) Simplify i39ii(-40)/i(((i*(-2/47)i)/i)/i)38 assuming i is positive. i(-1909/47) Simplify (a*(-6)/(a(a*37/a)/aa))/(a*0aa/(a/(a/a(-37)))) assuming a is positive. a(-82) Simplify ((uu*5u)/(u/(u(u(-2)/u)/u)))/((u(uu/(u(-5)/u))/uu)/(((u/(u/(uu(-2/31)))u)/u)/u)) assuming u is positive. u(-188/31) Simplify ((y/y(2/11))/yy3y((y/(yy/y*(-3/8)))/y)/(yy(2/5)))(-16/7) assuming y is positive. y(-38/385) Simplify b/(b(-2/7)b)b*(3/7)(b(-3))(2/9) assuming b is positive. b*(1/21) Simplify ((dd*(-11))/dd/(ddd*(-7)dd))/(d/d(2/9)d(d/(d8/dd))/ddd) assuming d is positive. d(-25/9) Simplify c(-2/23)/(cc/(c9cc)c)((cccc(-3))/c)(8/7) assuming c is positive. c(1090/161) Simplify (r/(r/(r/(r(8/5)/rr))r))/r*(2/3)rr(-2/5)rr(-7/5) assuming r is positive. r(-31/15) Simplify y9/y(-2/7)y*(-5)y(3/13)/y assuming y is positive. y(320/91) Simplify (dd3d/(d/(d*(-1/19)d))d)/(d(13/5)/(dd12/d)) assuming d is positive. d(1458/95) Simplify (q/(q/(qq(4/7))))/q(3/4)(qq/(q(1/3)q))(-2/69) assuming q is positive. q(4649/5796) Simplify ((s/(s*29s))(-48))(1/9) assuming s is positive. s(464/3) Simplify (r(-3/2)/(r/((rrr*(3/2)rr)/r)))/(r(1/6)r8) assuming r is positive. r(-37/6) Simplify ((j/(j*(-10/7)j))/(jj(-7)))/((j(-4)/j)/j(2/47)) assuming j is positive. j(4103/329) Simplify (i(-26)/(iii(-3/4)i))/(i/(i*11i))29 assuming i is positive. i(1163/4) Simplify ((((s/(s*(-3)s)s)/s)/((ss(3/8))/s))/((s/s2ss)/s(((ss5)/s)/s)/s))0 assuming s is positive. 1 Simplify (p/p(-22))(-16)p(-15)/p((pp25)/pp)/p assuming p is positive. p(-359) Simplify (u(-5))*1u*(-24)(((u/u(3/2))/u)/u)/u assuming u is positive. u(-65/2) Simplify (u(uu*18)/uuu)(-2/15)(((u/(u/(u/(u*(-3)u)u)))/u)/u)/uu/((u*27u)/uu) assuming u is positive. u(-144/5) Simplify o/(o/(o/(((oo*14)/oo)/o)o))o*(4/11)o*(2/39)/(oo/(o/((o(-1/3)/o)/o))) assuming o is positive. o(-1466/143) Simplify (i*(1/2)i)(-29)/((i/(i8/ii))/i(-18/7)) assuming i is positive. i(-547/14) Simplify (q(3/16)q)*(-44)(q(q(-27)/q)/qq)/qq/(qq*(-27))q assuming q is positive. q(-209/4) Simplify (f(3/5)((f(f/((ff(7/6))/f))/f)/f)/fffff)/(f(-2/9))(-1/6) assuming f is positive. f(647/270) Simplify (q/q7qq(-11))11 assuming q is positive. q(-176) Simplify (j5)(14/15)j(2/27)/((j/j1)/j) assuming j is positive. j(155/27) Simplify (j33j/j28)/((jj*(2/9)j)/(j/((j((j/j16)/j)/j)/j))) assuming j is positive. j(196/9) Simplify ((j/((jjj/(j(-4/7)jj))/j)j)/(jj(-1)/j))/((((j(-8)j)/j)/j)/jjj(j/(j(-2/55)j))/jjj) assuming j is positive. j(3616/385) Simplify (r/r15rr(2/35))(4/7) assuming r is positive. r(-1812/245) Simplify ((c(-1/2)c)(-6/13)/(c(1/3))(10/13))(-9/5) assuming c is positive. c(57/65) Simplify ((h(-3/5)/h)/(h/(hhh(3/5)hh))(h/((h/(h*(-8/5)h))/h))/(h/h(-2/31)))(-14) assuming h is positive. h*(-2898/155) Simplify (h(h/(h/(h/h*(-5))h))/h)50/(h/(h7/hh))(-2/15) assuming h is positive. h(1246/5) Simplify j(-2/41)j/(((j/(jj(3/5)))/j)/jj)j(-2/77)/j(j/(j/(jj(1/8))j)j)/j assuming j is positive. j(208393/126280) Simplify (((j/j(-4/17))/j)(-16/3))(-13) assuming j is positive. j(832/51) Simplify qq*(2/9)qq(1/8)(q29/q)/q14 assuming q is positive. q(1177/72) Simplify (o5o(1/31))(-2/129) assuming o is positive. o(-104/1333) Simplify ((y(1/5)yy)12(y/y(-2/13))/(y4y))(-10) assuming y is positive. y(-2932/13) Simplify ((r11)(9/7))37 assuming r is positive. r(3663/7) Simplify ((x(-1/4))44(xxx1)(-1))45 assuming x is positive. x(-630) Simplify (r(-7))36/(rr(-3)/r)(-40) assuming r is positive. r(-372) Simplify (g/(gg*(-4/3)gg)g*(3/2)gg)/((g/g(-14))/(g(-6/7)/g)) assuming g is positive. g(-589/42) Simplify ((a/(aa/((aa(-2/5))/a))aa(3/4))(-33))(-3/5) assuming a is positive. a(693/100) Simplify (((g(-2/13)/g)/g)/(ggg(-2)))/(g/g6g/g(4/19)) assuming g is positive. g(508/247) Simplify (((uu1u)(-34))(1/9))(-11) assuming u is positive. u(374/3) Simplify ((f(-14/3))(-6))(1/2) assuming f is positive. f14 Simplify (d(1/5))(-14)(d/((d/d(-4/3))/d))/(d/(dd9)) assuming d is positive. d(88/15) Simplify ((dd18)/(d/((d/(dd/(dddd0)))/d)))/(d(-1)d12) assuming d is positive. d8 Simplify u*11uu/u(-26)(uu(-15/4))/uu(1/19) assuming u is positive. u(2683/76) Simplify (i(2/5))(-2/55)i16/i(-12) assuming i is positive. i(7696/275) Simplify (n(-5/3)n)(-20)/(n/(n/(n/(n(-2/21)nn)))nn(n/n(6/5))/n) assuming n is positive. n(1411/105) Simplify (m(2/13)/m)(-2)/(m(-13/5)/(mmm(-4)mm)) assuming m is positive. m(279/65) Simplify (zzz7zz)35/((zz(-1/8))/z(2/33)) assuming z is positive. z*(101425/264) Simplify (((oo/o*(2/31))/o)/(o(o/(((o/(o*28o))/o)/o))/o))/(o*(1/9)o)(-15/8) assuming o is positive. o(-10409/372) Simplify ((s/(s/(s(((s/((ss*2s)/s))/s)/ss)/s)))/s(3/5)s/(ss(4/3)/s)s(ss*(2/17)s)/s)(-32) assuming s is positive. s(14816/255) Simplify (qq(4/13)q17)/((q(3/7)q)/qq)45 assuming q is positive. q(-4184/91) Simplify ((q*(-4)q)/q(-5))/(q(-1/6)/(q/((q(2/27)/q)/q))) assuming q is positive. q(275/54) Simplify (v/(vvv(vv/(vv22))/vv)v/(v/(v(1/4)/vv)))(-8/11) assuming v is positive. v(-14) Simplify (x(-1/8))(-46)/((x/(x*(3/8)/x))/xx/(xxx*(-6)x)) assuming x is positive. x*(9/8) Simplify (t/((t((t/(t/t*(-3/5)t))/t)/tt)/t)t*0)/((t(tttt(1/2))/tttt)/(t/t*(-2/17)t)) assuming t is positive. t*(-133/170) Simplify (aa(-23))/a(9/4)(a(-2))48 assuming a is positive. a(-481/4) Simplify (b/b(-12))/bb*(-10)bb(2/19)/bb(b/b(-2/5))/b assuming b is positive. b(333/95) Simplify (((((b/(bb(-2/11)))/b)/b)/b(-6))/((bbb3)/b0))(2/57) assuming b is positive. b(-6/209) Simplify (zz/z(-3/4)z)/(z*(-5)z)(z/(z(-1/35)z))/((z/(z/z(-32)))/z) assuming z is positive. z(5709/140) Simplify (q*(-11)/((q/(q/(qq*(3/2)q))q)/q))/((q/(q2/q))/q)(-38) assuming q is positive. q(-105/2) Simplify (y(-4)y(6/5))/(y(-12)yy*(-1/12)yy) assuming y is positive. y(377/60) Simplify ((p(-11/4)p)/((pp(-6/7))/pp))16 assuming p is positive. p(-212/7) Simplify (((uu/(uu*(-13)/u)uu)/u)/u)/(u(-2/7)/uu)(u(2/7))(-1/53) assuming u is positive. u*(5669/371) Sim	{ "pile_set_name": "DM Mathematics" }
) + sqrt(117) - -2sqrt(117)1)/(((sqrt(81) - (sqrt(81) - sqrt(81)2))-5 - sqrt(81) - sqrt(81))/(sqrt(9) + -2sqrt(1296))). -23sqrt(13)/6 Simplify ((sqrt(70) + -5sqrt(70))3 - sqrt(70)35)/(((sqrt(240)/sqrt(4))/sqrt(3))/(3-2sqrt(2))). 162sqrt(7) Simplify (1 + sqrt(14)/sqrt(2) - sqrt(7) - (2 + sqrt(7))3)*2 + 2 + (2sqrt(28)/sqrt(2))/(sqrt(2) - sqrt(160)/sqrt(5)). 88sqrt(7)/3 + 90 Simplify (-3(sqrt(1088) - (sqrt(1088) - (sqrt(1088) + sqrt(1088)-1)))25 + 6-2(sqrt(1088)-1)2 + -5)-4-5. -261220 Simplify (5(sqrt(77) - (3sqrt(77) - sqrt(77) - sqrt(77)))2-1)/((-1sqrt(99)-3 + sqrt(99))/(sqrt(9) - sqrt(27)/(sqrt(3) - (sqrt(3) - -1sqrt(3))))). 0 Simplify (-5 + 2(1 + (sqrt(108) - (sqrt(108)1 + -5)))4 + 2 + -3)2. 1764 Simplify (-1((-1sqrt(130)6 + sqrt(130) - sqrt(130)) + sqrt(130))-4)/((sqrt(360)-1 - sqrt(20)/(1sqrt(2)))-5). -4sqrt(13)/7 Simplify (1 + sqrt(125) + -3 + 1 + 5)2 + (5 + sqrt(720) + sqrt(720) + 2 + sqrt(720) + (sqrt(5) - (-1 + sqrt(5))-2))*2. 430sqrt(5) + 7771 Simplify (3(4 + (((3sqrt(189) - sqrt(189)) + sqrt(189))/sqrt(3) - sqrt(63)))*2 - (3sqrt(567)2 - (sqrt(567)-2 + 3))) + -3. 72sqrt(7) + 804 Simplify (-5 + (sqrt(612) - (sqrt(612) - (sqrt(612) + 2 + sqrt(612)))4)6 - (5 + 5(-2 + sqrt(68)/(sqrt(20)/sqrt(5)))))*2. 16800sqrt(17) + 522929 Simplify 3(-5 + (sqrt(11) - sqrt(1100)-2)-3 - -4sqrt(33)/(-5(sqrt(12)/sqrt(4) + sqrt(3)))). -951sqrt(11)/5 - 15 Simplify -2(1 + sqrt(1584))2 + 0 + -3(2 + sqrt(1584) + sqrt(1584))2 + 2sqrt(1584) + 5. -19019 - 312sqrt(11) Simplify (-5(sqrt(171) + -1 + -3) - (2 + -2(-5 + sqrt(684) + sqrt(684)))2) + 1. -11067 + 561sqrt(19) Simplify (-1sqrt(275)/(sqrt(11) - (sqrt(110)-2)/sqrt(10)))/(((1sqrt(300))/sqrt(5))/(sqrt(588)-2 + sqrt(588))). 7sqrt(5)/3 Simplify (sqrt(1377) + sqrt(1377) + (-4 + sqrt(1377)-2)*2)2 - (-4 + sqrt(153) - ((sqrt(204)3)/sqrt(12))2). 321sqrt(17) + 11205 Simplify (-5-6sqrt(68)13)/(-522sqrt(196)). -9sqrt(17)/14 Simplify (4(-1 + (-4 + 1sqrt(117) - sqrt(117)) + sqrt(117))*2 + -5((sqrt(117) - (-1 + sqrt(117))4) + sqrt(117) + sqrt(117) + 0))-1. -548 + 105sqrt(13) Simplify (-4 + 1sqrt(468))-1 - (6sqrt(39)/sqrt(3)-5-6)*2. -421196 - 6sqrt(13) Simplify (-2 + (2 + sqrt(637) + -1 - (2 + 0 + sqrt(637))))*2 + -1((sqrt(1053) + -5 + (sqrt(1053)-1 - sqrt(1053)))-6)*2. -38799 - 3240sqrt(13) Simplify -1(-4 + 5(sqrt(5) - 1sqrt(80))2) - (sqrt(30)/sqrt(6) + -4 + sqrt(540)/sqrt(3) + -3). -214 - 7sqrt(5) Simplify -5 + ((-3 + (-1sqrt(275))2 + sqrt(275) - sqrt(275)) + ((1sqrt(275))*2 - sqrt(275)) + 5 - (-3 + sqrt(275))4-1). 15sqrt(11) + 535 Simplify 0 + (-1 + (sqrt(500) - sqrt(5)))*2 + sqrt(60)/sqrt(3) + 5 + -3. -16sqrt(5) + 408 Simplify (-6((-5 + sqrt(80)2 + sqrt(80))-4-2 + 4(-5 + sqrt(80) + 2sqrt(80) + 4)))*2. -456192sqrt(5) + 3802176 Simplify (5(sqrt(245)/(sqrt(21)/sqrt(3)) + (sqrt(140) - 2sqrt(140))))/(4(1sqrt(1008) - sqrt(1008) - sqrt(1008)) - sqrt(1008)26). 5sqrt(5)/192 Simplify -2 + ((sqrt(1100) + 0)2-5 + sqrt(1100) - (-2 + sqrt(1100)2)) + -1 + 1. -5500 - 10sqrt(11) Simplify -1((2sqrt(104))/sqrt(8) + sqrt(143)/(sqrt(11)-2)) - (sqrt(78)/(-5sqrt(6)) + sqrt(13) + sqrt(13) + (sqrt(13) + 4)*22). -193sqrt(13)/10 - 58 Simplify (-4(sqrt(132) - sqrt(132)-3))/(sqrt(12) + 6(sqrt(12)-1 + sqrt(12))) + (-4 + (sqrt(891) + -3(sqrt(891) + 2) - sqrt(891)) + 5)*2. 254sqrt(11) + 8044 Simplify (sqrt(285)/(sqrt(25)/sqrt(5)) + sqrt(1425)1)/(((-2sqrt(270) - sqrt(270))/sqrt(10))/(sqrt(225)-1)). 10sqrt(19) Simplify (sqrt(68)1-5 + (sqrt(68) - sqrt(68)-5)-6)*2 + -4 + 3 + (2sqrt(68) + sqrt(68) + sqrt(68))*2 + -3. 115392 Simplify (-1-6(sqrt(24) - -1sqrt(24))4)/(((sqrt(88)2 + sqrt(88))-4)/(-1sqrt(33)/sqrt(3))). 4sqrt(3) Simplify (5(1 + ((2sqrt(170))/sqrt(10) + sqrt(187)/(sqrt(77)/sqrt(7)) - (-5(-1sqrt(187) - sqrt(187)))/(1sqrt(22)/sqrt(2)))))*2. -350sqrt(17) + 20850 Simplify (4(0 + sqrt(448))6 + 1 + 1 + (sqrt(448) - sqrt(448)-2) + -2)2. 326592 Simplify (2(sqrt(95)-2-3 + sqrt(95) - sqrt(95) - (sqrt(95) + sqrt(95)-2 + sqrt(95))-2))/((2sqrt(405) - sqrt(405))-62). -sqrt(19)/9 Simplify (-6(sqrt(204)3 + sqrt(204)) + sqrt(204) + -5sqrt(204)3)/(sqrt(432) + (sqrt(432) - 2sqrt(432)) + sqrt(432) + (1sqrt(48))/sqrt(4)). -38sqrt(17)/7 Simplify 5 + (4(sqrt(66) - (-1sqrt(66)1 + sqrt(66)))-4)/((sqrt(864) - sqrt(864)-2)-3 - (sqrt(864) - -1sqrt(864)-5)). 4sqrt(11)/15 + 5 Simplify -2 + -3(-21sqrt(153)-6)/(sqrt(9) + sqrt(36)/sqrt(64) + -4(1sqrt(9) - sqrt(9))). -144sqrt(17)/5 - 2 Simplify 1(1(sqrt(2448) - (sqrt(2448) + 2(-2 + sqrt(2448) - sqrt(2448))))-143)*2. 2304 Simplify 2(2((0 + sqrt(1573) - sqrt(1573)) + -4) + -4)5. -120 Simplify sqrt(38)/((sqrt(2) + sqrt(2)-2)-4)5 + -3 - (-1sqrt(76)-2)/(4sqrt(100)). -3 + 23sqrt(19)/20 Simplify -1 + 4((sqrt(10) + (sqrt(20) + sqrt(500))/sqrt(2))-2)/(sqrt(12)/(sqrt(42)/(sqrt(42)/sqrt(6)))). -56sqrt(5) - 1 Simplify 3(sqrt(275) + (sqrt(275) + 2)-2)*2 - -2(((2sqrt(11)5 - sqrt(11)) + sqrt(11) - sqrt(11))*2 - (sqrt(11) - sqrt(132)/sqrt(48))). 119sqrt(11) + 2655 Simplify (3(0 + sqrt(1100))1-4 - (5 + (sqrt(176) - 6(sqrt(176) - (-1 + sqrt(176)) - sqrt(176))))-3)2. 216sqrt(11) + 14265 Simplify (((sqrt(425)-2 + 3)-1 - 5(-1 + (sqrt(17) - sqrt(51)/(sqrt(12)/sqrt(4))) + sqrt(17)))-6)*2. 720sqrt(17) + 15444 Simplify (((-3sqrt(170)-3 - sqrt(170)) + sqrt(170) - -6sqrt(170)-1)/(-5sqrt(50)/(sqrt(55)/(sqrt(99) - sqrt(11) - sqrt(11)))))2. 153/25 Simplify (-1(sqrt(153) - -1sqrt(153)3 - sqrt(153))1)/((sqrt(9) - (sqrt(9) - -4sqrt(900))) + ((sqrt(9) + sqrt(9)5)5 - sqrt(9))). 3sqrt(17)/11 Simplify ((5 + (-1sqrt(833) + 2 - -1sqrt(833)-3) + 1(5 + 5(sqrt(833) - (0 + sqrt(833)))))-3)2. -6048sqrt(17) + 121248 Simplify ((sqrt(600)16 + sqrt(600)-22)/((sqrt(36) - (sqrt(1296) + (sqrt(1296) - sqrt(1296)-1)))/sqrt(3)))2 + 5. 1645/289 Simplify (-2 + sqrt(130)/((-3sqrt(110))/sqrt(11)))*2 + 2 + (6sqrt(130)/sqrt(5))/sqrt(2). 67/9 + 22sqrt(13)/3 Simplify ((-2sqrt(180) - sqrt(180))/sqrt(10) - sqrt(18))/(1sqrt(54)) + (-2(sqrt(297)1)/sqrt(11))2. -4sqrt(3)/3 + 108 Simplify ((sqrt(245) + -2 + -4 - (sqrt(245) - -3(sqrt(245) + 2))) + 1 - (2sqrt(245)-1 + -2 + sqrt(245) + 5)-3)*2. 168sqrt(5) + 8824 Simplify 3 + (2 + 1sqrt(3388) + 0 + -3 + -3)-3 + -1. -66sqrt(7) + 14 Simplify -2(1 + sqrt(512) + -1 - sqrt(512))644. 0 Simplify (4((sqrt(80) - (0 + sqrt(80))) + -1) - sqrt(80)1-33)254. -5760sqrt(5) + 129920 Simplify 5 + ((2 + (sqrt(275) - (1 + sqrt(275) + -2) - (sqrt(275) + (sqrt(275) + 1 - sqrt(275)) + sqrt(275))4) + -5 + -2)-5)*2. 16000sqrt(11) + 441605 Simplify -2 + 4 + sqrt(6)/(sqrt(242)2) + ((-1 + sqrt(432) + -3)2 - (sqrt(432) - (-6sqrt(432)3)2)). -2375sqrt(3)/22 + 140418 Simplify -2(((-4 + sqrt(720))-6)*2 + sqrt(720)) + -4 - ((-2(sqrt(720) + -1 + 4))*2 + -4). -55908 + 6600sqrt(5) Simplify 1(-5 + (sqrt(11)3)*2 - sqrt(11))-1 + (sqrt(88)/(sqrt(56)/sqrt(7)))*2 + (sqrt(825) - sqrt(33))/sqrt(3) + sqrt(11). -83 + 6sqrt(11) Simplify -3 + (5 + -5((3(sqrt(2) - (-2sqrt(2) - sqrt(2))) - sqrt(2)) + -5 + sqrt(8)) + 2)2 + 2. -4160sqrt(2) + 9473 Simplify -4 + (-1 + -3(-3 + sqrt(931) + sqrt(931)) + 1sqrt(931)2 + (sqrt(931) + (sqrt(931) - ((-2sqrt(931) - sqrt(931)) + 4)) - sqrt(931)))*2 + -5. 7 Simplify -2(sqrt(475) + 0 + -2 + sqrt(475)) - (-4 + (sqrt(19) - (-2sqrt(171))2) + sqrt(19) + 1 + sqrt(1900)). -32sqrt(19) + 691 Simplify ((-2sqrt(240))/(sqrt(5) + sqrt(25)/sqrt(5)5) - (23sqrt(243) - ((sqrt(243) + -1)-1 + sqrt(243) - sqrt(243))))2. -386sqrt(3)/3 + 37252/3 Simplify ((6-2sqrt(95) - sqrt(95) - sqrt(95))/sqrt(5) + -3 + 3 + (sqrt(228)2)/sqrt(12) + (sqrt(19) - (4 + sqrt(38)/sqrt(2))))-1. 4 + 12sqrt(19) Simplify (12-5sqrt(66)3)/((sqrt(120)4 - sqrt(30))/(sqrt(180)-2)). 360sqrt(11)/7 Simplify 4 + ((-6-2sqrt(2))*2 + -62sqrt(2) - sqrt(18)/((sqrt(81) + sqrt(81)3)/sqrt(9))) + 5. -49sqrt(2)/4 + 297 Simplify ((1sqrt(85)4 + sqrt(85) + (sqrt(85) - (-5-1sqrt(85) - sqrt(85))) + sqrt(85))-3)/(5(1sqrt(5)-2 + (-2sqrt(20) + sqrt(20))/sqrt(4))). 3sqrt(17)/5 Simplify ((sqrt(91) - 5-2sqrt(91) - (-3(sqrt(91) - s	{ "pile_set_name": "DM Mathematics" }
be ((-1)/(-10))/(3/6). Which is the third smallest value? (a) -5 (b) 6/5 (c) y b Let v = 1 - -13. Which is the smallest value? (a) v (b) -1 (c) 4/3 b Suppose -2k - 6 = -3g, -2k - 15 = 3k. Suppose -2x + 2t + 7 = t, 5x - 3t - 17 = 0. Which is the second biggest value? (a) -5 (b) g (c) x b Let l(j) = -j*2 + 3j - 1. Let f be l(3). Suppose 0x + 2x = 0. What is the second smallest value in 3/5, x, f? x Let h be (-10)/15 + 1/(-3). Let t = 3.1 + -3. Let p = -0.4 - t. What is the biggest value in p, 0.2, h? 0.2 Let f = 6.87 - 1.17. Let h = f + -6. What is the second biggest value in -0.2, h, 1/4? -0.2 Let s = -0.08 - 0.92. What is the second biggest value in 0.1, s, 0.6? 0.1 Let m = -41.5 - -28. Let u = m + 14. Which is the second biggest value? (a) -0.1 (b) u (c) -3/5 a Let m = -0.57 + 0.87. What is the biggest value in m, 1.1, -0.5, -0.4? 1.1 Let p = -34/49 + 1045/588. Let m be ((-40)/3)/4 + 3. Let l = m + p. What is the third biggest value in -0.2, -1, l? -1 Let f = -0.094 + -0.106. Which is the third smallest value? (a) 2/11 (b) -3 (c) f a Let m(q) = q*3 - 3q2 + q - 3. Let k be m(3). Let n = 19 + -11. Let x = n + -3. Which is the smallest value? (a) x (b) -2 (c) k b Let r = -5 + 4. Which is the smallest value? (a) r (b) -4 (c) -8 c Let l(q) = -q2 - q. Let b = -11 + 10. Let i be l(b). What is the second biggest value in i, 1/6, 4? 1/6 Let p = -79/56 - -9/7. Which is the second biggest value? (a) -1.1 (b) p (c) 0 b Let m = -347 - -1734/5. Let q = -0.1 + 0.3. Let l be (-2)/(-6)9/2. Which is the smallest value? (a) l (b) m (c) q b Let d = 10 - 6. Let y be (-9)/42-20 - d. Suppose -3 = 4x - x. Which is the second smallest value? (a) x (b) 0.03 (c) y b Let g = -38.8 - -39. What is the fourth smallest value in -4, 5, 0.03, g? 5 Let f = -5.7 - -7. Let k = -1 + f. Which is the second smallest value? (a) -0.3 (b) -4 (c) k a Let t = -104/5 - -21. Which is the biggest value? (a) t (b) -1 (c) -13 a Let k = 0 + -0.07. What is the biggest value in k, 0, 1/5? 1/5 Let u = -0.394 - 0.006. What is the third smallest value in 0, 4, u? 4 Let i = -0.06 + -4.94. Let w = -8.2 - -3. Let h = i - w. Which is the second smallest value? (a) h (b) 1/2 (c) 4 b Let t = 1.2 - -1.5. Let k = 0.3 + t. Let g = 202 + -1820/9. What is the third smallest value in 2, k, g? k Let d be 6/72(-1 - -5). What is the second biggest value in -0.3, d, -1/7? -1/7 Let j = 3 + -2.8. Which is the second smallest value? (a) j (b) 1 (c) 2/15 a Let g = 221 - 1550/7. What is the third smallest value in -1/5, g, -2/17? -2/17 Let z be 3/(30/98) - (-4)/20. Which is the third smallest value? (a) z (b) 5 (c) 2/17 a Suppose 0h - 2h = 12. Let w be h/520/8. What is the third biggest value in -4/5, w, -1? w Let h = 4/41 - -103/205. Let o = 0.7 + -0.3. Let y = -1 + -4. What is the second biggest value in h, o, y? o Suppose -18 = -z - 17. What is the third biggest value in z, 5, -4? -4 Suppose -45 - 9 = 3l. Let q be (-10)/20 + l/4. Let x be (6/(-9))/(4/(-3)). What is the second biggest value in x, q, -0.3? -0.3 Let o be (-8)/(-126)9/(-6). Let i = 2298/1595 - 16/11. Let v = 12/29 + i. What is the biggest value in v, o, -0.3? v Let j = -44/7 + 192/35. Which is the third biggest value? (a) j (b) -1 (c) -3 (d) 1/8 b Let t = 22 - 24. Which is the smallest value? (a) -1 (b) t (c) -0.4 b Let s(d) = -d3 - 2d*2 + 3d + 1. Let h be s(-3). Let g be 21/(-180) - h/(-4). Which is the third biggest value? (a) g (b) -2 (c) 3 b Let p(k) be the first derivative of -k*3/3 + 5k*2/2 - 5k - 5. Let x be p(4). What is the second smallest value in -4, x, 2/11? x Let u = -1 - -4. Let q = -2 - -1.1. Let p = -1 - q. Which is the third biggest value? (a) u (b) p (c) 0 b Let q = 0.77 - 0.7. Let f = q + -0.37. Let d = 13 + -10. Which is the smallest value? (a) d (b) f (c) 5 b Let h = -0.1 + -0.1. Suppose -3x - 5o = -15, 4x - 3o - 5 = 3x. Suppose -xu = -3u - 2. Which is the biggest value? (a) -2 (b) u (c) h b Let d = 0 + -1. Let q = -3 - -2.7. Let g(y) = y2 + 7y + 8. Let j be g(-6). What is the second biggest value in j, d, q? q Let l = -0.49 - 0.21. Let j = 4.3 - l. Which is the third smallest value? (a) 0.2 (b) 2 (c) j c Let p = 0.01 + 3.99. Let l = -5 + p. Let b = -5 + 9. What is the second smallest value in b, l, 0.03? 0.03 Let y be 4/(-33)(-9)/6. Which is the smallest value? (a) y (b) -3/2 (c) 4 b Let f = -188/5 - -1519/40. Let z = 8.9 - 8. Let r = z + -1.2. What is the third biggest value in 3/4, f, r? r Let f = -355/1608 + 12/67. Let l = -11/120 + f. Which is the second biggest value? (a) 0 (b) 3 (c) l a Let n = -8 + 10. Let g = -1.8 - -1.5. Which is the second biggest value? (a) 0.1 (b) g (c) n a Let h = -0.03 - -0.53. What is the biggest value in h, 0.2, 1? 1 Let d = 0.001 - -4.999. What is the third biggest value in -0.1, 0.2, d? -0.1 Let v = 42 - 17. Let p be (-10)/v + 1/(-35). What is the third smallest value in -3, 0.4, p? 0.4 Let c = -7 + 6. Let q = 4 - 13. Let s = -6 - q. What is the biggest value in 0.5, c, s? s Let r = -2 - -2.1. Let o be (1/(3 - 0))/(-1). Let s be 2/(-8)8/(-18). Which is the smallest value? (a) o (b) s (c) r a Let m = -111 - -891/8. Let q = -0.2 - -0.3. Let v = q - 0.3. Which is the second smallest value? (a) m (b) v (c) -3 b Let x = -0.1 - 0.1. Let z = -14 + 12. Which is the smallest value? (a) x (b) z (c) 4 b Let m = 0.01 - 0.21. Which is the second biggest value? (a) 0.2 (b) 2/7 (c) m a Let z = 7 + -5. Suppose 4f + 4 + 4 = 0. What is the smallest value in -4, z, f? -4 Let t = -0.71 + -0.29. What is the fourth biggest value in -3/2, 1/3, t, 1/23? -3/2 Let y = -0.02 + 0.06. Let s = 3.96 + y. What is the smallest value in s, 3, 0? 0 Let x = -0.46 + 0.06. Let k(d) = -d3 - 6d*2 + d + 6. Let f be k(-6). Suppose f = -g + 5g - 12. Which is the third smallest value? (a) -2/13 (b) x (c) g c Suppose 0 = 3l - 4h + 10, -2l - h - 4 + 12 = 0. What is the smallest value in -3, l, 0.1, -2? -3 Let u = -7 - -5. What is the third biggest value in -2/11, u, -0.5? u Suppose -24g = -20g - 12. Let q = 17 + -12. Let u = -1 + 0.5. Which is the biggest value? (a) u (b) q (c) g b Suppose -5m + i + 125 = 0, 0i = -4m - 2i + 86. Let s be ((-1)/(-7))/(m/(-28)). Which is the second smallest value? (a) 4 (b) 6 (c) s a Let t = -2 + 1. Let q = 12/17 + -50/119. Which is the second biggest value? (a) t (b) 3 (c) q c Let i = -43/330 + 1/33. Which is the third smallest value? (a) -1/7 (b) -2 (c) -2/11 (d) i a Suppose 0 = 5h + t + 9, t + 3 = h - 0. Let s be -42/((-8)/h). Let z be 27/35 - s/(-5). Which is the smallest value? (a) z (b) 0 (c) 3 b Let j be 45/184/10. Let o be (j/24)/((-2)/(-6)). Let l = -41/18 + 7/9. Which is the second smallest value? (a) o (b) 0.5 (c) l a Let y = -2 - -1.7. Suppose -28 = -5z + z - 4r, -4r + 14 = -3z. Which is the third smallest value? (a) y (b) z (c) 5 c Suppose -3t + 6t = 9. Suppose -ts - 6 = 3. What is the smallest value in -2, s, -0.2? s Let p be (-1 - -2) + (-1)/3. Let i = 0.017 - -3.983. Which is the second smallest value? (a) -1 (b) p (c) i b Let o = 1.4 + -1. Let x = o - 0.3. Let z = 209/5 + -42. Which is the third biggest value? (a) z (b) x (c) 2/17 a Let z be 40/(-30)(-6)/76. Which is the second smallest value? (a) z (b) 2/9 (c) 4 b Let l = 0.4 + -0.3. Which is the second biggest value? (a) 3 (b) l (c) -0.04 b Let i be 62(-3)/(-6). Let g = i + -4. Suppose -r = -3k - 15, -gr - k = -0k - 2. What is the third smallest value in r, -5/3, -0.4? r Let g(l) = l - 1. Let t be g(5). Let i be (t/6)/((-21)/(-9)). Which is the second smallest value? (a) 0.3 (b) 0.5 (c) i a Let x = 13 - 18. Let w be (-11)/13 - 5/x. Let s = 5 + -10. Which is the biggest value? (a) w (b) -1 (c) s a Let h(z) = -19z*2 - 1. Let v be h(1). Let j be v/(-8) + 1/2. Suppose -4l - 3 = -jl. What is the third smallest value in l, -2/5, 2/11? 2/11 Let n = 1 - 5. Suppose 7h - 14 = 5h. Let j be (-2)/(-24)(h + n). What is the third biggest value in -5, 0.1, j? -5 Let g = 14.02 + -14. Let o = -2.02 + g. Let i = -1382/7 + 197. What is the biggest value in o, i, 1/3? 1/3 Let q(w) = -7w2 + w. Let o be q(1). Let u = -6 - o. Let b(i) = -i*2 -	{ "pile_set_name": "DM Mathematics" }
? False Is 167116811 composite? False Is 154252886881 a prime number? False Is 67129793557 a prime number? True Is 814150187 a composite number? False Is 4244291169 prime? False Is 17880870211 composite? False Is 35861813833 a prime number? False Is 957998567 a composite number? False Is 290809606 a prime number? False Is 5201866447 composite? False Is 62312760313 a composite number? True Is 10754491199 a composite number? False Is 41566208583 composite? True Is 87397478423 a prime number? False Is 175568708845 a composite number? True Is 4886454611 composite? True Is 3683034359 a composite number? False Is 24182305351 composite? False Is 9799589387 a prime number? False Is 48095101817 a composite number? True Is 1969755679 a composite number? False Is 2228688587 composite? True Is 1498957763 a composite number? True Is 56169433465 a composite number? True Is 444747841 composite? True Is 4804993153 a prime number? True Is 161150513 composite? False Is 53371480789 composite? True Is 1398487567 prime? True Is 2844933421 composite? True Is 13732644713 a prime number? True Is 31390620463 a prime number? True Is 2053494841 a prime number? False Is 1295263493 prime? True Is 784018399 a composite number? False Is 26554723327 a prime number? False Is 17276802227 composite? False Is 3282392051 a composite number? False Is 18037519781 a composite number? False Is 52790603 a composite number? False Is 14521348489 a composite number? False Is 2349463759 a composite number? True Is 30502880161 prime? False Is 1213406759 prime? True Is 155705188103 prime? True Is 18242825563 a prime number? False Is 32778531521 composite? True Is 18461032727 a prime number? True Is 206939851 a composite number? False Is 435512678 prime? False Is 7532933774 a composite number? True Is 42124001702 a prime number? False Is 13394546939 a prime number? True Is 18543063499 composite? False Is 11915772837 a prime number? False Is 660709823 a prime number? True Is 53361533 composite? True Is 79333589711 a prime number? False Is 313302793 prime? True Is 573751741 prime? False Is 12417505523 a composite number? False Is 16190333569 prime? False Is 710338219 prime? True Is 44563439 prime? True Is 5738088599 a prime number? False Is 823774547 a composite number? False Is 4519552951 composite? False Is 15546413461 a prime number? True Is 7488819593 a composite number? False Is 1163884607 a composite number? False Is 25107679397 a prime number? True Is 2174460427 a composite number? False Is 25151545813 composite? False Is 225228793 a prime number? False Is 8605374907 a composite number? True Is 70110311027 composite? True Is 1021280749 a composite number? True Is 5662855403 prime? True Is 22840860799 a prime number? False Is 47891065063 composite? True Is 1015824793 composite? False Is 740060771 composite? False Is 17278911389 a prime number? True Is 94467960661 composite? False Is 40772592143 prime? True Is 22383923 prime? False Is 47330819051 a composite number? False Is 173921173 a composite number? True Is 10289744849 a composite number? False Is 2121384791 composite? False Is 593589533 composite? False Is 63482689463 a prime number? False Is 15123538763 a prime number? True Is 5516470609 a composite number? True Is 7993047603 prime? False Is 788836079 a prime number? False Is 79090473893 composite? False Is 2262647029 a prime number? True Is 29601981977 a prime number? True Is 546168811 a composite number? True Is 78157289681 a composite number? True Is 234174671 composite? False Is 3008084293 a composite number? False Is 750563029 composite? True Is 2564308573 composite? True Is 1503877841 a prime number? True Is 492899413 a prime number? True Is 31159327379 prime? True Is 475692559 a prime number? False Is 232624451 a composite number? False Is 11640084077 a composite number? False Is 689855941 composite? True Is 3773229773 composite? True Is 1221343489 composite? True Is 8654834371 prime? True Is 1048666579 a composite number? False Is 421611917 a composite number? True Is 2824102871 composite? False Is 3301004167 a composite number? False Is 362102339 composite? False Is 76512983 prime? False Is 60898872887 prime? True Is 298045973 a composite number? False Is 16265270579 prime? False Is 735652649 a prime number? True Is 905302897 composite? True Is 4317727 a composite number? False Is 34611585131 prime? False Is 1982867093 composite? True Is 14904913709 prime? False Is 113527012621 a prime number? False Is 1960680253 prime? False Is 5954689747 a prime number? True Is 231980251 a composite number? True Is 1157510782 composite? True Is 30559271 a prime number? True Is 30256631087 a composite number? False Is 540653053 a prime number? False Is 2780284681 composite? True Is 210335027 prime? False Is 21121759427 a composite number? False Is 86553395497 a composite number? False Is 53851172501 a prime number? False Is 196779059 prime? True Is 14370352949 a composite number? False Is 2736764097 a prime number? False Is 1712259607 composite? True Is 794833085 a composite number? True Is 68340884263 prime? False Is 582887705 a composite number? True Is 131203829 prime? True Is 1786872583 prime? True Is 50770241 a prime number? True Is 4484217761 prime? True Is 1101025059 a prime number? False Is 10188337403 a prime number? True Is 104340363 a prime number? False Is 3216180971 a prime number? True Is 207647359 prime? False Is 207093891949 a composite number? True Is 979794209 prime? False Is 13616865701 a composite number? False Is 1465343881 composite? False Is 74104124449 composite? True Is 2502727631 a prime number? False Is 1526865779 a composite number? True Is 94565924491 a prime number? True Is 793343515 a composite number? True Is 191147947 composite? True Is 7122026033 a prime number? False Is 1954720451 prime? True Is 1304434787 prime? True Is 203875229 a prime number? True Is 48438407 a prime number? True Is 105302339737 composite? True Is 280269562 a composite number? True Is 262894267 composite? False Is 614539619 a composite number? False Is 10604806183 prime? False Is 13702627369 a composite number? False Is 1991881343 a composite number? False Is 85023337 a prime number? False Is 89979098711 composite? False Is 6003546257 a prime number? True Is 80983411 composite? False Is 776310719 prime? True Is 2220649441 a prime number? False Is 409361930201 prime? False Is 161985179 a composite number? True Is 10999462279 composite? True Is 16760985107 a prime number? True Is 166414969 composite? True Is 230830973 composite? False Is 3789862537 prime? True Is 3433765081 prime? False Is 456556957 prime? True Is 478756729 a composite number? True Is 31500439037 a prime number? True Is 19014941279 composite? False Is 7964223401 a prime number? False Is 1349082547 a prime number? True Is 476045027 a composite number? False Is 1015358543 a composite number? True Is 35147123743 prime? False Is 5141680562 composite? True Is 856041101 prime? False Is 393306841 composite? False Is 325679503 a composite number? True Is 127159091 a prime number? True Is 7355296261 composite? False Is 345724061 composite? False Is 119558977 composite? True Is 8706521377 a prime number? False Is 34743975815 a prime number? False Is 342632869 a prime number? True Is 80684665199 a composite number? True Is 906585259 composite? False Is 4674128677 a prime number? True Is 297069289 composite? True Is 2061236533 a composite number? True Is 156147931513 composite? True Is 1444534969 a composite number? True Is 862602511 a prime number? False Is 334912879573 prime? True Is 5028578263 a composite number? False Is 104435025367 a composite number? False Is 419916611 a composite number? False Is 2528419681 composite? False Is 329242591 prime? False Is 371734303 a prime number? False Is 183775637 composite? True Is 1300952167 a composite number? False Is 2279448181 prime? True Is 181982939 a prime number? False Is 126430153 a composite number? False Is 403872745 prime? False Is 502406407 a composite number? True Is 137953259 a prime number? False Is 879011521 prime? False Is 8240478287 composite? False Is 1558234097 prime? False Is 73992010699 a composite number? False Is 475008559 a prime number? True Is 5508561259 p	{ "pile_set_name": "DM Mathematics" }
Let f(n) = -n*2 + 2n. Let b be f(0). Suppose 2j = -8, -d + 0d + 5j = -24. Solve b = 5a - p - 9, -5a - dp - 7 = -p for a. 1 Let w = 13 + 19. Suppose w = x + 9. Let j(f) = -2f + 22. Let q be j(9). Solve -d = -2n - 3, qd = -4n + n + x for n. 1 Let m = -5 - -3. Let r be 51/12 + m/8. Solve -rb + b = 2n - 8, -3b - 8 = -2n for n. 4 Suppose 8g - 3g - 40 = 0. Let k = -54 + 59. Solve -6 = -3i + x + 2, -ki = x - g for i. 2 Let x = 0 + 5. Let y be ((-6)/(-10))/(1/x). Solve t + 7 = n - yt, -12 = 4t for n. -5 Let r(c) = 2c - 13. Let d be r(8). Solve 2z = 5t + dz - 9, -2z = 4t - 12 for t. 1 Let b = 63 - 63. Solve b = -s - 2l - 3 + 4, l - 6 = 5s for s. -1 Let u(a) = -5a2 + 8a + 9. Let k(h) = -h*2 + 1. Let c(b) = -4k(b) + u(b). Let j be c(8). Solve -5 = -5q + ji + 35, 4q - 2 = -2i for q. 3 Suppose 4u = 15 + 9. Let s be (-15)/(-6)(-16)/(-10). Let h = u - s. Solve -5z + 4p = 0, -1 = 2z - hp + 1 for z. 4 Let x(d) = d*2 + 4d + 3. Let b be x(-4). Let m be (-4 - -1)/b + 5. Solve -n = 5q, mq + q - 4n = 0 for q. 0 Let s(t) = -t3 - 6t*2 + 6t - 1. Let k be s(-7). Let f(q) = -3 - 4q + 5q + 0q. Let d be f(k). Solve 4w - 4l = 5w - 17, dl - 12 = 0 for w. 1 Suppose 0 = -3b + 10 - 4. Solve 0p - 4a + 45 = 5p, 4p = -ba + 30 for p. 5 Let t(q) = 2q + 4. Let n be t(4). Let r = 14 - n. Solve 0w - 2z = 4w - 6, -w - rz = 6 for w. 4 Suppose 0 = 5w + 3 - 18. Solve -wh = -h - 5m + 5, -1 = m for h. -5 Suppose -5j = s + 23, 5j + 7 = -4s + 2j. Suppose 3 = n + sn. Let x be (n + -2)/((-3)/24). Solve -4a - x = -4k, -a = 2a - 5k + 6 for a. -2 Suppose 2z - 3n - 31 = 0, -n - 49 = -3z + 4n. Let q = 10 - 15. Let k = q + z. Solve -2v = kf - 5, 2f - 2v + 9 = f for f. -1 Let q(m) = -m*3 - 7m*2 - 3m - 16. Suppose 26 - 5 = -3j. Let v be q(j). Let o = 11 + -8. Solve 5d = -y + v + 15, -4y + 12 = od for d. 4 Let c be 24/10 - (-10)/(-25). Let f be (-8 - 0)/c + 6. Solve -5w + l = 2l, -4l = fw - 18 for w. -1 Suppose 5s - 15 = 15. Suppose 3j - j - s = 0. Suppose 27 = jh + 3c, -22 = -3h + c - 3c. Solve -ht + 2g - 8 = 0, -g + 13 + 0 = -5t for t. -3 Let q = -1 - -11. Solve -5w + 5k = q, 3w + 2k - 1 = 8 for w. 1 Let i be (0 + -1)(10 + 1). Let y = 5 + i. Let x be (2 + 0)/((-4)/y). Solve -r - l + 3l - 2 = 0, 4r - 14 = -xl for r. 2 Suppose 0 = -2k - 0 + 8. Solve 1 = a - 2, -a = -j - k for j. -1 Let o = 65 + -64. Solve 0 = -2z - a - 4, 0 = 5z + 3a + o + 11 for z. 0 Suppose -2r - 5q = -29, -2q = 2 - 12. Solve 31 = 2z + 3z + 3c, 0 = -rz - c + 12 for z. 5 Suppose 20 = 4y - 4m, 0m = -y - m - 3. Solve 3i - 3l - 6 = 0, -i - 5l - y = 3i for i. 1 Let z(p) = p2 - 3p - 7. Suppose 0 = s + 1 - 4. Suppose -sm + 25 = 2m. Let g be z(m). Solve -gk = 5t - 17, -4t - k = -t - 11 for t. 4 Let o(n) = -n3 + 4n*2 + 4n + 9. Let z be o(5). Solve -2s - 3 = -4p - 23, -4s + zp + 28 = 0 for s. 4 Let r be (2/4)/((-3)/(-6)). Let a be (-1)/(-1) + 2r. Suppose 25 = 5h + 3i + 2i, h - 4i = -5. Solve -4z - ht = -22, -3z + 3t + a = -3 for z. 4 Suppose i + 29 - 9 = 5x, 3x + 4i - 12 = 0. Let d be -23/(-6)x. Solve -y + d = j, y - 6j = -j + 10 for y. 5 Suppose 0 = -5i + 30 - 5. Suppose ia + 3o = -2o + 10, -o - 6 = -3a. Solve h - an = -5, 0h = -2h - n + 10 for h. 3 Let x(n) = n - 5. Let u be x(-6). Let w be (-230)/(-14) - (-12)/21. Let k = u + w. Solve -4c + 5t + 6 = -k, 0 = -c - 2t - 10 for c. -2 Let b be (8 + -11 + 6)/(0 + 1). Solve 0a + a = bt - 11, 5a = -t + 9 for a. 1 Suppose 4y + 2 = 3y - 2s, y + 5s + 5 = 0. Solve y = -3n - 4l - l, 4n + 5l - 5 = 0 for n. 5 Let s = 62 - 60. Solve 0l = -l - q + s, -3q = -5l - 6 for l. 0 Suppose 2 = -4n + 6n. Solve 8i - 4i - f = -n, 2f = -6 for i. -1 Let o be (-38)/(-8) - (-8)/32. Suppose 0 = q - o. Suppose 5z + qb - 1 = 14, 5b + 9 = z. Solve 7 = 2d - w + 3, -d = -zw - 2 for d. 2 Let s(q) = -2q3 - 2q*2 - q. Let y be s(-1). Let w be y/((-3)/(-32)). Solve 0 = 4a + 3g, -wa + 6 = -2g + 20 for a. -3 Let u(g) = 12g2 - g + 1. Let w be 4 - 1 - (6 + -4). Let h be u(w). Solve 4v - h = -a, 2a = 5v + a - 15 for v. 3 Suppose 6u = 7u - 3. Solve 3y - 5 = -2f - uf, -3f + 3y - 21 = 0 for f. -2 Suppose -4a = -b - 4 - 14, -28 = -4b - 4a. Solve 0 = -bk - k - 3, 0 = 3l + 4k - 11 for l. 5 Let i(m) = 2m3 - m2 + m - 1. Let n be i(1). Suppose 4s + 3 = 3s. Let j = 3 + s. Solve -10 = 4p - d, 5d + j = 3p - n for p. -3 Let v = 0 + 0. Let b(q) = q2 + 3q - 5. Let r be b(-5). Suppose 3l - 3x = 27, 3x + 33 = rl + x. Solve -8a + 4a = 5f - 36, -la + 20 = v for f. 4 Suppose 4z = -z + 10. Suppose zn - 4n + 50 = 0. Solve -n = -5g + 5b, -3g - 5b - 5 = 2g for g. 2 Suppose p - 4p + 26 = l, -5l = 4p - 20. Suppose -4n + 3 = -1. Solve n = v + a + 3, -p = -4v + 5a for v. 0 Suppose 0 = -5r - 4v + 10, 2r + 5v = -0 - 13. Suppose -3s - 5 + 35 = 0. Suppose -s = -rd + d. Solve k + 4u = -34 + 10, 0 = dk - u + 3 for k. -4 Let f(m) = -3m + 14. Let n be f(4). Solve 2x - 1 = o - 0x, -4 = -no + x for o. 3 Let b(d) = d*3 + 5d*2 - 6d - 4. Let s be b(-6). Let p be s/(-10) + (-76)/(-10). Let j be -8(-2 + 6/4). Solve 0 = -2x, 2x + x + p = jn for n. 2 Suppose -6 = 2n + 4c, 5n - n + 3c = 8. Let f = n + 7. Suppose 3u - f = -u. Solve 12 + u = -5z + 3i, -z = -2i + 10 for z. 0 Let z(f) = f*2 + 4f + 1. Let v be z(-5). Suppose -n = n - v. Solve -3y - 2m + 5m - 18 = 0, 3m = -ny for y. -3 Let i(d) be the second derivative of d5 - d4/12 + 2d. Let s be i(1). Let z be 1/((-3)/2 + 2). Solve 11 = -zx - 5l, -3l = -x - 4x + s for x. 2 Suppose 5v = 3o + 69 - 14, 0 = -v + 3o + 23. Suppose 8 = -i + 3i. Solve -2l + v = 5k, 2k + 3k + il - 16 = 0 for k. 0 Let s(j) = 3j*2 - j + 4. Let i be s(0). Solve 0 = 5x - 2w, -3x + iw = 4 - 18 for x. -2 Let m be (-3 - 0) + 0 + 4 + 3. Let d be 7/(-21)9-1. Solve x = -mk - dx - 32, 2k + 11 = -x for k. -3 Let h(l) = -l*3 + 2l*2 + l + 3. Let d be h(4). Let x = d - 11. Let s be 1/(-5) + x/(-5). Solve 2g - 3b = 14, -2b + 15 = -5g - sb for g. 1 Suppose 5c = 3c - 8. Let n = c - -8. Solve -2r - 10 = -5r - 4s, r = -2s + n for r. 2 Let t(w) = -8w - 6. Let z(c) = c. Let h(x) = t(x) + 5z(x). Let r be h(-5). Solve 6l - 15 = l + i, 3l - r = -2i for l. 3 Suppose 9 = o + 2o. Suppose 4r - or = 0. Suppose -5j = -15, 2s + 5j + 0j - 65 = r. Solve 0a + a + 5 = 4w, -s = 5a - 5w for a. -5 Let f be 736/63. Solve -4v + v - 21 = -fz, -4v = -3z + 29 for v. -5 Let y be ((-4)/6)/(16/72). Let v be (0/(-3))/(3/y). Solve -4c + 2 = -2h, 0 = -3c - h + 14 - v for c. 3 Suppose -5 = 4o - 13. Suppose -58 = -3f + o. Solve 5i + 16 = 3s, -5s = 4i - 3i + f for i. -5 Let b(x) = x*2 + 5x - 6. Let l be b(-6). Suppose r - 2r + 4 = l. Let n be ((-4)/6)/(r/(-18)). Solve 4o = -20, -2m - 4o + n = 17 for m. 3 Let c = 15 - 10. Let k = -3 + c. Suppose 3y - 6y - o + 11 = 0, -3y + 5o = 1. Solve l = yv + 16, -3l = -6l + kv + 20 for l. 4 Suppose 0 = -4h - 71 + 7. Let k = 19 + h. Solve -u = -kc - 4u + 3, 0 = -3c + 5u - 29 for c. -3 Let s = -5 - -2. Let k = 3 + s. Solve -2p - 9 = -p + 2u, k = 5u + 15 for p. -3 Suppose -3w + 6 = t - 3t, 3t = -4w + 8. Let v = -3 - -3. Suppose v = 3h + h - 8. Solve 4g - hg = 3m - 4, t = -5m - 5g + 40 for m. 4 Suppose -29v = -26v - 6. Solve 3 = h + 2h, vp = 4h - 2 for p. 1 Let w(u) = -u3 + 6u*2 - 4u - 1. Let l be w(5). Let s be 13 + (2 - 1 - -2). Solve -14 = -3m - 5h, 3h - s = -l for m. -2 Let u = 16 - -17. Suppose -2p + 3x = -0p - u, -5p + 2x + 66 = 0. Let w = -7 + p. Solve -wk = 3a - 5 - 0, 5a + 29 = k for k. 4 Let s = 8 - 4. Solve -3r - 17 = -2m, sr + 4m = -r + 1 for r. -3 Suppose 57 = -5z - 13. Let s be (-14)/(-4) + (-21)/z. Suppose 62 = sf - 2r + 18, 5f + 2r - 36 = 0. Solve 6 = -4i + 5v - 10, 2i - v + f = 0 for i. -4 Suppose -r - 2i = -4i + 1, 0 = 3i - 15. Suppose -2c - 8 = 0, 20 = n + n - 3c. Solve -3b - ng + rg - 10 = 0, 2g - 18 = 4b for b. -5 Suppose 23 + 17 = 5n. Let v(q) = -q*3 + 9q*2 - 8q + 5. Let p be v(n). Solve 3y + y = -2r + 8, 12 = 3r + py for r. 4 Let b = -1 - -3. Let r(v) = v*2 - 8v + 3. Let z be ((-24)/20)/(6/(-40)).	{ "pile_set_name": "DM Mathematics" }
= 4u. Is 5 a factor of u? True Suppose 0 = -0y + 4y - 132. Let d be 6/(-33) + 105/y. Let r(u) = -u3 + 3u*2 + 2u. Is 3 a factor of r(d)? True Suppose -2h - 3b = -7h - 9, 2h + 5b - 15 = 0. Let r be 1 + h + (-3 - -10). Suppose -24 - r = -4k. Is 7 a factor of k? False Let i = 26 + 58. Is 14 a factor of i? True Let a = -2 - -20. Suppose -x - a = -0x - 4g, 31 = 3x + 5g. Suppose -xn = n + 15, 4t = -2n + 150. Is t a multiple of 20? True Let t(a) = a3 - 6a*2 + 5a + 2. Let x be t(4). Is 15 a factor of x(-1)/(-2)-3? True Let b be (-3)/(2 + (-61)/29). Let m = b - 20. Does 3 divide m? True Let j be 4 - (-4 + 0 + 2). Let u be (0 - 2)/((-1)/j). Is 123/u + (-1)/4 a multiple of 10? True Let l be 84/(-35) - 2/(-5). Is 3 a factor of (l - 15/(-6))10? False Suppose x - 3x = -98. Let l = 95 - x. Does 23 divide l? True Let g(p) = -5p2 - 33p - 18. Let v(r) = -2r2 - 11r - 6. Let z(k) = -3g(k) + 8v(k). Let m = 21 + -12. Is 12 a factor of z(m)? True Does 15 divide 4 - 6 - (-1 - -2 - 18)? True Is 11 a factor of 52/4 - 2 - -1? False Let m(h) = 0 + 0h - 1 - 2h - 3. Let c be m(-3). Suppose cf = 6f - 136. Does 14 divide f? False Let d = 3 + -3. Suppose 3z = -dl + 4l - 15, -2z = 3l + 10. Suppose l = -2o - v + 13, -2o + v = o - 27. Does 8 divide o? True Suppose v - 4w = 5v - 40, 2w + 22 = 4v. Is 6 a factor of v? False Let u be 6/15 - (-13)/5. Suppose 4o - u = 129. Is 12 a factor of o? False Suppose 3s - 18 = -3r, 0 = -9r + 4r + s + 12. Let q(o) = -o*r + 2 + 0o*2 - 5o*2 - 6o - 4o2 - 3o. Does 10 divide q(-8)? True Let t(x) = 3x2 - x - x2 - 3 + 4 + 0. Let n be t(1). Suppose 2q + 3j = 43, -nq + 0j + 42 = 2j. Does 10 divide q? True Let w be 0/6 - 26/(-2). Let p = -7 + w. Let r(d) = -d*2 + 11d - 4. Is 13 a factor of r(p)? True Let t be (-1)/4 + 738/8. Is 5 a factor of (t/(-8))/((-2)/4)? False Let b(g) = g*3 - 11g*2 + 10g + 2. Let y be b(10). Suppose -2z + c - 72 = 0, yc + 22 = 3z + 130. Is 5 a factor of z/1015/(-6)? False Let i(n) = n - 5. Let r be i(7). Suppose ru = 7u - 110. Does 11 divide u? True Suppose 0 = 5r + 4t + 41 - 245, -2r + 2t = -78. Is 4 a factor of r? True Suppose -2c + r = -13, 5c - 29 = r - 1. Suppose -100 = t - ct. Is 5 a factor of t? True Let g(j) = -j3 - 8j*2 - 3j + 3. Let h = -12 - -4. Does 9 divide g(h)? True Let a(p) = p*3 + 7p*2 - 8p - 1. Let y be a(-8). Let l(r) = -36r + 2. Is 8 a factor of l(y)? False Suppose f + f = 36. Suppose 5h - 137 = f. Is h a multiple of 9? False Does 13 divide (-12)/18 - 80/(-3)? True Let s be -221/(-2) - 2. Let i = s - -20. Is i a multiple of 14? False Let f = -4 - -168. Is f a multiple of 24? False Let u be 0 + 0 - 9/(-3). Suppose -4m = -c - 2, 2m = -4c - u + 13. Suppose -3w - v + 120 = 0, -3w - 4 = cv - 121. Is w a multiple of 15? False Let h be 424/(-6) + 4/6. Let z be (-9)/12 - h/8. Suppose -x = -4 - z. Does 6 divide x? True Let q(v) = 2 - 2v*3 + 0v2 + v + v2 - 2v. Suppose 0 = s + 4x - 2, x - 1 = -0x. Is q(s) a multiple of 12? True Let s = -2 + 25. Let b(i) = -14i. Let w be b(-1). Let p = s - w. Is 5 a factor of p? False Let l = 90 - 42. Is l a multiple of 14? False Let a(m) = m + 12. Let s be a(0). Suppose s = 4p + 4. Does 19 divide p/1 - (-17)/1? True Suppose -2t + 83 = -101. Does 23 divide t? True Suppose 3f + 24 = n + 4n, 2f - 9 = -5n. Let m(v) = v - 1. Let s be m(6). Suppose -3g + 15 = 0, -sg - 15 = -nk - 2g. Does 10 divide k? True Let x(u) = -4u2 - u + 1. Let k(n) = -3n*2 + 2. Let z(r) = -3k(r) + 2x(r). Is 13 a factor of z(6)? False Suppose -5t - 820 = 85. Let z = -100 - t. Is 27 a factor of z? True Let o(s) = 12s2 - 2s + 3. Let i(r) = -r - 4. Let a be i(-6). Does 13 divide o(a)? False Let h = 11 - 6. Suppose 49 = 4x - m, 2x + 3m + 30 = 5x. Suppose 3p = h + x. Is 3 a factor of p? True Suppose 7a + 350 = 12a. Is a a multiple of 14? True Suppose -55 = 4s + y, -3s + 5y - 24 = -0s. Let n = s + 22. Is 7 a factor of (21/4)/(n/24)? True Suppose 2r + 5v - 301 = 0, -4r - 4v + 572 = -0v. Is r a multiple of 47? False Let c = 356 + -235. Suppose 0 = g - 4g - 4f + 68, -c = -5g + f. Does 12 divide g? True Let v(n) = 14n - 39. Is v(9) a multiple of 7? False Let z(y) = -y*2 - 8y - 5. Let c be z(-7). Let t be 0 + (0/c)/3. Suppose w + w - 68 = t. Is 12 a factor of w? False Let t(v) = -v*2 + 8v + 2. Does 3 divide t(7)? True Let d(o) = -2o3 - 2o*2 + 3o + 2. Let p be 1/(3/2 + -1). Let a be (-2 + -1)/(3/p). Is d(a) a multiple of 2? True Suppose -5u - 4t = -u, 4t + 15 = u. Suppose 0p = -up. Suppose 0 = z - pz - 14. Is 7 a factor of z? True Suppose 2j - 95 = -5m, -2m - 4 = -5j - 13. Let n = 28 - m. Does 11 divide n? True Suppose -2s - 3w = -42, 5s + 0s - 105 = -w. Let t be (-12)/(2 - 48/s). Suppose 0 = -2a - 0a + t. Is a a multiple of 7? True Is 785/9 - 12/54 a multiple of 10? False Let o(p) = -6p - 4. Let x be o(-3). Suppose 4m - 30 = x. Is 6 a factor of m? False Suppose 22 = 2f + 5p, -4p - 7 = 9. Let o = -11 + f. Is o a multiple of 10? True Let r(z) = 4z - 2z + 1 - 3z*3 + 10z*2 - 12z. Let n(d) = -4d3 + 11d*2 - 10d + 2. Let b(q) = -4n(q) + 5r(q). Is 18 a factor of b(-7)? True Suppose y + 17 = -a, 3a = -y - a - 29. Let i = 3 + y. Let k = -5 - i. Is 5 a factor of k? True Suppose t = -5n + 8, 0t + 10 = -2n + 4t. Is n/(-4) + (-822)/(-24) a multiple of 27? False Let v be -2-23/3. Let i = 17 - v. Is 13 a factor of i? True Let b = -4 + 9. Suppose 18 = -bt + 73. Is t a multiple of 11? True Let g = -38 + 151. Let j = g + 117. Suppose j = -3x + 8x. Is 17 a factor of x? False Let u = 150 - -14. Does 14 divide u? False Suppose -4j - j = -130. Suppose 0 = 3h - 45 + 9. Let l = j - h. Is 7 a factor of l? True Let x = -11 - -7. Is 38/x(-5 + 3) a multiple of 12? False Let k be 1 - (53 + 3 - 1). Let h = -11 - k. Does 16 divide h? False Suppose 5o = 15, 3o + 8 = 5f + 2. Suppose -fj = -p - 3p - 24, 5p = -2j - 7. Does 2 divide (-4)/(-16) - (-19)/j? False Suppose -13 = -3j - 4. Let h(o) = 6o + 1. Does 6 divide h(j)? False Let m(a) = 0a - 2a + 3 - 2 - 3. Let x be m(-2). Suppose 52 = xy - 0y. Is y a multiple of 13? True Suppose 6b - 3b = 153. Is 17 a factor of b? True Let x = 103 - 59. Does 11 divide x? True Let z(g) = 2g3 + 9g*2 - g - 5. Is 3 a factor of z(-4)? True Let t = 153 - -35. Is t a multiple of 47? True Let w = -26 - -63. Does 15 divide w? False Suppose -6n + 3n = 0. Suppose n = -i + 21 + 15. Is i a multiple of 30? False Suppose 5l + 3n = -115 + 361, -n = 5l - 242. Suppose -p = -0p - l. Does 8 divide p? True Suppose -3j = 5l - 258, -2j - 2l + 176 = -0l. Does 13 divide j? True Suppose d + 0 = 6. Let x(c) be the first derivative of 3c2/2 - 4c - 9. Is 6 a factor of x(d)? False Let t(i) = -11i2 - 3 + 3i*3 + 16i*2 - 2i*3. Is 6 a factor of t(-4)? False Suppose 0m = -m + 3. Suppose 0 = -3i + 9 - m. Suppose -x - 3r - i = 0, 4 - 50 = -3x + 4r. Does 7 divide x? False Suppose 5 = 4f - 7. Suppose fx - 98 = -38. Is x a multiple of 7? False Let p = 22 + -40. Is 17 a factor of (p + 1)(0 + -1)? True Let x be 129/93 + -3. Suppose 9n - 5n - x = 0. Is (-6)/(-4) - (-75)/n a multiple of 6? False Let h(x) = -4x2 - 11x - 12. Let l(m) = m*2. Let i(g) = -h(g) - 3l(g). Let t be i(-10). Suppose -tc + 87 = c - 3o, 3 = o. Does 10 divide c? False Let y be -7(23-1)/1. Let c be -109 + (-1 - -4 - 1). Let i = c + y. Does 19 divide i? False Let z(l) = l*3 + 8l*2 + 7l + 6. Let c be z(-7). Suppose -t - 3q + 64 = 0, t - ct + 266 = -3q. Does 14 divide t? False Suppose -l - 36 = -7. Let f = l + 51. Does 22 divide f? True Let n(m) = m2 + 1. Let p be n(1). Suppose y = -py + 42. Is 7 a factor of y? True Suppose -3a - 2m - 813 = -8a, -318 = -2a - m. Does 23 divide a? True Is 6 a factor of ((-36)/(-6))/(2/10)? True Suppose 132 = 2n - 12. Suppose 2s - n = -s. Does 12 divide s? True Let k = 93 - 54. Does 13 divide k? True Let g(f) = 0f3 - f + 13f*2 - 5f*2 - 6f - f*3. Let n be g(7). Suppose ns + 2s = 60. Does 11 divide s? False Is 16 a factor of 1(7 + -4)13? False Let d = 6 - 7. Let o(j) be the third derivative of 17j5/20 + j4/12 + j3/6 + j2. Is 25 a factor of o(d)? True Let	{ "pile_set_name": "DM Mathematics" }
is 661 - 0.04? 660.96 Add together 36938 and 0.2. 36938.2 What is -5 minus 55.053? -60.053 What is 3902 + 2? 3904 What is 45185 + 1? 45186 Work out 4 - -1098. 1102 Calculate -0.09 - -0.039. -0.051 Sum 125 and 0.074. 125.074 What is 1312 take away 3? 1309 What is the difference between -2 and 2118? 2120 -24+970.3 946.3 What is 2 + 5.6645? 7.6645 What is 0.4 plus -1316? -1315.6 Calculate -0.5 - -0.0763. -0.4237 -4418+-0.45 -4418.45 Work out 0.04 + 30674.3. 30674.34 What is 7 less than 0.094425? -6.905575 Work out 8.09 + 2. 10.09 -0.7+19.13 18.43 Sum 1 and 2.3091. 3.3091 What is -7 + -0.1968? -7.1968 What is 5 - 2030.142? -2025.142 Calculate -6.8 + -858.5. -865.3 Calculate 7698 + -2.79. 7695.21 Calculate 2 + -0.08665. 1.91335 What is the difference between -2844 and -0.055? 2843.945 What is the distance between -601498 and 0.1? 601498.1 What is -12057.46 - 2? -12059.46 What is 4320 - -43? 4363 What is 0.0345 less than -0.008? -0.0425 Calculate 126 + -6876. -6750 Add 0.3 and 2204. 2204.3 Add 2 and -739452. -739450 Work out 0.1 + -349277. -349276.9 What is 580 plus 0? 580 What is 96.8 plus -15? 81.8 Put together 5 and -0.808218. 4.191782 What is -1 plus 1620? 1619 -0.1 + -0.09837 -0.19837 What is -7.24513 less than -3? 4.24513 What is -2156761 - -0.4? -2156760.6 Add together 6.95 and -1.74. 5.21 Subtract -0.1 from -1412. -1411.9 Put together 28 and -9008. -8980 What is -0.20887 plus -209? -209.20887 Total of 7243 and -3. 7240 Work out 5 + 1976. 1981 What is -54 less than -0.042? 53.958 Add -368 and -12. -380 What is -11604.4 - -2? -11602.4 3.2 + -0.06 3.14 Add 23776 and 89. 23865 Calculate -15.29 - -0.1. -15.19 Subtract 0.8 from 13459.46. 13458.66 -0.1 - 156 -156.1 Calculate -2049 + -0.06. -2049.06 What is -3.58 less than 0.03? 3.61 What is -25542 less than 0.58? 25542.58 Add together -35.7 and -105.6. -141.3 What is the distance between 1 and 6868? 6867 What is -6.29008 - 0.2? -6.49008 What is 0.0275 take away 1.8? -1.7725 Work out -0.0419376 - -4. 3.9580624 What is the difference between -0.13103 and 11? 11.13103 Put together -113099 and 7. -113092 What is -20175 - 39.6? -20214.6 Total of 0.5 and -4.7459. -4.2459 Add together -70 and 722. 652 What is -0.1 less than -52571? -52570.9 Subtract 1699 from 0.5. -1698.5 Add -21.55 and 0. -21.55 Total of 0.4 and -5.288. -4.888 Put together 0.2 and -8649. -8648.8 Calculate 20.1 + -20.429. -0.329 Calculate 12350460 - -0.1. 12350460.1 What is -0.0369 less than -77? -76.9631 What is the difference between -97.39 and -4? 93.39 Add together -0.2 and -4.759. -4.959 What is -0.5 less than 446? 446.5 -29.81 + -5 -34.81 What is 0.1 minus 90.3668? -90.2668 -0.64 - 0.022 -0.662 What is -5709 plus 37? -5672 Subtract -12202 from -7. 12195 Calculate -43669 - -65. -43604 Calculate -18 - -0.684273. -17.315727 What is -49 less than -2144? -2095 What is -10 less than 0.6948? 10.6948 What is 1727 minus 0.061? 1726.939 What is -0.3 - 0.5952? -0.8952 What is -389.68 take away 0.5? -390.18 What is -4 + -1.3466? -5.3466 What is -0.066063 + 0? -0.066063 Put together -4 and 509. 505 What is the difference between -0.3 and -0.269? 0.031 What is 4346 take away -0.05? 4346.05 7.4 - 45034 -45026.6 Total of -76 and 21. -55 What is 13 take away 0.002? 12.998 Work out 0.069 - -0.00008. 0.06908 Calculate 75 + -120. -45 What is 5 take away -30.7? 35.7 What is 0.2 - 121336? -121335.8 What is 0.3 plus 160.7? 161 What is -181433 - -0.5? -181432.5 What is the difference between 48.0421 and 0.3? 47.7421 Subtract -0.08099 from -0.75. -0.66901 Total of 15 and 0.8. 15.8 Put together 0.1508249 and 1. 1.1508249 What is -1 + 1875? 1874 8355+486 8841 What is 0 take away -331? 331 Add together -0.4 and 0.0121. -0.3879 Total of 20649 and -0.199. 20648.801 Add -0.3 and -25250. -25250.3 Sum 0.16 and -816.6. -816.44 120 - 2 118 Sum -15 and 192.95. 177.95 What is -0.043 less than -311? -310.957 Sum -383.6 and -5. -388.6 Subtract -4 from -51.549. -47.549 Total of -0.023524 and 0.08. 0.056476 Sum 2 and 0.292. 2.292 What is -0.2 take away 600658? -600658.2 Total of 7 and 5662.4. 5669.4 Total of 0.24 and -10.225. -9.985 What is -9732 - -2? -9730 What is the distance between 0.2 and 1167.97? 1167.77 What is 32 less than -16? -48 What is 392 plus 2.5? 394.5 Calculate -481584 + 0.1. -481583.9 What is the difference between 5 and -4843? 4848 Sum -412 and 246. -166 What is -12262 take away 23? -12285 What is -101 take away 0.16? -101.16 Put together -0.1127 and 1736. 1735.8873 2 + 3 5 Work out 28 + -0.93. 27.07 What is 131034 plus 0.5? 131034.5 Put together 0.07 and 0.263. 0.333 -0.2145 + 5 4.7855 Subtract -2.69 from -0.01478. 2.67522 Calculate -31 - 3. -34 What is the distance between -517 and -0.03? 516.97 What is -0.1 less than 1.486? 1.586 0 - -14592 14592 What is -4.773 - 3.7? -8.473 Calculate 0.14 - -14.92. 15.06 Work out -8 + -47.72. -55.72 What is the difference between 130359 and -27? 130386 -6.005+0.4 -5.605 Sum 1441085 and 0.7. 1441085.7 Calculate -21834 + 5. -21829 Work out -0.5 - 837. -837.5 What is -252.2 minus -0.02? -252.18 What is the distance between -5 and -2786? 2781 Put together 11 and -21996. -21985 Put together 0.3 and -887. -886.7 Put together 12.7 and -25.9. -13.2 Sum -0.4 and -30. -30.4 2 + -0.03861 1.96139 What is the difference between 13.99 and -0.4? 14.39 What is the distance between -0.1 and 106? 106.1 Subtract 165525 from 0.01. -165524.99 What is the distance between 41063.2 and 0.3? 41062.9 -17.9 + -9 -26.9 What is 25.898 take away 2? 23.898 What is 0.144 - -0.4? 0.544 -13083 - 0.2 -13083.2 Subtract 0.066 from -1.7. -1.766 Add -3 and 31.3. 28.3 What is 0.5 - -7.28? 7.78 What is 0.05037 plus 1? 1.05037 What is the distance between 0.4 and -172.9? 173.3 What is -5 less than -8911? -8906 What is -1165 take away -69? -1096 What is 45 - 80? -35 What is -3.805 + 0.014? -3.791 Calculate 164 - 0.12194. 163.87806 What is 6 take away -817218? 817224 What is 62505 + -0.06? 62504.94 Sum 42644 and 0.1. 42644.1 What is -0.209 - 0.10311? -0.31211 Work out -2053 + -0.171. -2053.171 Calculate 3 + 25.683. 28.683 Put together -37.86 and 0.0311. -37.8289 Sum 13.2 and -2992. -2978.8 7.7 - 0.9961 6.7039 Put together -702.1 and -16.3. -718.4 What is -3.683 minus -0.151? -3.532 -11285 + 9 -11276 Work out 2 - 437.7. -435.7 What is -0.2 less than -15543? -15542.8 Total of 0.895 and -0.55. 0.345 Work out -1742 - 0.5. -1742.5 Put together -30.007 and 5. -25.007 What is 0.124 - 0.01? 0.114 What is 0.4 minus 175? -174.6 10 - -105795 105805 Add together -1010 and 28.47. -981.53 Subtract 11.79 from 0.2. -11.59 Work out 25.80168 - -3. 28.80168 -31+24.03 -6.97 0.15 + 20 20.15 Work out 10254 + -3. 10251 Add 86 and -0.457. 85.543 What is -1 take away 60876.8? -60877.8 0.7+-372622 -372621.3 Calculate 0.1 + 211.4. 211.5 What is -86197 - -0.116? -86196.884 0.1 + -27.62 -27.52 Work out -272 + -1.5. -273.5 What is -0.5 minus 119414? -119414.5 What is 0.04 minus -5.281? 5.321 Subtract -0.092 from -0.1. -0.008 Add together -9150 and -0.4. -9150.4 Work out 0.76 + 0.189. 0.949 Total of 5 and -1170925. -1170920 What is the distance between -0.4 and 1370? 1370.4 Calculate 200 - 77. 123 What is -0.88 + -2817? -2817.88 What is -0.042 take away -56? 55.958 -0.05 - 8323 -8323.05 Work out -0.1 + 0.060588. -0.039412 Add together 53.3 and 0.2. 53.5 What is 57 less than 1296? 1239 Subtract 6553 from -3. -6556 Sum 314.402 and -1. 313.402 Add together 624349 and 0.4. 624349.4 Add together 35 and 10744. 10779 Put together -1035 and -3463. -4498 Total of -0.637 and 2. 1.363 What is 0.159 plus -298? -297.841 Put together 3 and 193727. 193730 -0.0438+3 2.9562 Calculate 736 - 1.3. 734.7 Calculate -1 + -3272.4. -3273.4 What is -77998 plus -5? -78003 What is 0.51 plus 0.75? 1.26 What is -3516 + 0.0362? -3515.9638 Work out 23 + -7.6. 15.4 Work out -13.3 + 27. 13.7 What is 1246 minus 0.6? 1245.4 Calculate -166 - 1.2. -167.2 Subtract -46531 from 382. 46913 What is 27248 plus 5? 27253 What is -11372 minus 0.3? -11372.3 What is the difference between -5 and 2977116? 2977121 Add -0.039 and 264. 263.961 Calculate 182 + 0.29. 182.29 Work out 104 + -176. -72 What is -0.36544 take away 0.4? -0.76544 What is -7158763 minus -5? -7158758 What is 0.3979 less than -0.031? -0.4289 Calculate 6.3 + 0.04. 6.	{ "pile_set_name": "DM Mathematics" }
z + 237 = 0. Is z prime? True Let y(k) = 300k2 + 5k - 4. Is y(1) a prime number? False Let m = -9 - -12. Suppose -178 = -mj - 40. Is j a prime number? False Let i be 1((0 - 0) + -4). Let q be 2198/4108/(-63). Is q/(-30) + i/10 prime? True Suppose -u + 2u - 5 = 0. Suppose 4g - 646 = 394. Suppose uw - g = w. Is w prime? False Let k = -63 + 126. Let u = k + -24. Is u composite? True Is ((30/9)/(-5))/((-12)/15354) prime? True Let b(t) = -t*2 - 11t - 8. Let n be b(-10). Suppose nv + 0v - 106 = 0. Is v composite? False Suppose -6w + 27 = -5d - 3w, 2w - 28 = 5d. Let x be ((-75)/6)/((-3)/d). Let q = 0 - x. Is q a prime number? False Is (-3)/3 + (-1638)/(-3) composite? True Let x(h) = -38h + 1. Is x(-3) prime? False Let y(u) = -u. Let s be y(-6). Suppose -x + s = x. Suppose j + 2g = -0g + 43, 5j - xg = 280. Is j a composite number? False Let a = 8 + -8. Suppose -h = -5j + 178 + 147, 2j - 4h - 130 = a. Is j composite? True Let l = -16 + 7. Let p(a) = a - 1. Let c(h) = -19h - 8. Let r(u) = c(u) + 5p(u). Is r(l) composite? False Is (0 + 2-1)/((-44)/14806) a prime number? True Let k be (-1 - 0)/(2/(-4)). Let v be -2 + 3 + k/(-2). Suppose vr + 159 = 3r. Is r composite? False Let r(s) be the first derivative of -s*3/3 + 9s*2/2 + 5s - 2. Is r(5) a composite number? True Let d = 5 - 13. Let s(v) = 4v2 + 7v - 6. Let o be s(d). Let z = -115 + o. Is z prime? True Let x be 6/(-9)3/1. Let m = 6 + x. Suppose -59 = 2f - mf - w, 4f = 4w + 136. Is f composite? False Let v(r) = 6r*2 - 10r - 10. Let m(a) = -5a2 + 9a + 9. Let i(d) = -4m(d) - 3v(d). Suppose -5t = -3t - 10. Is i(t) a composite number? True Let b = -17 + 129. Suppose b = 2m - 6. Is m composite? False Suppose -1 + 5 = 4j. Is (-70)/(-8) + j/4 a composite number? True Suppose 0i + 2 = -2i. Let c(n) = 132n. Let z(d) = -19d. Let j(h) = 3c(h) + 22z(h). Is j(i) composite? True Let h(o) = 10o2 - 17o - 17. Is h(16) a prime number? False Suppose -1 = -2z + 177. Is z a composite number? False Let u = -242 - -360. Let z = -61 + u. Is z a composite number? True Is (3 - (-1)/(-2))82 a prime number? False Let n = -851 - -2890. Is n composite? False Suppose 0 = 2u + 2, 4u + 6 = -2l - 8. Let f(x) = 3x*2 + 4. Is f(l) a prime number? True Let u(b) = 18b*2 - 1. Is u(-3) composite? True Suppose -3t + 5 = -2s - 7, 4t = 3s + 16. Let c be (s/1 - -1) + 2. Suppose -2f = -23 - c. Is f a composite number? False Let b = -4 - -4. Let q be (b + 1)(2 + -1). Let a(i) = 35i*2 - i + 1. Is a(q) composite? True Suppose 3w = -5g + 1046, 2g - 2w - 118 = 310. Is g composite? False Let m = 106 + 143. Suppose -2i + 0i + 5j = -126, 4j = -5i + m. Is i a composite number? False Suppose -3k + 3z = -0k + 216, 2z - 69 = k. Is 5/(k/(-9))10 prime? False Let b be 3/12 + (-169)/4. Let p = b + 93. Is p prime? False Suppose p + 4o - 7 = 0, -5p + 4o + 16 = 5o. Suppose z + 2z + 5f - 8 = 0, -5z + 2f = -p. Is 1-49z-1 a composite number? True Suppose -4 = -3s + 2s. Suppose j + 472 = sn, 0 = -n + 3n + 3j - 250. Is n composite? True Suppose -4a = -7 + 3. Let l be (-273)/(-9) + a/(-3). Suppose -3g - l + 189 = 0. Is g prime? True Is 3364/5 + (-6)/(-30) a prime number? True Let j(s) = s3 + s2 - 7s + 7. Is j(6) a composite number? True Let o = 3533 - 2172. Is o a composite number? False Let h = -290 - 316. Is h/(-5) - 7/35 a prime number? False Let s(u) = -u + 1. Let y(a) = 22a - 7. Let c(l) = 3s(l) + y(l). Let h = -6 + 9. Is c(h) a prime number? True Let a(n) = n*3 - 4n*2 - 4n - 6. Let k be a(5). Let w be -36 + (-2)/4-4. Is 1 + (k - (w + -1)) composite? True Let h(j) = -6 - 7 + 3j - 7j - 2j. Is h(-14) a composite number? False Let x be 0/(16/(-4) - -2). Let v(s) = s*3 - 2s*2 - 2s + 2. Let t be v(3). Suppose xp = tp - 70. Is p a prime number? False Let h be (-1)/(-2) - 1/(-2). Let v(b) = 80b2 - 2b + 1. Is v(h) a composite number? False Let a = 483 - 218. Suppose a = j + 4j. Is j composite? False Let l(v) = -v + 17. Let k be l(11). Let u(r) = 6r*2 - 8r - 5. Is u(k) a prime number? True Let g = -17 - -29. Let w(s) be the second derivative of 11s3/6 + 11s*2/2 + 2s. Is w(g) composite? True Suppose -3l - 3 = -4k + 1, -4k - 2l + 4 = 0. Let f be k/(-3) - 106/(-3). Suppose -3b = -64 - f. Is b prime? False Let c = -3 + -3. Is 2(-3)/c - -114 composite? True Let l be ((2 - -2) + -3)2. Is (4/2)/l + 418 a prime number? True Let y = -38 - -115. Suppose 4w - 4z + 64 = w, -4w - 3z = y. Let t = w + 79. Is t prime? True Let t be (-2)/(-8) - (-6)/8. Let x(p) = -42p*2 - 1. Let n be x(t). Let a = 64 + n. Is a a prime number? False Suppose -2a + 230 = -4k, -4k + 2k - 448 = -4a. Is a a composite number? True Suppose 10u + 748 = 14u. Is u a composite number? True Let p(m) = 6m2 - 179m*3 - 6m*2 - 1 + 2m + 0m2. Let g be p(1). Is g/(-3) + (-4)/12 a composite number? False Suppose -w - 316 = -4c + 3w, 0 = c - 2w - 74. Suppose 0p - c = -3p. Let d = -9 + p. Is d prime? True Let s(j) = -110j3 + 2j + 1. Let g be s(-1). Suppose -m + 52 = -g. Is m prime? False Is (83/(-3))/((-12)/180) prime? False Let v = 570 + -277. Is v composite? False Suppose -3f - 513 + 3144 = 0. Is f composite? False Let d = 646 + -311. Is d a composite number? True Suppose 4b + 3x = -154, -b = -3x + 4x + 38. Let z = b + 74. Is z composite? True Let u(w) = -8w - 1. Is u(-4) a prime number? True Let u(g) = -g*3 + 3g*2 + g - 2. Let o be u(3). Suppose -o + 8 = h. Is h composite? False Suppose 51 = -3n - 2n + 2q, 12 = 4q. Let s = 9 + n. Suppose s = 2k - 4k + 98. Is k a prime number? False Suppose 3n = -0n + 180. Let s = -38 + n. Is s prime? False Suppose -2d = 4 - 2. Is 53/(-2)2/d composite? False Suppose 4v - 23 = -3d, 3d - 28 = -0d - 5v. Let r be (d + 2)(-10)/6. Let n(h) = h3 + 4h*2 - 6h + 2. Is n(r) a prime number? True Let v = -7 - -11. Suppose 4i - 4g - v = 0, 4i + 5g + 11 = -21. Is 49(3/i)/(-1) a composite number? True Suppose -2y = -32 - 56. Let n = y - 23. Is n a composite number? True Let l(k) = k*3 - 5k*2 + 5k - 6. Let u be l(5). Let x = u + 0. Is x composite? False Let d = -2 + 5. Suppose 564 = dm + m. Is m composite? True Suppose 0 = 3y + 4f - 45, -64 = -4y - 0f - 4f. Is y composite? False Suppose 4q + 6 = 490. Suppose 8 = 4p, -4p + q = b - 5p. Is b composite? True Let n be (25/(-4))/(2/(-24)). Is n/(-12)(-2 + -2) composite? True Suppose z = -5p + 9 - 1, -2p - z = -2. Suppose -2f = pf - 812. Is f a composite number? True Suppose 0 = -2m - m + 5r - 3, 4m - 3r - 7 = 0. Suppose 5l = -i + 3i - 32, ml - 25 = -3i. Is i a composite number? False Let o(c) = -c3 - 5c*2 + 3c + 5. Suppose -5t + 0t + 15 = 0. Let l(s) = s*2 - 4s - 3. Let a be l(t). Is o(a) a prime number? True Suppose -20 = -3v + 7v. Let f(t) = 2t2 + 6t + 6. Is f(v) prime? False Let c = -10 + 13. Let y(z) = 12z2 - 4z + 1. Is y(c) a composite number? False Let v = -19 + 27. Let k(c) = -c*3 + 8c*2 + 6c - 11. Let a be k(v). Let q = -26 + a. Is q a prime number? True Is 1/3 - (6240/(-18) + 8) a composite number? True Suppose 0b = 2b - 1006. Is b a prime number? True Let z be 48/(-21) - 4/(-14). Let i be (4/z)/(2/(-9)). Suppose -5v = -6 - i. Is v composite? False Suppose -3v - 48 = -204. Let j = -15 + v. Is j composite? False Let q(u) = u + 17. Let f be q(-13). Suppose -fz + 42 = 2z. Is z a prime number? True Suppose 26 = 6x - 2x + 2f, 0 = 4x + 3f - 31. Suppose -2t - 4i = -x - 6, 3t - 3i - 51 = 0. Is t composite? False Suppose -k + 10 = -3u, -2k + 3u = 3k - 62. Let y(f) = -f3 + 12f*2 + 16f - 16. Is y(k) a prime number? True Let i(b) = 5b3 - b2 - b. Let l be i(-1). Let j(y) = -4 - 4y*3 - 8y - 11y2 + 3y*3 + 5y2. Is j(l) prime? True Let c be 191 + 1 + 0/(-2). Let l(x) = x2 + 6x - 2. Let p be l(-7). Suppose -c = -ps - 17. Is s composite? True Let g be 21/((-6)/9). Let k = g + 3. Suppose y + 2 - 6 = k, d - 2y - 11 = 0. Is d prime? True Let w(h) = h3 - h2 + h - 4. Let r be w(0). Let k be 1/r + (-18)/(-8). Is -1 - 0 - -56k a prime number? False Is (635/(-10))/(-1)2 prime? True Suppose u - 29 = -4s, -s - 2u + 5 = -4u. Let m = -5 + s. Suppose -2t + 4*v	{ "pile_set_name": "DM Mathematics" }
+ 3j - 5. Let q be m(2). Sort -8, 4, q in descending order. q, 4, -8 Suppose -3b + 8b - 30 = 0. Let z be b/(-4)12/45. Let q(n) = -n*2 + 8n - 10. Let i be q(7). Sort z, i, 7 in descending order. 7, z, i Let z = -10826 + 10823. Suppose 5b = 3b. Sort z, b, -1, 2 in descending order. 2, b, -1, z Let r = -2.02 - -0.02. Let t = 3 - -63. Let j = t - 65.9. Sort 3/5, j, r in increasing order. r, j, 3/5 Let o = -9 - 5. Let t = 10527/8 - 1316. Sort 3/7, o, t. o, t, 3/7 Let w = -37.8 - -38. Let m(q) = -q*3 + 15q*2 - 13q - 9. Let x be m(14). Sort -4, x, w in ascending order. -4, w, x Let v = -16 + 14.5. Let b = v - -1. Sort 2/5, -4, b in increasing order. -4, b, 2/5 Let x(w) = 60w - 178. Let p be x(3). Put -5/3, -2/67, -2, p in decreasing order. p, -2/67, -5/3, -2 Let o = -2.6 + 4. Let x = -3.4 + o. Let p be -2(-2)/(-46)-1. Sort x, 1/4, p in descending order. 1/4, p, x Let v be 20/(-6) + 14. Let j = 250 - 247. Sort j, v, -5, 0.1 in decreasing order. j, v, 0.1, -5 Let m = 7 - 9. Let i be (4/3)/(m/6). Let s = 0 - 3. Put -5, i, s in ascending order. -5, i, s Let o be 9 + -15 - 28/(-4). Sort 267, -1, 5, o in descending order. 267, 5, o, -1 Let t be (12/(-30))/(((-7)/100)/(-7)). Put t, -1, -2 in ascending order. t, -2, -1 Let w = -21 - -24.62. Let q = -0.62 + w. Sort -2/5, q, -0.2 in ascending order. -2/5, -0.2, q Let s = 0.1 + -0.6. Let a = -2.2 - s. Let j = 1.3 + a. Put 0.5, -3, j in descending order. 0.5, j, -3 Suppose 26 = 13m - 13. Put 20, -2, -1, m in descending order. 20, m, -1, -2 Let t = 2492 - 12459/5. Put t, 1, -182 in descending order. 1, t, -182 Let u = 764/435 - -56/87. Sort -2/5, u, 3. -2/5, u, 3 Let p = -2.3 - 0.7. Let i = -7 - p. Let f = 422 - 421. Put 1/3, f, i in decreasing order. f, 1/3, i Let c(j) = j2 + 3j - 5. Let b be c(-9). Let i = b + -54. Put -1, 5, i, 2 in decreasing order. 5, 2, -1, i Let m(a) = -4a3 - a2 - 3a - 2. Let g be m(-1). Suppose 0 = -0r + 5r - x + 23, 0 = -gr + 3x - 14. Sort r, -0.04, -0.4 in decreasing order. -0.04, -0.4, r Suppose 3 = 2g + g. Let s = 5 - g. Let x = -53 + 51. Sort -4, x, s in decreasing order. s, x, -4 Let m be (-30)/54 + (-2)/(-6). Let u = 17 - 19. Sort m, 1/2, u in ascending order. u, m, 1/2 Suppose 9b - 13 = 12b - j, 5b + 23 = 2j. Put -2, 0.16, b in ascending order. b, -2, 0.16 Let g be (-3)/(-15)27 + (-15)/3. Let l = -5.3 - -4.8. Put 5, g, 2, l in decreasing order. 5, 2, g, l Let o = 2.6 - -0.4. Sort -3/2, o, -1, 0.2 in decreasing order. o, 0.2, -1, -3/2 Let y be (2/1 - 2)/(4 + -5). Suppose 2v + 2 = 2m + 3v, y = 3m + 2v - 4. Put -1, m, 6 in descending order. 6, m, -1 Suppose 2y + 2s = 4, -4s = -s. Suppose 4x + 4l = -24, yx - 5x + 2l = 8. Suppose 0 = -9c + 4c + 35. Sort x, c, 1 in ascending order. x, 1, c Let r = 1529/7 - 218. Let a = -4.021 + 0.021. Sort -2, a, -0.5, r in descending order. r, -0.5, -2, a Let v be (141/188)/((-6)/16). Sort v, 1, 17, 5 in decreasing order. 17, 5, 1, v Let a be 0 + (11 - -1)/3. Suppose 2 = -4m - 5n + a, -3n = 3m - 3. Suppose -3u + 7 = l, -5l = -3l - u - 7. Put -2/11, m, l in descending order. l, m, -2/11 Suppose 49i + 55 = -141. Put i, -115, -3 in ascending order. -115, i, -3 Let b be (7 - (3 - -3)) + 4. Put b, 9, 0 in decreasing order. 9, b, 0 Let i = 49.1 + -68. Let j = i - -6.9. Put -3, 0.3, j in ascending order. j, -3, 0.3 Let j(b) = b3 - 5b*2 - b + 1. Let w be j(5). Let z be 32/(-4)(-2)/w. Let x = -0.1 + 0.5. Put x, z, -3/2 in descending order. x, -3/2, z Let y be (-15)/6(-48)/(-40) - 2. Let n be 7 - (-1 + 0 - 0). Suppose -m = 5b + n, 2m - 2 = -8. Sort y, 4, b. y, b, 4 Let w = -241.94 + 242. Sort -11, w, -0.3 in descending order. w, -0.3, -11 Let u = -77983/29 + 2689. Sort 0, -4, 0.32, u. -4, u, 0, 0.32 Suppose 0 = -3n - 2n + 20. Suppose -2o = 3o - 75. Let h be (-2)/(-6) - (-40)/o. Sort n, -2, h in descending order. n, h, -2 Let a = -754 - -749. Sort a, 2, 1.9, 2/3. a, 2/3, 1.9, 2 Let y be -37 + 34 + (-1 - -9). Sort y, 0, -20. -20, 0, y Let f(l) = 3l - 4. Let n be f(3). Suppose -1 + 9 = 4y. Suppose yu + u + 3 = 0. Put u, 2, n in ascending order. u, 2, n Let q be 1 - (-1 + 5) - 0. Suppose -5j - 8 = -3. Sort 3, j, q. q, j, 3 Let y(z) = z - 1. Let d be y(7). Suppose -w = 5w. Put d, w, -2 in ascending order. -2, w, d Suppose 0 + 100 = 20h. Put 3, 4, h in descending order. h, 4, 3 Let f(p) = p3 - 10p*2 + 3p - 19. Let d be f(10). Suppose 4c + d = 3. Put 5, c, 3, 1 in descending order. 5, 3, 1, c Let j(v) = v + 17. Let d be j(-5). Let x be d + 3/90. Suppose 0 = -3o - 3i + i + x, 0 = 4o - 5i - 16. Put 0, 2, o in decreasing order. o, 2, 0 Suppose -2q - 4x - 8 = 0, -5q - 4x = -10q + 8. Suppose l + 2c = -5, 0 = 3l - 4c - 22 - 13. Put l, q, -1 in ascending order. -1, q, l Let j = 390 - 398. Put 4, j, 0, -3 in ascending order. j, -3, 0, 4 Let w = -6 + 6.35. Let v = w + -0.05. Sort v, -5, 1. -5, v, 1 Let p(b) = b*3 + 18b*2 - 110b + 23. Let a be p(-23). Sort 3, -3, a. a, -3, 3 Let c(y) = -y*3 - 3y*2 + 3y. Let a be c(-4). Let n(i) = 65i. Let h be n(0). Put h, 3, a, -1 in ascending order. -1, h, 3, a Let v be (-6)/1 - (-21 - -33 - 18). Sort v, 5, 3, -7 in decreasing order. 5, 3, v, -7 Suppose -4f + 19 = 3. Suppose 9a + 20 = fa. Let u(d) = d + 4. Let g be u(0). Sort 3, a, g in decreasing order. g, 3, a Let l = -240.9 - -254. Let g = l - 13.1. Sort g, 1/2, 1. g, 1/2, 1 Let q(x) = 2x - 2. Suppose t + 5 = -0t. Let a = 7 + t. Let p be q(a). Sort p, 1, 0 in decreasing order. p, 1, 0 Let y = 2.1 - 15.1. Let w = y + 10. Let d = 1 - 1.4. Sort w, -1/12, d. w, d, -1/12 Let c(b) = -b + 4. Let k be 4 - 8 - (-42)/2. Let w = k + -10. Let u be c(w). Sort -1, 0, u. u, -1, 0 Suppose j = 6j. Suppose -5k = -j + 20. Let m = 0.0675 + -0.4675. Sort k, -5, m in descending order. m, k, -5 Let b be (4 + 55/(-15))/(2/12). Let w(k) = -k + 2. Let c be w(8). Sort 4, c, b, -2. c, -2, b, 4 Let d = -2.46 - -2.1. Let g = -0.04 + d. Let p = -0.64 - -0.64. Put -0.1, p, g in descending order. p, -0.1, g Suppose -81k + 84k - 6 = 0. Let s be 6 + -21/k. Sort 2, s, -6, -3 in ascending order. -6, -3, 2, s Suppose 16 = 11u - 7u. Suppose -uo + o = 0. Let n = 7 + -10. Sort n, -4, o in descending order. o, n, -4 Let m(d) = -d*2 + 8d - 3. Let k be m(0). Sort 3, -2, k in descending order. 3, -2, k Let k be (32/(-48))/((-2)/(-6)). Put k, 24, 3, -1 in increasing order. k, -1, 3, 24 Let q = -1.284 - -0.984. Put 28, -3/2, q in increasing order. -3/2, q, 28 Let k = -7.17 - -6.9. Let h = k - -3.27. Let j = 0.3 - -0.7. Sort h, -1, j in decreasing order. h, j, -1 Let r = 0.03 + 0.07. Let h = -802/5 - -161. Put r, -1, 7, h in descending order. 7, h, r, -1 Let t = -218.01 + 217. Let i = -1.11 - t. Sort i, 0.1, 6/11 in descending order. 6/11, 0.1, i Let n be 5/(15/(-12)) + 3. Suppose 12r + 130 = 38r. Sort -3, 4, n, r in ascending order. -3, n, 4, r Let l = -24 + 12. Let p be (l/8)/(1/(-2)) + 4. Sort p, -1, 5, -5 in descending order. p, 5, -1, -5 Let c = -4/17 - -96/119. Let z = 0 + 0.1. Let m = z + -0.3. Sort 0.1, c, m. m, 0.1, c Suppose 0 = 6f + 1619 - 1619. Let q(b) = b3 - 5b*2 - 8b - 2. Let o be q(6). Put o, f, 3 in descending order. 3, f, o Let r = -3.2 - -3.6. Sort 5, r, -3. -3, r, 5 Suppose 3o - 2o - 2 = 0. Suppose 2c - 3g - 9 = -0c, 4c + og = -6. Suppose -4d - 7y + 3y + 40 = c, -3y = -15. Put -3, d, -6 in increasing order. -6, -3, d Suppose 0 = 4y - 0 - 12. Let z = 635 - 625. Put z, y, -4 in ascending order. -4, y, z Suppose -9 - 3 = -3p. Let k = 1954/64605 - -4/1095. Sort p, k, 2, -0.1. -0.1, k, 2, p Let y = 0.6 - 0.5. Let i = 356 + -359. Put -0.4, i, y, -0.3 in increasing order. i, -0.4, -0.3, y Let c be (4/2-1)/1. Let f be 8 - (-2 - (-8 - -4)). Let d be (2/f)/((-7)/21). Sort 2, c, d in descending order. 2, d, c Let s(o) = o - 11. Let r(y) = y - 11. Let m(p) = 4r(p) - 3s(p). Let l be m(10). Let n(j) = -j*2 + j + 1. Let a be n(l). Put -3, 4, a in ascending order. -3, a, 4 Suppose 2b = x - 8, -2x - 3x = -4b - 10. Let g(l) = l - 22. Let t be g(10). Let y be t/455/2. Sort y, x, -0.7 in descending order. y, -0.7, x Let n = -9/2707 - -10873/13535. Let p = 2 - 3. Sort n, -0.5, p in increasing order. p, -0.5, n Let n = -7 - -16. Put 6, -5, n in decreasing order. n, 6, -5 Suppose 0*h + 3	{ "pile_set_name": "DM Mathematics" }
d) = -d*2 + 15d - 7. Give u(x). 49 Let y(i) = i*3 - 7i*2 + 13i - 4. Let v(u) = -4u2 + 2u + 1. Let k(x) = 3v(x) + y(x). Calculate k(18). 17 Let h(g) = 21g - 15. Suppose 7 = 23q - 24 + 8. Give h(q). 6 Let o = -1375 + 1387. Let a be (-30)/4(-8)/10. Suppose -o = -as + 6. Let w(c) = 4c + 3. Give w(s). 15 Let k(q) = 4q - 114. Let t be k(30). Let u(v) = v3 - 10v*2 + 8v + 2. Let p(w) = w*3 - 9w*2 + 7w + 2. Let z(l) = -3p(l) + 2u(l). Give z(t). 4 Let d(x) = -15x2 + 3 + 7x + x*2 + 19x*2 - 7x*2 - 2x. Calculate d(-3). -30 Let f(z) be the third derivative of -z*4/8 - 19z*3/2 + 2457z2. Calculate f(8). -81 Let u(v) = -v3 + 8v2 + 33v + 1. Let r(d) = 13d2 - 126d + 173. Let t be r(8). Calculate u(t). 1 Let y(i) = i*3 - 9i*2 + 4i + 3. Suppose -233j = 69j - 43j - 1295. Determine y(j). -77 Let t(u) = 37 - 66 - 55 - u2 + 13u - 32u. Let a be t(-11). Let m(y) = 13y - 4. What is m(a)? 48 Suppose -394 = 23f - 371. Let l(u) = -u. Let y(b) = -3b + 2. Let p(d) = 6l(d) - y(d). Determine p(f). 1 Let r(f) = -f3 - 10f*2 + 20f - 13. Let y be r(-12). Suppose -5o + y = -3v, 4o + 2v - v = 11. Let l(m) = -m*2 + 2m + 2. Determine l(o). -6 Let i = 3630 + -3639. Let y(a) = 2a3 - 7a*2 - 11a + 11. Let o(c) = c*3 - 8c*2 - 11c + 11. Let t(r) = -3o(r) + 2y(r). What is t(i)? -29 Let h be (8 + 0)123/(-492). Let d(n) = 13n*2 + 5n + 6. What is d(h)? 48 Let h(u) = 16u3 + 10u*2 + 12u - 4. Let k(x) = 11x3 + 11x*2 + 11x - 3. Let t(z) = -2h(z) + 3k(z). Calculate t(-12). 35 Let q(x) = -3x2 + 19x + 9. Let j(d) = -4d2 + 28d + 14. Let k(z) = -5j(z) + 7q(z). Let m be (-2)/6((-72)/9 + 23). Determine k(m). 3 Let x be (5 - 8) + (-8 - 7)/(-5). Let p(y) be the first derivative of -y - y2 + xy*3 + 3/2y4 - 2. Determine p(-1). -5 Let s(i) = i3 - 5i2 + 9i + 5. Let p(k) = -6k3 + 34k*2 - 55k - 32. Let q(a) = -2p(a) - 13s(a). Determine q(-4). 43 Let z(r) = 13r2 + 23 - 22r - 11r2 + 5r - 28. Calculate z(9). 4 Let p be ((3/(-4))/1)/(-1 - (-33)/36). Let j(z) = -z*2 + 9z + 17. Determine j(p). 17 Let j(g) = -5g - 57. Let r be j(-12). Let f(s) = 5s*3 - 15s*r - 2s - 8s2 + 10 + 6s*3 + 5s*3. Give f(8). -6 Let w be ((-6)/(-33))/((-1212)/(-132) + -9)0. Let m(p) = -4p - 9. Give m(w). -9 Let p be ((-1100)/(-770))/((-20)/(-84)). Let k(x) be the first derivative of -x4/4 + 5x*3/3 + 5x*2/2 - 3x + 1. What is k(p)? -9 Let v(z) be the first derivative of 15z2/2 - 45z + 392. Give v(2). -15 Let h = 708 - 696. Let q(o) = 9o - 105. What is q(h)? 3 Let i(j) = -j3 + 2j*2 + 2j - 4. Let x = 1801 - 1216. Let g be x/52 - 1/4. Let o = -8 + g. Determine i(o). -7 Let q(s) = s*2 - 6s + 3. Suppose -4n + 316 = 2g, -2g - n + 597 = 2g. Suppose -27y + 14 = -g. Calculate q(y). 3 Let n(l) = -l3 + 55l*2 + 11l + 57. Let m be n(55). Let u(f) = f - 664f2 - mf*2 + 1321f*2 + 1. Calculate u(2). -17 Suppose -2m + x = -7m - 15, x = 3m + 17. Let q be (m - -5)/((-4)/4). Let t(d) = -14d - 1 + 3 - 3. What is t(q)? 13 Let w(u) = -51u + 1427. Let i be w(28). Let o(q) = -19q2 - 3q - 2. What is o(i)? -18 Let y(g) = -3g + 65. Let x be y(26). Let r(k) be the second derivative of k3/6 + 13k*2/2 - 20k - 4. Determine r(x). 0 Let j(q) be the third derivative of -q8/20160 + q7/5040 - q*6/360 + 57q5/20 - q2 + 52. Let h(a) be the third derivative of j(a). What is h(-2)? -8 Let i = -3 + 9. Let j(l) = 100l2 - 8l - 18. Let b(k) = 167k2 - 15k - 34. Let z(c) = -3b(c) + 5j(c). What is z(i)? 6 Suppose 3m = -5o - 67, -388o + 12 = -385o - 4m. Let k(x) be the third derivative of x6/120 + 7x*5/60 - 7x*4/24 + 5x3/6 + x2. Calculate k(o). -3 Suppose -2d = -5d - 2p - 1, -d + 2p + 13 = 0. Let j(u) = -u - u + 3 - 2u2 + 12u*d + 0u - 13u3. Determine j(-3). 18 Let p(n) = n + 30. Let i = 1696 + -1704. What is p(i)? 22 Let v(z) = -421825z*2 - 421855z*2 - 17 + 843717z*2 + 10z + 3z3. Calculate v(-12). 7 Let a = 1 + -1. Suppose -2l + al = 0. Let m(s) = -s2 + 19s + 19. Let k(d) = -d*2 + 16d + 16. Let i(g) = 6k(g) - 5m(g). Calculate i(l). 1 Let p(t) be the first derivative of -t*2 - t + 1. Let h = -233 + 230. Let n(m) = 10m + 6. Let f(r) = hn(r) - 14p(r). What is f(5)? -14 Let h(f) be the third derivative of 0 + 0f5 + 0f*4 - 1/6f*3 + 0f + 29/120f6 + 90f*2. Calculate h(1). 28 Suppose -428 = -174t + 1834. Let o(l) = -9l + 65. Determine o(t). -52 Let a be (12/3)/((-3)/(18/(-24))). Let t(u) = -4 + 8 - 55u*3 - 3 - 2u*2. Calculate t(a). -56 Let g(k) = 5k*3 + 7k*2 - 19. Let j(n) = 14n*3 + 19n*2 - 59. Let b(r) = 11g(r) - 4j(r). Let t = 2 - 2. What is b(t)? 27 Let r(n) = 33n - n*2 - 8n*2 + 0n*2 - 31n + 13 + 8n2. Give r(-5). -22 Let s be ((-7)/(-3))/((-3)/(-9)). Let a(r) be the third derivative of -1/24r*4 + 0r + 0 + 14r2 + 1/2r*3. What is a(s)? -4 Suppose -3h + 24 = 2t, -t - 2h = t - 24. Suppose 0 = -11u + 7u + t. Let l(v) = -1 + 5 - 2 + 3v. Determine l(u). 11 Suppose 62w - 84w = 66. Suppose -6 = -5o + 4q - 3, 0 = o + q - 6. Let x(f) = f2 - f - 2 + 3f + of2 - 3f*2. Calculate x(w). 1 Suppose -32m + 9 = -35m. Suppose 0 = 17k - 13k - 8. Let v(w) = -1 + 2 - 4 + 2wk - w2. What is v(m)? 6 Let c be 18/(-2)(-19 + 8). Let d = c - 106. Let r(j) = 25 - j2 - 3j - 5j - 32. Calculate r(d). 0 Let x(j) = -20j*3 - 4j*2 - 13j - 18. Let l(y) = -3y3 - y2 - 2y - 3. Let a(h) = 6l(h) - x(h). Let d = 1 - 1. Let g = d - -2. Calculate a(g). 10 Let b(y) = 13y + 62. Let h be b(-4). Suppose -6 + 26 = hl. Let o(k) = 10k + 2. Give o(l). 22 Let f(j) = 2j2 - 6j. Let x(c) = 4c2 - 27c + 10. Let l(g) = f(g) + x(g). Calculate l(5). -5 Let p = -528 - -531. Let k(j) = 3 - 10 + 8 + pj + 0. Calculate k(3). 10 Suppose 0r + 15 = -2q - 5r, 0 = -3q - 4r - 12. Suppose 3z - z = q. Let k(h) be the third derivative of -h4/24 - h3/6 - h2 - 1221h. Calculate k(z). -1 Let z(h) = -747h + 7462. Let c be z(10). Let v(p) be the second derivative of p4/12 + 3p*3/2 + 5p*2 + p. Give v(c). 2 Let q(n) = 141n + 270. Let x(m) = 52m + 91. Let s(i) = 3q(i) - 8x(i). Determine s(-13). -9 Let s(c) = -c - 5. Let w be s(0). Let o(a) be the first derivative of -155 - 6a + 1/2a2. What is o(w)? -11 Let q(v) = -47177 + 23602 + 23591 + 14v. Calculate q(-5). -54 Let l(h) = -4 - h*3 + 2 - 19h + 20h - 7h*2. Suppose 15z = -17 - 73. Give l(z). -44 Let t(x) = -11140 + 22236 + x*2 - 11177 - 4x. What is t(14)? 59 Let v(r) = 20r - 396. Suppose -m + i = -24, -3i - 20 + 48 = 2m. What is v(m)? 4 Let o(w) = 9w*2 + 2w - 6. Let b(r) = -54r + 57. Let j be b(1). Calculate o(j). 81 Suppose -4k = -2k + 8. Let j(m) = -11m*3 + 19m*2 + 3m - 17. Let q(s) = -25s3 + 44s*2 + 7s - 39. Let g(r) = -16j(r) + 7q(r). Determine g(k). -5 Let v(z) = -16z. Let j be (-2)/(-1) - (2 + -2 + -2). Suppose f + jf = 735. Suppose fq = 149q - 2. Determine v(q). -16 Suppose 125z - 297 = 122z. Let i = -79 + z. Let r(s) = -16 + 42 + 5s2 - i - s3 + 7s. Calculate r(6). 12 Let h(l) = -l - 1 + 0l - 4. Suppose 0 = 3a + 9, -3w + 0a - 2a + 231 = 0. Let n = w - 73. Determine h(n). -11 Let k(r) be the first derivative of r3/3 + 11r*2/2 - 9r - 188. What is k(-15)? 51 Let t be ((-14)/5 - -2)/((-2)/15). Suppose n = 2g - 6, -3n - 10 - t = -4g. Let u be -14g/2 + 1. Let i(h) = h*2 + 3h - 6. Determine i(u). 12 Suppose -p = 2f + 2, 4p + 2 = 5f + 3p. Let u(t) be the third derivative of 12t - 1/3t*3 + 1/60t*5 - 2t*2 + 1/24t*4 + 0. Determine u(f). -2 Let h(v) = 19v*2 - 31v + 3. Let j(s) = 29s2 - 47s + 4. Let o(u) = 8h(u) - 5j(u). Let z be o(2). Let i(t) = t*2 - 7t + 7. Calculate i(z). 1 Suppose 4x = -6l + l - 2, x - 8 = 3l. Let r(d) = 12d + 10d - 9 - 14d - dx. Determine r(7). -2 Let s = -7 + 3. Let t be 1/5 - s/5. Let h(g) be the first derivative of -g3/3 + g*2/2 + 832. Give h(t). 0 Suppose 171f - 235 = 166f. Suppose -8r + f + 25 = 0. Let p(q) = -q*3 - 5q + r - 4 - 7q2 - 2 - 2. What is p(-6)? -5 Let t(r) = r2 - 4r - 1. Let q(d) = -d*3 - 21d*2 - d - 16. Let v be q(-21). Let l(h) = -10 - vh - 3 - 2h - 2h. Let x be l(-2). Calculate t	{ "pile_set_name": "DM Mathematics" }
z3 + 4z Let n(m) = m*2 - 12m - 6. Suppose -p + 18 = 2u - 6, -48 = -4u + p. Let x be n(u). Let a(v) = -v. Let q(j) = 7j + 1. Determine xa(i) - q(i). -i - 1 Let d(i) be the first derivative of -i4/4 - i2/2 - 3i + 1. Let y(c) = 1920c - 3 + 4 - 964c - 957c. What is d(m) + 2y(m)? -m3 - 3m - 1 Let u(x) be the first derivative of -7x2/2 - 261. Let r(z) = 168z. Give -2r(g) - 49u(g). 7g Let n(c) = 117c*2 - 10c - 2. Let k(v) = 2807v2 - 245v - 49. Give -6k(s) + 147n(s). 357s2 Let z(l) = 2l*3 - 2l*2 - 2l + 2. Suppose 134k + 230 = 88k. Let f(g) = -3g3 + 5g*2 + 5g - 5. Give kz(x) - 2f(x). -4x3 Let v(x) = 11x + 7. Let f(s) = 2s + 1. Let d(y) = 10f(y) - 2v(y). Let b(c) = -2c - 3. Let l = -6 - -12. Determine ld(n) - 7b(n). 2n - 3 Let c(o) = -3o - 2o2 + 2o + o2 - 1. Let u(z) be the second derivative of z4/4 + 2z2 + 6z. Let n = 294 + -296. Give nc(h) - u(h). -h2 + 2h - 2 Let g(c) = -3c2 - 38c + 2. Let a(r) = -2r2 - 39r + 2. Calculate 4a(j) - 3g(j). j*2 - 42j + 2 Let z(v) = 4v3 - v2 + 5v. Let i(w) = 5w3 - w2 + 6w. Suppose 26 = p - 4u, -2 = -3u - 17. What is pz(c) - 5i(c)? -c3 - c2 Let n(u) = u + 4. Let h(f) = -f + 1. What is -5h(g) - n(g)? 4g - 9 Let s(z) = -4z + 2. Let n(f) = -f - 3. Let q be n(-8). Let w(l) = -18l + 35l + 2 - 20l. Give qs(x) - 6w(x). -2x - 2 Let o(q) = 2 - 3q + 154q2 - 465q*2 + 155q*2 + 157q2. Let j(u) = u2 - 4u + 3. What is 4j(m) - 5o(m)? -m2 - m + 2 Let o(g) = 5g + 10g - 3 - 2g*2 - 18g. Let d(a) = -22a2 - 34a - 34. Determine -6d(w) + 68o(w). -4w2 Let j(r) = 7r + 2. Let n(f) = 20f + 5. Let x be 88/(-16) - -21. What is xj(q) - 6n(q)? -q + 4 Suppose 6q - 8q = -4. Let a be (11/q)/(-11)2/(-1). Let w(f) = -f + 1. Let j(i) = 0 - 1 + 7i - 6. Calculate aj(m) + 6w(m). m - 1 Suppose -2h = -3r + 13, 2 = r + 5h - 8h. Let s(n) = -9n - 7. Let f(w) = -4w - 4. Calculate rf(m) - 2s(m). -2m - 6 Let r(t) = t2 + 2t. Let y(x) = -12x2 - 18x. Let f(n) = -9r(n) - y(n). Let z(d) = d2. Calculate -f(m) + 6z(m). 3m2 Let d(n) = n3 + n2 - 2n. Let q(p) = p. Let a(s) = d(s) + 2q(s). Let u(z) = -6z*3 - 5z*2. Suppose -1 = 11b - 12b. Calculate bu(y) + 5a(y). -y3 Let q(c) = 21c*3 - 2567c*2 - 11c + 27. Let u(w) = -4w3 + 513w*2 + 2w - 5. Calculate -2q(o) - 11u(o). 2o3 - 509o*2 + 1 Let h(f) = 3f - 69. Let j be h(24). Let y(r) = r*2 + 2r. Let k(v) = 2v2 + 2v + 1. Determine jy(u) - 2k(u). -u*2 + 2u - 2 Let y(k) = 7k2 - 2k - 1. Let l(m) = -7m2 + 3m + 1. Give 4l(o) + 5y(o). 7o2 + 2o - 1 Let u(j) = -2j2 + 13j + 11. Let l be u(7). Let c(o) = 0 + 7o2 - l + 515o - 519o. Let d(w) = -8w*2 + 5w + 5. Calculate 5c(r) + 4d(r). 3r2 Let z(l) = 35 + 11l*2 - 18l - 73 + 34 + 13l3 + 3l. Let b(c) = -7c3 - 6c*2 + 8c + 2. Determine 11b(j) + 6z(j). j*3 - 2j - 2 Let j(c) = 9c2 + 2c - 2. Let f(w) = -64w2 - 10w + 13. What is 2f(k) + 15j(k)? 7k2 + 10k - 4 Let c(u) = 39u3 + 6u*2 - 6u. Let x(m) = 39m3 + 5m*2 - 5m. Calculate 5c(b) - 6x(b). -39b3 Let x(f) = 2f - 9 + 2 + 5 - f*2. Let q = -10 + 24. Let o(m) = 3m*2 - 7m + 7. What is qx(a) + 4o(a)? -2a2 Let o(n) = -7n - 7. Let q = 5 - 11. Let l be 9/q(-20)/6. Suppose 0 = -0u - lu + 25. Let g(a) = -4a - 4. Give ug(r) - 3o(r). r + 1 Let l(n) = 3n + 2. Let b = 762 + -757. Let y = 2 - 1. Let v(h) = -1 - 4h - 2 + 0 + y. Calculate bl(m) + 4v(m). -m + 2 Suppose -2a = -4a - 3r + 3, -2r - 3 = 3a. Let q(h) = -3h + 5. Let y(l) = -3l + 4. Suppose -6 = -16n + 13n. Give ay(t) + nq(t). 3t - 2 Let i(z) = -65z3 + 45. Suppose 3t = -5n + 12, -2t + 48 = n + 40. Let o(h) = 3h3 - 2. Give ti(x) + 90o(x). 10x*3 Let l(r) = -6r*2 - r + 6. Suppose 45 = -3u + 3g, 4u - 3 = 3u - 5g. Let m be ((16/u)/2)/(1/6). Let h(t) = 13t2 + 3t - 13. Calculate mh(o) - 9l(o). 2o2 - 3o - 2 Let z(t) = -5t3 - 4t*2 - 3t - 2. Let v(f) = 4f3 + 3f*2 + 2f + 1. Suppose 11m = -846 + 868. Calculate mz(p) + 3v(p). 2p3 + p2 - 1 Let r(x) = x*3 + 19x*2 - 7x + 11. Let z(o) = -o*3 - 11o*2 + 4o - 5. Calculate -4r(q) - 7z(q). 3q3 + q2 - 9 Let z(d) = 259185d - 925. Let f(j) = 561j - 2. Calculate 925f(p) - 2z(p). 555p Let c(f) = f - 1. Let k(p) = 145p - 2. Calculate 3c(g) - k(g). -142g - 1 Let f(o) = -o2 - o. Suppose 5n - 1 - 9 = 0. Suppose 2a = -2p + p - 43, 4a = np - 90. Let v(t) = 10t2 + 11t. Give af(s) - 2v(s). 2s2 Let l(h) = -h3 - 3h*2 - 2h - 3. Let v(f) = 2f3 + 4f*2 + 3f + 2. Calculate -3l(y) - 2v(y). -y3 + y2 + 5 Let g(w) = -15w3 + 10w*2 - 10w + 10. Let p(z) = -z*3 + 51z*2 - 97z - 46. Let u be p(49). Let c(o) = 5o3 - 3o*2 + 3o - 3. Give ug(h) + 10c(h). 5h3 Let a be -1 + 6 - 12. Let d(b) = b - 1 + ab - 5b. Let y(p) be the second derivative of -p*4/6 + 2p*3/3 + 2p*2 + 2p - 70. Determine -4d(q) - y(q). 2q*2 Let y(o) = -5o*2 - 5o + 5. Let n(x) = -9x2 - 9x + 10. Calculate 6n(a) - 11y(a). a*2 + a + 5 Let k(g) = -16g - 99. Let c(n) = -2n + 2. Calculate 7c(o) - k(o). 2o + 113 Let i be 2/(-5) - (-16)/(-10). Let z(p) = 4p - 16p - 3p + 5p + 11p. Let s(w) = w*2 - 2w. Give iz(r) - s(r). -r2 Let b(t) = -44t*2 + 32. Suppose -4h - 13 + 5 = 0. Let o be (2 + 32/(-12))(-9)/h. Let v(c) = -4c*2 + 3. What is ob(i) + 32v(i)? 4i*2 Let x(d) = 3d*2 - 4d - 7. Let n(s) = 7 - 6 + 2s2 + 4 - 10 - 1 - 3s. Determine 5n(b) - 4x(b). -2b2 + b - 2 Let t(c) be the third derivative of -5c4/6 - c3 - 2c2. Let x(d) = 42d - 101. Let a be x(2). Let p(r) = 7r + 2. What is ap(m) - 6t(m)? m + 2 Let a(g) = 49g - 4. Let p(y) = 50y - 5. Calculate -4a(n) + 3p(n). -46n + 1 Let u(w) = -2w3 - 2w - w*2 - 4 + 1 + 2. Suppose 0 = -11161n + 11165n + 8. Let h(d) = -2d*3 - 2d*2 - 3d - 2. Calculate nh(a) + 3u(a). -2a3 + a2 + 1 Suppose 43u + 91 = -38. Let w(b) = -3b + 2. Let f(s) = 4s - 1. Determine uf(g) - 2w(g). -6g - 1 Let z(u) = -5u + 122. Let j(c) = 7c - 119. Calculate -2j(r) - 3z(r). r - 128 Let z(g) = -20g*3 - 4g2 + 4. Let l(q) = q3 + q*2 - 1. Calculate -24l(o) - 6z(o). 96o*3 Suppose 14p = 62 - 20. Let h(s) be the second derivative of -7/2s2 + 5s + 0 - 5/12s4 - sp. Let i(m) = -m2 - m - 1. Determine h(c) - 6i(c). c*2 - 1 Let z(c) = -3c*3 - 5c*2 - c + 4. Let u(x) = 8x*3 + 14x*2 + 3x - 11. Suppose -51q + 49q = -22. Calculate qz(o) + 4u(o). -o3 + o2 + o Suppose 44 - 62 = -2i. Let y(f) = -6f3 - f2 + 4f. Let v(x) = 13x*3 + 3x*2 - 9x. What is iy(s) + 4v(s)? -2s3 + 3s*2 Let k(p) = -2. Suppose -16 = -4b - 4. Let d(i) = -7i2 - 13. Let m(v) = -4v*2 - 6. Let z(y) = bd(y) - 5m(y). Determine -9k(a) + 2z(a). -2a2 Let o(u) = u3 + u. Let k(p) = 2p3 + 3p*3 - 2p*3 + 3 - 2 + 4p + 4p2. Let x = -27 + 28. Determine xk(l) - 4o(l). -l3 + 4l*2 + 1 Let q(i) = -39i + 15. Let o(a) = -10a + 4. Let w be 16/(-80) + (-84)/(-20). Determine wq(d) - 15o(d). -6d Let z(g) = 3g - 5. Let u(o) = o + 1. Let n(a) = -a2 + 4a - 5. Let i be n(2). Let h(v) = -7v - 4. Let c(s) = ih(s) - 6u(s). Give 10c(p) - 4z(p). -2p Let j(g) = -7g2 + 6g - 8. Let h be j(2). Let n be (-6)/(-5)(-5)/(-2). Let p(m) = -m - 8. Let o(k) = -1. What is ho(i) + np(i)? -3i Let s(t) = 5t. Let u(h) = -56h - 2. What is -68s(w) - 6u(w)? -4w + 12 Let k(p) = -2p*2 - 2p + 9. Let a(m) = -147m + 76m + 70m + 4 - m2. Give -7a(c) + 3k(c). c2 + c - 1 Let h(s) = 5s - 1. Let x(o) be the first derivative of -o*2/2 - o + 546. Determine h(m) + 3x(m). 2m - 4 Let a(s) = -7s*3 - 6s*2 - 3s + 6. Let w(t) = 13t3 + 11t*2 + 5t - 11. Let x = 9 - -3. Suppose -2g + 34 - x = 0. Calculate ga(d) + 6w(d). d3 - 3d Let n(b) = -11b3 + 11b*2 + 58b + 10. Let a(w) = 4w3 - 4w*2 - 19w - 4. What is -8a(j) - 3n(j)? j3 - j2 - 22j + 2 Let w be (-132)/21 + 165/(-35) + 5. Let l(n) = n. Let x(u) = 5u + 1. Give wl(t) + x(t). -t + 1 Let o(z) = -395z*3 + 8690z*2 - 4345. Let n(h) = -2h*2 + 1. Give 8690n(l) + 2o(l). -790l**3 Let i(h) = -h - 3. Let f =	{ "pile_set_name": "DM Mathematics" }
x*3 - 3x*3 + (2 - 2 + 4x*2)(-2x - 4x + x) to mx + l + gx*2 + wx*3 and give w. -22 Express (2h + 4h - 4h)(2h*3 - 3h + 3h) + 41h*3 - 41h3 - h4 + 12 as a + qh3 + ch*4 + nh + rh2 and give q. 0 Rearrange -l4 - 177l + l*3 + 186l + 3l4 - 2l*3 + 2 to the form rl*4 + ml*2 + ul + jl3 + h and give r. 2 Express -5s*3 + 2s + s*4 + 0s + 2s3 as us + cs4 + g + ts*2 + ys*3 and give t. 0 Express -3 + 9b - 10b + 41 + 2b as o + nb and give o. 38 Express 1 - 4v*3 - 2 + 3v*3 - 1 - v as rv*2 + hv + n + iv3 and give n. -2 Rearrange (1 - 1 + 2)(8a - 8a + a) to the form f + ua and give u. 2 Rearrange (0 - 7 + 1)(6t - 2t + 0t)(-5t + 2t + 4t) to the form kt*2 + qt + y and give k. -24 Express -2 + 4r3 + 2 - 22r*4 + r + 19r*4 as o + xr*2 + ur + ir4 + tr*3 and give u. 1 Express -3h*3 + 11h*2 - 8h - 6h2 + 2h*3 as oh + xh3 + ph*2 + g and give p. 5 Rearrange 21 - 21 - 7t*2 + (t - t - 2t)(4t - 4t + t) to the form ct + pt2 + z and give p. -9 Express 3p - 39p2 + 0p - 3p in the form rp + u + ap2 and give a. -39 Rearrange 0 - 3p - 4p3 + 0p + p + 2 to the form rp3 + op + yp2 + f and give r. -4 Express (-2 + 2 - r)(-4r + 2r + 18r)(r - r + 3r) in the form qr*2 + or*3 + v + sr and give o. -48 Rearrange (2 + 3u - 2)(7u2 + 3u - 3u) + 0u*3 + 0u*3 + 2u*3 to the form yu + b + tu2 + cu*3 and give y. 0 Rearrange 4q - 9q2 + 8q*2 - 3q to the form tq2 + pq + a and give t. -1 Express (-9a - 1 - 55a + 13a)((-a - a + 0a)(2 - 3 + 3) - 4 + 4 - a) as da2 + ba + m and give d. 255 Express 15p + p2 - 12p*3 - 2p*4 + 0p*2 + 12p*3 as tp + np2 + wp*4 + c + jp*3 and give j. 0 Express 3i*3 - 5i*3 + 5i*3 - 5i*3 + 4i*3 + 0i*3 + (-3i*2 + 4i*2 - 4i*2)(-2i + 3 - 3) in the form xi*2 + bi*3 + c + ni and give b. 8 Rearrange -7z2 - 2z2 + z2 to the form p + bz + hz*2 and give h. -8 Express 0i + i*4 - 7 + 8 - 2i + 2i3 as p + bi*4 + ui + fi3 + mi*2 and give f. 2 Express -90 + 33r*2 + 90 in the form hr + ir2 + j and give i. 33 Rearrange -3i*2 + 5i*2 - 2i*3 - 2i*2 - 4i*2 to ji*2 + hi*3 + y + bi and give y. 0 Rearrange (1 - 4 + 1)(3w - w - 43785 + 43035) to vw + q and give q. 1500 Rearrange -7o - 4o - 4o to uo + z and give u. -15 Rearrange (p2 - 5p*2 + 2p*2)(5p - 5p + 12p) + 0p - 2p3 + 0p to bp + sp*2 + a + rp*3 and give r. -26 Rearrange -2h*3 - 4h + 0h + 6h - 3 to the form jh3 + w + mh*2 + xh and give x. 2 Rearrange 5v + 9v + 33v + 8v to k + ov and give o. 55 Rearrange (n2 - 1 - 191n + 191n)(-8 + n + 9 - 8) to j + kn2 + zn + an3 and give z. -1 Rearrange (1 + 0 - 2)(-2u + 3u + 0u)(54 - 54 + u) to z + qu2 + tu and give q. -1 Rearrange -3 + 2s - s2 + 2s*4 + 0 + 1 to the form fs + q + ds4 + ws*3 + ms*2 and give f. 2 Rearrange 1 + 3o*3 - 2o*4 - 3o*3 + (-2o3 + o3 + 2o3)(-32o - 11o + 20o) to uo + no2 + bo*3 + mo*4 + g and give g. 1 Express (-6 + 4 - 4)((2y - 3 + 3)(2 - 1 + 0) - 2y + y + 3y) in the form h + vy and give v. -24 Express 6j*2 - 6 + j - 14j*2 + 3 + (-3 + 0 + 1)(-4j2 + 2j*2 + 0j*2) as yj*2 + nj + v and give v. -3 Rearrange -2h - 2h*4 + 2h + (-3h4 + 6h4 - h4)(1 + 0 + 1) + 6h*4 - 15h*4 - 7h*4 to the form mh + c + gh2 + oh*3 + uh*4 and give u. -14 Rearrange (0g + 3g - 2g)(-5 + 3 - 13)(-3g3 - 2g + 2g) to the form lg*4 + yg*2 + cg*3 + ag + k and give l. 45 Rearrange (-2a - a + a - 19 + 19 + 8a + (a + 1 - 1)(0 + 0 - 1) - 2a + 0 + 0)(-a2 - 2a + 2a) to the form ca*3 + la + y + za2 and give c. -3 Rearrange 4 + 0 + 3f*2 - 5 to the form tf*2 + w + sf and give t. 3 Rearrange (4 + 0 - 3)(x2 + 5x*2 - 5x*2) to d + cx + zx2 and give z. 1 Express 4 - 4 - q2 + (1 - 1 - 2)(-q + q + 2q2) + (-73 + 17q + 73)(-3q + 0q + q) as hq + z + vq2 and give v. -39 Express -2 + 30t*4 - 11t*4 - 20t4 - t3 - 2t - 2t*2 + 5 as x + jt*4 + it*2 + vt + ft3 and give i. -2 Rearrange (3 - 3 - 2 + (3 - 2 + 0)(2 + 3 - 2))(-2j + j + 4j) to the form zj + a and give z. 3 Express -x + 3x3 + 3 - 3x + 2x - 4x*3 in the form tx*3 + w + dx*2 + ax and give a. -2 Rearrange (4w4 - 5w4 - w4)(-6 - 1 + 1)(-1 + 2 - 3) to tw2 + n + iw + pw3 + mw*4 and give m. -24 Rearrange (-5 + 1 + 3)(4c + 0c - 6c) - c + 3c + 0c + (-3 + 3 - 1)(-2c + 7c - c) + 3 - 3 + c to the form nc + v and give n. 1 Express (2j - 2 + 2)(-3 + 3 + 1)(0 - 12 + 5) as mj + n and give m. -14 Express 0 + 7f4 + 1 + f3 + f*2 - 5f*4 as z + df*2 + nf*3 + xf + if4 and give z. 1 Express -3k*2 + 5k2 - k2 + (-2k2 + 5k*2 + 0k*2)(-3 + 0 + 5) + 4k2 - 2k*2 + 0k*2 in the form gk + r + xk2 and give x. 9 Express 46i - 98i - 13i*2 + 51i as ri2 + ji + k and give j. -1 Rearrange 61y + 36y - 12y to g + cy and give c. 85 Rearrange 17v2 - 5v + 8v2 - 11v + 18v + 2 to the form jv*2 + b + ov and give o. 2 Rearrange ((-2k + 4k - 5k)(-2 + 2 + 2) + 2k - 2k + k)(12 - 5 + 17) to the form tk + q and give t. -120 Express -4r3 - 1 + 3r*3 - 4 + 6 - 3r*2 in the form mr*2 + o + fr*3 + br and give m. -3 Rearrange 2l2 + 2 + l4 + 0l*2 + 0l*2 - 4l*2 + 19l to h + rl + nl*4 + tl*3 + dl*2 and give d. -2 Rearrange (-7r + r + 3r + 4)(0 + 5 - 1)(r3 + 2r3 - r3) to the form vr + kr*4 + z + yr*3 + ar*2 and give y. 32 Rearrange (b - 3 + 3)(-10 + 13 - 6)(4 - 4 + 3) to ub + d and give u. -9 Rearrange -4g + 18g + 37g to o + mg and give o. 0 Rearrange -104x + 49x + 54x + 13 to the form w + ux and give w. 13 Rearrange u*2 - 6u*3 + 2u*3 - 3u + 2u3 + u to z + iu + nu3 + hu*2 and give i. -2 Rearrange 2j*3 - 158 + 160 - 2j - 12j3 to the form q + wj + lj3 + vj2 and give w. -2 Express -c4 - c*3 + 2c*3 + 2c*4 - 3c*3 - 4c as mc4 + d + rc*2 + ac*3 + uc and give u. -4 Express (2 - 4 + 3 + (-4 + 3 + 2)(-5 + 2 + 2) + 2 - 4 + 3 + 2 + 9 + 9 + 1 - 4 + 1)(0b + b + 0b) - 3b + 5b - b in the form f + db and give d. 20 Express 16x + 6 - 2 - 12 + 6 in the form j + gx and give j. -2 Rearrange (-1 + 2h - 4h + 3)(22 - 22 + 9h) to q + ah*2 + rh and give a. -18 Rearrange w - 10w + 7w to the form j + lw and give l. -2 Express (0l + l + 0l)(-3 + 4 - 3) - 2l + 4l - 4l + 12 - 2l - 12 as u + zl and give z. -6 Express -1 + 1 + 5r*2 + 56r - 66r in the form nr*2 + jr + w and give n. 5 Express (6s2 + 8 - 16 + 10)(s - 4s + 5s) as b + ps3 + os*2 + ms and give m. 4 Express 2q + q2 - 2q + (0 + 0 + q)(3q + 0 + 0) + 39q2 + 7q*2 - 3q*2 in the form t + oq*2 + aq and give o. 47 Express 2f - f4 + 1 + 1 - 6f + 17f in the form cf*3 + wf*2 + kf*4 + q + hf and give k. -1 Rearrange (13v - 7v + 3v - 9)(1 - 1 - 2v) to pv + mv2 + r and give p. 18 Express 2m2 + m2 - 5m2 + (m - m + 2m)(2m - 2 + 0m + 3m) + (3m + m - 5m)(-2 + m + 2) in the form im*2 + f + bm and give b. -4 Rearrange (2t2 + 30t + 22t - 42t)(t - t - 2t) to the form ct2 + z + st*3 + vt and give c. -20 Express -11 - 3 - 4v + 14 in the form xv + i and give x. -4 Express 4 - 39g - 1 - 8 + 4 as j + mg and give j. -1 Express ((3 - 2 - 3)(-3 + 5 + 0) + 0 - 2 + 1)(-14c + 3c + 2c) as r + wc and give w. 45 Rearrange (-10h + 8h + 16h)(1 + 2 - 5) + (-3h + h + 3h)(0 - 1 + 0) + 0 + 0 + 2h to k + ch and give c. -27 Express -46m + 18m - 8m*2 + 27m in the form b + um + jm*2 and give u. -1 Rearrange (z + 2 - 2)(1 - 6 + 4)(-5 + 1 + 2)(-2 - 1 + 7) - 3z - z + 3z to the form lz + m and give l. 7 Rearrange (8j + 13j - 9j)(0 - j + 0 + (-4 + 1 + 2)(j - 3j + 3j)) - j*2 + 0 + 0 + (2j - 2j + 2j)(0j + 3j - 4j) to nj2 + u + qj and give n. -27 Rearrange -3 + 8d2 + 3 + d2 - 5d*2 + 2d*2 + (d + d - d)(-d + 3 - 3) + 0d2 - 5d2 + d2 to the form ad + yd*2 + l and give y. 1 Rearrange t - 2t + 2t - 2t + 2 - 2 + (-t + 0t + 2t)*(24 - 7 + 10) to the form v +	{ "pile_set_name": "DM Mathematics" }
112.1. Is 1 at least k? True Let y = 304 - 182. Suppose -124u + yu - 282 = 0. Is -141 less than u? False Let m = 0.038 + -0.268. Let y = -3.022 - -2.922. Which is greater: m or y? y Let i(z) = -z3 - z + 24. Let r be i(0). Let x be r/108 + 10/(-18). Is 0.05 at most as big as x? False Let w = -1/369 - -5911/2583. Let r(o) = o3 - 11o2 + 2o - 20. Let f be r(11). Is f < w? True Let p(z) = z*3 + 4z*2 + z + 3. Let f be p(-5). Let v = f + 21. Let u be ((-16)/380)/(v/(-15)). Which is smaller: u or -1? -1 Let g = -379 + 378. Does 2/173 = g? False Let c be 2 - (-3 - 24/(-5)). Let b be -1(-3)/(-6)-6. Let i be -2b/18-3. Which is bigger: c or i? i Let g be (-2)/892-2-12. Let x = 368695 + -328877047/892. Let f = x + g. Which is bigger: -3 or f? f Let i = 42 + -41.9. Suppose -2w - 7c = -3c - 6, 0 = 5w - 2c - 3. Let m(x) = x3 - x. Let f be m(w). Which is smaller: i or f? f Let d = 0.5 - -0.2. Let z = d - -0.3. Let c = 2.9 - 1.9. Is c greater than z? False Let x(c) = -102c + 222. Let d be x(2). Are d and 195/11 non-equal? True Let h(d) = d*2 - 12d + 2. Let g be h(12). Suppose 4f = z + 17, 7z + f = gz - 1. Let i be 1/((-4)/1 - z). Which is smaller: i or -0.5? -0.5 Let x be (-804)/21(-42)/12. Let t = x + -94. Which is smaller: 79/2 or t? 79/2 Let c = -0.281 - -0.381. Which is bigger: c or 0? c Let o = 8 - 52. Let f = o - -47. Is f > -1? True Suppose -5z = -604 - 161. Suppose -8v + 468 = -5v - 2y, -613 = -4v - y. Which is smaller: v or z? z Let r be 16/24 - (-328)/(-6). Let n = 48 + r. Are n and -3 equal? False Let n(x) = -2x + 93. Let m be n(-2). Is 98 greater than or equal to m? True Let i = -0.5 - 0.7. Let a = -2.06 - -0.66. Let t = i - a. Is -2/3 less than t? True Let h be 3 + -2 - (-24)/(-28). Let r = 6.87 - -0.13. Let p = r - 8. Do h and p have the same value? False Let h = 1339/8 - 167. Is h smaller than 1? True Let j(o) = o. Suppose -2d + 0t + 2t = -100, -250 = -5d + 2t. Let n be (-10)/d + 28/(-10). Let w be j(n). Is w at most 0? True Let s(a) = -5a + 21. Suppose -4p - 5p = -36. Let t be s(p). Is 15 at least t? True Let i(s) = 38s - 56. Let a be i(5). Are a and 133 equal? False Let l = -1136 - -1115. Which is bigger: l or -14? -14 Let d = 7 - 22. Suppose -8v - 14 = -7v. Which is smaller: d or v? d Let d = 1590 - 1589. Let x be (-6)/24 - 74/(-328). Is d < x? False Suppose 0 = -f - 2f - 4y, 4y = 0. Let l be (-4)/(-2) - 118/26. Let r = 31/13 + l. Which is greater: r or f? f Let d be 296/(-36) + 4/18. Let b(h) = h*3 + 7h*2 - 7h + 11. Let g be b(d). Suppose -5z = -gz. Which is smaller: z or 1? z Let d be (5 + -3)(-6)/4. Suppose 0 = 3t + 5v, 5t = 2v + 13 + 18. Suppose tx + 6 = 1. Is x smaller than d? False Suppose 0 = -0i - i + 4. Let b(o) = o2 - o - 30. Let f be b(-5). Suppose -8 = l - 2q, 0 = -l - fq + q - i. Which is greater: 2/7 or l? 2/7 Let u = 106 + -531/5. Let x(m) = m + 1. Let v(q) = 2q - 4. Let b(c) = -v(c) + x(c). Let d be b(6). Which is smaller: u or d? d Suppose 2y + 2 = 0, -4y + y + 25 = 4l. Let h = 29 - l. Is h at most 22? True Let f(i) = i - 6. Let d be f(6). Let r be (d1/(-2))/1. Let v be -4 + (-4 - 1035/(-130)). Which is smaller: r or v? v Let c = -4.6 + 14.5. Let a = -9.1 + c. Which is smaller: 0.3 or a? 0.3 Let v = 20 + -28. Let g be 30/140v/18. Does 1 = g? False Suppose l = 22l + 21. Which is bigger: 2/227 or l? 2/227 Let r be -1((-18)/(-4) + -4). Let t(f) = f2 - 10f - 7. Let p be t(10). Let n = p + 7. Which is smaller: r or n? r Suppose 904 = 7u + 1219. Is 9 > u? True Let g = 283 + -176. Is g bigger than 107? False Let c be (1 - (0 - -3)) + 7. Let t = c + -12. Let p(n) = n2 - 13n + 16. Let j be p(11). Which is greater: j or t? j Let y = -5 + 5. Suppose l + 12 = -ys - s, -5s - 3l = 66. Let a be 7/s + 4/(-20). Is a >= -2? True Let f be 2 - (11 - (-1 - 1)). Let i = f - -20. Suppose 3k - i + 6 = 0. Is k less than or equal to 6/17? False Let g(d) = -1. Let w(o) = o + 8. Let q(c) = 6g(c) + w(c). Let x be q(14). Let f be (8/x)/((-1)/10). Is -3 at most f? False Suppose -a = a. Suppose a = -4g + 53 + 39. Suppose -g = 3d - 5p, -2d = 2p - 4p + 10. Which is smaller: d or 2/17? d Let m = 110 + -110.5. Is m greater than -25? True Let a = 175 - 176. Does 2/373 = a? False Suppose -52 + 40 = -4c. Suppose -4w + cg + 68 = 0, 5w - 3g - 59 = 23. Is w greater than 13? True Let o(t) = 11t. Let h be o(-2). Let f(m) = 41m + 1290. Let p be f(-32). Is h bigger than p? False Let w = -27 + 42. Suppose 0 = -2c + 2b - 26, -w = c + b - 3b. Which is greater: c or -12? c Suppose 0 = -14q + 2q - 12. Let v be 9/9 + (-25 - q) - -4. Which is greater: v or -56/3? -56/3 Suppose -4a = 4c, -5c + 2a - 28 = 7. Is -191 at most as big as c? True Suppose 4d - 9 = -97. Let t = d - 4. Do -25 and t have different values? True Let h = -752 - -752.1. Is 726 greater than h? True Let g = 31939/18 + -1773. Is 2 not equal to g? True Let n be (-48)/(-22) - (-2 - -4). Suppose -4o - 4 = 2y, 0o - 2o = -y + 2. Which is smaller: o or n? o Let v(d) = -2d - 20. Let u be 22/(-4)7/((-21)/(-6)). Let y be v(u). Which is greater: 3 or y? 3 Suppose -21q + 46 = -38. Let u = 14 - 16. Which is smaller: q or u? u Suppose -w - 2w + 40 = m, m - 32 = -5w. Let b = m + -53. Which is greater: 2/65 or b? 2/65 Let r = 14 - 17. Let y(a) = -3a*2 - 3a. Let v be y(r). Is -18 <= v? True Let b be ((6 - 5)(3 + -4))/391. Are b and 1 non-equal? True Let v be 4 + 88/(-16)(-8)/(-10). Which is bigger: v or 0.068? 0.068 Suppose -18k + 24k = -996. Which is greater: 1 or k? 1 Let b = -27/2 + 12. Let v = 0.08 - -1.92. Is b less than v? True Let o = -9 + -27. Let u = o - -40. Which is bigger: u or 6? 6 Let k = -1508 + 10558/7. Which is greater: -1114 or k? k Let h(z) = 2z3 + 3z*2 - z + 6. Let i be h(-3). Let n be (-176)/i((-6)/8 - 0). Is n at least 2/7? False Let o = 26 + 84. Does 112 = o? False Let l = -37/4 - -9. Let b = -0.1734 - -10.2034. Let h = -10 + b. Which is greater: h or l? h Let y be 570/(-3) + (-4 - -5). Let v = y + 1515/8. Is v less than 0? False Suppose 0 = -109l + 92l - 21012. Which is greater: -1237 or l? l Let k(n) = 11 + 13 - n - 10. Let b be k(6). Suppose 0 = bi - i. Which is smaller: i or 10? i Let t be (-2)/4 + (583/18)/11. Which is bigger: t or 1? t Let i(g) = -g2 + 36g - 71. Let k be i(31). Which is smaller: 80 or k? 80 Let q(r) = 4r2 + 0r + 0r + 4r + 3 - 3r2. Let c be q(-6). Let n = c + -16. Is n > 2/5? False Let z be (-6 + 9)/(18/(-1632)). Which is smaller: -273 or z? -273 Suppose 3u = -2g - 88, -3g + 3u - 134 = 8u. Is g greater than -28? False Let g be (-1)/(8/(-2932)). Is g != 117? True Suppose 7n - 3n + 20 = 3l, -3n + 3l - 15 = 0. Let r(q) = -29q2 - 3q - 3 - 3 + 28q2. Let i be r(-3). Which is smaller: i or n? i Let x be (-100)/125 + (-6)/5. Which is smaller: 3 or x? x Let u be 120/469 - 146/511. Is u bigger than 4? False Let o = 1.2 + -1.126. Let b = -2.674 + o. Which is bigger: b or 1? 1 Suppose 2a - 5f = -0a - 397, -3a - 3f = 606. Let j = a + 598/3. Which is smaller: -3 or j? -3 Suppose 6a + 28 = 3h + 2a, 3h - 27 = 3a. Let u(s) = s2 - s + 3. Let v be u(0). Suppose y + 2 = vy. Which is greater: y or h? h Let h(o) = 2o2 + 3o + 10. Let t be h(6). Suppose 4a + 0v = -5v - t, 0 = -v. Which is smaller: a or -24? a Let u = -206 + 207. Is -3/205 less than u? True Let x be ((-224)/24)/(-2 - 3/(-2)). Is x != 20? True Suppose 5o = 2r - r - 157, -r + 33 = -o. Which is smaller: 14 or o? o Let t = 468 + -468. Which is greater: t or 1/73? 1/73 Let s = 57100 - 57151.038. Let f = s + 51. Is f at most as big as 1/3? True Suppose 2h + 35 = h - 5g, -4h + 2g - 30 = 0. Let p = h - -14. Suppose 2s - 4 = 4i, 4s - 12 = -p. Which is greater: i or 1/9? 1/9 Suppose -4q + 4j - 8 = 0, -3q - 6j - 30 = -j. Which is greater: q or -7? q Let z(p) be the first derivative of p4/12 + p3/6 + 2p2 - 4p + 10. Let g(q) be the first derivative of z(q). Let x be g(0). Which is smaller: 7 or x? x Suppose -21 = -7s + 8s + 5m, s = 4m + 24. Suppose 2y + 42 = -2d, sd - 8d - 101 = 5y. Is -19 at most y? True Let m = 70492106/2189134455 + 35/296029. Let n = -1/145 - m. Which is smaller: n or 0? n Let p be 1 - ((-4)/(-2) + -5). Suppose -4m	{ "pile_set_name": "DM Mathematics" }
i2 + li*3 + h + zi and give s. -1 Express (0g + g - 15g + 2)(4g - 2g + g)(4g2 - 3g*2 - 2g*2) in the form ug*2 + n + lg*3 + ag*4 + tg and give l. -6 Express -8 + 3o + 2 + 7 - o - o3 - o4 as ro*2 + b + ho*4 + to + ao3 and give a. -1 Express (8 - 21 + 2w*3 + 8)(2 - 5 + 1) in the form cw2 + gw + vw3 + p and give v. -4 Rearrange -1 - w4 - w4 + 4w + 5w2 - 5w to the form vw3 + b + tw*2 + jw*4 + yw and give t. 5 Express -3 + 3 + 3u + (1 - 3 + 4)(6u - 2u - u)(-4 + 16 + 1) as mu + i and give i. 0 Express 67s2 + 224s - 224s as as + y + qs2 and give q. 67 Rearrange -4i*2 - 2i*2 + 18i2 + i3 - i to gi2 + h + bi + yi3 and give h. 0 Express 86 + 1 - 3d*2 + 42 + 4d*2 as a + pd*2 + kd and give p. 1 Rearrange 16 + 2f + 14 - 11 + 0f to the form qf + j and give q. 2 Rearrange (k3 + 4k*2 - 4k*2)(-8k - 3k + 10k - 54) to the form sk*3 + a + dk*4 + mk + vk2 and give a. 0 Rearrange 12o*2 + 19o*2 - 14o*2 + 16o*2 to the form q + zo*2 + jo and give z. 33 Rearrange 25p2 - 694 + 694 + (4p - 3p - 3p)(p + p - 4p) to the form tp + gp*2 + f and give g. 29 Express (3 - 3 + k)(3k - 2k + 0k) + 21k*2 + 124k - 124k in the form pk + wk2 + h and give h. 0 Rearrange -16i*2 + 5i*2 + 1 - 2i*4 + 11i*2 + 3i*3 to b + xi*4 + yi + qi3 + hi*2 and give q. 3 Express -13m + 3 + 25m - 2 + 12m in the form n + am and give a. 24 Express (f2 + 35 + 9f - 37 - 4f)(4 + f - 4) as cf3 + g + if + mf2 and give c. 1 Express 245q - 121q + 37 - 123q in the form r + nq and give n. 1 Rearrange 0a - 15a3 - 240 + 2a + 242 to fa3 + ga*2 + x + ia and give f. -15 Rearrange -m3 - m4 - 248 - 2m + 246 + m3 - 16m*2 to nm*2 + ym*3 + rm + j + hm4 and give j. -2 Express 3c*4 + 151c*2 + 0c*4 - 149c*2 + 3c - 2c4 - c3 - 4 as rc*4 + a + qc*3 + ic + uc2 and give u. 2 Express (v - v - 3v)(2 + 2 - 5)(0 - 1 + 2) as n + uv and give u. 3 Rearrange -k3 - k2 + 3k3 + 1 + k2 to fk3 + lk*2 + m + rk and give f. 2 Rearrange 5 + 4 + 38h - 37h to the form n + xh and give n. 9 Rearrange (-2k + 2k - 2k*3)(3 - 4 - 1) + (0k - 3k - 4k)(k*2 - 4k2 + k2) + 7k3 + 0k*3 - 2k*3 to wk*3 + ok*2 + f + jk and give w. 23 Express d - 6d2 + d3 + 14 + 10 + 12 - 2d*4 - 37 in the form nd*2 + y + gd*3 + cd*4 + ad and give g. 1 Express (-2u2 - 4u*2 + 2u*2)(-1 + u + 1) - 4 + 4 - 2u3 - 5u + 5u - u3 as iu*3 + ru + cu2 + x and give i. -7 Rearrange -23i*2 - 3i + 6i2 - 2 + 2i*3 + 17i*2 to qi*3 + ri*2 + o + hi and give q. 2 Rearrange 22d + 12d + 9d + 52d to the form sd + p and give s. 95 Rearrange 0 + 5 - 2y*4 + y - 2y - 3y3 - 7 to uy*2 + xy + hy4 + my*3 + l and give m. -3 Rearrange -3s - 3s3 - 1 - s + 0s*3 to ws + bs2 + cs*3 + g and give g. -1 Express -31l + 0 + 2l2 + 34l + 6 - 4 - 5l3 in the form bl + zl3 + p + ql*2 and give p. 2 Express 175z*2 - 94z - 94z + 188z in the form k + jz + rz*2 and give r. 175 Rearrange 27a - 27a - 25a*2 to pa*2 + ba + n and give p. -25 Rearrange -10166 + 10166 + 21z2 to the form b + xz*2 + uz and give x. 21 Express -1 - 6y3 - 2y*2 + 2y*3 - 2y + 5y3 as f + wy*3 + ry + dy2 and give w. 1 Rearrange -n2 + 0n*2 + 3n4 + 4 + n3 - 5 + 0 - 2n to the form on*3 + jn*4 + p + zn*2 + sn and give j. 3 Rearrange (0 + 0 + 2j)(8j - 2j - 2j)(3j + 4j - 3j) + 2j*3 + 3 - 3 to aj*2 + wj + fj3 + q and give f. 34 Express (1 - 1 - a)(-2 + 0 + 0)(1 - 1 + a)(-a - 3a + 5a + (3 - 1 + 0)(-3a - a + 3a)) in the form x + ma*3 + ga + ia2 and give m. -2 Rearrange -6k*2 + 3k2 + k2 + (-2 + 3 - 2)(k2 + 1 - 1) - 16k*2 - 4k*2 + 13k*2 to the form q + ak*2 + yk and give a. -10 Rearrange (4m2 - 5m*2 + 1 - 2m*2)(-8m2 - 10m + 10m) + 0m*4 + 4m*4 - 6m*4 to the form dm*3 + lm*4 + sm*2 + g + om and give s. -8 Express (-h*2 + 6h*2 - 4h*2)(-3 + 3 + h*2) - 382h2 + h4 - 5h4 + 380h2 - h3 as sh + lh*2 + mh*3 + u + oh*4 and give o. -3 Express f - 24 - 3f*2 + 43 - 5f*2 - 3f*3 - 17 in the form gf*3 + q + rf*2 + kf and give q. 2 Express -4p3 + 8p*2 - 10p*2 + 4p*2 + 2 as vp + up3 + rp*2 + d and give r. 2 Express (q - 25q*2 - q + 0q*2)(2q2 - 4q*2 + 4q*2) as oq*2 + jq*3 + bq*4 + k + pq and give b. -50 Rearrange 16b - 1 - 21b - 4b2 + 2 to xb*2 + mb + k and give k. 1 Rearrange (k + 9k - 11k)(8k + k - 4k) to yk + wk2 + g and give w. -5 Express 3z*2 - 3z*3 - 2z*2 + 5z*3 - 3z*2 as yz + r + kz3 + lz*2 and give l. -2 Express (-2c*3 - 3c*3 + 3c*3)(14c - 10 + 10) + 2c*4 + 2c*4 - 3c*4 - 4c*2 + 4c2 + c4 as hc + pc*2 + dc*3 + m + zc*4 and give z. -26 Rearrange (0v3 - v3 - 4v3)((-3v + 5v - v)(1 + 1 - 3) - 7 + 7 + 3v) to the form yv + xv*2 + uv*3 + z + bv*4 and give u. 0 Rearrange (-4m*2 + 4m*2 - 3m*2)(5m - 3m + 2m) to jm*3 + cm*2 + i + lm and give i. 0 Express (-3g + 3g + g + (0 + 2 - 3)(-2g + 5g + g))(0 - 2 + 5) as d + zg and give d. 0 Express -2y*2 + 2y*2 + 2y*3 + (2y*2 + y - y)(-5y + 20y + 21y) in the form gy*3 + t + sy*2 + hy and give g. 74 Express -9j - 18j - 7j as hj + g and give h. -34 Rearrange 15y2 - 4y*2 - 7y*2 to dy + wy2 + i and give w. 4 Rearrange (-1 + 4 + 7)(2 - 4 - 1)(2n2 - n2 + n*2) to the form fn*2 + gn + y and give g. 0 Express -14q2 - 13q*2 + 23q*2 + 5 in the form kq + t + cq2 and give k. 0 Rearrange -24s*2 - 7 + 7 to us*2 + ls + g and give u. -24 Express m*3 - 2m*3 + 3m*4 + 153m - 155m - 2m*2 in the form rm*2 + ym*3 + cm*4 + lm + v and give l. -2 Rearrange -n*4 + 6n*2 - 22n*2 + 2n*3 + 15n*2 to the form gn + hn3 + un*4 + sn*2 + x and give s. -1 Express -3k + 5k2 + k + k - 4k*2 in the form v + uk + yk2 and give y. 1 Rearrange (3 + 0 + 2)(2y + y2 - 2y)(474 + 8y + 2y - 476) to ny + by2 + d + cy*3 and give c. 50 Rearrange 40u*2 + 22u2 - u2 to the form b + tu2 + ku and give t. 61 Express -27 + 27 + 10p + (1 + 3 - 3)(2p + 3 - 3) + 2p - p + p + p + 1 - 1 as tp + x and give t. 15 Rearrange -2b + 0b + b + (3 - 2 + 1)(-2b + b + 2b) + 0b + b - 4b - b - 2 + 2 + (-3 + 4 + 0)(5 + 0 - 1)(2b + 0b + 0b) to fb + o and give f. 5 Rearrange (3 + 1 - 6)(-3h + 3h - 2h) + (1 - 1 + 2h)(-65 + 24 - 15) to the form bh + l and give l. 0 Express (-1 + 0 - 1 + (-3 - 1 + 2)(1 + 6 - 5))(-8a - 28a + 9a) in the form va + x and give v. 162 Express (-3i*2 + 6i*2 + 3i*2)(16 + 6i2 - 16) + i4 + 2i - 2i as hi*2 + gi + si3 + zi*4 + w and give z. 37 Rearrange -m - 9m*3 - 1 - 1 - 2m3 + m3 to cm + w + fm*2 + sm*3 and give w. -2 Express 7t*2 - 3t2 + t2 as ht2 + k + jt and give h. 5 Express 5r2 + 8r - 8r - 2r*3 + 11r*2 as ir*3 + o + nr*2 + zr and give i. -2 Express c + 0c3 + 2c*2 - 2c*3 + 0c - 4c2 in the form r + ic + oc3 + wc*2 and give i. 1 Rearrange (-4t + 7t - t)(-t2 + t2 + t*2) - 2 + 0t*3 + 2t3 + t3 to the form j + ct + vt*2 + qt*3 and give j. -2 Express 3f - 50f + 0f in the form q + jf and give j. -47 Rearrange 8h*2 + 4h2 + h2 to the form t + ih + bh*2 and give b. 13 Rearrange -2p*4 - 8p*2 + 2 - 2p3 + p2 + 6p2 + 4p*4 to the form dp*3 + qp*4 + vp*2 + xp + u and give q. 2 Express -8b4 - b4 + 80b*2 + 4b - 82b2 in the form mb + n + sb3 + lb*2 + hb*4 and give m. 4 Express (26 - 8 + 2)(-2 + 9 - 3)(0y*3 - 5y*3 + 3y*3) + (2y - 3y - y)(-3y2 + 4y*2 + 2y*2) as k + uy*2 + oy*3 + ay and give o. -166 Express (-6a + 4a + 4a + 2)(0 + 1 + 0) as m + wa and give m. 2 Express (-2g - 2g - 3g)(1 - 2 - 2) + 0 - 2g + 0 + 4g - g - 4g as fg + w and give f. 18 Express 9d + 15d - 5d + 8d as zd + p and give z. 27 Rearrange b*4 - 104b*3 - 1 + 104b*3 - b - 3b to the form r + lb + cb*2 + zb*3 + kb*4 and give r. -1 Rearrange -3	{ "pile_set_name": "DM Mathematics" }
2/3 (c) 20/391 (d) 1 (e) -2/7 a Which is the closest to -3931? (a) 0.11 (b) 1/6 (c) 3/5 (d) -3 d Which is the nearest to 1? (a) -3 (b) 0.34 (c) -385/6 b What is the closest to -2 in 220/371, -0.02, 0? -0.02 Which is the closest to -2/5? (a) -1/127 (b) -2034.3 (c) 0.4 (d) 0.5 (e) 4 (f) -5 a What is the nearest to 19 in 2, 0.2, 7, 58? 7 What is the nearest to -3/5 in 21, -89, -15/7? -15/7 What is the closest to -19339.23 in -4/5, -2, 1/5? -2 Which is the nearest to -1? (a) 0 (b) 77 (c) 0.4 (d) -17 (e) -5 a What is the closest to -0.1 in -24, -19, 129051? -19 Which is the closest to -0.2? (a) -7/13 (b) 0.7 (c) 90 (d) 0.08 d Which is the closest to 0.1? (a) 2276 (b) -2/13 (c) -1/4 (d) -0.2 (e) -63/4 b Which is the closest to 0.065? (a) 2 (b) 230 (c) -301 (d) -0.1 d What is the nearest to 1/4 in 21, 110, -0.15? -0.15 Which is the nearest to -5? (a) -24 (b) -309/20 (c) -2 (d) 0.5 (e) 0.05 (f) -0.4 c Which is the nearest to 26? (a) -3 (b) 0.5 (c) -2 (d) 2337 (e) 0.3 b Which is the nearest to 1/16? (a) 0.04 (b) 5 (c) -2391 a What is the nearest to 14 in -1, 0.18, -107/5, 4, 0.12, -0.4? 4 Which is the nearest to 4? (a) -0.1 (b) -4/9 (c) 3/4 (d) -3 (e) 27 (f) 1 f Which is the closest to 155255? (a) 5 (b) 6 (c) 4 (d) -5 b Which is the nearest to -1? (a) -2/13 (b) -6272 (c) 5519 a Which is the closest to -0.2? (a) -2/7 (b) -50 (c) 4/7 (d) 5232 (e) 3 a What is the closest to 1 in -2.12, -2, -46/7, -0.3, 3? -0.3 What is the closest to 124 in 0.078, 3/2, 1/11, -4, 4? 4 Which is the nearest to -1? (a) -7/316 (b) 3/7 (c) -154 (d) 0 (e) -5 a What is the nearest to 4547 in 3, -85/13, -7? 3 What is the nearest to 1/3 in -1/9, 2, -28, -628? -1/9 Which is the nearest to 0? (a) -453 (b) 0.3 (c) -14 (d) 56 b Which is the nearest to 208? (a) -0.2 (b) -3/8 (c) 11/5 (d) 260 (e) -2/7 d Which is the nearest to 2/4341? (a) 3/2 (b) -2/3 (c) -0.3 c Which is the nearest to 520? (a) 1 (b) -1 (c) 0 (d) 0.47 (e) 99 e Which is the closest to 0.05? (a) 43 (b) -1/3 (c) -4 (d) 0.6 (e) 3/4 b Which is the closest to -3? (a) 5/12 (b) -0.1562 (c) 10/27 b What is the nearest to -2 in 266427, -2, 3/5? -2 Which is the nearest to 0.1? (a) 2/9 (b) 3389602 (c) -4/7 (d) -1/6 a What is the nearest to -0.2 in 3/2, -3, 0, -199, -1/3? -1/3 What is the nearest to 1/2 in -5, 4, -1, 1.1, 3/2, -260? 1.1 Which is the closest to 2122/9? (a) 0 (b) -4/7 (c) -2/43 a Which is the nearest to -0.1? (a) -1/152 (b) 72 (c) 0.3 (d) 2/9 a What is the nearest to 7 in 23, -1, 0.155, -4/17, 1/4? 1/4 What is the nearest to -0.6 in 5, 4/37, 0.4, 8, 3, 1? 4/37 Which is the closest to 1/29? (a) -3 (b) -5 (c) -1/4 (d) -11132 c What is the closest to 6 in -0.689, -1/9, -0.4, -5? -1/9 What is the closest to -0.17507 in 0, 2, -1, 1.4? 0 What is the nearest to 1 in 1/49, -5/23, -3? 1/49 Which is the nearest to -4? (a) -4 (b) -0.0883 (c) -3/31 a Which is the closest to 0.1? (a) -0.02 (b) 5/1788 (c) -4/33 b What is the closest to -4 in 2, 0.1, -0.54, 22, 5? -0.54 What is the nearest to 2/9 in 1, -55, -2768, 2/3, -1/3? 2/3 What is the nearest to 0.28 in -2/9, 0.5, 36, -12, 2? 0.5 What is the closest to -270/13 in 4, -1/173, -29, -4, -6? -29 Which is the closest to -0.06? (a) 0 (b) -0.5 (c) 1251/244 a What is the closest to 0.1 in -347, -18/7, 0.1, 1/3, 0? 0.1 Which is the nearest to -0.2? (a) -1/130 (b) -2/207 (c) 0.6 b Which is the closest to -2? (a) 0.19 (b) 2/183 (c) -19 (d) 5 (e) 1 b What is the nearest to -0.1 in -10, 4, -145, -3, -66? -3 What is the closest to 2/7 in 3, 1.9, 8/33, -549? 8/33 Which is the nearest to -1? (a) -0.4 (b) -11/14577 (c) -4/5 (d) -2/3 c What is the closest to -0.1 in 4, -0.04, -8, 364.87, 2/13? -0.04 Which is the nearest to -2.7? (a) -100 (b) -11/17 (c) 1/33 b What is the nearest to 1 in 54/23, -0.019, -2, -105? -0.019 Which is the nearest to -1? (a) -4 (b) -2 (c) 37 (d) -7488 b Which is the closest to 19/262? (a) 10 (b) 2/55 (c) 1/4 (d) 1 b Which is the nearest to -2/147? (a) 0.4 (b) 5 (c) 3/7 (d) 3 (e) -2 (f) 93 a What is the closest to -1/34 in 2, 7, -129.2, 5? 2 What is the nearest to -4 in 1/9, 3/62, 3, -5, 2/21, -133? -5 Which is the nearest to 0.2? (a) 4 (b) -2/11 (c) -377 (d) -2/23 d Which is the nearest to -1? (a) 2 (b) -0.06 (c) -11 (d) -2 (e) -0.127 e Which is the nearest to 3.6? (a) -407 (b) 0.115 (c) 11 (d) -1/6 b What is the closest to 0 in 4, -1/5, -0.1, 4.8, -0.5? -0.1 Which is the closest to 0.39? (a) 886 (b) -2 (c) -0.5 (d) 1/39 (e) -3/2 d What is the closest to -0.0069 in -1/942, 0.9, 1/5, -4/7, 0.16? -1/942 What is the nearest to -2.5 in 0.32, -1634, 4? 0.32 What is the nearest to -1 in 14/781, 0, 1499? 0 Which is the closest to -716.8? (a) 5 (b) -4/7 (c) 0 (d) 1854 b What is the closest to 0 in 0.5, 2, 5671, 1.7442, -0.1? -0.1 Which is the closest to 1/4? (a) -2 (b) 5797 (c) 5/3 (d) -32 c What is the nearest to 6942 in -2/27, 4/9, -0.1, -1.8? 4/9 What is the nearest to -16/5 in 2/5, -101, 0.5, -0.253, -4/7, 3/7? -4/7 Which is the closest to 959? (a) -5 (b) 0 (c) -3/4 (d) 23 (e) -1/32 d Which is the closest to 21? (a) -0.027 (b) -1 (c) 0.2 (d) 0.01 (e) 5 (f) 3 e What is the nearest to -1/4 in 36, -0.0583, 5, 1? -0.0583 Which is the closest to -6.6? (a) -4/5 (b) -2/7 (c) 27387 a Which is the nearest to 3/5? (a) -2 (b) 3029383 (c) -0.4 c What is the closest to -181 in -0.4, 2/11, 94, 1.6? -0.4 Which is the nearest to -1? (a) -2/13 (b) -5 (c) 0.2 (d) -65.97734 a Which is the nearest to 1? (a) -0.2 (b) -52461 (c) 25 a Which is the nearest to 0.1? (a) -1 (b) -6/9077 (c) 4 (d) 1/5 (e) 3 d What is the closest to 57 in 1/4, 0.64, 3, 0.7? 3 What is the closest to -0.1 in 5, 0.5, -4290.3, -1, 0.3? 0.3 What is the closest to -2 in 8.898, -5, 0? 0 What is the nearest to 177 in 5, -2/5, -45464? 5 What is the closest to 0.1 in 0.03, -0.3, -54, -1, 10/101? 10/101 What is the nearest to -1/8 in 1/16, -0.4, -1.862, 0.1? 1/16 What is the nearest to 5/8 in 2.4, 8183, 0.4? 0.4 What is the closest to 3 in 0.13, -913, 2, 0.2? 2 What is the closest to -7 in 2, 2/41, 33882? 2/41 What is the nearest to -0.1 in -126, -11, 254? -11 Which is the closest to -318? (a) 1.8375 (b) 0.08 (c) -3 c Which is the nearest to 900/59? (a) 4/23 (b) -3/5 (c) 1/3 c Which is the nearest to 616? (a) -0.049 (b) 0.5 (c) 0.1 (d) -0.5 (e) 0.4 b What is the closest to -69 in -0.3, 380, 0.043? -0.3 What is the closest to -4/27 in -1.04, 419, -2/7, 3? -2/7 Which is the nearest to -127/7? (a) -0.4 (b) 3 (c) 23.3 (d) 4 (e) 0.2 a What is the nearest to 1/2 in -0.2, -0.3, -1/3874, 3/4? 3/4 What is the nearest to -687 in 5, 4, -5, -2/23, -1/3, 0? -5 Which is the nearest to -3? (a) 0.003 (b) 1/3 (c) 8 (d) 3 (e) -8 a What is the nearest to -1 in 0.3, -1.6, 2/13, 0.296162? -1.6 What is the closest to -0.2 in 2/13, -0.4, -3, 0.5, -1677/4, -56? -0.4 Which is the nearest to 4? (a) -26 (b) -1/2 (c) -18 (d) -28 b Which is the nearest to 2? (a) 21/8 (b) 1 (c) 127 (d) -0.4 (e) 0 (f) 3/2 f Which is the nearest to -8? (a) -938 (b) -2/9 (c) 0.2 (d) -4/5 (e) -0.2 (f) 0.5 d What is the closest to 3 in 3/47, 12329, -5/6, 0.2? 0.2 Which is the closest to -1532? (a) 0.5 (b) -2/9 (c) 6 (d) -3/5 (e) -71 e What is the nearest to 0.2 in 1, -1182/17, 0.8, 0.9, -2? 0.8 What is the nearest to 0 in -5, 2, -5/3, 11899064? -5/3 Which is the nearest to -58? (a) -0.03 (b) -2/45 (c) -0.1 (d) 0.0374 c What is the nearest to -10/7 in 1, 0.5, -1/116068? -1/116068 What is the closest to 0.1 in -28260, -2/207, 4, 5, 1? -2/207 Which is the closest to 1/5? (a) 70 (b) 0 (c) -38 (d) -2/7 (e) 1/3 e What is the nearest to -0.1 in -4, 0.3, 20.1, -9, -1557? 0.3 Which is the closest to -1? (a) -352 (b) 0.2 (c) -14 (d) 105 (e) 2 (f) -0.1 f Which is the nearest to -0.1? (a) -1 (b) 0.3 (c) 2/63 (d) 12 (e) -2.5 (f) 1/11 c What is the closest to 5 in -5, 1/4, 0.1, -783.8, 0.9? 0.9 What is the closest to 2/3 in -138767, -16, -0.2, -4? -0.2 What is the closest to 0.1 in -2/17, 0, -1/43, -5, -26? 0 What is the nearest to 1.066 in -0.2, 1, 38, 5? 1 Which is the closest to 3452/3? (a) -1/2 (b) -4 (c) -84 a What is the	{ "pile_set_name": "DM Mathematics" }
2 + 45147q + 1300. Give m(34). -26 Let r(b) = -9510b + 142639. What is r(15)? -11 Let d(l) = 47564l + 523243. What is d(-11)? 39 Let r(c) = -80c + 502. Calculate r(-11). 1382 Let v(y) = -y3 - 97y*2 - 568y - 45317. Determine v(-96). -5 Let x(g) = 2342g + 121807. Give x(-52). 23 Let l(k) = -3740k + 33689. Give l(9). 29 Let v(f) = 42f2 - 513f - 2555. Determine v(16). -11 Let b(y) = y*3 + 21y*2 + 581y + 7314. Give b(-15). -51 Let a(r) = -3r3 - 252r*2 + 261r + 21827. Determine a(-84). -97 Let u(o) = -23o2 - 47o - 58. What is u(-8)? -1154 Let z(p) = 10p3 + 8p*2 - 23p - 165. Give z(-4). -585 Let q(m) = 489m - 40153. Determine q(82). -55 Let v(g) = -24041g + 13871658. Give v(577). 1 Let l(k) = 1007k + 102712. Determine l(-102). -2 Let o(f) = 595f - 53468. Calculate o(90). 82 Let c(t) = t*3 + 28t*2 - 303t + 120. Give c(8). 0 Let j(y) = -5y3 + 6y*2 - 11y + 50. What is j(5)? -480 Let y(k) = 2k2 + 2209k + 248015. Give y(-127). -270 Let n(w) = -58846w - 765006. What is n(-13)? -8 Let m(x) = 5931x + 83032. Give m(-14). -2 Let t(z) = -2z3 + 28z*2 + 557z - 7880. Determine t(15). 25 Let p(w) = 3w3 - 5w*2 - 37w - 108. What is p(-7)? -1123 Let f(r) = 16r3 - 6r*2 + 4391r - 8774. Give f(2). 112 Let p(z) = 21z3 + 120z*2 + 671z - 25. Give p(-6). -4267 Let g(i) = 2135i + 1133863. Give g(-531). 178 Let x(p) = 1814p - 11956. Determine x(5). -2886 Let o(g) = g*3 + 77g*2 + 63g + 46430. What is o(-83)? -133 Let q(b) = -2b3 - 153b*2 + 1270b + 69131. Calculate q(-79). 6 Let i(a) = -3755a + 4213122. Give i(1122). 12 Let t(q) = -1557q + 99448. Calculate t(64). -200 Let l(r) = -r*3 - 30r*2 - 136r - 9. Calculate l(-6). -57 Let a(s) = -8273s + 33113. Determine a(4). 21 Let s(t) = t3 + 123t*2 + 3694t - 1671. Give s(-54). 57 Let c(r) = 318r2 + 283r - 32. Calculate c(-1). 3 Let m(p) = -p*3 - 52p*2 - 282p - 9. Give m(-46). 267 Let k(o) = o*2 + 3734o - 59997. What is k(16)? 3 Let s(a) = 3a3 - 100a*2 + 344a + 23. What is s(4)? -9 Let l(a) = -1616a2 - 6855a - 1566. Determine l(-4). -2 Let u(g) = -8g2 + 3817g - 30018. What is u(8)? 6 Let b(z) = 31z3 - 1114z*2 - 68z - 5. Give b(36). 139 Let g(n) = -441n - 5929. What is g(-16)? 1127 Let o(d) = 100d*2 - 1255d - 17. Give o(14). 2013 Let d(l) = 6164l - 1017070. Determine d(165). -10 Let s(o) = -918o + 29865. Determine s(35). -2265 Let m(x) = 2x3 + 662x*2 - 653x + 3562. Give m(-332). -90 Let f(l) = -3l2 - 129l - 1488. What is f(-26)? -162 Let p(f) = 12f2 - 852f + 14154. What is p(45)? 114 Let x(s) = -2s3 - 191s*2 - 132s - 3511. Calculate x(-95). 4 Let q(p) = 7730p - 37840. Determine q(5). 810 Let x(l) = -l2 - 58l + 583. What is x(9)? -20 Let j(k) = 2k2 - 70249k - 843273. Determine j(-12). 3 Let l(g) = -g*3 + 13g*2 + 320g + 39. Calculate l(-12). -201 Let u(h) = -h*2 - 137h - 2012. Calculate u(-18). 130 Let v(x) = -2x3 + 583x*2 - 235x - 16404. What is v(291)? -108 Let p(b) = 22b2 - 109b + 433. What is p(6)? 571 Let m(j) = 677j2 - 18284j - 134. Calculate m(27). -269 Let d(f) = -f*3 + 37f*2 + 473f - 174. What is d(47)? -33 Let r(c) = -2c3 + 89c*2 + 14685c - 637010. Give r(43). -8 Let i(d) = 14469d - 462982. Give i(32). 26 Let j(g) = -3g*2 - 899g + 10238. Calculate j(11). -14 Let y(p) = -p*2 - 2125p + 58105. Determine y(27). 1 Let n(o) = 104o + 3638. Determine n(-53). -1874 Let y(r) = 3r*3 + 32r*2 - 252r + 21. Determine y(-16). -43 Let d(x) = 119x - 1308. Give d(0). -1308 Let z(v) = -123096v + 861799. What is z(7)? 127 Let o(u) = -17u2 - 764u + 6256. Calculate o(7). 75 Let b(l) = -7640l - 2788594. What is b(-365)? 6 Let z(w) = -9700w + 29650. Determine z(3). 550 Let x(u) = -18560u - 1150744. Calculate x(-62). -24 Let f(p) = p3 - 571p*2 - 133p + 75932. Calculate f(571). -11 Let s(a) = 711a3 + 19a*2 + 952a + 932. Give s(-1). -712 Let o(u) = -43u2 - 14470u - 7403. Give o(-336). -11 Let v(m) = 1910m - 317009. Determine v(166). 51 Let h(i) = -i3 + 19i*2 + 2095i - 37645. Calculate h(18). 389 Let d(v) = -7v2 + 1836v - 67228. What is d(44)? 4 Let v(a) = -163a3 - 443a*2 + 12a - 8. Give v(-3). 370 Let b(z) = 3330616z + 9991821. Calculate b(-3). -27 Let a(m) = 63988m - 4351164. What is a(68)? 20 Let n(d) = -27979d - 1343001. Calculate n(-48). -9 Let p(v) = 8453v + 456412. What is p(-54)? -50 Let t(v) = 3714v + 787476. What is t(-212)? 108 Let q(x) = 5x*2 - 509x + 3327. Give q(7). 9 Let o(h) = 5h2 + 40202h - 160753. Give o(4). 135 Let a(d) = 19d2 + 551d + 5033. What is a(-9)? 1613 Let j(g) = -g*3 - 12g*2 + 289g + 98. What is j(-21)? -2002 Let b(r) = 51r2 - 690r + 10. Give b(0). 10 Let y(b) = -107b + 2899. Give y(28). -97 Let j(m) = 1086m + 62939. Determine j(-58). -49 Let g(o) = -o*3 + 70o*2 - 161o + 1386. What is g(68)? -314 Let f(m) = 137985m + 1241861. Determine f(-9). -4 Let t(v) = 6v*3 - 315v*2 - 2502v + 9. Calculate t(-7). 30 Let n(k) = -102k3 - 43962k*2 - 20k - 8637. Determine n(-431). -17 Let u(i) = -3i2 + 3583i + 87707. Determine u(-24). -13 Let r(t) = -71t2 + 1618t - 2. Determine r(-1). -1691 Let x(c) = -2c3 + 22c*2 - 129c + 49. Give x(7). -462 Let k(z) = -z*2 + 149z + 5834. Determine k(181). 42 Let x(n) = -2n3 + 20n*2 + 89n - 20. Calculate x(13). 123 Let s(j) = -146299j + 2340781. What is s(16)? -3 Let t(y) = 28694y - 61146917. Determine t(2131). -3 Let j(r) = 4r3 - 626r*2 + 915r + 2418. Calculate j(155). 93 Let h(n) = 20592n - 123579. Calculate h(6). -27 Let a(f) = -1434f + 1181. Determine a(1). -253 Let l(n) = 263n + 1696. Give l(-7). -145 Let c(t) = -t3 - 83t*2 + 1563t + 335. What is c(16)? -1 Let b(k) = 39k3 + 3240k*2 + 240k + 248. What is b(-83)? 995 Let a(k) = -15k2 - 487k - 261. What is a(-32)? -37 Let y(o) = 1454o - 433493. What is y(298)? -201 Let r(t) = 516t*2 + 4651t + 54. What is r(-9)? -9 Let d(l) = -3l3 + 165l*2 - 1943l + 179. What is d(38)? -11 Let b(w) = 162w - 1498. What is b(9)? -40 Let p(b) = 7427b - 3572368. Calculate p(481). 19 Let l(b) = -3b2 + 765b - 28663. Calculate l(209). 179 Let f(k) = -5k3 - 51k*2 - 235k + 20. Give f(-5). 545 Let s(y) = -40y2 + 19796y - 97985. Give s(5). -5 Let g(l) = 124l2 + 31514l + 4293. Determine g(-254). -279 Let l(r) = 31r2 - 1106r + 9134. Give l(13). -5 Let i(y) = y*2 + 16874y + 151784. Calculate i(-9). -1 Let v(a) = a*2 - 84a - 274956. Calculate v(-484). -44 Let p(k) = k*2 + 33489k + 368251. Calculate p(-11). -7 Let l(c) = -2c3 - c2 + 33c + 1886. Determine l(0). 1886 Let a(g) = -155g2 - 363g + 361. What is a(1)? -157 Let n(q) = 2q3 + 40q*2 + 1141q + 4964. Determine n(-5). 9 Let g(x) = -181x + 54. Determine g(-9). 1683 Let o(a) = -5a*3 + 23a*2 + 322a + 626. Give o(-3). 2 Let k(j) = -14j3 - 1639j*2 - 121j - 458. What is k(-117)? 10 Let l(z) = z*2 + 27z - 1321. Calculate l(-52). -21 Let a(k) = -2k2 + 336k - 3709. Determine a(12). 35 Let f(p) = -134p2 + 28055p + 17845. Calculate f(210). -5 Let t(g) = 42530g - 126571. Determine t(3). 1019 Let z(j) = -2j*2 + 174138j + 696589. Determine z(-4). 5 Let o(u) = -30u2 + 41u + 233. Give o(-4). -411 Let u(y) = 3y3 - 3885y*2 - 7780y - 2605. Calculate u(1297). -11 Let j(g) = -228g3 + 2g*2 + 15g - 26. Give j(2). -1812 Let x(b) = 716b - 14264. Calculate x(19). -660 Let c(v) = -6293v + 711108. Determine c(113). -1 Let r(l) = -l*2 + 1248l + 534093. Calculate r(-337). -52 Let g(o) = 2o2 + 12905o - 232950. Give g(18). -12 Let q(u) = -20u2 - 317u - 9. What is q(-14)? 509 Let r(b) = -324b2 + 335b + 6. Determine r(1). 17 Let i(b) = 3371b2 - 43796b - 354. Calculate i(13). -3 Let x(m) = m*3 + 42m*2 + 49m + 6041. Determine x(-44). 13 Let b(j) = -j*2 + 655j - 15994. What is b(25)? -244 Let o(c) = -c*3 - 4856c*2 - 19416c - 28. Calculate o(-4). 4 Let f(l) = -223511l + 4470211. Give f(20). -9 Let c(a) = -159903a + 799453. Give c(5). -62 Let p(i) = 7i3 - 82i*2 + 175i - 130. What is p(10)? 420 Let d(l) = -6l3 - 66l*2 - 39l + 33. Determine d(-7). -870 Let b(s) = -110s2 - 9569s - 27678. Calculate b(-3	{ "pile_set_name": "DM Mathematics" }
many millilitres are there in 0.5426488l? 542.6488 How many micrometers are there in thirteen eighths of a millimeter? 1625 What is one sixth of a year in months? 2 What is twenty-one eighths of a kilogram in grams? 2625 How many minutes are there in 3/5 of a week? 6048 What is 31/2 of a litre in millilitres? 15500 What is 90.1312 millennia in centuries? 901.312 How many nanograms are there in 218.6t? 218600000000000000 How many millilitres are there in 15/4 of a litre? 3750 What is 60376.12 millilitres in litres? 60.37612 Convert 366.4711 weeks to nanoseconds. 221641721280000000 What is thirty-three fifths of a microgram in nanograms? 6600 How many millilitres are there in 7/8 of a litre? 875 What is 1/10 of a week in minutes? 1008 How many millennia are there in 7.877547 months? 0.00065646225 What is 362.2107 grams in nanograms? 362210700000 What is fourty-five quarters of a litre in millilitres? 11250 What is 47821.74 kilometers in centimeters? 4782174000 How many millilitres are there in six fifths of a litre? 1200 How many litres are there in 1.549558ml? 0.001549558 What is eighteen fifths of a litre in millilitres? 3600 How many months are there in 45/8 of a decade? 675 What is 3/10 of a kilometer in centimeters? 30000 What is twenty-nine halves of a second in milliseconds? 14500 What is 5/24 of a minute in milliseconds? 12500 What is 1220.665 nanograms in milligrams? 0.001220665 How many seconds are there in 0.0349758 hours? 125.91288 Convert 2.636237um to centimeters. 0.0002636237 What is 0.4732376 millimeters in micrometers? 473.2376 How many months are there in 3/5 of a decade? 72 How many micrograms are there in eighteen fifths of a milligram? 3600 Convert 724.5108l to millilitres. 724510.8 Convert 57.17773 days to seconds. 4940155.872 What is 8.261134l in millilitres? 8261.134 What is three eighths of a litre in millilitres? 375 How many meters are there in 6/25 of a kilometer? 240 What is eleven halves of a meter in millimeters? 5500 How many millilitres are there in 929143.3l? 929143300 Convert 83882.86m to micrometers. 83882860000 What is 21/5 of a microgram in nanograms? 4200 What is 0.1816717 days in hours? 4.3601208 What is 6/25 of a kilometer in meters? 240 Convert 17.2634 milligrams to grams. 0.0172634 How many nanograms are there in 50.66523kg? 50665230000000 What is one tenth of a gram in milligrams? 100 How many millilitres are there in six fifths of a litre? 1200 What is one tenth of a litre in millilitres? 100 How many millilitres are there in one tenth of a litre? 100 What is 3.565312 years in millennia? 0.003565312 How many months are there in 1/4 of a millennium? 3000 Convert 45894.29 grams to kilograms. 45.89429 Convert 0.290939ml to litres. 0.000290939 What is 25.437918 months in years? 2.1198265 What is 3.335569kg in nanograms? 3335569000000 What is 57.38646 kilometers in nanometers? 57386460000000 Convert 40.8159 months to millennia. 0.003401325 What is 5.598019 centimeters in kilometers? 0.00005598019 How many decades are there in 46/5 of a century? 92 Convert 271141.9 decades to years. 2711419 What is 752.1237 millilitres in litres? 0.7521237 How many months are there in 4/3 of a year? 16 How many months are there in 352.084 decades? 42250.08 What is eleven quarters of a litre in millilitres? 2750 How many millilitres are there in one twentieth of a litre? 50 How many micrograms are there in 54.37867 milligrams? 54378.67 How many kilometers are there in 34.77955 millimeters? 0.00003477955 How many months are there in 83541.72 decades? 10025006.4 Convert 6.74979 nanograms to grams. 0.00000000674979 What is twenty-five quarters of a centimeter in micrometers? 62500 How many kilograms are there in 7/4 of a tonne? 1750 How many nanometers are there in 9860.4km? 9860400000000000 How many hours are there in 4/3 of a week? 224 How many seconds are there in 6/25 of a day? 20736 What is 7731.922 nanometers in micrometers? 7.731922 How many nanoseconds are there in 78292.09 weeks? 47351056032000000000 How many micrometers are there in 1.12434nm? 0.00112434 What is 60878.2 nanograms in grams? 0.0000608782 Convert 0.0746479mm to nanometers. 74647.9 What is one fifth of a centimeter in millimeters? 2 What is 71688.1l in millilitres? 71688100 What is sixty-four fifths of a millennium in centuries? 128 How many millennia are there in 0.4975236 centuries? 0.04975236 How many kilograms are there in 48.38034mg? 0.00004838034 Convert 8.805071 micrograms to kilograms. 0.000000008805071 What is three eighths of a litre in millilitres? 375 What is 0.8451144 millilitres in litres? 0.0008451144 What is one twentieth of a century in years? 5 What is 7.510693 weeks in days? 52.574851 What is 0.9827572ug in tonnes? 0.0000000000009827572 Convert 6.073309mg to grams. 0.006073309 What is 0.6478458 millilitres in litres? 0.0006478458 What is 56589.97 millilitres in litres? 56.58997 How many milligrams are there in 1/5 of a gram? 200 What is 27/2 of a tonne in kilograms? 13500 What is 1780.6653 months in millennia? 0.148388775 What is 75271.44 millilitres in litres? 75.27144 Convert 79.69293g to kilograms. 0.07969293 How many microseconds are there in twenty-one eighths of a millisecond? 2625 What is 3/25 of a kilogram in grams? 120 How many decades are there in twenty-six fifths of a century? 52 What is 6/5 of a tonne in kilograms? 1200 How many grams are there in 13.40511t? 13405110 How many grams are there in 27/2 of a kilogram? 13500 How many millilitres are there in 740.6445 litres? 740644.5 What is 2192.48 hours in minutes? 131548.8 How many millilitres are there in 7.081637l? 7081.637 How many nanoseconds are there in one quarter of a microsecond? 250 What is 6.540844 millilitres in litres? 0.006540844 How many years are there in five quarters of a millennium? 1250 How many grams are there in 4.29437 nanograms? 0.00000000429437 How many centuries are there in 757077.8 millennia? 7570778 How many grams are there in twenty-one quarters of a kilogram? 5250 How many months are there in 74847.82 centuries? 89817384 How many months are there in four fifteenths of a decade? 32 How many years are there in 53/5 of a decade? 106 What is 0.980224ug in nanograms? 980.224 What is 43/4 of a meter in millimeters? 10750 How many micrograms are there in 8.06335kg? 8063350000 What is 3/40 of a litre in millilitres? 75 What is 0.0933246ng in grams? 0.0000000000933246 How many millilitres are there in twenty-five halves of a litre? 12500 How many months are there in one quarter of a millennium? 3000 What is 4058.115 kilometers in nanometers? 4058115000000000 What is 7/2 of a century in years? 350 How many centuries are there in 111771.8 decades? 11177.18 How many years are there in 373557.7 millennia? 373557700 Convert 87196.62 millilitres to litres. 87.19662 How many nanograms are there in five eighths of a microgram? 625 How many micrometers are there in 11/4 of a centimeter? 27500 How many litres are there in 31203.6 millilitres? 31.2036 What is 814332.2 kilometers in nanometers? 814332200000000000 How many micrometers are there in 5.255008mm? 5255.008 Convert 8.20322 milliseconds to microseconds. 8203.22 How many milligrams are there in 9/10 of a gram? 900 How many hours are there in 0.7097255 weeks? 119.233884 What is 27/5 of a litre in millilitres? 5400 Convert 2033.16 millennia to decades. 203316 What is 8.754847l in millilitres? 8754.847 What is 7/2 of a micrometer in nanometers? 3500 How many litres are there in 9.17313 millilitres? 0.00917313 How many centimeters are there in 17/2 of a meter? 850 How many months are there in seven halves of a millennium? 42000 What is 3/8 of a litre in millilitres? 375 Convert 707450.2 nanometers to millimeters. 0.7074502 How many litres are there in 0.0579985 millilitres? 0.0000579985 What is fifty-two thirds of a decade in months? 2080 What is 6/5 of a microgram in nanograms? 1200 What is 5761.728ml in litres? 5.761728 What is 6510.06 litres in millilitres? 6510060 How many micrometers are there in 0.4647672m? 464767.2 How many nanograms are there in 11/4 of a microgram? 2750 What is 5/4 of a litre in millilitres? 1250 What is 22.0943322 seconds in days? 0.0002557214375 How many millilitres are there in	{ "pile_set_name": "DM Mathematics" }
e (-9 - -12) + 3 + -11. -5 -5 + 1 + 4 + (-8 - -7) -1 What is -1 - (2 + 0 + 16 + -17)? -2 Evaluate -6 + (-1 - 0 - (-9 - -3)). -1 -2 - (-3 + (4 - 5)) 2 What is the value of (-2 - 2) + (3 - 0) + 4? 3 Evaluate (-3 - (0 + -2)) + -4. -5 -1 + (-6 - -7) + -1 + -1 -2 What is the value of -2 - -4 - (1 + -2 + 1)? 2 What is (-1 - 5) + (7 - 0)? 1 (-1 - 3) + 1 - (34 - 35) -2 What is the value of 4 + 2 + (-15 - -12) - 12? -9 What is (-2 - -2 - 8) + (0 - -3)? -5 Evaluate -13 - -25 - (24 + -1). -11 What is the value of 20 + -6 + -8 + (-12 - -2)? -4 What is -7 - (-9 - -12 - 10)? 0 (13 - 9 - (1 - 1)) + -3 1 Calculate 2 + -4 - (-1 - -1). -2 0 - (-10 - -1 - -8) 1 What is the value of -8 - (7 + -8) - (1 + -10)? 2 What is the value of -4 + 5 + 0 + -4? -3 Evaluate 10 - (0 + (-2 - -6)) - 9. -3 Calculate 1 - (1 + -5 - -10). -5 Calculate (2 - 1) + 1 - (18 - 21). 5 What is 2 + (1 - (-3 - (-5 - 0)))? 1 Calculate 0 + -4 - (-11 + (3 - -7)). -3 What is the value of 9 + -18 - -14 - (4 + 1)? 0 Evaluate (-1 - 3) + -22 + 25. -1 What is 4 - (4 - 4) - 5? -1 Calculate 4 + 1 + (3 - 2) + -3. 3 0 + -8 + 1 + 9 2 -1 - (-6 + 2) - (-82 + 88) -3 Calculate (-6 - -5) + (5 - 0) + 0. 4 What is the value of -9 + -8 + (13 - 3)? -7 What is the value of -1 + (-5 - 0) + 6 + -6? -6 What is 4 - (6 - 4 - 1) - 2? 1 -4 + (-10 - -8 - -1) -5 (-8 - (2 - 1)) + 1 - -3 -5 What is the value of -5 - (-1 + 4 + 3 + -6)? -5 26 - 29 - (-2 - -1) - 1 -3 What is the value of (-2 - 3) + 0 + 2? -3 Calculate 5 - (-3 - -2) - 2. 4 What is the value of -7 - (2 + -3 - 11)? 5 4 - (0 + (-5 + 4 - -6)) -1 Calculate (-1 - 1) + 3 - (-8 + 4). 5 What is (5 - (1 + 7)) + 4 + -5? -4 Evaluate 13 - (-5 + 4 - -8) - -4. 10 Calculate 4 - (1 - 5 - -3). 5 -6 + 2 - ((-6 - -2) + -1) 1 -2 - -2 - -7 - (7 + 7) -7 What is the value of -8 + 17 + -12 - -1? -2 7 - (-4 + -4 + 20) -5 Calculate (15 - 15) + (0 - -5). 5 (-8 - (7 + -9)) + -2 -8 Evaluate 11 + -8 + 2 + -6. -1 Evaluate -5 + (-7 - -3) + 14 - 1. 4 Evaluate -8 - -2 - (-34 - -29). -1 -2 + 0 - 2 - -2 - 2 -4 What is -13 + (-2 - -2 - -9)? -4 What is (-1 - 2) + (-5 - -9) + -2? -1 What is the value of 24 + -19 + 0 + -1? 4 Calculate 4 - 4 - (4 - 2 - -3). -5 Calculate (-3 - 0) + (-6 - -11 - 4). -2 What is (8 - 10) + 0 + 0 + -5? -7 Evaluate ((1 - -1) + 7 - 1) + -3. 5 What is 2 + -25 + 30 + 1 + -4? 4 Calculate 1 + -11 + 41 + -28. 3 Calculate -30 + 25 + -2 + 10 - -1. 4 Calculate (-4 - -7 - -1) + -1. 3 Calculate -2 - 0 - (-1 - 1). 0 (-1 - -2 - 2) + (-35 - -33) -3 What is the value of -5 + -2 + 0 + -1 + 1? -7 What is the value of -1 - (-3 + 2) - -4? 4 Calculate 7 - 10 - 1 - (4 - 7). -1 -1 - 1 - (5 - 3 - -1) -5 What is the value of 1 - (-1 + -6 + 12)? -4 (-1 - 3 - -9) + -1 4 What is the value of 2 - ((-6 - -4) + 0)? 4 Evaluate -7 + (-1 + 0 - -3) + 0. -5 Evaluate 3 - 1 - (0 + -2). 4 Calculate -1 + (15 + -7 - 9). -2 What is the value of 1 - 2 - (10 + -10)? -1 Calculate -6 + 5 + -11 + 6 + 4. -2 Evaluate -2 - (-4 - -5 - (1 + -3)). -5 What is -2 + 2 + 4 + (-1 - 1)? 2 Evaluate -6 - ((0 - 4) + 2). -4 Evaluate (2 - (0 + 0)) + -9. -7 Calculate -3 - -5 - (-6 + 3 - -3). 2 -18 + 1 + (6 - 1) + 6 -6 What is the value of 5 + 7 + (-11 - -1)? 2 0 + (3 - (-3 + 2)) + -11 -7 4 - (-2 + -6 + 1 + 6) 5 Evaluate 3 - (10 - 0 - 2). -5 What is the value of -3 + -3 + 13 + -7? 0 Evaluate (-18 - -8) + 4 + 0. -6 What is the value of -7 + (-9 - -9 - -5)? -2 What is -1 + (-2 - -1) - (-248 - -245)? 1 What is -8 - (1 + (0 - 11))? 2 -6 - -10 - (-2 + 2) 4 Calculate -13 - -7 - 1 - -9. 2 What is 106 + -101 - (-1 - -2)? 4 What is (11 - 1) + -40 + 36? 6 Evaluate 4 - (6 + (0 - 3)). 1 Evaluate -10 + 6 + (-9 - -12). -1 Calculate (-4 - 4 - -7) + -1 + 5. 3 What is 7 + -14 - (-1 - 5)? -1 What is -2 + -2 - (4 - 4)? -4 Evaluate 2 - (0 - (5 + -6)). 1 (0 - 1) + (-25 - -22) -4 Calculate 2 + 0 + 25 + -21. 6 What is the value of 8 + -11 + -4 + 2? -5 What is the value of -7 + (15 + -7 - 4)? -3 47 + -50 + 2 + 0 -1 Evaluate 9 - ((-7 - -7) + 3). 6 Evaluate 0 + (-1 - 5) + 2. -4 Evaluate (-2 + 0 - 1) + 11 + -13. -5 Calculate -1 + 6 + (0 - 14 - -4). -5 What is the value of (-2 - 2) + -6 + (10 - 5)? -5 What is 3 + -10 + 2 + (14 - 8)? 1 Evaluate -4 - -5 - (2 - -3). -4 What is the value of (0 - (-1 - 3)) + (-2 - 2)? 0 What is the value of -3 + (-13 + 14 - -1)? -1 3 - (-6 - -5 - (1 + -4)) 1 Evaluate 5 - -9 - 5 - 10. -1 What is (-5 - -2 - 1 - -5) + -3? -2 What is the value of -3 + (0 - 4) + 4? -3 Evaluate 2 - (-1 + 4 - 4). 3 (-2 - 3) + 4 - -2 1 What is 1 - ((-3 - 4) + 4) - -1? 5 What is the value of 6 + 0 + -2 - (-5 - -14)? -5 What is the value of -3 - -4 - (-5 - -2) - 0? 4 (-3 - -1) + (4 - (11 + -4)) -5 Calculate 0 + (1 - (-4 + 0 - -6)). -1 What is -3 + -4 + 2 - 0? -5 What is -11 + 11 + -3 + 6? 3 What is 10 + (-8 - -14 - 10)? 6 What is 7 - (-3 - -7 - -7)? -4 (6 - (1 + 2)) + -8 -5 What is -2 - -1 - (-9 + 7)? 1 What is the value of 2 - (0 - (0 + -3))? -1 Calculate 12 - 17 - (-2 + -3). 0 Calculate -3 + -2 + (5 - (-4 + 8)). -4 Calculate -7 + 1 + (159 - 159). -6 Calculate (-2 - -4) + -4 + -1. -3 What is the value of (-6 - -4) + -2 + 1 + 2? -1 Calculate -2 + (1 + 2 - 3). -2 Calculate 3 + (-9 - -2) + 11. 7 What is the value of 3 + -8 - (1 + -3)? -3 -6 + 0 - (16 + 1 - 20) -3 What is the value of -9 + 12 - (-1 + -2)? 6 What is -1 - (-1 - -10 - 8)? -2 Evaluate -2 - ((-2 - 1) + -3). 4 3 + (5 + -3 + -4 - -2) 3 Calculate -3 - (8 + -12 - -9) - -2. -6 0 + (-16 - -8) + 1 -7 Calculate 39 - 35 - (1 - (-13 + 2)). -8 What is the value of 1 + -4 - (-3 + 1)? -1 Calculate 4 + (-1 - (-9 + 13)). -1 What is 3 - 11 - (-6 + 3)? -5 Calculate 1 + -3 + (4 + -7 - -9). 4 Calculate (3 - (-1 + (-3 - -7))) + -5. -5 3 + (0 - 1) + 16 + -22 -4 1 - 2 - (-12 + 10) 1 Calculate 4 - (-3 + (5 - 2) + 3). 1 0 - (-8 + (3 - -2)) - -3 6 What is 2 + 2 + (0 - -2 - 1)? 5 What is 5 + (-6 - (-1 - 1)) + 3? 4 Calculate 7 + 1 + -7 - 7. -6 What is the value of -2 - (-1 - (-1 + 0 + -1))? -3 Evaluate -6 + -7 + 12 + 0. -1 Calculate 1 + (0 - (-1 - -4)). -2 Calculate 10 + (-15 - -8) - (-2 - -11). -6 What is the value of 7 - (3 - -1) - (-1 + -1)? 5 What is 1 + 0 + 0 + 3? 4 What is the value of -2 + 2 + -8 + 7 + 2? 1 What is the value of -3 + 3 - (6 - 8)? 2 (-18 - -14) + (-1 - (-3 + 0)) -2 Evaluate -10 - (-1 + -5 + 1) - -4. -1 What is the value of -2 + -2 + (5 + 0 - 2)? -1 Calculate 0 + ((-1 - -2) + 0 - -3). 4 What is (-2 - -5) + -1 + -2? 0 Calculate 8 + (-6 - 3 - -5) + 0. 4 What is 3 + (26 - 26) + (-1 - 4)? -2 Calculate (-12 - (-7 + (-4 - -5))) + 3. -3 What is -2 - (-11 - (-3 + -3))? 3 (13 - 25 - -12) + 6 + -1 5 What is 1 - 9 - (-112 + 98)? 6 (-1 - 0 - -5) + 0 4 Calculate 3 - (1 - (-7 + 5 - -5)). 5 6 - (-2 + 5 + (0 - -1)) 2 What is the value of 3 + -2 + 2 + -5? -2 What is the value of -9 - -19 - (-2 + 7)? 5 Evaluate -3 + 2 + (-3 - -5). 1 -12 - -12 - (4 + 0) -4 12 - 13 - (0 - -4) -5 (2 - 2) + -8 + 4 + 5 1 Evaluate (1 - 1) + (25 - 24). 1 What is (7 - (16 + -15)) + -1 + -3? 2 Evaluate -2 - (11 + -16) - 7. -4 Evaluate 5 - (-7 - 0 - (-6 - 7)). -1 -2 + ((0 - 2) + 5 - -1) 2 (2 - (4 + -7)) + -6 -1 Evaluate -2 + -2 + (-6 + 9 - 1). -2 What is the value of -1 + 1 + (11 - 23 - -10)? -2 What is the value of (-3 - (1 - (-4 - -5))) + 2? -1 What is the value of -2 - (-1 - 0) - (-1 + -1)? 1 -2 + -1 + (9 - 7) -1 Evaluate 11 - 11 - 4 - (-1 - -3). -6 What is -5 + (-2 - (0 - (0 - -2)))? -5 Evaluate (5 - 6) + 3 + -6. -4 What is -2 + -4 + 6 + -3 + -1? -4 Calculate -4 + (0 - -5) + -6. -5 Calculate (-4 + 3 + 0 - -3) + -2. 0 What is (0 + -6 - -3) + 6? 3 Calculate 1 + -3 - ((1 - -4) + -11). 4 Calculate 0 - -1 - (4 + 20 + -18). -5 4 + (0 - (4 - 0)) + 2 2 Calculate 2 + 0 + -1 + (-17 - -16). 0 Evaluate -1 + 1 + 2 + (7 - 4). 5 Calculate -1 + (-4 - (-2 - -1)) + 5. 1 -1 - (6 + -2 - 3) - -6 4 What is the value of 2 - ((-2 - 2) + 1)? 5 -4 + -4 + -2 + 14 4 (-2 - -12) + (5 - 13) 2 Evaluate -5 + (-1 - (5 + -1 - 11)). 1 What is 3 + (0 - (-2 - 3 - -4))? 4 What is the value of -2 + (-4 - 0 - (5 + -12))? 1 (-1 - -8) + 0 + (-6 - -4) 5 Evaluate 4 + -1 + -2 + 2. 3 Calculate -3 + 2 + -1 - (2 - -1). -5 2 - -4 - (0 - -5) 1 What is the value of (8 - (-9 - -24)) + 2? -5 -30 + 14 - -17 - (-6 - -1) 6 1 - -6 - (7 - 0) 0 What is (-6 - -2) + (3 - -1)? 0 Evaluate 0 + (-5 - (-1 + -10 - -1)). 5 What is the value of -8 + 9 + -2 + -1 - -3? 1 (2 - -11) + (-12 - -2) 3 -7 - 0 - (-22 - -19) -4 Wh	{ "pile_set_name": "DM Mathematics" }
-9f3 Let g(p) = 6p - 7. Let x be -1(-3)/6-10. Let w(y) be the second derivative of 7y3/6 - 4y*2 - 3y. What is xw(j) + 6g(j)? j - 2 Let t(l) = -5l + 4. Let n(a) = -1. Calculate -20n(i) - 5t(i). 25i Let d(c) = 15c3 - 9c*2 - 9c + 9. Let p(q) = 8q3 - 5q*2 - 5q + 5. Suppose 4n + 45 = -n. Calculate np(y) + 5d(y). 3y*3 Suppose -3u + 18 = -6u. Let h(m) = 6 + 2m - 4m3 - 9m + 2m2 + 3m*2. Let z(n) = -5n*3 + 6n*2 - 8n + 7. Give uz(b) + 7h(b). 2b3 - b2 - b Let j(x) = -2x*3 + 7x*2 - 3x + 2. Let a(f) = 5f3 - 15f*2 + 7f - 4. Calculate 3a(w) + 7j(w). w*3 + 4w2 + 2 Let b(u) = u3 - u*2 - u - 1. Let v(h) = -5h*3 + 2h*2 + 2h - 1. Calculate -2b(t) - v(t). 3t*3 + 3 Let y(l) = 4l3 - l2 + 5l - 4. Let s(v) = 5v3 - v2 + 6v - 5. Give 5s(w) - 6y(w). w3 + w2 - 1 Let x(j) = j3 + 9j*2 - 2j. Let l(c) = -5c3 - 36c*2 + 9c. Give 4l(t) + 18x(t). -2t3 + 18t2 Let q(i) = i2 - 2i - 5. Let v(l) be the first derivative of -l - 13. Calculate -q(z) + 3v(z). -z*2 + 2z + 2 Let k(t) = -t - 3t - 7 + 0t. Let l(y) = -5y - 8. Let q(r) = r2 + 7r - 10. Let f be q(-7). Let s be -1 + f3/6. Determine sk(z) + 5l(z). -z + 2 Let x(d) = d + 2. Let c(m) = m - m + m + 0. Suppose -s + 5p = -4, 3s - p + 5p + 7 = 0. Suppose 2o + 2 = 6, 5w + 3o - 1 = 0. What is sx(u) + wc(u)? -2u - 2 Let k(a) = -a*2. Let i(n) = -5n*2 + n. Determine i(m) - 3k(m). -2m2 + m Let u(c) be the first derivative of c + 0c*2 - 2 - 1/3c*3. Let h = -1 + -1. Let d(l) = -4l*2 + 2. Give hd(m) + 6u(m). 2m*2 + 2 Let w(v) = 3v*2 - 2v - 5. Let c(o) = o + 1. Determine -2c(j) - w(j). -3j*2 + 3 Let m(f) be the third derivative of 1/24f*4 - 3f*2 + 0 + 0f + 0f3. Let g(u) = u2 + u. Let a be (2/6)/(1/3). Give am(x) + g(x). x*2 + 2x Suppose 0 = 4t, s - t = -4t - 5. Let l(g) = -3g3. Let v(m) = -2m*3. What is sv(h) + 4l(h)? -2h*3 Let a(z) = -4z - 4. Let x(t) = t + 1. Suppose -2l - 19 = -21. Determine la(g) + 3x(g). -g - 1 Let r(w) = w. Let k(p) = 45p. What is -k(f) + 6r(f)? -39f Let w(f) = -9f3 + 5f*2 + 5f - 5. Let m(y) = -y3 - y2 - y + 1. Give -5m(j) - w(j). 14j*3 Let h(a) = -20a*2 + 2a. Let k(p) = p*2 - p. Determine h(x) + 2k(x). -18x2 Let w(q) = -2079q*2 - 81q. Let h(z) = -52z2 - 2z. Calculate 81h(n) - 2w(n). -54n2 Let s(b) = -b3 + 5. Let t(f) = -f. Let i(x) = -4x - 1. Let r(m) = 2i(m) - 7t(m). Let w be r(4). Let n(q) = q*3 - 7 + 5 - 4. Determine ws(a) - 5n(a). a3 Let d(c) be the second derivative of -c3/3 + c2 - 35c. Let r(x) = -x + 1. What is 2d(u) - 6r(u)? 2u - 2 Let x(a) = -2a - 3. Let n(v) = -v + 15. Let y(k) = -7. Suppose 0 = -3w - 0w + 9. Let q(z) = wn(z) + 7y(z). Determine -3q(s) + 4x(s). s Let w(u) = 2u - 23. Let y(a) = 2a - 23. Give 4w(s) - 3y(s). 2s - 23 Let n(s) = -9s*2 - 2s + 2. Let c(t) = 10t2 + 3t - 3. Give -2c(d) - 3n(d). 7d2 Let d be 4 + -4 + 12. Let s(b) = -b - 4. Let r(t) = t + 5. Calculate dr(j) + 3s(j). -j - 2 Let o(h) be the second derivative of h3 + h2/2 + h. Let u(b) = -5b - 1. Let f = -19 + 23. Give fo(j) + 5u(j). -j - 1 Let o(x) = x2 - x. Suppose 2 = -m - 3v + 14, -5m = -2v - 26. Let t be (-14)/10 - m/(-15). Let a(z) = -z*3 + 2z*2 - 6z. Give ta(p) + 4o(p). p*3 + 2p*2 + 2p Let z(g) = 3g3 - 5g - 5. Let u(n) = -n*3 + 2n + 2. Suppose -3y + 10 = -5y - a, -18 = 4y + 3a. Give yz(r) - 15u(r). -3r3 Let g(q) = 3q - 1. Let d(l) = -12l + 5. Suppose -5t + 0 = 45. Calculate tg(o) - 2d(o). -3o - 1 Let s(m) = 7m - 9. Let f(q) = -q*2 + 9q. Let c be f(5). Suppose y + 3y - c = 0. Let x be ((-4)/(-6))/(8/(-24)). Let k(v) = 3v - 4. Give xs(r) + yk(r). r - 2 Let x = -2 + 9. Let j(y) be the first derivative of -5y2/2 - y + 2. Suppose -t + 13 = -2n, -4n + 4t - 4 = 24. Let u(m) = -4m - 1. Give nj(k) + xu(k). 2k - 1 Let q(t) = 31t. Let s(g) = 15g. Determine -3q(j) + 5s(j). -18j Let k(n) be the first derivative of 3n*4 - 10n*3/3 + 5n2 - 15. Let l(r) = -r3 + r*2 - r. Let s = 22 - 32. Determine sl(q) - k(q). -2q3 Let b(x) = -x - 1. Let i(m) = -14m - 4. Calculate 2b(k) - i(k). 12k + 2 Let k(g) = g*3 + 2g2 - 1. Let v(n) = n3 + n*2 - 1. Suppose 8y - 35 = 5. Calculate yv(i) - 3k(i). 2i3 - i2 - 2 Let a(y) = -2y*3 - 7y*2 + 6y + 9. Suppose 8w = 13w - 15. Let s(d) = d*3 + 3d*2 - 3d - 4. Give wa(j) + 7s(j). j*3 - 3j - 1 Let q = -14 - -8. Let z(n) = -n*2 - n - 5. Let m(j) be the first derivative of -j + 25. What is qm(c) + z(c)? -c2 - c + 1 Let t(f) = f3 - 6f2 + 8f + 6. Let n(d) = -3d3 + 11d*2 - 15d - 11. Give -6n(c) - 11t(c). 7c3 + 2c Let l(i) = 5i3 - 15i*2 - 15i. Let q(u) = -u3 + u2 + u. Give l(m) + 15q(m). -10m3 Let l(u) be the second derivative of -u5/10 - u*4/3 + 2u*3/3 + 2u*2 + 4u. Suppose -d + 2 = 3. Let x(i) = i*2 - i - 1. Determine dl(v) - 4x(v). 2v*3 Let k(f) = 336f - 49. Let r(o) = 14o - 2. What is -2k(c) + 49r(c)? 14c Let k(a) = 4a2 + 3. Let m(o) = -2o2 - 2. Let z(f) = f3 + 2f2 + 6. Let h be z(-3). Calculate hk(b) - 5m(b). -2b2 + 1 Let u(a) = -a2 - 4a + 9. Let x(z) = 2z*2 + 6z - 14. Determine -8u(o) - 5x(o). -2o2 + 2o - 2 Let p(t) = t*2. Let r(m) = -12m*2 - 3m. Let u(y) = 4y2 + y. Let f(l) = 4r(l) + 11u(l). Give -f(q) - p(q). 3q*2 + q Let o(b) = 3b - 8. Let r(x) = 8x - 23. Let a(y) = 17o(y) - 6r(y). Let g(k) = -5k - 3. Calculate -7a(u) - 4g(u). -u - 2 Let i(v) = -5v3 + 8v*2 + 12v - 11. Let j(s) = 2s3 - 3s*2 - 4s + 4. Determine 4i(g) + 11j(g). 2g3 - g2 + 4g Let x(v) = 8v. Let b(q) = -209q. Calculate -3b(c) - 77x(c). 11c Let f(o) = -o. Let s(j) be the second derivative of -j3/2 - j2/2 + 2j. What is -5f(r) + 2s(r)? -r - 2 Let a(d) = 2d - 1. Let y = -3 + 6. Suppose -3r - 4 = 5u - 19, 9 = yu + 5r. Let b(l) = l - 1. Give ub(s) - a(s). s - 2 Let t(r) = -r - 3. Let j(a) = a*3 + 8a*2 - 9a + 3. Let b be j(-9). Let w(q) = 1. Give bw(k) + t(k). -k Let y(i) = i3 + 4i*2 - 6i - 8. Let f be y(-5). Let p(h) = -h + 3. Let w(m) = -1. Give fw(g) - p(g). g Let z(u) = 7u + 6. Let d(t) = -20t - 18. What is 4d(x) + 11z(x)? -3x - 6 Let k(t) = 5t2 + 7t + 5. Let f(n) = 2n2 + 3n + 2. Suppose -x + 4 = -0. Give xk(g) - 9f(g). 2g2 + g + 2 Let q(o) be the third derivative of -o4/24 + 5o*3/6 + 2o*2. Let d(y) = y - 4. Let b be (-1 - 3)(-1 + 0). Give bq(z) + 5d(z). z Let v(r) = r + 1. Let c(y) = 4y2 + 3y - 1. Give c(d) + v(d). 4d2 + 4d Let p(r) = 3r2 + 1. Let a(o) = 9o*2 + 3. What is 4a(h) - 11p(h)? 3h*2 + 1 Let w(k) = -5k - 3k + 2k + 4k. Let z(r) = -5r. Determine 14w(x) - 6z(x). 2x Let i(y) = 19y + 1. Let z(j) = 38j + 1. What is -5i(s) + 3z(s)? 19s - 2 Let f be 6/2(-13 + 14). Suppose 3d - f + 9 = 3q, -4d = -4. Let w(u) = 3u - 1. Let a(l) = 4l - 1. Determine qw(h) - 2a(h). h - 1 Let i(g) = -2g3 - g2 + 4g - 2. Let c(w) = -2w3 - w2 + 3w - 2. What is -4c(a) + 3i(a)? 2a3 + a2 + 2 Let h(y) = -y3 - y2 - 2y. Suppose -1 - 3 = -2j. Suppose 4x - 4n = 0, 2n = 5x - jn - 2. Let b(u) = -4u3 - 4u*2 - 9u. Determine xb(a) - 9h(a). a3 + a2 Let w(y) = -5y3 + 3y*2 + 4y - 3. Let c(r) = -4r3 + 2r*2 + 3r - 2. Give -4c(d) + 3w(d). d3 + d2 - 1 Let o be 21 - 0/12. Let i(n) = o + 3 - n - 2 - 2. Let u(l) = 5l - 3. Give 3i(b) + u(b). 2b Let q(s) = -2s3 + 20s*2 - 6s - 4. Let c(n) = 3n3 - 20n*2 + 7n + 5. Give -4c(a) - 5q(a). -2a3 - 20a*2 + 2a Let v(f) = f - 6. Let j(n) = -2n + 19. Calculate 3j(l) + 8v(l). 2l + 9 Let s(u) = -5u - 4. Let p(n) = 35n + 5. Let y(t) = 17t + 3. Let c(x) = 6p(x) - 13y(x). Give 4c(w) - 9s(w). w Let r(i) = -9i*2 - 3i - 9. Let c(y) = 2y + 23y2 - y2 + 22 + 6y. Calculate 5c(t) + 12r(t). 2t*2 + 4t + 2 Let a(k) = 5k - 7. Let i(m) = 0m*3 - 4m - 2 + m*3 - 1. Let s be ((-4)/7)/((-48)/(-168)). Let x be i(s). Let c(n) = 2n - 3. Give xa(p) + 7c(p). -p Let u(r) = 16r + 1. Let l(i) = 3i. Calculate 22l(n) - 4u(n). 2n - 4 Let z(x) = x3 + x. Let l(u) = u3 - u2 + 4u. Determine l(d) -	{ "pile_set_name": "DM Mathematics" }
biggest value? (a) 1 (b) i (c) m b Let n be ((-596)/(-12))/((-2)/6). Let w = n - -599/4. Let y = 13/2 + -7. What is the smallest value in w, y, 1/8? y Let f = -2 - -2.07. Let u = 16 - 15.57. Let t = u + f. Which is the smallest value? (a) -3 (b) -4/3 (c) t a Let v = -9.08 - -0.08. Let z = v + 8.94. Let o = z + -0.04. What is the third biggest value in o, 0, 2? o Let d(t) = t*3 + 11t*2 - t - 13. Let x be d(-11). Let o be (2/26)/(x/(-4)). Which is the third smallest value? (a) -0.5 (b) o (c) -2 b Let l = -16.009 - -0.009. Let m = l + 14. Which is the third smallest value? (a) 1 (b) -0.2 (c) m (d) -0.5 b Let l = 403 - 3227/8. What is the second smallest value in 0, 0.032, l? 0 Let r be 19/39 - 1/(3 + -1). Let u = r - 23/78. Which is the biggest value? (a) 5 (b) u (c) -1/6 a Let s be ((24/9)/(-4))/(2/66). Let c = s - -35. Let d = 505/4 - 127. What is the second smallest value in c, d, 0.5? 0.5 Let s = -535 + 531. Which is the biggest value? (a) 3/4 (b) 51 (c) s b Let s = 6.8 - 0.3. Let h = s - 1.5. Which is the smallest value? (a) -2 (b) 5/2 (c) h a Let c = -19.2 - 0.8. Let m = c + 19.7. Let a be (-5)/11 + 0 - -1. What is the smallest value in a, m, 2? m Let z = -2/731 + 1488/9503. Which is the second smallest value? (a) z (b) 0.03 (c) 5 (d) -0.4 b Let g = -207.2 - -207. Let q = 6.7 - -0.3. What is the biggest value in 3, q, g? q Suppose -5s = r + 8, -4 = -s - 4s + 3r. Let l = 0.2504 - -0.0496. What is the second smallest value in 6/11, l, s? l Let r be (12 - 18)(-1)/45. Which is the fourth smallest value? (a) -1 (b) -4 (c) 39 (d) r c Let q = 38.23 - -0.77. Let f = q - 39. Which is the third smallest value? (a) f (b) 1/7 (c) -0.4 b Let q = 501 - 494. What is the smallest value in -0.3, 5, q? -0.3 Let m = 6/29 - 99/58. Let l = -0.12 - -0.19. Let j = l + -0.17. What is the second smallest value in -19, m, j? m Let n be (4/(-42))/((-5)/15). Let a be (-147)/(-74) + (0 - 2). Let d = -151/222 - a. What is the third smallest value in n, -1/3, d? n Let x = 2.49 - 2.19. Which is the third biggest value? (a) 1/2 (b) -4 (c) -0.5 (d) x c Let m = 8417 - 252541/30. Let d = -3/10 + m. What is the smallest value in -1, d, -2/9? d Suppose -10 = 3o + 3t - 4, 5t = -15. Which is the third biggest value? (a) o (b) -1 (c) -5 (d) -2/13 b Suppose 4z - 4 = 2q, -3q - 2z + 2 = 40. Let c be 1/(-3) - 272/30. Let n = c - q. What is the second smallest value in n, 4, 0.1? n Let k = -11.5 + 57.5. What is the fourth biggest value in 1, 0, -5, k? -5 Let i be 5 - (-2 - (3 - (-3 - -9))). Suppose -5z + 18 = -0s + 4s, -is = -4z. Which is the second smallest value? (a) -2/11 (b) -5 (c) s a Let f = 41.5 - 42. Suppose -2k = 3r - 342, 6r - 2r = 3k - 513. Let o be 2 - (-3 - k/(-33)). Which is the third biggest value? (a) f (b) 0.3 (c) o a Let j = -4 - 1. Let v be (-2)/4(-9)/(-36). What is the second biggest value in v, -2, 4, j? v Let i be (2/(-3))/(2/(-6)). Let o be 6184/30 - 2/(-10). Suppose -5d = 12 - o. Which is the second smallest value? (a) d (b) i (c) -0.1 b Let t = 301.86 - 306. Let y = 0.86 - t. What is the third smallest value in 4, y, -2/13? y Let t = 4.1 + 0.9. Let w = 3.6 + 0.1. Let n = w - 3.5. Which is the smallest value? (a) n (b) 0.6 (c) t a Let t = 34.8 + -35. Let j = -0.3 + 0.5. Let i = -1.2 + j. Which is the second smallest value? (a) -2/5 (b) i (c) t a Let u = 1.34 - 1.44. Which is the smallest value? (a) -0.2 (b) 5 (c) u a Let x = -2.95 - 0.45. Let j = -2.94 - 0.06. Let l = x - j. What is the biggest value in -4, 0.2, l? 0.2 Let i be 9/(-6)20/15. Let h = 1.16 - 6.16. What is the third smallest value in h, i, 0.2, -1? -1 Let u be -2(-9)/(-18)-5. What is the second biggest value in u, -1, 0.2, 14? u Let g = 3.0321 + -0.0321. Which is the third smallest value? (a) g (b) -2 (c) -1/7 (d) 3/11 d Suppose 0 = -8g - g - 117. Which is the second biggest value? (a) g (b) 6 (c) -0.4 c Let n be (-150)/(-1700) + 1 + -1. What is the biggest value in -0.3, 2/5, -1/3, n? 2/5 Let x = 4241/3 + -1457. Suppose 0 = 5v - 20, v - 2v = 2w + 84. Let m = w - x. Which is the smallest value? (a) 1 (b) 4/5 (c) m c Let g = 55.99 + -57. Let p = g + 0.61. Let a = -0.2 + 2.2. What is the third biggest value in -1.4, a, p? -1.4 Let z = -42 + 41. Let d = z - -2. Which is the biggest value? (a) d (b) -0.4 (c) 0 a Suppose 29 = -5o + 4. Which is the third smallest value? (a) o (b) -3/7 (c) 0.3 (d) -1/16 d Let d(k) = -k + 4. Let s be d(2). Let m = -3.24 + 3.04. Which is the smallest value? (a) s (b) -1/2 (c) m b Let y(d) = -2d + 22. Let g be y(10). Suppose -gs + o = -2o + 11, 0 = s + o + 3. What is the third biggest value in -2, 5/2, s? s Let j = 0 + -0.1. Let t = 1148/3 - 382. Which is the second biggest value? (a) t (b) -0.3 (c) j (d) 3 a Let k = 0.161 - -0.579. Which is the fourth smallest value? (a) k (b) 2/5 (c) -0.3 (d) -5 a Let f = 47.749 - 47.8. Let q = -0.3 + 0.5. What is the biggest value in f, q, -0.5? q Let l = 808 - 812. Which is the smallest value? (a) -5 (b) -3/7 (c) l a Let m be (-4)/30 + 256/120. Which is the smallest value? (a) 3 (b) 0.3 (c) m (d) -2 d Let n = 95 - 45. Let y = n + -49. Which is the smallest value? (a) 4/5 (b) y (c) 0.1 c Let n be (-2 + -10)6/(-12). Suppose -18 = -nj + 3j. Let k(s) = -2s + 5. Let f be k(4). Which is the second smallest value? (a) j (b) -2/15 (c) f b Suppose 18l = 15l - 6. Let n = -0.01 - 8.69. Let y = -9 - n. Which is the third biggest value? (a) l (b) y (c) 0.2 a Let q be (3 - -1)/(13/((-455)/(-20))). What is the fourth biggest value in q, -1/3, -2/7, 2/5? -1/3 Let c = -258 - -254. What is the biggest value in 4, 29, c? 29 Let d = -2.2 + 2. Let v = 0.2 - d. Let x(c) = -5c3 - c2 + 3c - 2. Let l be x(1). What is the third smallest value in l, -0.14, v? v Let j = 46 + -48. Let s = -7/3 + 31/12. What is the fourth smallest value in -2/9, s, j, 0.1? s Let l = 3.1 - 16.1. Let m = l + 12.4. Let u = -1.1 - m. What is the second smallest value in 0, u, 5? 0 Let m = 10 - 9.98. Let u = m - 2.02. What is the second smallest value in 3/4, u, 6? 3/4 Let r = -0.9 + 1.1. Let y = -527 + 529. Which is the third smallest value? (a) 49 (b) r (c) y a Let u = 10 + -6. Let z = -35.023 - -0.023. Let p = -35.01 - z. What is the second smallest value in 1/2, p, u? 1/2 Let n be -1 + -6 + 0/15. Let j(l) = -l*2 - 10l - 17. Let o be j(n). Which is the third smallest value? (a) o (b) -1 (c) -5 a Let s = -0.528 + 0.728. Which is the third smallest value? (a) s (b) -4 (c) 0.03 (d) 2 a Let x = 481/5 - 96. Let k(b) = b*3 - 7b*2 + b - 10. Let r be k(7). What is the smallest value in x, r, -4? -4 Let y = 0.116 + 0.064. What is the smallest value in 5, y, 1/3, -0.3? -0.3 Let t = -15/22 - -19/22. Let q = 0.12 + -3.52. Let v = q - 0.6. What is the smallest value in v, 1/3, t? v Suppose -22z + 30 = -32z. Let h = -60/31 - -1205/62. Let l = h - 65/4. Which is the third smallest value? (a) z (b) -3/4 (c) l c Suppose h + 0 = -3. Let t be h/44-6. Let j be (-40)/45 - (-4)/t. What is the biggest value in j, -0.3, -2/5? -0.3 Let f = 5.22 - 1.22. Which is the biggest value? (a) 0.3 (b) 0.4 (c) -32 (d) f d Let x = 14 + -10. Suppose 0 = -20d + 21d + x. Let f be (0 + 7 - -2) + d. Which is the second smallest value? (a) f (b) -1 (c) -0.5 c Let d = 6 + -13. Let l be (1/d)/((-3)/(-7893)). Let i = -375 - l. What is the third smallest value in 0.2, i, -2/9? i Let w be 0/3 + (-4)/14. Let m be 1-2 + -6 + -7. Let j be (-12)/(-4) - m/(-6). What is the second smallest value in j, 3, w? j Let f(p) = p - 4. Let t be f(5). Let m = 1.6 - 1.5. Let v = 2.9 + m. Which is the smallest value? (a) 5 (b) v (c) t c Let s = -5.2 - -3. Let m = s - -1.8. What is the third biggest value in 1/5, -2/3, m? -2/3 Let t = -320 - -320.4. Which is the fourth biggest value? (a) t (b) 0.1 (c) 0.5 (d) 1 b Let p be 0((-1)/(-2) + -1). Let n = 7.822 + -6.822. What is the third smallest value in 0.4, p, n? n Let o = 897 - 897.1. Which is the smallest value? (a) -3.9 (b) o (c) -4/5 a Let g = 4.2 + -2.2. Let v = g + -1.6. Let u be 1/((-57)/61). What is the biggest value in u, 0.3, v? v Let v = -1633 - -1628. Which is the smallest value? (a) 5 (b) -0.	{ "pile_set_name": "DM Mathematics" }
1298. Is t a multiple of 12? False Let w = -123 - -226. Is 92/(-20) - -5 - w/(-5) a multiple of 7? True Let p(m) = -m*2 + 107. Let c = -16 - -16. Does 24 divide p(c)? False Let t be (0 + 1)/1 - -4. Let j be 1 + (-1 - (-35)/7). Suppose jd - 79 = -2w, tw - 2d - d - 213 = 0. Does 7 divide w? True Let y = 55 - -19. Is 38 a factor of y? False Let f(u) = u3 + 5u*2 - 2u + 3. Let i be f(-6). Let k be (-91)/(-2 - 9/(-3)). Let z = i - k. Is z a multiple of 14? True Let q = 317 + -17. Is q a multiple of 10? True Let w(y) be the third derivative of -y6/120 - y5/10 - y4/3 - y3 - 9y2. Is w(-7) a multiple of 33? True Suppose 3m - 1593 = -3h, 0 = -2h + 2m + 3m + 1041. Is h a multiple of 17? False Let f(m) = 2171m + 85. Does 48 divide f(1)? True Suppose -5y - 6 = -21. Let h(i) = -i - i + 4 + 5 + yi. Is h(7) a multiple of 6? False Suppose 330 = 28v - 25v. Let k be (-550)/(-14) - 4/14. Let y = v - k. Does 20 divide y? False Let b(x) = 3x*2 + 2x + 3. Let o(z) be the first derivative of z*3/3 + 3z*2 - 3z + 4. Let q be o(-6). Is 8 a factor of b(q)? True Let y(q) = q*2 - 12q - 22. Let u be y(10). Is ((-50)/(-6) - -5)u/(-8) a multiple of 5? True Suppose 0 = 4v - 388 + 220. Is 7 a factor of v? True Let d = -32 - -82. Let w = -46 + d. Does 3 divide w? False Suppose 5 - 17 = -3c. Suppose 0 = cd + o - 25, -o = 2d + d - 20. Suppose -dt + 2r + 134 = 0, 2r = -t + 8 + 14. Does 17 divide t? False Let o(c) = -78c - 2. Let q be o(-1). Suppose -b - 24 = -q. Is 26 a factor of b? True Let o = -147 + 100. Let g = 131 - o. Let x = -112 + g. Does 33 divide x? True Let a be (-1 + 514/6)/(10/15). Let w = a - 62. Does 5 divide w? True Suppose 4105 + 1034 = 9r. Suppose 3z - r = q, -917 + 163 = -4z + 5q. Is z a multiple of 18? False Suppose -4v = 8 + 40. Is ((-20)/3)/(4/v) a multiple of 4? True Suppose -5w + m + 12483 = 0, -158w + 163w - 12495 = -5m. Is 92 a factor of w? False Let n(x) = x*3 - 8x*2 + x - 3. Let i be n(8). Does 10 divide i/(-3 - (-192)/63)? False Suppose -20 = 4c, -y + 205 = 2c - 24. Is y a multiple of 30? False Let n be (-1)/2(-5 - 117). Suppose 0 = -3w + g + 9 + 7, 3w + 3g = 12. Suppose 5z - 4u = n, -wu - 2 = 4z - 2z. Does 2 divide z? False Suppose 3y = -4h + 2y - 193, 0 = 3h - 2y + 142. Does 12 divide (-142)/(-12) + (-8)/h? True Suppose -1 + 16 = 3u. Suppose u = -r - 5. Is 9 a factor of r/(-50) - 94/(-5)? False Let o(a) = a*2 + a - 69. Is 3 a factor of o(-19)? True Let b = -393 + 509. Does 4 divide b? True Let l be ((-1218)/(-30) - 4) + (-3)/5. Suppose 2f = l + 4. Is 10 a factor of f? True Suppose 0 = 5n - 5875 - 170. Is n a multiple of 39? True Suppose 3l - f = -5f + 40, 0 = -2l - 3f + 27. Let b be (-20)/6 - l/18. Is 4 a factor of b/(-4) - (0 - 3)? True Let j(k) = -3k + 51. Let n be j(17). Suppose 5h = 0, n = -5c + 3c - 5h + 352. Is c a multiple of 22? True Is 11 a factor of ((-1595)/(-116))/((-1)/(-16))? True Suppose 7132 - 1027 = 33j. Is 3 a factor of j? False Let w be 0(-1)/(-3) - -14. Suppose -4r = 3l - 2 - w, 9 = 2l + r. Is 12 a factor of 2/l + (-69)/(-6)? True Let d be (-18)/63 - (195/21)/(-1). Suppose 4v = -v + 2a + 226, d = -3a. Does 22 divide v? True Let r be (4/6)/(2/9). Suppose -4j - a = -101, 3j - 47 = 2a + ra. Is 16 a factor of j(3 + -2 + 1)? True Let o(c) = -c3 + 6c*2 + 4c - 8. Let k be o(6). Suppose -k = 5h + 4u, -h - 2u + 1 = 9. Suppose 34 = 3s - 4n, -s + 2n + n + 13 = h. Does 5 divide s? True Let t be (4/10)/((-3)/(-15)). Suppose -3o = 3h - 2o - 26, th - 4o + 6 = 0. Is (h - -1) + -1 + -1 a multiple of 6? True Suppose 7a - 12459 = -4213. Does 19 divide a? True Suppose -5x = -4s + 74, 6 = -4s - 10. Let w = x + 21. Let i = w + 15. Is i a multiple of 9? True Let l = 3172 + -2123. Is 19 a factor of l? False Suppose k - 3k = 4. Suppose -5z + 4c + 137 = 0, -z - c + 5 = -26. Let h = z + k. Is h a multiple of 9? True Is (1 + (0 - 3))/((-6)/651) a multiple of 35? False Let o(q) = q*3 - 8q - 7q2 + q2 - 7 - 2q*2. Let f be o(9). Does 21 divide (-68)/(-8)4 - f? False Let g = 75 + 165. Does 24 divide g? True Suppose 2f - 5 = -1. Suppose 0 = -n - 2j + 13, -fj = 4n + 2j - 40. Suppose 0 = -6b + nb - 5. Is 5 a factor of b? True Suppose 5s - 3437 + 307 = 0. Is s a multiple of 20? False Let c = 3390 - -754. Is c a multiple of 74? True Suppose -5k = 3a - 1413 - 1253, -k + 538 = 3a. Does 17 divide k? False Let f = -120 + 460. Suppose 4x + x - f = 0. Suppose -4p - 5g = -127, 2p - x = 2g - 0g. Is p a multiple of 33? True Let o = 40 - 35. Suppose 0 = 2k - 0k - 5t - 8, 3k - 37 = -ot. Does 2 divide k? False Suppose 2 = 5g + 3y - 11, -4g = 2y - 10. Let k(n) = -5n2 - n2 + 69 - gn + 7n2. Is k(0) a multiple of 33? False Let l = 7 + -11. Let o(x) = -x3 - 2x*2 + 5. Is o(l) a multiple of 12? False Suppose 2r = -2r + 248. Let d = 51 + -35. Suppose -r = -h - d. Is h a multiple of 12? False Let y be 1 - (1 - (1 - 0)). Let a(i) = 20i + 2 - 11i - i + 5i. Is 5 a factor of a(y)? True Let w(a) = a*3 - 34a*2 + 4a - 28. Does 3 divide w(34)? True Let d = 8 + -5. Suppose -5p - dj + 0j + 140 = 0, 0 = 2p - j - 67. Does 20 divide p? False Suppose x - 3d - 746 = 0, 0 = 5x - 2d - 4428 + 724. Does 19 divide x? False Is 84 a factor of (-9)/(-6) + (-805)/(-30)51? False Suppose 19 = a + 17. Suppose 2p + ap = 0. Suppose pq = 2q - 88. Is 19 a factor of q? False Suppose 52z + 29843 - 122143 = 0. Does 25 divide z? True Suppose 4794 = 3q + 2w, -2 + 11 = 3w. Is q a multiple of 19? True Let t(l) be the third derivative of l6/120 + l5/6 + 11l4/24 + 5l*3/6 + 11l*2. Let n be (-1 - -8)(0 - 1). Is t(n) a multiple of 16? False Let w = 1431 + -1040. Is 2 a factor of w? False Is 67344/132 - 2/11 a multiple of 34? True Suppose 3 + 1 = -4o. Let b(i) = -i2 + 10i - 6. Let f be b(9). Does 24 divide 24(f - o - 3)? True Let h = 12 + -9. Suppose 5y + 3n = 925, hy - 3n = n + 555. Suppose -4c + 5z = -y + 53, 0 = 2c + 4z - 66. Is c a multiple of 16? False Suppose 5i = -5n + 1275, -n + 820 - 53 = 3i. Suppose i = 2d + 5f, 2f + 41 + 599 = 5d. Is d a multiple of 32? True Let u(i) be the first derivative of -i*4/4 + 2i3/3 + i2/2 - 5i + 6. Is 5 a factor of u(-3)? False Suppose -6x + 37 = -5. Suppose xl - 4l = 27. Is l even? False Let g(b) = b + 1. Let o(m) = -12m - 36. Let h(a) = 6g(a) + o(a). Is 20 a factor of h(-15)? True Let w(o) = o + 11. Let j(x) = x3 + x2. Let m(p) = -5p3 - 3p - 8. Let q(c) = 6j(c) + m(c). Let l be q(-6). Is w(l) a multiple of 7? True Let u = 551 + -199. Is u a multiple of 32? True Suppose 0 = 5l - 131 - 189. Let u = 87 - l. Is u a multiple of 23? True Suppose 2y - 5y + 18 = 0. Suppose 7z - 8z = 51. Does 16 divide 0 - (z + -3 + y)? True Let f = -18 - -20. Suppose -3t = -3h + 300, -398 = -2h - 2h + ft. Does 33 divide h? True Suppose -2x = -7x + 100. Suppose -5u + 35 = 5n, x = 2u - 0u - 4n. Is 3 a factor of u? False Let x(s) = -3s + 74. Does 4 divide x(15)? False Let o(r) = 5r - 8. Let y be o(10). Suppose d - 7 = 2m + 5, y = 5d - m. Let x = 74 + d. Is x a multiple of 14? False Let c(y) = -4y - 3. Let i(v) = v + 1. Let p(q) = -c(q) - 5i(q). Let z be p(6). Let k = z + 26. Is 6 a factor of k? True Let z(x) = 4x2 - 6x - 8. Is 8 a factor of z(8)? True Let v = 329 - 257. Does 3 divide v? True Suppose -9r + 66 = -6r. Let p be (-14)/77 - (-334)/r. Suppose y + 2t = 10, 7 + p = y - 4t. Is y a multiple of 4? False Let q = 24 - 24. Suppose 3n - 8n + 10 = q. Suppose nm + 120 = 5m. Is m a multiple of 13? False Is 9 a factor of -1(1624/(-4) + -7)? False Suppose 0 = -24p + 54706 + 16814. Is p a multiple of 51? False Suppose 11w + 119 - 1274 = 0. Does 15 divide w? True Suppose -5v + 1019 = 2d, d + 3d - 2033 = -5v. Does 39 divide (-4)/2d/(-26)? True Suppose 7 = q - 4u - 125, 2q - 3u = 274. Is q a multiple of 14? True Suppose -3j = -3f, 2f + 4j - 21 = -f. Suppose u + 467 = fa, -2u - 781 = -5a + u. Is 15 a factor of a? False Let l = -434 + 644. Is 9 a factor of l? False Let s = -646 + 913. Is s a multiple of 2? False Let w(h) = 5h + 79. Let z(c) = -3c - 40. Let x(s) = 4w(s) + 7z(s). Let i be (7 - (-5 - 3))*(1 - 0). Does 12 divid	{ "pile_set_name": "DM Mathematics" }
506 - -515. Calculate the greatest common factor of p and 2. 1 Suppose -2h - 3o + 84 = 0, -3h - 4o = -148 + 24. What is the highest common divisor of h and 228? 12 Let f = -379 + 787. Calculate the greatest common divisor of f and 255. 51 Suppose 5b - 5i - 205 = 0, -198 = 27b - 32b - 2i. What is the greatest common factor of b and 184? 8 Let q be (-4 - -3 - 2) + 79 + -4. Calculate the highest common factor of q and 54. 18 Suppose 0 = 5j - b - 81, -b = -j + b + 18. Let z = 28 - -52. What is the greatest common divisor of j and z? 16 Let c = 30 - 15. Suppose -2m = -g - 359, -10 + 0 = -2g. Suppose 2w - m - 122 = -5a, 5a - 292 = 4w. What is the greatest common divisor of c and a? 15 Suppose -2 = -19z + 17z. Let t be -141(z - 6). What is the highest common divisor of t and 41? 41 Suppose 89i = 77i + 144. What is the greatest common factor of 78 and i? 6 Let r = 560 + 154. What is the greatest common divisor of 42 and r? 42 Let h = -13 - -19. Suppose 0 = x - h - 4. Let l be (0 - 16)/((-1)/5). What is the highest common divisor of x and l? 10 Let u be 2380/25 - ((-238)/35 - -6). Calculate the greatest common factor of 40 and u. 8 Suppose -18k = p - 17k - 59, -5k - 209 = -3p. Calculate the greatest common divisor of p and 126. 63 Let c be ((-70)/(-5))/(2/(-10)-2). What is the highest common divisor of c and 40? 5 Let c(w) = w + 21. Let y be c(-9). Let z(i) = 2i - 2. Suppose 0 = 4q, 4q - 10 = -b - q. Let f be z(b). What is the highest common divisor of y and f? 6 Suppose 9c - 781 - 38 = 0. Calculate the highest common factor of 13 and c. 13 Suppose -72 = -2m + 2u, -2u - u = 5m - 212. Calculate the highest common divisor of 440 and m. 40 Let p = 38 + -27. Let u = p - 9. Let v = 30 - 20. What is the highest common factor of v and u? 2 Let n = 492 + -481. What is the greatest common factor of n and 726? 11 Let u = 519 + 327. What is the highest common divisor of u and 470? 94 Let i be 51/(-85) + 2312/10. What is the highest common factor of 4 and i? 1 Let b(n) = 3n2 - 21. Let v be b(4). Calculate the greatest common factor of 81 and v. 27 Suppose 5a = -u + 57, 3u - 6a - 153 = -3a. Suppose -4w + 0w - u = 0. Let v = w + 15. What is the highest common factor of 8 and v? 2 Let t(g) = 5 + 20 + 2g + 55 - 15. Let c be t(-25). Calculate the greatest common divisor of 25 and c. 5 Suppose 4 = 3w - 5w. Let c be (-180)/(-16)(2 - w). What is the highest common divisor of c and 15? 15 Let l = -5 + 7. Let r = 10 - l. Let f be 0 - 0 - (-16)/r. Calculate the greatest common factor of f and 2. 2 Let r(b) = 4b*2 + 39b - 42. Let v be r(-15). What is the greatest common divisor of 455 and v? 91 Let v be 69/12 + (-9)/12. Suppose -vu = 5s - 1720, 2s - 427 - 255 = u. What is the greatest common divisor of 38 and s? 38 Let w = 53 - -99. What is the highest common divisor of w and 228? 76 Let q(a) = -28a - 2. Let f be q(-1). Suppose l + 8 = f. Calculate the greatest common divisor of 18 and l. 18 Let p(g) be the first derivative of g2 + g - 1. Let x(l) = -l2 + 6l - 3. Let w be x(5). Let i be p(w). Calculate the greatest common factor of 25 and i. 5 Let i(q) = 8q - 30. Let h be i(9). Suppose 3g + h = 4g. What is the highest common divisor of g and 14? 14 Let n be ((-1272)/530)/((-634)/(-640) + -1). Calculate the highest common factor of n and 4. 4 Let p(x) = x*3 + 6x*2 - 25x + 6. Let t be p(7). What is the highest common factor of t and 36? 36 Suppose -3g + 100 = 2o - 2g, 100 = 2o + 2g. Calculate the greatest common divisor of o and 325. 25 Suppose 0w = -2w + 44. Let x(o) = -o3 - 12o*2 - 22o + 13. Let h = -94 - -84. Let g be x(h). Calculate the greatest common factor of w and g. 11 Suppose -2k = 2b - 90, 0 = 4k - 2b - 2b - 172. What is the greatest common factor of k and 88? 44 Suppose -5j = -n, 14 = -4j - 3n + n. Let p(y) = -36y + 0 + 0 - 6y. Let q be p(j). What is the highest common divisor of q and 14? 14 Let r be 5672/22 - (-12)/66. Let q = r + -390. Let m = 260 + q. Calculate the highest common factor of 16 and m. 16 Let m(g) = 44g3 + 3g + 8. Let x be m(9). Let y be (-9)/(-72) + x/8. Let n be 1/4 + y/72. What is the greatest common divisor of 7 and n? 7 Suppose 3f - 6n - 182 = -n, 4n + 56 = f. Suppose -27 = 3o + 3x, -x = -0o - 2o - 18. Let g be 312(-2)/o. Calculate the highest common factor of f and g. 8 Let a(u) = -4u + 13. Suppose 0p + 3p + 6 = -2o, -2p + 4 = 0. Let n be a(o). Suppose 3h + 16 = n. What is the highest common factor of h and 7? 7 Suppose -x - o + 24 = 0, 4x + 0o + o - 105 = 0. What is the greatest common divisor of 135 and x? 27 Let u = -580 + 755. What is the highest common factor of 75 and u? 25 Suppose -2s + 20 = 2z, -2z = 3s + 2z - 30. Let u(d) = d3 - d2 - 5d + 5. Let t be u(5). What is the highest common factor of t and s? 10 Let u(b) = 3b*2 - 2b + 5. Let o = -2 + 4. Let p be u(o). Calculate the highest common divisor of p and 91. 13 Let p(a) = 11a3 + a2 - a + 1. Suppose -3 = -b - 2b. Let h be p(b). Suppose -3y = 0, -w = 3y + 3 - 7. What is the highest common divisor of h and w? 4 Suppose -16 = s - 14. Let x be (-6)/((-24)/(-7))24/s. What is the highest common divisor of x and 3? 3 Let o be ((-520)/(-24))/(0 - 3/(-90)). What is the highest common divisor of o and 26? 26 Let f = 44 - 42. Suppose p - 2u = 2u - 5, fu - 70 = -4p. What is the highest common divisor of p and 120? 15 Suppose 2t - 1545 = -t. Let i = -599 + 337. Let b = t + i. Calculate the greatest common divisor of 23 and b. 23 Let w be 90/24(-24)/(-9). Suppose 4z + w = -q, -3q - 2z = -5z - 30. Suppose 0u = -u + q. What is the highest common divisor of u and 3? 3 Let u = 2247 + -1303. Calculate the highest common factor of u and 59. 59 Let d be ((-2 - 9) + 5)(-7)/2. Suppose 4r = 356 - 104. What is the highest common factor of r and d? 21 Suppose -28 = 2p - 4p. Let s be 4/p - (0 - (-666)/(-21)). What is the highest common factor of 4 and s? 4 Let h(s) = s - 5. Let g be h(-3). Let p be (-18 - 0)4/g. Calculate the highest common divisor of 9 and p. 9 Suppose 27 = 35v - 32v. Calculate the greatest common factor of v and 24. 3 Let h(q) = q3 + 16q*2 + 47q + 37. Let k be h(-11). What is the highest common divisor of k and 40? 5 Let q = -1587 + 1821. Calculate the highest common divisor of q and 54. 18 Let o(p) = p*2 + 9p + 53. Let n be o(-10). What is the highest common factor of n and 7? 7 Let r = -14 - -34. What is the highest common divisor of r and 25? 5 Suppose -m - 2z = -0m - 816, -2433 = -3m - z. Calculate the highest common divisor of m and 30. 30 Let x(q) = 27q - 2. Let t = 30 - 29. Let a be x(t). Suppose -2f - 6 = -4k + 18, 4f - 12 = -4k. What is the greatest common divisor of a and k? 5 Let w be 3 - (1 - 7 - 17). Calculate the highest common factor of w and 6. 2 Let o(k) = 6k2 + 2k - 4. Let l be o(2). What is the greatest common divisor of 9 and l? 3 Suppose -7 - 1 = -4i - 4v, -6 = 4i - 3v. Suppose -4w + b + 20 = i, -b - 8 = -0w - w. Calculate the greatest common divisor of w and 10. 2 Suppose 177 = 4x + 5o, -3x - 2 = 3o - 131. Calculate the highest common factor of x and 494. 38 Suppose -2f - 112 = -0z - 2z, f = 5z - 272. Calculate the highest common factor of z and 30. 6 Let g be 2/10 - 114/(-30). Suppose 5t + 4m = 40, 0 = -gt + m + 3m - 4. Suppose -to + 3o = -2. What is the highest common factor of o and 2? 2 Let n be (3/1)/(3/5). Suppose h - 2c - 115 = 0, -6h + nc = -h - 550. Calculate the greatest common divisor of 42 and h. 21 Suppose 0 = -38c + 34c + 3r + 89, -53 = -3c + 5r. Let k(a) = 201a - 2. Let f be k(3). Let j = f - 419. What is the highest common factor of j and c? 26 Let m = -12 + -18. Let q = m - -42. Let n be (-2)/(-4) + (-355)/(-10). What is the highest common divisor of q and n? 12 Suppose 5a = -0v + 3v + 13, -5v - 2a + 30 = 0. Let p be (v - 4) + -1 + -4861. Let i be p/(-88) + 3/4. What is the highest common divisor of 7 and i? 7 Let y(v) = 11v - 3. Let i be y(3). Let m = -776 - -788. What is the highest common factor of m and i? 6 Let l = 0 + 3. Suppose 28q = 18q. Suppose qn = l*n - 12. What is the greatest common divisor of n and 12? 4 Let x = -114 + 127. Suppos	{ "pile_set_name": "DM Mathematics" }
et g(s) = -12s + 11s - 2 - 1 - 3. Let r be g(-10). Let f be 2/8 - 34/40. Which is bigger: f or r? r Let c be (33/(-15) + 1)/((-1)/10). Let t be 40/(-3)c/(-5). Which is smaller: 34 or t? t Let c = 10 - 8. Suppose -3f = -d + c, 3d + 8 = d. Let g be ((-30)/(-27))/5 + 22/(-18). Which is greater: g or f? g Let r(l) = -19 + 3l + l - 4l + 5l. Let z be r(5). Which is greater: 5 or z? z Let m be ((-4)/12)/((-5)/6). Suppose 138w = 52w. Is m at most w? False Suppose -20 = 5g + 2u, 19 = -g - 4u - 3. Let n = -2.58 - -2.68. Which is bigger: n or g? n Let y be 4/618/258. Let d be (-2)/7 + 120/28. Suppose 2f = v + d, -v = 4f - 3f + 4. Which is smaller: f or y? f Let r(j) = j + 1. Suppose -g + 3n - 16 = 0, 0 = -3g + n - 4 - 4. Let h be r(g). Let y be ((-23)/253)/(2/(-22)). Which is smaller: y or h? h Let v be ((-36)/(-30))/(1/5). Suppose -vb + 60 = -3b. Suppose 4s = -s - b. Is -5 >= s? False Suppose 30c = 38c + 120. Which is greater: c or -19? c Let a(n) = 3n + 59. Let p be a(-18). Let l be (10/p + -1)39. Which is smaller: 38 or l? 38 Suppose -3x + 3c = -6, 4x + 13 = 2c - 5c. Let k(o) = -4o*2 - 2o - 2. Let q be k(x). Let s be (q + 0 - -2) + 1. Which is bigger: -2/11 or s? -2/11 Let z(q) = 70q2. Let h be z(-1). Let w(u) = -u2 - 14u + 38. Let s be w(-11). Does s = h? False Let l = 108.9 + -108.92. Is 5 greater than l? True Let i(z) = -2z3 - 41z*2 - 21z - 52. Let w be i(-20). Is -46 > w? False Let j be (1-12)/(-4) + (10 - 3). Let d = 14 - 10. Let i = -4 + d. Which is greater: i or j? j Let l be 1(11 - (-16188)/(-1464)). Is 0 >= l? True Suppose 0 = -5b - 24 - 16. Let c be ((-1)/(-6))/(b/36). Let f be (9 + 5)/((-4)/(-2)) - 7. Which is smaller: f or c? c Let a(i) = -i2 - 4i - 1. Let b be a(-3). Let r be 0/1 + -3 + 6. Do b and r have the same value? False Let v = 11 + -9. Suppose -2h = 2 - 0, -18 = vz + 2h. Suppose -3l + 3g - 6 = 0, 4l + 4g = -6 + 22. Is z equal to l? False Let s be (7/(-2) + -1)(-4)/6. Suppose 5w - 15 = -3c, -sw = -0w. Is c less than 0? False Let v be (-1)/(928/3710) - -4. Let h = v + -9291/5104. Are h and -2 unequal? True Suppose 4p - 2t + 4 = 0, 5t - t = 2p + 14. Let s be 2 + (-2 + 0)/(3 + -1). Let n be (-14)/28 - (p - s). Does -1/4 = n? False Let n = 5 - 5. Is n != 2/1297? True Let c(b) = 2b2 - 17b - 9. Let y be (-1)/3-254/4. Let z be c(y). Which is greater: 2/109 or z? 2/109 Let s = -3803/100 + 38. Is s < 1? True Suppose -62 = 4u + 94. Let y be -3 - (3 - u/(-24)). Let l = y + 1101/248. Which is smaller: l or -1? -1 Let q(y) = y2 - 9y - 37. Let n be q(12). Suppose 2o = -o + 3. Let b be (12/(-8))/(o/(-12)). Which is smaller: n or b? n Let z be 3/4((-4)/(-3) + -3). Which is smaller: z or 1? z Let v(h) = -h3 - h2 + 13h + 4. Let i be v(-4). Is 1/378 != i? True Let j(o) = o2 - 13o + 22. Let m be j(10). Suppose -4k + 3 + 5 = 0. Suppose 4l + y = -37, -kl - 25 = 2y - 5. Is l at most m? True Let q(p) = -9p2 - 5. Let x be q(-3). Is x >= -84? False Let r be (-1494)/90 - 13/1. Is -31 greater than or equal to r? False Let x(a) = -3a*2 - 77a + 51. Let u be x(-27). Is -66 equal to u? False Let t = -2/2159 - -21616/28067. Suppose -13s - 2 = -15. Which is greater: s or t? s Let p = 0.1267 + -0.0267. Which is smaller: p or -5/93? -5/93 Let y = -1.7 - -1.1. Let a = y + 0.8. Is a not equal to 2/11? True Let p = -64534/73 + 884. Let r = -0.204 - -0.004. Are p and r unequal? True Let x = -535 - -535. Is 3/65 > x? True Suppose 25 = -5m - p, 0p + 2p - 10 = 2m. Suppose -k - 3n - 8 = 0, 2k + 20 = 4k - 3n. Let h be ((-3)/k)/((-5)/(-40)). Which is bigger: m or h? m Let w = 21 + -15. Let s be (8/w)/((-4)/6). Let u(m) = -m3 - m2 + m - 2. Let d be u(s). Is d < 2/37? True Let w be 1/((-2)/(-7))(-43)/(-301). Which is greater: -0.073 or w? w Let g = -2.51 + 0.01. Let r = 0.5 + g. Let k be 18/(-7) - 62250/(-17430). Which is bigger: k or r? k Let q(z) = -z*2 + 9z - 12. Let d be q(5). Let v(u) = -u*2 + 9u - 8. Let h be v(d). Which is smaller: -1/9 or h? -1/9 Suppose -2 = -3i + x - 105, -3i - 109 = 2x. Which is bigger: -27 or i? -27 Suppose -4k + 4v + 34 + 6 = 0, 0 = -5v. Let q(c) = c*2 - 8c - 21. Let s be q(k). Which is greater: s or 2/29? 2/29 Let w = -15 - -15. Suppose -14 = 4p - wp - 2y, -5p - 5y = 10. Let s = -141/2 - -69. Which is smaller: p or s? p Suppose 22o - 15 = -5z + 26o, -14 = 4z + 2o. Let t be (3 - 2)0 + 1. Is z equal to t? False Let z = -41 - -32. Let h = 9 + z. Does h = -2? False Let v be 9 + ((-2)/4)/(1/4). Suppose -5m = v + 3. Is m at least as big as 11? False Let y be (5 - 6)-1 + 645/(-33). Which is smaller: -20 or y? -20 Suppose z = -4l + 29, 5z = -l - 9 + 2. Suppose l = -2t + t. Which is smaller: 2/7 or t? t Let f be (33/(-12)11)/((-1)/4). Which is smaller: 604/5 or f? 604/5 Let f = 1 + 14. Let a = -14.91 + f. Let h = -2.09 + a. Which is smaller: 0.1 or h? h Let r = -806 - -872. Is -0.6 smaller than r? True Let r be 2/(-12) + (-4820)/(-120). Suppose -6 + r = -g. Which is smaller: g or -67/2? g Suppose -11 = -35q + 34q. Let o = -31 + q. Which is greater: -19 or o? -19 Suppose 0 = s + 2v - 2, 4v - 19 = -5s + 3v. Suppose sh = 5h - 2. Which is smaller: h or 12/5? h Let m(p) = 20p*3 - 2p*2 - 3p + 15. Let f be m(-3). Are -533 and f non-equal? True Let m be 4/(-6) + (-168)/396. Let u be 0((-9)/6 + 2). Which is smaller: u or m? m Let f(r) = r3 - 6r*2 + r - 12. Let y be f(6). Let g be (4/12 - 0)y. Which is smaller: g or -1? g Suppose -414 - 1661 = -25y. Which is smaller: y or 0.1? 0.1 Suppose 0 = 2y + 4 - 22. Suppose -37 = -i + 4k, -3i - k = -i - 47. Suppose 0 = 2u - 5j - i, 2u + 6 = -3j - y. Which is smaller: 2 or u? u Let n = 39 + -39.084. Let d = -0.184 - n. Which is smaller: 15 or d? d Suppose 0 = -7a - 393 - 76. Let k = 74 + a. Suppose 0 = -6i + i. Is k less than i? False Let z be (-306)/898962/(-3). Which is bigger: z or 0? z Suppose -v = -6v. Let y be ((-312)/(-45))/(4/(-6)). Let i = y - -166/15. Which is greater: v or i? i Let z = -360970/57 + 6333. Is z at least 0? True Let h(t) = -22t2. Let s be h(-2). Which is smaller: -90 or s? -90 Let v be (-3 + (-14)/(-4))(-1800)/130. Are v and -6 non-equal? True Let z = -12.9 + 0.9. Let j = -154 - -152. Is j > z? True Let y = -0.227 + 0.162. Is y greater than -1? True Let v = 11.7 - 2.7. Which is smaller: v or -14? -14 Let k be 56/82/7. Which is greater: k or 31/28? k Let u = -2.931 - -0.031. Let z = 3 + u. Is 7/2 smaller than z? False Let g(s) = 3s - 4s - 6 - s. Let w be g(-4). Let o be (-1 + 3/w)16. Which is smaller: o or 5? 5 Let f be (-97)/(-6)(-6)/28. Let h be (-6)/2113 - 0. Let l = f - h. Which is bigger: -1 or l? l Let o = 661 + -161. Is o at most as big as 500? True Let r = -40 - -40. Let y = r - 2. Let j be ((-1)/(-3))/((-2)/(-6)). Is y at most as big as j? True Let c = 26 - 22. Suppose 12 = cd, -47 = -2h + 6h - 5d. Is 0 != h? True Let c(l) = -l*3 + 2l*2 + 9l - 20. Let h be c(6). Is h less than -112? False Let v = -175384262/47 + 3731065. Let z = v + 515. Is 0 at most z? False Let g = -9 + 17. Suppose n + 3n - o = -133, 102 = -3n + 3o. Let b be 1(-2)/11 + (-270)/n. Is g >= b? True Suppose -6 = 8m - 6m, -5t + 3m = -2134. Which is bigger: t or 424? t Suppose -6v + v = 4b - 56, v = 3b - 61. Are b and 8 non-equal? True Let x = -5.11 + 0.11. Let v = -9 - x. Let u be 6/12((-4)/(-6))/1. Is u equal to v? False Let o be 12/90 - (-89)/(-690). Is 1 at least as big as o? True Let y be 3/9(-4 + -8). Let o be (20/(-4) - y) + 1. Is o greater than or equal to -9/8? True Let v = -2.7 + 1.1. Let c = v - -0.6. Which is smaller: 28 or c? c Let i = -0.8 + -0.2. Let d(w) = 2w*2 + 8w - 1. Let j be d(6). Let s = 835/7 - j. Which is smaller: i or s? i Let f(k) = k*3 + 8k*2 + k + 32. Let i be f(-8). Is 6 greater than i? False Let l be 13/(195/(-55))(-6)/8. Is 2 at most as big as l? True Let g(c) = c*2 - 8c + 27. Let m(q) = -q*2 + 9q - 26. Let h(v) = 3g(v) + 4m(v). Let o be h(13). Is o bigger than -2? False Let r be ((-34)/(-57306))/((-1)/3). Let o = 1009941/1384895 - r. Let b = 2/29 + o. Is 0 less than or equal to b? True Let y(c) = 2*c - 6. Let g be y(3). Let r = 9 + -12. Is r at least as big as g? False Let o(a) be the t	{ "pile_set_name": "DM Mathematics" }
e common denominator of -149/148357110 and 71/94409070? 1038499770 Calculate the common denominator of -34/125 and 42/1738105. 43452625 What is the common denominator of 7/18889566 and 73/963? 56668698 Find the common denominator of -43/702800 and -79/6606320. 33031600 What is the least common multiple of 7145880 and 2730? 92896440 What is the common denominator of -94/12105 and 1/1578492? 7892460 Calculate the common denominator of -11/2349972 and -8/87. 68149188 What is the lowest common multiple of 7055392 and 7937316? 63498528 Find the common denominator of 49/730 and 111/1449404. 529032460 Find the common denominator of -7/2050840 and -93/205084. 2050840 Calculate the lowest common multiple of 77600 and 10370. 80471200 Calculate the common denominator of 149/4856142 and -127/9712284. 9712284 Calculate the smallest common multiple of 242272 and 212. 12840416 What is the common denominator of 39/117308800 and -111/46923520? 234617600 Calculate the least common multiple of 22528 and 1024. 22528 Calculate the smallest common multiple of 1671 and 169521. 94423197 What is the lowest common multiple of 23172 and 22268292? 22268292 What is the smallest common multiple of 40 and 60467232? 302336160 Find the common denominator of -41/3040 and 31/18338800. 36677600 What is the common denominator of -21/55435589 and -47/2693801? 1053276191 What is the smallest common multiple of 13786 and 889536? 54261696 Calculate the common denominator of 20/21 and 6/4191263. 88016523 Calculate the least common multiple of 39423240 and 692. 39423240 What is the least common multiple of 378 and 812785? 307232730 What is the common denominator of -107/1628 and -57/14080? 520960 Calculate the smallest common multiple of 258 and 9073. 54438 Calculate the lowest common multiple of 2403123 and 9. 7209369 What is the lowest common multiple of 97410 and 39519237? 395192370 Calculate the common denominator of -73/2545116 and -67/320726. 78898596 Find the common denominator of -9/16 and 23/22196732. 88786928 Calculate the least common multiple of 195 and 23565. 306345 Calculate the smallest common multiple of 336 and 7548548. 90582576 Calculate the lowest common multiple of 434 and 447. 193998 Find the common denominator of -15/1357312 and -101/6454. 4380045824 Calculate the lowest common multiple of 4077 and 204001. 5508027 Find the common denominator of 53/494212 and -56/2889. 1427778468 Calculate the common denominator of -25/35839716 and -131/32581560. 358397160 What is the lowest common multiple of 625759 and 3382267? 267199093 What is the least common multiple of 22080 and 2510? 5542080 Calculate the common denominator of 41/7794952 and -19/24. 23384856 What is the smallest common multiple of 771806 and 1334502? 270903906 Calculate the smallest common multiple of 19464200 and 83418. 58392600 Find the common denominator of -58/33 and -29/659846. 1979538 Find the common denominator of 49/25290 and -47/174168. 244706040 What is the smallest common multiple of 7011342 and 122? 427691862 What is the common denominator of 9/36073820 and -57/110? 396812020 What is the least common multiple of 388 and 975432? 975432 What is the lowest common multiple of 14980 and 30626610? 61253220 Calculate the smallest common multiple of 456260 and 1236. 140984340 Calculate the smallest common multiple of 1186557 and 822. 2373114 Find the common denominator of -83/62330 and 34/208725. 113128950 What is the lowest common multiple of 458937 and 4436391? 13309173 Calculate the common denominator of -91/142812 and -155/53982936. 53982936 Calculate the common denominator of 23/464723 and 21/367. 170553341 What is the common denominator of -107/2023826 and 151/84? 12142956 Calculate the least common multiple of 96 and 354688440. 1418753760 What is the least common multiple of 3700284 and 34104? 7400568 What is the common denominator of -75/189596 and 117/2413040? 26543440 What is the smallest common multiple of 45248 and 17152? 12126464 What is the smallest common multiple of 6570630 and 660? 13141260 What is the common denominator of 209/735540 and -79/1471080? 1471080 Calculate the smallest common multiple of 219072 and 1400. 5476800 Calculate the least common multiple of 512997849 and 7581249. 1538993547 What is the common denominator of 113/3980860 and 55/122? 3980860 What is the smallest common multiple of 250 and 595750? 595750 What is the least common multiple of 5 and 2092670? 2092670 Calculate the common denominator of 151/12349974 and 187/546. 12349974 Calculate the common denominator of 113/9384 and -29/5118. 8004552 What is the lowest common multiple of 221931 and 91928752? 827358768 Calculate the lowest common multiple of 16976500 and 44317600. 4210172000 What is the common denominator of -59/4556 and -125/160242? 21472428 What is the common denominator of -73/64020 and 87/400? 1280400 What is the smallest common multiple of 144793341 and 1386? 289586682 What is the least common multiple of 112736 and 163512? 2304211104 What is the lowest common multiple of 1568925 and 3639906? 90997650 What is the common denominator of -167/2646 and -74/18432225? 258051150 Calculate the lowest common multiple of 655028552 and 10312. 655028552 What is the lowest common multiple of 23061 and 5711441? 17134323 Calculate the common denominator of -97/94440694 and -5/1052264. 377762776 What is the smallest common multiple of 23825925 and 3825? 23825925 What is the least common multiple of 50863 and 119? 6052697 Calculate the lowest common multiple of 1380 and 25641780. 25641780 Find the common denominator of -61/203544 and 131/24672. 814176 What is the lowest common multiple of 47530 and 1020? 4848060 Calculate the smallest common multiple of 199240 and 6475300. 12950600 Find the common denominator of 125/2566928 and 3/164164. 28236208 What is the common denominator of -79/83343 and -113/6167382? 6167382 Calculate the common denominator of 85/7907424 and 185/716352. 205593024 What is the common denominator of 23/90 and -52/114880371? 3446411130 What is the common denominator of 137/13116 and 9/130240? 427056960 Calculate the lowest common multiple of 73395 and 280605. 1373000265 What is the smallest common multiple of 149616 and 1848? 11520432 What is the lowest common multiple of 10572770 and 5845? 74009390 Calculate the common denominator of 85/6432 and 127/142308. 1138464 What is the least common multiple of 61314822 and 22? 674463042 What is the least common multiple of 7148 and 2248? 4017176 Calculate the smallest common multiple of 591 and 55837680. 55837680 What is the least common multiple of 490926 and 969? 9327594 Calculate the common denominator of -95/11938808 and 17/12. 35816424 Calculate the smallest common multiple of 104922 and 867114. 75438918 What is the least common multiple of 441 and 1865871? 1865871 Calculate the common denominator of 52/1634615 and -44/2525. 825480575 What is the lowest common multiple of 5480992 and 8096? 5480992 Find the common denominator of 27/24752 and -89/300716. 143140816 Calculate the common denominator of -37/429300 and -43/321525. 613469700 Calculate the least common multiple of 1398 and 4047909. 8095818 Calculate the smallest common multiple of 6501978 and 15. 32509890 What is the common denominator of 7/36 and -41/2569944? 7709832 What is the common denominator of 25/1906526 and -87/604? 3813052 What is the lowest common multiple of 5649 and 1018926? 1918637658 Calculate the smallest common multiple of 474 and 73734. 5824986 What is the common denominator of -103/9802806 and -53/1410? 2303659410 Calculate the common denominator of -173/172662 and 125/12366. 355856382 Calculate the least common multiple of 5931002 and 34. 100827034 What is the least common multiple of 1751 and 729? 1276479 Calculate the lowest common multiple of 25120 and 17172660. 137381280 Calculate the common denominator of 69/1635676 and -115/10164558. 142303812 Calculate the least common multiple of 96771084 and 42. 677397588 What is the smallest common multiple of 225624 and 872? 24593016 Calculate the common denominator of 37/11884530 and 81/905488. 95076240 Find the common denominator of -19/143 and -25/124189. 1366079 Calculate the least common multiple of 20424088 and 80621	{ "pile_set_name": "DM Mathematics" }
or u. 5 Suppose -56 = 30w - 58w. Solve 11 = -wi + 15 for i. 2 Let j = 4247 + -4242. Solve 8t - 7t = -j for t. -5 Suppose -2a + 4 + 28 = 0. Let d = -16 + a. Suppose 3y = -dy - 2y. Solve -3x + 4x + 1 = y for x. -1 Suppose 3y = 12s - 16s + 362, -s + 83 = -3y. Solve -91o = -so - 2 for o. 1 Suppose 2x = 2f - 10, 5f - 21x - 70 = -25x. Suppose 0 = fi - 15 + 5. Solve 2 = 3a - i for a. 1 Let v(a) = -552a + 2244. Let s be v(4). Solve sj = -448 + 376 for j. -2 Suppose 125w - 540 = -10w. Solve -126 = 17o + wo for o. -6 Let u be 1252/26 + 11/(-286)4. Solve -58d + 64d = -u for d. -8 Let m = 396 - 394. Solve -22i + 24i = -m for i. -1 Suppose -33 + 67 = r + 3w, -3r + 6w + 162 = 0. Solve -23f + 92 = r for f. 2 Let z be (-7 - -46)/(2/4). Let l = 91 - z. Suppose 0 = a - p, -2p = 3a + 3 - l. Solve -3 + a = c for c. -1 Let o(s) = s3 - 15s*2 - 2s + 36. Let d(f) = f3 + f2 - 9f + 6. Let b be d(3). Let g be o(b). Solve y + gy + 14 = 0 for y. -2 Let w = 324 - 319. Let u be (w/3)/((-15)/(-72)). Solve -23 = 5m - u for m. -3 Suppose 2t - 5490 = -13t. Suppose -11p + t = -5p. Suppose -p + 56 = -q. Solve -q + 4 = g for g. -1 Suppose 0 = 7a + 398 + 372. Let j = a - -155. Suppose -jr + 6 = -43r. Solve r = 2f + 11 for f. -4 Suppose 0 = -o - 3o - 2644. Let d = -657 - o. Solve dn - 12 = -8 for n. 1 Suppose 16r - 35 = 11r. Let q(b) = -b3 + 8b*2 - 6b - 10. Let g be q(r). Let z = -3 - g. Solve -4 = -j - zj for j. 4 Let l(f) = -2f*3 - 15f*2 + 10f + 11. Let m be l(-8). Let o be m/(-3)(54/3)/3. Let k be 33/6 - o/(-4). Solve 4u - 12 - k = 0 for u. 5 Let v be -42(-2 + -1 + 8/3). Suppose 4n = vn - 150. Suppose nz - 18z = -15. Solve -zd - 4 = 11 for d. -3 Let f(g) = -g*3 + 17g*2 - 62g + 30. Let p be f(12). Suppose 8t + p = 22. Solve -to = 13o + 15 for o. -1 Let b = 24542 - 24487. Solve bh = 70h + 75 for h. -5 Suppose 2l - 3n - 14 = 0, n - 2n = 2l - 14. Suppose 3v + s = l, 0 = 3v - 0v - 3s - 15. Solve -vi = -0i + 15 for i. -5 Suppose -988h + 983h = -70. Solve 0 = 10z + 4z + h for z. -1 Let j = 153 - 144. Solve j = 126f - 117f for f. 1 Suppose -5o + 21 = d - 7o, -2d + 36 = -3o. Solve -d - 15 = 8z for z. -3 Let w = -80 + 98. Suppose -f - 4j - 3 = -9, -3f - 2j = -w. Solve -25 + 7 = ft for t. -3 Suppose 36g = 59927 + 987 + 25630. Solve -2403t + gt + 6 = 0 for t. -6 Let f(y) = 5y*2 - 9y - 2. Let t(n) = 16n2 - 26n - 6. Let l(d) = 17f(d) - 6t(d). Let v be l(-1). Let m be 12/(-9)v + -31. Solve -5c - 38 = -m for c. -5 Suppose -2w + 5r = 8 - 4, 0 = 4w + 2r - 16. Suppose -5y + w = 3t, y = -5t - 30 + 13. Solve yn + 11 = -1 for n. -4 Let x = -40404 - -40645. Solve 0 = xg - 253g for g. 0 Let d(m) = m3 + 13m*2 + 23m + 14. Let i be d(-11). Suppose -5c = -5w + 20, -iw + 5c + 12 = 3c. Solve 27 = wv + 11 for v. 4 Let z = 4 + -4. Suppose 2m - 5d = -20, 7 = d + 3. Suppose zt + t - 8 = m. Solve -b - b - t = 0 for b. -4 Let q be (-4)/(-3)(-23 + 2330/40). Solve 0 = -21t - 16 - q for t. -3 Suppose -35 = -5u + 3x - 0x, 18 = 2u - 2x. Suppose 6 = -n - 3i, n + 2n - 4i = 21. Suppose 55w - 3 = 8w + 185. Solve ws = ns - u for s. -4 Let i(r) = 53 - 5r*2 + 7r*2 - 68. Let x be i(4). Suppose 3f = -0f. Solve 4v + 3 + x = f for v. -5 Let i(h) = -316h - 272. Let z be i(-1). Solve -z = -457p + 446p for p. 4 Let y = 0 - 31. Let b = y + 36. Suppose -5s = -a - 21, 2a - b + 2 = s. Solve -x = ax for x. 0 Let x be (242 + -245)(-11)/3. Solve xn + 41 - 8 = 0 for n. -3 Suppose 0 = -3u - 5r + 99, 5u - 220 + 65 = -5r. Solve 58h = 51h + u for h. 4 Let s = -10943 + 11184. Solve 185 = -8y + s for y. 7 Let a = -182 + 183. Let t be 187/85 + 8/10a. Solve -tf + 0 = 6 for f. -2 Suppose 2k = -4f + 6, 5f + 4k + 8 = 11. Suppose z = -j - 3z + 22, -4j + z + 71 = 0. Suppose 9x - j = fx. Solve x = -2n + n for n. -3 Let w(s) = s*2 - 3s + 2. Suppose -3k = 5i - 0i - 22, 0 = -2k + 3i + 2. Let z = k + -3. Let q be w(z). Solve q = -4h + 16 for h. 4 Suppose 5b = -3p - 2, 0b + 2b + 2p = 0. Let m be (-4 + 4 + -1)/b - -3. Suppose -20 = -q - j, mq - 7q + 4j = -60. Solve 3y + y - q = 0 for y. 5 Let s = 7 - 2. Let b be 54/36 + 3/2. Suppose -bf = -9f + 24. Solve 0 = -3v + s + f for v. 3 Let r = -15928 + 15960. Solve -rv = 25v for v. 0 Let l(n) = -8n2 - 166n - 106. Let x be l(-20). Solve 65m - 58m = -x for m. -2 Let j(w) = -w*3 + 10w*2 + 71w - 546. Let b be j(7). Solve 0 = -21m + b - 245 for m. -7 Let n = -575 - -724. Suppose -nb + 160b = 0. Solve -5i - 23 + 23 = b for i. 0 Suppose -2v = y - 16, 4y + 163 = -2v + 191. Let p(g) = -2g + 3. Suppose -q - 1 = m, q - 15 = 4q - 3m. Let u be p(q). Solve 3j + u = vj for j. 3 Let j = -7 - -20. Let n(w) = -7w + 89. Let q be n(7). Suppose 0 = 44l - ql - 16. Solve -j + 1 = -lc for c. 3 Suppose 0h + 4h - s - 61 = 0, -h + 2s + 10 = 0. Let m(n) = n2 - 4 + 2 - h + 4n. Let p be m(-7). Solve -pg = g - 8 for g. 2 Let p(i) = 6i + 75. Suppose 167 = -6l + 95. Let b be p(l). Let k be ((-1)/1)/(3/(-6)). Solve k = a + b for a. -1 Let n = -68 - -72. Suppose i - 4z + 5z + n = 0, z = 3. Let o be 6/(-4)(i - -5). Solve -20 = oh + h for h. -5 Let i = 16634 + -16209. Solve -26 = 57u - i for u. 7 Let n(x) = -2x2 - x + 3. Let s be n(1). Suppose -22u + 112 + 42 = s. Solve 4f - 22 = -uf for f. 2 Let h = -11 - 13. Let u = h + 24. Suppose u = -0f - 5f. Solve f = -3w + 7w + 12 for w. -3 Suppose 4q = 2j + 62, 5q + 36j - 34j - 55 = 0. Suppose qi - 42 = 6i. Solve -1 = -is + 17 for s. 3 Suppose -98q - 49068 = -75q - 305q. Solve 30f - f = -q for f. -6 Let v(d) = -d*2 - 6d + 31. Let j be v(-13). Let x = j - -75. Let i be (3 - 7) + (x/3 - 1). Solve i = p - 5 - 0 for p. 5 Let w(n) = 5n - 15. Suppose 5j - 5 = 3t + 4, -t = -2j + 4. Let a be w(j). Suppose -5p + 9 = r, ar = -r + 3p + 1. Solve -rg + 5 = 21 for g. -4 Suppose -7n + 1511 = -2927. Let s = n - 589. Solve 0 = -j - s + 46 for j. 1 Let k be -10 + 9 + (3 - -3 - 0). Solve 0 = -l - k + 8 for l. 3 Suppose -p + 5p = 0. Let c(x) = -9x. Let g be c(p). Suppose y - 8y + 98 = g. Solve -y = -3i - 2 for i. 4 Let u(c) = -3c + 44. Let a be u(14). Suppose -x - a + 69 = 0. Suppose xn = 68n - 4. Solve 2j - nj = 8 for j. -4 Let j(p) = -131p + 8526. Let q be j(65). Solve 0 = qz + 673 - 706 for z. 3 Suppose 3t - 20 = -3n + 7t, 0 = -3n - 4t - 20. Let j = 11 + -2. Let o = -7 + j. Solve n = ox + x + 15 for x. -5 Let k be (-15323/(-285))/(2 + (-55)/28). Solve 502v - kv + 104 = 0 for v. -4 Suppose -7y + 4y = -3i + 126, -2y = 6. Suppose -9t = -it + 150. Solve -tv - 12 = v for v. -2 Let i be 14 + -20 - 4-19. Let p = i + -66. Solve -19 + p = 5n for n. -3 Suppose -4w + 34d + 181 = 37d, 90 = 2w + 2d. Solve -3j - 46 = -w for j. 0 Let n = -8027 + 8029. Solve -165 = -na - 155 for a. 5 Let q(b) = -17b*2 - 299b + 193. Let a be q(-18). Solve -86f = -af + 133 for f. -7 Suppose 3593 = 9m + 19m - 10967. Solve -11s + m = 54s for s. 8 Let k = -3 + 5. Suppose 0 = -4z + z + 12. Suppose q + k = z. Solve m = qm + 3 for m. -3 Let m(u) = 129u - 5481. Let j be m(43). Solve 242q - j = 253q for q. -6 Let o = -240 - -114. Let d = -115 - o. Solve 2s + 13 - d = 0 for s. -1 Let k(m) be the third derivative of -m*4/24 + 5m*3/2 - 16m*2. Let l be k(4). Suppose 17d = ld + 12. Solve -8 = -5z + d for z. 2 Let o(m) = m*3 - 9m*2 + m - 3. Let v(f) = -38f3 + 4 - f2 + 48f3 - 4. Let u be v(1). Let r be o(u). Solve rc - 12 = 3c for c. 4 Let k be (-90)/315 + 4/14. Solve -243w + 237w - 18 = k for w. -3 Suppose 201c = 160c + 738. Solve -8 = -cd + 10 for d. 1 Let h(n) be the third derivative of n6/120 + n5/20 - n4/6 + n3/2 + 19n2. Let f be h(-4). Let k be (-7)/f(-10 + 7). Solve k + 8 = 5q for q. 3 Let g be 21/49 - (-134)/14. Let q be 208/12 + 8/(-6). Suppose gr = 8r + q. Solve -j - r = 3j for j. -2 Let t(l) = -3l3 + 38l*2 + 20l + 57. Let d be t(13). Solve -dk = -157k + 27 for k. 3 Let z be (2 + 0)/(26/24 - 1). Suppose -70 = zm - 29m. Suppose -2x = 3l - 2l - m, -22 = -4x + l. Solve -xr + 2r = 0 for r. 0 Suppose 0 = j + 4j - 40. Let f(x) = -8x*2 - 4x + 9. Let y(d) = 11d*2 +	{ "pile_set_name": "DM Mathematics" }
ue of ((-25)/(-10))/(295/118)? 1 What is the value of ((-9)/(-36) - 9/(-2)) + -51 + 45? -5/4 Calculate (-5115)/(-3906) + 2/24 + (-1)/4. 8/7 Evaluate (-420196)/(-166152) - 5/2. 2/69 What is the value of (-560)/840 + (-10)/(-105)? -4/7 Evaluate -1(7 + ((-7)/(-11))/(30/330)). -14 Evaluate (-429)/4026116/377. -2/61 126/4863/(-21) -1/27 Evaluate (-3240)/(-270) + 0/(-2). 12 What is the value of (-24)/(20/((-400)/30))? 16 What is (8 - 175/14)/(-6(-22)/(-32))? 12/11 Calculate ((-247)/39 - 1) + (-2)/3. -8 What is the value of ((-1830)/19825)/(2/5)? -3/13 What is -12(((-12)/(-8))/(-1))/(27/6)? 4 (31 - (35 - 19)) + 16-2 -17 What is (-4 - -10)((-244)/(-1708))/((-2)/14)? -6 Evaluate ((-120)/(-150))/(3/(-60)). -16 What is 232/52218/16 + (-18)/(-4)? 5 Calculate (((-893)/(-38))/47)/(2/20). 5 What is the value of (-640)/352(-759)/92? 15 (-110 - -107)4/(-3) 4 Calculate -2(1/(-1) + 22/(-66)) - 2. 2/3 Evaluate ((-92)/276)/(-1 - -2). -1/3 What is the value of 3(-12)/(-81) + (-18 - (-48 + 30))? 4/9 Calculate 50/66 - (-38)/(-57). 1/11 What is the value of -11924/816(-44)/7? 22 Calculate 2(1903/286 - 2/13). 13 Evaluate (1190/(-357))/(6/9 - 1). 10 (-13)/(-28) - ((-650)/(-52))/25 -1/28 0 + (35/(-108) - 240/(-3240)) -1/4 Calculate (-824)/608 + 28/(-63) + (-427)/(-252). -2/19 (4 - 3)((-60)/5 + 10 + 7) 5 Calculate 53/(770/98) + 4/10. 11 Calculate -5 + -13 - (-7191)/(-423). -35 Calculate (-30)/(-84)-24 - (13 + -21). -4/7 Calculate (27/63 - (-3 - 404/(-126)))1. 2/9 (-49)/(9604/(-924)) + -7 -16/7 What is 750/(-90)18/(-15)? 10 Calculate 4/((-112)/(-540)) + -19. 2/7 What is 4554/(-220) + (-15)/50? -21 What is (-69)/(-46)(-56)/(-126)? 2/3 What is the value of (-3552)/352 - ((-105)/(-55) - 2)? -10 What is the value of -18(2/(-24))/((-27)/216)? -12 What is 2/(-15) - ((-826)/120 - 7/28)? 7 What is the value of (-9 - -8)9/(-12)4/(-12)? -1/4 71768/(-546) + (-2)/6 -23 What is (-792)/(-8576) + (-2)/67? 1/16 Calculate (-128)/(-168) - (-12)/(-9). -4/7 Calculate 40/(-15) - (28 + (-3157)/105). -3/5 Evaluate -36 + (-28249)/(-795) + (-1)/5. -2/3 What is the value of ((-396)/70)/(-3) - 146/511? 8/5 What is the value of ((-1)/(-5) - 17/45) + 868/(-3906)? -2/5 Evaluate ((-468)/(-195))/((-9)/10) - (-2)/(-6). -3 Evaluate (-4378)/(-275) - (594/75 + -8). 16 What is the value of ((-1)/2-13 - 12) + 1/(-2)? -6 Calculate 42/561(-96)/45-1. 8/5 (-3)/((126/(-8))/(21/(-14))) -2/7 What is 3/(-9)-2294/392? 1/2 What is the value of 5/(-11)3551/(-335) - 5? -2/11 Calculate 4 - 0 - ((12 - 25) + 14 + 5). -2 What is the value of (-30 + 0)32/(-96)? 10 (4/(-26))/((-100215)/1105 + 91) -1/2 Evaluate 23/(-345) + (-91)/(-105). 4/5 Evaluate -2457/(-304)((-1)/3 + 1). 3 Evaluate 187/136 - (-3)/(-8). 1 What is the value of (-3 + (-68)/(-22))/(132/5940) + -3? 12/11 Evaluate (-13)/((-104)/(-176)) + -111 + 101. -32 What is the value of ((10/(-50))/(8/(-90)))/((-28)/112)? -9 What is the value of ((-175)/56)/5 + (-2864)/128? -23 What is the value of 123/9 + (-102)/(-306)? 14 Evaluate (((-4)/(-35))/1)/(-1 - 54/(-45)). 4/7 What is ((-6)/190)/(20 - 7880/400)? -2/19 What is 6/141732/(-544)? -3/7 Evaluate (132/(-4554))/(-6 + 3 + (3 - -1)). -2/69 What is the value of (-8)/(-10)((-110)/8 - -20)? 5 Evaluate (-16)/((-4816)/(-387))4/(-18). 2/7 What is 578/36 + (-13 - -8) + 385/(-35)? 1/18 (-312)/(-273) - 1/7 1 What is the value of (-18)/(-28) + (-32)/448? 4/7 What is the value of -5 - 130/21(-15)/75? 8 Evaluate 1/(-6) - 188/(-396)(-360)/(-240). 6/11 Calculate ((-13)/(104/(-16)))/((-420)/(-18) - 12). 3/17 (7/(-105))/((-5 - -6)(-19)/57) 1/5 What is the value of (-3)/((((-840)/(-25))/4)/((-16)/20))? 2/7 What is the value of (108/(-216))/(27/(-12))? 2/9 What is 8/(-40) + 13 + 14424/(-1080)? -5/9 (-2(-7)/(-280))/(-3(-4)/24) -1/10 Evaluate (-1)/((-9)/7) + (32 - 16)/(-144). 2/3 Evaluate (700/(-16) - 40/32) + 17. -28 What is -7 - ((-2590)/14)/37? -2 What is (-11 + 200/16)10? 15 What is the value of ((-1748)/851 - -2) + 690/(-925)? -4/5 What is the value of 5 - 99/(-12 - -23)? -4 What is (17 - (-23 + 32)) + -3? 5 What is 145/(-10) - 740/(-140)? -12/7 190/10 + (-325)/25 6 4-2 - (-15 + (-108)/(-9)) -5 Calculate -3(31/(-9) - -4)(32 + -44). 20 Evaluate (-1)/15 + -428/(-560). 2/15 What is the value of (342/7182)/(1/9)? 3/7 Evaluate -12 + (-114)/38 + 1. -14 What is the value of (-2)/(-6)46/(2622/171)? 1 What is 4/(-32)-104 - (0 - 3) - 7? 9 What is the value of (-40)/24(-78)/(-130)? -1 What is the value of (-46)/437 - (-1386)/(-399)3/(-42)? 1/7 What is (216/30 - 7) + (-308)/(-385)? 1 Calculate (-28)/3 - (10/42 + (-80)/140). -9 What is ((-58)/3480)/(4/10-1)? 1/24 Calculate ((-143)/165)/((-69)/(-1035)). -13 Evaluate -46(-3 - (-175)/70). 23 What is the value of (-21 + 429/26)2? -9 What is -1 + 1918/(-174) - (543 - 555)? -2/87 (-57)/4 + -108/(-320) -14 What is the value of ((180/54)/((-4)/(-6)))/5-2? -2 What is (22/10)/((-6)/(-5))? 11/6 What is the value of 56/(-30) + 1220/(-1800)? -2 Calculate 5700/(-2470) + (-8)/(-26). -2 ((-2)/(-5) - 42/(-20))(-30)/(-50) 3/2 Calculate 54 + -48 - 54. -14 Calculate -6(164/(-10) - -16)(4 + 6). 24 What is (405/35 + -9)/(6 - 215/35)? -18 Evaluate 37 + -19 + -33 - -6. -9 (1226/142216)/((-1)/8) -2/29 What is (-1 + 3)((4 - 1) + (-39)/(-13))? 12 ((-2)/77)/(400/560) -2/55 23 - (33/(-154) - (-1840)/224) 15 What is the value of 2/(1080/63) + (-4 - (-46)/12)? -1/20 Calculate (-2 - -1 - -7)-1827/8019. -4/11 1280/(-240)(18/8)/(-1) + -1 11 Evaluate (-735)/33 - (1725/(-275) - -6). -22 Evaluate (40/(-90))/(70/135). -6/7 Evaluate 6 + (336/32 - 18). -3/2 What is the value of 13 + -2 + (2 - (-104)/(-8))? 0 37/222 - (-4 + (-29)/6 + 2) 7 Evaluate (-64)/(-1920) + 1316/120. 11 What is the value of 12/124 - (-282)/(-1953)? -1/21 What is the value of 8/(-5)(-8720)/62784? 2/9 (8687/(-420) - -20) + 2/(-24)-1 -3/5 Calculate (1/(-7))/(7/(-35)). 5/7 (8/(-224))/((-18)/(234/(-13))) -1/28 Evaluate (506/(-1771))/(2/(-63)). 9 Evaluate (-3)/((-315)/(-40)) + 0 + (-24)/(-252). -2/7 What is the value of (-6)/(-4)(-4)/(-5)1470/(-84)? -21 What is ((-4)/(-3))/((-712)/16554)? -31 Evaluate (-10)/((-1050)/(-405)) - -5. 8/7 (-3)/(-22)(-3 + (-44)/36-3) 1/11 (1190/(-30))/17-3 7 (23/(-69))/((80/12)/4) -1/5 (3060/17)/15((-39)/9 + 3) -16 Calculate 2/((-4)/(-2))(0/(-19))/(-10). 0 (800/30 - (-16)/12)(-2)/(-4) 14 What is (-2)/(-3)6 + 9/(-5) + -1? 6/5 Calculate (25(-30)/450)/((-10)/168). 28 What is the value of (-738)/(-120) + -8 + 12/20? -5/4 What is 9/(((-90)/75)/(12/15))? -6 9/(-12)640/12720 -2/53 ((-3)/196)/((-799)/(-5593)) -3/28 Evaluate (-14)/(-42)21(-4)/154-1. 2/11 What is the value of -10 - (108/(-15) - 21/(-105))? -3 What is the value of (((-16)/12)/(26/39))/(395/(-5))? 2/79 33 + 21/(-15) + (-4 - (-22)/5) 32 Evaluate (-386)/(-11) + 16860/(-15455). 34 Evaluate 6 - 12(266/(-56) - -4). 15 What is (1661/906(-8)/66)/(-2)? 1/9 (6/(-5))/((-23)/(230/4)) 3 What is (2236/(-387))/(3 + (-29)/(-18)-2)? 26 What is the value of 1-4 + (20/(-45) - (-16)/4)? -4/9 Evaluate 442/442(-2 - -11). 9 What is 10 - ((-37)/(-2) + (-7)/14)? -8 What is the value of (-9 - 0)(2/(-45) - 18/45)? 4 What is 114 + -112 + 100? 2 Evaluate 378/27 + (-3612)/259. 2/37 What is the value of ((-27)/(-60) + 2/(-10))/((-2155)/(-2155))? 1/4 What is the value of -1548/(-880) + -1? -2/11 What is (-6 + -6 - -7) + (-133)/(-19)? 2 Evaluate (15/(-4))/((10/(-15))/(288/(-81))). -20 What is 22512/2268 + 4/54? 10 Calculate 10/7 + (-15660)/(-945). 18 Evaluate (11 + -30)40/(-76). 10 -420(-2)/16 10 485/(-105) + (38/152)/(14/16) -13/3 Evaluate (31/620)/((-2)/10)(-12)/2. 3/2 Calculate ((-36)/(-405))/((165/(-75))/(-11)). 4/9 -1 - (0 - 65)/(-7 + 2) -14 (70/(-20) - (-49)/35)/(18/(-15)) 7/4 What is ((-48)/10)/(4/(-14)(-1666)/1190)? -12 What is the value of (909/(-1818))/(2 - 238/40)? -5 What is the value of (-1 - -3)(7 - 4)7/(-98)? -3/7 (-279)/(-135)(-1 + 0) - (-16)/40 -5/3 What is (-234)/33 + (-7)/(-77) - (-326)/46? 2/23 What is the value of (1736/6519/(-12))/(-12 + 0)? 1/6 (-27 + 25)/(1 + (0 - 3/5)) -5 Calculate ((-4)/16-4)/(1 - 434/28). -2/29 What is the value of (5/(-10))/((-39)/(-182))? -7/3 (-9 - (-115)/15) + -3(-6)/18 -1/3 -20 - -3171/27 -1 (-72)/(-38) + (-2 - -5)*(-20)/30 -2/19 What is the value of 31185/2025 + ((-2)/	{ "pile_set_name": "DM Mathematics" }
pose 0 = 2l - 5m - s - 11, 6 = l - 3m. What is the units digit of l? 6 Suppose 0q - 4q = 5s - 665, 5q - 847 = -s. What is the tens digit of q? 7 Suppose 22 = 5w - 3d, 3d + 8 = d. Let l = w - 0. Suppose -h - 17 = -lh. What is the units digit of h? 7 Let w(h) = h3 + 6h*2 - 4. Let u be w(-6). Let v(j) = 0j + j*3 - 5 + 4 + 5j*2 + 2j. What is the units digit of v(u)? 7 Let x(n) = n + 4. Suppose -21 = 5b + 24. Let m be 1/(-2 - 15/b). What is the units digit of x(m)? 1 Suppose -10 - 10 = 4n, 27 = 3v - 3n. What is the tens digit of -2 + (108/v - 2)? 2 Let d(c) = c*2 + 2c + 3. Let b be d(-3). Suppose 4z + 0f = 2f + b, 0 = 3z + f - 12. What is the units digit of (0 + z/(-3))-1? 1 What is the hundreds digit of ((-1095)/(-30))/((-9)/(-4) - 2)? 1 Let f(l) = -3 - 1 - 2 - 3l. What is the units digit of f(-6)? 2 Let i(r) = -r*2 + 7r - 4. Let p(n) = 4n - 2. Let f be p(-3). Let m = -9 - f. What is the units digit of i(m)? 6 Let k(i) = i - 2. Let q be k(6). Suppose 0 = -qt - 11 + 139. What is the tens digit of t? 3 Let v be (-10)/45 + (-76)/(-18). Suppose 0p + 4 = vp. What is the units digit of p? 1 Let d(m) = -m3 - m2 + m + 26. What is the units digit of d(0)? 6 Let p be 10/(-2)1 + 0. Let v = 23 + p. What is the tens digit of v? 1 Suppose 0 = 3b - 0i - i - 182, 5b - 3i = 306. What is the tens digit of b? 6 What is the units digit of ((-12)/7)/(6/(-168))? 8 Suppose 0 = 2v + 2v. Suppose v = -2x - 4k + 8, x - 5k = 4x - 9. What is the units digit of x/12 - (-7)/6? 1 Let z(b) = b3 + 6b*2 + 3b - 2. Let l be ((-5)/2)/((-1)/(-2)). Let p be z(l). Suppose -4y = 4c - 8, -c - 4y = -y + p. What is the units digit of c? 7 Suppose 3l - 114 = -0l. What is the units digit of l? 8 Let c(i) = -2i*3 - 3i - 3. Let t be 11/(-7) + 30/(-70). What is the tens digit of c(t)? 1 Let m be -1 + -2(-2 - 0). Suppose mo + 42 = -5y + 120, -y = -3o - 30. Suppose g + 3q = y, -q = -g + q + 3. What is the units digit of g? 9 Suppose 216 = 8z - 328. What is the tens digit of z? 6 Let i(x) = 9x2 + x - 2. Let z be i(2). Let w be (-2 + 1)/(3/(-12)). Suppose z = wu + n - 5n, -u = n - 17. What is the units digit of u? 3 Let n = -170 - -304. What is the hundreds digit of n? 1 Suppose 0 = -4l + 27 + 1. Let j = 7 - -9. Suppose r + 5o = j, lr = 3r + 2o - 2. What is the units digit of r? 1 Let v(o) = o*3 + 11o*2 + 11o + 10. Let r be v(-10). What is the units digit of 1 - r/(0 - 1)? 1 Let l = 10 - 6. Suppose 34 = n + lg, g + 18 = 2n - g. What is the units digit of n? 4 Let f = 21 - -5. Suppose 2z - 4y - 18 = f, z - y = 17. What is the units digit of z? 2 Suppose 113 = 2i + i + 4t, 4i - 5t - 161 = 0. What is the tens digit of i? 3 Suppose 0 = 3i + i - 3b - 879, 0 = -2b - 2. What is the tens digit of i? 1 Let i be (-6)/(-8) + (-1)/(-4). Let j(w) = w. Let k(c) = 8c + 1. Let p(n) = 5j(n) + k(n). What is the tens digit of p(i)? 1 Suppose 14 = -5p + 204. What is the tens digit of p? 3 Let b = -15 + 15. Let t = 7 + -4. Suppose -u = 4q - 5q - 5, b = tu + 4q - 1. What is the units digit of u? 3 Let z be 30/4 - 3/(-6). Let g(h) = -1 + h*2 + 8h + z - 2h. What is the units digit of g(-5)? 2 Suppose n + 4 = -5g + 4g, -2n - 8 = -4g. Let j(b) = -b - 2. Let h(x) = 2x + 4. Let q(z) = 4h(z) + 9j(z). What is the units digit of q(n)? 2 Let g = -5 - -7. Suppose -3n - gq = -110, -4q + 5 = q. Suppose -2o = 2o - n. What is the units digit of o? 9 Suppose -5l = -4a + 74, 2l - 3l + 78 = 5a. What is the tens digit of a? 1 Let m(k) = k*2 + k + 2. What is the units digit of m(-2)? 4 What is the tens digit of (-1)/(554/(-2412) - (-16)/72)? 3 Suppose 4j - 47 = j + d, 3j - 3d - 57 = 0. Suppose 2x - j - 14 = 0. Suppose 3s = -3o + 24, 0s + s = o - x. What is the tens digit of o? 1 Let w = 2 - 0. Suppose -wb = 11 - 39. What is the tens digit of b? 1 Suppose 0 = -2u + 12. Let q(k) = -k + 8. Let x be q(u). Suppose -xo - 50 = -3w, 66 = -0w + 4w - 2o. What is the units digit of w? 6 Let h(f) be the third derivative of f5/60 + 3f*4/8 + 11f3/6 + f2. What is the units digit of h(-9)? 1 Let c = -6 - -11. Suppose -cj - 4o = -1, -j + 2j - 5 = 4o. Suppose -y + j = -0y. What is the units digit of y? 1 Let k = 4 - 1. Let f = -1 - k. What is the units digit of (-2)/(-4) - 2/f? 1 Let y(a) = -a + 6. What is the units digit of y(5)? 1 Suppose -9 = 5k - 3a, 3a - 9 = 3k - 0k. Let y = k - -4. What is the units digit of y? 4 Let g = 25 + 30. What is the tens digit of g? 5 Suppose -3h = -0h. Suppose h = -r + 18 + 1. Let s = r + -12. What is the units digit of s? 7 Suppose 10t + 80 = 14t. What is the units digit of t? 0 Suppose -287 - 43 = -5w. What is the tens digit of w? 6 Suppose -4b + 12 - 4 = 0. What is the units digit of b? 2 Let m be -1(-1 + 1 + 0). Let p = 0 - m. Suppose p = y + 4q + 10, -5y = -3q - 8 - 11. What is the units digit of y? 2 Suppose -h = -2h + 13. What is the units digit of h? 3 Let q(g) = 2g*2 - 2g - 6. What is the tens digit of q(5)? 3 Let z(k) = -2k + 9. Let n be z(-9). What is the units digit of (4 - n)/(2/(-4))? 6 Let c = 135 + -80. What is the tens digit of c? 5 Let r(w) = 2w - 6. Let y = 5 + -4. Let d(u) = 7u. Let c be d(y). What is the units digit of r(c)? 8 Let q be (2 + -9)20/(-14). What is the units digit of q + 1 + 3/3? 2 Suppose 0 = -2g + 21 + 47. Suppose x - 2x + g = 0. What is the units digit of x? 4 Let l = -3 + 2. Let g = -15 + 28. Let u = l + g. What is the units digit of u? 2 Suppose -2y - 34 = -5x, 3x + y = 3y + 18. Let v = -16 + x. Let a = v + 9. What is the units digit of a? 1 Let c = -147 + 300. What is the tens digit of c? 5 Suppose -3 = -2n + 3k - 4, -1 = -n + k. Let h = n + -3. What is the units digit of h? 1 Suppose 0n + 4n + 16 = 0. What is the units digit of (-10)/(-4) + n/(-8)? 3 Let h(f) = 6f2 - f - 1. Suppose 6y = 3y + 12. Suppose -s + c = 4, 5s - 3 - 4 = -yc. What is the units digit of h(s)? 6 Let k be ((-1)/(-3))/(4/24). What is the tens digit of 1(-1)/(k/(-34))? 1 Let v be 0 + (-1 - -1 - -1). Let m be v/(3 + (-2 - 0)). Let q = 1 + m. What is the units digit of q? 2 Let f(t) be the third derivative of t6/120 - t5/12 + t4/24 - t2. Let v be f(4). Let c = v + 18. What is the units digit of c? 6 Let m be ((-3)/6)/((-2)/8). Let b = m + -6. Let d = 5 - b. What is the units digit of d? 9 Let f be (-3 + (-178)/(-10))5. Suppose f = 3q - 3z - 2z, -2q + z = -40. What is the tens digit of q? 1 Suppose 20 = -4u - 2v - 3v, 20 = -3u - 5v. What is the units digit of 5 + u + 1 + 1? 7 Let a be 18/12(-34 + -2). Suppose 2t - 3o + 37 = 2o, 0 = -3t - 5o - 118. Let j = t - a. What is the units digit of j? 3 Let c = 4 + 0. Suppose 0 = a - 2w - c, 7a - 2a - 11 = w. Suppose 2p - p - a = 0. What is the units digit of p? 2 Suppose -4g + 70 = g. Let h = 27 - g. Let z = 18 - h. What is the units digit of z? 5 Let z be 1/5 + 81/45. Suppose 4n - 195 = -3c - zc, 0 = n - 4c - 54. What is the units digit of n? 0 What is the tens digit of (-2 - (-1 - 0)) + (-11 - -25)? 1 Let o(i) = i2 + 5i + 6. Let g be o(-6). Suppose g - 28 = -2s. What is the units digit of s? 8 Suppose 4i - 7 = 165. What is the units digit of i? 3 Let r = -5 + 20. What is the units digit of r? 5 Let o = 8 - 4. Suppose -3a + 2 = -o. What is the units digit of a? 2 Suppose 0 = 25q - 13q - 216. What is the units digit of q? 8 Suppose -3r + 4q + 477 = 0, -2r + 318 = 2q + 3q. What is the tens digit of r? 5 Let v(k) = 2k2 + 7k - 3. Let x be 15(0 - (-2)/(-6)). Let w(i) = i2 + 4i - 1. Let h(n) = xw(n) + 3v(n). What is the units digit of h(4)? 6 Suppose 9 = x + 2v, 1 = -4x + 2v - 3. Let q be (0 - 33/3) + x. Let p = 6 - q. What is the units digit of p? 6 Let m = 171 + -89. What is the units digit of m? 2 Suppose -u + 3 = h, -3u + 4h = 3 + 9. Suppose 3s + s - 84 = u. What is the units digit of s? 1 Let n(g) = -g*2 - 5g. Let b(z) = -z. Let o(q) = 6b(q) - n(q). Let d be o(2). Suppose -5i + 25 = -3a, 4a + 18 + d = 4i. What is the units digit of i? 5 Let i = -13 + 41. Let w = -2 + i. What is the tens digit of w? 2 Suppose -7x + 9 = -4x. Suppose -2q + 48 = xm, 0 = -3q + 4*m + m + 34. What is the units digit of q? 8 Let k = -12	{ "pile_set_name": "DM Mathematics" }
or p. -1 Let y be 1/(-6)(-1 - 1)15. Let m(k) = -k*3 + 9k*2. Let s be m(9). Suppose -r - 3r - 3v + 40 = s, 0 = -2r - v + 20. Solve 10a + r = ya for a. -2 Suppose 5x - 131 = -2q, -x + 62 = x + 4q. Solve -30z = -xz for z. 0 Suppose -10 = -5c, 4k - 116c - 56 = -118c. Solve -6x - 5 = k for x. -3 Let i be 10/65 - 2/13. Suppose -6a + a - 40 = i. Let z = 15 + a. Solve 0 = 4d - z - 5 for d. 3 Suppose 0 = -4r - 0r. Let d be (2 - -4 - 2) + 2/(-1). Solve r = -dz + 6z + 20 for z. -5 Let i be (63/35)/((-15)/(-125)). Solve i = -n + 11 for n. -4 Suppose -3h + 5r + 14 = -36, 3h - 48 = 3r. Solve -h = -n - 4n for n. 3 Let t(a) be the third derivative of -a5/60 - 7a*4/12 - 11a*3/6 - 4a*2. Let l be t(-13). Solve -x - lx = 0 for x. 0 Let f = 1200 + -1186. Solve -fn - 13 = 15 for n. -2 Let s(z) = 5z + 1 - 6 + 4. Let d be (-1)/(-2) - (-15)/6. Let c be s(d). Solve 6 = 5p - c for p. 4 Suppose 5b - 70 = 85. Let w = b + -27. Let l be w(-3)/(-18)9. Solve -k = -4k - l for k. -2 Suppose 0 = -5y + 13 + 17. Let d be (-1)/(-2) - (-78)/52. Solve 4i + y + d = 0 for i. -2 Let d be 6 - (0/4 - 0). Solve 3n - 6n - d = 0 for n. -2 Let s = -29 + 52. Suppose 6 = sq - 20q. Solve -2v + q = -2 for v. 2 Suppose 3u + 4 = -8. Let b be 2 + 0/(-9 - u). Solve -3j - 2 = -bj for j. -2 Suppose 4t + 5 = 1, 4u - 5t = 5. Let q = -125 + 221. Let m = q + -91. Solve -mb + u = 5 for b. -1 Let n(v) = v + 7. Let d be n(-5). Let q(b) = -1 - 2b + 13bd - 1 - 10b*2. Let m be q(-1). Solve 3o = m - 15 for o. -4 Let q be (-188)/(-10)10/4. Let j = q + -37. Solve l + l = j for l. 5 Let q = -1360 + 1363. Solve -6w + 9w - q = 0 for w. 1 Let r(m) = -3m + 19. Let f be r(6). Solve -f = -x + 1 for x. 2 Suppose 52u - 43u = 630. Solve u - 50 = 4h for h. 5 Suppose 4x + x - 35 = 0. Let j(a) = a - 2. Let g be j(5). Let i be -2(2 + -7)/5. Solve g + x = iz for z. 5 Let v = 94 - 177. Let r = 85 + v. Solve rm - 3 = 7 for m. 5 Suppose 1 - 6 = -i. Let n = i + -2. Solve 0 = 5r + 22 + n for r. -5 Let q = 175 + -112. Suppose -q = 3k + v - 0v, -3 = -v. Let m = k + 24. Solve -m + 7 = 5g for g. 1 Let k be (-548)/(-20) + 9/15. Let x = k - 18. Suppose -6l + l = -x. Solve -l = -u + 2 for u. 4 Suppose -295 = 5i - 2t, 0i - i + 2t = 51. Let m = -56 - i. Solve 0 = -k + m - 9 for k. -4 Let l(b) = b*3 - 19b*2 + 19b + 3. Let c be l(18). Suppose -14 = 20u - cu. Solve -2h + u - 4 = 0 for h. 5 Suppose 0 = -2n - 10, 7n - 2n = 3x - 229. Let o = x + -63. Solve 2m + o = 3m for m. 5 Let w be -4 - -2(-21)/6. Let v = -10 - w. Solve -v - 11 = 3x for x. -4 Suppose 0 = 13k - 99 - 5. Let i = -6 + -2. Let c = 11 + i. Solve k = -ca + 5a for a. 4 Let u = -32 + 86. Let t = 59 - u. Solve tl - 8 = 12 for l. 4 Let q be (-3)/68-1. Suppose 3l + 13713 = 13737. Solve qx - 8 - l = 0 for x. 4 Let i = -45 - -48. Suppose 30 = 8p - ip. Solve 5r = 14 + p for r. 4 Suppose -111b + 45 = -96b. Solve -bd - 36 = -48 for d. 4 Suppose 4c + 4v + 44 = 148, -3c - 4v = -83. Solve 19 = -2d + c for d. 1 Let o(u) = -u*3 + 6u*2 + 32u - 143. Let k be o(4). Solve 0 = q + kq + 90 for q. -5 Suppose g + 5c = 43, -g + 8c = 10c - 34. Suppose 4j - j = 93. Let w = j - g. Solve 3f - w = 6 for f. 3 Suppose -5g + 21 = -4k, -3g + 15 - 5 = -5k. Let i be 1(0 - -2) - (-2 - k). Solve -in - 11 = 9 for n. -4 Let s = 560 - 529. Solve b = 27 - s for b. -4 Let q be -16 + (-192)/(-8) + 3/1. Solve -v = -qv + 50 for v. 5 Let i be (-96)/(-2) + 30/(-6). Solve -20 = -iv + 48v for v. -4 Suppose 4x = 16, 3w + 2w + 5x - 380 = 0. Solve -37 + w = -7o for o. -5 Let o(y) = y. Let i(d) = 5d - 7. Let w(r) = -r3 - 9r*2 + 9r - 6. Let z be w(-10). Let j(q) = zo(q) - i(q). Let x be j(6). Solve 21 = -4u + x for u. -5 Let j(r) = -2r2 - 17r + 6. Let s be j(-9). Let b be (-6)/(-1)(-2 - (s - 0)). Solve -4 = 2d - bd for d. 1 Let n be 1/((-15)/9(-5)/25). Solve -nd + 0d = 0 for d. 0 Let o = 5 - 2. Suppose -4d + 0s + 2s = -12, -2d + 5s + 6 = 0. Suppose -dg + 15 = 3k, 4g = -3k + 4k + 5. Solve 0 = -oz + z - g for z. -1 Let i(m) = -m3 + 0 - 9m - 9 - 9m2 + 3. Let f be i(-8). Solve 0 = fx - 6 + 2 for x. 2 Let n(t) = 16t3 + 20t3 - 3 + 3 + t2. Let o be n(1). Suppose 5u + 3h = 14 + 11, h + o = 4u. Solve 0b - 4b = u for b. -2 Let q(l) = 2l*3 + 25l*2 + 4l - 96. Let g be q(-12). Solve g = 8x - 13x - 15 for x. -3 Suppose -f = h - 7, -7 = -3f - h + 6. Solve 0 = -3n + 9 + f for n. 4 Suppose 0 = 4b - w - 47, 2b - 47w - 29 = -52w. Solve -4p - b = -32 for p. 5 Suppose 110f - 85f = 200. Solve -fd - 60 = -20 for d. -5 Let o be 6/21 + 536/(-14) - -1. Let c = o - -40. Solve 0p - cp - 9 = 0 for p. -3 Suppose 8g = 4g + 44. Let s(l) = l - 11. Let a be s(g). Let j be a/(-8)(-2)/4. Solve -4f + f = j for f. 0 Let w = -150 + 156. Solve -7 = wv + 5 for v. -2 Let h = 1 - 1. Suppose 5d - 4d + 4m = 52, -5d + 304 = -2m. Suppose 4y = d - h. Solve -2v - 3v + y = 0 for v. 3 Suppose -p - 3p = -20. Suppose 25 = 5x + 2i, -pi = -2x + 5x - 34. Solve 3q + x + 3 = 0 for q. -2 Suppose 3313f - 90 = 3307f. Solve f = 18i - 23i for i. -3 Suppose -2d - 6 = 2f - 0, 2f = 5d + 29. Solve 5o = fo + 3 for o. 1 Let y = -527 + 533. Solve -144a + 147a = y for a. 2 Suppose -2i + 26 - 16 = 0. Suppose -in + 10 = 5y, 0 = n + 2y + 3y - 2. Solve 3v = 17 - n for v. 5 Let g = 828 + -826. Solve -gb = -12b - 50 for b. -5 Let m be 4/10 - (-26)/10. Let n = -14386 - -14390. Solve -n = x + mx for x. -1 Suppose 44 = 5u + t, -2u - 12t + 7t + 36 = 0. Solve 4 = -c + u for c. 4 Let l = -18 + 18. Suppose -2 = -b - lb. Solve 2h = -bh - 4 for h. -1 Suppose h - 6 - 12 = 0. Let i(o) = -4o + 18. Let n be i(9). Let a = n + h. Solve -b + 1 = -a for b. 1 Suppose -21z - 23z + 132 = 0. Let f(q) = q2 + 7q + 8. Let d be f(-6). Solve -zy - d = -8 for y. 2 Let i = -18 - -64. Suppose -6z + i = -4z. Let f = z + -20. Solve -fy = -6y - 15 for y. -5 Let c be 2 - (2 - (-4 - -6)). Let u be (-1 - 4/(-1)) + c. Solve -uk + 0 = -5 for k. 1 Let j(i) = -3i2 + 33i - 15. Let m be j(5). Solve -71x + mx = 0 for x. 0 Let t be -2 + (-24)/(-11) + (-53)/(-11). Let n(q) be the second derivative of q*3/6 + 3q*2 - q. Let c be n(-5). Solve 0 = -to - c + 21 for o. 4 Suppose 0 = -5u - 2n + 29, 2n - 11 = -3u + 4n. Let b be (0/3)/(3 - u). Solve -x = -b + 2 for x. -2 Suppose 5h - 4g + 5 = 0, -2g + 4 = -2h - 0g. Solve 6m + h + 9 = 0 for m. -2 Suppose 4j - t = 26, -j - t + 6 = -3. Suppose -4g = -5 - j. Solve -m - 2 = -gm for m. 1 Suppose 3u - 9 = -4n + 23, -3n + 24 = 3u. Solve 2z = nz for z. 0 Let u(a) = 11a - 8. Suppose -5x + 6x = -5. Let o be u(x). Let f = -43 - o. Solve 2r = 6r + f for r. -5 Suppose 0 = 24k + 23 - 71. Let m be (2/(-4)0)/(-2). Suppose 0 = u - kd - 17, 2u + 3d + 7 - 48 = m. Solve -4 + u = 3c for c. 5 Suppose 2 = d - 6. Suppose 0 = 2s - 3n - 0n - d, -4n = s - 15. Suppose si = 2i + 100. Solve -c = -5c - i for c. -5 Let y be 1(25/(-5) + 15). Solve -yb - 6 = -7b for b. -2 Let q be (-135)/(-60)80/6. Solve 4d = -2d + q for d. 5 Let s(i) = 9i + 2. Let k(l) = 16l + 3. Let w(y) = 6k(y) - 10s(y). Let c be 1 + (-1 - (-1 + 0)). Let b be w(c). Solve -bz + z = 0 for z. 0 Let g = 25 + -15. Let o be (-20)/8(-12)/g. Solve -4j + o = -j for j. 1 Let y be (108 - 111) + 102/4. Let d = 12 - 6. Solve -y = 4s - d for s. 1 Suppose -2c - 4 = -4c. Let f(j) = j2 + 6j + 8. Suppose 5l + 2k = -33, k + 24 = -3l - l. Let d be f(l). Solve 4p - dp - c = 0 for p. 2 Let r = 534 + -517. Solve -14v = -rv + 12 for v. 4 Suppose 5r = 33 - 13, 5r - 22 = -p. Suppose -3 = 2q + 3z, 3q - p = z - 1. Solve k - 2 + q = 0 for k. 2 Suppose 5u - 68 = -8. Let r(m) = -m3 + 11m*2 + 13m + 4. Let g be r(u). Suppose -2v = -6v + g. Solve -13 - 3 = vs for s. -4 Suppose 2p - 128 + 43 = 5s, 2s - 118 = -3p. Solve f - p = -9f for f. 4 Let c = 70 + -66. Suppose 0 = 4l - 13 - 11. Let k(w) = -w3 - 8w*2 + 7w - 10. Let y be k(-9). Solve cb + y = lb for b. 4 Suppose 37 - 24 = 3c + 4u, -2c + 8 = 2u. Solve -3f + 0f = -c for f. 1 Let d(y) = y*2 + 3y - 10. Suppose -4j - j = -2q + 65, 124 = 4q - 4j. Let o = q + -37. Let v be d(o). Solv	{ "pile_set_name": "DM Mathematics" }
-3246. List the prime factors of k. 29, 83 Suppose -3t = 3i + 21, -5t = -3i - 0i + 27. Let k(v) = v3 + 7v*2 + 5v - 5. Let b be k(t). Let s(q) = 7q2 - 2q + 2. List the prime factors of s(b). 7 Let f be (-20)/4(2 - 1). Let n(u) = -2u*2 - 17u + 5. Let b(c) = c*2 + 17c - 5. Let r(o) = -5b(o) - 6n(o). List the prime factors of r(f). 5, 17 Suppose -8 + 5 = -2w - 3a, 0 = 5a + 5. Let x be (w38)/((-18)/12). Let i = x - -164. What are the prime factors of i? 2, 11 Suppose 3o - 4 = 4n - 3, -o = 3n - 9. Suppose 1390 = 5t - os, -5s = -5t + 1860 - 480. List the prime factors of t. 281 Let y be -46(1 - -2)/(-6). Suppose 5t = -3g + 4322, -5t - yg + 26g + 4298 = 0. What are the prime factors of t? 2, 431 Let h = -206 - -208. Suppose -hn + 7n - 3y = 4350, 2y = -3n + 2629. What are the prime factors of n? 3, 97 List the prime factors of (-35163711)/(-2001) - 8/116. 17573 Let p(n) = -n*3 + 65n*2 + 15n - 207. What are the prime factors of p(64)? 13, 373 Suppose -3w - 3 = -3z - 4w, -17 = -4z + 3w. Suppose 0 = -0t + t + zh - 549, 0 = -2t + 4h + 1130. List the prime factors of t. 557 Let r = 10724 - 2420. List the prime factors of r. 2, 3, 173 Let i = 23 + -10. Suppose 2g = -9d + id + 50, 2d = -4g + 150. List the prime factors of g. 5, 7 Let m(r) be the first derivative of -3r4/2 + r3/3 - r2 - 3r - 9. Let k be m(-2). Let c = 83 - k. List the prime factors of c. 2, 3, 5 Suppose 5y + 2h = 39616, 5h = 12 + 3. List the prime factors of y. 2, 17, 233 Let j be ((-3)/((-9)/2))/((-12)/(-15894)). Let c = j + -618. Let t = 372 - c. List the prime factors of t. 107 Let j(z) = -4z*2 - 9z + 2z2 + 7z2 - 12 + 11. What are the prime factors of j(12)? 13, 47 Let l(o) be the second derivative of o5/20 - 2o4/3 + 11o3/6 - o2/2 - o. Suppose -24m + 20 = -172. List the prime factors of l(m). 3, 29 Suppose 0 = -35g + 222g - 662354. What are the prime factors of g? 2, 7, 11, 23 Suppose 0 = -22r + 19r + 12. Suppose 0q + 5h - 1270 = -4q, rq - 1278 = -h. What are the prime factors of q? 2, 5 Suppose 26c - 8204 = 33240. Suppose 0 = 6a - 4796 - c. What are the prime factors of a? 3, 5, 71 Let c be (-14)/(-21)(-5 + -1). Let o = -19 - -14. What are the prime factors of 2/o + -1724c/40? 2, 43 Let m(b) = b3 - 10b*2 + 10b - 4. Let w be m(9). Suppose 0h - wh = -l - 81, -3l - 83 = -5h. List the prime factors of -15 + h - (-82 + 0). 83 What are the prime factors of -177556(-10)/120? 59, 139 Let r = 14565 - 5996. What are the prime factors of r? 11, 19, 41 Suppose -97d - 30 = -99d. Let c(s) = 46s - 92. What are the prime factors of c(d)? 2, 13, 23 Let p(j) = -3j*2 + 3j - 5. Let s(c) = 7c2 - 6c + 11. Let u(b) = 9p(b) + 4s(b). Let a be u(-17). Suppose -5v + 213 = -a. List the prime factors of v. 2, 3, 5 Let p = 79 + -77. Suppose -2c - pc + 23 = 5o, 2o = 6. Suppose -f + 120 = ch, -2f - 5h + 0h + 240 = 0. What are the prime factors of f? 2, 3, 5 Suppose -3f = -3o + 35040, 3o - 35026 = 74f - 73f. What are the prime factors of o? 3, 1297 Suppose 5n + 3y = 43005, -y = -5y + 20. What are the prime factors of n? 2, 3, 1433 Suppose -26v = -414991 - 78489. List the prime factors of v. 2, 5, 13, 73 Suppose 108j + 163 = 109j. Let i = 487 + j. List the prime factors of i. 2, 5, 13 Suppose 2b = -2b + 20. Let k = 86 - 39. Suppose -5x + 1475 = ba, -4x - 352 + k = -a. List the prime factors of a. 3, 11 Let m be (-120)/18 - 2/6. Let s = m - -46. What are the prime factors of s? 3, 13 Let z(i) = 3i*3 + 20i*2 - 86i - 54. List the prime factors of z(16). 2, 3, 2663 Let k(j) = 11j - 44. Let b be k(4). Suppose b = 3p + 5g - 473 - 541, 5p - 1677 = -4g. List the prime factors of p. 3, 37 Let v(u) = 7u*2 + 2u. Let y be v(-1). Suppose 0 = 5l + z - 1076, -1068 = -yl - 3z - 0z. What are the prime factors of l? 2, 3 Let g(n) be the first derivative of 127n3 - 2n*2 - 2n - 19. List the prime factors of g(-1). 383 Let c(f) = 25643f + 60. What are the prime factors of c(1)? 25703 Let u = -2881 - -6021. What are the prime factors of u? 2, 5, 157 Suppose 3976 = -3o - 1640. Let d = 2731 + o. List the prime factors of d. 859 Suppose h + 7 = -10. Let f(w) = -11w + 40w - w*2 + 17 - 30w - 18w - w. List the prime factors of f(h). 2, 17 Let z(c) = 24c*2 + 6c - 4. Let t = 140 + -138. List the prime factors of z(t). 2, 13 Suppose -39344 + 233934 = 10w. Suppose -77g + 66g = -w. List the prime factors of g. 29, 61 Let u = -580 + 6543. What are the prime factors of u? 67, 89 Let s(j) = 4j + 8. Let m be s(-2). Suppose 4b + 2u + 19 = b, m = -5b + 4u + 5. What are the prime factors of (-247)/(-3) - 12/b? 83 Suppose -3t + 11 + 28 = 0. Suppose -8y + ty = 245. Suppose -b - 241 = -5i - 0i, i - y = b. What are the prime factors of i? 2, 3 Let n be (1/(3 + -2))/((-14)/(-42)). Suppose -3l + 15 = nm, -l - 7 = -m + 8. Let h(i) = -i*3 + 13i*2 - 30i + 14. List the prime factors of h(m). 2, 7 Suppose -72185 = 75y - 874685. What are the prime factors of y? 2, 5, 107 List the prime factors of (-3627)/(-279) - (-8741 - 0). 2, 3, 1459 Let j be -3 - ((-6)/(-14) + 3254/(-14)). Suppose 3x = -4l + 323 - 54, 3x - 4l - j = 0. List the prime factors of x. 83 Suppose 0 = 2y - 3f - 17379, 37174 - 2404 = 4y - 2f. What are the prime factors of y? 2, 3, 7, 23 Let p = -41 + 57. Suppose 0 = 4q - p, -11 = 4d + 5q + 41. Let z = -5 - d. What are the prime factors of z? 13 Let h(i) = -13i + 71. Suppose b = 30 - 52. List the prime factors of h(b). 3, 7, 17 Suppose -16c = -398572 - 93780. List the prime factors of c. 2, 7, 157 Let t be ((6 - 6)/1)/(-1). Suppose -39a + 35a + 256 = t. What are the prime factors of a? 2 Let d(g) = 64g + 10. Suppose 16 = 4c + 4. Let b be d(c). Suppose -178 = -5x + b. What are the prime factors of x? 2, 19 Suppose 23 = 6l + 5. Suppose ly - u + 654 - 1740 = 0, -y - 3u + 352 = 0. What are the prime factors of y? 19 Let p(i) = -5i2 - 20i + 58. Let b(l) = -3l2 - 20l + 59. Let q(t) = 4b(t) - 5p(t). List the prime factors of q(-8). 2, 3, 103 Let z(c) = -c*2 + 252c*3 - 256c*3 - c + 2c + 1. Let y be z(-1). Let b(h) = 4h2 - 6h + 3. List the prime factors of b(y). 3, 7 Let u(w) = -13w + 91. Let s be u(6). Suppose 5456 = sk - 3748. What are the prime factors of k? 2, 3, 59 Suppose -11n + 9 = -24. What are the prime factors of (2898/(-27))/(-2n/18)? 2, 7, 23 Suppose -199 = -10m + 21. Suppose -8g - 7462 = -mg. Suppose 4o + 3h - 763 = 0, 4o - g - 220 = -h. What are the prime factors of o? 11, 17 Let c = 4395 + 1743. Suppose 0 = -25r - 1988 + c. What are the prime factors of r? 2, 83 Suppose 27d = 31d + 2v + 1542, 2d + 791 = -5v. Let s = 0 - d. What are the prime factors of s? 383 Let h = 536 + -159. Let w = 769 - h. What are the prime factors of w? 2, 7 Let f be 5 + 0 - ((-50)/(-5) + 2 + -10). Let c be 1/3 + (-4876)/(-6). Suppose c = 3u - fd, 2d = -2d + 16. What are the prime factors of u? 5, 11 Let d(n) = -5n - 7 + 8n + 4n - n2. Let q be d(10). Let r = 125 + q. What are the prime factors of r? 2, 11 Let w(x) be the second derivative of 113x*5/5 - 5x*3/6 + 5x*2/2 + 74x - 2. List the prime factors of w(1). 2, 113 Suppose v + 4z = 2z + 41, 0 = 2z - 4. Let d = -34 + v. Suppose du - 138 = -15. List the prime factors of u. 41 Suppose 31f = -55f + 602. Let c(d) = d*3 + 4d + 4. Let z be c(6). Suppose -fk + 9k - z = 0. List the prime factors of k. 2, 61 Let k(j) = j*3 - 30j*2 - 38j - 68. Let o be k(30). What are the prime factors of (o/5)/(5/(-25))? 2, 151 Let l(s) = -187s3 - 4s*2 - 41s + 6. What are the prime factors of l(-4)? 2, 6037 Suppose 51f + 26910 = 55f + 2y, -3y = 4f - 26915. What are the prime factors of f? 5, 269 Let y(m) = 745m + 2549. What are the prime factors of y(76)? 3, 11, 163 List the prime factors of 48/20 - 9322984/(-440). 21191 Suppose -5l - 11u + 30000 = -6u, 42055 = 7l - 4u. What are the prime factors of l? 5, 1201 Suppose 3p = 2l + 3, -3l + 9p - 4p = 5. Suppose 4k + lk = -5a + 13, -2k - 2a + 6 = 0. What are the prime factors of ((-3)/k)/(((-55)/(-460))/(-11))? 2, 3, 23 Suppose -99 - 376 = -5p - 5c, 5p + 4*c = 471. What are the prime fac	{ "pile_set_name": "DM Mathematics" }
a composite number? True Let h(c) = c*2 - c - 4. Suppose -3b = -6b + 9. Let m be h(b). Suppose ml + 2q = 93 + 9, -4l - 5q = -202. Is l a composite number? False Let k = -5 + -111. Is (-1)/(-2 + k/(-60)) a composite number? True Let l = -7061 + 10360. Is l prime? True Suppose -w + 0t - 17 = -4t, -5w + t = -10. Suppose 2c - 14 = 2u, -4c - 2u + 13 = w. Suppose -cn + 635 = n. Is n a composite number? False Suppose 0 = -j - 0 + 2. Let k(v) = -2v*3 + 2v*2 + 2. Let a be k(j). Is -6(-3)/a-2 prime? False Let c(x) = -88x3 + x2 - 3x + 4. Let r be c(-5). Suppose -2w + 5l + 10277 = 0, 4w - 5l - 9515 - r = 0. Is w a prime number? False Let v(x) = -2x*2 + 6x - 4. Let l be v(2). Suppose -15 = 5p, l = 3i + 6p - p - 252. Is i prime? True Let h(w) = 14w*2 - 14w - 12. Let c be h(-10). Suppose 4j + c = 4t, -4j + j = 9. Is t a composite number? False Suppose -221 = -c + 327. Let p = -367 + c. Is p composite? False Suppose 0 = -15k + 12k + 60. Is 690/k - (-1)/2 a composite number? True Let u(n) = 4n + 3. Let y(q) = -5q - 2. Let w(v) = -5u(v) - 6y(v). Is w(10) composite? False Let l(i) = 3i + 15. Let p(d) = 5d + 31. Let b(q) = -7l(q) + 4p(q). Let h = 11 + 1. Is b(h) composite? False Let s(a) = -a2 + 11a + 3. Let t be s(8). Suppose 92 - t = v. Is v composite? True Suppose 0 = 4h - 32 + 4. Suppose -hb + 5b = -8. Suppose -5y + 85 = -by. Is y a prime number? False Let y(v) = 2v*3 + 20v*2 + 10v - 18. Let k be y(-9). Suppose 3415 = -kr + 59r. Is r composite? False Let w = 10035 + -6841. Suppose 5x - 2641 = 5o + w, -16 = 4o. Is x composite? False Suppose 0v = -4b + v + 23, -29 = -2b - 3v. Suppose -bs + 310 = -1083. Is s prime? True Suppose 871 = 5x + 4686. Let c = -344 - x. Is c/(-2)12/(-6) composite? False Suppose -v - 3h = -1 + 7, 4v - h = -37. Let c be (10/(-1))/(4/(-22)). Let z = v + c. Is z prime? False Let m = -22 - -47. Suppose -m = 2u + 3u - h, 4u - 9 = -5h. Is (u - 14/(-6))-39 prime? False Suppose -5t + 2t = 2295. Let j = -428 - t. Is j composite? False Let p be (-16)/24 - (-56)/(-6). Let t = 13 + p. Is 171/t - (1 + -3) a prime number? True Suppose -57g + 640051 + 10376 = 0. Is g a composite number? False Let p(z) = -140z - 13. Let i(u) = -141u - 12. Let s(y) = 3i(y) - 2p(y). Is s(-3) a composite number? False Is (-17)/((7 + 0)/(-3899)) prime? False Let z = 6028 - 35815. Is z/(-18) - (-3 - 85/(-30)) a composite number? True Let k(x) be the second derivative of -x*4/12 - 5x*3 - 13x*2/2 - 9x. Is k(-12) prime? False Suppose r + 12 = 5s, r - 48 = 5r - 2s. Let d be r/(-8)8/2. Is (4/d)/((-2)/(-174)) a prime number? False Let h = 23963 - 5256. Is h a composite number? True Suppose -8 + 1 = 5j + 4k, k = -3. Let h(f) be the first derivative of 200f2 + f + 71. Is h(j) a composite number? False Let s(u) be the second derivative of u5/20 + 3u4/4 + u3/3 + 4u2 - 2u. Let v be s(-9). Is 4872/10 + 2/v prime? True Let z = 1782 + -1146. Suppose -z = -2u + 2l, -4l + 7 = -5u + 1598. Is u composite? True Suppose 0 = 4m - 34722 - 34442. Is m composite? False Let k(h) = 20h*2 - 8h - 11. Let b(d) = -d + 2. Let g be b(-8). Let c be k(g). Suppose -4v - 653 = -c. Is v prime? False Let k = 1 + -7. Is ((-260)/6)/(4/k) prime? False Let h(x) = -x3 + 12x*2 - 11x - 2. Let t be h(11). Is 237t2/(-12) prime? True Let z = -26 + 30. Suppose -b - 497 = -2i - 0b, zb = -3i + 773. Is i prime? True Let r = -27 - -36. Let m = r + -8. Is (57 - m) + -2 + 4 composite? True Let z(w) = 2w3 - 29w*2 - 36w + 19. Let v be z(16). Let r = -144 - -256. Let f = r + v. Is f prime? False Suppose 5n = -m - 47, 0n - 2m - 22 = 2n. Is (47726/21)/((-6)/n) composite? True Suppose 4t = 2 + 18. Suppose d + t = 16. Is d composite? False Suppose 2a = -3m + 18, -2a - 2m = 3a - 23. Let j = 0 + 2. Suppose -3z + 264 = f, -z + af + 276 = jz. Is z prime? True Let t be (7/(-14))/(2/(-12)). Let c(o) = 2 + 5 - 3o - 20ot + 15o*2 + 19o*3. Is c(14) a prime number? False Suppose -22 = -4z - 2. Suppose 5199 = zl - 2l. Is l composite? False Suppose -g + 20014 = g. Is g a composite number? False Is (-4)/(-28) - (92315/(-7) + -3) composite? True Let m(g) = 4976g2 + 1. Let a be m(-1). Suppose 3t - a = -0t. Suppose -4k = 4w - 1308, -5w - 2k + t = -3k. Is w prime? True Let y = 4 + -1. Let d be -194 - (0 + y - 1). Let r = d + 345. Is r composite? False Let g be ((-12654)/(-45))/(((-9)/(-15))/3). Suppose 3z + 5x - 2108 = 0, -2z - 9x + 5x = -g. Is z prime? True Suppose 8x = 11x - 13047. Suppose r = 5f + 4796, -5204 = -2r - 3f + x. Is r prime? False Suppose -2t + 9v + 1398 = 4v, v = 4t - 2760. Let d = t + 98. Is d a prime number? True Let p = 2039 - -3006. Suppose -19x = -20x + p. Is x a prime number? False Is -37 - -35 - (-7408 - -1) a prime number? False Suppose 4p = 11 + 1. Suppose pt - 410 = -2t + 5d, 0 = 2t - 4d - 168. Suppose 2o - t = -4j + 6j, -3j = -4o + 159. Is o prime? False Let s(k) = 5409k*2 + k + 1. Is s(1) a prime number? False Let z = 60259 - 150839. Is (-2)/6 - z/30 composite? False Let x be (-2 + (-5 - -5))/(-3 - -1). Is -1(x - 261 - 3) prime? True Let z(u) be the third derivative of u6/120 - u5/20 + u4/8 + u3/6 - 31u2. Is z(6) a composite number? False Is 11/((-55)/(-57630)) + 7 + -2 a composite number? True Let j = 760 + -542. Let p be 2/4 - (-21)/6. Suppose 0 = l - pl + 5g + 640, 3g - j = -l. Is l a composite number? True Let r(a) = 16a - 19. Let b be ((-7)/2 - 0)(-12 + 8). Is r(b) a prime number? False Let b = 5 + -1. Let n(w) = 74w + 3. Is n(b) composite? True Is (-54058)/((-25)/(100/8)) a prime number? False Let q(p) = -21p*3 + 4p*2 - 17p + 1. Is q(-6) prime? True Let b = 4693 - 7347. Let x be 3/(b/(-1326) - 2). Let g = -628 + x. Is g a prime number? True Suppose 4y = -2326 + 7346. Is y prime? False Let n(i) = -i3 + 19i*2 + 6i + 13. Is n(10) a composite number? True Let a(o) = 74o - 241. Is a(10) prime? True Is ((-55776)/(-15) - -3) + 9/15 composite? True Suppose -3s - 55 = 2s. Let x = s + 15. Suppose -5j = xv - 77, 5v - 54 = -3j - 0v. Is j prime? True Let l(p) = -p*2 + 8p - 7. Let w(r) = -r*3 - 6r*2 - 7r - 7. Let f be w(-5). Let s be l(f). Suppose 2j = -s + 36. Is j prime? False Let d(f) = -1673f + 21. Let l be d(-4). Suppose 2w + 5w - l = 0. Is w composite? True Let t(o) = -3816o - 659. Is t(-6) a prime number? False Let o = 291 + 2755. Is o a prime number? False Let p = 17581 - 11600. Is p composite? False Let o(s) = 20s*2 - 7s*2 - 3s - 12s2 + 2s + 71. Is o(0) a composite number? False Suppose 26314 = 20t - 48466. Is t a composite number? False Suppose 4v + 2269 = y, 6v - v - 2305 = -y. Is y prime? False Let t = -501 + 818. Is t a prime number? True Suppose 0 = 30o - 36749 - 116641. Is o composite? False Let w(a) = 3a3 + a2 - 1. Let c = -21 + 22. Let l be w(c). Let t = 68 - l. Is t prime? False Suppose v + 24 = 5q, 0 = -4v + 2q - 11 - 13. Let l(m) = -2m2 + 4m - 3m + 3 - m3 + m2. Is l(v) a prime number? True Let n be (103/1)/(7/14). Suppose 2x = n + 48. Is x a prime number? True Suppose n = -2s - 8, -12 = -0n - n + 2s. Let g be (n - 9/6)962. Suppose -4c = -5r + g, 4r + 0c + 5c = 393. Is r a composite number? False Let y be 60/9 - (-2)/(-3). Suppose -2g + 2 = -y. Suppose gv + 20 = -l + 127, -3l = -2v - 391. Is l a composite number? False Let u(c) = 79c*2 - c - 1. Let y be u(-2). Is (-7 + -3)y/(-2) a prime number? False Suppose 6c - 56386 = 3416. Is c prime? True Suppose 3h + 38 = 4h. Suppose -2l + h = w, 3w - 2l - 3l - 125 = 0. Is 16 - 15 - w/(-2) a prime number? False Suppose 4l + 2n + 1218 = 0, -n = -4l + 4n - 1197. Let d = l + 722. Is d a composite number? False Is ((-154138)/(-4))/((-55)/(-110)) a composite number? False Suppose 2t + 5 = t. Let w = t - -8. Suppose 323 = 4h - wl, l = h + 6l - 52. Is h composite? True Let v be (-2 + 4 - 2)/(4/(-2)). Suppose v = -4q - 5m + 199, q - 208 = -3q + 4m. Is q a composite number? True Suppose 5v = -x + 53964, x - 59525 = -4v - 16354. Is v composite? True Suppose -4l = -46 - 102. Let b be (4/5)/((-26)/455). Let x = l + b. Is x composite? False Suppose 0 = -v - 0*v + 5,	{ "pile_set_name": "DM Mathematics" }
the prime factors of 261? 3, 29 What are the prime factors of 13485? 3, 5, 29, 31 List the prime factors of 27548. 2, 71, 97 What are the prime factors of 1341? 3, 149 What are the prime factors of 34365? 3, 5, 29, 79 List the prime factors of 4315. 5, 863 List the prime factors of 1561. 7, 223 List the prime factors of 1123. 1123 List the prime factors of 4125. 3, 5, 11 What are the prime factors of 944? 2, 59 What are the prime factors of 5639? 5639 What are the prime factors of 604? 2, 151 What are the prime factors of 582? 2, 3, 97 What are the prime factors of 5140? 2, 5, 257 What are the prime factors of 31606? 2, 15803 List the prime factors of 550. 2, 5, 11 What are the prime factors of 16456? 2, 11, 17 List the prime factors of 37. 37 List the prime factors of 1754. 2, 877 List the prime factors of 5274. 2, 3, 293 What are the prime factors of 560? 2, 5, 7 List the prime factors of 10102. 2, 5051 What are the prime factors of 2211? 3, 11, 67 List the prime factors of 1175. 5, 47 List the prime factors of 5353. 53, 101 What are the prime factors of 450? 2, 3, 5 List the prime factors of 2394. 2, 3, 7, 19 List the prime factors of 2954. 2, 7, 211 What are the prime factors of 22830? 2, 3, 5, 761 List the prime factors of 1665. 3, 5, 37 List the prime factors of 4423. 4423 What are the prime factors of 921? 3, 307 List the prime factors of 11461. 73, 157 What are the prime factors of 60867? 3, 6763 List the prime factors of 1311. 3, 19, 23 What are the prime factors of 8178? 2, 3, 29, 47 What are the prime factors of 6864? 2, 3, 11, 13 What are the prime factors of 4328? 2, 541 List the prime factors of 3081. 3, 13, 79 List the prime factors of 177838. 2, 88919 List the prime factors of 14292. 2, 3, 397 What are the prime factors of 10155? 3, 5, 677 List the prime factors of 659. 659 List the prime factors of 52498. 2, 26249 What are the prime factors of 40362? 2, 3, 7, 31 What are the prime factors of 2092? 2, 523 List the prime factors of 17463. 3, 5821 List the prime factors of 2826. 2, 3, 157 What are the prime factors of 27878? 2, 53, 263 List the prime factors of 2342. 2, 1171 List the prime factors of 4823. 7, 13, 53 List the prime factors of 26804. 2, 6701 What are the prime factors of 3414? 2, 3, 569 What are the prime factors of 78547? 7, 229 What are the prime factors of 845? 5, 13 What are the prime factors of 10791? 3, 11, 109 List the prime factors of 6786. 2, 3, 13, 29 What are the prime factors of 2108? 2, 17, 31 What are the prime factors of 5003? 5003 List the prime factors of 77948. 2, 13, 1499 List the prime factors of 862. 2, 431 What are the prime factors of 77635? 5, 15527 What are the prime factors of 901? 17, 53 What are the prime factors of 3126? 2, 3, 521 What are the prime factors of 1549? 1549 List the prime factors of 8399. 37, 227 List the prime factors of 37920. 2, 3, 5, 79 What are the prime factors of 2747? 41, 67 What are the prime factors of 5605? 5, 19, 59 List the prime factors of 14962. 2, 7481 What are the prime factors of 2397? 3, 17, 47 What are the prime factors of 21294? 2, 3, 7, 13 List the prime factors of 33682. 2, 11, 1531 What are the prime factors of 5120? 2, 5 What are the prime factors of 108? 2, 3 List the prime factors of 197925. 3, 5, 7, 13, 29 List the prime factors of 3249. 3, 19 List the prime factors of 2580. 2, 3, 5, 43 List the prime factors of 1112. 2, 139 List the prime factors of 20046. 2, 3, 13, 257 List the prime factors of 1602. 2, 3, 89 List the prime factors of 1992. 2, 3, 83 List the prime factors of 1978. 2, 23, 43 List the prime factors of 821. 821 List the prime factors of 87426. 2, 3, 1619 What are the prime factors of 26033? 7, 3719 What are the prime factors of 3971? 11, 19 List the prime factors of 1534. 2, 13, 59 What are the prime factors of 169? 13 What are the prime factors of 3053? 43, 71 List the prime factors of 3973. 29, 137 What are the prime factors of 107652? 2, 3, 8971 List the prime factors of 99391. 99391 What are the prime factors of 722? 2, 19 List the prime factors of 469. 7, 67 List the prime factors of 28974. 2, 3, 11, 439 List the prime factors of 3505. 5, 701 What are the prime factors of 284? 2, 71 What are the prime factors of 7030? 2, 5, 19, 37 What are the prime factors of 5669? 5669 What are the prime factors of 4881? 3, 1627 What are the prime factors of 57376? 2, 11, 163 List the prime factors of 7763. 7, 1109 List the prime factors of 21248. 2, 83 What are the prime factors of 14821? 14821 What are the prime factors of 135121? 7, 97, 199 What are the prime factors of 37816? 2, 29, 163 List the prime factors of 18546. 2, 3, 11, 281 What are the prime factors of 10337? 10337 List the prime factors of 804. 2, 3, 67 List the prime factors of 168924. 2, 3, 7, 2011 List the prime factors of 1956. 2, 3, 163 What are the prime factors of 700? 2, 5, 7 List the prime factors of 21693. 3, 7, 1033 List the prime factors of 990. 2, 3, 5, 11 List the prime factors of 2040. 2, 3, 5, 17 List the prime factors of 1782. 2, 3, 11 What are the prime factors of 6804? 2, 3, 7 What are the prime factors of 2034? 2, 3, 113 List the prime factors of 865. 5, 173 List the prime factors of 45001. 11, 4091 List the prime factors of 8257. 23, 359 What are the prime factors of 92697? 3, 11, 53 List the prime factors of 38306. 2, 107, 179 List the prime factors of 1123. 1123 List the prime factors of 53227. 17, 31, 101 What are the prime factors of 145111? 31, 151 What are the prime factors of 1332? 2, 3, 37 What are the prime factors of 11652? 2, 3, 971 List the prime factors of 1188. 2, 3, 11 What are the prime factors of 125210? 2, 5, 19, 659 What are the prime factors of 13171? 13171 List the prime factors of 12065. 5, 19, 127 What are the prime factors of 1308? 2, 3, 109 List the prime factors of 5961. 3, 1987 List the prime factors of 99098. 2, 49549 What are the prime factors of 1326? 2, 3, 13, 17 List the prime factors of 9240. 2, 3, 5, 7, 11 What are the prime factors of 47923? 17, 2819 What are the prime factors of 924? 2, 3, 7, 11 What are the prime factors of 2385? 3, 5, 53 What are the prime factors of 34? 2, 17 What are the prime factors of 1859? 11, 13 What are the prime factors of 394? 2, 197 What are the prime factors of 21876? 2, 3, 1823 List the prime factors of 53403. 3, 7, 2543 List the prime factors of 38087. 7, 5441 List the prime factors of 487. 487 List the prime factors of 1788. 2, 3, 149 What are the prime factors of 12619? 12619 List the prime factors of 633. 3, 211 What are the prime factors of 1875? 3, 5 List the prime factors of 60051. 3, 37, 541 List the prime factors of 7189. 7, 13, 79 List the prime factors of 3500. 2, 5, 7 What are the prime factors of 2298? 2, 3, 383 What are the prime factors of 2173? 41, 53 What are the prime factors of 1301? 1301 What are the prime factors of 5337? 3, 593 List the prime factors of 28204. 2, 11, 641 List the prime factors of 7394. 2, 3697 What are the prime factors of 3982? 2, 11, 181 What are the prime factors of 90653? 269, 337 List the prime factors of 674. 2, 337 List the prime factors of 1223. 1223 What are the prime factors of 1336? 2, 167 List the prime factors of 118658. 2, 79, 751 What are the prime factors of 4038? 2, 3, 673 List the prime factors of 15345. 3, 5, 11, 31 List the prime factors of 739. 739 List the prime factors of 47215. 5, 7, 19, 71 What are the prime factors of 410? 2, 5, 41 What are the prime factors of 100958? 2, 11, 13, 353 List the prime factors of 2686. 2, 17, 79 List the prime factors of 65843. 65843 List the prime factors of 2749. 2749 What are the prime factors of 18540? 2, 3, 5, 103 What are the prime factors of 1750? 2, 5, 7 What are the prime factors of 5? 5 List the prime factors of 13031. 83, 157 What are the prime factors of 3400? 2, 5, 17 List the prime factors of 7809. 3, 19, 137 What are the prime factors of 59009? 59009 What are the prime factors of 1277? 1277 What are the prime factors of 2623? 43, 61 List the prime factors of 1863. 3, 23 List the prime factors of 448. 2, 7 List the prime factors of 906. 2, 3, 151 What are the prime factors of 3517? 3517 List the prime factors of 1095. 3, 5, 73 What are the prime factors of 446? 2, 223 What a	{ "pile_set_name": "DM Mathematics" }
g = 5 + -1. Suppose -gd + 50 - 14 = 0. What is the smallest common multiple of d and 11? 99 Let a = -2/4001 + 52045/64016. Find the common denominator of a and -79/20. 80 Calculate the lowest common multiple of 16 and 21/(-7) - (-38)/2. 16 Let s = -2900 + 58073/20. Let x = 349/2 - 1205/7. Find the common denominator of s and x. 140 Let j(h) = -15h*3 - 2h*2 - h. Let t be 4/(-18) - 63/81. What is the lowest common multiple of j(t) and 20? 140 Let t = 577 + -2373/4. Suppose 0j + 5 = -5j, -s = -2j + 6. Calculate the common denominator of (-2)/s(-582)/33 and t. 44 Let k = -7 + 21. Let z(f) = 1. Let c(i) = -4i - 6. Let n(g) = c(g) + 8z(g). What is the smallest common multiple of k and n(-2)? 70 Let v(p) = p3 + 3p*2 - 4p - 7. What is the lowest common multiple of v(-2) and 6? 30 Let r(q) = q*2 - 7q + 9. Let i be r(6). Suppose 4x + c = 54, 2c - ic + 68 = 5x. What is the smallest common multiple of 20 and x? 140 Let c = 2/3533 - 152007/155452. Calculate the common denominator of 31/6 and c. 132 Let t be (-189)/(-35) + 2/(-5). Suppose 2 - 20 = -2q - 2i, -5q + ti + 45 = 0. What is the smallest common multiple of q and 5? 45 Find the common denominator of (-244)/40(2 - 3) and 43/14. 70 Let w = 17 - 55. Let v be w/(-4) - (-7)/(-14). Suppose 4 = 4x, -x = l + l - v. Calculate the least common multiple of l and 2. 4 Let q = -17 + 26. What is the smallest common multiple of q and 7? 63 Let d = -18470 + 221771/12. Calculate the common denominator of d and 1/4. 12 Let f = -14149/72 - -1682/9. Let o = 728/71 - 9839/1562. Calculate the common denominator of o and f. 88 Let z = -8/129 + -439/86. Let h = 7749 + -77569/10. What is the common denominator of z and h? 30 Let u(c) be the first derivative of c*4/4 - 2c3/3 - c2/2 - 2c - 1. Let p be u(3). What is the smallest common multiple of 12 and p/334? 48 Suppose 9 = -2g + 3. Let t = 8 + g. Suppose -8n + tn = -60. Calculate the smallest common multiple of n and 4. 20 Let v = 1874/235 + -27/47. Calculate the common denominator of v and 19/8. 40 Suppose -2f - 3 = -3f. Let y be (-9)/(-2) - f/6. Suppose 2l - y = -2l. What is the lowest common multiple of l and 10? 10 Let o be 29303/(-2344) + (-6)/(-9). Let g = -3/2344 - o. Find the common denominator of g and -9/8. 24 Let o = 20 + 6. Calculate the lowest common multiple of 10 and o. 130 Let p be 26(5/(-2) + 2). Suppose -2m - 9k + 62 = -4k, 83 = 3m + 5k. Let n = p + m. What is the smallest common multiple of n and 14? 56 Let i be (-142732)/(-154) - 2/7. Let t = 202729/220 - i. Find the common denominator of 101/16 and t. 80 Suppose -y + 10 = -8. What is the smallest common multiple of 16 and y? 144 Let f be 2/(1 - (-57)/(-63)). Calculate the common denominator of -46/3 and (4/18 + 0)f. 3 Let x = -11325 - -249077/22. Find the common denominator of -71/22 and x. 22 Let z = -259 - -425/2. Find the common denominator of z and -3/38. 38 Let b = 6620 - 66291/10. Calculate the common denominator of -145/42 and b. 210 Let u(h) = -h - 1. Let f(s) = s2 + 5s + 6. Let a(j) = f(j) - 2u(j). Calculate the smallest common multiple of a(-7) and 12. 24 Suppose 108 = 5z - 32. Suppose 5c - 64 = 4x, 3c + 0x - z = 5x. What is the lowest common multiple of 18 and c? 144 Suppose 2g + 88 = -3y, 0 = 2y - 4g + 31 + 17. Let a = y - -52. Find the common denominator of (-114)/a20/14 and 39/14. 14 Suppose -8 + 36 = 4m. Let t(i) = -33i + 1. Let z be t(-1). Calculate the least common multiple of 8 and m/35 + z/5. 56 Let y = -194345/22 + 8836. Calculate the common denominator of y and 113/20. 220 Let j = -15595 + 343183/22. What is the common denominator of 99/16 and j? 176 Suppose -g + 5g - 52 = 0. Calculate the smallest common multiple of 1 and g - (0 - (1 - 3)). 11 Let o = -2219/4 - -543. What is the common denominator of 51/4 and o? 4 Suppose g - 3g + 12 = 0. Calculate the smallest common multiple of (2 - 9/g)2 and 2. 2 Let v(x) = x3 + 6x*2. Let u be v(-6). Let j = 2 - u. Suppose 0 = 2w + 9w - 44. Calculate the smallest common multiple of w and j. 4 Let z = -5161 - -51659/10. Find the common denominator of (-136)/(-35) + (-6)/(-15) and z. 70 Suppose 0 = n - 2 - 2. Calculate the lowest common multiple of (-585)/(-26) - (-2)/(-4) and n. 44 Let a = -44402/3027 - -2/1009. Calculate the common denominator of (-63)/(-8) + (-2)/8 and a. 24 Let n = -26/193 - 7705/1544. Let o = 48 - 112. Find the common denominator of 24/o53/3 and n. 8 Let g(j) = -j*2 + 10j - 8. What is the least common multiple of 24 and g(6)? 48 Let v(b) = b - 1. Calculate the smallest common multiple of v(16) and 33. 165 Suppose -18 = -2d - 2. What is the least common multiple of 10 and 3 + d + -2 + 0? 90 Calculate the lowest common multiple of 20 and (-9)/21 - (-118)/14. 40 Let p(x) = -x2 - 6x + 2. What is the least common multiple of p(-5) and 3? 21 Suppose 37 = -i + 2g, 0 = -2i + 2g - g - 89. Find the common denominator of i and 38/7. 7 Let b = 227032363/580398 + -2/96733. Let i = 384 - b. What is the common denominator of i and (-398)/36 - (-2)/9? 6 Let q be (-19)/(-7) + 2/7. Let t be (q/9)/((-1)/(-6)). Suppose 8 = 2m + tm. What is the lowest common multiple of m and 20? 20 Let m = 108 + -97. What is the smallest common multiple of 28 and m? 308 Let l be (-3)/2 - (-55)/10. Calculate the lowest common multiple of (l/(-10))/((-3)/30) and 5. 20 Suppose -3p = 3d - 36, p + 6 = 2d - d. Calculate the smallest common multiple of 28 and d. 252 Let v = -7199 - -43079/6. Calculate the common denominator of -7/22 and v. 66 Let k = 6/85 + 1397/680. Find the common denominator of 89/12 and k. 24 Let u = -817 - -2479/3. Let z = -38 - 9. What is the common denominator of u and z? 3 Let j(v) = v*2 - 10v - 4. Let p be j(10). Calculate the common denominator of 27/20 and p/10 - (-69)/10. 20 Let n(h) = h*2 + 5h - 4. Let c be n(-6). Suppose u + 3d - 13 = -2, 4u - 86 = cd. What is the least common multiple of 20 and u? 20 Calculate the lowest common multiple of 75/7 - (-4)/14 and 6. 66 Let d be ((-1761)/99)/(1/(-1)). Let i = d - 170/11. Find the common denominator of i and 41/4. 12 Let u(f) = 2f - 4. What is the lowest common multiple of u(5) and 8? 24 Let g = 265 - 597/2. Suppose 4z - 5k - 400 = 0, -222 = 5z - 5k - 717. What is the common denominator of g and z/(-45) - 2/2? 18 Let d = 6570/13 - 1189014/2353. Let x = d - 8627/1810. Suppose 136 = -2s + 6s. Calculate the common denominator of x and s. 10 Let v(d) = -d3 + d2 + d + 78. Calculate the least common multiple of 18 and v(0). 234 Let g = -103/530 - 557089/1060. Let c = g + 529. Calculate the common denominator of c and -19/7. 28 What is the common denominator of 47/16 and (-8)/12(-303)/12? 48 Find the common denominator of 65/16 and (-70)/(-68)(-14 + 13). 272 Suppose p - 5 = -3, -36 = -2n + 4p. Calculate the lowest common multiple of 10 and n. 110 Let d = 3/5 + -44/15. Calculate the common denominator of d and 4/21. 21 Let z(h) = -1281h + 4. Let n be z(3). Let u = -8966 - n. Let g = u + 30617/6. Find the common denominator of g and 49/16. 48 Suppose -h + 7 = -15. Let k = 38 - 18. Let a = 42 - k. Calculate the smallest common multiple of h and a. 22 Suppose 2s + 2s = 36. Let z = 34 + -19. Suppose -2p - 26 = -3j - p, z = -3p. Calculate the lowest common multiple of s and j. 63 Let k be -5 - -2 - 0 - 0. Let p be (-4 + (-6)/k)-44. Suppose -3v + 7v = p. Calculate the least common multiple of 22 and v. 22 Let a(o) = o2 + 7o - 2. Let i be a(-8). Suppose -z + 0z + i = 0. Let f = 0 - -8. Calculate the smallest common multiple of f and z. 24 Let v be (1 + 69/21)28. Let u = -85 + v. Calculate the common denominator of u and 48/5. 5 Let x = -21341 - -426729/20. Let q = -18887/140 - -653/35. Let i = q + 3229/28. What is the common denominator of i and x? 140 Calculate the common denominator of 93/16 and ((-2)/128)/(1/(0 - 186)). 32 Let g be (124/(-8))/(5/8). Let m = -1457/117 + -84133/6435. Let n = g - m. What is the common denominator of -43/4 and n? 44 Suppose -5q = -4q - 92. Suppose -5g + 3j - j + q = 0, -4j - 64 = -4g. Let w = 19 + 1. Calculate the smallest common multiple of g and w. 20 Let d = -3244/3 - -1091. Calculate the common denominator of -5/18 and d. 18 What is th	{ "pile_set_name": "DM Mathematics" }
, 1, -24, 39 in ascending order. -528, -24, 1, 2, 39 Sort 59, 0, 4, 5, -391, -6 in ascending order. -391, -6, 0, 4, 5, 59 Sort -12, -3, 27, -1, -118, 46, -11. -118, -12, -11, -3, -1, 27, 46 Put -51/11, 1/3, 40 in ascending order. -51/11, 1/3, 40 Put -11, 5, -1, 4, 2583 in descending order. 2583, 5, 4, -1, -11 Put -7, -5, 304, -2, -43 in decreasing order. 304, -2, -5, -7, -43 Put 3/5, 3, 13, 0.4, 5.85 in ascending order. 0.4, 3/5, 3, 5.85, 13 Put 72, 2, 3, -5, 28, 23 in ascending order. -5, 2, 3, 23, 28, 72 Put 24, -11612, -3, 0, 4 in decreasing order. 24, 4, 0, -3, -11612 Sort 2, -32, 5, 4949, 0, 2/9 in descending order. 4949, 5, 2, 2/9, 0, -32 Put 1, -7, -410111 in decreasing order. 1, -7, -410111 Sort -99, 26, -12.052 in decreasing order. 26, -12.052, -99 Sort -85712, -24, -41. -85712, -41, -24 Put -18268, 1, -859 in descending order. 1, -859, -18268 Put 1391, 6, 0.4, -1/335, 2 in ascending order. -1/335, 0.4, 2, 6, 1391 Sort -170, 11, -4, 0, -5, 3. -170, -5, -4, 0, 3, 11 Sort 0.17, 3960, 2, 8, -2/13, -23. -23, -2/13, 0.17, 2, 8, 3960 Sort 2/7, 556.1, -1, 89/6, 0, -0.1. -1, -0.1, 0, 2/7, 89/6, 556.1 Sort -1, -13, -126376. -126376, -13, -1 Sort 9, -375561, -5 in decreasing order. 9, -5, -375561 Put -9, -0.2, 835049 in decreasing order. 835049, -0.2, -9 Put -0.1, 4, 1/5, -0.079, 391 in descending order. 391, 4, 1/5, -0.079, -0.1 Sort 4, -11927, -223, 3, -3, -1 in descending order. 4, 3, -1, -3, -223, -11927 Put 25, -802, 83 in decreasing order. 83, 25, -802 Sort 2113, -4, -0.0665 in decreasing order. 2113, -0.0665, -4 Sort -117, 0, -12, -1, 1, -498, 2 in descending order. 2, 1, 0, -1, -12, -117, -498 Sort 2, -638, 0, 35, -3 in decreasing order. 35, 2, 0, -3, -638 Sort 8, -145, 100, 1, 0.5, 0.3 in decreasing order. 100, 8, 1, 0.5, 0.3, -145 Put 1, 27134/27, -11, 2/9 in ascending order. -11, 2/9, 1, 27134/27 Put 7773, 85, 3, -4 in decreasing order. 7773, 85, 3, -4 Put 273, 1142, 11, -1, 2, -2 in ascending order. -2, -1, 2, 11, 273, 1142 Put -1830, -363, -5 in increasing order. -1830, -363, -5 Sort 7/6, -0.4, -19, 20 in descending order. 20, 7/6, -0.4, -19 Put 2, 0.4, 0.8, 3/6077, -4 in ascending order. -4, 3/6077, 0.4, 0.8, 2 Put 4, 1934, -1, 36, 47, -4 in ascending order. -4, -1, 4, 36, 47, 1934 Put -613990, -2, -0.1 in increasing order. -613990, -2, -0.1 Put -7, 2, 5, 18, -2, -21, -1 in ascending order. -21, -7, -2, -1, 2, 5, 18 Sort 0, -5, 2/15, -3, -1, -501 in decreasing order. 2/15, 0, -1, -3, -5, -501 Put 57, 5420, -4 in descending order. 5420, 57, -4 Sort -99, 3/6166, -2/23, 0. -99, -2/23, 0, 3/6166 Put 6, -12, -64.194 in increasing order. -64.194, -12, 6 Put 3, 37, -49, 313 in increasing order. -49, 3, 37, 313 Put -4, 2643247, 24 in descending order. 2643247, 24, -4 Sort 0.4, 5, -2/5, 2, -51872, -2/7 in ascending order. -51872, -2/5, -2/7, 0.4, 2, 5 Put 86, -2, -4/3, -0.5, -0.2, 56 in decreasing order. 86, 56, -0.2, -0.5, -4/3, -2 Put 28, -3, 162, -2, 9, 4 in ascending order. -3, -2, 4, 9, 28, 162 Sort 69, -1, -11, 23, 0 in decreasing order. 69, 23, 0, -1, -11 Sort 83, 9, 0.11195. 0.11195, 9, 83 Sort -1, 10, 2, 10665, 7, -4. -4, -1, 2, 7, 10, 10665 Put 88, 0, -64, 2650 in descending order. 2650, 88, 0, -64 Sort 32, -5, 0.016, 2/7, 2/5, 8, 5 in descending order. 32, 8, 5, 2/5, 2/7, 0.016, -5 Sort -28, 1, -58366, -4 in descending order. 1, -4, -28, -58366 Put -14108992, -5, 0 in descending order. 0, -5, -14108992 Put -4, -1/6, 8, 5782, -0.74 in decreasing order. 5782, 8, -1/6, -0.74, -4 Sort -3/2, -21, 268.2, -0.9. -21, -3/2, -0.9, 268.2 Sort -0.74, 0, -34571. -34571, -0.74, 0 Put 0, 1, -18977, -5, -2 in increasing order. -18977, -5, -2, 0, 1 Sort -35, 5, 3, -4, -3, -2, -2651. -2651, -35, -4, -3, -2, 3, 5 Sort -18, -28413, 4 in ascending order. -28413, -18, 4 Sort -83, -0.5, 2.0391, 0.1. -83, -0.5, 0.1, 2.0391 Sort 0, -103, 252, -4, -3 in ascending order. -103, -4, -3, 0, 252 Put -0.9, 4, 18, 33, 0.5, -4/7 in decreasing order. 33, 18, 4, 0.5, -4/7, -0.9 Put 5, -73, 2, 6, -26, 4 in ascending order. -73, -26, 2, 4, 5, 6 Put -95, 0, -5, 134, 14 in decreasing order. 134, 14, 0, -5, -95 Sort -0.1, -7, -11, 4/4341, 5, -2 in increasing order. -11, -7, -2, -0.1, 4/4341, 5 Put 2, 547, -4, 11921 in decreasing order. 11921, 547, 2, -4 Sort -2598, 0.9, 2, 9, 6, 1/5 in descending order. 9, 6, 2, 0.9, 1/5, -2598 Sort -1, 2, -5, -32, -102, -14 in decreasing order. 2, -1, -5, -14, -32, -102 Sort 223, 977, -2, -5 in ascending order. -5, -2, 223, 977 Sort -5, -21, -575, -3, 93, 4. -575, -21, -5, -3, 4, 93 Sort 95950682, 3, -5 in ascending order. -5, 3, 95950682 Put 5, 0, -2, -62627, -10, 1, -1 in ascending order. -62627, -10, -2, -1, 0, 1, 5 Put 1, -4, 11, -2, 4, -136222 in descending order. 11, 4, 1, -2, -4, -136222 Sort 269532, 3, 9 in ascending order. 3, 9, 269532 Sort -39, 15, -2, -3, 4, -1, 27. -39, -3, -2, -1, 4, 15, 27 Put 2, 28, 1, -6, 3, -56 in ascending order. -56, -6, 1, 2, 3, 28 Sort -18, -1, -327, -4, 3. -327, -18, -4, -1, 3 Sort -3, -2, 3, -351, 5. -351, -3, -2, 3, 5 Sort 10, 11, -2, -5, 297, 4, 16. -5, -2, 4, 10, 11, 16, 297 Sort -0.1, -630, -0.5, -1780 in descending order. -0.1, -0.5, -630, -1780 Sort 20445, -1, -5, 2, 8, -3, 5 in decreasing order. 20445, 8, 5, 2, -1, -3, -5 Put -152761120, 4, -1 in descending order. 4, -1, -152761120 Sort -1, 1, 3, -30870, 5, -5, -2 in ascending order. -30870, -5, -2, -1, 1, 3, 5 Sort 102, 3/2, -0.3, -0.2, -1/2 in ascending order. -1/2, -0.3, -0.2, 3/2, 102 Sort 0, 43, 331, 110 in descending order. 331, 110, 43, 0 Sort 8, 0, 13, 2057. 0, 8, 13, 2057 Sort -6, -12, -1649, -5, 10 in increasing order. -1649, -12, -6, -5, 10 Sort -0.2, 177/4, 0.066, -4, -1/4 in decreasing order. 177/4, 0.066, -0.2, -1/4, -4 Put 34, 52, 44, -5, 3, 1, 9 in descending order. 52, 44, 34, 9, 3, 1, -5 Sort -3304, 1, 0.037 in increasing order. -3304, 0.037, 1 Put -0.03, 1, 6592.57, 2, -1, 1/3 in increasing order. -1, -0.03, 1/3, 1, 2, 6592.57 Sort 0.5, 4/31617, -3/5, -6, -0.3 in increasing order. -6, -3/5, -0.3, 4/31617, 0.5 Put -4, 23, -57, 3, -5, 15, 4 in decreasing order. 23, 15, 4, 3, -4, -5, -57 Put 4, 3973.146, 0.23 in increasing order. 0.23, 4, 3973.146 Sort 2, 4, -3, -2, 14254, -13. -13, -3, -2, 2, 4, 14254 Sort 17, -0.04, 0.1, 1476.3, 2/27 in decreasing order. 1476.3, 17, 0.1, 2/27, -0.04 Sort -4, 0.4, -90204.06 in ascending order. -90204.06, -4, 0.4 Put 2373089, -1, 0 in decreasing order. 2373089, 0, -1 Put 1619460, 0.1, 0.27 in decreasing order. 1619460, 0.27, 0.1 Sort 4, 50467, 3816. 4, 3816, 50467 Sort -5, -319, -16614 in increasing order. -16614, -319, -5 Sort -143, 5, 8, 6586, -5 in decreasing order. 6586, 8, 5, -5, -143 Sort -99.3972, -5, 3 in descending order. 3, -5, -99.3972 Sort 1/533, -5, 2, 415, -1. -5, -1, 1/533, 2, 415 Sort 0, 48, 306/59, 0.5, -0.01, 1 in descending order. 48, 306/59, 1, 0.5, 0, -0.01 Sort 1/41, 0.4, -27/5, 32, -2/51. -27/5, -2/51, 1/41, 0.4, 32 Sort -9, 1312, -4, 3. -9, -4, 3, 1312 Put 1, -1, -837, -3, 88, 0 in decreasing order. 88, 1, 0, -1, -3, -837 Sort -107, 158, -3, -10 in decreasing order. 158, -3, -10, -107 Put 23121, -0.33, 3/7, -0.3 in decreasing order. 23121, 3/7, -0.3, -0.33 Sort -4, -2, 3, 49, 1022, 205 in ascending order. -4, -2, 3, 49, 205, 1022 Sort -0.1, 1.58, 1/730, 4.3. -0.1, 1/730, 1.58, 4.3 Sort 0.1, 6502.4, 0 in ascending order. 0, 0.1, 6502.4 Sort 35, -0.04, 0.015, 75, 0.4, 3. -0.04, 0.015, 0.4, 3, 35, 75 Sort -8.758, 2, 23.1, 3/2. -8.758, 3/2, 2, 23.1 Put 92, 15, -9, -1, -5, 2 in descending order. 92, 15, 2, -1, -5, -9 Sort -84012.7, 0.4, -247, 4/3, 4/7 in descending order. 4/3, 4/7, 0.4, -247, -84012.7 Put 30, -4, 1, -27 in decreasing order. 30, 1, -4, -27 Sort -3/4, 65, -3638 in descending order. 65, -3/4, -3638 Sort -1, -0.334, -2/11, -3, 0.172 in decreasing order. 0.172, -2/11, -0.334, -1, -3 Sort 2, -1/33, -171, -6, 0.0215 in descending order. 2, 0.0215, -1/33, -6, -171 Put 1888, 46, -114, 3 in descending order. 1888, 46, 3, -114 Put -1/3, -47/2, 6746 in decreasing order. 6746, -1/3, -47/2 Sort 22070, -5, -2737 in descending order. 22070, -5, -2737 Put 2, -13, -159409, -3 in increasing order. -159409, -13, -3, 2 Put 0, -236, 47, 49 in descending order. 49, 47, 0, -236 Sort -1, -93, 3, -3, 1892, 4, -11 in ascending order. -93, -11, -3, -1, 3, 4, 1892 Sort -1, 30,	{ "pile_set_name": "DM Mathematics" }
4). 2 Suppose x - 3f = -8f + 17, 0 = -x - 2f + 8. Suppose 2i - 8 = x. What are the prime factors of i? 5 Let m = -30 + 60. Suppose -5c + m = -5. What are the prime factors of c? 7 Let f be 3(0 - 4/(-3)). Suppose 5r - 7 - 12 = -fv, 5v - 65 = 2r. List the prime factors of v + (-3 - -21). 2, 5 Let g be 57/12 + (-1)/(-4). What are the prime factors of (-880)/(-24)6/g? 2, 11 Suppose 4g + 3o = 41 + 58, -5o - 67 = -3g. What are the prime factors of g? 2, 3 Suppose 2g + 27 = -3g + l, -5l = 15. Let t = g + 9. Suppose -ta + 6 = -3. What are the prime factors of a? 3 Suppose 16n - 507 = 13n. What are the prime factors of n? 13 Suppose 0 = -p + 2 + 1. Suppose -6x + 14 = 2. Let r = p + x. What are the prime factors of r? 5 Let l(i) be the first derivative of i4/4 + 7i*3/3 - 2i2 - 5. List the prime factors of l(-6). 2, 3, 5 Let k = 48 - 31. Let p(s) = -s3 + 12s2 - 11s - 9. Let m be p(11). Let l = m + k. List the prime factors of l. 2 Suppose -3d + 21 = -4t, 5d - 4 - 8 = -t. Let a = -95 + 135. Suppose -dl = l - a. List the prime factors of l. 2, 5 Let r(s) = 3s2 + 0 - 4s - 1 + s*3 - 5s*2 + 2. Let u be r(3). List the prime factors of ((-2)/(-2))/(u/(-8)). 2 Let q = -22 - -69. List the prime factors of q. 47 Suppose -8 = -3m - k, -3 = -m - 5k + 9. What are the prime factors of 1m8/2? 2 Let y(m) = -17m + 60. List the prime factors of y(-7). 179 Let v = 9 - 17. Let s = v + 13. Let t(o) = o - 3. What are the prime factors of t(s)? 2 Let c(a) be the second derivative of a*5/20 + 7a*4/12 + 5a*3/6 + 7a. What are the prime factors of c(-5)? 5 Let g(b) = 6b2 - 5b + 5. What are the prime factors of g(3)? 2, 11 Let k = -5 - -24. What are the prime factors of k? 19 Let x = -1 + 3. Suppose -2b - 3b - 6 = -3t, -t = -b - x. List the prime factors of (-1)/(-3)(b + 9). 3 Suppose l + 2 = 4. Suppose 0 = -n - 4z + 27, n + 36 = 5n - lz. List the prime factors of n. 11 List the prime factors of -1 - 14/(-10) - 1290/(-25). 2, 13 Let o(i) = 2i*2 + 6i - 11. List the prime factors of o(-6). 5 Suppose -4v + v = 33. Let g = 50 + v. What are the prime factors of g? 3, 13 Suppose 130 = h + g, -2h - 130 = -3h + 4g. What are the prime factors of h? 2, 5, 13 Let u = 125 - 86. Let y = -22 + u. What are the prime factors of y? 17 What are the prime factors of (54/10)/(11/55)? 3 Suppose -2c - 1 = -0w + w, 2w - 8 = -2c. Let q(i) = 2i + 4. Let a be q(-5). Let b = w + a. What are the prime factors of b? 3 Let x = 17 + -12. Let f = -14 + 18. Suppose 5j + 62 = xv + 17, 46 = fv - 2j. What are the prime factors of v? 2, 7 Suppose 0 = -4t + 16 + 44. List the prime factors of t. 3, 5 Suppose 34 - 14 = -2r. Let l(x) = 12 - 2x*2 - 9x - 3x2 + 4x2. List the prime factors of l(r). 2 Let w(k) = k3 + 7k2 + 5k - 4. Suppose -29 = 3t + 1. Let j be t/2 - (-1 - -1). List the prime factors of w(j). 3, 7 Let a(o) = o3 - 6o*2 - 8o + 7. Let b be a(7). Suppose 10 = 5k - 4q, bk + q + 4 = 2k. List the prime factors of (-2)/(-3)(k - -4). 2 Let d(h) = h + 5. Let k be d(-7). Let z be (-1 - (0 - 1))/k. Suppose 8 = v - z. List the prime factors of v. 2 Let y(c) = 4c*2 + c - 9. Let x(r) = 3r3 - r2 + r. Let a be x(1). What are the prime factors of y(a)? 2, 3, 5 Suppose 2b = l - 6, 3b = -l + 1 - 0. What are the prime factors of (-115)/(-13) + l/26? 3 Let i(q) = -q*3 - 5q*2 - 4q - 2. Let l be i(-4). List the prime factors of (2/l)/((-5)/10). 2 Let y = -54 + 120. List the prime factors of y. 2, 3, 11 Suppose 5u = -0f + 2f + 5, -11 = 2f + u. What are the prime factors of (f/(-10))/(2/132)? 3, 11 Let x(s) = 5s - 8. Let g be (-6)/33 - (-136)/22. What are the prime factors of x(g)? 2, 11 Suppose -32 = -2o - 2o. Let y be (-140)/o12/(-10). Suppose -2r = -a - 17, 2a + 1 - y = -5r. What are the prime factors of r? 2, 3 Suppose -4o + 3 + 5 = 0. List the prime factors of o. 2 Let m = 35 - -12. List the prime factors of m. 47 Let n(x) be the third derivative of x*4/6 + 5x*3/6 - 3x*2. Let t be n(7). What are the prime factors of 2(1 - t/(-6))? 13 Suppose -3h = -3t - 189, 0 = 5h - h + 4t - 220. What are the prime factors of h? 59 Let v(b) = 4b + 1. Let j = 7 - 7. Let d = 4 - j. What are the prime factors of v(d)? 17 Let o = -48 - -85. What are the prime factors of o? 37 Let d(n) = -n3 + 7n*2 - 5n + 2. Let r be d(6). Suppose -r = -0q + 4q. List the prime factors of q/(-3) - 34/(-3). 2, 3 What are the prime factors of (-627)/(-12) - (-4)/(-16)? 2, 13 Let i = 13 + 4. What are the prime factors of i? 17 Suppose 8v - 3v = 0. List the prime factors of (1 - v) + 0 - -26. 3 Suppose -4x + 129 + 143 = 0. Let o = -46 + x. List the prime factors of o. 2, 11 Let f(v) = 3v - 2. Let p be f(3). Suppose -4j - 2s + 2 = 0, 0s - 6 = -2j - 2s. Let o = p - j. List the prime factors of o. 3 Suppose 9k = 13k - 44. What are the prime factors of k? 11 Suppose 0 = 5i - 0i - 45. List the prime factors of i. 3 Let r(m) = 48m*2. What are the prime factors of r(1)? 2, 3 Let w(k) = 22k2 + 4. List the prime factors of w(-2). 2, 23 Let b be (6/(-8))/((-2)/(-24)). Let c(z) be the second derivative of -z5/20 - 5z4/6 - 11z3/6 - z2/2 - 16z. What are the prime factors of c(b)? 17 Let p(c) = c2 - 9. Let b be p(-7). Let r = b - 22. Let d = r + -8. What are the prime factors of d? 2, 5 Let o(g) = -20g + 20. What are the prime factors of o(-4)? 2, 5 Suppose -3i - 256 = -2m, m - 373 = -2m - i. What are the prime factors of m? 5 Suppose 0 = -0a - 7a. Suppose a = -5f - 41 + 251. What are the prime factors of f? 2, 3, 7 What are the prime factors of (-100)/42-48 + 4/(-14)? 2, 3, 19 Suppose -2s = -4g - 12, 0 = -5s + s + 3g + 24. Suppose 2p - 3t = 9, 4p - p + 3t - s = 0. Let b(n) = 5n + 4. What are the prime factors of b(p)? 19 Let h(u) = -u + 1. Let l be h(-2). Suppose 2z - 285 = -lz. List the prime factors of z. 3, 19 Let r = 0 + 3. List the prime factors of r/(1 - 8/20). 5 Let s(p) = p - 7. Let t be s(5). What are the prime factors of (-7 - t)(-24)/5? 2, 3 Let x = 7 - 11. Let f be 159/6 + (-2)/x. Suppose 2t - f = -3. List the prime factors of t. 2, 3 Suppose 98 = 2l - 118. List the prime factors of l. 2, 3 Let t = 11 - 2. Let w(n) = -n3 + 9n*2 + n + 11. What are the prime factors of w(t)? 2, 5 List the prime factors of (16/2)/((-1)/(-40)). 2, 5 Suppose 0 = 3j - 12. Let h(r) = jr + 2r + 0 - 7r - 1. List the prime factors of h(-5). 2 Suppose 5 = 4i - y - 2, i - 2y = -7. Suppose -5q - 4x + 65 = 0, 0 = 2q - iq - 3x + 24. List the prime factors of q. 3 Let c(f) = -12f3 + f2. What are the prime factors of c(-1)? 13 Let z = 443 + -244. What are the prime factors of z? 199 Let h = -4 - -6. Suppose -7s = -hs - 95. List the prime factors of s. 19 Let l = 19 + -3. Let m be l(-1 - (-6)/3). Suppose 0 = -5t + 20, 2w - m = t - 0t. What are the prime factors of w? 2, 5 List the prime factors of (6625/35 - 8) + 2/(-7). 181 Let b(o) = -o + 2. Let a be b(2). Let j be 1 + (1 + -2 - a). Suppose -2c + 5h + 5 + 23 = j, -4h = 8. List the prime factors of c. 3 Suppose 46 = 4i + 2s, s = -2i - 2s + 21. Let o be 1/(((-12)/(-21))/(-4)). Let m = o + i. List the prime factors of m. 5 Let z(t) = 2t3 + 2t*2 - 2t - 1. Let q be z(2). Suppose 21k = qk + 18. List the prime factors of k. 3 Let m(u) = u - 1. Let t be m(-2). Let w be t/(-9) - 1312/(-6). List the prime factors of 1/(-6) - w/(-18). 2, 3 Let p be (-2 - -180) + (-1 - -3). List the prime factors of 1/(-4) + p/16. 11 Let n be (12/8)/((-1)/(-46)). Suppose 285 = 4t + n. List the prime factors of t. 2, 3 Let q(k) = 2k*2 + 10k + 10. What are the prime factors of q(-6)? 2, 11 Suppose 5f + 0f = 35. Let j = 13 - f. Suppose g - n - j = 0, -2n = -3g - 0g + 22. What are the prime factors of g? 2, 5 Let y(i) = i3 - 17i*2 - 8i - 6. List the prime factors of y(18). 2, 3, 29 Let c(f) = 4f2 - f - 1. Let v be -2 - 2-1 - 0. Let u = v - 1. What are the prime factors of c(u)? 2 Let g be 7/(-3) + 1/3. List the prime factors of 12 + ((-4)/2 - g). 2, 3 Suppose 5l + 2z = z - 80, 3z = 0. Let i = l + 30. What are the prime factors of i? 2, 7 Suppose q + q - 5 = w, 2w = 2q - 10. Let d(t) = 1 + 3t + 1 - 4t2 + 15t**3	{ "pile_set_name": "DM Mathematics" }
rivative of 2v3z*2 - 14v*3z - 5002v3 + v2z*2 - 3vz2 + 2vz + 12768z*2 wrt z. 4v*3 + 2v*2 - 6v + 25536 Differentiate -1227h4 + 79h*2 - 2h + 1582447 with respect to h. -4908h3 + 158h - 2 Find the third derivative of 6795uw*5 + 2799uw2 + 2w*6 - 3w*2 wrt w. 407700uw2 + 240w*3 Find the third derivative of -26694l*3 - 56574l*2. -160164 Differentiate 19n*3o + 37nox + 21nx + 2o - 2x + 70163 wrt n. 57n*2o + 37ox + 21x What is the third derivative of 756d*4 + 25d*3 - 6d*2 + 1319d wrt d? 18144d + 150 What is the first derivative of 9853y + 34032? 9853 What is the second derivative of 20264p2y*3 + 2p*2y - 3p2 - 14py3 - 456py2 wrt p? 40528y*3 + 4y - 6 What is the first derivative of 73p2 - 216p + 93463 wrt p? 146p - 216 Differentiate -1955k*4 + 19k*2 + 2k - 789218. -7820k3 + 38k + 2 What is the first derivative of 2d2l*2 - 4252d*2ln + 12d*2l + 4d2n - 5l2n - 3l2 - 328 wrt n? -4252d*2l + 4d2 - 5l*2 Find the second derivative of 21g*2p*2v - 280g2pv - g2v*3 + 103gp2v + gp2 + 2gpv*3 - 20p wrt g. 42p2v - 560pv - 2v3 Find the third derivative of 1972512p*3 + 365742p*2. 11835072 What is the first derivative of 1543y*3 + 2y*2 + 2y + 2783? 4629y2 + 4y + 2 Find the first derivative of -335sw*2 - 132sw + 20s - 812840w2 wrt s. -335w*2 - 132w + 20 Differentiate 8d4 + d3 - d2 - 29974d + 857128 with respect to d. 32d3 + 3d*2 - 2d - 29974 Find the second derivative of 434430p3 - 663397p wrt p. 2606580p Differentiate -1166l*3 + 160l*2 + 727755 with respect to l. -3498l*2 + 320l What is the third derivative of -7f2w*3 - 2f*2w*2 + 2fw3 - 341w*3 + 8947w*2 wrt w? -42f*2 + 12f - 2046 Find the third derivative of 18hl*2z*3 + 8hl2z*2 + 1206hl2 - 2hl - 11295lz5 - 2l wrt z. 108hl*2 - 677700lz2 What is the second derivative of -82965v*2 + 74619v wrt v? -165930 Find the second derivative of 2659135m3 + 8799m + 70 wrt m. 15954810m What is the third derivative of 332447v*4 + 62v*2 + 25 wrt v? 7978728v Differentiate -154833b2 + 193885 wrt b. -309666b Find the third derivative of 115r6 - 16r*5 + 5r*3 + 2769r*2 + 2r + 7. 13800r3 - 960r*2 + 30 Find the third derivative of 10l*4 + 1907l*3 + 7l*2 - 4l + 1956. 240l + 11442 Find the second derivative of 5k*5 - 202k*3 + 47k*2 - 46k - 1372. 100k3 - 1212k + 94 Find the third derivative of 226071l5 - 2l*2 + 2l - 84339. 13564260l2 Find the first derivative of 35231h + 46308. 35231 What is the first derivative of 2g4 + 92g*3p + 7p + 3894 wrt g? 8g*3 + 276g*2p What is the third derivative of 40is*4 + 487i - 2s4 - 9315s*3 + 1591s*2 wrt s? 960is - 48s - 55890 Find the third derivative of 833766a3 + 2a*2 - 2250a + 3 wrt a. 5002596 What is the first derivative of 362365t3u + 120t3 - 25t*2 + 3t - 2 wrt u? 362365t3 What is the third derivative of 2260507b*5 + 42b*2 + 3715 wrt b? 135630420b*2 Find the second derivative of -58b*4vz - 582b*4v - 2bvz + 49bz + 482v wrt b. -696b2vz - 6984b*2v What is the derivative of q*4 - 2q*3 + 5q*2 + 2498q - 4833188 wrt q? 4q3 - 6q*2 + 10q + 2498 Find the third derivative of 43o5 + 2o*4 - 14092o*3 + 19o*2 + 5o + 1498 wrt o. 2580o2 + 48o - 84552 Find the first derivative of -1266rs*3 - 2rs2 + 2rs - 35r + 360411s3 wrt r. -1266s*3 - 2s*2 + 2s - 35 What is the third derivative of 33642v4 + 10872v*2? 807408v Find the second derivative of -25973m2 + 215m + 10. -51946 Differentiate -2361381d2 + 2874460 with respect to d. -4722762d What is the first derivative of -13b2o - 19b2s - 69bos2 + 123s*2 wrt o? -13b*2 - 69bs2 Differentiate 1299s*3 - 36s*2 - 173213. 3897s*2 - 72s Find the third derivative of 16ko*3 - ko*2 + 2ko - 3k - 574o3 - 27 wrt o. 96k - 3444 What is the second derivative of 71nq*5 + 37nq3 - 3nq2 + 54307n - q wrt q? 1420nq*3 + 222nq - 6n Find the first derivative of 1073979u - 4726543. 1073979 What is the first derivative of 55i*4 + 18i3 - i2 - 40i - 95222? 220i*3 + 54i*2 - 2i - 40 Find the second derivative of -2b3ip3r*2 + 13b*3ip2r - b*3p*3r - 6987b3r*3 + 167bip*3r - pr wrt r. -4b*3ip3 - 41922b*3r Differentiate -12s4 + 17335s + 130987. -48s3 + 17335 Find the second derivative of 121312v*3 - 11v + 4486 wrt v. 727872v Find the third derivative of 60701t*3 + 2t*2 + 3t + 492 wrt t. 364206 Find the second derivative of 18865r4 - 50379r wrt r. 226380r2 What is the second derivative of -1211626c*2 + 430c? -2423252 What is the third derivative of -122526m4 - 16m*2 + 12818m? -2940624m What is the second derivative of -2075v*2x*3 - 23v*2x*2 + 10696vx3 + 3x*3 wrt v? -4150x*3 - 46x*2 What is the second derivative of 401510f*2w*3 - 41fw3 + 2fw2 - f + 5w - 14 wrt f? 803020w3 What is the third derivative of 14204f5 + f4o - 7f*3o + f*2o - f*2 - 198fo - 13f wrt f? 852240f2 + 24fo - 42o What is the second derivative of -37o3 - 1669o*2 + 474015o wrt o? -222o - 3338 Find the third derivative of -5786t*4 - 2t*3 + 172t*2 + 3t wrt t. -138864t - 12 What is the third derivative of 42k*6 + 2919k*5 + 1735k*2 + 19? 5040k*3 + 175140k2 What is the second derivative of c4 - 19915c3 + c2 - 2325c - 10? 12c2 - 119490c + 2 What is the first derivative of -7302r3 - 321 wrt r? -21906r*2 Find the second derivative of 885178i*2 + 220402i. 1770356 What is the second derivative of 3k3y*3 - 6772k*3 - 4ky2 + 103ky - 63y*3 - y wrt k? 18ky3 - 40632k Find the first derivative of 70cv - 178974c - 706v wrt v. 70c - 706 Find the second derivative of -67884d*3r*2 + 5055d*3r + d*2r*2 + 3dr2 + 2dr - 15 wrt r. -135768d*3 + 2d*2 + 6d What is the second derivative of 14760kp + 3kx*2 + 2px2 + 3px - 2088x*2 wrt x? 6k + 4p - 4176 Find the third derivative of 1036623a*3m*3 + 57a*3m + 3a2m2 + a2 - 3m2 - 7 wrt m. 6219738a*3 Differentiate -1217489u - 2578497 wrt u. -1217489 Differentiate -448718h4 + 346187. -1794872h*3 Find the second derivative of 7b*3j*3 + 50b*3j + 2b3 + 11b*2j*3 - 2bj + 11b - 68j2 wrt j. 42b*3j + 66b2j - 136 Find the second derivative of -2234w5 + 3w*2 - 99w - 133 wrt w. -44680w3 + 6 Find the second derivative of -31c*3pz2 - 2c*3pz - 8c*3z + c*2pz - 24331pz2 - 5p - 655 wrt z. -62c3p - 48662p Find the third derivative of 1278043b*3 - 61b*2 + 203b - 51 wrt b. 7668258 What is the second derivative of -3a2d*3 - 42a*2d*2 - 62a*2 + 321a + 18d3 wrt a? -6d*3 - 84d2 - 124 What is the third derivative of -b3m2 + 40284b*3m - 10693b2m*2 - 3b*2m wrt b? -6m2 + 241704m What is the derivative of 1309439a - 1188354 wrt a? 1309439 Differentiate -d3lm + d3m + 12d2l*2m - 14d2m + 182d + 33l*2m with respect to l. -d*3m + 24d2lm + 66lm Find the first derivative of -118269o*2 + 101472. -236538o Differentiate 306v2w - 23214v2 + 4vw3 - 3w - 1 wrt w. 306v2 + 12vw2 - 3 What is the third derivative of 13176m*5y + 3m3y + m*2y + 2my + m + 8y wrt m? 790560m*2y + 18y What is the third derivative of 100318f*2gk3l - 194f2l + fgk*2 + 2fgkl + 4fg - 3k wrt k? 601908f2gl Differentiate 130675x + 954512. 130675 What is the second derivative of -2d5 + 49468d*2r*2 - 245dr2 + 10dr - r2 wrt d? -40d*3 + 98936r*2 What is the second derivative of -3403743bf3 + 28276bf - b + 5f - 1 wrt f? -20422458bf Find the first derivative of -2h4 - 14089h*3 - 32649 wrt h. -8h*3 - 42267h*2 Find the first derivative of 16489j*3o + 3j2o - 3jo + 1179o - 30 wrt j. 49467j*2o + 6jo - 3o What is the second derivative of -973f*3 - 16f*2 + 15862f? -5838*f - 32 Find the third de	{ "pile_set_name": "DM Mathematics" }
our letters picked without replacement from {e: 2, h: 2, c: 3, m: 2}. 1/252 Two letters picked without replacement from {a: 2, y: 1, m: 2, t: 4, l: 3}. Give prob of sequence tm. 2/33 Calculate prob of sequence gc when two letters picked without replacement from gceon. 1/20 Two letters picked without replacement from {e: 4, k: 3}. Give prob of sequence kk. 1/7 Calculate prob of sequence yyy when three letters picked without replacement from ppyppppypppy. 1/220 Three letters picked without replacement from fff. What is prob of sequence fff? 1 Calculate prob of sequence wx when two letters picked without replacement from {e: 1, w: 2, x: 2}. 1/5 Two letters picked without replacement from cmmcccccrcmccyry. Give prob of sequence cm. 9/80 What is prob of sequence aaaa when four letters picked without replacement from aaaa? 1 Two letters picked without replacement from brrbqxbbqbb. Give prob of sequence rq. 2/55 Two letters picked without replacement from shsssssshsssshs. Give prob of sequence hs. 6/35 Two letters picked without replacement from {w: 9, n: 5}. Give prob of sequence ww. 36/91 Calculate prob of sequence rfss when four letters picked without replacement from {r: 8, s: 5, f: 4}. 4/357 Calculate prob of sequence ncp when three letters picked without replacement from ffffpncofsfsffpso. 1/2040 Two letters picked without replacement from lsnynysl. What is prob of sequence ny? 1/14 Three letters picked without replacement from eeee. Give prob of sequence eee. 1 Four letters picked without replacement from aaeeuee. Give prob of sequence euee. 1/35 Calculate prob of sequence wwx when three letters picked without replacement from {w: 2, k: 1, x: 1, j: 1}. 1/30 Calculate prob of sequence cd when two letters picked without replacement from {c: 2, g: 1, d: 3, m: 2, z: 1, s: 3}. 1/22 Four letters picked without replacement from etteettete. Give prob of sequence ttee. 5/63 Four letters picked without replacement from moomtktttttmtttmmmk. Give prob of sequence kmmt. 15/2584 Three letters picked without replacement from {e: 1, s: 2, r: 5, j: 2, i: 2, v: 5}. Give prob of sequence ssr. 1/408 Calculate prob of sequence nqnn when four letters picked without replacement from nnnnzqnzz. 5/252 Two letters picked without replacement from jzwqzw. Give prob of sequence qw. 1/15 What is prob of sequence dyd when three letters picked without replacement from ydy? 0 Calculate prob of sequence xs when two letters picked without replacement from {k: 1, s: 1, g: 1, x: 2, u: 3, h: 3}. 1/55 What is prob of sequence iai when three letters picked without replacement from tkqktihkiat? 1/495 Four letters picked without replacement from {f: 6, a: 4, u: 2}. What is prob of sequence auua? 1/495 What is prob of sequence qq when two letters picked without replacement from qqqqqqqu? 3/4 Calculate prob of sequence vdd when three letters picked without replacement from {d: 6, v: 12}. 5/68 What is prob of sequence usur when four letters picked without replacement from cruucsrriyyi? 1/1980 What is prob of sequence yqy when three letters picked without replacement from {q: 5, n: 3, y: 3}? 1/33 What is prob of sequence dzz when three letters picked without replacement from azzpadpd? 1/84 What is prob of sequence vu when two letters picked without replacement from vvuuuuu? 5/21 Two letters picked without replacement from {p: 9, l: 4, m: 2, i: 1}. Give prob of sequence lm. 1/30 Two letters picked without replacement from pppp. What is prob of sequence pp? 1 Calculate prob of sequence mm when two letters picked without replacement from mmxmmxxxmmmxm. 14/39 Two letters picked without replacement from fzjonojjozzyozyfooz. Give prob of sequence ny. 1/171 Two letters picked without replacement from {g: 6, n: 4, a: 2, i: 6}. What is prob of sequence ga? 2/51 Three letters picked without replacement from jvnnvz. Give prob of sequence vzv. 1/60 Three letters picked without replacement from {p: 2, t: 10}. Give prob of sequence ttt. 6/11 Four letters picked without replacement from fjppvptfqtfp. What is prob of sequence fpfj? 1/495 What is prob of sequence gl when two letters picked without replacement from kllkdlllg? 5/72 Two letters picked without replacement from {b: 7, x: 1, i: 1}. Give prob of sequence ib. 7/72 Three letters picked without replacement from mokokmkmmok. Give prob of sequence okk. 2/55 Calculate prob of sequence rhe when three letters picked without replacement from {j: 1, r: 2, c: 2, h: 1, e: 1}. 1/105 Three letters picked without replacement from {d: 10, w: 2}. What is prob of sequence ddw? 3/22 Calculate prob of sequence dudd when four letters picked without replacement from uududuuuuuududduduu. 65/3876 Two letters picked without replacement from bbubbubbbub. What is prob of sequence uu? 3/55 Three letters picked without replacement from savssssssvvavssv. Give prob of sequence sva. 3/112 Two letters picked without replacement from etljmstmmelmss. Give prob of sequence st. 3/91 Two letters picked without replacement from yazghzz. Give prob of sequence zy. 1/14 Four letters picked without replacement from {u: 5, g: 7, o: 2}. Give prob of sequence ggoo. 1/286 Calculate prob of sequence ppk when three letters picked without replacement from {k: 2, p: 3}. 1/5 What is prob of sequence odoo when four letters picked without replacement from {x: 3, d: 2, r: 2, o: 5}? 1/99 Calculate prob of sequence regr when four letters picked without replacement from {r: 2, g: 3, h: 2, e: 3, u: 6}. 3/7280 Two letters picked without replacement from rraakkffffbfdkfararb. Give prob of sequence ka. 3/95 What is prob of sequence dt when two letters picked without replacement from ztdxddttxxdxtoddtddt? 12/95 What is prob of sequence vc when two letters picked without replacement from ssvcvjcsvsjvs? 2/39 What is prob of sequence utgg when four letters picked without replacement from ttvtgqtuttggtq? 1/572 What is prob of sequence uo when two letters picked without replacement from wusswvo? 1/42 Two letters picked without replacement from {o: 2, v: 1, s: 1, h: 3, u: 5}. Give prob of sequence vo. 1/66 Two letters picked without replacement from {s: 2, m: 2, d: 2, r: 2, f: 5}. Give prob of sequence fr. 5/78 Three letters picked without replacement from rkrrrrrkrkrr. What is prob of sequence kkk? 1/220 What is prob of sequence fzz when three letters picked without replacement from {f: 6, z: 7}? 21/143 What is prob of sequence cctc when four letters picked without replacement from {s: 7, c: 4, t: 3}? 3/1001 Calculate prob of sequence amk when three letters picked without replacement from kkfnnaknkkkmnkkz. 1/420 What is prob of sequence oo when two letters picked without replacement from {f: 2, o: 2, l: 1, g: 1, h: 4, j: 2}? 1/66 Three letters picked without replacement from {m: 4, s: 1, o: 3}. Give prob of sequence omm. 3/28 Two letters picked without replacement from {a: 11, p: 5}. What is prob of sequence aa? 11/24 Four letters picked without replacement from zzezzezeeeeezzzzzzz. What is prob of sequence eeee? 35/3876 Calculate prob of sequence lf when two letters picked without replacement from {m: 2, x: 1, a: 5, l: 3, f: 1}. 1/44 Four letters picked without replacement from {y: 2, o: 1, u: 1, b: 3, s: 4, a: 1}. Give prob of sequence uoas. 1/2970 Calculate prob of sequence nn when two letters picked without replacement from hnnrrnrr. 3/28 Three letters picked without replacement from {x: 1, n: 1, v: 1, f: 4, j: 4}. What is prob of sequence ffv? 2/165 Calculate prob of sequence iib when three letters picked without replacement from {i: 2, b: 3, f: 7}. 1/220 Two letters picked without replacement from {p: 1, q: 2, c: 2, w: 3, l: 4}. What is prob of sequence pw? 1/44 Three letters picked without replacement from uqqququluquuluq. Give prob of sequence llq. 2/455 Three letters picked without replacement from {b: 4, z: 7}. What is prob of sequence bzb? 14/165 Two letters picked without replacement from {y: 2, w: 9, d: 1, p: 4}. Give prob of sequence wp. 3/20 Calculate prob of sequence kkv when three letters picked without replacement from vvykvkyvk. 1/21 What is prob of sequence ycw when three letters picked without replacement from {w: 3, y: 3, k: 1, c: 7}? 3/104 What is prob of sequence ojjj when four lette	{ "pile_set_name": "DM Mathematics" }
plify (5sqrt(800)5 - sqrt(800))/(sqrt(1210) + -5sqrt(1210)-4 - sqrt(1210) - sqrt(1210)) + 5. 96sqrt(5)/209 + 5 Simplify -1(1 + 3 + -2-1sqrt(425)) + -1 + 3. -10sqrt(17) - 2 Simplify (-1-3sqrt(68) - sqrt(68))/((sqrt(400) - -2sqrt(400)) + sqrt(400)) + -1(0 + sqrt(272) + 4)-1. 4 + 81sqrt(17)/20 Simplify ((5(-3 + (sqrt(612) + -1)*2) - -5(4 + 1 + sqrt(612))*2) + 3)-2. -12476 - 480sqrt(17) Simplify (sqrt(52)/sqrt(72) + sqrt(156)/(sqrt(18)/sqrt(3)))/(sqrt(2048) - (sqrt(10)/(sqrt(45)/sqrt(9)) + sqrt(2))). 7sqrt(13)/180 Simplify ((sqrt(1300) - (sqrt(1300) + (2sqrt(1300) - sqrt(1300))) - sqrt(1300)) + -4 + sqrt(1300) + -1sqrt(1300)-2 + -2)2 + (sqrt(104)4-1)/(sqrt(648)3). -3244sqrt(13)/27 + 1336 Simplify (2(sqrt(72) + (sqrt(72) - -2sqrt(72)3))/((sqrt(1620) + sqrt(45))/sqrt(5))-2)24. 32768/49 Simplify -1((sqrt(19) - sqrt(171)-2) + -2) - (-5sqrt(1900) + (sqrt(19) + sqrt(304) + -4)2). -489 + 83sqrt(19) Simplify (6(1sqrt(119) + sqrt(119))-4-5)/(((-2sqrt(84) + sqrt(84))-3)/(sqrt(24)/sqrt(18)))3. 80sqrt(17) Simplify (1 + 2(sqrt(1053) + 0)1 + -4 + (1 + sqrt(1053)-2 - -6-1sqrt(1053)))2. 216sqrt(13) + 37912 Simplify (32sqrt(66)36)/((2sqrt(5400))/((sqrt(81) - sqrt(9))4)). 216sqrt(11)/5 Simplify (4sqrt(1100)1-5)/((sqrt(320)/(sqrt(24)/sqrt(3)))/(sqrt(490)-1 - sqrt(10))). 800sqrt(11) Simplify ((1sqrt(2835) - sqrt(2835))/((sqrt(40)/sqrt(2) - sqrt(20) - sqrt(20))/sqrt(4)) - (5sqrt(140)/sqrt(4) - sqrt(35))/((sqrt(50)/sqrt(2))/sqrt(5)))*2-5. -560 Simplify (1 + (sqrt(245) + 2)6 + 5 + 3 + sqrt(405) + 0 + -4 + -1)2. 1632sqrt(5) + 13261 Simplify (5 + sqrt(108)/sqrt(4)-4 + (sqrt(900) - (sqrt(900) - (sqrt(900) + (sqrt(900)1 - sqrt(900)) + sqrt(900))))/(sqrt(12)-2-2) + 5)*2. -190sqrt(3) + 1483/4 Simplify 5(-4 + 5(sqrt(7) + sqrt(672)/sqrt(6) - sqrt(112)-1 - (-4 + sqrt(77)/(sqrt(11)-2)))*2). 1900sqrt(7) + 64695/4 Simplify (5(5 + ((sqrt(392)-2-6 - sqrt(392))/sqrt(7))/((-2sqrt(2904))/sqrt(3))))*2. -125sqrt(7) + 2675/4 Simplify -3((51sqrt(11) + sqrt(11) + sqrt(11) + sqrt(44)/sqrt(4)5)*2 + (-4sqrt(77)/sqrt(7))*2 + -5)-3. 15795 Simplify -4 + 1 + (sqrt(625)2)/(sqrt(55)/sqrt(44)) + -1 + 1. -3 + 20sqrt(5) Simplify ((-4 + (sqrt(76) + -4(sqrt(76) + -2) - -42sqrt(76)) + -4)2 + 5)-1. -1905 Simplify ((-2sqrt(6655))/sqrt(11) + 3sqrt(40)/(sqrt(16)/sqrt(2)))-5 + -1. -1 + 95sqrt(5) Simplify (sqrt(6)/(sqrt(24)/sqrt(2) - sqrt(3)) + (sqrt(6)/sqrt(3) + -3 + sqrt(2) + -2)*2)-1-2. -38sqrt(2) + 66 Simplify -5(-5 + -2sqrt(17)2 + (sqrt(17) - (sqrt(17) - (-3sqrt(17)2 - sqrt(17)))) + 5((sqrt(170)-5 + sqrt(170))/sqrt(10) - sqrt(17)))2. -110285 - 1800sqrt(17) Simplify (-1sqrt(132)-3 - -3(sqrt(132) + -1sqrt(132) + sqrt(132)))/(-4(sqrt(12) + (sqrt(72)1)/sqrt(6) + sqrt(12))-5) + 5. sqrt(11)/10 + 5 Simplify (6sqrt(539)1)2 - (sqrt(539) + 2 + 0 + sqrt(539))2 - (-3 + -4 + sqrt(539) + 2)2. 14sqrt(11) + 16680 Simplify (2sqrt(78)-3)/(sqrt(6) - (sqrt(12)/(sqrt(2)1) - sqrt(6))) + 3 + (0 + 6(sqrt(1872)1 + sqrt(1872))-3)*2. -6sqrt(13) + 2426115 Simplify 1((sqrt(133) + sqrt(133) + (2sqrt(133)2 + sqrt(133) + sqrt(133) - sqrt(133)))/(sqrt(343)-1) - ((sqrt(304) + sqrt(19))-36 + 2)*2). -153904 + 359sqrt(19) Simplify (5 + (-3(sqrt(3328) + sqrt(52)))/((sqrt(44) - 2sqrt(44))/sqrt(11)) + -4)*2. 54sqrt(13) + 9478 Simplify ((5 + ((sqrt(242)-1)2 - sqrt(242)) + sqrt(242))-3 - ((sqrt(242) + -4 + sqrt(242) + -1)*2 - sqrt(242) - (sqrt(242) + 1 + 3)))5. -8650 + 1210sqrt(2) Simplify (0 + -1(2 + -2 + -2sqrt(75)) + 1)2. 20sqrt(3) + 301 Simplify 1 + (-3sqrt(133)1 + sqrt(133))/(-1sqrt(28)/sqrt(4)) + (sqrt(684) + -3)2 + sqrt(114)/(-2sqrt(6)). -69sqrt(19)/2 + 694 Simplify (-343(sqrt(19) + (sqrt(19) - (sqrt(19) + 1 + sqrt(19)))) + (sqrt(171)/(sqrt(54)/sqrt(6)) - (0 + sqrt(2299))) + 0)*2. -720sqrt(19) + 3196 Simplify (6(0 + -4(-4 + sqrt(704) + (sqrt(704) + -2 - sqrt(704)) + 3 + 1 + 4)))*2. 18432sqrt(11) + 407808 Simplify (5(((sqrt(208) + 4 - sqrt(208)) + 2)-3 + -1 + -5))*2. 14400 Simplify ((-1 + -5 + (-4 + sqrt(13)-16)3-5)-4)*2. 155520sqrt(13) + 1731456 Simplify (sqrt(1216)1 + sqrt(1216) + -4 + 1)2-5 + -3 + (sqrt(1216) + 1 + 5 - (3 + sqrt(1216)-2)). -24365 + 504sqrt(19) Simplify ((-3 + sqrt(704) + sqrt(704)-2 + 5)-13 + 2(sqrt(704) + (sqrt(704) - (-1 + sqrt(704))))53-6)2. 526752sqrt(11) + 22090212 Simplify ((-3 + (1 + sqrt(75)-3 + sqrt(75) - sqrt(75)) - (sqrt(75)1 + 3 + 1)) + -4)*2. 400sqrt(3) + 1300 Simplify (3 + ((0 + -1sqrt(108))2 - sqrt(108)) - (4 + (sqrt(108) + -2sqrt(108)-4 + sqrt(108))2))1. -10693 - 6sqrt(3) Simplify -1sqrt(171)3 - (sqrt(171) - 2(-3 + sqrt(171) + sqrt(171)))2 - ((sqrt(190)/sqrt(490))2 + 0 + sqrt(475) + sqrt(19) + 1). -77243/49 + 93sqrt(19) Simplify -6((2sqrt(11)-2 - sqrt(11) - sqrt(1331)2)-6)*2 - (-2 + (-6sqrt(99)2 + sqrt(99))/(-4(sqrt(144) + sqrt(9)))). -1732102 - 11sqrt(11)/20 Simplify ((sqrt(171) - (sqrt(171) + (sqrt(171) + 5(4sqrt(171) - sqrt(171)) + sqrt(171) - sqrt(171))))3)/((3(sqrt(90) + 2sqrt(90)))/sqrt(10))-3. 16sqrt(19) Simplify (-3sqrt(209)2-2-2)/(3sqrt(176)-3). 2sqrt(19)/3 Simplify (sqrt(304) - ((1 + sqrt(304))-3 - sqrt(304)) - (sqrt(304) + (-1sqrt(304) - sqrt(304)))-1)*2 + (sqrt(684)/sqrt(108))/(sqrt(21)/sqrt(112)). 292sqrt(19)/3 + 4873 Simplify ((5sqrt(90)4 - sqrt(90))/sqrt(3))/((sqrt(10) - -1sqrt(490)) + (sqrt(80)/sqrt(2))/sqrt(4)) + 5. 19sqrt(3)/9 + 5 Simplify ((sqrt(468) + 1 + sqrt(468) + 4 + 2 + (sqrt(468) + sqrt(468)13 + sqrt(468))6)4)*2 + -5. 43008sqrt(13) + 7668491 Simplify ((((sqrt(125)-1 - sqrt(125)) + sqrt(125))-4 - (sqrt(125) - (sqrt(125) + (sqrt(125) + -2)4) - sqrt(125)))2)*2-1-5. -14400sqrt(5) + 203780 Simplify 5-5(0 + -4(sqrt(128)2)*2 + (-5-2sqrt(128)1)*2). -268800 Simplify (((sqrt(847) - -3sqrt(847)) + sqrt(847))-5 + -5 + -4 + -3sqrt(847) + 1)*24. 19712sqrt(7) + 2656448 Simplify (2(4(1sqrt(425)-3 + sqrt(425) - sqrt(425)) + 5(-1 + sqrt(425))1 + 3))2. 560sqrt(17) + 83316 Simplify (sqrt(99)/sqrt(3))/sqrt(11) + (sqrt(75) + sqrt(75)3)2 + 3 - (sqrt(18) - (1sqrt(180))/sqrt(10))/((sqrt(60)/(-3sqrt(10)) - sqrt(6)) + sqrt(6)). sqrt(3) + 1203 Simplify (sqrt(304) - (sqrt(304)-4)*2)-4 + 2 - ((sqrt(209) - (2sqrt(209) - sqrt(209)))3)/(1sqrt(1584)). -16sqrt(19) + 19458 Simplify -2(((1sqrt(231) + sqrt(231))6)/sqrt(11))/(sqrt(33)/(sqrt(539)2 + sqrt(539))). -504sqrt(7) Simplify (-3 + ((sqrt(175))2 - sqrt(7) - sqrt(7)) + -3)-6 + (-5sqrt(84)-1)/((sqrt(84)2)/sqrt(7) - sqrt(12)). -1014 + 17sqrt(7) Simplify (sqrt(280)/(sqrt(14)/sqrt(2)6 + sqrt(7))2)/((sqrt(64) - (sqrt(64)-1 - sqrt(64) - sqrt(64))4)/(1sqrt(1152))). 24sqrt(5)/91 Simplify 2(2 + sqrt(304) + sqrt(304))4 + -3-5(sqrt(304) + 1). 31 + 124sqrt(19) Simplify ((sqrt(88) - sqrt(88)-1)6 + sqrt(88) + sqrt(88) - (sqrt(88) + sqrt(88) + 2-3sqrt(88) + sqrt(88) + sqrt(88)))/(sqrt(800)1-42). -sqrt(11)/5 Simplify 5(2 + -1 + (-5(sqrt(7) - (sqrt(7) + -1)*2) - sqrt(567)1) + 5)2. -240sqrt(7) + 460 Simplify -5(sqrt(153) + (sqrt(153) + -1 + -1)2 + (sqrt(153) + -2 + sqrt(153))-1 + ((-2 + sqrt(153) + 0)-2)2). -3935 + 315sqrt(17) Simplify (((sqrt(450)-5 + sqrt(450))4 - sqrt(450))/sqrt(10))/(sqrt(81) - -4(sqrt(81) + -1sqrt(81))). -17sqrt(5)/3 Simplify ((sqrt(190) + 1sqrt(190) + sqrt(190))-5)/(sqrt(490) + sqrt(490)2 + sqrt(490)) + -1(-3 + sqrt(1900) + 1)6. -1695sqrt(19)/28 + 12 Simplify -3((-62sqrt(3200) + sqrt(3200) + sqrt(3200) + 2 + 5 + sqrt(3200))*2 + ((5 + sqrt(3200) + 2)-6)*2). -1128639 - 45360sqrt(2) Simplify (-3((sqrt(65)-1 + sqrt(65))3)/(-2sqrt(5)2))2 + (((sqrt(637) + -1)2)*2 - (-4 + 1sqrt(468) + sqrt(468))). -68sqrt(13) + 2556 Simplify (-2 + (sqrt(36)2)/sqrt(12) + (sqrt(3) - (-1sqrt(192) + sqrt(192))) + 5 + (-6(sqrt(336) - -2sqrt(336)))/(sqrt(77)/(sqrt(22)/sqrt(2))))2 + -2. -414sqrt(3) + 14290 Simplify (4 + (((sqrt(168)3 + sqrt(168))1)/sqrt(7))/(sqrt(48)/sqrt(4)-1 - (sqrt(192)-2 + sqrt(12) + sqrt(12))))*2. 32sqrt(2)/5 + 432/25 Simplify -4((-1sqrt(343)-3 + 5)2 + -4 + 2 + 2 + sqrt(343)). -12448 - 868sqrt(7) Simplify (((-1sqrt(170) - sqrt(170)) + sqrt(170))4 - 1*s	{ "pile_set_name": "DM Mathematics" }
st ten. 50 What is 1.312512 rounded to 1 decimal place? 1.3 What is 0.000177832 rounded to 6 dps? 0.000178 Round -55310930 to the nearest one hundred thousand. -55300000 What is 5.576678 rounded to two decimal places? 5.58 What is -123324000 rounded to the nearest 1000000? -123000000 What is -0.10802683 rounded to 1 dp? -0.1 What is -0.00347777 rounded to three decimal places? -0.003 What is 1240.935 rounded to the nearest one hundred? 1200 Round -7699.73 to the nearest 10000. -10000 What is 174544300 rounded to the nearest 1000000? 175000000 What is 8.4593 rounded to the nearest integer? 8 What is -3378553 rounded to the nearest 100000? -3400000 Round 134905.2 to the nearest 100000. 100000 What is -569.44194 rounded to zero dps? -569 What is -41.7086 rounded to one dp? -41.7 Round -144.96497 to the nearest ten. -140 Round 0.0271092 to 4 decimal places. 0.0271 What is -419.7313 rounded to zero dps? -420 Round -1.925508 to 3 decimal places. -1.926 What is 942.2437 rounded to the nearest 10? 940 Round 1.01605 to two dps. 1.02 Round 0.55194 to one dp. 0.6 What is 0.0030899 rounded to 3 dps? 0.003 Round 4513.087 to the nearest 10. 4510 Round -2.1827667 to one dp. -2.2 Round -11502.58 to the nearest 10. -11500 What is 12825.9 rounded to the nearest one hundred thousand? 0 Round -22.3593 to the nearest ten. -20 What is -24225320 rounded to the nearest one hundred thousand? -24200000 What is -0.00001251776 rounded to six decimal places? -0.000013 What is -0.0001929928 rounded to 6 decimal places? -0.000193 Round -186.831 to the nearest ten. -190 Round -157.375 to zero dps. -157 Round -398064090 to the nearest one hundred thousand. -398100000 What is -6398800 rounded to the nearest one million? -6000000 Round -0.78237007 to 1 decimal place. -0.8 Round 804.5818 to the nearest ten. 800 What is -0.000003795762 rounded to 7 dps? -0.0000038 Round -92054.278 to the nearest 100. -92100 What is -39119000 rounded to the nearest one million? -39000000 What is 3450530 rounded to the nearest ten thousand? 3450000 What is -0.00000021348303 rounded to seven decimal places? -0.0000002 Round -1715.79 to the nearest 100. -1700 Round 18614253 to the nearest 10000. 18610000 Round -0.0000944084 to six decimal places. -0.000094 Round -0.000322601 to 6 decimal places. -0.000323 Round -308717600 to the nearest 100000. -308700000 Round 0.0000000068142 to seven decimal places. 0 Round 51504.03 to the nearest one thousand. 52000 Round 0.0018549248 to 5 decimal places. 0.00185 What is 148474800 rounded to the nearest one million? 148000000 Round -0.006282235 to 4 dps. -0.0063 What is 0.00000842048 rounded to 7 decimal places? 0.0000084 What is 21597900 rounded to the nearest one million? 22000000 Round -0.000000780873 to seven decimal places. -0.0000008 What is -4516.7759 rounded to the nearest ten? -4520 Round 1529751.3 to the nearest one hundred thousand. 1500000 What is 3530890.4 rounded to the nearest one hundred thousand? 3500000 Round 477487.9 to the nearest one hundred thousand. 500000 What is -0.00000266224 rounded to seven dps? -0.0000027 Round 24676.98 to the nearest 10. 24680 What is -4457.0197 rounded to the nearest ten? -4460 What is 0.061564 rounded to 3 dps? 0.062 Round -2.98746 to 3 dps. -2.987 Round -124115 to the nearest ten thousand. -120000 Round 1.0641267 to three decimal places. 1.064 Round 133.35 to the nearest 10. 130 What is 7450.68 rounded to the nearest 1000? 7000 What is -0.0131147265 rounded to six decimal places? -0.013115 Round -41917890 to the nearest 1000000. -42000000 Round 38238100 to the nearest 1000000. 38000000 What is -0.0226946 rounded to three decimal places? -0.023 Round -0.000006636444 to seven dps. -0.0000066 Round 15068356 to the nearest 1000000. 15000000 What is 168720.26 rounded to the nearest ten thousand? 170000 What is -2.559758 rounded to 3 decimal places? -2.56 Round -1423.858 to the nearest 100. -1400 What is -546.5791 rounded to the nearest one hundred? -500 Round 0.002030798 to four decimal places. 0.002 Round -83.610404 to one decimal place. -83.6 Round 4.4827482 to 3 decimal places. 4.483 What is -0.0642166 rounded to four dps? -0.0642 Round -2.210799 to 1 decimal place. -2.2 Round -0.4626922 to 2 dps. -0.46 Round 676.4452 to the nearest 10. 680 Round 0.000474183 to 5 decimal places. 0.00047 What is -0.24840225 rounded to 1 decimal place? -0.2 Round -34282 to the nearest one hundred thousand. 0 Round 71.036 to the nearest ten. 70 What is -0.00013914485 rounded to six decimal places? -0.000139 Round 3.639476 to 3 dps. 3.639 Round -152286.2 to the nearest ten thousand. -150000 What is 21421404 rounded to the nearest 10000? 21420000 Round -2.03589 to 2 dps. -2.04 Round 0.000803745 to six decimal places. 0.000804 What is 1807.15 rounded to the nearest 1000? 2000 Round -33656450 to the nearest 1000000. -34000000 What is 0.865581 rounded to four dps? 0.8656 What is -181.75103 rounded to two dps? -181.75 What is -0.0000279436 rounded to 6 dps? -0.000028 Round -0.3731548 to one dp. -0.4 What is -243.95 rounded to 0 dps? -244 Round 398.03315 to 1 decimal place. 398 What is -0.00049557332 rounded to four decimal places? -0.0005 Round 0.4019701 to three dps. 0.402 Round -0.05027855 to two decimal places. -0.05 Round -0.2434459 to 2 decimal places. -0.24 What is -0.0027952 rounded to 3 dps? -0.003 What is -78.1581 rounded to 0 dps? -78 What is -9167075 rounded to the nearest one hundred thousand? -9200000 What is -0.0014334774 rounded to four decimal places? -0.0014 Round 2228.789 to the nearest ten. 2230 Round 363098000 to the nearest one hundred thousand. 363100000 What is 0.0223544 rounded to five dps? 0.02235 Round -0.01544653 to 5 dps. -0.01545 What is -0.000109637 rounded to four dps? -0.0001 Round -0.616105 to 1 dp. -0.6 Round 0.000075737 to 6 decimal places. 0.000076 Round -0.0003722496 to five dps. -0.00037 What is -98473.86 rounded to the nearest 1000? -98000 What is 11.09342 rounded to the nearest ten? 10 Round -9913133300 to the nearest one million. -9913000000 What is -0.014348 rounded to 4 dps? -0.0143 Round -0.055790359 to 4 dps. -0.0558 Round -25279400 to the nearest 100000. -25300000 What is 633721.48 rounded to the nearest one thousand? 634000 What is 0.0003390714 rounded to 7 decimal places? 0.0003391 What is 877714 rounded to the nearest ten thousand? 880000 What is -2444.5484 rounded to zero dps? -2445 Round 1.7727827 to 1 dp. 1.8 Round 50493390 to the nearest one hundred thousand. 50500000 What is -29183.498 rounded to the nearest one thousand? -29000 What is -8406.11 rounded to the nearest ten? -8410 What is -392.772 rounded to 0 dps? -393 Round -1.336737 to 2 dps. -1.34 What is -0.0129796 rounded to 3 decimal places? -0.013 Round 4728430 to the nearest 1000000. 5000000 What is 0.0002913277 rounded to six decimal places? 0.000291 What is -0.821908 rounded to 3 decimal places? -0.822 What is 0.00061953158 rounded to four decimal places? 0.0006 Round 0.00006343569 to six dps. 0.000063 What is -1514524900 rounded to the nearest 100000? -1514500000 What is 0.0001575587 rounded to 6 decimal places? 0.000158 What is 0.14644904 rounded to five dps? 0.14645 Round -199773200 to the nearest one hundred thousand. -199800000 Round 57023.57 to the nearest 100. 57000 What is -0.00001457143 rounded to five dps? -0.00001 Round 0.288732 to one decimal place. 0.3 What is 9745.018 rounded to the nearest one thousand? 10000 Round 2188508800 to the nearest one million. 2189000000 What is -3.3112 rounded to zero dps? -3 What is 524785.81 rounded to the nearest one hundred? 524800 What is 41828480 rounded to the nearest 1000000? 42000000 Round 4131.7326 to the nearest one hundred. 4100 Round -0.001096424 to 6 decimal places. -0.001096 Round -3.37857 to 0 dps. -3 Round -500509.4 to the nearest one hundred. -500500 What is 0.0084700451 rounded to five dps? 0.00847 Round 0.025604765 to two decimal places. 0.03 What is 0.593425 rounded to two dps? 0.59 Round -0.092703 to 2 dps. -0.09 What is 2909846 rounded to the nearest one hundred thousand? 2900000 Round -117184180 to the nearest one hundred thousand. -117200000 What is -0.54946 rounded to one dp? -0.5 Round -0.00238859 to 5 dps. -0.00239 What is 0.0000043794 rounded to six dps?	{ "pile_set_name": "DM Mathematics" }
the units digit of f? 2 Suppose 0 = -0i + 2i. Suppose -17 = -y - 3d, id = y - 5d + 23. What is the units digit of y? 2 Let t be 1(2 - -2) - -2. Suppose w - n - t = -0n, -2n + 33 = 3w. What is the units digit of w? 9 Let s(x) = -13x - 2. Let l be s(-1). What is the units digit of l/33 + (-86)/(-3)? 9 Suppose 0 = w + 2m + 4 - 30, 0 = -4w - 2m + 86. Suppose -13 = -3h + w. What is the tens digit of h? 1 Suppose 4t - 54 = 4g + 6, 27 = t + 3g. What is the tens digit of t? 1 Let w(x) = x2 + x - 1. Let g(z) = z3 - z2 - z + 4. Let u be g(0). Let r = -6 + u. What is the units digit of w(r)? 1 Let i(k) = 7k - 14. What is the units digit of i(8)? 2 Let c(l) = l*3 + 11l*2 - 4l - 16. What is the tens digit of c(-11)? 2 Let q(v) = 27v2 + 1. Let x be 2 - ((-12)/(-2) - 3). What is the units digit of q(x)? 8 Suppose -4d + 2w - 3 = -17, -3d = -w - 8. Let t = d + -12. Let i = -6 - t. What is the units digit of i? 5 Let v(q) = -q + 41. What is the units digit of v(0)? 1 Suppose -m = -2 + 3. Let p = 4 + m. Suppose -pb = -5b + 2. What is the units digit of b? 1 Let x(q) = -4q - 7. Let n be x(-5). Let u(z) = z2 - 10z + 1. What is the units digit of u(n)? 0 Let c(v) be the third derivative of v6/120 - v5/20 - v4/12 + v3/3 + 2v2. What is the tens digit of c(4)? 1 Let f be (-158)/22 + (-2)/(-11). Let d(s) = 2s - s*2 - 9s + 1 + 0s2. What is the units digit of d(f)? 1 Suppose -7 = -5o + 8. What is the units digit of 0 + 4 + -5 + o? 2 Let r = 27 + -17. What is the units digit of r? 0 Suppose 5 = -b, b - 3 + 40 = -4c. Let i = c + 11. What is the units digit of i? 3 Let x = 4 - -6. Suppose -v + x = -18. What is the units digit of v? 8 Suppose -2 = 2w + 2. What is the units digit of (w + 52/6)3? 0 Let t = -94 + 274. Suppose 2r + 2r - t = 0. What is the units digit of r? 5 Suppose 0 = 4p - 5m - 105 - 11, 0 = 4m - 16. What is the units digit of p? 4 Suppose 194 = 5x + 4. What is the units digit of x? 8 Suppose -17h - h + 54 = 0. What is the units digit of h? 3 What is the units digit of ((-2401)/14)/(1/(-2))? 3 What is the tens digit of ((-21)/(-1))/(7 + (-36)/6)? 2 Suppose 4x + 59 = u + 237, -x + 36 = 4u. What is the tens digit of x? 4 Let q be (9 + -9)(-2)/(-6). Let u(g) = g2 + g - 2. Let l be u(q). What is the tens digit of (1-8 - l)-2? 1 Suppose -20z - 285 = -23z. What is the units digit of z? 5 Let x be (-6)/(-4) - (-17)/(-2). Let m = 10 + x. Suppose mw - 53 = -20. What is the units digit of w? 1 Let c = 4 - -11. Suppose -2o + 4j = -o - c, -4j = 3o + 19. Let u = 3 + o. What is the units digit of u? 2 Suppose -v + 3d = -4, -v - d - 4d - 12 = 0. What is the tens digit of 0 - (-16 + v) - 0? 1 Suppose 2t = -z + 3z + 180, t - 108 = -5z. What is the tens digit of t? 9 Suppose 0 = 5d - d - 564. What is the hundreds digit of d? 1 Let g = 1 - 1. Suppose -4s + 0s + 44 = g. What is the tens digit of s? 1 Let u(g) = -g. Suppose -3i + 3z = -0i + 6, -3i = -2z + 1. Suppose -6x + ix = 21. What is the units digit of u(x)? 7 Suppose -4n + 5r - 28 = -9, 0 = 2n + 4r + 16. Let l = 7 + n. What is the units digit of l? 1 Let u(k) = k3 - 6k*2 + 10k + 8. What is the units digit of u(6)? 8 Suppose -12p - 2904 = -24p. What is the tens digit of p? 4 Suppose 130 + 108 = c + v, 4c - 3v - 945 = 0. What is the tens digit of c? 3 Suppose -4j = y + 51 - 4, 94 = -2y + 5j. Let t = -20 - y. What is the tens digit of t? 2 Suppose u + 5q - 2q = -12, -3u + 4q + 29 = 0. Let m be 2/3 + 10/(-6). What is the units digit of m/u + 38/6? 6 Let k = 141 + -20. Suppose -4s = -3a - k, -2s - 2a = s - 78. Suppose 3r - s = -1. What is the units digit of r? 9 Let b(l) = l - 5l3 - 6l + 2l - 1 - 3l*2 + 2l. What is the units digit of b(-2)? 9 Let v(c) = c*3 + 10c*2 + 3c - 12. What is the tens digit of v(-9)? 4 Suppose 0 = f - 2 + 6. Let h = f - -4. Let v = 1 - h. What is the units digit of v? 1 Let p(b) = -b3 - b2 + 4b. Suppose y - 10 = -4y. Let i be y/4 - (-21)/(-6). What is the units digit of p(i)? 6 Suppose -200 = -0o - 5o. Suppose 0 = 5m - 0m + o. Let c = m - -14. What is the units digit of c? 6 Let t be 6/4(-16)/(-6). Let h(w) = -11w + 1 + 4 + 12w. What is the units digit of h(t)? 9 Suppose 0 = f + 3f - 28. Let n = f + 7. Suppose 70 = 7x - 2x - a, n = x + a. What is the tens digit of x? 1 Let l = 87 + -27. What is the tens digit of l? 6 Let m(r) = r*3 + 7r*2 - 4r + 2. What is the tens digit of m(-6)? 6 Let f = -27 + 22. Let r(i) = 5i + 1 + i2 + 0i*2 + 6. What is the units digit of r(f)? 7 Suppose 0 = -v - 2j + 47, -3v = -0j - 3j - 105. What is the tens digit of v? 3 Let l = 17 - 12. Suppose -24 - 26 = -5t + lp, 3t = -2p + 15. Suppose tf - 2f - 12 = 2g, f = -5g + 24. What is the units digit of g? 4 Suppose n + 3f + 5 = 0, 3f = 4n + f + 48. Let s(p) = -7p + 8. Let m be s(4). Let d = n - m. What is the units digit of d? 9 Suppose -o = -3o + 62. What is the tens digit of o? 3 Suppose -3a = -2a. Suppose a = -5x + 3x + 26. What is the tens digit of x? 1 Let o(m) = m*3 + 4m*2 - 1. Let k be o(-3). What is the tens digit of ((-10)/k)/((-1)/8)? 1 Let g be (2/5)/((-1)/(-65)). Let v = 14 - g. What is the units digit of 49/4 - (-3)/v? 2 Suppose f = -0f. Let s(y) = y - 4. Let p be s(5). Let l = f + p. What is the units digit of l? 1 Let h(j) = j*2 - 3j - 8. Suppose -35 = -9u + 4u. What is the units digit of h(u)? 0 Suppose 57 = -3q + 4q. What is the tens digit of q? 5 Let w(z) = -z*3 - 4z - 4. What is the units digit of w(-4)? 6 Let y = 1 - 2. Let d(n) = 2n2 - n - 1. Let p be d(y). Suppose 0 = 2k + pk - 16. What is the units digit of k? 4 Let a(n) = -2n - 7. Let l be a(-5). Suppose c - 8 = 2c + lv, -v = c. What is the units digit of c? 4 Let f(p) = p + 23. Suppose -5h + 5q = -35, -q - 75 = -5h - 4q. Suppose h = n - 2n. What is the units digit of f(n)? 1 Suppose -s - 29 = 3. Let o be (s/20)/(4/(-10)). Suppose -l = -4 - o. What is the units digit of l? 8 Let h = -126 + 237. What is the hundreds digit of h? 1 Let i(y) = -y2 + 5y - 3. Let z(v) = 4v2 - 2v + 1. Let c be z(1). What is the units digit of i(c)? 3 Let q(i) = i*2 + i + 3. Let f = 4 - 7. Let j be q(f). Suppose 5t - 29 = -j. What is the units digit of t? 4 Let h(v) = 2v2 + 9v + 5. What is the units digit of h(-6)? 3 Suppose 0 = -v + t + 35, -2t = -4v - 0v + 146. What is the units digit of v? 8 Let k = 1 + 2. What is the units digit of k? 3 What is the hundreds digit of ((-59)/(-4))/(3 - (-115)/(-40))? 1 Let g(z) = 2z - 12. Let l be g(8). Suppose 3 = -3r - 0r. What is the units digit of l/2 - (r - -1)? 2 Let m = -10 + 14. Suppose 70 = -mq + 234. What is the units digit of q? 1 Let c(i) = 30i*2 + 1. Suppose -7g - 5 = -2g. What is the units digit of c(g)? 1 Let d(c) = -3c - 11. Let i be d(-5). Suppose ih = 2g + 20, g = 3h - 5h + 10. What is the units digit of h? 5 Suppose o + 0o = -r + 4, 5o = 4r - 34. Suppose -7p + rp = -12. What is the units digit of p? 2 Let a = -5 - -1. Suppose -33 = 3i - 3g, 5g + 1 = 16. Let d = a - i. What is the units digit of d? 4 Suppose 2r = -2r + 116. Suppose -2 + r = 4x + 3d, 2x - 11 = d. What is the units digit of x? 6 Let t = -14 + 82. Suppose y - t = -3y. What is the units digit of y? 7 Let p = 40 - 20. Suppose p = j + 2s, 3s - 21 = -3j + 2j. What is the units digit of j? 8 Suppose 5f + 5l + 17 = 557, -3f - 2l + 322 = 0. What is the units digit of f? 6 Suppose 0 = -4c - 20, -2f - 4c - 194 = f. What is the tens digit of -2 + -1 - f/2? 2 Let t = -98 - -55. Let u = 60 + t. What is the tens digit of u? 1 Let u = 9 - 5. Suppose 54 = 5c - uj, -4c + 59 = 3j - 9. Let z = c - 5. What is the units digit of z? 9 Suppose -4l + 6l = 2. What is the units digit of (-1 - l) + (18 - 9)? 7 Suppose -4w = -0w - 3g + 30, 4g = 3w + 19. What is the units digit of (6/5)/(w/(-30))? 4 Suppose -12 = -5z - 2. Suppose -3s + 2y = -0y - 22, -2s - zy = -8. What is the units digit of s? 6 What is the units digit of (-3 + (-24)/(-9))-42? 4 Let x = -4 + 1. Let y = x + 5. Suppose -yi = 2b + b - 40, b + 4i = 30. What is the units digit of b? 0 Suppose z + 26 = 5d, -2z + 4 = -z. Let w(i) = -i*3 + 7i**2. What	{ "pile_set_name": "DM Mathematics" }
- 4g = 27. Let f(m) = -7m*2 + 9m + 5. Let s(v) = -3v2 + 4v + 2. Calculate qs(h) + 2f(h). h*2 - 2h Let z(o) = -4o3 + 5o*2 + 3o. Let n(x) = -3329x3 - 2 + 2 - 6x*2 + 3x + 3334x3 - 6x. Calculate -5n(h) - 6z(h). -h*3 - 3h Suppose -k - y = -2y - 12, 0 = 5k + 2y - 46. Let v(z) = z2 + z. Let w(j) = -3j*2 - 2j. What is kv(m) + 5w(m)? -5m2 Let d(c) = -c3 - c - 1. Let w(z) = -61 + 16z + 64 + 4z3 - 4z*2 - 12z - 2z3. Calculate -3d(h) - w(h). h*3 + 4h*2 - h Let s(d) = d + 2. Let y(f) = 4f*2 - 4f - 7. Let i(t) = -2s(t) - y(t). Let h(p) = 3p*2 - p - 2. Calculate 3h(m) + 2i(m). m2 + m Let o(b) = -9b*2 - 190b + 57b + 69b + 64b. Let d(t) be the first derivative of t3/3 - 1. What is 24d(f) + 3o(f)? -3f2 Let n(d) be the first derivative of d2 - d + 283. Let m(i) = -2i + 1. Calculate -5m(t) - 6n(t). -2t + 1 Let u(v) = -6v3 + 3v*2 - 2v + 3. Let b be -4 + (-7 + 16 - 6). Let y(j) = j3 - j2 - 1. Determine bu(x) - 3y(x). 3x3 + 2x Let d(b) = -b*3 + 64b*2 - 2b + 2. Let f(r) = -65r2 + 3r - 3. What is 6d(m) + 4f(m)? -6m3 + 124m*2 Suppose -17p = -18p + 79. Let b = p + -74. Let n(x) = x3 - 5x*2 - 7x + 2. Let a(o) = o*3 - 4o*2 - 6o + 2. Give ba(v) - 4n(v). v*3 - 2v + 2 Let g(l) = -5l. Suppose 20 + 65 = 5u. Let n(y) = -106 + 106 - 14y. Calculate ug(a) - 6n(a). -a Let w(s) = 7s - 3. Let j = -62 - -63. Suppose -3z + 3 = 2n - j, -4z + 4 = 2n. Let m(r) = -3r + 1. Determine nw(t) + 5m(t). -t - 1 Let v(g) = -17g - 7. Let k = -2108 - -2102. Let p(f) = -9f - 4. Let h(l) = -3l - 4. Let j be h(-5). Determine jp(o) + kv(o). 3o - 2 Let s(t) = 25t*3 - 7t*2 + 11t - 33. Let q(f) = -13f3 + 3f*2 - 6f + 18. Calculate -11q(k) - 6s(k). -7k3 + 9k*2 Let d = -2 - -3. Let z be 0 + (-1 + -1)/(-1). Let s(v) be the first derivative of 3v*2/2 + v - 1135. Let k(i) = -i - 1. Give ds(g) + zk(g). g - 1 Let n(w) = 12w - 1. Let k(z) = 35z - 6. Let i be k(0). Let m(x) = 12x - 1. What is im(u) + 5n(u)? -12u + 1 Let p(n) = -6n*3 - 3n2 - 3. Let o(h) = h3 + h*2 + 1. Let l = 687 - 684. Give lp(x) + 9o(x). -9x*3 Let x(l) = -l - 1. Let c(p) = -2p. Let r(a) = -2c(a) + 2x(a). Let n be (-33)/(-9) + 1/3. Let d(t) = 2t - nt + 27 - 25. Calculate 3d(u) + 2r(u). -2u + 2 Let j(p) = -25. Let l(m) = -m - 27. Determine 3j(z) - 2l(z). 2z - 21 Let q(s) = 413s - 9. Let u(a) = -827a + 15. Calculate -5q(h) - 3u(h). 416h Let f(z) be the first derivative of -2z*3/3 + 3z*2 + 6z - 82. Let p(x) = -x - 1. Determine -2f(y) - 14p(y). 4y2 + 2y + 2 Let r(q) = -q*2 + 11q + 8. Let y(s) = 3s - 3. Let o be y(3). Let l be 1 - (-8)/(-6) - (-20)/o. Let h(g) = -4g - 3. Give lr(k) + 8h(k). -3k2 + k Let a(y) = -y2 + 1. Let p(k) be the third derivative of k5/10 - 7k*3/6 + 88k*2. Give -35a(f) - 5p(f). 5f*2 Let n be -25-711/(-385). Let y(p) = -2p - 7. Let o(l) = l + 6. Calculate ny(h) - 6o(h). 4h - 1 Let c(x) = -10x. Let k(o) = 1. Let h be 8/6222/148. Calculate hk(t) + c(t). -10t + 2 Let i(q) = q + 2. Let p(r) = -r + 25. Let x be p(-11). Let o = -27 + x. Let h(z) = -5z - 9. Give oi(c) + 2h(c). -c Let s(y) = -31y + 13. Let n(w) = -w2 - 35w - 202. Let r be n(-7). Let i(o) = 16o - 7. Determine rs(u) - 11i(u). 10u - 1 Let d(n) = 4n. Let k be 3(4 + -3)/(-7 + 8). Let f(b) be the first derivative of 6b2 - 1. Calculate kf(t) - 10d(t). -4t Let s(f) = 2f3 + 16f - 88. Let n(i) = 3i. Determine 6n(q) - s(q). -2q3 + 2q + 88 Let x(z) = -6z3 - 3z + 3. Let o(b) = -5b3 - 409 + 0b - 2b + 411. Calculate 3o(n) - 2x(n). -3n*3 Let l(y) = -3y*3 + 5y*2 - 3y. Let u(q) be the first derivative of -q4/4 + q3/3 + q*2/2 - 564. Give l(s) - 5u(s). 2s3 - 8s Let d(v) = -2v3 + v2 + v - 1. Let n(w) = -10w*3 + 4w*2 + 4w - 75. Give 4d(u) - n(u). 2u*3 + 71 Let o(i) = -3i - 1. Let j(p) be the first derivative of p + 1. Let f(k) = j(k) - o(k). Let m(a) = -a. Suppose d = -0d - 1. What is dm(s) - f(s)? -2s - 2 Suppose 4g = -0 + 4. Let w(b) = -b. Let f(x) be the first derivative of 1/2x2 - 29 + x. Determine gw(y) + 2f(y). y + 2 Let g(w) be the third derivative of w4/24 - w2. Suppose 4p - 15 = -h, -5h = -3p + 2 + 15. Let a(b) = -3 - 2b + 1 + 0. Determine hg(c) - a(c). c + 2 Let t(u) = -6u2 - 3u + 7. Let n(z) = 15z2 + 5z - 15. Give 3n(y) + 5t(y). 15y2 - 10 Let j(q) = -102q - 190. Let l(n) = 34n + 68. Let b(g) = -5j(g) - 14l(g). Let x(r) = -17r + 1. Calculate 6b(s) + 13x(s). -17s + 1 Let b(i) be the first derivative of -i2/2 + 2. Let v(m) = -2. Suppose 2g - 3h = 17, -4g - 9 = 2h - 3. Suppose -3x = -2 - g. What is xv(o) - 2b(o)? 2o - 2 Let w(n) = -2n + 86. Let q(t) = 2t - 43. Calculate -5q(h) - 3w(h). -4h - 43 Let x(n) = 2n3 + n2. Let j(f) = 3f*3 + 4f*2 + f - 34. Calculate -j(g) + 3x(g). 3g3 - g2 - g + 34 Let f(u) = -24u*2 + 3u + 3. Let q(m) = 455m2 - 56m - 56. What is -56f(s) - 3q(s)? -21s2 Let h(v) = 8v - 10. Let y(f) = -9f + 9. Calculate 5h(x) + 6y(x). -14x + 4 Suppose 0 = -15m + 225 - 315. Let g(f) = f + 5. Let b(a) = 1. Calculate mb(q) + g(q). q - 1 Suppose 1 = -c + i, 3c - 8c - 4i = -40. Let f(t) = -6t*2 - 4. Let k(n) = 6n*2 + 5. Give ck(j) + 5f(j). -6j*2 Let b(k) = 19k3 - k2 - 5k. Let m(d) = -d3 - 31d*2 + 5d + 158. Let a be m(-31). Let r(l) = 10l3 - l2 - 3l. What is ab(x) - 5r(x)? 7x3 + 2x*2 Suppose -3212n + 3201n = -33. Let l(k) = 4k*3 + 5k*2 - k - 3. Let q(p) = 8p*3 + 9p*2 - 2p - 5. Determine nq(f) - 5l(f). 4f3 + 2f*2 - f Suppose 2 = -2z - 6. Let k = 9 + z. Let c(l) = -l + 2. Let t(a) = 23 + 3a - 31 + 3. Give kc(o) + 2t(o). o Let x(d) = 41d + 164. Let o(s) = s + 2. What is 82o(f) - x(f)? 41f Let d(r) = 3r - 4. Let w(s) = -7s. Let m(c) = -20c - 1. Let k(z) = m(z) - 3w(z). What is 3d(y) - 12k(y)? -3y Let s(v) = -719v*2 + 39v - 13. Let o(r) = 359r2 - 18r + 6. Calculate -13o(y) - 6s(y). -353y2 Let n(z) = 3z*3 + 2z*2 - 402z + 2. Let q(r) = 10r3 + 7r*2 - 1211r + 7. What is -7n(w) + 2q(w)? -w*3 + 392w Let l = -3450 - -3467. Let b(t) be the third derivative of t*4/6 - 2t3/3 + t2. Let i(x) = -12x + 11. What is lb(g) + 6i(g)? -4g - 2 Let x(i) = -2i3 - 2i*2 - 2i + 3. Let z(u) = -u*2 - u + 1. Suppose -6t - 10 = -t. Let k = t + 4. Give kz(a) - x(a). 2a*3 - 1 Suppose -12d + 56d - 88 = 0. Let o(i) = -9i + 2. Let k(p) = 242p - 55. Calculate dk(j) + 55o(j). -11j Let q(y) = 9y - 26. Let f(m) = 5m - 12. Determine -13f(s) + 6q(s). -11s Let a(c) = 2c*3 - 8c + 2. Let m(s) = s*3 - 7s + 3. What is -3a(k) + 2m(k)? -4k3 + 10k Let p(f) be the first derivative of -4/3f3 + 0f - 3/2f2 + 11. Let w(y) = -15y*2 - 11y. Determine -22p(v) + 6w(v). -2v2 Let c(p) = -361p*3 + 19p*2 + 38. Let s(f) = -60f*3 + 3f*2 + 6. Determine 6c(n) - 38s(n). 114n*3 Suppose -5r - 4 - 31 = 0. Let b(f) = -f. Let n(d) = 2d + 1. What is rb(p) - 4n(p)? -p - 4 Let t(v) = 3. Suppose 4q - 40 = 4w, 3q = -2q - 3w + 26. Let y(l) be the second derivative of -l*3/6 - 7l*2/2 - 14l. What is qt(g) + 3y(g)? -3g Let z(f) = -f2 + f. Suppose 20t = 7t - 78. Let j(i) = 13i*2 - 8i. Give tz(c) - j(c). -7c*2 + 2c Let m(n) = -5n - 8. Suppose -3z + 45 = -5r, 2r + z - 23 = 5r. Let b(s) = -5s - 7. What is rb(t) + 5m(t)? 5t + 2 Let v(y) = -34y*3 + 7y*2 + 4y - 2. Let q(o) = -11o3 + 2o*2 + o. Determine 7q(c) - 2v(c). -9c*3 - c + 4 Let t(d) = -4d - 14. Let v(b) be the first derivative of -b*2/2 - 5b + 422. Calculate -3t(g) + 8v(g). 4g + 2 Let z(k) = -6k. Let n(v) = 3v - v - v. Let l be 693(-2)/(-18). Let q = l - 32. What is qn(j) - z(j)? -3j Let x(v) = -13v*2 + 8v - 3. Let f(j) = 28j2 - 18j + 7. Let y(z) = -3f(z) - 7x(z). Let a(d) = -21d2 + 7d. What is 4a(m) + 14y(m)? 14m2 Suppose 0s + 14 = s + 2k, -5k + 37 = 3s. Let w(z) = 2z*2 + 15z - 4. Let x(n) = n*2 + 8n - 2. Determine sw(g) - 7x(g). g*2 + 4g - 2 Let r(x) be the first derivative of -3x4/2 + 3x*2/2 - 66. Let q(a) = 11a*3 - 5a. What is -3q(m) - 5r(m)? -3m*3	{ "pile_set_name": "DM Mathematics" }
29. Solve 0 = -4j - 3x + 2x + k, j - 5x = -15 for j. 5 Let n be -10(1 - 2)(-7)/(-14). Suppose 0m + 4i = nm - 537, 0 = 4i - 8. Let l = m + -107. Solve 4a + 4 = -p, -5a - lp - 5 = -6p for a. -1 Suppose -3m + 35 = -4d, 129 = d + 134. Solve -4u + 82j = 78j - 24, 0 = -mu - 5j - 10 for u. 2 Suppose -12r + 402 = -14r + 2u, -2r - 402 = u. Let o = 202 + r. Solve 8i + 9 = -k + 3i, 5k + 3i = -o for k. 1 Let l be (-20)/(-4) - (-2)/(-1). Suppose -7a + 5a + 10 = 0. Suppose 2v + ac = 5v - 68, -4c = 2v - 60. Solve -u - v = -lh - 6, 5u + 50 = 5h for u. -5 Let k = 75 - 73. Suppose kz = 4r, 0 = 3z - 0r - r - 15. Let j = z - 3. Solve 14 = -4q + 5y - 6, -jq - 5y - 15 = 0 for q. -5 Suppose -2o + 7o - 15 = 0. Suppose -132q + 137q + 2h - 14 = 0, 0 = 3q + h - 9. Suppose w + o = qw. Solve -2c - 2 = 0, 3r + 2c + w = c for r. 0 Let m(t) = -t2 - 9t - 12. Let n be m(-6). Suppose -3f = -2b + 14, nb - 30 = b + 5f. Solve -14 = v - bz, -v = -5v + 2z for v. 2 Suppose 3f - 45x = -50x - 58, -12 = f - 2x. Let r be (-5 + (-72)/f)-4. Solve 5q - 26 + 1 = 5o, -5o - rq = 11 for o. -3 Let g(d) = -d*2 + 21d - 30. Let c be g(18). Suppose -14 + c = 5p. Let m(j) = 2j*2 - j - 1. Let f be m(p). Solve 0 = 4y + fh + 2 + 4, 3h - 10 = y for y. -4 Let s be (-2)/((-5)/10 - 0). Suppose -sv - 3v = -14. Suppose -vj = 4j. Solve u - i = 3, u + ju - 3 = -5i for u. 3 Let b = -14 + 15. Let d = b - -4. Let o = -3192 - -3195. Solve 5 = -dv, -3v + 2 = -ok + v for k. -2 Let c(v) = v2 - 121v + 1953. Let m be c(19). Solve 4j = -2h - 14, -2h - 5j = m - 0 for h. -5 Let k = -256 + 259. Let b = -67 - -72. Solve -2 - 39 = 4j + bo, 27 = -kj - 3o for j. -4 Let k = -4285 - -4288. Solve -ku = -2i + 7i - 5, 5u + i + 21 = 0 for u. -5 Let v be 7 + ((-64)/4)/4. Let b be 54/((-3)/9v) - 4. Let d = b - -58. Solve -n - o + 5 + 0 = 0, 5n - 2o + 10 = d for n. 0 Suppose 0 = -4m - 2q + 16 - 38, m + 3q = -18. Suppose 2g - 4h - 22 = -26, 5g = 5h. Let o be 0/g - (0 + 1m). Solve of + f = j + 7, 2f = 2 for j. -3 Let a = 9349 + -9339. Solve a = 2n, 3q - 22 = -0q - 2n for q. 4 Let m(b) = 46b + 9. Let z be m(5). Let h = z + -167. Let v be (-4)/(h/(-78)) - (-2)/3. Solve -4c + t = 12 - 2, 5t = vc + 20 for c. -2 Suppose 0 = -3u + 4n + 33, -u - 2n = -n - 4. Suppose u = 4h - 2h - 3m, -4h + m + 19 = 0. Solve -4z = -ha - 31, -4a + 5z - 8 = -8a for a. -3 Let v(l) = -9l + 26. Let o be v(3). Let t be o(-1 + -6 + 4). Solve -tu + 1 = 16, 2u = -y - 14 for y. -4 Let n = -7235 - -7237. Solve -5o - 2w + 25 = 0, 3o - w = -nw + 14 for o. 3 Suppose 1365 = 5o + a, 2o - 413 = 3a + 150. Suppose -28v + o = -174. Solve v = 4f + 5c, 2f + 3c - 4 - 6 = 0 for f. -1 Let c = -711 + 715. Solve 3k - 8v = -6v - c, 5v = 5k + 5 for k. -2 Suppose -17 = j - 6. Let x be (j - -8)/((-3)/8). Suppose 9m = xm. Solve -3k + 2w + 3 = -2k, m = 3k + 3w + 27 for k. -5 Let g = -283 + 291. Suppose 0 = -h - 4 + g. Solve 0 = o + hu, -3o + 15 = 2u - 5u for o. 4 Suppose 10r - 6307 = -6277. Solve -2n - 6 = rc, 4n - 15c + 18c = 0 for n. 3 Let c = 163 - 83. Suppose cn - 8 = 76n. Solve 4o - 4q = -12, -n = o + o + 2q for o. -2 Let d = -130 - -140. Suppose 2k - 14 = -2l - 0l, 0 = -5l + 4k - d. Solve 6m - m + 7 = -lx, 3 = 2m - 5x for m. -1 Let q be (-18)/(-4)((-352)/(-33))/(-8). Let s be (0 - -64)/8 + q. Solve 0 = sx + r + 1, 4r + 22 = 3x - 4 for x. 2 Let d = 342 - 321. Let a be (6/d - 132/(-77)) + 10. Solve 2c + 6 = -2w - c, 4w + a = 5c for w. -3 Let p be (4 + -5 - 2)/(0 + -1). Let y be (1/p)/((-2 + 0)/(-150)). Solve 4l - y = 5m, 0m = -5m + l - 25 for m. -5 Let b(r) = -133r - 1460. Let q be b(-11). Solve -5j - 22 = -h, qj + 3 = -3h - 3 for h. 2 Let i = -92 - -94. Let f be (-1)/(4/(-18) + 5/(-180)). Solve 5b = -0b + il + 12, 0 = -l + f for b. 4 Suppose -50 = -59d + 34d. Solve -da - l + 2 = 0, 0 = -5a + 2l - 5l + 7 for a. -1 Let s be ((-15)/20)/(12/(-64)). Suppose k - s = -w, -3k = 4w - 7 - 7. Solve -3z = -3, -4z + 5 = wc + 1 for c. 0 Let m = 45 - -56. Let c = m - 96. Solve -2t = t - ck - 10, -5k = -t + 20 for t. -5 Suppose -13788n = -13789n + 3. Solve 0 = 4y - 4, -y = 4r - 0 + n for r. -1 Suppose -6w + w + 24 = -4z, 3z + 7 = w. Suppose 4n - 6n + ws - 4 = 0, 3n - 4 = s. Solve -3r - 10 = 7g - 2g, 0 = -ng - 10 for r. 5 Suppose -16n = -37n + 19n + 20. Solve -3q = 4f + 11, 3q - nf + 8f = 19 for q. 3 Let i(a) = 4a*2 + 94a + 50. Let y be i(-23). Solve -11d = -7d - yf + 8, 0 = -4f + 8 for d. 0 Suppose 24g - 59 = 9 + 28. Solve 2p - 3v - g = 0, 0 = -2p + 5v + 16 - 4 for p. -4 Let j(r) = 7r + 44. Let l be (-9 + 3)/(-1 - -2). Let t be j(l). Solve 2c + 5g - 16 = 3c, 3c = -tg + 3 for c. -1 Suppose -14 = 10p - 9p - 8h, -5p + 2h = -6. Solve -x + 4m = 7m - 20, px = m + 5 for x. 5 Let l = -11544 - -11556. Solve -lq + 14q - 10 = 2w, 0 = 3w - 3 for q. 6 Let k(m) = 19m - 63. Let n be k(-11). Let s = n + 286. Solve 3z - s = 2h, 5z - 33 + 7 = 4h for z. 2 Suppose -19k = -58k - 11 + 206. Solve -6g = -5d - 5g + 23, 0 = -kd - g + 17 for d. 4 Let x be 14 + 4 + -9 + 4. Suppose 78 = xn - 0. Solve 4d + 2r + 19 = -r, -2d + 2r - n = 0 for d. -4 Suppose -19t + 90 = -25t. Let b be (-55)/(-11)((-24)/t - 1). Solve -8 = -m - 2q - 2, 0 = 2m - bq - 5 for m. 4 Suppose -567s + 60 = -557s. Solve 5b - 24 - s = -5q, -b = 3q - 16 for q. 5 Let y(g) = -35g - 873. Let i be y(-25). Solve -w = -ih + 7h + 5, 2w - 4 = 4h for h. -1 Suppose 43 = 3s + 2f, -4f - 46 = -5s + 11. Suppose -2k + s = -o, 7k - 3k + o = 17. Solve -a + 3a = 4h - 18, -4a - 27 = -kh for a. -3 Let m be (-22)/33216/(-48). Solve mp = -2v, -43p = -39p - v for p. 0 Let q be (-216)/28 + 7 - 6832/(-98). Solve -3m + q - 61 = -2u, 0 = 4u + 5m - 28 for u. 2 Let q = 5 - -22. Let g = -20 + q. Suppose -gl = 2 - 37. Solve 0 = ld - 3v + 17, 3v = 6v - 12 for d. -1 Let w(h) = 4h2 - 5. Let v be w(-2). Let p(m) = -2m - 4. Let b be p(-2). Suppose -6u + vu = b. Solve un = -3n - 3g, n = -3g + 2 for n. -1 Let x = -9968 - -9988. Solve -5n = -s - 9 + x, -4n + 2s - 4 = 0 for n. -3 Let h(m) = 264 - 32 - 4m - 2m - 2m. Let i be h(29). Solve 0 = -5y, 4y + i - 20 = -5z for z. 4 Let d(g) = 14g*2 - 2g + 5. Let o be d(0). Solve -3y + 4 + 0 = 4b, -oy + 3 = 3b for b. 1 Let a = 9995 + -9988. Solve -3i + 12 = 4g - ag, 0 = -g + 5i - 20 for g. 0 Let o = 29 - 19. Suppose -r + 26 = o. Suppose -16 = rz - 20z. Solve 2i - 4 = f, -5f + z + 12 = -i for f. 4 Let a be (-22)/55 + (17/5 - 1). Suppose 3g = at + 21, -2g - 5t - 25 = -20. Solve -2d + gx - 21 = -0, 5x - 27 = 4d for d. -3 Let m be (-7 - -17)(-5 + 3)/(-10). Solve 4f - mp - 38 = 0, -5f = -62p + 57p - 60 for f. 7 Let n(u) be the third derivative of u*5/60 - 5u4/12 + u3/3 + 83u2. Let i be n(10). Solve -18 = 5c - 5t + 7, -it = -5c - 16 for c. -2 Let u(f) = -f3 + 20f*2 - 20f + 21. Let w be u(19). Solve r = -s + 4, 65s - 60s - wr = -8 for s. 0 Suppose 54q - 5i = 57q + 3, 2q - 2i = 14. Let f = 5 - 3. Solve 0 = qx + fm + 3m - 25, -4x = 3m - 23 for x. 5 Suppose -18 + 10 = -2p. Suppose -8 - 24 = -5w + b, pw - b - 26 = 0. Solve -4g - 2l + wl = -20, -3l - 9 = 0 for g. 2 Suppose 0 = 134k - 156k + 374. Solve -5a + 9a + u - k = 0, 1 = a - 3u for a. 4 Let i be -3 + (92/12 - 2/3). Suppose 127 = -4g + h - 113, 4g + 240 = ih. Let b = g + 69. Solve b = -2z - 3u, 5z + 3u + 3 = -6 for z. 0 Let g(f) = -5 - 3 + 8 + 14f + 4f*2. Let y be g(-4). Solve 4u + u - 7 = v, 4v - 2u = y for v. 3 Suppose 168 = 12d - 12. Let z be 56/20 + -3 + 93/d. Solve 2b + 4 = 0, 5 - z = -s - b for s. 3 Let j(q) = 11q + 24. Let o be j(23). Let l = -275 + o. Solve -l = a - 5z + 11, -2z = -3a for a. 2 Let s be 38/14 - (-6)/21. Suppose 0 = 3r + 68r. Solve -m - sf - 1 = 0, 3m - f + 14 - 1 = r for m. -4 Suppose 2s - y - y = 40, -2s = -3y - 44. Let u(v) = -v3 + 17v*2 - 12v - 44. Let i be u(s). Solve 0 = 4z + d + 2 - 5, 0 = 5z - 2d - i for z. 2 Let g be ((-4)/(-10))/((-1)/(-10)). Solve 4i - 2s + 22 = 0, -3i + 3s - 5 = -gi for i. -4 Let p = -3145 + 3156. Solve 3x = 9b	{ "pile_set_name": "DM Mathematics" }
usands digit of 116693? 1 What is the thousands digit of 9452016? 2 What is the units digit of 271561? 1 What is the ten thousands digit of 169816? 6 What is the millions digit of 2102751? 2 What is the ten thousands digit of 5902431? 0 What is the thousands digit of 272389? 2 What is the units digit of 448224? 4 What is the ten millions digit of 23151720? 2 What is the tens digit of 13316186? 8 What is the ten thousands digit of 155049? 5 What is the hundreds digit of 7400234? 2 What is the units digit of 3292244? 4 What is the hundreds digit of 26194587? 5 What is the ten thousands digit of 84725? 8 What is the hundred thousands digit of 36947004? 9 What is the units digit of 5426451? 1 What is the hundred thousands digit of 1897833? 8 What is the units digit of 4943270? 0 What is the hundreds digit of 553402? 4 What is the ten thousands digit of 774984? 7 What is the millions digit of 1272189? 1 What is the ten thousands digit of 54715? 5 What is the hundred thousands digit of 425804? 4 What is the hundred thousands digit of 34835587? 8 What is the hundred thousands digit of 1892037? 8 What is the tens digit of 150516? 1 What is the hundreds digit of 2668565? 5 What is the millions digit of 4163275? 4 What is the tens digit of 3759382? 8 What is the tens digit of 183224? 2 What is the units digit of 22891100? 0 What is the millions digit of 1978472? 1 What is the ten thousands digit of 129361? 2 What is the hundred thousands digit of 1155894? 1 What is the hundred thousands digit of 9438619? 4 What is the thousands digit of 7346921? 6 What is the hundred thousands digit of 12706583? 7 What is the units digit of 21924? 4 What is the ten thousands digit of 281412? 8 What is the hundred thousands digit of 7040312? 0 What is the hundreds digit of 31987622? 6 What is the units digit of 335737? 7 What is the ten thousands digit of 545723? 4 What is the tens digit of 758324? 2 What is the hundred thousands digit of 3614836? 6 What is the ten thousands digit of 448366? 4 What is the millions digit of 1059527? 1 What is the hundreds digit of 4586988? 9 What is the millions digit of 2035104? 2 What is the tens digit of 25486468? 6 What is the thousands digit of 397946? 7 What is the hundreds digit of 525397? 3 What is the hundred thousands digit of 13596066? 5 What is the hundred thousands digit of 3477059? 4 What is the units digit of 1956663? 3 What is the ten thousands digit of 12369469? 6 What is the thousands digit of 421998? 1 What is the units digit of 672149? 9 What is the units digit of 1801838? 8 What is the tens digit of 58759? 5 What is the units digit of 7847351? 1 What is the thousands digit of 17446554? 6 What is the tens digit of 957035? 3 What is the tens digit of 75203? 0 What is the ten thousands digit of 240209? 4 What is the hundreds digit of 181673? 6 What is the units digit of 2193732? 2 What is the hundreds digit of 162790? 7 What is the tens digit of 11305? 0 What is the hundreds digit of 349117? 1 What is the ten thousands digit of 6026243? 2 What is the hundred thousands digit of 789429? 7 What is the units digit of 1026319? 9 What is the tens digit of 456932? 3 What is the units digit of 1217335? 5 What is the hundred thousands digit of 1695820? 6 What is the ten thousands digit of 10235336? 3 What is the thousands digit of 76828? 6 What is the millions digit of 11268464? 1 What is the thousands digit of 543271? 3 What is the hundreds digit of 331488? 4 What is the ten thousands digit of 48297? 4 What is the units digit of 36738? 8 What is the thousands digit of 2393248? 3 What is the hundreds digit of 5267318? 3 What is the hundred thousands digit of 742002? 7 What is the millions digit of 6051513? 6 What is the hundreds digit of 1887711? 7 What is the units digit of 167784? 4 What is the hundreds digit of 1447328? 3 What is the ten thousands digit of 404862? 0 What is the units digit of 2289216? 6 What is the tens digit of 5090792? 9 What is the thousands digit of 174329? 4 What is the units digit of 84709? 9 What is the millions digit of 2156704? 2 What is the millions digit of 3419907? 3 What is the hundreds digit of 5052855? 8 What is the ten millions digit of 27371673? 2 What is the tens digit of 209970? 7 What is the thousands digit of 57106? 7 What is the tens digit of 458161? 6 What is the thousands digit of 5130694? 0 What is the hundred thousands digit of 4405395? 4 What is the ten thousands digit of 7387266? 8 What is the hundred thousands digit of 2118381? 1 What is the thousands digit of 5804507? 4 What is the hundreds digit of 6153145? 1 What is the tens digit of 5258584? 8 What is the units digit of 9969? 9 What is the millions digit of 3057977? 3 What is the ten thousands digit of 344792? 4 What is the tens digit of 555893? 9 What is the units digit of 1387827? 7 What is the tens digit of 587708? 0 What is the hundred thousands digit of 2013208? 0 What is the hundreds digit of 14874? 8 What is the ten thousands digit of 627381? 2 What is the thousands digit of 697966? 7 What is the hundreds digit of 5042714? 7 What is the ten thousands digit of 136879? 3 What is the hundred thousands digit of 8245375? 2 What is the units digit of 150685? 5 What is the units digit of 68371? 1 What is the hundred thousands digit of 2025831? 0 What is the thousands digit of 1169181? 9 What is the units digit of 48614? 4 What is the hundred thousands digit of 261116? 2 What is the hundreds digit of 5567651? 6 What is the millions digit of 1368052? 1 What is the thousands digit of 1037896? 7 What is the units digit of 3676098? 8 What is the thousands digit of 3627460? 7 What is the hundreds digit of 5273? 2 What is the hundreds digit of 1724396? 3 What is the hundred thousands digit of 217161? 2 What is the tens digit of 2630426? 2 What is the hundred thousands digit of 1758219? 7 What is the hundred thousands digit of 151968? 1 What is the millions digit of 4236155? 4 What is the ten thousands digit of 1634634? 3 What is the units digit of 871775? 5 What is the ten thousands digit of 13760865? 6 What is the hundreds digit of 112308? 3 What is the thousands digit of 349983? 9 What is the hundreds digit of 74197? 1 What is the thousands digit of 237171? 7 What is the hundred thousands digit of 16630518? 6 What is the units digit of 120852? 2 What is the hundred thousands digit of 30042374? 0 What is the millions digit of 4039218? 4 What is the thousands digit of 79883? 9 What is the tens digit of 260329? 2 What is the tens digit of 36882089? 8 What is the units digit of 296786? 6 What is the thousands digit of 6630847? 0 What is the thousands digit of 6506821? 6 What is the millions digit of 3528582? 3 What is the hundred thousands digit of 146969? 1 What is the thousands digit of 29283563? 3 What is the thousands digit of 104106? 4 What is the thousands digit of 1895822? 5 What is the hundreds digit of 123286? 2 What is the units digit of 630333? 3 What is the tens digit of 1108315? 1 What is the thousands digit of 4169188? 9 What is the ten thousands digit of 12111872? 1 What is the millions digit of 16738573? 6 What is the hundred thousands digit of 2775736? 7 What is the units digit of 975606? 6 What is the units digit of 1336160? 0 What is the hundred thousands digit of 2943095? 9 What is the units digit of 10872235? 5 What is the thousands digit of 12019038? 9 What is the thousands digit of 1129380? 9 What is the hundreds digit of 8654319? 3 What is the units digit of 2034506? 6 What is the ten thousands digit of 90333? 9 What is the ten thousands digit of 12685873? 8 What is the units digit of 377632? 2 What is the ten thousands digit of 6147630? 4 What is the thousands digit of 88488? 8 What is the thousands digit of 629900? 9 What is the units digit of 1968750? 0 What is the hundred thousands digit of 190369? 1 What is the hundred thousands digit of 1422402? 4 What is the ten thousands digit of 725731? 2 What is the millions digit of 7442449? 7 What is the ten millions digit of 31902694? 3 What is the thousands digit of 14427870? 7 What is the thousands digit of 12733565? 3 What is the tens digit of 381638? 3 What is the tens digit of 199466? 6 What is the hundreds digit of 93977? 9 What is the tens digit of 215870	{ "pile_set_name": "DM Mathematics" }
1 - 1637602m/11 = 0. Calculate m. 0, 818801 Let -2f*4 + 4454f*3 + 53792f*2 - 125384f = 0. Calculate f. -14, 0, 2, 2239 Factor l*2 - 1080l + 38591. (l - 1043)(l - 37) Find x, given that -x5/2 + 1595x*4/2 - 197589x*3/2 + 8589121x*2/2 - 66399439x + 116398248 = 0. 2, 43, 1464 Solve 2x5/5 - 7596x*4/5 + 9608872x*3/5 - 4038694268x*2/5 - 2494619106x + 113898465128/5 = 0. -7, 4, 1267 Factor -t*3/8 + 14300t2. -t2(t - 114400)/8 Solve -3n*2 + 239202n = 0 for n. 0, 79734 Suppose 4x5/7 + 1236x*4/7 - 2184x*3 + 38408x*2/7 - 35916x/7 + 11556/7 = 0. What is x? -321, 1, 9 Factor -2h2/13 - 112460h/13 - 112458/13. -2(h + 1)(h + 56229)/13 Determine p, given that -2p2/11 - 20150p/11 + 1832 = 0. -10076, 1 Let 7c4/4 - 115c*3/2 + 1101c*2/4 + 81c/2 = 0. What is c? -1/7, 0, 6, 27 Factor -4q3 - 2121q*2 + 1594q + 531. -(q - 1)(q + 531)(4q + 1) Factor 3h*2/7 - 1208h/7 - 452176/7. (h + 236)(3h - 1916)/7 Factor -o*3/3 - 29o*2 - 1886o/3. -o(o + 41)(o + 46)/3 Factor 125f3/2 - 634825f*2 + 1523445f/2 - 228510. 5(f - 10156)(5f - 3)2/2 Solve -3g*2 - 2307g + 4626 = 0 for g. -771, 2 Determine s so that 19s2 - 1281s - 2070 = 0. -30/19, 69 Suppose 4k4 - 1396k*3 - 119884k*2 - 572636k - 676968 = 0. Calculate k. -67, -3, -2, 421 Factor -4y4 - 20144y*3 - 25601872y*2 - 605770368y - 3617300736. -4(y + 12)2(y + 2506)*2 Let 7z*3 + 2032z*2 + 14447z + 3962 = 0. What is z? -283, -7, -2/7 Suppose -5z2 + 928730z - 43126970645 = 0. What is z? 92873 Let -p*3/8 - 5691p*2/8 - 11379p/8 - 5689/8 = 0. What is p? -5689, -1 Determine p so that 4p4/7 - 2264p*3/7 - 29888p*2/7 - 127080p/7 - 173700/7 = 0. -5, -3, 579 Factor -4l2/5 + 2268l/5 - 80408/5. -4(l - 529)(l - 38)/5 Find m, given that 148m2/3 + 58156m/3 - 1048 = 0. -393, 2/37 Factor -20p2/11 - 218p/11 - 18. -2(p + 1)(10p + 99)/11 Solve -d3 + 57d*2 + 4d - 228 = 0. -2, 2, 57 Factor -h*3 - 46h*2 + 95h - 48. -(h - 1)*2(h + 48) Solve -14z5 + 620z*4 + 3912z*3 + 4432z*2 - 1600z = 0 for z. -4, -2, 0, 2/7, 50 Suppose 4f5 - 652f*4 - 3388f*3 + 4684f*2 + 3384f - 4032 = 0. What is f? -6, -1, 1, 168 Factor j*3/6 + 152j*2/3 + 23015j/6 + 11356/3. (j + 1)(j + 136)(j + 167)/6 Suppose -10o4 - 96o*3 + 570o*2 - 632o + 168 = 0. Calculate o. -14, 2/5, 1, 3 Let -n*3/2 - 27n*2 - 249n/2 - 98 = 0. Calculate n. -49, -4, -1 What is y in -3y3/8 + 32883y*2/8 - 90091197y/8 - 90124083/8 = 0? -1, 5481 Factor y*2 + 345y + 6500. (y + 20)(y + 325) Let 2g*4/3 - 102g*3 - 416g*2 - 1256g/3 = 0. What is g? -2, 0, 157 Factor -2z2 + 2180z + 10950. -2(z - 1095)(z + 5) Determine j so that 2j4 - 14j*3 - 1374j*2 + 19550j - 33524 = 0. -29, 2, 17 Find x, given that -2x2/11 + 101540x/11 - 1288796450/11 = 0. 25385 Factor v*4/2 - 55v*3/2 - 2250v2. v2(v - 100)(v + 45)/2 Determine b, given that -2b4 - 5746b*3 + 2b*2 + 5746b = 0. -2873, -1, 0, 1 Factor j*4/2 + 4613j*3 + 21178041j*2/2 - 234635632j + 1293573248. (j - 11)*2(j + 4624)*2/2 Factor 55w*2 - 14365w + 42600. 5(w - 3)(11w - 2840) Factor 2i*2/3 - 2068i/3 - 60210. 2(i - 1115)(i + 81)/3 Factor -3v2 + 29859v + 29862. -3(v - 9954)(v + 1) Factor -o*3/4 + 58287o*2 - 1398861o/4 + 1049139/2. -(o - 233142)(o - 3)2/4 Solve 5o*3 + 1460o*2 + 11315o - 12780 = 0. -284, -9, 1 Suppose -20b4 - 68b*3 + 656b*2 - 688b - 384 = 0. What is b? -8, -2/5, 2, 3 Factor -5r3 - 1400r*2 + 7105r - 5700. -5(r - 4)(r - 1)(r + 285) Suppose -8b*5/3 + 29b*4/3 - 23b*3/3 - 19b*2/3 + 31b/3 - 10/3 = 0. Calculate b. -1, 5/8, 1, 2 Factor -a*2/2 + 137108a + 274217/2. -(a - 274217)(a + 1)/2 Factor -4f*4 - 204f*3 + 8224f*2 - 15600f. -4f(f - 25)(f - 2)(f + 78) Determine u so that 128u5 + 3424u*4 + 8504u*3 + 1050u*2 - 7056u = 0. -24, -7/4, 0, 3/4 Factor 2v5/9 + 158v*4/3 - 1928v*3/9. 2v*3(v - 4)(v + 241)/9 Let -4o*3/11 + 8942o*2/11 + 22386o/11 - 13428/11 = 0. What is o? -3, 1/2, 2238 Let -3a5 - 2991a*4 - 225114a*3 - 4625538a*2 - 8587683a - 4184271 = 0. What is a? -917, -39, -1 Solve 3x2/4 + 33927x/4 + 709821/2 = 0 for x. -11267, -42 Factor -162z3 - 9792z*2 - 4328z - 480. -2(z + 60)(9z + 2)2 Suppose -2p*2/3 - 46552p/3 - 270886088/3 = 0. What is p? -11638 What is w in -3w3 + 174w*2 - 2097w + 6966 = 0? 6, 9, 43 Suppose -3l3/2 - 36693l*2 - 146763l/2 - 36690 = 0. What is l? -24460, -1 Suppose -3p2/4 - 6357p - 12711 = 0. What is p? -8474, -2 What is z in 4z4/7 + 432z*3/7 + 1256z*2/7 - 432z/7 - 180 = 0? -105, -3, -1, 1 Factor 5b3 + 385b*2 - 7800b - 774000. 5(b - 43)(b + 60)2 Factor v4/5 + 5v3 - 392v*2/5 - 4224v/5. v(v - 16)(v + 8)(v + 33)/5 Factor 3l*2/2 - 368961l + 45377406507/2. 3(l - 122987)2/2 Factor 6n*2 + 19839n + 128700. 3(n + 3300)(2n + 13) Factor -5o*5 + 29985o*4 - 60029700o*3 + 40298321840o*2 - 357844317120o. -5o(o - 1996)*3(o - 9) Find a such that 45a5 - 1257a*4 - 120a*3 + 996a*2 + 336a = 0. -2/3, -2/5, 0, 1, 28 Factor c*3 - 197c*2 - 1004c - 1212. (c - 202)(c + 2)(c + 3) Suppose -t*5/7 + 2t*4/7 + 195t*3/7 + 640t*2/7 - 2624t/7 - 3072/7 = 0. What is t? -8, -1, 3, 16 What is b in b*5 + 178b*4 + 3654b*3 - 369500b*2 + 5479321b - 20601654 = 0? -109, 6, 17 Find s such that 4s3 - 134s*2/21 - 190s/21 = 0. -19/21, 0, 5/2 Let y*5 + 1904y*4 - 11459y*3 + 1934y*2 + 45856y + 30560 = 0. Calculate y. -1910, -1, 4 Find x, given that 2x4 + 58852x*3 + 58848x*2 - 58852x - 58850 = 0. -29425, -1, 1 Factor q*2/5 - 927086q/5 + 214872112849/5. (q - 463543)*2/5 Factor 3y*3/7 - 4578y*2 + 85610880y/7 - 171093600/7. 3(y - 5340)2(y - 2)/7 Suppose 8f5/15 + 14f*4 - 10372f*3/15 + 5862f*2/5 - 4936f/15 - 832/5 = 0. What is f? -52, -1/4, 1, 24 Factor u*5/8 + 7u4/4. u4(u + 14)/8 Suppose 14544j*5 - 53616j*4 + 40244j*3 + 17000j*2 + 1264j - 32 = 0. What is j? -1/6, 2/101, 2 Factor 5x3 + 55055x*2 + 151580175x + 151525125. 5(x + 1)(x + 5505)*2 Determine g so that -24g*3 - 60741g*2 - 38458530g - 33604725 = 0. -1265, -7/8 What is k in -2k4 - 16k*3 + 132k*2 + 656k - 770 = 0? -11, -5, 1, 7 Solve -2u5/9 - 5912u*4/3 + 3942u*3 - 17740u*2/9 = 0. -8870, 0, 1 Let -5s*3 - 6075s*2 - 6070s = 0. What is s? -1214, -1, 0 Factor 5y3 + 50y*2 - 1105y + 1050. 5(y - 10)(y - 1)(y + 21) Determine q, given that -5q*2 - 1023185q + 1023190 = 0. -204638, 1 Factor 5o3 - 150o*2 - 20o + 600. 5(o - 30)(o - 2)(o + 2) Factor -2c*3 + 410c*2 - 20414c - 20826. -2(c - 117)(c - 89)(c + 1) Factor -z4/4 + 3159z*3/2 - 9985597z*2/4 + 4988061z - 2493241. -(z - 3158)*2(z - 1)2/4 Factor -g3/4 + 117g2/2 - 77g/4 - 9087. -(g - 233)(g - 13)(g + 12)/4 Suppose -2g2 - 1028g - 2048 = 0. Calculate g. -512, -2 Let 3d5 + 105d*4 + 849d*3 + 2607d*2 + 3360d + 1500 = 0. Calculate d. -25, -5, -2, -1 Find d such that 867d4 - 964512d*3 + 453744d*2 - 53376d = 0. 0, 4/17, 1112 Suppose -3y5/4 - 213y*4/4 - 399y*3/4 + 1053y*2/4 + 621y/2 = 0. What is y? -69, -3, -1, 0, 2 Determine l, given that 22801l4 + 593430l*3 + 3869077l*2 + 102180l + 676 = 0. -13, -2/151 Solve -16o5/3 - 538o*4 - 7259o*3/3 + 7304o*2 - 2325o - 2016 = 0. -96, -7, -3/8, 1, 3/2 Factor 3p2 + 1239p + 2466. 3(p + 2)(p + 411) Factor g*2 + 29063g - 145340. (g - 5)(g + 29068) Solve 32s*5/9 - 5872s*4 + 8774s*3/3 + 155308s*2/9 - 62750s/3 + 6604 = 0 for s. -2, 3/4, 1, 1651 Find f such that 3f3 - 1593f*2 + 151404f = 0. 0, 124, 407 Find b such that -25b4/4 - 51395b*3/2 - 164381b*2/4 + 19522b - 2055 = 0. -4110, -2, 1/5 Let 4r5 - 5740r*4 - 86856r*3 - 208800r*2 = 0. What is r? -12, -3, 0, 1450 What is s in -2s*4 + 64s*3 - 238s*2 - 2104s + 4680 = 0? -5, 2, 9, 26 Let -4w4 - 4878w*3 - 1466214w*2 + 12839968w + 6785928 = 0. What is w? -614, -1/2, 9 Factor -2g2/3 - 830g/3 - 824. -2(g + 3)(g + 412)/3 Factor 231s3/4 - 6011s*2/2 + 39169s - 1690. (s - 26)*2(231s - 10)/4 Factor r3/6 + 55r*2/6 + 233r/3 + 12	{ "pile_set_name": "DM Mathematics" }
cimal places. 0.6 What is 0.00002862764 rounded to six decimal places? 0.000029 Round 0.960042 to three decimal places. 0.96 What is -0.009111095 rounded to four dps? -0.0091 What is -0.00011407305 rounded to 6 decimal places? -0.000114 What is 1321110 rounded to the nearest one thousand? 1321000 What is -0.0000004591048 rounded to seven decimal places? -0.0000005 Round -0.0065884 to 4 dps. -0.0066 Round 51747800 to the nearest one million. 52000000 What is -8564.507 rounded to the nearest 10? -8560 What is 26572.47 rounded to the nearest ten thousand? 30000 Round 0.1699639 to two dps. 0.17 Round 0.00008807338 to six dps. 0.000088 What is 0.2623875 rounded to 2 decimal places? 0.26 What is 0.000001404178 rounded to six dps? 0.000001 Round -63908.3 to the nearest one thousand. -64000 Round 250.067 to the nearest integer. 250 What is -1.0183091 rounded to 3 decimal places? -1.018 Round 2.9588 to one dp. 3 Round -11.26141 to one decimal place. -11.3 Round 51757861 to the nearest 10000. 51760000 Round -0.0001285538 to seven decimal places. -0.0001286 What is -0.743147 rounded to one decimal place? -0.7 What is 0.000271321 rounded to 5 dps? 0.00027 Round 737590 to the nearest 100000. 700000 What is -85819.68 rounded to the nearest 10000? -90000 Round -0.068825434 to 3 dps. -0.069 What is -2885.7 rounded to the nearest one thousand? -3000 What is 0.0002161003 rounded to seven decimal places? 0.0002161 Round 6146.54 to the nearest 10. 6150 Round -162264 to the nearest 10000. -160000 What is -211202 rounded to the nearest ten thousand? -210000 What is 859412900 rounded to the nearest one million? 859000000 Round -0.000141813 to six decimal places. -0.000142 What is -77869.47 rounded to the nearest 10000? -80000 Round -0.16009 to 2 dps. -0.16 Round -200825.17 to the nearest 100. -200800 Round -7114.97 to the nearest 10. -7110 What is 0.0001691576 rounded to six decimal places? 0.000169 Round -0.00003439399 to six decimal places. -0.000034 Round -1.135647 to two dps. -1.14 Round 0.000011127275 to 7 decimal places. 0.0000111 Round 13844395 to the nearest 1000. 13844000 Round -0.08128967 to three decimal places. -0.081 What is 165217700 rounded to the nearest one hundred thousand? 165200000 What is 528207000 rounded to the nearest 1000000? 528000000 What is -0.0012423252 rounded to six dps? -0.001242 Round 21813500 to the nearest 1000000. 22000000 Round 0.21181605 to four dps. 0.2118 Round 17.57139 to the nearest integer. 18 What is 323.9044 rounded to 1 decimal place? 323.9 Round -0.07812705 to five decimal places. -0.07813 What is -320.56229 rounded to the nearest 10? -320 What is 70633477 rounded to the nearest one hundred thousand? 70600000 What is -0.00004703523 rounded to 6 decimal places? -0.000047 What is -43.74825 rounded to the nearest integer? -44 What is 90001.83 rounded to the nearest 100? 90000 Round -0.00249077 to four dps. -0.0025 Round 7061049 to the nearest ten thousand. 7060000 Round -281.7375 to the nearest integer. -282 Round 0.0000021838 to 6 dps. 0.000002 Round -0.5863822 to 4 dps. -0.5864 What is 1910479.5 rounded to the nearest 10000? 1910000 Round 127569300 to the nearest one million. 128000000 Round -0.004881631 to five decimal places. -0.00488 What is -0.001053068 rounded to four decimal places? -0.0011 Round 1.8488773 to two decimal places. 1.85 Round 498450.3 to the nearest one thousand. 498000 What is 269115.9 rounded to the nearest one hundred thousand? 300000 Round 3579011500 to the nearest 1000000. 3579000000 Round -7.318615 to the nearest integer. -7 What is -3.6104616 rounded to three decimal places? -3.61 Round 18.9709 to one decimal place. 19 What is -0.1688879 rounded to four dps? -0.1689 Round -0.00033609437 to 5 dps. -0.00034 Round -0.0000035273294 to seven dps. -0.0000035 What is -0.024406 rounded to 2 dps? -0.02 Round -6.1557 to the nearest integer. -6 Round -13.709037 to 1 dp. -13.7 What is -0.00285606 rounded to three decimal places? -0.003 Round 45.253 to the nearest ten. 50 What is -2.8946967 rounded to zero dps? -3 Round -2758722 to the nearest one hundred thousand. -2800000 What is -0.0000813898 rounded to five dps? -0.00008 What is -33195.04 rounded to the nearest 10000? -30000 Round -0.01956302 to two dps. -0.02 Round -38.214 to 1 dp. -38.2 Round -0.6671043 to 3 decimal places. -0.667 Round -60.29544 to the nearest 10. -60 What is -0.00635135 rounded to 4 dps? -0.0064 What is -290482.4 rounded to the nearest 1000? -290000 What is 6.108314 rounded to the nearest integer? 6 Round -234175.63 to the nearest one thousand. -234000 Round 0.00112103 to 5 dps. 0.00112 What is 282430.6 rounded to the nearest one hundred? 282400 What is 641458.6 rounded to the nearest one hundred? 641500 What is 0.02113698 rounded to 4 dps? 0.0211 Round -5871.475 to zero dps. -5871 What is -0.00000497829 rounded to six dps? -0.000005 What is 0.0000458326 rounded to 6 decimal places? 0.000046 Round -0.0001041886 to five dps. -0.0001 What is -61.0469 rounded to one decimal place? -61 Round 2.7001 to two decimal places. 2.7 Round 27104250 to the nearest one hundred thousand. 27100000 Round 0.0001118853 to 5 decimal places. 0.00011 What is 32835.39 rounded to the nearest one thousand? 33000 Round 21.2467 to the nearest 10. 20 What is 63100.836 rounded to the nearest ten thousand? 60000 What is 1480.4681 rounded to the nearest ten? 1480 What is -597600 rounded to the nearest one hundred thousand? -600000 What is -9994.59 rounded to the nearest 100? -10000 What is 71.004 rounded to the nearest 10? 70 Round -0.00050674 to 5 dps. -0.00051 Round -30577 to the nearest 1000. -31000 What is -106697.46 rounded to the nearest ten thousand? -110000 What is -4874248 rounded to the nearest 10000? -4870000 What is 4489712 rounded to the nearest 10000? 4490000 Round 1420.326 to the nearest ten. 1420 Round -0.0000907069 to six decimal places. -0.000091 Round 254.5642 to the nearest ten. 250 Round 0.0099677 to three decimal places. 0.01 Round 6192476 to the nearest 100000. 6200000 What is 1223102.8 rounded to the nearest one thousand? 1223000 What is 893996600 rounded to the nearest one million? 894000000 Round -0.560996 to two dps. -0.56 Round 0.0001809514 to five dps. 0.00018 Round -50413.2 to the nearest 100. -50400 Round 249.5718 to the nearest ten. 250 Round 0.1283317 to two dps. 0.13 Round 0.00648276 to 3 decimal places. 0.006 What is -0.0194377 rounded to two dps? -0.02 What is -20.368 rounded to the nearest one hundred? 0 What is 0.054893 rounded to 3 dps? 0.055 Round 24918.3 to the nearest one hundred. 24900 Round -0.000000805826 to 7 decimal places. -0.0000008 What is 0.0000347144 rounded to seven decimal places? 0.0000347 Round -9423.464 to the nearest 1000. -9000 Round 3710.655 to the nearest ten. 3710 What is 0.00010994349 rounded to five dps? 0.00011 Round -0.0000210755 to six decimal places. -0.000021 What is -0.83982354 rounded to one dp? -0.8 What is -432.9448 rounded to zero decimal places? -433 What is 5475456.4 rounded to the nearest one hundred thousand? 5500000 Round -0.015862802 to 4 decimal places. -0.0159 Round 0.0000282641 to 6 decimal places. 0.000028 Round 0.05562864 to four decimal places. 0.0556 What is 0.00003504037 rounded to 6 decimal places? 0.000035 What is -0.6285954 rounded to three decimal places? -0.629 What is 0.00001495451 rounded to 7 decimal places? 0.000015 What is -8.7533 rounded to the nearest 10? -10 Round 1921.8101 to the nearest 100. 1900 Round 0.01462756 to three dps. 0.015 Round 0.000012852637 to seven decimal places. 0.0000129 What is -1958260 rounded to the nearest one million? -2000000 What is -1226.314 rounded to the nearest 100? -1200 What is 6.26303 rounded to two decimal places? 6.26 What is 3.83733 rounded to two decimal places? 3.84 Round -1.2197 to zero decimal places. -1 What is -0.0005898432 rounded to 5 decimal places? -0.00059 What is 0.00116213 rounded to 5 dps? 0.00116 Round 0.0053709472 to 4 decimal places. 0.0054 Round -4.3029 to 0 dps. -4 Round -3692.16 to the nearest 10. -3690 What is -479.9651 rounded to the nearest ten? -480 Round -1703460 to the nearest 10000. -1700000 Round 103.552 to 0 dps. 104 What is -0.0291349 rounded to four dps? -0.0291 Round 0.008467809 to 5 dps. 0.00	{ "pile_set_name": "DM Mathematics" }
nd h. 11 Suppose 5p + a - 550 = 0, -2p - 2a - 2a + 220 = 0. Calculate the greatest common divisor of 33 and p. 11 Suppose -2s + r = -11, 0 = -s + 3r + 4 + 4. Suppose 3y = 29 + 31. What is the highest common divisor of s and y? 5 Suppose 13 = x + 2x - k, -5x + k + 19 = 0. Suppose 0 = -5w + 57 + x. What is the highest common factor of 84 and w? 12 Suppose -4j + 3 = -17. What is the highest common divisor of 20 and j? 5 Suppose -96 = -4a + 2w, 5a + 4w - 90 = -w. What is the greatest common divisor of a and 154? 22 Let a(x) = 3x - 3. Let f be a(2). Let y be ((-66)/f)/((-6)/39). What is the greatest common divisor of y and 13? 13 Let z = -92 + 235. Let k be (2/3)/((-10)/(-195)). What is the greatest common factor of z and k? 13 Let x = -30 - -36. Calculate the greatest common divisor of 6 and x. 6 Let w(q) = 3q2 - 9q + 2. Let f be w(4). Calculate the highest common divisor of 112 and f. 14 Suppose -3u + 550 = 46. What is the greatest common factor of 21 and u? 21 Suppose 0 = 2d - 4y - 26, 5d + 3y - 6y - 30 = 0. Let s(q) be the first derivative of q2 + 1. Let n be s(d). What is the highest common factor of n and 2? 2 Let p be (22/(-3))/(2/(-6)). Let u(j) = -j3 + 6j2 - 8j + 7. Let w be u(5). Let c be (0 + -6)/(w/44). What is the highest common factor of p and c? 11 Let x be (2/6)/(2/12). Let v(j) = -4j - 1. Let k be v(-4). Suppose xw = 3w - k. What is the highest common factor of w and 6? 3 Let x(u) = -u3 + 2u*2 + 3u + 3. Let z be x(3). Suppose -d + 55 = -2n, n = -2d + zn + 118. What is the highest common divisor of 42 and d? 21 Let d be (12/(-9))/((-2)/57). Let h(a) = -2a + 8. Let t be h(7). Let n be (-3)/9 - 344/t. What is the greatest common divisor of n and d? 19 Suppose 3 = 5k - 4u, 0u + u = 3. Suppose -ka + i + 71 = 0, 27 = -3a + 4a + 3i. Let c = -18 - -42. What is the highest common divisor of a and c? 24 Suppose 3b - 1203 = s, -6s - b = -s + 5983. Let n = 845 + s. Let g be 2/(-5) + n/(-5). Calculate the highest common divisor of 10 and g. 10 Let c(y) = -y3 + 2y*2 - 2y + 8. Let f be c(6). Let l = -106 - f. Let u = l - 30. Calculate the greatest common factor of 18 and u. 6 Let r = 6 - 5. Suppose -3t = -14 - r. Suppose 4n = 2l + 126, -n + 4n = tl + 105. Calculate the highest common factor of 10 and n. 10 Suppose -x = -5x + 16. Let z be (-36)/(-12) - (-2 + (-1 - -2)). Calculate the highest common divisor of z and x. 4 Let o be 36/(33/24). Calculate the highest common divisor of o and 12. 12 Let s = 142 + -40. Suppose 4h + 38 = s. What is the greatest common factor of h and 8? 8 Suppose 2601 = 5t + 701. Suppose 0 = -3b - 2b + t. Calculate the highest common divisor of b and 19. 19 Let a be (7/(-28)4)/(2/(-132)). What is the greatest common divisor of a and 6? 6 Suppose 3s = i - 111, -i - 5s + 167 = i. Calculate the highest common factor of i and 48. 48 Suppose -3u + q + 10 = 0, 4q = 2u - u + 15. Let c = -19 - -29. Calculate the highest common divisor of u and c. 5 Let h be ((-6)/5)/((-2)/20). Suppose 0 = -421u + 436u - 90. What is the highest common divisor of u and h? 6 Let a be (5/(-15))/(2/(-12)). Let f be a/(-3)(-15)/1. Calculate the greatest common factor of f and 90. 10 Suppose -3n + 20 = -4w, 5w = 30 - 10. Suppose 2z = -2z + n. Suppose c = 4, 0 = s - 2s - c + 10. What is the greatest common factor of z and s? 3 Suppose -2w + 42 = -2k + 122, -55 = -k - 2w. Let p be (-6 - (-15 + 2))(-60)/(-14). What is the greatest common divisor of k and p? 15 Suppose -3h - 7 = -19. Let v = -15 - -45. Suppose -3b + 3z + v = 5z, -2b + 4 = -4z. What is the greatest common factor of h and b? 4 Suppose -4u + 5k = -133, 5u - 3k - 155 = -8k. Calculate the greatest common divisor of u and 16. 16 Suppose 0 = -2k - 2k - 3b + 264, -k + 4b = -47. Suppose 3 = w - 10. Let p = w + -4. Calculate the greatest common divisor of p and k. 9 Let k(p) = 11p - 25. Let l be k(8). Calculate the highest common factor of 9 and l. 9 Let w = -41 - -59. What is the greatest common factor of 6 and w? 6 Let h(y) be the second derivative of y4/12 - y3/3 + 2y2 + 2y. Let o be h(4). Calculate the highest common factor of o and 60. 12 Suppose -5c + 0c + 180 = 0. Suppose c = 5x - 44. What is the highest common factor of x and 144? 16 Let j be (2 - 20)/((-32)/48). Let t be (2 - 1/(-4))4. What is the greatest common divisor of j and t? 9 Let k = 3 + -1. Suppose 0 = -kc - c + 2g + 122, -g + 44 = c. Let l = -237 - -243. Calculate the greatest common divisor of c and l. 6 Let y be -20 + 0 - (-1 - -2). Let o = 73 - 129. Let b = y - o. Calculate the highest common divisor of 14 and b. 7 Let u(r) = -3r3 + 3r*2 + 5r + 2. Let y be u(-2). Calculate the greatest common factor of 4 and y. 4 Suppose o - 23 = 67. Let f(a) = 9a + 1. Let p(h) = -2h - 1. Let k be p(-1). Let y be f(k). What is the greatest common factor of o and y? 10 Let a(p) = -7p - 44. Let v be a(-22). Calculate the greatest common divisor of v and 20. 10 Suppose -3a - 28 = -4t, 3t + 1 = 3a + 25. Suppose 0 = -tz - z + 740. Suppose 72 = 2q - z. Calculate the highest common factor of q and 10. 10 Let b be ((-36)/(-2))/((8/(-3))/(-4)). Calculate the highest common factor of b and 45. 9 Suppose 3k - 5d = 67, 0d - 4d + 11 = k. Let n = k + 3. What is the greatest common divisor of n and 2? 2 Suppose -101 = -2g - 0d - 3d, -153 = -3g - 3d. What is the highest common divisor of 468 and g? 52 Let s(n) = -n*3 + 1. Suppose 0m + 10 = -2m. Let o be (4/6)/(m/15). Let j be s(o). Calculate the greatest common factor of 72 and j. 9 Let h(q) = q + 7. Let c be h(-5). Let r be 28/(2/c2). What is the highest common divisor of r and 35? 7 Let h be 6(0 + 0 + (-24)/(-9)). Calculate the highest common factor of 144 and h. 16 Let x(d) = 5d3 + d2 - d + 1. Suppose 9 = 5r - 4k, 0 = 4r + 3k - 3 + 2. Let i be x(r). Calculate the highest common divisor of 30 and i. 6 Suppose 0 = -x + 5q + 31, 2 = -x - 5q - 7. Calculate the highest common divisor of 55 and x. 11 Let c be -1 - (-3 - (-3 - -14)). Calculate the highest common factor of 26 and c. 13 Suppose -10 + 115 = 5x. Suppose 4m + s - 934 = -s, -3m + 698 = s. Calculate the greatest common divisor of m and x. 21 Suppose 4b = 8b + 2v - 66, 4b = -v + 65. Calculate the highest common factor of b and 80. 16 Let l(r) = -18r - 3. Suppose 2k + 4n = 4, 2k + 2 + 6 = -n. Let y be l(k). Let d be (-15 - 0/1)-1. Calculate the highest common factor of d and y. 15 Suppose 5i = 3s + 3 + 92, 0 = 3i - s - 53. Let z = 23 + 17. What is the greatest common factor of i and z? 8 Suppose 120 = 4k - 5r, 30 = -3k + 4k + 2r. Let j be (45/6)/((-2)/(-12)). Calculate the greatest common divisor of k and j. 15 Suppose -55 = -4g - g. Suppose 0 = -14d + gd + 165. Suppose 1 = -4l + 21. Calculate the greatest common factor of d and l. 5 Suppose 0l + 5l = 25. Suppose 2q + 2 = 3m, lq - 4m - 5 = 4. Calculate the greatest common factor of 5 and q. 5 Suppose y + 2y - 72 = 0. Calculate the greatest common divisor of y and 3. 3 Let n(p) = 8p*2 - 2p. Let s be n(4). Suppose -2r = -2q + 25 + 35, -2r = -4q + s. Calculate the highest common factor of q and 10. 10 Suppose -2h + 14 = 4v, 3h = -10v + 5v + 17. Let w be v/(-3)(-29 - -2). Calculate the greatest common divisor of w and 54. 18 Let u = 3 - 1. Let h be u/(-5) + 44/10. Let w be (-8)/16 - (-46)/h. Calculate the greatest common factor of 33 and w. 11 Let z(f) = -6f3 + f. Let x be (1 + -2)/(2 - 1). Let i be z(x). What is the highest common divisor of i and 2? 1 Let h(t) = t3 + 5t*2 + 4t + 2. Let u be h(-3). Suppose d = -2d + 216. Calculate the highest common factor of u and d. 8 Let z be ((-9)/(-4))/(4/16). What is the greatest common divisor of z and 99? 9 Let n(a) = 36a*2 + a - 1. Let v be n(1). Let g be 5/((-10)/(-1)) + 46/4. What is the highest common factor of g and v? 12 Suppose -b - 134 = -3t + 3b, -2t - 5b + 74 = 0. What is the highest common divisor of t and 105? 21 Suppose -116 = -5h - 16. What is the highest common divisor of h and 70? 10 Let l(a) = a*3 + 5a*2 - a - 2. Let g be l(4). Let f be -168-52/8. Let r = f - g. What is the greatest common divisor of r and 9? 9 Let u(m) = -4m	{ "pile_set_name": "DM Mathematics" }
decimal place? -0.8 Let f = 56.0308 + -56. Round f to 2 dps. 0.03 Let d = -4342062 + 4342062.1862681. Let h = 1.1137323 + d. Let n = 1.3 - h. What is n rounded to 6 dps? 0 Let h = 1054 + -1053.99998679. Round h to 6 dps. 0.000013 Let t = -27.8 - 0.2. Let o = -28.56 - t. Let r = o + 0.55999977. What is r rounded to 7 dps? -0.0000002 Let j = -1473430.569 - -1473581.5690081. Let x = 148.95 - -2.05. Let h = x - j. Round h to six decimal places. -0.000008 Let l = -1018.428051 - -0.018051. Let u = l + 1019.729722. Let f = u + -1.32. Round f to 5 dps. -0.00028 Let s = -0.0525312 - -0.0527. Round s to five dps. 0.00017 Suppose m - 5o = -2m + 79, m = 5o + 13. Let v be (-1 - m)/(-1 - 1). What is v rounded to the nearest ten? 20 Let n = 63 + -155. Let m = -2132853.0079 + 2132945. Let o = m + n. What is o rounded to three decimal places? -0.008 Let o = 2869 - 2869.00001611. Round o to six dps. -0.000016 Let z = -3137.8649 - -3138. What is z rounded to three decimal places? 0.135 Let d = 600 - 533.9. Let m = 64.3975 - d. Let o = m + 1.7. Round o to 3 decimal places. -0.003 Let h = 6 + -2. Let q = -9 - -14. Suppose 9v = hv - q, -2a + 131 = -5v. Round a to the nearest ten. 60 Let c = 1414 + -1414.1575. What is c rounded to 1 decimal place? -0.2 Let x = -4.1 - -5.38. Let w = 0.08 - x. Let k = w + 1.203. What is k rounded to three decimal places? 0.003 Let z = 1.1300592 + -1.13. What is z rounded to five dps? 0.00006 Let t = 5415990 - 2785990. What is t rounded to the nearest 100000? 2600000 Let q = 1198.3065 + -1198. Let c = 0.1 - -0.2. Let k = c - q. Round k to three decimal places. -0.007 Let f = -2423.9996262 - -2424. What is f rounded to 4 decimal places? 0.0004 Suppose 2l - 4f = 1710206, 2l + 2l - 3420426 = f. Let g = l - 1609183. Let k = 324076 + g. Round k to the nearest one hundred thousand. -400000 Let z be (-13 + 1699 + 9)/((-3)/40). What is z rounded to the nearest 1000? -23000 Let p = -1419.0743 + 1419. Round p to 2 decimal places. -0.07 Let t = -5.32 - -4.637. What is t rounded to 1 dp? -0.7 Let u = 9289 + -9288.9991778. Round u to 5 decimal places. 0.00082 Let j = 383 - 382.999994. What is j rounded to six decimal places? 0.000006 Let p = 607973.400005 - 607976. Let n = p + 2.6. What is n rounded to 6 dps? 0.000005 Suppose -5j - 3c = 3336, -2j + 5c = 4c + 1341. Let a be (3 - j)(-600000)/14. Round a to the nearest 1000000. -29000000 Let m = -167.048 + 169. Let i = 0.46 + -2.36. Let x = i + m. What is x rounded to two decimal places? 0.05 Let o = -63.44 + -3.86. Let w = -67.30000938 - o. What is w rounded to 6 decimal places? -0.000009 Let r = 77 + 151. Suppose q - 2i - 124 = 0, 2q + 4i - r = 3i. Suppose -5m = -b - 565, -q = -2b + 2m - 1222. Round b to the nearest one hundred. -600 Let j = 20376544.65999938 - 20376545. Let l = j - -0.34. Round l to seven decimal places. -0.0000006 Let p = -0.96 - -0.95999094. Round p to 6 decimal places. -0.000009 Let b = 99 - 288. Let v = b + 188.9999265. Round v to five dps. -0.00007 Let j = -3.15 + 0.4. Let m = j - -2.749869. Round m to five decimal places. -0.00013 Let f = 30.0000002 - 30. Let y = 0 - f. Round y to seven decimal places. -0.0000002 Suppose 25f = 18f - 5502000. What is f rounded to the nearest 100000? -800000 Let d = 1088 + -1088.000010672. Round d to 6 decimal places. -0.000011 Let f = 51 - 31. Let r = -19.08 + f. Round r to one decimal place. 0.9 Let t = -0.23 + 1.13. Let s = t - 1.22. Let x = s - -0.08. Round x to 1 decimal place. -0.2 Let p = 1985 - 1984.9083. Let b = 0.093 - p. What is b rounded to four decimal places? 0.0013 Let v = 0.056 + -0.516. Let i = 9.96 + v. Let f = -6 + i. What is f rounded to the nearest integer? 4 Suppose 4a + 353559980 = -4r, -3r = -4a + 18723094 - 372283109. Round a to the nearest one million. -88000000 Let f(l) = -2l + 10. Let s = -1 - -1. Let g be f(s). Let n(y) = -20y*3 - 11y*2 + 9y + 10. Let p be n(g). Round p to the nearest 10000. -20000 Let z = -38.43 - -20.52. Round z to the nearest integer. -18 Suppose -4m = 721 + 22543. Let l = -80 - m. Suppose -3z = d - 18569 - l, 4z - d = 32395. Round z to the nearest 1000. 8000 Let u = -0.1675 + 0.2524. Round u to 2 decimal places. 0.08 Let y be 50156/4 + -2 + -4 + 0. Suppose 0 = -8p + y + 507. What is p rounded to the nearest 100? 1600 Let b = 186 + -187.328. Round b to 1 dp. -1.3 Let d = 62 + -54. Suppose 7u + 12400 = du. Round u to the nearest one thousand. 12000 Let y = -410.807 + 411. Round y to 2 decimal places. 0.19 Let z be 4/(-16) - 0 - (-143090)/8. Suppose 0 = 3x - 2214 - z. What is x rounded to the nearest 1000? 7000 Let p = 249120 + -156220. What is p rounded to the nearest one thousand? 93000 Let i(p) be the first derivative of -2959p3/3 + p2 - 23p - 23. Let y be i(7). Round y to the nearest ten thousand. -150000 Let w = -0.1753 - 0.8497. Round w to two dps. -1.03 Let k = 31 + -31.00864. Let a = -0.008 - k. Round a to four decimal places. 0.0006 Let m = -842.75 - -854. Round m to 0 decimal places. 11 Let p = 349.53 + -345. Let t = 58.73 - p. What is t rounded to the nearest ten? 50 Let w be (388-10)/((-2 + 0)/(-5000)). Round w to the nearest one million. -10000000 Let h = -53 + 53.0588. Round h to two dps. 0.06 Let k(j) = -3j3 + 15j*2 - 17j + 3. Let t be k(17). Let x = -19490 - t. Round x to the nearest one thousand. -9000 Let w = -28.3 + 27. Let s = 0.0021714 + 1.2975666. Let q = w + s. What is q rounded to 5 dps? -0.00026 Let s = 0.4 + -0.40299. What is s rounded to three dps? -0.003 Let t(a) = 518547a + 4. Let g be t(3). Suppose -3u - 115645 + g = 0. Round u to the nearest one hundred thousand. 500000 Let h = -0.762766 - -316.736466. Let p = 0.0263 + h. Let q = p - 313.87. Round q to 1 decimal place. 2.1 Let t(v) = 19 - 124v - 7 + 6. Let g be t(7). Round g to the nearest 100. -900 Let z = 388 - 226. Suppose -5j - 252 = 198. Let b = z + j. Round b to the nearest 10. 70 Suppose -18d - 41278 = 43502. Round d to the nearest one thousand. -5000 Let h be (240/(-7))/(4(-4)/164640). Round h to the nearest one hundred thousand. 400000 Let x = -14.04 - -14.944. What is x rounded to one dp? 0.9 Let g be (-6)/(-27) + ((-498965356)/18)/(-2). Let z = g - 60149. Round z to the nearest one million. 14000000 Let x = -83 - -150. Let t = x + -66.9999946. What is t rounded to six decimal places? 0.000005 Let j = 294 - 293.9999996043. Round j to 7 dps. 0.0000004 Let k(m) be the first derivative of -5280m2 - 40m + 7. Let n(y) = -y + 1. Let u(d) = 2k(d) + 80n(d). Let l be u(5). Round l to the nearest ten thousand. -110000 Let n = -404.3 + 446. Let a = -40 + n. Let r = a - -6.6. Round r to the nearest integer. 8 Let v = 748.9999593 + -749. What is v rounded to 6 dps? -0.000041 Let l = 23.9 - 23.2. Let r = 148085.57 + -148086.26999932. Let u = l + r. Round u to seven dps. 0.0000007 Let v be 684/(-45) - 2/(-10). Let c(a) = a*3 + 13a*2 - 16a + 12. Let q be c(v). Round q to the nearest 100. -200 Let i = -125501.54546 + 122466.015. Let u = i + 3014.5304551. Let z = u - -21. What is z rounded to six dps? -0.000005 Suppose 8 = -9k + 98. Suppose -kj = -5*j - 5500000. What is j rounded to the nearest one million? 1000000 Let k = 589326 + -589422.0038. Let u = 96 + k. What is u rounded to 4 dps? -0.0038 Let r be (46/(-5))/(22/(-385)). Let t = 340 - r. What is t rounded to the nearest 10? 180 Let c = 19 - 7. Let f = c - -4. Let m = 16.07 - f. Round m to one dp. 0.1 Let a = 29833.459874 + -29842.66. Let n = 6.2 + 3. Let b = a + n. Round b to five decimal places. -0.00013 Let g = -8744967.72699926 - -8744849.727. Let l = g - -118. What is l rounded to seven dps? 0.0000007 Let u = 73 - 36. Let k = -95 + u. Let o = k + 58.73. Round o to one decimal place. 0.7 Let v = -20 - -35.4. Let r = 16.149065464 - 0.749064774. Let j = r - v. Round j to seven decimal places. 0.0000007 Let g = -10674270799 + 10674270227.0000703. Let j = -572 - g. What is j rounded to five dps? -0.00007 Let l = 0.1 + -20.1. Let x = -16.196 + 36.094. Let n = x + l. Round n to 2 decimal places. -0.1 Let v = 4.2391 - -0.0409. Round v to 1 decimal place. 4.3 Let r = -12938115.05600037 + 12938115. Let d = 0.09 - 0.034. Let o = d + r. Round o to seven dps. -0.0000004 Let h = 0.29 - 2.89. Let k = -	{ "pile_set_name": "DM Mathematics" }
the common denominator of (-9)/(-162)369/6 and 125/12. 12 What is the common denominator of (-435)/2412/10 and 25/4? 4 Let d be (9/(-6))/(3/(-6)). Suppose 2x + 12 = b, -3b + dx + 10 + 11 = 0. Let v = -1 + 11. Calculate the smallest common multiple of v and b. 10 Let k = -219809 + 889273/4. Suppose 0 = -w - 8w - 22410. Let b = w + k. What is the common denominator of 21/4 and b? 4 Let f = -11 + 15. Suppose -5r - 2g = -0g - 18, -4r = -3g + f. What is the least common multiple of 16 and r? 16 Find the common denominator of (-2)/(-3)3729/(-220) and 41/16. 80 Let u(y) = y*3 - 12y*2 + 10. Let d be 24(2/4)/1. Calculate the least common multiple of 2 and u(d). 10 Let s = -278 - -711. Suppose -3g = 4p + 16, 0 = 3g - p - 3p + 32. Find the common denominator of g/(-28) - s/21 and 16/11. 33 Let i be 3/(1/281-115). Let n = i + 3/23. Find the common denominator of -11/4 and n. 20 Suppose m - 4o - 30 = -0o, -m + 26 = -3o. What is the least common multiple of (-2)/(-6) + (-174)/(-18) and m? 70 Let i = 23 - -49. Calculate the least common multiple of 11 and i. 792 Let s = -9455 - -94629/10. Let f = -2894 + 109989/38. Let q = 43/95 + f. What is the common denominator of s and q? 10 Suppose -c = 2q + 3q + 8, 0 = 5c - 3q - 16. Suppose co = 9 + 25. Suppose 0 = -2v - o + 49. Calculate the lowest common multiple of 12 and v. 48 Suppose 4m + 4 = -4q, 5m = -2q - 1 + 11. What is the lowest common multiple of m and 10? 20 Let f = 4 + 57. Calculate the common denominator of (f/(-5))/(10 + -12) and -83/16. 80 Let h be 111/31. Let u = 50382167/186 + -1083455/4. Let g = h - u. Calculate the common denominator of 57/16 and g. 48 Calculate the lowest common multiple of (6/9)/(1/15) and -1 + -2 + 4 - (-63)/21. 20 Let z(m) = m*2 + 3m. Let d be (-2 + 1)/((-1)/11). Let w = d + -1. What is the lowest common multiple of w and z(-6)? 90 Let i = 474 + -118. What is the common denominator of 61/14 and (3/16)/(12/i)? 112 Let m(n) = -n - 3. Let v be m(-6). Suppose -30 + 0 = -vy. What is the least common multiple of y and (-83)/3-1? 40 Let j = -1 + 4. Let p be ((-10)/3)/(j/(-9)). Suppose -2a + 3a = p. What is the lowest common multiple of 8 and a? 40 Suppose 2s + 0s + 4c - 8 = 0, -4c + 6 = s. What is the lowest common multiple of 18 and s? 18 Let h = -449 - -1747/4. Let k be (-47 - 1)/((-21)/(-4312)). Let v = k - -98671/10. Find the common denominator of h and v. 20 What is the common denominator of (3/(-60))/((-9)/1278) and -51/2? 10 What is the least common multiple of 6 and (-20)/(-6)(-45)/(-25)? 6 Let n(y) = y*2 - 6y + 4. Let x be n(6). Suppose -2 = -h + 1. Suppose -xg - 4a + 60 = a, -68 = -4g - ha. Calculate the lowest common multiple of 20 and g. 20 Let g = -21163/8 - -2634. Calculate the common denominator of g and -139/18. 72 Let n(f) = 2f - 7f*2 + 2f + 0 + 6 + f3. Let s be n(6). Let z(j) = j2 + 6j + 7. What is the lowest common multiple of 4 and z(s)? 28 Let g be -17 - (1 + -1 + -2). Find the common denominator of 11/10 and -1 + (-153)/g + -2. 10 Let b = 8251/4 - 2053. Find the common denominator of b and -3 - (-10)/6119/14. 12 Let b be (-9)/(-6)2/3. Let s = 3 - b. What is the smallest common multiple of 4 and (s + -5)/((-3)/8)? 8 Suppose -2u + 14 = -0u - r, -u + r = -6. Let a = -5 - -10. What is the smallest common multiple of a and u? 40 Calculate the common denominator of 12/(-153)(-267)/(-72) and 95/14. 2142 What is the common denominator of -51/4 and 0 + (-3 - 93/(-6))? 4 Let z = -46015/6 + 7686. Find the common denominator of 143/12 and z. 12 Suppose 3c + b = 38, 0 = c - 2c - 2b + 6. What is the lowest common multiple of (-23)/(-2) + (-2)/(-4) and c? 84 Let m be (-2)/(-3) - 14/3. What is the least common multiple of (m/6)/(7/(-42)) and 8? 8 Suppose -6 = 15j - 17j. What is the lowest common multiple of 1 and j? 3 Let v = -8 - -13. Suppose 5f - f + 5n = 6592, -vf - 3n + 8253 = 0. Let m = -23221/14 + f. Calculate the common denominator of 73/18 and m. 126 Let x = -2099/48 - -497/12. Calculate the common denominator of x and (-12)/(-24) + (-37)/(-8). 16 Let c be -2 - (-3)/((-324)/33069). Let d = c + 1203/4. Calculate the common denominator of d and 11/3. 9 Let y be 6469/(-15) - (-3)/(-9). Let r = -433 - y. Calculate the common denominator of 1/4 + (-642)/168 and r. 35 Suppose 0 = -h - 4r + 28, -4h - r + 42 = r. What is the least common multiple of h and (-2)/1(1 + -2)? 8 What is the common denominator of -93/4 and (-1959)/297 + (-4)/22? 36 Let i(x) = -4x3 - 3x*2 + 2. Let r(j) = 3j*3 + 20j*2 + 10j + 10. Calculate the smallest common multiple of r(-6) and i(-2). 22 Let d = -35 - -59. Calculate the smallest common multiple of d/(-9)-13 and (-6)/(-4)56/12. 56 Let y = 54 - 114. Find the common denominator of -65/6 and 2 + -2(-327)/y. 30 Suppose 0 = -13t + 87 - 9. Let k = 58 - 38. Calculate the smallest common multiple of t and k. 60 Suppose 3d - 28 = 20. Let r be 0/(-2 + 2 - 2). Suppose -5a = -ra - 100. What is the least common multiple of d and a? 80 Let p = 31 + -9. What is the least common multiple of p and 6? 66 Suppose -4x - 2c + 116 = -26, -2x = 2c - 76. Let l be 6/x + (-42022)/132. Let d = l - -587/2. What is the common denominator of 31/4 and d? 12 Let q(p) = 314p. Let f be q(1). Find the common denominator of 23/16 and -4 + 2 - f/(-12). 48 Let l = 9 - -8. Suppose 4v - 3 - l = 3z, 3v - z - 10 = 0. What is the smallest common multiple of 8 and v(2-1 - -7)? 40 Let s be 1-1(-23 - -3). Let w = -9 + s. What is the least common multiple of (6/4)/(33/176) and w? 88 Let s(m) = m + 62. Suppose 3k = -2k. Let j be s(k). Suppose 3d = -4q + d + j, 2d = 4q - 50. What is the least common multiple of q and 12? 84 Suppose 4u + 1 = 5u. Let t = -211741/12 + 17633. Find the common denominator of t and u/(63/(-123)). 12 Suppose 32 = -5s - p + 4p, -4p + 16 = 0. Find the common denominator of ((-1)/(-4))/(22/84) and (-2)/s174/8. 88 What is the common denominator of ((-2)/10)/((-56)/3570) and 71/18? 36 Suppose 5h + 36106 + 35909 = 0. Let y = h + 201737/14. Calculate the common denominator of y and 97/10. 70 Calculate the least common multiple of 8 and (1/(-1) - 1) + 8. 24 Let v be ((-6)/(-4))/((-3)/28). Suppose 0 = 5t - 6 - 19. What is the lowest common multiple of (-4)/v - t/(-7) and 4? 4 Let o(n) = n2 - 3n + 4. Let s be o(4). Let z = 8081/5 - 1606. What is the common denominator of z and (-87)/s + 3/6? 40 Suppose -5h + 6 = -3h. Suppose -hr - 52 = -5k, r = -3k + 8 + 12. Calculate the smallest common multiple of 8 and k. 8 Let b be (-2)/1(11 + -6). Let g(s) = -2s3 - 2s2 - s + 2. What is the lowest common multiple of g(-2) and (-10)/(-4) - b/(-20)? 12 Let z = -6475936/145 - -44662. Let p = 24/29 + z. What is the common denominator of -143/6 and p? 30 Let m(p) = -p3 + 7p2 - 4p + 8. Suppose 5a + 3 - 63 = 0. Let d = a - 6. Calculate the lowest common multiple of d and m(6). 60 Let x be ((-2)/4)/((-2)/24). Suppose n = -2n + x. Suppose -5v + 37 = n. Calculate the lowest common multiple of 8 and v. 56 Let d = -118968 - -698329/6. Let u = -2573 - d. Let n = -151/24 + 277/168. What is the common denominator of u and n? 42 Let t = -150102 - -1052612/7. Let j = -584 - -315. Let s = t + j. What is the common denominator of 31/7 and s? 7 Let a = 37 - 15. Calculate the lowest common multiple of 10 and a. 110 Let s be (24/(-60))/(1/5). What is the common denominator of 85/16 and 2 - ((-87)/s + 4)? 16 Calculate the common denominator of 67/15 and (-7)/(-3)(-64)/80. 15 Let a = 1899/14 + -806/7. Let k = -622 - -21125/34. Calculate the common denominator of a and k. 34 Let r(h) = -6h - 56. Let b(g) = g2 + g - 2. What is the least common multiple of b(2) and r(-13)? 44 What is the common denominator of 55/42 and -4 - (5 + 515/(-70))? 42 Suppose 44 = -4n + 3n. Find the common denominator of 2 + -2 + 106/n and (-134)/(-28) + 3 + -2. 154 Let b(s) = -s3 - 2s + 10. Calculate the lowest common multiple of b(0) and 6. 30 Let o = 73 + -49. Calculate the lowest common multiple of o and 27. 216 What is the common denominator of -211(3 + 264/(-87)) and -42? 29 Suppose -5i = -0 - 5. Suppose 3f = -4b + 17, 0b - 4f = 3b - 18. Suppose 2r - 6a + 6 = -a, -2*r + 3	{ "pile_set_name": "DM Mathematics" }
= j + -18. Suppose -l = -1 + 4. Sort l, o, 9 in ascending order. l, o, 9 Suppose 28 = 2p - 9p. Let h be (p + (-80)/(-15))(1 + 2). Let x be 0 - (-1 - 0)-2. Put 1, -3, h, x in ascending order. -3, x, 1, h Let k = -518 - -519. Sort k, 4, -5, 2 in increasing order. -5, k, 2, 4 Let c = 3489.94 - 3490. Put -0.44, -4, c, -5 in ascending order. -5, -4, -0.44, c Let p = -2338 + 2336. Let d be 7 + -1 + 6 + -3. Sort -0.3, p, d, -0.5 in decreasing order. d, -0.3, -0.5, p Let s be (-13)/(-52) + (-10756)/16. Let u = -667 - s. Put -5, -13, u, 4 in decreasing order. u, 4, -5, -13 Let v be 46215/14931 + -2 + (-40)/(-21). Put -9, 0, -2, v, -4 in descending order. v, 0, -2, -4, -9 Let w = 16.81 + -17.43. Let u = 148 - 143. Sort 0, 4, w, u in increasing order. w, 0, 4, u Let m(f) = -201f2 + 807f - 17. Let j be m(4). Sort 4, -44, j, -3 in ascending order. -44, j, -3, 4 Let c = -63.06 - -63. Let w = -360.1 - -360. Sort c, 6, w. w, c, 6 Suppose -26 + 38 = -2u - 4r, 43 = -3u - r. Let v = -27 + 15. Let l be (3 + v/9)-3. Sort -4, l, -2, u in increasing order. u, l, -4, -2 Let j = -230336307450381 + 757576102192258995/3289. Let n = j - -3956231. Let z = n - -3/143. Sort z, -0.9, -0.2 in decreasing order. z, -0.2, -0.9 Let f be (169/(-26))/((-2)/(-4)). Put f, 0.04, 3, 0 in descending order. 3, 0.04, 0, f Let x be 7 + -7 + (36 - 2). Suppose xv - 36v - 14 = 0. Let l(a) = a - 3. Let m be l(0). Sort m, 1, v in descending order. 1, m, v Let y = 19 - 22. Let w be (184/276)/(1/84-1). Put -1, y, w in decreasing order. -1, y, w Suppose 0 = -2v + 3v + 2v - 9. Sort v, -2, 5, 4, 8 in decreasing order. 8, 5, 4, v, -2 Suppose 40w - 33w - 35 = 0. Let p be (-1)/5 + 33/715. Sort 0, w, p in increasing order. p, 0, w Let m = -1 + 1.2. Let v = 172517 - 172519. Sort v, 0.39, m in increasing order. v, m, 0.39 Suppose 0 = 116b - 154b - 304. Put 13, b, 2 in ascending order. b, 2, 13 Let k(z) be the second derivative of -z4/12 + z3/6 + 19z2/2 + z. Suppose -110d - 28d - 315 = -1005. Let v be k(d). Put 2, 5, 1, v in ascending order. v, 1, 2, 5 Let s = 208 + -206.93. Let f = 1.87 - s. Sort -3/2, f, 3 in ascending order. -3/2, f, 3 Let a be 44/132 + -3 + 1 + 2. Suppose -40 = -29o + 37o. Sort o, 27, a, 0.2. o, 0.2, a, 27 Let v(z) = 78z + 5. Let l be v(-1). Let f = l + 70. Let g = -51 + 55. Sort -2, g, f. f, -2, g Let s(g) = -8g + 125. Let j be s(0). Sort j, -1, 3 in ascending order. -1, 3, j Let w be (-2)/530/(-42). Let r(i) = -1. Let f(u) = 6u - 98. Let a(t) = f(t) - 5r(t). Let d be a(17). Sort d, 0.2, w in descending order. d, w, 0.2 Suppose 3o = o - 8. Let r(f) = 2f*2 - 56f + 59. Let w be r(29). Let a be (-12)/w6/o. Sort -2/3, -2, a. -2, -2/3, a Let p(o) be the third derivative of o5/30 + 5o4/8 + o3 - 21o2. Let c be p(-6). Put c, -0.2, 0.2, -2 in increasing order. c, -2, -0.2, 0.2 Let j(s) = -s2 + 6s - 1. Let y be j(6). Let w(k) = k*2 + 7k + 2. Let a be w(-6). Let g be (-56)/(-26) + a/2. Sort y, -2/7, g, 0 in increasing order. y, -2/7, 0, g Let c be 3/(-1) - (-18)/5. Let o = -44 - -44.5. Let h be (-1)/(1 + (-14)/(-4)). Put h, c, o, -3/2 in descending order. c, o, h, -3/2 Suppose 124c + 58 = 125c. Let t be c/203 - ((-37)/(-7) + -1). Put 6, 3, t in descending order. 6, 3, t Let g be (-20)/8(6 + (-160)/25). Sort g, 5, 318 in decreasing order. 318, 5, g Let l = -34826 - -34827. Let a = 4 - 2. Sort -13, -3, l, a in descending order. a, l, -3, -13 Let c(q) = -20q + 36 + q*3 + 582q*2 - 1167q*2 + 568q*2. Let u be c(18). Put 5, -28, u in descending order. 5, u, -28 Let l be (2652/(-1547))/(6/(-14)). Suppose 5x + 2 = -13. Sort x, l, 19. x, l, 19 Let c = 4682 + -4682.1. Let p = 10 + -5. Sort -5, p, c in ascending order. -5, c, p Let q = -3.5 + 3.5. Let w = -9 + 14. Suppose wr + 2 = 7. Put q, r, -2/5 in ascending order. -2/5, q, r Let n = -626 + 346. Let p = n - -275. Put p, -0.5, -3, 0.2 in decreasing order. 0.2, -0.5, -3, p Suppose 6g - 12g = -2g. Suppose 7d + 86 - 100 = g. Put d, -23, 1 in decreasing order. d, 1, -23 Let y be ((0 - -1)/(10/2 - 2))/(22223/200007). Let l = 5.86 - -0.14. Sort y, l, 3/5 in ascending order. 3/5, y, l Let f = 2753 + -1203. Suppose -fv = -1557v - 35. Let h be 12/(-2)2/4. Sort h, 5, v. v, h, 5 Let c = -1074 + 1069. Sort -2/3, 176, c in ascending order. c, -2/3, 176 Suppose -5f - 2 = 3. Suppose 44 = 1165z - 1176z. Sort f, 5, 0, z in decreasing order. 5, 0, f, z Let h be 865/100 - 8 - 4/10. Let q = -35 + 31. Sort q, h, 1/8, 1 in ascending order. q, 1/8, h, 1 Let s(t) = -t3 + 18t*2 + 17t + 41. Let m be s(19). Suppose 3x - 9 = -3p, -1 = -x - mp + 4. Sort -4, x, -19 in ascending order. -19, -4, x Suppose -288v - 63 - 269 = 244. Sort -5, 36, v, -6 in descending order. 36, v, -5, -6 Let n = 336 - 339. Suppose -2i = -2a - 0a + 8, 0 = 5i + 5a - 30. Let s = i + -3. Sort s, n, -5 in decreasing order. s, n, -5 Let r = -226 - -228. Let c be ((-36)/162 - r/(-9))/(-4). Sort 3, -3, c in descending order. 3, c, -3 Let l = -169.083 - -169. Let w = -0.417 + l. Sort w, -0.06, 3/7 in ascending order. w, -0.06, 3/7 Let k = 25 + -126/5. Let n = -499 + 503.73. Let q = n + -1.73. Sort q, 0, k, 4. k, 0, q, 4 Let q = -2423 - -2396. Put 14, 0, q, 1 in increasing order. q, 0, 1, 14 Let h = 0.4366 + -0.4736. Let k be -21 - 24/(-10). Sort k, 2, -5, h in ascending order. -5, h, k, 2 Let o be (1 - 10)2/2. Let d = o - -4. Let r be (-1 - -3)/2 + 42/(-14). Put d, r, -10 in increasing order. -10, d, r Let d(v) = -v - 9. Let y be d(7). Let n(j) = j2 - 7j + 2. Let s be n(5). Let p = s - -7. Sort -3, p, y. y, -3, p Let v = 6151 - 6148. Put 4, -0.5, v, -74, -0.07 in decreasing order. 4, v, -0.07, -0.5, -74 Suppose 0 = 11v - 15v - 5n - 7, n = 3v - 9. Put 8, v, 140 in decreasing order. 140, 8, v Let l = -13 - -13. Let b be (-5)/20 + (-27)/(-12). Suppose 3f + 5a = -25, ba = -3f - 2a - 26. Put f, l, 3 in descending order. 3, l, f Let o = -54 - 0. Let j be (-4)/o3 - 190/45. Suppose 3n - 3 = 3p + 21, -5p = 3n. Put j, 4, p in decreasing order. 4, p, j Let c = 1588 - 1599. Put c, -1, 2, 8 in descending order. 8, 2, -1, c Let c = -295107/197 - -1498. Let j = c + -389/985. Let r = -2.89 + 2.79. Sort 1, 5, r, j in ascending order. j, r, 1, 5 Let n be 15/20(-32)/(-56). Put -1/2, n, -11, 1, 0.1 in descending order. 1, n, 0.1, -1/2, -11 Suppose 59 = -2u - 3g, -69g + 31 = -u - 72g. Suppose -68 = 5n + 52. Let q = n - u. Put -11, 5, q in ascending order. -11, q, 5 Suppose -4m - 2x = 30, -x - 10 = -3m + 4x. Suppose 13c - 14c = -5. Let z(k) = k*3 - 4k*2 - 3k - 6. Let w be z(c). Sort w, m, 0 in decreasing order. w, 0, m Let x(p) = -477p + 1009. Let c be x(2). Sort -2/13, c, 0.5, -0.1 in decreasing order. c, 0.5, -0.1, -2/13 Let t(a) = -a3 + 12a*2 + a - 4. Let q be -1 + (-2 - -19) + -4. Let k be t(q). Suppose -k = -3r + 1. Sort 4, -2, r in ascending order. -2, r, 4 Let d = 3873 - 3880. Sort -1/5, d, -0.4, 0.0159 in increasing order. d, -0.4, -1/5, 0.0159 Let b be (1 - 2) + 2 + 2. Let d be 1/(-3) - -14(-1)/b. Put 2, d, 6, -4 in decreasing order. 6, 2, -4, d Let p be (83/96)/(4 - 5). Put p, -4/3, -3 in descending order. p, -4/3, -3 Let p = 6198 + -6201. Sort 1, 3, 19, 2, p. p, 1, 2, 3, 19 Let s = 2941/55 - 597/11. Put s, 1/2, 5/4, 27 in descending order. 27, 5/4, 1/2, s Let h = -1 - -10. Let c = -241 - -240.8. Put c, -0.3, h in decreasing order. h, c, -0.3 Let k(x) = -2x - 11. Let u be k(-6). Let i be (-2 - -3)/(0 + 3/(-471)). Let p = -159 - i. Sort 3, -1, p, u in descending order. 3, u, -1, p Suppose -5k - 7m - 29 = 51, 0 = -m - 10. Let y = -22 - -16. Let c = -4 - -3. Put k, y, -4, c in descending order. c, k, -4, y Let g(f) = -2f*3 - 18f*2 - 66f - 378. Let j be g(-8). Sort j, -9, -7. -9, -7, j Let c be (45/(-10))/((-1)/20). Let f be 12/c(0 + -3). Let q be (-1820)/5355 + (-4)/(-34). Put q, -0.5, 1/2, f in descending order. 1/2, q, f, -0.5 Let i = -8 + 3. Let r be 1/((-9)/6)(-30)/4. Suppose -5n + 2y = -22, -5 = -4n - 4y + 7. Sort n, 2, i, r in ascending order. i, 2, n, r Let x = -158 + 85. Let c = x + 74. Sort 3/4, 0.05, 4, c. 0.05, 3/4, c, 4 Let t(c) = -c*2 - 12c - 32. Let v be t(-3). Let q = -496 - -476. Put v, -2, 4, q in ascending order. q, v, -2, 4 Let i = -2 + 3. Suppose -z - 7924	{ "pile_set_name": "DM Mathematics" }
Let h = 486 - 485. Solve 7a = 8 - h for a. 1 Let o = 41 + -38. Suppose -oz = 3g - 12, 0 = -2z + 3 - 1. Suppose 4q = -f + 8, -4f = q + f - 21. Solve -2t - g = q for t. -2 Suppose 1 = -4t - 0c + c, -5t - 2c = -2. Let b = -103 + 103. Suppose -7r = -3r - br. Solve tg - 2g = r for g. 0 Suppose -3z = 3x - 111, 4x = -z + 50 - 13. Solve 0 = 5v - z + 37 for v. 0 Suppose 0 = 4a - 6a + 8. Let h be (a/(-3))/((-20)/30). Solve s = hs + 5 for s. -5 Suppose 5w - k + 0k - 72 = 0, -5w - 2k + 66 = 0. Suppose 3u + 4z = 10, u + 2z + 20 = 2u. Let h = w - u. Solve s - 2s = h for s. -4 Let q(n) = n*3 - 14n*2 + 13n + 2. Let h be q(13). Solve 1 + 5 = -hj for j. -3 Let c be 2 - ((-4 - -4) + 4) - -19. Suppose 3n - c = -3u + 10, u = -3n + 17. Solve -nw = w for w. 0 Let s(x) = x - 5. Let b = 6 + -6. Let i be s(b). Let h(g) = -g3 - 5g*2 - g - 5. Let v be h(i). Solve -f - f + 4 = v for f. 2 Suppose 3b - 13 = -p + 5b, -4b - 65 = -5p. Solve 0 = -pm + 14m for m. 0 Suppose -4q = -3q - 4z + 12, 4q = -3z + 9. Suppose 7k + 0k - 70 = q. Solve -k = -3r + r for r. 5 Let m be 2/(-2) - (-54)/(-18). Let k = m + -13. Let w = -13 - k. Solve -6 = -wo - 2 for o. 1 Suppose 0 = -2m - 3k - 11, 3m - 4k - 11 = 15. Let d be (9 - 6) + 2/1. Solve dr - m = 3 for r. 1 Suppose -5s + 2d - d + 38 = 0, 0 = -s + d + 10. Suppose -3v - 116 = -sv. Suppose v - 32 = -q. Solve -7o + qo = 8 for o. -2 Suppose -5d = -g - 16 - 17, 5d = -5g - 15. Let y be 1 - (g/2)/(-4). Suppose 2f + 2t - 53 = -3t, -f + t = -23. Solve y = -3v - f + 9 for v. -5 Suppose 0 = 7c - 3 - 39. Suppose -11v = -14v + c. Solve w - 1 = v for w. 3 Let n(s) = -16s*3 + 5s*2 - 4s. Let u be n(1). Let x = -15 - -40. Let d = x + u. Solve -d = -3h + 2 for h. 4 Let z(c) = c3 - 10c*2 + 16c + 1. Let l be z(8). Let v be (-9 - -12) + 1/l. Let h(t) = 5t. Let r be h(3). Solve j = vj + r for j. -5 Let j(a) = a*3 + 10a*2 - a - 9. Let w be j(-10). Suppose -9 = -h - w. Solve u - 5u = -h for u. 2 Let y = 5 - 2. Suppose 3b = 4c + 7b + 4, yb = -15. Solve c = 2t + 2t for t. 1 Let c be 1-5(-12)/20. Let s(t) = -9t + 17. Let f(p) = -10p + 18. Let h(k) = 5f(k) - 6s(k). Let d be h(8). Solve cr + d = -2r for r. -4 Let s = -49 - -50. Let i be (-4)/(-12) + (4 - s). Solve 4f - if = 5 for f. -5 Let d(a) = a2 - 93a + 270. Let b be d(3). Solve b = 7p - 16p + 27 for p. 3 Let l(h) = h*3 - 2h + 1. Let j be l(1). Solve -3z + jz = -12 for z. 4 Let l(z) = -z*3 - 3z*2 + 3z - 3. Let p be (13/2)/(2/(-4)). Let y = 9 + p. Let a be l(y). Solve -r - 3 - a = 0 for r. -4 Let v be (-5 - (-249)/51) + (-336)/34. Let w be v/(2((-1)/5 + 0)). Solve -4a = a + w for a. -5 Let v = -1121 + 1121. Solve v = -6y - 0 + 12 for y. 2 Let j(w) be the second derivative of w4/12 + 5w*3/3 + 9w*2/2 + 9w. Let g be j(-9). Solve g = 5i - 8 - 17 for i. 5 Let m(h) be the first derivative of -h3/3 + 2h*2 + h + 12. Let f be m(3). Solve -12 = fn - 0n for n. -3 Let x(a) = -a2 + 4a + 1. Let i be x(4). Suppose 2m - h + 8 = 0, -2h + h = -3m - 11. Let y be (5 + -2)(-2)/m. Solve yd + i = 3 for d. 1 Let s(b) = 17 + 3b + 11b - b2 - 2b*2 - 10. Let x be s(5). Solve xq + 10 - 4 = 0 for q. -3 Let s(n) = 22n + 128. Let z be s(-5). Solve -zy + 0y - 54 = 0 for y. -3 Let g(r) = r2 - 2r - 5. Let d be g(-2). Suppose -du + 62 = 14. Solve -a = 3a - u for a. 4 Let w(z) = -23z + 395. Let v be w(17). Solve 9o = 4 - v for o. 0 Let q(n) = -18n - 216. Let h be q(-12). Solve 11w = -11 - h for w. -1 Suppose 0 = -2z + 2m - 4m + 2, 0 = -5z - 2m + 20. Solve -zc + 3c = 9 for c. -3 Let v = 4 - 0. Suppose -5 - 29 = -4b - n, 0 = 3b + 5n - 34. Solve 12 = -vc + bc for c. 3 Suppose 3a - 18 = a. Suppose -5f - m + 4 = 0, 97m - 12 = -5f + 94m. Solve 2x + a - 1 = f for x. -4 Suppose 5l + 2t + t - 16 = 0, 2t - 19 = -5l. Solve -ld - 10 = -3d for d. -5 Let q = -204 - -146. Let b = -35 - q. Let i = 30 - b. Solve -3j = -ij + 16 for j. 4 Suppose 25x - 176 = 9x. Solve -5 = xn - 12n for n. 5 Let h(b) = b*2 - 14b + 13. Let c(g) = -g*3 - 4g*2 - 6. Let q be c(-5). Suppose 5a = -q + 84. Let y be h(a). Solve 4o - o - 15 = y for o. 5 Let f = -43 + 69. Suppose t + 28 = 5h, -6h + h = -2t - f. Let q be h/12 - 39/(-2). Solve 0 = 3x + x + q for x. -5 Let z(f) = -4f + 2 + f + 26f2 - 25f*2. Let v be z(2). Suppose -c = -vc - 2, -2c = -g - 2. Solve -gm = -3m + 3 for m. 3 Suppose -5a = -15, y = 2a - 2 - 2. Suppose 2h - 5k = -8, -yk + 4 + 5 = 5h. Let g = 1 - -1. Solve n - h + g = 0 for n. -1 Let o be (-2 + 1)(-2 + 2). Suppose o = -3p + 5 + 10. Let z = p + -3. Solve z = l - 2 for l. 4 Let b(y) = -3y - 2. Suppose -1 = -2u - 13. Let s be b(u). Suppose 4f = 30 - 18. Solve -r - fr = -s for r. 4 Suppose -3n + 26 = 2p, -4p + 20 = -p - 5n. Solve -p = -q + 3q for q. -5 Let a be (-136)/(-1156) - 49/(-17). Let p(b) = b*2 + 4b - 7. Let s be p(-6). Solve 2n = -an - s for n. -1 Let b = 211 + -208. Solve by = -5y + 32 for y. 4 Let a(s) = s*3 + 4s*2 + s + 7. Let j be a(-4). Suppose -5z - 11 = -4k, -k + 5z = -jk + 13. Solve kh - 4 = 12 for h. 4 Suppose -4 = -4p + 4. Let w = 35 + -26. Let r be (0 - 3/w)/(8/(-24)). Solve -r = pa + 7 for a. -4 Suppose 5p - 36 = 49. Let s = -17 + p. Solve s = -v + 2 - 5 for v. -3 Suppose 0 = -2i - 9 + 1. Let j be (1 - 5)1/i. Let r be (-3)/j4/(-4). Solve 6 = -rc + c for c. -3 Let x(d) = d2 + 11d - 9. Let r be x(-11). Let y be r/12(-7 - 1). Let f be 14/6 + (-2)/y. Solve fi + 0i + 8 = 0 for i. -4 Suppose -c + 4c = 0. Suppose -2u - 3u + 15 = c. Suppose 0m + um = 0. Solve 0 = -2d - md + 6 for d. 3 Suppose -4y + 55 = -4d + 19, 0 = y - 5d - 29. Solve ym = -15 + 3 for m. -3 Suppose f = -3o + 12, f + 4 = 4o - 5. Suppose ol + j - 8 = 2j, -4l + 2j + 10 = 0. Solve -l = -3s - 15 for s. -4 Let a(u) = -u3 - 10u*2 - 17u + 1. Let h be a(-8). Solve 6d + 21 = -h for d. -5 Suppose 4w + 6w = 30. Suppose -wf - c = 4c + 14, -4f + 16 = -2c. Solve s + 3 = fs for s. 3 Let y be (-4)/2(1 - 5). Let m(t) = t + 7. Let d be m(-1). Suppose -64 = -dn - 4. Solve -3g + yg - n = 0 for g. 2 Let c = -18 + 24. Suppose -p + 0u - u - c = 0, -p - 9 = 4u. Let m = 8 + p. Solve 2f - 1 = mf for f. -1 Let z = -107 - -177. Let u = z + -68. Solve -7j + 25 = -uj for j. 5 Let a be (2/10)/((-1199)/110 + 11). Solve 12 = 6s - as for s. 3 Suppose 3 - 12 = -9f. Solve 0 = 3z - 2 - f for z. 1 Let o be (-3 + 3)/(-2 - (-2)/(-2)). Let r = o + 8. Solve -3s + r = s for s. 2 Let p(j) = -3j*2 + 6j - 4. Let x be p(4). Let d be (-7)/x + ((-350)/(-8))/5. Solve -d = -4k - 21 for k. -3 Suppose r - 13c - 8 = -9c, c + 77 = 4r. Let z(t) = t - 1. Let q be z(3). Solve -r = 7j - qj for j. -4 Let p = -8 + 12. Suppose 4 + 8 = pj. Let r be -19(-3)/62. Solve j = 4n + r for n. -4 Let n(m) = 3m2 - m + 0 - 4 + 2 + 6m. Let d be n(-2). Solve d = a + 2a + 3 for a. -1 Let g = 14 - 10. Let z(v) be the second derivative of v5/20 - 2v*4/3 + 4v3/3 - v2/2 + v. Let x be z(7). Solve gl - l = -x for l. -2 Let r = -12 + 18. Suppose 2q - 3v = 7q - 14, -2v + r = 0. Solve -q = -4k - 5 for k. -1 Suppose 79s - 14 = 72s. Solve 0 = sx + 12 - 4 for x. -4 Let v be 0/(-2 - 1)(-79)/(-316). Suppose 2z + 3z - 5 = 0. Let c be (-3)/(0 - (0 + z)). Solve v = -cp - p - 4 for p. -1 Let s(i) be the third derivative of i5/60 - i4/24 - 13i*3/2 + 27i*2. Let y be s(-6). Solve -3j + 4j = -y for j. -3 Suppose -5a + a + 4 = 0. Suppose 71 = 3q + 2t + 8, 0 = 2q - t - 49. Suppose 2v = q - 15. Solve a = i + v for i. -3 Suppose -g - 1 = -0. Let w be (9/1 - g) + -3. Let l be (4 + 0)(w + -6). Solve 0 = -2s + s - l for s. -4 Let d(c) = 2c2 + 45c + 64. Let q be d(-21). Solve -3 = 2n - q for n. -1 Suppose 48j - 7 + 7 = 0. Let u be ((-10)/(-4) + -1)2. Solve -p + u = -jp for p. 3 Let s(n) = 3n - 64. Let t be s(25). Solve -13h + 10 = -th for h. 5 Suppose -x + 69 = 4z, -5x = z - 856 + 530. Solve -2 = 21l - x for l. 3 Suppose -2k - 7 = 1. Let z be 46/6 - k/(-6). Suppose 3g = zg. Solve gd + 2 = -d for d. -2 Let b be (-5)/(25/(-10)) - 14. Let q = b - -14. Solve d = 3 + q for d. 5 Let p(j) = 4j3 + 17j*2 + 3j + 2. Let v be p(-	{ "pile_set_name": "DM Mathematics" }
uence xe. 3/68 Four letters picked without replacement from {a: 1, w: 1, y: 1, m: 1, q: 1}. Give prob of sequence yyqy. 0 Calculate prob of sequence cbc when three letters picked without replacement from rrrrerreeerbcceee. 1/2040 Calculate prob of sequence mh when two letters picked without replacement from {m: 3, h: 5}. 15/56 Three letters picked without replacement from {b: 1, i: 1, q: 1, l: 2, y: 1, j: 2}. Give prob of sequence lyb. 1/168 Four letters picked without replacement from xgylbbt. What is prob of sequence gbxl? 1/420 Two letters picked without replacement from {b: 3, k: 1, e: 1}. What is prob of sequence ek? 1/20 Three letters picked without replacement from aptpntsrptn. Give prob of sequence tts. 1/165 What is prob of sequence iiko when four letters picked without replacement from poppkopppbpipppipo? 1/12240 Calculate prob of sequence ris when three letters picked without replacement from {w: 1, h: 3, r: 2, x: 1, i: 2, s: 3}. 1/110 Two letters picked without replacement from {w: 1, g: 8, s: 2, v: 2}. Give prob of sequence sg. 4/39 Two letters picked without replacement from {w: 1, z: 2, j: 1, y: 2, x: 1, i: 1}. Give prob of sequence yz. 1/14 Calculate prob of sequence xwe when three letters picked without replacement from xxwwexwe. 3/56 Four letters picked without replacement from apnperrrrerareprp. What is prob of sequence aeer? 1/680 Two letters picked without replacement from encneooecoogezo. What is prob of sequence cc? 1/105 Calculate prob of sequence jj when two letters picked without replacement from qjqj. 1/6 Two letters picked without replacement from hpxwwxxwwxwxww. What is prob of sequence xx? 10/91 What is prob of sequence wl when two letters picked without replacement from plwelw? 2/15 What is prob of sequence tb when two letters picked without replacement from ootywgwotggogbgyyg? 1/153 Three letters picked without replacement from {w: 12, a: 1, y: 7}. What is prob of sequence wya? 7/570 Calculate prob of sequence tot when three letters picked without replacement from {s: 2, t: 2, o: 2}. 1/30 Four letters picked without replacement from xxxxxbbxbxxxxxx. What is prob of sequence xbbb? 1/455 What is prob of sequence asx when three letters picked without replacement from ppaxaxpaasxxasao? 1/70 Two letters picked without replacement from {q: 1, x: 1, n: 1}. What is prob of sequence nq? 1/6 Calculate prob of sequence ii when two letters picked without replacement from {p: 2, f: 4, t: 4, i: 5}. 2/21 Calculate prob of sequence ssks when four letters picked without replacement from skkkkkkskkkkkkkssks. 35/3876 Three letters picked without replacement from eeqiireiiireiieeei. Give prob of sequence iei. 49/612 Calculate prob of sequence vk when two letters picked without replacement from {d: 2, u: 1, v: 4, k: 2}. 1/9 Calculate prob of sequence phh when three letters picked without replacement from {p: 1, x: 2, h: 4, w: 7}. 1/182 What is prob of sequence wc when two letters picked without replacement from {e: 3, o: 1, c: 2, w: 6}? 1/11 Calculate prob of sequence bll when three letters picked without replacement from {k: 6, l: 4, b: 3, j: 1}. 3/182 Three letters picked without replacement from neofcii. What is prob of sequence eno? 1/210 Three letters picked without replacement from {k: 3, h: 6, o: 6}. What is prob of sequence ooo? 4/91 What is prob of sequence ss when two letters picked without replacement from nssssssssn? 28/45 What is prob of sequence ss when two letters picked without replacement from {c: 1, s: 7}? 3/4 Calculate prob of sequence ldd when three letters picked without replacement from lldldddddd. 7/40 What is prob of sequence kkk when three letters picked without replacement from kkjjkj? 1/20 Two letters picked without replacement from {m: 3, a: 13}. What is prob of sequence mm? 1/40 Three letters picked without replacement from sbbebwzswswbkwzwz. What is prob of sequence swb? 1/68 Four letters picked without replacement from {i: 3, p: 1, r: 2, j: 5, n: 1}. What is prob of sequence jrij? 1/99 Calculate prob of sequence jk when two letters picked without replacement from vjvkjvkkvk. 4/45 Four letters picked without replacement from tbmvtmbvm. Give prob of sequence vmmt. 1/126 Three letters picked without replacement from stdid. What is prob of sequence dds? 1/30 Calculate prob of sequence sscs when four letters picked without replacement from cyycccyyccsssyyyyc. 7/12240 What is prob of sequence pmmp when four letters picked without replacement from msmpmpmmsmmmsssmssmm? 11/5814 Three letters picked without replacement from {v: 1, o: 1, l: 1, q: 1, t: 1}. Give prob of sequence vto. 1/60 Four letters picked without replacement from {d: 8, e: 6, o: 1}. What is prob of sequence oded? 2/195 Calculate prob of sequence gd when two letters picked without replacement from {d: 1, o: 1, g: 2}. 1/6 Three letters picked without replacement from {m: 3, f: 1, l: 3, n: 3, g: 3, b: 2}. What is prob of sequence fnm? 3/910 Four letters picked without replacement from vcvcvvvvlxlccv. Give prob of sequence lcvx. 1/429 Calculate prob of sequence vbbv when four letters picked without replacement from {b: 2, v: 3, a: 1, u: 1}. 1/70 Two letters picked without replacement from wvwwikvwvwv. Give prob of sequence wv. 2/11 What is prob of sequence jnn when three letters picked without replacement from {o: 1, j: 1, n: 2, d: 1}? 1/30 Four letters picked without replacement from {n: 4, s: 6, c: 10}. Give prob of sequence snsc. 10/969 Two letters picked without replacement from {y: 1, r: 2, b: 3, m: 1}. What is prob of sequence yr? 1/21 Calculate prob of sequence pppa when four letters picked without replacement from {a: 10, p: 9}. 35/646 Calculate prob of sequence mqm when three letters picked without replacement from qqqmqqmqqqqqqmq. 12/455 Two letters picked without replacement from {x: 4, g: 7}. Give prob of sequence gx. 14/55 Four letters picked without replacement from {o: 3, t: 3, z: 2, q: 1, i: 3, j: 1}. Give prob of sequence ztot. 3/1430 Calculate prob of sequence hsc when three letters picked without replacement from {h: 11, c: 1, s: 6}. 11/816 Calculate prob of sequence vatf when four letters picked without replacement from ffefeffjttvjjeaafee. 1/3876 What is prob of sequence pfhn when four letters picked without replacement from {f: 1, h: 1, n: 1, g: 2, y: 2, p: 1}? 1/1680 Three letters picked without replacement from {n: 4, r: 6, y: 2}. Give prob of sequence rrn. 1/11 Three letters picked without replacement from xxxkxxkxxxxxxxxxkxgg. Give prob of sequence xgk. 1/76 What is prob of sequence xlb when three letters picked without replacement from xllbbffbbx? 1/45 Three letters picked without replacement from {k: 10, r: 6, f: 2}. What is prob of sequence rrr? 5/204 Calculate prob of sequence bcb when three letters picked without replacement from {b: 14, c: 1}. 1/15 What is prob of sequence ss when two letters picked without replacement from jsoauajg? 0 Three letters picked without replacement from {z: 1, l: 7, v: 2}. Give prob of sequence vvz. 1/360 What is prob of sequence ss when two letters picked without replacement from {b: 2, a: 2, d: 4, o: 1, s: 1}? 0 Calculate prob of sequence uhuq when four letters picked without replacement from {r: 1, u: 11, e: 1, h: 2, q: 2, t: 2}. 55/11628 What is prob of sequence hm when two letters picked without replacement from hmheeeeeheme? 1/22 What is prob of sequence lj when two letters picked without replacement from {v: 1, j: 5, k: 1, l: 2}? 5/36 Calculate prob of sequence bglb when four letters picked without replacement from bgbbglbg. 3/140 Four letters picked without replacement from ieggaieigeegpega. What is prob of sequence gpeg? 5/2184 Calculate prob of sequence iz when two letters picked without replacement from ioooiifzmf. 1/30 What is prob of sequence msym when four letters picked without replacement from {u: 2, y: 8, m: 2, s: 3, e: 2}? 1/1190 Calculate prob of sequence zx when two letters picked without replacement from xxzxxzszxsxsxxxszxx. 22/171 Two letters picked without replacement from {m: 2, r: 3, j: 1, t: 1}. What is prob of sequence rr? 1/7 Three letters picked without replacement from yomymossosomoss. Give prob of sequence yoo. 4/273 Two letters picked without replaceme	{ "pile_set_name": "DM Mathematics" }
1 + (5 - 4)) a prime number? False Let n be 2/(-8) - 1118/8. Let t = -71 - n. Suppose u - 4u + t = 0. Is u a prime number? True Let q(y) = y2 - y - 4. Let v(u) = 3u3. Let w be v(1). Let p be q(w). Is ((-2)/(-2))/(p/70) composite? True Let b(t) = -t2 + 9t - 11. Let u be b(9). Let s = -7 - u. Suppose -103 + 19 = -sh. Is h composite? True Let v = 339 + -116. Is v composite? False Is 0 + (-6)/(-2) - (-538)/1 prime? True Suppose 2s = -2s + 24. Suppose 0 = 2z - 3z + 14. Is (z/3)/(s/9) composite? False Is 0 + 247 + 2 + 0 a prime number? False Let v(w) = w*3 - 7w*2 + w + 7. Suppose 0 = m - 6m + 15. Suppose a - 2h + 7h - 18 = 0, 30 = ma + 3h. Is v(a) composite? False Let b be (-1244)/(-10) - (-14)/(-35). Suppose g - b = -3g. Is g composite? False Suppose -5p + 5g = -615, 3p - 4g - 373 = -3g. Suppose b + 2c = 32 + p, 0 = -5b + 2c + 737. Is b composite? False Let n = 2824 - -411. Is n composite? True Let l = 7 + 268. Let w(r) = r3 + 11r*2 + 9r - 8. Let y be w(-10). Suppose -yn + 7n - l = 0. Is n a prime number? False Let u be -1(-3 + 1 - -2). Suppose -w + 3o - 10 = -0w, 3o - 8 = 2w. Suppose -5v - d + 395 = u, 4v - wd - 316 = -0d. Is v prime? True Suppose 3f - 4f = 1, 2k = -2f + 2078. Suppose -n - 7g + 507 = -2g, -2n + k = -3g. Is n prime? False Suppose 0 = -6t + 4t - 4v + 1314, -v = -2t + 1339. Is t composite? True Let i(t) = -t3 - t2 + 2t - 204. Let d be i(0). Let c = d + 523. Is c composite? True Suppose -2h + 5l + 20 = 0, 12 = -0h - 5h - 3l. Suppose h = g - 6g + 110. Is g a prime number? False Suppose -4q = 221 + 1263. Let x = 916 + q. Suppose 64 = -2t - 3l + 278, 5l - x = -5t. Is t prime? True Let t = 28 - -30. Is t prime? False Suppose 3q - 16 = -q. Suppose qf + 5l = 41, 0l = -3f - 3l + 27. Is ((-7)/(-2))/(2/f) a composite number? False Let t(b) = -b3 - 9b*2 - 9b - 4. Let p be t(-8). Let s be 4 + p(-3)/6. Let m = s - -7. Is m a composite number? True Let n(m) = -3m*3 + 2m*2 + 13m - 17. Is n(-8) composite? False Let l = -3 - -2. Is l1(-88)/8 a composite number? False Let o(d) = 15d - 5. Let q(n) = 16n - 6. Let y(p) = 7o(p) - 6q(p). Is y(6) a composite number? True Let h(g) = 5g3 + g2 - g + 1. Let k be h(1). Let u(s) = -s2 + 10s - 5. Is u(k) composite? False Suppose 2x + 924 = 7x + 3h, x - 180 = h. Is x a composite number? True Let f(o) = -15o - 3. Let s(j) = 22j + 4. Let y(d) = 7f(d) + 5s(d). Let c = 7 + -4. Is y(c) a prime number? False Let p = 10 - 5. Let b = p + -6. Is 35 - (b - (0 - 3)) a composite number? True Suppose -x - v + 425 = -977, 3v = -x + 1408. Is x a composite number? False Let i(k) = 49k2 + 5k - 13. Is i(3) composite? False Let l(c) = c*2 - 21c - 5. Is l(-21) composite? False Suppose 0t + 5t - 200 = 0. Let k = -17 + -4. Let j = k + t. Is j a prime number? True Let c(j) = j*2 - 3j + 2. Let w be c(4). Suppose wq = 5q + 57. Suppose -q + 438 = 3i. Is i a composite number? False Let r = 65 - 31. Is r prime? False Let v = -13 - -17. Let j(c) = 7c*3 - 5c*2 + 2c - 5. Is j(v) a composite number? True Let p(f) = 16f2 + 23f + 31. Is p(12) a composite number? True Let o be 302 + (-2)/(0 - -2). Let i = o - 144. Is i a prime number? True Suppose -178 - 7 = -5n. Suppose -3y - n = -4y. Is y composite? False Suppose 764 = -2p + 6p. Is p composite? False Let r(h) = -h2 + h + 3. Let d be r(0). Suppose -2x = 5p - 237, -dp = x - 4x + 408. Is x a prime number? True Suppose -4f - 10 = -6f. Is 3/f + 742/5 a composite number? False Is (-2(-3)/(-9))/((-4)/10938) composite? False Let r(f) = -f*3 - 4f*2 - 7f + 11. Is r(-4) composite? True Let l be 4/(-6) + (-7530)/(-9). Let f be l/14 + (-2)/(-7). Suppose 35 = 5s - f. Is s prime? True Is (-2)/(-7) + (-1970)/(-14) prime? False Let s = -10 + 22. Is (1 + s)/(2/14) prime? False Let p = -177 - -271. Is p composite? True Is 1567 - (4/22 + (-126)/(-33)) a composite number? True Let w be ((-12)/(-9) + 2)-3. Is (-584)/w - (-2)/(-5) a composite number? True Suppose -4p - 12p = -14512. Is p composite? False Is 111626(-4)/(-8) composite? False Let x = 6 + -4. Suppose -34 - 34 = -2w - z, -4z - 78 = -xw. Is w prime? False Suppose -5w - 5160 = -5m + 1540, -6740 = -5m - 3w. Suppose 4g - 1304 = -5y, -m - 285 = -5g + 3y. Is 3/(-15) + g/5 a prime number? False Let s = 12 + -17. Let q = s - -9. Is (q/(-12))/(2/(-222)) a composite number? False Is (-2)/42(-324 - -1) a composite number? True Let g be (707/14)/(1/2). Let d = 166 - g. Is d prime? False Let h(n) = -6n*2 + n - 2. Let b = 2 - -1. Let x be h(b). Let d = 74 + x. Is d composite? True Let h(d) = 3d*2 - d. Let z be h(1). Let s be (-10)/(-10)(-16)/z. Is (0 + -4)/(s/6) composite? False Is (-2 - -60)/(2/3) prime? False Suppose 8w = 3w + 20. Suppose -wf + 0f = -764. Is f a prime number? True Let t = 11 + -8. Suppose -j = -2x - 245, -2j + tj = 3x + 242. Is j a prime number? True Suppose 3l = -5c + 4, -5c - 2l + 6 = -0l. Is 2/c - -361 prime? True Is (3126/(-18))/((-1)/(-3))-1 composite? False Let b = 4 + 0. Suppose -bf + 232 = -3x, -2x + 174 = -f + 4f. Suppose 4p + f = 654. Is p a prime number? True Let d(s) = s*3 - 2s*2 + 8s + 3. Let q be d(6). Suppose m = 4m + 4g - q, 0 = -m + 4g + 65. Suppose m = 4j - 23. Is j composite? True Is 214948/36 - 1(-6)/27 a composite number? True Suppose 7s + 398 - 20845 = 0. Is s a composite number? True Suppose -t - 64 = -d, 261 = 4d - 8t + 3t. Is d prime? True Let k(p) be the second derivative of p6/120 - p5/30 + p4/12 - p3/2 + p2/2 - p. Let x(z) be the first derivative of k(z). Is x(4) a composite number? False Let c(j) = j2 - 6. Let y(t) = -2t*2 - t + 7. Let b(f) = -4c(f) - 3y(f). Let i be b(-3). Suppose 8k = 4k + i. Is k prime? True Suppose -3s - b = -1146, -s - 3b = -3s + 753. Is s composite? True Suppose -s + 1 + 22 = 0. Let u = -43 + s. Let y = -14 - u. Is y prime? False Let d = -53 - -90. Is d a composite number? False Let p = 2415 + -1321. Is p a composite number? True Let v be 2(-4)/(8/(-5)). Suppose 0 = vi - i - 2212. Is i a prime number? False Let x(l) = 4l2 + 8l. Suppose -2 = t - 5w + 4, -6 = t + 2w. Let u be x(t). Suppose -2h + 34 = -u. Is h prime? False Let a be -1 - (3 + -2 - 3). Let n(b) = a - 2 + 30b + 5b. Is n(1) composite? True Let o = -62 - -65. Suppose 3c - 13 = -2v, 0c + 2c = 5v - 23. Is c/((-1)/(-74)) + o composite? True Suppose -2b - 3 = -2h + 1, 4h = b - 4. Let a be 5(1 - 3 - b). Let y(n) = 2n - 7. Is y(a) a composite number? False Suppose 2r + 2t - 28 = 0, -5r - 4t + 79 - 13 = 0. Let f(d) = -d + 11. Let a be f(r). Is 12 + a - (0 - 0) composite? False Suppose 2g - y - 7 = -2y, -3y = 4g - 17. Let r be (-2)/(-3) - g/3. Suppose -2h + h + 65 = r. Is h a composite number? True Let i(r) = -7r - 1. Let n be i(11). Let y be n/(-18) - (-1)/(-3). Suppose 0 = g - b - 14, 2g = g + 3b + y. Is g prime? True Let g = 11 + -6. Suppose 2c + 3w - 11 = -96, gw + 210 = -5c. Is (-1)/(-3) - c/3 prime? False Let z(t) = -t3 + 6t*2 - 7t + 1. Let q be z(5). Is (42/q)/((-6)/27) prime? False Let z be (-3 - 1) + (-97)/(-1). Suppose 0 = 2k - 275 + z. Is k a composite number? True Suppose -n - 2 = 4. Let g = 16 + n. Is g composite? True Suppose 3k + 5p = 7767, 5k + 5p - 8p = 12945. Is k a composite number? True Suppose 0 = k + 3y - 16, -3k = 5y + 11 - 47. Suppose -3i - 2d = -kd - 29, d = -2i + 2. Is (-2)/i + (-46)/(-6) a prime number? True Let l = 775 + -456. Is l prime? False Let m be (-2 + 4)(-2)/(-1). Suppose 0 = mh - h - 12. Suppose -5 = -5j, -hg + g + 3j = -3. Is g a prime number? True Let k(t) = -t*3 + 15t*2 - 13t - 19. Let s be k(14). Let l(d) = 6d2 - 8d - 5. Is l(s) prime? False Let m = -10 + 18. Let u(o) = 4o + 7. Is u(m) prime? False Let t(u) = u3 + 4u*2 + 3u + 4. Let m be t(-3). Let l = m - -73. Is l a prime number? False Suppose 2c = 5c - 27. Is c composite? True Let w = -11 - -8. Is w/(-6)(134 + 0) a composite number? False Let m be (-42)/(-4) - (-2)/4. Suppose 4y - m = 5c, -2y + c + 15 = 2y. Suppose 2f = y*f - 94. Is f a composite number? False Let a = 2523 - -184. Is a a composite number? False Let n(p) be the first derivative o	{ "pile_set_name": "DM Mathematics" }
-7 + 0 + -63. -56 What is the value of (14 - 1 - (50 - -16)) + 1? -52 Evaluate -5 + 3 + (-1 - (22 - 0)). -25 Calculate 64 + -63 + 16 - (5 + -7 + 87). -68 Calculate 23 - (-13 - (-3 - 12)) - 43. -22 What is the value of ((2 - (-14 + 9)) + -18 - (-25 + 3)) + 38? 49 (-102 - -141) + 8 + -15 + -9 23 Evaluate -4 + -77 - -16 - (-3 + -13 + 6). -55 Calculate (-16 + 27 + -18 + 7 - -13) + -2 + 10. 21 Evaluate -8 - (0 - -4 - (0 + (-6 - (5 - 12)))). -11 -19 + 9 - -20 - (11 - (-6 + -9)) -16 33010 + -32940 + (-7 - 2) + 1 62 What is the value of (40 + -20 + -1 + 7 - -7) + 13? 46 8 + -1 + -70 + (115 - 124) -72 What is 226 + -76 + 95 + -128? 117 What is -62 - (21 - (-11 - -21) - (-2 + -1))? -76 Calculate -55 + -59 + (322 - 134). 74 (-13 - (-12 + 0)) + (20 - (58 + 23)) -62 (26 - -4) + -36 - (-3 + 8 - -19) -30 What is the value of 106 + -104 + 10 + (7 - -1)? 20 Evaluate -19 + (-2 + -11 + 7 - (6 + -5)). -26 Calculate -113 + (-27 + 41 - -27). -72 What is -19 + (-18 - -119 - -25)? 107 What is -26 + (-12 - (49 + -79))? -8 (-123 - -98) + (-16 - -3 - -33) -5 Calculate -2 - -13 - (7 - -5) - (6 - 10) - 35. -32 -35 + -8 - (-53 + -18) 28 -5 + -3 + 12 + (-1 - (2 + 4) - -1) -2 What is -16 + (14 - 11) - (-55 + 21 - 11)? 32 Calculate -4 + -82 - (-2 - (21 + -29) - (1 + 11)). -80 What is -4 + 3 - ((16 - 23) + 10) - -10 - -8? 14 What is -23 + (40 - -1) + -45? -27 What is the value of (-93 - -40 - -187) + -53? 81 Calculate 53 - (-49 - -34 - -55) - (0 + -3). 16 What is (27 - 41 - -15) + -1 + 13 + -1? 12 Calculate -11 - (30 - 19 - 5) - -19. 2 -9437 + 9445 - (1 + 58 + 0) -51 What is 51 + 36 - ((1 - 0 - 1) + 11) - 4? 72 Evaluate (-43 - 42 - -103) + 62. 80 Evaluate 1 + 28 + -1229 + 1250. 50 What is the value of (-22 - (5 - -3 - 18)) + 3 + 16? 7 What is 355 - 382 - (-121 + 8)? 86 What is the value of -8 + -58 + (1379 - 1331)? -18 What is -85 + (-2 - (23 + 9 + -15))? -104 What is the value of -110 + 339 + -128 + -61? 40 Evaluate 898 + -850 - (-2 - -15). 35 Evaluate (44 - 3) + (-5 + -25 + 9 - -9). 29 Calculate 169 + -84 - (-1 - 25 - (17 + -28)). 100 What is the value of -27 - (-77 - (46 - (-27 + 39)))? 84 Calculate 30 - (41 + 5 + -29). 13 Evaluate 85 + 7 + -39 + -36. 17 What is the value of (32 - -2) + (-30 - -12) - 72? -56 (36 - (-16 - -52)) + (2 - -1 - -77) 80 64 + (-12 - (6 - (6 + -6 + 4))) 50 -14 - (-103 - ((18 - 5) + -16 + -19)) 67 (83 - -11) + 3 + (-10 - 11) - -20 96 Calculate 0 + (-5 - (2 - 7)) - ((-4 - 17) + -57). 78 Evaluate -22 + -33 + (166 - 25) - (0 + 10). 76 Evaluate -23 + (5 + 3 - ((-6 - -7) + -4)) + 0. -12 What is the value of -125 + 122 + -90 + 0 - 40? -133 Calculate -9 - 5 - (-136 - -93 - (-7 + 1)). 23 Evaluate 57 - 39 - (50 + -19) - (-6 + 36). -43 What is 16 + (21 - 20) + -61 + (1 - 2) + 8? -37 What is 31 + 4 + -6 + 0 + (-1 - 11)? 17 What is 22 + ((-23 - -54) + -12 - 28)? 13 -4 - (-408 + 419 - (-1 + (11 - 0))) -5 4 + (-17 + -17 - 41) -71 Calculate -63 - ((-12 - -1) + (-43 + 93 - 23)). -79 (4 - 86) + 6 - ((-7 - (-30 + -19)) + -27) -91 Calculate 29 - 21 - (-12 + 3 + 4). 13 19 + (-24 - (10 - 57)) 42 Evaluate -8 - (-6 + -6 + (-50 - -4) + 14 + -4). 40 Calculate 12 - ((4 - -46) + -10). -28 What is (57 - (37 + 28)) + (2 + 0 - 0) + 9? 3 What is the value of -4 + 9 - (-43 + (-4 - 7 - -4) + 3)? 52 What is 0 + -126 + (-3 - 10 - -33 - 5 - 25)? -136 97 - (-45 + 128) - (-1 - -29) -14 4 + 24 + 0 - 10 - (47 - -24) -53 (-79 + 103 - (-20 + 1)) + 16 - -1 60 Evaluate 7 - (16 - -5) - (31 - (-6 + 7)). -44 What is the value of -3 - (-31 + 15 - -15 - (-43 - 1))? -46 Calculate -27 + (-2038 + 2046 - (-1 + -3 + 7)). -22 What is the value of (3 - -5) + 31 - 0 - (64 - 86)? 61 Evaluate -4 - (-89 + (65 - 37)). 57 333 + -126 - 52 - 97 58 What is 27 + (-19 - (11 - -2)) - -29? 24 Evaluate -61 - (3 + (-3 - -1) + (-26 - (-41 + 7))). -70 Calculate (66 - -14) + -92 + 42. 30 What is (2 - (10 + -8) - -63) + (9 - 6) + -12? 54 What is 1 - -16 - (37 + (-61 - -42))? -1 Evaluate (-5 - (3 - 6)) + (6 - 7 - 5) + 71. 63 What is the value of 59 + (-343 - -106) + 73? -105 9 + (-15 - 1) + (-82 - -163) 74 15 + -1 + -31 + 30 + -48 -35 What is -1 - -8 - ((74 - 21 - 12) + -24)? -10 What is the value of 49 + -10 + (4 - (-8 + -2)) + -7 - 2? 44 (100 - (0 + 16 + 274 + -276)) + -10 76 Evaluate 1 + (22 - (-13 - (3 - (25 + -1 - 10)))). 25 What is the value of 115 + -208 + 34 + 141? 82 Evaluate (364 - 339) + (-49 - -8). -16 12300 + -12261 - (0 + 29 - -1) 9 Evaluate (1 - -11) + -4794 + 4800. 18 -12 + 39 + -24 + 26 + 15 44 What is the value of 0 + 8 + (-186 - -151) + (32 - -1) + -29? -23 Evaluate 4 - (2 + 40 + 54 + -40). -52 Calculate -4 + 1 + -55 + 70 + 35. 47 Calculate -110 + (113 - 64 - -41). -20 What is the value of (-5 - -3) + 1 + 95 + -21 + 37 + -7? 103 What is 0 - (3 + -18) - (26 - 24) - (-13 + 116)? -90 (-4 - (1 - 2)) + (-20 - (-68 + 55)) -10 Calculate -1 + -124 - (-49 + 28 - (0 - 36) - 21). -119 Calculate -23 + (-40 - (4 + -27)) + 2 + 4. -34 Evaluate 1 + 3 + -12 + 8 + -16 + -31. -47 What is the value of -5 + -17 + (-4 - -3) - (28 + 39 + -65)? -25 Evaluate -9 + (-6 - 7) + -13 - (0 + (0 - 0)). -35 Evaluate (15 - -21) + (-49 - -14) + 21. 22 Calculate -26 - (-8 + (-20 - -27) - -22). -47 What is (-76 + 32 + 32 - (4 + -1)) + 55? 40 Evaluate 40 + 46 + -17 + 27 - 25. 71 What is the value of ((-10 - -33) + 23 - -3) + (-2 - 3)? 44 Evaluate -29 + 3 - (-53 - -8 - -47). -28 -58 - (-16 - -40) - -67 -15 What is the value of 51 - -1 - (56 + 25 - 70)? 41 Evaluate (-8 - -5) + 7 + 1 + -435 + 441. 11 What is 39 + -10 - (-147 + 148)? 28 Calculate (18 - 31 - 9 - -3) + (0 - 11). -30 Evaluate -16 - (-122 + 148 + -70). 28 -10 + (-8 - (-3 + -33)) + 45 + -37 26 What is 99 + -196 + 188 + -93? -2 Calculate 1609 - 1551 - (91 - 0). -33 What is -4 - (-52 - 3) - (22 + -8 + -1)? 38 Calculate -25 - -16 - (-89 + (5 - 1) + (35 - 27)). 68 What is -106 + (-12 - (-94 + -120))? 96 What is the value of 37 - (-41 - ((14 - 21) + 0))? 71 Calculate -288 + 35 + 273 - (104 + -2 + 1). -83 Evaluate -24 + (-22 - (-28 - -12)) + -14. -44 Evaluate 8 + 6 + -18 + 3 + 2 - 27. -26 Calculate 18 + 1 + -1 - (-401 + 396) - -12. 35 -67 - (10 + (-4 - 7) + 21) -87 -5 + 1 + (1301 - 1299) -2 What is the value of (-4 - 0) + 110 + -138 + 26? -6 Evaluate -97 + (-10 + 3 + 0 - (35 - 32)). -107 Evaluate -107 + 74 + -75 + 9. -99 What is -89 + -11 + -19 + 30 - -11? -78 What is 40 - -25 - (24 + -33)? 74 Evaluate -28 + 93 - (18 - (13 + -1 - 13)). 46 Evaluate 24 + (7 - -12) + -25 + -17. 1 What is the value of 13 - (-8 - (-28 - (-10 + -10)))? 13 What is the value of (182 - 146) + (-19 - 5) - 51? -39 What is the value of (20 + -2 - 17 - 91) + 29? -61 -19 + 30 + -36 + (5 - 5) -25 Calculate (-64 - (75 - 12)) + 6 + 1 + -1. -121 Calculate -22 + 4 - -4 - (39 + (-45 - -4)) - -132. 120 Evaluate 58 + (-4 - -4 - 8) + (-148 - -145). 47 Evaluate -47 - ((-23 - 0) + (4 - 12) + 20). -36 What is the value of -72 - 17 - (-26 + -114)? 51 What is 11 - (-23 - 0 - 0)? 34 Evaluate 0 + 38 - (-2548 - -2528). 58 Evaluate (3 - (5 - 3)) + -22 + 57 + (-1 - 2). 33 Calculate (-15 - (-7 - -16) - -24) + (-78 - -9). -69 Calculate -2 + 2 + -1 - (32 + (25 - 88)). 30 What is the value of -56 - ((-9 + (15 - -7) - 12) + -11)? -46 Evaluate (79 + -5 - (-78 - -89)) + 2 + -1. 64 Calculate -6 + (18 - 7) + -51 + 10. -36 Evaluate -21 - (-3 + -9) - 3 - 5 - (-3 + 8). -22 Evaluate (-67 - (60 - 107)) + 3. -17 What is (5 - -13) + -8 - (-2 + 12 + 1)? -1 What is -5 + (-12 - -14) + 13 - (44 + -1 + -1)? -32 (30 + 6 + -8 - 14) + -190 + 72 -104 Evaluate (-9 + (-10 - (-15 - 2)) + -10 - -6) + -108. -114 Evaluate 12 - -23 - (43 - -11). -19 Calculate 57 - (8 - (-5 - -4)) - (-6 + (13 - 8)). 49 Evaluate -160 + (18 + 50 - -60). -32 What is -100 - 49 - -170 - (145 + -1)? -123 Calculate (-1 - -7 - -79) + 3 + 1028 + -1006. 110 Calculate (-200 - -190) + 0 + 90 - (49 + -50). 81 Calculate -343 + 165 + 163 + 25 + 0. 10 Calculate -74 + -18 + 3 + 9 + 17. -63 Evaluate (-7 + -16 - -78) + -25 - -26. 56 What is -2 + 83 - (-19 + (-21 + 23 - -6))? 92 Evaluate (16 - -16) + (-29 - 15) + -9. -21 8 + (-51 - -20) + 1 + 17 -5 Evaluate (9 - 1) + -1 + -56 + 525 + -499. -23 What is (-7 - (-25 + 12)) + -6 + 0? 0 Evaluate 59 + 2 + (-37 - (-29 + 16)). 37 (-40 - -100 - 25) + -65 -30 Evaluate (-38 - (46 + -60)) + 1 + 8 + -32. -47 -14 + -129 + 8 - -24 - (11 - 0) -122 Evaluate (-123 - -84) +	{ "pile_set_name": "DM Mathematics" }
-5x - r = 5s for s. -3 Suppose 2x - r - 6 = -2r, 0 = -5x + r + 22. Solve -2t = -3c + 16, xt + 10 = -9c + 4c for c. 2 Suppose -5k = -3n - 3k + 40, 3k + 35 = 2n. Solve -2u = m + 5, 7m - 5u + n = 2m for m. -3 Let z = -9 + 17. Solve 4x = k + 3k + z, -x + 4k + 8 = 0 for x. 0 Let u be 0/2(-2)/(-4). Suppose -3s + 2s + 1 = u. Solve 3w = 7w, 0 = -t - 2w - s for t. -1 Let k = 13 + -8. Solve -2m - kc = -14, -2c + 4 = -3m + 3c for m. 2 Let u = 24 + -21. Solve 4n - 3h = 7n + u, 0 = -2n + 4h + 10 for n. 1 Let i = -3 + 5. Solve -5l = 5f + 20, 0 = 4f - 3l + l - i for f. -1 Let d be 2 + (2 - (-1 + 6)). Let j(g) = 2g3 + g2 - 2g + 2. Let q be j(1). Let k = q + d. Solve 4h + 9 = 5m, 2h + m - 1 = -k for h. -1 Let h be 4/6 - 292/(-12). Suppose 5a - p = 15, p = -4p - h. Solve -3o = -4i - a, 5o + 5i + 18 = o for o. -2 Let z be (0 - (-5 - -2)) + 9. Solve 0 = -3m + z, 2g + 0m - 6 = -m for g. 1 Let i = 1 - 1. Suppose i = -3t - 2 + 14. Let b be (t-4)/(0 + -2). Solve 0y + 2d = -y + 4, 3d + b = 2y for y. 4 Let w = 101 + -98. Solve -4m - 3k = 14, -m - wk + 0 = -1 for m. -5 Let k = -7 + 13. Suppose -3t - 51 = -3i, -2t + 22 = 2i - 0t. Let q be 2/3 + i/6. Solve -3r + k = 3y, r = -3y - q + 15 for y. 5 Let g(w) = w2 - 7w + 2. Let j be g(7). Let z(r) = 2r3 + 0r*3 + 1 - 2r*2 - 2 - r. Let f be z(j). Solve o - 7 = -4o - 2a, fa - 8 = -3o for o. 1 Suppose -5m + 11 = 3k + 47, 5k + 16 = -m. Let c = -3 - m. Let i(b) = 2b2 + 3b + 1. Let v be i(-2). Solve vh = cu + u - 12, 3h + 9 = 3u for h. 0 Suppose -13k + 8k + q + 85 = 0, -2k + 5q + 57 = 0. Solve 5d + k = 2t + t, -d = 2 for t. 2 Let o(w) = w*2 + 9w + 4. Suppose 7p - 3p = -36. Let r be o(p). Solve -19 = m - rd, 8 = 5m + d - 2 for m. 1 Suppose 0 + 5 = 2l + 5p, -l = 2p - 3. Suppose lm - 25 = -5k, -2k = 5m - 7 - 18. Solve 0 = 2q - 2d - 16, q - m = 3d + 13 for q. 3 Suppose -3t = -t + 5d - 9, -t - 4d = 0. Let k = t + -9. Solve 5b = 5, 5f + kb + 16 = -b for f. -4 Suppose -3t = 5 + 4, -13 = -2u + 3t. Let a = 7 + -2. Solve 8 = -an - 3z + 30, n - uz + 6 = 0 for n. 2 Let y be (-2 - 4)6/(-4). Suppose -l = 7 - y. Solve -3m + 15 = 3o, 4m - 6 = -lo + 4 for m. 0 Let m = -7 - -12. Solve 5p - 4d = -d - 15, 0 = 2p + d - m for p. 0 Suppose 3y = -4m - 4, 0 = m - 4y + 11 - 29. Solve -5k - 5p - 24 = -mk, 3k - 5p - 6 = 0 for k. -3 Let i = 70 + -68. Solve 3m + 30 = -2m + 5k, -im + 8 = 2k for m. -1 Suppose -5v = -v - 16. Suppose 2u + 10 = 7u. Let o = 5 - u. Solve -oh = -2t - 23, t + vh - 11 = 5 for t. -4 Let t be 2/(-4) - 10/(-4). Suppose -y = -ty + 2. Let x be 1/(y - 3/2). Solve a = o - xa + 2, 4o = -2a - 8 for o. -2 Let n be (-9)/(-27)6/(-3)-6. Let w = -9 - -29. Solve -g + 6g + w = 3r, -2r - ng = -6 for r. 5 Let q = -20 - -20. Solve 4x = -5m + 4, 5m + 5x + qx = 0 for m. 4 Suppose 17 = 3d - 2k, 2d - 3k - 18 = -d. Suppose -dp = -0p - 5. Solve -5m - r = -3r - 15, 4m + r = -p for m. 1 Let d = 20 - 49. Let g = -15 - d. Suppose k + 3w = -8, -2k = 2w - 0w. Solve -f + kf + 4t + g = 0, 8 = -4t for f. -2 Suppose -7v + 6 = -29. Solve -c + 6 = -vu - 5c, -2 = -u - 4c for u. -2 Let j(a) = 11a - 52. Let k be j(5). Solve 2z = -2, -3m - kz + 4z = 14 for m. -5 Let o be (2/6)/(1/87). Suppose -o = -5v - 4f, -v = 3v + 4f - 24. Solve -3z - 1 = 4m, 3z - 1 + 0 = -vm for m. 2 Suppose -3z = -4n + 128, 3n - 3z + 15 = 114. Let f = n - 5. Suppose t - 2 - 3 = -3s, -s - 15 = -3t. Solve j = r - 8, -tj + 4r - 12 = f for j. -4 Let g = 13 + 9. Solve 2c = -3c + 25, 3j + g = 2c for j. -4 Let u be -1 + (9 - 4) - -1. Solve 15 = p + 4i - 0, up - 2i - 9 = 0 for p. 3 Suppose 27t - 37t = -10. Solve 0 = h + 3j + j + 6, j + t = 0 for h. -2 Let w be (22/(-6))/((-2)/6). Let r = 16 - w. Let h be (-1)/r - (-21)/5. Solve -hx - 16 = -4k, -3x + 3k + 2k = 12 for x. -4 Suppose 14w + 0w - 252 = 0. Solve i = -3i + 3g + w, -g + 13 = 5i for i. 3 Let d = -19 + 17. Let k(p) = -p3 - 2p*2 - 2p - 1. Let f be k(d). Solve 2a + a + fy + 6 = 0, 15 = -3y for a. 3 Let i(f) = f3 - 7f*2 - 9f + 11. Let g = 15 - 7. Let p be i(g). Solve -5t + 2k = 6 - p, -5t + 5k = 0 for t. -1 Let j(s) = s*3 - 8s*2 - 9s + 4. Let h be j(9). Suppose -ht + 98 = -2. Solve 6i = -g + i + t, g + 2i - 13 = 0 for g. 5 Suppose 5f = -5j, 5j - 9j + 5f = -27. Solve 4l + jb = 23 - 1, -b + 6 = l for l. 4 Let v(h) = -h*2 + 6h. Let w(z) = z*3 - 10z*2 + 11z - 13. Let g be w(9). Let a be v(g). Solve -5x - 3q - 10 = 0, -41 + 11 = x - aq for x. -5 Let i(g) = g3 - 3g*2 - 3g - 3. Let x be i(4). Let w = 1 + x. Suppose ws + s - 6 = 0. Solve l - 8 = -2m, 10 = sm + 2l + 2 for m. 4 Let x(y) be the first derivative of -y*3/3 + 2y*2 + 5y - 1. Let w = 33 + -28. Let j be x(w). Solve 4a + t = 19, j = 3a + t + 4t - 27 for a. 4 Suppose 0 = 5c - 4z + 116, -4c + 5z = z + 92. Let m be (-23)/(-5) + c/40. Solve -18 - 6 = 3d + 3q, md + q = -20 for d. -4 Let t(q) be the second derivative of q*3/6 - 2q*2 + 2q. Let w be t(4). Solve -5f - 8 + w = 3x, 0 = -f + x for f. -1 Let k be (1 - 2)/(-1)4. Solve 5r - 14 - 36 = 5j, r = kj + 25 for j. -5 Let t(g) = -2g + 9. Let c be t(3). Solve -2y = -r - 1, -8y + cy = -r - 7 for r. 3 Let f(d) = -2d - 21. Let v be f(-13). Solve 0 = vm + 4p - 13 - 23, -5m - 3p + 32 = 0 for m. 4 Let x be 21 + 1/((-1)/2). Suppose -o = 2o - s - x, s = o - 5. Suppose -3 = -5h + 7. Solve -oa + 2d = -ha - 1, -4a + d = -2 for a. 1 Let p = 56 + -51. Solve ph + 2g + 23 = 0, -h - g = 2h + 13 for h. -3 Let i = 25 - 22. Solve 3k - if = -2k - 1, k + 2f = 5 for k. 1 Let t be ((-10)/3)/((-2)/9). Suppose 0c - 9 = -3l + 3c, -5c = 2l + t. Suppose 10 = 5x - 15. Solve 10 = 3v - n - l, xn - 4 = -3v for v. 3 Suppose 5y = 3x - 15, 4y + x + 12 = -x. Let j(s) = -4s + 89 - 89. Let r be j(y). Solve 5l - 2l = 3n + 12, -3n - 3l - r = 0 for n. -4 Suppose -2d = -0d. Suppose 4 = 4q, -u - 3q + 9 = 2u. Let g = 2 - u. Solve -2v + 2z + 13 - 5 = d, -v - z = g for v. 2 Let p be (-9)/(3/12-3). Suppose 5l - p = l. Suppose 0 = -li + 4b + 5 + 19, 3 = 3i + 3b. Solve -9 = j + 5n, ij + n + n = -18 for j. -4 Suppose 0 = -7l + 3l - 3j, 3l - 2j - 17 = 0. Solve -lb = -5u + 7, 1 = -5b - 2u + 10 for b. 1 Let l(d) = -d + 23. Let w be l(18). Suppose 147 + 7 = 5a - 4j, 27 = a + 3j. Suppose wf = -5 + a. Solve 2q - q = -5g + 17, -4q - fg = -8 for q. -3 Let s = 3 + -11. Let y = 11 + s. Solve -yv - 10 = c + c, -3v = 3c + 9 for v. -4 Let t be 5 + (-5 - -2) + 0. Suppose 2g = -tm + 14, 8m - 5m = 2g + 6. Solve 5a = -5y, -2y + y - 8 = ga for a. -4 Suppose 4t - 5t = -2. Suppose 4n = -tg + 16, -3g + 24 - 4 = 5n. Solve g = -l + 2w - 4, 5l + 2w = -w + 32 for l. 4 Let u be (2/3)/(6/(-36)). Let x = u + 8. Solve 0o + o + 2 = -3d, -xo = -3d - 7 for d. -1 Suppose -10 = -21x + 20x. Solve 4j - 3y + 14 = -4y, -3j - y - x = 0 for j. -4 Let i be (3 - (4 - 2))-1. Let n(c) = -4c3 + 2c*2 + c. Let d be n(i). Solve 4s - 5q - 24 = 0, -ds - 4q + q - 7 = 0 for s. 1 Let f be (3/3)/(1/7). Let y(z) = z2 - 7z + 4. Let c be y(f). Solve -b - 8 = -5i - cb, 3i + 2b = 5 for i. 1 Let p = -29 + 47. Suppose 4g + 16 = 2w, 0 = -2w - 2w + g + p. Suppose wx - 24 = 24. Solve -5j + b - x = 0, 6b - b = 4j - 3 for j. -3 Let j = -7 + 22. Let q = 9 - j. Let b be 1/((-1 + -1)/q). Solve 5p - 2g + 5g + 5 = 0, 7 = -4p - bg for p. 2 Let f be 5(9/(-3) - -2). Let j = 9 + f. Let x = 0 + 5. Solve -xh - 2o = -10, -3o = -jo for h. 2 Let q(p) = 9p3 - p2 - 3p*2 + 3p*2 - 3p*3. Let n be q(1). Solve 6b - b = 10, 16 = -2s + nb for s. -3 Let n be (8/(-5) + 1)(-150)/30. Solve -ni - 1 = k, i + i = 4k + 4 for k. -1 Suppose 66 + 144 = -3x. Let o = -49 - x. Solve -25 = 5i + 5u, -4u - o + 2 = 3i for i. -1 Suppose -7g - 35 = -14g. Let x = 1 - -2. Solve -j - 4k = -x, 3j + k + 6 = gj for j. 3 Suppose -3k = -8 - 1. Solve 0n - kn = -c + 7, -c - n - 5 = 0 for c. -2 Suppose 0 = -10n + 5n + 10. Let g be (-80)/(-44) - 2 - (-2)/11. Solve g = -3f + 12, -nh + f - 8 - 2 = 0 for h. -3 Let n(d) = -2d3 + 11d*2 - 6d + 8. Let u be n(5	{ "pile_set_name": "DM Mathematics" }
2, 664, 816? w*3 + 2w2 - w + 382 What is the v'th term of -1682, -3359, -5034, -6707, -8378, -10047? v2 - 1680v - 3 What is the d'th term of 75, 90, 105, 114, 111, 90, 45, -30? -d3 + 6d*2 + 4d + 66 What is the u'th term of 112, 104, 74, 10, -100, -268? -2u3 + u2 + 3u + 110 What is the b'th term of -127, -438, -953, -1672, -2595? -102b2 - 5b - 20 What is the k'th term of -17, -36, -53, -56, -33, 28, 139, 312? 2k3 - 11k*2 - 8 What is the w'th term of 137, 259, 381, 503? 122w + 15 What is the a'th term of -15, -77, -179, -321? -20a2 - 2a + 7 What is the w'th term of 71, 598, 2041, 4862, 9523? 77w3 - 4w*2 - 2 What is the t'th term of 22, 58, 110, 178, 262, 362, 478? 8t*2 + 12t + 2 What is the o'th term of 29, 34, 39, 44, 49? 5o + 24 What is the y'th term of 649, 1307, 1965, 2623, 3281, 3939? 658y - 9 What is the q'th term of 2, -2, -16, -46, -98, -178, -292? -q3 + q2 + 2 What is the b'th term of -3, 1, 19, 57, 121, 217? b3 + b2 - 6b + 1 What is the l'th term of 9, 49, 121, 225, 361, 529, 729? 16l*2 - 8l + 1 What is the h'th term of -13, -82, -211, -412, -697, -1078, -1567, -2176? -2h3 - 18h2 - h + 8 What is the l'th term of -770, -762, -756, -752, -750? -l2 + 11l - 780 What is the k'th term of -204, -408, -612, -816, -1020? -204k What is the a'th term of 180, 359, 538? 179a + 1 What is the p'th term of 2353, 4707, 7061, 9415, 11769, 14123? 2354p - 1 What is the v'th term of -453, -467, -481, -495, -509, -523? -14v - 439 What is the p'th term of -296, -298, -302, -308, -316, -326, -338? -p2 + p - 296 What is the x'th term of 280, 278, 278, 280, 284? x2 - 5x + 284 What is the l'th term of -25, -54, -95, -142, -189, -230, -259? l*3 - 12l*2 - 14 What is the q'th term of 3887, 3884, 3881, 3878? -3q + 3890 What is the m'th term of 325, 316, 303, 286, 265? -2m2 - 3m + 330 What is the w'th term of 2999, 3000, 3001? w + 2998 What is the m'th term of -36, -143, -328, -597, -956? -m*3 - 33m2 - m - 1 What is the i'th term of -39, -58, -75, -90, -103, -114? i2 - 22i - 18 What is the y'th term of 63, 105, 133, 141, 123, 73? -y3 - y2 + 52y + 13 What is the k'th term of 16, -218, -862, -2120, -4196, -7294, -11618, -17372? -34k3 - k2 + 7k + 44 What is the y'th term of -235, -503, -781, -1075, -1391? -y3 + y2 - 264y + 29 What is the g'th term of -35, -33, -31, -29, -27? 2g - 37 What is the a'th term of -46, -93, -156, -223, -282, -321? 2a3 - 20a*2 - a - 27 What is the l'th term of -53, -123, -215, -329? -11l*2 - 37l - 5 What is the a'th term of 7, -4, -39, -110, -229, -408? -2a3 + 3a + 6 What is the m'th term of -41, -54, -65, -74? m*2 - 16m - 26 What is the n'th term of 111, 134, 157, 180? 23n + 88 What is the l'th term of -35, -79, -123, -167? -44l + 9 What is the l'th term of -1815, -1830, -1871, -1950, -2079? -2l3 - l2 + 2l - 1814 What is the i'th term of 28, 33, 50, 85, 144, 233? i*3 - 2i + 29 What is the g'th term of 1148, 1141, 1120, 1079, 1012, 913, 776, 595? -g3 - g2 + 3g + 1147 What is the x'th term of -44, -93, -144, -197, -252, -309, -368? -x2 - 46x + 3 What is the i'th term of -488, -979, -1472, -1967? -i*2 - 488i + 1 What is the p'th term of 53, 88, 121, 152, 181? -p*2 + 38p + 16 What is the j'th term of 38, 8, -34, -88? -6j2 - 12j + 56 What is the p'th term of -53, -70, -99, -140, -193, -258, -335? -6p2 + p - 48 What is the w'th term of -52, -165, -336, -565, -852, -1197, -1600? -29w*2 - 26w + 3 What is the z'th term of -113, -121, -129, -137, -145? -8z - 105 What is the j'th term of -15, -34, -53? -19j + 4 What is the u'th term of -749, -748, -745, -740, -733, -724? u*2 - 2u - 748 What is the l'th term of -26, -127, -372, -833, -1582? -12l3 - 17l + 3 What is the a'th term of 1709, 1712, 1717, 1724, 1733, 1744, 1757? a*2 + 1708 What is the t'th term of 41, 70, 119, 188? 10t*2 - t + 32 What is the d'th term of -669, -676, -683? -7d - 662 What is the j'th term of 4, -7, -34, -83, -160, -271, -422? -j*3 - 2j*2 + 2j + 5 What is the y'th term of 278, 284, 294, 308, 326, 348, 374? 2y2 + 276 What is the v'th term of -29, -128, -297, -536, -845, -1224, -1673? -35v*2 + 6v What is the n'th term of 7, 21, 35? 14n - 7 What is the d'th term of -102, -95, -74, -33, 34, 133? d3 + d2 - 3d - 101 What is the v'th term of 23, -7, -97, -277, -577, -1027? -5v3 + 5v + 23 What is the q'th term of 10, 44, 106, 208, 362? 2q3 + 2q*2 + 14q - 8 What is the f'th term of 1931, 1934, 1937, 1940? 3f + 1928 What is the q'th term of -360, -712, -1064, -1416, -1768? -352q - 8 What is the w'th term of 985, 3935, 8851, 15733, 24581, 35395, 48175? 983w2 + w + 1 What is the c'th term of 90, 98, 106, 114, 122, 130? 8c + 82 What is the v'th term of -9, -14, -21, -30, -41, -54? -v*2 - 2v - 6 What is the p'th term of 117, 120, 127, 138? 2p2 - 3p + 118 What is the t'th term of -39, -35, -31? 4t - 43 What is the c'th term of 20, 16, 2, -28, -80, -160? -c3 + c2 + 20 What is the t'th term of 2027, 2026, 2025, 2024? -t + 2028 What is the s'th term of 2069, 4138, 6207, 8276? 2069s What is the f'th term of -1785, -3576, -5367? -1791f + 6 What is the c'th term of -10379, -10384, -10391, -10400? -c2 - 2c - 10376 What is the v'th term of 13, 55, 131, 259, 457, 743? 3v3 - v2 + 24v - 13 What is the y'th term of -39, -69, -127, -219, -351, -529? -y*3 - 8y2 + y - 31 What is the q'th term of -48, -36, -12, 30, 96, 192? q3 + 5q - 54 What is the t'th term of -1, -31, -123, -307, -613, -1071, -1711, -2563? -5t3 - t2 + 8t - 3 What is the i'th term of -19, -72, -127, -184, -243, -304, -367? -i2 - 50i + 32 What is the s'th term of 42, 41, 40? -s + 43 What is the y'th term of -59, -170, -281, -392? -111y + 52 What is the m'th term of 59, 70, 93, 134, 199, 294? m3 + 4m + 54 What is the v'th term of 81, 157, 231, 303, 373, 441, 507? -v*2 + 79v + 3 What is the h'th term of 503, 1011, 1521, 2033, 2547, 3063? h*2 + 505h - 3 What is the o'th term of 136, 133, 126, 115? -2o2 + 3o + 135 What is the t'th term of -15, -13, -11, -9? 2t - 17 What is the z'th term of 30, 46, 62, 78, 94, 110? 16z + 14 What is the d'th term of -3, 2, 19, 54, 113? d*3 - 2d - 2 What is the g'th term of -41, -45, -37, -11, 39, 119, 235, 393? g*3 - 11g - 31 What is the c'th term of 198, 177, 130, 45, -90, -287, -558? -2c3 - c2 - 4c + 205 What is the t'th term of -658, -683, -708, -733, -758? -25t - 633 What is the b'th term of -470, -471, -472, -473? -b - 469 What is the s'th term of 11, 13, 17, 23, 31? s2 - s + 11 What is the v'th term of 85, 88, 91, 94? 3v + 82 What is the y'th term of -18, -24, -32, -42, -54, -68, -84? -y*2 - 3y - 14 What is the g'th term of -124, -112, -100, -88, -76, -64? 12g - 136 What is the c'th term of 43, 63, 105, 175, 279, 423, 613? c3 + 5c*2 - 2c + 39 What is the x'th term of 914, 913, 912? -x + 915 What is the o'th term of 20, 11, -10, -49, -112, -205, -334? -o*3 - 2o + 23 What is the s'th term of 13293, 13294, 13295, 13296, 13297, 13298? s + 13292 What is the i'th term of 2, -13, -42, -85, -142, -213? -7i2 + 6i + 3 What is the c'th term of -180, -361, -544, -729, -916, -1105? -c*2 - 178c - 1 What is the x'th term of -329, -332, -335? -3x - 326 What is the y'th term of -1338, -1316, -1268, -1182, -1046, -848, -576? 2y3 + y2 + 5y - 1346 What is the s'th term of -4189, -4185, -4181? 4s - 4193 What is the b'th term of -70, -62, -38, 8, 82, 190? b*3 + 2b*2 - 5b - 68 What is the t'th term of -11, -22, -61, -134, -247, -406, -617, -886? -t*3 - 8t*2 + 20t - 22 What is the k'th term of 357, 360, 365, 372? k2 + 356 What is the q'th term of -3746, -3749, -3754, -3761, -3770, -3781? -q2 - 3745 What is the i'th term of -9, -12, -31, -72, -141, -244, -387? -i*3 - 2i*2 + 10i - 16 What is the l'th term of 410, 813, 1216, 1619, 2022? 403l + 7 What is the t'th term of -199, -197, -199, -205, -215, -229, -247? -2t*2 + 8t - 205 What is the o'th term of -18700, -18701, -18702, -18703, -18704, -18705? -o - 18699 What is the r'th term of 7, 31, 63, 97, 127, 147, 151? -r*3 + 10r**2 + r - 3 What is the m'th term of 5117, 5113, 5109, 5105,	{ "pile_set_name": "DM Mathematics" }
11g - 73g. Let b = -0.06 + -2.94. Let j = b - -4. What is the smallest value in g, 3/7, j? g Let h be ((-2)/(-6))/(-7 - 742/(-105)). Let l = -0.078 - -1.078. Which is the third biggest value? (a) -0.3 (b) 3 (c) l (d) h c Let o = -0.36 - -0.06. Let t = -0.248 - -0.448. Which is the fourth smallest value? (a) 2 (b) o (c) t (d) 5 d Let d = 699/37 + -19. Let n = 108743 - 36211457/333. Let v = d + n. Which is the biggest value? (a) 0.3 (b) -0.3 (c) v a Let d be (-2)/11 + 5 + 192/(-33). Which is the second biggest value? (a) d (b) -2/49 (c) 0.1 b Let f = 30 + -59. Let y = f + 26. Let q = -2 + y. Which is the second smallest value? (a) 0.2 (b) q (c) 0.19 c Let f(z) = -z*2 + 9z + 12. Let y be f(11). Let v be ((-48)/y)/(6/(-20)). Let x be 3 + v/12 + -1. What is the second biggest value in 1, -1, x? x Let v = -15 - -17. Suppose -vs + 1 = -7. Suppose 0 = 4h, 0i + 4i = sh + 12. Which is the third biggest value? (a) i (b) 1.2 (c) -1 c Let j = 1.4 + 1.6. Let i = 256 + -257. What is the biggest value in j, i, -8? j Let n = -2.7 - -2.3. Suppose 0 = -3w - w + 2s + 8, 0 = -2w - 2s - 8. What is the fourth smallest value in 5, 4, w, n? 5 Let t = 0.0101 + -0.2101. Let h = 0.07 - -3.93. Let d be 5(-2)/353. What is the second biggest value in h, t, d? t Let q = 0.345 - -0.655. Which is the second biggest value? (a) q (b) -0.02 (c) -2/13 (d) -0.4 b Let t = 22/27 + -17/54. What is the fourth biggest value in -2, -978, 0.2, t? -978 Let k be (116/36 - 3) + 89/(-279). Let y = k + -22/93. Let q = -71/12 + 29/4. Which is the second biggest value? (a) q (b) y (c) 2 a Let r(w) = -w2 + w + 1. Let t be r(3). Let h = -2932.9 - -2933. Which is the second smallest value? (a) 3 (b) h (c) t b Let d = 0 + -2. Let p = 2587/7779 - -2/2593. Which is the third biggest value? (a) p (b) 1 (c) d c Let g be (2 - 2) + (-1)/(-2). Let b = 0 + g. What is the third biggest value in b, -3, 2? -3 Suppose -7t = 26 - 40. Let n = 0.1 + -0.5. What is the third biggest value in t, -0.1, n, 0.1? -0.1 Let i = -28.48 + 28. Let t = 0.08 + i. Let o = 87 + -177/2. What is the biggest value in t, o, 1/4? 1/4 Let i be 53/5 + (-18)/30. Let y be 26/5 - 2/i. What is the second biggest value in -0.4, 0.2, y? 0.2 Let f = -78.4 - -75. Let v = -1.37 + -0.03. Let r = v - f. Which is the smallest value? (a) r (b) -0.3 (c) -4 c Let m = 38.05 - 38. Let q = -0.25 + m. What is the second smallest value in q, 3/2, 6? 3/2 Let m = -62 + 98. Let q = m + -32. Let f = -0.06 - -0.46. Which is the second smallest value? (a) f (b) 0.3 (c) q a Suppose 0 = -39c + 1111 + 137. What is the second biggest value in 2/11, -1, -3, c? 2/11 Suppose 2r - o - 13 = -10, o + 4 = 3r. Which is the third smallest value? (a) r (b) 5 (c) -5.6 b Let z = -1621 + 1616. Which is the second biggest value? (a) 1/7 (b) z (c) -0.41 (d) -0.3 d Let o = 1.889 + 0.111. Let r be -2 - (1 + (-22)/8). Which is the second biggest value? (a) r (b) -5 (c) o a Let t = -17.4 - -17. Which is the third biggest value? (a) 16.4 (b) t (c) -0.5 c Let z = -5.31 - -5.31. What is the second smallest value in z, -0.1, 0.01, -3? -0.1 Let f be (-2)/1 - 276/(-45). Let c = -14/5 + f. What is the smallest value in -0.4, c, 4? -0.4 Let h be -1(4/16 - 0). Let i be 15/12 + (2 - 10/4). What is the fourth biggest value in h, i, -3, 1/4? -3 Let o be 5 + (-7 - -3) + 2. Let t be (154/(-21))/((-2)/(-9)o). Which is the smallest value? (a) 0.3 (b) 5 (c) t c Let g(y) = 6y + 5. Let z be g(-4). Let k = -14 - z. Let j = 0.8 - -1.2. Which is the biggest value? (a) -1 (b) k (c) j b Let u = 0 - 0.07. Let h = -0.43 + u. Let l = -19 - -21. Which is the third biggest value? (a) h (b) l (c) 5 a Let u = 82 - 80. Let f = 2.19 + 1.89. Let q = f + -0.08. What is the second smallest value in q, -2/3, u? u Let v(t) = t*2 + 11t + 2. Suppose -2p - 2c - 18 = 0, -6p + 5c = -p + 65. Let w be v(p). What is the third smallest value in 1, w, 3/5, 4/7? 1 Let h be 11/(-2) - (8 - 12). Which is the second biggest value? (a) -3 (b) 0.03 (c) h (d) -2 c Let r = -383 + 383.2. What is the biggest value in 9, -4, r, 11? 11 Let j(r) = 4r2 + 17r - 7. Let u be j(-5). What is the smallest value in u, 2, 0.2? 0.2 Let m be (-11233)/1195 - (-3 - -2)9. Let q = -2.4 + 0.4. Let i = -2.5 - q. Which is the second smallest value? (a) m (b) i (c) -5 b Let k = 10.936 + -10.9. Let t = k + -4.036. Which is the third biggest value? (a) -1 (b) -1.3 (c) 0.1 (d) t b Let m(y) be the first derivative of -y2/2 - 2y + 1. Let t be m(-4). Let a be t + 11/(-6)1. What is the smallest value in a, 5/2, 0.5? a Let h = -0.1 - -0.1. Let s be (-2 - -4)-1-6. Let k be s/(-30)(-1)/2. Which is the third smallest value? (a) k (b) -6 (c) h a Let v be (4 - 87/21)/((-30)/(-42) + 1). Let x be -122/4. Which is the third smallest value? (a) x (b) v (c) -3 b Let x = 32 - 51. Let w = x + 14. What is the third biggest value in -1/5, -1, 4, w? -1 Suppose 0 = -4s - 3w + 6, 4s = -0w + w - 2. Let f be (-14)/(-2) - s - 3. Let t = f + -4. What is the biggest value in 5, 0.1, t? 5 Let a = 11 - 11. What is the second biggest value in 2, 1/6, 2/7, a? 2/7 Let z = -0.95 + 1. Let l = -926 + 930. Which is the fourth biggest value? (a) l (b) -1 (c) 0.5 (d) z b Let m = -108 + 77. Let w = -27 - m. What is the fourth smallest value in 5, 1, w, 2? 5 Suppose -10 = 3s + w + 1, 0 = 3s + 4w + 8. Which is the third smallest value? (a) -0.5 (b) 9 (c) 5/3 (d) s c Let q(i) = -25i - 454. Let v be q(-18). Which is the fourth biggest value? (a) 0.5 (b) 9 (c) v (d) -0.1 c Let h be (-9)/(-3) - 3 - -2. Suppose 0 = hb - 1 - 1. Let a be (0 - 6/(-15))/b. What is the third biggest value in 0, a, 3/5? 0 Suppose 0 = -5r - 4h - 133, -h = 5r - 21 + 148. Let s = 0 + 25. Let w = s + r. Which is the smallest value? (a) 0.4 (b) w (c) -0.2 c Let v = 0.0639 + 0.0361. Which is the second smallest value? (a) -1/2 (b) -0.4 (c) 3 (d) v b Let k = -133/8 - -129/8. What is the biggest value in 0, k, 18, 2/13? 18 Let i = 1.1192 - 0.1192. Let q be 3/30(-3 + -1). Let m = -3 - -2.7. What is the third biggest value in i, q, m? q Let n(m) = -m3 + 5m*2 - 6m + 2. Let h be n(2). Let l be (616/36)/h. What is the third biggest value in 0.07, l, 0? 0 Let r = 36 + 87. Let d be (-4)/(-12) - r/54. Let x = d - -13/6. Which is the third smallest value? (a) 3/4 (b) -4 (c) x a Let m = -26 - -15. Let f = -11 - m. Suppose 3q = -3s + 18, 10 = -5q + 2s + 3s. Which is the third smallest value? (a) f (b) q (c) 4/5 b Let k = 71 - 157. Let u = k + 93.8. Let v = u + -9. Which is the second smallest value? (a) -3 (b) v (c) -0.3 b Let l = 0 + 4. Suppose 2t = -3f - 2, 0 = -f - 3f + 4t + l. Which is the third smallest value? (a) f (b) 4 (c) 11 c Let g = 107 + -112. Which is the biggest value? (a) 0.4 (b) g (c) 13 c Let y = 70 - 72.8. Let l = 0 + 3. Let h = y + l. Which is the third smallest value? (a) -4 (b) -4/3 (c) h c Let c = 265.316 + -0.316. What is the second smallest value in c, 1/2, 3/5? 3/5 Let s = 808 - 808.3. Which is the second biggest value? (a) -8 (b) s (c) -0.08 b Let u = 334 - 333.95. Which is the second biggest value? (a) 4 (b) 1/7 (c) -2 (d) u b Let u be 1/2(-4)/(-14). Let z be (-7 + 2)-23/165. What is the second biggest value in 4, z, u? z Let i = 24/13 + -87/26. Which is the third smallest value? (a) -1.4 (b) i (c) 0 c Let h = 13 + -28. Let n = h + 15.1. Let u = -108 - -106. Which is the second smallest value? (a) n (b) -4 (c) u c Let a = 71 - 98. Let u = 25 + a. Let x = 4.94 + 0.06. What is the second smallest value in u, -0.02, x? -0.02 Let h = -52.8 + 53. Let g = -1.3 + 1.1. Which is the third biggest value? (a) g (b) h (c) 3/5 a Let j = -753.28 + 753. What is the second biggest value in 5, j, 8? 5 Let r = 164/15 - 23512/2145. Let j = r + 322/1287. Which is the second smallest value? (a) j (b) 3 (c) -2/21 a Suppose -4s + 2a + 62 - 234 = 0, -a - 229 = 5s. What is the second biggest value in -5, s, 0.4? -5 Let t(m) = -4m2 - 4m + 10. Let a be t(5). Let o = 107 + a. Let k = -0.2 - -0.5. What is the second biggest value in o, k, 0.5? k Let p be (14/(-196))/((-1)/(-4)). Let s be 12/(-34)*-6 + -2. Which is the second smallest val	{ "pile_set_name": "DM Mathematics" }
- 2o. 2o(o - 3)2(o - 1)/9 Factor -2o5 + 2o*4 + 6o*3 - 10o*2 + 4o. -2o(o - 1)*3(o + 2) Solve 5b2 + 1100b = 0. -220, 0 Let -6s4 - 21s*3 - 18s*2 = 0. What is s? -2, -3/2, 0 Factor -2z*4/9 + 124z*3/9 + 130z*2/3. -2z*2(z - 65)(z + 3)/9 Factor -2t*3/7 - 3950t*2/7 - 278898t - 278334. -2(t + 1)(t + 987)*2/7 Solve -2l*3 + 8l*2 - 8l = 0. 0, 2 Factor -5m4 + 285m*3 - 5415m*2 + 34295m. -5m(m - 19)*3 Factor -5a*3/3 - 62a*2/3 + 41a/3 + 26/3. -(a - 1)(a + 13)(5a + 2)/3 Suppose -u2/4 - 3u/2 - 5/4 = 0. What is u? -5, -1 Find t such that -2t5 - 30t*4 + 190t*3 - 210t*2 - 188t + 240 = 0. -20, -1, 1, 2, 3 Factor -2k4 - 90k*3. -2k*3(k + 45) Factor -39z3 + 3z*2/4. -3z*2(52z - 1)/4 Factor 3o*5 + 24o*4 + 48o*3 - 48o*2 - 240o - 192. 3(o - 2)(o + 2)*3(o + 4) Suppose -2v4/11 - 2v*3 - 38v*2/11 - 18v/11 = 0. Calculate v. -9, -1, 0 Factor -2x2/11 - 232x/11 + 234/11. -2(x - 1)(x + 117)/11 Suppose 4c5 + 7c*4 - 22c*3 - 19c*2 + 6c = 0. Calculate c. -3, -1, 0, 1/4, 2 Find l, given that 25l4/4 + 30l*3 + 46l*2 + 24l + 4 = 0. -2, -2/5 Factor -4z3 - 180z*2 - 2652z - 12716. -4(z + 11)(z + 17)*2 Solve -63k*3/4 + 7113k*2/4 + 339k/2 = 0. -2/21, 0, 113 Determine b, given that b*3 + 19b*2 + 50b + 32 = 0. -16, -2, -1 What is b in -35b5 + 45b*4 + 410b*3 - 1100b*2 + 840b - 160 = 0? -4, 2/7, 1, 2 Factor 2i5 - 14i*4 + 30i*3 - 26i*2 + 8i. 2i(i - 4)(i - 1)3 Find p, given that -p4 - 611p*3 - 124236p*2 - 8364816p + 8489664 = 0. -204, 1 Factor -x*3/4 - 299x*2/4 + 151x/2 + 150. -(x - 2)(x + 1)(x + 300)/4 Solve 10d2 + 132d + 26 = 0 for d. -13, -1/5 Let -p*2/5 - 73p/5 = 0. What is p? -73, 0 Let -3y3 - 18y*2 - 24y = 0. What is y? -4, -2, 0 Determine n, given that 3n5 - 57n*4 + 297n*3 - 243n*2 = 0. 0, 1, 9 Solve -3m*2/4 - 3m/2 + 18 = 0. -6, 4 What is c in -20c5 - 332c*4 + 36c*3 + 14780c*2 + 8624c - 5808 = 0? -11, -1, 2/5, 6 Factor 4c3 + 8c*2 - 96c. 4c(c - 4)(c + 6) What is j in j2/4 + 3j/8 + 1/8 = 0? -1, -1/2 What is p in 2p4/7 - 172p*3/7 - 360p*2/7 + 688p/7 + 1408/7 = 0? -2, 2, 88 Factor -b*5/8 + 9b*4/8 + 8b*3 + 11b*2 - 6b - 14. -(b - 14)(b - 1)(b + 2)*3/8 Factor -4s*2/5 + 696s - 3476/5. -4(s - 869)(s - 1)/5 Find i such that 3i3/7 - 633i*2/7 = 0. 0, 211 Factor -10d*4 - 65d*3 - 30d*2. -5d*2(d + 6)(2d + 1) Factor 2u2/19 - 36u/19 + 162/19. 2(u - 9)2/19 Solve a5/7 + 9a*4/7 + 22a*3/7 - 32a/7 = 0 for a. -4, -2, 0, 1 Factor q*5/6 - 17q*4/6 + 31q*3/6 - 5q2/2. q2(q - 15)(q - 1)2/6 Factor y3/4 + 1113y2/4 + 2223y/4 + 1111/4. (y + 1)*2(y + 1111)/4 Factor -4k3 + 8k*2 + 20k - 24. -4(k - 3)(k - 1)(k + 2) Determine g so that 2g*3/3 + 10732g*2/3 + 14396978g/3 = 0. -2683, 0 What is z in z*4/5 - 27z*3/5 + 137z*2/5 + 123z + 90 = 0? -2, -1, 15 Determine s, given that 3s5/4 + 57s*4/4 + 189s*3/2 + 243s*2 + 162s = 0. -6, -1, 0 Factor f*3 + 140f*2 - 283f + 142. (f - 1)*2(f + 142) Find o, given that -9o4 + 66o*3 - 75o*2 + 18o = 0. 0, 1/3, 1, 6 Let -b*5/3 + 29b*4/6 - 37b*3/6 - 13b*2/3 = 0. What is b? -1/2, 0, 2, 13 Factor 2g*3 + 194g*2 - 394g + 198. 2(g - 1)2(g + 99) Factor 31250t3/3 + 2500t*2 + 200t + 16/3. 2(25t + 2)*3/3 Determine x, given that 11x*2/2 - 1913x - 348 = 0. -2/11, 348 Suppose 2w5/7 + 24w*4/7 + 74w*3/7 - 12w*2/7 - 328w/7 - 48 = 0. Calculate w. -7, -3, -2, 2 Find g such that -125g3 - 40g*2 + 125g + 40 = 0. -1, -8/25, 1 Factor 3p2/4 - 27. 3(p - 6)(p + 6)/4 Let -3v*2/7 - 393v/7 + 114 = 0. Calculate v. -133, 2 Factor -20l2 - 9505l - 2375. -5(l + 475)(4l + 1) Factor 9x*3 - 663x*2 - 896x - 300. (x - 75)(3x + 2)*2 Factor -5d*4 - 18710d*3 - 23343840d*2 - 9718806250d - 9695481115. -5(d + 1)(d + 1247)3 Factor -y4/4 + 7y3/4 - 7y*2/2 + 2y. -y(y - 4)(y - 2)(y - 1)/4 Suppose 3u*4 + 3u*3 - 69u*2 + 9u + 270 = 0. Calculate u. -5, -2, 3 Find b such that -2b4/9 - 70b*3/9 - 52b*2 = 0. -26, -9, 0 What is w in -12w*2 + 6165w + 1542 = 0? -1/4, 514 Factor 4x3/7 - 436x*2/7 - 1336x/7 - 128. 4(x - 112)(x + 1)(x + 2)/7 Factor j3/2 + 35j*2/2 - j/2 - 35/2. (j - 1)(j + 1)(j + 35)/2 Factor -3p*5/5 - 699p*4/5 - 41754p*3/5 - 121098p*2/5 - 23943p - 7935. -3(p + 1)3(p + 115)*2/5 Let -9o*5 + 348o*4 + 3093o*3 - 2556o*2 - 3084o + 2208 = 0. What is o? -8, -1, 2/3, 1, 46 Factor 3j2 - 492j + 489. 3(j - 163)(j - 1) Let 3g4 - 423g*3 + 14256g*2 + 46656g = 0. Calculate g. -3, 0, 72 Suppose y*5 + 17y*4 + 78y*3 + 140y*2 + 88y = 0. Calculate y. -11, -2, 0 Determine a so that 5a2 + 230a - 480 = 0. -48, 2 Determine y so that 2y3/3 - 10y*2/3 = 0. 0, 5 What is f in 2f*5/19 - 48f*4 + 908f*3/19 + 48f*2 - 910f/19 = 0? -1, 0, 1, 455 Factor -4m2 - 1408m - 123904. -4(m + 176)2 Factor v4/4 + v3/2 - 3v*2 - 9v/2 + 27/4. (v - 3)(v - 1)(v + 3)*2/4 Determine v so that 2v*4/3 - 2v*3/3 - 46v*2/3 - 26v - 12 = 0. -3, -1, 6 Let 2s5 - 6s*4 = 0. What is s? 0, 3 Factor -4u*5 - 148u*4 - 1576u*3 - 3880u*2 - 3604u - 1156. -4(u + 1)3(u + 17)*2 Factor 2v*2 - 88v + 86. 2(v - 43)(v - 1) Factor g*2 + 22g + 40. (g + 2)(g + 20) Factor -j2/6 - 41j/3 - 272. -(j + 34)(j + 48)/6 Determine t so that 5t*2 + 40t - 2565 = 0. -27, 19 Solve 3b2/5 + 249b/5 - 252/5 = 0. -84, 1 Factor 3a3 + 141a*2 + 1026a. 3a(a + 9)(a + 38) Factor -5o*2 + 105o + 1550. -5(o - 31)(o + 10) Factor -9w3 + 56w*2 - 12w. -w(w - 6)(9w - 2) Solve 2d*3/3 - 416d*2/3 + 6142d + 114996 = 0 for d. -14, 111 What is s in -2s5/9 + 14s*4/3 - 10s*3/3 - 194s*2/9 - 40s/3 = 0? -1, 0, 3, 20 Solve -36z5 - 12z*4 + 83z*3 + 14z*2 - 49z = 0. -7/6, 0, 1 Factor r*2/2 + 2r - 5/2. (r - 1)(r + 5)/2 Factor -3b*2 - 180b - 2193. -3(b + 17)(b + 43) Suppose -4s2 + 52s + 56 = 0. Calculate s. -1, 14 Let 3h3/4 + 3h*2/2 - 87h/4 + 63/2 = 0. Calculate h. -7, 2, 3 Solve -500s5 - 625s*4 + 1835s*3/2 + 590s*2 - 835s/2 + 35 = 0. -7/4, -1, 1/10, 2/5, 1 Factor -5w2 - 1305w - 1300. -5(w + 1)(w + 260) Factor r*4 + 129r*3 - 801r*2 + 1215r. r(r - 3)2(r + 135) Factor -4q3 + 52q*2 - 220q + 300. -4(q - 5)2(q - 3) Factor -p*5 + 2p*4 + 29p*3 + 46p*2 - 20p - 56. -(p - 7)(p - 1)(p + 2)*3 Determine h so that 2h*2 - 11012h + 15158018 = 0. 2753 Suppose 3z5/5 - 6z*4 + 87z*3/5 - 96z*2/5 + 36z/5 = 0. Calculate z. 0, 1, 2, 6 Let -p*2/4 - 19p/4 - 9/2 = 0. What is p? -18, -1 Factor 3q2 + 366q + 720. 3(q + 2)(q + 120) Factor -2z3 + 400z*2/3 + 1624z/9 + 544/9. -2(z - 68)(3z + 2)2/9 Factor -2j*2 + 240j. -2j(j - 120) What is f in -2f4/5 + 4f*3/5 + 26f*2/5 + 4f = 0? -2, -1, 0, 5 Factor 5c4 - 575c*3. 5c*3(c - 115) Factor -2n4/5 + 8n*3/5 + 6n*2 - 36n/5. -2n(n - 6)(n - 1)(n + 3)/5 Factor -2h2 + 104h + 570. -2(h - 57)(h + 5) Factor -n*2 + 19n + 92. -(n - 23)(n + 4) Factor -2m*2/13 - 70m/13 - 68/13. -2(m + 1)(m + 34)/13 Let -12z5 - 68z*4 - 88z*3 - 32z*2 = 0. Calculate z. -4, -1, -2/3, 0 Suppose 2z*4/9 + 8z*3 - 50z*2/3 + 76z/9 = 0. What is z? -38, 0, 1 Suppose -z*3/5 + 27z*2/5 - 159z/5 - 187/5 = 0. Calculate z. -1, 11, 17 Factor k*2 - 728k + 727. (k - 727)(k - 1) Let 2v*3 - 50v*2 - 34v + 5202 = 0. Calculate v. -9, 17 Determine x so that x*2/3 + 2x/3 = 0. -2, 0 Find h such that 2h3/5 + 14h*2/5 - 42h/5 - 54/5 = 0. -9, -1, 3 What is k in 2k3 - 208k*2 + 5408k = 0? 0, 52 Factor -3j5 + 3j*3. -3j*3(j - 1)(j + 1) Factor -g3 + 4g*2 + 39g - 126. -(g - 7)(g - 3)(g + 6) Factor -q*2/11 - 20q/11. -q(q + 20)/11 Find w, given that -6w*5 + 201w*4 - 1401w*3 - 2571w*2 - 105w + 858 = 0. -1, 1/2, 13, 22 What is y in -2y5/3 + 6y*4 - 50y*3/3 + 18y*2 - 20y/3 = 0? 0, 1, 2, 5 Factor r*4/3 - 5r*3/3 + 2r*2/3 + 8r/3. r(r - 4)(r - 2)(r + 1)/3 Factor -5y*2/6 + 35y/2 + 55/3. -5(y - 22)(y + 1)/6 Suppose -4i2/5 + 108i/5 - 112 = 0. Calculate i. 7, 2	{ "pile_set_name": "DM Mathematics" }
38 Calculate prob of sequence nnn when three letters picked without replacement from aaaaaannanannnnannn. 40/323 What is prob of sequence ttt when three letters picked without replacement from ttttt? 1 Two letters picked without replacement from lazzlzzlal. Give prob of sequence za. 4/45 Calculate prob of sequence fz when two letters picked without replacement from flyylyzy. 1/56 Two letters picked without replacement from {w: 1, z: 1, g: 2, c: 1}. Give prob of sequence wz. 1/20 Four letters picked without replacement from cncccncccccncc. What is prob of sequence cnnc? 5/182 Two letters picked without replacement from fyyy. Give prob of sequence fy. 1/4 Two letters picked without replacement from fssszyfts. What is prob of sequence sy? 1/18 What is prob of sequence ofof when four letters picked without replacement from iorofnfnoo? 1/210 Calculate prob of sequence xx when two letters picked without replacement from {l: 7, h: 2, x: 3}. 1/22 What is prob of sequence htqt when four letters picked without replacement from hfthtq? 1/90 What is prob of sequence wii when three letters picked without replacement from {w: 2, i: 6}? 5/28 What is prob of sequence ewe when three letters picked without replacement from ewjeejejjjewjj? 5/273 Four letters picked without replacement from {q: 5, h: 3, g: 4, i: 1}. Give prob of sequence qihg. 1/286 What is prob of sequence qjj when three letters picked without replacement from {q: 4, j: 13, p: 3}? 26/285 Calculate prob of sequence vy when two letters picked without replacement from {s: 1, g: 1, x: 3, y: 1, v: 1}. 1/42 Calculate prob of sequence pv when two letters picked without replacement from {k: 3, v: 1, h: 9, w: 1, a: 3, p: 1}. 1/306 Two letters picked without replacement from {v: 1, w: 1, x: 1, z: 1, l: 1}. Give prob of sequence lz. 1/20 Three letters picked without replacement from yxyxyrxxqxkxdyqdyy. What is prob of sequence kqx? 1/408 Calculate prob of sequence hwz when three letters picked without replacement from {a: 1, t: 2, p: 1, z: 1, w: 1, h: 1}. 1/210 Calculate prob of sequence ogog when four letters picked without replacement from {g: 4, o: 6}. 1/14 Calculate prob of sequence vsaa when four letters picked without replacement from {s: 2, a: 2, v: 5}. 5/756 Two letters picked without replacement from {f: 5, i: 3, s: 3, k: 1}. What is prob of sequence ff? 5/33 What is prob of sequence onr when three letters picked without replacement from {r: 6, n: 4, o: 3}? 6/143 Two letters picked without replacement from kcgimxg. What is prob of sequence kx? 1/42 What is prob of sequence qqqq when four letters picked without replacement from qqqlqlql? 1/14 What is prob of sequence picp when four letters picked without replacement from opucpia? 1/420 Two letters picked without replacement from {k: 5, h: 7}. What is prob of sequence hh? 7/22 Two letters picked without replacement from flfllflllffllllllll. What is prob of sequence ff? 10/171 Calculate prob of sequence pzy when three letters picked without replacement from {z: 3, p: 1, y: 4}. 1/28 Two letters picked without replacement from {z: 3, o: 4, v: 2}. Give prob of sequence oz. 1/6 Calculate prob of sequence nls when three letters picked without replacement from ltsntlpnstsstsssn. 7/680 Two letters picked without replacement from pkejkuupup. What is prob of sequence eu? 1/30 Calculate prob of sequence pl when two letters picked without replacement from llllpllplllpll. 33/182 Calculate prob of sequence tt when two letters picked without replacement from ttttlttltt. 28/45 Calculate prob of sequence ggge when four letters picked without replacement from geggegggegegeg. 15/143 Two letters picked without replacement from iikicxiiiiinidii. What is prob of sequence ix? 11/240 Two letters picked without replacement from {d: 1, x: 1, z: 1, j: 1, l: 1}. Give prob of sequence dz. 1/20 Three letters picked without replacement from {p: 3, h: 3}. What is prob of sequence ppp? 1/20 Calculate prob of sequence pp when two letters picked without replacement from {g: 10, n: 3, p: 4, i: 1}. 2/51 Two letters picked without replacement from nnnnnrnrn. Give prob of sequence rn. 7/36 What is prob of sequence wkvk when four letters picked without replacement from {v: 1, w: 11, k: 3}? 11/5460 Three letters picked without replacement from {v: 2, s: 4, z: 2, i: 2}. Give prob of sequence zvi. 1/90 What is prob of sequence lo when two letters picked without replacement from {o: 4, l: 7, p: 4}? 2/15 What is prob of sequence yy when two letters picked without replacement from {q: 3, y: 2}? 1/10 Calculate prob of sequence iff when three letters picked without replacement from iiff. 1/6 Calculate prob of sequence aya when three letters picked without replacement from {y: 3, a: 17}. 34/285 Four letters picked without replacement from {e: 2, s: 1, o: 2, z: 6, c: 7}. Give prob of sequence ozcs. 7/6120 Calculate prob of sequence sn when two letters picked without replacement from snnsn. 3/10 Calculate prob of sequence gvx when three letters picked without replacement from {x: 3, v: 3, m: 1, g: 4}. 2/55 What is prob of sequence gf when two letters picked without replacement from {f: 9, g: 2}? 9/55 Two letters picked without replacement from ckkllkcckknknkl. Give prob of sequence nn. 1/105 Four letters picked without replacement from dxxkk. Give prob of sequence xxdx. 0 Four letters picked without replacement from qqmmainmnmmqim. What is prob of sequence nnqi? 1/2002 Three letters picked without replacement from befbrueqbrfu. Give prob of sequence fef. 1/330 What is prob of sequence ylx when three letters picked without replacement from xmyll? 1/30 Three letters picked without replacement from gsgsyskgysyysysssgg. What is prob of sequence ggg? 10/969 Two letters picked without replacement from cziziiwicc. Give prob of sequence wc. 1/30 Two letters picked without replacement from {m: 7, x: 1}. Give prob of sequence xm. 1/8 What is prob of sequence pfe when three letters picked without replacement from {l: 1, t: 1, f: 2, e: 1, b: 1, p: 1}? 1/105 Two letters picked without replacement from kdodyddyydkkd. What is prob of sequence dd? 5/26 Two letters picked without replacement from vvvvvvkvkkvkkvvvvv. Give prob of sequence kk. 10/153 What is prob of sequence ic when two letters picked without replacement from uutucit? 1/42 Four letters picked without replacement from {k: 4, c: 8, b: 2, f: 4, z: 1}. Give prob of sequence ccck. 14/969 What is prob of sequence zcys when four letters picked without replacement from sacccsysszcbcscsyzc? 7/3876 What is prob of sequence au when two letters picked without replacement from hwkakwwugkak? 1/66 Two letters picked without replacement from wqqqrqrkqrrqwqrqww. What is prob of sequence rk? 5/306 What is prob of sequence pmm when three letters picked without replacement from {m: 11, p: 9}? 11/76 What is prob of sequence ece when three letters picked without replacement from ceecqccecq? 1/24 Two letters picked without replacement from {o: 2, p: 3, r: 5, f: 1, x: 1, u: 8}. Give prob of sequence of. 1/190 Calculate prob of sequence ht when two letters picked without replacement from {h: 1, n: 3, t: 2, q: 6, g: 1}. 1/78 Two letters picked without replacement from ahhxpxpb. What is prob of sequence xh? 1/14 Two letters picked without replacement from gyoyogvgoglyy. What is prob of sequence gg? 1/13 Calculate prob of sequence il when two letters picked without replacement from {h: 1, q: 2, l: 2, i: 4, t: 1, x: 2}. 2/33 Three letters picked without replacement from vyvyvvyyvyyyyryr. What is prob of sequence yvr? 3/112 Two letters picked without replacement from zzbz. Give prob of sequence bz. 1/4 Four letters picked without replacement from tmttmmtxgmc. Give prob of sequence mxgc. 1/1980 What is prob of sequence becu when four letters picked without replacement from eccccccecuccuccebecb? 8/4845 Four letters picked without replacement from vynyyyvvvyyyyyvvyy. Give prob of sequence nvyy. 11/1224 What is prob of sequence la when two letters picked without replacement from gljalllllllajgg? 8/105 Calculate prob of sequence ppee when four letters picked without replacement from ppppppppppeppeppppep. 4/285 What is prob of sequence bpb when three letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
be 3/(-4) - (-22)/p. Suppose -kr - 3s + 11 = -134, -4r + 2s = -298. Is r prime? False Suppose 3q - 231 = 261. Suppose m - 5s - q = 0, -5s + 283 = 6m - 4m. Is m composite? False Let j be -107 - -2 - (2 - 0). Let w = j + 226. Is w composite? True Suppose -t + 2391 = 4d, -4d + 5t + 3359 = 986. Is d a composite number? True Suppose 5c + 3m = 1892, -3c + 4m = 2c - 1899. Is c a composite number? False Let v = 337 + 60. Suppose -m = 5o - v - 860, -m - 751 = -3o. Is o a composite number? False Let m be (4/(-6))/((-1)/3). Suppose 0 = -d + l - 5l + 75, -ml + 2 = 0. Is d prime? True Let b(j) be the third derivative of j5/30 + 11j*4/24 + 5j*3/6 - 3j*2. Let f be b(-7). Is (f/(-4))/((-2)/4) prime? True Suppose -319 = r - 2r. Is r a prime number? False Suppose 2f = 7f + m - 1018, 2f - 412 = 2m. Let z = 299 - f. Is z a composite number? True Suppose 0 = -5h + h + 2164. Is h prime? True Let i be (0 + -1)-1 + 1. Suppose 0 = t - it + 58. Is t a prime number? False Let x(b) = b2 + 9b + 11. Let c be x(-6). Suppose 2v = -0v + d - 8, 0 = -4d - 16. Is c/((-21)/v) - -15 composite? False Suppose 12 = -3h + 486. Is h a composite number? True Let c = 327 + 92. Is c a composite number? False Suppose -3l - 4p + 177 = -49, -3p - 97 = -l. Let y = l - -135. Suppose -5v = -v + 3w - y, 5v - 272 = -3w. Is v prime? False Suppose 5i + 0 = -5. Is (-3)/(i - 2) + 118 prime? False Suppose 0 = 4i + i - 25. Let f(c) = c - 2. Let a be f(i). Suppose n + t + 106 = an, 4n = t + 208. Is n a prime number? False Suppose -2g = -5p + 1209 - 156, 635 = 3p + 2g. Is p prime? True Suppose -4w - 46 = 4k + k, 3w + 18 = -k. Let u = k + 29. Is u composite? False Suppose 8961 = 5c - 10004. Is c a prime number? True Let m be (-33)/(-5) + (-4)/(-10). Suppose 7p + m = g + 2p, 2p = -3g + 38. Suppose 3c = -5b + 186, -c - g = 3c. Is b a prime number? False Let f be 2/321/(-14). Is ((-635)/10)/(f/2) prime? True Let p(q) = -q2 - q - 68. Let n be p(0). Let z = n + 189. Is z prime? False Suppose -16c = -12c - 7964. Is c composite? True Let j(x) = x + 102. Let b be j(0). Suppose -4o + 5u - 118 = 45, 5u = 15. Let w = b + o. Is w a composite number? True Suppose 0f - 4f = -152. Suppose -z + 9 = -f. Is z a prime number? True Let k(q) = q + 14. Let x be k(-10). Let d be x(-1)/((-4)/643). Suppose 97 = 4j - d. Is j composite? True Let j(w) = w + 2. Let v be j(-5). Let s be v/6 + (-1)/(-2). Let a = s + 9. Is a prime? False Let p = 650 - 157. Is p a composite number? True Let r(f) be the second derivative of 17f6/720 - f4/6 - f. Let i(u) be the third derivative of r(u). Is i(2) a prime number? False Let s(f) = f3 + 9f*2 - 5f - 3. Let z be s(-8). Let d be 772/12 - (-1)/(-3). Suppose -z - d = -5q. Is q a composite number? True Let m(u) = 320u - 37. Is m(10) prime? True Suppose 5d = -4c + 30, 5c - 2d - 9 = 12. Let k(x) = -x + 7. Let b be k(c). Suppose 0 = 3o - bp + p - 36, 0 = 3p - 9. Is o prime? True Let a(p) = -p3 + 25p*2 - 2p - 29. Let n(m) = -2m3 + 49m*2 - 4m - 57. Let u(b) = -11a(b) + 6n(b). Is u(18) composite? True Let l(k) be the second derivative of 5k3/6 - 13k*2 + 8k. Is l(12) prime? False Suppose 2c = 5k - 3539, 5c = -4k - 1459 + 4310. Is k prime? True Is -1468(95/(-20) + 3) a composite number? True Suppose 0 = -5l - 2u + 27, 5l + u + 4u - 30 = 0. Suppose l = 2p - 5. Suppose -2k + 157 = k + t, 3k - pt = 169. Is k prime? True Let v be (16/(-10))/2-5. Is v3/(18/39) composite? True Suppose -3n + n - 12 = 0. Let u be 1/(-4) + (-18)/(-8). Is u(0 + (-237)/n) a prime number? True Let v(y) = 78y*2 - y + 2. Is v(1) a prime number? True Let r = -126 - -211. Is r prime? False Suppose 2m + 876 = 4k, -2k + 3k - 219 = m. Let j = -154 + k. Is j prime? False Suppose -2d + 4m - 516 = -m, 5d + 3m + 1290 = 0. Let j = -704 - d. Is j/(-18) + (-8)/(-36) a prime number? False Suppose 0 = 3d + 2m - m - 214, -3m = 3d - 216. Suppose -d = -3p + 40. Is p a prime number? True Suppose 0g + 2g - 360 = -4o, 0 = 2o - g - 176. Is o a composite number? False Suppose 20r - 19r = 541. Is r prime? True Let y be 173(0 + -1) - -2. Let w = 258 + y. Is w a prime number? False Is 6/9339/2 prime? True Is (0 - (3 + -5)) + 329 a composite number? False Let m(j) be the first derivative of -31j2/2 - 5j + 2. Is m(-4) a prime number? False Let a be (-3)/2(-88)/3. Suppose -3y = a - 401. Is y a composite number? True Let w = -439 + 848. Is w prime? True Let k = 4 + -4. Suppose 3j - 2h + 4 = k, 2h = -4j + 7 + 11. Suppose -3q - 73 = -5t, 0 = 3t - jt + q - 13. Is t composite? True Suppose -5t + 174 + 196 = 0. Is t a prime number? False Let j(a) = a2 - 2a*2 + 21a + 4 - 2 + 1. Is j(11) a prime number? True Suppose 2 = 2a, 3a + 1 = -3n - 5. Is n1 + (3 - -233) prime? True Let j be (18/(-5))/(3/(-10)). Suppose 2q - j = -q. Suppose 2t = -t - i + 381, 2t - 254 = -qi. Is t a prime number? True Suppose -5 + 0 = 4r + 5a, -2a + 10 = 4r. Let s be 10/r - (-2 + -18). Suppose -s = 4c - 162. Is c a composite number? True Suppose -716 = -5i + 299. Is i a composite number? True Let d = -491 - -996. Is d a composite number? True Let r(l) = -6l3 - 2l*2 - 5l - 10. Is r(-3) a prime number? True Suppose -3h + 1147 = -2c + c, 0 = -5h - 3c + 1907. Suppose -h = 2z - 4z. Is z composite? False Let z = 752 - 445. Is z composite? False Let o be (3 - 3) + 2 - 4. Let q = o - -473. Is q a composite number? True Let j be 6147/(-6)(-2)/3. Suppose 5n - v - 692 = 0, -5n - 4v = -j - 24. Is n prime? True Let a(u) = -34u - 3. Is a(-10) prime? True Let n(u) = 36u - 5. Let f be (-3)/(-12) - (-46)/8. Is n(f) prime? True Let u = 1193 - -1944. Is u composite? False Let f = -39 - -124. Is f composite? True Suppose 39164 = 22h - 18h. Is h composite? False Is 981/21 + 2/7 prime? True Let u(a) = a + 1. Let w(l) be the first derivative of -5l4/4 + l3 - l2/2 - 3l + 2. Let n(y) = 4u(y) + w(y). Is n(-2) a composite number? False Let u(n) = 3n*2 + 8n - 2. Let i(f) = -10f2 - 25f + 6. Let y = 3 - 1. Let d(x) = yi(x) + 7u(x). Is d(-9) prime? False Let n(z) = -3z3 - 7z*2 - 4z + 4. Let d be n(-4). Let x = 148 - d. Suppose 5a - 2v - x = 0, 0 = -2a - 4v + 15 + 9. Is a prime? False Suppose 6h + 2335 = 7h. Is h composite? True Let h(j) = 5 - 4j - 3j - 4j - 2. Is h(-8) a composite number? True Let x(q) = 2q*2 + 2q + 491. Is x(0) prime? True Let s(f) = f + 1. Let b(z) = 7z + 15. Let a(q) = -b(q) + 5s(q). Let u be a(-7). Suppose d = 3n - 115, un = -0d + 2d + 156. Is n composite? False Let n(y) = -4y3 + y2 + 6y + 14. Is n(-5) prime? True Let w(m) = 3m - 17. Let q be w(7). Suppose -ql = 4a - 1572, -l + a = l - 798. Is l composite? False Let d = 7 - 6. Let h be d/(((-2)/(-118))/(-1)). Let f = h + 82. Is f composite? False Let m(a) = -10a*3 + 7a*2 + 13a - 7. Is m(-6) prime? False Let s be (-9)/(2 + 1) + 305. Let t = -175 + s. Is t a prime number? True Let o = 1469 - 966. Is o composite? False Let j(r) = r + 13r2 - 3r + 8r - 5 + 3r. Is j(4) composite? False Let u(i) be the second derivative of -i3 - i2/2 + 4i. Is u(-8) a prime number? True Let j be (2 - (2 - 1)) + -2. Is (-1 + 0)/j - -126 a composite number? False Let f = 72 - -17. Let c(l) = 2l3 + l2. Let o be c(1). Suppose 0b - f = -oz + 2b, -2z + 3b + 56 = 0. Is z a prime number? True Let o(t) = 7t*3 - 7t*2 + 31. Let r(x) = -3x*3 + 4x*2 - 15. Let b(g) = 4o(g) + 9r(g). Is b(-7) a prime number? False Let h = -6 - -11. Let b = h + 0. Suppose 0 = n - bc - 141, -530 = -5n + n + 3c. Is n composite? False Is (-1046)/(-8) - 11/(-44) prime? True Let a = -62 + 122. Let c = -41 + a. Is c composite? False Let g be (-11)/(-4) - 1/(-4). Suppose -2s - 10 = gs. Is s + (0 - 0) - -8 a prime number? False Let h(y) = -4 - y*2 + 5y*2 + 7y - 2y. Is h(-7) a prime number? True Let o = -89 + 32. Let f = o - -96. Suppose -2h + f - 10 = q, -3q = h - 62. Is q prime? True Let u(x) be the second derivative of x4/12 + x3/6 + 4x*2 - x. Is u(-6) a composite number? True Let m = 0 + 0. Suppose 0 = -3k - 3x + 612, 2k + mx - 5x = 401. Is k prime? False Suppose 262 = 2g - 4q, 842 = 5g - 3q + 208	{ "pile_set_name": "DM Mathematics" }
1 -0.31165401 Work out 4912197 + 3. 4912200 3185 - -24582 27767 Sum 1 and 56487.92. 56488.92 Add 136481 and 130929. 267410 0.23932258 + -5 -4.76067742 Total of -0.06916747 and 94. 93.93083253 7087.6+-0.009 7087.591 What is the distance between 2.91 and -8959.9934? 8962.9034 Add together -0.18 and 83663766. 83663765.82 What is -0.2945975 minus 1913? -1913.2945975 What is -147519 take away -138? -147381 Sum 4.4308 and -0.33837. 4.09243 0.4 + 8677.16055 8677.56055 What is -19914225036 plus 0.1? -19914225035.9 Work out -501.7 - -600.67. 98.97 What is 21.672 less than 0.067? -21.605 What is -0.2 + 2166140.6? 2166140.4 What is -253442720 minus 49? -253442769 What is -190.886 minus -0.0486? -190.8374 What is -1366304 - 15? -1366319 Add together 4.6 and -19853353. -19853348.4 Put together -332028967 and -3. -332028970 Calculate -0.112658257 - -0.01. -0.102658257 Work out 45 + -665240414. -665240369 What is the difference between -5151117 and -22? 5151095 Work out -1665648.91 - -15. -1665633.91 What is the difference between 46.7223 and -12.06? 58.7823 What is 31909 - -43.49? 31952.49 What is -289783 - -1.1? -289781.9 What is -345.1 plus -16356? -16701.1 Work out -17.2647 + -141. -158.2647 Add together -3 and -0.1650269025. -3.1650269025 What is the difference between -42 and 61818? 61860 Calculate -137 - -350288.33. 350151.33 0.237 - 3012798 -3012797.763 What is the distance between -553317.1 and 78? 553395.1 Sum -121.35 and -0.04787. -121.39787 Calculate 4533 + 477376. 481909 What is 17991 + 1076? 19067 What is -42352 plus 6.69? -42345.31 Calculate -5997.22088 - -0.5. -5996.72088 Work out -120703 + 12080.3. -108622.7 Total of -514.8 and 4353332. 4352817.2 Total of -1107 and 51866. 50759 What is -1321.3123 less than -12? 1309.3123 What is -0.05 take away 1430.0445074? -1430.0945074 What is -24358148 less than -20.8? 24358127.2 What is 255.3 - 22971.5? -22716.2 What is -2228534 plus 1376? -2227158 What is the difference between -422891497 and 3? 422891500 Work out -11 - 2005703984. -2005703995 What is 256.78269 minus 7? 249.78269 Add together 7645986 and 4279. 7650265 What is 6.0281 + 0.12207? 6.15017 What is -381 minus 104.21947? -485.21947 What is the difference between -199856.08147 and 0.06? 199856.14147 Total of -2396 and -472060. -474456 Total of -848868 and 26. -848842 What is 16590564 less than -5? -16590569 1.12+-0.0296821 1.0903179 Put together -1 and 46552971. 46552970 -74301.4 + 1.43 -74299.97 Calculate 3.548 + -30.55. -27.002 Subtract -1952.51 from 11357. 13309.51 0.3 - -68725.23 68725.53 Add -2 and 5795.045. 5793.045 -39493.365 - 16 -39509.365 11743990 - -1 11743991 What is the difference between 146 and -13309700? 13309846 Work out 1 - 8542.931. -8541.931 Work out -424 - -1.09091. -422.90909 Sum -0.71 and -704523262. -704523262.71 Calculate -1.619155 - 142.7. -144.319155 -77 - 7705409 -7705486 16.57445 - -193.7 210.27445 Put together -0.3 and 1841437. 1841436.7 What is the difference between 20440604 and -0.4? 20440604.4 873.289 - -5 878.289 Work out -0.75757 - 913. -913.75757 What is 2287 + 1040479? 1042766 Work out 18113.87 - 367. 17746.87 Put together -68272330723 and -2. -68272330725 Work out -1090524400 + 0.5. -1090524399.5 What is -21 plus 696.3107? 675.3107 Work out 0.387912 + 3. 3.387912 Calculate 0.0915 - 0.4781282. -0.3866282 Calculate 661 - -0.084788. 661.084788 Put together -478 and 31893. 31415 Calculate -4 - -0.0021044366. -3.9978955634 What is -4 minus 2143963? -2143967 Total of 0 and 136.17065. 136.17065 What is 479215 take away 48.5? 479166.5 Subtract -0.01539722 from -2.4. -2.38460278 Calculate -0.4 - 17533405. -17533405.4 Work out -51799809764 + -4. -51799809768 Put together 5 and 2013894905. 2013894910 Sum 2.38 and 2467.57. 2469.95 What is -0.02 minus -1114256393? 1114256392.98 22+0.073618815 22.073618815 Add together 10 and -118.8577. -108.8577 Add -1174 and 74326. 73152 409503336 - -11 409503347 What is -23890 - -16.2? -23873.8 What is -533.2 minus 0.14996? -533.34996 What is -1 + -376.7757216? -377.7757216 What is the distance between 0.3 and 1516.732? 1516.432 What is the difference between -397.7718 and -3215? 2817.2282 What is 0.3 minus 51.85323? -51.55323 Put together 18.2 and 1161181. 1161199.2 Put together 40562.65 and 2. 40564.65 Add together 11312 and -2231.49. 9080.51 Subtract 74 from -23575831. -23575905 What is the difference between -13.19402615 and 2? 15.19402615 What is the distance between -718.359 and -0.56? 717.799 Put together 151392.27 and 114.8. 151507.07 -91353 - -178 -91175 Put together 0.03 and -966117. -966116.97 1268 - -91.32 1359.32 Sum -188.357 and -30. -218.357 What is 65 - 95978035? -95977970 Add 0.009 and -913317985. -913317984.991 What is 0.3483 minus 0.11997? 0.22833 Sum -0.10600282 and 0.3. 0.19399718 Add -0.2 and -109086610. -109086610.2 Calculate -201946 - -2807. -199139 What is the distance between -6241301128 and 0.3? 6241301128.3 Sum -0.4 and -5501.92. -5502.32 What is the difference between 478041 and 922.7? 477118.3 What is 0.0727 take away 97? -96.9273 What is the distance between -39805 and 168586.8? 208391.8 What is the difference between -0.16 and -4.461184? 4.301184 Work out 5337.05 - 73.781. 5263.269 What is -622 - 3352657? -3353279 Total of 309.4423 and 4249. 4558.4423 What is 0.1 - -3702065566? 3702065566.1 Calculate -62376 - -23. -62353 Subtract -0.80808 from 0.12336. 0.93144 0.0068+410895 410895.0068 Calculate 25.9 - -0.02818. 25.92818 Add together 0.5 and -11.026575. -10.526575 Work out 0.5 - 6104651. -6104650.5 What is 3.5 + 4.34615? 7.84615 Add -726.91874 and 89. -637.91874 Total of -49.7 and -23430982. -23431031.7 Add together 0.0791546 and 0.67. 0.7491546 Put together 21739304 and 0.1. 21739304.1 0.0746685431 - 2 -1.9253314569 Add together -477 and -7905514. -7905991 Calculate -28815 - 406. -29221 What is 42030017 - -387? 42030404 What is 0.15 minus 2955527726? -2955527725.85 Put together 341.713429 and 3. 344.713429 Calculate 8675.1 + 484.185. 9159.285 Work out 109 - -116569907. 116570016 Total of -8793086 and -1.9. -8793087.9 What is -0.5 less than -2.648571? -2.148571 What is 233 take away 794.73? -561.73 Add 260878 and -0.33562. 260877.66438 What is the difference between -34.62 and 157.87? 192.49 What is -773443100 take away -0.4? -773443099.6 Add together 8209.13 and -0.1826. 8208.9474 -9 - 7449498 -7449507 What is -116.7121144 - 51? -167.7121144 Calculate -16.419 - 0.2216. -16.6406 What is the difference between -1.223 and 287.30709? 288.53009 What is -0.081058 + 4.7? 4.618942 Total of 11858041 and 76. 11858117 Work out -5 + 60288.48238. 60283.48238 Calculate 94346483 + 1. 94346484 Work out 17941138 + 0.98. 17941138.98 Calculate 0.2 - 0.12116482432. 0.07883517568 2 - 2636024.4442 -2636022.4442 Work out 46.8763044 - 28. 18.8763044 Total of -119.795 and 512. 392.205 Put together -3946943 and -1692. -3948635 Subtract 56312098.3 from -4. -56312102.3 What is -0.8 minus -120815726? 120815725.2 What is -5.4 less than -57569491? -57569485.6 Total of 1213951 and -0.4. 1213950.6 Add 90 and -607874. -607784 Work out 155 + -446692. -446537 What is -4 less than -222364069? -222364065 What is the distance between 1.2164 and -0.241531? 1.457931 What is 63 minus 15840542? -15840479 Total of -14242355.23 and -11. -14242366.23 What is 4 minus 141162967? -141162963 What is 9 less than -8756473806? -8756473815 Calculate 297 - -1.6897. 298.6897 -169352.78+-0.1 -169352.88 What is 0.59 - 21.395959? -20.805959 What is -24455 minus 0.1410726? -24455.1410726 What is -11720084 plus -0.1? -11720084.1 Total of -431612 and -27101. -458713 Calculate -0.4 - -69747875. 69747874.6 What is the difference between 14 and 2616625? 2616611 Add together -74.5 and -0.05005. -74.55005 Sum -1.4 and 468662. 468660.6 What is -4 + -4746877599? -4746877603 What is -0.51468 plus 72.461? 71.94632 What is -0.57 plus -68246.6? -68247.17 Calculate 10322.2 + 123. 10445.2 1004 - -136722 137726 Work out -2 - 105924395. -105924397 Work out 16 + 101.52632. 117.52632 Put together 45064.582 and -5. 45059.582 Add together 984 and -4.62. 979.38 Add -0.6 and 16109381. 16109380.4 Calculate 1.1170115 - 2727. -2725.8829885 What is 271931 take away 0.7463? 271930.2537 What is -0.27 + -0.05928984? -0.32928984 What	{ "pile_set_name": "DM Mathematics" }
. 1.0658 Product of 0.02 and -65.1. -1.302 2100.1 times 15 31501.5 -14-13.1957 184.7398 0.2 times 1371 274.2 -3 153.38 -460.14 -232 * -0.135 31.32 Product of 0.3 and 288377. 86513.1 Work out -1372 * -20. 27440 Product of -0.4 and -3.6369. 1.45476 What is 2 times -0.123484? -0.246968 4.1103.9 425.99 Calculate 1.15357. 65.721 -378 * 1534 -579852 -632218 times -5 3161090 Product of -0.1 and 52.45. -5.245 What is -1 times 2.03858? -2.03858 Product of 0.63 and 0.496. 0.31248 -8578-1 8578 0.03386-0.0326 -0.001103836 Calculate -1228360.2. -24567.2 0 -31432 0 Multiply 0.1 and 176161. 17616.1 Multiply 0.236222 and 0. 0 Work out 1.9 * -30.39. -57.741 Calculate 0.068120.68. 0.0463216 -0.05 -3043 152.15 What is 3.98925 times 0? 0 -5 * 7466 -37330 Calculate 0.0532630.19. 0.01011997 Calculate 21361.74. 7596.54 Work out -1362 * -0.4. 544.8 What is -6.3 times -1.16? 7.308 Multiply -6708 and 0.08. -536.64 Product of -85 and 0.717. -60.945 What is 0.23734 times 3? 0.71202 Calculate -1276-607. 774532 -47771.94 -36281.18 Work out 278 * 6.3. 1751.4 120 * 195 23400 11 * -84264 -926904 3215477 646431 Calculate -4-730. 2920 What is the product of 5148 and -24? -123552 Multiply -0.5 and 257366. -128683 What is the product of 0.0073 and 0.02? 0.000146 2 * -11841 -23682 Work out 2025 * 136. 275400 What is the product of -289 and -0.74? 213.86 Work out -506.8 * 283. -143424.4 Product of -0.5 and -28.76. 14.38 Product of -51.4 and -46. 2364.4 What is -11925 times 1.1? -13117.5 Product of 7 and 680.17. 4761.19 Work out 35.58 * -0.5. -17.79 Multiply 32 and -9. -288 Calculate 52.41115. 786.165 0.2871.13 174.226 Calculate -136521.5. -20478 -4.314 times 2 -8.628 -150.760.2 -30.152 1796.7 times 522 937877.4 Multiply -4.2 and -5663. 23784.6 Product of 2.322 and 5. 11.61 Calculate 0.3580.0838. 0.0300004 Product of 0.11 and -12150. -1336.5 Product of 0.043 and 31. 1.333 30.3 times -1.6 -48.48 What is 21 times 62732? 1317372 Calculate -23-40557. 932811 Calculate -0.318-117.3. 37.3014 Product of -12.716 and -0.5. 6.358 Product of -0.5 and 10705. -5352.5 -0.038 times 10.39 -0.39482 Calculate -32.2918-0.2. 6.45836 What is 11 times 3526.9? 38795.9 Product of 29556 and -0.04. -1182.24 584.8 times -333 -194738.4 34 * -5048 -171632 Multiply 0.04673 and 0.079. 0.00369167 What is the product of 153427 and -1? -153427 What is the product of 6 and -0.06858? -0.41148 -43.4 * 1.42 -61.628 Product of 0.4 and 168855. 67542 1132.4 * 1.05 1189.02 114-0.7114 -81.0996 Multiply -4 and 219099. -876396 15 -38 -570 What is -2.92 times -0.892? 2.60464 Calculate 66-20482. -1351812 Multiply 285 and -6.8. -1938 -35630 10 -356300 -0.84-0.46152 0.3876768 Calculate 0.31.29856. 0.389568 -2.532783 -1982.556 13.303 times 4 53.212 1.737516 896.292 What is 95926 times 0.28? 26859.28 20210.405 818.505 -254775 -109550 What is the product of -3 and 7163.5? -21490.5 Product of -51 and -3442. 175542 Calculate 40279.4. 31918.8 -3341 times -0.088 294.008 Work out 707965 -0.2. -141593 Calculate -694.87-0.06. 41.6922 What is the product of -4434 and -87? 385758 Multiply 7933 and 17. 134861 What is the product of -11188 and -5? 55940 Multiply -0.2 and -0.020773. 0.0041546 1.1-0.04891 -0.053801 1-0.016663 -0.016663 2 -1149 -2298 Work out -42311 * 9. -380799 -14443 times -38 548834 Product of -118578.5 and 0. 0 Calculate -2-0.22529. 0.45058 Work out -8091 -0.53. 4288.23 Multiply -0.1 and 366935. -36693.5 Work out 0.6276 * -0.8. -0.50208 What is the product of -3 and 3.4198? -10.2594 What is the product of 17.2 and 1090? 18748 Work out -0.5468 * 41. -22.4188 What is the product of 1 and 173.057? 173.057 0.35 * 9.38 3.283 -22656 times 5.5 -124608 Product of 0.0147 and -26. -0.3822 Product of 4 and -10212. -40848 Multiply -0.3 and -2861.34. 858.402 -0.045879 -39.555 -0.04 2.925 -0.117 0.21517-0.8 -0.172136 1189 times 571 678919 -152.5153 -23332.5 -4486542-4 17946168 What is 3.102 times 7? 21.714 Work out -91019 -26. 2366494 Multiply -0.034331 and 4. -0.137324 Product of -106.43 and -39. 4150.77 Calculate -4-22798. 91192 Product of -401 and -2.1. 842.1 36080-2 -72160 Multiply 533385 and 4. 2133540 922900.5 46145 What is -0.007846 times 0.2? -0.0015692 665.3615 3326.805 1335.18 10680.8 Calculate 40.64442. 2.57768 Product of -0.2 and -625.02. 125.004 -8-0.20797 1.66376 Product of 0.5096 and -3. -1.5288 What is 4 times -0.0085? -0.034 Product of 0.08 and -26892. -2151.36 0.2-11783.97 -2356.794 Product of -13075.9 and 0.07. -915.313 Calculate -5-67066. 335330 Multiply -15.4 and -967. 14891.8 Multiply -48.777 and -0.4. 19.5108 Multiply -6409 and -2. 12818 0.1 times 184 18.4 Product of 13 and 19.27. 250.51 What is 75203 times 3? 225609 Work out 5 9.388. 46.94 Work out -110611 * 4. -442444 Product of -309 and -33.2. 10258.8 0 * -275601 0 What is 0.0132 times -81.8? -1.07976 -2027.64 -8110.4 What is the product of 5 and -4.8289? -24.1445 Multiply -0.1 and 2448.2. -244.82 Calculate 55.86. 29.3 Product of -0.5 and -82028.1. 41014.05 What is -268395 times 5? -1341975 Work out -67 * 261. -17487 Product of 3 and 7.46113. 22.38339 What is the product of -0.155679 and -0.4? 0.0622716 Calculate -1-0.02611. 0.02611 2122129 244258 Work out 0.1 * -1368820. -136882 What is the product of 3 and 223087? 669261 What is the product of 5 and 0.036158? 0.18079 Calculate -0.16-74261. 11881.76 330188 times -2 -660376 0931064 0 Multiply -0.0941 and -857. 80.6437 0.965 * 162 156.33 -1 * 666797 -666797 What is the product of 4 and 149.83? 599.32 Multiply 5.2 and -3495.1. -18174.52 0.39314 * 166 65.26124 What is the product of 3 and 0.10607? 0.31821 What is the product of 4 and 70858? 283432 977-126 -123102 833.6 times -51 -42513.6 What is the product of -0.3 and -12945? 3883.5 -2 -415877 831754 Multiply 335 and -236. -79060 What is the product of 52920 and -48? -2540160 What is the product of -0.04 and -0.3335? 0.01334 59 times -0.096 -5.664 -3657.209 * -0.1 365.7209 What is the product of -3 and 59.07? -177.21 64917 times -1 -64917 Work out -102 * -0.081. 8.262 667093 468138 Work out 90698 10. 906980 14.23 times -0.089 -1.26647 71 * 14842 1053782 What is -5 times -0.088471? 0.442355 0.6024 times 2 1.2048 What is the product of -0.4 and -34337? 13734.8 1 * 0.13138 0.13138 -1288.61 -1288.6 What is 2230 times -4.68? -10436.4 0.08372-51 -4.26972 0.004120.25 0.00103 What is 640901 times -0.3? -192270.3 Multiply -580 and -0.295. 171.1 340636 121908 Work out 1.23 * -6.62. -8.1426 Work out 0.713 * -15. -10.695 Calculate -6.855070.4. -2.742028 1.37 times 0.613 0.83981 What is the product of -39 and -12.23? 476.97 943 times -8.6 -8109.8 What is -7.3 times -0.139? 1.0147 -24.1 0.56 -13.496 What is 23.76 times -1? -23.76 -3488-7 24416 0.236-1.99 -0.46964 Calculate -0.4-4573.2. 1829.28 Work out 0.18 17.77. 3.1986 4.909 * -1 -4.909 What is -0.0468 times -1.373? 0.0642564 0.2 times 293897 58779.4 Calculate -9078830.4. -363153.2 20 -93.4 -1868 Multiply 22.22512 and 0.3. 6.667536 Work out -6.1 * 1608. -9808.8 What is -31.968 times -0.07? 2.23776 Calculate 0.319.379. 5.8137 Work out -5733 28.2. -161670.6 805 times -0.3 -241.5 Calculate 435461.4. 234840.2 Product of -3.146 and -2. 6.292 Product of 301300 and -1. -301300 What is 5.8 times -4898? -28408.4 -0.5 0.27736 -0.13868 What is 0.0265 times -0.72? -0.01908 Work out -0.3 * -1735491. 520647.3 Product of -33 and 0.95. -31.35 Calculate 323-124. -40052 0-410.21 0 -0.2 * -195.3 39.06 What is -0.314 times -154? 48.356 Multiply 9 and 1292.2. 11629.8 Calculate 1.6-533229. -853166.4 Calculate 21-60.76. -1275.96 12-588.4 -7060.8 Work out -78283 0.3. -23484.9 Multiply 2.57 and 206. 529.42 Product of 261407 and 0.8. 209125.6 What is 48.86019 times -2? -97.72038 What is the product of -219 and -392? 85848 What is the product of 10401 and -0.083? -863.283 Work out -3 * -58874. 176622 Multiply 0.1025 and -79. -8.0975 Calculate 46995-1.6. -75192 What is -967 times 58? -56086 What is 10656 times 6? 63936 Calculate 711422. 100962 -17.44-0.031 0.54064 Multiply 0.01 and -17.9891. -0.179891 Multiply 2628 and -365. -959220 Product of 1 and -1521570. -1521570 What is 16 times 44.2? 707.2 Product of 4 and -29.755. -119.02 0.1361960.0	{ "pile_set_name": "DM Mathematics" }
9m = 10m - 2 for m. 2 Solve 8z = 23z - 60 for z. 4 Solve -24h + 27 - 51 = 0 for h. -1 Solve 14b - 29b = -90 for b. 6 Solve -47l + 18 = -50l for l. -6 Solve -1 - 8 = 3m for m. -3 Solve -15 = -128n + 125n for n. 5 Solve 0 = -11t - 2 - 20 for t. -2 Solve 24z + 24 = 12z for z. -2 Solve 88 - 44 = -11x for x. -4 Solve 20 = 8y - 3y for y. 4 Solve 18 + 10 = 7x for x. 4 Solve 12g = -14 - 10 for g. -2 Solve 66z - 32z - 136 = 0 for z. 4 Solve -28m - 32m + 180 = 0 for m. 3 Solve -40 = -24h + 14h for h. 4 Solve 7f = -132 + 111 for f. -3 Solve 17m - 44m = 108 for m. -4 Solve -34 = -10o - 14 for o. 2 Solve 5g - 4 - 1 = 0 for g. 1 Solve 126 = 79u - 61u for u. 7 Solve -534 = 7o - 96o for o. 6 Solve -6p + 21 = p for p. 3 Solve -8c = -17c for c. 0 Solve 0 = -3y - 6 + 9 for y. 1 Solve -10y = -17 + 47 for y. -3 Solve -6 = -3n - 0n for n. 2 Solve 0 = 222i - 188i + 136 for i. -4 Solve 12v + 15 = 3 for v. -1 Solve -14m = -8m - 12 for m. 2 Solve -7s + 12 = -3s for s. 3 Solve -7b - 5b + 2b = 0 for b. 0 Solve 267 - 3 = -44d for d. -6 Solve 25p - 35p = -10 for p. 1 Solve 3p = 11 + 4 for p. 5 Solve 7h + 41 - 6 = 0 for h. -5 Solve 3 = 2r - 7 for r. 5 Solve 0 = 5n + 3 - 3 for n. 0 Solve 79o - 66o = 78 for o. 6 Solve -13b - 3b + 16 = 0 for b. 1 Solve -18l - 105 = 3l for l. -5 Solve 40 = -42r + 208 for r. 4 Solve -2a + 57 = 17a for a. 3 Solve 56s = 206s - 1350 for s. 9 Solve 14s - 72 = 40 for s. 8 Solve 6c - 28c = -22 for c. 1 Solve -l + 23 = 20 for l. 3 Solve -2 = 2a + 4 for a. -3 Solve -98n = -66n - 160 for n. 5 Solve -90l = -86l for l. 0 Solve -2 + 4 = -2z for z. -1 Solve -16v = -12v for v. 0 Solve -268r + 261r + 49 = 0 for r. 7 Solve -2091z = -2089z - 16 for z. 8 Solve -4 = 5t - 14 for t. 2 Solve 4x - 32 = -20 for x. 3 Solve 9g = -114 + 168 for g. 6 Solve 160b - 28 = 174b for b. -2 Solve -16 - 40 = -14n for n. 4 Solve -15h + 2 = -16h for h. -2 Solve -s - 190 = -187 for s. -3 Solve -7k = -2 - 5 for k. 1 Solve 20i + 20 - 60 = 0 for i. 2 Solve 0 = -6u - 9u for u. 0 Solve 80 = 15f + f for f. 5 Solve 20 = 31p - 26p for p. 4 Solve 0 = -0m - 4m - 12 for m. -3 Solve 0 = -15q + 88 - 13 for q. 5 Solve 46p = -42p + 17p for p. 0 Solve -227o + 30 = -221o for o. 5 Solve 2n = 8n - n for n. 0 Solve 14d + 13 = -57 for d. -5 Solve -6 = 7w - 9w for w. 3 Solve -4o + 327 - 363 = 0 for o. -9 Solve -25n + 4 = -29n for n. -1 Solve -5j + 8j + 15 = 0 for j. -5 Solve -26 = -15o + 64 for o. 6 Solve 0 = 83n + 222 - 1135 for n. 11 Solve 166 - 242 = 38n for n. -2 Solve -18a = -155 + 11 for a. 8 Solve -7w = 28 + 14 for w. -6 Solve 26t + 68 = 9t for t. -4 Solve 0 = -68p + 76p + 16 for p. -2 Solve 3r = -2r + 10 for r. 2 Solve 0 = -5w - 0w - 10 for w. -2 Solve -6k - 12 = 24 for k. -6 Solve 371i - 11 = 372i for i. -11 Solve 3300a + 6 = 3301a for a. 6 Solve -5i - 6716 = -6726 for i. 2 Solve -16 = -4l - 12 for l. 1 Solve -33u + 13u + 80 = 0 for u. 4 Solve 0 = -370i + 379i + 90 for i. -10 Solve 15u = 22u - 21 for u. 3 Solve 14 = -12z - 10 for z. -2 Solve 16n + 20 = 6n for n. -2 Solve 0 = 65n - 12n - 371 for n. 7 Solve 3o + 88 = 97 for o. 3 Solve -s - 33 = -27 for s. -6 Solve 16v + 7v = 92 for v. 4 Solve -24q = -25q for q. 0 Solve 4z = -9 - 15 for z. -6 Solve -8 = -39v - 8 for v. 0 Solve 930 = 26j - 119j for j. -10 Solve -25j + 12 = -29j for j. -3 Solve 0 = -12d + 99 - 15 for d. 7 Solve 55 = 4q + 59 for q. -1 Solve s = -3s - 8 for s. -2 Solve 8 = 3p + 26 for p. -6 Solve -3 - 15 = 3f for f. -6 Solve 8h = -288 + 272 for h. -2 Solve -y - 11y - 5y = 0 for y. 0 Solve -1 = 2l - 5 for l. 2 Solve -103s + 308 = -59s for s. 7 Solve 0 = g - 49 + 53 for g. -4 Solve -85c + 52c - 198 = 0 for c. -6 Solve -16k - 34 = 14 for k. -3 Solve 62r = 61r - 4 for r. -4 Solve -34f + 4 = -35f for f. -4 Solve 7c - 24 = -31 for c. -1 Solve -17v + 13v = -28 for v. 7 Solve -433k = -430k + 12 for k. -4 Solve 2u - 15u = 39 for u. -3 Solve 467i - 462i = -30 for i. -6 Solve 293x = 297x - 4 for x. 1 Solve 1 = -5b - 4 for b. -1 Solve -651 = 13s - 742 for s. 7 Solve 0 = 16v - 11v - 25 for v. 5 Solve 2l = -l + 9 for l. 3 Solve -8q - 28 = -q for q. -4 Solve 0 = -17r - 202 + 219 for r. 1 Solve -24 = -2g - 12 for g. 6 Solve 2o - 7o = 15 for o. -3 Solve -10v = -11v + 3 for v. 3 Solve -13r + 9 = -16r for r. -3 Solve g = -2g + 18g for g. 0 Solve -1493 + 1472 = 3i for i. -7 Solve 106t = 124t - 90 for t. 5 Solve 8r - 16 = 4r for r. 4 Solve -2u + 66 - 52 = 0 for u. 7 Solve 7 = 3m + 13 for m. -2 Solve -61w = 57 + 4 for w. -1 Solve -5 = g - 10 for g. 5 Solve 10k + 171 = 161 for k. -1 Solve -38 = 10x - 8 for x. -3 Solve -16k + 7 = -9k for k. 1 Solve 12 = v + 15 for v. -3 Solve -5s = 72 - 57 for s. -3 Solve 2w = 906 - 918 for w. -6 Solve 0 = -u - 12u + 52 for u. 4 Solve -8v + 35 + 5 = 0 for v. 5 Solve 9k - 4 = 41 for k. 5 Solve j - 4j - 3j = 0 for j. 0 Solve -34l - 24 = -26l for l. -3 Solve 8v - 13 = 19 for v. 4 Solve y = -9y + 70 for y. 7 Solve 15 = -23r + 8r for r. -1 Solve 0 = -13j - 19j + 32 for j. 1 Solve 46j - 39j + 14 = 0 for j. -2 Solve -7 - 68 = -25c for c. 3 Solve -9f = -2f - 21 for f. 3 Solve -6q = -3 - 27 for q. 5 Solve 6q - 6 - 18 = 0 for q. 4 Solve -15i = 17i - 224 for i. 7 Solve 0 = 1038g - 1042g - 8 for g. -2 Solve 2 - 14 = -2w for w. 6 Solve -7n = -330 + 337 for n. -1 Solve -2h + 2 = -4 for h. 3 Solve 29 = 2u + 13 for u. 8 Solve -3g = -37 + 34 for g. 1 Solve -10d + 2 = 62 for d. -6 Solve 25z = -28 + 78 for z. 2 Solve 65 + 1 = 22g for g. 3 Solve -39z + 34z + 15 = 0 for z. 3 Solve -2a = -11 + 3 for a. 4 Solve -22a + 26a - 20 = 0 for a. 5 Solve 0 = 11l + 6 + 16 for l. -2 Solve 53l - 126 - 86 = 0 for l. 4 Solve 30w - 3 = 31w for w. -3 Solve 0 = 50n + 1 - 351 for n. 7 Solve 2l - 22 = -9l for l. 2 Solve 10 = -4l + 22 for l. 3 Solve 3c = 8c - 10 for c. 2 Solve 0l = -8l + 32 for l. 4 Solve 2v - 2v + 4v = 0 for v. 0 Solve 182g + 172 = 96g for g. -2 Solve -40g = 8g + 192 for g. -4 Solve 21w - 86 + 2 = 0 for w. 4 Solve 11w = 20w + 18 for w. -2 Solve 36 + 28 = -32i for i. -2 Solve 0 = -78p - 43 - 269 for p. -4 Solve 0 = -0a + 9a - 18 for a. 2 Solve -7a + 7 = -0a for a. 1 Solve 0 = -6r + 11r for r. 0 Solve 25t - 238 = -9t for t. 7 Solve 15t = -28 + 133 for t. 7 Solve 5q + 9 + 11 = 0 for q. -4 Solve -100j - 842 + 242 = 0 for j. -6 Solve 59h = 64h + 5 for h. -1 Solve 306 = -58v + 92v for v. 9 Solve 4779i - 8 = 4777i for i. 4 Solve 39t = -5t for t. 0 Solve -108 = 70p + 172 for p. -4 Solve 27b = 26b - 4 for b. -4 Solve -464a + 423a = -410 for a. 10 Solve 10u = 10 - 20 for u. -1 Solve -4o - 18 = -7o for o. 6 Solve 36 = 301x - 313x for x. -3 Solve w - 22 = -24 for w. -2 Solve 0 = 78l - 58 - 98 for l. 2 Solve 45o = 47o + 4 for o. -2 Solve 112 + 68 = 36c for c. 5 Solve 205 = 80u - 115 for u. 4 Solve 11p + 18 - 62 = 0 for p. 4 Solve 0 = 105f - 118f - 78 for f. -6 Solve -9878d = -9882d + 44 for d. 11 Solve 0 = 4p - 6 - 14 for p. 5 Solve 8 - 4 = -z for z. -4 Solve 152 = 18d + 98 for d. 3 Solve 25k - 79 = -179 for k. -4 Solve 13a + 7 = 6a for a. -1 Solve 4 = -3y + 22 for y. 6 Solve 92 = -7j - 39j for j. -2 Solve -46a = -51a - 15 for a. -3 Solve -13w = -14w - 10w for w. 0 Solve -36k - 8 + 116 = 0 for k. 3 Solve 34w - 671 = -27w for w. 11 Solve -3 = -21x + 123 for x. 6 Solve -19 = -j - 17 for j. 2 Solve 13i - 16i - 15 = 0 for i. -5 Solve -3d - 3 = -9 for d. 2 Solve 4p = -198 + 178 for p. -5 Solve 0 = 5263p - 5279p + 176 for p. 11 Solve 49c + 42 = 43c for c. -7 Solve 0 = 8y + 10y - 126 for y. 7 Solve 45x = 48x + 9 for x. -3 Solve 0 = 15j - 34j for j. 0 Solve 6 = 24h + 102 for h. -4 Solve -2p = -5p + 5p for p. 0 Solve 14 - 4 = 5g for g. 2 Solve 1056l + 8 = 1052l for l. -2 Solve -i + 13 = 8 for i. 5 Solve -38 = -p - 41 for p. -3 Solve 12w + 1 = 11w for w. -1 Solve 5l + 3 = -7 for l. -2 Solve 60 = 161j - 101 for j. 1 Solve 0 = -26z + 10z + 96 for z. 6 Solve 212z + 10 = 214z for z. 5 Solve 0 = -32a + 43a for a. 0 Solve 148b - 82 + 378 = 0 for b. -2 Solve 0 = -296l + 315l - 19 for l. 1 Solve -1 = -12*d - 37 for	{ "pile_set_name": "DM Mathematics" }
128.3 - 128. Which is the third biggest value? (a) p (b) 2/3 (c) -7 c Let h be (-5)/3 + ((-6)/14 - (-46)/42). Let j = 2913/11 + -265. Which is the fourth biggest value? (a) -2/15 (b) h (c) 0.4 (d) j b Let k = -129 + 122. What is the third smallest value in -5, k, 1/8? 1/8 Let h = -3/185 - -191/370. What is the smallest value in h, 3/40, 0.4? 3/40 Let o = 5/723 + 57/3374. Which is the third biggest value? (a) -0.5 (b) o (c) -1.6 c Let y(x) = x + 13. Let d be y(-11). Let s be (3/5)/(0 - 3/d). Which is the second biggest value? (a) -9 (b) 2/15 (c) s c Let j = -3936.02 - -3904. Let n = -5.12 - j. Let o = 27 - n. Which is the third biggest value? (a) -2/15 (b) o (c) 1/3 a Let j = 18 + -16. Which is the second smallest value? (a) 0.5 (b) -2 (c) -1 (d) j c Let n = 8.6 + -8.3. Let l = 11 - 89/8. What is the fourth smallest value in l, 6, n, -3? 6 Let o = -523 - -522.5. Which is the third biggest value? (a) -1 (b) -5 (c) o (d) 0.161 a Let f(s) = -s + 8. Let w be f(7). What is the third smallest value in -6/31, w, 2/7? w Let w = -0.25 - 0.06. Let x = w - 0.09. Which is the third biggest value? (a) -4 (b) 0.2 (c) x a Let n = 75 + -75. What is the fourth biggest value in n, 1/8, 2/13, 0.3? n Let z = -175 + 6127/35. What is the third biggest value in -2/3, 2/13, z, -1/6? -1/6 Let z = 31.78 - 0.78. Let r = -31 + z. What is the third biggest value in -1/5, r, 0.1? -1/5 Let s = 0.81 + -0.01. Let i = -2.1 - -3.1. Let d = i - s. What is the second smallest value in 0.4, 2, d? 0.4 Let t(r) = -2r3 - 16r*2 - r - 3. Let k be t(-8). Which is the second smallest value? (a) -1/2 (b) 1/3 (c) k (d) -1.1 a Let u = 7/68 + 87/476. What is the second smallest value in u, 7, 0.4? 0.4 Let o = 513 + -507. Let r = -314/11 - -28. Which is the third biggest value? (a) r (b) o (c) -4 (d) -5/2 d Let l be 3 + 48/(-27) - 1. Let p = 1.6 - 1.9. Suppose 0 = 4t - 16, -5o + 7t - 51 = 3t. What is the second smallest value in l, o, p? p Suppose -107v = -106v - 3. Which is the third biggest value? (a) -0.14 (b) 5 (c) v a Let x be (1 - 4)/(-3 + 72/(-16)). Which is the third biggest value? (a) 2 (b) -3 (c) x (d) -4/3 d Let d = 0.3 + -1.3. Let y = -0.04404 - -5.04404. Let a be -3 + (-2 - 18/(-8)). What is the third smallest value in d, y, a? y Let y = -6523 - -45569/7. Which is the smallest value? (a) y (b) -0.3 (c) -2/5 a Let m = -6713 - -6709. Let y be ((-2)/5)/((-1)/(-5)). Which is the fourth biggest value? (a) y (b) m (c) 1/2 (d) 5 b Let w = -1.7 + 1.8. Let d = -10 + 15. Which is the third biggest value? (a) d (b) w (c) -1/9 c Suppose -4 + 11 = -5t + g, -5t = g - 7. Let s be 10/(-15) - 1/(-3). What is the third biggest value in s, 1, t? s Let r = -2.2 + 0.38. Let g = 0.18 - r. Let n = 36 + -32. What is the third biggest value in -3, g, n? -3 Let l = 11.632 + 0.068. Let x = -11.9 - 0.1. Let v = x + l. What is the biggest value in -0.1, v, 2? 2 Let u = 22 - 24.2. Let s = -30.5 + 28.7. Let k = u + s. What is the smallest value in k, 2/19, 1? k Let u = 51 + -50.96. What is the second biggest value in u, -5, 0.05? u Let z = -75 - -75.3. Which is the smallest value? (a) -12 (b) -2/9 (c) z a Let o = -210 + 210. What is the second biggest value in -0.3, o, 1/5? o Suppose -5r = -13 - 7. Let i = -334 - -198. Let m = 135.5 + i. What is the third smallest value in r, 0, m? r Let i = 8 - 19.6. Let j = 2.4 - i. Let o = j - 12. What is the smallest value in o, 3/2, -6? -6 Let u = 0.475 - 0.775. Which is the second smallest value? (a) u (b) 18 (c) -3 (d) 0.5 a Let g = 281.1 - 320. Let k = g + 39. Which is the third smallest value? (a) k (b) 5 (c) 5/2 b Let r = 5 - 3. Let j be ((-2)/(-10))/(-1 + r). Let o be 5/(-1) + (-63)/(-12). What is the biggest value in j, o, -2/5? o Let x be 5((-501)/165 + 3). Let a = -138 + 135. What is the third biggest value in a, 1/5, x? a Let f = 0.4 - 0. Let q = -0.0959 - -4.0959. What is the third smallest value in f, 0.1, q, 3/5? 3/5 Let s be (1((-51)/(-12) - 4))/(-1). Let g = -11 + 8. What is the second smallest value in s, g, 4? s Let p = -59.3 + 64.3. What is the smallest value in 3, p, -447, -1? -447 Let t = -26 + 24. Let n be t/6 + 20/24. What is the smallest value in n, 7, 0.4? 0.4 Suppose 0m + 5x + 17 = -4m, m = -x - 3. What is the fourth biggest value in -1, 1, m, 0? -1 Let v be (8/6 + -1)(-81)/(-45). Which is the second biggest value? (a) 2 (b) 0.04 (c) v (d) -0.4 c Let p = -6777.5 + 6778. Let z = -334/5 + 67. Which is the third biggest value? (a) 5 (b) 4 (c) p (d) z c Let w = -346 + 4497/13. Let r = -40.6 + 41. Which is the smallest value? (a) -1/8 (b) 1 (c) r (d) w a Let q = 209/120 - 15/8. Let m = 3 - 3. Which is the smallest value? (a) -1/5 (b) m (c) q a Let x = -249/4 + 62. Let g = 124 + -119. Which is the second smallest value? (a) x (b) 1 (c) g (d) -0.4 a Let c be (1 - -1)/((-27)/((-459)/136)). Let v = 944/1085 + -2/155. What is the third smallest value in v, 0.4, c? v Let l = 1/20 + -1/4. Let u = -5 + 5. Let q = u - 1/14. Which is the third biggest value? (a) -1 (b) q (c) l a Let y = -908 + 905. What is the fourth biggest value in y, -2/7, -4, 22? -4 Let j = 0.2329 - 0.2329. Let k(d) = d*2 + 2d - 1. Let n be k(-3). Let m be (4/8)/(n/(-8)). Which is the smallest value? (a) j (b) 1/11 (c) m c Suppose 0 = 5r + v + 4, -3r = -r - 2v + 4. Which is the third smallest value? (a) 83 (b) -1/5 (c) r a Let i = -44.7 - -45. Let d = -29.4 - -33. Let n = d - 4.1. Which is the second biggest value? (a) n (b) -3/7 (c) i b Let w = 201/394 + -2/197. What is the biggest value in -0.2, 0.2, 0.3, w? w Let j = 1/468 + -941/2340. Which is the second smallest value? (a) -2/11 (b) -1/3 (c) -23 (d) j d Let s(u) = -2u*2 + 3u - 2. Let l = 9 - 7. Let m be s(l). Let q(b) = 3b + 13. Let j be q(m). What is the second biggest value in j, 2, 3? 2 Let n = -13 + 8. Let g = n + 4.7. Suppose 23j + 45 = 32j. Which is the second biggest value? (a) -0.2 (b) g (c) j a Let s be 185/(-1332)(-4)/(-10). What is the fourth smallest value in 0.4, 1/9, 0.1, s? 0.4 Let o = 1099.87 + -1100. Suppose i + 0i + 13 = 3u, 3i - 5u + 23 = 0. Let z = i + 0. Which is the biggest value? (a) z (b) 0.3 (c) o b Suppose 27j = 3j - 11j. Which is the biggest value? (a) -7/4 (b) j (c) -1/6 b Let p = 147.7 + -147.8. What is the second smallest value in p, 4/41, 1/5? 4/41 Suppose 0 = -6p + 129 - 213. Which is the third smallest value? (a) p (b) 6/7 (c) 0.4 b Let p = -5 - 0. Let o = -147 + 5. Let i = o + 142.07. What is the third smallest value in -1/5, i, p? i Suppose 3i + y = 3y - 3, -2y - 6 = 0. Let c be 34i4/(-24). Let k be c/55 - 2/5. What is the biggest value in 3, k, -3? 3 Let s = -143/3 - -48. What is the biggest value in -5, s, -0.2? s Let j = 39 - 37. Let t = -7.3 - -5.3. Which is the fourth biggest value? (a) j (b) 4 (c) -0.4 (d) t d Let n(f) = 34f + 1848. Let j be n(-55). Suppose -2p + 5 = -7p. Which is the smallest value? (a) 0 (b) -1/4 (c) p (d) j d Suppose -5x - 11 = 4. Let t be (2 + x)14/4. Let s = 29/6 + t. Which is the biggest value? (a) 0.3 (b) 1/3 (c) s c Let o = 22.5 - 22.6. What is the fourth biggest value in -3, o, -5, -0.9? -5 Let p = 78 + -78.7. Let r = -34.3 - -32. Let m = r + p. Which is the biggest value? (a) 0.4 (b) -1/3 (c) m a Suppose -v + 3s = 4v - 18, 5v - 16 = s. Let p = -103.22 + 103. Which is the smallest value? (a) 1 (b) p (c) v b Let p = 20962/9 - 2332. Let a = -148/45 - p. What is the fourth smallest value in a, 0.1, 5, 2? 5 Let v = -7 - -3. Suppose -4 = 3q - 1. Let f be (q/(-3))/((-5)/(-50)-2). What is the third biggest value in 4, f, v? v Let d = -53/2 - -27. Let b be -35((-33)/(-18) + -2). Let r = b - 443/78. What is the biggest value in r, 5, d? 5 Let j = 1627 + -1622. What is the third smallest value in 154, j, 0.1, 2/17? j Let c = 522.92 - 523. Let n = 0.11 - 0.41. What is the second biggest value in 0, c, n? c Suppose -2b - m = 4m - 34, 5*b - m - 58 = 0. Let f = -99.73 + -0.07. Let w = 100 + f. What is the smallest value in b, -0.5, w? -0.5 Let p be (-3 - -6) + (-2 - -47). Let m = -53 + p. Which is the third biggest value? (a) 54 (b) -1/11 (c) m c Let n be 1/4 - (-1)/28. Let q = 75 - 76. Which is t	{ "pile_set_name": "DM Mathematics" }
2 - 2650n*2 + 430n*2. -13n*2 Collect the terms in -37w + 46w + 3w*2 - 33w*2 - 6 - 87w*3 + 2. -87w*3 - 30w*2 + 9w - 4 Collect the terms in 77600s - 25734s - 25738s - 26124s. 4s Collect the terms in -19o + 157 + 25548o2 - 2o - 25561o2 - 20o - 157. -13o2 - 41o Collect the terms in -222210s3 + 3 + 222222s*3 - 3 - 1 + 1. 12s*3 Collect the terms in -133 + 366 - 114 - 119 - 579s*3. -579s*3 Collect the terms in 10r + 241r3 - 243r*3 - 11r*2 - 8r - 4r + 2r. -2r3 - 11r*2 Collect the terms in -60u - 20 - 46u + 11 + 57u - 60u + 10. -109u + 1 Collect the terms in -26o - 146o + 28o - 3o + 18o. -129o Collect the terms in -872f2 - 940f*2 + 1602f*2. -210f*2 Collect the terms in 717 + 546635y - 546634y - 9106. y - 8389 Collect the terms in k + 9k*2 + 2k + 6k3 + 121 + 125 - 2k*3. 4k*3 + 9k*2 + 3k + 246 Collect the terms in 25v3 - 103v3 - 112 + v2 - 261v3. -339v3 + v2 - 112 Collect the terms in -963493 + 963493 + 162o2 - 161o2. o2 Collect the terms in 2108b - 700b - 720b - 695b. -7b Collect the terms in 3c - 3c - 150995c*3 - 34c*2 + 34c*2. -150995c*3 Collect the terms in -1159n + 530 + 18619n - 530 + 1923n. 19383n Collect the terms in -346r*2 + 21 - 40 + 57r*2 + 6r*3 + 20. 6r*3 - 289r*2 + 1 Collect the terms in 12662a - 24776a + 13002a. 888a Collect the terms in 420r*2 - 3170r*2 - 4712r*2. -7462r*2 Collect the terms in 60354220j + 2321j2 - 60354220j. 2321j2 Collect the terms in 54b + 40b - 16b - 522b. -444b Collect the terms in 57f2 + 43 + 16f*2 - 67f*2. 6f*2 + 43 Collect the terms in -536o + 1349o - 3063o - 2200o. -4450o Collect the terms in -6 - 1004y3 + 1779y*3 + 1844y*2 - 1844y*2 + 6. 775y*3 Collect the terms in -57 - 6 - 4j + 11j + 5 + 19. 7j - 39 Collect the terms in -169 + 392 - 109 + 6l2 - 115. 6l*2 - 1 Collect the terms in -2p*2 + 59p3 + 2965 - 2965 - p2 + 3p2. 59p*3 Collect the terms in 2z*3 - 6z*3 - 71002z*2 + 7178z2 + z3. -3z3 - 63824z*2 Collect the terms in 161n*2 - 1206570n + 1206570n. 161n*2 Collect the terms in 179q*2 - 630q*2 + 175q*2 + 117q*2 + 163q*2. 4q*2 Collect the terms in -40l + 10l + 112 + 7l + l - 112 + 24l. 2l Collect the terms in -3 - 16859y2 + 3 + 19651y*2. 2792y*2 Collect the terms in 6n + 28 + 35 + 8n + 52 + 40 - 139. 14n + 16 Collect the terms in 6047412932a3 + 0 + 3 - 6047412928a*3. 4a*3 + 3 Collect the terms in -2050 + 8743 - 3344 + 16s - 3349 - 16s - 2s*3. -2s*3 Collect the terms in 3800t*3 - 12677t*3 + 4437t*3 + 4419t*3. -21t*3 Collect the terms in -1162016831u*2 - 1162016813u*2 + 3u*3 + 2324033644u*2. 3u*3 Collect the terms in 244027 - 1189v - 244027 + 4v. -1185v Collect the terms in 102 + 124j - 102 - 135j - 138j. -149j Collect the terms in -2l2 + 13l*3 - 15l*3 + 0 - 2802l - 1 + 3 - 12661l. -2l*3 - 2l*2 - 15463l + 2 Collect the terms in -2 - 39u2 + 243u2 - 6 - 2 + 0 + u3. u*3 + 204u*2 - 10 Collect the terms in 367756s + 367754s + 367752s + 367750s - 1838774s + 367760s. -2s Collect the terms in 2117t2 + 2112t*2 - 6307t*2 + 2106t*2. 28t*2 Collect the terms in 4268g*2 + 13158g*2 + 15496g*2 - 2238g*2. 30684g*2 Collect the terms in -78 + 78 + 5266r*2 - 1767r*2. 3499r*2 Collect the terms in -27286q - 6695q - 4061q. -38042q Collect the terms in 42311 + 2912225z*3 - 42311 - 2912224z3. z3 Collect the terms in 10 - 9 + 17r + 5 + 21 + 13. 17r + 40 Collect the terms in -3113u - 5114u*2 + 3113u + 2. -5114u2 + 2 Collect the terms in -1080t - 1 - 415t + 2177t + 4t2. 4t*2 + 682t - 1 Collect the terms in 139b2 + 874b*2 - 363b*2 + 487b*2 + 1346b*2. 2483b*2 Collect the terms in -17374n + 39n - 13580n - 397n. -31312n Collect the terms in -362z2 - 358z*2 - 357z*2 + 386z*2 - 350z*2 + 1050z*2. 9z*2 Collect the terms in -1472o + 1381o + 77o. -14o Collect the terms in -1835k*3 - 813k*3 - 18 + 18. -2648k*3 Collect the terms in -3d*2 + 3d*2 - 82872d*3 - 35568d*3. -118440d*3 Collect the terms in -2851848r - 1940739r + 937845r. -3854742r Collect the terms in 2476s*3 + 100s*3 - 2578s*3. -2s*3 Collect the terms in -214148n*2 + 106966n*2 - 3 + 107181n2. -n2 - 3 Collect the terms in -49 + 21 - 86 - 13y - 70. -13y - 184 Collect the terms in -586b - 1117b - 2 - 1696b. -3399b - 2 Collect the terms in 1560t + 654366 + 654364 - 1308730. 1560t Collect the terms in 151948c - 3 - 303876c + 3 + 151925c + 1 - 1. -3c Collect the terms in 663917y - 331959y - 7y2 + y2 - 331958y + 5y2. -y2 Collect the terms in 0x*3 - 4828x - 3x3 + 2 + 6x*3 + 529x. 3x3 - 4299x + 2 Collect the terms in -55k3 + 27k + 30k3 + 26k - 12k3. -37k*3 + 53k Collect the terms in -7985n - 8134n + 24225n - 7985n. 121n Collect the terms in -1 - 82441123a*3 + 2 - 1. -82441123a*3 Collect the terms in -29100z + 28522z + 21004z + 35161z. 55587z Collect the terms in 547d + 496d - 1586d + 506d. -37d Collect the terms in 69340t*3 - 137530t*3 + 68189t*3 + 48t2. -t3 + 48t2 Collect the terms in -31u - 3 + 6u - 6 + 87 - 76 + 0. -25u + 2 Collect the terms in 1238 - 1238 - 48z - 19z. -67z Collect the terms in 9p - 10p - 5 + 4 + 218837p*2. 218837p*2 - p - 1 Collect the terms in 27y*2 - 41y*2 + 23624311 - 23624311 + 23y*2. 9y*2 Collect the terms in -4 - x - 12 - 14 + 2 - 7. -x - 35 Collect the terms in -36 + 100 - 29 - 563k - 35 - 606k + 1161k. -8k Collect the terms in 27k*2 - 105857k + 317766k - 7k*2 - 105954k - 105955k. 20k*2 Collect the terms in 1854z + 1857z - 5907z + 2202z. 6z Collect the terms in -166s3 - 207s + 84s + 39s + 84s. -166s*3 Collect the terms in -94 + 249 - 397g*3 - 101 - 54 + 401g*3. 4g*3 Collect the terms in 1172445p + 1170343p - 2342778p. 10p Collect the terms in -8g - 86 - 8g - 4g + 48 + 24g. 4g - 38 Collect the terms in -1111971 - 408n2 + 1111971. -408n2 Collect the terms in -j2 - 4009j3 - 122j + 4069j3 + j2 + 122j. 60j3 Collect the terms in 6 - 116 - 88m + 20 - 16 - 104. -88m - 210 Collect the terms in 34v3 + v3 + 10v3 + 3 - 27v - 8v3 + 12v*2 - 9v*2. 37v*3 + 3v*2 - 27v + 3 Collect the terms in 0q2 - 100q*3 + 6q*2 - 14 + 98q*3 - 4q*2 - 30. -2q*3 + 2q*2 - 44 Collect the terms in 8 + 107 - 29043w + 14523w + 14522w - 20. 2w + 95 Collect the terms in -221268r + 109091r + 109013r. -3164r Collect the terms in -5i + 13i - 2i - 6i - 2046131i*2. -2046131i*2 Collect the terms in -2522a*2 - 4 - 8324a*2 - 16181a*2. -27027a*2 - 4 Collect the terms in -3 - 4 + 12 - 3 + 132s*2 - 531s + 528s. 132s*2 - 3s + 2 Collect the terms in -2c2 - 500300 - 2c*3 + 500300 + 2c*2. -2c*3 Collect the terms in -33327m*2 - 33334m*2 - 33332m*2 + 166578m*2 - 33328m*2 - 33256m2. m2 Collect the terms in 13n2 - 4709n - 27n2 + 5n*2 + 533n + 8n2. -n2 - 4176n Collect the terms in -18z - 1854 + 26z - 55z + 1854. -47z Collect the terms in 165n2 - 24n*2 - 24n*2 - 94n*2 - 18n*2 - 26n*2. -21n*2 Collect the terms in 152860 + 104w - 103w - 156618. w - 3758 Collect the terms in -2 - 63z*2 + z + 1157z*2 - z + 486z*2. 1580z*2 - 2 Collect the terms in -28443h*2 - 25679h*2 + 2512h*2. -51610h*2 Collect the terms in 1044 + 1256 + 10f - 2301. 10f - 1 Collect the terms in 12x*2 + 10x*2 - 17x*3 + 23x*3 - 27x*2 + 11x*3. 17x*3 - 5x*2 Collect the terms in -973v*3 + 18928v*2 - 1500v*3 + 805v*3 - 18930v*2. -1668v*3 - 2v*2 Collect the terms in 225n*3 - 285n*3 + 61n*3 - 125n - 73n. n3 - 198n Collect the terms in 2h3 + 262070h + 262074h + 4h*3 - 524144h. 6h3 Collect the terms in 23i*2 - 3i + 3i - 21i*2 + 1 + 173i*2 - 86i*2. 89i*2 + 1 Collect the terms in -34x - 79376578 + 79376578. -34x Collect the terms in 9018g*2 + 487 - 986 - 3g + 497. 9018g2 - 3g - 2 Collect the terms in -128b + 490b - 124b + 22 - 123b -	{ "pile_set_name": "DM Mathematics" }
1, -4588? -847a - 353 What is the w'th term of 132883, 265759, 398635, 531511? 132876w + 7 What is the j'th term of 2055, 4138, 6221, 8304? 2083j - 28 What is the w'th term of -12801, -51247, -115319, -205011, -320317, -461231? w3 - 12819w*2 + 4w + 13 What is the z'th term of -1729, -1730, -1723, -1702, -1661, -1594, -1495? z*3 - 2z*2 - 2z - 1726 What is the o'th term of 967, 960, 955, 952, 951? o*2 - 10o + 976 What is the n'th term of -21211, -21203, -21195, -21187? 8n - 21219 What is the l'th term of 1026, 1078, 1152, 1254, 1390, 1566, 1788? l3 + 5l*2 + 30l + 990 What is the o'th term of -1451, -1655, -1991, -2453, -3035, -3731, -4535, -5441? o*3 - 72o*2 + 5o - 1385 What is the f'th term of -2193561, -2193559, -2193557, -2193555, -2193553? 2f - 2193563 What is the s'th term of 46, 105, 162, 199, 198, 141, 10? -3s*3 + 17s*2 + 29s + 3 What is the q'th term of 4519, 4478, 4437, 4396? -41q + 4560 What is the q'th term of -24961, -24908, -24759, -24466, -23981, -23256, -22243? 8q*3 - 3q - 24966 What is the i'th term of 3100, 6259, 9410, 12553? -4i2 + 3171i - 67 What is the s'th term of 10, -23, -108, -269, -530, -915? -4s3 - 2s2 + s + 15 What is the a'th term of 3861, 3820, 3793, 3786, 3805? a3 + a*2 - 51a + 3910 What is the j'th term of 38, 84, 154, 254, 390, 568, 794, 1074? j*3 + 6j*2 + 21j + 10 What is the k'th term of -45, -167, -449, -951, -1733? -10k3 - 20k*2 + 8k - 23 What is the r'th term of 250, 389, 534, 679, 818, 945, 1054, 1139? -r*3 + 9r*2 + 119r + 123 What is the t'th term of 1224, 4892, 10982, 19488, 30404? -t*3 + 1217t*2 + 24t - 16 What is the d'th term of -13, 11, 105, 305, 647, 1167, 1901? 6d3 - d2 - 15d - 3 What is the y'th term of -14266, -28525, -42780, -57031, -71278, -85521, -99760? 2y2 - 14265y - 3 What is the n'th term of -8572, -17133, -25712, -34309, -42924, -51557, -60208? -9n2 - 8534n - 29 What is the j'th term of -55, -158, -355, -694, -1223? -8j3 + j2 - 50j + 2 What is the s'th term of -1521, -1588, -1653, -1716, -1777, -1836, -1893? s*2 - 70s - 1452 What is the a'th term of -549, -833, -1117, -1401, -1685? -284a - 265 What is the r'th term of -26202, -26177, -26152, -26127, -26102? 25r - 26227 What is the o'th term of 1597, 6684, 15141, 26962, 42141, 60672, 82549, 107766? -o*3 + 1691o*2 + 21o - 114 What is the t'th term of -395, -758, -1095, -1400, -1667, -1890? t*3 + 7t*2 - 391t - 12 What is the b'th term of -87, -102, -113, -120, -123, -122? 2b2 - 21b - 68 What is the b'th term of 591, 1181, 1775, 2379, 2999, 3641, 4311? b*3 - 4b*2 + 595b - 1 What is the g'th term of -206, -804, -1818, -3260, -5142? -2g3 - 196g*2 + 4g - 12 What is the v'th term of 3162, 3144, 3092, 2988, 2814, 2552? -3v3 + v2 + 3164 What is the v'th term of -1773, -1803, -1853, -1923, -2013, -2123, -2253? -10v*2 - 1763 What is the l'th term of -3643235, -3643234, -3643233? l - 3643236 What is the c'th term of -119, -247, -379, -515, -655, -799, -947? -2c*2 - 122c + 5 What is the g'th term of -227, -203, -179? 24g - 251 What is the f'th term of -92954, -92957, -92960, -92963, -92966? -3f - 92951 What is the o'th term of -89, -368, -867, -1610, -2621? -4o3 - 86o*2 + 7o - 6 What is the c'th term of 191, 396, 601, 806, 1011, 1216? 205c - 14 What is the s'th term of -565, -588, -647, -760, -945, -1220? -3s*3 - 2s - 560 What is the j'th term of -259, -524, -785, -1036, -1271? j*3 - 4j*2 - 260j + 4 What is the r'th term of 9739, 9741, 9743, 9745, 9747? 2r + 9737 What is the n'th term of 72, -161, -558, -1125, -1868? -n3 - 76n*2 + 2n + 147 What is the l'th term of -124, -499, -1130, -2023, -3184, -4619, -6334? -l*3 - 122l*2 - 2l + 1 What is the h'th term of -57475, -114956, -172439, -229924? -h*2 - 57478h + 4 What is the t'th term of -1773, -1768, -1759, -1746? 2t2 - t - 1774 What is the z'th term of 54, 94, 120, 126, 106, 54? -z3 - z2 + 50z + 6 What is the h'th term of -3846, -3818, -3790, -3762? 28h - 3874 What is the q'th term of -1098, -1077, -1032, -957, -846, -693? q3 + 6q*2 - 4q - 1101 What is the t'th term of 1177, 2375, 3573, 4771? 1198t - 21 What is the c'th term of -83142, -332555, -748244, -1330209, -2078450? -83138c2 + c - 5 What is the m'th term of -1486313, -1486314, -1486315, -1486316, -1486317? -m - 1486312 What is the d'th term of -911162, -1822320, -2733476, -3644630, -4555782? d2 - 911161d - 2 What is the b'th term of -199, -448, -753, -1114, -1531? -28b*2 - 165b - 6 What is the w'th term of -27069, -53972, -80875, -107778, -134681, -161584? -26903w - 166 What is the g'th term of 724, 986, 1434, 2074, 2912, 3954, 5206, 6674? g3 + 87g*2 - 6g + 642 What is the m'th term of 459717, 919433, 1379149, 1838865, 2298581? 459716m + 1 What is the p'th term of -7435, -7297, -7161, -7027, -6895, -6765, -6637? -p2 + 141p - 7575 What is the w'th term of 47765, 47765, 47773, 47795, 47837? w*3 - 2w*2 - w + 47767 What is the x'th term of -1217, -1339, -1461, -1583, -1705? -122x - 1095 What is the u'th term of 197, 1452, 4829, 11390, 22197, 38312? 177u3 - u2 + 19u + 2 What is the u'th term of -6056, -6122, -6188? -66u - 5990 What is the k'th term of -200, -128, -56? 72k - 272 What is the w'th term of 184, 177, 170, 163? -7w + 191 What is the i'th term of 11034, 11068, 11102? 34i + 11000 What is the t'th term of 44044, 88094, 132144? 44050t - 6 What is the n'th term of -373, -752, -1127, -1498? 2n*2 - 385n + 10 What is the l'th term of -628191, -1256387, -1884583? -628196l + 5 What is the k'th term of 55310, 55311, 55312, 55313, 55314, 55315? k + 55309 What is the f'th term of -259262, -518532, -777806, -1037084, -1296366, -1555652? -2f*2 - 259264f + 4 What is the n'th term of -297, -430, -561, -690? n*2 - 136n - 162 What is the k'th term of -651519, -651518, -651517, -651516? k - 651520 What is the t'th term of 368408, 736817, 1105226? 368409t - 1 What is the p'th term of -27541, -27538, -27535, -27532, -27529, -27526? 3p - 27544 What is the r'th term of 1513, 1473, 1433, 1393, 1353, 1313? -40r + 1553 What is the b'th term of -1156, -4623, -10402, -18493, -28896, -41611, -56638? -1156b*2 + b - 1 What is the j'th term of -148468, -148450, -148420, -148378, -148324, -148258? 6j2 - 148474 What is the x'th term of 3751, 3730, 3707, 3688, 3679? x3 - 7x2 - 7x + 3764 What is the q'th term of 15165, 15163, 15159, 15153, 15145, 15135, 15123? -q*2 + q + 15165 What is the q'th term of -50, 383, 1160, 2281, 3746? 172q*2 - 83q - 139 What is the t'th term of 30158, 60322, 90486? 30164t - 6 What is the l'th term of -1683, -3188, -4619, -5940, -7115, -8108, -8883, -9404? 6l3 + l2 - 1550l - 140 What is the m'th term of 57, 52, 29, -24, -119, -268, -483? -2m*3 + 3m*2 + 56 What is the u'th term of -6945, -6827, -6733, -6675, -6665, -6715? -2u*3 + 132u - 7075 What is the u'th term of -616, -1253, -1952, -2743, -3656, -4721? -5u3 - u2 - 599u - 11 What is the v'th term of 75, 135, 223, 357, 555, 835, 1215? 3v3 - 4v*2 + 51v + 25 What is the m'th term of -20625, -41250, -61875, -82500? -20625m What is the q'th term of 648816, 648822, 648830, 648840, 648852, 648866, 648882? q2 + 3q + 648812 What is the k'th term of -2940, -2936, -2932, -2928? 4k - 2944 What is the i'th term of 5021, 5024, 5031, 5042, 5057, 5076? 2i*2 - 3i + 5022 What is the g'th term of -514, -2350, -5410, -9694, -15202? -612g2 + 98 What is the m'th term of 1979, 2010, 2031, 2042, 2043, 2034? -5m*2 + 46m + 1938 What is the k'th term of -105647, -105644, -105627, -105590, -105527? k3 + k2 - 7k - 105642 What is the y'th term of -10062, -20122, -30184, -40248, -50314, -60382? -y2 - 10057y - 4 What is the l'th term of 4721, 9489, 14259, 19037, 23829, 28641? l*3 - 5l*2 + 4776l - 51 What is the p'th term of -251, -1070, -2451, -4388, -6875, -9906? p*3 - 287p*2 + 35p What is the n'th term of 6609, 6575, 6541? -34n + 6643 What is the z'th term of -5822, -11637, -17452, -23267, -29082? -5815z - 7 What is the r'th term of -987, -1883, -2779? -896r - 91 What is the s'th term of -642, -1137, -1634, -2133, -2634, -3137, -3642? -s*2 - 492	{ "pile_set_name": "DM Mathematics" }
ird derivative of 1/8v4 + 0v*3 + 0v + qv2 + 0. Calculate x(u(b)). -3b Let w(o) = 3o - 2o + 6o. Let v(a) = -6a + a + 10a - 2a. Give v(w(c)). 21c Let z(c) = 156c. Let i(d) = 5d. Determine i(z(u)). 780u Let f(l) = -7l. Let g(x) = 9x*2 - 7x + 7. Let h(t) = -5t2 + 4t - 4. Let y(v) = 4g(v) + 7h(v). Give y(f(o)). 49o2 Let p(k) = k2. Let v(o) = o2 + o. Let x(b) = 3b*2 + 2b. Suppose -3r = -0r - 6. Let h(s) = rv(s) - x(s). Calculate h(p(m)). -m4 Suppose 4j - 14 = -2. Let x be (20 + (j - 3))/2. Let v(n) = -2n + x - 10. Let l(r) = -r2. Determine l(v(z)). -4z*2 Let x(j) = -19j2. Let l(q) be the third derivative of -q4/12 + 13q2. Determine l(x(w)). 38w2 Let p(i) be the first derivative of -i3 + 2. Let u(o) be the second derivative of 0 + 0o2 + 2o - 1/3o3. What is p(u(q))? -12q*2 Let y(r) = 7r. Let k(v) = -11v2 + 11v - 11v + 2v*2. Give k(y(j)). -441j*2 Let d(s) = 13s*2. Let q(l) = -6l. Determine d(q(u)). 468u2 Let n(w) = w2. Let x(t) = 9t*2 + 1. Calculate x(n(c)). 9c4 + 1 Let c(t) = t. Let w(d) = d2 - 849d. Determine w(c(p)). p2 - 849p Let f(p) = 2p2 + 3p. Let d(m) = -6m2 - 10m. Let g(b) = 3d(b) + 10f(b). Let z(s) = -6s. What is z(g(j))? -12j*2 Let t(z) = 3z*2 + 2. Let v(q) = -57q*2 - 39. Let c(m) = -117t(m) - 6v(m). Let o(l) = -2l. Give c(o(r)). -36r2 Let z(s) = -2s*2. Let d(u) = -2u*2 + 33. What is z(d(b))? -8b*4 + 264b*2 - 2178 Let g(p) = -p. Let b(l) = 3l + 12. Calculate g(b(y)). -3y - 12 Let u(l) = -7l*2. Let z(i) = 6i - 3. What is z(u(w))? -42w2 - 3 Let u(v) = v2. Let o(d) = -d3 - d2 + 6d + 1. Let w be o(-5). Let b(l) = w + 9l2 - 71. What is u(b(n))? 81n*4 Let h(t) = -2t*2 - 3. Let x(u) = 5u*2 + 5. Let b(d) = -5h(d) - 3x(d). Let j(f) = -4f. Give j(b(g)). 20g2 Let n(k) be the third derivative of k4/8 - 26k*2 - 2. Suppose 4d = -0d + 8. Let z(l) = 1 - 1 + dl. What is z(n(b))? 6b Let w(k) = -38k*2 + 2. Let f(s) = -5s*2. What is w(f(h))? -950h*4 + 2 Let m(p) = -2p. Let b(x) = 112x - 53. What is m(b(f))? -224f + 106 Let v(d) = -2d2. Let q = 1 - -1. Let s(y) be the first derivative of -q + 2/3y*3 + 0y*2 + 0y. Determine s(v(h)). 8h4 Let b(i) = 8i2. Let y(a) = a2. Let h(x) = b(x) + 10y(x). Let d(z) = -3z. Determine d(h(g)). -54g2 Let f(v) = -v2. Let t(c) be the third derivative of c4/4 + 12c*2. Give f(t(k)). -36k*2 Let k(u) be the third derivative of 0 + 1/30u*5 + 0u*3 + 0u*4 - 4u*2 + 0u. Let l(x) = 4x + x2 - 4x. Calculate l(k(w)). 4w4 Let r(h) = h2. Let x(g) = -81g*2. Calculate x(r(c)). -81c*4 Let c(u) = -4651u. Let l(s) = -7s. Determine l(c(r)). 32557r Let v(h) = 36h2 + 2. Let d(o) be the first derivative of -o3/3 - 5. Determine v(d(s)). 36s*4 + 2 Let o(n) = 9n*2. Suppose 134 = 3r + 5m + 17, 5m = 2r - 53. Let s(t) = 34t + 10t2 - rt. Let u(z) = -4o(z) + 3s(z). Let l(i) = -i. Give l(u(b)). 6b2 Let x(p) = 43p. Let f(q) = 7q. Calculate f(x(z)). 301z Let k(w) = w2. Let s(c) = c2. Let g(i) = -5k(i) + 4s(i). Let a(v) = 5v2. Determine g(a(n)). -25n*4 Let z(d) be the first derivative of -3d*2/2 - 3. Let x(j) = j. What is x(z(u))? -3u Let w(h) = 66h2 + 27h. Let u(p) = -5p2 - 2p. Let r(o) = 54u(o) + 4w(o). Let z(k) = -k*2. Give z(r(g)). -36g*4 Let r(m) = 5m*2. Let w = 19 - 11. Let s(q) = 14q*2. Let n(k) = wr(k) - 3s(k). Let x(h) be the second derivative of h4/6 + h. What is n(x(c))? -8c*4 Let d(z) = 45z*2 + 41z*2 + 52z*2 - 122z*2. Let w(k) = -3k. Determine d(w(c)). 144c2 Let b(p) be the third derivative of 5p*4/24 - 14p2. Let o(w) = -w2. Calculate b(o(g)). -5g2 Let r(o) = -29o - 21o + 53o. Let g(x) = 6x. Determine g(r(z)). 18z Let p(w) = -w*2. Let y(n) = 485n + 4. What is p(y(v))? -235225v2 - 3880v - 16 Let s(z) = -12z - 2. Let o(f) be the first derivative of f2/2 - f - 6. Let r(x) = 2o(x) - s(x). Let l(y) = 2y. Determine r(l(u)). 28u Let n(t) be the first derivative of -t*2 + 7. Let v(j) = -7j. Give n(v(k)). 14k Let b(h) = 2h. Let k be 2 + -1 + -1 + 2. Suppose 4s - 6 = 2. Let z(p) = 0p*s - 3p*2 + kp*2. Calculate b(z(v)). -2v*2 Let k(i) = -2i. Let o(z) = 24395z. What is o(k(p))? -48790p Let m(h) = 3h. Let q(w) be the third derivative of w6/180 - w4/12 - 3w*2. Let z(a) be the second derivative of q(a). Determine z(m(s)). 12s Let r(u) be the third derivative of u4/12 - u2. Let v(g) = -g - 5. Let h(p) = 1. Let b(l) = -5h(l) - v(l). Determine r(b(s)). 2s Let k(s) = 14s + 5. Let t(b) = 1. Let a(i) = k(i) - 5t(i). Let h(j) = -2j. Give a(h(n)). -28n Let j(m) = -2m2. Let b(u) be the second derivative of -3u*3 - 11u. Determine b(j(v)). 36v2 Let u(j) = -9j. Let c(r) = -17r + 14r*2 - 6r*2 + 17r. Calculate c(u(x)). 648x2 Let u(q) = -q. Suppose h + 32 = 3h. Let a(z) = 16z + 13z*2 - hz. What is a(u(n))? 13n2 Let y(o) = -2o*2. Let i(z) = z + 1. Suppose -w = -5w + 24. Let r(v) = 6 - 6 - 8v - w. Let q(b) = -6i(b) - r(b). What is q(y(m))? -4m2 Let v = 2 - 2. Suppose v = -0m + 2m. Let l(z) = mz*2 - 3z*2 + 2z*2. Let r(f) = -3f*2. Determine r(l(q)). -3q*4 Let q(l) = 693l*2. Let f(g) = 3g. Determine f(q(y)). 2079y2 Let s(j) = 8j*2. Let h(t) = -23t. Calculate h(s(y)). -184y2 Let p(r) = 2r*2. Let o(j) = 6064j*2. Calculate o(p(v)). 24256v*4 Let j(u) = -2u. Let q(y) = 88y2 - 7y. Calculate j(q(o)). -176o2 + 14o Let r(w) = 14w2. Let s(f) = -341f*2. Give r(s(d)). 1627934d*4 Let l be (-2 + 0)/(-2) - 1. Let a(d) = -4d + 5d + d + ld. Let f(v) = -4v. Determine a(f(q)). -8q Let f(d) = -3d. Let y(t) = -65t*2 + 43t*2 + 33t*2. Give f(y(l)). -33l*2 Let o(n) be the first derivative of 0n*2 - 2 + 0n - 2/3n3. Let f(c) = 3c*2. What is f(o(v))? 12v4 Let w(p) = -p2 - 10p - 12. Let i be w(-8). Let x(q) = 2q + q - iq - 5q. Let m(d) = d. Give m(x(o)). -6o Let u(h) = -13h*2. Let s(b) = -b - 11. Let n(j) = -2. Let d(i) = -11n(i) + 2s(i). Calculate d(u(w)). 26w2 Let o(p) be the second derivative of p5/30 - 3p2/2 + 2p. Let c(j) be the first derivative of o(j). Let v(r) = -r*2 + 0r*2 + 4r*2. Give c(v(g)). 18g*4 Let x(z) = 2z*2. Let r(d) = 374d + 5. Determine x(r(k)). 279752k2 + 7480k + 50 Let d(r) = -2r. Let x(a) = -8a*2 - 2a - 2. Let j(w) = -9w2 - 3w - 3. Let s(o) = 4j(o) - 6x(o). Calculate d(s(g)). -24g2 Let d(f) = 4f*2 + 37. Let k(v) = 2v. Calculate d(k(x)). 16x2 + 37 Let u(k) = -31k2 + 85. Let d(p) = p2. Give d(u(v)). 961v4 - 5270v*2 + 7225 Let z(m) = m + 2. Let k be z(0). Let d(x) = kx + 1 - 1. Let j(w) = 3w. Let o(b) = -b. Let s(g) = -6j(g) - 15o(g). Give s(d(v)). -6v Let n(l) be the first derivative of 11l3/3 - 11. Let b(i) = -2i. What is n(b(v))? 44v2 Let g(d) = -9d*2. Let o(i) be the first derivative of -2i*3/3 - 6. Give g(o(p)). -36p4 Let q(t) be the third derivative of -t5/12 - 2t2. Let o(c) = -c. Determine o(q(n)). 5n*2 Let t(f) be the second derivative of 0f*2 + 0 + 1/4f*4 - 2f + 0f3. Let a(k) = -3k. Give t(a(p)). 27p2 Let f(l) = 4l2 - l2 - 2l2. Let o(p) = -4p*2 - 5p + 5. Let n(c) = -c + c*2 + c + c + 2 - 3. Let k(r) = 10n(r) + 2o(r). Calculate f(k(u)). 4u4 Let u(z) = -z2 - 8z + 4. Let i be u(-8). Let k(f) be the second derivative of 0f*3 + 0 + 1/12f*i + 0f*2 + 2f. Let a(v) = 2v2. Determine a(k(q)). 2q*4 Let m(f) = -2f2. Let g(n) be the second derivative of n3/3 - 5n. What is g(m(x))? -4x*2 Let u(g) = 42g*2. Let q(i) = -28i. Calculate u(q(y)). 32928y2 Let f(a) = 42a. Let g(u) = -2u. Give f(g(m)). -84m Let x(m) = 7m. Let l(r) = -22 - 14r*2 + 11 + 11. Calculate x(l(q)). -98q*2 Suppose 0 = -4j + 2j - 2q + 16, -2j - 12 = -5q. Let f(r) = 4r2 - jr + 0r2 + 4r. Let h(i) = -i*2. Calculate f(h(y)). 4y*4 Let d(n) = 2n*2. Let o(v) = -1 - 3v + 1 + 5v. What is d(o(f))? 8f*2 Let v(t) = 5t*2 + 7t - 7. Let y(j) = 3j2 + 4j - 4. Let c(d) = 4v(d) - 7y(d). Let o(x) = -5x2. Give o(c(k)). -5k*4 Let a(z) = 13z*2 + 7z - 7. Let g(y) = 4y2 + 2y - 2. Let x(w) = -2*a(w)	{ "pile_set_name": "DM Mathematics" }
nder when 13007 is divided by 250. 7 Calculate the remainder when 5942 is divided by 136. 94 Calculate the remainder when 1780 is divided by 418. 108 Calculate the remainder when 8067 is divided by 207. 201 What is the remainder when 18 is divided by 4? 2 What is the remainder when 7519238 is divided by 1279? 1276 Calculate the remainder when 2225101 is divided by 78. 73 Calculate the remainder when 676019 is divided by 214. 207 What is the remainder when 27414 is divided by 347? 1 What is the remainder when 230453 is divided by 23? 16 What is the remainder when 80477 is divided by 26821? 14 Calculate the remainder when 28999 is divided by 9665. 4 Calculate the remainder when 4295 is divided by 539. 522 Calculate the remainder when 304 is divided by 60. 4 Calculate the remainder when 9402 is divided by 39. 3 Calculate the remainder when 5072 is divided by 364. 340 Calculate the remainder when 2052 is divided by 991. 70 Calculate the remainder when 1655687 is divided by 12. 11 Calculate the remainder when 7423 is divided by 1235. 13 Calculate the remainder when 50379 is divided by 882. 105 What is the remainder when 121151 is divided by 48? 47 Calculate the remainder when 94229 is divided by 496. 485 What is the remainder when 96071 is divided by 129? 95 Calculate the remainder when 90762 is divided by 128. 10 What is the remainder when 303029 is divided by 455? 454 Calculate the remainder when 12892 is divided by 772. 540 Calculate the remainder when 2506 is divided by 898. 710 Calculate the remainder when 160 is divided by 148. 12 Calculate the remainder when 12811 is divided by 267. 262 Calculate the remainder when 100679 is divided by 197. 12 What is the remainder when 26002 is divided by 102? 94 Calculate the remainder when 102594 is divided by 69. 60 What is the remainder when 1065593 is divided by 59? 53 Calculate the remainder when 3986 is divided by 440. 26 What is the remainder when 270193 is divided by 19? 13 Calculate the remainder when 309348 is divided by 538. 536 What is the remainder when 8946 is divided by 112? 98 Calculate the remainder when 4711 is divided by 44. 3 What is the remainder when 29776 is divided by 268? 28 What is the remainder when 580102 is divided by 56? 54 What is the remainder when 7745 is divided by 17? 10 Calculate the remainder when 7268856 is divided by 27. 24 Calculate the remainder when 24918 is divided by 2264. 14 What is the remainder when 70430 is divided by 272? 254 Calculate the remainder when 576161 is divided by 916. 913 What is the remainder when 59949 is divided by 189? 36 What is the remainder when 2684 is divided by 54? 38 What is the remainder when 24383 is divided by 29? 23 Calculate the remainder when 788775 is divided by 197191. 11 What is the remainder when 96177 is divided by 458? 455 What is the remainder when 10242 is divided by 206? 148 Calculate the remainder when 14401 is divided by 44. 13 Calculate the remainder when 54866 is divided by 94. 64 Calculate the remainder when 2492 is divided by 277. 276 Calculate the remainder when 2309 is divided by 34. 31 What is the remainder when 219585 is divided by 43917? 0 What is the remainder when 231035 is divided by 160? 155 Calculate the remainder when 321217 is divided by 319. 303 Calculate the remainder when 231609 is divided by 12. 9 Calculate the remainder when 217853 is divided by 5066. 15 Calculate the remainder when 24787 is divided by 2754. 1 What is the remainder when 5387 is divided by 76? 67 What is the remainder when 144599 is divided by 23? 21 What is the remainder when 8819 is divided by 520? 499 Calculate the remainder when 913 is divided by 77. 66 Calculate the remainder when 209 is divided by 66. 11 What is the remainder when 338182 is divided by 239? 236 What is the remainder when 4574 is divided by 142? 30 Calculate the remainder when 3002 is divided by 671. 318 What is the remainder when 2504 is divided by 156? 8 What is the remainder when 2208 is divided by 673? 189 What is the remainder when 288 is divided by 176? 112 What is the remainder when 273476 is divided by 114? 104 Calculate the remainder when 35907 is divided by 45. 42 Calculate the remainder when 85688 is divided by 38. 36 What is the remainder when 592144 is divided by 65? 59 What is the remainder when 3072 is divided by 234? 30 Calculate the remainder when 48406 is divided by 8030. 226 Calculate the remainder when 352131 is divided by 9. 6 What is the remainder when 495 is divided by 228? 39 Calculate the remainder when 2088 is divided by 1020. 48 What is the remainder when 27293 is divided by 1796? 353 Calculate the remainder when 7389 is divided by 10. 9 Calculate the remainder when 59229 is divided by 7. 2 Calculate the remainder when 3960 is divided by 3957. 3 Calculate the remainder when 15705 is divided by 449. 439 Calculate the remainder when 1221 is divided by 257. 193 What is the remainder when 39667 is divided by 76? 71 Calculate the remainder when 29898 is divided by 2989. 8 What is the remainder when 174264 is divided by 87129? 6 What is the remainder when 2896 is divided by 1219? 458 Calculate the remainder when 14183 is divided by 1548. 251 What is the remainder when 28291 is divided by 9310? 361 What is the remainder when 4954 is divided by 2434? 86 Calculate the remainder when 96819 is divided by 11. 8 Calculate the remainder when 3837 is divided by 1002. 831 Calculate the remainder when 69002 is divided by 8624. 10 What is the remainder when 543163 is divided by 102? 13 What is the remainder when 8676 is divided by 962? 18 What is the remainder when 16911 is divided by 28? 27 Calculate the remainder when 1082 is divided by 274. 260 Calculate the remainder when 94598 is divided by 44. 42 Calculate the remainder when 80 is divided by 22. 14 Calculate the remainder when 3368021 is divided by 21. 20 Calculate the remainder when 13448 is divided by 532. 148 What is the remainder when 22275 is divided by 47? 44 Calculate the remainder when 16989 is divided by 774. 735 What is the remainder when 2288411 is divided by 1134? 1133 Calculate the remainder when 383 is divided by 61. 17 What is the remainder when 19710 is divided by 111? 63 Calculate the remainder when 21657 is divided by 238. 237 What is the remainder when 3715 is divided by 167? 41 What is the remainder when 843222 is divided by 531? 525 What is the remainder when 1295 is divided by 317? 27 What is the remainder when 480009 is divided by 60000? 9 Calculate the remainder when 7232 is divided by 7232. 0 What is the remainder when 5874 is divided by 21? 15 Calculate the remainder when 89101 is divided by 24. 13 What is the remainder when 311 is divided by 18? 5 Calculate the remainder when 113881 is divided by 29. 27 Calculate the remainder when 5741 is divided by 174. 173 Calculate the remainder when 6691 is divided by 1321. 86 Calculate the remainder when 167337 is divided by 545. 22 Calculate the remainder when 1668 is divided by 1649. 19 Calculate the remainder when 1259747 is divided by 126. 125 Calculate the remainder when 971 is divided by 58. 43 Calculate the remainder when 2823 is divided by 156. 15 Calculate the remainder when 68330 is divided by 2009. 24 What is the remainder when 595009 is divided by 44? 41 Calculate the remainder when 2713 is divided by 14. 11 What is the remainder when 81835 is divided by 223? 217 Calculate the remainder when 5725 is divided by 336. 13 What is the remainder when 299926 is divided by 74976? 22 What is the remainder when 385112 is divided by 93? 92 What is the remainder when 171109 is divided by 292? 289 What is the remainder when 5606 is divided by 5556? 50 Calculate the remainder when 4855 is divided by 4759. 96 Calculate the remainder when 373696 is divided by 865. 16 Calculate the remainder when 1300 is divided by 547. 206 Calculate the remainder when 2380 is divided by 1163. 54 What is the remainder when 62287 is divided by 2395? 17 Calculate the remainder when 2307 is divided by 198. 129 What is the remainder when 172928 is divided by 264? 8 Calculate the remainder when 59540 is divided by 14875. 40 What is the remainder when 2957905 is divided by 118? 117 Calculate the remainder when 54717 is divided by 608. 605 Calculate the r	{ "pile_set_name": "DM Mathematics" }
What is the nearest to 1 in -42, -15.5, -0.3, 1? 1 What is the nearest to 0.2 in 2, -1, -96? -1 Which is the nearest to 0? (a) -0.06641 (b) 0 (c) 0.5 (d) -3 b What is the nearest to 3.6 in 0.3, -10, 22? 0.3 What is the closest to 1/2 in -19, -2/5, 0.04, -5? 0.04 Which is the closest to 2/3? (a) 2 (b) 1/9 (c) -1/15 (d) 102 b Which is the nearest to 2/5? (a) -9.7 (b) -9 (c) 5 (d) 9 (e) 0.3 e Which is the closest to -0.1? (a) 0.5 (b) 0 (c) -0.5 (d) 2/3 (e) -4943 b What is the nearest to -0.1 in -2/5, 0.01, -9, -59, 1/8? 0.01 Which is the nearest to 1/3? (a) -12 (b) 1/3 (c) -1067 b What is the closest to -0.1 in 0, 2/11, -9, 46, 116? 0 Which is the nearest to -4? (a) 8/17 (b) 5 (c) 34 a What is the closest to 2 in 11, -50, 5? 5 Which is the closest to -0.4? (a) 5 (b) -2 (c) 3267 b What is the closest to -4 in -3, 0.2, 3, 3/4, 0.25? -3 Which is the closest to 1? (a) -0.2 (b) -958 (c) 0.5 c What is the closest to 2 in -3, 0.1, 604? 0.1 Which is the closest to -1/4? (a) -2/17 (b) 6/23 (c) -2 (d) -0.29 (e) 5 d Which is the nearest to -26? (a) 1/7 (b) 4 (c) 2/203 c What is the nearest to 0.06 in -1, -4, -20/27, 1, -0.2? -0.2 Which is the closest to -10? (a) 388 (b) -10 (c) -3 b Which is the nearest to 2/15? (a) 5 (b) 111 (c) 0.4 c What is the nearest to -2 in 247/2, 4/5, 4, -3.9, -4? -3.9 Which is the nearest to -0.1? (a) -304 (b) 20 (c) 0 c What is the closest to 1 in 311, 5, 0, -0.7? 0 Which is the nearest to 1.65? (a) 0.5 (b) 6/85 (c) -2 a Which is the closest to -2? (a) 7/16 (b) -3/4 (c) -0.05 (d) 1/3 b What is the closest to -0.01 in -0.04, -3/8, -5, 120? -0.04 What is the closest to -334.92 in 0.3, -0.4, 3, -1? -1 What is the closest to -1 in 4, -2/5, -37, -175/6, 2? -2/5 What is the nearest to 10 in -2/5, -0.3, -1.2, -0.37? -0.3 What is the closest to -1/4 in 4, -1, 0.011, 26.5, 1/5? 0.011 Which is the nearest to 1461? (a) -5 (b) -1/6 (c) -2/27 c Which is the nearest to 47? (a) -4/9 (b) -46 (c) -0.1 (d) -1/16 d Which is the nearest to 13/10? (a) 4 (b) -4/7 (c) -8 b What is the nearest to 0.2 in 0, 30, -1/12, -1/3? 0 What is the closest to -0.3 in 4, 221/5, -0.2, 1/4, 62? -0.2 Which is the closest to -9? (a) -19 (b) -1/5 (c) -1/10 b What is the nearest to 1 in -2/415, 2, -408? 2 What is the closest to 3/16 in -2/3, -1, 2/9? 2/9 Which is the nearest to 0? (a) -1/4 (b) -2/3 (c) -8/25 (d) 20 (e) -4/3 a What is the nearest to 0.1 in 1056, -2, -3? -2 Which is the nearest to 2? (a) 0.05 (b) 14 (c) 0.4 (d) -0.4 (e) 0 c What is the closest to 3 in 2/5, -129, 2, -5/4, -19? 2 What is the closest to 6 in -1, 1/5, -0.065, 4? 4 Which is the nearest to -0.2? (a) 4/15 (b) 2/7 (c) 3 a Which is the nearest to 179? (a) 1 (b) -3 (c) -168 a What is the nearest to -0.2 in 2, -0.15196, 3, 1? -0.15196 What is the nearest to 4 in -1/4, -10, 2/5, 3, 4? 4 What is the closest to -1 in 2/7, 43, 4, 0.4, -4? 2/7 Which is the nearest to 4? (a) 0.2 (b) 32 (c) 0 (d) 1 (e) 0.01 d Which is the closest to 1518? (a) 4 (b) 0 (c) -1/8 a What is the nearest to -0.1 in 1/3, -18, -6.2? 1/3 Which is the closest to -2/9? (a) -2/13 (b) 53 (c) -0.08 (d) -2/11 d What is the nearest to 0.1 in 3, 0.4, 2/1013, -0.02, 1/5? 2/1013 Which is the closest to 0.8? (a) 2/5 (b) -2 (c) 5 (d) 11 a What is the nearest to -1 in -78, 1/6, -11? 1/6 What is the nearest to -19 in 1.1, -0.0682, 0.4? -0.0682 Which is the closest to 0.2? (a) -2/3 (b) -10/77 (c) 2.2 b What is the nearest to 2/7 in 0.1, -5, -6/4777, -0.4? 0.1 Which is the closest to -3? (a) 3 (b) 1/3 (c) -1/2 (d) -0.003 c Which is the nearest to 1/3? (a) -3 (b) -588 (c) 1/6 (d) -1 (e) 5 c What is the closest to 8 in -3, 0, -2, -46? 0 Which is the closest to 0? (a) 4 (b) 3/2 (c) -3 (d) -3/62 d Which is the nearest to 2994? (a) -0.1 (b) 1/4 (c) 2/35 (d) -5 b Which is the nearest to 2/5? (a) 13119 (b) -2/9 (c) 4 b Which is the nearest to 2.1? (a) 247 (b) -0.5 (c) 2 c What is the nearest to 0 in -0.34, 0.1, 1/12, 2? 1/12 Which is the nearest to 3? (a) 101 (b) -3 (c) -5 (d) -0.3 (e) -2 d Which is the closest to -0.08? (a) -0.14 (b) 8/7 (c) 1/12 a What is the nearest to -41 in -2.3, 0.1, -0.1, -1/31? -2.3 What is the closest to 24 in 2/13, 2/19, -3, -0.2, 0? 2/13 What is the nearest to -1/2 in -1/25, -2/15, -0.12? -2/15 Which is the closest to 2/15? (a) 130 (b) -4 (c) -5 (d) -5/4 d Which is the closest to 2? (a) -4 (b) -0.5 (c) -0.67 (d) -1.9 (e) -5 b What is the nearest to 9/10 in 6.8, 3/8, -0.2? 3/8 What is the closest to 0 in 128/379, -4, 15? 128/379 What is the nearest to 7/103 in 2/9, -4, -2, -3? 2/9 Which is the nearest to 0? (a) 0.8 (b) -4 (c) -3076 a What is the closest to 1 in -0.5, -5, 4, -1/44? -1/44 Which is the closest to 2/65? (a) -1.1 (b) 4 (c) -7 (d) -56 a Which is the closest to -11? (a) 4/13 (b) -5 (c) 4 (d) 1/3 b What is the nearest to 6 in 1/2, -0.5, -49/3? 1/2 Which is the nearest to 0.04? (a) 2/9 (b) -2.5 (c) -0.5 (d) -0.3 (e) -0.05 e Which is the closest to -2/5? (a) 0.1 (b) -19 (c) -7 (d) -3 a What is the nearest to 2 in 2.02, 1, 2? 2 What is the closest to -2/11 in 2/7, 2/11, 1, 2148/7? 2/11 Which is the closest to 1? (a) 2/9 (b) -71 (c) -1 (d) -0.5 (e) -5 a What is the nearest to -0.1 in -1/3, 2/7, 0, 44, 4/5? 0 Which is the nearest to -4? (a) 5 (b) 127/3 (c) 0.3 (d) 0 (e) -1 e What is the closest to -4 in -5, 5/1913, 1? -5 Which is the nearest to 2/7? (a) 0 (b) -0.7 (c) 4509 a What is the nearest to 0 in 0.3, -2/27, 389? -2/27 What is the nearest to 1 in 1/4, -2/13, 1.01? 1.01 Which is the closest to 31/145? (a) 9 (b) -0.01 (c) -4 b What is the nearest to -49.2 in -0.3, 6, -2? -2 Which is the closest to 5? (a) 1/4 (b) -4 (c) -3221 (d) -5 (e) -2/3 a What is the closest to 1/7 in 3, -1276/5, -0.04? -0.04 Which is the closest to -2? (a) 0.1 (b) 201 (c) -2/15 (d) -4 c Which is the nearest to -3? (a) 4 (b) 0.4 (c) -72/5 (d) -4 d Which is the closest to 4? (a) -5 (b) -2 (c) 0.2263 (d) -3/2 c What is the closest to -12 in 0, -1/2, 2/7? -1/2 Which is the nearest to -196? (a) -4/3 (b) 0.08 (c) 0.06 a Which is the closest to 1/5? (a) -1/15 (b) 154 (c) -1 a Which is the nearest to -1? (a) 5 (b) -1/3 (c) -17/3 (d) -1/13 (e) -0.1 b Which is the nearest to -2312? (a) 3/2 (b) 2 (c) 1 (d) 0.4 (e) -1 e What is the nearest to 0 in 203, 1, 2, 75? 1 What is the nearest to -363 in 1, 1/6, -7? -7 Which is the closest to 6? (a) -1/7 (b) 0.4 (c) -0.1 (d) -3 (e) -0.068 b Which is the nearest to 3? (a) -5 (b) -1 (c) 0.8 (d) 137 c What is the nearest to -1/2 in 2/3, 36.71, -2? 2/3 What is the closest to 0 in 2, -63, -2/113, 1? -2/113 Which is the nearest to -1? (a) 3 (b) -0.4 (c) 0.0235 (d) -24 b What is the closest to 0.1 in 0.08, 9, -9.978? 0.08 Which is the nearest to 0? (a) 0.0593 (b) 5 (c) -4 (d) 2/3 (e) 2/7 a What is the nearest to 0.4 in 1, 24, -2? 1 Which is the nearest to 0.1? (a) 0.0118 (b) 1/3 (c) 0.04 (d) -0.1 (e) -5 c What is the nearest to 3/13 in -0.3, -43, 5? -0.3 What is the nearest to -2 in 69, 3/4, 0, -2/11, -3? -3 Which is the nearest to -0.1? (a) 0.5 (b) -1.434 (c) -0.304 c What is the closest to 3856 in -1, 0.5, -0.3? 0.5 What is the nearest to 2/5 in -425, 26, -3, 0.4? 0.4 What is the nearest to -0.123 in 13, -52, -3? -3 Which is the nearest to 5? (a) 0 (b) 1 (c) -1/62 b Which is the closest to -9/2? (a) 3 (b) -4 (c) -1 (d) 4 (e) 30 b Which is the nearest to 0.1? (a) 10 (b) 3.3 (c) 4 (d) 5 b Which is the closest to 11? (a) -5 (b) 0.2 (c) -1/13 b Which is the closest to 13? (a) -3/5 (b) -8 (c) 8/15 c Which is the closest to -0.07? (a) -0.32 (b) 2 (c) 34 (d) -2/17 d Which is the nearest to -0.1? (a) 38 (b) 1 (c) 2/5 (d) 6 (e) -0.8 c What is the closest to -59 in -0.048, 5/2, 1/5? -0.048 What is the closest to 4 in -20, -1/13, 0.2, 228, -1/2? 0.2 What is the nearest to 2/7 in 0.1, -1, -5, 4/7, 9/8? 0.1 Which is the nearest to 0.22? (a) 1/3 (b) 2/3 (c) 2/7 (d) -1/4 (e) 1872 c What is the closest to -0.1 in 1, -4, 6, 104/7, 0.8? 0.8 Which is the nearest to 0.6? (a) -2 (b) -1/4 (c) 32 b Which is the nearest to 2? (a) -1/3 (b) 1/48 (c) -1 (d) -3 b What is the near	{ "pile_set_name": "DM Mathematics" }
fferentiate m(d) with respect to d. -3723d2 What is the third derivative of 30 - 310b*4 - 28b*2 - 5 + 252b*4 + 21b*2 - 1330b*4 wrt b? -33312b Suppose -4s - t + 12 = 0, -7s + 10s - 9 = -3t. What is the second derivative of -27p5 - 4 - 1 - 5 - 3p*2 - 82p + 79p - sp*5 wrt p? -600p*3 - 6 Let t = -92 + 151. Find the second derivative of 2 + tu*2 - 17u + 5 - 6 - 18u wrt u. 118 Let c = 365 - 281. Differentiate -28 - 154b - c + 20 - b with respect to b. -155 Suppose -5 = 2m - 4y + 9, 3y - 27 = -4m. What is the third derivative of 40v6 + 1149v + 130v2 - 1149v - 2v5 + mv*5 wrt v? 4800v*3 + 60v*2 Let i(r) = -57r - 3. Let s be i(-4). Let v = s - 155. What is the third derivative of vk3 - k2 - 70k*3 - 2k*2 + 21k*4 wrt k? 504k Suppose 3 = 3m - 9. Suppose 56k + 9 - 13 = 52k. Find the first derivative of mw - 43w + 6 - k + 9 wrt w. -39 Let u(s) = -s2 + 11s - 7. Let d be u(10). Suppose -2q + 42 = dn, 4n + 4q - 45 = 5q. Differentiate nl*4 - 10l*4 - 5l*4 + 15 with respect to l. -12l*3 Let t be (126/105)/(2/85). Find the first derivative of tu + 11u + 3u - 51 wrt u. 65 Let z(x) be the third derivative of 599x4/12 + 399x*3/2 + 395x*2. What is the derivative of z(m) wrt m? 1198 What is the second derivative of 1155k*5 - 2504k + 141k5 - 3537k + 1799k - 2 wrt k? 25920k3 Let u(m) = m3 - 11m2 + 7m + 36. Let n be u(10). Find the second derivative of 3i2 - n + 3 + 10i*5 - 5 + 104i - 109i wrt i. 200i*3 + 6 Let u(k) be the second derivative of -47k*3/3 - 107k*2/2 - 20k. Let z(t) = 2t - 1. Let w(b) = -u(b) - 2z(b). What is the derivative of w(j) wrt j? 90 Let c(i) = 81i2 - 8i. Suppose 40 = -13h - 25. Let g(o) = -o. Let z(d) = hg(d) - c(d). What is the second derivative of z(w) wrt w? -162 Let k(s) be the third derivative of -3/40s6 + 0s - 1/24s4 + 1/60s5 + s2 + 35 - 19/3s3. What is the second derivative of k(o) wrt o? -54o + 2 Let d(n) = -n*2 + 6n + 15. Let u be d(7). Let l be 2/244/u. What is the second derivative of -1 - lc4 + 17c*4 + 1 + 14c wrt c? 180c2 Let o = -8818 + 8822. Let a(r) be the first derivative of 31/4r*4 + 0r*3 - 8 + or*2 + 0r. Find the second derivative of a(l) wrt l. 186l Find the second derivative of 1544f*2 + 529f*2 + 1790f + 1675f2 wrt f. 7496 Let x(q) be the second derivative of 2131q5/10 - q4/12 + 1061q3/3 - 9330q. What is the third derivative of x(o) wrt o? 25572 Let j(i) = 24i + 4. Let q(l) = 5l + 1. Let c be 15/45 - (-22)/6. Suppose cn + 2 + 6 = 0. Let u(v) = nj(v) + 11q(v). Differentiate u(b) with respect to b. 7 Let p(t) be the second derivative of -429t*5/20 - 6461t*2/2 + 1121t - 1. Differentiate p(c) wrt c. -1287c2 Let j(h) be the third derivative of -1/6h*4 + 36h2 + 0 - h3 + 0h - 67/60h*5. Find the second derivative of j(i) wrt i. -134 Let h(u) = 3u - 5. Let a(b) = -641b + 752. Let y(x) = -a(x) - 9h(x). What is the derivative of y(q) wrt q? 614 Let v(f) be the first derivative of -1683f5/5 - 4847f + 9474. Differentiate v(i) wrt i. -6732i3 Find the second derivative of -34 - 529j*2 - 609j*2 + 0j + 56j2 + j wrt j. -2164 Let b(d) = d2. Suppose 4 = 2f - 0. Let h be 1f17/34. Let a(i) = 7i2 + 2i. Let m(z) = ha(z) - 6b(z). Find the second derivative of m(q) wrt q. 2 Let k = 8 - -16. Let h(y) be the first derivative of -44y2 + 54y2 + y4 - k + 5y4. What is the second derivative of h(t) wrt t? 144t Let t(n) be the third derivative of 2n6/15 - 131n*5/60 - 1213n*3/3 - 16n*2 + 3n + 2. Differentiate t(d) with respect to d. 48d2 - 262d Let v(i) = i*3 - 13i*2 - 2i + 32. Let y be v(13). Suppose -yq + 98 = -388. What is the first derivative of 28 - 125d*4 - q + 98d*4 wrt d? -108d3 Let x(i) = i2 + 4i + 7. Let v be x(-2). What is the third derivative of -p6 - 2p*6 + 3p*v - 2p*6 + 16p*2 - 4p - p*3 wrt p? -600p*3 + 12 What is the derivative of 457 + 449u*2 + 1169u*2 + 2414u*2 - 987u*2 wrt u? 6090u Suppose 0 = -d + 2d + 5q + 53, q = 5d + 135. Let s = -23 - d. Find the third derivative of 6o*2 - 17o*5 + so*2 + 14o*2 wrt o. -1020o*2 Let t = 53 - 50. Suppose -2l = 5x - 11, 2l + 11x = 14x + t. What is the third derivative of -14y2 + 33y*3 - 19y*3 + 28y*l wrt y? 252 Let y(i) be the second derivative of 23i - 37/15i6 - 7i*2 + 0i*5 + 0i*4 + 0 + 1/6i*3. What is the second derivative of y(s) wrt s? -888s*2 Let n(t) be the first derivative of 0t - t*2 + 0t*6 - 26 - 40/7t*7 + 0t*5 + 12t*3 + 0t*4. What is the third derivative of n(i) wrt i? -4800i*3 Let s(p) be the second derivative of -1/42p*7 + 1/4p*4 + 0 + 168p + 23/10p5 + p2 + 0p*3 + 0p*6. What is the third derivative of s(f) wrt f? -60f*2 + 276 Find the first derivative of -1361v + 2835v + 7393 - 92v + 4609v + 1283v wrt v. 7274 What is the derivative of 949f + 113f*2 + 192 + 109f*2 - 684 - 224f*2 wrt f? -4f + 949 What is the second derivative of 13x2 - 3x*2 - 79x*4 - 16x*2 - 9300x - 58x4 wrt x? -1644x*2 - 12 What is the second derivative of -5922t*5 - 11059t - 1069t - 1084t wrt t? -118440t3 Let k(i) be the first derivative of 61i*7/7 - 955i*3/3 - 126. Find the third derivative of k(s) wrt s. 7320s*3 Let g(k) be the first derivative of -327k*5/5 + 130k*3/3 + 2k - 372. Find the third derivative of g(w) wrt w. -7848w Let k(i) be the first derivative of 17/2i*6 + 0i*5 + 0i*3 + 0i*4 - 3 - 5/2i*2 + 0i. What is the second derivative of k(u) wrt u? 1020u3 Let w be 18/(-81)(-13 - -4). What is the second derivative of -4 + 7q - 4q*3 - 10q - q + 12qw + 0q*3 - 2q*3 wrt q? -36q + 24 Let k(x) be the second derivative of -141x6/10 + 9779x*2/2 - 8116x. Differentiate k(s) with respect to s. -1692s3 Let n(w) = w2 + 1. Let p(d) = -2112d*3 + 7d*2 - 1728d + 8. Let q(s) = -7n(s) + p(s). What is the second derivative of q(f) wrt f? -12672f Let a(w) = -w + 3. Let t(v) = -3499v - 1715. Let l(p) = 30a(p) + 2t(p). Differentiate l(c) with respect to c. -7028 Let v(d) be the first derivative of -1079d*5/5 + 3d*4/4 + 16d*3/3 - 5d*2/2 - 9d + 7919. What is the third derivative of v(y) wrt y? -25896y + 18 Let o(y) = y3 + 25y*2 + 23y - 8. Let u be o(-24). Find the third derivative of 22f2 + 36f*6 - 20f*2 + uf + 19f6 wrt f. 6600f*3 Let w(p) = -95p*2 - 24p. Let f = 62 + -69. Let s(x) = -95x2 - 24x. Let k(v) = fw(v) + 6s(v). Find the second derivative of k(o) wrt o. 190 Let m = -11704 + 11706. Let u(n) be the first derivative of -35 + 38/3n3 + 0n*m + 19n. What is the derivative of u(s) wrt s? 76s Find the first derivative of 837 - 341l - 752l - 140l - 863l wrt l. -2096 Let k be (1 - (-5 + -57)) + -2. Find the third derivative of -4z*2 + 77z*2 - kz5 + z2 wrt z. -3660z2 Let b(m) be the third derivative of -3/2m*3 + 0m4 - m2 - 1/60m5 - 44 + 0m - 1/3m6. What is the third derivative of b(a) wrt a? -240 Let t(k) = -5740k - 18k4 + 5746k - 122k4 + 37 + 148 + 6k3. Let u(f) = f3 + f. Let a(b) = -t(b) + 6u(b). Find the first derivative of a(r) wrt r. 560r*3 Let f(u) be the second derivative of 43u*6/30 + 31u*5/20 - 1397u*4/6 + 3260u. Find the third derivative of f(q) wrt q. 1032q + 186 Let y(d) be the first derivative of -673d*2/2 - 1928d - 1098. Differentiate y(m) with respect to m. -673 Let k(h) = 762h2 + 3h - 40. Let f(g) = -2289g2 - 8g + 122. Let j(a) = 6f(a) + 17k(a). What is the second derivative of j(i) wrt i? -1560 Let l(u) be the first derivative of -8u5/5 - 11u*3/3 + 2223u*2/2 - 555. Find the second derivative of l(g) wrt g. -96g*2 - 22 What is the first derivative of 14m*2 + 40m*2 - 469 + 375m*3 - 54m*2 wrt m? 1125m*2 Let m(n) be the third derivative of 0n*3 + 29/8n*4 + 0n + 0 + 91/60n5 - 67n*2. What is the second derivative of m(r) wrt r? 182 Let k(h) = 95h*3 + 3h - 50. Let m(l) = 89 - 5l - 192l*3 + 345l*2 - 345l*2 + 12. Let b(i) = -5k(i) - 3m(i). Differentiate b(t) wrt t. 303t*2 Let z = 255 - 252. Find the second derivative of 40s -	{ "pile_set_name": "DM Mathematics" }
at is the hundreds digit of b(-10)? 1 Suppose -2r - 14 = -f - 7r, 50 = 2f - r. What is the units digit of f? 4 Let z(r) = -18r*3 + 6r*2 + 7r + 6. Let v(i) = -i*2 - i - 1. Let a(u) = 5v(u) + z(u). Let f be a(-1). What is the tens digit of (-10)/45 - (-328)/f? 1 Let v = -56 + 61. Let x(p) = 6p3 + 5p - 4. Let o(r) = 5r3 - r2 + 4r - 4. Let l(u) = -5o(u) + 4x(u). What is the units digit of l(v)? 4 Let f(j) = 2j + 8. Let q(z) = 5z + 23. Let a(u) = 11f(u) - 4q(u). What is the units digit of a(8)? 2 Let d(u) = -u*3 + 12u*2 + 12u + 1. Let y be d(13). Let t(k) = k + 14. What is the units digit of t(y)? 2 Suppose 5j = -g + 8, 4j - 7j = 4g - 15. Suppose 0 = -2z + 5 + g. What is the units digit of z? 4 Suppose -3y + 4w = -0w - 36, 67 = 4y + w. What is the units digit of y? 6 Suppose -1108 = -6m - 310. What is the hundreds digit of m? 1 Suppose 30 = -4n + 2n. Let j = 29 + n. What is the units digit of j? 4 Let c(h) be the third derivative of -h*5/60 - 3h*4/8 + 5h*3/6 - 3h*2. What is the units digit of c(-9)? 5 Let a be (-3)/(-2)(-32)/12. What is the tens digit of ((-26)/4)/(a/8)? 1 Suppose 5b - 11 = v, v - 2b - 3 = -5. Suppose -vr = 22 - 162. What is the tens digit of r? 3 Let h be 0/(-1) + 60/2. Suppose 4x - h = -x. What is the units digit of x/10 - 68/(-20)? 4 Let u(q) = -81q + 1. What is the units digit of u(-1)? 2 Let a be (-346)/(-18) - 4/18. Suppose -2g - 2g - 3u + 43 = 0, -2g + u = -a. What is the tens digit of g? 1 Let u be ((-18)/(-15))/(9/240). Let z = u - 17. What is the tens digit of z? 1 Suppose -s - 4 = -7. What is the units digit of s? 3 Let w(t) = t2 + 5t - 5. Suppose -b + 17 = 2b + 5g, -3b - 4g + 16 = 0. Suppose -4m - 5r = -2r + 31, 11 = -m - br. What is the units digit of w(m)? 9 Let w(n) = -2n + 127. What is the units digit of w(0)? 7 Suppose 5g - 23 = -2h, -5g - 6h = -2h - 31. Suppose -a - 5q + 14 = 0, 42 = -ga + 6a + 5q. Suppose -a = -4p + 26. What is the tens digit of p? 1 What is the tens digit of (-3)/(5 + -2 - 63/20)? 2 Suppose f + 7 = 2. Let l = -1 - f. What is the units digit of l? 4 Let t = 20 + -25. Let n(q) = -10q - 12. What is the tens digit of n(t)? 3 Let t = -10 + 14. Suppose -2l - 8 = 4d, 2 = -4l - td - 2. What is the units digit of l? 2 Suppose -23 = -4u - 7. Suppose us + 0 = 8. Suppose -10 = -sb + 2. What is the units digit of b? 6 Let o be (-3 - -2)/((-1)/2). Suppose 0m = 5m - 25, -o = 4k - 2m. Let h = 9 - k. What is the units digit of h? 7 Suppose -2b - 12 = -3d, -2b = -d - b + 3. What is the units digit of d? 6 Let a be (-4)/(-5)55/(-11). Let k(x) = 3x*2 - x + 1. Let p be k(1). Let r = p - a. What is the units digit of r? 7 Let r = 4 - 2. What is the units digit of r? 2 Suppose -3b + 298 + 77 = 0. What is the units digit of b? 5 Suppose 27 + 23 = 5g - 3m, -2g + 21 = -m. What is the tens digit of g? 1 Suppose -g = 2q - 71, -3g = -q + 23 - 5. What is the tens digit of q? 3 Let z(o) = o3 - 2o2 - 2. Let v(a) = -a3 + a*2. Let b be v(-1). Let u be z(b). What is the units digit of (-7 - -3)u/1? 8 Suppose 20 = 5z, 3y + z + 5 = 12. Let p be y - 3 - 3 - 3. Let c = 18 + p. What is the tens digit of c? 1 Let i = -2 + 2. Suppose i = -2t + 5t - 48. What is the tens digit of t? 1 Let o(u) = -u*3 + 4u*2 - 3u + 2. Let s be o(3). Suppose 23 = -sh - 11. Let a = -12 - h. What is the units digit of a? 5 Let z = -16 + 13. Let b(l) = -3 + 1 - 2 + l2 - l. What is the units digit of b(z)? 8 What is the tens digit of (555/12)/(3/(-2 + 14))? 8 Suppose -3a + 0a + 39 = 3c, -8 = 2a. What is the units digit of c? 7 Let j = 76 + -32. What is the tens digit of j? 4 Suppose 0 = 5y + 58 - 288. What is the units digit of y? 6 Let p be 2 + 1 + -2 + -3. Let f be 7/p + (-1)/(-2). What is the units digit of (-1 - -6) + f/1? 2 Suppose t = -3t + 20. Suppose -5c = 3j - 5j - t, -3j + 18 = c. Suppose ck + 9 = -3g, 3k = g + 4 + 7. What is the units digit of k? 2 Let u(c) = 23c2 + 6c - 7. What is the units digit of u(2)? 7 Let x(c) = -c*3 - 10c*2 + 13c + 14. Let u be x(-11). Let d = u - -18. What is the units digit of d? 0 Suppose 3s = -4w + 8, 2w + 5s = 3w - 2. Suppose -2h - j + 3j + 54 = 0, wh - 46 = -2j. What is the units digit of h? 5 Suppose 0 = -0b + 5b. Suppose 3y = a + 3a - 12, b = 2a - 3y. What is the tens digit of 64/a - (-16)/(-24)? 1 Suppose 65 = 5x - 275. What is the units digit of x? 8 Suppose -15 = -3o + 3d, 7o = 4o - 2d - 10. Let v = 10 - o. What is the units digit of 10 - (-5)/(v/4)? 2 Suppose 3j + 0j = 9. Suppose jc - 48 = 30. What is the tens digit of c? 2 Let s(p) be the first derivative of 2p2 - 11p + 5. What is the tens digit of s(8)? 2 Let t be (18/4)/((-1)/2). Let u(b) = 3 - 2b - 3 - 1 - 3. What is the tens digit of u(t)? 1 Let r be (-13)/(-5) - 6/(-15). Suppose 6q - 29 = q - 2a, -5q = ra - 31. What is the units digit of q? 5 Let v = -1 - -3. Let o be (v + 0/2)2. Suppose 0 = or - 0r - 4. What is the units digit of r? 1 Let t(y) = -y3 - y2 + y + 1. Let b(k) = -2k + k2 - k3 + k3 - 1 + 0k*2 - 12k*3. Let o(x) = b(x) + 2t(x). What is the units digit of o(-1)? 4 Let m be -1 - (18 - (3 + -1)). Let a be (-34)/3-3 + -2. Let t = m + a. What is the units digit of t? 5 Suppose 3 - 2 = -v. Let k = -1 - v. Suppose k = 2z + 5 - 31. What is the tens digit of z? 1 Suppose 5j + 4 = u, 2j + 5u = 7j. Let g be 3 - 8 - j/(-1). What is the units digit of g/((3 + -1)/(-2))? 6 Let z be (3/(-2))/(2/(-8)). Let y be z/31 + 1. What is the units digit of (2 - -1 - y) + 3? 3 Let c be 22 - -6(-4)/8. Let l = 35 - c. What is the units digit of l? 6 Let a(y) = y*3 + 3y*2 + 2. Let p be a(-3). Let v be 1/p(14 + -2). Suppose -10 - v = -4k. What is the units digit of k? 4 Suppose 0 = 3a - 2i - 131, 5i = -3a + 5a - 69. What is the units digit of a? 7 Let g be ((-2)/2 - 2)-1. Suppose -3o + 2c + 19 = 0, -2 = -2o - gc + 2. What is the units digit of o? 5 Suppose -5m + 2q = -14, -5m - q + 8 = -0q. Suppose -54 = -2r - u, -mr + 3r - 41 = 3u. What is the tens digit of r? 2 Let s(m) = m2 + 3m - 2. Let k be 2/((-3)/6 - -1). What is the units digit of s(k)? 6 Suppose 4a + 3p + 137 = 0, 3a = 8a + 5p + 175. Let h = -8 - a. What is the tens digit of h? 2 Let n(q) = q2 + q + 3. Let f be n(3). Let l = 2 - -3. Suppose -4j = -lx + 29, -4 = 3x - 4j - f. What is the units digit of x? 9 Let r be 4 - (3 - 482). Suppose r = 4f + 29. What is the units digit of f? 7 What is the units digit of (-12)/24-182? 1 Let o be (16/(-10))/((-2)/10). Suppose 3u + o = t - 6, 0 = t + 3u + 10. Suppose -4y + 3w + 12 = -6, y + tw - 10 = 0. What is the units digit of y? 6 Suppose 3l - y - 76 = 2l, 3l + y - 212 = 0. What is the units digit of l? 2 Suppose -2l + 5l - 108 = 0. What is the tens digit of l? 3 Suppose -h + 4h = 9, 0 = 5d + 2h - 26. Let y(z) = -3z + 6. Let g be y(d). What is the units digit of (g/(-9))/((-2)/(-39))? 3 Suppose 3k - k - 4 = 0. Let b(a) = 10a2 - 5a + 4. What is the tens digit of b(k)? 3 Let c = 124 + -8. What is the units digit of c? 6 Let c(y) = y*3 - 4y*2. Let u be c(4). Let b = 8 + -5. Let s = u + b. What is the units digit of s? 3 Suppose 0 = -0p + p - 7. What is the units digit of p? 7 Suppose 5k = -43 + 128. What is the tens digit of k? 1 Suppose 30 = 5s + 4q, 3s - 7q + 2q + 19 = 0. Suppose 0 = -5w - sz - 19, 0w + z - 18 = 3w. Let b(k) = -k. What is the units digit of b(w)? 5 Let j(f) = 6f - 4. What is the units digit of j(15)? 6 Let k(x) = 3x - 2. Let i be k(2). Suppose 30 + 34 = ih. What is the units digit of h? 6 Let r(t) = -3t. Let w be r(-1). Suppose m - 20 = v, 11 + 29 = 2m + wv. What is the units digit of m? 0 Suppose -2o = o - 390. Suppose -68 = -2v - 4h, -o = -4v - h - h. What is the tens digit of v? 3 Suppose 0 = 3x + 4b + 10, -5b - 4 - 8 = 4x. What is the units digit of (-1 - -3)6 - x? 0 Let i(a) = -3a*3 - 3a*2 + a - 4. What is the units digit of i(-3)? 7 Let c = -71 + 103. Suppose 2t + c + 20 = 2g, 3t = -g + 6. What is the tens digit of g? 2 Suppose -2r + 4l + 210 = 0, 4l = r - 0l - 99. What is the tens digit of r? 1 Let i(x) = -8x3 - x*2 - x. Let d be i(-1). Let a be (-2	{ "pile_set_name": "DM Mathematics" }
a9? 10061 In base 5, what is 20020223 - -1040? 20021313 In base 10, what is -1 - -136687264? 136687263 In base 15, what is -175a - 4844? -609e In base 8, what is -2 - -16426217? 16426215 In base 11, what is 1224 + -20398? -1a174 In base 16, what is 5e88278 + 4? 5e8827c In base 5, what is -200 + 422010400? 422010200 In base 12, what is 10 + -415272? -415262 In base 7, what is -130 - -13516436? 13516306 In base 5, what is 4 + 1042101211? 1042101220 In base 16, what is -5 + 12db517? 12db512 In base 16, what is -32 + -a7f20? -a7f52 In base 4, what is -1220 - -22101310? 22100030 In base 9, what is -52716 + -2176? -55003 In base 6, what is -32304343 - 5? -32304352 In base 10, what is 54730875 + -2? 54730873 In base 3, what is -10012102001022022111 - -11? -10012102001022022100 In base 2, what is 110 + 1100100001011011000? 1100100001011011110 In base 16, what is 4 + -ff6faa? -ff6fa6 In base 2, what is -10001011 - -1011111101100010? 1011111011010111 In base 12, what is -30b - -156980? 156671 In base 8, what is -56 - -12233? 12155 In base 8, what is -12216111474 - 2? -12216111476 In base 16, what is -41 - -3c739f? 3c735e In base 4, what is -202033 - 223010133? -223212232 In base 7, what is 225044046 - -6? 225044055 In base 4, what is -1000 - -121033210? 121032210 In base 11, what is 222443a - -2a? 2224469 In base 7, what is 65125 - -20641? 116066 In base 5, what is 24311241 - -2321? 24314112 In base 4, what is 2310310100 + 33? 2310310133 In base 9, what is 7 - -5244050? 5244057 In base 16, what is 39d25 - -18a? 39eaf In base 5, what is -414344412 - -1? -414344411 In base 15, what is 234 - 26ce? -249a In base 9, what is -613 - -328460? 327746 In base 8, what is -4510 - 32741? -37451 In base 10, what is -4 + -12234023? -12234027 In base 15, what is 1d7e690 + -5? 1d7e68a In base 3, what is -1021211100 - 102211? -1022021011 In base 8, what is 11471410 - -222? 11471632 In base 12, what is 5 - -7b9310? 7b9315 In base 6, what is -1 + 4313231402? 4313231401 In base 9, what is -1483 + 54044? 52451 In base 3, what is -1222212222100101 + -1? -1222212222100102 In base 10, what is -13029 + -1725? -14754 In base 16, what is -103 - -c4593? c4490 In base 11, what is a + 164317a? 1643189 In base 14, what is 1b - -6599b? 659b8 In base 15, what is 72d + -a303? -9ac5 In base 9, what is -128844 + 27? -128816 In base 11, what is -6591011 + -5? -6591016 In base 5, what is -3330410324430 - 0? -3330410324430 In base 13, what is 401a999 - 3? 401a996 In base 5, what is 234 - -13003242? 13004031 In base 4, what is -2301 + 102211212? 102202311 In base 10, what is -1626 - 10059? -11685 In base 9, what is 2733802 - -2? 2733804 In base 4, what is -1231200 - -30130? -1201010 In base 13, what is 49430b92 + -1? 49430b91 In base 15, what is 26788 + 2a? 267b3 In base 16, what is 27 + -35ba7? -35b80 In base 9, what is -237423478 + 2? -237423476 In base 12, what is -28a8a - 62? -28b30 In base 12, what is -8636776 + -5? -863677b In base 5, what is -202 - 11114042? -11114244 In base 6, what is -213051400 + -5? -213051405 In base 12, what is -66 - 162221? -162287 In base 12, what is -1 - 29583990? -29583991 In base 13, what is -55b180 - -1? -55b17c In base 9, what is 12 + -7823717? -7823705 In base 5, what is 3 + 14001132033? 14001132041 In base 2, what is -1111100110 + 11110000000? 1110011010 In base 11, what is -30a5a + -1a? -30a79 In base 16, what is 378b + -105? 3686 In base 11, what is 1 + -12109253? -12109252 In base 7, what is -205141023 - 10? -205141033 In base 4, what is 30322002333333 - 2? 30322002333331 In base 2, what is -1111 - -110010111111101011000? 110010111111101001001 In base 9, what is 27277 + -6308? 20868 In base 15, what is -3 - -227d969? 227d966 In base 6, what is -2012 - -1304204? 1302152 In base 10, what is -113096729 - 0? -113096729 In base 4, what is 23303100033 - -12? 23303100111 In base 14, what is 7b534a6 + -4? 7b534a2 In base 16, what is -1a7a5 + -fb? -1a8a0 In base 16, what is 5 - 52d8c8? -52d8c3 In base 16, what is -98 + 69278? 691e0 In base 8, what is 26024 - -57101? 105125 In base 14, what is a + -537dc4c? -537dc42 In base 11, what is 10 + 445359? 445369 In base 7, what is 304 - -1512223? 1512530 In base 8, what is 107562173 - 0? 107562173 In base 8, what is -430 + -224127? -224557 In base 4, what is 1 + 11201132112? 11201132113 In base 11, what is 3 + -3a13488? -3a13485 In base 3, what is 111000120 + -1022000? 102201120 In base 16, what is -4 - 10e68f? -10e693 In base 15, what is -134d89 - 1? -134d8a In base 14, what is 4a5 - 42aa0? -425d9 In base 10, what is 0 + 1258839? 1258839 In base 16, what is 34d - -1f05? 2252 In base 9, what is -1618761 + -4? -1618765 In base 6, what is -30 + -1001141144? -1001141214 In base 7, what is -43053 + -3060? -46143 In base 15, what is -4b - 1d3c? -1d88 In base 16, what is c094 + 2ec? c380 In base 15, what is -2 + 6c8187? 6c8185 In base 5, what is 1300 - -1024023130? 1024024430 In base 2, what is -1010010111010010100 - -1? -1010010111010010011 In base 5, what is -23004 - -114? -22340 In base 14, what is 14b + -7b348? -7b1db In base 8, what is 42002 - -5315? 47317 In base 16, what is 4b + 5167? 51b2 In base 12, what is 264aa7 - -29? 264b14 In base 2, what is 1110011100101000111110 + -1001010? 1110011100100111110100 In base 7, what is -1 - -3343415545? 3343415544 In base 14, what is 3725d16 - 2? 3725d14 In base 16, what is 11faf + -6c? 11f43 In base 5, what is -31400303202 + -1? -31400303203 In base 3, what is -2 + -21021212211111? -21021212211120 In base 2, what is -1011111010101100110110101010 + 110? -1011111010101100110110100100 In base 4, what is 102200100302113 - -10? 102200100302123 In base 9, what is -4 + -65285735? -65285740 In base 10, what is -5 + 2753336? 2753331 In base 10, what is -36043 + -551? -36594 In base 14, what is -189236 - 17a? -1893b2 In base 4, what is 31200 + 32002202? 32100002 In base 16, what is 19 + -219e19? -219e00 In base 10, what is -19899 - -3695? -16204 In base 3, what is 21200012012210 + 1? 21200012012211 In base 14, what is 5 + 63620c? 636213 In base 8, what is -3 + -3110220? -3110223 In base 5, what is -3034010 + 24? -3033431 In base 4, what is 320132110 + 13? 320132123 In base 16, what is c66ea + -154? c6596 In base 3, what is 12001112010121 - -10? 12001112010201 In base 11, what is -4864887 + a? -4864878 In base 8, what is 44477 + 346? 45045 In base 6, what is -2421 + 22534? 20113 In base 11, what is -11 + 2a9996? 2a9985 In base 11, what is 1233 + 26a2aa? 270532 In base 15, what is -4913d08 + 1? -4913d07 In base 16, what is a2 - 7ae? -70c In base 16, what is -2 - 5dbcfd? -5dbcff In base 5, what is -24 + -130143244? -130143323 In base 13, what is 9824 + 190? 99b4 In base 9, what is 8 - 37036? -37027 In base 9, what is 5 + -53665632? -53665626 In base 16, what is -165c358 - -2? -165c356 In base 10, what is 38996 - -835? 39831 In base 12, what is -790 - 109885? -10a455 In base 10, what is 0 + -2222205? -2222205 In base 6, what is 3235023 - 23? 3235000 In base 10, what is 36 - -2974097? 2974133 In base 16, what is 2b - 142818? -1427ed In base 12, what is 11aaa + 6643? 18531 In base 6, what is -5 + -1043543420? -1043543425 In base 14, what is d2997 + -191? d2806 In base 2, what is 1000101101111000111001 - -1011? 1000101101111001000100 In base 14, what is 5 + -350d449? -350d444 In base 8, what is -25 - -423473? 423446 In base 3, what is -10 + 20100201221100122? 20100201221100112 In base 3, what is -10222010110011000 + 10? -10222010110010220 In base 12, what is -51b140a0 + 4? -51b14098 In base 8, what is 2212561 - 1731? 2210630 In base 12, what is -19a2 - -86437? 84655 In base 3, what is -101100212022212 - -11? -101100212022201 In base 9, what is 7817 + -18283? -10365 In base 3, what is 2 + -11220101202122121? -11220101202122112 In base 12, what is 8705779 + 1? 870577a In base 7, what is 4220 - 615236? -611016 In base 5, what is -3 - -32313112? 32313104 In base 12, what is -52 + 13173a? 1316a8 In base 4, what is 20 + -12301210232102? -12301210232022 In base 12, what is 633 + -4122? -36ab In base 14, what is 9a6ad - 98? 9a615 In base 12, what is -902b + -183? -91b2 In base 16, what is -1 + -126ce? -126cf In base 15, what is -1494 + -2c5e? -4203 In base 14, what is -1b5bc2d - -30? -1b5bbdd In ba	{ "pile_set_name": "DM Mathematics" }
6t. Let o = -2 + 9. Suppose s = os - t. Is s prime? False Let k(o) = -3462o + 23. Is k(-8) a prime number? False Let x = -2243 + 3336. Suppose -2s + x + 69 = 0. Is s composite? True Let g = 108481 - 61230. Is g composite? False Let t(r) = -4r3 - 20r*2 + 2r + 35. Is t(-18) prime? False Suppose k + 5m + 22 = 0, -k - m + 8 = -2m. Suppose -2w + 699 = w + 3v, -kv - 699 = -3w. Is w prime? True Let q = 1582 - -313. Is q prime? False Let z(q) = -q. Let r(a) = -4a2 - 3a - 5. Let j(u) = -r(u) - 5z(u). Is j(14) a composite number? True Let j be 3 + -5 + 6 - 4. Suppose j = 6f - 3f - 174. Is f a prime number? False Let u(b) = 49b*2 + 37b + 221. Is u(-33) composite? False Let b = 1245 + -631. Suppose 2l = -2f + 5l + 413, b = 3f + l. Is f prime? False Suppose 11l + 20 = 15l, -2511 = -4g + l. Is g a prime number? False Suppose -128q = -121q - 13811. Is q composite? False Let c = -624 - -1155. Let g = 922 - c. Is g composite? True Let u be (-2 + 11228)/(-3) + 2/2. Let h = u + 5398. Is h a composite number? False Let h(w) = -w3 + 4w*2 + 5w + 8. Let a be h(5). Let p(i) = 5i - 19. Is p(a) a composite number? True Let m be (-1568)/72 - (-4)/(-18). Let s = m - -20. Is s + 37 + 6/3 a prime number? True Let s be (-2 + 1)1(16 + -16). Let d(w) = -15w + 263. Is d(s) composite? False Suppose -24c - 30 = -34c. Let f be (-2)/(-8) - (-7)/4. Suppose cw - 278 = -fz, -3z - 3w + 234 = -189. Is z composite? True Is (20 - 24)((-451)/4 + 0) prime? False Let i(v) = 12v*2 - 19v + 21. Is i(-12) prime? False Suppose -3f + 3982 + 509 = 0. Let i = f - 1004. Is i prime? False Suppose 0 = 4z - 10595 - 52737. Is z prime? False Is 37 + (-12 - -8)/(2/3) a prime number? True Let y = 22662 - -6823. Is y prime? False Suppose 1172 + 244 = 4v. Suppose -3l - 810 = -129. Let d = v + l. Is d a prime number? True Let s be (-2 - -3)/(-1) + 104. Suppose -s = 4x - 5x. Let j = x + -34. Is j a prime number? False Suppose -2r = -4f + 2f - 1404, -2f = r - 702. Let g = r - 415. Is g composite? True Let t(x) = -6x - 2. Let s be t(-1). Suppose -3g + k = -0k - 188, -sg + 2k = -252. Let i = 109 - g. Is i a prime number? True Suppose 0 = -3s + 12306 + 2070. Suppose 0 = 3o - s - 18155. Is o composite? False Suppose -3x - 55b = -50b - 2905, -5x - 3b + 4831 = 0. Is x a prime number? False Suppose -57728 = -6w + 14494. Is w prime? True Suppose 11c = 8c - 855. Let d = 592 + c. Is d a prime number? True Let f = -11 - -47. Suppose -q = -k + f + 156, 0 = q + 5. Is k a composite number? True Is 0 + 8545 + -100 + 97 a composite number? True Suppose -u + 820 = 3u. Is u composite? True Suppose 0 = 5h - 5a - 9465, -3a + 13 = 1. Is h prime? False Let o(z) = 21z*2 + 60z - 23. Is o(-30) a composite number? False Let l(v) = -41v3 - 6v*2 + 4v + 2. Let b(j) = j*2 - 4j - 3. Let i be b(4). Is l(i) a prime number? False Is ((-1)/(-4))/(3/23388) composite? False Suppose 4z - b + 2 = 0, 0 = 2z + b - 2 - 0. Suppose -2q - 1878 + 8990 = z. Is (q/21)/(4/6) composite? True Let t(m) = 15m*3 - 5m*2 + 5m - 13. Let c be (18/4)/((-9)/(-12)). Is t(c) prime? False Let w be (-60)/(-16) + 1/4. Suppose -4d = t - 0t - 13, -2t = -3d - w. Is 4 - ((d - 2) + -181) a prime number? False Let d(f) be the third derivative of 0 + 0f + 9/10f*6 - 5f*2 + 0f*4 + 1/60f*5 + 0f*3. Is d(1) a composite number? False Suppose -10h - 6h = -29936. Suppose 2c - 5g + 7429 = 6c, 0 = -c - 4g + h. Is c a prime number? False Suppose 43 = -7h - 90. Let i(x) = -x*3 - 15x*2 + 18x + 39. Is i(h) composite? True Let f = 5199 - 2036. Is f a prime number? True Suppose 0 = -2h + 4w + 26, -31 = -3h + 6w - 2w. Suppose 0 = hr + 5i + 106 - 461, -3r - i = -203. Suppose 3c = 315 + r. Is c a prime number? True Let d = 7 + 134. Is d prime? False Suppose -12 = -x - 3x. Suppose -1003 = -xq - 10. Is q a composite number? False Suppose 4y + 94 = 3n, n + 4y = 2y + 38. Suppose n = c - 289. Is c a prime number? False Is 295/177 + (-9236)/(-6) a composite number? True Let c(p) = -p3 + 14p*2 - 12p - 10. Let i be c(13). Suppose -if + 2765 = 4s, 0s - 4f - 715 = -s. Is s a composite number? True Is (-9)/(-15) - (550669/(-35) - -7) composite? False Suppose -4p = -0u + 5u - 15, 3u = 3p - 18. Let n be ((-4)/(-5))/(p/75). Is 2/(-8) + 1899/n prime? False Let h(r) = 3r*3 + 7r*2 - 12r + 5. Is h(8) a prime number? False Is 287/(-3 + 6 + -2) composite? True Suppose t = -3s + 163, -5t + t - 50 = -s. Is 2(47475/s + 1/3) composite? False Suppose 0 = a - 14 + 2. Is (934/(-8))/((-3)/a) a composite number? False Let t = 195 - 52. Is 130 - (t/55 + 4/10) composite? False Suppose 0 = 4q - 3q - 900. Let g = -413 + q. Is g prime? True Let c(n) = 41n + 30n - 8n - 11. Is c(2) composite? True Let r be 1084/4 + 3. Suppose 2i - 5i + r = 0. Is i a prime number? True Let n = 1043 - -548. Is n composite? True Let i = -38 + 40. Suppose iv - 293 = 137. Is v composite? True Suppose 56s = 61s - 11230. Is s a prime number? False Let d(q) = q*3 - 3q*2 - 6q + 1. Let v be d(8). Let s = 1064 - v. Is s prime? False Suppose -2x - 2978 = -0x + 4r, 4x + 2r = -5962. Let l = -969 - x. Let t = l + -309. Is t prime? False Let i = 160 - -1458. Is i composite? True Is 9 + -14 + (3 - 2)456 prime? False Let y(j) = 2j2 + 12j - 9. Let a be y(9). Let q = a - 166. Let g = 184 - q. Is g composite? False Let i = -16 + 16. Suppose ib - 2f = -b + 424, 1217 = 3b + 5f. Is (2/6)/(6/b) composite? False Suppose 40 = -3j - j. Let z = j + 10. Suppose 13h - 16h + 669 = z. Is h a prime number? True Let l(n) = 3360n*2 + 13n + 12. Is l(-1) a composite number? False Let n = 3192 - 1623. Is n prime? False Let j(y) = -15y3 + 4y*2 + 6y - 4. Is j(-3) composite? False Let g(s) = -10s - 6. Let z be g(13). Let q = z + 295. Is q prime? False Suppose 0 = -3k + 2q + 16, -2k + 4k + q + 1 = 0. Suppose ks - 18 = 5s. Is (-314)/s(3 + 0) a prime number? True Suppose -l - 144 = 2l. Let i = 73 + l. Let o = -6 + i. Is o a composite number? False Let v(w) = 633w + 56. Is v(7) a composite number? True Suppose -10v = -6v - 35336. Suppose 94u = 92u + v. Is u prime? False Let c = -316 + 303. Let q(i) be the first derivative of i*4/4 + 5i*3 + 5i*2 - 17i - 2. Is q(c) a composite number? False Let r = -16148 - -31501. Is r a prime number? False Let z(l) = -381l + 28. Is z(-9) prime? True Let h be (-2)/((10/25)/((-3)/5)). Suppose 0 = -hc + 469 + 404. Is c prime? False Let u = 31491 - -11626. Is u prime? True Let a be 1/3 + 6251/3. Suppose 0 = -9b + a + 2839. Is b prime? True Suppose -144h + 145h = -634. Is (h/4)/(5/10 + -1) a prime number? True Let y = 210 - -644. Let a = 1265 - y. Is a composite? True Let w(k) = k3 - 59k*2 - 40k - 79. Is w(60) composite? True Let k = 19 + -29. Is (-2)/k + (-18194)/(-55) composite? False Let d(m) = -106m2 - 13m - 8. Let b be d(7). Let y = b - -8748. Is y a composite number? True Let k be 16/24339/2. Let j(d) = -d2 - 5d + 6. Let s be j(6). Let f = s + k. Is f composite? False Suppose x - 5x - 172 = 0. Let q = x + 73. Let p = 61 - q. Is p prime? True Suppose 13g - 32g = -33763. Is g a composite number? False Let f(g) = 263g*2 + 3g - 1. Let l = 24 - 22. Is f(l) a prime number? False Let w be 4 - 2/((-8)/(-12)). Let p = w - -3. Suppose 156 = -pl + 8l. Is l a prime number? False Suppose 16u - 84u + 3636028 = 0. Is u composite? True Suppose -q + 4q = 3f + 3, -4f - 4q = -20. Suppose 4m - 36167 = -5p, 16184 = 5p - fm - 19995. Is p composite? True Suppose 0 = -12i + 816751 - 268555. Is i a prime number? False Suppose 0 = 5q - 4q - 27. Let s be (-18)/q - 154/(-6). Suppose -5p = -d + 332, -d - s = -2p - 342. Is d prime? True Is (3 - (-1807)/4-2)-4 a composite number? True Let j(u) = u + 7. Let m be j(-7). Suppose -y + my = -4. Suppose 5s + 4z - 1321 = 2120, -4s + 2756 = yz. Is s a composite number? True Let v be ((-4)/(-3))/(2/159). Suppose t + 11 = -v. Let l = 25 - t. Is l a composite number? True Let z(j) = j*2 - 12j + 11. Let u be z(10). Let a = u + 27. Let y = 131 + a. Is y a prime number? True Let t = -22 + 24. Suppose tg = 5g. Suppose 2q - 7q + 55 = g. Is q a prime number? True Let x(d) = d**2	{ "pile_set_name": "DM Mathematics" }
. What is the remainder when t is divided by 35? 34 Suppose 0 = -6f + q + 1107, -1331f + 1336f - 940 = 2q. Calculate the remainder when f is divided by (-1)/((-2)/190) + 1. 86 Let u = 13866 + -13818. What is the remainder when 2780 is divided by u? 44 Suppose -92d = -101d + 1260. Calculate the remainder when 276 is divided by d. 136 Let o = -117 - -514. Calculate the remainder when o is divided by 5/((-30)/(-116)) - 54/(-81). 17 Let i = -19 - -5. Calculate the remainder when 2/(((-252)/1053)/i) is divided by 15. 12 Suppose 42p = 39p + 12. Suppose po = -0d - 4d + 316, 0 = 5o - 4d - 395. Calculate the remainder when 309 is divided by o. 72 Suppose 0 = 4u - 4r - 552, -5u + 19r - 15r = -684. Calculate the remainder when 1583 is divided by u. 131 Suppose 0 = -14f + 5h + 5218, -2f + 9h = 6h - 750. Calculate the remainder when 1368 is divided by f. 252 Let f = -241 - -545. Calculate the remainder when 297 is divided by (f/(-64) + 41)-20. 12 What is the remainder when 531 is divided by -1(-1)/((-10)/(-590))? 0 Let o(m) = -m*3 - 3m*2 + m - 1. Let z = 55 + -60. What is the remainder when o(z) is divided by 31? 13 Suppose -3j = -143 - 43. Let l = 1486 - 1478. Calculate the remainder when j is divided by l. 6 Suppose 7448 = 119y - 5y + 38y. Calculate the remainder when 190 is divided by y. 43 Let p(w) = -2w3 - w2 - 16w + 5. Let n be p(-5). Let t = n - 280. Let v = 101 + -43. Calculate the remainder when v is divided by t. 28 Let s = -13855 - -13864. Calculate the remainder when 3071 is divided by s. 2 Suppose 4d + 6 = 6d. Suppose dh = 15 - 3. Calculate the remainder when (-8)/(-2)(4 - (-110)/(-40)) is divided by h. 1 Suppose -h - 1040 = -4d, 1040 = 4d - 127h + 124h. What is the remainder when d is divided by 34? 22 What is the remainder when (117/12)/((-12)/(-22) + (-9795)/18260) is divided by 40? 39 Let b(x) = -74x*3 - 3x*2 + 8x + 11. Calculate the remainder when 353 is divided by b(-1). 57 Calculate the remainder when 6562 is divided by 23 + 16 + 69 - -26. 130 Suppose 3l - f = 235, 4l + l + f = 381. Suppose -19p + j = -20p + 171, -3p + 5j = -497. What is the remainder when p is divided by l? 15 Suppose 130d - 4452 = 77d. Calculate the remainder when 192 is divided by d. 24 Suppose 2o = -u + 1011, 5o - 1482 = -u - 459. Calculate the remainder when u is divided by 53. 49 Suppose -42u = 19u - 4453. What is the remainder when 162 is divided by u? 16 Let p = 174 - 181. Let w(o) = -o*3 - 5o*2 + 13o + 1. What is the remainder when w(p) is divided by 5? 3 Let d(j) = 3j2 + 11j - 7. Let g = -65 + 66. Suppose 47 = 2p + 5b, p + g - 17 = -5b. What is the remainder when p is divided by d(-5)? 5 Suppose 3t - 8t + 30 = 0. Suppose -2y - v + 1182 = 3v, -3y + 5v + 1806 = 0. Let q = -576 + y. What is the remainder when q is divided by t? 3 Let m(i) = 287i - 1702. Calculate the remainder when m(23) is divided by 129. 126 Suppose -3q + 7t = 2t - 1156, -4t - 1536 = -4q. What is the remainder when q is divided by 77? 74 Let q(o) = 32o - 4. Let x be 8 - (-26905)/(-20) - 4/(-16). Let h = x + 1368. Calculate the remainder when q(3) is divided by h. 30 Let r = -4000 + 4048. What is the remainder when 527 is divided by r? 47 Suppose 0 = 4s + 5s - 513. Let l be (20/(-8) + 1)2. Calculate the remainder when s is divided by ((-228)/18 - -6)(l - 0). 17 Let q be 6/3 - (6/2 - 0). Let j be 6 - 4 - (q - 38). Let t = j + -24. What is the remainder when 31 is divided by t? 14 Let v(w) = 3w2 - 57w + 376. What is the remainder when 1472 is divided by v(12)? 108 Suppose 87 = 2t - 3o, 3t + 2o = 2t + 26. Suppose 2w = -4c - t + 178, 5w - 280 = 5c. What is the remainder when w is divided by 18? 7 Let v(y) = -41y - 1117. What is the remainder when v(-36) is divided by 11? 7 Suppose 14s - 18s = -56. Calculate the remainder when 57 is divided by s + 3/4 + (-11)/4. 9 Calculate the remainder when -2 + 1 + (81 - -3) is divided by 43/((-387)/(-432)) - 21. 2 Let f(q) = -q*3 + 24q*2 - 3q + 3. Let p be f(24). Calculate the remainder when ((-59)/177)/(1/p) is divided by 9. 5 Suppose -5504 = 3696l - 3712l. What is the remainder when l is divided by 110? 14 Suppose -1664 = -216u + 214u + 3110. Calculate the remainder when u is divided by 114. 107 Let f(t) = t*2 - 26t - 532. Calculate the remainder when 104 + 0 - 8/(-4) is divided by f(40). 22 Let s(l) = l*2 - 72l + 1158. What is the remainder when 6321 is divided by s(50)? 57 Suppose 25j = -j + 104. Suppose -205 = -jm - 5z, 5m - 2z + 15 = 296. Calculate the remainder when 162 is divided by m. 52 Let k be 12 + (-1)/((-5)/10). Suppose -25 - k = -f. Suppose 5s = 3w + 3s - 21, -5s + 15 = 0. Calculate the remainder when f is divided by w. 3 Suppose 0b + 38 = b. Let c = -7310 - -7389. Calculate the remainder when c is divided by b. 3 Let w = 3500 - 3491. Calculate the remainder when 1329 is divided by w. 6 Suppose -4z + 5w = -0z - 21, 5z - 4w - 24 = 0. Suppose -3v = zv - 126. Suppose -vp + 76 = -14p. What is the remainder when 35 is divided by p? 16 Let b(t) = 2t*2 - 80t - 302. Calculate the remainder when 2218 is divided by b(45). 146 Suppose -2c = 30 - 844. Suppose -2a - 397 = -c. Calculate the remainder when 67 is divided by a. 2 Let z be ((-1)/(-3))/(19/342). Let q be (21/(-4))/((-360)/(-64) - z). Suppose -qp = -p - 52. What is the remainder when 17 is divided by p? 1 Let l = 85 + -79. Suppose 0 = lc - 49 + 1729. Let m = 399 + c. What is the remainder when m is divided by 12? 11 Suppose -91a + 36288 = 5a. Calculate the remainder when a is divided by 128. 122 Suppose -y + 14m = 16m - 26, -y + 4m + 8 = 0. What is the remainder when 446 is divided by y? 6 Let u = 9071 + -9052. What is the remainder when (3 + -2)/(3/255) is divided by u? 9 Suppose -12t - 178t = -83t - 665326. Calculate the remainder when t is divided by 109. 5 Suppose 0 = -4d + 2m + 668, -5m = 5d - 0d - 835. What is the remainder when 627 is divided by d? 126 Suppose 46m + 3k = 50m - 94, -70 = -3m + 2k. Calculate the remainder when 361 is divided by m. 9 Suppose 3926 = 22q + 4q + 468. What is the remainder when q is divided by 77? 56 Suppose -74 = -23n - 28. What is the remainder when 54 is divided by -2n/(-4) - (10 + -24)? 9 Suppose 0 = -3n + 3d + 1818, -16d = -n - 9d + 618. Calculate the remainder when n is divided by 13. 6 Suppose -989 + 7289 = 100u. What is the remainder when 435 is divided by u? 57 Let f = -51 + 56. Suppose 0 = -h, 12q - fh = 7q + 450. What is the remainder when 81 is divided by 3/(15/139) + 18/q? 25 Let y = 4 + -4. Let w(x) = 9x - 1. Let t be w(y). Calculate the remainder when t(14/(-35) - 226/10) is divided by 5. 3 Let g(q) = -12q2 + q + 13. Calculate the remainder when 3899 is divided by g(0). 12 Calculate the remainder when (4 + -5)/(2/(-6910)) - (4 - -2) is divided by 66. 17 Suppose 57 = 5u - 13v + 15v, 28 = 3u - 5v. What is the remainder when 86 is divided by u? 9 Let l(h) = h*3 - 6h*2 - 2h + 4. Calculate the remainder when 971 is divided by l(7). 35 Let v(q) = q*2 - 5q + 5. Let f(p) = 3p - 13. Let y be f(3). Let l = 1 - y. Calculate the remainder when 12 is divided by v(l). 2 Suppose -3f - s = 112, 4f - 3s + 108 = f. Let n = 828256 - 828243. Calculate the remainder when f(-2 + 1)1 is divided by n. 11 Let z(r) = r3 + r2 + 2r + 11. Let f be z(-2). Suppose fd - 2p - 20 = 43, -d + 5p + 21 = 0. Calculate the remainder when 187 is divided by d. 19 Suppose -79 = 10y + 211. What is the remainder when 82 is divided by (y/3)/(-7 + 180/27)? 24 What is the remainder when 374 is divided by -9 - -63 - (-9 - -21)? 38 Suppose 3j = -5t + 39, 5j - 91 = 4t - 26. Suppose -jg + 396 = -930. What is the remainder when g is divided by 12? 6 Let y be 13 - 18 - (-1 + 0). What is the remainder when ((-3)/y)/((-21)/(-2968)) is divided by 56? 50 Suppose -4p + 579 = h, 42p - 587 = -h + 46p. What is the remainder when h is divided by 80? 23 Suppose 0 = -5b + 3x + 1047, 26b = 28b + 5x - 425. Calculate the remainder when b is divided by 45. 30 Suppose -3s = -j + 816, 2s - 8j + 554 = -4j. Let x = 383 + s. Calculate the remainder when x is divided by 23. 20 Suppose 0 = -5x - 5l +	{ "pile_set_name": "DM Mathematics" }
- u*2 + 6u + 4100 What is the d'th term of 132, 555, 1254, 2217, 3432, 4887, 6570, 8469? -2d3 + 150d*2 - 13d - 3 What is the m'th term of -11116, -22207, -33298, -44389, -55480, -66571? -11091m - 25 What is the s'th term of 49166, 49116, 49066, 49016, 48966, 48916? -50s + 49216 What is the j'th term of -140, -211, -304, -425, -580? -j*3 - 5j*2 - 49j - 85 What is the y'th term of 2908, 5827, 8746, 11665? 2919y - 11 What is the i'th term of -1138, -1234, -1328, -1420, -1510, -1598? i2 - 99i - 1040 What is the o'th term of 735, 1436, 2139, 2844, 3551, 4260? o*2 + 698o + 36 What is the f'th term of 17336, 17344, 17352, 17360, 17368? 8f + 17328 What is the b'th term of 44148, 43958, 43768, 43578? -190b + 44338 What is the m'th term of -476, -412, -348, -284? 64m - 540 What is the i'th term of 34073, 34084, 34095, 34106, 34117, 34128? 11i + 34062 What is the n'th term of -398, -1016, -1634, -2252, -2870, -3488? -618n + 220 What is the m'th term of 266, 2032, 6794, 16046, 31282, 53996, 85682, 127834? 249m*3 + 4m*2 + 11m + 2 What is the w'th term of -7240, -14331, -21422, -28513, -35604, -42695? -7091w - 149 What is the s'th term of -84062, -84060, -84058? 2s - 84064 What is the v'th term of 8734, 17472, 26210, 34948, 43686, 52424? 8738v - 4 What is the w'th term of 44750, 44741, 44732, 44723, 44714? -9w + 44759 What is the b'th term of 71870, 143744, 215618, 287492? 71874b - 4 What is the v'th term of -7148, -7062, -6920, -6722, -6468, -6158, -5792? 28v*2 + 2v - 7178 What is the h'th term of -1138, -2256, -3368, -4480, -5598, -6728, -7876, -9048? -h*3 + 9h*2 - 1138h - 8 What is the c'th term of -887, -1736, -2539, -3284, -3959? 2c3 + 11c*2 - 896c - 4 What is the l'th term of 15, 99, 299, 669, 1263, 2135, 3339? 9l3 + 4l*2 + 9l - 7 What is the t'th term of 443, 477, 103, -679, -1869, -3467, -5473? -204t2 + 646t + 1 What is the c'th term of 1021, 1165, 1429, 1825, 2365, 3061, 3925, 4969? 2c3 + 48c*2 - 14c + 985 What is the q'th term of 410, 421, 436, 455, 478, 505, 536? 2q2 + 5q + 403 What is the i'th term of -57, -323, -589? -266i + 209 What is the s'th term of 30122, 30126, 30142, 30176, 30234, 30322? s3 - 3s + 30124 What is the i'th term of 64, 156, 258, 370? 5i2 + 77i - 18 What is the f'th term of -5413, -5419, -5425, -5431, -5437? -6f - 5407 What is the t'th term of -242, -304, -414, -578, -802, -1092, -1454, -1894? -t3 - 18t*2 - t - 222 What is the d'th term of -435, -844, -1217, -1536, -1783? 3d*3 - 430d - 8 What is the t'th term of 1126, 1073, 1022, 973? t*2 - 56t + 1181 What is the d'th term of -28, -20, 84, 332, 772, 1452, 2420? 8d3 - 48d + 12 What is the h'th term of -22, 76, 194, 344, 538, 788, 1106? 2h3 - 2h*2 + 90h - 112 What is the w'th term of 6, -52, -96, -120, -118? w3 + w2 - 68w + 72 What is the s'th term of -13052, -13129, -13206, -13283, -13360? -77s - 12975 What is the s'th term of -6, -345, -1348, -3345, -6666, -11641, -18600? -55s3 - 2s*2 + 52s - 1 What is the v'th term of 1216, 1241, 1266, 1291, 1316? 25v + 1191 What is the v'th term of -33350, -66705, -100060, -133415, -166770? -33355v + 5 What is the m'th term of -126, -449, -986, -1737, -2702, -3881? -107m2 - 2m - 17 What is the v'th term of 299, 499, 713, 947, 1207, 1499, 1829, 2203? v3 + v2 + 190v + 107 What is the s'th term of 112617, 112616, 112615, 112614? -s + 112618 What is the v'th term of -956, -5476, -13008, -23552, -37108, -53676, -73256? -1506v*2 - 2v + 552 What is the d'th term of -1764, -3601, -5438, -7275? -1837d + 73 What is the p'th term of -41227, -41229, -41233, -41239, -41247? -p2 + p - 41227 What is the g'th term of -397, -747, -1097? -350g - 47 What is the r'th term of 828, 1715, 2604, 3495, 4388, 5283, 6180? r*2 + 884r - 57 What is the d'th term of 42770, 42768, 42766, 42764, 42762, 42760? -2d + 42772 What is the u'th term of 16999, 16963, 16913, 16843, 16747? -u3 - u2 - 26u + 17027 What is the l'th term of -4403, -35212, -118831, -281666, -550123? -4401l3 + l2 - 5l + 2 What is the b'th term of -186, -479, -778, -1083, -1394, -1711, -2034? -3b2 - 284b + 101 What is the l'th term of -1520, -1525, -1534, -1547? -2l2 + l - 1519 What is the m'th term of -348, -680, -1026, -1386, -1760, -2148? -7m*2 - 311m - 30 What is the p'th term of 1145, 2326, 3509, 4694, 5881, 7070, 8261? p*2 + 1178p - 34 What is the b'th term of -16964, -17007, -17052, -17099, -17148, -17199, -17252? -b*2 - 40b - 16923 What is the t'th term of -256, -846, -1830, -3208, -4980? -197t2 + t - 60 What is the q'th term of -479, -605, -723, -833? 4q*2 - 138q - 345 What is the a'th term of -5951, -11326, -16701, -22076, -27451, -32826? -5375a - 576 What is the t'th term of -780, -804, -786, -720, -600, -420? t3 + 15t*2 - 76t - 720 What is the l'th term of 2069, 2075, 2081, 2087, 2093? 6l + 2063 What is the w'th term of 3567, 14252, 32059, 56988? 3561w*2 + 2w + 4 What is the y'th term of 3929, 8063, 12197? 4134y - 205 What is the b'th term of -26169, -26165, -26161, -26157, -26153? 4b - 26173 What is the i'th term of -37, 10, 123, 332, 667, 1158? 5i3 + 3i*2 + 3i - 48 What is the f'th term of -1131550, -1131547, -1131542, -1131535? f*2 - 1131551 What is the p'th term of 172, 117, 24, -107? -19p*2 + 2p + 189 What is the j'th term of -488, -1845, -4076, -7181, -11160, -16013, -21740? -437j2 - 46j - 5 What is the h'th term of -347096, -694191, -1041286? -347095h - 1 What is the i'th term of -40869, -40833, -40797, -40761, -40725, -40689? 36i - 40905 What is the a'th term of 715, 1668, 2851, 4258, 5883, 7720? -a*3 + 121a*2 + 597a - 2 What is the q'th term of 1775, 7099, 15975, 28409, 44407, 63975, 87119? q*3 + 1770q*2 + 7q - 3 What is the h'th term of -138301, -138303, -138305, -138307? -2h - 138299 What is the k'th term of 6250, 7048, 7844, 8638, 9430, 10220, 11008? -k2 + 801k + 5450 What is the m'th term of 9649, 9797, 9945, 10093? 148m + 9501 What is the u'th term of -57787, -57769, -57715, -57607, -57427? 3u*3 - 3u - 57787 What is the t'th term of -7539, -30162, -67867, -120654, -188523? -7541t2 + 2 What is the w'th term of -236, -238, -234, -218, -184, -126? w3 - 3w*2 - 234 What is the f'th term of -98, -122, -204, -374, -662, -1098? -5f3 + f2 + 8f - 102 What is the w'th term of 63, 177, 277, 357, 411? -w3 - w2 + 124w - 59 What is the k'th term of 7140, 7144, 7150, 7158, 7168, 7180, 7194? k2 + k + 7138 What is the o'th term of -1333, -2672, -4007, -5332, -6641? o3 - 4o2 - 1334o + 4 What is the x'th term of -5096, -5173, -5300, -5477, -5704? -25x2 - 2x - 5069 What is the q'th term of -309374, -618744, -928114? -309370q - 4 What is the s'th term of -524, -1064, -1604, -2144, -2684, -3224? -540s + 16 What is the r'th term of -9762, -9763, -9772, -9795, -9838? -r*3 + 2r*2 - 9763 What is the i'th term of 176, 785, 2452, 5705, 11072, 19081, 30260, 45137? 88i3 + i2 - 10i + 97 What is the c'th term of 23, 22, 23, 32, 55, 98? c3 - 5c*2 + 7c + 20 What is the x'th term of 166116, 166117, 166118, 166119, 166120? x + 166115 What is the j'th term of 7329, 14649, 21963, 29271? -3j2 + 7329j + 3 What is the s'th term of 5227, 10455, 15683, 20911, 26139, 31367? 5228s - 1 What is the g'th term of 1290, 5145, 11566, 20553, 32106, 46225? 1283g*2 + 6g + 1 What is the g'th term of 69, -187, -1067, -2883, -5947, -10571? -52g3 + 108g + 13 What is the l'th term of 120, 515, 1184, 2127, 3344, 4835, 6600? 137l2 - 16l - 1 What is the w'th term of 9205, 9202, 9199, 9196, 9193, 9190? -3w + 9208 What is the q'th term of -2218, -2911, -3604, -4297? -693q - 1525 What is the x'th term of 133, 1347, 4631, 11017, 21537, 37223, 59107, 88221? 172x3 + 3x2 + x - 43 What is the s'th term of 3318, 3323, 3338, 3369, 3422, 3503, 3618? s3 - s*2 + s + 3317 What is the c'th term of 72, 513, 1248, 2277? 147c*2 - 75 What is the n'th term of -196, -284, -428, -628? -28n*2 - 4n - 164 What is the g'th term of 116, 237, 482, 845, 1320? -g*3 + 68g*2 - 76g + 125 What is the a'th term of -993, -2042, -3075, -4092, -5093? 8a2 - 1073a + 72 What is the p'th term o	{ "pile_set_name": "DM Mathematics" }
f2l - 739bf - 86bl wrt f. -4b3 - 53283656bl Find the third derivative of 1041488j*5 - 2970008j*2. 62489280j*2 What is the second derivative of -33236c*2o*2 + 35606c*2o - 212co*2 - 16co wrt o? -66472c*2 - 424c Find the third derivative of 3d3p*4 - 63d*3p*2 - 8d*3p + 4d3 + 18d*2p2 - d2 - p*5 - 6097133p*3 wrt p. 72d*3p - 60p2 - 36582798 What is the second derivative of 1285226i*2w*2z + i*2wz + 7iw + 1015iz - 5wz - 3w - 1 wrt w? 2570452i2z Find the second derivative of -8995095j2p*3 - 6259jp2 - jp - 2j - 522p*3 wrt j. -17990190p*3 What is the second derivative of 19964x*3 - 1368x*2 + 2x - 100772803 wrt x? 119784x - 2736 What is the second derivative of 25364009a*2 - 30454016a wrt a? 50728018 What is the second derivative of 11532299b5 - 42b*4k*2 - bk*2 - 3bk + 254k*2 - 3k + 2318 wrt b? 230645980b3 - 504b*2k*2 Find the second derivative of 559nv4 + 2nv - 6n - 40060v5 - 2676444v wrt v. 6708nv*2 - 801200v*3 Find the second derivative of -158373296k*2 + 72089430k wrt k. -316746592 Find the second derivative of -1178262q3 + 20084895q. -7069572q Find the third derivative of -39111m*4o + m*4 - 2m*3o - 2929013m2o wrt m. -938664mo + 24m - 12o Find the first derivative of 6f4 + 1111205f + 435987428. 24f3 + 1111205 What is the third derivative of -503muy*4 - 101933muy*2 - 87mu - 146759my6 - 11my wrt y? -12072muy - 17611080my*3 What is the second derivative of 75721786c*2i*3 - 98691ci - 2i*3 - 11i*2 wrt c? 151443572i3 Find the second derivative of -n3q2 - 2n*3q + 4n3 - 82n*2q*2 + 23n*2 + 3nq + 147987q*2 - 4q + 339 wrt q. -2n3 - 164n*2 + 295974 Find the second derivative of -9893233h*2 - 5015208h wrt h. -19786466 What is the second derivative of 2573r4 - 2798r*3 - 55987254r wrt r? 30876r2 - 16788r Differentiate -h*2qy + 6h*2y - 21265479hqy + 33815536hy + qy with respect to q. -h*2y - 21265479hy + y What is the third derivative of 59433452z3 - 6169330z*2 wrt z? 356600712 What is the third derivative of -9x*5 + 299511x*4 - 16x3 - x2 + 78009079x + 1? -540x*2 + 7188264x - 96 Differentiate -2625a2s + 752a2 - 15916as - 55890 wrt s. -2625a*2 - 15916a Find the second derivative of -3a3 + 4724a*2j*3 + 49a*2j - aj3 - 238996aj2 + aj - 2a - 3j*3 - 2j wrt a. -18a + 9448j*3 + 98j Find the second derivative of -697859048ay*2 - 2ay + 55412564a - y wrt y. -1395718096a Find the third derivative of -133736766s*3 - 7s*2 + 25s + 53338. -802420596 Find the second derivative of -234660644w2 + 83w + 66498. -469321288 Find the third derivative of -1382r2z*3 + 5r*2z*2 - 6754r*2 + 81rz3 + 5r - 49z3 - 208z*2 wrt z. -8292r*2 + 486r - 294 What is the derivative of 3dx - 223588d - 1100572x - 16 wrt x? 3d - 1100572 Find the third derivative of 35830530m*5 - 17772881m*2. 2149831800m*2 What is the second derivative of 10547599a*4 - 3320293a wrt a? 126571188a2 What is the derivative of -16262520b*3n - 3b3 + 803198b*2 - 4n wrt n? -16262520b3 - 4 Find the third derivative of 1357fh2s*3 - 21fh2s*2 - 2fh2s - 81fhs2 + 175hs3 - 139hs2 wrt s. 8142fh2 + 1050h Find the third derivative of -2t5 + 23960557t*3 + 19193092t*2 - 3 wrt t. -120t*2 + 143763342 What is the derivative of -16086238x*4 + 150732371? -64344952x*3 What is the second derivative of 2109676u*2v3 + u2v2 + 6u*2v - 277uv + 198v wrt v? 12658056u*2v + 2u2 Differentiate -112335009r*3 + 24156170 with respect to r. -337005027r*2 What is the first derivative of -113318881f*4 + 129814146 wrt f? -453275524f*3 What is the first derivative of 312658i*2l*3 + 451101142i*2 + 819l wrt l? 937974i2l*2 + 819 Find the third derivative of 27036975u*3 + 17995089u*2. 162221850 Differentiate 12i*2 - 2468815i - 18792476 wrt i. 24i - 2468815 What is the second derivative of 51916498o*2 + 4221589o - 1? 103832996 What is the second derivative of -18o5 + 98o*4 - 554o*2 + 263461524o wrt o? -360o3 + 1176o*2 - 1108 What is the second derivative of -6z*5 + 4031336z*3 + 109663z - 148? -120z3 + 24188016z Differentiate -18sv*2 - 2sv - 196s + 63v2 - 10v + 189 with respect to v. -36sv - 2s + 126v - 10 What is the third derivative of -495299q6 - 243q*4 + 9q*2 + q + 546748 wrt q? -59435880q*3 - 5832q Differentiate 14612998y3 - 14471827 wrt y. 43838994y*2 What is the second derivative of 780o*5r - 117181o5 + 16or + 1381784o wrt o? 15600o3r - 2343620o3 What is the third derivative of -dp*2x + 91715dpx3 + 27dpx + 60p2x*3 + 11p*2x - 151px*2 wrt x? 550290dp + 360p*2 What is the second derivative of 8029019v*4 - 14v + 23422? 96348228v2 Differentiate 4d*3o*2 - 2d*3 - 2556756d*2o*3 - 65022d*2 - 37 wrt o. 8d*3o - 7670268d2o*2 What is the second derivative of -139876961h*2 - 48476730h? -279753922 Differentiate -96738285i + 28126002. -96738285 What is the first derivative of 5lt + 214681632l - 157807530t wrt t? 5l - 157807530 What is the second derivative of -cv3 + 1448153cv + 68v*3 + 97184v*2 - 5v wrt v? -6cv + 408v + 194368 What is the first derivative of 980228d*2k*2 + 31dk2 + 72907k*2 - k - 57 wrt d? 1960456dk2 + 31k*2 What is the first derivative of 368715942x + 375312438? 368715942 What is the first derivative of -15x4 - 472x*3 - 22x - 43936572 wrt x? -60x3 - 1416x*2 - 22 What is the first derivative of 520k*3m*3p - 2k3m*2 - 2k*2m - 252m3p + 670519m3 wrt p? 520k*3m*3 - 252m*3 What is the first derivative of -77z*2 + 62925z - 3851883? -154z + 62925 What is the second derivative of 3p*3 - 1032659p*2 - 73245212p wrt p? 18p - 2065318 Find the second derivative of -120x*5 - 177447x*3 - 2x*2 - 14066522x + 1. -2400x3 - 1064682x - 4 Find the first derivative of g*2j - 85889g2 + 66gj2 - 4gj + 21j2 - 1 wrt j. g2 + 132gj - 4g + 42j What is the third derivative of -16449797z4 + 1074304z*2 + 1 wrt z? -394795128z Differentiate 81bj*2 - 9bjt + 163bt + 26b - 10jt - 6j - 5t wrt j. 162bj - 9bt - 10t - 6 What is the first derivative of -111805511h + 384800496? -111805511 Find the third derivative of -1275119299o*4 - 23o*2 + 13o - 101636 wrt o. -30602863176o What is the derivative of 7a*2fm2 + 2a*2m*3 - 58a*2m*2 - 2202a*2m - 2a2 + 10am - 5685311fm3 wrt f? 7a*2m*2 - 5685311m*3 What is the derivative of -459cp2x - 5088cx*2 + 14689p*2x*2 + 35p*2x - 2p2 wrt c? -459p*2x - 5088x2 Find the third derivative of 11684412d*6 + 7d*2 - 728509d. 1402129440d3 Find the second derivative of 2481550c*4t*2 + 3c*3t*3 + 304ct2 + ct + 10c - 13t*3 + t wrt c. 29778600c*2t*2 + 18ct3 Differentiate -483270998f*3 - 1120088268. -1449812994f*2 What is the third derivative of 2529k5 + k4 - 16k3 + 3k*2 + 522404k wrt k? 151740k2 + 24k - 96 What is the first derivative of 11191258b3 + 12b*2 - 507295595? 33573774b*2 + 24b What is the second derivative of 63a2s*2 + 3a*2s + 701a2 + 108629as2 + 2as + 3a - 14s2 + 214s - 2 wrt s? 126a2 + 217258a - 28 What is the first derivative of -8fk + 642f + 373451k*2 - 3733 wrt k? -8f + 746902k Find the third derivative of -4194865n*3 - 2n*2 - 8403n - 49 wrt n. -25169190 Find the first derivative of 31518bl*3 + 511bl2 - 73585194l*3 wrt b. 31518l*3 + 511l*2 What is the derivative of 2h*2l + 27151h2 + 10hl + 24h + 204159042l wrt h? 4hl + 54302h + 10l + 24 What is the third derivative of -238b*4 + 294235b*3 + 132628600b*2? -5712b + 1765410 Differentiate 472843926c2 - 343220611 with respect to c. 945687852c Differentiate 9g4s*2 - 131060g*4 + 3s*2 - 5s + 122908 wrt g. 36g3s*2 - 524240g*3 Differentiate -46021m*3n + 20m3 - 35m*2 - 6mn + 4m + 8 wit	{ "pile_set_name": "DM Mathematics" }
9860? 9 What is the units digit of 1930906? 6 What is the tens digit of 3297338? 3 What is the hundred thousands digit of 1263428? 2 What is the ten thousands digit of 2478467? 7 What is the hundred thousands digit of 8416767? 4 What is the millions digit of 10046995? 0 What is the ten thousands digit of 294159? 9 What is the hundreds digit of 2320046? 0 What is the tens digit of 8362904? 0 What is the hundred thousands digit of 36757362? 7 What is the units digit of 2144581? 1 What is the units digit of 2471749? 9 What is the tens digit of 22040751? 5 What is the hundreds digit of 1371586? 5 What is the hundred thousands digit of 594300? 5 What is the units digit of 1245877? 7 What is the tens digit of 9828? 2 What is the ten thousands digit of 457399? 5 What is the units digit of 1202289? 9 What is the tens digit of 13287962? 6 What is the thousands digit of 250206? 0 What is the units digit of 15924453? 3 What is the thousands digit of 215144? 5 What is the units digit of 97567? 7 What is the thousands digit of 249504? 9 What is the thousands digit of 237034? 7 What is the millions digit of 3777934? 3 What is the units digit of 883734? 4 What is the ten thousands digit of 1421043? 2 What is the ten thousands digit of 112493? 1 What is the millions digit of 8148107? 8 What is the hundreds digit of 332697? 6 What is the thousands digit of 332182? 2 What is the hundreds digit of 82038? 0 What is the ten thousands digit of 25868334? 6 What is the hundred thousands digit of 1150467? 1 What is the units digit of 146537? 7 What is the units digit of 294992? 2 What is the millions digit of 4493993? 4 What is the hundreds digit of 2837593? 5 What is the hundreds digit of 130971? 9 What is the units digit of 4480952? 2 What is the ten thousands digit of 5450449? 5 What is the ten thousands digit of 189683? 8 What is the tens digit of 121417? 1 What is the hundred thousands digit of 5988415? 9 What is the units digit of 414078? 8 What is the ten thousands digit of 92008? 9 What is the hundred thousands digit of 379371? 3 What is the hundred thousands digit of 799704? 7 What is the millions digit of 3842661? 3 What is the thousands digit of 3343987? 3 What is the units digit of 76886? 6 What is the thousands digit of 372098? 2 What is the hundreds digit of 3565559? 5 What is the millions digit of 3833738? 3 What is the units digit of 2686949? 9 What is the ten thousands digit of 267430? 6 What is the hundreds digit of 212894? 8 What is the hundreds digit of 154195? 1 What is the thousands digit of 749034? 9 What is the ten thousands digit of 148560? 4 What is the hundred thousands digit of 20608353? 6 What is the tens digit of 901773? 7 What is the tens digit of 29775439? 3 What is the thousands digit of 780497? 0 What is the hundred thousands digit of 8318636? 3 What is the tens digit of 7382211? 1 What is the units digit of 12989474? 4 What is the units digit of 6988959? 9 What is the hundred thousands digit of 220516? 2 What is the hundreds digit of 38435? 4 What is the units digit of 278711? 1 What is the ten thousands digit of 12906284? 0 What is the units digit of 9449948? 8 What is the thousands digit of 2917366? 7 What is the thousands digit of 350333? 0 What is the hundreds digit of 3019847? 8 What is the units digit of 111581? 1 What is the tens digit of 139126? 2 What is the hundreds digit of 668253? 2 What is the hundreds digit of 576107? 1 What is the units digit of 4878993? 3 What is the hundred thousands digit of 5128165? 1 What is the hundred thousands digit of 2883485? 8 What is the hundred thousands digit of 148056? 1 What is the thousands digit of 179264? 9 What is the units digit of 3852377? 7 What is the ten thousands digit of 2919080? 1 What is the millions digit of 4629096? 4 What is the ten millions digit of 22314789? 2 What is the hundred thousands digit of 1319750? 3 What is the hundreds digit of 9403? 4 What is the units digit of 20366370? 0 What is the thousands digit of 7191913? 1 What is the millions digit of 3127758? 3 What is the ten thousands digit of 886352? 8 What is the units digit of 3996942? 2 What is the thousands digit of 11931539? 1 What is the hundred thousands digit of 3777423? 7 What is the hundred thousands digit of 1942453? 9 What is the hundred thousands digit of 739862? 7 What is the tens digit of 1121870? 7 What is the units digit of 8692841? 1 What is the millions digit of 42009272? 2 What is the tens digit of 1714908? 0 What is the ten thousands digit of 772397? 7 What is the hundred thousands digit of 2245877? 2 What is the thousands digit of 2747142? 7 What is the hundred thousands digit of 4232723? 2 What is the units digit of 774486? 6 What is the hundreds digit of 5432795? 7 What is the hundred thousands digit of 1395517? 3 What is the millions digit of 2108805? 2 What is the ten thousands digit of 1023994? 2 What is the hundred thousands digit of 2898443? 8 What is the units digit of 1516982? 2 What is the hundreds digit of 1993036? 0 What is the units digit of 4327294? 4 What is the thousands digit of 65072? 5 What is the units digit of 133304? 4 What is the tens digit of 17396? 9 What is the millions digit of 18081717? 8 What is the hundred thousands digit of 406033? 4 What is the hundred thousands digit of 3159161? 1 What is the hundred thousands digit of 191087? 1 What is the tens digit of 206454? 5 What is the units digit of 2919281? 1 What is the hundreds digit of 345390? 3 What is the tens digit of 310241? 4 What is the hundreds digit of 1857026? 0 What is the tens digit of 1150742? 4 What is the tens digit of 395984? 8 What is the tens digit of 1881157? 5 What is the units digit of 19567038? 8 What is the tens digit of 6162794? 9 What is the ten thousands digit of 220654? 2 What is the thousands digit of 518620? 8 What is the thousands digit of 537439? 7 What is the tens digit of 1627541? 4 What is the ten thousands digit of 172347? 7 What is the tens digit of 1745019? 1 What is the thousands digit of 510437? 0 What is the thousands digit of 645885? 5 What is the ten thousands digit of 1867308? 6 What is the units digit of 1778566? 6 What is the thousands digit of 35750419? 0 What is the hundreds digit of 926191? 1 What is the tens digit of 250951? 5 What is the units digit of 115603? 3 What is the ten thousands digit of 132717? 3 What is the units digit of 407868? 8 What is the ten thousands digit of 15661623? 6 What is the hundred thousands digit of 379814? 3 What is the units digit of 298309? 9 What is the thousands digit of 165980? 5 What is the units digit of 166394? 4 What is the tens digit of 377350? 5 What is the ten thousands digit of 1852002? 5 What is the thousands digit of 331444? 1 What is the hundred thousands digit of 546664? 5 What is the hundreds digit of 493629? 6 What is the ten millions digit of 13324959? 1 What is the thousands digit of 10067? 0 What is the thousands digit of 1352095? 2 What is the hundred thousands digit of 9647650? 6 What is the thousands digit of 8302849? 2 What is the ten thousands digit of 336244? 3 What is the thousands digit of 143893? 3 What is the millions digit of 1905127? 1 What is the ten thousands digit of 50852? 5 What is the hundreds digit of 1289823? 8 What is the thousands digit of 3591750? 1 What is the hundreds digit of 1741927? 9 What is the ten millions digit of 21110195? 2 What is the thousands digit of 830234? 0 What is the ten thousands digit of 208280? 0 What is the tens digit of 704490? 9 What is the millions digit of 9237519? 9 What is the millions digit of 7311671? 7 What is the units digit of 1091253? 3 What is the hundred thousands digit of 313858? 3 What is the ten thousands digit of 254632? 5 What is the thousands digit of 5546075? 6 What is the ten thousands digit of 131178? 3 What is the tens digit of 3266151? 5 What is the hundreds digit of 1460988? 9 What is the tens digit of 6855326? 2 What is the tens digit of 260338? 3 What is the thousands digit of 190773? 0 What is the hundreds digit of 1961319? 3 What is the hundreds digit of 2214883? 8 What is the millions digit of 3543637? 3 What is the units digit of 12809404? 4 What is the hundred thousands digit of 1261204? 2 What is the millions digit of 1188224? 1	{ "pile_set_name": "DM Mathematics" }
-5o - 1. Let i = -3 - h. Solve 5 = -it + 5u, 5t + 0 = 3u - 1 for t. 1 Suppose 4f - 5y = -29, 3f - 2f - y = -6. Let a = f + 5. Solve -10 = 2x - 3m - m, -3x + 5 = am for x. -1 Suppose 6 - 4 = d. Suppose -r = -5j - 18 - 10, 0 = -5j - 25. Solve dq + 7 = rk, 0k + 5k - 25 = 0 for q. 4 Let q = 21 - -16. Let v = q - 21. Solve 0 = 4w + 4f + v, 2w - 7w = -4f + 29 for w. -5 Let s(g) = 15 - 12g + 9g2 - g2 + 4g2 - g3. Let k be s(11). Solve -3c + 2w = kw + 16, 2 = c - 3w for c. -4 Let p = 7 - 7. Let t(w) = 4w*2 + w - 5w + 0w3 + 3 - w3. Let v be t(3). Solve p = -5a - vi + 3i + 10, -a + i + 2 = 0 for a. 2 Suppose b + 7 + 5 = 4u, b - 6 = -2u. Suppose 1 = z - 4. Solve -zf = -2d + d + 3, ud = -2f - 8 for f. -1 Let m be (-1 - 0) + (-14 - -18). Solve -4x + 14 - 33 = n, 4x - mn = -7 for x. -4 Suppose i + 18 = 4i. Solve -2m = 5y - 6, y - i = -2m - 0m for m. 3 Let t(z) = -4z - 20. Let s be t(-6). Suppose m = 4k + 4, -m + 3 = -2m - 3k. Let y be 2/sm/(-3). Solve y = 2v - 3i - 4, -i = -2v - 3i - 6 for v. -1 Let y = 63 + -44. Solve a - y = 4p - 5, 0 = 5a + 10 for p. -4 Suppose -2q + 23 - 5 = 0. Solve -3l - v = -q, 0l - 2l - 3v - 1 = 0 for l. 4 Let q be 7/28 - 2/8. Suppose -6n = -9n + 12. Solve 2y + 3o + 10 = q, -ny + 3o = -y - 15 for y. 1 Let f = -52 - -72. Solve -f = -4b + 2x, 2b - x - 2 = -4x for b. 4 Suppose -3p - 6 = -5g - 2p, g - p + 2 = 0. Solve 3v + g = 3a - 2a, 4 = -a for v. -2 Let c(b) = -b + 13. Let x be c(0). Suppose w - 5t + t = -x, w = -2t + 11. Solve -10 = -5p + wi, 0 = 3p - i - 4 - 2 for p. 2 Let c be (-2)/(-6)(15 - -6). Suppose -3o - 4i = -3, o - c = 3i + 7. Solve 0 = -of - u + 12, u = 3f - 2f for f. 2 Let h be 16/20(-5)/2 + 7. Solve 3u = 2v + v - 3, -5u - hv = -45 for u. 4 Let f = -10 - -18. Let i be 3 + (-4)/(f/(-2)). Solve -3 = it + h, -3t - h = -3 + 4 for t. -2 Suppose 12q - 14q = -8. Solve -4 + 33 = -3u + 5z, 13 = u + qz for u. -3 Let d be (-10 - 2)(-4)/12. Let y be 0 + 1 + 2 + 2. Let l be (8/(-10))/((-2)/y). Solve -z + 4k = -dz - 14, 5k = 4z - l for z. -2 Let f(h) = 2h*2 - 2h - 1. Let v = 10 - 7. Let q be f(v). Solve -2a + 0a + 19 = -5m, -3a = -4m - q for m. -5 Let s be 0 + -1 + (-4 - 6). Let v be s/(-3) + (-6)/(-18). Solve 5y - vi - 3 = 3, -3y = 5i - 11 for y. 2 Let l(v) = -2v - 9. Let m(y) = -5y - 19. Let r(j) = 7l(j) - 3m(j). Let b be r(8). Solve -3t - 2p - 12 = -4p, 0 = bt + 4p + 8 for t. -4 Let k(b) = 2b2 - 2b - 11. Let w be k(4). Let v be 2/8 + (-2)/8. Solve 3h + 4g + 0g + w = v, -3h + 2g + 11 = 0 for h. 1 Suppose 3j - 16 = -0s - s, 2s + 12 = 5j. Solve -3v = -v + x - 5, 4v + jx = 20 for v. 0 Suppose -5l + 48 = -62. Suppose j + j - l = -5z, 3j - 15 = -3z. Solve -3r + 9 = k, 5r - 3r - j = k for r. 2 Let m(b) = b2 - 8b - 13. Let a be m(10). Let o = a + -5. Solve v - 4v - 28 = 5w, 0 = 5w - ov + 23 for w. -5 Let m(g) = g + 12. Let d be m(-9). Suppose -ds - 23 - 32 = 2q, 3s - 2q = -71. Let l be (-6)/s - (-26)/7. Solve 11 = -ln - c, 5 = 4c + 1 for n. -3 Let h = -6 - -6. Suppose -2b + 6 = -0b - 2v, h = b + 2v + 6. Solve 5z + bz - 15 = -3w, -4w + 15 = 5z for w. 0 Let i = 7 + -4. Let o = 0 - i. Let f be o15/(3-1). Solve -3r = b + 3, -5r + 2b + f = -3b for r. 0 Let n = -29 + 34. Suppose -3t + 5m = -17, 2t + m - n = -2m. Solve -3k = 4u - 1, tk + 12 = -6u + 4u for u. 4 Suppose -3v - 5b = -7, -3v + 3b + 7 = -2v. Let d = 1 + 2. Solve 2m - 5i = -0m - 6, -dm + i = -v for m. 2 Let g(s) = -s3 + 9s*2 + s - 10. Let i be g(9). Let w be i + 5 - (-2)/(-1). Solve -2k - h + 11 = 0, 3k = k - wh + 14 for k. 4 Let r be 2/(-7) - 4/(-14). Let a(w) = -w3 - w2 + 8. Let m be a(0). Let x = -4 + m. Solve xf - 2u - 14 = r, 5u - u + 16 = 5f for f. 4 Suppose i - 2l + 5 - 14 = 0, -4i + 4l + 24 = 0. Solve m = o - im - 3, o = -m + 3 for o. 3 Let t(f) = -6f - 3. Let a be t(-4). Solve -6 = 3n + n - 2g, -a = 4n + 3g for n. -3 Let h be 1/(-3)0 + 3. Suppose -a - a + 18 = 0. Suppose hy - 5y + a = b, y = b. Solve z + 18 = c - bz, -c = -5z - 22 for c. 2 Suppose -5x - 4v + 0v - 20 = 0, -2x - 2v = 10. Solve 3 = -j - xj - 2w, -5j - w + 3 = 0 for j. 1 Suppose -4 = -m - 0. Suppose mr - 2w = 164, 0r = -3r + 3w + 126. Suppose -3j - 13 = -r. Solve -q + 2b - j = 4b, -4q - b - 22 = 0 for q. -5 Suppose 17 - 56 = -3r. Let h = r - 13. Solve 5b + 0b + 5o + 35 = h, -o = -4b - 13 for b. -4 Let m be 22/((-4)/3). Let k = -1 - m. Suppose 3c + o = 5c - 10, 3c + o = 15. Solve ca = 0, -a - ka - 20 = 5z for z. -4 Let k(q) = -q3 - q2 + q + 2. Let y be k(-2). Let p(r) = -4r*3 - 2r*2 - 2r - 1. Let v be p(-1). Solve -ym = vg + 21, 0m - 15 = 5m for g. -3 Suppose -4i - 19 = -51. Solve 6j - 2j - 2y = -i, -2j = y for j. -1 Let n = 12 - 7. Suppose 0 = 4z - 4, 0 = -4c - c + nz + 55. Suppose 2h = -2h + c. Solve -hm - y = 11, -3m - 7y + 5 = -2y for m. -5 Suppose 4u = -2u + 30. Solve 5x = -0w + 2w + 10, x = w + u for w. -5 Let l = -1 + 4. Solve -4a = -4c - la - 16, 4 = -c + a for c. -4 Let p(y) = y - 3. Let v be p(7). Let s = 6 - 1. Suppose -sh + 0h = -15. Solve 0 = -4i, -vi - h = -3q + 3 for q. 2 Suppose -5y = 2z - 14, -6y - 2z = -3y - 6. Let p(l) = -l*2 + 4l. Let m be p(y). Suppose 2u = -mu. Solve 2w + uo - 3 = -o, 0 = 5o - 15 for w. 0 Let s = 8 + -6. Suppose o - 5c = -10, -5 - 1 = -sc. Suppose -2x + 0x + 31 = 5t, 4x - ot + 13 = 0. Solve xv = -4h - 23, 5v - h = 3h - 17 for v. -5 Suppose -2n = 2n - 8. Suppose -no + 85 = 3o. Solve -f = f - 10, 3v = -f + o for v. 4 Let d(o) = o3 - 13o*2 + 11o + 15. Let m be d(12). Solve mr = -2r + 4t - 17, 3r + 11 = 2t for r. -5 Let h = -6 - -6. Solve -3k - 2v + 2 + 1 = h, -7 = -2k - 3v for k. -1 Let v be 2/2(4 - -5). Solve 0 = -g - n + 6n + 15, 3n - v = -3g for g. 5 Let a(w) = -w - 2. Let c be a(-4). Suppose -cm = 3m - 20. Solve 4s = m, 6s + 4 = -2t + 2s for t. -4 Let h(b) = 7b - 3b3 + 4b*2 - 2 + 2b*3 - 2. Let d be h(5). Let m = d - 1. Solve 5r = -mz - 0z + 40, 0 = 5z - 15 for r. 5 Suppose -2z - 3z = 3m - 26, -2m + 22 = 4z. Suppose 5d = -0d + 5. Solve r = -3f - z, -4f + 7f = r + d for r. -4 Suppose 0 = -2i - u + 4u + 17, 5u = -15. Solve a = -4, -g - a = -ig - 5 for g. -3 Let c(t) = -t + t2 - t2 - t3. Let p be c(0). Let f be 12 - -1(1 - p). Solve -2v + 2k - 16 = 0, 7 + f = -4v + k for v. -4 Let r(n) = n3 - 5n*2 + 4n + 2. Let l be r(4). Suppose 0 = lk + 3k - 20. Solve 3p = 4p, 0 = -y - p + k for y. 4 Suppose 5o - 16 = 9. Suppose 9c - on = 4c + 40, 3n = -c - 12. Suppose -4h - 2q + 22 = 0, 7 = 3h - q - 2. Solve -hb + 2 = 2a, b = cb - a + 1 for b. 0 Suppose 18 = 4y - 2, -5a = 3y - 45. Suppose -23 = -5h - 4s, -4 + a = s. Solve -2b - 10 = -5r, 0 = -5r + hb + b + 20 for r. 0 Suppose -4k + 33 = 17. Solve -3n = -2l + 20, 3n = n - l - k for n. -4 Let f(z) = z*2 - 2z - 5. Suppose 5j + 4n = 20, j = 3j + 2n - 8. Let a be f(j). Solve 0 = at - 0t - g - 11, -2t - g = -9 for t. 4 Let z = 14 + -9. Suppose zm = -5h + 25, 4m + 0h - 20 = 5h. Solve -15 = -mi, -2t - 8 = -3i - 1 for t. 1 Suppose 3p - y = p - 2, -5y = -5p. Let s be p/(-3) - (-4)/3. Solve -sl - 5 = -k - 1, 3k - 4l = 8 for k. 0 Suppose n + 24 = -3n + 2l, 2l + 16 = -4n. Let f = 0 - n. Solve 0 = 5a + 5c - 5, -4c + f = 2a + c for a. 0 Suppose 17 = 5v + g, 0 = v + g + g + 2. Let j(r) = 7r + 11. Let i be j(-1). Solve 4m = -3d - 2, -id + vm = -0d + 12 for d. -2 Suppose 0n - 4 = 4z + n, 5n + 20 = -2z. Suppose zr + r - 5 = 0. Suppose j + 0j - 4 = 0. Solve -rt - 11 = -jy, -4t - 9 = -t for y. -1 Let u be (2 + -2)/(-3) - -3. Suppose t = 4t - u. Let c be (-13)/(-4) + 1/(-4). Solve -t = p, -cp - 2 = x - 0x for x. 1 Suppose 4c + 0o = 5o - 25, -25 = -c - 5o. Suppose -3r + 24 = -0b + 3b, -2r - 4 = -2b. Solve cf - f + b = j, 4f - 3j - 6 = 0 for f. 3 Suppose -6 = x - 4x. Let k be (x/4)/((-1)/(-10)). Solve 4f = -4b - 28, 3b + 1 = 2f - k for f. -3 Let v be (-4)/(-18) - 129/(-27). Suppose 5b - v = 5. Suppose 0 = 2w + 3w. Solve 2d + p + 3 = w, d - 2p - 3 = b*d for d. -1 Let	{ "pile_set_name": "DM Mathematics" }
e the prime factors of 41(5 - 24/z)? 41 Let h = -6616 - -24304. List the prime factors of h. 2, 3, 11, 67 Let p(l) = -l3 - 10l*2 - 6l + 11. Let a = 5 + -17. List the prime factors of p(a). 7, 53 Let t = -131 + 129. List the prime factors of t + (754/(-1))/(-2). 3, 5 Let p(t) = -t*3 + 8t*2 - 7t + 2. Let q be p(7). Suppose 7r - q = 33. Suppose 0o = -ro + 340. What are the prime factors of o? 2, 17 Let d be (-10)/(-4)(-392)/(-140). What are the prime factors of 36/(-6) + d - -243? 2, 61 Let r be -2 + 1 - -2 - 5540/20. List the prime factors of 5(r/(-10))/3. 2, 23 Let v = -87 - -87. Suppose g = k - vg - 24, 0 = -5g - 20. List the prime factors of 811/(k/285). 2, 3, 19 Let d(l) = 3l*2 + 3l + 5. Let w be (-42)/(-11) - (-4)/22. Let b be (-19 - -23)/(w/5). List the prime factors of d(b). 5, 19 Let c(g) = -g*2 - 30g + 159. Let u be c(-30). Let f = 49 + u. List the prime factors of f. 2, 13 List the prime factors of ((-1)/11)/(320/(-15097280)). 4289 Suppose 4d - 2 = -2r, 16 = 2d - r + 9. List the prime factors of d-115(-20)/10. 2, 5, 23 List the prime factors of 440/93091068 + 2/622. 2, 3, 43, 167 Suppose 186w - 5d - 13063 = 183w, 5d - 17359 = -4w. What are the prime factors of w? 2, 41, 53 Let x(o) = -548o - 143. List the prime factors of x(-3). 19, 79 Suppose -2o + 1144 = 5392. Let z = 3852 + o. List the prime factors of z. 2, 3 What are the prime factors of (-168)/(-42) + 1 + -2 + 13674? 3, 47, 97 Let p be 2415(1 - 0). Suppose g = 2k - 25, -4k - 1261 + 1281 = 4g. Suppose 0o - p = -ko. List the prime factors of o. 83 What are the prime factors of 334416/28 - (-56)/98? 2, 1493 Let u(y) = y2 - 39y - 40. Let f be u(40). Suppose f = -h - 4, -3i + h + h = -932. What are the prime factors of i? 2, 7, 11 Let q = 8349 - -7067. What are the prime factors of q? 2, 41, 47 Let d be -33 + 8 + (-3)/((-3)/4). Let g be (35/d)/(1/15). Let v = 161 - g. What are the prime factors of v? 2, 3, 31 Let j = 35835 - 28853. List the prime factors of j. 2, 3491 Let a(l) = -l + 12. Suppose -5y + 3h - 18 = -62, 5y = -3h + 26. Let r be a(y). What are the prime factors of (r + -2)(-2 + (-97)/(-3))? 7, 13 Suppose 27o - 29o + 5s + 29579 = 0, -3o = -5s - 44381. List the prime factors of o. 2, 3, 2467 Suppose -3w = -6, -86642 = -4k - 2w + w. List the prime factors of k. 2, 3, 5, 19 Suppose 699 = -2u + u. Let n = -318 - u. List the prime factors of n. 3, 127 Let u be (7/1)/(-14)14992. List the prime factors of (u/(-6))/((-96)/(-72)). 937 Let t = 267 - 263. Suppose -4k - h = -7681, -k - 5h + 9620 = tk. List the prime factors of k. 19, 101 Let r be -395/30221. Let t = 22 - r. List the prime factors of t. 421 Suppose -5b + 11837 = 568d - 566d, -3b = 5d - 7106. List the prime factors of b. 3, 263 Let p(d) = 11d*2 + 9d. Let k be p(-3). Let z = 180 - k. Let t = -71 + z. List the prime factors of t. 37 Suppose 7l = l - 114. Let b(k) = -k2 - 19k + 6. Let d be b(l). Suppose 165 = -3p + dp. List the prime factors of p. 5, 11 Let n = -21 + 26. Suppose -5w - a + 180 = 0, 3w + 2a = 4w - 47. Suppose 443 + w = nm. What are the prime factors of m? 2, 3 Suppose -13t + 30594 = -201222. What are the prime factors of t? 2, 3, 743 Suppose -z = -3y + 1, -3y - z = -0y + 1. Let x be 43 - (y + 2 - (5 - 6)). Suppose 104 = 2j + x. List the prime factors of j. 2 Let w be 2 + 5 - (-7 + 7). Suppose wl = 3l - 520. What are the prime factors of 2/3 + 77/(-21) - l? 127 Suppose 16v - 11v = 1890. Let f = 468 - v. List the prime factors of f. 2, 3, 5 Let l = 13279 + -5206. List the prime factors of l. 3, 13, 23 Suppose 40v + 0v = 377143 + 158617. What are the prime factors of v? 2, 37, 181 Suppose -2n + 271696 = 5q, 56n - 52n = q - 54304. What are the prime factors of q? 2, 3, 283 Let j(b) = b*2 - 26b + 2812. List the prime factors of j(77). 23, 293 Let u be (3 - -1)(-95)/5. Let v = u + 76. Suppose -4j + 5k + 908 = v, 4j + 6k - 7k = 908. What are the prime factors of j? 227 Let t be 1/(35/(-49))(1 + -11). Suppose 29d - 50826 = -td. What are the prime factors of d? 2, 3, 197 Let v(o) = -o2 - 87o + 188. What are the prime factors of v(-57)? 2, 13, 73 Suppose -1732 + 34947 = 3l - 4m, -m + 33205 = 3l. List the prime factors of l. 11069 Let j(a) = 1032a - 359. What are the prime factors of j(6)? 19, 307 Suppose -5k = 5d - 365, 93 = d + 3k + 28. Let v = 254 - d. List the prime factors of v. 3, 59 Suppose -44 = 5g - g. Let d(v) = -138v3 + 139v3 + v2 + 0v2 + 10v*2 - 6 - 6v. What are the prime factors of d(g)? 2, 3, 5 Suppose 959h = 992h - 173943. What are the prime factors of h? 3, 7, 251 Let r be (-1288)/42(-9)/6. List the prime factors of -39r/18-31. 13, 23 Let u(d) = d*3 + 12d*2 - 12d + 10. Let c be u(-13). Let p be 1-1 - (60/c)/4. What are the prime factors of 153 - p/4 - 2? 2, 3, 5 Let d be -5 - (-19 + -1 + (-3 - -3)). Suppose -35100 = -21o - do. List the prime factors of o. 3, 5, 13 Let x = -6641 - -9563. Let a = x - 1494. What are the prime factors of a? 2, 3, 7, 17 Let z(f) = -f2 - 7 + 0 + 3 + 12f*3 - 7f*3 + 2f. Let w be z(4). Suppose -8n - w = -12n. What are the prime factors of n? 7, 11 Let i = -666 + 674. Suppose ic - 3320 = 3264. List the prime factors of c. 823 Let n(l) = -59l - 55. Let h(g) = -g - 2. Let s(w) = 6h(w) - n(w). Let m be s(9). Suppose 4q = -4q + m. List the prime factors of q. 5, 13 Let b(d) = -28 + 13 + 10 - 49d. List the prime factors of b(-3). 2, 71 Let d(h) = 18h - 14. Let f = -377 - -409. List the prime factors of d(f). 2, 281 Let s(f) = 498f + 5. Let j be s(1). Let d = 411 + j. What are the prime factors of d? 2, 457 Suppose 23b - 15b = 288. List the prime factors of 7155/33 + (b/(-99))/(-2). 7, 31 Let w = -1483 - -8264. What are the prime factors of w? 6781 Let y(h) = -h3 + h2 - 10596. Let o be y(0). What are the prime factors of (o/18)/212/(-2)? 2, 883 Suppose 3361t - 3324t = 402375. What are the prime factors of t? 3, 5, 29 Let f(w) = -5w + 3. Let z be f(-5). Suppose -zn = -34n + 156. What are the prime factors of n? 2, 13 Let h(w) = w*2 + 44w - 268. List the prime factors of h(21). 1097 Suppose -23j + 21636 = -14j. What are the prime factors of j/30 + 158/(-1185)? 2, 5 Suppose 0 = 1385z - 1368z - 233682. What are the prime factors of z? 2, 3, 29, 79 Let n(o) = 79o3 + o2 - 3o + 2. Let t be n(1). Suppose 2p = p + t. Suppose p = 3v - 191. What are the prime factors of v? 2, 3, 5 Suppose b = 0, b - 5b + 750 = -3s. List the prime factors of ((-3)/(2/(s/3)))/1. 5 Let b(q) = -2q2 - 64q + 72. Let h be b(-33). List the prime factors of 8/h-13 - -241. 3, 79 Suppose 0 = -m + t + 7, 3 = m - 3t - 10. Suppose 335 = mw - k, w - 5k + 6k - 85 = 0. List the prime factors of w. 2, 3, 7 Suppose -4k = -6k - 2z + 4, -3k = 4z - 10. What are the prime factors of (-3)/(1358/(-676) - k)? 2, 13 Let v = -1980 + 35884. List the prime factors of v. 2, 13, 163 Suppose -7v - 16 = -15v. Suppose 0 = -4h + va + 1500 + 382, 4h + a - 1879 = 0. List the prime factors of h. 2, 5, 47 Let u be -9(-88)/(-2 + -2). Let s = u - -371. Let i = s - 98. List the prime factors of i. 3, 5 Let h be (-7024)/32(-4 - -2). Suppose 8v + h = 4439. What are the prime factors of v? 2, 5 What are the prime factors of (-1001288)/(-11) - (612/(-187))/(-18)? 2, 3, 13, 389 Let u = -1921 - -3749. What are the prime factors of u? 2, 457 Let z be ((-54)/(-8))/((4/(-2))/(-40)). Suppose -7t + 2t - 3n = -119, -5n = -5t + z. List the prime factors of t. 5 Let n(p) = -p*3 - 4p*2 + 12p - 27. Let w be n(-7). Suppose -13d - 989 = -wd. List the prime factors of d. 43 Suppose -y + 3 + 0 = 0. Suppose -81 = 218b - 219b. Suppose yj - b - 69 = 0. List the prime factors of j. 2, 5 Suppose 2b - 1200 = 842. Suppose -b = -3k + 323. What are the prime factors of k? 2, 7 Let k = -74 - -85. Let b(j) = -j3 + 12j*2 + 17j - 61. List the prime factors of b(k). 13, 19 Let h(n) = -3n - 25. Let y be h(-10). Let s(i) = i3 - 4i*2 + 5i - 6. Let o be s(y). Let k = o - 8. What are the prime factors of k? 2, 3 Suppose 6b = 3b. Suppose -4l - 2q = 2q + 32, b = -3l + 4q - 10. List the prime factors of (l + 7)/(1/89). 89 Let p(w) = 6w**2 - 4	{ "pile_set_name": "DM Mathematics" }
- 5/2h4 + 0. -h2(h + 1)(5h - 1)/2 Suppose -21d + 70522 = 70459. Let 8/15 + 2/3c*2 - 2/15c*d - 16/15c = 0. What is c? 1, 2 Let l = 8 + -3. Suppose 8f = 3f + l. Let -3u2 - u2 - f + 5u*2 - 2u*2 - 2u = 0. What is u? -1 Let y be (3 - 86/6)/((-2)/(-18)). Let j = y - -104. Factor -1/2f + 5/2f*3 - 2f*j + 0. f(f - 1)(5f + 1)/2 Let 9/2a - 1/2a*3 + 0 + 4a*2 = 0. What is a? -1, 0, 9 Let s(h) = 2 + 0 - 2 + 4h*2 + h. Let k be s(-1). Factor -3o*k - 9o*3 + 12o*2 + 4o*4 - 15o + 11o. 4o(o - 1)3 Let d(h) be the second derivative of -h6/360 + h5/60 + h4/18 + 17h*2/2 + 12h. Let s(j) be the first derivative of d(j). Factor s(x). -x(x - 4)(x + 1)/3 Let p(b) be the third derivative of 3b6/280 + 29b*5/140 + 17b*4/56 - 9b*3/14 - 272b*2. Factor p(l). 3(l + 1)(l + 9)(3l - 1)/7 Let j(y) be the first derivative of -16/5y + 25 + 2/25y5 + 1/2y*4 - 4/5y*2 + 4/5y*3. Determine u, given that j(u) = 0. -2, 1 Let k(b) be the first derivative of 1/4b*6 + 0b*3 - 3/8b*4 + 0b*2 + 0b*5 - 30 + 0b. Factor k(o). 3o3(o - 1)(o + 1)/2 Factor 3/7c*2 - 93/7c + 0. 3c(c - 31)/7 Suppose -5b = -0b + 10. Let c be (-199)/b + -2 + (-7 - -4). Find u such that -3u - 15u*2 + 0 + 9/4u*3 + cu*4 + 405/4u5 = 0. -2/3, -1/3, 0, 2/5 Let j(d) be the third derivative of d8/560 - 3d7/56 + 5d*6/8 - 25d*5/8 + 3d*3 + 21d*2. Let g(c) be the first derivative of j(c). Factor g(i). 3i(i - 5)3 Suppose -15x - 12 = -17x - 3l, 3l = 4x - 6. Factor -8/3u + 2/3 + 8/3u*x - 2/3u*2. 2(u - 1)(u + 1)(4u - 1)/3 Let j(l) be the first derivative of -l6/1200 - 7l5/600 + l4/48 + 5l3 + 27. Let m(h) be the third derivative of j(h). Let m(a) = 0. What is a? -5, 1/3 Let o(a) be the third derivative of -a8/168 - 9a*7/70 - 7a*6/10 + 49a*5/60 - 76a2. Factor o(x). -x2(x + 7)2(2x - 1) Let g(i) = i4 - i3 - 2i*2 + 1. Let w(x) = -6x*5 - 6x*4 + 14x*3 + 10x*2 - 4x - 4. Let r(p) = 4g(p) + w(p). Find f such that r(f) = 0. -1, 0, 2/3, 1 Let f be 4 - 20/5 - 2(-4)/16. Factor 1/2 + h*3 - 3/4h - 1/4h5 - fh*2 + 0h4. -(h - 1)3(h + 1)(h + 2)/4 Suppose -73n - 29n + 400 = -22n. Find r such that 9/5r*4 + 0r + 0r2 - 3/5r*3 - 6/5r*n + 0 = 0. 0, 1/2, 1 Let 1/3p*4 - 2/9p*3 + 1/9p + 1/9p5 - 2/3p*2 + 1/3 = 0. What is p? -3, -1, 1 Let t be 15/3 - (-1)/(-6)28. Let r(j) be the first derivative of -1/2j2 + 0j - 2 + tj3. Determine z, given that r(z) = 0. 0, 1 Let i = -143110/10089 - -889/59. Let p = 21/19 - i. Factor -p - 2q*2 + 4/3q. -2(3q - 1)*2/9 Let p(o) = -13o*2 - 24 - 42o + 11o - o. Let d(n) = -30n + 8n2 + n2 + 46n + 12 - 2n2. Let b(q) = 5d(q) + 3p(q). Factor b(x). -4(x + 1)(x + 3) Let w(b) be the first derivative of -b8/420 + b7/84 - b6/45 + b5/60 + 4b*3 - 14. Let l(v) be the third derivative of w(v). Let l(o) = 0. Calculate o. 0, 1/2, 1 Suppose 2g - 2 = 3g + l, 16 = -4l. Factor -6mg + 1606 + 4m*3 - 1590 - 6m*2. 4(m - 2)*2(m + 1) Let d(v) = -v*3 + 5v*2 - 5v + 4. Let s be d(4). Factor 5 + s - 12a - 12a*3 + 18a*2 + 5a*4 - 2a*4 - 2. 3(a - 1)*4 Let i = -113/85 + 679/255. Let -it*2 - 56/3t - 196/3 = 0. Calculate t. -7 Let v be (0 + 6)20/24. Let m(c) be the first derivative of 0c - 6 + 2/55cv + 3/22c*4 + 0c*2 + 4/33c*3. Factor m(r). 2r*2(r + 1)(r + 2)/11 Let n = 67 - 52. Let a be 2((-1)/n)/(2/(-6)). Let -a + 0f + 2/5f*2 = 0. Calculate f. -1, 1 Suppose j - 16 = -2k - 8, k - 1 = j. Let o(z) be the third derivative of 1/8z4 + 1/480z*6 + 0z - 1/3z3 - 4z*j + 0 - 1/40z5. Factor o(d). (d - 2)3/4 Let 3y - 28 - 23y - 4y + 4y2 = 0. What is y? -1, 7 Let p(b) be the third derivative of -b5/60 + 18b2. Let q(t) = -4t*3 + 6t*2. Let v(j) = 2p(j) + q(j). Factor v(f). -4f2(f - 1) Let f(r) = r*2 + 7r. Let y be f(-8). Suppose 3m - y = -2m + 4s, m - 4s = -8. Factor 0 - 4/9t - 8/9t*3 + 14/9t*2 - 8/9t*m. -2t(t + 2)(2t - 1)2/9 Let h(o) be the first derivative of o7/840 + o6/90 - o5/40 - 3o*4/4 + 4o*3 + 4. Let t(c) be the third derivative of h(c). Find l, given that t(l) = 0. -3, 2 Let v = -18685/21 - -890. Let g = 29/63 - v. Factor 4/9p + 2/9 + gp2. 2(p + 1)*2/9 Let p(q) be the first derivative of -2q*3/3 - 5q*2 + 208q - 545. Factor p(b). -2(b - 8)(b + 13) Let i = -7 - -11. Suppose -p + 12 = -5p, 0 = -it - 3p + 7. Determine z, given that -1/4z*t + 1/2z*3 - 1/4z*5 - 1/4z + 1/2z2 - 1/4 = 0. -1, 1 Let -10x*4 - 408/13x - 662/13x2 - 14/13x*5 - 34x*3 - 72/13 = 0. What is x? -3, -2, -1, -2/7 Let q = 7 + -52. Let n = 45 + q. Suppose -1/2g*2 + n - 1/2g = 0. What is g? -1, 0 Suppose 0 = 6i - 16i - 20. Let m be (-9)/(-15) + (68/90)/i. Factor 4/9p3 + 2/9p*5 + m - 2/3p*4 - 2/3p + 4/9p2. 2(p - 1)*4(p + 1)/9 Let x = 2140 - 10697/5. Factor -12/5 + xw3 - 3/5w + 12/5w2. 3(w - 1)(w + 1)(w + 4)/5 Suppose 190z - 191z = -14. Suppose 2q = -2l + z, -5l = -4q + 2 - 1. Let -1/6k5 - 8/3k - 2/3 - 19/6k3 - 7/6k*q - 25/6k*2 = 0. Calculate k. -2, -1 Let j(l) = -4l*3 + 108l*2 - l + 31. Let t be j(27). Let f(p) be the third derivative of 0p - tp2 + 5/3p*4 + 4/3p*3 + 5/6p*5 + 0. Factor f(n). 2(5n + 2)2 Let k = -3316 - -3319. Let f be (3 + 4)(-3)/(-4). Suppose 0r2 + 15/4r*4 + fr*5 + 0r + 0 - 3/2rk = 0. What is r? -1, 0, 2/7 Let f(w) be the first derivative of 48w*3 + 39w*2 + 3w + 351. Determine q, given that f(q) = 0. -1/2, -1/24 Let d(o) be the first derivative of -3o4/4 - o3 + 3o*2 - 39. Solve d(t) = 0 for t. -2, 0, 1 Let q be (-264)/(-110)10/3. Let w be (-69)/92q/(-3). Factor -3/2 - 3l*w - 15/4l - 3/4l3. -3(l + 1)*2(l + 2)/4 Suppose 0 = -42b + 51b - 27. Suppose -bk = -13 + 4. Determine v so that 4/3v + 2/3vk + 0 + 2v2 = 0. -2, -1, 0 Let p(t) be the third derivative of t6/24 + 29t5/12 + 175t*4/3 + 750t*3 + 4t*2 + 45t. Factor p(i). 5(i + 9)(i + 10)*2 Let k(c) = -5c*5 - 435c*4 - 355c*3 + 25c + 25. Let m(w) = w*5 + 108w*4 + 89w*3 - 6w - 6. Let v(t) = 6k(t) + 25m(t). Solve v(r) = 0 for r. -1, 0, 19 Let l(o) be the first derivative of -4/15o5 - 40000/3o - 8000/3o2 - 800/3o*3 - 40/3o*4 + 25. Let l(u) = 0. Calculate u. -10 Suppose 3n + 2f + 7 = -3f, 0 = 4n - 4f - 12. Let z be n/7 + (2 + -3)/7. Suppose z + 1/4v3 - 1/2v + 1/4v2 = 0. Calculate v. -2, 0, 1 Let h be (45/(-60) - (-78)/72)6. Factor -1/2m3 - 1/2 - 3/2m*h - 3/2m. -(m + 1)3/2 Let b(f) be the second derivative of f6/75 - 13f5/50 + 9f*4/5 - 92f*3/15 + 56f*2/5 - 196f + 1. Find k, given that b(k) = 0. 2, 7 Suppose 0 = r + 3x - 9, 4 = -3r + 5x - 11. Let n be 8/(-6)(-6 + r). Factor -p*2 - np + 8p. -p2 Let z(t) = -5t*4 - 6t*3 + 9t*2 + 2t + 4. Let y(b) = 14b4 + 17b*3 - 25b*2 - 6b - 11. Let o(i) = -4y(i) - 11z(i). Solve o(j) = 0 for j. -2, -1, 0, 1 Let u(o) = -5o2 - 151o - 134. Let p(j) = -9j2 - 301j - 272. Let x(l) = -3p(l) + 5u(l). Factor x(d). 2(d + 1)(d + 73) Factor 80/3 + 124/9w + 2/9w*2. 2(w + 2)(w + 60)/9 Let s = -83 + 78. Let v(a) = 12a*2 + 2a + 5. Let c(l) = -12l2 - l - 4. Let p(n) = sc(n) - 4v(n). Solve p(f) = 0. 0, 1/4 Let j(n) be the second derivative of n5/30 - 20n*4/9 + 400n*3/9 - 4n + 40. Factor j(o). 2o(o - 20)*2/3 Let q be ((-3)/1)/((-9)/(-78)). Let g be (-9)/(-26) + (-1)/q4. Solve 1/2n3 + 0n - gn2 + 0 = 0 for n. 0, 1 Let c = 1607/610 + 4/61. What is w in 27/10w*4 - 13/5w*2 + cw*5 - 9/10w - 9/5w3 - 1/10 = 0? -1, -1/3, 1 Let p(a) be the third derivative of a7/105 - 13a6/15 + a2 - 56a. Factor p(s). 2s*3(s - 52) Factor 884/3b + 97682/3 + 2/3b*2. 2(b + 221)*2/3 Factor 22j + 6j + 3j3 + 25 - j3 - 22j2 + 36j - 81. 2(j - 7)(j - 2)*2 Let b(q) = 7q*2 + 323q - 13796. Let z(l) = -3l2 - 162l + 6897. Let o(w) = 4b(w) + 9z(w). Factor o(p). (p - 83)*2 Suppose -3w = -5k + 25, -3k + 2w + 6 + 9 = 0. Factor -10l - 4l2 - 2l*k + 2l*4 + 12l*3 - 6 + 0l*2 + 4l*2 + 4l*2. -2(l - 3)(l - 1)(l + 1)3 Let t(y) be the second derivative of -y6/50 + 24y	{ "pile_set_name": "DM Mathematics" }
places? -0.000009 Let g be 66164564/10 + 2/(-5) - -3. Suppose -w + g = -14183541. Round w to the nearest 1000000. 21000000 Let o = 421.000347 + -421. What is o rounded to 4 decimal places? 0.0003 Let d = -67156 + 34556. What is d rounded to the nearest ten thousand? -30000 Let w = -1379 - -1378.999996223. What is w rounded to six decimal places? -0.000004 Let s = -2051 - -2051.2631. What is s rounded to 2 dps? 0.26 Let x = -409.229 - -409. Let t = -0.5639 - -0.324. Let w = x - t. What is w rounded to three dps? 0.011 Let l = 95 - 242. Let k = l - -147.93. What is k rounded to 1 decimal place? 0.9 Let s = -203105 - -203104.4999944. Let g = 0.9 + -1.4. Let k = g - s. What is k rounded to 6 decimal places? 0.000006 Suppose 7q + 1382 = 5q + 3h, -688 = q - 3h. What is q rounded to the nearest one hundred? -700 Let l = -6009 + 5331.7. Round l to the nearest ten. -680 Let i = 0.1140456 + -0.1133. Round i to 4 decimal places. 0.0007 Let y = -6153 - 2447. What is y rounded to the nearest 10000? -10000 Suppose 22721 = 3s + x - 10632, -4s = 4x - 44476. Let c(q) = sq + 14803q + 8680q. Let i be c(5). What is i rounded to the nearest ten thousand? 170000 Let u = 1.2 - 0.9. Let g = -2 - u. What is g rounded to one dp? -2.3 Let r = -19.3 - -10.6. Let j = -8.7039 - r. Round j to three decimal places. -0.004 Let h(w) = 7w2 - 8w - 22. Let q be h(17). Suppose 2f + 4p = 4f + 752, -5f = -5p + q. Round f to the nearest one hundred. -400 Let l = 55394416 + -117094416. What is l rounded to the nearest one million? -62000000 Let k = 16468 - 9327. Let l = k - -15859. What is l rounded to the nearest ten thousand? 20000 Let x = 9013703546560.874 + -9013896124861.10400091. Let g = -192578299 - x. Let f = g + -1.23. What is f rounded to seven decimal places? 0.0000009 Let h = 1057.56 + -545.09. Let q = h + -516. What is q rounded to 1 dp? -3.5 Let h = -1270239789811 - -1270220885143.00059. Let g = h - -18904563. Let q = g - -105. What is q rounded to 4 dps? 0.0006 Suppose -49830000 = -2k + 13k. What is k rounded to the nearest 100000? -4500000 Let m = -46 + 45. Let a = m - -0.9999956. What is a rounded to 6 dps? -0.000004 Let t be 1910/16/(-4). Suppose -1675 = -19f + 24f. Let j = t + f. What is j rounded to the nearest 1000? -3000 Let u = 15.688 - 15.6879992911. What is u rounded to seven decimal places? 0.0000007 Let v = -49 + 150. Let y = v + -101.000043. What is y rounded to five dps? -0.00004 Let u = -26380 + 48484. Let n = -14607 + u. Suppose -w - 2d = -19698, n = -4w + d + 86298. What is w rounded to the nearest one thousand? 20000 Let t = 8.65180803 + 0.01908497. Let a = 0.670873 - t. Let w = a - -8. Round w to 4 decimal places. 0 Let o = 0.511 - 0.51554. Round o to 3 decimal places. -0.005 Let h be 1 - (-4 - (-521003 - 6/3)). What is h rounded to the nearest one hundred thousand? -500000 Let r = 707 - 410. Let h = r - 297.617. Round h to one dp. -0.6 Let z be (5890/3)/(-2 + 50/30). Round z to the nearest 1000. -6000 Let p = -10218274029045 + 10218274177121.97199954. Let d = 148077 - p. Let f = -0.028 + d. What is f rounded to seven dps? 0.0000005 Let q = 4.458 - 4.43087. Round q to three decimal places. 0.027 Let r be ((1 - 4)/(-6))/(8/(-176)). Let n be (10/1)/(r/519200). Round n to the nearest 100000. -500000 Let i(d) = -1291d + 21. Let j be i(-12). Suppose 0 = 2y - 4l + 94501 - j, -5y - 197506 = 2l. Round y to the nearest 1000. -40000 Let k(f) = 37079f - 4. Let w be k(5). Suppose -2r = 2x + 492010, -x - w - 60584 = -5r. What is x rounded to the nearest 10000? -250000 Let m = 0.5806012884 + -0.5806. Round m to 7 dps. 0.0000013 Let d = 76.5 + -76.499481. What is d rounded to five dps? 0.00052 Let v = -1 + -3. Let z = 19468.99992 - 19473. Let n = v - z. What is n rounded to 4 dps? 0.0001 Suppose 3m - 2m - 3p + 11 = 0, -4p + 36 = 4m. Suppose -3i - mk = 3596, 0i = i - k + 1201. What is i rounded to the nearest 1000? -1000 Let x = 394 - 394.903. What is x rounded to one dp? -0.9 Let q(g) be the second derivative of -83611g*3 - 2g*2 + 2g - 3. Let a be q(6). What is a rounded to the nearest 1000000? -3000000 Let q = -0.455 - -0.45479. Round q to three dps. 0 Suppose -5f - 4u - 77786 - 19974 = 0, -19576 = f - 4u. Let z = f - -13756. Round z to the nearest 1000. -6000 Let j(p) = -p3 + 8p*2 - 4p + 9. Let v be j(6). Suppose 597 - v = -3y. What is y rounded to the nearest 100? -200 Let n = -0.078 - 3.622. Let f = -70276795 - -70276798.7000029. Let d = f + n. What is d rounded to six decimal places? 0.000003 Let b be ((-19320)/98)/(2/287). What is b rounded to the nearest 1000? -28000 Let w = 54.932 - -0.068. Let v = 54.9999951 - w. Round v to 6 dps. -0.000005 Let k(y) = -5029y3 - y2 - 2498y3 + 2y - 4349y3. Let w be k(-2). Round w to the nearest ten thousand. 100000 Suppose 0 = 3l - 3f - 31920, -2l = -5l + f + 31924. Let g = l - 44142. What is g rounded to the nearest 10000? -30000 Let k(j) = 8j + 11789j2 + 30206j*2 + 26094j*2 - 14963j*2. Let w be k(-8). Round w to the nearest one million. 3000000 Let g = -18839.260067 - -18836.96. Let q = -231 + 233.3. Let d = g + q. Round d to 5 decimal places. -0.00007 Let p = -28.2 + 30. Let n = 1.80000169 - p. What is n rounded to 7 decimal places? 0.0000017 Let a = -1060.902 - 2.098. Let v = a - -973.9. What is v rounded to the nearest ten? -90 Let b = 132 + -153.2. Round b to 0 decimal places. -21 Let c(g) = 892g + 6. Suppose k + 4 = -p + 2k, -5k + 17 = -4p. Let m be c(p). Let a = -14630 + m. Round a to the nearest 1000. -17000 Let z be 4860001/31 - 9/27. Suppose 5j - 8j - z = 0. Round j to the nearest one hundred thousand. -500000 Let m be 62/6 + (8/(-6) - -1). Let k be m/195-3 - 522600004/(-26). What is k rounded to the nearest one million? 20000000 Suppose 6l + 10l - 32 = 0. Suppose -3o = -0o + 3i - 13680012, -5o + li = -22799992. Round o to the nearest 100000. 4600000 Let s = -181 + 180.814. Let j = -0.019 + s. Round j to two dps. -0.21 Let u(l) = l*2 - 7l + 9. Let g be u(7). Let d be -3((-1675263)/g - 3). Suppose 1391570 = -5s - d. What is s rounded to the nearest 100000? -400000 Let d = -864.36 + 921. Round d to 0 dps. 57 Let m(n) = 1 + 8 - 7n + n2 - 1 - 2. Let y be m(5). Let j be (2700/14)/(y/560). What is j rounded to the nearest ten thousand? -30000 Let a = 0.18 - 0.02. Let c = -0.07 + a. What is c rounded to two dps? 0.09 Let h(o) = -30o*2 + 5o + 5. Suppose -3f - 45 + 36 = 0. Let a be h(f). What is a rounded to the nearest one hundred? -300 Let m = 866736 + -3912736. Round m to the nearest one hundred thousand. -3000000 Suppose 6c - 44114 = 7846. Round c to the nearest one thousand. 9000 Let u = -1050.99998661 - -1051. Round u to six dps. 0.000013 Let u(r) = 1085r3 - 19r*2 - 67r + 5. Let o be u(-3). Round o to the nearest one thousand. -29000 Let n = -55.8 + 60. Let x = 4.2000023 - n. What is x rounded to seven dps? 0.0000023 Let k = -5844518.00007 - -5844544. Let w = k - 26. Round w to 4 dps. -0.0001 Let x = -82.54 - -80. Let h = x + 4. Let m = h + -1.6. Round m to one decimal place. -0.1 Let n = -22271.320004 + 22280.32. Let u = n + -9. Round u to 6 dps. -0.000004 Let p(u) = u*3 - 22u*2 - u + 26. Let k be p(22). Suppose kc = -27 + 455. Round c to the nearest 10. 110 Let t = 105 - 105.0000067. Round t to six dps. -0.000007 Let f = 372.1 + -398. Let i = f + 0.9. Let n = i + 24.999922. Round n to five dps. -0.00008 Let i = -9.5948 + -2.5362. Round i to zero dps. -12 Let z = -12 - 113. Let m = -125.0000068 - z. Round m to six decimal places. -0.000007 Let b = 0.1191 + -0.0515. Round b to three decimal places. 0.068 Let r = -1295.1 - -1155. Let g = r - -151. What is g rounded to the nearest 10? 10 Suppose -p = 3p + 68. Let h(t) = 6t*2. Let d be h(-1). Let f be (p/(-1))/(2/d). Round f to the nearest 10. 50 Let g = -158.94 + 158.93993189. What is g rounded to six dps? -0.000068 Let o = -13.2582 + -15.7363. Let g = 5.1 - 34.1. Let u = g - o. Round u to three dps. -0.006 Let r = 16.3 + 3.7. Let c = -15 + r. Let u = 5.088 - c. Round u to 2 dps. 0.09 Let s(l) = -10382l + 2. Let d be s(1). Round d to the nearest 100. -10400 Let h = -0.1502 + 0.1500883. Round h to five decimal places. -0.00011 Let q be 6/2 + 1	{ "pile_set_name": "DM Mathematics" }
(57061/210) Simplify f/((f(ff*(2/15))/f)/f)f*12(ff3)(-6) assuming f is positive. f(-167/15) Simplify (dd*(-4/7)d/((dd(-3/11))/d))/(d(d*(-24)/d)/dd/(d/(dd(-1/40)))) assuming d is positive. d(79237/3080) Simplify (u(-1/10)uu(-33)/u)(10/11) assuming u is positive. u(-331/11) Simplify (((ll*(-1/9))/ll(-2/9))(2/15))9 assuming l is positive. l(-2/5) Simplify (((y/(yy(-2/11)/y)y)/y(-19))(-2/13))(-6/5) assuming y is positive. y(2796/715) Simplify (((i/((i/(i(ii(2/13))/i))/i))/i1)/(i(-2/3))(-2/19))(-8/5) assuming i is positive. i(-6424/3705) Simplify (n9/n)(-29)n(-2/21)/(n/(n/(((n/(n(-4)n))/nn)/n))) assuming n is positive. n(-4937/21) Simplify ((a/(a3/aa))*39aa(-6/7)aaa(aaaa*(-1/6)a)/a)(-37) assuming a is positive. a(111925/42) Simplify (k/(kkk1))(-18)/((k*(1/9)kk)/kk/(k/(kk(-4/9)))) assuming k is positive. k(103/3) Simplify (((r/r(-3))/r)/rr)(4/19)/(r(5/6)r0r) assuming r is positive. r(-137/114) Simplify (a(-6))*17/(aa/(a/(a/a(-8))))(-20/3) assuming a is positive. a(-106/3) Simplify (x21/(x*(-10)/xx))/(xx/((xx(x/(xx/((xx0)/x)))/xxx)/xxxx)x/(xx/(xx(6/7)))) assuming x is positive. x(225/7) Simplify (t(-1/2))42(t(2/9))17 assuming t is positive. t(-155/9) Simplify (((y(-2)y)/y)/y)28y/(y*20/y)y/(y(((y/y(-8)y)/y)/y)/y) assuming y is positive. y*(-109) Simplify ((aa*(-34))/(a/(((aa*(-3)a)/a)/a)))/((a/((a*29a)/a))/(a/(a*(-24/7)/aa))) assuming a is positive. a(-32/7) Simplify (h/h(-4)h)(-3)h*7h(-1) assuming h is positive. h(-12) Simplify ((gg(-1/2))/g(-9/2)(g(gg*(1/5)gg)/ggggg)(-4/13))(-7) assuming g is positive. g(-1267/65) Simplify (g/(ggg(-6))((gggg(6/5)gg)/g)/g)/(g/g6)(-8) assuming g is positive. g(-154/5) Simplify (b(-15))(2/3)(b/((b*(-4)b)/b))(-3/2) assuming b is positive. b(-35/2) Simplify (m/(m/(mm3)))(-31)/(m/(mm*9)mm)17 assuming m is positive. m(-5) Simplify (p(1/2))(-2)((p((pp/(pp(-10/3)))/p)/ppp)/p)/p(-6) assuming p is positive. p(28/3) Simplify (((b/(b/(b/b(-6)b))b)/b)/((b/((bb*(-8/5))/b))/bb))(-2/11) assuming b is positive. b(-54/55) Simplify (g*12(gg(g*(-2/17)/gg)/gg)/g)/(g7/g(2/23)) assuming g is positive. g(2334/391) Simplify (nn/(n/(nn(-2/41)/n)))/(n/(n(n/(n/(n*7/n))n)/nn))(n/n(-6/7))/n0 assuming n is positive. n(2815/287) Simplify ((q(-10))(-21))22 assuming q is positive. q4620 Simplify (b(-2/13)/b)*(-23/2)b*(4/3)/((bb*(-16))/bbb) assuming b is positive. b(2231/78) Simplify ((mm/(mm/(mm*10)mm)m)/m)*(-42)/(m/((mm1)/m))(1/14) assuming m is positive. m(-378) Simplify ((q/(q/q5))/q)*18(q(2/23)/q)(-1/50) assuming q is positive. q(82821/1150) Simplify (c(2/3))(-18)/((c11c)/c(11/3)) assuming c is positive. c(-61/3) Simplify (g22g)/(ggg*(-1/32)g)gg*(14/5)/ggg(7/6)g assuming g is positive. g*(12479/480) Simplify (a/(aa*(-3/20)a)a(-1/3))(-2/45) assuming a is positive. a(71/1350) Simplify (oo*(-25)oo/(oo*23o))/(o(-14))30 assuming o is positive. o373 Simplify v17/vv/(v/v17)(v(-4))3 assuming v is positive. v*21 Simplify ((h/(hh/(((h/(h/h(3/2)))/h)/h)))/(h/h(-7)))/(hh(1/17)h/(hh/(h/h5)h)) assuming h is positive. h*(-155/34) Simplify (s/(ssss*(-2))s*17s)/((((ss(4/7))/ss)/s)/(ss(4/13))) assuming s is positive. s(1705/91) Simplify ((k8/(kkk/k(1/2)k))/(kk/k(2/11)kkkkk(-7)/k))44 assuming k is positive. k294 Simplify (k/k13k)/k(-10)k*(4/7)k(-7) assuming k is positive. k(-52/7) Simplify (w*(1/5)(www/(w/(ww(4/11))))/w)/(w(-17)/www(5/8)/w) assuming w is positive. w(8773/440) Simplify (z(-1/6))(20/11)(z/z(-3/7))/z14 assuming z is positive. z*(-2974/231) Simplify (((zz(1/2))/(z/(z/(z(-5/8)z))))/(z7z/(zzz*5)z))(-7/3) assuming z is positive. z(49/24) Simplify g*(-9)gg/(gg*4g)g((g/(gg(10/3)))/g)/g13 assuming g is positive. g(-88/3) Simplify (r(1/13)r(r5/r)/r)/(r10(r(-3/2)/r)/r) assuming r is positive. r(-63/26) Simplify ((w(2/3))(-22)/(w/((ww/(ww*(-4/3)w))/w)w(-4)))(17/4) assuming w is positive. w(-289/6) Simplify ((yyy/(yy/(y*(3/4)y)))/(yy(-2/69)))/(y(-6)/yy(1/2)) assuming y is positive. y(2285/276) Simplify (w*(-37)/(w(w/(w/w*(2/21)))/w))/((www(-7/2)www)/w)46 assuming w is positive. w(-1262/21) Simplify d/((dd(-19))/d)d/(d/((d/d*(2/13))/d))(d(2/7))(2/5) assuming d is positive. d*(9082/455) Simplify ((mm(-1))3/(m*(-6)/mm/m7))32 assuming m is positive. m416 Simplify ((s/s(-12/7))/(s/s40))/(s/s(6/5))(-3/22) assuming s is positive. s(32099/770) Simplify yy(10/3)y(yy/(y/(y*(1/22)y))y)/y((y10/y)/y)(9/8) assuming y is positive. y(1081/66) Simplify ((((u/(u/(u/(u/u(-1)))))/u)/((u*2u)/u))(-19))(1/6) assuming u is positive. u(38/3) Simplify ((y(-1))(3/34)/((y6/y)/(yy6)))(3/8) assuming y is positive. y(195/272) Simplify (n/(n/n(3/4)))(-3/4)(n(-2))(1/8) assuming n is positive. n*(-13/16) Simplify (y((y*(-5)yy)/y)/y)/y17(y((y/(y/y(-3/8)))/y)/yyy)(-5) assuming y is positive. y(-193/8) Simplify (((uu/u*(-5)u)/uu)/u(-6)((u*3/uu)/uu)/(u(-1/7)u))(-36) assuming u is positive. u(-4068/7) Simplify (r/r*10r*6r/((r/(r/(r*(-1/13)/r)))/r)(rr(-9)r)/r)(-35) assuming r is positive. r(3605/13) Simplify ((((a/(aa4))/a)/a(1/13))/(a(-2/19)a/(a*(4/5)a)))3 assuming a is positive. a(-15456/1235) Simplify ((c5/c)/c)(-4/25)/(((c/(cc(cc/c20)/c))/c)/((c/(c(c/(c(cc27)/c))/c))/c)) assuming c is positive. c(238/25) Simplify (((ffff/f(5/6)ffff)/f(3/4))14)(-3/37) assuming f is positive. f(-539/74) Simplify ((rrr23)/rrrr(8/9))32 assuming r is positive. r(7744/9) Simplify c(-33)c20(c(-11/3)/c)(-24) assuming c is positive. c*99 Simplify (((s/(s/(ss*(-4))s))/s)/s15)/(s(2/9)ss(s/(ss/(s/(s*(-7/6)s)))s)/s) assuming s is positive. s(-403/18) Simplify (uuuuuu*15u)*(1/10)(u6)(-19) assuming u is positive. u(-1119/10) Simplify ((l(-2/3)l)(-5/18)/(l(-2/7))20)(2/67) assuming l is positive. l(2125/12663) Simplify ((t/((t(-3/5)/tt)/tt))/t1(tttt/((t1/ttt)/t)t)(-2/75))25 assuming t is positive. t(37/3) Simplify j(1/8)/j*(-15)j/(j/j*(-3/7))j(-15)/j assuming j is positive. j(-73/56) Simplify m(-1)/m(-23)(mm18)/m(-1/3) assuming m is positive. m(124/3) Simplify (x/x(1/9)x19)(-2/21) assuming x is positive. x(-358/189) Simplify (s/((s(-2/5)/s)/s))(-3/11)((s/(s/(s/s29)))/s)3 assuming s is positive. s(-4836/55) Simplify ((x26x)/(xx*(2/21)))/(x/(x(x*(-9)x)/x)x(-12/5)) assuming x is positive. x(2027/105) Simplify ((t/t(3/7)tt(-6))(-40))(-2/9) assuming t is positive. t(-2480/63) Simplify ((m/(m((m/((m/(m*(-9)mm))/m)m)/m)/mmm))/((m/(m(mmmm*(-9))/m))/mm))/(mm(-16)mmmm(-1/21)) assuming m is positive. m(211/21) Simplify c(-13/4)/(c(-1)/c)(cc0)/(ccc/((c20/c)/c)c) assuming c is positive. c*(55/4) Simplify ((r/(rr*(-5/6)))/r(r*2r)/r(rrrr/(r/(r/r*5))r)/r(-6))14 assuming r is positive. r(329/3) Simplify (k5k(-9)k)/((k/(k/(kk/((kk(-23)/k)/k))))/k(-34)) assuming k is positive. k(-63) Simplify (x(-1/12)xx26)(-48) assuming x is positive. x(-1292) Simplify v(-1/21)/v*(1/3)(v/(vvvv(14/9))v)36 assuming v is positive. v(-1940/21) Simplify (((ll/(l(-24)/l)l)/l)/(ll(-22)ll))/(llll*9l(-1/2)) assuming l is positive. l(69/2) Simplify (hh(1/6)hhh(-6))/((h/h(2/3))/h9) assuming h is positive. h(35/6) Simplify (i*(2/7)i*(-12)i)/(i12/i(-13)) assuming i is positive. i(-250/7) Simplify (k(-2/7))(-42)/((k12k)/(k(2/41)/k)) assuming k is positive. k(-80/41) Simplify (q/((q(3/4)/qq)/q))/(q/(((qq/q(8/9))/q)/q))q*18qqq*(-15/4)q assuming q is positive. q(299/18) Simplify (z5*z)/	{ "pile_set_name": "DM Mathematics" }
2 Let k(f) = 9f4 - 5f*2 - 5f - 5. Let u(z) = -3z. Let o be u(4). Let x(r) = 22r*4 - 12r*2 - 12r - 12. Let i(n) = ok(n) + 5x(n). Factor i(h). 2h4 Let d = 7877/10412 + -17/2603. Factor -df*2 - 33/4 + 9f. -3(f - 11)(f - 1)/4 Determine n so that -140/9n3 + 226/9n*2 - 44/9n - 5 + 1/3n4 = 0. -1/3, 1, 45 Suppose 2q - q = 14. Suppose -42 = -m + q. Let -32j + 37 - 45 - 4j*2 - m = 0. Calculate j. -4 Let x = -57/5 + 414/35. Find m such that xm*4 + 6/7m + 0m2 - 3/7 - 6/7m*3 = 0. -1, 1 Let a(l) be the third derivative of -45l*2 + 1/252l*7 - 1/8l*5 - 5/9l*3 + 0 + 0l - 55/144l4 - 1/144l*6. Factor a(w). 5(w - 4)(w + 1)3/6 Let d(a) be the first derivative of -a8/112 + 3a6/40 - a5/10 + 2a2 + 4a - 46. Let u(q) be the second derivative of d(q). Factor u(c). -3c2(c - 1)*2(c + 2) Let w(y) = 8y2 - 28y + 40. Let g be 15/((-6)/8-4). Let l(a) = 9a*2 - 29a + 41. Let z(m) = gw(m) - 4l(m). Factor z(h). 4(h - 3)2 Factor -9604/9 - 4/9k*2 + 392/9k. -4(k - 49)2/9 Let v(t) be the second derivative of 3/20t*5 - 4t - 3/4t4 + 3/2t*3 - 3/2t*2 + 0. Factor v(y). 3(y - 1)*3 Suppose -k = 3j - 5j + 10, -3j + k + 15 = 0. Suppose 3y - 1 = j. Suppose -11 + 3v*2 - 3v*4 + 3v*y + v + 9 + 5v*4 - 7v*3 = 0. Calculate v. -1/2, 1, 2 Let g(k) be the second derivative of 2/15k*5 + 0 + 0k*4 + 0k*3 + 14k + 1/63k7 + 4/45k*6 + 0k*2. Let g(x) = 0. What is x? -2, 0 Let s(y) = 4y*4 - 11y*3 - 7y*2 + 2y - 6. Let a be 2/472/6. Let n(f) = 11f*4 - 32f*3 - 20f*2 + 6f - 17. Let o(l) = an(l) - 17s(l). Factor o(p). -p(p + 1)(p + 2)(2p - 1) Let m(k) be the second derivative of k*7/210 - 7k6/270 + k5/18 - k*4/18 - 19k*3/6 + 28k. Let l(x) be the second derivative of m(x). Factor l(w). 4(w - 1)2(3w - 1)/3 Let p(i) = 8i + 40. Let j be p(-5). Let o(n) be the second derivative of -5/12n4 + 3n + j - 7/6n3 - n2. Factor o(a). -(a + 1)(5a + 2) Suppose -319z + 568 = -19z - 932. Factor -22/5c*2 - 18/5c*3 + 2/5c*z - 8/5c - 2/5c4 + 0. 2c(c - 4)(c + 1)3/5 Let j be ((-2)/(-12))/(7/(2 + 5)). Let d(o) be the third derivative of 0 + o2 + 1/60o5 + 0o*4 + 0o - jo3. Suppose d(q) = 0. Calculate q. -1, 1 Let j(u) be the third derivative of -25u8/2688 - u7/24 - 23u6/320 - 7u5/120 - u4/48 - u*2 + 39u. Suppose j(s) = 0. Calculate s. -1, -2/5, 0 What is d in -13/5d + 22/5 + 1/5d2 = 0? 2, 11 Let h(n) = n3 + 7n2 - 75n + 41. Let o be h(-13). Let f(m) be the first derivative of 7 + 1/15m5 - 1/4m*4 + 0m*o + 0m + 2/9m3. Factor f(z). z2(z - 2)(z - 1)/3 Let f(y) = y2 + 3y + 2. Let t be f(-3). Suppose 3d + 12 = 12. Suppose 2/11v - 2/11vt + d = 0. Calculate v. 0, 1 Let c = 20 - 32. Let w(g) = -g3 - 1. Let a(y) = -2y*3 + 3y*2 + 3y - 2. Let o(h) = cw(h) + 4a(h). Factor o(i). 4(i + 1)3 Let w(m) = m3 - 28m*2 + 31m + 53. Let f be w(27). Determine h, given that 16 - 160h + fh*2 - 365h*3 + 307h*2 + 41h3 = 0. 2/9, 1 Let k(h) be the first derivative of h5/10 + 11h4/4 + 157h*3/6 + 99h*2 + 162h + 27. Factor k(n). (n + 2)*2(n + 9)2/2 Let c(x) = x3 + 6x2 - 8x - 5. Let n be c(-7). Factor -6z4 + 4z4 + z2 + z*n - 2z*3 + 2z*5. 2z*2(z - 1)*2(z + 1) Let z(t) be the third derivative of -t5/300 - t4/10 - 6t3/5 + 2t*2 + 2t. Factor z(l). -(l + 6)2/5 Let g(k) be the first derivative of -k6/12 - 2k5/5 - k4/2 + k3/3 + 5k*2/4 + k + 85. Factor g(m). -(m - 1)(m + 1)*3(m + 2)/2 Let i = -8343 + 8346. Suppose -6348/17p2 + 552/17p + 24334/17pi - 16/17 = 0. Calculate p. 2/23 Let c(k) be the third derivative of k8/252 - k7/15 + 29k*6/90 - 34k5/45 + k4 - 7k3/9 + 61k*2 + 2. Find a such that c(a) = 0. 1/2, 1, 7 Suppose 4w + 29 = 2w - 5m, 2w = 5m + 1. Let u(s) = -s - 7. Let j be u(w). Find k such that jk - 1/3 + 0k*3 - 1/3k*4 + 2/3k2 = 0. -1, 1 Let j(h) be the second derivative of -h7/28 - 2h6/5 - 39h*5/40 - 3h*4/4 + 46h. Let j(u) = 0. Calculate u. -6, -1, 0 Factor -20d - 21d*2 - 30d*2 + 47d*2 + 96. -4(d - 3)(d + 8) Let h(r) be the third derivative of -r5/80 - 5r*4/8 + 12r*3 - 46r*2. Suppose h(q) = 0. Calculate q. -24, 4 Let b = -1/79 - -241/316. Let q = -206 + 833/4. Find j such that 0j*2 - 3/2 - qj + bj3 = 0. -1, 2 Suppose 3d - 6 = -0x + x, d - 3 = 0. Suppose -v - z - 6 = -3z, -4v - xz + 9 = 0. Factor -1/2s2 + v - 1/2s + 1/2s3 + 1/2s*4. s(s - 1)(s + 1)2/2 Let x(b) be the second derivative of -3b*6/10 + 21b*5/10 - 3b*4 - 12b*3 + 48b*2 - 366b. Factor x(f). -3(f - 2)3(3f + 4) Let h = -4096 - -20481/5. Suppose 2/5l*2 - 2/5 + 1/5l - hl3 = 0. Calculate l. -1, 1, 2 What is a in 35a*5 + 21 - 181 + 80a*2 - 1350a*3 + 1070a*3 - 10a*4 + 560a = 0? -2, 2/7, 2 Suppose -825 = 13b - 851. Let p(y) be the second derivative of -1/10y*5 - 9/4y*b - y - 7/2y*3 + 0 - 25/24y4. Factor p(n). -(n + 3)2(4n + 1)/2 Determine u, given that -2/11u5 + 0u - 16/11u2 + 0 - 28/11u*3 - 14/11u*4 = 0. -4, -2, -1, 0 Let f be (-3 + 0)8998/(-198). Let d = f - 131. Find q, given that dq - 2/3q*5 + 10/3q*4 - 4q*3 + 0 - 8/3q*2 = 0. -1, 0, 2 Factor -17n + 22n - 29n*2 - 37n - 27 + 23 - 7n3. -(n + 2)2(7n + 1) Suppose 4/9z - 40/3 + 4/9z2 = 0. Calculate z. -6, 5 Let b be (-189)/(-405)24/28. Factor -6/5l2 + 0 - 4/5l - bl3. -2l(l + 1)(l + 2)/5 Let u = 14/93 - 27/248. Let z(l) be the second derivative of -2l + 1/60l*6 + 1/40l*5 + 0l*3 - 1/84l*7 + 0l*2 + 0 - ul4. Factor z(v). -v2(v - 1)2(v + 1)/2 Suppose 12/7 - 3/7j2 + 0j = 0. What is j? -2, 2 Determine c so that -1/7c2 - 47/7 + 48/7c = 0. 1, 47 Determine u so that 1/4u4 + 325/4u*2 + 375u + 15/2u3 + 625 = 0. -10, -5 Let q = 20726/3 + -6986. Let p = q + 545/6. Factor -9n + 3/2n2 + p. 3(n - 3)2/2 Let z(f) be the second derivative of f7/70 + 2f6/25 - 7f*4/10 - 17f*3/10 - 9f*2/5 + f + 2. Factor z(w). 3(w - 2)(w + 1)3(w + 3)/5 Let r be 4 + (4 - (-2 - -2)). Suppose -3a5 - 4a*3 - ra*3 + 15a*3 = 0. What is a? -1, 0, 1 Factor 1012/5y - 24 + 68/5y2. 4(y + 15)(17y - 2)/5 Suppose 8z = 13z + 4d - 30, 4z - 2d = -2. Let w(l) be the second derivative of -1/60l*4 + 0 + 1/30l*3 + 9l + 1/5lz. Factor w(s). -(s - 2)(s + 1)/5 Let j be 33273/(-18)(1 + (-13)/11). Let s = 337 - j. What is n in 2/11n*4 + sn*2 + 4/11n + 8/11n3 + 0 = 0? -2, -1, 0 Let j = 7/173 + 1529/692. Find c such that 0 + 0c + jc3 - 3/4c*5 - 3/2c*2 + 0c4 = 0. -2, 0, 1 Let l(t) = t3 + t*2 + 116t - 242. Let b be l(2). Find s, given that -3/4 - s - 1/4sb = 0. -3, -1 Let a = 23 - 18. Let z be ((-8)/a)/((-104)/(-20) + -8). Determine g, given that 2/7g + zg2 - 4/7 - 2/7g*3 = 0. -1, 1, 2 Suppose 19m - m = 54. Let z(l) be the second derivative of -1/9lm + 0l*4 - 4l + 0l2 + 1/30l*5 + 0. Let z(b) = 0. Calculate b. -1, 0, 1 Factor 0 + 14/3v - 2/3v2. -2v(v - 7)/3 Let k(v) be the first derivative of 2v*3/3 + 5v*2 + 13. Factor k(g). 2g(g + 5) Let 10/11l*4 - 64/11l + 206/11l2 - 24 + 114/11l*3 - 2/11l*5 = 0. What is l? -3, -2, 1, 11 Let s = 47/36 + -5/4. Let p(l) be the second derivative of -2/3l*3 + 0 - sl*4 - 3l*2 - 2l. Factor p(d). -2(d + 3)2/3 Let l be (9/78)/((-840)/(-1820)). Factor -m + lm*4 + 11/4m*2 + 1/4m*5 - 9/4m*3 + 0. m(m - 1)*3(m + 4)/4 Let j = -18298/15 + 1220. Suppose 4/15z2 + 2/15 - 2/5z + jz5 - 2/5z*4 + 4/15z*3 = 0. What is z? -1, 1 Let g(t) be the first derivative of -2t*3/3 - 2t*2 + 16t - 59. Find m such that g(m) = 0. -4, 2 Let l(y) be the first derivative of 2y6/9 - 8y*5/5 + 14y*4/3 - 64y*3/9 + 6y*2 - 8y/3 - 153. Factor l(d). 4(d - 2)(d - 1)*4/3 Let v = -1859/15 - -124. Let a = v - -2/15. Factor 1/5c*2 - ac - 2/5. (c - 2)(c + 1)/5 Let q = 15 - 5. Suppose 4 = -2u + q. Factor u - 12i2 + 7 - 9i*3 - 3i - 10. -3i(i + 1)(3i + 1) Let u(g) = g5 + g4 + 17g3 - 40g*2 + 27g - 3. Let z(b) = 5b5 + 3b*4 + 69b*3 - 160b*2 + 109b - 13. Let l(x) = -26u(x) + 6z(x). Factor l(c). 4c(c - 2)*2(c	{ "pile_set_name": "DM Mathematics" }
u(5). Is h equal to a? False Let k = 171 - 159. Suppose f + 25 = 2s + 2f, s = 2f. Let a = k - s. Which is smaller: 3 or a? a Let q = 6612.634 - 6.634. Is -2/5 not equal to q? True Let m = -102415/136 - -4916/17. Is -464 at most as big as m? True Let b = -520319 + 520321. Let u be (-6)/(-4)(-2)/(-1). Is u at least as big as b? True Let t(w) = w. Let o(p) = -64p + 10. Let b(a) = o(a) + 2t(a). Let x be b(4). Let j be (-204)/x7/4. Which is greater: j or 1? j Let l = 4678 + -4678. Which is greater: -1069 or l? l Let s(q) = 27q*2 - 85q + 5. Let z be s(4). Suppose -7h - 3h + 980 = 0. Is z > h? False Let t = 0.43148 - 0.13148. Which is smaller: t or 0.434? t Let g = -24 + 14. Let y be 3(-5)/(-15) + g/(-2). Let z be -1y/(-15) - 9/(-15). Is z < 1/23? False Let j = 71 - 75. Let z be j/(-20) - 28/(-385). Is z not equal to -1? True Let d = -1518.675 - 3.325. Which is greater: d or -3? -3 Let f(g) = -1252g + 6105. Let y be f(5). Which is smaller: y or -149? y Let x = -65 - -609. Let m = 549 - x. Do -1 and m have different values? True Suppose 2s - x - 4 = -2s, -3s + 2x = 2. Let w be (-6)/s(-5)/(-18). Let y = -8417 + 8415. Is w < y? False Let f(j) = j*2 + 5j - 21. Let v be f(-9). Let s be (-212)/(-10) + 12/v. Let n be (-2)/(s - -3 - 2). Which is greater: 1 or n? 1 Let l be ((-1)/(8/6))/(15/20220). Is -1011 at least as big as l? True Let r be (-1)/((-7)/(-14)) - -2. Let i(g) = g3 - g2 - g - 26. Let l be i(r). Is -27 less than l? True Let b(v) = v*2 + 106v - 66. Let c be b(-107). Which is bigger: c or -91? c Let u = 9119 - 81857/9. Is u at most as big as 25? True Let r be (5 + 57/(-15))(2 - (-16)/72). Is -773 greater than r? False Suppose 3a + 5t = 1, -5t = -2 - 23. Let p be (-4)/14 - (0 + a/28). Let g = 14/15 - 34/15. Is p < g? False Suppose 0 = -5n - m - 687, 5632m = 5n + 5629m + 679. Is -90 at most n? False Let j be 45/(-27)(-114)/(-15485). Suppose 0s = -2s. Which is smaller: s or j? j Let s(d) = 5987d - 5992d - 85 + 7. Let r be s(-32). Which is greater: 81 or r? r Let n = 1151 + -1149. Is n bigger than -1859? True Suppose -3m = -4v - 16333, -3m = -10v + 14v + 16291. Is v > -4077? False Let r be 1/3 - 35/(-3). Let s = 6944 - 6939. Suppose sc - 3m = -r, -3m = c + m - 16. Which is bigger: -4/3 or c? c Let b be (4 - 17-6)((-63)/(-9))/14. Suppose -3d + 135 + 24 = 0. Is d at least b? True Let t = 131/8 + -3529/216. Are -11/2 and t equal? False Let g be 11 + 135/(-12) + (-9335)/201. Which is smaller: g or -471? -471 Let d = 17859 + -17859.03. Does 2/695 = d? False Suppose -55w + 103 = -54w. Let x = -307/3 + w. Is -326 less than x? True Let z = -703.9 - -1166. Let h = z + -462. Let j = 13 + -13.36. Is h less than or equal to j? False Let p be (99/1287)/((-2)/8). Which is smaller: p or -0.18? p Let o(l) = -l2 - 9l + 13. Let d be o(-10). Suppose 0 = 5f + w - 3698 + 3726, 0 = w + 8. Are d and f nonequal? True Let i(x) = -11x - 941. Let k be i(5). Which is smaller: -992 or k? k Suppose -5s + 2z = -103 + 276, 0 = 4z + 24. Let t be ((-35)/(-2))/(2/(-4)). Is t bigger than s? True Let q = -0.57 + 0.07. Let p = -683.5 + 683.4. Which is bigger: p or q? p Suppose -3a + 1 = y, 0 = -6a + a - 5y + 15. Which is bigger: 13 or a? 13 Let r(c) = -11c + 133. Let u(s) = -11s + 131. Let o(a) = -4r(a) + 3u(a). Let d be o(-23). Is d <= -393? False Let a = -0.3214 + 0.0214. Suppose 2q + 10 = -3q. Let h be 57/(-84) - q/8. Which is bigger: a or h? a Let s(n) = 12n3 + n2 + 2n + 1. Let t be s(-1). Let b = 43916 + -43927. Which is greater: b or t? b Let s(o) = -o*2 - 2o + 1. Let p be s(-2). Let f(j) = j*2 - 2j. Let v be f(p). Let i be ((-2)/76)/(v/(-4)). Is i at least -1/5? True Let z = 230.4 + -208. Let i = -23.37 + z. Let c = i - -0.97. Which is smaller: c or -0.8? -0.8 Let h(l) = -10l + 19l + 12 + l*3 - 14l*2 + 21 - 11. Let s be h(13). Let x be -3265/s(-2)/(-3). Is x at least as big as 18? False Let y(c) = 17c*2 + 20c - 29. Let n be y(3). Let z be 8/2 + 26(-20)/n. Is 1 bigger than z? False Suppose 0 = 2u + 10, u - 14 = -3p - 1. Suppose -w = p + 3. Let a = 134 + -143. Is a greater than or equal to w? True Let k = 0.467 - 3.571. Let b = k - -0.104. Is b greater than 98? False Let w(t) = 4t*2 + 8t + 10. Let n = 16 - 20. Let u be w(n). Let b = u - 29. Is 13 equal to b? True Let r(l) = -106l - 119l + 248l + 25. Let y be r(2). Is y > 71? False Let a be (9/2 + -1)(12 - 14). Let d be (6/(-10))/(a + (-2736)/(-390)). Are d and -35 equal? False Let i = -6657 - -6892. Which is smaller: 229 or i? 229 Let b be (-674)/17861 + 2098/5035. Which is smaller: 1 or b? b Let w = 450 + -2707/6. Let c(m) = -3m2 - 5m + 61. Let d be c(-13). Let f = d + 380. Which is bigger: f or w? f Let v be (-106083)/156 + -1 - 10/(-40). Let n = v + 680. Let l = -47 + 46. Is l less than or equal to n? True Let d = 3899 + -3756. Is d less than 145? True Let r be 7282/10 + (-21)/(-70). Let l = r + -700. Is l equal to 30? False Let s be (0 - -4) + 8/(-2). Suppose -631u + 649u = -90. Which is smaller: s or u? u Let k = -134 + 134. Let p(u) = -15u + 3. Let h be p(2). Let x be (-1 - 650/(-576)) + 6/h. Which is bigger: x or k? k Let q = -48 + 49. Let d be (1 - (1 + 1)) + 3 + q. Suppose -2k = 4, 4o + dk = 2k - 6. Which is bigger: o or 2/157? 2/157 Suppose -2u - 6 = 3f, 3f = -2u + 4f + 10. Suppose 4t - 3t + 78 = -3o, 0 = t - uo + 102. Is t at most as big as -90? True Suppose 26 - 29 = -3z, 0 = -5k + 2z + 418. Let o be ((-8)/k7)/(4/21). Let r(i) = -i + 2. Let x be r(6). Do o and x have different values? True Suppose 3z + 5 - 8 = 0, 2w + 19 = -z. Let j be ((-2)/(-29))/((-7 - 53)/w). Are 0 and j unequal? True Let j(c) = -c*3 - 12c*2 + c + 11. Let p be j(-12). Let a be 17 - (7 - (p - -1) - 3). Suppose 3v - 4 + a = 0. Which is bigger: 1 or v? 1 Let x = 23902806070/56409 - 423741. Which is greater: x or 0? x Let g = 1193 - 684. Which is smaller: g or 510? g Let g = 11 - 20. Let i = 47 - g. Let b = i + -55. Which is bigger: 26 or b? 26 Suppose 51q = 56q - 2w + 10, 4q - 25 = -5w. Which is smaller: q or -9/2? -9/2 Let v = -2546.1 - -2560.1. Which is bigger: v or 595? 595 Let m(p) = 2p*3 - 11p*2 + 4p - 1. Let s be m(5). Let l be (-24)/s - (-1 - (-423)/87). Is l bigger than 1? False Let s be 2/(-10)(-8 - 57). Suppose -r + 11 = -3z + 2z, -3z - r - s = 0. Let u = 16/105 - 20/21. Which is bigger: u or z? u Suppose 0 = -27r - 2r - 172r - 15678. Is r at least as big as -61? False Let z be (-4)/10 + 5343/4080. Let t = z + 3095/136. Let l = -22 + t. Which is bigger: 0 or l? l Let n be (24/(-27))/((-14)/63) - -546. Let q = n + -559. Do q and -21 have different values? True Let k = 8.56 + 301.44. Let d = 308 - k. Is d at most 3.69? True Let u = -4488913/30 - -149596. Let c = -107/6 - u. Let b = 2603/155 - c. Is b < -1? False Let v = -3198 - -3221. Are 43 and v equal? False Let q = 2362 + -2361. Which is smaller: 11/249 or q? 11/249 Let w = -0.0549 - 1.3251. Let d = w - 20.62. Is d greater than 0.02? False Let a = -0.67817 + 0.05817. Which is bigger: -13 or a? a Let f be (1664/(-834))/1 + 2. Suppose -63w - 283 = 51w - 397. Is f greater than w? False Let k = -533 + 22. Let y = k - -6640/13. Suppose -5r - 2z = -9, 0 = r - 2z - 149 + 152. Which is greater: y or r? r Let g = 9635 - 9816. Suppose l + 30 + 152 = 0. Is l less than g? True Let h(f) = -f2 - 18f - 13. Let z be h(-17). Let o(v) = -15v - 6. Let w(l) = -45l - 17. Let r(c) = zw(c) - 11o(c). Let j be r(1). Is -17 less than j? False Let j = -116604 + 116627. Let n(s) = s*3 + 2s - 1. Let y be n(1). Suppose 18 = yb - 26. Is b greater than j? False Let t be (-18)/135 - (-1209)/(-45). Suppose -2a = 2a + 3r + 87, -4r - 84 = 4a. Let i = -52 - a. Is t > i? True Let v = 4/116671 + -43415342/116671. Let n = -372 - v. Let r = 251 + -250. Is n less than r? True Let n be 2/(-7) + 27/21. Let i(j) = -16j - 2 + 26j + 0j - 8j. Let u be i(n). Do 3 and u have the same value? False Let d(l) be the third derivative of l*4/24 + 25l*3/6 - 9l*2 - 2. Let p be d(-16). Let o = -18 - -13. Which is bigger: p or o? p Let o = 12884 - 142518/11. Which is bigger: o or -72? -72 Let t be -10(3/6 - 0). Let f = 7 + t. Let v be (-2 + 6)*(14/7 + -4) + 10. Is f at l	{ "pile_set_name": "DM Mathematics" }
pose -dn = 3f - 12 - 24, 4n = -2f + 28. Suppose -9k - 35 = -fk. List the prime factors of k. 5, 7 Let v(h) = 3 + 2h2 + 0h - 8 - h. Let y = 123 + -127. List the prime factors of v(y). 31 Let y(k) = 61k2 - 13k + 5. What are the prime factors of y(-6)? 43, 53 Let m(t) = -6t - 27. Let z be (-4)/2(-7 + 14). List the prime factors of m(z). 3, 19 Let h be (-1 + 1)/(-7 - -5). Suppose 5s + 40 = -hs. Let u = 17 - s. List the prime factors of u. 5 Suppose y = -5u + 20, -5y - 2u + 20 = 3u. Suppose 2q = 4h - 0q - 46, -5h - q + 47 = y. Let v = h + 27. What are the prime factors of v? 37 Let i be 8 + -3 - (-3)/(-1). Suppose -5d = -ij - 165, 5j - 103 + 4 = -3d. What are the prime factors of d? 3, 11 Suppose -v = 5 + 3. Let m(z) = -z*2 - 10z - 9. Let g(o) = -o*2 - 10o - 10. Let w(j) = -2g(j) + 3m(j). List the prime factors of w(v). 3 Let w(u) = -3u2. Let j be w(-1). Let q be (-2)/((-1)/(j + -1)). Let c(f) = -3f + 5. What are the prime factors of c(q)? 29 Suppose -r + 4 = 3r. Let m(w) = 4w*2 - 3w + 2. List the prime factors of m(r). 3 Let i(b) = -7b3 - 3b2 - 2. Let n(w) = w3 + w*2. Let y(k) = i(k) + 6n(k). Suppose 2j = -2 + 6. What are the prime factors of y(j)? 2 Let b(i) = -12 + 4 + 11i - 8 - 2. What are the prime factors of b(7)? 59 Suppose -62n = -82171 - 29305. List the prime factors of n. 2, 29, 31 Suppose 4o = 5j + 13929, -3o = -j - 7222 - 3211. List the prime factors of o. 2, 11, 79 Let u = -19 + 11. Let d(z) = z*3 + 9z*2 + 10z + 18. Let c be d(u). What are the prime factors of -2 - (0 - (54 + c))? 2, 3 Let m = -340 - -477. What are the prime factors of m/(2 - (-3)/(-2))? 2, 137 Let h(r) be the second derivative of -5r - 5/3r*3 + 1/6r*4 + 0 + 5/2r*2. What are the prime factors of h(7)? 3, 11 Suppose 23c = 27c - x - 8828, -2c - x + 4414 = 0. What are the prime factors of c? 2207 Suppose 0 = 273v - 286v + 6227. What are the prime factors of v? 479 Let r = -1710 - -2901. List the prime factors of r. 3, 397 Let r = 64 - 60. Let m = r - -29. What are the prime factors of m? 3, 11 Suppose -16 = -8p + 4p. Suppose -pw = -5n + 12, 0n - 3w + 26 = 5n. Suppose 0 = q + nh - 12, -3h = -5q - 8h + 45. What are the prime factors of q? 2 Let i(b) = 25b - 10. Let h be i(13). Suppose 4k - 843 + h = 0. Suppose -2t + k = 2t. List the prime factors of t. 3, 11 Let z = 8 + -4. Suppose -3a + 69 = -5h + 16, 4h = za - 36. Let t = h + 21. List the prime factors of t. 2 Let o(k) = k3 - 3k*2 + 4. Let r be o(3). Suppose -2m + 2c = -m + 8, rm - 13 = -c. List the prime factors of 6(1 - m)-1. 2, 3 Suppose 3 + 22 = 5b. Suppose 2n = 8, -bk + 5n = -95 - 25. List the prime factors of k. 2, 7 Let i = -32 - -52. Suppose 0 = -3k - 5a + 25, -2a + 6a = i. List the prime factors of -1 - ((-132)/4 - k). 2 Suppose -523 = -5y + 247. Let l = y + -103. List the prime factors of l. 3, 17 Let i(y) = 70y. Let m be ((-2)/(-6))/(12/36). List the prime factors of i(m). 2, 5, 7 Suppose -2h + 2j = -770, -3j - 876 = -5h + 1055. List the prime factors of h. 2, 97 Let o be 10/(-15)15 + 4. Let s = o - -121. List the prime factors of s. 5, 23 Let g be (-38)/(-8) + 3/(-4). Suppose 35 = go - 5. What are the prime factors of (-924)/(-15) - (-4)/o? 2, 31 Let v(j) = -481j - 3. List the prime factors of v(-2). 7, 137 Let x be 2/(-10) + 5/25. Suppose 2q - 2k = 12, 4 = -2k - xk. Suppose -3o = -qu - 65, 0 = -4o + 2u + 28 + 42. List the prime factors of o. 3, 5 Let a = -239 - -985. List the prime factors of a. 2, 373 Let a(t) = 13t*2 - 5t + 21. Let g be a(6). Let x = g - 272. List the prime factors of x. 11, 17 Let r be (-9 + 9)(-1)/3. Suppose r = -4m - 4v + 481 - 165, 5m - 395 = v. List the prime factors of m. 79 Let k be ((-6)/(-4))/(6/(-32)). Let s(o) = -o*3 - 7o*2 + 7o + 1. Let z be s(k). List the prime factors of 202/6 + (-6)/z. 3, 11 Let d = -659 - -2484. List the prime factors of d. 5, 73 Let r(s) = s*2 - 18s + 34. Suppose -32 = 6p - 134. List the prime factors of r(p). 17 Suppose -z + 177 = 25w - 21w, -z + 5w = -186. What are the prime factors of z? 181 Suppose -4 = -5a - 4. Suppose -12p + 366 - 54 = a. What are the prime factors of p? 2, 13 Suppose -18b - 20 = -23b. Suppose bj + 4j = 992. List the prime factors of j. 2, 31 Let o = -46 + 49. Let g = 6 + -4. Suppose m + on - gn = 57, -m + 69 = 4n. What are the prime factors of m? 53 What are the prime factors of ((-30)/(-140)-1132)/(1/(-7))? 2, 3, 283 What are the prime factors of (-178 + 0)(-288)/192? 3, 89 Let t be (1 + 1)5/(-2). Let l = 3 - t. List the prime factors of 282/l - 3/12. 5, 7 Let k(z) = 101z + 30. What are the prime factors of k(5)? 5, 107 List the prime factors of 22/(6 + 55/(-10)). 2, 11 Suppose -h = h - 8. Suppose 4o - 44 = -2m, o - hm = -7 - 0. Let x = 0 + o. List the prime factors of x. 3 Suppose -85 + 1 = -4c. Let x = c + -3. What are the prime factors of x? 2, 3 Let g(p) = -p2 + 3. Let t be g(0). Suppose -5q + d - 35 = 4d, 0 = -4q - td - 25. List the prime factors of 4/q + 762/30. 5 Let r be 13 - (-15 - 0)/(-5). Suppose -ra + 48 = -7a. List the prime factors of a. 2 Suppose -3m + 2 = -10. Let p be m/661. Suppose -p = -3j + 23. What are the prime factors of j? 3 Suppose 4d = 21 + 51. Suppose -3a = -a + d. What are the prime factors of 10 + 3/(a/(-6))? 2, 3 Let z = -234 - -269. List the prime factors of z. 5, 7 Suppose -15312 = -10k + 2818. List the prime factors of k. 7, 37 Let z be (6 - (3 + 0))1. Suppose -b + 156 = 4i, -2b = zi - 5b - 102. Let d = -13 + i. List the prime factors of d. 5 Suppose h + 8 = -3h. What are the prime factors of (35/(-20))/(h/48)? 2, 3, 7 Let g(z) = 2z3 - 15z*2 - 7z - 5. What are the prime factors of g(11)? 3, 5, 17 Let w be (-375)/508/(-6). Suppose 0u - w = -5x + 5u, 0 = 4u - 4. Suppose 0 = -xr - 3 + 231. List the prime factors of r. 2, 19 Let o = -197 + -42. Let q = -119 - o. List the prime factors of q. 2, 3, 5 Suppose 83760 = 205n - 189n. List the prime factors of n. 3, 5, 349 Suppose -p = -4, -261 = -9w + 4w + p. Suppose -3g + w = -37. What are the prime factors of g? 2, 3, 5 List the prime factors of ((-24)/(-14))/((-95)/(-85785)). 2, 3, 43 Suppose 55 = 4k - 29. Let i = -6 + k. Let n = 0 + i. List the prime factors of n. 3, 5 Let j = -27 + 1. List the prime factors of 35/28(2 - j). 5, 7 What are the prime factors of (66/12 + -5)266? 7, 19 Suppose -4f = 5o - 3343, 1322 = 4f + 3o - 2031. List the prime factors of f. 2, 421 Suppose -y + 614 + 404 = -4r, -5y = -2r - 5162. What are the prime factors of y? 2, 11, 47 Suppose -o = -2l - 397, 4l + 382 = 4o - 1206. Suppose -3d + 166 = -2z + 4z, -3d + o = 5z. List the prime factors of (-2)/(-11) - (-1526)/z. 2, 5 Let b(a) = -a3 + 9a*2 + 7a + 10. Let u = 38 + -38. Suppose 5c + 4c - 81 = u. List the prime factors of b(c). 73 Suppose -5a + 16z + 4445 = 11z, 0 = a - 3z - 889. What are the prime factors of a? 7, 127 Let a(x) be the first derivative of x*3/3 - 5x*2/2 + 2x - 6. List the prime factors of a(9). 2, 19 Suppose -2c + 7 = -3s - 3, -3c = 4s - 15. Suppose 0 = ca + 2y - 390, -a - 2y - 90 = -2a. List the prime factors of a. 2, 5 Suppose 0 = 5c + 5, 3a - 12 = -a - 4c. Let v(t) = 4t*2 - 6t - 5t2 + 2t*2 + 2t*2. What are the prime factors of v(a)? 2, 3 Suppose -15 = -5w - 2k - k, -3w - 5k + 25 = 0. Suppose 208 = 4m - 0m - 2d, w = -m + 3d + 57. Suppose -4q = -7q + m. List the prime factors of q. 17 Let s(a) = -a2 + 4a - 2. Let t be s(2). Suppose 59 = 3r - 3z + tz, r + 2z = 29. Let u = r - 13. What are the prime factors of u? 2 Let x(y) = -494y3 + 4y*2 + 2y. List the prime factors of x(-1). 2, 31 Let c(h) = -565h - 53. What are the prime factors of c(-2)? 3, 359 Suppose 21835 = 37t + 2706. List the prime factors of t. 11, 47 Suppose 348 = x - 4w - 216, -5w + 1658 = 3x. What are the prime factors of x? 2, 139 Let b(m) = m3 + 10m*2 - 14m + 6. Let g be (-54)/5 - (-6)/(-30). Let s be b(g). Let j = 81 - s. What are the prime factors of j? 2, 3, 7 List the prime factors of (1194/(-4))/((-4)/32). 2, 97 Let z = -20 - -25. Let b be (z/2)/((-6)/(-348)). Suppose 4r + 2u = 194, 2r = -2*u - 43 + b. Wha	{ "pile_set_name": "DM Mathematics" }
ided by -507? -17952 What is -2 divided by -97887485? 2/97887485 Divide 162535720 by -4594. -35380 -13830102 divided by -48357 286 55510400 divided by 8300 6688 Divide -7684040 by 4. -1921010 -6599736 divided by 52 -126918 Calculate 5 divided by 11528768. 5/11528768 What is 1059396 divided by 81492? 13 Divide 95 by 180040. 19/36008 Calculate 2 divided by -23030519. -2/23030519 Divide -686 by 5826. -343/2913 What is -132407396 divided by 5? -132407396/5 What is -12208375 divided by -10? 2441675/2 Calculate 16912835 divided by -14153. -1195 What is 38998285 divided by -5? -7799657 Divide -3583788 by 78. -45946 What is 2452824 divided by -222984? -11 1653413 divided by 234 1653413/234 -7735871 divided by -703261 11 Calculate 18037888 divided by -32. -563684 Calculate 2586304 divided by 646576. 4 Divide -34 by -10256223. 34/10256223 What is 71242272 divided by -3? -23747424 Divide 139180 by -135. -27836/27 What is 2372864 divided by 403? 5888 36 divided by 13112350 18/6556175 -25401959 divided by 2309269 -11 -5443638 divided by 2822 -1929 Divide -7 by -45120200. 7/45120200 3988 divided by -27747 -3988/27747 Calculate 854680083 divided by -2. -854680083/2 -125567498 divided by 2562602 -49 Calculate 28964005 divided by 7. 4137715 What is -9618049 divided by -9618049? 1 What is 10 divided by -1581851? -10/1581851 Calculate 4692424 divided by -11. -426584 Calculate -808408 divided by 221. -808408/221 -136675272 divided by 1448 -94389 Calculate 1215370 divided by -11. -1215370/11 What is 174792508 divided by -1409617? -124 Calculate -32708397 divided by 6. -10902799/2 Calculate 36380092 divided by -2. -18190046 19749340 divided by 7 19749340/7 Divide 4816346 by 23. 4816346/23 Calculate -14380394 divided by 2. -7190197 Divide 393 by 32830. 393/32830 5 divided by 11732971 5/11732971 What is -846978 divided by 33? -25666 Divide 177790032 by -16. -11111877 Divide 249622304 by 1264. 197486 Divide 31093444 by 1. 31093444 What is -3 divided by -66034628? 3/66034628 What is -3 divided by -18796566? 1/6265522 Calculate 3 divided by 20256197. 3/20256197 Calculate -17325716 divided by -8662858. 2 What is -4941793 divided by 3? -4941793/3 What is -197399835 divided by -2322351? 85 131802 divided by -65901 -2 Divide -1360012 by -340003. 4 Calculate 3851915 divided by -770383. -5 Calculate 81547296 divided by -10544. -7734 What is 1748691 divided by -83271? -21 Calculate 1 divided by -19152164. -1/19152164 What is 10 divided by -232479? -10/232479 Divide 0 by 211855546. 0 What is 3795660 divided by -22? -172530 Calculate 3465498 divided by 1155166. 3 What is 91346403 divided by -2? -91346403/2 Calculate 107822057 divided by 15403151. 7 Calculate 9633 divided by -8302. -9633/8302 Calculate 109 divided by 258504. 109/258504 Calculate 75313096 divided by 4. 18828274 What is 58114908 divided by 189918? 306 What is 37026132 divided by 132? 280501 Divide 5 by 11151905. 1/2230381 -147899 divided by -82 147899/82 Divide 392102855 by 5. 78420571 -140485873 divided by -11 12771443 What is -2822 divided by -114264? 1411/57132 What is -1202407890 divided by -3? 400802630 -65807 divided by -2263 65807/2263 Divide -3345 by 495. -223/33 Calculate 8242300 divided by -275. -29972 Calculate 28652377 divided by -2. -28652377/2 Divide -923956 by -226. 461978/113 -430720719 divided by 419397 -1027 Calculate -20012 divided by -285. 20012/285 What is -28152134 divided by -4? 14076067/2 What is 109429 divided by -35? -109429/35 Calculate 29922192 divided by -3. -9974064 Divide -104284 by -43. 104284/43 43 divided by 55883 43/55883 Calculate -1079 divided by 288941. -1079/288941 Divide -964 by 545. -964/545 What is -1000152 divided by -75? 333384/25 What is -96731831 divided by -133? 727307 Divide 20026311 by -3. -6675437 Calculate 1 divided by -3185733. -1/3185733 Calculate 155513 divided by 8. 155513/8 Divide 0 by -2743987. 0 What is 333279 divided by -75? -111093/25 What is -8676896 divided by 4208? -2062 What is -879 divided by 726317? -879/726317 -1137092 divided by -6611 172 Calculate 760278 divided by -6. -126713 What is -1152392414 divided by 25052009? -46 Calculate -324 divided by 15902. -162/7951 895023 divided by 6 298341/2 What is 729158 divided by -25? -729158/25 Divide 31445970 by 3144597. 10 Divide 133103403 by -133103403. -1 What is -2678152 divided by -8? 334769 What is 84176993 divided by 22769? 3697 Divide 10541820 by 2. 5270910 What is 9011321 divided by 89221? 101 What is -4238863 divided by -12? 4238863/12 Divide -256727712 by 1. -256727712 What is -72496880 divided by -3? 72496880/3 Calculate 9 divided by -3960266. -9/3960266 Divide -3537708 by 3. -1179236 Calculate -262134 divided by 248. -131067/124 What is 52834 divided by -68? -26417/34 Divide 3508332 by -9431. -372 -202 divided by 78651 -202/78651 -18396950 divided by -10 1839695 Calculate 13482942 divided by 1686. 7997 What is -138597000 divided by 230995? -600 Calculate 3 divided by 3323214. 1/1107738 What is 17 divided by -38897158? -17/38897158 Calculate 238279820 divided by -2. -119139910 What is 59 divided by -1958636? -59/1958636 What is 0 divided by 1332777? 0 14866936 divided by -1061924 -14 Divide 93430356 by -15571726. -6 342 divided by -41853 -114/13951 Calculate 15448055 divided by 755. 20461 Calculate 3 divided by -189586927. -3/189586927 Calculate -11 divided by -262719. 11/262719 Divide 571200 by -420. -1360 Calculate 216501766 divided by 5. 216501766/5 Divide 45166904 by 5. 45166904/5 Calculate -2 divided by -4034293. 2/4034293 Divide -167076375 by 125. -1336611 Divide 422598992 by 52824874. 8 What is 46276 divided by 52? 11569/13 Divide 4 by 326435. 4/326435 Divide -4 by 1416465. -4/1416465 Divide -4299 by -132076. 4299/132076 What is 1 divided by 40309148? 1/40309148 -72 divided by -518141 72/518141 Calculate 9471812 divided by -2367953. -4 What is -62 divided by 4111631? -62/4111631 What is 6485 divided by -1871? -6485/1871 Divide 3858 by -2811. -1286/937 19297122 divided by 17062 1131 610 divided by 24629 610/24629 Calculate 10370 divided by -26629. -10370/26629 Calculate -3 divided by -5110833. 1/1703611 260967339 divided by -3221819 -81 Divide -7178 by 484. -3589/242 -10741941 divided by 1169 -9189 What is -12119952 divided by 24? -504998 What is 2501142 divided by 21? 119102 Calculate 3557275 divided by 25. 142291 What is -7142555 divided by 3? -7142555/3 Calculate 1573 divided by 355127. 1573/355127 What is -38 divided by -10992? 19/5496 Divide -197 by -7861. 197/7861 What is -108442 divided by 14? -54221/7 -24760083 divided by 8253361 -3 Calculate -256 divided by -335848. 32/41981 504031600 divided by -20161264 -25 Calculate -21972647 divided by 2. -21972647/2 What is 501075 divided by -167? -501075/167 What is -4706840 divided by -470684? 10 Calculate 236416336 divided by 26. 9092936 What is 172223850 divided by 5? 34444770 Calculate 165984 divided by 535. 165984/535 Divide -2 by -1060114. 1/530057 Divide -3639825 by 5. -727965 Divide -9106 by -1552. 4553/776 What is 64907 divided by 87? 64907/87 Calculate -2 divided by 2971421. -2/2971421 Divide 60917 by -1451. -60917/1451 What is 27201351 divided by -4? -27201351/4 60 divided by 302269 60/302269 Divide 4571272 by -230. -2285636/115 Divide -405 by 390702. -135/130234 Divide -651893725 by 130378745. -5 Divide -32986952 by 4. -8246738 -22 divided by -492566 11/246283 What is -1353895452 divided by 108? -12536069 Divide 18523693 by 4. 18523693/4 Divide 70 by 9541463. 70/9541463 What is 3 divided by -858676? -3/858676 Calculate -2068268 divided by -1. 2068268 Divide -13654 by 78. -6827/39 20918 divided by -1279 -20918/1279 -7225919 divided by 127 -56897 Divide 10535 by 6822. 10535/6822 What is 1 divided by 3293151? 1/3293151 Calculate 22799016 divided by -1062. -21468 Calculate 39635796 divided by -428. -92607 What is -19705464 divided by 4926366? -4 Divide -1577 by 1321. -1577/1321 Calculate -32248004 divided by -4. 8062001 What is 910 divided by 228508? 65/16322 -5 divided by -2446547 5/2446547 0 divided by -1748216 0 What is 8019395 divided by 205? 39119 What is -127975254 divided by -187647? 682 -17140250 divided by -2125 8066 Divide 1271438 by 2. 635719 Calculate 107899520 divided by -3181. -33920 -18877518 divided by 67 -281754	{ "pile_set_name": "DM Mathematics" }
11 = 26. Calculate the remainder when f is divided by s. 10 Suppose 174x - 24 = 151x - 1. What is the remainder when 352 is divided by x? 0 Let q = 39 - 18. Let r(n) = n*3 + 24n*2 - 129n - 37. What is the remainder when r(6) is divided by q? 17 Suppose 0w - 840 = -4w. Let x(f) = f*3 - 13f*2 - 87f - 34. What is the remainder when w is divided by x(18)? 10 Let g(d) = 10d2 + 4d - 86. What is the remainder when g(11) is divided by 6? 4 Let d be ((-3)/15-2)/(1/120). Suppose -5n + d + 17 = 0. Let y(s) = s*3 - 14s*2 + 15s - 18. What is the remainder when y(n) is divided by 4? 0 Let a = -6997 - -42154. What is the remainder when a is divided by 24? 21 Suppose -x = -19 - 16. Suppose 7d - 12 = 9. Suppose 2y + 2y = 16, -5y = -dm + 394. Calculate the remainder when m is divided by x. 33 Suppose 4q + q + 3x - 2 = 0, 5x = 4q - 9. Suppose 0k = -2k + 138. What is the remainder when k is divided by (11 + -2 + -2)/q? 6 Let p(d) = -d3 + 11d*2 - 28d + 19. Calculate the remainder when 303 is divided by p(7). 18 Suppose 0 = 89p - 88p - 2y - 37, 0 = -4p - 5y + 109. What is the remainder when 351 is divided by p? 10 Suppose -1686b + 1691b = -3v + 4391, 0 = -4v + b + 5801. Calculate the remainder when v is divided by 85. 7 Let h be 1/(-2) - (-70135)/166. Let a = 451 - h. What is the remainder when 1012 is divided by a? 26 Suppose -695 = -18u - 11. What is the remainder when 156 is divided by u? 4 Let h(s) = s + 59. Let r be h(-48). Suppose 0 = 26v - rv - 2265. Calculate the remainder when v is divided by 51. 49 What is the remainder when 1102 is divided by 10/(-1) + (-3366)/(-153)? 10 Suppose 285944 = 9f + 11f + 42f. Calculate the remainder when f is divided by 15. 7 Suppose -18u + 16u = -10. Let c(y) = uy + 1 - 7 - 25y. What is the remainder when c(-2) is divided by 19? 15 Suppose 5m - 2z - 453 = 0, -3z - 33 - 55 = -m. Calculate the remainder when m is divided by (-3)/9 - 316/(-12). 13 Let x = -3380 + 3453. What is the remainder when 83 is divided by x? 10 Suppose z - 14 = -5j + 33, 2j - 10 = 4z. Suppose 0 = -3i + 2t + 460, 4i + 5t - 125 = 3i. Calculate the remainder when i is divided by j. 6 Suppose 64k - 70 = 78k. What is the remainder when (k/2)/(29/(-754)) is divided by 61? 4 Suppose -16153 + 3332 = -274s + 24991. Calculate the remainder when 322 is divided by s. 46 Suppose -2a = -3f - 118, -303 = 3f - 291. Suppose 3g - 38 = 7. Calculate the remainder when a is divided by g. 8 Let k = 26 - 0. Calculate the remainder when k2 + 0(-2)/(-6) is divided by (-3)/6 + (-3)/((-18)/33). 2 Suppose -4o + 115 = -101. Let f = -55395 + 55407. What is the remainder when o is divided by f? 6 Suppose 358 = 36k + 34. Let i(x) = 25x - 107. What is the remainder when i(5) is divided by k? 0 Suppose 0 = 55f - 53f - 52. Suppose 0 = 5z - 2q - 113, 4q + 37 = fz - 25z. Calculate the remainder when z is divided by 8. 5 Let u(v) = -78v + 826. What is the remainder when u(7) is divided by 58? 48 Let v be (-7 - (-366)/54) + (-1312)/9. Let q = v + 174. What is the remainder when q is divided by 11? 6 What is the remainder when 463 + 42/(-12)(-2 + 52/14) is divided by 154? 149 Calculate the remainder when (-4)/(-14) - (-1 + 8084/(-28)) is divided by 68. 18 Let b = -547 - -29957. What is the remainder when b is divided by 342? 340 Let r = 118 + -110. Suppose 2k = 3u + 81, -2k + 86 = -ru + 6u. Let q(z) = 5z2 + 2z + 1. What is the remainder when k is divided by q(-2)? 14 Suppose 3o + 8o = 198. Suppose 0 = -3t + 1 - 1. Suppose tf + 184 = 2f + 2l, -3f + 272 = 2l. Calculate the remainder when f is divided by o. 16 Let t(c) = c*2 + 17c - 14. Let o be t(-18). Suppose -552 = ok + 4v, 3v + 139 = -k + v. Calculate the remainder when 1/(2 + 273/k) is divided by 35. 32 Let c(b) = -1 - 2 - 4b + 9 + 5b - 3. Let w = -4 + 10. Calculate the remainder when 16 is divided by c(w). 7 Let o(f) = 23f - 271. What is the remainder when 556 is divided by o(14)? 46 Let q = -2048 + 2102. What is the remainder when 1133 is divided by q? 53 Let t be 28/6-3 + 0. Suppose -3h = -2h + 5 + 6, -4d = -5h - 259. What is the remainder when d is divided by (t/(-3))/((-2)/(-6))? 9 Suppose 3f + 16 = 5r, 5f = -5r + 4f + 28. Suppose -3c + 4 = 3z - 26, rc + z - 58 = 0. What is the remainder when 54 is divided by c? 6 Suppose 4j - 2q - 348 = 3084, -5j = -q - 4296. Calculate the remainder when j is divided by 36. 32 Suppose 14n = -9n + 10350. Suppose 0 = -3b - m + 343, -4b - 2m + n = 3m. Calculate the remainder when b is divided by 58. 57 Let n(y) = 2y3 - 9y + 14. Suppose -48w = -58w + 30. Let p(a) = 2a2 - 7a. Calculate the remainder when n(w) is divided by p(5). 11 Let d = -19755 - -19857. Calculate the remainder when 677 is divided by d. 65 Let m be (-23)/((2 - 3)/2). Let w = m - 43. Suppose 3g - 42 = -3h, 4g + 4h - 23 = wg. Calculate the remainder when 20 is divided by g. 9 What is the remainder when (17 - 49) + (285 - 11) is divided by (-185)/(-3) + 1/3? 56 Let k(f) = 4f - 3. Let g be 3(-2)/6 - -691. Let t be (g/51)/((-2)/(-9)). What is the remainder when 38 is divided by k(t)? 17 Let k = -30 - -32. Suppose -2x + 4x - 2 = kz, 5x = 4z + 7. Suppose 1209 = zv + 11v. What is the remainder when v is divided by 16? 13 Let g(w) = w + 13. Let r be g(-10). Suppose -rp + 8p = 160. Calculate the remainder when p is divided by 156/(-182)(-1)/3 + (-145)/(-7). 11 Let j = 248 + -47. Let t = j + -171. What is the remainder when 119 is divided by t? 29 Let q(n) = -5n + 58. Let z = -1440 + 1484. What is the remainder when z is divided by q(9)? 5 What is the remainder when (1 - 2 - -7)/((-452)/(-27346)) is divided by 111? 30 Suppose -60b = -15b - 5635 - 2735. What is the remainder when 1468 is divided by b? 166 Suppose 30 = 2q + 3q. Suppose x - 19 = -4v, 26 = 8x - qx + 2v. Let s = 3 - -1. Calculate the remainder when x is divided by s. 3 Calculate the remainder when (-1 + 2903)/((-4)/(-3 - -1)) is divided by 290. 1 Suppose -4o = 3d - 5o + 565, -5o = -3d - 557. Let p = -136 - d. What is the remainder when p is divided by 11? 9 Suppose 0 = -40g + 1274 + 1046. What is the remainder when 190 is divided by g? 16 Suppose 0 = -16d + 17d - 8, 2d + 74 = 3x. What is the remainder when 395 is divided by x? 5 Let c(n) = n - 3. Let k = -36 + 39. Let d be c(k). Suppose d = -t + 5 + 10. Calculate the remainder when 87 is divided by t. 12 Let g(r) be the second derivative of -2/3r*3 + 0 + 1/4r*4 - 7/2r*2 - 33r + 1/20r5. Calculate the remainder when 33 is divided by g(-3). 3 Suppose 5l + 2k = 967, 5k = -4l + 658 + 136. What is the remainder when 1706 is divided by l? 178 Let l be (18/(-24))/1 + 245/(-4). Let c = l + 118. Calculate the remainder when c is divided by 19. 18 Suppose -3t = 2j - 2848 - 1315, -5t - j = -6950. What is the remainder when t is divided by 24? 23 Suppose -2s - 20z + 102 = -23z, -5z = 2s - 54. Calculate the remainder when s is divided by 28. 14 Suppose 27 = 32j - 549. Let t(q) = 6q2 + 6q - 1. What is the remainder when t(-3) is divided by j? 17 Suppose 36r - 137r = 83r - 3680. Calculate the remainder when 182 is divided by r. 2 Suppose 0 = -32x - 834242 + 834434. Suppose -s = -3 - 4. Calculate the remainder when s is divided by x. 1 Let o(k) = k*3 - 14k*2 - 41k + 174. Calculate the remainder when 131 is divided by o(16). 11 Suppose 29 = -2m + 3m. What is the remainder when -7(-72)/3 - (3 - 3)/(-2) is divided by m? 23 Let l(j) = -j2 + 168. Suppose 7 = -2w - 25. Let o = -11 - w. What is the remainder when l(12) is divided by o? 4 Let y = -9477 + 9548. Calculate the remainder when y is divided by 69. 2 Let m(l) = l*3 + 41l*2 + 177l - 89. Suppose 0 = 2o - 63 - 3. Calculate the remainder when o is divided by m(-36). 14 Let o(a) = -a3 + 17a*2 - 39a - 17. What is the remainder when 91 is divided by o(14)? 16 Let j(t) = t*3 - 24t2 + t - 50. Let b(h) = h3 - 24h2 + h - 51. Let r(a) = -4b(a) + 3j(a). Calculate the remainder when 177 is divided by r(24). 27 Let x be -3 - ((-9)/6 - 45/(-6)). Let t(c) = -20c + 31. What is the remainder when t(x) is divided by 107? 104 Let f = -7586 + 7641. Calculate the remainder when 2	{ "pile_set_name": "DM Mathematics" }
1/4. Let g = s - x. Sort 1, g, 5 in decreasing order. 5, 1, g Suppose 35u - 28 = 42u. Sort 3, -5, 7, u in decreasing order. 7, 3, u, -5 Let r(i) = -2i + 14. Let u be r(6). Sort u, -2/3, 0, -7. -7, -2/3, 0, u Let y be 4(-2 - 15/(-6)). Let r = y - -1. Let g = -7 + r. Sort 4, g, 0 in increasing order. g, 0, 4 Let m(s) = -s*2 - 5s - 9. Let w be m(-2). Sort 0, w, -2/11 in increasing order. w, -2/11, 0 Let q(l) = -l. Let b(u) = -u. Let c(f) = -b(f) + 6q(f). Let d be c(1). Put 3, d, 1/3 in decreasing order. 3, 1/3, d Let f = -108 + 105. Let a be 45/(-2)(0 + 2). Let q be (-1)/(f3/a). Put q, -2, -4 in ascending order. q, -4, -2 Let p = -13 - -9. Suppose 5m - 5 = -3y, -7y - 5m + 10 = -3y. Suppose -3i + 4i = 0. Sort i, p, y in descending order. y, i, p Let y = -75 - -74. Put y, -1/2, 0, -2 in descending order. 0, -1/2, y, -2 Let o(z) = -z. Let m(k) = 10k2 + 5k - 1. Let d(v) = m(v) + 6o(v). Let a be d(-1). Suppose 6y - y = a. Sort y, 5, -5 in ascending order. -5, y, 5 Let v be 3-1 + (-40)/(-8). Suppose -16 = 2f + vf. Sort 3, 1, f. f, 1, 3 Let q = -9 + 4. Sort q, 2/13, 3. q, 2/13, 3 Let n = -14 + 10. Sort n, 2, -3 in ascending order. n, -3, 2 Let b be (-10)/(-4)(-42)/(-15). Sort 2, -1, b in descending order. b, 2, -1 Let d be (-2)/(-12) + (-9)/54. Suppose t = -t - 6. Put d, t, 4 in increasing order. t, d, 4 Let p = -135 + 119. Put 2, p, 4 in ascending order. p, 2, 4 Let j = 12 - 10. Suppose -jm + 7m = -20. Sort -3, m, 5 in decreasing order. 5, -3, m Suppose -30 = 8o - 18o. Put o, 0, -1, 4 in ascending order. -1, 0, o, 4 Let k = -129/350 + -3/50. Sort -4, k, 0.5 in descending order. 0.5, k, -4 Suppose -2l = -8 - 14. Let n be (0/l)/(0 + 2). Put n, 2, -4 in increasing order. -4, n, 2 Let u be (-2)/(-7) + (3 - 111/21). Sort 1, u, 11 in descending order. 11, 1, u Let x = -17 - -16.9. Put -4, x, -3 in decreasing order. x, -3, -4 Let c(r) = -r2 - 2 - 4r + 0r2 + 0r - 2. Let o be c(-6). Let s be 12/o + (-22)/(-8). Sort 3, -1, s in ascending order. -1, s, 3 Suppose -v + 2 = -0v. Suppose -36 = 4j - 2o - vo, -4o + 24 = -j. Let u be (-9)/6(-8)/6. Put -3, j, u in increasing order. j, -3, u Let r = -57 + 57.56. Put -4, 2/9, r in ascending order. -4, 2/9, r Let n = -0.7 - 0.3. Let d = 508 - 511. Let t be (-1)/2(-2)/(-3). Sort t, d, n in decreasing order. t, n, d Suppose m - 5m = 8. Let o(l) = l*2 - 9l + 8. Let j be o(8). Suppose -n - 2k + 2 = 4n, -2n - 3k - 8 = j. Sort n, m, -3 in ascending order. -3, m, n Let f = 40 - 39.6. Let r = 0 + 0.2. Let i = 0 - r. Sort f, 1/3, i in decreasing order. f, 1/3, i Suppose -21q + 8q + 65 = 0. Suppose -2s = -2u + 6, s + 13 = -3u + 2. Let i = -9 + 4. Sort i, q, u in descending order. q, u, i Suppose -3k = 8 + 7. Let i = 0 + k. Put 0, -3, i in decreasing order. 0, -3, i Suppose 10 = 4a - 2v, -a - 4a + 5v + 25 = 0. Suppose 4m - 4 = -h, 4m + am = -4h + 16. Sort -1, 2/7, h in ascending order. -1, 2/7, h Let y be 32/8 - 146/37. Sort -0.2, y, -0.5 in ascending order. -0.5, -0.2, y Let x be 1188/252 - (18/(-14) + 1). Sort 2, 1, x, 3 in ascending order. 1, 2, 3, x Let g(t) = -t - 6. Let p be g(-4). Sort p, -3, -1 in ascending order. -3, p, -1 Suppose 3l - 19 = -m, 5l + 3m + 0m - 29 = 0. Let c = -4 + l. Suppose -5 + 11 = 3n. Sort n, c, -4. -4, n, c Let l(n) = -n3 + 4n*2 + 14n - 8. Let z be l(6). Sort 3, z, 17 in increasing order. 3, z, 17 Let x(n) = -3n + 5. Let s(j) = j3 - 6j*2 + 7j - 4. Let p be s(5). Let k be x(p). Let f = 9 + k. Sort f, -1, 0 in increasing order. f, -1, 0 Let m(b) = b*2 - 7b + 9. Let t be m(4). Sort -2, 2, t in decreasing order. 2, -2, t Let t be 2 + -4 + 12/7. Let s = 10 - 11. Let n be 2/44-1. Put n, t, s in ascending order. n, s, t Let h(f) = -2f - 3. Let r be h(-4). Let q = 11 + -16. Sort r, 2, q in increasing order. q, 2, r Let a be 2 - ((-24)/(-5))/2. Let s = 687.01 + -690. Let l = s - 0.01. Sort a, 1/6, l in descending order. 1/6, a, l Suppose 17n - 18n = 0. Sort 1, n, 4. n, 1, 4 Let g = 4 - 3. Let b be 7/(-4) + g/(-4). Let a be (b1)/(16 - 1). Sort a, -3/7, 3 in descending order. 3, a, -3/7 Let r = 1 + -1. Let q = 197 + -199. Put r, 0.3, q in descending order. 0.3, r, q Suppose 2a = a + 1, 0 = -j + 2a + 6. Put 0, j, -4 in decreasing order. j, 0, -4 Suppose -5y - 5w = -1 - 39, -5y + 30 = 3w. Suppose -ys + 5 = 20. Put 4, 3, s in decreasing order. 4, 3, s Let z = 0.6 + 0.4. Let b = -3 + z. Let k = 2.4 + b. Put -0.4, k, 0.3 in decreasing order. k, 0.3, -0.4 Let t = 5 - 6. Suppose 2o = y, 5y - 17 - 11 = -4o. Let i = -1 - o. Put t, 3, i in decreasing order. 3, t, i Let v(n) = -6n2 - n. Let s be v(-1). Put s, 1, -3 in increasing order. s, -3, 1 Let n be ((-10)/4)/((-3)/(-6)). Put 4, -3, n in decreasing order. 4, -3, n Let m = -2 - -6. Suppose 0 = j - m - 1. Put j, -4, 4 in ascending order. -4, 4, j Let i be ((-8)/(-10))/(4/(-20)). Put 0, i, 4 in ascending order. i, 0, 4 Let t = -49 - -52. Put 12, -3, t in descending order. 12, t, -3 Let a be ((-6)/(-1))/(-12)0. Suppose o + 5 = 2. Sort o, a, -2 in descending order. a, -2, o Let z be (-2 - -1)(-2)/10. Let d = -47 - -939/20. Let c = z - d. Sort c, 0.4, 2 in ascending order. c, 0.4, 2 Let t = -3.059 + 0.059. Sort 7, 0, -4, t in ascending order. -4, t, 0, 7 Let p = 3 + -4. Let o = p - -0.5. Let i = o - -0.2. Sort 0.3, 2/11, i. i, 2/11, 0.3 Let d be (-13 - 1)/(-2). Let m be (2/40)/d. Let g(v) = -3v. Let j be g(1). Put -2, j, m in decreasing order. m, -2, j Let i(b) = -2b - 4 - 2 + 3b + 0. Let m be i(7). Sort 4, -3, m. -3, m, 4 Let j = -57 - -56. Put j, 10, 0, 5 in decreasing order. 10, 5, 0, j Let s be (0 - -4) + 0 + -8. Put -9, s, 2/3 in decreasing order. 2/3, s, -9 Let z = 0.05 + 2.95. Let y = 6 + -3. Suppose -7m = -ym. Sort z, -0.2, m. -0.2, m, z Suppose 6o - 4o - 8 = 0. Put 5, o, -4 in increasing order. -4, o, 5 Let w = -0.8 - -1.8. Sort 5, w, 0.08. 0.08, w, 5 Let n(j) = -j*2 - 6j - 2. Let a be n(-5). Let g be 4/(-48) - 4/6. Let p = -2 - -3. Sort p, a, g in descending order. a, p, g Let o = 0 - 0.03. Let h = 4.03 + o. Sort h, 0.1, 1/5 in descending order. h, 1/5, 0.1 Let l(i) = -i*2 - 6i + 6. Let z be l(-7). Sort 1, z, -4 in decreasing order. 1, z, -4 Suppose -7j + 3j - 12 = 0. Let f = 10 - 14. Let x = f + 7. Put j, -2, x in descending order. x, -2, j Let f = -44/3 - -15. Put f, -1, -0.1 in descending order. f, -0.1, -1 Let f(n) = n*3 - 6n*2 - 10n + 9. Let k be f(7). Let s be (0 - -2)(-6)/k. Let g be -1s - (-3 - -1). Put -5, g, -4 in increasing order. -5, -4, g Let t(z) = z*3 - 7z*2 + 6z. Let r be t(6). Put r, -10, -4 in decreasing order. r, -4, -10 Let g = -21 + 17. Sort g, -0.3, 0.1. g, -0.3, 0.1 Suppose -5c + 2c - 18 = 0. Let t = 2 + c. Let f be ((-2)/(-4))/(1/t). Put -1/8, f, -2/5 in ascending order. f, -2/5, -1/8 Suppose 0 = k - 3, 2t = -4k - k - 1. Let x = -11 - t. Let w be x/6 + (-7)/2. Sort -2, w, 5 in decreasing order. 5, -2, w Let u be (-5 - -2) + 1 + 0. Let w(l) = l*3 - 3l*2 - 3l - 1. Let d be w(-2). Let b be d/(-6)4/2. Sort 1, u, b in ascending order. u, 1, b Let v be ((-12)/24)/((-2)/8). Suppose 2x = -x. Put x, -6, v in descending order. v, x, -6 Let l = -5 - -2. Sort 5, 0, l. l, 0, 5 Suppose -3t = 0, 0 = b - 4t + 3t + 2. Suppose 0s = -2s + 2. Suppose -2k - s = 7. Sort 2, b, k. k, b, 2 Let y(r) = r*3 + 16r*2 - 18r - 13. Let s be y(-17). Put 0, 2, s in ascending order. 0, 2, s Let f be ((-6)/(-6))/(2/(-3)). Sort 4, 2, 5, f in descending order. 5, 4, 2, f Let i = -6 + 11. Let f be ((-18)/(-45))/(1/5). Let z be -2-1f/1. Sort 0, i, z. 0, z, i Let u = 0.36 + -2.36. Let q = 44 + -29. Let i be q/12 + -1 + 0. Put 1/12, i, u in decreasing order. i, 1/12, u Let r be (-6)/8 + (-3)/12. Sort r, 2, -3. -3, r, 2 Let b be (156/143)/(4/(-6)). Let f = b + 20/11. Sort 3, -4/9, f in descending order. 3, f, -4/9 Let n = 2 - 5. Let g(f) = -f*3 + 6f*2 - 3f - 6. Let s be g(5). Let h = s + -5. Sort 2, n, h in decreasing order. 2, h, n Let z = 0 - 1. Put -5, -2, z in descending order. z, -2, -5 Let p(x) = 2x2 + 8x - 6. Let y be p(-5). Suppose -g = yg. Sort 3, g, -3 in increasing order. -3, g, 3 Let a be -13(-6 + 3 - -1). Suppose 19 + a = -5k. Let x = -14 - k. Sort x, 4/7, 0.1 in decreasing order. 4/7, 0.1, x Let c be 1(1 + -2	{ "pile_set_name": "DM Mathematics" }
177, -237, -327, -453? -h3 + h - 117 What is the l'th term of 3, 6, 11, 18, 27? l2 + 2 What is the c'th term of 72, 118, 154, 174, 172, 142? -c3 + c2 + 50c + 22 What is the z'th term of 1325, 1320, 1315, 1310? -5z + 1330 What is the s'th term of 304, 456, 608? 152s + 152 What is the d'th term of 95, 206, 403, 692, 1079? d3 + 37d*2 - 7d + 64 What is the q'th term of -168, -337, -506? -169q + 1 What is the y'th term of 160, 259, 416, 625, 880, 1175, 1504? -y3 + 35y*2 + y + 125 What is the p'th term of 561, 564, 567, 570? 3p + 558 What is the d'th term of -151, -213, -275, -337, -399, -461? -62d - 89 What is the l'th term of -58, -113, -170, -229, -290? -l2 - 52l - 5 What is the p'th term of -470, -940, -1410, -1880? -470p What is the a'th term of -21, -30, -45, -66, -93, -126? -3a*2 - 18 What is the p'th term of 131, 262, 393, 524? 131p What is the j'th term of 158, 192, 224, 254? -j*2 + 37j + 122 What is the g'th term of -34, -31, -26, -19, -10, 1? g2 - 35 What is the n'th term of -25, -11, -3, -7, -29, -75, -151? -n3 + 3n2 + 12n - 39 What is the m'th term of -59, -84, -93, -92, -87, -84? -m*3 + 14m*2 - 60m - 12 What is the k'th term of 16, 19, 30, 55, 100, 171? k*3 - 2k*2 + 2k + 15 What is the f'th term of -160, -315, -468, -619, -768, -915? f*2 - 158f - 3 What is the j'th term of -40, -100, -164, -226, -280, -320? j*3 - 8j*2 - 43j + 10 What is the z'th term of -249, -257, -269, -285? -2z2 - 2z - 245 What is the z'th term of 18, 19, 20, 21? z + 17 What is the g'th term of 19, 30, 47, 70, 99, 134, 175? 3g2 + 2g + 14 What is the c'th term of 691, 692, 693, 694? c + 690 What is the h'th term of -1896, -3790, -5684? -1894h - 2 What is the u'th term of -6468, -12935, -19402, -25869? -6467u - 1 What is the o'th term of -736, -732, -726, -718, -708, -696, -682? o*2 + o - 738 What is the u'th term of -15, -28, -67, -144, -271, -460, -723, -1072? -2u3 - u2 + 4u - 16 What is the v'th term of -592, -610, -628? -18v - 574 What is the p'th term of 6884, 13767, 20650? 6883p + 1 What is the c'th term of 80, 328, 740, 1316, 2056, 2960, 4028? 82c*2 + 2c - 4 What is the q'th term of 30, 42, 68, 114, 186? q3 + q2 + 2q + 26 What is the g'th term of -4937, -4935, -4931, -4925, -4917, -4907, -4895? g2 - g - 4937 What is the z'th term of -153, -167, -181? -14z - 139 What is the r'th term of 10, 26, 50, 82, 122, 170, 226? 4r2 + 4r + 2 What is the f'th term of -804, -3221, -7250, -12891, -20144, -29009, -39486? -806f2 + f + 1 What is the o'th term of -15, -68, -191, -414, -767? -5o*3 - 5o*2 - 3o - 2 What is the k'th term of -479, -954, -1429, -1904, -2379, -2854? -475k - 4 What is the m'th term of -5, -10, -17, -26? -m2 - 2m - 2 What is the l'th term of 47, 246, 569, 1010, 1563, 2222, 2981, 3834? -l*3 + 68l*2 + 2l - 22 What is the u'th term of 115, 181, 287, 433, 619? 20u2 + 6u + 89 What is the q'th term of 127, 252, 377, 502? 125q + 2 What is the w'th term of -95, -386, -873, -1556, -2435, -3510? -98w*2 + 3w What is the u'th term of -17, -34, -61, -98, -145? -5u2 - 2u - 10 What is the j'th term of -119, -252, -383, -512, -639, -764, -887? j*2 - 136j + 16 What is the y'th term of 284, 567, 850, 1133? 283y + 1 What is the a'th term of -186, -719, -1606, -2847, -4442, -6391? -177a*2 - 2a - 7 What is the k'th term of 2434, 2436, 2438? 2k + 2432 What is the d'th term of 865, 864, 863? -d + 866 What is the z'th term of -244, -1036, -2362, -4228, -6640, -9604? -z3 - 261z*2 - 2z + 20 What is the i'th term of 27, 17, -21, -99, -229, -423, -693? -2i3 - 2i*2 + 10i + 21 What is the f'th term of -233, -479, -737, -1013, -1313, -1643? -f*3 - 239f + 7 What is the h'th term of 1342, 2683, 4026, 5371, 6718? h*2 + 1338h + 3 What is the i'th term of 55, 116, 177? 61i - 6 What is the x'th term of -28, -48, -48, -22, 36, 132? x3 + 4x*2 - 39x + 6 What is the o'th term of -112, -244, -376? -132o + 20 What is the l'th term of 9, 20, 31, 36, 29, 4, -45, -124? -l3 + 6l*2 + 4 What is the p'th term of 1027, 1028, 1029? p + 1026 What is the o'th term of -2492, -4984, -7476, -9968? -2492o What is the i'th term of -11, -51, -115, -203, -315? -12i2 - 4i + 5 What is the a'th term of 189, 186, 183, 180, 177, 174? -3a + 192 What is the b'th term of -13, -19, -39, -85, -169, -303? -2b*3 + 5b*2 - 7b - 9 What is the z'th term of 151, 304, 457, 610, 763? 153z - 2 What is the m'th term of -395, -789, -1183, -1577? -394m - 1 What is the y'th term of 1073, 2144, 3217, 4292, 5369, 6448? y*2 + 1068y + 4 What is the n'th term of -174, -343, -514, -687, -862, -1039, -1218? -n*2 - 166n - 7 What is the y'th term of 138, 265, 392, 519, 646, 773? 127y + 11 What is the f'th term of 51, 122, 191, 258? -f2 + 74f - 22 What is the u'th term of -121, -117, -111, -103, -93, -81, -67? u*2 + u - 123 What is the v'th term of 77, 123, 169, 215, 261? 46v + 31 What is the t'th term of 34, 70, 104, 136, 166, 194, 220? -t*2 + 39t - 4 What is the t'th term of 138, 277, 414, 549, 682, 813? -t*2 + 142t - 3 What is the j'th term of 31, 64, 101, 142? 2j2 + 27j + 2 What is the d'th term of 240, 234, 228? -6d + 246 What is the v'th term of -29, -125, -287, -515? -33v*2 + 3v + 1 What is the f'th term of 59, 93, 113, 113, 87, 29? -f3 - f2 + 44f + 17 What is the l'th term of -51, -105, -167, -243, -339, -461, -615, -807? -l3 + 2l*2 - 53l + 1 What is the z'th term of 91, 181, 271, 361, 451, 541? 90z + 1 What is the o'th term of 4, 15, 50, 121, 240? 2o*3 - 3o + 5 What is the o'th term of -652, -650, -648, -646, -644? 2o - 654 What is the c'th term of -124, -303, -482? -179c + 55 What is the n'th term of 9, 23, 37, 51, 65? 14n - 5 What is the u'th term of 3, 5, -1, -21, -61, -127, -225? -u3 + 2u*2 + 3u - 1 What is the p'th term of -116, -230, -344, -458, -572, -686? -114p - 2 What is the f'th term of -7, -17, -33, -55? -3f*2 - f - 3 What is the g'th term of -93, -187, -281, -375, -469, -563? -94g + 1 What is the v'th term of 7, 59, 157, 301, 491, 727, 1009? 23v2 - 17v + 1 What is the r'th term of 11, 3, -5, -13, -21, -29? -8r + 19 What is the o'th term of 16641, 16643, 16645, 16647, 16649? 2o + 16639 What is the g'th term of -336, -647, -968, -1305, -1664, -2051? -g3 + g2 - 307g - 29 What is the j'th term of -103, -94, -71, -28, 41, 142, 281? j3 + j2 - j - 104 What is the o'th term of -1460, -1461, -1462, -1463, -1464, -1465? -o - 1459 What is the u'th term of 100, 201, 302? 101u - 1 What is the n'th term of 26, 44, 88, 170, 302, 496, 764, 1118? 2n3 + n2 + n + 22 What is the j'th term of 41, 68, 95, 122? 27j + 14 What is the i'th term of -73, -80, -99, -136, -197, -288, -415, -584? -i*3 - 72 What is the h'th term of -1764, -1765, -1766, -1767? -h - 1763 What is the v'th term of -2278, -2276, -2274, -2272, -2270? 2v - 2280 What is the n'th term of 5532, 5533, 5534, 5535? n + 5531 What is the a'th term of -31, -97, -195, -319, -463, -621? a*3 - 22a*2 - 7a - 3 What is the p'th term of -25932, -25933, -25934, -25935, -25936? -p - 25931 What is the j'th term of -58, -103, -148, -193, -238? -45j - 13 What is the q'th term of -21, -16, -9, 0, 11? q2 + 2q - 24 What is the r'th term of 7, 144, 519, 1252, 2463, 4272? 20r3 - r2 - 12 What is the g'th term of 6428, 6413, 6384, 6335, 6260, 6153? -g3 - g2 - 5g + 6435 What is the x'th term of 315, 333, 351, 369, 387, 405? 18x + 297 What is the k'th term of -738, -737, -726, -699, -650, -573, -462, -311? k3 - k2 - 3k - 735 What is the w'th term of -111, -225, -351, -495, -663, -861, -1095, -1371? -w*3 - 107w - 3 What is the i'th term of 2180, 4361, 6542, 8723, 10904, 13085? 2181i - 1 What is the w'th term of 11, 55, 133, 251, 415, 631, 905, 1243? w3 + 11w*2 + 4w - 5 What is the y'th term of 63, 270, 625, 1128, 1779, 2578, 3525? 74y2 - 15y + 4 What is the b'th term of 40, 112, 248, 460, 760, 1160, 1672? 2b3 + 20b*2 - 2b + 20 What is the u'th term of 15, 9, 3, -3? -6u + 21 What is the p'th term of -23, -62, -175, -398, -767, -1318? -6p3 - p2 + 6p - 22 What is the l'th term of -38, -28, -8, 28, 86? l3 - l2 + 6l - 44 What is t	{ "pile_set_name": "DM Mathematics" }
+ sqrt(133) + sqrt(133)) - sqrt(133)1-4)/(sqrt(7) + sqrt(441)/sqrt(7) + -2sqrt(112)). sqrt(19)/2 Simplify (sqrt(2736)-3 + sqrt(2736) + -2 - sqrt(2736) - (-4sqrt(2736) + 0))2 + 4. -48sqrt(19) + 2744 Simplify ((2sqrt(6000) + sqrt(6000))/(sqrt(240)/sqrt(5) + sqrt(12)))2. 500 Simplify (0 + (-1(0 + sqrt(2299)) - 1sqrt(2299)-1 - (sqrt(2299) + -1 + 0 + sqrt(2299) - (sqrt(2299) + -1 + sqrt(2299) + 3 - sqrt(2299) - sqrt(2299)))))*2. -132sqrt(19) + 9205 Simplify ((-6(2 + sqrt(1377)) + 3 + -5 + sqrt(1377)-1 + -5)-3)2. 21546sqrt(17) + 610506 Simplify (sqrt(42)/(2sqrt(847)))/(sqrt(192) - -2(sqrt(3) + sqrt(6)/sqrt(2))). sqrt(2)/264 Simplify ((sqrt(26)/(sqrt(72)5) + -4 + -1 + 3sqrt(13))3)2. -273sqrt(13) + 130153/100 Simplify ((5 + sqrt(245))3)2 + (3sqrt(45) - sqrt(20)/(-1sqrt(4)))2. 630sqrt(5) + 2930 Simplify (-2((1sqrt(187) - sqrt(187)) + sqrt(187))-4)/(sqrt(66)/sqrt(54) + sqrt(22)/(sqrt(32) - sqrt(2))). 12sqrt(17) Simplify -4(3 + 5(sqrt(2) - 2(sqrt(2) + 1 + sqrt(2)) - (sqrt(2) - (sqrt(200)-2)*2))). -15972 + 80sqrt(2) Simplify (sqrt(120)/(sqrt(288)3))/(sqrt(33)/(sqrt(11)2)-3). -sqrt(5)/27 Simplify (-6(sqrt(540) - -1sqrt(540)))/(sqrt(36)/sqrt(3)4). -9sqrt(5) Simplify (-1 + sqrt(1539))2 + 4 - ((sqrt(19) - (-1 + (3sqrt(19))*2)) + 4). -19sqrt(19) + 1710 Simplify (sqrt(66) - -6(sqrt(66) + sqrt(66)5 - sqrt(66)))/sqrt(6) - ((sqrt(11) - (-2sqrt(11) + sqrt(11) + 5 + sqrt(11)))2 + -4). -32 + 41sqrt(11) Simplify 3(2 + -2sqrt(5) - (sqrt(500) + 1)*2) + -5. -1502 - 66sqrt(5) Simplify ((1-2sqrt(264) + sqrt(264))/sqrt(8))/(4(sqrt(11) + (sqrt(44) + sqrt(11))4)). -sqrt(3)/52 Simplify 4(1sqrt(832)1 + -1)2. -64sqrt(13) + 3332 Simplify -4 + (-4 + 4 + sqrt(2299)1-6-6)2. 2979500 Simplify 5(-1 + sqrt(475)) - 5(-1 + sqrt(475)) - 6(sqrt(475) - (sqrt(475) + 2 + sqrt(475) + 1sqrt(475) + sqrt(475) - sqrt(475) - sqrt(475))2). 210sqrt(19) + 11424 Simplify -4 + ((sqrt(72) - (0 + sqrt(72))) + sqrt(18))2 + (3 + sqrt(98) + 0 - (sqrt(98) + 0 + -4 + sqrt(98)))2. -98sqrt(2) + 161 Simplify (5(3 + sqrt(448)) + 0 + -2 + 1sqrt(7))2-1. -11936 - 1066sqrt(7) Simplify -6-2(sqrt(1584)-4 + sqrt(11))-4-1. -2256sqrt(11) Simplify (-6sqrt(180)/sqrt(4) + (sqrt(45) - (2sqrt(315))/sqrt(7)))/(sqrt(9) + 1sqrt(1089) + sqrt(9) + (sqrt(900) - (sqrt(900) - (2sqrt(900) + sqrt(900))))). -7sqrt(5)/43 Simplify (2 + sqrt(700) + 1 + -2 + -3 + 5)1. 3 + 10sqrt(7) Simplify (1sqrt(875) - sqrt(875))/sqrt(7) + (sqrt(45)/((-2sqrt(9) - sqrt(9))3))2. 5/81 Simplify -1sqrt(51)/sqrt(12)-4-3. -6sqrt(17) Simplify -1((0 + sqrt(176))*2 + ((sqrt(77) + -1sqrt(77))/sqrt(7) - sqrt(11)))1. -176 + sqrt(11) Simplify ((sqrt(432) + 1 + sqrt(144)/(sqrt(24)/sqrt(2)))-2)*2. 112sqrt(3) + 2356 Simplify (62sqrt(209)5)/(sqrt(11) - sqrt(132)/sqrt(108) - sqrt(121)/(sqrt(22)/sqrt(2) + sqrt(11))). 360sqrt(19) Simplify -5 + (3(sqrt(88) - -2sqrt(88)))/sqrt(2) + 1. -4 + 18sqrt(11) Simplify -4((sqrt(136) + -1sqrt(136)3 + sqrt(136))/(-6sqrt(32)/sqrt(4)) + 0). -2sqrt(17)/3 Simplify (sqrt(57) - sqrt(228)/sqrt(4)5)/(sqrt(108)/sqrt(4)) - (sqrt(608)/sqrt(2) + 1)2-6. 140sqrt(19)/3 + 1830 Simplify ((sqrt(350) + -3sqrt(350))/sqrt(10))/(sqrt(5)-3-6). -sqrt(7)/9 Simplify -2 + ((1sqrt(180) + sqrt(180))/sqrt(9))/(sqrt(10) + sqrt(10)-25). -2 - 2sqrt(2)/9 Simplify 1(2 + sqrt(10)/sqrt(5) + -2)-4. -4sqrt(2) Simplify (-6(1 + -2sqrt(605)))2 - 6(((sqrt(605) + 0)1)2 - sqrt(605)). -1518sqrt(5) + 83526 Simplify (sqrt(125)13)*2 + (sqrt(125) - (sqrt(125) + -2 + sqrt(125)))3. -15sqrt(5) + 1131 Simplify ((1sqrt(77)1 - (sqrt(77) - (1sqrt(77) - sqrt(77))6))/(((sqrt(11) - (sqrt(11) - sqrt(22)/sqrt(2))) + sqrt(11))2 + sqrt(55)/(-2sqrt(5))))2. 0 Simplify ((sqrt(77) - 1sqrt(77))-6)/(2sqrt(176))5. 0 Simplify 4 + -4((sqrt(108) + -1)4)2-1. -768sqrt(3) + 6980 Simplify (3 + sqrt(1872) + -4)2 - (-5 + sqrt(117)/(sqrt(9)2))*2. -19sqrt(13) + 7379/4 Simplify ((-6(sqrt(168) - sqrt(168)-2))/sqrt(12))/(sqrt(14)/(sqrt(32)-3 - sqrt(2))). 234sqrt(2) Simplify (3sqrt(50)/(sqrt(250)2))*2 + (sqrt(5) + -6(sqrt(5) + -1)*2 - (sqrt(10)/(sqrt(2) + sqrt(2)1))*2). -184/5 + 13sqrt(5) Simplify ((-3sqrt(750)3)/(1(sqrt(640) - (sqrt(640) - (sqrt(640)-2 - sqrt(640))))))*2. 675/64 Simplify (sqrt(56) - sqrt(8064)2)/(sqrt(8) + -2sqrt(288)) - 4(sqrt(448)-1 + 0 + sqrt(448)). 23sqrt(7)/11 Simplify (1sqrt(825) - (sqrt(33) + -3sqrt(33)-2))/(2(sqrt(3) + sqrt(3)-1) - (-2sqrt(24))/sqrt(8)). -sqrt(11) Simplify (6-5(5 + (sqrt(1100) - (2sqrt(1100) + -5 - sqrt(1100))))1)*2. 90000 Simplify -4((sqrt(156) + sqrt(156)-1 + sqrt(156) + sqrt(156))/sqrt(3))/(sqrt(4) + sqrt(48)/(sqrt(12)1) - sqrt(4)). -8sqrt(13) Simplify (3sqrt(189)/(sqrt(9)/sqrt(3) + sqrt(3)))/(sqrt(108)/(-1sqrt(48))). -3sqrt(7) Simplify (sqrt(24)/(sqrt(8) - sqrt(128)6) - ((sqrt(3)1 + -1 - sqrt(3)) + sqrt(33)/sqrt(176)))*2. -27sqrt(3)/46 + 10651/8464 Simplify 5(2(5(sqrt(110) - (sqrt(110)-1 - sqrt(110))) - sqrt(110)))/((sqrt(360)2 - sqrt(360))3 + sqrt(360) + sqrt(360)). 14sqrt(11)/3 Simplify (0 + (sqrt(2299) + sqrt(2299)1 - sqrt(2299)) + sqrt(2299) + sqrt(2299)1 + -5 + -2)2 + 1. -462sqrt(19) + 20741 Simplify (((sqrt(42) - (sqrt(42) - (sqrt(42) - (sqrt(5082)-1 + sqrt(5082))))) + 6sqrt(126)/sqrt(3))/(sqrt(24)/(sqrt(4)-1) + sqrt(216)1 + sqrt(216)))*2. 343/121 Simplify ((31sqrt(21))/(-4sqrt(3)2 + sqrt(3)))2-5. -45/7 Simplify ((-2 + sqrt(243) + 1sqrt(243))4 + -31sqrt(243)-2)2. -2016sqrt(3) + 47692 Simplify (sqrt(200) + 1 + 3 + 4)*2 + 2. 160sqrt(2) + 266 Simplify ((sqrt(143)-35 - sqrt(143)) + sqrt(143))/(sqrt(539)-6). 5sqrt(13)/14 Simplify 1 + -2(0 + 0 + -1 + 1 + sqrt(272)). -8sqrt(17) + 1 Simplify ((sqrt(56)/(sqrt(8) + (sqrt(8) - sqrt(64)/sqrt(8))))2 + (sqrt(49)/sqrt(7))22)4. 84 Simplify -5 + (-3 + 5 + -2 + sqrt(147)-1-5)*2. 3670 Simplify ((0 + sqrt(1377))-6 + -4 + (sqrt(1377) - (sqrt(1377) + 0)) + 1)*2 + 5. 324sqrt(17) + 49586 Simplify (sqrt(4235) + (-3-1sqrt(4235) - sqrt(4235)))/(sqrt(252)-5). -11sqrt(5)/10 Simplify (1sqrt(2940))/(sqrt(84)/sqrt(175)) + -3. -3 + 35sqrt(5) Simplify -2 + ((sqrt(171))*2 + -3 + sqrt(19) + sqrt(684)3)1. 19sqrt(19) + 166 Simplify 1(sqrt(1300) + ((sqrt(1300)-4)*2 - sqrt(1300))) + 2 + sqrt(1300) + 3. 10sqrt(13) + 20805 Simplify -1 + (-3 + sqrt(8) + 5 + -1sqrt(8) + sqrt(8))2. 11 + 8sqrt(2) Simplify -5 + (62sqrt(180))*2 - -1((sqrt(180) + (-1 + sqrt(180) + sqrt(180))*2 - sqrt(180)) + 0). -24sqrt(5) + 26636 Simplify 0 + ((-4sqrt(513))/(sqrt(75) + (sqrt(75) - (sqrt(75) - (sqrt(75) - (sqrt(75) + (-1sqrt(75) - sqrt(75))))))))*2. 304/25 Simplify (sqrt(121)-2-54)/(1sqrt(396)-5). -4sqrt(11)/3 Simplify (-1(-3sqrt(28)/sqrt(4) + 0 + sqrt(343))4 + -3)*2. 96sqrt(7) + 1801 Simplify (-4((sqrt(34) + (sqrt(34) - (sqrt(34) - sqrt(340)/(sqrt(10)-2 + sqrt(10)))))/(sqrt(72) - (sqrt(72) - sqrt(72)-1)) + 4))2. 256 Simplify (sqrt(102) + 3(sqrt(102) - sqrt(102)1))/(sqrt(726)1 + sqrt(726) + sqrt(726))-1 + 5. -sqrt(17)/33 + 5 Simplify (1 + sqrt(1584))2 + sqrt(132)/sqrt(108) + (sqrt(88)/sqrt(144))/sqrt(2). 49sqrt(11)/2 + 1585 Simplify 1 + -3sqrt(272) + 2 + sqrt(272)1 + -3 + 0. -8sqrt(17) Simplify (((sqrt(448) - (sqrt(448) - (sqrt(448) + sqrt(448) + -2 + sqrt(448)))5) + 5)54)*2. -352000sqrt(7) + 21693200 Simplify ((61sqrt(11))*2 - (1 + sqrt(1100) - sqrt(1100))) + 2 - 6(-2 + (sqrt(1100)2)2). -25991 Simplify (1 + (1(sqrt(4617) + (sqrt(4617)1 - sqrt(4617))))/((1sqrt(294))/sqrt(2)))*2. 18sqrt(19)/7 + 1588/49 Simplify sqrt(35)/((sqrt(147)/sqrt(3))/sqrt(7)) - 6sqrt(20)/sqrt(4)-1. 7sqrt(5) Simplify (4 + (3sqrt(300))2 - (sqrt(147) + (1 + sqrt(147) + 1 - sqrt(147)) + sqrt(147))2)6. -336sqrt(3) + 12672 Simplify ((-5 + sqrt(17) + 1 - sqrt(17) - ((sqrt(153)2)/sqrt(9) - sqrt(17))) + 5 + -6((sqrt(17) - sqrt(68)) + sqrt(17)))*2. -2sqrt(17) + 18 Simplify ((sqrt(486)3)/sqrt(6))/(4sqrt(270)/sqrt(10)). 3sqrt(3)/4 Simplify sqrt(572)/(sqrt(33)/sqrt(48)) + 1. 1 + 8sqrt(13) Simplify (-1sqrt(672))/(sqrt(486)1 - sqrt(486) - sqrt(6)) + -4. -4 + 4sqrt(7) Simplify -1 + 3 + ((sqrt(5) - (sqrt(5) - sqrt(3645))) + sqrt(35)/(sqrt(7)-5))**2. 1	{ "pile_set_name": "DM Mathematics" }
number? True Is 1900153 composite? False Is 838 a prime number? False Is 21313 a composite number? False Is 301447 composite? False Is 2227 prime? False Is 120421 prime? False Is 8997 composite? True Is 4043 prime? False Is 1552583 prime? True Is 271367 a composite number? False Is 1245758 a prime number? False Is 40559 composite? False Is 275105 a prime number? False Is 9023 composite? True Is 17567 composite? True Is 90578 composite? True Is 5065 composite? True Is 477409 composite? False Is 9019 a prime number? False Is 151273 a composite number? False Is 68755 a composite number? True Is 815 a prime number? False Is 2081 prime? True Is 246757 a prime number? False Is 2222653 a prime number? True Is 6143 composite? False Is 24355 prime? False Is 7243 prime? True Is 50639 composite? True Is 706709 a composite number? False Is 330821 composite? False Is 29483 a composite number? False Is 140977 a composite number? False Is 10369 a composite number? False Is 458499 composite? True Is 1385123 a composite number? True Is 974 a composite number? True Is 1819 prime? False Is 239667 composite? True Is 15901 a prime number? True Is 45143 composite? True Is 286607 a prime number? False Is 631 a composite number? False Is 10169 a prime number? True Is 869 a prime number? False Is 594359 a composite number? False Is 42433 composite? False Is 5143 composite? True Is 1397 a composite number? True Is 465271 a prime number? True Is 22759 a composite number? True Is 199889 composite? False Is 45119 prime? True Is 66545 prime? False Is 51131 a composite number? False Is 12889 a prime number? True Is 185947 composite? False Is 3349 composite? True Is 30539 composite? False Is 43346 a composite number? True Is 381481 a prime number? True Is 233171 composite? True Is 832705 composite? True Is 1493837 a prime number? False Is 5501 a prime number? True Is 162473 prime? True Is 868993 prime? True Is 252137 a composite number? True Is 117163 a composite number? False Is 1601 composite? False Is 75479 a composite number? False Is 431474 a prime number? False Is 410651 prime? True Is 3101 a composite number? True Is 504311 a composite number? False Is 122497 composite? False Is 12389 a prime number? False Is 55457 prime? True Is 23623 prime? True Is 1087 composite? False Is 2570921 a prime number? True Is 9227 a composite number? False Is 7438 a prime number? False Is 72035 a prime number? False Is 4535 a prime number? False Is 26747 composite? True Is 75883 a prime number? True Is 60953 a composite number? False Is 478889 composite? True Is 3683 a composite number? True Is 1295974 prime? False Is 27199 a composite number? True Is 11243 composite? False Is 99079 a prime number? True Is 556843 prime? False Is 699931 prime? True Is 11905 a composite number? True Is 18947 a composite number? False Is 20011 a composite number? False Is 152499 composite? True Is 787 prime? True Is 12811 composite? True Is 101037 a composite number? True Is 1211401 composite? True Is 97013 prime? False Is 149585 a prime number? False Is 73247 a prime number? False Is 135887 prime? True Is 2333 prime? True Is 75133 prime? True Is 28873 a composite number? True Is 812627 composite? False Is 820541 a composite number? False Is 22063 composite? False Is 428981 a prime number? False Is 427802 a composite number? True Is 2777 a composite number? False Is 1003 a prime number? False Is 64553 composite? False Is 72307 a composite number? False Is 60299 prime? False Is 4721 a composite number? False Is 4751 a composite number? False Is 387545 a composite number? True Is 24407 a prime number? True Is 38513 composite? True Is 469 a prime number? False Is 1477 composite? True Is 1499983 composite? True Is 40577 a prime number? True Is 34647 a prime number? False Is 68543 a composite number? False Is 28697 a composite number? False Is 4157399 a prime number? True Is 419231 composite? False Is 4541 a composite number? True Is 594023 composite? False Is 113 a composite number? False Is 12667 prime? False Is 33809 prime? True Is 1641 a composite number? True Is 608621 composite? True Is 14683 a prime number? True Is 2805047 composite? True Is 6683 a composite number? True Is 2051 a prime number? False Is 111778 composite? True Is 12389 a prime number? False Is 55351 a composite number? False Is 4627 a prime number? False Is 3787 composite? True Is 23159 prime? True Is 303959 composite? False Is 449 prime? True Is 2986 a prime number? False Is 20201 a composite number? False Is 15727 a prime number? True Is 2101 prime? False Is 61309 a prime number? False Is 4481 prime? True Is 11623 a prime number? False Is 52447 a prime number? False Is 11141 a prime number? False Is 47935 a composite number? True Is 59347 composite? True Is 14114 prime? False Is 60181 composite? True Is 10817 a prime number? False Is 459939 composite? True Is 31957 composite? False Is 353063 a prime number? False Is 14779 a composite number? False Is 319097 a composite number? False Is 68659 a composite number? False Is 86902 a prime number? False Is 7993 a prime number? True Is 109973 a composite number? True Is 29537 composite? False Is 43037 composite? False Is 20201 a composite number? False Is 127637 composite? False Is 12515 a prime number? False Is 4391 a prime number? True Is 581089 composite? False Is 7243 a prime number? True Is 166781 prime? True Is 1111 prime? False Is 2707 prime? True Is 5857 composite? False Is 9047 composite? True Is 150999 a composite number? True Is 27257 a prime number? False Is 22013 prime? True Is 80651 a composite number? False Is 3317 prime? False Is 78599 prime? False Is 731551 prime? False Is 7901 a prime number? True Is 268153 composite? False Is 535 a prime number? False Is 118661 prime? True Is 35561 composite? True Is 1777 a composite number? False Is 60247 a composite number? True Is 1755697 composite? False Is 8219 composite? False Is 107585 a composite number? True Is 316127 composite? True Is 6343277 a prime number? True Is 1901 a prime number? True Is 823855 a composite number? True Is 7822589 prime? True Is 19961 composite? False Is 17729 a prime number? True Is 39127 a composite number? True Is 5557 composite? False Is 5039 a composite number? False Is 2897 a prime number? True Is 104827 prime? True Is 66995 a prime number? False Is 4649 composite? False Is 1049 a composite number? False Is 1397 a composite number? True Is 2473 a composite number? False Is 4621 composite? False Is 6121 a prime number? True Is 62417 a prime number? True Is 222001 composite? True Is 83837 prime? False Is 3299 a composite number? False Is 67033 a composite number? False Is 87499 composite? True Is 16759 prime? True Is 1043 a prime number? False Is 9305 a prime number? False Is 208303 composite? True Is 104863 prime? False Is 402149 prime? False Is 29649 a prime number? False Is 631535 prime? False Is 83949 a prime number? False Is 56687 a prime number? True Is 14983 composite? False Is 484521 a composite number? True Is 15119 a prime number? False Is 94177 composite? True Is 422231 a composite number? False Is 255413 a prime number? True Is 7247 composite? False Is 143 a composite number? True Is 3593 prime? True Is 65057 composite? True Is 16871 prime? True Is 82385 prime? False Is 21451 composite? True Is 773407 a composite number? False Is 27733 a prime number? True Is 2129 a composite number? False Is 48973 composite? False Is 14051 composite? False Is 22141 prime? False Is 6449 composite? False Is 39019 prime? True Is 2954789 a composite number? False Is 2822707 composite? False Is 48221 a composite number? False Is 54751 composite? False Is 907 a prime number? True Is 424537 a prime number? True Is 10487 composite? False Is 331739 a prime number? True Is 39659 a composite number? False Is 42061 composite? False Is 75111 prime? False Is 7819 a composite number? True Is 42947 composite? True Is 6883 prime? True Is 85 prime? False Is 1372207 composite? False Is 40879 prime? True Is 10441 prime? False Is 55453 a prime number? False Is 467 a prime number? True Is 81281 a prime number? True Is 14969 a prime number? True Is 81386 composite? True Is 95 a prime number? False Is 269089 a prime number? Tru	{ "pile_set_name": "DM Mathematics" }
4w3 + (64 + 19 - 7)(-54 + w + 54)(-5w + 3w2 + 5w) in the form rw3 + vw + cw2 + z and give r. 232 Rearrange -11i*4 - 2i*3 + 2i*4 + 139 + 32i*2 - 31i2 + i - i4 - 138 to the form vi + gi*2 + ti*4 + ni*3 + w and give v. 1 Rearrange 0i2 + 5845 - 5842 + i3 - 10i + 2i*2 - 3i*2 to n + di + mi3 + wi*2 and give w. -1 Rearrange (4c - c + 0c)(0c - c + 0c) + 5917c2 + 5923c*2 + 5888c*2 + 190c - 17784c2 to the form m + nc + oc2 and give o. -59 Express -3814u - 4967u + 875u + 1615u as x + ou and give o. -6291 Express (-366l + 4l - 101l + 24l)(-3l - 734 + 734) as tl + g + wl*2 and give w. 1317 Express -3p - 3 + 738p2 - 353p*2 - 2 - 336p*2 - 5 in the form j + yp*2 + lp and give l. -3 Rearrange 8 + 7 - 9 - 113p - 2 to zp + f and give f. 4 Rearrange -3x - 4 + 6 + x + (3 - 1 - 3 + (4 + 0 - 3)(0 - 5 + 3))(-110x + 26x - 56x)(1 + 0 - 3) to ux + o and give o. 2 Express ((-3 - 4 + 5)(u + 0 + 0) + u - 4u + u + 0u + 4u - 5u)(-814u3 - 2235u*3 - 92u*3) as ou*2 + pu + su3 + r + hu*4 and give h. 15705 Express -p + 5461098 + 2p2 + p3 - 5461115 - p in the form np + dp*2 + lp*3 + v and give l. 1 Rearrange (-2z*2 + 5z - 5z)(-2z - 4z + 44455205z2 - 44452240z*2) to oz*2 + vz*4 + h + uz + mz3 and give m. 12 Express (-1 + 1 + a)(4 + 1 - 4) - 3a + 0a + 6a - 2 + 2 + a + 3582a + 288a - 20112a - 3583a in the form ia + z and give i. -19820 Rearrange -6d4 - 33d*3 - 2d - d*2 + 10d - 55d3 - 46d*3 + 132d*3 to the form md*2 + ld + ud4 + fd*3 + w and give f. -2 Express ((-2i - 3 + 3)(1 - 1 - 1) + 2i + 2i - 2i - 2i + 0i + i)(-129i + 56i - 59i + 1) in the form si + v + fi*2 and give s. 3 Express -3840v*2 + 7665v*2 - 3828v*2 - 283 as bv + z + sv2 and give s. -3 Rearrange -9t + 0t4 + t2 + 9t + 2t - 7t*3 - 1 - 4t*4 + 3t*4 to the form pt*4 + kt + nt3 + vt*2 + x and give n. -7 Rearrange -6136c + 4c4 + 3 - 3c*2 + 6138c - 5 - 27c2 to k + ac*4 + jc + zc2 + yc*3 and give y. 0 Rearrange -46931z*3 - 2 + 15643z*3 + 71z - z*2 + 15646z*3 + 15640z*3 to pz + dz2 + qz*3 + y and give p. 71 Express -l - 1 - 14l - 6l + 70l*2 + 3 - 3 as kl*2 + ql + m and give m. -1 Express (-3p2 + 6p2 - p2)(-95 - 344p*2 - 358p*2 + 704p*2 + 5p) as w + rp4 + jp*3 + hp*2 + xp and give r. 4 Rearrange 6y3 + 85y*3 + 13y*3 + 29y*2 + 2y*3 - 29y*2 + (0y - y + 3y)(2y2 - y2 - 3y*2) to the form fy + m + ly3 + xy*2 and give l. 102 Express -4b*3 + 4 + 42026b*2 + 8b*3 + 42015b*2 - 84077b*2 + 5b*3 in the form c + ob*3 + wb*2 + zb and give o. 9 Rearrange (4n - 2n + 3n)((-1 + 3 + 0)(-2 - 2 + 2) - 2177 + 3220 + 12196 + 4919) to the form an + m and give a. 90770 Express 10 + 78k - 2 - 7 - 17k*2 - 31k as lk2 + rk + f and give f. 1 Express 3 - 15m3 + 13m*3 + 41577m*2 - 41523m*2 as cm*2 + y + bm*3 + zm and give y. 3 Rearrange 0 + 0 - 2n - 3n + 3n + 4n - n + 6n + 3n - 5n + 0n + 3n + n + 2n - 5n + (-18 + 21n + 18)(-1 + 2 - 2) to tn + k and give t. -15 Rearrange -228h + 76h + 71h - 4h*3 + 74h + 3h - 10 + h2 to sh*2 + ih + gh3 + j and give j. -10 Rearrange ((-4v2 + v2 + 5v2)(-3v + 3v - 2v) - v3 - v3 + 0v*3)(-834 - 750 + 1806 + 3v) to iv + zv3 + ov*2 + x + mv4 and give z. -1332 Express (-u3 + 2u3 - 4u*3)(20 - 12 + 25 + 25)(60u + 9u + 14u) in the form hu4 + ou + du3 + iu*2 + t and give h. -14442 Express -84y + 170y - 363y*3 - 54y3 - y2 - 84y - 2 in the form xy + s + ry2 + cy*3 and give c. -417 Express (-195r + 367r + 786r)(3r*3 + 19r - r*3 + 2r - 4r3) as y + nr*3 + tr*2 + fr*4 + zr and give f. -1916 Express (66 + 993 + 848)(-s + s + s) in the form x + us and give u. 1907 Express 16r3 + 0r + 2778r2 - 17r*3 - 2770r*2 + 89 + 4r - r as g + ur + qr*2 + vr*3 and give q. 8 Express 13g + 5g - 31 + 37 + 78 - 3g as cg + z and give z. 84 Rearrange 1004t*3 + 415t - 413t - 17t*2 + 3 - 1005t*3 to ot*2 + ut*3 + nt + b and give o. -17 Express -2207j + 3121j*3 + 3086j*3 - 6205j*3 in the form o + fj + pj2 + vj*3 and give f. -2207 Express (2 - 2 + 5)(-2 - 3 + 2)(1 - i - 1)(44 + 74 - 147) as y + ui and give u. -435 Express 9w*2 + 128w*3 - 6w*2 + 315w*3 + 748w*3 - 2w*2 in the form nw + j + aw3 + mw*2 and give m. 1 Rearrange 207k + 169k - 564k + 774k to zk + v and give z. 586 Rearrange (-3m - 4m + 5m)(-3m + 4m - 2m)(26 - 528 + 39)(2m - 3m - 6m) to the form fm + um*3 + n + hm*2 and give f. 0 Express (38b*3 - 24b*2 - 38b*3 - 2b*4)(1 - 106 - 136) as cb + fb*3 + mb*4 + ib*2 + q and give m. 482 Express (-6v*2 + 2v*2 + 3v*2)(-162462 + 162462 - 2657v) as cv*3 + wv + fv2 + a and give c. 2657 Rearrange 0 - 104c - 3 + 538c + 3 + (2 - 2 + 2)(0c - c + 3c) - 2c + 0 + 0 - 42c + 67c + 254c to the form h + ic and give h. 0 Rearrange (-38w - 39w + 4w)(47 - 16 + 66) to the form y + iw and give y. 0 Rearrange 26o2 - 519o + 164o - 474o - 11o2 to b + co + vo2 and give v. 15 Rearrange (1 - 1 - 2)(-3c - 3c + 4c) + (0 + 0 + 2c)(6 - 5 + 0) - 7c + 4 - 4 + (c - 3c + 6c)(2 - 4 + 0) to the form xc + f and give x. -9 Express -1157v - 316v4 - v3 - 1 + 682v4 - 365v4 - v2 as cv + hv*3 + lv*4 + a + dv*2 and give c. -1157 Rearrange -10p*4 - 7p3 - p2 + 10p - 173p + 1 - 14p4 + 2p*4 + 141p to the form ip + gp*4 + fp*2 + bp3 + v and give g. -22 Express q3 - 5471q + 5 - 55q*2 + 5471q as gq2 + xq*3 + i + uq and give i. 5 Express -34a - 3a*2 - 22a - 18a + 73a + 7a2 - 2887a*3 in the form la*3 + wa + oa2 + x and give o. 4 Express 1826c + 2322c - 569c in the form g + nc and give n. 3579 Express 3t - 33t3 + 3739135t*2 - 3739146t*2 - 8 + 4 in the form ot + g + pt2 + st*3 and give s. -33 Express 137r*2 + 183r*2 - 18 + 34r*2 + 19 + 382r*2 as nr + qr2 + w and give q. 736 Express -88 - 108 + 14573x + 196 in the form dx + c and give d. 14573 Rearrange 4017894l - 4017894l + 8l*2 - 1679 to the form t + wl + xl2 and give t. -1679 Rearrange (14d - 9d - 4d2 + d2)(-1 + 11 - 7)(-8d + 12d + 6d + (d - 3d + 3d)(0 + 1 + 0)) to xd + ad*2 + md*3 + b and give a. 165 Express 233 - 491 + 189n + 258 as zn + s and give z. 189 Express (-765 + 765 - 92a)(0 - 2 + 0)(-3 + 0 + 5 - a)(2a - 2a + 2a*2) in the form ta*3 + ga*4 + qa*2 + w + ca and give g. -368 Express (382x + 38x + 8x + x - x - x + (-1 + 0 + 0)(-3 + 2x + 3) + 5x + 3x - 7x)(-3x + 4 - 4 - 2) in the form px + kx*2 + h and give k. -1278 Express -29 - 48 + 330 - 5m + 390 as r + nm and give r. 643 Rearrange (-2362 - 2443 + 4921)(3w - 3w - 2w4) to the form vw + ow3 + g + pw*2 + fw*4 and give f. -232 Rearrange -5493w*2 - 21579w + 10791w + 10788w to the form a + tw2 + zw and give t. -5493 Rearrange 0z + 2z - 4z + (0 + 4 - 2 + (0 + 0 - 2)(0 + 2 + 0) + 3 + 0 - 1 + 1 + 1 - 4)(690 + 431z - 690) to the form y + qz and give q. -864 Express 992o - 72144 - 72143 + 144287 in the form po + i and give i. 0 Express (-56h + 14h2 + 56h)(-4h2 + h2 + 5h2) - 21811h + 21811h + 16h*4 as fh*3 + dh + ih2 + mh*4 + l and give f. 0 Express -59j + 108j + 140j*2 - 55j + 335j2 in the form g + vj + bj2 and give b. 475 Rearrange 95954 - 273y*3 - 95951 - 1686y*3 to the form ry + v + jy2 + hy3 and give h. -1959 Rearrange (v2 + 28v2 + 25v*2 + (3v + 0v - v)(14v - 32v + 15v))(-2 + 2 - 3v)(-1 - 1 + 4) to the form dv + pv*3 + c + nv*2 and give p. -288 Rearrange (-7 - 6 + 8)(-7 + 2 - 4)(-8 - 24 - 27 + (0 - 3 + 5)(3 - 3 - 2))(-o - o + 0o) to vo + c and give v. 5670 Express 25i*2 + 12099i - 1 - 24202i + 12102i + 4i3 in the form li*2 + c + oi*3 + ji and give c. -1 Rearrange -3m4 - 2 - 439m*2 + 836m*2 + 8m*3 - 391m*2 + 30m*3 to wm + jm2 + h + xm*4 + om*3 and give j. 6 Rearrange 2v + 9v2 - 26v	{ "pile_set_name": "DM Mathematics" }
uppose -96i - 45700344 - 5801016 = -336i. Is i prime? True Let h = -6173 - -10944. Is h a composite number? True Suppose -139 = -3r - 121. Is 20/r1596/56 composite? True Suppose 2q - 13q = -33. Suppose 0 = 3j - 5a - 3193, -2j - a = -qa - 2122. Let r = j - 739. Is r a composite number? False Let l(c) = 0c3 + 10 - 5c - 26c - 13c2 - 25 - c3. Let q be l(-10). Let n(i) = 5i2 - 27i - 7. Is n(q) composite? True Let m(b) = 3b3 - 31b*2 + 19b + 15. Let z = 118 + -104. Is m(z) composite? False Let v(x) = 2 + 3x2 + 0 - 4x*2 + 20x*3. Suppose -27k - 6 = -87. Is v(k) composite? True Let k(i) = i*3 - 71i*2 + 4i + 1331. Is k(72) composite? False Let s(k) = k*3 + 21k*2 - 49k + 241. Is s(-20) a prime number? True Let g(v) = 99v3 - 3v*2 - v + 14. Is g(9) composite? False Let a(f) = -142f - 120. Suppose -4w = 4v + 40, 0w = -4w - 3v - 43. Is a(w) a composite number? True Suppose -56m + 28m - 42560 = 0. Let d = 5523 - m. Is d a composite number? False Suppose -z + 3l = -3283, -3z - 8l = -5l - 9873. Suppose 1217 = -4x + 5i + 14403, -z = -x + 5i. Is x prime? True Suppose -5j = -4s + 68, -5j = -0s + s + 8. Let n(w) be the first derivative of 4w3/3 + 5w*2 - 19w - 3. Is n(s) a prime number? True Suppose -311097 = 15r + 108273. Let c = 50525 + r. Is c a composite number? False Let a = 25995 - -12032. Is a a prime number? False Let m(p) = -90p - 7. Let n be 8/28 + (-19)/(-7). Suppose -y - y = -4x + 20, 0 = 5y + nx + 37. Is m(y) prime? False Is 1522/(-1 - 663/(-629)) composite? True Let g(n) = -13n + 57. Let b be g(5). Is (-5)/(-60)-3 - 51594/b a composite number? False Let v = 2396 + -983. Let t = v - 618. Suppose -5g + 2g = -t. Is g composite? True Let u = -324975 - -557057. Is u prime? False Let h be 1/(-7)0/(-29). Suppose h = -2c - 5u + 41361, -2c + 28528 = -u - 12863. Is c composite? False Let n = 261105 - 37438. Is n composite? False Suppose 4u - 13f - 179 = -14f, -2f - 194 = -4u. Suppose -48i = -ui - 70598. Is i a composite number? True Suppose -t - 744 = 6m - 11m, -5m = 0. Let g = 1774 + t. Suppose -5n + 1030 = -5z, 0 = 5n - 3z - z - g. Is n composite? True Let p be ((-144)/40)/(26/1160). Let f = 1117 + p. Is f prime? True Let y = 73632 - -29857. Is y prime? False Suppose 4y = 4o + 677916, -377453 - 130928 = -3y - 4o. Is y a composite number? False Let f(y) be the first derivative of 3y4/4 + 5y*3/6 - 7y*2/2 - 8y - 32. Let c(n) be the first derivative of f(n). Is c(-6) composite? True Let i = 131 + -130. Is 23/(-115) + (i - (-35582)/10) a composite number? False Let p = 157 + -155. Is (-907)/((((-42)/15)/7)/p) a composite number? True Let k = 264926 - 132375. Is k composite? True Suppose -4i = -2i + 6. Is 3/15 - (i + 11676/(-20)) prime? True Let v(r) be the second derivative of -r*5/20 + 5r*4/12 + 4r*3 + 19r*2/2 - 23r. Is v(-12) composite? False Let c(w) = -182w3 + 5w*2 + 12w - 11. Let x be c(-11). Suppose -8y = 3y - x. Suppose y = q + 15q. Is q prime? False Let b(i) = i2 + 1. Let u be b(5). Let g = u + -27. Is 14/(-28) - (g - 225/2) composite? False Let n(t) = 181t*2 - 77t - 1351. Is n(-16) a prime number? False Let m = 108 - 77. Suppose -md = -45d + 262402. Is d composite? False Let l = -35 - -38. Let t(m) = -4m3 - 4 - m2 + 2m*3 + 0 - 3m - l. Is t(-6) a composite number? True Suppose 0 = -654o + 678o - 493656. Is o composite? True Let t(p) be the second derivative of -19p3/3 + 3p*2/2 - 421p. Let f(o) = -3o + 4. Let g be f(4). Is t(g) a composite number? False Let l(u) = 53u - 43u - 1 + 71u. Is l(8) prime? True Suppose -9a - 14 = -32. Is (a + -3)-4 - (-43318)/22 a composite number? False Suppose -50r - 1758440 = -55r + 2w, -5w = 5r - 1758405. Is r prime? False Let j be (-7 - -8)/((-1)/(-15)). Let b be (j/(-4))/(8/192). Is (-36)/b - 136/(-10) a composite number? True Let z be (8/(-3))/((-14)/21). Suppose d + l + 19 = 5l, l + 25 = -zd. Let g(v) = 45v*2 + 10v + 18. Is g(d) a composite number? False Is -18 + (-3 - -20334) + (-10)/(-1) a composite number? False Suppose 21p - 10p - 43857 = 0. Suppose 5y - p - 33878 = 0. Is y prime? True Let b = -756 - -1326. Suppose b = 54m - 44m. Is m a prime number? False Is 424205 - ((-16)/24)/(9/(-81)) prime? True Suppose -5b + 23 = 2l, 5b - 2l + 5 = 3l. Suppose -bf + 3j = 924, 2f + j = -0j - 622. Let r = f - -603. Is r a prime number? True Suppose -2s + 4c - 5310 - 4278 = 0, 3s - c = -14392. Let j = s + 2568. Is (6/(-4))/(15/j)7 a composite number? True Let u(a) = 4a + 44. Let q be u(-10). Suppose 8k + 25739 = 5l + 4k, ql + k = 20587. Is l prime? True Let n be 31156 + (1 - -3 - 2). Suppose 0 = -5p - p - n. Let b = -3040 - p. Is b prime? True Suppose y + 3y - 2w = -70366, -17569 = y + 4w. Let g = y - -32848. Is g prime? True Let b = -107 + 154. Let o = 50 - b. Is (-7014)/(-7)1/o a prime number? False Let l be (-5637)/(-2) + (-6)/4. Suppose -13s - 4s - 28526 = 0. Let m = s + l. Is m a composite number? True Let y(a) = 1559a2 + 29a - 85. Is y(-3) a prime number? True Suppose 3b + 5f = 7070, 2232 - 14037 = -5b - 4f. Let u = b - 1662. Is u a composite number? True Is -1 - -1 - (-161412 + 6 - -33) prime? False Suppose -4z + 3z = -4k + 15, 0 = 2k - 2z - 12. Suppose n + 569 + 3486 = kp, 2701 = 2p - 3n. Is (-2)/(-2) + 2p composite? True Let g = 99 + 3. Let b be 34(5 - -1)g/8. Suppose 4427 = 4n - b. Is n composite? True Let o = 695812 - 326021. Is o composite? False Let m = -2929 - -1717. Let j(o) = 19o - 84. Let x be j(-23). Let k = x - m. Is k composite? False Suppose 76o - 10o + 156o - 396509538 = 0. Is o a composite number? False Suppose 0 = -2a + 6, 5y + 5a = y + 772987. Is y a prime number? True Suppose 5 = -2f - 5, 5r - 3f = -25. Let o be r/(-10) - (-1)/5. Is 0 + 6163 - (o - 1)/3 prime? True Let c(s) = 160586s3 - 2s*2 + 2s - 1. Let v be c(1). Suppose 28g - v = 4531. Is g composite? False Suppose -9 - 1 = -5s. Suppose 16m - 11m = 4w - 100, -56 = -sw + 4m. Suppose -1214 + w = -3d. Is d a composite number? True Let c(q) = -47q3 + 19q*2 + q + 45. Let i(r) = 23r*3 - 10r*2 - r - 23. Let u(b) = -4c(b) - 7i(b). Is u(5) a composite number? False Let d(y) = y - 5. Let b be d(0). Let u be (-18)/(-12)-3371(7 + -5). Is (b + 17/3)u/(-2) a prime number? True Is (2/13 - (-17569734)/(-1014))/((-1)/2) composite? True Let v(n) be the second derivative of n*5/20 - 25n*4/12 + 11n*3/2 - 5n*2/2 + n. Suppose -q + 2s + 357 - 337 = 0, s = 2. Is v(q) a composite number? False Suppose -8o + 100 + 132 = 0. Suppose -2g + 11 = -o. Is 2(-81850)/g(-3)/5 prime? False Let a(i) = 13i + i2 + 22i + 4 + i*3 - 30i + 8i2. Is a(5) prime? True Let r(m) = -m3 + 50m*2 + 35m - 88. Let o be r(37). Suppose 4k = -b + 19004, 3b = 4k + 5b - o. Is k composite? False Let s(p) = 7p3 - 25p*2 + 10p - 307. Is s(23) a prime number? True Suppose 4w - t = -0t + 46, 0 = w + 2t - 7. Suppose -wg - 918 = -5417. Is g prime? True Let a = -8295 - -15937. Suppose 42b = 44b - a. Is b a prime number? True Let r = -96873 - -150686. Is r prime? True Let j(n) = -1 + 3 + 0 + 1 + 436n. Let u = -170 + 171. Is j(u) composite? False Let v(b) = -3639b + 800. Is v(-23) prime? False Suppose 499a + 484605 = 502a - 3n, 323068 = 2a - 3n. Is a a prime number? False Let x = 134544 - -77033. Is x a composite number? True Let h be (-220)/(-385)((-21)/(-2))/(-3). Is 256 - -35 - (-3 + (-1 - h)) prime? True Let b be (6/(-1) - -246)(-656)/(-6). Suppose 5m = 143495 - b. Is m composite? True Let g(d) = 170d - 139. Is g(19) a composite number? True Suppose -5v + 0k - 4k + 42524 = 0, -4v = -4k - 34012. Let l = v - 1287. Is l composite? True Let q(w) = 93789w + 1117. Is q(4) prime? False Suppose 8b = 2u + 13b - 150138, -375387 = -5u - 2b. Is u a composite number? False Suppose f = -2g - 0f - 24, 0 = -4g - 3f - 46. Let a = g + 419. Suppose 3m - a = -5p, -3m + 2p + 300 = -71. Is m composite? False Suppose -88g + 93g = 10. Suppose -3t + 0t + 2094 = w, gw - 2097 = -3t. Is t a composite number? True Suppose -2 = -y, -a + 2y + 0y = -4. Suppose 4f + 16 = z - 5z, 5f = 2z + a. Suppose f = -21*r +	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.